Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
0199. 280199 List the prime factors of 24973566. 2, 3, 4162261 List the prime factors of 3200344. 2, 7, 57149 What are the prime factors of 12398888? 2, 131, 11831 List the prime factors of 10913684. 2, 23, 313, 379 What are the prime factors of 179451? 3, 127, 157 List the prime factors of 574061. 574061 List the prime factors of 241758. 2, 3, 11, 37 List the prime factors of 520839. 3, 11, 5261 What are the prime factors of 414925? 5, 7, 2371 What are the prime factors of 4055626? 2, 19, 106727 List the prime factors of 59133. 3, 23, 857 List the prime factors of 227610. 2, 3, 5, 281 What are the prime factors of 8833393? 8833393 What are the prime factors of 983488? 2, 11, 127 What are the prime factors of 414292? 2, 103573 What are the prime factors of 1544139? 3, 171571 List the prime factors of 333916. 2, 11, 7589 List the prime factors of 6042814. 2, 3021407 List the prime factors of 86236. 2, 21559 What are the prime factors of 522136? 2, 65267 What are the prime factors of 2552205? 3, 5, 229, 743 What are the prime factors of 459629? 17, 19, 1423 List the prime factors of 15992614. 2, 11, 17, 61, 701 What are the prime factors of 44937? 3, 4993 What are the prime factors of 4223247? 3, 7, 201107 What are the prime factors of 2208370? 2, 5, 19, 59, 197 List the prime factors of 20333. 20333 List the prime factors of 287450. 2, 5, 5749 What are the prime factors of 33285035? 5, 7, 951001 What are the prime factors of 669393? 3, 74377 What are the prime factors of 245639? 245639 List the prime factors of 1727247. 3, 241, 2389 What are the prime factors of 152325? 3, 5, 677 List the prime factors of 1755236. 2, 7, 62687 List the prime factors of 20042651. 3461, 5791 What are the prime factors of 1840779? 3, 79, 863 List the prime factors of 119332. 2, 29833 What are the prime factors of 8173702? 2, 17, 311, 773 List the prime factors of 38204594. 2, 19102297 List the prime factors of 18181681. 7, 137, 18959 What are the prime factors of 5277359? 71, 239, 311 What are the prime factors of 229521? 3, 76507 What are the prime factors of 6075679? 6075679 List the prime factors of 18741186. 2, 3, 347059 List the prime factors of 2556115. 5, 511223 What are the prime factors of 782437? 23, 34019 List the prime factors of 225859. 225859 What are the prime factors of 1101752? 2, 41, 3359 What are the prime factors of 9074311? 17, 1847 List the prime factors of 1089933. 3, 13, 27947 What are the prime factors of 1485814? 2, 11, 67537 List the prime factors of 2301773. 461, 4993 What are the prime factors of 2644570? 2, 5, 373, 709 What are the prime factors of 123388? 2, 109, 283 List the prime factors of 1728839. 7, 31, 257 List the prime factors of 31092846. 2, 3, 5182141 List the prime factors of 295914. 2, 3, 149, 331 What are the prime factors of 13193908? 2, 7, 13, 67, 541 List the prime factors of 494803. 494803 What are the prime factors of 353005? 5, 17, 4153 List the prime factors of 1699091. 1699091 What are the prime factors of 1119035? 5, 79, 2833 What are the prime factors of 153021? 3, 11, 4637 List the prime factors of 1739797. 17, 29, 3529 List the prime factors of 550165. 5, 7, 11, 1429 List the prime factors of 8170847. 8170847 What are the prime factors of 37732212? 2, 3, 7, 149731 List the prime factors of 36789. 3, 12263 List the prime factors of 294120. 2, 3, 5, 19, 43 What are the prime factors of 2496270? 2, 3, 5, 7, 11887 List the prime factors of 10017030. 2, 3, 5, 31, 10771 What are the prime factors of 4392023? 103, 42641 What are the prime factors of 20361002? 2, 17, 598853 List the prime factors of 13497236. 2, 101, 33409 What are the prime factors of 621041? 61, 10181 What are the prime factors of 174967? 13, 43, 313 List the prime factors of 26866761. 3, 8955587 List the prime factors of 281035. 5, 56207 What are the prime factors of 1029362? 2, 514681 What are the prime factors of 12282027? 3, 4094009 List the prime factors of 9337273. 11, 848843 What are the prime factors of 6902674? 2, 331, 10427 List the prime factors of 27134708. 2, 6783677 What are the prime factors of 2951082? 2, 3, 67, 2447 What are the prime factors of 9160918? 2, 13, 463, 761 List the prime factors of 11055492. 2, 3, 7, 19, 2309 List the prime factors of 3450332. 2, 862583 List the prime factors of 948458. 2, 7, 37, 1831 List the prime factors of 2873431. 11, 97, 2693 List the prime factors of 3331452. 2, 3, 227, 1223 List the prime factors of 400532. 2, 11, 9103 What are the prime factors of 157737? 3, 52579 What are the prime factors of 6675616? 2, 227, 919 What are the prime factors of 23982650? 2, 5, 67, 7159 What are the prime factors of 2425184? 2, 75787 List the prime factors of 4060194. 2, 3, 31, 83, 263 List the prime factors of 542681. 661, 821 What are the prime factors of 4270679? 7, 433, 1409 What are the prime factors of 11763? 3, 1307 What are the prime factors of 82507? 82507 List the prime factors of 2915274. 2, 3, 131, 3709 What are the prime factors of 730004? 2, 11, 47, 353 What are the prime factors of 135790? 2, 5, 37, 367 What are the prime factors of 1949244? 2, 3, 11, 14767 List the prime factors of 2578244. 2, 41, 79, 199 List the prime factors of 405528. 2, 3, 61, 277 List the prime factors of 119161. 7, 29, 587 List the prime factors of 256085. 5, 51217 What are the prime factors of 1337584? 2, 41, 2039 What are the prime factors of 5457244? 2, 13, 104947 List the prime factors of 286709. 409, 701 What are the prime factors of 1607651? 41, 113, 347 List the prime factors of 742672. 2, 7, 19, 349 What are the prime factors of 5556278? 2, 7, 13, 30529 What are the prime factors of 6417478? 2, 19, 281, 601 List the prime factors of 1500255. 3, 5, 11113 List the prime factors of 380334. 2, 3, 63389 What are the prime factors of 849522? 2, 3, 141587 What are the prime factors of 236611? 29, 41, 199 List the prime factors of 262382. 2, 127, 1033 List the prime factors of 1100963. 127, 8669 What are the prime factors of 1031458? 2, 17, 23, 1319 List the prime factors of 748713. 3, 7, 101, 353 What are the prime factors of 26496819? 3, 149, 19759 List the prime factors of 579434. 2, 289717 List the prime factors of 165735. 3, 5, 29, 127 List the prime factors of 710601. 3, 236867 List the prime factors of 115261. 79, 1459 What are the prime factors of 2650631? 157, 16883 What are the prime factors of 16732324? 2, 7, 85369 List the prime factors of 318690. 2, 3, 5, 3541 What are the prime factors of 588674? 2, 294337 What are the prime factors of 4283415? 3, 5, 31729 List the prime factors of 225482. 2, 112741 What are the prime factors of 11258301? 3, 17, 31, 7121 List the prime factors of 586993. 11, 17, 43, 73 List the prime factors of 622605. 3, 5, 41507 List the prime factors of 289302. 2, 3, 13, 3709 What are the prime factors of 12506404? 2, 97, 32233 What are the prime factors of 2162703? 3, 720901 List the prime factors of 840877. 47, 17891 What are the prime factors of 4944779? 7, 31, 22787 List the prime factors of 984154. 2, 492077 List the prime factors of 11685370. 2, 5, 1168537 What are the prime factors of 3946977? 3, 113, 3881 List the prime factors of 5970553. 17, 157, 2237 List the prime factors of 10422394. 2, 17, 306541 What are the prime factors of 471063? 3, 23, 6827 List the prime factors of 740617. 359, 2063 What are the prime factors of 211979? 211979 List the prime factors of 1898138. 2, 11, 19, 239 What are the prime factors of 493230? 2, 3, 5, 41, 401 List the prime factors of 593165. 5, 118633 List the prime factors of 46841. 31, 1511 List the prime factors of 10430. 2, 5, 7, 149 List the prime factors of 251833. 251833 What are the prime factors of 339769? 339769 List the prime factors of 830423. 11, 6863 List the prime factors of 21743. 17, 1279 List the prime factors of 538482. 2, 3, 7, 12821 List the prime factors of 4282480. 2, 5, 199, 269 What are the prime factors of 2816941? 2816941 List the prime factors of 3798253. 89, 42677 List the prime factors of 27652409. 41, 674449 List the prime factors of 1589999. 541, 2939 What are the prime factors of 41741801? 89, 469009 List the prime factors of 1604771. 7, 229253 What are the prime factors of 2222013? 3, 740671 What are the prime	{ "pile_set_name": "DM Mathematics" }
ided by -10255? 3 What is -5 divided by -1664? 5/1664 What is 247 divided by -4432? -247/4432 -1409177 divided by -201311 7 What is -81335 divided by -5? 16267 What is -654705 divided by 1? -654705 Calculate 20254 divided by -247. -82 Calculate 327932 divided by 1. 327932 0 divided by 26005 0 45 divided by 393 15/131 Calculate -2 divided by 645003. -2/645003 -28 divided by 1136 -7/284 Calculate 175004 divided by -134. -1306 -9528 divided by -1 9528 What is 55839 divided by 3? 18613 32 divided by -5076 -8/1269 Divide -2 by -448094. 1/224047 What is 227166 divided by 6? 37861 Divide 22 by -16374. -11/8187 Calculate -907508 divided by -453754. 2 What is 290 divided by -394? -145/197 -5 divided by -511903 5/511903 Divide 348126 by -116042. -3 Calculate 2165874 divided by -1. -2165874 Calculate -118 divided by -6815. 118/6815 What is -11076 divided by 923? -12 What is -515440 divided by 6? -257720/3 791693 divided by -7 -113099 Divide 21 by -518. -3/74 103141 divided by -2 -103141/2 Calculate 112250 divided by 22450. 5 What is 4 divided by 135667? 4/135667 18744 divided by 142 132 Calculate 3395181 divided by 1. 3395181 Calculate -714480 divided by -780. 916 Divide -52493 by -3. 52493/3 Divide -292640 by 58528. -5 What is -502 divided by -27? 502/27 Divide 271 by 2283. 271/2283 Calculate -71685 divided by -14337. 5 What is 12354 divided by -87? -142 -33568 divided by 33568 -1 What is 924042 divided by -898? -1029 Divide 0 by -36617. 0 Calculate 0 divided by -939017. 0 Calculate -97332 divided by 1. -97332 595 divided by -1305 -119/261 What is -231268 divided by -19? 12172 What is -5234973 divided by -1? 5234973 What is -1507801 divided by 1103? -1367 What is -32085 divided by 23? -1395 What is -13586 divided by -13586? 1 Divide 5 by 99986. 5/99986 Divide 6 by -17460. -1/2910 What is 319998 divided by 319998? 1 What is 1494 divided by 26? 747/13 Calculate 2459 divided by -101. -2459/101 Divide -1569618 by -6. 261603 What is 663343 divided by -3? -663343/3 Calculate -2498 divided by 2. -1249 Divide -3442 by -198. 1721/99 What is -460 divided by -359? 460/359 -6168 divided by -24 257 Divide 690148 by -4. -172537 Calculate -315742 divided by -14. 22553 What is -9 divided by 43745? -9/43745 Calculate 38382 divided by 6. 6397 Calculate -45728 divided by -8. 5716 Calculate -1731340 divided by 26. -66590 What is -4 divided by 5358? -2/2679 -1309 divided by -255 77/15 Calculate 4345 divided by -6. -4345/6 411252 divided by -4782 -86 Divide -4327131 by 3. -1442377 Calculate 22601 divided by 4. 22601/4 Calculate 4703 divided by 19. 4703/19 Divide 11420 by 2284. 5 Calculate 2 divided by -755697. -2/755697 Calculate 0 divided by 5783. 0 30306 divided by 3 10102 What is 14 divided by -67763? -14/67763 -6 divided by 30650 -3/15325 Divide 0 by -4790. 0 What is -1662144 divided by -4? 415536 -3 divided by -18411 1/6137 Divide 44915 by 2. 44915/2 What is -128 divided by -1403? 128/1403 Divide 34305 by 60. 2287/4 What is 79050 divided by 75? 1054 Calculate 6711 divided by -22. -6711/22 -55266 divided by -61 906 -7 divided by 17620 -7/17620 2945879 divided by -2533 -1163 Calculate -506256 divided by 8. -63282 What is 2226204 divided by 18? 123678 Calculate -32967 divided by 13. -32967/13 What is 240 divided by 7332? 20/611 What is 332 divided by 8086? 166/4043 -1 divided by -20293 1/20293 Divide 4 by -1135. -4/1135 What is 100355 divided by 18? 100355/18 Divide 65249 by -919. -71 What is 7 divided by -2219? -1/317 2413129 divided by -4 -2413129/4 Calculate -181324 divided by 2. -90662 Calculate -5 divided by 32792. -5/32792 What is -13 divided by -25581? 13/25581 Calculate -40689 divided by -1507. 27 Calculate 0 divided by 530430. 0 3 divided by -25156 -3/25156 0 divided by -55747 0 7858 divided by -3929 -2 -7302 divided by 2 -3651 Divide 134940 by -33735. -4 Calculate -2 divided by -17164. 1/8582 What is -1226688 divided by 32? -38334 Divide 320 by -9742. -160/4871 Divide 31556 by -161. -196 What is 444 divided by 2? 222 What is -30024 divided by -15012? 2 Calculate 212352 divided by -2. -106176 Calculate 14394 divided by 2. 7197 What is -612984 divided by -3? 204328 What is 197659 divided by 17? 11627 Calculate 2703594 divided by 901198. 3 -7 divided by -78540 1/11220 What is -33241 divided by 1? -33241 Divide 5 by -45457. -5/45457 What is -4164795 divided by 5? -832959 -12 divided by -798 2/133 Calculate 2366172 divided by 1. 2366172 Calculate -234585 divided by -13. 18045 What is -242753 divided by 3? -242753/3 Divide 0 by -1780. 0 What is -214575 divided by 14305? -15 What is 1 divided by -2911? -1/2911 Divide -3375 by 5. -675 Calculate -347 divided by 7731. -347/7731 -112041 divided by 633 -177 Divide -17046 by 1. -17046 42435 divided by -205 -207 Divide 86346 by -28782. -3 What is 9408 divided by -672? -14 3 divided by 160502 3/160502 -1932635 divided by -2 1932635/2 Calculate -187915 divided by 2065. -91 Divide 199434 by -33239. -6 Calculate -494965 divided by 5. -98993 Divide -1280 by 575. -256/115 Divide -3 by -582. 1/194 What is -17706 divided by 227? -78 Divide 118570 by 59285. 2 Calculate -194508 divided by 32418. -6 212 divided by 10 106/5 Divide -30 by -1136. 15/568 What is 1190475 divided by 117? 10175 Divide -45 by 248. -45/248 What is 44180 divided by 11045? 4 Divide -455516 by 1. -455516 Calculate -53568 divided by -1. 53568 Calculate 29862 divided by 79. 378 Calculate 435 divided by 5011. 435/5011 51060 divided by 1702 30 Divide 150220 by -4. -37555 What is 14 divided by 567? 2/81 What is 168696 divided by -44? -3834 -63000 divided by 5 -12600 Divide 3 by -2553. -1/851 0 divided by 9524 0 336186 divided by 336186 1 209 divided by 1989 209/1989 Divide 506115 by -2. -506115/2 Calculate -9666 divided by 6. -1611 What is -230535 divided by 327? -705 What is 332210 divided by 2? 166105 -38 divided by -324 19/162 0 divided by 15734 0 112375 divided by -29 -3875 Divide 16076 by -13. -16076/13 What is 33 divided by -154550? -3/14050 Divide -48 by 456. -2/19 What is -39660 divided by 1? -39660 -3 divided by -687784 3/687784 What is 42 divided by -3458? -3/247 Calculate 1862775 divided by -2435. -765 What is 4 divided by 12432? 1/3108 -2268 divided by 5 -2268/5 What is 4725 divided by -4725? -1 What is 232 divided by 69? 232/69 Calculate -15728 divided by -983. 16 886528 divided by -3 -886528/3 -1304815 divided by -1601 815 What is -426705 divided by -28447? 15 Divide 47114 by 2. 23557 Calculate -131557 divided by -131557. 1 Divide -15317 by 10. -15317/10 What is -94360 divided by -18872? 5 Divide -2186448 by -2706. 808 What is -46 divided by -2552? 23/1276 Divide 212 by 1275. 212/1275 Calculate 7950 divided by -159. -50 59744 divided by -7468 -8 Divide -7023 by 4. -7023/4 Calculate -242288 divided by -304. 797 -563596 divided by 22 -25618 Calculate 2 divided by 222662. 1/111331 5265 divided by -49 -5265/49 Divide -38386 by 2258. -17 Calculate -317125 divided by -63425. 5 Divide -168786 by 18. -9377 Calculate -24 divided by 716. -6/179 What is -323000 divided by -161500? 2 Calculate -649 divided by 213. -649/213 263814 divided by -3 -87938 -11913 divided by -4 11913/4 Divide -443300 by -130. 3410 5732247 divided by -3 -1910749 Calculate 6551 divided by 4. 6551/4 Divide -6 by -9989. 6/9989 Calculate -5 divided by 8850. -1/1770 What is -13986 divided by 54? -259 Divide 6650 by 950. 7 8056416 divided by -6 -1342736 What is -3 divided by 18237? -1/6079 What is 100 divided by -133? -100/133 What is 351670 divided by 1? 351670 Calculate -369900 divided by -540. 685 Divide 52 by -6803. -52/6803 151856 divided by 4 37964 Divide 112700 by -56350. -2 -28881 divided by 3209 -9 Calculate -469352 divided by 1. -469352 Calculate 1 divided by 1156382. 1/1156382 Divide -31520 by 2. -15760 What is -743 divided by 23? -743/23 156046 divided by 3806 41 Divide 1160 by -10. -116 298814 divided by -53 -5638 Calculate 8645 divided by 1. 8645 1167720 divided by 526 2220 Calculate 2240665 divided by 5. 448133 Calculate 6665 divided by -6. -6665/6 Calculate -3706 divided by 15. -3706/15 Divide 354600 by -1. -354600 Calculate 2888 divided by -8. -361 Divide 4922 by -152. -2461/76 -632352 divided by -158088 4 Calculate 2637984 divided by 4. 659496 Calculate 120342 divided by -1203	{ "pile_set_name": "DM Mathematics" }
(b) be the third derivative of b*5/60 + 2b*2. Determine u so that z(u) = 0. 0 Let u be 1/((-2)/8) - -4. Let a(o) be the first derivative of 1 + uo - 1/6o3 - 1/4o*2. Factor a(w). -w(w + 1)/2 Let n(k) be the third derivative of 0k - 21/20k*5 - 1/14k*7 - 17/40k*6 - 11/8k4 + k2 - k*3 + 0. Suppose n(x) = 0. Calculate x. -1, -2/5 Let y(v) be the first derivative of 3v*4/4 - 5v*3 + 12v*2 - 12v + 7. Factor y(m). 3(m - 2)2(m - 1) Suppose 125 = 19f + 68. Factor 0b*2 + 1/5b*f - 4/5b + 0. b(b - 2)(b + 2)/5 Find g, given that 2/5g5 - 2g*4 + 0 + 18/5g*2 + 0g + 6/5g3 = 0. -1, 0, 3 Let v(m) = m2 - 1. Let u(l) = 4l*2 + l - 5. Suppose -5h + 4i = 2i - 5, 11 = -3h + 4i. Let q(w) = hu(w) - 15v(w). Factor q(f). -3f(f - 1) Let f(d) be the first derivative of -d4/24 - d3/18 + d*2/12 + d/6 + 56. Determine m, given that f(m) = 0. -1, 1 Let m(r) be the third derivative of 0r*3 + 0r - 1/525r7 + 0r*4 + 1/150r5 + r2 + 0 - 1/300r6 + 1/840r*8. Determine b so that m(b) = 0. -1, 0, 1 Let t = 20 - 18. Suppose 0 = 3x + x + 20, 0 = tn + x + 1. Solve -8/9q - 2/3qn + 8/9 = 0. -2, 2/3 Suppose -2h = -v, 0 = -v + 6v. Let x = h + 3. Suppose -3m*2 + xm + 0m3 + 2m3 - m3 - 1 = 0. What is m? 1 Factor 120u3 + 114u*3 - 229u*3 + 35u*2. 5u*2(u + 7) Let 26t2 + 65t*3 + 21t + 56t2 + 5t*5 - 22t*2 - t + 30t*4 = 0. Calculate t. -2, -1, 0 Suppose 4/5q*3 + 0 + 8/5q*2 + 4/5q = 0. What is q? -1, 0 Let r(d) = -d*3 - 13d*2 - 10d + 15. Let g be r(-12). Let l be g/15 + (-21)/(-10). Factor -lz - 3/2z*2 + 3/2z*4 + 3/2z*3 + 0. 3z(z - 1)(z + 1)*2/2 Let n(m) be the second derivative of 5m*3 + 0 - 4m*4 - 2m*2 - 8/5m*5 - 7m. Factor n(o). -2(o + 2)(4o - 1)2 Let n(u) be the first derivative of 1/6u*3 + 1/24u*4 + 0u + 1 + 1/240u5 - 1/2u*2. Let h(r) be the second derivative of n(r). Solve h(x) = 0. -2 Let s = -1 + 5. Factor -8 + 3i*2 - 14i*3 + s + 13i3. -(i - 2)2(i + 1) Factor -2g*3 - 6g + 3g + g3 + 4g. -g(g - 1)(g + 1) Let h(d) = -10d4 - 6d*3 - 2d*2 - 2d. Let t(o) = -o*5 + 51o*4 + 29o*3 + 11o*2 + 11o. Let i(x) = 22h(x) + 4t(x). Determine u so that i(u) = 0. -2, 0 Suppose -2u - g - 8 = -24, -4g = -u - 10. Let h be 9/u - 1/(-2). Suppose -8 - 2j2 + 3j*h - 8j - j*2 - 2j*2 = 0. What is j? -2 Suppose -3a = -8a - 25. Let k = a - -9. Suppose -5d*3 - 2 + kd*3 - 2 - 5d*2 - 2d - 6d = 0. What is d? -2, -1 Let s = 1 - -1. Let j(n) = -n2 + 3n + 4n2 - sn - 4n. Let h(o) = 12o*2 - 13o + 1. Let l(y) = 4h(y) - 18j(y). Find w, given that l(w) = 0. -2/3, 1 Suppose -16 = 4s - 40. Let h(l) be the second derivative of 0l*4 + 1/120l*s + 2l + 0l3 - 1/80l*5 + 0 + 0l2. Factor h(u). u3(u - 1)/4 Let g(j) be the first derivative of j8/672 - j6/120 + j4/48 - j2 + 3. Let t(a) be the second derivative of g(a). Solve t(l) = 0 for l. -1, 0, 1 Let h(s) be the third derivative of -2s7/735 - s6/210 - 24s2. Factor h(f). -4f*3(f + 1)/7 Suppose 0 = -4k + 3k + 4. Suppose -kj = j - 10. Let 1/3p + 1/3pj - 1/3p*3 - 1/3 = 0. Calculate p. -1, 1 Let i be 25/10 - 2/4. Let c(f) be the first derivative of 0f + 0fi - 1/15f*6 + 0f*5 + 0f*3 + 1 + 1/10f*4. Factor c(b). -2b*3(b - 1)(b + 1)/5 Let j(i) = -10i*2 + 13i - 7. Let s(t) = -19t2 + 27t - 13. Let q(l) = -5j(l) + 3s(l). Let q(z) = 0. Calculate z. 2/7, 2 Let g(l) be the second derivative of 1/15l5 + 0 - 1/60l*6 - l - 3/2l*2 - 1/12l*4 + 0l*3. Let n(c) be the first derivative of g(c). Factor n(p). -2p(p - 1)2 Let l = -144/7 + 1324/63. Let i(k) be the third derivative of 0k - 1/9k4 + 0 + 1/90k*5 + lk*3 - 3k*2. Factor i(b). 2(b - 2)2/3 Let b(t) be the third derivative of t6/40 - t5/15 + t4/24 + 3t2. Determine m so that b(m) = 0. 0, 1/3, 1 Let h(r) be the second derivative of r5/90 - r4/18 + 2r*3/27 + 3r + 1. What is s in h(s) = 0? 0, 1, 2 Let p(j) = j*3 + j. Let o be p(1). What is b in 0b - 4 + ob3 + 3b - 26b2 - 10b*3 - 25b = 0? -2, -1, -1/4 Let s(j) = -7j4 - 21j*3 - 54j*2 - 60j - 24. Let b(a) = a*4. Let k(n) = 4b(n) + s(n). Solve k(d) = 0 for d. -2, -1 Let y(b) = -b + 17. Let l be y(14). Factor -3m4 - 13m - 9ml + 10m + 1 - 9m2 - 1. -3m(m + 1)3 Suppose 22/3i*3 - 2/3i*4 - 70/3i*2 + 50/3i + 0 = 0. What is i? 0, 1, 5 Let c(p) be the second derivative of -p*6/30 + 3p*5/4 - 4p*4 - 32p*3/3 + p. Find g such that c(g) = 0. -1, 0, 8 Let h(b) = -3b*2 + b - 2. Let s(n) = 2n*2 - n + 2. Let a(o) = 3h(o) + 4s(o). Factor a(z). -(z - 1)(z + 2) Let s(b) = -b*3 + 4b*2 + 6b - 5. Let x be s(5). Suppose -4o = -23 + 3. Suppose 0z*4 + xz*2 + 0 - 1/2z + z*3 - 1/2zo = 0. Calculate z. -1, 0, 1 Let l(i) be the first derivative of -i4/26 - 2i3/13 + 8i/13 + 2. Solve l(a) = 0. -2, 1 Suppose -2s - 12 = -5s. Let l be (-30)/((-1)/s6). Let -lz*2 + 4z - z + z*3 + 2 - 22z3 = 0. Calculate z. -1, -2/7, 1/3 Let n(y) be the third derivative of -y6/24 - y*5/4 - 5y*4/12 - 13y*2. Factor n(c). -5c(c + 1)(c + 2) Let o(x) be the second derivative of -x5/25 + x4/30 + 4x3/15 - 3x*2/2 - 3x. Let f(u) be the first derivative of o(u). Solve f(q) = 0. -2/3, 1 Let y(o) be the first derivative of -o*4/20 - 8o*3/5 - 96o*2/5 - 512o/5 - 18. Factor y(t). -(t + 8)*3/5 Let u(t) = 2t + 4t + t2 + 0t*2 + 5t2 - 11. Let m(w) = w2 + w - 2. Let b(h) = 22m(h) - 4u(h). Factor b(s). -2s(s + 1) Let a = -4 - -7. Suppose -z = az - 16. Factor u5 + u - u4 - 3u*z + 6u*3 + 0u*4 - 4u*2. u(u - 1)*4 Let y be 2/(-5 - -1)-2. Factor 0d3 - y + 3d - 2d3 + d4 - d. (d - 1)3(d + 1) Let a = 13 - 7. Let r be a - (1 - (-1 - 0)). Factor -r + 5 - 3 - 2o2 + 6o - 2. -2(o - 2)(o - 1) Let d(t) be the third derivative of t6/480 + t5/240 - t*4/48 + 6t*2. Factor d(a). a(a - 1)(a + 2)/4 Let u(k) be the second derivative of -k4/6 + k3/3 + 12k. What is h in u(h) = 0? 0, 1 Suppose -2/13 + 16/13p - 14/13p*2 = 0. What is p? 1/7, 1 Let h(y) = 6y*2 - 12y - 4. Let g(u) = -5u2 + 11u + 4. Let j(v) = 2g(v) + 3h(v). Suppose j(p) = 0. What is p? -1/4, 2 Suppose 0 = 2p - 23 + 7. Suppose -24r + 20r + p = 0. Suppose 1 + 1/2y*r - 3/2y = 0. What is y? 1, 2 Let v = -1 - -1. Find n such that 2/5n3 - 2/5n*5 + 0 + 0n*2 + vn*4 + 0n = 0. -1, 0, 1 Factor -4 + 4 + c*3 - 3c*3 - 2c*4. -2c*3(c + 1) Suppose -2a - 5t = -a - 55, 3a - 2t - 114 = 0. Factor v4 - 40 + v3 + a. v*3(v + 1) Let g(l) be the first derivative of l6/540 + l5/60 + 4l3/3 + 10. Let q(o) be the third derivative of g(o). Factor q(j). 2j(j + 3)/3 Let f = 667 + -658. Factor -fl - 3/2l2 - 27/2. -3(l + 3)*2/2 Let b(c) be the first derivative of 0c*2 - 8/15c*5 + 3 + 5/6c*4 - 4/9c*3 + 1/9c*6 + 0c. Factor b(k). 2k2(k - 2)(k - 1)2/3 Let b(r) be the third derivative of -1/1440r*6 + 1/6r3 + r2 - 1/120r5 + 0 + 0r - 1/24r4. Let s(q) be the first derivative of b(q). Factor s(o). -(o + 2)2/4 Suppose 2t = -s + 2, 0 = -s - 5t - 2 + 7. Suppose 2/3h*4 + 2/3h*5 - 2/3h*3 + 0 - 2/3h*2 + sh = 0. Calculate h. -1, 0, 1 Let k(m) be the third derivative of -m*5/12 + 15m*4/8 - 20m*3/3 - 8m*2. Factor k(y). -5(y - 8)(y - 1) Factor 5j*3 + 64j + 13 + 32j2 - 13 - j3. 4j(j + 4)2 Let c be (-8)/(0 + -3 - -1). Factor -q5 + 4q*2 + 2q*3 - q + 0q - cq2. -q(q - 1)*2(q + 1)*2 Suppose -6q + 4q = 4q. Let y(z) be the first derivative of -1/2z6 + 0z*3 - 3/5z*5 + 0z + 2 + qz2 + 0z*4. Find h, given that y(h) = 0. -1, 0 Let x(l) = -2l*3 - 4l*2 + 4l - 4. Let f(q) = 2q3 + 5q*2 - 5q + 5. Let w(m) = 4f(m) + 5x(m). Factor w(p). -2p3 Let b(t) be the second derivative of -t5/10 - t4/3 + t3/3 + 2t*2 - 4t. Factor b(s). -2(s - 1)(s + 1)(s + 2) Let s(g) = -g3 + 5g*2 + g + 2. Let h be s(5). Suppose hy - 2y = 40. Factor 0w + 2w + 2w*2 - 10w + y. 2(w - 2)2 Suppose -3c - 5 + 11 = 0. Let s(g) be the first derivative of 3 - 4/15g3 + 0g + 0g4 + 1/5g*c - 1/15g*6 + 4/25g*5. Factor s(n). -2n(n - 1)3(n + 1	{ "pile_set_name": "DM Mathematics" }
8. Let d be m(4). Let c be (8/(-6))/(4/d). Let o(n) = n + n - n - c. Give o(-6). -10 Let i(g) be the first derivative of g*3/3 + 2g*2 - 10g - 14. Let r be i(-6). Suppose -2k + 2 = -r. Let u(h) = -5h + 1. Calculate u(k). -9 Let p(n) be the second derivative of n*3/6 - 6n*2 + 3264n - 2. Suppose -3k + 10 = -2k. Give p(k). -2 Let d(k) = -2k3 + 209k*2 - 116k + 1241. Let x be d(104). Let o(g) = -3g + 18. What is o(x)? 39 Let m(p) = -6p - 10. Suppose -184 = 4v - 4g - 160, 0 = 2v + 3g + 42. Give m(v). 62 Let a(s) = 65s - 689. Let m(z) = 33z - 337. Let j(u) = -2a(u) + 5m(u). Determine j(9). 8 Let y(c) = c*2 + 237c - 1714. Let j be y(7). Let o(q) = -q*2 - 8q - 12. Give o(j). 0 Let t(v) = v*2 + 8v + 11. Let u be 2/(275/(-70) - -4). Suppose 0 = -3a + u + 71. Suppose -3q + 2 = -i - q, a = -3i - 3q. Give t(i). 11 Let l(w) = -w*3 + w + 1. Let r(p) = -13p*2 - p + 1. Let j be r(2). Let g = j - -54. Suppose -g = 2v + 1. Calculate l(v). 1 Let z(r) = 2r3 + 31r*2 + 10r - 117. Let l be z(-15). Let n be (10/6)/(1/(-24)). Let v = l - n. Let x(c) = -c*3 - 5c*2 - 3c. Give x(v). -6 Let k(q) = 5q - 22q + 594 - 73 - 19q + 67. Determine k(16). 12 Suppose -3b - 21 = -2s - s, -3s - 3 = b. Let c(z) be the third derivative of -z*4/12 - 7z*3/6 - 426z*2 + 2z + 2. Calculate c(b). 5 Let z(y) = 2y3 - y2 + 6y - 4. Suppose 4m + 16 = 4h, 4m - 3h + 13 = 2m. Let v be z(m). Let t(f) = -2 + 0f + f*2 - 2f*2 + f. Give t(v). -8 Let m(h) = 9h*3 - 10h*2 + 21h - 9. Let q(k) = -4k3 + 4k*2 - 9k + 4. Let y(g) = 6m(g) + 14q(g). Let l = 4 - 7. What is y(l)? 20 Suppose 3g = 8g - 5, 0 = 3k + 5g - 32. Let v(m) = -13 + 10m + 146m*2 + 117m*2 - 264m*2. What is v(k)? -4 Suppose 0 = 7h - 1 - 27. Suppose -hy - 4 = -16. Suppose 11 - 2 = yj. Let c(d) = d - 4. Give c(j). -1 Let t(j) be the first derivative of j*2/2 - 20j - 1893. Calculate t(-9). -29 Let j(o) be the second derivative of o*4/12 - 4o3/3 + o2/2 + 332o + 4. Calculate j(11). 34 Let m(f) = 7f*3 + 17f*2 + 13f - 4. Let x(y) = 12y3 + 34y*2 + 27y - 10. Let i(g) = 5m(g) - 3x(g). Determine i(-16). 10 Let v(y) = -56y + 173y + y*2 - 63y - 61y + 9. Calculate v(5). -1 Suppose 0 = -3t + a + 8, 21 = -4t + 5a - 10a. Let j be 3t/(3/(-7)). Let h(p) = -278p - 3 + 14 + 279p. What is h(j)? 4 Suppose -2q = -12q + 40. Let b(f) = -2f + qf + 0 + 5 - 1. Give b(10). 24 Let a(q) be the third derivative of -58q2 + 0 + 2/3q*3 + 1/4q*4 + 0q. Let u be (-3)/(-1 + 3 + -1). Give a(u). -14 Let f(s) = 11 - 2s - s + 4s + 0. Let w be (-836)/110 + 6/10. Give f(w). 4 Let c(y) be the second derivative of y5/20 + y4/2 + 4y3/3 - 2y*2 - 1340y. Calculate c(-4). -4 Let z(q) = -q*2 - 12q + 3. Let o(k) = 4k - 40. Let n be o(7). Let j be ((-100)/42 + (-8)/n)7. Determine z(j). 3 Let h(d) = d + 1. Let s = -67 + 67. Suppose s = -114n + 113n - 2. Give h(n). -1 Let r(u) = -2u2 + u - 2. Let v be ((-14)/35)/(2/10). Let q be (344/16)/((v/(-1))/4). Let m = q - 40. Give r(m). -17 Let x(p) = 4p - 51 + 168 - 52 - 48. Give x(4). 33 Let q(d) = -d. Let m(s) = -16s + 3. Let w(u) = -m(u) + 3q(u). Let i(z) = -27z - 619. Let a be i(-23). Give w(a). 23 Suppose 4r = -5a + 4, 5a + 32 = -5r + 47. Let s(i) = 5i - 4. Let b(p) = -9p + 7. Let k(n) = 4b(n) + 7s(n). Calculate k(a). 8 Let i(j) = j3 + 16j*2 + 17j + 22. Let d(b) = 19b2 - 18b - 15. Let o be d(0). Calculate i(o). -8 Let p(g) = -g*2 + 6g + 4. Let d = -27 - -29. Suppose -2s - 46 = -a, -ds = 3a - 2a - 26. Let y = a - 30. Give p(y). 4 Suppose 72q = -27q + 297. Let g(l) = -4l - l - 2 + 0l. Give g(q). -17 Let l(u) = -u3 - u2 + 7u - 4. Suppose 249s - 133s - 879 = -177s. Give l(s). -19 Let a = -9 + 19. Let b(x) = 5817x + 11x2 - x3 - 5826x + 588 - 592. Determine b(a). 6 Let f(i) = i3 - 3i2 - i - 3. Let o(j) = j3 - 2j2 - 2j - 5. Let y be 4(-10)/25(-20)/(-8). Let a(w) = yf(w) + 3o(w). Determine a(4). 21 Let t(j) = -j*2 - 9j - 12. Let n be (5 - 9) + 0 + 31. Suppose -nq + 1065 = -12q. Suppose 4f + q - 39 = 0. Give t(f). -4 Let g(c) = c. Let k(x) = -6x - 15. Let r be k(-6). Suppose 2l - r = 5i, 2i + 5l = -2i + 3. Let j be -2 + (i - -4) - 5. Calculate g(j). -6 Let c(z) be the second derivative of z5/20 - 3z*4/4 + 5z*3/2 - 57z*2/2 - 234z. What is c(8)? -1 Let g(s) = s*2 + 13s + 13. Let k = -428 + 421. Let q be (k - (2 - -5))1. Give g(q). 27 Let t(d) be the first derivative of -d4/4 + d - 54. Let x be -1 + (1 - 0) + (7 - 7). Calculate t(x). 1 Let i(m) = -m + 43. Let w(u) = -u + 20. Suppose 5h = 4h - s - 11, -h + 2s + 4 = 0. Let l(b) = hi(b) + 13w(b). Give l(1). -5 Let h be (((-36)/5)/(-3))/(1/5). Let n(o) = -h + 10 + 2o + 5. Determine n(-4). -5 Let b(f) = f3 + 8f*2 + 7f - 3. Let j = 264 - 271. Give b(j). -3 Let a(t) be the first derivative of -t*3/3 - 13t*2 + 55t - 236. Calculate a(-28). -1 Let v(d) = 11d2 + 160d - 538. Let h(u) = 3u2 + 40u - 134. Let q(w) = 15h(w) - 4v(w). Determine q(36). -2 Let o(y) = -18 - 111y + 34y + 4y2 + 25y + 35y - 5y2. Calculate o(-16). -2 Let q(c) = c2 - 14c - 8. Let d(y) = -y2 + 16y + 9. Suppose 2w = 5 - 17. Let b(t) = wq(t) - 5d(t). Calculate b(6). -9 Let a(m) be the third derivative of 0m + 61m2 + 1/2m*3 - 1/24m*4 + 0. Let i = -10 + 17. Determine a(i). -4 Let q(d) = 5d*2 + 35d + 11. Let t(f) = 2f2 + 12f + 4. Let l(o) = -o*2 - 13o + 22. Let u be l(-14). Let r(a) = ut(a) - 3q(a). Give r(7). -15 Let a(w) = -2w + 1. Let n be 14/63 - (-17052)/54. Suppose 24 = -324y + ny. Give a(y). 7 Let q = -13 + 23. Let l(f) = -8141 + 24394 - 8124 - 8130 - f. Give l(q). -11 Let n(m) be the second derivative of m4/6 + 5m*3/3 + 21m*2/2 - 5682m. Give n(-10). 121 Let c(o) = -5o2 + 37o - 3. Let w be c(7). Suppose 4 + w = -5j. Let r(v) = 7v. Determine r(j). -21 Let s(h) = -h*2 - 15h + 59. Let g(z) = -z*2 - 16z + 56. Let m(w) = 4g(w) - 3s(w). Give m(-21). 5 Let z(w) = -w*2 + 14w - 14. Let n be z(13). Let k = -4 + n. Let m(c) be the second derivative of c*4/12 + 2c3/3 + c2 + c + 96. What is m(k)? 7 Let h(i) = -i*3 + 3i*2 - 3i + 1. Let c = 218 - 221. Let m be 6 + -3 + c + 3. Give h(m). -8 Let t(i) be the first derivative of -22i3/3 - i2/2 - 195i + 177. Let f(r) be the first derivative of t(r). What is f(1)? -45 Let y(g) = 3 + 15 - 4 + 5 - 4 + 11g. Determine y(-1). 4 Let o(c) be the first derivative of -1/2c2 - 65 + c. Determine o(6). -5 Let z(r) = r3 + 5r2 - 2r - 7. Let x be 432/96 + (-10)/(-4). Suppose -xk + 0k - 35 = 0. Calculate z(k). 3 Let c = 3 - 1. Let h(l) = -2l - 78l*2 - 1 + 19l*2 + 3l*2 + 41l*2 + 19l*2. Calculate h(c). 11 Let j(d) = 13d + 1. Let o(n) = n - 1. Let c(f) = j(f) - 2o(f). Let v be 0/(-2) + -7 + 25/5. Determine c(v). -19 Suppose -5k + 4 = -16. Let d(u) = 4u2 + ku + 4u2 - 9u*2 + 6 - 5u. Give d(-3). 0 Let f(m) = 22m2 + 14m - 29. Let k(v) = -9v2 - 8v + 13. Let h(p) = 2f(p) + 5k(p). Calculate h(-12). 7 Let o(l) = -3l - 20. Let v be 146/292 - 5/2. Give o(v). -14 Let j(r) = r2 - 2r - 8. Let d(x) = x*2 + 25x - 181. Let h be d(-31). Determine j(h). 7 Let s(t) = t + 1. Let c(k) = -k*2 - 4k - 9. Let i = 81 + -85. Let b be c(i). Let v be (-1)/(-31/b). Give s(v). -2 Let d be 3/32/1. Suppose 4l - 3f - 1885 = 0, 4l - 7l + 1435 = 2f. Let z(p) = l - 476 + p + p. Determine z(d). 3 Let f(d) = -d - 15. Let n(w) = w2 + 6w - 9. Let h be n(-8). Suppose -8s + 19 = -9s - 2o, -3s + 4o = h. What is f(s)? -6 Let a(v) = 43v*2 + 21v + 69. Let z(c) = 9c2 + 4c + 16. Let n(y) = -4a(y) + 19z(y). What is n(-12)? -20 Let m(z) = -4z3 - 10z*2 - 10z - 2. Suppose -12 = -15a + 9a. Let t(y) = -3y3 - 8y*2 - 8y - 2. Let b(k) = am(k) - 3t(k). Determine b(-3). -1 Let p(o) = -61o2 - 3o + 119o2 + o - 59o*2. What is p(0)? 0 Let x be 1(-1 - 0/1). Suppose 5l + 211 - 191 = 0. Let h = l - x. Let u(o) = 2o + 1. Give u(h). -5 Let b(v) be the first derivative of -5/2v2 + 137 + 5v - 1/3v3. Suppose -t - 7 = t + 5o, -2 = -2o. What is b(t)? -1 Suppose 54w + 280 = 62w. Let d(o) = -82o + 6 + 44o + wo - 2. Give d(2). -2 Let v(c) = 109c*2 +	{ "pile_set_name": "DM Mathematics" }
5/3u2 + 10/3u5 = 0. -1/2, 1, 446 Let c(x) = -x4 + x3 + x2 - x. Let o(f) = -4f5 - 18f*4 - 18f*3 - 6f*2 - 2f. Let h be (-1)/(3 + 15/(-6)). Let s(d) = hc(d) + o(d). Factor s(r). -4r*2(r + 1)*2(r + 2) Let m(p) be the third derivative of -p*8/336 - 19p*7/70 - 149p*6/20 - 235p*5/6 - 747p*4/8 - 243p*3/2 - 3195p*2 - 2p. Suppose m(q) = 0. What is q? -27, -1 Let a = -18044/11 + 90264/55. What is z in -1/5z3 + az*2 - 1/5z - 6/5 = 0? -1, 2, 3 Let r(q) = q*3 - 2q*2 - 4q - 8. Let x be r(4). Determine z so that -13z - 20z*2 + 43 - 10z*3 + 15z - 12z2 + xz*3 - 11 = 0. -16, -1, 1 Suppose 98/3n*2 + 68/3n - 2n3 - 34/3n*4 + 2/3n5 + 0 = 0. Calculate n. -1, 0, 2, 17 Let q(x) = x3 + 19x2. Let t(s) = s3 + 55s*2 - 55s + 39. Let n(i) = 4q(i) - 2t(i). Find l such that n(l) = 0. 1, 3, 13 Let y = -131627 + 394882/3. Solve 0c - yc3 - c2 + 0 = 0 for c. -3, 0 Suppose -43o = -53o + 50. Let g be 6/o-25(-6)/420. Factor 12/7 + gn2 - 12/7n. 3(n - 2)2/7 Let f be (39/(-315))/((-28)/5 - -6). Let x = 1699/210 - f. Solve -6/5k + 42/5k2 - xk*4 + 6/5k*3 + 0 = 0. -1, 0, 1/7, 1 Factor -2303j*3 - 18j*2 + 2305j*3 - 12 - 2j*4 + 3j4 - j2 + 28j. (j - 2)(j - 1)*2(j + 6) Let h(f) = -5f3 - 619f*2 - 1336f - 245. Let r(p) = 5p3 + 620p*2 + 1337p + 246. Let n(g) = 4h(g) + 3r(g). Determine u, given that n(u) = 0. -121, -2, -1/5 Suppose 0 = 2l + 87b - 83b - 54, -l = -5b + 22. Let n(a) be the third derivative of 0a - 1/240a*5 + 1/16a*4 - 3/8a*3 + la2 + 0. Factor n(i). -(i - 3)2/4 Let p(y) = -7 + 2y - 4 + 23 - 1 - 12. Let x(v) = 4v*2 - 104v + 412. Let o(q) = -12p(q) - x(q). Find f, given that o(f) = 0. 10 Let m be 10/(-2) - (-14 + (2 - -3)). Let w be m/(-1) + -2(-104)/48. Factor -13/3j2 + w - 10/3j*3 - 2/3j. -(j + 1)(2j + 1)(5j - 1)/3 Let w = -823 + 1694. Suppose 15 - 3q2 + 42 + 841q + 15 - wq = 0. Calculate q. -12, 2 Let u(y) be the first derivative of 2/3y*3 + 0y + y*5 - 7/4y*4 + 154 + 0y2. Factor u(c). c2(c - 1)(5c - 2) Let d(w) = 52w - 164. Let u be d(3). Let t be 4/18(-6)/u. Factor 1/3 - 1/6s*2 + ts. -(s - 2)(s + 1)/6 Let x(i) be the third derivative of 432/13i*3 - 31i*2 + 36/65i*5 + 2/65i*6 + 72/13i*4 - 2 + 1/1365i*7 + 0i. Find j, given that x(j) = 0. -6 Let x = -20191 - -20194. Let h(i) be the second derivative of 1/7i7 + 24i - 1/3i6 + 0 + 0i*x + 0i*2 + 1/6i*4 + 1/10i*5. Solve h(w) = 0. -1/3, 0, 1 Let b(o) be the first derivative of 0o*2 - 1/6o*4 - 16/9o*3 + 0o - 29. Suppose b(w) = 0. Calculate w. -8, 0 What is t in -444/7t2 + 30/7t*3 + 3/7t*4 - 855/7 + 1266/7t = 0? -19, 1, 3, 5 Let r(k) be the first derivative of 5k6/6 + 9k*5 - 140k*4 - 2949. Determine s so that r(s) = 0. -16, 0, 7 Let c = -63 - -65. Let w be c - ((-9)/(-9))/(7/11). Find f such that -wf - 1/7 - 3/7f2 - 1/7f*3 = 0. -1 Let p be (-44596)/252 + 54/180. Let w = -176 - p. Let 12/7u2 - wu*3 + 3/7 - 10/7u + 1/7u4 = 0. What is u? 1, 3 Suppose 140z = 130z + 30. Let h(c) be the first derivative of -16 - 2/11c*z + 0c + 0c4 + 2/55c*5 - 2/11c*2. Factor h(r). 2r(r - 2)(r + 1)*2/11 Let v(k) be the first derivative of 0k + 11/8k4 - 3k*3 + 2k*2 - 109 - 1/12k*6 + 0k*5. Determine h, given that v(h) = 0. -4, 0, 1, 2 Let i = -1/602052 - -64218881/602052. Suppose -256/3r + 10/3r3 + i - 2/3r*4 + 12r*2 = 0. Calculate r. -5, 2, 4 Suppose -130/7w + 372/7 + 2/7w2 = 0. What is w? 3, 62 Let w(a) = -a2 - 2139a + 2134. Let f(v) = -18v2 - 34224v + 34143. Let s(t) = -2f(t) + 33w(t). Suppose s(b) = 0. What is b? 1, 712 Let p(y) be the third derivative of -6y7/35 - y6/30 + 26y*5/15 - 8y*4/3 - 180y*2 + 2y. Factor p(n). -4n(n - 1)(n + 2)(9n - 8) Factor -2141u + 60u2 - 12u*2 + 65u*3 - 89u*4 + 2171u + 108u4 + u5 + 29u*2. u(u + 1)*2(u + 2)(u + 15) Let c(b) = -3b*4 - 146b*3 - 2276b*2 - 9768b - 11616. Let r(d) = 3d4 + 147d*3 + 2274d*2 + 9768d + 11616. Let p(u) = -3c(u) - 4r(u). Factor p(a). -3(a + 2)(a + 4)(a + 22)2 Let p(j) = -60j - 10. Let s be p(-4). Let x be (23/46)/(s/(-116) + 2). Determine g, given that -20g3 + 3g + xg3 - 23g*2 + 6g - 7g2 = 0. 0, 1/3, 3 Let a(o) be the first derivative of 4o*5/5 - 191o*4 + 12287o*3 - 18145o*2 + 9025o - 7454. Solve a(s) = 0 for s. 1/2, 95 Let y(d) be the first derivative of -d*7/2940 - 2d6/105 + d5/420 + 2d4/7 - 295d*3/3 - 124. Let z(g) be the third derivative of y(g). Factor z(t). -2(t - 1)(t + 1)(t + 24)/7 Let n(t) be the first derivative of 28t + 0t*2 + 1/33t*3 - 3 - 1/66t*4. Let m(l) be the first derivative of n(l). Solve m(o) = 0 for o. 0, 1 Determine l, given that 22l*4 + 94/5l*3 - 156/5l*2 + 16 - 152/5l + 24/5l5 = 0. -2, 5/12, 1 Let p = 21470 + -21374. Factor p + 75/2w*2 + 120w. 3(5w + 8)*2/2 Solve 992v - 1910v - 3v*3 - 4782v - 368v2 - 27000 + 62v*2 - 24v*2 = 0 for v. -90, -10 Let 82/7l + 2/7l4 - 12 + 18/7l*2 - 18/7l*3 = 0. What is l? -2, 1, 3, 7 Let m(s) = 13s*2 - 517s - 984. Let t(i) = -140i2 + 5685i + 10825. Let n(r) = 65m(r) + 6t(r). What is w in n(w) = 0? -99, -2 Let s(u) be the first derivative of -55/2u2 + 135 + 5/3u*3 + 0u. Find x, given that s(x) = 0. 0, 11 Let q(g) = 8g3 + 8g*2 - 8g + 16. Let u(y) = 2 + y3 - 4 + y2 - y + 3. Suppose 4d = 40 + 8. Let j(z) = du(z) - q(z). Find b, given that j(b) = 0. -1, 1 Let a = -11 - -19. Determine f so that -252f + a + 279f*2 + 154f*2 + 155f*2 + 19 = 0. 3/14 Let v = -3569 - -10712/3. Let n(o) be the second derivative of 1/2o*5 - 5o*2 + 0 - 1/3o*6 - 5/6o*3 - 5/42o*7 + 11o + vo4. Let n(t) = 0. What is t? -2, -1, 1 Let c(k) be the third derivative of -1/210k*7 + 0k*5 + 2k*2 - 2 + 0k - 1/20k6 + 0k*4 + 0k3. Factor c(a). -a3(a + 6) Let j(h) = h2 + h - 44. Let z be j(7). Factor -60 - 38s*2 + 43s*2 - zs + 7s. 5(s - 4)(s + 3) Let g be (1 + 2)/7510/72. Let d(k) be the third derivative of -k*2 + 0 + 1/3k*3 - 7/36k*4 + 0k - gk6 + 1/18k*5. Factor d(y). -2(y - 3)(y - 1)2/3 Factor -327x*2 - 342x*2 + 664x*2 - 1220 + 620x. -5(x - 122)(x - 2) Suppose 3a - 2o = -4, 2o = 2a - 0o + 4. Let u be a + ((-80)/(-140) - (-8)/(-14)). Suppose 0v*3 + 0 + uv*2 + 1/5v*4 + 0v = 0. Calculate v. 0 Let n(i) = 43i2 + 11139i + 5589. Let v(j) = -32j2 - 8356j - 4192. Let f(o) = 8n(o) + 11v(o). Determine y, given that f(y) = 0. -350, -1/2 Let b(k) = 4k3 - 374k*2 - 48k. Let u(d) = -8d3 + 747d*2 + 120d. Let f(s) = 5b(s) + 2u(s). Factor f(z). 4z2(z - 94) Let i(g) be the first derivative of -g*4/32 + 3g*3/8 + 21g*2/16 - 169g - 89. Let y(s) be the first derivative of i(s). Factor y(x). -3(x - 7)(x + 1)/8 Suppose 6473 - 3263 = -32v + 3274. Let r(z) = -z2 - 5z + 3. Let b be r(-5). Factor 3/4l5 + 0l*b - 3l*v + 0 + 0l + 9/4l4. 3l*2(l - 1)(l + 2)2/4 Let c(s) be the third derivative of 0 + 1/35s*5 + 57s*2 - 2/3s*3 + 0s - 10/21s4. Determine v so that c(v) = 0. -1/3, 7 Let -47105s + 2860 + 23560s + 22953s + 4s2 = 0. What is s? 5, 143 Factor -3/4n*3 - 99/4n*2 + 171 + 147n. -3(n - 6)(n + 1)(n + 38)/4 Let v(l) be the second derivative of 0l*2 - 4/5l*4 + 0 - 4/25l*6 - 2/105l*7 + 204l - 13/25l5 - 8/15l*3. Determine d, given that v(d) = 0. -2, -1, 0 Suppose -2x = 4h - 2, -2x + 20h + 12 = 14h. Suppose -1/10tx + 0 + 2/5t + 3/10t2 = 0. Calculate t. -1, 0, 4 Let o(j) = -45j*2 - 145j - 125. Let f(h) = 11h2 + 36h + 31. Let s = 136 + -161. Let v(b) = sf(b) - 6o(b). Factor v(l). -5(l + 1)(l + 5) Find r such that 1056/5 + 3/5r2 + 114/5r = 0. -22, -16 Suppose 18n + 27 = -45. Let p(r) = 3r*3 - 31r*2 + 5r + 5. Let v(j) = 2j3 - 30j*2 + 4j + 4. Let g(y) = np(y) + 5v(y). Factor g(s). -2s2(s + 13) Solve 4/7y2 + 2/7y*3 + 0 - 16/7y = 0. -4, 0, 2 Let a(u) = 17u4 - 57u*3 + 104u*2 - 96u + 41. Let j(t) = 4t4 - 14t*3 + 26t*2 - 24t + 10. Let l(v) = 2a(v) - 9j(v). Factor l(o). -2(o - 2)2(o - 1)2 Let y(q) = q3 + q*2 - 13q + 3. Let s be	{ "pile_set_name": "DM Mathematics" }
d and 3 u? 8/21 Two letters picked without replacement from iiclillxckklixlgi. Give prob of picking 1 g and 1 x. 1/68 What is prob of picking 4 a when four letters picked without replacement from aooaaoa? 1/35 Three letters picked without replacement from eelejeeehkd. Give prob of picking 1 e, 1 d, and 1 j. 2/55 What is prob of picking 1 v, 2 r, and 1 o when four letters picked without replacement from {o: 1, v: 2, p: 1, g: 1, r: 2}? 2/35 Calculate prob of picking 2 t when two letters picked without replacement from {x: 8, a: 4, t: 4}. 1/20 Calculate prob of picking 1 i, 1 n, and 1 y when three letters picked without replacement from {t: 2, n: 1, d: 4, y: 2, i: 5, k: 1}. 2/91 What is prob of picking 3 q when three letters picked without replacement from {c: 5, h: 2, q: 3}? 1/120 Calculate prob of picking 1 w and 1 g when two letters picked without replacement from gggww. 3/5 Two letters picked without replacement from sruiscddi. What is prob of picking 1 u and 1 s? 1/18 Three letters picked without replacement from uababowuoaoaaaoouuu. What is prob of picking 1 b, 1 w, and 1 u? 10/969 Calculate prob of picking 1 f and 1 k when two letters picked without replacement from hohoffhhhhhkhohqh. 1/68 Two letters picked without replacement from {n: 2, r: 3, k: 3, j: 1, o: 2, u: 1}. Give prob of picking 1 r and 1 o. 1/11 Three letters picked without replacement from zkkkazekt. What is prob of picking 1 k, 1 z, and 1 t? 2/21 Calculate prob of picking 2 d and 1 n when three letters picked without replacement from nddddddndnn. 28/55 What is prob of picking 3 x when three letters picked without replacement from xexwxwexeeex? 1/22 Calculate prob of picking 1 y, 1 q, and 1 t when three letters picked without replacement from fyqst. 1/10 Calculate prob of picking 2 l and 2 y when four letters picked without replacement from {y: 4, l: 3}. 18/35 Two letters picked without replacement from qjqq. Give prob of picking 2 q. 1/2 Two letters picked without replacement from attpmat. What is prob of picking 2 a? 1/21 Two letters picked without replacement from xjxdxixxxijihiijh. Give prob of picking 1 x and 1 i. 15/68 What is prob of picking 2 o and 2 a when four letters picked without replacement from haaoookhoooo? 7/165 Three letters picked without replacement from peurbpuerpbepubpeuu. What is prob of picking 1 p, 1 b, and 1 e? 20/323 What is prob of picking 1 y and 1 t when two letters picked without replacement from {y: 2, t: 3, e: 9, z: 4}? 2/51 What is prob of picking 2 t when two letters picked without replacement from {t: 8, b: 2, s: 4}? 4/13 What is prob of picking 3 f when three letters picked without replacement from {r: 2, p: 1, f: 4, n: 1, v: 2}? 1/30 Three letters picked without replacement from slhllshllhsqlhh. What is prob of picking 1 s and 2 h? 6/91 What is prob of picking 2 n when two letters picked without replacement from {n: 9, g: 7}? 3/10 Calculate prob of picking 1 e, 2 v, and 1 y when four letters picked without replacement from yeeevvyeevyeyeveyeey. 24/323 Calculate prob of picking 2 e and 2 w when four letters picked without replacement from {w: 3, e: 4, g: 2}. 1/7 Calculate prob of picking 2 x, 1 l, and 1 s when four letters picked without replacement from {o: 1, l: 10, s: 1, x: 3}. 2/91 Calculate prob of picking 1 x, 2 z, and 1 h when four letters picked without replacement from {h: 8, x: 4, z: 8}. 896/4845 Three letters picked without replacement from {u: 2, s: 15, e: 3}. What is prob of picking 1 e and 2 s? 21/76 Calculate prob of picking 2 p and 1 a when three letters picked without replacement from apapppappp. 21/40 Three letters picked without replacement from jjlljlhjjhjjlllljl. What is prob of picking 1 l and 2 j? 14/51 Calculate prob of picking 1 x, 1 i, and 2 h when four letters picked without replacement from {l: 1, b: 3, i: 1, h: 4, x: 1, m: 5}. 2/455 Two letters picked without replacement from {d: 4, a: 8, k: 4}. Give prob of picking 1 a and 1 d. 4/15 Two letters picked without replacement from jjjmjjxajjmcammmm. Give prob of picking 1 c and 1 j. 7/136 What is prob of picking 1 p, 1 x, and 1 e when three letters picked without replacement from plpjepljeqqx? 3/110 Two letters picked without replacement from {j: 4, k: 1, g: 5}. What is prob of picking 2 g? 2/9 Two letters picked without replacement from iofi. What is prob of picking 1 f and 1 i? 1/3 Calculate prob of picking 1 a and 1 x when two letters picked without replacement from {t: 3, a: 5, w: 1, p: 1, x: 3, u: 1}. 15/91 Three letters picked without replacement from wgwwrrgwrrrwrrwrrr. What is prob of picking 3 r? 5/34 Two letters picked without replacement from zhxzzfd. Give prob of picking 1 f and 1 z. 1/7 Four letters picked without replacement from {z: 2, j: 2, g: 1, l: 1, n: 2, y: 1}. Give prob of picking 2 j, 1 n, and 1 z. 2/63 Calculate prob of picking 1 x, 2 l, and 1 k when four letters picked without replacement from {u: 3, k: 1, l: 9, x: 1}. 36/1001 What is prob of picking 2 j and 1 r when three letters picked without replacement from yirjytej? 1/56 Four letters picked without replacement from nngtggggn. Give prob of picking 2 n and 2 g. 5/21 What is prob of picking 2 n when two letters picked without replacement from nnnbnbbbnnnbbb? 3/13 Calculate prob of picking 3 k when three letters picked without replacement from {q: 4, k: 5, y: 1}. 1/12 What is prob of picking 1 g, 1 p, and 1 q when three letters picked without replacement from xpprgqprp? 1/21 What is prob of picking 2 o when two letters picked without replacement from {o: 6, k: 1, a: 4, p: 4}? 1/7 What is prob of picking 3 n when three letters picked without replacement from {c: 2, n: 9, t: 2}? 42/143 What is prob of picking 1 y and 2 q when three letters picked without replacement from {y: 5, d: 1, c: 5, q: 3, f: 3, l: 1}? 5/272 Four letters picked without replacement from {y: 7, i: 5}. What is prob of picking 4 i? 1/99 What is prob of picking 1 o, 1 l, 1 a, and 1 v when four letters picked without replacement from znznnznazozlzvlnvloz? 4/1615 Four letters picked without replacement from ruppr. Give prob of picking 2 r and 2 p. 1/5 Three letters picked without replacement from fronjuru. What is prob of picking 1 n, 1 u, and 1 j? 1/28 What is prob of picking 1 g and 1 w when two letters picked without replacement from {l: 3, w: 2, j: 5, g: 3, d: 2}? 2/35 Two letters picked without replacement from {r: 1, n: 3, s: 4, f: 3}. What is prob of picking 1 r and 1 s? 4/55 What is prob of picking 2 n when two letters picked without replacement from njjjjiiinnjninijinj? 5/57 Three letters picked without replacement from rzrztrzrzrrzrrtrzr. Give prob of picking 3 z. 5/204 What is prob of picking 3 o when three letters picked without replacement from czoccoocccczocoooo? 7/102 What is prob of picking 1 s and 1 y when two letters picked without replacement from {e: 6, y: 2, q: 1, v: 2, s: 5}? 1/12 What is prob of picking 2 t when two letters picked without replacement from {v: 2, t: 2, c: 5, y: 3}? 1/66 Calculate prob of picking 3 a when three letters picked without replacement from aaarraaa. 5/14 Two letters picked without replacement from {u: 5}. What is prob of picking 2 u? 1 What is prob of picking 2 z when two letters picked without replacement from zrrrrrzzrrrrrr? 3/91 Calculate prob of picking 1 x and 1 p when two letters picked without replacement from {x: 6, p: 4}. 8/15 What is prob of picking 2 t and 2 k when four letters picked without replacement from gtttgkggtkggt? 2/143 Calculate prob of picking 1 a and 1 o when two letters picked without replacement from gygghgggaamhygoggg. 2/153 Calculate prob of picking 1 n and 1 g when two letters picked without replacement from {n: 5, p: 3, g: 4}. 10/33 Calculate prob of picking 2 e when two letters picked without replacement from {u: 1, w: 4, e: 2, t: 1, v: 2, g: 2}. 1/66 What is prob of picking 1 e and 1 v when two letters picked without replacement from evnnvevvvvnnvv? 16/91 Calculate prob of picking 1 t and 1 w when two letters picked without replacement from wtxw. 1/3 Calculate prob of picking 1 f, 1 m, and 1 x when three letters picked without replacement from xxxmfxrxmxrrxmmrxmxr. 3/76 Two letters picked without replacement from {m: 2, g: 10}. Give prob of	{ "pile_set_name": "DM Mathematics" }
c) + c - 4c - 13c). 100c*5 Expand 63t4 - t2 - 73t4 + 2t2 + (-t2 - t2 + t2)(t2 + t2 - t2). -11t4 + t2 Expand (-2d + 5d - d)(-137d*3 + 14d*3 - 118d*3). -482d*4 Expand (-3w - 2w + 3w)(0w + w + 0w) - 6w*2 - 5w + 5w + 93w*2 + 9578w - 9578w. 85w*2 Expand (t + 2 + 0 - 1)(7t - 13t - 9t)(163t - 163t + 33t2). -495t*4 - 495t3 Expand (-o2 - 2o2 - 6o*2)(-4o - o + 9 - 1). 45o*3 - 72o*2 Expand (5 - 2q - 5)(-46q - 18080 + 18080)(6q*3 - 2q3 - q3). 276q5 Expand 8l*4 + 25l*2 - 25l2 + (-l2 - 2l2 + l2)(-1 - 3l - l + 3l + 2l2). 4l*4 + 2l*3 + 2l*2 Expand (-2o + o - o)(-16 + 8 - 8)(-1 - 1 + 5 + (0 + 1 + 1)(-4 + 4 + 1)). 160o Expand 4q3 - 4q*3 + 2q*3 + (-3 - 2 + 4)(0q + q3 + 0q) + (7q3 + 11 - 11)((4 - 2 + 0)(-2 - 5 + 2) + 4 - 5 + 3). -55q*3 Expand -35z*5 + 14z*5 + 3z + 9z5 + (3z - z + 0z)(3z4 - 5z*4 + 4z*4) - 2z*5 - 3z*5 + 6z*5 - 4z*5 + 3z*5 - 3z*5. -11z*5 + 3z Expand (26 + 15a3 - 26)(a + 7 + a - 22). 30a4 - 225a*3 Expand (2r2 - r2 - 5r2)(-2 + 6 - 1) + 26 - 11r2 - 26. -23r2 Expand (m3 + 0 + 0)(m - 11m + 0m + (1 + 4m - 1)(-3 + 0 + 1)). -18m*4 Expand ((2y - 6y + 2y)(-y3 + y3 + 2y3) + y4 - 3y4 + y4)(3y + 2y - 4y). -5y*5 Expand ((0 + 2 - 3)(-1 - 2 + 1) + (-4 - 2 + 1)(0 + 1 - 4))(0z - z + 3z) + 2z + z - 2z. 35z Expand (-1 - 7 + 4)(-16d2 - 26d*3 - 18d*2 + 32d*2). 104d*3 + 8d*2 Expand (-61h - 65h - 37 + 127h)(h3 + 3h*3 - 3h*3)(h - h + 3h). 3h*5 - 111h*4 Expand -142a + 142a + 158a*4 + (-a + 4a - a)(-4a + 4a - 2a)(0 - 2a*2 + 0). 166a*4 Expand (-p - p + 5p)(0 - 2 + 3)(5p - 2p + p) - 54p2 + 26p*2 - 11 + 30p*2. 14p*2 - 11 Expand (35z*3 - 122z*3 - 66z*3)(-3z - z + 2z). 306z4 Expand (0 + 3v + 0)(-2v*2 - 3v*2 + 4v*2)(-v - 5v + 5v)(0v + 0v - 5v)(3 - 7 + 6). -30v*5 Expand (3a - 4a - 2a)(-2 + 3 + 1) - a - 4a - 4a + (-3a + 0 + 0)(-4 + 3 + 3). -21a Expand (2b2 + 2b*2 + 2b*2)(-6b2 + 7 - 7). -36b*4 Expand (2y - 1 + 1)(2y*3 - 2y*4 - 2y*3) - 90y*5 + 44y*5 + 2y*2 + 64y*5. 14y*5 + 2y*2 Expand (-75 - 58 + 94)(-a + 6a + 0a). -195a Expand (-2y + 6y - 2y)(2y - 2y2 - 2y) + 0y3 - 5y*3 + 3y*3 + (0y*2 - 2y2 + y2)(-11 + 11 - 6y) - 3y3 - 4y*3 + 6y3. -y3 Expand 0u - u5 + 0u + (u*4 + 3u*4 - 3u*4)(2u - 3u + 0u) + 9u*5 - 14u*5 - 11u*5 + (3u*2 + 2u*2 - 4u*2)(-4u3 + 0u*3 + 3u*3). -19u*5 Expand 2c3 - c3 - 2c3 + 316c*3 - 308c*3 - 232c*3 + 0c*3 + 2c*3 - 3c*3 - 3c*3 + 3c3 - c3 + (0c3 + 2c*3 - 3c*3)(-1 + 3 + 0). -229c3 Expand (-7a2 + a2 + a*2)(-3 + 5 - 1)(2a + 5 + 5 + a). -15a3 - 50a*2 Expand (2x*3 - x + x)(-5 + 3 + 0)(3x*2 - 31x + 31x). -12x*5 Expand -4h3 + h4 + 4h3 + (-33h*3 + 35h*3 - 34h*3)(-h + 2h + 0h). -31h4 Expand (-t3 - 10t*2 + 9t*2 - 4t*2)(-21t + 21t + 5t2). -5t*5 - 25t*4 Expand -1465l*2 + 1467l*2 + 2 - 1 + 28l + (-3l + l + 4l)(l + l - l) + l2 + 0l*2 + 0l*2. 5l*2 + 28l + 1 Expand 2i2 + i2 - 2i*2 + (2i + 0 + 0)(2i - 2i + i) - 11i*2 + 12i - 12i - 4i2 + i2 + 7i2. -4i*2 Expand (-4a + 0a - 12 + 11)(0a3 - 10a3 - a3). 44a4 + 11a*3 Expand (3f*4 - 16f*2 + 16f*2)(0f + 10f + 18f). 84f*5 Expand (-2b*3 + 2b*4 + 2b*3)(-30b + 6 - 9b - 5). -78b5 + 2b*4 Expand (-2a - a + 4a + (4a - 7a + a)(1 + 2 - 2) + 3a - 5a - a + 2a + 3a - 4a)(0 - 2 + 3 + (3 - 2 + 0)(2 + 0 - 1)). -6a Expand (-165p - 31 + 10 + 22)(1 + 0p2 + 1 + 2p*2). -330p*3 + 2p*2 - 330p + 2 Expand (2a3 + 2a*3 - 5a*3)(-434a - 1347a*2 - 441a + 875a). 1347a*5 Expand (-5t - 9t - 9t)(-32 + 16 + 5). 253t Expand (-4q2 + 3q*3 + 4q*2)(-9q2 - 5q - 11q2 + 2q) + (2q3 - 2q*3 + 2q*4)(q + q + q). -54q5 - 9q*4 Expand 2s*4 + 0s4 - s4 + (2 - 2s3 - 2)(-5s + 0s + 6s) - 5s*4 + 4s4 - s4 + (25s3 - 15s*3 - 16s*3)(-3 + 2s + 3). -15s*4 Expand ((-a + 0a + 2a)(-3 + 6 - 1) + a + a + 2 + 0)(3a*2 + 8a*2 - 4a*2). 28a*3 + 14a*2 Expand 3c*2 + 0c2 - c2 - 3c - c2 + 3c + (c + 4 - 4)(1 - 2c - 1) - 1 - c*2 + 1 - 179c*2 + 517c*2 + 321c*2 + 106c*2. 763c*2 Expand (-68 - 194 + 59)(-3w3 + 3w*2 - 3w*2). 609w*3 Expand (0j*2 + 0j2 + j2)(-3j + 4 - 4) - 17j + 17j + 67j3. 64j*3 Expand -6f*4 + 2f*4 + 0f*4 + (0f*2 + 0f2 + f4)(4 + 0 - 6) - 4f*2 - 2f*4 + 4f2 + (-5 + 3 - f3 + 0f3)(2f + 2 - 2). -10f*4 - 4f Expand -3 + y + 3 + (1 + 0 - 3)(-14y + 28y - 15y). 3y Expand (9k - 10k - 12k)((-2 + 2 - 3)(1 - 6 + 2) + 4 - 1 - 2 - 2 + 2 + 1). -143k Expand (1 + 2t - 1)(-t - 30 + 15 - 30). -2t*2 - 90t Expand (6m2 + m2 - 4m*2)((-3 + 4 + 1)(-3 + 3 - 2) + 2 - 1 + 2)(-3m - 4 + 4). 9m3 Expand (-y2 - 3y2 + 2y*2)(-1 + 1 - y*2) - 64y*4 + 73y*2 - 141y*2 + 71y*2. -62y*4 + 3y*2 Expand 2s - 9s + 5s + (-3s + s + 4s)(1 - 4 + 1) + (-2 + 2 - 2)(s - s - s). -4s Expand 4n*3 - 6n*3 + 6n*3 + (-n - 4n + 2n)(-1 - 1 + 1)(2n*2 - n + n) + (2n*3 + 3n*3 - 6n*3)(1 + 3 - 2). 8n3 Expand (z4 + z - 3z + 3z + z3)(102 - 50 - 550). -498z4 - 498z*3 - 498z Expand (-169 + 424 - 178)(2o + 6o - 7o). 77o Expand (2y - 7 + 7)(-8 + 3 + 118). 226y Expand (-794m + 398m + 3 + 395m)(-2m3 + 0m*3 + 0m*3). 2m*4 - 6m*3 Expand (-49 + k + 0k + 26)(7k + 5k - 4k). 8k2 - 184k Expand (-5 + 3 + 5)(3 + 1 - 1 + 0 + 1 + 1 + (2 + 4 - 5)(0 + 1 + 1) + 3 - 2 + 5)(0o + 2o - o). 39o Expand (-2l + l - l)(l - l + l) - 2l2 + 0 + 0 - 5 - l - 36629l*2 + 4 + 36806l*2. 173l*2 - l - 1 Expand -26z*4 + 49z*4 + 0z5 + z5 + (4 + 2z3 - 4)(-4z2 + 6z*2 - 4z*2). -3z*5 + 23z*4 Expand (y + y - 4y)(-50 + 57 + 42 + 120). -338y Expand (0 + 0 - 2s)(0 - 1 + 2 + 0 - 6 + 4 + (1 - 4 + 2)(0 + 3 - 1) + 4 - 3 + 0 - 2 + 1 + 3 - 1 - 1 + 0 + 0 + 5 - 2 + (0 - 11 + 3)(-5 - 3 + 4))(2 + 0 - 1). -66s Expand 1 + o - 1 + (4 - 4 - 3o)(0 - 4 + 3) + (3o - 4o + 3o)(0 - 4 + 6). 8o Expand -1 + 1 + 2f3 + f3 + 3f3 - 5f*3 + (3 - 4 - 1)(-3f3 - 2f*3 + 3f*3) + 2f - 3f3 - 10f + 6f. 2f*3 - 2f Expand (3c4 + c - c)(0 + 2 + 2)(-10c + 19 - 19). -120c5 Expand (-2 - 2p + 2 - 3p + 3p + p + (4p - p - p)(1 - 1 + 2) + 0 - 2p + 0)(418p4 - 39556 + 39556). 418p*5 Expand (-3 - 1 + 6)(-3t + 2t + 3t)(-4731 + 4727 - t*3 + 3t*2 - 18t*2). -4t*4 - 60t*3 - 16t Expand (4p - 2p - p)(-26p*3 - 13p*3 + 25p*3)(p + 2p - 5p). 28p5 Expand (-89 + 80 - 48)(-5 - 2h3 + 5)(-9 + 4 - 25). -3420h3 Expand (7b + 0b - 2b)(77b*2 - 26b*2 - 32b*2). 95b*3 Expand (4v*2 - 4v2 - v2)(2v*2 - 4v*2 + 3v*2) + ((3 - 4 + 5)(-3v + 7v - 2v) + 5v - 8v + v + v + 3v - 3v)(-4v3 + 7v3 - v3). 13v4 Expand (0 - 2o*2 + 0)(o*3 - 34o + 24o + 19o - 2o2). -2o*5 + 4o*4 - 18o*3 Expand (0x2 + x5 + 0x2)(0 + 3 - 2) + 287x5 + 10x*5 + 121x*5. 419x*5 Expand (n + 2n - n)(-2 + 1 - 1)(26n + 16n - 63n). 84n*2 Expand (0 - 1 - 3)(-j*3 + 0j + 0j) - 2283j*2 + 12j*3 + 2283j*2. 16j*3 Expand (s + 3s - 3s)(603s - 785s - 213s - 1253s). -1648s2 Expand (-l + 2l + l)(2l - 5 + 5) + 3l2 + l - l - 36l*2 + 62 - 62. -29l*2 Expand (2k - 3k - k)((2 + 3 - 4)(-2k + k + 0k) + 3k + 4 - 4 + k + 0k - 2k + 63 + k - 63). -4k2 Expand (5j - 5j - 3j)(-159j + 66j - 184j + 2j + j - j + (-1 + 1 + 2)(j + 0j + 0j))(-3 + 3 - 2j). -1638j3 Expand (2 - 2 - w)(7 + 5 - 2)(-5w - 10w + 3w). 120w2 Expand (2 - 2 + 2)(-2 + 0 - 2)(20 - 11 + 2j - 8). -16j - 8 Expand (83 + 25 + 77 - 57)(2c3 - 3c*3 + 5c*3). 512c*3 Expand (-4r - 2r + 3r - 2r - 1 + 1 + (2 - 2 - r)(2 + 3 - 4) + 0 + 2r + 0 - 6r + 3r + r - 5r - 20 + 20)(-3r + 5r - r). -11r*2 Expand (-42k*2 + 49k*2 - 25k*2)(-18 + 1 + 14 + 2k2 + 3k). -36k	{ "pile_set_name": "DM Mathematics" }
(-1037/330) Simplify (((h*(-10)/hhh)/h)/h(-1/4)(h((((h(-5/6)h)/hh)/hhh)/h)/h)/(hh/(hhh2)))(1/8) assuming h is positive. h(-91/96) Simplify (x2x(-4)(x/(x/(x/(x*(-1/2)x)))x)(-27))(1/57) assuming x is positive. x(-85/114) Simplify (s7sssss)(-1/8)/((s/(s(2/13)s))/sss(-12/7)s) assuming s is positive. s(-115/182) Simplify (j(2/3)/(j/j(7/4)))/(j/(j7/jj)jj)(5/2) assuming j is positive. j(137/12) Simplify (n(1/9)n)*(7/5)(n*9nn)/(nn8) assuming n is positive. n(32/9) Simplify (y(1/3))(2/5)/(y*(-3/2)(yy/(yy(-21)))/y) assuming y is positive. y(-581/30) Simplify (c/(c*(-3)/c)c)*(-6)/((cc(cc/(c/(cc/((c((c*3/c)/c)/c)/ccc)cc)))/c)/c(4/11)) assuming c is positive. c(-436/11) Simplify ((f(-1/3))26(f*(-7)f)/f(f/(f/(f/f(3/4))))/f)(-2/29) assuming f is positive. f(197/174) Simplify (t(-5/2))14(t/(t/t(-2/5)))(3/14) assuming t is positive. t*(-1228/35) Simplify (nn(1/5))(-3/10)n20nn/n(-8) assuming n is positive. n(741/25) Simplify ((h6/h)/h)/((hh*6)/hh)h(2/5)hh/h7 assuming h is positive. h(-38/5) Simplify (z(-6/11)z/(z/z24))/(z24/(z/z10)) assuming z is positive. z(-105/11) Simplify m(-11/2)/m(-32)(((m/(m(-3/4)mm))/mm)/m)(-17) assuming m is positive. m(191/4) Simplify (((v2/v)/v)/(v5/v)vv/v*7(vvv*(3/7))/vv)(18/5) assuming v is positive. v(-828/35) Simplify (a*(-13)aa(-8)(a*3a)13)17 assuming a is positive. a*544 Simplify ((yy/y*(2/17)y*(4/9)/y)/((y/((yy*(-9))/y))/(yyyy(-11))))45 assuming y is positive. y(-12755/17) Simplify (m(-3/16)m)/(mm*(-4/15))(m/m*21m)/m28 assuming m is positive. m(-11261/240) Simplify (uu(-2/5)uu(2/11))/(u/(u3u)u5) assuming u is positive. u(-12/55) Simplify ((f(2/11)f/(((((ff3f)/f)/ff)/ff)/f))(-2/17))(-25) assuming f is positive. f(-1000/187) Simplify (((d(-2/11))9)(25/3))(-1/7) assuming d is positive. d(150/77) Simplify (g*3g)*(-8/7)/(((gg*(3/14))/gg)/g(g/g(-8))/ggg) assuming g is positive. g(-207/14) Simplify (f(-4))(-1/7)(ff(-3)/f)26 assuming f is positive. f(-542/7) Simplify ((mmm(3/4))/(m/(m(-20)m)))/(mm/(mm(-2/53)))(2/57) assuming m is positive. m(-208889/12084) Simplify ((y10/y)/(y/y(-5/7)))/(y/(y/(y/y(-13)))yyy11y) assuming y is positive. y*(-145/7) Simplify u/(((uu*13/u)/u)/u)uu((u((u/u(-3))/u)/u)/u)/u(uu/u(2/11))(-45) assuming u is positive. u(-977/11) Simplify (s(1/5))30s(-21)/s(3/2) assuming s is positive. s(-33/2) Simplify v17/(v*(-1/2)v)v25v8 assuming v is positive. v(99/2) Simplify d/(((d*1dd)/dd)/d)d(2/13)(d/d*17)/dd/(d/((d/(d/d*10)d)/d)) assuming d is positive. d(-102/13) Simplify ((o/o(-1)o)(-13)(o(-1/3))(-2/77))(-22) assuming o is positive. o(18014/21) Simplify (d*(-1/6)d/(dd(-23)ddd))/((d*(-8)d)/d(-10)) assuming d is positive. d(101/6) Simplify (c4/c22)32 assuming c is positive. c(-576) Simplify (y/(y/((y(yy*(-1/2))/yy)/y))y)(-1/15)y*(-10)y/(y/(y*(-1/21)y)) assuming y is positive. y*(-1921/210) Simplify j/(j/(jjj(2/13)j))j/(j(-1/15)/j)((j/j(-8))/j)2 assuming j is positive. j(4138/195) Simplify (n11/n(-4/13))/(n0/(n/n4)) assuming n is positive. n(108/13) Simplify (((kk/k(2/9))/(kk/((k*8k)/k)k))/((k(-2/3)k)/kkkk)(-32/3))(-19/3) assuming k is positive. k(-1805/9) Simplify (((i(-1/3))(3/13))40)18 assuming i is positive. i(-720/13) Simplify (y(-3)/(y/((y(-5/4)yy)/y)))/((y(-7)/y)/(y/((y/(y(1/2)y))/y))) assuming y is positive. y(25/4) Simplify (l(-2/11)/l3)/((l(-5/7)/lll)/((ll/(l23/l))/ll)) assuming l is positive. l(-1807/77) Simplify (i(-20)/i(-1/13))/((i(-3)/ii)/ii(5/7)) assuming i is positive. i(-1514/91) Simplify ((((nn17nn)/nn)/n)(-5))(-14) assuming n is positive. n*1330 Simplify (ww2)/(w/((w/(w8/w))/w))(w/(w/(ww/(w/((w((w/(w/((w4/w)/ww)w)w)/ww)/w)/ww))w)))(2/9) assuming w is positive. w(-35/9) Simplify (k/(kk/(k*4/k))kk(-1/2))/(k(1/6)/kk4/k) assuming k is positive. k(1/3) Simplify ((ss7)/(s(-13)s))(-5) assuming s is positive. s(-100) Simplify (((x(-6)/x)/x(-3/5))/(x(-2/7))42)(-26) assuming x is positive. x(-728/5) Simplify (oo(-2/7)o)/(o/(o*(-23)/o)o)(oo*(-8)o)14 assuming o is positive. o(-758/7) Simplify (cc(-1)/c)(-5/4)c/(c/(c/(c/c*(1/4))c)c)c(6/13) assuming c is positive. c(51/26) Simplify (vvv(-13))(-2/5)/(v/(v/(vv(-29)))vv(4/19)/vv) assuming v is positive. v(2963/95) Simplify l(-7)ll*12(l*1ll)(-2/35) assuming l is positive. l(204/35) Simplify ((c/c(-11))/c(1/7))/((c(cc/((c/c(-7))/c))/c)/(c10c)) assuming c is positive. c(195/7) Simplify (b(-1))*(-3/2)/(b/(b(b/b*(-1))/b)bb(-9/5)) assuming b is positive. b(33/10) Simplify ((u(2/19)/u(-4/5))20)11 assuming u is positive. u(3784/19) Simplify (k/((k/(k(-5/4)/k))/k))/((k(k/k*(-3/5))/k)/k)(kk(-14/5))/k(-3/11) assuming k is positive. k(-743/220) Simplify (t0)(4/3)t*(1/8)t6 assuming t is positive. t(49/8) Simplify ((h*(-1)h(1/5))(13/3))(6/19) assuming h is positive. h(-104/95) Simplify (u(-2/3))28/(u/u(-8/3))(-28) assuming u is positive. u84 Simplify (o24(o/(oo(-17/5)))/o)(-4/9) assuming o is positive. o(-176/15) Simplify j(1/4)jjjj*(-1/6)j(jj/j*(-4/3))/(jj*27j) assuming j is positive. j(-259/12) Simplify (o/(o/((o(-1)/o)/o)))/o*(-11)o*(-12)o(-2/9) assuming o is positive. o(-38/9) Simplify (f/(ff(4/5)f))/ff/((f6/f)/f)f/(f/(f*(2/39)f))f/((f/f(-12))/f) assuming f is positive. f(-3071/195) Simplify m9/m(4/9)(m*1mm)(-2/155) assuming m is positive. m(11881/1395) Simplify ((u(1/3)uuu(-3/2))29)(1/22) assuming u is positive. u(145/132) Simplify (j(4/5)/((j/j(1/28))/j))/(j*0j/j(2/5)) assuming j is positive. j(33/140) Simplify r*15r((rrr16)/rr)/r((r/(rr(3/14)))/r)/r(2/33) assuming r is positive. r(14657/462) Simplify (f9/(ff/(f(1/16)f)))/(ff/(f(-1/6)f)ff5) assuming f is positive. f(43/48) Simplify (v*(-1)v)*(-4/9)/(((v(vv21)/vv)/vv)/(vvv(-15/4))) assuming v is positive. v(-99/4) Simplify (k(-2/3)/k(-1/7)k*(4/7)k(-1/8)/k)41 assuming k is positive. k(-7421/168) Simplify (((y/(y/y(-1/4)))/y)/y(-13))/(((y/y(-11/3))/y)/(y/((y/y*(1/5))/yy))) assuming y is positive. y(497/60) Simplify (k/(k/((k(-21)/k)/k)k))(1/49)(k*33/k)/(kk(-9)) assuming k is positive. k(1936/49) Simplify (c*6cc7)/(c/c(-1)cc(-3/14)/c) assuming c is positive. c(171/14) Simplify (qq*4q*(-3/5)qqq*(-6)q/q(3/7))(-14/9) assuming q is positive. q(-68/45) Simplify (a25a(1/8))(1/8) assuming a is positive. a(201/64) Simplify (x(-1/14)(x/(xx/x7))/x)/(x(-2/13)x(3/2)) assuming x is positive. x(326/91) Simplify ((s(2/13)/s(7/4))/(s(-1/4))(9/8))(-44) assuming s is positive. s(6017/104) Simplify (w/(ww28)w(-15/8))(-8/3) assuming w is positive. w(239/3) Simplify (a(-2/3))29/(a(-7/5))(-33) assuming a is positive. a(-983/15) Simplify ((gg/(gg*16/g)g)/g)/(g*(9/2)/g)(g/g(-20/7))8 assuming g is positive. g(187/14) Simplify x(2/25)/x*5(x(x(-5)/x)/xx)/x(-3) assuming x is positive. x(-173/25) Simplify d*23d*(-12)/d(d*(2/37)/d)/dd(2/35) assuming d is positive. d(10504/1295) Simplify ((p/((ppp6)/p))/p)11/(pp/((p/p0p)/p)(p(-1/2)p)/p) assuming p is positive. p*(-155/2) Simplify (ff/f*(-13)f(ff/(f/f(1/26)))/f)/(f(-4/5)ff(-2/73)) assuming f is positive. f(150567/9490) Simplify (yy(8/7))(-2/5)(y/y*21y)/((y*(-11/2)yy)/y) assuming y is positive. y(-215/14) Simplify fff(-1/4)f*(2/31)(f12)(-4/9) assuming f is positive. f(-1309/372) Simplify (v(9/2)/(v/(v/v*(-4/13)v)))/(v7)(-14) assuming v is positive. v(2699/26) Simplify (a(1/13)(aa*14a)/a)/(aaa*(-2)aaa/(a**(-1/20)/a)) assuming a is positi	{ "pile_set_name": "DM Mathematics" }
t is the closest to -1/3 in -20/3, 2/7, 680? 2/7 Which is the nearest to -2? (a) -0.126 (b) 1 (c) -40 (d) -4 a Which is the nearest to 5? (a) 2 (b) 3/13 (c) 0.987 (d) 0.4 a What is the closest to -1.113 in 1/2, -0.2, -2/9, 3? -2/9 What is the closest to -964 in -5, 1/4, 0.054? -5 What is the nearest to 0.1 in -5, 906, 6, -8, 0.2, 3? 0.2 What is the nearest to 6 in -2/33, 2, -0.4, -265, -49/4? 2 What is the nearest to -0.4 in -0.4, -3, 8, 777, -0.1? -0.4 Which is the closest to 1? (a) 2/8195 (b) -3/5 (c) -5 (d) -1 a Which is the closest to 48.6991? (a) -2/7 (b) -1 (c) -2/3 (d) -0.3 (e) 1 e Which is the closest to -0.01? (a) 39 (b) 498 (c) 2 c Which is the closest to 1/6? (a) -1/3 (b) 12 (c) -3 (d) -1/4 (e) -302 d What is the closest to -5/7 in -2/3, -8, -189, -17, 0? -2/3 What is the closest to 18 in 0.03, 4/5, 2.5, 1/8, 2, 1/11? 2.5 Which is the nearest to 821? (a) 351 (b) 8 (c) -2 a Which is the closest to -2/417? (a) 24 (b) 1 (c) 2 (d) 5.2 b Which is the closest to 2/17? (a) 1 (b) 915726/11 (c) 4 a Which is the nearest to -4/3? (a) -966 (b) 6.5 (c) -0.2 c What is the closest to 303 in 0, -0.2, 60, 0.1, -1? 60 What is the nearest to 0.1 in 1/2, -3/5, -13, -2/3, 0.76? 1/2 What is the nearest to 6 in -389, 0.1, 13, 10/13? 10/13 Which is the closest to -14410? (a) 2/39 (b) -1/13 (c) 1/2 b Which is the closest to 2? (a) -67 (b) 0.8 (c) -240 b Which is the nearest to 2? (a) -9/2 (b) 20 (c) 0.11 (d) -6 (e) 2/13 (f) 4/5 f Which is the nearest to 0? (a) -1/4 (b) 2/3 (c) -0.11 (d) 483 (e) 39 c Which is the nearest to 0.2? (a) 37 (b) 2 (c) -112 (d) 5 (e) 39 b Which is the nearest to 2? (a) 294469 (b) -319 (c) 1/4 c Which is the closest to -248? (a) 1 (b) 2 (c) 3.288 a What is the closest to 4209 in -0.4, 1/4, 1/2, 0, 5, 146? 146 Which is the nearest to 29? (a) 624 (b) 1/4 (c) 24 c What is the closest to -0.4 in -1, 1/4, -258, 2, -0.46? -0.46 What is the closest to 0.1 in 1, 238, -0.4, -1496? -0.4 What is the nearest to 11 in -1333.2, 0.4, 134? 0.4 What is the nearest to -137.145 in 0.2, -0.5, -0.08? -0.5 What is the nearest to 3 in 1, 1/7, -1.45654, -2/3? 1 Which is the closest to 1/2? (a) -6 (b) -3 (c) -1652 (d) -55 (e) -1 e What is the nearest to 0 in -1, 3, -218, 66? -1 Which is the closest to -2? (a) 0.4 (b) -33 (c) 0.1 (d) 3 (e) -5 (f) -655 c Which is the nearest to 0.0540423? (a) 2/5 (b) -2/3 (c) -1/3 a What is the closest to 1/4 in 1/29, 1/5, 2/13, 265, -1376, -5/2? 1/5 What is the nearest to 157 in -5, 0.02, -1, -2/13, -3, -1/223? 0.02 Which is the closest to -1? (a) -0.69 (b) -0.0354484 (c) 2 (d) 0.5 a What is the nearest to -551 in -5, -15, -0.3, -2/15, 11? -15 What is the nearest to 0 in 17, 1/23898, 0, -2? 0 Which is the nearest to 1? (a) -28 (b) -7/11184 (c) -1 b Which is the nearest to -2/5? (a) 1 (b) 18 (c) 0.5 (d) 31 (e) 493 c What is the closest to -855 in -0.5, 5, 38? -0.5 What is the closest to -2/7 in -2, 222, -1/2, -2/15, -11.6? -2/15 Which is the closest to 0.06? (a) -743 (b) 307 (c) 0.1 (d) -2 c Which is the closest to -0.05? (a) -1 (b) -10580 (c) -6 (d) 2/7 (e) 4 (f) 3 d What is the closest to 0.1 in 1, -0.05175, -4, 0.126, 1/5? 0.126 Which is the nearest to 5786478? (a) 4 (b) 5 (c) -2/5 b Which is the nearest to -1/90? (a) 1/3584 (b) 2/11 (c) -2 a What is the nearest to -1 in -8, -0.3, -1/2, -3/5, 507? -3/5 What is the closest to -9 in -3, -0.5, 4/119, 0.5? -3 What is the closest to 230 in -2, 12/53, 0.07? 12/53 What is the closest to 3 in 1/2, 104/5, -1/350, 0.1? 1/2 What is the closest to -3 in -5, -0.06, 78, 531? -5 Which is the closest to -2/3? (a) 5517 (b) -0.0863 (c) 2/9 (d) 0.2 b Which is the nearest to 4? (a) -3672 (b) 0.1 (c) -38 b Which is the nearest to -82/23? (a) -3/7 (b) -1/7 (c) -5/9 (d) -1/29 c What is the closest to 0.1 in -0.5, -743/5, 1/4, 11, 3? 1/4 Which is the nearest to -25? (a) -0.43 (b) 4/9 (c) 1/23 (d) 4 a What is the closest to -161803 in -0.2, 0.5, 1, -1/8, -0.8? -0.8 What is the closest to -93 in 1, -584, 2/59? 2/59 Which is the closest to 1/11? (a) 1 (b) 2 (c) -5 (d) 4 (e) 0.0246 e Which is the closest to -1? (a) 22.936 (b) 4/9 (c) -0.4 (d) 5 (e) -1/13 c What is the nearest to -2/63 in 2, 109, 1, 3? 1 What is the closest to 6164 in -3, 0.4, 38, -0.7, -1, 0.2? 38 What is the closest to -0.1 in -2437, -0.1, 1/1440? -0.1 Which is the nearest to 1/2? (a) -5351 (b) 745 (c) -12 c What is the nearest to -0.003041 in 10, 3/10, -1/6? -1/6 What is the nearest to -6 in -1/2, 2.4, -2, -2/5, -100? -2 What is the closest to 12 in 0.4, -4630, 1, 3, -0.1? 3 What is the nearest to -1 in -82/907, -3, -29? -82/907 What is the nearest to -300002 in -0.5, -2, 10, 2/3, -2/7? -2 What is the nearest to -72/541 in -1/11, -2, 0, 1/8? -1/11 Which is the closest to 21? (a) -528 (b) -9/5 (c) 5 (d) -26 c Which is the nearest to 0? (a) 2/13 (b) -4 (c) -1/2 (d) -67.5 (e) 79 a Which is the nearest to -2/9? (a) -3.82 (b) 0 (c) 44 b What is the closest to -1 in -71/3, 2/7, -0.4, 7, 3/7, -0.5? -0.5 Which is the nearest to 0.1? (a) -1/6 (b) -2/17 (c) -12081 (d) 16/13 (e) 0.1 (f) 3/8 e What is the nearest to -3 in 923, -3/2, 10/3, 0.2? -3/2 Which is the closest to -2? (a) 522 (b) -2/3 (c) -11 (d) 18 (e) 4/3 b Which is the nearest to 0.35? (a) -4 (b) -0.02236 (c) -2 (d) 1/5 (e) 3 (f) 3/5 d What is the closest to 1/7 in 15, 1/6, 4, 27/5? 1/6 What is the closest to 4 in -0.2, 61, -0.5, 89970? -0.2 Which is the nearest to -32/13? (a) -2/15 (b) 0.33 (c) -8.2 a What is the closest to -1/29778 in 0.5, 0.3, 0.071? 0.071 Which is the nearest to 2? (a) -2909 (b) -3/13 (c) 5/4 c Which is the closest to 0.4? (a) -18/11 (b) 64 (c) 38/9 (d) -4 (e) -5 (f) -1 f Which is the closest to 64/13? (a) 11 (b) -5 (c) 0.4 (d) 4 d What is the closest to -0.4 in 2/5, 5, -5/6, -28, -1/4, 7? -1/4 Which is the closest to 2? (a) -1/3 (b) -15491 (c) -11 (d) -0.025 d Which is the closest to -18? (a) -1414 (b) -37 (c) -2/7 c Which is the closest to 1/8? (a) -7 (b) 453 (c) 4 (d) -2/3 d What is the closest to 1 in 1/5, 0.03, 1210.4, -3? 1/5 What is the nearest to -0.06 in 2/7, 61.4, -2702? 2/7 Which is the closest to -0.1? (a) 20.948 (b) -3 (c) -5/2 (d) 0.3 (e) 3 (f) -2 d What is the closest to -2/12803 in 5, -25, 79? 5 What is the nearest to -2/3 in 6524, 0.2, -30, -3.7? 0.2 What is the closest to 2/107 in 40, 3802, -0.7, -2? -0.7 Which is the nearest to -2/17? (a) -7.815 (b) 2/7 (c) 1 (d) -1/457 d Which is the closest to -2? (a) -5 (b) -2/5 (c) -1.1 (d) -4545 c Which is the closest to -2? (a) 117/5 (b) -3/3500 (c) 1/4 b Which is the nearest to 1/2? (a) 2/63 (b) -2 (c) 1/2 (d) 0.2 (e) -0.17 c Which is the nearest to -1/5? (a) 2831 (b) -3/11 (c) -5 b Which is the closest to -0.08? (a) -1/2 (b) -3 (c) 2044/67 a What is the nearest to -1 in 7, -2, -251/3, -11.9? -2 What is the closest to -0.1 in 2/23, 20.7, 3/76, -0.2? -0.2 What is the nearest to -1 in -2, -21, -33274, -9, 1? -2 What is the closest to 0.2 in -12, -3, 0.039, 2, 434? 0.039 What is the nearest to 0 in 50649, 5/8, -0.1? -0.1 What is the closest to -19.8 in -2/7, 1044/11, 4, -5? -5 What is the closest to -1/8 in -717, 3, -3, -37? -3 Which is the nearest to 281? (a) 2/5 (b) 0.3 (c) 3 (d) -0.2 (e) -0.01 c Which is the nearest to -3? (a) 1/7 (b) 165 (c) 1788 (d) 5 (e) -2 (f) 2/3 e Which is the nearest to -7? (a) -0.29 (b) -4 (c) 9 (d) 2/5 b What is the closest to -19.1 in 2/17, -0.008, 11, -0.2, 3? -0.2 What is the nearest to -0.026 in -0.11, 8, 2/3, -1, 2/7, -5? -0.11 What is the closest to 5 in -7, -0.3, 27/4, -17, 21? 27/4 What is the closest to -1 in 11.5, 3, -2/7, -3/5, -0.7? -0.7 What is the closest to 386 in 1/502, 0.5, 0.2, 5/2, 9? 9 Which is the nearest to -14/745? (a) 4 (b) 1/5 (c) -3/14942 c Which is the nearest to -194? (a) -2 (b) -0.5 (c) 3/5 (d) -0.111 (e) -0.2 a Which is the closest to 221? (a) -69 (b) -1 (c) -0.4 (d) -132 c Which is the nearest to 0? (a) -509 (b) 104 (c) 1/7 (d) -1 (e) 5 c What is the nearest to 137 in 0.4, 1/34, -60, 2/7? 0.4 Which is the closest to 0.01? (a) -589 (b) -0.0087 (c) 0.5 b What is the closest to 1099/3 in 4, -	{ "pile_set_name": "DM Mathematics" }
- 11. What is xn(m) + 6d(m)? 2m3 + m2 Let j be ((-56)/21 - 6/(-4))-6. Let q(z) = -13z2 + z - 6. Let k(x) = 4x*2 + 2. Give jk(y) + 2q(y). 2y*2 + 2y + 2 Let n(x) = x2 + 1. Let c(b) = b2 + 2. Suppose 0 = -6h + 5 + 7. What is hn(m) - c(m)? m*2 Let v(m) = -3m. Let l(w) = 1. Give 3l(t) + 3v(t). -9t + 3 Let b(h) = -h - 1. Let o(s) = -5s + 3. Give 6b(m) - o(m). -m - 9 Let m(h) = -4h + 3. Let c(d) = -d*3 + 13d - 10. Determine 2c(z) + 7m(z). -2z3 - 2z + 1 Let r(i) = i + 1. Let m(l) = -2l3 + l2 - l + 1. Let f be m(1). Let d(c) = -c2 + c. Give fr(b) - d(b). b*2 - 2b - 1 Let t(i) = -3 - 7i3 - 23i + 23i. Let y(g) = -g3 - 1. Determine -t(z) + 5y(z). 2z3 - 2 Let m be (-4)/(55/(-15) - -3). Let q(g) = -9g*3 + 7g*2 - 13g + 11. Let d(b) = 5b3 - 4b*2 + 7b - 6. Calculate mq(v) + 11d(v). v*3 - 2v*2 - v Let a = -19 - -21. Let s(g) = -10g*a + 18g*2 - 2 + 5g - 4. Let d(i) = -i*2 - 5 + 18 - 16i*2 - 11i. Give -6d(v) - 13s(v). -2v2 + v Let j(h) = -2h + 6. Let g(n) = n*2 + 14n + 50. Let t be g(-9). Let s(d) = 3d - 9. Determine ts(a) + 8j(a). -a + 3 Let h(i) = 2i - 1. Let k(z) = z - 2. Let l(j) = -j*2 + 1. Let a(d) = -k(d) - l(d). Let f(s) be the first derivative of a(s). Calculate -2f(t) + 3h(t). 2t - 1 Let w(q) = 2q3 + 8q*2 + 3q + 5. Let h(v) = v*2 + 1. Let m(p) = -5h(p) + w(p). Let y(a) = 5a3 + 8a*2 + 8a. Determine -8m(j) + 3y(j). -j*3 Suppose k + 1 = 5. Let d = k + -3. Let u(a) = d + a + 0 - 2. Let i(n) = 6n - 7. Give -2i(z) + 14u(z). 2z Let r(t) = 2t*2 - 2t - 1. Let v(h) = -2h2 + 2h + 1. Suppose -c = -3u - 16, -2c = 3c + u - 16. Suppose -8b + 2 = -22. Determine bv(j) + cr(j). 2j2 - 2j - 1 Suppose 1 = -5t + 4h - 44, -4t = 5h - 5. Let d(r) = -2r + 4. Let k be d(t). Let b(z) = 8z. Let w(n) = -3n. Calculate kw(p) + 5b(p). -2p Let g(o) = -2o2 - 2o. Let b(c) = -4c2 - 4c. Let h(u) = u*2 - 9u + 2. Let z be h(9). Determine zb(n) - 5g(n). 2n2 + 2n Suppose -4d = 8, -2j = j + 2d - 17. Let p(s) = 6s. Let n(b) be the third derivative of 5b4/24 - 13b*2 + 6b. Calculate jn(u) - 6p(u). -u Let i(s) = 2s + 1. Let q(k) = 1. Determine -i(n) + 5q(n). -2n + 4 Let c(p) = -22p + 2. Let u(d) = -44d + 3. Give 7c(m) - 4u(m). 22m + 2 Let c(x) = -5x + 5x*2 - 3x*3 + 0 + 0. Let w(s) = 2s - 3s2 - s3 + 3s*2 - 4s + 2s2. Give 2c(n) - 5w(n). -n3 Let l(z) = 15z2 + z + 1. Let p(v) = -v2 - v - 1. Calculate l(k) + p(k). 14k2 Let w(x) = 4. Let i(c) = -c + 17. Let m(p) = -6i(p) + 26w(p). Let y(z) = -7z - 6. Let s(j) = -5j - 4. Let g(u) = 8s(u) - 5y(u). Give -4g(v) - 3m(v). 2v + 2 Let t(i) = 40i + 3. Let x(c) = -27c - 2. Calculate 5t(g) + 7x(g). 11g + 1 Let h(r) = -r2 - 6r + 8. Let u(g) = g*3 + 25g*2 - 25g + 32. Let t be u(-26). Let m(y) = -y*2 - 5y + 7. Calculate th(c) - 7m(c). c*2 - c - 1 Let x(m) = 7m*2 + m - 1. Let r(v) = -15v*2 - 3v + 3. Let c(f) = -3r(f) - 5x(f). Let u(j) = -3j2 - j + 1. What is 2c(p) + 7u(p)? -p2 + p - 1 Let u(m) = 3m. Suppose 2r + 0r = 6. Let o(t) = 3t - rt - t. Give 5o(h) + u(h). -2h Suppose 2y - 30 = 4d - 6, -4y + 30 = -2d. Let x(q) = 3q2 - 6. Let n(o) = 6o*2 - 13. Calculate yn(p) - 13x(p). -3p*2 Let f be 1 + (-120/4)/1. Let b(k) = 6k + 6. Let z(g) = -2g - 2. Calculate fb(x) - 11z(x). -2x - 2 Let g(l) = 7l*3 + 6l*2 - 6l - 7. Let a = 55 + -61. Let q(t) = -15t3 - 13t*2 + 13t + 15. Calculate aq(d) - 13g(d). -d*3 + 1 Let k(q) = 28q. Let f(z) = -28z. What is -6f(u) - 7k(u)? -28u Let d(o) = 5o3 - 6o*2 - 6o + 6. Let j(l) = 14l3 - 17l*2 - 17l + 17. Let b be 1/(((-20)/(-85))/(-4)). Determine bd(p) + 6j(p). -p*3 Let l(n) = n + 4. Let v be l(-9). Let q = 11 + v. Suppose -3r - q = -2r. Let j(a) = 8a*2 - 2a - 7. Let h(b) = -17b2 + 4b + 15. Give rh(d) - 13j(d). -2d2 + 2d + 1 Let k(q) = -6q3. Let y(g) = g3. Determine k(i) + 2y(i). -4i3 Let m(t) = 13t*2 + 4t - 4. Let a(f) = 25f2 + 7f - 7. Give 4a(r) - 7m(r). 9r2 Let s = -4 - -5. Let y be (-1 - -2)/(-1s). Let f(j) = j - 2. Let x be (-5)/(-2) + 2/(-4). Let v(m) = -1. Give xv(d) + yf(d). -d Let u(q) = 7q + 9. Let l(t) = 5t - 9 + 14 + t - 2t. What is 5l(n) - 3u(n)? -n - 2 Suppose 0 = q - 0q - 5. Let y(s) = -9s + 7. Let v(c) = 5c - 4. Let w = -2 + 4. Suppose -13 - w = -5r. Give qv(o) + ry(o). -2o + 1 Let s(q) = 20q3 - 11q + 11. Let r(g) be the second derivative of g5/5 - g3/3 + g*2 + 23g. Calculate -11r(i) + 2s(i). -4i3 Let o(r) = -5r. Let f(j) = 16j. What is 5f(x) + 14o(x)? 10x Let s(w) = -79w + 7. Let t(a) = 119a - 11. Calculate 8s(h) + 5t(h). -37h + 1 Let f(o) = 1. Let c(t) = 3t - 3. Let k be 1/(-2 - 9/(-5)). Let i(q) = 4q - 2. Let l(a) = kc(a) + 4i(a). Determine -6f(z) + l(z). z + 1 Let h(l) = 6l3 - 11. Suppose z + 16 = 5. Let n(d) = -3d*3 + 6. What is zn(s) - 6h(s)? -3s*3 Let o(i) be the second derivative of 7i*5/20 + 11i*4/12 - 11i*3/6 + 11i*2/2 + 16i. Let k(c) = -2c3 - 3c*2 + 3c - 3. What is 22k(t) + 6o(t)? -2t3 Let h(s) = -9s*2 + 11s - 29. Let f(o) = 5o2 - 6o + 15. Calculate 7f(m) + 4h(m). -m*2 + 2m - 11 Suppose 0 = 5l - 9 - 31. Suppose -l = -s - 3z, -z + 12 = 2z. Let v(c) = -2c. Let a(y) be the first derivative of -y*2/2 - 113. Calculate sv(f) + 10a(f). -2f Suppose -4v = -72 - 36. Suppose 5w - 3c = -0w, 0 = 4w + 3c + v. Let d(i) = -25i. Let p(m) = -3m. Determine wd(q) + 24p(q). 3q Suppose 5 = 5c + 4a, c - 15 + 0 = 2a. Let r = -2 - c. Let u(q) = -4q3 - q2 - q. Let y(k) = -13k*3 - 4k*2 - 3k. What is ru(v) + 2y(v)? 2v3 - v2 + v Let k(g) = -g3 + g2 - g + 1. Let f(m) = -13m*3 + 6m*2 - m + 11. Let w(z) = -f(z) + 6k(z). Let c(t) = -10t3 + 7t + 7. What is -5c(l) - 7w(l)? l*3 Let n(r) = 3r*2 + 5r + 1. Let t(d) = -4d2 - 6d - 1. Let c(q) = q*3 - 3q*2 - q - 2. Let w be c(3). Determine wt(p) - 6n(p). 2p*2 - 1 Let v(u) = 3u*3 - 5u*2 + 6u. Let i(x) = -4x3 + 6x*2 - 7x. Suppose -2k = 5s - 78, -k = 5s - 85 + 6. Let l = s - 9. Give lv(d) + 6i(d). -3d3 + d2 Let j(o) = -7o2 - 7o. Let x(y) = -y*3 + 6y*2 + 6y. Give 6j(d) + 7x(d). -7d3 Suppose -5p - 2 = 43. Let o be p/(-3)4/(-6). Let k(d) = 10d*3 + 21d + 16. Let s(g) = -2g3 - 4g - 3. Give ok(z) - 11s(z). 2z3 + 2z + 1 Let j(p) = 5 - 4 - 3p + 2. Let m(y) be the third derivative of 2y*4/3 - 8y*3/3 - 4y*2. Give -22j(o) - 4m(o). 2o - 2 Let c(a) = a*3 + 2a*2 + 2a. Let o(r) = -7r2 - 2r*3 - 7r + 0r + 0r. What is 7c(d) + 2o(d)? 3d3 Let y(f) = -4f + 2. Let b(z) = -z*2 + z + 1. Give -2b(o) + y(o). 2o2 - 6o Let w(v) = -2v3 - 5v*2 + 3v. Let z(g) be the second derivative of -3g5/10 - 7g*4/6 + 4g*3/3 - 3g. Calculate 14w(b) - 5z(b). 2b3 + 2b Suppose -5p + p = 5l + 40, p = l - 1. Let h(o) = -2o2 - 3o - 3. Let f(z) = 3z2 + 4z + 4. What is lh(n) - 3f(n)? -n*2 Let a(b) = 0b2 + 3 - b2 + 2b2 - 2b3. Let w(d) = d3 - d + 3. Let m be w(0). Let u(t) = -3t3 + t2 + 5. Give mu(k) - 5a(k). k3 - 2k*2 Suppose 3t + 1 - 28 = 0. Let h = -3 - 1. Let j(k) = k + 4. Let g(s) = 3s + 9. Give hg(b) + tj(b). -3b Let r(t) = -7t + 18. Let q(w) = -w + 1. Give -6q(l) + r(l). -l + 12 Let z(v) = 27v2 - 4. Let a(s) = s2 + 1. What is -4a(n) - z(n)? -31n2 Let t(w) = 5w*3 + 9w*2 - w - 7. Let r(n) = -4n*3 - 8n*2 + n + 6. Let x be (-4)/18 + (-130)/(-18). Give xr(o) + 6t(o). 2o*3 - 2o*2 + o Let u(p) = -5p + 4. Let l(c) = c - 4. Let v(z) = -z + 5. Let q(h) = 5l(h) + 4v(h). What is 3q(s) + u(s)? -2s + 4 Let h(u) = -10u3 - u2 + u. Let d(y) = y2 - y. Calculate d(s) + h(s). -10s3 Let q(g) = -g2 + g + 1. Let j(d) = d*2 - 3 - 6d - 3d + 7d. What is -j(w) - 3q(w)? 2w*2 - w Let i(q) = q + 3. Let h(s) = 2s + 8. Let u = 75 - 80. Determine uh(r) + 12i(r). 2r - 4 Let r(a) = 3a - 6. Let o(h) = -5h + 11. Calculate 4o(v) + 7r(v). v + 2 Let b(p) = 1 - 7 + 0 + 7. Let k(d) = 2d + 7. What is -4b(c) + k(c)? 2c + 3 Let r(q) = -q - 19. Let g(z) = -19. Determine 4g(m) - 3r(m). 3*m - 19 Let v(t) = -	{ "pile_set_name": "DM Mathematics" }
*2 - 138. 2(i - 23)(i - 3)(i - 1) Suppose -y - 2c + 4 = 0, -y = -2c - 2c + 8. Suppose y = x - 61 + 59. Let -2/5n*5 - 2/5n*x + 0n + 0 - 6/5n3 - 6/5n4 = 0. What is n? -1, 0 Let r(u) be the second derivative of u8/168 - u6/20 + u5/15 - 7u2 + 28u. Let o(y) be the first derivative of r(y). Let o(l) = 0. What is l? -2, 0, 1 Let b(n) = -109n + 547. Let i be b(5). Let f(d) be the second derivative of 7d - 1/12d4 - 2/3d*3 + 0 - 3/2d*i. Factor f(w). -(w + 1)(w + 3) Suppose -5h - 17 + 2 = 5u, 8h + 32 = -4u. Determine j so that 16/11j + 6/11j*u + 8/11 - 2/11j*4 - 4/11j3 = 0. -2, -1, 2 Let r(u) be the third derivative of u7/7560 - u6/360 + u5/40 + u*4/6 - 10u2. Let k(h) be the second derivative of r(h). Find o such that k(o) = 0. 3 Let v(j) = -j5 + 11j4 + 8j*3 - 4j2. Let a(u) = -165 + 165 - u5. Let b(l) = 12a(l) - 3v(l). Factor b(p). -3p2(p + 2)*2(3p - 1) Factor 2i*2 + 2i - 24 + 6i + 6i + 0i2 - 12i. 2(i - 3)(i + 4) Suppose w*2 - 7/6w*3 + 0w*4 + 0w + 0 + 1/6w5 = 0. Calculate w. -3, 0, 1, 2 Let m be -1 + -2 + (-1323)/(-343). Factor 24/7c*2 + 2/7c*4 - 12/7c*3 - 20/7c + m. 2(c - 3)(c - 1)*3/7 Factor -8/7 - 2/7m*2 + 8/7m. -2(m - 2)2/7 Let g(c) be the third derivative of 169c*7/1260 - 65c*6/144 + 8c5/15 - c4/4 - 498c2. Determine a so that g(a) = 0. 0, 6/13, 1 Factor -41/2c - 1/8c2 - 1681/2. -(c + 82)2/8 What is d in 0 + 60/7d*3 + 24/7d*4 - 9/7d*5 + 0d - 48/7d2 = 0? -2, 0, 2/3, 4 Let y(f) = 2f*2 + 10. Let x(a) = 1. Let k(j) = 2. Let n(o) = -k(o) + x(o). Let d(s) = -10n(s) - y(s). Factor d(p). -2p2 Let g be (30/20)/((-3)/(-4)). Let h be (g/(-14))/((480/(-70))/12). Factor 2x + hx2 + 4. (x + 4)2/4 Let w = -4 + 6. Solve -30 - 2y*w + 28 + 4y*2 = 0. -1, 1 Let z = -550/9 - 6644/63. Let w = 167 + z. Solve -4/7u*4 - wu + 4/7u2 + 1/7u*5 + 2/7u*3 + 0 = 0 for u. -1, 0, 1, 3 Let s be 44 - 39 - (-73)/(-13). Let t = 123/52 + s. Factor 0 - tp*2 + 1/2p. -p(7p - 2)/4 Let f(y) be the second derivative of y*4/30 - 136y*3/5 + 41616y*2/5 - 292y. Factor f(n). 2(n - 204)2/5 Factor 23n*3 - 2n*4 + 1755 + 2n*4 + 1620n - 7n3 + 450n*2 - 5n*4 + 4n*3. -5(n - 13)(n + 3)3 Determine m, given that 64/19 + 18/19m*3 - 72/19m - 2/19m4 - 8/19m*2 = 0. -2, 1, 2, 8 Let j(b) be the third derivative of 4/3b*3 - 1/15b*5 + 0b + 0 + 10b2 + 1/90b*6 + 1/6b4. Let q(r) be the first derivative of j(r). Solve q(d) = 0. 1 Let c(q) be the third derivative of -q4 - 1/15q5 + 8/3q*3 + 0 + 11/60q*6 + 0q - 2/35q7 - 3q*2 + 1/168q*8. Factor c(l). 2(l - 2)*3(l - 1)(l + 1) Factor 227t*3 + 362t*2 - 92t*2 + 24300t - 226t3 + 729000. (t + 90)3 Suppose -s + 13 = -4u, u = 4s - 0s - 22. Let i(z) = 7z4 - 2z3 + z2 + 5. Let y(t) = t4 + t2 + 1. Let c(a) = ui(a) + 10y(a). Factor c(q). -4q2(q - 2)(q + 1) Let m(j) = 2155j + 10775. Let z be m(-5). Factor -2/3s4 + 0 + zs + 0s3 + 0s*2. -2s*4/3 Suppose 4c + 4d + 112 = 0, -5c - 186 + 6 = -5d. Let b be c/(-63) - (-48)/(-168). Factor -2h*4 + bh + 10/9h2 + 0 + 2/3h*3. -2h(h - 1)(3h + 1)2/9 Let z(k) be the second derivative of -k6/60 - k5/10 - k4/6 - 9k*2 - 11k. Let u(h) be the first derivative of z(h). Factor u(c). -2c(c + 1)(c + 2) Let n(a) be the first derivative of -2a*6 + 88a*5/5 - 58a*4 + 272a*3/3 - 70a*2 + 24a - 77. Determine w, given that n(w) = 0. 1/3, 1, 2, 3 Let v(c) be the second derivative of c8/3360 + c7/840 - c6/720 - c5/120 - 11c3/6 + 6c. Let y(x) be the second derivative of v(x). Factor y(j). j(j - 1)(j + 1)(j + 2)/2 Let h = -37904 - -37907. Factor -2/13y*h + 8/13y*2 + 22/13y + 12/13. -2(y - 6)(y + 1)*2/13 Let f be (-111)/2594/(-6). Let k(x) be the first derivative of 6/7x5 - fx*2 + 3/7x*6 + 1 - 2/3x*3 + 0x + 1/14x4. Find j, given that k(j) = 0. -1, -1/3, 0, 2/3 Let a(t) be the second derivative of t5/80 - t4/6 + 13t*3/24 - 3t*2/4 + t + 15. Factor a(b). (b - 6)(b - 1)*2/4 Suppose -1/5x*3 + 16/5 - 6/5x - 9/5x2 = 0. What is x? -8, -2, 1 Let z(h) be the first derivative of -h5/15 + 2h*4/3 - 8h*3/3 - 10h2 - h + 16. Let c(l) be the second derivative of z(l). Solve c(s) = 0 for s. 2 Let n(w) be the second derivative of w4/6 - 11w3/6 + 7w*2/2 - 11w. Let b be n(5). Factor 3/2c4 - 3/2c*b + 0 + 3/4c*5 + 0c*3 - 3/4c. 3c(c - 1)(c + 1)3/4 Let 5/4c*5 + 5/2c*2 + 20c*3 - 85/4c - 25/2c4 + 10 = 0. What is c? -1, 1, 8 Factor 216p3 - 9 + 6 + p4 + 3 - 17p2 - 217p*3 - 15p. p(p - 5)(p + 1)(p + 3) Let v(x) be the second derivative of x6/15 + 3x5/50 - x4/15 + 111x. Find q, given that v(q) = 0. -1, 0, 2/5 Let o(l) be the second derivative of -1/60l*4 + 0 - 1/15l*3 + 4/5l*2 - 43l. Factor o(r). -(r - 2)(r + 4)/5 Suppose 2j - 5j - 19 = 5p, -j + 4p + 22 = 0. Factor 3 - 5o*2 + 2o*j + 2o + 2o2. -(o - 3)(o + 1) Let j(x) = x + 21. Let p be j(-18). Suppose 0 = pr - 8r + 15. Factor 1/4tr - 1/2t*2 + 1/2 - 1/4t. (t - 2)(t - 1)(t + 1)/4 Let a(k) be the third derivative of -k7/1470 + k6/168 - k5/420 - k4/8 + 3k3/7 + 22k2. Factor a(d). -(d - 3)2(d - 1)(d + 2)/7 Let r(z) be the second derivative of z6/660 - z5/66 + z*4/33 + 5z*2/2 + 5z. Let j(x) be the first derivative of r(x). Let j(l) = 0. Calculate l. 0, 1, 4 Factor -162u + 74u*2 - 4u*5 - 67u*3 + 41u*4 - 87u*3 + 190u*2 + 27 - 12u2. -(u - 3)3(u - 1)(4u - 1) Let p(a) be the third derivative of -a6/30 + 2a*5/3 - 13a*4/6 - 16a*3 - 12a*2 + 19a. Determine s, given that p(s) = 0. -1, 3, 8 Let l = 56 - -79. What is w in -2w4 - 4w*4 + 2w*4 - 139w*3 + lw*3 = 0? -1, 0 Let l(h) = -3h*2 - 302h - 22800. Let a(j) = -2j2 + 1. Let z(f) = 5a(f) - 5l(f). Factor z(d). 5(d + 151)2 Let x(v) be the second derivative of v6/240 + 3v5/160 - v4/32 - 11v*3/48 - 3v*2/8 - 15v - 1. Factor x(b). (b - 2)(b + 1)2(b + 3)/8 What is k in 0k + 6 - 3/2k2 = 0? -2, 2 Let m(c) be the third derivative of -c9/90720 + c*8/15120 + 17c*5/60 - 26c*2. Let o(g) be the third derivative of m(g). Factor o(k). -2k*2(k - 2)/3 Let l(m) be the first derivative of -2m5/5 - 9m*4/2 - 16m*3 - 16m2 + 226. Solve l(n) = 0. -4, -1, 0 Let v(r) = -r2 - 76r + 409. Let a be v(5). Let d(i) be the second derivative of 6i - 7/10i5 - i2 + 0 - 5/3i*3 - 3/2i*a - 2/15i*6. Factor d(c). -2(c + 1)*3(2c + 1) Let t(o) be the second derivative of o4/72 - o3/9 - 7o*2/4 - o - 7. Factor t(q). (q - 7)(q + 3)/6 Let v(m) be the first derivative of m*6/2 + 84m*5/5 + 735m*4/4 + 698m*3 + 1152m*2 + 864m + 170. Determine g so that v(g) = 0. -12, -2, -1 Let u(c) be the third derivative of 1/72c6 + 1/45c*5 + 0c - 1/18c4 - 1/210c*7 - 8c*2 + 0c*3 + 0. Factor u(m). -m(m - 2)(m + 1)(3m - 2)/3 Let l(r) = 9r + 3. Let v be l(1). Let f(m) = 4m2 + 6m + 8. Let y(p) = -p*2 - p. Let o(i) = vy(i) + 2f(i). Factor o(d). -4(d - 2)(d + 2) Let n(z) = -z - 3. Let y be n(-6). Let h be ((-9)/6 + 3)2. Let ha2 + ya*2 - 3a*2 - 2 - 1 = 0. Calculate a. -1, 1 Let p = 29 + -27. Factor 30m + 34m + 0m*2 - 44m + 4mp. 4m(m + 5) Let q(l) be the first derivative of -7l*4/10 + 16l*3/3 + 12l*2/5 - 110. What is d in q(d) = 0? -2/7, 0, 6 Let j = -19 + 16. Let q be (-1 - -1 - 1)-7. Let r(i) = -3i3 + i2 + 9. Let v(k) = -k3 + 4. Let l(g) = jr(g) + qv(g). Let l(a) = 0. Calculate a. -1/2, 1 Suppose l = 2s - 6, -2l - 13 = -5s + 3. Suppose so + o + 5j = -10, 22 = 4o - 2j. Solve -4m4 + 54m*2 - 21m*o + 15 - 60m + 9 + 7m4 = 0 for m. 1, 2 Let k be (-2)/(-4)-7(-30)/3. Factor kf*3 + 934f - 17f2 - 5f*4 - 358f*2 - 309f + 40f3. -5f(f - 5)3 Let r(k) = k5 + k3 - k2 - k + 1. Let w(m) = -15m*5 + 65m*4 - 70m*3 + 30m*2 - 10m + 5. Let a(t) = 5r(t) - w(t). Factor a(f). 5f(f - 1)3(4f - 1) Let i = 14776 - 14772. Factor 0 - 2p*3 + 4/9p*2 + 14/9p*i + 0p. 2p2(p - 1)(7p - 2)/9 Let w(r) be the first derivative of -r7/126 + r6/45 + 5*r + 1. Let h(u) be the first d	{ "pile_set_name": "DM Mathematics" }
791 = -4m - 4g, -4m - 5g + 30785 = 0. What is m rounded to the nearest 1000? 8000 Let v(d) = -d*3 + 5d*2 + 15d - 2. Let a be v(7). Let g = -1 + 3. Suppose -f + 69996 = -u, -2u - 140012 = -gf + af. Round u to the nearest 10000. -70000 Let v(h) = -h2 + 14h + 4. Let r be v(10). What is r rounded to the nearest 10? 40 Let m = -1.30000306 + 1.3. Round m to 6 decimal places. -0.000003 Suppose 8s - 9s = 27000. Round s to the nearest 10000. -30000 Let p(a) = -a - 530000. Let t be (1(0 + 0))/1. Let h be p(t). What is h rounded to the nearest one hundred thousand? -500000 Let t(y) = -y3 - 17y*2 - 21y - 1. Let b be t(-16). What is b rounded to the nearest ten? 80 Let w = -38.00000012 + 38. What is w rounded to 7 dps? -0.0000001 Suppose -52618 = 9l + 466682. Round l to the nearest 10000. -60000 Let n = 1.09 - 1.089969. Round n to six dps. 0.000031 Let a = -0.044 + 0.04399929. What is a rounded to 7 decimal places? -0.0000007 Let q = 27.76 + -28. Let j = -0.2376 - q. What is j rounded to three dps? 0.002 Let l = -24.00000035 - -24. Round l to seven dps. -0.0000004 Suppose -3i + 6i - 4988 = -2b, 5b - 2i = 12508. Let j be (-2 + 38)/(1/b). What is j rounded to the nearest one hundred thousand? 100000 Suppose 4p - j - 33237 = 2p, j = 4p - 66477. Let i be (1000/(-6))/(1/p). Round i to the nearest one hundred thousand. -2800000 Let f be (-6)/(-10) + 2/5. Suppose -j + 4 = f. Suppose x + 203 = 3b - x, -270 = -4b + jx. Round b to the nearest 10. 70 Let i = -4 + -10. Let j = i + -4. Let s = j + 13.2. Round s to the nearest integer. -5 Let i = -0.34 - -0.2. Let s = 33795.699 - 33795.83899991. Let x = i - s. Round x to seven dps. -0.0000001 Let x = -0.0359855 + 0.036. Round x to 6 decimal places. 0.000015 Let k = 17.6999934 - 17.7. Round k to six decimal places. -0.000007 Let r = 580 + -603.844. Let l = r + 1.324. Let i = l + 22. What is i rounded to one decimal place? -0.5 Let b be 2/1(2 + -1). Suppose 4z - bn = -n - 120001, z + 2n = -29998. Round z to the nearest 100000. 0 Let u be (30 - (1 - 2))261. Suppose 2c - 14998 = 3j, -4j - 2c - u - 11911 = 0. What is j rounded to the nearest one thousand? -5000 Let n(l) = -l + 10. Let r be n(8). Let h = 0 + r. Suppose hg - 3900000 = g. Round g to the nearest 1000000. 4000000 Let w = -1 + 1. Let v = 3.6 + w. What is v rounded to the nearest integer? 4 Suppose d - 45997 = -2p, 7p + 5d - 68985 = 4p. What is p rounded to the nearest 10000? 20000 Let x = 0.08 - 0.0706. What is x rounded to two decimal places? 0.01 Let g = -2820 - -4296. Round g to the nearest 100. 1500 Let f = 121.5 + -98. Let c = f - -3. Let j = c - 21. What is j rounded to 0 decimal places? 6 Suppose 0 = -10j + 11j + 1880000. What is j rounded to the nearest 100000? -1900000 Let v = 16.00125 + -16. Round v to 4 decimal places. 0.0013 Let i = -3.5 - -4.5. Let n = 30668097.99999972 - 30668097. Let w = i - n. What is w rounded to seven dps? 0.0000003 Let l = -0.0879 + 0.07. Round l to 3 dps. -0.018 Let p(m) = -456m2 - 8m - 12. Let k be p(-7). Round k to the nearest one thousand. -22000 Let z be (2000-22)/(3/150). Round z to the nearest 1000000. -2000000 Suppose -10r + 17271872 = -242728128. Round r to the nearest 1000000. 26000000 Let b = -2889 + 2890.0005. Let n = -1 - -2. Let v = n - b. Round v to four dps. -0.0005 Let s = -8.824 + -2.83. Let b = s + 11.8. What is b rounded to two dps? 0.15 Let g = -815.9 - -850. Let s = -37 + g. What is s rounded to the nearest integer? -3 Let s(l) = 1018l2 - 4l + 4. Suppose 0g + 15 = -3g. Let c be s(g). Let d = 11174 - c. What is d rounded to the nearest one thousand? -14000 Let t = 3511 - 3547.58. Let b = t + 36. What is b rounded to 1 decimal place? -0.6 Suppose 2105 = 2w - 2f - 3f, -4155 = -4w - f. Let u = w + -550. What is u rounded to the nearest 100? 500 Let n(k) = -k*2 + 6k - 5. Let y be n(5). Let z = 4 - y. Suppose 4h + 2m - 4460 = -2m, -2h - zm = -2220. Round h to the nearest one hundred. 1100 Let z be (-145600258)/(-13) + (-8)/(-52). Suppose 0n - 16800020 = 3n + 4a, 0 = 2n + 4a + z. Round n to the nearest one million. -6000000 Let i = 19302.942 - 19248. Let f = i - 55. Let u = 0.057943 + f. What is u rounded to 5 dps? -0.00006 Let o = 8.857 + -9.69. Round o to one dp. -0.8 Let s be (21 + 9)/((-6)/(-404)). Round s to the nearest 100. 2000 Let g = 716.83 - 712. What is g rounded to zero decimal places? 5 Let f = -1.700045 + 1.7. Round f to five dps. -0.00005 Let z = -5225781 - -3125781. What is z rounded to the nearest one million? -2000000 Let q = -0.17 - -0.36. Let n = q - -0.01. Round n to 1 dp. 0.2 Let f = 143375 + -143375.170009. Let n = f - -0.17. Round n to five decimal places. -0.00001 Suppose 32 = -4f + 8. Let r(c) = 306318c*2 - 4 + 4 - 5c - 92430c2 + 2. Let a be r(f). Round a to the nearest one million. 8000000 Let t(i) be the second derivative of -19i*3/6 - 3i*2/2 - 3i. Let l be t(-7). Round l to the nearest 100. 100 Let y = 124116889 - 204916886. Let t be y/(-4) + 15/20. What is t rounded to the nearest 1000000? 20000000 Let m(z) be the first derivative of 8046z2 + 12z - 5. Let r be m(-11). What is r rounded to the nearest ten thousand? -180000 Let w = 0.02036 + -0.02. Round w to 4 dps. 0.0004 Let n = -12826 + 12825.63068. Let r = -0.71 + 1.08. Let c = r + n. Round c to four dps. 0.0007 Let p = -0.1 + 0.1. Let j = 7 + -6.99997. Let z = j + p. Round z to five dps. 0.00003 Let k be 39/4 - 1/(-4). Suppose 2c + 0 - k = 0, t - 259985 = 3c. Suppose -2x + x - t = 0. Round x to the nearest one hundred thousand. -300000 Let r(j) = -1275001j - 3. Let g be r(-4). Let z be g/3 - 9/27. Round z to the nearest one million. 2000000 Let p = 5970982 + 2049018. Round p to the nearest one million. 8000000 Let i be (-8)/20 - (-42)/5. Let t be 5 + (2 - i/2). Let b be 2460((-497)/t - 1). Round b to the nearest one hundred thousand. -400000 Let h = -28 + 28. Let o = 0.216 + h. What is o rounded to 2 dps? 0.22 Let m(f) = 15754f + 5. Let q(s) = -47261s - 16. Let w(v) = 8m(v) + 3q(v). Let l be w(-8). Round l to the nearest 10000. 130000 Let g(h) = -26750h3 + h2 - 2h. Let n be g(2). Round n to the nearest ten thousand. -210000 Let r = -5038140.89999977 + 5038141. Let s = r + -0.1. Round s to 7 decimal places. 0.0000002 Let a = -0.32 + 32.32. Let l = 112 - a. Let w = -93.9 + l. What is w rounded to 0 dps? -14 Let w = -28.000012 + 28. What is w rounded to 5 decimal places? -0.00001 Let a = -9.2 - -12. Let s = 2.799939 - a. Round s to 5 decimal places. -0.00006 Suppose 0g - 11391 = 2g - 3p, 0 = -4g + 2p - 22794. Round g to the nearest 1000. -6000 Let i = 0.69 + -134.69. Let k = i - -134.0106. Round k to three decimal places. 0.011 Let l = 21 + -21.055. What is l rounded to 2 dps? -0.06 Let t = -121283.36057 + 121284. Let c = t + -0.64. What is c rounded to four decimal places? -0.0006 Let l = -329 - -329.652. Let y = 0.59 - l. What is y rounded to 2 decimal places? -0.06 Let z = 2.4 - 2.6. Let y = 2.5 - 2. Let h = y - z. What is h rounded to 1 dp? 0.7 Let v be (3244 + -1)/(9/(-6)). Let g be v3/(12/1738). Let j = 1729389 + g. Round j to the nearest 100000. 800000 Let v be (-5996 - (-2 - -2)) + -4. Round v to the nearest ten thousand. -10000 Let l = 3.6 - 5.3. Let h = 1.7000007 + l. What is h rounded to six dps? 0.000001 Let w = -0.6 + 0.3956. Let f = 18 + -17.8. Let r = w + f. Round r to three dps. -0.004 Let m = 20.9984 + -21. Round m to 3 decimal places. -0.002 Suppose 2z + z + 39300000 = 0. What is z rounded to the nearest one million? -13000000 Let l = 0.3 + 0.2. Let f = l - 0.4994. Round f to four dps. 0.0006 Let l = 4 + 1.5. Let v = l + -6. Let u = v - -0.50032. Round u to 4 dps. 0.0003 Let o = -0.059 + 1.099. What is o rounded to zero decimal places? 1 Suppose 0 = -2m + 27 - 139. Let x be (-4)/(-2) - (m + -2). What is x rounded to the nearest 10? 60 Let m = 16.89 + -0.45. Let p = -16 + m. What is p rounded to 1 decimal place? 0.4 Let i = 449919.69 + -217256003.69. Let p = -216806064.9999958 - i. Let z = -19 + p. What is z rounded to 6 dps? 0.000004 Suppose 2p - t = -23924 + 6863, -15 = -5*t. Let i = p + 13629. What is i rounded to the nearest 1000? 5000 Let s = -0.2 - -0.19. Let k = s + 0.07. Let v = k - 0.0600	{ "pile_set_name": "DM Mathematics" }
(54 + 35 + -12)? -62 Calculate -15 + -5 + 11 - (10 - 30). 11 What is the value of -2 + 6 + 2198 + -2283? -81 Calculate -56 - -21 - 47 - (-13 + -3 - -5). -71 What is the value of (0 - -6) + (-13 + 1 - (1655 - 1654))? -7 What is (3192 - 3136) + (-2 - -21)? 75 What is the value of -6 - (1 - 1) - (-32 + -40 + 93 + -29)? 2 Calculate 1 + -190 + -517 + 603. -103 (-58 - -3) + (3399 - 3320) 24 What is -23 - (-23 + 7 + (-13 - -10))? -4 What is 59 - (173 + 11 - 38)? -87 What is (58 - -71 - 105) + -32? -8 Calculate 25 - 26 - (-16 + 9 + 13 + -1) - -27. 21 What is 8 - (4 + -8 - -6)? 6 What is the value of (-16 - (11 - (13 - 1))) + 13 + 13 + 0? 11 Evaluate (27 - 5) + (-57 - (9 - 12)). -32 77 + -84 + (5 - (2 - 2)) + -4 -6 What is (0 - (0 + -2) - (49 - 36)) + -42? -53 (-2 - (-2 + -1 - 3)) + 65 + -152 + 78 -5 What is (5 - (14 - -7)) + (-2 + 34 - -19)? 35 Calculate 120 + -110 + -18 + 11. 3 What is 19 + 26 - 71 - 8? -34 Evaluate 5 + 187 + (2564 - 2662). 94 Calculate 18 + (1 + -14 - -49) + 16. 70 Evaluate -47 + (-10 + -6 + 33 - -5). -25 -2 - -4 - (-5 + 5 + (-19 - -9) - -51) -39 What is the value of (120 - 15) + -98 + (-3 - -42)? 46 What is -108 + (-24 + 9 - -17) + (-8 - -8 - 5)? -111 Calculate 32 - (20 + (51 - 89)). 50 What is the value of 13 + 15 + (12 - 51) + -21? -32 What is the value of -6 + 12 - (-3 - ((0 - 0) + -14 + 10))? 5 What is the value of (-10 + 19 + -25 - (-1 - 2)) + -6? -19 What is 21 + (-44 - -4) + 14? -5 Calculate 4 - 67 - (-115 - 2). 54 What is -1 + (34 - (15 - (-1 - -10)))? 27 What is the value of 59 + 39 + -56 + (-44 - -25)? 23 What is the value of -176 + 180 + (-34 - 7)? -37 (-2 - 4) + (-15 - (-12 - 0)) + (34 - 0) 25 What is -2 + (-17 - ((-3 - -13 - 88) + 18))? 41 Calculate 25 + -32 + 16 + 9 + 1. 19 (8 - (145 + -13) - (0 - -1)) + 296 + -286 -115 What is the value of (126 - 131) + -47 - ((0 - -2) + -2)? -52 Calculate -12 - ((7 - -4) + 14) - (-2 + 15). -50 Evaluate (-4 - -3 - (-8 + (-11 - -28 - 12))) + -2. 0 Evaluate (-4 - -1 - 4) + 91 + 25 + -10 + 4. 103 Evaluate 678 + -654 - (-17 + -1) - 14. 28 What is the value of 17 + -73 + 49 + (-7 + 1 - -2)? -11 Calculate 3 + 2 - (-1 + 6) - ((-9 - -61) + -13). -39 Evaluate 0 - 5 - (-29 - 19 - 13). 56 What is the value of -131 - (17 + -22 + -27) - 8? -107 What is the value of (5 - ((-7 - (-18 - 4)) + (-5 - 21))) + -154? -138 What is the value of (6 - (-23 + 3 + 5 + 8 + -8)) + 1? 22 15 + -61 - -33 - (-76 - 0) 63 What is (-80 + 6 - -13) + (-8 - -20) + -10 + -7? -66 63 - (48 - -43) - (18 + 2) -48 (-2 - -6) + (3 + -12 - (2 - 54)) 47 -3 + 28 + -2 - (1474 - 1451) 0 Calculate (6 - 2) + (-51 - 1 - -15). -33 Evaluate 49 + -1 - (-43 + 60 + -36 - -26). 41 Calculate -85 + 123 + (6 - -36) + 33. 113 Evaluate (67 - 130 - -48) + 40. 25 What is the value of (-6 - 104 - -52) + 1? -57 Calculate 9 - (44 + -2 - -1 - (26 - -23 - 36)). -21 Evaluate 7 + (15 + -44 - -3) - 34. -53 0 + -34 + (-280 + 531 - 214) 3 What is the value of (1 + (-2 - 4) - -14) + -30 - (-9 - -10)? -22 What is the value of -2 - 0 - (2 + -4 + (-10 - 15) - 38)? 63 What is the value of (1773 - 1690) + (-44 - -3)? 42 Evaluate (3 - -15) + (0 - 27 - 17). -26 What is the value of -4 + 43 + -30 - (-6 + 11 - -9)? -5 Evaluate (-116 - -132 - (2 + 6)) + -1 + -80. -73 What is the value of -48 - (127 + -79 + -52 - (0 + 5))? -39 Calculate (-4 - 186) + 150 - (-1 + -8). -31 What is the value of (50 - 12 - 40) + (-32 - -1)? -33 Evaluate -18 + (-11 - -21) + (20 + -11 - 46) + -11. -56 Evaluate 8 + -19 + 12 - (74 - 89). 16 What is -38 - 2 - (-12 + (17 - (-10 + -7 + 31)))? -31 Evaluate (-87 + 83 + -3 + (-5 - -5) - -9) + 98. 100 10 + -7 + (-18 - 14) + 18 + 40 + -1 28 26 - (-55 - -57 - -54) -30 Calculate -2 + -16 + 7 - (-27 + 16 + -30). 30 What is 38 - (-10 + (-52 - -49))? 51 (25 - 129) + (2 - (-39 - -8)) -71 Evaluate 98 - 54 - 42 - -31. 33 What is 9 + (1 - 25) + 12 + 61? 58 What is the value of -4 - -16 - (-54 + (-79 - -90))? 55 Calculate 5 + -60 + (-95 - -144). -6 What is the value of (-13 - (-1 + -47)) + (5 - -29)? 69 134 - (105 + 9) - (2 + -80) 98 Evaluate 49 + 0 + (2402 - 2454). -3 -2 - -3 - 11 - (1 - (26 - 7)) 8 Evaluate 21 - (-83 - -160) - -79. 23 What is the value of 30 + (-127 - -18 - -31) + 15? -33 8 - ((-17 - -28) + -15) - (-38 + -4) 54 Evaluate (-39 - (-14 + 12 + -6 + 11)) + -13. -55 What is the value of -32 + 6 + (31 - (-17 + -43))? 65 What is the value of 24 - (17 + -3 + 43 + -41)? 8 -11 + 19 + -1 + (26 - 43) -10 -52 + 14 + -113 + 182 31 What is -32 - (-6 + (7 - 4)) - (25 - 6 - 13)? -35 Calculate -5 + (-38 - (-17 + -35) - (1 - 0)) - -133. 141 Calculate -887 + 891 - (-76 + 14). 66 Evaluate 9 + 0 + -11 + (58 + 23 - 0) + 8. 87 Evaluate -42 - -22 - 91 - -10. -101 What is 19 + -2 + 2 - 3 - (37 - (9 + 23))? 11 Calculate (7 + -12 - (5 - -37)) + -5. -52 Calculate -1 - (1 + -2 + -72 + 8) - (-30 + 22). 72 What is -46 + -78 + -18 - -80? -62 Calculate 207 + (-49 - (64 + -24)). 118 -2 - (46 + -54 - 32) 38 -79 + -19 + 37 + (13 - (0 - 1) - 4) -51 Calculate -100 + 3 + -3 + (-4193 - -4157). -136 What is -52 - (-72 + 66 + (-18 - -2))? -30 Evaluate 4 + 14 + -8 + (-11 - -5) + 18. 22 What is the value of (15 - (-3 + -8)) + 24 + 27 + -5? 72 What is 7 + -85 + 37 - -10? -31 Calculate -3 + 24 - (3 - 2 - (16 - 29)). 7 Calculate -43 + 146 + -202 - (31 + -3). -127 What is (6 - (-6 - -25)) + 4 - (-20 + (3 - 13))? 21 What is the value of 42 - 2 - (27 + -45 + 44)? 14 What is the value of 98 - (21 + (7 - -15) + -17)? 72 -65 + -2 - (167 + -91 - 88) -55 What is the value of (7 - 51) + (-692 - -759)? 23 Evaluate -6 + -30 + 5 + 40. 9 Evaluate 55 + -40 + 10 - 71. -46 Evaluate 4 - (2 - 0) - (45 - 81 - -37) - -72. 73 Evaluate 84 - (-42 - (-120 + -79)). -73 Calculate 5 + 3 - ((12 - (-7 + 7 + 4)) + -3). 3 What is the value of -121 - 2 - ((0 - -5) + -12 + (12 - 11))? -117 Evaluate -49 + (112 + -2 - -47). 108 What is the value of -13 + -14 + 12 + 15 + -6 + -2 + 18? 10 Evaluate (-1 + 5 - -7) + 37 + -48 + 42 + -6. 36 Evaluate 26 - (-9 + -6 + -8 + -4 + 28). 25 Calculate -5 - (-2 + 10 - (18 - (-8 - -3) - -60)). 70 What is the value of -16 + (-6 - (7 - (-18 - -25) - -15))? -37 Calculate (-14 - -49) + (13 - 60). -12 What is the value of 106 - (-19 - 1 - (149 - 181)) - (-13 - 1)? 108 Evaluate -40 + 41 + 20 + -43. -22 Calculate (-14 - 3) + (-35 - -48). -4 16 - (31 - 14 - 4 - -9) -6 Calculate 2 + 2 + (-20 - -22) + (-49 - -44). 1 Evaluate (-512 - -536) + 38 + 3. 65 What is the value of -7 - -1 - (40 + -90 - -41)? 3 Evaluate 52 - (36 - (-47 - -95)). 64 What is 162 + -33 + -139 + 2 + 0 + -32? -40 Calculate (189 - 288) + ((1 + -4 - 8) + 4 - 4). -110 What is the value of -6 + -83 + (-24 - -62)? -51 Calculate -2 + -9 + -44 - (-291 + 293). -57 Calculate (-12 - 41 - -95) + -34. 8 Calculate (4 - 6) + 49 + -47 - 13. -13 Evaluate (2 - -7) + 0 + (-81 - (-1 - 57)). -14 Evaluate -121 + 56 + 8 + 58. 1 Evaluate -13 - (-11 - (-15 + 19 - 78)). -76 -11 - (-6 + -20 + (2 - -1) - (-76 + 82)) 18 What is the value of -107 - (-3 - (-37 - 2 - -28))? -115 (0 - -4 - (2342 + -2376)) + 38 76 Evaluate 1 + 15 + -12 + (-43 - -24) + 102. 87 Evaluate (-29 - (-86 - -44)) + 47. 60 What is (-19 - -7) + -11 + (-44 - -21)? -46 What is the value of 14 + (-34 - -3) + 6 + 13 + (87 - 1)? 88 -3 + 6 + 0 + -38 + 19 + 25 + -12 -3 What is the value of 93 + -42 + 5 - (1 - 9) - 13? 51 Evaluate 122 - (19 - (53 + (-6 - 38)) - (0 - 3)). 109 What is 22 + 15 + 19 + -15 + 10? 51 What is the value of (-15 + 75 - 65) + (61 - (2 - 2))? 56 What is (34 - 26) + 0 + 8 + (-162 - -152)? 6 What is -30 + -6 + 8 - -22? -6 (5 - 2) + 16 + -38 + (3 - -17) 1 What is the value of 120 + (2 - 18) + (26 - 17) + -6 + -2? 105 Calculate 26 - (8 - (7 - 3)) - 77. -55 Evaluate 0 + 0 + -1 + (59 + -197 + 50 - -40). -49 What is the value of (-55 + 32 - -4) + 6 + 6? -7 Evaluate 23 + -41 + 107 + -50. 39 What is 1966 + -1982 - (-55 - (1 - 1))? 39 What is 39 + -23 + -28 - -10? -2 What is -23 + -83 + -19 + 31? -94 Calculate 1 + 7 + -4 + (32 + -25 - (-38 - 2)). 51 Evaluate -22 + (10 - 4 - -33). 17 What is (-2 + -48 - 1) + 3 + -202 + 182? -68 (-46 - (3 + -17)) + 12 + -44 + 0 + 0 -64 Calculate (-2 + 0 + 0 - (-1168 + 1221)) + -8 + 3. -60 What is the value of (5 - 7) + -2 + 37 - (17 + -14 - 7)? 37 Calculate (11 - 5 - -3 - -32) + (-4 - 0). 37 Evaluate -19 - (-1 - 14) - -45. 41 Evaluate 203 + -105 + (-145 - -96	{ "pile_set_name": "DM Mathematics" }
(-1)))(-2) assuming u is positive. u9 Simplify (((ll/(l/(l(ll*(-7)l)/ll))l)/l)/l4)/(l(2/3)l)(7/3) assuming l is positive. l(-98/9) Simplify (i/i10)/i(-10) assuming i is positive. i Simplify ((p/p8)/pp(-1/6))/(p/p(-2)ppp/(p(-1/3)p)) assuming p is positive. p(-27/2) Simplify y(2/21)(yy/(y(-26)/y))/y assuming y is positive. y(590/21) Simplify dd(-4)ddd8 assuming d is positive. d7 Simplify (w*(-5)w)/(ww/(w6/w)) assuming w is positive. 1/w Simplify (a/(a/a(3/2))(a/(a/a*(1/4)))/a)/(aa/(aa(-1)a)a)37 assuming a is positive. a(-293/4) Simplify (l2l)/l10 assuming l is positive. l(-7) Simplify (j*(1/8)j)(9/13) assuming j is positive. j(81/104) Simplify (u*8u/(u/(u*(-1/11)uu)))(15/4) assuming u is positive. u(1635/44) Simplify (((q/(q(2/5)/qqq))/q)/q)/(qqq/(qq/q*(2/7))qq)(q*(1/3)q)(-1/15) assuming q is positive. q(-1819/315) Simplify (q/((qq(1/11)qq)/q)(q/q(-8))/q)(1/6) assuming q is positive. q(38/33) Simplify (f/(f(-13/5)/f))(1/5) assuming f is positive. f(23/25) Simplify (m*(-1/4)m)/m(m(7/5)m)/m((m/m(1/3))/m)(-48) assuming m is positive. m(343/20) Simplify ((s/s4)/((s/s(3/2))/s))(-3/4) assuming s is positive. s(9/8) Simplify ((c/(cc/(c*(-21/5)/c)))/cc)/cc(4/9) assuming c is positive. c(-304/45) Simplify (z(1/6)/z6)/(zz(-2/3))(1/15) assuming z is positive. z(-527/90) Simplify (a5/a(-5/3))/(a/a(2/11))(-16/11) assuming a is positive. a(2852/363) Simplify v/(v/(v*(-1/8)v))v(-10)/v assuming v is positive. v(-81/8) Simplify i((ii/i15i)/iii)/ii(-1/11) assuming i is positive. i(-122/11) Simplify t(-11/2)tt/t34 assuming t is positive. t(-75/2) Simplify (f(-3/8)f)/(f/f(2/7)) assuming f is positive. f(-5/56) Simplify s*(-16/7)ss(25/2) assuming s is positive. s(157/14) Simplify (((h(h*0h)/hhh)/h)/hh)21/(h/h2)5 assuming h is positive. h47 Simplify (z0)1/(z(-2)/(zz*(-2/3)z)) assuming z is positive. z(10/3) Simplify ((((y/(y(2/29)y)yy)/y)/y)/y(-9))(-5/4) assuming y is positive. y(-1295/116) Simplify (hh*6/h)/(hh*0)((hh(-1)hh)/h)(-3/34) assuming h is positive. h(167/34) Simplify (k(-4)/(k/(k/k(-3/11)kk)k))/((k(-3)/k)/k(-4/5)) assuming k is positive. k(26/55) Simplify ((v(2/7)/v)(2/5))(-9) assuming v is positive. v*(18/7) Simplify ((z/(zz1))/(z/z(-2/3)))/((z*1z)/z(-1/4)) assuming z is positive. z(-59/12) Simplify (x*7x*(-2/7)/xx)/(x(-1))33 assuming x is positive. x(278/7) Simplify ((b(-2/7)/b)(-2/7))(-17) assuming b is positive. b*(-306/49) Simplify (((ss*5)/s)/s((ss7/s)/ss)/sss)/(s*(-3)/(ss/s(-1/7))) assuming s is positive. s(120/7) Simplify c/(c*(6/5)/c)cc/(c(-8)c) assuming c is positive. c*(49/5) Simplify ((jj((j/((((j/j(1/2)j)/j)/jjj)/j))/j)/jj)/jj)*19/((jj/(j(j/(j(-4)/j))/jj))/jj(-1)/jj) assuming j is positive. j(71/2) Simplify (l/l1)15 assuming l is positive. 1 Simplify (l2)*(-11)/(l(l/(l*(-1)l))/lll)(-2/41) assuming l is positive. l(-896/41) Simplify x*4(x17/x)/x assuming x is positive. x19 Simplify nnnn(-1/7)nn(-7)/n(nn2nn)(-2/37) assuming n is positive. n(-1143/259) Simplify (z/(z(z/(z*(-4/3)z))/z))/((z/(z*(-2/9)z))/z) assuming z is positive. z*(4/9) Simplify (s(ss14)/s)/s(2/7) assuming s is positive. s(103/7) Simplify (ii(-3/8))42 assuming i is positive. i*(105/4) Simplify ((a((aa(-1/12))/a)/aa)/((a/a(3/2))/a))(-24) assuming a is positive. a(-58) Simplify (q11/qq9)28 assuming q is positive. q532 Simplify (aa*(3/4))/(aaa(3/2)a) assuming a is positive. a(-11/4) Simplify (g(-2))48/(((g(-1/5)/ggg)/g)/ggg)(-19) assuming g is positive. g(-404/5) Simplify xx13/xxx(2/7) assuming x is positive. x(100/7) Simplify r(-21)/(r8/r) assuming r is positive. r(-28) Simplify f/(f(2/29)f)ffff(7/3) assuming f is positive. f(458/87) Simplify (s/s*8s(sss/(s(-3/7)s))/s)/((s/s*2s)/s6) assuming s is positive. s(10/7) Simplify (u(-1/7)/u)41 assuming u is positive. u(-328/7) Simplify ((r0/r)(4/33))8 assuming r is positive. r(-32/33) Simplify (s(2/21)/s(-13/5))(-8) assuming s is positive. s(-2264/105) Simplify x(-6)/(x(x/((x4x)/x))/x)(x(-1/4)x)(2/63) assuming x is positive. x(-125/42) Simplify (h/h5)38 assuming h is positive. h(-152) Simplify (s1)*(-1/8)s*1/(s(ss/(s(-2)s))/s) assuming s is positive. s(-17/8) Simplify (o(-1)/oo(-2/7))(-34/9) assuming o is positive. o(544/63) Simplify l(-1/9)l(l(2/27)/llll)/l assuming l is positive. l*(53/27) Simplify (nn*(-1/4))/nnn(2/5) assuming n is positive. n(23/20) Simplify (n(-1/4)/((n5n)/n))/((n(-2/5)/n)/n)2 assuming n is positive. n(-9/20) Simplify (b(-2/17))(-1/32) assuming b is positive. b(1/272) Simplify (j2)(2/33)j(1/2)j/j(3/5) assuming j is positive. j(337/330) Simplify (d(-6/7))(-2/41) assuming d is positive. d*(12/287) Simplify ((mmm29)/m)/(mm(-28/3)) assuming m is positive. m(115/3) Simplify p*(2/5)(p*2/p)/p(p/(p/p*(-1/6)))/(pp(-1/2)/p) assuming p is positive. p(11/15) Simplify ((zzz5)/(z(-1/2)z))(25/3) assuming z is positive. z(325/6) Simplify (u/u(1/2))(2/173)u*(8/3)uuu(-3) assuming u is positive. u(868/519) Simplify ((t*2t)/(tt/((ttt/((t(-5/4)ttt)/t))/t)))/(t*(-1/10)/(tt6)) assuming t is positive. t(187/20) Simplify (w(-5/14)/w)/(w/w(2/19)w) assuming w is positive. w(-865/266) Simplify (n(-6))(-44/5) assuming n is positive. n(264/5) Simplify (s(31/2)sss)/(s/s(8/13)) assuming s is positive. s(471/26) Simplify (l*(-6)l/(l/l*(3/4))ll)(1/11) assuming l is positive. l(-13/44) Simplify zz*23zz(2/31) assuming z is positive. z(777/31) Simplify (h(-4)/h)/((h(-8/9)h)/h) assuming h is positive. h(-37/9) Simplify f(-20)/(ff(-15)/f) assuming f is positive. f(-5) Simplify w(-1/4)w(w/(www(-13)/ww))/w assuming w is positive. w(47/4) Simplify (p1)*(-2/15)(p(2/5))(-15) assuming p is positive. p*(-92/15) Simplify (vv/(v*(-8)/vv)vv(-1/3))(1/3) assuming v is positive. v(32/9) Simplify f(-6)ff*(-1/5)(ff1)(2/9) assuming f is positive. f(-214/45) Simplify (z/(z/((z/z(-1))/z)))46zz(-1/6)z/z(2/13) assuming z is positive. z(3719/78) Simplify ((hh(4/7))/(h(hh(4/11))/h))/((h11h)/(h*(-4)hh)) assuming h is positive. h(-1062/77) Simplify (o/(o4o))/(oo/(o/(o(6/17)o))) assuming o is positive. o(-108/17) Simplify ((o(-2/5)o)(1/4))50 assuming o is positive. o(15/2) Simplify (z/((z/(z(zzz*(1/2)/zzz)/z))/z))(-12)/(z(-1/3)zz(-1/6)) assuming z is positive. z(-109/2) Simplify (l(l/(l(ll(-1)/l)/l))/l)(1/42)/((l(-6)/l)/(l/l(-6))) assuming l is positive. l(295/21) Simplify ((b(2/3)b)/b)(-23) assuming b is positive. b(-46/3) Simplify w(2/23)/w(13/5) assuming w is positive. w(-289/115) Simplify (v(-3/13)v(-8))(1/8) assuming v is positive. v(-107/104) Simplify l2l(l*5l)/l(l1l)(-2) assuming l is positive. l4 Simplify ((qq/q(-3/7)qq)/q(2/9))(-16/3) assuming q is positive. q(-4240/189) Simplify (rr/(r*(-1/4)r))*(-45)r(4/11)/(r(2/27)/r) assuming r is positive. r(-65293/1188) Simplify v(7/4)/(v/(vv(6/7))) assuming v is positive. v(73/28) Simplify a(-12/5)aa4/a assuming a is positive. a(8/5) Simplify (x(2/79)/x)/x(-2/61) assuming x is positive. x(-4539/4819) Simplify ((gg(-2))(38/5))19 assuming g is positive. g(-722/5) Simplify ((i(-1/5)/i)/(i(2/5)/ii))42 assuming i is positive. i(-336/5) Simplify (mm/((m/(m/(m(2/11)/m)))/m))(-43) assuming m is positive. m*(-1806/11) Simplify (h/(h((h/((h*(2/3)h)/h))/h)/hh))/h(-18) assuming h is positive. h(56/3) Simplify (z(2/9))(10/9) assuming z is positive. z(20/81) Simplify ((b(b/b*(3/16))/b)/bb)/bb6 assuming b is positive. b(93/16) Simplify i(-11)/(i/(i*(-8)/i)) assuming i is posi	{ "pile_set_name": "DM Mathematics" }
rm gh3 + kh*2 + u + fh*4 + ih and give g. 2 Rearrange (1 - 3 - 1)(-6m + 2m + 2m - 2) to the form vm + l and give l. 6 Rearrange (-3x*2 + 5x*2 + 8x*2)(-2x2 - 1 - 4 + 2) to hx*4 + px*3 + tx*2 + dx + j and give t. -30 Express 1 - 25o2 - 13o*2 - 87o*2 as xo*2 + no + j and give x. -125 Rearrange 4l3 + 4l*3 - 2 + 0l*3 - 3l*3 to al*3 + pl + m + wl2 and give a. 5 Rearrange (1 + 1 - 4)(5h + h + 0h + 2h - 3h + 0h + (4 - 1 - 5)(2h + 4 - 4) - 3h + 4h + 0h) to bh + f and give b. -4 Rearrange (-12 + 5 + 4)(-2 + 6 - 2)(0s + 2s + 0s)(3 - 3 + 2) to the form us + d and give u. -24 Express 2 - 5o4 - 62o*3 + 4o*2 + 62o*3 in the form mo*3 + b + ko*2 + uo + ho4 and give k. 4 Rearrange -8 + 8 - 5i + (0 + 0 + i)(-2 - 1 - 3) to u + di and give d. -11 Express ((-4 + 4 + 2)(-2 - 2 + 0) + 2 - 1 - 2 - 2 + 4 - 3)((-2f - 3f + 3f)(f - f - f) - f2 + f2 + 2f2) in the form n + xf + hf2 and give n. 0 Rearrange (-9q + 3q - 3q)(-4q + 5q - 2q) to oq2 + b + iq and give o. 9 Express (-7 - 145l + 152l - 3 - l*2)(-1 + 3 - 1) as ul2 + k + gl and give g. 7 Express -12a3 + 2a*4 + 12a*3 - 1 + 2a*2 - 2a as va3 + y + ra*2 + ma + ga4 and give r. 2 Rearrange 2 + 2c*3 + 7c2 + c2 - 6c2 to qc*3 + fc*2 + yc + z and give z. 2 Express (u*2 - 2u2 - u2)(-18u*2 + 61u*2 - 14 + 15) as zu + bu3 + r + qu*4 + wu*2 and give w. -2 Rearrange (-4 + 4 - 1)(2 + 2i - 2) + i - 8i + 6i to yi + k and give y. -3 Rearrange -3c + 4c + 4 - 2c2 + 45c*4 - 48c*4 - 5 to nc*4 + pc*3 + ic + yc2 + g and give n. -3 Rearrange -4 + 13 - 11 - 3a*3 to the form la + s + ia3 + qa*2 and give i. -3 Rearrange 39 - 39 - 7k + 3k - 2k + 0k + (0 - 2 + 3)(1 - 1 + 2k) - k + 0 + 0 + (k + 2 - 2)(-4 + 1 + 7) - 2k - 2k + 6k to d + uk and give u. 1 Rearrange -20 + 12 + 7 - 2p2 + 0p4 - p4 + 2p3 to up + gp4 + rp*2 + a + zp*3 and give u. 0 Express -2w*2 + 3 - 3 + (2w + w - 4w)(-w - 2w + 4w) + (2w + 0 + 0)(w - 3w - w) as tw*2 + nw + b and give t. -9 Express -27g3 + 0 + 43g*3 - 1 as bg*3 + dg + m + qg2 and give m. -1 Express (-1 - 5 + 4)(6g + 3g - 5g) + 4g + 6g - 6g in the form ug + h and give u. -4 Rearrange 3m - m + 0m + (-82 + 22m + 82)(-5 - 1 + 4) to the form sm + p and give s. -42 Rearrange 17r2 - 2 - 8r*2 - 3r - 10r2 - r4 to the form jr*2 + fr + m + br3 + ur*4 and give m. -2 Rearrange (34 + 7y*2 - 34)(-5 + 1 + 0)(-2 + 3 - 3) to gy*2 + vy + s and give g. 56 Express r*2 + 28 + 27 - 64 as nr + hr2 + l and give l. -9 Express -6 + 0r2 + r2 - 2r2 + 0r*2 in the form i + nr + hr2 and give h. -1 Rearrange -2d*2 + 3d*4 - 2d - 3d2 - d3 + 5d*2 to w + sd*2 + rd*4 + fd*3 + gd and give r. 3 Express (3q + 8q - 10q)(-3 - 2q + 3)(5q - 4q - 2q) in the form kq*3 + yq*2 + c + vq and give c. 0 Rearrange (127m2 - 120m*2 + 1 + 3)(2m - m2 - 2m) to the form j + qm + tm*3 + nm*2 + um*4 and give n. -4 Rearrange (-2 + 1 + 3)(3q + q - 5q)(19 - 54 - 4)(2q2 - 7q*2 + 4q*2) to wq*3 + oq + zq2 + a and give a. 0 Rearrange -5d + 10d + 10d to the form td + q and give t. 15 Rearrange (2 - 2 - 3)((16 - 4 + 13)(-3g + 6g - 4g) + 4 - 4 + 2g) to the form qg + z and give q. 69 Rearrange (3z - 2z - 2z)(1 - 1 + 2z2) + (z + 4z - 4z)(-3z2 + 3z*2 - 2z2) + z3 + z2 + 2 - z2 to m + jz + sz*2 + qz*3 and give q. -3 Express 351q - 2q2 - 172q - 12q3 - 175q + 2 as dq2 + cq*3 + iq + n and give d. -2 Express -34b2 + 0 - 2b*3 + 1 + 1 + 29b*2 in the form vb + zb2 + mb*3 + w and give m. -2 Express 51w + 2w3 - 24w - 28w in the form lw + rw2 + s + tw*3 and give l. -1 Express -9 - 3y - 12 + 17 in the form ly + i and give l. -3 Rearrange -263 + 263 - 94p3 + (p2 + 2p2 - 4p*2)(-p - 3p + 3p) to qp2 + m + tp*3 + np and give m. 0 Express 7u - u2 - u3 - 56 + 56 in the form iu*3 + z + ku*2 + ju and give z. 0 Rearrange (0 - 1 + 0)(-7 + 0 + 0)(5r3 - 5r*3 - 2r*4) to u + mr*2 + dr + qr4 + jr*3 and give q. -14 Rearrange -2y*2 + 3y*2 - 4y2 + y2 + 27y3 to the form s + ny*2 + gy*3 + ly and give s. 0 Rearrange 8 - g*4 + 2g + g3 - 1 - 5 - g2 - 2g3 to bg*4 + o + kg + mg3 + tg*2 and give o. 2 Rearrange -w - 3 + 3 + (-1 + 1 + 2w)(3 - 4 + 0) + 5w + 0w + w to the form d + kw and give k. 3 Rearrange j - j + j - j + 0 + 0 + (-1 - 1 + 3)(2j + 3j - 3j) + 0 - 2j + 0 - 2j + 2j - 2j - 18j + 32j - 22j to the form qj + t and give q. -10 Rearrange 3 - 14w - 1 + 10w to g + nw and give g. 2 Express 6r*3 - 2r*3 + 2 - 3 + 2 in the form xr*2 + m + gr*3 + kr and give g. 4 Rearrange -2x3 + 3x + 3x4 - 2x*2 + 0 - 7 + 5 to wx*4 + a + ux*3 + kx + mx2 and give a. -2 Rearrange -8 + 16x*2 - 25x*2 + 14x*2 to the form hx*2 + ix + u and give u. -8 Rearrange -2x4 + 6 - 10 + 11 - x - 2x*3 + 0x*3 to the form k + hx*4 + nx + zx2 + qx3 and give n. -1 Rearrange z2 - 3z2 + 0z2 + (4 - 4 - z2)(2 + 2 - 2) + 8z*2 - 38 - 12z*2 + 2z*2 to qz + nz2 + u and give n. -6 Rearrange 8 - 9 + 2r + 11r to the form cr + u and give u. -1 Express (-3b4 + 0b + 0b)(0 + 4 - 1) as sb2 + ob*3 + t + pb + nb4 and give n. -9 Rearrange p3 - 3p*3 + 0p2 - p4 + 4p4 + 5p*2 to ip*3 + f + zp + wp4 + hp*2 and give i. -2 Express 6a - a - 1 - a4 + a2 - 3a + 0a in the form ja2 + va + l + ka4 + ia*3 and give l. -1 Express (6a + 36a + 24a)(0a - 2a + a) as ra*2 + va + s and give s. 0 Express -2i3 + 11i*2 + 7i*2 - 4i*2 + 2 in the form qi + ci3 + yi2 + n and give y. 14 Rearrange -c2 - 3c2 + 21c*3 + 2 - 10c3 + c2 to kc3 + tc*2 + d + sc and give d. 2 Rearrange (6 - 10z - 6)(-3z3 - z3 - 52z + 53z) to x + tz*4 + hz*3 + lz*2 + nz and give l. -10 Rearrange 7j3 - j3 - j - 2 + 0 + (1 + 2 - 5)(-5j + 5j - j*3) - 3j*2 + 3j2 + j3 - 2j3 + j - j to yj*3 + n + uj*2 + oj and give y. 7 Rearrange 2j + 28 - 48 - 31 to the form yj + c and give y. 2 Rearrange -129 + 129 - 41w to the form i + vw and give i. 0 Express 47k - 1 - 13 - 49k in the form rk + i and give i. -14 Express (0 - p + 0)(38 + 96 - 148 + 92) as dp + x and give d. -78 Rearrange 3b*4 + 3b*3 + 0b*2 - 2b4 + b2 to hb4 + z + rb + ib3 + tb*2 and give r. 0 Rearrange 4k*2 + 2k*3 - 4k2 + (k3 + k - k)(0 + 3 - 1) - k3 + 4k*3 - 2k*3 to the form lk*2 + bk + z + pk3 and give p. 5 Rearrange -z3 - 2z*2 + 0z*3 + 467 - 2z*4 - 469 + 2z to w + uz2 + vz*4 + pz + bz3 and give p. 2 Rearrange (0 + 0 + 2j)(6j + 0j - j2 - 2j) to the form fj3 + sj + d + yj2 and give y. 8 Express (-2d + d + 0d)(0d - 2d + 0d) + 10d*2 - 61d*2 + 9d*2 in the form qd + yd2 + c and give y. -40 Express -16c*2 - 2c*3 + 16c*2 - 1 + c in the form gc + nc3 + l + zc*2 and give g. 1 Express 26 + 15 - 26 + j + (-1 - 1 + 0)(-4j + j + j) - j - 2j + 2j in the form v + fj and give f. 4 Rearrange (3 + 0 - 5)(2 + 1 - 1)(2b - 3b - b) to v + ab and give a. 8 Rearrange 5t*3 - 9t*4 + 7t4 - t2 - 4t - 7t*3 to the form mt + bt4 + ht*3 + l + wt*2 and give w. -1 Express 3 - 1 + 0 - 7y*3 in the form qy*2 + p + ky*3 + hy and give p. 2 Rearrange (-3 + 2 - 2)(2 - 2 + q3 + (3 - 3 - 2q*2)(3q + 2q - 4q)) to the form tq*2 + oq + z + lq3 and give l. 3 Express 14 - 16 + 2 + d3 - 18d*2 as l + md*3 + td*2 + ad and give t. -18 Express (1 - 3 + 0)(-4 + 4 + 2)((c - c - c)(3 - 5 + 1) - 23c + 23c + 90c) as dc + s and give d. -364 Express 7w*2 + 145w*3 + 3w - w - 3w2 - 142w*3 as ow + yw2 + aw*3 + l and give a. 3 Express 3l*2 + 3 + 0l*2 - 3l*2 - 2l*3 as y + tl*3 + zl*2 + ml and give y. 3 Express -17x3 + 9 + 18x*3 - 2 as ox + i + kx2 + cx*3 and give i. 7 Express 5m + 7m - 18m - 7m as n + vm and give v. -13 Rearrange -16a4 - 6a*4 - 16a*4 + (-2a*2 + 4a**2	{ "pile_set_name": "DM Mathematics" }
t be (-16)/(-7) + (-2)/7. What is the common denominator of d/(-4) + t + (-24)/(-208) and -6/11? 143 Let u = 229 - 2068. Let j = 5566/3 + u. Calculate the common denominator of j and -31/2. 6 Let c = 4119012689/84 + -343993189/7. Let q = c - -106020. Find the common denominator of q and 73/18. 252 What is the least common multiple of ((-23)/(-2))/(9/(130 + -4)) and 184? 1288 Let z be (-8)/(-48) + 35/6. Find the common denominator of (291/24-2)/z and -49/11. 264 Let d = -7860 + 7992. Calculate the smallest common multiple of d and 1914. 3828 Suppose 2l + 3o - 42 = 0, -4o + 21 = l - 5o. Find the common denominator of ((-42)/(-8) + -5)/(l/(-81)) and 1/(-8)182/8. 224 Let c be (-7)/2(-660)/(-385). Calculate the common denominator of (2 - 33)/(1 - -8) and 670/c87/(-290). 18 Calculate the lowest common multiple of (-3720)/(-50)1 - (56/(-10) + 5) and 66. 1650 Let c = 2493 + -2484. What is the lowest common multiple of 1659 and c? 4977 Find the common denominator of -33/8 and (2920/3018)/(-5)(-552)/(-1472). 4024 Let h be ((6 - 6) + 2)/(2/206). Suppose 5f = -2u + 221, -3f = 2u - 21 - h. Calculate the lowest common multiple of u and 20. 1180 Let n = -512 + 788. What is the smallest common multiple of 14 and n? 1932 Let o = 18 + 0. What is the common denominator of (-25)/o(-1)/5 and 1196/2093 - (-1653)/(-504)? 72 Suppose -5a - 9 = p - 4p, 2p = 4a + 6. Suppose 809f + 53284 - 89020 - 100985 = 0. Calculate the smallest common multiple of p and f. 507 Let p be (2/(-15))/(-2420/477475). Let n = -899/16 + p. Let b = n - 76. Calculate the common denominator of b and 59/21. 63 Suppose 25j - 13260 = 440 + 3175. What is the smallest common multiple of 9 and j? 675 Suppose -4s = -s - 99. Let u(i) = -i2 + 70i - 1095. What is the least common multiple of u(46) and s? 99 Suppose -3517 - 2723 = -20r. Let n = 389 - r. What is the lowest common multiple of n and 49? 539 Suppose 2m + 2y + 48 = 0, 3m + 24 + 48 = 2y. Find the common denominator of 85/8 and (248/(-32))/(2212/m). 4424 Let n = -26269 + 26281. Calculate the least common multiple of 18192 and n. 18192 Let n(v) = -v2 + 23v + 489. Calculate the least common multiple of n(36) and 257. 5397 Let p(r) = -359r - 1888. What is the least common multiple of p(-6) and 3781? 52934 Find the common denominator of 27/829 and (-3180)/(-530) + (-105)/4. 3316 Let z = 24 - 2. Let h(f) = 7f + 34. Let x = -12 + 8. Calculate the least common multiple of z and h(x). 66 Calculate the smallest common multiple of (-65)/1590/105-21 and 351. 702 Let z = 28314799/250 + -113259. Find the common denominator of z and -77/200. 1000 Let t = -44997/22 + 2043. Calculate the common denominator of t and (-3843)/(-1872)-3 + (-2)/13. 176 Let x be (6 - 7)(2 - 1) + 3. Suppose -xs + q = -17, -2q - 2 + 8 = 0. Calculate the lowest common multiple of 16 and s. 80 Let q = 5489/32 + -173. Find the common denominator of 91/3888 and q. 7776 Suppose 5g = -10p + 15p + 170, 2p - 124 = -4g. Calculate the lowest common multiple of 152 and g. 608 Suppose 24b - 2d = 21b + 62, -d = b - 24. Let r(m) = -91m - 2. Let n be r(-7). What is the lowest common multiple of b and n/15 - 2/6? 462 Let j(x) = -226x + 9296. Calculate the smallest common multiple of j(41) and 3 + (-1 - 1) + 23. 120 Let r be 2646/1224 + 3/(-4). Let c = r + 152/85. Find the common denominator of (4/55)/((-2)/(-5)) and c. 55 Suppose -127c - 128 = -128c + 75. What is the least common multiple of 70 and c? 2030 Let d = -2334/31 - -127927/1674. What is the common denominator of d and 13/12(-30)/(-12)? 216 Suppose 4o = 91g - 90g + 4034, -4 = 2g. What is the smallest common multiple of 90 and o? 5040 Let n = 1543532/26058573 - -2/40653. Find the common denominator of n and 67/4. 2564 What is the common denominator of 65/76 and (16/24 - (-10)/75) + 3266/(-5320)? 532 Let j = 13774 + -220465/16. Calculate the common denominator of (-3 + 54/36)221/30 - -7 and j. 80 Let a = 1417390/70153 + -1474/73. Let m = -27725/11532 - a. Calculate the common denominator of m and 169/20 + 12/(-60). 12 Let d be (2/4)/((-3)/102). Find the common denominator of (d/7)/((-36)/(-14)) and (48/27)/(12/(-72)). 18 Let l = 108 - 106. Suppose lx - x - z = 13, -2z = 5x - 100. What is the lowest common multiple of x and 54? 54 Let s(o) = -o2 + 10o + 26. Let a be s(12). Suppose 3i - 309 = -3c, 4c - 289 = c + ai. Let m = c + -94. What is the least common multiple of m and 2? 10 Let q = -10/280933 + -33540309817/3371196. Let i = -9943 - q. Calculate the common denominator of -71/18 and i. 36 Suppose -i - 506 = -5p + 10045, 4p - 4i - 8444 = 0. Calculate the lowest common multiple of p and 2. 2110 Suppose -5g - 16406 = x - g, 4x + 65663 = -3g. Let v = -393977/24 - x. Calculate the common denominator of 87/4 and v. 24 Let k = -14 - -12. Let j be 19 - 0/k - (-6 - -3). Suppose -6 = -2f + j. Calculate the smallest common multiple of 4 and f. 28 Suppose 0 = 14u - 2907 + 933. Let j = -121 + u. Calculate the lowest common multiple of 55 and j. 220 Let q(t) be the second derivative of t*5/20 - 8t*4/3 + 55t*3/3 + 33t*2 + 355t. What is the least common multiple of q(28) and (2/2 - 0) + 75? 380 Let j = 48 + -43. Suppose -5b + 0b + l = -33, jl = -3b + 3. What is the smallest common multiple of 20 and 4(169/30 - b/45)? 220 Calculate the common denominator of 20/(-110) + (-10)/70 and -67/1617. 1617 Let i = 5/5629 + 21598433/45032. Let b = i - 479. Find the common denominator of b and 53/46. 184 Suppose -y + 66 = y. Let s = 88262 - 88256. What is the smallest common multiple of (-4)/22 - (-567)/y and s? 102 Suppose 0 = -c + 16 + 12. Let f = -130537 + 130569. Calculate the lowest common multiple of f and c. 224 Suppose -5q + 1 = -4. Let p(c) = 2c2 - 22c + 57. What is the smallest common multiple of (231/(-11))/(q + -2) and p(7)? 21 Let d be 3 + (-1 - -1 - 378). Let s = d + 464. What is the lowest common multiple of 4 and s? 356 Let i = -43231 - -4106982/95. Find the common denominator of 109/2240 and i. 42560 Let q = -284 - -409. Let w = q - 107. What is the common denominator of -67/12 and (-4540)/1260 + (-8)/w? 84 What is the common denominator of -19/22 and 6/2613 - 14064/(-1511712)? 11946 Let p be 2/4(-273849)/30. Let w = -4570 - p. Let h = 2119 + -12613/6. Find the common denominator of w and h. 60 Let s = -212076332/683 + 310507. Let w = 2/3413 - -44365/6826. Find the common denominator of s and w. 1366 Find the common denominator of 1977/(-398) + 24 + (-11 - 8) and 61/6. 1194 Let n be (12/(-36) + 0)/((-1)/(-32163)). Let o = n + 193031/18. Calculate the common denominator of o and 103/468. 468 Suppose 2x + 43 + 165 = -4z, -3x + 238 = -5z. Calculate the least common multiple of 1875/z8/(-10) and 40. 120 Let n = -79348/273 + 3724/13. What is the common denominator of n and -149/138? 966 Let r(f) = -f3 - 4f*2 + 4f + 7. Let h be r(-5). Let t = -70061/10 - -7013. Find the common denominator of t and ((h/(-3))/4)/((-19)/43). 190 Let b = 112323277/420 - 267436. Find the common denominator of 83/60 and b. 420 What is the lowest common multiple of 840 and 2(-4)/14 + (-98332)/(-91)? 7560 Calculate the lowest common multiple of (-1)/(((-186)/(-46) - 4)/(-57 + 3)) and 552. 4968 Let v be -1 + -4 + 6180/(-87). Let q = -673423/8816 - v. What is the common denominator of 77/16 and q? 304 Let p be 24/(-15)5/(-2). Find the common denominator of 19/18 and -95p/(-32) + -2. 72 Let b = 71713/2252898 - -2/23967. Find the common denominator of -13/940 and b. 940 Calculate the common denominator of -55/12 and ((-5)/100)/((-144)/4020). 48 Let i(u) = -2u*2 + 57 - 17u*3 + 19u3 - u3. Calculate the least common multiple of i(0) and 3. 57 Let h(y) be the second derivative of -2y3/3 + y2 + 18y. Let b(c) = c + 8. Let w be b(-9). Calculate the lowest common multiple of h(w) and 5. 30 Let i = 1867 - 1801. Calculate the smallest common multiple of 3 and i. 66 Suppose 3x + x = 4. Find the common denominator of 14 + (11550/(-22) + 1)/44 and 15/(-18)x-23. 66 Suppose 5p = -4o - 49, -13 = -9o + 10o + 2p. Let q(a) = -a*2 - 12a + 12. Calculate the common denominator of 187/30 and q(o). 30 Suppose 5q = -5a + 940, 1471 = 7a - 2q + 191. What is the smallest c	{ "pile_set_name": "DM Mathematics" }
1)/((-15)/12)). Which is the fourth biggest value? (a) 1 (b) 96 (c) m (d) 2/3 c Let u = 282 - 128. Let h = -467/3 + u. What is the third smallest value in -1, h, -2/3, 2/13? -2/3 Let a be (-6)/(-9) - (-11 + 13). Let j = 659.023 + -659. What is the biggest value in a, j, -3? j Let s = 175/4 + -1607/36. Let k = s - -154/153. Let l = 829 + -826. Which is the smallest value? (a) l (b) -12 (c) k b Let x(s) = -s*3 + 3s*2 + 2. Let n be x(3). Let p = -44303 + 310768/7. Let c = 93 - p. What is the biggest value in 0.2, c, n? n Let n = -12958 - -64791/5. What is the fourth biggest value in n, 0.3, 7/23, -2? -2 Suppose -2b = n + 8, -n - 11b + 1 = -12b. Let w = -20 + 22. What is the second biggest value in n, w, 7? w Let o be (-1)/212/615. Suppose 10h + 13h + 123 = -18h. Which is the smallest value? (a) 3 (b) o (c) h c Let m = -1350 - -1350. Let w = -26.5 - -26. What is the fourth smallest value in -1, w, -3, m? m Let l = 94.2 + -18.2. Let q = l + -76.4. Suppose -5k + 10 = -5p, 2p = -3k + k - 8. Which is the fourth smallest value? (a) 0.2 (b) k (c) -2 (d) q a Let f = -35089 + 35090. Which is the third biggest value? (a) 31.41 (b) f (c) -0.2 c Let x = -0.6577 - -0.6577. Which is the fifth biggest value? (a) 1/12 (b) 1/4 (c) -20/3 (d) 4 (e) x c Let k = 2239/862 + -42/431. What is the smallest value in -4, 0.59, k? -4 Let k be (-63)/(-36)544/7140. Let b = 6.6 - 7. Let l be (1/2)/((-2)/3). What is the fourth biggest value in 3, b, l, k? l Let f = -188 + -413. Let g = 600.9 + f. What is the fourth smallest value in g, -1, 1, 10? 10 Let w(z) = 10882z + 261166. Let j be w(-24). Let m(s) = s*2 - 4s + 4. Let l be m(3). Which is the smallest value? (a) -0.02 (b) l (c) j (d) 5 c Let s = 0.125 + -0.525. Let k be -1 + (-65)/(-15) + -4. Which is the second biggest value? (a) -8 (b) s (c) 1 (d) k b Let h = 68 - 38. Let z = h - 54. Let s = 24.5 + z. What is the second smallest value in -4, s, 0? 0 Let m = -7449 - -37244/5. What is the third biggest value in 0.1, m, 1796? m Let h be (10/3)/(-2) + 2. Let n = -236.826 - -237. Let w = n - 2.174. Which is the third biggest value? (a) h (b) -1/3 (c) 0.5 (d) w b Let j = 24.512 + -284.512. Which is the third smallest value? (a) -3 (b) 1/2 (c) j b Let h be 2/(-8)216. Let y(q) = q*2 + 5q - 19. Let l be y(h). Let z = 0.17 - 0.07. Which is the third smallest value? (a) 1 (b) l (c) z b Let s = 60.7 - -3.3. Let n = s - 69. Which is the smallest value? (a) 1/17 (b) 4/7 (c) n (d) 2/13 c Let j = -4 - -7. Let x be 3/((0 + 4)/8). Let i be x/8 + 385/(-588). Which is the smallest value? (a) i (b) j (c) 0.2 a Let v(g) = 9g3 + 82g*2 - 33g - 119. Let p be v(-9). Which is the fifth biggest value? (a) p (b) -1/3 (c) 1/9 (d) -0.1 (e) 0.5 b Suppose -5w + 173 = -26w + 26. Which is the third smallest value? (a) -5 (b) 24 (c) w b Let f = -5235.437 + 5238. Let j = -0.037 - f. Let v = -2.2 - j. What is the third smallest value in 0, v, 5/3? 5/3 Suppose -5n + 24 = 4g + 8, -n - g = -3. Let l = -178.65 - -0.65. Let i = l - -137. What is the third biggest value in n, i, -3? i Let k = 106.4231 + 0.5769. What is the fourth smallest value in k, 1, -0.1, -5? k Let x = 663.4 + -659.4. Let q = -0.009 - -5.009. Which is the third smallest value? (a) x (b) 3.8 (c) q c Let v = 7/27 - 13/27. Let r = 1771.5 - 1773. Let t be 1/2 - (-32)/(-48). Which is the smallest value? (a) r (b) v (c) t a Let g = -4805 + 4809. Let q = -0.04 + -0.26. Which is the second smallest value? (a) 5 (b) q (c) g c Let d(p) = 2p2 + 10p - 34. Let x(i) = -2. Let o(l) = d(l) - 4x(l). Let k be o(-7). Which is the third biggest value? (a) -1/8 (b) k (c) -113 c Let j = 4.1 - 4. Let h = -0.56115 - 1.43885. Let o(x) = x3 - 3x*2 + 3x - 4. Let k be o(3). Which is the third biggest value? (a) 6 (b) h (c) j (d) k c Suppose -2h + 13 = 1. Let f be (-70)/8(-2)/(-7). Which is the fourth biggest value? (a) h (b) 5 (c) 4/9 (d) f d Let o = 811/3 - 271. Let p = -1.6 - -4.6. Let q = -43/170 - 5/34. Which is the biggest value? (a) q (b) o (c) p (d) -2 c Let p be (-3)/(-4)(-5068)/(-63). Let w = p - 60. Let k = -11 - -13. Which is the smallest value? (a) w (b) -0.4 (c) k b Let z = -3.383 - -3.383. What is the smallest value in 2/9, z, -0.03? -0.03 Let j = -188 - -187. Let z be (-26)/7 - 20/70 - -7. Which is the third smallest value? (a) z (b) 8/5 (c) j a Let a = -2.92 + -0.08. Let s = -7 - a. Let t = 2853 - 8561/3. What is the biggest value in 3, s, -1, t? 3 Let o = 12824 + -12944. What is the third smallest value in -4/3, -1, o? -1 Suppose -79w + 6579 = -88w. Let z = -3656/5 - w. Which is the third smallest value? (a) z (b) 0.11 (c) -8 (d) -4 a Let k be -473 + (-1)/5-5. Let z = k - -1421/3. Which is the second biggest value? (a) -1 (b) -0.2 (c) 4 (d) z d Let j = -244 + 243.5. What is the third smallest value in -348, j, -1? j Let v = 0.4641 - -4.5359. Which is the fourth smallest value? (a) 2 (b) v (c) -94 (d) -1 b Let i be (-2)/6 + ((-1596)/72 - -18). What is the biggest value in 3/2, -4/7, i, -0.4? 3/2 Suppose -8m + m = 14. Let j(h) = 6h*2 + 12h + 4. Let v be j(m). Let p = -13/138 - -6/23. Which is the third biggest value? (a) 0.1 (b) p (c) -7 (d) v a Let o = 7 - 30. Let w be -11(6 + 609/(-84)) - (14 + -1). What is the third biggest value in o, 0.4, w? o Let p = -17.26 - -21.26. What is the fourth biggest value in -0.3, -97, -0.5, p? -97 Let f = 7.12 + -0.82. Let g = f - 7.16. Let q = g - -0.46. Which is the second smallest value? (a) 3 (b) q (c) 3/5 c Let q(w) = -43w - 1463. Let s be q(-34). Which is the third biggest value? (a) 3/7 (b) -0.4 (c) 3 (d) s b Let u = 0.1327 - -0.8673. Let d = -2.028 + 0.128. What is the second smallest value in u, d, -0.3, -2/7? -0.3 Let r = -192.765 + -0.235. Let h = r + 188. Let q be (-475)/(-465) - (1 + 0). Which is the smallest value? (a) h (b) -4 (c) q a Let u = 57/28 + -279/140. Let t = u + -97/630. Let h = 38/9 - 155/36. What is the second biggest value in h, t, 0? h Suppose 4h - 15 + 11 = 0. Suppose -2i - 3 = -h. Let l = -14 - -13.9. What is the smallest value in -0.4, i, l? i Let m = 10/109 + 89/218. Let d be 2/(-8) - 26/(-40). What is the third biggest value in 1/11, -2, m, d? 1/11 Let l = -23920.219 - -23906. Let c = l + 0.219. What is the smallest value in 5, 1, c? c Let o be ((-540)/(-756))/(2/(-2))(-2)/5. Which is the second biggest value? (a) 25 (b) -2 (c) o (d) -3 c Suppose 5m - 69 = 4d, -46d - 4m = -41d + 35. What is the biggest value in -11/8, d, -5? -11/8 Suppose -133 - 57 = 2p. Let q(h) = -297h*2 + 3h - 1. Let y be q(1). Let v be (-6)/(-2) - y/p. What is the third smallest value in -1, -0.3, v? v Let l = -18.61 - -16.61. Which is the second smallest value? (a) -3 (b) 3 (c) 0.07 (d) 2/17 (e) l e Suppose 114 = -35i - 61. Which is the second smallest value? (a) -2.3 (b) -6 (c) i c Let q be ((702/(-22))/9 - 4) + 17. Which is the fourth smallest value? (a) 0.07 (b) -0.4 (c) -4/7 (d) q a Let y be 2/(-6) - (-4)/6. Let f(p) = -p*3 - 24p*2 - 7p - 37. Let k be f(-24). Let x = k - 143. Which is the smallest value? (a) x (b) y (c) 2/7 a Let u = -608.277 + -2.223. Let p = u + 610. What is the biggest value in 2, p, -7/13? 2 Let g = 240.5 - 240.5. Let d = -5 + 12. Which is the second smallest value? (a) 1 (b) g (c) d a Let w be (-12)/5 + 9/(-15). Let a = -30 - -30.5. Let p(t) = -t*2 - 10t - 11. Let f be p(-8). What is the second smallest value in a, w, f, -0.06? -0.06 Let l = 3.1595 - 3.2385. Let k = 0.4 - -0.1. What is the third biggest value in l, 5, k? l Let z = -69 + 69. Let r = 1305 + -1300. What is the second biggest value in z, -3, r, -31? z Let x = 2061 + -2062.18. Which is the second smallest value? (a) x (b) -5 (c) -2 c Suppose 0 = 3u + 2v - 16, -u + 38v - 42v = -2. Which is the second biggest value? (a) 1.1 (b) -0.5 (c) u (d) -5 a Let t be (-8416)/52 - -5 - -1. Let c = t + 156. Let b = -0.4 - -9.4. What is the second smallest value in b, c, -3? c Let u = 4052.9 - 4053. What is the biggest value in -5, 3/8, u, 1/3, -9/4? 3/8 Let t = 154 + -199. Let d = -0.1 + -44.4. Let m = d - t. Which is the biggest value? (a) 0.2 (b) m (c) 2/17 b Suppose 0 = -	{ "pile_set_name": "DM Mathematics" }
v - 96163. Is k composite? True Let c = 304 + 1730. Let t = c + -1053. Suppose -t = -3h + i - 87, 3h + 5i = 912. Is h a prime number? False Let t(s) = -s + 4. Let y be t(-18). Let h(q) = 8q*2 - 27q - 27. Is h(y) prime? True Suppose o + 3455 = -2y, -3o = 3y - 6o + 5169. Let u be y/(-10) + 4/10. Suppose 49 - u = -4l. Is l a prime number? True Let f(v) = 2134v - 229. Is f(11) prime? False Let z be ((-5)/(45/(-6)) - 1)51. Let b(y) = -y3 - 14y*2 + 10y - 23. Is b(z) a prime number? False Let i(n) = -199n3 - 2n*2 - n + 2. Let x be i(-2). Suppose q = 5q + x. Is q/(-7) - (-8)/28 composite? True Is (-1)/(-4(-5)/(-27740)) a prime number? False Let c(w) = -8w + 5. Let r(o) = 9o - 5. Let u(j) = 3c(j) + 4r(j). Let h be u(5). Suppose -h = -a - 4a. Is a composite? False Let p(q) = 485q - 6. Let i be p(4). Suppose -i = -10b + 8b. Is b composite? False Suppose 3d - 7d + 5306 = 2x, -3d - 2653 = -x. Is x composite? True Let j = 2716 - -916. Suppose -j + 9942 = 10x. Is x a prime number? True Let q(p) = 6p - 10. Let u be q(14). Let h = -39 + u. Is h a prime number? False Suppose -3j - 5q = -49, -5 = 3j + q - 34. Is 1/82 - (-25622)/j a composite number? False Let v(z) = 3z*2 + 2z + 1. Let t be v(-1). Suppose 4f + 4l = tf, l + 3 = 0. Is (-1719)/f12/(-18) a composite number? False Let k = -51 + 22. Let z = k + 232. Is z prime? False Let f = -7 - -7. Suppose -4t + t + 378 = f. Suppose -2x = -3c - t, 5c - 208 = -3x - x. Is x prime? False Is (-1 + (-4)/(-3))/((-17)/(-16473)) a composite number? True Let w(p) = -p3 - p2 - 3p + 4. Let b be w(0). Suppose 1315 - 6060 = -5a + br, -5a + 4745 = 3r. Is a composite? True Let l(i) = -43957i - 519. Is l(-4) a prime number? True Let w be 7 + -2(-12)/(-8). Suppose 4j + wd - 724 = 0, j - 77 = 2d + 92. Is j prime? False Let d be (-53)/3 - (-3)/(-9). Let u be (9/(-2))/(d/120). Suppose -l = 2l - u. Is l prime? False Suppose -2h + 4 = -12. Let p = h - 5. Suppose 5d = -x + 557, -4d - px + 454 = 2x. Is d composite? True Suppose 5r + 207 = -973. Let l = r + 351. Is l a composite number? True Suppose 695 + 2645 = 4r. Suppose 5v - r = 2u, -865 = -0v - 5v - 4u. Is v composite? True Suppose -9n = -23n + 731122. Is n prime? True Let a = 14884 + -8499. Is a composite? True Suppose -48 = -4c - 36. Let t be -2 - (-2 + (-1 - 0)). Is c/(-6)-66t composite? True Let r = -1502 + 2164. Is r composite? True Let n(q) = 703q*2 + 19q - 167. Is n(12) a prime number? True Let g(a) = -6a3 + 3a*2 + 2a + 3. Let l be g(-4). Let t = -4 + 8. Suppose -u + td + l = 0, -3u + 1585 - 379 = 3d. Is u a composite number? True Suppose -3g + 6 + 0 = 0. Let s(z) = -z + 6. Let v be s(g). Suppose -94 + 492 = 2r - 3k, 3r - vk = 598. Is r a prime number? False Let l = -811 + 511. Suppose k + 1258 = 3k. Let o = l + k. Is o prime? False Let r be (-2 - (-13419)/14)(-1 - 1). Let s = -1246 - r. Is s a composite number? True Let i(v) = -v*3 + 8v*2 - 8v. Let t be i(7). Is ((-35)/4)/t716 composite? True Let z = -27135 - -76390. Is z prime? False Is (-15634)/((-6)/2(-22)/(-33)) a prime number? True Let b = 420 - 417. Let s be (-2)/((-2)/(-1))-2. Suppose 89 = bj - 2j + sd, 2d = 2j - 166. Is j a prime number? False Suppose 4k + 2s = 4860, 0 = -k - 5s + 178 + 1046. Is k prime? False Let m be (-6)/(-9) + (0 - (-565)/3). Let d = m - 71. Is d prime? False Let v = -20 + -104. Let h(u) = 10u*2 + 2u - 5. Let r be h(2). Let g = r - v. Is g a composite number? False Suppose 29477 = -37l + 38l. Is l a prime number? False Let s = -4550 - -7479. Is s composite? True Suppose -2k - 35 = -5a - 121, k + 5a = 73. Suppose -4y + k = -7. Is y a prime number? False Let o(r) = 8r3 - 2r + 1. Let s(y) = -y*3 - 9y*2 + 3. Let b(d) = 10d3 + d2. Let a be b(-1). Let f be s(a). Is o(f) composite? False Let o(j) = 31j2 - 5. Let u(x) = x3 + 2x2 + 2. Let m be u(-2). Is o(m) a composite number? True Let s(d) = d3 + d*2 + 1. Let y(w) = -78w3 + w2 - 2w - 3. Let r(g) = s(g) + y(g). Is r(-1) composite? False Let x(f) = 6702f + 9. Is x(1) composite? True Suppose -3m - 7o + 9o + 5837 = 0, 0 = -3m - o + 5852. Is m a composite number? False Suppose 99z - 30569 = 88z. Is z a composite number? True Let l = -758 + -771. Let b = 1212 - l. Is b a composite number? False Let d(x) = -7x + 2x*3 + 17x*2 - 3 - 3 - 19x*2. Is d(7) composite? True Let j(k) = 4k. Let y be j(12). Let v = 10 + y. Is v a prime number? False Suppose -38s + 166880 - 11574 = 0. Is s a prime number? False Suppose 756 + 497 = 7v. Let m = 288 - v. Is m a prime number? True Let w be -68/12-3. Let c(m) = m*3 - 8m*2 - 2m - 5. Is c(w) composite? False Suppose u - 28 = 239. Suppose -376 = -3q - 5t, -u = -2q - 3t - 16. Is q composite? False Let m(w) = -306w + 121. Is m(-7) a composite number? True Let s be ((-12)/6 + 0)(28 + 0). Let a = s + 177. Is a composite? True Suppose 5c - 16f = -14f + 74547, -3c = -f - 44728. Is c a composite number? True Suppose 2t = -4t + 60. Is (4975/t)/((-5)/(-10)) a prime number? False Suppose 6g = 2g + 5d + 69, 47 = 2g - 5d. Suppose 2f - g = -7. Suppose 0 = 4v - fv - 178. Is v composite? False Let q = 5499 - -1262. Is q composite? False Is (-47920)/12132/(-55) + 3 prime? True Let i(h) = 2669h + 136. Is i(3) prime? False Let i = 12282 - 7279. Is i a prime number? True Let n(k) = k*3 - 8k*2 - k + 8. Let s be n(8). Suppose -2a + 9 - 1 = s. Suppose -ay - 149 = -5y. Is y a composite number? False Suppose -2d = -d - 4g - 3755, -4d + 14978 = -2g. Is d composite? True Let w = -20 - -23. Suppose h - 232 = wx, -4h + 682 = -h + 5x. Suppose -4g = -1887 - h. Is g a prime number? False Let k(n) = 13n + n2 + 2 + 0n*2 + 6. Let y be k(-12). Is (-53)/y - 15/(-20) composite? True Let s(x) be the third derivative of 13x*4/24 - 7x*3/2 - 22x*2. Is s(20) a prime number? True Let j be 6/(-10) - (-307800)/(-125). Let y = 778 - j. Is y composite? True Let v = -11 - -9. Is 5/v(240/(-5) + 2) a prime number? False Suppose -23766 = 4n - 8n - 2y, 3n + y - 17822 = 0. Is n a composite number? False Suppose -11c - 21c + 358816 = 0. Is c composite? False Let c = -15 - -17. Suppose v = -3a + 166, 3v - cv + 119 = 2a. Is a a composite number? True Let z = 15 - 6. Let y = 13 - z. Suppose -q = -ym - 191, -5q + m + 1050 = -0q. Is q a composite number? False Let g(d) = 28d*3 + d - 1. Suppose 4h = -2l - 14, -3l + 2l - 3 = h. Let u be g(l). Is (u/(-6))/(3/(-9)) a composite number? True Let r be 2163/9 - (2 - 24/9). Let f = r + 66. Is f a composite number? False Suppose 0 = 4x - 12, 5m - 3x = 2 + 4. Suppose mu - 2 = 4. Is 141 - (-2u + 2) composite? True Let p(i) = 2i - 6i - 1 - 15i2 - i3 + 14i*2 - 4. Is p(-7) a composite number? False Suppose -14 = -b - 12, 5b = d - 3933. Is d a composite number? False Suppose 5f + 2u + 28805 = 0, 4f - 5u = -16912 - 6132. Let i = -3288 - f. Is i prime? True Suppose l - 30 = -5p + 6l, -2p - 16 = 5l. Suppose 4q - 2i - 459 = 3i, -pq + 228 = -4i. Suppose 452 + q = 4c. Is c a composite number? True Let q = -42 + 49. Let b(f) = 2f2 - 7f + 10. Is b(q) a composite number? False Suppose 3x - 796 - 2186 = 0. Let z = x - 557. Is z prime? False Let x(i) = 2i + 23. Let r be x(-11). Let j(t) be the first derivative of 21t4 + t3/3 - t2/2 + t + 2. Is j(r) prime? False Let d(p) = -13p + 31p + 40p - 5p. Let w(o) = 2596o. Let u(b) = -295d(b) + 6w(b). Is u(-1) composite? False Let i(l) = l*2 - 10l - 12. Let f be i(11). Is (f(2 - -50))/(-2) prime? False Let l(h) = 163h2 + h + 1. Let k(n) = -n2 - 8n + 23. Let c be k(-10). Is l(c) a prime number? True Let c(n) be the second derivative of -n3/3 + 7n*2/2 + 84n. Let z(p) = 7p + 1. Let f be z(-1). Is c(f) a prime number? True Let b = -60 + 85. Let d = 299 - b. Is d prime? False Let s(h) be the second derivative of h5/20 + 29h*4/12 + 14h*3/3 + 43h*2/2 - 27h. Is s(-28) a composite number? False Let j(r) = -45r + 13. Let i(q) = 46q - 14. Let a(z) = 4i(z) + 3j(z). Is a(4) a composite number? False Let c(t) be the second derivative of 4t - 2/3t*3 - 1/2t*2 + 0 + 1/12t*4. Is c(-12) prime? True Let j(r) = 4r - 3	{ "pile_set_name": "DM Mathematics" }
+ 618. Let u = z + -930. Let n = 2279/2 + u. What is the common denominator of n and 29/2? 2 Let w = 3 + -1. Let u be 2/(-10) - (-294)/(-30). Find the common denominator of (w/u)/(6/(-705)) and 151/18. 18 Let k = -1956 - -46913/24. What is the common denominator of 76/21 and k? 168 Let m = 7 + -5. Calculate the smallest common multiple of 2 and m. 2 Let i = -215/12 - 59/12. What is the common denominator of i and 1312/(-80)5/(-4)? 6 Let v = 36 + -9. What is the smallest common multiple of 27 and v? 27 Let g = -2/541 - 50305/2164. What is the common denominator of -68/3 and g? 12 What is the common denominator of 49/11 and (-4 - (-545)/30)(-12)/(-15)? 33 Let c = 54 - 36. Suppose -3w + c = -w. Calculate the smallest common multiple of 1 and w. 9 Suppose 0 = 46d - 44d - 66. Calculate the least common multiple of 12 and d. 132 Let x = 0 + 2. Suppose 42v = 45v - 21. What is the least common multiple of v and x? 14 Let k = -28 + 7. Let i = -3953/90 + 231/5. What is the common denominator of 7/k - (-434)/24 and i? 36 Suppose -o + q = -19 - 10, -3q = -o + 27. What is the common denominator of 264/o - (0 + -1) and 1 + 0 + 29/(-8)? 40 Let h(f) = f*2 - 6f + 6. Calculate the lowest common multiple of 4 and h(6). 12 Find the common denominator of (0 - 4) + (-763)/(-42) and 14/3. 6 Let p = -24123/91 + 1836/13. Let r be 10/(78/(-555)). Let q = r - p. Find the common denominator of -133/6 and q. 12 Let f be (175/147)/((-4)/(-24714)). Let b = f + -7348. What is the common denominator of -91/2 and b? 14 Calculate the common denominator of 3 + 1 - (-29)/15 and 22/21. 105 Suppose 3u + 1357 = 283. Let b = 952/3 + -1028/3. Find the common denominator of u/(-40) - (-3)/(-4) and b. 15 Let y be 22839(0 - 1/964). Let h = -14/241 + y. Calculate the common denominator of h and ((-297)/(-2))/(-4 - (-3 + -16)). 20 Let q = 2844 - 34211/12. Let j = -221/4 - -55. Find the common denominator of j and q. 12 What is the common denominator of ((-3)/(-4))/(24/752) and -31/11? 22 Let u = -3 - 9. Calculate the common denominator of (-131)/u - (-3 + 2) and 83/14. 84 Let k = -19 + 23. Calculate the least common multiple of 13 and 1/(((-1)/k)/(-1)). 52 Calculate the common denominator of -89/6 and (-430)/96 + (-3 - (-76)/24). 48 Let p = -237 + 1670/7. Calculate the common denominator of -113/18 and p. 126 Suppose -18657 = -2i + 19003. Let j = i + -452041/24. What is the common denominator of 113/10 and j? 120 Let w(r) = r*2 + 4r + 1. Let c = -21 + 27. What is the lowest common multiple of w(-4) and c? 6 Let g = 586685/266 - 27956/19. Let r = 742 - g. Let h = 567 - 1113/2. What is the common denominator of h and r? 14 What is the lowest common multiple of 4 and 37 - (27/(-36) - 1/4)? 76 Let u = -7 - -6. Calculate the lowest common multiple of (-3)/4-28 and (-18)/(-3)u-1. 12 Let v(w) = 21w3 - w2 + w - 1. What is the common denominator of -50/3 and v(1)? 3 Let g(q) be the first derivative of q2/2 + 3q - 6. What is the smallest common multiple of g(3) and 18? 18 Let u = 7327 - 58529/8. Let c = 5220 + -2887. Let g = c - 46687/20. What is the common denominator of g and u? 40 Suppose -5o - 28 = -y, 6y - 4y = -o + 56. Let z = -12 + y. Calculate the lowest common multiple of 54 and z. 432 Suppose 5w + 8 = -12. Calculate the lowest common multiple of 2 and 4/w + 0 - -9. 8 Let u = -32 + 48. Suppose -g = -3i + 41 + 7, 5g = i - 170. Let x = 55 + g. Calculate the least common multiple of u and x. 176 Let x(r) = r - 4. Let n be x(7). Suppose -nk - w = -11, -3k - 4 = 2w - 4w. Suppose kp = -2p + 40. Calculate the least common multiple of p and 8. 40 Suppose 6 = -2h - 4i, 12 = -4h + 4i - 0i. Suppose 0 = -5s - 2z + 62 - 4, -2s = 4z - 36. What is the least common multiple of s and (-2 - (0 + h))/1? 10 Suppose -5 = -2x - 3x. Let l(a) = 14a. Let j be l(x). Find the common denominator of -51/4 and 18/(-14)j/40. 20 Let j = 14 - 3. Let l(c) = c3 - 6c*2 + 7c - 5. Let p(s) = s*2 - 8s - 4. Let q be p(9). Calculate the least common multiple of l(q) and j. 55 Suppose 0 = 4l - l + 3b - 33, -2b - 58 = -3l. What is the lowest common multiple of 2 and l? 16 Let q = -9 - -95. Suppose -4m + 2j + 78 = 0, -3m + 0m = 4j - q. Suppose -2 = 5u - m. What is the least common multiple of u and 7? 28 Find the common denominator of 1/2(-79)/(-2) and -83/28. 28 Let h = -1/4 - 57/4. What is the common denominator of -3 - 74/3(-6)/26 and h? 26 Suppose -131 = -5y + 4u - 33, 78 = 3y + 4u. Suppose -2w + 26 + y = 0. Find the common denominator of -49/22 and 1/1 + (-146)/w. 132 Let d = -10 + 17. Calculate the smallest common multiple of d and (-12)/(-2) + 8/(-8). 35 Suppose -4z = a + 4a - 175, 0 = 5z - 2a - 194. Let l be 91144/(-292)(-1)/z. Let v = l + -1/292. Find the common denominator of v and 15/4. 20 Let m be 61251/122526 + 2/(-4). Let w = 823651/40842 + m. Let o = 7393 - 103595/14. Calculate the common denominator of o and w. 42 Suppose -u + 20 + 0 = 0. Let q(m) = m*2 + 2. Calculate the smallest common multiple of q(-4) and u. 180 Suppose -4o + 6 = -o. Let i(v) = v2 + v + 2. Let u(h) = -h3 - 7h2 + 8h. Let y be u(-8). Calculate the lowest common multiple of i(y) and o. 2 Let i be (-12)/(-4) + 0 - 5. Find the common denominator of i/2 - (-194)/12 and 54/88 + 1/(-4). 66 Suppose 6m - 8 = 2z + m, 3m - 7 = -z. Calculate the smallest common multiple of z and 4. 4 Let a = -39 + 57. Calculate the smallest common multiple of a and 46. 414 Let z(v) = v3 - v2 + 1. Let c be z(0). What is the common denominator of 157/362 - c and -9/14? 126 Let n = 2143/2 + -1051. What is the common denominator of ((-2)/(-6))/(3/183) and n? 6 Let z = 600 + -1239/2. Find the common denominator of z and ((-36)/(-20))/((-12)/(-75)). 4 Let z be (-2)/(-10)9615/(-18). Let b = z - -338/3. What is the common denominator of (-11)/(-33) + 23/(-6) and b? 6 Suppose -2i = -3i + 30. Suppose 6f = f + i. Calculate the lowest common multiple of f and 6. 6 Let q = 10 + -5. What is the smallest common multiple of q + 0/((-4)/2) and 9? 45 Let z(i) = -20i - 2. Calculate the least common multiple of z(-1) and 58. 522 Let r = 78 - 56. Calculate the lowest common multiple of r and 22. 22 Suppose -c = c - 32. What is the smallest common multiple of (-25)/20(-7 + -1) and c? 80 Let u(p) = -4p3 - p2 - p. Let k be u(-1). Suppose -kz + 25 - 5 = 0. What is the lowest common multiple of 1 and z? 5 Let i = 2813/990 + -38/165. Let z = -51/20 - -1/20. What is the common denominator of i and z? 18 Suppose o - 3 = -0o. Suppose -22 = -d - 0d. Calculate the least common multiple of -2 - (-3)/(o/22) and d. 220 Let l(u) = -u*3 + 4u*2 + 5u + 3. Let a be l(5). Suppose 0 = -ax - 2 - 4. Find the common denominator of 6/4x/(-6) and 61/14. 14 Let w = -3431/1220 + 93/122. What is the common denominator of (5/18)/((-3)/(-117)) and w? 60 Let q(y) = -y - 8. Let c be q(-7). Calculate the least common multiple of 4 and (18/10)/(c/(-5)). 36 Let p = 23/36 - 19/4. Find the common denominator of 83/22 and p. 198 Suppose 0 = -g + 6g - 2w, 0 = -5g + 4w. Suppose 2a - 26 + 8 = g. What is the smallest common multiple of a and 6? 18 Let k = 7 + 35. Calculate the least common multiple of k and 10. 210 Suppose z - 3z - 5l = -12, 0 = 2l. Calculate the least common multiple of (-2)/(-2)(0 - -18) and z. 18 Let w be (-2)/2 + 135718/(-472). Let s = -1153/4 - w. Let k = s - 2353/590. What is the common denominator of k and -55/14? 70 Suppose 0v + 2v - 64 = -4s, s + 5v - 25 = 0. Calculate the lowest common multiple of s/2 + 1/2 and 1 + 233/6. 24 Calculate the common denominator of ((-1)/(-1))/((-3)/13) and 29/9. 9 Let g(t) = t*3 + 10t*2 + 9t + 10. Calculate the least common multiple of g(-9) and 8. 40 Let f = 2/17 - 91/51. Calculate the common denominator of f and 20/9. 9 Find the common denominator of -14/25 and (-9)/151119/77. 275 Let m = -16 + 21. Calculate the least common multiple of 3 + -1 + -1 - -7 and m. 40 Let s(a) = -4a + 5. Let u be s(2). Let b = u - -14. Calculate the lowest common multiple of b and 8. 88 Suppose 0 = -z - 0z - 1. Calculate the common denominator of 35/3 and z171/11. 33 Calculate the common denominator of 43/9 and ((-21)/(-13) + -1)15/4. 117 Suppose 2d - 31	{ "pile_set_name": "DM Mathematics" }
6 = 0. Give f(p). 136 Let k(n) = 56n + 235. Let d(h) = -13h - 60. Let m(q) = -9d(q) - 2k(q). What is m(-12)? 10 Let k(p) be the third derivative of -p6/120 + p5/10 - p4/24 - p3/3 + 76p2 + p + 13. Let g be 7 - (-2)/(4/(-2)). What is k(g)? -8 Let u = 1 - 2. Suppose -3a + 249 = 6m - 3m, 2a + 5m = 154. Let r(i) = -a + 5i - 93 - 92 + 361 - 88. Calculate r(u). -4 Let o(v) be the third derivative of -v6/60 - v5/10 + v4/3 - 2v3/3 + v2 - 40v + 1. Determine o(-4). -4 Let l(g) = -5g*3 + 4g*2 + 6g - 15. Let n(s) = -49s3 + 39s*2 + 59s - 148. Let r(b) = 59l(b) - 6n(b). Let t = 5 + -2. What is r(t)? -6 Let x(b) = -2b2 + 90b + 498. Let u be x(50). Let g(a) = 4a2 + a. What is g(u)? 14 Suppose 3k - w - 4 - 2 = 0, 2k = -w + 4. Suppose 0 = -4r - 5 - 7, km + r = 5. Let d(h) = -18h*3 + h + 846h*2 - 844h*2 - mh*3. Determine d(-1). 23 Let r be 60/40(-44)/(-6). Suppose -15c - 156 = -rc. Let k = c - -34. Let p(w) = w*3 + 4w*2 - 2w - 1. Calculate p(k). -16 Let j(h) = 34h2 - 2414h - 5. Let t be j(71). Let c(m) = -m*2 - 13m - 39. Determine c(t). 1 Let n(i) = -i*3 + 7i*2 - 9i - 1. Let u be n(3). Suppose 2j + 24 - u = 0. Let d(o) = -3o - 6o - o2 + 5 + o. Give d(j). 5 Let b(y) = -2y*2 - 12y - 6. Let p = 406 - 396. Suppose -5m + p = n, 7m - 4m - 29 = 4n. Determine b(n). 4 Let d(m) = m*3 + 0m*2 + 2m - 81m2 + 41m*2 + 123 + 41m*2. Determine d(0). 123 Let y(h) = -17h + 4 + 17h + h2 + 0h*2. Let a be (6/(-4))/(-10 + (-332)/(-32)). Determine y(a). 20 Let b(u) be the first derivative of -16 + 5/2u*2 - 4u. Give b(9). 41 Let x(f) = f*3 - 8f*2 - 15f - 19. Suppose 19 = 7y - 51. What is x(y)? 31 Let m be ((2 + -1)3)/1. Let z(o) = 2o2 - 1637o + 1. Let u(x) = x*2 - 728x. Let i(g) = 9u(g) - 4z(g). What is i(m)? -7 Let f be (-5 + 56/(-64)-4)(7 - 5). Let q(j) = -j*3 - 4j*2 - 8j - 4. Calculate q(f). 11 Suppose 17t = 12t + 25. Let m(n) = 5n2 - 2n - tn2 - 4n*2 + 2 + 3n*2. Suppose -10 = -x - 4x. Calculate m(x). -6 Let c(t) be the first derivative of t7/840 + t6/60 + t*4/4 + 2t*3/3 + 6t - 87. Let n(b) be the third derivative of c(b). Give n(-6). 6 Let r = -4289 + 4289. Let w(v) = -10v. What is w(r)? 0 Let o(l) = -l3 - 8l*2 - 8l - 6. Suppose -32n - 35 + 860 = -307n. Calculate o(n). -27 Let h(c) be the first derivative of -c6/180 + c5/20 - c*4/24 + 16c3 + 86. Let s(i) be the third derivative of h(i). What is s(4)? -9 Let q(n) = n3 + 8n2 - 6n - 48. Let x be q(-8). Let d(k) be the third derivative of -1/3k3 + 0 - 1/15k*5 + xk + 26k2 - 1/6k4. Calculate d(-2). -10 Let j(c) be the third derivative of -c5/30 - c4/6 + c3/6 + 3c2. Let t be (156/(-78))/(4/6). Give j(t). -5 Let c(p) = -p3 + 63p*2 + 341p - 44. Let o be c(68). Let m(a) = -a*2 + 24a - 3. What is m(o)? -3 Let m(f) = 3f2 + 6f + 4. Let v be m(-3). Let j(z) = 638 - 3z - 640 + vz. Give j(3). 28 Let x(o) = o - 9. Suppose -g + 5 = -3w + 1, -4g = -2w - 16. Let t be w/((-7)/213). Calculate x(t). -9 Let z = -16393 + 16386. Let r(i) = -i*3 - 7i*2 - 4i - 12. Determine r(z). 16 Suppose 605 = 7j + 598. Let g be ((-6)/18)/j-9. Let x(u) = 10u - 6. What is x(g)? 24 Let v = 4815 + -4821. Let b(a) = 5a - 21. What is b(v)? -51 Let q(a) = -15a2 + 9a*2 - 25a - 15 + a*3 + 29a*2 - 18. Give q(-24). -9 Suppose -2z + 7 = -4x - 15, 0 = -2x + 3z - 9. Let m(j) = -2j2 + 63. Calculate m(x). -9 Let y(d) = d2 - 36906d + 5 + 0d2 - d3 + 36899d. Give y(2). -13 Let m = -383878 + 383880. Let h(b) be the second derivative of -1/12b*4 + b + 1/2b*2 + 0 + 1/6b*3. What is h(m)? -1 Let v be (-2)/((-12)/(-9)4/24). Let n be (8/(-12))/((-21)/v - 2). Let t(m) = -76 + 37 - 2m + 2m*2 + 40 - 4m*2. What is t(n)? -3 Let t(u) = 12u + 28. Let m be -5(5/(-10)4 + 1). Let o(s) = -4s - 9. Let a(l) = mt(l) + 16o(l). Give a(-3). 8 Suppose -a + 2t + 75 - 76 = 0, 5t + 10 = 0. Let m(b) = 0 + 2 + 2b + 2. Determine m(a). -6 Let m(s) = 2420s + 2263s + 209 - 4726s. What is m(5)? -6 Let j(m) = 73m - 428. Suppose 5d = -3x + 54, -17d + 18d = 4x - 26. Determine j(d). 10 Suppose 5 = -2h - 3. Let p(f) = -5f + 47. Let d be p(8). Let b(x) = -4 - dx - 7x2 + 13x*2 - 8x*2. Give b(h). -8 Let p(h) = -14h - 20h - 21h + 16h - 8h*2 + 2 + 38h. What is p(1)? -7 Suppose -3t - 2k = -2460, -4t - 4k + 3275 = -3k. Let l = t - 822. Let u(j) = -4j - 7. What is u(l)? 9 Let c(z) = -439z - 433. Let h be c(-1). Let l(q) = q2 - 6q + 9. Let o(m) = -m*2 + 6m - 10. Let g(k) = -3l(k) - 2o(k). Give g(h). -7 Let u(q) = 7q3 - q2 - 9q - 14. Let i be u(-3). Let h = i + 178. Let k(z) = -z*3 - 8z*2 - 10z + 3. Give k(h). 24 Let r(d) be the third derivative of 47d5/60 + 5d4/24 - d3/2 + 3d2 - 2d + 1382. What is r(1)? 49 Let s be (-9 + -4)(2 - 3). Let z(c) = -c - 3. Let y be z(5). Let g = s + y. Let j(t) = 3t - 5. Determine j(g). 10 Let a(n) be the third derivative of 15n2 + 1/60n*5 + 0 - 5/24n*4 + 2n - n3. Determine a(6). 0 Let r(z) be the third derivative of -z6/5 - z5/30 + z3/6 - 3z2 + 212z. Calculate r(-1). 23 Suppose 0 = 3r - 9, 0v = -v + 2r - 3. Suppose -4b - vn = -b + 9, -2b + 24 = -4n. Let j(q) = 165q - q*b + 0q*2 - 173q - 4. Determine j(-8). -4 Let h be -2 + (-7)/28-36. Let r(b) = -b + 12. Give r(h). 5 Suppose -5j = l - 9, 20j + 13 = 24j - 5l. Let q(u) = 7u + 72u2 - 7 - 144u*j + 71u*2. Calculate q(5). 3 Let c(t) be the first derivative of -4t*2 + 71t - 3062. What is c(6)? 23 Let i(y) be the third derivative of -y*5/30 + 7y*4/24 + 13y3/6 + y2 + 2y + 337. Calculate i(5). -2 Let y(f) = 169f - 209. Let t be y(6). Let h(q) = 804 - 7q - 40q - t. Calculate h(-1). 46 Let x(d) = -d*3 + 17d*2 + 37d + 27. Let z = 641 - 622. What is x(z)? 8 Let q = 121 + -224. Let r = q - -103. Let h(b) = -b + 3. Calculate h(r). 3 Suppose 3d - 5r + 7 = -3, 0 = -3d + 2r - 4. Let u = 144 + -107. Let y(z) = -z - 38z2 + uz2 - 5 - 4 + 4. Give y(d). -5 Let s(y) = y2 + y - 1. Let i = 1 - 0. Let p be s(i). Let c(z) be the first derivative of -8z2 - 838. What is c(p)? -16 Let b(x) = x3 - 111x + 341x - 115x + 2 - 113x. Let c = 3 + -2. Let l(h) = h2 - 1. Let m(v) = cb(v) + 4l(v). Calculate m(-3). 1 Let m(p) = -p3 + 5p*2. Let s(q) = -5q*3 + 36q*2 + 4q - 2. Let w(c) = -6m(c) + s(c). Let z = -8 + 10. Suppose -zo - 5 = -o. Give w(o). 3 Let n(t) = 2t2 + 2t. Suppose 86q + 109 = 23. Calculate n(q). 0 Let p be 6/(-12)(-15 - -3). Let n(t) = 8t - 9. Let a(u) = 3u - 3. Suppose 0 = 6r + 17 - 41. Let l(q) = rn(q) - 11a(q). What is l(p)? -9 Let h(m) = -8m - 60. Let x(v) = -3v - 27. Let q(o) = -2h(o) + 5x(o). Calculate q(8). -7 Let t = -2 + 4. Let b(x) = 10x - 12x + x2 + 12x + 5 - tx. Determine b(-7). -2 Let y(a) be the third derivative of a5/30 - a4/6 - 7a*3/6 + 2a*2 - 111. Calculate y(3). -1 Let s = 3844 - 3842. Let p(h) = 3h*2 + 5h - 13. Determine p(s). 9 Let z(f) = 271f + 2709. Let m be z(-10). Let w(u) be the first derivative of 19u3/3 - u2/2 - u - 1. Give w(m). 19 Let j(h) = 4h + 77. Let z = -3508 + 3485. What is j(z)? -15 Let d(s) = s2 + 5s - 3. Suppose -18 = -3o - 18. Let f(n) = -n3 - n2 - 3n + 60. Let m be f(o). Suppose -4x + 48 = m. Determine d(x). -9 Let b(k) be the second derivative of -k5/20 + k3/2 + 2k*2 + 2k + 240. Let z = 1 - 4. Give b(z). 22 Let w(b) = 12 - b + 2b2 + 3b - 4b2 - 13. Let h be (-400)/(-180) + (8/(-18))/2. Calculate w(h). -5 Let p(k) = -k3 - 3k*2 + k + 1. Let t(i) = 2i*2 - 4i + 1. Let v be t(3). Let w(d) = 2d - 4d - 25 - 6d + vd. Let s be w(-22). Calculate p(s). -2 Let d = 1986 + -1986. Let i(w) be the first derivative of -w7/840 - w6/360 + 5w4/24 - w3 - 5. Let v(j) be the third derivative of i(j). What is v(d)? 5 Let b(i) = -6i - 7. Let h(q) = -5q + 7. Let t(g) = 2g. Let s(r) = -h(r) - 4t(r). Let a(v) = 2b(v) - 3s(v). Calculate a(-6). 25 Let i(p) = -4p*2 + 9p*2 + 259738 + 2p - 259735. Let u be (-2)/11 - (-48)/22. Let t(h) = 26h2 + 10h + 16. Let z(a) = ut(a) - 11i(a). Give z(-2). -9 Let d(y) be the second derivative of y6/120 - y5/60 - y**4	{ "pile_set_name": "DM Mathematics" }
for k. -4 Let l = -6 + 16. Suppose -25 = -5d - l. Solve 2g - 6 + 0 = -2m, 5g - 15 = -dm for m. 0 Let d = 6 - 3. Suppose 2y = dl - 6l - 10, -4l = 3y + 15. Solve 5t - 2q = 17, l = 2t - t - 3q + 7 for t. 5 Suppose -11z = -6z + 60. Let p be 9/z - (-92)/16. Solve 3s = -2c + 9, -2c - ps + 15 = 2c for c. 0 Let s be 4/(-6) - (-34)/6. Suppose -sm + 6 - 1 = -z, -4z = -4m - 12. Solve -4w - w = -l + 5, -mw = -2l + 2 for w. -1 Let f be 0 + 3/(-9)-3. Let y be -2 + f/((-1)/(-4)). Solve -1 = -3z - yx + 18, -5z + 29 = 2x for z. 5 Let g = 83 - 80. Solve 5u = -4h + gu - 2, -u - 3 = 3h for h. -2 Let j(n) = -n*3 + 5n*2 - 3n + 4. Let s be j(4). Suppose -3w = -sw. Let p = 2 + w. Solve -pt - 4r = -2r + 12, 2 = -3t + 5r for t. -4 Suppose -2f + 6 = 5t, -3t = 5f + 2t - 15. Let p(h) = h - 5. Let x be p(7). Solve -2o - 14 = -xv, 5o - 2o - 3 = -fv for v. 4 Suppose 0 = o + 2o. Suppose 26 + 8 = 5j - k, 4j - 4k - 24 = o. Solve -3s = -4x - j + 3, -12 = 2s + x for s. -4 Let m be (-3 + -1 + 24)/1. Solve -4s - 4p = -m, 4s - 20 + 0 = 2p for s. 5 Let m be 6 - 17/6 - 2/12. Solve 4a + mz = -z, 0 = -2z + 6 for a. -3 Suppose -z - 135 = 4z. Let s = -24 - z. Solve x + 10 = -sf, 9 = -3x + f - 1 for x. -4 Suppose 5p - 20 = -6x + x, 0 = 5x - p - 26. Solve xf - 20 = -t, -t = 2f - 5 - 0 for t. -5 Let z(i) = -i2 + 13i + 4. Let q be z(13). Solve x + 5d + 2 + 15 = 0, 0 = 3x + qd + 18 for x. -2 Let l be -23(-1)/3. Suppose -y = ly - 6. Suppose 38 = 3m + y. Solve -2z - m = 2j, -2 = 3j - 4z - 19 for j. -1 Suppose -4r = 4k - 3k - 17, -30 = -5r - 3k. Solve ra - 21 = -0a - 5h, 3a = -4h + 18 for a. 2 Let j be (-18)/(-4) + 5/(-10). Solve 3b - 12 = jg, -g + 7b - 3 = 2b for g. -3 Suppose g = -0g + 2. Suppose -2 = -gd + 2s, -s + 1 = 5d - 2s. Suppose -5v + 5c = -4 - 21, -c - 5 = d. Solve -1 = 3z - j, vz + 8 = -2z - 3j for z. -1 Suppose 3s + 13 = -g, -4g - 4s = 14 - 2. Let q be 4 + (-1 - g - -1). Solve -1 = -o - 2x, 2o - x - 16 = qx for o. 5 Suppose 5v = 4v + 29. Solve 3d = 5u - v, 3u - 6u + 15 = -d for u. 4 Let c be 19 + -16 - (0 - -1). Solve -4 = 4b - 3q - 2, 0 = -cb + 4q - 6 for b. 1 Let z be (-2)/6 - (-4)/(-6). Let n = z + 1. Suppose -3q + t + 11 = -n, 2t = 3q - 10. Solve 0 = 2m - q, 0 = 4f - m + 2 for f. 0 Let v be (-4 + 27/6)0. Solve -2m - m + 3o + 9 = 0, o + 4 = v for m. -1 Suppose 0 = -2u - 2a + 18, 3a + 8 = -7. Solve -3t - 5r = -0r + 16, u = -5t - 2r for t. -2 Suppose -j = 4m - 20, 4 = -4m + 13j - 8j. Solve -d + 3w + m = 2, 2d + 5 = -3w for d. -1 Let h(s) = 4s - 5. Let k be h(2). Solve 0 = ki - 2d + 2 - 0, -4i - d = 10 for i. -2 Suppose 2t + 2t - 12 = 0. Suppose 3z = 3v + t, -5v + 40 = 4z - 0z. Solve 5q - 6a - 15 = -a, -za = q + 21 for q. -1 Let k be (-1)/2 + 2/4. Let s(h) = 3 - 5 + h + 2 + 3. Let j be s(k). Solve 0c + 2c + t - 3 = 0, 2t + j = -c for c. 3 Suppose -j - 4 = 1. Let k be (-6)/(j/(30/9)). Let c(z) = 5z2 + 2z + 1. Let t be c(-1). Solve 0 = 4d + d, t = kp - 5d for p. 1 Suppose -2g - 2 = -6. Suppose -gs - 2s + 8 = 0. Suppose 25 = -5h + 65. Solve -q - 3t - h = 0, -5 = 2q - q + st for q. 1 Let x(k) = -k*2 + 9k - 5. Let s be x(8). Suppose -4j - 20 = -4w, -2 = -sw - 5j - 27. Solve -2f = -0z - 2z + 4, -z + 3 = w for f. 1 Suppose 0 = -2v + 11 - 3. Suppose 2u = -10, 0d + vu = d - 22. Solve -2o - dl - 18 = 2o, l = 2o - 1 for o. -2 Let g(v) = -11v*3 - v + 1. Let f be g(1). Let j = -6 - 9. Let y = f - j. Solve 0z + yz + u + 18 = 0, -5z = 3u + 19 for z. -5 Suppose 3o + 5f = 32, o = -5f + 24 - 0. Suppose o - 10 = -3m. Solve -5k = 5s + 50, -mk + 15 = -0k - 5s for k. -5 Suppose -2n + 6 = -n. Let u be (11 - 9)n/4. Solve 3y = -4b + 18, -uy = -5b - 0 + 9 for y. 2 Let m = 2 - 13. Let x = -11 - m. Solve xw - 5w + 10 = -3a, -6 = 2a - 4w for a. -5 Suppose 6n = 2n + 8. Suppose d + n = 0, -4d + 12 = -k + 2k. Solve 3c = 3i + 18, -3i - k = 2i + 5c for i. -5 Suppose -10u = -12u + 130. Let m be (-4)/10 + 546/u. Solve -s - 3z = m, -3s + 9 = 5z + 29 for s. -5 Let f be 1 + -1 + 2 + 0. Let b be ((-4)/(-3))/(f/6). Let h be ((-12)/3)/4 - -4. Solve -y + 8 = bj - h, 4j = 3y - 1 for j. 2 Let p be 5/14/(-2). Let d be ((-36)/(-10))/((-2)/p). Solve -3o - 2y + 8 = 0, 0 = 3o - 4y + d - 2 for o. 0 Let h(o) = o2. Let g = 11 - 5. Let l = g + -4. Let k be h(l). Solve kx = 5f + 17, -x + 16 = 4x - f for x. 3 Suppose 3o + 1 = 2o. Let t = 2 + o. Let m be (t - (-12)/(-3)) + 3. Solve u + 4v = m, -2u + 2v = -v + 11 for u. -4 Suppose 2h - 28 = -5r, 2r - h = 3 + 1. Solve -n = -a + 3, 0n + 4 = -ra - 4n for a. 1 Let m = -2 - -9. Let h be -2 - 7(-2 + 1). Let g = m - h. Solve s + 2s + 16 = a, 0 = gs - 4a + 14 for s. -5 Let x = -1 + 2. Let h(q) = 5q*2. Let l be h(x). Solve -3r - r + 5z = 0, -5r + 5z - l = 0 for r. -5 Let p(y) = y2 - 4. Let s be p(-3). Let m be 25 + (1 + 0 - -2). Let i be 188/m - (-2)/7. Solve 5 = 5v + 3z - i, sz = -3v + 20 for v. 0 Let c be (-12)/42 - (-4)/14. Solve c = 2n + 3g - 7, -2n + g = -2 + 7 for n. -1 Suppose j - 2j = -4. Let v = -1 - 2. Let h be (-3 - v) + 3 - -2. Solve -hd = -ja - 12, a + 6 = -a for d. 0 Let z = 38 + 82. Suppose l + 4l - z = 0. Suppose -2f + l + 6 = 0. Solve -2x = -6, 5x - 15 = -3h + f for h. 5 Suppose -1 = 5q + 4h + 4, -q - 1 = -3h. Let n be 1/(1/2)q. Let l be (n/3)/((-4)/18). Solve -3y = -a - 2y - 1, -ly = 12 for a. -5 Let j = 29 - 19. Solve -2u - 4p = -3p - j, 4u + 5p - 20 = 0 for u. 5 Suppose 2i - 20 = 2h, i - 5h = -2i + 40. Suppose 0 = 2x + 4u + 16, -11 = 2x - 0x + 3u. Solve -xt - 5d = -7 - 9, t - 13 = -id for t. 3 Let n(l) = l*2 - 11l - 7. Let a be n(12). Solve 4m = -ar + 4, 0m - r - 8 = 3m for m. -4 Suppose -y - 4y = 5y. Solve 2u + 3u - 5j + 35 = y, -u - j - 1 = 0 for u. -4 Suppose 3u + 2j = -3j, 4j = -12. Solve -3r - 5c = -2c - 18, uc = 20 for r. 2 Suppose -4k + 5 = 45. Let r(c) = -c - 2 + 6c + 2c - 10c. Let x be r(k). Solve -g + 6g - x = -2i, 3g - 8 = i for i. 4 Let q be (-1 + -3)(-5 - -2). Solve -4 = -n, n = 3i + i + q for i. -2 Let v(n) = -3n + 1. Let q be v(-4). Let w = 31 + -28. Suppose -4c = 2d - wc - 7, -3d + 3c = 3. Solve j + 13 = ds, -5j = -5s + 58 - q for j. -5 Suppose -5q + 81 = -2q - m, 0 = 5q - 5m - 135. Solve 2t = -5d - 16, 5d + q = -t + 9 for d. -4 Let a = 16 - 10. Let j(r) = r*2 - 3r - 1. Let p be j(4). Suppose -py + 6 = -a. Solve yn - 1 = -2d - 3, n - d + 2 = 0 for n. -1 Suppose -27 = -3c + 2f, 5c - 45 = -0f - f. Let q be -2 + 1 + 2 - -1. Solve -5z = j + 13, 5z = qz - c for j. 2 Let i be (6/(-24) - (-39)/(-4))-1. Solve -4g + 3v - 15 = -0v, 0 = 4g + 2v - i for g. 0 Let p = 26 + -23. Solve 5 = -pl - 5x, 2l + 12 = -x + 4 for l. -5 Let g be 4/4 + 18 + 1. Suppose 2o - g = -0o. Solve -4j = m + o, -2j = 2m - 0 + 2 for j. -3 Let y be (-7 + 1 - -12)/((-4)/(-2)). Solve 3m = 4z + 20, 6z = 3m + yz - 18 for m. 4 Let n(d) = -17d - 2. Let z be n(-1). Suppose -zk - 15 = -20k. Solve -5h - k = -p + 15, -4 = h for p. -2 Let j be ((-14)/(-3))/(1/3). Suppose 0 = 3q + 4d - 14, -j = 3d - 2. Suppose -l = 5b - 4 + 16, -15 = -4l + b. Solve lg = 2o - q, -o = 3g + 6 - 2 for g. -2 Let h(f) = -f3 - 2f2 - 4. Let t(q) = -q2 - 9q - 3. Let i be t(-9). Let s be h(i). Solve j + s = g, -5 = g + 3j + j for g. 3 Suppose -2y + 2g - 4 = 0, 0 = 5y + 4g - 3g - 14. Solve 2q - 4z - y = -8, -4q + 14 = 5z for q. 1 Let y(b) = b2 - b - 3. Let q(n) = 1. Let r(l) = 6q(l) + y(l). Let m be r(0). Solve 5h = 10, -5g - mh = -0h - 11 for g. 1 Let p(d) = d*3 - 3d*2 + d. Let m be p(3). Let k = 5 + -5. Suppose ko = o - 11. Solve -j - o = 5c, -4j + 10 = mc - c for c. -3 Let m = 4 + 17. Suppose 5n - 17 = 3. Solve 8l - s = nl + m, -2s = -3l + 22 for l. 4 Suppose h + 0h = 0. Solve 4b - 2w - 14 = 0, -4b + hb + 13 = -3w for b. 4 Suppose 7n - 3n = 8. Solve d + 6 = -3l, -nl - 7 + 2 = d for d. -3 Suppose 0 = a - 19 - 1. Solve 6h - 4h - a = -4y, 0 = 5h - y - 6 for h. 2 Suppose 0 = 5q + 3y - 15, -3q = -6q - y + 13. Suppose q = -v + 1. Let j = -2 - v. Solve -h + j = -5s + h, 0 = s + 5h - 21 f	{ "pile_set_name": "DM Mathematics" }
+ 6q3 - q4 - bq. -q(q - 2)(q - 1)*2 Suppose -184u = 88u + 28u. Factor u + 1/4n2 - 1/4n. n(n - 1)/4 Suppose 4k - i + 108 = -0i, 0 = -2k - 5i - 32. Let j = -21 - k. Let 0b - 2/3b2 + 0 + 2/3b*j + 2/3b*4 - 2/3b*3 = 0. What is b? -1, 0, 1 Let m(w) = -16w*3 + 156w*2 - 20w + 20. Let s(g) = g*3 - 6g*2 + g - 1. Let v(f) = m(f) + 20s(f). Factor v(y). 4y2(y + 9) Factor -12d3 - 6 + 12d*4 + 2d*2 - 5d*2 + 3 + 12d - 6d2. 3(d - 1)(d + 1)(2d - 1)2 Let i(u) be the second derivative of u7/280 + u6/40 + 3u5/40 + u4/8 - 17u3/6 - 2u. Let b(k) be the second derivative of i(k). Factor b(x). 3(x + 1)3 Suppose 3s - 12 = -3x, 37x + 6s = 39x + 24. Suppose 3/5p + x - 3/5p*2 = 0. Calculate p. 0, 1 Factor -8/7a*3 - 2/7a*4 - 8/7a - 2/7 - 12/7a2. -2(a + 1)4/7 Let n(k) be the first derivative of k5/480 - 6k2 - 11. Let t(l) be the second derivative of n(l). Factor t(s). s2/8 Let g = -768571/21 + 36599. Solve 0 - 2/21r*4 - 2/21r*5 - gr*2 + 8/7r*3 - 32/21r = 0. -4, -1, 0, 2 Let m be ((-252)/(-924))/(4/22). Find k such that mk - 3/8k*2 - 3/2 = 0. 2 Let b(y) = 33y + 14. Let l be b(-2). Let g = 54 + l. Factor 1/4r5 + 0r + 1/2r3 + 0r*g + 0 - 3/4r4. r3(r - 2)(r - 1)/4 Let n be (-6)/(-8) + (-165)/252. Let z = n - -4/7. Factor -zc3 - 8/3c*2 - 4/3 - 10/3c. -2(c + 1)2(c + 2)/3 Factor 2/3f3 - 6f + 10/3 + 2f2. 2(f - 1)*2(f + 5)/3 Suppose -2h - 121u - 17 = -126u, 0 = -h - 4u + 24. Let -1/4lh + 3/2l*2 + 2l + 3/4 + 0l3 = 0. What is l? -1, 3 Suppose 0 + h + 6/7h*2 - 1/7h3 = 0. Calculate h. -1, 0, 7 Let r(m) be the third derivative of -m5/100 - m*4/20 + 7m*2 - 4. Let r(k) = 0. Calculate k. -2, 0 Let r(i) be the second derivative of 35/3i*3 + 245/2i*2 + 0 + 5/12i*4 + 30i. Find s, given that r(s) = 0. -7 Let q be (332/(-120))/((-2)/5). Let r(n) be the first derivative of 0n - 2 + 2/7nq + 1/14n*4 + 2/7n*3. Factor r(a). 2a(a + 1)(a + 2)/7 Let w(x) = -4x3 - x2 + x + 1. Let c be 0 - (-2)/(-6)3. Let v be w(c). Suppose 15yv - 21y*3 + 3y*2 + 3 + 6y - 6y2 = 0. What is y? -1, -1/2, 1 Let g = -7061 + 21236/3. Suppose -4/3v*2 + 0v - 28/3v3 + 0 - 20/3v*5 - gv4 = 0. What is v? -2, -2/5, -1/4, 0 Let m(z) be the first derivative of -z6/4 + 3z5/2 - 9z4/4 - z3 + 21z2/4 - 9z/2 + 56. Let m(g) = 0. Calculate g. -1, 1, 3 Let n(d) = 5d4 + 25d*3 + 12d*2 - 49d - 14. Let m(t) = -t*4 - 6t*3 - 3t*2 + 12t + 4. Let w(f) = -9m(f) - 2n(f). Suppose w(l) = 0. Calculate l. -1, 2, 4 Let a(b) be the first derivative of -b6/10 + b5/10 + b*4/12 + 5b - 8. Let p(n) be the first derivative of a(n). Factor p(m). -m*2(m - 1)(3m + 1) Let r(m) be the second derivative of 0 + 45m + 1/4m*3 + 3/8m*2 + 1/16m*4. Factor r(v). 3(v + 1)2/4 Let u(w) be the third derivative of -w6/180 + w*5/10 - 3w*4/4 + 2w*3/3 + 4w*2 + 4w. Let g(c) be the first derivative of u(c). Factor g(q). -2(q - 3)2 Let f(g) = 3g*3 + 132g*2 - 279g + 144. Let x(r) = -3r3 - 132r*2 + 277r - 142. Let h(u) = 2f(u) + 3x(u). Solve h(d) = 0. -46, 1 Solve -2/3z3 + 10/3z*2 + 0z + 0 = 0. 0, 5 Suppose -7o = -12o + 490. Let p = -96 + o. Determine c so that 1/3cp + 2/3c + 0 = 0. -2, 0 Let d = 6156/5 - 1224. Let 8/5 - ds2 - 28/5s = 0. What is s? -1, 2/9 Let b(a) = 3a3 + 24a*2 + 15a - 38. Let d(i) = 3i3 + 24i*2 + 15i - 39. Let z(l) = -3b(l) + 4d(l). Let z(f) = 0. What is f? -7, -2, 1 Factor -74f2 + 147f*2 - 35378 + 334f - 75f2 + 198f. -2(f - 133)2 Suppose 3f + 2 = -a + 6f, 3f = -a + 10. Let m(p) be the third derivative of 0 - 1/40p6 + 0p*a - 1/10p5 - p2 + 0p3 + 0p. Solve m(l) = 0 for l. -2, 0 Let b = 72 + -70. Let i be (b + 1)/18 + 34/84. Factor -2/7u2 - 6/7u - i. -2(u + 1)(u + 2)/7 Let m(h) = -5h4 + h3 + 24h*2 - 24h - 4. Let j(x) = -14x4 + 2x*3 + 72x*2 - 73x - 11. Let p(q) = -4j(q) + 11m(q). Let p(c) = 0. Calculate c. -7, 0, 2 Let c = 976 - 3899/4. What is w in -1 + 2w - cw*2 + 1/4w*3 = 0? 1, 2 Let a be (9/3)/((-15)/(-10)). Suppose aq*3 - q + 14q2 + q4 - 16q2 + 1 + 0 - q5 = 0. Calculate q. -1, 1 Let l(h) be the third derivative of -h6/840 + h5/70 - 5h*4/168 + 51h*2 + h. What is j in l(j) = 0? 0, 1, 5 Let h(r) = 3r*3 + 16r*2 + 9r - 4. Let w(p) = 3p3 + 15p*2 + 9p - 3. Let g(k) = 3h(k) - 4w(k). Factor g(u). -3u(u + 1)(u + 3) Let y be (-2)/10 + (-17)/(-64 + -21). Let z(b) be the second derivative of 2/9b*3 + 7/18b*4 + 0b*2 - 2/15b*5 + 5b + y. Factor z(i). -2i(i - 2)(4i + 1)/3 Let t be -1((-4)/(-6) - 18805/(-45)). Let g = t + 419. Factor -2/9p - 4/9p2 + gp*3 + 2/9p*4 + 2/9 - 2/9p*5. -2(p - 1)*3(p + 1)*2/9 Let f(o) = 3o*3 + 9o*2 + 9o + 15. Suppose 0p + 2p = 3w - 4, 4w + p = 9. Let m(v) = w + 1 - 4. Let d(b) = -f(b) - 12m(b). Factor d(h). -3(h + 1)*3 Let t = -14 - -13. Let p be 3/(t/(3/(-1))). Suppose 0b*3 - pb2 - b3 + 8b2 + 0b*2 = 0. What is b? -1, 0 Let l be (-5)/(175/10) - 15/(-28). Let p(m) be the first derivative of -6 + lm - 3/8m2 - 1/3m*3. Factor p(x). -(x + 1)(4x - 1)/4 Let o(u) be the third derivative of -1/900u*6 + 6u*2 + 1/300u*5 - 7/6u*3 + 1/30u*4 + 0 + 0u. Let i(w) be the first derivative of o(w). Factor i(a). -2(a - 2)(a + 1)/5 Let i(a) be the second derivative of 4489a4/36 + 134a*3/9 + 2a*2/3 - 108a. Determine v, given that i(v) = 0. -2/67 Let i(b) = b*3 - 6b*2 - 3b + 4. Let g be i(6). Let z = g + 19. Factor -zk4 + 3k4 - k4 + 5k2 + 4k*2 + 6k. -3k(k - 2)(k + 1)2 Let d be 4/(-2) + 2 + 0. Let r(g) be the second derivative of -1/100g*5 + 0g*3 - 5g + 0 + 1/60g4 + dg2. Factor r(t). -t2(t - 1)/5 Find x, given that -10/13x*2 + 0x + 0 + 10/13x4 + 2/13x*5 - 2/13x*3 = 0. -5, -1, 0, 1 Let l(u) be the third derivative of -19u*8/28 + 32u*7/15 + 2u*6/15 - 38u*5/5 + 53u*4/6 + 4u*3/3 - 18u*2 - 5u. Let l(j) = 0. What is j? -1, -2/57, 1 Factor 528/7j - 1440/7 - 58/7j*2 + 2/7j*3. 2(j - 12)*2(j - 5)/7 Let x be (8 + -2)2/6. Suppose 26 - x = 6n. Factor 5 - 5jn + 13j*3 - 3j*3 + 0j*4 - 10j + 0. -5(j - 1)3(j + 1) Let h(d) be the first derivative of d7/3780 + d6/810 - d5/540 - d4/54 - 19d3/3 + 14. Let z(n) be the third derivative of h(n). Factor z(s). 2(s - 1)(s + 1)(s + 2)/9 Let u(t) be the first derivative of t*5/30 - 5t*4/12 - 2t*3 - 31t*2/2 + 17. Let m(y) be the second derivative of u(y). Factor m(z). 2(z - 6)(z + 1) Let h(u) = 12 + 0 - u2 + 14u - 2u + 3. Let v be h(13). Factor 4m - 2m2 + 2m*2 + 2m*v + 2. 2(m + 1)*2 Factor 98o - 231681 + 231681 + 2o2. 2o(o + 49) Let o = 45883/1518 + -15/253. Let n = o + -30. Find b, given that 1/3b - n - 1/6b2 = 0. 1 Factor -2523/5l*2 - 12/5 - 348/5l. -3(29l + 2)*2/5 Let o(h) = 13h*3 + 144h*2 + 702h - 2035. Let q(u) = 4u3 + 48u*2 + 234u - 678. Let g(w) = 2o(w) - 7q(w). Find i, given that g(i) = 0. -13, 2 Let i = 17368/9 - 1928. Factor -ij + 10/9j*2 - 2/9j*3 + 8/9. -2(j - 2)*2(j - 1)/9 Let v(x) be the first derivative of x*6/14 - 9x*5/35 - 3x*4/28 + 11x*3/7 - 18x*2/7 + 12x/7 - 54. Determine r, given that v(r) = 0. -2, 1, 2 Let p(c) be the second derivative of -2/15c3 + c + 0c*2 + 1/60c*4 + 0. Let p(j) = 0. Calculate j. 0, 4 Suppose 3t + l - 17 = 0, -t - 4l - l - 13 = 0. Factor -4v*3 - 4v*4 + 2v*4 + 14v*3 + tv*4 - 5v*5. -5v*3(v - 2)(v + 1) Let -18b*4 - 5b*5 - 47b*4 - 56b*3 - 59b*3 - 46b*2 - 9b2 = 0. What is b? -11, -1, 0 Let z(y) be the second derivative of -y4/42 + y*2/7 + 4y - 1. Determine w, given that z(w) = 0. -1, 1 Let b be 36/15 - (-1 + (-6)/(-15)). Let k be 8 - (-4)/(-2) - b. Factor 0 - 2hk - 8h*4 + 4/3h*2 + 0h - 14/3h5. -2h*2(h + 1)*2(7h - 2)/3 Factor -169/2 + 51/2q2 - q3 - 156q. -(q - 13)2(2q + 1)/2 Suppose 13l = -240 + 58. Let k be (-12)/(-6 - 0) - (-8)/l. Suppose kp + 12/7p*2 - 8/7p*4 + 6/7p*5 - 16/7p*3 - 4/7 = 0. What is p? -1, 1/3, 1, 2 Let r(j) be the third derivative of 7j*6/40 - 5j*5/4 - 3j*4/2 - 31j**2 +	{ "pile_set_name": "DM Mathematics" }
is the remainder when 179 is divided by u? 57 Let x(k) = 9 + 3k - 13 + 2k*2 - 2k. Let o be x(-4). Suppose 3v + 2v - 56 = -3q, -3v + o = 5q. What is the remainder when 50 is divided by v? 11 Suppose -970 = -18s + 398. What is the remainder when 221 is divided by s? 69 Suppose 5n = -170 - 25. Let g = 64 - n. What is the remainder when g is divided by 26? 25 Let k = 78 - 37. Calculate the remainder when k is divided by 11 - (6 - (11 - 0) - -5). 8 Suppose y - 3v - 61 - 70 = 0, -3y + 4v + 378 = 0. Calculate the remainder when 243 is divided by y. 121 Suppose -6o + 10 = -o. Suppose -ol + 45 = 5k + 3l, 3 = -k + 5l. Suppose -y = 3y - 48. What is the remainder when y is divided by k? 5 Let b = 56 + -43. Suppose 8t + bt = 315. Suppose 0 = -4i + i + 222. Calculate the remainder when i is divided by t. 14 What is the remainder when ((19 - 23) + -316)/(2/(-6)) is divided by 37? 35 Let a = 14 + -14. Suppose -8 = -2b - 0b. Suppose -o - bk = -ao - 14, -101 = -4o - k. What is the remainder when 51 is divided by o? 25 Let p = 1324 + -281. What is the remainder when p is divided by 18? 17 Suppose 0 = 4s - 7d + 10d - 32, s - 4d - 27 = 0. Calculate the remainder when 163 is divided by s. 9 Suppose 2w + 3l - 40 = 0, -7w + 8w - 4l - 9 = 0. Calculate the remainder when 50 is divided by w. 16 Suppose -3n = -n - 34. What is the remainder when n is divided by (4 - (4 + -3 + 3)) + 4? 1 Suppose 5x - 173 = -68. Calculate the remainder when 142 is divided by x. 16 Suppose 3x + 2x - 200 = 0. Let q be (8/20)/(4/x). Calculate the remainder when 10/q(21 - -5) is divided by 17. 14 Let x = 1703 - 1637. What is the remainder when 143 is divided by x? 11 Suppose -16z + 28548 = -4z. What is the remainder when z is divided by 70? 69 Suppose 260 = 3z + r + 95, -4r = -12. Suppose 7 = 5x - 13. Suppose y + 5i = 1, xi = -8 - 0. What is the remainder when z is divided by y? 10 Let g(w) = -w3 + 50w*2 + 8w - 255. Calculate the remainder when 1009 is divided by g(50). 139 Let b = 31 - -26. Let f(g) = -6g - 18. Suppose -x = -3x - 16. Calculate the remainder when b is divided by f(x). 27 Suppose 0 = -2m + 7m - 145. Let k = 8 - -2. Calculate the remainder when m is divided by k. 9 Suppose -4r - 19 = 5. Let g = r - -10. Suppose -2a + 0a = -2i + 4, -a = i - g. What is the remainder when i is divided by 3? 0 Calculate the remainder when 713 is divided by (-17)/(15/(-9)(-3)/(-15)). 50 Suppose -118 = 2j - 3j. Calculate the remainder when j is divided by (-1612)/(-6) - -8. 38 Suppose -z + 454 = -3q + 415, 0 = -3z + 3q + 87. Let o(u) = 2u*2 - 5u - 4. What is the remainder when z is divided by o(4)? 0 Suppose -5s + 37 = 17. Suppose -4i + 93 = -63. Calculate the remainder when i is divided by s/2 - (10 - 22). 11 Let u = -19 + 12. Let b = u + 11. Suppose 3t - 23 - 43 = -k, bt - 341 = -5k. What is the remainder when k is divided by 18? 15 Let h be 6/(-21) + 46/14. Suppose 2w + 16 + 1 = l, hl - 59 = 4w. Let m = 23 - 14. What is the remainder when l is divided by m? 7 Suppose -j = -5 - 1. Suppose -j + 3 = u. What is the remainder when (-4102)/(-35) + u/15 is divided by 30? 27 Let n = -30 + 39. Let s(u) = u*2 - 8u - 6. Calculate the remainder when s(n) is divided by 1. 0 Let m = -79 - -229. What is the remainder when m is divided by 31? 26 Let l(y) = y*3 - 5y*2 + 1. Let g be l(5). Let v be ((-4)/(-8))/(g/10). Suppose vw - w = 108. Calculate the remainder when w is divided by 15. 12 Let d = -700 - 335. Let f be 1/2 + d/(-30). Suppose 0 = -4v - f + 175. Calculate the remainder when v is divided by 9. 8 Let g(y) = -y3 + 14y*2 + 19y - 6. Calculate the remainder when g(15) is divided by 14. 12 Let o(f) = -f + 9. Let z be o(4). Let l = -79 + 111. Suppose 0 = 2q - zt - 70, 5t + 2 - l = -2q. What is the remainder when q is divided by 13? 12 Calculate the remainder when 819/4 - ((-162)/(-24) + -7) is divided by 71. 63 Suppose -11s + 56 = -4s. What is the remainder when 41 is divided by s? 1 Let y(r) = -23r - 127. Calculate the remainder when 31 is divided by y(-6). 9 Let x(w) = -6w - 281. Calculate the remainder when 7 is divided by x(-47). 0 Let x(o) = o*2 + 50o + 146. What is the remainder when 9 is divided by x(-47)? 4 Let w be 6(-3 + 6 - 2). Suppose -wi + 137 = 53. Suppose 2b = -2b + 220. What is the remainder when b is divided by i? 13 Let w(x) be the second derivative of 0 - 1/12x4 - 5/2x*2 - 5x + 13/6x3. What is the remainder when w(11) is divided by 6? 5 Let s(l) = l + 7. Let h be s(-7). Suppose 5w - 2w - 57 = h. Calculate the remainder when 127 is divided by w. 13 Suppose 4y - 13 = -5c + 52, 64 = 4y + 4c. Let q = 35 + 7. Calculate the remainder when q is divided by y. 12 Suppose 28 = -6g + 13g. Suppose -gh = 2h - 162. Let d(x) = x3 - 3x - 1. Calculate the remainder when d(4) is divided by h. 24 Let v(i) = -2i2 + 6i - 13. Let u(r) = r*2 + 1. Let z(a) = 3u(a) + v(a). What is the remainder when 83 is divided by z(-9)? 15 Suppose 5x + l = -4 + 1, -l - 3 = -3x. Let u be 2 + x + 0/1. Suppose 8 = -0f - uf + 5y, 2f + y = 16. What is the remainder when 16 is divided by f? 4 Let a = 10 + -7. Suppose -405 = -6g + ag. Suppose 4n = -43 + g. Calculate the remainder when n is divided by 13. 10 Suppose 0 = -5j - n + 483, 0n = j - 2n - 101. Let d(v) = 2v2 - 27v + 6. What is the remainder when j is divided by d(14)? 17 Let c be (0 - -23)(-4)/(-4). Suppose 117 = -105p + 92p. Let m = c + p. What is the remainder when m is divided by 5? 4 Suppose -4s + 2w + 14 = 0, 2s - 17 = -4w + 3w. Suppose s = -f + 16. What is the remainder when 58 is divided by f? 8 Let z(r) = r*2 - 10r + 8. Calculate the remainder when 35 is divided by z(11). 16 Suppose 3a = 3m - 42, 0 = 3m - 4a - 9 - 30. What is the remainder when 45 is divided by m? 11 Suppose -658 = 3o - 10o. What is the remainder when o is divided by 12? 10 Let f(s) = s*3 - 7s*2 - 8s - 9. Let c be f(8). Let n = c + 36. Let u = 15 + -8. Calculate the remainder when n is divided by u. 6 Suppose -7p + 3p = -376. Let v(a) = -a*2 + 23a - 84. Calculate the remainder when p is divided by v(18). 4 Let a(u) = u*3 + 11u*2 + 24u + 4. What is the remainder when a(-5) is divided by (39 - 3)(-2)/(-4)? 16 Suppose 3x - 157 - 74 = 0. Suppose p - 13 = 5y, -5y = p + 3p - x. What is the remainder when 50 is divided by p? 14 Suppose 2r + 0r = -2t - 88, -5t - 172 = 4r. Let x = 56 + r. Calculate the remainder when 39 is divided by x. 7 Suppose 2b - 139 + 9 = -4k, -4k = -b - 145. Let r = 19 + -10. Calculate the remainder when k is divided by r. 8 Let h(x) = x2 + x + 7. Let r(u) = -u2 + 7u - 5. Calculate the remainder when h(3) is divided by r(4). 5 What is the remainder when 440 is divided by -6 + (4 - 4) - -27? 20 Suppose -30w + 31w = 87. Let d = 21 - 6. What is the remainder when w is divided by d? 12 Suppose 2t + 40 = -3t + 5x, -1 = 2t + x. What is the remainder when 86/5 - (-8 - t)/(-25) is divided by 5? 2 Suppose i + m = 0, -i = -5m + 2m - 4. Let d = -17 - -20. Calculate the remainder when d is divided by i. 0 Let w = 651 + -486. Calculate the remainder when w is divided by 14. 11 Let m = 86 - 26. Suppose 3b + m = 5b. Let l = 39 + -23. Calculate the remainder when b is divided by l. 14 Let u(s) = s*3 + 4s*2 - 3s - 2. Let n be u(-3). Calculate the remainder when 69 is divided by -1 + (-15)/(-12) + 300/n. 12 Suppose 4g + 4m = 384, 0 = -4g + 5m + 477 - 102. What is the remainder when g is divided by 8? 7 Let j(x) = -x*3 - 16x*2 + 18x + 8. Let o be j(-17). What is the remainder when (-5 - o)/(1/8) is divided by 18? 14 What is the remainder when 193 is divided by -5(1 + 219/(-15)) - 3? 63 Let g = 46 + -10. Let z = 56 - g. Let v = 10 - 3. What is the remainder when z is divided by v? 6 Suppose 2b - 44 = 66. Calculate the remainder when 157 is divided by b. 47 Let s be (65/55 - 1) + (-603)/(-11). Let i = s + 20. What is the remainder when i is divided by 41? 34 Let r = -81 - -131. What is the remainder when r is divided by 6? 2 Suppose -42 = 69i - 72i. Let j(b) = 40b3 + b2. Let u be j(1). Suppose s + u = 2s. Calculate the remainder when s is divided by i. 13 Let t(s) = -3s3 + 10s	{ "pile_set_name": "DM Mathematics" }
8h(d) + 4t(d). 2d + 2 Let t(j) = 7j - 1. Let h be -4 - (-7 - -10 - 0). Let n(w) = -2w - 1. Let g(x) = -4. Let c(u) = hn(u) + 2g(u). Calculate -3c(o) + 5t(o). -7o - 2 Let l(x) = -3x3 - 6x*2 + 6x + 8. Let w be (110/(-88))/((-4)/16) + 0. Let y(n) = -2n3 - 5n*2 + 5n + 7. Determine wl(u) - 6y(u). -3u3 - 2 Let x(d) = -3d*3 + 4d*2 - 5d + 4. Let a = 40 - 41. Let s(k) = -k3 + k2 - k + 1. Let y = 155 - 151. Give ax(g) + ys(g). -g*3 + g Let a(q) = 8q*3 - 14q*2 + 16q + 4. Let j(m) = m*3 - 5m*2 + 4m + 1. Let r(b) = a(b) - 3j(b). Let i(h) = h3 + h2 - h + 1. Give i(p) - r(p). -4p*3 - 5p Let i(s) be the third derivative of 5s4/12 - 5s*3/6 - 610s*2. Let p(g) = g - 1. What is i(w) - 4p(w)? 6w - 1 Let o(i) = 6 + 7 - 5 + 0 - 2i. Let a(m) = m*3 - 2m*2 + 5m - 4. Suppose 0 = -2u - 10 + 14. Let g be a(u). Let z(s) = -s + 7. Give gz(p) - 5o(p). 4p + 2 Let x = -52 - -48. Let f(b) = 5b2 - 5. Let j(l) = -4l*2 + 4. Let i(w) = xf(w) - 6j(w). Let z = -7 - -11. Let k(n) = 1. Calculate zk(s) + i(s). 4s2 Suppose 6 = 2u, 5o - 7u = -4u + 56. Suppose 0 = -oj - 14 + 53. Let c(n) = n + 6. Let z(x) = 2x + 17. Calculate jz(b) - 8c(b). -2b + 3 Let z(k) = 2k2 + 3k. Suppose 0 = -2n + 10n - 120. Let h be (12/(-15))/(n/((-300)/(-8))). Let v(c) = 8c2 + 12c + 1. Calculate hv(r) + 9z(r). 2r2 + 3r - 2 Let d(s) = -s3 + s2 - s. Let t(y) be the second derivative of 3y5/4 - y4/4 + y3/6 + y2 + 3y - 20. What is d(b) + t(b)? 14b3 - 2b2 + 2 Let o(a) = a2 + 2a. Let g(y) = -2y*2 - 5y. Suppose -3n - 2 = -d - 4n, d = 2n + 14. Let s = 874 - 861. Calculate dg(j) + so(j). j2 - 4j Let i(v) = 3v3 - 20v*2 - v + 17. Let c(u) = 4u*3 - 21u*2 - u + 23. Determine -2c(x) + 3i(x). x3 - 18x2 - x + 5 Let x(g) = g3 - 2g2 - 424g + 3. Let k(b) = -3b3 + 5b*2 + 1697b - 11. Determine -3k(p) - 11x(p). -2p3 + 7p*2 - 427p Let h(r) = 108r3 + 21r*2 - r - 9. Let d(o) = -27o*3 - 5o*2 + 2. Give 9d(q) + 2h(q). -27q*3 - 3q*2 - 2q Let m(i) = -6i - 6. Suppose 3l + 4v - 2462 = 0, 2v = 3l - 1144 - 1288. Let r be 95/15 - 1/3. Let o(g) = 819 - g - l + rg. Determine -4m(p) - 5o(p). -p - 1 Suppose 1386 = 5y + 4i, -3i - 675 = -3y + 135. Let j = y - 276. Let p(c) = 6c + 2. Let s(b) = -25b - 9. Determine js(o) - 9p(o). -4o Let b(n) be the first derivative of n2/2 + 9663. Let j(r) = r - 1. Calculate 7b(w) - 4j(w). 3w + 4 Suppose -u - 3g - 3 = 0, -4u = -69g + 65g + 28. Let l(k) = -52k - 6. Let d(t) = 17t + 2. Give ul(i) - 17d(i). 23i + 2 Let g(q) = -16q*3 + 5q*2 - 37q - 5. Let s(a) = -63a3 + 19a*2 - 135a - 19. Give 11g(k) - 3s(k). 13k3 - 2k*2 - 2k + 2 Let x(z) = 3z. Let k(g) = -1214g. Determine k(o) + 4x(o). -1202o Let m(i) = 36i2 - 10i - 11. Let g(v) = -34v2 + 8v + 10. What is 6g(p) + 5m(p)? -24p2 - 2p + 5 Let l(s) = -3282s + 4. Let d(g) = 6601g - 9. What is -4d(a) - 9l(a)? 3134a Let k = 1 - 2. Let r(x) = -12x*3 + 3x + 2. Let s(l) be the third derivative of l6/120 - l4/24 - l*3/6 - 2l*2 + 56866l. What is kr(u) - 2s(u)? 10u3 - u Let v(n) = -13n*2 - 16 + 40 - 30. Let c(h) = -27h*2 - 11. What is -4c(l) + 7v(l)? 17l*2 + 2 Let v(j) = -2j + 0j3 + 13j*3 + 2j*2 - 22j*2 + 33j*2 + 7. Let y(t) = 9t*3 + 9t*2 - t + 5. Calculate 5v(n) - 7y(n). 2n*3 + 2n*2 - 3n Let k(b) = b*2 - 16b - 5. Let j(m) = -8m - 2. Let s = 528 - 528. Suppose -13q - 12q + 50 = s. Give qk(y) - 5j(y). 2y*2 + 8y Let s(m) = 5m - 5. Let o(p) = -5p + 4. Let q(t) = 23 - 11t - t2 + 0 - 14t + 22t. Let y be q(-7). Determine yo(g) - 4s(g). 5g Let u(l) = l*2 - 3l. Let d(t) = -33t2 + 13t + 8. Let x(n) = d(n) + 2u(n). Let m(b) = 31b*2 - 8b - 9. Give -6m(c) - 7x(c). 31c2 - c - 2 Let d(s) = 5s - 10. Let h(w) = 2840w - 5581w + 2742w. Give d(i) - 6h(i). -i - 10 Let r(o) = -6o2 + 5o + 15. Let q(c) = 3c2 - 2c - 8. Suppose 5f - 3611 = -2m - 3678, 4m + 2f = -62. Determine mq(g) - 6r(g). 3g2 - 8g - 2 Let o(c) be the second derivative of c4/6 + c2/2 + 24c. Suppose -536 + 176 = -72q. Let s(i) = -2i2 - 1. Calculate qs(g) + 6o(g). 2g*2 + 1 Let f(d) = -52d*2 - 2d + 5. Let y(j) = 105j2 + 4j - 9. What is -5f(b) - 2y(b)? 50b2 + 2b - 7 Let c = 6 - 8. Let b(a) be the second derivative of 5/2a3 + 0 - 21/2a*2 - a. Let z(q) = 3q - 4. Determine cb(s) + 11z(s). 3s - 2 Let k(m) = -45m + 11. Let f(c) be the first derivative of -15c2/2 + 4c + 1354. Calculate 8f(t) - 3k(t). 15t - 1 Let h(d) = 7551d - 19. Let j(q) = 1885q - 5. Calculate -6h(g) + 23j(g). -1951g - 1 Let b(g) = 5. Suppose -5y - p + 2 = 0, 5y + 1 = -p - p. Let c(n) = n - 1. Suppose -2s = -4v + 28, 3s + 3s = -5v - 33. Determine vc(k) + yb(k). 3k + 2 Let m(j) = 3j - 21. Let t(y) = -4y + 32. Let q(k) = 3m(k) + 2t(k). Let l(i) = -29i2 + 145i + 145. Give l(a) - 145q(a). -29a*2 Let k(f) = 4f*2 + 105f + 29. Let m(x) = 5x2 + 158x + 41. What is 7k(q) - 5m(q)? 3q2 - 55q - 2 Suppose 2v - 4x - 36 = 0, 4v - x - 19 = v. Let p(c) = -c3 - c2. Let s(i) = 5i*3 + 4i*2 - 27i. Calculate vp(u) + s(u). u3 - 27u Let d be -13(3 - 2/1). Let u(s) = 19s + 17. Let i(g) = -8144g - 27. Let p(m) = 3133m + 11. Let z(r) = 5i(r) + 13p(r). What is dz(k) + 6u(k)? -3k - 2 Let j(n) = -2n - 5. Let v(o) = o*2 + 8o + 2. Let l be v(-7). Let f = 1722 - 1726. Let b(u) = -u + u + 3u + 6. Determine fb(t) + lj(t). -2t + 1 Let j(n) = n*2 + 4n - 3. Let y(a) = -a*3 - 4a*2 - 35a + 19. What is 4j(u) + y(u)? -u3 - 19u + 7 Let q(t) be the first derivative of 3t3 + 11t*2/2 - 9t - 949. Let a(w) = -5w2 - 5w + 4. What is 9a(h) + 4q(h)? -9h2 - h Let m(j) = -138j*2 + 26j + 3. Let h(g) = -276g2 + 45g + 5. What is -3h(o) + 5m(o)? 138o2 - 5o Let j(i) = -8i3 + 36i*2 - 27i + 10. Let b(y) = 16y3 - 66y*2 + 53y - 18. Determine -6b(l) - 11j(l). -8l3 - 21l - 2 Let k(s) = 73s3 + 3s*2 - 3s + 3. Let w(p) = 30222p3 + 1241p*2 - 1241p + 1241. Calculate 2482k(b) - 6w(b). -146b3 Let u(y) = -243y + 3. Let c(s) = -152s + 2. Let w(n) = 8c(n) - 5u(n). Let k(o) = -o2 - 27o + 2. Give -k(p) + 2w(p). p2 + 25p Let b(m) = 21. Let q(h) = h + 41. Let g(l) = 3l3 + 22l*2 - 18l - 18. Let v be g(-8). Calculate vq(x) + 5b(x). -2x + 23 Let l(n) be the third derivative of n6/120 + n5/12 - 5n*4/24 - 8n*3/3 - 2n*2 + 195n. Let d(f) = f*3 + 3f*2 - 3f - 8. What is -5d(v) + 3l(v)? -2v3 - 8 Let o(j) = 2j + 2. Let w(s) = s + 1. Suppose -q + 12 = -5b - 6, 4b - 50 = -2q. Let a = -5479 + 5486. Suppose -q - a = 5l. Determine lo(k) + 14w(k). 2k + 2 Let d(v) = v2 - 27v - 325. Let f be d(-9). Let h(p) = -4p3 + 5p*2 + 5p - 5. Let s(l) = -l3 + l2 + l - 1. Give fh(x) + 5s(x). -x*3 Let z(g) = 9g - 4. Let s(w) = -4w + 2. Let k(n) = 9n - 2. Let a be (-60)/27 + 2/9. Let o be k(a). Let b be 13/4 + 5/o. What is bz(x) + 7s(x)? -x + 2 Let f(k) = k*2 + k. Let z(d) = 26d*2 + 39d. Suppose 0 = 3h + 6, -17 + 48 = 5b - 18h. Determine bz(c) + 39f(c). 13c2 Let f(x) = -x2 - 3. Let q(r) = 152r3 + 11r*2 + r + 27. What is -11f(b) - q(b)? -152b3 - b + 6 Let h(f) = 2 + 0 + 9f*3 - 9 + 7f*2. Let l(n) = 363n + 3996. Let z be l(-11). Let k(w) = 4w3 + 3w*2 - 3. What is zh(b) - 7k(b)? -b3 Let u be (-4)/(-10) - 28/20. Suppose -9x = 44 - 206. Let b(r) = -5 + x - 6 - 6 + r. Let t(a) = -3a. Determine ut(g) - b(g). 2g - 1 Let z(w) = -2w*3 + 4w2 - 9. Let y(l) be the second derivative of l5/2 - 7l4/4 + 45l*2/2 + 2l + 514. What is -2y(v) - 11z(v)? 2v3 - 2v2 + 9 Let q(k) be the third derivative of k5/12 + 11k4/24 + 2k*3/3 + 10271k2. Let c(j) = -j3 - 6j2 - 12j - 5. Give -4c(o) - 5q(o). 4o3 - o2 - 7o Let x(w) = 1454w3 + 34896. Let h(m) = 3. What is 58160h(c) - 5x(c)? -7270c*3 Let a(z) = 30z - 1. Suppose -179u + 183u = -44. Let h(o) = 6o. Determine uh(g) + 2a(g). -6g - 2 Let m(s) = 11s2 - 25s + 326. Let i(y) = -6y2 + 14y - 163. Determine 9i(r) + 5m(r). r*2 + r + 163 Let y(c) = 18c**3 + 1	{ "pile_set_name": "DM Mathematics" }
ulate 0.362753 + 18. 18.362753 What is the distance between 0.054639 and -0.0469? 0.101539 What is -485 less than 45316? 45801 Put together -8 and -3598189. -3598197 Sum 8 and 2.392898. 10.392898 What is 0.1379804522 take away -0.05? 0.1879804522 What is -0.3 minus -1218353216? 1218353215.7 What is 445 less than 3269763? 3269318 271658 + -0.2697 271657.7303 Calculate -686405 - -213. -686192 Work out -0.332 + -6644430. -6644430.332 What is 347934.503 plus 3? 347937.503 0.3990021 + 0.1012 0.5002021 What is -2665 + -5.1116? -2670.1116 303547 - -0.0096 303547.0096 What is 1.361 minus -374712? 374713.361 Sum 2590 and 1.4314. 2591.4314 What is -8611073 take away -0.0868? -8611072.9132 What is 1407321.338 plus -0.1? 1407321.238 What is -43 plus 6729353? 6729310 What is -2.3429 plus 382? 379.6571 Add -0.03332045 and -233. -233.03332045 What is 908.7 take away 2.7? 906 What is 95.8 plus 87.5? 183.3 Work out -1.0827 - -0.0101784. -1.0725216 Add -3.018947 and 1.05. -1.968947 Work out 0.46303 + 0.061658. 0.524688 Subtract -3.2 from 74.797537. 77.997537 22.73+-707.73755 -685.00755 What is the distance between 0.004579 and 0.55? 0.545421 6+-20.92876 -14.92876 What is -3092.839 take away 0.5? -3093.339 -1.5 - 272506609 -272506610.5 What is -17613 plus 604? -17009 -0.5 - 34005875 -34005875.5 Add together 12.94932 and -6942. -6929.05068 Calculate -19963082407 + -0.1. -19963082407.1 Total of -2336208.35 and 0.2. -2336208.15 Add together 20653801 and -2.54. 20653798.46 Sum 400259273.2 and 3. 400259276.2 Work out 4 + 873616. 873620 What is -12 - 1005754? -1005766 What is 0.5 plus -152647.58? -152647.08 Add together -19 and -0.031883781. -19.031883781 Total of 6 and -42.3901009. -36.3901009 Work out -0.6 + -1907.451772. -1908.051772 -34+-421208 -421242 Work out 548 - 18884. -18336 What is -429 - 23310877? -23311306 Add -0.3 and -19607015. -19607015.3 Total of 3 and -1136307049. -1136307046 What is -472015644 minus -2? -472015642 What is 5 plus -2537631072? -2537631067 What is 2.074 - 3839? -3836.926 -3466 - 593682.4 -597148.4 Subtract -1115327 from 0.028018. 1115327.028018 -0.09 + -118557885 -118557885.09 Sum -3246 and 10580. 7334 1376.14127 + 5 1381.14127 0.029022 - 2242 -2241.970978 Add -12906880062 and -10. -12906880072 Calculate -359010 - -138. -358872 Add together 0.08 and 21935994. 21935994.08 What is the distance between 6279 and -88753? 95032 What is the distance between 1 and 1017602566? 1017602565 Calculate 10.6 - -4484348. 4484358.6 What is the distance between -7048.87619 and 0? 7048.87619 Put together 54 and -1123494. -1123440 Work out -958176 - -38. -958138 Work out 16518.36 - 1.8. 16516.56 Calculate 476575 - 884. 475691 Calculate 35348 + -109.7614. 35238.2386 -59707703 + 26 -59707677 Calculate 3212 - 2347. 865 What is -1 - 12.68566? -13.68566 What is -1524910 take away 1.94? -1524911.94 -0.8 + 725.8896 725.0896 What is -679229 take away 782? -680011 Subtract 7598.10158 from -0.7. -7598.80158 What is 4777455166 less than -5? -4777455171 Put together 15951 and 18.828. 15969.828 Work out -4760105 - 6. -4760111 What is 6082740 minus -0.073? 6082740.073 Work out 3 + 2133830502. 2133830505 Add 0.307 and 3771. 3771.307 Calculate 0 + -70586706. -70586706 -5+2870537884 2870537879 Put together -9271274 and -0.04. -9271274.04 Subtract 0.1751216 from -0.9474. -1.1225216 Sum -2 and -2.649515. -4.649515 What is -0.2929003561 - 3? -3.2929003561 What is 40 minus -1099096787? 1099096827 What is -15911017 + -0.5? -15911017.5 What is the difference between -0.45 and 9.371263? 9.821263 Work out 1.1 - 71026560. -71026558.9 What is -200 + -8606? -8806 What is -2 plus 2696731.68? 2696729.68 What is -14 minus 12402225? -12402239 What is 0.4 plus 177505983? 177505983.4 Total of -0.060684 and -615.906. -615.966684 What is the distance between -0.2 and 314621.8? 314622 What is -0.1185 take away -7450? 7449.8815 What is the difference between 245062959 and 5? 245062954 Subtract 437.71 from -0.089. -437.799 Work out 6688779 + 0.073. 6688779.073 Calculate -5469.1 + -47.85. -5516.95 What is the difference between -37.6895 and 0.03426? 37.72376 What is 8261459 take away 2? 8261457 Subtract 5 from -1168631664. -1168631669 0.0358562+-0.02534 0.0105162 Subtract 27517.9 from 0.65849. -27517.24151 Total of -5 and -11.513981. -16.513981 Work out 1.5 + -44583955.4. -44583953.9 Work out 383 - -31546050. 31546433 What is 511 take away -7400787? 7401298 0.271+-23.363 -23.092 Calculate 63888 + 90682. 154570 Total of -113 and -3132519. -3132632 What is -4.3 plus 1892.602? 1888.302 Work out 5.8328730218 + -5. 0.8328730218 What is -8724551 plus 2.18? -8724548.82 Add together -1.5199294 and 4. 2.4800706 Calculate -154749 - 148903. -303652 Subtract -3 from 35871.65. 35874.65 What is 7.3596 less than -0.73? -8.0896 Add 71 and 0.6351216. 71.6351216 What is the difference between 29465597 and 0.3? 29465596.7 Work out -6017015 + 1.6. -6017013.4 Add -694356 and -2953. -697309 -0.012442608 + -38.1 -38.112442608 Work out 3.285698 + -0.18239. 3.103308 What is -51961017 - 0.2? -51961017.2 What is 13045.26 - 84432? -71386.74 Sum -61.27629 and -6.57. -67.84629 -0.109635449 + -0.4 -0.509635449 Sum -250.3 and -941.0464. -1191.3464 Add together -35.43 and -4777510. -4777545.43 What is the distance between -22733 and 295.73? 23028.73 763.587 - 0.6 762.987 -3208+0.027569 -3207.972431 What is the difference between 6877772 and -77? 6877849 What is -1202719 - -0.212? -1202718.788 Put together -0.5 and 10705701. 10705700.5 What is the difference between 0.556371121 and 0? 0.556371121 What is 0.00980034 take away 5030? -5029.99019966 Total of -2.2 and -23869875. -23869877.2 -0.0317915923+45 44.9682084077 -46 - 299854 -299900 What is -7743.3 + -16.8? -7760.1 -316.6966 - 141 -457.6966 -0.14 + 0.03491048 -0.10508952 Add 0.07 and -41372.42. -41372.35 Calculate -2495.1 - 2208. -4703.1 Add together -222.258 and -2.7185. -224.9765 What is -64408.715 less than -9? 64399.715 Add -882 and 155422. 154540 Calculate 1803718 + -4. 1803714 What is 2364 plus 7.034? 2371.034 0.06 - -83246187 83246187.06 Add together -0.4 and -667.28173. -667.68173 What is -432768 - 0.237981? -432768.237981 What is the difference between 1.4 and 31230.94? 31229.54 Calculate -20320.37 - 5. -20325.37 Sum 3.5 and -0.992874. 2.507126 What is 0.4517 - 15.23? -14.7783 What is the difference between -0.1301 and -0.47387? 0.34377 What is 601 less than -105849? -106450 What is the distance between 45410.69 and 19.473? 45391.217 Add together 54 and 438046. 438100 What is 22125 take away 0.1269? 22124.8731 1151 - -181134 182285 What is -0.059 + -12.81017? -12.86917 -5 - 40843812352 -40843812357 Work out -10.4209681 - 0.0402. -10.4611681 Work out -3698.19 + -120. -3818.19 Total of -0.6306 and 6098981. 6098980.3694 What is the difference between 1293144 and -227? 1293371 -23699628 - 0.59 -23699628.59 Total of -390 and -51.563. -441.563 What is 0.1 take away -50.15946? 50.25946 What is the distance between -0.0287 and 0.216216? 0.244916 Calculate -349.7 + 2.96. -346.74 What is -3709309 minus -17? -3709292 What is -5 - -46.59498? 41.59498 -165.711+11 -154.711 What is -6492 take away -321513? 315021 Put together -4 and 60592114. 60592110 Add -50716.15 and -0.06. -50716.21 149 - 18.817 130.183 What is -3971989 take away 185? -3972174 What is the difference between 771.12154 and 2? 769.12154 Put together -2 and 40.8259888. 38.8259888 Calculate -279 - -601.48. 322.48 What is -0.01 minus 4740768? -4740768.01 Calculate 58242 - -7.2. 58249.2 What is -39 less than -28780849? -28780810 Work out 0.6798476 + -0.2. 0.4798476 Work out -0.4 - 417118293. -417118293.4 Add together -278.33 and 805396. 805117.67 What is -0.2 + 404.877329? 404.677329 Work out 15.63 + 22266. 22281.63 Subtract -7.83446376 from 0.5. 8.33446376 Calculate 1 - 89.078165. -88.078165 What is 71197932635 minus -3? 71197932638 What is 3 plus -105344725? -105344722 Add together -24168721 and -3. -24168724 What is the difference between 0.3 and -85678.59424? 85678.89424 Add together 102799 and -0.541. 102798.459 Subtract 80.8726 from 47. -33.8726 Put together 116 and 0.0027779. 116.0027779 What is 342175717 + -7? 342175710 Add 1879448 and 0.04705. 1879448.04705 307626 - 25 307601 Calculate -21443 - -1256619	{ "pile_set_name": "DM Mathematics" }
2) - g3 - g3 + 0g*3). 8g5 Expand (-t3 - 95 + t*2 + 99 - 2t*2)(1 - 2 + 3). -2t3 - 2t*2 + 8 Expand (g + g - 4g)(-g2 + 5g - 5g) + (g2 + 4g*2 - 4g*2)(2g + g + 2g). 7g3 Expand (0n*2 + 3n2 + n2)(-1 + 1 + 2n3) - n3 + n*3 - 2n*5 + (n - 5n + 2n)(-5n4 + n4 + 2n*4). 10n*5 Expand (23 - 23 + 8k + (1 + 4 - 3)(-2k - k + 2k))((0k - k - k)(-1 + 1 - 2) + 5k - k - 2k). 36k2 Expand (4t*2 + 7t*2 - 8t*2)(-3t2 + 0t*2 + 2t*2) + (3 + 1 - 2)(-t*4 + 4t4 - t4). t4 Expand h2 - 32h + 32h - 4h3 + 2h3 + h3 - 2h3 + (2h + h - 4h)(4h2 - 3h2 + h2) - 4h3 - h3 + 3h*3. -7h3 + h2 Expand (5 + a - 3a - 3)(-a - 12 + 12 + 3a2). -6a*3 + 8a*2 - 2a Expand ((j + 1 - 1)(-1 + 0 + 0) + 0 - j + 0)(-4j + 2j + 3j). -2j2 Expand l3 + 0l3 + 0l*3 + (-19l - 23l + 5l)(2l2 - l2 + 2l2). -110l*3 Expand (-193 + 33q*2 + 193)(-1 + 1 + q). 33q3 Expand (-19 + 19 - 3g)(1 - 1 - g) + g2 + 0g*2 + 0g*2. 4g*2 Expand (4 - 2 + 0)(11o2 - 6 + 6)(-1 + 0 - 1)(o + 0o + o). -88o3 Expand (l2 - 3l*2 - 16 + 17)(0l3 - l3 - l3). 4l*5 - 2l*3 Expand -2d*3 + 2d3 - d5 + 186d2 - 186d*2 - 37d*5 + (2 - d - 2)(-6d4 + 2d*4 + 3d4) + d5 - d5 + d5. -36d5 Expand -3x*2 + 2x*4 + 3x*2 + (-4x*2 + 3x*2 + 0x*2)(-2x2 - 3x + 3x) - x4 + x4 - x4 - 12x*4 + 3x*4 + 2x*4. -4x4 Expand (-r2 + 6r2 - 3r*2)(-r + 2r - 2r) + 5r2 + r3 + 2r*3 - 10r2. r3 - 5r2 Expand (j + j2 - j + (6 - 1 + 0)(2j2 + 0 + 0))(-5j2 + 3j*2 + 3j*2). 11j*4 Expand 4k2 - k2 + 2k2 + (-4k*2 - 3k*2 + 6k*2)(-1 - 1 + 0). 7k2 Expand 5 + 4g*2 - 5 + (-2g - 2g + 6g)(-3g + g + 0g) - 4g2 - g2 + 4g2 - 2g2 + g2 - 4g2 + 2g2 + g2 - 4g2. -7g*2 Expand (-1 + 0 + 3)(-3f + 3f - 3f) - 10 + 2f + 10. -4f Expand (5v - 2v - 4v)(-v4 + 5v*4 + 0v4) - v5 - 2v5 + 4v*5. -3v*5 Expand (-2h + 5h + 3h)(2h - 3h + 3h) + (3h - 7h + 3h)(-h + 2h - 3h). 14h2 Expand (0 - 2 + 1)(3 - 9 + r + 5). -r + 1 Expand (9m - 3m + 10m)(m*3 - 5m*3 + 5m*3). 16m*4 Expand (5v - 5v - v)(1 - 3 + 6) - 2v + v + 2v. -3v Expand (0k - 4k + 2k)(k2 + 2k*2 + 0k*2) + (5k*3 - 5k3 + k3)(1 + 1 + 0). -4k*3 Expand ((-3m + 3m - 2m)(2m - 1 + 1) + 14m2 - 9m + 9m)(-3m2 + 3m*2 + 2m*2). 20m*4 Expand (1 - 2 + 2)(-4s3 + 2s*4 + 0s*3 + 2s*3). 2s*4 - 2s*3 Expand (0o + 4o - 2o)(-4o*4 + 3o4 - o4) - 12o - 10o - o*5 + 20o. -5o5 - 2o Expand (0 - 3d + 0)(-4 + 4 + 4d)(3d2 + 4d*2 - 3d*2). -48d*4 Expand (2z + 0z + 0z)(3 - 3 + 5)(-3 + 1 - 1). -30z Expand (-x - x + 4x + 0x - 2x + 0x + (4 - 5 + 2)(-4x + x + x))(4 - 3 - 2). 2x Expand -f2 - 4f*2 + 0f*2 + (3f + 0f - 5f)(-2f + 0f + 3f) - 2f2 - 5f*2 + 2f*2. -12f2 Expand -y5 + 3y2 - 3y*2 + (-4y*3 + 5y*3 - 3y*3)(4y2 + 5y - 5y). -9y*5 Expand (4d + 2d - 2d)(4 - 2 + 0)(3 + 1 - 3). 8d Expand (-u + 1 - 1)(4u + 2 - 3 - 3u). -u2 + u Expand (-z5 + 0z3 + 0z*3)(-3 - 1 + 5) - 25z2 + 10z*5 + 25z*2 - 2z*3 - 2z*5 + 3z5 + z3. 10z5 - z3 Expand (-g + g + 6g)(-1 + 1 + 2). 12g Expand -q*3 - 3q*3 + 2q3 + q3 + 3 - 3 + (-3q2 - q2 + 6q*2)(q - 1 + 1) + 0q - 29q*3 + 0q. -28q3 Expand (4 - 4 + 2o)(-3 + 5 + 3)(2o2 + 4o*2 - 4o*2)(-2o + 0o + o). -20o4 Expand (-30 - l2 - 4l*2 + 31)(2l2 + 2l*2 - 3l*2). -5l4 + l2 Expand (-32p - 24p - 10p)(1 - 1 + p*3 + (-p + 2p + 0p)(1 + p*2 - 1)). -132p*4 Expand (-3 - 3a*2 + 3)(-a*2 + 4a2 - a2) + (2a2 - 2a + 2a)(2a - a2 - 2a) - a*4 - 4a*4 + 3a*4. -10a*4 Expand w - 4w + 4w + (-1 + 1 + 2w)(-3 + 0 + 1) + 0w - 3w + 2w. -4w Expand (3q2 - q2 - 3q2)(0 + 0 - 4) + 2q2 + 0 + 0 + (2q + 0q - q)(2 - 2 - q). 5q2 Expand (1 + 0 - 2)(v - 1 + 1) - 7v - 6v - 7v + (v + 4v - 4v)(1 + 0 - 2) + 3v - 5v + v. -23v Expand 2w - 22w3 + 21w*3 - 2 - 4w - 3w3 - 3w*3 + 7w*3 + (0w + 0w + w3)(-2 + 1 + 3). 2w3 - 2w - 2 Expand (-5 + 2 - 2)(-q + 2 - 2). 5q Expand (2w4 + 0w + 0w)(-4w + 4w - 2w) - w5 + w5 + w5 - 2w*5 - 2w*5 + 5w*5. -2w5 Expand ((h2 - 3 + 3)(-2h2 - h2 + 2h2) + 7h*4 - 6h*4 + 7h*4)((-2 + 5 - 2)(-1 + 1 - 1) + 0 + 4 - 6). -21h4 Expand (-v5 + 0v + 0v)(3 - 35 - 10). 42v*5 Expand (4j*4 + 0j*4 - 3j*4)(3 - 3j + 1 - 3). -3j5 + j4 Expand (6a2 - 6a*5 - 6a*2 + (-2a*2 + 4 - 4)(2a + a3 - 2a))(3 - 5 - 3)(0 + 1 + 1). 80a5 Expand 4u - 2u - u + (-3u + 0u + 2u)(0 + 4 - 7)(1 + 0 - 3). -5u Expand f - f3 - f + (-5 + 5 + 1)(5f3 - 3f*3 + 2f*3). 3f*3 Expand (-1 + 9 - 2)(3h - 4h + 3h). 12h Expand q*2 - 7q*4 - 7q*2 + 4q*2 + 6q4 - q4 - 3q4 + (-q3 + 0 + 0)(3q + 3q - 5q) - 2q*4 + 1 - 1. -8q*4 - 2q*2 Expand -2x5 - x5 + x*5 + (-1 - 3 + 3)(-2x5 - x5 + x5) + x5 - x2 + x2. x5 Expand (-5 + 0 + 3)(13w4 + 65w - 65w) - 4w*4 + 3w*4 + 2w*4. -25w*4 Expand 4d2 + d2 - 3d2 + (-4d + 6d - d)(5 + 1 + 4)(2d + 4 - 4). 22d2 Expand (-j2 + 0 + 0)(9j - 9j + 5j2 - 2 + 2 + 4j*2 + (5 + 2 - 5)(2j2 - 2 + 2)). -13j*4 Expand (3 - 2z - 3)(12z*2 + 0z*2 - 5z*2). -14z*3 Expand ((-2r - 2r + 6r)(-3 + 4 - 2) + r + 0r + 2r - 2 + 2 - 2r)(6 - 4 - 3). r Expand 3a + a*4 - 3a + a*2 + (99a*3 + 68a*4 - 99a*3)(1 - 2 + 2). 69a4 + a2 Expand (3j*2 + 0j*2 + 0j*2)(2j - 3j + 2j) + 0j3 + j3 + 0j3. 4j*3 Expand 3a*3 - 3a*3 - 2a*3 + (-2a + 0 + 0)(13a - 6a2 - 13a) - 8a3 - a3 - 2a3. -a3 Expand ((-i + 4i - 2i)(-2 - 1 + 5)(-i*2 + i - i) + 0i3 - i3 + 2i3)(-i + i + 4i). -4i*4 Expand (-1 - 5l*2 + 1)(l + l*3 - l) - 4l + 4l + 3l2 + l5. -4l5 + 3l*2 Expand (4q + 2 - 2q - 3)(-7q - 14q + 8q). -26q*2 + 13q Expand -s - 1 + 0s2 + 0 - s2 + (2 + 0 + 0)(3 + s2 - 3). s2 - s - 1 Expand 0z3 - z3 + 2z*3 + (1 - 6 + 2)(0z3 - z3 + 5z*3). -11z*3 Expand (-2b*4 - 3b*4 + 6b*4)(13 - 18 - 10)(b - 2b + 3b). -30b*5 Expand (-1 + 3 - 1)(-9z + 378 - 378). -9z Expand (-2z + 1 - 1)(3 - 2 + 0) - 38 + 11z + 38. 9z Expand ((1 - 4 + 4)(-4a + 2a + a) + 42 - 8a - 42)(0 + 4 - 2). -18a Expand (-2i + 4i - 3i)(5i2 - 4i*2 + 0i*2) + 23i*3 + 71i*3 + 189i*3. 282i*3 Expand 0g*3 - 4g*3 + 3g*3 + (-2 - 2g*2 + 2)(g - 4g + g) - g2 - 2g3 + g2 - 7g3 + 2g*3 - 3g*3 + (1 + 4 - 3)(2g3 + 3g*3 - 6g*3). -9g*3 Expand (2 - 4 - 1)(q - 2q + 2q)(3q*2 + q - q). -9q*3 Expand (-6 + 3 + 4)(3v3 - 3v*3 - 2v*3). -2v3 Expand (j4 + 0j4 + j4)(-1 + j + 1) - j*5 + 3j*5 + 3j*5 + (j + 3j - 2j)(2j4 + 2j*4 - 6j*4). 3j*5 Expand -3l*2 - 5l + 3l3 + 4l - 2l + (0 + 0 + 2l)(4 + l2 - 4) - l + l - l3. 4l*3 - 3l*2 - 3l Expand 2s - s3 - 2 - 2s + (-3 + 0 + 1)(-5s3 - s3 + 2s3) - 2s*3 + 0s3 + s3 + 6s - 6s - 3s3. 3s*3 - 2 Expand (-4 - 2o + 4)(2 - 5 + 1) + (-2 + 2 - o)(1 + 0 + 0) + 3o + 0o - o + 2o - 2o + 2o. 7o Expand (2j2 - j2 + 2j*2)(3 + 1 - 5)(4 - 4 + 3j). -9j3 Expand -2m*5 + 4m*5 + 0m*5 - 3m*5 - 3m*5 + 4m*5 + (-5m3 - m3 + 0m3)(2m + 2m*2 - 2m). -12m5 Expand (-5 + 1 + 0)(-y + 4 - 4) + 0y + 3y + 0y. 7y Expand -7b - 11b + 56b + (-2 + 4 - 3)(2b + 2 - 2). 36b Expand (4p - 5p + 1 - 1)(2 - 16 - 7). 21p Expand -s*3 + 2s*3 - 3s*3 - 3 + 2s*3 + 3 + (-2s + 5s - s)(0s2 - 3s*2 + 5s2) - s3 - 1 + 1 + 2s3 - 6s*3 + 5s*3 - 119 + 119 + 6s*3. 10s*3 Expand (1 + 3 - 1)(0 + 3 - 2)(1 + 2 - 2)(2m - 6m + 2m). -6m Expand (-1 + 1 - v)(-3v - 2v + 3v)(-7v + 2v + 2v)(-v + 20v - 2v). -102v*4 Expand -4 + 4 + k + (4 - 2 - 4)(-4 + 4 + k) - 3k - 1 + 1 + (-3 + 4 + 1)(k - 3k + 3k) + 2k + 0k + 2k. 2k Expand (-7 - 5 + 3)(h + 0h + h). -18h Expand (n2 - n2 + n3)((-4 + 1 + 6)(2n	{ "pile_set_name": "DM Mathematics" }
hi4. Differentiate q(u) wrt u. 3u*2 Let u = 3 - 0. Suppose 5 = n - 5q + 12, -4 = -4n + 4q. Differentiate 28bn + 0 - 34b*u - 6 wrt b. -18b*2 Let b be (-36)/(-126)14/24. Let t(q) be the second derivative of 0q4 + 0q*2 - bq*3 - 1/4q*5 + 0 + 4q. Find the second derivative of t(p) wrt p. -30p Let y(k) be the third derivative of k6/5 + 5k3 + k2 - 4. What is the derivative of y(l) wrt l? 72l2 Let u be (-1 + (-16)/(-4))/1. Suppose -3k = -4i + 2, 2k + ui - 4i - 2 = 0. What is the third derivative of -5r2 - 2r2 + rk + r*2 + 2r*6 wrt r? 240r*3 Let r(a) = 48a - 49a + 0 - 3 + 4. Let p(l) = 29l*3 - 12l - 3. Let y(f) = -p(f) - 3r(f). What is the second derivative of y(n) wrt n? -174n Suppose 2u - 3m = 19, 5m + 18 = 3. Suppose 10j - 8 = 6j. What is the second derivative of -d2 - 9d*2 - d + udj wrt d? -10 Let f(r) be the second derivative of -r6/15 + 26r5/5 + 65r*4/4 - 73r. What is the third derivative of f(k) wrt k? -48k + 624 Suppose 9 = 3m + 3. Suppose f + 3 = mf. What is the derivative of -y2 + 13y*2 - f - 3y*2 wrt y? 18y Suppose 0d + 504 = 8d. What is the second derivative of 6g + d - 63 - 23g + 29g3 wrt g? 174g Let c(p) be the second derivative of 19p4/12 - 385p*3/6 - 174p. Find the second derivative of c(d) wrt d. 38 Let q be (-116)/(-14) + (-18)/63. Suppose f + q = 5f. Differentiate -4o + o - 2o - fo - 8 with respect to o. -7 Let d = 25 - 21. Find the second derivative of -11u + 5u - ud - u - u4 wrt u. -24u2 Suppose 0 = 19k - 60 - 35. Let d(a) be the third derivative of -7/60ak + 0a - 2/3a3 + 0 + 0a*4 + 5a*2. What is the first derivative of d(l) wrt l? -14l Suppose 4m = 2 + 34. Let p = m + -9. Find the third derivative of pl + 0l + 33l2 - l4 - 34l2 wrt l. -24l What is the first derivative of -515 + 338 + 285s2 + s - s wrt s? 570s What is the derivative of -125 - 117 + 285w + 202w - 13 wrt w? 487 Find the first derivative of 290 + 50 + 69 + 24t3 + 92t*3 + 19t*3 wrt t. 405t*2 Find the third derivative of -9 - 238d*4 - 6d*5 + 7 - 314d*2 + 4 + 8d*5 wrt d. 120d*2 - 5712d Find the second derivative of 6b + 108b*2 - 113 + 86b*2 + 67 + 62 wrt b. 388 Let w = 6 - 4. Suppose -5m = -5b, wm + b - 24 = -3m. What is the second derivative of -2h + 3h + 2h*m - 2h wrt h? 24h2 What is the derivative of 154 + 154 - 3q - 11q + 160 wrt q? -14 Differentiate -l2 - l3 - 38 - l2 - 364l + 348l + 2l*2 wrt l. -3l*2 - 16 What is the first derivative of 32g + 2214 - 1142 + 18g - 1129 wrt g? 50 Let x be 5/1 - (2 - 4). Let v(l) be the first derivative of -l4 + 5l + x + 0 - 2l - 4. What is the derivative of v(u) wrt u? -12u*2 Differentiate -55 + 77 - 35p*4 + 88 wrt p. -140p*3 What is the third derivative of -3t*2 - 69t + t*2 - 4581t*3 + 3923t*3 wrt t? -3948 Let a(j) be the third derivative of 49j5/30 + j4/8 + j*3 - 55j*2 - 2. Find the second derivative of a(u) wrt u. 196 Let t(p) be the second derivative of 0p*4 + 0p*5 + 0 - 8p - 17/30p6 + 0p*3 - 19/2p*2. What is the first derivative of t(o) wrt o? -68o*3 What is the second derivative of -4141n + 20n4 - 1 + 4196n + 2n2 - 2n*2 wrt n? 240n*2 Let x(v) = 3v*2 + 2v + 7. Let g(f) = 10f2 + 7f + 21. Suppose 3 = -4m + m. Let z = m - -3. Let s(u) = zg(u) - 7x(u). Differentiate s(q) wrt q. -2q Let j(s) be the second derivative of -37s4/12 - s3/6 + 43s*2 + 18s - 2. Find the second derivative of j(t) wrt t. -74 Suppose 5i - 26 = -2o, i - 4o + o - 12 = 0. Suppose -5 = -im + 5m. Find the second derivative of -h5 + 23h - 12h - 2h*m wrt h. -60h3 Let t(f) be the second derivative of -f4/4 + 13f3/6 - 25f*2 - 87f. What is the derivative of t(k) wrt k? -6k + 13 Find the second derivative of 30804u*2 - 15 - 30804u*2 - 25u*3 + 45u*3 - 18u + 50u3 wrt u. 420u What is the third derivative of 49f2 + 96f*3 - 43f*2 - 32f*2 wrt f? 576 Let j(z) = -18z + 4. Let d(p) = -17p + 3. Let i(b) = -6d(b) + 5j(b). Let n(l) = l. Let v(q) = 2i(q) - 14n(q). Find the first derivative of v(k) wrt k. 10 What is the third derivative of -140v + 3v2 + 0v*2 + 146v + 19v3 wrt v? 114 Let s(d) be the third derivative of -43d7/70 - d4/3 + d*3/3 + 5d*2 + 15d. Find the second derivative of s(k) wrt k. -1548k2 Let h(c) be the first derivative of -7/3c*6 + 3 - 4c*3 + 0c*4 + 0c + 0c5 + 0c*2. What is the third derivative of h(v) wrt v? -840v*2 Let d(q) = q - 1. Let i(g) = 6g - 7. Suppose 4z - b + 4b = 9, 0 = -4z - 4b + 8. Let w(n) = zd(n) - i(n). Differentiate w(y) with respect to y. -3 Let d = 68 - 68. Let r(c) be the first derivative of -11/4c*4 - 6 + 0c*2 - 8/3c*3 + dc. Find the third derivative of r(u) wrt u. -66 Let z(w) = 2w2 + 2w - 6. Let l be z(-4). Find the third derivative of -2y2 + 12y*3 + 4y*2 - ly*2 wrt y. 72 Let c(t) = -32t*2 - 28t - 368. Let a(q) = -10q2 - 9q - 123. Let r(m) = -7a(m) + 2c(m). Find the first derivative of r(z) wrt z. 12z + 7 Let t(m) be the third derivative of -1/30m*5 + 16m*2 - 2m + 0 + 5/12m4 - 19/3m*3. Find the first derivative of t(h) wrt h. -4h + 10 Find the second derivative of -469h + 80h*4 + 144h + 63h4 - 33h*4 wrt h. 1320h*2 Let q(b) = 20b3 + b2 - 2b + 1. Let m be q(1). Suppose 0 = -4k + 2k + m. Find the third derivative of -5l*6 + kl6 - l2 + l*6 wrt l. 720l*3 Suppose -a = 5v - 31, 2a - 3v - 2 + 5 = 0. Find the third derivative of 7m6 + am*2 - 14m*6 - 14m*2 wrt m. -840m*3 Find the second derivative of -13z*4 - 736z + 283z + 11z*4 - 120z*2 wrt z. -24z*2 - 240 What is the derivative of 5i - 136 + 10i4 - 11 - 4i + 13i4 wrt i? 92i*3 + 1 Suppose -4h + v = -12, -2h = -0h + 3v - 6. What is the second derivative of -hi*4 - 5i*4 - 9i + 0i4 - 4i*4 wrt i? -144i*2 Let i(v) be the first derivative of -13v*7 + 2v*3/3 - v + 28. What is the third derivative of i(p) wrt p? -10920p*3 Let m be 1 + 3 + 1 + -3. What is the third derivative of -72p*2 + 74pm + p6 - 10p6 wrt p? -1080p*3 Suppose -4h = -5z - 31, 4h + 3z = -0h + 7. Differentiate -17xh - 1769x*2 + 1769x*2 - 17 wrt x. -68x*3 Let h = -41 + 13. Let f be 18/8 - (-7)/h. Find the first derivative of -8 + 6q - f + 0 + 1 wrt q. 6 Suppose -60 + 15 = 5f. Let w(v) = -14v + 5. Let j be w(f). What is the third derivative of 7x3 - j + 131 - 2x*2 + 9x*2 wrt x? 42 Let v(q) be the second derivative of 14q*3 + 97q*2 + 29q. Let s(t) = -17t - 39. Let z(k) = -11s(k) - 2v(k). What is the first derivative of z(l) wrt l? 19 What is the derivative of 42 + 43v*2 + 75 + 10v - 10v wrt v? 86v Let h(i) be the first derivative of 3i4/4 - 5i3/3 - i2/2 + 76i - 295. What is the second derivative of h(n) wrt n? 18n - 10 Let s be 6 - -8 - 6/2. Suppose 2h - s + 3 = 0. Find the second derivative of 5f + 2f4 - 6f*h + f - f wrt f. -48f*2 Let a(x) be the second derivative of 5x + 0x5 + 0 - 7/10x*6 + 5/6x*3 + 0x*2 + 0x*4. What is the second derivative of a(m) wrt m? -252m*2 Find the third derivative of 60048a*5 + 7a*2 - 6a*6 + 3a*4 - 60048a*5 wrt a. -720a*3 + 72a Let p be (-22)/(-6) + (-3)/(-9). Differentiate 31 + 4q4 - 17q*p - 18 with respect to q. -52q*3 Let n = -18 + 20. What is the second derivative of 11a*2 - 6a*n - 3a*2 - 3a + 13a2 wrt a? 30 Suppose -25 + 31 = -m. Let s(r) = 17r*3 + 6r*2 + 4r + 6. Let b(k) = -k3 - k2 - 1. Let o(v) = mb(v) - s(v). Find the second derivative of o(t) wrt t. -66t Let s(b) = b*3 + 6b + 6. Let w(r) = r - 1. Let z(l) = -s(l) + 6w(l). Let i(f) = 1. Let t(h) = -4i(h) - z(h). Find the first derivative of t(j) wrt j. 3j2 Let p(c) be the first derivative of 699c*2/2 + 441c - 192. What is the derivative of p(t) wrt t? 699 Let b(p) be the first derivative of 2p5/5 - 119p*2/2 - 47p - 363. Differentiate b(j) with respect to j. 8j3 - 119 Let j(p) be the first derivative of -23p4/4 + p2/2 - 28p + 55. Differentiate j(n) wrt n. -69n*2 + 1 Let w(x) = -5x - 47. Let q be w(-10). Find the second derivative	{ "pile_set_name": "DM Mathematics" }
- 10 for y. -2 Suppose 3w - 2 = 2a, w + 4a = 6w - 2. Solve s + s = w for s. 1 Let j be ((-15)/(-10))/((-2)/(-4)). Solve 10 = -2z - jz for z. -2 Suppose -1 = x + 2p - 0p, 4x - 16 = -4p. Suppose -3r = -v + 6 + 2, -5v + 1 = -2r. Let d be (0/v)/(0 - -2). Solve 3k = -dk - x for k. -3 Suppose 39 = 4h - 1. Suppose -29d + h = -24d. Solve 2 = -dm + 8 for m. 3 Let d(a) be the third derivative of a4/24 - a3/3 - a2. Let x(m) = -m2 + 11m - 13. Let q be x(9). Let f be d(q). Solve fp = p - 2 for p. -1 Suppose -2d - 2d = 0. Suppose d = -o - 0o + 3. Solve 0 = -og - 0g - 9 for g. -3 Let p(q) = q*2 - 6q + 5. Let u be p(5). Suppose 20 = 5v - u. Solve vk = 6k + 8 for k. -4 Suppose 0x - 57 = -3x. Suppose xf + 4 = 20f. Solve 0 = fv - v for v. 0 Let l be 3 + ((-10)/(-5) - -3). Solve -3j + j + l = 0 for j. 4 Let v be (2/(-4)0)/(-1). Suppose 2w + vw = 4. Suppose -5y + 0 + 30 = 0. Solve y = -2n + w for n. -2 Let l(k) = k*3 - 5k*2 - k + 5. Let o be l(5). Solve -4q + 4 + 4 = o for q. 2 Let m be (3 - -1) + -4 + 2. Solve -mn - 6 - 4 = 0 for n. -5 Let z(c) = c2 - 9c + 11. Suppose -15 = x - o + 4, -3x + o = 51. Let t = 24 + x. Let r be z(t). Solve 0 + 12 = -rp for p. -4 Let z(k) = -3 + 0k + 0k + k. Let d be z(9). Solve d = -4t + 6t for t. 3 Let i = 25 + -22. Solve 2 = f + i for f. -1 Let w = 4 - 1. Let s = -9 - -14. Suppose 0 = 4m - sm + 2. Solve mx - w = -1 for x. 1 Suppose -4t = t. Suppose g - 6g + 80 = t. Let n be (6/4 + -2)0. Solve g + n = 4y for y. 4 Suppose 38 = -2d + 46. Solve -2q = d - 2 for q. -1 Let m(z) = z3 - 3z*2 + z + 1. Let j be m(2). Let i be (19 - j)(-8)/(-32). Solve io = o for o. 0 Let f be 10(21/(-6))/(-7). Solve 2m + 1 = f for m. 2 Let a(j) = -2j*2 - 5j + 3 - 3j3 - 4 + 8j - 5j. Let c be a(-1). Solve 0b - cb = -8 for b. 4 Let w(r) = 5r*2 + 7r. Let p(g) = -g - 9. Let c be p(-10). Let q(m) = -m3 - m2 - m. Let k(a) = cq(a) + w(a). Let u be k(5). Solve us = -0s for s. 0 Suppose 9 = 2w - t, 3t = -w + 5 + 10. Let d = 8 - 3. Suppose s = du - 8, -5u - s - s = -14. Solve 4m - w = u for m. 2 Let u = -2 + 2. Let q = u + -1. Let l = 3 + q. Solve 2a = 6 + l for a. 4 Let r be (12/(-24))/((-1)/(-8)-2). Solve -2i - 6 = r for i. -4 Let j(f) be the first derivative of f4/4 - 2f*3 - 7f*2/2 + 5. Let y be j(7). Solve m = -y - 4 for m. -4 Let r = -69 + 84. Solve y + 2y = -r for y. -5 Let v = 31 + -27. Solve -2w + vw = -4 for w. -2 Let i = 1 + 1. Let j be (1 - i)(-4 - 1). Solve 0z = -jz for z. 0 Suppose -3o = 5j - 43, 0j - 5o = -4j + 27. Solve -2u + j = -4u for u. -4 Let p(g) = -g*3 - 13g*2 - 11g + 14. Let x be p(-12). Solve 4s = xs for s. 0 Suppose -5y = -34 + 14. Solve 0 - y = q for q. -4 Let l = -14 + 20. Suppose -o + lo = 20. Solve -of = 1 + 3 for f. -1 Let c = -2 - 4. Let q(s) = s + 8. Let g be q(c). Solve gd - 5 = 1 for d. 3 Suppose -208 = -5v - 4h, 69 + 53 = 3v + h. Let f be (-12)/(-5)v/6. Solve 0 = -5p - 1 + f for p. 3 Let n be (-1)/3 - (-24)/(-9). Let w be ((-7)/(-2))/(n/(-6)). Solve wo = 2o for o. 0 Let w(c) = 3c - 2. Let d be w(1). Solve -d = s - 0 for s. -1 Let k(j) = j - 4. Let l be k(8). Let y be l + (-1 - (3 - 0)). Solve yq - 4q = 0 for q. 0 Let q(m) = 3m3 - 9m*2 - 4m. Let p(t) = -2t3 + 5t*2 + 2t. Let i(j) = 5p(j) + 3q(j). Let b be i(-2). Solve 0 = 2u - bu for u. 0 Let w = -11 - -22. Let h = 15 - w. Solve -3i = -4i - h for i. -4 Let w(n) = n - 4. Let i(j) = 2j - 8. Let v(y) = 6i(y) - 11w(y). Let x be v(6). Let f be (-120)/52/(-4). Solve 0 = a + xa + f for a. -4 Suppose -2s = -5s. Suppose s = -j + 13. Solve 7 = 5z - j for z. 4 Suppose 16 + 0 = 4c. Solve ch + 9 = -3 for h. -3 Suppose -f + 30 = -5s + f, 0 = 4s + 4f + 24. Let c(h) = -h + 6. Let v be c(s). Solve -4p + 8 = -v for p. 5 Let n = -5 + 9. Let u be -10((-9)/(-3) - n). Solve 0a - 2a + u = 0 for a. 5 Let f = 15 + -4. Suppose -3 = r - f. Solve 0 = 3i - 4 - r for i. 4 Let p be ((-6)/12)/((-1)/38). Suppose -4 = h - p. Solve x = -4x - h for x. -3 Let d be (-13)/((-65)/10) - (1 + -1). Solve 10 - 2 = da for a. 4 Let n = 52 - 48. Solve 0 = -nz + z for z. 0 Let f = -58 - -64. Solve 3 = -3w - f for w. -3 Suppose 5p - 33 + 3 = -2u, -16 = -4u + p. Suppose 0 = q - 6d + 4d - 12, -33 = -4q + ud. Solve -2 = m + q for m. -4 Suppose 3j = 8j - 75. Let b = j + -11. Suppose -2q = 2q - 96. Solve bc = 4 - q for c. -5 Let y = 2 + 3. Let c(a) = -a*2 + 8a. Let l be c(y). Solve l = 4d - 5 for d. 5 Suppose -4r + 4 = s - 14, s + 6 = 2r. Suppose sn + 5 = -f + 1, 2n - 4f = 16. Solve nb = 2b - 8 for b. 4 Suppose 4d - 1 = 4l - 9, 2l = 3d + 1. Let g be -6(5 + 14/(-3) + -1). Solve -p = -lp - g for p. -1 Let x be (9/(-5))/(12/(-40)). Suppose 2a + x = 5a. Solve 7r = ar for r. 0 Let u(x) = x*2 + 10x + 9. Let a be u(-9). Solve -5v + av - 5 = 0 for v. -1 Let v(k) = 2k2 - 11k + 14. Let g be v(6). Solve -4j + g = 4 for j. 4 Suppose s = 2j - 2, -j = -s - s - 4. Let b be (-3)/(-18) + (-2)/12. Solve b = -jy + 5y - 20 for y. 4 Let u be 0 + (-3)/(-6)4. Suppose -3g + 7g - 8 = 4s, g + 2s = u. Solve gd + 2d = 16 for d. 4 Let c(r) = -r3 - r2 - r - 3. Let h be c(0). Let q = -1 - h. Suppose 5t - 58 - q = 0. Solve -5u = -u + t for u. -3 Let l = 6 - 4. Let i(m) = m2 + 3m - 1. Let a be i(l). Let g(f) = -f + 20. Let b be g(14). Solve -5x - b = a for x. -3 Suppose -a = 29 - 31. Solve -az = z - 12 for z. 4 Let p(v) = -v*2 - v + 5. Suppose 4a - 5l = 4, -5a - 51 = 5l - 11. Let x be p(a). Let z = x + 11. Solve 0 = -3d - d + z for d. 1 Let r be 30/(-4)(-4)/6. Let m = r - 5. Suppose m = n - 4n. Solve 2 = -2w - nw for w. -1 Let j(k) = -k*3 - 5k*2 - k + 2. Let w be j(-5). Let m = -4 + w. Solve -my = -2y for y. 0 Suppose -j = 5a - 31, 3 = a - 2. Let w = -3 + j. Solve -2u - 1 = -w for u. 1 Let b be 1-2(2 - 3). Suppose -2t + 8 = 4l, 0 = -bt + 6t + 2l - 10. Suppose 5 = 3a - 2u, -ta - 2u - 4 = -7u. Solve 0 = -v + av - 4 for v. 2 Let u be 9/(-2)(-4)/3. Let v(r) = -4r*2 - 6r. Let k(w) = -w*2 + 1. Let d(m) = -3k(m) + v(m). Let f be d(-5). Solve fy + u + 2 = 0 for y. -4 Let w = 1 + -1. Let v = 13 - 26. Let t = v - -21. Solve 5g - t + 33 = w for g. -5 Let y(f) be the third derivative of f5/60 + f4/4 + f3/3 - f2. Let h be y(-6). Solve hl - 7 = 1 for l. 4 Let j(x) = x. Let g(s) = 4. Let l(w) = g(w) + j(w). Let c be l(-5). Let d be (c - -3)(-5)/(-2). Solve -d + 0 = -u for u. 5 Let c = 0 - -2. Solve -cd + d = -3 for d. 3 Suppose 3f - 6 + 0 = 0. Let i = f + -2. Suppose i = -5w + 11 + 19. Solve w = 5m - 3m for m. 3 Suppose -2 = 9i - 20. Solve -b - 1 - i = 0 for b. -3 Let k(w) = w*3 - 4w*2 + 2w. Let h be k(3). Let m be -2 + 1 + (2 - h). Let d = m - 0. Solve 0 = -0v + v + d for v. -4 Suppose 4v = -2o, 8 - 3 = 2o - v. Solve 3d = od for d. 0 Suppose -5b + 7 = -8. Solve bx - 2x - 5 = 0 for x. 5 Let a(v) = v3 + 5v*2 + 5v + 3. Let s be a(-5). Let x be (-15)/(-2)s/(-33). Solve 2y - xy = 9 for y. -3 Suppose -g + 19 = -4d + 2, -2g + 2d = -46. Solve t = -4t + g for t. 5 Let y = 25 - 13. Suppose 3i - y + 0 = 0. Solve 2n = n - i for n. -4 Suppose -2g + 125 = 3g. Suppose 0 = gp - 26p + 7. Solve pf = 2f + 20 for f. 4 Let g = -50 + 53. Solve gm - 7m + 4 = 0 for m. 1 Suppose -6 = -4q - 3z - 0, -3q = z - 7. Solve 2v - 15 = -qv for v. 3 Let x = 15 + -4. Let n = -6 + x. Suppose -5y + nd + 5 = 0, 5d - d - 8 = 0. Solve -7 = -v - y for v. 4 Let o(h) = 2h - 1. Let q be o(3). Solve 3 = qg + 13 for g. -2 Suppose 5v - 2m = 121, 0m - 98 = -4v + m. Let k(g) = g3 - g2 - 3g - 3. Let z be k(3). Solve s + v = zs for s. 5 Let h(x) = -2x. Suppose 2 + 4 = -v. Let s be h(v). Solve -5b + 8 = -s for b. 4 Suppose -2 = -2l - 0. Solve -f + 6 = l for f. 5 Let p = 35 + -33. Solve 0 = -2q - p - 6 for q. -4 Let d(n) = -n2 - 10n - 7. Let r be d(-9). Let y(z) = 3z2 - 3z + 2. Let j be y(r). Solve 7 = -3k - j for k. -5 Suppose 44r - 41r = 6. Solve -rk = -k - 1 for k. 1 Suppose -4t - 9 = 7. Let h(b) = b3 + 5b*2 + 4b. Let d be h(t). Solve d = -3m - 0m - 3 for m. -1 Suppose 4h = 3h + 8. Let g(l) = 9 + l*3 - 6l + 9l2 - 3l*2 + 0l**2. Let k be g(-7). Solve	{ "pile_set_name": "DM Mathematics" }
/3, -1/4, -4? 1/3 Let n = 64416/7 + -9202. What is the closest to 1 in 4, n, -3, -28? n Let g = 83 + -41. Let t = g - 42.01. Let q be 7 + 100/(-12) - 2/(-6). What is the closest to q in -3, 5, t? t Let j be (-18)/27 - (-133574)/(-132). Let x = j - -1013. Let r = 67/110 - x. Which is the nearest to r? (a) 2/5 (b) -1 (c) -0.3 a Let x = -60109 - -60066. Let q = -0.7 + 0.2. What is the closest to -1/4 in q, x, 5? q Let h = 149 - 149. Let k be (0 + h)/((0 + -8)/(-8)). What is the nearest to -1 in 2/21, 8/11, k? k Let u = -30 - -38. Let n(y) = -6y2 + 13y*2 + 4y + 5 - uy2. Let l be n(4). Which is the nearest to 0.1? (a) -1 (b) 12 (c) l a Let w = 1.647 - 1.947. What is the nearest to 2/25 in -5, 0.3, w, -12/7? 0.3 Suppose 2k + 10 = -f, -4f - 6 - 7 = -k. Which is the nearest to 1.7? (a) -6/11 (b) -1 (c) k (d) -4 a Let k = 56.3 + -55.3. Which is the nearest to k? (a) -271 (b) 0 (c) -1/5 b Let m = -1.99 + -0.01. Let u = 8104.6 - 7402. Let t = 703 - u. What is the closest to m in -5, 5, t? t Let q = 6074 + -6073. Which is the nearest to 23? (a) -3 (b) 4/11 (c) q (d) -0.2 c Let v = 0.756296 + -0.356296. Let r be 2/(-6) - 10/24. What is the nearest to 0 in r, -4, -3, v? v Let h = 0.02 + 3.98. Let i = 72.1 + -72. Which is the closest to i? (a) -1 (b) h (c) 0 c Let i(s) = -124s + 373. Let r be i(3). What is the nearest to r in 0.2, 3/7, -3/26? 3/7 Let m(h) = 20h - 3h2 - 161 + 145 + h2. Let j be m(9). Which is the nearest to 1? (a) -2/3 (b) j (c) -6/13 b Let u = 4671 - 4676. What is the closest to 6/7 in 5, -4, 39, u? 5 Let y = 2.101 + 0.899. Let f = -1.13 - -5.13. What is the nearest to 1 in 0.5, y, f, 5? 0.5 Let o = 2/819 + -4936/9009. Which is the closest to 2/5? (a) o (b) 8/7 (c) -1 b Let y = -1211.32 + 1247. Let s = -35.6 + y. Which is the closest to -0.1? (a) s (b) -3 (c) 0.3 a Let m = 1.57 - 1.37. Let d = 15 + -9. Let z = d + -3. Which is the nearest to 2? (a) -0.4 (b) z (c) m b Let p be ((-1)/12)/(1 - (-14)/(-8)). What is the nearest to p in 2, 0.5, -21, 2/9? 2/9 Let x be 41 - 53 - 3/(-1)16/6. Which is the closest to -0.3? (a) 0.4 (b) -0.7 (c) x (d) -0.05 d Let p(s) = -19s - 317. Let o be p(-17). What is the nearest to 1/2 in 6.3, 1/2, o? 1/2 Let x = -63 - -63.5. Let j = 3.16 - 0.76. Let c = j + -3.4. What is the nearest to c in x, 0, 5/6? 0 Let k = 174.91 + -176. Let x = k + 1.09. Let g = -12.9 - -12.1. Which is the closest to x? (a) 2/11 (b) -0.3 (c) g a Let r = 1.3485 + -2.2305. What is the closest to r in -0.3, 4, -0.1? -0.3 Suppose 6t + 9 = 3t, -66 = -3s + 4t. Suppose 0 = 4j - 5m + 25, -5j - 5m + s + 7 = 0. What is the closest to -10 in 0.3, -2, j? -2 Let a be (-1090)/(-1744)2/5. What is the nearest to 2/5 in 0.13, a, 2/5? 2/5 Let n = -0.01042 - 0.08958. Which is the closest to -0.2? (a) n (b) -5/4 (c) -0.2 (d) -8.7 c Suppose 3 - 11 = -3r - b, r = -4b + 10. Suppose -rl = 4 - 6. Let i = -28.8 - -29. What is the closest to l in i, 2, 4/5? 4/5 Let v be ((-6)/4)/(3/(-4)). Let q be 32/84 - ((-8)/(-3))/4. Which is the closest to 0.1? (a) q (b) v (c) 4 a Let j be (-2)/11 + 370/220. Which is the nearest to -1? (a) -4/3 (b) j (c) 2 (d) 4/3 a Let t = 199 - 198.897. Let u = t - -70.897. Let q = 70.9 - u. What is the nearest to -0.1 in -5, q, 0.02? q Let y = 196 - 195.896. Let h = -0.896 - y. Which is the nearest to h? (a) 2/27 (b) 0.4 (c) -2/3 c Let s = -3.1 + 3. Let y = -25.9 + 20.9. Let q = 3.1 - 2.6. Which is the nearest to s? (a) q (b) -2/7 (c) y b Let x be -3 + 2/(-21) + (-1346)/(-462). Which is the nearest to -2? (a) x (b) -2/9 (c) -2 (d) -17 c Let s be -64/(-24)(-1 + 0). Let o = 15 + -11.1. Let l = o - -0.1. Which is the nearest to s? (a) l (b) -1 (c) 0.1 b Let x = -5 - -7. Let r = -9675 - -9680. What is the nearest to x in r, 0.4, -0.5? 0.4 Let c be 1/((-8)/24) + (-7)/(-1). Suppose -4q + 5l + 45 = -0l, cl + 45 = 5q. What is the closest to -1 in q, 6, -4? -4 Let n(v) = -2v*3 - 4v*2 - 15v - 29. Let h be n(-2). Let l = -2 - -2. Which is the closest to h? (a) -0.4 (b) l (c) 5 b Let s = -34151 + 34148. Let m be (-399)/35 - 4/(-10). Which is the closest to 2? (a) s (b) -2/17 (c) m b Let f = 1.41963 - 1.41963. Let h = -7 + 4. Which is the closest to -1/2? (a) h (b) f (c) 32/7 b Let l = -0.36589 - -0.66589. Let v = 6 - 11. What is the nearest to 0 in l, -0.4, v? l Let t = -25.01584 - -0.01584. Let r = -0.0547 - 24.8453. Let p = r - t. What is the nearest to 0.1 in -4/5, -1, p? p Let l = 13187/99 - 1464/11. Let v = -2/101 - 95/303. Which is the nearest to 1? (a) 1 (b) l (c) v a Let x = -1171 - -542. Let h = x - -628.6. Let u = -1 - -1.1. Which is the closest to u? (a) 2 (b) -2 (c) h c Let z = 0.1 - 0.17. Let j = 150.2 - 150. What is the nearest to 1/4 in z, 4, j? j Suppose 0 = 336r - 57r - 558. Let g = 0 - -1. Which is the nearest to r? (a) -4 (b) -2/7 (c) g c Let l(x) = x - 116. Let g be l(0). Let w = -467/4 - g. Let z = 247.7 - 248. Which is the closest to w? (a) z (b) -0.4 (c) -2 b Let h = -64 + 449/7. Let a = 0.24684 - 0.44684. What is the nearest to h in 1/4, a, -0.7? 1/4 Let t = -51891/5 - -10378. Let r be (-27)/33 - (-2 - -1). Which is the closest to t? (a) r (b) -5 (c) 4 a Let u = 362 + -385. Let v = 113/5 + u. Let s be ((-2)/18)/((-2)/12). Which is the nearest to -3/8? (a) -5 (b) v (c) s b Let u = -0.19711 + 3.19711. Which is the closest to u? (a) -3 (b) 1/12 (c) -2/13 b Let o = -1222.4897 + 1223. Let a = -0.0103 + o. What is the nearest to -4 in 0.2, -1/2, 1/4, a? -1/2 Let z = -2 - -6. Let w = 10314 - 10308. Which is the nearest to -10? (a) w (b) 0.4 (c) z b Suppose 33m - 5 = 5k + 28m, -m - 1 = -2k. Which is the nearest to 3? (a) -1/5 (b) 4/7 (c) -2/7 (d) k d Suppose 4m - 3q = -q - 62, 1 = q. Let n be (-6)/(-9) - (-4)/m. Let x = 1677 + -3353/2. Which is the nearest to n? (a) x (b) -2/3 (c) -2 a Let t = -0.1 + 8.1. Let o = -0.0413 + -0.1587. Let k = 120/13 + -973/104. What is the nearest to -1 in o, t, k? o Let l = 46926 + -46926. Let i = 7.2 - 7. Which is the nearest to l? (a) 1/4 (b) 5 (c) -4 (d) i d Let p be (-16874)/858 - -45. Let d be 4/(-10)(-2)/4. Which is the closest to 2? (a) 54 (b) d (c) p c Suppose -11p + p = 110. Let i = p - -43/4. Which is the nearest to 0? (a) -1/2 (b) i (c) -0.2 c Let c = 15.4 + -15.3. Let f = 0.105 - -0.195. What is the nearest to 1 in c, 1/5, f? f Suppose 8s + 836 = 844. Let m be (3/9)/((-3)/45). Which is the closest to s? (a) -2/3 (b) m (c) -0.35 c Let p = 1793 + -5378/3. What is the closest to 0.5 in p, 4, 0.6, 5? 0.6 Let l = 278 - 277.7. What is the nearest to l in -1, -0.5, -0.058? -0.058 Let f be (-6 - 60/(-9))/(2/(-48)). Let z be -5f/(-120) + (-4)/3. Which is the closest to z? (a) -2/3 (b) 0.4 (c) 1/8 a Let n = 6 + -5. Let g be (2 + -3)/(n-1). Let d be (-44)/16 - 2380/(-784). Which is the nearest to g? (a) 4 (b) d (c) 0 b Let n = 177 - 169. Suppose 0 = 7k - 3k + n. Let v = -0.2 - -4.2. Which is the closest to 0.03? (a) v (b) 2/7 (c) k b Let n = 116 + -113. Let j = -945 + 945.1. What is the nearest to -2/5 in n, j, -0.8, 1? -0.8 Let q be 6/9 + 8/(-21). Let a = -32.816 + 33.216. What is the nearest to q in a, -8/5, -2? a Let d = 468 + -443. Which is the closest to -0.3? (a) -2/5 (b) d (c) 1/2 a Let p = -17 + 19.4. Let i = 2.5 - p. Let q = 2.53 - 2.13. Which is the nearest to i? (a) q (b) 1/4 (c) 1/9 c Let f = -0.91 + 0.61. Which is the nearest to 1? (a) f (b) -5 (c) 0 (d) -10 c Suppose 11 = u - 4k, -4k - 78 + 45 = -3u. What is the closest to u in -3, -2, 35? -2 Let i = -0.3164 + 0.0164. Let g = -89 - -86. Which is the closest to g? (a) -5 (b) i (c) 3 a Let r = 348 - 232. Let q = r - 116.1. What is the nearest to -1 in q, -0.5, 37? -0.5 Let m = -9/4 - -2. Let q be ((-2)/(-50))/(((-112)/364)/(310/(-403))). What is the nearest to m in q, 3, -5/4, -0.5? -0.5 Let j = -1888.23 - -1896.23. Suppose -27 = 4u + 3y, -2u - 5 = -4*y + 3. What is the closest to 0.1 in 0.3, u, j, -3? 0.3 Let o = -1167088/2805 + 7061/17. Let x = o - -3/55. Let l = -0.2 - -0.3. Which is the closest to x? (a) l (b) -5 (c) 1 a Let v = 13022 + -13117.892. Let s = 0.708 - v. Let z = 97 - s. Which is the closest to -1? (a) 4 (b) z (c) -5 b	{ "pile_set_name": "DM Mathematics" }
without replacement from qvfvvvjffvjjfvjj? 1/8 Two letters picked without replacement from iltixfitltl. What is prob of sequence it? 9/110 Three letters picked without replacement from {l: 1, w: 1, b: 4, k: 2, z: 1}. Give prob of sequence kbw. 1/63 Three letters picked without replacement from pypttyatpttyblty. Give prob of sequence yya. 1/280 Three letters picked without replacement from hhhhhshhhhhhhhhhhhss. Give prob of sequence ssh. 17/1140 Calculate prob of sequence vh when two letters picked without replacement from vfhfhffw. 1/28 Three letters picked without replacement from {n: 3, h: 2, j: 3, w: 1, u: 1}. Give prob of sequence uhj. 1/120 What is prob of sequence uoy when three letters picked without replacement from {y: 3, u: 2, o: 3}? 3/56 Calculate prob of sequence wwwv when four letters picked without replacement from {v: 2, p: 2, w: 3, e: 6}. 1/1430 What is prob of sequence mr when two letters picked without replacement from {x: 4, h: 4, r: 2, m: 4}? 4/91 Three letters picked without replacement from {e: 2, y: 1, l: 2, t: 4, o: 1}. Give prob of sequence ttl. 1/30 Four letters picked without replacement from {j: 4, m: 6, d: 5}. Give prob of sequence djjm. 1/91 Two letters picked without replacement from {j: 2, z: 1, m: 5, s: 1}. Give prob of sequence jm. 5/36 What is prob of sequence mdm when three letters picked without replacement from {i: 3, d: 3, k: 6, m: 5}? 1/68 Two letters picked without replacement from {i: 2, b: 1, o: 1, p: 3}. Give prob of sequence pi. 1/7 Calculate prob of sequence hm when two letters picked without replacement from kqkqhm. 1/30 Three letters picked without replacement from oqonoqqilooo. Give prob of sequence qoi. 3/220 Calculate prob of sequence xf when two letters picked without replacement from xfu. 1/6 Calculate prob of sequence iir when three letters picked without replacement from innnmininnrn. 1/220 Calculate prob of sequence oa when two letters picked without replacement from nonnrnoarjoaoonroa. 1/17 Three letters picked without replacement from {h: 4, v: 3}. What is prob of sequence vhh? 6/35 Calculate prob of sequence wu when two letters picked without replacement from {u: 1, t: 2, w: 2, j: 1, c: 1}. 1/21 What is prob of sequence ss when two letters picked without replacement from zssssszz? 5/14 What is prob of sequence uccb when four letters picked without replacement from cubbuuucuuucdbudu? 27/9520 What is prob of sequence azaz when four letters picked without replacement from azazazz? 3/35 Calculate prob of sequence hv when two letters picked without replacement from hvhhvvvvhh. 5/18 Calculate prob of sequence rooo when four letters picked without replacement from {o: 5, m: 1, r: 12}. 1/102 Calculate prob of sequence lb when two letters picked without replacement from {l: 1, b: 5, p: 4}. 1/18 Calculate prob of sequence xx when two letters picked without replacement from {h: 7, c: 4, x: 3}. 3/91 Three letters picked without replacement from illiliiitllti. What is prob of sequence ltl? 10/429 Calculate prob of sequence hsss when four letters picked without replacement from {s: 11, h: 2}. 3/26 Calculate prob of sequence mm when two letters picked without replacement from vmmivvvqs. 1/36 Calculate prob of sequence qj when two letters picked without replacement from qjqjqjqqqq. 7/30 What is prob of sequence eueu when four letters picked without replacement from geeoueeeeoeogggueee? 5/2584 What is prob of sequence pq when two letters picked without replacement from qqqqqpqqqp? 8/45 Three letters picked without replacement from {p: 3, k: 7, f: 2, m: 5}. Give prob of sequence fkk. 7/340 What is prob of sequence us when two letters picked without replacement from {d: 5, u: 1, o: 5, s: 4}? 2/105 Three letters picked without replacement from lalllgalccllgllgawwl. Give prob of sequence acc. 1/1140 Three letters picked without replacement from {x: 2, g: 9, a: 7}. What is prob of sequence xag? 7/272 Four letters picked without replacement from {e: 1, k: 2, d: 3, l: 1, y: 1, v: 3}. Give prob of sequence veyd. 1/880 Four letters picked without replacement from {v: 1, j: 1, m: 2, s: 3}. Give prob of sequence svsj. 1/140 Two letters picked without replacement from qqyiqpqqqiqqqqlllyp. What is prob of sequence qy? 10/171 Four letters picked without replacement from {c: 2, j: 2, g: 1, b: 1, d: 1, o: 13}. What is prob of sequence djoj? 13/58140 What is prob of sequence dzo when three letters picked without replacement from {o: 2, z: 1, d: 4}? 4/105 Calculate prob of sequence qb when two letters picked without replacement from qbqqbbbbqbqbbbbbqb. 4/17 Calculate prob of sequence yyyy when four letters picked without replacement from ryyryrrrryyry. 3/143 Two letters picked without replacement from qqqqoxqqqqqqqqq. What is prob of sequence oo? 0 Four letters picked without replacement from vbbbv. What is prob of sequence bbvb? 1/10 What is prob of sequence tty when three letters picked without replacement from {t: 2, y: 1}? 1/3 Three letters picked without replacement from {t: 2, a: 3, j: 9, v: 5}. What is prob of sequence jvv? 10/323 Four letters picked without replacement from cococococc. Give prob of sequence ococ. 1/14 Calculate prob of sequence ffff when four letters picked without replacement from fgfffffg. 3/14 Calculate prob of sequence bgtt when four letters picked without replacement from gtvggggbg. 0 Four letters picked without replacement from {y: 5, h: 9}. What is prob of sequence yhhy? 60/1001 Calculate prob of sequence lt when two letters picked without replacement from xyhtllyyy. 1/36 Calculate prob of sequence tei when three letters picked without replacement from etzzi. 1/60 What is prob of sequence pkvp when four letters picked without replacement from {k: 1, q: 5, p: 9, g: 2, v: 1}? 1/1020 What is prob of sequence phh when three letters picked without replacement from {h: 5, p: 2, j: 3, x: 1, c: 5}? 1/84 Calculate prob of sequence idqx when four letters picked without replacement from diiqjdixjijdi. 1/1144 Calculate prob of sequence xpz when three letters picked without replacement from {x: 1, e: 2, o: 1, u: 2, z: 1, p: 2}. 1/252 Three letters picked without replacement from {e: 10}. What is prob of sequence eee? 1 What is prob of sequence bt when two letters picked without replacement from {t: 2, b: 2, i: 1, n: 1, l: 1, q: 1}? 1/14 Four letters picked without replacement from {q: 2, u: 2, a: 3, p: 4, m: 2}. Give prob of sequence mpap. 3/715 Two letters picked without replacement from nfolzhl. What is prob of sequence fn? 1/42 Three letters picked without replacement from {m: 1, e: 4, z: 7, i: 2, c: 4}. What is prob of sequence emi? 1/612 What is prob of sequence pttp when four letters picked without replacement from {m: 2, t: 4, p: 4, a: 4}? 6/1001 Three letters picked without replacement from {n: 1, q: 5, g: 7, f: 1}. What is prob of sequence nfg? 1/312 Two letters picked without replacement from {y: 5, m: 7}. What is prob of sequence yy? 5/33 Four letters picked without replacement from mmmtmmtmott. Give prob of sequence mtmt. 1/22 Calculate prob of sequence pdcg when four letters picked without replacement from dgpcpg. 1/90 What is prob of sequence qsmi when four letters picked without replacement from {m: 10, i: 1, q: 1, v: 1, n: 3, s: 3}? 5/15504 What is prob of sequence aa when two letters picked without replacement from {h: 2, a: 4}? 2/5 Three letters picked without replacement from wwwwwwwwwofwwww. Give prob of sequence oww. 2/35 What is prob of sequence npn when three letters picked without replacement from gncrqpqprpr? 0 Three letters picked without replacement from {w: 1, t: 5, d: 11, r: 1, e: 2}. Give prob of sequence wet. 1/684 Calculate prob of sequence kkk when three letters picked without replacement from kkkkk. 1 Two letters picked without replacement from xzznxnxiyzxi. Give prob of sequence yi. 1/66 Four letters picked without replacement from {i: 2, u: 2, d: 2, k: 1, j: 4, l: 6}. Give prob of sequence jlkl. 1/476 Four letters picked without replacement from btbtbbbbbbtttb. What is prob of sequence bbtt? 60/1001 What is prob of sequence gdd when three letters picked without replacement from {b: 2, d: 2, g: 1}? 1/30 Calculate prob of sequence nt when two letters picked with	{ "pile_set_name": "DM Mathematics" }
hat is (6(-2)/(-30))/(101/(233310/396))? 7/3 Calculate 11/(1782/(-144))(6 - 0 - 15). 8 Calculate ((-2486015)/(-539))/73 + 10/(-55). 63 What is the value of ((-18468)/(-8550))/((-14)/(-175))? 27 Calculate ((126/4)/1 + -3)/((-301)/602). -57 Evaluate (69 - 20069/294)42. 31 Evaluate 294750/1575 + -203 - 19-1. 22/7 (-5)/1 - (53 - (-5336)/(-92)) 0 (-325 - -298)(7 - (-28)/(-6)) -63 Evaluate -31 + ((-2)/69)/((-2108)/216597). -1/46 What is ((-6440)/(-1127))/(130/210 + ((-20)/15 - -1))? 20 What is ((-10)/(-3))/(3(-4)/18)(-4412)/159935? 4/29 Calculate (7/(-5 + 54))/((-2561)/(-4137)). 3/13 Evaluate 3434/(-3366) - (-1)/(-11). -10/9 (25929/(-670))/(18/(-65)) - 51/(-4) 141 Calculate 1554/(-37) - (-36 - (-1 + -9)). -16 What is ((-594)/117)/11 + (-238)/18231? -41 Calculate 2880/(-2080) + 1700/26. 64 Calculate (-1056)/(-30)2455/(-1964). -44 Evaluate (((-6 - -5)/2)/((-3)/(-282)))/1. -47 -6 - 260718/(-8856) - 6/(-8) 2/41 What is the value of ((-323532)/(-32680))/(6/(-40))? -66 Evaluate (-42)/15 - 73786/(-16345). 12/7 What is the value of ((-6194)/(-489))/(10/(-15))? -19 ((-112)/20 + 3)/((-9835)/175 - -56) 13 Calculate (10/(-11))/((-128)/(-128)). -10/11 What is ((10/(-3514))/(3985/3188))/(4/(-14) - 0)? 2/251 What is the value of (-32143098)/1147562 + 31 + -3? -1/101 Evaluate ((-126)/(-112) - 57/(-152))/((-1 + 2)/(-6)). -9 What is the value of (-8)/168 + ((-21240)/14700)/(45/(-70))? 11/5 What is the value of 36/(-3) - (-2)/(-6)(86 - 26)? -32 Evaluate -70 + (-71168)/(-832) + -114. 20/13 Evaluate 8/(-5)-495(-35)/(-630). 44 (-2)/2((-1264)/79 - -5) 11 Evaluate 35/(-33 - -38) - 3. 4 What is the value of 139460/51380 + 9/(126/(-32))? 3/7 Calculate 2613688/(-950432)(2/(-7) + 391/(-77)). 59/4 What is (-4)/(-25) - ((-6711312)/(-600))/(-178)? 63 What is (21892/82095)/(68/(-6))? -2/85 ((-48)/120)/(((-750)/39375)/(2/(-14))) -3 Evaluate 5075/223301320/50. 6 What is the value of (-14)/(-217) + (-30 - (-143416)/806 - -4)? 152 Calculate (324/(-252))/(7569/609). -3/29 What is -1 + 121/(-11) - (-90)/10? -3 What is (31/2)/(312/(-624))1(-6 - -5)? 31 Evaluate 3 - 3 - (156/(-15))/(14/(-35)). -26 What is the value of -133 + (-2 - (-128 + -80))? 73 Calculate 6174/2142 - (-6)/(-10)(6 - 1). -2/17 What is the value of 55167/(-102564) - 4/(-48)? -5/11 What is (((53 - 45) + 3)3/33)/(95/(-2))? -2/95 Evaluate 89 + -53322/120. 2/15 Evaluate (261/(46 - 37))/(-1) + 107. 78 Evaluate ((-124)/(-775)4/16)/(14/(-4) + 3). -2/25 (9212/343)/(18/21)78/(-52) -47 What is (-16)/6 - -126(-166)/8964? -5 Calculate (-10 + 1045/(-38))(-84)/(-70). -45 Evaluate ((-150350)/162475)/(6/(-227)) - 35. 2/201 Calculate (-13664)/(-244) + (630/7)/9. 66 Evaluate (-65001)/672 + (-715)/(-4576) + 3/(-7). -97 57316/8372 - (-4)/26 - (6 + (-7 - 0)) 8 Evaluate (-10388)/(-168)((-51)/42 + 1)10/10. -53/4 What is -1161(-8)/(-56)1? -23 Calculate (2 + -6 + 96/27)/(2788/123). -1/51 What is ((-229900)/2394 - -96)/(3/(-168))? 16/9 What is 60/(-150) - ((-20286)/(-1485))/(-49)? -4/33 Calculate (-75 - 11340/(-147))(-7)/12. -5/4 Evaluate 3654/(-56637) + -94(-10)/8463. -2/91 What is (-7917)/(-4524) - 1084/16? -66 13/(-1196) - (-296286)/4232 70 What is the value of ((-749)/91 - -8) + (-330)/(-78) - 2646/675? 2/25 What is the value of (42 + -9)(1300/90 + -14) + -15? -1/3 (15022/17168)/((-15)/8) -7/15 Calculate ((-9432)/744 + 13)18/(-30). -6/31 Evaluate 2424032/4679081 + 18/(-33). -2/73 What is the value of (-5852)/(-247) + -24 + (-435)/(-1625)? -1/25 Evaluate 94/(-130) - (-253)/(31625/100). 1/13 (7524/(-66) - -122)/((-104)/(-30)) 30/13 (-22970)/20673 + 4/(-9) -14/9 What is 777/21 + (-139041)/3759? 2/179 Calculate (95/(-10) - -1)/((-13)/455 - (-45)/(-1050)). 119 Evaluate -5 + 0 - ((-5)/1007)/(308/3696). -4/5 564/((-7360)/1817) -79 Calculate 14/(((-3906)/(-27))/31) + -68. -65 Evaluate ((-132)/(-60) + -1 + -2)/(51/(56 + -821)). 12 (1626750/(-1140))/75 + 19 -1/38 -52 + 84060/1620 - (-1 + 188/9 - 1) -19 Calculate (3 + 7 + (-12 - -4))/((-2)/(-31)). 31 Calculate ((-50)/(-14))/((-180)/14 + -27325/(-525)). 25 What is (320/(-260))/(8(-16)/832)? 8 146/(-2) - 3861019/(-52775) 4/25 (0 - (-8)/(-252))(-18)/(-432)(65 - 9) -2/27 What is the value of 66454/(-1338) - (-1 - (-24)/(-9))? -46 Calculate 60 - 63/84-2((-60)/(-9))/(-5). 58 -2924/(-7656) + ((-4140)/44 - -2) -92 What is (1 - (7/3 - 2))(-110085)/1790? -41 (-17)/(204/64)(-1365)/364 20 What is the value of (-1 - (-4)/3)(-22)/(4796/25506)? -39 Calculate 2594/(-6485)10/274. -2/137 What is the value of (13/234(-9)/15)/((-8)/(-10))? -1/24 What is the value of (3/10)/(-25(-990)/15000)? 2/11 Evaluate (-3)/2(3024/2268)/(2/(-66)). 66 Calculate 4 - 1 - (-36 + 18 + 8). 13 What is (-4)/(7636/249((-5)/(-5) - (-25)/(-10)))? 2/23 20((-10)/(-8)5334/(-3175) + (-2)/(-4)) -32 (338208/216)/(-52) - (20 - 50) -1/9 Calculate (-150)/16 + 0 + 172/21560/8. -27/8 (-9)/(-15) + (-1314)/90 + (-4104)/(-306) + 0 -10/17 What is (-15080)/(-374400) + (-4)/(-180)? 1/16 What is (2/(-15) - 1/5)54/(55350/41)? -1/75 Calculate (2052/(-14877))/((-12)/(-1566)). -18 What is (((-3738)/(-168))/(-89))/((-6)/32)? 4/3 What is the value of 8/(561/(-11220) - 1202/(-40))? 4/15 (-284)/20 + (-289536)/(-5655) 37 What is 8/22(-254163)/13034? -78/11 (-97 - 345427/(-3568))/(13/(-8)) 3/26 What is the value of (1317384/1647)/(-57) + (-4)/(-122)? -14 Evaluate (0 - 1)(-180)/(-630) + 226/7 - -4. 36 Calculate 572/2211/(-6) - 1177/(-321). -44 What is the value of 9/(-6)3/(42/(-656))66913/(-57354)? -82 Calculate ((2175/(-100))/87)/((-7)/(-44)). -11/7 Evaluate (30 - (-13860)/(-270))/2. -32/3 Evaluate -39 + 37 - (-18)/(-2)6(-11)/198. 1 What is the value of (-2535)/115 + (-282)/(-6486)? -22 What is the value of (18/33 + 4466/94743 + 4/54)2? 4/3 Evaluate (-1206)/(-6180) + (13/85 - 516/6286643). -1/206 What is (18 + (42750/133)/(-18))/(54/63)? 1/6 Calculate ((2 - 4)/(-290))/(109/((-1090)/4)). -1/58 What is (-19)/((-4332)/24) + (41923/8778)/(-53)? 1/66 What is the value of (-4904)/2680 - 249/(-747)135/25? -2/67 (16/(-28)-1)/(304/(-58 - 18)) -1/7 (-4)/10(-521)/104220/(-3) -4/3 What is the value of (72/(-69) + 1)/((-72)/120 + (-8)/(-10))? -5/23 Evaluate -31 - 18 - (-1)/((-266)/252 - -1). -67 Evaluate -24/14((-297)/6 - -32). 10 Calculate 3 + (5 - 9) + 238/(5 - 19). -18 Evaluate ((-14456)/(-4587))/(34/561). 52 What is the value of (-3)/(-2 - 507/(-258))(-823)/(-1646)? 43 (5 + (-15 - -21) - -11) + -3 19 Calculate -2 - (-741)/55 - (-6849)/(-25113). 56/5 What is the value of (-11 + -635)/34 + 13? -6 Calculate 22/154 + (-5529)/(-399). 14 (108417/(-44792) + 12/22)/(1/(-8)) 15 Evaluate (10 - (-10413)/(-1035))405/(-1134). 1/46 Calculate (207870/95940)/(2/(-60)). -65 Calculate (3549/(-810) - -2)-415(-18)/3. -83 Calculate (-5 - -8)/(30/(-570)). -57 Calculate -1 + -38(-4)/72 - (620340/(-11880))/(-49). 1/22 Evaluate 11 - (203/28 + (40 - 31)). -21/4 Calculate -39 - (-64 - (44 + -63)). 6 What is (-70)/((-2800)/1160) + (-835)/25? -22/5 What is (-28)/((-896)/48)12/(-2)? -9 What is 130/(-4)(2016/(-117))/56? 10 Calculate 102343/(-774). -17 53 - (-63 - -120) - ((-26)/(-12))/(4/12) -21/2 What is 27/9 + ((-680)/16)/(10/(-8))? 37 Calculate (((-162006)/(-335))/(-39))/((-4)/10). 31 What is (-837)/(-1581)(44/(-9))/11? -4/17 Evaluate (-5 - 0) + (-310 - -221 - -78). -16 What is the value of ((-9)/633)/((-273)/21 + 10)? 1/7 Evaluate 24 + (463 - 12)108/(-594). -58 What is 34/(-160) - ((-48026)/590 - -81)? 3/16 -9 + ((-2324)/(-84) - 14) 14/3 Calculate 10225/(-175) - (-1 + -58). 4/7 What is (((-9)/(-4))/(306/816))/27? 2/9 -78 - (-15525)/200 - (-362)/112 20/7 3/13 + (-132132)/(-7436) 18 Evaluate ((-148)/518 + 122/(-14))(480/36 + -18). 42 What is (-60)/(-18) + (-14)/(-104)-24? 4/39 1050/600 - 135/4200158/3 2/35 What is (-1338)/3122 - ((-8)/32 - (-318)/(-56))? 11/2 ((-776)/582)/(((-50)/435)/5) 58 What is the value of (-2)/(-18) + 13176803/662724 + 20-1? -1/164 What is the value of ((-20)/(-21) + (-6)/7)/(153/631)? 2/51 What is (-22 - (-7)/(63/188))/((-1)/(-9)) + 44? 34 Evaluate 70/26157079/(-36249). -35/3 Calculate 13-1 - (-122220)/(-11640) - 1/(-2)*9. -19 What is (77 - (-194112)/(-2520))/((-1)/21)? 3/5 Calculate 5073/4806 + 6/(-18) + (-21)/(-27). 3/2 What is the value of 129 + 219635/(-1705) - ((-380)/572 + 2 + 0)? -15/1	{ "pile_set_name": "DM Mathematics" }
o3 - 4o*2 - 2o + 1. Let g be u(-2). Let k(w) be the second derivative of w*3/3 - 3w*2/2 + 2w. Calculate k(g). 7 Let j(w) = -3w + 5. Let y be j(4). Let p = y - -11. Let f(r) = r3 - 4r*2 + pr - 2 - 4r + 4r. Determine f(2). -2 Let l = 16 + -8. Suppose 0 = u + 3u + l, -3r - u - 11 = 0. Let h be r + 0 - (-5 + -2). Let s(v) = v*3 - 3v*2 - 6v + 2. What is s(h)? -6 Suppose 0 = 2q - 2 - 4. Suppose -5c + 12 = -2d, qd + c - 8 - 8 = 0. Let o(p) = p*3 - 5p*2 + 7p - 5. Give o(d). 7 Let j(t) = 2t2 + 0t*3 + 4 - 3t2 - t3 + t. Let r = -50 - -50. Calculate j(r). 4 Let l = 10 + -4. Suppose -y + l = y. Let m(a) = 2a3 - 3a*2 + 11a - 6. Let n(w) = w3 - w2 + 6w - 3. Let c(p) = 3m(p) - 5n(p). Calculate c(y). -3 Let a(p) = 0 + 1 - 3 - 2p. Determine a(-4). 6 Let u(d) = -2d2 - 2d. Suppose p - 3a = 8 + 9, 5a + 21 = -2p. Calculate u(p). -12 Let q(y) = 3y*2 + 3y - 4. Let t(z) = -z*2 + 1. Let c(f) = -q(f) + t(f). Let x(j) = 3j*2 + 3j - 4. Let o(m) = -2c(m) - 3x(m). Calculate o(2). -8 Let c(u) = 2u2 + 6u - 4. Let h(x) = -x*2 - 3x + 2. Let v(g) = -6c(g) - 13h(g). Let t(i) = -i + 25. Let k be t(18). Let f = k - 5. Calculate v(f). 8 Let n(k) = -3k3 - 11k*2 + 6k - 6. Let f(l) = 2l3 + 6l*2 - 3l + 3. Let o(m) = -5f(m) - 3n(m). Give o(3). -6 Suppose -5b = 4z + 26, 9 + 25 = -5b + 4z. Let u(m) = m - 7. What is u(b)? -13 Let b(y) = -2y + 3y - y - y - 8. Let r be b(-10). Let j = 1 - r. Let h(a) = -a2 - a + 1. Determine h(j). 1 Let v(j) = -j2 + 8j - 6. Let k be v(6). Let r be (-6)/k - 51. Let u(n) = 1 + 5n + 2n2 - n2 + n. Calculate u(r). 1 Let x(h) = -h - 13. Let l(k) = 2k - 2. Let a be l(1). Let v be (-3)/6a/3. Calculate x(v). -13 Let x(a) = -2a3 - a2 - a + 4. Let w(b) = b3 - 4. Let j(f) = -3w(f) - 2x(f). Determine j(-3). -11 Let a(j) = -2j*3 - 23j*2 - 16j + 3. Let x(i) = -i*3 - 12i*2 - 8i + 2. Let t(m) = -4a(m) + 7x(m). Give t(-7). -5 Let s be (-2)/17 - (-192)/(-102). Let m(v) = v*3 + 2. What is m(s)? -6 Let k be ((-3)/2)/(2/(-8)). Let j be k((-27)/6 + 4). Let d(w) = -w*2 - 5w - 4. What is d(j)? 2 Let v(u) = -u + u*2 - 7u*2 + 0u3 + 4 - u3. What is v(-6)? 10 Let c(s) = 5 - s - s*2 + 4s*2 - 2s*2 + 9s. Calculate c(-7). -2 Let u(r) = -6r2 - 4r - 4. Let x be u(-1). Let z(k) be the second derivative of 5/12k4 - k + 0 + 1/20k*5 - 7/6k3 - k2. Calculate z(x). 4 Let g(o) = 3o - 1. Let j be g(1). Let a(r) = r3 + 2r*2 - r + 4. Let t be a(-3). Let l = t - j. Let p(u) = -2u. Give p(l). 8 Suppose 0z = -3z + 18. Let m(i) = -i - 1. Calculate m(z). -7 Let o(t) = -3t - 21. Let v be o(-8). Let h(c) = -c3 + 3c*2 - 4c + 2. What is h(v)? -10 Let t(m) = -m*2 + 1. Let c be 8 + 0 + 2/1. Suppose 0 = n + 3l + c + 3, 3l + 11 = n. Give t(n). 0 Suppose 0x = -4x + 20. Suppose -xr - 6 = -2a, a - 4a - 5r + 9 = 0. Let w be 1/(a/(-33)). Let y(o) = -o*2. Determine y(w). -9 Let r be 20/(-50) - 34/(-60). Let d(c) be the second derivative of 0 - c - rc*3 - 1/2c*2. Calculate d(2). -3 Suppose 5z + 20 = -m, -m - 12 = 3z - 0m. Let q(n) be the second derivative of n3/6 + n2 + n. Give q(z). -2 Let o(t) = t3 + t2 + t + 4. Let p be o(0). Let c(h) = h - 4h + 0h + ph. Let u(a) = 2a*2 + 10a. Let g(r) = -10c(r) + u(r). What is g(2)? 8 Let b(m) = -m2 - m + 4. Let o(k) = k. Let q(j) = b(j) + 6o(j). Suppose -6 = 6z + 42. Let w be (-1)/((z/(-12))/(-2)). Calculate q(w). 10 Let y be 2 - (1 - (-3 + 1)). Let h = y + 5. Let m(a) = -a + 4. Calculate m(h). 0 Let j(l) = -l3 + 5l2 - l - 2. Let w(v) be the second derivative of v3/6 + 2v2 + v. Suppose 0 = -m - m. Let c be w(m). Give j(c). 10 Let v(r) = r2 - 4. Let g(x) = x2 - x + 1. Let b(c) = 2g(c) + v(c). Calculate b(2). 6 Let a(y) = -4y2 - y. Let v = 3 + -5. Let m = v + 3. What is a(m)? -5 Let j(b) = b - 9. Suppose 0 = -p + 4p - 18. Suppose 16 = -pn + 2n. Let z(v) = 1. Let g(q) = nz(q) - j(q). Calculate g(5). 0 Let h(z) = 61z - 3 + 4 - 61z - 3z*2. Give h(-1). -2 Suppose -30 = 2f + 3f. Let p(g) = g3 + 5g*2 - 7g - 2. What is p(f)? 4 Suppose -20 = -3l - l. Let h(j) be the third derivative of -j6/120 + j5/15 + 5j*4/24 + 5j3/6 + j2. Calculate h(l). 5 Let m(r) = r - 2r + r2 - 5r + 4. Suppose -5y + 8 + 0 = -4q, q = -y + 7. What is m(q)? -5 Let z(x) be the third derivative of -x*5/60 - 5x*4/24 + 2x*3/3 - 11x*2. What is z(-6)? -2 Suppose 0c = 2c - 10. Let a(y) be the first derivative of -y3/3 + 3y*2 - y + 10. Give a(c). 4 Let h = 7 + -5. Let a(g) = -3 - hg + 4 + 0g. Suppose 0 = 3f + 4 - 16. What is a(f)? -7 Let v be 4/14 + 692/28. Suppose -20 = -3x + w, x = 2x - 4w - v. Let c(y) = y2 - 2 - y - xy*2 - 3 + 3y*2. What is c(0)? -5 Let b(t) = 20t + t*2 - 13t - t - 4. What is b(-7)? 3 Let z(x) be the second derivative of -3/2x2 - 3x + 1/6x4 + 0 - 1/2x*3 + 1/10x*5. Let a be -3 - (0 - (-1 + 2)). What is z(a)? -5 Let u = 17 - 11. Let o(k) be the third derivative of -1/4k*4 - 4/3k*3 + 0k + 1/60k5 + 4k*2 + 0. Calculate o(u). -8 Let g(f) = 10f*2 - 1. Suppose 4j - 2j - 8 = 0. Suppose -jn - 4 = -0. What is g(n)? 9 Let n(w) = 15w3 + 7 - 20 - 11w - 3w2 + 4w2 + w2. Let l(b) = -7b3 - b2 + 5b + 6. Let m(j) = 13l(j) + 6n(j). Calculate m(0). 0 Let c(b) = -5b3 - b2 + 1. Suppose -2p - 10 = -4p + 4l, -4p + 4l = -12. Calculate c(p). -5 Let g be (8/10)/(4/10). Let u(s) = 0s3 - 2s*3 + 9s*2 - 2sg + 1 + s3 - 5s. What is u(6)? 7 Let h(o) = o3 + 4o*2 + 3o - 4. Suppose 2k + 2 = 5w - 9, 3k - 2w = 0. Suppose 2v + 9 = ky - v, -5v - 31 = 2y. Give h(y). -4 Let t(a) = -a*2 + 2a. Suppose -2w = 5f + 7 - 3, -3f = 2w. Suppose -5o = -42 - w. Let r = 12 - o. What is t(r)? -3 Let g(d) = -3d - 8. Let h(m) = -6m - 17. Let x(a) = 9g(a) - 4h(a). Determine x(-3). 5 Let j(u) be the second derivative of -u5/20 - u4/6 + u3 + u2/2 + 16u. What is j(-4)? 9 Suppose 4p + 0 = 20. Suppose 2r + p = 7r. Let b(x) = 10x*2 - x. What is b(r)? 9 Let q(p) = 0 + p - 1 + 3 + 3. Suppose 0 = -3x - 2 + 14. Calculate q(x). 9 Let m(w) = 3w - 2. Let d(p) = -p - 20. Let y be d(-16). Calculate m(y). -14 Let r(b) be the first derivative of -5b4/24 + b3/2 - 3b2 + 2. Let k(s) be the second derivative of r(s). Give k(4). -17 Suppose 0 = 3k - 2i - 8, 2k + 4i + 6 = 3k. Suppose -kw = 3w - o - 12, -2w = 4o + 4. Let m(c) = -c + 1. Give m(w). -1 Let h be ((-4)/5)/(16/160). Let s(z) = -2z - 1. Calculate s(h). 15 Let g be 2/(-7) - 23/(-7). Let t(p) = -p2 + 4. Let u be t(0). Let y(n) = 1 + un*3 - 4n*2 - 3n3 + 1. Calculate y(g). -7 Let t(h) be the first derivative of -h3/3 + 3h2 - 4h + 4. Suppose -6 = -5x + 4. Let y = x - -2. Calculate t(y). 4 Let h(t) = t2 - 11t + 9. Let n be h(10). Let l(j) = 13j2 - j. Give l(n). 14 Let w(l) = 5 - 3l*2 + 4l*2 + 4l - 4. What is w(-5)? 6 Let h(x) = -x*2. Let a(n) = -2n*2 + n + 1. Let i(g) = a(g) + 5h(g). Suppose j + 1 + 12 = -3s, 4j + 12 = -2s. Let o = 3 + s. What is i(o)? -7 Let p be 7/(21/(-6)) + -1 - -9. Let d(t) = -t + 1. Calculate d(p). -5 Let s(o) = o3 - 6. Suppose 0 = -18n + 23n. Calculate s(n). -6 Suppose 2i = 5 + 1. Let l(a) be the second derivative of -7/2a2 + 2a + 1/2ai + 0. Calculate l(5). 8 Let t(u) = -u2 - 6u - 5. Let v(f) = 2f2 + 12f + 11. Let x(q) = -5t(q) - 2v(q). Let w = 19 + -23. Determine x(w). -5 Let j be (-2)/(-2) - (-8 - -4). Let b(p) = p - 1. Calculate b(j). 4 Suppose 0 = -5b + 7b - 3g - 18, -4b + 20 = -2g. Let l(o) be the first derivative of -o3/3 + 5o2/2 + o - 10. Determine l(b). 7 Let j(y) = -3. Let q(u) be the second derivative of -u3/6 - u*2 + u. Let d(l) = -3j(l) + 2q(l). Calculate d(5). -5 Let j be (-3)/(-12) - 22/(-8). Suppose -5x + j = -12. Let m(g) = 7g2 - g - 10. Let i(a) = -6a*2 + a + 9. Let q(c) = -6i(c) - 5m(c). Give q(x). 2 Let a(u) = 3u - 3 + 5u - 6u + 2u. Calculate a(5). 17 Let o(s) = 4s2 - s - 1. Let a be o(-1). Let u(t) = -t3 + 5t + 1 + at*2 - 8 - 3t*2 - 5t2. Determine u(-5). -7 Let s(t) be the third derivative of t6/120 + t5/30 - t4/24 - t*3/2 + 13t*2. What is s(-3)? -9 Suppose 5 = -i - 2f, -6*i +	{ "pile_set_name": "DM Mathematics" }
ivided by r. 10 Calculate the remainder when 4 is divided by ((-5)/(-30))/(2/12). 0 Let i be (-31)/((-33)/(-12) + -3). Suppose -d - d + i = 3n, -5d - 20 = 0. What is the remainder when n is divided by 12? 8 Let n be ((-3)/9)/1-9. Suppose -nt - 5 = -8t. Let f(q) = 9q + 1. Calculate the remainder when 29 is divided by f(t). 9 Suppose 5s + 4p - 74 = 12, -32 = -2s - 4p. Calculate the remainder when 71 is divided by s. 17 Suppose -4a + 0a + 36 = 0. Let m = a + 0. Calculate the remainder when 34 is divided by m. 7 Let y(c) = 124c + 4. Let g be y(3). Suppose -g = -3l - l. What is the remainder when l is divided by 24? 22 Let a = -23 + 31. What is the remainder when a is divided by 3? 2 Let g be (-26)/7 - (-2)/(-7). Let x = -12 - -34. Calculate the remainder when (-1)/(-2)g - -65 is divided by x. 19 Let l be (-425)/(-15) + 4/6. What is the remainder when 3/3l1 is divided by 10? 9 Let m(c) be the first derivative of c4/4 + 7c3/3 - c2 - 7c - 1. Let b be m(-7). Let j = b - -9. Calculate the remainder when 47 is divided by j. 15 Suppose -2m - 15 = m + 3k, -4m - k = 20. Let t(n) = n*3 + 6n*2 + 6n - 1. Let w be t(m). Let d = w - -12. What is the remainder when 10 is divided by d? 4 Let v(f) = f*3 + 15f*2 + 14f + 8. Let i be v(-14). Suppose n - i = -0n. Suppose 0 = -4r - 0r + 124. What is the remainder when r is divided by n? 7 Suppose 2j = 3m - 19, -2j = -4m + 10 + 16. What is the remainder when (-98)/(-10) + (-3)/(-15) is divided by m? 3 Let o(j) = j2 - 1. Let g(u) = 4u*2 - 8. Let m(c) = g(c) - 3o(c). Suppose -22 = -5s + 3s. Calculate the remainder when m(5) is divided by s. 9 Let v(u) = u*2 - 8u - 1. Let i be v(6). Let c = -6 - i. Calculate the remainder when 13 is divided by c. 6 Let k(b) = -b*3 + 3b*2 + 3b + 2. Let r = 2 + 1. What is the remainder when k(r) is divided by 4? 3 Let r(w) = w*3 - 4w*2 - 8w. Suppose 4n = 12 + 52. Suppose 3 = -s + n. Calculate the remainder when r(6) is divided by s. 11 Suppose 2o = -4c + 220, 0o = 3c - 4o - 143. Let z = c + -28. What is the remainder when z is divided by 14? 11 Suppose -3v + 1 = -5. Suppose -vt - 28 = -6t. What is the remainder when 20 is divided by t? 6 Suppose 4j + 52 = -0j. Let u = -4 - j. What is the remainder when 24 is divided by u? 6 Suppose -2w + 0 = -y - 3, 3w - 5 = 2y. Suppose 3n - 5 = w. Let i = 0 - -1. Calculate the remainder when n is divided by i. 0 Let p = -74 + 103. What is the remainder when p is divided by 8? 5 Suppose -6h + 11h = 115. Let n(c) = -c3 + 8c*2 + 4c - 5. Calculate the remainder when n(5) is divided by h. 21 Let p = 133 + -106. What is the remainder when 51 is divided by p? 24 Let o = 18 - 9. Suppose om = 4m + 85. Calculate the remainder when 31 is divided by m. 14 Suppose -c - b + 33 = 0, c + 5b - 25 = -0b. Calculate the remainder when c is divided by 18. 17 Suppose 24 = -o - 3o. Let c = 10 - o. Suppose -5y + c = -4y. Calculate the remainder when y is divided by 6. 4 Suppose n + 744 = -2n. Let r(o) = 4o2 + 3o - 1. What is the remainder when r(-3) is divided by n/(-18) + (-4)/(-18)? 12 Let p be 0/1 - (-30)/(-5). Let a = 22 + p. Suppose 3j - a = j. What is the remainder when 13 is divided by j? 5 Let d(n) be the second derivative of n4/12 - n3/2 + 3n. Let p be (-3 - 9)(-2)/4. Calculate the remainder when 52 is divided by d(p). 16 Let s = 20 + -15. Suppose -4d + sd - 8 = 0. Suppose 4n + 2j - 60 = 0, -2n + 0j = 5j - 30. Calculate the remainder when n is divided by d. 7 Let t be -3 - (2 + -3 + -15). Let d(x) = x*2 - 11x + 10. What is the remainder when d(t) is divided by 4/10 - (-93)/5? 17 Let n = 12 + -6. Let h(j) = -j*3 + 8j*2 - 8j - 6. What is the remainder when h(n) is divided by 10? 8 Let h(y) = 3y + 12. What is the remainder when h(14) is divided by 19? 16 Let u be (0/2)/((-10)/5). Suppose 3t + t - 24 = u. What is the remainder when 10 is divided by (t/(-8))/((-3)/12)? 1 Let c(w) = 4w - 19. Calculate the remainder when 42 is divided by c(6). 2 Let q = -6 + 16. Calculate the remainder when 38 is divided by q. 8 Suppose -7 = -5g + 3d + 11, -d = 5g - 14. Let p = 418 + -206. What is the remainder when 4/(-26) + p/26 is divided by g? 2 Let v(g) = 7g. What is the remainder when 146 is divided by v(7)? 48 Let z(d) = -2d - 13. Let a be z(-11). Let x(s) = -5s2 - 4s - 3. Let g be x(a). Calculate the remainder when g/(-14) - 8/(-28) is divided by 17. 15 Let a be ((-3)/(-1))/((-7)/(-7)). Suppose o = -ao + 236. Calculate the remainder when o is divided by 30. 29 Suppose 93 - 37 = 2g. What is the remainder when g is divided by 17? 11 Let v(m) = m*2 - m - 5. What is the remainder when (-296)/(-6) + (-2)/6 is divided by v(-5)? 24 Let m = 11 - 9. Suppose 0 = -2w - mg + 114, 5g = -7 + 2. Calculate the remainder when w is divided by 15. 13 Let j = 151 + -69. What is the remainder when j is divided by 17? 14 Let f(b) = b*3 + 18b*2 + 30b + 12. Calculate the remainder when 168 is divided by f(-16). 36 Suppose 0 = -2q - 3q + 10, -g - 4q + 28 = 0. Suppose 5x - g = 0, 5x - 14 = -k + 9. What is the remainder when 0 - 2/1-2 is divided by k? 1 Suppose 0 = 2i - 130 + 28. Suppose -5p + i + 19 = 0. Let o(n) = 3n + 2. Calculate the remainder when p is divided by o(2). 6 Let i = 28 + 9. Calculate the remainder when i is divided by 20. 17 Suppose 17i - 165 = 14i. What is the remainder when i is divided by 19? 17 Suppose 2o - o - 4 = 0. Let a(v) = -v*2. Let q be a(4). What is the remainder when o is divided by 4/q - 13/(-4)? 1 Let x be (-4)/(-14) + (-37)/7. Let u(b) = -b - 3. Let t be u(x). Calculate the remainder when 93/t - 2/(-4) is divided by 16. 15 Suppose 3l - 102 = -3c, 0l - c - 68 = -2l. Let h be (-3)/6 - 38/(-4). Suppose 0 = 2y - y - h. Calculate the remainder when l is divided by y. 7 Suppose 16 = 3b + b. Let i(x) = -x + 1. Let s be i(-1). Calculate the remainder when b is divided by s + 0/((-9)/3). 0 Let w(n) = -2n - 2. Let k be w(1). What is the remainder when 24 is divided by k/26 - (-714)/78? 6 Suppose 3n - 5w = 24, 3w + w = -n - 9. Let m(k) = k2 + 8 + 2k*3 + 0 - nk3. What is the remainder when 15 is divided by m(0)? 7 Let h(w) be the second derivative of w3/2 - 4w2 + 3w. What is the remainder when h(7) is divided by 7? 6 Let p be 1 + 1019 - 0/6. What is the remainder when 45 is divided by ((-4)/(-10))/(17/p)? 21 Let y(m) = 3m2 + 7m + 16. Let d(o) = o*2 + o + 1. Let u(v) = 4d(v) - y(v). Calculate the remainder when u(-6) is divided by 15. 12 Let j = 18 - 2. Suppose 0 = 2v - 46 + j. Calculate the remainder when 29 is divided by 20/v15/2. 9 Let j(r) = -r2 - r + 29. What is the remainder when 84 is divided by j(0)? 26 Let t(i) = -i3 + 10i2 + 16i - 13. Let p be 2/10 + (-54)/(-5). Calculate the remainder when t(p) is divided by 11. 9 Let m = 16 + 10. Calculate the remainder when m is divided by 7. 5 Let i be (-192)/40100/(-6). Suppose 3b - 14 - 10 = 0. What is the remainder when 1/8 - (-2470)/i is divided by b? 7 Let t(n) = -n*3 + 5n*2 + 5n - 4. Calculate the remainder when t(3) is divided by 11. 7 Let w = -153 - -295. Calculate the remainder when w is divided by 18. 16 Let n = -1 - -6. Suppose 30 = k + 5z, -4z = z + n. Suppose 2t - 44 = -5x, -3x + 2x = -2t + 20. Calculate the remainder when k is divided by t. 11 Let y be 0/3(2 - 1). Suppose y = w + 2, -3k + k + 3w = -80. What is the remainder when k is divided by 19? 18 Let w = -26 - -114. Calculate the remainder when w is divided by 9. 7 Suppose 0 = g - 9g + 456. Let k = 4 + 11. What is the remainder when g is divided by k? 12 Let o(y) = -2y - 3. Let w be o(-4). Suppose 4i = wi. Suppose i = -3j + j + 32. What is the remainder when 61 is divided by j? 13 Let g(p) = -p2 - 8p + 5. Let j(f) = -2f + 6. Let r be j(7). What is the remainder when 8 is divided by g(r)? 3 Let j = -9 - 2. Let c = -17 - j. Let f(t) = -3t - 4. Calculate the remainder when 40 is divided by f(c). 12 What is the remainder when -27 - -29 - (0 - 0 - 39) is divided by 11? 8 Let s(z) = 2z2 + z - 1. Let r be s(-7). Suppose -5f + 3l + r = 0, 2f + 36 = 4f - 3l. What is the remainder when 34 is divided by f? 16 Suppose -3b + 6b - 15 = 0. Suppose 3l - bf = 5, 0 = 2	{ "pile_set_name": "DM Mathematics" }
) - sqrt(2205)). -17sqrt(5) + 500 Simplify (sqrt(85) - -2-2sqrt(85))/((sqrt(5)-12 - sqrt(5)) + sqrt(5)). 3sqrt(17)/2 Simplify (5sqrt(38)/sqrt(800))2. 19/16 Simplify ((sqrt(343) - (4 + sqrt(343) + sqrt(343) + 1)) + 5 + -3)2. 42sqrt(7) + 352 Simplify ((sqrt(13) - (sqrt(65)/sqrt(45) - sqrt(13)))*2 + -5)-5. -1400/9 Simplify sqrt(26)/(-2sqrt(2))3 - (-1 + sqrt(832))*2-1. -35sqrt(13)/2 + 833 Simplify (-1sqrt(468))/(sqrt(288)/sqrt(8)). -sqrt(13) Simplify (sqrt(60)/sqrt(3)5 - sqrt(20))/(2sqrt(100)). 2sqrt(5)/5 Simplify -2(-3 + 2sqrt(242)). -44sqrt(2) + 6 Simplify sqrt(187)/(sqrt(539)-1). -sqrt(17)/7 Simplify (2 + (1sqrt(175) + sqrt(175) + -5 - sqrt(175)) + 2)*2. -10sqrt(7) + 176 Simplify 6(sqrt(136)/(sqrt(16)/sqrt(2)) + (sqrt(272) - (sqrt(272)1)*2)). -1632 + 30sqrt(17) Simplify -1-1(sqrt(3) + 1)*2. 2sqrt(3) + 4 Simplify (4 + sqrt(243) + -1 - (-2 + 1 + sqrt(243))) + 1. 5 Simplify 3(1 + sqrt(7)) + (-2sqrt(7)-3)2. 3sqrt(7) + 255 Simplify (1sqrt(243)-5 + -11sqrt(300))*2. 9075 Simplify (-3(sqrt(17) - (sqrt(17) - (sqrt(17) - (sqrt(102)/sqrt(3))/sqrt(2)))))*2. 0 Simplify 2 + (-4(sqrt(700) + 0) - (3(2sqrt(700) + sqrt(700)) - sqrt(700))*2). -44798 - 40sqrt(7) Simplify (sqrt(5) - (sqrt(5) + -5 + sqrt(5)))1 - (sqrt(80))2-6. -sqrt(5) + 485 Simplify -2 + (5 + (sqrt(3) - (2 + sqrt(3))))-4. -14 Simplify sqrt(56)/(3sqrt(512)). sqrt(7)/24 Simplify (3 + sqrt(208)-3 + 4)2. -168sqrt(13) + 1921 Simplify 6(-1(1 + sqrt(13)) - ((sqrt(39)/(sqrt(6)/sqrt(2)))*2 - sqrt(13)))1. -84 Simplify sqrt(800) + sqrt(800) + 2 - sqrt(50)-1-2. 2 + 30sqrt(2) Simplify ((sqrt(2) - sqrt(72)3 - 6sqrt(72))3)*2. 50562 Simplify ((sqrt(204) + (sqrt(204) - (sqrt(204) + (sqrt(204) - sqrt(204)2))))-1)/sqrt(12). -2sqrt(17) Simplify sqrt(612)3-2-4. 144sqrt(17) Simplify (3(sqrt(180) + 1 + sqrt(180)))2. 216sqrt(5) + 6489 Simplify -1(3 + sqrt(112))-4. 12 + 16sqrt(7) Simplify (3 + sqrt(208) + -1)2. 16sqrt(13) + 212 Simplify ((sqrt(3645)1 + sqrt(45) + sqrt(45) + sqrt(45))/((sqrt(126)/sqrt(2))/sqrt(7)))2 + 2. 722 Simplify (sqrt(36)/sqrt(3)-4 - sqrt(12))/(2sqrt(216)). -5sqrt(2)/12 Simplify (3 + sqrt(1053))*2 + 1. 54sqrt(13) + 1063 Simplify -5(6(sqrt(396) - (sqrt(396) + (sqrt(396) + sqrt(396) + -2 - sqrt(396)))))*2. -72000 + 4320sqrt(11) Simplify sqrt(13)22 + -1(sqrt(104)/sqrt(8))2. -13 + 4sqrt(13) Simplify sqrt(18)/(sqrt(63)/(-1sqrt(7))). -sqrt(2) Simplify 13sqrt(13)1. 3sqrt(13) Simplify (5 + sqrt(931) + 1)2 + 4(2sqrt(133))/sqrt(7). 92sqrt(19) + 967 Simplify 0 + ((1sqrt(132))/sqrt(12) + -1sqrt(1331))*2. 1100 Simplify (sqrt(16) - sqrt(16)21)/((sqrt(240)/sqrt(6))/sqrt(5)). -sqrt(2) Simplify -2((1 + sqrt(200))*2 + -2). -398 - 40sqrt(2) Simplify (sqrt(153) + sqrt(153) + (sqrt(153) - (sqrt(153) - (sqrt(153) + 1)) - sqrt(153)) + 3)*2. 48sqrt(17) + 628 Simplify ((sqrt(30) + sqrt(90)/sqrt(3))-1)/(sqrt(96)-2). sqrt(5)/4 Simplify ((-4(sqrt(66) - 1sqrt(66)))/sqrt(6))*2-5. 0 Simplify (((sqrt(1600) - (sqrt(1600) - -1sqrt(1600) - sqrt(1600)) - sqrt(16)) + sqrt(16))/(sqrt(96)/sqrt(3)) + 1)2. 1 Simplify -2 + 2-1sqrt(1584). -24sqrt(11) - 2 Simplify sqrt(1539)2-2. -36sqrt(19) Simplify 3 + ((-1 + 0 + sqrt(19))2 - sqrt(19) - (3 + -1 + sqrt(19))2). -7sqrt(19) Simplify (sqrt(26) + sqrt(26)1 + sqrt(26))/sqrt(2) + 2. 2 + 3sqrt(13) Simplify -2 + sqrt(133)/((sqrt(7) + sqrt(14)/sqrt(2))2). -2 + sqrt(19)/4 Simplify sqrt(114)/sqrt(384) - (sqrt(133)/sqrt(567))2. -19/81 + sqrt(19)/8 Simplify (2(sqrt(275) + -2 + (sqrt(275) + 2 - sqrt(275))))*2. 1100 Simplify 5 + -2sqrt(567) + sqrt(567) + (sqrt(567) - (1 + sqrt(567) + -4 + sqrt(567)))*2. -63sqrt(7) + 581 Simplify 2 + sqrt(5) + -2 + (sqrt(1815)/sqrt(3))*2. sqrt(5) + 605 Simplify -5(sqrt(19)-5 + 3). -15 + 25sqrt(19) Simplify ((sqrt(19) + -1sqrt(19))-5)*2 + -3sqrt(304). -12sqrt(19) Simplify 6(-2 + sqrt(125))*2 - sqrt(125) - (sqrt(125)-1 + -4). -120sqrt(5) + 778 Simplify 5 + 1 + sqrt(68)/sqrt(4) + 4. sqrt(17) + 10 Simplify (-1sqrt(14)-2)/(sqrt(6)/sqrt(3)-4). -sqrt(7)/2 Simplify 5(sqrt(5) - (sqrt(180) + -3)). -25sqrt(5) + 15 Simplify 31sqrt(343) + ((sqrt(448)1)2 - (sqrt(7) + 1)-5). 26sqrt(7) + 453 Simplify -4 + sqrt(2299)1 + sqrt(2299). -4 + 22sqrt(19) Simplify sqrt(20)/(sqrt(20)/(sqrt(5) + (sqrt(80) - sqrt(5)))). 4sqrt(5) Simplify (-3(sqrt(1200) - (sqrt(1200) + 0 - sqrt(1200))) - (sqrt(1200) + -1)-2)*2. 80sqrt(3) + 1204 Simplify 2 + (sqrt(1300))*2. 1302 Simplify 1(2sqrt(256))/sqrt(8). 8sqrt(2) Simplify 2 + (sqrt(1088) + 2)*2 + -1. 32sqrt(17) + 1093 Simplify (0 + sqrt(3) + -1 + sqrt(3) + sqrt(3)2 + 5)2. 32sqrt(3) + 64 Simplify (0 + -1 + sqrt(17))*2 + -2. -2sqrt(17) + 16 Simplify (4(-63sqrt(242) + sqrt(242) - sqrt(242)))2. 1254528 Simplify (-3(sqrt(833)-2 + -3sqrt(17)2))2. 61200 Simplify (sqrt(68)2 - sqrt(68)) + -2 + sqrt(68) + 0. -2 + 4sqrt(17) Simplify -4sqrt(448)1 - (1(sqrt(448) - (sqrt(448) - (sqrt(448) + 0))) + sqrt(448)). -48sqrt(7) Simplify (sqrt(2057) - (4 + sqrt(2057)))2 + -2. 14 Simplify (-2 + (sqrt(80) - (0 + sqrt(80)) - sqrt(80)))2. 16sqrt(5) + 84 Simplify sqrt(35)/(sqrt(7) - -3sqrt(7)) - (1sqrt(5) + -3 - sqrt(5)). sqrt(5)/4 + 3 Simplify ((-1sqrt(147))/sqrt(3))/sqrt(7) - sqrt(77)/((sqrt(132)-2)/sqrt(12)). -sqrt(7)/2 Simplify -5(3 + 0 + sqrt(2) - sqrt(2) - (0 + sqrt(288))). -15 + 60sqrt(2) Simplify -1(sqrt(5) + sqrt(5) + -1sqrt(5)-1). -3sqrt(5) Simplify 4(0 + sqrt(475)). 20sqrt(19) Simplify 2(sqrt(17) + 2) - (sqrt(272) - (sqrt(272)1)*2). -2sqrt(17) + 276 Simplify -5(3 + sqrt(17) + ((sqrt(170)-1)/sqrt(10) - sqrt(17)))-1. -5sqrt(17) + 15 Simplify (((sqrt(68) - (sqrt(68) + -2sqrt(68) + sqrt(68) - sqrt(68))) + sqrt(68) + sqrt(68) - sqrt(68) - sqrt(68) - sqrt(68))1)/(sqrt(36)/(2sqrt(9))). 2sqrt(17) Simplify (-1(3 + sqrt(3) + -1 + sqrt(33)/sqrt(176)))2. 5sqrt(3) + 139/16 Simplify (sqrt(132) - (sqrt(132) + sqrt(132) + sqrt(132)-2 + sqrt(132) - sqrt(132)))/sqrt(12) - (sqrt(11) - (sqrt(704) + 4 + sqrt(11)))2. -720 - 63sqrt(11) Simplify (sqrt(15)/sqrt(320))*2. 3/64 Simplify -5 + -1 + sqrt(75) + ((1sqrt(75))*2 + 2 - sqrt(75)). 71 Simplify (2sqrt(567))*2 + -3. 2265 Simplify -1 + sqrt(19)1 - ((sqrt(57)/sqrt(3) - sqrt(19)) + 1 + sqrt(19)). -2 Simplify ((sqrt(1980) + -2sqrt(1980) + sqrt(55))/(sqrt(110)/sqrt(40)))2. 500 Simplify sqrt(245)1 + sqrt(245) + 4sqrt(20). 22sqrt(5) Simplify ((0 + sqrt(1100) - sqrt(1100)) + (sqrt(11) + -1)-5)2. -50sqrt(11) + 300 Simplify (4(2sqrt(300) + -3))*2. -1920sqrt(3) + 19344 Simplify sqrt(77)/((sqrt(99)-2 - sqrt(99))/sqrt(9)). -sqrt(7)/3 Simplify (-2 + sqrt(11))2-4 + (sqrt(11) - (sqrt(11) + 0 + sqrt(539))*2). -764 + 17sqrt(11) Simplify 2 + sqrt(36)/(-2sqrt(588) + sqrt(12)). -sqrt(3)/13 + 2 Simplify sqrt(42)/(sqrt(6)3-1 - sqrt(6)). -sqrt(7)/4 Simplify 5 + sqrt(3)1 + -5 + sqrt(21)/(-2sqrt(7) + sqrt(7)). 0 Simplify (-4 + -1 + sqrt(396) - (sqrt(396)3 + -2))*2. 72sqrt(11) + 1593 Simplify -5(sqrt(52) - (1sqrt(364))/sqrt(7))/(sqrt(36)2). 0 Simplify (5sqrt(36)/sqrt(3))/(-4sqrt(64)). -5sqrt(3)/16 Simplify ((sqrt(80) + (sqrt(80) + (sqrt(80) - -2sqrt(80)) - sqrt(80)) - sqrt(80))/sqrt(8))/((sqrt(135)/sqrt(3))/sqrt(9)). 3sqrt(2) Simplify (sqrt(180) + (sqrt(180) - -2sqrt(180)))/sqrt(4) - (1sqrt(5)2 + (sqrt(20)/(sqrt(16)/sqrt(4)) - sqrt(5))). 10sqrt(5) Simplify ((sqrt(44) + -1)-3 - (-4(sqrt(66) - sqrt(66)-1))/sqrt(6))2. 12sqrt(11) + 53 Simplify (sqrt(704) - -1((sqrt(704) + 1)2 + sqrt(704))) + -2. 32sqrt(11) + 703 Simplify (2(sqrt(539) + 1)-4)*2. 896sqrt(11) + 34560 Simplify -2(-4 + (sqrt(7)-3)*2 + 0 + sqrt(7) + 5). -128 - 2sqrt(7) Simplify ((sqrt(168)/(sqrt(3)-2) - sqrt(56))/sqrt(8))2. 63/4 Simplify (4 + -2 + sqrt(304)-2)*2. -32sqrt(19) + 1220 Simplify ((-1sqrt(704) + sqrt(704))2 - sqrt(704))-6. 48sqrt(11) Simplify 3 + (sqrt(36)/sqrt(192) - (-1 + 1sqrt(3))). -3sqrt(3)/4 + 4 Simplify (sqrt(44)/sqrt(4)-6-3)2. 3564 Simplify ((sqrt(19) + 0)2)*2 + 1 + 3sqrt(1216)1. 77 + 24sqrt(19) Simplify (-1(1 + -2sqrt(288)))*2. -48sqrt(2) + 1153 Simplify (-2sqrt(55)/sqrt(5) - (1sqrt(99))*2)5. -495 - 10sqrt(11) Simplify 4(sqrt(168)/sqrt(4))/sqrt(6) - (sqr	{ "pile_set_name": "DM Mathematics" }
x + 4. Determine -4f(a) + 9p(a). 2a*3 + 10a*2 - a + 2 Let u(p) = 2p*3 - 3p*2 + 2p. Let k(q) = -6q3 + 10q*2 - 7q - 1. Suppose r - 5x = 13 - 53, -x = 0. Let i be r/6 - 4/12. Determine iu(c) - 2k(c). -2c3 + c2 + 2 Suppose -5t = -r + 30 + 4, 4r = 16. Let q be 4(-2 - 3/2). Let x = q + 24. Let i(d) = -4d - 3. Let v(j) = -7j - 5. Give tv(l) + xi(l). 2l Let p = 11 - 12. Let c(o) = 3o3 - 2o2 + 2. Let h(j) = j3 - j*2 - j. Give pc(t) + 2h(t). -t3 - 2t - 2 Suppose -j + 2j = -2y - 6, y = -4. Suppose -jw = 2n - 1 - 9, w + 3 = -3n. Let f(b) = 0 + 2b - 5b - 4. Let z(u) = 7u + 9. Determine wf(h) + 4z(h). h Let t(l) = -24l + 14. Let c(h) = -5h + 4 + 3 - 8 + 4. Let j(s) = -s*3 + 3s*2 + 6s - 5. Let b be j(4). Calculate bt(n) - 14c(n). -2n Let f(t) = 8t*3 + 17t*2 - 17t. Let b be 2/(4 + (-10)/3) + 48. Let h(a) = a*3 + 2a*2 - 2a. What is bh(r) - 6f(r)? 3r3 Let x(w) = -7w*2 - 7w + 5. Suppose -4l = 4g - 9 - 39, g - l - 8 = 0. Let b(h) = -5h - gh - 10h2 + 7 + 5h. What is 5b(t) - 7x(t)? -t*2 - t Let s(h) = -8h + 6. Let f(g) = -7g + 5. Suppose 0 = -q - t + 10, 0 = 2q - 4t - 2. Suppose 4n + 44 = -4r, -2n + 11 = -5r - 2. What is ns(k) + qf(k)? -k - 1 Let o(w) = -w3 - w2 + w - 1. Let a be (-6)/(-12) + (-2)/(-4). Let l(q) = -7q*3 - 8q*2 + 6q - 6. Calculate al(m) - 6o(m). -m*3 - 2m*2 Let i(a) = -31a. Let y(n) = 21n. Give -5i(m) - 8y(m). -13m Suppose 0 = g - 2. Let j(l) = 2l2 + 3l + 3. Let k be ((-3)/2)/((-6)/8). Suppose -kf + 6 = -0f. Let c(q) = -2q2 - 2q - 2. Give fc(y) + gj(y). -2y2 Let n(y) = -y2 + 0 + 0. Let v(a) be the third derivative of -2a5/15 + a3/3 - 2a2. Let t = 11 - 5. Determine tn(b) - v(b). 2b2 - 2 Let h(v) = 4v + 2. Suppose -5u + w + 7 + 1 = 0, -4w = u + 11. Let a(l) = -l. Calculate uh(r) + 2a(r). 2r + 2 Suppose 2w = w. Let f(q) = w - 2 + 1 + 0. Let c(s) = -2s2 + 5. Calculate -c(r) - 4f(r). 2r2 - 1 Let z(a) = -a3 - a2 - a - 1. Let y(s) = -s3 + s2 + s + 1. Suppose n + 6 - 7 = 0. Determine ny(x) + z(x). -2x3 Let j(n) = 15n + 5. Let f = 31 + -35. Let z(o) = 5o + 2. Give fj(r) + 11z(r). -5r + 2 Let d(h) be the first derivative of h3/3 - h2/2 + h - 16. Let k(w) = -7w2 + 6w - 6. Give -6d(f) - k(f). f2 Let d(z) = -9z2 - z + 1. Let v(c) = c2. Determine -d(g) + 3v(g). 12g*2 + g - 1 Let d(w) = 2w*3 - 4w*2 + 4w. Let a(m) = -m*3 + 2m*2 - 2m. Give -7a(l) - 4d(l). -l*3 + 2l*2 - 2l Let z be (-11)/2 - (-1)/(-2). Let b(h) = -163h - 7 + h2 - 5h*2 + 317h - 161h. Let o(j) = 5j*2 + 8j + 8. What is zb(p) - 5o(p)? -p*2 + 2p + 2 Let o(w) = 4w2 - 9. Suppose -6k = -7k - 5. Let t(i) = 3 - 2i2 + 1 - 4 + 5. Let r(c) = c2 - 5c + 3. Let n be r(3). Calculate kt(x) + no(x). -2x*2 + 2 Let j be ((-4)/10)/(1/5). Let u = -77 - -55. Let r(w) = -12 + 0 + 3w*2 + 7w2 - w. Let o(n) = -n2 + 1. Calculate jr(c) + uo(c). 2c2 + 2c + 2 Let d(z) be the second derivative of z*2/2 - 20z. Let f(g) = 2g + 5. Suppose -5n = -3 - 2. Give nf(w) - 6d(w). 2w - 1 Let l(o) = -13o*3 + 13o*2 - 7o - 10. Let j(y) = -9y2 - 26 - 17 + 5y + 9y3 + 50. Let u = -13 + 18. Determine ul(w) + 7j(w). -2w*3 + 2w*2 - 1 Let b(v) = -v. Let d(o) = -4o*2 - 7o. What is 21b(p) - 3d(p)? 12p2 Let b(d) = 5d - 3. Let c(g) = 11g - 7. Let v be -4(0 - -1) - 3. Suppose -5t + 9 = -2t. Calculate tc(p) + vb(p). -2p Let d(v) = -5v + 2. Let w(h) = 11h - 5. Determine -13d(a) - 6w(a). -a + 4 Suppose 3q + 29 = 2v, 10 = -2q - 0q. Let n(k) = 8 + vk - 1 + 2k. Let h = 14 - 17. Let o(r) = -4r - 3. Determine hn(l) - 7o(l). l Let g be -3((-12)/9 + -2). Let n(a) = 5a*3 + 3a*2 + 3a. Let j(l) = l*3 + 0l*3 + 11l*2 + 15l3 - l2 + 10l. Give gn(d) - 3j(d). 2d*3 Suppose -19g + 35 + 22 = 0. Let d(j) = -1 + 1 - 1. Let h(p) = 3p + 4. Calculate gd(q) + h(q). 3q + 1 Let c(k) be the third derivative of k5/15 + k4/6 - 2k2. Let p(h) = -h2 - 6h. Let j(r) = r. Let u(v) = 5j(v) + p(v). Give c(a) + 6u(a). -2a*2 - 2a Let y(o) = -11 + 6 - 12o2 - 1 + 4o + 15o2. Let m(i) = 5i*2 + 7i - 11. Let h be (-2)/((-1 - -2)/2). Give hm(l) + 7y(l). l*2 + 2 Let a(q) = -37q*3 + 5q*2 - 5q. Let l(f) = 19f3 - 3f*2 + 3f. What is 3a(k) + 5l(k)? -16k3 Let u be 2/11 + 40/22. Let a(y) = -2y - 2. Let k(i) = 8i + 9. Calculate uk(m) + 9a(m). -2m Let g(k) = -3k - 7. Let w(f) = 2f + 7. Give -3g(n) - 4w(n). n - 7 Let w(b) = -5b3 + 3b*2 - 2b + 3. Let d(z) = -16z3 + 8z*2 - 6z + 8. What is -3d(a) + 8w(a)? 8a3 + 2a Let t(x) = 3x2 - 7x + 8. Let q(s) = 3s2 - 6s + 8. What is 5q(n) - 4t(n)? 3n2 - 2n + 8 Let g = 15 + -13. Let h(t) = -16t2 + 21t - 6. Let s(d) = 3d2 - 4d + 1. Give gh(f) + 11s(f). f*2 - 2f - 1 Let h(d) = -5d3 - 6d*2 - 5d - 3. Let u(g) = 11g3 + 13g*2 + 11g + 7. Give 13h(b) + 6u(b). b3 + b + 3 Let k(y) = -1. Let w(v) be the third derivative of -v5/30 - v4/24 + v3/6 + 6v2. What is -3k(u) - w(u)? 2u2 + u + 2 Let k(w) = 2w*3 - 7w*2 - 9w + 5. Let r(q) = q*3 - 4q*2 - 5q + 3. Give -3k(a) + 5r(a). -a3 + a2 + 2a Let b(m) = -23m*3 + 17m*2 + 17m - 11. Suppose -5 = -4o - 4u + 7, -4o = 3u - 15. Let v(t) = -4t3 + 3t*2 + 3t - 2. Calculate ob(y) - 34v(y). -2y3 + 2 Let a(n) = -n + 2. Let j(o) = -3o*3 - 5o - 9. Let d(k) = -5a(k) - j(k). Let f = 7 + -5. Let u(w) = w3 + 3w. Determine fd(h) - 7u(h). -h*3 - h - 2 Let h(r) = -2r*2 - 4r - 8r2 + 3r3 + r2 + 5 + 5r2. Let x(j) = 2j*3 - 3j*2 - 3j + 4. Calculate -3h(b) + 4x(b). -b*3 + 1 Let p(k) = -6k - 1. Let s be (-34)/289 + (-567)/(-51). Let w(j) be the first derivative of j*2/2 - 1. Give sw(a) + 2p(a). -a - 2 Let w(t) = 17t*2 - 12. Let c(q) = 4q*2 - 3. Let k(x) = -9c(x) + 2w(x). Let f(a) = -5a*2 + 7. Give -3f(b) + 7k(b). b2 Let z(l) = -7l*3 + 8l*2 - 7. Let t(g) = 20g*3 - 23g*2 + 20. Suppose -2f - 12 = -0f. Give ft(y) - 17z(y). -y3 + 2y*2 - 1 Let i(y) = 0y*2 + 0y - 3y2 - 3 + 3y - y. Let r(g) = -7g2 + 5g - 7. Calculate -10i(c) + 4r(c). 2c2 + 2 Let r(o) = 3o*3 - 5o*2 - o + 4. Suppose 2 - 6 = -3d + 2s, 2 = -d - s. Let w(b) = b + db - 3b3 - 5 + 6b2 - b3. Determine 6r(a) + 5w(a). -2a3 - a - 1 Let d(h) = 2349h + 203. Let o(t) = -58t - 5. What is -5d(b) - 203o(b)? 29b Let g(z) = -z. Let u(n) = -2n2 + 2. Give g(q) - u(q). 2q2 - q - 2 Let m(w) = -w2 + 6w + 4. Let i(a) = 3a*2 - 5 + 7 - 2 + 3a. Let x be i(-2). Let t(k) = k*2 - 5k - 3. Determine xt(u) + 5m(u). u*2 + 2 Let k(w) = 4w - 1. Let r be 0 - -2 - 0/1. Suppose -4g + 16 = -8. Let m(n) = 8n + 2n - g - 4n + 15n. Determine rm(y) - 11k(y). -2y - 1 Let t(c) = 4c2 + 4. Let b(s) = s2 + 2s + 5. Let w(n) = n*2 + 5n + 11. Let g(h) = 5b(h) - 2w(h). Let i = 28 + -34. What is ig(p) + 5t(p)? 2p2 + 2 Let b(l) = 2l*2 - l + 1. Let i(n) = -6n*2 + 3n - 3. Let u be (1/2)/((-5)/80). Let r = 7 + u. Let h be (-6)/9(r - 11). What is hb(j) + 3i(j)? -2j2 + j - 1 Let i(g) = g3 - 23g2 + 23g - 28. Let k be i(22). Let q(c) = -2c3 + 2c*2 - 6c - 3. Let r(a) = 4a3 - 4a*2 + 13a + 6. Calculate kr(x) - 13q(x). 2x3 - 2x*2 + 3 Let s(w) = 3w*2 - 2w + 3. Let x(h) = 7h2 - 3h + 5. Determine -5s(l) + 3x(l). 6l2 + l Let a(p) = p3 - p2 + p - 1. Let u(d) = 8d*3 - 5d*2 + 5d - 5. Calculate -5a(b) + u(b). 3b*3 Let w(a) = 2a + 5. Let x(y) = 2y + 2. Let q(m) = 3m + 3. Let k(n) = 3q(n) - 5x(n). Give 5k(r) + w(r). -3r Let b(k) = k + 1. Let n(t) = 10t + 4. Give 6b(v) - n(v). -4v + 2 Let q(b) = -2b + 13. Let p(s) = -10s + 66. What is -2p(m) + 11q(m)? -2m + 11 Suppose 1 = -2g + 3. Let z(v) = 0v - v - g - 1 + 0v. Let a(y) = y + 3. Determine 5a(x) + 7z(x). -2x + 1 Let c(f) = 3f2 - 4f - 4. Let y = 18 + -19. Let n(h) be the second derivative of h4/12 - h3/6 - h*2/2 + h. Give yc(i) + 4n(i). i2 Let t(h) = h2 + 1. Let k be -8 + (-44)/(-6) + 40/6. Let v(g) = -7g*2 - 8. Determine kt(m) + v(m). -m*2 - 2 Let u(g) = 22g - 4. Let q(t) = -7t + 1. What is -7q(f) - 2u(f)? 5f	{ "pile_set_name": "DM Mathematics" }
0. What is the units digit of v? 4 Let s = 14 + -9. Let v(p) = 14p + 3. Let k be v(s). Let w = -44 + k. What is the tens digit of w? 2 Let b(r) = -r2 + 3r - 6. Let m be b(4). Let q = m + 14. Suppose 4i - 151 = -d, 2d = i + qd - 29. What is the tens digit of i? 3 Let h(r) = r2 - 13r + 2. Let m = 14 - 1. Let z be h(m). Suppose zf = 4f - 100. What is the units digit of f? 0 Let j be 0(-1 + (-8)/(-6)). Suppose 4h + 3c - 83 = j, -2c + 42 = h + h. Let s = 35 - h. What is the tens digit of s? 1 Suppose 54y - 45y - 22959 = 0. What is the thousands digit of y? 2 Let m = 8 + -11. Let c be (6/(-3) - m) + -7. What is the units digit of c/(-8) + 186/8? 4 What is the hundreds digit of -5 + 808 - (2 + 2 + -3)? 8 Suppose 704 = -73t + 81t. What is the tens digit of t? 8 Suppose 0 = 5r - 3f - 22, 5 - 1 = -f. Suppose 5t - s = 92, -rt + 4s + 26 = -0t. What is the tens digit of t? 1 Let g(q) = q. Let n(a) = 5a - 6. Let j be n(4). Suppose -v - j = -2l - 0v, -v + 21 = 3l. What is the units digit of g(l)? 7 Let n(d) = -d3 - d2 - d. Let o be n(-1). Let a be 3 - ((-2)/3 - (-24)/9). Suppose 2w = k + 14, -2w - o = 3k + a. What is the units digit of w? 5 Suppose q = 35 - 30. Suppose h - 2h = 0, 168 = 2a + qh. What is the units digit of a? 4 What is the hundreds digit of (-60 - -60) + -32712/(-2)? 2 Suppose -3p = -k - 2p + 1045, -4p + 4156 = 4k. What is the hundreds digit of k? 0 Let f(d) be the first derivative of 5d4/4 + d3/3 + d + 9. Let v be f(2). Suppose -3u + 78 = -v. What is the tens digit of u? 4 Let l(d) = d2 - 3d + 2. Let i be l(2). Suppose -7p - 5v = -4p - 321, i = -3p + 2v + 342. What is the tens digit of p? 1 Let l = -106 - -489. What is the hundreds digit of l? 3 Let z = -35 - -40. Let o(c) = c2 + 9c - 4. What is the units digit of o(z)? 6 Let o = 3241 + -2227. What is the thousands digit of o? 1 Let m = 1196 + 21. What is the units digit of m? 7 Suppose -2p + p + 2 = 0. What is the tens digit of 6/(-2) + (p - -46)? 4 Let z(g) = 4g*2 - 2g. What is the tens digit of z(3)? 3 What is the tens digit of 150/(-60)-19032/10? 5 Let n = 1768 - 1143. What is the units digit of n? 5 Let r be 1(-3)/1 - -9. Suppose -8d + rd = 0. Suppose 3t + 21 = 6t - 4j, -5t + j + 18 = d. What is the units digit of t? 3 Let q be (-6)/(-8)(-10 - -6). Let d = q + 8. Suppose -37 = -3b + 2l, -3l + 29 = db - 20. What is the tens digit of b? 1 Let n(p) = 2p2 - 1 + p - 1 + 2p*2 - 3p*2. Let k be n(-3). What is the units digit of (k/8)/((-2)/(-68))? 7 Let y = -4 + 7. Suppose y = 3b - 0. What is the tens digit of (0 - -22)2 + b? 4 Let r be -4 + (4 + -1 - -2). What is the units digit of 23/(-2r/(-4))? 6 Let z be (17/(-2))/(3/(-6)). Let u = z + -13. Suppose 38 = 2q + r, u = -3q - 4r + 61. What is the tens digit of q? 1 Let w = 671 - -19. What is the units digit of w? 0 Suppose 2q + 33 = 41. Suppose -qr = -4v + 476, 3v + 4r - 268 - 82 = 0. What is the hundreds digit of v? 1 What is the thousands digit of (164 - 168)-321(3 + -2)? 1 Let q = 171 + -117. Let b = q - 30. Let u = -17 + b. What is the units digit of u? 7 Let f = -119 - -82. Let z be -19 - -26 - (68 + 3). Let i = f - z. What is the units digit of i? 7 Suppose 0 = -r - 65 + 182. Suppose 89 + r = x. What is the hundreds digit of x? 2 Let o be 4/12 - 980/(-12). Let u(z) = -6z3 - z2 + 5. Let j be u(-2). Let r = o - j. What is the units digit of r? 3 Let w(f) = f2 - 5f + 3. Let c be w(6). Let j = c - 7. Suppose r = ju - 60, -2u + 0u + 2r = -62. What is the tens digit of u? 2 Let o(j) = -3j + 51. Let v be o(0). Let w = 65 + v. What is the tens digit of w? 1 Let v = -113 + 41. What is the tens digit of 0 + (-1 - v) + 2? 7 Suppose 4j - 10 = 10. Suppose 2f - jf + 2h + 179 = 0, 3h = -f + 67. What is the units digit of f? 1 Let l be (1 + -2)/((-2)/(-4)). Let f be (4/6)/(l/(-18)). What is the tens digit of (-17)/(-2) - f/(-4)? 1 What is the tens digit of 6/(-6)(-2 - 219)? 2 Suppose -k = -5o - 12, 8 = 3k - 2o + o. Let z(t) = 20t + 9t2 + 2 + t3 - 18t + k. What is the units digit of z(-8)? 2 What is the units digit of ((-264)/(-55) - 3/(-15)) + 10? 5 What is the hundreds digit of (-3185)/2688/(-10)? 0 Suppose 2t + 260 = 7t. Let u = t - 7. What is the units digit of u? 5 Let u = -98 - -212. What is the units digit of u? 4 Let d(o) = 32o - 206. What is the tens digit of d(10)? 1 Suppose -7063 = 2s - 9s. What is the units digit of s? 9 Let l(v) = 2v + 12 + 0v + 4v + 5. Suppose 2s - 3j - 3 = 0, 3s = 2s + 2j. What is the tens digit of l(s)? 5 Let f(v) = -3v*3 - 6v*2 + 35v + 216. What is the tens digit of f(-11)? 9 What is the thousands digit of 12051 - (-4 - -12)? 1 Let a = 1670 + -607. What is the tens digit of a? 6 Suppose -2o = -15o + 7566. What is the units digit of o? 2 What is the tens digit of 7330/18 + 130/(-18) + 7? 0 Suppose 4c - 2m - 2262 = 0, -5c + 1259 = -m - 1573. What is the units digit of c? 7 Let i be (0 - -2 - 2)/(-1). Suppose 4z - 2x + 6x + 8 = i, 2z = -4x - 8. Suppose zg = 5g - 20. What is the units digit of g? 4 Let o(t) = 7t + 1. Let v be o(2). Let x = 18 - v. Suppose -4p + xp = -4z + 38, -10 = -2z - 4p. What is the units digit of z? 9 Let s(c) = 2c + 4. Let v be s(6). Suppose 0 = -n + 4n - 5z - 76, -3z = n - v. What is the tens digit of n? 2 Let d be -3 - (-2 - 0 - 3). Suppose -do = -3q - 9, -5q - 4o - 15 = -0o. What is the tens digit of 26 - (7 - (q + 6))? 2 Suppose 11 + 1 = 6b. Suppose 0 = 4y - 3g - 639, 4y - by = -2g + 302. What is the tens digit of y? 5 What is the hundreds digit of (-4 + -8)15/(-12)38? 5 Suppose -4o + 2o + 6 = 0. Suppose -4p - ok = -1176, 3p - 313 = -3k + 572. What is the units digit of p? 1 Let f(p) = -p*2 - 4p - 3. Let y be f(4). Let v(j) = -j*2 - 12j + 24. Let b be v(-15). Let l = b - y. What is the units digit of l? 4 Let y(a) = a + 10. Let o be y(-3). Suppose of - 663 = -208. What is the units digit of f? 5 Let b = 20 - 17. Suppose 4n + 32 = bp, 0 = 2p + 2n - 40. What is the tens digit of p - 3/(3 - 6)? 1 Let j = 10 - 18. Let f = -66 - -26. Let y = j - f. What is the units digit of y? 2 Let d = 9 - 9. Let c be (3 + d - -4) + -2. Suppose -c = -n, -2n - 12 = 2x - 34. What is the units digit of x? 6 Suppose -17 = -c - 4k, -3c = 2c + 4k - 37. Suppose 0 = -3d - cm + 315, -35 = 4d + m - 455. Suppose 37 - d = -2b. What is the units digit of b? 4 What is the tens digit of 2 + 3/(1 - 2) + 303? 0 Suppose 27w - 29w + 572 = 0. Let y = w + -75. What is the hundreds digit of y? 2 Let c(s) = 7s*3 - 2s - 1. Let m be c(-1). What is the units digit of m/(-4) - 850/(-20)? 4 Let i(s) = -6s - 9. Suppose 3 = -3q - 15. What is the tens digit of i(q)? 2 What is the units digit of (-621)/(-21) + 22/(-14) + 1? 9 What is the tens digit of 7/1 + -5 + 2930? 3 Suppose 4i - 59 = 1. What is the units digit of 2/(-6) + 605/i? 0 Let p(t) be the third derivative of -t5/60 + t4/3 - 2t*3/3 - 2t*2. Let s be p(7). What is the units digit of 3 + (-6)/s - -12? 3 Let d(b) = b. Let p be (3/2)/((-2)/4). Let q(w) = 26w*2 + 5w + 1. Let l(j) = pd(j) + q(j). What is the tens digit of l(1)? 2 Let x(o) = -o2 + 10o - 4. Let k be x(6). Suppose -k = d - 167. What is the hundreds digit of d? 1 Let m = -148 + 265. Suppose -m = -4v - 9. What is the tens digit of v? 2 Suppose 2055 + 840 = 3c. What is the hundreds digit of c? 9 Let n(m) be the third derivative of 3m2 + 0 - 1/30m*6 - 1/60m*5 + 0m + 0m4 + 1/6m*3. What is the units digit of n(-1)? 4 Suppose -864 = -4p + 4d, 3d = 16p - 11p - 1076. What is the units digit of p? 4 What is the tens digit of (-25244)/(-16) + -61/8? 7 Let o(h) = h3 - 10h*2 - 8h - 147. What is the hundreds digit of o(19)? 9 Suppose 0 = 7m - 947 - 943. What is the units digit of m? 0 Let k(m) = 127m*2 + 47m + 221. What is the hundreds digit of k(-5)? 1 Let t(b) = 6b3 - 5b*2 - 10b + 13. What is the tens digit of t(5)? 8 Suppose 0n + h + 8 = 3n, h + 2 = 0. What is the tens digit of (1335/(-30))/(n/(-4))? 8 Let t be 1 + (-2 - 0) - -8. Suppose tp + 24 = 3p. What is the units digit of (0 - -6)(-8)/p? 8 Let g = 1600 - 760. Suppose g = 6v + 4*v. What is the units digit of v? 4 L	{ "pile_set_name": "DM Mathematics" }
*3 - 1097y*2 Find the second derivative of -306905213f*3o*3 - 2f*3o + 9fo*3 - 695123fo + 3o*3 wrt f. -1841431278fo3 - 12fo Find the second derivative of 623038j*2v*3 + 3j*2v*2 - 38jv3 - 3jv2 + v3 - 354v*2 + 2 wrt j. 1246076v*3 + 6v*2 Find the second derivative of -700t*5 - 164t*3 + 14t*2 + 226173857t. -14000t3 - 984t + 28 What is the second derivative of -90055472t5 + 9t + 3132049? -1801109440t3 What is the first derivative of 280z*4 - 174z*3 - 6z*2 - 20934184 wrt z? 1120z*3 - 522z*2 - 12z Find the third derivative of 62c6 - c5 - 121334c*3 + 107202591c*2 wrt c. 7440c*3 - 60c2 - 728004 Find the second derivative of q2vz*2 + 67313q*2vz + q2z*2 + 42q*2z - 1085381qz*2 wrt z. 2q*2v + 2q2 - 2170762q What is the third derivative of 32347818m4 - 34347224m*2? 776347632m Find the third derivative of -1170873453x3 + 486x*2 + 2748x + 3. -7025240718 What is the third derivative of -1376g4o*2 + 1214g*3o - 5g3 - 32g*2o*2 - 2g*2 + 87o*2 + 146 wrt g? -33024go2 + 7284o - 30 Find the third derivative of -30677569t5 + 87t*2 - 251320t. -1840654140t2 Find the first derivative of 2t*2y + 337t2 - 89ty - 21452y - 20451 wrt y. 2t2 - 89t - 21452 Differentiate -8123094apz - 9ap - 418447827az wrt p. -8123094az - 9a What is the derivative of 305834011w + 288248880? 305834011 What is the first derivative of -866gn2 - 25gn + 411804759g + 23n2 - 19n wrt n? -1732gn - 25g + 46n - 19 Find the second derivative of 39511363p4 - 65060130p. 474136356p2 What is the second derivative of 24307u*4 - 11u*2 - 4u - 1306706 wrt u? 291684u2 - 22 What is the third derivative of -363w*4 - 2720w*3 - 7727w*2 + 105? -8712w - 16320 Find the third derivative of 1274j4s + j*4 + 40j*3s + 3j3 + 55j*2 + 64s + 606 wrt j. 30576js + 24j + 240s + 18 What is the second derivative of -13534153l2 + 1774l - 4518? -27068306 Find the second derivative of -m*3w2 + m3w - 106m*3 + 14m*2w*2 - 14m*2 - 4mw2 + mw + 187w2 - 22w wrt w. -2m3 + 28m*2 - 8m + 374 What is the third derivative of 273185504c3 + 2c*2 - 94c + 112478? 1639113024 Differentiate 133369q4 + 2q*2 + 3q + 47066596 with respect to q. 533476q3 + 4q + 3 What is the first derivative of 4611462m2 - 10092837 wrt m? 9222924m What is the derivative of 401256n4 + 6846623 wrt n? 1605024n*3 Find the second derivative of -2b*2d*2x - 2225b2dx + 511b*2d + bx - 111588d*3x - 120d2x - 17d wrt d. -4b*2x - 669528dx - 240x Differentiate -225x*3 - 5x*2 - 4072x - 62268073 with respect to x. -675x2 - 10x - 4072 Find the third derivative of 10903223a6h*2 + 3a*2h*2 - 12a*2h + 197ah*2 - 62h*2 + 1 wrt a. 1308386760a*3h*2 What is the second derivative of 15702949f*2 + 4851097f wrt f? 31405898 What is the second derivative of -4d4 - 8645653d*2 + 631d + 7532? -48d2 - 17291306 Find the second derivative of 183f*3 + 6178f*2 + 745f - 5542. 1098f + 12356 Find the third derivative of -7079k*4 - 129k*3 - 70k*2 - 33k + 121. -169896k - 774 Find the third derivative of 3729fpv*3 - 5fpv - fp + 19fv3 + 19f - 24pv*3 + 45pv2 + 25pv - 2p + 9v3 - 17v*2 wrt v. 22374fp + 114f - 144p + 54 Find the third derivative of -12637j*5l*2 + 540j*5 + 119j*2l*2 + 61331jl2 wrt j. -758220j*2l*2 + 32400j*2 What is the third derivative of -76257hx3 + 807964hx2 - 25x*3 wrt x? -457542h - 150 What is the third derivative of 9176465w6 + 20w*5 + 212w*2 - 106w - 450? 1101175800w3 + 1200w2 What is the third derivative of -s5 - 303s4 - 1022s*3 - 4057s*2 + 3878 wrt s? -60s*2 - 7272s - 6132 Find the third derivative of 248895d4 - 498d*3 - 44d*2 + 4d + 348198. 5973480d - 2988 What is the third derivative of 14292i*6 - 6i*4 + 23i*3 + 5i*2 + 3207838i? 1715040i3 - 144i + 138 Find the third derivative of -8301w5 - 233w*4 + 10292749w*2 wrt w. -498060w*2 - 5592w Differentiate 1684n3 - 1888n - 246144891 wrt n. 5052n2 - 1888 What is the second derivative of 38618162a*3 - 46991105a? 231708972a Find the first derivative of -54003618t*3 - 29694498. -162010854t*2 What is the third derivative of -32052i*6 - 239i*4 - 6976i*2 - 4033 wrt i? -3846240i*3 - 5736i Find the second derivative of -c*2m*3 + 6c*2m + 115c2 - 282cm + 46m*5 + 4614m*2 + 3 wrt m. -6c*2m + 920m3 + 9228 What is the third derivative of 1312215868m*3 - 492110166m*2? 7873295208 What is the derivative of 12f*3 + 1478f*2 + 4f + 41813429? 36f2 + 2956f + 4 What is the derivative of -48062295y2z + 23772213y2 wrt z? -48062295y*2 What is the second derivative of -1625343v*2z + 5v2 + 221vz + 5v - 3z + 696 wrt v? -3250686z + 10 What is the third derivative of -606963243h2w3 - h2w2 + 38h*2w + 2hw*2 + 354547h + w wrt w? -3641779458h2 What is the second derivative of 6567397y*2 - 2y - 1804841 wrt y? 13134794 What is the derivative of 289f2i - 516fi*2 + 2572i*2 - 17 wrt f? 578fi - 516i*2 What is the third derivative of -2b*3nr - 154500b*3n + 19b3rz + 2b*2nz + b2n + 3b2r + 5b - 592rz + 61z wrt b? -12nr - 927000n + 114rz What is the second derivative of 2724665i*2 - 24i + 381922? 5449330 Find the third derivative of -4o6 + 16o*5 + 13238o*3 + 527135o*2 wrt o. -480o*3 + 960o*2 + 79428 Find the second derivative of -760184523y*3 - 1018698613y. -4561107138y What is the second derivative of -226981925w*3 - 214614817w? -1361891550w Find the second derivative of 115f*2g*3k*2 - 6f*2gk + 83f*2k2 + f2k - 2fgk*3 + 235fk3 + 3265g*3k*3 + gk wrt g. 690f2gk2 + 19590gk3 What is the third derivative of -13678923r*4 - 3232574r*2 - r? -328294152r Find the second derivative of -b*5 - 4449353b*3l*2 + 1119bl2 - 3939l wrt b. -20b3 - 26696118bl2 Find the second derivative of 29f*4z - 147963f2z*2 - 31531fz2 - 227f wrt f. 348f2z - 295926z2 What is the second derivative of 66128458d*2 + d - 15003458 wrt d? 132256916 Find the third derivative of 1237648i*3 - 12711094i*2 wrt i. 7425888 What is the second derivative of 8g*2v*2 + 12g*2v - 2g2 - 25gv2 - 6gv - 25g - 99917v2 - 1204v wrt v? 16g2 - 50g - 199834 Find the third derivative of 93fkr3u + 80fkr2u*2 + 1202fkr*2u - 3fkr2 - 2fr2 + 429671kr3u*3 + 2kr2u*3 + 2r*2u wrt r. 558fku + 2578026ku3 Find the second derivative of -2270y*4 - 71y*3 - 16y*2 + 931723y - 11. -27240y2 - 426y - 32 Find the first derivative of 14519972u2 + 7254010 wrt u. 29039944u What is the third derivative of 250753359o5 - 340o*2 - 81695o? 15045201540o2 Find the second derivative of 11461s*5 + 83s*4 - 438793s + 2. 229220s3 + 996s*2 What is the first derivative of 306s*4 + 100747s + 1841439? 1224s3 + 100747 Find the second derivative of -2826131l*2z - 51lz - 34479 wrt l. -5652262z What is the second derivative of 2ms5 - 3ms4 - 1034ms - 4m + 408760s2 + 36s + 1 wrt s? 40ms*3 - 36ms2 + 817520 Find the second derivative of -110295964o4 + o2 + 214119249o wrt o. -1323551568o*2 + 2 Find the third derivative of 121303142w*3 + 2w*2 - 18076240 wrt w. 727818852 Find the first derivative of -19150c*3lr2 + 17091902c*3r + 334clr2 + 14r*2 wrt l. -19150c*3r*2 + 334cr2 Find the second derivative of -18i*3 - 18736i*2 - 15641342i wrt i. -108i - 37472 Find the third derivative of 1764376u*2vz3 - 23251u*2z - uz2 - vz*2 - 2v + 6 wrt z. 10586256u2v Find the third derivative of -2088196r3 + 8226123r*2 + 5r. -12529176 Find the third derivative of 1939159m3o*2 - 12m*3o + 18m2o2 - m2 + 62mo*2 - 249mo + o2 wrt m. 11634954o*2 - 72o What is the derivative of 19819968p2u*2x + 4p2x - 544p2 + 3x - 59 wrt u? 39639936p2u*x Differentiate	{ "pile_set_name": "DM Mathematics" }
ming l is positive. l(1/3) Simplify (((n/n16)/(n12/n))31)48 assuming n is positive. n(-38688) Simplify (((x*(-1)xx)/xx)(1/21)/((x(-2/7)x)/x)(41/5))(-18) assuming x is positive. x(-1506/35) Simplify (u/(u/(uu*0u))u)/((u/(u(u*(1/3)/uu)/u))/u)u(-2/35)/(u/u(-10/7)) assuming u is positive. u(89/105) Simplify (w/(w/(w/w(1/2))))(14/5)(w/(ww(1/5)w))(-43) assuming w is positive. w53 Simplify (b*(-5/4)b*(-4/9)b)/((b(-1/2)/b)/b)(9/2) assuming b is positive. b(95/9) Simplify (i(-25)/(ii(2/11)/ii))/(i5)(13/6) assuming i is positive. i(-2443/66) Simplify (c(-2/21)c8/c)/(c(-11)/(cc/c(1/7))) assuming c is positive. c(415/21) Simplify (h/(h/h(-1)))(-3/49)(h(1/8)/hh)/(h/(h*9/hh)) assuming h is positive. h(3209/392) Simplify ((n(3/4))(2/17))(-7) assuming n is positive. n*(-21/34) Simplify (ii(1/14))(-15)/((i/(iii*(4/5)i))/i(3/11)) assuming i is positive. i(-10009/770) Simplify ((c1/((c(-1/5)/c)/cccc))/((c/(c(-6)/c))/c(-6)))(-2/21) assuming c is positive. c(46/35) Simplify (www(-14)www(-6))/(w22/(ww/(ww(-6)))) assuming w is positive. w(-31) Simplify (((y/(y(y(2/5)yy)/y))(1/19))(10/11))(-26) assuming y is positive. y(364/209) Simplify (q(-3)/(qqq(-2/29)q))/((qq/q(-1))/(((qq*(-2/39)qq)/q)/q)) assuming q is positive. q(-9028/1131) Simplify (o(3/4)/(((o/((o(-12)/oo)/o))/o)/o))/(o*(-9/5)o((o(oooo19/oo)/o)/o)/o) assuming o is positive. o(-609/20) Simplify ((r(-2/11))(-2/35))(-18) assuming r is positive. r*(-72/385) Simplify pp*(-31)p*(-19)p*(-30/13)p(-1/4)/p assuming p is positive. p(-2733/52) Simplify g*(2/63)gg(gg(-16)g)/gggg(3/19)/g19 assuming g is positive. g(-35683/1197) Simplify (l(6/17)/l1)/(l11l/(l*(-3/10)l)) assuming l is positive. l(-2031/170) Simplify l(2/37)/(ll(-4))l/((ll(2/19))/l)llll(2/5) assuming l is positive. l(25831/3515) Simplify (b(-5/4))(1/7)/(bb*6b/(b/(b/b*6)bb)) assuming b is positive. b(-5/28) Simplify (q(2/9)/q6q*(-2)q/(qq/(q(2/7)q)))(4/9) assuming q is positive. q(-1888/567) Simplify ((((yyy0)/y)/y)(-14)((yyy(-1)y)/y)10)(-16) assuming y is positive. y(-160) Simplify ((((c/((c/(c11/cc)c)/c))/c)/cc)/(c9/c))/(c11c(cc*(-3/4))/ccc) assuming c is positive. c(-45/4) Simplify (h10/(h/((hhh(3/8)h)/h)))/(h(1/5))32 assuming h is positive. h(199/40) Simplify (p(-3)/(p/p(-2/13)))(-42) assuming p is positive. p*(2268/13) Simplify ((qq/(qqqq/(((qq*7)/q)/q))q)/(((q/(qq(-11))qq)/q)/q)(q/(q/q(1/2)))(-2/13))26 assuming q is positive. q(-158) Simplify (((rr(-3/4))/rr)/r(-6/23))/(r(-21))(4/5) assuming r is positive. r(7963/460) Simplify (j/(jj(-14)))/(j/(j/(jjj/j(-24)j))j)jj/j(-6/5)jj8 assuming j is positive. j(-14/5) Simplify (t3)(-11/6)(t/t(-4))(-32) assuming t is positive. t(-331/2) Simplify (f10ff/(((f*4/ff)/f)/f)f)/(f(-5)/(f/(f(f/f*(6/17))/f)f)) assuming f is positive. f*(295/17) Simplify ((dd12/d)/d(-14))/(d/d*(3/2)d/(d/(d(d/(d(-17)d))/d))) assuming d is positive. d(19/2) Simplify ((h/(h(-2)/hh))/h)/hh/(hh(-3))(h*(-11)h)/(hh(1/8)) assuming h is positive. h(-57/8) Simplify t24tt(-3)(tt15t)(-33) assuming t is positive. t(-539) Simplify (f/f*(-29)f/(f/f3))/(f(-5)f(1/42)) assuming f is positive. f(1595/42) Simplify (a(-15)/aa/a(-3))(-21) assuming a is positive. a*252 Simplify ((((z/(zz/(z*(-3/7)z)))/z)/z(z/z7)/z)/(z/z0)3)(-28/3) assuming z is positive. z116 Simplify ((((gg/(g/(g/(gg(2/31))g)))/g)/gg)/g(2/19))/(gg/((((((g/g*3)/gggg)/g)/g)/g)/g))42 assuming g is positive. g(-147939/589) Simplify (jj(1/15)j)*(-1/73)j*(-3/7)jj(-7/2)/j assuming j is positive. j(-60659/15330) Simplify (d(-31)/(d/d(-19)))/(d/(d/(dd(-28))))(-6/25) assuming d is positive. d(-1437/25) Simplify (c(-15))*(-48)(cc(c/((((c*13c)/c)/c)/c))/cc)37 assuming c is positive. c424 Simplify ((c(-1)c(-6))(-26/5))(-5/9) assuming c is positive. c(-182/9) Simplify ((kk(1/4))(-2/35)(k*(-1/4)k)(8/3))(-1/23) assuming k is positive. k(-27/322) Simplify (((x/x2)(14/3))0)(-5) assuming x is positive. 1 Simplify ((x0/(x/x*2x))/(x/x*(4/3)(x/(x/(xx/x(-1)x)))/x))(-13) assuming x is positive. x(104/3) Simplify ((xxx*(2/17))/xxx(-7/8))/(x11)(-43) assuming x is positive. x(64497/136) Simplify (b/(b10/b))/(bb/(b*1/b))(b18)(3/22) assuming b is positive. b(-83/11) Simplify (o(-8)o)49/((oo(1/10))/o)(-1/53) assuming o is positive. o(-181789/530) Simplify (u/u11)*11(uu(-13))31 assuming u is positive. u(-482) Simplify (hh*(18/11)h/(h*32h)h)/(h(-3))(1/8) assuming h is positive. h(-2463/88) Simplify r(-9/2)r*(-3/10)rr(3/2)/rr4/r assuming r is positive. r(-3/10) Simplify ((b*(-5/3)/b)/bbb12)/(b0)(-44) assuming b is positive. b(28/3) Simplify ((i(1/4))(-29)/(i(-2/5))(-11))(-44) assuming i is positive. i(2563/5) Simplify (rr*14r)/r*5(r(-4))(1/14) assuming r is positive. r*(75/7) Simplify ((zz/(z/(z*(-9/4)z))z)/(zz*0zz)zzzz(6/7)zz(1/6))15 assuming z is positive. z(1165/28) Simplify (t(-3)t*(4/7)t*(-2)tttt(-5))(-2/81) assuming t is positive. t(10/63) Simplify (n2)(-1/30)/(n(3/2))37 assuming n is positive. n(-1667/30) Simplify (r5r)*(1/69)(r/r(-5))34 assuming r is positive. r(4694/23) Simplify j(-9)jjj(2/7)j(jj3/j)(-2/13) assuming j is positive. j*(-562/91) Simplify (h/(h/(hh*(7/4))h))/((h*(-34)/h)/h)(h(3/16))34 assuming h is positive. h(353/8) Simplify (v/v(-2/7))*(2/95)vv(-8)vvvvv3 assuming v is positive. v(18/665) Simplify ((a/((a/(aa(-1)aa))/a))(1/10)/(((aa(2/3))/a)/a)(-44))(3/26) assuming a is positive. a(-431/260) Simplify ((n11/n)(-34))(-1/22) assuming n is positive. n(170/11) Simplify (((h/(hhh(2/7)/h))(3/29))50)47 assuming h is positive. h(-14100/203) Simplify (o(-1)/oo/o(1/13))/(oo/o*(-4/5)ooo(1/2)) assuming o is positive. o(-829/130) Simplify (c/c*(-12))/(c/(c(c/(ccccc*(-15)c))/c))cc*(-12)cc/(cc*(-2)/c)c assuming c is positive. c*17 Simplify (u/(u/(uuu(2/61)u))u/(u/((uu*1u)/u)))/(u/(uu/u(-4/17)))(-4/5) assuming u is positive. u(20971/5185) Simplify (m2)(12/5)m*(-11)/mm(-1/9)/m assuming m is positive. m(-374/45) Simplify ((q/(q/q*(-10)q))(-2/57))(-42) assuming q is positive. q*(-308/19) Simplify www(-15)w*13(w/(w*(4/7)/w))/((www16ww)/w) assuming w is positive. w(-123/7) Simplify w(3/4)(w*(1/5)w)/w(w(-3/2))(-11) assuming w is positive. w(349/20) Simplify (((dd(-11/2))/d)/(d/(d/d(-2/7))))/(d7/(d/(d1/dd))) assuming d is positive. d(-171/14) Simplify (((l5/l)/ll(-1/5))(2/53))(-3) assuming l is positive. l(-84/265) Simplify ((xx(2/5)x*(-1/5))/(xx*(-2/21)xx(1/2)/xx))(-1/38) assuming x is positive. x(253/7980) Simplify (h(-3)/h)(-37)(h/(h(-11)h))/h(-2/5) assuming h is positive. h(797/5) Simplify (s*(-1/9)sss*(2/17)s)/(s(-1/3)/s)34 assuming s is positive. s*(7396/153) Simplify (((t/(tt*(-1/10)t))/t)7)36 assuming t is positive. t(-2394/5) Simplify j/(j/j(-1/3))j(j/(j/(jjj*(-34))))/j(jj(-4/9))/(j(j/(jjj(j/j(3/14))/j))/j) assuming j is positive. j(-3779/126) Simplify (((y/y(9/5))/y9)/((y/y3)/y(-1/7)))15 assuming y is positive. y(-834/7) Simplify ((p(p/p*(-17/5)p)/p)/p(3/34))(-42) assuming p is positive. p*(-18963/85) Simplify i/((ii*(2/37))/i)i/i*(-4/13)(i/i7)(-5/3) assuming i is positive. i(5894/481) Simplify (((l/(l(-15)/l))/((l*3l)/l))(1/4))(-32) assuming l is positive. l*(-112) Simplify ((ff/(ff(1/33)))/(f/(f/(f((ffffff(-22))/f)/f))))/(f/(ff/((f/f*20)/f)ff))16 assuming f is positive. f(12770/33) Simplify (((s(-1/7)s)/s(-1))43)29 assuming s is positive. s(	{ "pile_set_name": "DM Mathematics" }
3d. Let n be s(6). Let j = -13 - n. Suppose -14 = -ju + 4u. Calculate the remainder when u is divided by 8. 6 Let m(b) = -b3 - 6b*2 - 4b + 3. Let g be m(-5). Calculate the remainder when ((-32)/(-1)-1)/(-1) is divided by (-40 + 6)1/g. 15 Calculate the remainder when -122(-1)/2 - 3 is divided by 12. 10 Let q = 21 - -4. What is the remainder when q is divided by 13? 12 Let t(x) = -2x. Let k be t(-7). Suppose 0 = 3p - 28 - k. What is the remainder when 41 is divided by p? 13 Let h be (46/(-3))/((-2)/6). Let v = 66 - h. Suppose t + 3t - v = 0. Calculate the remainder when 7 is divided by t. 2 Let v(j) = 3j2 - 3 - 1 - 4j + j*3 + 1. Let t be v(-4). Let w = t + 4. Calculate the remainder when 1 is divided by w. 0 Let r be (0 - 0)/(-2) + 0. Let c = 4 + 35. Suppose r = 3u - c + 3. What is the remainder when 35 is divided by u? 11 Let w be 12/6-3. Let t be (-4)/(1 + 1) - w. Calculate the remainder when 8 is divided by 1 - -2 - 0/t. 2 Let v = -31 + 54. What is the remainder when 158 is divided by v? 20 What is the remainder when ((-30)/4)/((-3)/2) is divided by 2? 1 Suppose -3u + 2r + 56 = 9, -42 = -3u + 3r. What is the remainder when u is divided by 10? 9 Suppose 0 = -5u + 3b + 72, -4b + 1 + 3 = 0. Let h = 25 - u. Suppose 5f = -r + 100, 4f + r - 64 = 17. What is the remainder when f is divided by h? 9 Suppose 31n - 32n + 11 = 0. What is the remainder when n is divided by 4? 3 What is the remainder when 98 is divided by 92/4 - (-3 - -1)? 23 Let f = -4 - -2. Let b be (-2 - f)/(-3 + 2). Calculate the remainder when -1 - (-2 + b + -54) is divided by 19. 17 Suppose k - 93 = -3k - 3w, 99 = 4k + 5w. Let r = k + 13. What is the remainder when r is divided by 18? 16 Let i be 167 + (0 - 1). Suppose 0 = 4q - 16 + 4. Suppose 88 = 5w - j, qw - 7j = -2j + i. Calculate the remainder when w is divided by 6. 5 Let o = 191 - 157. What is the remainder when 54 is divided by o? 20 Let s = 13 - -7. Calculate the remainder when s is divided by 6. 2 Let a(g) = g2 + 7g - 4. Let o be a(-8). Suppose 0 = 3c - oc + 17. Let h = c - 3. Calculate the remainder when 27 is divided by h. 13 Suppose -3h + p + 339 = -175, -h + p + 174 = 0. What is the remainder when h is divided by 43? 41 Let c be (-4)/(-10) + 21/(-15). Calculate the remainder when (8/c)/((-3)/12) is divided by 2/(-10) - ((-324)/20 - -5). 10 What is the remainder when 64 is divided by 14/56 + (-67)/(-4)? 13 Let f = 6 - 1. Let a = 18 - 13. Suppose an = 42 + 28. Calculate the remainder when n is divided by f. 4 Let s(k) = 34k2 - 1. Let f be s(-1). Let i = f + -15. Calculate the remainder when i is divided by 5. 3 Suppose 2s - 185 = -3s + 4o, 4o - 46 = -2s. Let d be (5/5)/((-2)/54). What is the remainder when s is divided by (-441)/d - (-2)/3? 16 Let x(j) = -5j3 + 3j - 1. Let u be x(3). Let s = 186 + u. Calculate the remainder when s is divided by 15. 14 Let s(w) = w + 14. Let i = -25 - -39. Calculate the remainder when i is divided by s(-9). 4 Let q(o) = -3o + 1. Let h be q(1). Let x(f) = 2f*2 - 2f - 2. Calculate the remainder when 29 is divided by x(h). 9 Suppose -2 = 2o, 0 = b + o - 10 - 12. What is the remainder when 67 is divided by b? 21 Let m be (-1)/(18/10 - 2). Suppose mn = n + 252. What is the remainder when n is divided by 22? 19 Suppose 2w - 56 = -4l, 4l + 3w = 5 + 49. What is the remainder when 59 is divided by l? 14 Suppose 5j - 5i - 260 = 0, 2j = -i + 142 - 32. Calculate the remainder when j is divided by 28. 26 Suppose 8v = 83 + 85. What is the remainder when 53 is divided by v? 11 Let r(h) = 3h2 + 2 - h2 - 5h + 2h + 7h. Let i be r(-4). Suppose -3d = -12 - i. What is the remainder when d is divided by 4? 2 Suppose -h + 2h - 5y - 22 = 0, -h = 2y + 6. Suppose 0 = 3n + hn - 185. Calculate the remainder when n is divided by 10. 7 Let v = 72 - -45. What is the remainder when v is divided by 17? 15 Let d(n) = n*2 + 6n - 3. Let g be d(-6). Let i = 2 - g. Calculate the remainder when 6 is divided by i. 1 What is the remainder when 13 is divided by 4/(32/20)2? 3 Let q(x) = x2 + 2x + 2. Let z be q(-1). What is the remainder when 5 is divided by z + 4/(4 + 0)? 1 Suppose -2m - 4 = -14. Suppose 0 = 9w - 13w + 76. What is the remainder when w is divided by m? 4 Let b = 19 + -13. Calculate the remainder when 13 is divided by b. 1 Let p(g) be the second derivative of -g5/20 + 2g*4/3 - 7g*3/6 - 3g*2 + g. Let c be p(7). What is the remainder when 2/(-3) + (-214)/c is divided by 12? 11 Suppose -1 = -4c + 11. What is the remainder when c is divided by 1? 0 Let l(i) = 2i + 4. Let h be l(5). Let m = h - 9. Calculate the remainder when 8 is divided by m. 3 Suppose -44 - 72 = -4x. What is the remainder when 114 is divided by x? 27 Suppose -5 - 7 = -4x. Suppose 104 = xg + g. Calculate the remainder when g is divided by 9. 8 Let j = 4 - -1. Suppose -2 = -jc - 12. Let p = 4 + c. What is the remainder when 4 is divided by p? 0 Calculate the remainder when 7 is divided by (-90)/122/(-3). 2 Suppose -b + 5q - 26 = -2, -5b - 98 = -3q. Let w = b - -45. What is the remainder when w is divided by 9? 8 Suppose -5l + 8l + 15 = 0. Let v(x) = x + 7. What is the remainder when v(l) is divided by 2? 0 Let y(f) = -f + 11. Suppose -4u = -9 - 23. Let g be y(u). Suppose -3q = -gn - 126, -4q - 2n + 165 = -5n. What is the remainder when q is divided by 14? 11 Let s(c) = 14c + 2. Suppose 135 = 4i - 3f - 0f, 50 = 2i + 2f. What is the remainder when i is divided by s(1)? 14 Suppose -2s + 0s = -2a + 64, 0 = -2a + s + 65. Let q(n) = -n + 20. Calculate the remainder when a is divided by q(11). 6 Let u(c) = c2 - 7c - 16. Suppose -16 = -4o + 2o. What is the remainder when u(10) is divided by o? 6 Let n(p) = -7p3 + 2p*2 - p - 1. Suppose -21 + 65 = 2a. Calculate the remainder when n(-2) is divided by a. 21 Suppose 49 = 2j - 31. Suppose 4k = 3p - j, 0 = p - 2p - 5k + 7. Calculate the remainder when 35 is divided by p. 11 Suppose -y - 2 = -0y + 4n, -3n = 4y - 44. What is the remainder when 27 is divided by y? 13 Suppose -2z - 162 - 144 = -4r, -2r - 3z = -133. What is the remainder when r is divided by 19? 17 What is the remainder when 10 is divided by ((-14)/(-7))/(3/9)? 4 Let c = 7 + 3. What is the remainder when c is divided by 3? 1 Let i = -16 + 31. What is the remainder when 27 is divided by i? 12 Let z = 62 - 25. Let y(n) = -2n - 8. What is the remainder when z is divided by y(-9)? 7 Suppose h + 13 - 4 = -3a, -5h - 19 = 2a. Suppose 0 = -3d + 2g + 27, -3d + 2d = -4g - 9. Calculate the remainder when d is divided by -1 - (-6)/(a - -3). 4 Let r = -38 - -47. What is the remainder when 17 is divided by r? 8 Suppose 0 = -4n + 27 + 21. Calculate the remainder when n is divided by 3. 0 Let i(o) = -o2 + 3. Suppose 3z + 17 = -2t + 2, 5t + 4z + 20 = 0. What is the remainder when i(t) is divided by 2? 1 Let k be (0 + -11)(-7 + 2). Suppose -k = -4f - 3. Calculate the remainder when 37 - (2/2 - 1) is divided by f. 11 Let h = -14 + 6. Let a be ((-15)/(-4))/((-3)/h). Let r = 3 + a. Calculate the remainder when 37 is divided by r. 11 Let h(f) = f + 13. Let m be h(-7). Suppose 4j + 3g = 72, -3g + mg = -3j + 57. Calculate the remainder when 27 is divided by j. 12 Calculate the remainder when 4/(-2)(-6 - -4) is divided by 2. 0 Let k be (-1)/((-3)/(18/(-3))). Let w(q) = q - 1. Let l be w(3). Calculate the remainder when 10 is divided by (-2 - k) + l - -4. 4 Suppose 0 = -x + 2x. Suppose -3a + xm + 4m = -120, 2a + 2m - 66 = 0. What is the remainder when a is divided by 10? 6 Suppose 33 + 49 = 2j. Calculate the remainder when j is divided by 21. 20 Calculate the remainder when 42/(-105) - (-117)/5 is divided by (0 - -1) + (0 - -11). 11 Suppose 5i = 0, 3i + i = 5x - 105. Suppose 2p - x = 31. Let h = 26 + -17. Calculate the remainder when p is divided by h. 8 Calculate the remainder when 42(-2)/(12/(-3)) is divided by 12. 9 Let u(s) = 48s*2 + 2s + 2. Let y = -5 + 18. Calculate the remainder when u(-1) is divided by y. 9 Suppose n = -5d + 4d + 109, 0 = 4d + 5n - 432. Calculate the remainder when d is divided by 23. 21 Suppose 10 = 2s + k + 4, 5s - 2k - 33 = 0. Suppose -su = w - 3*	{ "pile_set_name": "DM Mathematics" }
p + 0p + ap. Let k(r) = -17r2. What is k(h(z))? -833z*2 Let y(o) be the first derivative of 2o*3/3 - 1. Let s(c) = 463 - c + 478 + 474 - c - 1380. Calculate y(s(a)). 8a*2 - 280a + 2450 Let z(w) be the third derivative of 45w4/8 - 170w*2. Let a(r) = -r. What is z(a(k))? -135k Let m(k) = 13k - 1. Suppose 3i - 4s - 1093 = 0, 5s = 3i + 4s - 1108. Let q(f) = -if2 + 126f*2 + 119f*2 + 121f*2. Give m(q(h)). -65h2 - 1 Let k(i) be the second derivative of -i6/360 + i4/4 - i2/2 - 6i + 1. Let l(m) be the third derivative of k(m). Let r(q) = -q - 7. Determine r(l(z)). 2z - 7 Let w(y) = -y*2 - 4y + 103. Let j(f) = -f. Let r(o) = -4j(o) + w(o). Let q(c) be the first derivative of r(c). Let s(x) = 4x*2 - 5. Give s(q(k)). 16k*2 - 5 Let j(r) = 5r + 2. Let o(w) = 119w + 49. Suppose -i = 4a - 2a + 99, 2a - 3i = -95. Let z(u) = aj(u) + 2o(u). Let d(f) = -16f*2. What is d(z(c))? -784c*2 Let r(z) = 2z. Let f = 27 - -27. Let i = 64 - f. Let k(a) = 18a2 - 10 + i. Give r(k(h)). 36h*2 Let o(q) = -68q + 5q + 37q*2 + 33q*2 - 8q - 71q2. Let d(v) = 5v. Determine d(o(r)). -5r2 - 355r Let l(k) = 2k2 + 17. Let a(g) = g2 + 6. Let j(p) = 17a(p) - 6l(p). Suppose 0 = -30c - 17 + 77. Let u(m) = m*2 - 17m*c + 8m*2. Give j(u(y)). 320y*4 Let o(m) = 149637m*2. Let d(h) = 10861h*2. Let f(k) = -124d(k) + 9o(k). Let v(l) be the third derivative of l5/12 + l2. Give v(f(p)). 4805p*4 Let c(q) = -10q + 721. Let o(r) = -7r + 515. Let a(d) = -5c(d) + 7o(d). Let u(k) = -2k*2 - 554k. What is u(a(i))? -2i2 - 554i Let v(t) = 19t - 24. Let x(f) be the third derivative of -f4/8 + 5796f*2. What is x(v(y))? -57y + 72 Let w(j) = 11j - 7 + 6 + 4 - 3. Let r(o) = -o2 - 419o. What is r(w(a))? -121a2 - 4609a Let a(w) = -135w2. Let q(g) = -1029417g. Determine a(q(m)). -143059413585015m2 Let z(t) = 67t - 1. Let q(f) = -3f2 - 2f*2 - 5f*2 - 18f*2 + 25f*2. Determine q(z(x)). -13467x*2 + 402x - 3 Let j(v) be the second derivative of 13v4/6 - 130v*2 + 32v - 1. Let n(y) = -2. Let i(k) = j(k) - 130n(k). Let d(l) = -3l + 0l + l + 0l. Give d(i(w)). -52w2 Let i(u) = 490u*2. Let m(h) be the third derivative of -52h*2 + 0h*3 + 0 + 0h - 1/24h4. Calculate i(m(z)). 490z*2 Let v(i) = 3i - 5. Let u(k) = k - 2. Let n(w) = 15u(w) - 6v(w). Let p(f) be the second derivative of 7f4/12 - 55159f. Determine p(n(j)). 63j2 Let c(x) be the third derivative of x4/8 + x2. Let q(r) = -50r - 197. Let h(z) = 101z + 460. Let v(l) = -3h(l) - 7q(l). Calculate v(c(t)). 141t - 1 Let u(s) = 4s. Let v(m) = 54m*2 + 7008m + 1. Give u(v(n)). 216n2 + 28032n + 4 Let s(j) = 2j2. Let p be (-11)/(-4) + (-39)/52. Let u(d) = 77d*p + 71d*2 + 87d*2. Determine u(s(r)). 940r*4 Let v(o) = 402o. Let b(g) = 34g2 + 21. Let w(x) = -29x*2 - 18. Let m(i) = -6b(i) - 7w(i). Give m(v(d)). -161604d*2 Let p be (-17 - -15)(-3)/2. Let q be (-2 + 1)(p - (4 - -14)). Let s(b) = qb + 14b - 3b. Let h(a) = -3a2. Determine s(h(o)). -78o*2 Let g(n) = -n + 2. Let u be g(-1). Let k(v) = v + 4. Let l(q) = 3. Let s(f) = uk(f) - 4l(f). Let i(t) = -17t*2. Give s(i(h)). -51h*2 Let z(k) = 7200k - 7158k - 1 + 1. Let c(s) = -s. Determine z(c(u)). -42u Let k(b) = -10b2 + 1830. Let d(o) = 316o + 2. Calculate k(d(h)). -998560h2 - 12640h + 1790 Suppose 756 = 10u + 86. Let w(c) = 67 + 9c + u - 134. Let r(x) = -x*2. Calculate w(r(p)). -9p2 Let g(m) = m2 + 1. Let l(z) = 3z2 + 4. Let v(b) = -4g(b) + l(b). Let p(c) = 182c - 3. Let r be p(1). Let u(q) = -2 + 2 + 155q - rq. Determine v(u(d)). -576d*2 Let g(u) = -51011084u. Let n(i) = 3i2. Determine n(g(z)). 7806392072565168z*2 Let d(y) = -9802930y. Let m(v) = 12v2. Determine m(d(s)). 1153169239018800s*2 Let o(z) = -459z - 35. Let l(f) = 2f2 + 190f. Give l(o(n)). 421362n2 - 22950n - 4200 Let v(c) = -2c2. Suppose -118u = -108u - 1040. Let o(g) = -98g*2 - 3g. Let x(r) = -3432r2 - 104r. Let d(k) = uo(k) - 3x(k). Calculate v(d(t)). -21632t4 Let k(b) = -3b*2. Let h(w) = 2w + 4. Let g(a) = -5a + 6. Let f(d) = 12d - 13. Let z(n) = 6f(n) + 14g(n). Let t(i) = 3h(i) - 2z(i). Give t(k(o)). -6o2 Let l(v) = -72v*2. Let s(d) be the second derivative of 14d + 1/4d4 + 0d*2 + 0d*3 + 0. Calculate l(s(g)). -648g*4 Let k(q) = -604q. Let w(h) = 19510h + 1. Determine k(w(r)). -11784040r - 604 Let c(x) = -20x2. Suppose 82w - 75w - 1 + 1 = 0. Let y(m) be the second derivative of -17m + wm2 + 0 + 0m*3 + 1/6m*4. What is c(y(l))? -80l*4 Let x(t) = -4t. Let h(q) = -578419q2 + 25q. Determine h(x(m)). -9254704m2 - 100m Let y(w) = -3321031779w. Let i(v) = 2v*2. What is y(i(l))? -6642063558l*2 Let i(c) be the second derivative of 0c*3 + 3/2c*2 - 4/3c*4 + 0 + 58c. Let o(j) = 2j2. Determine i(o(b)). -64b4 + 3 Let y(i) = -i2. Let h(c) = 16c2 - 15c*2 - 199c*2 + 66c*2. Calculate y(h(r)). -17424r*4 Let o(w) = -330w. Let v(i) = 1704i2 + 118. Calculate v(o(g)). 185565600g*2 + 118 Let z(j) = -3j + 11. Let u be z(3). Let t(c) = -35cu + 358 - 718 + 360. Let m(w) = -4w. Determine m(t(i)). 140i2 Let y be 1 - 1/(4 - 3). Let v(w) be the third derivative of yw*3 + 0w + 0 + 0w4 + 8w*2 + 3/20w*5. Let o(p) = -2p*2. Give v(o(u)). 36u*4 Let v(c) = 3317c*2 - 1196c*2 + 3287c*2. Let w(j) = -212j*2. Let s(i) = 5v(i) + 128w(i). Let h(g) = 3g. Determine h(s(d)). -288d2 Let m(h) = -35415h*2. Let a(g) = -10g*2 - 113g*2 + 130g*2 - 8g*2. Determine a(m(q)). -1254222225q*4 Let d(b) = -2b*2. Let m(k) be the second derivative of 11129k*3/6 - 5339k. Give m(d(g)). -22258g2 Let n(v) = 4v*2. Let l(r) = 127020862r*2. What is l(n(i))? 2032333792i*4 Let u(h) = 225474h. Let w(d) = -1563d2. Determine w(u(y)). -79460614068588y*2 Let y(g) = 2g. Let d = 48 + -43. Suppose -2x - 5 = -5h + 4h, -dh - 2x = -85. Let s(u) = -9u*2 + 11u*2 + hu*2. Determine y(s(o)). 34o*2 Let i(f) = -608f. Let b(h) = 87199h2 - h + 1. Give b(i(n)). 32234331136n*2 + 608n + 1 Let s(f) = 9f. Let c(q) be the third derivative of -59q*5/20 + 775q*2. What is s(c(h))? -1593h*2 Let i(m) = 85m. Let q(d) = -4d2 + 12359d. What is i(q(c))? -340c2 + 1050515c Let a(s) = -12s. Let q(b) be the first derivative of 6b*3 - 1791. What is q(a(j))? 2592j*2 Let w(u) = -328097u. Let y(x) = -3x + 8. What is y(w(a))? 984291a + 8 Suppose m + 2y = 1, -4m + 14 = 2y + y. Let n(r) = -6r - 18r + mr + 4r. Let d(b) = -b2. Give n(d(j)). 15j*2 Let c(q) = 4q. Let z(h) = -44h2 - 10. Let r be (-1)/(2/4(-8)/20). Let f(g) = 44g2 + 8. Let v(t) = rf(t) + 4z(t). Calculate c(v(j)). 176j*2 Let r(m) = 25652m + 11448. Let k(i) = 202i + 90. Let u(o) = 636k(o) - 5r(o). Let a(c) = -3c*2 + 4c*2 + 0c*2. Calculate u(a(w)). 212w*2 Let d = -129 - -87. Let y be (-7)/23/d8. Let c(n) = -3n*2 - yn*2 - 15n2 - n2. Let g(h) = -h*2. What is c(g(f))? -21f*4 Let d(p) be the third derivative of 97p*4/24 - 6p*2 - 307p. Let t(o) = -2o2. What is d(t(q))? -194q*2 Let n(d) = -439d*2. Let m(h) = -28h*2 + 12h + 2. Calculate m(n(a)). -5396188a4 - 5268a*2 + 2 Let c(q) = -74q*2 - 2q + 2. Let b(o) be the second derivative of o*3/3 + 7104o. What is b(c(x))? -148x2 - 4x + 4 Let n(x) = -x + 5334. Let u(d) = 3d2 - 11d. Calculate u(n(c)). 3c2 - 31993c + 85295994 Let g be (-17)/(-5) - (-30)/(-75). Let q(u) = gu - 2u - u - 2u. Let l(f) = f. What is q(l(x))? -2x Let u(m) = -m - 2093294. Let d(j) = -j2. What is u(d(f))? f2 - 2093294 Let p(k) = -k + 2. Let o(f) = 4f + 40. Let z(j) = -3j - 28. Let i(c) = 5o(c) + 7z(c). Let g(a) = i(a) - 2p(a). Let x(m) = 259m*2. Calculate x(g(y)). 259y*2 Let q(s) = 600336s*2. Let u(g) = 8g. Determine q(u(m)). 38421504m2 Suppose -15f = -5f - 20. Let d(m) = -12m*2 + 20m*2 - 9m*2 - fm*2. Let p(h) = -25h*2 - 3 + 3 + 18h*2. Determine d(p(s)). -147s*4 Let x(o) = -4o*2. Let m(d) = 20 - 15 - 6. Let c(p) be the second derivative of -7p*3/6 - 2p*2 - 23p. Let r(z) = c(z) - 4*m(z). Calcu	{ "pile_set_name": "DM Mathematics" }
e Is 1537 composite? True Is 12037 composite? False Is 137035 composite? True Is 85889 a prime number? True Is 217849 a composite number? False Is 717553 prime? False Is 1889 a composite number? False Is 29245 a prime number? False Is 13323 prime? False Is 556477 a prime number? True Is 149861 a prime number? True Is 733763 a prime number? False Is 347621 prime? True Is 41273 a prime number? False Is 1407143 a prime number? True Is 9197 prime? False Is 9305 composite? True Is 44053 a composite number? False Is 19613 a composite number? True Is 38821 prime? True Is 4717 a prime number? False Is 1755057 composite? True Is 160141 prime? True Is 225853 prime? False Is 200771 prime? True Is 454 prime? False Is 18926 a composite number? True Is 112087 composite? False Is 24749 prime? True Is 72139 a composite number? False Is 997877 a prime number? True Is 59687 a prime number? False Is 27137 composite? True Is 829151 a prime number? True Is 27785 composite? True Is 123643 prime? False Is 8819 a composite number? False Is 445579 a composite number? True Is 191 prime? True Is 26557 composite? False Is 319885 composite? True Is 84974 a prime number? False Is 29179 a composite number? False Is 1319 prime? True Is 1907 a composite number? False Is 1777 composite? False Is 545539 prime? False Is 298153 composite? False Is 59467 composite? False Is 559739 composite? False Is 59539 a composite number? False Is 119723 prime? True Is 587 a composite number? False Is 247 a prime number? False Is 11201 a prime number? False Is 14377 a prime number? False Is 8637 a prime number? False Is 33659 composite? True Is 2554 prime? False Is 44329 a prime number? False Is 1755803 a composite number? True Is 195521 a composite number? True Is 2237 a prime number? True Is 14143 a composite number? False Is 54989 prime? False Is 13147 a composite number? False Is 48731 a prime number? True Is 1663711 prime? False Is 2429 a prime number? False Is 462721 a composite number? True Is 17707 a composite number? False Is 12407 prime? False Is 7283 prime? True Is 1462367 a prime number? True Is 27623 prime? False Is 1903 composite? True Is 278 a prime number? False Is 7663 a prime number? False Is 8501 prime? True Is 1543 a composite number? False Is 6637 prime? True Is 1693 a prime number? True Is 21919 composite? True Is 327127 prime? True Is 12833 composite? True Is 366083 prime? False Is 51943 a composite number? True Is 66017 a composite number? True Is 37451 a prime number? False Is 828995 a prime number? False Is 11617 prime? True Is 1319777 prime? True Is 19473 a prime number? False Is 421273 composite? False Is 7989 composite? True Is 9661 a prime number? True Is 182579 a prime number? True Is 11981 a composite number? False Is 30883 prime? False Is 10559 composite? False Is 151617 a composite number? True Is 7523 composite? False Is 187 prime? False Is 2174 a prime number? False Is 171799 a composite number? False Is 500959 composite? True Is 15013 a composite number? False Is 306367 a prime number? True Is 1993 a composite number? False Is 126343 a prime number? False Is 42793 prime? True Is 575317 prime? True Is 128181 composite? True Is 86477 composite? False Is 2513905 composite? True Is 25279 a prime number? False Is 13613 a composite number? False Is 1675747 a composite number? False Is 3761 prime? True Is 51749 a composite number? False Is 8641 a prime number? True Is 545233 a composite number? True Is 91705 a prime number? False Is 353915 a prime number? False Is 1561 composite? True Is 62845 a composite number? True Is 121919 prime? False Is 165941 prime? True Is 115691 prime? False Is 1825247 a prime number? False Is 11159 a composite number? False Is 16917 a composite number? True Is 5099 a prime number? True Is 131305 prime? False Is 1062914 a prime number? False Is 1361 a composite number? False Is 58933 prime? False Is 205237 a prime number? True Is 26063 prime? False Is 7819 prime? False Is 12227 a composite number? False Is 189901 a composite number? False Is 73933 prime? False Is 19121 a prime number? True Is 8623 prime? True Is 1294561 a prime number? True Is 123001 a composite number? False Is 36109 a prime number? True Is 8609 composite? False Is 5923 a composite number? False Is 39581 a composite number? False Is 169561 a composite number? True Is 314 prime? False Is 23459 a composite number? False Is 236053 composite? False Is 5297 a composite number? False Is 1471 a prime number? True Is 42843 prime? False Is 180949 a prime number? True Is 117751 a prime number? True Is 196747 composite? True Is 26735 a prime number? False Is 1387571 prime? True Is 853 composite? False Is 1795483 a composite number? False Is 3979 composite? True Is 687767 composite? False Is 42043 a composite number? False Is 55997 a prime number? True Is 5981 prime? True Is 73417 prime? True Is 15499 a composite number? True Is 730447 prime? True Is 7067 composite? True Is 81887 composite? True Is 7985 composite? True Is 576787 composite? False Is 362693 a prime number? True Is 297533 a prime number? True Is 1940795 a composite number? True Is 224359 a prime number? True Is 2498 a composite number? True Is 236143 prime? True Is 78823 a composite number? False Is 10195 composite? True Is 828517 a prime number? True Is 237449 a composite number? True Is 1399 a prime number? True Is 374303 a prime number? False Is 10559 a prime number? True Is 5981 a prime number? True Is 77471 a composite number? False Is 4493 prime? True Is 60769 prime? False Is 1004101 a prime number? False Is 162349 prime? False Is 148499 a composite number? True Is 1293 composite? True Is 802519 composite? True Is 2231 prime? False Is 32953 prime? False Is 62365 composite? True Is 73977 a composite number? True Is 136997 prime? False Is 4111 a composite number? False Is 203707 composite? True Is 1528399 prime? True Is 4399 a prime number? False Is 75039 prime? False Is 319961 composite? True Is 115657 composite? False Is 2797637 prime? True Is 307 composite? False Is 98729 prime? True Is 1683949 composite? False Is 43889 a composite number? False Is 108401 composite? False Is 60181 a prime number? False Is 22861 a prime number? True Is 2513 a prime number? False Is 9643 composite? False Is 15091 a prime number? True Is 298021 prime? True Is 3602 composite? True Is 30289 prime? False Is 9577 a composite number? True Is 1657 a prime number? True Is 364891 prime? True Is 20627 a composite number? False Is 52231 a prime number? False Is 203789 prime? True Is 12601 a prime number? True Is 330145 a composite number? True Is 25481 a prime number? False Is 583921 prime? False Is 3653 a prime number? False Is 9941 a prime number? True Is 36965 a composite number? True Is 13535 a composite number? True Is 62359 a prime number? False Is 2503 a prime number? True Is 529877 composite? True Is 17473 prime? False Is 32933 a prime number? True Is 135241 a prime number? True Is 2409679 a composite number? False Is 955 a composite number? True Is 226741 a composite number? False Is 10183 a prime number? False Is 32839 a prime number? True Is 73081 composite? True Is 877 a prime number? True Is 631 a prime number? True Is 54737 prime? False Is 4783 composite? False Is 329863 composite? False Is 3299 composite? False Is 42373 a composite number? False Is 16397 prime? False Is 1361 a prime number? True Is 1582313 composite? True Is 7401 a prime number? False Is 24074 a composite number? True Is 214161 a composite number? True Is 142589 prime? True Is 203 a composite number? True Is 3049 composite? False Is 98603 a composite number? True Is 69205 a composite number? True Is 3137 prime? True Is 10361 a prime number? False Is 92519 a prime number? False Is 313189 a prime number? False Is 840197 a composite number? False Is 1306901 prime? True Is 481807 prime? True Is 264029 a prime number? True Is 62809 a prime number? False Is 163253 a composite number? True Is 14971 prime? False Is 2101 prime? False Is 19813 a composite number? False Is 3407 a composite number? False Is 9689 composite? False Is 953 a prime number? True Is 94961 a composite number? False Is 599551 a composite number? False Is 152797 a composite number? True Is 51	{ "pile_set_name": "DM Mathematics" }
(7)/55 Simplify (-2(-2sqrt(102)-1 + sqrt(102) - sqrt(102))5)/(-6sqrt(48)/sqrt(8) + sqrt(726)4). -10sqrt(17)/19 Simplify 0 + -2 + sqrt(2420) - 6(-3 + sqrt(245))*2-6. -1490sqrt(5) + 9142 Simplify sqrt(567)-13 + -2 + 3sqrt(567) + (1 + sqrt(567) + 3 + (sqrt(567) - (2 + sqrt(567) + 1)))*2 + 0. 18sqrt(7) + 566 Simplify 0 + sqrt(208) + -2 + sqrt(208) + 1 - ((-1sqrt(208)3)*2 + (sqrt(208) - (-1(sqrt(208)-1)2 - sqrt(208)))). -2081 Simplify ((sqrt(4840)1 - (sqrt(5760) - sqrt(5760)-2))/(sqrt(72)/(sqrt(9) - sqrt(9)-2) + sqrt(800)-2))2. 28125/3481 Simplify -3(-5(-5sqrt(78)/sqrt(6) - (2 + sqrt(208) - sqrt(208))))*2-3-6. -444150 - 27000sqrt(13) Simplify (sqrt(7) + 3 + sqrt(21)/sqrt(3) - (-2 + 2sqrt(7)) - 3(1 + sqrt(448) + sqrt(84)/(sqrt(12)2)))2-4. -18223 + 408sqrt(7) Simplify 3 + (5 + (0 + sqrt(128) - sqrt(6)/(2sqrt(3))) + 2sqrt(72)-1)*2 + 2. -45sqrt(2) + 141/2 Simplify (sqrt(27)4 + 2 + sqrt(363))2 - (6(-4sqrt(243))2 + -1). -21736 + 92sqrt(3) Simplify 3 + (5(-2 + 43-2sqrt(500) + -4 + 4))*2. 24000sqrt(5) + 7200103 Simplify (5-1(sqrt(17) + 1sqrt(17)3) + (sqrt(170) + (4(sqrt(170) - (-2sqrt(170) - sqrt(170))) - sqrt(170)))/(sqrt(20)/sqrt(2)-3))2. 98192/9 Simplify (((1sqrt(120) + sqrt(120))-5 + sqrt(120)1-5)/((sqrt(6000) - (sqrt(6000) + (sqrt(6000) - (sqrt(6000)-2 - sqrt(6000)))))/(sqrt(96) - sqrt(24))))*2. 27/4 Simplify ((-5 + sqrt(112) + 0)2 - ((sqrt(175) + -1)3 - (sqrt(175) + sqrt(175)1 + 3)))*2. -24sqrt(7) + 79 Simplify ((sqrt(864) + (sqrt(864) - -2sqrt(864)1) - -2(sqrt(864)2 - sqrt(864)))/((sqrt(60)-15)/((2sqrt(10))/sqrt(2))) + -1)2. 144sqrt(2)/5 + 10393/25 Simplify 0 + (-6(sqrt(33) - (sqrt(33) + (-1sqrt(33) - sqrt(33)))) - 5sqrt(1188))/((sqrt(192) + (sqrt(192) + (-2sqrt(192) - sqrt(192)))6)-3). -7sqrt(11)/44 Simplify -1(1 + sqrt(80)) + (sqrt(80) + 3 + sqrt(80))*24 + sqrt(80) - ((2(-3 + sqrt(80) - sqrt(80)))2 + 6(sqrt(80) + sqrt(80)-4)). 264sqrt(5) + 1279 Simplify (-6-6((sqrt(1008) + -6(sqrt(1008) + sqrt(1008) + 1) - sqrt(1008) - sqrt(1008)) + -5 + 3 + 5sqrt(1008)-2) + 2)2. 5683392sqrt(7) + 691150468 Simplify (sqrt(192) + -3 + 1 + -5 + (5 + sqrt(243) - sqrt(243)))3. -6 + 24sqrt(3) Simplify 0 + 4(4 + 0 + (sqrt(112) + -1 + -1 + sqrt(112) + 0 + -5)2). -448sqrt(7) + 2004 Simplify 2 + (sqrt(847) - (-2 + (sqrt(847) + -2 - sqrt(847))*2 + sqrt(847))) + 4((sqrt(448) + 4)*2 + -5). 256sqrt(7) + 1836 Simplify 6(sqrt(11) - (-4 + sqrt(11))) + sqrt(704) + 4 - (24(sqrt(44)/sqrt(4) + -5))2. -2276 + 648sqrt(11) Simplify (2 + -6(5(-1 + sqrt(500) + sqrt(500)-2 - 1sqrt(500)-2) + 4))2. -4800sqrt(5) + 450064 Simplify -4(1(sqrt(637) + (sqrt(637)-3 - sqrt(637))))2 - (sqrt(13)-2 + -1 - sqrt(3328)). -22931 + 18sqrt(13) Simplify ((sqrt(121) + (4(sqrt(121)3 + sqrt(121) + sqrt(121)) - sqrt(121) - sqrt(121)) - sqrt(121))2)/(sqrt(396) + sqrt(396) + -5-2sqrt(396)). sqrt(11)/2 Simplify -1 + 3(((0 + sqrt(539))2 - sqrt(539)) + (2sqrt(33))/sqrt(3)) + -3 + (((1sqrt(88) - sqrt(88) - sqrt(88)) + sqrt(88))/sqrt(8) - sqrt(11)) + -3 + 1. -16sqrt(11) + 1611 Simplify 1 + sqrt(272)26 + 1 + (2sqrt(272) + sqrt(272) - sqrt(272) - sqrt(272))2 + 5 + 1. 48sqrt(17) + 280 Simplify 1sqrt(425) + -1 - 4(3 + sqrt(425)) - (5(0 + sqrt(425)) + (-1 + -2sqrt(425) + sqrt(425))*2 + -3). -436 - 50sqrt(17) Simplify 6(5(sqrt(100)2 - sqrt(100)))/(-3(sqrt(2) - (sqrt(18) - sqrt(2))) - ((sqrt(24)-1)/sqrt(12) - sqrt(2))). 30sqrt(2) Simplify -4 + ((-2sqrt(110)/sqrt(2))/((-4sqrt(66))/sqrt(6)) + -5)6. -34 + 3sqrt(5) Simplify 5 + 2 + sqrt(363)-2 + 4 + (sqrt(363) + sqrt(363) + sqrt(363)-1)*2 + -3 + -1(-1 + sqrt(363)). -33sqrt(3) + 372 Simplify ((sqrt(4500) - (sqrt(4500) - 1sqrt(4500)) - sqrt(4500))/((sqrt(60)2)/sqrt(12)))/(sqrt(36)/(sqrt(12)-1) - sqrt(12)4). 0 Simplify (sqrt(125)-6 + -2)1 - (3 + 0 + -4(sqrt(5) + -1)). -26sqrt(5) - 9 Simplify -5(4-6sqrt(132)-2)/(sqrt(12) - -2sqrt(12)-1 - sqrt(24)/sqrt(2)1)-6. -720sqrt(11) Simplify (5 + ((1(sqrt(130) + sqrt(130)1)-2)/((3(sqrt(100) - ((sqrt(100) - 4sqrt(100)) + sqrt(100))))/sqrt(10)))2)2. 1226/81 Simplify -4(-5 + (23(sqrt(4800) - -5sqrt(4800)-1))2). -11059180 Simplify (((3sqrt(588)-4 - sqrt(588) - sqrt(588))/sqrt(12))/(sqrt(252) - sqrt(252)-3-5)-5)*2. 175/36 Simplify (4(0 + (sqrt(19) - sqrt(76)-1)1))*2 - ((sqrt(1539) + 1 - 6(-1 + sqrt(19))) + (3 + (sqrt(38)/sqrt(2)-3 - sqrt(19)))2). 21sqrt(19) + 2416 Simplify (-1(sqrt(432) + 0)2 + 4)-6 - (sqrt(432) + 4 + sqrt(432) + 2 + sqrt(432) + sqrt(432)24)*2. -49740 - 1584sqrt(3) Simplify ((sqrt(288) + -3(sqrt(288) + -1))25 - (0 + (sqrt(2) - sqrt(162)) + (sqrt(2) + 4 + -3)*2))-6. -34812 + 4284sqrt(2) Simplify (sqrt(32)/(sqrt(14)/(sqrt(56)/sqrt(8))))/(2(sqrt(8) - sqrt(24)/sqrt(3)) + 61sqrt(8)). sqrt(2)/6 Simplify (-66(-3(sqrt(325) + -1 + sqrt(325) + sqrt(325)) + sqrt(325) + -5)6)*2 + 4. 7464960sqrt(13) + 970631428 Simplify (sqrt(10)/(3sqrt(12)/sqrt(6)))2 + 3 - (-5sqrt(720)/sqrt(4))*2-3. 121532/9 Simplify 2 + (-5 + (-2sqrt(4500)2 - sqrt(4500))-2)2. -3000sqrt(5) + 450027 Simplify 3(((sqrt(363) - (sqrt(363) + sqrt(363)-2 + 3)) + (-2 + sqrt(363))-4)1)*2. -660sqrt(3) + 4431 Simplify -1((-3(-1 + sqrt(175)) + sqrt(175) + sqrt(175))1 + 5(sqrt(700) + -1 + sqrt(700) + sqrt(700))1)6. -870sqrt(7) + 12 Simplify (sqrt(77)2-2)/(-3sqrt(112) - sqrt(112)) - (sqrt(99)/(sqrt(9) - sqrt(144)-5) + 3)2. -6 + 13sqrt(11)/84 Simplify -5-33(0 + (sqrt(75) + -1)3 + -3)2. -8100sqrt(3) + 31995 Simplify (((sqrt(200) + -2 + 3)*2 - (-2 + sqrt(200)-1 + sqrt(200))) + 1)-1 + 0. -204 - 20sqrt(2) Simplify (sqrt(12)/sqrt(3)-1 + sqrt(4) + sqrt(4) + (sqrt(4) - sqrt(256)2) + sqrt(4))/(-5-1sqrt(288) + 4sqrt(288)1 + sqrt(288)). -13sqrt(2)/120 Simplify (2((2sqrt(18))/sqrt(9))2-1 - (((sqrt(72)-1)2 - (sqrt(28)/sqrt(2))/sqrt(7)) + 1))-3. -3sqrt(2) + 267 Simplify (-1(-5 + (sqrt(76) + 3 - sqrt(76)) + 3) - (-4 + sqrt(76) + 4sqrt(76) + 1 + -5))2. -140sqrt(19) + 1949 Simplify (3(sqrt(78) + ((sqrt(78) - (sqrt(78) + sqrt(78) + -2sqrt(78) + sqrt(78)))-5 - sqrt(78))))/(3(sqrt(72)/sqrt(4))/sqrt(3)). 0 Simplify ((sqrt(33)-2-1 + sqrt(33))/(sqrt(121)/sqrt(99)))*2 - 5(2 + ((3 + 1sqrt(75))2 - sqrt(75))). -125sqrt(3) - 187 Simplify 1(((sqrt(375)5 - sqrt(375))2)/(-6(sqrt(36)6)/sqrt(12)) + 0). -10sqrt(5)/9 Simplify (2sqrt(56) - sqrt(14) - sqrt(112)/sqrt(2))/(sqrt(6)/(3sqrt(3)1)). 3sqrt(7) Simplify ((-1 + (5 + sqrt(1539) + 0 - sqrt(1539)) + 3)5-1)*2. 1225 Simplify ((4(sqrt(170) - (sqrt(170)1 + sqrt(170) - sqrt(170))))/(sqrt(90)-1) - ((sqrt(170) + (sqrt(170)2 - sqrt(170)))3)/(sqrt(160)/sqrt(4)))*2. 153 Simplify -3(-4((0 + sqrt(704))-3 - -2sqrt(704)-2)-3)246. -357654528 Simplify ((((sqrt(84) - -5(sqrt(84) - (sqrt(84) + sqrt(84)2))) + (sqrt(84) - ((sqrt(84)22 - sqrt(84)) + sqrt(84))))-1)/(1-11sqrt(192)))2. 63 Simplify (2sqrt(104)3)/((sqrt(48)/sqrt(2))/sqrt(3)) + 5 + (sqrt(13) - -1sqrt(325)) + sqrt(637) + -1 + 3. 7 + 19sqrt(13) Simplify -3 + (2(1 + -3 + sqrt(432) + 5))*2 + 4 + 1. 288sqrt(3) + 1766 Simplify -2 + -1sqrt(171) + 4(sqrt(171) + sqrt(171) + 1)2 + -5 + 4 + 4 + (sqrt(19) - (-3 + sqrt(19))2) + sqrt(19). 53sqrt(19) + 2713 Simplify ((-3sqrt(190))/sqrt(10) + sqrt(76)/sqrt(16))*2 - (sqrt(95)-26)/(sqrt(50)/(sqrt(10) - (sqrt(10) - sqrt(10)1))). 12sqrt(19) + 475/4 Simplify (6(sqrt(147) - (sqrt(147) - (sqrt(147) + -2 - sqrt(147))))2 + (sqrt(147) + 2 + -1 + sqrt(147) - sqrt(147))2 + (4 + 0 + sqrt(147))*2 + -3)4. 280sqrt(3) + 1328 Simplify (5 + (-1sqrt(228)-45)/(43sqrt(1728)))*2. 25sqrt(19)/18 + 32875/1296 Simplify (46(-5 + (-2(sqrt(1331)-2 + sqrt(1331))3 - ((sqrt(1331) - (sqrt(1331) + 1sqrt(1331)1)) + -4(sqrt(1331) + 0)))))*2. -696960sqrt(11) + 92779776 Simplify ((-2sqrt(1862)2)/(sqrt(24)/(sqrt(108)/sqrt(9))-2)6)*2. 134064 Simplify (sqrt(130)/(-4sqrt(10))4 + -5 - (sqrt(117)/(sqrt(90)/sqrt(10)) + -63sqrt(13)))2. -160sqrt(13) + 3353 Simplify ((sqrt(66) + sqrt(66) + 1(sqrt(66) + sqrt(66)-2) - sqrt(66))/sqrt(3))/(sqrt(275)2-1)5. 0 Simplify -3((sqrt(44)/(sqrt(40)/sqrt(40)) + (sqrt(1100) + -2(2sqr	{ "pile_set_name": "DM Mathematics" }
424.9238 millennia to months. 5099085.6 How many seconds are there in 40189.5ms? 40.1895 Convert 155.9578km to nanometers. 155957800000000 What is 2672.5308 minutes in hours? 44.54218 What is 7/2 of a litre in millilitres? 3500 What is 3/8 of a litre in millilitres? 375 Convert 98.43984 microseconds to days. 0.00000000113935 How many minutes are there in thirty-two fifths of a day? 9216 How many milligrams are there in one quarter of a gram? 250 How many kilograms are there in three tenths of a tonne? 300 How many millimeters are there in thirty-two fifths of a centimeter? 64 What is 0.5305637 kilograms in nanograms? 530563700000 How many kilometers are there in 888398.6 micrometers? 0.0008883986 What is seventy-one thirds of a year in months? 284 What is twenty-one quarters of a litre in millilitres? 5250 Convert 0.7803819 centuries to years. 78.03819 How many nanograms are there in five quarters of a microgram? 1250 How many centimeters are there in sixty-four fifths of a meter? 1280 What is 2/9 of a day in minutes? 320 What is one quarter of a microgram in nanograms? 250 How many nanograms are there in 17/2 of a microgram? 8500 How many milligrams are there in 0.3684994t? 368499400 How many millilitres are there in one quarter of a litre? 250 How many milligrams are there in 63.72803ug? 0.06372803 What is 5/8 of a microgram in nanograms? 625 What is eleven eighths of a hour in seconds? 4950 How many milligrams are there in 82092.06 micrograms? 82.09206 Convert 0.7531168 centuries to months. 903.74016 How many litres are there in 82.12749ml? 0.08212749 How many micrometers are there in 6/25 of a centimeter? 2400 How many centimeters are there in 392879.5 meters? 39287950 How many kilograms are there in one tenth of a tonne? 100 How many seconds are there in 1/36 of a day? 2400 What is 829.8852 kilograms in micrograms? 829885200000 How many nanograms are there in 285.4278t? 285427800000000000 What is 19/4 of a millennium in decades? 475 How many millilitres are there in three eighths of a litre? 375 What is 0.1561323 centimeters in meters? 0.001561323 Convert 913.2094 micrograms to tonnes. 0.0000000009132094 What is 7365.446t in grams? 7365446000 How many millimeters are there in 0.1190515m? 119.0515 What is 2143.488cm in meters? 21.43488 How many minutes are there in 59/4 of a day? 21240 How many litres are there in 45934.06ml? 45.93406 How many minutes are there in 3.154404ns? 0.0000000000525734 What is three fifths of a millennium in decades? 60 What is 84.26314ml in litres? 0.08426314 What is 4.065072 millilitres in litres? 0.004065072 How many minutes are there in 11/4 of a week? 27720 Convert 719.0426ml to litres. 0.7190426 What is 10.963263 months in years? 0.91360525 What is 7638.6 seconds in nanoseconds? 7638600000000 What is twenty-seven quarters of a meter in centimeters? 675 What is thirty-three fifths of a litre in millilitres? 6600 How many millilitres are there in 54/5 of a litre? 10800 What is three fifths of a week in minutes? 6048 What is 13/5 of a kilometer in meters? 2600 What is 5/8 of a tonne in kilograms? 625 What is 9/10 of a millennium in centuries? 9 How many milligrams are there in 3/40 of a gram? 75 How many hours are there in 0.90668 days? 21.76032 How many millilitres are there in 6/25 of a litre? 240 What is 9836.768 years in millennia? 9.836768 Convert 8.187606um to meters. 0.000008187606 How many millennia are there in 0.6443332 decades? 0.006443332 How many kilometers are there in 5397.57mm? 0.00539757 What is six fifths of a century in decades? 12 What is 32/5 of a century in months? 7680 How many micrograms are there in 1/64 of a gram? 15625 How many nanograms are there in 943.3971 kilograms? 943397100000000 Convert 226074.7nm to centimeters. 0.02260747 How many millilitres are there in three eighths of a litre? 375 What is 7/4 of a micrometer in nanometers? 1750 How many micrograms are there in 752.1933mg? 752193.3 What is 11/2 of a gram in milligrams? 5500 How many seconds are there in one fifth of a minute? 12 How many millilitres are there in 11/2 of a litre? 5500 Convert 457.0164g to tonnes. 0.0004570164 How many micrograms are there in 3/40 of a gram? 75000 Convert 9.950188 milligrams to kilograms. 0.000009950188 What is 844570.7 centuries in millennia? 84457.07 How many grams are there in 3/32 of a tonne? 93750 Convert 82743.67 seconds to microseconds. 82743670000 What is 828443.6 micrometers in millimeters? 828.4436 What is 7.00739 millilitres in litres? 0.00700739 What is 347.8621 litres in millilitres? 347862.1 How many seconds are there in 2/63 of a week? 19200 How many weeks are there in 54912551.4 milliseconds? 0.0907945625 What is 1/20 of a litre in millilitres? 50 How many micrometers are there in twenty-nine fifths of a centimeter? 58000 Convert 14501.84 millilitres to litres. 14.50184 How many millilitres are there in eleven halves of a litre? 5500 What is 14.50366ml in litres? 0.01450366 How many centuries are there in 4864.856 years? 48.64856 How many nanograms are there in 3/10 of a microgram? 300 How many months are there in 7/3 of a year? 28 Convert 7649.806km to millimeters. 7649806000 What is 6/5 of a millennium in centuries? 12 What is 5/4 of a litre in millilitres? 1250 How many nanograms are there in 5/4 of a microgram? 1250 What is three eighths of a microgram in nanograms? 375 What is 27/2 of a gram in milligrams? 13500 What is 1/16 of a tonne in grams? 62500 What is one tenth of a kilometer in meters? 100 What is one twentieth of a microgram in nanograms? 50 What is one tenth of a milligram in micrograms? 100 Convert 494.5217 decades to centuries. 49.45217 What is 407.0408 kilograms in grams? 407040.8 What is 5/4 of a kilometer in meters? 1250 How many weeks are there in 179.0151489 seconds? 0.00029599065625 Convert 0.6281695 kilometers to nanometers. 628169500000 How many milliseconds are there in 1/4 of a second? 250 How many minutes are there in 0.9417392 hours? 56.504352 How many millilitres are there in 11/4 of a litre? 2750 How many meters are there in 5/8 of a kilometer? 625 How many millilitres are there in 1/20 of a litre? 50 Convert 0.4105749 hours to microseconds. 1478069640 What is fourty-two fifths of a century in years? 840 What is thirteen quarters of a meter in centimeters? 325 What is fifty-one halves of a litre in millilitres? 25500 Convert 69528.18 millennia to decades. 6952818 What is 1.119438 minutes in hours? 0.0186573 What is three fifths of a kilometer in meters? 600 Convert 0.9210496 decades to years. 9.210496 Convert 22.78246 millilitres to litres. 0.02278246 How many centimeters are there in thirty-four fifths of a meter? 680 How many years are there in 21/4 of a millennium? 5250 What is 6/25 of a minute in milliseconds? 14400 How many millilitres are there in one quarter of a litre? 250 How many minutes are there in 68/3 of a day? 32640 Convert 0.168137ml to litres. 0.000168137 How many nanograms are there in twenty-one halves of a microgram? 10500 Convert 8075.061nm to micrometers. 8.075061 Convert 55356.77 centuries to years. 5535677 How many minutes are there in 50.39001us? 0.0000008398335 How many milligrams are there in fifteen quarters of a gram? 3750 What is one tenth of a millennium in centuries? 1 What is 1/5 of a micrometer in nanometers? 200 How many millilitres are there in 1/5 of a litre? 200 What is 3/25 of a millimeter in micrometers? 120 What is 12/7 of a week in hours? 288 How many centimeters are there in fourty-eight fifths of a meter? 960 What is 4008.586 millennia in decades? 400858.6 Convert 75508.53um to meters. 0.07550853 What is 11136.69 nanometers in kilometers? 0.00000001113669 How many weeks are there in 20097.973 days? 2871.139 What is one fifteenth of a century in months? 80 Convert 6.041757ml to litres. 0.006041757 What is seven quarters of a meter in centimeters? 175 What is fifty-five halves of a year in months? 330 What is 0.5541378g in nanograms? 554137800 Convert 0.0110113 micrometers to nanometers. 11.0113 What is 11/2 of a day in minutes? 7920 What is 8.959293 centuries in millennia? 0.8959293 How many decades are there in twenty-nine fifths of a millennium? 580 What is twenty-nine thirds of a decade in mont	{ "pile_set_name": "DM Mathematics" }
a. Is (-91)/a - (-2)/4 a prime number? False Let q = 4 + -6. Let r = 3 - q. Suppose 3x - 60 = -4o + 10, -5x + ro = -105. Is x a composite number? True Let w(p) = 9p2 + 6p - 18. Is w(-7) prime? False Suppose 3c - 4d - 4549 = 0, d - 1528 = -3c + 2c. Is c composite? False Suppose k + 0k + 1 = 0. Let u be 94 - (-3 - 2k). Suppose -463 = -5j + 2i, u = j - 0j - i. Is j prime? False Suppose -2r - 3p + 2p = -411, 0 = -2r + 4p + 386. Suppose 0 = -4f - 7 + r. Is f a prime number? False Let m(s) = s2 - 5s + 4. Let q be m(4). Let z(f) be the first derivative of -f4/4 - f3/3 + 69f + 23. Is z(q) composite? True Let n(m) = 51m*2 + 3m - 49. Is n(13) composite? False Is 3/(6/(-2524)-2) prime? True Let j be 16/(-3)(-5 - -2). Suppose -j = -4c, 0q - q - 5c + 57 = 0. Is q prime? True Let f = 36 + 163. Is f a composite number? False Let k(d) = d2. Let j be k(0). Suppose 0q - 3q + 105 = j. Is q a composite number? True Let a = 2 - 0. Suppose 469 = 5b - 4u, 3u - 63 + 438 = 4b. Suppose -v + b = av. Is v composite? False Let n = -296 + 532. Suppose 3y = -4f + 6y + 191, y + n = 5f. Suppose 2r = -f + 153. Is r a prime number? True Let b be (-24)/4(-2)/6. Is 34/(-3)(-6)/b a prime number? False Suppose -5t = 4l - 4, 3t + 3 + 1 = -4l. Suppose -5q + 13 = -3n, -3q = tn - 4 + 2. Suppose 0s - 6 = -qs. Is s a composite number? False Let j be -1 - ((-2 - 0) + -1). Suppose jq = 24 + 92. Is q a prime number? False Suppose -5w = -0j - 5j - 220, -2w + 93 = -3j. Let m = 92 - w. Is m composite? False Let d = 6 + -12. Let p be (-3)/d + 9/2. Suppose 4s - 125 = s + px, 43 = s - 2x. Is s a composite number? True Let z = 8 - 6. Let s = z + 1. Let x(j) = 10j + 1. Is x(s) a prime number? True Let g = 16 + -13. Suppose -2r + 110 = gr. Is r composite? True Let b be (-16)/(-9) - 8/(-36). Suppose 235 = 4x - bn - 283, 523 = 4x - 3n. Is x composite? False Let r(c) = 156 + 95 - 6c + 3c. Is r(0) composite? False Is (-7826)/(-42) - (-4)/6 prime? False Let q(c) = -c - 7. Let p be q(-3). Let b = 0 - p. Suppose 0 = -0w + bw - 76. Is w a prime number? True Let p(c) = -c3 + 2c + 2c + 4c*2 + 7c*2 - 10. Is p(11) prime? False Let u be 1 + 2-1-1. Let b be 27u + (-1 - 1). Suppose -3f + 80 + b = 0. Is f composite? False Let u be (-14148)/(-28) + 2/(-7). Suppose 0 = 8g - 3g - u. Suppose 3p + p = -d + 213, -g = -2p + 5d. Is p composite? False Let q(p) = p*3 - 11p*2 + 10p - 8. Let m be q(10). Is (-2)/8 - 170/m a composite number? True Let p = 3 + 0. Suppose -4g = -3m + 674, -m + g + 222 = -pg. Is m a composite number? True Let k(l) be the second derivative of -2l*3/3 + 9l*2/2 - 2l. Is k(-7) prime? True Suppose 0h = -2h - 5o - 10, -2o = -5h + 4. Suppose -7y + 3y = h. Suppose 0 = 2v - yv - 106. Is v a composite number? False Let c(o) = 45o*2 - o + 3. Let g be c(-2). Suppose d + 555 = 4d - 3p, -d + 3p = -g. Is d a composite number? True Suppose i + 34 = 3b, -3b - 4 = -2i - 39. Is b a prime number? True Suppose -n = -34 + 5. Let z = n + -18. Is z composite? False Let y(u) = -u2 + 8u - 7. Let v be y(5). Let o(t) = 6t - 11. Let x(j) = 6j - 11. Let a(m) = -3o(m) + 4x(m). Is a(v) a composite number? False Suppose -4m + 2m = 0. Suppose m = 4f - f - 12. Suppose fx + 111 = 7x. Is x prime? True Let d(n) = -n - 8. Let r be d(-8). Is (31/(-2) - r)-2 prime? True Let z be (9-2)/(-2) + -1. Suppose z = 5b - 2. Suppose l = bl - 19. Is l composite? False Let k = 133 - 46. Is k a prime number? False Let t(v) be the second derivative of v6/720 - v5/120 + v4/4 - 2v. Let r(y) be the third derivative of t(y). Is r(8) prime? True Let z be 7 - 6 - (-1 + -17). Suppose -1 - 3 = -h, 3y + 4h = z. Let c(u) = 10u3 + 2u*2 - 2u + 1. Is c(y) prime? True Let p = -133 + 194. Let g(m) = 2m2 - m - 1. Let l be g(-1). Suppose 0 = 4b + 5i - p, 0i - 23 = -lb - 5i. Is b composite? False Suppose 4b - g - g = 700, -5b - 5g = -875. Let k = b - 56. Is k a prime number? False Suppose -3155 - 1054 = -4u - 3l, 3u + 3l = 3156. Suppose -u - 202 = -5s. Suppose 0 = -0a - a + s. Is a composite? False Let o(w) = 5 + 1 - 1 + 12w - 7. Is o(1) composite? True Let y = 952 - 425. Is y composite? True Let v = -50 - -36. Let o = -6 - v. Let a(u) = 21u - 5. Is a(o) composite? False Let w(x) = x3 + x2 - 3x + 1. Let z be w(3). Suppose 0 = 3k - 3h - 87, k - 3h = 2h + 45. Suppose -k = -a + z. Is a a prime number? True Suppose 2d = 3d - 2. Let q(k) = -7k - 2k*d - 2k*3 + 6 + 3k - 2k2 + 3k*3. Is q(5) a composite number? False Let z = 968 + -47. Is z a composite number? True Let z(v) = -3v + 10. Let m be z(6). Is (-2698)/m + (-5)/20 composite? False Let t be -4 + 5 - (-8 - -1). Suppose 2f + 2f - t = 0. Suppose a + w + 1 = 11, fw = -3a + 30. Is a prime? False Suppose -a + 0a = -3v + 968, -4a - 319 = -v. Is v a composite number? True Let k(j) = -11j*2 - j + 6. Let x be k(6). Let v = -219 - x. Is v composite? True Suppose 5l + 2i = 38, -4l + 2 = -5i - 2. Suppose 0 = -5k + l + 14. Suppose f + kt = 45, -5t + 49 = f - 3t. Is f composite? False Suppose -2a + 14 = -2. Let w(q) = 4q + 5. Is w(a) a composite number? False Is (-1)/4 + (-705)/(-20) prime? False Is 232/(-6)3/(-2) a composite number? True Suppose 775 = 5o - 5y, -2o = 3o - 2y - 781. Is o a composite number? False Suppose 16556 - 4696 = 10g. Is g composite? True Let s(n) = 36n2 + 7n - 21. Is s(4) a prime number? False Let z(j) = -j*3 - 7j*2 - 6j - 3. Let f(d) = -2d3 - 14d*2 - 12d - 5. Let c(n) = 3f(n) - 7z(n). Let r be c(-6). Is (r/4)/((-2)/(-28)) a prime number? False Suppose 0 = n - 996 + 37. Is n a prime number? False Suppose -4745 = -4w - 3p, -2p + 1127 = -3w + 4690. Is w a composite number? False Let y(h) = h*3 - 2h2 - 1. Let o be y(2). Is 85 - o/((-1)/(-1)) prime? False Let k(f) = f3 - 5f2 - 8f. Let d be k(6). Let c be ((-6)/(-4))/((-2)/d). Suppose 5h = 4a + 185, 0 = 2h - ca + 4a - 74. Is h a prime number? True Let p(j) = -2 + j - 2j*2 + 3j*3 + 3 - 5 - 5j*2. Let r be p(5). Suppose 56 = -d + r. Is d composite? True Let z(o) = -34o - 2 + 2 + 3 - 1. Let c be z(-5). Suppose 5d = 73 + c. Is d composite? True Let p be (9 + -3)(-1)/(-2). Suppose 2g - 2t = 274, 0t + 137 = g + 5t. Suppose -90 = -2o - 2f, -f = po + f - g. Is o prime? True Let z(x) = x3 - x2 + 6. Is z(0) prime? False Suppose 3c - q - 1 = -0c, -15 = -c + 4q. Is (-15 - c)/(0 + -1) prime? False Suppose -4l + 6 = -d, -l + 2l - 10 = -4d. Is (-2220)/(-18)3/l a prime number? False Let g be ((-6)/5)/(3/(-10)). Suppose -n = -gn + 9. Is n-35(-1)/3 prime? False Let i(d) = -2d + d + 0d + 8d*2 - 2d*2. Let u be i(1). Suppose uf - 285 = 2f. Is f prime? False Let l = -369 + 1351. Let g = l + -611. Is g prime? False Suppose 29a = 30a - 34. Is a prime? False Suppose -27q + 28q - 407 = 0. Is q a composite number? True Let q(h) be the third derivative of -h4/3 + 5h*3/6 - 2h*2. Is q(-9) a prime number? False Suppose -2p - 14 = -4d, 9 - 1 = p + d. Suppose -3b - 4x - 25 = -9, -4x = -pb - 32. Let a = 93 + b. Is a a composite number? True Is 5/(-1) + (-23436)/(-21) prime? False Let k(v) = 17v*2 + 7v + 7. Is k(8) a prime number? True Suppose i = -i + 6. Suppose 2h = 4h - 978. Suppose 6r = ir + h. Is r prime? True Suppose 0 = 2c + 13 + 17. Let w be 2/8 - c/4. Suppose 4m = -4d + 124, 4d + 31 = 5d - wm. Is d a composite number? False Let w(s) = 2s - 3. Let b be w(3). Suppose 3u = -x - u - 12, bx - 4u - 12 = 0. Suppose 5m + n - 55 = x, 0 = -5m - 3n + 7 + 48. Is m prime? True Let r(a) = -2a + 4. Let t be (-3)/(0 - -3) - -4. Let g be r(t). Is g/7 - 233/(-7) prime? False Let y(b) = 4b - 3. Let k be y(2). Suppose -5v - kr = 0, -3r + 0r = -3v + 12. Suppose -3t = vt - 1865. Is t prime? True Let h be (-48)/(-20) + 2/(-5). Let o be 1(6/h)/(-3). Is 35 + -1 - (o - -2) a prime number? False Let d = 1962 + -3355. Let j = 2026 + d. Suppose h + 4h - j = -o, 0 = -o - 2. Is h a composite number? False Let t(z) = 21z - 9. Is t(8) composite? True Let a = 72 - 41. Is a prime? True Let t(s) = 4s*2 - 5s + 12. Is t(-9) composite? True Let x = -4 - -7. Let q(g) = 4g*2 - 1.	{ "pile_set_name": "DM Mathematics" }
st to 1? (a) j (b) z (c) 1 c Suppose 0 = 4u - 5 - 11. Suppose u - 5 = r. What is the closest to r in 0.2, -1/4, 2? -1/4 Let h = 1.4 + 0. Let j = 0.4 - h. What is the nearest to j in -3, 4, -0.4? -0.4 Let h be -44/(-8)1. What is the closest to 0.2 in -2/3, h, 3? -2/3 Suppose 1 = -4t - k, -2t = k + 4k - 13. What is the closest to 0 in 0.4, 2, t? 0.4 Let t = -9/4 - -15/8. Which is the closest to -0.1? (a) 2/3 (b) t (c) 1 b Let c = -27 + 26.7. What is the nearest to 0 in 3, 0.1, c? 0.1 Let m = 17 + -10. Let v = -10 + m. Let f = 23 + -23. What is the closest to 0.1 in v, -0.4, f? f Let w be (-4)/10 - (-26)/(-10). Let c = -0.05 - -9.05. Let t = c - 8. What is the closest to -2/7 in w, -0.3, t? -0.3 Let n = -3 + 7. Suppose -nv = v - 10. Which is the nearest to v? (a) -5 (b) 0.2 (c) 0.5 c Let t = -20 + 50. Let p be (-3)/4(-20)/t. What is the nearest to p in 5, 1/4, 1/2? 1/2 Let s = 0.52 + -0.12. Let n = -0.05 + -2.95. Which is the closest to -2/3? (a) 2/3 (b) n (c) s c Let t = -4 - -10. Suppose 3s + 2z = tz - 25, 0 = 2s + 4z - 10. Which is the closest to 1? (a) s (b) 2 (c) -0.3 b Let o = -4 - -3.6. Let u be 6/(-9)6/(-34). Suppose -3l = -0l + 3. What is the closest to l in 0.1, o, u? o Let r = 5 - 1. Let j be (-338)/91 - 2/7. Let x = j + 3. What is the closest to x in r, 3/4, 5? 3/4 Let m = 0.42 + -0.12. Which is the closest to 1? (a) -0.1 (b) m (c) 3/4 c Let o = -3/130 - 239/910. Let s(x) = -5x + 20. Let z be s(4). Which is the closest to z? (a) 1 (b) o (c) 0.2 c Let j = 3 + -3. Let t be (-4 - -2) + 22/12. Let k = -0.03 + 0.03. What is the closest to k in j, t, -5? j Let m = -115/323 + 9/19. What is the nearest to -0.2 in -5, 4, m? m Let r be (-1)/(-4 - (-3 + 0)). Which is the closest to 0.3? (a) -1 (b) r (c) 1/10 c Let w = 23/124 + 2/31. Let u = -1.04 + -0.06. Let d = 6.1 + u. What is the closest to w in 2, 1, d? 1 Suppose -6i - 28 = 4z - 2i, 0 = -2z + 4i + 10. Let m = -55 - -167/3. Let p = -5.13 - -5.13. Which is the nearest to p? (a) z (b) m (c) -0.4 c Suppose 0 = 3t - t + 2. Let y = -0.03 + 0.63. Let w = -0.9 + y. Which is the closest to t? (a) w (b) 0 (c) -0.1 a Let w = -9.9 + 0.9. Let x = w - -8. Let o = x - -0.9. Which is the closest to 1? (a) 2/15 (b) -1/4 (c) o a Let i = -13 + 11. Let y = 0.05 + 3.95. Which is the nearest to i? (a) 2/11 (b) y (c) -4/5 c Let m = -0.3 - 0.7. Let a = 4 - 2. Let u = 205/9 + -23. What is the nearest to u in m, a, -1/7? -1/7 Let f = -1143/55 + 103/5. Let p = 1.4 + -2.1. What is the closest to -1 in f, -1, p? -1 Let m = 0.3 + -0.8. Let n = m + 0.8. Let f = 2.6 + -3. Which is the closest to -0.1? (a) f (b) n (c) -4 a Let z = -0.21 + 0.31. Let q = 4.1 + -0.1. Which is the closest to -1? (a) 3 (b) q (c) z c Let m = -3.5 + 3. Let t = -0.4 - -0.3. Let p = -27 + 28. What is the closest to p in -0.4, t, m? t Let f = 4 + -4.1. Let i be ((-10)/(-6))/(7/(-21)). Which is the nearest to f? (a) 4 (b) -3 (c) i b Let p = -0.99 - -3.99. Which is the nearest to 2/15? (a) 4 (b) p (c) -2/9 c Let f = 0.02 + 1.98. Which is the nearest to -0.6? (a) 1 (b) -5 (c) f a Let v be (-26)/(-10) - (-6)/(-2). Which is the closest to 0? (a) -2/3 (b) v (c) 0 c Let t = -47 + 50. Which is the nearest to t? (a) -2 (b) 0 (c) 4 c Let c = 3.87 - -0.13. What is the closest to -2 in 0, c, -0.1? -0.1 Let u = 5/7 - 1. Let b = 1 + -3. Let t = 4 + -3.8. What is the nearest to 2 in t, u, b? t Let q = -0.1 - 0.2. Let s = -0.2 - q. Let w be (-19)/(-7) - (-7 - -10). Which is the closest to -3? (a) w (b) s (c) 2/7 a Let i = -5.4 + 6. Let f = -0.5 + i. What is the nearest to -1 in f, 4, -1? -1 Let p = 45 + -44. What is the closest to -2/7 in 2, p, 4? p Let v = 0 - -6. Let i = 40/7 - v. Suppose -2z + 7z - 5 = 0. What is the nearest to z in 1/7, 1/2, i? 1/2 Let m = 34 - 33. Which is the nearest to -2? (a) -1 (b) 0.4 (c) m a Let d = -23 - -20. What is the closest to 1 in d, -1, -5? -1 Let u = -1.3 + -3.7. Let y = -235 - -233. What is the closest to -0.1 in u, -2/11, y? -2/11 Let y = -0.1 + 0.6. Let u = 17/9 - 103/45. What is the nearest to 0.3 in -2/7, u, y? y Let q = -4.3 - 0.7. Let n = 2 + q. Let t = n + 2. Which is the nearest to -1/2? (a) t (b) 4 (c) 2/3 a Let v(r) = -r3 + 6r*2 + 4r - 22. Let s be v(6). Let d = 0.7 - 0.6. Which is the closest to d? (a) s (b) -3/4 (c) -0.1 c Let i = -0.112 - -0.012. Which is the closest to -5? (a) -2 (b) 5/2 (c) i a Let s = 49 + -44. Let z = 0.2 - -0.3. Which is the closest to 0? (a) s (b) 0 (c) z b Suppose 0 = -9f + 12f + 12. Which is the closest to 2? (a) -2/5 (b) f (c) 0.5 c Suppose 0 = 3g - 0 - 3. Let h = 20.1 + -20. Which is the nearest to h? (a) -1/4 (b) -0.1 (c) g b Let x = 13 - 22. Let z = x + 10. What is the nearest to 0 in 2, -0.3, z? -0.3 Let n = 12 - 13. Which is the closest to -2/9? (a) -3/5 (b) n (c) -3 a Let i = -25/3 - -8. Suppose 2p - 52 = 4m, -2m + m - 121 = -5p. Let o be (p/(-60))/((-4)/5). Which is the nearest to o? (a) 0.1 (b) -3/4 (c) i a Let j(m) = -m - 7. Let h be j(-6). Let i = 0.5 + -0.4. Which is the nearest to i? (a) -2 (b) -3/4 (c) h b Let q(a) = a2 - 6a - 1. Let x be q(6). What is the closest to 0 in x, -2/13, 5/4? -2/13 Let k be (-12)/(-8)12/(-9). Let q = 8 - 5. Let l = q + -2. What is the nearest to l in k, 0.5, -1? 0.5 Suppose 0 = 3x - 0x + 318. Let g = x - -741/7. Let y = -0.4 + 1.4. Which is the closest to y? (a) -1 (b) -5 (c) g c Let g = 2/245 - -464/3185. Let n = -13 + 12. What is the closest to n in -0.1, g, -2? -0.1 Let c = 7.8 + -1.3. Let z = c + -6. Let l(i) = i3 + 4i*2 - 6i - 4. Let x be l(-5). What is the nearest to x in -0.5, z, -0.3? z Let t = -0.24 + -0.06. Let u = -0.1 + t. Which is the nearest to u? (a) -1/3 (b) -4 (c) -2 a Let i be (-22)/10 - (4 - 6). Let v = -0.12 + -0.03. Let s = v - 0.35. Which is the closest to 0? (a) 0 (b) s (c) i a Let y = 0.6 + -1.1. Let n = 0.2 - -3.8. Which is the nearest to 0.1? (a) n (b) 2/5 (c) y b Let i = 142 + -4968/35. What is the nearest to i in 0.2, 0, -0.4? 0 Let w = -3/11 - -23/44. What is the closest to -2/9 in 0, w, -0.4? -0.4 Let i = -0.152 - 0.048. Which is the nearest to -0.6? (a) -1/6 (b) i (c) -0.3 c Let x(j) = -2j + 3. Let k be x(2). Let n be 21/(-24) + (-5)/5 + 2. Let v be (-3)/(-84) - 4/14. Which is the closest to v? (a) k (b) n (c) -3 b Let t be 6 - ((2 - 0) + 0). Let k(j) = -j + 2. Let m be k(t). Let w be (m/(-21))/(2/(-6)). Which is the nearest to 1? (a) w (b) 4 (c) 5 a Let r = -1168.03 - -1173. Let z = r + 0.03. Let v = z - 4.9. Which is the closest to 0.1? (a) -3/5 (b) v (c) 1 b Let t = -13.18 - -0.18. Let l = t + 16. Which is the closest to -1/2? (a) -0.4 (b) l (c) -5 a Let p be 6/126 + (-1)/3. What is the closest to -0.1 in 2, 0.1, p? p Let g = 1.2 - 1.37. Let l = g - -0.27. Which is the closest to 1? (a) 0.5 (b) 1 (c) l b Let x = -1.9 + 1.6. Let s = 2.5 - 2. Which is the closest to -1? (a) 3 (b) x (c) s b Suppose 0a - a + 4 = 0. Let m be 2/2 + 1/(-2). Let i = 1.5 + -2. What is the closest to -1 in a, i, m? i Let w be 3578(2 - 29/14). Let j = 256 + w. What is the closest to -0.1 in 1, 0, j? 0 Let d be ((-18)/90)/(1/(-2)). What is the closest to -2/7 in -1.1, d, -4? d Suppose -2r - 21 = -5f - 1, 5r = 4f + 1. Suppose 4c + 2d + 2 = 0, -2c - f - 4 = -2d. Let q be 0/(c + 1 + 0). What is the nearest to 0.1 in q, -3, -1/5? q Let h be (-21)/(-28)52/3. Which is the nearest to -2? (a) h (b) 5 (c) 1 c Let z = 8.5 + -8.9. Suppose 4i - 9 = i. Which is the nearest to -0.1? (a) 0.3 (b) z (c) i b Let l = 1.4 - 1.2. Which is the closest to 1? (a) -2/13 (b) -1/3 (c) l c Let p be (-52)/16 - 3/(-1). Which is the nearest to p? (a) 0.3 (b) -1/10 (c) -0.3 c Let q = 0.6 + 1.4. Which is the nearest to -1? (a) -5 (b) 5 (c) q c Let y = 7 - 7. Let b = y - -3. What is the closest to -0.1 in 0.2, b, 2? 0.2 Let i = -90 + 87. Which is the nearest to 2? (a) i (b) 2 (c) -0.1 b Let t = -2 + 1.7. Let i = 5.7 + -6. Which is the closest to i? (a) 3 (b) t (c) 1 b Let v = -108 - -107. Let j = 6 - 2. Let t be ((-6)/4)/(-5 - 1). What is the nearest to t in 1/9, j, v? 1/9 Suppose 3n = 7n. Suppose w = -nw + 7. Suppose -3r + w = -4x, 4r - 3x - 2x - 9 = 0. What is	{ "pile_set_name": "DM Mathematics" }
of 8445533? 3 What is the hundreds digit of 881805? 8 What is the millions digit of 5707298? 5 What is the thousands digit of 1033759? 3 What is the hundreds digit of 1935088? 0 What is the millions digit of 1687551? 1 What is the millions digit of 2152363? 2 What is the hundred thousands digit of 186143? 1 What is the units digit of 145785? 5 What is the hundreds digit of 131600? 6 What is the units digit of 84476? 6 What is the hundreds digit of 2941777? 7 What is the millions digit of 12352378? 2 What is the units digit of 3386396? 6 What is the thousands digit of 15101852? 1 What is the hundred thousands digit of 1778246? 7 What is the thousands digit of 451933? 1 What is the hundreds digit of 168214? 2 What is the hundred thousands digit of 10008427? 0 What is the hundred thousands digit of 2380918? 3 What is the hundreds digit of 405946? 9 What is the units digit of 1059331? 1 What is the millions digit of 5094277? 5 What is the tens digit of 15386129? 2 What is the ten thousands digit of 874238? 7 What is the hundred thousands digit of 3790637? 7 What is the hundred thousands digit of 20638982? 6 What is the units digit of 9526038? 8 What is the tens digit of 2248144? 4 What is the ten thousands digit of 385007? 8 What is the units digit of 1467973? 3 What is the millions digit of 2121134? 2 What is the tens digit of 565987? 8 What is the units digit of 3168459? 9 What is the ten thousands digit of 15077451? 7 What is the millions digit of 8014074? 8 What is the ten thousands digit of 10240680? 4 What is the units digit of 212433? 3 What is the hundred thousands digit of 208517? 2 What is the hundreds digit of 292244? 2 What is the hundreds digit of 2232779? 7 What is the units digit of 2666755? 5 What is the tens digit of 49628? 2 What is the hundred thousands digit of 291858? 2 What is the ten thousands digit of 1154220? 5 What is the hundreds digit of 2357135? 1 What is the hundreds digit of 270164? 1 What is the units digit of 314377? 7 What is the tens digit of 544391? 9 What is the ten thousands digit of 10767031? 6 What is the tens digit of 8947483? 8 What is the ten thousands digit of 469199? 6 What is the millions digit of 2731637? 2 What is the units digit of 2707899? 9 What is the hundreds digit of 701723? 7 What is the tens digit of 8601481? 8 What is the units digit of 12322632? 2 What is the ten thousands digit of 4805210? 0 What is the thousands digit of 125637? 5 What is the hundreds digit of 58376? 3 What is the units digit of 82399? 9 What is the ten thousands digit of 756002? 5 What is the ten thousands digit of 3395997? 9 What is the units digit of 1469277? 7 What is the hundreds digit of 10628? 6 What is the units digit of 23281612? 2 What is the tens digit of 15081498? 9 What is the tens digit of 69403? 0 What is the millions digit of 1585561? 1 What is the ten thousands digit of 4926305? 2 What is the tens digit of 3166140? 4 What is the units digit of 30532128? 8 What is the units digit of 66150? 0 What is the units digit of 54000? 0 What is the hundreds digit of 2573? 5 What is the units digit of 20625308? 8 What is the ten thousands digit of 689622? 8 What is the units digit of 4144492? 2 What is the thousands digit of 1334135? 4 What is the thousands digit of 10916461? 6 What is the thousands digit of 90125? 0 What is the ten thousands digit of 424200? 2 What is the units digit of 1615375? 5 What is the millions digit of 27926645? 7 What is the hundreds digit of 132334? 3 What is the units digit of 829626? 6 What is the thousands digit of 540716? 0 What is the hundreds digit of 3209563? 5 What is the units digit of 45974? 4 What is the thousands digit of 710213? 0 What is the hundreds digit of 902066? 0 What is the ten thousands digit of 2301490? 0 What is the ten thousands digit of 195493? 9 What is the units digit of 3242152? 2 What is the thousands digit of 52315? 2 What is the ten thousands digit of 56311? 5 What is the millions digit of 1070396? 1 What is the hundred thousands digit of 161885? 1 What is the hundreds digit of 22764? 7 What is the ten thousands digit of 18508? 1 What is the ten thousands digit of 132342? 3 What is the thousands digit of 11254584? 4 What is the units digit of 1640574? 4 What is the thousands digit of 7579622? 9 What is the tens digit of 4236212? 1 What is the thousands digit of 2824480? 4 What is the ten thousands digit of 51129? 5 What is the hundreds digit of 3422108? 1 What is the millions digit of 10813131? 0 What is the ten thousands digit of 3935210? 3 What is the ten thousands digit of 236787? 3 What is the ten millions digit of 12348573? 1 What is the ten thousands digit of 931062? 3 What is the ten thousands digit of 13446102? 4 What is the hundreds digit of 5408444? 4 What is the hundreds digit of 74787? 7 What is the units digit of 209293? 3 What is the units digit of 1394181? 1 What is the thousands digit of 12594241? 4 What is the thousands digit of 915045? 5 What is the units digit of 243685? 5 What is the ten thousands digit of 9228366? 2 What is the tens digit of 16907934? 3 What is the tens digit of 2423523? 2 What is the units digit of 125009? 9 What is the tens digit of 413785? 8 What is the millions digit of 9411444? 9 What is the ten thousands digit of 13709019? 0 What is the units digit of 1363279? 9 What is the hundred thousands digit of 258876? 2 What is the millions digit of 3626431? 3 What is the hundred thousands digit of 39612444? 6 What is the hundreds digit of 78830? 8 What is the hundreds digit of 289893? 8 What is the ten thousands digit of 4563903? 6 What is the units digit of 237382? 2 What is the hundred thousands digit of 17445942? 4 What is the units digit of 29326433? 3 What is the ten thousands digit of 3574908? 7 What is the thousands digit of 2870942? 0 What is the ten thousands digit of 4602866? 0 What is the hundreds digit of 58988? 9 What is the thousands digit of 2289339? 9 What is the hundred thousands digit of 129864? 1 What is the hundred thousands digit of 1054844? 0 What is the hundreds digit of 6948204? 2 What is the thousands digit of 1566401? 6 What is the hundreds digit of 683967? 9 What is the tens digit of 12342641? 4 What is the thousands digit of 659207? 9 What is the ten thousands digit of 15494? 1 What is the units digit of 1380532? 2 What is the ten thousands digit of 1185988? 8 What is the ten thousands digit of 1004976? 0 What is the units digit of 6061421? 1 What is the tens digit of 217718? 1 What is the hundreds digit of 2702451? 4 What is the millions digit of 1691507? 1 What is the hundred thousands digit of 23317817? 3 What is the millions digit of 2860228? 2 What is the thousands digit of 133809? 3 What is the ten thousands digit of 1955732? 5 What is the units digit of 1082249? 9 What is the thousands digit of 3944541? 4 What is the hundreds digit of 29443879? 8 What is the tens digit of 295025? 2 What is the hundreds digit of 24831? 8 What is the tens digit of 166586? 8 What is the ten thousands digit of 7315034? 1 What is the units digit of 1718728? 8 What is the millions digit of 5559437? 5 What is the thousands digit of 321449? 1 What is the hundred thousands digit of 272128? 2 What is the tens digit of 40676? 7 What is the millions digit of 2207239? 2 What is the units digit of 1012474? 4 What is the tens digit of 4082555? 5 What is the units digit of 1742522? 2 What is the tens digit of 2964737? 3 What is the ten thousands digit of 540344? 4 What is the thousands digit of 368619? 8 What is the thousands digit of 4406988? 6 What is the hundreds digit of 181066? 0 What is the units digit of 1633019? 9 What is the thousands digit of 29141819? 1 What is the hundreds digit of 48414? 4 What is the thousands digit of 1551593? 1 What is the tens digit of 1487190? 9 What is the ten thousands digit of 245134? 4 What is the tens digit of 3404853? 5 What is the units digit of 288855? 5 What is the tens digit of 1498785? 8 What is the hundred thousands digit of 341479? 3 What is the thousands digit of 11054509? 4 What is the thousands digit of 1263303? 3 What is the hundreds digit of 6361522? 5 What is the hundreds digit of 201324? 3 What is the ten thousands digit of 254748? 5 What is the hundreds digit o	{ "pile_set_name": "DM Mathematics" }
u - 528 = -4g, -u + g + l = -63. Suppose 2z + 3r = 57, 4r = 3z + z - u. Does 9 divide z? True Let s = 337 - 120. Is 11 a factor of s? False Let i(t) = -t*3 - 4t*2 + 6t + 5. Let g be i(-6). Let n = g - 20. Does 7 divide n? True Let d(z) = -z*3 - 5z*2 + 11z - 11. Let u be d(-9). Suppose -6b + 254 = -u. Does 26 divide b? True Let d(f) = -f3 - 3f*2 - 5f - 3. Let k be d(-7). Let h be (k/(-18))/((-6)/9). Suppose 39 = 3l + 5w, -3l = w - 20 - h. Is l a multiple of 13? True Let z(a) = -a3 + 7a*2 + 15a - 28. Is z(8) a multiple of 4? True Suppose -14g = -5508 - 1422. Is 103 a factor of g? False Let y(t) = -2t*3 + 3t*2 - t. Let l be y(1). Suppose -2a + 5k + 12 + 4 = l, 2a = k + 32. Is a a multiple of 3? True Let z(c) = 4c2 + c - 8. Let u be z(2). Suppose b = -u + 21. Is b even? False Let v(y) = 3y - 7. Let o be v(3). Suppose -4m - b + 36 = 13, 0 = -3m + ob + 9. Suppose 0 = mw - 0w - 65. Is w a multiple of 13? True Let y(a) = -5a + 5. Let l be y(-4). Suppose 0 = -0t - 3t + 3, 3t + l = 2f. Is f a multiple of 7? True Let s be (1 - -32) + (-8 - -10). Suppose -3c + 4x = -180, -4c + 5x + 275 = s. Let a = -9 + c. Does 17 divide a? True Let l = 39 - 15. Does 7 divide l? False Suppose 4b - 6 = -22, 2b - 1342 = -2u. Is 15 a factor of u? True Suppose 2o - 1320 = -9o. Does 8 divide o? True Let q = -411 - -844. Does 18 divide q? False Let r(i) = 28i*3 - 2i*2 + 5i - 2. Let f be r(1). Let k = f - -43. Is 12 a factor of k? True Let x = -329 - -573. Does 61 divide x? True Let l = -530 + 854. Suppose 7g - l = 3g. Is g a multiple of 9? True Let m = -487 + 828. Suppose -4o + m + 283 = 0. Is 24 a factor of o? False Suppose -8 = t + 3h, 5h + 4 = t + 12. Let j(q) = q3 + 8q*2 - 6q - 20. Does 5 divide j(t)? False Suppose 0 = -4c + 8, 4x - 26 = -x - 3c. Suppose -4h + 144 - x = 0. Is 7 a factor of h? True Suppose 3x = 7z - 3z + 258, 4x + 3z = 369. Let q be ((-5)/(-10))/((-1)/(-84)). Let r = x - q. Is r a multiple of 24? True Is -31/3(-46 + 3) a multiple of 12? False Suppose 3n - 4o - 20 = 14, -2n + 2o + 26 = 0. Is n a multiple of 3? True Suppose -3n + 18 = 3g, -17 = -5g + g + 3n. Let t be g - (-4)/(-4)-2. Suppose 0 = 2o - 4u + 2u - 10, 5o - t = -4u. Does 2 divide o? False Let z(f) = -f2 + 18f + 9. Let x be z(18). Suppose -xk + 4k + 75 = 0. Is 8 a factor of k? False Is (12 + 30)/(-14) - 912/(-1) a multiple of 107? False Does 15 divide ((-17185)/(-21) - -4) + 6/9? False Let g = 811 - 670. Does 15 divide g? False Let y be -1 - 1(-5 - -2). Suppose yd + 2i = -2i + 56, -i = -4d + 103. Suppose -35 = -n + d. Is 15 a factor of n? False Let b = 256 + -137. Let k = -39 + b. Does 19 divide k? False Let u = 425 - 412. Is 13 a factor of u? True Let n be (0 - 0)2/(-4). Suppose n = 5o - 3o - 58. Is 5 a factor of o? False Let m(a) = -7a - 10. Let i be ((-6)/(-4))/(12/(-80)). Let p be (-37)/5 + (-4)/i. Does 13 divide m(p)? True Suppose -11q = -0q + 5q. Suppose -5m = -5o + 314 + 211, 4o - 3m - 417 = q. Is o a multiple of 26? False Let n(c) = 7c - 27. Does 2 divide n(7)? True Let q be (-98)/(-7)(16 + 0). Suppose -4t - 4t + q = 0. Is 14 a factor of t? True Suppose -x = 5c - 201, 92 + 27 = 3c - x. Does 11 divide 504/c - 1/(5/(-2))? False Suppose 0d = 2d - 4. Suppose f = -dx - 3, 2f + 4x - x + 1 = 0. Does 7 divide f? True Let r(o) = -5o*3 + 11o2 + 13. Let w(z) = z3 - z*2 - 1. Let l(s) = -r(s) - 6w(s). Does 37 divide l(-8)? True Suppose 0 = -87y + 86y + 2. Is 11 a factor of 55/(-3)(y - 11)? True Suppose 0 = 38g - 36g - a - 816, -1628 = -4g + 4a. Does 17 divide g? False Let a = 1410 - 626. Suppose 4b + 2f - a = 920, -4f - 2130 = -5b. Suppose 5k - b = -k. Is 10 a factor of k? False Suppose -3u = -2p - p + 252, 0 = 2p + 2u - 180. Let l = p - 53. Is 2 a factor of l? True Suppose -h = -3p + 140, p - h + 175 = 5p. Is 6 a factor of p? False Is 13 a factor of (-13)/(117/99) + 588? False Suppose 5i - 777 = -4g, -2i - 3 = 3. Is g a multiple of 11? True Let u = 17 + -15. Let k(r) = 6r + 0r - 8 - 8r + r*u. Does 5 divide k(6)? False Let b be 18/(-8)96/36. Is 21 a factor of (-2)/(8/126)8/b? True Let v(a) = 50a*3 - 2a2 - a + 1. Is 23 a factor of v(2)? True Let y(m) be the third derivative of -m4/24 + 15m3/2 + 7m*2. Let j be y(17). Let i = j - -8. Is i a multiple of 13? False Let a(v) = 5v + 2v - 2 + 9v - 2. Is a(4) a multiple of 10? True Let n = -209 - -391. Is n a multiple of 7? True Let d(f) = -f + 10. Let t be d(10). Let k be 1 - t/4 - 1. Suppose kw = 2w - 36. Is w a multiple of 18? True Suppose 7m - 11m = 36. Suppose 73 - 10 = 3x. Let v = m + x. Is 12 a factor of v? True Suppose -18w + 33 + 21 = 0. Is w even? False Let s be 3861/(-7) + (-33)/77. Is ((-4)/6)/(16/s) a multiple of 19? False Suppose 8s = 3s - 5n, 0 = -5n - 15. Suppose -2p - 2l + 114 = 0, -57 - 16 = -p + sl. Suppose -20 = h - p. Does 19 divide h? False Let t(z) = z3 - 7z*2 + 6z + 12. Let h be t(5). Does 12 divide (2022/h)/(-3) + 2/(-8)? True Let t(d) = d*3 + 2d*2 + 8d - 12. Is t(4) a multiple of 15? False Let k(q) = 2q2 - q - 7. Let w be k(0). Let j = w - -76. Does 20 divide j? False Is (-7 + 9/((-27)/(-6)))-8 a multiple of 11? False Let z be (931 - 1)(0 - 4/(-8)). Suppose -z = -3x + 2q + q, 0 = x + 5q - 125. Is 26 a factor of x? False Suppose -130 = -3f - 4j, f - 20 = -j + 22. Suppose -26 = -x - 3c + f, -3c + 272 = 5x. Does 13 divide x? True Let c(n) = n2 - 3n + 4. Let q = 27 + -21. Suppose -10 - q = 4w. Is 16 a factor of c(w)? True Let k = -68 - -20. Let r = -23 - -109. Let q = r + k. Is q a multiple of 15? False Let v(u) = 4u*2 - 20u + 23. Let q(p) = 7p2 - 40p + 45. Let c(r) = -3q(r) + 5v(r). Is c(14) a multiple of 8? True Suppose -27q + 5200 = -2q. Is q a multiple of 4? True Suppose -3l - 4a = 24 - 164, 5l - 276 = 4a. Does 11 divide l? False Let i = -471 - -1016. Does 4 divide i? False Suppose 5b - 2p = 3p + 1820, 0 = -b - p + 358. Suppose 5g - b - 399 = 0. Does 11 divide g? False Let k(z) = 27z2 - 1. Let s be k(1). Let a be ((-444)/(-30))/(2/10). Suppose 4i - s = a. Does 11 divide i? False Let o(b) = -4b - 73. Is o(-29) a multiple of 21? False Let q(k) = 2k + 53. Let v be q(-24). Let y(z) = z*2 - z + 1. Let i(d) = -4d*2 + 7d - 1. Let b(j) = i(j) + 6y(j). Is b(v) a multiple of 15? True Let m(j) be the first derivative of 25j*3/3 + 3j*2/2 + 2j + 7. Is 12 a factor of m(-1)? True Let n be -18 + (2 - 2). Let y = 9 + n. Is (-70)/(-4) - y/2 a multiple of 13? False Let l(d) = d3 + 19d*2 - 46d - 36. Let v be l(-20). Let z = v - 273. Is 22 a factor of z? False Let m(g) = 5g2 - 7g - 8. Does 13 divide m(6)? True Let r(g) = -16g2 - g - 1. Let p be r(-1). Let k(h) = -h3 - 15h*2 + 17h + 18. Let y be k(p). Is 27 a factor of 91/y(-2 - -4)? False Suppose 5j - 4f + 246 = 5716, -2f = -j + 1100. Does 8 divide j? False Let x(d) = -7d2 - 2d - 2d2 - d3 + 3d*2 - 6d*2. Is 8 a factor of x(-12)? True Does 40 divide -1 - -326 - (5 - 0)? True Let l = 47 - 46. Let z(f) = 21f + 1. Is 10 a factor of z(l)? False Let m(l) = 4l3 + 6l - 14. Is m(4) a multiple of 38? True Suppose -p + 1695 = -4j, 0 = 20p - 16p + 5j - 6822. Is 85 a factor of p? False Let a be (-8)/4(1 - 2). Suppose at - 3q - 88 = -0q, 3q = -6. Is 14 a factor of t? False Suppose -3742 = -3u - h + 5036, -5u - h + 14628 = 0. Is u a multiple of 73? False Let q be (-100)/(((-2)/18)/(8/(-48))). Let l = q - -255. Does 15 divide l? True Suppose -2p + 4820 = 2s, -2p - s + 9646 = 2p. Let g be p/135 - (-4)/30. Suppose 16y = gy - 112. Does 8 divide y? True Is 12/(-15) + 1014/30 a multiple of 11? True Let i(w) = -w - 3. Let x be i(-5). Suppose 0 = y - 2y - xn + 46, -y - 5n + 43 = 0. Suppose 5z - 264 = -a, 6a - y = -z + a. Does 9 divide z? False Let n be (6/5)/((-6)/(-20)). Suppose 0 = 5d - 4k + 3k - 35, 2k - 7 = -d. Suppose -da + n = -5a. Does 2 divide a? True Suppose 5z + 210 = m, 4z = -5m + 410 + 553. Does 23 divide m? False Let c = 3476 + -2152. Is c a multiple of 10? False Is 29 a factor of 6(-11)/(11/(-64))? False Let f be (66/(-15) + 4)-5. Suppose fd - 338 = -0d. Does 17 divide d? False Suppose -3	{ "pile_set_name": "DM Mathematics" }
uppose -3n + p + op = -74, -5n + 135 = 5p. List the prime factors of n. 2, 13 Suppose 50 = 5o - 10o. Let q = o - -14. Suppose -4x + 38 = -5w, -w = qw + 10. List the prime factors of x. 7 Let c = -19 + 14. List the prime factors of (c + 1)(-11)/22. 2 Suppose 0 = -2g + g + 2. Let b(w) = 7w*2 + 2w - 1. Let i be b(-2). Suppose 5a - 62 = -3r, -1 = -ga - r + i. What are the prime factors of a? 2, 5 What are the prime factors of ((-3)/6)/((-4)/136)? 17 Suppose -4 - 2 = -3c. Let q = -26 + 14. Let n = c - q. List the prime factors of n. 2, 7 Let o(w) = 37w2. What are the prime factors of o(1)? 37 Let n(o) = -4o + 2. Let y be n(-3). Let f = 4 - 14. Let v = f + y. List the prime factors of v. 2 Suppose r - 18 = 3q, 3r - 47 - 22 = 4q. Suppose g + 3y - 11 = -0y, r = g - y. List the prime factors of g. 23 Let x(k) = -k + 1. Let w be x(-3). Let q(r) = 4r - 2r - 1 - 2 - r3 - wr2. What are the prime factors of q(-5)? 2, 3 Let s(v) be the third derivative of -v4/6 - v*3 - 2v*2. Suppose 5j - 3 + 23 = 0. What are the prime factors of s(j)? 2, 5 Let n = 1 - -12. Let h = 19 - n. List the prime factors of (-76)/(-6) - 4/h. 2, 3 Let w(l) = -l*2 + 6l + 2. Let k be w(6). Let c(r) = 1 + 3r - 1. What are the prime factors of c(k)? 2, 3 Suppose -4w - 82 = 5i, 2w = 3i - 34 + 4. Let m be (27/6)/(12/(-32)). Let b = m - w. What are the prime factors of b? 2, 3 Suppose 5d + l + 3 = 0, -l + 3l + 6 = -2d. Suppose 4t + o - 45 = d, -t + 0o = 4o. What are the prime factors of t? 2, 3 Let m be 1/2 - (-31)/2. Let t = m + -11. Suppose 0 = -tq + 25, -3c - 2q - 3q + 70 = 0. What are the prime factors of c? 3, 5 Let g be 69/(-5) + (-1)/5. Let q = g + 69. List the prime factors of q. 5, 11 Let v(z) = z3 + 6z*2 - 2z - 5. List the prime factors of v(-4). 5, 7 Suppose 3g - 8 = 2g + 2p, 0 = 5g + 3p + 25. Let j be 6/(-4) + (-21)/(-2). Let o = j - g. List the prime factors of o. 11 Let l = 15 - 8. Suppose -3w - l = -46. List the prime factors of w. 13 Suppose 0 = -4c + 6c - 6, -2b + 2c + 54 = 0. What are the prime factors of b/128/5? 2 Let y(r) = -r2 + 3r + 4. Let t be y(3). Suppose v = 2a - 0a + t, -3a = -6. List the prime factors of v. 2 Let z(c) = 5c - 4. Let w be z(4). Suppose -5n = -5q - w - 14, 3q - 6 = 0. Let t = n + -6. List the prime factors of t. 2 Suppose 2x - i - 49 = 0, -2x - 4i = -6i - 52. List the prime factors of x. 23 Let s(w) = -w3 + 5w*2 - w + 3. Let l be s(5). Let r be (12/16)/(l/(-16)). Suppose z - r = 1. What are the prime factors of z? 7 Suppose 2x + 4 = 3x. Suppose 0 = -j - xj + 75. What are the prime factors of j? 3, 5 Suppose -2z = k - 3k + 64, 5z - 92 = -2k. List the prime factors of k. 2, 3 Suppose 3d - 4l - 204 = 0, -l = -d + 4l + 68. What are the prime factors of d? 2, 17 Let b(u) = 0u2 - 15 + 19 + u2 + 3u - 4u. List the prime factors of b(0). 2 List the prime factors of (-2285)/(-65) + 4/(-26). 5, 7 Let z be (6/4)/(1/2). Suppose -zu + 23 - 8 = 0. Suppose 0w - 55 = -uw. List the prime factors of w. 11 Let h(i) = -i2 + 2i. Let a be h(3). Suppose j = 5j - 4. What are the prime factors of j/a - 50/(-6)? 2 Suppose -42 = 4z - 7z. What are the prime factors of (-6)/(z/(-10) - -1)? 3, 5 Suppose 0 = p - 0h - 3h - 51, -5p + 217 = 4h. List the prime factors of p. 3, 5 Let d be (12/9)/(2/(-6)). List the prime factors of (-56)/(-21)(-33)/d. 2, 11 Let a = -38 - -80. Let f = a + -28. What are the prime factors of f? 2, 7 Let l = 97 - 55. Suppose 5i - 2 = -l. List the prime factors of (-14)/i(5 + -1). 7 Let t(i) = i*2 + 4i - 4. Let w be t(-6). Let z = 12 - w. What are the prime factors of z? 2 Let d(o) = -o*3 - 2. Let q be d(-2). Suppose 4 = qc - 2c. What are the prime factors of (3/(-3))/(c/(-12))? 2, 3 Suppose -5g - 5 = -0. What are the prime factors of (g/3)/((-1)/9)? 3 Let p(m) = -4m - 7. Let g be p(-3). List the prime factors of -9(g/(-3))/5. 3 Let x = 36 - -4. Suppose q - x = -q. List the prime factors of q. 2, 5 Suppose -2c - 6 = 0, 2z - 2 = c + 7. Suppose -zd + 16 = -11. Suppose -x + 3 = -d. List the prime factors of x. 2, 3 Let n = 16 - 12. Suppose -ni = -75 + 15. List the prime factors of i. 3, 5 Let j(b) be the first derivative of b*2 - 8b - 1. What are the prime factors of j(11)? 2, 7 Suppose 3s + s = 0. Suppose 16 = 4m - sm. Suppose -mw - 10 = -6w. What are the prime factors of w? 5 Let w(j) = -j2 + 6j - 5. Let p be w(4). Let x = p + -1. List the prime factors of 7 + x - (1 + 1). 7 Let d(i) = i + 1. Let c be (7 + -2 + 0)/1. What are the prime factors of d(c)? 2, 3 Let y(b) = b*2. Let f(v) = 2v - 1 + 2v2 + 3v*2 - 3v*2. Let j(p) = f(p) + 4y(p). What are the prime factors of j(1)? 7 Suppose -498 + 1379 = 5z + 4a, -2a - 857 = -5z. What are the prime factors of z? 173 Suppose -7w + 4w + 18 = 3j, -w + 36 = -5j. Let v = -7 + w. Let b = 7 - v. What are the prime factors of b? 3 Suppose -i - 4o + 8 = 0, 5o + 0 = 3i + 10. Let v = i + 2. List the prime factors of v. 2 Suppose -3y + 4v - 4392 - 2593 = 0, -9303 = 4y + 5v. List the prime factors of y/(-65) - (-2)/10. 2, 3 Suppose -3u - 5v = -3v - 951, 2v = 3u - 951. List the prime factors of u. 317 Suppose -133 = -3u + 5w, -49 = -u + w - 4w. List the prime factors of u. 2, 23 Let l be 2/(-6) - (-2)/(-3). Let x be l - -4 - 0/2. Suppose -23 = -2u + i, 0i + xi + 14 = u. List the prime factors of u. 11 Let q = -91 - -168. List the prime factors of q. 7, 11 Suppose 0 = -p - 0w - 5w + 13, -34 = -2p - 2w. What are the prime factors of p + (-1 - 5) + 3? 3, 5 Let j = -4 - -26. List the prime factors of j. 2, 11 Let i(h) be the third derivative of -h4/12 + h3/3 + h*2. What are the prime factors of i(-4)? 2, 5 Suppose 3 - 2 = 3p + 4f, 3f = -2p. Let b(n) = pn*2 + 3n + n*2 - 4 + 3 - 5n. What are the prime factors of b(2)? 11 Suppose -10y + 503 = -157. What are the prime factors of y? 2, 3, 11 What are the prime factors of -21236/(-8)? 59 Suppose 4s - 2 + 30 = 0. Let r = s - -26. What are the prime factors of r? 19 Let k(l) = l*2 - 3l - 2. Let n be k(4). Suppose no - 2j - 22 = 0, -2j = -o + 10 - 0. List the prime factors of o. 2, 3 Suppose -j = j. Suppose -2 = b - jt - 3t, 0 = -3b - 3t + 6. Suppose 8 = -2r, 5r = -3a + 9 + b. List the prime factors of a. 2, 5 Suppose f + 20 = 5f, 2v - 3f = -3. Let o be 250/v + 4/(-6). Let u = o + -26. List the prime factors of u. 3, 5 Suppose 3v + 4 = 4v. Suppose 0 = g - 4g + 3i + 3, -4g + 12 = vi. Let r = g + 4. What are the prime factors of r? 2, 3 Let b be 1((-1 - -2) + 1). Suppose -y = 5q, -2y + 6y = -2q. Suppose 0 = -2k - 7n + 6n + 3, q = 2k + bn. List the prime factors of k. 3 Let w(d) = d2 + d - 1. Let k be w(2). Suppose 3v = kb + 12, b + 1 - 21 = -5v. List the prime factors of v. 2 Suppose 2x = -3a + 59, -a + 45 = 2x - 8. What are the prime factors of x? 5 Let d = -6 - -9. Suppose -m + 2m = -dx - 1, -2m + 4x + 8 = 0. List the prime factors of m. 2 Let k = -1 - 6. Suppose p - 5b + 14 = -7, 4b = -3p + 32. Let c = p - k. What are the prime factors of c? 11 Suppose -4 = 2r + 10. Let h(g) = -2g + 8. List the prime factors of h(r). 2, 11 Let r(o) = 3o + 1. List the prime factors of r(2). 7 List the prime factors of 23 + -13 - 8/(-2). 2, 7 Let k = 196 - 80. Suppose -7s + k = -3s. What are the prime factors of s? 29 Let f(z) = -13z + 4. Let l(o) = -15o + 2. Let v(r) = 7r - 1. Let k(u) = -3l(u) - 7v(u). Let h(x) = -6f(x) + 21k(x). What are the prime factors of h(-2)? 3 Let o be (-7)/28 + 63/(-4). Let f = -24 - o. List the prime factors of 250/40 + 2/f. 2, 3 Suppose -2v = 6, 3v = -k - 0 - 5. What are the prime factors of k? 2 Let w be -1 - (-1 + (-8 - 2)). Suppose 4y - w = 2y. Suppose -3k = yq - 17, -11 + 3 = 4q. List the prime factors of k. 3 Let u(v) = v3 + 12v*2 + 10v - 7. Let n be u(-11). Suppose -f = 4b - 3f - 22, 0 = -nb + 5f + 31. What are the prime factors of (5 + -4)1b? 2 Suppose 2x + d - 55 = 0, -3x - 6d = -11d - 102. What are the prime factors of x - (-7 - (-2 - 1))? 3, 11 What are the prime factors of (1/(-3))/(4/(-1308))? 109 Let x(s) = 5s - 1. Let u be x(-6). Suppose -3v + 157 = 3h - 4v, -5*h + 259 = -v. Let l =	{ "pile_set_name": "DM Mathematics" }
5. Is 9/2 >= i? True Let b be 34/6 + (-2)/(-6). Let j = 8 - b. Which is bigger: 0 or j? j Let g = 19 - 18. Is g less than or equal to 1/2? False Suppose 8h - 9h + 1 = 0. Is 1 <= h? True Let w be (2 - (0 + 4))/(-1). Suppose -6x + 40 = -wx. Is x equal to 12? False Let j = 0.31 + 0.29. Which is smaller: j or 0? 0 Let n(a) be the first derivative of a*2 - 6a - 3. Let i be n(10). Suppose -3w - 10 = -4l, 5l + 1 = 4w + i. Which is smaller: -1 or l? -1 Let h = 4.3 + -0.3. Let u = h + -8. Is -1/3 <= u? False Let k be (-8)/(-4)(-2)/12. Let x = -48/7 + 418/63. Which is smaller: x or k? k Let c = -0.1 - -0.3. Let n = 3 - 0. Suppose -r = 2r + n. Are c and r non-equal? True Suppose -3j + 2c + 11 = -2, 3j + 17 = -4c. Which is bigger: -1/21 or j? j Let b be ((-2)/3)/(1/(-3)). Let o(h) = h*2 - h. Let c be o(2). Suppose -3x = 15, 6x = -cs + bx - 22. Does s = -1? True Let q(b) = -b2 - 9b - 1. Let j be q(-12). Is j bigger than -38? True Suppose 3q - a = -6, 2a - a + 6 = -3q. Let z be ((-3)/6)/(q/4). Are z and -1/4 nonequal? True Let j(h) = 2 + 3 - 5 + h - 1. Let q be j(-5). Let o be ((-2)/q)/(3/36). Which is smaller: 2 or o? 2 Let a = -202 + 183.2. Let h = -20 - a. Which is bigger: 1 or h? 1 Suppose -4c + 39 = 7. Suppose -5m + c = -12. Suppose g = 5, -2z + g + 5 = -0g. Does m = z? False Let u = -42 + 125/3. Let h = 6.01 - 6. Let w = h - 4.01. Is u at least as big as w? True Let b(q) = q - 1. Let a be b(1). Let n = -1 + 1. Is a not equal to n? False Let h = 0.089 + 0.011. Suppose 4o = m + 27, -2 = 3o + 5m - 51. Which is smaller: o or h? h Let g = -1.37 - -1.07. Is 6/5 < g? False Suppose 0 = -3i - 2i + 85. Let d = 16 - i. Which is bigger: d or 1/2? 1/2 Suppose 3s - 7 - 2 = 0. Let q be 1/(11(-4 + s)). Which is bigger: 0 or q? 0 Let g = -51.7 - -2.7. Which is smaller: 0 or g? g Let c(g) = -g*2 + 10g - 10. Let v be c(7). Let y = v + -9. Suppose -2l + l - y = 0. Is 1 < l? False Let o = -0.24 - -0.14. Is o less than or equal to 0.06? True Let a = 145 + -140. Which is greater: a or 8? 8 Let q = -1135/56 + -1/56. Let n = q - -20. Are n and 1/3 equal? False Let q(z) = z2 + z - 1. Suppose -2r = 5u - 2 - 4, -5u + 2r + 14 = 0. Let p be q(u). Let f = 5 + 0. Is p greater than or equal to f? True Suppose 5f + 5i = 80, -i = f - 3i - 4. Suppose 4d - 3x - f = -x, 3x = 6. Which is smaller: d or 0.2? 0.2 Let c be ((-97)/(-48) + -2)/(-1). Let o = c - -13/48. Is 0.1 >= o? False Let d = -5 + 4. Let w = -0.5 - d. Let t = w - -2.5. Is t at least as big as 2/3? True Let j(v) = 2v*2 + 3v + 6. Let c(a) = -2a2 - 3a - 7. Let l(u) = 5c(u) + 6j(u). Let p be l(-2). Suppose 0w - pw = 0. Which is greater: w or 1? 1 Let l be 46/8 + 11/44. Suppose 4s + l = -2. Is -4/3 less than or equal to s? False Let h(s) = -4s*3 + 2. Let r be h(-2). Let j be 5/r(-8)/(-10). Which is bigger: j or 1? 1 Suppose 2v + 30 = 7v - 2n, 4n = v - 6. Let h = -7 + v. Do h and -2 have the same value? False Let y = 5 + -2. Suppose -2 = yc - 2z, 0 = -5c - z + 3z - 2. Is 2/13 < c? False Suppose -11 = -2v - 5l, -v + 0 = -5l + 2. Which is smaller: 8 or v? v Let c = 3 - 3. Let z = -10 + 10.3. Are c and z nonequal? True Suppose 7n = 8n - 6. Suppose -3a = -6m + m + n, 0 = 3m + a + 2. Let h be 16/42 - 4/6. Which is smaller: m or h? h Let x be 3/4 + (-4)/112-27. Which is smaller: 1 or x? 1 Let d(o) = -o + 12. Let w be d(13). Let v be ((0 - 0)/(-1))/1. Is w <= v? True Let l = -3.5 - -3.39. Are 0 and l non-equal? True Let a = -75.97 - 1.03. Is 1/4 greater than or equal to a? True Suppose 3 - 1 = -k, -1026 = 4j - 5k. Let o = j - -1797/7. Is -1 less than or equal to o? False Suppose -4q = -5a - 17, 5q + a = 3a. Let z = 4 - 3. Let j = z + q. Is 0 >= j? True Let x be (-46)/(-216) - (-5)/(-20). Is 1 at least x? True Suppose -3m = -15 - 9. Let x be (-1)/2 + 2/m. Do 0 and x have the same value? False Let f be (-3)/(-4) - 310/40. Which is smaller: f or 0? f Suppose -3o - 905 = -8o - 5m, -4o = -m - 724. Let t = -1271/7 + o. Are t and -2 nonequal? True Let j(v) = -2v2 - 5v + 2 + 8v + v2. Let g be j(4). Which is smaller: 0 or g? g Suppose 3 = i - 2i, 0 = -2h - 2i - 6. Which is smaller: h or 2/105? h Let r(l) = l2 - 3. Let y be r(0). Let p(h) = -h3 - 2h2 + 4h + 4. Let t be p(y). Is 0 <= t? True Let h(r) = r + 9. Let i be h(-9). Which is smaller: 1 or i? i Let t be -16((-11)/6 - -2). Let s be -8 + 6 - (2/2 - 1). Does t = s? False Let t be -33/(-15)-5. Let b be t(-5)/((-330)/4). Is 0 at least b? True Let a be (2/(-5))/(2/20 - 0). Which is smaller: a or 1? a Suppose 0 = -2b - 3b + 5d + 25, d + 5 = 5b. Is b at most 0? True Let u = -532 - -341. Let l = 192.97 + u. Let g = -0.03 - l. Which is smaller: -1/2 or g? g Let a(z) = z*3 + 2z*2 - 6z - 5. Let m be a(-3). Let b be ((-4)/(-8))/(m/(-24)). Which is smaller: b or -1? b Let f = -1.3 - -1.5. Which is smaller: f or 2? f Let o = 8.79 - -0.21. Let m = -6 + o. Let n = 1 - 1. Is m greater than or equal to n? True Let o = -5.1 + 0.6. Which is greater: o or 2/5? 2/5 Let f be ((-42)/(-4)(-32)/(-40))/(-4). Is f greater than -2? False Let v = 2 - 2.1. Let h = v - -0.3. Let p = 2.9 + -3. Which is greater: p or h? h Suppose -10 = 5v - 5d, 0 = -3v + 5d - d - 8. Suppose vx = -3x + 3. Do -1 and x have the same value? False Let c be ((-21)/28 - 0)/(3/(-2)). Which is bigger: 1 or c? 1 Suppose 0 = 2n + n - 2k - 5, 0 = 5n + 5k + 25. Let u = -979 - -1913/2. Let h = u + 22. Which is smaller: h or n? n Let b be 54/(-24) - 1/(-4). Is b at most -42/13? False Let d = -5/18 + -43/18. Is -2 at least as big as d? True Let a = -7.11 + 0.11. Let k = a + 6. Which is smaller: 6 or k? k Let p = 18 - 12. Suppose -c + pc - 10 = 2k, -5k = -3c + 6. Which is bigger: 4 or k? 4 Let u = -123 - -120. Suppose -3x - 16 = 2z, 5z - 16 = -x - 43. Is z < u? True Suppose 0 = -b + 5z + 20, 4b + 0b = -5z - 20. Let p = b + -1. Let q be (24/(-36))/(11/(-3)). Is q at least p? True Let t = 2 + 26. Is t greater than or equal to 26? True Suppose -11 = 7n + 17. Let d = 6 - 4. Let f = -7 + d. Is f smaller than n? True Suppose 2t = 5t + 9, -2t - 60 = 3l. Is -18 > l? False Let t = -6 + 5. Let w be 1 + -91 + t - -1. Let f be (-132)/w + 2/(-3). Is 1 not equal to f? True Let a(u) = u3 + u2 + 5u + 3. Let q(y) = y + 1. Let l(o) = a(o) - 4q(o). Let p be l(1). Is p at most 3? True Let i = -15125/8 + 1887. Are -5 and i unequal? True Let o be (24/70)/(26/91). Which is bigger: o or 2? 2 Suppose -3o - 18 = 3l, 4o + 3l + 28 = 9. Let u be o + 3 - 28/15. Do u and 0 have different values? True Let l be -5 - 6(-4)/8. Let y be l/3(-3)/(-7). Which is bigger: y or -1? y Let s = 23 + -14. Let w = s - 5. Is w less than -0.2? False Let h = -8 - 0. Let x(d) = -d3 - 8d2 - d - 8. Let v be x(h). Which is bigger: v or -2/11? v Let c = -21.2 + 21. Which is bigger: c or 3? 3 Let f(d) = -d3 + 18d2 + 2d - 23. Let v(c) = c*3 + 7c*2 + 3c. Let x be v(-6). Let i be f(x). Which is greater: i or 14? 14 Let f = 5 + 0.1. Let y = f + -5. Let q be -12(-21)/(-6). Is q < y? True Let c be 111/2(-24)/18. Is c > -74? False Let i = -0.09 - 0.91. Is i at least as big as 0? False Let g(v) be the first derivative of v3/3 + 5v*2/2 - 6v - 5. Let y be g(-5). Is y less than -2? True Suppose s - 54 = -12. Suppose -3t + 3k - s = 2t, -k - 26 = 5t. Is t at least -4? False Let t(a) = -a*2 - 12a - 13. Let i be t(-9). Suppose 0 = -5v - m + 8, 2v + 3m = -m + i. Is 1/9 bigger than v? False Let l(a) be the first derivative of -6a - 3/2a2 + 2a*3 - 1/4a*4 - 1. Let r be l(5). Is r greater than 4? False Suppose -5n + 4 = -1. Let j be 0 + -13 + 2 + n. Which is smaller: j or -9? j Let v be 0 - (0 - 2/(-1)). Which is bigger: v or 4/3? 4/3 Let m be (-1)/1-2 + -1. Let u be m/3 - 100/12. Is u < -13/2? True Let l = -2.3 + -12.7. Let f = l - -14.1. Let s = -1 - f. Which is smaller: 0.1 or s? s Let w(g) = g3 - 5g2 + g + 5. Let j(r) = -r2 - 6*r + 4. Let l be j(-6). Let z be w(l). Is z < -6? True Let k = 29 - 29. Let q = 1 - -2. Let h be 5/q + 1 + -2. Which is smaller: k or h? k Let i = -5.1 + 4.9. Which is smaller: i or 6/5? i Let h = -1/364 + 417/19292. Which is smaller: h or 0? 0 Let v = 0.184 + -0.084. Let k = -0.1 + 6.1. Is v	{ "pile_set_name": "DM Mathematics" }
s kr(w) + 5s(w)? -w*2 - w Let w = 1 + 5. Suppose 0 = -5q + 5n + 60, wn = 5q + 2n - 60. Let k(f) = 10f - 10. Let m(t) = 4t - 4. What is qm(h) - 5k(h)? -2h + 2 Let x = 66 - 60. Let h(c) = -4c - 7. Let r(n) = 9n + 15. What is xr(k) + 13h(k)? 2k - 1 Let d(y) = -y + 7. Let x(j) = -3j + 20. Give -11d(a) + 4x(a). -a + 3 Let z(t) = 13t + 6. Let f(d) = -12d - 5. What is 6f(a) + 5z(a)? -7a Let a(t) = 4t2 - 5t - 5. Let l(q) be the second derivative of q + q*3 + 3q*2 - 5/12q*4 + 0. What is 6a(w) + 5l(w)? -w2 Let q(y) = -5y - 1. Let t(f) = 3f + 1. Give -2q(a) - 5t(a). -5a - 3 Let n(p) = -4p2 + 8p. Let a(m) = 8m2 - 15m - 1. Let t(v) = -4a(v) - 7n(v). Let u(k) = -11k2 + 11k + 11. Calculate -17t(z) + 6u(z). 2z2 - 2z - 2 Let j(t) = 4t - 1. Let z(o) = -3o + 1. Determine 5j(q) + 7z(q). -q + 2 Let x(h) = 14h3 + h2 - 4h. Let d(g) = -13g3 - g2 + 3g. Determine -6d(k) - 5x(k). 8k3 + k2 + 2k Let z(w) = -17w + 11. Let s(q) = 6q - 4. Let h be 1/(-5) + 112/10. Determine hs(b) + 4z(b). -2b Suppose 0 = 3w + 3. Let y(t) = -3t - 14. Let u(x) = x + 5. Suppose -3l - 26 = 25. Let z(m) = lu(m) - 6y(m). Let d(a) = a + 2. What is wd(k) - z(k)? -2k - 1 Let v(s) = -s*2 - 4s + 5. Let b be v(-5). Let x(i) = 1 + 2 + bi - 2i. Let p(q) = 5q - 7. Calculate -3p(r) - 7x(r). -r Let z(a) = -5a*3 + 14a*2 + 8a + 11. Let n(w) = 2w3 - 5w*2 - 3w - 4. Give 11n(u) + 4z(u). 2u3 + u2 - u Let a(p) = 10p*2 - 17p + 23. Let y(o) = -3o2 + 6o - 8. What is 6a(g) + 17y(g)? 9g2 + 2 Let c(t) = 5t + 9. Let k be c(-3). Let n(l) = -1. Let o(g) = g + 3. Determine kn(r) - o(r). -r + 3 Let a(x) = 19x*3 - 4x*2 - 4x - 4. Let r(k) = -360k3 + 75k*2 + 75k + 75. Determine -75a(m) - 4r(m). 15m3 Suppose g = 4g + 3. Let h(b) = -b*2 + 3b + 3. Let s(k) = 11k - 16. Let m(t) = 7t - 10. Let j(w) = 8m(w) - 5s(w). What is gh(i) + j(i)? i2 - 2i - 3 Suppose 5m = 16 + 4. Let r be (m + -2)15/(-6). Let y(q) be the second derivative of -q*2/2 - q. Let z(l) = -l + 7. Determine ry(k) - z(k). k - 2 Let t(s) = -7s2 - 6s - 3. Let i(r) = -6r2 - 5r - 4. Calculate -4i(m) + 3t(m). 3m2 + 2m + 7 Let w(t) = -5t2 + 2t - 1. Let k(o) be the second derivative of -7o4/6 + 5o*3/6 - 3o*2/2 + 3o. Calculate -4k(s) + 11w(s). s*2 + 2s + 1 Let k(r) = 6r - 2. Let a(n) = 1 - 1 + 2 + 2n + 4. Let g(v) = -v - 2. Let x(l) = -6a(l) - 17g(l). What is 4k(y) - 5x(y)? -y + 2 Let o = -2 + 0. Let y(z) = z2 + z + 2. Let l be y(o). Let v(q) = -q3 + 4q2 + 4q. Let c(r) = 2r - r3 + 0r*3 + 3r*2 + r. What is lv(j) - 5c(j)? j3 + j2 + j Let y(l) = -8l*3 + 4l*2 + 4l - 4. Let f(v) = -9v3 + 5v*2 + 5v - 5. Let b(n) = 5n3 + n2 + n. Let w be b(-1). Calculate wy(p) + 4f(p). 4p*3 Let n(y) = 7y - 4. Let p(a) = a + 9. Let h(i) = 2i - 4. Let b be h(0). Let x be p(b). Let d(c) = -10c + 6. Determine xd(u) + 7n(u). -u + 2 Let s(p) = -p + 1. Let w(l) = -l. Give s(b) - 5w(b). 4b + 1 Let o(m) = m*3 - 1. Let s(y) = -2y*3 + 3. Suppose 5w + 0g + 3g - 39 = 0, 9 = 3g. Calculate wo(h) + 2s(h). 2h*3 Let o = 6 - 0. Let u(i) = -2i + 4i - 3 - 5i. Let j(f) = 2f + 2. What is ou(k) + 10j(k)? 2k + 2 Let x(t) be the third derivative of -t6/60 - t5/12 - 5t3/6 - 4t*2. Suppose -6 - 19 = 5v. Let s(l) = 2l3 + 6l*2 + 6. Determine vx(i) - 4s(i). 2i3 + i2 + 1 Let h(t) = t3 + t2 + 2t + 2. Let x(v) = -v3 - v2 - 2v - 2. Give -5h(n) - 4x(n). -n3 - n2 - 2n - 2 Let f be -3 + 2 - (-19 - 0). Suppose -n - 5k + 2k = -f, 3k = n + 12. Let z(i) = i2 + i + 2. Let j(r) = -r2 - 2r - 3. Calculate nz(w) + 2j(w). w2 - w Let m(n) = n2 + n + 1. Let u(g) = -10g*2 - 5g - 6. Give -5m(j) - u(j). 5j*2 + 1 Let s(w) = -w + 1. Let g(m) be the third derivative of 7m4/24 - m3/2 + 11m2. What is g(i) + 3s(i)? 4i Let i(u) = u. Let r be (-61)/(((-84)/8)/(-7)). Let s(b) = -3b. Give rs(v) - 10i(v). 2v Suppose 0 = 20b - 6b + 14. Let j(z) = z + 0 + 0z + z2 - 1. Let v(p) = p2 + 2p - 2. Determine bv(h) + 2j(h). h*2 Let i(s) = -8s - 9. Let w(c) = -c - 1. Give 6i(t) - 51w(t). 3t - 3 Let q(o) = -4o - 18. Let x(a) = a + 1. Give -q(w) - 5x(w). -w + 13 Let i(n) = -3n*2 + n + 5. Let c(m) = -m + 1. What is -3c(f) + i(f)? -3f2 + 4f + 2 Let g(r) = -7r2 + 6r - 7. Suppose -11f - 37 + 103 = 0. Let i(n) = 8n*2 - 7n + 8. Determine fi(b) + 7g(b). -b*2 - 1 Let l(a) = 2a*2 - 2a + 5. Let n = 12 - 7. Let f(s) = 3s2 + ns*2 - 1 + 5 - 2s - 6s2. Give 6f(i) - 5l(i). 2i*2 - 2i - 1 Let k(y) = -2y2 + 5y + 5. Let d(a) = -3a2 + 5a + 5. Let i(s) = -6d(s) + 5k(s). Let n(u) = -12u2 + 8u + 8. What is 8i(v) + 5n(v)? 4v2 Let m(l) = -2l + 14. Let x(t) = t - 13. Determine -2m(g) - 3x(g). g + 11 Let h(r) = 2r3 - 22r + 5. Let d(k) = k*3 - 7k + 2. Let c(v) = 7d(v) - 2h(v). Let l(q) = -q*3 - 2 + 6q - 3q3 - 3. Calculate -5c(m) - 4l(m). m3 + m Let a(j) = -j2 + 2. Suppose -5w - 264 = -4m, -3m - 4w + 198 = w. Let t(l) = -m + 63 + 0l*2 + 2l*2. What is 3a(r) + 2t(r)? r2 Let v(j) = 1. Let y(k) be the second derivative of -k3/6 + 2k*2 - 8k. Give -12v(s) + 3y(s). -3s Let n(g) = -4g - 10. Let d(l) = -1. What is -8d(a) + n(a)? -4a - 2 Let c(o) = -3o3 + 5o. Let a(f) be the third derivative of f6/8 - f4 + 11f2. What is 5a(z) + 24c(z)? 3z*3 Let a(y) = -y. Suppose 5w - 17 = -4h + 8h, 43 = -5h - w. Let s(m) be the third derivative of -1/8m*4 + 0m + 0 + 0m3 + m2. Calculate ha(j) + 3s(j). -j Let f(j) = -2 - 4j - 13j2 + 6 - 14j*2 + 28j*2. Let m(y) = -y + 1. Suppose 23 + 13 = -4v. Let c = v + 15. What is cm(o) - f(o)? -o2 - 2o + 2 Let i(w) = 5w3 - 2w*2 - 2. Suppose 0 = 10r - 2r - 16. Let x(f) be the first derivative of 3f4/2 - f3 - 3f - 1. Give rx(z) - 3i(z). -3z*3 Let k(m) = -6m + 5. Let o(d) = -1. Let j(h) = 7h - 1. Let s(w) = j(w) + 5o(w). Determine 4k(b) + 3s(b). -3b + 2 Let g(y) = y3 - y2 - y - 1. Let h = 0 + 4. Suppose -9 = 3p + hf, 0 = 5p + 6f - f + 10. Let z(q) = 2q3 - q2 - 2. Calculate pg(s) - z(s). -s3 - s + 1 Let m(n) = 9n - 1. Let x(o) = 26o - 3. Give -7m(s) + 2x(s). -11s + 1 Let a(q) = -q*3 - 12q*2 + 2q - 1. Let f(d) = 4d3 + 35d*2 - 7d + 4. What is 7a(n) + 2f(n)? n*3 - 14n*2 + 1 Let v(d) = -2d - 1. Let t(r) = 0 + 1 - r + 3r. Suppose 2x - 2o = -18, 5x + 39 = -0x + 3o. Let p be 1-1(43 - 38). Calculate pt(q) + xv(q). 2q + 1 Let u(o) = 9o*2 - 4o - 2. Let w(p) = 8p2 - 3p - 2. Give -5u(c) + 6w(c). 3c2 + 2c - 2 Let k be -1 + 9/7 + (-546)/(-147). Let w(y) = 6y3 + 3y*2 + 4y. Let p(m) = -7m3 - 4m*2 - 5m. Give kp(c) + 5w(c). 2c3 - c2 Let k(a) = -2a*2 + 3a + 4. Let h(b) = -6b2 + 9b + 12. Determine 6h(u) - 17k(u). -2u2 + 3u + 4 Let t(i) = i - 1. Suppose k + 9 - 6 = 0. Let c(r) = 2r2 - 5r + 2. Calculate kt(x) - c(x). -2x*2 + 2x + 1 Let u = -9 + 32. Let q(k) = 4k + uk*2 - 22k*2 - 4 - 2k. Let v(d) = -d*3 - d + 1. Give -q(z) - 2v(z). 2z3 - z2 + 2 Let k(x) = x2 + x - 1. Let v(a) = 14a*2 + 12a - 12. Let h be 1/(-1 + -2 + 4). What is hv(p) - 12k(p)? 2p2 Suppose -3s - 18 + 6 = 0. Let j(g) = -4g. Let t(x) = 4x. Determine sj(k) - 5t(k). -4k Let l(b) = -4b - 31. Let j(o) = -o. Determine 5j(s) - l(s). -s + 31 Let u(r) = 3r*3 + 8r*2 - 8r + 8. Let q(v) = -2v3 - 5v*2 + 5v - 5. Give -8q(i) - 5u(i). i*3 Let g(m) = -3m + 5. Let l(h) = -4h + 6. Let w(u) = -2 + 0u*3 + 5u + u*3 - 3 + 7u*2. Let s be w(-6). Let r be (-2 - -9 - 2) + s. Give rg(p) - 5l(p). 2p Let j(y) = 3y2 + y + 3. Let r(z) = -z - 1. Let h(p) = p3 - 4p*2 - 7p + 7. Let s be h(5). Determine sr(b) - j(b). -3b*2 + 2b Let k(l) = -2. Let g(a) = a + 8. What is -2g(u) - 6k(u)? -2u - 4 Let a(i) = -i2 - i. Let n(z) = 16z*3 - 6z*2 - 6z. Determine 6a(o) - n(o). -16o3 Let m(z) = -z2 - 6z + 7. Let k(g) = 20g + 14. Let a(i) = -7i - 5. Let p(v) = 17a(v) + 6k(v). What is m(h) + 6p(h)? -h*2 + 1 Let x(p) = 2 + 4p + p3 - 4 + 0. Let y(k) = -k3 - k + 1. Suppose -5*n + 13 = 8. Determine n	{ "pile_set_name": "DM Mathematics" }
132)? -127 Evaluate (-2)/10 + (28/35 - (12008/(-920))/(-19)). -2/23 What is 11/43-1(6 - 16 - -11)? -1/43 What is the value of 5 + (-1128)/558 + (60/(-21) - 24/168)? -2/93 Evaluate (-149)/(43806/84) + -6(-212)/42. 30 8 + 153/54 + (-385)/210 9 Evaluate ((-532)/(-2128) - (1 + (-110)/4))4. 107 What is ((3/621)/((-156)/(-2106)))/(33/12 - 2)? 2/23 ((261 - -4)/(12/(-4)))/(115/552-8) 53 (-2)/7 + (-3036)/(-385) - (-102 - (150 - 260)) -2/5 What is 21 + 11040/(-525) + 199166/4235? 47 What is 2 + 10/(-35) - ((-2)/28)/((-896)/(-680960))? 56 What is the value of ((-24)/(-132) - (-8130)/660)20/175? 10/7 Calculate (-11840 - -11825) + ((-1524)/(-116) - -2). 4/29 Calculate (10191/387 - 23)(-1 + 13/(-5)). -12 What is the value of -30 + 490/(-175)(-600)/63? -10/3 Evaluate 182/(-221) + 23595/27846. 1/42 What is the value of 3/((-117)/45 + (-21)/(7140/(-3434)))? 2/5 What is ((-52)/(-12))/((-20)/35149/(-108))? 13/2 (6 - 795/120) + (-6176)/(-1280) 21/5 What is the value of (9 + -2)1 + (2968 - -10)1/(-426)? 2/213 Calculate (-2)/(-109) + (-1743456)/(-41529). 42 What is the value of (-820)/(-29110) + 104/1349? 2/19 What is the value of (705/470)/(((-108)/(-880))/9)? 110 Evaluate 6580/(-19656) + 222/5772. -8/27 928757/129594 - (-202)/(-60) 19/5 4277/(-455)-3 + (-6)/5 27 Calculate (3/9)/((-82)/(-60 + -3466)). 43/3 Calculate (-294)/539-11 + 27. 33 Evaluate ((-760)/(-570))/((-19)/(627/286)). -2/13 Calculate 2585/66 - 25/(-10) - 24/36. 41 Calculate (-27)/(-81)((-931)/98)/((-2)/(-4)). -19/3 Calculate 171 + -151 - (-5)/(-10)-36. 38 What is ((-19)/(-2))/((-32864)/12064) + (-1)/((-2)/7)? 1/79 Calculate (5978/245 + -25)/((-1278)/60). 2/71 Evaluate (-522)/116(1 - (-2)/(-12))(-148)/2109. 5/19 What is 11958/342 - (-2 - -9) - 28? -2/57 What is 102(-2926)/(-5412) - 55? 6/41 Calculate -5 - (-342)/95 - 77/(-35). 4/5 What is ((-2)/6 - (-1769)/183)/(2/612)? 7/3 What is the value of ((-180)/140-2(-3)/9)/(99/924)? -8 Calculate (-70)/(-2)((-268)/(-16) - ((-140)/10 + 31)). -35/4 Evaluate (18/(-7))/(-6)(-77154)/(-4546575). 2/275 What is ((46/(-84) - 380/(-532))-14)/(66/(-54))? 21/11 What is the value of 41805/(-684) - (-15 - (27/(-3) + 4))? -5/9 Evaluate (-73)/(-146)((-26)/5)/(1/45). -117 Calculate (-8 - 102/(-12))(824/(-1064) - (-5)/35). -6/19 (37 + (-545)/15)(-7)/91 -2/39 Evaluate -4 + (200/(-112) + 2)/((-3)/(-44)). -6/7 (22 + (-1027)/39)/(51/27 + -2) 39 What is the value of -1 + ((-80)/8 - (1996/(-88) - -12))? -7/22 Evaluate (8 - (-792)/(-108))/(4(-7)/(-504)). 12 What is the value of (2/(-13) + (-7248)/(-2496))/(10 - (-355)/(-40))? 22/9 Evaluate 223 - (-27 - -28 - 112/8 - -17). 62 What is the value of (-236 - -117)(-42)/(-102)? -49 (-12000)/3848/(-7) - ((-30)/(-21))/(-5) 36 Calculate -39 + 10339/147 - ((-20)/(-15) + -2). 32 Evaluate 225/(-125) + 4032/(-60). -69 Evaluate 434900/134850-31 + 100. 2/87 Evaluate (4/7 + (-24)/2688-16)(19 - 20). -5/7 Evaluate (63/39)/((-8153)/(-105989)). 21 Evaluate -53 - 8754/(-168) - (1-2 + 25/20). -1/7 Evaluate (-117453)/7038 + 19 + 181/(-75) + 18/225. -1/46 Calculate (-6)/(-24)-2 + (-923)/(-142) + (34 - -1). 41 What is the value of 5391/(-7188) - (-50)/72? -1/18 What is the value of 0 + 16/4(2175/570)/(-29)? -10/19 What is the value of (37 + 1875/(-50))/(77/(-120) - (-2)/3)? -20 What is the value of (-594)/(-24 + -30) - 210/19? -1/19 What is the value of 192/(-1176)((-10915)/(-444) + -24)? -2/21 Calculate ((-608)/(-112))/(45/4217/(1020/48)). 19/3 Evaluate (-14)/2 + (4 - -2) - 31/(-1). 30 What is (-148)/(-144) - (15/1 - (6 + (19 - 11)))? 1/36 What is the value of ((-114)/24 - (-21)/28)(-181 + 182)? -4 What is (-106)/11 + (56620/(-1045))/149? -10 What is (-25)/(-465)(-1149)/1915? -1/31 What is (-24(-32)/256 - ((-11)/(-2) - 2))6? -3 What is the value of 25/3(856/(-8988) - 1/(105/(-766)))? 60 (-8433)/(-153) + ((-69760)/1088 - -64) 55 What is the value of ((-7540)/(-195))/((-6)/(-63)21/(-6))? -116 Calculate (-15188)/280978 + (200/2331)/1. 2/63 Calculate -20 - (-4 + 1880/(-47)). 24 What is the value of (358 - 364)/((156/(-40) + 4)6)? -10 Calculate (-4552/(-390) - (-198)/(-30))/(-30). 1/50 Evaluate 2004/201 - ((-2730)/(-91) + -20). -2/67 (-7928)/(-67388) - (-285)/612 7/12 Evaluate (-147)/7 + 23 + ((-3600)/459)/4. 2/51 Calculate (46 - (-41412)/(-901) - (-192)/(-13515))-15. -6/17 Evaluate 2952/(-2460) + 809/(-180) + 12/27. -21/4 What is (-4)/(-16(-12 - (-1221)/99))? 3/4 What is the value of (1531 + -1439)(6/(-16))/(9/(-12))? 46 Calculate ((-31)/(-403))/(936/(-676)). -1/18 What is (-1 - 3)(7 - (13/3 + 3))? 4/3 What is (22/((-4928)/288))/(15/(-455))? 39 Evaluate (481/39)/((-3025)/75 + 40). -37 Calculate 1(8/10 + (1176/(-120))/(2/2)). -9 ((-39)/(-28))/(-18(-18)/(-720) + 6/5) 13/7 Calculate (-5 + 5466/(-18))/(-28) + (-4 - 14/2). 1/42 What is the value of 32598/467238 + (-9626)/(-86)? 112 88(-4)/(-132) - (2 - 173/(-3)) -57 Calculate (54/6669)/((-12663)/(-351) + -36). 2/19 What is 12 - (14340/800 + -23) - (16 - -1)? 3/40 Evaluate (-21040)/4734 - 22910/(-5175). -2/115 Evaluate (663/51 + -15)10. -20 Evaluate (-232)/(-435)(-15)/18(-1 - 8) + -35. -31 Evaluate 3 + 35(5 + -6). -32 What is the value of (3447/2298)/(3/(-40)) + -28? -48 What is the value of (1 + 1)(-62006)/(-4532) - 28? -7/11 What is the value of ((-2)/((-4)/(-6)))/(25650/(-135) - (-25)/10)? 2/125 Evaluate (-10)/80-106212/(-212). -53/4 What is (-28)/6276/(-805) + -4? -12/5 What is (28 - (-9982)/(-168)) + 31? -5/12 2246595/(-9360) - -241 - (-1)/48 1 Evaluate ((-8)/(-256) - 1065/288)-3. 11 Calculate ((-9471)/10824)/((-1155)/45). 3/88 24 + 416(-145)/2030 -40/7 42 + (1628/(-296))/(7/(-4)(-6)/(-21)) 53 What is (-2)/(-8) + ((-2548)/(-2128) - (-21)/(-14))? -1/19 What is (-2932430)/346350 - (-5)/62? -34/5 Evaluate (18844/161520((-222)/(-21) - -1))/((-3)/5). -9/4 14 + ((-83)/3)/((-10)/(20(-6)/24)) 1/6 Evaluate (30 + -8 + -19)(-2)/75195/(-52). 3/10 Evaluate (-14 + 12 - (-9)/5)(-3)/6. 1/10 What is the value of (-14180)/709 - 612/(-32)? -7/8 Evaluate -12903/23478 - 372/234. -5/3 What is the value of (-9 - (-4)/(-12))(18 + 43884/(-2436))? 4/29 ((-228)/2(-1)/(-5))/((-58320)/(-145800)) -57 Calculate ((3213/(-78))/7 + (2210/68 - 28))-13. 18 Evaluate ((-116)/105 + 1162/(-12201))-80. 96 (-94 + 50)/(-44) + 31/(31527/(-1026)) -1/113 Evaluate 40/((-23120)/102)(-26)/26. 3/17 (3 - 35) + 4/(-6)(-810)/(-60) -41 Calculate (-7880)/(-985) - (-98 + -3). 109 What is 26/80 + -3 + (-354)/(-105) + 2048/(-3584)? 1/8 What is 708/(-4602) + (6/2 - (-142)/78)? 14/3 Evaluate 13/8 - 7(-5778)/(-24624). -1/57 Evaluate 1400/7760048/(-42). -2/97 What is (6 - -12)/(11448/1484)? 7/3 (-1081)/47 - 1819/(-85)5 84 What is the value of (1 - (5 + -1)) + 91/(-273)? -10/3 What is the value of 366/10 - ((-2288)/65)/88? 37 Evaluate (146/(-584))/((2 + -4)(-1)/(-280)). 35 (8/(-4))/4(28 - 16) + 246/42 -1/7 Evaluate (-5 - 566/30) + (114/(-399))/(45/21). -24 Evaluate -6 + (2 - 5) + (46 - 49) + (-657)/(-27). 37/3 Evaluate 4/238(-21641)/(-53466). 1/147 Calculate (9/(-35))/(2958/(-85) - -33). 1/7 Calculate (-2760)/(-348) + -8 + (-21)/(-3) + 25504/(-232). -103 Calculate 46/186 - (8214/21904)/(25/(-8) - -2). 18/31 Calculate (87/(16443/14))/(18/(-324)). -4/3 What is ((-2)/(-22))/((-1806)/(-735042))? 37 (-20)/2940020(5 + -8) 2/49 (-4)/14(-336)/(-1296) + (7 - 4654/351) -19/3 -9 - ((6 - -3) + 25 + 31 + -71) -3 What is 68/5474020965 - 26? 1/23 (-4)/(-15)4641/14 - 1920/4800 88 Evaluate ((28850/550 + -53)/((-66)/(-4)))/(1 - -1). -2/121 What is the value of ((24/(-160))/((-792)/(-1540)))/((-3)/18)? 7/4 Evaluate (-3218)/(-140) + 5892/412440. 23 What is (12367/(-249) - -50)(-8)/1216? -32/9 Calculate ((-1142)/3426 + (-2)/(-60))/3. -1/10 What is the value of (-410/(-4) - (-161195)/(-1565)) + (-26)/(-2)? -80 Evaluate 23 - ((-8)/96 - (-1465)/12). -99 What is the value of (-29564)/(-2971182) - 11674/1608? -29/4 Evaluate -19 - ((12 - -6) + -31) - 21. -27 Calculate (-198)/(-23100)25 - 4772/56. -85 Calculate ((-45)/(-243))/((-5775)/495). -1/63 -43 + -34 + 87 + -12 -2 (-33 - -641)/(-38) + (-1 - -18) + 81 82 What is (149 - 87) + (75 - 80) + 2/21? 58 3801/77 - 18424/376 4/11 Evaluate 9*(580/(-696) - (805/(-90) - -8)). 1 102 + (11799 - -161)/(-65) -82 What is ((-1)/3)/(22589/(-3234) + 35 - 28)? -22 Eva	{ "pile_set_name": "DM Mathematics" }
- 2f = -12. Suppose g - 3l + 3 = 0, 11g = 9g + 2l + 6. Is g less than or equal to p? True Let b = 849.12 - 12.12. Let i = -800.3 + b. Let v = -37 + i. Which is greater: -5 or v? v Let n = 26.72 + -26.9. Is -0.23 at least n? False Let x be (-3 - (-2 - -2))-1. Let z be (-370)/(-380) - (x - (-12)/(-8)). Is -1 greater than z? False Let x be (-2)/(6 + 4048/(-676)). Let p = x - -169. Is p at least as big as -1/245? True Let o = 1263 - 1264. Which is bigger: -29/48 or o? -29/48 Let v = 1003836/68468701 - 2/100247. Is -1 > v? False Suppose -2a - 16 = -4f, 0 = -69a + 70a - f + 15. Is -89 greater than or equal to a? False Let d = 1.37 - 95.37. Let l = -90.1 - d. Let y = l - 0.7. Is y at least -0.1? True Let d = 28 - 24. Suppose -d = g + 5. Suppose 0r - 8 = r. Is g smaller than r? True Let q = -958/3 + 319. Is -9.74 != q? True Let y be (1 - 88)1/3. Let r = -1529 - -1502. Is r bigger than y? True Suppose -2n = -n + 27. Let g(d) = -44d + 40. Let b be g(6). Let u be (b/n)/4 - 2. Is u < 1/5? True Let k(o) = -o*3 + 13o*2 - 16o + 2. Let v be k(11). Let u be (-1587)/(-23) + (7 - 7). Which is smaller: v or u? v Let x(u) = -3u3 - u2 - u - 1. Let n be x(-1). Suppose -nw - 21 = -57. Which is greater: w or 35/2? w Suppose -59 = -4x - 5p, -7x = -6x - 4p - 20. Let f be (-20)/(-12)x/(-10). Which is bigger: f or -3? f Let a be 12 - (-15672)/9156-7. Which is greater: a or 0.3? 0.3 Let a(o) = -2o*3 + 167o*2 + 266o + 85. Let g be a(85). Is g smaller than -1? False Let w be (-78 - -80)12/206. Which is smaller: w or -1? -1 Let l = 13477 + -13476.9. Which is smaller: -7286/9 or l? -7286/9 Let m(j) = 3j*3 + 67j*2 - 29j + 37. Let q be m(-23). Let g be (3 - q/(-114))/((-4)/(-70)). Which is greater: g or -1? -1 Let r = -3/410645 - 4742128397/8623545. Let h = -550 - r. Which is smaller: -2/27 or h? h Let l(f) = -2f2 - 11f - 13. Let c be l(-4). Which is greater: 1285 or c? 1285 Let n = 102/5 + -704/35. Let w = 19862.9536 + -19863. Which is smaller: w or n? w Suppose -33d - 57163 + 117850 = 0. Which is smaller: 1836 or d? 1836 Let o = -45 + 53. Suppose -3k - 10 = -a + 6a, -o = 4a - 3k. Suppose f - 2f + 5i = -13, -3f + 2i = 0. Are f and a nonequal? False Let j be ((-387)/63 + 5)(-3 + 2692/(-8)). Which is smaller: 374 or j? 374 Let l = 5498 - 5532. Let w be ((-24)/(-28))/((-6)/(-56)). Which is bigger: l or w? w Let k be 130 - (5 - 8) - 2/1. Let u be ((-4)/6)/((-40)/7860). Is u >= k? True Let h = -650 + 783. Let v be 16/(-10)((-588)/8 - 9). Which is bigger: v or h? h Let v = -174.35 + 227.35. Is -1/15 < v? True Let y(d) = 16d*2 + 4d - 9. Let n be y(-4). Which is smaller: n or -1? -1 Let n(b) = 45b - 121. Let u be n(5). Which is smaller: u or 106? u Let o = 15129/284 + -3147179/11644. Let z = 217 + o. Which is greater: z or 1? 1 Let t(o) = 6o - 7. Let n be t(0). Let j = n + 4. Let x be j(-80)/(-45)-3. Which is smaller: 13 or x? 13 Let h be (6/4)/((-12)/(-16)). Suppose 0 = hu + 6u - 320. Suppose u = -13b + 21b. Which is smaller: 3 or b? 3 Suppose n - a = -6, n + 4a - 3 = 16. Suppose -2k + 5z = 3z - 22, 31 = k - 5z. Suppose -km = 6m - 96. Which is greater: m or n? m Let i(y) = y3 + 3y*2 - 6y - 8. Suppose 0h = -h + 16. Suppose -5k = -4x + h + 4, -2k + 5x = 8. Let a be i(k). Are 0 and a equal? True Let t(f) be the second derivative of f4/12 - f3/3 - 5f*2/2 + 6f. Let c be t(3). Let g be c/10 - (-182)/1085. Is 0 at least as big as g? True Suppose -34y - 3y + 320 = -17y. Which is smaller: 83 or y? y Let x(s) = -s2 + 22s - 34. Let b be x(20). Suppose -2 = ba + 16. Let p be (-51)/(-21) - (-4 - a - -2). Which is smaller: -2/5 or p? -2/5 Let h(s) = -s2 - 101s - 649. Let x be h(-92). Is 40 < x? True Let t be (-1)/((111 - 117) + ((-57175)/(-6))/5). Which is greater: 0 or t? 0 Let i(x) = -599x - 2396. Let n be i(-4). Is -6/1817 at least as big as n? False Suppose 5n + 12o = 13o + 72, -2n - 3o = -5. Is n bigger than 166? False Let w(h) = 5h2 + 9h - 56. Let b(d) = 14d2 + 29d - 169. Let y(v) = 4b(v) - 11w(v). Let k be y(-20). Do k and -6/29 have the same value? False Let b(a) be the third derivative of a5/40 + a4/4 - 13a3/3 + 26a*2. Let p(q) be the first derivative of b(q). Let c be p(-2). Is -3/14 < c? True Let o = 587 + -611. Let c be (-18)/o - (-222)/120. Is c greater than 2? True Suppose 0 = 365c - 3 - 5 + 8. Let z(v) = 2v2 + 2v - 4. Let n be z(3). Let s be (3/2)/((-21)/n). Which is bigger: c or s? c Suppose 2v + 4 = -0q + 5q, -v + 4q - 2 = 0. Let s(c) be the second derivative of -3c3/2 - 17c*2/2 + c - 10. Let p be s(v). Is p greater than 4? False Let h = -43515 + 43513. Let p = 1.94 + 0.06. Let g = -2 - p. Is g > h? False Let p be (7005/9)/(-5) + 5-1. Let f = 161 + p. Is f bigger than 7/11? False Suppose -4o + 4k - 12 = 0, -3o + 6o = -3k + 21. Let u = o - -34. Suppose 2156 = 92w - 1235 + 171. Which is smaller: u or w? w Let w = 60 - 19. Suppose -4 = -l + 49. Let m = w - l. Which is bigger: m or -35/3? -35/3 Let t(w) be the second derivative of -2w3/3 + 31w*2 - 8w - 5. Let x be t(9). Which is smaller: 0.6 or x? 0.6 Let k = -0.0473 - 359.9527. Let q = 497 + k. Is q at least as big as -2/5? True Let t be (24/90)/(4/(-6)). Let a be -9 + 42/7(-40)/(-24). Which is smaller: a or t? t Let x = -713 - -712.6. Is x greater than or equal to -1073? True Let f = -130 + 143. Is -144 > f? False Let b(x) = -4x*2 - 36x - 79. Let q be b(-5). Let c = -2/361 - -381/3610. Which is bigger: q or c? q Let s = -2/11 + -8/77. Let n = -58 + 39. Let l = -21 - n. Which is smaller: l or s? l Let t = -7571 + 53077/7. Suppose 12 = 2i + 2i. Suppose 16 - 46 = -iv. Which is bigger: t or v? t Suppose 6323 = -4k - g, 953 = -k + 7g - 577. Which is bigger: k or -1582? k Let c(o) = -o2 + 3o + 5. Let p be c(4). Let h be 303/102 - (2/15 + (-559)/(-195)). Is p less than or equal to h? False Let y = 3/22 + 5/286. Let h = 23.66 + 0.34. Is y at least as big as h? False Let o be (-1341)/(-8) - -29/48. Suppose -o = -20d - 8. Do 20/3 and d have the same value? False Let x(j) = -j*3 - 16j*2 - 17j - 31. Let a be x(-15). Let o be ((-11)/9 - a) + (-36456)/14553. Which is smaller: o or -3? -3 Let y(p) = -10p2 - 36p - 28. Let v be y(17). Is -3530 less than v? False Let i = -647.5133 - 0.3867. Let a = i + 648. Is 203/3 less than or equal to a? False Let q be 22/33 - (0 - (-8)/21). Let h = -1259 + 1295. Is h not equal to q? True Let n = -123 - -125. Let t be (7/1)/((-4 + n)/2). Let y(m) = -2m2 - 15m + 2. Let a be y(t). Is a at least 14? False Suppose 203m + 1536 = 200m - 2118. Which is smaller: m or -1219? -1219 Let s = 237.8 + -229.8. Let i be 2 + (3 - (-62)/(-14)). Is i greater than s? False Let v be ((-2)/(-4))/(98/1344). Let r(k) = k*3 - 4k*2 - 3k - 4. Let y be r(5). Which is greater: v or y? v Let p be (-3 + 1935/2)/(-18). Let w = 209/4 + p. Let l = 15/4 + -4. Are w and l nonequal? True Let n be 20((-68)/(-425))/(((-12)/15)/4). Which is smaller: 10 or n? n Let t be 39/(-3)1 - 1. Let n = -20 + -156. Let o = 160 + n. Which is greater: t or o? t Let d = 9981.865 + -9982. Which is smaller: d or 1/3? d Let k(v) = v*3 - 2v*2. Let t be k(1). Let u be (-3 - t)/(2/36). Let i be 34/(-12) + 3/u2. Which is smaller: -2/19 or i? i Let n = -53.289 + -252.711. Let a(b) = -b*3 + 5b*2 + 6b + 1. Let v be a(6). Is v != n? True Let h(v) = 2v2 - 3v - 16. Let k be h(4). Suppose kn - 19 = 5d, -n + 6n - 4d = 17. Let q = -71497/420 - -681/4. Is n at least as big as q? True Suppose -28 = -2j + 3n, -4j + 2j + 20 = n. Let o(r) = -5r + 12. Let f be (-3 + 50/15)0. Let b be o(f). Is b > j? True Suppose 4b - k = 17, b + b + 2k - 6 = 0. Let l be 6/b(-7)/(-2). Which is smaller: l or 4? 4 Let i = -2.262 + 2.46. Let d = i + -2.198. Which is greater: -1 or d? -1 Let l(z) = 13z*2 - 2z + 8. Let a be l(2). Let j be 16/a - 86/7. Let f be (-13)/18 - j/24. Is f bigger than 1? False Let h(a) = a*3 - 18a*2 + 2a + 28. Let r be h(18). Let i be ((-3)/(-28))/(2424/r). Which is greater: -1 or i? i Suppose -p + 4p + 736 = -20p. Which is greater: p or 0.39? 0.39 Let n be 2/4 + 893/38. Suppose 3y + o + 0o = 16, n = y + 5o. Suppose -yk = -6*k. Is k <= -2? False Let m = -255 - -	{ "pile_set_name": "DM Mathematics" }
nd 0.21. -282.303 2 * 12.9 25.8 Product of 6243 and 26. 162318 52973-0.1 -5297.3 -2-2.2698 4.5396 Product of -3 and -0.96782. 2.90346 0.4 * 0.8139 0.32556 Calculate 16121380. 3442180 1.760.19 0.3344 Product of -7.66 and -0.0019. 0.014554 85655 47080 Work out -31147 0.1. -3114.7 Product of -73.7 and 79. -5822.3 3-85989 -257967 -241559-0.1 24155.9 Work out -489 * -80. 39120 0485272 0 Calculate -1.25170. -6204 -59512-0.056 3332.672 Product of -1 and -110121. 110121 -2534 -8.1 20525.4 Work out -0.4378051 * 0.3. -0.13134153 Product of -132 and -0.157. 20.724 Multiply 0 and -322383. 0 What is 0.2 times 0.19793? 0.039586 Product of -0.027 and -4441. 119.907 What is -9.8 times -8.56? 83.888 34937.9 13227.1 What is the product of 0.4 and 0.377? 0.1508 Product of 0.4 and 1.33603. 0.534412 Work out -0.2 21.0936. -4.21872 What is the product of -233995 and 1? -233995 Multiply 0.497 and 41. 20.377 0.1-3684 -368.4 Calculate 3224-0.28. -902.72 3540.83 times -0.9 -3186.747 Work out 0.122 * 4.681. 0.571082 -0.19 * 220818 -41955.42 Multiply -4 and -293.79. 1175.16 3296 times 949 3127904 -7333.5 -2445.5 Product of 2367 and -0.02. -47.34 Multiply -3 and 102569. -307707 What is 1 times -85.45? -85.45 -1.00512-4 4.02048 Work out -237884 * 0.1. -23788.4 Calculate 1810613. 191034 Multiply -1818 and 0.3. -545.4 -364197 0 0 Product of 1.0875 and -4. -4.35 -0.08 * -7535 602.8 What is the product of 2.17729 and 0.5? 1.088645 Work out -0.36505 * -9. 3.28545 Calculate -1.48329. -43.007 What is the product of -0.21 and 5.224? -1.09704 Calculate 181.40668. 25.32024 What is the product of 140037.6 and -2? -280075.2 10377 times 0.107 1110.339 What is the product of 7628 and -10? -76280 -14188.61 * -0.3 4256.583 -27174 times 2 -54348 What is the product of 0.5 and 0.03263? 0.016315 Calculate -4-59.468. 237.872 Work out 0.06987 -0.11. -0.0076857 What is the product of -0.3 and -57427? 17228.1 Work out -3878 * 2. -7756 Product of -2 and 590.548. -1181.096 Calculate -0.2-45.95. 9.19 Product of 0.5 and 3953.7. 1976.85 What is 1998 times -228? -455544 What is the product of 12.48 and -116? -1447.68 0.5 times -0.004784 -0.002392 Product of 0 and -33582. 0 What is -15 times 10516? -157740 Work out 1381 -0.98. -1353.38 What is the product of 1 and 0.002105? 0.002105 Multiply 4 and 547. 2188 Product of -150 and -1121. 168150 What is 4 times 29.717? 118.868 -10.038755 -0.038755 Product of -835156 and -2. 1670312 Calculate -0.285-2440. 695.4 Multiply 72 and 4483. 322776 Product of -967 and -23. 22241 0.01 * 2608 26.08 0-23060 0 Calculate -0.5154456. -77228 Multiply -0.01314 and -2. 0.02628 1 * -31865 -31865 0.1 times 2.0521 0.20521 Calculate -359718. -340130 0.022728 times -0.13 -0.00295464 What is -47 times -0.13616? 6.39952 0.09 12299 1106.91 2-5989 -11978 Work out -0.1 -18967. 1896.7 Multiply -2512 and 0.9. -2260.8 What is the product of 0.1 and 12197? 1219.7 Work out -19.94 * 19. -378.86 What is the product of 0.5 and 9036.8? 4518.4 Multiply -7 and -0.0199. 0.1393 0.10650.0134 0.0014271 268 1451 388868 250610 25060 Product of 0.138 and 0.32. 0.04416 Work out 0.9 298887. 268998.3 Calculate -91.6921.3. -119.1996 Work out 24 -1827. -43848 Multiply 8347.8 and -0.2. -1669.56 What is 0.0693 times 0.15? 0.010395 What is the product of -0.2 and -13.264? 2.6528 3 * -9.7143 -29.1429 -226 * 0.14 -31.64 Work out -662726 * 1. -662726 Calculate 40-174. -6960 Product of 0.2 and 16062. 3212.4 Multiply 7041 and -26. -183066 Calculate -2-97.192. 194.384 -0.258660.4 -0.103464 Work out 0.08646 -2.4. -0.207504 Multiply 26216 and 0.2. 5243.2 35500 * 0.01 355 394430 times 5 1972150 2626 times -30 -78780 Multiply -5198 and -97. 504206 -0.294-178 52.332 -51888 times 0.6 -31132.8 Work out 3.013 49.3. 148.5409 What is 203 times 1.684? 341.852 0.4-852.444 -340.9776 What is 0.4 times 62342? 24936.8 0.0873 times 1.38 0.120474 0.999 0.05 0.04995 Work out 0 * -1201. 0 Multiply 99.8 and 1.5. 149.7 Work out -0.086 * 2.995. -0.25757 148 times -5.322 -787.656 Calculate -9701.6-5. 48508 0.09433 times -245 -23.11085 Work out -1 36.61. -36.61 Work out -0.3 * -0.06251. 0.018753 Calculate -0.6-78950. 47370 Calculate 0.417.551. 7.0204 What is -2847 times -1.19? 3387.93 -0.5 times 1094.048 -547.024 Work out 0.1 * 1.4977. 0.14977 Product of -2172 and 5. -10860 Work out -62.436 * 1.6. -99.8976 Work out -13.995 * -82. 1147.59 Calculate -0.0172663. -0.051798 95095 0.49 46596.55 144 * -2255 -324720 0.082.11 0.1688 -408.77-1 408.77 Product of -2712.2 and 0.04. -108.488 Work out 12282 * -0.4. -4912.8 Multiply -219 and 7.62. -1668.78 Multiply 131.7 and -25. -3292.5 -3 * -16810 50430 -1.8460.1 -0.1846 Product of 8 and -0.04829. -0.38632 Multiply -158 and -4.623. 730.434 Multiply 1.48 and -335. -495.8 -399130.4 -15965.2 -43.270.8 -34.616 10 times -328.3 -3283 What is the product of -6 and -2375? 14250 What is the product of -0.81 and 103? -83.43 -95 0.04238 -4.0261 -12054 * 4 -48216 Calculate -1224.118. -502.396 What is the product of -0.68 and -0.066? 0.04488 Calculate 11892.78. 10948.04 6-60335 -362010 Calculate -211-6759. 1426149 Multiply -0.1 and 0.08396. -0.008396 10835-0.1 -1083.5 What is 0.7 times 21.68? 15.176 275.7 1.6 441.12 Product of -0.567 and 1064. -603.288 Product of 4495 and -3. -13485 Calculate -851332. -170266 Multiply 0.6 and 0.03635. 0.02181 What is the product of 0.103 and 3927? 404.481 What is 0.5 times 34362? 17181 266533 87945 What is the product of -110 and -0.0358? 3.938 1638 * 1.32 2162.16 -1.4 * 1350.1 -1890.14 Product of -4.2947 and -1. 4.2947 What is -8.906 times -173? 1540.738 What is -33013 times 0.03? -990.39 Work out -0.893 * -13. 11.609 Product of 0.0846 and -1.87. -0.158202 Multiply -0.035572 and 0.07. -0.00249004 5-255237 -1276185 What is the product of -4 and -184.687? 738.748 What is 9.63329 times 5? 48.16645 Product of 0.03283 and 0.046. 0.00151018 4 times 0.956 3.824 Calculate 0.095584-11. -1.051424 Calculate 12306.522. 270743 -2904729 -842363 5488 * 2 10976 -2003.74 -748 What is the product of -6022 and 6? -36132 Multiply -1587 and 1.26. -1999.62 Work out 0.07 -319978. -22398.46 Product of -143 and -12.7. 1816.1 Calculate -11211-0.4. 4484.4 What is 11 times 0.4521? 4.9731 Product of 1 and 2579. 2579 0.14.0769 0.40769 Multiply -3780082 and 1. -3780082 Multiply 3312846 and -0.5. -1656423 Product of -0.141 and 0.38. -0.05358 -5184 * 15 -77760 Multiply -0.057509 and -0.5. 0.0287545 What is the product of -0.4 and 132645.4? -53058.16 What is -12105 times 0.01? -121.05 What is -15 times -25865? 387975 Calculate -20650670.1. -206506.7 Product of -0.5 and -146159. 73079.5 Product of 1209 and 1.3. 1571.7 Multiply -1 and -118975. 118975 Product of 1613 and -23. -37099 -0.24 -6.221 1.49304 131-9.6 -1257.6 0.13-2763 -359.19 Work out -0.4 * 17070. -6828 Product of -92702.3 and 1. -92702.3 What is -2 times -0.3989? 0.7978 What is the product of -40 and 2.86? -114.4 What is the product of -25 and -1.106? 27.65 Multiply -441136 and -0.2. 88227.2 112.6 times 2.004 225.6504 Product of -0.09 and 519201. -46728.09 What is -1.3 times 0.039? -0.0507 What is the product of -0.076 and -9.3? 0.7068 What is -27.99 times 0.63? -17.6337 What is 65.49 times -0.05? -3.2745 What is the product of 28600.8 and 0.4? 11440.32 Multiply -153.94 and 2. -307.88 -69193 * -0.4 27677.2 Multiply -6.04 and 264. -1594.56 Calculate 5-23.43. -117.15 What is the product of 0.2 and -0.5445? -0.1089 122413 4 489652 Multiply 1.3 and 37666.3. 48966.19 59935 29965 What is -0.2 times -15513? 3102.6 0.0196002 5 0.098001 What is 0.1129548 times -4? -0.4518192 Work out 205 * 423. 86715 68618 times -0.4 -27447.2 What is 2.171 times 38? 82.498 What is -36 times 15418? -555048 Work out 145442 * 0.5. 72721 What is 25 times -25128? -628200 Product of -4 and 0.01081. -0.04324 2.4 times 0.1717 0.41208 Work out 1089355 * 0.3. 326806.5 Product of 0.492397 and 0. 0 1.1 times 0.7656 0.84216 1 * 1137821 1137821 What is the product of -490 and 231? -113190 Product of -2 and 25.154. -50.308 -4 times 758 -3032 Calculate 275.283. 825.84 210.36406 7.64526 Product of 25.683 and -0.1. -2.5683 -756.19-8 6049.52 Calculate -0.3-7946. 2383.8 Calculate 88*-0.039	{ "pile_set_name": "DM Mathematics" }
mon multiple of c and l. 9 Let x = -11295 + 3286835/291. Let w = -11449/2910 - x. What is the common denominator of -21/10 and w? 10 Calculate the least common multiple of 288 and (-105)/(-14) + -9 - (-4671)/18. 12384 Let q = -360121/3091550 - -1/21175. Find the common denominator of q and -20/3. 438 Let p = -285 - -281. What is the common denominator of 51/2 and 57/p + 17/(34/8)? 4 Let s be 3 - ((-915)/(-675))/(1/(-1083)). Let b = 1470 - s. Find the common denominator of -39/10 and b. 30 Suppose 18d = 3519 + 3609. Calculate the smallest common multiple of 352 and d. 3168 Let v(w) = -w3 + 11w*2 - 7w - 2. Let s(z) = z3 - z2 + 5z - 4. Let y = 33 - 31. Let t be s(y). What is the lowest common multiple of v(t) and 24? 168 Calculate the least common multiple of 7231 and 264/(-396)(-315)/(0 + 3). 72310 Suppose -4 = 2y - 3k + 7k, -4k = -5y - 24. Let v(s) = s2 - 2s - 25. Let o be v(y). What is the common denominator of 19/24 and o/14 - 11/(-66)? 168 Suppose -4u = -17 - 55. Suppose u + 7 = 25h. What is the lowest common multiple of 17 and h? 17 Suppose 0 = -9m - 5 + 23. Suppose -3x + 144 = -4c, 4x - mx - 96 = c. Calculate the lowest common multiple of 30 and x. 240 Let m be (-4)/(-6) + 44776/(-96). Let q = m + 463. Let h = -1722 + 24121/14. What is the common denominator of h and q? 28 Let j(y) = -461y*3 - 6y*2 - 45y - 82. What is the smallest common multiple of j(-2) and 1530? 18360 Let h be (-204)/16 + -3 - -2. Let i = h - -249/20. Find the common denominator of 2/(-5) + (-5751)/(-2340) and i. 260 Let n(w) = w - 2. Let t be n(6). Suppose tm = -m + 10. Suppose -38h + 388 = -296. What is the smallest common multiple of m and h? 18 Let f = -78 - -77. Let j = -6 + f. What is the lowest common multiple of (-8)/(((-2)/4)/(j/(-14))) and 77? 616 Let h(p) be the third derivative of 17p4/24 - p3/6 + 10p*2. Calculate the smallest common multiple of 32 and h(1). 32 Let d be ((736/(-24))/(-4))/((-78)/742). Let s = -1042/13 - d. Calculate the common denominator of s and -2/21. 63 Let s = 5777 + -5647. What is the smallest common multiple of 416 and s? 2080 Let j = 5623 + -5475. Calculate the least common multiple of 2 and j. 148 Let h = 39766/2013 + -217/11. Let i = 919/2379 - h. Calculate the common denominator of 11/51 and i. 663 Let l be 1-1 + (-210)/7. Let a = l + 85. Calculate the lowest common multiple of a and 12. 108 Suppose -15x + 120 = 5x. Calculate the common denominator of ((-1827)/(-240))/(-3) - x/15 and 3/56. 112 Let i = 108 + -112. Calculate the common denominator of 23/42 and 1/(-2)i - 554/132. 462 Suppose -10n = 3082 + 27528. Let h = n + 64241/21. Calculate the common denominator of h and 19/9. 63 Suppose 2j - 35a + 34a - 11455 = 0, 0 = j + a - 5717. What is the lowest common multiple of j and 4? 5724 Suppose 2032h - 1848 = 2020h. Calculate the least common multiple of 392 and h. 4312 Let n = -449 - -472. Calculate the common denominator of (-12)/18 - n/(-3) and -9/5. 5 Let l be 6448/144 - 4/(-18). Let n = 1096/21 - 1123/28. Calculate the common denominator of n and ((-42)/60)/((-5)/l). 60 Let j = 2909193/47 - 190376391/2632. Let o = -10433 - j. Find the common denominator of -77/12 and o. 168 What is the common denominator of 11/2107 and (3/1032)/(156/36 + -4)? 16856 Let q be (-575)/(-15)(11 - -1). Let i = q + -454. Calculate the least common multiple of 3 and i. 6 Let k = 99 - 57. Suppose -2u + 101 = f, 160 = 3u - f + 16. What is the lowest common multiple of u and k? 294 Suppose -5t = -3d - 117, -3 = -2t + 3. Find the common denominator of d and 14/(-49)-14 + 3/996-1526. 166 Calculate the common denominator of 0 - 3160/432 - (5 - (14 + -2)) and ((-158)/(-18) - 1)/(17 - 11). 54 Suppose 8n - 11n + 87 = 0. Suppose -6j = -n - 7. Calculate the least common multiple of 16 and ((-25)/15)/((-1)/j). 80 Let y(f) = -222f2 - 45f - 3. Let k be y(-7). Let u = k - -169149/16. What is the common denominator of 29/114 and u? 912 Let z be (-618)/8(-392)/147. Let o = -78 + z. Calculate the least common multiple of o and 6. 384 Let x = 2609 - 2524. What is the smallest common multiple of 34 and x? 170 Find the common denominator of 145/4458 and (4/30)/((-260)/(-9425)). 4458 Let f(s) = 162s + 2359. What is the lowest common multiple of 209 and f(-6)? 15257 Let m = 3/1709 + 83639/58106. What is the common denominator of m and -151/816? 816 What is the common denominator of -61/240 and (218/(-5341))/((-1023)/301 + 3)? 1680 Let n(j) = -j*2 + 13j - 1. Let c be n(11). Suppose c = 10h - 3h. Calculate the smallest common multiple of 244 and h. 732 Let q = 2027 + -2007. What is the least common multiple of 576 and q? 2880 Calculate the common denominator of ((-15)/7)/((-10494)/220) and 63/22. 24486 What is the least common multiple of 76 and (-24)/((-120)/(-10) + -18)? 76 Let t = -3256609/8710758 - -928/2313. What is the common denominator of t and 35/4842? 33894 Suppose -25d - 51d = -31d - 2880. Calculate the least common multiple of d and 1024. 1024 Suppose 72a + 47a - 8880 = 45a. What is the least common multiple of a and 64? 960 Let k = 45674 + -271165/6. Let c = k - 1588/3. Calculate the common denominator of -49/4 and c. 4 Suppose -2u + 2d = -1496, 3u - 2244 = -123d + 128d. Calculate the least common multiple of u and 220. 3740 Let p(g) = -g2 + 13g + 6. Suppose -4z = -4, 4r - z + 3z - 2 = 0. Calculate the least common multiple of 28 and p(r). 84 Suppose 2299 = 13l - 10l + 16l. Calculate the smallest common multiple of l and 88. 968 Let t = -2077392 - -1384093. Let x = -4862829/7 - t. Let n = 1385 + x. Calculate the common denominator of 73/16 and n. 112 Suppose -18m + 14m = -2g + 356, 1290 = 7g - 3m. Calculate the smallest common multiple of 48 and g. 1488 Let q be (-2)/(2 + 360/(-185)). Let k = q + 42. Suppose 34 = j - 2z - 3, z = -k. Calculate the smallest common multiple of 30 and j. 270 Let x = 123/79 + -12989/4740. What is the common denominator of (2 + 0)/((-3927)/(-583) - 7) and x? 420 Let x be 258/33 - ((-18)/(-33))/(-3). Find the common denominator of -47/22 and (420/(-225) + x/(-10))-15. 22 Let s(p) = -35p + 29. Calculate the lowest common multiple of s(-2) and 33. 99 Suppose -14u + 124 + 1640 = 0. Calculate the common denominator of 0 - (-721)/u - 4 and 113/84. 252 Suppose 55u = 59u + 2m - 62, 5m - 59 = -4u. Calculate the smallest common multiple of 1630 and u. 13040 Suppose 70n = 69n + 6. Calculate the least common multiple of (0 - (2 - -7))/(-1) and 0/n + 2 - -3. 45 Let x = 250582 + -123286433/492. Find the common denominator of x and 53/451. 5412 Let n be -1(6/2 - 6) + 169. Let f = -76 + n. Suppose 2w = -w + f. What is the least common multiple of 14 and w? 224 Suppose 0 = -14m - 13m - 2m + 4930. Calculate the lowest common multiple of m and 248. 21080 Let t = -15783 + 1010047/64. Calculate the common denominator of ((-6014)/1488)/(6/(-8)) and t. 576 Let v be (-8268)/(-1196) + 2/23. Suppose 9 = vj + 2. Calculate the least common multiple of 1 and j. 1 What is the smallest common multiple of (60/(-21))/((-144)/504) and 80? 80 Let o = -103499/6 - -17244. Find the common denominator of -6/3199 and o. 19194 Suppose 85g = 73g + 36. Suppose -5j = y + 27, -4y = 5j - 0 + 33. Let o = y - -4. What is the lowest common multiple of o and g? 6 What is the common denominator of 27/256 and (18/(-20))/((-190168)/(-1155) + 48/18)? 15616 Let r = 5073999/176 + -28829. Find the common denominator of r and (6/(-8))/((-1536)/(-1232)). 1408 Find the common denominator of 115/6 and 4 - ((-74776)/(-1536))/13. 192 Let y be (-25 + 26)(-2 - 0 - -2). Let q(z) = 2z2 + 3z + 60. What is the smallest common multiple of 24 and q(y)? 120 Let i be (-3564)/8835 - (-5)/((-75)/(-6)). Let s = 1148/8835 - i. Calculate the common denominator of 131/6 and s. 30 Suppose -18u + 4399 + 47 = 0. Let h = 249 - u. Suppose 9 = a - 0a. Calculate the lowest common multiple of a and h. 18 Suppose -5023 = 12j - 5899. What is the smallest common multiple of j and 438? 438 Let n(f) = -101f - 5 + 0 + 90f. Let l be n(4). Let c = 53 + l. What is the smallest common multiple of 2 and c? 4 Let m = 608 - 1031. What is the common denominator of 85/16 and m/12((-56)/(-54) + -1)? 144 L	{ "pile_set_name": "DM Mathematics" }
s be (-16)/(-6)3/4. Let m be (-1180)/(-380) + (s - -1)/(-1). Which is the closest to 3/2? (a) 2 (b) m (c) -1 a Let h = -7616 - -7614.72. What is the nearest to 0 in -2, -9, h, 4? h Let p = -0.5735 + 0.7235. What is the closest to -2 in -1/4, 1/4, p, -11? -1/4 Let f = -5.2 + 20.2. Let p = f - 15. Let l = -0.2 + p. What is the closest to 2/3 in 3/5, l, 4? 3/5 Let f be (-5 + -1 + 0)/2. Let w be 2(12/24 + f1). Which is the closest to 0.1? (a) w (b) -0.04 (c) 0.3 b Let t = 3175 - 3174.7. What is the nearest to -2/11 in -0.2, -641, t? -0.2 Let s be (181/2)/(-15). Which is the closest to -0.2? (a) 5 (b) 12/5 (c) -1/2 (d) s c Let x = -0.29 - -0.39. Let q = 155.3 - 157. Which is the closest to x? (a) 0 (b) q (c) 5 a Let g = -614 + 613. Let u = -169 - -171. What is the closest to g in -2/9, -16, u, 1? -2/9 Let v be -3(-30)/(-18) - (-33)/7. What is the closest to 0 in v, -126/5, -0.4? v Let f = -8.27 + -327.73. Let n = 331 + f. What is the closest to -0.02 in 0.2, n, 5/6? 0.2 Let d be 0 - 1 - 8/(-14). Let h = 432 - 432.2708. Let i = h + -0.0292. What is the closest to i in d, -3, 0.5? d Let h be (-2)/(-6)(-19 + 483/42). Which is the closest to 0? (a) -3/5 (b) -1/26 (c) h b Let d be (18 + (-5962)/330)(-2)/(-1). What is the closest to -2 in d, 0.3, 5/8? d Let b = -120.59 - 0.41. Let h = b - -119. What is the closest to 2 in h, -3, -0.4? -0.4 Let v = -140 + 150. Let m be (6/v)/((-5)/(60/(-9))). What is the closest to 0.1 in 3/4, m, 9/2? 3/4 Let z = -175 - -175.287. Let x = z + -0.287. Let w = 0.2 + -0.3. What is the nearest to 2/5 in x, w, -5? x Let r = -396.8 + 396.8. Let p be (-1 + (-1)/(-2))/1. Which is the closest to 1? (a) r (b) 0.2 (c) p (d) 1/6 b Let l = 0.188 + 85.812. Let b = l + -85.6. What is the nearest to 1 in 2, b, 7? b Let x be (9/78 + 0)360/(-1890). Let d = 4696507/21128835 + -14/46437. Let h = x + d. Which is the closest to -1? (a) h (b) 3 (c) 0.4 a Let l = 13 + -11. Let z = 52 + -51. Which is the nearest to -1/2? (a) l (b) 8 (c) z (d) 0 d Let c = 4766.1 + -4766. What is the nearest to -20 in -3/8, -7, c, -0.4? -7 Let h = 43.9 + -44. Which is the closest to h? (a) -0.06 (b) -1/13 (c) 7 b Suppose 0 = -h, 0 = 51r - 54r + 4h. Let a = -233 - -236. What is the nearest to -2/7 in a, r, 2/3, 2/13? r Suppose -110 = -3h + 24z - 29z, -5z + 65 = 2h. Let f be (21/(-10))/7 - 9/h. Which is the nearest to f? (a) 0.3 (b) -5 (c) -1/7 c Let p = -2 - -1.5. Let z = 21/34 - 2/17. Let o = -444/41 + 2705/246. Which is the nearest to -1? (a) z (b) p (c) o b Let u = 2491 + -2487. Which is the closest to -0.1? (a) u (b) -321.6 (c) 0.5 c Suppose 0 = 2y + 3s - 235, y - 4s - 129 = 5. What is the closest to 1 in -1/2, 0.5, y? 0.5 Let w = -23.6 + 4.6. Let k be (((-12)/(-10))/2)/(9/(-6)). What is the nearest to -0.2 in w, -5, k? k Let k = 18 - 18.3. Let r be (-22245/(-10))/(-2 + 7). Let p = r - 89. What is the closest to -2/5 in -5, p, k? k Let j = 394.1 + -400. Let p = -1.1 + j. Which is the nearest to 0.1? (a) 0.4 (b) p (c) -2/17 c Let n = -0.2 - -1.2. Let f = n - 3. Let v = -12292/5 - -2458. What is the nearest to v in 4, 2/15, f? 2/15 Let z be (6/14)/((-186)/(-124)). What is the closest to z in 0, -7, 0.07, -2/43? 0.07 Suppose -36 = -13i + 4i. Suppose 0 = -is + s. Suppose -2b - 2 = 4, s = 5w - b + 2. What is the closest to 0 in 5, w, -0.3? -0.3 Let f = 4.1 - 3.7. Let d = -58 - -56. Let q = -3 - -5. What is the closest to d in f, q, -0.4? -0.4 Let w be (2 - 3)/(-8 + -4 + 4). Let j = -11/51 + -2/17. Which is the closest to j? (a) 0.04 (b) w (c) 1/6 a Let l = 366 - 361. Let n be l67/945. Which is the nearest to 2? (a) n (b) -0.6 (c) 0.3 c Let g = -481/42 - -67/6. Let j = -2864 - -2882. What is the nearest to 2/3 in 3, g, 0.4, j? 0.4 Let w be ((-12)/(-108))/(2/24). Let s = -21 - -13. Let d be s/1705/2. Which is the closest to -1? (a) d (b) w (c) -1/3 c Let s be 30500/200 - 142 - (11 - (-1)/(-1)). Let p = 0.2 - 0.2. Let t = -3 - p. What is the closest to 0.1 in t, 4, s? s Let z = -776.3 + 776. What is the nearest to z in 0.4, 2/3, 10? 0.4 Suppose 0 = -2p + 2, 4r - 5p = -4 - 1. Suppose 18 = 3m + 4h, r = 24m - 20m - h - 5. What is the closest to 0.007 in m, 0.1, -1/3? 0.1 Suppose s + 0z - 2z - 4 = 0, 4s - z - 9 = 0. Suppose sl = 4l - 8. Suppose w + w = -lw. What is the nearest to -1 in w, 0.5, -5? w Let z be 0 + (-21)/12 - -1. Suppose 4 - 7 = -3n. Let u = 2.8996 - 2.9996. Which is the closest to n? (a) z (b) -0.4 (c) u c Let y(b) = b*3 - 7b*2 + 34b - 237. Let l be y(7). What is the closest to 3 in l, 0, 2/15? l Let c be 2/3 - 7/3. Let w = -94665 + 94667. What is the nearest to c in w, -2/5, 5? -2/5 Let o = 0.3 - -0.2. Let k = -471921 - -2359606/5. Which is the closest to -1/4? (a) 1 (b) k (c) -0.01 (d) o c Let p = 206.023 + -0.023. Let m = 205.9 - p. Let j = 5 - 1. What is the nearest to m in 5, 2/15, j? 2/15 Let o be (-10)/45 + 2/9. Let r = -17 - -14.7. Let q = r - -1.3. Which is the nearest to o? (a) -0.1 (b) -0.4 (c) q a Let p = 2/5443 + 5439/10886. Let t be (-44)/(-204) + (-2)/6. What is the closest to p in 1, t, 1/13? 1/13 Let t = -23.6 + 4.5. Let i = t - -19. Let z = 64 - 324/5. Which is the nearest to 2? (a) 1/7 (b) z (c) i a Let s(v) = 2v + 16. Let g be s(-9). Let f be ((3 - 2)/12)/(1/g). Let o(i) = 2i*2 - 6i + 6. Let t be o(3). What is the closest to -3 in f, -4, t? -4 Let v = -4 + 7. Let i = -115908/5 + 23181. Which is the nearest to v? (a) 13 (b) i (c) 0 c Let v = 2.507 + 0.043. Let t = -2.5 + v. Let i = t - -0.05. Which is the closest to i? (a) 4 (b) -0.2 (c) 3 b Let y = 330 - -227. Let q = y - 549. What is the closest to -0.1 in -0.3, 2/7, q? -0.3 Let l = -3627.4 - -3627. Which is the closest to -1/6? (a) l (b) -13 (c) -0.2 c Let h = 317/24 + -103/8. What is the closest to 1/3 in h, -5, -0.9, 0? h Let p = 18 - -13. Let w = -0.8 - -0.3. Let v be (-48)/(-128) + (-68)/32 + 2. What is the closest to v in w, p, -1? w Let j = -485 + 444. Let l = -47 - j. What is the closest to 1 in -2/7, -4, l? -2/7 Let l = -29678.08 + 29678. What is the nearest to l in -0.073, -3, -0.2, 2? -0.073 Let p be (-2)/((-11)/(44/420)). Let s = -13/21 + p. Which is the nearest to -2? (a) s (b) -0.1 (c) -1/2 a Let f = -115722 + 115725. Let o = -4.6 + 5. Which is the nearest to 24/7? (a) o (b) f (c) -2/9 b Let i = -321015 + 321018. Let f = 1/64 + -69/320. Which is the nearest to -2/3? (a) 3/4 (b) f (c) 0.2 (d) i b Let j = -2.2 - -2. Let m = 11.2 - 11.098. Let a = 0.098 + m. What is the nearest to j in 1, -0.09, a? -0.09 Let s = -5.89 + 342.89. Let f = s + -338. Which is the nearest to f? (a) -14 (b) -2 (c) 3 (d) 2/7 b Let j = -1 + 1.2. Let c be ((-5)/15)/((-5)/2859). Let x = -190 + c. What is the closest to -2 in x, -1, j? -1 Let r = 0.3 - 0.4. Let x(d) = -32d - 49. Let o(q) = -15q - 24. Let s(h) = 13o(h) - 6x(h). Let l be s(-6). What is the nearest to -6 in l, r, -0.5? -0.5 Suppose 17v - 18v + 5 = 0. What is the nearest to 3 in v, 0, 4? 4 Let k = 0.334 + -0.834. Let y = 57 + -13. Which is the closest to 1? (a) y (b) k (c) -0.1 c Let j = -5.8384 + -0.0916. Let t = 0.23 + j. Let f = 5.2 + t. Which is the closest to 1? (a) f (b) -0.3 (c) 0.5 c Let m = -0.3 - 0.2. Let r(h) = -514h - 1546. Let z be r(-3). Which is the nearest to 2/3? (a) 0.5 (b) z (c) m a Suppose 58 = 28d - 138. Let k = -0.3826 + -0.0174. What is the closest to -1 in -0.13, k, d? k Let r(m) = -m*2 + 7m - 11. Let q be r(6). Let l be (2/(-10))/((-1)/2)q. Let d be 3(-4)/30l. What is the closest to 1 in 0.4, d, 1/4? d Suppose 0 = 2y + 3p - 3, 6 = -3y - p - 0. Let h = 4.3 - 3. Let z = -18832.3 + 18832. What is the nearest to h in y, -2/13, z? -2/13 Let f = -103 + 101.49. Let o = f + 7.51. Which is the nearest to o? (a) -0.4 (b) -4 (c) 0 c Let l = -0.2 + 0.3. Let z = -1749.40995 + -0.29005. Let r = 1750 + z. What is the nearest to 0.1 in -2, r, l? l Let l = -6531 - -6265. Which is the closest to 0.1? (a) -2/3 (b) l (c) 1 a Let q = 744 - 680. Let n be ((-6)/(-104))/((-24)/q). What is the nearest to -0.01 in -3, -0.3, n, -5? n Let w be (-11)/18 - (-82)/123. Let m = -31/90 - w. What is the nearest to 0.1 in 0.07, 0.2, m, 8? 0.07 Let q = 58822/7 - 8402. Which is the close	{ "pile_set_name": "DM Mathematics" }
42h Let o(b) = -3647b*3 + 6200b*2 + 403b. Let k(q) = 2735q3 - 4650q*2 - 310q. Let r(g) = 13k(g) + 10o(g). What is the third derivative of r(p) wrt p? -5490 What is the second derivative of -1 + 3 - 1514a - 745585a*4 - 3a*3 + 745879a*4 wrt a? 3528a*2 - 18a Let b(r) = -10r + 4r*2 - 5r*2 + 19 + 12 - 12. Let x be b(-11). Find the second derivative of 7l - 7l2 - 5l*2 - 3l*2 + xl*2 wrt l. -14 Suppose -4j + 5i - 17 = 0, 5j + 5i + 5 = 8i. Let o(q) be the third derivative of 1/6q3 + 0q + 18qj - 5/6q*4 + 0. Differentiate o(b) wrt b. -20 Suppose 0 = -0n - 3n + 1737. Suppose -50p = -53p + n. What is the third derivative of 193k - 10k2 - pk - 11k3 wrt k? -66 Let m(i) = -i3 - 17i*2 - 23i + 107. Let d be m(-15). What is the second derivative of 29o2 - 22881o + d + 22883o - 5o*2 - 2o*5 wrt o? -40o*3 + 48 Suppose -8q + 5q + 9 = 0. Let f = -1 + q. Find the first derivative of -2o*f + 13o*2 - 7 - 4o*2 wrt o. 14o Let v(l) = -1198l6 + 6l*3 + 1304l*2 + 6l - 6. Let u(i) = -i3 + i2 - i + 1. Let f(m) = 6u(m) + v(m). Find the third derivative of f(k) wrt k. -143760k*3 Let g(k) = -1074k + 1593. Let v(a) = 538a - 795. Let b(s) = 2g(s) + 5v(s). Differentiate b(m) wrt m. 542 Let w be -64213/468 + 19. Let l(c) be the third derivative of 0 - 31c2 + wc4 - c3 + 0c. What is the derivative of l(i) wrt i? 28 Suppose 85p + 200 = 90p. What is the second derivative of 122d*2 - 11d - pd2 + 71d*2 + 5d wrt d? 306 Let b = 697/1674 - -1/3348. Let g(v) be the second derivative of -7/3v3 + 0 + 0v*2 - bv*4 + v. What is the second derivative of g(q) wrt q? -10 Let d be 6 + 0/(-2) + -4. What is the third derivative of -52i*3 - 83i*d - 102i*3 + 91i*3 wrt i? -378 Suppose -5q = 35t - 33t - 120, 0 = 2t - 10. Differentiate 18r + 99 + 33r + qr wrt r. 73 Let o(p) = 77p - 82. Let u = 257 + -253. Let b(l) = 2l. Let w(g) = ub(g) - o(g). What is the derivative of w(q) wrt q? -69 Let p(g) = 2g*4 + 61g*3 - 24g*2 - 15. Let w(l) = 14l3 - l2. Let y(a) = p(a) + 3w(a). What is the third derivative of y(d) wrt d? 48d + 618 Let h(j) be the first derivative of 3717j4/4 - 4j3/3 + j2/2 + 54j - 1330. What is the third derivative of h(o) wrt o? 22302 Suppose -205y + 210y - 365 = 0. Find the first derivative of 37 + 35g*4 + yg*4 + 62 wrt g. 432g*3 Suppose -14 = 12n - 26n. What is the first derivative of n - 165 - 21 - 160f wrt f? -160 Let d be 78/(2 - 0) - 6. Differentiate 18y2 - 4y + d + 36 + 42 + y wrt y. 36y - 3 Let c = -184 + 451. Find the first derivative of -466z + cz + 235z + 102 wrt z. 36 Let o be ((-15)/10)/(23/(-88)). What is the derivative of -8 - 87j + oj - 41 - 11 wrt j? -65 Let a(k) be the first derivative of k5/5 + 33k*4/2 - 17k*2/2 + 11249k + 13343. Differentiate a(x) wrt x. 4x3 + 198x*2 - 17 Differentiate 145197l - 72739l - 73196l - 152 wrt l. -738 Find the second derivative of 81 + 340c + 5039c*2 - 147 + 29 + 328c + 38 wrt c. 10078 Let u(s) be the second derivative of -257s8/56 - s4/4 - 150s*2 + 8s - 140. Find the third derivative of u(c) wrt c. -30840c3 Let h(u) be the second derivative of 4u - 83/2u3 - 36 + 94u2. Differentiate h(k) with respect to k. -249 Let z(a) = -a2 - 11a - 11. Let y be (6 - -3)/((-1)/1). Let b be z(y). Find the second derivative of -bk + 4k2 + 0k*2 - 4k*2 - 4k*2 wrt k. -8 Let n(a) = -5907a + 5896. Let f(c) = -5909c + 5866. Let w(d) = -2f(d) + 3n(d). What is the derivative of w(j) wrt j? -5903 Let z be 50/300 + (-17)/(-6). Find the third derivative of 5o*3 - 2o*z + 46o - 48o + 126o*4 + 53o*2 - 3o*3 wrt o. 3024o Suppose 0 = -32s + 38s. Let d be (1 - s)(2 + 1 + -1). What is the third derivative of -12t*2 + 36td - t3 + 2t3 wrt t? 6 What is the first derivative of -4751p + 1485 - 1385 + 3918 wrt p? -4751 Let l(d) = -11d3 + 1416d*2 - 37d + 2. Let s(u) = -3u3 - 8u*2 + 1. Let m(z) = l(z) - 3s(z). Find the second derivative of m(t) wrt t. -12t + 2880 What is the third derivative of 467l*3 + 760l*3 - 379l*2 - 541l - 383l2 + 763l*2 wrt l? 7362 Let v(o) be the second derivative of 181o6/10 - o4/6 + 163o2/2 + 226o. Find the third derivative of v(c) wrt c. 13032c Let m(y) be the third derivative of -389y*8/336 - 737y*4/24 - 3y*2 - 274. What is the second derivative of m(j) wrt j? -7780j*3 Let l(y) = -y + 46. Let x be l(0). What is the derivative of 27 + x + 24a - 2a2 + 17 wrt a? -4a + 24 Suppose -57k + 196 = 99k - 58k. Let w(a) be the second derivative of 0a*k + 16/3a*3 - 14a + 7/12a4 + 0. What is the second derivative of w(l) wrt l? 14 Suppose 0 = -13n - 1000 + 64. Let b = n - -231. What is the first derivative of 143 - b - 39z2 + 6z*2 wrt z? -66z Suppose -6z + 109 = -41. What is the second derivative of -16a*2 + 41a*2 + 36a*2 - za - 2 wrt a? 122 Let s = -17 + 19. What is the second derivative of -s - 15x + 65x + 5x3 - 21x*3 - 24x wrt x? -96x Let j(r) = 175r*2 + 3r - 169. Let x(c) = 123c + 128c - 338 - 246c + 352c*2. Let s(l) = -5j(l) + 3x(l). What is the derivative of s(g) wrt g? 362g What is the second derivative of -5540d - 4534d*4 + 41532d*3 - 3494d - 41532d3 wrt d? -54408d*2 Suppose -7f = -285 - 317. What is the derivative of -52a3 - fa - 96a - 3a*2 + 182a - 133 wrt a? -156a2 - 6a Suppose -4i + 9 = -0i - 3f, -4f + 4 = 0. Suppose 12u + 14 = 14u. Find the second derivative of 0t3 - it*4 + 0t*3 + ut wrt t. -36t2 Find the second derivative of -10 + 40 + 192j*3 - 171 + j + 698j*2 - 193j*3 wrt j. -6j + 1396 What is the derivative of -903 - 3346z3 + 781z*3 + 330 - 1676z*3 wrt z? -12723z*2 Find the second derivative of -76p*2 + 303p + 72p + 416p + 273p - 120p*2 wrt p. -392 Let y be (-2 - -98 - -3) + 2 + -2. Let f(z) be the first derivative of 10z*4 - y + 12z*2 + 75 + 0z*4. Find the second derivative of f(k) wrt k. 240k Let h(c) = 13286c3 - 30c + 4364. Let b(s) = 6643s3 - 18s + 2182. Let w(z) = -5b(z) + 3h(z). Differentiate w(j) with respect to j. 19929j2 Let z be (-2)/(-12)(942 - -36). Find the second derivative of 9 - 9 - zm - 118m*2 - 27m wrt m. -236 Let b(x) = 27267x - 1076. Let z(h) = 6793h - 269. Let a(p) = 2b(p) - 9z(p). What is the derivative of a(y) wrt y? -6603 What is the third derivative of 345t2 + 11833t*5 - 4882t*2 - 623t*2 + 802t*2 + 596t*2 wrt t? 709980t*2 Let f(b) be the third derivative of 0 + 0b + 171b2 + 0b*5 - 5/3b*3 + 157/120b*6 + 1/6b*4. Find the second derivative of f(m) wrt m. 942m Differentiate -166859w + 4939 + 83426w + 1146w2 + 83433w wrt w. 2292w Let n(a) be the third derivative of 0a*3 + 5/12a*5 + 0a - 41/30a6 + 120a*2 + 0a*4 + 0. What is the third derivative of n(c) wrt c? -984 What is the derivative of -508 - 676 + 45 + 971c wrt c? 971 Let t(m) = -13m + 107. Let o be t(8). Differentiate -z - 1686z*o + z + 1686z*3 - 7 - 98z*4 with respect to z. -392z*3 Let f(j) be the third derivative of -1283j*7/210 + 451j*3/3 + 181j*2. Differentiate f(b) with respect to b. -5132b*3 Let l = -246 - -260. What is the third derivative of -4s2 + s5 - 57s4 + s2 + 104s*4 - l wrt s? 60s*2 + 1128s What is the third derivative of 3462899o3 - 3462899o*3 + 2o4 + o2 + 84o5 + 100o + 6 - 25o6 - 28o wrt o? -3000o3 + 5040o*2 + 48o Find the third derivative of -k*5 + 1384k + 20 - 3 - 696k + 3303k*4 - 690k - 6k2 wrt k. -60k*2 + 79272k Let n(l) = 4l2 + 162l - 79. Let d be n(-41). Let y(a) be the first derivative of 10/3ad + 2a*2 + 0a - 9. Find the second derivative of y(o) wrt o. 20 Let b(x) = 166668x2 + 267376x - 187. Let y(p) = 1792p2 + 2875p - 2. Let w(t) = -2b(t) + 187y(t). Find the second derivative of w(k) wrt k. 3536 Let l(y) = -y*3 - 5y + 61. Suppose 1 + 91 = 23b. Let m(v) = -v3 - 10v + 123. Let k(t) = bm(t) - 7l(t). What is the derivative of k(q) wrt q? 9q2 - 5 Let d(a) = a5 - 6a*4 - a - 1. Let s(i) = -5i*5 + 2727i*4 - 2744i + 3. Let y(g) = 3*d(g) + s(g). What is the seco	{ "pile_set_name": "DM Mathematics" }
to base 11 -118693 What is -5302662 (base 8) in base 7? -14663123 Convert -2121110222112 (base 3) to base 12. -56a9a2 Convert 31323311 (base 4) to base 7. 325256 -112121111102 (base 3) to base 2 -1000110001101100100 -101011101101100 (base 2) to base 11 -158a6 -114144324 (base 5) to base 8 -2031570 -12abd1 (base 14) to base 2 -10011101010101010011 Convert 212b87 (base 12) to base 16. 7fd17 What is -24aaba (base 13) in base 14? -18cd11 What is -21100202102 (base 3) in base 4? -203113331 Convert -e03e (base 15) to base 9. -71805 Convert -548527 (base 9) to base 16. -50047 What is -101101101000110111001011 (base 2) in base 16? -b68dcb What is -107484 (base 10) in base 16? -1a3dc Convert 3644322 (base 7) to base 2. 1110001100000100000 -13658 (base 15) to base 6 -1155515 a74410 (base 12) to base 6 132334420 What is -78edd (base 16) in base 3? -221011110101 Convert -140131234 (base 6) to base 9. -5254374 What is 212102130300 (base 4) in base 12? 3440580 -11c2880 (base 14) to base 2 -100000100011110111100000 -3298aa (base 15) to base 7 -26333140 Convert -76901 (base 11) to base 9. -180028 Convert 13034026 (base 7) to base 9. 2205561 What is 201202101120022 (base 3) in base 10? 10498742 What is 1042033034 (base 5) in base 16? 231508 2048b2 (base 14) to base 4 10021231130 What is da520 (base 14) in base 4? 2000313300 What is -345a5 (base 11) in base 12? -24abb -650a310 (base 11) to base 6 -1045213225 110012330 (base 6) to base 7 22446246 Convert 1674752 (base 9) to base 2. 11100100010100011000 What is 3511560 (base 7) in base 4? 1223123031 -12431332 (base 5) to base 8 -362077 What is -1122233110 (base 4) in base 6? -11544404 Convert -9267 (base 12) to base 13. -7327 15dbcba (base 15) to base 10 15885625 -25d3d1 (base 16) to base 6 -125045041 -272217 (base 8) to base 3 -11211211102 What is 217011 (base 10) in base 16? 34fb3 What is 652ea (base 16) in base 7? 3344200 Convert 21330320110 (base 4) to base 13. 7044b2 10011110001011001011 (base 2) to base 6 21515243 Convert -25aa7 (base 12) to base 15. -104a4 Convert 353000120 (base 6) to base 16. 646170 Convert -2214 (base 13) to base 4. -1022031 342455250 (base 6) to base 2 10111111111110011101110 -101376511 (base 8) to base 5 -13343412422 3327403 (base 8) to base 10 896771 What is 2e72d (base 15) in base 14? 3c9ca What is 3bcba (base 14) in base 8? 440754 -121141411 (base 5) to base 4 -2022300210 What is -538405 (base 11) in base 10? -860315 -775627 (base 8) to base 3 -111021001020 What is 20140344 (base 5) in base 14? 43058 12543210 (base 6) to base 7 3360525 Convert 1001110100001101000 (base 2) to base 7. 2506504 3132134 (base 5) to base 11 36217 Convert 2200332 (base 4) to base 7. 42015 Convert -981246 (base 10) to base 2. -11101111100011111110 Convert -1343314400 (base 6) to base 5. -13144330023 71c80 (base 14) to base 11 177a50 What is 6f0248 (base 16) in base 4? 123300021020 100201201110 (base 3) to base 14 4db23 What is 12100201 (base 4) in base 14? 94ad -1011101101011010110000 (base 2) to base 15 -4097b1 2a3c13 (base 15) to base 9 3745350 977a9 (base 13) to base 10 273750 Convert -73c (base 13) to base 4. -103102 Convert 21904a9 (base 12) to base 5. 3120030004 -3e63e (base 15) to base 4 -300331112 Convert -373473 (base 10) to base 16. -5b2e1 Convert -1104100004 (base 5) to base 8. -11141643 b06c3 (base 15) to base 7 4514004 What is -4650b (base 12) in base 13? -33a61 Convert -4c756a (base 14) to base 15. -37004a Convert 33b9b1 (base 13) to base 15. 19312e Convert -1974345 (base 10) to base 6. -110152253 What is -24b6348 (base 13) in base 14? -1746b8a Convert 641235 (base 7) to base 10. 110913 Convert 352de (base 16) to base 12. a607a What is -2553056 (base 7) in base 11? -20781a Convert -357779 (base 12) to base 6. -30301033 Convert 11326244 (base 7) to base 12. 401a8b 225440100 (base 6) to base 8 17765044 -562676 (base 9) to base 4 -1102023300 Convert 1819a4 (base 16) to base 8. 6014644 -155242414 (base 6) to base 12 -114940a Convert 1361654 (base 8) to base 10. 385964 -32428365 (base 9) to base 6 -1315445305 Convert -1d4e06 (base 16) to base 9. -3546408 What is b45d9 (base 15) in base 9? 1061206 443411551 (base 6) to base 3 120002000000211 What is 1102b9 (base 12) in base 4? 1001322231 -10911 (base 10) to base 13 -4c74 What is -3361056 (base 8) in base 5? -213103440 What is -1130020 (base 4) in base 13? -28b7 What is -b741cf (base 16) in base 13? -2646692 -979a13 (base 12) to base 10 -2401647 -62452 (base 11) to base 12 -44835 -bd342 (base 14) to base 2 -1110000000010001110 352323054 (base 6) to base 5 3134332232 Convert 63579 (base 10) to base 4. 33201123 Convert -251303433 (base 6) to base 9. -10071103 Convert 1020001210 (base 3) to base 4. 11320221 What is -37a9c6 (base 14) in base 3? -10121010110000 Convert 103312244 (base 5) to base 12. 1971a8 10000001000011111111 (base 2) to base 6 15155223 d5ba (base 15) to base 5 2421200 What is 88a394 (base 15) in base 16? 636784 Convert 145443305 (base 6) to base 10. 3069689 -101010010001110000 (base 2) to base 3 -22210112122 100011110011001100111 (base 2) to base 6 41050555 Convert -30558016 (base 9) to base 12. -4b00bb0 Convert -21761033 (base 9) to base 15. -dd629c Convert -426015 (base 8) to base 14. -39c3b Convert -4231411304 (base 5) to base 10. -8857079 What is -356894 (base 11) in base 10? -565415 What is 1da66c (base 15) in base 11? 902489 -23220322013 (base 4) to base 7 -34635314 Convert 16422166 (base 7) to base 12. 65328a What is -118421 (base 10) in base 6? -2312125 214453031 (base 6) to base 7 44562301 What is -dbd1 (base 15) in base 11? -31a75 Convert 156821 (base 12) to base 5. 43122212 14213234 (base 5) to base 14 3bcb6 Convert -22bc5 (base 14) to base 10. -84649 What is 1a782a (base 13) in base 8? 2443606 Convert 1220120001 (base 3) to base 10. 37585 Convert -1010011001001000010110 (base 2) to base 5. -1144134444 What is -101002020222110 (base 3) in base 11? -3030215 -2db39 (base 16) to base 2 -101101101100111001 Convert 389716 (base 10) to base 15. 7a711 What is -2c937f (base 16) in base 13? -7b3909 What is 1373065 (base 8) in base 2? 1011111011000110101 -2c54c (base 15) to base 10 -142947 188511 (base 9) to base 4 130300120 Convert 1245334053 (base 6) to base 11. 8401039 Convert 666053 (base 9) to base 3. 202020001210 10266316 (base 10) to base 8 47123314 2175145 (base 10) to base 9 4074657 What is 59ea6 (base 15) in base 4? 1012001112 Convert -120658 (base 13) to base 9. -724144 Convert 772b1 (base 13) to base 3. 101222000011 -4431103 (base 6) to base 4 -312022233 What is -10011100011011001 (base 2) in base 9? -131767 -247467 (base 15) to base 3 -10021200212221 Convert -1110111010100000010 (base 2) to base 11. -304199 -3541254 (base 8) to base 13 -27b3ba What is -23311001131 (base 4) in base 8? -13650135 What is -110021101202222 (base 3) in base 2? -11000111000100000110001 Convert 1d6b (base 15) to base 6. 45345 What is 482f96 (base 16) in base 5? 2202341044 Convert 102001111 (base 3) to base 4. 1331323 What is 354b1 (base 13) in base 5? 11104423 Convert 1010132121102 (base 4) to base 9. 36688146 Convert 1204163 (base 8) to base 6. 11023015 Convert -88d83 (base 15) to base 14. -b478c Convert 68a898 (base 15) to base 5. 2234400233 1323033221 (base 4) to base 7 4201514 Convert -342742 (base 11) to base 14. -102a00 10201201010221 (base 3) to base 9 3651127 What is 3965a93 (base 13) in base 14? 256a06d Convert -222112222220 (base 3) to base 2. -1111111100111000010 -959724 (base 11) to base 12 -620738 Convert -860250 (base 9) to base 8. -1747735 What is -20120112200 (base 3) in base 4? -133212111 -6880 (base 16) to base 10 -26752 2a3e61 (base 16) to base 3 12012122122100 Convert 2554225 (base 8) to base 16. ad895 Convert -12451011 (base 6) to base 12. -179a67 -251530050 (base 6) to base 5 -2220121431 -3445303 (base 6) to base 2 -101011010100100111 Convert -22633a (base 16) to base 14. -429414 Convert 1164a03 (base 12) to base 13. 90ba72 Convert -253192 (base 11) to base 14. -a5854 17662615 (base 8) to base 7 50213006 32c8c6 (base 13) to base 16 124b1f What is -547318 (base 10) in base 4? -2011213312 What is -1a900 (base 11) in base 10? -29040 -1100010000010111100001 (base 2) to base 3 -20001020002110 What is 75701 (base 15) in base	{ "pile_set_name": "DM Mathematics" }
(-14)). Suppose -3j = -bj. Suppose 7y - 4 = 6y. Solve j = -0k - yk for k. 0 Let u = -2 - -7. Solve -2 + u = 3m for m. 1 Let w be 4/(-18) + 12/54. Suppose 4m + r - 7 = 0, 4r - r + 5 = m. Solve -ms = -ws - 10 for s. 5 Let s(b) = -3b*3 + 2b*2 + b. Let l be s(2). Let t be (-6)/l - 22/(-14). Solve 4 = 3k - tk for k. 4 Let n(u) = 2 - 1 + 2u - u. Let c be n(2). Let q(z) = z*2 - 4z + 3. Let a be q(c). Solve -l + 3 = -al for l. 3 Let t(z) = -z + 5. Let d(v) = -2v - 1. Let i be d(-2). Let u be t(i). Suppose -uo + 5 = -5. Solve -2 = or + 8 for r. -2 Let t = -6 - -10. Suppose -i + ti - 12 = 0. Let r be (-2)/(-8) - 14/(-8). Solve 0 = rz + 2z + i for z. -1 Let r(u) = -u2 + 11u + 3. Let j = 21 - 10. Let v be r(j). Solve -2a - 13 = -v for a. -5 Let l(m) = -m2 - 10m + 2. Let p be l(-10). Suppose 2j = -2j + 16. Solve -ji + pi = -8 for i. 4 Let k = -49 + 77. Suppose -3z + k = -8. Solve -3m = m + z for m. -3 Let h = -9 - -13. Solve l + 15 = hl for l. 5 Let l be (12/(-8))/(6/16). Let x be 0 + -1 + (l - -13). Let u be 3/15 + (-3)/15. Solve 5t - t + x = u for t. -2 Suppose 0 = -4i - 3r + 39, -2i + 0r + 17 = -r. Solve -4l - 15 = -il for l. 3 Suppose 2f + 24 = 3f. Suppose 4g + f = 8g. Suppose -3z = 2z + 3c - g, 4z = -4c + 8. Solve 5w - 3 + 13 = z for w. -2 Suppose 3g - 24 + 15 = 0. Solve 0i = -i + g for i. 3 Suppose 0 - 10 = -5u. Solve x + x = u for x. 1 Let z = -33 + 15. Let j = z - -13. Let r = 17 + j. Solve 0 = -5l - r - 8 for l. -4 Suppose -6x + 15 = -3x. Let b be 1/(-1) - (0 - x). Solve 8c - 20 = bc for c. 5 Let r(f) = -2f + f + 2 - 3. Let l(d) = 2d + 1. Let g(w) = 6l(w) + 5r(w). Let k be g(1). Solve -b - k = b for b. -4 Let n(g) = -g - 23. Let x be n(-26). Solve k - 1 + x = 0 for k. -2 Suppose -7y + 2y + 40 = 0. Solve -y = p - 5p for p. 2 Suppose l - 43 = -5i + 17, 50 = 5i + 3l. Suppose -7 = -5a + i. Solve -y = ay + 5 for y. -1 Suppose -3j + 40 = j. Let z = 141 + -140. Solve 3l = j - z for l. 3 Suppose 2q = -d + 8, 0 = 4d - 3q + 4 - 25. Let t = d + -1. Solve 5 + t = 2o for o. 5 Let o = 13 + -13. Solve -a = -o + 4 for a. -4 Let d = 5 - 2. Solve -2r = 5 + d for r. -4 Let y(l) be the second derivative of -l4/12 - l3/6 + 2l*2 + l. Let o be y(0). Let b be 2/8 + 23/4. Solve -b = -7k + ok for k. 2 Let x(s) be the first derivative of -s2 - 2s + 1. Let f be x(-5). Solve 0 = fy - 6y + 6 for y. -3 Suppose y + 4w = 12, 5w = 5y + 3 + 12. Solve y = -2v + 4 for v. 2 Let h(y) = -y - 1. Let p be h(-4). Let u(g) = -g2 + g + 4. Let f be u(0). Let n(k) = k3 - 4k2 + k - 2. Let l be n(f). Solve a - l = pa for a. -1 Suppose 4m - 3 = 1. Let d be 6/(-4)(-3 + m). Suppose 3h = 3, -p = h - 9 + d. Solve -ps = -2s - 6 for s. 2 Let m = -69 + 79. Solve 5o + m = -0o for o. -2 Suppose 6z - 3z = 0. Solve -5j + 3j + 4 = z for j. 2 Suppose 0 = 2m + p, m + 3m = -3p + 4. Let j = m - -3. Suppose 2g - 1 = j. Solve 0 = a - g for a. 1 Suppose 4l - 10 = r - 2r, 2l - 8 = -2r. Let h be 3 - (4 - (6 - l)). Let v(u) = 2u - 6. Let k be v(6). Solve -hg = -kg + 15 for g. 5 Let t be (2/(-3))/(1/(-6)). Suppose 2w + 5l + 0l - 1 = 0, 3w + 11 = 5l. Let i = t + w. Solve -f - if = -3 for f. 1 Let h be (-6(-4)/16 + -2)-4. Solve -h = -j + 3j for j. -1 Let b = -35 + 65. Suppose 4l = 5s - b, 6 = -l + 1. Solve 2n + s = -0n for n. -1 Let n(j) = j2 + 6j + 2. Let t(k) = -4k2 - 25k - 9. Let z(u) = 9n(u) + 2t(u). Let w be z(-4). Let d = w - 0. Solve 0 = a - da for a. 0 Let h(j) = j3 - j2 - j + 1. Let c be h(1). Solve -2x - 2x + 20 = c for x. 5 Suppose 0 = 2p - 4x - x + 9, -2x = -p - 3. Solve 0 = pn + n + 8 for n. -2 Let p(t) = 2t. Let h be p(0). Solve 5z + 16 + 4 = h for z. -4 Let s = -1 + 1. Suppose 0 = -3b + 5n - 12, -4b + 3n = -sb + 5. Solve 0 = -o + 5 - b for o. 4 Suppose -i - 40 = -5y + 2i, -4y = -4i - 40. Let l = y - 3. Solve -lb = -4 - 6 for b. 5 Suppose 4b - 11 = -g, -4g = -0g - b + 41. Let y be ((-3)/9)/((-3)/g). Let j be 2/(-1)(y + 0). Solve -d = -6 + j for d. 4 Let f(o) = -o3 - o2. Let d be f(-2). Suppose 5u = du. Let j = 40 + -22. Solve -4q - 2 + j = u for q. 4 Let q = 41 - 38. Solve 16 = -qa - a for a. -4 Suppose 2s + q = 6, 0s - 5q + 6 = 4s. Let r be s - (2/(-2) - -2). Suppose 2b = 2g - 20, -rg - 3b - 20 = -4g. Solve -gv + 21 = -4 for v. 5 Let j(k) = k + 70. Let i(y) = -y2 + y + 2. Let o be i(2). Let p be j(o). Suppose 0 = -u + 6u - p. Solve u + 1 = 5n for n. 3 Suppose -5q + 15 + 8 = y, -3q - y = -15. Suppose qk - 17 = -1. Let h be -3(14/(-6) + 2). Solve -5 + h = ku for u. -1 Let v be (1 - 1 - 3)/(1/(-1)). Solve 0 = 4o + v + 1 for o. -1 Suppose -11 = -t - 8. Solve -t = -b + 2 for b. 5 Suppose -10 = -9k + 4k. Suppose -4h - 25 - 5 = -5v, -4h = -kv + 12. Suppose 0i - 2n + 77 = 5i, 12 = i - 3n. Solve -3j - i = -vj for j. 5 Let f(w) = w2 + 15w. Let j be f(-15). Solve jt = -5t - 25 for t. -5 Let f(w) = w + 3. Let a be f(0). Solve 2s - a = 7 for s. 5 Suppose 7h - 6 = 5h. Suppose 5d = 5j + 30, 2d + j = 7d - 14. Solve c = dc - h for c. 3 Let z(p) = 2p2 + 11p + 8. Let x be z(-9). Suppose -h = 2g - 11, 2g = -6h + h + x. Let o(r) = 2r*2 - 2r + 1. Let d be o(2). Solve dv + h = 2v for v. -5 Let p(z) = -z*2 + 9z - 4. Let n(m) = -4m - 4. Let v be n(-3). Let d be p(v). Solve dl = l - 3 for l. -1 Let n be -3 + (-5)/((-10)/(-4)). Let q = n + -5. Let o(y) = -y*2 - 9y + 13. Let v be o(q). Solve -2t - t + v = 0 for t. 1 Suppose 0 = 2k - k - 3. Solve -u + k = 8 for u. -5 Let d be (1/1 - -2)/1. Let n be 0 + (-6)/d - -3. Let l be (0 - n/5)-5. Solve -3 = -2x + l for x. 2 Suppose 0 = -4f + 2j + 16, -f + 4f = 4j + 7. Solve fo = 3o for o. 0 Let m = 98 - 89. Solve -mu = -4u + 10 for u. -2 Let b(v) = v*2 - 3v + 2. Let a be b(3). Solve 0 = ay - 0y - 2 for y. 1 Let h(g) = 3g - 6. Let s be h(2). Solve -4 = 2i - si for i. -2 Suppose -2m + 5l - 5 = 0, 2m + 3l - 3 = m. Suppose 6 = t - m. Let u(g) = -g3 + 5g*2 + 7g - 4. Let w be u(t). Solve wv = -v - 3 for v. -1 Let v be (4/(-6))/(18/(-405)). Solve -6m + 3m = v for m. -5 Suppose -j = 5p + 23, 4j + 2 + 10 = -4p. Let k = -6 + 6. Solve 2b + 8 - j = k for b. -3 Let j(v) = -2v - 3. Let x be j(-4). Suppose -2q + 15 + 6 = xa, -2q + 6 = 0. Let r be 3 + 0 + (2 - 2). Solve -ap + r = -4p for p. -3 Suppose 11 = 5s - 4. Suppose 0 = -4i + 13 - 1. Let b be 0/(-1) + i + -1. Solve -m - s = -bm for m. 3 Suppose h - 2h = 6. Let v(u) = -u3 - 6u*2 - u - 6. Let g be v(h). Solve t + 4t - 15 = g for t. 3 Suppose 0 = 2g - 4q - 46, -g + 0g - 2q + 43 = 0. Suppose c - 3w - 20 = 7, 3w = -4c + g. Suppose 0r = 4r - c. Solve h - 4 = rh for h. -2 Let g(z) = z*2 - 2z - 2. Let b be g(4). Suppose -2w - 3w + 20 = 0. Solve 2t - bt = w for t. -1 Suppose 2h + 2h - 20 = 0. Suppose -9n = -4n - 10. Solve h = 3g + n for g. 1 Suppose -4i = -0i - 20. Suppose -d - ix - 10 = 0, -d - 32 = -5d + 4x. Suppose l = 5a + 23, 3a - da = 5l - 61. Solve -l = -5n + 7 for n. 4 Suppose 4g - 29 = -x - 2x, -3x = -g - 4. Let a be (-4)/(-6) - 4/(-3). Suppose u - 2 = -av, -3v - xu = 2u - 10. Solve v = -2o - 3o for o. 0 Let g(j) = -j*2 - 4j - 10. Let f(w) = -w*2 - 5w - 9. Let l(t) = 3f(t) - 2g(t). Let y be l(-5). Solve 4k + 11 - y = 0 for k. -2 Let v = 16 - 14. Suppose -vt + 6t = 0. Solve 3l = 15 - t for l. 5 Let h be -30((-12)/5 - -2). Let j be h/(-7)(-14)/4. Solve -5k - j = -16 for k. 2 Let u = -13 + 17. Solve 5r + u = 3r for r. -2 Let o(g) = 2g*3 + 2g*2 - 2g + 1. Let q be o(1). Suppose -3f + 5 = -5v + 25, -2f = -qv + 12. Solve -vw + 5 = -3w for w. 5 Suppose 1 = -3r + 7. Solve -2d + 4 = rd for d. 1 Let s = 2 - -1. Let b be s/24/3. Solve by - 7y - 5 = 0 for y. -1 Let s be (-8)/(-2) + (-1 - 1). Solve -2i + s - 12 = 0 for i. -5 Let x = -8 - -14. Let j = x - 6. Let r be ((j - 0)/2)/1. Solve 2l + 10 = -rl for l. -5 Suppose 5j - 12 = 53. Solve -2 = 5d + j for d. -3 Let k be (-1)/(-6) + 2/(-12). Let h = -3 - 0. Let z be h/(17/10 + -2). Solve kg - 5g + z = 0 for g. 2 Let m be ((-8)/(-3) - 2)3. Let k = 5 - m. Let i be k/9(-18)/(-3). Solve -2p + 2 = -i for p. 2 Let a be 2/(-4) - (-85)/10. Solve 4	{ "pile_set_name": "DM Mathematics" }
culate the common denominator of ((-8)/(-24))/((-5)/(-145)) and x. 15 Let o = 10 - 7. Let i = -17 + 12. What is the common denominator of (o/i)/(2/18) and -17/6? 30 Find the common denominator of -73/20 and (-2)/(-14) + (-379)/(-42) + -5. 60 Let x(r) = r*2 + 8r + 17. Let m = 22 - 29. Calculate the least common multiple of 7 and x(m). 70 Let r = 63 - 53. Calculate the common denominator of 58/21 and 4879/(-210) - 6/r. 42 Let v = 20 + -8. Suppose 95 - 93 = -c, 2c - 26 = -5n. Calculate the least common multiple of v and n. 12 Let r(v) = 12v + 693. Calculate the lowest common multiple of 108 and r(-48). 1404 Suppose -p + 6p = 25. Suppose -q - 3z + 60 = 4q, 2q + pz - 24 = 0. What is the smallest common multiple of 8 and q? 24 Let l = 66 + -65. What is the smallest common multiple of ((-2)/(-8) - l)/((-2)/16) and 5? 30 Suppose 3g + 33 = 3h, -2h + 5g + 30 = 5. Calculate the smallest common multiple of h and 28/6 + (-14)/21. 20 Let o = 4265/7 + -47006/77. Let r = -4343/4 + 1094. What is the common denominator of o and r? 44 Let b = -930290/3268881 + -2/36729. Calculate the common denominator of -62/33 and b. 2937 Suppose 0g + 4g = 6148. Let z = g + -30753/20. What is the common denominator of -69/16 and z? 80 Let n = -2/4072758765563 - 5324661596808265895797/1792013856847720. Let p = n - -2971327. Let q = p + 45/88. What is the common denominator of 127/12 and q? 60 What is the common denominator of 19/396 and (-22)/(7744/(-1740)) + -6? 792 Suppose -2k + 3k - 60 = 0. Suppose 5q - 4q = 3. Suppose -5l + 15 = 5y, qy - 8l - 17 = -3l. What is the least common multiple of k and y? 60 Suppose 4k - 5k = -51. Suppose p + 3w = -2p + k, p - 11 = -3w. Calculate the lowest common multiple of p and 24. 120 Suppose 2b = -6b + 104. Calculate the common denominator of -121/24 and b/10 + (-15)/(-15). 120 Suppose 2t + 16 = -2h, -2h - 3t + 6 = -4h. Let q be h/(-2)3/(-69). Let x = 787/138 - q. Calculate the common denominator of 25 and x. 6 Let w be 3/(105/25 - 4). Suppose 2g = 55 + w. Find the common denominator of -11/7 and g. 7 Let y = 21353/840 - 178/7. Calculate the common denominator of y and -71/192. 960 Suppose 12 = 4m - 2m. Suppose 4g + 54 = mg. What is the least common multiple of 12 and g? 108 Calculate the lowest common multiple of (((-7296)/9)/(-16))/(1/18) and 22. 10032 Let r be (1 + -2)/(3/72). Let d = 1/15289 - 1207857/397514. Find the common denominator of (2/r)/((-10)/1660) and d. 78 Let y = -9 + 17. Calculate the smallest common multiple of y and ((-3)/(-9))/((-13)/(-936)12). 8 Suppose -2k + 351 = k. Find the common denominator of (22/55)/((-8)/(-113)) and ((-3)/k)/(4/6). 260 What is the lowest common multiple of 6 and ((-140)/322)/(7/(-28))? 210 Let i(b) = 4b2 - 38b - 14. Calculate the least common multiple of i(11) and 140. 1820 Let q be ((-14377)/(-3690))/(4/12). Let h = 7/615 + q. What is the common denominator of h and -47/14? 70 Let q(p) = 5p - 68. What is the least common multiple of 744/42 + 4/14 and q(16)? 36 Let x be (-15)/(-20)(-8)/(-3). Let q = 18 - x. Calculate the lowest common multiple of 4((-22)/(-4) - -2) and q. 48 What is the common denominator of -41/56 and (-515)/55(2 - 116/56)? 616 Let m = 100 - 190. Find the common denominator of 91/18 and -2 - 3/m53. 90 Let q be (0 + (-1 - 2 - -2))-4. Let i(r) = r + 2. What is the least common multiple of 2 and i(q)? 6 Let n = -26 - -32. Calculate the least common multiple of ((-3)/6)/(n/(-324)) and 27. 27 Let z = 1163 - 915. What is the smallest common multiple of 20 and z? 1240 Suppose -420 = -34i + 28i. What is the lowest common multiple of i and 28? 140 Let s be (-140)/(-30)112. Let a = s + -49. What is the smallest common multiple of 5 and a? 35 Let c = 6/415 + 60139/2490. Let y = 24376 + -243443/10. Let r = y - 152/5. What is the common denominator of r and c? 30 What is the least common multiple of 15 and 2/5((-145)/(-10) - 2)? 15 Let z = -7527/8 - -949. Let n = -29/49 - -8/49. Find the common denominator of n and z. 56 Let w = 145 + -11735/81. What is the common denominator of 79/63 and w? 567 Suppose 63q - 64 = 47q. What is the least common multiple of 20 and q? 20 Let z(s) be the first derivative of s*3/3 - 11s*2/2 - 3s + 2. Calculate the lowest common multiple of z(12) and 6. 18 Suppose -3u + u + 28 = 0. Let v(f) = 2f + 8. What is the lowest common multiple of u and v(7)? 154 Find the common denominator of (18/32)/((-105)/(-180)-8) and 99/196. 1568 Let q = 15344 - 1242902/81. What is the common denominator of 83/18 and q? 162 What is the common denominator of -4/55 and 99264/61710 + (-4)/10 + -1? 935 Suppose -x - 5m - 4 = 0, 0 = -5x + 2x + 2m + 5. Let c = -384 - -396. Calculate the smallest common multiple of c and x. 12 Suppose 4i - 242 = -22. Let g = 469/8 - i. Calculate the common denominator of (-117)/(-12)(-21)/(-9) and g. 8 Let n = 367/18 + -248/9. What is the common denominator of 143/42 and n? 42 Suppose 1 = -5c - 34. Let v(x) = x*2 + 7x + 8. Let a be v(c). Find the common denominator of a/60 - (-2337)/(-990) and -39/20. 220 Let g(u) = 38u3 + 3u*2 - 13u - 4. What is the smallest common multiple of g(3) and 2? 1010 Suppose r + 54 = -r. Let y be (-151)/(-3)r/(-90). Let g = -15 + y. Calculate the common denominator of g and 37. 10 Let t(i) = -i3 - i2 + i - 56. Let s be t(0). Let u = -36 - s. Calculate the lowest common multiple of 4 and u. 20 Suppose 95 + 24 = 5v - l, 5l + 43 = 2v. Calculate the lowest common multiple of v and 8. 24 Suppose u - 23 = 13. What is the least common multiple of u and (-4 + 4 - 2)/2 + 30 + 3? 288 Let h = -101442258329/15784170885 + 13/33090505. Let r = 14/795 - h. Let t = -1487/7 - -213. Find the common denominator of t and r. 63 Let c = -900 - -3663/4. Find the common denominator of c and 93/22. 44 Let s be -657/(35/(-4)). Let v = -644 + 12877/20. What is the common denominator of v and ((-105)/24 + 4)s? 20 What is the common denominator of (5/66)/((-1)/27) and 504/352 - 4/(-96)6? 22 Calculate the common denominator of (-64)/(-280)(-720)/54 and (-2)/(-2) + 34/3. 21 Suppose 0 = 5p - 163 - 187. What is the common denominator of (-2)/355 + 258/p and -93/20? 20 Let n be (9/27)/(2/(-42)). Let p = n - -23. Let b = 1 + 1. Calculate the lowest common multiple of b and p. 16 What is the common denominator of (106/(-108))/(-8 + 9 + -6) and -103/144? 2160 Suppose -2o = -o - 3. Suppose 4x = o + 9. Calculate the lowest common multiple of x/(0 - 3/(-4)) and 1. 4 Suppose 0 = 5l - r - 1, l + 2 = -l + r. Let v be (-78)/(-18) + l/(-3). Find the common denominator of v/(-10) - 382/120 and 27/4. 12 Suppose 0 = -2r + 4f + 18, -101 + 88 = -r + 3f. What is the least common multiple of r and 37? 37 Let q(k) = k*3 + 2k*2 - 5k + 1. Let r be q(-4). Let z = -10 - r. What is the least common multiple of z and (-1)/((-4)/(1 - -3))? 1 Find the common denominator of -139/726 and -1 - 13/(14300/(-2370)). 3630 Let v be (-16)/2 - (9 - 12). Let i = 9 + v. Suppose -3q + 5g + 0g + 41 = 0, 0 = iq + 2g - 98. What is the smallest common multiple of q and 6? 66 Let k(s) = -s3 - 17s*2 - 7s - 53. What is the lowest common multiple of 8 and k(-17)? 264 Suppose -170 = -5s - 5n, 25s + 5n + 70 = 28s. What is the lowest common multiple of 76 and s? 1140 Suppose -2y = -2g + 5 + 11, g - 5y - 16 = 0. Calculate the smallest common multiple of 6/1(g + 2 + -3) and 25. 150 What is the common denominator of 79/42 and (-2)/8 + (11 - (-10402)/(-1176))? 42 Calculate the smallest common multiple of (-10)/(-1)10 + (-235 - -234) and 99. 99 Let a(c) = -12c + 2. Let v be a(5). Calculate the smallest common multiple of (-2)/9 - v/18 and 11. 33 Suppose 3c + 142 = 4s, -5 = 2c + 4s + 123. Let v = -9 - c. What is the lowest common multiple of 3 and v? 45 Let q = 9/457 + -109376/7769. Let j = -15/34 + q. Calculate the common denominator of j and 0 + 2/(-15) + 14846/(-780). 6 Calculate the common denominator of -53/9 and (-1460)/(-30)1/2. 9 Suppose -d = -2b - 5d - 48, 0 = 2b - 5d + 57. Let a be -353113/b. Let n = 171 - a. Find the common denominator of n and 43/28. 28 Let z = -4 - -9. Suppose -v - 3v = 3a + 4, z*a - v = -22. Calculate the common denominator of -15/7 and 1 - -1	{ "pile_set_name": "DM Mathematics" }
= -238 - -768. Is 7 a factor of v? False Does 19 divide (5 - 5/153) + 153? False Let q(c) = -c2 - 6c + 3. Let f be q(-6). Let i be (13/(-2))/((410/420)/(-41)). Suppose 0 = 5k - fn - i, 0 = k + n + 8 - 61. Does 27 divide k? True Let f(m) = -m*3 - 15m*2 - m - 15. Let w be f(-15). Suppose 3n - n = w. Suppose 2u - 2x = 188, -5u + nx + 476 = -2x. Is 32 a factor of u? True Suppose -10j + 17719 = 19j. Does 13 divide j? True Let y = -122 - -212. Is y a multiple of 4? False Suppose 2d + 3d = 0. Suppose d = k - 5q + 5, -2k - 2q = -6k + 34. Suppose -k = -0g - 2g. Does 5 divide g? True Suppose 20c = 22c. Suppose -4i + 3i + 166 = c. Does 9 divide i? False Suppose 4d - 360 = -4s, 8s - 460 = -5d + 5s. Does 14 divide d? False Let q = -26 - -34. Suppose 0 = qp - 144 - 176. Does 10 divide p? True Let p(x) = 9x*2 - 7x - 12. Let c be p(-4). Let k = c - 64. Is k a multiple of 8? True Let t be 1/8-6 - (-9)/12. Suppose 3p = -m - tp + 15, 3p = 5m - 129. Is m a multiple of 3? True Let j(a) = 7a*2 - 20a + 9. Let w(f) = 6f2 - 19f + 10. Let i(t) = 5j(t) - 6w(t). Is 2 a factor of i(12)? False Suppose -6l + 5073 = -3873. Is l a multiple of 101? False Let t = -20 + 23. Suppose -u + 2u = -4, tu + 108 = 2g. Is 24 a factor of g? True Let p(a) = 3a3 + 4a*2 - 7a + 5. Suppose -3m - 81 = -2c, 5c = 5m + 10 + 185. Let f be -4(-3)/c6. Does 14 divide p(f)? False Suppose -1221 - 10161 = -7w. Is 6 a factor of w? True Let d = 14 + -10. Suppose -12 = -dy, -2p + 3y + 111 = -p. Is 12 a factor of p? True Suppose 1 + 5 = 2s. Suppose -5f + 53 = -sf - 5z, -48 = -3f - 3z. Does 19 divide f? True Let a = -9 + 9. Suppose aq = -3q + 90. Does 22 divide q? False Let j be (-5 + 1)26/8. Let d(p) = -7p - 10. Is d(j) a multiple of 42? False Suppose -3f = -8f + 140. Let p = f + 62. Suppose -4x - p = -7x. Is 15 a factor of x? True Suppose 2g - 1 = 5. Suppose -6j + 45 = -gj. Is 3 a factor of j? True Suppose -11p - 2 = -12p. Let h(c) = 2c*3 + 5c*2 - 8c + 6. Let a(g) = g*3 - g + 1. Let t(k) = -3a(k) + h(k). Is t(p) even? False Let t(q) = 16q2 + 33q - 10 - 7q2 - 11q*2 + 2q. Does 10 divide t(10)? True Suppose -4f + 777 + 135 = 4g, 4f = 4g + 944. Suppose 5d - f + 52 = 0. Does 5 divide d? False Let h(o) = -35o + 16. Let l be (-1)/(-1 - -4)15. Is h(l) a multiple of 14? False Let n = 27 + 3. Let z be 12/n + (-16)/(-10). Suppose -u - 3 = -zu. Does 2 divide u? False Let g = -3 - -1. Let m be 173 - (1 + g2). Suppose -2w - 64 = -3w + d, -d + m = 3w. Is 16 a factor of w? False Let v = 79 - 128. Let k be (v + -2)2/6. Let i = k + 29. Does 5 divide i? False Suppose 2l - 35 = -3o - 2l, -o = -l. Suppose -45 + 143 = 3c + b, -oc + b = -150. Is c a multiple of 11? False Let h(z) = 6z + 48. Let p be h(-8). Does 7 divide (3 + -2)/(4/84 + p)? True Let y be -217/2-11. Suppose -9s + 434 = -y. Is 23 a factor of s? True Let n = -29 + 34. Suppose -q = 4g - nq - 536, 0 = -2g + q + 265. Suppose 0 = 5d - v - g, 4 - 15 = -d + 4v. Is d a multiple of 8? False Let l(j) = -3j*3 - 2j*2 + 8j - 4. Let a(u) = -5u3 - 4u*2 + 15u - 7. Let n(z) = 4a(z) - 7l(z). Is n(3) a multiple of 10? False Let d = 1417 + -1382. Is d a multiple of 7? True Suppose 4c = j + 2543, -582 - 1322 = -3c + 4j. Is 12 a factor of c? True Let u(d) = -d2 + 7d - 4. Let r be u(6). Let l be ((-4)/(-1) + 2)/r. Suppose -111 = -lx - 3. Is 18 a factor of x? True Let y = 6 - 4. Suppose -35 = -7a + ya. Suppose -10i = -ai - 42. Is 9 a factor of i? False Let o(z) = -8z - 26. Let t be 69/(-12) - ((-9)/(-4) + -2). Is o(t) a multiple of 14? False Suppose 4j - 2j - 30 = -3d, d = 5j - 7. Is d even? True Suppose -i = 3t + 4, -42 = 5i - i - t. Let z = i - -2. Let s = 4 - z. Is 4 a factor of s? True Suppose 960 = -372t + 374t. Does 25 divide t? False Let p = 112 - 56. Let t = p + 13. Does 19 divide t? False Suppose -1150 = -41r + 16r. Is r a multiple of 8? False Let g(w) = -w*3 + 3w*2 - 2. Let t be g(3). Let p be (52)/((-4)/t). Suppose 0 = -pf, 4d + 0f - 156 = 5f. Does 12 divide d? False Suppose 0 = -7w - 7w + 6496. Does 29 divide w? True Let w(p) = p*3 + 16p*2 - 19p - 37. Let n(x) = -x - 5. Let f be n(11). Does 20 divide w(f)? False Suppose 170 + 100 = 2z. Let p = 146 - 65. Let b = z - p. Is 15 a factor of b? False Let s(g) = 6g - 16. Let m be s(13). Is 43 a factor of m-24/(-8)? False Let h = 3 + 1. Suppose 0 = -4g - 2t, 2g - 2t + h = 16. Suppose -222 = -4m + 3j, 0m - gm + 5j + 104 = 0. Is 29 a factor of m? False Let k = 2 - -1. Suppose 168 = 6s - ks. Does 11 divide s? False Let z(m) = 6m + 32. Let n be z(-6). Let d(k) = -k*3 + 2k2 + 4. Does 24 divide d(n)? False Let l(c) = c2 - 13c + 84. Does 35 divide l(27)? False Let b be (2 + 4/(-2))/(-2 - -4). Suppose 0 = i + 5q - 45, b = 3q + q - 8. Is i a multiple of 12? False Let d be (-3)/(-6) + (-7)/(-2). Suppose 5u = du + 56. Is 28 a factor of u? True Suppose 3n + n = -1136. Let r = -119 - n. Is r a multiple of 16? False Let q be (-225)/(-2) - (-3)/6. Suppose -2s - z + q = 0, -z = -3s - 4z + 165. Is 23 a factor of s? False Let j(b) = -b3 - 7b*2 - 14b - 14. Is j(-11) a multiple of 48? True Let b(w) be the third derivative of w6/60 + w5/60 - w4/8 + w3/6 - 3w2. Let u(c) = -c - 5. Let v be u(-8). Is 22 a factor of b(v)? False Let t(u) = -3u*3 - 2u*2 + 5. Let j be t(-3). Suppose 11q = -j + 552. Is 11 a factor of q? True Suppose -6b - 477 = -9b. Let i = b + -84. Is i a multiple of 13? False Let p(g) be the third derivative of -g*5/30 + 9g*4/8 + 10g*3/3 - 11g*2. Does 3 divide p(14)? True Let v be (-1 + 0)(-4 + 2). Let i be v/6 - 20/6. Is 63/(-2)4/i a multiple of 23? False Let h = 921 + -622. Is h a multiple of 13? True Let y = 1 + 4. Suppose 3j - y = -2j. Does 3 divide -13j(1 - 2)? False Let p(x) = -x3 + 7x*2 + x - 7. Let t be p(7). Suppose tw - 29 = -w. Is 8 a factor of w? False Suppose -t + 0t + 2a = 2, -55 = -5t - 3a. Suppose -2y = -3y - t. Does 4 divide y/(-2)60/16? False Suppose -176o = -163o - 25662. Is 14 a factor of o? True Is 53 a factor of (-6)/(-14) + (-10560)/(-252)36? False Suppose 5z - 5d - 7526 = 4429, 0 = 3z + 3d - 7179. Is z a multiple of 20? False Let y(t) = t*2 + 6t - 6. Let f be y(-7). Let k be (-5)/(5/f) + 3. Let i = 27 - k. Does 14 divide i? False Let z(d) = d3 + d2 - 4d - 8. Let p be z(-2). Is 14 a factor of (-181)/p + (-39)/(-52)? False Is 2 a factor of (0 + -2)(-19 - 48/(-8))? True Suppose 4f = -3z + 827, -30 = -3z - 2f + 799. Is 32 a factor of z? False Let r(f) = f*3 - 14f*2 + 27f + 8. Is r(12) a multiple of 4? True Let v(x) = -2x2 - 19x - 9. Let w(k) = k + 1. Let y(z) = -v(z) - 6w(z). Let d(p) = p2 - 17p - 7. Let c be d(17). Does 10 divide y(c)? True Suppose -2j + 128 + 172 = 0. Suppose 0 = -4d + 722 - j. Is d a multiple of 29? False Suppose 8d = -13d + 903. Does 3 divide d? False Let m(h) = -h*3 - 29h*2 + 72h - 87. Is 11 a factor of m(-32)? False Suppose 0 = -5v - 2q - 0q + 40, -4q + 44 = 4v. Suppose 2p = 4p - v. Is 8 - -32/p a multiple of 3? False Let w = 78 + -374. Is (-10)/25 + (w/10)/(-4) a multiple of 2? False Let g(u) = -3u3 + 9u*2 + 7u + 8. Let w(h) = 2h3 - 10h*2 - 8h - 7. Suppose -8 - 4 = 3t. Let s(x) = tw(x) - 3g(x). Is s(-12) a multiple of 4? True Let m = 13 - 9. Does 19 divide m/((3 + -1)/16)? False Suppose u - 68 = -2k, -4k = -u + 6 + 44. Let g be (-25)/5(-1 + 2/10). Suppose -4x - u = -2c + x, -5c - gx = -221. Is 13 a factor of c? False Let p = -40 - -151. Is p a multiple of 37? True Let z = -74 + 163. Is z a multiple of 9? False Let a be (25 - (2 + -4 - -3)) + -4. Suppose -6f + 480 = -f + q, -4q + a = 0. Is 42 a factor of f? False Suppose 18y = 14y + 1952. Is y a multiple of 45? False Let a be (-2 - -3)/(1/93). Suppose -407 = ao - 1355. Is o a multiple of 14? False Let z = 39 - 12. Does 19 divide 36/z - 184/(-3)? False Let s(h) be the second derivative of -h5/10 - h4/2 + 2h*2 - 36h. Let q be (-3)/(6(-2)/(-16)). Does 11 divide s(q)? False Suppose -4q - 3l = -2157, -47q + 49q - 5l = 1059. Does 14 divide q? False Let g = 81 - 91. Let n(q) = q*3 + 12q*2 + 12q - 8. Is 1	{ "pile_set_name": "DM Mathematics" }
o 0? (a) z (b) 2/7 (c) 2/11 c Let d(g) = g3 - g2 - g + 2. Let i be d(2). Suppose -4 = -2c + a, -4c - 2a - 20 + 28 = 0. What is the nearest to i in 4, -1, c, 5? 4 Let f = 6.5 + 4.5. Let n = f + -12. Let s = 0.857 + 0.143. What is the nearest to -0.2 in s, n, 3? n Let a = 238.93 - 239.43. What is the closest to -0.1 in -1/6105, 1, a, 5? -1/6105 Suppose 971s - 968s = 9. Suppose 0 = 11y + 2 - 90. Which is the closest to -1? (a) s (b) 0.4 (c) y b Let r be (-1060)/55657/(-6). Let i = 2/163 + -503/1141. Let j = 0.5 + -1. What is the nearest to i in j, r, 3? j Let x be 10/(-15)12 + 360/44. Which is the nearest to -0.3? (a) -0.2 (b) 2/5 (c) x (d) -4 a Let t = 0.03 + 0.05. Let g = -4.92 - t. Let p(z) = -4319z + 17278. Let l be p(4). Which is the closest to l? (a) 4/5 (b) g (c) -7 a Suppose 5f + 47 - 12 = 0. Let o be -3 - -11 - ((-22 - -44) + -10). What is the nearest to f in 0, o, 4? o Let g = -0.14942 - 0.05058. What is the nearest to -1 in g, 1857, -0.5, 0.3? -0.5 Let u = 8 - 16. Let q = 91.31 - 91.21. What is the closest to -1/3 in u, -1, -2/9, q? -2/9 Let w = -0.01 + -0.49. Let s = 794.1 + -794. What is the closest to s in -0.32, 4, w? -0.32 Let a = -4846 - -4843. Let o(b) = 2b2 + 3b - 4. Let q be o(-3). Suppose 4l - 6 = -2c, 0 = -qc - 2l + 4l + 3. What is the nearest to c in -1, 2, a? 2 Let b = 9.22 + -0.22. Let z = b + -9.1. Let o be 2/(-4) + 5 + 68/(-16). What is the closest to -1 in z, o, -4? z Let z be (-2 - 0)(-28)/(-42). What is the nearest to -0.3 in 0.73, -0.2, z? -0.2 Let f = -4970 + 4970. What is the nearest to -18/19 in 5, f, 3/4? f Suppose 32 = 42p - 26p. Let q be -1 + (4/1 - (p - 1)). What is the closest to q in -3, -0.2, 2, 1? 2 Let z = -0.373 + 0.073. What is the nearest to -1.1 in 2/7, -9/4, z, 1? z Let s = -0.2 - -0.7. Let x = s - 1.5. Suppose 3v - 132h + 133h - 87 = 0, 3v - 3h - 51 = 0. What is the closest to x in v, -5, 0.5? 0.5 Let y be (3/3)/(-5) - (-1893)/(-10). Let g = y + 192. What is the closest to 1 in 0.4, 0.5, g? 0.5 Let v = 7917 + -7929. What is the nearest to 0.1 in -4, -1/7, v? -1/7 Suppose 3g + 4u = -0u - 31, 5g + 2u + 19 = 0. What is the closest to 700 in -0.2, g, -3? -0.2 Let m = -5102 - -5166. Let g be 1 - (26/(-195) - (-362)/240). Which is the closest to -2? (a) -5 (b) g (c) m b Let n = 31/194 + -791/2522. Which is the closest to -35? (a) n (b) 1 (c) 5 a Let h be 2 - (-17 - -4 - -1). Let d(v) = 9v - 1 + hv - 3 - 25v. Let y be d(-4). Which is the closest to y? (a) -2/3 (b) -1 (c) -2 a Let x be (-10)/25 + 4/10. Suppose -3r + 9 + x = 0. Let z(w) = -w*3 - 14w*2 + 26w + 165. Let f be z(-15). What is the closest to 0 in -5, r, f? f Let g be ((-12)/135)/((-4)/10). Let p = 109357/8 - 13670. What is the closest to 0 in p, 0.4, g? g Let p = -18 + 17.9. Let l = 52/105 + -2/21. What is the closest to p in l, 1/43, 1/6? 1/43 Let x be (48/(-6))/(-2 - -4). Suppose -227 + 202 = -25t. Let d = 2 + -2. Which is the closest to t? (a) -2/9 (b) x (c) d c Let n be 30/(-24)1986/30. Suppose 0 = -i - 3i - 332. Let v = i - n. What is the closest to 0.2 in -0.3, 4, v? v Let y = -0.082 + 0.113. Let h = -0.569 - y. Which is the closest to h? (a) -2 (b) 0 (c) -1/8 c Let y = 27318 - 27318. What is the closest to 1 in 7, 0.29, y, 1/3? 1/3 Let v be (-40)/42 + (-2)/(-7). Let r = -74.1 + -351.9. Let i = 433 + r. Which is the closest to v? (a) 4 (b) i (c) 0.1 c Let h be 1 - 1 - (2 - -1). Let t = -1735 + 1737. What is the nearest to 0.1 in -0.07, t, h? -0.07 Let z = -183 + 204. Let k be 12/(-28)-7(-6)/z. Which is the nearest to -4? (a) k (b) -1/3 (c) 3 a Let t = 23 - 40. Let x = -18 - t. Which is the closest to x? (a) -2 (b) -5 (c) 2 a Let f = 0.1 - 0. Let s = -350.84 + 351.24. What is the closest to 6 in 2, s, f? 2 Let o = -37.2 - -37. Let p = -9638.5 - -9639. Which is the closest to -2/3? (a) o (b) -1/4 (c) -1 (d) p c Let r = -0.1 + 0.2. Let l = 941 + -605. Let b = l + -332. What is the nearest to -1/4 in b, r, 7? r Let u = -332 + 331.761. Let z = u - -3.239. What is the closest to 8 in 0.2, -2, z? z Let x(q) = -q - 3. Let p be x(-4). Let h = 0.3991 + 0.0009. Let w = 0.1 + -0.2. Which is the nearest to w? (a) p (b) h (c) 3 b Let r = 558 + -557.905. Let l = -4.905 - r. What is the nearest to -1/2 in l, 1/5, 3, -0.2? -0.2 Let n = 210.58 + -213.58. Let z = -0.2 + -0.3. Which is the closest to 2? (a) z (b) 3/5 (c) n b Let s = 4.1 + -4. Let t = 1.9 - 2.2. Let u(x) = -x + 2. Let j be u(3). What is the closest to j in s, 2, t? t Let j(m) = 2m*3 + 219m*2 - 115m - 550. Let v be j(-110). Which is the nearest to 0.1? (a) v (b) -0.115 (c) -0.05 a Let t = 3.64 - 2.64. Let g = -121 - -121. What is the closest to t in 4, g, 1? 1 Suppose -8d = -74 + 42. Let t be d + 1 + (-144)/28. Let r be (3/2)/(1 + -4). Which is the closest to -2/3? (a) r (b) t (c) 0.1 a Let f be (1232/84 + -15)3/(-2). What is the closest to f in -6/5, 3, -160? -6/5 Let w be 17128/47840 + (-5)/10. Let l = 3/260 + w. Let j be ((-2)/(-12))/(2/8). What is the nearest to -0.1 in -0.3, j, l? l Let j be (5/21)/(1595/58 + -25). Let a = 47 - 187/4. Let v = 23.046 + -0.046. What is the nearest to a in -2, j, v? j Let r(j) = -j*3 + 13j*2 - 2j - 18. Let x be r(13). Let u be x(0 - (-3 + 4)). Let t = 45 - u. What is the nearest to 2 in -1/7, t, -12? t Suppose 0 = -4h - 5h - 2538. Let i be h/9 + (13/3 - 5). What is the nearest to 1 in -5/4, -5, i? -5/4 Let d = -0.05 + -0.25. Let z = -34332/5 + 35124/5. Let w = -159 + z. Which is the closest to 2.5? (a) 3 (b) d (c) w a Suppose 28 = -2k + 8. Let l = -11528 + 11528.1. Which is the nearest to -1? (a) l (b) 4 (c) k a Let r be (12/30)/(2/(-10)). Let d = 843 + -844. Which is the closest to d? (a) 0.5 (b) r (c) 2 b Suppose 3w + 19 = -20. Let g be ((-6)/(-4))/(w/(-182)). Let z = g + -20. Which is the closest to 5? (a) -2 (b) z (c) 0.4 b Let w = 20.2 - 20. Let m = -5.04 + 0.04. Let v = 9 + m. Which is the nearest to v? (a) w (b) 0.4 (c) -3 b Suppose h = -0i - 3i - 19, i = 2h + 3. Let k be (-150)/(-1125) - (-2 - (-32)/15). What is the closest to k in 2/3, -0.4, h? -0.4 Let d = -105.3 + 43.3. Let k = -63.7 - d. What is the nearest to k in 2, 1/6, -0.3? -0.3 Suppose -7n = -2n. Let x = -362 + 362.1. What is the closest to x in 0.4, -5, 2/9, n? n Let g be ((-112)/30)/(-4) - 1. Let u(s) = -s*2 + 26s + 66. Let o be u(28). Suppose 274a - 276a - o = 0. What is the nearest to -2/3 in a, g, -1/9? -1/9 Let h = 9.93 + -10. Let u = -5.2677 + 12.2677. Which is the nearest to u? (a) h (b) -5 (c) 0 c Let m be 23/(-2)(-51 + 2162/47). Which is the closest to -3? (a) 2/15 (b) -2 (c) -1/6 (d) m b Let w = 35.91 + -36.01. Which is the nearest to -2? (a) 4 (b) 1/7 (c) w (d) -3/7 d Let h be (40/(-6))/((-6)/(-9)). Let j = -23 + 21.7. Let y = -0.9 - j. What is the nearest to 1 in y, 3/8, h? y Let d(v) = 3v*2. Let k be d(1). Let n = -72955/3 + 24319. Which is the closest to n? (a) k (b) 2/7 (c) 5/9 c Let s = -633 + 3163/5. What is the nearest to -0.1 in s, -70, -3, -3/5? s Let v = 6679.1 + -6679. Which is the nearest to v? (a) -1 (b) -3/11 (c) 14/5 b Let c = -0.3206 + -0.0354. Let k = -0.056 - c. What is the closest to -0.3 in k, -0.2, -32? -0.2 Let k = -38882 - -38895. What is the closest to k in 9, -1, -2/7? 9 Let j be (-19 - -9) + (-960)/(-110). What is the nearest to j in 5, 2, 3/8, -2? -2 Let t = 748.83 + -743.83. Let h = 20/99 - 2/99. What is the nearest to 2/5 in h, 1/4, t? 1/4 Let q = 5957 + -5958. Which is the closest to 292? (a) q (b) 4 (c) 0 (d) 5 d Let v be ((-96)/168)/((-4)/14). Suppose 4s + 3u = 42, 0s - 5s = 4u - 53. Let o = s - 35/4. Which is the nearest to 0.1? (a) 0 (b) v (c) o a Let g = -759/5 - -4549/30. What is the nearest to -1 in 0.5, g, -26? g Let y = 63.09 + -62.89. Which is the nearest to y? (a) -1/2 (b) 3/2 (c) -3 (d) -63 a Let f = 15276 + -15271. Which is the closest to -4/11? (a) 0.21 (b) f (c) -5 (d) 0.01 d Let i = -4635 + 4635. Let k = 0.37 + 23.63. Let g = k + -24.5. Which is the closest to i? (a) -0.3 (b) g (c) 1/6 c Let x = 0.93 - 1.93. Let m = -25 - -24.4. Let h = -0.7 - m. Which is the nearest to -1? (a) -0.4 (b) h (c) x c Let h be ((-220)/200)/(2/(-5)). Let r = -113/44 +	{ "pile_set_name": "DM Mathematics" }
e 0 = 130g - 88g + 84 for g. -2 Solve -69 - 48 = 39d for d. -3 Solve -31o + 63 = -13o - 225 for o. 16 Solve 2683o - 104 = 2670o for o. 8 Solve -93c - 16c = -18c - 91 for c. 1 Solve -37a = -24986 + 24912 for a. 2 Solve -948w + 904w = -176 for w. 4 Solve 32b - 155b + 385 = -353 for b. 6 Solve 20760 = -26l + 718l for l. 30 Solve 113 = -11l - 22 - 8 for l. -13 Solve 710z + 10477 = -12243 for z. -32 Solve 2145 + 357 = -120a - 258 for a. -23 Solve -40 + 35 = -29r - 5 for r. 0 Solve -10 + 47 - 179 = -71k for k. 2 Solve 1237 = 440u + 3246 + 2391 for u. -10 Solve 199d + 45d + 1324 = 6692 for d. 22 Solve 0 = -110i + 226i - 117i + 11 for i. 11 Solve 65z + 77z = 852 for z. 6 Solve 0 = -72q + 974 - 326 for q. 9 Solve 0 = -4r - 12973 + 12989 for r. 4 Solve 0 = -z - 8382 + 8388 for z. 6 Solve -49v + 708 = -271 + 146 for v. 17 Solve 16 = -444v + 448v for v. 4 Solve 41o - 656 = -108 + 764 for o. 32 Solve 3j - 1920 = 99j for j. -20 Solve 167g + 1287 = 266g for g. 13 Solve -383s = -404s - 21 for s. -1 Solve 26w + 138 = -44 for w. -7 Solve -63i - 86 - 141 = -38 for i. -3 Solve 15294 = 13z + 15359 for z. -5 Solve 41x - 6x + 336 = -84 for x. -12 Solve -94d + 1341 - 151 = 25d for d. 10 Solve 125i - 729 = 279i - 73i for i. -9 Solve 0 = 12u - 26 + 160 - 2 for u. -11 Solve -187x - 4x = 102x for x. 0 Solve -1408 = -480i - 155i + 17642 for i. 30 Solve 67 + 16 = 160n + 4243 for n. -26 Solve 23i + 498 - 149 - 165 = 0 for i. -8 Solve -57n + 57 = -62 + 5 for n. 2 Solve -40 = 294c - 314c for c. 2 Solve 1015o - 1080 = 1150o for o. -8 Solve -3360 = -89y - 191y for y. 12 Solve 161n = 576 + 229 for n. 5 Solve -294q + 276q - 198 = 0 for q. -11 Solve -24m - 10m - 25m + 590 = 0 for m. 10 Solve -362q = -354q + 96 for q. -12 Solve -75t + 510t + 303t = 13284 for t. 18 Solve 0 = -4a - 5a - 613 + 541 for a. -8 Solve 0 = -13x + 3x - 2x + 144 for x. 12 Solve -22t - 90 = 94 - 30 for t. -7 Solve -59 - 70 = -59z + 48 for z. 3 Solve 5229 = 531a + 17442 for a. -23 Solve 5j - 38j + 10j - 437 = 0 for j. -19 Solve -5i = 282i + 74i - 361 for i. 1 Solve -143 = -9f + 33 - 59 for f. 13 Solve l = -17l - 36l for l. 0 Solve -377 + 393 = -2r for r. -8 Solve 1014y - 5498 = 2682 + 8044 for y. 16 Solve 0 = 111t + 120t + 2541 for t. -11 Solve 38x - 540 - 524 = 0 for x. 28 Solve -36 = -19b + 21 for b. 3 Solve 64 - 34 = 3n + 2n for n. 6 Solve 275i = 6680 + 1295 for i. 29 Solve -57h - 109h = -62h - 624 for h. 6 Solve -13b + 8b + 528 = 28b for b. 16 Solve -27t - 21837 + 21918 = 0 for t. 3 Solve 53s + 10 + 24 + 178 = 0 for s. -4 Solve -25j - 3246 + 3096 = 0 for j. -6 Solve 0 = -152o - 888o - 24960 for o. -24 Solve 492t + 22t + 16962 = 0 for t. -33 Solve -3420q = -3338q + 1312 for q. -16 Solve 201z + 386 = -185z for z. -1 Solve 175d + 725 = 30d for d. -5 Solve -46 = -25k + 7 + 22 for k. 3 Solve -10u + 55 = -25 + 20 for u. 6 Solve 569j + 3619 = 137j + 14419 for j. 25 Solve -205n + 152n = -1484 for n. 28 Solve 0 = 85a - 352a + 534 for a. 2 Solve 0n + 2n = -69 + 61 for n. -4 Solve 157a - 219a + 1048 + 192 = 0 for a. 20 Solve 33478 - 1243 = -1167r - 1608 for r. -29 Solve 5007 + 4158 = -705p for p. -13 Solve 3589p - 3628p = -1014 for p. 26 Solve 221p + 643 = -2230 for p. -13 Solve -149g - 2470 = -125 + 2274 for g. -31 Solve -161s - 1540 = -67s - 39s for s. -28 Solve -9v + 4 + 8 = -12v for v. -4 Solve -479 + 247 = -6y - 292 for y. -10 Solve -293j = -638j - 5175 for j. -15 Solve -72p + 913 = -455 for p. 19 Solve 0 = -45p + 11p + 10p + 48 for p. 2 Solve 92l + 17 - 245 = 232 for l. 5 Solve -2740 = 334l + 2123 + 3153 for l. -24 Solve -372n = 296n - 7348 for n. 11 Solve -7z + 84 + 38 = 38 for z. 12 Solve -10h - 35 + 5 = 80 for h. -11 Solve 348g - 365g + 85 = 0 for g. 5 Solve 1556c = 1528c - 280 for c. -10 Solve 38a + 732 = -23a for a. -12 Solve 0 = 358p - 387p + 232 for p. 8 Solve 169 = 14s - 6s + 5s for s. 13 Solve -3835u = -7670u + 3812u - 506 for u. -22 Solve -809 + 710 = 9l for l. -11 Solve 439 + 252 = -81y - 38 for y. -9 Solve -18v + 0 + 124 = 34 for v. 5 Solve -219 = -55w - 18w for w. 3 Solve 51k = -5260 + 6025 for k. 15 Solve 114x = -18x + 65x for x. 0 Solve 722j = 715j + 154 for j. 22 Solve -733875j - 720 = -733923j for j. 15 Solve 19332 - 32041 - 37885 = -1234t for t. 41 Solve -11d + 40 = 73 for d. -3 Solve 228h - 37 = -17 - 20 for h. 0 Solve 0 = 26r + 538 - 96 for r. -17 Solve 6j - 2j + j + 40 = 0 for j. -8 Solve -15 + 280 = 16v - 135 for v. 25 Solve 142 + 41 = -61k - 244 for k. -7 Solve -11 = -50w + 303 - 64 for w. 5 Solve -528x = -651x + 2337 for x. 19 Solve -128s - 75 = -153s for s. 3 Solve 448c + 458 + 10294 = 0 for c. -24 Solve -3t - 120 = -27t for t. 5 Solve 6354 = -17x + 6320 for x. -2 Solve p = 10p - 34 + 88 for p. -6 Solve -265k + 256k - 63 = 0 for k. -7 Solve 22113s = 22122s + 99 for s. -11 Solve -174w = 142w - 646 - 7886 for w. 27 Solve -2461d + 2503d = -252 for d. -6 Solve 15u - 59600 + 59240 = 0 for u. 24 Solve 19z + 4 - 316 = -5z for z. 13 Solve 1202u - 1519u - 10461 = 0 for u. -33 Solve 0 = 568i + 536i - 1168i + 640 for i. 10 Solve -32g + 40g + 24 = 20g for g. 2 Solve 21m - 810 = -4m - 20m for m. 18 Solve 675w = -714w + 9723 for w. 7 Solve 8142q + 1060 = 8195q for q. 20 Solve -324z - 95z = 838 for z. -2 Solve -102r = 79r - 224r + 1419 for r. 33 Solve -72u - 114 = 246 for u. -5 Solve -4180 = 335s - 115s for s. -19 Solve -19j + 291 = 253 for j. 2 Solve 22j - 126j = 832 for j. -8 Solve 38t - 51t - 69t - 328 = 0 for t. -4 Solve 21 = 20h - 99 for h. 6 Solve -27r + 5r + 244r - 444 = 0 for r. 2 Solve 401 = -29f + 115f - 201 for f. 7 Solve -2492h + 264 = -2470h for h. 12 Solve 27s = -89s + 1972 for s. 17 Solve 26c - 374391 = -374131 for c. 10 Solve 98r + 46r = 144 for r. 1 Solve -139c - 7 = -140c for c. 7 Solve -405 - 711 = -124c for c. 9 Solve 249x = -2115 + 123 for x. -8 Solve -40z + 681 - 161 = 0 for z. 13 Solve 760g - 1028 - 4560 = 5052 for g. 14 Solve -452 = 36o - 380 for o. -2 Solve 0 = 1507n - 1451n - 728 for n. 13 Solve -33h + 718 + 137 = 1680 for h. -25 Solve 710 + 558 = -76j + 356 for j. -12 Solve 12044 - 1382 = 726p - 11118 for p. 30 Solve o = -3o - 3o - 56 for o. -8 Solve -101g - 158 = 104g - 773 for g. 3 Solve 9n - 1606 = 28n + 54n for n. -22 Solve 9o + 17o = 34o - 120 for o. 15 Solve -166 = 15a - 361 for a. 13 Solve -56g + 17g = 86g + 1125 for g. -9 Solve 289 = -10g + 379 for g. 9 Solve -207f = 1966 - 1759 for f. -1 Solve 5p - 980 = -1795 + 900 for p. 17 Solve -16z - 131 = -339 for z. 13 Solve -142 - 380 = 87v for v. -6 Solve -18a = -1546 + 1384 for a. 9 Solve 97l = -45l - 10l + 152 for l. 1 Solve -1031 + 2057 = -42m + 4m for m. -27 Solve 4602 - 8514 = -163t for t. 24 Solve -666t - 337 = 320t + 1635 for t. -2 Solve -5 + 109 = 3z - 29z for z. -4 Solve 30 = 1722c - 1677c - 60 for c. 2 Solve 0 = -90d + 193 + 141 + 26 for d. 4 Solve 40j - 30 + 6 = 56 for j. 2 Solve 6a + 6a = 48 for a. 4 Solve -75 = 26j + 6 - 29 for j. -2 Solve -599 - 593 = -149j for j. 8 Solve -572z = -589z + 34 for z. 2 Solve 178b = -1680 - 1262 - 618 for b. -20 Solve 0 = -307f + 336f + 58 for f. -2 Solve 0 = 49v - 68v + 266 for v. 14 Solve -19w + 286 = -0w + 590 for w. -16 Solve -1285i + 1242i - 247 = 613 for i. -20 Solve 86y + 205 + 103 + 36 = 0 for y. -4 Solve 14v + 22 + 12 = -22 for v. -4 Solve -3n - 169n = 1720 for n. -10 Solve 471c - 461c - 60 = 0 for c. 6 Solve -21v + 381v + 4508 = 38v for v. -14 Solve -2891 + 8708 = -375x - 2058 for x. -21 Solve 89g - 77 - 181 = 187 for g. 5 Solve 33n + 535 = 73 + 33 for n. -13 Solve 49n + 1097 = -66n + 177 for n. -8 Solve 537 + 1220 = -119x - 266 for x. -17 Solve -17g - 104 = 14g + 82 for g. -6 Solve 0 = -655h - 313h + 22264 for h. 23 Solve -3768 + 4353 = -65n for n. -9 Solve 5090 = 420q - 4570 for q. 23 Solve -3w - 335 = 319 - 678 for w. 8 Solve 1236 = 389w - 80w for w. 4 Solve -21 - 75 = 8r for r. -12 Solve -330 = -0z + 13z + 20z for z. -10 Solve 202 - 280 = 39l for l. -2 Solve -415n - 4148 - 4152 = 0 for n. -20 Solve -207 = -87*z - 990 for	{ "pile_set_name": "DM Mathematics" }
ple of 40? True Is 183049 a multiple of 36? False Is 14 a factor of 185063? False Is 923 a factor of 35074? True Is 121 a factor of 66649? False Is 8540721 a multiple of 567? True Is 99 a factor of 634095? True Is 16081529 a multiple of 378? False Is 1119794 a multiple of 8? False Is 21326644 a multiple of 15? False Is 12 a factor of 2063364? True Is 17 a factor of 214965? True Does 323 divide 189738? False Is 3 a factor of 182046? True Does 11 divide 187275? True Is 52440 a multiple of 30? True Is 2804856 a multiple of 140? False Does 27 divide 2971999? False Does 45 divide 336416? False Does 65 divide 320449? False Does 17 divide 290598? True Is 18733190 a multiple of 68? False Is 10 a factor of 6121770? True Is 8 a factor of 245534? False Does 274 divide 5214494? True Does 62 divide 3407396? True Does 610 divide 2717548? False Does 16 divide 216870? False Does 489 divide 1746811? False Is 386991 a multiple of 18? False Is 5 a factor of 41715? True Does 57 divide 14752113? True Is 138 a factor of 1876763? False Is 342990 a multiple of 326? False Does 155 divide 241490? True Is 3419141 a multiple of 1051? False Is 68 a factor of 119476? True Is 686742 a multiple of 42? True Does 12 divide 8695703? False Is 624720 a multiple of 411? True Is 792 a factor of 1461407? False Is 145884 a multiple of 6? True Is 29 a factor of 114787? False Does 13 divide 12783480? False Is 3112989 a multiple of 33? True Is 40138 a multiple of 94? True Does 26 divide 237978? True Does 47 divide 783752? False Is 44 a factor of 80968? False Is 148101 a multiple of 35? False Is 237270 a multiple of 21? False Does 26 divide 762320? True Does 245 divide 315070? True Is 67 a factor of 146998? True Is 93412 a multiple of 121? True Is 31 a factor of 2537686? False Is 13 a factor of 1597834? False Is 168 a factor of 50064? True Is 1717326 a multiple of 18? True Is 2735802 a multiple of 87? True Does 115 divide 97290? True Is 1514972 a multiple of 16? False Is 346465 a multiple of 492? False Is 365 a factor of 1460? True Is 12256 a multiple of 19? False Is 374 a factor of 1213273? False Is 3150204 a multiple of 41? False Is 19 a factor of 1145567? True Is 50 a factor of 22887550? True Is 142822 a multiple of 11? False Is 682 a factor of 2030996? True Does 36 divide 3415? False Is 1673 a factor of 2499462? True Does 7 divide 589188? False Is 13 a factor of 62413? True Does 390 divide 4615815? False Does 26 divide 529750? True Is 124 a factor of 325872? True Is 115 a factor of 15527035? False Does 59 divide 966420? True Does 7 divide 1789? False Is 97122 even? True Is 250 a factor of 105000? True Does 202 divide 1516818? True Does 81 divide 1118969? False Does 20 divide 939200? True Does 160 divide 3481453? False Is 156 a factor of 2550526? False Is 11 a factor of 1994100? False Is 23 a factor of 996659? True Is 4 a factor of 7893? False Is 178288 a multiple of 7? False Is 4 a factor of 716697? False Is 470 a factor of 27260? True Is 33 a factor of 925419? True Is 44754 a multiple of 3? True Does 22 divide 3565171? False Is 3 a factor of 115362? True Does 197 divide 10492023? True Is 13 a factor of 5304? True Is 26157537 a multiple of 38? False Is 5 a factor of 976450? True Is 271722 a multiple of 11? True Does 6 divide 2075093? False Is 218 a factor of 33136? True Is 221 a factor of 505250? False Is 15651 a multiple of 7? False Is 19232 a multiple of 8? True Is 54 a factor of 288488? False Is 11059628 a multiple of 44? False Does 21 divide 66672? False Is 9353358 a multiple of 7? True Is 288 a factor of 181728? True Does 4 divide 4032? True Is 181 a factor of 1918238? True Does 203 divide 247051? True Is 205616 a multiple of 24? False Is 391824 a multiple of 24? True Is 140 a factor of 68092? False Is 11 a factor of 3696357? False Is 54 a factor of 13910238? True Is 8 a factor of 4197337? False Is 341255 a multiple of 76? False Is 180 a factor of 928407? False Does 282 divide 4425426? True Is 13 a factor of 2000840? False Does 4 divide 58652? True Is 28475 a multiple of 166? False Is 103306 a multiple of 14? True Does 16 divide 1813360? True Is 350140 a multiple of 205? True Does 309 divide 97026? True Does 310 divide 294346? False Is 17 a factor of 1427575? True Is 429938 a multiple of 454? True Is 19507 a multiple of 17? False Is 10798228 a multiple of 14? True Is 20 a factor of 1914440? True Is 65323 a multiple of 24? False Is 90896 a multiple of 13? True Is 9 a factor of 1459234? False Is 17 a factor of 3308217? True Does 8 divide 17778? False Is 369355 a multiple of 23? False Is 36 a factor of 3600? True Is 13 a factor of 7749963? True Does 18 divide 3800196? True Is 92 a factor of 1295297? False Does 366 divide 219966? True Does 13 divide 9208622? False Is 54 a factor of 1432242? True Is 296935 a multiple of 71? False Is 232500 a multiple of 60? True Is 22 a factor of 224207? False Is 761 a factor of 859930? True Is 962711 a multiple of 13? False Is 100 a factor of 106800? True Is 266 a factor of 1050168? True Is 7 a factor of 1564309? False Is 551 a factor of 2386932? True Is 423 a factor of 2371265? False Is 2239845 a multiple of 15? True Is 51 a factor of 41106? True Is 14441840 a multiple of 140? True Is 77588 a multiple of 326? True Does 173 divide 5659540? False Is 99 a factor of 3380076? False Does 11 divide 606320? True Does 10 divide 2505000? True Is 94236 a multiple of 5? False Does 157 divide 1977447? False Is 192 a factor of 532319? False Does 21 divide 7251279? True Is 2929110 a multiple of 326? True Is 163 a factor of 138775? False Is 251966 a multiple of 31? False Does 18 divide 2150270? False Is 14168 a multiple of 46? True Is 2709291 a multiple of 127? True Is 28 a factor of 119784? True Is 15 a factor of 1631215? False Does 4 divide 33472? True Is 24 a factor of 155650? False Is 123 a factor of 48339? True Is 111328 a multiple of 284? True Does 139 divide 4315438? False Is 1132 a factor of 1293017? False Does 10 divide 5714370? True Does 95 divide 51435? False Is 318879 a multiple of 156? False Is 45 a factor of 149625? True Does 140 divide 11730? False Is 2610 a factor of 19551510? True Is 107472 a multiple of 6? True Is 42499 a multiple of 329? False Is 2208006 a multiple of 14? False Does 13 divide 3618168? False Does 17 divide 4966482? True Is 141 a factor of 3593526? True Does 44 divide 1636578? False Is 86999 a multiple of 175? False Is 10 a factor of 107410? True Does 19 divide 460256? True Is 34 a factor of 2748338? False Does 126 divide 386316? True Does 13 divide 1080638? True Does 1490 divide 629634? False Is 10 a factor of 17870? True Is 1927848 a multiple of 668? True Does 144 divide 15127? False Is 3 a factor of 46151? False Does 48 divide 164210? False Is 134 a factor of 4597257? False Does 71 divide 25362123? True Is 18 a factor of 2550697? False Is 10784356 a multiple of 83? True Is 334776 a multiple of 58? True Is 60 a factor of 8389167? False Is 307470 a multiple of 370? True Is 129720 a multiple of 46? True Is 510701 a multiple of 383? False Is 411992 a multiple of 327? False Is 160 a factor of 608002? False Does 7 divide 190987? False Is 546 a factor of 3039306? False Is 2 a factor of 7225? False Does 34 divide 946281? False Is 54 a factor of 56862? True Is 1818318 a multiple of 120? False Does 36 divide 4295138? False Is 26 a factor of 4232809? False Is 352284 a multiple of 31? True Does 88 divide 2871029? False Does 6 divide 149034? True Is 28 a factor of 503916? True Is 28960 a multiple of 20? True Does 63 divide 32004? True Is 47 a factor of 129624? False Is 462 a factor of 264290? False Is 256490 a multiple of 65? True Does 24 divide 526553? False Is 3198594 a multiple of 88? False Is 713 a factor of 11412401? False Is 1475693 a multiple of 364? False Is 56718 a multiple of 18? True Is 199 a factor of 5350911? True Is 3750969 a multiple of 761? True Is 356839 a multiple of 25? False Is 10 a factor of 185160? True Is 19997 a multiple of 6? False Does 36 divide 309790? False Is 539485 a multiple of 62? False Is 1128219 a multiple of 69? True Is 6669803 a multiple of 272? False Is 78 a factor of 828828? True Is 22 a factor of 6163349? False Is 79 a factor of 374223? True Is 31 a factor of 339075? False Does 30 divide 252541? F	{ "pile_set_name": "DM Mathematics" }
e (-1)/24-1. Suppose u = 4r - 14. Let t be 2(-2)/4-10. Solve 2c = -m - t, -10 + 2 = 5m - rc for m. -4 Suppose -3p - 21 = -0p. Let o(j) = -j - 6. Let k be o(p). Suppose 5z + 2a + 2a = 4, -k = -a. Solve z = 2u - 2r, 7u - 2u + 12 = -r for u. -2 Let g = 208 - 208. Solve -2x - 6 = 4o - gx, 2o - 9 = -5x for o. -3 Let i = -42 - -41. Let u(d) = -d - 7. Let v(s) = -s - 1. Let l(h) = -2u(h) + 14v(h). Let x be l(i). Solve -10 = -y + 4y + 4g, 3g + x = 0 for y. 2 Suppose -19s = -39 - 18. Solve 0b + sb = -3t + 18, 5b = -3t + 22 for b. 2 Let b be (-6)/20(-10 - 0). Solve 0 = 2u + bx - 13, 21 = 4u + 2x - x for u. 5 Let m(n) = 0n + 0n + 7n - 71 + 33. Let b be m(6). Solve bl = -3y + 2 + 3, 0 = 4y + 3l - 2 for y. -1 Suppose -3h = -4g + 4, -g = -0h - h. Solve -3a + n = h, n - 1 + 5 = -a for a. -2 Let v(a) = 29a - 288. Let o be v(10). Solve r - 4 = 3l, 2l + o = 4r - 14 for l. 0 Let p = 0 + -18. Let z be (p/(-1))/(2 + 0). Solve -4c - 11 = 3o - 4, -z = 3c + o for c. -4 Suppose -4s + 14 = -y - 2s, -4y - 4 = 5s. Let z be (-8)/y - 2/(-3). Solve 12 = 4h - zo, -5o = -2h + 5h - 9 for h. 3 Let q(c) = 10c - 45. Let z be q(5). Let i(v) = -v*3 + 3v*2 + 10v + 3. Let t be i(z). Solve y = u + t, 5u - 3u + 5 = 3y for y. -1 Suppose 14s - 13s + 4 = 0. Let h be (-18)/s - (-5)/(-10). Let z = 9 - 9. Solve -5d + 3d + 6 = 2g, 4g - hd - 20 = z for g. 4 Let a = -158 - -229. Let z = 76 - a. Let r be (-6)/(-5)5/2. Solve -rc = -f - z, 5 = f - 0f + 2c for f. 1 Suppose -82 = -29o + 5. Solve -oj + d - 15 = 0, -11j + d = -9j + 10 for j. -5 Suppose g - f - 3 = 4f, -5g + f + 15 = 0. Suppose 5h = gr - 26, h + 6 = r - 0h. Solve m - 4a = -9, -6a + 6 = -rm - 2a for m. 3 Let p = 12 + -18. Let w(r) = r2 + 11r + 7r - 7 - 20r + 6r. Let n be w(p). Solve -3t = x + n, -2x - 5 = 2t - 3 for x. 1 Let j(b) = 14b + 7. Let s be j(1). Suppose -4i = -4g - 3i + s, -4g = -4i - 24. Solve 5z - 41 = 4m, 5m + 3 - 8 = -gz for m. -4 Let r(x) = x + 23. Let n be r(-11). Suppose -2o + n = -5s, -5o + 3s + 17 = -13. Solve -5 = -g, h + 13 + o = 3g for h. -4 Let w be (6/(-9))/(8/(-12)). Suppose 2 = q - w. Suppose 4 = -3k + 5k, r - 4k = -q. Solve -ra - 30 = -3i - 7, 0 = 4i - a - 8 for i. 1 Let a = -38 + 50. Suppose ai - 35 = 13. Solve id = -l + 1 + 3, 2l - d = -10 for l. -4 Let p(a) = -148a - 9. Let x be p(-2). Suppose -98 + x = 9c. Solve 3l + c = 3m, 4l = 3m - 7m - 4 for m. 3 Let p(i) = -i3 + 32i*2 + 71i - 100. Let q be p(34). Solve s = -g + qs - 4, -s = 4g - 4 for g. 0 Let j(k) = k*2 - 17k - 58. Let l be j(20). Solve -2n - lp = 16, 5n + 4p - 3p + 24 = 0 for n. -4 Let w(s) = s - 1. Let f be w(5). Suppose 3 = -n, n + 2 = h - 13. Let k be -1 + h/4 + -1. Solve 5y + x + k = -f, -2x = 5y + 10 for y. 0 Let o be 8 - (9/15 - 28/(-20)). Solve -3l + v = -4, o = -3l + 3v - 0 for l. 3 Suppose 0 = 2t - r - 11, 0 = 5t - 0t + 3r. Suppose -37 = -tb - 3g - 2g, -2b - 12 = -4g. Solve 0 = 2p - p - 5h + 3, bp + 12 = -2h for p. -3 Let b(o) = o*3 + 8o*2 + 6o + 5. Let y(n) = 5n + 13. Let v be y(-8). Let f be v/4 + (-1)/4. Let a be b(f). Solve s + 5k = a, 0 = 5s - 3k + k + 21 for s. -3 Let v(b) = -170b - 334. Let s be v(-2). Solve -2c - 6 = -5p + 4p, 0 = -4p + 2c - s for p. -4 Suppose -7 = -m - p, 4m = 38p - 37p + 3. Solve 5n = mj + 28, -4j = j - n + 24 for j. -4 Let r be 1(-2)/(-6) + (-32)/(-12). Solve -11 = -ro - p, p + 6 - 13 = -2o for o. 4 Let h be 4/(50/6518/45). Solve -3f + 1 = 10, 5b + f + h = 0 for b. -2 Suppose 62 + 60 = -2u. Let o = u - -66. Solve -30 = 5b + os, 3b = -2s - 0 - 13 for b. -1 Let l be -2 + 16/(-4) + 6. Suppose 5r - 3p - 207 = l, -199 = -5r - p + 2p. Suppose 0 = -5n + r - 14. Solve nh = 3f - 13, -3f - 7 = 5 for h. -5 Suppose -3 = -t - 4a + 7a, -5t + 5a = -15. Solve -12h + 4l = -13h - 14, 0 = -h - tl - 10 for h. 2 Let b = 592 + -589. Solve 2f - s + 7 = bf, 0 = 2s - 6 for f. 4 Suppose 0 = -k + 3k + a - 8, 3k + 4a - 7 = 0. Suppose kf = -0f. Suppose f = -0o - 2o + 6. Solve 0 = -5b - 5l - 40, -4l - o = b + 20 for b. -3 Let n = 48 - 43. Suppose -13 = nf - 13. Solve b + 5g = 6, 0 = -fb - b - 2g for b. -4 Suppose 2p - 29 = -5t, -5p - 15 = -0p - 5t. Let d = 8 - 6. Solve 0 = -m - du + 5, 5m - pm = -5u + 13 for m. 1 Suppose 14c - 28 = 210. Solve -5 = l + 4y - c, -3l - 24 = -3y for l. -4 Let g(y) = -y2 + 5y. Let k be g(6). Let s be -6 + 248/40 - (-54)/5. Let c = k + s. Solve cn - 15 = -5x, -x = -5 - 0 for n. -2 Let s = -72 + 48. Let z = s - -32. Solve -4p = -5w - 10, zp - 4p + 6 = -3w for p. 0 Suppose -145 = -4i - 3w, 2i + w - 105 = 6w. Solve 0 = -5y - 4a - i, y + 4a + 8 = 4y for y. -4 Suppose -x = 24j - 29j - 122, -j = -3x + 30. Let g be (2/(-3))/((-1)/39). Let y = g + j. Solve -5k = -yh - 4, -h + k = -0k + 2 for h. -2 Let n(z) = 2z*2 - z - 6. Let x be n(2). Solve -2 + x = 2m - 5c, 3m - 16 = -2c for m. 4 Let l(o) = o3 - 5o*2 + 5o - 9. Let f be l(5). Let z be (f/(-14))/(-4 - 130/(-35)). Solve zq - 2t = 2, -3q + 3t = -t + 6 for q. 2 Let t be (-9)/(-6)172/(-6). Let l = t + 47. Solve -10 = -3o + ly, 0o - o - 3y - 1 = 0 for o. 2 Suppose -6m + 24 = -3m - 2c, c - 23 = -2m. Solve 0 = 2t + 3u - m, -6 = -t - 3u + 5 for t. -1 Let r(k) = 3 - k*2 - 5 + 2k*2. Let s be r(2). Let h be (-3)/(-9) + s/(-6). Solve h = 3z + 2c - 5, -2 = -2z + 3c - 3 for z. 1 Suppose 0 = -5o - 5y + 26 + 9, -5y = -2o + 28. Suppose -op = -6p - 39. Solve -3c - 9 = -2a, 5a = 3c - 4 + p for c. -3 Let b be 4 + 6 - 1 - -3. Suppose b = 2f - f. Solve 0 = -4y + n + f, 4 = -6y + 2y + 5n for y. 4 Suppose 25n + 34 = 134. Solve -4x + 24 = -nc + 2c, -5c + 3x - 32 = 0 for c. -4 Let c(y) = y*2 + 3y - 14. Suppose 0 = -22v + 20v - 12. Let n be c(v). Solve 0 = 4s + o - 5o - 4, -3s - n = 4o for s. 0 Let f(n) = 2n + 80. Let q be f(16). Let a be -1 - -1 - (10 - q/8). Solve 5m = -4d + 45, -m - d = ad - 30 for m. 5 Let x(c) = c*3 + 6c*2 + 5c. Let y be x(-5). Suppose o = 4 - y. Solve u - 2 + o = -j, -4u = j + 2 for j. -2 Let l = -37 + 17. Let u = -18 - l. Solve 3g + 6 = 5b, -g = -0g + 2b + u for g. -2 Suppose -2z + 5n - 1 - 4 = 0, 4n = z + 7. Suppose zs = -3h + 2, 6h - 2 = 8h + 5s. Solve d - ho - 9 = 0, -2o + o - 26 = -5d for d. 5 Let z be 30/(-20) - 14/(-4). Solve -3l + 3i = 18, 3i = -0l + zl + 14 for l. -4 Let g = 37 + -35. Suppose -2n = 3t - 3 - 5, 8 = -4t + 2n. Let q = g - t. Solve -qs = m, -m = -2s - 0m - 4 for s. -1 Let n = -359 + 362. Suppose 6 = 5v - 4. Let p be (-1)/v2 - -3. Solve -3g = nh + 12, -h = -p + 5 for g. -1 Suppose -8i - 6i = -5i. Suppose 2g = -2g + 8. Suppose -3a - ga + 15 = i. Solve -aw - 1 = 3k - 4, 0 = -2w - 4k + 4 for w. 0 Let q(n) = 3n*2 - 38n + 36. Let g be q(15). Let y = -141 + g. Solve -4c - f + 8 = 0, c + 5 = -yc - 2f for c. 3 Let c(h) = -7h*2 - 152h + 46. Let u be c(-22). Let k = 2 + 0. Solve 5p - 1 = -uq, kq + 4 = -3p + 7 for q. 3 Let c(v) = 7v - 30. Let n be c(5). Let g be (20/(-6))/(22/(-165)). Solve 0 = na - g, -a - a + 26 = -4r for r. -4 Let a be (-77)/(-14)1(-8)/(-22). Solve -2 = -4y + 2, 3y - 1 = -ax for x. -1 Let w = 1815 - 1806. Solve 6j - wj = 2c - 13, -j - 9 = -2c for c. 5 Suppose -3b + u + 15 = 0, 0 = 3b - 33u + 37u. Solve -bp + v = -v + 6, 24 = -4p - 4v for p. -3 Suppose -2351v - 32 = -2353v. Solve u + 1 = -5z + 22, 4u + v = 0 for z. 5 Let h = -10 + 11. Let v(j) = 2j*2 + j + 1. Let n be v(h). Solve 16 = -4u + 4q, -u = -nq - q for u. -5 Let c(b) = b + 20. Suppose -4u + 34 = -3m, m + 4u = -3 + 13. Let d be c(m). Let y = -12 + d. Solve 3n + 14 = -s, 4s - n = yn + 19 for s. 1 Suppose 0 = j + 94k - 96k + 8, -4k + 14 = -3j. Solve 0l = l + 2g + 13, jg + 25 = -5l for l. -3 Let n = 33 - 20. Suppose 17m = nm + 40. Solve -a + 1 = -3o, 4o + m = -3a - 0 for a. -2 Let t = 59 - 60. Let f be t/5 + 48/15. Let h(n) = -5n - 3. Let j be h(-6). Solve 4d + z - j = -f, 4z = -3d + 31 for d. 5 Let k = 616 - 613. Solve 3x + kg = -2x + 9, -g - 2 = 0 for x. 3 Suppose -4l + 2w + 38 = 12, -3l + 3 = 4w. Solve -4i + lk - 16 = 0, -3i = -7i -	{ "pile_set_name": "DM Mathematics" }
1 b Which is the closest to 2? (a) 5 (b) -1.2 (c) -4 (d) 4 d What is the nearest to -2/5 in -0.2, -25, 3/2? -0.2 What is the nearest to 0 in -10, -7/2, -3, 1/2? 1/2 What is the closest to -1 in 5, 4, -12? 4 What is the closest to -21 in -3/8, -2, 6, -2/9? -2 Which is the nearest to -0.16? (a) -5 (b) -1/6 (c) -1/7 (d) -4 b What is the closest to -3 in -70, 0.3, -1, 1? -1 What is the nearest to -2 in 2/5, 13/6, -2/3? -2/3 Which is the closest to 22? (a) 5 (b) 2/5 (c) -0.4 a Which is the nearest to -1? (a) -377 (b) 1/3 (c) 3 b Which is the closest to -14? (a) 1 (b) -1/2 (c) 1/2 (d) -1 d What is the closest to -2 in 9, 0.08, -0.2? -0.2 What is the closest to 24 in 1, -3, -1/2? 1 What is the closest to 42/5 in 3, 0.5, -2/7, 4? 4 What is the nearest to -37 in 2.1, 3, 4? 2.1 Which is the closest to 251? (a) -0.5 (b) 2/11 (c) 1/3 c What is the closest to -0.2 in -4, 0.2, -2/15, 2/9? -2/15 Which is the nearest to 3? (a) 1 (b) -0.5 (c) 0 a Which is the nearest to -2/5? (a) 2/19 (b) 4 (c) -45 (d) -5 a What is the closest to 1 in -5, -2/19, 1/5, -8? 1/5 Which is the nearest to 2? (a) 0.3 (b) -1/7 (c) 68/7 (d) 2 d Which is the nearest to -6? (a) 5 (b) 10 (c) 0.3 c What is the nearest to -1/18 in -1, -4, 1, 3? -1 What is the closest to -2/3 in 1/3, 0.1, -6/25? -6/25 Which is the nearest to -1/2? (a) -0.1 (b) -2/59 (c) -4 a What is the nearest to -1/2 in -5/3, 0, 4, 1/5? 0 Which is the nearest to 78? (a) -2/7 (b) 20 (c) -5 b What is the closest to 0 in 2, -64, 0.1, -0.4? 0.1 What is the closest to 0.4 in -3/2, -0.1, 0.5, 1? 0.5 What is the closest to -0.3 in -26, -2/5, -3, 0? -2/5 What is the nearest to 0 in 1/8, 2/23, 5/4? 2/23 Which is the nearest to -1? (a) 1/4 (b) 1/153 (c) -1 c Which is the nearest to -2/7? (a) -1/6 (b) 3 (c) -2/9 c Which is the nearest to -2/13? (a) -1 (b) 3 (c) -2/9 c Which is the nearest to -2/9? (a) 1 (b) 2/5 (c) -0.2 (d) -3/4 c What is the closest to -1 in -1, 2/39, -5, -3/8? -1 Which is the closest to 0.1? (a) 1/16 (b) -1 (c) -3/4 (d) 5 a Which is the closest to -0.05? (a) -2 (b) -6 (c) 1/3 (d) -3/2 c What is the nearest to -0.1 in 0.2, 0.4, -5, 0.02? 0.02 What is the nearest to -0.1 in -2/19, -7, 18, 2? -2/19 What is the closest to 8 in -0.12, 1, -0.2? 1 What is the nearest to 1/4 in 1, -1, 2/3, 5? 2/3 What is the nearest to 2/9 in 4/7, -2/5, -491, 0.5? 0.5 Which is the nearest to -4/3? (a) 3 (b) 0.2 (c) -129 b Which is the closest to 0? (a) -0.4 (b) -2 (c) 3/4 (d) 120 a Which is the closest to 10? (a) -0.2 (b) -0.1 (c) 0.1 c Which is the closest to -0.03? (a) 0.6 (b) 1 (c) 3 a What is the nearest to 2/9 in -4, -0.015, 0.1? 0.1 Which is the nearest to 0.1? (a) 3 (b) -4 (c) 33 (d) 4 a What is the closest to 0.1 in 1/2, -3/8, 2, -2? 1/2 What is the nearest to -1/3 in 0.1, -0.13, -2/11? -2/11 Which is the nearest to -1? (a) 19 (b) -0.5 (c) 0 b Which is the closest to -1? (a) 1/5 (b) 6 (c) -0.091 c What is the nearest to -1 in 5/6, 0.4, 3/2, -2/7? -2/7 What is the nearest to 2/3 in -4, 3/2, 0.2, -1.14? 0.2 Which is the nearest to -25? (a) 0.02 (b) -3 (c) 0 (d) -5 d What is the closest to -4 in 0, 21, -3/8, -4? -4 What is the closest to -4 in 250, 3, 2/11? 2/11 Which is the closest to -3? (a) -1/7 (b) 1/10 (c) -0.2 (d) 2/5 c Which is the nearest to 0.5? (a) 4 (b) 0.6 (c) -24 (d) -0.5 b Which is the nearest to 0? (a) 0.4 (b) 1/2 (c) 40 a Which is the closest to -1/2? (a) 0.2 (b) -4 (c) -1 (d) 17/4 c Which is the nearest to -0.1? (a) -2/5 (b) -5 (c) -1/8 (d) 0 c Which is the nearest to 2/873? (a) -0.4 (b) 5 (c) 1 a Which is the closest to -1/4? (a) -5 (b) 0.3 (c) 5 (d) -4/7 d What is the nearest to 16.3 in 4, 2, -1, 1/2? 4 What is the closest to -0.3 in 0, -1, -2? 0 Which is the nearest to -5? (a) 0.5 (b) 3/2 (c) -0.4 (d) 1/12 c Which is the nearest to 1? (a) -1 (b) -7 (c) -0.1 (d) -2 c Which is the nearest to 1/12? (a) -1/6 (b) -0.2 (c) -8 a Which is the closest to -1? (a) -198 (b) 2/3 (c) -5 b What is the nearest to 1/3 in -31, 1/10, 1? 1/10 What is the nearest to 1/2 in -5, -1.9, 1/5, -1? 1/5 What is the closest to 0 in -0.4, -0.9, -0.08? -0.08 What is the closest to 2/3 in 3, -8/17, 0.4, 5? 0.4 What is the closest to 2/3 in 3.8, -1, -2/13, 2? -2/13 Which is the closest to 1/2? (a) -0.9 (b) 2 (c) 3 a Which is the nearest to -0.3? (a) 2/3 (b) 0 (c) -5 (d) -59 b Which is the nearest to 4/7? (a) -2/7 (b) 0.2 (c) 2 (d) -0.3 b What is the closest to 15 in -22, -1, -2, 3? 3 What is the closest to -2/9 in -0.5, -40, -4? -0.5 What is the closest to 3/4 in 0, -1, -0.4? 0 Which is the nearest to 37? (a) 2/15 (b) -2/5 (c) -71 a Which is the closest to 24? (a) 0.1 (b) -0.5 (c) -1/11 (d) 4 d What is the closest to 1 in -9, -4, -0.04, 2/3? 2/3 Which is the nearest to -0.1? (a) -0.5 (b) -1973 (c) 2 a What is the closest to -4 in -0.033, -5, -4/3? -5 What is the closest to 1 in -30, 1, -0.1, 0.2? 1 Which is the closest to -5? (a) 0.01 (b) 4 (c) -1 c What is the nearest to -1.5 in 29, -5/2, 2? -5/2 What is the closest to 3/7 in -2, 7, 1/2, -5? 1/2 What is the closest to 0.2 in -3, 3, -0.1, -1? -0.1 Which is the closest to -0.1? (a) -6 (b) 2/19 (c) 10 b Which is the nearest to -1? (a) -0.1 (b) 4 (c) -12 a Which is the closest to -2/3? (a) 37 (b) -2/9 (c) -5 b What is the nearest to 1 in -2, -2/3, -1, 4/5? 4/5 What is the nearest to 1/18 in -1, 4/7, -3/5, -4? 4/7 Which is the nearest to 1? (a) -5 (b) -22 (c) 3 (d) -3 c Which is the nearest to -1/3? (a) -0.5 (b) 0.03 (c) 0 a What is the nearest to -1 in 2/9, 2/7, 16? 2/9 What is the closest to 2/3 in 1.6, -1/3, 0? 0 What is the closest to 1/3 in -1, 37, -0.362? -0.362 Which is the nearest to 10? (a) 4 (b) -6/5 (c) 3 a Which is the closest to -2/7? (a) 4 (b) -23 (c) -1/3 c Which is the closest to 1? (a) -4 (b) 0.4 (c) 4/19 (d) -0.4 b What is the nearest to -3 in 4, -0.3, -0.5, 6? -0.5 Which is the nearest to -1? (a) 2/11 (b) 0.05 (c) 2 b Which is the nearest to -2/3? (a) 4 (b) -0.3 (c) -0.06 b Which is the closest to 6? (a) 0.3 (b) 0.08 (c) 1 c What is the nearest to -7 in -4, 4, 65? -4 Which is the nearest to 0.2? (a) -0.5 (b) 4 (c) 0.05 (d) -2 c Which is the closest to 0.11? (a) -2/17 (b) -2 (c) -5/3 (d) 1 a Which is the nearest to -1? (a) 3/4 (b) -1/8 (c) -54 b What is the closest to 1/6 in -0.4, -1, 0.03? 0.03 What is the nearest to -2/7 in -4, 0.4, -0.137? -0.137 What is the nearest to 1/6 in -4, 0.2, -0.5, -1? 0.2 What is the nearest to -2 in 0.1, 7/4, 1, -2? -2 Which is the nearest to 1? (a) 84/11 (b) 0 (c) -4 b What is the closest to -5 in -1/3, -1/7, -0.1, 0.1? -1/3 What is the closest to -0.1 in -1, -1/7, 4, -154? -1/7 What is the closest to 1/4 in 7, -1/2, -0.2? -0.2 What is the nearest to -5 in -11, 5, -0.2, -0.4? -0.4 What is the closest to 5 in 0, -6, 1.5? 1.5 Which is the nearest to 0? (a) 0.2 (b) 70 (c) 0.1 (d) 0.4 c Which is the closest to -1? (a) 38 (b) 2 (c) 2/9 (d) 8/3 c What is the nearest to 2/3 in -5, 0.06, 3/5, 4? 3/5 What is the closest to 3/2 in -0.29, -6, 4? -0.29 What is the closest to -1/3 in -0.077, 3, 4? -0.077 Which is the nearest to 0.05? (a) -2/3 (b) 0 (c) -0.07 (d) -8 b Which is the closest to 7/2? (a) -4/9 (b) -1 (c) -4 a Which is the nearest to -4? (a) 2/5 (b) 2/27 (c) -2/23 c Which is the nearest to -1/2? (a) 43 (b) 2 (c) -2/11 c Which is the closest to -5? (a) -5/2 (b) 14 (c) 4 (d) -0.08 a Which is the closest to -0.2? (a) -2/7 (b) -3 (c) 13 a Which is the closest to -1/23? (a) 3/8 (b) -1 (c) -5/2 a Which is the nearest to 7/2? (a) 5 (b) -1 (c) 0.64 a Which is the closest to -0.1? (a) -0.03 (b) -2/9 (c) -6 a What is the nearest to 2/7 in 1, -0.3, 82, -3? -0.3 What is the nearest to 3 in 0.1, 0.04, -2, 2? 2 What is the closest to -0.1 in 3, -140, 2, 0.5? 0.5 What is the closest to -2/7 in 3/4, 1.6, -1/112? -1/112 What is the closest to 0 in 0, -430/11, 0.3, 0.1? 0 What is the nearest to 28 in -2/5, -5, 0.2? 0.2 What is the nearest to -0.107 in 0.5, 3, 0? 0 What is the nearest to 0 in 3, 2/7, 1, 0? 0 What is the closest to -1 in 4, 0, -9/4, 1/10? 0 What is the nearest to -2/19 in 4, -4, 8, 0? 0 Which is the closest to 1? (a) 1	{ "pile_set_name": "DM Mathematics" }
than -671088? False Are -1 and 6/71055685 equal? False Which is smaller: -127/125005 or -1? -1 Which is smaller: 2026/26127 or -1/2? -1/2 Is 1012011 equal to 1011996? False Are -69 and -11051/163 nonequal? True Do -160344093 and -160344088 have the same value? False Which is smaller: -0.4328 or 3/179? -0.4328 Which is smaller: 48458 or 48409? 48409 Which is bigger: 261/17 or -7/3601? 261/17 Which is bigger: 1 or 9/72902117? 1 Is 0.3 at most as big as -225434.119? False Is -1897/4 >= -133310? True Which is smaller: -4/190832389 or 0? -4/190832389 Which is smaller: 2997 or 0.0652? 0.0652 Which is smaller: -182316506 or -182316507? -182316507 Is 0 equal to -1/1849016606? False Are -1 and -7709721 unequal? True Is 4/2169169935 greater than or equal to 0? True Does 127444049/4 = 31861011? False Is 18835988 at least as big as 18835990? False Are 1404/153293 and 0 equal? False Is 188624726/3 > 62874909? False Is -16.71 bigger than -1/3365? False Which is bigger: -15289489 or -15289456? -15289456 Which is greater: -397 or 1464.1? 1464.1 Which is smaller: 0.22 or 1331590? 0.22 Which is smaller: -44.318 or 2682? -44.318 Is 155/133878 <= 1? True Is 783831081 > 783831082? False Is -20591/5777 > -3? False Which is bigger: 58298/4215 or 15? 15 Which is smaller: 5748820 or 5748823? 5748820 Which is greater: 705169 or -7/64? 705169 Is -1022850 at least -1022852? True Which is smaller: 226343 or 2263417/10? 2263417/10 Is 288945 less than or equal to 288902? False Which is greater: -22767/5935 or -3? -3 Which is bigger: 94120 or 94456? 94456 Is -0.324 != -568.9? True Is -5319 < 258? True Is -412 < -199096? False Is 12370786 greater than or equal to 12370786? True Which is smaller: 8718343 or 8718341? 8718341 Is -130 at most -3030.4? False Is -957269 bigger than -957268? False Which is bigger: 3846 or 2022? 3846 Which is smaller: 1 or -3/6229754? -3/6229754 Which is bigger: 428/7 or -2389.1? 428/7 Which is smaller: 555 or -853419? -853419 Which is smaller: -1 or 4/325013017? -1 Do 14354198/35 and 410120 have the same value? False Are -1587 and -1270 nonequal? True Which is smaller: -168696 or -3205248/19? -3205248/19 Is 36365 < 36314? False Which is smaller: 2/41107243 or 1? 2/41107243 Is 1 > 2/32650371? True Which is greater: 1 or 2/105433561? 1 Is -73 <= -138532? False Is -1 at most 4372/20867? True Is -27/14556340 at most 1? True Is 1 < -90/900319? False Which is bigger: 652/3538819 or 0? 652/3538819 Which is greater: 1342436032 or 1342436033? 1342436033 Is -8310 less than -8346? False Is 2036547 at least as big as 2036548? False Is 0 at most -1804/110051? False Is -4/11147 at most 129? True Is -734805 less than -16900522/23? False Which is smaller: 0 or 2/19382301? 0 Which is greater: 12543 or 12313? 12543 Is 13/2235 >= 1300/11? False Is 21/15356 at least as big as 0.026? False Which is bigger: -14334092 or -14334087? -14334087 Is -6690707 >= -6690708? True Is 191046 greater than or equal to 23? True Is 7881/80690 greater than 1? False Is 1 != -2/464127395? True Is -157381881 greater than or equal to -157381886? True Which is bigger: 3027141 or 3027144? 3027144 Are 1 and -588/10189 non-equal? True Is 862 equal to 580670? False Is 6693 greater than or equal to 1213/8? True Which is greater: 482353 or 482355? 482355 Is -260188 != -260180? True Is -0.054 at least 22858? False Do -8/6541071 and -1 have the same value? False Which is greater: 1 or 2/22203623? 1 Which is smaller: -3267541 or -3267539? -3267541 Which is greater: -15342.649 or 0.3? 0.3 Is -255865 greater than 3/7? False Is -0.2 > -29745340? True Is -37129 greater than or equal to -37807? True Which is smaller: -9662780 or -125616150/13? -125616150/13 Which is greater: 0 or -73/3016780? 0 Are 1078492 and 1078492 unequal? False Is 64170770/51 >= 1258251? False Is 6/30559 greater than or equal to -0.396? True Do -4 and -13979/3594 have the same value? False Which is smaller: 307801 or 309344? 307801 Are 2914817 and 40807421/14 equal? False Is -1213528/43 less than -28221? True Is 6/11 > -227.59? True Is -458963852 <= -458963852? True Which is greater: 4289 or 3804? 4289 Which is greater: -738.2 or -34218? -738.2 Is -8082050 bigger than -8082051? True Is -1/4 at most -13086988? False Is -57931846 bigger than -57931846? False Is 345608 greater than -2632? True Does -4079936 = -4080016? False Is -2822070230 equal to -2822070230? True Is 430297 greater than 430657? False Which is smaller: 54450 or 54342? 54342 Which is smaller: -647 or -65647.6? -65647.6 Is 4621 greater than 3924? True Is -24175730 not equal to -24175728? True Which is greater: -6/49 or 1766896? 1766896 Which is greater: 8/129 or -117/1652? 8/129 Which is greater: -0.16635666 or -2? -0.16635666 Which is smaller: 4763716 or 4763722? 4763716 Which is smaller: -2/533005283 or 0? -2/533005283 Which is bigger: 226458 or 226453? 226458 Does -2/139740195 = 1? False Which is bigger: -25 or -98997/3874? -25 Which is smaller: -5403005 or -5403024? -5403024 Which is smaller: 419844 or 422194? 419844 Is 3 at least as big as 11901/2806? False Which is smaller: 1300382 or 1300393? 1300382 Which is greater: 10962474 or 10962465? 10962474 Which is smaller: -0.075 or -19.42? -19.42 Which is smaller: 338181015 or 338181016? 338181015 Does 8/4743 = -40? False Is -25/5999728 equal to 0? False Are 1351557/31 and -1/8 non-equal? True Does -62 = -1618280? False Are -54 and 16744 equal? False Is 34165651 smaller than 34165651? False Are -563811/257 and -2193 non-equal? True Do 312/3093733 and 0 have the same value? False Which is greater: 16305166 or -3? 16305166 Is -37 >= 245822? False Which is greater: -5206 or -5849? -5206 Are 282444 and 12 nonequal? True Which is bigger: 135305 or 135310? 135310 Is 50.94 < -461? False Do -4941138 and -3/5 have the same value? False Is 0 equal to 2/1177362975? False Is 15606783 != -0.1? True Which is greater: 52949923 or 52949922? 52949923 Which is smaller: 1610 or 4429? 1610 Is -1 != 13/43893608? True Is 121599 at most 1823981/15? False Is -2343446 > -2343445? False Is -1/7 not equal to -3/12850342? True Does -1137951 = -1? False Is -0.082 less than or equal to -2439516? False Are -4315582 and -4.3 equal? False Which is smaller: -239681 or -239737? -239737 Is -5610 > -3379? False Which is bigger: -2 or -4685/2492? -4685/2492 Which is bigger: -36988 or -36573? -36573 Which is bigger: 118075 or 117605? 118075 Which is smaller: -505 or -35024? -35024 Which is greater: 2/1349727571 or -1? 2/1349727571 Which is smaller: 5331 or -929? -929 Is -3 smaller than -12754876? False Which is greater: -3970942 or -3970951? -3970942 Which is smaller: -28129/97 or -289? -28129/97 Are -105 and 86729 nonequal? True Which is bigger: 37812 or 34424? 37812 Which is smaller: 26656505 or 26656508? 26656505 Which is bigger: -156702 or -156818? -156702 Which is bigger: 1 or 26/50009? 1 Is 15146941 less than 15146945? True Which is greater: -5 or -14180/2577? -5 Which is bigger: -4407754 or -4407755? -4407754 Which is smaller: -1908067 or -15264529/8? -1908067 Which is bigger: -1 or 6685924/9? 6685924/9 Which is smaller: -14 or 19357446? -14 Which is greater: 2 or -11669712? 2 Which is bigger: 0 or -754.27465? 0 Which is smaller: 4515/2 or 7401? 4515/2 Is 15/368 != 1026? True Which is smaller: -8736 or -2035? -8736 Is -100407 equal to -98195? False Which is bigger: 0.1 or -195985475? 0.1 Which is smaller: 4/7 or 9084815? 4/7 Is -885104 less than or equal to -885103? True Which is smaller: -44765 or -44757? -44765 Which is bigger: 0 or 12590893? 12590893 Is 0 equal to 14/25076809? False Is -165196/687 less than -241? False Which is bigger: 1/42928658 or 1? 1 Are 2389137/7 and 341305 equal? False Which is greater: -4/45 or 38499? 38499 Are 1/2 and -1530/21433 unequal? True Which is smaller: -4/271533089 or 0? -4/271533089 Which is smaller: -1 or -53/19201524? -1 Which is smaller: 10256 or 3497004/341? 3497004/341 Which is bigger: -1871 or 7161? 7161 Which is smaller: -7192773 or -21578318/3? -7192773 Which is greater: 11/1804598 or 0? 11/1804598 Is 1/303059370 at most -1? False Which is greater: 2850 or 505? 2850 Is -15/434 bigger than 31/194? False Is 840 bigger than -292.73? True Which is greater: 49980 or 48315? 49980 Which is bigger: -7294 or 26	{ "pile_set_name": "DM Mathematics" }
Suppose 9c - 108 = -81. Is 4/(-10) - ((-9387)/35)/c composite? False Let w(c) = -28467c + 983. Is w(-2) prime? True Suppose 4295237 = -44c + 361c + 390114. Is c a composite number? True Let i(k) = -955k3 + 6k*2 - 31k + 27. Is i(-8) prime? False Let b(x) be the second derivative of 29x4/12 + 3x*2/2 - 2x. Let f be b(-2). Let d = f + -30. Is d composite? False Let s be -123 + ((-21)/4 - 15/(-60)). Let f = s - -12051. Is f composite? False Suppose -3o + 23 = 2x, -3x + 26 + 1 = 3o. Suppose -6d + x = -8d, -d - 660 = -2q. Is q composite? True Suppose 7b = -0b + 2b. Suppose 2n + 5v + 0v - 22 = b, 3 = -n + v. Is -447(0 - -1)(n - 2) a composite number? True Suppose 1441205 = 3o + 4a, 3a + 9490 = 5o - 2392470. Is o a composite number? True Is (2/6)/(-12 - (-923)/78) - -410929 prime? False Is (-1319004)/(-23) + -4 + 19 composite? True Let k(w) = -2w*3 - 6w + 9. Let o be k(-6). Suppose 2p = -5v + 4v + o, -v + 501 = -4p. Is v prime? False Suppose -4027v + 36 = -4031v. Let l(m) be the second derivative of -3m3/2 + 3m*2 + m. Is l(v) a composite number? True Suppose 16 = -4b, 5s - 11b + 13b + 458 = 0. Let o = s + 90. Suppose o = -4t + 17t - 1339. Is t prime? True Let m(a) = 687a*2 + 3a + 3. Let q be -4 + (21/4 - (-15)/20). Is m(q) composite? True Let a(g) = -2092g + g3 - 31 + 18g*2 + 4176g - 2104g - 2g*3. Suppose 5o - 20 = 45. Is a(o) a prime number? False Let x = 195504 - 99365. Is x a composite number? True Let m(t) be the first derivative of -7t2/2 - 4. Let i be m(-1). Suppose 0 = -iy + 2396 + 362. Is y prime? False Let r(g) = -2g3 - 31g*2 - 15g + 13. Let d be r(-15). Suppose di = 18i - 29245. Is i prime? True Let l = -16 - -24. Let w(z) be the first derivative of z*3 - 3z*2/2 - 9z - 95. Is w(l) composite? True Let h be 2105/((-7)/(-6 - 1)). Suppose 0 = -2g + h + 1841. Is g a prime number? True Suppose 15m = 58m - 2029901. Is m a composite number? False Suppose -3u = -10360 + 1534. Suppose 0 = -435b + 437b - u. Is b a composite number? False Let k be ((-4944)/4 - 4)-4. Suppose -9a + 14a = k. Is (1/4)/(8/a) prime? True Suppose -2a + 209841 = -132q + 137q, -104898 = -a - 7q. Is a a prime number? True Let x(y) = 3y*2 - 8y - 2. Let f(h) = h*3 - 2h + 7. Let z(b) = 8b - 40. Let g be z(5). Let u be f(g). Is x(u) a composite number? False Suppose 4g - 63016 = -3d + 1309359, -457470 = -d + g. Is d prime? False Let h(u) = -2u*2 + 8u. Let w be h(4). Suppose w = -12a + 7a + 10. Is a/(-4) - (-2835)/14 a prime number? False Suppose -15 = -3t, 1174 = 5c - 4t - 561. Let x = 547 - c. Let h = x + 601. Is h a composite number? False Let n = -11523 - -31112. Is n composite? True Let f = 10682 + -17508. Let i = 3036 - f. Is i composite? True Let r(k) = 11644k*2 - 7k. Is r(-1) composite? True Let b(p) = 3p + 25. Let o be b(-7). Suppose 5c + ot + 6 - 41 = 0, 3t = 4c + 3. Suppose 0 = -cm + 6m - 2631. Is m prime? True Let n = 4431354 + -2616497. Is n a prime number? False Let p be ((-48)/(-40))/((-4)/(-10)). Suppose -10245 = -5k - 5u - 2695, 7556 = 5k + pu. Is k prime? False Let t be -32255/(-9). Let c = 409 - 512. Let z = c + t. Is z a composite number? False Let w(y) = 47y*2 + 26y + 121. Let a be w(-9). Let s = a - 2292. Is s composite? True Let a(z) be the first derivative of 65z2/2 + 7z - 11. Let x be a(-6). Let q = x - -876. Is q prime? False Is -11(-2)/111 - -71177 a prime number? True Let c be (-9)/(-15) - (-51)/15. Suppose 16 = co, -o - 1575 = -z - 3o. Is z composite? False Let w be (-27)/(1620/24) + (-102)/(-5). Suppose -66094 = wt - 22t. Is t a composite number? True Suppose 5i - 107 = 2v + 86, 2i + 4v = 82. Suppose 33q = iq - 64842. Is q composite? True Let q(w) = w2 - w. Let r(k) = 3k*2 - 11k + 4. Let y(j) = 4q(j) - r(j). Is y(6) a prime number? False Suppose 11u = 744416 + 175679. Is u a prime number? False Let a(z) = 15z2 + 25z + 1207. Is a(54) a composite number? True Let s = -253935 - -401854. Is s composite? False Is 0 - 1-64439 - (-484)/121 a prime number? False Let f(o) = 136o*2 - 15o. Let c be ((-3)/18-3)/(2/28). Is f(c) a composite number? True Let g(z) = -59z - 45 + 69z + 102z*2 - 24z*2. Is g(7) composite? False Is (11 + -732916)(-2 + (-27)/(-15)) composite? False Suppose -5r - 41 = -4t - 6, 0 = -t + 2r + 11. Suppose td - 20 = -y, y - 2 + 9 = 4d. Suppose -y = -5c, 5c = -4q + 3c + 24270. Is q a prime number? True Suppose 137307 = -100u + 538007. Is u a composite number? False Suppose 11u = 13u - 30. Let i be ((-21)/4)/((15/4)/u). Let x(s) = -s*3 - 16s*2 + 41s - 5. Is x(i) a composite number? True Suppose -308110 - 78296 = -9a. Is a a prime number? False Let r(z) be the second derivative of z5/20 - 13z*4/12 + 11z*3/3 + 31z*2/2 - 55z. Is r(16) a composite number? False Suppose 125a = 112a + 657007. Is a prime? True Suppose 41459 + 5712 = 3f - 2u, -78655 = -5f - 4u. Is f composite? False Let i = -39 + 43. Suppose 0 = -0t - it + 2368. Let r = 899 - t. Is r composite? False Let s(k) = -8 + 4 + 5 + 2 - 68k. Is s(-6) prime? False Is (-60)/(-45) - (-558895)/15 a composite number? True Is (4/(-2))/(-10 + 463728/46373) prime? False Let r be 4/16 + -1(-23)/4. Suppose 2p = -4 + r. Is (380/2 - 1) + p + 1 a composite number? False Suppose 932786 = 11810n - 11772n. Is n composite? False Suppose -4d + 523 = 31. Let f(i) = 694 + 5i + 172 - d. Is f(0) prime? True Suppose -f + 20575 = -3x, -19f - 41156 = -21f + 5x. Is f a prime number? True Let z(q) = 0 - 8 + 3 + q + 0. Let x be z(9). Suppose -3165 = xs - 7s. Is s a composite number? True Let s be (-8 - -9)/(4/8). Is (-161095)/(-35) + s/7 a prime number? True Let l = 1580 + 2454. Is (-2)/(-52)l + (-24)/156 a composite number? True Let g(k) = -2818k + 1525. Is g(-12) composite? True Let k(i) = 1. Let l(d) = -258d + 147. Let j(t) = -4k(t) + l(t). Is j(-7) a prime number? True Let i be (-5)/15(-3 + -21). Let n(a) be the second derivative of 23a3/3 + 5a*2/2 + a. Is n(i) prime? True Suppose 4t = -4t - 24t + 8828192. Is t composite? False Suppose 4p - 1439524 = 2s, 3p - 45s - 1079658 = -41s. Is p a composite number? True Let f(y) = -2y*3 + 2y*2 + 5y - 6. Let p be f(2). Let n be (p/8 - 0)6. Is -3 - (n/1 - 1049) composite? False Let k(h) = -h3 - 8h*2 + 6h - 15. Let f be k(-9). Let d(y) = -30 + 7y + 37 + 2y*2 + fy*2. Is d(10) prime? False Let h be -2 - ((-7)/((-14)/(-12)) + 0). Suppose hk + 1346 = 474. Let s = 33 - k. Is s prime? True Let t = -1747 - -4064. Is t a composite number? True Let q be (4/3)/2(-60)/(-8). Suppose 0 = -2p - qh + 3438, 2p - 4050 + 618 = -2h. Suppose 4w - 4y + 106 = p, -y + 1226 = 3w. Is w composite? True Let a(z) = 2z + 48z*2 - 9 - 83z*2 + 3. Let m(c) = 141c*2 - 7c + 23. Let v(t) = -9a(t) - 2m(t). Is v(3) composite? False Let z(u) = 27u2 - 6u + 8. Let q = 49 + -47. Suppose 6p + qj - 30 = 2p, 2p = -4j + 30. Is z(p) composite? False Let i = 1399 + -351. Let y = 2191 - i. Let x = y + -706. Is x a composite number? True Let p = 32 + -15. Suppose -p = -3x - 2. Is (-23981)/(-6) + x/30 a prime number? False Let x(r) be the third derivative of r6/120 + r5/20 - 7r4/8 - 8r*3/3 + 11r*2. Let c be x(11). Let a = c - 978. Is a a prime number? False Suppose 18s - 22897 - 48743 = 0. Suppose -u + a + s = 2a, -4a + 7966 = 2u. Is u composite? True Suppose 5y = u + 7217, -3u - 3y - 10191 - 11478 = 0. Let w = 12044 + u. Is w a prime number? False Let i = 22 + -18. Suppose 0 = ik - 3138 - 14426. Is k composite? False Let d(n) = -21n - 20. Let m = -41 + 33. Let z be d(m). Let i = z + -102. Is i a prime number? False Let i(s) = 340s - 36. Let o be i(4). Is o/(6/(-120)-16) a composite number? True Suppose -v - 6h = -h - 4702, -4h + 4703 = v. Suppose -v = -3j - 2l + 5l, 3l = j - 1565. Is j a prime number? True Let a(b) = 2036b + 978. Is a(20) composite? True Let d = 11835 + -186. Suppose -8z + d = -4967. Is z prime? False Let x(k) = -k*3 + 6k*2 + 8k - 11. Let w(l) = -l*2 - l. Let i(z) = 3w(z) - x(z). Let u be i(10). Is -1275/5(-1)/u a prime number? True Let s(c) be the second derivative of 608c4/3 - 5c*3/6 + 11c**2	{ "pile_set_name": "DM Mathematics" }
4/(-26))24. Solve -48/7f*2 - 64/7f - 16/7f3 - d - 2/7f*4 = 0. -2 Let a = -1561 - -1561. Find f such that -2/5f*3 + 0f + 0f2 + a = 0. 0 Let g(n) be the second derivative of -10n*4/3 - 25n*3/6 + 15n*2/2 + 97n. Factor g(v). -5(v + 1)(8v - 3) Let w(x) be the second derivative of 0 - 12x + 1/3x3 + 0x*2 - 1/6x*4 + 1/15x*6 - 1/10x*5. Factor w(o). 2o(o - 1)2(o + 1) Let i = 137 + -133. Let s(m) be the third derivative of -5m2 + 1/600m*6 + 0m*3 + 0m + 0 - 1/120mi + 0m*5. What is a in s(a) = 0? -1, 0, 1 Factor -46/17 - 2/17j*2 - 48/17j. -2(j + 1)(j + 23)/17 Let z = -4362 - -4364. Let -4/5q3 + 0 - 8/5q*z + 4/5q*4 + 0q = 0. Calculate q. -1, 0, 2 Let q(p) be the second derivative of p7/10080 + p6/2880 - p*4/12 + 7p. Let j(s) be the third derivative of q(s). Factor j(l). l(l + 1)/4 Factor -84 + 117a + 5a2 - 4a*2 - 37a + 3a2. 4(a - 1)(a + 21) Factor -7/3b*2 + 0b + 0 - 1/3b5 - 3b*4 - 5b3. -b2(b + 1)2(b + 7)/3 Let j(y) be the second derivative of 2y7/105 - 2y*6/15 + 4y*5/15 - 43y*2/2 + 30y. Let g(b) be the first derivative of j(b). Let g(n) = 0. Calculate n. 0, 2 Suppose 2j = -2l + 14, -l - 14 = 2l - 4j. Let b(w) be the second derivative of -2w + 3/8w*l + 0 + 1/16w*4 - 1/4w*3. Determine r, given that b(r) = 0. 1 Suppose 10p - 40 = 6p. Let o be 3/p(-2 + (0 - -10)). Solve ox2 + 64/5 - 48/5x - 1/5x3 = 0. 4 Let g(s) be the third derivative of -s8/6720 - s7/1680 + s6/360 + s5/60 + 8s*3/3 + 23s*2. Let m(d) be the first derivative of g(d). Factor m(u). -u(u - 2)(u + 2)2/4 Suppose -15 = -2s - 3j, -s - 194j + 7 = -193j. Suppose -3/4r*2 + 9 - sr + 3/4r3 = 0. What is r? -3, 2 Let m(z) be the second derivative of 0z*3 + 0z*2 + 0 - 25/12z*4 - 1/2z*6 + 4z - 4z5. Solve m(q) = 0. -5, -1/3, 0 Let s = 2119/22 - 1054/11. Factor q3 + 0 - sq*2 - 1/2q. q(q - 1)(2q + 1)/2 Let z(o) = 4o*5 - 72o*4 + 172o*3 - 152o*2 + 40o. Let x(t) = t*5 - 24t*4 + 58t*3 - 51t*2 + 13t. Let i(j) = -8x(j) + 3z(j). Factor i(h). 4h(h - 2)*2(h - 1)2 Let n(w) = w3 + 6w2 + 5w - 10. Let h = 16 - 20. Let v be n(h). Determine m, given that -1/4m - 1/8 - 1/8m*v = 0. -1 Solve 10v4 - 32 - v5 + 35v - 32v2 - v5 + 9v - 8v*3 + 20v = 0. -2, 1, 2 Let f(y) = 5y2 - 30y + 2. Let n be f(6). Let r(g) be the second derivative of -3/2gn + 5g - 3/20g5 - 3/4g*4 + 0 - 3/2g*3. Factor r(l). -3(l + 1)*3 Let c be (-2125)/(-34) + (-1)/((-2)/4). Let b = 66 - c. Determine h, given that 1/2h*2 + 1 - bh = 0. 1, 2 Suppose -75o - 25 + 88 = -87. Factor -7/2r*2 - o - 8r. -(r + 2)(7r + 2)/2 Let z(k) be the third derivative of -5/21k3 + 0k + 0 - 1/24k4 - 15k*2 - 1/420k*5. Factor z(m). -(m + 2)(m + 5)/7 Let b = 7/332 + 1223/4980. Let z(r) be the second derivative of 0 - 1/3r3 - 1/21r*7 - 2/3r*4 + 0r*2 - 7r - 3/5r5 - br*6. Factor z(v). -2v(v + 1)4 Find x such that -220/9x*2 + 4/9x*5 + 8x + 0 - 28/3x4 + 76/3x*3 = 0. 0, 1, 18 Let k(w) be the third derivative of 0w - 1/78w5 - 4/39w*3 + 0 - 10w*2 - 2/39w*4 - 1/780w*6. Factor k(q). -2(q + 1)(q + 2)2/13 Let k(h) be the third derivative of -h7/525 - 3h*6/25 - 194h*5/75 - 96h*4/5 - 1024h*3/15 - 782h*2. Solve k(p) = 0. -16, -2 Suppose 2x - x = -3x. Factor -3/7k*4 + 0k + 6/7k2 + xk*3 - 3/7. -3(k - 1)*2(k + 1)*2/7 Let m = 7 + 21. Factor 4z*3 - 20 - mz*2 + 4z + 3z + 17z + 20z. 4(z - 5)(z - 1)2 Factor -88/5i*2 - 14/5i*3 - 30i - 36/5. -2(i + 3)2(7i + 2)/5 Let l be 1 - (-2)/(-6) - (-326)/(-300). Let d = 2/25 - l. Let 0 - dh - h*2 + 3/2h*3 = 0. Calculate h. -1/3, 0, 1 Let o(l) = l + 1. Let d be o(1). Factor -3w*3 - 8w - 10w2 - 4w + 14wd + 11w*2. -3w(w - 4)(w - 1) Let x(d) be the second derivative of 7/1440d6 + 0 + d3 + 0d*2 + 0d*4 + 1/240d*5 + 9d. Let h(m) be the second derivative of x(m). Factor h(o). o(7o + 2)/4 Let -10/9y + 2/9y*2 + 4/3 = 0. Calculate y. 2, 3 Suppose 504t*3 - 304t*2 - 359t*2 - 121t*2 - 2t*5 - 60t*4 + 4t*5 = 0. What is t? 0, 2, 14 Let i(f) = -5f + 15. Let q(b) = -16b + 46. Let p(x) = -10i(x) + 3q(x). Let g be p(7). Determine u so that -1/3u*g + 2/3u*3 + 0u + 0 = 0. 0, 1/2 Let m be ((-6)/(-55))/(6/20). Suppose 0 = 22x + 66x - 182 - 170. Determine t, given that 6/11tx - mt*3 + 0t*2 + 0t + 0 = 0. 0, 2/3 Let r(q) = -7q2 - 11q + 7 + 2q3 - 3q*2 + 3 + 3q. Let x be (2 - 1)(4 + -5). Let u(z) = -z2 - z + 1. Let d(k) = xr(k) + 6u(k). Factor d(l). -2(l - 2)(l - 1)(l + 1) Suppose 5i + 27 + 3 = 0. Let h(f) = 6f*3 + 8f*2 + 7. Let y(c) = 5c*3 + 7c*2 + 6. Let u(t) = ih(t) + 7y(t). Find r such that u(r) = 0. 0, 1 Let u be 3 + (-1 - -5) + -7. Let x(q) be the second derivative of u - 1/18q*4 + 1/90q*6 - q + 0q*3 + 1/6q*2 + 0q5. Factor x(i). (i - 1)2(i + 1)2/3 Let q(a) be the first derivative of -2/17a*2 + 7/34a*4 + 41 - 10/51a*3 + 0a. Let q(k) = 0. What is k? -2/7, 0, 1 Let o = -123/637 + 17/49. Factor 2/13t4 - 4/13t*2 + 4/13t*3 - 2/13t*5 + 2/13 - ot. -2(t - 1)3(t + 1)2/13 Let r(y) be the second derivative of -y4/6 - 20y3/3 - 64y*2 + 161y. Factor r(a). -2(a + 4)(a + 16) Solve 14/5j + 0 + 2/5j*2 = 0 for j. -7, 0 Factor 1/5u*3 - 14/5 - 16/5u*2 + 29/5u. (u - 14)(u - 1)2/5 Let z(l) be the second derivative of 0l*2 + 0l3 - l6 + 5/42l7 - 7l - 5/3l4 + 9/4l*5 + 0. Find x, given that z(x) = 0. 0, 1, 4 Determine j, given that 4/17 - 50/17j + 4j2 - 22/17j3 = 0. 1/11, 1, 2 Let a(v) = v3 - 6v2 - 7v + 1. Let k be a(7). Suppose 6 = 2y + 4x, 3x - 14 = -5y + k. What is g in -2/3gy + 0g + 1/3g4 + 0 + 1/3g*2 = 0? 0, 1 Let m be ((-2)/(-5))/((-2)/(-10)). Suppose 3q*2 + 2q - 8q - q - mq = 0. Calculate q. 0, 3 Let a = -21 - -23. Suppose 0 = 4j + 4, -3u + aj + 3 = -5. Let -4/3x*4 + ux*5 - 4/3 + 2x + 8/3x2 - 4x*3 = 0. What is x? -1, 2/3, 1 Let 6f*3 + 74 - 30f - 82 + 0f3 - 16f*2 = 0. Calculate f. -1, -1/3, 4 Let i = -2872733/9 + 318867. Let n = i + 326. Determine b, given that -2/9b - 2/9b5 + 4/9b*2 - 2/9b*4 - 2/9 + nb3 = 0. -1, 1 Factor x3 + x*3 + 16x - x*4 + 11x*2 - 18x - 10x. -x(x - 4)(x - 1)(x + 3) Suppose 128h - 122h - 120 = 0. Suppose -2q + w + 3w = -h, q + 4w = -20. Let -2/13u*3 + 0u + 4/13u2 + q = 0. Calculate u. 0, 2 Suppose -2l = -4 - 4. Suppose -2r = -5r - 6, -4m - 4r = -l. Factor 1/3sm - 1/3 - 1/3s + 1/3s2. (s - 1)(s + 1)*2/3 Suppose -5w + 84 = 7w. Suppose 12h = wh. Determine g, given that h + 1/2g*3 + 1/6g*4 + 0g + 1/3g2 = 0. -2, -1, 0 Let f(c) be the first derivative of 2c*6/3 + 8c*5/5 - 2c*4 - 16c*3/3 + 2c*2 + 8c - 66. Let f(n) = 0. Calculate n. -2, -1, 1 Let u(c) be the second derivative of -c7/336 - c6/60 + 5c4/48 + c3/48 - 3c*2/8 - 384c. Determine l, given that u(l) = 0. -3, -2, -1, 1 Let -34s + 226s + 1294 + 141 + 869 + 4s2 = 0. What is s? -24 Suppose -3n + 11 = -13. Suppose 4d + 4f = 6 + 2, -4d - 2f + n = 0. Determine l so that 2l3 - 3l*4 + 3l*3 - 8l*3 - 3l*d + 3l + 6l4 = 0. -1, 0, 1 Let h(l) = -20l*2 - 120l + 40. Let q(c) = 5c2 + 30c - 11. Let y(r) = -6h(r) - 25q(r). Factor y(p). -5(p - 1)(p + 7) Let n(u) be the first derivative of u7/840 - u6/90 - u*5/24 - 14u*3/3 - 15. Let j(q) be the third derivative of n(q). Factor j(i). i(i - 5)(i + 1) Let z(s) = -s3 - 5 + 4s*2 + 5 - 2s + 4 - 4s. Let f be z(2). Find x, given that 6/5x + 3/5x2 + f = 0. -2, 0 Suppose 0w - 13 = -3a + 5w, -a = -5w - 11. Factor -3 + 5 - 9 + 3g + 3g2 + a. 3(g - 1)(g + 2) Let t be (-1 - -2)(1 - -1)1. Let 4z*t + 28/5z*5 + 0 - 4z*4 - 36/5z*3 + 8/5z = 0. Calculate z. -1, -2/7, 0, 1 Let r(z) be the third derivative of 1/96z4 + 8z*2 + 1/480z*6 + 0 + 0z + 1/120z5 + 0z*3. Factor r(t). t(t + 1)*2/4 Let r(o) be the first derivative of 0o + 10/9o3 - 2/3o*5 + 1/3o*4 - 2/3o*2 - 35. Suppose r(x) = 0. What is x? -1, 0, 2/5, 1 Let r be 16/((-48)/9) + 7. Factor -2/15b*3 + 0b + 0b2 - 2/15b*r + 0. -2b**3	{ "pile_set_name": "DM Mathematics" }
t = -94, 4t - f = -0b - b. What is the greatest common divisor of b and 184? 46 Let k = -86 + 141. Let d be (84/(-8))/((-1)/2). Let a = -10 + d. Calculate the greatest common divisor of k and a. 11 Suppose -98n - 840 = -106n. What is the greatest common divisor of n and 45? 15 Let t(s) = 4 + 0s + 0 - 2s + 3s. Let q be t(7). Calculate the highest common factor of q and 121. 11 Let y be (0 + 1 - 0)-2. Let f be y + 2 + (-8)/(-4). Suppose 0 = -s + 4o + 2, 0 = 2s + o + 2o - 59. Calculate the greatest common divisor of f and s. 2 Suppose -3p + 2d = -1087, -1 = 5d - 6. Suppose 7l = p - 13. Calculate the greatest common factor of 25 and l. 25 Let u(l) be the second derivative of 7l3/3 + l2 - 17l. Let o be u(2). What is the highest common divisor of 50 and o? 10 Suppose -4590 - 975 = -53s. Let w = 35 - 20. What is the highest common divisor of s and w? 15 Suppose 0 = -3f + 6f - 459. What is the greatest common factor of f and 68? 17 Suppose 26y - 2166 = 20y. Calculate the greatest common divisor of y and 38. 19 Let g(v) = -8v3 - 17v*2 - 11v - 9. Let k be g(-5). What is the highest common factor of 46 and k? 23 Suppose 3n - 8n + 110 = f, 2f = 4n + 178. Let s be 16/(-12) - 1/(-3). Let b be 1 - -17 - (0 + s). What is the highest common factor of f and b? 19 Let d = 16 + -6. Suppose 0 = 2l - 24 - d. Let c = 145 + -9. What is the highest common factor of l and c? 17 Let r = 1388 + -1163. Calculate the greatest common divisor of 180 and r. 45 Let t(x) = 3x*2 + 18x - 180. Let a be t(6). Suppose h - 8 = -2g + 6, 5h - 5g = 145. Calculate the greatest common factor of h and a. 12 Let t(w) = -2w*2 + 19w + 6. Let f be t(9). Suppose -4n + f + 21 = 0. What is the greatest common factor of 27 and n? 9 Let u be 5/5 + (55 - -8). Calculate the highest common factor of u and 832. 64 Let g(f) = -7 + 4f + 4f + f2 - 7f. Let j be g(0). Let t = 10 + j. What is the greatest common factor of 15 and t? 3 Suppose 4s - 138 = 2h, 9 = h - 4h. Let z = 32 + s. What is the highest common divisor of 13 and z? 13 Let s be -2 + (20/40 - 69/(-2)). What is the highest common factor of 55 and s? 11 Let t be 0 + ((-12)/(-8))/(9/12). Let o = t - -3. Calculate the greatest common factor of 2 and o. 1 Suppose -y = -4y + 2n + 28, 2n + 34 = 4y. What is the highest common factor of y and 174? 6 Let w(g) = -20g + 84 + 95 - 203. Let a be w(-12). What is the greatest common divisor of a and 36? 36 Suppose 2g = -2o + 16, 2o = -3g + 2g + 12. Suppose 2m - gm = -32. What is the greatest common divisor of 4 and m? 4 Let k = -326 - -851. What is the highest common factor of k and 25? 25 Let h = -1298 + 1494. What is the highest common divisor of h and 4? 4 Suppose 5s - 3h = 2s + 114, 5s - h - 198 = 0. Let j(l) = 34l - 1. Let a be j(1). Suppose 3i = -a + 93. What is the highest common divisor of s and i? 20 Let i = 54 - 25. Calculate the highest common divisor of 58 and i. 29 Suppose 11 - 5 = 3q. Let t(y) = -5 + 2 - q + 4 - 56y. Let c be t(-1). Calculate the highest common factor of c and 5. 5 Let f(v) = v3 - v + 115. Let j(o) = -o3 - 9o*2 + 8o - 20. Let x be j(-10). Let n be f(x). Calculate the greatest common divisor of 46 and n. 23 Let s be 2486/(-4)(8 + -10). What is the greatest common divisor of 226 and s? 113 Suppose 2y + 3h - 91 = -20, 2y = -4h + 74. Let w = y + -122. Let s = w + 163. Calculate the highest common divisor of 8 and s. 8 Suppose -6s - 4s = -1920. Let g(p) = p3 + 24. Let n be g(0). What is the greatest common divisor of n and s? 24 Let p = -384 + 416. Calculate the greatest common divisor of 160 and p. 32 Let a be 14 + (2 - 3) + -1. Let m = 182 - -52. Let h = 354 - m. What is the highest common factor of a and h? 12 Suppose 0 = 3k - 66 + 21. What is the greatest common divisor of 6 and k? 3 Let l = -33 + 18. Let m = l - -16. Let t be 8(4 + (-2 - m)). Calculate the greatest common divisor of 24 and t. 8 Suppose -2x = 3u - 342, -2x + 4u = -451 + 123. What is the highest common divisor of 231 and x? 21 Suppose 8h - 3u = 672, 3h - 13u - 252 = -12u. Calculate the greatest common factor of 315 and h. 21 Suppose 5d - 378 = -4d. Suppose -5z + 5l = -0l + 25, 0 = 4z + l + 5. Let m be z - -1 - 1-106. What is the greatest common divisor of d and m? 21 Let z(d) = d + 4. Suppose t + 0t = 19. Suppose -23q = -tq - 28. Let u be z(q). What is the highest common factor of u and 11? 11 Let u = -10 - 10. Let r be 32/(-10)u/8. Suppose -p + 9 = r. Calculate the greatest common factor of 7 and p. 1 Let d be (-8)/(-10)(-45)/(-18). Suppose dt = 4s + 210, 5t - 3s = s + 525. What is the greatest common factor of t and 15? 15 Let w(m) = -2m - 24. Let u be w(-14). Suppose uq + d = 24, -q - 6 = -2q - 4d. What is the greatest common divisor of q and 2? 2 Let s = -376 - -379. What is the greatest common divisor of 23 and s? 1 Let p(y) = 3y3 - 10y*2 - 4y + 12. Let o be (-34)/(-8) - (-2)/(-8)-3. Let q be p(o). What is the highest common factor of q and 13? 13 Let v(b) = -30b + 1. Let x(k) = k3 + k2 - 2k - 3. Let n be x(-2). Let u be v(n). Calculate the highest common divisor of u and 7. 7 Let p = -7 - -28. Suppose -16q = -pq + 650. Suppose o + 2h = -0o + 23, -4h = -20. Calculate the greatest common divisor of o and q. 13 Let p be (4 - 9/(-5)) + 11/55. Calculate the greatest common divisor of p and 1008. 6 Let k be 1 - (-331)/6 - (-6)/(-36). Calculate the greatest common factor of 952 and k. 56 Let w(f) be the second derivative of f4 - f3/2 + 9f2/2 - 3f. Let l be w(4). Calculate the greatest common factor of l and 27. 27 Let f(n) = n*3 + 9n*2 - n - 5. Let y be f(-9). Suppose -7p - ya = -12p + 6, -p = -2a. Calculate the highest common factor of 1 and p. 1 Suppose z - 45 = k, -3z - k + 131 = -0k. Let r = z - 26. What is the greatest common divisor of 27 and r? 9 Let x be (-74)/(-1) + (-54)/(-6) + -5. What is the highest common divisor of 273 and x? 39 Let m(s) = -s2 + 17s - 7. Suppose 0 = 8z - 11 - 61. Let i be m(z). Calculate the greatest common factor of i and 13. 13 Let a(g) = g3 - 4g*2 - 8g + 4. Let i be a(8). Calculate the greatest common factor of 49 and i. 49 Let y be (-4)/30 - 17742/(-90) - 2. Calculate the greatest common divisor of 30 and y. 15 Suppose 10a + t - 138 = 6a, -2a = -t - 72. What is the greatest common divisor of a and 14? 7 Suppose -4q - 94 = 5w, 3q + 3 = -0. Let c be (14/21)/((-1)/w). Let t be (6/(-5))/(c/(-400)). Calculate the highest common divisor of t and 100. 20 Suppose -82 = -k + 3j - 3, 5j = k - 85. What is the highest common divisor of k and 105? 35 Suppose 8 = 3d + 2i - 2, 25 = -d + 5i. Suppose 20p - 21p + 3 = d. Let g be ((-4)/(-5))/(2/5). Calculate the highest common divisor of p and g. 1 Let q = -258 - -292. Calculate the greatest common divisor of 578 and q. 34 Let x(c) = 6c*3 - 34c*2 - 10c + 11. Let t be x(6). Calculate the greatest common factor of 23 and t. 23 Let v(l) = 36l2 + 2l + 2. Let q be (-4)/6 - (-6)/(-18). Let o be v(q). Calculate the greatest common divisor of o and 24. 12 Let t = 1398 - 1380. Calculate the greatest common factor of 126 and t. 18 Suppose 5j - 100 = -0z - 3z, 5z - 4j = 105. Calculate the highest common divisor of z and 50. 25 Suppose -5b + 62 = -3b - h, -b + 28 = h. Let l be (-4)/b - 182/(-15). Calculate the greatest common factor of l and 6. 6 Let v = 8844 - 5404. What is the highest common factor of v and 20? 20 Let u = -293 + 514. Let q = u - 111. Suppose -r - 5 = -15. What is the highest common divisor of q and r? 10 Suppose z - 2z + n - 40 = 0, 5z + 190 = 3n. Let w = z - -56. What is the highest common divisor of 21 and w? 21 Suppose -5p + 736 - 151 = 0. Let t = -207 + 220. What is the greatest common divisor of t and p? 13 Let v = -55 + 20. Let c = v - -36. Let x(q) = q2 + 4q - 3. Let r be x(-5). What is the greatest common divisor of r and c? 1 Let a(m) = -9m2 - 53m + 13. Let u be a(-6). Calculate the highest common factor of 98 and u. 7 Suppose 2v + 10 = 2c, 5c + 3v + 15 = -0. Let f be 4/(10/25 + c). Let t = 31 - 21. What is the greatest common divisor of t and f? 10 Suppose 27*q - 226 + 10 = 0. What is the greatest common divisor of q and	{ "pile_set_name": "DM Mathematics" }
-15 + 12. Let a be m(z). Let y = a + 45. What are the prime factors of y? 13 Let g = 128 + -28. List the prime factors of g. 2, 5 Let x = 136 - -84. What are the prime factors of x? 2, 5, 11 Let o = 211 - 196. What are the prime factors of o? 3, 5 Let g = -110 + -127. What are the prime factors of (g/(-6) + 2)2? 83 Let h(x) = 24x*2 - 11x + 12. What are the prime factors of h(7)? 11, 101 Let t(c) = c - 1. Let y(l) = 15l - 5l - 3l + 8l - 2. Let w(b) = -6t(b) + y(b). What are the prime factors of w(2)? 2, 11 Let n(g) = -18g - 13. What are the prime factors of n(-6)? 5, 19 Suppose 12q - 9q = -126. What are the prime factors of ((-12)/14)/(3/q)? 2, 3 Let v(x) be the third derivative of -x*6/120 - 2x5/15 + x4/12 - 10x2. List the prime factors of v(-9). 3, 7 Suppose -121 = -3c + 251. Suppose 0t + 4t = c. List the prime factors of t. 31 Suppose 0 = -4q - 4m - 0m - 156, 5m - 21 = q. Let k = q + 60. What are the prime factors of k? 2, 3 What are the prime factors of ((-108)/(-21))/((-16)/(-56))? 2, 3 List the prime factors of (4 - (971 + 0))-1. 967 Suppose 2200 = 2i - 480. List the prime factors of i. 2, 5, 67 Suppose -9 = 3r, 8n - 4n - 3494 = 2r. List the prime factors of n. 2, 109 Suppose -2k + 4y + 208 = 0, -5k + 585 - 70 = -5y. What are the prime factors of k? 2, 3, 17 Suppose -5r + 9r - 5s = 1506, 5s = -3r + 1147. Let a = r - 202. List the prime factors of a. 3, 59 Suppose l + 0d - 4d = 421, -4l + 1768 = 5d. Suppose w + l = -78. What are the prime factors of w/(-15) + 4/6? 5, 7 Let v be ((-9)/4)/(5/(-120)). Suppose i = 4f + 62, -5f - v = -f + 3i. Let d = 7 - f. List the prime factors of d. 2, 11 Suppose 2o + 6 - 25 = -3w, -2w - 3o + 21 = 0. Suppose 5z = -wv + 178, 3v + 3z = 8v - 308. Suppose 0 = 4i - v - 47. List the prime factors of i. 3 Let b(c) = -26c + 13c - 25c - 3c - 17. Let x be b(-4). Suppose -3o = -x + 30. List the prime factors of o. 3, 13 List the prime factors of ((-120)/7)/((-30)/315). 2, 3, 5 Suppose 9j - 6j = 18. Suppose r = -r - 2n - j, -5n = 25. Suppose 42 = rg + g. What are the prime factors of g? 2, 7 Let w(i) = i*3 + 9i*2 + 8i - 10. Suppose 4z + 29 = -3u, -u + 2 = u. Let d be w(z). Let a = 58 + d. List the prime factors of a. 2, 3 Suppose -5k + 1430 = -5l, -5k + l + 1333 = -77. List the prime factors of k. 281 Suppose -2h + 503 = -p, 4h + 2p - 1011 = 3p. What are the prime factors of h? 2, 127 Suppose -3j + 4f - 76 = 2f, -3j + 5f - 82 = 0. List the prime factors of j/201/(6/(-100)). 2, 5 Suppose 2328 = 7p - p. Suppose -a + 5a = p. List the prime factors of a. 97 Suppose 32 - 8 = -6r. What are the prime factors of ((-1270)/(-15))/(r/(-6))? 127 Suppose -4y = -19y - 30. List the prime factors of (y - (-2)/4)(-28 - 10). 3, 19 Suppose 2v = l - 4, -v + 8 = -3l + v. Let z(w) = -24w - 12. What are the prime factors of z(l)? 2, 3, 11 Suppose -6 = -0v - 2v. Suppose 148 = 2x - 5i, -241 = -vx + 2i + 3. List the prime factors of x. 2, 3, 7 Let i(g) = -g*3 - 8g*2 - 7 - 9g - 9 + 6. Let t be i(-7). Suppose -tl + 107 = -7d + 2d, 3l - 3d = 84. List the prime factors of l. 3, 11 Suppose 3x - 1 = 2x. List the prime factors of (-28)/(-2x/4). 2, 7 List the prime factors of 8/(-6)2175/(-10). 2, 5, 29 Suppose 8 = -a + 7, -517 = -3w + a. List the prime factors of w. 2, 43 Suppose -34i + 36i - 758 = 0. List the prime factors of i. 379 Suppose -2p - 30 = -0c - 4c, 0 = -4c + 4p + 28. Suppose cg = 10g - 118. What are the prime factors of g? 59 Let v(u) be the third derivative of -5u2 - u3 + 1/60u5 + 0u - 1/6u4 + 0. What are the prime factors of v(-4)? 2, 13 Let u be 4/(5/(140/8)). Let p be 7/28/u. What are the prime factors of (2 - 0/(-2))p? 2 Let t = -11 + 7. Let c(m) = -14m - 7. What are the prime factors of c(t)? 7 Let g(q) = 77q3 - 1. Let c be g(-1). Let f = 35 - c. List the prime factors of f. 113 Let i(m) = -m2 + 7m - 5. Let g be i(5). Suppose gv = f + 4v - 6, f - 2v = 10. Suppose fl - 3 = 1. List the prime factors of l. 2 Let m = 6 - 4. Let n(j) = -4 - 3 + 5jm - 3j + 5. List the prime factors of n(-2). 2, 3 Suppose -2m - 17m + 3686 = 0. List the prime factors of m. 2, 97 Suppose m = -5u - 2247, -2m - 3350 - 1133 = -u. List the prime factors of m/19(-2)/4. 59 Let a be 5/(25/(-10)) + 20. Let l = a - -20. List the prime factors of l. 2, 19 Let r(z) = 47z*3 + 3z*2 - 5z + 8. List the prime factors of r(2). 2, 193 Let d be ((3 - 1) + -4)-2. Suppose dp = 3p + 295. Suppose b = 6b - p. What are the prime factors of b? 59 Suppose y + 13a - 17a - 408 = 0, 0 = 3y + 5a - 1207. List the prime factors of y. 2, 101 Let i(s) be the third derivative of s6/40 + s5/30 - s4/6 + s3/3 + 5s2. Let u be i(2). What are the prime factors of 386/u + 2/13? 3, 5 Suppose 2f - 470 = -3i, -4i + 785 = i + 3f. Let v = i - 20. List the prime factors of v/6 + (-4)/12. 23 List the prime factors of (-115)/(-23)2/(10/467). 467 Suppose -15 = j - 6j - 2q, -q + 5 = 0. What are the prime factors of 3/(15/130) - j-1? 3 Let y be 54/1274/3. Let c = y - 59. List the prime factors of c. 2, 13 Suppose 190 = -6c + c. Let x = -2 - c. Let k = x - 32. List the prime factors of k. 2 Let d = -32 + 34. List the prime factors of 89 - ((d - 0) + -3). 2, 3, 5 Suppose -2q - 5s - 22 = -q, -2q - 3s - 9 = 0. What are the prime factors of -5(-490)/75q? 2, 7 Suppose 188c - 178c = 21340. What are the prime factors of c? 2, 11, 97 Let y = 1109 - 235. What are the prime factors of y? 2, 19, 23 Suppose -4b + 9 = -3m, 3 = -2b - 3b - m. Let r(l) = -l2 + 5. Let n be r(b). Suppose -j + n - 1 = 0. What are the prime factors of j? 2 Suppose 0 = -25a + 21a + 2l + 320, 0 = -4a - 5l + 334. What are the prime factors of a? 3 What are the prime factors of (-2)/17 - (-88770)/255? 2, 3, 29 Suppose 8w + 5 = 9w. Suppose y - z - z = 107, wy - 3z - 521 = 0. What are the prime factors of y? 103 Let s(k) = -k*3 + 7k*2 - 4k - 4. Let q(l) = -l*3 + 3l*2 - l + 2. Let f be q(2). List the prime factors of s(f). 2, 7 Let k(x) = 2x - 7x2 + 23x*3 + 5x*2 - 4x*2 - 22x*3 - 9. List the prime factors of k(6). 3 Suppose 0 = c - 5k + 13, 5c + 2k = -0k + 16. Suppose -24 = -d - h - 0h, -ch = 4. What are the prime factors of d? 2, 13 Let m be (12/10)/((12/(-10))/(-3)). Let t(x) = 33x - 1. What are the prime factors of t(m)? 2, 7 List the prime factors of ((-320)/(-4))/8232/10. 2, 29 Suppose -b + 3 + 0 = 0. Suppose -4a + 2a + 44 = 3c, -3c + 48 = 3a. Suppose j = -2w + 17, -2j + 37 = bw + c. What are the prime factors of w? 3 Let n(t) = 48t + 105. List the prime factors of n(17). 3, 307 Let x(j) = 3j2. Let p be x(-1). Let m = -1 + p. Suppose 0 = 3c - mc - 10. List the prime factors of c. 2, 5 Suppose 0 = 3z - 0z. Suppose z - 116 = -4c. List the prime factors of c. 29 Let c(b) = -24b - 151. What are the prime factors of c(-29)? 5, 109 Let k = 35 + -19. Let m(z) = 25z - 8. Let q be m(0). Let t = k + q. What are the prime factors of t? 2 Let g(k) = -30k - 16. Let r(z) = -60z - 31. Let l(s) = 5g(s) - 2r(s). What are the prime factors of l(-5)? 2, 3, 11 Let d be 3/(-2) + 14/4. What are the prime factors of (-14)/((0 - d) + 1)? 2, 7 List the prime factors of (-2)/(-7) + 2681/49. 5, 11 Let f(c) be the first derivative of -c*4/4 + 13c3/3 + c2/2 + 3c + 78. Let d = -18 - -31. What are the prime factors of f(d)? 2 Let y = 14 + -10. Suppose -l - 138 = -yl. What are the prime factors of l? 2, 23 Let w = 2 - 0. Suppose 0 = -3a + b + 15 - 11, 22 = 4a + 2b. Suppose 136 = az + 2z - wv, 5v = z - 41. What are the prime factors of z? 2, 13 Suppose -2g - 3a + 92 = -201, -134 = -g - 4a. List the prime factors of g. 2, 7, 11 Let h(z) = 41z - 4. Let m be h(2). Suppose 4p = -5j - 55, 3p = -2p + 3j - m. List the prime factors of (p/6)/(6/(-36)). 3, 5 Let i(r) = -r*3 - 7r*2 + 9r + 5. Let k be i(-8). Let c(v) be the second derivative of 5v4/12 - 3v*2/2 + 2v. What are the prime factors of c(k)? 2, 3, 7 Let l(r) = r*2 - 3r - 4. Let h be l(4). Let m(d) = 0d + h - 12 + 4d - 3. List the prime factors of m(10). 5 What are the prime factors of -1056*((-45)/(-10) - 5)? 2, 3, 11 Let h(v) =	{ "pile_set_name": "DM Mathematics" }
14z + 238 - 238. Suppose 0b - 2b = q - 1, -q = 5. Let h(o) = -bo + o + o. Give h(n(f)). 14f Let u(j) = -4j - j + 19 - 14 - 11 - 3. Let k(p) = p*2. What is k(u(h))? 25h*2 + 90h + 81 Let v(l) = 2l2. Let o(h) = -2h + 10. Let w be o(6). Let r(t) = -t. Let p(j) = -6j. Let g(f) = wr(f) + p(f). Give g(v(a)). -8a2 Let w(s) = -4s - 6. Let g(t) = -t - 2. Let l(z) = -3g(z) + w(z). Let k(f) = -82f*2. Determine k(l(u)). -82u*2 Let r(c) = 90c*2 + 2c - 5. Let h(f) = -2f. Determine h(r(w)). -180w*2 - 4w + 10 Let n(i) = -21i - 2. Let v(w) = -w2 - w2 - 3 + 3. Give v(n(d)). -882d*2 - 168d - 8 Let o(w) = 5w2. Let g(t) = -6219t. What is g(o(v))? -31095v2 Let g(n) = 4n2. Let a(u) be the third derivative of u4/24 + 25u3/6 - 103u*2 + 3. Determine a(g(o)). 4o*2 + 25 Suppose -9y + 84 - 39 = 0. Let p(n) = 50n - 9n - yn. Let i(d) = d. Give p(i(l)). 36l Suppose 0b - 21 = -2b - 5w, 2b + 4w - 18 = 0. Let g be b/4 - (-6)/(-8). Let p(d) = -d - 6d + d + gd. Let u(t) = -2t*2. Calculate p(u(v)). 12v2 Let o = 12 + -10. Let r(j) = -j2 + 0j2 + 2j*o. Let h(x) = 9x. Let k(z) = 2z. Let u(y) = 4h(y) - 21k(y). Give u(r(b)). -6b*2 Let d(p) = 13468p. Let r(b) = b*2. Determine d(r(c)). 13468c*2 Suppose 2u + 0u = b - 10, 2b + 3u = 20. Let a(i) = 6 - 9 + bi*2 + 3. Let g(l) = 2l. Calculate a(g(m)). 40m2 Let d(y) = 129y*2 + 33. Let v(g) = -10g + 7. Let q be v(4). Let l(i) = 8i2 + 2. Let k(x) = ql(x) + 2d(x). Let r(m) = -2m + 1 - 1. Determine k(r(n)). -24n2 Let f(r) = 15r*2. Let s = -185 + 260. Let u(t) = st*2 + 71t*2 - 142t*2. Give f(u(l)). 240l*4 Suppose 3i + 2 = 4i. Let y(l) = -4l2 - l2 + 0li + 3l*2. Let f(v) = -13v - 8 + 8. Give f(y(r)). 26r2 Let s be ((-24)/18)/((-1)/39). Suppose -3r = -r + s. Let o(q) = 10q2. Let t(k) = -91k*2. Let c(v) = ro(v) - 3t(v). Let i(x) = -x. Calculate i(c(d)). -13d*2 Let t(n) = -8n*2 - 9n. Let u(y) = -y*2 - y. Let k(s) = 2t(s) - 18u(s). Suppose 97w = 100w - 30. Let x(l) = -l + l + wl. Determine k(x(z)). 200z2 Let s(k) = -2k*2. Let o(y) = 37y - 10. Let z(w) = -183w + 48. Let f(u) = 24o(u) + 5z(u). What is f(s(v))? 54v*2 Let w(q) = q - 33. Let b(k) = 3k - k + 3k - 6k + 2k. Calculate b(w(n)). n - 33 Let o(f) = -2f*2 + 4f - 4. Let n(c) = c - 1. Let k(a) = 4n(a) - o(a). Let w(s) = 8s. Determine w(k(p)). 16p2 Let t(b) = 2b*2. Let q(s) be the first derivative of 35s*2/2 - 143. Determine q(t(m)). 70m*2 Let u(m) = -365m. Let n(z) = -5z - 27. Give u(n(r)). 1825r + 9855 Let n(i) = -32402i2. Let a(p) = -40p*2. Determine a(n(z)). -41995584160z*4 Let y(c) = 2c - 1503319. Let s(q) = -q. Calculate s(y(h)). -2h + 1503319 Let z(k) = -237k + 1. Let c(g) = -102 + 3g2 + 199 - 5g*2 - 97. Give c(z(b)). -112338b*2 + 948b - 2 Let b(d) be the first derivative of d*2/2 - 115. Let a(q) = -89q*2. Determine a(b(t)). -89t*2 Let r(y) be the third derivative of 0y*4 + 1/30y*5 - 6y*2 + 0y*3 + 0 + 0y. Let z(o) = 5o2. Calculate r(z(f)). 50f*4 Let w(l) be the first derivative of -84l - 23 + 84l - l2. Let n(q) = -14q*2. Determine n(w(f)). -56f*2 Let u(s) = -220s*2 + s + 3. Let r(m) = 6m. Give u(r(h)). -7920h2 + 6h + 3 Let o(c) = 334c. Let v(s) be the first derivative of s3 + 195. Calculate v(o(a)). 334668a2 Let d(g) be the second derivative of -g4/3 - g*3/3 - 125g. Let h(y) = -2y. What is d(h(n))? -16n*2 + 4n Suppose 88 = 3r + r. Let d(f) = 7f - 5f + r - f. Let b(h) = -h. Give d(b(p)). -p + 22 Let l(h) = h. Let u(a) = -a2 - 4a - 1. Let z be u(-2). Let o(b) = b*2 - b + 4. Let t be o(0). Let k(n) = -15n + z + t - 7. Give k(l(p)). -15p Let c(s) be the third derivative of s5/12 - 3s2. Let l(q) be the second derivative of q4/6 - 23q. Give l(c(i)). 50i*4 Let k(o) be the third derivative of -5o*2 + 0o + 1/12o4 + 0 + 0o*3. Let w(i) = 1 - 1 + 5i*2. What is k(w(y))? 10y*2 Let w(n) = 33n. Let x(c) = -c + 3. Let h(f) = -3f + 7. Let d(o) = 6h(o) - 14x(o). Calculate d(w(v)). -132v Let z(o) = 6o - 1. Let b(c) be the first derivative of -5c*3/3 + 588. Calculate z(b(j)). -30j*2 - 1 Let z(i) be the first derivative of -4i*2 - 28. Let m(t) = -7t. Let l(h) = 6m(h) - 5z(h). Let p(y) = -10y2. What is p(l(o))? -40o*2 Let l(f) = -11f. Let t(b) = 7b2 - 65b. What is t(l(w))? 847w2 + 715w Let i(z) = -2z2. Let r = -727 - -729. Let f(y) be the second derivative of 0y*r + 0 + 1/3y*3 - 7y. Give f(i(a)). -4a2 Let o(f) = 2f - 925. Let s(z) = -z - 34. Determine s(o(d)). -2d + 891 Suppose 4m - 5m = -17. Let q(j) = m + 4j*2 - 17 - 3j. Let c(l) = 5l2 - 4l. Let u(g) = -3c(g) + 4q(g). Let s(w) = -w. Calculate u(s(k)). k*2 Let o(x) = -11x. Let a(n) = -3n2 - 4n. What is o(a(d))? 33d2 + 44d Let r(j) = 16j2 - 5. Let k(p) = -p2 - 1. Let l(v) = 5k(v) - r(v). Let i(x) = 4x2. What is l(i(y))? -336y*4 Let f(t) = t - 3. Suppose 2o + 8 = 4o. Let c(z) = 2z - 4. Let k(b) = of(b) - 3c(b). Let a(g) = 2g2. Determine k(a(l)). -4l*2 Let z(y) = 7y*2 + 6y - 6. Let w(m) = 20m2 + 17m - 17. Let p(a) = 6w(a) - 17z(a). Let i(q) be the first derivative of -q*2 + q + 27. Give i(p(c)). -2c*2 + 1 Let b(c) = -2546c - 11. Let i(y) = -12y2. Calculate b(i(x)). 30552x*2 - 11 Let m(l) be the second derivative of 1/3l*3 + 0l*2 - 3l + 0. Let v(r) = 184r2. Let q(k) = -14k*2. Let i(z) = 40q(z) + 3v(z). Determine m(i(j)). -16j*2 Let n(l) = 5l. Let r(d) = 421d + 2. Give r(n(c)). 2105c + 2 Let t(a) = -144a2 + 63a - 63. Let z(u) = 9u2 - 4u + 4. Let g(k) = 4t(k) + 63z(k). Let b(x) = 63x + 59x - 121x. Give g(b(h)). -9h*2 Let w(k) = k. Let t(v) = 60v*2 + 18v*2 + 141v*2 + 81v*2 - 48v*2. Give w(t(c)). 252c*2 Let k(j) = 24j*2 - 42j*2 + 16j*2. Let w(m) = 32m. Determine k(w(n)). -2048n2 Let s(u) = u2. Let l(z) = 1037389z. Determine l(s(o)). 1037389o2 Let f(j) = -51j. Let w(u) be the first derivative of 7u3/3 + 68. Calculate f(w(r)). -357r*2 Let h(k) = 7k. Let u(n) = 0n + 0n - 27n2 + 15n*2 + 64n*2. Calculate h(u(i)). 364i*2 Let f(i) = 2i*2. Let a(b) be the third derivative of 17b*4/24 - 109b*2 - 2. What is a(f(w))? 34w*2 Let k(p) = -12p - 10. Suppose 5c - 1 - 4 = 0. Let x(r) = -r + 0 - 1 + 0. Let b(v) = ck(v) - 10x(v). Let u(n) = n2. Give b(u(g)). -2g2 Let k(j) = j2. Let a be (68/(-51))/((-2)/3). Let p(u) = -6u - 4u + 10u + au. Calculate k(p(i)). 4i2 Let c(t) = -40723t*2 + 4t. Let m(b) = 2b2. Determine c(m(o)). -162892o*4 + 8o*2 Let t(y) = -3y. Let k(b) = -35b2 - 2b - 806. What is k(t(n))? -315n2 + 6n - 806 Let m(n) = -6n + 2. Let z(h) be the second derivative of -h6/720 - 17h*4/12 + 10h + 3. Let l(a) be the third derivative of z(a). Give m(l(u)). 6u + 2 Let z(i) = 2i. Let l(q) = 4q. Let u(j) = 4j. Suppose c + 3c = 3o + 29, 2 = -2c - 4o. Let h(f) = cl(f) - 4u(f). Calculate z(h(n)). 8n Let j(v) = -5v. Let y(s) = 3s - 25s + 0s + 3s - 10s - 1. Give j(y(k)). 145k + 5 Suppose -10 - 18 = -i. Let b(n) = 31n - 55n + in. Let l(o) be the second derivative of -o3 + o. Give b(l(u)). -24u Let a(t) be the first derivative of -24t2 + 2t + 128. Let c(w) = w*2. What is a(c(v))? -48v2 + 2 Let u(x) = x2 - 5x - 195. Let t(i) = 4i. What is u(t(b))? 16b2 - 20b - 195 Let z(o) = 9o2 + 10o. Let k(b) = 2b - 23. Determine z(k(y)). 36y*2 - 808y + 4531 Let o(p) be the first derivative of 4p + 6 + p2 - 4p. Let d(w) = -27w. Calculate d(o(h)). -54h Let o(x) = 19x2. Let k(q) = -149 + 74 + 73. Let d(r) = r + 3. Let i(t) = 2d(t) + 3k(t). What is i(o(f))? 38f*2 Let m(r) = -7r*2. Let y(l) = 25l*2 + 6l. Let u(x) = 28x2 + 7x. Let g(c) = -6u(c) + 7y(c). Calculate m(g(a)). -343a4 Let w(d) = 3478d + 2. Let a(g) = g. Calculate w(a(y)). 3478y + 2 Let d(u) = -25126u. Let n(t) = -2t. Determine n(d(f)). 50252f Let p(y) = y*3 - 15y*2 + 13y + 16. Let g be p(14). Let o(n) = 2ng + 15 - 15. Let i(b) = -3 - 5 - 15b + 8. Calculate i(o(x)). -30x2 Let m(a) = 2a. Let t(b) = -361b. Let x(q) = 15q. Suppose 587 + 78 = 7r. Let w(p) = rx(p)	{ "pile_set_name": "DM Mathematics" }
a3 + 11a*2 + 15a + 13. Determine 13v(i) - 6w(i). i3 - i2 + i Let s(f) = 69f + 5. Let g(c) = 3071c + 222. Give 5g(w) - 222s(w). 37w Suppose 4p - 12 = -4. Suppose 0u + 19 = -4n - u, -18 = 4n + 2u. Let k = p + n. Let t(f) = f*3 - 3f2. Let c(z) = z2. Determine kc(s) - t(s). -s3 Let z(b) = -4b - 7. Let i(d) = -d - 2. Give 22i(l) - 6z(l). 2l - 2 Let y(j) = j2 - 3j + 3. Let x(g) be the second derivative of -2g2 - 1/12g*4 + 0 - 2g + 2/3g3. Give -3x(q) - 4y(q). -q2 Let p(t) = -4t*3 - 4t. Let d(b) = b. Let r = -10 + 14. Determine rd(v) + p(v). -4v*3 Let r(a) = 3a*2 + a + 4. Let b(o) = -17o*2 - 13o + 9. Let y(c) = 4c2 + 3c - 2. Let h(t) = -6b(t) - 26y(t). What is 5h(m) + 3r(m)? -m*2 + 3m + 2 Let g(r) = -30r3 + 4r*2 - 4r - 4. Let z(t) = 119t3 - 17t*2 + 17t + 17. Calculate 17g(c) + 4z(c). -34c3 Let u(a) = 3a*2 - 4a + 4. Let s = 229 + -230. Let r(c) = c*3 - 4c*2 + 2c - 1. Let h be r(3). Let z(j) = j - 1. Calculate hz(f) + su(f). -3f2 Let x(f) = -13f*2 - 3f - 5. Let t(l) = 7l2 + 2l + 3. Calculate -5t(a) - 3x(a). 4a2 - a Let r(p) = 7p - 4. Let c = -1 - 5. Let q(i) = 13i - 7. What is cq(t) + 11r(t)? -t - 2 Let m(o) = -6o + 3. Let i(n) = -n. Give -12i(k) + m(k). 6k + 3 Let y(g) = g + 1. Let r(c) = -c - 1. Let s(h) = -h*3 + 3h*2 + 2h + 4. Let z be s(4). Calculate zy(a) - 3r(a). -a - 1 Let v(m) = 17m + 5. Let j(p) = -50p - 16. Let w(s) = 3j(s) + 8v(s). Let u(r) = 5r + 3. Determine -11u(x) - 4w(x). x - 1 Let o(b) = 3b*3 - 3b2 - 11. Let u(x) = -x3 + x*2 + 4. Let y(d) = -3o(d) - 8u(d). Let w(i) = 3i*3 - 2i*2 + 5i - 4. Calculate -w(q) - 2y(q). -q3 - 5q + 2 Let y(n) be the third derivative of 7n5/12 + 5n*4/8 - 5n*3/2 - 22n*2. Let x(u) = 9u*2 + 4u - 4. Give 15x(c) - 4y(c). -5c2 Suppose -z = z - 2i + 6, -2z = 4i + 30. Let m(o) = 4o2 + 33o - 24o + 7 + 7o*2. Let w(b) = 6b*2 + 5b + 4. Give zw(s) + 4m(s). 2s2 + s Let v(z) = 5z*2 - 11z - 3. Let g(h) = -17h2 + 10h + 6. Let t(b) = -6b2 + 3b + 2. Let c(f) = 3g(f) - 8t(f). What is -7c(d) - 4v(d)? d*2 + 2d - 2 Let u(v) = -6v2 - 3v + 5. Let r(z) be the third derivative of -7z5/60 - z4/6 + z3 - 8z*2. Give 5r(x) - 6u(x). x2 - 2x Let g(h) = -5h3 - 3h - 5. Let r(k) = 6k3 + 3k + 5. Give 4g(s) + 3r(s). -2s3 - 3s - 5 Let v(c) be the second derivative of -c4/6 + c3/3 + c*2 - 2c. Let r = -29 - -24. Let w(z) = 2z2 - 2z - 2. What is rw(j) - 6v(j)? 2j2 - 2j - 2 Let v(w) = 6w3 - 2w + 9. Let n(s) = -3s3 + s - 4. Calculate -7n(k) - 3v(k). 3k*3 - k + 1 Let h(n) = -14n*3. Let q(c) = -7c*3. Calculate 4h(z) - 7q(z). -7z*3 Let z be ((-1)/(-2))/((-2)/16). Let m(i) = -i - 2. Let y be m(z). Let q(c) = c - 4. Let v(a) = -2a + 13 + 0a - 8. What is yv(j) + 3q(j)? -j - 2 Let b(n) = 2n - 4. Let f(m) = 2m - 3. Give 5b(g) - 6f(g). -2g - 2 Let r(c) = -49c2 - 3. Let g(o) = 99o*2 + 7. Determine 2g(n) + 5r(n). -47n*2 - 1 Let n(s) = 6s - 3s + 2s - 6. Let r(u) = 11u - 13. Let g(f) = -f3 - 5f*2 + 2f + 6. Let z be g(-5). Give zr(q) + 9n(q). q - 2 Let f(p) = -2p + 5. Let d(s) = -s + 3. Let h be 28/(-8) - (-4)/8. What is hf(r) + 5d(r)? r Suppose 18f - 4f = -84. Let m(x) = 5x + 2. Let w(s) = -14s - 6. Calculate fw(v) - 17m(v). -v + 2 Let d(w) = -19w - 4. Let o(g) = 989g + 207. Give -207d(h) - 4o(h). -23h Let c(k) = 7k3 - 20k*2 - 6. Let y(m) = -15m*3 + 39m*2 + 13. Give 13c(x) + 6y(x). x3 - 26x2 Let i(z) be the second derivative of -z5/20 + z4/12 - z3/6 + z*2/2 + 13z. Let v(u) = 3u3 - 2u*2 + 4u - 4. Calculate 4i(k) + v(k). -k3 + 2k*2 Let s(m) = 2m*3 - 2m*2. Let h be 2 + (-1 - 6) + -1. Let f be -6 - (-2 - -1 - 0). Let p(a) = -2a*3 + 2a*2. Determine fp(y) + hs(y). -2y*3 + 2y2 Let k(x) = -1. Let o(d) = d3 - 3d - 3. Determine -2k(h) + o(h). h*3 - 3h - 1 Let i(t) = 3t3 + 3t2 - t. Let f(a) = -a2. What is -3f(s) - i(s)? -3s*3 + s Let v(r) = 2 + 5r*2 - 2 - 2r3 - 1. Let o(c) be the second derivative of c5/10 - c4/2 + c2/2 + 4c. Determine 5o(u) + 6v(u). -2u3 - 1 Let x(n) = n2 + 4n - 2. Let p be x(-5). Let v(o) = -1 + 17o*3 + p - 2 - 17o - 13o2. Let f(s) = -4s*3 + 3s*2 + 4s. Determine -26f(i) - 6v(i). 2i3 - 2i Let m(x) be the second derivative of x*5/10 + 2x4/3 - x2/2 - 19x. Let a(b) = 2b*3 + 7b*2 - 1. Calculate 6a(l) - 5m(l). 2l*3 + 2l*2 - 1 Let n(z) = -2z*3 + 9z*2 - 9z - 4. Let k = -22 - -33. Let t = 7 - k. Let s(f) = -f*3 + 4f*2 - 4f - 2. What is tn(j) + 9s(j)? -j*3 - 2 Let t(m) = -6m*3 + 7m*2 - 7m - 7. Let k(h) = -2h3 - h2 + 4h + 1. Let s(g) = -g*3 + g. Let z(i) = k(i) - 3s(i). What is 3t(x) + 21z(x)? 3x3 Let u(h) = -h - 5. Let p(i) be the third derivative of i4/12 + 7i*3/6 + 34i*2. Determine 5p(q) + 7u(q). 3q Let w(f) = f. Let x(u) = -5u + 1. What is 6w(o) - x(o)? 11o - 1 Let w(v) be the third derivative of -3v4/8 - v3/2 - 3v2. Suppose x + 3x + 5p - 12 = 0, 3x = -p - 2. Let t(y) = 4y + 1. Calculate xw(z) - 5t(z). -2z + 1 Let w(h) = -9h + 5. Let m(u) = 8u - 6. What is -6m(j) - 5w(j)? -3j + 11 Let k be (1 - 0) + 2 - 1. Let q(s) = -6s*2 + s - ks + 7s2. Let t(g) = -g2 + g. What is -3q(m) - t(m)? -2m2 + 2m Let c(v) = -2v - 1. Let z(s) = -7 + s + s + 2s + 8. Suppose p + 5n = 6p + 35, 2p - 5n = -20. What is pc(y) - 3z(y)? -2y + 2 Let s(o) = -o2 - o. Let j(y) = 18y*2 + 15y. Determine j(d) + 15s(d). 3d*2 Let d(p) = -5p - 2. Let t = 8 + -6. Suppose -u = 9 + t. Let x(a) = 14a + 5. What is ud(b) - 4x(b)? -b + 2 Let v(i) = -i + 6. Let x = -14 + 10. Let a be ((-4)/((-48)/(-54)))/((-1)/2). Let k(y) = -2y + 13. Calculate av(f) + xk(f). -f + 2 Let s be 14/8 + (-1)/(-4). Let i(l) = l*3 + 2l*2 - 2l + 2. Let f(w) = -15w3 - 33w*2 + 33w - 33. Calculate sf(a) + 33i(a). 3a3 Let h(n) = n2 + 2n + 5. Let a(r) be the first derivative of r - 4. Let u be ((-1)/(-1))/(11/55). Give ua(g) - h(g). -g2 - 2g Let d(u) = 4u - 4. Let g(x) = -3x + 3. Suppose 5n + s = 130, s + 10 = 3s. Suppose -n = -0l + 5l. Calculate ld(t) - 7g(t). t - 1 Let m(v) = -1. Let j(z) = 6z2 - 4z*2 + 2 - z + z. Determine -j(k) - 2m(k). -2k2 Let r(j) = -24j*3 + 150j + 24. Let x(i) = 5i3 - 30i - 5. Determine 3r(o) + 14x(o). -2o3 + 30o + 2 Let p(m) = m*2 - 4m - 1. Let i be 28/(-3) + (-4)/6. Let o be (-8 + 6)i/(-4). Let v(k) = 2k*2 - 6k - 2. Determine ov(d) + 8p(d). -2d2 - 2d + 2 Let x(c) = -2c2 - c. Suppose -7 + 3 = -2o. Suppose 0 = oi + i - 6. Let y(p) = 2 + 6p*2 + 3 - ip*2 + 2p - 4. Give -5x(g) - 2y(g). 2g2 + g - 2 Suppose 4 = -4b + 4y, -y - 17 = -3b - 3y. Let k(c) = -6c*2 - 11c - 7. Let j(t) = -3t2 - 5t - 3. What is bk(a) - 7j(a)? 3a2 + 2a Let w(k) = k*2 + k + 1. Suppose 2m + s = -2s - 5, 35 = 5m - 2s. Let f(o) = -6o - 6 - mo2 - 4 - 2o*3 + 3o + 7. Determine f(u) + 5w(u). -2u*3 + 2u + 2 Let o(x) = 17x + 2. Let t(j) = j + 1. Let d(m) = o(m) - 4t(m). Let f(q) be the first derivative of -3q2 + q + 89. Determine 4d(r) + 9f(r). -2r + 1 Let d = 5 - 5. Let f(w) = -1 + dw + 3w - 4w. Let l(h) = 4h + 7. Calculate 5f(q) + l(q). -q + 2 Let y(c) = 6c + 15. Let z(f) = 9f + 23. Give -8y(l) + 5z(l). -3l - 5 Let q(p) = -5p3 - 5p. Let w(t) = t. Give 4q(c) + 20w(c). -20c3 Let q(k) = -2 + 4k + 4 + k. Let g(u) be the third derivative of -3u4/8 - 2u*3/3 - 2u*2. Give 4g(v) + 7q(v). -v - 2 Let w(d) = 9d3 - d2 + 3d + 3. Let i(c) = 37c*3 - 5c*2 + 13c + 13. Give 4i(k) - 18w(k). -14k3 - 2k*2 - 2k - 2 Let r(d) = d + 7. Let k = -7 + 5. Let x(y) = 11. Let s(i) = 5. Let q(w) = 9s(w) - 4x(w). Let c(n) = -n*2 - 8n + 2. Let m be c(-6). Give kr(f) + mq(f). -2f Let h be (17 - 19)/((-2)/(-6)-2). Let c(l) = -l*2 - 3l - 3. Let o(y) be the first derivative of -y*2/2 - y + 1. Determine ho(i) - c(i). i*2 Let i(m) = -2m*2 + 2. Let s = 1 + 1. Let v(l) = -2l*2 + 3. Let h = -6 + 3. What is hi(t) + sv(t)? 2t2 Let r(w) = w - 1. Let f(i) = i2 + 3i + 5. Determine -f(q) + 3r(	{ "pile_set_name": "DM Mathematics" }
st value? (a) -0.32 (b) 0.5 (c) -1.56 (d) -0.2 (e) -3 (f) 1/5 c Which is the biggest value? (a) 13/4 (b) -50/7 (c) -0.04 (d) -5 a What is the smallest value in -5, 6/181, 2/7, 0.2? -5 Which is the sixth smallest value? (a) 2 (b) 0.4 (c) 0 (d) 0.1 (e) 16 (f) -572 e What is the fourth smallest value in 12, -2/7, -15, 2/27, -2? 2/27 Which is the third biggest value? (a) 1 (b) 21.4 (c) -3 c What is the third smallest value in -2/5, -327, 2/3, -2? -2/5 Which is the third biggest value? (a) -4 (b) -6 (c) 0.3826 b Which is the smallest value? (a) -1 (b) -2/19 (c) 2 (d) -119 (e) 0 (f) 5 d Which is the fifth smallest value? (a) 1 (b) -4 (c) -0.05 (d) 17 (e) 6 (f) -7 e What is the biggest value in -959/3, 0, 2/13? 2/13 Which is the fifth biggest value? (a) -0.5 (b) -4 (c) -12 (d) -0.6 (e) 1 c Which is the smallest value? (a) 3/5 (b) -721 (c) 2 b What is the second biggest value in -0.9, -1/4, 6/17, 983, 5? 5 What is the second biggest value in 7.718, -0.5, 2? 2 Which is the smallest value? (a) -0.0256 (b) 1 (c) -1 (d) -2 d Which is the second biggest value? (a) 17 (b) -502 (c) 27 a What is the biggest value in 2/3, 4, -0.5, -0.51? 4 Which is the biggest value? (a) -16 (b) -2/13 (c) 96/7 (d) 2/71 c What is the second biggest value in -23/3, 5, 3200, 1? 5 What is the biggest value in 27, 5, 1, 0.4, -13? 27 Which is the second smallest value? (a) 9/8 (b) -4 (c) 1 (d) 2/9 d Which is the fourth smallest value? (a) 0.2 (b) 25 (c) -1 (d) 107 (e) 3 b What is the biggest value in 0.3, -3/4, -4/9, 921, 5? 921 What is the third biggest value in 1689, -1/8, 3? -1/8 Which is the fourth smallest value? (a) 19/4 (b) 2 (c) -0.3 (d) -4 (e) -1 (f) 13 b What is the third smallest value in 0.22, -72, 7/4? 7/4 Which is the fourth biggest value? (a) 0.046 (b) -3/5 (c) 0.06 (d) 2 b What is the biggest value in 37/3, 16, 0.5, 2? 16 Which is the second biggest value? (a) -89 (b) -1 (c) -821 (d) -5 (e) -3/8 b What is the third biggest value in -35731, 2/3, -5? -35731 What is the fourth smallest value in -2, -1/9, -0.05, 1, 1/6? 1/6 Which is the third smallest value? (a) 0 (b) 614 (c) -17 b What is the smallest value in -3/2, -18, 1/2, 209? -18 What is the smallest value in 5, 0.0016, 24? 0.0016 Which is the second biggest value? (a) 0.22 (b) 4 (c) -36.2 (d) 0.5 d What is the second smallest value in -4, -7, -0.2, -79.5, -2/5? -7 What is the fourth smallest value in 1.4, -5/4, -1/6, 0, -0.07? 0 Which is the second biggest value? (a) -387 (b) 4 (c) -0.3 (d) 0.1 (e) 0 d What is the third smallest value in -4, 2/11, 9, -6, -2, 387/4? -2 What is the second smallest value in 4, 2/15, 0.003965, 2/11? 2/15 What is the second biggest value in 2/11, 0.1, -10/9, 2209, -2/13? 2/11 Which is the smallest value? (a) 0 (b) 1 (c) 5 (d) -15.3 (e) 3 d Which is the biggest value? (a) 0.3 (b) -72127 (c) -2 a What is the fourth biggest value in 759, 0.3, 2/11, -2? -2 Which is the third biggest value? (a) 9 (b) 0 (c) -2/15 (d) 87 (e) 1 (f) 2 f Which is the biggest value? (a) -0.5 (b) -3 (c) -14.76 (d) 2/3 (e) 22 e What is the fourth biggest value in -0.4, 3, -10/17, -2? -2 What is the fifth smallest value in 0.2, 3/4, 0.241, 2, 2/3? 2 Which is the third biggest value? (a) 6 (b) 2 (c) -0.16 (d) 152 b What is the second smallest value in 0.07, 5, -272.32? 0.07 Which is the second smallest value? (a) 1/12 (b) 0.2 (c) -118/11 a What is the biggest value in 0.011, -1, 18? 18 Which is the third biggest value? (a) -3/16 (b) 2 (c) 5316 (d) -0.2 a Which is the biggest value? (a) 5 (b) 0.52192 (c) 0.1 a What is the third smallest value in -3/10, -0.4, 22/51, 0.4, 2/7, -0.2? -0.2 What is the second biggest value in 50, -5, -2, 5/2, -3? 5/2 What is the smallest value in -2/19, 24/77, -4, 1/5? -4 Which is the third smallest value? (a) -137 (b) -2/13 (c) 9/4 (d) 3/4 d What is the third smallest value in -1/5, -1, 3/94105? 3/94105 Which is the smallest value? (a) 0.1 (b) -2.7 (c) 2/5 (d) 3.7 b Which is the second smallest value? (a) 142 (b) -5/6 (c) -50 b Which is the second smallest value? (a) 0.28 (b) -140 (c) -1 (d) 5 c What is the second biggest value in -736, -2/5, -3, -1151? -3 Which is the smallest value? (a) 5 (b) -2637 (c) -6 b Which is the fifth smallest value? (a) 2/9 (b) -376 (c) -2/15 (d) 5 (e) 2 d Which is the third biggest value? (a) 19 (b) -2/5 (c) -91.5 c Which is the fourth smallest value? (a) 2/13 (b) 4/3 (c) -8.01 (d) 5/3 d What is the third smallest value in -0.1, -3/4, 0.3729, 1/2? 0.3729 Which is the third smallest value? (a) 262 (b) -5 (c) -32 (d) 0 d What is the second smallest value in 0.2, -9/2, -3051? -9/2 What is the second smallest value in -0.3, -0.51, 200, -0.1, 0, 4/3? -0.3 What is the second smallest value in -16, 3.999, -7? -7 Which is the second smallest value? (a) -2/11 (b) 5 (c) 340 b What is the second smallest value in -2639, 1/4, 381? 1/4 What is the second biggest value in 1, 3, 5, -4, -0.51? 3 Which is the third biggest value? (a) -1 (b) 65/4 (c) -0.3 (d) 9 c Which is the fifth biggest value? (a) 1/2 (b) -2 (c) -146 (d) -5/6 (e) -5/4 (f) -5 f Which is the fourth smallest value? (a) 0.1 (b) -4 (c) 3 (d) -2 (e) 18687 c Which is the fourth smallest value? (a) 9/7 (b) 0.3 (c) 73 (d) 4 c What is the fourth smallest value in -4/5, 108, 2236, 4? 2236 Which is the third biggest value? (a) 1 (b) -0.18 (c) 0.054 (d) -4 (e) 2 c Which is the fifth biggest value? (a) 11/8 (b) -51 (c) 0.09 (d) 1 (e) -2/7 (f) -1/3 f Which is the biggest value? (a) -5 (b) 76 (c) -1/5 (d) 5 b What is the second smallest value in 27/2, -1/4, 2, -3/2, -2/5? -2/5 What is the third biggest value in 3, 0, -3, -4, 0.5? 0 What is the smallest value in 41, -44/39, 0.1? -44/39 What is the second biggest value in -42, 5/6, 0.4? 0.4 What is the fourth biggest value in -0.36, 2/9, -1, -0.1, -5? -1 What is the second smallest value in 2.3, -0.4, -2, 0.8? -0.4 What is the fifth biggest value in -1, -6, 0, 149, -3, 0.4? -3 What is the fourth smallest value in -1/4, 0.631, 8, -3, 3? 3 Which is the fourth biggest value? (a) -199 (b) -5/6 (c) -0.2 (d) 1.4 a Which is the third smallest value? (a) 0.2 (b) -2.62 (c) -275/2 (d) 4/5 a What is the fourth biggest value in -0.3, 0.2, -5.5, 0, 1/2? -0.3 What is the third smallest value in 0.4, 1/12, -33? 0.4 What is the fourth smallest value in 126824, -1/2, 5, -4? 126824 Which is the biggest value? (a) -2 (b) -124 (c) 0.135 c What is the third biggest value in 1, 0.1, 17.11, -2/9, -0.7, 3? 1 Which is the second smallest value? (a) -1 (b) 0.3 (c) 187 (d) -16 (e) -1/8 (f) -2/5 a Which is the second biggest value? (a) -0.06 (b) 0.04 (c) -15356 a What is the second smallest value in 6, 0.3, 1/3, 345, -2/11? 0.3 Which is the second smallest value? (a) 5 (b) 35 (c) -0.08 (d) 15 a What is the third biggest value in -24, -1, -3, -0.5, 1/7, -5? -1 Which is the fourth biggest value? (a) 0.2 (b) 0.5 (c) 3 (d) 0.046 (e) -10/37 d What is the biggest value in -7, 593, -1/4, -1/3, -2, 2/15? 593 What is the second smallest value in -28/11, 48/7, 0.4? 0.4 Which is the third biggest value? (a) -9 (b) -0.3 (c) -1 (d) -44 a What is the fourth smallest value in 3.4, -3/4, -0.3, -194? 3.4 Which is the smallest value? (a) 42.9 (b) -0.1 (c) 0.3 (d) -10 d What is the third smallest value in -1/6, 0.2, -17/155, 6? 0.2 What is the second biggest value in 1/3, -0.2, -86.39? -0.2 Which is the third smallest value? (a) -0.2 (b) -6 (c) -5 (d) 52 (e) 84 a Which is the second smallest value? (a) -3 (b) 17 (c) 3/2 (d) 586 c Which is the biggest value? (a) -1/6 (b) 4487 (c) 0.2 b Which is the second smallest value? (a) -2 (b) 0.2 (c) 3319/5 b Which is the third smallest value? (a) 8/7 (b) 5 (c) -0.09 (d) -3 (e) 1/33 e What is the fifth smallest value in 6/11, 0, 0.0649, 4/5, -5, 0.5? 6/11 What is the third biggest value in -0.030329, 3/7, -4? -4 Which is the fourth smallest value? (a) 9 (b) 0.1 (c) 45.4 (d) 0.017 (e) -3 a What is the sixth smallest value in -0.2, 0.476, 5, 2, 1/5, -4? 5 Which is the second smallest value? (a) 2/13 (b) 0.1 (c) 1 (d) -7/3 b Wh	{ "pile_set_name": "DM Mathematics" }
z be n(-1). Let b(l) be the second derivative of l4/12 - l3/2 + l*2/2 - 8l. List the prime factors of b(z). 11 Let g(l) = 3l - 1. Let a be g(1). Suppose -v + a + 33 = 0. List the prime factors of v. 5, 7 What are the prime factors of ((-322)/3)/((-4)/6)? 7, 23 Suppose 0 = -5k + 17 - 2. Suppose 4x - 4o = 60, kx + 2o - 39 - 21 = 0. Suppose x = 5l - 32. What are the prime factors of l? 2, 5 Let u = 6 + -3. Suppose 4k + 3 = ui, -3k - 2 = -2i - 0. Suppose k = -5z + a + 74, -a = 4z + 3a - 40. List the prime factors of z. 2, 7 Let u = -4 + 6. Let d(g) = -g*2 - 2g + 2. Let w be d(-2). Suppose -k + 39 = 3y + uy, 2 = -wk. What are the prime factors of y? 2 List the prime factors of (-117)/(-7) + (-20)/(-70). 17 Suppose 5v + 11 = -2k - k, -k + 2v = 0. Let w(n) = n*2 + n + 3. List the prime factors of w(k). 5 Let j(w) = 0w + 4 - 3w - 3 + 8. Let p be j(-9). Let z = p - 22. What are the prime factors of z? 2, 7 Let z = -23 + 75. Suppose 220 = -4u - z. What are the prime factors of u/(-10)(-20)/(-8)? 17 Let w be 3/(6/4) + 1. Suppose 8 = 2y + 4j, 2y = y - 3j + 2. List the prime factors of wy(-1)/(-6). 2 Let g be (-12)/15 - 1/5. Let d be 2 - g/1 - 0. Suppose -3t + 6t + 3l = 9, -t - 3 = dl. List the prime factors of t. 2, 3 Let d = -5 + -17. Let o = 49 + d. What are the prime factors of o? 3 Suppose 167 = -2x + 477. What are the prime factors of x? 5, 31 What are the prime factors of (-993)/(-9) + 5/((-30)/(-4))? 3, 37 Let p be -34(-1)/6. List the prime factors of (p/(-4))/(6/(-132)). 11 Let y be (-2)/3 + 29/3. What are the prime factors of 4 + y/(-3) - -6? 7 Suppose 5h - 103 = 37. Let c = h - 15. List the prime factors of c. 13 Suppose -4i + 2j + 26 = 0, -3j - 2 = 13. List the prime factors of 53/i + 2/(-8). 13 Let i = 9 - 6. Suppose 4s = iu + 21, s + s + 4u - 16 = 0. What are the prime factors of (s/(-4))/((-6)/16)? 2 List the prime factors of (-18)/(-10)20/4. 3 What are the prime factors of 7/9 - 1 - (-4572)/162? 2, 7 Let q = 47 - 1. What are the prime factors of q? 2, 23 Suppose -s - 6 = 6. Let i = s + 25. What are the prime factors of i? 13 Suppose 4k - 9k + 800 = 0. List the prime factors of k. 2, 5 Let i(x) = x*3 + 5x*2 - 8x. Let w(l) = -l + 16. Let s be w(11). Suppose -sa - 29 - 1 = 0. What are the prime factors of i(a)? 2, 3 Let t = 11 - -16. List the prime factors of t. 3 Let p = 83 - -27. What are the prime factors of p? 2, 5, 11 Let v(y) = y3 - 19y*2 - 14y. What are the prime factors of v(20)? 2, 3, 5 Suppose -2z - 16 = -0z. Let a = -6 - z. List the prime factors of a. 2 Let b(k) = -23k2 - 7k - 5. Let d(n) = -12n2 - 3n - 2. Let a(s) = 2b(s) - 5d(s). List the prime factors of a(-1). 13 What are the prime factors of 2/6 - (-4720)/60? 79 Let p = 17 + -2. Suppose -2j - a + 1 = 0, -p = a + 4a. Suppose -jk = k - 27. List the prime factors of k. 3 Let l(s) = -s - 4. Let y be l(-4). Let n be 0/(y + -2 + 0). List the prime factors of 2 - -7 - n/(-2). 3 Let w(c) = -c2 + 9c + 5. Let y be w(9). Suppose u - y = -5h, 2h + 0u + u = 2. Let a(j) = 5j*2 + 2j - 1. What are the prime factors of a(h)? 2, 3 Suppose u + 15 = -3o, 5o + 27 - 2 = u. Suppose u = -f + 4h + 18 + 3, -10 = 5h. What are the prime factors of f? 13 Let y be 0 - (2 + -16 + 3). Suppose -4j + y = -9. What are the prime factors of j? 5 Let w = 12 + -8. Let i = 8 - 6. Suppose 0 = -wt + 14 + i. List the prime factors of t. 2 Let h(s) = 9s2 - 2s - 1. Let l be h(-1). Let g = 30 - l. What are the prime factors of g? 2, 5 Suppose 0x = -9x + 54. Let v(k) = -k*2 + 8k + 2 - 1 - 8. What are the prime factors of v(x)? 5 Let f(o) = o + 3. Let c be f(-5). Let d be c/(-9) - (-100)/36. Suppose -6u + 15 = -du. What are the prime factors of u? 5 Let r(m) = -m*2 - 2m + 2. Let h be r(-2). Suppose 0 = -2g + 14 + h. List the prime factors of g. 2 Let h(s) = 2s. Let p be h(1). Let x(y) = -5y - 9 - py2 - y2 + 4y2. What are the prime factors of x(8)? 3, 5 Let j be 7(23/7 - 3). Suppose -w + jw - 9 = 0. What are the prime factors of w? 3 Let o be (6/(-4))/(6/(-8)). Suppose -ov - v - 2m + 1 = 0, 0 = -v + m - 3. What are the prime factors of (2v)/(6/(-12))? 2 Let j be (-764)/3 - 2/(-3). List the prime factors of (-2)/(-3) - j/6. 43 Suppose v + 2 = 5o, 2v + o + 4 = -2o. Let p = 6 - v. Let l = 4 + p. List the prime factors of l. 2, 3 Suppose 4b = -2o + 1630, -4b + 5o + 1238 = -413. What are the prime factors of b? 409 Let g = 15 + -12. Suppose g = -3w + 108. What are the prime factors of w? 5, 7 Suppose 5f = -0f - 460. What are the prime factors of (4/8)/((-2)/f)? 23 Let b(d) = 2 + 0 - 6 - 3d + 2d. Let q = 13 + -21. List the prime factors of b(q). 2 Let a be 4/52345/14. Suppose 5t - c - a = 0, 3t - t = 5c + 49. What are the prime factors of t? 3 Let q(x) = 8x3 - 2x*2 + x + 1. What are the prime factors of q(1)? 2 Suppose 2x + 120 = v, 0 = -3v - 17x + 14x + 333. List the prime factors of v. 2, 3, 19 Let t = -79 + 125. What are the prime factors of t? 2, 23 What are the prime factors of 15 - 3/(-3 + 0)? 2 What are the prime factors of (-20)/90 + 371/9? 41 Let w(x) = 16x*2 - 1. Let s be w(1). Suppose 3t = s + 6. List the prime factors of t. 7 Let k(r) = -43r + 1. List the prime factors of k(-1). 2, 11 Let w be (35/(-14))/(2/(-4)). Suppose -4i - 19 = -wi. What are the prime factors of i? 19 Let a = -3 + 6. Suppose -2c + 5c = 0. Let m = a - c. What are the prime factors of m? 3 List the prime factors of (-6)/(-2)630/27. 2, 5, 7 Let d(r) = r - 1. Let t be d(1). Suppose 5y + l - 124 = t, 4y + 2l - 71 = 33. What are the prime factors of y? 2, 3 Suppose 10s = 7s + 399. What are the prime factors of s? 7, 19 Let o(x) = x2 + x - 2. Suppose 3t - 2 = 2t. What are the prime factors of o(t)? 2 Let w = 656 - 389. Suppose -w = -5x - 72. What are the prime factors of x? 3, 13 Let s = 83 + 11. What are the prime factors of s? 2, 47 Suppose -3k + 4p = 26, -3p + 4p = 2k + 9. Let y = k - -4. Suppose -4 = -ya + 4. What are the prime factors of a? 2 List the prime factors of 2013/224/6. 61 Let o = 1 + -1. Let n(b) = b3 + b2 + b + 20. Let c be n(o). Suppose -5k + 4l + c = -6, 3k - l = 17. List the prime factors of k. 2, 3 Suppose 2a - 178 = -4c, 0a = 5a + 4c - 433. List the prime factors of a. 5, 17 Let y(o) = 15o*2 - 2o + 2. What are the prime factors of y(1)? 3, 5 Let k = 16 - 7. Let u be 1/(-2) - k/(-2). What are the prime factors of 10 - u2/4? 2 Let k = 62 + -43. List the prime factors of k. 19 Let n = 45 - 13. Let r = n - 17. List the prime factors of r. 3, 5 Let m be (-1)/(-2) - 9/(-2). Suppose v = -m + 1. Let p = v + 11. What are the prime factors of p? 7 Let w be 4/(-10) + (-1008)/105. List the prime factors of (-335)/w - (-2)/(-4). 3, 11 Let p be (-1)/(-3) + 452/(-6). List the prime factors of ((-7)/(-3))/((-5)/p). 5, 7 Let h(o) be the first derivative of o6/45 - o5/120 - 2o3/3 - 1. Let n(p) be the third derivative of h(p). What are the prime factors of n(1)? 7 List the prime factors of ((-101)/2)/((-5)/10). 101 Let t(d) = d2 + 2d. Let c be t(-3). Suppose 0 = -7s + cs + 28. What are the prime factors of s? 7 What are the prime factors of (4 - -196 - 8) + -1 + 0? 191 Let t = 78 - 44. List the prime factors of t. 2, 17 Let q be 8/36 + (-86)/(-18). Suppose qo = 2l - 2 + 8, 0 = -2o + 2l. Let i(x) = 2x*3 - 4x*2 + 2x + 2. What are the prime factors of i(o)? 2, 3 List the prime factors of (-4)/(-2)13 + 1. 3 Let m be 2/4 + 6/(-12). Let n be (-4)/22 + (-97)/11. Let h = m - n. What are the prime factors of h? 3 Suppose 4p - 249 = z - 0z, -z = -p + 63. What are the prime factors of p? 2, 31 What are the prime factors of (82/6)/(1/3)? 41 Let x(b) = -2b*2 - 23b - 13. Let s(t) = -t*2 - 12t - 7. Suppose 3f - 8 = 13. Let u(c) = fs(c) - 4x(c). List the prime factors of u(-8). 3 Let y = -3 - -6. Suppose 4n = p - yp - 22, 3p + 12 = n. Let r = n + 5. List the prime factors of r. 2 Let b = 215 - 123. List the prime factors of b. 2, 23 Let f(b) = 2b3 - b2 + 4b - 4. Let w be f(3). Let m = w - 31. List the prime factors of m. 2, 11 Let t(i) = 4i2 + 3i + 4. What are the prime factors of t(-3)? 31 Let u(j) = -j*3 - 6j**2 - j + 3. Let	{ "pile_set_name": "DM Mathematics" }
1g)(-72g + 3020 - 3020). -2232g*4 Expand -2424b*2 + 24051b*2 + 5908b*2 + (1 - 2 + 3)(3b + b2 - 3b). 27537b2 Expand (0 - 1 - 3)(-4 + 2 + 8)((0z + 15z - 3z)(z + z - 3z) - 7z2 - 20z*2 + 8z*2). 744z*2 Expand -122l*2 + 14l*2 - 92l*2 + (0l - 2l - l)(-l + l + l). -203l2 Expand -191 + 191 - 98h - 1 + 1 - 2h + (3 + 0 + 0)(-18h + 2h - h). -151h Expand 2p3 + p3 - 5p3 + (-5p*2 + 6p*2 + 3p*2)(3 - 2p - 3) + p3 + 671p + 0p3 - 458p. -9p3 + 213p Expand (32 - 32 + 2j2)(366j3 + 60j + 360j3 - 1 - 725j*3). 2j*5 + 120j*3 - 2j*2 Expand (-1 + 2z*5 + 1)(289 + 24 + 180) - 7z2 - 2z*5 - 4z*2 + 9z*2 - 7. 984z*5 - 2z*2 - 7 Expand (159x*4 - 202x*4 - 194x*4)(0x + 2x + 0x + 1 + 2x - 1 + (0 - 3 + 2)(-x + 0x + 2x) + 2x + 1 - 1 + 3x - 8x - 4x). 948x*5 Expand (-38g + 38g + 4g*2)(164 + 168 - 69 + (1 + 0 + 2)(-4 + 2 + 3) - 3 + 2 + 3). 1072g*2 Expand (49343n + 18n2 - 49343n)(0n - 2n + 3n) + (2n - 2n + 2n3)(0 + 4 - 2). 22n3 Expand (45812 + 680c*3 - 45812)(2c - 3c + 0c). -680c*4 Expand (2w*4 + 4w*4 - 4w*4)(-10385w - 34685w - 4769w - 3507w). -106692w5 Expand (4 - 5 + 4)(-8v + 77 - 40 - 38) - 3v - v + 3v + (v + 0 + 0)(2 - 1 - 2). -26v - 3 Expand 2 - 2g*3 - 2 + (698g - 102 + 102)(g2 - 4g2 + g2). -1398g3 Expand (0 - 3 + 1)(-2r + 2r + r)(21311 - 12350 - 12931). 7940r Expand (0m4 - 5m*4 + 2m*4)(29 - 2439m + 27 - 91 + 35). 7317m*5 Expand (-1621k - 2253k - 5258k + 2363k - 2537k + 4k2)(-2k3 + 2k3 - k3). -4k5 + 9306k*4 Expand -3146f + 1 - 1 + 2658f + (4 + 0 - 2)(0f - 2f + 3f) - 3 + 3 + f. -485f Expand (4a2 - 4a2 + a2)(-19a*2 + 117a - 214a + 112a). -19a4 + 15a*3 Expand (-3 - 3 + 4 - d)(-531d4 - 213d*4 + 123d*4). 621d*5 + 1242d*4 Expand (-1 + 6 - 4)(4f + 4 - 4)(-24f - 1 + 15f - 12f + (-f - 2f + f)(1 - 4 + 0)). -60f*2 - 4f Expand -3k2 - 4k*2 + 5k*2 + (0 + 0 - 2k)(-3k + k + 4k) + 0k*2 + 3k*2 - 4k*2 - 6k*2 + 27k - 27k + 107k*2 - 37k*2 + 44k*2. 101k*2 Expand (4r - 730 + 730)(-r + 0 + 0) + (2r - r + 0r)(2 - 2 - r) - 15r2 - 12 + r2 + 13. -19r*2 + 1 Expand (-24 + 24 + 12m)(48m*3 + 50m*3 + 278m*3). 4512m*4 Expand (2x - 3 + 3)(-10x - 34x + 10x)(4 - x - 4)(2 + 0 - 1). 68x3 Expand (m - m + m3)(157451 - 157451 + 312m + m - 2m + 3m + 0m - m + 2m + (-2m + m + 3m)(1 - 4 + 2) - 2m + 1 - 1)(-2m + 4m + m). 933m5 Expand 3z - z + 0z + (-z - z + 4z)(-1 - 3 + 8) + (-16z + 3z - 15z)(-3 + 5 + 0) - 287 + 287 - 83z. -129z Expand (4g*3 - 3g*3 - 3g*3)(15g + 6g - 6g) - 3g*4 - 15g*4 - 33g*4. -81g*4 Expand (3 - 3 + 1 - 2y)(-173y - 256y + 140y). 578y2 - 289y Expand -n - 5n - n + (-21 - 20 + 14)(5 + 3n - 5) + 3n + 0 - 2n + 1. -87n + 1 Expand a*5 - 11a*5 + 6a*5 + (-2 + 2 + 2a)(3a*4 - 3a*4 + 3a*4) + 13a*5 + 276a*2 - 276a*2. 15a*5 Expand (-10 + 5 + 11)(-8v - v - 2v)(-1 + 2 + 0)(-6 - 7 + 1). 792v Expand (3g + 0g - 4g)(-17g + 10g + 2g) - 3g2 + 2g - 2g + (128g - 178g + 111g)(3 + 3g - 3). 185g2 Expand -2r*3 + 17r*3 + 28199r*4 - 28195r*4 + (-10r + 3r - 15r)(3r*3 - 2r3 + r3). -40r4 + 15r*3 Expand 3 - 3 + 26v + 26v - 3v + 6v + 7v + (-1 - 3 + 2)(-2v + 5v - v). 58v Expand i - 3i2 - i - 11i*2 + 19i*2 + 20i*2 + (-2 + 2 - 2i)(0i + 0i - i) + (-3 + i + 3)(0 + 20i + 2 - 2i - i). 44i2 + 2i Expand (-264 + 216 - 113)(-4n*5 + 15n*5 + 4n*5). -2415n*5 Expand (4y - 3y + y)(2y2 + 2y*2 - 3y*2) + 2y3 - y2 + y*2 + 1704y*2 + 4y*3 - 826y*2 - 824y*2. 8y*3 + 54y*2 Expand (2 - 17 + 4)(-2l - 2l + 3l)(-85l - 186 + 94 + 94). -935l*2 + 22l Expand (-1001 + 574o + 1001)(8o + 2o + o). 6314o2 Expand -g2 + g2 + 3g*3 + (-2 + 3 + 1)(-2g2 + 2g*2 - 2g*3) + 11710g*3 - 6g*2 - 10 - 10132g*3 + 10. 1577g*3 - 6g*2 Expand (0n + 4n - 3n)(-2 + 5 - 2)(-5 - 5527n + 5453n + 6). -74n2 + n Expand (0r*2 - 4r*2 + 0r*2 - 5r*2 + 2r2 + r2 + (-r + 0r - r)(1 - 1 - 2r) + r2 + r - r)(5r + 5r + 0r). -10r*3 Expand -406 + 406 + 100z*4 + (-3 + 3 + 1)(2z + 2z*4 - 2z) + (-z + 1 - 1)(19z - 6 - 2z3 - 19z) + 2z4 - 5z*4 + 9z*4. 110z*4 + 6z Expand 5b5 - 2b*5 - 5b5 + (b2 - b2 - b2)(-2b*3 - 4b*3 + 5b*3) + 51329 - 51329 - 9b*5. -10b*5 Expand (12w + 2w - 10w)(-1640w*2 + 225w*3 + 1640w*2). 900w*4 Expand (-1622034 + 987n + 1622034)(0n2 + n2 + n*2) + 3n*3 + 0n*3 + 0n*3. 1977n*3 Expand (-2r2 - r2 + r*2)(64410r + 1257 + 1841 - 64412r). 4r3 - 6196r*2 Expand (-3 + 5 - 1)(-4h + 0h + h) + 36675 - 37281 - h + 0h. -4h - 606 Expand (8 + 2o2 - 3o*2 - 10)(8102o + 1062 + 1066 + 1063 - 3191). -8102o*3 - 16204o Expand 332515 - 332515 - 837q + (1 + 2 - 2)(q - q - q) - q - 2q + 2q - 2 + 2 - q. -840q Expand (-c4 - 2c*4 + 2c*4 + (5c + c - 3c)(0c3 + 4c*3 - 3c3) + c4 + 5c4 - 5c*4)(438 - 129c - 438). -387c*5 Expand (0 + 0 - 2m)(-1 - 2 - 4)(-176m2 - 26m*2 - 69m2 + m4). 14m5 - 3794m*3 Expand (-16i*3 + 3i3 - i3)(-63i - 29i - 67i). 2226i4 Expand (-5 - 1157f + 2287f + 5)(-3f + f + 1 + 6f). 4520f2 + 1130f Expand (t + 0 + 0)(31 - 336 - 381) + (3 - 3 + t)(1 - 1 + 4). -682t Expand (79v + 18 - 18)(-1 - 3 + 5 + (0 - 1 + 2)(-1 - 1 + 1) + 1 - 2 + 2)(-1 + 2 + 2 + (0 + 0 + 1)(-1 + 4 - 5)). 79v Expand (-117 - d - 15d + 115)(71d + 139d + 92d). -4832d2 - 604d Expand -k + 3 - 3 + (-36k - 56 + 56)(3 + 14 - 2). -541k Expand (3o*2 - 3o*2 - 3o*4)(12o + 4o + 7o) + 15o*5 + 14o*5 + 2o*5. -38o*5 Expand (-3247 + 2389 - 3455)(-2b - 3b + 3b)(b*2 + 0b*2 - 2b*2). -8626b*3 Expand (493 + 35v*3 - 493)(16 + 3v - 5 - 9). 105v*4 + 70v*3 Expand (4s*2 - 3s*2 + 2s*2)(-10s + 26 - 10s + 16s + 2s + 3s - 6s + (-1 + 1 - s)(-2 + 1 + 2)) + 3s*3 - 7s*3 + 0s*3. -22s*3 + 78s*2 Expand k + 0 + 0 - 29 + 24k + 29 + (-3 + 0 + 2)(-4 - 2k + 4) - 2 + 2 - 5k. 22k Expand (105 - 85 - 70)(3z - z - z) - 4z - 3z + z. -56z Expand (-4 + 0 + 2)(17o4 - 3632 + 1813 - 3o + 1817). -34o4 + 6o + 4 Expand -61r5 - 9r*5 + 534r*5 + (-2r + 2r - 2r)(3r4 - r4 + 0r4). 460r*5 Expand (-1 + 5 - 3)(-2 + 1 - 1)(z + 2z - z)(2 + 3 - 3)(-2 + 2 - 2)(-13 + 16 - 12). -144z Expand (-7 + 7 + c*3)(0c + 0c + 2c) + (2c*2 - 10c*2 - 75c*2)(2c2 + 2c - 2c). -164c*4 Expand (21 - 13 + 5)(2 + 2a + 17 + 10 - 3). 26a + 338 Expand (-5u + 2u + 2u)(12u3 - 1 + 1) + 57u*4 + 83u*4 - 40u*4. 88u4 Expand (t4 - 3t4 + 4t*4 + (-2 + 2t + 2)(0t*3 + 0t3 + t3) + 5t3 - 5t*3 + 2t*4 - 3t*4 + 3t*4 + 2t*4)(-2 + 3 - 4)(89 - 179 - 280). 8880t4 Expand (-433 - n + 749 - n2 - 411)(-189 - 41n*2 + 189). 41n*4 + 41n*3 + 3895n*2 Expand 571j*2 - 95 + 63 + 34 + (j - 6j + 3j)(3j + 0j - j). 567j2 + 2 Expand (-1 - 2f + 1)(-f2 - f2 + 0f*2 + (-3 + 3 + 30f)(-2f - 4f + 3f) + 2f + 0f*2 + 24f*2 - 5f*2). 146f*3 - 4f*2 Expand (2l*2 + 0l*2 - 7l*2)(5 - l - 6 + 3l) + (0 + 2l*2 + 0)(-15l + 60l - 108l). -136l*3 + 5l*2 Expand (-q + 3q - 20q + 13q + 42133q2 + 5q)(-2q + 3 - 3). -84266q3 Expand (5m4 + m4 - 4m4)((1 + 0 + 0)(0 + 2 - 4) - 4 + 5 - 2 + 407 + 546 - 1598)(-2m - 3m + 0m). 6480m*5 Expand (f + f + 0f)(-3f + 0f + 5f) + (1 - 1 + f)(3 + 8f - 3) + 3f2 - 3f*2 - 3f*2. 9f*2 Expand (34 + 49 + 11 - 16)(0m2 + 11m*2 - 3m2 - m2 + 2m2 - 2m*2 + (-2m*2 + 3m*2 + 0m*2)(0 - 2 + 0)). 390m2 Expand (3 - v - 3)(17v2 - 7v*2 - 19v*2)(-32 - 1 + 4)(-1 + v + 1) + (-v4 + 0v*4 + 0v*4)(-3 + 0 + 1) - 2v3 + 2v3 + v4. -258v4 Expand (-4c*2 - 2c*2 + 4c*2)(-196 + 574 + 62 + 39 - 9). -940c2 Expand (-d + 2d*2 + 4d*2 + 0d)(42d + 530 - 531 - 15d). 162d*3 - 33d*2 + d Expand (-448t - 462t + 69t + (0t - t + 0t)(-5 + 3 + 0))(-1 + 1 + 1). -839*t Expand	{ "pile_set_name": "DM Mathematics" }
Suppose 0 = d - 5d. Let q be (1 + -4)(d + -5). Suppose -2r = -3b + r, 0 = 5r - q. Solve 2y + 10 = 0, -6i + 2i - b = 3y for i. 3 Suppose 7i - 5i = -4. Let u be i(-22)/(-8)-2. Suppose -u = -4a + 13. Solve 2n + 19 = -5f + an, -2f - 3n = 3 for f. -3 Let l be ((-16)/20)/((-4)/10). Suppose 0 = -lc + 3 + 1. Solve 0 = 4x + 3s - 5, -cx - 4s = -0s for x. 2 Suppose 3x + 3t - 9 = t, x = -3t + 3. Solve 2h = 3d - d + 16, 0 = 4h - xd - 28 for h. 4 Let t(v) = -v*2 - 2v + 3. Let w be t(-3). Let m(r) = r - 3. Let g be m(4). Let f be 1(g - 31)/(-3). Solve -3s + 4h = f, ws + s = -h - 1 for s. -2 Let k = -97 + 100. Solve 2f + 21 - 6 = -3s, -15 = -2f + ks for f. 0 Suppose -3k = y - 2, 4k + 0k - y = 12. Solve -i - 3b = -b + k, -b + 8 = 5i for i. 2 Suppose 2c + 20 = l - 5, -30 = 2c - 2l. Suppose s = 5k + 40, 4k + 3s + 13 = -0k. Let d = k - c. Solve -5q = dj + 40, 5j - 5q + 10 = -2q for j. -5 Suppose x - 6 = -t, -3t + 5x = -7t + 26. Suppose 5w + 3 - 13 = -5g, 0 = -g - 2w - 1. Suppose d - g = t. Solve d = -5z - 3u, -4z = 4u - 2u + 6 for z. 0 Let q = -5 - -3. Let i be (-5)/(-2) - 1/q. Suppose iw = 2 + 7. Solve -5y - 4k - w = -0y, -5y = -3k + 24 for y. -3 Suppose -15 + 5 = -5b. Suppose r + 2y = 4 + 1, -b = -r + y. Suppose -5a - 3t = -135, -rt - 4 = 11. Solve 4u + 7 = -5v - 10, 5u - a = 4v for v. -5 Suppose 5s - 29 = -d + 88, -3s = -d - 75. Let i be (-1)/(-23/s). Suppose in - 8 = 2h, -2h - n + 0 + 2 = 0. Solve -t + 2g + 6 = h, 2t + 0g = g for t. -2 Let a(b) = -b + 19. Let m be a(16). Solve mz + 9 = 4u, 0 = -4z + z + 3 for u. 3 Suppose 0 = -3z - 5f + 14, -4z + 3f - 2f = -11. Suppose 0 = -3l + r + 4, 0l + 2 = 3l - 2r. Solve -lw = -o + z, 2o - 10 = 5w - 0o for w. -4 Let m be 1(-1 - 1)-1. Let k be (20/(-6) + m)-3. Suppose -2x + 5y = -6, -5x = ky - 36 - 12. Solve -t + 2z + x = -3t, 5t + 16 = -4z for t. 0 Let t(r) = -r3 - 6r*2 - 2r - 7. Let o be t(-6). Suppose -265 = -op - 0p. Solve 5c - 4g + 18 = p, -c + g = -8 for c. 3 Let p = 31 - 25. Solve -t - 3 = n, -4t - p = -2 for n. -2 Suppose -2s - 4 = 0, -4w - w + 8 = s. Solve -2g + 0 = 2v + 4, 0 = -wg + 4v - 22 for g. -5 Let f(c) = -7c*2 + c. Let r be f(1). Let h be r + 3 + -3 + 14. Solve -3p = 2p - 5, -n = 4p - h for n. 4 Let u(b) = b*3 + 4b*2 + b - 2. Let s be u(-2). Let j(r) = 2r - 4r - s + 3r. Let a be j(6). Solve 0 = 5z + d + ad + 12, d = 2z + 7 for z. -3 Suppose -o + 3k - 8 = 5k, 4o - 5k - 20 = 0. Suppose 0q + 2q = o. Suppose -3 = -a - q. Solve 4s - 3w = -9, -w = -aw + 6 for s. 0 Let n(a) be the second derivative of 0 + 0a2 + 2a + 1/2a3. Let h be n(2). Solve 0 = -2w + t + 9, 0 = w - 2t - h - 6 for w. 2 Suppose -4u = 12, 6 = -2a - a - 4u. Suppose -4d + 18 = -ap + 2, 5d = 3p + 22. Solve o + 2o - 4m = -7, do = 4m - 2 for o. -5 Suppose 4 = 4t - 4. Solve -3h = -5h - 2w - 6, 6 = h - tw for h. 0 Let j be (3/3)/((-1)/(-5)). Suppose -z + 0z - 15 = 0. Let p be 8/(-10)z/6. Solve -p = -n, 5n + j = r + 4r for r. 3 Suppose g + 3g = 36. Suppose -11 - g = -5q. Solve b + 19 = 4s + 3, -qs + 3b + 16 = 0 for s. 4 Let n = -1 - -2. Let w = 4 + n. Solve 2u + wt + 2 = -0t, 3t + 4 = -4u for u. -1 Suppose -14 - 13 = -3k. Let h(q) = q*2 - 4q - 3. Let d be h(5). Suppose 4j - 14 = -d. Solve jg - a = 17, -a = 3g - k - 4 for g. 5 Let o = -91 - -94. Solve op - 2 = -3h - 8, -20 = 3h - 4p for h. -4 Let c be 7/((-28)/16) + 30. Solve 0 = 4y - 3a + 10, -2y - c = 3y + 3a for y. -4 Let v = -53 - -96. Suppose -4t - 3j - 49 = 0, -3j = -5t - v + 2. Let r = -6 - t. Solve rg = 5x + 21, 25 = -2g + 7g - 5x for g. 4 Let a = 70 + -68. Let g(s) = 0s2 - 3 - s3 + 1 + 3s2. Let b be g(a). Solve -2x + y - 6 = 0, bx - 2y + 0y + 10 = 0 for x. -1 Let p(n) = 14n - 42. Let a be p(3). Let l(f) = -f*2 + 21. Let m be l(0). Let g be (2 - 3)(2 + -17). Solve 5j - 5d - 14 - m = a, 3j = d + g for j. 4 Let h be (2/(-2))/(3/(-15)). Suppose m - hb + 15 = -1, -5b + 40 = 5m. Solve -y + 2 = 2s - m, 4s = -5y for y. -4 Let u(a) be the first derivative of 9/2a*2 - 1/3a*3 + 2 - 9a. Let d be u(7). Solve 3c = -dh - 32 - 2, c - h = 2 for c. -3 Let w(h) = h*3 + 2h*2 - 6h - 1. Let q be w(-3). Solve -2a = -v + q, 5v + 7a = 3a - 30 for v. -2 Let j = -54 - -59. Solve t - 2i = j, 3t = -t - 3i + 20 for t. 5 Let u be ((-2)/6)/(8/(-24)). Solve s = -3w + 5w - u, -2s = 5w + 20 for w. -2 Let r(o) = o - 4. Let h be r(8). Suppose 0g = -hg + 8. Solve -n = u, 3n + 25 = -gu + 4u for u. 5 Suppose -3m - 2m = 0. Let a be m/((-3)/(-1)) + -1. Let h be 0 + 1 - 1a. Solve 4p - hr - 2 = 0, -3p + 4p + 3r = 18 for p. 3 Let h(o) = 2o2 - 2o + 1. Let p(c) = -c*3 + 9c*2 - 9c + 10. Let f be p(8). Let m be h(f). Solve -19 = t + 5a, mt - a - 15 = -6 for t. 1 Let a be 3/(4/((-80)/(-12))). Let d be (-1)/2(-40)/a. Suppose -u + 8 = 3u. Solve dr - g = 8, 5r + 0g - 13 = ug for r. 1 Let t(f) = -f*3 - 7f*2 - f + 5. Let k be t(-7). Suppose -3r + 4u + k = -7r, 7 = 3r - u. Solve 4j - 5g + 25 = 0, -3g = -3j - 14 - r for j. 0 Let d(u) = -u2 - 10u + 2. Let f be d(-10). Suppose 0 = 4h - 0c + 3c - 19, -19 = -5h + c. Solve 0 = 2r - 0a - a - 10, 0 = hr + fa - 12 for r. 4 Let b be (-1)/(-2) - 6/(-4). Suppose -r - 3y = r - 8, -2 = -4r + y. Suppose x + 0x - 4 = 0. Solve -10 = 3u + bq - r, -xq = 5u + 15 for u. -3 Suppose 0 = -4b + 9 - 1. Let l be 3 + -1 - b-1. Solve -4a + ln = -16, 3a - a + 3n = 8 for a. 4 Suppose 9 = 3l - 2c, -2l - l + c = -6. Let d be (0/(-1) + l)/1. Suppose m - d = 5. Solve -2v = -m, 5 = -5z - v - 12 for z. -4 Let u be 168/18 - 9/27. Let x(j) = j - 1. Let k be x(6). Solve 6 = -3h, p - 3 + u = -kh for p. 4 Let n be 60/75 - (-61)/5. Solve -3o - g = -3 + 9, -4o = 3g + n for o. -1 Suppose 0 = 2f - 2i - 3 - 11, -3i = f - 3. Let h(o) = o*3 - 6o*2 + 2o - 8. Let d be h(f). Solve -du + 6 = -k - 10, -3u - 5k + 12 = 0 for u. 4 Let z(j) = 3j + 10. Let t be z(-6). Let u = t + 10. Solve 0 = -3d + 9, -a + ud = -d + 8 for a. 1 Let x(i) = i*3 - 13i*2 + 13i - 8. Let z be x(12). Suppose -5w + 4t = -48 + 15, -3t = 6. Let c be ((-3)/w)/(z/(-20)). Solve 4y + l = cy, -l = 3 for y. 3 Let x = -13 - -18. Suppose -6 + 0 = -3b. Solve xg - 24 = 2j, -2 = 4g - bg + 5j for g. 4 Suppose -5s - 7 = 4a, 0 = -2a - 4s - 11 + 3. Suppose -3q = -3, -av + q + 32 = v. Solve 3r + 5 = -2c - 6, -5r + v = -4c for c. -4 Let w be 3 - (-1 - -1)/(-1). Solve -14 = -4i - 3s, -ws + 10 = 2i - 0s for i. 2 Let i be (02/(-8))/2. Let v be (-1 - 3)60/(-16). Suppose i = 2a - a - v. Solve -f + 3q = q - a, 5f + 3q = 10 for f. 5 Suppose 0m = 2m. Solve -4y + 6y + 4 = m, g = -2y - 2 for g. 2 Let x = -30 + 32. Solve -xy = 2d - 4, 2y + 5d = 2 + 5 for y. 1 Let d be 3(-6)/(-9) + -6. Let z be (-1 + d)(-1 - 0). Solve zl - 5h = -4h + 8, -10 = -l + 3h for l. 1 Suppose -3k = -8k + 25. Let x = 2 - -1. Solve 4 = i + xb, ki - 3b = b + 20 for i. 4 Let i(f) = -f + 4. Let w be i(-3). Suppose -3 + w = 2p. Solve -3g + 2j = 15, -3g - 4j + p = -1 for g. -3 Let r = -7 + 10. Let j be 0 + 0 + r + -1. Suppose -jc + 3c = 2. Solve 0u - 7 = u - 3p, -2u + cp - 6 = 0 for u. -1 Let a = -26 - -44. Let x be 17/2 + a/12. Let m = -1 - -1. Solve 5v + x = 5r, mv - 24 = -5r - 2v for r. 4 Let b(m) = -m*2 + 2m. Let a be b(0). Solve -f = -4v - 1, a = 4f + v + v + 14 for f. -3 Let g(j) = -3j + 4 + 7 + 2j. Let q be g(9). Solve w - 18 = -4m, -5m = w - qw - 27 for m. 5 Suppose -z = 4r - 15, -2z - r = -z - 3. Let u be z - -1(3 + -1). Suppose 4 - u = 2f - 3a, -3f - a = -10. Solve 3m - 1 = 4m - 2k, -9 = -fk for m. 5 Let y = -13 + 24. Solve 2t - 21 = 7t + 3v, -3t - v = y for t. -3 Let l = -5 + 26. Suppose -6h - 2 = -4h. Let r be 2 + 1/h - -7. Solve 4g = 5a + 1 - l, 2g + r = 2a for g. 0 Suppose 0 = l + 2l - 4b - 18, -3l + 3b = -15. Solve 0 = k + 4, lu + 18 = -3k - 4 for u. -5 Let o(v) = -v2 + 1. Let w be o(-1). Let d = 6 - w. Let j = 10 - d. Solve -4s = 5p + 37, -p - 40 = 5s + jp for s. -3 Let c = 0 + 0. Suppose -2i + 5i = 75. Suppose -5d + 5v = i, 0d = -4*d - v + 5. Solve d = -k +	{ "pile_set_name": "DM Mathematics" }
i = -84 + 86. Let m(j) = 50j2 + 42j*i - 108j*2. Calculate m(d(c)). -64c*2 Let y(r) = 44r + 581. Let o(g) = 485g. What is y(o(j))? 21340j + 581 Let a(u) be the second derivative of 130u3/3 + 311u. Let r(y) = -y. Calculate a(r(h)). -260h Let w(l) = 260l. Let q(j) = 357802j2. What is q(w(b))? 24187415200b*2 Let y(n) = 12n*2. Let z(g) = -105g*2 - 8g + 17. What is z(y(a))? -15120a4 - 96a*2 + 17 Let f(v) = 37v*2 - 16v - 4. Let b(y) = -2y2 + 4y + 1. Let r(t) = -4b(t) - f(t). Let k(w) = -2w. What is k(r(h))? 58h2 Let w(p) be the third derivative of -p5/60 + 16576p*2. Let m(b) = -6b*2 + 3b. Let a(q) = -q*2 + q. Let s(k) = -3a(k) + m(k). Give w(s(h)). -9h4 Let s(c) = 16c*2. Suppose -7b + 4718 + 1155 = 0. Let g(m) = -1677m + 842m + bm. Give s(g(q)). 256q*2 Let s(r) = 13r - 12r + 9r. Let b = 48 + -39. Let n(v) = -bv + 29v - 16v. What is s(n(u))? 40u Let v = 7538 + -4612. Let c(k) = -k*2 + 4 - 4 - vk + 2926k. Let w(j) = -202j*2 + 2j. Calculate w(c(l)). -202l4 - 2l*2 Let z(a) = -5a2. Let y(f) be the second derivative of -f7/630 - 4f4/3 - f2/2 + 7f. Let j(p) be the third derivative of y(p). Determine z(j(w)). -80w4 Let a(g) be the first derivative of -g3/3 + 1. Let v = 358 + -356. Let z(r) = -5r - v + 11r + 2. What is a(z(d))? -36d*2 Let w = 167 + -169. Let k(c) = -9c. Let a(x) = 9x - 1. Let z(o) = wa(o) - 3k(o). Let r(d) = -2d. Determine z(r(u)). -18u + 2 Let k(i) = -18i. Let s(u) = -19u + 76. Let z(b) = 75b - 285. Let t(g) = -15s(g) - 4z(g). Determine k(t(d)). 270d Let o(t) = -137t + 2. Let i(d) = -11d2 + 14d. Determine i(o(c)). -206459c2 + 4110c - 16 Let h(b) be the first derivative of -2b3/3 - 18. Let y(x) = 6x + 4. Let k(q) = 13q + 9. Let w(t) = 4k(t) - 9y(t). Give w(h(r)). 4r*2 Let i(s) = 5241s*2. Let v(n) = -13n*2 + 5n - 10. Let d(t) = -16t2 + 6t - 12. Let g(k) = -5d(k) + 6v(k). What is g(i(m))? 54936162m4 Let n(d) = 240d. Let a(c) = -70c2 + 39c*2 + 14c*2. Calculate a(n(v)). -979200v*2 Let m(y) = -4y - 3. Suppose 16w + 5g - 10 = 11w, -3w - 7g = -2. Let q(v) be the second derivative of 1/6v*w + 0v*2 - 4v + 0. Determine m(q(o)). -4o - 3 Let j(l) = l + 13. Let n(g) = -411g*2 + 208g*2 + 147g*2 + 141g*2. Calculate n(j(k)). 85k*2 + 2210k + 14365 Let g(v) = 19v. Let t be ((-104)/(-60))/(624/480). Let o(l) be the first derivative of 0l*2 - tl*3 + 2 + 0l. What is g(o(u))? -76u2 Let g(q) = q2 - 48. Let j(x) be the third derivative of -37x*4/24 - 1898x*2. Determine j(g(r)). -37r*2 + 1776 Let g(q) = -147 + 50 + 47 - q + 50. Let s(m) = 305m*2 - 15m. Let n(y) = -152y2 + 7y. Let p(d) = 13n(d) + 6s(d). What is g(p(b))? 146b2 - b Let g(v) = 3v. Let b(p) be the third derivative of -p6/90 + p5/60 + 35p3/6 + 6p*2 + 3p. Let d(k) be the first derivative of b(k). Calculate d(g(s)). -36s2 + 6s Let v(z) = 50587z. Let d(b) = -5b + 11. Give d(v(g)). -252935g + 11 Let k(h) = 0 - 278520h*2 - 2h + 0 + 0h + 278521h*2. Let x(g) = 8g - 2. Determine k(x(m)). 64m2 - 48m + 8 Let w(y) = -90y. Let s(i) = -17i. Let h(m) = 16s(m) - 3w(m). Let c(o) be the first derivative of 41o3/3 - 50. What is c(h(d))? 164d*2 Let l(p) = -2p. Let b(r) = -198r. Let z(f) = f. Let i = -17 - -37. Suppose 3x - i = -x + 4a, 4a = -16. Let q(g) = xb(g) + 165z(g). Calculate l(q(m)). 66m Let k(j) be the second derivative of 3j + 1/6j4 + 0j*2 + 0 + 0j*3. Let z(n) = -22n. Let t(d) = 7d. Let b(v) = -11t(v) - 4z(v). Give k(b(p)). 242p*2 Let q(u) = 10u*2. Let o(g) = -251g*2 + 18g + 3. Let c(y) = -141310y2 + 10140y + 1690. Let r(l) = 3c(l) - 1690o(l). Determine r(q(w)). 26000w4 Let v(w) be the second derivative of -w + 0w*2 - 7/6w*3 + 3. Let p(l) = -33l*2. Determine v(p(n)). 231n*2 Let h(z) = -7513458z*2 + 6. Let o(l) = 2l*2. Give h(o(p)). -30053832p*4 + 6 Suppose 3d - 34 - 8 = 4p, 0 = -2p. Let y(f) = 33f - 7f - 14f - df. Let w(n) = 89n2. Give w(y(a)). 356a*2 Let g(m) = 50m + 17m2 - 35m*2 + 16m*2. Let v(d) = -2d - 24. Let f(k) = 6k + 64. Let l(x) = -3f(x) - 8v(x). Determine g(l(n)). -8n*2 - 100n Suppose 4n - 5k - 46 = 0, -4n + 2k + 10 = -30. Let p(r) = -nr - 2r - 9 - 3r + 9. Let o(f) = -11f. Determine p(o(m)). 154m Let x(l) = -3115481 + 25l + 3115481 - 246l. Let d(y) = -4y. Calculate x(d(r)). 884r Let j(q) = 0q - 2q + 4q - q. Let b(n) = -n*2 - 18n - 14. Let f be b(-17). Let o(k) = -15k2 + fk*2 - 10k*2 + 2k*2. Calculate o(j(t)). -20t*2 Let b(a) = 1104105a. Let i(o) = -556o2. Calculate b(i(h)). -613882380h2 Let q(d) be the first derivative of d3/3 + 39. Let h(p) be the third derivative of 0 + 0p3 + 0p + 5/24p4 + 8p*2. Give q(h(x)). 25x*2 Let i(g) = 4g + 4g + 5g - 20g + 11g. Let w(j) = 325j. Calculate w(i(q)). 1300q Let q(x) = -485662x - 1. Let t(b) = -63b. Give q(t(y)). 30596706y - 1 Let i(h) = -h + 35. Let y(p) = -2p*2 - p + 4839. Give i(y(t)). 2t*2 + t - 4804 Let n(k) = 128k*2 + 5983. Let l(g) = 36g. Calculate l(n(t)). 4608t2 + 215388 Let t(s) = -61718 - 2s + 61718. Let v(a) = -5643a. What is t(v(d))? 11286d Let j(b) = -4b + 5. Let u(h) = -25h + 30. Let w(i) = 6j(i) - u(i). Let z(v) = -76v*2 - 3v - 1. Give w(z(k)). -76k2 - 3k - 1 Let g = -533 - -544. Let t(x) = -gx2 + 14x*2 + 2x*2. Let a(k) = -9k + 3. Determine a(t(l)). -45l2 + 3 Let g(h) = -2h - 24. Let n(w) = 936525w. Calculate g(n(p)). -1873050p - 24 Let t(o) = 93o2 - 3o + 2. Let b(m) = -m - 53493. Determine b(t(u)). -93u2 + 3u - 53495 Let l(n) be the third derivative of n*5/30 + 2n*2 - 437n + 4. Let q(x) = 7842x - 2. What is l(q(p))? 122993928p*2 - 62736p + 8 Let c(f) = 9f2 + 6f + 2. Let m(s) = 13s2 + 9s + 3. Let l(y) = -6c(y) + 4m(y). Let p(z) = 987z2 - z. Determine p(l(u)). 3948u*4 + 2u*2 Let q(l) = -3l. Let b(c) = -626427c + 4. Calculate b(q(j)). 1879281j + 4 Let p(h) = 103290965h2. Let s(d) = d. What is p(s(y))? 103290965y*2 Let t(y) = -117y + 117y + 201y*2 + 204y*2 - 414y*2. Let s(m) = -7m*2 - 4. Let k(a) = -14a*2 - 9. Let i(q) = 4k(q) - 9s(q). What is i(t(z))? 567z*4 Let y(o) = -28331059o. Let n(c) = -5c2. Give n(y(u)). -4013244520307405u*2 Let o(h) = -30h - 46. Let v be o(-2). Let t(u) = 9u - 1 + v - 13. Let y(n) = -22n. Determine t(y(s)). -198s Let b(d) = 3d*2 + 22d + 16d - 5d. Let j(m) be the second derivative of -m*3/2 - 204929m. Give b(j(p)). 27p2 - 99p Let w(g) = 32g. Suppose 112h - 163 - 733 = 0. Let s(l) be the third derivative of 0l - 1/12l*4 - hl*2 + 0 + 0l*3. What is w(s(m))? -64m Let c(n) = 117164775n. Let k(s) = -2s*2. Calculate c(k(f)). -234329550f*2 Let a(k) = 8k - 3k - 5k - 4k + 2k. Let c(f) = -43f - 11. Determine a(c(d)). 86d + 22 Let f(m) = 379m. Let k(c) be the second derivative of c4/12 - 1354c. Calculate k(f(y)). 143641y2 Let j(d) = 2d - 2360. Let y(c) = -c - 441. Calculate j(y(x)). -2x - 3242 Let v(k) = -k2. Let p be (16/2805)/(51/833). Let y(j) be the second derivative of -29j - pj3 + j2 + 0. Calculate y(v(x)). 28x2 + 2 Let w(q) = -3q + 60. Let r(k) = -2k + 36. Let u(i) = 5r(i) - 3w(i). Let t(z) = 1345z. What is u(t(n))? -1345n Let o(c) = 2c*2. Let i(k) = 634k - 417k2 + 3 - 3 - 634k. Give i(o(l)). -1668l4 Let i(j) = -53 + 11j*2 + 81 - 28. Suppose -4 = y - 3y. Let m(v) = 0 - 112v2 + 116v*y + 0. Calculate i(m(w)). 176w*4 Let h(t) = -70149t + 96. Let i(c) = -c. Calculate h(i(r)). 70149r + 96 Let y(b) = -22b2 - 1. Let j be (6 - (-30)/(-4))/(1/(-2)). Let r(p) = -3 - p2 + j - 2p2. Calculate r(y(v)). -1452v*4 - 132v*2 - 3 Let i(a) = -4a*2 - 1559360a. Let g(h) = h. Determine i(g(o)). -4o2 - 1559360o Let z(a) = 6a2. Let d(r) be the first derivative of -7r4/12 - r2 - 27r - 102. Let i(l) be the second derivative of d(l). What is i(z(c))? -84c*2 Let p(o) = 29o*2 - 6o*2 - 13o*2 + 25o*2. Let q(l) = 123 - l - 188 + 65. Calculate q(p(t)). -35t2 Let p(a) be the third derivative of -a5/60 + 4a3/3 + 5985a*2. Let r(z) = 163z. Give p(r(l)). -26569*l	{ "pile_set_name": "DM Mathematics" }
9)? 52 What is the value of 6 + (12 - 26) + 37 - 4 - -14? 39 Evaluate (37 - (44 - 21) - (-2 - -2)) + (-2 - 0). 12 What is the value of 10 - 16 - 3 - (5 - (12 - 2)) - -60? 56 Evaluate 11 + -6 + (3 + 11 - 18) + -3. -2 -324 + 309 + 1 + 30 + -3 + 0 + 103 116 Calculate (86 + -8 - -8) + -11 - 7 - (-10 - -16). 62 What is (45 - (99 - 33)) + (0 - -2 - -9)? -10 What is the value of -43 + 66 + -14 + (1 - (-4 + 0)) + -3? 11 What is (22 - -1 - (-21 + 23)) + 8? 29 (-2 - 0) + (-74 - (14 + 0 + -37)) -53 What is 0 - (-4 - 15 - ((-146 - -10) + -2))? -119 What is the value of (5 - 13 - -3) + -9 - 2? -16 (0 - (-1 + 2)) + 11 + (102 - (514 - 393)) -9 Evaluate -129 + 1 + 10 + 158. 40 12 - (-2 + 7 + -2) - ((-48 - -149) + -39) -53 Calculate (17 - (48 - -7)) + 25. -13 Evaluate (-39 - -63) + -191 - (-54 + 8). -121 What is (22 - 1) + -43 + 68 + -35 + -38? -27 What is the value of 1 + -12 + (-1272 - -1277 - (0 + 1 - 77))? 70 Calculate (31 - -18) + -45 + 32. 36 Calculate -16 + 23 + 10 - (-8 - 1). 26 What is the value of (-47 - -11) + 6 + 3 + -1? -28 Calculate 85 + 38 + -45 + -18. 60 What is (-2 - -101) + -2463 + 2392? 28 (82 - (-19 + 58) - 18) + -55 -30 What is 4 - 27 - -26 - 45 - 0? -42 Calculate (-57 - -91) + 15 + -14. 35 Calculate -5 + (-36 - -25) + 15 + -2 + -38 + -10. -51 6 - (-16 + 18 + 41) -37 What is the value of 87 - (-37 + 97) - ((0 - -1) + 6)? 20 Evaluate (72 - ((-34 - -57) + 7)) + -12. 30 Evaluate -6 - (19 - (-32 - (-18 + 2) - -170)). 129 What is -16 - 0 - (-5 + -11) - 21? -21 Evaluate -28 - -97 - (-4 - -35). 38 Calculate -10 - (7 + -18 + 12 - (1 - (3 - 7))). -6 What is (3497 - 3490) + -4 + -68? -65 What is 18 + 13 + 10 + -50? -9 What is the value of 77 + (-4 - -3) - (23 - (52 - 25))? 80 What is 35 + 16 + -14 + 8 + -17 + 6? 34 What is -1 - 22 - ((-95 - 17) + 32)? 57 Calculate -29 - (121 - 51) - -104. 5 What is 313 - 348 - (-1 - 11)? -23 Calculate 7 + 0 + -12 + -29 + (9 - -18). -7 What is 109 + 41 - 94 - 24? 32 What is the value of -42 + 104 - 80 - (26 + 0)? -44 What is -74 + 70 + (-53 - (-3 - (1 + 0)))? -53 What is 15 - 2 - (-3 - (1 + -9 - (51 - 56)))? 13 Evaluate -96 + 41 - -3 - 11. -63 Calculate 8 - 90 - (12 - 83). -11 What is 11 + -83 + 22 + (17 - -2)? -31 4 + -7 + 9 + (-42 - -35) - 2 -3 Evaluate 0 + (4 - (-27 + 39)) + 7 + (0 - -67). 66 Evaluate (3 - -1) + (11 + -40 - -11 - -11) - 0. -3 Evaluate (-36 + 29 - -178) + -127. 44 What is 33 + (-13 + 8 - -4 - (-6 + 1))? 37 -8 + -3 + (-3 - 11 - -9) + 99 83 What is 47 - (-6 + -1 + 6 + (2 - -5) + -2)? 43 What is the value of -7 - -36 - (261 + -217)? -15 9 - (1 - -3) - (861 - 799) -57 Evaluate -5 - (3428 + -3437 + (-2 - (-2 - 0) - -3)). 1 What is (3 - 5 - (2 + (-32 - -21)) - 23) + -5? -21 Calculate (-2 - (-17 + 30 + -5)) + 41 - -7. 38 Calculate -145 + 296 + -107 + (-163 - -2). -117 Calculate 4 + -3 + (0 - -6) - (-104 - -87). 24 -17 + (91 - 64) + -84 -74 What is (-8 - -1 - 0 - (4 + 21)) + (2 - 0)? -30 What is the value of -9 + 1 + (-10 + 1 + 50 - 8)? 25 Evaluate 71 + -16 + (37 - -9 - 15). 86 Evaluate -8 - (14 + -19) - (2 + 8). -13 Evaluate 2 + -39 + -5 + 5 - (-1 - -4). -40 (29 - -1) + (-83 - -7 - -67) 21 Calculate 1 + (1 - (13 + -1)) - (-254 + (122 - -69)). 53 What is (18 - (-1 - -14)) + -52 + -1 + 6? -42 75 + (-5 - 31) + -73 + -1 + -7 -42 Evaluate (-4 - (-4 - 33)) + -2 + 12. 43 What is the value of (1 - 3) + (31 - (-3 + -6 + 39))? -1 Evaluate 80 + (91 - 58) - 60. 53 What is the value of (6 - -2) + (1673 - 1682) + (1 - -70)? 70 Calculate 45 + (58 - (35 - -42)). 26 Calculate -9 - 16 - (-48 - -4) - (118 + 3). -102 What is the value of (-175 - (118 + -208)) + 71? -14 -2 + 125 - -1 - (739 + -741) - -1 127 Calculate -1 + (7 - (10 + -6 + 7)) + -22. -27 What is -5 - (-1 - -2) - ((296 - -87) + -314)? -75 What is -18 + -6 + (-5 - ((-11 - -18) + -13))? -23 Calculate 27 - (2 + (-15 - 0) + 15 + -18). 43 -11 + (4 - (-59 - -15) - 16) 21 Calculate (73 - 91) + -6 + -24. -48 What is the value of -16 + (41 - (-5 + -25))? 55 -105 - ((-103 - -77) + -47) -32 What is (6 - -11) + -53 + 30? -6 What is 11 + (136 - 99) + 80? 128 (-2 + 77 - 41) + 2 + 55 91 What is (-48 - (0 - -6)) + 23 + (-47 - -13)? -65 Evaluate -45 + (5 - -12) + 3 - -14. -11 What is the value of -38 - (-164 + 14 + 101)? 11 Evaluate 28 + ((-70 - -48) + 31 - 17). 20 Evaluate 16 + 3 + 0 - (16 - -24). -21 What is the value of -32 + -5 + -26 + 11 + 15? -37 Calculate (-20 + 1 - (-105 - -123 - 34)) + -47 + 0. -50 Evaluate 49 - ((19 - 62) + 80). 12 63 + -132 + (105 - 45) -9 Evaluate (-2 - 5 - 3) + (-44 - -45). -9 -4 - (-5 + (4 - -26) + -57) 28 What is (6 - -3 - 5 - 19) + 15 + 0 + 47? 47 Evaluate 1040 - 1052 - (-2 + 4 + -59) - 9. 36 What is the value of 13 + 1 + (-20 - -13) + (-6 - -5)? 6 What is the value of (-5713 - -5845) + -1 + -50? 81 What is (2 - 1) + 50 - (14 + -41 - -58 - 19)? 39 Evaluate 5 + -28 + -28 + (-1 - -11) + 15. -26 What is the value of 44 + (-112 - -34 - 13)? -47 What is 2 - (-162 - -110 - -2)? 52 -35 - (-41 + 93) - (-1 - 15) - 22 -93 Evaluate -2 - -7 - (-73 + 1) - (-196 + 211). 62 Calculate 1 - (-164 + 151 - (-30 - 1)). -17 What is the value of 28 + 3 + (21 - (-15 + 21)) + -15? 31 Evaluate -6 + (23 - (3 - 15)). 29 What is the value of 5 + -2 + -4 + ((11 - 27) + 30 - 4)? 9 Calculate -721 + 742 + (-2 - 21) + 70. 68 What is the value of (1 - 2) + -58 - (-31 - (-28 + -1))? -57 What is 370 + -374 + 4 + (6 - 10)? -4 What is 41 + 20 + -51 - -22? 32 Evaluate -19 + 83 + -81 - 4. -21 1 + 0 + 9 + (7 - 3) + -17 -3 What is the value of (27 - -1 - -6) + (-30 + 17 - -30)? 51 0 + -9 - -23 - (92 + -119) 41 What is 14 + -38 + 49 + -5 - 17? 3 Evaluate 7 + 4 + 18 + -48 + -20. -39 What is the value of -68 - -37 - (51 - 22 - 22)? -38 Calculate -45 - (-31 - (-29 - -9)). -34 What is (-7 + 17 - 10 - -3) + 5 + -6 - 33? -31 Evaluate -37 + 40 + -51 - -30. -18 Calculate -4 + (6 - 12 - -6) + (3 - 9). -10 Calculate 8 - (12 - ((-10 - -21 - 9) + 10 + 96)). 104 Calculate 1 - -41 - (-38 + -11 + (29 - -32)). 30 What is 42 + (3 - 172) + -982 + 967? -142 What is the value of 84 + (21 - 39 - -17) + (1 - 6) + 2? 80 What is 63 + 60 + -101 + 20? 42 (7 - (9 + -7 + 0)) + -7 + -31 -33 97 - 68 - (15 - -2 - 0) 12 What is the value of -86 + 39 + (-126 - -190)? 17 Evaluate 40 - 33 - ((3 - -8) + -1) - (5 + 12). -20 Calculate -87 - ((-74 - 51) + -77). 115 Evaluate 21 + (1 - 1) + 8 + 32 + 32 + -77. 16 What is the value of (-9 - -21) + (39 - (5 + 7))? 39 What is -5 - (11 + -34 + -17) - (-2 + 14)? 23 (37 + 9 - (22 + -2)) + 19 45 Calculate (1294 - 1392) + (61 - -6). -31 What is (-86 - -91) + (2 - -31) + (2 - (-2 - -5))? 37 What is the value of -2 - -1 - (-265 - -262) - 19? -17 Evaluate 6 - (-64 + 44 + 64). -38 Calculate -53 + -16 + -9 + 6 - -14. -58 1 + (2 - 0) + (26 - 35) - 40 - -2 -44 -15 + (-8 - ((5 - 7) + -23)) - -47 49 Evaluate (-38 - (64 - 161)) + -17. 42 -2 + (19 - 21) + 6 - -15 17 Calculate (-4 - -1 - -12) + (22 - 22 - -16) + 11. 36 Calculate -67 - ((114 - 36) + -131). -14 What is the value of 10 - (-9 - (-24 - -3)) - -3? 1 What is the value of (159 - 78) + -23 + (-1 - 2)? 55 Calculate -16 + (-165 - -161 - (-11 - 1)). -8 Evaluate -34 + (7 - (-4 - 17)) + (0 - 23). -29 What is (85 - (19 + 68)) + (13 - 1) - (0 - 46)? 56 Calculate (58 - (13 + -5 - (24 - (-4 + 9)))) + -2. 67 Evaluate 3 + (-38 - (-15 + (-1 - -6) - 0)) + 6. -19 Calculate (-7 - (-11 - (4 - 9)) - -13) + (-149 - -272). 135 What is -430 - -432 - (-4 + -2 + 1) - (-4 - 17)? 28 What is (3 - 28) + 324 + -312? -13 What is the value of 1 - (1 - -6) - (-5547 - -5476)? 65 Evaluate (30 - 40) + 14 - (-58 - -3 - (-5 + 0)). 54 What is the value of (-4 - -15) + (-3 + -8 - -21 - 38)? -17 Calculate 31 + ((2 - 16) + 31 - 3) + -3. 42 What is the value of (1 - 42) + (-433 - -491)? 17 What is (-29 - -3) + -141 + 145 + 45? 23 Calculate -10 - (-1 + -1 - -2) - (-61 - (79 + -112)). 18 Evaluate (0 - -47) + (50 + -48 + 16 - 36). 29 (61 - (92 - -18) - 12) + -3 + (2 - 4) -66 What is the value of 1 + 0 - -17 - (4 + (-22 - -4) + 13)? 19 Evaluate -1 + -9 + ((-53 - -4) + -2 - (-1222 + 1205)). -44 71 + (83 - 91) + -58 5 Evaluate -9 - 1 - (44 + -44) - (-22 + 4 + 5). 3 -30 + 4 + -19 + 26 + 15 -4 (12 - -1) + (22 - (-32 + (-16 - -79))) + 46 50 What is the value of (3 - -46) + 102 + -90? 61 Evaluate -42 - (-15 - -13) - (-12 + (13 - 11)). -30 27 - (-48 - (-33 + -73)) -31 Calculate (12 - 12	{ "pile_set_name": "DM Mathematics" }
4, -5/2, 3/8, 7.9? 7.9 What is the second biggest value in 0.047, 4, 1679? 4 Which is the third biggest value? (a) -2/129 (b) -1 (c) 0.2 (d) -5 b What is the fourth smallest value in -5/3, 19, 13716, -5? 13716 Which is the third smallest value? (a) 6/7 (b) 2/129 (c) 1/5 a What is the smallest value in -109, -227, 1? -227 What is the smallest value in -49.45, -5, -1? -49.45 What is the second biggest value in 16/7, 0.4, 3/50? 0.4 What is the second biggest value in 1, -2, -18.389? -2 Which is the fourth smallest value? (a) 447237 (b) 5 (c) 2/7 (d) 1/5 a Which is the fourth smallest value? (a) 8 (b) 5 (c) 2/67 (d) -0.11 (e) -3/7 (f) -2 c Which is the third smallest value? (a) -2539.3 (b) 4 (c) 0.1 b Which is the fifth smallest value? (a) 6.06 (b) 2/3 (c) 1 (d) 0.95 (e) -1/2 a Which is the second smallest value? (a) -2/7 (b) 22 (c) -1 (d) -40 (e) -4 e What is the second smallest value in -0.06, -1/27370, 0? -1/27370 Which is the third smallest value? (a) 0 (b) 2 (c) 14249/20 c What is the sixth smallest value in -3/2, -0.06, 2, -0.5, 65/43, -3? 2 What is the second biggest value in -3/2, 0.06, -2/11, -353/4? -2/11 What is the third smallest value in -5, -0.4, 101400? 101400 What is the smallest value in -49, 2, -1.2, -5, 3/5, 0.37? -49 Which is the second smallest value? (a) 2659 (b) 9/5 (c) 4 c What is the smallest value in -3/2, 10, -0.08, -5, 1.1, 0.3? -5 What is the fifth smallest value in 0.7, 0.054, 1, -2, -3, 4? 1 What is the fifth biggest value in -11, -0.05, 0.1, -0.3, 6, -7/3? -7/3 Which is the fourth smallest value? (a) 5 (b) -1/4 (c) 1/16 (d) -0.5 (e) 573 a Which is the biggest value? (a) -243 (b) 3 (c) 0.81 b What is the third smallest value in 2, -16, -11, 8/17? 8/17 Which is the fifth smallest value? (a) 0.05 (b) -4 (c) 0.4 (d) -5 (e) -2 (f) -23/5 a Which is the second smallest value? (a) 448 (b) -3 (c) -0.3 c What is the third biggest value in 0.2, -10, -1, 1.00693? -1 What is the second smallest value in -10/21, 1, 0.1, 0.5? 0.1 Which is the fifth smallest value? (a) 8 (b) 0.1 (c) -5 (d) 34 (e) 0.3 d What is the second biggest value in -5/1072, -4, 0.02? -5/1072 Which is the third biggest value? (a) -1036.8 (b) -2/127 (c) 2/7 a What is the fourth biggest value in -1, -3, -165, 5? -165 Which is the fourth smallest value? (a) -4 (b) 215 (c) -3 (d) 100 b Which is the fourth smallest value? (a) -5 (b) 5 (c) -3/7 (d) -5803 (e) -1/6 (f) -1 c Which is the second smallest value? (a) 1493 (b) 1/6 (c) 114.1 c What is the fourth biggest value in 0.4, 7, 2/9, 54, 0.5, 39.8? 0.5 Which is the second smallest value? (a) -0.051 (b) 0.14 (c) -0.21 a What is the third smallest value in 0, 8, 3, -47, 0.3? 0.3 Which is the smallest value? (a) -0.32 (b) -1/4 (c) -69 c Which is the fourth biggest value? (a) -0.23 (b) 0.03 (c) -64/7 (d) -0.2 c Which is the biggest value? (a) -3/4 (b) -4 (c) -12 (d) -2/9 (e) 0 e Which is the third biggest value? (a) 0.2 (b) 0.45 (c) 1 (d) 0.4 (e) 0 d Which is the smallest value? (a) -0.5 (b) 1/2 (c) -2/7 (d) 2/3 (e) -965 e Which is the third smallest value? (a) 1.5 (b) 102 (c) 7 b What is the third biggest value in -0.3, -2.717, 0.5, 3? -0.3 Which is the fifth biggest value? (a) -1 (b) -0.1 (c) 17 (d) -1/4 (e) -0.01396 a What is the second biggest value in -5, -1/9, -1/4, 466/5? -1/9 What is the second biggest value in 9415, -28, -3? -3 What is the biggest value in 0.4, 42, -50/13, 1, 3? 42 Which is the second smallest value? (a) 0.03 (b) 15.4 (c) 1/7 c What is the biggest value in 3, 0.3, -595? 3 What is the third biggest value in -0.4, 5/63, -2, -1/3, 0.5? -1/3 Which is the second biggest value? (a) 4 (b) 0.2 (c) -1/229 (d) 0.7 d Which is the smallest value? (a) 2/13 (b) -0.5 (c) 17/5 (d) 90 b What is the third biggest value in 25, 0.5, -2/25, 0.1, 2? 0.5 What is the second smallest value in -0.567, -12, 4/7, -3? -3 What is the third biggest value in 2/7, -5, 1/943, 38/9, 1? 2/7 What is the fifth smallest value in 2/9, -0.4, 0.5, 18, -4? 18 Which is the third smallest value? (a) -3 (b) 0.02 (c) 3/2 c What is the second biggest value in -132, -2/7, -194? -132 What is the fourth biggest value in -0.4, 0.01, 0.08, 0.5, -39? -0.4 What is the fourth biggest value in -1, -409, 2, -0.035, -3/2? -3/2 Which is the biggest value? (a) 1/9 (b) 1 (c) 2/15 (d) -3/5 (e) 2/13 b What is the third biggest value in 2, -0.0993, -4/3? -4/3 What is the fifth smallest value in -4, -9, -2, 8480, -3? 8480 Which is the third biggest value? (a) -5 (b) -319 (c) 7 (d) 4 a Which is the biggest value? (a) 3 (b) -1/10 (c) 0.7 (d) 50 d What is the third biggest value in 1.8, -4, -1, -1/11, -5? -1 Which is the fifth biggest value? (a) -0.1 (b) 1479 (c) 0.09 (d) 3 (e) 0.2 a Which is the smallest value? (a) 0.4 (b) -1444.5 (c) -1 b Which is the second smallest value? (a) 0 (b) 10688 (c) 7 c Which is the smallest value? (a) -2 (b) -528/13 (c) -1/14 b What is the third biggest value in 3/5, 3.6, -0.0261? -0.0261 Which is the smallest value? (a) -2/7 (b) -2/23 (c) 5 (d) 0 (e) 369 (f) -2/9 a What is the second smallest value in -38/13, 0.08, -11, 1, -10/3? -10/3 What is the third smallest value in 5/2, -2/3, -0.14, 1/6, -0.04? -0.04 Which is the smallest value? (a) -3/4 (b) 2/51 (c) 5 (d) -1 (e) -0.39 (f) 4 d Which is the smallest value? (a) 13 (b) 0.02 (c) 117 b Which is the third smallest value? (a) 1 (b) 3 (c) -2/19 (d) -2 (e) -26 c What is the fourth biggest value in 0.07, 5, 0.4, 18/5, 2/27, -2/3? 2/27 What is the second smallest value in 3, -5, -8/9, 1, 18? -8/9 What is the second smallest value in 23/6, -5/69, 1/5? 1/5 Which is the third smallest value? (a) 0.5 (b) -1 (c) -38.5 (d) -4/35 d Which is the third smallest value? (a) -5 (b) 13847 (c) 0.4 b Which is the third biggest value? (a) 1 (b) 26 (c) -47/4 (d) -95 c What is the second smallest value in 0.02812, -1/5, 63? 0.02812 What is the second smallest value in -5, 219, 2, 37? 2 What is the smallest value in -16, -7, -3, -129/14, 0.06? -16 Which is the second biggest value? (a) 12 (b) -18 (c) -5 (d) 45 (e) 9 a What is the second smallest value in 1, 2, 1/4, -96? 1/4 What is the biggest value in -2/5, 3, 1/2, -28492, -2/11? 3 Which is the biggest value? (a) 1 (b) -5299 (c) 8 c What is the smallest value in 4, -0.19, -2/3, -0.2, 21, 1/6? -2/3 What is the second smallest value in -1.6, 9/13204, 4? 9/13204 Which is the second biggest value? (a) 3 (b) 4 (c) 2/9 (d) 8/43 (e) -4.7 a Which is the biggest value? (a) 5 (b) 90 (c) -1/3 (d) 140 (e) 1/2 d Which is the biggest value? (a) 3 (b) 568.2 (c) -0.12 b What is the fifth smallest value in -0.2, -80, 0.1, 4, -1/22? 4 What is the fourth smallest value in 2, -4/13, 2/101, 0.09? 2 Which is the third smallest value? (a) -5 (b) -18 (c) -32682 a What is the second biggest value in 3, 2/23885, 2/79? 2/79 Which is the third biggest value? (a) -4 (b) -1/3 (c) 3/2 (d) -3 (e) 13/2 b Which is the fourth smallest value? (a) 4 (b) 23 (c) 1/64 (d) -2/23 (e) -0.02 (f) -3 c What is the fourth biggest value in -1/5, 0.05, 0, 3/5, -1/11? -1/11 What is the biggest value in -6, -1.4, -3.33? -1.4 Which is the second biggest value? (a) -5 (b) 63 (c) 6 (d) 4/7 c Which is the fifth biggest value? (a) -0.1 (b) -4 (c) 3/8 (d) -4253 (e) -1 d Which is the smallest value? (a) -2 (b) 0.09 (c) -39856 c Which is the fourth smallest value? (a) 11 (b) -2 (c) 1/4 (d) 2 a What is the second biggest value in -2, -623, -2/3? -2 What is the fourth smallest value in 4/9, 1965, 1, -16/11? 1965 What is the third smallest value in 1.03, -4, 16/5, -1, -2? -1 What is the fourth biggest value in -5/4, -211, 8.2, -3/8, -0.4? -5/4 What is the smallest value in 38.9, 2, -2, -1/8, 9/4? -2 What is the third smallest value in -4, -3, 0, -5.25? -3 Which is the third biggest value? (a) -17 (b) 3/5 (c) 3 (d) 2/5 (e) -3/4 (f) 16 b Which is the second smallest value? (a) -0.114 (b) -5 (c) 1 (d) 1/8 (e) 5 (f) -20 b What is the third biggest value in 0.017, -3, 1.56? -3 Which is the smallest value? (a) 1/5 (b) 2/7 (c) 5 (d) -292 d Which is the second smallest value?	{ "pile_set_name": "DM Mathematics" }
2 - t. Let g be r(1). Let z = -232 + 249. Which is the smallest value? (a) z (b) -3/8 (c) g (d) -3 d Suppose 0 = 206f - 211f - 15. What is the biggest value in f, -1/2, 3/7? 3/7 Suppose -r = -4k, -5r = -2r + 5k - 17. Let n = 8.714 + -5.714. Which is the biggest value? (a) -2/5 (b) n (c) r c Let p = 2761/19425 - -2/2775. Let t = 10 - 3. What is the third smallest value in t, p, -5? t Let g = -52048/75 + 694. Let q = g + -47/75. What is the smallest value in 2, 4, q? q Let i = -484 + 7262/15. Let q = -0.8 + 0. Let u = q + 0.5. Which is the second smallest value? (a) i (b) u (c) -5 b Suppose -4z - 3 - 9 = 0, -3z - 53 = -4x. Suppose -3r + x = 8. Suppose -2n + n = 4. Which is the second smallest value? (a) r (b) n (c) -6 b Let f = 751/7 - 107. Suppose 0 = -3m + 8 + 7. Suppose l = -4r - 4 - 1, mr = l - 13. Which is the third biggest value? (a) l (b) -3 (c) f b Let k = -3 - -2. Let n(t) = -t3 - 5t*2 + 6t - 14. Let o be n(-6). Let y = -350 + 350.2. Which is the second biggest value? (a) y (b) o (c) k c Let o = -256 + 255. Which is the second biggest value? (a) -5 (b) -4 (c) o (d) 2/3 c Let d = -150 + 149.5. Which is the third smallest value? (a) -3 (b) d (c) 11 c Let r be -5(5/(-20) + (-56)/(-96)). Which is the biggest value? (a) -2/23 (b) r (c) -0.2 a Let l = -0.141 - -91.141. Let m = l - 77. Let n = 1699/9 - 189. Which is the third smallest value? (a) -1/4 (b) m (c) n b Let j = 535 + -3747/7. What is the biggest value in 3/5, 4, j? 4 Let y = 3.905 - -0.035. Let v = -0.06 - y. Let t = v - -4.4. Which is the third smallest value? (a) -3/4 (b) -5 (c) t c Let i = -679 + 679.1. What is the second smallest value in 1/5, i, -1, -5? -1 Let u = 1.11 + -70.21. Let w = 69 + u. Let o = -3.3 + 3. Which is the smallest value? (a) o (b) w (c) 0.2 a Let l = -3923/506 + 3/1012. Let r = l - -15/2. Suppose -4j = p - 22, -3p + 10 = 2p. What is the second biggest value in 0, j, r? 0 Let w = -128739 - -127798.89. Let z = w - -936. Let j = 0.11 + z. What is the third biggest value in -5, 6, j? -5 Let x be (-14581)/(-35) - (-3)/(-5). Let b be (-4)/(x/(-140) + 3). Let k = 698/5 + b. What is the second smallest value in 14, -3, k? k Let i = 4052/35 + -616/5. What is the third biggest value in i, 4, 5? i Let u = 207 - 203. Which is the second smallest value? (a) u (b) -47 (c) 0.6 c Let h = 4.01 + -1.34. Let l = 2.7 - h. What is the second smallest value in l, -2/17, -5? -2/17 Let k be (-520)/56 + 14/49. Let w = -17 + 26. Let c = w + -5. What is the biggest value in c, k, -2? c Let h(d) = -d*3 + 6d*2 + 8d - 11. Let v be h(7). Let s be (-6)/4 + v/(-2). Which is the third biggest value? (a) s (b) -1/6 (c) -0.1 b Let f = -25 - -25.41. Let s = -17.41 + f. Let a = 17.5 + s. What is the second biggest value in 5, a, -1? a Let a = -70.2 + 65. Let d = a - -2.2. Let u = 0.3 + 0.2. What is the second smallest value in u, d, -1/7? -1/7 Let q = 14 - 14.9. Suppose 2i = -3f - 33, 47 = -3i - 0i - 5f. Let y be (2/(-3))/((i/(-9))/(-4)). Which is the second biggest value? (a) q (b) -2/3 (c) y b Let j = -0.07 + -0.3. What is the third biggest value in 1/4, 4, j, -5? j Suppose i + 1 = 5n, 24i - 21i - 7 = 5n. Which is the third biggest value? (a) -0.3 (b) n (c) 1.9 a Let m = -1965254832 + 5595080914780/2847. Let f = m + -2/949. Let w = f - 7316/51. What is the smallest value in -5, w, -2/13? -5 Let b = 0.883 + -0.683. What is the third smallest value in 2/5, 16, b? 16 Let z = -8.53 + 8.73. What is the second smallest value in 2/11, -1/4, z, -0.19? -0.19 Let j = -557 + 1119/2. Let h be (-8)/3(-2)/(-24). Which is the biggest value? (a) h (b) j (c) 0.1 b Let f = -3.38 + 2.98. Let h = 3.9 - 4. What is the smallest value in f, h, -0.18? f Let r = 397 - 1589/4. What is the second smallest value in 0.9, -2/37, r? -2/37 Let r = 9.64 + -8. Let n = r - 0.04. Let k = -1.8 + n. Which is the third smallest value? (a) -1/3 (b) 1/7 (c) k b Let y be -4 + 3 + 1/6. What is the smallest value in -5, y, -1/5, 3? -5 Let k = 3.2741 + 1.7259. Let r be 4/10(-2)/4. What is the second biggest value in k, r, 2/71? 2/71 Let w = -26 + 46. Let x = -20.1 + w. What is the third biggest value in 5, x, -0.6? -0.6 Let h = 4087.531 - 4059.5. Let y = h + -0.031. Let k = y + -33. What is the second smallest value in 2, -0.5, k? -0.5 Let s be (0 - 1)/(0 - -2). Let u = -2.75 + 3.94. Let r = u - 0.69. What is the third smallest value in s, 1, r? 1 Let h = 69.3 + -81.7. Which is the second smallest value? (a) -4 (b) -0.1 (c) h a Let i = -208 - -211. What is the biggest value in 0.5, i, -5? i Let k = -19.91 + 20. Let d = 3.04 + -0.04. Let f = -64 + 64.3. What is the third biggest value in k, d, f? k Let i be ((-39)/(-60) - 9/12)/(-7). Let z = i + 16/105. Which is the second smallest value? (a) z (b) 1 (c) 2 b Let r = -24 - -18. Let u = 23 + -26. What is the second biggest value in -2/9, 2, u, r? -2/9 Let q = 1059 - 1058. What is the second smallest value in -1, q, -251/2? -1 Let k = 2658 + -2653. What is the second smallest value in 114, k, 0.5, -2? 0.5 Let r = 546 - 549. Which is the smallest value? (a) 0 (b) r (c) 39 (d) -0.3 b Suppose -2v = -1 - 17. Let l be (-1)/(-4)(11 - v). Which is the third smallest value? (a) 19 (b) l (c) -1/2 a Let z = -715 - -715.3. What is the third smallest value in -5, z, 0.7, -12/11? z Let d(v) = 2v*3 - 3v*3 + 11v - 2v - 10 + 2v*2 + 4v2. Let x be ((-1)/(-2))/((6/28)/3). Let o be d(x). What is the second smallest value in -4, 0.3, o? 0.3 Let n = 20.19 - 19.19. Which is the second smallest value? (a) n (b) 5 (c) 0 (d) 46 a Let x = -553 + 558. Which is the fourth smallest value? (a) -1/7 (b) 4 (c) -6 (d) x d Let g be (-46)/12 - (-2)/(-12). Let f(x) = -x2 - 10x + 8. Let n be f(-11). Which is the biggest value? (a) n (b) g (c) 5 (d) 4 c Let w be 5/(-20)(-8)/13. Let i be (-88)/48 + (-24)/(-18). Which is the second smallest value? (a) w (b) i (c) -10/11 b Let k = 5/39 - -160/273. Let o be ((-77)/35)/((-8)/(-16)) - (-1 + -3). Which is the smallest value? (a) k (b) o (c) -0.5 (d) -0.2 c Let c be 3 - (3 + 0 + -2). Let m be ((-4)/(-6))/(16/108-6). What is the biggest value in m, c, 0.2? c Let z = -208 - -123. Let k = z - 45. Let q be k/(-110) + 0 + -1. Which is the second biggest value? (a) 1 (b) q (c) -4/3 b Let d = 1.259 - 1.188. What is the third biggest value in -1/6, 5, d? -1/6 Let o = 3.391 + -2.391. Which is the third smallest value? (a) -2 (b) -1110 (c) o c Let i(b) = b3 - 3b*2 - 5b - 2. Let c be i(4). Let l = c + 4. Let k be (-10)/40l1. What is the second smallest value in -4, k, 3? k Suppose -5p - 5k = -110, 4k - 42 = -2p - 0k. Let r = 25 - p. Which is the smallest value? (a) -4 (b) r (c) -8 c Let q = 3.0718 - 0.0718. What is the second biggest value in -2/13, 2/5, 10, q? q Let b(j) = -11j - 71. Let u be b(-6). Let k be (-230)/(-660) + (-4)/22. What is the third smallest value in k, u, -3, 0? 0 Let h be 15/(-20)-4 - -1. Let s be (h/5)/((-5)/25). What is the second smallest value in 2, s, 1/5? 1/5 Let i = 7 - 6.94. Suppose d + 6 = 5q, 0 = -d - 6q + q + 34. Suppose 17n - dn - 3 = 0. Which is the third biggest value? (a) 1/4 (b) n (c) i c Let u = -43.8 - -43.5. Which is the second biggest value? (a) u (b) 2 (c) 57 b Let k = -0.17 + -1.63. Let n = 0.2 + 1. Let g = k - n. Which is the second smallest value? (a) g (b) 5 (c) 2 c Let g = 277/3 + -1388/15. Which is the biggest value? (a) -3 (b) g (c) 19 c Let s = -1.08 - -0.9. Let v = -0.82 + s. Let f be (1/(-1))/(1/(-3)). What is the second biggest value in f, 0.5, v? 0.5 Suppose -2v + v = 4d + 53, -4d + 2v - 62 = 0. Which is the smallest value? (a) 4 (b) -4/7 (c) d c Let o = -808543/408 + 32228/17. Let n = 86 + o. Let y = 1/12 + n. Which is the third smallest value? (a) -0.4 (b) 0.1 (c) y c Let k = 104 - 201. Let x = -94 - k. What is the smallest value in -0.5, 2/3, -2/13, x? -0.5 Let x be (-144)/(-216) + (-8)/(-33)-2. Let n = -8 - -6. Let p = 418/13 + -32. Which is the second biggest value? (a) p (b) x (c) n a Let s = -2091 + 2091.5. Let c = -3 + 1. What is the second biggest value in c, 2/5, s? 2/5 Let y = -226 - -225. Let k = -12203/21 + 581. Which is the fourth b	{ "pile_set_name": "DM Mathematics" }
e in d, 0.3, -6? d Let h(r) = r - 4. Let u be h(5). What is the third biggest value in u, 0.01, -3? -3 Let t be 22/30 - 6/15. Let s = 0 - -2. What is the second smallest value in 3/2, t, s? 3/2 Let w(t) = t*3 - 3t*2 - 3t - 3. Let h be w(4). Let i be 0 - h/(-3)1. Let v = -25 + 23. Which is the third smallest value? (a) v (b) i (c) -0.4 b Let o(u) = u3 - 10u*2 - u + 10. Let z be o(10). What is the third biggest value in z, 0.1, 2/13? z Let o = 2.44 + 0.16. Let r = 17 + -20. Let q = o + r. Which is the third biggest value? (a) q (b) 2/9 (c) 1 a Suppose 4m = 3v - 22, 0 = -v - 2m - 3m - 18. Suppose -vy = 2c - 12, 2c = 3y + 4c - 15. What is the third biggest value in -3/8, -5, y? -5 Suppose q - 20 = -q. Let j = q + -5. Suppose 0 = -3h - 1 - 2. What is the third smallest value in 4, h, j? j Let k = -6 + -2. Let g = 13 + k. What is the smallest value in 0.1, g, 4? 0.1 Let s be (0 + 1/(-9))/(-1). Let y be (-72)/105 + (-4)/(-14). Let p = 7 - 5. Which is the third smallest value? (a) y (b) s (c) p c Let i = -0.07 - 4.93. Let z = -97.7 + 93. Let v = -5 - z. Which is the second biggest value? (a) i (b) 5 (c) v c Let z = -0.04 + 2.04. Let p = -1.78 + -0.02. Let j = -2.2 - p. Which is the third biggest value? (a) 0 (b) j (c) z b Let j = 3.9 - -1.1. Let g = j + -7. Which is the second biggest value? (a) 0.5 (b) g (c) 0.1 c Let y = 182 + -182.07. What is the fourth biggest value in 4, -5, y, 5? -5 Suppose -w - 2w = -9. Let q be (8 + 184/(-22))1/(-2). Which is the second biggest value? (a) -2/7 (b) w (c) q c Let l = 0.222 + -2.912. Let f = l + 0.71. Let d = 0.02 - f. What is the third smallest value in -3, 1, d? d Let w(x) = 3x - 3. Let f be w(-3). Let u be (-46)/(-60) + 8/f. Which is the third smallest value? (a) -4/9 (b) u (c) -2 b Let p = -1.3 + 1.8. Which is the third smallest value? (a) -4 (b) -0.2 (c) p c Let f = 20.3 - 22. Let x = -3.3 + f. What is the third smallest value in -3, x, 7? 7 Let f = 51 - 48.1. Let u = f + -1.9. Which is the third biggest value? (a) -0.1 (b) 0.1 (c) u a Let w = 9 + -9. Let k = 4 - w. What is the second biggest value in -1, k, 0.1? 0.1 Let x = 0.06 + 0.84. Let g = -0.8 + x. Which is the smallest value? (a) g (b) 2/9 (c) -2 c Let d(z) = -z*3 - 9z*2 + z + 12. Let u be d(-9). Let v(y) = y + 1. Let h be v(0). What is the biggest value in u, -2, h? u Let p = -60 - -59.5. Which is the fourth smallest value? (a) -2/23 (b) -6 (c) p (d) 2 d Let f = -1.5 + 1.63. Which is the smallest value? (a) -5 (b) f (c) 2 a Let i = -17 + 19. What is the second biggest value in 14, i, 3? 3 Let a = 13/10 - 9/5. What is the third biggest value in -2/5, -1/3, a? a Let p be (-8)/(-36) + (-32)/36. Which is the smallest value? (a) p (b) -3 (c) -3/2 b Let o = 190.92 - 194. Let f = -0.08 - o. Let u = 0.01 - 0.51. Which is the third biggest value? (a) -4 (b) u (c) f a Let p = -34.5 - -18.5. Which is the fourth smallest value? (a) p (b) 4 (c) 0.1 (d) 0 b Let p = 72 + -75. Which is the second smallest value? (a) -1 (b) -1/6 (c) 2 (d) p a Let v = 24 - 24. Let m be (-2 - 0/1)/(-12). Which is the third smallest value? (a) m (b) v (c) 3/5 c Let l be -2 - 2/7 - -2. Let y be (-28)/70 - 64/(-110). Which is the second biggest value? (a) l (b) 2/5 (c) y c Let d = -21 - -21.1. What is the smallest value in d, -4, -5? -5 Let r = 0 - 0. Let i = -91 + 90. Which is the second biggest value? (a) r (b) -4 (c) i c Let d be ((-6)/(-12))/(7/(-2)). Let p = -1.05 + 1. Which is the third smallest value? (a) d (b) p (c) 3/7 c Let v be (-3)/(-5)(-4)/6. Let l = -0.7 - -1. Which is the biggest value? (a) v (b) l (c) -4 b Let q be (3 - 2) + (-24)/20. Which is the biggest value? (a) 6 (b) -4 (c) q a Let b = 0.6 + -1. Let y = 351/7 + -50. What is the second smallest value in b, 2, y? y Let s = -3 + 3.1. Let l = 43.1 - 41. Let m = l - s. What is the smallest value in m, -0.4, 1? -0.4 Let b = -0.5 - -0.1. Let k = 0.4 + b. Let v = 0.5 + k. What is the third biggest value in -1, v, 0.4? -1 Let r be -59 - (-1 - (-3 - 0)). Let w be r/(-59) - 2/2. Let o = -73/413 + w. Which is the biggest value? (a) 3 (b) o (c) -4 a Let w = -1.5 + 1.6. Which is the second biggest value? (a) 2/9 (b) w (c) 1 a Let l be (-4)/(-14) + (-10)/84. Let u be (-2 + 32/10 - 2)5. Let f = 7 + -2. What is the smallest value in l, u, f? u Let c = -157.03 - -157. What is the fourth biggest value in 0.2, 1/3, c, -2/11? -2/11 Suppose -13w + 16w + 6 = 0. What is the third biggest value in 3, -4, w? -4 Let u = -4.007 + 0.007. Which is the fourth biggest value? (a) 1 (b) -5 (c) 4/3 (d) u b Let s = -4 - -6. Which is the biggest value? (a) s (b) -8 (c) 1/2 a Let x = 14 + -8. Suppose -3z + 0 - x = 0. Which is the smallest value? (a) 4 (b) 1/6 (c) z c Let h be (-2)/7 - 37/(-7). Suppose -i + 5q = -24, -3i + 7 = 3q - 5q. Let f be h/15 + (0 - i). Which is the third smallest value? (a) f (b) 0.5 (c) 0.1 a Let m = -20 + 19.8. What is the biggest value in 0.4, m, -1/6? 0.4 Let p be 1275/2475 + (-4)/22. Let n = -3 - -2. What is the second biggest value in n, 5, p? p Suppose 2a + 3 = 3a. Suppose -2x - k + a = 8, -25 = -5x + 5k. What is the biggest value in x, 0.5, -0.4? 0.5 Let u = 23 - 22.89. Let i = u + -5.11. Let n = 0.24 + -0.04. Which is the biggest value? (a) n (b) i (c) -2 a Let o = 0.1 - -0.9. Let f = 0.26 - -12.74. Let v = f - 8. What is the third biggest value in 4, o, v? o Let t be (-8)/(-12) - (-52)/(-42). Which is the third biggest value? (a) 4 (b) -1 (c) t b Let v = 112 - 111.8. Which is the fourth smallest value? (a) -0.5 (b) -0.3 (c) v (d) 6 d Let k = 7 - 5.2. Let m = k + -2. Let i = -5.7 + 5.7. Which is the second smallest value? (a) i (b) -0.3 (c) m c Let j = -3.3 + 2.8. Which is the second smallest value? (a) j (b) -2 (c) -18 b Let p = 13 - 7.5. Let y = p + -5. Which is the third smallest value? (a) 5 (b) 2 (c) y a Suppose -5k = -0 + 5. Let f(l) = -21l - 109. Let x be f(-5). Which is the smallest value? (a) k (b) x (c) 0.1 b Let w = 0.6 - 0.5. Let c = 2.6 - w. Let i = c - -0.5. What is the third smallest value in 5, -1/3, i? 5 Let t = 2.1 - 2. Let d = 1.5 + -1.8. What is the biggest value in t, d, -0.5? t Let f = -1/32 - -81/544. Let o = 7 + -5. What is the second biggest value in o, 0, f? f Suppose -3d + 3 = -2d. Let x(u) = u + 5. Let f be x(-7). Let b = -2 - 2. What is the second smallest value in b, f, d? f Let r = -69 + 31. Which is the second smallest value? (a) -0.3 (b) 1 (c) r a Let y = -6 + 7. Which is the third biggest value? (a) 0.32 (b) y (c) 3/2 a Let u = 63.5 - 63. What is the third smallest value in 4/7, -5, -1, u? u Let f be 1/(-4) + (-19)/4. Let g = 23.1 + -23. What is the second smallest value in 1, g, f? g Let c be ((-3)/(-2))/(3/(-18)). Let a = -12 - c. What is the smallest value in a, -1, -2? a Let h = 12 + -14. Which is the second smallest value? (a) h (b) -3 (c) -1/6 (d) -3/7 a Let o(l) = -l + 6. Let r be o(4). Suppose -1 = -ra - 13. What is the second biggest value in a, -3, 0.3? -3 Let z(x) = -11x - 6. Let c be z(-6). Let t = -1022/17 + c. Let j = -0.2 - -0.4. What is the second smallest value in j, -2, t? t Suppose 4w - 75 = 5. Suppose -w + 2 = -3u. What is the third smallest value in u, 3/4, 3? u Let j be -3 + 1(-21)/(-9). Which is the third biggest value? (a) j (b) 2 (c) -2/17 a Let w be 1(-4 - (-120)/28). Which is the fourth smallest value? (a) w (b) -1 (c) 0.5 (d) -4 c Suppose -10 + 24 = 7y. What is the second smallest value in 0.2, 4, y, 1? 1 Let o = 12 - 10. Let m = -8.06 - -8. Let n = -3.94 + m. Which is the third biggest value? (a) 0.1 (b) o (c) n c Let o = 0.8 + 0.2. Which is the biggest value? (a) -4 (b) -1/5 (c) -0.06 (d) o d Let s = -22 + 21.5. What is the smallest value in 0.1, 5, s, 1? s Let u = 48 + -44. Which is the biggest value? (a) -2 (b) 0.3 (c) u c Let z be (-14)/(-35) - 64/10. Let w(a) = -a*2 - 6a + 5. Let y be w(z). What is the third biggest value in y, -0.4, -1/4? -0.4 Let x = -0.02 + 3.02. Suppose -12 = -4m, -l + 8 = -0m + 2*m. Which is the second smallest value? (a) l (b) -0.3 (c) x a Let n = -25.5 + 25. Which is the biggest value? (a) -5 (b) n (c) 0 c Let j = -0.1 + 0.3. Let	{ "pile_set_name": "DM Mathematics" }
- 13. Let a be -1(v/4 + 1). Suppose -3g = -3f - a, 5 = 3g - 4. Calculate c(f). 2 Let j(f) = f - 7. Let y(c) = 2c - 15. Let p(q) = 11j(q) - 6y(q). Give p(0). 13 Let q(v) = 2v + 4. Let d be q(-3). Let z(t) = 5t3 + 6t*2 + 6t + 3. Let y(c) = -7c3 - 7c*2 - 7c - 3. Let s(u) = 2y(u) + 3z(u). Determine s(d). 3 Let m = -14 - -16. Suppose mw = -w + 15. Let j(n) = -w + 4n - 1 + 3n + 5. Calculate j(-1). -8 Let x(p) be the second derivative of -p3/3 - 13p*2/2 + 46p - 3. Give x(-10). 7 Let d(o) = o*3 - 45o*2 + 38o + 265. Let k be d(44). Let n(a) = 6a3 + 3a*2 + a - 3. Give n(k). 7 Let p(v) = 5v*2 - v - 10. Let k(j) = -4j*2 - j + 9. Let w(q) = -6k(q) - 5p(q). Calculate w(9). 14 Let c(i) be the first derivative of i3/3 - 3i*2 - 3i + 136. Determine c(3). -12 Let l = -14 - -19. Suppose 2j + 12 = 5w + 1, -w - l = -4j. Let p(q) be the third derivative of q5/60 - q4/8 - q3/6 - 5q*2. Determine p(j). -3 Let u(l) = 5l + 4. Let i(p) = p*3 + 4p*2 - 6p + 4. Let w be i(-5). Let h(y) = -20 + w + 6 - 5y. Let x(m) = 3h(m) + 4u(m). Determine x(-1). -4 Let y(w) = -2w*2 - 8w - 12. Let n(z) = -5z2 - 17z - 25. Let o(j) = -3n(j) + 7y(j). What is o(7)? 5 Let b(c) = -2c3 - 15c*2 - 15c + 5. Let m(k) = k*3 + 8k*2 + 8k - 3. Let l(o) = 4b(o) + 7m(o). Suppose -2r - 10r - 36 = 0. Give l(r). 2 Let a(w) = -w + 5. Let n be a(2). Suppose 5l = s - ns - 5, 0 = l - 2s + 1. Let u(c) = 3c3 - c2 + 1. Determine u(l). -3 Let v(o) be the third derivative of o*6/120 + 7o5/60 + o4/12 + 7o3/2 - 43o*2 + 2. Give v(-7). 7 Let v(j) = 4j + 39j2 - 8j - 3 - 28j2 - 3. Let b(u) = u2 - u - 1. Let d(s) = -5b(s) + v(s). Let q = -38 - -39. Calculate d(q). 6 Let d(s) = 7s + 6. Let q(a) = -2a - 2. Let r(k) = d(k) + 3q(k). Let b = 2 - 5. Determine r(b). -3 Let q be (-20 + 19)(5 - 4). Let i(o) = -54o3 - o2 - o - 1. What is i(q)? 53 Let r(w) = -5w*2 + 3w*2 + 2w2 - w2. Give r(-2). -4 Let l(r) = 5r - 11. Let q(g) = -4g + 10. Let k(d) = -3l(d) - 4q(d). What is k(14)? 7 Let j(r) = -6r. Let m = 242 + -244. Give j(m). 12 Let f = 244 + -240. Let g(c) be the first derivative of f - 3c + 3/2c2. Calculate g(-3). -12 Let p(a) = -a + 1. Let t(q) = 2 - 11q + 7q2 - q3 + 2q*3 + 3q. Let c be t(-8). Suppose -5j + ck = -2, 6j = 2j - k - 1. Calculate p(j). 1 Let f(q) = q*3 + 7q*2 + 2q + 9. Let p = 200 - 207. Give f(p). -5 Let z(s) = 25s - 12. Let h(i) = -46i + 27. Let r(c) = 6h(c) + 11z(c). Calculate r(20). 10 Let h(p) = p*2 - p - 1. Let d = -69 + 68. Let q be (21 + -27)d/3. Determine h(q). 1 Let x = 15 - 15. Suppose o = -3r - 3o + 30, x = 2o - 6. Let y(p) = -2p + 7. Determine y(r). -5 Let d(k) = k*3 - 2k*2 - k. Let v = 5 - 7. Let o = -23 + 29. Let p be (-1)/v(o + -8). Determine d(p). -2 Let d be -9((-4)/(-6))/(-2). Let b(w) = -wd + 3 + w + w2 + 2 - 5. Determine b(0). 0 Let w(k) = -k - 6. Let s = -7 + 3. Let x be (-6)/(15/(-6) - s). Determine w(x). -2 Let t(o) = 2o*2 - 229 + 3o*2 - 2o + 230. Let p(v) = -v. Let u be 15/(-10) - 2/(-4). Let f be p(u). Give t(f). 4 Let b be 4/18 + 65/(-9). Let i(u) = u*3 + 103u*2 + u - 11. Let m(n) = -24n*2 + 1. Let g(a) = -i(a) - 4m(a). Determine g(b). 14 Let m(i) be the third derivative of -i5/60 - i4/3 - i*3 - 3i*2 + 3i. What is m(-8)? -6 Let t(n) be the second derivative of -n8/480 + n7/2520 + n6/360 + n5/120 - 9n4/4 - 7n. Let l(p) be the third derivative of t(p). What is l(-1)? 14 Let g be (-2)/(-3)(-14 + 44). Let k = -18 + g. Let o(j) = j - 4j2 + j3 + 4j2 - 1. Calculate o(k). 9 Suppose 5k = 5b - 10, -4k + b = -4b + 11. Let s(c) be the first derivative of -7c4/4 + c2/2 - 174. Determine s(k). -6 Suppose 5u = 5, 2 = 2k - 5u + 3. Let q(l) = 4l*2 + 1. What is q(k)? 17 Let q = -37 - -40. Let d(a) = -2a2 + 5 + a3 + 6 - qa2 - 9. Give d(5). 2 Let u(t) = 3t3 - t2 + 12t - 24. Let w be u(2). Let q(m) = -m2 + 18m + 45. Determine q(w). 5 Let i(x) = 0x + 2x - 3x + 7. Suppose -5y + 31 = -19. Suppose r + r = y. Give i(r). 2 Let c(f) = -1 + 3f2 + 3f - 4f2 + 0f + 4. Suppose 0 = 4v - 4, -3 = a + 4v - 12. Give c(a). -7 Let z = -3 - -4. Let o be z + -2 + 2 + 0. Let j(c) be the third derivative of c5/30 - c4/24 - 5c2. Give j(o). 1 Let j(b) = -4 + 4 - 3 - b2 - 3b. What is j(-2)? -1 Let l = -215 - -223. Suppose -o = 11 - l. Let j(b) = -b2 + b - 1. Let k(q) = -q3 - 9q2 + 6q - 2. Let h(u) = 6j(u) - k(u). Give h(o). -4 Let i(j) = -2j - 6. Let l(p) = -p*3 - 3p*2 + p - 7. Let r be l(-3). Let b be (-30)/1212/r. Suppose 5z + 14 = 4q + 6, q = -bz - 15. Calculate i(z). 2 Let c(l) = -5l - 12. Let t(b) = 19b + 49. Let s(k) = 9c(k) + 2t(k). Let w(m) = 3m + 6. Let p(v) = -4s(v) - 9w(v). Give p(10). -4 Let z(h) be the third derivative of h6/120 + h5/5 + 11h4/24 - h3/3 - 50h2 - 1. What is z(-11)? -2 Let k(b) = b2 + 14b + 12. Suppose r - 32 = 2z - 7, 0 = 5z + 4r + 69. What is k(z)? -1 Let n(g) = -g*3 + 2g + 24 - 8 + 4g2 - 11. Determine n(5). -10 Let s(n) be the first derivative of n2/2 - 3n + 159. What is s(0)? -3 Suppose 0 = 4r - 2f - 4, 3r - 2r = 4f - 6. Let a(i) = -r + i + i - 7 + 14. Let d be a(-4). Let w(x) = x3 + 4x*2 + 3x - 1. Calculate w(d). -1 Let f(d) = d - 1. Let u be 1/2(-3 + -1). Let r = -8 - u. Give f(r). -7 Let y be (11 + -13)/(6/(-21)). Let c(i) = i + 5. Calculate c(y). 12 Let a(z) = -z - 2. Let x(g) = -g2 - 15g - 1. Let f be x(-13). Suppose 3h - j - f = 0, 3 - 4 = j. Suppose 3y = hy + 15. What is a(y)? 1 Let v be 1/(-5) - (-42)/10. Let b(w) be the first derivative of 3w*2 - 44 - 5/3w*3 - 2w + 1/4w4. Give b(v). 6 Suppose -2p = 2p. Let h be -9 + -1 + 1 + p. Let w(j) = 5j + 541 + j*2 - 544 - j + 0j*2 + 5j. What is w(h)? -3 Let x(r) = 3r - 5. Let j(a) be the third derivative of 13a*4/24 - 7a*3/2 + 9a*2. Let u(t) = -2j(t) + 9x(t). Determine u(6). 3 Let n(a) be the first derivative of 0a*2 - 38 + 1/3a*3 - 4a. Determine n(0). -4 Suppose 8l - 10 = 3l. Suppose 3w + 4 - 16 = 0. Let f(m) = 5 + 2m + lm - w + 2m. Give f(2). 13 Let x(z) be the second derivative of z*5/20 - 3z*4/4 + 7z*3/6 + 11z*2/2 - 5z. Let s(a) = -3a + 14. Let n be s(2). Calculate x(n). 3 Let a(q) = -q + 0q2 + 1 - q2 - 7. Let m = -260 + 260. Calculate a(m). -6 Let h be 183/6. Let n(g) = 5g + 3. Let o(c) = -15c - 8. Let f(x) = ho(x) + 11n(x). Suppose 0 = p + 2. Determine f(p). 11 Let r(f) be the second derivative of -f5/20 + f4/3 + f*3 + 4f*2 + 255f. Give r(6). -28 Suppose -v = 23 - 7. Let w be 40/v - (-2)/(-4). Let t(q) = -q*2 + 3q. Let k(o) = 2o2 - 7o - 1. Let d(g) = wk(g) - 7t(g). Give d(0). 3 Let f(h) = -4h + 3 + 3h2 + h2 - 9h2 + 2h*2. What is f(-4)? -29 Let s(u) = -u + 6. Let c = 171 - 96. Suppose -2 - c = -7q. Give s(q). -5 Let p be ((-6)/(-9))/((-2)/(-6)). Let b = -3 + p. Let d(g) = 17g3 + g + 2. Let u(j) = 4j*3 + j + 1. Let x(y) = d(y) - 3u(y). Give x(b). -4 Suppose -41a = -48a - 21. Let j(i) = -2i. Determine j(a). 6 Let k = -357 + 352. Let d(m) be the second derivative of -m5/20 - 5m4/12 + m3/6 + 7m2/2 + m. Determine d(k). 2 Let i(u) = 55u + 17. Let b(r) = -7r - 1. Let h(t) = 8b(t) + i(t). Let x be ((-7)/2 - 0)-2. What is h(x)? 2 Let k = 41 - 41. Suppose 2m = -i - 2 - k, -5m - 2i = 3. Let x(w) = -16w2. Calculate x(m). -16 Let j(x) = 98x - 22x + 21 - 26x - 26x - 23x. Determine j(-14). 7 Let k = 186 + -182. Let n be (2 - 1) + (-3 - -2). Suppose -kh = -8, np + p - 14 = -5h. Let s(t) = t3 - 3t*2 - 5t + 5. What is s(p)? 1 Let a = 47 - 42. Suppose 0 = 3r - v - 3, -3v = 5r + v - a. Let t(d) = 9d3 - d + 1. Determine t(r). 9 Let g(s) be the second derivative of s5/20 + 13s4/12 - 13s*3/6 + 10s*2 - 120s. Determine g(-14). 6 Let c(w) = 5w2 - 4w. Let b(a) = 14a2 - 13a + 1. Let h(g) = 4b(g) - 11c(g). Let v(n) = 2n3 + 10n*2 + 31n + 164. Let o be v(-5). What is h(o)? 13 Let k be 5/2 - (-9)/(-18). Suppose 0 = 3q + 9, -kc = 3q + 14 - 3. Let d(z) = -14z*2 - z + 6 - 5 - 2 - z. Give d(c). -13 Let z(m) = 0m*3 + 2m + m*3 - 2m*2 + 3m + 41 - 43. Let y(j) = -j*2 + 7j + 11. Let	{ "pile_set_name": "DM Mathematics" }
st the prime factors of 3557. 3557 What are the prime factors of 91678? 2, 23, 1993 List the prime factors of 3875. 5, 31 What are the prime factors of 1106? 2, 7, 79 What are the prime factors of 916? 2, 229 List the prime factors of 2586. 2, 3, 431 What are the prime factors of 3533? 3533 List the prime factors of 71010. 2, 3, 5, 263 List the prime factors of 94498. 2, 37, 1277 What are the prime factors of 1125? 3, 5 What are the prime factors of 4982? 2, 47, 53 List the prime factors of 10968. 2, 3, 457 List the prime factors of 42293. 42293 What are the prime factors of 139994? 2, 69997 What are the prime factors of 1001? 7, 11, 13 List the prime factors of 1599. 3, 13, 41 List the prime factors of 1065. 3, 5, 71 What are the prime factors of 8049? 3, 2683 What are the prime factors of 15792? 2, 3, 7, 47 List the prime factors of 342. 2, 3, 19 What are the prime factors of 1223? 1223 List the prime factors of 703. 19, 37 List the prime factors of 31092. 2, 3, 2591 What are the prime factors of 750? 2, 3, 5 List the prime factors of 2532. 2, 3, 211 List the prime factors of 13400. 2, 5, 67 List the prime factors of 44144. 2, 31, 89 What are the prime factors of 23377? 97, 241 What are the prime factors of 90304? 2, 17, 83 List the prime factors of 143. 11, 13 What are the prime factors of 33351? 3, 11117 What are the prime factors of 21069? 3, 2341 List the prime factors of 2387. 7, 11, 31 What are the prime factors of 2369? 23, 103 What are the prime factors of 20960? 2, 5, 131 What are the prime factors of 771? 3, 257 List the prime factors of 64317. 3, 11, 1949 List the prime factors of 24121. 24121 What are the prime factors of 22160? 2, 5, 277 List the prime factors of 11485. 5, 2297 List the prime factors of 4025. 5, 7, 23 List the prime factors of 1052. 2, 263 What are the prime factors of 47701? 47701 What are the prime factors of 588? 2, 3, 7 List the prime factors of 669. 3, 223 List the prime factors of 12210. 2, 3, 5, 11, 37 What are the prime factors of 1395? 3, 5, 31 What are the prime factors of 2153? 2153 List the prime factors of 698. 2, 349 List the prime factors of 40168. 2, 5021 List the prime factors of 6181. 7, 883 List the prime factors of 8996. 2, 13, 173 What are the prime factors of 3072? 2, 3 What are the prime factors of 1373? 1373 List the prime factors of 14101. 59, 239 List the prime factors of 58729. 11, 19, 281 List the prime factors of 1380. 2, 3, 5, 23 What are the prime factors of 816? 2, 3, 17 What are the prime factors of 10278? 2, 3, 571 List the prime factors of 22433. 22433 What are the prime factors of 130747? 17, 7691 List the prime factors of 2732. 2, 683 List the prime factors of 89754. 2, 3, 7, 2137 List the prime factors of 1159. 19, 61 List the prime factors of 2840. 2, 5, 71 List the prime factors of 4133. 4133 List the prime factors of 53664. 2, 3, 13, 43 What are the prime factors of 43? 43 What are the prime factors of 212? 2, 53 What are the prime factors of 1817? 23, 79 List the prime factors of 1790. 2, 5, 179 List the prime factors of 700. 2, 5, 7 List the prime factors of 546. 2, 3, 7, 13 List the prime factors of 6148. 2, 29, 53 List the prime factors of 2904. 2, 3, 11 What are the prime factors of 8161? 8161 List the prime factors of 731. 17, 43 What are the prime factors of 930? 2, 3, 5, 31 What are the prime factors of 24621? 3, 29, 283 List the prime factors of 76366. 2, 38183 What are the prime factors of 168? 2, 3, 7 What are the prime factors of 9835? 5, 7, 281 List the prime factors of 25961. 13, 1997 What are the prime factors of 336? 2, 3, 7 What are the prime factors of 7080? 2, 3, 5, 59 List the prime factors of 1655. 5, 331 List the prime factors of 693. 3, 7, 11 List the prime factors of 43236. 2, 3, 1201 List the prime factors of 1338. 2, 3, 223 What are the prime factors of 79992? 2, 3, 11, 101 List the prime factors of 3789. 3, 421 List the prime factors of 925. 5, 37 What are the prime factors of 1303? 1303 List the prime factors of 10580. 2, 5, 23 What are the prime factors of 449? 449 List the prime factors of 1306. 2, 653 What are the prime factors of 16379? 11, 1489 List the prime factors of 54778. 2, 61, 449 What are the prime factors of 323? 17, 19 List the prime factors of 680. 2, 5, 17 List the prime factors of 55233. 3, 17, 19 What are the prime factors of 6417? 3, 23, 31 What are the prime factors of 135469? 135469 List the prime factors of 63349. 11, 13, 443 List the prime factors of 9082. 2, 19, 239 List the prime factors of 411. 3, 137 What are the prime factors of 1330? 2, 5, 7, 19 What are the prime factors of 10203? 3, 19, 179 List the prime factors of 8245. 5, 17, 97 What are the prime factors of 1006? 2, 503 List the prime factors of 3045. 3, 5, 7, 29 List the prime factors of 660. 2, 3, 5, 11 What are the prime factors of 278? 2, 139 What are the prime factors of 1766? 2, 883 List the prime factors of 54043. 11, 17 List the prime factors of 4413. 3, 1471 What are the prime factors of 64162? 2, 7, 4583 What are the prime factors of 7517? 7517 List the prime factors of 2941. 17, 173 What are the prime factors of 18755? 5, 11, 31 List the prime factors of 2452. 2, 613 What are the prime factors of 11602? 2, 5801 List the prime factors of 5606. 2, 2803 What are the prime factors of 2926? 2, 7, 11, 19 What are the prime factors of 10486? 2, 7, 107 What are the prime factors of 6534? 2, 3, 11 List the prime factors of 3030. 2, 3, 5, 101 What are the prime factors of 36897? 3, 7, 251 List the prime factors of 40569. 3, 13523 List the prime factors of 5803. 7, 829 What are the prime factors of 84571? 23, 3677 List the prime factors of 645. 3, 5, 43 What are the prime factors of 940? 2, 5, 47 What are the prime factors of 2320? 2, 5, 29 What are the prime factors of 90858? 2, 3, 19, 797 What are the prime factors of 123515? 5, 7, 3529 What are the prime factors of 339? 3, 113 What are the prime factors of 4158? 2, 3, 7, 11 List the prime factors of 45540. 2, 3, 5, 11, 23 What are the prime factors of 31671? 3, 17, 23 What are the prime factors of 3756? 2, 3, 313 List the prime factors of 293. 293 What are the prime factors of 7420? 2, 5, 7, 53 What are the prime factors of 21451? 19, 1129 What are the prime factors of 29235? 3, 5, 1949 List the prime factors of 175. 5, 7 What are the prime factors of 20276? 2, 37, 137 List the prime factors of 2639. 7, 13, 29 List the prime factors of 9222. 2, 3, 29, 53 What are the prime factors of 45916? 2, 13, 883 What are the prime factors of 313? 313 What are the prime factors of 1198? 2, 599 What are the prime factors of 19466? 2, 9733 What are the prime factors of 52345? 5, 19, 29 List the prime factors of 99. 3, 11 List the prime factors of 19337. 61, 317 What are the prime factors of 2131? 2131 List the prime factors of 1719. 3, 191 List the prime factors of 3525. 3, 5, 47 List the prime factors of 59887. 59887 List the prime factors of 962. 2, 13, 37 List the prime factors of 38492. 2, 9623 List the prime factors of 10215. 3, 5, 227 List the prime factors of 1683. 3, 11, 17 List the prime factors of 6810. 2, 3, 5, 227 What are the prime factors of 143? 11, 13 List the prime factors of 918. 2, 3, 17 What are the prime factors of 127198? 2, 63599 List the prime factors of 1574. 2, 787 List the prime factors of 39876. 2, 3, 3323 What are the prime factors of 4509? 3, 167 List the prime factors of 192006. 2, 3, 10667 List the prime factors of 3705. 3, 5, 13, 19 List the prime factors of 35656. 2, 4457 What are the prime factors of 43226? 2, 21613 What are the prime factors of 1798? 2, 29, 31 What are the prime factors of 22679? 22679 List the prime factors of 1232. 2, 7, 11 List the prime factors of 590. 2, 5, 59 List the prime factors of 477. 3, 53 What are the prime factors of 1709? 1709 List the prime factors of 2311. 2311 What are the prime factors of 3694? 2, 1847 List the prime factors of 1349. 19, 71 What are the prime factors of 4334? 2, 11, 197 What are the prime factors of 143983? 7, 67, 307 What are the prime factors of 39513? 3, 13171 What are the prime factors of 24554? 2, 12277 What are the prime factors of 292? 2, 73 List the prime factors of 899. 29, 31 List the prime factors of 12032. 2, 47 Lis	{ "pile_set_name": "DM Mathematics" }
nds digit of 3342? 3 What is the hundreds digit of 457? 4 What is the units digit of 12130? 0 What is the units digit of 1669? 9 What is the thousands digit of 5541? 5 What is the units digit of 9482? 2 What is the thousands digit of 3270? 3 What is the thousands digit of 4290? 4 What is the hundreds digit of 322? 3 What is the thousands digit of 1477? 1 What is the hundreds digit of 6545? 5 What is the tens digit of 4134? 3 What is the units digit of 12875? 5 What is the units digit of 2736? 6 What is the hundreds digit of 6926? 9 What is the hundreds digit of 10226? 2 What is the ten thousands digit of 116197? 1 What is the units digit of 54? 4 What is the tens digit of 1399? 9 What is the units digit of 54593? 3 What is the thousands digit of 15801? 5 What is the hundreds digit of 1486? 4 What is the ten thousands digit of 13975? 1 What is the units digit of 2885? 5 What is the hundreds digit of 25269? 2 What is the tens digit of 2048? 4 What is the units digit of 43455? 5 What is the thousands digit of 1479? 1 What is the thousands digit of 2378? 2 What is the units digit of 32392? 2 What is the hundreds digit of 12829? 8 What is the hundreds digit of 8986? 9 What is the ten thousands digit of 49741? 4 What is the hundreds digit of 5284? 2 What is the ten thousands digit of 125263? 2 What is the thousands digit of 52922? 2 What is the tens digit of 8820? 2 What is the thousands digit of 5423? 5 What is the hundreds digit of 661? 6 What is the thousands digit of 34880? 4 What is the units digit of 1645? 5 What is the hundreds digit of 49149? 1 What is the hundreds digit of 6445? 4 What is the hundreds digit of 541? 5 What is the ten thousands digit of 67292? 6 What is the thousands digit of 10620? 0 What is the units digit of 20655? 5 What is the ten thousands digit of 23355? 2 What is the units digit of 4928? 8 What is the ten thousands digit of 41288? 4 What is the units digit of 1784? 4 What is the hundreds digit of 102806? 8 What is the units digit of 2073? 3 What is the thousands digit of 8247? 8 What is the hundred thousands digit of 159313? 1 What is the thousands digit of 5541? 5 What is the tens digit of 2246? 4 What is the thousands digit of 10095? 0 What is the units digit of 2660? 0 What is the hundreds digit of 2569? 5 What is the units digit of 585? 5 What is the units digit of 4685? 5 What is the units digit of 4501? 1 What is the thousands digit of 18905? 8 What is the units digit of 4508? 8 What is the tens digit of 762? 6 What is the thousands digit of 47637? 7 What is the hundreds digit of 6448? 4 What is the thousands digit of 1157? 1 What is the ten thousands digit of 43805? 4 What is the hundreds digit of 4507? 5 What is the ten thousands digit of 17757? 1 What is the tens digit of 29865? 6 What is the tens digit of 653? 5 What is the hundreds digit of 11801? 8 What is the tens digit of 1597? 9 What is the units digit of 5374? 4 What is the tens digit of 1107? 0 What is the hundreds digit of 19293? 2 What is the hundreds digit of 2188? 1 What is the hundreds digit of 9730? 7 What is the tens digit of 3384? 8 What is the hundreds digit of 570? 5 What is the units digit of 5657? 7 What is the tens digit of 1840? 4 What is the units digit of 1121? 1 What is the hundreds digit of 1788? 7 What is the units digit of 243? 3 What is the hundreds digit of 25286? 2 What is the hundreds digit of 22601? 6 What is the hundreds digit of 3774? 7 What is the thousands digit of 2669? 2 What is the units digit of 204? 4 What is the thousands digit of 35633? 5 What is the thousands digit of 7677? 7 What is the units digit of 3561? 1 What is the hundreds digit of 276? 2 What is the hundreds digit of 4225? 2 What is the ten thousands digit of 96908? 9 What is the thousands digit of 2171? 2 What is the ten thousands digit of 86757? 8 What is the hundreds digit of 288? 2 What is the hundreds digit of 36112? 1 What is the ten thousands digit of 64565? 6 What is the thousands digit of 6077? 6 What is the units digit of 54894? 4 What is the hundreds digit of 1309? 3 What is the tens digit of 2336? 3 What is the hundreds digit of 5654? 6 What is the thousands digit of 1651? 1 What is the tens digit of 48? 4 What is the thousands digit of 89069? 9 What is the thousands digit of 10690? 0 What is the tens digit of 1044? 4 What is the units digit of 52665? 5 What is the tens digit of 2187? 8 What is the ten thousands digit of 78579? 7 What is the hundreds digit of 5500? 5 What is the thousands digit of 2462? 2 What is the units digit of 9777? 7 What is the units digit of 34345? 5 What is the thousands digit of 7981? 7 What is the thousands digit of 1661? 1 What is the tens digit of 1162? 6 What is the tens digit of 38126? 2 What is the ten thousands digit of 161194? 6 What is the thousands digit of 4083? 4 What is the hundreds digit of 6041? 0 What is the units digit of 926? 6 What is the hundreds digit of 5822? 8 What is the units digit of 95323? 3 What is the units digit of 41294? 4 What is the thousands digit of 1086? 1 What is the thousands digit of 55488? 5 What is the hundreds digit of 25941? 9 What is the ten thousands digit of 22168? 2 What is the thousands digit of 1129? 1 What is the units digit of 184? 4 What is the hundreds digit of 1508? 5 What is the ten thousands digit of 10059? 1 What is the ten thousands digit of 70686? 7 What is the thousands digit of 2360? 2 What is the units digit of 1802? 2 What is the units digit of 3243? 3 What is the tens digit of 6244? 4 What is the thousands digit of 11295? 1 What is the ten thousands digit of 22397? 2 What is the hundred thousands digit of 113002? 1 What is the units digit of 1760? 0 What is the units digit of 1085? 5 What is the units digit of 3680? 0 What is the hundreds digit of 144585? 5 What is the thousands digit of 8157? 8 What is the hundreds digit of 37917? 9 What is the hundreds digit of 139? 1 What is the hundreds digit of 6432? 4 What is the units digit of 13765? 5 What is the units digit of 9198? 8 What is the hundreds digit of 67962? 9 What is the hundreds digit of 387? 3 What is the units digit of 7332? 2 What is the tens digit of 50273? 7 What is the units digit of 19256? 6 What is the thousands digit of 2390? 2 What is the units digit of 406? 6 What is the tens digit of 497? 9 What is the units digit of 10572? 2 What is the thousands digit of 7949? 7 What is the thousands digit of 71213? 1 What is the tens digit of 95809? 0 What is the tens digit of 2611? 1 What is the tens digit of 82304? 0 What is the units digit of 916? 6 What is the tens digit of 1838? 3 What is the tens digit of 15346? 4 What is the tens digit of 1746? 4 What is the hundreds digit of 2760? 7 What is the thousands digit of 2041? 2 What is the hundreds digit of 354? 3 What is the thousands digit of 4697? 4 What is the units digit of 20144? 4 What is the thousands digit of 95259? 5 What is the units digit of 739? 9 What is the ten thousands digit of 23160? 2 What is the hundreds digit of 4384? 3 What is the thousands digit of 3419? 3 What is the tens digit of 304? 0 What is the units digit of 545? 5 What is the thousands digit of 1606? 1 What is the units digit of 18359? 9 What is the units digit of 8002? 2 What is the thousands digit of 1614? 1 What is the units digit of 12811? 1 What is the units digit of 5290? 0 What is the hundreds digit of 594? 5 What is the hundreds digit of 7570? 5 What is the tens digit of 40745? 4 What is the hundreds digit of 63711? 7 What is the tens digit of 13205? 0 What is the hundreds digit of 28894? 8 What is the tens digit of 1179? 7 What is the hundreds digit of 10176? 1 What is the ten thousands digit of 35349? 3 What is the units digit of 252? 2 What is the units digit of 30447? 7 What is the units digit of 7260? 0 What is the hundreds digit of 84242? 2 What is the hundreds digit of 2010? 0 What is the units digit of 523? 3 What is the hundreds digit of 7634? 6 What is the tens digit of 10181? 8 What is the hundreds digit of 500? 5 What is the ten thousands digit of 30841? 3 What is the thousands digit of 3447? 3 What is the hundreds digit of 17889? 8 What is the tens digit of 7258? 5 What is the thousands digit of 1260? 1 What is the tens digit of 873? 7 What is	{ "pile_set_name": "DM Mathematics" }
es? 21250 How many weeks are there in 181.5972669 microseconds? 0.00000000030026003125 What is 43/2 of a millennium in centuries? 215 What is 3.368718g in tonnes? 0.000003368718 How many millilitres are there in 8.301718l? 8301.718 How many seconds are there in 401.7183ms? 0.4017183 How many millilitres are there in three fifths of a litre? 600 How many minutes are there in 37/2 of a day? 26640 What is 42596.88 kilometers in micrometers? 42596880000000 What is 46357.32 centimeters in micrometers? 463573200 What is 6.117627ng in grams? 0.000000006117627 What is 50671.03 centuries in months? 60805236 What is 8477.61 centuries in decades? 84776.1 What is thirty-two fifths of a gram in milligrams? 6400 What is 3/40 of a litre in millilitres? 75 What is one-hundred-and-one quarters of a milligram in micrograms? 25250 Convert 3793.979 milligrams to grams. 3.793979 What is 5574.805mm in centimeters? 557.4805 How many kilograms are there in 3222.773 milligrams? 0.003222773 How many meters are there in 1/20 of a kilometer? 50 What is 34433.47km in millimeters? 34433470000 How many decades are there in 7/2 of a century? 35 How many nanograms are there in 21/4 of a microgram? 5250 What is one tenth of a millennium in decades? 10 How many millimeters are there in thirty-seven fifths of a centimeter? 74 What is 7/3 of a minute in seconds? 140 How many tonnes are there in 57.83744 micrograms? 0.00000000005783744 How many millilitres are there in fifty-seven fifths of a litre? 11400 What is 4/3 of a year in months? 16 Convert 37.8864 milligrams to micrograms. 37886.4 Convert 0.0118903ml to litres. 0.0000118903 How many decades are there in three fifths of a millennium? 60 How many milligrams are there in 75/4 of a gram? 18750 How many millilitres are there in 15/4 of a litre? 3750 What is 1/10 of a millennium in months? 1200 What is 62015.29g in tonnes? 0.06201529 How many nanometers are there in fourty-four fifths of a micrometer? 8800 How many litres are there in 6028.84 millilitres? 6.02884 How many months are there in 3169.439 decades? 380332.68 What is 5/4 of a litre in millilitres? 1250 What is 1/15 of a week in seconds? 40320 Convert 4.354669 millennia to months. 52256.028 What is 1/4 of a kilometer in centimeters? 25000 Convert 88.07098 hours to milliseconds. 317055528 How many centuries are there in fourty-five halves of a millennium? 225 What is 4/15 of a decade in months? 32 Convert 0.0561182 litres to millilitres. 56.1182 Convert 839.1095 micrometers to kilometers. 0.0000008391095 What is 53807.25l in millilitres? 53807250 What is 6/5 of a decade in years? 12 What is 3/25 of a meter in millimeters? 120 What is one tenth of a litre in millilitres? 100 How many decades are there in 0.975613 millennia? 97.5613 How many centuries are there in 74/5 of a millennium? 148 What is 69.3685ml in litres? 0.0693685 What is one quarter of a micrometer in nanometers? 250 What is 169.70409 months in millennia? 0.0141420075 Convert 9117.664 meters to nanometers. 9117664000000 What is 17/2 of a century in decades? 85 What is 31/5 of a century in months? 7440 Convert 96970.94 centuries to years. 9697094 What is 179.0721 millimeters in kilometers? 0.0001790721 Convert 0.5365475 millennia to decades. 53.65475 What is 27/5 of a litre in millilitres? 5400 How many minutes are there in four thirds of a hour? 80 What is 3/8 of a kilometer in meters? 375 Convert 0.0445319um to centimeters. 0.00000445319 Convert 9.907365 centimeters to kilometers. 0.00009907365 What is 59/5 of a century in years? 1180 Convert 2829.966 tonnes to milligrams. 2829966000000 How many months are there in 6/5 of a decade? 144 What is 51.5228l in millilitres? 51522.8 Convert 0.3130959kg to micrograms. 313095900 What is thirteen fifths of a micrometer in nanometers? 2600 How many nanograms are there in 677888.3g? 677888300000000 How many micrograms are there in twenty-one halves of a milligram? 10500 What is 6.922795 centuries in years? 692.2795 What is 11/2 of a litre in millilitres? 5500 How many microseconds are there in 3/50 of a second? 60000 Convert 31.95633 hours to weeks. 0.19021625 What is 2709.9531 months in years? 225.829425 What is 1/20 of a litre in millilitres? 50 What is fifty-three quarters of a decade in months? 1590 What is 77/3 of a decade in months? 3080 How many millimeters are there in fourty-four fifths of a meter? 8800 How many years are there in 13/5 of a millennium? 2600 What is 96.0111 milligrams in grams? 0.0960111 What is 324124.1kg in grams? 324124100 What is 4/7 of a week in days? 4 How many nanograms are there in 5/4 of a microgram? 1250 Convert 720.1649 micrograms to grams. 0.0007201649 What is sixty-four fifths of a litre in millilitres? 12800 How many micrograms are there in 33/5 of a milligram? 6600 What is fifty-four fifths of a litre in millilitres? 10800 How many micrometers are there in 3/5 of a millimeter? 600 What is 0.3484118 hours in minutes? 20.904708 What is 17/2 of a litre in millilitres? 8500 How many days are there in 51.493347 seconds? 0.0005959878125 How many years are there in twenty-seven fifths of a millennium? 5400 Convert 9.708455 litres to millilitres. 9708.455 What is 11/10 of a litre in millilitres? 1100 What is twenty-one fifths of a millennium in decades? 420 Convert 116481.3 millilitres to litres. 116.4813 What is twenty-one quarters of a meter in millimeters? 5250 How many centuries are there in 4.70799 years? 0.0470799 How many months are there in 5/6 of a millennium? 10000 What is 3/8 of a centimeter in micrometers? 3750 Convert 5578.082 years to millennia. 5.578082 What is seven thirds of a minute in seconds? 140 How many millilitres are there in sixty-three eighths of a litre? 7875 How many years are there in six fifths of a century? 120 What is 7/2 of a century in years? 350 What is 235172.91 months in millennia? 19.5977425 How many kilometers are there in 31.62382 centimeters? 0.0003162382 What is 215.6327 tonnes in milligrams? 215632700000 How many years are there in seven quarters of a century? 175 What is 0.0494644 millilitres in litres? 0.0000494644 Convert 736.4998l to millilitres. 736499.8 How many seconds are there in 1/30 of a minute? 2 How many grams are there in fifty-one quarters of a kilogram? 12750 What is fourty-one halves of a centimeter in millimeters? 205 How many hours are there in thirty-one sixths of a week? 868 What is 9.023852ml in litres? 0.009023852 How many seconds are there in 0.484081 milliseconds? 0.000484081 What is 29/2 of a hour in seconds? 52200 How many months are there in 1084.26 millennia? 13011120 What is thirteen eighths of a centimeter in micrometers? 16250 What is 17/2 of a decade in years? 85 How many microseconds are there in 783936.2 hours? 2822170320000000 How many millilitres are there in 19.45974 litres? 19459.74 What is 1/5 of a litre in millilitres? 200 What is three tenths of a century in years? 30 What is thirteen quarters of a minute in seconds? 195 What is 24.86437 tonnes in micrograms? 24864370000000 How many decades are there in 201857.04 months? 1682.142 How many micrograms are there in 4.568653ng? 0.004568653 What is four fifteenths of a minute in milliseconds? 16000 What is 70058.91 nanometers in meters? 0.00007005891 Convert 29651.81g to milligrams. 29651810 Convert 96.36886 kilometers to meters. 96368.86 How many grams are there in 3/10 of a kilogram? 300 How many centimeters are there in 3/16 of a kilometer? 18750 What is five eighths of a microsecond in nanoseconds? 625 How many micrograms are there in 45/2 of a milligram? 22500 How many millilitres are there in sixty-nine halves of a litre? 34500 Convert 0.2214855 nanoseconds to milliseconds. 0.0000002214855 What is 3.950906t in micrograms? 3950906000000 Convert 10.66172l to millilitres. 10661.72 What is 1/20 of a meter in micrometers? 50000 What is 1/4 of a kilogram in grams? 250 How many weeks are there in 11915.31411 milliseconds? 0.000019701246875 How many tonnes are there in 0.2871051ng? 0.0000000000000002871051 Convert 369.0167km to meters. 369016.7 How many millimeters are there in fourty-five halves of a centimeter? 225 How many nanometers are there in 45398.64cm? 453986400000 What is 0.8807014 nanoseconds i	{ "pile_set_name": "DM Mathematics" }
t u(d) = 3d2 - 11d - 43. What are the prime factors of u(13)? 3, 107 Let n(y) = y*2 + y - 4. Let j be n(-3). Suppose -4 + j = -m. List the prime factors of m. 2 Suppose 9 = -5b + 29. What are the prime factors of b? 2 Let w be 3/9 - 28/3. Let r = 20 + w. List the prime factors of r. 11 Suppose 3q - 15 = -69. List the prime factors of (-462)/q - (-2)/(-3). 5 Let s(c) = 4c*2 + 22c + 5. List the prime factors of s(5). 5, 43 Suppose 0 = -6d + d + 5p - 80, -2p + 56 = -4d. Let l = d + 21. List the prime factors of l. 3 Let m be 541/7 + (-4)/14. List the prime factors of 3017/m - 4/22. 3, 13 Let h = 5 + -2. Suppose 2a = -h + 9. Suppose -35 = -4b - a. List the prime factors of b. 2 Suppose -5v - 2s + 271 = 0, 10s + 285 = 5v + 5s. Suppose 5r + v = 290. List the prime factors of r. 47 Let u be -2 + 2 - 10/1. Suppose 0 = -y + 4x - 58, -x = x. What are the prime factors of 1/5 + y/u? 2, 3 Suppose 1 = -3p + 7. Suppose p + 4 = f. What are the prime factors of f? 2, 3 Let s = 17 - 25. Let y(w) = -w - 2. Let q be y(s). List the prime factors of q/(-15) + 44/10. 2 Let v = -4 + 6. Let u be (1 + v)/3 + -8. Let y = -1 - u. List the prime factors of y. 2, 3 Suppose 0 = -5l + 9l - 588. What are the prime factors of l? 3, 7 Suppose 331 + 179 = 3z. List the prime factors of z. 2, 5, 17 Suppose -n + 2r + 211 = 2n, -4r = -n + 67. List the prime factors of n. 71 Let t be -51 - (-3 + 4). What are the prime factors of 30((-22)/t - 3)? 2, 5 List the prime factors of 1646/14 - ((-36)/21)/4. 2, 59 Suppose 9s - 28 = 5s. Suppose 8g - 6 = sg. What are the prime factors of g? 2, 3 Let z(m) = 3m2 - 2m + 5. Let b(l) = l*2 + 1. Let j(w) = -4b(w) + z(w). Let x be j(-3). What are the prime factors of 2(0/x - -1)? 2 Let i = -26 + 11. Suppose -7k - 8 = -3k. What are the prime factors of k/(17/i - -1)? 3, 5 List the prime factors of (-4)/(-16) + 223/4. 2, 7 Let i = 10 + -5. Suppose 5z = 3q - 4q + 16, iq = 5z - 10. Let v = 14 - z. What are the prime factors of v? 11 Suppose 15 + 17 = -4x. Let o = 16 + x. What are the prime factors of o? 2 Let f be (-30)/(-2)4/6. Suppose 0s = s - f. Suppose -3u - 1 = -s. What are the prime factors of u? 3 Let j = -6 + 3. Let a = 3 + j. Suppose -4m + 9 = 3o, am = -2o + m + 6. List the prime factors of o. 3 Let y(r) be the second derivative of -r5/5 + r4/3 + r3/2 - r2 - 3r. What are the prime factors of y(-2)? 2, 5 Let c(z) = z3 + 5z*2 - 5z + 4. Let p be c(3). Let j = p + -32. List the prime factors of j. 29 Let r be (-1)/(2 + 9/(-5)). Let b(s) = -s*2 - 7s + 7. What are the prime factors of b(r)? 17 Let o = 36 - 18. What are the prime factors of o? 2, 3 List the prime factors of 156/505. 3 Let p(r) = r*2 - 12r - 24. List the prime factors of p(-9). 3, 5, 11 What are the prime factors of 1/((20/(-244))/(-5))? 61 Let w(r) be the third derivative of r*2 + 2r*3 - 1/120r*6 + 0r - 2/15r5 + 0 + 5/12r4. List the prime factors of w(-9). 3 Let s(i) = i2 - 2i - 10. What are the prime factors of s(7)? 5 Let q = 18 + -4. List the prime factors of q. 2, 7 Suppose -1 = -r - 0. Let v = -5 - r. Let w = 11 + v. List the prime factors of w. 5 Let l be (-6)/(0 + -1) + 2. Let o be ((-4)/l)/(1/20). What are the prime factors of (8/o)/((-2)/25)? 2, 5 Suppose -5b = 4i - 64, 2b - 2i - 26 = -4i. List the prime factors of b. 2, 3 Let j = 5 - -17. List the prime factors of j. 2, 11 Let c(y) = -y*3 + 4y*2 + 5y + 4. Suppose 2s + 0q - 16 = 3q, -4q + 7 = 3s. List the prime factors of c(s). 2 Suppose 3r + 4b = 2r - 2, -5b - 1 = 2r. Suppose 5x - 43 = -2k, 3x - x + rk - 22 = 0. List the prime factors of x. 7 Let a(d) = -d*3 - 5d*2 - 4d - 1. Let b be a(-4). Let q be 192/(-9) - b/3. Let i = -8 - q. List the prime factors of i. 13 Let n(d) = 26d3 + 2d. What are the prime factors of n(2)? 2, 53 Suppose 2p - 225 - 7 = -4s, 3s - 229 = -2p. What are the prime factors of p? 2, 5, 11 List the prime factors of (155/10)/((-3)/(-6)). 31 Let d = 100 + -65. Suppose 3a - 8a = -d. Suppose -5w + 37 = a. List the prime factors of w. 2, 3 Suppose -4u - 18 = -2x, 2x - 10 = 2u + 2. What are the prime factors of 37 + (4 - 3) + x? 41 Suppose -5t - 9 + 4 = 0. Let k = 8 + t. Let v(i) = i*2 - 7i + 3. What are the prime factors of v(k)? 3 Suppose 0 = -z + 4z + 69. Let p = -41 - z. Let u = p - -25. What are the prime factors of u? 7 Suppose -4o + 124 = -4y, 2o + 5y = -o + 53. List the prime factors of o. 2, 13 List the prime factors of 1/(3 + 69/(-24)). 2 Let w = -5 + 5. Suppose 6f + 87 - 255 = w. What are the prime factors of f? 2, 7 Let w(k) = -k*3 - 8k*2 + 4k + 3. Let x(z) = -2z2 - 3z. Let n be x(-3). List the prime factors of w(n). 2, 3 Let p be -3 - 5/(-1) - -4. Let o be (99/p)/(-3)2. Let c = o - -16. What are the prime factors of c? 5 Let n be 32/12(-69)/(-2). Suppose 5y = y + n. List the prime factors of y. 23 Suppose 0 = b - 3b + 6, 5j + b = 8. Let h = j + 1. Suppose 3v = -hv + 35. What are the prime factors of v? 7 Suppose -j - 4 = 0, 10o = 5o + 5j + 100. What are the prime factors of o? 2 List the prime factors of 706/26 + (-30)/195. 3 Suppose 4y - i + 16 = 0, 28 = -4y + i - 3i. List the prime factors of ((-68)/y)/((-8)/(-20)). 2, 17 Suppose 0 = -3q + 18. Let b = -7 + 11. List the prime factors of q/b(-56)/(-21). 2 Let v be ((-4)/(-6))/(2/(-6)). Suppose 2t - 5 = -1. What are the prime factors of (t/4)/(v/(-20))? 5 Suppose 5c - 16 - 179 = 0. What are the prime factors of c? 3, 13 Let v(m) = 2m - 3. Let w(t) = -t*2 - 7t + 5. Let u be w(-6). Suppose -4a - 2 = -h - 5a, 2h = -5a - u. List the prime factors of v(h). 11 Let r(z) = z*3 + 4z*2 + 2z - 2. Let d be r(-2). List the prime factors of 2/d(5 + 0). 5 Suppose 4v - 69 - 26 = -3l, -2l - 4v + 58 = 0. Suppose -3y - 3o - o + 35 = 0, 3y - l = -2o. List the prime factors of y. 13 Let g(v) = -v2 - 13v - 3. What are the prime factors of g(-11)? 19 List the prime factors of 40 + 4 - -6 - (2 - -1). 47 List the prime factors of (33/(-12))/(2 + (-114)/56). 7, 11 Suppose 2k - 15 = 25. Suppose k = 3a + a. Suppose 6g - 8 = 2g - 4c, -ag = 3c - 14. What are the prime factors of g? 2 Suppose 5y - 126 = 94. What are the prime factors of y? 2, 11 Suppose 4o - 406 = 30. List the prime factors of o. 109 Let d be (0 + -10)/(-1 + 0). Let u = -6 + d. What are the prime factors of u? 2 Let s(x) = -202x + 1. List the prime factors of s(-1). 7, 29 Let d = 18 + -18. Let o(h) = h - 1. Let a be o(5). Suppose d = 2j - aj + 20. What are the prime factors of j? 2, 5 Let x = 30 + -21. What are the prime factors of x? 3 Suppose 187 = i + 74. Let y = i - 60. List the prime factors of y. 53 Let i = -3 - -6. Suppose -d - 2 = -2x, 3d = -ix - 2 + 5. Let g(w) = -w2 + w + 4. List the prime factors of g(d). 2 Let t(s) = s2 - 18s + 18. Let v be t(17). Suppose 2a - 17 = v. What are the prime factors of a? 3 Let b be ((-6)/(-5))/(4/10). Let v be 9/(-2 + 55/20). Suppose -v - b = -3y. List the prime factors of y. 5 Let d = -16 + 37. Let a = 39 - d. List the prime factors of a. 2, 3 Suppose 5q + 368 = 9q. List the prime factors of q. 2, 23 Let p(w) = 2 - 2 + 69w - 27w. Let x be p(2). Suppose 5i = i + x. List the prime factors of i. 3, 7 Suppose 0 = w - 4c - 6, -2w + c + 24 = -c. Suppose 2o - o = w. What are the prime factors of o? 2, 7 Suppose 5g = 5i - 995, 2i + 2g = -2g + 410. List the prime factors of i. 3, 67 Let i be (-14)/8(4 + 0). Let g(j) = 4j2 + 10. Let n(t) = -3t*2 + t - 10. Let o(a) = 4g(a) + 5n(a). What are the prime factors of o(i)? 2 Let g(d) = d3 - 11d*2 + d - 9. Let s be -11(-13 + 2). List the prime factors of g(s). 2 Suppose 4i = 4d + 476, -142 = -2i - 4d + 78. What are the prime factors of i? 2, 29 Let v(w) = 3w*2 + 2w + 6. What are the prime factors of v(-2)? 2, 7 Suppose 7j - 2j + 5i - 650 = 0, -496 = -4j + 2i. Suppose j = -4v - 18. List the prime factors of (-12)/(-9)v/(-8). 2, 3 What are the prime factors of (-1)/(-3 + (-1012)/(-338))? 13 Let k(a) = 2a*3 + 14a*2 - 3a + 1. List the prime factors of k(-5). 2, 29 Suppose 2 = 4x - 6. Suppose xj = 4 - 0. Suppose jm + m - 15 = 0. List the prime factors of m. 5 Let w(m) = -5m - 25.	{ "pile_set_name": "DM Mathematics" }
80459/37360 - -1/37360. Let v = 118 - z. Let j = 13/12 + -35/36. What is the nearest to 0.2 in 0.3, v, j? j Let m = -0.1 - -0.3. Which is the nearest to m? (a) 0.1 (b) 1 (c) 4 a Let v = -1.7 + 1.6. Let l = -0.17 - -12.17. Let p = l + -17. What is the nearest to 0.1 in p, v, 3? v Suppose -x - 2x = -6. What is the nearest to x in -5, -4, 0? 0 Let t be 1/2 + -1 + 2. Let i = -0.989 - 0.011. What is the closest to i in t, 1, -5? 1 Let o = -0.018 - 1.882. What is the nearest to -2 in -2/9, o, -3? o Let t = 85.5 + -109. Let p = t + 24. What is the closest to -1 in p, 0.4, -1? -1 Let i = 8.8 - 9. What is the closest to -2 in -0.3, i, 1/3? -0.3 Let x be 1/(-1) - (-1 + -1). Let u = -1.7 + 9.7. Let w = 3 - u. Which is the nearest to 1? (a) -1/7 (b) x (c) w b Let c = 0.1 - -0.2. Let p(z) = -z2 + 3z - 2. Let o be p(3). What is the closest to -0.1 in c, o, -3? c Let p = 39 - 34. What is the closest to 21 in 1, -0.3, p? p Let v = -1.9 - -2. Suppose 5z - 14 = -4. Let p = -74 - -74.1. What is the nearest to v in p, 0.2, z? p Let f be 0/(-2) + (-16)/(-48). Which is the nearest to f? (a) -2 (b) 3/4 (c) -0.08 c Let w be (-10)/6 + 1 + 2. Let g = -383/10 + 67/2. Let j = g + 274/55. Which is the nearest to -1? (a) w (b) 3/2 (c) j c Let r = 0.4 - -0.1. Let f = 1.401 + -1.301. Suppose j = d + 3, 4j - 4 = -4d - 8. What is the nearest to f in d, -5, r? r Let f = -17 + 17.1. Which is the closest to f? (a) -4 (b) -3 (c) 2 c Let n = -39 - -40. What is the nearest to n in -4/7, 3, -0.2? -0.2 Let r = -51 + 53. What is the closest to -1 in -0.08, -0.3, r? -0.3 Let t be (27/(-24))/(5/(-12)). Let s = -23/10 + t. Let j = -0.1 + -0.1. What is the nearest to s in 5, 4, j? j Let v be 6/(-15) - (-11)/15. Let g = 20 - 21. Which is the nearest to g? (a) -5 (b) 0.4 (c) v c Let m = 3/8 + -23/40. Which is the nearest to 2/3? (a) -0.4 (b) m (c) 1 c Let l = 2 + -3. Let z = -2.92 - 0.08. What is the closest to -2/3 in l, z, 0? l Let i = 6.6 + -6.6. What is the closest to i in 0.05, -0.5, 2? 0.05 Suppose -2l + 4l - 2 = 0. Let x be -3 - (1/l + -8). Which is the closest to -1? (a) 5 (b) 0.1 (c) x b Let z = -1.4 - -2.1. Let x = z + -0.4. Let j = -7 - -10. What is the nearest to -0.1 in x, j, -0.4? -0.4 Let u = -535595070 - -6970502069/13. Let z = u + -597710. Let x = -313 - z. Which is the nearest to 1? (a) -3 (b) -1 (c) x c Let x = -21 - -22. Which is the nearest to x? (a) 3 (b) -3/5 (c) -5 b Let y = -0.27 - -0.07. Let v = -0.2 + y. Let d = v - -0.3. Which is the closest to d? (a) -3 (b) -1 (c) -0.3 c Suppose -4 + 1 = -3a. What is the closest to a in -2/5, -4, -0.05? -0.05 Let n(t) = 19t + 10. Let o be n(12). Let x = o + -1663/7. Which is the nearest to 0? (a) 3 (b) x (c) 0.2 c Let y = -0.191 + 2.191. What is the nearest to 1/4 in 2/17, -2, y? 2/17 Let n = -642/35 - -134/7. Let x = -0.5 + 0. Which is the closest to -2? (a) x (b) -3 (c) n b Let g = 0.347 + 0.053. What is the nearest to -5 in 0, g, -5? -5 Let m = 279381/289 - 1015772377/1089530. Let g = 1004/29 - m. Let n = 5/26 + g. What is the closest to -2 in 5, -2/15, n? -2/15 Let t = -0.28 + 0.28. Let j = -0.1 - -0.08. Let i = j + 5.02. What is the closest to t in 2/11, i, 0.2? 2/11 Suppose -3a + 5r = -23, -3r - 2r = -4a + 24. Let f be (-5)/10 - a/(-3). What is the nearest to 1/2 in f, -2/15, 1? 1 Let w = -36 - -24. Which is the nearest to w? (a) -3 (b) -2 (c) -0.2 a Let d = 0.4 + 0.6. What is the nearest to 1 in 3/10, d, 1/5? d Let h be (-2 - 6/2) + 1. Let u = -8 - -3. Let j be ((-2)/16)/((-3)/(-6)). What is the nearest to -1 in h, u, j? j Let i be 0/((-20)/(-5) + -3). Let f = 9 + -6. What is the nearest to i in -2, 5, f? -2 Let x = 56 + -57. Let m = -3 + 3. Let a = m - -0.2. What is the closest to x in -0.5, a, -1/5? -0.5 Suppose 0 - 2 = -2z. Let u(n) = -4n*2 - n. Let f be u(z). Let w(x) = x + 5. Let i be w(f). What is the nearest to 0.1 in -3, i, -5? i Suppose 0 = 242r - 243r + 2. What is the closest to r in -2/9, 0, -1/3? 0 Let o = 46 - 49. What is the closest to 0 in o, -2/7, -0.2? -0.2 Let v = -18.9 - -18. Let g = v + 1. Which is the nearest to g? (a) 0.4 (b) 3 (c) 5 a Suppose -5f - 27 = -47. Which is the closest to 0.3? (a) f (b) -0.2 (c) -0.4 b Let k = -10.6 + 8.6. What is the closest to k in 2, -5, 0.7? 0.7 Let p = -1.05 - -0.65. Which is the nearest to 0? (a) -1/4 (b) -4 (c) p a Let s = -8.6 - -8. Let x = -0.5 - s. Which is the closest to 0.1? (a) x (b) -1 (c) 0.5 a Let g = -3 + 2.5. Let l(h) = -h*3 - 7h*2 - 5h + 8. Let j be l(-6). Suppose 1 = -p + j. Which is the nearest to p? (a) -0.1 (b) g (c) 2 c Let j = 0.009 - -2.691. Let u = 3 - j. Let r be ((-3)/10)/((-6)/(-8)). Which is the closest to r? (a) u (b) 1 (c) -0.2 c Let o be 24/4 + -1 + -3. What is the nearest to o in -2/11, -3/5, -0.3? -2/11 Let z = -32.8 - -34.8. Let j be 3/(-7)(-1)/3. Which is the closest to z? (a) j (b) 0.5 (c) -1/3 b Let l be (0 - 2/6)12. Which is the nearest to -0.05? (a) l (b) 0.4 (c) 0.3 c Let m = -0.1 + -0.1. Suppose -5b + 0 - 5 = -4h, 5b + 5 = 3h. What is the closest to 0 in h, m, -5? h Let k = -8.1 - -0.1. Let l = -190.9 + 183. Let o = k - l. Which is the closest to -2/9? (a) 1/5 (b) -1 (c) o c Let i = -47/3 - -15. Let z be ((-6)/8)/((-2)/4). What is the closest to -0.2 in -3, i, z? i Let p = 27 - 27.5. What is the closest to 2 in 2/15, -5, p? 2/15 Let n = -12 - -14.6. Let s = 1.6 - n. Which is the closest to s? (a) 0.4 (b) -1 (c) 4 b Let j = -2.8 + 2.7. What is the nearest to 2/5 in 1, j, -2/11? j Let h = -12.5 + 12. Let s = 12 - 11. What is the closest to -2/9 in s, 2, h? h Let j be (-42)/(-60)24/(-182). Let q = j - 4/13. Which is the nearest to 0? (a) 4 (b) -0.2 (c) q b Let a = 2.5 + -0.5. Suppose 5y = 5r + 22 + 88, 0 = 4y - 2r - 94. Suppose -4d = d - y. What is the closest to 1/2 in d, -2, a? a Suppose -4l - 25 = -9l. What is the closest to -1 in 0.3, l, -8? 0.3 Let t = 3.6 - 3.5. Which is the nearest to t? (a) -2 (b) -0.04 (c) 1/10 c Let n = 130 - 125. What is the closest to 0 in n, 1/22, 4/7? 1/22 Let i = -1 + 1.5. What is the closest to 3 in i, 1, -2? 1 Let d = -23 + 43/2. Which is the nearest to d? (a) 0 (b) -0.1 (c) 0.1 b Let h = 1.1 + -1. Suppose -8w = -41 + 1. Which is the nearest to h? (a) 0 (b) w (c) 1 a Suppose 2t - 10 = -3t. Let h = -449/174 + 7/87. What is the closest to 0.4 in h, -2/11, t? -2/11 Let k be (-2)/20-1378 + -3. Let z = k - 134. Let j = -0.1 - 0. What is the closest to j in z, -4, -0.3? -0.3 Let u(k) = -k - 7. Let g(n) = n - 11. Let f be g(6). Let l be u(f). Let y = -104 - -104.1. Which is the closest to y? (a) 1 (b) l (c) 0.1 c Let m(u) = 20u2 + 1. Let h be m(-1). Suppose -6 = 3i - h, 0 = -2l + i + 1. Which is the nearest to -1? (a) l (b) 4/5 (c) -0.1 c Let t be -2 - (6/(-9) + -2). Let i = -0.03 + 0.23. Which is the nearest to 0.1? (a) t (b) i (c) -0.1 b Let y = 1.22 + -5.11. Let m = y - 0.11. Which is the closest to 0.1? (a) 0.5 (b) -3 (c) m a Let c = -0.02 + -0.58. Let q = c - 1.4. What is the nearest to 0.2 in q, 0.4, 1/4? 1/4 Let x = 17 - 25. Suppose 0 = 2h - 3l - 18, 2h + 4l + 13 = h. Which is the closest to x? (a) -0.3 (b) h (c) 4 a Let a be (-2)/8 - 21/(-4). Suppose 0 = -2t + 6, 2t = -4l - 14. Let n(b) = b*3 + 5b*2 - 4. Let f be n(l). What is the nearest to 0.1 in 2/7, a, f? 2/7 Let q = 16 + -16.18. Which is the closest to q? (a) 0.5 (b) -3 (c) -0.4 c Let g = -66 + 70. Which is the nearest to 1/4? (a) 0 (b) -2 (c) g a Let d = -1.2 + -3.8. Let u = d + 5.4. Suppose -4o + 1 = -3z, 0 = -4z + 4o - 9o + 40. Which is the nearest to 0.1? (a) z (b) -0.4 (c) u c Suppose -13 = -o - 2b, -4o = -b - 31 - 12. Suppose d - h = -2, -4h = -3d - 6h - o. Let w = 1.94 - -0.06. What is the closest to -1 in d, -5, w? d Let t(l) = -2l + 18. Let h be t(9). Which is the closest to h? (a) -5 (b) -0.1 (c) 2/13 b Let a = 109 - 113. What is the closest to 0.1 in a, -2, -3? -2 Let a = 0.4 + -5.4. Let w be -6*((-14)/3)/7. Let y be (3/(-2))/(3/5). What is the closest to -2/7 in w, y, a? y Let q = -48 + 238/5. Let h = 4 + -10. Let v = h + 4. What is the closest to v in -1/2, -3, q? -3 Let y = 2/123 + 11/164. Which is the nearest to -0.2? (a) -1 (b) y (c) 0.3 b Let	{ "pile_set_name": "DM Mathematics" }
t 17892 (base 15) to base 13. 288a7 1100011011011000101110 (base 2) to base 4 30123120232 Convert -6c26a (base 14) to base 9. -442013 Convert 6724747 (base 8) to base 11. 1029122 What is -200122010202201 (base 3) in base 16? -971cbf 1256547 (base 9) to base 2 10100111110000111110 31021 (base 15) to base 10 155281 522aa (base 11) to base 15 178be Convert 3b533 (base 13) to base 2. 11011000010010001 200655465 (base 7) to base 5 10440110112 -222020221012221 (base 3) to base 6 -1215025341 What is 402035 (base 6) in base 12? 1631b Convert -2303044 (base 6) to base 4. -130221010 20311222 (base 4) to base 2 1000110101101010 What is -13622077 (base 8) in base 15? -4105eb Convert -5316787 (base 9) to base 12. -b52b51 -132121300 (base 4) to base 12 -60094 444174 (base 8) to base 5 14242003 Convert 6b4c5 (base 13) to base 2. 101111111100010010 What is -da0b9e (base 15) in base 6? -1010255005 What is 1111223021 (base 6) in base 5? 11044241314 What is 39732 (base 10) in base 4? 21230310 Convert -1300200343 (base 5) to base 15. -41cc18 20029 (base 15) to base 9 163843 165199 (base 11) to base 5 31141111 -9b6b6 (base 13) to base 16 -44f0b 1240777 (base 9) to base 2 10100101001001000100 Convert -1b9ac1 (base 15) to base 12. -550854 What is -13e93 (base 16) in base 13? -2b176 Convert -10101000100101011100110 (base 2) to base 10. -5524198 -111010001010100001011 (base 2) to base 4 -13101110023 -ab8020 (base 16) to base 8 -52700040 3033221 (base 4) to base 15 3e0e Convert -22211301 (base 6) to base 3. -1021001120001 Convert 31441304 (base 5) to base 13. 93934 -110011111010010 (base 2) to base 3 -1100110101 What is 48a275 (base 11) in base 13? 21197a What is -a8944 (base 11) in base 13? -5700b What is 54431 (base 16) in base 2? 1010100010000110001 What is -13002202103 (base 4) in base 16? -1c2893 What is 200011111 (base 3) in base 11? 9a4a Convert 203011210 (base 6) to base 13. 957597 What is 18042448 (base 9) in base 6? 522124155 -36ab8 (base 12) to base 14 -1d04c -a08608 (base 11) to base 2 -110001011111110000100 -1222010122 (base 3) to base 15 -b725 What is 10100101110001110 (base 2) in base 9? 138378 Convert -2540502 (base 8) to base 12. -29ba82 5532554 (base 6) to base 5 32323234 Convert 10132202110 (base 4) to base 12. 487244 Convert -1201377 (base 8) to base 14. -879a7 What is 1403154 (base 6) in base 2? 10011001010001110 42976c (base 13) to base 3 2221102111111 -11100011111010101 (base 2) to base 16 -1c7d5 12021200122 (base 3) to base 5 11312041 Convert 3089ba (base 16) to base 11. 1882a16 Convert 5b2c2 (base 16) to base 6. 12000522 227167 (base 9) to base 16 21511 Convert -21503653 (base 7) to base 9. -3428811 What is 6311a6 (base 14) in base 4? 30300231332 -2ab42 (base 12) to base 15 -12d5b Convert 513123 (base 10) to base 9. 861776 What is -14642436 (base 8) in base 15? -465870 What is -1430014 (base 7) in base 14? -5000b What is 259340 (base 11) in base 7? 3315416 What is -61f7 (base 16) in base 7? -133055 What is -102113401 (base 5) in base 7? -3423164 Convert 320201132230 (base 4) to base 10. 14817196 Convert 11200211112222 (base 3) to base 12. a04898 What is 2e7a3c (base 16) in base 11? 17a0514 Convert 28056c (base 15) to base 6. 105131533 -202011131 (base 4) to base 14 -38c45 What is 215333050 (base 6) in base 2? 1110111000001110110110 115808 (base 10) to base 15 244a8 Convert -12122120200211 (base 3) to base 8. -13351573 What is -1304302 (base 6) in base 11? -49348 What is -20000201021111 (base 3) in base 15? -433e34 183110 (base 9) to base 13 3ca5c Convert -2231101031 (base 4) to base 5. -140202314 -696568 (base 10) to base 3 -1022101111211 dd858 (base 14) to base 15 a906b -443927 (base 10) to base 16 -6c617 What is -10bba9 (base 14) in base 15? -b3ead -235605061 (base 7) to base 4 -320002230010 What is cc3b (base 14) in base 6? 431325 What is 1153645 (base 9) in base 14? 1241cd Convert -10177371 (base 8) to base 4. -20033323321 2252058 (base 10) to base 15 2e7423 What is -547a5 (base 11) in base 4? -103122003 Convert 5555413 (base 8) to base 9. 2732616 What is 24662533 (base 7) in base 16? 22161d Convert -7a983 (base 14) to base 16. -48cf7 305323454 (base 6) to base 12 193658a Convert 1213000012 (base 4) to base 7. 3405004 What is 488321 (base 10) in base 14? c9d61 -201101201020 (base 3) to base 2 -1011101001101011010 What is -430596 (base 11) in base 9? -1258814 -1112021122002 (base 3) to base 13 -225b12 101100221212 (base 3) to base 4 301310321 -131060 (base 8) to base 5 -2424431 What is 2152132 (base 7) in base 2? 1000000101010100100 What is 31113320101 (base 4) in base 12? 1210901 -103708 (base 10) to base 12 -50024 Convert 310000 (base 9) to base 7. 1363410 Convert 202414331 (base 5) to base 10. 826216 What is -9361aa (base 11) in base 7? -15522604 Convert -1214443551 (base 6) to base 3. -222020020221211 11011001100100001000011 (base 2) to base 6 412445203 18c515 (base 16) to base 3 10001110202212 What is 135d37 (base 14) in base 6? 22203005 Convert 6d73d (base 16) to base 9. 752870 What is -23113203130 (base 4) in base 12? -bb86a4 What is 100011111101101100 (base 2) in base 9? 244055 Convert -13581231 (base 10) to base 15. -12d4106 What is -a98a (base 14) in base 5? -1414301 -140aa (base 15) to base 13 -23350 Convert -18085a (base 14) to base 13. -238586 Convert -75885a (base 16) to base 8. -35304132 -1533212 (base 7) to base 5 -23210043 -4560612 (base 10) to base 16 -4596e4 Convert 597774 (base 11) to base 12. 398231 13300010031 (base 4) to base 15 2a2090 Convert 92078 (base 11) to base 8. 406564 Convert -96ff2b (base 16) to base 7. -150053335 Convert -6254507 (base 8) to base 11. -a35142 -273014 (base 8) to base 7 -546113 What is 151286 (base 9) in base 11? 63815 792e01 (base 16) to base 12 27aba29 1651433 (base 8) to base 15 9736c What is -142a5 (base 14) in base 8? -141411 -501511235 (base 6) to base 5 -4133011343 What is -22385 (base 12) in base 11? -31179 Convert -2013314 (base 6) to base 3. -11211211101 What is 9d0cb3 (base 14) in base 9? 11042265 What is -2323c (base 14) in base 10? -85510 221232134 (base 5) to base 6 32335332 10212002110 (base 3) to base 5 4412012 Convert -2940578 (base 10) to base 5. -1223044303 -10001010001000011001000 (base 2) to base 9 -8457800 Convert 2445168 (base 9) to base 14. 268526 Convert -38670 (base 12) to base 13. -29067 Convert 1748 (base 13) to base 15. 1045 Convert 418807 (base 9) to base 16. 3cd9c What is 281925 (base 10) in base 5? 33010200 -822558 (base 10) to base 6 -25344050 -13622653 (base 8) to base 6 -150120443 Convert 474473 (base 14) to base 6. 124043325 Convert 54442241 (base 6) to base 12. 663381 -124200003 (base 6) to base 15 -3336cc What is 201313311 (base 4) in base 3? 21001022120 Convert -130222154 (base 7) to base 6. -453204232 What is 52255021 (base 6) in base 3? 2212000201111 What is 22626203 (base 7) in base 11? 113a291 What is 306905 (base 10) in base 9? 516885 511544 (base 6) to base 2 1001111010011000 -10c00b (base 13) to base 15 -7cc63 Convert 76a8395 (base 11) to base 5. 11430243013 Convert 1804215 (base 9) to base 15. 14d535 Convert d14079 (base 15) to base 9. 20623706 Convert -10201101100100 (base 3) to base 11. -112a530 -10878428 (base 10) to base 8 -51376734 What is ea515 (base 16) in base 13? 277b11 Convert -2423003 (base 6) to base 11. -87a04 Convert -189ba4 (base 13) to base 16. -97beb 223113031 (base 4) to base 6 3450141 Convert 2430002 (base 5) to base 13. 179ca 53a234 (base 14) to base 16 2b3776 Convert 3433132 (base 5) to base 11. 42371 What is -103112023331 (base 4) in base 6? -300411405 What is 19690b0 (base 12) in base 11? 3035263 32113323203 (base 4) to base 2 1110010111111011100011 What is -2876186 (base 9) in base 14? -2d3c6a -10031302123 (base 4) to base 7 -12251503 What is 132139 (base 14) in base 7? 5412502 Convert -747447 (base 8) to base 13. -89820 What is -9c1492 (base 14) in base 4? -110033023220 -7334025 (base 9) to base 2 -1110111100111111110000 Convert 16836 (base 16) to base 5. 10422324 1472761 (base 8) to base 5 102022114 Convert -12528a (base 13) to base 14. -b6420 What is -182324 (base 11) in base 13? -9b011 Convert 110120201002 (base 3) to base 8. 743536 Convert -23baa9 (base 14) to base 6. -42114525 83ca4 (base 13) to base 8 717271 Con	{ "pile_set_name": "DM Mathematics" }
Let x(s) = s3 + s2 - 1. Let d(a) = h(a) - 3x(a). What is the units digit of d(-1)? 8 Let n(q) = 5q + 3. Let d(z) = -z. Let t(k) = -4d(k) - n(k). Let r be t(-7). Suppose m - 2a - 16 = -0a, rm + a = 73. What is the units digit of m? 8 Let j(q) = 3q2 + q - 2. Suppose 8 = -5g + 2c, 3g + c + 5 = g. Let s be j(g). Suppose -6x + 202 = -s. What is the units digit of x? 5 Suppose s + 5j = 982, -2j + 3j + 1006 = s. What is the hundreds digit of s? 0 Suppose 2i + 3i = -3d - 142, -d - 74 = -5i. What is the tens digit of 9/d + 182/12? 1 Let z(j) = -17j - 18j - 5 + 25j - 3. What is the tens digit of z(-28)? 7 Let k = 464 - 378. What is the units digit of k? 6 Let d be 168/(-4) - (-4 + 2). Let l = d - -56. Suppose 2u - l = -2u. What is the units digit of u? 4 Let k = 155 + -158. Let w(n) = -11n*3 - 4n*2 - n - 2. What is the hundreds digit of w(k)? 2 Suppose 5g - 3630 = -2n, 2g - 2n = 1329 + 137. What is the hundreds digit of g? 7 Let m(l) = -11l - 6. Let v be m(-6). Suppose -y - 5b = -v, -3y + b + 4b + 260 = 0. What is the tens digit of y? 8 Let t be (-78)/(-36) + (-2)/12. Suppose u - 51 = -tf, 5f = f + 5u + 123. What is the tens digit of f? 2 Let a(u) = 2u2 - 26u - 17. Let x(s) = -s*2 + 13s + 9. Let d(t) = -4a(t) - 7x(t). What is the tens digit of d(11)? 2 Let i(j) = 2j3 - 10j*2 - 39j + 17. What is the hundreds digit of i(14)? 9 Let t = 476 - -1306. What is the tens digit of t? 8 Let o = -5 + 8. Let s(m) = -2m - 10 - mo + m + 10m*2 + 0 - 9m. What is the units digit of s(8)? 8 Suppose 5p + 81 + 474 = 4i, 5p - 390 = -3i. Suppose 3x - 5h + 4h - i = 0, 4h = 0. What is the units digit of x? 5 Suppose -10o + 32852 = 8952. What is the tens digit of o? 9 Let h(x) = 8x - 17. Let o(n) = 4n - 2n + 4n - 9 - 2n. Let t(c) = -3h(c) + 5o(c). What is the tens digit of t(-3)? 1 Suppose 0f + 8 = 4y - 4f, 2y - 24 = -2f. What is the tens digit of ((-345)/(-35) + 3)y? 9 Let o be (-2)/((-6)/813). What is the tens digit of 3/o - (-2 - 3040/15)? 0 Let d(t) = -8t*2 + 3t + 6. Let u(j) = -4j2 + 2j + 3. Let q(s) = -4d(s) + 7u(s). Suppose 10c + 3 = 9c. What is the tens digit of q(c)? 2 Suppose -19 = 4t + 5. Let n = t - -10. Suppose -nj + 5j - 22 = 0. What is the units digit of j? 2 Let r = 1022 + 385. What is the tens digit of r? 0 Let w = -11 + 8. Let p be w/9138/2. Let o = -16 - p. What is the units digit of o? 7 Let u(c) = -8c + c + c2 - 8 - 3c2 + c2. Let v be u(-6). What is the tens digit of 38 + 6 - (0 + v)? 4 Let f(j) be the first derivative of j*3/3 - 11j*2/2 + 16j + 1. Let i = -244 - -255. What is the tens digit of f(i)? 1 Let p be 2 + -2 + 2 - -9. Suppose 0 = pq - 8q - 378. What is the tens digit of q? 2 Let l(m) = -12m - 37. What is the hundreds digit of l(-17)? 1 Let h be 4/8(-264)/(-2). Let t be h/2 + (-1 - 0). Suppose t + 16 = 3d. What is the tens digit of d? 1 What is the tens digit of 396 + (-19)/((-76)/(-24))? 9 Suppose -10i + 14i + 2u = 11110, 3i - 8313 = 5u. What is the tens digit of i? 7 Let i = 2307 - -1263. What is the thousands digit of i? 3 Let s = -1716 + 2950. What is the units digit of s? 4 Suppose 26 - 4726 = -5r + 2h, 4h = -r + 940. What is the units digit of r? 0 Suppose -4370 = -5u + 3005. What is the units digit of u? 5 Let j(d) = 14 - d - 3 - 9 - 8d. What is the tens digit of j(-6)? 5 Let g = 20 + -28. Let o be (2/g)/((-10)/200). Let x = 1 + o. What is the units digit of x? 6 Let w(q) = 4q*3 - 3q*2 - 8q - 20. Let z(f) = 11f3 - 10f*2 - 23f - 59. Let o(b) = 8w(b) - 3z(b). What is the units digit of o(7)? 3 Let i(n) = -n*3 + 4n*2 + 6n - 3. Let f be i(5). Suppose -4g = fo - 8g + 12, 0 = 2o - 3g + 7. What is the units digit of ((-400)/(-24))/(o/18)? 5 Suppose -24 = -5i - 14. Suppose 0l = -il - 56. What is the units digit of l/(-42) - 28/(-3)? 0 Let o(g) = -3g2 + 5g - 6. Let p(f) = -f*2 + 2f - 3. Let x(j) = -2o(j) + 5p(j). Let b be ((-10)/12)/(-1 + 20/24). What is the tens digit of x(b)? 2 Let d be ((-2)/3)/(6/(-234)). Suppose 3s - d = 2s. What is the units digit of s? 6 Let b = 896 + -472. Suppose 3n + b = o, -4 = -3o - 1. Let w = -96 - n. What is the units digit of w? 5 Suppose 1336 = 3c + 427. Let j = c + -131. What is the hundreds digit of j? 1 Let w(h) = h3 - 7h*2 + h - 7. Let v be w(7). Suppose 6 = 3m - vm. Suppose 5y = my + 3. What is the units digit of y? 1 Let o(v) = 5v*2 + 7v + 1. Suppose 6h - 3h + 9 = 0. What is the tens digit of o(h)? 2 Suppose -2j + 12 = j - 3a, 0 = 4j + 4a - 56. Let s = -7 + j. What is the units digit of 38 + 8/s - 1? 1 Suppose 33z = 32z + 2t + 952, 5t = -25. What is the tens digit of z? 4 Let v(a) = 41a + 248. What is the thousands digit of v(36)? 1 Suppose 0t = -t + 19. Let p(h) = -h - 20. Let c be p(-6). Let r = c + t. What is the units digit of r? 5 Let u = -799 + 1385. What is the hundreds digit of u? 5 Let k = 47 + 27. Let h = k + -29. What is the tens digit of h? 4 Let u = -15 - -18. Suppose 0 = -3f - 3, ut + f - 290 = 3f. What is the tens digit of t/189/4? 1 Let r = -17 - -122. Let m be 2/(-4) - r/(-14). Suppose mh = 4h + 114. What is the units digit of h? 8 Suppose 0 = 5c - 4c. Suppose -a - 4r - 26 = c, 4a - r = -6r - 82. Let b = a - -32. What is the tens digit of b? 1 Let o(t) = -t3 + 5t*2 + t - 2. Suppose 5 = -5g - m, -2m + m - 5 = 0. Let u = g + 4. What is the units digit of o(u)? 8 Suppose -3z = -2z - 2x - 1651, 0 = -3z - 3x + 4944. What is the hundreds digit of z? 6 Let y(z) = -z*2 - 12z + 10. Let j(m) = m*2 + 2m - 11. Let l be j(-5). Suppose -56 = 4a - 2i, -la + 2i - 28 = 7i. What is the units digit of y(a)? 0 Suppose -13v = 15v - 112392. What is the thousands digit of v? 4 Suppose -4q + 4i = 12, -4i + 3i + 1 = q. What is the tens digit of ((6/9)/2)/(q/(-111))? 3 Let l = -81 + 79. What is the tens digit of (-69)/6(-1 + (l - 9))? 3 Let n(u) = -u*3 + 2u2 + u - 1. Let h(s) be the third derivative of -s4/24 - 2s2. Let y be h(-2). What is the units digit of n(y)? 1 What is the units digit of ((-5352)/30)/((-2)/10)? 2 Let x be 2 + (-3 - (2 + -4)). What is the hundreds digit of x/(-4) - (3 - 2991/12)? 2 What is the tens digit of (((-1524)/(-8))/3)/(5/20)? 5 Let p = 3 - 0. Suppose 80 = -q - pq. Let v = q - -47. What is the tens digit of v? 2 Let q be (-9)/((-45)/2) + 2336/(-40). Suppose -v + 39 = -2v. Let s = v - q. What is the units digit of s? 9 Suppose -5f = -9f + 2144. What is the tens digit of f? 3 Let v(c) = -15c + 4. Let u be v(-2). Suppose 3o = 208 - u. What is the units digit of o? 8 Let v = -213 - -269. Suppose -2u + 0s + 4s + 18 = 0, 3u + 4s = -3. Suppose -n + 67 = uh, 0 = -0h - 2h + 5n + v. What is the tens digit of h? 2 Let l = 15 - 10. Let k be 2/(l/(-2) + 3). Suppose kb = 88 + 112. What is the tens digit of b? 5 What is the units digit of 1(-1)/5 - 864/(-45)? 9 Suppose 7 = 3j - 3w + w, -2j + 2w + 2 = 0. Suppose -ja + 60 = -60. Suppose -u = u - a. What is the units digit of u? 2 Let s = 124 + -119. Suppose -sy + 354 = 5p + 29, 129 = 2y + p. What is the tens digit of y? 6 Let n be (-3)/2 - (17/(-2) - -2). Suppose -nu - 176 = -j, -145 = -3j + u + 327. What is the tens digit of j? 5 Suppose -2 = -2o + 2v, 4o - 3 = 5v - 0. Suppose -2l + o + 4 = 0. Suppose 5g + 4x = -0x + 269, 3x = l. What is the units digit of g? 3 Let y = 1708 - 707. What is the units digit of y? 1 Let s = 49 + -43. Suppose -4p - 218 = -sp. What is the tens digit of p? 0 Suppose -119 = 8f - 23. Let h(q) = -q*2 - 15q - 19. Let k be h(f). Suppose s = 4o - o + k, 2s + 4o - 74 = 0. What is the units digit of s? 9 Suppose -4c + 29 = z, -4z + 2c + 60 = 16. What is the units digit of z? 3 Suppose 29 - 353 = -27w. What is the tens digit of w? 1 Suppose 17 + 82 = -9s. Let k(c) = c*3 + 12c*2 + 9c + 15. What is the units digit of k(s)? 7 Suppose 4n = -2p + 1896, n + 952 = 3n - p. What is the hundreds digit of n? 4 Suppose -40 - 6 = 2r. Let z = r + 99. What is the tens digit of z? 7 Suppose -4 = -2z + 2. Suppose 5y + 2w + w - 64 = 0, zw + 35 = 4y. Suppose -yk = -6k - 115. What is the tens digit of k? 2 Let o(r) = -351r - 297. What is the hundreds digit of	{ "pile_set_name": "DM Mathematics" }
w(d))? -4d2 Let h(x) = -x + 162. Let q(y) = 109y. Give q(h(s)). -109s + 17658 Suppose 2 = -2n - 8. Let t(r) = 11r + 8. Let w(i) = 7i + 5. Let c(u) = nt(u) + 8w(u). Let b(o) = -79499o + 79503o + 0 + 0. Determine c(b(z)). 4z Let q(i) = 9i - 13. Let n(z) = -4z + 6. Let p(r) = -13n(r) - 6q(r). Let f(t) = -t2 + 5t. Give f(p(d)). -4d2 - 10d Let m(b) = 198b. Let x(f) = -96f - 4. Determine m(x(l)). -19008l - 792 Let o(f) = 21f*2 - 15f - 5. Let u(g) = 23g2 - 12g - 4. Let i(s) = 4o(s) - 5u(s). Let c(q) = -2q. Give c(i(v)). 62v*2 Let l(d) = 2d. Suppose 0u + 2u - 24 = 0. Let p(a) = -ua2 + 8a*2 - 6a*2. Calculate l(p(v)). -20v*2 Let o(x) = 9x - 2x - 4x. Let z(w) = 2w2 + 6w + 3. Let v(h) = 2h + 1. Let k(a) = -3v(a) + z(a). Give k(o(p)). 18p2 Let z(w) = w - 1. Let d(x) = -3x*2 - 4. Let c(u) = -d(u) + 4z(u). Let n(t) = t*2. Calculate n(c(r)). 9r*4 + 24r*3 + 16r*2 Let w(h) = h. Let c(i) = 12569i. Determine c(w(u)). 12569u Let s(k) = 26k + 40273 - 40273. Let c(v) = v*2. Determine c(s(r)). 676r*2 Let j(x) = 2x*2. Suppose s - 2n - 3n - 8 = 0, 2s - 6 = 5n. Let z be 2/(-3)9/s. Let c(t) = -3t - zt*2 + 3t - t*2. What is j(c(y))? 32y*4 Let l(a) = -33862a*2. Let r(h) = 37h. Give r(l(u)). -1252894u2 Suppose 3m + 5n = 72, 4m - 3n = -7n + 104. Let i(z) = mz - 12z - 8z. Let q(p) = -4p*2. What is q(i(y))? -324y*2 Let h(t) = 38t. Let b(u) = 18981u2. Give h(b(m)). 721278m*2 Let o(a) = 0a - 4a + 0a. Let d(r) = -443r2 + 148r*2 + 145r*2 + 148r*2. Calculate o(d(x)). 8x*2 Let j(m) be the first derivative of -2 + 3/2m*2 + 0m. Let k(n) = -19n2. Calculate j(k(q)). -57q*2 Let n(w) = 3w. Let l(k) = 37k - 69k + 34k. Let f(c) = 8l(c) - 5n(c). Let y(t) be the first derivative of t3/3 + 1. Determine y(f(s)). s2 Let p(v) = 2v. Let j(g) = 35 - 300g - 68 + 33 - 269g. Calculate p(j(a)). -1138a Let n(g) = 160 + 8g + 170 - 331. Let s(x) = -2x2. What is n(s(i))? -16i*2 - 1 Let k(b) = 2b*2. Let i(j) be the second derivative of -4j + 5j3 + 3j - j*3. What is k(i(g))? 1152g*2 Suppose -3b = -4p - 0b + 10, 3p - 4b = 4. Let o(d) = p - 4 + 7d. Let i(t) be the second derivative of t3/3 + 11t + 2. Calculate o(i(v)). 14v Let o(j) = -j2. Suppose 3k = 27 - 9. Let q(u) = 3u + 0u - ku + 13u. What is q(o(a))? -10a2 Let j(y) = -y. Let b(h) = -23h. Let m(z) = -b(z) + 46j(z). Let q(g) be the first derivative of -2g*3/3 + 2. Give q(m(n)). -1058n*2 Let j(k) = 0k*2 + 0k*2 - 3k*2 + 0k*2. Let w(t) be the first derivative of -6 + 0t - 3/2t2. Give j(w(d)). -27d*2 Let b(k) = 2k + 254. Let w(u) be the first derivative of -u*2 + 116. Calculate b(w(s)). -4s + 254 Let z(l) = -2l. Let n(o) = 1447336o. Calculate z(n(b)). -2894672b Let w(p) be the first derivative of p3 - 78. Let n(q) = 3q2. Let r(h) = h2. Let z(f) = -3n(f) + 5r(f). What is w(z(x))? 48x4 Let x(o) be the third derivative of o5/20 - 15o*2 - 3. Let s(q) = 61q*2 - q. Determine s(x(j)). 549j*4 - 3j*2 Let a = -4 + 6. Let c(t) = 226t*2 + 0 + 0 - 243t*a. Let v(y) = 3y. What is c(v(l))? -153l2 Let d(c) be the second derivative of c4/4 + 7c. Let s(w) be the third derivative of w*5/12 - 11w*2. Give s(d(j)). 45j4 Let f(i) be the second derivative of i3/3 + 5i. Let l(o) = o2 + 3o + 2. Let s be l(-4). Let d(v) = -6v + 6v - sv. Calculate d(f(c)). -12c Let c(r) = 3143 + 2r - 3143. Let s(d) = 21d - 7d + 44d - 8d. Give s(c(x)). 100x Let g(u) = -14u. Let v(o) be the second derivative of -o4/3 - 11o + 1. Determine v(g(r)). -784r2 Let i(c) = 7c + 9. Let d(b) = -25024b. Give d(i(w)). -175168w - 225216 Let p be (-6)/(-5)(-90)/(-54). Let h(x) = 24 - 24 - 2x*2 + 0x*p. Let u(a) = -3a + 4 - 4. What is u(h(t))? 6t2 Let c(w) = -34w. Let b(u) be the first derivative of -3u3 + 5u*2/2 + 5u - 9. Let j(f) = -4f2 + 2f + 2. Let m(l) = -2b(l) + 5j(l). What is m(c(k))? -2312k2 Let u(x) = -8x*2. Let h(q) = -1228q*2. Determine h(u(c)). -78592c*4 Let u(l) = -24l*2. Let f(p) = 5p*2 + 22074p - 22074p. Give f(u(m)). 2880m*4 Let u(k) = -5k*2 + 0k*2 + 16k*2 - 9k*2. Let q(j) = 8j + 6. Let w(f) = -8f - 5. Let g(b) = 5q(b) + 6w(b). Calculate g(u(y)). -16y*2 Suppose -o - o = 4. Let g = o - -4. Let q(h) = -gh + 4h - 7h*2 - 2h. Let s(a) = -2a. What is s(q(d))? 14d2 Let t(v) = -v2. Let q(k) be the second derivative of -7/6k3 + 0k*2 + 20k + 1/6k4 + 0. What is q(t(y))? 2y*4 + 7y*2 Let a(y) be the second derivative of 0y*3 - 9y + 0 + 0y2 - 2/3y4. Let l(b) = b2. What is a(l(x))? -8x4 Let s(n) = -5402n*2 - 29. Let j(q) = q. Determine j(s(y)). -5402y*2 - 29 Let c(z) = -647z + 219z + 208z + 1 + 208z. Let w(a) = -8a. Determine c(w(x)). 96x + 1 Let p(x) = 11x. Let i(z) = -1 + z - 5z + 7. Let c(d) = -3d + 148 - 70 - 73. Let g(u) = -6c(u) + 5i(u). Calculate p(g(l)). -22l Let h(r) = 6r*2. Let f be ((-16)/20)/(3/(-15)). Let m(d) = 2d. Let p(u) = -11u. Let o(a) = fm(a) + 2p(a). What is h(o(s))? 1176s*2 Let j(u) = 6u. Let i(c) = 20593c. Give i(j(z)). 123558z Let y(n) = -9302n2. Let o(w) = -3w. What is y(o(g))? -83718g2 Let u(q) = -2q - 62. Let h(w) = 60w2. Calculate h(u(c)). 240c*2 + 14880c + 230640 Let u(l) be the first derivative of -l*5/20 + 15l*2/2 + 6. Let c(r) be the second derivative of u(r). Let q(o) = -o. Give q(c(n)). 3n*2 Let l(a) = -2a. Suppose 8d - 14 - 2 = 0. Let i(t) = -dt + 3t - t - t. Give i(l(z)). 2z Let w(v) = -207v2 - 215v*2 + 440v*2. Let o(n) = -14n. What is o(w(h))? -252h2 Let y(m) = -16m*2. Let q(b) = -168b*2 + 35b + 70. Let z(j) = -10j2 + 2j + 4. Let o(r) = -2q(r) + 35z(r). What is o(y(d))? -3584d4 Let y(h) = -39h*2 - 3. Let r(m) = 18m + 5. Let i(q) = -14q - 4. Let j(z) = 5i(z) + 4r(z). What is y(j(v))? -156v*2 - 3 Let v(m) = 202m*2. Let k(n) = 65n*2 - 4n. What is k(v(t))? 2652260t4 - 808t*2 Let z(q) = 3q. Suppose 0h + h + 63 = 4x, -10 = -2h. Let c(n) = -16n - 17 + x + 25n. Calculate c(z(t)). 27t Let y(x) = -17082x - 1. Let v(j) = -64j. What is v(y(c))? 1093248c + 64 Let d(g) be the first derivative of -g3/3 - 13. Let t(o) = 15o - 12. Let y(u) = 646u - 513. Let w(j) = 171t(j) - 4y(j). What is w(d(h))? 19h*2 Let a(f) = -2f. Let i(j) = -1041j2 - 981j*2 + 2073j*2. What is i(a(l))? 204l*2 Let b(h) = 129h. Let g(v) = -1036v. What is g(b(x))? -133644x Let m(y) be the second derivative of 7y4/12 - y3/3 + 2y - 276. Let h(g) = -2g. Calculate m(h(z)). 28z*2 + 4z Let k(y) = -4y2 - 2y + 4. Let v(l) = 9l2 + 5l - 10. Let d(m) = -5k(m) - 2v(m). Let g(x) be the second derivative of x*4/12 + x. Give d(g(p)). 2p*4 Let r(j) = -327j. Let x(v) = 54v. Calculate x(r(b)). -17658b Let s(k) = 38k + 2. Let q(f) = 401f*2. Calculate s(q(z)). 15238z*2 + 2 Let m(b) = -15b. Let w(y) be the second derivative of 0 - 5y + 1/6y*3 + 0y*2. Determine w(m(q)). -15q Let k(n) = -n*2. Let y(v) = 4v*2 + 30482. Give y(k(h)). 4h*4 + 30482 Let r(p) = -28p - 1. Let u be r(-1). Let n be (-1 + 9)u/18. Let b(o) = 36 - 36 + no. Let w(t) = t. Determine b(w(f)). 12f Let f(t) = -78t*2 + 27t + 27. Let m(s) = -6s2 + 2s + 2. Let y(o) = -2f(o) + 27m(o). Let u(d) = 3d. Give u(y(w)). -18w*2 Let a(r) = 17r - 334. Let i(l) = -l*2. Calculate a(i(p)). -17p*2 - 334 Let w(o) = -6o - 8. Let n(p) = -13p2 + 15p - 5. Let s(t) = 11t2 - 12t + 4. Let d(f) = -4n(f) - 5s(f). What is w(d(g))? 18g2 - 8 Let v(n) = -13n2. Let l(y) = y. Let z(g) be the second derivative of -g3/6 + 22g. Let p(f) = -5l(f) - 6z(f). Calculate p(v(h)). -13h*2 Let a(f) = 3f - 22. Let y be a(8). Let q(n) = 6n + yn - 17n + 7n. Let z(v) = -v*2. Give q(z(s)). 2s2 Let a(b) be the third derivative of -b4/12 - b*2. Let i(y) be the second derivative of -17y*4/6 - 192y. Calculate i(a(c)). -136c2 Let u(h) = -4h + 18. Let a(f) = 37f2. Give a(u(j)). 592j*2 - 5328j + 11988 Let w(x) = x + 2. Let f(b) = -2b2 + 4b. Give f(w(d)). -2d2 - 4d Suppose -331 - 87 = -11l. Let c(y) = -ly*2 - 37y*2 + 78y**2. Let t(b) =	{ "pile_set_name": "DM Mathematics" }
- 1. Let j be g(-4). Suppose s - 156 = -3t + 5s, 5s - 104 = -2t. Let k be (784/t)/7 + (-2)/13. Solve 0 = -kf - jf + 5 for f. 1 Let j = -10 - -2. Let q be 1/(8/7 - (-7 - j)). Suppose qs - 3s = 8. Solve 2c + s = 4c for c. 1 Let g = -1 - -1. Let u = -32939 + 32966. Suppose g = -ul + 20l. Solve l = b - 1 + 5 for b. -4 Let o be -12/(-4) - (-18846)/(-108). Let g = o + 180. Solve -2d = -gd + 4 for d. 1 Suppose -4f - 12 = 0, 2c - 20 = -0f + 4f. Let a = c - -14. Let q = a - 16. Solve qy = -2y - 16 for y. -4 Let a = 51 + -43. Let r be (-18)/2a/(-36). Suppose -rp + 9 = -31. Solve 2o = -2o + p for o. 5 Let z(q) = -q2 + 32q - 26. Let a be z(31). Suppose 3d + k - 7 - a = 0, 0 = -4d - 3k + 11. Solve dn - 3n = 6 for n. 3 Let r(c) = c2 - 20c - 67. Let d be r(23). Solve 15n = 17n + d for n. -1 Let c be 2 + 6/4 + 7/(-14). Suppose -q - 3w = 25 - 1, 0 = -cw + 6. Let n = q - -32. Solve 8 - n = 3o for o. 2 Let j = -79 + 123. Let f = -41 + j. Suppose -2s = 2o - 3 - 7, -fo = s - 11. Solve 2d + 0d = s for d. 1 Let g = -16691 + 16740. Solve -752d + 745d - g = 0 for d. -7 Suppose 48 - 15 = -3i. Let p(g) = -g2 - 11g + 11. Let d be p(i). Suppose 15z - dz = 24. Solve 5h - 1 = -z for h. -1 Suppose 135a = -982 + 1657. Solve -at + 27t = 154 for t. 7 Suppose 0k = -k + 3. Suppose -2x = 2p + x - 15, 3p - 2x = 3. Suppose 5u + po = 12, 0 = -3u + 6u - ko - 12. Solve u = 2n + n for n. 1 Let r be 56/1020/8. Let k be (-24)/15(-140)/(-728) - (-424)/26. Solve k = w + r for w. 2 Suppose 6f - 3f - 299 = -10f. Solve fm + 32 = 15m for m. -4 Let q be ((-48)/30)/(2/5). Let g(z) = -z*3 - 6z*2 - 7z + 6. Let n be g(q). Suppose -f + 3f = -nt, -2f + t = -15. Solve -fr - 5 = -0r for r. -1 Let y(r) = -2r*2 + 14r - 9. Suppose 2b - 26b + 96 = 0. Let d be y(b). Solve 0 = -0l - 3l + d for l. 5 Let j(f) = -5f3 - 4f*2 + 27f + 28. Let a(q) = -14q3 - 13q*2 + 80q + 84. Let u(v) = -4a(v) + 11j(v). Let p be u(-10). Solve 0 = -3r + p - 5 for r. -1 Let g be 2/4 + 2/(9 - 5). Suppose 0 = j + d - 3, -2j + g = 5d - 11. Solve -a + 0 = -j for a. 1 Let q(z) = -z3 - 5z*2 - 3z + 10. Let n be q(-4). Suppose -3u = nu - 6u. Suppose -3h - 16 = -4j, u = 3h - 2j + 6j - 16. Solve -8 = -ht + 4t for t. -2 Let n be ((-39)/((-2535)/26))/((-2)/(-25)). Solve nw + 404 = 384 for w. -4 Let f(q) = -q2 - 12q + 19. Let k = 94 + -107. Let v be f(k). Solve 2j - v = -14 for j. -4 Suppose 114 = 17d + 46. Suppose -2x - 3m - 16 = -4x, -dx = -m - 12. Solve x = -4c - 2 for c. -1 Suppose -4n + 1837 = 4i - 7n, 0 = 5n - 25. Solve 451s = is + 48 for s. -4 Let y be 122/12 - ((-38)/(-12) - 3). Let z be (-1 + y/6)/((-16)/(-72)). Suppose 0 = zo - 4o + 2. Solve -os - 3s = -10 for s. 2 Let z(a) = 50a*2 - 2a. Let x be z(2). Suppose 5m + x = -4. Let g be 6/(-10) - -26(-4)/m. Solve 2 = t - g for t. 4 Let b(t) = 108t3 + t2 - 10t - 10. Let x be b(-1). Let k = x - -107. Solve l + 3 + 2 = k for l. -5 Suppose 198 - 158 = 8m. Suppose -40 + 60 = mr. Solve -p - r = -1 for p. -3 Let y = 0 + 0. Let v be ((-695)/(-25) + -3)-10. Let q = v - -254. Solve q = -2o - yo for o. -3 Let s be -711/(-154)130. Suppose 5z = 3b + s, -3b = -3z + 2b + 9. Solve -5t + 6t = z for t. 3 Let g = 58 + -34. Suppose -gz = -26z + 2. Suppose z - 5 = -f. Solve 0i + fi = 0 for i. 0 Suppose 103 = -5l + 108. Let m be 0 - (-12)/(1 + l). Solve 0 = 2k - m - 2 for k. 4 Let a be (30/(-5))/(0 - 3/2). Suppose 18 = 5w + l, 0 = w + al - 3 - 12. Suppose -wt - 3n = -45, 3t = 2n + 69 - 24. Solve -2g + 7g + t = 0 for g. -3 Let y be ((-6)/(-12) - 2)-12. Solve -yo = -22o - 16 for o. -4 Let k = -227 - -231. Let z be k/(24/55) + 23/(-138). Solve 31 + z = -10r for r. -4 Let c(q) be the third derivative of -q5/30 + 7q4/12 + q3 - 4q2 + 15q. Let w be c(7). Solve 18 = -wn - 0n for n. -3 Let z be 3/((-6)/(-60)2). Let x(s) = s + 5. Let v be x(3). Suppose v = t + 4. Solve to + o = -z for o. -3 Let h be (13872/(-1445))/(1/(-5)). Solve 0 = 7n - 23n + h for n. 3 Suppose -62a = -8a + 64a + 11446. Let p = 123 - 232. Let l = a - p. Solve -4b = -0b - l for b. 3 Let g = 8911 - 8847. Solve -21w = 20 + g for w. -4 Suppose 0 = 45y - 3y - 5460. Solve 4 = -126u + yu for u. 1 Let o = -217 - -237. Suppose -od - 126 = -346. Solve 0 = 4v - 9 - d for v. 5 Let s(y) = -y*3 - 34y*2 - 87y + 227. Let a be s(-31). Solve a = -14k + 27 for k. -1 Suppose -z - 1981 = 5p - 0p, 4p + z + 1584 = 0. Let a = p - -403. Suppose 0 = s - 2s. Solve sg - a = -2g for g. 3 Let i be (-23)/(230/(-3840)) + (-1 - -2). Let j = -381 + i. Solve -ju = -13u + 9 for u. 1 Let u(p) = 11p3 + p2 - p + 2. Let m be u(1). Suppose -ml = -2l - l. Solve 9v - 45 + 9 = l for v. 4 Suppose 8l + 5l + 69 = 368. Solve 3t = 32 - l for t. 3 Suppose -6t = 4a - t - 95, -155 = -5a + t. Suppose -12n - a + 162 = 0. Solve 0 = y + n - 13 for y. 2 Let x(c) = c*3 + 17c*2 + 66c + 2. Let u be x(-11). Suppose -20 = -s + 5s, -44 = -4n + 4s. Solve -5f - n = -uf for f. -2 Let p(u) = 3u*3 + 32u*2 + 19u + 3. Let y be p(-9). Solve yz = 245z + 64 for z. -8 Let m = 11627 + -11603. Solve 0 = -1713w + 1710w - m for w. -8 Let b(o) be the third derivative of -o6/120 + o5/30 + o*3/6 + 37o*2. Let p be b(2). Suppose h = 2w, -w + 2h - p - 5 = 0. Solve w = -2m + 3m for m. 2 Suppose -36c + 15 = -33c, 0 = 4y - 3c - 245. Solve -5t = 70 - y for t. -1 Let a(x) = 2x3 - 39x*2 - 339x + 37. Let k be a(26). Solve -k = m - 15 for m. 4 Suppose -5f - 109 = -4l, -5f - 130 = -0l - 5l. Suppose 0 = 51u - 44u + l. Let y be 13 - 13 - (u + -2). Solve -y = 7g - 12g for g. 1 Suppose -5p - 20w + 24w + 4 = 0, -2w - 4 = -3p. Solve -pd - 2d = 18 for d. -3 Let q = -13533 + 13543. Solve qn - 540 = 100n for n. -6 Suppose -5n = -2r + 37, -3r - r + 5n + 99 = 0. Let h = -8 + r. Let g(t) = 306t + 2145. Let x be g(-7). Solve 8 = xy + h for y. -5 Suppose 2r + u - 6 = 2u, -r + 2u = 0. Suppose -68 = rp - 68. Let y be (-3)/(3 + p)0. Solve z + z = y for z. 0 Let q = -12317 - -12434. Solve -93v + qv = 0 for v. 0 Let u = -522 - -531. Suppose -15 = -uo + 10o + 3a, 0 = 4o - 5a - 25. Solve 2k - 12 + 8 = o for k. 2 Suppose 5o - 13 = 4k - 0k, 4o + 3k = -2. Let h = -132 + 140. Suppose -v = -h + 5. Solve o = -2i - v for i. -2 Let f be ((-27)/(-4))/(2/8). Let r(t) = t3 + 63t*2 + 8t + 533. Let n be r(-63). Let q = n - f. Solve ql + 0 - 2 = 0 for l. 1 Suppose -14 = z + 191. Let u = z - -205. Solve -4j = -uj + 12 for j. -3 Suppose 47 = -50l + 54l + 5z, -10l = -2z - 16. Solve 0 = lk + 4 - 1 for k. -1 Let i = 43 + -26. Let a = 19 - i. Solve 0 = -8r + ar - 24 for r. -4 Let p be (-3)/(-12) + 25/40-58. Let k be ((-9)/p0)/(12). Let u(g) = -g*2 + 2g + 12. Let o be u(k). Solve 3n = 3 + o for n. 5 Let o(b) = 280b + 2884. Let f be o(-10). Solve -f = -9v - 12 for v. 8 Let w = -574 + 577. Suppose wf = -m + 11, 17f - 1 = 14f + m. Solve -f = 3d + 7 for d. -3 Suppose 52q = 809 - 81. Solve 0 = -2j - 18 + q for j. -2 Suppose -4t + g - 1 = 1, 6 = -4t + 3g. Solve t = 16a + 24a - 240 for a. 6 Let b(p) = p*3 + 53p*2 + 16p + 849. Let i be b(-53). Let u(s) = s*2 - 7s + 4. Let h be u(7). Let q = h + 5. Solve i + q = 5c for c. 2 Suppose 0 + 3 = v + 4f, 0 = f - 3. Let a = -7 - v. Suppose 3i + 15i - i = 0. Solve -m + i = a for m. -2 Suppose 21 = -485x + 506x. Let u = -4 - -4. Suppose -3j + 7 = 4b - 2, 3b - 3j - 12 = u. Solve bc - 16 + x = 0 for c. 5 Let w = 75314 + -75295. Let m = -2 + 7. Solve -7s = -m + w for s. -2 Let v(r) = 4r - 8. Suppose -3 = -i - 0i. Let c be v(i). Suppose 0 = -4p - 0n + 5n + 10, 0 = -3p + 5n + 10. Solve -cs + ps + 20 = 0 for s. 5 Suppose 95s + 6 = 3k + 98s, 2s = 4. Solve -2n = 3n - kn for n. 0 Suppose 38 = -7a + 276. Suppose 37r - ar = 9. Solve rv = 5 - 14 for v. -3 Let y be 4/((-3)/(-1) - 70/24). Let n = y + -51. Let c be (n/4)/(-4 - (-30)/8). Solve -2h = h - c for h. 1 Let u(i) = -2i*2 - i + 2. Let j be u(-8). Let g = -115 - j. Suppose 4z = -5q + 1 + 28, z - gq = 3. Solve -d = 2d - z for d. 2 Let t be (4/6)/((-4)/(-402)). Let r = -65 + t. Let f(c) = c3 - 3c*2 + 4c	{ "pile_set_name": "DM Mathematics" }
72964? False Does 719 divide 1349668846? False Does 34 divide 129048295? False Does 72 divide 170761968? True Is 20153876 a multiple of 51? False Is 72954126 a multiple of 36? False Is 51509113 a multiple of 27? False Is 2854440 a multiple of 3? True Is 133843024 a multiple of 2296? True Is 2264 a factor of 109593448? True Does 1162 divide 165243491? False Is 17 a factor of 1046237443? True Is 1403473783 a multiple of 76? False Is 2687 a factor of 184304017? True Is 196 a factor of 24535229? False Is 1474720480 a multiple of 16? True Is 18377370 a multiple of 6? True Does 9 divide 60884035? False Is 273 a factor of 759973578? True Is 191 a factor of 4527846? True Is 13 a factor of 80933502? True Is 665 a factor of 50540000? True Is 55 a factor of 2847845? True Is 82303636 a multiple of 1532? True Does 54 divide 188935308? True Does 8 divide 920567792? True Does 1118 divide 203343467? False Is 135867648 a multiple of 384? True Does 22 divide 5860874118? True Is 61416241 a multiple of 53? True Is 973 a factor of 18529812? True Is 345634908 a multiple of 10? False Is 52380075 a multiple of 367? True Is 1521905 a multiple of 649? True Is 58031829 a multiple of 27? True Does 3379 divide 77296878? False Does 680 divide 880227939? False Is 537 a factor of 79409949? True Is 182 a factor of 4861903592? True Does 973 divide 87375245? False Does 90 divide 110141224? False Is 60532793 a multiple of 1069? False Is 88 a factor of 726451176? True Is 146 a factor of 31846980? True Is 495 a factor of 33832442? False Is 113 a factor of 546363808? False Is 9915 a factor of 696062745? True Is 39726531 a multiple of 81? True Is 1857352544 a multiple of 1674? False Is 10693151 a multiple of 138? False Is 35 a factor of 480816035? True Is 28 a factor of 234592344? True Is 233 a factor of 71596989? False Is 208 a factor of 9044880? True Does 335 divide 646820010? True Is 17 a factor of 4477435037? False Is 206 a factor of 16264112? True Is 112989647 a multiple of 8? False Is 2054 a factor of 84429956? False Is 24306968 a multiple of 266? False Does 1763 divide 866609702? True Is 9 a factor of 87473810? False Is 16 a factor of 3708880? True Does 2457 divide 87545367? True Does 24 divide 956566659? False Is 33 a factor of 32618817? True Is 7 a factor of 9782087? True Is 497 a factor of 184502056? False Is 47 a factor of 44070678? True Does 160 divide 30447360? True Is 1358407260 a multiple of 84? True Is 112 a factor of 40658113? False Does 95 divide 255626710? False Is 26 a factor of 1722452458? False Is 697939076 a multiple of 226? True Is 98 a factor of 1074806376? True Is 1752 a factor of 40562304? True Does 40 divide 212992080? True Does 1663 divide 1210680630? True Is 5651 a factor of 146304390? True Does 111 divide 1137327090? True Is 3 a factor of 4331389? False Is 21 a factor of 241594080? True Does 65 divide 2220920? True Is 90 a factor of 15143295? False Is 27 a factor of 291364172? False Is 1141997690 a multiple of 5? True Is 1179 a factor of 890832630? False Is 23 a factor of 80733542? True Does 2680 divide 309095120? True Does 187 divide 425090745? False Is 165 a factor of 357553350? True Is 10 a factor of 203976150? True Is 56789767 a multiple of 52? False Is 13 a factor of 10750458? False Is 546517216 a multiple of 23? False Does 361 divide 412288725? False Does 4872 divide 87592311? False Does 839 divide 117360998? True Is 379 a factor of 9113528? False Is 707850 a multiple of 330? True Is 433 a factor of 113256096? False Is 115371280 a multiple of 40? True Does 510 divide 70789530? True Does 16 divide 3947897? False Is 22655213 a multiple of 7? True Is 393 a factor of 13488939? True Does 7 divide 8598905? True Does 223 divide 227850919? True Is 312555486 a multiple of 61? False Does 342 divide 94375242? True Is 14 a factor of 147664524? True Is 4 a factor of 18263177? False Does 6 divide 2811707097? False Does 3278 divide 173084956? True Does 349 divide 127097424? True Is 193472972 a multiple of 308? True Does 28 divide 11890676? True Is 1166 a factor of 34773618? True Is 1829686653 a multiple of 801? True Is 1166820780 a multiple of 491? False Is 100 a factor of 1406866? False Is 2367986303 a multiple of 10899? False Is 103778928 a multiple of 27? True Does 1516 divide 91922660? True Is 157603002 a multiple of 331? True Is 124642336 a multiple of 26? True Is 29 a factor of 742100314? True Does 92 divide 353953992? True Does 1341 divide 33531705? True Is 27 a factor of 1076553558? True Does 1300 divide 620379051? False Does 13 divide 355902560? True Does 9 divide 399715910? False Is 99303082 a multiple of 7? False Is 72 a factor of 541308233? False Is 131322 a multiple of 84? False Is 44057336 a multiple of 1382? False Is 776267237 a multiple of 637? False Is 11553746 a multiple of 13? False Is 291 a factor of 14283633? False Is 75719209 a multiple of 47? True Does 34 divide 59955083? False Is 453 a factor of 69099261? True Is 21315837 a multiple of 42? False Is 1520751501 a multiple of 281? False Is 19 a factor of 18253871? False Does 37 divide 423333032? False Does 13 divide 567601567? True Is 8 a factor of 3041577? False Does 67 divide 16964820? False Does 1909 divide 40675829? False Does 7092 divide 2153287224? True Is 100816144 a multiple of 143? True Is 101 a factor of 176018154? True Does 890 divide 62137555? False Does 2740 divide 132796840? True Does 19 divide 51869183? True Does 40 divide 168848466? False Does 122 divide 59484210? False Is 11684935 a multiple of 19? False Does 9095 divide 2228588684? False Is 168203760 a multiple of 12? True Is 685080974 a multiple of 973? False Does 2358 divide 142056331? False Does 30 divide 1017913980? True Does 6 divide 544095173? False Is 159947711 a multiple of 36? False Does 9 divide 827429814? True Is 13394895 a multiple of 255? True Is 24 a factor of 65385456? True Is 150 a factor of 21834900? True Is 64256570 a multiple of 10? True Does 465 divide 44160390? False Is 404199860 a multiple of 355? False Does 93 divide 64418124? True Is 37968750 a multiple of 1215? True Is 3 a factor of 35730608? False Does 92 divide 30536417? False Is 244228545 a multiple of 2994? False Is 197810950 a multiple of 5? True Does 2936 divide 38235528? True Is 2046 a factor of 1139752944? True Is 403767159 a multiple of 89? False Does 347 divide 35463876? False Is 111 a factor of 698115973? False Is 232442366 a multiple of 46? False Is 340 a factor of 67741078? False Is 419850606 a multiple of 6181? True Is 9013267 a multiple of 109? False Is 1745 a factor of 16162190? True Is 220 a factor of 1213407756? False Is 172934283 a multiple of 917? False Is 107 a factor of 2091260760? False Is 1292 a factor of 3543956? True Does 65 divide 74691370? True Is 16 a factor of 1576862514? False Is 2075 a factor of 480968106? False Is 12 a factor of 248931552? True Does 165 divide 76797765? True Is 33 a factor of 109101066? False Is 15 a factor of 75662325? True Does 1565 divide 2270815? True Is 17 a factor of 3072155? True Does 355 divide 97397445? True Does 17 divide 4005355? False Is 110 a factor of 53938266? False Is 5357 a factor of 5315234547? False Is 313084567 a multiple of 256? False Is 116321700 a multiple of 1396? True Is 5 a factor of 945959480? True Is 1024374668 a multiple of 41? True Is 14 a factor of 188603284? False Is 205916760 a multiple of 33? False Does 38 divide 63789916? True Is 26 a factor of 13681252? True Is 271754084 a multiple of 14? True Is 161687410 a multiple of 2? True Is 110791366 a multiple of 9? False Is 26 a factor of 323606166? True Does 250 divide 55249750? True Is 12372904 a multiple of 8? True Is 65341404 a multiple of 2800? False Is 248523216 a multiple of 564? True Does 3 divide 46224558? True Is 254 a factor of 636951736? True Does 82 divide 3776100? True Is 358 a factor of 1093173783? False Does 362 divide 24836136? False Is 89777883 a multiple of 13? True Does 362 divide 267587142? True Is 1303471689 a multiple of 583? False Is 44 a factor of 4898192772? True Is 1397 a factor of 37566727? True Is 363 a factor of 790701846? True Is 227 a factor of 77414945? True Is 1347136224 a multiple of 177? False Is 652064 a multiple of 568? True Does 3 divide 71672131? False Is 280269553 a multiple o	{ "pile_set_name": "DM Mathematics" }
7/5 less than 77362? True Which is greater: 875 or -0.77? 875 Which is bigger: 0 or 67/122608? 67/122608 Which is greater: 31224 or 31219? 31224 Is -668 >= -1281? True Are 0.1 and -2854911 nonequal? True Is 22 != -42? True Is -3218 at least -3236? True Which is greater: -31152 or -1/4? -1/4 Is 111481 != 111481? False Which is greater: 18211 or 1/6? 18211 Is 408 less than 15142/37? True Which is bigger: -1819 or -7271/4? -7271/4 Which is smaller: -162 or 3427? -162 Does -1/13 = 23? False Is 17174 less than or equal to 120216/7? False Does -24949 = -24949? True Which is greater: -0.1 or -10303/128? -0.1 Which is greater: -66682 or -66686? -66682 Which is bigger: 39618 or 237703/6? 39618 Is -396/2869 smaller than 1? True Are 9497 and 9497 unequal? False Which is smaller: -22913 or -22915? -22915 Which is greater: 542/5171 or 1? 1 Is 285 less than 280? False Which is smaller: 182 or 113? 113 Which is smaller: -2558 or -2557? -2558 Is 13.1 less than 11? False Which is bigger: -968 or -958? -958 Which is smaller: -391 or -1152? -1152 Is -71 equal to -2042/29? False Is 8601 at least 8606? False Does -23942 = -23958? False Is 0.04368 not equal to -30/13? True Do 1144893 and 1144893 have different values? False Which is greater: -1/130816 or -1? -1/130816 Which is bigger: -4/190399 or 1? 1 Which is greater: 2515 or -11? 2515 Is -3690 bigger than 3/2? False Is -473.1 at least 1/12? False Which is smaller: -1 or 2/2017961? -1 Is 1 smaller than 19/4710? False Which is bigger: -160340 or -24? -24 Which is smaller: 8364 or 8361? 8361 Is 2014664 <= 2014664? True Do 137/47419 and -1 have the same value? False Which is smaller: 9871 or -7? -7 Is 15258 less than 15265? True Is -2.05427 less than 2/3? True Which is smaller: -299419/7 or -42773? -299419/7 Which is smaller: -540103 or -540102? -540103 Is 2/18707 not equal to -1? True Which is greater: -2/81543 or -1? -2/81543 Which is smaller: 468374/15 or 0.2? 0.2 Which is smaller: 340739 or 3066652/9? 340739 Is 695454 less than 695459? True Which is bigger: 0 or -348/1685? 0 Do 252 and 618 have the same value? False Which is greater: 134 or -213? 134 Is -8 greater than -22329? True Which is smaller: 0 or 375/4526? 0 Is 3353 at most 43605/13? True Which is smaller: 6718 or 2.7? 2.7 Which is bigger: 58/2307 or 0? 58/2307 Which is bigger: 37419 or 37427? 37427 Which is smaller: 103532 or 1967133/19? 103532 Which is greater: 1/1421 or 0? 1/1421 Do 2/1174035 and 0 have different values? True Which is greater: 309761 or 309763? 309763 Are -3/110182 and 0 non-equal? True Are 1 and 2/679 non-equal? True Which is smaller: 4 or 422320? 4 Is 336349/2 at least 168176? False Which is bigger: -1948 or -1385? -1385 Is 6389 at least as big as 198082/31? False Is 654 > 7188/11? True Which is bigger: -57464 or -402240/7? -402240/7 Which is smaller: 1058505 or 1058506? 1058505 Are -1 and -1/36091 unequal? True Is 17873 > 17882? False Is -1515 greater than -1488? False Are -17 and -105 equal? False Which is bigger: -42294 or -465240/11? -42294 Which is smaller: 1 or -11/145846? -11/145846 Which is greater: 53294 or 53293? 53294 Which is smaller: 2 or 2/50933? 2/50933 Which is smaller: 1273 or -83? -83 Is 1/11 smaller than -3409? False Is -2466/7 >= -352? False Is -237 greater than or equal to -9724/41? True Which is smaller: 47 or 8385/184? 8385/184 Are -12134 and -424726/35 equal? False Is 275117/4 < 68778? False Which is smaller: -8 or -2424/355? -8 Is 86247 equal to 86247? True Which is bigger: 2156/53 or 42? 42 Is 383636 at least as big as 383635? True Which is smaller: -3534383 or -3534385? -3534385 Is 4/44915 less than 1? True Which is smaller: 47928/11 or 4358? 47928/11 Is 4/633 > 61/3? False Which is smaller: 0.7 or 0.22949? 0.22949 Which is greater: 37701 or 37700? 37701 Is -231836 >= -231835? False Which is greater: -1 or 7/228061? 7/228061 Is 1724 bigger than -1/1374? True Is -0.002 at most 3.1? True Is -2618552 less than -2618550? True Is 6/5 greater than 44378? False Which is greater: -66 or -2/21? -2/21 Is -579 > -228? False Does 0.0287913 = 0.4? False Is 3926 less than or equal to 4137? True Which is bigger: 0 or -51/292? 0 Is -219604 smaller than -219606? False Are 530485 and 530486 equal? False Is -10 less than or equal to -232/21? False Are -0.19554 and -2/3 equal? False Is 36 not equal to 100.31? True Is 250978 bigger than 250978? False Is 72291 <= 72286? False Is 3/2884 at most as big as 12? True Which is greater: -239/106 or -1? -1 Is -2477 >= -321? False Which is bigger: -2180 or -2356? -2180 Is 36 less than 3961/114? False Which is smaller: 33.4561 or 0? 0 Is -2 less than -253341? False Does -1710924/11 = -1? False Is -74415/14 smaller than -5315? True Is -6/164183 greater than -1? True Is -173077/2 equal to -86539? False Do -2 and -739/219 have the same value? False Which is bigger: -2780 or -2751? -2751 Which is smaller: 474 or -38? -38 Which is greater: -1 or -17/12623? -17/12623 Is 18509 greater than or equal to 18503? True Which is smaller: 75 or -85? -85 Are -14683 and -1 equal? False Is 2/617375 equal to -0.1? False Which is smaller: -57081/26 or -2196? -2196 Which is bigger: 1934078 or 1934077? 1934078 Which is smaller: 899 or 117? 117 Is -4749 less than or equal to 238? True Is 7 > 2503? False Are -0.021 and -16224 unequal? True Is 12463 at most 12460? False Which is smaller: 2/93657 or -1/7? -1/7 Which is greater: 0 or 61/273? 61/273 Which is greater: -1/10708711 or 0? 0 Is 17863 > 17863? False Which is smaller: 61869 or 61859? 61859 Do -32/132857 and 1 have different values? True Is 0.05172 not equal to 19? True Which is greater: -3622 or -3651? -3622 Which is bigger: -27535 or -27? -27 Which is bigger: -154 or -144? -144 Is -103524 equal to 0? False Which is greater: 501934/13 or 38610? 501934/13 Is -132 bigger than -1509? True Is 2382 at most 2382? True Is 43 greater than or equal to 28524/679? True Which is bigger: -541040 or -541041? -541040 Which is smaller: -34151 or -34158? -34158 Is 507600/103 at least 4927? True Which is greater: -2.8 or 4009? 4009 Which is smaller: 1.4 or -983.8? -983.8 Do -2816 and -2816 have the same value? True Which is bigger: -82325/51 or -1613? -1613 Which is greater: -2986174 or -2986173? -2986173 Which is greater: -1614 or -32253/20? -32253/20 Is -47362/37 != -1279? True Which is smaller: -13 or 1897? -13 Is 0 at least as big as -4/10775? True Do -139828 and -139817 have the same value? False Which is smaller: 1253 or 39? 39 Which is bigger: -2/3 or 505? 505 Which is smaller: -370 or 265? -370 Do -41/1710 and 0 have different values? True Which is greater: 0 or -6/512659? 0 Which is bigger: 0.048258 or -1? 0.048258 Is 13629 greater than or equal to 24? True Is 37016 != 37018? True Is 2183170 < 2183169? False Is 34082 at least 306742/9? False Which is bigger: 2958 or 2784? 2958 Which is smaller: -1 or -1290/1949? -1 Which is bigger: -1564264 or -1564266? -1564264 Is 4325 at most 4322? False Which is bigger: 16/25037 or 1? 1 Are 51209 and 51207 non-equal? True Is 13 at most 139594? True Is -617 < -518? True Are -969 and -5809/6 nonequal? True Is 136559 at least as big as 136563? False Which is smaller: 1397 or 15379/11? 1397 Is 25 at least 6912/281? True Which is smaller: 942713 or 942710? 942710 Which is smaller: -255 or 2.6? -255 Which is smaller: -3708 or -3598? -3708 Which is smaller: -1/10 or 176301? -1/10 Is 9601 != 9685? True Which is smaller: -981955 or -2? -981955 Is 28335 bigger than 28334? True Which is bigger: 32 or 6655/216? 32 Is -993 bigger than -112? False Is 0 greater than -1/633886? True Which is smaller: -605 or -23? -605 Which is smaller: 3 or 3302/809? 3 Is -5413446 > -5413444? False Which is smaller: 55 or 753/14? 753/14 Is 3986 less than 0.11? False Is 103127/18 not equal to 5730? True Is 2835557 at most 2835559? True Do 1892 and 6 have the same value? False Which is bigger: 1 or 11/373? 1 Is -22973 less than or equal to -15? True Are -267878 and 1 equal? False Does 0 = 1/1201942? False Which is greater: 1 or 56/6621? 1 Is 6 < 254/35? True Which is smaller: 202390 or 202389? 202389 Is 1383614 at most as big as 1383616? True Which is smaller: -90502 or -90500? -90502 Does -47/41410 = 0? False Which is smaller: -3/22171 or 1? -3/22171 Is 57	{ "pile_set_name": "DM Mathematics" }
hat is next in -2271, -1755, -1239, -723, -207, 309? 825 What is next in 1031, 2105, 3181, 4259, 5339, 6421? 7505 What is next in -499, -3668, -12273, -29032, -56663, -97884, -155413, -231968? -330267 What is next in -1075, -1076, -1077, -1078, -1079? -1080 What is next in 20472, 20447, 20418, 20391, 20372, 20367, 20382? 20423 What is next in 3001, 5935, 8881, 11845, 14833, 17851, 20905? 24001 What is the next term in 6241, 12569, 18897? 25225 What is the next term in -363, -1793, -4167, -7479, -11723, -16893, -22983, -29987? -37899 What is next in 1469, 1433, 1381, 1307, 1205? 1069 What is the next term in -62957, -125914, -188873, -251834, -314797, -377762? -440729 What comes next: 329, 6806, 24393, 58646, 115121, 199374, 316961, 473438? 674361 What is next in -65481, -65489, -65499, -65511, -65525? -65541 What comes next: 47710, 47715, 47720, 47725, 47730? 47735 What comes next: 6437, 6440, 6445, 6452? 6461 What is the next term in -1356, -2707, -4058, -5409? -6760 What is the next term in -3628, -29083, -98172, -232711, -454516, -785403, -1247188, -1861687? -2650716 What is the next term in -1085, -1099, -1113, -1127, -1141? -1155 What comes next: -104, -521, -1252, -2297, -3656, -5329? -7316 What is next in 2575, 2478, 2381, 2284, 2187, 2090? 1993 What is the next term in -44, -601, -2152, -5195, -10228, -17749? -28256 What is the next term in -94, -121, -172, -253, -370, -529, -736? -997 What is the next term in -750763, -750765, -750767, -750769, -750771? -750773 What comes next: -158258, -316517, -474776, -633035, -791294, -949553? -1107812 What is next in 16, -12, -56, -122, -216, -344? -512 What comes next: 25, 94, 203, 340, 493, 650, 799, 928? 1025 What is the next term in -709, -645, -575, -499? -417 What comes next: 1086, 997, 904, 807, 706? 601 What comes next: 138077, 138070, 138063, 138056, 138049, 138042? 138035 What is next in -5075, -5030, -4989, -4952, -4919? -4890 What is the next term in 725, 735, 713, 647, 525, 335, 65, -297? -763 What is next in 175, 67, -113, -365, -689, -1085, -1553? -2093 What is next in 37, 55, 107, 211, 385, 647? 1015 What is next in 368, 738, 1110, 1484, 1860, 2238, 2618? 3000 What is the next term in -1539, -1708, -1875, -2040? -2203 What is next in 1379, 2757, 4135? 5513 What comes next: 2013, 4011, 6009? 8007 What is the next term in 1432, 1501, 1670, 1987, 2500, 3257? 4306 What is the next term in 2707, 2740, 2787, 2854, 2947, 3072, 3235? 3442 What is the next term in -82557, -330224, -743003, -1320894, -2063897, -2972012, -4045239? -5283578 What is next in -3039491, -3039493, -3039495, -3039497, -3039499, -3039501? -3039503 What is next in -147, -152, -129, -60, 73, 288, 603, 1036? 1605 What comes next: 9, 46, 173, 444, 913, 1634, 2661? 4048 What is next in 169, 600, 1031, 1462, 1893? 2324 What is the next term in -555, -585, -663, -813, -1059, -1425, -1935, -2613? -3483 What is next in 28129, 56254, 84377, 112498, 140617, 168734? 196849 What is the next term in 188, 204, 222, 242, 264? 288 What comes next: 348, 631, 914, 1197, 1480, 1763? 2046 What is the next term in 16, 47, 116, 235, 416? 671 What is the next term in -123698, -123695, -123694, -123695, -123698, -123703, -123710? -123719 What is next in -965, -952, -937, -920, -901? -880 What comes next: 99, 150, 173, 156, 87, -46, -255? -552 What is next in 747, 1401, 2053, 2703? 3351 What is next in -154, -263, -372, -481, -590, -699? -808 What is next in 358, 705, 1034, 1339, 1614, 1853, 2050? 2199 What is the next term in 8296, 8385, 8474, 8563, 8652, 8741? 8830 What is the next term in -9804, -9818, -9864, -9960, -10124, -10374, -10728, -11204? -11820 What is the next term in 192743, 192736, 192727, 192716, 192703, 192688? 192671 What is next in 83, 130, 209, 320, 463, 638? 845 What is next in 90570, 90571, 90572, 90573, 90574? 90575 What is next in -55839, -111676, -167515, -223356, -279199, -335044? -390891 What comes next: 720, 1294, 1868? 2442 What is next in 159, 454, 885, 1452? 2155 What is next in -17, 7, 29, 49, 67, 83? 97 What is the next term in -10, -81, -196, -355? -558 What is next in 116, 121, -128, -757, -1892? -3659 What comes next: 3645, 3900, 4339, 4968, 5793, 6820, 8055? 9504 What is the next term in 141583, 566318, 1274209, 2265256, 3539459, 5096818? 6937333 What is next in 4752, 4501, 4250, 3999? 3748 What is the next term in -71, -195, -363, -581, -855, -1191, -1595? -2073 What comes next: -10502, -21028, -31552, -42074, -52594, -63112? -73628 What is next in 4466, 8950, 13436, 17924, 22414? 26906 What is the next term in 736, 738, 728, 700, 648, 566, 448? 288 What is the next term in 2590, 5108, 7632, 10168, 12722, 15300? 17908 What comes next: -1227, -4918, -11069, -19680, -30751? -44282 What comes next: 94, 306, 646, 1102, 1662, 2314, 3046? 3846 What comes next: -285, -1053, -1821, -2589, -3357? -4125 What is the next term in 662, 1297, 1944, 2609, 3298? 4017 What comes next: -11, -132, -405, -890, -1647, -2736? -4217 What comes next: 25566, 51139, 76712? 102285 What is the next term in -4229739, -4229743, -4229751, -4229763, -4229779, -4229799, -4229823? -4229851 What comes next: -755, -751, -725, -665, -559, -395? -161 What comes next: 43487, 86966, 130439, 173906? 217367 What is next in -212050, -848199, -1908452, -3392815, -5301294, -7633895, -10390624, -13571487? -17176490 What is next in -2146, -2157, -2168, -2179? -2190 What is the next term in 181, 316, 539, 850? 1249 What comes next: -982, -546, -120, 290, 678? 1038 What is the next term in -2, -41, -112, -233, -422, -697? -1076 What is next in 21873, 43747, 65621, 87495? 109369 What is the next term in -1666, -3341, -5028, -6733, -8462, -10221, -12016? -13853 What is next in 20353, 40671, 60989, 81307, 101625, 121943? 142261 What is next in 98, 137, 228, 395, 662, 1053, 1592? 2303 What is next in 267, 262, 261, 264, 271? 282 What is the next term in -2356, -2320, -2238, -2092, -1864, -1536, -1090? -508 What comes next: -290, -546, -736, -824, -774, -550, -116? 564 What is next in 2120, 4182, 6244? 8306 What is the next term in -83068, -166134, -249200? -332266 What is next in -225, -491, -785, -1119, -1505, -1955, -2481? -3095 What comes next: 582070, 582068, 582066? 582064 What comes next: -293, -434, -415, -236, 103? 602 What comes next: 42, 83, 146, 237, 362, 527? 738 What is the next term in -21664, -43334, -65004, -86674, -108344, -130014? -151684 What comes next: 92528, 185063, 277598, 370133, 462668? 555203 What is the next term in -630, -1598, -2894, -4512, -6446, -8690? -11238 What comes next: -17873, -35754, -53647, -71552, -89469? -107398 What is the next term in -272, -295, -318, -341? -364 What is the next term in 35, 251, 877, 2129, 4223, 7375, 11801, 17717? 25339 What is the next term in 14708, 14706, 14690, 14654, 14592, 14498, 14366, 14190? 13964 What is the next term in 18530, 18543, 18558, 18575? 18594 What is next in 3815, 7624, 11433, 15242, 19051? 22860 What comes next: 44, 145, 404, 899, 1708, 2909, 4580? 6799 What comes next: -4580, -4602, -4648, -4724, -4836, -4990, -5192, -5448? -5764 What is the next term in 4230, 8516, 12802, 17088, 21374? 25660 What comes next: -1673, -3161, -4649, -6137? -7625 What is next in 174, 480, 916, 1488, 2202? 3064 What comes next: 2153, 4323, 6489, 8651? 10809 What is the next term in -22704, -45416, -68128? -90840 What comes next: 1466, 3210, 6118, 10190, 15426? 21826 What comes next: 75650, 75645, 75640, 75635, 75630, 75625? 75620 What is the next term in 1861, 1856, 1835, 1786, 1697, 1556? 1351 What is the next term in 2076, 2065, 2066, 2085, 2128, 2201, 2310? 2461 What is the next term in 9938417, 9938416, 9938415, 9938414? 9938413 What comes next: 118187, 118217, 118247, 118277, 118307? 118337 What is the next term in 150, 651, 2012, 4665, 9042, 15575, 24696, 36837? 52430 What comes next: -1595, -1600, -1605, -1610? -1615 What comes next: -91977, -91978, -91979? -91980 What is the next term in -214898, -429793, -644688? -859583 What comes next: -64842, -64844, -64846, -64848, -64850, -64852? -64854 What comes next: -706, -703, -700, -697, -694, -691? -688 What comes next: 61, 103, 165, 241, 325, 411? 493 What is next in -11, -62, -149, -272? -431 What is the next term in -256, -529, -7	{ "pile_set_name": "DM Mathematics" }
((-3 - 7) + 4 - (-40 - 3)). -32 Evaluate 102 - 124 - (-24 - -2). 0 Calculate -307 - -348 - (-52 - -2). 91 Calculate 1 - (-15 + (68 - 1 - (93 - 97))). -55 -1 - -18 - (73 - 170 - -79) 35 Calculate 2 + (-40 - (11 - 20)). -29 What is the value of 4 + -11 + (4 - 0) + 33 + -41 + 14? 3 What is the value of (-24 - -8) + (6 - -13) - (6 + 0)? -3 Calculate (6 - (38 + 11) - -17) + 3. -23 (6 - 9) + 0 + (-2 - 3) + -447 + 473 18 Calculate (210 - 216) + 8 + -5 + (-3 - 2 - 118). -126 Evaluate -3 - 0 - ((25 - 63) + -75 - -38). 72 (0 + 1 - -36 - (432 + -444)) + -7 42 What is the value of 21 + 6 + 12 + -14? 25 (7 - (-1 + 22)) + 26 + -1 + 8 19 68 - ((2 - -9 - (-79 + 90)) + 2) 66 0 - 15 - (-74 + 4 + 101) -46 Evaluate -38 - (-34 - (-61 - -115)). 50 What is the value of (-105 + 43 - -29) + -9? -42 Calculate -4 - (21 + -18 + (3 - (-8 + 75 - -1))). 58 What is 9 - ((-51 - 11 - 4) + (11 - 12))? 76 0 + 59 + -872 + 805 -8 What is the value of -51 + 58 + -102 - -47? -48 7 - 0 - (-53 - (-33 - -10) - -4) 33 Calculate -1 + -3 + (126 - (-3 - (10 + -21 - 15))). 99 -23 + (-1 + 18 - (-2063 - -2085)) -28 What is the value of (6 - 57) + 11 - (11 - (5 - -2))? -44 What is the value of 30 + -36 + 0 + (7 - 3) + -24 + -1? -27 What is the value of -107 + (4 + -7 - -8 - 5 - (3 - 12))? -98 What is the value of -12 - -46 - 14 - 25? -5 What is the value of -108 - (57 - (-25 - -144))? -46 Evaluate (1 - 1) + (19 + -2 + -11 - -3) - -59. 68 What is the value of -246 + 8 + -62 + 183? -117 What is 90 + (33 + 0 + -5 - 44)? 74 What is 0 - 34 - (21 + -41 + (30 - -9))? -53 31 - 1 - (6 - -40) -16 Evaluate 11 + (8 - 4) + (218 - 200). 33 -345 + 47 + 304 - (-46 - (-2 - -4)) 54 Calculate 90 + (-68 + 52 - 21). 53 Calculate -5 + -4 + 0 + -2 + 7 + -18 + 9. -13 What is -2 + (-54 - -41) + (-1 + 28 - 0)? 12 What is the value of -86 + (38 + -75 - -38) + 35? -50 What is the value of 23 - (-1 + -12 + (254 - 234) - (-2 + -1))? 13 Evaluate (-9 - (-16 + 13)) + (-1 - (4 - 8)). -3 What is the value of -10 + 3 + (71 - (8 + -5 + 8 + -5))? 58 6 + (5 - 1) + (-19 - 3 - -9 - 54) -57 3 + (31 - (0 + -2)) + 240 + -91 + -152 33 (-13 - (-23 - -7)) + (-1 - (4 + -5 + 1)) 2 Calculate (6 - -1) + (486 - 487) + -42. -36 -57 - (-15 + 1 - (-187 - -135)) -95 What is -76 + 80 + (4 - (24 + -1)) + 3? -12 Calculate -66 + 2 + 34 + -7 + -80 + 67. -50 Evaluate 66 + 0 - (-1540 - -1596). 10 What is the value of (0 - -41) + (-31 - 2) + (109 - 95) + 11? 33 What is -1 - (-6 + 40) - (-2 - (7 + -8))? -34 What is the value of 2 - 20 - (-7769 + 7678)? 73 -101 + 40 - (2 + 6 + (-11 - (-7 + 2))) -63 What is -66 - (297 + -325 + 1 + 9)? -48 -25 - (6 - 45) - -22 36 Evaluate -2 - ((-2 - -3 - -1 - 91) + (-97 - -98)). 86 Calculate -4 + 3 + -5 + -2325 + 2372. 41 15 + -26 + (3 - -89) 81 33 + (141 - (383 - 110)) -99 Calculate -81 + (17 - (-8 - -17 - 7)). -66 -39 + (313 + -330 - (-2 + -21)) -33 2 + 21 - (-6 - (-94 - -4)) -61 What is the value of (-29 + -44 - -40) + 4 + (3 - 1)? -27 -140 - -4 - (2307 - 2426) -17 9 + -16 + (22 - 14) + -6 + -13 -18 What is the value of (5 - (4 - 1)) + 1 + -65 + 5248 + -5257? -71 What is -41 - ((-5 - (-4 + (9 - 18) + 5)) + 1)? -45 Calculate 19 - 92 - -73 - 81. -81 What is the value of -2 + -13 + 25 + -16 - 14? -20 Evaluate 583 + -587 + 26 + 2. 24 Calculate 65 + -24 + -65 - 33. -57 Evaluate 19 - ((-54 - -79) + -26). 20 What is the value of (-12 - -16 - (0 + 9)) + -62 + 48 + 50? 31 What is -6 + -1 + 6 + 2 + 14 - (-3 + 3)? 15 What is 6 + -15 - (-14 + 30 + -3)? -22 (10 - 3) + 33 + 123 + -143 - -14 34 Evaluate 20 - ((-281 - -281) + (-3 - 18)). 41 Calculate -88 + (-20 - -42) - -26. -40 Calculate 41 + (4 - -5 - 19 - 5). 26 -9 + -38 - (-51 + -5) - (-47 + (1 - 3)) 58 What is the value of -1833 + 1789 - (-16 + 9 + 1 + -2 + -2)? -34 Calculate (-6 - -59 - 54) + -6 + 64 + 2. 59 What is the value of (-166 - -144) + (-50 - (2 - (-3 - -4)))? -73 (0 - 56) + 40 + -39 - ((35 - 32) + -15) -43 Calculate 107 - ((1 - -39) + 358 + -369). 78 2 + -40 + -2 + (-5 + -42 - 31) + 66 -52 (6 - -1) + -37 + -7 + (49 - 18) - 68 -74 Calculate 67 + (9 - 42 - 20). 14 Evaluate 2 - -1 - (569 - 591) - (8 + -5 - -8). 14 -1 - (-6 - (-20 + 3) - (-25 + 1)) -36 Evaluate -27 + (-24 + 33 - -13). -5 What is -4 + (-1 - 15) + (-1 - 2) - (-18 + 7)? -12 Evaluate -85 - 7 - (-108 + 63 + 6). -53 Evaluate -255 + 131 + 253 - 99. 30 (1 - (0 - 2)) + (-35 + -9 + -18 - -12) -47 -224 - -59 - -119 - -146 100 -26 + -29 + 33 - -15 -7 Evaluate -45 + 140 + (84 - 144). 35 Calculate 24 + (-3 - -2) + (-395 - -381) + -27 + 0. -18 What is the value of -66 + 25 + (-124 - -118) + 0 + 2 + 12? -33 What is 157 - (25 + 4 - (54 + -63))? 119 Calculate (0 + -3 - -8) + (-22 - (25 - 94)). 52 What is the value of -40 - ((-23 - -53) + -30) - -90? 50 Calculate -5181 + 5120 + (6 - -1 - (-5 - (1 + -4))). -52 What is 1 + -3 - (-331 + 231 - -153)? -55 What is -3 + (-13 - (28 + -36 + (-4 - -16)))? -20 What is 86 + 26 + -215 + 98? -5 -50 + 33 + (61 - 3) 41 -5 + (-6 - -23) + -46 + 43 + -12 + 0 -3 Evaluate 0 + 50 - (-15 + (-21 - -18) - (6 - 27)). 47 What is 44 + (-73 - 1) + 63? 33 Calculate 0 - 1 - (-26 + 27 - 35 - 13). 46 Calculate (44 - -4) + (414 - 402). 60 0 - 0 - (-29 + (16 - 21) + 4) 30 Calculate -19 + -59 + (9 - 39) + 19. -89 -90 + (221 - 153) + -105 -127 Evaluate 47 + -8 + -46 - -26 - 47. -28 What is -25 - (-9 + 1) - (80 + 6 + 5)? -108 Evaluate 4 - -4 - 21 - (49 - 11). -51 Evaluate 73 + 2 - (14 - 22 - 7 - (-7 + -1)). 82 49 + 2 - (-10 + 4 + (-6 - 1)) 64 Calculate -40 + (-26 + (2 - -8) - -14 - 9). -51 What is 46 - 45 - (-57 - -2) - 21? 35 Calculate -2 - (-58 - (-38 - -29)). 47 What is the value of (-19 - (-5 + 26 + -34)) + -9 + -6? -21 What is the value of 100 + -53 - -11 - 24? 34 Calculate 122 + -47 + -33 + -48 + -2 + 0. -8 What is the value of -104 - (-111 + -82 + 115)? -26 13 + -15 + (-6 - (22 - 11)) -19 Evaluate 2 - (-10 + (-4 - (12 + -35))). -7 What is 141 + (-17 - 132 - -139 - (1 - -12))? 118 What is the value of -84 + (69 - 54) + 118? 49 Calculate 48 - 4 - (2 + -12) - 3. 51 Calculate -30 - 163 - -125 - -154. 86 What is the value of -26 + (-10 - (-20 + (-8 - (-7 - 3))))? -18 Evaluate ((-7 - -15) + 11 - 19) + 17. 17 Calculate -110 + -1 - (182 + (-253 - -72)). -112 Evaluate -28 + -2 + 399 + -334. 35 What is the value of (24 - 21) + (-14 + 6 + -46 - (1 - 5))? -47 Calculate -4 - -3 - (-242 - -224 - (-1 + -33) - 2). -15 Calculate 5 - (-21 + 27 + -62 + 33). 28 -41 + 49 + -13 + -34 -39 Evaluate -61 - (-78 + (22 - -21)). -26 What is the value of 49 + -4 + (-7 - (-33 + 17 + 4))? 50 Evaluate 0 + 22 + -6 + 29 + 12. 57 What is 93 + -88 + (38 - -2)? 45 Evaluate (6 - (9 + -11) - 2) + -9 + 10 + -30. -23 -10 + -3 + (0 - -1) + (-223 - -230) -5 Calculate 11 + 11 + 7 + -15 - 19. -5 What is (-3 - -62) + -729 + 671? 1 What is 21 + -43 + 59 + (-5 - -2) + (-2 - 6)? 26 What is (-23 + 24 - -19) + 15 - (0 - 4)? 39 What is (-47 - -47) + (-23 + 9 - -45)? 31 6 + (-539 - -545) + -21 + -2 -11 What is -20 - (140 - 36 - 23)? -101 What is 1 + (-2 - (47 + -47)) - (2 + -2)? -1 Evaluate (7 - -1) + 32 + -4 - (17 - 4). 23 What is (30 - -9) + 130 + -156? 13 Evaluate (27 - (21 + 7 + -17)) + (0 - -7 - 0). 23 Calculate (106 - 14) + -26 - (11 - 1) - -11 - 5. 62 Evaluate 29 - (18 + -18 + (-1 - -60)). -30 3 + 0 + 1 - (-155 + (339 - 176)) -4 335 + -317 + (1 - 16) - (3 - 15) 15 What is the value of 114 + -12 + -110 - 46? -54 What is -10 - -2 - (-25 - (-97 + -4 + -24))? -108 Evaluate 8 + (-39 - -6 - -15) + -17. -27 What is -34 + (-89 - (-43 + -18))? -62 Evaluate (-23 + 4 - -1) + -1490 + 1531. 23 -51 + 145 + (-160 - -87) 21 What is (133 - (-3 - -10)) + 14 + (-3 + 2 - 8)? 131 Calculate -10 - (1 + (-16 - 50)) - 3. 52 What is -13 - (-55 - (4 - (-11 - -22)))? 35 What is (206 - (-241 - -456)) + (0 + -2 - 2)? -13 What is the value of -1 + (-1 - 2) - 3 - (-10188 + 10136)? 45 Calculate (40 + -18 - 90) + -3. -71 What is -48 - (-68 - (-119 + 76))? -23 Calculate (3 + -4 - (4 - 8)) + 37. 40 28 - ((-33 - -85) + -50) 26 Evaluate -7 - (2 + -4 + 34 + 71 + -86). -24 -51 - (19 + 5 - 17) - -20 -38 Evaluate 68 - (110 + 32 + -16). -58 Evaluate 0 + -804 + 798 + (-1 - 2 - (-27 + -2)). 20 Calculate (0 - 20) + (-11051 - -11065). -6 What is the value of 14 + 0 + (-6 - 15 - -31)? 24 Evaluate -47 + (-19 - -7 - -74). 15 What is 40 + (8 - 6) - ((14 - -7) + -33)? 54 Calculate 17 - (-59 + -6 - -1	{ "pile_set_name": "DM Mathematics" }
ng r is positive. r*(3184/77) Simplify (fff(-7)ff/(ff*(-6))f)/(f*(2/7)/f(((ff(-7/3)/ff)/f)/f)/f)((f3)(-1/8))37 assuming f is positive. f(-979/168) Simplify ((o(2/3)/o)/o6oo/o(-5)(o(-1)/o)/o)/(((o(-1/3)/o)/o)*34(oo(-5))/(o/(o/o(-4/9)))) assuming o is positive. o(725/9) Simplify (((gg*(-6)g)/g*5)/(gg*5g(g(2/7)/g)/g))/(g/(g/g2)g/g*(-3)g*(2/3)g6) assuming g is positive. g(-566/21) Simplify ((p*(-2/9)/ppp)17)44((pp1p)/p(5/4))(-1/91) assuming p is positive. p*(272263/468) Simplify (rr*(-3/4)r/(r*0/r))/((rr/(rr(2/3)))/rrr/(r(-2/9)/r))(r(2/9)/r6)/(r/r1)34 assuming r is positive. r*(-73/12) Simplify (((hhh(-2/29))/h(hh/((h((h*46h)/hh)/hhhh)/h)h)/h)/(h(1/7)/h)(-24))49 assuming h is positive. h(-94696/29) Simplify (v(-4)vv(-2/19)vv)(8/13)((v/v*(-2))/vvv/v(2/11))/(v(-2/15)/v7) assuming v is positive. v(418609/40755) Simplify ((v/(v(-1/5)/v)v/v*(2/5)v*(-4)v(-1/5))(2/53))(-14) assuming v is positive. v(196/265) Simplify (ll4l/l(-2))34(l(ll/(l/(((l((l*(-6/5)/l)/l)/l)/l)/l))ll)/ll/(l/l(4/3)))/(l(-4/3)l6) assuming l is positive. l(3997/15) Simplify ((o(-6)/(o/(o/((o/o(-3))/o)o))(o/o(-1/4))(10/7))50)18 assuming o is positive. o(-39150/7) Simplify ((f(3/5)f)/f(-4/7))(6/17)(f(-6)f*(-2/5)f)(2/3) assuming f is positive. f(-1686/595) Simplify ((oo(-20))(-12/11)/(o22)(-6/5))(-3/14) assuming o is positive. o(-3888/385) Simplify (l(5/7)ll(14/5)ll(l(1/2))(3/7))(-2/159) assuming l is positive. l(-157/1855) Simplify (l7/l(-6))/(l*2ll(-4/9)/l)((l/((ll(-2))/l)l)33)(-3/26) assuming l is positive. l*(-443/117) Simplify (((((ppp(p/(p(p(1/2)p)/p))/p)/p)/p)/(p*(-5)p))/((p*(-5/7)p)/(p*(-22)p)))(-5) assuming p is positive. p(1245/14) Simplify ((ll/(l/(ll/l3)))/l)(-2/53)(l/l(11/2))/l26 assuming l is positive. l(-3229/106) Simplify ((((t/t2t)/tt)/t)(2/75)/(t/(ttt/t(-5)t))32)19 assuming t is positive. t(364762/75) Simplify (c38c)/cc*(-2/27)(c19/c)(2/25) assuming c is positive. c(26572/675) Simplify ((s(3/5)/s)/(ssss(7/5)sssss))/(s/(ss(-33))s(-44)/s) assuming s is positive. s(11/5) Simplify (((i*(1/4)i)/(ii/(iii7/ii)))/(i(-1/2)/(i/i7)))/((i(1/2))(-27)/(i*(-4/3)i/i(-2/7))) assuming i is positive. i(1361/84) Simplify ((r*(-4)r*(1/5)r)/(r*6r(-2/27)))/(r(-1)r(3/4)(r*(1/4)r)(-20/3)) assuming r is positive. r(-77/540) Simplify w(2/7)/(w/(w(-4)ww))w/w(-3)www*(-3)w/(w/(ww/w(-4/3)))w*2/w(w/((w/(ww(-1/4)))/w))49 assuming w is positive. w(7591/84) Simplify ((h21h)/(hhhh(-13)/h)(hhh/h*(-13/3)hh)/(hh/h(2/17)))45 assuming h is positive. h(30945/17) Simplify (w(-19))*(17/3)/(w(w(4/17)/w)/w)(1/17) assuming w is positive. w(-93308/867) Simplify ((h(-9/7)/(h*2h))/((h/((h/(h/h*(-4)))/h))/((hh*(-14)h)/h)))2 assuming h is positive. h(-326/7) Simplify ((a/(a/(a/(a*(5/2)a))))/a*(-17)(a/(aa(10/7)))39)(-38) assuming a is positive. a(10963/7) Simplify (u/u6)/((uu*(-2))/u)((u/(uuuu6u))/u)/uu/u(2/11)(u*6/((uu1)/u))/(u5u5) assuming u is positive. u(-200/11) Simplify (((w(-3)w)/ww)3ww32(ww11/www)/w)(-17) assuming w is positive. w(-663) Simplify ((y(-6)/((((y(y/(y/(yy/y4)))/y)/y)/yy)/y))/(y1)(14/3))/((((yy(-1))/y)/y)(-21))(-1/15) assuming y is positive. y(-58/15) Simplify ((y5/y12)/(yyy/(y/y(-9/7))y*2y))(-20) assuming y is positive. y(1500/7) Simplify ((rr4rrr(-6))/(r/r(-4)(rr10)/r))(3/5) assuming r is positive. r(-42/5) Simplify (h/(h/h(2/3))h/(h3/h))/((h(-3)h)/hh(2/3))((h(-2))(-3/16))(-2/25) assuming h is positive. h(197/100) Simplify ((g/g(-42))/g(-9))/(g*36g(24/7)) assuming g is positive. g(88/7) Simplify (b5/((b/b2)/b)(b/(b/b(-2/9)))/(b/b(-2)))(-10) assuming b is positive. b(-340/9) Simplify (c(-6/11))22(c/(c/c11))(-5/3) assuming c is positive. c(-91/3) Simplify (c(-3/4))(3/8)/(c/c26)(2/11) assuming c is positive. c(1501/352) Simplify (i*(3/4)iii3)(-23)/((iii((i/((i/i2iii)/i))/ii)/ii)(5/4))(3/22) assuming i is positive. i(-11683/88) Simplify (w(3/17)/wwww(-12)ww(-7)www/(w/((ww36/w)/w)))(-31) assuming w is positive. w(-10633/17) Simplify (((cc*(-2/5)c)/c)*(-19)(cc(16/7))/c(3/10))11 assuming c is positive. c(-6479/70) Simplify (l(-10)l*13l*(2/45)/(l/(ll*(-1/4)/lll)))(5/3) assuming l is positive. l(683/108) Simplify ((b(-14/3)/(b7/bb))/(b*(2/9)(b*5b)/b))1 assuming b is positive. b(-152/9) Simplify ((l*(-1)ll)(2/11)/((l/(l/l6l))/l*(-1/3)))/((lll(-2/19))/(l/(((l/l(1/3))/l)/l)))21 assuming l is positive. l(2545/627) Simplify (((d(-1/2)/d)/(d/(d/d(1/6))d))/(d/(d/d(2/5)))48)/((((dd2)/d)/d)(-6))(-35) assuming d is positive. d(-3478/15) Simplify ((f/(fff3/f)ff/(ff/f*(-5)fff))/(f*(3/10)/fff/f(2/3)))/(f5f*(1/5)f/f*(-2/13)f(-5)) assuming f is positive. f(-1013/78) Simplify ((m(-6)/(m/(m/(m/(m/(m/(m/m(-12))m))))))/(mm*(4/7)/mmm13))(-14) assuming m is positive. m134 Simplify ((pp7)/p5)/(((p/(((p*(-7)/p)/ppp)/p))/pp)/(p/p*(-2/13)))(p*(-7)/(p(p/(pp(-2/5)/p))/p))38 assuming p is positive. p(-21063/65) Simplify (p16p(-24)/p)/(p(14/3)p43p) assuming p is positive. p(-173/3) Simplify (p10/(p/p7))(4/5)((pp/(pp(2/11)))12)(-18) assuming p is positive. p(-9016/55) Simplify (g(3/7)g(ggg(-17)g)/g(g(-2/105)g)/(gg21))29 assuming g is positive. g(-105328/105) Simplify ((u/(u(-10)/u)u)/(u/u*(-5)u)u(u(u/((uu*(-2/23))/u))/u)/uu18/u)(-45) assuming u is positive. u(-24930/23) Simplify c0c/c(-3/22)c/c*(-23)(c21/c)/c assuming c is positive. c(971/22) Simplify (a*(-20)/(aa*1/aa)aa*12aa(-19))(-3/8) assuming a is positive. a(81/8) Simplify (((((l9ll)/l)/l)/(l/(ll15)))/(l12)35)49 assuming l is positive. l(-19404) Simplify ((o/o(-1))*(-24)(o9/o)/(o(-5/4)o))/(((oo*(2/13)o)/(o/o*(2/9)))/(oo/((oo(-2/5))/o)o(2/9))) assuming o is positive. o(-10011/260) Simplify (x*(-1/4)xx)50(x*(-31)/xx)/((x/(x/x*(1/18)x))/x) assuming x is positive. x*(526/9) Simplify ((jjj(-2/13))/jjjj/j*(-3/2)jj(-1)jjj/(jj/j39))(-36/5) assuming j is positive. j(-21222/65) Simplify ((s(2/7))44/(((sss3)/s)/((s/(ss(-3)))/s)))/((s(-2))(-1/12))(-26/9) assuming s is positive. s(2089/189) Simplify (((p/p22)/(p*(-19/3)p))/((p/(p*14/p))/(pp*17/pp)))(-1/16) assuming p is positive. p(-43/48) Simplify ((ss(-1/5))/s(-7))(-4/9)/((s/(ss/(s*(-2/9)s)))/s*(-1/10)s*(3/5)ss/(s(s/s*(-1))/sss)s) assuming s is positive. s(-53/18) Simplify ((w(-5))35/(w/(w10/w))(5/17))(-12) assuming w is positive. w(35220/17) Simplify ((h/h(5/11))(-35)/(h(-7/2)h15))(-43) assuming h is positive. h(28939/22) Simplify (r(-2/5))(-11/5)/(r/(r/((r/((r(-1)r)/r))/r))r)(2/75)((r(2/5))(-7))21 assuming r is positive. r(-4348/75) Simplify ((uu(uu(((u/(uuu*(1/3)/u))/u)/u)/uuu)/uuuuu)(2/79))(6/35)((u*(-5)u)/(u/(u/(uu/(u(-1)/uu)u))))(-8) assuming u is positive. u(177028/2765) Simplify q/(q(qq/(q/(q/q(-28/9))))/q)q/q*(-22/5)q(1/11)/q(-4/15) assuming q is positive. q*(163/99) Simplify (((jj*(2/17))/jj)/(jjj/j*(2/13))(jj(1/50))/j(3/5))(2/93) assuming j is positive. j(-14459/513825) Simplify ((i(ii(1/2)/i)/i)/(i(-2/17)i)(iii/(i(-1/3)/i))36)/((i4/(ii/(ii(2/11))))/(ii(-2/5))(-15)) assuming i is positive. i*(53645/374) Simplify ((jj*(-1/14)jjj)/(jj(-1/6)))(-4)j/(j/(jj(-6)/j))j*4(jj1)/(jjj/j(1/4)j) assuming j is positive. j(-1355/84) Simplify p(-1/2)p/p(2/7)(p/(ppp/(p/(p*(4/21)p))p))(-1/25) assuming p is positive. p(359/1050) Simplify (((p/p(3/5)ppp)/p*	{ "pile_set_name": "DM Mathematics" }
1 = 4v + 67w. Is v a multiple of 9? False Suppose 0 = -88x + 1015933 - 296885. Is 32 a factor of x? False Let c = 104885 - 48767. Does 47 divide c? True Suppose a + 5v = 46, -3v + 89 = 4a - 10. Suppose -15 - a = -6p. Does 23 divide (-20)/p1104/(-40)? True Let n(z) = 87z3 + 2z + 2. Suppose -15y = -17y - 2. Let k be n(y). Let s = 12 - k. Is 9 a factor of s? True Let x(c) = 3 + 20c + 11 + 4c*2 - 6c - 17c. Does 21 divide x(-8)? True Suppose -4b + 3i + 17 = 0, 2b - 3i - 13 = -0i. Suppose 3x - 2x = -5t - 17, 0 = -bt - 4x - 14. Let a(u) = 6u*2 - 3u + 4. Is a(t) a multiple of 10? False Let v(z) be the first derivative of -19z2 - 46z - 9. Let r be v(9). Is 2/(-1) - (-3 + r/4) a multiple of 51? False Let c be (-2 - 10/(-4))(-24)/(-6). Suppose -cu + 2x = -2x - 20, 5u = 4x + 26. Let t(m) = 65m - 19. Is t(u) a multiple of 37? True Let p = -241 + 388. Suppose -10z = p - 467. Suppose zw - 184 = 28w. Is 46 a factor of w? True Let m = 8 + -5. Suppose ml - 4l - 222 = 0. Let f = -150 - l. Is f a multiple of 15? False Let h(x) = x*2 - 2x - 17. Let v be h(6). Let q(a) = 1 + v + 4 + 6 - 2a. Is 2 a factor of q(8)? True Let u(q) = q3 - 20q*2 + 153q - 15. Does 3 divide u(13)? False Let o = -6147 + 13395. Is 20 a factor of o? False Let b be -5 - -3 - (51 + 0 - 3). Let i = 4 + -33. Let w = i - b. Is w a multiple of 16? False Suppose -4n - 15 = -n. Let h be (-109 + -1)n/2. Suppose 6j = j + h. Is 11 a factor of j? True Is 27 a factor of ((-56034)/1415)/(1/(-300))? True Let o be 4 + (-27)/(-6)(-20)/(-6). Let v(u) = -u*2 + 34u + 43. Is 14 a factor of v(o)? False Let p = 2810 + -1526. Is 21 a factor of p? False Suppose 2t + 3n + 10 = 28, 5t + 4n - 31 = 0. Suppose v + 7 = -t. Let r(l) = -l*3 - 10l*2 - l + 2. Is 6 a factor of r(v)? True Suppose -19587 - 8583 = -10r. Is 3 a factor of r? True Suppose -59l + y = -63l + 79340, -l - 2y + 19828 = 0. Is 29 a factor of l? True Let l(c) = c2 - 4c - 19. Let j be l(6). Let x be j - (-1 - (2 + -2)). Let f(k) = -k + 1. Does 6 divide f(x)? False Let k(v) = 3v + 37. Let g be k(-11). Suppose m + g = 520. Is m a multiple of 45? False Let i(p) = 12p*2 - 41p - 136. Is 36 a factor of i(15)? False Let c = 5240 + -3738. Is c a multiple of 7? False Let s be ((-100)/15)/(4/(-12)). Suppose 0 = sd - 8d - 444. Does 30 divide d? False Let z = -19482 - -23284. Does 25 divide z? False Suppose 1873020 = 187z + 409558. Is z a multiple of 26? True Is 18 a factor of (15/30)/((-115605)/(-23120) + -5)? False Let v = -560 + 739. Suppose -3z + v = -685. Does 24 divide z? True Let k(w) = 52w - 32 - 11 - 7 + 2w2. Does 89 divide k(-34)? False Let h(x) = x2 + 6x - 3. Let c be h(-5). Let d(m) = -m3 - 4m*2 - 14m - 25. Is d(c) a multiple of 15? False Suppose -35 = -93k + 92k. Is 11 a factor of 15/(-25) + 6951/k? True Let r = 9 - 8. Let p(s) = r - 3s + 18s*2 - 14s*2 - 11s. Is 11 a factor of p(6)? False Let a = 45 + -43. Suppose -5j - 2b + 440 = 2b, -ab = -5j + 410. Is j a multiple of 25? False Suppose x + 78 = 112. Let f(l) = -3l*2 + 116l + 28. Does 84 divide f(x)? True Let i = 3398 - 2318. Is i a multiple of 12? True Let v = -15489 + 15705. Is v a multiple of 76? False Let h be 70/4212/10. Suppose 0 = 3u + 4y - 198, -hu + 117 = -2y - 29. Does 14 divide u? True Let t(a) be the third derivative of -a6/120 + 7a*5/20 - 13a4/24 + a3/6 - 71a2. Is 47 a factor of t(20)? True Suppose -b + 20 = -5z, -4z + 4b + 2 - 18 = 0. Is (z - -5 - (-221 + 1)) + -1 a multiple of 22? True Let b(i) = -i*3 + 10i*2 + 11i. Let r be b(11). Let v be (-162)/(-12)(2 - r). Suppose -vh + 21 = -24h. Is 2 a factor of h? False Let l be 144 + 1 + 5 - -5. Let r = -29 + l. Is 14 a factor of r? True Is 15 a factor of (-558790)/(-55) + 81/(-99) + 1? False Let x(c) = 2c*3 + 62c*2 - 8c - 494. Is x(-29) a multiple of 11? True Suppose 0 = b + 3p - 828, -5b - 2811 + 6991 = 5p. Suppose -b = 13w - 18w. Is w a multiple of 7? True Suppose 2f = 3t - 312, 5t - 10 = -0t. Let l = f - -414. Is 29 a factor of l? True Suppose 0 = 2c - 14, 70621 = 6z + 4c - 9c. Is 46 a factor of z? True Is 5 a factor of (10178/(-70))/(20/(-1000))? True Suppose 9g - 24g + 28320 = 0. Does 118 divide g? True Let t(p) = -p3 - 6p*2 - 4p + 9. Let n be t(-5). Let j be -291 + 6 - -1n. Let d = 400 + j. Does 12 divide d? False Let p = 197 - 193. Suppose -2h = -po - 2, 0o + 2o - 26 = -2h. Is h even? False Let x = 765 - 858. Suppose -w + 2w + 36 = 0. Let a = w - x. Does 14 divide a? False Let m(s) = -s2 + 29s - 65. Let r be m(25). Let t = 21 - 14. Suppose tw - r - 196 = 0. Is 13 a factor of w? False Is 37/(-42) - ((-9421)/2)/1 a multiple of 15? True Let b(i) = -i*3 + 17i*2 + i + 52. Let m(n) = 6n*3 + 25n*2 + n + 4. Let x be m(-4). Is b(x) a multiple of 12? True Let o = -4071 + 10021. Does 35 divide o? True Suppose -6y = -y - 17460. Suppose -6k + 1499 = -4o + 6155, 0 = -3o + 4k + y. Does 97 divide o? True Let m = 8 - 26. Let n be (m/(-5))/(-6) + 204/15. Let r = 9 + n. Is r a multiple of 13? False Let f = 25 + -20. Suppose 2m = -fn + 303, -3m + 460 = -0m + 2n. Suppose 31 = c - m. Is c a multiple of 54? False Suppose 6 = 2t + 4c, 7t - 3c - 28 = 2t. Suppose -q - 245 = -2p - 0q, -5q = -tp + 610. Suppose 237 = 4v - p. Is v a multiple of 15? True Let w(r) = -226r - 789. Is w(-39) a multiple of 107? True Suppose 1781797 + 129203 = 7j + 63j. Does 21 divide j? True Suppose -45h + 112223 + 373338 = -60469. Does 199 divide h? False Let i(d) = d3 - 12d*2 - 10d. Let p be i(14). Let c be 13/(-65) - p/(-10). Suppose -2k - 2h = -k - c, 5h = 20. Is 6 a factor of k? False Suppose -2x = -12, -7b + x + 170 = -6b. Does 88 divide b? True Let q = -12727 + 19916. Does 3 divide q? False Let p = 9 + -4. Suppose 0 = 37g - 272 - 142 - 363. Is 7/(g/72) - (-2 + p) a multiple of 9? False Let j(g) = -2g + 24. Let n(u) = -1. Let o(v) = j(v) - 2n(v). Let h be 5 - (-17 + (-50)/(-5)). Is o(h) even? True Does 15 divide 3597 - (20/(-5) - 11)? False Let p = 2027 - 253. Let x = p - 1022. Does 22 divide x? False Suppose -26f - 2791 = 2019. Let u = -226 + -67. Let i = f - u. Is i a multiple of 12? True Suppose 12q - 39751 + 11661 = 17774. Does 147 divide q? True Suppose 13o - 14o + 4917 = q, -8q - 3o + 39346 = 0. Is 13 a factor of q? False Suppose 31 - 8 = j. Suppose 8 = -3a + j. Suppose -301 - 331 = -4s + an, 0 = -2n. Is s a multiple of 28? False Suppose 0 = 3i + 5t + 9, 0i = -2i + 5t - 31. Let w(l) = 25l + 120. Let k(g) = 38g + 180. Let a(n) = 5k(n) - 8w(n). Is a(i) a multiple of 14? False Let r(q) = 2q. Let a(k) = 2k*2 - 5k - 19. Let v(x) = -a(x) - 5r(x). Let n be v(6). Let f = 122 + n. Is f a multiple of 8? False Let y(x) = -29x + 13. Let i = -100 - -88. Is 29 a factor of y(i)? False Let v be (5 - -6)/(1/(-5)). Let y = v + 73. Is 9 a factor of (-3 - 11/(-2))y/3? False Suppose 0 = 2l + 2q - 8391 - 9953, 2q - 9176 = -l. Is 12 a factor of l? True Let f = -493 + 1956. Does 11 divide f? True Let w(n) = 2n2 - 2n - 7. Let u be w(4). Suppose 4q - u - 527 = 0. Does 27 divide -1 + 1 + -3 + q/4? False Let o(h) = h3 - 6h*2 - 13h - 8. Let s be o(-4). Let v = s - -264. Is v a multiple of 13? False Let v(h) = -h*2 + 57h + 18. Let g be v(18). Let l = g - 398. Is 32 a factor of l? False Suppose -89x + 90x = 868. Suppose 1196 + x = 8l. Is l a multiple of 8? False Suppose 46l = 47l - 1. Does 15 divide -3((-588)/9 - 0) - l? True Let q(w) = -w*3 + 9w*2 - 3w + 24. Let b be q(10). Let z = 144 + b. Suppose 2x - 196 + z = -4f, 5f = 25. Does 23 divide x? True Suppose 2p - 34917 = -z, z + 3p - 5p = 34905. Does 81 divide z? True Let t = 2920 + -387. Is t a multiple of 17? True Suppose -47p - 213 = -1623. Does 5 divide p? True Let q(m) = 2m*2 + 12m - 8. Let v be q(8). Let i be (-4)/(v/(-52) - -4). Is 22 a factor of 1634/i - -3 - (-4)/26? True Suppose -22y + 3848 = -376. Let f = y - -64. Is 28 a factor of f? False Let n = -6386 - -9182. Does 13 divide n? False Let x(f) = -9f*2 + 5f + 6. Let a be x(-1). Let c(y) = y*3 + 15y*2 + 17y + 29. Is c(a) a multiple of 11? True Let h(j) = j*3 - 8j*2 + 6j - 3. Let f be h(6). Let c = 20 - f. Sup	{ "pile_set_name": "DM Mathematics" }
ers picked without replacement from {c: 4, i: 1, b: 1, v: 2, t: 2}. 1/630 What is prob of sequence ae when two letters picked without replacement from {e: 2, b: 1, m: 3, s: 1, g: 3, a: 2}? 1/33 What is prob of sequence twt when three letters picked without replacement from tttwwwtt? 5/28 What is prob of sequence tyy when three letters picked without replacement from {e: 1, q: 2, y: 8, t: 1, n: 2, v: 6}? 7/855 Three letters picked without replacement from gccjgggjzpccgjtgtg. What is prob of sequence pjz? 1/1632 Two letters picked without replacement from fftaftf. Give prob of sequence at. 1/21 What is prob of sequence wwht when four letters picked without replacement from {h: 5, w: 2, b: 2, t: 4, c: 1, i: 1}? 1/819 Three letters picked without replacement from {c: 9, y: 2, r: 7}. Give prob of sequence rcc. 7/68 What is prob of sequence ln when two letters picked without replacement from {l: 1, t: 3, n: 1, z: 2, a: 7}? 1/182 Two letters picked without replacement from vhmhmvhmvvvmvh. Give prob of sequence mh. 8/91 Four letters picked without replacement from pplplppppppplpplpp. What is prob of sequence ppll? 91/3060 Calculate prob of sequence wlw when three letters picked without replacement from {r: 2, x: 13, l: 1, w: 3}. 1/969 Three letters picked without replacement from thh. Give prob of sequence tth. 0 Calculate prob of sequence bb when two letters picked without replacement from fffffffbffffffbffff. 1/171 Calculate prob of sequence rmr when three letters picked without replacement from mpbupppuprmmurbrbm. 1/204 What is prob of sequence xdh when three letters picked without replacement from {x: 1, d: 1, h: 3}? 1/20 What is prob of sequence ap when two letters picked without replacement from {s: 6, j: 1, p: 2, a: 9, c: 1, e: 1}? 9/190 Three letters picked without replacement from {y: 2, q: 9}. Give prob of sequence qqy. 8/55 Three letters picked without replacement from xxxxxxkxxxkx. What is prob of sequence kkx? 1/66 What is prob of sequence inn when three letters picked without replacement from inemn? 1/30 Calculate prob of sequence rrr when three letters picked without replacement from {r: 5, e: 8}. 5/143 Two letters picked without replacement from {n: 2, a: 2, y: 1, l: 1, x: 2}. What is prob of sequence ay? 1/28 Three letters picked without replacement from {z: 7, w: 4, v: 2, b: 2, q: 5}. Give prob of sequence qbb. 1/684 What is prob of sequence xfx when three letters picked without replacement from {f: 12, x: 3}? 12/455 Calculate prob of sequence wklp when four letters picked without replacement from {p: 1, k: 2, w: 6, l: 4}. 2/715 What is prob of sequence mbm when three letters picked without replacement from {m: 5, b: 13}? 65/1224 Calculate prob of sequence oo when two letters picked without replacement from ozzzozzznpnuuzzgzzz. 1/171 What is prob of sequence phph when four letters picked without replacement from pphp? 0 Three letters picked without replacement from {f: 1, n: 1, x: 2, b: 2, m: 2, i: 1}. What is prob of sequence bmn? 1/126 Three letters picked without replacement from {m: 1, j: 1, r: 2, l: 1, p: 1, b: 1}. What is prob of sequence mpb? 1/210 What is prob of sequence mv when two letters picked without replacement from vmffmmsfsffmmfvfvv? 10/153 Three letters picked without replacement from {n: 7, b: 6}. Give prob of sequence nnn. 35/286 Two letters picked without replacement from mmmxmxmmmmxmmm. Give prob of sequence xx. 3/91 Two letters picked without replacement from lcnollllcloolloo. Give prob of sequence nn. 0 Calculate prob of sequence rwa when three letters picked without replacement from araaaaraaraawaa. 11/910 Two letters picked without replacement from fjqqjx. What is prob of sequence jj? 1/15 Two letters picked without replacement from tttuxuxuuttuu. What is prob of sequence xx? 1/78 Four letters picked without replacement from {e: 1, o: 1, v: 2, n: 2, p: 2, a: 1}. Give prob of sequence opvv. 1/756 Calculate prob of sequence iill when four letters picked without replacement from {n: 2, l: 13, i: 3}. 13/1020 Calculate prob of sequence fffe when four letters picked without replacement from efeefeffvfv. 1/33 What is prob of sequence rry when three letters picked without replacement from yrrrpyyryy? 1/12 What is prob of sequence sa when two letters picked without replacement from {a: 6, i: 2, s: 10}? 10/51 Calculate prob of sequence rr when two letters picked without replacement from {r: 2, q: 6}. 1/28 Two letters picked without replacement from itiiittittiiiiitii. Give prob of sequence ti. 4/17 Three letters picked without replacement from secqq. Give prob of sequence qcq. 1/30 Two letters picked without replacement from ltizbiizllblbi. Give prob of sequence tt. 0 Three letters picked without replacement from {a: 2, d: 4, k: 3}. What is prob of sequence kad? 1/21 Four letters picked without replacement from {p: 2, z: 1, q: 2, m: 1, c: 2, j: 1}. What is prob of sequence jcqc? 1/756 Four letters picked without replacement from wbvbuybbiuubvii. Give prob of sequence uibu. 1/364 What is prob of sequence uju when three letters picked without replacement from uujuujuuujuuuj? 15/91 Two letters picked without replacement from yvybbybbpivpgby. Give prob of sequence gp. 1/105 Four letters picked without replacement from {j: 12, h: 3, e: 3}. Give prob of sequence jjej. 11/204 Calculate prob of sequence iyi when three letters picked without replacement from {i: 2, y: 1, z: 1}. 1/12 Calculate prob of sequence tdug when four letters picked without replacement from {t: 1, d: 3, u: 1, v: 1, g: 1}. 1/280 Two letters picked without replacement from sslsssl. What is prob of sequence sl? 5/21 Two letters picked without replacement from {i: 2, m: 6, y: 1, z: 4}. Give prob of sequence iy. 1/78 Calculate prob of sequence nhnh when four letters picked without replacement from {n: 2, h: 6, q: 9}. 1/952 Two letters picked without replacement from qqqqqyqqqqqqqk. What is prob of sequence kq? 6/91 Three letters picked without replacement from {g: 1, p: 1, r: 2}. Give prob of sequence gpr. 1/12 Calculate prob of sequence sas when three letters picked without replacement from ootxsotaaoooosawww. 1/816 Three letters picked without replacement from {d: 1, t: 5, u: 1, r: 5, g: 1, h: 1}. Give prob of sequence guh. 1/2184 Calculate prob of sequence gete when four letters picked without replacement from grefbegtf. 1/756 What is prob of sequence qbb when three letters picked without replacement from ggqqpgbppbp? 2/495 Calculate prob of sequence kriw when four letters picked without replacement from rwwwffiwkfiiw. 1/1144 Calculate prob of sequence azq when three letters picked without replacement from zaqqaaaaqaaazaqa. 1/42 Calculate prob of sequence xce when three letters picked without replacement from {a: 1, x: 2, e: 1, y: 4, c: 1}. 1/252 Four letters picked without replacement from {w: 5, t: 1, l: 3, n: 1, d: 2}. What is prob of sequence lldd? 1/990 Calculate prob of sequence lwy when three letters picked without replacement from {w: 2, n: 1, f: 1, y: 1, l: 1, t: 1}. 1/105 Three letters picked without replacement from {f: 4, e: 1, i: 3}. What is prob of sequence eff? 1/28 Three letters picked without replacement from xxxxxmxmx. What is prob of sequence xmx? 1/6 Three letters picked without replacement from {j: 7, u: 3, y: 4, i: 1, z: 2}. What is prob of sequence yiy? 1/340 Calculate prob of sequence xtet when four letters picked without replacement from {u: 1, e: 1, t: 2, q: 1, x: 1, r: 2}. 1/840 Calculate prob of sequence gggv when four letters picked without replacement from vvgvvgvvvgv. 1/165 What is prob of sequence umv when three letters picked without replacement from {v: 2, m: 1, k: 1, u: 1}? 1/30 Four letters picked without replacement from {r: 4, w: 1, y: 4, p: 6}. Give prob of sequence rrpw. 1/455 Calculate prob of sequence ibi when three letters picked without replacement from {b: 1, t: 1, n: 6, p: 6, k: 2, i: 2}. 1/2448 What is prob of sequence co when two letters picked without replacement from {o: 1, l: 1, s: 1, c: 2, p: 1, y: 1}? 1/21 What is prob of sequence fffz when four letters picked without replacement from ccfffvffcczc? 1/198 Three letters picked without replacement from {c: 10}. What is prob of sequence ccc? 1 Calculate	{ "pile_set_name": "DM Mathematics" }
second derivative of 1076q5 + 379q*3 + 2q*2 - 26q + 43605 wrt q. 21520q3 + 2274q + 4 Find the second derivative of 430o2u*2 + 81o*2u + 10o2 - 18832ou2 + 5o + 8u wrt o. 860u*2 + 162u + 20 What is the derivative of -4x4 + 2x*3 - 124435x - 20493120? -16x3 + 6x*2 - 124435 What is the second derivative of 19531q*2w*2 + 941q*2w - 335qw*2 + 2q - 2w2 + 3085 wrt q? 39062w*2 + 1882w Find the first derivative of 41874621r2 + 314331457 wrt r. 83749242r Find the second derivative of -18241791h5 - 30h - 250914 wrt h. -364835820h3 Find the third derivative of 51gp4 - 894430gp2 + gp - 123689p5 - 14p*3 - 2p*2 + 2p + 49 wrt p. 1224gp - 7421340p2 - 84 What is the second derivative of 12725840u*2y + 3839765uy - y wrt u? 25451680y Differentiate -3j*2l - 2321j2 - 1127j - 367482057l wrt j. -6jl - 4642j - 1127 What is the second derivative of 36735000f3hz2 - 25f*3hz + 3073f*2hz + f2z - 14hz wrt z? 73470000f3h Find the second derivative of 7418895x5 - 1992705x + 2. 148377900x3 What is the second derivative of 702813243i*2 - 886208868i wrt i? 1405626486 Differentiate 88654488g - 80329107 wrt g. 88654488 Find the first derivative of 2799551fn3 + 4686597n*3 wrt f. 2799551n*3 What is the second derivative of -6386a*3 + 919a*2q*2 - 91aq2 + 2aq - 4a - 2q2 - 2017q wrt a? -38316a + 1838q*2 What is the first derivative of -424301922x*2 - 541694626? -848603844x Find the first derivative of 47551n3o - 2n3 + n2o*2 - 8537591n + 132o2 wrt o. 47551n*3 + 2n*2o + 264o Find the second derivative of -1017918t*4 + 51653203t. -12215016t2 What is the second derivative of -396c*3f*2 - 64c*3f + 7566c2f*4 - 45190c*2f wrt f? -792c3 + 90792c*2f*2 What is the third derivative of -71r*5 + 222r*4 + 349r*3 - 78120014r*2 wrt r? -4260r*2 + 5328r + 2094 Find the first derivative of 3m3 - 85m*2 + 78498m - 25672897. 9m2 - 170m + 78498 What is the derivative of 97219832d2o - 3d2 - 6396o - 53094 wrt d? 194439664do - 6d Differentiate d3 - 51805388d*2 + 45046684 wrt d. 3d*2 - 103610776d What is the second derivative of 3425555v3 + 2v*2 + 8810566v? 20553330v + 4 What is the derivative of -q3 - 218q*2 - 6658q - 17050598? -3q2 - 436q - 6658 Find the third derivative of 11f4 + 718899f*3 + 56691834f*2. 264f + 4313394 Find the first derivative of -274806885b - 252739291. -274806885 What is the third derivative of -11j5 - j4 - 655880j3 - 4688224j*2 + 1? -660j*2 - 24j - 3935280 What is the second derivative of -1627g2n*2q - 2g2n*2 - 728g*2q - 551709gn - gq - 3g + 3n2q wrt g? -3254n2q - 4n2 - 1456q What is the third derivative of 412bu*4 + 320545bu3 + 12581bu2 - 1878b wrt u? 9888bu + 1923270b What is the derivative of -6i*2yz3 - 369i*2z*2 + iz*2 - 3236450y + 706z3 - 19 wrt y? -6i*2z*3 - 3236450 Differentiate -127ac2 + 8ac - 62482a + 3593105c2 - 3c + 7 wrt a. -127c2 + 8c - 62482 Find the second derivative of 791800l2 - 10085209l wrt l. 1583600 Differentiate 1044601022p3 + 1011630750 wrt p. 3133803066p*2 Find the third derivative of -206101ip5 + 221ip + 29p4 - p2 + 5124 wrt p. -12366060ip*2 + 696p Find the third derivative of 12451231i4 - 25i*2 - 1386i + 1 wrt i. 298829544i What is the derivative of -8644038x + 229878651 wrt x? -8644038 Find the third derivative of -799k5 - 1297k*4 + 9k*3 - 52429k*2 - 147k. -47940k2 - 31128k + 54 What is the second derivative of -1737c4 - c3 - 59c*2 - 37968116c wrt c? -20844c2 - 6c - 118 Differentiate 2mr*2 + 11mr - 4m + 14r2 + 15995r + 78628012 with respect to r. 4mr + 11m + 28r + 15995 What is the second derivative of -4r4 - 3r*3 + 245122r*2 - 7384r - 1331 wrt r? -48r2 - 18r + 490244 Find the first derivative of 17530769q + 27906129 wrt q. 17530769 Differentiate 431d*2q + 2d2w + 2d2 - 8dqw - 16dq - dw + 98d + 13w - 1 with respect to q. 431d*2 - 8dw - 16d What is the third derivative of -3j6 - 18301074j*4 - 51451929j*2? -360j*3 - 439225776j Find the second derivative of -q*5 - 8q*4 + 262806q*2 + 12226490q. -20q3 - 96q*2 + 525612 What is the second derivative of 192kt3 - 191kt2 - 846459kt + 3t*3 + 3t*2 + 66 wrt t? 1152kt - 382k + 18t + 6 Find the second derivative of 8094135f*2 + 16784194f. 16188270 Find the third derivative of 5gr*4 - 70726652gr2 + 2048984r*4 wrt r. 120gr + 49175616r What is the first derivative of 52468711v - 50117658 wrt v? 52468711 What is the second derivative of 853650d*2y2 - d2 + 18dy*2 - 2dy + 323215y*2 wrt d? 1707300y*2 - 2 Differentiate -15412888m*3 - 96001305 wrt m. -46238664m*2 What is the derivative of 5l*4o + 106041l4 + 5842902o wrt l? 20l3o + 424164l3 What is the second derivative of -295659420l*3 + l + 31288548? -1773956520l Find the first derivative of -147adh + 6128ad - 2ah - 15a - 61dh + 113d - 4418h wrt a. -147dh + 6128d - 2h - 15 Find the second derivative of 102225060q3 + 215q + 139545. 613350360q Differentiate -60mr + 27792m + 5987922r with respect to m. -60r + 27792 What is the third derivative of -29775386d3t + 153d2t - 1534d2 + 8dt + 2d + t wrt d? -178652316t Find the first derivative of -103708079w*2 + 200774931. -207416158w What is the second derivative of 2r5v - 1351827r3v + 2r3 - 8r - 14979v wrt r? 40r*3v - 8110962rv + 12r Find the second derivative of -5926316x*2 + 14554512x wrt x. -11852632 What is the third derivative of -41448a5m - 9690a4 - 2a*2m - 1842a2 + 15am - 56a wrt a? -2486880a2m - 232560a Find the second derivative of -5m*3 - 2486m*2 + 7880935m wrt m. -30m - 4972 What is the third derivative of -110598g*2w3 - g2w2 - 6421g*2 + 1067gw - 255w*3 wrt w? -663588g*2 - 1530 Find the second derivative of -65554684x*4 + 4046578x - 4. -786656208x2 Differentiate 6l*3 + 17l*2 + 1591l + 10090945 wrt l. 18l2 + 34l + 1591 Differentiate 6519618i4 - 13456595 wrt i. 26078472i*3 What is the second derivative of 40653m*4 + 1412m*3 + 72018160m? 487836m2 + 8472m Find the second derivative of b*3z*2 - 3213b*3 + 3b*2z2 - b2z + 3b*2 + 5bz2 - 35bz + 12z*2 + 1 wrt z. 2b*3 + 6b*2 + 10b + 24 What is the first derivative of -413418984k2 + 384578278? -826837968k What is the third derivative of 57y5 - 2y*4 - 84y*3 + 2y*2 - 23y - 83397? 3420y2 - 48y - 504 Differentiate -78632712v4 - 22401033 wrt v. -314530848v*3 What is the third derivative of -1062h*3l*3 - 10183h*3l - 36h2l*3 - 14h*2 - 9l*3 + 21l*2 wrt h? -6372l*3 - 61098l What is the first derivative of -6749661d - 11965058? -6749661 What is the second derivative of 3v*5 - 23204v*4 - 50v*3 - 20396125v wrt v? 60v3 - 278448v*2 - 300v What is the third derivative of 30750gw*4 - 59gw3 + 7gw + 32w4 + w3 - 20008844w2 wrt w? 738000gw - 354g + 768w + 6 Differentiate -1921r3 - r2 - r - 65443111 wrt r. -5763r2 - 2r - 1 What is the third derivative of -32203526m4t + 79m2t - mt - 196m + 11t - 1 wrt m? -772884624mt Find the first derivative of 26mr2 + 56mr + 2418425m - 658r2 - 2r wrt r. 52mr + 56m - 1316r - 2 What is the derivative of 129221668g - 297072719 wrt g? 129221668 What is the derivative of 6938847j*4 + 32841194? 27755388j*3 What is the second derivative of 2988a*2mu2x - 85a2mux*2 - 2amu*2 - 47au2x*2 + 9au2 - au + 36mu*2x*2 wrt a? 5976mu2x - 170mux2 Find the second derivative of -2381p*4 - 6669p*3 + 1066353p + 22. -28572p2 - 40014p What is the second derivative of -666b3 - 2894b*2 - 19987591b? -3996b - 5788 What is the first derivative of 3332037ai2o - 666i2 - 2223io wrt a? 3332037i*2o Find the second derivative of 14824636d2 + 4d - 5008573 wrt d. 29649272 Find the third deriva	{ "pile_set_name": "DM Mathematics" }
s the nearest to -0.17 in -10, -2, -5, -2/21? -2/21 Which is the nearest to -0.03? (a) 1/9 (b) 4 (c) 92 (d) 0.1 d Which is the nearest to 0.1? (a) 3 (b) -0.5 (c) -4 (d) -0.1 d Which is the nearest to 0.4? (a) -1/2 (b) -3 (c) 2/5 (d) 4/3 c Which is the closest to 1? (a) -6 (b) -4 (c) -0.2 (d) -2/5 c Which is the nearest to 0.2? (a) 6 (b) -1/7 (c) -24 b Which is the nearest to 1/3? (a) 1/6 (b) -23 (c) -0.1 a What is the nearest to 0 in 3, 0.41, 0.09, 2/5? 0.09 What is the closest to 0 in 0, 11, 0.3, 27? 0 Which is the nearest to 0.1? (a) 0.099 (b) -0.06 (c) 0 (d) -3 a Which is the closest to -2/43? (a) -22/9 (b) 3/7 (c) -3/2 b Which is the closest to -1? (a) -2/13 (b) -1/3 (c) 0.1 (d) 0.3 b What is the closest to 2/7 in 8, 5, -0.2? -0.2 Which is the nearest to 0? (a) -1/8 (b) 0.2 (c) 10 a What is the closest to -2/3 in -1, 4, -0.5, -1/5? -0.5 Which is the nearest to -4/3? (a) -0.1 (b) 4 (c) -100 a What is the nearest to -1/4 in -3/7, 6, -4, -0.1? -0.1 Which is the nearest to 1? (a) -1 (b) 0.09 (c) 1/9 c Which is the nearest to -2/9? (a) -264 (b) 3 (c) 4 (d) 2/9 d Which is the nearest to 1? (a) -2/23 (b) -2/5 (c) -6 (d) -1 a Which is the nearest to -1? (a) 6 (b) 16 (c) 0.25 (d) -1 d Which is the closest to -2/5? (a) -2/9 (b) 3 (c) -52 a What is the closest to -1/4 in -1/3, 1.9, 0, -0.3? -0.3 What is the closest to -2/5 in -0.4, 0.1, 5, -492? -0.4 Which is the nearest to 3? (a) 0.1 (b) -0.3 (c) -0.05 (d) 66 a Which is the nearest to -4? (a) 3 (b) -4 (c) -3 (d) 262 b What is the nearest to -3.28 in -3, -3/5, -2/17? -3 Which is the nearest to 0.6? (a) 3/4 (b) -4 (c) 1/3 (d) -1/4 a Which is the nearest to 0.33? (a) -3 (b) 2 (c) 0 c What is the closest to -2/9 in 255, -2/19, 2, 4? -2/19 Which is the closest to -0.1? (a) -90 (b) 1/9 (c) -4/7 b What is the closest to -1/4 in -14/13, 0.4, 4, 2/7? 2/7 Which is the closest to 0? (a) -4 (b) -1/11 (c) -18 b What is the closest to -3 in -9/2, -0.1, 2/5? -9/2 What is the nearest to 38 in 3, 1/34, -0.5, 0? 3 Which is the nearest to 1? (a) -0.2 (b) 899 (c) 3 a What is the closest to -2 in -4, -1, -16? -1 Which is the closest to 2/15? (a) 1 (b) 3 (c) -2/13 c Which is the nearest to 0.1? (a) -3 (b) -1.6 (c) -4/11 c Which is the closest to -1? (a) -2/11 (b) 0.2 (c) -2 (d) -1/4 d What is the closest to 0 in -0.7, 5, 3? -0.7 What is the nearest to 6 in -5, 8/27, 0.3, 5? 5 What is the closest to -3 in -5, 4, 7, 0.3? -5 Which is the nearest to -82? (a) -4/7 (b) 0.5 (c) 0.1 (d) 3 a Which is the closest to 1/3? (a) 0.5 (b) 0.4 (c) -5 (d) -7 b Which is the closest to 2/9? (a) -3/5 (b) -2/3 (c) 2 (d) -4 a What is the closest to -4 in 0.1, 4, -19? 0.1 Which is the closest to 2? (a) 0.4 (b) 0.98 (c) 3 (d) -2/5 c What is the closest to -6 in -5, -2, 4/9, -35? -5 What is the closest to -109/6 in -3, 0.2, -1/8, -4? -4 Which is the nearest to 2/13? (a) 8 (b) 0.1 (c) -0.2 b Which is the closest to -0.01? (a) -0.9 (b) -20 (c) -0.5 c What is the closest to -5/3 in 3/7, 0.5, -2/29, 4? -2/29 What is the nearest to 0 in -1/3, -0.2, 5, 0.9? -0.2 Which is the nearest to 1? (a) 0.03 (b) 1 (c) -1/2 (d) -2 b Which is the nearest to -3? (a) -1 (b) 7 (c) -1/10 (d) -1.7 d Which is the closest to 1? (a) 0 (b) -1/10 (c) -0.4 a What is the nearest to 8 in 0.5, -6, -1? 0.5 What is the closest to -2/45 in 0.4, 0.1, -1, -0.5? 0.1 Which is the nearest to -2/21? (a) 14 (b) -1 (c) -0.2 c What is the nearest to -10 in -0.4, 0.1, -4/15, -4? -4 Which is the closest to -3/5? (a) -5 (b) -45 (c) -1 (d) -4 c What is the nearest to -1/20 in 2, 11, -5? 2 What is the closest to -2/5 in -3, -4, -385? -3 Which is the nearest to 2/7? (a) -1/4 (b) 4/5 (c) -1.6 (d) 3 b Which is the nearest to 2/11? (a) -0.5 (b) 4 (c) 2/3 c What is the nearest to 31 in -0.3, -2/3, -4, 4/9? 4/9 What is the closest to 0.11 in 3, -0.3, -0.4, 0.1? 0.1 Which is the nearest to 0.29? (a) -1 (b) -0.4 (c) -2/9 c Which is the nearest to -0.1? (a) -5/2 (b) -0.5 (c) -96 b Which is the nearest to -2/3? (a) 5 (b) 0.1 (c) 3 b Which is the nearest to 0? (a) 2/9 (b) 0.19 (c) 0.4 b Which is the closest to 1/9? (a) -1/4 (b) -0.042 (c) -0.4 b What is the closest to -0.1 in 4.8, 1, -2? 1 Which is the nearest to -92? (a) -0.3 (b) -5 (c) -8 (d) 0.5 c Which is the nearest to -581? (a) 5 (b) 0.4 (c) -2/5 c Which is the nearest to -0.1? (a) -0.1 (b) -31 (c) -4/7 (d) 3/2 a What is the nearest to 0.1 in -0.5, 0.5, 1221? 0.5 What is the nearest to 1 in 5, 7, -0.4, -170? -0.4 What is the nearest to 1 in 4/5, -22, -1? 4/5 What is the nearest to -2/3 in -0.3, 2, 0.7, 31? -0.3 Which is the nearest to 1? (a) -6 (b) 0.024 (c) 0.4 (d) -2/15 c What is the nearest to 0.1 in -5, 0.4, 0.3, -8? 0.3 Which is the closest to 0.014? (a) -5 (b) -3/2 (c) -0.2 c What is the nearest to -1/2 in -2, -2/3, -4? -2/3 What is the nearest to -0.2 in -3/4, 34, 0.1? 0.1 Which is the nearest to 29? (a) -0.07 (b) -0.3 (c) -3 (d) 2/21 d What is the closest to 0.2 in 1/2, 0.03, -2, -2/17? 0.03 Which is the nearest to -0.1? (a) 0 (b) -2/3 (c) 10 a What is the closest to 1 in -10, -5, -4/5, -0.5? -0.5 What is the closest to -0.1 in -4, -16, 3.2? 3.2 Which is the nearest to 1.2? (a) -5 (b) -4 (c) -1/5 c What is the nearest to -1 in -7, 6, -1? -1 What is the closest to 1.4 in -0.3, 8, 0.3? 0.3 What is the nearest to -1 in 2, 5, 0.156, 4/7? 0.156 Which is the closest to 7.5? (a) 0.5 (b) 0.4 (c) 2/11 a What is the closest to -0.1 in 5/6, -3, 2, 7? 5/6 What is the nearest to 5 in 5, -5, -4/3, -0.4? 5 What is the closest to -1 in 68, -2, 0.038? -2 What is the closest to -1/3 in 3, -0.4, 2/3, -0.11? -0.4 What is the nearest to -1 in 19, 1, -0.14? -0.14 Which is the closest to 0? (a) 14 (b) 0.3 (c) 1 (d) -0.4 b What is the closest to 10 in 1, -5, 3/4, 9? 9 Which is the closest to 2/5? (a) -3 (b) 5 (c) 4 a Which is the closest to -0.11? (a) -3 (b) 3 (c) -0.3 c Which is the nearest to 0.2? (a) 1/9 (b) -7 (c) -4 a Which is the nearest to 1/6? (a) -5/2 (b) -1 (c) 69/2 b What is the nearest to 17 in 3/4, 0.2, -2, -7? 3/4 Which is the nearest to 1? (a) 1 (b) -2/25 (c) 16/9 (d) 0.3 a Which is the closest to 4? (a) -0.2 (b) 0.14 (c) -8 (d) -2 b What is the nearest to 2/7 in 4, -3/2, -81, 2/3? 2/3 What is the closest to 1/3 in -0.34, 2, -0.1, -2? -0.1 What is the nearest to -1 in 17, -1, 1/4, 0? -1 Which is the closest to -0.1? (a) 2 (b) 0.1 (c) 1/36 (d) 5 c What is the nearest to 1 in -3, 2/5, -24, 2? 2/5 Which is the nearest to 0? (a) 5/4 (b) -4 (c) 4.2 (d) 2 a Which is the closest to 1? (a) 4 (b) -2/15 (c) 0.2 (d) -3/4 c Which is the closest to 36? (a) 1 (b) -2 (c) -4 a Which is the closest to -2? (a) 0.4 (b) 1 (c) 1/9 (d) -1 d What is the nearest to 0.2 in 7, 1, -6.2? 1 What is the nearest to -3 in 9/5, -0.04, -5? -5 Which is the nearest to -2/7? (a) 0.1 (b) 2/11 (c) 122/11 (d) 4 a Which is the nearest to 0.1? (a) 1 (b) 2 (c) -1 (d) -0.3 d What is the closest to -5 in -0.03, 1/11, 0.5? -0.03 Which is the nearest to 0.86? (a) -1/6 (b) -0.4 (c) 2 a What is the closest to 3/8 in 0.9, -1, 0.5? 0.5 Which is the closest to -13/5? (a) -0.2 (b) 3/5 (c) -2 c What is the closest to -3 in -0.3, -0.2, -0.74? -0.74 Which is the nearest to -6/5? (a) -1/4 (b) 1 (c) -2/3 c Which is the nearest to -1? (a) 2/109 (b) -0.018 (c) -0.3 c What is the closest to 1 in 2, 0.1, -5/8, -0.7? 0.1 Which is the closest to 0.1? (a) 0.21 (b) 0.1 (c) 1.2 b Which is the closest to 9? (a) -0.03 (b) 0.4 (c) -5/6 b What is the closest to 1/10 in 3/5, 3/8, -0.6, -0.3? 3/8 What is the closest to -0.8 in -2, 5/4, 0.1? 0.1 What is the closest to -1 in -1/6, 5, -51, 2? -1/6 What is the closest to -0.1 in 3, 1, 0.895? 0.895 What is the nearest to 0 in -0.2, -3, -7, 1? -0.2 What is the closest to 0.2 in -1, 600, -7/2? -1 Which is the nearest to 0.5? (a) -0.3 (b) 0.05 (c) 0.1 (d) -0.09 c What is the nearest to -25 in -0.3, -1/6, -2? -2 Which is the nearest to 0.2? (a) 1/5 (b) 1 (c) 2/47 a What is the nearest to 0 in -2/11, -0.19, 0.2? -2/11 What is the nearest to 1/4 in 0.27, -1/21, -2/5? 0.27 Which is the nearest to -1.7? (a) -1/8 (b) 1/3 (c	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.