Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
16988. 2126 What is the highest common divisor of 811 and 25313743? 811 Calculate the greatest common divisor of 4064 and 408178. 254 What is the greatest common factor of 616 and 70442? 2 What is the highest common divisor of 36 and 48820221? 9 Calculate the highest common factor of 2030 and 192560. 290 What is the highest common divisor of 41209182 and 82? 82 Calculate the greatest common factor of 13387 and 979231. 11 Calculate the greatest common factor of 512458584 and 12. 12 Calculate the highest common divisor of 916 and 2306667994. 458 What is the highest common divisor of 20114145 and 2040? 255 Calculate the greatest common divisor of 216267 and 282. 3 What is the greatest common factor of 8065791 and 108? 27 Calculate the highest common factor of 27935 and 3667995. 185 Calculate the highest common factor of 1810370 and 22882. 1346 Calculate the greatest common factor of 23025747 and 109356. 2103 What is the greatest common factor of 18513 and 50908693? 2057 Calculate the highest common factor of 130095 and 391860. 315 Calculate the greatest common divisor of 45163 and 1083304. 19 What is the greatest common divisor of 329430 and 2661510? 2370 Calculate the highest common divisor of 1171244 and 162983. 349 Calculate the highest common divisor of 50300730 and 50. 10 What is the highest common divisor of 15624 and 1415736? 504 Calculate the greatest common divisor of 8270 and 185060. 10 What is the greatest common factor of 69922168 and 824? 824 Calculate the greatest common factor of 157807236 and 7885. 1577 Calculate the highest common divisor of 7392 and 3701313. 231 Calculate the greatest common factor of 1744 and 669360. 16 Calculate the greatest common factor of 112 and 382729564. 28 Calculate the greatest common factor of 160491 and 28512147. 2631 Calculate the greatest common factor of 551052 and 38664. 36 Calculate the highest common factor of 143 and 2691246844. 143 What is the highest common divisor of 210772472 and 152? 152 What is the greatest common divisor of 2842611 and 24? 3 What is the greatest common divisor of 77891517 and 351? 27 Calculate the highest common divisor of 1211910 and 11710. 10 Calculate the greatest common factor of 10164 and 278292. 84 What is the greatest common factor of 2354442 and 708282? 2166 What is the greatest common factor of 479265 and 4223635? 1795 What is the highest common divisor of 17303482 and 438? 146 What is the greatest common factor of 40 and 29709580? 20 Calculate the greatest common factor of 2086736 and 11152. 656 What is the highest common factor of 1036049775 and 300? 75 What is the greatest common factor of 1605796 and 1131028? 628 What is the greatest common divisor of 3132948 and 528500? 4228 What is the greatest common factor of 1211 and 912191? 7 Calculate the highest common divisor of 11211 and 1742589. 111 What is the greatest common divisor of 32465 and 112833995? 755 Calculate the highest common factor of 1168 and 18610640. 16 Calculate the highest common divisor of 892433584 and 28. 28 Calculate the greatest common divisor of 1320 and 989460. 60 What is the highest common factor of 5222 and 565460? 14 Calculate the highest common factor of 36498 and 5728338. 462 What is the highest common divisor of 27 and 208145565? 27 Calculate the greatest common factor of 502320 and 1051284. 3588 What is the highest common factor of 126 and 1789569? 9 Calculate the highest common divisor of 945032806 and 7235. 1447 What is the greatest common factor of 7044136 and 7524? 836 What is the highest common divisor of 438 and 49321209? 219 What is the greatest common divisor of 7374 and 62025172? 2458 What is the highest common divisor of 19078071 and 37430? 3743 Calculate the greatest common divisor of 24814990 and 10. 10 What is the highest common divisor of 360 and 1504836? 36 Calculate the greatest common factor of 4775 and 314675. 25 Calculate the highest common divisor of 39888 and 10383068. 1108 Calculate the highest common factor of 112014 and 2059686. 2286 What is the highest common divisor of 1049 and 405231847? 1049 What is the greatest common divisor of 384044626 and 652? 326 What is the greatest common divisor of 78028516 and 23180? 4636 What is the greatest common divisor of 267165 and 345? 15 What is the highest common divisor of 439284339 and 26? 13 What is the greatest common factor of 7554256 and 1904? 272 What is the highest common divisor of 17 and 73062? 1 Calculate the highest common factor of 620 and 5387420. 20 What is the highest common factor of 823839 and 116556? 2649 Calculate the highest common divisor of 2352078 and 1458. 162 What is the greatest common divisor of 2490 and 20528556? 498 Calculate the greatest common factor of 175050 and 1246950. 450 Calculate the greatest common divisor of 819 and 510336. 9 What is the greatest common factor of 259136 and 4814261? 4049 Calculate the highest common factor of 4356 and 9113484. 12 What is the highest common factor of 1598 and 309094? 34 What is the greatest common factor of 4372 and 3446355788? 4372 Calculate the greatest common factor of 1075362 and 30. 6 Calculate the greatest common divisor of 90 and 75513285. 45 Calculate the highest common divisor of 13613950 and 70. 70 Calculate the highest common divisor of 12 and 596779872. 12 What is the greatest common divisor of 90 and 189276510? 30 Calculate the highest common divisor of 11595 and 13470. 15 What is the highest common factor of 56 and 283629388? 28 Calculate the greatest common divisor of 3164 and 54825001. 791 Calculate the highest common factor of 169582741 and 496. 31 What is the highest common divisor of 126808683 and 1542? 771 Calculate the highest common divisor of 55706 and 2187024. 322 What is the highest common factor of 1092 and 300342? 42 What is the highest common divisor of 7765 and 61351265? 7765 Calculate the highest common factor of 274801 and 427. 1 What is the greatest common divisor of 3325630 and 326095? 2695 Calculate the greatest common factor of 766835 and 49543. 103 What is the highest common factor of 33564051 and 162? 81 What is the highest common factor of 1692 and 13966191? 423 Calculate the greatest common divisor of 32 and 746218576. 16 Calculate the greatest common divisor of 45784717 and 33. 11 What is the greatest common divisor of 6524567 and 469? 7 Calculate the greatest common factor of 33520 and 7967285. 2095 What is the greatest common divisor of 529549958 and 196? 98 Calculate the highest common factor of 782 and 5868910. 782 Calculate the greatest common factor of 3913 and 14092. 13 What is the greatest common factor of 13585 and 402325? 1045 Calculate the greatest common divisor of 347400 and 178525. 4825 Calculate the highest common divisor of 217 and 460859. 7 Calculate the greatest common divisor of 19542 and 339060214. 6514 What is the greatest common divisor of 391 and 38287364? 23 What is the highest common divisor of 392 and 340053224? 56 Calculate the highest common divisor of 435590 and 116100. 430 What is the greatest common divisor of 4277 and 10370409? 329 Calculate the greatest common divisor of 4508975 and 11925. 1325 Calculate the highest common divisor of 195 and 100772100. 195 Calculate the greatest common divisor of 4978 and 1572786. 262 What is the greatest common divisor of 358555418 and 2990? 598 Calculate the greatest common divisor of 17536 and 815872. 128 What is the highest common factor of 4435156 and 6424? 44 What is the highest common factor of 2010 and 1311405? 15 What is the highest common factor of 29792 and 5465312? 608 What is the highest common divisor of 3794 and 111368534? 542 What is the highest common factor of 2893196 and 20096? 628 Calculate the greatest common divisor of 30904443 and 2538. 27 Calculate the highest common factor of 2225721 and 58. 29 What is the highest common factor of 34703236 and 202831? 3827 What is the greatest common factor of 1424 and 7005368? 712 Calculate the greatest common divisor of 81234937 and 4328. 541 What is the greatest common factor of 1660 and 4421660? 20 What is the greatest common divisor of 5068 and 199444? 28 Calculate the highest common factor of 5085036 and 3276. 36 What is the greatest common factor of 45687442 and 499? 4	{ "pile_set_name": "DM Mathematics" }
3 + -3 + 1). Let v be ((-2)/q)/((-18)/45). Suppose 4d = 133 - v. List the prime factors of d. 3, 11 Let z = 420 + 318. What are the prime factors of z? 2, 3, 41 Suppose -1 - 100 = -l - 3n, -l + n + 105 = 0. List the prime factors of l. 2, 13 Let t be 5/24/5. Let d(a) = -3 + 1 + a - t + 1. List the prime factors of d(11). 2 Suppose 0 = -8q - 4 + 316. Suppose -q = -3b + 3. List the prime factors of b. 2, 7 Let w(j) = -4j + 25 + 0j - 2j*3 + 3j*3 - 4 - 12j*2. List the prime factors of w(13). 2, 3, 23 Suppose 7b + 2b = 1647. What are the prime factors of b? 3, 61 Let c = -61 + 91. Suppose -8g + 3g = -c. Let o(i) = i2 + 5i - 14. What are the prime factors of o(g)? 2, 13 Suppose m = 6m + 345. Let i(y) = 15y - 2. Let t be i(8). Let u = m + t. List the prime factors of u. 7 Suppose g = 2u - 17, 0g - 2g = -3u + 26. Let z = u + -5. Suppose 0o + 10 = o + zk, 5k + 86 = 3o. List the prime factors of o. 2, 11 Suppose 0 = 3o + 12, -6o = a - 2o - 394. Suppose 12r - 2630 + a = 0. List the prime factors of r. 5, 37 Let r(c) = -c*3 - 8c*2 + 9c + 4. Let f be r(-9). Suppose 0 = z - n + 1, 2n + 36 = fz + 6n. Suppose -g = zg - 55. What are the prime factors of g? 11 Let w = -511 - -881. List the prime factors of w. 2, 5, 37 Suppose 0 = 72f - 70f - 1350. Suppose -4i - i = -4b + 538, 0 = -5b + 5i + f. What are the prime factors of b? 137 Let f = -6 + 6. Suppose fr = -3r + 6. Suppose -3l + 84 = -3h, rh = -2h + 4. List the prime factors of l. 29 Let q(o) = o*3 - 3o*2 - 14o - 2. Suppose -2g = 2g - 16, -2g = -2v - 8. Suppose -5u + 2d + 33 = d, v = -3d - 9. List the prime factors of q(u). 2, 11 Let u = 11 - 8. Suppose -8 = uv - v. Let a = 13 - v. List the prime factors of a. 17 Suppose 12 = -4v - 5l, -v + 4l + 8 = -5v. Suppose 0 = -w + 5y + 19, -2w - vy = -3w + 19. What are the prime factors of w/7 + 4/14? 3 Suppose 3p + 0p = 4x - 13, x = 2p + 7. Let i(f) = -f3 + f2 + 2f - 1. What are the prime factors of i(p)? 29 Let s(o) = -13o*2 - 4o - 5. Let n(g) = 14g2 + 4g + 4. Let v(u) = -5n(u) - 4s(u). Let z be v(-10). What are the prime factors of z/(-56) - (-6)/(-14)? 31 Suppose -15v + 20v - 390 = 0. Let o = -48 + v. List the prime factors of o. 2, 3, 5 Let o = 44 - 59. List the prime factors of 4/(-6)(-69 + o). 2, 7 Suppose f = 3h - 201, 5h = 3h + 2f + 134. What are the prime factors of h? 67 Suppose 7i - 3i = 2d - 64, -d + 33 = -i. Let m(x) = 2x2 + 6x - 3. Let h be m(-5). Let c = d - h. List the prime factors of c. 17 Let c(q) = 278q2 - 19q + 42. List the prime factors of c(2). 2, 3, 31 Let v = 4122 - 2621. What are the prime factors of v? 19, 79 Suppose -2j = -1 - 1. What are the prime factors of (171/6)/((-6)/(-16)) + j? 7, 11 Let f(m) = m3 + 9m*2 - 11m - 15. Let s be f(-10). Let j = 7 + s. Suppose 0 = 4d + a - 56, -2d + d + ja + 14 = 0. List the prime factors of d. 2, 7 Let h(a) = -a2 + 11. Let x be h(12). List the prime factors of -1 + 2/(-4) - x/2. 5, 13 Suppose 70 - 248 = 4l + 3d, 4l = 5d - 194. What are the prime factors of (l/10 - -3)/(3/(-300))? 2, 5 Suppose -4554 = -919k + 916k. What are the prime factors of k? 2, 3, 11, 23 Let m be (99/18)/(1/(-12)). Let r = m + 98. What are the prime factors of r? 2 Let q be (5/(-4))/((-4)/(-96)). Let t be (-4)/5q/2. What are the prime factors of (t/10)/(15/350)? 2, 7 Suppose -3r + 0r = -2n + 17, 4r + 12 = 0. Let j be 2 + 0 + -3 + n. Suppose m - l = 39, -m + 5l + 157 = jm. List the prime factors of m. 2, 19 Suppose 4a + g = 23, -11a + 3g - 27 = -16a. Let t(n) = 2n. Let j be t(-3). List the prime factors of 237/a - (-9)/j. 2, 19 Let a = 4334 - 2253. What are the prime factors of a? 2081 Let b(d) = d2 - 5d + 4. Let i be b(5). Let x = 16 - i. List the prime factors of x. 2, 3 Let c(t) be the second derivative of -7t3/6 - 10t*2 + t. Suppose -2p = -3q - 29, -8 = 5q + p + 36. List the prime factors of c(q). 43 Let v = 26 - 55. Let y = 25 + v. List the prime factors of (-4 + (-6)/y)-10. 5 Suppose -4u = -3i - 10, 0i + 14 = 2u + 3i. Suppose -v - u + 39 = 0. Let b = v - 20. What are the prime factors of b? 3, 5 Suppose -10i = -13i + 321. List the prime factors of i. 107 Let z(x) = 59x2 + x. Suppose -7l + 1 = -6l. List the prime factors of z(l). 2, 3, 5 Let x be -7(1356/(-28) + -3). Suppose 2v - 138 = 5m - 4m, -5v - 5m + x = 0. What are the prime factors of v? 2, 5, 7 Suppose -2o + 2w = 6, -41 = -2o - 5w - 12. List the prime factors of (o/(-3))/((-2)/219). 73 Let a be 1 + (1 - -2) - (-14 - -18). What are the prime factors of (13 - a)7 - 1? 2, 3, 5 Let m be 585/18(6 + -2 - 0). Suppose m = -3x + 5x. What are the prime factors of x? 5, 13 Let z(o) = -3o. Let x(d) = 2d + 1. Let u = -6 + 5. Let g be x(u). What are the prime factors of z(g)? 3 Suppose -5876 = 27f - 29f - 2r, -3f + 8818 = 4r. What are the prime factors of f? 2, 3, 163 Let c(o) = -o2 + o + 1. Let w(x) = x2 + 10x - 2. Let g(z) = -2c(z) - w(z). Let r be g(13). What are the prime factors of (r/2 - 4)4? 2, 5 Suppose -7o = -2o + 4j - 1211, 0 = -4o + 4j + 976. List the prime factors of o. 3 Let h(w) = 23w - w + 23w - 2. List the prime factors of h(3). 7, 19 Suppose -4s + 1862 = 2x - 2s, 3 = -s. What are the prime factors of x? 2, 467 Let b(d) = -2d + 2 + 0d + 3d + d*2 - 6d. What are the prime factors of b(6)? 2 Suppose 0 = -0v + 4v - 16. List the prime factors of 6/v + (-154)/(-4). 2, 5 Suppose 5j + g + 1290 = -4g, 5j = 5g - 1330. What are the prime factors of j/(-10) + 5/(-22 + -3)? 2, 13 What are the prime factors of 1/(((-1)/(-1721))/(3/3))? 1721 Let d(o) = -77o - 568. What are the prime factors of d(-58)? 2, 1949 Let j(w) = w3 + 5w*2 - 7w + 1. Let p = 130 - 126. What are the prime factors of j(p)? 3, 13 Let q(j) = -j*2 - 4j - 5. Let d be q(-5). Let a = d + 13. Suppose 4k = 3s + 32, k = -as - s + 8. List the prime factors of k. 2 Let q = 38 - 34. Suppose -7p = -3p + qn - 140, 0 = -3n + 12. List the prime factors of p. 31 Let h = -1588 - -4256. What are the prime factors of h? 2, 23, 29 Let i = 211 - 45. Let u = -97 + i. List the prime factors of u. 3, 23 Let o = -33 - -38. Suppose -oy = -138 - 377. What are the prime factors of y? 103 Let t(s) = -s3 - s2 + 2s + 170. Suppose -2m + 0m = 0. Let r be t(m). Suppose 3l - 37 = r. List the prime factors of l. 3, 23 What are the prime factors of 42(2 + -3)/(-2 - -1)? 2, 3, 7 List the prime factors of 27717/7 + 444/(-42) + 11. 2, 3, 5, 11 Let x = 25 - 27. Let s(k) = -5k - 7. List the prime factors of s(x). 3 Suppose -z = -u - 1172, 2z - 2364 = -0z - 2u. What are the prime factors of z? 11, 107 Suppose -857 = -5k + 113. What are the prime factors of k? 2, 97 Let g = -1376 - -2903. What are the prime factors of g? 3, 509 Let a(t) = t*2 - 7t + 7. Let x be a(5). What are the prime factors of (x/9)/(9/(-675))? 5 Let u(t) = -11t2 + 3t + 51t2 - 5t - 1. List the prime factors of u(2). 5, 31 Let j(o) = 16o2 - 2. Let h(u) = -3u*2 - u - 1. Let c be h(-1). What are the prime factors of j(c)? 2, 71 Suppose 0 = 19n - 11n - 1232. Suppose -2v - n = -4v. What are the prime factors of v? 7, 11 Suppose -4c = -0c + 3q + 3, 5 = -4c - 5q. Suppose -4w - m = -216, c = -2w - 2m + 62 + 46. What are the prime factors of w? 2, 3 Let b = 56 + -52. Suppose d = -4r + 4d + 985, -2r - bd + 498 = 0. List the prime factors of r. 13, 19 Let a(l) = -l3 + 2l*2 - 4l - 64. What are the prime factors of a(-9)? 863 Suppose -4m + 33 = -7m. Let b = 34 + m. What are the prime factors of b? 23 Suppose -4q + 2h + 406 = 0, 4q + 4h - 403 = 5h. List the prime factors of q. 2, 5 Let k = -440 + 2495. List the prime factors of k. 3, 5, 137 Let u = 4260 - 2842. List the prime factors of u. 2, 709 Let f(i) = 495i - 23. List the prime factors of f(2). 967 Let n(b) = -164b + 6. Let l(y) = y + 1. Let v(s) = 8l(s) - n(s). What are the prime factors of v(1)? 2, 3, 29 Let c = -12 - -22. Suppose 107 = o + c. What are the prime factors of o? 97 Let p be 1 + 477 - 6/(-12)-2. Suppose p = 3s - 3u, -4s + 382 = -3u - 257. What are the prime factors of s? 2, 3 Suppose -3k = -4q + 52, -2k + 84 = 4q + 3k. Let n = q + 75.	{ "pile_set_name": "DM Mathematics" }
by 7. 3 Calculate the remainder when 255 is divided by 47. 20 What is the remainder when 985 is divided by 26? 23 Calculate the remainder when 1165 is divided by 130. 125 Calculate the remainder when 326 is divided by 49. 32 What is the remainder when 45 is divided by 39? 6 What is the remainder when 221 is divided by 7? 4 Calculate the remainder when 616 is divided by 234. 148 Calculate the remainder when 3657 is divided by 6. 3 Calculate the remainder when 5057 is divided by 12. 5 What is the remainder when 69 is divided by 9? 6 What is the remainder when 1769 is divided by 582? 23 What is the remainder when 205 is divided by 16? 13 Calculate the remainder when 1327 is divided by 44. 7 Calculate the remainder when 111 is divided by 82. 29 Calculate the remainder when 303 is divided by 31. 24 What is the remainder when 351 is divided by 59? 56 Calculate the remainder when 9245 is divided by 136. 133 Calculate the remainder when 120 is divided by 45. 30 Calculate the remainder when 833 is divided by 73. 30 Calculate the remainder when 33438 is divided by 71. 68 Calculate the remainder when 388 is divided by 26. 24 What is the remainder when 92 is divided by 49? 43 Calculate the remainder when 550 is divided by 29. 28 What is the remainder when 138 is divided by 31? 14 Calculate the remainder when 45 is divided by 22. 1 Calculate the remainder when 1351 is divided by 85. 76 Calculate the remainder when 1171 is divided by 14. 9 What is the remainder when 47 is divided by 12? 11 Calculate the remainder when 1085 is divided by 87. 41 What is the remainder when 1149 is divided by 479? 191 What is the remainder when 136 is divided by 20? 16 Calculate the remainder when 585 is divided by 16. 9 Calculate the remainder when 752 is divided by 64. 48 What is the remainder when 61 is divided by 57? 4 Calculate the remainder when 128 is divided by 113. 15 Calculate the remainder when 18720 is divided by 151. 147 Calculate the remainder when 707 is divided by 241. 225 What is the remainder when 3103 is divided by 97? 96 What is the remainder when 181 is divided by 62? 57 What is the remainder when 571 is divided by 2? 1 Calculate the remainder when 166 is divided by 110. 56 What is the remainder when 1025 is divided by 508? 9 Calculate the remainder when 261 is divided by 30. 21 Calculate the remainder when 213 is divided by 43. 41 What is the remainder when 150 is divided by 65? 20 Calculate the remainder when 36 is divided by 7. 1 Calculate the remainder when 4081 is divided by 18. 13 What is the remainder when 752 is divided by 11? 4 What is the remainder when 14771 is divided by 83? 80 Calculate the remainder when 412 is divided by 16. 12 Calculate the remainder when 540 is divided by 88. 12 What is the remainder when 479 is divided by 23? 19 What is the remainder when 3707 is divided by 12? 11 What is the remainder when 155 is divided by 60? 35 Calculate the remainder when 1225 is divided by 10. 5 Calculate the remainder when 56 is divided by 9. 2 Calculate the remainder when 440 is divided by 65. 50 Calculate the remainder when 626 is divided by 129. 110 Calculate the remainder when 1651 is divided by 92. 87 Calculate the remainder when 410 is divided by 70. 60 What is the remainder when 42 is divided by 22? 20 Calculate the remainder when 85 is divided by 55. 30 What is the remainder when 1215 is divided by 607? 1 What is the remainder when 1039 is divided by 58? 53 What is the remainder when 185 is divided by 17? 15 Calculate the remainder when 46783 is divided by 157. 154 What is the remainder when 7149 is divided by 13? 12 Calculate the remainder when 50 is divided by 15. 5 Calculate the remainder when 314 is divided by 95. 29 What is the remainder when 2485 is divided by 11? 10 What is the remainder when 187 is divided by 21? 19 Calculate the remainder when 89 is divided by 10. 9 What is the remainder when 129 is divided by 10? 9 What is the remainder when 8501 is divided by 81? 77 Calculate the remainder when 191 is divided by 32. 31 Calculate the remainder when 250 is divided by 7. 5 What is the remainder when 4918 is divided by 40? 38 What is the remainder when 348 is divided by 42? 12 Calculate the remainder when 609 is divided by 301. 7 Calculate the remainder when 2359 is divided by 40. 39 What is the remainder when 153 is divided by 39? 36 What is the remainder when 107 is divided by 31? 14 What is the remainder when 544 is divided by 230? 84 What is the remainder when 223 is divided by 110? 3 What is the remainder when 271 is divided by 7? 5 What is the remainder when 28 is divided by 6? 4 What is the remainder when 488 is divided by 99? 92 What is the remainder when 148 is divided by 7? 1 What is the remainder when 139 is divided by 56? 27 Calculate the remainder when 73 is divided by 22. 7 Calculate the remainder when 563 is divided by 190. 183 What is the remainder when 4233 is divided by 1057? 5 Calculate the remainder when 1480 is divided by 11. 6 What is the remainder when 630 is divided by 205? 15 What is the remainder when 18 is divided by 11? 7 Calculate the remainder when 3191 is divided by 103. 101 Calculate the remainder when 288 is divided by 7. 1 Calculate the remainder when 444 is divided by 8. 4 What is the remainder when 3191 is divided by 265? 11 What is the remainder when 475 is divided by 80? 75 Calculate the remainder when 104 is divided by 69. 35 Calculate the remainder when 200 is divided by 31. 14 Calculate the remainder when 237 is divided by 39. 3 Calculate the remainder when 93 is divided by 31. 0 What is the remainder when 214 is divided by 20? 14 What is the remainder when 1050 is divided by 178? 160 What is the remainder when 6320 is divided by 51? 47 Calculate the remainder when 345 is divided by 30. 15 What is the remainder when 25 is divided by 8? 1 Calculate the remainder when 1886 is divided by 90. 86 Calculate the remainder when 136 is divided by 32. 8 What is the remainder when 268 is divided by 70? 58 Calculate the remainder when 222 is divided by 113. 109 Calculate the remainder when 1726 is divided by 69. 1 Calculate the remainder when 368 is divided by 89. 12 What is the remainder when 862 is divided by 108? 106 What is the remainder when 841 is divided by 169? 165 What is the remainder when 240 is divided by 101? 38 What is the remainder when 585 is divided by 132? 57 Calculate the remainder when 280 is divided by 91. 7 Calculate the remainder when 192 is divided by 52. 36 What is the remainder when 1039 is divided by 20? 19 Calculate the remainder when 256 is divided by 130. 126 Calculate the remainder when 142 is divided by 36. 34 What is the remainder when 35462 is divided by 31? 29 What is the remainder when 188 is divided by 109? 79 What is the remainder when 200 is divided by 55? 35 Calculate the remainder when 5001 is divided by 2495. 11 Calculate the remainder when 307 is divided by 77. 76 Calculate the remainder when 14 is divided by 4. 2 Calculate the remainder when 57 is divided by 30. 27 Calculate the remainder when 766 is divided by 25. 16 What is the remainder when 35 is divided by 14? 7 Calculate the remainder when 738 is divided by 44. 34 What is the remainder when 176 is divided by 84? 8 Calculate the remainder when 42 is divided by 9. 6 What is the remainder when 77 is divided by 37? 3 Calculate the remainder when 364 is divided by 74. 68 Calculate the remainder when 5057 is divided by 7. 3 What is the remainder when 1181 is divided by 6? 5 Calculate the remainder when 307 is divided by 30. 7 What is the remainder when 62 is divided by 17? 11 Calculate the remainder when 35258 is divided by 205. 203 What is the remainder when 255 is divided by 99? 57 What is the remainder when 115 is divided by 8? 3 What is the remainder when 178 is divided by 138? 40 Calculate the remainder when 377 is divided by 48. 41 What is the remainder when 2644 is divided by 16? 4 Calculate the remainder when 149 is divided by 31. 25 Calculate the remainder when 98 is divided by 63. 35 What is the remainder when 118 is divided by 17? 16 Calculate the remainder when 255 is divided by 50. 5 Calculate the remainder when 373 is divided by 95. 88 What is the remainder when 1892 is divided by 617? 41 What	{ "pile_set_name": "DM Mathematics" }
(-3)/((-27)/(-2)) and -83/24. 120 Suppose 538 = -8o + 986. Calculate the lowest common multiple of o and 140. 280 Let u = 52456/321825 + 5/1839. Let y = u + -1559/16800. Let d = 3793/672 - y. Find the common denominator of 6 and d. 7 Let b = 37741 - 73837/2. Let c = -845 + b. Calculate the common denominator of c and -44/7. 14 Let z = -40389 - -1777005/44. Let k = -10182 + 142609/14. Calculate the common denominator of k and z. 308 Suppose -45 = -5b + 5y, 4b = -4y + 53 - 1. Let t = 58364/11 - 5301. Find the common denominator of b - 12 - (-114)/16 and t. 88 Let y(u) = u3 + 12u*2 - 3u - 9. Let b be y(-12). Let f = b + -29. What is the smallest common multiple of -4 - 1/(f/32) and 20? 60 Let k = -23 + 38. Let b = 947/28 - 102/7. What is the common denominator of b and 5/k(-366)/(-40)? 20 Let t = 35 - 32. Let x be (-1)/(t + (-4173)/1380). Let v = x - 42. Calculate the common denominator of -87/4 and v. 44 Let n = -3404 + 27177/8. Calculate the common denominator of 79/4 and n. 8 Calculate the common denominator of ((-52)/32)/(3/36) and -39/7. 14 What is the lowest common multiple of 6 - (-23 + (-7)/(-1)) and 110? 110 What is the least common multiple of 30 and 30/6 - 1-19? 120 Let h(w) = -w*3 + 0w - w - 6w2 - 2w. Let i be h(-5). Calculate the smallest common multiple of (48/(-20))/(2/i) and 6. 12 Let w(p) = -p*2 + 14p - 8. Let o be w(6). Let n = -2082 + 20803/10. Calculate the common denominator of n and 0 + 0 + 46/o. 20 Let r be 253/(-22)(-1484)/1383. Let s = r + -3/461. Find the common denominator of 33/2 and s. 6 Suppose -20 = 2w + 4o, -4w + 0w = 3o + 65. Let a = -11287/1004 - 2/251. Find the common denominator of a and w. 4 Suppose t + 6 - 20 = 0. Calculate the least common multiple of t and 56. 56 Suppose 29d - 19d = 20. Let x be 72/(-10)(-3 + -2). What is the least common multiple of x/10 + (-4)/(-10) and d? 4 Let d(x) = x2 - 7x + 1. Let r be d(4). Let w = 25 - r. Let g = -24 + w. Calculate the smallest common multiple of 14 and g. 84 Let z = 4231077/76 - 55673. What is the common denominator of z and (658/84)/(-12)? 228 Let y = 2 - 24. Let s = 2869/2 + -28647/20. Calculate the common denominator of s and (0 - (-114)/(-132)) + (-4)/y. 220 What is the least common multiple of 72 and 41(1343/68 - 4)? 504 Suppose -i + 5 = 1. Suppose i - 1 = 3s. Calculate the least common multiple of 6/(-8)(-224)/42 and s. 4 Let n(j) = 11j - 9. Let k be n(6). Suppose 4o - k = 31. What is the smallest common multiple of o and 10? 110 Let k = 13425/22 - 607. Let a = -4868925/2366156 - -2/45503. Find the common denominator of a and k. 572 Calculate the common denominator of -91/8 and (5 + (4 - 83608/9280))2. 1160 Let u be (-11188)/390 + ((-20)/(-65))/2. Let z = 542/15 + u. What is the common denominator of z and -62/15? 15 Let u = 6 + -3. Suppose 0 = 5y - 20, ux - 88 = -4y. Calculate the least common multiple of 6 and x. 24 Calculate the common denominator of -77/30 and ((-128)/810)/(174/145). 2430 Let u = 47 + -47. Let y(p) = p2 + 3p - 6. Let c be y(-5). Calculate the common denominator of -16/11 and (-2)/c + u + -41. 22 Let h be (0 - 3) + -18130 + 1. Let j be (-27)/h(-2)/(-3). Let t = -119363/6044 - j. Calculate the common denominator of t and 77/2. 4 Suppose -o = 3o + 3p - 543, 4o = -p + 533. Calculate the lowest common multiple of o and 15. 660 Suppose 3z - 11 = 7. Suppose -n + 60 = 35. Suppose 0 = 2k + 5l - n - 19, 2l = -k + 22. What is the smallest common multiple of k and z? 66 Calculate the common denominator of (-4)/(-2) + (-202)/(-48) and (987/224)/((-63)/28). 24 Suppose 4t + 318 = -1090. Calculate the common denominator of -63/20 and (-8)/t(0 + -47). 220 Suppose q = -5p + 614, -2q - 4 = 2q. Suppose 4r + 3g = 76 + 23, -5r - 3g + p = 0. What is the least common multiple of r and 10 + -1 - (2 + 1)? 24 Suppose -134 = -3n + 4j + 2, 5j - 83 = -2n. What is the smallest common multiple of 60 and n? 660 Let j(i) = i3 - 7i*2 + i - 3. Let v be j(7). Suppose 6n = vn + 20. Let p(y) = y3 + y2 + y + 15. What is the least common multiple of n and p(0)? 30 Let p = 31 + -3. What is the common denominator of (-766)/p + 8/(-56) and -95/8? 8 Suppose -24 = -17x + 452. What is the lowest common multiple of 32 and x? 224 What is the common denominator of 10/185 - (-3682)/4440 and 113/90? 180 Let r(q) = -q3 + q2 + 13q + 1. What is the least common multiple of 30(-2 + (-24)/(-9)) and r(3)? 220 Let g = 660626/33 - 20017. Calculate the common denominator of (-42)/(-90)16/7 and g. 165 Suppose 5p + 35 = g, -6 = 2p - 0p. Suppose -5s = 37 + 23. Let l = 4 - s. Calculate the smallest common multiple of l and g. 80 Let j(a) = -a3 + 6a*2 + 8a + 5. Let v be 11 + (2/(-8))/((-3)/12). Calculate the lowest common multiple of j(7) and 0 + (-1)/(-6) - (-238)/v. 60 Let q(r) = -r*3 - 17r*2 + 83r - 10. Suppose 3m = -0m - 3. Calculate the lowest common multiple of q(-21) and 2/m10/(-4). 55 Suppose 4u - 2k - 168 = 0, -u = -2k + 5k - 28. What is the lowest common multiple of 16 and u? 80 Suppose 2h = f + 76, -3h - 2f + 20 = -108. Calculate the least common multiple of 64 and h. 320 Suppose -7l + 43 = -279. What is the lowest common multiple of 22 and l? 506 Suppose -k + 15 = -4o, -4k + 5k - 15 = 3o. Let z = 1 + k. Calculate the smallest common multiple of 2 and z. 16 Let x = -6 + 129. What is the least common multiple of x and 11? 1353 Let z(f) = -10f - 427. What is the lowest common multiple of 81 and z(-43)? 81 Suppose 5c - 5 = 0, -33 = 2d - 0d + 3c. Let j = -72 + -159. What is the common denominator of 85/4 and (d/(-135))/(8/j)? 20 Let y = -12329/462 - -520/21. Calculate the common denominator of y and 67/9. 198 Let k = -296711/20 + 14841. Calculate the common denominator of 7562/380 - 3/(-5) and k. 20 Let f be (-520)/396/(-4). Suppose -6 + 2 = -4y. What is the smallest common multiple of y and 19/(-38)f-1? 10 Let f = 339 + -315. Calculate the lowest common multiple of f and 51. 408 Suppose 0 = 48u + 3344 - 10256. Calculate the smallest common multiple of 16 and u. 144 Suppose -8m + 6m + 8 = 0. Suppose -l + ml = 15. Calculate the lowest common multiple of l and 28. 140 Let p = -113 - -10. What is the lowest common multiple of 6 and -5 - (-3 + -1) - p? 102 Let b be (-12)/(-18)6/4. Suppose k = b + 1. Suppose n = -3v, n + 9v = 4v - k. Calculate the smallest common multiple of 1 and n. 3 Let g(h) = h*2 - 4h + 1. Suppose 4p + p - 45 = 0. Calculate the smallest common multiple of 8 and g(p). 184 What is the least common multiple of 4/(-4) + 0 + 17 and 18? 144 Let u(z) = 3z*3 - 42z*2 - 43z + 12. Calculate the least common multiple of 168 and u(15). 168 Let y = 4191 + -62824/15. Find the common denominator of -67/36 and y. 180 Let r = -2 + 24. Let s = r + 2. Calculate the common denominator of -85/2 and s. 2 Suppose -m = -2i - 37, 2m - 112 = 3i - 42. Let t = 0 - 3. What is the least common multiple of t/9 - (-16)/3 and m? 145 Let h = -3369/4 - -831. Let v = -194/371 + 1149804/2197433. Let x = -450154/17769 + v. Calculate the common denominator of x and h. 12 Let j(k) = k2 - 6k + 4. Calculate the lowest common multiple of j(6) and 57/513 - 232/(-18). 52 Let l = -1432/3 + 28481/60. Let m = 338357/36 - 9400. Calculate the common denominator of l and m. 180 Suppose -o = 4o + 3b - 341, 3o - b = 213. Let p(t) = -3t*3 - 23t*2 - 15t - 1. What is the smallest common multiple of o and p(-7)? 210 Suppose -17x - 17 + 221 = 0. Calculate the least common multiple of 16 and x. 48 Let w(i) = -2i + 10. Let m be 32/14 - (-4)/(-14). Suppose -t + 4l + 16 = 0, -2t - ml - 4 = 4. What is the lowest common multiple of 14 and w(t)? 70 Suppose 5q - 13 - 6 = 2u, -3q = -u - 12. Calculate the least common multiple of u and 3. 3 Suppose -2f + 22f - 1120 = 0. What is the smallest common multiple of f and 24? 168 Let w(c) = -c*3 - 5c*2 + 13c - 4. Let x be w(-7). Suppose 0 = xb - 9, 5b + 57 = 4o - 0b. Calculate the least common multiple of 30 and o. 90 Let v(b) = b + 37. Let a(z) = 20z2 + 3z - 3. Calculate the smallest common multiple of v(7) and a(1). 220 Let k(o) = -o*3 + 5o*2 + 16o + 8. What is the least common multiple of 42 and k(7)? 462 Let p(s) = s**3	{ "pile_set_name": "DM Mathematics" }
(c) be the first derivative of 28c2 - 2. What is m(r(l))? 3136l*2 Let n(p) = 878p + 29. Let y be n(4). Let k(l) = 3534l2 - yl2 + 5 - 5. Let x(g) = -2 - g2 + 2. Calculate k(x(u)). -7u4 Suppose 2j + j - 5 = 5d, -j + 9 = 2d. Let r(z) = 21z2 + 2z*2 - 4z*d + 15z*2. Let n(g) = -2g*2. Calculate r(n(o)). 136o*4 Let d(h) be the first derivative of -4h*3 + 4h*2 - 8h - 5. Let x(p) = 4p2 - 3p + 3. Let y(c) = -3d(c) - 8x(c). Let s(u) = 7u2. What is s(y(r))? 112r*4 Let f(j) = -591j + 591j - j2. Let y(d) = -391d. Let z(h) = 13h. Let p(w) = -4y(w) - 119z(w). Determine f(p(m)). -289m*2 Let i(s) = 14s*2 - 2s - 2. Let a(z) = -27z2 + 5z + 5. Let k(c) = -2a(c) - 5i(c). Let r(p) = 0 - 9 - 2p2 + 8 + 1. What is k(r(g))? -64g*4 Let r(o) = 6 - 6 - 7 + 3o*2. Let n(t) = -2t*2 + 4. Let g(s) = 7n(s) + 4r(s). Let p(c) = 13c. What is g(p(k))? -338k2 Let d(c) = -4c. Let u(h) = -391300h. Calculate d(u(p)). 1565200p Let z(b) = 14b - 82. Let o(q) = -204q - 2. Determine z(o(i)). -2856i - 110 Let s(m) = 10m. Let u(c) be the third derivative of c*4/24 + 6c*2. Let b(i) = -5i. Let z(g) = -b(g) - 6u(g). Give z(s(q)). -10q Let n(a) = 12a2. Let f(k) = 77827k. What is n(f(h))? 72684503148h2 Let g(c) = c. Suppose -5v + 15v - 330 = 0. Let w(t) = vt - 7t + 20t. Give g(w(s)). 46s Let k(d) = 17d + 70. Let c(n) = 8n + 30. Let x(p) = 7c(p) - 3k(p). Let i(o) = -o - 5. Let s(m) = 4m + 24. Let z(u) = 24i(u) + 5s(u). Give z(x(v)). -20v Let o(d) = 6d. Let l = 43 + 22. Let k(q) = -l + 4q + 28 + 37. Determine k(o(w)). 24w Let r(x) = -4x2. Let q(o) = 27978o*2 + 5. Calculate q(r(y)). 447648y*4 + 5 Let f(g) = 2g + 277. Let c(q) be the third derivative of q*4/12 + 157q*2. Determine c(f(s)). 4s + 554 Let c(s) = 9s. Let y(p) be the first derivative of -2p*2 + 6. Let o(l) = 6c(l) + 14y(l). Let x(b) be the first derivative of -b2 - 2. Calculate o(x(h)). 4h Let c(b) = -115b - 15. Let w(g) = -15g - 2. Let s(x) = 2c(x) - 15w(x). Let t(r) = 265r. Calculate s(t(k)). -1325k Let c(k) = -k*2. Let z(g) = -1670210g. What is z(c(n))? 1670210n2 Let h be ((-13)/(-4) - 2)4. Let c be h/2(-24)/(-20). Let z(o) = -7 + 7 - co*2. Let k(d) = d. Give k(z(n)). -3n*2 Let k(r) = 7r + 32. Let d(v) = 463v. Determine d(k(w)). 3241w + 14816 Let j(k) = -k*2. Let o(g) = -11322g*2 - 4. Determine o(j(f)). -11322f*4 - 4 Let t(s) = 2s*2. Let l(a) = 14202a. Determine t(l(i)). 403393608i2 Let f(p) = -38p*2. Let y(o) = 7o + 6. Let l(c) = 4c - 1. Let k(v) = -3v + 1. Let t(q) = 5k(q) + 4l(q). Let d(u) = 6t(u) - y(u). Calculate f(d(i)). -38i2 Let a(q) be the second derivative of -q3/3 + 13q. Let j(i) be the second derivative of -i4/12 - i. Give j(a(h)). -4h*2 Let w(q) be the first derivative of -28q*3/3 - 83. Let i(c) = -2c*2. Calculate w(i(o)). -112o*4 Let q(i) = -114i*2 + 361i*2 - 137i*2 - 133i*2. Let k(j) = 9j + 5. Let x(g) = 5g + 3. Let w(p) = 6k(p) - 10x(p). Give w(q(r)). -92r*2 Let i(p) = -2p - 2. Let o(r) = -r + 1. Let c(s) = -4s + 1. Let q(v) = -c(v) + o(v). What is q(i(n))? -6n - 6 Let o(z) be the first derivative of z5/20 + z3/3 + 22. Let c(v) be the third derivative of o(v). Let x(n) = 3n2. What is c(x(h))? 18h*2 Let c(j) be the second derivative of -2j*3/3 + 3j*2 - 253j. Let h(l) = 2l. Calculate c(h(t)). -8t + 6 Let m = 15 - 13. Let o = 1 + m. Let n(w) = -ow2 + 3w2 - w2. Let p(b) = -8b. Calculate p(n(z)). 8z2 Let o(a) be the first derivative of -a2 + 53. Let v(t) = 205t2. Calculate v(o(h)). 820h*2 Let p(d) be the second derivative of -53d*3/6 - 52d - 9. Let q(o) = 3o + 2o - 3o. Determine q(p(s)). -106s Let b(d) = -4594d. Let k(h) = 3h. What is k(b(g))? -13782g Let m(q) = 3q*2 + 18q - 18. Let i be (3/(-4))/(18/432). Let z(s) = s - 1. Let r(l) = iz(l) + m(l). Let j(x) = -11x. Determine j(r(v)). -33v2 Let u = -16 + 27. Let i(c) = -c + c - uc2. Let f(s) be the first derivative of s3/3 - 974. What is i(f(x))? -11x4 Let g(c) be the third derivative of 0 + 0c + 0c3 + 0c*4 + 2/15c5 - c2. Let r(b) be the first derivative of -b*3/3 + 103. What is r(g(y))? -64y*4 Let v(z) = -16z*2. Let n(k) = -196368k*2. Give n(v(o)). -50270208o*4 Let r(l) be the third derivative of 0l*4 + 0l + 1/30l5 + 0l*3 - 10l2 + 0. Let a(j) = j2. What is r(a(d))? 2d4 Let k(y) = 9y. Let c(v) = 7v + 3. Let i(a) = -117a - 52. Let h(u) = -52c(u) - 3i(u). Calculate k(h(r)). -117r Let g(q) = 13q*2 + 3q + 3. Let j(r) = -60r2 - 14r - 14. Let o(k) = 14g(k) + 3j(k). Let h(z) = -46z - 15z + 6z. What is h(o(d))? -110d*2 Let u be 12/(-9)-6 + -5 + 5. Let f(z) = -7 - uz + 11 - 4. Let q(b) = -3b*2. What is f(q(h))? 24h*2 Let j(f) = -3f*2 - 27f*2 + 18f2 - f2. Let o(x) = -x*2. Give j(o(k)). -13k*4 Let h(r) = -8 - 1 + 10 + 19r*2 - 1. Let m(q) = 6q*2. Give m(h(g)). 2166g*4 Let x(a) = -19933a*2. Let r(g) = 127g. What is r(x(i))? -2531491i2 Let g(p) = p. Let h(z) be the third derivative of 19z8/20160 + z6/240 + 13z5/20 + 13z*2. Let y(a) be the third derivative of h(a). Calculate y(g(f)). 19f*2 + 3 Let q(r) = 2r2. Let a(j) = -j2 - 2j. Let m(u) = -3u*2 - 4u. Let f(w) = -10a(w) + 5m(w). Calculate q(f(p)). 50p4 Let p(y) be the third derivative of y4/24 + 8y2. Let r(v) = -v2 + 4v + 4. Let m(f) = f2 - 5f - 5. Let z(h) = 4m(h) + 5r(h). Calculate p(z(n)). -n*2 Let b(v) = -3v. Let o(s) be the first derivative of 5s3 + 15. Give o(b(t)). 135t*2 Let c(s) = -6s*2 - 7s*2 + 14s + 13s2 - 6s - 6s2. Let r(h) = h2. Determine r(c(g)). 36g*4 - 96g*3 + 64g*2 Let u(q) = -q. Let r(n) be the first derivative of 3/2n*2 + 0n - 8. Determine r(u(z)). -3z Let q(a) = -11a2 - a2 - 12a2. Let m(f) = -3f. Calculate m(q(j)). 72j2 Let r(b) = -2b. Let m(l) = -7l + 4. Let q(f) = -10f + 5. Let n(j) = 11j - 5. Let x(k) = -2n(k) - 3q(k). Let w(u) = 5m(u) + 4x(u). Calculate w(r(v)). 6v Suppose -u - 3 = -8. Let h(s) = -10s + us + 8s. Let p(g) = -6g*2. What is h(p(v))? -18v*2 Let k(x) = 3x. Let v(j) be the second derivative of 8j3 + 5j - 18. Give k(v(u)). 144u Let p(m) = -3m. Let q(t) = 26543t. Give p(q(i)). -79629i Let v(q) be the first derivative of 4q3 + q2 + 6. Let d(z) = 49z*2 + 9z. Let j(w) = -2d(w) + 9v(w). Let g(h) = 7h. Calculate g(j(p)). 70p*2 Let s(p) = p. Let i(j) be the second derivative of -j + 2 + 0j*2 + 14/3j*3. What is i(s(b))? 28b Let f(o) = -41 + 15 + 26 - 13o2. Let q(u) = -7u. Calculate q(f(p)). 91p2 Let w(i) be the first derivative of -2i*3/3 + 56. Let c(b) = -49b*2 + 2b. What is c(w(o))? -196o4 - 4o2 Let w(h) be the second derivative of -h3/3 + 98h. Let q(y) = y2 - 11y. Give q(w(n)). 4n2 + 22n Let c(v) be the first derivative of 13v4/24 - 5v*2/2 + 17. Let f(w) be the second derivative of c(w). Let b(d) = 3d. Determine b(f(j)). 39j Let n(w) = -7w*2. Let j(k) = -46738k*2. Determine n(j(r)). -15291084508r*4 Let x(g) = 10g - 23 - 15 + 38. Let b(z) = 4z2. Determine x(b(u)). 40u*2 Let s(f) = -4f. Let i(u) = 17u - 3. Let n be i(6). Let v(j) = 99 - n - 4j. Give s(v(g)). 16g Let x(d) = -156d2. Let n(j) be the third derivative of -j4/12 + 4j2. Give n(x(p)). 312p*2 Let q(l) = 3l*2. Let j(s) = -21s + 2. Determine q(j(k)). 1323k2 - 252k + 12 Let n(w) = -2w. Let v(h) = 182466h. Calculate n(v(q)). -364932q Let q(b) = -b - 6. Let d(x) be the second derivative of -x3/3 - 13x*2/2 - 16x. Let n(f) = 6d(f) - 13q(f). Let g(s) = 0 + 0 - 4s2. Calculate g(n(l)). -4l2 Let k(r) = r2 + 14r + 15. Let j be k(-13). Let x(o) = 7o + 3oj + 0o*2 - 7o. Let u(c) be the first derivative of 3c2/2 - 2. What is u(x(m))? 9m*2 Let a(y) be the second derivative of 3y + 13/6y3 + 0 + 0y*2. Let p(s) = 2s*2. Give p(a(q)). 338q*2 Let m(z) = 16z*2 - 19z - 2. Let f(k) = 4k2 - 4. What is m(f(t))? 256t*4 - 588t*2 + 330 Let d(w) = -w. Let f be ((-32)/24)/((-2)/3). Let s(r) = 4r. Let k(u) = fd(u) + s(u). Let x(v) = 2 - 3 + 1 - 5v. Calculate k(x(m)). -10m Let b(r) = 7845r. L	{ "pile_set_name": "DM Mathematics" }
-25 = 4n + 5w. Let r = -11 - -15. Solve -rk - 4d + 28 = n, -3k + 11 + 6 = d for k. 5 Suppose 0 = 2h + p - 3, -p = h + 2h - 5. Let a = 26 - 25. Let t be (-40)/(-24) + a/3. Solve hi + 4y - 3 = 7i, 2i + 12 = -ty for i. -3 Let p = -11 - -14. Let a = p - 3. Let h(t) = -t + 3. Let d be h(a). Solve -5v + 35 = -5f, 5v + 2f = -f + d for v. 3 Let l(i) = -i*2 + 11i + 12. Let k be l(12). Let d be -43/(-6) - 0. Let t be ((-50)/30)/(d/(-6)). Solve kg = 3p - tg + 4, 5p + 2g = 14 for p. 2 Let b be ((-57)/76)/(6/(-16)). Solve 4f + 2 = -bi, 1 = -i + 3f + f for i. -1 Let s(t) = -t3 - 20t*2 - 21t - 36. Let p be s(-19). Solve 4d - 4a = 12, 4 + p = -3a for d. 1 Suppose -23c - 72 = -20c. Let j = 26 + c. Solve -4v + 5r + 6 = 0, 5v - 3r + jr = -3 for v. -1 Let l = -101 - -102. Let p = l + 3. Solve 4 = ph, 0 = -z - h + 5 for z. 4 Let d = 1195 + -1190. Solve 0 = 5q - 5m + 20, 3 = -2m + d for q. -3 Let f(w) = w3 - w2 - 3w + 3. Let d be f(1). Suppose d = t - 14 + 13. Solve 7 = -r + 5u, 3u = -2r - 2 + t for r. -2 Let c(p) = p*3 + 3p*2 + 4p + 2. Let r be c(-1). Solve 4v = 3q - 2 - 6, r = -2q + v - 3 for q. -4 Let g = -28 - -20. Suppose 2r + 38 + 2 = -4w, -4r + 2w = 30. Let p = g - r. Solve -4c + 3n - 13 = 2n, 0 = c - pn - 2 for c. -4 Let y(h) = -3h - 1. Let u = -64 + 62. Let f be y(u). Solve 0 = 5k + 3v + f, -2v - v = -2k - 2 for k. -1 Suppose 1 = -3y - 2. Let q be (2 + -1)7 - (y - -3). Solve d + 2p - 2 = 0, -2d + qd = p + 6 for d. 2 Suppose -48l = -47l - 2. Solve -18 = 4o + lb, 2b + b + 3 = 2o for o. -3 Suppose -277t + 282t - 55 = 0. Solve 2m + h = -t, -m = 3h - h + 10 for m. -4 Let z be -4 - 5/(-2) - 26/(-4). Suppose 2o = -4r - 8, 2o = -2o - 16. Solve -zy = -y - 4d + 20, r = 3y - 5d + 19 for y. -3 Let d be (26/16)/(2/16). Solve a = -5y - 12, y = -da + 9a + 9 for a. 3 Let x(y) = -y*2 + 4y + 14. Let m be x(-5). Let z = m - -35. Solve zw + j = 24, -j - 15 = w - 6j for w. 5 Suppose 2k - 6 - 6 = 2g, g = -4k + 14. Solve 5r - 20 = b, kb - 6r + 20 = -r for b. 0 Let n(q) = -q*3 + 9q*2 - 16q - 4. Let k be n(3). Solve b - 5h + 2 = 0, -b = -2b + h - k for b. -2 Suppose -5a + 36 = 2h, a = 3h + 11 - 31. Suppose -o = 5s - 43, 5o + 5s = 3s + 123. Solve 5t - h = -l, 5l + 7 = -t + o for t. 1 Suppose -3y + 8y - 2c - 23 = 0, 8 = -2c. Solve 2h = 3b + 2 + 3, yb = -4h + 1 for b. -1 Suppose 5h - 2h + 9 = 0, 2o - 3h = 13. Let u be (-10)/(-8)(4 - (-168)/(-70)). Solve 3 = 5a - 6a - od, -3a - 9 = ud for a. -3 Suppose 20t = 18t + 8. Solve -ts + 8 = 3g, g = -s + 2 - 1 for s. 5 Suppose -y + 29 = 2y - 2s, 5y + 5s = 40. Suppose 3x = -y, 5h - 3x - 13 = 4h. Solve -hu - z - 24 = z, 2z - 16 = 4u for u. -5 Let l = 407 + -403. Solve b - 4z = -3b - 12, lz = -3b - 23 for b. -5 Let k be 3 + (1 - 2) + (2 - 1). Suppose -kv + 16 = 4. Solve 2b - o + 6 = 0, 0 = -vb + 4o - o - 12 for b. -3 Let o = 279 - 273. Solve -4m + 5 = 2z - 13, 2m = 2z + o for z. 1 Let a be (4 - 4/1)/(-3 - -7). Solve -o = 4c + 2o - 10, a = 4o + 8 for c. 4 Suppose -5o - 5q = -70, 2o + 5q = 3o - 44. Solve 4z - o + 56 = -5j, -2z - j = 11 for z. -3 Let q = 0 - -2. Suppose c - 20 = -5s, -s + 12 = qs - c. Suppose 18a = 20a - 10. Solve -w = 3f, af = sw - 5 - 12 for f. -1 Let b be (-6)/(-9)(-21)/(-2). Suppose -3y - t + 142 = 0, -2y - 312t = -315t - 80. Solve 4q - b = i, 5q + 5i = -6 + y for q. 3 Let l(v) = -22v - 87. Let i be l(-4). Solve 4 = 3r + i, 4b + 2r + 6 = 0 for b. -2 Suppose 0 = t + 3j + j - 1, -1 = j. Solve 13 = -2w + tb, -2w - 7b + 2b = -17 for w. 1 Let c = -173 - -173. Solve -2i - 4a = -i + 15, c = 2i - 5a - 22 for i. 1 Suppose 5g = a + 29, -2a - 18 = g - 15. Solve -2k - l = 8, -gk + 0k + 5l - 35 = 0 for k. -5 Let h = -64 - -44. Let k = h + 24. Solve 4 = 3z - p, 3z - kp + 17 = 2z for z. 3 Let b(w) = w - 1. Let y(s) = s*2 + 6s + 8. Let c(m) = 4b(m) + y(m). Let l be c(-10). Solve 2j = -5t, -l = 3t + 3j - j for t. 2 Let u be 14/2 + 4 + (-15)/5. Suppose ud - 10d + 10 = 0. Solve -2w = 2w - dv - 7, 2v = -3w - 12 for w. -2 Let f(d) = 1 + 16d - d + 0. Let o be f(1). Suppose 5l + 4 = -q, -42 = -5q + l + o. Solve 2k + q = 3b - 0, -2k - b = -9 for k. 2 Let z = 12 + -20. Suppose 38 = -3r + 5y, -6 = r + 2y + 3. Let h = z - r. Solve -3m - hv - 12 = 0, -2m - 3m - 3v - 10 = 0 for m. 1 Suppose 0 = 3d, 2d + 56 + 0 = 4y. Solve 2i + 0 = -z - 5, 2i = -4z - y for z. -3 Let f = -177 - -180. Solve 0w - 16 = -fw - 5l, 3w + 4l = 11 for w. -3 Suppose q + 3 = 10. Let g be 0 - (-6 + 3) - q. Let v be (-50)/(-15) + g/(-6). Solve -4d - 5w + 32 = 0, vd + 1 = w + 9 for d. 3 Let o(l) = -57l - 280. Let h be o(-5). Solve -2k = -3t + 1, -4k + 3t - 26 = ht for k. -5 Let v = -13 + 18. Suppose -vs + 52 + 48 = 0. Let n be 23/5 - 12/s. Solve 0 = -nj - 3 - 5, -3m - 3j - 18 = 0 for m. -4 Suppose -2p - l = -32, -p + l + 15 = 2. Suppose 4d = 11d + 63. Let q = d + p. Solve 8 = -2w - v, w - v = -2v - q for w. -2 Let r(y) = -59y - 55. Let p be r(-1). Solve pk + 4 = -3t - 4, 0 = -k + 2t + 9 for k. 1 Suppose 54 = -2c - 10. Let a = -31 - c. Solve -i + 3i - 8 = 0, -i = -3k - a for k. 1 Let o(q) = -3 - 3q + q2 + q + 3q. Let s be o(-3). Suppose 5z - sz = 0. Solve -3b + d - 7 = z, 29 = -5b - 4d - 11 for b. -4 Suppose 0 = -0o + o + 4n + 116, 4o + 404 = -n. Let y = o + 100. Solve y = v + 5, 5s + 7 = -4v - 8 for s. 1 Let x = -53 + 57. Suppose -9 = -4g - 3l, 5g + 6l - 9 = 3l. Solve g = 5s - 2z - x, -4 = -4s + 2z - 2 for s. 2 Let q be (-28)/(-182) - (-206)/13. Solve 4w - q = 4j, -2w + 6w + 4j = -8 for w. 1 Suppose 16m = 87 + 105. Suppose -5o = -10, -4o + 3 + 3 = -q. Suppose -qa + 5a - 12 = 0. Solve w + 0d + 12 = -ad, -4w + m = d for w. 4 Let l = 23 - 38. Let g be (-2)/(l/(-6) - 3). Solve v = -go - 2 - 2, 2o + 5v + 20 = 0 for o. 0 Suppose -v + 15 = 5b - 4v, -3v - 15 = -3b. Solve 0 = -3a + 5t, bt = -a - t for a. 0 Let b(x) be the third derivative of x6/30 - x5/60 + 2x2. Let p be b(1). Let m be ((-280)/60)/(2/(-3)). Solve -pt - 8 = 4, 0 = -3u + t + m for u. 1 Let q = 103 + -100. Solve -2z = -3 + 1, -a = qz for a. -3 Let w be 2 + -1 - (0 - -1). Suppose w = 5f, -6h + h = 4f. Suppose -2m + 7m = h. Solve -2g = 4o - 0g, m = -5o - 5g + 5 for o. -1 Let r be -8 + 1 + 182 + -170. Solve -5j - ry = 30, 3y + 4 = -0j + 4j for j. -2 Suppose 4r - f - 10 - 41 = 0, 3r - 2f - 42 = 0. Solve 0 = -2d + 4d + 3a - 13, 3d - 3a = r for d. 5 Suppose 5w = 4i + 20 + 14, w = -3i + 3. Solve -2p - 2b - 2 = -w, -p + b = 8 for p. -3 Let d = 1 - -4. Suppose -2a + 21 = -5h, 21 + 3 = da - 3h. Let f(z) = -z - 1. Let m be f(-4). Solve al - 3q - 14 = -l, -12 = -ml + 3q for l. 2 Let k = 6 - 3. Suppose f = s + 1, -3s - 2f = -16 + 9. Let z = 6 + -3. Solve 0 = -2h + kn - s, -4n = -h + n + z for h. -2 Let f = -13 - -38. Let q = -30 + 38. Let c be -4 + 16/12(4 + q). Solve -3n + 5h + c = -f, -25 = -5n + h for n. 4 Suppose 0 = x + 4n + 4, -n = -5x + 25 + 39. Let j(c) = -2c3 - 14c*2 + 11c + 138. Let o be j(-6). Solve 4q + oq - x = 2k, 5k + 19 = -q for k. -4 Let b = -14 + 29. Suppose -b = -2w - 9. Solve -wt - 2 = -4l - 9, 4l + 25 = -3t for l. -4 Let p(s) = 7s + 29. Let i(b) = 6b + 28. Let d(x) = -6i(x) + 4p(x). Let w be d(-10). Solve 0 = 4r - 4h, -h - w = -3r - 5h for r. 4 Suppose 3f - s + 2s - 15 = 0, s - 10 = -2f. Let m = -222 - -158. Let d = m - -68. Solve 0 = 4i - i + fn + d, 4n = -i + 1 for i. -3 Let j(x) = 2x*3 + 5x*2 + x + 1. Let p be j(-2). Solve -k - 4 = pc + 8, -3k = c + 4 for c. -4 Suppose -2o - 20 = -o. Let g be ((-3)/(-2))/(15/o). Let w be 3 - (0 - -2)/g. Solve -wa - b = -a - 9, -a = 5b + 11 for a. 4 Let t(s) = -s*2 + 22s - 115. Let o be t(12). Solve 3r - 10 = -k, -ok - 12 = -5r + 38 for r. 5 Let v be (3/(-2))/((-6)/52). Let w(a) = -a2 + 13a + 2. Let x be w(v). Solve -3z + 6 = -xz - 2u, 4u = -3z - 12 for z. 0 Let l = 451 - 424. Solve -p + l = w - 6w, 0 = -2w - 10 for p. 2 Let z be 16 + 9/((-9)/4). Let d(o) = 26 - 12 - 2o - z. Let a be d(1). Solve -4t + 5k + 6 = -t, a = 2t - k + 3 for t. -3 Suppose -3	{ "pile_set_name": "DM Mathematics" }
at is -2011331302 (base 5) in base 16? -3d35bc What is 44540452 (base 8) in base 3? 200002122000100 What is 310200210 (base 4) in base 14? 58548 11010101001100101100001 (base 2) to base 15 92ee3b 121220244 (base 5) to base 3 1001221222212 -1012020111 (base 4) to base 11 -1868aa -22020000022110 (base 3) to base 13 -ba0018 10100101121112 (base 3) to base 11 1005820 What is -525425 (base 7) in base 12? -4463b Convert -381506 (base 11) to base 9. -1117076 What is 12440341 (base 5) in base 2? 11110011000110111 What is -100111000010001000 (base 2) in base 5? -20104010 What is -111010001000100011 (base 2) in base 12? -b596b What is 2c9781 (base 13) in base 6? 35414043 Convert 2043688 (base 9) to base 7. 12165215 Convert 55141152 (base 7) to base 12. 1702a80 86a74 (base 12) to base 6 3451024 17c4 (base 15) to base 12 2b7a Convert 5054c3 (base 16) to base 4. 110011103003 465232 (base 7) to base 9 136444 Convert -1012133012 (base 4) to base 3. -112200000222 4102001 (base 6) to base 13 6a8b2 What is -303131032 (base 4) in base 15? -426b1 -20157362 (base 8) to base 13 -b5b111 -a56a (base 11) to base 3 -201012012 What is -5a0793 (base 14) in base 11? -1810146 What is 2001010010101 (base 3) in base 8? 4106653 What is -31231331003 (base 4) in base 13? -98ba90 What is 2510302 (base 6) in base 10? 133598 Convert 56257627 (base 8) to base 3. 211212012210022 What is -608500 (base 10) in base 15? -c046a 7710319 (base 11) to base 13 2a625bc What is 100629 (base 11) in base 15? 32e23 Convert -10278815 (base 9) to base 7. -60050441 -90328 (base 12) to base 8 -555320 What is 142631 (base 8) in base 10? 50585 -6db3e (base 15) to base 8 -1253717 What is 2033241 (base 5) in base 4? 20030203 What is 1867917 (base 10) in base 11? 1066437 Convert 101011011110111100 (base 2) to base 14. 48ca0 136468 (base 13) to base 8 1627610 Convert 614bc7 (base 13) to base 8. 10513771 -1440555255 (base 6) to base 10 -17962451 -104464 (base 7) to base 14 -69db Convert -10111202221 (base 3) to base 4. -100313203 Convert 1823635 (base 9) to base 14. 1c784c 3141011 (base 11) to base 14 a4150d -52b6b (base 15) to base 8 -1000463 -84658 (base 9) to base 2 -1101101010000111 -2781aa5 (base 11) to base 15 -64950d What is 64e1c (base 15) in base 11? 1a9818 Convert 2625557 (base 10) to base 2. 1010000001000000010101 What is 19894 (base 12) in base 16? 92b0 Convert 203301202 (base 4) to base 11. a00aa Convert -eb42e (base 15) to base 9. -1357388 Convert -111000010010010 (base 2) to base 9. -43470 What is 98163c (base 13) in base 14? 69037d Convert -52232132 (base 6) to base 12. -60b648 What is 33ba3e (base 15) in base 3? 11122110102112 What is -40baa (base 15) in base 13? -724a8 e325 (base 16) to base 13 20610 Convert -97798 (base 14) to base 9. -617615 Convert 22012010210 (base 3) to base 5. 20124321 Convert 1012112001121 (base 3) to base 11. 3a7a14 Convert 2646356 (base 7) to base 4. 1110331112 f511a (base 16) to base 7 11350352 What is 1dd91 (base 14) in base 10? 76763 What is 598560 (base 14) in base 9? 5670554 Convert -32550101 (base 8) to base 16. -6ad041 Convert -11111011110000110 (base 2) to base 4. -133132012 -292a1 (base 11) to base 13 -15c31 What is 1101413320 (base 5) in base 6? 122505532 456650 (base 10) to base 4 1233133022 Convert 230303342 (base 5) to base 9. 1832613 What is 100010101001011101 (base 2) in base 14? 39a0d What is 324996 (base 10) in base 11? 2021a1 What is -49687 (base 14) in base 13? -63a08 -11000011101011100000100 (base 2) to base 16 -61d704 2133312 (base 4) to base 3 112000220 -2b7d9 (base 15) to base 7 -1122420 Convert 1801a (base 12) to base 16. 8716 Convert 10435310 (base 6) to base 5. 40103442 2003321220 (base 4) to base 8 2037150 2222011121 (base 3) to base 12 299a4 What is -577723 (base 11) in base 12? -383263 What is 230440014 (base 7) in base 14? 1c261b4 552126 (base 10) to base 5 120132001 948200 (base 14) to base 12 181b034 -27693 (base 15) to base 13 -45693 What is 100101011011101001000 (base 2) in base 12? 4b19a0 What is -7975 (base 16) in base 4? -13211311 100000000010101111 (base 2) to base 3 20200001000 Convert 645423 (base 12) to base 13. 43669b -11203231302 (base 4) to base 16 -163b72 -27c73 (base 15) to base 6 -2423043 Convert 188426 (base 11) to base 15. 5aae4 What is -42155110 (base 6) in base 2? -100101011111010010010 What is 11a464 (base 11) in base 12? 91844 515764 (base 12) to base 2 100110111001011111100 Convert 2466d2 (base 14) to base 9. 2310666 What is a1458 (base 11) in base 12? 71994 What is -28a91 (base 11) in base 6? -514532 1a7da6 (base 14) to base 8 3463416 23223223 (base 7) to base 8 7617451 What is 23211212031 (base 4) in base 5? 1234200311 103834 (base 9) to base 15 1352a Convert 3ac79 (base 15) to base 7. 1413246 Convert -3408321 (base 9) to base 16. -1c0645 1156202 (base 7) to base 4 210102023 Convert -16415644 (base 7) to base 14. -2d96cb What is 2001221220100 (base 3) in base 7? 12235134 Convert -120001002011 (base 3) to base 4. -1020101200 54a0ab (base 12) to base 3 2112022022212 Convert 110001101100010100001011 (base 2) to base 6. 1143112111 Convert -34c1 (base 14) to base 6. -110305 What is -545152304 (base 6) in base 13? -203c155 What is 32ad (base 15) in base 11? 8082 What is 2756621 (base 11) in base 10? 4752419 Convert -14221342 (base 5) to base 9. -245440 Convert -3146614 (base 8) to base 13. -234ba6 2355a (base 11) to base 6 421053 Convert -24533122 (base 6) to base 9. -1433555 Convert -7ed38 (base 16) to base 4. -1332310320 -435262 (base 9) to base 12 -106392 What is -13023323 (base 5) in base 7? -1035266 What is 6928 (base 15) in base 12? 10ab5 What is -310210322 (base 4) in base 7? -1554566 Convert -1d44f (base 16) to base 7. -1006345 Convert 2206843 (base 9) to base 14. 22c333 Convert 1525d71 (base 14) to base 16. 9d58af Convert -11110010011111000 (base 2) to base 5. -12433102 What is 11212101222 (base 3) in base 13? 347ab What is 455274 (base 8) in base 12? 75364 Convert 2511324 (base 6) to base 13. 48bb6 What is -140443 (base 6) in base 9? -20010 Convert 1605364 (base 7) to base 4. 311303233 41141213 (base 5) to base 13 b8cc2 Convert -28b2068 (base 12) to base 2. -11111010000100011010000 848a51 (base 14) to base 7 53036631 -1301222223 (base 4) to base 5 -104344304 What is 17701431 (base 8) in base 16? 3f8319 Convert -2452754 (base 11) to base 7. -51146530 What is 31266166 (base 7) in base 5? 1133412303 Convert 2330342 (base 5) to base 16. a665 What is 1566 (base 12) in base 3? 10110120 -187a30 (base 12) to base 10 -428292 Convert 721841 (base 10) to base 14. 14b0c1 Convert 122523414 (base 6) to base 14. 45b7a2 Convert -5807434 (base 9) to base 8. -13753117 What is 2c0684 (base 13) in base 16? 1093e8 Convert -23231120121 (base 4) to base 12. -1040389 What is -2302100 (base 6) in base 12? -57930 Convert 1643176 (base 10) to base 16. 1912a8 Convert 221020012010 (base 3) to base 7. 4135530 -3301532 (base 6) to base 5 -20214322 -13304430140 (base 5) to base 16 -1017943 110211122211100 (base 3) to base 5 3221321224 What is 105a3c (base 14) in base 4? 2013021112 What is 183207 (base 9) in base 14? 2d713 What is 48a45a (base 12) in base 4? 10133320012 Convert -33513 (base 12) to base 16. -10a1f 11220001201220 (base 3) to base 8 11724776 110000000001111100 (base 2) to base 15 3d457 What is -3b3c4 (base 14) in base 3? -21102112112 What is -406814 (base 9) in base 12? -b7727 Convert -3689ce (base 15) to base 4. -21331132112 -9dd26 (base 14) to base 4 -1131233332 What is -214504 (base 8) in base 3? -10122202211 Convert -70016 (base 11) to base 12. -4b3a0 Convert -101211101110121 (base 3) to base 8. -25750272 What is -5242027 (base 9) in base 8? -12542526 -2101110110 (base 3) to base 9 -71413 -117300 (base 10) to base 12 -57a70 Convert -22010121221112 (base 3) to base 11. -2492977 Convert -11110011001110011 (base 2) to base 10. -124531 -344242002 (base 6) to base 11 -3659184 -298838 (base 13) to base 15 -151c25 -11000000000011000 (base 2) to base 11 -6796a What is 1a01b (base 16) in base 9? 172108 Convert -61610056 (base 7) to base 12. -188b467 What is 146466521 (base 7) in base 3? 200112101001002 What is -652460 (base 7) in base 15? -23a9b Convert -102210112001022 (base 3) to base 10. -6269435 What is 284187 (base 9)	{ "pile_set_name": "DM Mathematics" }
300d2 Suppose -6c - 6 = -9c. Suppose -p = cf - 11, 8 = -0f + f + p. Find the second derivative of 0 + 5h + 3 - 3 + fh3 wrt h. 18h What is the third derivative of 418o6 - 325o*2 + 105o*2 + 122o*2 wrt o? 50160o*3 Let b(r) be the first derivative of -3r*5/5 - 2r*2 + 6r - 8. Let j(c) be the first derivative of b(c). What is the first derivative of j(i) wrt i? -36i2 Find the second derivative of g4 + 33g*2 - 156g*3 - 2g - 163g2 + 130g*2 + 29 wrt g. 12g*2 - 936g Suppose 3w - 2c - 3 = -4, -w + 4c = 17. Let o(r) be the first derivative of 0r*2 + 0r + 1/3r3 + 5/4r*4 - w. Find the third derivative of o(q) wrt q. 30 Suppose 2h = -3h. Suppose -2s + 22 = -y + 3y, s = -3y + 21. Find the third derivative of -b*6 + hbs + b2 - 6b2 wrt b. -120b*3 Suppose -3 = -d + 1. Suppose 0 = dk + 3p - 25, k - 7 = -4p + 9. What is the third derivative of -6r2 + r2 + 6r*4 - 2r*k wrt r? 96r Suppose -3q = q + 6q. Let t(d) be the third derivative of -d*3 + 1/30d*6 + qd + 0 + 0d5 - 2d*2 + 0d*4. Differentiate t(p) with respect to p. 12p*2 Let l = 2 + -1. Let w be 23/(-1)5/(-10). Differentiate 7 + sw - s3 + l - 2s*3 wrt s. -6s2 Let i(c) be the third derivative of -c6/24 - c*5/10 - 4c3/3 - c2 - 5. Find the first derivative of i(k) wrt k. -15k2 - 12k Let p(j) be the third derivative of -27j2 - 25/12j*4 + 0j + 0 - 3j3. What is the first derivative of p(w) wrt w? -50 Let j(r) be the second derivative of 11r*4/6 + 31r3/3 - r2 + 42r. Find the second derivative of j(z) wrt z. 44 Let l = -356 - -356. Let h(u) be the first derivative of 3/2u*4 + 0u*3 - 5 + u + lu*2. Differentiate h(x) with respect to x. 18x*2 Find the third derivative of -36 - 5773w*3 - 9w*2 + 5773w*3 - 635w*4 - 124w*4 wrt w. -18216w Suppose 11 = l - 4i, -3l + 3i + 5 + 19 = 0. Suppose 1 = -3f + l. What is the third derivative of 3k6 - 28k*3 - 11k*f + 28k*3 wrt k? 360k*3 Let l(f) be the second derivative of -139f*6/15 + 137f4/12 - f3/3 + 2f + 202. What is the third derivative of l(j) wrt j? -6672j Find the third derivative of -17y3 + 19y*2 - 2 + 14y*3 - 9y*3 - 38y*3 wrt y. -300 Let l(o) be the third derivative of -17o6/60 - o5/60 - 35o4/6 + 2o*2 - 6o. Find the second derivative of l(x) wrt x. -204x - 2 Let b(c) be the second derivative of 9c + 7/2c3 + 0c*4 + 0c*2 + 0c*5 + 0 + 3/5c*6. Find the second derivative of b(g) wrt g. 216g*2 Find the first derivative of -89 + 27u*4 + 8 + 47u*4 - 3u3 - 34 + u3 wrt u. 296u3 - 6u*2 Let j(t) be the first derivative of -77t*5/5 - 62t - 161. Find the first derivative of j(x) wrt x. -308x3 Let v(i) be the third derivative of 0 + 0i*4 - 1/24i*6 + 0i + 3i2 - 1/6i*3 + 0i*5. What is the derivative of v(m) wrt m? -15m*2 Find the third derivative of 9f + f2 + f6 + 58f6 + 2f*2 + 42f*6 wrt f. 12120f*3 Suppose 0 = -3s + 5s - 88. What is the first derivative of -s - 45 - 5q + 91 wrt q? -5 Find the second derivative of n - 12n3 - 110 - 48n*3 + 175 wrt n. -360n Let t = 328 - 328. Let h(y) be the second derivative of 1/20y5 - 3/2y*2 + 0y*3 + ty*4 + 3y + 0. Differentiate h(k) with respect to k. 3k2 Suppose -3 = 2q - 3j, 5j + 6 = 4q + 3j. Find the third derivative of -2w2 + 18w*3 - 9w*2 + 6w*q wrt w. 144 Suppose -h - 2l - 1 = 0, 4h - 3 - 5 = -2l. Let c(v) be the second derivative of 4v - 1/2v*2 + 0 - 1/3v*h. Find the first derivative of c(x) wrt x. -2 Suppose 48 = 3l - 18. Suppose l = 3f - m, 9 + 39 = 5f + 4m. What is the first derivative of -4 + 5 - 5 - 9t - f wrt t? -9 Let i(v) be the first derivative of -5 - 11/2v2 + 0v*3 + 1/4v*4 + 0v. What is the second derivative of i(z) wrt z? 6z Let z(n) be the second derivative of -2n + 0n3 + 23/30n*6 + 0n5 + n2 + 0n4 + 0. What is the first derivative of z(j) wrt j? 92j*3 Let o(d) be the third derivative of 19d7/70 + d5/60 - 173d3/6 + 270d*2. Find the first derivative of o(x) wrt x. 228x*3 + 2x Let u(t) be the third derivative of 11t9/63 - t8/168 + 3t*5/2 - 13t*2. What is the third derivative of u(i) wrt i? 10560i*3 - 120i*2 Let n(l) = -2l*2 - 14l - 12. Let k be n(-6). Suppose 2i - 2w = -kw + 24, i - 6 = -w. What is the derivative of 3d + id + 118 - 117 wrt d? 12 Let d(o) = -o2 + 7. Let k be d(-3). Let l be (k/(-1) - 0)1. Differentiate -4 + w2 - wl + 2w3 wrt w. 6w*2 Let g be (-23 - -24) + (-61 + -1)/(-2). Find the third derivative of 13l*3 + 11l - 11l - gl*3 + 28l2 wrt l. -114 Let w(n) = -n3 + 9n2 + 10n + 8. Let g be w(10). Let j be -1(3 - 4) + g. Find the second derivative of jc*2 + c - 2c*2 - 10c wrt c. 14 Let f(m) = -2m + 11. Let w(o) = -2o + 11. Let u(h) = -7f(h) + 6w(h). Let l be u(7). What is the first derivative of 10 + xl - x3 + 5x3 wrt x? 15x*2 Let t(h) be the first derivative of 9h5/5 + h3/3 - 75h - 78. What is the third derivative of t(j) wrt j? 216j Let d be (9/(-6) + -1)-2. Suppose -19 + 4 = -ds. Find the third derivative of -4is + 4i*2 - 11 + 11 wrt i. -24 Let i(n) = -15n*4 + 13n*3 - 2n*2 - 13n + 37. Let x(c) = 7c4 - 6c3 + c2 + 6c - 19. Let l(t) = -6i(t) - 13x(t). Differentiate l(k) wrt k. -4k*3 - 2k Suppose 0 = 2m - 5m. Suppose -4o + m = -8. What is the second derivative of 10g + 7g2 + 5g*2 + 0g*o + 0g wrt g? 24 Let v(k) = -k*3 - 13k*2 - k + 15. Let m be v(-13). Let l = -25 + m. Differentiate 5p*2 + l - 2 - 3 wrt p. 10p Let m(w) be the third derivative of 25w6/8 + 83w*3 + 1024w*2. What is the first derivative of m(a) wrt a? 1125a2 Let s(z) be the third derivative of -z7/105 + 5z4/24 + 59z*3/6 + 101z*2. Differentiate s(r) with respect to r. -8r*3 + 5 Find the second derivative of -35w - 26w + 8w*2 + 21w - 38w2 + 2 - 27w*2 wrt w. -114 Differentiate -2y*2 - 3y*2 - 152 + 4y*2 - 25y + 295 + 255 wrt y. -2y - 25 Let u(x) = x + 11. Let v be u(0). Differentiate -2 - 1 + v + 15j*2 + 6 with respect to j. 30j Let o(d) be the first derivative of 2d7/105 - 7d*5/15 + 3d*2 + 42. Let m(k) be the second derivative of o(k). What is the third derivative of m(j) wrt j? 96j Let y(p) = -p*5 - 7p*4 - 30p + 7. Let t(z) = 1. Let o(c) = 14t(c) - 2y(c). What is the second derivative of o(n) wrt n? 40n3 + 168n*2 Let r(q) be the third derivative of -11q*8/560 - 9q4/8 + q3 + 28q2. Let m(u) be the first derivative of r(u). Find the first derivative of m(x) wrt x. -132x3 Let p(a) be the third derivative of -a8/210 + 5a4/12 - a3 + a2. Let r(o) be the first derivative of p(o). Differentiate r(f) wrt f. -32f*3 Let z(o) be the third derivative of 0o + 0o3 + 8o*2 + 1/120o*6 + 0o*4 + 1/60o*5 + 0. Find the third derivative of z(q) wrt q. 6 Let d(a) be the first derivative of -44a7/7 + a3/3 - 7a2/2 + 62. What is the third derivative of d(y) wrt y? -5280y*3 Let o(r) be the first derivative of -88r*7/7 - 3r*4/4 - 175r*3 + 288. Find the third derivative of o(d) wrt d. -10560d*3 - 18 Let o(x) be the first derivative of -64x*6/3 - 10x*2 - 2x - 99. What is the second derivative of o(l) wrt l? -2560l3 Let z(y) = 3 + 1 - 3y - 5. Let i(v) = 3v - 1. Let u(f) = -f. Let k(d) = i(d) + 6u(d). Let x(p) = 3k(p) - 2z(p). Differentiate x(b) wrt b. -3 Let r = -63 + 89. Find the first derivative of -5119j + 5119j - rj3 + 5 wrt j. -78j*2 Let v(q) be the first derivative of 17q7/42 - q4/12 - 19q + 5. Let r(i) be the first derivative of v(i). What is the third derivative of r(k) wrt k? 1020k*2 Differentiate 231 - 32k - 44k - 18k - 72k wrt k. -166 Let n(i) be the second derivative of 12i*6/5 + 28i*2 - 97i. What is the derivative of n(c) wrt c? 288c3 Let l(x) = -x5 - x4 + x2 + x - 1. Let i(o) = -24o5 - o4 + 3o3 - 8o*2 + 4o - 1. Let v(b) = i(b) - l(b). Find the third derivative of v(w) wrt w. -1380w2 + 18 Let n(u) = -28u*3 - 74u*2 + 9u + 9. Let r(d) = -7d3 - 19d*2 + 2d + 2. Let z(s) = -2n(s) + 9r(s). What is the third derivative of z(t) wrt t? -42 Find the th	{ "pile_set_name": "DM Mathematics" }
nearest integer? 8 What is the fourth root of 4692649 to the nearest integer? 47 What is 89017 to the power of 1/9, to the nearest integer? 4 What is the cube root of 5182720 to the nearest integer? 173 What is the seventh root of 937855 to the nearest integer? 7 What is 2934175 to the power of 1/5, to the nearest integer? 20 What is 92435 to the power of 1/3, to the nearest integer? 45 What is the cube root of 19093136 to the nearest integer? 267 What is the eighth root of 245676 to the nearest integer? 5 What is 2815842 to the power of 1/7, to the nearest integer? 8 What is 240511 to the power of 1/4, to the nearest integer? 22 What is the square root of 802757 to the nearest integer? 896 What is the eighth root of 232737 to the nearest integer? 5 What is 306815 to the power of 1/9, to the nearest integer? 4 What is the square root of 321446 to the nearest integer? 567 What is 279359 to the power of 1/2, to the nearest integer? 529 What is the cube root of 7533672 to the nearest integer? 196 What is the third root of 1788470 to the nearest integer? 121 What is 2957836 to the power of 1/2, to the nearest integer? 1720 What is the cube root of 8729260 to the nearest integer? 206 What is the fifth root of 177758 to the nearest integer? 11 What is 52933 to the power of 1/2, to the nearest integer? 230 What is 9913856 to the power of 1/2, to the nearest integer? 3149 What is the square root of 1188827 to the nearest integer? 1090 What is the ninth root of 19327024 to the nearest integer? 6 What is the square root of 745423 to the nearest integer? 863 What is 278564 to the power of 1/2, to the nearest integer? 528 What is 28984 to the power of 1/2, to the nearest integer? 170 What is 1021216 to the power of 1/2, to the nearest integer? 1011 What is the third root of 823271 to the nearest integer? 94 What is 261077 to the power of 1/8, to the nearest integer? 5 What is 624123 to the power of 1/3, to the nearest integer? 85 What is the sixth root of 788388 to the nearest integer? 10 What is 3795 to the power of 1/2, to the nearest integer? 62 What is the third root of 717617 to the nearest integer? 90 What is the tenth root of 90826 to the nearest integer? 3 What is 1282051 to the power of 1/3, to the nearest integer? 109 What is the eighth root of 189858 to the nearest integer? 5 What is 85801 to the power of 1/10, to the nearest integer? 3 What is the cube root of 3324089 to the nearest integer? 149 What is 328237 to the power of 1/6, to the nearest integer? 8 What is 20344799 to the power of 1/9, to the nearest integer? 6 What is the eighth root of 11837510 to the nearest integer? 8 What is the fifth root of 6325159 to the nearest integer? 23 What is the cube root of 506890 to the nearest integer? 80 What is the fourth root of 67283 to the nearest integer? 16 What is the square root of 520251 to the nearest integer? 721 What is the third root of 42623505 to the nearest integer? 349 What is the square root of 2160319 to the nearest integer? 1470 What is 23888566 to the power of 1/3, to the nearest integer? 288 What is the square root of 238703 to the nearest integer? 489 What is 538274 to the power of 1/2, to the nearest integer? 734 What is the fourth root of 5275738 to the nearest integer? 48 What is the square root of 336804 to the nearest integer? 580 What is the cube root of 16021204 to the nearest integer? 252 What is the square root of 500017 to the nearest integer? 707 What is the third root of 32130547 to the nearest integer? 318 What is 34422 to the power of 1/9, to the nearest integer? 3 What is the seventh root of 160568 to the nearest integer? 6 What is the ninth root of 278270 to the nearest integer? 4 What is the tenth root of 731967 to the nearest integer? 4 What is the third root of 8378157 to the nearest integer? 203 What is the square root of 198551 to the nearest integer? 446 What is the ninth root of 1933046 to the nearest integer? 5 What is the cube root of 479968 to the nearest integer? 78 What is the third root of 194748 to the nearest integer? 58 What is 2500994 to the power of 1/2, to the nearest integer? 1581 What is the cube root of 130059 to the nearest integer? 51 What is 378988 to the power of 1/2, to the nearest integer? 616 What is 285015 to the power of 1/2, to the nearest integer? 534 What is 6209096 to the power of 1/2, to the nearest integer? 2492 What is 180798 to the power of 1/3, to the nearest integer? 57 What is the eighth root of 208046 to the nearest integer? 5 What is the cube root of 17136990 to the nearest integer? 258 What is the third root of 430415 to the nearest integer? 76 What is 66258 to the power of 1/3, to the nearest integer? 40 What is the third root of 6400023 to the nearest integer? 186 What is the square root of 12425597 to the nearest integer? 3525 What is the sixth root of 139150 to the nearest integer? 7 What is the third root of 9240927 to the nearest integer? 210 What is 160107 to the power of 1/3, to the nearest integer? 54 What is 4317415 to the power of 1/2, to the nearest integer? 2078 What is 3675502 to the power of 1/4, to the nearest integer? 44 What is 2428665 to the power of 1/9, to the nearest integer? 5 What is the square root of 3672515 to the nearest integer? 1916 What is the eighth root of 22097796 to the nearest integer? 8 What is 221026 to the power of 1/2, to the nearest integer? 470 What is 8111961 to the power of 1/7, to the nearest integer? 10 What is the seventh root of 1427892 to the nearest integer? 8 What is 5980784 to the power of 1/3, to the nearest integer? 182 What is the eighth root of 218236 to the nearest integer? 5 What is the ninth root of 465597 to the nearest integer? 4 What is the square root of 53920 to the nearest integer? 232 What is the seventh root of 274783 to the nearest integer? 6 What is 9947917 to the power of 1/4, to the nearest integer? 56 What is 19143039 to the power of 1/10, to the nearest integer? 5 What is the eighth root of 104803 to the nearest integer? 4 What is the cube root of 3540871 to the nearest integer? 152 What is the third root of 2108635 to the nearest integer? 128 What is the third root of 297365 to the nearest integer? 67 What is the sixth root of 19825844 to the nearest integer? 16 What is the square root of 1479300 to the nearest integer? 1216 What is 1341763 to the power of 1/4, to the nearest integer? 34 What is 9469998 to the power of 1/2, to the nearest integer? 3077 What is 21679169 to the power of 1/9, to the nearest integer? 7 What is 379597 to the power of 1/2, to the nearest integer? 616 What is the cube root of 107808 to the nearest integer? 48 What is 787572 to the power of 1/2, to the nearest integer? 887 What is 56653 to the power of 1/7, to the nearest integer? 5 What is 27509973 to the power of 1/2, to the nearest integer? 5245 What is the square root of 61550 to the nearest integer? 248 What is the square root of 13014038 to the nearest integer? 3607 What is the third root of 827538 to the nearest integer? 94 What is 10533836 to the power of 1/10, to the nearest integer? 5 What is 320038 to the power of 1/8, to the nearest integer? 5 What is the square root of 4978843 to the nearest integer? 2231 What is the square root of 4848327 to the nearest integer? 2202 What is 469111 to the power of 1/8, to the nearest integer? 5 What is the fourth root of 17100070 to the nearest integer? 64 What is the seventh root of 533220 to the nearest integer? 7 What is the seventh root of 480553 to the nearest integer? 6 What is the third root of 2451952 to the nearest integer? 135 What is the tenth root of 5355 to the nearest integer? 2 What is the fourth root of 444754 to the nearest integer? 26 What is 2246966 to the power of 1/9, to the nearest integer? 5 What is 4125336 to the power of 1/2, to the nearest integer? 2031 What is 290029 to the power of 1/9, to the nearest integer? 4 What is the third root of 427273 to the nearest integer? 75 What is the third root of 1631105 to the nearest integer? 118 What is 173768 to the power of 1/3, to the nearest integer? 56 What is the fourth root of 154202 to the nearest integer? 20 What is the square root of 6854959 to the nearest integer? 2618 What is the third root	{ "pile_set_name": "DM Mathematics" }
2) - 3l2 - l2 + 2l*2 + (0 + 2l + 0)(3l + 2l - l) - 3 + 3 - 2l2 - l2 - 4l2 + 3l*2. 34l*2 Expand (-s + 9 + 5 - 15)(2s + 19s + 3s)(0s2 + 0s2 - s2). 24s4 + 24s*3 Expand (5y*2 - 10y*2 + 4y*2)(-7y3 - 5y - 2y2 - 6y*3 + 0y*2) + (3y*4 + 4y*4 - 5y*4)(-2y + y + 0y). 11y5 + 2y*4 + 5y*3 Expand l - l - l + (3 - 7 + 2)(-4l - 4l + 6l) - 18l - 2l + 6l + (3 + 1 - 3)(2l + 0l - l). -10l Expand 4n3 + 100n*2 - 100n*2 + (6n*2 - 2n*2 - 3n*2)(3n + 4n - 3n) + 3n*2 - 3n2 - n3. 7n3 Expand (-2a + a + 3a + 2 - 2a - 2 + (-3 - 2 + 4)(-2 - a + 2) + 4a - 4a + 2a + a + 3a + a + a + a - a)(4a + 4a - 5a). 27a*2 Expand (-2v + 0v + 3v)(26v - 26v - 23v*2) + 4v - 7v + 2v - v*2 + 1 - 2v*3. -25v3 - v2 - v + 1 Expand (2l4 - 2l*4 - 3l*5)(-17 - 60 + 3). 222l5 Expand (2u*2 + 1 - 1)(-8u - 7u + 4u)(0u - u + 5u + 3u - u - u - 2u - 2u + 3u + (3u - 2u + u)(0 - 1 + 0))(3 - 2 + 1)(3u - u - u). -88u5 Expand (d - d - 2d*2)(2 - 2 + d*2) + 10d2 - d4 + 5d2 + 2 - 23d*2. -3d*4 - 8d*2 + 2 Expand (5r*2 - 13r*2 - 11r*2)(-7 + 7 - 6r) + 2r3 - r3 - 2r3. 113r*3 Expand 5r - 18r - 34r + (0 - 2 + 3)(-2r + 4r - r) - 3r - 1 + 1. -49r Expand (27c*3 + 40c*2 - 42c*2 + 3c*3)(4c + 0c - 3c)(2 - 1 - 3). -60c4 + 4c3 Expand (122 - b2 - 60 - 61 - b + 11b3)(2 - b - 2). -11b4 + b3 + b2 - b Expand (-9 + 19 - 5 + 2r)(42r - 16r2 - 42r). -32r3 - 80r*2 Expand (0t + 0t + t - 1)(3 + 2t - 3 + (1 + 0 + 1)(-2t + 3t - 3t) + 0t + 2t - 3t + 4t + t - 3t)(368 - 785 + 310). 107t*2 - 107t Expand (-4v + 0v + 3v - 2v - 2v + 5v + (-4v + v + 2v)(1 - 2 + 3) - 24v + 11v - 6 + 11v)(2 - 1 + 0)(-6 + 4 + 3). -4v - 6 Expand 6r5 - r5 - 3r5 + 10r*5 - 4r*5 + 7r*5 + (0r - r + 2r)(-3r2 + 3r2 + r4) - 2r5 + 1 - 1 - 139r + 139r - 20r*5. -6r*5 Expand 8r*2 + 6r - 6r + (r - 2r - r)(-1 + 2r + 1) - 5r + 0r + 4r + 2 + r2. 5r2 - r + 2 Expand (s4 - 2s4 - s4)((-2 - 1 + 2)(-1 - 4 + 1) + 3 + 0 - 5 - 3 - 1 + 6 + (1 - 1 + 1)(0 + 2 + 0) - 1850 - 1861 + 3122). 1166s4 Expand (1 + 0 + 0)(0d4 - 3d*4 + 0d*4) - 8d*4 - 5d*4 + 4d*4. -12d*4 Expand (0g*2 + 0g2 - g3)(5 - 4 - 2) - 3g*3 + 6g*3 - 2g*3 + 7438 - 7438 + 86g*3 + (4g + 2g - 4g)(5g2 - g2 - 5g2) - 2g*3 - 2 + 2. 84g*3 Expand 28o*5 - 469o*5 + 954o*5 + 1219o*5 + 3o5 - o5 - 4o5 + (4o*3 - 4o*3 - 2o*3)(o*2 + 0o*2 + 0o2) + o5 + 0o5 + 0o*5. 1729o*5 Expand 0f + 5f - 6f - f + 0f - 2f - 2 + 2 - 2f + (-5f + 0f + 3f)(5 - 4 + 1) - 1 + 1 - f + 0f + 4f - 3f + (1 - 3 + 9)(f - 3 + 3). -3f Expand (0i + 2i - 3i)(3i2 + 3i*2 - 5i*2) + (-2i2 - i2 + 2i2)(34i - 15i + 19i) + 0i3 - i3 - i*3. -41i*3 Expand (-1680 + 1104 + 846 - 2a)(5 + 1 - 4). -4a + 540 Expand 3z3 - 7z*3 + 3z*3 + 1 + (-3 - 2 + 3)(13z3 - 5z*3 - 6z*3). -5z*3 + 1 Expand (-1 + 1 - w)(-1 + w + 1) + 46w - 47w*2 - 10w + 49w2. w2 + 36w Expand (2m - 2m + 2m + (-5 + 5 - 4m)(-7 + 1 + 2))((-5m + 3m + 4m)(5m3 + 0m*3 - 6m*3) + 5m*4 + 2m*4 - 3m*4 + 3m*4 + 0m4 - m4). 72m5 Expand (174m - 115m + 396m)(2 - 2m*2 - 2). -910m3 Expand (4 - v3 - 4)(1169v + 1185v - 2408v - 3) + (3 - 2v - 3)(2v3 + 4v*3 - 4v*3). 50v*4 + 3v*3 Expand -2n*5 + 5n*5 - 2n*5 + 3n*5 - 4n*5 + 0n*5 + (4n - 4n + 4n)(-4 + 4 - 2n*4) - 12n*5 - 3n*3 + 3n*3 - 14n*5 + 30n*5 - 20n*5. -24n*5 Expand (3 - 5 + 0)(-11 + 14h + 11)(-5h2 + h2 + 3h*2). 28h*3 Expand (1 + 2l - 1)(-l2 - l2 + 3l*2 + (136 + l - 136)(4 - 4 - 2l)). -2l*3 Expand ((-3 + 3 + 2)(-2 - 1 + 1) - 1 - 1 + 4 + 4328 - 2324 - 2414)(3o - 3o - o3). 412o3 Expand -s4 + 5s4 - s4 - 5s*4 + 8s*4 - 47s*4 + (2s*3 - 2s*3 + 2s*3)(-4s + 4s + s). -39s4 Expand (3x*2 - 4x*2 + 17x*2)(x - x - 2x2) - 5x + 5x + 2x*4. -30x*4 Expand (0 - 5 + 3)(2d + 3d + 5d) + 2d - 8 + 8. -18d Expand (-1 - 1 + 0)(3t + 0t - 2t) - t - 2t + t - 1 + 1 + t + 71t - 418t - 89t. -439t Expand (4 + 0 - 2)(-7 + 2 - 2)(-7 + 2 + 3)((3 - 4 - 1)(-1 - 3 + 2) - 1 + 5 - 3)(-7d*2 - 2d*2 + 4d*2). -700d*2 Expand (26b*3 - 56b*3 + 2b + 33 + 32b3)(-2b2 + 0b*2 + 5b*2). 6b*5 + 6b*3 + 99b*2 Expand 36h*5 + 17h*5 - 25h5 + (h5 - 3h5 + 0h*5)(3 - 1 - 3). 30h5 Expand (-17b - 24b3 + 17b)(0 + 0 - 12b). 288b4 Expand (19 - 24 - 8)(4h - 14h - 5h)(-1 - 3h2 + 1). -585h*3 Expand -2g*5 + 5g*5 + 21g*2 - 23g*2 + (0g*3 + 0g*3 - 3g*4)(18 - 2g - 18). 9g*5 - 2g*2 Expand (-1 - 1 + 1)(-2b + 0b + 3b) + (-39b + 0 - 13 + 41b)(0 + 0 - 2). -5b + 26 Expand (3 - 3 + m)(-4m4 + m4 + 2m*4) + 2m*5 + 0m*4 + 0m*4 + 331m + 91m5 - 331m. 92m5 Expand (2 - 2 - 1)(5h + 3h - 5h)(h*2 - 4h*2 + 4h*2 + (5h - 22h - 8h)(0 + 4h + 0)). 297h3 Expand (3 + 2k*2 + 5 - 6 + (-2 + 5 - 5)(-5k2 - k2 + 5k*2))(10 - 3 - 3). 16k2 + 8 Expand -d - 7d*5 + d + (-3d + 0 + 0)(-1 + 1 + 1)(d*4 - 5d*4 + 2d4). -d5 Expand 236p2 + 3p*5 - 266p2 - p5 + (3p + 3p - 7p)(p*4 - 2p4 - p4). 4p5 - 30p*2 Expand (-72 + 209 - 36g + 35g)(4 + 0 - 5). g - 137 Expand (-2 + 0 + 0 + (3 + 2 - 4)(5 - 2 - 1) + (5 + 1 + 0)(0 + 1 + 2))(-v2 + v2 + 4v*3). 72v*3 Expand -58t*3 - 63t*3 + 113t*5 - 112t*5 + 2t*5 + 3t*5 - 4t*5 + (0t*2 + 0t2 + t2)(-3t*2 + 2t*3 + 3t*2). 4t*5 - 121t*3 Expand (5 - 2 - 1)(-3s - 4 + 4)(3 - 3 - 1)(1532s*2 + 1 - 115s*3 - 1532s*2). -690s*4 + 6s Expand (-n*3 + 0n + 0n)(n + 18n + 6n) + n*4 + 3n*4 - 2n*4 + (3n + 2n - 3n)(2n*3 + 0n + 0n). -19n*4 Expand (-34i + 10i - 27i)(4 - 4 - 1) - 2i - 9 - i + 4. 48i - 5 Expand (-363 + 336 - 833)(-2b + 3 - 3). 1720b Expand (-3f - 3f + 5f)(-88 - 49 + 12) + 1 - f - 1 + (3f - 3f - 2f)(-4 - 2 + 4) + 1 - 1 + f + f + 2f - 2f. 130f Expand 3o - 3o + o2 + o2 - 3o2 + o2 + (3 + 0 - 2)(5o*2 + 0o*2 - 6o*2) - 13o2 - 15 + 12 - o2. -15o2 - 3 Expand (16 - 4 + 2)(0 - 9 + 3)(2s - 4 + 4)(-2s3 + s3 - s*3). 336s*4 Expand (-3o + 1 - 1)(-42 + 174 + o + 53). -3o*2 - 555o Expand -2s5 - 8s + 8s + (3s2 - s2 - s*2)(s*3 + 1 - 1) + (-2s*4 - 5s*4 - 6s*4)(-2 + 5s + 2). -66s*5 Expand (2h3 + h3 + 0h3)(66h2 - 68h*2 + 49h + 82h). -6h*5 + 393h*4 Expand (22m - 46m - 66m)(2m + m*4 - 2m) - m5 + m5 - 4m5. -94m5 Expand (f2 + f2 - 2 + f2)(54f - 30f - 56f). -96f3 + 64f Expand (3 - 1 + 6)(k2 + 8k2 - k - k2 + (k - 2k + 3k)(k - 2 + 2)). 80k*2 - 8k Expand -905i2 - 76i*5 + 905i*2 + (0i4 - i4 + 0i4)(-18 + 18 - 3i). -73i*5 Expand (-5 - 14 + 8)((4 + 1 - 3 + (2 - 3 + 0)(-5 + 1 + 3))(9 - 9 - 2l) + (-4 + 4 + 2)(l - 5l + 3l)). 88l Expand (0 - 8 - 4)(-29f - 77f + 13f). 1116f Expand 17 + 19h + 7h - 19 - h + h + h + (2h + 4 - 4)(2 - 5 + 4) - 6h + 4h + h + 2h + 2h - 2h + 0h + h + 0h - 1 + 1 + 6h - 3h + 0h + 4h. 38h - 2 Expand (5j - 4j + j)(1 - 1 - 5j*2 + 3 - 2j*2 - 3 + 3j2 + j2 - 2j2 + (j - 3j + 4j)(0j + j + 0j) + 35 - 35 + 8j2). 10j*3 Expand (0 - 4 + 5)(y*4 + 5y*5 - 9y5 + y5). -3y5 + y4 Expand (2v + 0v + v)(-1 + 1 + 24 + 0 + 2 + 0 + (4 + 1 - 7)(3 + 2 - 7))(-3 + 3 + 2v)(0 + 3 - 4). -180v2 Expand (-2j*3 - 5j*3 + 4j*3 - 1)(7 + 10j - 7 + (-3j + j + 4j)(4 - 5 - 1) + 8j - 8j + 14j). -60j*4 - 20j Expand (-7 + 2 + 3 - 11)(12l + 9l + 12l). -429l Expand (0 + 0 + 20g*2 + 3g*3)(-2g + 0g + g)(2 - 2 + 2). -6g*4 - 40g*3 Expand (-1 - 2 + 0)(-151u + 3u + 242u)(0u + 4u - u). -846u2 Expand -4l*4 + 4l4 + l5 + (1 + 2 + 4)(-5l*5 + 3l*5 + 11l*5). 64l*5 Expand (4y*2 - 23y + 23y)(-31y + 46y + 17y - y + 2y + y + (-2 + 4 + 0)(-3 + 3 - 2y))(-5 + 0 + 2). -360y*3 Expand (-6 + 6 + 4a)(-1 + 2 + 0) - 26a - 33a + 72	{ "pile_set_name": "DM Mathematics" }
or of u and q? 4 Let w(y) be the third derivative of y5/20 + y4/24 - y*3 + 3y*2. Let n be w(-5). What is the highest common divisor of n and 16? 16 Let n be (-12)/9(-3)/2. What is the highest common divisor of n and 3? 1 Let o be 24 - (1 + -4 + -2 + 2). Suppose 2z + 6 = 4z. Calculate the greatest common factor of z and o. 3 Suppose 0 = 3k - 5k + 20. Suppose 246 = 3d + 5i - 109, 0 = -3d - 3i + 345. What is the greatest common divisor of k and d? 10 Suppose 3u + 5b = 2b - 39, u + 15 = b. Let m be u/49 - (-464)/7. Calculate the highest common factor of 11 and m. 11 Let g = -5 + 4. Let x = g - -4. Suppose 6q = xq + 60. What is the highest common factor of 5 and q? 5 Let r = 16 + -11. Let i be (6 - r) + 1431. Calculate the greatest common divisor of 16 and i. 16 Suppose 3p - 74 - 25 = 0. What is the greatest common divisor of 22 and p? 11 Let b be (-1 - -4)8/(-6). Let o = -19 - -9. Let u be (-3)/(b/o + -1). Calculate the highest common factor of u and 25. 5 Let m(h) = -5h - 20. Let d be m(-12). Calculate the highest common factor of 10 and d. 10 Let l = -2 - 0. Let m be 90 + (-4 - (0 + l)). Suppose 4w - 50 + 6 = 0. What is the greatest common divisor of w and m? 11 Suppose -5q - 20 = -5t, -3 - 17 = -2t + 5q. Suppose 0l = 2m + 2l - 26, t = -2l + 8. Calculate the highest common factor of m and 72. 9 Let u = 52 - 36. Calculate the greatest common divisor of 16 and u. 16 Let d(a) = a*3 - 12a*2 + 16a - 21. Let f be d(11). Calculate the greatest common divisor of f and 17. 17 Let a = -5 + 8. Let k be 2(9/3 + a). Calculate the highest common divisor of 24 and k. 12 Let y(u) = -u2 - 3u + 6. Let c be y(-7). Let d be 4/c + (-114)/(-22). Let a = -1 - -6. What is the greatest common divisor of d and a? 5 Let x(w) = w*3 - 8w*2 + 12w + 7. Let r be x(9). Calculate the greatest common factor of 28 and r. 28 Suppose -5g + g = 0. Suppose -3d - 16 + 4 = g. Let b be 70/7(-6)/d. Calculate the greatest common factor of 45 and b. 15 Suppose -4m - 5a + 73 = 0, 2a = -5m + 8m - 26. What is the highest common divisor of 16 and m? 4 Let o be (22/(-5))/((-13)/65). What is the highest common divisor of o and 55? 11 Let n = 19 + -41. Let i = -32 + -10. Let k = n - i. What is the highest common divisor of k and 10? 10 Let t(m) = -3m + 4. Let b = 7 + -15. Let y be t(b). Let r(g) = 12g - 6. Let i be r(4). What is the greatest common factor of i and y? 14 Suppose -1 = -5r + 44. What is the greatest common factor of r and 6? 3 Let y = 5 + 15. Calculate the greatest common factor of 20 and y. 20 Suppose -p - 2i = -0p - 4, 2p = 4i + 48. Suppose 7 + 3 = 5w. Suppose 0 = wz + 29 - 113. Calculate the greatest common factor of z and p. 14 Let v be (((-360)/25)/(-6))/((-6)/(-40)). What is the greatest common divisor of v and 80? 16 Suppose 0d - 6 = -2d. Suppose 644 = -dv + 2v. Let o be v/(-10) + (-4)/10. Calculate the greatest common divisor of 16 and o. 16 Let y(w) be the second derivative of -w4/12 + 5w*3/3 - 7w*2 + 5w. Let q be y(6). Calculate the highest common factor of 90 and q. 10 Let q be 329/28 + (-2)/(-8). Calculate the greatest common factor of 84 and q. 12 Suppose 3g + 2g - 95 = 0. Let y(x) = 39x2 - 3x + 2. Let o = 6 + -4. Let p be y(o). Calculate the greatest common factor of g and p. 19 Let s be -3 - 5/((-25)/35). What is the highest common factor of 10 and s? 2 Suppose -60 = 72t - 76t. Suppose 0 = 2z - 4z + 210. What is the greatest common factor of t and z? 15 Let m(p) = 2p2 + 8p + 4. Let g be m(-6). Let t = g - 18. What is the greatest common factor of t and 4? 2 Let n(j) = 9j + 31. Let d be n(11). What is the highest common factor of d and 52? 26 Let q(s) = 4 + 3s - 2s + 2s*2 + 0s + 5s. Let n = 0 - 4. Let r be q(n). Calculate the highest common factor of r and 60. 12 Suppose 0j + 33 = -j. Let b = j + 57. Calculate the greatest common factor of b and 3. 3 Let z be (-4)/(-6) + 618/18. Let q be (4/5)/2z. Calculate the greatest common divisor of q and 21. 7 Suppose 5n + 3i - 1159 = -i, 2n = -2i + 464. Calculate the greatest common factor of 33 and n. 33 Let k = -8 - -33. Suppose 5r = f + 2r, -2r - 28 = -3f. Suppose -8 - f = -4w. What is the highest common divisor of k and w? 5 Suppose -92 = -5g - 4i, 0g + g = -3i + 25. Suppose 0 = -v - v + g. Calculate the highest common divisor of 8 and v. 8 Let c(s) = -21s - 5. Let g be c(-4). Suppose m + 24 = g. What is the greatest common divisor of 11 and m? 11 Let j be 63 - (0 + 1) - 2. What is the greatest common factor of 20 and j? 20 Let i = -31 + 43. Suppose -3f + 4v = -128, 5v = 2f - 7f + 260. Calculate the greatest common divisor of i and f. 12 Let q = -4 - -26. Calculate the greatest common divisor of 22 and q. 22 Suppose 3m = 28 - 4. Calculate the greatest common factor of m and 8. 8 Let j(c) = 2c - 2. Let s be (-1)/(-2)(0 + 4). Let r be j(s). Suppose 3h - 80 = -2h. Calculate the greatest common factor of r and h. 2 Let k(r) = -r3 - 8r*2 - 8r - 3. Let h = 1 + -8. Let f be k(h). What is the greatest common factor of 10 and f? 2 Let n = 3 + -8. Let u = n + 9. Suppose -24 = -5v - uk, -13 = -4v + 4k - k. Calculate the greatest common factor of v and 8. 4 Suppose 0 = -98x + 102x - 200. What is the greatest common factor of 200 and x? 50 Suppose 8d - 5d - 21 = 0. What is the greatest common divisor of 21 and d? 7 Let a(z) = -82z + 2. Let k be a(-1). What is the highest common divisor of 56 and k? 28 Suppose -4i - 3i = 42. Let c = i + 32. What is the greatest common divisor of c and 182? 26 Suppose -5s - 20 = -5r, -3r = -4r - 2s + 10. What is the greatest common factor of 54 and r? 6 Let k = -31 - -51. Suppose 5m + k = 5t, -t + 0 = -3m + 4. What is the greatest common factor of 64 and t? 8 Let y = -43 + 186. Calculate the greatest common divisor of 13 and y. 13 Let k = -39 + 61. Let y = -6 - -6. Let s = y + 22. Calculate the highest common factor of s and k. 22 Let f = -3 + 7. Suppose 6t = ft - 18. Let c = -1 - t. Calculate the greatest common divisor of c and 40. 8 Let v = -55 + 70. Suppose 2s = 5s + 192. Let t = s + 109. What is the greatest common factor of t and v? 15 Suppose -c + 5o = -3c, 5c - 19 = -3o. Suppose 0z = 4k + z - 50, -46 = -3k - cz. What is the greatest common divisor of k and 36? 12 Suppose -6 = -9y + 6y. Suppose 2t + yt - 60 = 0. What is the greatest common divisor of 3 and t? 3 Suppose 5c = -m + 196, 106 = 5c + 4m - 78. What is the highest common divisor of 16 and c? 8 Let m(j) = 2j2 + j + 5. Suppose -5h = -63 + 18. Let r be m(h). Calculate the highest common factor of r and 16. 16 Let n(y) = y*2 - 5y + 3. Suppose 5u + 9 + 21 = 3l, -l + 8 = -u. Let b be n(l). Suppose -112 = -bg + 2g. What is the greatest common factor of 16 and g? 16 Suppose 16x - 12x = 476. Calculate the highest common factor of 17 and x. 17 Let c(g) = g*3 + 7g*2 + 2g. Let p be c(-3). Calculate the greatest common factor of 6 and p. 6 Let n(z) = 4z2 + 2z - 2. Let o be n(-2). What is the highest common factor of o and 35? 5 Let l(c) = c*3 - 5c*2 - 6c + 6. Let m be l(7). What is the greatest common divisor of 31 and m? 31 Let u = -14 - -35. Let a(n) = n*2 + 14. Let d = 2 - 2. Let m be a(d). What is the greatest common factor of u and m? 7 Let s = 26 - -29. Calculate the highest common factor of s and 11. 11 Let t be (36/45)/(4/30). Calculate the highest common factor of t and 9. 3 Let l(v) = -3v - 2v2 - v3 + 7v - v*2 + 20 - 16. Let j be l(-4). What is the highest common factor of 8 and j? 4 Let m = -5 - -16. Calculate the highest common divisor of m and 44. 11 Suppose -27b = -23b - 140. What is the highest common divisor of 280 and b? 35 Let a be 822/24 + 1/(-4). What is the highest common factor of 17 and a? 17 Let i(c) = c + 13. Suppose 0 = 14z - 9z + 40. Let n be i(z). What is the greatest common factor of 5 and n? 5 Suppose -23 = -3f + c, -3f - 34 = -7f - 2c. Let a be 756/f - 1/(-2). Calculate the highest common factor of a and 19. 19 Suppose -2i = -4c - 112, 3i + i - 212 = -4c. What is the greatest common divisor of 6 and i? 6 Suppose -5d + 4d = 5q - 75, 2d - 45 = -3q. Calculate the greatest common factor of 105 and q. 15 Suppose -	{ "pile_set_name": "DM Mathematics" }
rt(180) + sqrt(180)1)1)*2. -12sqrt(5) + 8100 Simplify (6sqrt(42)/sqrt(2))/sqrt(3)2 - (5sqrt(28) + sqrt(7) - ((((3sqrt(63) + sqrt(63))/sqrt(9))*2 - sqrt(7)) + sqrt(7))). sqrt(7) + 112 Simplify ((2sqrt(17))*2 + 1)-5 + (sqrt(1700) + sqrt(1700) + -1 + -4)*2. -200sqrt(17) + 6480 Simplify (sqrt(1900)-24)*2 + (((sqrt(76) + -2sqrt(76))/sqrt(4))*2 - sqrt(19) - (sqrt(19) + (sqrt(190) - -1sqrt(190))/sqrt(10) + sqrt(19))). -5sqrt(19) + 121619 Simplify (sqrt(114) - -5sqrt(114)-6)/(sqrt(486) + (sqrt(486) - (2sqrt(486) + sqrt(486)) - sqrt(486) - sqrt(486) - sqrt(486)) + sqrt(486) - sqrt(486)). 29sqrt(19)/36 Simplify (3 + (sqrt(108)1 - sqrt(108)) + 5(sqrt(108) + sqrt(108) + -5))2. -2640sqrt(3) + 11284 Simplify (-2((sqrt(80) + -2 - sqrt(80)) + sqrt(80))-2)*23. -768sqrt(5) + 4032 Simplify 1 + (-2sqrt(76))*23 - (-6sqrt(95)/sqrt(5) + sqrt(228)/(sqrt(72)/sqrt(6))). 5sqrt(19) + 913 Simplify (-16(sqrt(275) + 1) + (sqrt(297)-3 - sqrt(33))/(sqrt(12)/(sqrt(4)-1)))*2. 240sqrt(11) + 4436 Simplify ((-2sqrt(114)/sqrt(3))/(sqrt(2) + sqrt(4)/(sqrt(2) - sqrt(8)/sqrt(4) - sqrt(2)) + sqrt(2)) + -5)2. 20sqrt(19) + 101 Simplify (sqrt(245)-2)2 + (-1 + sqrt(180) - sqrt(5)) + 0. 5sqrt(5) + 979 Simplify ((sqrt(114)-15 - (sqrt(114) + (sqrt(114) - (sqrt(114) - sqrt(114)-16))))/(((sqrt(180)-1)/sqrt(5))/sqrt(6)))2. 0 Simplify sqrt(10)/(sqrt(2) - -3sqrt(8)/sqrt(4)) - -4(sqrt(5) + 1)4. 16 + 65sqrt(5)/4 Simplify sqrt(98) + (sqrt(98)1 + -2 - sqrt(98))*2 - (-3sqrt(98) + -2). 6 + 28sqrt(2) Simplify 3(1 + (2sqrt(475))2 + ((sqrt(19) + 0)-6 - sqrt(2299)-1))-4. -22812 - 60sqrt(19) Simplify (sqrt(605) - (sqrt(605) + sqrt(605) + 21sqrt(605)))2 + (5sqrt(80))*2 + 5. 7450 Simplify ((sqrt(2057) + sqrt(2057) + 12sqrt(2057) + sqrt(2057) + sqrt(2057) - -3(sqrt(2057)1 + sqrt(2057)))-5)*2. 7405200 Simplify 2((sqrt(95) + 2(sqrt(95) - (sqrt(95)1 + sqrt(95) + sqrt(95) + sqrt(95))))4)/(2sqrt(720) - (sqrt(5) - sqrt(720)-2)). 40sqrt(19) Simplify (sqrt(36)/sqrt(3)5 + 1sqrt(108))/(((sqrt(84) + sqrt(84)2 - sqrt(84))/sqrt(7))/sqrt(3)). 4sqrt(3) Simplify 3 + sqrt(300) + 1 + sqrt(300) + -3 + (-2 + 1 + sqrt(300) - (-3 + (sqrt(300) - -1sqrt(300))2 + sqrt(300) + sqrt(300))). -1197 + 10sqrt(3) Simplify (5((sqrt(143) - (sqrt(143) - sqrt(143)4) - sqrt(143)) + sqrt(143)))/(-3sqrt(1331)) + -2. -20sqrt(13)/33 - 2 Simplify (sqrt(12)/sqrt(4)63 + -5 - (3 + -2-1sqrt(147)))*2. -64sqrt(3) + 112 Simplify -6-42sqrt(1088)2. 768sqrt(17) Simplify (((4 + sqrt(500))-1 + 3 + sqrt(500)-4)-2 + 3)*2. 1000sqrt(5) + 50025 Simplify (sqrt(133)/(sqrt(70)/(sqrt(40)/sqrt(4))) - (sqrt(190)2-6)/sqrt(10))*2. 3211 Simplify 2((sqrt(3) + -1(-1 + sqrt(3)))2 + sqrt(33)/sqrt(44) - (1sqrt(864))/sqrt(2)). -23sqrt(3) + 2 Simplify 0 + (3(sqrt(2700) - (sqrt(2700) + -1sqrt(2700))) + 1)2. 180sqrt(3) + 24301 Simplify ((-4sqrt(165) - sqrt(165))/sqrt(11))/(sqrt(500)1). -sqrt(3)/2 Simplify (-2-2(sqrt(153) + -1 + 1 - (sqrt(153) - 4(3sqrt(153) + sqrt(153) - sqrt(153)))))*2. 352512 Simplify (-2 + sqrt(432) + 3 + 0)-2. -24sqrt(3) - 2 Simplify (1(sqrt(7) - (sqrt(7) + -1))-2 + (sqrt(175) + 0 - sqrt(175)1))*2 + -3. 1 Simplify -2 + 4((sqrt(1008)-1)2 - sqrt(49)/sqrt(28)) + 0. -2sqrt(7) + 4030 Simplify (6(5sqrt(432) + 1))*2 + 0. 4320sqrt(3) + 388836 Simplify 3 + (4 + sqrt(833) + sqrt(833) + -2sqrt(833))2 + sqrt(17) + (sqrt(612) + -5 - sqrt(17))2 + (sqrt(119)2 + sqrt(119))/sqrt(7). -46sqrt(17) + 469 Simplify 0 + -2 + sqrt(176) + 1 + (sqrt(99)/(sqrt(9)2))*2. 7/4 + 4sqrt(11) Simplify (-2sqrt(1296) - (1sqrt(36)/sqrt(4) - sqrt(9)))/(sqrt(3) + -12sqrt(3) - sqrt(27)/sqrt(36)). 16sqrt(3) Simplify (3(3 + sqrt(75))2)2 + 4. 1080sqrt(3) + 3028 Simplify (-6((-3 + sqrt(180)1 + sqrt(180) - sqrt(180)) + (1 + sqrt(180) + sqrt(180) - sqrt(180)) + 3 + sqrt(180)))*2. 1296sqrt(5) + 58356 Simplify -4(1 + ((sqrt(220)2 - sqrt(220))/sqrt(10))/(6sqrt(2)-1)). -4 + 2sqrt(11)/3 Simplify 4 + (2 + ((sqrt(242) - 2sqrt(242)) + sqrt(242))*2)6 + 3. 19 Simplify (5(-2 + sqrt(99))2 - (sqrt(99) - ((-3 + sqrt(99))-2 + sqrt(99) - sqrt(99)))*2)-4. -192sqrt(11) + 1648 Simplify (-1 + sqrt(2448) + 0 + sqrt(2448) + (-5((sqrt(2448) - (sqrt(2448) + 0)) + sqrt(2448) + sqrt(2448)) - sqrt(2448)))*2-2 + 4. -396574 - 432sqrt(17) Simplify -2sqrt(11) + 0 - sqrt(11) - (3 + sqrt(55)/sqrt(5))*2 - (sqrt(1100) - -3(2 + sqrt(11))*2). -31sqrt(11) - 65 Simplify ((sqrt(616)/(sqrt(88)/sqrt(8)))/sqrt(8) - 6(sqrt(252) + 1 + sqrt(252)))2. 852sqrt(7) + 35323 Simplify -1((2-2sqrt(220))/(sqrt(176) - -1sqrt(176) - (sqrt(99)/(2sqrt(9)) - sqrt(11))))2. -1280/289 Simplify -3(3 + sqrt(125) + sqrt(125)-1 - (sqrt(125) + 1 - sqrt(125))-4)*2. -147 Simplify (-4((sqrt(1960) - sqrt(1960)-4) + sqrt(1960)))/(5(sqrt(8) + sqrt(8)1-6)). 168sqrt(5)/25 Simplify (4(-5 + 3 + (2 + sqrt(68) - sqrt(68)) + sqrt(68) + 3(sqrt(68)1 + sqrt(68))))*2. 53312 Simplify (0 + -1 + 1 + sqrt(162) + 2(sqrt(162) + 0) + 2(sqrt(162) + -1))2. -180sqrt(2) + 4054 Simplify ((3(2sqrt(171) - sqrt(171)))/((sqrt(9)-1 - sqrt(9))5)-4)25-5. -684 Simplify -2(((1 + sqrt(448) + -1 - sqrt(448)) + -2sqrt(448) + 2)-1 + -3)*2. -3634 + 320sqrt(7) Simplify (-1(sqrt(66) - (sqrt(66) - sqrt(66)1)))/sqrt(6) + sqrt(176) + (-4 + sqrt(176) + sqrt(176)1)2. -61sqrt(11) + 720 Simplify (sqrt(10)/sqrt(5)2 + sqrt(16)/(sqrt(8) - sqrt(72)) - (2sqrt(36) - sqrt(36))/(sqrt(4)/sqrt(2)6))2. 2 Simplify ((sqrt(931) + sqrt(931)2 + sqrt(931) + 0)-1 + -5 + ((5 + -1sqrt(931) + sqrt(931) - sqrt(931)) + sqrt(931) + sqrt(931) - sqrt(931)))*2. 14896 Simplify ((sqrt(165)1)/sqrt(5))/sqrt(3) - (5-3sqrt(110))/sqrt(10). 16sqrt(11) Simplify 2 + (-2 + (sqrt(128) - (sqrt(128) + -2 + sqrt(128))) - (((sqrt(128) - (2sqrt(128) - sqrt(128))) + -2)*2 + sqrt(128))) + -2. -16sqrt(2) - 4 Simplify ((-2(sqrt(209) - -1sqrt(209)-1))/((-2sqrt(99)/sqrt(3))/sqrt(3)))*2 + 1. 1 Simplify 5(-4 + -1sqrt(468) + -5) + 4 + 3. -30sqrt(13) - 38 Simplify (sqrt(33)/(sqrt(27)-3 - sqrt(3)) - ((-2sqrt(121))/sqrt(11) - sqrt(55)/(sqrt(15)/sqrt(3)))) + -4. -4 + 29sqrt(11)/10 Simplify (((sqrt(84) + sqrt(84)-2 + sqrt(84))-3 + sqrt(84))/sqrt(4))/((sqrt(84) + 2sqrt(84)1)/sqrt(12)). sqrt(3)/3 Simplify ((3(sqrt(6) - (sqrt(6) - 1(sqrt(96) + sqrt(6)))))/(sqrt(20)/(sqrt(40)/sqrt(16))))2-3. -2025/4 Simplify ((-4sqrt(245))/sqrt(7))/(-2sqrt(63)/sqrt(9) - sqrt(7)). 4sqrt(5)/3 Simplify ((sqrt(77) + sqrt(77)-2 - sqrt(77))2 - -52sqrt(77))/(sqrt(63)/((sqrt(9) + 2sqrt(9) + sqrt(9))5)). 120sqrt(11) Simplify -46(2 + -2sqrt(7)-3). -144sqrt(7) - 48 Simplify (((sqrt(450)-2 - sqrt(450)) + sqrt(450) - sqrt(450))/sqrt(10))/(sqrt(900)-5) + 3. 3sqrt(5)/50 + 3 Simplify 3 + (sqrt(637) + -2)*2 + 3 - (sqrt(637) + 0 + -3 + sqrt(637))-3. 14sqrt(13) + 638 Simplify (6(1sqrt(72)2 + sqrt(72) + 2 + -5 + 1))*2 + -1. -2592sqrt(2) + 23471 Simplify (4((sqrt(136) + sqrt(136) + sqrt(136)2)/sqrt(8) - sqrt(1088)-1))2. 39168 Simplify sqrt(405)11 + 3. 3 + 9sqrt(5) Simplify (3sqrt(126) + (2sqrt(98))/sqrt(7))/(sqrt(28)6 + sqrt(7) - (sqrt(77) + sqrt(77)-2 - sqrt(77))/sqrt(11)). 11sqrt(2)/15 Simplify (-2sqrt(16)/sqrt(72) + -4)*2 - ((sqrt(162) + (sqrt(162) - (sqrt(162) + (sqrt(162) - (-2sqrt(162) + sqrt(162))1))))/sqrt(9))2. -10/9 + 16sqrt(2)/3 Simplify (6((sqrt(448) - (sqrt(448) + (sqrt(448) - (1 + sqrt(448)1)))) + sqrt(448) - -6(0 + sqrt(448))))2. 4032sqrt(7) + 790308 Simplify (5sqrt(187)2 + ((sqrt(187) - 1sqrt(187)) + sqrt(187))1)/((sqrt(1331) - 1sqrt(1331) - sqrt(1331) - sqrt(1331) - sqrt(1331))4). -sqrt(17)/12 Simplify (6(sqrt(343) + -3 + (sqrt(343) + sqrt(343)-5 - sqrt(343)) + sqrt(343) + sqrt(343) + sqrt(343) + 0 + -3) + 3)*2. 2772sqrt(7) + 13437 Simplify (sqrt(8640) + -3(sqrt(8640)-2 + sqrt(8640)) + sqrt(8640) + sqrt(8640))/(sqrt(108)/(1sqrt(9))2). 36sqrt(5) Simplify (-5((sqrt(125) - (-4 + sqrt(125))-5 - sqrt(125)) + 5)-4)*2. -300000sqrt(5) + 1340000 Simplify ((-51sqrt(170))/(1sqrt(10)6))2. 425/36 Simplify 5 + ((2 + sqrt(20))2 - (sqrt(5)-1 + -2)2 - ((sqrt(50)-1)/sqrt(10) - (1 + sqrt(20))*2)) + 5. 9sqrt(5) + 46 Simplify 5*((sqrt(847) - (1 + sqrt(847)	{ "pile_set_name": "DM Mathematics" }
)(-7/6))/(((x(3/4)x)/x(2/5))/(x4/xx6)) assuming x is positive. x(13273/1980) Simplify (j(-1/9))(4/11)/((j/(j5/j))/j(-3)) assuming j is positive. j*(-4/99) Simplify (tt*(-7)tt/t(1/6))(12/11)t*(-8)t*(-1/6)t*(1/6)(t*(-1/2)t)/t assuming t is positive. t*(-287/22) Simplify (bbb(1/2))7/(b/b(-2/19)bb(bb(2/9))/b)(b/(b/(b/(b*(-1/4)bb)b)bbb))31/(b(-3)b/((b*(-5)/b)/b)b) assuming b is positive. b(-52721/684) Simplify ((a(2/5))41/(a(-1)/(aa(-6))))/((aa/(a*(-2/15)/aa))/a(-6))(1/3) assuming a is positive. a(436/45) Simplify (a(2/5)/(a/a(-1/5)))(-2/17)((a(-3))34)(-3) assuming a is positive. a(26018/85) Simplify (q(1/3)/(q/q(-1/3))q*4(q/((q*(2/7)/q)/q))/q)/(((q/(qq0))/q)(-5)/(q*(-1)q/(q((q/q5)/q)/q))) assuming q is positive. q(33/7) Simplify ((l/(l/l(-2/57)))(2/49)(l/l(1/12))(-5/13))(-2/5) assuming l is positive. l(51413/363090) Simplify ((h/(h/(h/(h/(h/(h*(-36)hh))))h))/(hhh/(h/h(3/5))))/(h(2/13)/(hh23)) assuming h is positive. h(3591/65) Simplify (((l(l/l*(2/17))/ll)/ll(2/11))/(ll*(-3/5)l(2/3)))/((l(4/7)l(-1/2))/(ll(1/3))(-19)) assuming l is positive. l(-332581/13090) Simplify ((((k(-1/17)k)/(k(-1/2)/k))(-35))34)(1/17) assuming k is positive. k(-2905/17) Simplify ((xxx(-6))/x(-3)(xxx/(xx(x*0xx)/x))(1/22))/(x(-3/7)x/x*(-3)x)2 assuming x is positive. x(-71/7) Simplify (q*(1/3)qq6)(-27)/((q/(q(-1/4)/q))(-50)/(q(-1)q)40) assuming q is positive. q(-171/2) Simplify (p/p*(9/2)p/(p/((p/(p/(pp(-2/5)))p)/p)))*34(p*(-3/5)p8)/(p(-2/5)p(5/3)) assuming p is positive. p(-1387/15) Simplify ((((p19/p)/p(-14))(2/23))(-1/35))(-29) assuming p is positive. p(1856/805) Simplify (((oo*(-2/3)oo)/o)/((o(-3)o)/o)(o(1/4))(3/17))/((oo/o*(1/4)o)*(2/159)/((oo*(5/6)o)/o(-4/5))) assuming o is positive. o(143731/18020) Simplify (((l/(l/l*(-1)l))/l(1/5))/(l5/(l/l(-1))))/((l(-4/9)l)/l(-1/10)l*(-2/17)l3) assuming l is positive. l(-13369/1530) Simplify (a(-11)/(a/(a(3/10)/a))(a/a(1/13))/a(-27))(-4/15) assuming a is positive. a(-3958/975) Simplify (zz/(z*(-2)z)z(-9))(-1/19)((z(-3))(-33))(-4/5) assuming z is positive. z(-7494/95) Simplify (z(-3)/(z/z(-2/3)))*(-1/5)z*(-3)/(z((z/(z/(z/(z*6/z)z))z)/z)/z)((zz4)/z)/zz*(2/3)z assuming z is positive. z(28/5) Simplify (k1k/(k/(kk*6k)k))/(kk(3/28))(-1/46) assuming k is positive. k(10335/1288) Simplify (y23/(y/(y*25y))y(1/17)y(-6/7))4 assuming y is positive. y(22468/119) Simplify ((t5t(4/9))/(tt*(-1)/ttt)35)/((t(-2/3))(-21)/(t(-1)/t)(12/5)) assuming t is positive. t(-2176/45) Simplify (d(2/5)/(d(4/9)/dd))/(d*7d*0)(d/d*3((d/(dd/d(-1)))/d)/d)/(d/(dd/d*(-1/2)d))(-31) assuming d is positive. d(-8149/90) Simplify (((((tt/t(7/3))/t)/(tt/t*2t))/(t/(t*(-5)/t)t(2/27)))(-13/3))(2/13) assuming t is positive. t(508/81) Simplify (((ff0f)/f)(2/33))(-2/33)/((f/(ff(1/4)))(-4/33))(-7/9) assuming f is positive. f(65/3267) Simplify (z3/z(1/23)z/(z/(zz(-7)z))zz/z*(-1/38)z)(-46) assuming z is positive. z(-859/19) Simplify ((l(-1/4))(-19)/(l*(1/3)/lllll/(ll6)))/(l(-2/17)ll*(1/4)l(lll/(ll(ll*(-3))/ll)l)/l(-6)) assuming l is positive. l(-379/102) Simplify (t2t/t*(-1/7)t)/(t(4/3)/t(-2))(t/((t/t(1/5))/t)t*3tt)(-4/3) assuming t is positive. t(-261/35) Simplify (b(-1/7)bb(-3/4)b*5b/(bb(1/6)b))/(b/(bb4)b*(-6/7)b*4b7) assuming b is positive. b(-185/84) Simplify (((rrr*23/r)/((rr/r*(-2/129))/rr))/((rr13r)/rr(-5/7)))(-1/17) assuming r is positive. r(-7855/15351) Simplify (k/k(4/3)k)/(k*(-8)kk)(k(-1))(-14/9)(k0)(2/129)k*(2/5)k/(k*9k) assuming k is positive. k*(-17/45) Simplify (kkk(5/3)/kk5)5/((kkk(-4))/(k(3/2)k))10 assuming k is positive. k(250/3) Simplify ((j/(j/(j/(jj(-2/3)))))15/(j(-8)/(j/(j(4/5)j))))/((j1jjj)39/(j/(((j/j(-2))/j)/j)j(-1)/j)) assuming j is positive. j(-704/5) Simplify ((q(-2/5)/qq)*(-1/14)(q/q4)/(q(-2/5)q))/(qq((qq((q/q6)/q)/q)/q)/qqq(-5/6))(-36) assuming q is positive. q(-1243/7) Simplify v(1/5)v*8(vv(-1/17)v)/(v/(v*7vv))((v*(1/2)v)/v(-1/5))(-10/11) assuming v is positive. v(15517/935) Simplify (n/n(-3/29)nn(-20)/n)/((n(2/87)nn)/((n/(((n/n(2/31))/n)/n))/n)) assuming n is positive. n(-53549/2697) Simplify ((g/(gg(1/18)))/(g/g(-10/9)))(-10/7)/(((g/(g(-2/11)/g))/(g(-6)g))/((g/(gg/(g/(g(1/2)g)g)))/(g5g))) assuming g is positive. g*(-4891/462) Simplify (aa/(a*(-2)/a)aa(-3/2))(-6/5)/((aa((a/(aa*(-1)))/a)/aaa)37a/(a/a*(2/9))a(aa/((a(1/3)/a)/a))/a) assuming a is positive. a(-5413/45) Simplify (d*(-11)dd/d(-1/5)d9/(d/d5))(-2/55) assuming d is positive. d(-42/275) Simplify (s(-10)/(s(-9)s))(-3/25)(s/(s(s(-6/11)/s)/s))/((s(-1/3)/s)/s)s(2/15)/(s(-1/2)/s) assuming s is positive. s*(11141/1650) Simplify (ggg14gg/g29)/(g(-3/20)/gg*(23/4)g) assuming g is positive. g(-83/5) Simplify (l0)(-1/32)/(l/l(-1/3)l6)((l/(ll(-3)/lll))/(ll*(-2/5)ll))/((ll/l*3l)/((l/(ll(-2)l))/l)) assuming l is positive. l*(-119/15) Simplify ((aaaa/(aa/a(-1/9))aaa)/((a*(-5/3)/a)/a)(a(-1/4))39)/((a(-1/2))39)(-26/5) assuming a is positive. a(-18467/180) Simplify ((s/s8)/s)(-2/5)(ss/(((s*(-4/11)s)/s)/s))/((((s(7/6)/s)/s)/s)/s) assuming s is positive. s(3101/330) Simplify (t/(tt(-5))t/(t*5t)(t/t(-1/4))(1/75))/(((tttt/((ttt*(-1/4)t)/tt)t)/t)/(t(-4)/t))(3/11) assuming t is positive. t(-557/330) Simplify (a/(a/(a(-1/2)a))(a*(-1/7)/a)/aa)/(((aaaa/(a7a)a)/a)/(a(1/8)/a))(a*14a(-3/4))(-7/8) assuming a is positive. a(-2041/224) Simplify ((p/(p2/p))/pppp(1/2)pp(-3)p/p*(-2/19)pp)/(p(-1/9)/p0)(-11/8) assuming p is positive. p(3355/1368) Simplify (vv*(-2/7)v(2/7))(-2/15)/((((vv/v(2/7))/v)/v)/(vv*(-1/2))v*(-1/5)v(-3/4)) assuming v is positive. v(673/420) Simplify (u/(uu/(uu*10))uu(-7/3)uu/u14uu(-40)/u)11 assuming u is positive. u(-1430/3) Simplify ((q(-26/5)/(q31q))/((q/(qq(-5/4)))/((((qq*(-9/7)q)/qq)/q)/q)))(-47) assuming q is positive. q(261461/140) Simplify x(-7/10)x*(4/5)/xx((x25xx)/x)38 assuming x is positive. x(9881/10) Simplify ((b(2/27)bbb(-2/53))/(b(20/9)/bb(-26)b))6 assuming b is positive. b(73880/477) Simplify ((s4)(-42)(ss*(-2/11)s)(-46))(2/55) assuming s is positive. s*(-5536/605) Simplify (g/(gg(10/11)))50/(g*32g/g*37g) assuming g is positive. g(-467/11) Simplify (l(3/4)/l(-8/5))(-33)/(((ll(-4)ll)/ll)42)(-4) assuming l is positive. l*(-4911/20) Simplify ((j/(((j/(((jjj1j)/j)/j))/j)/j))7/(j0/jj)(1/12))/(j(-6)jj/(((j5/j)/jj)/j))(-44) assuming j is positive. j(-280) Simplify (((f/(f*(2/21)ff)f(-6))/(f(-7)/(ff(-3/2))))(26/7))(11/6) assuming f is positive. f(-3575/882) Simplify (bb44/b)/b(32/5)(b/b(-12)b)/((bb9/b)/b) assuming b is positive. b(218/5) Simplify (o(3/11)oo/(o/o(-14)o)o(19/2)o(-2/49))(22/7) assuming o is positive. o(-4601/343) Simplify (((y(1/2))*12y*(-4)yyy/(((yy(4/5))/y)/yy))(2/11))10 assuming y is positive. y(84/11) Simplify ((l(-2)l)25/((l/l(1/9))/l(2/29)))(-7/5) assuming l is positive. l(47173/1305) Simplify (((n/n(-2/11)n)/n)*(-25)n5/n(-1))(-1/6) assuming n is positive. n(259/66) Simplify (((((u/(u*(-2/7)u))/u)(4/3))(-28))48)(-17/4) assuming u is positive. u(-5440) Simplify (y2y)(2/13)/(((y/(y(-6)y))/y)/(y/y*(-2)))y*(-1)y*(-6)y/(y/((y*(-4)/y)/y))yy(3/2) assuming y is positive. y(-313/26) Simplify (s(ss/(s(-6)s))/s)/s*(-4/3)(s*(1/5)s)/s*(3/4)(s*(1/16)/(s/(ss/s(-8))))/((s/s(-3/2)s)/(s/s(2/3)s)) assuming s	{ "pile_set_name": "DM Mathematics" }
be (b/(-18))/((-2)/102). Determine gq(r) + tn(r). -3r Let g(s) be the second derivative of 0s*3 + 0 - 4s + 1/4s4 + 0s*2. Suppose -7y - 4 = -8y. Let o(i) = i2. Calculate yg(f) - 9o(f). 3f*2 Let k(b) = 9b*2 + b + 2. Suppose 2d - 5m + 11 = 35, -4d + 20 = -3m. Let q = 1 + 4. Let p(y) = -4y*2 - 1. What is dk(c) + qp(c)? -2c*2 + 2c - 1 Let r(p) = 0p + 0p - p*2 + p. Let s(x) = -4 + 35 - 4x - 10 - 7 - 13. Let k(a) = -2a - 1. Let i be k(-1). What is is(z) + 2r(z)? -2z*2 - 2z + 1 Let y(t) = -1. Let i(n) = -n + 5. Let g(r) = -i(r) - y(r). Let o(v) = -5v + 16. Suppose 0 = 2j - 5j + 2h, 4h = -4j - 20. Give jo(a) - 9g(a). a + 4 Let x = -5 - -16. Let d = -10 + x. Let z(f) = 9f - 7f + f3 + d + 4 - 3. Let c(v) = -v3 + v*2 + v. What is -2c(l) + z(l)? 3l3 - 2l2 + 2 Let y(m) = m2 - 12m. Let x(r) = r + 2583 - 2583. What is 6x(b) + y(b)? b*2 - 6b Let g(r) = r + 2. Let v = -9 + 7. Let c(d) be the third derivative of 0d - 6d*2 + 0 + 1/12d*4 + 5/6d*3. What is vc(h) + 5g(h)? h Let r(s) = s - 24. Let p(d) = -121d - 37 + 237d - 114d. Let v(c) = -5p(c) + 7r(c). Let o(j) = 5j - 2j + 6 - 4j. What is -11o(l) + 4v(l)? -l + 2 Suppose -9p + 15p = 6. Let o(w) = -w + 2. Let r(b) = b + 1. Determine po(t) - r(t). -2t + 1 Let a be (-5)/120-8 - (-8)/(-6). Let w(s) = -2s - 6. Let k(v) = 1. Determine aw(u) - 5k(u). 2u + 1 Let p(w) = 1 - 2 - w*2 + 0w*2 - w. Let r(z) = -z - 8. Let f be -9 + (-2 - -4) - 2. Let y be r(f). Let o(g) = -7g*2 - 6g - 6. What is yo(h) - 6p(h)? -h2 Let k(r) = -r - 1. Let s(y) = y3 + 5y + 7. Suppose -4m - m - 5 = 0. Let h be (-42)/(-8) - (-2)/(-8). Suppose -15 = 4p + h. Calculate ms(o) + pk(o). -o3 - 2 Let q(b) = 2b*3 + b. Let p(f) = 13f*3 - 3f*2 + 6f - 4. Calculate -p(m) + 6q(m). -m3 + 3m*2 + 4 Let j(f) = -211f*2 + 137. Let l(d) = 55d*2 - 34. Calculate 6j(x) + 23l(x). -x2 + 40 Let m(z) be the third derivative of z4/2 - z3/3 - 109z*2 - 3z. Let j(o) = 48o - 9. Determine -2j(q) + 9m(q). 12q Let o(q) = -338q3 + 4q*2 - 4q. Let b(n) = -95312n3 + 1127n*2 - 1127n. Determine -4b(k) + 1127o(k). 322k3 Let b(i) be the first derivative of 2i - 5/2i2 + 5. Let h = 2 - 0. Let j(t) = -16t + 7. What is hj(z) - 7b(z)? 3z Let u(k) = -2k*2 - 2. Let r(s) = 10s*2 - 9s + 7. Let t(a) = -28a2 + 25a - 20. Let n(i) = -11r(i) - 4t(i). Let f = -5 - -8. Determine fu(y) + 2n(y). -2y2 - 2y Let c(j) = j*2 + j + 1. Let z(r) = 7r*2 - 10r - 6. Let m(x) = 10x2 - 18x - 13. Let b(y) = -3m(y) + 5z(y). What is b(a) - 4c(a)? a2 + 5 Let o = -34 - -35. Let z(i) = -i2 - i. Let r(d) = 7d*3 - 5d*2 - d. Let u(v) = -2v3 + v2. Let f(c) = r(c) + 4u(c). Determine oz(t) - f(t). t*3 Let m(w) = 254w - 122w - 3 - 128w. Let o(v) = 5v - 3. Give 6m(p) - 5o(p). -p - 3 Let y(i) = -7i*2 - 2i - 6. Let a(b) = -20b2 - 6b - 16. Give -3a(z) + 8y(z). 4z2 + 2z Let g(y) = -61y3 - y2 + 5y + 3. Let h(p) = 60p3 + 2p*2 - 6p - 4. What is -4g(j) - 3h(j)? 64j3 - 2j*2 - 2j Let a(w) = 3w2 + 6w. Let t(v) = 2v2 - 25v - 15. Let n be t(13). Let j(u) = -u*2 - 3u. Determine na(r) - 5j(r). -r*2 + 3r Let u(y) = y. Suppose 0 = 2c + 10 - 6. Let p(j) be the third derivative of j5/30 + j3/6 + 16j*2. Give cu(a) + p(a). 2a2 - 2a + 1 Let v(b) = -8b - 11. Let k(t) = 12t + 17. Let p(j) = -145j + 1010. Let c be p(7). What is ck(h) - 8v(h)? 4h + 3 Let l(q) = q. Let c(h) = 2h + 45. Let x be c(-22). Let m(n) = -n2. What is xl(r) + m(r)? -r*2 + r Let l(s) = 5s - 3. Let d(c) = -26c + 16. Determine -2d(z) - 11l(z). -3z + 1 Let b(i) = -2i3 - i2 - i + 9. Let x(y) = y3 - 9. Let m(j) = 6b(j) + 7x(j). Let d(g) = 14g*3 + 17g*2 + 17g + 26. Determine 6d(v) + 17m(v). -v*3 + 3 Let y(o) = o + 1. Suppose -p + 2 + 3 = 0. Suppose 3b - 32 = 2b. Let w(z) = 37z + 1 - bz + 4 - z2 + 3z*3. Give py(i) - w(i). -3i3 + i2 Let j(r) = -3r*3 - 4r + 2. Let i = -438 - -435. Let z(w) = -4w3 - 5w + 3. Suppose 4k + 4 = 12. Calculate ij(s) + kz(s). s3 + 2s Let x(h) = -h3 + h2 + h - 1. Let j(c) be the first derivative of c*4/4 - 2c*3 - 3c*2 + 6c - 107. What is -j(f) - 6x(f)? 5f*3 Let m(n) = -8n + 15n - 29 - 7n + 18 - 3n. Let d(s) = -2s - 11. Determine 5d(a) - 4m(a). 2a - 11 Let o(i) = i3 + 5i + 4. Let v be o(0). Let g(j) = -22j. Let s(f) = -4f. Determine vg(z) - 20s(z). -8z Let n(b) = -b2 - 3b - 3. Let v(h) = h2 - h + 2. Let j be v(2). Let d(y) = 14 - y2 + jy2 + 8y + 6y + y2. Give 3d(t) + 14n(t). -2t*2 Let g(m) = -4m - 12. Let f(l) = l. Give 3f(s) + g(s). -s - 12 Suppose 20b = 29b + 54. Let v(f) = -f. Let n(l) = 2l - 1. Give bv(p) - 2n(p). 2p + 2 Let f(x) be the first derivative of -3x*2 - 20x - 53. Let o(p) = -2p - 7. Determine 4f(n) - 11o(n). -2n - 3 Let k(y) = -3y + 6. Let r = -232 + 234. Let f(n) be the third derivative of 0 + 0n + 9nr + 5/6n*3 - 1/12n*4. Give 6f(l) - 5k(l). 3l Let k(n) = 74n2 - 8n + 1. Let p(i) = -71i2 + 6i - 1. Calculate -2k(u) - 3p(u). 65u2 - 2u + 1 Let m(a) = -76a + 4. Let j(o) = 2o + 1. What is 3j(h) - m(h)? 82h - 1 Let m(w) = -10w2 + w - 1. Let o(v) = 32v*2 - 5v + 8. Determine -3m(r) - o(r). -2r*2 + 2r - 5 Let x(v) = -v - 1. Let s be -6 - 3 - -13 - -1. Let y(i) = -i - 2. What is sx(p) - 3y(p)? -2p + 1 Let h(x) = -2x*2 - 2x - 1. Let v(z) = z*2 + 9z - 1. Let f(a) = -2a2 - 13a + 1. Let l(m) = -3f(m) - 4v(m). Calculate 5h(r) + 4l(r). -2r2 + 2r - 1 Let h(d) = d*2 + d + 1. Let s(b) = 5b*2 + 2b + 3. Let v(n) = -n*3 + 7n*2 + 9n - 7. Let g = -58 + 66. Let a be v(g). What is as(u) - 3h(u)? 2u2 - u Let t(d) = 13d*3 + 14d*2 + 199d - 16. Let q(s) = -8s3 - 9s*2 - 133s + 10. What is 8q(n) + 5t(n)? n*3 - 2n*2 - 69n Let h(p) = -605 - 615 + 1214 - 3p. Let k(d) = -1. Let j = -1 - 0. Let v be (-2)/(j/(2/(-4))). Calculate vh(q) + 4k(q). 3q + 2 Let j(t) = t + 1. Let f be ((-33)/2)/(-11) + (-21)/(-14). Let s(m) = 5m + 8. Determine fs(a) - 24j(a). -9a Let l(u) = -2u2 + 51u. Let z(k) = -25k - 140k*2 + 69k*2 + 72k*2. Calculate -2l(o) - 5z(o). -o2 + 23o Let t(w) = -w3 + w2 + 3. Let n = -15 + 26. Let k(v) = -115 - 113 + 3v2 + 236 - 3v*3. Give nt(c) - 4k(c). c3 - c2 + 1 Let c(b) = -225b*2 - 13b - 15. Let t(a) = 112a2 + 6a + 7. Give -6c(h) - 13t(h). -106h2 - 1 Let u(p) = -62p*2 + 26. Let v be 0/38 - 3-2. Let c(t) = -7t2 + 3. Determine vu(q) - 52c(q). -8q*2 Let u(s) = s. Let q(y) be the third derivative of -11y4/24 + y3/3 - 2y2 + 29y. What is -q(z) - 4u(z)? 7z - 2 Let t(j) = 212 - 218 - 2j - 3j. Let o(d) = 1. Calculate 6o(u) + t(u). -5u Let s(k) = 8k2 + 4k + 5. Let q(o) = 1. Give 5q(v) - s(v). -8v*2 - 4v Let u(j) be the first derivative of 5j2/2 - 263. Let h(q) = 81q. Determine 2h(n) - 33u(n). -3n Let v(y) = y2 + 1. Let g(a) be the second derivative of a5/20 - a4/4 + a3/6 - 3a*2/2 - 123a. What is -2g(f) - 6v(f)? -2f3 - 2f Let m(c) = -2c2 + 2c + 2. Let k be m(2). Let u(q) = -4q - 1. Let b(a) be the second derivative of 3a*3/2 + 3a*2/2 - 197a. Calculate kb(l) - 5u(l). 2l - 1 Suppose -o - v = -8, -17o + 20o - 5v - 40 = 0. Let n(k) = -5k3 - 2k. Let r(x) = -10x3 - 5x. Give on(t) - 4r(t). -10t3 Let h(o) = 3o*2 - o + 3. Let c(i) = 4i*2 - i + 3. Let m(v) = -2c(v) + 3h(v). Let r(b) = 2. Suppose 2q = -2q + 8. What is qm(k) - 3r(k)? 2k*2 - 2k Suppose 32i = 157 - 93. Suppose 0 = -4t + 38 + 2. Let w(j) = -j + 1. Let y(o) = o3 - o2 + 5o - 5. What is iy(d) + tw(d)? 2d*3 - 2d*2 Let h(z) = 5z + 25. Let n(o) = 11o + 51. Give 5h(f) - 2n(f). 3f + 23 Suppose -11 = 12p + 61. Let c(i) be the second derivative of i5/5 + 3i2/2 + i. Let f(j) = j3 + 1. What is pf(d) + c(d)? -2d3 - 3 Let u(f) be the second derivative of f4/6 - f3/2 - f2 + f. Suppose 50w - 24 = 58w. Let i(z) = -z. Give wi(a) + u(a). 2a*2 - 2 Let m(f) = -695301f*2 - 8168f + 2042. Let z(p) = -1021p2 - 12p + 3. What is -3m(a) + 2042z(a)? 1021a2 Let x(i) = -4i*2 - 11i - 133. L	{ "pile_set_name": "DM Mathematics" }
01212212 (base 3) to base 7. -21115616 What is -1403424 (base 5) in base 11? -1a553 -100101001100100111010001 (base 2) to base 10 -9750993 What is -101011101101101110011111 (base 2) in base 14? -17442ab What is -4b05 (base 16) in base 11? -1347a What is 21034522 (base 8) in base 3? 22102011020010 Convert -4ad0e (base 16) to base 13. -a963a Convert 1121042224 (base 5) to base 6. 125551235 -348b8 (base 12) to base 5 -4223122 Convert 116642555 (base 7) to base 16. 710057 What is 2104064 (base 8) in base 13? 167680 Convert 2001111121221 (base 3) to base 15. 168a84 -8790 (base 10) to base 4 -2021112 What is 4362102 (base 7) in base 3? 1000020110210 -3221131 (base 5) to base 2 -1101010100001101 What is 18872 (base 12) in base 11? 24994 785864 (base 9) to base 7 3665536 Convert -33b0b (base 14) to base 7. -1032214 -41228 (base 16) to base 8 -1011050 32014314 (base 5) to base 13 945b9 Convert -75181 (base 10) to base 9. -124114 -1111230121 (base 4) to base 6 -11305001 Convert 52d46a (base 14) to base 10. 2802502 34214141 (base 6) to base 11 653588 -376b709 (base 12) to base 10 -10844217 10001101111100010101 (base 2) to base 16 8df15 -220001200 (base 3) to base 4 -10102011 What is 20230130 (base 5) in base 13? 59ab4 12899 (base 10) to base 8 31143 121665130 (base 7) to base 12 2689121 Convert -271235 (base 9) to base 13. -5a104 What is -120527 (base 8) in base 12? -1ba9b -354652 (base 9) to base 7 -1546106 -7335b2 (base 12) to base 2 -110111001111010010110 What is -1036d (base 16) in base 3? -10101002202 Convert 2888020 (base 9) to base 14. 2d6a96 Convert -5486b1 (base 12) to base 13. -37ca50 Convert 110022021 (base 5) to base 2. 1110010110011110101 What is 2452230 (base 7) in base 6? 10431520 -782182 (base 9) to base 7 -3654545 Convert 41556 (base 9) to base 8. 65445 What is 2b245 (base 12) in base 11? 41772 Convert -7df4c6 (base 16) to base 7. -130110033 Convert ee523 (base 16) to base 5. 222214123 -1015151 (base 6) to base 4 -23333023 2734422 (base 8) to base 16 bb912 Convert -2341735 (base 8) to base 13. -1953a1 11057750 (base 8) to base 12 96b660 Convert -10100001111111011101000 (base 2) to base 9. -10880348 -42656505 (base 7) to base 10 -3644625 What is 2c8c4 (base 16) in base 9? 307262 What is -49eba9 (base 15) in base 6? -203534453 Convert -4230021231 (base 5) to base 6. -513125342 Convert -1896525 (base 11) to base 4. -30031111210 -133a22 (base 11) to base 3 -101200100020 Convert -21002021211 (base 3) to base 13. -4b61c -242575 (base 8) to base 9 -136263 -c7f741 (base 16) to base 2 -110001111111011101000001 -785614 (base 9) to base 14 -c33b9 Convert 77b59 (base 13) to base 5. 23422424 Convert -14a980 (base 15) to base 12. -4014b6 Convert 27b6e (base 15) to base 2. 11111000111011110 What is -12465636 (base 7) in base 4? -10112323233 b2744a (base 12) to base 16 2a97ba What is -206147 (base 9) in base 3? -20020011121 76413 (base 13) to base 16 34329 -1e8e4f (base 16) to base 13 -551624 Convert -462576 (base 8) to base 10. -157054 Convert 333012223 (base 4) to base 9. 433504 -122231333210 (base 4) to base 12 -2419398 Convert a325b (base 15) to base 10. 516911 Convert -1c960 (base 13) to base 7. -323536 -726230 (base 8) to base 13 -857a6 71b42 (base 13) to base 10 204037 -2011221202021 (base 3) to base 10 -1160386 64265543 (base 7) to base 10 5461865 58574 (base 14) to base 3 101221002012 Convert -2301330323 (base 4) to base 16. -b1f3b Convert -12010022022 (base 3) to base 15. -1ed1b 65360 (base 7) to base 2 11111110110110 Convert 1241302 (base 5) to base 7. 131440 What is -1212110002 (base 3) in base 11? -256a3 -911c18 (base 14) to base 7 -56340631 Convert bb5494 (base 12) to base 4. 23112031300 Convert 44547 (base 13) to base 7. 1024221 Convert a091b6 (base 13) to base 11. 211a746 What is 1072656 (base 8) in base 6? 10133034 What is 1da95 (base 15) in base 3? 11220220112 -15503326 (base 7) to base 6 -52030351 Convert 2314222212 (base 5) to base 4. 103330000331 -165367 (base 8) to base 7 -340240 -1001110001100010100 (base 2) to base 5 -40222101 Convert -231102303021 (base 4) to base 13. -25c9539 Convert -7766017 (base 10) to base 13. -17bba9c What is 7bb332 (base 15) in base 16? 5a2f4b What is -5a3db (base 15) in base 8? -1062014 What is 774113 (base 8) in base 9? 435788 What is 311343 (base 14) in base 7? 20032613 Convert 3c2bb0 (base 14) to base 7. 23461510 What is 2199a74 (base 13) in base 15? d87d63 Convert 407755 (base 10) to base 2. 1100011100011001011 Convert -10011001001101110001 (base 2) to base 12. -263215 Convert -5346833 (base 9) to base 11. -1688005 4397a36 (base 11) to base 8 35325764 -1133251 (base 6) to base 9 -100024 Convert -132112202 (base 4) to base 7. -1025312 -14334455 (base 9) to base 7 -114265343 2101010011 (base 3) to base 2 1011011010010101 Convert 50865 (base 9) to base 16. 82e8 101000110111100100001 (base 2) to base 10 1339169 Convert -181940 (base 14) to base 9. -1534528 Convert 100300120 (base 4) to base 11. 47623 114221 (base 9) to base 15 15557 What is 3020033323 (base 4) in base 15? 113064 What is -1ab9a (base 14) in base 2? -10000101000110100 What is 150073 (base 11) in base 15? 49676 Convert -101010110101100101100101 (base 2) to base 13. -24323cb Convert -11111100011011000010 (base 2) to base 15. -156532 130302331 (base 4) to base 15 24e34 Convert 1161766 (base 8) to base 4. 1032033312 What is -3c059a (base 13) in base 5? -333120313 Convert 9aa3c (base 13) to base 10. 280760 What is 670135 (base 15) in base 16? 4aef34 Convert 205118 (base 9) to base 10. 121841 Convert 232648 (base 10) to base 6. 4553024 11188885 (base 9) to base 3 101012222222212 What is -1a5139 (base 11) in base 12? -131a5b 78c6b6 (base 14) to base 4 33222201320 What is -344011 (base 9) in base 15? -411e7 Convert 12020002200 (base 3) to base 8. 310715 What is 23000320 (base 5) in base 11? 129747 Convert 11a9271 (base 11) to base 7. 23530101 -c7b5c (base 15) to base 9 -1165226 232731 (base 11) to base 13 cc2a4 4031766 (base 11) to base 6 412512241 What is -1466564 (base 7) in base 8? -611640 3824a (base 12) to base 15 1796d -23050530 (base 6) to base 7 -6001551 101111201002022 (base 3) to base 11 3174548 -cb64 (base 16) to base 5 -3131233 Convert 378a7 (base 14) to base 13. 49c99 What is -14114451 (base 7) in base 14? -2632d1 What is 1000111000100110110 (base 2) in base 13? a2684 Convert -2124401 (base 5) to base 15. -ab01 Convert -2dc797 (base 14) to base 16. -188f11 What is 39dd29 (base 14) in base 15? 296c9d 141047 (base 9) to base 2 10101000000110001 What is c63a8 (base 13) in base 12? 152413 140125 (base 6) to base 5 404023 1024162 (base 10) to base 16 fa0a2 Convert -401918 (base 10) to base 5. -100330133 Convert 731341 (base 9) to base 15. 8890a Convert 8982488 (base 10) to base 9. 17810582 What is 2ef66 (base 16) in base 10? 192358 Convert 218996 (base 12) to base 5. 114034014 Convert -12d54 (base 15) to base 10. -60379 -1516412 (base 7) to base 4 -302120030 What is 86a3a7 (base 11) in base 15? 1c6ce9 What is -110110011001000111001 (base 2) in base 13? -4a5343 Convert -154590 (base 10) to base 9. -255046 What is 3004415 (base 8) in base 14? 167633 What is 49698 (base 12) in base 16? 18494 2b00336 (base 12) to base 2 100001001110010111011010 Convert 14114132 (base 6) to base 10. 476552 Convert -2a7b0a (base 13) to base 14. -1d2dc8 Convert 12455311 (base 9) to base 16. 5d5d5e Convert 84843 (base 11) to base 5. 12422332 What is -3409 (base 14) in base 13? -4153 What is 391b3 (base 13) in base 15? 21516 110110110000111101 (base 2) to base 9 371631 Convert -144504011 (base 6) to base 15. -3eb7aa What is 301020111 (base 4) in base 8? 611025 13335314 (base 6) to base 15 8cc7d What is -1210122202110 (base 3) in base 11? -5a4613 Convert -102122214 (base 6) to base 8. -6634002 What is -30033303 (base 5) in base 13? -8397c Convert 11311136 (base 8) to base 14. 4814aa Convert 436320 (base 7) to base 14. 1dd10 -11000122000012 (base 3) to base 9 -4018005 8c18c (base 13) to base 2 111110010010100001 What is -545357 (base 9) in base 4? -1033130311 Convert -101230312 (base 5) to base 6. -12514441 What is -2313650 (base 7) in base 12? -11b632 -13112100300 (base 4) to base 2 -111010110010000110000 Convert 143233442 (base 5) to base 9. 1375563 1001010001	{ "pile_set_name": "DM Mathematics" }
11f + 28 + 7f - f*2 - 16f - 27 in the form vf2 + hf + c and give h. 2 Express 129x2 - 4x - 119 + 9x - 6x + 117 as j + bx + wx*2 and give w. 129 Rearrange (l - 2l - l)(-5l + 4l + 4l) + 174 - 16l2 - 174 + 0l + 2l2 + 0l to pl + q + kl*2 and give k. -20 Express -1 - 16m*3 + 1 - 30m*2 + 31m*2 - 2 as v + cm*3 + dm*2 + am and give a. 0 Rearrange 3m4 + 22m*3 - 275m*2 - 23m*3 + 2 + 274m*2 to qm*4 + wm + bm3 + c + km2 and give w. 0 Express -d4 - 16d3 - 19d*2 + 14d*3 - 15d*3 + 5d*2 - 5 + 13d*2 as td*2 + rd*4 + hd + bd3 + u and give r. -1 Rearrange (-3294 + 3294 - 46a*2)((1 - 4 + 0)(-4a + 3a + 2a) + (-2 - 2 + 2)(-a - a + a)) to the form f + sa + da3 + ua*2 and give d. 46 Rearrange (w + 0w - 3w)(68235 - 31275 - 33972) to the form gw + n and give g. -5976 Rearrange (2a - 3a + 7a)(-2 + 1 - 3) + (-2 - 2 + 3)(-a + a - a) + 3a - 5a + 4a to x + ja and give j. -21 Rearrange -17x3 + 18x*3 + 8 + 117x + x*2 - 121x to l + ox2 + wx + dx3 and give d. 1 Express (-3q*2 + 5q - 5q)(-5 + 1 + 3 + (-6 + 0 + 1)(-1 + 0 + 3) - 1 - 3 - 1) as nq + y + oq2 and give o. 48 Express 153 + 152 - 7i - 295 as n + bi and give n. 10 Express -56o*2 + 52o*2 + 31 + 0o + o - 7 - o*3 in the form t + jo + wo2 + vo*3 and give t. 24 Express -34z - 5z2 - 29z + 0z2 + 67z as dz2 + v + yz and give y. 4 Express -5 + 0q - 2 + 5 - 7q*3 - 10q in the form v + yq3 + bq*2 + pq and give v. -2 Express 0m3 + 5 - 18 + 13 - 5m*3 - 7m*2 in the form q + hm*3 + ym + pm2 and give h. -5 Express -4b + 14b2 - 7 + 4 + 3 + 0 as nb*2 + vb + p and give n. 14 Rearrange ((-3 + 0 + 1)(-4 + 4 + 2) - 2 + 2 - 3)(-288f - 78f + 7f) to the form tf + v and give t. 2513 Rearrange h + 4h3 + 1 - 3 + 4h*3 + 0h*3 to yh*3 + lh + rh2 + d and give l. 1 Rearrange (-2r + 2r - r)(0 + 0 - 6) - 44 - 3r + 44 + (4r + r - 4r)(-4 - 1 + 3) to the form u + kr and give u. 0 Express -53q - q + 322q in the form u + fq and give f. 268 Rearrange 88 - 152 - v - 129 to yv + f and give y. -1 Express 532f - 32506 + 32506 as k + vf and give v. 532 Express (1 + 3 + 1)(2v - 3v - v) + (-2 + 0 + 4)(-v - v + 0v) as zv + y and give z. -14 Rearrange 141z*2 - 4z*4 - 143z*2 + 5 + 3z - 4 to fz3 + uz + b + dz4 + vz*2 and give d. -4 Rearrange (-3 + 0 + 4)(272j2 + 113j*2 + 18j*2) + (-2j + 1 - 1)(j - 1 + 1) - j + j - 2j*2 - 2j*2 + 6j*2 - 2j*2 to f + cj + oj2 and give o. 401 Express 29w - 2 - 29w - 54w as y + nw and give n. -54 Rearrange (-10 + 3s + 14 - 5)(-86s + 86s + 6s*2)(-2s + s + 4s) to the form g + js4 + us*3 + ws + fs2 and give g. 0 Express -10 + 45 - 20 + 2f - 19 in the form yf + c and give y. 2 Express 22 - 2 - 4 - 7 - 6 + 83p as ap + i and give i. 3 Rearrange 6k*2 + 6k*4 - 6k*2 + (4k*3 - 544 + 544 - 26k*2)(2k - 3k - k) to rk + yk*3 + fk*4 + m + ak*2 and give y. 52 Rearrange -98 + 206 - 21l - 106 - 25l to cl + a and give c. -46 Express d*2 - 8d*2 + 2d*2 - d - 2d*2 + d + (-2d - 2d + 3d)(-d + 1 - 1) + 16d*2 + 10d*2 - 58d*2 as yd*2 + od + c and give y. -38 Express (2o + 0o - o)(-1626o - 123o3 + 1626o) + o*4 - 4o*2 + 4o2 + o4 + 0o + 0o in the form fo + io*4 + y + po*3 + so*2 and give i. -121 Express 44h + 13h - 1 - 3 in the form m + rh and give m. -4 Rearrange -3u2 - 2u - 2 + u + 5u2 + (11u - 30u + 5u)(u - 6u + 0u) to the form du + bu2 + l and give b. 72 Rearrange (-8 + 20 + 18)(0p + 0p + 3p)(1 - 2 - 6) to the form tp + c and give t. -630 Express (-2p*2 + 0p*2 + 3p*2)(-p - 1 + 1) + (1 + 2 - 1)(-4p*3 + 4p*3 + 3p*3) - 3 + 6p*3 + 3 in the form np*2 + sp*3 + qp + h and give s. 11 Rearrange (-3 + 3 - 2 + (-4 + 0 + 2)(-4 + 3 + 0) + 1 + 3 - 3)(-2 - 3 + 4)(-497s + 236s + 236s) to the form is + j and give i. 25 Rearrange 0j - 10 - 176j2 + j - 1 + 3j - 3j3 + 182j*2 to n + tj*3 + kj + lj2 and give n. -11 Rearrange (2 - 2 - 2j)((0j - j + 2j)(-30 - 9 + 106) + 0 + 2j + 0) to the form gj + h + oj2 and give o. -138 Rearrange (-4f - 7 - 9f - 8)(-15 + 15 - 10f) to the form if + rf2 + m and give r. 130 Express (-g - 3g + 2g)(-2 + 2 - 1) + 102 - g - 5 - 8 in the form dg + y and give d. 1 Rearrange (145 + 132 - 48)(6 - 3 - 1)(-3z*2 - 15 + 13 + 0z*2) to the form h + kz + qz2 and give q. -1374 Express 3330p*2 - 4p - p*3 - 1661p*2 - 1666p*2 in the form rp + a + jp2 + qp*3 and give r. -4 Rearrange -20 - 6z*2 + 40 - 29 to the form d + pz*2 + qz and give p. -6 Express (1 - 6 + 2)(32 - 36m - 32)(17m + 36 - 36) in the form q + um2 + am and give u. 1836 Rearrange 2k + 49 - 3k - 3k2 + 2k*4 + 2k*3 - 53 to the form mk*2 + wk*3 + nk + sk4 + b and give w. 2 Rearrange -35d - 37d + 26d - 35d + 5d to z + xd and give x. -76 Rearrange (0a - 5a + 4a)(-2 + 8 - 2) - 6 + 4 - 3a + 3 + (-2 + 1 - 1)(-5a - 5a + 2a) to the form r + ua and give u. 9 Express 10 + 6 + 11 - 60r - 28 in the form nr + u and give n. -60 Express -12r - 13r + 43 + 15r + 17r in the form hr + f and give f. 43 Express 0j2 + 338j4 - 12 + j2 - 2j3 + 0 - 335j*4 + 3j - j as sj3 + c + dj*2 + uj + xj4 and give x. 3 Rearrange (194 - 327 + 307)(1 - 3 - 1 - i) - 2i + 3i + 0i to the form m + vi and give v. -173 Express (0b - b + 2b)(1 - 2 - 2 + (0 + 1 + 1)(0 + 3 + 0) - 3 + 3 + 2)(3 + 1 - 2) in the form ib + m and give i. 10 Express (2 - 355i - 124i + 57i)(2i2 - 2i + 2i - 2) as bi*3 + wi + v + li2 and give w. 844 Express -6m*2 + 4m2 - m2 + 5 - 5 + 2m2 + (3 + 1 - 1)(0m - m + 3m)(3m - 4m + 2m) as y + qm2 + im and give q. 5 Express ((-2 + 0 + 3)(-5a + 3a + 0a) - 2a + a - 3a - 3 + 3 - 3a + 3a - 2a + a)(4 - 1 + 3) as ya + m and give y. -42 Express 0 - 7y + 1 + 4y3 - y3 - 2y*3 - 6y - y*2 in the form by*2 + ly*3 + jy + m and give l. 1 Rearrange (141 + 106 + 35)(-3h3 - h3 + h*3)(0h - h - h) to jh*2 + oh*3 + ph*4 + f + th and give p. 1692 Rearrange -32d + 0d - 2 + 109d3 + 32d to the form vd + md*2 + l + wd*3 and give l. -2 Rearrange 11 - 4c - 373c2 + 4c - 11 to w + oc + zc*2 and give z. -373 Express (0 + 0 + 1)(73 + 3w + 69 - 146) in the form y + fw and give f. 3 Rearrange -25f - 11f*2 - 39f + 2 + f*3 + 66f to the form of2 + v + if*3 + cf and give i. 1 Rearrange (-2s + 2s - s*3)(-3s + 3s - s)(-41 + 8 + 87) to d + zs*2 + is*3 + us + as4 and give a. 54 Rearrange 260f*2 - 38f + 131f - 258f*2 to the form hf + y + rf2 and give r. 2 Rearrange 25p - 54p + 29p + 105p2 + 509p*2 to the form r + lp + gp2 and give g. 614 Rearrange -391 + 133 + 128 + 474u*2 + 131 to the form qu*2 + t + mu and give t. 1 Express 17 - 27k - 11k2 + k4 - 4k4 - 20 + 29k + 0k4 in the form yk*2 + fk*3 + d + ck + xk4 and give d. -3 Rearrange -5 - 197f4 - f3 - 12f - 188f*4 + 382f*4 to of + qf3 + d + nf*4 + kf*2 and give d. -5 Rearrange (0 + 2 + 0 + 1 + 4 - 3 + (-3 + 2 + 0)(2 - 3 - 1) + 8 + 5 - 1)(p + 1 - 1)(150 - 131 - 99) to the form fp + z and give f. -1440 Rearrange 2n*3 + 7n + 0 - 9n4 + 2 + 6n4 - n4 + 12n to the form wn*3 + u + pn*2 + rn*4 + fn and give u. 2 Express 38 + 39 - 66b - 82 + (-1 + 5 - 2)(2b - 4b + 3b) as wb + m and give m. -5 Express f3 + 4 + f4 + 5f3 + 2 - 5 - 28f + 26f in the form af*3 + rf*4 + nf + z + kf2 and give a. 6 Rearrange -2 + 11 - 44u + 38u to w + zu and give w. 9 Rearrange ((-2 + 3 + 1)(0 - 2 + 9) - 1 - 1 + 1)(-5w - 39 + 39) to the form r + dw and give d. -65 Rearrange -16y3 + 137y - 28y3 - 19y*3 - 23y*3 + 93y*3 to gy + my2 + ay*3 + o and give a. 7 Express 6351 + 8r*3 - 6351 + 6r in the form jr + b + wr*3 + pr*2 and give j. 6 Rearrange (-2o - 2o + 3o)(-37o*2 + 99o + 58o2 - 20o*2) to co*3 + io*2 + t + ro and give c. -1 Rearrange -270 + 270 + 1522t - 249t to dt + w and give d. 1273 Rearrange -309 + 309 + 9a - 222a to la + i a	{ "pile_set_name": "DM Mathematics" }
9571/1122) Simplify (r*3r*(-1/6)rr(1/5)/(r(-5)/r))(3/8) assuming r is positive. r(301/80) Simplify (r/((r(-3)/r)/r)(r*(-2/3)/r)/r(r2)11)(-17/2) assuming r is positive. r(-646/3) Simplify ((y*(-1/5)/(yy(4/7)))(7/2))(-15) assuming y is positive. y93 Simplify h(h/((h15h)/h)h)/hhhhh(-3)h(h(-8))(-1/19) assuming h is positive. h(-220/19) Simplify ((jj/(jjj/j*0)(jjj*0j)/j)25)(1/3) assuming j is positive. j*(25/3) Simplify (b/((b/(bb*(-2/29)b))/b))/bbb*6bb(1/3)bb(-6) assuming b is positive. b(458/87) Simplify (jj*(-2/89)/jj24)(-21) assuming j is positive. j(-44814/89) Simplify ((y/(y/y(-1/12)y))/y(3/4))45 assuming y is positive. y(-165/2) Simplify ((b29)(2/11))(-14) assuming b is positive. b(-812/11) Simplify ((bb*(5/4)(b((bb*(-2/5)b)/b)/b)/b)(-10/11))(8/15) assuming b is positive. b(-148/165) Simplify (d(-1/2))*40/(d/((d/(dd*1d))/d)dd*(-1)d) assuming d is positive. d(-25) Simplify y(1/10)y(6/11)(y/y(-3/8))/y(1/7) assuming y is positive. y*(5783/3080) Simplify (((((nn(-6))/n)/n)/n(3/5))/(n*0/(nn/n*(-5)n)))(-5/11) assuming n is positive. n(-2/11) Simplify ((d*(-4)d*(-4)d)/((d/((d((d/(d(-5)/d))/d)/dd)/d))/d(2/25)))(-2/9) assuming d is positive. d(32/75) Simplify (v3v)(2/45)/(vv/v*(-8)vvvv(5/6)) assuming v is positive. v(-1229/90) Simplify ((bb(-2))(-23)/((bbb/b(-4))/b(2/19)))(-22) assuming b is positive. b(-6732/19) Simplify n(-11)/(n(-2/3)n)n/((n/(n((n(-9)/n)/n)/n))/n)nn(-2) assuming n is positive. n(-67/3) Simplify d(1/2)/(d/(d(d/d*(-20))/d))(d((d/d(-5/3)dd)/d)/ddddd)(-3/29) assuming d is positive. d(1143/58) Simplify y(-8)/((yy/(yy(-3)))/y)(((((y/y*2)/y)/yy)/y)/y)(-5/7) assuming y is positive. y(-57/7) Simplify (p(-3))(2/107)/(p*14/ppp/p(-2/9)) assuming p is positive. p(-14713/963) Simplify (l((lllllll11)/l)/l)/((l/(l/l(2/3)))/l)l4l(-8) assuming l is positive. l(37/3) Simplify ((oo(-1/5)o)/o(-2/13))/(o9/(oo(-11))) assuming o is positive. o(-1108/65) Simplify (rr*(-4)rr(2/13)r)/((r/r(-2/33))/r(-5/4)) assuming r is positive. r(-5417/1716) Simplify ((p(-23)/p)/p(-10/3))(2/199) assuming p is positive. p(-124/597) Simplify (w(3/4))*22(w/w4)/w(-3/8) assuming w is positive. w(111/8) Simplify (j(1/3)j)(-5)jj(-11)j8 assuming j is positive. j(-26/3) Simplify (aa9aa)(1/24)a(-16/3)/(a(-2/11)a) assuming a is positive. a(-373/66) Simplify (w(-2/19)ww14)/(w(-1/7)/w(-4)) assuming w is positive. w(1468/133) Simplify ((mm(3/2))/m(3/14))/(m/m(-2))37 assuming m is positive. m(-761/7) Simplify h(-11)h0hh(-7)hh/(h(8/5)/h) assuming h is positive. h(-78/5) Simplify i/i(2/9)i(i(ii(-2/25))/iii)/i((i/i*1i)/i)/i(-4/11) assuming i is positive. i(10052/2475) Simplify t18/t(-9/4)(tt*34t)/(t(-2/3)/t) assuming t is positive. t(695/12) Simplify (j/(j*(-15)jj))(-12)(j/(j/(j(-2/19)/j)))(1/57) assuming j is positive. j*(-60655/361) Simplify (j/((jj*(13/2)j)/j)j)/(j/(j/(j/j(-1/2)j)))(j(1/10)j)/(j/(j*10/j)jj) assuming j is positive. j(-9/10) Simplify (nnnn*6nn/((n(-1/4)n)/n)n((((n*(-1)n)/n)/n)/n)/nn(-1/5))(-2/95) assuming n is positive. n(-161/950) Simplify (((h(1/5)h)/h(1/10))10)33 assuming h is positive. h363 Simplify (jj19j*(-12/7))/(((j(jj(2/35))/j)/j)/(j23/jj)) assuming j is positive. j*(1443/35) Simplify ((pp*(-4/5)pp)/p)(-49)p*(-32)p10 assuming p is positive. p(-404/5) Simplify ((m/(m/(m*(-6)/mmm)))(2/7))(-43) assuming m is positive. m(430/7) Simplify (((d/(d/(d/d13))d)/d)/d*(1/8))/((ddd(-4/13))/(d/(d/(d/(dd*12/dd))))) assuming d is positive. d(-2685/104) Simplify (c(-5/6)/c)/c*(-2/13)c21/c12 assuming c is positive. c(571/78) Simplify s(-2/5)ss*26sss*(-23)ss/(ss20) assuming s is positive. s(-67/5) Simplify s16/((s/s14)/s)s2s/(ssss/s(1/9)) assuming s is positive. s(262/9) Simplify k(-9)/k39k*37kkk*(-10/11)k assuming k is positive. k*(-98/11) Simplify ((lll(-2/11)l)/l)*(5/2)l*(-1)/(l/((ll(4/5))/l)) assuming l is positive. l(184/55) Simplify (a/a(1/12))(-21)/(a*(-11/6)a*(-4/17)a) assuming a is positive. a(-3709/204) Simplify (c5/c)7/(c3)(2/43) assuming c is positive. c(1198/43) Simplify ((s((s(-4/7)s)/s)/s)/ss/s27)/(((s(-29)/s)/ss)/((s/(s15/s))/s)) assuming s is positive. s(-81/7) Simplify (o(-29))(-33)o/o9o5 assuming o is positive. o954 Simplify (ii/((i/(i/((ii(-18))/i)))/i))27/(i*(-1)iii/(ii34)) assuming i is positive. i600 Simplify ((w/(w3ww))(-4/9)/(w/(w/w8)w/(ww2)w))(-2/15) assuming w is positive. w(94/135) Simplify nn(2/41)n*10/n(n/n(2/3))/n10 assuming n is positive. n*(47/123) Simplify (dd*2d)*(-18)(d/(d/(ddd*1)))/(dddd/(d*(-9)ddd)d) assuming d is positive. d(-80) Simplify (j/(j(3/10)/j))(-5/2)j5/(j(-25)jj) assuming j is positive. j(95/4) Simplify q(-3/7)/(qq(4/9))qq(-1/5)(q/q(4/7))/q assuming q is positive. q(-74/45) Simplify (((l/l(2/3))/l)(-39)/((l/((ll(-3))/ll))/ll(2/17)ll))(-31) assuming l is positive. l(-11532/17) Simplify r/(r(-2/9)/r)rr4(rr/(rr*3r))9 assuming r is positive. r(-178/9) Simplify l*(-2)/((l/((l/(ll/l*8))/l)l)/l)(ll*(4/5)l)22 assuming l is positive. l(323/5) Simplify (r(-3))(-13/3)r(-2/7)/(r/((r/(r(-5/2)/r))/r)) assuming r is positive. r(213/14) Simplify ((j(3/23)j(-2/21)/j)(-2/17))47 assuming j is positive. j(43804/8211) Simplify b/((b/(b/((b/(b/(b*(7/4)/b)))/b)b))/b)(bbbb/(bb1b)b)/bb/b*(-15)bbb*(-2/9)bb assuming b is positive. b(865/36) Simplify (k(-1/5))(-2/9)/(k(-15)/k((k/((kk/(k(3/4)k))/k))/k)/kk) assuming k is positive. k(2753/180) Simplify ((d(-2/11)dd/(ddddd7))(1/61))32 assuming d is positive. d(-3232/671) Simplify (m/((m8/mm)/m))/(mm(-15)/m)mm(-1/23)mm(-6)m assuming m is positive. m(137/23) Simplify k(2/17)/(k*(-9)k)(k/(kk/(k*(-12/7)kk)k))(1/33) assuming k is positive. k(10558/1309) Simplify (r/(rr/(r(-7)r)r))(-2/29)/(rrr(-3/5))(-3/16) assuming r is positive. r(1889/2320) Simplify ((b/b22)/bb(b/b27)/b)/(b26b(-18/5)) assuming b is positive. b(-352/5) Simplify ((f(-6)/f)(2/19))(4/23) assuming f is positive. f(-56/437) Simplify (qq5q(-3))/(q1)(8/7) assuming q is positive. q(13/7) Simplify ((w/(w(1/5)/w))/w)(-28)w(-1/6)/(w/((w(9/5)ww)/w)) assuming w is positive. w(-623/30) Simplify (yy/y(-3))(-39)yy*(-3)yy/(y/(y(y/y*(2/7)y)/yy)) assuming y is positive. y(-1353/7) Simplify (t/(t/(tt*(-11)t))tt*(-1/18))/(t((tt0)/t)/tt)(1/5) assuming t is positive. t(-743/90) Simplify (c*(-3)c)/(c/((c/c*(-13))/c)c)c(1/7)/((c(-3/7)c)/cc) assuming c is positive. c(60/7) Simplify (k0((k/k47)/k)/k)(-2/31) assuming k is positive. k(96/31) Simplify (o/(o/o(-4)))*(10/3)o*(-21)oo7 assuming o is positive. o(-79/3) Simplify ((h/(h/((h(hh/(hh*4)hhh)/h)/h)))/h)/h*(1/37)h/(h/((hh(13/2))/hh))h(1/19) assuming h is positive. h(7769/1406) Simplify (nnn(1/3)n)*(34/7)nn(2/29)(((n/n*(2/17))/nn)/n)/nn assuming n is positive. n(177469/10353) Simplify (y5/(y/(((y/(y/((y(3/19)y)/y)yy))/y)/y)))/(y*(-10)((((y/(((y(y(-14)y)/y)/yy)/y))/y)/y)/y)/y) assuming y is positive. y(-16/19) Simplify ((ggggggggg/g(1/4)ggggggg)*(-2/15)(gg/g(2/3))/g(g*(2/9)g)/g)13 assuming g is positive. g(-1807/90) Simplify (z(2/51)/((z/(z(-6)/z))/z))/(z(-1/7)/z(2/21)) assuming z is positive. z*(-800/119) Simplify ((j/(j/(j/(jj*(-2)))j))(-2/3))(-6/13) assuming j is positive. j*(4/13) Simplify (s/((ss*(-3)ss)/s)s)*(19/5)/(((sss(3/2))/s)/sss/(s/(s/(((s(-2/3)/s)/ss)/s)))) assuming s is positive. s(157/30) Simplify (q(-2/3))*(-6)(q/(	{ "pile_set_name": "DM Mathematics" }
) = -641a. Let n(t) = -666018t*2. What is k(n(p))? 426917538p*2 Let v(d) = -6d. Let y(g) = -5679234g. Calculate v(y(h)). 34075404h Let u(i) = i - 103. Let p(g) = -g*2 + 49614g. What is p(u(v))? -v*2 + 49820v - 5120851 Let g(z) = -15z2 - 46z - 23. Let k(h) = -4h2 - 12h - 6. Let w(y) = -6g(y) + 23k(y). Let t(d) = -d - 428. Calculate t(w(r)). 2r2 - 428 Let j(g) = -47599800g. Let x(u) = 18u2. Calculate j(x(k)). -856796400k2 Let c(u) = u2 + 89u - 13. Let d(m) = 16m - 1. Let r(p) = 146p - 9. Let n(x) = -9d(x) + r(x). Give c(n(b)). 4b2 + 178b - 13 Let t(b) = -66b2 - 4. Let z(c) = -6c*2 + 5c - 5. Let g = -171 + 177. Let p(d) = -7d2 + 6d - 6. Let r(j) = gz(j) - 5p(j). Determine r(t(o)). -4356o4 - 528o*2 - 16 Let v(p) = -5p + 9592. Let y(a) = -8a. Calculate y(v(i)). 40i - 76736 Let y(j) = 38j. Let c(s) = -4s - 1. Let a(n) = -187n - 44. Let p(x) = -a(x) + 44c(x). Determine y(p(l)). 418l Let u(g) be the second derivative of g4/6 - 58g. Let t(m) be the second derivative of -m*4/6 - 7m*2 + 3m + 5. Calculate u(t(k)). 8k4 + 112k*2 + 392 Let n(a) = 827 + 10a*2 + 3a*2 - 827. Let w(t) = -2t*2 - 123. What is n(w(u))? 52u*4 + 6396u*2 + 196677 Let y(j) = 2228j - 4454j + 2225j. Let x(w) = 655w + 2. Determine x(y(r)). -655r + 2 Let v(h) = -6h2. Let u(q) = 7q*2 - 425095q + 425095q. Calculate u(v(b)). 252b*4 Let n(s) = -2s*2. Let z(d) = 4d - 4d + 26d*2 - 17. Let x(f) = 6f*2 - 3 - 2 + 2 + 3f*2 - 3. Let j(v) = 17x(v) - 6z(v). Determine j(n(r)). -12r*4 Let h(s) = -5s*2 + 1406489s. Let t(c) = -c. What is h(t(r))? -5r2 - 1406489r Let f(l) be the third derivative of -7l4/8 - 76l*2 + 5l. Let o(r) = -598r. What is o(f(m))? 12558m Let m(g) = 6g2. Let z(q) be the first derivative of -q4/6 + 9q*2 + 104. Let w(t) be the second derivative of z(t). Determine m(w(s)). 96s*2 Let z(f) = -169f. Let l(u) = -5091194u. What is z(l(i))? 860411786i Let n(h) be the first derivative of -3h2 - 315. Let p(m) = -56m - 55m - 53m + 158m. Give n(p(a)). 36a Let k(t) = -120t2. Let u(j) = -117j*2 + 11j. Let c(n) = -11n2 + n. Let w(l) = 88c(l) - 8u(l). What is k(w(y))? -122880y*4 Let u(j) = -108799j + 5. Let w(s) = 287s. Determine w(u(h)). -31225313h + 1435 Let l(u) = -268 - 82u2 + 567 - 299. Let t(a) = -83a*2. Determine t(l(v)). -558092v*4 Let f(l) = 53153919l. Let a(u) = -2u. Give a(f(h)). -106307838h Let x(u) = 5u2. Let l(a) = -7622158a*2. Determine l(x(y)). -190553950y*4 Let h(s) = -8s. Suppose 3x - 4r - 17 = 0, -4x + 8 = 2r - 0r. Let o(t) = 15t + 1502. Let k be o(-87). Let z(d) = -xd + 197 - k. Calculate h(z(w)). 24w Let d(z) = -3z. Let b(l) = -264423616l - 2. Give b(d(t)). 793270848t - 2 Let x(f) = 85416797f2. Let b(w) = w2. Calculate x(b(v)). 85416797v4 Let t(n) = 8n*2. Let l(m) = m - 12. Let d(c) = -36c + 36. Let f(p) = -5d(p) - 15l(p). What is f(t(r))? 1320r2 Let a(i) = 70i*2. Suppose -y + 3 = -g - 0, 0 = 5y - 25. Let z(x) = -x + x + 294x2 - 293x*g. Determine z(a(f)). 4900f4 Let d(b) = b + 41. Let i(j) be the third derivative of -j5/30 - 1622j2. What is d(i(l))? -2l2 + 41 Let a(f) = f2. Let j(y) = y*3 + 17y*2 - y - 5. Let h be j(-17). Let c = 12 - h. Let x(w) = c + 0 - 87w*2 + 88w2. Determine a(x(r)). r4 Let v(r) = -20r. Let s(m) be the third derivative of m7/1260 + m5/20 + 7m*3/6 + 50m*2. Let o(d) be the third derivative of s(d). What is v(o(u))? -80u Let q(f) = 4f. Let g(h) = 5h + 2. Let s(p) = 4g(p) - 6q(p). Let z(o) = 1664o + 0 - 1666o + 0. Calculate z(s(n)). 8n - 16 Let i(k) = -2k. Let h = -9171 - -9171. Let n(b) be the third derivative of -1/60b5 + 0 + hb - 12b2 + 0b*4 - 2b*3. Calculate n(i(g)). -4g*2 - 12 Let h(n) = 908103n*2. Let x(w) = -10w*2. Calculate h(x(l)). 90810300l*4 Let d(f) = 213f*2 + f. Let w(j) = 16031j - 2. Give w(d(q)). 3414603q2 + 16031q - 2 Let f(w) = -2w. Let a(x) = -12759x + 18058x + 22784x. Give a(f(c)). -56166c Let g(q) = 106q. Let r(m) = -19m2 + 15m + 6. Let x(d) = -38d2 + 25d + 10. Let v(f) = 5r(f) - 3x(f). Determine g(v(y)). 2014y2 Let p(m) = 13m - m + 0m. Let k(i) be the second derivative of 1/3i*3 + 0i*2 - 5 - 8i. Give k(p(g)). 24g Let b(c) = -8c. Let s(j) = 2214626j2. Give b(s(m)). -17717008m*2 Let q(n) = 23n - 8. Let m(i) = 172i - 60. Let c(x) = -2m(x) + 15q(x). Let b(w) = -w - 19212. Determine c(b(k)). -k - 19212 Let d(v) = -73v. Let m(g) = -2216g + 2. Give m(d(l)). 161768l + 2 Let z(a) be the first derivative of 112a3/3 + 1319. Let c(i) = 10i*2. What is z(c(o))? 11200o*4 Let u(v) = 955v - 505v - 476v. Let g(j) = -14j + 1. Calculate g(u(d)). 364d + 1 Let u(o) = -5o2. Let x(b) = -183 - 43 - 413b + 272 - 46. Determine x(u(s)). 2065s2 Let h(c) be the second derivative of -25c*4/6 - 959c - 2. Let k(i) = 2i + 4. Determine h(k(p)). -200p*2 - 800p - 800 Suppose 0 = -30a + 24 + 96. Let q(i) = -35i. Let l(x) = 13x. Let m(g) = aq(g) + 11l(g). Let y(j) = 41j. Give m(y(b)). 123b Let m(i) = -4i + 6. Let c(u) = 3 + 8u2 - 1 + 1 - u3. Let g be c(8). Let q(o) = -go + o + 3o - 2o. Calculate m(q(k)). 4k + 6 Let d(h) = h2. Suppose 0 = -52n + 31n. Let c(s) be the first derivative of -9 + 23/2s*2 + ns. What is d(c(b))? 529b2 Let d(n) = -2n*2. Let v(g) = 9g - 384. Let r(z) = -24z + 1152. Let i(p) = 4r(p) + 11v(p). Determine i(d(s)). -6s*2 + 384 Let k(j) = -13j + 16. Let w(r) = -87872r2 + 43941r*2 + 43934r*2. Determine w(k(n)). 507n*2 - 1248n + 768 Let k(i) = 192i2. Let s be ((-4)/(-9))/(152/36 - 4). Let z(f) = -98f*2 + 50f*2 + 50f*s. What is k(z(v))? 768v*4 Let x(r) = 4r. Let h(d) = 46820992d. Calculate x(h(y)). 187283968y Let w(q) = -2q. Let u(m) be the second derivative of -79m*3/6 - 5m*2/2 + 14m + 1. Let j(z) = 592z + 37. Let d(g) = -5j(g) - 37u(g). Calculate w(d(t)). 74t Let l(w) = -6w2. Let j(s) be the first derivative of -65s*3/3 + 1840. Give l(j(r)). -25350r*4 Let v(m) = -2905m. Let g(j) = -3155j. Determine v(g(f)). 9165275f Let d(t) be the second derivative of -t*4/12 - 2t - 456. Let l(v) = 289v. Give l(d(q)). -289q*2 Let t(h) be the first derivative of -17h*2/2 - 3h + 1249. Let s(f) = -4f2 - 2f*2 + 5f*2 + 0f*2. Give s(t(u)). -289u*2 - 102u - 9 Let b(y) = -306y. Let x(d) = -34933d. Give b(x(h)). 10689498h Let z(c) = -7c*2. Let g(s) = -37470s. Calculate z(g(f)). -9828006300f2 Let y(k) = -399827155k*2 - 2. Let s(w) = w. Calculate y(s(i)). -399827155i*2 - 2 Let w(r) = 322r*2. Let c(v) = -12v*2 + 30v - 60. Let a(s) = -s*2 + 2s - 4. Let o(d) = 15a(d) - c(d). What is o(w(f))? -311052f*4 Let p(n) = 5n*2 + n - 1. Let v(l) = -4l*2 - l + 1. Let y(i) = -2p(i) - 2v(i). Let j(a) = 2a*2 - 38a. Give y(j(t)). -8t4 + 304t*3 - 2888t*2 Let i(n) = -93n*2 - 4. Let g(s) = 6s - 828. Give g(i(b)). -558b2 - 852 Let u(c) = -7c. Let p(w) = 10720652w. Determine p(u(z)). -75044564z Let h(g) = 3g2. Let f(l) be the second derivative of 0 + 0l*2 - 66l - 17/2l3. Determine f(h(a)). -153a*2 Let o(h) = -6h*2 - 3h*2 - 2h2. Let a(z) = -z2 - 7z - 14. Let g(b) = b2 + 2b + 4. Let c(m) = -6a(m) - 21g(m). Give o(c(f)). -2475f4 Let z(a) = -22a - 8. Let o(b) = 14b + 5. Suppose 64d - 717 + 205 = 0. Let k(x) = do(x) + 5z(x). Let i(n) = -5n2 - 21n. Give i(k(v)). -20v2 - 42v Let a(n) = 3n. Let b(o) = -72o*2 - 646o + 536. Calculate b(a(z)). -648z2 - 1938z + 536 Let n(r) = 61r - 15. Let u(p) = 98p - 24. Let i(l) = -8n(l) + 5u(l). Let t(g) = -3208g2. Give i(t(a)). -6416a*2 Let b(x) = -29x*2 + 8x - 934. Let u(c) = -86c. Determine b(u(p)). -214484p*2 - 688p - 934 Let d(f) = 5f + 6. Let m(i) = -15i - 17. Let q(s) = 17d(s) + 6m(s). Let z(y) be the first derivative of 4y3/3 + y2 - 3234. Determine q(z(p)). -20p*2 - 10p Let n(d) = 142d + 10. Let k(a) = -28a - 2. Let g(m) = -5k(m) - n(m). Let c(s) = -70s*2 + 123. What is c(g(r))? -280r*2 + 123 Let q(k) = 47k + 48. Let x(a) = 6a + 6. Let n(o) = 5q(o) - 40x(o). Let h(i) be the first derivative of 5i	{ "pile_set_name": "DM Mathematics" }
hat is prob of sequence mn when two letters picked without replacement from {z: 1, a: 3, n: 1, m: 2, u: 4, i: 1}? 1/66 What is prob of sequence pbjp when four letters picked without replacement from pbbbpbbbbojbbpbobbob? 13/19380 Three letters picked without replacement from bppiilbiplllbllpbbl. What is prob of sequence blp? 70/2907 Two letters picked without replacement from {x: 10, n: 10}. Give prob of sequence nn. 9/38 Calculate prob of sequence ww when two letters picked without replacement from {n: 2, y: 7, w: 5}. 10/91 Calculate prob of sequence ror when three letters picked without replacement from nnorqrqqrnnn. 1/220 Two letters picked without replacement from {p: 1, x: 3, q: 2, u: 1}. Give prob of sequence xx. 1/7 Four letters picked without replacement from ayyaaaayaaayayaaayy. What is prob of sequence ayya? 77/1292 Two letters picked without replacement from jlccuccjokujkll. Give prob of sequence uu. 1/105 What is prob of sequence ki when two letters picked without replacement from {m: 6, u: 1, i: 2, k: 3, w: 1}? 1/26 Two letters picked without replacement from {i: 1, s: 1, a: 1}. Give prob of sequence sa. 1/6 Calculate prob of sequence xd when two letters picked without replacement from {d: 11, x: 1}. 1/12 What is prob of sequence yyn when three letters picked without replacement from {f: 4, n: 1, g: 2, p: 2, z: 1, y: 2}? 1/660 Four letters picked without replacement from ffttqjfjtqttt. Give prob of sequence ffjf. 1/1430 Calculate prob of sequence na when two letters picked without replacement from {a: 1, n: 18}. 1/19 What is prob of sequence yy when two letters picked without replacement from {y: 2, b: 13, g: 3}? 1/153 Calculate prob of sequence xiuo when four letters picked without replacement from {x: 2, o: 1, u: 1, i: 1, c: 5}. 1/2520 Four letters picked without replacement from wwkwwkwwwwkkwwwwww. What is prob of sequence kwkw? 91/3060 Four letters picked without replacement from {f: 2, v: 2}. Give prob of sequence ffvv. 1/6 Calculate prob of sequence rr when two letters picked without replacement from {r: 2, v: 6}. 1/28 Three letters picked without replacement from {k: 4}. Give prob of sequence kkk. 1 Two letters picked without replacement from {c: 4, j: 1, p: 3}. What is prob of sequence pp? 3/28 Calculate prob of sequence gggx when four letters picked without replacement from xxgggx. 1/20 Four letters picked without replacement from uayux. Give prob of sequence axuy. 1/60 What is prob of sequence vv when two letters picked without replacement from {v: 3, n: 1}? 1/2 Three letters picked without replacement from {f: 9}. Give prob of sequence fff. 1 What is prob of sequence rxyn when four letters picked without replacement from dyyexndnr? 1/756 Two letters picked without replacement from {k: 7, n: 1, r: 10}. What is prob of sequence nr? 5/153 What is prob of sequence oeke when four letters picked without replacement from {l: 2, c: 1, e: 2, o: 2, k: 2, s: 10}? 1/11628 Calculate prob of sequence xj when two letters picked without replacement from sdxessxxxdxjejx. 2/35 Two letters picked without replacement from {a: 1, r: 1, g: 5, s: 2}. Give prob of sequence rs. 1/36 Two letters picked without replacement from mjjmmmjomj. What is prob of sequence jm? 2/9 Calculate prob of sequence gjw when three letters picked without replacement from {x: 2, v: 1, g: 2, w: 1, j: 10}. 1/168 What is prob of sequence ppp when three letters picked without replacement from {s: 3, p: 3, i: 2, v: 1, g: 1}? 1/120 Two letters picked without replacement from rrlznllll. Give prob of sequence rl. 5/36 What is prob of sequence pp when two letters picked without replacement from {p: 11, a: 1}? 5/6 What is prob of sequence em when two letters picked without replacement from {q: 4, m: 2, e: 8, k: 3, g: 2}? 8/171 Four letters picked without replacement from {n: 3, x: 1}. Give prob of sequence nnxn. 1/4 Four letters picked without replacement from {o: 1, q: 4, x: 1, w: 2, z: 5, n: 2}. What is prob of sequence wzwz? 1/819 Three letters picked without replacement from {l: 9, o: 1, m: 1, d: 4, c: 1, q: 4}. Give prob of sequence dod. 1/570 What is prob of sequence waaa when four letters picked without replacement from aaaaawaaaawa? 4/33 Two letters picked without replacement from qmmgqmsmwgggwg. What is prob of sequence qs? 1/91 Four letters picked without replacement from cmmyyccccy. Give prob of sequence cmmy. 1/168 What is prob of sequence tgt when three letters picked without replacement from ttg? 1/3 Two letters picked without replacement from zzhqzokzhkzgkkh. Give prob of sequence kq. 2/105 What is prob of sequence qhtd when four letters picked without replacement from {q: 2, t: 2, a: 2, h: 1, p: 4, d: 1}? 1/2970 Three letters picked without replacement from wnwnwnn. Give prob of sequence nnn. 4/35 Calculate prob of sequence ftjj when four letters picked without replacement from ftttttjjtfttttt. 11/8190 Three letters picked without replacement from nnrzrrnrzhzrooro. What is prob of sequence nho? 3/1120 Four letters picked without replacement from pppppplp. Give prob of sequence pplp. 1/8 Two letters picked without replacement from yzoyz. What is prob of sequence yz? 1/5 What is prob of sequence wlw when three letters picked without replacement from {m: 1, w: 6, l: 3, i: 5}? 3/91 What is prob of sequence jeye when four letters picked without replacement from {q: 1, j: 1, y: 5, h: 5, k: 5, e: 2}? 5/46512 What is prob of sequence ttv when three letters picked without replacement from {c: 1, q: 5, v: 5, t: 7}? 35/816 Three letters picked without replacement from vwlyallkvvll. Give prob of sequence vka. 1/440 Three letters picked without replacement from eejrnnrz. Give prob of sequence eje. 1/168 Three letters picked without replacement from {g: 1, y: 7, t: 1, r: 6}. What is prob of sequence tyr? 1/65 Three letters picked without replacement from rtmrtrtmtr. Give prob of sequence rrm. 1/30 What is prob of sequence zyr when three letters picked without replacement from rrffffyfffzff? 1/858 Four letters picked without replacement from qzzzzkrkzkkzkzunr. What is prob of sequence krur? 1/5712 Calculate prob of sequence bt when two letters picked without replacement from {h: 4, t: 1, o: 4, b: 2}. 1/55 Four letters picked without replacement from kkokodkkw. Give prob of sequence wdkk. 5/756 Three letters picked without replacement from {c: 3, k: 1, f: 4, j: 6, i: 4, l: 2}. Give prob of sequence fjc. 1/95 Four letters picked without replacement from uulruyclylycurcny. What is prob of sequence lurn? 1/2380 Two letters picked without replacement from {y: 6, q: 6}. What is prob of sequence yy? 5/22 What is prob of sequence nlh when three letters picked without replacement from {v: 1, y: 5, h: 1, n: 1, l: 2}? 1/360 What is prob of sequence qq when two letters picked without replacement from cqcqryd? 1/21 Three letters picked without replacement from {l: 6, i: 4, t: 1, n: 3}. What is prob of sequence iii? 1/91 What is prob of sequence nm when two letters picked without replacement from nmtdn? 1/10 Two letters picked without replacement from {c: 4, q: 2, i: 2, m: 7, z: 3}. What is prob of sequence qm? 7/153 Two letters picked without replacement from snpjesl. Give prob of sequence ns. 1/21 Calculate prob of sequence mm when two letters picked without replacement from {m: 2, k: 1, i: 2, e: 2, h: 1}. 1/28 What is prob of sequence zz when two letters picked without replacement from {k: 2, t: 1, h: 3, g: 1, z: 10}? 45/136 Calculate prob of sequence mm when two letters picked without replacement from {m: 8, x: 6, l: 3}. 7/34 Three letters picked without replacement from {w: 3, r: 1, b: 2, p: 4, i: 2}. What is prob of sequence wir? 1/220 Three letters picked without replacement from {h: 3, e: 4, q: 3, s: 10}. What is prob of sequence seh? 1/57 Calculate prob of sequence zn when two letters picked without replacement from ncncnnzzz. 1/6 What is prob of sequence dtdt when four letters picked without replacement from {d: 3, t: 3}? 1/10 Two letters picked without replacement from kttdtdfxdddfpdktd. Give prob of sequence dp. 7/272 Two letters picked without replacement from {g: 1, z: 11, k: 4, x: 2, a: 1}. What is prob of sequence zg? 11/342 Three letters picked without replacement fr	{ "pile_set_name": "DM Mathematics" }
19.3705 - -0.0295. Let x = o - 55.2. What is x rounded to the nearest ten? 60 Let w = 164.9576 - 165. What is w rounded to 3 decimal places? -0.042 Suppose -4y + 3y = -3. Suppose -yq = -5q. Suppose q = -5j + 1129 + 221. Round j to the nearest one hundred. 300 Let d = -0.75 + 2.77. Let t = -0.23 - d. What is t rounded to the nearest integer? -2 Suppose -5i + 23750 = 38k - 39k, -23750 = -5i + 4k. Round i to the nearest one thousand. 5000 Let w = 12 - 12.22. Let m = w - -1.22. Let z = 1.00076 - m. What is z rounded to 4 dps? 0.0008 Let n = -3 + 16. Let q = -20 + n. Let z = -7.00038 - q. Round z to 4 dps. -0.0004 Let a = 82.3 + -86. Let u = 16 + -19.8. Let r = a + u. Round r to the nearest integer. -8 Let k = 406.9999337 + -407. Round k to five dps. -0.00007 Suppose 2h = -4w + 2, 5h - 2w + 0w = -7. Let k be 3 + (-2001 - 1) + h. Let p be (-138)/((-2)/k2). Round p to the nearest ten thousand. -70000 Let i = 1544 - 1543.9999974. Round i to six decimal places. 0.000003 Let f = -18.3 - -10. Let g = f + 8.2621. Round g to three dps. -0.038 Let i = 2.60000262 - 2.6. What is i rounded to 7 dps? 0.0000026 Let p be 2 + (42/126 - (-205)/(-3)). What is p rounded to the nearest 10? -70 Let s(a) = -a3 - a2 + 1. Let m be s(-1). Let u be -2 + -2 - (-9)/m. Suppose 0 = -uj + 30514 - 114014. Round j to the nearest 1000. -17000 Let j(z) be the second derivative of -z4/12 + 3z*3/2 + 1600000z*2 - 2z - 2. Let f be j(0). Round f to the nearest 1000000. 3000000 Let h(b) = 35804b3 - 15b*2 - 6b + 5. Let z be h(7). Round z to the nearest 1000000. 12000000 Suppose 0 = 3g - 5 - 4. Suppose 3b - 8 = f, 0 = -2b + 6f - 9f + 20. Suppose 0 = -gt + bt + 10600000. Round t to the nearest one million. -11000000 Let j = 0.063 - -0.085. Let o = -0.08 + j. Let x = o + -0.06767. What is x rounded to 4 decimal places? 0.0003 Let f = -698 - -698.00000201. What is f rounded to seven dps? 0.000002 Let b = -0.2 - 5.78. Let d = -7.5 - -1.5. Let k = b - d. Round k to 1 dp. 0 Let w = 25 - 39. Let u = w + 13.48. Let p = 0.52114 + u. Round p to four decimal places. 0.0011 Let q = -544 - -544.00000049. Round q to 7 dps. 0.0000005 Let n = -60160516.85696731 + 28834054.68696945. Let j = 31326463 + n. Let u = 0.83 - j. Round u to 7 dps. -0.0000021 Let g = 2136 - 2136.0000358. Round g to 5 dps. -0.00004 Suppose 2l = -3m - 24 - 0, 2m - 16 = 4l. Let z be ((-1468)/l)/(8/36). Suppose -s + z = -2b, -3b - 1763 = -5s - 108. Round b to the nearest 100. -600 Let f = 2.612 - 2.60127. What is f rounded to two decimal places? 0.01 Let h be (-27)/(-12) + (-1)/4. Let o(g) = 0g - 2g + 7797gh + 3036g2. Let a be o(-6). Round a to the nearest one hundred thousand. 400000 Let x = -0.16 + 0.38. Let w = 0.2200013 - x. Round w to 6 dps. 0.000001 Let v = 39 - 38.89. Let h = v - 1.06. What is h rounded to one decimal place? -1 Let d(y) = y2 + 4y + 2. Let z be d(-1). Let o be (18 + -43)/(z/(-47561)). Let w = 1759025 + o. Round w to the nearest one hundred thousand. 600000 Let l = 0.08745 - 0.091. What is l rounded to three decimal places? -0.004 Let r = -614.83 + 607. Round r to the nearest integer. -8 Let o = -362148.180166587485 + 0.060168827485. Let a = o + 362148. Let r = a + 0.12. What is r rounded to 7 decimal places? 0.0000022 Let v = -882 + 443. Let m = -439.0267 - v. What is m rounded to three dps? -0.027 Let n = -2927724 - -1197724. What is n rounded to the nearest one million? -2000000 Let y = 4.414 - 4.41391863. Round y to 5 decimal places. 0.00008 Let o = -2089 + 406. Let p be 1 + 0 + -4 - o. Suppose p = -6z + 2z. Round z to the nearest 100. -400 Let p(x) = 4x*2 - 15x - 1. Let y be p(4). Suppose -yg = -6g + 34200. What is g rounded to the nearest ten thousand? 10000 Let j = -13.95 + 14. Let w = -5.05 + j. Let p = w - -5.00000007. Round p to seven dps. 0.0000001 Let c = -0.055 + 16.555. Let w = 17 - c. Let b = w - 0.499965. Round b to five dps. 0.00004 Let z = -105.959 + -0.041. Let k = 103.15 + z. What is k rounded to one dp? -2.9 Let b(y) = -22286357y2 + 4303069y*2 - y - 19116712y*2 - 1. Let w be b(-1). Round w to the nearest one million. -37000000 Let v = -0.69 + 0.28. Let u = -0.58 - v. Let c = u - -0.1700001. What is c rounded to 7 dps? 0.0000001 Let k be 30/(-20)(-8)/6. Suppose 5 = -kf + 1. Let g(r) = -131251r3 - r2 + r - 2. Let o be g(f). Round o to the nearest 100000. 1100000 Suppose 38n - 116820 = 20n. Round n to the nearest one hundred. 6500 Let b = 2535328 + -3804580. Let m = b - -426832. Let q = m - -4042420. Round q to the nearest one million. 3000000 Let i be (4 - 52/10) + -9. Let z = 14 - 32. Let s be ((-440)/(-6))/(i/z). What is s rounded to the nearest 100? 200 Let c = 11478265590 - 11478265789.99999676. Let y = c - -200. Round y to seven dps. 0.0000032 Let s = -17 + 16.75. Let v = s - -0.354. Let b = 0.10597 - v. What is b rounded to 4 decimal places? 0.002 Let p = 178520 + -176795.3036. Let n = p + -1727. Let f = n + 2.3. Round f to three dps. -0.004 Let o = 85 - 97.5. Let y = o - -16. Round y to the nearest integer. 4 Let f = 53.1 + 7.9. Let m = f + -60.999968. Round m to 6 decimal places. 0.000032 Let h = 183.83 - -15.47. Round h to the nearest ten. 200 Let l = 471823 + 27800. Let v = l + -499622.9799997. Let q = v + -0.02. What is q rounded to 6 decimal places? 0 Suppose -21w - 958760 = w. Round w to the nearest 1000. -44000 Let r(i) = -i*3 - 18i*2 + 18i - 28. Let j be r(-19). Let o = -13 - 42. Let v = j - o. Round v to the nearest 10. 50 Let o = 5.40404371 + -5.404. What is o rounded to 5 decimal places? 0.00004 Let u = -5761138 - -5761138.2401029. Let g = -17.2401039 + u. Let k = 17 + g. Round k to six dps. -0.000001 Let s = -6 + 6.38. Let v = -343.6115 + 344. Let o = s - v. Round o to 3 decimal places. -0.009 Let p = -1292 + 1291.999283. Round p to 4 decimal places. -0.0007 Let h = -1.5 - -1. Let l = h + 0.13. Let j = -0.369899 - l. Round j to 5 decimal places. 0.0001 Let v = 21 - 18. Suppose -2b - vf = 549 - 23, b - 4f + 252 = 0. What is b rounded to the nearest one hundred? -300 Let m be 3/5 - (-6)/15. Suppose -2z = -b - 4 + m, 3 = 3b. Suppose -4g + 3u = 36006, -4g - 23952 = -zu + 12052. Round g to the nearest one thousand. -9000 Let u = -471 + 461.38. What is u rounded to the nearest integer? -10 Let s = 293.99998425 + -294. What is s rounded to five dps? -0.00002 Let x = 1.25 + 12.75. Let j = -884.18 + 870. Let c = j + x. What is c rounded to one decimal place? -0.2 Let o = -225145.35 - -96185.32. Let z = -128898.03233 - o. Let x = 62 - z. Round x to four dps. 0.0023 Let h = 0.6984 - 0.66779. What is h rounded to 3 dps? 0.031 Let u = -29.1 + 28. Let a = 1516.7 - 1515.6007. Let v = a + u. Round v to three dps. -0.001 Suppose -14d - 18 = -17d. Let v be 0/(-5)(-2)/d. Round v to the nearest one thousand. 0 Let s = -7 - 16. Let d = s + 23.36. Let v = d - 0.504. Round v to 2 decimal places. -0.14 Let h = 595.0855 - 595. What is h rounded to three dps? 0.086 Let n = 112 - 77. Let b = 849455 - 1339445. Let a be 4/14 - b/n. Round a to the nearest 10000. 10000 Let m = 66 - 111. Let u = m - -44.47. Let w = u - -0.33. Round w to one dp. -0.2 Let v = 1.17 - 1.364. Let z = v + 0.107. Round z to two dps. -0.09 Let i be 1696/(-24)(-18)/(-12). What is i rounded to the nearest ten? -110 Let a = -36.29 - 4.11. Let p = -0.29 - -51.29. Let v = a + p. What is v rounded to 0 dps? 11 Suppose 16f - 12f - 702165 = k, -2f + 351065 = 3k. Round f to the nearest 1000. 176000 Let m = 7 + -34. Let d = m - -27.00000092. What is d rounded to six decimal places? 0.000001 Let y = 4.58 + -4.47505. Round y to 2 dps. 0.1 Let s = 618.33 + -615. Let z = -152.33 + s. Let f = -149.000133 - z. What is f rounded to five decimal places? -0.00013 Suppose 4l = n - 882, 9l - 2681 = -3n + 14l. Round n to the nearest one hundred. 900 Let h = 286.4 + -153.2. Round h to the nearest ten. 130 Let w = -3185.09101398 + 3045.091009. Let i = w + 140. Round i to 6 decimal places. -0.000005 Let y = 863269 + -981250.6. Let m = y - -117928.6021. Let t = m - -53. What is t rounded to 3 dps? 0.002 Suppose -37s + 4629151 = 180749151. What is s rounded to the nearest 1000000? -5000000 Let m = -168.38 - -167. Let b = -22119 - -22120.4009. Let	{ "pile_set_name": "DM Mathematics" }
in nanometers? 997228.6 What is 0.9265363m in kilometers? 0.0009265363 What is 11/4 of a centimeter in micrometers? 27500 Convert 2674.417ml to litres. 2.674417 What is four fifteenths of a minute in seconds? 16 How many minutes are there in 4/3 of a hour? 80 How many millilitres are there in 709.2508l? 709250.8 How many centimeters are there in five eighths of a kilometer? 62500 How many minutes are there in 6.093351 milliseconds? 0.00010155585 What is 368162.4km in meters? 368162400 What is 8/3 of a millennium in months? 32000 What is 67055.29 centuries in months? 80466348 What is 1777.185nm in centimeters? 0.0001777185 How many minutes are there in 9/10 of a hour? 54 How many millilitres are there in 1/5 of a litre? 200 Convert 5.316959mm to nanometers. 5316959 Convert 97.45083 meters to centimeters. 9745.083 Convert 69048.18 millilitres to litres. 69.04818 Convert 0.3929816kg to tonnes. 0.0003929816 What is 43/4 of a litre in millilitres? 10750 What is nineteen tenths of a millisecond in microseconds? 1900 How many kilograms are there in 6/25 of a tonne? 240 How many decades are there in 26/5 of a millennium? 520 Convert 0.3512008 grams to nanograms. 351200800 What is 25/2 of a micrometer in nanometers? 12500 What is 21131.712 days in weeks? 3018.816 What is 371.1343g in kilograms? 0.3711343 What is 5.064071 millilitres in litres? 0.005064071 How many micrograms are there in 5/4 of a milligram? 1250 What is 3320.823mm in nanometers? 3320823000 What is 7/4 of a microgram in nanograms? 1750 What is twenty-one quarters of a litre in millilitres? 5250 Convert 8425.519ml to litres. 8.425519 What is nineteen ninths of a day in minutes? 3040 How many millilitres are there in 79.38582l? 79385.82 What is three fifths of a milligram in micrograms? 600 What is 55.40131 years in decades? 5.540131 What is 21/2 of a year in months? 126 How many millilitres are there in 0.7925906 litres? 792.5906 Convert 600455.8 millennia to months. 7205469600 What is 872.3205 decades in centuries? 87.23205 What is fourty-nine quarters of a meter in centimeters? 1225 Convert 8722.166 decades to centuries. 872.2166 What is 21250.4985ms in weeks? 0.00003513640625 What is 0.0717942 hours in nanoseconds? 258459120000 How many meters are there in 1.698097mm? 0.001698097 What is 81.55472mg in grams? 0.08155472 What is one tenth of a meter in centimeters? 10 What is 868.0201nm in meters? 0.0000008680201 Convert 352.9571um to centimeters. 0.03529571 What is 0.419478 hours in days? 0.01747825 What is 3/25 of a kilometer in centimeters? 12000 What is thirty-four fifths of a litre in millilitres? 6800 How many kilograms are there in one quarter of a tonne? 250 What is 10667.721 months in years? 888.97675 How many centimeters are there in one sixteenth of a kilometer? 6250 What is 0.5640094 years in millennia? 0.0005640094 How many minutes are there in eleven tenths of a week? 11088 What is 372806.7 litres in millilitres? 372806700 What is 3/50 of a kilogram in milligrams? 60000 How many nanometers are there in eleven quarters of a micrometer? 2750 What is 4.21438 nanometers in centimeters? 0.000000421438 What is 5913.809m in micrometers? 5913809000 How many millilitres are there in 3/50 of a litre? 60 How many nanograms are there in 2/125 of a milligram? 16000 How many millilitres are there in 51/8 of a litre? 6375 Convert 11.00914nm to micrometers. 0.01100914 What is 317676.4ng in micrograms? 317.6764 What is 1/20 of a millisecond in nanoseconds? 50000 How many minutes are there in five eighths of a day? 900 How many kilometers are there in 24.35805 centimeters? 0.0002435805 What is 0.9529779ms in minutes? 0.000015882965 How many millilitres are there in 11/4 of a litre? 2750 What is 13/5 of a micrometer in nanometers? 2600 Convert 59.929632 days to weeks. 8.561376 Convert 0.5808746 years to decades. 0.05808746 Convert 418678.2l to millilitres. 418678200 What is 18/5 of a millennium in months? 43200 How many years are there in 51/5 of a decade? 102 What is 13/4 of a millennium in months? 39000 What is 6/5 of a litre in millilitres? 1200 How many centuries are there in 0.9030101 millennia? 9.030101 How many tonnes are there in 0.2531877 micrograms? 0.0000000000002531877 What is 17/2 of a decade in months? 1020 What is 65588.81l in millilitres? 65588810 Convert 2476362.3 minutes to hours. 41272.705 How many grams are there in one fifth of a kilogram? 200 How many weeks are there in 586181.799 minutes? 58.15295625 How many kilograms are there in twenty-nine halves of a tonne? 14500 How many micrograms are there in 3/5 of a milligram? 600 How many minutes are there in 2/15 of a day? 192 What is 356.02497 microseconds in days? 0.000000004120659375 What is 15614.74341 seconds in weeks? 0.025818028125 How many millimeters are there in 6/5 of a centimeter? 12 How many micrometers are there in 21/5 of a centimeter? 42000 How many nanograms are there in 25.87385 milligrams? 25873850 What is 72020.8t in grams? 72020800000 How many millilitres are there in 944.0824 litres? 944082.4 What is 29/2 of a century in years? 1450 How many grams are there in 734.4993ng? 0.0000007344993 How many millimeters are there in 76/5 of a centimeter? 152 How many micrometers are there in 881319.3m? 881319300000 How many millilitres are there in twenty-six fifths of a litre? 5200 What is fourty-three halves of a litre in millilitres? 21500 How many years are there in eighteen fifths of a century? 360 How many millilitres are there in twenty-one quarters of a litre? 5250 How many micrometers are there in twenty-seven fifths of a millimeter? 5400 What is twenty-one halves of a kilometer in meters? 10500 How many months are there in nine sixteenths of a century? 675 Convert 18591.8 centimeters to nanometers. 185918000000 How many minutes are there in ten ninths of a week? 11200 What is four fifteenths of a hour in seconds? 960 How many micrometers are there in 1/4 of a centimeter? 2500 Convert 56.61442kg to micrograms. 56614420000 How many milliseconds are there in 1/5 of a minute? 12000 How many micrograms are there in 3/40 of a milligram? 75 Convert 169.7375 nanometers to millimeters. 0.0001697375 What is six fifths of a gram in milligrams? 1200 Convert 865502.9 nanometers to centimeters. 0.08655029 Convert 388096.6 minutes to seconds. 23285796 Convert 666325.8 meters to nanometers. 666325800000000 Convert 801.0077 millilitres to litres. 0.8010077 How many grams are there in three eighths of a kilogram? 375 What is 1/6 of a minute in milliseconds? 10000 What is 1/5 of a century in years? 20 What is 9/10 of a meter in centimeters? 90 How many nanograms are there in 3/50 of a milligram? 60000 What is 21/8 of a litre in millilitres? 2625 Convert 27574.01 millilitres to litres. 27.57401 What is 0.9837988um in millimeters? 0.0009837988 How many millilitres are there in five eighths of a litre? 625 Convert 472.3381 minutes to seconds. 28340.286 What is 1/20 of a millimeter in micrometers? 50 What is 0.6491821ng in tonnes? 0.0000000000000006491821 Convert 0.1203448 decades to years. 1.203448 How many millilitres are there in 6/5 of a litre? 1200 What is 742.904l in millilitres? 742904 What is three fifths of a gram in milligrams? 600 What is 6/25 of a gram in milligrams? 240 How many nanograms are there in 59/4 of a microgram? 14750 What is fourty-three quarters of a meter in centimeters? 1075 What is fifty-one fifths of a litre in millilitres? 10200 What is twenty-seven quarters of a meter in millimeters? 6750 What is 6/5 of a millennium in decades? 120 How many years are there in 34/5 of a decade? 68 How many grams are there in 9897.279 micrograms? 0.009897279 How many kilograms are there in 3/8 of a tonne? 375 What is 574.9404mg in grams? 0.5749404 What is fourty-three halves of a gram in milligrams? 21500 How many months are there in 13/4 of a decade? 390 What is 31/5 of a litre in millilitres? 6200 How many milliseconds are there in 19754.39s? 19754390 How many millilitres are there in 7/8 of a litre? 875 What is 3/8 of a day in minutes? 540 How many millilitres are there in 8629.316l? 8629316 How many microseconds are there in seventeen quarters of a millisecond? 4250 How many minutes are there in 11/10 of	{ "pile_set_name": "DM Mathematics" }
6)/(-14)). 6 What is the value of ((120/(-300))/((-3)/5))/8? 1/12 (-80)/(-570)5/((-60)/9) -2/19 -432/(-24) 1 3(-2)/96/22 -2/11 Calculate (8/(-20))/(1/(30/(-48))). 1/4 Evaluate 54/1626/(-10). -1/5 Calculate (28/(-12))/(6/18). -7 Calculate 0/3(-6)/((-36)/6). 0 What is (-8)/(-96)2-3? -1/2 Calculate ((-9)/181)/((-1)/1). 1/2 (20/(-70))/((-272)/112) 2/17 What is 5/(-1)2(-4)/40? 1 Calculate (-6)/2(-1296)/(-486). -8 What is (12/836/(-27))/(-8)? 1/4 What is (-192)/2881/(-2)-18? -6 Evaluate ((-12)/6)/(65/45). -3 What is the value of ((-20)/32)/((-6)/(-48))? -5 What is (-5)/21(-12)/(-6)? -5 Calculate ((96/28)/(-2))/(6/(-21)). 6 Evaluate ((-1)/141)/(58/(-203)). 1/4 (4/(-13))/((-44)/22) 2/13 What is the value of 10/(-3)(-603)/(-335)? -6 Calculate ((-10)/(-6))/((-6)/126-7). 5 Evaluate ((117/6)/(-13))/((-6)/4). 1 Evaluate 40/(-12)(-18)/12. 5 What is ((-2)/(-4))/(32/(-8))? -1/8 What is the value of (1/(-8)-6)/(45/30)? 1/2 What is the value of ((-24)/60)/(17/(-5))? 2/17 What is the value of 2/634/4? 1 Evaluate 6((-56)/(-42))/4. 2 What is 3/((3/9)/(5/(-45)))? -1 Evaluate (3-1)/((-8)/((-64)/6)). -4 236/40(-1)/(-3) 3/5 Calculate (0/12)/((-20)/4). 0 -1(-6)/(24/10) 5/2 Calculate (60/(-55))/(-12)3. 3/11 What is the value of 9/6-1-2? 3 Calculate (-81)/135(-5)/2. 3/2 Evaluate 0/((-9)/((-72)/(-16)))1. 0 What is 14/212/(-16)6? -1/2 Calculate ((-6)/(-9))/((-3)/95). -2/5 What is the value of ((-135)/300)/(1/((-15)/18))? 3/8 Evaluate (-120)/(-15)(-5)/20. -2 What is ((-3)/(3/3))/(33/11)? -1 ((-240)/280)/(8/42) -9/2 What is the value of ((-2)/(-12))/((-14)/21)? -1/4 What is (-99)/242(-4)/(-3)? -6/11 What is ((-75)/175)/(4/(-28))? 3 Calculate (-4)/10(-30)/(-24). -1/2 Evaluate 4/(-5)5/2. -2 Evaluate ((-28)/6)/((-210)/315). 7 What is 2/(((-12)/(-16))/((-9)/6))? -4 Calculate (9/((-5265)/(-52)))/(6/27). 2/5 What is the value of (72/(-40))/((-84)/105)? 9/4 What is the value of ((-1)/(-189)3)/((-52)/(-156))? 1/21 Evaluate (13)/(36/(-72)). -6 Evaluate ((-2)/(-10))/(35/25). 1/7 Calculate -5((-40)/25)/4. 2 Calculate (16/(1-2))/((-1368)/684). 4 10/(-2)(-93)/(-1085) -3/7 What is -32/(-30)(-150)/(-10)? 3 Evaluate (-8)/(-3)36/(-16). -6 Calculate 36((-9)/(-9))/6. 6 What is the value of (13/(6435/(-81)))/((-6)/20)? 6/11 What is (-2)/2(4/(-1))/(-4)? -1 Evaluate (9/(-3))/(-1)20/(-20). -3 ((-2)/3)/(5/15) -2 Calculate 56/831/(-12). -7/4 What is the value of ((-1)/(-5))/((-12)/60)? -1 (-1)/3((-21)/(-10))/(-7) 1/10 Calculate ((-36)/8)/38/(-42). 2/7 What is 1/(-4)(-1)/(6/12)? 1/2 What is the value of ((-36)/(-9)-3)/(-4)? 3 What is the value of 3/((-72)/(-160))(-18)/(-30)? 4 ((6/(-8))/3)/((-4)/(-24)) -3/2 What is 12/(-6)21? -4 Calculate (-2)/(2/(-6)(-99)/66). -4 Evaluate (-1)/(((-2)/3)/((-550)/(-75))). 11 (-1)/((-7)/(308/11)) 4 36/(-9)2/(-14) 4/7 Calculate 15/(-605)-112/(-3). -2/11 ((-10)/5012)/(-1) 2/5 What is 12/(-9)(-5)/(-30)? -2/9 What is the value of ((-6)/(36/1))/((-18)/(-24))? -2/9 What is the value of 40/(-100)2/(-1)? 4/5 Evaluate (06/48)/((-9)/(-3)). 0 What is ((-15)/(-10))/(3/10)? 5 What is (-4)/(-11)7/(-14)? -2/11 Calculate -36(91/(-28))/(-13). -9 What is the value of (91/14)/(-13)4/(-10)? 1/5 What is 8/(-12)6/4? -1 What is (-19)/((-95)/2)-15? -6 Evaluate (-3)/(153)(-68)/(-34). -2/15 What is 30/(-528)4(-6)/(-15)? -1/11 Calculate ((-2)/4)/(13/((-91)/14)). 1/4 Calculate (1/(4/(-3)))/(-2). 3/8 What is 10/((-180)/9)(-8)/(-26)? -2/13 Evaluate (-3)/12(-12)/(-6). -1/2 5/8(-24)/180 -1/12 What is -4((-150)/8)/15? 5 What is (78/8)/13-4? -3 ((-12)/(-9))/4(-46)/69 -2/9 Evaluate (1449/(-69))/((-6)/(-2)). -7 What is (16/(-24))/((-1)/(-3)1)? -2 1043/150 4/5 Calculate 6/(-16)(-434)/217. 3/4 Evaluate 8/(-8)(-28)/322. 2/23 What is (2/(8/(-6)))/((-780)/130)? 1/4 What is (7/(147/27))/(2/(-14))? -9 What is (1/(-11)-3)/(291/(-194))? -2/11 Evaluate (20/2)/(32). 5/3 Calculate ((-2)/6)/((-4)/962). 4 What is ((-3)/6)/((-21)/(-126))? -3 Evaluate (5(-4)/(-50))/(22/10). 2/11 What is the value of (3(-2)/3)/2? -1 Evaluate 1/(-3(-7)/29410). 7/5 Evaluate 16/(-20)9/(1386/35). -2/11 What is the value of 13/(-26)21? -1 What is (-8)/(-12)((-75)/(-2))/(-5)? -5 What is the value of ((-5)/25)/(9/30)? -2/3 Calculate 1/2-11(-8)/22. 2 Calculate ((-9)/(-12))/(2/((-128)/(-60))). 4/5 What is ((-32)/(-80))/((-2)/(-30))? 6 (-27)/(-216)16 3/4 Calculate (4/(-16))/((-3)/(-8)). -2/3 ((-22)/11)/(-56/(-3)) -1/5 What is ((-3)/3)/((-5)/(-2))? -2/5 Evaluate (8/(-12))/(2/3). -1 Calculate (175/45)/(-7)(-4)/10. 2/9 Evaluate ((-28)/357)/(4/6). -2/17 Evaluate (1/(-3))/(-61/(-4)). -2/9 Evaluate (2/(-3))/((990/(-216))/(-55)). -8 What is the value of (4/(-10))/(-1(-30)/50)? -2/3 (-4)/2-26/60 2/5 What is the value of (-4)/105(-1)/2? 1 Calculate (-1)/(1/(-2)(-3)/6). -4 (21/(-21))/(6(-1)/(-10)) -5/3 What is the value of 4/((-8)/(-25/1))? 5 Evaluate (-8)/(96/18)220/33. -10 What is the value of (-512/300)/(3/(-15))? 1 ((-7)/(147/36))/(10/35) -6 What is the value of 9/(-5)25/30-2? 3 (18/(-4))/(-165/(-160)) -9 Calculate ((63/(-9))/(-21))/((-25)/(-15)). 1/5 Evaluate (2(-2)/(-10))/(4/5). 1/2 Evaluate (6/(-5))/((-12)/(-30)). -3 Calculate 3/(15/(35/(-7))). -1 Evaluate (-13)/2660/(-5). 6 Evaluate ((-24)/(-80))/(4/(-10)3). -1/4 Evaluate 75/(315/12). 4/3 Calculate (819/(-104))/(-21)(-4)/(-6). 1/4 What is 1/1(-3)/33? -1/11 Evaluate 2/((16/(-14))/((-6)/42)). 1/4 What is the value of (-3)/(-60)10-6? -3 Calculate (-160)/192(-6)/(-15). -1/3 Calculate ((-14)/3)/((-13)/((-546)/140)). -7/5 Calculate (-4)/(-5)(100/8)/5. 2 Evaluate (9/24)/((5/4)/5). 3/2 What is the value of 11/112/2? 1 (11/33)/(2/(-30)) -5 Evaluate (-2(-3)/(-15))/2. -1/5 Evaluate 1/((6/(-12))/(2/(-2))). 2 Evaluate 6/4(-8)/(-20). 3/5 What is -8(-6)/360-6? -4/5 Calculate ((-3)/(42/(-4)))/((-255)/105). -2/17 ((-12)/9)/(6/9) -2 Calculate (-22/4)/(3/(-9)). 3 What is the value of -12/(-35)10? 4/7 What is the value of -88/(-96)(-3)/2? -1 What is (12/(-28))/(6/(-21))4? 6 Evaluate 3/(((-27)/12)/3). -4 What is 4(-5)/(-40)-1? -1/2 What is (8/2405)/((-1)/4)? -2/3 Evaluate (48/6)/72-2. -2/9 What is (-20)/(-6)(-11)/(110/(-12))? 4 Evaluate -2(-12)/(-6)1. -4 (-2)/939/6 -1 Evaluate -35/(-6)38/19. 5 What is ((-114)/(-456))/(1/(-20))? -5 ((-6)/(-5))/((-1)/52) -3 Calculate ((-1)/3)/(((-35)/75)/7). 5 Calculate (-6)/(36/(-27)). 9 ((-5)/(25/4))/(8/(-40)) 4 (-32)/2842/(-24) 2 Evaluate (((-9)/2)/(-9))/(6/12). 1 Evaluate 51/(-10)3/3. -1/2 Calculate 3/(3/2)(-18)/9. -4 What is (-2)/(-12)-472/16? -3 (396/(-165))/(2/20-4) 6 What is ((-96)/600)/((-1)/(2-5))? -8/5 What is 12/(-9)660/(-88)? 10 Evaluate ((-9)/6)/((-5)/((-20)/24)). -1/4 (-4)/(-3)(-39)/26 -2 (-5)/(((-13)/91)/((-2)/14)) -5 Evaluate (17/(1530/40))/(4/18). 2 What is the value of (-77)/771-3? 3 Calculate (-16)/4(-11)/11. 4 12/(-3)-8(-4)/1216 -2/19 What is (-185)/(-74)6/5? 3 Evaluate ((-1)/2)/((-20)/40). 1 Calculate 12/((-9)/(-3))16/(-544). -2/17 What is 5/(10/3)3/18? 1/4 Evaluate ((-3)/(-24)6)/(600/64). 2/25 (((-4)/(-10))/1)/(-2) -1/5 Calculate (50/250)/((-6)/(-40)). 4/3 Evaluate (-84)/(-63)(-2)/(-28). 2/21 ((-3)/2-1)/(120/400) 5 Evaluate (-10)/(-6)7/(56/24). 5 (-2(-60)/(-96))/(-5) 1/4 What is the value of 15/(21/(-14)2)? -5 4536/2439/24 7 What is ((-15)/(-165))/((-1)/2)? -2/11 Evaluate (-720)/(-840)(-2)/(-6). 2/7 Evaluate (-16)/120-53. 2 312/(-26)6/9 -8 What is (16/(-8)1)/(9/1)? -2/9 (-38)/(-133)140/5 8 What is (-76)/(-57)3/8? 1/2 Calculate 2/(-99)72/(-16). 1/11 What is the value of (((-10)/4)/5)/((-9)/3)? 1/6 ((63/(-108))/(-7))/((-9)/(-6)) 1/18 What is the value of 0/(1/((-2)/4))? 0 (5/(-5))/(126/(-12))-9 -6/7 Evaluate (((-1)/((-1)/(-6)))/1)/(-2). 3 Calculate (6/(-10))/((-20)/100). 3 Calculate (60/(-18))/(8/(-12)). 5 Calculate (0/(-5))/(-4)(-1)/1. 0 Calculate 12/(-10)5(-5)/(-225). -2/15 What is the value of (12/3)/((-400)/40)? -2/5 (-4)/6(-9)/(-2) -3 ((76/24)/19)/(4/6) 1/4 Calculate ((-68)/221)/((-4)/26). 2 Calculate 6/(-21)(-98)/7. 4 What is (37/(-259))/(2/(-4))? 2/7 Evaluate 120/50(9/12)/3. 3/5 What is the value of (((-165)/(-20))/(-11))/(15/2)? -1/10 Evaluate 3((-20)/(-6))/5. 2 Evaluate ((-6)/(-21))/(16/112). 2 What is the value of (-3)/1064/288-3? 1/5 What is the value of -	{ "pile_set_name": "DM Mathematics" }
s) = -15s - 4s*2 + 18s + 0s2 + 2. Let h(x) = 5x*2 - 4x - 3. Suppose 0r + 5 = -r. Let p(a) = rh(a) - 6d(a). Let p(w) = 0. What is w? -1, 3 Suppose -8i = -7i + 5, 10r + 4i - 10 = 0. Solve 5/2t*4 + 1 - 3/2t*r + 3/2t - 7/2t2 = 0 for t. -1, -2/5, 1 Suppose -2q - 2n = 10, -5n - 30 = -5q - 5. Let w(u) be the third derivative of 27u*2 + qu + 0 - 7/80u6 + 19/40u5 - u3 - 1/2u4. Factor w(a). -3(a - 2)(a - 1)(7a + 2)/2 Let n(f) = -f2 + 38f - 35. Suppose 187 = 5k - w, -2k - 16w + 15w + 72 = 0. Let q be n(k). Determine l, given that 0l + 0 - 3/7l*q = 0. 0 Let c(y) be the first derivative of 2y*3/21 - 38y*2/7 - 48y - 69. Determine t, given that c(t) = 0. -4, 42 Let n(p) = 3p3 - 180p*2 + 182p + 75. Let w(l) = -4l3 + 270l*2 - 273l - 105. Let y(z) = 7n(z) + 5w(z). Factor y(d). d(d - 1)(d + 91) Factor -2g2 - 126 + 100g - 426 + 354g - 172 - 620. -2(g - 224)(g - 3) Let g(y) = 3y - 78. Let v be g(27). Let o be (-160)/45 + -2 + -2 + 8. Factor -o - 88/9u2 - 50/9u - 14/3uv. -2(u + 1)*2(21u + 2)/9 Let o = -637 + 511. Let l = 129 + o. Factor -3/2p2 + p + 0 - pl + 3/2p4. p(p - 1)(p + 1)(3p - 2)/2 Factor 9k*2 + 47/5 - 1/5k*3 + 93/5k. -(k - 47)(k + 1)2/5 Let z(n) be the second derivative of 3n*7/14 + 10n*6 + 297n*5/5 + 281n*4/2 + 321n*3/2 + 87n*2 - 5n - 751. Find c, given that z(c) = 0. -29, -2, -1, -1/3 Let p(v) be the second derivative of v*5/180 + 1771v*4/36 + 3136441v*3/18 + 5554637011v*2/18 - 36v + 35. Factor p(k). (k + 1771)*3/9 Let b be (1300/(-1430))/((-7)/11). Determine v, given that -10/7v*3 - 8/7 + bv*2 - 2/7v*4 + 2/7v*5 + 8/7v = 0. -2, -1, 1, 2 Let l = -337210/11 - -337246/11. Determine n so that 38/11 - 2/11n2 + ln = 0. -1, 19 Let s(c) = -10 + c + c*2 + 4c + 8c2. Let i(v) = 19v*2 + 10v - 20. Let x = -71 - -80. Let b(m) = xs(m) - 4i(m). Suppose b(a) = 0. What is a? -2, 1 Suppose 0 = -t + n + 15, -t - 3 - 7 = 4n. Suppose a + 2a - 2d = 22, 0 = -a - 2d + t. What is f in 0f3 - 40f + 2f3 - 17f3 + f3 - 46f2 - a = 0? -2, -1, -2/7 Let b(i) = 6i*2 - 3i. Let m(h) = -134h2 + 44h + 120. Let q(l) = -44b(l) - 2m(l). Factor q(x). 4(x - 4)(x + 15) Let o(v) be the third derivative of -v5/630 - v4/21 + 253v3/63 - 1967v*2. Factor o(f). -2(f - 11)(f + 23)/21 Let d be 10/40 + 177/12. Let t be ((-9)/d)/((-3)/15). Determine f, given that -tf*4 - 25f + 22f2 + 4f*4 - 66 + f + 75 - 8f*3 = 0. 1, 3 Find u such that 42/5u*2 + 0 + 3u*3 + 0u - 3/5u4 = 0. -2, 0, 7 Let b(o) be the second derivative of -2o*4 + 0o*2 + 0 - 1/90o*6 - 4/15o5 + o3 + 24o. Let s(w) be the second derivative of b(w). Factor s(k). -4(k + 2)(k + 6) Let p(q) be the first derivative of q6/72 - 5q*5/8 + 35q*4/12 + 26q3/3 - q2 - 18. Let n(f) be the third derivative of p(f). Factor n(t). 5(t - 14)(t - 1) Let m = 3479 + -417479/120. Let y(a) be the third derivative of -1/24a4 + 0a + 0a5 + a2 + 0 + ma*6 + 0a*3. Let y(d) = 0. What is d? -1, 0, 1 Suppose -840 = 496h - 2733h + 5871. Factor -4/5y + 12/5y4 + 4/5y*2 + 4y*h + 0. 4y(y + 1)2(3y - 1)/5 Let u be 12670/350 - 21/10. Let l(k) be the first derivative of -3/4k2 + 0k + 3/20k5 - 3/4k*3 + 0k*4 + u. Determine y, given that l(y) = 0. -1, 0, 2 Let y = 215 - 248. Let z be (-4826)/(-1045) + (-6)/y. Factor -48/5 - zm - 3/5m2. -3(m + 4)*2/5 Let n = 2575/5154 + 1/2577. Factor 1/2 - nx*2 + 0x. -(x - 1)(x + 1)/2 Let h = -182167/117 + 20248/13. Find f, given that -2/3f + 0 + hf3 + 13/9f*2 = 0. -3, 0, 2/5 Suppose 2/9f*3 + 0f + 10/9f2 + 0 = 0. What is f? -5, 0 Let o(r) be the first derivative of -2r*3/3 + 20r*2 + 138r + 765. Determine l, given that o(l) = 0. -3, 23 Suppose -z = 5v + 68, 49z + 52 = -3v + 54z. Let m be (-576)/(-672)v/(-40). Factor -1/10y*2 - m - 2/5y. -(y + 1)(y + 3)/10 Find b such that 0 + 1/2b*4 + 45b + 69/2b2 + 8b3 = 0. -10, -3, 0 Let g(z) be the second derivative of z7/3150 - 17z6/900 - 19z*5/75 + 6z4 - z3/3 - 3z + 20. Let n(r) be the third derivative of g(r). Factor n(q). 4(q - 19)(q + 2)/5 Suppose 281p + 120 = 286p. Suppose 27r - pr - 12 = 0. Factor -9/5v*r + 0 - 3/5v - 3v2 - 21/5v*3. -3v(v + 1)2(3v + 1)/5 Let s = -5/4452 + 1091/636. Factor 16/7v + 0v3 - 2/7v*4 + sv*2 + 6/7. -2(v - 3)(v + 1)3/7 Let r(p) = 4p + 123. Let l be r(-12). Let z be (l/2)/5 - (-42 - -48). Factor 0 - 3w - zw*2. -3w(w + 2)/2 Let r = -709/210 + 107/30. Let q(b) be the second derivative of 0 - 2/21b*3 + 12/7b*2 - rb*4 - 1/35b*5 + 2b. What is c in q(c) = 0? -3, -2, 1 Let x(l) be the third derivative of l*6/280 - 1167l*5/35 + 907926l*4/7 - 1883643808l*3/7 - 6213l*2. Factor x(q). 3(q - 1556)*3/7 Solve -11/2i*2 + 59/4i + 1/4i3 - 19/2 = 0 for i. 1, 2, 19 Let k be 35(-3)/(-15) - 175/(-7). Suppose -10h = -2h - k. Find f, given that -2f2 + 0 + 2/7f*5 + 6/7f*h + 12/7f - 6/7f3 = 0. -3, -2, 0, 1 Let k(u) = -2u - 1. Let v be k(3). Let i(b) = -b*2 + 14. Let h(a) = 2a*2 - 43. Let d(r) = vi(r) - 2h(r). Find p, given that d(p) = 0. -2, 2 Let f(s) be the third derivative of 0 - 1/480s*6 - 1/6s*4 + 0s + 0s3 + 89s*2 - 1/30s*5. Let f(x) = 0. Calculate x. -4, 0 Factor 14/5b*3 - 72/5b*2 + 66/5b - 8/5. 2(b - 4)(b - 1)(7b - 1)/5 Let o(g) be the first derivative of -3g4/16 + 536g*3/3 + 717g*2/2 - 716g - 8613. Let o(s) = 0. Calculate s. -2, 2/3, 716 Let u be -33 + 1 - 411588/(-12051). Factor um + 2/13m*2 + 98/13. 2(m + 7)*2/13 Determine a, given that -15a*3 - 15048/5a - 411a2 - 13068/5 = 0. -66/5, -1 Let h(m) be the second derivative of m7/210 + m6/24 + m5/10 - 51m*2/2 - 4m + 6. Let o(p) be the first derivative of h(p). Factor o(n). n*2(n + 2)(n + 3) Let v be ((4/12)/((-5)/(-2)))/((-9)/(-27)). Let x be 8/(-6)(-9)/30. Factor -7/5c2 + vc*3 + 7/5c - x. (c - 2)(c - 1)(2c - 1)/5 Let h = -17 - -20. Suppose 14 = -hb + 5m, -m = 3b - 18 + 8. Factor -3/2d3 + 0 + 3/2d*b + 3d. -3d(d - 2)(d + 1)/2 Let h(f) be the first derivative of f5/35 - 41f*4/21 + 950f*3/21 - 2166f*2/7 + 274f + 123. Let j(s) be the first derivative of h(s). Factor j(p). 4(p - 19)2(p - 3)/7 Let t(p) = -p*3 - 45p*2 - 88p - 80. Let a be t(-43). Solve 3d5 + 3d*3 - 275 + 557 - 282 - ad*4 = 0. 0, 1 Factor -350j - 679 + 15j2 + 29 - 70 + 5j*3. 5(j - 8)(j + 2)(j + 9) Let y(l) be the second derivative of -l*5/10 - 2l*4/3 + 20l*3/3 + 48l*2 + l + 505. Factor y(x). -2(x - 4)(x + 2)(x + 6) Let c be (21/6 - 5)-2. Let n(u) be the first derivative of -6u + u + u*5 + 2u*2 - cu*3 + 29 + 2u*2 - 2u*4 + 9u. Solve n(i) = 0. -1, -2/5, 1, 2 Factor -448l3 + 123l*4 - 23l*5 + 24l*5 + 99l*4 - 224 + 326l + 121l + 2l2. (l - 1)3(l + 1)(l + 224) Let z(o) = 415 + 317 - 96 + 64 + 53o2 + 2797o. Let d(x) = -26x2 - 1399x - 350. Let g(s) = 13d(s) + 6z(s). Suppose g(r) = 0. What is r? -70, -1/4 Let l(m) be the first derivative of m*4/60 - 2m3/15 - m2/2 - 45m + 68. Let t(w) be the first derivative of l(w). Factor t(v). (v - 5)(v + 1)/5 Suppose -33750 + 1125/2g2 - 115/2g*3 + 3375/2g + 3/2g4 = 0. Calculate g. -20/3, 15 Let t(g) be the third derivative of g8/504 - 478g*7/315 - 959g*6/180 - 16g*5/3 + 6g*2 + 212. Factor t(j). 2j*2(j - 480)(j + 1)2/3 Factor -2/9g*2 - 628/9g + 1264/9. -2(g - 2)(g + 316)/9 Let w = -18/16561 - -596322/115927. Factor -3/7b4 - wb*2 + 0 - 18/7b*3 - 24/7b. -3b(b + 2)*3/7 Let h = 76188/5 - 15180. Factor 10r*2 + h - 2/5r*3 - 336/5r. -2(r - 12)2(r - 1)/5 Find h such that 0 - 16/5h - 156/5h*3 - 64h*2 = 0. -2, -2/39, 0 Factor -32/3g*3 - 2/9g*4 + 0 - 94/9g*2 + 0g. -2g2(g + 1)(g + 47)/9 Let x = 9 - 1626. Let y be 7 - (4/(-30) + x/(-315)). Factor 5/2a*y + 125/6 + 25/2a + 1/6a3. (a + 5)3/6 Let a(f) be the first derivative of -2f*3/21 - 6f*2/7 + 320f/7 - 3834. Factor a(t). -2(t - 10)(t + 16)/7 Factor 904/5n - 2/5n*2 - 102152/5. -2(n - 226)*2/5 Factor 0q - 1/2q3 - 40q2 + 0. -q2(q + 80)/2 Let j(t) = 2t*2 - 8t +	{ "pile_set_name": "DM Mathematics" }
30g Collect the terms in 694d*3 - 661d*3 - 25d*2 - 30d*2 - 33d*2 + 88d*2. 33d*3 Collect the terms in 701f*3 - 2822f*3 + 678f*3 + 638f*3 - 2f*2 + 698f*3. -107f*3 - 2f*2 Collect the terms in 7c + 4c - 35c + 2c + 10c + 13c. c Collect the terms in -4282 + 0c*2 - 6452 + 5c*2. 5c*2 - 10734 Collect the terms in 19n*2 + 84n + 105n + 81n + 85n - 355n. 19n2 Collect the terms in -113833a*2 + 3241a - 3241a. -113833a*2 Collect the terms in -p - 70 - 28 + 369 + 180 + 207. -p + 658 Collect the terms in -3720v*2 - 1190v*2 - 3280v*2 + 317v*2. -7873v*2 Collect the terms in -712m*2 - 276 + 601 - 330. -712m*2 - 5 Collect the terms in 1633945v - 3267695v + 1633760v. 10v Collect the terms in 16 + 1421i + 8 + 13833i. 15254i + 24 Collect the terms in 28 - 7r3 - 200844r*2 - 291 + 3r + 200844r2. -7r*3 + 3r - 263 Collect the terms in -6318939w - 1159587w - 11950742w. -19429268w Collect the terms in 3h2 + 6505 - 6874 + 3h*2. 6h*2 - 369 Collect the terms in 111n + 22n + 5n - 31n + 23n - 47n. 83n Collect the terms in 23y2 - 21749192244383 + 21749192244383. 23y*2 Collect the terms in -38305226 + 13n + 38305226. 13n Collect the terms in -80w*3 - 21w - 285w3 - 12w*2 + 22w - 323w3. -688w*3 - 12w*2 + w Collect the terms in 189p*3 - 195p*3 - 697p*2 - 335p*3 + 698p*2 - 111p*3. -452p3 + p2 Collect the terms in 307z - 1499z + 289z + 309z + 289z + 306z. z Collect the terms in -2540 + 54i + 2496 + 13613 - 53i. i + 13569 Collect the terms in 0 - 811486b + 0 - 1640894b. -2452380b Collect the terms in -s2 + 4s*2 - 7s2 - s3 + 38s + 164s. -s*3 - 4s*2 + 202s Collect the terms in -1467 + 294 + 296 + 291 - 25d + 294 + 294. -25d + 2 Collect the terms in -c - 64c2 + 28383794 - 28383794. -64c*2 - c Collect the terms in 6 + 0 - 4 + 12 - 2 + 2d*2 + 5d. 2d2 + 5d + 12 Collect the terms in 14j2 + 2382583 + 174j - 2382588 - 174j. 14j*2 - 5 Collect the terms in 16q - 1113335883 + 17q2 + 1113335883. 17q*2 + 16q Collect the terms in -3144o3 + 1787o*3 - 502o*3 - 175o*3 - 3137o*3. -5171o*3 Collect the terms in -339b - 332b - 373b - 335b - 339b + 2052b - 330b. 4b Collect the terms in -7n*2 + 2 + 0 - n - 2 + 0 - 1. -7n*2 - n - 1 Collect the terms in 3l + 193085390l2 - 193085387l*2 + 6l*3 + 12l. 6l3 + 3l*2 + 15l Collect the terms in 3 + 56d3 + 18715726d*2 - 18715726d*2 - 30d*3. 26d*3 + 3 Collect the terms in 1 + 2o + 860o2 - 4503o*2 - 6o. -3643o2 - 4o + 1 Collect the terms in 97i2 + 43 - 249i*2 - 7 + 55i*2. -97i*2 + 36 Collect the terms in 7618q - 15294q + 7595q. -81q Collect the terms in 2769 + 5j - 5j + 7j*3 - 3220. 7j*3 - 451 Collect the terms in -4h*2 + 0h*2 + 3h + 11h2 - 10602. 7h*2 + 3h - 10602 Collect the terms in -560v + 9v*3 - 552v - 562v + 1665v. 9v3 - 9v Collect the terms in -s + s - 417s2 + 807s*2 - 1502s*2. -1112s*2 Collect the terms in -57255 + 112947 + 7l - 55692. 7l Collect the terms in 2376w*2 + 93w - 93w + 3153w*2. 5529w*2 Collect the terms in 113030w + 3w2 + 120w*3 - 2w*2 + 0w*2 - 113030w. 120w3 + w2 Collect the terms in 2328t*2 + 2951t*2 - 1261t*2. 4018t*2 Collect the terms in -5294s*3 + 1759s*3 + 1 - 1 - 2989s*3. -6524s*3 Collect the terms in 43728g - 3824g + 16675g. 56579g Collect the terms in -8 + 10 - 6 - 3v - 5 + 9 + 0. -3v Collect the terms in 418a - 1538a + 5609a - 1630a. 2859a Collect the terms in 34075f2 + 4 - 7 + 2 + 74230f*2 + 0. 108305f*2 - 1 Collect the terms in -482977 - 411t*2 + 482977. -411t*2 Collect the terms in 2 + 1 + 0 - 7920200b. -7920200b + 3 Collect the terms in -12314k + 20 - 11850k + 23419k. -745k + 20 Collect the terms in -3r*3 + 7936683r - 7936683r. -3r*3 Collect the terms in 2738q + 4823q - 2083q - 12q2 + 13q2. q2 + 5478q Collect the terms in 49045b + 29b3 + 2b*3 - 920b*2 - 49045b + 920b2. 31b*3 Collect the terms in 2378849i + 5i2 - 2378849i. 5i2 Collect the terms in -61s - 712731419882 + 712731419882. -61s Collect the terms in 12449 + 12437 + 12464 + 12446 - 62251 + 5r + 12455. 5r Collect the terms in 2 - 1 + 169534d*2 + 161d*3 - 169534d*2. 161d*3 + 1 Collect the terms in 30 + 29 + 78018z - 56. 78018z + 3 Collect the terms in -13m*2 - 7m*2 - 9m*2 - 3615943413 + 3615943413. -29m*2 Collect the terms in -5b + 113 + 35 + 129 - 257. -5b + 20 Collect the terms in -i3 - 3i*3 + 76409i - 80108i - 213121i. -4i3 - 216820i Collect the terms in -119a3 - 510a*2 - 121a*3 - 120a*3 + 366a*3 - 93a*2. 6a*3 - 603a*2 Collect the terms in 16852j - 33699j + 16846j - 292. -j - 292 Collect the terms in -2600p + 647p - 194p3 + 647p + 657p + 649p. -194p3 Collect the terms in -32581b + 16380b + 17258b. 1057b Collect the terms in 421516z*2 - 841877z*2 + 422204z*2. 1843z*2 Collect the terms in -41 - 16a + 20a + 43 + 23a + 80. 27a + 82 Collect the terms in -7992y - 4y2 - 8000y + 16007y + 0y*2. -4y*2 + 15y Collect the terms in -716 - 710 + 2137 + 9t + 11t - 712. 20t - 1 Collect the terms in -455372a*3 + 910969a3 + a2 - a*2 - 455590a*3. 7a*3 Collect the terms in 631x - 331x - 799x + 499x + 2x*3. 2x*3 Collect the terms in 147 + 12049h - 11941h - 70 - 74. 108h + 3 Collect the terms in 147n3 + 52665 - 52665 - n. 147n*3 - n Collect the terms in 54 + 484u - 82 + 29. 484u + 1 Collect the terms in 778t - 30405 + 30405. 778t Collect the terms in -803a*2 - 873a*2 + 7a*3 + 2578a*2 - 902a*2. 7a*3 Collect the terms in -131477g + 65719g + 65758g + g2. g2 Collect the terms in 268065s3 - 1 - 268072s*3 + 3. -7s*3 + 2 Collect the terms in 64380d - 23 - 32143d - 32145d - 2d2. -2d*2 + 92d - 23 Collect the terms in 8927 - 14f3 - 17935 + 12f*3 + 9008 - 19f. -2f3 - 19f Collect the terms in -866g + 2130g - 1279g. -15g Collect the terms in -15402w - 15396w - 15392w + w3 - 15394w + 61584w. w3 Collect the terms in 16543c*3 - 5519c*3 - 5518c*3 - 5508c*3 + 90. -2c*3 + 90 Collect the terms in -190 + 141m - 190 + 601 - 173. 141m + 48 Collect the terms in -3058b - 12163b - 2107b. -17328b Collect the terms in 4520522a + 4520536a - a2 - 9041219a. -a*2 - 161a Collect the terms in 3i2 - 5i2 - i2 + 1208i3 + 4782i*3. 5990i*3 - 3i*2 Collect the terms in -25387604432 + 16p + 25387604432. 16p Collect the terms in 17x + 24x + 15x - 95x + 3x + 11x. -25x Collect the terms in -596q3 - 613q*3 - 17695 + 17695 + 1210q3. q3 Collect the terms in 10p + 19p - 7p2 - 52 + 21p - 50p. -7p*2 - 52 Collect the terms in -1102s + 539s2 + 2201s - 1099s. 539s*2 Collect the terms in -233887526836101 + g + 233887526836101. g Collect the terms in -1544z - 4335z + 3601z. -2278z Collect the terms in u3 - 31381u*2 + 31383u*2 - 208u*3. -207u*3 + 2u*2 Collect the terms in 34g + 96 - 109 + 39g. 73g - 13 Collect the terms in 8105h - 16255h + 3 + 8152h. 2h + 3 Collect the terms in 4966x + 4992x - 14953x + 4975x. -20x Collect the terms in -31z + 6897 + 29z + 34242. -2z + 41139 Collect the terms in -932646277629 + 3a3 + 932646277629. 3a*3 Collect the terms in -8s*3 - 36s*3 + 19s + 881s2 - 881s*2 - 6s*3. -50s*3 + 19s Collect the terms in 5 + 71670j - 1 - 4. 71670j Collect the terms in 5520i + 2258i + 1967i. 9745i Collect the terms in 731367g - 184 - 174 + 367 - 731362g. 5g + 9 Collect the terms in 23248z*3 + 23175z*3 - 69391z*3 + 23164z*3. 196z*3 Collect the terms in 815w*2 + 247299w - 247299w. 815w*2 Collect the terms in -1753 + 1119 + 2j - 5j + 634. -3j Collect the terms in -104a + 26919a*3 + 104a + 51635a3. 78554a*3 Collect the terms in -77404f*2 - 56078 + 56080 + 77327f*2. -77f*2 + 2 Collect the terms in -72803r - 234212r + 69387r - 2r2. -2r*2 - 237628r Collect the terms in -5 - 922w3 + 5 - 898w*2 + 936w*3. 14w*3 - 898w*2 Collect the terms in -24 + 17 + 20 + 115h - 19 +	{ "pile_set_name": "DM Mathematics" }
icking 1 u and 1 p when two letters picked without replacement from nupnwuuuppguwiwpwuup. 7/38 Two letters picked without replacement from wnwwn. Give prob of picking 1 n and 1 w. 3/5 Two letters picked without replacement from wimzzsm. Give prob of picking 2 z. 1/21 Calculate prob of picking 1 x and 1 a when two letters picked without replacement from {a: 5, x: 5, q: 4}. 25/91 What is prob of picking 2 b when two letters picked without replacement from xxybxyyyyxxbbyx? 1/35 Calculate prob of picking 1 n and 1 c when two letters picked without replacement from {c: 2, v: 4, b: 6, n: 1, z: 3}. 1/60 Four letters picked without replacement from mxcmmmxx. What is prob of picking 4 c? 0 Four letters picked without replacement from {c: 5, t: 3}. What is prob of picking 3 c and 1 t? 3/7 Calculate prob of picking 3 w and 1 s when four letters picked without replacement from swsssww. 4/35 Three letters picked without replacement from {o: 7}. Give prob of picking 3 o. 1 Three letters picked without replacement from ppppnppppnppppn. What is prob of picking 3 p? 44/91 What is prob of picking 3 b when three letters picked without replacement from fbbbuuupwufvbuf? 4/455 Four letters picked without replacement from wwiwwuuwwiuwwwwowww. What is prob of picking 1 u, 1 w, 1 i, and 1 o? 13/646 Three letters picked without replacement from effa. Give prob of picking 1 e, 1 a, and 1 f. 1/2 Calculate prob of picking 4 x when four letters picked without replacement from xxxxhxxxxxxxxxm. 11/21 Calculate prob of picking 1 r, 1 f, and 1 y when three letters picked without replacement from rccrcrrrrfmcoocrryrc. 3/380 What is prob of picking 2 r and 2 b when four letters picked without replacement from {r: 4, b: 2, c: 3}? 1/21 What is prob of picking 1 n, 1 i, and 1 m when three letters picked without replacement from {m: 2, i: 1, n: 1}? 1/2 Calculate prob of picking 1 g and 1 s when two letters picked without replacement from wssgssmssggs. 7/22 What is prob of picking 2 w and 1 g when three letters picked without replacement from {g: 1, i: 1, w: 2, q: 1}? 1/10 Calculate prob of picking 1 d and 1 w when two letters picked without replacement from japjpppwjpd. 1/55 Calculate prob of picking 2 z when two letters picked without replacement from {l: 2, z: 2, d: 2, b: 3}. 1/36 Calculate prob of picking 2 i when two letters picked without replacement from {c: 6, f: 1, i: 4}. 6/55 Two letters picked without replacement from edcccxceeed. What is prob of picking 1 e and 1 d? 8/55 Calculate prob of picking 1 t, 1 g, and 1 k when three letters picked without replacement from tghftyfk. 1/28 Four letters picked without replacement from undvupdnffnu. Give prob of picking 2 f, 1 n, and 1 d. 2/165 Four letters picked without replacement from ffffaffaaafafafa. Give prob of picking 4 f. 9/130 Two letters picked without replacement from {c: 5, x: 2, d: 1, i: 1}. Give prob of picking 2 c. 5/18 What is prob of picking 2 b and 1 g when three letters picked without replacement from {k: 2, b: 3, g: 12}? 9/170 Calculate prob of picking 1 t and 1 u when two letters picked without replacement from uuqqtuuqqq. 4/45 Two letters picked without replacement from {b: 6, m: 12}. Give prob of picking 2 m. 22/51 Three letters picked without replacement from {n: 5, f: 1, c: 3}. Give prob of picking 2 n and 1 c. 5/14 Two letters picked without replacement from ouwuyulyyulu. What is prob of picking 1 y and 1 w? 1/22 What is prob of picking 3 o when three letters picked without replacement from {j: 6, o: 4, p: 5}? 4/455 What is prob of picking 1 f and 3 x when four letters picked without replacement from {x: 8, f: 5}? 56/143 What is prob of picking 3 t when three letters picked without replacement from ttiittiitttit? 28/143 Two letters picked without replacement from jpjczhzcrjc. What is prob of picking 1 z and 1 r? 2/55 Three letters picked without replacement from pppppwwwpwpwp. What is prob of picking 3 w? 5/143 Four letters picked without replacement from tuitiiuuuutiuttuttut. What is prob of picking 2 u and 2 t? 784/4845 Three letters picked without replacement from {f: 3, l: 5, b: 1, c: 3, i: 1}. What is prob of picking 1 c, 1 f, and 1 l? 45/286 What is prob of picking 1 i and 1 w when two letters picked without replacement from wihwhfclfwwwi? 5/39 Calculate prob of picking 2 w when two letters picked without replacement from {w: 9}. 1 What is prob of picking 1 o and 1 j when two letters picked without replacement from {a: 1, o: 1, j: 2}? 1/3 Two letters picked without replacement from {p: 3, s: 1}. Give prob of picking 2 p. 1/2 Calculate prob of picking 1 a and 1 c when two letters picked without replacement from ddxdxcxztdaa. 1/33 What is prob of picking 1 a and 1 f when two letters picked without replacement from afnai? 1/5 Three letters picked without replacement from aooaaaaaaoo. What is prob of picking 3 a? 7/33 What is prob of picking 1 y and 1 a when two letters picked without replacement from {a: 5, y: 12, i: 1}? 20/51 Calculate prob of picking 1 b and 1 s when two letters picked without replacement from {q: 7, b: 2, a: 1, c: 7, s: 1}. 2/153 Three letters picked without replacement from {o: 6, z: 3, f: 3, y: 2, k: 2, r: 2}. What is prob of picking 3 f? 1/816 What is prob of picking 1 w, 1 m, and 1 u when three letters picked without replacement from kmmffflmfmwmmmuffmfw? 4/285 Four letters picked without replacement from {f: 4, v: 3, y: 6, r: 2}. What is prob of picking 3 f and 1 r? 8/1365 What is prob of picking 1 h, 1 p, and 1 t when three letters picked without replacement from {t: 3, p: 4, h: 3, u: 4, x: 1, n: 2}? 9/170 Four letters picked without replacement from eneenjnaanjnajaaji. What is prob of picking 3 e and 1 n? 1/612 Two letters picked without replacement from {x: 1, i: 1, h: 1, n: 1, y: 1, d: 2}. What is prob of picking 1 h and 1 n? 1/21 What is prob of picking 1 t and 1 n when two letters picked without replacement from {s: 2, j: 1, a: 1, l: 5, n: 3, t: 1}? 1/26 What is prob of picking 1 c and 1 n when two letters picked without replacement from creknkrkrrnrz? 1/39 Two letters picked without replacement from {u: 8, g: 2}. What is prob of picking 2 u? 28/45 Four letters picked without replacement from {i: 12, s: 4, l: 4}. Give prob of picking 1 s, 1 i, and 2 l. 96/1615 Three letters picked without replacement from {l: 7, y: 6}. Give prob of picking 3 l. 35/286 What is prob of picking 2 m, 1 t, and 1 j when four letters picked without replacement from {m: 4, j: 2, t: 3}? 2/7 Four letters picked without replacement from {u: 11, q: 1, e: 3, h: 5}. Give prob of picking 1 h and 3 e. 1/969 Three letters picked without replacement from {t: 1, b: 1, v: 14}. Give prob of picking 2 v and 1 t. 13/80 Three letters picked without replacement from uuoutuo. Give prob of picking 3 u. 4/35 What is prob of picking 2 e and 2 m when four letters picked without replacement from ebmmhenbeemqqn? 18/1001 Four letters picked without replacement from voorznono. What is prob of picking 2 n, 1 z, and 1 r? 1/126 Calculate prob of picking 2 i and 1 y when three letters picked without replacement from eeiyiyieeeeeyiy. 24/455 Calculate prob of picking 1 f, 1 y, and 2 v when four letters picked without replacement from vwywfwv. 1/35 Four letters picked without replacement from {e: 2, j: 2, m: 2, i: 4, d: 2}. What is prob of picking 1 m, 1 i, and 2 j? 8/495 Two letters picked without replacement from {q: 1, b: 1, z: 1, y: 2, v: 1, c: 1}. What is prob of picking 1 c and 1 y? 2/21 Calculate prob of picking 2 k when two letters picked without replacement from {q: 9, k: 5}. 10/91 Calculate prob of picking 2 m when two letters picked without replacement from {p: 1, j: 3, a: 2, m: 4, z: 2}. 1/11 Calculate prob of picking 3 l when three letters picked without replacement from {l: 5, z: 2}. 2/7 What is prob of picking 2 s and 1 n when three letters picked without replacement from mzimmnissim? 1/165 Two letters picked without replacement from {s: 1, m: 2, n: 1, y: 1, b: 1, a: 2}. What is prob of picking 1 b and 1 a? 1/14 Two letters picked without replacement from {r: 1, u: 10, q: 2, v: 1}. What is prob of picking 1 u and 1 v? 10/91 Two letters picked without replacement from unnnnu. Give prob of picking 1 u and 1 n. 8/	{ "pile_set_name": "DM Mathematics" }
at 4p - 9p*3 + 7pm + p3 = 0. -2, 0, 2 Let z be 195/(-126) - (-1)/(-2). Let b = -12/7 - z. Factor 0 + 1/3k - bk*2. -k(k - 1)/3 Let s(i) = 3i3 + 6i*2 + 3i. Let m(f) = -14f3 - 42f*2 - 4f*3 - 3f*3 - 21f. Let d(a) = 2m(a) + 15s(a). Find y, given that d(y) = 0. -1, 0 Let h(r) be the first derivative of 39r4/2 + 62r*3/3 + 4r*2 + 2r + 5. Let o(v) = -77v3 - 61v*2 - 7v - 1. Let t(d) = 5h(d) + 6o(d). Factor t(a). -2(2a + 1)*2(9a - 2) Let j(m) be the third derivative of m9/20160 - m7/560 + m6/120 - m5/20 - 3m*2. Let c(h) be the third derivative of j(h). Suppose c(s) = 0. What is s? -2, 1 Factor 2l*4 + 4l - 3l3 - l3 + 2l*4 - 4l*2. 4l(l - 1)2(l + 1) Factor 1/2j4 + 0 - j + 5/2j*2 - 2j*3. j(j - 2)(j - 1)2/2 Suppose -h = -7h + 12. Factor 0 - hv3 - 6/5v*4 + 2/5v - 2/5v2. -2v(v + 1)2(3v - 1)/5 Let f = 5945/4 + -1494. Let b = f - -8. Let bk*2 + 0 + 1/2k*3 + 1/4k*4 + 0k = 0. Calculate k. -1, 0 Let f(q) = -12q4 - 6q*3 - 2q - 4. Let t(b) be the first derivative of b5/5 + b3/3 + b*2/2 - 4. Let z(n) = f(n) + 8t(n). Let z(g) = 0. Calculate g. -2, -1, 1/2, 1 Let i(t) be the first derivative of -35t6/6 + 9t*5 - 5t*4/2 - 22. Solve i(d) = 0 for d. 0, 2/7, 1 Factor 129z + 9246z + 750z*3 - 50z*4 + 125z*4 + 3750z*2 + 9375 + 3z*5. 3(z + 5)*5 Let p = -1313/5 - -263. Factor -4/5 + ps*2 + 2/5s*4 - 6/5s*3 + 6/5s. 2(s - 2)(s - 1)*2(s + 1)/5 Factor 3y + 1/5y*3 - 9/5 - 7/5y2. (y - 3)2(y - 1)/5 Let w(z) be the first derivative of -2z*5/15 + 2z*4/3 - 2z*3/3 - 4z*2/3 + 8z/3 - 2. Let w(t) = 0. What is t? -1, 1, 2 Let d be (-25)/(-75)(1 - 1). Factor -3/2j*2 - 3/2j + 3/2j4 + d + 3/2j*3. 3j(j - 1)(j + 1)2/2 Let i(f) be the first derivative of -f4/4 + f*2/2 + 58. Determine s so that i(s) = 0. -1, 0, 1 Let 1/2v*2 + 32 + 8v = 0. What is v? -8 Let -2/3i3 + 0i*2 + 0 + 2/3i = 0. Calculate i. -1, 0, 1 Suppose 9 = 5u - 36. Let g = u + -5. Let 0q*2 - 2/3 + 4/3q*3 + 2/3q*g - 4/3q = 0. Calculate q. -1, 1 Let w(g) = -g*3 + g. Let i(b) = 16b*4 + 17b*3 - 23b*2 - 8b - 2. Let m(y) = 2i(y) - 14w(y). Find v such that m(v) = 0. -2, -1/4, 1 Suppose 376y - 80y*4 - 20y*3 + 134y*4 + 612y*2 + 398y3 + 80 = 0. Calculate y. -5, -2/3 Let r(j) be the second derivative of -j6/195 - 3j5/130 + 21j. Find u such that r(u) = 0. -3, 0 Let a be 2/5 - 48/20. Let u = 5 + a. Factor -3g3 - 2 + g2 - 7g*2 - 6g + g*u. -2(g + 1)*3 Let z = -44 - -44. Let m(g) be the third derivative of 5/72g*4 - 1/9g*3 + zg - 3g2 + 0 - 1/60g*5. Find j, given that m(j) = 0. 2/3, 1 Let i(f) be the second derivative of -1/5f*5 + 1/3f*3 + 1/15f*6 + 1/21f7 + f2 - 1/3f4 + 0 - 4f. Factor i(t). 2(t - 1)2(t + 1)*3 Let n = -104/5 - -22. Factor 3/5 + 0d*3 + 3/5d*4 - nd*2 + 0d. 3(d - 1)2(d + 1)*2/5 Factor -8x*3 - 6x*3 + 19x*3 + 3x - 6x3 - 2x*2. -x(x - 1)(x + 3) Let w(m) be the second derivative of 1/2m*3 - 1/10m*6 - 2m - 3/20m5 + 0m*2 + 1/4m*4 + 0. Find f such that w(f) = 0. -1, 0, 1 Let z(j) = 129j*3 + 81j*2 - 21j - 21. Let h(g) = -13g3 - 8g*2 + 2g + 2. Let p(t) = -21h(t) - 2z(t). Solve p(k) = 0. -2/5, 0 Let i(j) be the third derivative of 0j3 + 1/84j*4 + 0j*5 + 0j + j*2 - 1/420j*6 + 0. Factor i(m). -2m(m - 1)(m + 1)/7 Let p(q) = 10q3 - 2q*2 - 10q + 2. Let i(o) = -9o3 + 2o*2 + 10o - 1. Let w(l) = -6i(l) - 5p(l). What is k in w(k) = 0? -1, -1/2, 2 Let l(u) be the third derivative of -u7/1050 - u6/200 - u5/100 - u4/120 - 8u2. Factor l(z). -z(z + 1)*3/5 Let k(m) be the first derivative of 2m*3/33 - 16m*2/11 + 128m/11 + 3. Factor k(y). 2(y - 8)2/11 Find g such that 2/3g*3 + 0 + 2/3g*2 - 2/3g*4 - 2/3g = 0. -1, 0, 1 Let o(a) be the third derivative of -a6/240 - a5/60 + a*4/16 - 18a*2. Find x such that o(x) = 0. -3, 0, 1 Let n(u) = -4u*5 + 20u*4 + 4u*3 - 20u2. Let z(v) = -v5 + 4v4 + v3 - 4v*2. Let f(l) = -3n(l) + 16z(l). Factor f(q). -4q*2(q - 1)*2(q + 1) Factor 7/4w2 - 3/4w + 1/4w4 - 5/4w*3 + 0. w(w - 3)(w - 1)2/4 Let 832/7p - 544p2 + 896p*3 - 1372p*5 + 196p4 - 64/7 = 0. What is p? -1, 2/7 Let h(z) be the first derivative of -z5/270 + z*4/108 + 2z*3/27 + 7z*2/2 + 4. Let v(a) be the second derivative of h(a). Suppose v(c) = 0. What is c? -1, 2 Let p be (-20)/(-42)54/45. Factor py - 4/7y*3 + 2/7 - 2/7y*2. -2(y - 1)(y + 1)(2y + 1)/7 Let q(x) be the third derivative of -x8/40320 - x7/3360 + x5/60 - 4x2. Let j(z) be the third derivative of q(z). Let j(a) = 0. Calculate a. -3, 0 Let p(i) = i2 - i. Let u be p(-1). Factor u + 0 - 2 + s4. s4 Suppose 5a = 6a + 1, a + 13 = 3f. Let u(w) be the first derivative of 2 + fw + 2w5 - 3w*2 - 14/3w*3 + 3/2w*4. Determine q so that u(q) = 0. -1, 2/5, 1 Let w = -661/20 - -137/4. Find b, given that wb*2 - 6/5 - 16/5b = 0. -1/3, 3 Let y = 30 + -30. Let s = 172/405 + -2/81. Factor 2/5n2 + y - sn. 2n(n - 1)/5 Let v(a) = 4a3 - 2a*2 + 2a - 1. Let o be v(1). Suppose og - 8 = -g. Factor 3q*g - 2q*3 + 5q*3 - 3q - 2q4 - q4. -3q(q - 1)2(q + 1) Let o = 38/21 - -6/7. Let -o - 2/3p2 - 8/3p = 0. Calculate p. -2 Let r(v) be the third derivative of v5/330 - v4/33 + v*3/11 + 29v*2. Let r(k) = 0. What is k? 1, 3 Let n(p) be the third derivative of 0 - 1/15p*3 + 1/20p*4 - 1/50p*5 + 0p + 1/300p6 + 4p*2. Let n(v) = 0. Calculate v. 1 Let a be (-3)/4(-8)/(-1). Let h be (a/10)/(2/(-10)). Factor -2mh + 7/4m*2 - 4m*4 + 0 - 1/4m. -m(m + 1)(4m - 1)2/4 Let s be (126/(-105))/(3/(-5)). Factor 4/3c*s + 0 + 2/3c*3 + 2/3c. 2c(c + 1)2/3 Let a(k) be the third derivative of -k5/180 + k4/36 - k3/18 + 7k2. Solve a(p) = 0. 1 Let u(r) = -2r*2 + 3r + 5. Let l(j) = -2j2 + 2j + 6. Let x(o) = 3l(o) - 2u(o). Find m, given that x(m) = 0. -2, 2 Let k(p) be the first derivative of -p*6/3 + 6p5/5 - p4 - 4p3/3 + 3p*2 - 2p - 2. Suppose k(y) = 0. Calculate y. -1, 1 Let y(u) be the third derivative of -u7/2520 + u5/360 - u3/3 + u2. Let w(o) be the first derivative of y(o). Find t, given that w(t) = 0. -1, 0, 1 Suppose -5s - 22 + 84 = -4z, -5z + 5 = 2s. Factor -sk2 + 20k*2 - 9k*2 - 1. (k - 1)(k + 1) Let i(u) be the first derivative of -u6/120 + u5/30 + u4/24 - u3/3 - u*2/2 + 1. Let o(d) be the second derivative of i(d). Factor o(w). -(w - 2)(w - 1)(w + 1) Factor 0 + 3/4x*2 - 3/4x*3 + 3/2x. -3x(x - 2)(x + 1)/4 Let r(p) = -p2 + 4p - 1. Let u(v) = v*2 - 3v + 1. Let t(f) = -5r(f) - 6u(f). Let x be t(-1). Find l such that -3l + 2 - 1 - 4l*2 + xl = 0. -1, 1/4 Let b(u) be the third derivative of u6/240 + u5/120 - u*4/24 + 10u*2. Solve b(g) = 0 for g. -2, 0, 1 Suppose 7d - 5 = 6d. Suppose -dv = -v - 20. Find u, given that -6u3 - 2u*5 + 4u*4 + 2u*2 + 0u*v + 2u*4 = 0. 0, 1 Let o(j) be the third derivative of 1/6j*3 + 0j - 1/60j5 + 0 + 2j*2 + 0j*4. Factor o(d). -(d - 1)(d + 1) Let r(n) be the second derivative of n5/120 + n4/12 + n*3/3 - 3n*2/2 - 2n. Let d(l) be the first derivative of r(l). Solve d(f) = 0 for f. -2 Let k(p) = -p3 - p2 - 2p - 2. Let y be k(-2). Let z be 4/(-6) - (-4)/y. Solve 1/2h*2 + 0h + 9/4h5 + z - 3h*4 + 1/4h*3 = 0. -1/3, 0, 2/3, 1 Let w(q) be the second derivative of 2q + 1/3q4 - 3/10q*5 + 0q*2 + 0 + 0q*3. Find x, given that w(x) = 0. 0, 2/3 Let k(f) = 3f*2 + 22f - 144. Let m(i) = -26i2 - 175i + 1152. Let p(d) = -51k(d) - 6m(d). Factor p(n). 3(n - 12)2 Factor 0 + 17/3s*4 - 5/3s*5 - 7s*3 - 2/3s + 11/3s2. -s(s - 1)*3(5s - 2)/3 Let t = -6 + 5. Let y be (-2 - t)/((-3)/4). Solve -j3 + yj + 0j2 + 0 - 1/3j*4 = 0 for j. -2, 0, 1 Factor -48k - 30k3 - 2/5k*5 - 72/5 - 6k*4 - 58k*2. -2(k + 1)*3(k + 6)*2/5 Suppose -14 - 13 = -9k. Let i(v) be the second derivative of 0vk + 0v*2 - 3v + 0 - 1/30v6 + 0v*4 + 1/84v*7 + 1/40v5. Factor i(j). j3(j - 1)2/2 Let d(p) be the first derivative of p8/840 - p*3/3 - 1. Let n(x) be the third d	{ "pile_set_name": "DM Mathematics" }
q) = -3q2 + 21039q - 105206. Determine t(5). -86 Let m(u) = -318u - 19997. Calculate m(-63). 37 Let s(h) = -h2 + 94862h - 4930122. What is s(52)? -2 Let h(z) = -185z2 - 1026z + 4. Calculate h(-4). 1148 Let w(b) = 10b2 + 85b - 11. Determine w(-7). -116 Let d(f) = f*2 - 571f - 11783. Calculate d(-20). 37 Let p(g) = 5g2 + 10g - 6894. Determine p(-38). -54 Let z(j) = j*2 + 378j + 3282. Calculate z(-7). 685 Let u(z) = -1049z - 123781. What is u(-118)? 1 Let f(n) = 2n*2 - 30205n + 1385183. Calculate f(46). -15 Let v(p) = 23p2 + 624p + 229. Calculate v(-27). 148 Let q(h) = 2h3 - 30h*2 + 150h + 344. What is q(10)? 844 Let v(n) = -7n2 + 175n + 39. Calculate v(29). -773 Let t(i) = -17i2 + 1595i - 5946. Give t(90). -96 Let l(j) = -425j + 9361. Give l(22). 11 Let s(o) = -1104o*3 + 2o*2 + 485o - 487. Give s(1). -1104 Let s(z) = -2z3 - 17z*2 + 3z + 358. Determine s(-13). 1840 Let a(y) = 3761y + 18788. What is a(-5)? -17 Let d(j) = 74267j + 222802. Give d(-3). 1 Let y(a) = -112a - 447. Give y(-8). 449 Let x(k) = -31699k + 158506. Give x(5). 11 Let l(t) = 195t + 28025. Calculate l(-142). 335 Let i(f) = 22423f + 313931. What is i(-14)? 9 Let i(o) = -7515o + 105253. Give i(14). 43 Let g(v) = -11v*3 - 105v*2 - 209v - 120. Give g(-7). -29 Let q(f) = -46f + 5820. What is q(121)? 254 Let f(z) = 3z*2 + 23766z - 47471. Calculate f(2). 73 Let u(l) = 9249l - 286724. What is u(31)? -5 Let g(l) = -l3 - 4l*2 + 1663l + 10052. Give g(-6). 146 Let f(m) = -m*3 + 178m*2 - 5279m - 11274. Determine f(-2). 4 Let h(y) = -401y - 8512. What is h(-22)? 310 Let r(h) = 2635h - 81680. What is r(31)? 5 Let c(m) = -m*3 + 9m*2 + 50m - 183. Calculate c(-6). 57 Let t(x) = 14339x - 1218828. Determine t(85). -13 Let o(k) = k2 - 2k - 20820. Determine o(147). 495 Let r(m) = 2m3 + 20m*2 - 13m - 308. Determine r(-9). -29 Let t(n) = 38683n + 38218. Calculate t(-1). -465 Let b(h) = h3 + 189h*2 + 7808h - 127. Determine b(-61). -127 Let i(o) = 3470o - 34745. Determine i(10). -45 Let z(x) = x3 - 236x*2 + 2678x - 64. What is z(12)? -184 Let b(p) = 48876p - 195499. What is b(4)? 5 Let a(b) = 3250b - 9763. Calculate a(3). -13 Let b(g) = -615g + 1973. Calculate b(4). -487 Let w(r) = 18r*2 - 267r - 3. Determine w(12). -615 Let w(m) = 16m2 - 26m - 14544. What is w(31)? 26 Let p(s) = 2601s + 187265. Give p(-72). -7 Let c(l) = -l3 + 22l*2 + 374l + 120. Determine c(33). 483 Let v(m) = -7331m - 183276. Calculate v(-25). -1 Let b(w) = -1829w + 27423. Calculate b(15). -12 Let w(d) = d*3 - 154d*2 - 1554d - 14111. What is w(164)? -7 Let l(h) = -2h2 + 4155h - 8323. Calculate l(2). -21 Let g(p) = 2065p - 102315. Calculate g(50). 935 Let r(i) = 3i*3 - 143i*2 - 100i + 2714. Give r(48). 218 Let c(d) = -235d2 - 4537d + 86. What is c(-19)? 1454 Let f(c) = 12c3 - 26c*2 + 161c - 340. What is f(3)? 233 Let f(c) = -22c - 688. Determine f(-29). -50 Let f(o) = 84o*2 + 3666o + 11003. Give f(-3). 761 Let z(n) = 40n + 991. What is z(-71)? -1849 Let z(d) = d3 + 54d*2 + 817d + 46175. Calculate z(-55). -1785 Let u(x) = -2x3 - 22x*2 - 12405x - 136463. What is u(-11)? -8 Let v(a) = -33150a + 265251. Calculate v(8). 51 Let m(x) = -70x*2 - 75512x + 19430. What is m(-1079)? 8 Let m(h) = 1609h + 1547822. Give m(-962). -36 Let s(n) = n3 + 16n*2 + 144n + 1666. Calculate s(-15). -269 Let b(d) = 2d3 - 115d*2 + 1552d - 158. Give b(36). -14 Let r(i) = 141i - 15442. What is r(107)? -355 Let o(r) = r3 - 586r*2 - 7786r + 18. What is o(-13)? 5 Let y(u) = 51296u + 4411451. Calculate y(-86). -5 Let h(z) = -z3 - 56z*2 - 20z + 708. Determine h(-56). 1828 Let r(t) = -t*3 - 99t*2 + 295t + 18. Determine r(3). -15 Let u(p) = -27p2 + 11199p - 55302. Calculate u(5). 18 Let c(x) = x*3 - 83x*2 + 277x + 3118. What is c(79)? 37 Let k(i) = 727i - 37927. What is k(52)? -123 Let c(w) = 725w + 26531. Determine c(-36). 431 Let b(o) = -2o2 + 253o + 28052. Determine b(-71). 7 Let w(q) = -38q - 673. Calculate w(14). -1205 Let y(q) = -2q*2 - 54073q + 370. Calculate y(0). 370 Let a(w) = -866w - 13491. What is a(-16)? 365 Let f(a) = a2 - 77a + 992. What is f(63)? 110 Let a(v) = v*3 + 2v*2 - 266v - 587. Determine a(-18). -983 Let i(r) = -25411r + 359. Give i(0). 359 Let y(w) = -964w + 290160. Determine y(301). -4 Let g(z) = -112531z - 673947. Calculate g(-6). 1239 Let l(g) = 649g*3 - 605g*2 + 3g - 2. What is l(1)? 45 Let w(c) = -43c - 45. Calculate w(-2). 41 Let s(t) = 3t*2 + 79t + 490. Give s(-10). 0 Let d(p) = -31p2 + 1739p - 19956. What is d(40)? 4 Let q(g) = g*3 - 61g*2 - 347g + 483. Give q(66). -639 Let r(h) = h*3 - 518h*2 - 10207h - 62. Calculate r(-19). 14 Let x(f) = -130f3 - 1690f2 + f + 95. Calculate x(-13). 82 Let v(r) = -r3 - 26r2 + 921r - 20. Give v(20). 0 Let y(i) = i*3 - 201i*2 + 400i - 369. Calculate y(199). 29 Let s(x) = 39x2 - 1689x - 5035. What is s(-3)? 383 Let d(p) = -97p + 1808. What is d(7)? 1129 Let g(k) = -3k*3 - 15k*2 - 24k + 50. What is g(-9)? 1238 Let o(l) = -2874l - 100446. What is o(-35)? 144 Let b(m) = 4m*3 + 366m*2 + 7965m - 988. Determine b(-36). -16 Let u(j) = 108j3 - 646j*2 + 14j - 130. What is u(6)? 26 Let s(p) = -5p3 - 9p*2 + 15p + 2. Calculate s(5). -773 Let t(j) = 3j2 - 1324j + 131136. Give t(150). 36 Let w(t) = t*3 + 25t*2 + 956t + 62248. What is w(-40)? 8 Let u(i) = i*3 + 27i*2 + 7639i + 197951. What is u(-26)? 13 Let m(y) = -8y2 - 409y - 3294. What is m(-10)? -4 Let d(g) = 2721g - 231514. Give d(84). -2950 Let v(s) = 144s + 6134. Give v(-11). 4550 Let y(l) = -4l2 + 1005l + 2828. Determine y(254). 34 Let d(b) = -b*3 - 2b*2 - 33b + 68. Determine d(-8). 716 Let p(a) = -a*3 + 710a*2 + 2231a - 65623. Give p(713). -27 Let p(o) = -32o2 + 8177o - 4418. Give p(255). -83 Let x(v) = -91v2 - 1286v - 3865. Calculate x(-3). -826 Let b(t) = -449t - 5767. Give b(-11). -828 Let j(y) = -23y + 222. What is j(12)? -54 Let g(u) = u*2 + 79419u - 317688. Calculate g(4). 4 Let k(d) = -3207d + 44998. Give k(14). 100 Let y(u) = u3 - 25u*2 + 31u + 83. Calculate y(23). -262 Let f(n) = 21n2 - 1683n + 33380. Determine f(36). 8 Let f(s) = -1525s - 21322. Calculate f(-14). 28 Let g(f) = 6603f + 1413042. What is g(-214)? 0 Let y(j) = -92j + 8090. What is y(88)? -6 Let q(o) = 258038o + 2838422. Determine q(-11). 4 Let k(w) = -w*3 + 28w*2 - 167w + 5151. Give k(28). 475 Let g(i) = -7699i - 15522. Give g(-2). -124 Let c(s) = 662s - 7219. Calculate c(11). 63 Let c(t) = -26t3 - 6t - 1. Determine c(3). -721 Let x(q) = 4872q - 14025. Give x(3). 591 Let b(x) = 13274x - 93109. Give b(7). -191 Let d(c) = 25c2 + 88c - 13. What is d(-4)? 35 Let b(f) = -2f3 - 656f*2 - 1908f + 152. Calculate b(-3). 26 Let v(b) = -2b3 - 139b*2 + 8421b + 585812. Determine v(-69). 2 Let q(f) = 4584f - 41490. Give q(9). -234 Let r(s) = 30s*3 + 1017s*2 - 56s + 1537. Determine r(-34). -27 Let a(y) = -872y - 456368. Give a(-523). -312 Let f(c) = -8264c + 16491. What is f(2)? -37 Let f(x) = -x*3 + 26x*2 - 120x - 112. What is f(20)? -112 Let d(y) = 12y2 - 105y + 202. What is d(4)? -26 Let v(m) = -39m2 + 1141m - 1371. What is v(28)? 1 Let b(j) = 11294j - 316406. Determine b(28). -174 Let n(x) = 13x*3 + 1312x*2 - 93x + 800. What is n(-101)? -8 Let d(c) = 4c3 - 33c*2 - 32c + 233. Calculate d(7). -236 Let c(s) = -7s3 + 296s*2 - 99s + 676. What is c(42)? 46 Let t(b) = -2b3 - 112b*2 - 599b + 150. Determine t(-50). 100 Let m(h) = -14h3 - 351h*2 - 113h - 2181. Calculate m(-25). 19 Let d(z) = 309z2 - 23543z + 4495. Determine d(76). 11 Let y(w) = -4w3 + 318w*2 + 158w + 107. Determine y(80). -53 Let p(s) = s*2 + 103112s - 618700. Give p(6). 8 Let s(g) = -g*3 + 70g*2 + 801g - 49. What is s(80)? 31 Let a(b) = -3b2 + 45b + 45. What is a(7)? 213 Let f(l) = -2l3 + 588l*2 - 17227l + 243. Give f(261). -18 Let o(q) = -q*3 + 310q*2 + 97099q + 3855. Determine o(-193). -5 Let m(n) = 3n3 + 4n*2 + 243n + 984. Give m(-4). -116 Let q(s) = s*2 - 321s - 2954. Determine q(	{ "pile_set_name": "DM Mathematics" }
the closest to 0.3? (a) g (b) 4 (c) 2/45 c Let k = -63.91 - -64.31. Let n = 2.2 - 2.2. Which is the nearest to -2? (a) k (b) -2/9 (c) n b Let q = 0.9 + 0.1. Let z(d) = 68d + 79. Let n be z(-1). Suppose 19c + n = -8. What is the closest to c in q, -0.14, -0.3? -0.3 Let p(a) = -4a + 60. Let r be p(16). Let c be r(-5)/(-90) + (-12)/(-297). What is the nearest to -0.12 in c, 0.2, 0.4? c Let f = 24451/5 - 4890. Which is the nearest to 2/3? (a) f (b) 1/2 (c) 0.036 (d) 3 b Let c = 13.228 + -13.128. What is the closest to -9/2 in 4, 5/12, -1/6, c? -1/6 Let t = -12 + 7. Let r = t - -4.9. Let d = -29794/5 - -5959. Which is the closest to r? (a) -2/11 (b) -0.5 (c) d a Suppose 146r - 48 = 158r. What is the closest to -1 in -1, r, -28? -1 Let x = -1.831 - -1.531. Which is the nearest to 2? (a) 1/6 (b) x (c) 5 (d) 0.1 a Let j be (2/12)/((-125)/20 - -5). Which is the nearest to -649? (a) j (b) 0 (c) 0.4 a Let u be 14(-3)/(-36) + -1. Let o = 2.2 + -2. Let i = 908 + -913. Which is the nearest to o? (a) 0 (b) u (c) i b Suppose 6q - 767 = 5q. Let j be q/6 + 4/1205. Let s = j + -638/5. Which is the closest to -0.3? (a) 3 (b) 0.5 (c) s c Let z(x) = x*2 - 3x - 10. Let g be z(-3). Let b(c) = -c*3 + 7c*2 + 7c + 13. Let q be b(g). What is the nearest to 1/18 in q, 0.1, -0.2? 0.1 Suppose -6q = 105 + 15. Let p be 4/q(4 + -9 - -10). What is the nearest to 0 in -10, -2/15, -0.3, p? -2/15 Let t be ((-6)/(-8))/((-4)/(-8)). Let l be 18 - (4452/(-18))/(-14). Which is the closest to -1.6? (a) -1/6 (b) l (c) t a Let t = 30900 + -61803/2. What is the nearest to -167 in 0.1, t, -1, -4? -4 Let s = 0.00092 + 0.39908. Let d = -0.05 + 0. What is the nearest to -4 in d, s, -3? -3 Let u(i) = -i*3 - 7i*2 - 8i - 13. Let y be u(-6). Let h be (y/6)/((-24)/(-18)). Let d = -1122 - -1122.1. Which is the nearest to 1? (a) d (b) -2/7 (c) h a Let u = -0.05 + 0.05. Let p = -17.5 + 17. Let s = 418 - 440. Which is the nearest to u? (a) p (b) s (c) 3/2 a Let f be (-4)/1 - 91/(-21). Let j be (-45)/(-12) - 78/104. Which is the closest to 2/5? (a) j (b) f (c) 0.5 b Let b = -3.07 + 223.07. Let c = b + -219. What is the closest to 1 in 0.3, c, 0.02? c Let t = -0.18 - 2.82. Let q be (-44)/660(-5)/(-4). Which is the nearest to -3/4? (a) t (b) q (c) 4 b Let k = 4 - 4.3. Let g be (-135270)/600 + (-4)/5. Let d = g - -226. Which is the closest to 0.1? (a) 5 (b) k (c) d c Let i = -301.1 - -295.1. Which is the closest to -9? (a) -5 (b) i (c) 0.5 (d) 0.2 b Let i = 18.9 - 22. Let o = i + 3.3. Which is the nearest to 2/9? (a) 0.1 (b) o (c) -1/4 b Let i be (0 - 2/(-11))/(44/121). What is the nearest to i in 0.5, -0.5, -3, -1.2? 0.5 Let w = 83.283 + -83.483. Let g = -1 - -5. What is the nearest to -0.7 in w, g, -2/7? -2/7 Let z be (-4)/10 + (-132)/20. Let h be 3 + -1 + ((-34)/z)/(-2). What is the closest to -8 in 0.2, h, 0? h Let g(h) = -4h*2 - 86h - 456. Let x be g(-10). What is the nearest to 0 in -1/5, -0.1, 60/19, x? -0.1 Let a(k) = 2k2 + 15k + 24. Suppose 10z + 121 = 31. Let b be a(z). What is the nearest to -2/5 in b, 2, 5? 2 Let j(g) = -g2 - 5g + 4. Suppose 15u - 14u = -2. Let l be j(u). Which is the nearest to 0.1? (a) -2 (b) l (c) 0.03 c Let f be 1 + ((-952)/(-85) - 12). Which is the nearest to -1? (a) f (b) -102 (c) 1/4 (d) -0.08 d Let f = 0.04265 + -0.44265. Which is the closest to -2/7? (a) -1/3 (b) -3 (c) -0.5 (d) f a Let v = 66953 - 66952. Let a be (5/(-4))/(3/(-2)). What is the nearest to -0.1 in -0.4, v, a? -0.4 Let s = 64 - 65. Let p = 29.6 - 30. What is the closest to 0.2 in s, p, -5? p Let p = -144142/11385 - -574/45. Let z = p - -2/23. What is the closest to -0.1 in z, -0.06, 0.3? -0.06 Let n = -1/65 - -69/260. Let y = 155245 - 155248. Which is the nearest to 32? (a) y (b) 0.1 (c) -0.4 (d) n d Let h = -9 + -30. Let r = -42 - h. Let g = -61 - -61.2. What is the nearest to -2/5 in g, -3/5, r? -3/5 Let b be (13/(-52))/(7/(-56)). Let d be b/(-4) + 100/40. Let f be (1 - 0) + 7/(-9). What is the nearest to d in f, -0.2, 0.1? f Let q = 103 + -928/9. Let o = -34 - -5. Let i = -28.8 - o. Which is the closest to -1/3? (a) i (b) 5 (c) q c Let z = -0.2 + 0. Let o = -304 + 315. Let l be (o - 12)/(-31). Which is the nearest to 1? (a) z (b) l (c) 2 b Let v = -5480 - -5475. What is the closest to 0 in -0.01, v, -17, 3/5? -0.01 Let o = -10 - -6. Let z = -648 + 662. Let l = z + -10. Which is the nearest to -2? (a) -0.04 (b) l (c) o a Let m = -363.273 + 363. Let p = m - -0.173. What is the nearest to p in -0.4, -1, 7, 3/2? -0.4 Suppose -w - 3s = 14, -s - 2 = 3w - 0. Let h = 1829 + -1826. What is the nearest to w in 8, h, -0.1? -0.1 Let p be 0 + 11/(-3) - -3. Suppose -4t = -5t + 3, 4t = f + 17. Suppose 127d + 68 = 93d. What is the closest to p in d, f, -1/7? -1/7 Let p = 1 + -3. Let z = -1407 + 1410. Which is the closest to -2/7? (a) -0.4 (b) p (c) z a Let r be (0 - 3/(-14))2256/(-1692). What is the nearest to r in 1/3, -5, -2, 2? 1/3 Let d = -3629/102 - -602/17. Which is the closest to 0? (a) 9 (b) d (c) -2/17 c Let m(j) = 2j*2 + j - 11. Let u be m(-8). Suppose -u + 527 = 11z. Let y = 81/2 - z. Which is the closest to -1/3? (a) -0.5 (b) y (c) 0 a Suppose -4u - 2l = -688, 2l + 190 = u + 23. Let q = u + -1537/9. What is the closest to q in 2/11, -0.1, 1/2? 2/11 Let z = -46 + 50. Let r(a) = a3 - 2a*2 - a - 5. Let y be r(z). Let f = 47/2 - y. What is the nearest to 1 in 6, f, 5? f Let q = 1061/121930 - -1/445. Let t = 497/4658 + q. Which is the nearest to 0.3? (a) -4 (b) -3/2 (c) t c Let n = 84479/12672 + 1/12672. What is the nearest to -2/3 in -1, n, 4/3, -1/10? -1 Let z = 2010 - 2011. What is the closest to z in -0.2, -2/9, -38? -2/9 Let f be (-417)/(-1377) + 6/(-51). Let i = f - 52/135. What is the closest to 1 in i, 1, 3/4? 1 Let x = -48 - -49. Let n be (-8x + 1)/((-1)/9). Let j = 188/3 - n. Which is the closest to -2/5? (a) -3/4 (b) j (c) -5 b Let d = -622/29 + 9301/435. What is the nearest to d in 1, 0.6, -1/4, 0? 0 Let k = 3660 - 3661. What is the closest to 2 in -0.0466, 0.4, k? 0.4 Let o be (-30)/(5/(100/15)). Let f be (-15)/o + (-12)/32. What is the nearest to f in -4, -8/9, -0.2? -0.2 Let q = -8251 - -8453. What is the nearest to 0.1 in 1/8, -3/5, q? 1/8 Let h = -271099/7 - -38729. What is the closest to h in -1, -0.2, -0.8, -0.1? -0.1 Let h = 161.1 - 153.1. Which is the closest to 6? (a) -0.08 (b) 3 (c) h c Suppose 274 = -8l - 86. Let s be (-3)/91(-30)/l-7. Which is the nearest to -0.3? (a) 0.3 (b) 1 (c) s (d) 4/5 c Let i be 114/380 + 38/(-60). Which is the closest to i? (a) 4/3 (b) 1/14 (c) 0.2 (d) -4 b Let n(o) = -5o*2 + 319o + 63. Let w be n(64). Which is the closest to -0.2? (a) -0.6 (b) w (c) -4/3 a Let p(u) be the first derivative of -u3/3 - u2/2 + 7u + 1670. Let n = -1 + -2. Let i be p(n). What is the closest to i in -0.4, 0, 0.4? 0.4 Let f = 22/765 - 1684/5355. Which is the nearest to -0.2? (a) -31 (b) f (c) -2/9 c Let x be (-16)/56 + 108/(-14). Let b be 1 + (-9)/1 + (-5 - x). What is the closest to b in 3/5, 0.1, -4? -4 Let f = -2.8 + 3. Let d = -2876/573 - -895/191. What is the nearest to d in f, 0.1, -2/7, 2/47? -2/7 Let r be ((-5)/(10/4))/5. Let o = -190/127 - -3484/2159. Which is the closest to o? (a) 2/3 (b) r (c) -5 b Let d = -2.069 - 6.931. What is the closest to -2/3 in 0.1, d, 6? 0.1 Suppose 2702z = 2672z + 30. Which is the closest to 0.2? (a) -0.91 (b) -4 (c) z (d) -2 c Let d(w) = -w2 + 2233w - 17796. Let v be d(8). Let u = -0.3 + 0.1. Which is the closest to -2/3? (a) v (b) 51 (c) u c Let h = 1.03 + -1. Let o = -0.09623 + 2.09623. What is the nearest to o in 2/21, -0.1, h? 2/21 Let c be (-3 - -7) + 8/16-2. Suppose 0 = -n + cm + 12 - 0, -2n + 9 = -m. What is the nearest to 3/2 in -3, 2, -2/5, n? 2 Let a = -31/3 + 11. Let h = -1744 + 1515.2. Let x = -229 - h. What is the closest to -1/3 in a, x, -5? x Let j = -0.06 + 1.3. Let h = -1.177 + j. Let a = 3.063 - h. What is the closest to -1/3 in 0, a, 0.2? 0 Suppose 0 = -3r + 12 - 3. Let k be 6(-129)/(-24) + (-3)/12. Suppose -20 + k = rp. What is the closest to 1/5 in p, 2/23, 7? 2/23 Let u = 3 + -6. Let m be (-23)/(-230)1-4. Which is the closest	{ "pile_set_name": "DM Mathematics" }
. 24, 6, 3, 2, -3 Put -22, 2, -16 in decreasing order. 2, -16, -22 Sort -3/2, 3.9, 0.2, 2/7 in increasing order. -3/2, 0.2, 2/7, 3.9 Put 0.3, -2/11, 49 in ascending order. -2/11, 0.3, 49 Sort 2, 4, -164. -164, 2, 4 Put 2, -5, 198 in descending order. 198, 2, -5 Sort -2, -4, 4, 2, -5. -5, -4, -2, 2, 4 Put -1, 310, 2 in ascending order. -1, 2, 310 Sort -1, -35, -13 in decreasing order. -1, -13, -35 Sort 9, -3, 4, 2. -3, 2, 4, 9 Sort 5, -13, -2, -64 in descending order. 5, -2, -13, -64 Put -5, 1, -0.2 in increasing order. -5, -0.2, 1 Put 0, 3, -4/5, 8/5 in descending order. 3, 8/5, 0, -4/5 Sort -3, -2, 0.18, -10 in ascending order. -10, -3, -2, 0.18 Sort 1/2137, -1/7, -2/7 in increasing order. -2/7, -1/7, 1/2137 Put -4, -1, -252 in increasing order. -252, -4, -1 Sort -3/4, -0.4, 1, 21/4, -4 in decreasing order. 21/4, 1, -0.4, -3/4, -4 Put 5, -90, -1 in decreasing order. 5, -1, -90 Put -2, -5, -5503 in decreasing order. -2, -5, -5503 Sort 4, 13, 25 in ascending order. 4, 13, 25 Sort -3, -2/13, -2/9, -1/4, -2098 in descending order. -2/13, -2/9, -1/4, -3, -2098 Sort -7, 11, 2, -3 in decreasing order. 11, 2, -3, -7 Sort 10, -1, -4, 0.4 in increasing order. -4, -1, 0.4, 10 Put -3, 4, -1, 0 in increasing order. -3, -1, 0, 4 Sort -240, -3/2, 0.16 in decreasing order. 0.16, -3/2, -240 Put 0.06, -3, 2, 5, -2/11 in decreasing order. 5, 2, 0.06, -2/11, -3 Sort 0.3, 14, -1/13. -1/13, 0.3, 14 Sort 4, -5, -3, -21 in descending order. 4, -3, -5, -21 Put 105, 0, 5 in increasing order. 0, 5, 105 Put -13, -316, 3 in increasing order. -316, -13, 3 Sort -3, 3, -9, -5 in increasing order. -9, -5, -3, 3 Put 2, 10/13, 2/7 in increasing order. 2/7, 10/13, 2 Sort -61, -5, -1. -61, -5, -1 Sort 3, -539, 8 in increasing order. -539, 3, 8 Put 20, 2, 14 in descending order. 20, 14, 2 Sort -2/925, 1/3, 0 in ascending order. -2/925, 0, 1/3 Put 3, -2, 1, -24, -4 in ascending order. -24, -4, -2, 1, 3 Sort -3/2, -3.8, -6/7 in descending order. -6/7, -3/2, -3.8 Sort -2, -115, -1/3. -115, -2, -1/3 Put 2, 3/7, -0.1, 0.1, -16 in decreasing order. 2, 3/7, 0.1, -0.1, -16 Sort 3/2, -4, -0.5, 5.9 in descending order. 5.9, 3/2, -0.5, -4 Sort 4, -0.2, 1/9 in increasing order. -0.2, 1/9, 4 Put -6, 1/4, 3, 1, 2/5 in ascending order. -6, 1/4, 2/5, 1, 3 Sort -3/8, 0.5, 2, 8 in decreasing order. 8, 2, 0.5, -3/8 Sort 1, -2/137, -0.5. -0.5, -2/137, 1 Sort -55, -4, 3, 2, 1 in ascending order. -55, -4, 1, 2, 3 Put -2, 4, 48 in descending order. 48, 4, -2 Put -4, 5, 283 in ascending order. -4, 5, 283 Sort 0, 0.5, -0.01, -4 in decreasing order. 0.5, 0, -0.01, -4 Put -3, -2, -5, -7 in ascending order. -7, -5, -3, -2 Put -1, 70, 6, -0.5 in decreasing order. 70, 6, -0.5, -1 Put 1, -5, 3, 6 in decreasing order. 6, 3, 1, -5 Sort -88, -2, 4. -88, -2, 4 Sort 2, -5, -15, 28, -4 in descending order. 28, 2, -4, -5, -15 Put 5, -18, 9, 3 in ascending order. -18, 3, 5, 9 Put -47, 3, 14, 5, 2 in increasing order. -47, 2, 3, 5, 14 Put -2, -1/6, 2, -0.3, 9 in decreasing order. 9, 2, -1/6, -0.3, -2 Sort 1/4, 0.5, 0, 309. 0, 1/4, 0.5, 309 Sort -3, 1, 4, -0.3 in increasing order. -3, -0.3, 1, 4 Sort 3, 2, 0, 4, 5 in decreasing order. 5, 4, 3, 2, 0 Sort 3/5, -7, -0.11, -0.4 in descending order. 3/5, -0.11, -0.4, -7 Put 1/4, 2/5, 1, -41 in descending order. 1, 2/5, 1/4, -41 Put 1/3, 1/5, -0.6, -4 in descending order. 1/3, 1/5, -0.6, -4 Sort -3, 2, -16. -16, -3, 2 Sort 0, -27, 3 in decreasing order. 3, 0, -27 Sort 0, -2, 34, -5 in ascending order. -5, -2, 0, 34 Sort -0.1, 0, -1, -36/11 in decreasing order. 0, -0.1, -1, -36/11 Sort 0, 5, -1, 390. -1, 0, 5, 390 Put -0.2, -72, -5, -0.5 in decreasing order. -0.2, -0.5, -5, -72 Sort -7, -4, 0, 1 in ascending order. -7, -4, 0, 1 Sort -2/3, 0.45, 1, -1 in descending order. 1, 0.45, -2/3, -1 Sort 2, 2/17, -9 in decreasing order. 2, 2/17, -9 Sort 1, -6, 2 in decreasing order. 2, 1, -6 Put 0.1, 2/11, -15.7 in increasing order. -15.7, 0.1, 2/11 Sort -3, 0, 21, -4 in decreasing order. 21, 0, -3, -4 Sort -2, 2, 208, 6. -2, 2, 6, 208 Sort 5, -3, 1, 102. -3, 1, 5, 102 Sort 3, -2, 26 in descending order. 26, 3, -2 Put -3, 19, -4, -28 in decreasing order. 19, -3, -4, -28 Sort 0.1, -1/11, -58/11, 6 in ascending order. -58/11, -1/11, 0.1, 6 Put 9/2, 2/11, -5/4, 5 in decreasing order. 5, 9/2, 2/11, -5/4 Sort 3, -4, -5, 12 in ascending order. -5, -4, 3, 12 Sort -5/3, -0.01, -46. -46, -5/3, -0.01 Put 0.1, -1, 16, -5 in descending order. 16, 0.1, -1, -5 Put 65, -2, -30, -5 in ascending order. -30, -5, -2, 65 Sort 401.7, 1, -3 in ascending order. -3, 1, 401.7 Put -2/3, -1/4, 2/2755 in descending order. 2/2755, -1/4, -2/3 Put -5, -1, -74, 0, -4 in increasing order. -74, -5, -4, -1, 0 Sort 3, 5, 3/2, 0.041. 0.041, 3/2, 3, 5 Put 4, -11, 2, -3 in decreasing order. 4, 2, -3, -11 Sort 0.52, -3/8, 1 in descending order. 1, 0.52, -3/8 Sort -7, 6, -29, -1. -29, -7, -1, 6 Sort 33, 5, -1, 0 in increasing order. -1, 0, 5, 33 Put -5168, -3, 3 in increasing order. -5168, -3, 3 Sort -35, 0, 5, 1 in decreasing order. 5, 1, 0, -35 Sort 0.2, -76, -1/5, 2/11 in ascending order. -76, -1/5, 2/11, 0.2 Put 0.4, -10, 0.9, -1, 26 in descending order. 26, 0.9, 0.4, -1, -10 Put 15, -3, 3, 5 in decreasing order. 15, 5, 3, -3 Put 2, 6, -24 in descending order. 6, 2, -24 Put 9, -5, 3 in increasing order. -5, 3, 9 Put 2, 10, -21, 1, 5 in increasing order. -21, 1, 2, 5, 10 Sort 1, 168, -1, -3, 5 in ascending order. -3, -1, 1, 5, 168 Sort 3, -0.3, -0.1, 1.8 in increasing order. -0.3, -0.1, 1.8, 3 Sort -0.2, -5, -3, -2/15 in ascending order. -5, -3, -0.2, -2/15 Sort 40, -3, -2 in descending order. 40, -2, -3 Sort 12, -2, -13 in descending order. 12, -2, -13 Sort -3, -1, -5, 51, 2. -5, -3, -1, 2, 51 Sort 0.3, 7, -109, -3 in descending order. 7, 0.3, -3, -109 Sort 2/21, -0.1, 7 in increasing order. -0.1, 2/21, 7 Sort 3, 247, -5. -5, 3, 247 Put 1/7, 1, 4/5, -2 in ascending order. -2, 1/7, 4/5, 1 Sort 4, -3, -21, 1. -21, -3, 1, 4 Sort 6/17, -1/8, 5. -1/8, 6/17, 5 Put -10, -3, 2 in descending order. 2, -3, -10 Put 4, 5, -1, 15, -50 in increasing order. -50, -1, 4, 5, 15 Put -2, 4, 0.14, -1, 3 in decreasing order. 4, 3, 0.14, -1, -2 Put -0.7, 3/2, 5, 53/5 in descending order. 53/5, 5, 3/2, -0.7 Sort -4, -1, -3 in decreasing order. -1, -3, -4 Sort -2/5, -1.8, 0.4, 0, -4/7 in ascending order. -1.8, -4/7, -2/5, 0, 0.4 Put -0.4, -2/33, 0, 33, -1/4 in decreasing order. 33, 0, -2/33, -1/4, -0.4 Put 38, 0.2, -2 in increasing order. -2, 0.2, 38 Put -0.5, -1/10, -4 in descending order. -1/10, -0.5, -4 Put -1, -0.5, -2/5, -3/5, 0.3 in decreasing order. 0.3, -2/5, -0.5, -3/5, -1 Put 1/8, 1, 7, 4 in decreasing order. 7, 4, 1, 1/8 Put -0.4, -0.3, 10013 in increasing order. -0.4, -0.3, 10013 Sort 2, 9.2, -4, -0.3, 5 in descending order. 9.2, 5, 2, -0.3, -4 Sort -5, 1, 47 in increasing order. -5, 1, 47 Sort -2, 2, 24, 1. -2, 1, 2, 24 Sort 0, -38, -4 in decreasing order. 0, -4, -38 Put 8, -464, 4, -4 in decreasing order. 8, 4, -4, -464 Sort -2/3, 2/9, -0.2, 5 in descending order. 5, 2/9, -0.2, -2/3 Put 0.6, -2, 1/3, -5 in increasing order. -5, -2, 1/3, 0.6 Put 0.4, -4, -34.3 in increasing order. -34.3, -4, 0.4 Sort -14/11, 2/13, -462, -4/7. -462, -14/11, -4/7, 2/13 Sort 3, -4, -28, 0. -28, -4, 0, 3 Put -7, -5, 2/27 in ascending order. -7, -5, 2/27 Put 3/4, 0.5, -0.5, -0.4 in decreasing order. 3/4, 0.5, -0.4, -0.5 Sort 3, 13, -2, -1 in descending order. 13, 3, -1, -2 Sort -4, 17, -2. -4, -2, 17 Sort 0, 1, 4, 3 in ascending order. 0, 1, 3, 4 Sort 1, 0.07, 4/5, -12, 2. -12, 0.07, 4/5, 1, 2 Put -1/2, 0.4, -8.8, 1 in decreasing order. 1, 0.4, -1/2, -8.8 Put -2, 1, -13, 4 in increasing order. -13, -2, 1, 4 Put 9, -0.3, 9/4 in decreasing order. 9, 9/4, -0.3 Sort -1/8, -2/7, 1, -0.5, -4. -4, -0.5, -2/7, -1/8, 1 Put -5, -10, -0.1, 9 in ascending order. -10, -5, -0.1, 9 Sort -4, 3, 80, 2 in decreasing order. 80, 3, 2, -4 Sort -57, -58, 5 in decreasing order. 5, -57, -58 Sort -5, -0.1, 64, -0.3 in ascending order. -5, -0.3, -0.1, 64 Sort 1, 5, -3, 6, 2. -3, 1, 2, 5, 6 Put 4, -4, -2 in descending order. 4, -2, -4 Sort 4, 3, 0.9, 0.03 in increasing order. 0.03, 0.9, 3, 4 Sort -1, 15, 20, -3, 3 in descending order. 20, 15, 3, -1, -3 Put 6, 3, -2, -5 in increasing order. -5, -2, 3, 6 Put -406, 1, -5 in decreasing order. 1, -5, -406 Put -2/3, -25/3, 0.2 in decr	{ "pile_set_name": "DM Mathematics" }
08. 2, 123077 What are the prime factors of 377013? 3, 7, 13, 1381 What are the prime factors of 1428131? 97, 14723 What are the prime factors of 80460? 2, 3, 5, 149 What are the prime factors of 8958872? 2, 13, 86143 List the prime factors of 5568786. 2, 3, 19, 857 List the prime factors of 1464578. 2, 179, 4091 List the prime factors of 2976323. 7, 425189 List the prime factors of 145235. 5, 31, 937 List the prime factors of 1211484. 2, 3, 100957 List the prime factors of 465323. 193, 2411 What are the prime factors of 270307? 270307 List the prime factors of 6442. 2, 3221 List the prime factors of 80343. 3, 79, 113 List the prime factors of 33704. 2, 11, 383 List the prime factors of 8936242. 2, 7, 638303 What are the prime factors of 6288839? 2473, 2543 What are the prime factors of 84073? 11, 7643 What are the prime factors of 1697057? 1697057 What are the prime factors of 7671594? 2, 3, 7, 182657 List the prime factors of 7680400. 2, 5, 7, 13, 211 List the prime factors of 274865. 5, 54973 What are the prime factors of 1051499? 1051499 What are the prime factors of 20757347? 13, 43, 71, 523 List the prime factors of 222883. 222883 List the prime factors of 161352. 2, 3, 83 What are the prime factors of 173321? 31, 5591 List the prime factors of 1621468. 2, 41, 9887 What are the prime factors of 1025442? 2, 3, 11, 5179 What are the prime factors of 1744472? 2, 17, 101, 127 What are the prime factors of 811826? 2, 29, 13997 List the prime factors of 1810424. 2, 7, 11, 2939 List the prime factors of 21444485. 5, 29, 71, 2083 What are the prime factors of 2569920? 2, 3, 5, 2677 List the prime factors of 107797. 17, 373 What are the prime factors of 1415292? 2, 3, 59, 1999 List the prime factors of 767056. 2, 191, 251 List the prime factors of 356890. 2, 5, 89, 401 List the prime factors of 11034472. 2, 47, 29347 List the prime factors of 12071064. 2, 3, 502961 What are the prime factors of 3044735? 5, 608947 List the prime factors of 615719. 13, 47363 What are the prime factors of 893811? 3, 251, 1187 List the prime factors of 733590. 2, 3, 5, 11, 13, 19 What are the prime factors of 1311451? 167, 7853 List the prime factors of 8017745. 5, 379, 4231 List the prime factors of 28763407. 149, 193043 List the prime factors of 3146366. 2, 1573183 What are the prime factors of 2829744? 2, 3, 43, 457 List the prime factors of 89500. 2, 5, 179 What are the prime factors of 2732457? 3, 7, 13, 10009 List the prime factors of 586552. 2, 157, 467 List the prime factors of 847887. 3, 233, 1213 List the prime factors of 87239. 23, 3793 List the prime factors of 148209. 3, 127, 389 What are the prime factors of 34758? 2, 3, 1931 List the prime factors of 1836493. 17, 59, 1831 What are the prime factors of 17215571? 31, 163, 3407 List the prime factors of 4615963. 11, 233, 1801 List the prime factors of 3020244. 2, 3, 293, 859 What are the prime factors of 137558? 2, 109, 631 What are the prime factors of 47239? 97, 487 What are the prime factors of 139853? 7, 19979 List the prime factors of 572223. 3, 19, 10039 List the prime factors of 986284. 2, 13, 1459 List the prime factors of 43711. 43711 List the prime factors of 9857779. 59, 167081 List the prime factors of 7895047. 29, 61, 4463 List the prime factors of 4520276. 2, 269, 4201 What are the prime factors of 198339? 3, 17, 3889 List the prime factors of 1325095. 5, 31, 83, 103 What are the prime factors of 9415961? 167, 56383 What are the prime factors of 2115118? 2, 19, 55661 What are the prime factors of 16723441? 7, 2389063 List the prime factors of 375107. 23, 47, 347 What are the prime factors of 2678731? 11, 243521 List the prime factors of 26885. 5, 19, 283 List the prime factors of 670550. 2, 5, 13411 What are the prime factors of 10488982? 2, 7, 37, 20249 What are the prime factors of 5509799? 179, 30781 List the prime factors of 1097505. 3, 5, 29 List the prime factors of 1546205. 5, 309241 What are the prime factors of 5164060? 2, 5, 11, 23473 What are the prime factors of 792130? 2, 5, 113, 701 List the prime factors of 5666893. 31, 182803 What are the prime factors of 5293073? 997, 5309 What are the prime factors of 15374829? 3, 5124943 List the prime factors of 545170. 2, 5, 54517 What are the prime factors of 300041? 7, 42863 List the prime factors of 15419948. 2, 47, 82021 List the prime factors of 1288438. 2, 701, 919 What are the prime factors of 3114512? 2, 37, 5261 What are the prime factors of 916691? 17, 53923 What are the prime factors of 22145271? 3, 17, 434221 What are the prime factors of 600109? 600109 What are the prime factors of 852035? 5, 23, 31, 239 List the prime factors of 744740. 2, 5, 23, 1619 List the prime factors of 380006. 2, 11, 23, 751 What are the prime factors of 326706? 2, 3, 17, 3203 List the prime factors of 3113255. 5, 229, 2719 What are the prime factors of 3553? 11, 17, 19 What are the prime factors of 2102160? 2, 3, 5, 19, 461 What are the prime factors of 138581? 138581 What are the prime factors of 795007? 795007 What are the prime factors of 297102? 2, 3, 13, 293 What are the prime factors of 3701897? 773, 4789 What are the prime factors of 586474? 2, 7, 163, 257 List the prime factors of 1857061. 1063, 1747 What are the prime factors of 617222? 2, 43, 7177 List the prime factors of 6887467. 41, 167987 What are the prime factors of 200514? 2, 3, 23, 1453 What are the prime factors of 20596728? 2, 3, 29, 101, 293 What are the prime factors of 20989429? 61, 223, 1543 List the prime factors of 1108297. 929, 1193 List the prime factors of 1050638. 2, 47, 11177 List the prime factors of 881472. 2, 3, 4591 List the prime factors of 3415911. 3, 1138637 List the prime factors of 1787546. 2, 577, 1549 List the prime factors of 932586. 2, 3, 17, 41, 223 List the prime factors of 1568350. 2, 5, 7, 4481 List the prime factors of 291962. 2, 11, 23, 577 List the prime factors of 370883. 370883 What are the prime factors of 636120? 2, 3, 5, 19, 31 List the prime factors of 201017. 179, 1123 List the prime factors of 21767599. 7, 17, 182921 What are the prime factors of 150550? 2, 5, 3011 List the prime factors of 295944. 2, 3, 11, 19, 59 List the prime factors of 3339122. 2, 41, 43, 947 What are the prime factors of 5048255? 5, 1009651 What are the prime factors of 519641? 137, 3793 List the prime factors of 87388. 2, 7, 3121 List the prime factors of 1166437. 31, 191, 197 List the prime factors of 7245747. 3, 37, 7253 List the prime factors of 13569024. 2, 3, 7, 631 What are the prime factors of 26736355? 5, 5347271 What are the prime factors of 365147? 365147 List the prime factors of 1176562. 2, 241, 2441 What are the prime factors of 95952? 2, 3, 1999 List the prime factors of 822189. 3, 53, 5171 List the prime factors of 301228. 2, 75307 List the prime factors of 21946. 2, 10973 What are the prime factors of 244985? 5, 13, 3769 What are the prime factors of 603916? 2, 150979 List the prime factors of 1262823. 3, 420941 What are the prime factors of 1848087? 3, 17, 47, 257 What are the prime factors of 138444? 2, 3, 83, 139 List the prime factors of 93413. 109, 857 List the prime factors of 57040. 2, 5, 23, 31 List the prime factors of 177963. 3, 137, 433 List the prime factors of 11112860. 2, 5, 11, 50513 What are the prime factors of 923715? 3, 5, 13, 1579 List the prime factors of 250845. 3, 5, 7, 2389 What are the prime factors of 257887? 7, 19, 277 List the prime factors of 226911. 3, 43, 1759 What are the prime factors of 347564? 2, 7, 12413 What are the prime factors of 7090136? 2, 853, 1039 List the prime factors of 15760560. 2, 3, 5, 97, 677 What are the prime factors of 746150? 2, 5, 14923 What are the prime factors of 2911579? 11, 19, 13931 What are the prime factors of 1922339? 1922339 What are the prime factors of 11854142? 2, 149, 39779 List the prime factors of 1044922. 2, 17, 73, 421 List the prime factors of 1918765. 5, 383753 What are the prime factors of 77835? 3, 5, 5189 List the prime factors of 2513801. 2513801 What are the prime factors of 5127828? 2, 3, 569, 751 What are the prime factors of 22044878? 2, 59, 227, 823 List the prime factors of 5422843. 503, 10781 List the prime factors of 1867436. 2, 466859 List the prime factors o	{ "pile_set_name": "DM Mathematics" }
alue in 0.006, 23, -6, 1? 1 Which is the second smallest value? (a) 0.1 (b) -209 (c) 4.3 (d) 2 a What is the fourth smallest value in -5, 2, -1/3, -635, 5? 2 What is the biggest value in -0.1, -19, -120, 2, -2/11, -3/5? 2 What is the third smallest value in 0.7, -3, 0.5, -5, -7? -3 What is the third biggest value in 2/11, 1/36, 1.4, 10, -6? 2/11 Which is the third biggest value? (a) -890 (b) -5 (c) -6/5 a What is the biggest value in 0.3, -16, 6423? 6423 Which is the fourth smallest value? (a) -2 (b) 9/2 (c) 0.14 (d) -5 (e) 1 e Which is the third smallest value? (a) -54 (b) -8 (c) -21 b What is the third smallest value in -1/7, -20, -5/2, 1/3, -1/45? -1/7 Which is the smallest value? (a) 0.4 (b) 40/3 (c) 5 (d) -12 (e) 3/2 d Which is the smallest value? (a) 0 (b) 859 (c) -7 (d) 0.3 c What is the second biggest value in -49, 0.4, -0.12? -0.12 Which is the second smallest value? (a) -4 (b) 1/8 (c) -0.02 (d) 10 (e) -2/93 (f) -1 f Which is the second smallest value? (a) -8 (b) -5446 (c) -4 a Which is the third biggest value? (a) -0.3 (b) -17 (c) -24/7 (d) 0 c What is the fifth smallest value in 0.049, 2, 48, -1/7, -1? 48 Which is the fourth smallest value? (a) 1 (b) 16 (c) -0.3 (d) -0.1 (e) 174 (f) 0.5 a What is the third smallest value in -1/10, 2/7, 110? 110 Which is the biggest value? (a) -5 (b) -0.9 (c) 397 c What is the third biggest value in -2, 1, -0.1, 0.4, -83? -0.1 What is the smallest value in 0.2, 43, 2, 11? 0.2 What is the sixth biggest value in -5, 0.5, 87, -0.2, 4/9, -7? -7 What is the fifth biggest value in 0.1, -1/8, 5/2, 156, -3, 0.3? -1/8 Which is the biggest value? (a) 1.8 (b) 1.01 (c) 6 c What is the second smallest value in 1, 2/21, 727.2, 0.4? 0.4 Which is the third biggest value? (a) -0.2 (b) -2/7 (c) -2 (d) -6 (e) 9.84 b What is the smallest value in 5, -6/7, 47, 2, 0.27? -6/7 Which is the second biggest value? (a) 2 (b) 1 (c) -2/3 (d) 3/4 (e) -1/17 b Which is the smallest value? (a) 48/13 (b) -3 (c) 64/11 b What is the third smallest value in 43/3, -83, -1, 0.4? 0.4 Which is the smallest value? (a) -11 (b) 1486 (c) 0.1 a Which is the smallest value? (a) -25.08 (b) 222 (c) -2 a Which is the third biggest value? (a) 83 (b) -3/8 (c) -9 (d) -0.1 (e) 2/11 d What is the second smallest value in 1/3, -502, -4/3, 205? -4/3 What is the smallest value in -1/2, -2, 6, 998, -3/4, -1/12? -2 What is the second biggest value in 0, 5, 59, -4/9, 1? 5 Which is the second smallest value? (a) 276/17 (b) 5 (c) -11 b Which is the third biggest value? (a) 0.4 (b) -5 (c) 874 (d) -3 (e) 0 e What is the second smallest value in 2/7, -2, -24336? -2 Which is the fourth biggest value? (a) 10 (b) -2/5 (c) -0.2 (d) 31 (e) 5 c Which is the second biggest value? (a) -1/3 (b) -0.17 (c) 4 (d) 42 c What is the fifth smallest value in 0.2, -180, -1/5, 4/3, -1881? 4/3 Which is the second smallest value? (a) 0 (b) 5 (c) 1/3 (d) -3 (e) 0.023 (f) -1 f Which is the second smallest value? (a) -156 (b) -6 (c) -1/3 b Which is the smallest value? (a) -3 (b) -5 (c) 3/8 (d) 1/36 (e) -4 b Which is the third biggest value? (a) 2/15 (b) 1.251 (c) 3 a What is the smallest value in 3/7, 21, 0.2, -2/7, 2/19, -1.1? -1.1 Which is the third smallest value? (a) -4 (b) 5.6 (c) 83 c Which is the third smallest value? (a) 1288 (b) 0.4 (c) 0.5 (d) 5 d Which is the second smallest value? (a) 24 (b) 4 (c) 2/3609 b Which is the biggest value? (a) -3 (b) -6/5 (c) -5 (d) 0.35 (e) 2 e What is the biggest value in 2658261, 1/3, 2/15? 2658261 What is the smallest value in -21045, -5, 0.2? -21045 Which is the second smallest value? (a) 2 (b) 64 (c) -0.4266 a What is the biggest value in 2, 0.29, 1, -227? 2 Which is the second biggest value? (a) -1/14 (b) -1/5 (c) -0.6 (d) -1.96 b Which is the third smallest value? (a) -7/11 (b) -1/2 (c) 30 c Which is the biggest value? (a) 1/1031 (b) -4/5 (c) 3 c Which is the biggest value? (a) 5 (b) -0.5 (c) -186.5 a Which is the second biggest value? (a) 3/4 (b) -0.6 (c) -105 (d) 3 (e) -0.4 a What is the third smallest value in 5, 1/4, -4, -46, -4/3, 38? -4/3 Which is the fifth biggest value? (a) -1 (b) -2/3 (c) -120 (d) 2 (e) 6 (f) 1 a Which is the smallest value? (a) -1/3 (b) 4 (c) -4 (d) 1/10 (e) -15 (f) -2/3 e Which is the smallest value? (a) -1/5 (b) 4 (c) -0.0396 (d) 0 (e) -10 e What is the third biggest value in -4, -463/47, -2/9? -463/47 Which is the smallest value? (a) 0.3 (b) -4822.73 (c) 1/2 b What is the second biggest value in 4, 1/5, -2/11, -31/8, 1? 1 Which is the smallest value? (a) 6.4065 (b) -3 (c) -0.2 b Which is the sixth smallest value? (a) 1/4 (b) 1/12 (c) -11 (d) 6 (e) 53 (f) -1/4 e What is the fifth smallest value in -22.7, -0.1, -2/7, 0.1, 1, -49? 0.1 What is the second smallest value in 2, 1, -71668? 1 What is the smallest value in 0.8, 2/5, 3/5, 19/4, 7, 11? 2/5 Which is the smallest value? (a) -0.5 (b) -1.8 (c) -2 (d) 1 (e) 2 c Which is the third smallest value? (a) 0.1 (b) -37.3 (c) 6 (d) 29 c What is the fourth biggest value in -98, -451, 3/5, -1/4? -451 What is the third smallest value in -4, 1395, 10? 1395 What is the smallest value in 1, -5.7, -115? -115 Which is the second smallest value? (a) -2.4 (b) 0.3 (c) 2148 b What is the third smallest value in 2, -0.1646, -0.24, -2? -0.1646 Which is the biggest value? (a) -16 (b) 0.3 (c) -1183 b What is the third smallest value in -3, 22, -20/13? 22 What is the second smallest value in -0.1, -1/4, 1/5, 27, 3, 26/19? -0.1 What is the biggest value in 0.44, 0, -0.005, -2/7? 0.44 Which is the third biggest value? (a) 2/5 (b) 3 (c) 0 (d) -5 (e) -1 (f) -2/117 c Which is the third smallest value? (a) 1 (b) -35/241 (c) 0.3 a What is the third smallest value in -0.1, 0, -0.3, -2, -6? -0.3 What is the smallest value in -6/65, 151, 4/7? -6/65 What is the fourth biggest value in 1, 4, 0.65, -22/3? -22/3 Which is the fourth smallest value? (a) -4/5 (b) 10/1179 (c) 53 (d) 2/7 c What is the biggest value in -24, -2/3, 0.121? 0.121 What is the third biggest value in -12, 1/5, 80? -12 Which is the smallest value? (a) 0 (b) 42 (c) 5 (d) 10 (e) 32 (f) 4 a Which is the second smallest value? (a) 0.302 (b) -3 (c) -2 c Which is the third biggest value? (a) 3 (b) -0.072034 (c) 0.4 b Which is the fifth smallest value? (a) -2/7 (b) 1/5 (c) 3 (d) -2 (e) -42 (f) -0.3 b Which is the second smallest value? (a) 0.05 (b) -2 (c) 3 (d) -10 (e) -4 (f) 0.5 e What is the second biggest value in -279, 11, 3? 3 What is the fourth biggest value in -3/5, -0.1, 5, 1/2, 4/41, -2/99? -2/99 What is the fifth smallest value in -340, -4, -129, -3, -0.2? -0.2 Which is the second smallest value? (a) 109 (b) 0.5 (c) -4/7 (d) -15/8 c Which is the second biggest value? (a) -5/2 (b) -0.2 (c) -1 (d) -0.085 (e) -2 (f) 0 d Which is the sixth smallest value? (a) -3 (b) -4 (c) 5 (d) 3/4 (e) 5.7 (f) -2/125 e Which is the second biggest value? (a) -1/2 (b) -7 (c) 391 a Which is the third biggest value? (a) -1/11 (b) 0.76 (c) 0.4 (d) -114 (e) -4 a Which is the second smallest value? (a) -0.1 (b) 89/6038 (c) 0 c Which is the biggest value? (a) 3 (b) -5/2 (c) 0.1 (d) 3/4 (e) 178 e Which is the biggest value? (a) 14 (b) -4 (c) 135/19 a What is the biggest value in 13.08, -443, 0.5? 13.08 What is the third biggest value in 0.1, 88, 4, -2/21, -2? 0.1 Which is the fourth smallest value? (a) -37 (b) 0 (c) 0.06 (d) -3 (e) 2/9 (f) 2 c What is the biggest value in 60, 4, 55? 60 Which is the third smallest value? (a) -0.2 (b) -72 (c) -3601 a What is the third biggest value in -241847, 3, -1, -2, 0.3? -1 Which is the second biggest value? (a) -100/63 (b) -3 (c) -4 (d) -0.4 a Which is the second smallest value? (a) 3 (b) -3 (c) 0.174 (d) -10 b What is the sixth smallest value in -5, -11, 0.042, -15, -3, 0.1? 0.1 Which is the third biggest value? (a) 0.6 (b) -5/3 (c) -0.26 (d) 2 c What is the fourth smallest value in -9, -2/13, -0.4, 1, 0? 0 What is the biggest value in -0.7, -133, 5? 5 What is the smallest value in 15970, 2/5, -0.5, -2? -2 What is the biggest value in -0.3,	{ "pile_set_name": "DM Mathematics" }
alse Is 1 >= -3/11747? True Which is smaller: -2/35 or 3? -2/35 Is -6296 at least as big as -6297? True Which is greater: 16/95 or 0? 16/95 Which is greater: 0 or 1299? 1299 Is -4/4573 at least 1? False Which is smaller: 45.29 or -4? -4 Is 49/10 smaller than 4? False Which is smaller: 20 or 550/27? 20 Is 87 less than 431/5? False Which is greater: 131 or 392/3? 131 Is -24043 at most -72130/3? False Is 20/2183 <= 0? False Is 8 <= -33? False Which is greater: 22 or -3? 22 Which is bigger: 59 or 58? 59 Is -8373 at least -8373? True Do 163 and 220 have the same value? False Which is greater: -3/8 or -9/257? -9/257 Which is smaller: 2/963 or 1? 2/963 Do -1/4999 and 1 have the same value? False Which is smaller: -1 or 26/113? -1 Is 4/53 <= 0? False Which is bigger: -232 or -227? -227 Which is smaller: -241 or -242? -242 Is -1 at least -6/6121? False Is 5 bigger than -0.923? True Is 13 less than 0.8? False Which is smaller: 10 or 1? 1 Which is greater: 2/861 or -1? 2/861 Does 205/8 = 25? False Is 33/5 >= 16/7? True Which is smaller: 5.3 or -3? -3 Which is greater: -792 or -793? -792 Are 2/703 and -1 nonequal? True Which is bigger: 10890 or 10889? 10890 Which is greater: -10 or -145/14? -10 Is -3 < -28.8? False Which is bigger: 99/2 or 50? 50 Which is smaller: -179/5 or -36? -36 Which is smaller: -8208 or -24626/3? -24626/3 Is -77 at most as big as 0.3? True Is -102 less than 8? True Which is smaller: 1/68 or 4/7? 1/68 Which is bigger: 91/5 or 19? 19 Do 296 and 282 have the same value? False Is -0.135 at least as big as 0.7? False Is 0 greater than or equal to 2/3261? False Which is greater: -78785 or -78786? -78785 Which is greater: 349/18 or 19? 349/18 Does -90 = -90? True Which is smaller: -132 or -135? -135 Which is smaller: -3000 or -2999? -3000 Which is smaller: 3446 or 3452? 3446 Which is bigger: -2/7 or -4.24? -2/7 Is -1178 at least -1160? False Is -2/3235 at least as big as -1? True Which is greater: 5 or 15/4? 5 Is 1 <= 3/379? False Is -111 at most -111? True Which is smaller: -77 or -74? -77 Is -2 less than or equal to -12/73? True Which is greater: -5/323 or 0? 0 Which is bigger: 31 or -599? 31 Do -0.175 and -0.1 have different values? True Which is greater: -7 or -95? -7 Is 17 greater than 21? False Which is smaller: 119 or -3/2? -3/2 Which is smaller: -30 or -25? -30 Is -465 greater than or equal to -48? False Which is greater: 0 or 3/3097? 3/3097 Which is smaller: -8 or -19? -19 Is -171 < -2? True Which is smaller: -505 or -506? -506 Which is smaller: -2 or -26/19? -2 Which is smaller: -5/3442 or 1? -5/3442 Which is bigger: 4/4773 or 1? 1 Is 3 less than 2/63? False Which is greater: -4 or 3? 3 Is 17/3 at least as big as 5? True Which is bigger: 1/251 or 40? 40 Which is smaller: -49/8 or -5? -49/8 Is -0.21 at most as big as 15/151? True Which is smaller: -1 or 5/18? -1 Is 79 at most as big as 2/7? False Which is bigger: -109 or -97? -97 Which is smaller: -78 or 5/6? -78 Are -19 and -9 equal? False Does -2.366 = 0.1? False Which is smaller: 1 or -6/217? -6/217 Is -7 smaller than 0.203? True Which is smaller: 395 or 385? 385 Which is bigger: -0.28 or 0.103? 0.103 Which is smaller: 310/9 or 34? 34 Which is greater: -55/9 or -7? -55/9 Which is bigger: -1 or -15/17? -15/17 Is -1/188 < -1? False Which is greater: 8/175 or 1/4? 1/4 Which is bigger: 712 or 1/2? 712 Which is smaller: -4462 or -4458? -4462 Which is smaller: -597/22 or -26? -597/22 Is 1 at most as big as 7/3? True Is -63 bigger than -78? True Which is bigger: 511 or -3? 511 Is -1 equal to 2/6737? False Are 2221 and 0 equal? False Which is bigger: 1/6 or 940? 940 Is 0 <= -13/901? False Which is greater: 19 or 2? 19 Are 4 and 101/37 equal? False Is -43/16 at least -4? True Which is greater: 1 or 1/89? 1 Which is bigger: 0.1 or 9616? 9616 Which is smaller: -10 or -43/6? -10 Is -12269 less than -12270? False Which is smaller: 0.2 or -96.9? -96.9 Is 5656 less than 1/4? False Which is bigger: -570 or -569? -569 Which is bigger: 10/559 or -1? 10/559 Which is smaller: -0.6752 or -0.1? -0.6752 Is 1364 <= 1364? True Do 5/4 and -3.405 have the same value? False Which is bigger: 7/113 or 0? 7/113 Is 7 <= 197/25? True Is -19/112 > -1? True Which is bigger: -0.08 or -0.07? -0.07 Which is bigger: 7705 or 7704? 7705 Which is smaller: 23 or 7? 7 Which is greater: 288/67 or 3? 288/67 Is -1/6455 less than -1? False Which is smaller: 5 or 82/17? 82/17 Which is smaller: 17 or 16? 16 Is 42/481 at most as big as -1? False Is 730 less than 4375/6? False Is -1 < 90? True Is -249 less than or equal to -251? False Are 2056 and 2052 nonequal? True Which is bigger: -3/14 or -1? -3/14 Which is smaller: -288 or -289? -289 Is -683 less than -1365/2? True Is -6/19 at most as big as 83? True Which is greater: 2 or -6/35? 2 Does 189/43 = 4? False Which is smaller: -146 or -144? -146 Is 17 > -20/27? True Is 17 smaller than -137? False Which is smaller: -0.06 or -3/4? -3/4 Which is bigger: 1176/13 or 90? 1176/13 Which is smaller: -1 or 0.0286? -1 Which is smaller: 44 or -20? -20 Which is greater: -2019 or -2020? -2019 Is -15606 at most as big as -15606? True Which is greater: 0 or 2/4179? 2/4179 Which is smaller: 602 or 601? 601 Which is greater: 6182/9 or 686? 6182/9 Are 1 and 16/507 nonequal? True Which is smaller: -3609 or -21661/6? -21661/6 Is -2 smaller than -2/935? True Which is greater: -3/877 or -1? -3/877 Is 30 at least 266/9? True Which is bigger: -54/29 or -1? -1 Is 64 > 68? False Which is greater: 1 or 1/774? 1 Which is bigger: -1 or 3/100? 3/100 Which is smaller: 0.17 or -0.2? -0.2 Is -443 at most as big as -443? True Do 588 and 589 have different values? True Is -9 bigger than -11? True Is -89.9 bigger than -1/5? False Do -2 and 1 have different values? True Is 1.54 < -0.1? False Is -51 at most as big as -59? False Is -68/41 equal to -3? False Which is smaller: -1/2739 or 1? -1/2739 Which is smaller: -33/226 or 0? -33/226 Is -1.66 at least 2? False Is -1/29 <= 2/631? True Which is bigger: 2/3637 or 1? 1 Is -1 at most -1/1426? True Is -1275 greater than or equal to 0.1? False Is -802 at least as big as -803? True Is 94 at most as big as 14? False Is 23/45 smaller than 1? True Which is greater: -66 or -65? -65 Which is greater: 303 or 306? 306 Is 7561 smaller than -2/7? False Which is smaller: 616 or 615? 615 Which is smaller: 0 or 22/31? 0 Does -37 = 0.1? False Which is bigger: -28 or 0.34? 0.34 Are 111 and 1452/13 unequal? True Which is greater: 0.42 or -1.36? 0.42 Which is smaller: -3 or -25/9? -3 Does 205 = 2662/13? False Which is bigger: 1 or -2/47887? 1 Is -28024 greater than -28024? False Do -249 and -247 have different values? True Which is smaller: 2715/7 or 389? 2715/7 Is -27/55 at least 0? False Is -0.2 > 41/3? False Which is greater: -6/89 or 1? 1 Which is greater: 305 or 312? 312 Which is bigger: 451/47 or 10? 10 Which is smaller: 26 or 1.4? 1.4 Which is smaller: 4234/7 or 604? 604 Is 47 >= 41? True Is 27/5 at most 0? False Which is smaller: -24 or -2? -24 Which is greater: -700 or -2/7? -2/7 Which is bigger: -2/23 or -682? -2/23 Is 103/15 less than or equal to 7? True Which is smaller: -103 or -127? -127 Which is smaller: 363 or 364? 363 Is -44 != -16? True Which is smaller: 759 or 723? 723 Does 8921 = 8920? False Which is smaller: -2 or -246/127? -2 Is 1 <= -2/103? False Which is smaller: -0.469 or 3/4? -0.469 Which is greater: -10 or -884? -10 Is -407 < -1? True Are -9 and -465 unequal? True Is -2/597 > 0? False Is 1 < 945? True Which is smaller: -0.07 or -24/11? -24/11 Are -9 and -139/16 unequal? True Is -2434 smaller than -2434? False Which is greater: -543 or -544? -543 Which is bigger: 69 or 70? 70 Is 316 less than 312? False Is 0 bigger than 45? False Which is smaller: -286 or -281? -286 Is -117 at least -1274/11? False Is 188 < 189? True Which is greater: 263 or 2360/9? 263 Is -1285/3 greater than or equal to -427? False Is -7/5 greater than 2/225? False Which is greater: 2 or -374? 2 Is -0.1 > 617? False Which is greater: -3102 or -3099? -3099 Is -18 less than 1? True Is 8021 smaller than 8020? False Is 1 smaller than -25/1098? False Is 49 less than 17? False Which is greater: 101 or 512/5? 512/5 Which is greater: -65 or 12? 12 Is 0.3 > -472? True Which is greater: 38 or 3? 38 W	{ "pile_set_name": "DM Mathematics" }
c) = -3c2. Calculate h(s(k)). -1083k*2 Let d(y) = 3y*2. Let k(j) = 55j*2. Determine d(k(s)). 9075s*4 Let f be (-5)/28/(-10). Let w(k) = -2k + fk + 0k + 3k. Let s(y) = 2y2. Give w(s(t)). 6t*2 Let i(v) = -2v. Let g(j) = j. Let u = 8 - 4. Suppose -4h - 60 = -up, 0 = 4p - h - 21 - 27. Let b(d) = -3d. Let y(q) = pg(q) + 4b(q). Determine i(y(f)). 2f Let l(i) = 7145i. Let x(p) = -p. Determine l(x(n)). -7145n Let o(k) = -2k. Let h(q) = -13q2 - 7q + 7. Let w(r) = 4r2 + 2r - 2. Let c(l) = -2h(l) - 7w(l). Calculate o(c(v)). 4v2 Suppose 3c - q - 23 = 0, -2q = 3q + 10. Let b = -4 + c. Let a(d) = -bd + 14 - 14. Let p(s) = 2s*2. Determine p(a(r)). 18r*2 Suppose 0 = 5b - 3k - 37, -k + 1 = 3b - 2b. Let s(f) = -5 + 0f + b + 2f. Let j(n) = -3n*2. What is j(s(q))? -12q*2 Let l(i) = 15i*2 - 6i + 1. Let b(h) = 4h. Calculate b(l(n)). 60n*2 - 24n + 4 Let g be (-1)/2 + (-20)/(-8). Let x = 2 - g. Let o(n) = xn - 2n + n. Let c(h) = -2h. Give c(o(y)). 2y Let a(u) = -5u2. Let g(x) be the third derivative of -x4/12 + 12x*2. Give a(g(z)). -20z*2 Let p(m) = -4m2. Let s(c) be the first derivative of c5/30 - 11c2/2 - 4. Let k(f) be the second derivative of s(f). Determine k(p(g)). 32g*4 Let g(j) = -59j*2. Let b(h) = -15h. Give g(b(z)). -13275z2 Let j(g) be the second derivative of 10g*3/3 + 21g. Let i(z) = -z*2. Determine i(j(q)). -400q*2 Let h(q) = 8q + 0q + 4q. Let r(t) = 2t. Give r(h(d)). 24d Let p(b) = -40b2. Let f(c) = 31c*2. Give f(p(r)). 49600r*4 Let u(r) = -3r + 2r + 4r. Let i(z) be the third derivative of z*4/12 + 6z*2. Determine i(u(p)). 6p Let a(b) = 2b2. Let g(n) = -3n*2 - 3n - 3. Let o(j) = -3j2 - 2j - 2. Let h(d) = -2g(d) + 3o(d). Give a(h(t)). 18t4 Let r(l) = 3l2. Let w(h) = -h2. Calculate w(r(o)). -9o4 Let q(x) = 13x*2. Let i(z) = -83z*2. Determine i(q(b)). -14027b*4 Let s = -5 + 6. Let f(q) = 3 - 2 + q - s. Let n(o) = -2o. What is f(n(h))? -2h Let s(l) = -15l*2 - 1. Let z(p) = 4p. Determine z(s(m)). -60m2 - 4 Let b(f) = 17f*2 - 31f*2 + 8f2. Let o(g) = -g2. Give b(o(w)). -6w4 Let s(v) = -4v*2. Let a(x) = -17x*2. Let q(o) = -2a(o) + 9s(o). Let h(t) be the first derivative of -13t*3/3 - 273. Give q(h(b)). -338b*4 Let l(c) = 2c + 3c - 2c + 16c. Let y(q) = -2q. Determine y(l(p)). -38p Let n(k) = -3k*2. Let d(l) = 6l*2 + 5l - 5. Let y be 2/((-4)/18) + -3. Let u(o) = -15o2 - 12o + 12. Let w(t) = yd(t) - 5u(t). Calculate w(n(v)). 27v4 Let j(o) be the second derivative of -o7/2520 + o4/12 + o. Let p(i) be the third derivative of j(i). Let x(q) = 5q*2. Give x(p(g)). 5g*4 Let q(s) = -5s*2. Let g(y) be the first derivative of 4y*3/3 + 14. What is q(g(v))? -80v*4 Let x(y) = 10y. Let z(f) = f. Determine x(z(t)). 10t Let h(y) = 1563y - 2y2 - 1563y + 4y2 + 0y*2. Let v(l) be the first derivative of 1 + 0l + 3/2l2. Determine h(v(c)). 18c2 Let p(n) = -n2. Suppose 0 = 5d - 3 - 7. Let b(z) = -4 + 0z*d + 4 - 7z*2. Give b(p(x)). -7x4 Let r(j) be the third derivative of j5/60 + 2j2. Let m(h) = -26h. Calculate m(r(y)). -26y2 Let t(f) = 44f - 64f + 36f. Let j(k) = k*2. Give t(j(l)). 16l*2 Let s(p) = 6p + 8. Let f(g) = 7g + 9. Let t(v) = 3f(v) - 4s(v). Let c(k) = 2k*2. What is t(c(w))? -6w2 - 5 Let b(k) be the second derivative of k4/2 - 6k. Let j(r) = -r2. Determine b(j(n)). 6n*4 Let w(i) = 3i*2. Let a(x) = -3x*2 - 434x. Calculate a(w(z)). -27z4 - 1302z*2 Let t(i) = 18i. Let q(u) = 4u2. Give q(t(n)). 1296n2 Let n(q) = q2 - 17q2 + 2q - 2q. Let a(m) = -2m*2. Determine n(a(b)). -64b*4 Let l(q) = q. Let o(s) be the first derivative of 9s*2/2 + 3. Calculate o(l(c)). 9c Let d(i) = -i*2. Let x(l) = -1081l + 161. Let s(z) = -27z + 4. Let t(y) = -161s(y) + 4x(y). Determine d(t(j)). -529j*2 Let v(d) = 5d*2 + 16d - 16d - 4d2. Let s(m) = m2. What is s(v(j))? j*4 Let s(k) = 6k*2 - 16. Let t(h) = -15h. Determine t(s(c)). -90c2 + 240 Let o(l) = -l. Let w(u) = u - 1. Let t(z) = -8z*2 - 8z + 8. Let s(d) = -t(d) - 8w(d). Give s(o(q)). 8q*2 Let a(x) = -2x*2. Let d(y) = 3y + 38. What is d(a(o))? -6o2 + 38 Suppose -5 = -4g + 5h + 6, 0 = -h - 3. Let f(u) = -u. Let k(v) = -3v. Let l(j) = gk(j) - 2f(j). Let c(w) = -w*2. What is c(l(x))? -25x*2 Let h(o) = 2o*2 - 3o - 3. Let r(c) = c + 1. Let q(x) = -h(x) - 3r(x). Let s(a) = 3a. Calculate s(q(b)). -6b2 Let h(m) = -1. Let o(r) = 12r - 2. Let w(x) = 6h(x) - 3o(x). Let p(i) = -i*2. Determine p(w(u)). -1296u*2 Let s(f) = -29f*2. Let q(n) = -4n. Calculate s(q(y)). -464y2 Let c(x) = -x. Let m(a) = 3a - 2a - a + a. Give c(m(w)). -w Let y(m) = m. Suppose 2u - 3u = 3u. Let o(s) be the first derivative of 0s + 1 + 2/3s*3 + us*2. What is o(y(r))? 2r*2 Let n(k) be the third derivative of 0 - 1/30k*5 + 0k*3 + 0k*4 + 0k - 3k2. Let q(h) = 2h*2. What is q(n(s))? 8s4 Let c(q) = q2. Let a(v) = v + 3v + 0v + 3v. Calculate c(a(n)). 49n*2 Let u(t) = 2t - 35. Let v(q) = 12q2. Calculate u(v(c)). 24c*2 - 35 Let r(b) be the first derivative of 1 + 0b*2 + 0b - 2/3b3. Let w(y) be the second derivative of y4/4 + 4y. Determine w(r(p)). 12p4 Let h(j) = -5j2. Let r(u) be the second derivative of -u4/3 - 13u. Calculate h(r(n)). -80n*4 Let d(z) be the first derivative of 3z2/2 + 126. Let g(o) be the third derivative of o5/60 - o*2. Calculate d(g(c)). 3c*2 Let w(s) = 2s*2. Let j(y) = -2y*2 - 3710y. Calculate j(w(q)). -8q4 - 7420q2 Let m(g) = g2. Let d(n) be the first derivative of 0n + 3/2n*2 + 1. Let y(p) = p. Let l(j) = -2d(j) + 7y(j). Determine m(l(t)). t2 Let j(x) = -x. Let s(c) = 645c*2. What is s(j(q))? 645q*2 Let q = -9 - -8. Let k(r) = -2r + 1. Let n be k(q). Let g(o) = -no + 2o*2 - o + 4o. Let p(v) = v. Calculate p(g(b)). 2b2 Let g(w) = -3w*2. Let h(i) = -i - 1. Let x(z) = 24z + 27. Let t(b) = -54h(b) - 2x(b). Determine g(t(o)). -108o2 Let p(i) = 3 - 2i + 11 - 14. Let y(m) = m*2. Calculate y(p(s)). 4s*2 Let t(b) = 0b*2 + 5b*2 + 0b*2 - 3b*2. Let d(o) = -9o*2. Give d(t(q)). -36q4 Let k(q) = q2. Let l(j) = -13j - 3. Let r(h) = -1. Let x(a) = -l(a) + 3r(a). What is x(k(f))? 13f2 Suppose -3f + 8f - 10 = 0. Let b(w) = -5w2 - w2 + 4w2 - 2w*f. Let n(m) = 2m*2. Calculate n(b(v)). 32v*4 Let v(a) = -169a*2. Let z(s) = -s. Give v(z(h)). -169h*2 Let g(p) be the first derivative of 5p*3/3 + 28. Let n(r) = -12r*2. Determine g(n(b)). 720b*4 Suppose 0 = z + 2x - 1 - 2, z - 3 = -4x. Let t(o) = 0o2 + 3 - z + o2. Let u(k) = -31 + 31 - k. Give u(t(g)). -g2 Let r(o) be the first derivative of o3/3 - 5. Let x(g) = 7g. Determine r(x(i)). 49i*2 Let q(k) = -13k. Let l(n) = -n*2 + 1. Let f(t) = 4t*2 - 5. Let z(a) = -3f(a) - 15l(a). What is z(q(b))? 507b*2 Let n(h) = -3h. Let x(z) = 7z2 + 1. Calculate n(x(i)). -21i2 - 3 Let k(z) = z2 + z - 4. Let l be k(-3). Let c(p) = -3p2 + 3p*2 - 3pl + p2. Let t(m) = -2m. Calculate t(c(s)). 4s*2 Let o(t) = 7t. Let p(y) = 234y2 + 3. What is p(o(m))? 11466m2 + 3 Let v(u) be the first derivative of u4/24 + u*2/2 - 5. Let f(q) be the second derivative of v(q). Let l(w) = 12w*2. Calculate f(l(p)). 12p*2 Let h(p) = 2p*2. Let s(m) = -9m*2 - 5m + 5. Suppose -1 = n - 4. Let l(q) = -1 - nq + 4 + 3q*2 - 8q*2. Let g(b) = 5l(b) - 3s(b). Calculate h(g(z)). 8z*4 Let w(a) = 3a*2. Let l(u) = -14u*2. Calculate l(w(p)). -126p4 Let d(x) be the third derivative of x4/24 + 19x2. Let o(q) = -q - 6. Let f be o(-6). Let c(b) = fb - 2b + 5b. Give c(d(z)). 3z Let u(h) = 1. Let v(s) = 6s + 21. Let z(w) = 42u(w) - 2v(w). Let a(x) = x + 5 - 6 + 1. What is z(a(y))? -12y Let x(z) = 2z. Let h(i) = -2731i2. What is h(x(j))? -10924j*2 Let t(i) = 4i. Let r(j) = -2j2 - 3. Let v(l) = -1. Let g(f) = -r(f) + 3v(f). Calculate g(t(k)). 32k2 Let q(d) = 26d + 7d + 12d. Let r(j) = j*2. Determine r(q(x)). 2025x*2 Let x(p) = -13p. Let s(r) = -2r - 6. Let d(b) = -2b + 0 - 6 + 1. Let h(v)	{ "pile_set_name": "DM Mathematics" }
be (-78)/(-104)(2 - -2). Solve 3i - jo - 9 = 0, 5i + o + 13 = -2 for i. -2 Let j = -19479 - -19491. Solve -92t - j = -96t, -15 = 2r - 5t for r. 0 Let g be 111 - -207/(-28). Suppose 10m = gm + 8. Solve -4l + ml - 4 = -2k, -3k + 4 = -2l for k. 0 Let z be (-27)/45 + 2/(10/3). Suppose zt = -u - 4t - 2, -2t = -5u + 78. Suppose 0 = 19f - uf - 55. Solve -4j + 6j = v - 3, j = -2v + f for v. 5 Let f be (-8)/20 + (-24)/(-10). Suppose -64v = -61v + o - 9, v + 2o = 8. Solve -vi = 5a - f, 2 = -a + i + 1 for a. 0 Let l be 6/(-4)28/(-3). Let s(z) = z - 9. Let k be s(l). Solve -d = ky + 13, 5y + 3d + d = -7 for y. -3 Let m = 478 + -484. Let q be m/16 - (4 + 102/(-16)). Solve 0 = -5b + qp - 20, -3p - 23 = 4b - 6p for b. -2 Let q = 9604 - 9600. Solve -qf - 16 = 2k, 0 = -28f + 24f + k - 10 for f. -3 Let u = 384 - 200. Let m = -181 + u. Solve -2k + 27 = ma + k, -3k = 4a - 32 for a. 5 Let d = -3746 - -3754. Solve 0 = -3y - 4c - 9, 2y - 3c - 19 = -d for y. 1 Let k be (-2)/9 + 8/36. Let s(g) = -10g - 62. Let z be s(-8). Suppose 60 = zo - 6o. Solve 2l + 4i + 8 = k, -2l + 5 = -oi - 5 for l. 0 Let s be (-6)/(-27) + (-5618)/(-477). Solve 16 = 4j + 3m - 4m, 3m = s for j. 5 Suppose 2v - 8 = 74. Let b be ((-55)/(-10))/110/(-1). Suppose 9d - 4d - 20 = b. Solve 2s - 24 = -df, -5f = 2s + 12 - v for s. 2 Suppose -15m + 18m = -2w + 1090, 4w = -4. Suppose m = -11b + 25b. Solve -2k + b = 3n + 4, -4k + 3n + 8 = 0 for k. 5 Suppose -2p - 2u = -14 + 12, 4u + 20 = 4p. Suppose -6b + p = -27. Solve 5x + 0x = bd - 10, 4x - d = 1 for x. 1 Suppose -3i = -q + i + 21, 3q = -4i - 1. Let r = -64 - -67. Let b be r/((-4)/4 - (-6)/3). Solve -10 = qo + 5g, bo - 11 = g - 1 for o. 2 Suppose -2g - 3g + 73 = -3n, -30 = -2g + 2n. Solve -3t - 3c + 9 = 0, 4t - g + 2 = 5c for t. 3 Suppose 3p + 2k + 20 = 7p, -2k - 8 = 0. Solve 3b = 5d - 20, pb + 4d - 16 = -0d for b. 0 Suppose 12l - 83 = 41 + 32. Solve -3b + 12 = 0, -l + 12 = -5m + b for m. 1 Let s(j) = -51j*2 - 360j + 3. Let k be s(-7). Solve 2h + 9 = 5c, 5c - k = h - 4h for h. 3 Let o = -205 + 217. Suppose 13b = ob + 4g - 1, b + g - 14 = 0. Solve 4j - 9 - 11 = 0, y + 3j = b for y. -4 Let t be (-7 - (2/4)/((-4)/112)) + -5. Solve 0v - 3j + 15 = tv, -v = -5j + 12 for v. 3 Suppose 5s - 5h = 22 + 28, -3h = -s + 12. Suppose -14x = -21x + 49. Suppose s + x = 4v. Solve 0 = -3z + vz + 5o, -2o + 12 = -2z for z. -5 Let r be (-1 - (-407)/(-22))(12/(-9))/2. Solve 9 + 16 = -5n, r = -h - 2n for h. -3 Let h = 244 - 110. Let j = h - 131. Let w be (2/(-2) + -2)/(-1). Solve 3t = 4m - 14, w = -jm - t + 20 for m. 5 Suppose 8125 - 8026 = 11c. Solve -22r - c = 5y - 23r, -4y + 3r = 16 for y. -1 Suppose 189a + 15 = 192a. Solve l + 3 - 2 = 0, 4i = l + a for i. 1 Let q = 14067 + -14002. Solve -2g + 67b - qb = 14, 0 = 3g + 4b for g. -4 Suppose -15k + 63 - 63 = 0. Solve -s - 4b + 12 = k, -b + 0 - 14 = -4s for s. 4 Suppose 0s + 64 = 2s. Let h(m) = 2881m + 5767. Let v be h(-2). Solve 0 = 5i - b + 34 - 10, -3i + vb = s for i. -4 Let j(h) = 222h + 1144. Let u be j(-5). Solve -s + ub = 30b + 23, -3s - 3b + 6 = 0 for s. -3 Let c = -275 - -277. Let r(h) = -h*2 - 6h + 2. Let k be r(-6). Solve 0 = ci + 3d - 5, 0i + 2i - 6 = -kd for i. 4 Let p(u) = -412u + 1252. Let g be p(3). Solve -4k + 12 = 4v, gv + 3k - 13 = 11v for v. 2 Let g(a) = 13a*3 - 3a + 3. Let t be g(1). Suppose 0 = tb - 384 + 85. Solve -b = -3j + 4i, -4i - 8 = -5j + 25 for j. 5 Let y be ((-1)/((-16)/20))/((-47)/(-376)). Solve 0 = 2o - 2, -4s + 2o + 24 = y for s. 4 Let d(i) = i + 33. Let s(j) = -18j3 - j2 + 1. Let q be s(-1). Let n be d(q). Let w = 59 - n. Solve 0 = 2c - 5f + 3, -2c - 2 + w = 4f for c. 1 Let g be ((120/50)/((4/5)/2))/1. Solve 4i - g = y - 21, -5y - 5i = 0 for y. 3 Let n be (0 - 9) + (4 - -79). Suppose -nz = -68z - 336. Solve 3u + 5q = -37, -5u - 3q + 21 = z for u. -4 Let g(p) = -389p - 1554. Let x be g(-4). Suppose -4n - 2b = 2 - 0, -2n + 24 = -4b. Solve 2c - xt + 5 = -c, 0 = -nt - 10 for c. -5 Let z(a) = a*3 - 80a*2 + 816a + 2. Let m be z(68). Solve -4h + j - 9 = 0, 0j + 4j - 8 = mh for h. -2 Let s be (-5)/(-15) - ((-62)/18 + 94/(-423)). Solve f + 4 = -2x - 4, 0 = -sx - 12 for f. -2 Suppose -5k - i + 17 = 0, 22 = 3k - 6k + 4i. Solve 0 = ka + 3z - 7, -4z = 5a + z - 5 for a. -4 Let t = -28316 + 28320. Suppose 2j + 5 = 7j. Solve -j = -q + 2f - 2, t = 2q - f for q. 3 Suppose 3z = 3t - 1935, 6z = 8z + 3t + 1280. Let k = 646 + z. Let l be (-3)/(-2)4/2. Solve -lm = -5v - 18 + 43, 2m + 4 = -kv for m. -5 Let v(q) = -18q - 130. Let p be v(-8). Let y = 26 - 24. Let l(z) = z3 - 2z*2 + 3z. Let c be l(y). Solve cj - p = 8j - 4x, -2 = -4j - 2x for j. -1 Let l = 5034 + -5005. Solve 2m = 5w - l, -2w + 12 = 5m - 6m for m. -2 Let p(o) = -296o - 4140. Let z be p(-14). Solve 35 = 5m - 5t, 22 - 1 = 3m + zt for m. 7 Let z(v) = -v3 + 24v*2 + 27v - 45. Let m be z(25). Suppose 3o = -md + 68, 5d - 28 - 56 = -4o. Solve -p - 10 = -3p - 3b, 0 = -4p + 3b - o for p. -1 Let c(h) = -h*2 - 21h - 3. Let m = -7 - 14. Let x be c(m). Let g be ((-3)/(-2))/((3/(-2))/x). Solve gp + 0p = 3z + 24, -3p = 4z + 4 for p. 4 Let q be (-105)/(-2)114/95. Suppose -q = -4o + 29. Suppose l - 7 = -2b, 4l = 5b - l + 5. Solve br + 5v + 4 = -13, -2r = -3v - o for r. 4 Suppose 5b - 4x - 57 = -x, 2b - 34 = 4x. Let l be (-87)/((45/(-30))/((-2)/(-4))). Solve -4w - b = -3t - 7w, -2t + 5w - l = 0 for t. -2 Let m(b) = 2b*2 + 66b + 66. Let h = 231 - 263. Let x be m(h). Solve -5k + 4t - t = 6, 0 = xk + t - 2 for k. 0 Suppose 2p = 4q - 26, -p - 23q = -24q + 6. Solve -l = 4f - 4, -2f = l - 3 - p for f. 0 Let w(l) = -3l - 3. Let t be w(-2). Suppose 29 = 3h - 85. Suppose hc - 33c - 105 = 0. Solve -4u - 2m - 3m - 35 = 0, -tu = 2m + c for u. -5 Suppose -43 = -6f - 67. Let c be 5 + (-6 - f) - -10. Solve 3q = 5u + 4, 4u + 6q - 3q = c for u. 1 Let c = -63 - -63. Suppose c = -y + 5f - 48, 123 = -y - 3y - 3f. Let k = 38 + y. Solve s - 7 - 12 = -5u, -4s = -ku - 1 for u. 3 Suppose -3p + 239 = 230. Suppose pa + 1 = -m, 0m - 5m = -4a - 14. Solve 15 = -5u, x - mu - 14 = u for x. 5 Let g(l) = -143l + 1004. Let x be g(7). Solve -2w + i = -xi - 18, 4i = -w - 15 for w. 1 Let t(g) = -15g*2 + g - 2g + g*3 + 1 + 14. Let w = 1377 - 1362. Let n be t(w). Solve 0k - 3u - 30 = -3k, 5k - u - 30 = n for k. 5 Suppose 0 = 2i + 5y + 61, 4i - y + 49 = i. Let a be ((-2)/10)/(i/1710). Solve -2v = 5m + a, -4m + 2v - 8 = -0v for m. -3 Let t = -18 - 94. Let n = 115 + t. Suppose 0 = -0c + 4c + 4i - 12, 0 = -4c + 5i + n. Solve -13 = 5q + v, -q + 1 = cv - 0 for q. -3 Let y = -2609 - -2614. Solve 0 = -yt + 5f + 5, 2t + 28 = -4f - 0f for t. -4 Suppose 248t - 1144 - 244 = -396. Solve -4q = 4u - 19 - 9, -u + 19 = tq for u. 3 Let d(r) = 84r - 655. Let h be d(8). Solve 4t + 20 = 0, 28 = -3w - 4t + h for w. 3 Let o = 5962 + -5947. Solve ob + 9 = 4i + 14b, 3i = -5b + 1 for i. 2 Let g(y) = -y*3 - 7y*2 - 6y + 7. Let z be g(-5). Let b(c) = -2c - 24. Let l be b(z). Solve 5v - 5 = -lo - 2, -4 = -2o - 4v for o. 4 Let j = -1058 - -1063. Solve -2i - j = 11v - 6v, -3v - 3 = i for i. 0 Let b be -3 + 51/12 - 3/12. Suppose -b + 10 = 3f. Solve 4k - k = 5v + 24, -24 = fv - 5k for v. -3 Let s be (-30)/(-4) - (-1708)/(-488). Solve 8x - 6x = -m + 11, 5x = -sm + 29 for m. 1 Let x be ((-240)/84)/(2/(-7) - 0). Suppose 21l - 44 = xl. Solve 0t - t + 2 = 2s, -2 = -lt - 2s for t. 0 Let l(i) = -27i - 38. Let y be l(-2). Solve 5k - 3s + 9 = -y, 3k = 3s - 15 for k. -5 Let m = 39 - 34. Let a(x) = x2 - 6x + 7. Let t be a(m). Solve -5p = -2c + 3c + 14, -tp = -c for c. -4 Suppose -20 = -2h + 7q - 10q, 5q = -4h + 38. Solve -j = k + 1, -k + hj - 4j = -7 for k. 1 Suppose -10m - 5m + 344 = 71m. Solve 4a + 8 = -md, -2a = 3d - 0 + 8 for a. 2 Let m(b) = -b*2 + 6b + 2. Let f be m(7). Let n be f-2(-7)/(-14). Solve 0 = ni + 3y - 10, 6 = 3i + 2y - 0 for i. 2 Suppose -i = -4, -8 + 24 = 4q - 2i. Solve -4*u +	{ "pile_set_name": "DM Mathematics" }
-24a3 - 6a. Let u(p) = -p*3 + p. Give -q(k) - 6u(k). 30k3 Suppose 4 + 2 = -h. Let u(t) = t2 - t - 1. Let r(l) = 6l*2 - 5l - 4. Let y(p) = -r(p) + 5u(p). Let c(q) = -7q*2 - 2q - 5. Give hy(x) + c(x). -x2 - 2x + 1 Let a(b) = -6b + 5. Let j(p) = 3p - 3. Suppose s + 10 = -s. Let f(i) = -i*3 - 5i*2 + 5. Let d be f(s). Determine dj(t) + 3a(t). -3t Let l(p) = 6p2 - 2p + 5. Let h(w) = -w + 7 + 3w - 3w + 2w2 - 5. Determine 8h(n) - 3l(n). -2n*2 - 2n + 1 Suppose 0 = 14j - 116 + 270. Let m(v) = -19v + 18. Let s(p) = -p - 1. Let i(w) = m(w) - 3s(w). Let t(q) = 3q - 4. Give jt(k) - 2i(k). -k + 2 Let w(a) = -13a3 + 5a - 5. Let k(m) = -20m3 + 8m - 8. Determine 5k(x) - 8w(x). 4x3 Let g(m) = -435m*3 + 85m*2 - 85m - 85. Let y(p) = -31p3 + 6p*2 - 6p - 6. Give -6g(t) + 85y(t). -25t3 Let r(n) = -2n + 7. Let u(a) = -6 + 1 + 2 + 2a - a. Give 4r(b) + 9u(b). b + 1 Let l(p) = 3p + 1. Let b be l(-2). Let f(m) = -2m + 0m*2 + 8m*2 + 4m + 5m3 + 6m. Let v(n) = 3n3 + 5n*2 + 5n. Determine bf(y) + 8v(y). -y*3 Suppose 0 = -13j + 12j + 4. Let d(f) = -5f*2 - 3f. Let w(o) = -6o2 - 4o. Give jd(p) - 3w(p). -2p2 Let v(r) = r3 - 2r2 - 3. Let a(m) = m3 + 3m2 + 2m + 1. Let d be a(-2). Let b(f) = -f3 + f2. Calculate dv(j) + 2b(j). -j3 - 3 Let q(d) = d3 - 4d2 + d - 4. Let z(l) = -l2 - 1. What is -q(j) + 3z(j)? -j3 + j2 - j + 1 Let n be 1/(-4)-2-6. Let s(w) = -4w3 - 3. Let o(z) = 9z*3 + 7. What is no(a) - 7s(a)? a3 Let u(n) = -2n. Let i be u(-2). Let k(h) = -h. Let a be k(-5). Let c(b) = 6b + 2. Let r(v) = -5v - 2. What is ar(m) + ic(m)? -m - 2 Let q(j) = -2j + 3 + 7 - 3. Let g(p) = 6p - 20. Calculate -6g(f) - 17q(f). -2f + 1 Let d(b) = b2 - b. Let r(o) = -12o*2 - 2o + 1. Determine -2d(g) + r(g). -14g*2 + 1 Suppose -1 + 3 = c. Suppose cn + 1 = 5. Let g(f) = -13f2. Let x(q) be the first derivative of 4q*3/3 + 2. Determine ng(l) + 7x(l). 2l*2 Let a(s) = -4s. Let t = 20 - 14. Let m(z) = -3z. Give tm(j) - 5a(j). 2j Let f(i) = -5i2 - 6i + 1. Let v(y) = -y2 - y. Let w(o) = -o3 + 10o2 - 9o - 11. Let k be w(9). Calculate kv(q) + 2f(q). q*2 - q + 2 Let h(k) = -10k + 4. Let v(a) = -a - 1. Calculate 2h(m) - 22v(m). 2m + 30 Let h(s) = 9s*2 - 9s - 9. Let w(m) = -m3 - m2 + m + 1. What is 2h(a) + 18w(a)? -18a3 Let g(i) = -2i*2 + 14i + 8. Let o(p) = 16 - p*2 - 11 + 3p + 6p. Calculate -5g(t) + 8o(t). 2t*2 + 2t Let y be 1/(3/(-2) + 2). Suppose -yz = -2 + 22. Let b(u) = 4u*2 - 10u - 10. Let p(d) = d*2 - 3d - 3. Determine zp(s) + 3b(s). 2s2 Let k(p) = p2 + 5. Let g(z) = 3z*2 - 8z + 10. Let x(m) = m*2 - 3m + 3. Let j(o) = 3g(o) - 8x(o). Let w = 14 - 10. Determine wk(l) - 3j(l). l*2 + 2 Let a(v) = v - 1. Let z(d) = -2d + 12. Determine 2a(j) + 2z(j). -2j + 22 Let s(q) = q3 - q2 + q - 1. Let l(u) = 8u*3 - 8u*2 + 6u - 9. Give -l(j) + 6s(j). -2j*3 + 2j*2 + 3 Let a(f) = -7f*2 + 4f + 4. Let m(o) = -o*2 + o + 1. Give -a(z) + 3m(z). 4z2 - z - 1 Let t(c) = -2c*3 + 3c*2 - 3c + 2. Let j(y) = -2y3 + 2y*2 - 2y + 2. Let z be (6/10)/(-2 - (-22)/10). Calculate zj(p) - 2t(p). -2p3 + 2 Suppose -2 = n - 2n. Let u(q) = 6 + 4q2 - 3 - 3q*2 + 4q*n. Let w(y) = 4y*2 + 2. What is -2u(k) + 3w(k)? 2k*2 Let i(a) = 5a3 + a2 + a + 2. Let h(l) = l*3 + 1. Give -4h(o) + i(o). o3 + o2 + o - 2 Let n(d) = -d*2 + 2d + 1. Let r(p) = 2p2 - 5p - 3. Let a(t) = -7n(t) - 3r(t). Let g(z) = -z3 - z2 - z - 1. Calculate a(j) + 2g(j). -2j3 - j2 - j Let c be 1((1 - 0) + -3). Let s(w) = 2w*2 - 3w. Let h(u) be the first derivative of -u3/3 + u2/2 - 48. Calculate cs(n) - 5h(n). n*2 + n Let v(m) = -19m*2 - 13m - 11. Let f(t) = 45t2 + 19t + 25. Let j(i) = 9i2 + 4i + 5. Let a(s) = -2f(s) + 11j(s). Calculate -13a(n) - 6v(n). -3n2 + 1 Suppose 0 = -n - 5r + 16, -2n + 56 - 24 = 4r. Let y be n/10 - (-2)/5. Let w(j) = j + 4. Let p = 40 + -39. Let z(v) = -1. What is pw(b) + yz(b)? b + 2 Let k(m) = -m + 1. Let l(s) = -s - 1. Give k(n) - 4l(n). 3n + 5 Let m(d) = -21d3 - 9d*2 - 13. Let c(s) = -10s*3 - 4s*2 - 6. Give 13c(w) - 6m(w). -4w*3 + 2w*2 Let l(g) = -2g + 1. Let d(b) = b + 52. Give d(m) + l(m). -m + 53 Let y = 23 + -45. Let s(g) = -13g - 10. Let j(w) = -w - 1. Determine yj(o) + 2s(o). -4o + 2 Let f = -18 - -9. Let v(u) = -19 - 4u + 3u3 + u2 + 4 + 4 + 10. Let c(i) = 7i3 + 2i*2 - 9i - 2. What is fv(x) + 4c(x)? x3 - x2 + 1 Let w(d) = d - 1. Let b be w(4). Let c(p) = 0p + p + 0p + pb + 9 - 2. Let q(m) = -m3 - m - 5. Calculate -5c(n) - 7q(n). 2n3 + 2n Let c(d) = -d2 - 3. Let b(g) be the second derivative of g4/3 + 13g2/2 + 17g. What is 6b(m) + 26c(m)? -2m2 Let f(n) = -8n*2 + 7n - 9. Let a(r) be the second derivative of -7r4/12 + r3 - 4r*2 + 9r. Calculate -7a(m) + 6f(m). m2 + 2 Let g(r) = -r2 - r. Let w(u) = 15u2 + 5u - 1. What is -5g(p) - w(p)? -10p*2 + 1 Let p be -6 + 4 + -4 + 3. Let m(n) = -n. Let v(g) = 5g + 1. What is pm(x) - v(x)? -2x - 1 Let q(j) = -j*2 - j - 1. Let o(m) = 7m*2 + 5m + 5. Let w(x) = o(x) + 5q(x). Let f(r) = 2r*2. Calculate -5f(i) + 6w(i). 2i*2 Let u(d) = 16d - 1. Suppose 3y + 14 = -2x, -3x + y - 7 = -2x. Let n(h) = 11h - 1. Determine xn(q) + 5u(q). 3q + 2 Let k(v) = v*2 - 2v + 2. Suppose -3i + 20 = -2o, -4o - 26 = 5i - 4i. Let x(j) = -7 - 5j - 3j2 + 3j + 9j. What is ok(l) - 2x(l)? -l2 Suppose -t = 4d + 1, 5t - 3d + 4d + 5 = 0. Let o = t + 2. Let p(j) = -j3 - j2 - j - 1. Let u(m) = m3 + 3m*2 + 3m + 3. Determine ou(i) + 3p(i). -2i3 Let a be (6-1)/(6/(-3)). Let k(u) = 4u2 + 3. Let j(v) = -3v*2 - 2. Suppose -5b + 16 = -2b + 5i, 2 = 5b - 4i. What is aj(q) + bk(q)? -q*2 Let s = 11 - -10. Let o be 112/s - (-8)/(-6). Let z(h) = -5h*3 + 5h*2 + 4h + 6. Let r(f) = -4f3 + 4f*2 + 3f + 5. Calculate or(m) - 3z(m). -m3 + m2 + 2 Let n(h) = -14h3 - 11h*2 + 7h + 8. Let m(o) = 5o + 10 - 7o*2 - 3 - 9o*3 - 2. Determine 8m(r) - 5n(r). -2r3 - r2 + 5r Let k(u) = -u + 14. Let m be k(12). Let f = 6 - m. Let b(s) = -2s*2 - 4s - 4. Let h(z) = 2z + 2z*2 + 6 - 3 + z. Determine fh(t) + 3b(t). 2t*2 Let f(c) = 6c - 1. Let o(k) = 19k - 2. Give 7f(x) - 2o(x). 4x - 3 Let p(a) = -5a + 0 + 3 + 3a - 4. Let t be p(1). Let u(o) = -6o3 + 8o. Let y(i) = -2i3 + 3i. Give tu(n) + 8y(n). 2n3 Let y be (-3 + 3 - -2)/(26/(-65)). Let i(o) = -6o + 5. Let t(z) = -9z + 4. Let p(c) = 37c - 15. Let f(d) = 2p(d) + 9t(d). Give yi(n) + 4f(n). 2n - 1 Let z(h) = h. Let u(t) = -6t. Let a be 21/((-4)/(-10)). Let s be (-3)/(-6) - (-2)/4. Suppose q = -0q + s. Give az(x) + qu(x). -x Let n(j) = j + 5. Let d(k) = -2k - 11. Let f(h) = -6d(h) - 13n(h). Let o(a) = -a. Calculate -f(q) + 3o(q). -2q - 1 Let g(k) be the first derivative of 7k*3/3 + 11k*2/2 - 11k - 31. Let t(y) = -3y2 - 5y + 5. Give 4g(h) + 9t(h). h2 - h + 1 Let y(r) = -r2 - 1. Let t(k) = -7k2 - 2k + 3 - 4 - 6. Calculate t(i) - 6y(i). -i2 - 2i - 1 Let w(q) = -12q2 - 11. Let v = -4 - -4. Suppose v = 4z - 7z + 6. Let l(t) = -t2 - 1. Calculate zw(f) - 22l(f). -2f*2 Suppose 3q + 0q = -33. Let i(v) be the first derivative of 2v2 - 1. Let c(h) be the first derivative of -h2 - 1. Determine qc(p) - 6i(p). -2p Let o(k) = -k2 + 1. Let q(u) be the first derivative of u4/4 - u3 + 5u - 1. Suppose -1 = -5y + 4. Give yq(p) - 5o(p). p3 + 2p*2 Let l(o) = -o - 6 + 21 - 6 - 10. Suppose 0 = -b - b - 4. Let k(i) = 4. Give bl(t) - k(t). 2t - 2 Let h(v) = 85v - 3. Let x(k) = -9605k + 340. What is 340h(u) + 3x(u)? 85u Let h = 171 - 167. Let p(v) = -3v2 + 4v - 1. Let c(o) = 4o2 - 4o + 1. What is hc(d) + 5p(d)? d*2 + 4d - 1 Let d(v) = -6v. Let z(g) be the second derivative of g3/6 + 10g + 3. What is d(k) + 2z(k)? -4k Let j(z) = -10z - 1. Let v(f) = 9f + 2. Give 2j(r) + 3v(r). 7r + 4 Let z(i) = -11i*2 + 2i + 1. Let u(k) = -16k2 + 3k + 1. Let v be (0 - 3) + -84/8. Give vz(m) + 5*u	{ "pile_set_name": "DM Mathematics" }
(2). Let n be (-5872)/r + 2/7. Round n to the nearest one hundred. 200 Let u = 1286 + -1294.49. What is u rounded to one dp? -8.5 Let y be (-4 - 2)/(9/6). Let u be 1604/((-5)/(356270/y)). Let b = u + -41272854. What is b rounded to the nearest one million? -13000000 Let q be 17/(-2) - 6/(-12). Let n(l) = -l - 10. Let d be n(q). Let o be 1/d - 3358/4. What is o rounded to the nearest 100? -800 Let m(x) be the first derivative of 4666x2 - 8x - 1. Let q be m(-6). What is q rounded to the nearest ten thousand? -60000 Let r = -412 + 413.02116. Let z = -127.03184 - r. Let b = 128 + z. Round b to two dps. -0.05 Suppose 20l - 334000 = 22l. What is l rounded to the nearest ten thousand? -170000 Let z = 67 + -82.5. Let w = z - -22. Let c = w + 0.4. What is c rounded to 0 decimal places? 7 Let g = -1.2 + 1.26. Round g to 2 dps. 0.06 Suppose a - 4a - 750 = 0. What is a rounded to the nearest one hundred? -300 Let w = 3.7986021 + 0.80139695. Let v = -0.18 + 4.78. Let l = v - w. Round l to seven decimal places. 0.000001 Let n(h) be the first derivative of h2/2 + 2h + 2. Let o be n(-3). Round o to one decimal place. -1 Let d = -31 - -37. Let g(h) = -3 + 1434h3 + 6 + 1 - 6h + 8h2. Let f be g(d). Round f to the nearest 100000. 300000 Suppose 2u + 3u = -4k + 4, 0 = k + 5u + 14. Suppose 4l - 659988 = kq - 4q, -5l = -3q - 989985. Round q to the nearest one hundred thousand. -300000 Let h = -5.3 - -0.3. Let p = 5.00000004 + h. Round p to 7 dps. 0 Let w = -0.23 - 0.47. What is w rounded to 1 dp? -0.7 Let k be 3 - (1 + (-56008)/(-4)). Round k to the nearest 1000. -14000 Let c = 1131.7 - 1131.830006. Let i = c + 0.13. What is i rounded to 6 dps? -0.000006 Let k = 38 - 38.00000007. What is k rounded to 7 decimal places? -0.0000001 Let w = 2.7 - 2. Let v = w - 0.85. Let t = -0.51 + v. Round t to 1 decimal place. -0.7 Suppose 0 = f + 2d - 3724, f - 3d = 2d + 3745. Round f to the nearest one thousand. 4000 Let f be 43200010/(-30) + (-3)/(-9). What is f rounded to the nearest 100000? -1400000 Let n be (26/3)/((-4)/540). Let b = n + 2520. Round b to the nearest 100. 1400 Let w = 0.41 - -0.97. Let b = w - 20.78. Let n = b - -17. Round n to 0 dps. -2 Let t = 2476.98839 + -2477. Round t to 3 dps. -0.012 Suppose -15 = -3c, c - 13 = -2v - 2. Let g(s) = 1250000s*2 + vs - 2s - 1 + 3. Let r be g(-2). Round r to the nearest one million. 5000000 Let a = -140 - -124.6. Round a to the nearest 10. -20 Let d = 1 + -0.92. Let i = -0.022 + d. What is i rounded to two decimal places? 0.06 Let f = 14 + -12.7. What is f rounded to 1 decimal place? 1.3 Let p = -0.18 + -2.22. Let a = -2.399945 - p. Round a to five dps. 0.00006 Suppose -2j = 1157 + 5243. Round j to the nearest 1000. -3000 Let m = -12.7 - -12. Let j = 433.0021 + -432.3020958. Let w = j + m. What is w rounded to six decimal places? 0.000004 Suppose 3k = -k + 12. Let q(s) = -2s - 1. Let b be q(k). Let d be 72/(-2) - (8 + b). Round d to the nearest ten. -40 Let r be 18/(-15)10/2. Let c = r + 8. Suppose -69 = o + 5v - 1199, 5696 = 5o + cv. What is o rounded to the nearest 100? 1100 Let x = 4.9997 + -5. Round x to four decimal places. -0.0003 Let z = -58.3748257 - 2511.6143843. Let j = 2570 + z. Let v = j + -0.011. Round v to four dps. -0.0002 Let b be (-3760)/30(-75 - 0). What is b rounded to the nearest 1000? 9000 Let a = -121 - -84. Let p = -40.2 - a. Round p to the nearest integer. -3 Let c = 10 - 27. What is c rounded to the nearest 10? -20 Let v = 314 - 315.67. Let o = -0.09 - v. Round o to 1 dp. 1.6 Let l be -250(-29 + 2)-2. Round l to the nearest ten thousand. -10000 Let w = -44169235 + 12769235. Round w to the nearest 1000000. -31000000 Let o = 0.1 - 3.1. Let z = -2.8 - 1.32. Let w = z - o. Round w to one decimal place. -1.1 Let b = 6 + -18. Let v = 123013 + -123024.99972. Let r = v - b. Round r to four dps. 0.0003 Let o(y) = y3 - 7y*2 - 9y + 2. Suppose 0 = -2g + 2z + 29 - 11, 0 = 3g - 5z - 31. Let x be o(g). What is x rounded to the nearest ten? -60 Let t = 76304 - 76346.79875. Let m = -43 - t. Let k = m - -0.2. Round k to four dps. -0.0013 Suppose -2r = -4y + 10 + 22, y - 2 = 2r. Let n be ((-264)/y)/((-4)/500). What is n rounded to the nearest 1000? 3000 Let l = -4348.695 + 4350.1949995. Let u = -1.5 + l. Round u to 6 decimal places. -0.000001 Let s(n) = n - 4. Let p be s(4). Suppose 2k - 4k - 39996 = 2b, p = -k + 5b - 20010. What is k rounded to the nearest ten thousand? -20000 Let c be 5/((-5)/131998)-2. Suppose 2u - 351992 = 4r, c = -5r + 2r + u. Round r to the nearest ten thousand. -90000 Let b = 5 + -4.95. Let i = b + -0.045. Let a = 0.01 - i. Round a to two decimal places. 0.01 Let t = 3390 - 1970. Let o = t - 1419.7054. Let s = o + -0.3. What is s rounded to 3 dps? -0.005 Let s = 44.000058 + -44. What is s rounded to five decimal places? 0.00006 Let q = -116.9082782461 + -0.0917308539. Let x = 117 + q. What is x rounded to 6 decimal places? -0.000009 Let r = 25 + -14. Let b = 16 - r. Suppose 415005 = 3j - 8j - bc, -c = 1. What is j rounded to the nearest 10000? -80000 Let i = 0.01 + 2.99. Let c = i + 2. Let q = 4.99999936 - c. Round q to seven decimal places. -0.0000006 Let o = -2.31 + -0.29. Round o to the nearest integer. -3 Let n = 1678 - -1816. Suppose -3t + 674 - n = 0. What is t rounded to the nearest one hundred? -900 Let x = 51140 + -51140.069986. Let w = -0.07 - x. Round w to 6 decimal places. -0.000014 Let s(m) = 1949999m - 1. Let w be s(-1). Round w to the nearest one hundred thousand. -2000000 Let i = -2 - -6. Let g = -7547.7814 + 7543.7813997. Let u = g + i. What is u rounded to 7 decimal places? -0.0000003 Let o = 128.4 + -128.40000829. What is o rounded to seven dps? -0.0000083 Let g(o) = o2 + 11o + 13. Let n be g(-10). Suppose y = ny - 4. Suppose -yp + 7p = -8500000. Round p to the nearest 1000000. -2000000 Suppose 27520 = 6r - 2r. Suppose -4s = 2h + 9208, -3s + 5h = -0s + r. Round s to the nearest one thousand. -2000 Suppose 168885 + 251115 = -7o. What is o rounded to the nearest 100000? -100000 Let m = -1.1 + -11.7. Let d = m - -11. Let a = d + 1.87. Round a to 1 dp. 0.1 Suppose -10p - 26 = -12p. Suppose py = 18y - 835000. What is y rounded to the nearest 10000? 170000 Let c = 1.751 - 1.64. What is c rounded to 2 dps? 0.11 Let a = 2.7 + -21.7. Let x = -19.35 - a. Round x to one dp. -0.4 Let o = -0.2000004 - -0.2. What is o rounded to six decimal places? 0 Let g = -8556.71 - -8606. Let x = -0.71 - g. Let v = -50.0042 - x. What is v rounded to three decimal places? -0.004 Let d = -32810716142.00165 + 32814273304. Let i = d + -3557236. Let k = i - -74. What is k rounded to 4 dps? -0.0017 Let y = -2878 - -5486. Suppose 2192 = 2r - y. Round r to the nearest one thousand. 2000 Let r(s) = 162s2 - 7s + 4. Let v be r(5). Let l(j) = 4652j + 4 - 2422j + vj + 0. Let g be l(4). What is g rounded to the nearest ten thousand? 30000 Let m be 10/(-6)(-13 - -10). Let b be m/((2 + 0)/5720). What is b rounded to the nearest one thousand? 14000 Let n = 0.055 - 28.055. Let m = -4654879148.99999987 + 4654879121. Let k = n - m. Round k to 7 decimal places. -0.0000001 Let a = -45 + 45.023. What is a rounded to two dps? 0.02 Let h = 0.2868 + -0.29. Round h to three dps. -0.003 Let a = 0.18 + 8.82. Let p = 9.082 - a. Round p to two decimal places. 0.08 Let x = -0.0572243 + -0.0177704. Let w = x + 0.075. Round w to 6 dps. 0.000005 Let q be (8/(-5))/(3/277500). Round q to the nearest ten thousand. -150000 Let h = 87.6622 - 87.9222055. Let a = 0.26 + h. Round a to 6 decimal places. -0.000006 Let f = -148.9999893 - -149. Round f to 6 dps. 0.000011 Let r = 30 + -29.999931. Round r to five dps. 0.00007 Let m = 1649.3 - 1720. Round m to the nearest 10. -70 Let b(p) = p + 15. Suppose -3y = 2x + 24 + 9, 0 = 5y + 25. Let q be b(x). What is q rounded to the nearest integer? 6 Let i = -84 + 50. Let u = i - -33.26. Round u to one decimal place. -0.7 Suppose -11 = -5o + 4. Suppose -or = 2 + 4. Let b be (-2)/4(190 + r). What is b rounded to the nearest ten? -90 Let n = 1.6519352 - 1.77193511. Let u = n + 0.12. What is u rounded to seven dps? 0.0000001 Let j = 50313 - 26613. What is j rounded to the nearest 1000? 24000 Suppose 2*o -	{ "pile_set_name": "DM Mathematics" }
l to 2/369? False Suppose 0 = -3c + 4w + 4, -c + 2w + 2w = -4. Is c < 1? True Let r = -51 + 157/3. Suppose -6 + 4 = -2z. Is z != r? True Let b = -1 + 3. Let l be b/4(-4 - 0). Which is smaller: l or -3? -3 Let k = -1 - -2. Let w be (2/42)/((-1)/(-6)). Which is smaller: w or k? w Let t = 0.18 - 0.11. Let i = 5 - 6. Is t at least as big as i? True Let u = -1864/19 - -98. Which is smaller: 0 or u? u Let b be (3/(-3))/((-3)/12). Suppose 3 = g + b. Are 1/5 and g nonequal? True Suppose 44 = 2l + 4t, 2l + 3l + 5t = 105. Suppose -5 + l = v. Suppose 0 = -f - d - 5, 0 = -5f - 0d + 5d + v. Is 0 bigger than f? True Let t(h) = h - 2. Let d be t(0). Let n be ((-6)/18)/(d/(-6)). Which is bigger: -1/2 or n? -1/2 Let a = 1/207 - -403/2277. Suppose -2i - 2k + 3 = 1, -4i = -3k - 11. Let t = -1 + i. Which is bigger: t or a? t Let r = 22 + -21. Let s = -11 - r. Is -1 >= s? True Let z = 0.4 - 0. Let p = z + 0.6. Which is smaller: 0.2 or p? 0.2 Let z(n) = -n3 - n2 - 5n + 7. Let y be z(5). Let m = y + 1182/7. Let k = -3 + 4. Is m smaller than k? True Let r be 4/(-8)0/2. Let j = 3.7 - 4. Which is smaller: j or r? j Let p be (-3)/96/5. Which is greater: p or -0.03? -0.03 Suppose -b - 3s = 2b - 45, s = -2b + 26. Let o = -15 + b. Is o less than or equal to -5? False Let d be -2 - (-7 - -1) - 2. Suppose 0 = -4v + dv. Which is smaller: 1 or v? v Let h(q) = q*2 + 5q + 6. Let m be h(-5). Is 5 less than m? True Let n be ((-4)/(-5))/(2/(-5)). Let r be 2/(-1)2 - -2. Is n <= r? True Let o = 49228/19 - 2590. Let j = 107/133 - o. Is j equal to -0.1? False Let z(d) = -d2 + 4d + 3. Let u be z(4). Let t be (-2 - (-10)/4)0. Suppose -2w + 5y = -tw - 13, uw = 5y + 17. Which is smaller: 5 or w? w Let s(i) = -i - 3. Let k be s(-7). Suppose -51 = -5x + 5z - 21, -kz = -x + 21. Is 2 smaller than x? False Let f(k) = k3 + 8k*2 - k - 2. Let j(q) = 3q + q*2 - 2 - 2q - q*3 - 7q*2. Let y be j(-6). Let r be f(y). Which is smaller: 5 or r? 5 Let p = -319/5 + 64. Which is smaller: p or 7? p Let o be (-1)/(-2)0/(-3). Let w = -1 + o. Let b = -589/3300 - 1/300. Which is greater: w or b? b Let y be 5(355/125 + -3). Suppose 6v = 4v - 4. Which is smaller: y or v? v Let a be (1/1)/(3/6) - 23. Is a at most -23? False Let o = 0.4 + 0.1. Let z = o + -0.2. Let d = 0.7 + z. Which is smaller: 0.2 or d? 0.2 Let h be 1312/402/12. Let z = h - 17/3. Suppose -20 = -3f - 5v + 2, 23 = 2f + 5v. Is f equal to z? False Let j = -12 - -18. Let l = j - 9. Are -3 and l non-equal? False Let s(o) = o*3 - 2o*2 - 3o. Suppose -1 = -2f + 5. Let u be s(f). Is -3/7 at most u? True Suppose -3m = -5b - 10, -5b - m - 3m = -25. Is -2/19 <= b? True Let k be ((-1)/2)/(3/2). Suppose 0 = a - 2. Let y be (1/5)/(a/10). Which is smaller: k or y? k Let w(k) = -3k. Let d be w(-1). Suppose -dx - 7 = -2x. Is x less than -7? False Let u = -3 - -5. Suppose 0m + 3m = -z + 8, 10 = uz. Let n be (-1)/m - (-1 - 2). Is n at most 0.1? False Suppose 4s = -i - 4, -2i - 5 + 7 = -2s. Which is smaller: -18/23 or s? s Let y be (1/(-12))/(8/36). Let o = y - -1/24. Which is smaller: o or 0? o Suppose -2r - w = -4r + 18, 2w = -5r + 54. Let a = r + -16. Which is bigger: a or -2? -2 Let n = 11/84 + -5/12. Is 0 bigger than n? True Let k be 3/(-15) + 22/(-90). Is k less than 0? True Let j = -37 - -34. Which is bigger: j or 2/7? 2/7 Let i = -11024/35 - -315. Let f = -1338923/70 - -19126. Let s = f - i. Is s > -3? True Let w be ((-6)/(-75))/(1/(-5)). Are 1/2 and w equal? False Let r be (-2 + 40/18)/((-48)/(-792)). Is r at least 1? True Let o be 3/(-33)(-144)/(-74). Let w = -1448080/5291 - -3558/13. Let j = w - o. Which is smaller: -2/5 or j? -2/5 Let i be -127/(-56) - 7/6. Which is bigger: -0.07 or i? i Let p be ((-4)/10)/((-2)/(-24)). Let m(j) = -j + 17. Let x be m(12). Let l = x + p. Which is greater: 0 or l? l Suppose 4h - 1 = 5h. Let t(z) = 5z. Let s be t(h). Suppose 3n = 6n + 4v + 22, -11 = 2n - v. Is s > n? True Let a = -221/3 + 71. Is a greater than -4? True Let z = 10 + -1. Is z not equal to 1? True Let v be 2/7 - 30/105. Is 0 at least v? True Let l = 52915 - 5291453/100. Let x = l + 32/25. Are x and 2 equal? False Suppose 0 = -4w - 6 + 2. Let o = w - -4. Suppose 5y = oa - 4, 2y + 10 = 2a + 6y. Which is smaller: a or 1? 1 Let x = -2 + -6. Let h be ((-6)/(-14))/(3/2). Is h > x? True Let n = 74 + -52. Let u = n + -45/2. Let v = -2 - 0. Is v greater than or equal to u? False Let d be ((-10)/99 - 0)-5109. Let k = d - 516. Is k less than 1? True Let b be 2/(18/57) + -2 + -1. Is b at most as big as 3? False Let d = -1/189 - -431/10017. Is d != -1? True Let j be 2 - -57(-5)/120. Is 3 equal to j? False Let b = 0.035 - -37.965. Is b >= 2/11? True Let j = 79.9 - 80. Which is bigger: 0.23 or j? 0.23 Let v = -24 - -39. Suppose -f + 5 = -v. Let u be 6/f10/(-12). Which is smaller: 1 or u? u Let u be 4/(-12) + (-25)/(-3). Let z be -7(0 - (2 - 1)). Let j = z - u. Is j at most as big as -1? True Suppose -c + 5c + h = 12, -3h = 4c - 12. Suppose -6p + cp = -9. Which is greater: 4 or p? 4 Suppose -5f + 0f = -20. Let s = 1 - f. Let a(y) = y - 4. Let x be a(2). Is s bigger than x? False Let f = -0.2 - -0.2. Suppose 0 = -2s + s + 3. Let x be 1(s - (-2)/(-2)). Which is greater: x or f? x Let p = -18 + 17.96. Which is smaller: -0.05 or p? -0.05 Let u = 2 + 0. Let j = u - -2. Suppose 2 = -w + j. Is 0 at least w? False Let i be 2/(-6) + (-9)/(-108). Are 1.4 and i equal? False Let w = 3 + 0. Suppose wi + 12 = -i. Suppose -r - 3q = -12, -3r - 24 = -q - 2q. Are i and r equal? True Suppose -2o + 4 = -0m - m, -o = -3m + 8. Which is greater: m or 3? m Let z be 4/88/(-2). Let k be -7 - -2z/(-4). Which is smaller: k or 1? k Suppose 0 = 2f - 5o + 7, 0 = -4f - 5o - 16 - 13. Let w = -4 - f. Suppose wq - 5q = 6. Is -4 at most as big as q? True Let k = -328/7 + 16735/357. Which is greater: 0 or k? k Suppose -9 + 14 = q. Is q <= 3? False Let j = 44 + 4. Let i be (-36)/j(-8)/(-33). Is i at least 0.1? False Suppose -g - 2 = -3. Suppose 0 = 2x + 4o - 20, -o + 4 = -g. Is 3/5 bigger than x? True Let z = 15 + -15. Which is greater: 0.12 or z? 0.12 Let g(i) = -3i3 - 3i*2 - 5i - 10. Let w be g(-3). Are 58 and w non-equal? True Let q be -1440/28-1. Is -3 < q? True Suppose -2s = 4u + 12, -4 - 2 = -3s. Let v = u - -4. Suppose v = w - 2w. Is 0 less than or equal to w? True Let m = -18 + 37/2. Let i = -11 - -13. Which is smaller: m or i? m Let u = 0 + 0. Let m = -79/4 - -379/20. Which is greater: m or u? u Let i = 37/2 - 385/18. Is -2 >= i? True Let u = -11.7 - -12.7. Suppose 0f - 2f - m = 3, 3f - 5m = -11. Which is greater: f or u? u Suppose 5b + o - 15 = 6o, 4b - 11 = 5o. Suppose 3d + 1 = bd. Let t = 0 + d. Is t at most 1/2? False Let v be -2(0 - (-2 - -1)). Let n be (3 + -2)v/13. Which is smaller: -0.4 or n? -0.4 Let p = -7.8 + 9.2. Which is bigger: p or 5? 5 Let m be 1 + -1 - (0 - 4). Suppose mi - 429 + 117 = 0. Let u be (-9)/i8/(-6). Is -1 at most u? True Let m(c) = -c*2 - 4c - 3. Let b be (0 - -1)/((-2)/4). Let a be m(b). Let k be -3 + a/(3/6). Which is smaller: k or -3/4? k Let q = -0.278 + -0.122. Is q at most -2/7? True Suppose 0 = 4s - 0 + 4. Let w = 13 + -10. Is w at least as big as s? True Suppose -v - 9 = -2y, -3y + 2y - 1 = 5v. Let n be (105/(-28))/(3/(-16)). Let f be 0/(5/(n/(-8))). Which is bigger: f or v? f Let s = -7 + 7.1. Let i = 5 + -2. Let v = i - 3. Which is smaller: v or s? v Let c be (4/(-3)3)/1. Let a = c - -3. Let v be (-1)/2 - (-10)/36. Which is greater: v or a? v Suppose -2f = -5f + 3. Is f less than or equal to -4/69? False Let m = -0.06 - 0.04. Let u = -0.3 - m. Is 0 > u? True Let l = -2.9 + 2.825. Is 1 greater than or equal to l? True Let t = -8.9 + 7.9. Which is greater: 7 or t? 7 Let m(p) = p + 3. Let d be m(0). Let n be -2 + (d - 6)/(-3). Is 0 greater than or equal to n? True Let u be 1 - (-13)/(2 - 1). Let h be 66/u - 2/(-7). Is 5 > h? False Let w be 14/(-35) + 2/5. Suppose -4h - h + 15 = w. Let l be (-12)/9h/22. Which is smaller: l or -1? -1 Let r = 9743/28980 - 47/483. Let o = -7/20 + r. Is 1 <= o? False Let r = -3 - 3. Which is smaller: -0.1 or r? r Let f = 12 + -4. Let o = -14 + f. Let j(v) = v - 3. Let u be	{ "pile_set_name": "DM Mathematics" }
y 44 - (-1)/30. 43 Let o(j) = j3 - 47j*2 + 141. What is the remainder when 1264 is divided by o(47)? 136 What is the remainder when 225 is divided by 4/(12/(-9)) - (10 + -18)? 0 Suppose -3p + 5 = -10, 2p = -3d + 169. Let c be ((-3)/(-2) + 4)4/1. Let n = 50 - c. Calculate the remainder when d is divided by n. 25 Suppose -x = -f - 7, -3x - 11 = -0f + 5f. Let k(r) = 27r - 24. Let q be k(4). Suppose -q = -0l - 7l. What is the remainder when l is divided by x? 0 Calculate the remainder when 656 is divided by 0 + 5 - (3 - 0 - 6). 0 Let s be 1(1/(-2) - (-174)/(-4)). Let x = 25 - s. Let w = 122 - x. What is the remainder when w is divided by 14? 11 Let n(z) = -z*3 + 18z*2 + z + 16. Suppose -4a + 74 = 3m - 8a, -110 = -5m + 4a. Calculate the remainder when 270 is divided by n(m). 32 Let q(p) = -23p - 525. What is the remainder when q(-46) is divided by 7? 1 Suppose -3o + 10y + 62 + 49 = 0, 132 = 5o + y. Calculate the remainder when 1792 is divided by o. 10 Let f(t) = 284t + 660. Calculate the remainder when f(12) is divided by 11. 9 Let o(n) = 15n + 2512. Calculate the remainder when o(0) is divided by 180. 172 Suppose 9k - 448 = 263. Suppose 77g = kg - 94. Calculate the remainder when g is divided by 21. 5 Let s(h) = h2 + 13h + 66. Let i(w) = -w*3 + 2w - 12. What is the remainder when i(-5) is divided by s(-10)? 31 Suppose 4l + 61v = 65v + 464, -439 = -4l - v. Let o = l - 103. What is the remainder when 18 is divided by o? 2 Suppose -26 - 2 = 7d. Let l be 68 + (-6 - -3) - d. Suppose lr = 70r - 24. Calculate the remainder when 68 is divided by r. 20 Let r = 12821 - 283. Calculate the remainder when r is divided by 66. 64 Suppose -3m = -t - 5 - 2, 0 = -m + 4. Let s(f) = -280f - 4. Let i be s(1). Let q = -265 - i. Calculate the remainder when q is divided by t. 4 Calculate the remainder when (45/(-12))/((-1403)/200 - -7) is divided by 125. 0 Let u = -4 + 19. Suppose 28z = -5t + 30z + 59, 0 = 3t + 5z - 54. Let b = t + u. Calculate the remainder when 139 is divided by b. 27 Suppose -a = 4t - 1, 6 = -3a - 5t + 2. Let l be (-1)/(1 - (18/4 + a)). Suppose -lb + 24 = -62. Calculate the remainder when b is divided by 16. 11 Suppose 2040 = 48v - 24v. Calculate the remainder when v is divided by 68. 17 Let s = 606 - 573. Calculate the remainder when 129 is divided by s. 30 Let q(a) = 5a2 + 7a - 10. Let k be q(-12). Suppose -d + k = 312. What is the remainder when d is divided by 45? 44 Suppose 2n - k = 237, 2n + k - 228 = 5k. What is the remainder when n is divided by 52? 16 Suppose -3c - 180 = -2z, 5z + 27c = 23c + 427. What is the remainder when z is divided by 19? 11 Suppose 0 = -65l + 68l - 243. Let p = l + -72. Calculate the remainder when 77 is divided by p. 5 Let w(l) = l*2 - 3l + 2. Let z = 356 + -192. Let j = z + -46. Calculate the remainder when j is divided by w(5). 10 Suppose 35b - 28b - 1715 = 0. Suppose -3n - 5x = -b, -8n + 4x - 91 = -9n. Calculate the remainder when n is divided by 39. 36 Let t(d) = d3 - 5d*2 + 3d + 9. Let w(q) = q*2 + 23. What is the remainder when w(-8) is divided by t(5)? 15 Suppose -3j + 3v + 275 - 245 = 0, 0 = -3j + 2v + 29. What is the remainder when 837 is divided by j? 0 Let m = -60 + 106. Suppose -2i + 4c = 0, 0 = -i - 0i + 4c - 8. Calculate the remainder when m is divided by i. 6 Calculate the remainder when ((-5 - 34/(-3))-3)/((-1)/22) is divided by 147. 124 Let r = -307 + 335. Suppose 6n - 109 = 167. Calculate the remainder when n is divided by r. 18 Suppose -6b + 4b = -v + 3856, -b - 19298 = -5v. Calculate the remainder when v is divided by 28. 24 Let m = -9 - -2. Let b(k) be the second derivative of -k*4/12 - 7k3/3 - k2 + 1875k. Calculate the remainder when 185 is divided by b(m). 44 Let u = -104 + 117. Let w = -998 - -647. Calculate the remainder when (-4)/10 + w/(-15) is divided by u. 10 Suppose 0 = -h + 1 - 3, -h + 70 = 4w. Let r(o) = o*3 - 3o*2 - 23o + 108. Calculate the remainder when r(4) is divided by w. 14 Suppose -3l + 3 - 11 = -x, -9 = 3l. Let r(c) = -5c2 + 137c - 40. Calculate the remainder when (-1 - x/(-1)) + 41 is divided by r(27). 11 Let a(s) = 18s - 617. What is the remainder when a(43) is divided by 54? 49 Let l(x) = 2x*3 - 150x + 52. What is the remainder when l(10) is divided by (-3)/6(0 + -56)? 12 Let d = 151 + -150. Let x = 52 + -49. Calculate the remainder when x is divided by d. 0 Let g be 2/((12/46)/(-3)). Let y = -2028 - -2053. Let m = g + y. Calculate the remainder when 8 is divided by m. 0 Let c = -567 - -1031. Let k = c + -442. What is the remainder when 197 is divided by k? 21 Let p(j) = 211j3 - 2j*2 - 8j + 9. Let d be p(1). Let k = d + -204. What is the remainder when 58 is divided by k? 4 Let x = 6560 + -3297. What is the remainder when x is divided by 46? 43 Let f(q) = -q*3 + 11q*2 - 14q + 43. Let d be f(10). What is the remainder when 200 - 6/(-4)6/d is divided by 51? 50 Let w(f) = -558f - 2206. Let q(o) = -o*2 - o + 75. What is the remainder when q(0) is divided by w(-4)? 23 Suppose 973 - 3387 = -34t. Calculate the remainder when 1132 is divided by t. 67 Let y(d) = 9d - 10. Let n = 173 + -156. What is the remainder when y(n) is divided by 48? 47 Suppose 0 = -j - 5j + 54. Suppose 0 = jp + 4p - 143. What is the remainder when p is divided by 7? 4 Let a = -31315 + 35064. What is the remainder when a is divided by 150? 149 Suppose -2w = -3w - 28. Let k(u) = 9u - 57. Calculate the remainder when k(7) is divided by w/(-12) - (-2)/(-6). 0 Suppose -67u + 96880 = 106u. Calculate the remainder when u is divided by 225. 110 Let l(o) = -o + 5. Let w be l(8). Let z(d) = -d3 - d + 2. What is the remainder when z(w) is divided by 10? 2 Let i = 6082 + -5601. Calculate the remainder when i is divided by 158. 7 Let q(f) be the third derivative of -f5/60 - 5f*4/6 - 35f*3/6 - 51f*2. Calculate the remainder when q(-17) is divided by 15. 1 Suppose -6p + 2139 = -5p - 4g, 0 = -2g + 8. Calculate the remainder when p is divided by 712. 19 Let b = -91 + 127. Suppose 3t - 78 = 4i + b, -33 = -t + 3i. What is the remainder when t is divided by 24? 18 Let v be ((-6)/10 + 39/65)/(-4). Suppose l - 2 = -0. Suppose lu - 124 = -5n, 3u + vu = 4n - 113. What is the remainder when n is divided by 6? 2 Let j(z) = z2 + 5z + 2. Let a be j(-4). Let t(y) = y*3 - 10y*2 + 22y - 47. Let h be t(7). Calculate the remainder when 27 is divided by (h/12)/(a/6). 7 Suppose g = o + 411, -o + 861 = 2g - 6o. Let t = -5 - -30. What is the remainder when g is divided by t? 23 Let o be ((-41)/12-9)/((-12)/(-128)). Let v = o - 187. Calculate the remainder when v is divided by 36. 33 Suppose 0 = -2i + 149 - 23. Let x(q) = q*3 + 5q*2 - 4q - 6. Let t be x(-6). Calculate the remainder when i is divided by -993/t2. 30 Let y = -10403 - -10594. Calculate the remainder when 393 is divided by y. 11 Let l(s) = -s*2 - 16s + 16. Let q be -2 + (-4)/(-3) + (-238)/21. Let n be l(q). Let u = n + -34. What is the remainder when u is divided by 17? 13 Let s(b) = -b*2 - 51b - 49. Calculate the remainder when s(-20) is divided by 123. 79 Suppose -i = 4h - 67, -2h = i - 127 + 90. Calculate the remainder when 4409 is divided by h. 14 Suppose v + 19 = 20v. What is the remainder when 46 is divided by (142 + -2)/10 + (v - -1)? 14 Let x(a) = 6a*2 + 5a - 4. Let d = -23185 - -23232. Calculate the remainder when x(-6) is divided by d. 41 Let t(o) = -o*3 + 10o*2 - 6o - 7. Let n(q) = 4q2 + 124q + 13. What is the remainder when t(6) is divided by n(0)? 10 Suppose -2x + 17u = 16u - 9, -3u - 3 = 0. Calculate the remainder when 104 is divided by 27/(-15)(x - 76/4). 23 Let n = -3330 + 3336. Calculate the remainder when 742 is divided by n. 4 Suppose -1813k - 398k = 41042 - 441233. Let s(t) = -t3 + 5t*2 - 2t - 4. Calculate the remainder when k is divided by s(3). 5 Suppose -4z - 1092 = 4n - 1472, -2z = -3n - 150. Calculate the remainder when 9393 is divided by z. 84 Let u be (-495)/66(-2)/5. Suppose 2o - 6o + 181 = -5b, -3o = -ub - 135. Calculate the remainder when o is divided by 10. 4 Let q(s) = -s*3 + 8s*2 + 13s - 15. Let i be q(9). Let y be (12/(-1	{ "pile_set_name": "DM Mathematics" }
le of 43? True Does 11 divide 3492? False Is 109 a multiple of 2? False Is 1120 a multiple of 28? True Is 20384 a multiple of 49? True Does 29 divide 29? True Is 2760 a multiple of 30? True Does 2 divide 86? True Is 5 a factor of 23? False Is 1344 a multiple of 112? True Is 2557 a multiple of 16? False Does 302 divide 18120? True Does 8 divide 175? False Does 75 divide 3034? False Is 60 a factor of 10320? True Does 44 divide 1232? True Is 102 a multiple of 3? True Is 61 a factor of 82? False Does 83 divide 415? True Does 30 divide 1034? False Is 70 a factor of 37800? True Is 19749 a multiple of 51? False Is 5 a factor of 144? False Does 2 divide 597? False Is 1725 a multiple of 114? False Is 297 a multiple of 27? True Is 3 a factor of 653? False Is 1063 a multiple of 3? False Does 18 divide 540? True Is 1831 a multiple of 3? False Does 8 divide 48984? True Is 66 a factor of 198? True Is 13452 a multiple of 57? True Does 46 divide 1748? True Does 5 divide 44526? False Is 410 a multiple of 10? True Is 12 a factor of 952? False Does 59 divide 31624? True Is 53 a factor of 62010? True Is 100 a factor of 1400? True Is 49285 a multiple of 14? False Does 18 divide 396? True Is 3456 a multiple of 8? True Does 7 divide 464? False Is 43 a factor of 1720? True Is 2896 a multiple of 16? True Does 4 divide 38? False Is 14445 a multiple of 15? True Does 39 divide 82290? True Is 27 a factor of 2457? True Is 1334 a multiple of 29? True Does 13 divide 2452? False Is 90 a factor of 25991? False Does 11 divide 3597? True Is 8 a factor of 664? True Does 84 divide 588? True Is 1792 a multiple of 28? True Does 155 divide 10545? False Is 40 a factor of 7565? False Is 76 a multiple of 5? False Is 3567 a multiple of 41? True Is 38 a factor of 15289? False Does 19 divide 14656? False Is 50 a factor of 18214? False Does 21 divide 3675? True Does 20 divide 3240? True Is 210 a multiple of 5? True Is 37 a factor of 50949? True Does 5 divide 408? False Is 128 a factor of 93440? True Is 195 a multiple of 15? True Is 832 a multiple of 20? False Is 35 a multiple of 7? True Does 14 divide 452? False Does 20 divide 7806? False Is 15419 a multiple of 54? False Is 1199 a multiple of 7? False Is 8 a factor of 424? True Does 77 divide 17515? False Is 57 a factor of 1186? False Does 5 divide 31950? True Does 4 divide 52? True Is 833 a multiple of 17? True Is 26 a factor of 641? False Is 71278 a multiple of 106? False Is 186 a factor of 77190? True Does 80 divide 1429? False Does 26 divide 19344? True Is 1744 a multiple of 93? False Is 58 a factor of 2378? True Is 45 a factor of 38333? False Is 513 a multiple of 57? True Is 631 a multiple of 40? False Is 785 a multiple of 6? False Is 2445 a multiple of 4? False Does 41 divide 10582? False Is 28305 a multiple of 9? True Is 15 a factor of 5075? False Does 80 divide 15492? False Is 494 a multiple of 21? False Is 73959 a multiple of 89? True Is 270 a multiple of 27? True Does 21 divide 966? True Does 17 divide 1037? True Is 3152 a multiple of 16? True Is 60 a multiple of 5? True Is 2322 a multiple of 6? True Does 7 divide 20279? True Does 2 divide 118? True Does 18 divide 684? True Is 18 a factor of 457? False Is 16963 a multiple of 8? False Is 12 a factor of 204? True Is 650 a multiple of 35? False Is 23824 a multiple of 16? True Is 181 a multiple of 7? False Does 12 divide 1260? True Does 31 divide 11687? True Is 8899 a multiple of 26? False Is 165 a multiple of 10? False Does 10 divide 20? True Does 7 divide 266? True Is 2304 a multiple of 18? True Does 4 divide 4304? True Does 10 divide 14080? True Is 21352 a multiple of 14? False Is 1783 a multiple of 56? False Is 192 a multiple of 24? True Is 13846 a multiple of 26? False Does 31 divide 93? True Does 69 divide 6779? False Is 413 a multiple of 59? True Is 576 a multiple of 18? True Is 18 a factor of 10031? False Is 25 a factor of 7025? True Does 19 divide 641? False Does 4 divide 1402? False Is 2171 a multiple of 4? False Does 51 divide 1121? False Is 5 a factor of 55? True Is 38 a multiple of 28? False Does 42 divide 252? True Is 2 a factor of 428? True Is 10 a factor of 441? False Is 79025 a multiple of 25? True Is 11 a factor of 62292? False Does 13 divide 17723? False Is 21 a factor of 1785? True Is 12 a factor of 11268? True Is 2466 a multiple of 18? True Is 3640 a multiple of 9? False Does 12 divide 4155? False Is 15880 a multiple of 40? True Is 22 a factor of 836? True Is 7546 a multiple of 19? False Is 9996 a multiple of 102? True Is 15 a factor of 19? False Is 5499 a multiple of 47? True Is 66 a factor of 5089? False Is 70 a factor of 23222? False Is 51 a factor of 9540? False Does 23 divide 29256? True Does 33 divide 36934? False Is 47 a factor of 799? True Is 55 a factor of 330? True Is 6 a factor of 317? False Is 3009 a multiple of 17? True Is 6 a factor of 541? False Does 65 divide 3575? True Is 49 a factor of 111034? True Is 3 a factor of 480? True Is 17 a factor of 95738? False Is 503 a multiple of 4? False Is 35 a factor of 42945? True Is 20642 a multiple of 143? False Does 32 divide 1361? False Does 7 divide 1751? False Is 8274 a multiple of 21? True Is 24548 a multiple of 34? True Is 27 even? False Does 2 divide 192? True Is 290 a multiple of 38? False Is 16 a factor of 2255? False Does 2 divide 682? True Does 30 divide 4071? False Is 2117 a multiple of 117? False Is 12933 a multiple of 27? True Is 22 a factor of 8932? True Is 4410 a multiple of 30? True Does 100 divide 20700? True Does 4 divide 8982? False Does 7 divide 3045? True Does 28 divide 1204? True Does 5 divide 6975? True Is 108416 a multiple of 308? True Is 77596 a multiple of 221? False Is 468 a multiple of 78? True Is 40656 a multiple of 42? True Is 2825 a multiple of 113? True Does 4 divide 43404? True Does 45 divide 1215? True Is 13707 a multiple of 55? False Is 2718 a multiple of 54? False Is 10 a factor of 2570? True Is 3 a factor of 6905? False Does 40 divide 2080? True Is 5721 a multiple of 41? False Is 91 a multiple of 35? False Is 58 a factor of 629? False Does 35 divide 2170? True Is 1562 a multiple of 20? False Is 726 a multiple of 22? True Is 9467 a multiple of 47? False Does 5 divide 46849? False Does 46 divide 690? True Is 18 a factor of 129564? True Is 34 a factor of 1062? False Is 14 a factor of 700? True Is 2700 a multiple of 8? False Is 64 a multiple of 8? True Does 23 divide 2461? True Is 10 a factor of 36697? False Is 103 a factor of 18231? True Is 90192 a multiple of 201? False Does 74 divide 11493? False Does 57 divide 2672? False Is 14 a factor of 5670? True Does 7 divide 14343? True Is 10 a factor of 290? True Is 12 a factor of 17099? False Is 14 a factor of 417? False Does 5 divide 152? False Does 247 divide 42484? True Does 2 divide 5940? True Is 8446 a multiple of 83? False Is 18 a factor of 17231? False Is 4208 a multiple of 9? False Is 176 a multiple of 17? False Is 12034 a multiple of 22? True Does 57 divide 627? True Is 37 a factor of 8917? True Does 345 divide 41055? True Does 57 divide 18777? False Is 18 a factor of 36? True Is 3 a factor of 378? True Is 3481 a multiple of 86? False Is 43226 a multiple of 61? False Is 100 a factor of 100? True Does 3 divide 658? False Is 2332 a multiple of 61? False Is 104 a multiple of 15? False Does 60 divide 12495? False Is 19 a factor of 1702? False Is 463 a multiple of 7? False Is 151 a factor of 18977? False Does 78 divide 2340? True Is 12698 a multiple of 14? True Is 189 a multiple of 4? False Is 14635 a multiple of 73? False Does 4 divide 64? True Does 4 divide 1597? False Is 2280 a multiple of 12? True Is 11 a factor of 14699? False Is 12 a factor of 3324? True Does 25 divide 4770? False Is 999 a multiple of 33? False Is 23 a factor of 253? True Does 25 divide 6425? True Does 43 divide 30141? False Is 49 a factor of 3675? True Is 12 a factor of 88? False Is 250 a multiple of 10? True Is 43757 a multiple of 47? True Does 98 divide 546? False Is 54 a factor of 13824? True Is 413 a factor of 33571? False Is 10633 a multiple of 49? True Is 114 a multiple of 38? True Does 51 divide 15402? True Does 21 divide 6195? True Does 26 divide 17836? True Is 120892 a multiple of 141? False Is 70 a multiple of 7? True Is 23 a factor of 1334	{ "pile_set_name": "DM Mathematics" }
together -169139643 and 0. -169139643 What is 1.1 take away -18944708? 18944709.1 What is the difference between -11.29 and 1223403? 1223414.29 Work out -5571558 - -165. -5571393 Subtract 156840717 from 10. -156840707 What is 6984420 - 205? 6984215 What is -1.584001818 take away 0.1? -1.684001818 What is 3938173.8139 plus -0.2? 3938173.6139 What is 38439585 plus 0.1? 38439585.1 -43.89+290841.8 290797.91 -364.32 + 44.3 -320.02 What is -2.828 less than 4230.662? 4233.49 Subtract 4.3 from -85240. -85244.3 Total of -20010 and 1608. -18402 Calculate -1014388 - 0.0563. -1014388.0563 What is 22779 take away 9493? 13286 Work out -1.525 + 6.01649. 4.49149 What is 3.6969 - 1677? -1673.3031 What is 4711 less than 4.79? -4706.21 Put together -310 and -4271935. -4272245 Add together -1.345 and 38925. 38923.655 What is the difference between 5 and 0.9207028? 4.0792972 Calculate -0.0366356891 - 7. -7.0366356891 -35511 + -298755 -334266 What is -315 - 134455? -134770 8216745 - -1608 8218353 What is 86262 + -82291? 3971 -3.6 + -9849.5474 -9853.1474 -0.4+238692.43262 238692.03262 -15811 + 3155.2 -12655.8 Add -10746152 and -0.2. -10746152.2 What is the difference between -128.024 and -510? 381.976 What is the distance between 0.59 and 620887154? 620887153.41 What is 3231792.789 minus -0.3? 3231793.089 Total of -0.26878 and -578. -578.26878 What is the distance between -35811913 and 1? 35811914 Add -6672 and 126688. 120016 -2110821+-6841 -2117662 0+574272187 574272187 What is the difference between 0.3 and -4500758201? 4500758201.3 Total of 107.8 and 45876.7. 45984.5 Calculate -0.2831 - 48604. -48604.2831 Work out 836.62 - -12219.11. 13055.73 0.5 - 2.32781 -1.82781 What is -213713 minus 8.6271? -213721.6271 What is -1.92 less than 243004? 243005.92 What is -3237779 take away -60? -3237719 Calculate 3042039 - -182. 3042221 Sum -171378 and -0.72027. -171378.72027 Put together -5340993 and -4.38. -5340997.38 What is 0.05322 take away 1755.8? -1755.74678 What is 418321 take away -349? 418670 Add together 11602299 and -66.8. 11602232.2 -144.255 + -590 -734.255 233.9871 + 18 251.9871 Add -125.843 and 0.734. -125.109 Subtract 0.07051 from 37413. 37412.92949 What is 7923 - -141463? 149386 Subtract 549463 from -297. -549760 Work out -158911028.01 - -0.4. -158911027.61 Add together 82677 and -2.104. 82674.896 -49854+1782681 1732827 What is the distance between 0.0331971 and -4? 4.0331971 What is -2 take away 3339.9889? -3341.9889 Calculate 146 + -34382.4. -34236.4 What is -70628 + -40993? -111621 Add -11.139585 and 603. 591.860415 0.5+85831190 85831190.5 Calculate -41440 - -15.4. -41424.6 What is -2.8603579928 - -0.3? -2.5603579928 Put together -149533144 and 254. -149532890 Sum -31106 and 5.309. -31100.691 What is -58 + 109288? 109230 What is the distance between 0.1957398 and 9? 8.8042602 What is the distance between -3 and -538268323? 538268320 -58153 + 101.2 -58051.8 What is the difference between 196 and 86340995? 86340799 Put together -1624.88209 and 3. -1621.88209 What is the distance between 51.6799 and -0.04? 51.7199 What is 0.305987041 - -0.4? 0.705987041 What is 11.318944 minus -1.69? 13.008944 What is the distance between -1839 and -1603654? 1601815 What is -14 less than 4707132? 4707146 Calculate 262617 - -0.36. 262617.36 What is 2.951 minus -0.075204? 3.026204 What is 0.2 take away 310599284? -310599283.8 -0.42+-2692414 -2692414.42 116 + 7.9549 123.9549 What is -59.250816 take away 450? -509.250816 What is 4607889 less than -0.18? -4607889.18 Sum 0.2277 and -1904.4. -1904.1723 28361 - -68999 97360 Work out 0 + 508315.486. 508315.486 What is -2.9 + -96734.2? -96737.1 Work out 8 - -318298. 318306 Work out 136.0619 - -3802. 3938.0619 What is -6128704 less than 101? 6128805 Work out -2281974.36 + 0.076. -2281974.284 Subtract -26186435 from -5. 26186430 650082+-238 649844 -0.4 - 334317.7455 -334318.1455 What is 1.6 take away 36060947? -36060945.4 10 - 956393601 -956393591 Calculate -121.4762 - -67. -54.4762 What is -0.3062972895 plus 3? 2.6937027105 18004934 + 620 18005554 Add 7836.2 and -5.374. 7830.826 -3 + -107104502 -107104505 Put together 419708 and -13. 419695 Total of 79.6 and 24017. 24096.6 What is the distance between -844 and 44.393? 888.393 What is 1409882227 + -4? 1409882223 -4682290 + -134 -4682424 Put together -6 and -1212482. -1212488 Sum -0.43 and 587467. 587466.57 Put together -1068569 and -0.199. -1068569.199 Sum -0.25 and 486012270. 486012269.75 Work out -0.828 + 38.249. 37.421 What is -0.06 minus 34254098.1? -34254098.16 What is 4 plus -3830368963? -3830368959 Work out 0 - -17172588355. 17172588355 Put together -4601 and -0.27796. -4601.27796 Calculate -1456.2857 + -0.3. -1456.5857 Calculate -3985573933 - 0.1. -3985573933.1 Add 68984 and 12297. 81281 -4 - 663347169 -663347173 -0.623631 + 9828 9827.376369 Add together -735.42 and 18.948. -716.472 Calculate 2233 - 13739. -11506 What is 8.708911 - 185? -176.291089 -0.41822 - -65779 65778.58178 Total of 3592981 and 0.4. 3592981.4 -49.261 + 0.010161 -49.250839 2682.155 - 10 2672.155 What is 1 minus 1130.886501? -1129.886501 What is 87975 less than -0.78? -87975.78 Calculate 3262 - -45741. 49003 -2331906 - 30.89 -2331936.89 Sum -263 and 454.54. 191.54 Total of 27439933 and -131. 27439802 Calculate -408774 - -7485.4. -401288.6 Calculate 0.0481917 + 0.0624. 0.1105917 Calculate 0.2 + -0.3520421. -0.1520421 18 + 4.9819213 22.9819213 What is -0.153143 minus -21563? 21562.846857 Put together 17140414515 and -10. 17140414505 Calculate -0.3 - 528101361. -528101361.3 Subtract -2.208134 from -1317. -1314.791866 Subtract 8.42029 from -5141. -5149.42029 7 - 29613.5735 -29606.5735 Calculate 1.5515417 + 1. 2.5515417 What is -6586444 plus 0.02? -6586443.98 Put together -0.22 and 0.012609471. -0.207390529 Put together 653.45 and -0.38. 653.07 What is 107 + -111737? -111630 What is 16730306 less than -0.05? -16730306.05 Calculate -0.5 + 13100955. 13100954.5 Total of -61863 and 46.13. -61816.87 Total of 0.05 and -117961.83. -117961.78 Subtract 93.017327 from -0.04. -93.057327 What is the distance between -3.4 and 156.616492? 160.016492 Work out -132.76 - 153.425. -286.185 Add -7621 and 1499607. 1491986 Calculate -0.1976529 - -0.23. 0.0323471 Total of 9 and 5940315. 5940324 What is -65819 minus -2565? -63254 Calculate -10607 - -15.8. -10591.2 What is -3 less than 1638085943? 1638085946 Work out -0.017733071895 - -2. 1.982266928105 Add together -139 and -5.15686. -144.15686 Calculate -0.3 - -0.13002661. -0.16997339 What is -35 less than 83484588? 83484623 Add together 34958 and -5.194. 34952.806 What is the difference between -96.97 and 5.423? 102.393 -2.366793+9 6.633207 Calculate 131196669 - 2. 131196667 Total of -0.2 and 23250200. 23250199.8 -6214 + 1500 -4714 0.1+2791855 2791855.1 What is 1636319 less than 382? -1635937 Work out 4500 - 209.74. 4290.26 What is -18762763 + 0.1144? -18762762.8856 Calculate -1053.53 - -4400. 3346.47 262.2 + 20.164 282.364 Total of 3537187057 and 0. 3537187057 What is 8292603.175 + -1? 8292602.175 -0.02+0.14524788 0.12524788 Calculate -9346645 + 0. -9346645 Put together 3 and 0.719476137. 3.719476137 What is 1 less than -93.5311? -94.5311 What is -1017.1558 less than -0.57? 1016.5858 What is -2.9 less than -0.0261885? 2.8738115 Add -8.498 and -23820. -23828.498 What is -0.011102 minus -75? 74.988898 Calculate 7143.081 + 0.9. 7143.981 3344 - 498 2846 What is the distance between 19 and 2.37420645? 16.62579355 Put together 5631 and -21.51. 5609.49 Calculate -8 + -9.50251292. -17.50251292 -0.06 - 0.340745 -0.400745 What is 223 less than -3.43637? -226.43637 958809 - -22.5 958831.5 What is the distance between 2 and 9534972169? 9534972167 Calculate 6.5 - 2023172. -2023165.5 Add -3901.2 and 0.06409. -3901.13591 Sum 35894954 and 0.3. 35894954.3 What is 76 - 66962? -66886 Put together -0.342206067 and 24. 23.657793933 What is -51701.6 plus 135533? 83831.4 Add -407 and -51.558729. -458.558729 What is -0.07 less than -644181? -644180.93 Add 46742216073 and 0.1. 46742216073.1 -78.34 + 0.1323 -78.2077 Add 0.4 and 19846344. 19846344.4 Calculate -683.50328 - -0.906. -682.59728 What is -7140 - 346230? -353370 What is 299997 - 1440? 298557 What is 149682045 + -30? 149682015 -218 - 460517039 -4605	{ "pile_set_name": "DM Mathematics" }
-5 (d) -64 a What is the second biggest value in 38.8, 9, -2/15? 9 What is the second biggest value in -4, -3, -1.8, -29/14, -5? -29/14 What is the third biggest value in 22, -2, 24, -187, -3/4? -3/4 Which is the second biggest value? (a) 16 (b) -1/3 (c) -185 b What is the second biggest value in -2, 37, 14575? 37 Which is the second biggest value? (a) -8 (b) -1 (c) -8168 (d) -2 (e) -0.1 b Which is the second biggest value? (a) -0.2 (b) -54369 (c) 8 a What is the third smallest value in 1/16, 1, -0.5, -3/4, 0, 10? 0 Which is the third biggest value? (a) -0.3 (b) -186 (c) -0.22 (d) 2/13 a Which is the biggest value? (a) 99 (b) -0.05 (c) 1 (d) -9 a What is the fifth biggest value in 0.1, -5, 1/78, 9/31, 1? -5 What is the smallest value in 3850, 2/5, 1/2, 3/2? 2/5 What is the third smallest value in -153, -3, -260? -3 What is the third biggest value in -3/2, -3, 0.3, 2, 251? 0.3 What is the fourth smallest value in -1/6, -1.1, 1, 0.4, 4.3, -0.05? 0.4 Which is the third biggest value? (a) -29 (b) 23 (c) -164.1 c What is the second biggest value in -466, 0.5, 1.7, -0.06? 0.5 Which is the second smallest value? (a) -2/7 (b) 12/251 (c) -2 (d) -5 (e) 2/3 c Which is the third smallest value? (a) -1/4 (b) -3 (c) -4 (d) -1 (e) -96/23 b Which is the third biggest value? (a) -0.78 (b) -3 (c) -0.063 (d) -0.1 a Which is the fourth smallest value? (a) -0.1 (b) -2/13 (c) 4 (d) 355 (e) -13 c What is the fifth smallest value in -4/93, -0.1, 0.5, -22, -1/6? 0.5 Which is the biggest value? (a) 1 (b) 2/9 (c) 9 (d) 1/12356 c What is the fourth smallest value in 2/9, 2/73, -3/8, -0.972? 2/9 Which is the third biggest value? (a) 16 (b) 23/2 (c) 0.07 c What is the third biggest value in -62, 0.31, -3? -62 What is the sixth biggest value in -0.5, -3/25, -0.02, 3, 23, 0.4? -0.5 Which is the third smallest value? (a) 0.3 (b) -5.9 (c) -5 (d) 16/5 a Which is the biggest value? (a) 1/2 (b) 1/16 (c) -20.6 (d) -2/11 (e) -7/4 a Which is the fourth smallest value? (a) -4/15 (b) 4 (c) -3 (d) -12/11 (e) -5 (f) -9/8 d Which is the third biggest value? (a) -1 (b) -2 (c) 630 (d) 5/6 a What is the fifth biggest value in 17, 9, -3/7, -0.2, 1? -3/7 Which is the third biggest value? (a) -61 (b) 0.4 (c) -0.9 (d) -3 (e) 4 c Which is the second biggest value? (a) 4/9 (b) -0.85 (c) -1/251 (d) 1/5 d What is the biggest value in 3, 4, 17, -0.0197? 17 What is the fourth smallest value in -0.04, -2/19, -8, 0.3, -13? -0.04 What is the second biggest value in -2/369, -3, -4, 1, -4/7, 0.5? 0.5 Which is the third smallest value? (a) 1/4 (b) -0.3 (c) -564 (d) -9 b Which is the second biggest value? (a) -135 (b) 267 (c) 1 c What is the second biggest value in -2, 4, 1.9, -6.7, -2/9? 1.9 Which is the biggest value? (a) 4 (b) -2 (c) -0.02 (d) 1.14 (e) -1 a Which is the fourth smallest value? (a) 1/39 (b) 3 (c) 0.4 (d) 9 (e) -0.02 (f) -1/5 c What is the third smallest value in -2, -105, -100, -13? -13 What is the fourth biggest value in -21, -188, -0.4, 0.1? -188 What is the third biggest value in -129/7, 1/5, 25? -129/7 What is the fourth biggest value in -7, -2/29, -2/9, -3/5, 4, -6/5? -3/5 Which is the second smallest value? (a) -19 (b) -0.5 (c) -1/55 (d) -15 (e) -2 (f) 0.2 d What is the second smallest value in 284, -3/13, 0.02? 0.02 Which is the fourth biggest value? (a) 1/2 (b) 0.1 (c) 13.6 (d) -2 d What is the second biggest value in 119, -0.2, -2/17, 11, -0.1? 11 Which is the biggest value? (a) -11.8 (b) -0.3 (c) -108/5 b Which is the second smallest value? (a) 0.5 (b) -1583/4 (c) -2/105 c Which is the fourth smallest value? (a) -6/5 (b) -2/9 (c) -4 (d) 605 d Which is the second biggest value? (a) -3 (b) 3/10 (c) 2/19 (d) -1 (e) 41 b What is the third smallest value in -26, -5, 0.19, 38? 0.19 Which is the fourth biggest value? (a) 1 (b) -4/15 (c) -2.5 (d) 38 c What is the fourth biggest value in -4, -3/7, 9/2656, -0.4? -4 What is the second smallest value in -1, -273, 4/7, -5, 4/5, 5/3? -5 Which is the biggest value? (a) -0.1 (b) -1/4 (c) 10 (d) 37 (e) -3 (f) 0.1 d Which is the second smallest value? (a) -0.01 (b) 16.19 (c) -7 a Which is the fourth smallest value? (a) -0.067 (b) 0.06 (c) -0.3 (d) -5 b What is the biggest value in -17, -8, 419? 419 Which is the second biggest value? (a) -4.3 (b) 117 (c) -3/5 (d) 0 (e) 5 e Which is the second biggest value? (a) -0.8 (b) -6 (c) -0.4 (d) -6/5 (e) -2/9 (f) -10 c What is the smallest value in -4091, 0.1, -9/2? -4091 Which is the fourth biggest value? (a) 0 (b) 4 (c) -97 (d) 14 c Which is the smallest value? (a) -63 (b) 0.5 (c) -3/4 (d) -0.04 a What is the smallest value in -0.4, -1/79, -2/9, -0.02, -5? -5 Which is the fifth smallest value? (a) 1 (b) 285.3 (c) -2/13 (d) -0.2 (e) -2 b What is the fifth smallest value in 0.019, -0.3, -1/3, -5, -638? 0.019 What is the biggest value in 1/3, 5, 1/4? 5 What is the third biggest value in 2, 139, 1/5, 0.24, 33, -1? 2 What is the third biggest value in -2/15, 0.1, -15, 4, -0.3, -13? -2/15 What is the third smallest value in -5, -0.02, -373? -0.02 What is the third biggest value in 0.058, -47.05, -3? -47.05 What is the second smallest value in -0.3, -1/3, -7/3, 1/3, 1.1, 0.58? -1/3 Which is the smallest value? (a) -2 (b) -1/2 (c) 1.09 (d) -2/35 a Which is the biggest value? (a) 0.6 (b) -3.7 (c) -2/1917 a Which is the second smallest value? (a) 0.0153 (b) 3 (c) 4.3 b What is the smallest value in 492, 2/7, 431? 2/7 What is the fifth biggest value in 3/8, 1/121, 68, 1/8, 1/4? 1/121 Which is the biggest value? (a) 0 (b) -5 (c) 40 (d) -185/3 c Which is the third smallest value? (a) -6 (b) -0.18014 (c) -2 (d) 1 b What is the third smallest value in -1/8, 2/3929, 14, 15/2? 15/2 Which is the biggest value? (a) -172 (b) 1 (c) -7.6 b Which is the second biggest value? (a) 4 (b) 100 (c) -0.3 (d) -0.2 (e) 3 a What is the fourth biggest value in 15/4, 2, 0.1, 568? 0.1 What is the fourth biggest value in -6, 4/7, -14, -1/22? -14 Which is the smallest value? (a) 1/6 (b) 1 (c) -3 (d) -0.09 (e) -1282 e Which is the biggest value? (a) -0.155 (b) -3/7 (c) -2/3 (d) -0.1 d Which is the second smallest value? (a) -0.3 (b) -4 (c) -2497 b Which is the biggest value? (a) 77 (b) 0.06 (c) -629 a Which is the third biggest value? (a) -1 (b) -96 (c) -1/5 b What is the fifth biggest value in 0.04, -3, 5, 4, -1/7, 0.18? -1/7 Which is the third biggest value? (a) -2 (b) 796 (c) 93/5 a Which is the third biggest value? (a) 0.1 (b) 1 (c) -0.02 (d) -5.6 (e) 0.3 a What is the fifth smallest value in -3/2, -2/11, 1/5, -4, 1/7, 3.1? 1/5 What is the third biggest value in -1, -6/7, 0, -69, 11? -6/7 What is the biggest value in 2.55, 2, -5, 0.5, 3? 3 Which is the third biggest value? (a) 3/5 (b) 20 (c) 4159 a What is the second biggest value in -168, -1, -2, 3? -1 Which is the biggest value? (a) 18836 (b) -2 (c) -0.3 (d) -3/7 (e) 1/7 a Which is the smallest value? (a) -1/3 (b) 1408 (c) -1/7 (d) -480 d Which is the fourth biggest value? (a) -0.3 (b) -39 (c) 6 (d) 0 (e) 0.6 a Which is the second smallest value? (a) 0.05182 (b) 3/5 (c) -1 a What is the second biggest value in -9, -23, 13? -9 What is the fifth smallest value in 1/25, -2/15, 2/5, 1/4, -3/5? 2/5 What is the fifth biggest value in 2/11, 0.3, -1/3, 1, 298? -1/3 Which is the fifth smallest value? (a) 18/7 (b) 1.2 (c) 2/15 (d) -5 (e) -0.5 (f) 4 a Which is the fourth biggest value? (a) 2 (b) -1/15 (c) -2/11 (d) 4 (e) 5 b What is the third smallest value in 0.5, -43, 5, 47/4? 5 Which is the fourth biggest value? (a) 1.46 (b) -25 (c) -2 (d) 1 (e) -2/13 c Which is the smallest value? (a) 18 (b) -0.5 (c) -4 (d) -3 (e) 23.2 c What is the third biggest value in -5/4, 12, -1, -3, 2, 12/7? 12/7 What is the biggest value in -21, -1, 56, 1, 26? 56 Which is the third smallest value? (a) -97 (b) -0.1 (c) 6 c What is the third biggest value in 0.3, -5/66, -0.07? -5/66 Which is the second biggest value? (a) 3/7 (b) -6 (c) 25 a Which is the fourth biggest value? (a) 2 (b) 1 (c) 81 (d) 0 (e) -0.52 d Which is the second smallest value? (a) -2 (	{ "pile_set_name": "DM Mathematics" }
4 - a*3/18 - 7a*2 - 1. Let f(p) = 0. What is p? 1, 2 Factor -13o*4 - 3o*2 + 16o*4 - 2187o + 2172o + 15o*3. 3o(o - 1)(o + 1)(o + 5) Suppose -6k = 2724 - 2754. Factor 2/5a3 + 0a + 2/5a2 + 0 - 2/5a*k - 2/5a*4. -2a*2(a - 1)(a + 1)2/5 Let v = 284 + -284. Let l(r) be the third derivative of 0 + 0r*4 - 1/735r*7 - 1/420r*6 + 0r + vr3 - 2r*2 + 1/105r*5. Factor l(n). -2n*2(n - 1)(n + 2)/7 Let a(v) = v2 - 9v + 2. Let p = -192 - -201. Let n be a(p). Suppose 1/3wn + 2/3 + w = 0. Calculate w. -2, -1 Let u(a) be the third derivative of 2a*7/105 + 14a*6/15 - 29a*5/15 - 336a2. Determine b, given that u(b) = 0. -29, 0, 1 Let s(t) be the first derivative of t6/180 - t*5/150 + 5t*3/3 + 10. Let j(q) be the third derivative of s(q). Factor j(y). 2y(5y - 2)/5 Let q be 4/((-7)/((-14)/4))5. Find v, given that qv*2 - 2v*2 - 9v*2 = 0. 0 Let f be (-4)/66 - ((-8)/12)/2. Let t = f - -5/22. Factor tq - 1/2q2 + 0. -q(q - 1)/2 Let f(m) be the second derivative of 0 - 19/15m4 - 3/5m*2 + 4/3m*3 + 9m + 3/25m6 + 6/25m*5. Determine z, given that f(z) = 0. -3, 1/3, 1 Let d = 63 - 36. Factor 2 + dn*2 - 2n - 11n3 - 11n - 12n3 + 7n4. (n - 1)3(7n - 2) Factor 30w2 + 6w*2 + 1093 + 2568 - 525 + 565w + 107w. 4(3w + 28)2 What is n in -16 + 296/7n + 10n3 - 6/7n*4 - 236/7n2 = 0? 2/3, 2, 7 Let i(m) be the third derivative of -m8/336 - m7/70 + m6/12 - m*5/30 - 3m*4/8 + 5m*3/6 + 2m2 - 18. Solve i(z) = 0. -5, -1, 1 Let b(c) be the third derivative of c5/180 - 5c4/72 - 7c*3/9 + 50c*2 + 3c. Factor b(s). (s - 7)(s + 2)/3 Let y(m) be the first derivative of -m4/8 - 5m*3/2 - 75m*2/4 - 26m + 32. Let i(h) be the first derivative of y(h). Find f, given that i(f) = 0. -5 Let a = -9389 - -9391. Factor -8/3k + 2/3k*a + 8/3. 2(k - 2)2/3 Let y(x) be the third derivative of x5/60 - 7x4/16 + 5x*3/6 - 27x*2. Factor y(v). (v - 10)(2v - 1)/2 Solve 45m - m*2 - 2m*2 + 42m - 66m = 0. 0, 7 Let u(p) be the second derivative of -p7/8820 - p6/1260 + p5/140 - 11p*4/6 - 26p. Let f(k) be the third derivative of u(k). Solve f(v) = 0. -3, 1 Let z = -32 + 34. Solve 2w + 4w*5 + 14w*3 - 10w*z - 10w*4 + 4w*3 - 4w*4 = 0. 0, 1/2, 1 Factor 0 + 40/7k + 12/7k2 - 4/7k*3. -4k(k - 5)(k + 2)/7 Let u(w) = 9w - 1. Let j be u(1). Let x = -4 + j. Determine c so that -5c*4 + 4c*2 - 3c - 2c5 + 4c*4 + 5c - 3cx = 0. -1, 0, 1 Factor -57q*2 - 2q + 115q2 - 57q*2. q(q - 2) Factor -45x - 87/2 - 3/2x*2. -3(x + 1)(x + 29)/2 Suppose 0 = -3c - i + 4, -5c = -c + 4i. Solve 180r + r4 - 2r*c - 180r + 1 = 0 for r. -1, 1 Let j(n) = n*4 + 37n*3 + 178n*2 + 334n + 192. Let w(d) = -36d3 - 177d*2 - 333d - 192. Let a = 19 + -21. Let m(l) = aw(l) - 3j(l). Factor m(b). -3(b + 1)(b + 4)*3 Let c = 1084 + -1082. Let y(i) be the first derivative of -4/3i*c - 4i - 3 + 4/9i3. Factor y(b). 4(b - 3)(b + 1)/3 Let i = -32590/21 - -1552. Let p(s) be the first derivative of -11 + 3/7s*2 - is*3 - 4/7s. Factor p(w). -2(w - 2)(w - 1)/7 Let m(d) be the second derivative of 0d6 + 0d*4 + 0d*2 + 0 - 32d - 5/6d3 + 1/2d*5 - 5/42d7. Suppose m(v) = 0. What is v? -1, 0, 1 Let i(d) be the first derivative of d5/50 - 3d4/40 + d3/30 + 3d*2/20 - d/5 - 88. Factor i(q). (q - 2)(q - 1)*2(q + 1)/10 Let i(g) = 0g - g2 + 0g. Let s(r) be the first derivative of -r*4/4 - 3r3 - r2/2 + 61. Let f(h) = 22i(h) - 2s(h). Solve f(k) = 0 for k. 0, 1 Let w be 90/270 - (-1)/(-3). Let k(p) be the second derivative of 5/12p4 + 0 + wp*3 + 0p*2 + 1/4p*5 - 12p. What is o in k(o) = 0? -1, 0 Let v be -3 + 10 + -1 + -226. Let t be 2/8 + (-1025)/v. Factor 54/11n + t + 18/11n*2 + 2/11n*3. 2(n + 3)3/11 Let q(f) = f3 + 4f2 + 2f + 11. Let l be q(-4). Let s(n) be the second derivative of 0 + 8n - 1/12n*4 + 0n*l + 1/2n*2. Factor s(m). -(m - 1)(m + 1) Let c = -8959/80 + 112. Let l(p) be the third derivative of 5p2 + 0p*3 + cp*6 - 1/40p*5 + 1/48p*4 - 1/420p*7 + 0 + 0p. Factor l(h). -h(h - 1)3/2 Let d(q) = -6q + 63. Let k be d(0). Factor -12l - k - 2l*2 + 36 + 35 + 6l*2. 4(l - 2)(l - 1) Let c(s) = -2s + 1. Let m be c(-7). Suppose 0 = -5o + 10o - m. Factor 0d5 - 8d*4 + 4d*4 + 8d*o - 4d*5. -4d*3(d - 1)(d + 2) Factor -24 + 15y*2 + 9y*3 - 4y*3 - 5y - 33 + 42. 5(y - 1)(y + 1)(y + 3) Let n(v) be the third derivative of v6/660 - 3v*5/55 + 7v*4/12 - 20v*3/11 + 20v*2 - 6v. Factor n(m). 2(m - 12)(m - 5)(m - 1)/11 Factor -2i*3 - 44i*2 - 220 + 180 - 97i + 15i. -2(i + 1)*2(i + 20) Factor 0 - 1/10m3 - 1/10m + 1/5m2. -m(m - 1)2/10 Let q(v) = v4 - v3 + v2 - v. Let d(w) = -12w4 + 27w*3 + 21w. Let y = 6 + 11. Let m = y + -16. Let r(b) = md(b) + 15q(b). Factor r(t). 3t(t + 1)*2(t + 2) Let r(v) be the second derivative of v*4/20 + 11v*3/5 + 363v*2/10 - 349v. Find z, given that r(z) = 0. -11 Suppose -3c + 6c - 72 = 0. Factor 9u + 3u*2 - cu - 8u2. -5u(u + 3) Factor 198224 + 64f*2 + 11664f - 58256 + 260f2 + 3f*3. 3(f + 36)*3 Let z(c) = -32c*4 - 13c*3 + 11c*2 + 13c + 7. Let s(f) = 17f4 + 6f*3 - 5f*2 - 6f - 4. Let y(i) = 7s(i) + 4z(i). Find w such that y(w) = 0. -10/9, -1, 0, 1 Let p = 15 + -3. Let j be 5 - (78/p - 3). Factor -3/4x2 + 0 + jx*3 - 3/4x. 3x(x - 1)(2x + 1)/4 Let c(m) = 8m3 - 4m*2 - 75m - 20. Let i(r) = r3 - r2 + 1. Let y(f) = -c(f) + 5i(f). Factor y(p). -(p - 5)(p + 5)(3p + 1) Let o(u) = -u*2 + 3u + 20. Let d(k) = 4k2 - 10k - 81. Let s(b) = 2d(b) + 9o(b). Find c such that s(c) = 0. -2, 9 Let v(m) be the second derivative of 2m6/21 - 12m*5/35 - 71m*4/21 + 20m*3/7 + 2m. Let v(y) = 0. What is y? -3, 0, 2/5, 5 Determine k, given that 1/4k5 - 7/4k*3 + 0k*4 + 0k + 3/2k2 + 0 = 0. -3, 0, 1, 2 Suppose -u2 - 66u + 49u + 37u = 0. What is u? 0, 20 Let g(j) be the third derivative of 0 + 49/320j6 + 0j + 0j3 + 1/16j*4 + 7/40j*5 - 9j*2. Let g(l) = 0. Calculate l. -2/7, 0 Suppose 0 = -r - 3r + 76. Suppose -r - 5 = -4o. Factor x2 + x + ox - 6x. x(x + 1) Let q(t) be the first derivative of -5t6/6 - 13t*5 + 75t*4/2 - 10t*3/3 - 145t*2/2 + 75t - 310. Solve q(d) = 0. -15, -1, 1 Let l(n) = n*2 + 6n. Let d be l(-6). Let k(f) be the third derivative of 0 - 5f2 + 0f + 1/240f5 + 0f*3 + df*4. Suppose k(h) = 0. What is h? 0 Factor -37o + 30o3 - 40o*2 + 5o*4 + 11o - 4o + 35. 5(o - 1)*2(o + 1)(o + 7) Let j(b) be the third derivative of 5b8/336 + b7/21 - b*5/6 - 5b*4/24 - 6b*2 + 10b. Let j(o) = 0. What is o? -1, 0, 1 Let n(d) = -17d3 + 60d*2 - 105d + 50. Let x(h) = -14h3 + 59h*2 - 106h + 51. Let u(m) = 5n(m) - 6x(m). Determine p, given that u(p) = 0. -56, 1 Let u(r) be the first derivative of -5r6/6 + 3r*5 - 20r*3/3 - 64. What is l in u(l) = 0? -1, 0, 2 Factor 2/7h*4 + 6/7h*3 + 0 + 4/7h*2 + 0h. 2h2(h + 1)(h + 2)/7 Let o(i) be the second derivative of -2/3i*6 + 0 + 0i*2 + 2/3i*4 + 8/21i*7 + 14i + 0i3 - 7/5i*5. Suppose o(f) = 0. Calculate f. -1, 0, 1/4, 2 Let r(h) be the first derivative of -1/30h*6 - 15 + 4/25h*5 - 2/5h + 1/2h2 - 2/15h*3 - 1/5h*4. Let r(d) = 0. What is d? -1, 1, 2 Let r(l) be the second derivative of -1/45l*6 + 18l + 0l2 + 0 + 0l*3 + 0l*4 + 0l5. Determine d, given that r(d) = 0. 0 Factor -p4 + 5p4 + 2708p*3 + 12p*2 - 2692p*3. 4p*2(p + 1)(p + 3) Let i(c) = c2. Let z be i(-2). Let p = 2 + z. Factor 3v*2 - 4v*2 - 9 + 0v - pv. -(v + 3)2 Let h(m) be the first derivative of -m6/180 + 7m5/120 - m4/4 + 5m3/9 - 2m*2/3 + 40m - 25. Let x(w) be the first derivative of h(w). Factor x(n). -(n - 2)*3(n - 1)/6 Let z = -7 + -5. Let b be (-2)/z + 11/6. Let 10k2 - 5k*b - 2k*2 - 9k + 6 = 0. Calculate k. 1, 2 Let m(x) = -6x2 - 75x + 39. Let f = 5 - 26. Let c(b) = b*2 + 15b - 8. Let i be (3 - 13)(-16)/(-40). Let u(z) = fc(z) + im(z). Solve u(n) = 0. 1, 4 Let i = 245 - 3667/15. Let m = 3864 - 57958/15. Factor -8/15 - mv*	{ "pile_set_name": "DM Mathematics" }
rt(11) + sqrt(33)/sqrt(3))) + (sqrt(77) - (2sqrt(77)-3 + sqrt(77)))/sqrt(7). 61sqrt(11)/10 Simplify -65(-3 + sqrt(5) + sqrt(125))2. -5670 + 1080sqrt(5) Simplify (sqrt(210)/(sqrt(6) + sqrt(384)))/sqrt(7). sqrt(5)/9 Simplify sqrt(1377)-1 + 2. -9sqrt(17) + 2 Simplify (-4 + (sqrt(720) - (sqrt(720) + (sqrt(720)-4)2)))-3. 34572 Simplify (sqrt(80)/(sqrt(10)/sqrt(5)) - sqrt(40))/(sqrt(200)-1 + sqrt(8)). 0 Simplify (sqrt(168)/sqrt(6) - (-3 + sqrt(35)/sqrt(5)))2. 6sqrt(7) + 16 Simplify sqrt(110)/(sqrt(250) - (sqrt(250) + (sqrt(250)-3 - sqrt(250) - sqrt(250)))). sqrt(11)/25 Simplify (sqrt(5) + (2 + sqrt(5))2)6. 24 + 18sqrt(5) Simplify (sqrt(110)-5 + sqrt(110))/sqrt(10) - (2(sqrt(99))*2 - sqrt(11)). -198 - 3sqrt(11) Simplify (-1sqrt(1275))/sqrt(3). -5sqrt(17) Simplify 0 + (sqrt(76)/sqrt(4))*2 + sqrt(76) + -1sqrt(76). 19 Simplify (-2-1sqrt(102) + sqrt(102) - sqrt(102))/(sqrt(72)/(sqrt(24)/sqrt(2))). 2sqrt(17) Simplify 1(sqrt(88) + (sqrt(88) - (sqrt(88) + 1sqrt(88))-6))/(-1(sqrt(8)2 + sqrt(8))). -14sqrt(11)/3 Simplify (sqrt(70)11)/sqrt(10)-5. -5sqrt(7) Simplify -4(-1(sqrt(7) + sqrt(252) + sqrt(7)))2. -1792 Simplify ((sqrt(20)/(sqrt(20)/sqrt(5)))2 - sqrt(5)) + (sqrt(5) - (-5 + sqrt(20))). -2sqrt(5) + 10 Simplify (sqrt(8) + 1 - sqrt(8)) + 5. 6 Simplify ((sqrt(68)-26)/(sqrt(324)1 - sqrt(4)))2. 153/4 Simplify (5(sqrt(700) + 2) + 3)*2. 1300sqrt(7) + 17669 Simplify (sqrt(4320)-1 + sqrt(30))/(2sqrt(810) - sqrt(810) - sqrt(810) - sqrt(810)). 11sqrt(3)/9 Simplify sqrt(208) + (sqrt(208) + sqrt(208)-1 + 1 - sqrt(208)) + (1 + sqrt(208) + sqrt(208) + 0 + sqrt(208))*2. 24sqrt(13) + 1874 Simplify -5 + (sqrt(175)-1)2 + (1sqrt(7) + 2 - -2sqrt(448)). 17sqrt(7) + 172 Simplify (sqrt(18) + -2sqrt(288))/(-4(sqrt(6) + sqrt(6)-2)). -7sqrt(3)/4 Simplify (-6sqrt(50) + sqrt(22)/sqrt(275))2. 44402/25 Simplify (((sqrt(136) + sqrt(136)2)-5)/(sqrt(8) - -3sqrt(8)2))2. 3825/49 Simplify (sqrt(1800)-2)/((-3sqrt(36))/sqrt(6)). 20sqrt(3)/3 Simplify 4(sqrt(12) + -1) - (sqrt(36)/sqrt(3) + 0). -4 + 6sqrt(3) Simplify 3 + 0 + sqrt(567) + 5 + (sqrt(567) + 1)*2. 27sqrt(7) + 576 Simplify sqrt(25)/(sqrt(10)/(sqrt(10)/sqrt(5))). sqrt(5) Simplify sqrt(1008) + 3. 3 + 12sqrt(7) Simplify (-3 + sqrt(108) + 0 + sqrt(108))2 + -5 + sqrt(108) + 2. -66sqrt(3) + 438 Simplify -3(2sqrt(245) + 3 - (sqrt(245) - (0 + 2sqrt(245))))2. -6642 - 378sqrt(5) Simplify sqrt(36)/(sqrt(2940)/sqrt(5)). sqrt(3)/7 Simplify 0 + (sqrt(1372) + 3)*2. 84sqrt(7) + 1381 Simplify (sqrt(500) - (sqrt(500) - 3sqrt(500))) + -5. -5 + 30sqrt(5) Simplify sqrt(76)/((sqrt(32) - (sqrt(32) + sqrt(2592)))/sqrt(8))-5. 5sqrt(19)/9 Simplify ((-3sqrt(264))/sqrt(12))/sqrt(2). -3sqrt(11) Simplify (1 + sqrt(12) + 2)-2. -4sqrt(3) - 6 Simplify (sqrt(78)/sqrt(6)-4 + sqrt(13) + sqrt(1300) + -2)2. -28sqrt(13) + 641 Simplify (0 + sqrt(11))5 + -2. -2 + 5sqrt(11) Simplify (-2sqrt(320)/sqrt(4) - sqrt(320)-25)2. 25920 Simplify (sqrt(7) - (sqrt(28)/sqrt(4) + -5))1. 5 Simplify 4 + sqrt(17)-2 + 1 + (sqrt(17) - sqrt(170)/sqrt(160)) + 3. -5sqrt(17)/4 + 8 Simplify 3(sqrt(3) - 4(sqrt(3)3 + sqrt(3) + sqrt(3))2). -900 + 3sqrt(3) Simplify 5 + (sqrt(19) - (-1sqrt(76)/sqrt(4) - sqrt(19))) + sqrt(608)/sqrt(2). 5 + 7sqrt(19) Simplify (sqrt(192) - (1sqrt(192) + 4))2. 16 Simplify ((sqrt(7) + -2 + 1 + sqrt(7))-4)*2. -64sqrt(7) + 464 Simplify (((sqrt(288)2)/sqrt(12))/sqrt(8))2. 12 Simplify 0 + -3sqrt(11) + 2. -3sqrt(11) + 2 Simplify (-6(1 + sqrt(1377)2 - (sqrt(1377) - (-4 + 0 + sqrt(1377)))))2. -3888sqrt(17) + 198612 Simplify sqrt(1331)3 + -4. -4 + 33sqrt(11) Simplify -5(sqrt(833) + sqrt(833)4). -175sqrt(17) Simplify 5((1sqrt(3))2 + -5). -10 Simplify (5sqrt(55))/sqrt(11)-1. -5sqrt(5) Simplify (-1 + sqrt(1700) - -6(sqrt(51)/sqrt(3) - sqrt(17)))2. -2 + 20sqrt(17) Simplify (-3 + -1sqrt(468))*2. 36sqrt(13) + 477 Simplify (sqrt(2880)1 + sqrt(2880))/(1sqrt(729) + sqrt(729)). 8sqrt(5)/9 Simplify (((-1sqrt(189))/sqrt(9))/(sqrt(108)2))2. 7/144 Simplify -5 + sqrt(1900) + 1. -4 + 10sqrt(19) Simplify (sqrt(33)/sqrt(3))*26 + 2 + 1 + sqrt(11). sqrt(11) + 69 Simplify (-6-1sqrt(121))/(sqrt(77)/(sqrt(21)/sqrt(3))). 6sqrt(11) Simplify (((sqrt(190) - 2sqrt(190)) + sqrt(190))-3 - sqrt(190))/sqrt(10). -sqrt(19) Simplify sqrt(102)/(-2sqrt(6)) - sqrt(153)1. -7sqrt(17)/2 Simplify -4 + (sqrt(468)-1)2. 464 Simplify -4(0 + sqrt(11)) - (sqrt(396) + -2 + sqrt(396))*2. -1588 + 44sqrt(11) Simplify (5 + (sqrt(3) - (sqrt(3) - sqrt(3)1)6)*2)-2. -16 Simplify (sqrt(136)16)/(sqrt(128)-2 + sqrt(128)) + 3. -3sqrt(17)/2 + 3 Simplify (2sqrt(68)/(sqrt(16)/sqrt(4)))2. 68 Simplify -1 + -1(sqrt(5) + 1). -sqrt(5) - 2 Simplify -3 + (sqrt(65)/sqrt(20))*2 + sqrt(26)/(-2sqrt(2) + sqrt(2)). -sqrt(13) + 1/4 Simplify -5 + 6(-3sqrt(7)-1)2. 373 Simplify (1 + 1 + sqrt(11))2-2. -30 - 8sqrt(11) Simplify -4((sqrt(500) + -2 - sqrt(500)) + sqrt(500))*2. -2016 + 160sqrt(5) Simplify sqrt(20)/sqrt(360) + 3 + sqrt(18). 3 + 19sqrt(2)/6 Simplify 1 + 0 + ((sqrt(704) - (sqrt(704) + 1)) + -2 - sqrt(704))2. 48sqrt(11) + 714 Simplify sqrt(88)/(sqrt(1152) + 1sqrt(1152) - sqrt(1152)). sqrt(11)/12 Simplify (2sqrt(8208))/sqrt(3). 24sqrt(19) Simplify (sqrt(1872) + sqrt(1872)2)*2 + -2 + -4. 16842 Simplify (((-5sqrt(99) - sqrt(11)) + 3)3)2. -864sqrt(11) + 25425 Simplify (sqrt(1331)2 + 4)2. 176sqrt(11) + 5340 Simplify ((sqrt(13) - sqrt(52))-2 - (sqrt(13) + (sqrt(130)2)/sqrt(10)))*2 + -1. 12 Simplify -2 + sqrt(20) + -3. -5 + 2sqrt(5) Simplify (3 + sqrt(19) + 2)4. 4sqrt(19) + 20 Simplify sqrt(77)/((sqrt(1100) - (sqrt(1100)2 + sqrt(1100))) + sqrt(1100)). -sqrt(7)/10 Simplify 3 + (sqrt(750)-2)/sqrt(6). -10sqrt(5) + 3 Simplify -1(-1sqrt(19))2 + 5 + sqrt(76)/sqrt(4). -14 + sqrt(19) Simplify -1sqrt(6480)4. -144sqrt(5) Simplify (1sqrt(847))2 + sqrt(7) + (sqrt(1008)-2 - sqrt(7))*2. sqrt(7) + 5222 Simplify (sqrt(84) + sqrt(84) + sqrt(84) + ((sqrt(84) + sqrt(84) + (sqrt(84)1 + sqrt(84) - sqrt(84)) + sqrt(84))-4 + sqrt(84) - sqrt(84)))/(1sqrt(12)-2). 13sqrt(7)/2 Simplify sqrt(104)/(2sqrt(8)) + (3sqrt(78))/sqrt(6). 7sqrt(13)/2 Simplify sqrt(2548) + -4 + -4. -8 + 14sqrt(13) Simplify -5 + -1 + sqrt(275) + sqrt(11) + -4 + -2. -12 + 6sqrt(11) Simplify -5-4sqrt(44). 40sqrt(11) Simplify (sqrt(88)3)/sqrt(8) - (sqrt(11) - (sqrt(11) + -1)-5)*2. -421 + 63sqrt(11) Simplify ((sqrt(475) + 1)-3)21. 90sqrt(19) + 4284 Simplify (sqrt(26)/sqrt(2) + sqrt(13))2 + 4 + (sqrt(13) - (1 + -1 + sqrt(13))). 56 Simplify (-4 + sqrt(720)-2 + sqrt(720) + 4 + 0)*2. 720 Simplify (-2sqrt(24)/sqrt(3))/(sqrt(24)/sqrt(150)). -10sqrt(2) Simplify 0 + 4(sqrt(3) + sqrt(9)/sqrt(3))*2. 48 Simplify sqrt(99)/(1sqrt(576) - sqrt(9)). sqrt(11)/7 Simplify -2 + -2 + sqrt(5) - ((sqrt(500) - (sqrt(500) + sqrt(500)-2) - sqrt(500))2 - sqrt(5)). -504 + 2sqrt(5) Simplify (sqrt(343) - sqrt(343)24)*2 + 5. 16812 Simplify 3(sqrt(153) + 3(sqrt(153) + 1sqrt(153) + sqrt(153)))/sqrt(9). 30sqrt(17) Simplify (1sqrt(48)/sqrt(2))/(sqrt(800)1 + sqrt(8)). sqrt(3)/11 Simplify (sqrt(2) + (sqrt(2) - sqrt(22)/sqrt(44)))2 - sqrt(2) - (0 + sqrt(4)/sqrt(2)). -2sqrt(2) + 9/2 Simplify sqrt(63) + -2 + -3. -5 + 3sqrt(7) Simplify ((sqrt(1200) - (sqrt(1200) - (sqrt(1200) + 1))) + 2)2. 120sqrt(3) + 1209 Simplify (-13-1sqrt(3))2 + 4. 31 Simplify -6((1 + 0 + sqrt(19))*2 + sqrt(19) - sqrt(19))3. -360 - 36sqrt(19) Simplify 4(-5 + sqrt(208)). -20 + 16sqrt(13) Simplify 5-1sqrt(5324)1. -110sqrt(11) Simplify ((sqrt(68) - (sqrt(68) + 1)) + sqrt(68))2 + sqrt(17) + 5 + sqrt(136)/sqrt(8). -2sqrt(17) + 74 Simplify (sqrt(175)/sqrt(80) + sqrt(35))/(-6sqrt(45)). -5sqrt(7)/72 Simplify (sqrt(39)/sqrt(3) + sqrt(13))*2-6 + 5 + 4. -303 Simplify sqrt(425) + 1 + (sqrt(17) - (sqrt(17) - (sqrt(17) - (sqrt(17) + 2 + 1 + sqrt(17)) - sqrt(17))*2)). 17sqrt(17) + 78 Simplify sqrt(720) + 1(sqrt(720) + -1)2. -12sqrt(5) + 721 Simplify (sqrt(44) - sqrt(3564)1)/((sqrt(96)/sqrt(3))/sqrt(8)). -8sqrt(11) Simplify -2(-2sqrt(612) - sqrt(612)) + -5. -5 + 36sqrt(17) Simplify -1sqrt(325)1. -5sqrt(13) Simplify 2(sqrt(1872) + -1 + 4 - sqrt(1872))-3. -18 Simplify	{ "pile_set_name": "DM Mathematics" }
2). Suppose 0 = 2x + 2 + 2, kx = -y - 1. What is the remainder when 25 is divided by y? 4 Let n = 6 + 1. Let k be -3(100/(-15))/5. Suppose -a + k = -9. Calculate the remainder when a is divided by n. 6 Let q be 1 + -4 + (1 - 0). Let z be 2 - 0 - 4/q. What is the remainder when (2/3)/(z/6) is divided by 1? 0 Let o(a) = 7a*3 - 3a*2 + 2a + 2. Let i = 14 - 12. Calculate the remainder when o(i) is divided by 13. 11 Let b = 5 - 2. Suppose -bz + 213 - 12 = 0. What is the remainder when z is divided by 17? 16 Let o(p) = p3 - p2 - p. Let c be o(0). Calculate the remainder when 18 is divided by 9 + c + 0 + 1. 8 Suppose 4m - 232 = -4o, 3o = -2o - m + 286. Let w(d) = -2d + 4. Calculate the remainder when o is divided by w(-8). 17 Let g(i) = 2 - 27i + 2i - 3. Calculate the remainder when g(-1) is divided by 4/(-8) + (-54)/(-4). 11 Let u(k) be the second derivative of 11k4/6 - k3/3 + k2/2 - k. Calculate the remainder when 8/((-33)/(-15) + -2) is divided by u(1). 19 Let t = 16 + -9. Let d be 1(3 + -2)-8. Let n = t - d. Calculate the remainder when n is divided by 6. 3 Let o = 1 - -16. Let c = o - 0. What is the remainder when c is divided by 6? 5 Let h = -9 + 30. What is the remainder when 98 is divided by h? 14 Let k(z) = z2 + 8. Calculate the remainder when k(7) is divided by 20. 17 Let p be (11 + -7)(1 - 0). Suppose 5i - 12 = -2x + 2, x = -i + p. Suppose -2 = -xj + 26. Calculate the remainder when 41 is divided by j. 13 Suppose 0 = z + z - s - 6, -2s = 4z - 28. Let l(w) = -2w*2 - 2w*2 - 3 + 8w + 3w2. What is the remainder when 22 is divided by l(z)? 10 What is the remainder when (-1 - -4)(-3)/(-9)7 is divided by -4 + (-4)/(-2) + 7? 2 Suppose -2r + 4r - 6 = 0. Suppose -12 = -3s + r. Calculate the remainder when 13 is divided by s. 3 Suppose 4t + 1 = -3. Let n be -4 + 29 + 4 + t. Suppose 2u + n = 4u. What is the remainder when 27 is divided by u? 13 What is the remainder when 61 is divided by (-1 + 2 - -18) + -3? 13 Suppose -9d = -12d + 9. Suppose 5q - 3t = 4q + 19, 0 = -4q - dt + 151. What is the remainder when q is divided by 12? 10 Let t be (1/2)/(1/6). Suppose 0j = -s + 3j - 2, t = j. Let d = 5 + 7. Calculate the remainder when d is divided by s. 5 Let s = -1 + 1. Let u(i) = -i + 28. What is the remainder when u(s) is divided by 15? 13 Suppose 148 = 25s - 252. Calculate the remainder when s is divided by 5. 1 Suppose 0 = 11g - 7g - 92. Let i = -16 + g. What is the remainder when 13 is divided by i? 6 Let b = -3 - -9. Calculate the remainder when 22 is divided by b. 4 Let m = -1 + 9. Calculate the remainder when 29 is divided by m. 5 Let j(o) = 2o - 2. Let r be j(4). Let k = 15 - r. Let m = 13 - k. Calculate the remainder when m is divided by 2. 0 Suppose 6x - 6 = 3x. Suppose -2g + 2i + 18 = 0, -16 - 21 = -5g + i. What is the remainder when g is divided by x? 1 Suppose 5i + 139 = 34. Suppose 3n = b + 98, 5n + b - 140 = n. Let j = n + i. What is the remainder when j is divided by 8? 5 Suppose 12 = -8h + 4h. Let c(d) = -d + 3. Calculate the remainder when ((-1)/h)/((-2)/(-66)) is divided by c(-3). 5 Let w = -36 - -51. What is the remainder when w is divided by (-3 - (-51)/15)20? 7 Suppose 4v - 16 = -2a - 2a, 4a = -2v + 4. What is the remainder when 27 is divided by v? 3 Suppose 9j = 10j - 2. What is the remainder when 3 is divided by j? 1 Let j(l) be the second derivative of l*5/20 + 5l4/12 - l3/3 - 2l2 - l. Let u be j(-4). Calculate the remainder when (-14)/(-8)1u is divided by 12. 11 Suppose 383 + 225 = 4l. Let y = l - 96. What is the remainder when y is divided by 19? 18 Suppose 2k + 55 = 5f, 4f - 2f - k - 22 = 0. What is the remainder when f is divided by 7? 4 Let h = 14 + -2. Calculate the remainder when 20 is divided by h. 8 Let o(k) = -k*3 + 4k*2 - k + 1. Suppose 0 = -0g - 4g + 76. Calculate the remainder when g is divided by o(2). 5 Suppose a = 6a + 40. Let u = 9 - -9. Let h = a + u. Calculate the remainder when 18 is divided by h. 8 Suppose -5i + 20 = g, 4i - 2 = -g + 15. Suppose -iy = 4b - 129, 0 = -0b - 2b. Calculate the remainder when y is divided by 16 - (1 + 0 + 0). 13 Let j = 77 - 39. Suppose -11s + 217 = 74. What is the remainder when j is divided by s? 12 Let z(k) = k3 + 2k*2 + 2. What is the remainder when 49 is divided by z(2)? 13 Suppose 0t = 5t - 20. Calculate the remainder when 13 is divided by t. 1 What is the remainder when 70 is divided by 3/1 - (-8 + -1)? 10 Let i = -1 + -8. Let f = i + 5. Let c = 2 - f. What is the remainder when 16 is divided by c? 4 Suppose 7 = -2y + 25. Let u = -98 + 157. Let h = u - 34. Calculate the remainder when h is divided by y. 7 Let n = 62 - 36. Calculate the remainder when 103 is divided by n. 25 Let d(a) = -a*3 - 4a*2 + 3. Let k be d(-4). Suppose 7n = kn - 8. Let f = 20 - n. What is the remainder when f is divided by 8? 6 Let f = -44 + 73. What is the remainder when 85 is divided by f? 27 Let i be 0 + -1(2 - 170). Suppose 5s - 209 = d, 4s + d - 2d = i. Calculate the remainder when s is divided by 14. 13 Suppose -7 + 23 = 4p. Suppose 0 = s, -3s + s = pg - 80. Calculate the remainder when g is divided by 11. 9 Suppose -2a = -3a + 5. Suppose -2q = al - 186, -3q = -4q + 3. Calculate the remainder when l is divided by 19. 17 Suppose -2w - 31 = 5j, 3w - w - 5j - 19 = 0. Let a = 2 - w. Calculate the remainder when 9 is divided by a. 4 Suppose -5j + j + 16 = 0. Suppose -v + jv = 9. Suppose -4q = -vq - 15. What is the remainder when q is divided by 8? 7 Suppose 18 - 66 = -2c. Let k be 90 + 1/((-2)/(-2)). Suppose -k = -5d + c. What is the remainder when d is divided by 8? 7 Let o = 49 - 31. Let c be (-1036)/12 + (-3)/(-9). Let d = c + 138. What is the remainder when d is divided by o? 16 Suppose 0 = -2j + 3 + 29. What is the remainder when 30 is divided by j? 14 Let c = 60 - 41. What is the remainder when c is divided by 4? 3 Suppose 24 = 3u + u. Calculate the remainder when u is divided by (16/(-10))/((-4)/10). 2 Let c = 17 + -10. Let a(d) = 20d2 - 2d + 1. What is the remainder when a(1) is divided by c? 5 Let c be 2/((-3)/((-30)/4)). Suppose -d + 12 = -x + 29, 0 = -cx + 2d + 82. Calculate the remainder when x is divided by (-184)/(-20) + (-2)/10. 7 Suppose 0 = 3u + 3x - 312, -2x = -u - u + 196. What is the remainder when u/4 + 5/(-20) is divided by 13? 12 Let q(p) = -5p*2 - 2p - 1. Let r be q(-1). Let j be -56((-10)/r - 2). What is the remainder when j(-2 + (1 - 0)) is divided by 10? 8 Let m(f) = -f*3 - 7f*2 - 5f + 8. Let y be m(-6). Let l be y/5 - 39/(-15). Calculate the remainder when 11 is divided by 3(l + -2 + 0). 2 Suppose 5u - 20 = 0, 5h = 3u - 0u + 43. Calculate the remainder when 30 is divided by h. 8 Let o(u) = -u3 - u2 + 2u + 1. Suppose c - 5c + 24 = 0. Suppose -4q - c = -q. Calculate the remainder when 2 is divided by o(q). 0 Let p = 32 + -8. Suppose -10s - 52 = -14s. Calculate the remainder when p is divided by s. 11 Let p(o) = -o*2 + 22. Let k = -15 - -56. What is the remainder when k is divided by p(0)? 19 Let w(h) = 16h*2 + h + 1. Calculate the remainder when w(-1) is divided by 2. 0 Let b be 4/18 - 14/(-18). What is the remainder when 4b - (-275)/5 is divided by 12? 11 What is the remainder when (6 - -15 - 2) + (0 - 1) is divided by 5? 3 Let c = 17 + -15. What is the remainder when c is divided by 1? 0 Let r = 15 - 5. Suppose 2h + 2h + 8 = 0, 3h = -2n - 6. Suppose -5i + ni = -90. What is the remainder when i is divided by r? 8 Let d(i) = 7i2 + 2i. Let u be d(-2). Calculate the remainder when ((-2)/4)/(1/(-8)) is divided by 66/u + 6/(-8). 0 Let q = 1 - -2. Suppose 5m = -0m - 2r - 58, -qm - 4r - 32 = 0. Let t = m + 29. What is the remainder when t is divided by 9? 8 Let k(q) = q3 - 3q - 2. Suppose 3d = 7d - 240. Calculate the remainder when d is divided by k(3). 12 Let p(g) = 2g2 - 3g + 3. Suppose -2z = -2h + 18, -6h - 7 = 3z - 5h. Let u(b) = b2 - 4b. Calculate the remainder when p(z) is divided by u(6). 11 Suppose -6u = -2u - 84. Suppose 3n = 3o + u, 2n - o = -0o + 15. What is the remainder when 22 is divided by n? 6 Let k = 18 + -8. Let b(f) = -4f*2 + 4. Let p(j) =	{ "pile_set_name": "DM Mathematics" }
0000 How many years are there in 282.3414 months? 23.52845 Convert 2049.373l to millilitres. 2049373 What is 7562.85ng in kilograms? 0.00000000756285 What is 87/2 of a litre in millilitres? 43500 What is 2/15 of a week in minutes? 1344 Convert 9623.857ns to milliseconds. 0.009623857 What is 19/4 of a gram in milligrams? 4750 How many months are there in 10/3 of a year? 40 Convert 51676.3 meters to millimeters. 51676300 What is sixty-four fifths of a litre in millilitres? 12800 How many litres are there in 337326.8ml? 337.3268 Convert 253.75242 months to millennia. 0.021146035 How many millilitres are there in thirteen eighths of a litre? 1625 What is 0.5115343g in nanograms? 511534300 What is 47/4 of a century in years? 1175 What is 43/4 of a kilometer in meters? 10750 What is 780.6987 millimeters in nanometers? 780698700 How many seconds are there in 2.137591 hours? 7695.3276 How many milliseconds are there in three fifths of a minute? 36000 How many months are there in twenty-seven halves of a year? 162 How many grams are there in 6919.204 kilograms? 6919204 How many millimeters are there in seventeen halves of a meter? 8500 How many minutes are there in one sixth of a day? 240 What is 45723.267 milliseconds in hours? 0.0127009075 How many meters are there in 300.5661nm? 0.0000003005661 How many micrograms are there in 54/5 of a milligram? 10800 How many nanometers are there in 3/40 of a millimeter? 75000 What is thirty-one fifths of a century in decades? 62 How many millilitres are there in fourty-nine quarters of a litre? 12250 What is 2.215268ng in grams? 0.000000002215268 Convert 554.3392 nanometers to centimeters. 0.00005543392 How many years are there in 252002.6 decades? 2520026 What is 14359.97 millennia in decades? 1435997 Convert 807655.5l to millilitres. 807655500 What is 3/50 of a week in seconds? 36288 What is 10/7 of a week in minutes? 14400 How many years are there in 1.1997588 months? 0.0999799 How many centimeters are there in nine sixteenths of a kilometer? 56250 How many micrograms are there in 18/5 of a milligram? 3600 What is 6/25 of a meter in millimeters? 240 Convert 7770.666ms to seconds. 7.770666 How many milliseconds are there in 3/50 of a second? 60 What is 66038.08 decades in millennia? 660.3808 What is 18/5 of a litre in millilitres? 3600 What is three eighths of a litre in millilitres? 375 How many micrometers are there in 33/5 of a centimeter? 66000 What is 11/4 of a gram in milligrams? 2750 Convert 417263.2 hours to milliseconds. 1502147520000 What is 459.8kg in grams? 459800 How many millilitres are there in one fifth of a litre? 200 What is 3/5 of a kilometer in centimeters? 60000 Convert 4192.719 micrometers to centimeters. 0.4192719 How many months are there in 13/5 of a century? 3120 How many nanoseconds are there in 1/16 of a millisecond? 62500 What is eighteen fifths of a millennium in decades? 360 What is three tenths of a meter in centimeters? 30 What is 0.3686102 weeks in seconds? 222935.44896 What is 31/6 of a week in hours? 868 How many litres are there in 213.206 millilitres? 0.213206 What is 6898.048 millennia in centuries? 68980.48 Convert 49.53944ns to milliseconds. 0.00004953944 What is 145889.9l in millilitres? 145889900 What is one fifth of a century in decades? 2 Convert 0.0691375 weeks to minutes. 696.906 How many micrograms are there in 3/8 of a milligram? 375 What is 0.4979874 litres in millilitres? 497.9874 Convert 61.93866 litres to millilitres. 61938.66 How many years are there in 9.567449 decades? 95.67449 What is 989.8703 seconds in microseconds? 989870300 How many hours are there in seven sixths of a week? 196 Convert 761.3331 months to years. 63.444425 How many millimeters are there in 1257.399 meters? 1257399 What is 47/4 of a litre in millilitres? 11750 Convert 126.674 days to seconds. 10944633.6 How many seconds are there in 8.194118 milliseconds? 0.008194118 Convert 0.9573994km to centimeters. 95739.94 What is 18/5 of a millimeter in micrometers? 3600 How many millilitres are there in seventeen quarters of a litre? 4250 How many millilitres are there in 3/10 of a litre? 300 How many seconds are there in 33212.52 days? 2869561728 What is three tenths of a microgram in nanograms? 300 What is 25.91559 centimeters in kilometers? 0.0002591559 How many seconds are there in 17/2 of a hour? 30600 How many millilitres are there in 37/5 of a litre? 7400 How many centimeters are there in six fifths of a meter? 120 Convert 9.19918 decades to months. 1103.9016 Convert 0.9174629us to milliseconds. 0.0009174629 What is 1159609.5ns in minutes? 0.000019326825 What is 70.96408 hours in milliseconds? 255470688 Convert 6984.527 meters to nanometers. 6984527000000 What is eleven eighths of a kilometer in meters? 1375 How many kilograms are there in 86164.83ug? 0.00008616483 How many tonnes are there in 7279.904mg? 0.000007279904 How many months are there in 5/6 of a year? 10 How many meters are there in 7/4 of a kilometer? 1750 What is 71.29109 micrograms in grams? 0.00007129109 What is 0.779466 nanoseconds in minutes? 0.0000000000129911 Convert 736.1788g to kilograms. 0.7361788 How many millilitres are there in 1/20 of a litre? 50 How many hours are there in 7732601.1 seconds? 2147.94475 How many kilograms are there in 27/4 of a tonne? 6750 Convert 119123146.8ms to weeks. 0.196962875 How many hours are there in 74821.923ns? 0.0000000207838675 How many minutes are there in 1/45 of a day? 32 How many decades are there in 781.7094 centuries? 7817.094 How many micrometers are there in 3.177537nm? 0.003177537 How many hours are there in 62/7 of a week? 1488 How many years are there in 21/4 of a century? 525 What is fifty-one halves of a microgram in nanograms? 25500 How many milligrams are there in 6/25 of a gram? 240 How many years are there in one twentieth of a millennium? 50 How many millilitres are there in five eighths of a litre? 625 What is 54468.51 days in microseconds? 4706079264000000 What is seven halves of a tonne in kilograms? 3500 How many centimeters are there in 1.836324um? 0.0001836324 What is 27/4 of a litre in millilitres? 6750 How many months are there in 766.2619 years? 9195.1428 Convert 0.9306424 millennia to centuries. 9.306424 How many hours are there in fourty-five eighths of a day? 135 How many centuries are there in fifty-one halves of a millennium? 255 How many months are there in fourty-nine fifths of a century? 11760 How many months are there in one tenth of a decade? 12 Convert 26250.36 years to millennia. 26.25036 Convert 1.5875595ms to days. 0.00000001837453125 How many millilitres are there in 61/4 of a litre? 15250 What is 62060.76l in millilitres? 62060760 Convert 1449.64 litres to millilitres. 1449640 What is 445083.9 weeks in days? 3115587.3 What is eleven halves of a meter in millimeters? 5500 How many years are there in 5/4 of a millennium? 1250 How many decades are there in 1/4 of a millennium? 25 What is one twentieth of a milligram in nanograms? 50000 How many centimeters are there in 19/4 of a meter? 475 What is fifty-four fifths of a millennium in years? 10800 Convert 711745.6 litres to millilitres. 711745600 How many years are there in 3/5 of a century? 60 What is seven eighths of a century in months? 1050 What is 46/5 of a minute in seconds? 552 How many litres are there in 454097.6 millilitres? 454.0976 Convert 2.0961399 months to centuries. 0.00174678325 Convert 4199.239cm to meters. 41.99239 What is 8927.691 millilitres in litres? 8.927691 How many milligrams are there in 933152.1ng? 0.9331521 What is 116.5865l in millilitres? 116586.5 What is 1/5 of a litre in millilitres? 200 What is seventeen tenths of a tonne in kilograms? 1700 What is twenty-one eighths of a millennium in years? 2625 What is 4135.475 centuries in months? 4962570 What is 2830.287 nanograms in milligrams? 0.002830287 What is 12.72105 grams in nanograms? 12721050000 What is 6671921.4 minutes in days? 4633.27875 How many millilitres are there in thirty-two fifths of a litre? 6400 What is 11327114.4 hours in weeks? 67423.3 What is 0.3007743 hours in nanoseconds? 1082787480000 Convert 4.516624mm to micrometers. 4516.624 Convert 63.04643 millilitres to litres. 0.06304643 What is el	{ "pile_set_name": "DM Mathematics" }
k) + 2u(k). Solve j(h) = 0 for h. -1, 0, 2, 3 Suppose -12 = 2j - 6j. What is h in -h3 - h4 + 3h*3 + 3h2 + h5 + 2h - 5h*j - 2h2 = 0? -1, 0, 1, 2 Let i(s) be the third derivative of s5/300 - 11s4/120 - 23s*2. Find w such that i(w) = 0. 0, 11 Suppose 16 = 4v - 12v. Let r be 6/45(-12)/v. Factor 14/5f2 + 0 + rf + 2f3. 2f(f + 1)(5f + 2)/5 Let d = 635/126 + -83/18. Find s, given that -2/7s*2 + 0 + ds*3 + 0s*4 + 0s - 1/7s5 = 0. -2, 0, 1 Let o(l) be the first derivative of -l5/30 - 3l*4/16 - 5l*3/12 - 11l2/24 - l/4 + 46. Factor o(f). -(f + 1)3(2f + 3)/12 Let z(m) = m*3 + 41m*2 + 366m + 58. Let b be z(-28). Let 125/2u5 + 30u*3 + 0u - 4ub + 0 - 75u*4 = 0. Calculate u. 0, 2/5 Suppose -4a = -0a - 24. Let n be 3 - a - (-51)/15. Suppose -2/5q*4 + 0q + 0 - 2/5q5 + nq*3 + 2/5q2 = 0. What is q? -1, 0, 1 Let d(a) be the third derivative of -a6/720 + a5/36 - a4/12 - 2a3 - a2 - 177. Find k such that d(k) = 0. -2, 6 Let v(q) be the second derivative of q6/45 + q5/10 - q4/18 - q3/3 + q + 175. Factor v(g). 2g(g - 1)(g + 1)(g + 3)/3 Let h(s) be the third derivative of s8/168 - s7/105 - s6/20 + s5/30 + s4/6 + 3s*2 + 8s. Find b such that h(b) = 0. -1, 0, 1, 2 Let x(f) be the third derivative of -2f7/525 + f6/75 - f5/75 - 2f*2 - 46f. Solve x(y) = 0 for y. 0, 1 Factor 2/3j3 - 8j*2 - 100/3 + 30j. 2(j - 5)2(j - 2)/3 Suppose -2 = -2p, -5w + p = -2w + 505. Let i be w/(-49) - 3/7. Solve 2r*2 + 2r*4 + 0r*4 - 30r - 2ri + 32r - 4r2 = 0 for r. -1, 0, 1 Let t(r) be the first derivative of r5/20 + 3r*4/16 - 9r*3/4 - 59r*2/8 - 15r/2 + 81. Determine u so that t(u) = 0. -6, -1, 5 Let l = 597 + -1789/3. Suppose lv + 2/15v*4 - 2/5v*2 - 4/15 - 2/15v3 = 0. What is v? -2, 1 Let j(c) = c2 - 5c + 6. Let s be j(4). Solve -g2 + 7gs - g3 - g*2 - 4g*3 = 0. 0, 1 Let h be (010/(-80))/(-4). Find u, given that h + 4/7u5 - 4/7u*4 + 4/7u*2 + 0u - 4/7u3 = 0. -1, 0, 1 Suppose 56 - 10c*2 - 66 - 6c*5 + 11c - 20c4 + 14c - 20c3 + 40c4 + c5 = 0. Calculate c. -1, 1, 2 Let l(j) be the second derivative of -j*7/28 + 153j*6/20 - 23409j*5/40 + 132651j*4/8 + 286j - 1. Factor l(u). -3u2(u - 51)*3/2 Let h = 451 - 447. Let w = -416 - -871/2. Determine g so that 6g*5 + wg*h + 0 - 24g*2 + 9/2g*3 - 6g = 0. -2, -1/4, 0, 1 Let u be (9/30)/((-57)/(-76) + 0). Find o such that -uo + 1/5o*2 + 0 = 0. 0, 2 Suppose 18b = -13b + 8b + 92. Factor 0 + 0r + 2/7r*2 - 11/7r*3 + 16/7rb - r5. -r*2(r - 1)*2(7r - 2)/7 Factor 2/11w*3 + 32/11w + 0 + 20/11w2. 2w(w + 2)(w + 8)/11 Let x(o) = 128o - 1405. Let g be x(11). Let 1/2 + 1/8k*4 + 3/4k*g + 3/2k + 13/8k2 = 0. Calculate k. -2, -1 Let a(m) = -3m*2 + 64m - 4. Let p(f) = f - 1. Let b(h) = a(h) - 4p(h). Let b(j) = 0. Calculate j. 0, 20 Let m = 61 + 25. Let r = m - 427/5. Factor 0 - 3/5v - rv2. -3v(v + 1)/5 Factor -15i*2 + 15i*2 + 2i*2 + 1 - 30i - 1. 2i(i - 15) Solve -544t + 276t + 278t + 5t*5 + 5t*4 - 5t*2 - 15t*3 = 0 for t. -2, -1, 0, 1 Let u(q) be the third derivative of -11q*6/240 + 97q*5/120 - 35q*4/24 - 4q*3/3 + 723q*2. Factor u(d). -(d - 8)(d - 1)(11d + 2)/2 Factor 96d - 9d*3 + 3d*5 + 12d*4 - 120d - 42d2 + 7 - 7. 3d(d - 2)(d + 1)*2(d + 4) Let b be (-6)/4 + (-11)/(-22). Let w be 15/(-3 - -8) - b. Let -18p - 5p*3 + 23p + 16p4 - pw - 25p2 + 10 = 0. Calculate p. -1, -2/3, 1 Let w(x) be the second derivative of x6/60 + 7x5/40 + 11x*4/24 + 5x*3/12 + 70x + 2. Factor w(q). q(q + 1)2(q + 5)/2 Let m(u) be the second derivative of u9/15120 + u8/2240 + u7/840 + u6/720 + 3u4/4 - 15u. Let w(v) be the third derivative of m(v). Factor w(b). b(b + 1)3 Suppose -k - 3 - 1 = 0. Let o be (10/(-15))/(k/18). Factor -3p*o - 1 + 6p - 2 + 3p4 - 3p*3. 3(p - 1)*3(p + 1) Suppose -a = 2t - 4, 51 = -5a + 71. Factor 2/5m + t - 6/5m*2 - 2/5m*4 + 6/5m*3. -2m(m - 1)3/5 Suppose -h - 30 = -2r, 3h - 54 = r - 4r. Suppose 11 + rj + 4 + j2 - 6j - 6j2 = 0. Calculate j. -1, 3 Find v, given that -v5 - 21v*2 + 14v*3 - 45v*3 - 909v*4 + 898v4 = 0. -7, -3, -1, 0 Let v(n) = 4 + n2 - 6n2 + 28n + 9n2. Let j(d) = d. Let a(f) = 20j(f) - v(f). Find m such that a(m) = 0. -1 Let x(v) be the first derivative of -v*4/14 + 110v*3/7 - 9075v*2/7 + 332750v/7 - 440. Factor x(j). -2(j - 55)3/7 Let w(u) be the third derivative of -13u*2 + 0 - 64/39u*3 - 4/39u*4 - 1/390u*5 + 0u. Factor w(z). -2(z + 8)2/13 What is c in -92/17c*2 + 66/17c + 60/17c3 - 18/17 + 2/17c*5 - 18/17c*4 = 0? 1, 3 Let w(q) be the third derivative of -5/6q*4 + 0 + 1/36q*5 - 30q*2 + 0q + 10q3. Let w(n) = 0. What is n? 6 Suppose 108o - 99o = 0. Let k(y) be the third derivative of 1/330y*5 - 1/132y*4 - 10y*2 + 0y + o + 0y3. Factor k(w). 2w(w - 1)/11 Let k be 3298/(-12) + (1 - (-7)/(-6)). Let w = 1387/5 + k. Suppose 0 + 6/5z*2 + 4/5z + 12/5z5 - 2z*4 - wz*3 = 0. Calculate z. -2/3, -1/2, 0, 1 Let k = 10 + -10. Suppose 10f - 5f - 45 = k. Factor -2 - 8 - 6r*3 + 5r*2 + 4r*2 + 4 + fr. -3(r - 2)(r + 1)(2r - 1) Let w(t) be the third derivative of -t*5/90 + 3t*4/2 - 81t*3 + 47t*2. Factor w(d). -2(d - 27)2/3 Let c(p) be the second derivative of -p6/120 - p*5/40 + 7p*3/6 - 6p. Let a(g) be the second derivative of c(g). Factor a(d). -3d(d + 1) Let t = 429/1405 - 3/562. Let i(m) be the first derivative of 5 + 0m - 3/5m*3 + 3/5m*4 - tm*2. Factor i(p). 3p(p - 1)(4p + 1)/5 Let h = 9 + -1. Let w = h - -3. Find k such that 14k*5 + wk*4 - 4k2 - k4 - 14k3 - 6k4 = 0. -1, -2/7, 0, 1 Let a(u) be the third derivative of u5/100 - 49u4/4 + 12005u*3/2 + 14u*2 - 8u. Find v, given that a(v) = 0. 245 Let u(h) be the second derivative of 3h5/160 + h4/32 - 129h. Factor u(c). 3c2(c + 1)/8 Factor 0c + 16/7c*2 + 31/7c*3 - 1/7c*5 + 2c4 + 0. -c2(c - 16)(c + 1)2/7 Let f(d) = -d3 + 2d2 - 9d + 3. Let p(y) = 2y3 - 4y*2 + 14y - 4. Let r(v) = -8f(v) - 5p(v). What is s in r(s) = 0? -1, 1, 2 Suppose 0 = -2b - x + 66, x - 15 + 166 = 5b. What is v in -8v2 + b + 4v*2 - 257 - 30 - 64v = 0? -8 Let f(n) be the third derivative of 2n7/105 + n6/10 + n5/15 - n4/2 - 4n*3/3 + 12n2 + 4. What is o in f(o) = 0? -2, -1, 1 Let c(f) = f2 - 13f + 25. Let q be c(11). Let k = q + 2. Find x, given that 2x + 25/2xk + 55x*4 + 141/2x*3 + 22x*2 + 0 = 0. -2, -1/5, 0 Let o(u) be the second derivative of 7u*5/15 - 25u*4/3 - 44u*3/9 + 13u. Suppose o(r) = 0. Calculate r. -2/7, 0, 11 Let s = -13319 - -13322. Determine v, given that -8/9v2 + 2/3v + 2/9vs + 0 = 0. 0, 1, 3 Let f(m) be the second derivative of m5/22 + m4/3 + 23m*3/33 + 6m*2/11 - 9m - 14. Factor f(x). 2(x + 1)(x + 3)(5x + 2)/11 Factor -1796 + 1792 - 3q2 + q2 - 6q. -2(q + 1)(q + 2) Let z = -4 + -20. Let i = 170/7 + z. Factor 6/7j2 - ij*3 + 0 - 4/7j. -2j(j - 2)(j - 1)/7 What is u in 800u*2 + 12u - 3u3 + 6u*3 - 4 + 803u*2 - 2413u*2 + 799u*2 = 0? 2/3, 1, 2 Determine a so that 52/7a - 8/7a2 - 24/7 = 0. 1/2, 6 Let d = 9 + -25. Let c = d + 21. Factor -2x*2 - cx*2 - 3x + 0x. -x(7x + 3) Let v(x) be the third derivative of -x5/75 + 53x*4/15 - 5618x*3/15 - 80x*2. Let v(w) = 0. Calculate w. 53 Let y = -914/3 + 2744/9. Let -y - 2/9k*3 + 2/9k*2 + 2/9k = 0. What is k? -1, 1 Let i(w) be the first derivative of -2w5/35 + 2w3/21 - 156. Find m such that i(m) = 0. -1, 0, 1 Let k(n) be the second derivative of n10/90720 - n*8/20160 + 11n*4/12 - 19n. Let w(q) be the third derivative of k(q). Determine f so that w(f) = 0. -1, 0, 1 Let h(q) be the third derivative of -2q7/105 - 2q*6/15 + 11q5/15 - q4 - 32q2 + 1. Factor h(k). -4k(k - 1)2(k + 6) Suppose d - 129 = -3d - 3g, g + 117 = 4d. Determine s so that 11s - 6 - ds + 11s - 2s2 = 0. -3, -1 Let z be 5 + (5 + -8 - 8) + 0 + 8. Solve 0 + 11/2r + 1/2rz = 0 for r. -11, 0 Let z(v) be the first derivative of -15/4	{ "pile_set_name": "DM Mathematics" }
d 3:36 AM? 159 How many minutes are there between 7:40 AM and 4:59 PM? 559 What is 414 minutes before 6:07 AM? 11:13 PM How many minutes are there between 6:46 AM and 8:23 AM? 97 How many minutes are there between 4:32 AM and 8:42 AM? 250 How many minutes are there between 3:07 AM and 1:17 PM? 610 What is 353 minutes after 8:08 AM? 2:01 PM What is 467 minutes before 3:51 PM? 8:04 AM How many minutes are there between 9:39 AM and 2:41 PM? 302 How many minutes are there between 3:26 AM and 7:03 AM? 217 How many minutes are there between 6:40 PM and 12:33 AM? 353 How many minutes are there between 12:29 AM and 7:00 AM? 391 How many minutes are there between 5:08 PM and 6:24 PM? 76 What is 317 minutes after 3:54 PM? 9:11 PM What is 398 minutes before 8:41 AM? 2:03 AM What is 546 minutes before 5:20 PM? 8:14 AM How many minutes are there between 6:25 PM and 12:31 AM? 366 What is 173 minutes after 12:35 AM? 3:28 AM How many minutes are there between 3:25 PM and 10:06 PM? 401 How many minutes are there between 3:27 AM and 1:58 PM? 631 What is 685 minutes before 12:23 PM? 12:58 AM How many minutes are there between 9:54 PM and 5:27 AM? 453 How many minutes are there between 12:42 PM and 4:04 PM? 202 What is 318 minutes after 2:01 PM? 7:19 PM How many minutes are there between 2:27 AM and 5:05 AM? 158 How many minutes are there between 4:19 PM and 6:52 PM? 153 How many minutes are there between 4:51 PM and 4:31 AM? 700 What is 310 minutes after 5:55 AM? 11:05 AM What is 293 minutes after 2:21 AM? 7:14 AM What is 398 minutes after 7:36 PM? 2:14 AM How many minutes are there between 6:28 PM and 11:24 PM? 296 What is 344 minutes after 6:00 PM? 11:44 PM What is 585 minutes after 3:00 PM? 12:45 AM How many minutes are there between 11:43 PM and 10:47 AM? 664 How many minutes are there between 11:12 PM and 3:23 AM? 251 What is 591 minutes after 8:02 PM? 5:53 AM How many minutes are there between 7:40 PM and 11:44 PM? 244 How many minutes are there between 3:27 AM and 1:52 PM? 625 What is 191 minutes after 10:35 AM? 1:46 PM How many minutes are there between 3:02 PM and 7:15 PM? 253 What is 104 minutes after 5:43 PM? 7:27 PM What is 111 minutes after 4:46 PM? 6:37 PM How many minutes are there between 7:34 AM and 9:03 AM? 89 How many minutes are there between 5:59 AM and 6:37 AM? 38 What is 165 minutes before 11:20 PM? 8:35 PM How many minutes are there between 12:19 PM and 1:28 PM? 69 How many minutes are there between 10:15 AM and 5:43 PM? 448 How many minutes are there between 12:47 PM and 11:48 PM? 661 What is 88 minutes after 12:13 AM? 1:41 AM What is 530 minutes before 2:05 AM? 5:15 PM How many minutes are there between 1:05 AM and 6:33 AM? 328 How many minutes are there between 11:36 AM and 3:34 PM? 238 What is 91 minutes before 9:21 PM? 7:50 PM What is 657 minutes after 4:07 PM? 3:04 AM What is 678 minutes after 9:03 PM? 8:21 AM How many minutes are there between 8:16 AM and 3:35 PM? 439 How many minutes are there between 5:30 AM and 8:41 AM? 191 What is 321 minutes after 12:16 PM? 5:37 PM How many minutes are there between 3:59 PM and 3:20 AM? 681 How many minutes are there between 6:13 PM and 7:57 PM? 104 How many minutes are there between 12:45 AM and 1:54 AM? 69 How many minutes are there between 5:55 PM and 9:01 PM? 186 How many minutes are there between 3:02 AM and 5:37 AM? 155 What is 630 minutes after 4:29 PM? 2:59 AM How many minutes are there between 4:05 AM and 6:26 AM? 141 What is 400 minutes after 1:55 AM? 8:35 AM What is 63 minutes after 11:30 PM? 12:33 AM What is 2 minutes before 12:43 PM? 12:41 PM How many minutes are there between 10:12 AM and 9:45 PM? 693 What is 507 minutes after 7:35 PM? 4:02 AM What is 400 minutes before 7:02 AM? 12:22 AM How many minutes are there between 6:09 PM and 9:00 PM? 171 What is 302 minutes after 8:25 AM? 1:27 PM How many minutes are there between 11:20 AM and 2:49 PM? 209 How many minutes are there between 9:16 AM and 1:40 PM? 264 What is 418 minutes after 4:23 AM? 11:21 AM How many minutes are there between 7:20 AM and 7:58 AM? 38 How many minutes are there between 3:02 PM and 3:21 PM? 19 How many minutes are there between 3:05 AM and 3:15 AM? 10 How many minutes are there between 11:45 AM and 8:31 PM? 526 What is 156 minutes after 12:17 PM? 2:53 PM What is 704 minutes after 7:33 PM? 7:17 AM How many minutes are there between 3:55 AM and 3:12 PM? 677 How many minutes are there between 4:07 PM and 1:24 AM? 557 How many minutes are there between 6:02 PM and 5:51 AM? 709 How many minutes are there between 7:20 AM and 1:26 PM? 366 What is 44 minutes before 7:22 AM? 6:38 AM What is 517 minutes before 7:30 PM? 10:53 AM What is 655 minutes before 7:43 PM? 8:48 AM What is 401 minutes after 5:54 AM? 12:35 PM What is 35 minutes before 10:35 AM? 10:00 AM How many minutes are there between 1:35 AM and 7:07 AM? 332 What is 631 minutes before 11:15 PM? 12:44 PM What is 443 minutes before 8:29 PM? 1:06 PM What is 40 minutes before 12:51 PM? 12:11 PM What is 665 minutes after 3:26 PM? 2:31 AM What is 391 minutes before 12:18 AM? 5:47 PM How many minutes are there between 2:05 PM and 6:35 PM? 270 How many minutes are there between 6:05 PM and 1:13 AM? 428 How many minutes are there between 5:12 PM and 6:01 PM? 49 How many minutes are there between 5:32 PM and 7:49 PM? 137 How many minutes are there between 1:36 PM and 12:51 AM? 675 What is 20 minutes after 4:08 AM? 4:28 AM What is 705 minutes after 8:08 AM? 7:53 PM What is 62 minutes before 1:39 AM? 12:37 AM How many minutes are there between 4:13 PM and 3:31 AM? 678 How many minutes are there between 10:32 PM and 1:00 AM? 148 What is 655 minutes before 9:46 PM? 10:51 AM How many minutes are there between 7:12 PM and 7:56 PM? 44 How many minutes are there between 9:05 AM and 3:53 PM? 408 What is 33 minutes after 9:12 PM? 9:45 PM How many minutes are there between 2:27 AM and 10:20 AM? 473 How many minutes are there between 4:33 AM and 4:58 AM? 25 How many minutes are there between 1:25 PM and 5:31 PM? 246 How many minutes are there between 12:44 PM and 7:12 PM? 388 What is 324 minutes after 12:01 PM? 5:25 PM What is 9 minutes before 3:16 AM? 3:07 AM How many minutes are there between 7:27 PM and 12:18 AM? 291 How many minutes are there between 12:47 PM and 3:43 PM? 176 What is 321 minutes after 3:16 AM? 8:37 AM How many minutes are there between 12:21 AM and 11:00 AM? 639 How many minutes are there between 10:50 PM and 1:22 AM? 152 What is 104 minutes before 2:23 AM? 12:39 AM How many minutes are there between 10:48 PM and 3:14 AM? 266 What is 107 minutes before 10:51 PM? 9:04 PM What is 89 minutes after 2:12 AM? 3:41 AM What is 56 minutes before 6:50 AM? 5:54 AM What is 386 minutes after 4:14 AM? 10:40 AM How many minutes are there between 10:46 AM and 6:39 PM? 473 What is 485 minutes after 12:12 PM? 8:17 PM What is 11 minutes after 6:53 PM? 7:04 PM How many minutes are there between 5:46 PM and 3:38 AM? 592 What is 117 minutes after 1:42 PM? 3:39 PM How many minutes are there between 11:52 AM and 2:53 PM? 181 How many minutes are there between 5:34 PM and 2:08 AM? 514 What is 682 minutes after 11:29 PM? 10:51 AM How many minutes are there between 12:58 PM and 7:04 PM? 366 What is 36 minutes before 10:01 AM? 9:25 AM What is 402 minutes after 12:50 AM? 7:32 AM How many minutes are there between 6:58 PM and 9:04 PM? 126 How many minutes are there between 3:48 PM and 9:12 PM? 324 What is 702 minutes after 5:39 PM? 5:21 AM What is 255 minutes before 11:09 AM? 6:54 AM How many minutes are there between 4:32 AM and 1:39 PM? 547 How many minutes are there between 4:36 AM and 5:16 AM? 40 How many minutes are there between 8:35 AM and 2:48 PM? 373 How many minutes are there between 1:42 AM and 6:28 AM? 286 How many minutes are there between 8:39 PM and 3:47 AM? 428 How many minutes are there between 3:35 PM and 3:54 PM? 19 What is 371 minutes before 12:19 PM? 6:08 AM How many minutes are there between 10:38 AM and 1:14 PM? 156 What is 617 minutes after 5:33 PM? 3:50 AM What is 488 minutes after 8:38 AM? 4:46 PM What is 564 minutes after 10:20 AM? 7:44 PM How many minutes are there between 6:17 PM and 10:13 PM? 236 What is 607 minutes after 12:40 PM? 10:47 PM What is 40 mi	{ "pile_set_name": "DM Mathematics" }
of m and 112. 8 Suppose -2r - t = -939, r + 2t = 686 - 212. What is the greatest common divisor of 27 and r? 9 Let r be 4 - (1 - 2/2). Suppose rz - 7 = 149. Let i be (-3)/(-4)988/57. What is the greatest common divisor of i and z? 13 Let f = -12990 - -13010. Let m(i) = -5i + 6. Let r(u) = 30u - 35. Let v(p) = -35m(p) - 6r(p). Let q be v(-4). What is the highest common divisor of q and f? 20 Suppose 2s = 4s - 4. Suppose 0y - sy + 308 = 0. Suppose 5o = 4a - 0a + 86, -68 = -4o + 3a. Calculate the highest common divisor of y and o. 14 Let c = 10 - 3. Suppose -k - 3w + 0w + c = 0, -12 = -4k + 4w. Let l be 50(k - (3 - 0)). Calculate the highest common divisor of 125 and l. 25 Suppose 3v + 4v = 525. Suppose v = -l + 6l. Let k(n) = 2n - 3. Let b be k(4). Calculate the highest common divisor of l and b. 5 Suppose 23i - 105 = 2i. Calculate the highest common divisor of 1 and i. 1 Let j(f) = -3f - 32. Let w be j(-13). Suppose 5y - 4y + 4q = 6, 5y = 3q + w. Calculate the greatest common factor of 26 and y. 2 Let g = 27 - 23. Suppose 3l = -2j + 28, -j + 4j = -gl + 39. What is the highest common factor of l and 3? 3 Let b be -1(-36 + 1) - 1. Let c be (1 - 1) + (-2244)/(-66). What is the greatest common divisor of b and c? 34 Let a = 195 + -63. Suppose -26u = -3623 + 3051. Calculate the greatest common divisor of u and a. 22 Let q(t) = -t*3 - 3t*2 + 3t + 5. Let k be q(-3). Let m = k + 7. Suppose mf - 2 = -4p + 40, -f + 4p = 2. Calculate the highest common factor of 4 and f. 2 Let k = -7 + 14. Let p be (-9)/6 - (-9)/6. Let m = k - p. What is the greatest common divisor of m and 7? 7 Suppose 14t = -2v + 12t + 124, 5v - 5t = 290. Let n be (-29)/(-2) - 1/(-2). What is the highest common divisor of v and n? 15 Suppose 4v + 0t - 5200 = 5t, v = -2t + 1287. Calculate the highest common divisor of 7 and v. 7 Let j(z) = z*3 - 10z*2 + 11z + 31. Let q be j(9). What is the greatest common divisor of q and 1? 1 Let g be 2/10 - 140/(-50). Suppose -2r + 52 = -2n, -gr + 2r + 4n = -32. What is the highest common divisor of 120 and r? 24 Suppose 2v = 1314 + 148. What is the highest common divisor of v and 172? 43 Suppose -4q + 2k - 3k = -899, 0 = 3q + 4k - 684. What is the highest common factor of 14 and q? 14 Suppose 0 = l + 127 - 131. Let i be -9 + l + (-2 - -6) + 13. What is the greatest common divisor of i and 20? 4 Let w be 1/1015166/3. What is the highest common divisor of w and 913? 83 Let j(t) = t3 - 14t*2 + 15t - 10. Let h be j(13). What is the highest common factor of h and 16? 16 Let t be (-150)/(-12) - 1/2. Let m = -47 + 107. What is the greatest common factor of m and t? 12 Let r be (-500)/7 - 15/(-35). Let t = -35 - r. What is the highest common divisor of t and 4? 4 Let h(o) = -o + 4. Let d be h(0). Let i be (-1)/40 + d. Suppose 10 = -2r, 0r + 19 = ij + r. Calculate the greatest common divisor of 66 and j. 6 Let i be (-8 + (-48)/18)(-54)/8. Calculate the greatest common divisor of i and 168. 24 Let j(z) = 95z - 682. Let o be j(8). Let v(c) = -c*3 + 14c*2 - 3c - 13. Let d be v(13). What is the highest common factor of o and d? 39 Suppose 2u - 47 = -2z + 33, -u + 36 = -z. Calculate the highest common divisor of u and 2. 2 Let a = -234 + 238. What is the greatest common divisor of a and 6? 2 Let h(u) = 2u + 10. Let r be h(-5). Suppose rb - 175 = -2x - 5b, 3b + 93 = x. What is the highest common divisor of 36 and x? 18 Let a = -223 - -227. Calculate the highest common divisor of a and 4. 4 Let p(j) = -3j*2 - 4j + 9. Let s(o) = -4o2 - 3o + 9. Let w(x) = 3p(x) - 2s(x). Let g be w(-7). What is the highest common divisor of 1 and g? 1 Let z = 2 + -1. Let n(h) = h - 1. Let g(j) = -8j - 19. Let a(y) = g(y) + 4n(y). Let u be a(-8). Calculate the greatest common divisor of u and z. 1 Let j = -5 - -8. Let f be (-252)/(-35)75/10. Suppose 2i + 0u + 3u - f = 0, 5i = -5u + 125. Calculate the greatest common factor of j and i. 3 Let o be 29 - (-1 + (-5 - -3)). Suppose 59 = 2n + 5t, o = n - t + 6t. Calculate the greatest common factor of n and 216. 27 Suppose 0 = k + 2c - 102, c = 3k - 410 + 104. Calculate the highest common divisor of 459 and k. 51 Suppose 0 = 4h + 13 + 3. Let j be (-3)/((-3)/h - 1). Suppose 0 = 64m - 6m - 2088. Calculate the greatest common divisor of m and j. 12 Let t(g) = g*2 + 4g + 1. Let p be (18/(-27))/(2/15). Let f be t(p). Suppose -8y + 44 = -fy. Calculate the greatest common factor of y and 110. 22 Suppose 2l = -12l + 7084. Calculate the greatest common factor of l and 46. 46 Suppose -4w + w + 726 = 0. Let c = -12 + 20. Let n be ((-132)/c)/(6/(-8)). Calculate the highest common divisor of w and n. 22 Suppose -24 = -x - x. Let l(f) = -147f - 139. Let i be l(-1). Calculate the greatest common factor of i and x. 4 Suppose 7216 = 29o + 12o. Calculate the greatest common divisor of 32 and o. 16 Let a = 52 - 49. Suppose -aj - 4j = -1225. What is the greatest common divisor of 25 and j? 25 Suppose 3x - 17 - 61 = 0. Suppose 32k - xk = 30. What is the highest common factor of 60 and k? 5 Suppose -2 = -k + 20. Suppose 2s = 50 - k. Suppose 25 = 3y - 4d - 46, -2y = 3d - 36. Calculate the highest common divisor of s and y. 7 Let g be (22/(-10) - -1)/(1292/95 + -14). Let x be 50/8 - 2/8. Let l(m) = m*2 - 3m + 6. Let z be l(x). What is the highest common factor of z and g? 3 Let u(v) = -10v2 - 2v - 4. Let f be u(-4). Let i be 3/(f/(-76) - 2). Let l = -25 + i. Calculate the highest common divisor of l and 48. 16 Let j(t) be the third derivative of t5/30 - t4/24 - 2t3/3 - t2. Let l be j(4). Let k = -3 - -6. Calculate the highest common factor of k and l. 3 Let d be -9(-1 - 19/3). Let v = 102 + -92. Suppose -4 = f - v. What is the greatest common factor of f and d? 6 Let b be (10/4)/((-24)/(-48)) - -9. Suppose 0 = 5a - 3a - 56. Calculate the highest common divisor of b and a. 14 Suppose -5l - 7 = 8, 0 = -2q - 2l + 12. Let d = -534 - -606. What is the greatest common factor of q and d? 9 Let z be (3 + -18)/((0 + -3)/81). Calculate the highest common divisor of 15 and z. 15 Let q = 5 + -3. Suppose r = 5r + 3d - 55, 20 = 3r - qd. Suppose -9i + 12 + 125 - 2 = 0. What is the highest common divisor of i and r? 5 Let a(v) = 4v3 - 2v*2 + 27v - 13. Let y be a(7). What is the highest common divisor of 25 and y? 25 Suppose 21u - 10362 = -u. What is the highest common divisor of 6 and u? 3 Suppose 16 = -3h + 4, 4v - 5h - 100 = 0. Let j(z) = -4z - 6. Let k be j(10). Let w be k/(-10) + 10/25. Calculate the greatest common factor of w and v. 5 Let z be 24(90/12)/15. Suppose 5x + 2n = z, -5x + 3n + 17 = -x. Let f = 7 + -1. What is the greatest common factor of f and x? 2 Let f = -18 - -31. What is the highest common factor of 338 and f? 13 Let u be 6 + -11 - (1 - 42). Calculate the highest common divisor of u and 16. 4 Let w(f) = -f2 + 22f + 111. Let k be w(26). Let v be 278/4 - 1/(-2). Calculate the greatest common divisor of v and k. 7 Let j(h) = -8h + 92. Let k be j(0). Suppose k = 4r + 5b - 0b, -20 = 5b. Let x = -235 + 375. Calculate the greatest common divisor of r and x. 28 Let w = 812 + -730. Calculate the greatest common divisor of w and 779. 41 Let d = 907 + -872. What is the greatest common factor of 145 and d? 5 Let t(b) = b + 12. Let m be t(6). Let j(x) = x + 10. Let h be j(-9). Let f be -9(h/(-1) - 2). Calculate the greatest common divisor of m and f. 9 Let f(l) = 4l2 + 14l + 24. Let n be f(-6). Let d(o) = -o*2 - 16o - 8. Let k be d(-8). What is the greatest common divisor of k and n? 28 Suppose -6o + o = -25. Suppose 0 = or + 9 - 54. Suppose -2j + 3 + r = 0. Calculate the greatest common factor of 2 and j. 2 Suppose 27j = 25j + 42. Let x = -357 - -525. What is the highest common divisor of j and x? 21 Let w(c) = -4c*3 + 10c*2 - 11 + 15c + 3c3 - 22c. Let i be w(9). Suppose -4x + 46 + 10 = 0. Calculate the greatest common divisor of i and x. 7 Suppose -g + 3x = -57, 2g + 10 = x + 119. Calculate the highest common factor of 18 and g. 18 Let r(h) = 2h*2 - 5h - 1. Let w be r(4). Suppose -w = -d + 5v, -d - 2v + 1 = -17. Suppose -s = -2*s + d. Calculate the gr	{ "pile_set_name": "DM Mathematics" }
= 4f(o) - y(o). Calculate nw(s) - 7t(s). -4s Let k(x) = -5x + 17. Let c be k(-7). Let v = 45 - c. Let r(g) = 3g*3 - 11g*2 - 7g - 7. Let n(y) = -2y3 + 6y*2 + 4y + 4. Determine vn(m) - 4r(m). 2m3 + 2m*2 Let n(u) = u - 2. Let b(k) = 4k - 17. Let s(j) = -j + 6. Let d(p) = 2b(p) + 7s(p). Let l(f) = 4. Let q(v) = 3d(v) - 7l(v). Calculate 5n(c) - 2q(c). -c - 2 Let m = -24 - -28. Let r be (1/m)/((-2)/(-40)). Let b(w) = 2w2 - 4w - 2. Let t(y) = -3y2 + 6y + 3. Determine rt(d) + 8b(d). d*2 - 2d - 1 Let o(t) = -10t3 - 26t - 21. Let i be (-1308)/14 - (-18)/42. Let m = i - -95. Let z(l) = 2l3 + 5l + 4. Calculate mo(g) + 11z(g). 2g3 + 3g + 2 Let a(i) = i + 1. Suppose -m = 3d - d - 12, 3d - m = 8. Let z(g) = -3g - d + 2g - 2g. Suppose -5t - 15 = -5. Give ta(n) - z(n). n + 2 Let u be (-2)/(2 + 0/(-4))-1. Let c(k) = k*3. Let m(g) = -2g*3 + 2g*2 + 2g. Calculate um(v) - 2c(v). -4v3 + 2v*2 + 2v Let y(f) = -123 + 46 - 2f + 75 - 17f*2. Let h(z) = -460z*2 - 55z - 55. Determine -2h(q) + 55y(q). -15q2 Let t(f) = -2f - 6. Suppose 0v + 12 = 3v. Let n = -3 - v. Let l(w) = 4w + 11. What is nt(y) - 4l(y)? -2y - 2 Let z(o) = -27o3 - 2o*2 + 5o + 5. Let y(w) = -152w + 306. Let x be y(2). Let h(b) = -14b3 - b2 + 2b + 2. Determine xz(k) - 5h(k). 16k3 + k2 Let t be -2 - 44/(-16) - (-66)/8. Let i(y) = 0 + 4 - ty + 13y - 9y. Let s(n) = -n + 1. Calculate -3i(r) + 12s(r). 3r Let s(a) be the first derivative of a + 1/3a3 + 2a*2 - 13. Let y = -4 + 7. Let t(f) = f + 1. What is yt(l) - s(l)? -l*2 - l + 2 Let j(v) = 83v - 6. Let r(k) = k - 1. Determine j(o) - 5r(o). 78o - 1 Let k(t) = -308t + 28. Let a(v) = -103v + 10. Give -17a(h) + 6k(h). -97h - 2 Let r(h) = 53514 - h - 53514 + 2h*2. Let w(j) = -5j*2 - 3j + 8. Let d(s) = -2s2 - s + 3. Let v(i) = 8d(i) - 3w(i). What is -5r(x) - 5v(x)? -5x*2 Let m(q) = -2q - 112. Let t(z) = -z - 74. Determine 5m(y) - 8t(y). -2y + 32 Let s(f) = 1. Let q(g) = 1 + 4 - 4. Let t(v) = 2q(v) - s(v). Let h = -177 + 175. Let u(w) = w - 1. Calculate ht(z) - 2u(z). -2z Let h be 3(-1 - 8/(-6)). Suppose 2g + 9 = h. Let a(p) = 2p + 4. Let t(d) be the third derivative of d*4/12 + 5d3/6 + d2. Calculate gt(j) + 5a(j). 2j Let k(o) = 3o3 + o2 + o - 1. Let u be k(1). Suppose uz - 9 = h - 4h, -5h = -5z + 20. Let w(i) = 4i - 1 + i - i. Let y(d) = d. Give hw(g) + 2y(g). -2g + 1 Let o(y) = -3. Let i(l) = -2l2 + l2 - 100l + 100l + 5. Determine 6i(f) + 10o(f). -6f*2 Let n(d) = -2d*2 + d - 9. Let l(a) = -1. What is l(v) + n(v)? -2v*2 + v - 10 Let a(r) = 2r - 1. Let m(j) be the second derivative of -5j + 7 - 1/6j*3 + 0j*2. Calculate a(o) + 5m(o). -3o - 1 Let t(v) = -2v + 7. Let r(l) = -l + 1. What is -6r(b) + t(b)? 4b + 1 Let j(i) = -8i3 + 2i*2. Let c(k) = 4k*2 + 3k - 18. Let z(r) = -3r2 - 2r + 12. Let t(d) = -2c(d) - 3z(d). Give j(a) - 2t(a). -8a*3 Let j(i) = -i. Let u(w) = w + 1. Let c be u(-3). Let t(b) be the first derivative of 2b*2 - 2b + 11. Determine cj(d) - t(d). -2d + 2 Suppose -18w = 78 + 12. Let s(n) = 4n*2 + 3n + 3. Let x(t) = 2t2 + t + 1. Give wx(v) + 2s(v). -2v*2 + v + 1 Let u(g) = 2g + 7. Let h(q) = q + 2. What is 10h(k) - 4u(k)? 2k - 8 Let y(n) = 14n*2 + 8n - 2. Let j = 183 - 191. Let t(o) = -5o2 - 3o + 1. Determine jt(c) - 3y(c). -2c2 - 2 Let s(b) = b - 1. Let w(i) = 4156 - 8312 - 18i + 4160. Give 4s(c) + w(c). -14c Let w(x) = 8x2 + 5x + 1. Let i(a) = -2a2 - a. Let d(p) = p2 - 9p - 9. Let t be d(10). Suppose -t = -u, 4 = 2c - 3u + 3. Give cw(r) + 9i(r). -2r2 + r + 2 Let l = 28 + -25. Let h(p) = -14p*2 + 9p*2 + lp*2 + 2. Let y(n) = -1. Determine h(g) + 2y(g). -2g2 Let q(j) = 85j*3 + 25j*2 - 25j + 25. Let i(x) = -7x3 - 2x*2 + 2x - 2. What is 25i(f) + 2q(f)? -5f3 Let i(k) = -5k - 4. Let o(h) = 11h + 8. Suppose -2j = 2f, 2f = 3j - 20 + 5. What is jo(v) + 7i(v)? -2v - 4 Let c(y) = -9y3 - 3y*2 + 3y. Let d(h) = 2h3 - 9h*2 - 5h + 4. Let k be d(5). Let r(i) = -9i3 - 4i*2 + 4i. What is kc(j) - 3r(j)? -9j3 Let v(t) = t2 - 1. Let n(h) = -677h*3 + 2h*2 - 2. Determine n(l) - 2v(l). -677l3 Let c(q) = -2q - 5. Let v(y) = -2y - 4. Let u = 13 + -8. Suppose -8o + 7o = -u. What is ov(z) - 4c(z)? -2z Let w(r) be the second derivative of 3r5/20 + r4/2 + 5r*3/6 - 24r. Let d be ((-40)/25)/(2/(-5)). Let b(h) = -h3 - h2 - h. What is db(f) + w(f)? -f3 + 2f*2 + f Let j(g) = -3g*2 - 67g - 5. Let w(z) = 5z2 + 101z + 8. What is -8j(c) - 5w(c)? -c*2 + 31c Suppose p + 4p + 30 = -u, -4p - 15 = -u. Let x(g) be the third derivative of g4/6 + g3/6 + 104g2. Let h(j) = -5j - 1. What is uh(d) - 6x(d)? d - 1 Let l(n) = -14100n2 - 752. Let r(s) = 188s*2 + 10. Determine -5l(u) - 376r(u). -188u*2 Let h(p) = 8p + 857. Let b(f) = -5f - 428. What is -5b(a) - 3h(a)? a - 431 Let v(x) = -3x - 1. Let c(y) = 2y2 - 7y - 2. Let p(k) = 3c(k) - 7v(k). Let l(o) = -o*2. Determine 5l(s) + p(s). s*2 + 1 Let b(q) = -8q*2 - 3q + 22. Let k(s) = s*2 + 3. Give -b(y) + 6k(y). 14y2 + 3y - 4 Let u(z) = -3z2 + z + 1. Let c(v) = 7v*2 - v - 15. What is -c(s) - 2u(s)? -s2 - s + 13 Let c(q) = q3 - 2q2 + 2q + 3. Let l(t) = -2t2 - 28t + 4 + 0t2 + 59t - 28t. Determine -3c(h) + 2l(h). -3h*3 + 2h*2 - 1 Let n(m) = -14m + 14. Suppose 0 = d + 6 - 54. Let a(s) = -59 - d - 9s + 116. Calculate -8a(k) + 5n(k). 2k - 2 Let c(b) = b*2 - 55b - 27. Let i(k) = 11k + 5. What is -2c(g) - 11i(g)? -2g*2 - 11g - 1 Let k(w) = 42w2 + 8w + 29. Let y(m) = 14m2 + 3m + 10. Give 4k(j) - 11y(j). 14j2 - j + 6 Let r(m) = 44m*2 - 9m - 11. Let n(v) = -22v2 + 4v + 5. Determine -9n(k) - 4r(k). 22k2 - 1 Let q(c) = -22c + 34. Let k(l) = 33l - 51. Let p(o) = 5k(o) + 7q(o). Let r(h) = 5h - 8. Give 6p(s) - 13r(s). s + 2 Let j(y) = 36y2 + y - 115y*2 + 39y*2 + 41y*2. Let s(q) = 15q*2 + 12q. Determine -12j(t) + s(t). 3t*2 Let y(l) = -27l*2 + l + 5. Let h(q) = 2q*2 - q + 1. What is h(i) + y(i)? -25i*2 + 6 Let n = -220 + 226. Let a(f) = -8f*3 + 9f*2 - 2f. Let g(h) = -7h3 + 8h*2 - 2h. What is na(c) - 7g(c)? c*3 - 2c*2 + 2c Let t(y) = y*2 + y - 1. Let i(d) = -4d*2 - 7d + 4. Let c = -45 + -2. Let a = c + 42. Let k = 1 - 2. Determine at(s) + ki(s). -s*2 + 2s + 1 Let p(x) = -x*2 + x - 1. Let r(d) = -89d*3 + 178d*2 - 178d + 178. Give -534p(a) - 3r(a). 267a3 Let r(k) = k + 1. Let c(f) = 2f + 3. Give 4c(p) - 7r(p). p + 5 Let m(w) = 9w - 89. Let b(x) = -4x + 42. Determine -7b(s) - 3m(s). s - 27 Let a(m) = 54m2 - 12. Let j(x) = 164x*2 + x - 33. Determine 11a(f) - 4j(f). -62f*2 - 4f Let l(f) = -f*2 - 52f - 386. Let i be l(-43). Let w(u) = -5u + 5. Let z(p) = -1 + 1 + 1. Calculate iw(b) - 5z(b). -5b Let y(f) = -82f2 + 170f*2 + 3f*3 - 4 + 4f - 84f2. Suppose 0z - z + 4 = 0. Let p(r) = 2r3 + 3r*2 + 3r - 3. Calculate zp(q) - 3y(q). -q*3 Let f(c) = c + 1. Let i(n) = 203n + 5. What is -4f(d) + i(d)? 199d + 1 Let u(o) = -o2 + o + 6. Let t(y) = -y2 + 2y - 2. Suppose 4x - 13 = 7. Let p be t(x). Let f(i) = -3i2 + 3i + 17. Calculate pu(g) + 6f(g). -g*2 + g Let r(o) = -8o - 17. Let q(t) = -14t - 35. What is -6q(b) + 11r(b)? -4b + 23 Let w(z) = 4z + 0 - 3z2 + 5 - z2. Let p(y) = -9y2 + 9y + 11. Let b be ((-156)/(-130))/(4/10). Let i = -12 - -5. What is bp(h) + iw(h)? h*2 - h - 2 Let l(f) = -42f*3 + 3f2 - 1. Let p(s) = s3 - 2s2 + 2s - 1. Calculate l(n) + p(n). -41n3 + n2 + 2n - 2 Let x(f) = 8 + 10 + 7 - 2f2 + 12f*2 - 26. Let v(b) = -21b*2 + 2. Determine -6v(k) - 13x(k). -4k*2 + 1 Let s = -4 - -6. Let v(m) = -6m + 3m - 2 + 4m + m2. Let w(x) = -x2 - 2x + 3. Suppose 2c - 12 = -6. Give cv(r) + sw(r). r2 - r Let u(x) = x2. Let q(z) = 19z2 + 21z - 6. Let b(g) = 4g2 + 4g - 1. Let k(y) = -11b(y) + 2q(y). Give k(h) + 4u(h). -2h*2 - 2h - 1 Let u(q) = 9q3 + 11q*2 + 7q - 13. Let h(b) = -5b3 - 6b*2 - 4b + 7. Let y be (5 - -1)	{ "pile_set_name": "DM Mathematics" }
vide -94939548 by -33. 2876956 What is 1489280 divided by 128? 11635 What is -148322673 divided by 53? -2798541 Divide 5381492 by -14866. -362 What is 104421 divided by -138? -34807/46 -9869315 divided by 240715 -41 559 divided by -26425 -559/26425 -118380 divided by -1621 118380/1621 What is 27360790 divided by 5? 5472158 What is -324729922 divided by 6? -162364961/3 What is -113791482 divided by 126? -903107 What is 2380 divided by -92877? -2380/92877 Calculate -10164 divided by 33. -308 Calculate 50410274 divided by 6. 25205137/3 What is -302332156 divided by 2? -151166078 Calculate -47932320 divided by -1997180. 24 What is 7710440 divided by -1542088? -5 Divide 4 by 19662952. 1/4915738 What is 75 divided by 2835? 5/189 -397615020 divided by -128678 3090 Divide 15 by 130219422. 5/43406474 Divide -79407336 by -12209. 6504 -7391383 divided by -103 71761 21616 divided by 25 21616/25 What is 3784550 divided by -5? -756910 What is 14842 divided by -707? -14842/707 Divide 116347630 by -14. -8310545 Calculate 19841700 divided by -950. -20886 What is 13090926 divided by -1? -13090926 What is 515421545 divided by -4? -515421545/4 Divide 1 by 4423971. 1/4423971 -82994192 divided by -334654 248 19013212 divided by -7076 -2687 3 divided by -14145018 -1/4715006 Calculate -179853 divided by 1. -179853 Divide 1416945 by 45. 94463/3 Divide 1083297744 by 4. 270824436 Divide -23110935 by 19. -1216365 10335110 divided by 2 5167555 Calculate -6682 divided by 127779. -6682/127779 Calculate -2 divided by -55660547. 2/55660547 Divide 4530279 by -348483. -13 -5721197 divided by -3 5721197/3 -47945145 divided by 8 -47945145/8 Calculate 618009561 divided by -13. -47539197 What is 1245048 divided by 4? 311262 Divide -13770764 by 4. -3442691 What is 8515995 divided by -15? -567733 Divide 14222970 by -6. -2370495 288832608 divided by 4 72208152 Divide 123727110 by 3. 41242370 1312480784 divided by 6 656240392/3 Divide -985034 by -1. 985034 -145236 divided by 74 -72618/37 What is 1575288 divided by -9724? -162 -97528685 divided by 5 -19505737 Divide -1293896948 by 982. -1317614 -3956 divided by 211105 -3956/211105 7433556 divided by -204 -36439 What is -3741 divided by 16930? -3741/16930 What is 72342684 divided by -1? -72342684 -3886 divided by 307266 -1943/153633 Divide 33282488 by 3. 33282488/3 Divide 20452929 by -3. -6817643 Divide 15 by 6114639. 5/2038213 704467925 divided by 140893585 5 -18148 divided by 11 -18148/11 Calculate -195328004 divided by -48832001. 4 What is 121987 divided by 3541? 121987/3541 Calculate -5 divided by -386491. 5/386491 Divide 19031 by -780. -19031/780 -2142443 divided by -1 2142443 What is 61730 divided by 30865? 2 Calculate -1309214 divided by -34453. 38 Calculate -796526 divided by -796526. 1 Calculate -3 divided by 3779612. -3/3779612 Calculate -13 divided by -2055461. 13/2055461 -31378347 divided by -129129 243 What is 146 divided by -7990? -73/3995 What is -22130612 divided by 23? -22130612/23 -9109828 divided by 100108 -91 -317752 divided by -158876 2 What is 1213509670 divided by 5? 242701934 What is 239757 divided by 67? 239757/67 -2507200 divided by 3134 -800 71713200 divided by 4780880 15 Divide 2226145 by 90. 445229/18 Calculate -323104 divided by -55. 323104/55 Divide -5 by 1649769. -5/1649769 What is 29056405 divided by -200389? -145 What is 6868116 divided by 32094? 214 -2190987 divided by -141 730329/47 Divide -94 by 1354261. -94/1354261 Calculate 43 divided by 640777. 43/640777 What is 2666172 divided by -5? -2666172/5 Calculate 3063 divided by 970. 3063/970 -914 divided by 44166 -457/22083 What is 18297962 divided by -1? -18297962 What is 119714012 divided by 11? 10883092 Calculate -29742084 divided by -6. 4957014 What is -950 divided by 3208? -475/1604 Calculate 19933824 divided by 3322304. 6 Calculate -8159588 divided by -2. 4079794 What is -57182720 divided by -3191? 17920 2 divided by -26652214 -1/13326107 What is -11141120 divided by 163840? -68 -5 divided by -74825236 5/74825236 Calculate 3 divided by -64191869. -3/64191869 Divide 231412768 by -3. -231412768/3 -1006 divided by 271 -1006/271 Calculate -27611 divided by -59. 27611/59 21713504 divided by 285704 76 Calculate 40387041 divided by 12. 13462347/4 Divide 4 by -45891024. -1/11472756 15527 divided by -79 -15527/79 Divide -6077 by 36615. -6077/36615 -65932020 divided by 84420 -781 461771952 divided by 17 27163056 -156251174 divided by -2 78125587 Calculate -24618300 divided by -82061. 300 -75049412 divided by 1234 -60818 What is -149243 divided by -3642? 149243/3642 -91 divided by 12038 -7/926 -16982490 divided by -80869 210 -854436531 divided by -284812177 3 Divide 258475294 by 87857. 2942 Divide 704444 by 437. 1612 Calculate 29490432 divided by -1634. -18048 -31370431 divided by -1 31370431 What is -4408 divided by 6? -2204/3 -19620252 divided by 4 -4905063 443356299 divided by -9 -49261811 What is 308227968 divided by 72? 4280944 Calculate -26887 divided by 7060. -26887/7060 Divide 1414266 by 9366. 151 Calculate -21896886 divided by -8. 10948443/4 Calculate 9 divided by 2205577. 9/2205577 Divide -733 by -59312. 733/59312 What is 7217747 divided by 33? 7217747/33 What is 4338770 divided by 867754? 5 What is 28 divided by -16216745? -28/16216745 Calculate 6801676 divided by -4. -1700419 What is 25120084 divided by -13277? -1892 Divide 20203351 by 2. 20203351/2 Divide -551117028 by -16700516. 33 Divide 54833274 by 18277758. 3 -10125874 divided by -11 920534 What is -530797131 divided by 2? -530797131/2 Calculate 6313772 divided by -6313772. -1 Calculate -66994070 divided by -1210. 55367 Divide -66722792 by -1. 66722792 What is -2055 divided by 2392? -2055/2392 Calculate -417100 divided by 104275. -4 Calculate -435031236 divided by -35478. 12262 332376144 divided by 4 83094036 What is -100 divided by -2340265? 20/468053 What is -3366588 divided by 29? -3366588/29 What is -565084710 divided by -6445? 87678 26078 divided by -439 -26078/439 62 divided by -113476 -31/56738 298415250 divided by 170523 1750 What is 61400224 divided by -2? -30700112 -63497928 divided by 129 -492232 -167 divided by 703075 -167/703075 Calculate 2 divided by 56431127. 2/56431127 What is -197758584 divided by -8239941? 24 What is -242032752 divided by -6? 40338792 -148 divided by 19269 -148/19269 1 divided by -56128640 -1/56128640 Calculate 0 divided by -5347405. 0 Calculate 0 divided by 6346822. 0 Divide -4 by -473703. 4/473703 Divide -35626066 by -147826. 241 Calculate -344365775 divided by 598897. -575 2841878 divided by -13 -218606 Calculate -65766000 divided by -16441500. 4 20 divided by -3560745 -4/712149 What is -38042 divided by 42? -19021/21 Divide 163953376 by -400864. -409 What is 7754780 divided by -3839? -2020 Divide -114898384 by 28724596. -4 Calculate -233 divided by 27686. -233/27686 10829973 divided by 11 984543 Calculate 17945192 divided by 7. 17945192/7 Divide 1608 by 3064. 201/383 What is -3 divided by -2977? 3/2977 1145 divided by 511189 1145/511189 Divide -23792028 by -258609. 92 What is -93328583 divided by -3? 93328583/3 What is 5670 divided by -14619? -1890/4873 Divide 333411 by -972. -111137/324 15316410 divided by -7658205 -2 What is 369575289 divided by -2? -369575289/2 Divide 4 by -32855037. -4/32855037 Divide 4 by 268805. 4/268805 What is -4 divided by 140295? -4/140295 What is -335136 divided by -27928? 12 Calculate 94220488 divided by 23626. 3988 Divide -17961116 by -6. 8980558/3 What is 16250976 divided by 7? 2321568 -186 divided by -210295 186/210295 What is 0 divided by -596837? 0 What is 1744584 divided by 2778? 628 What is -117123054 divided by -4038726? 29 -5732 divided by 602 -2866/301 What is 68969670 divided by -77? -895710 Calculate -8966233 divided by -3. 8966233/3 Divide 36940 by 276. 9235/69 What is 41237938 divided by 2945567? 14 Divide 2219418 by -34. -65277 Calculate 29439 divided by -166. -29439/166 Divide 343480158 by -5452066. -63 Divide -68781986 by 53989. -1274 Divide -550777744 by 1798. -306328 What is -55624810 divided by 2418470? -23 406963986 divided by 167406 2431 What is -23519295 divided by -10495? 2241 What is -165250 divided by -21? 165250/21 Divide 53722176 by -6715272. -8 Calculate -87419741 divided by -2. 87419741/2 -53	{ "pile_set_name": "DM Mathematics" }
587 composite? False Is 97021 prime? True Is 2099 composite? False Is 47363 a composite number? False Is 7907 prime? True Is 227993 a composite number? False Is 8180351 composite? False Is 1549001 composite? True Is 20959 prime? True Is 187 prime? False Is 1804249 prime? True Is 106163 composite? False Is 6803 composite? False Is 9151 a composite number? False Is 11947 composite? True Is 1651 a composite number? True Is 47041 composite? False Is 6289 prime? False Is 43391 prime? True Is 623093 a prime number? False Is 25409 composite? False Is 857335 composite? True Is 112741 a prime number? True Is 23957 prime? True Is 2417 a composite number? False Is 42101 composite? False Is 8851 a prime number? False Is 35951 a composite number? False Is 2923 a prime number? False Is 39469 a prime number? False Is 36629 composite? False Is 132017 a composite number? True Is 168286 a composite number? True Is 485189 a composite number? True Is 954034 composite? True Is 22465 a composite number? True Is 14657501 prime? True Is 70271 a composite number? False Is 68167 a prime number? False Is 745363 prime? False Is 7017007 prime? True Is 836063 a composite number? False Is 7253 composite? False Is 8009 prime? True Is 173249 composite? False Is 42521 composite? True Is 5645 prime? False Is 10211 composite? False Is 19217 prime? False Is 1817 a prime number? False Is 126913 prime? True Is 447943 a composite number? False Is 239357 a composite number? False Is 58423 a prime number? False Is 81709 prime? False Is 45947 a composite number? True Is 10729 a composite number? False Is 19801 a prime number? True Is 4391 prime? True Is 5981 a composite number? False Is 1319 a prime number? True Is 332959 a composite number? True Is 34807 prime? True Is 19286 prime? False Is 205187 prime? True Is 422749 composite? False Is 1849171 a composite number? False Is 48881 prime? False Is 218098 prime? False Is 157627 prime? True Is 3341 prime? False Is 4811 a prime number? False Is 582793 prime? True Is 256915 composite? True Is 718 a prime number? False Is 13397 prime? True Is 2288003 a composite number? False Is 79369 a prime number? False Is 33961 prime? True Is 4742 a prime number? False Is 76079 prime? True Is 46381 composite? False Is 2552843 a composite number? False Is 2401103 a prime number? True Is 317829 a composite number? True Is 13738 prime? False Is 299422 composite? True Is 373313 prime? False Is 207611 prime? False Is 2411 a composite number? False Is 4201 prime? True Is 239831 prime? True Is 75001 prime? False Is 11567 prime? False Is 5623 a prime number? True Is 89041 composite? False Is 352579 a prime number? True Is 32689 a composite number? True Is 35285 a composite number? True Is 33311 composite? False Is 5951 a prime number? False Is 104257 a prime number? False Is 339455 a prime number? False Is 370043 a composite number? True Is 155003 composite? False Is 615871 prime? False Is 1597331 a prime number? True Is 113345 prime? False Is 15646 composite? True Is 214163 a composite number? False Is 23846 prime? False Is 7639 prime? True Is 17657 a prime number? True Is 8219 a composite number? False Is 21311 composite? True Is 441793 composite? True Is 284723 a prime number? True Is 30731 prime? False Is 2179 a composite number? False Is 1282 composite? True Is 45187 a prime number? False Is 352043 a composite number? False Is 42907 a composite number? True Is 57389 a prime number? True Is 1651 a composite number? True Is 87977 prime? True Is 79009 a prime number? False Is 22367 prime? True Is 140323 composite? True Is 293555 composite? True Is 12197 a prime number? True Is 12581 composite? True Is 81401 prime? True Is 13273 composite? True Is 13093 composite? False Is 628517 a prime number? False Is 2889073 a composite number? True Is 55997 prime? True Is 653357 a composite number? False Is 78427 composite? False Is 14386 a prime number? False Is 418553 prime? True Is 9533 prime? True Is 260563 a prime number? False Is 62189 prime? True Is 271657 prime? True Is 14591 a prime number? True Is 115 composite? True Is 3137 prime? True Is 21059 composite? False Is 17833 a composite number? True Is 200521 a composite number? True Is 643583 a composite number? False Is 1642799 a prime number? False Is 110431 a prime number? True Is 190823 composite? False Is 337 prime? True Is 31397 composite? False Is 907 a composite number? False Is 1114069 composite? True Is 66431 prime? True Is 382 composite? True Is 3194 a composite number? True Is 167861 prime? True Is 3251 a composite number? False Is 7829 a composite number? False Is 3989 a composite number? False Is 502301 a prime number? True Is 278231 a composite number? True Is 3433 composite? False Is 23731 composite? True Is 5003 a prime number? True Is 5437 composite? False Is 1409435 a composite number? True Is 249311 a prime number? True Is 454011 a prime number? False Is 13901 a prime number? True Is 15427 prime? True Is 9005 a prime number? False Is 85159 prime? True Is 18779 a prime number? False Is 130283 a prime number? False Is 336439 a composite number? True Is 132113 composite? False Is 771809 a prime number? True Is 2014351 composite? False Is 39677 prime? False Is 162379 prime? False Is 1856633 prime? False Is 327401 a composite number? False Is 16143 composite? True Is 6287 a prime number? True Is 29533 a composite number? True Is 1157 a prime number? False Is 86539 prime? True Is 200667 prime? False Is 9407 a prime number? False Is 109 composite? False Is 462221 a composite number? False Is 8093 a prime number? True Is 168367 a prime number? False Is 187003 a composite number? False Is 10877 prime? False Is 62027 a prime number? False Is 954827 a composite number? False Is 3407 a prime number? True Is 578207 a composite number? True Is 1073 composite? True Is 809 a prime number? True Is 2103 prime? False Is 200894 a prime number? False Is 4861 a composite number? False Is 869 a prime number? False Is 2253 composite? True Is 4121 a composite number? True Is 46261 prime? True Is 3267257 a prime number? False Is 470343 a composite number? True Is 656823 a prime number? False Is 503293 a composite number? True Is 420419 a composite number? False Is 166406 prime? False Is 8209 prime? True Is 667 composite? True Is 14849 a composite number? True Is 101681 composite? False Is 105997 prime? True Is 585635 a prime number? False Is 106721 prime? True Is 1149 prime? False Is 57403 a prime number? False Is 44155 a prime number? False Is 27134 a prime number? False Is 126287 composite? True Is 2203 a prime number? True Is 116593 composite? False Is 22639 a prime number? True Is 132001 prime? True Is 206071 composite? True Is 333137 a prime number? False Is 3127 a composite number? True Is 37087 prime? True Is 27329 a prime number? True Is 32947 a prime number? False Is 1801 a composite number? False Is 21487 composite? False Is 10961 a prime number? False Is 1169 a composite number? True Is 17827 a composite number? False Is 6779 prime? True Is 150473 composite? False Is 163577 a prime number? False Is 20329 composite? True Is 9143 composite? True Is 1245759 a composite number? True Is 101257 prime? False Is 95987 a composite number? False Is 3345665 a prime number? False Is 2533 prime? False Is 101737 a prime number? True Is 37049 a composite number? False Is 528911 a composite number? False Is 183493 a composite number? True Is 48163 a composite number? False Is 68461 prime? False Is 110791 composite? True Is 34757 prime? True Is 235699 prime? True Is 27787 a composite number? True Is 40787 a composite number? False Is 2818 prime? False Is 23251 a composite number? False Is 1716703 composite? False Is 3067 composite? False Is 1735 prime? False Is 127103 composite? False Is 743 a composite number? False Is 377681 composite? False Is 653 prime? True Is 769623 a prime number? False Is 787 composite? False Is 44351 composite? False Is 46855 prime? False Is 886643 composite? False Is 20771 a prime number? True Is 398773 composite? True Is 75559 a prime number? False Is 4421 composite? False Is 21557 prime? True Is 52149 a composite number? True Is 15245 a composite number? True Is 253417 composite? False Is 582	{ "pile_set_name": "DM Mathematics" }
00000100100 (base 2) to base 5 22243034 Convert 2067274 (base 10) to base 14. 3bb546 33121320 (base 6) to base 15 148720 Convert -100110010011011 (base 2) to base 10. -19611 Convert 34610533 (base 8) to base 14. 10042cb Convert 41e838 (base 16) to base 13. b82cbc Convert 27732 (base 12) to base 16. d556 What is -5e670 (base 16) in base 11? -244570 What is 142113022 (base 5) in base 16? b44d0 Convert 9d9ac (base 16) to base 9. 1183465 -377570 (base 8) to base 12 -63934 What is -4795136 (base 11) in base 8? -37670671 Convert 107836 (base 10) to base 13. 3a111 What is -1209335 (base 12) in base 7? -41514062 Convert -41031530 (base 6) to base 15. -181d1c Convert 893b8c (base 14) to base 6. 243504424 What is 1513053 (base 9) in base 15? 11783c What is 11103120110 (base 4) in base 13? 39895a Convert 114131022 (base 5) to base 7. 4362545 What is 221201020002 (base 3) in base 15? 9ee45 What is 1465248 (base 9) in base 11? 504230 Convert 22020120010 (base 3) to base 5. 20142441 Convert -4323366 (base 7) to base 8. -2005303 -10323500 (base 6) to base 3 -120120200200 b510 (base 14) to base 9 46682 What is 42455045 (base 6) in base 9? 2317062 -26515b (base 14) to base 5 -314221031 Convert 103345016 (base 7) to base 16. 5e4aad What is 3040241204 (base 5) in base 14? b6c6a0 230b80 (base 13) to base 12 340560 What is 344b6 (base 15) in base 7? 1262160 What is -12222212200 (base 3) in base 15? -24e73 What is 10001011010011110 (base 2) in base 9? 117751 What is -11331022101 (base 4) in base 3? -2221022121110 What is 3033383 (base 11) in base 9? 11073647 What is 100320231021 (base 4) in base 15? 5c6899 What is d58a5 (base 16) in base 6? 30425205 Convert -8d7ab (base 15) to base 4. -1232000303 -3121131 (base 6) to base 3 -21122121001 What is 423041 (base 7) in base 9? 121228 What is -10303220311 (base 4) in base 8? -4635065 -68873 (base 10) to base 12 -33a35 What is -93578 (base 12) in base 11? -12179a What is 3374c (base 16) in base 12? a1b78 382433 (base 14) to base 15 280ee7 Convert 11113121 (base 6) to base 7. 2600434 Convert 548bc (base 13) to base 10. 153100 Convert 2251f4 (base 16) to base 13. 6099b9 Convert 502312 (base 6) to base 12. 1a998 What is -11515053 (base 6) in base 7? -3061353 What is 63855 (base 12) in base 4? 133330001 What is -101000111110000100 (base 2) in base 14? -45228 30d3 (base 15) to base 4 2201103 Convert 153785 (base 9) to base 11. 65158 Convert -9457a (base 13) to base 5. -32014113 280569 (base 12) to base 4 2202030201 What is -1407286 (base 11) in base 8? -11201112 Convert 1101210121011 (base 3) to base 15. ea6b1 -320b30 (base 12) to base 14 -167a72 What is 280828 (base 14) in base 7? 14524451 8abb4 (base 14) to base 5 41241312 What is 3556202 (base 7) in base 8? 1561111 Convert 10101100011111111 (base 2) to base 10. 88319 Convert 20203114 (base 5) to base 2. 100111110001011101 Convert 650555 (base 12) to base 9. 3004262 Convert 250028 (base 9) to base 10. 150929 What is 1478 (base 14) in base 3? 11222121 Convert 10521634 (base 9) to base 14. 967c7c -3331290 (base 10) to base 6 -155222350 -334219 (base 11) to base 12 -218306 What is 13353262 (base 7) in base 6? 42325051 -10131012033 (base 4) to base 15 -181009 c476 (base 16) to base 11 34872 What is 26262 (base 9) in base 6? 214002 -1163158 (base 9) to base 16 -9a571 What is 10033033 (base 5) in base 9? 132245 -2020210022221 (base 3) to base 12 -49852a What is 47618 (base 14) in base 5? 21032240 What is -4310011 (base 5) in base 11? -4a525 What is 28ce6 (base 15) in base 9? 218830 4eb11e (base 16) to base 12 1888566 What is 349ba (base 12) in base 5? 4224213 What is -625659 (base 14) in base 9? -6217421 What is -1364116 (base 7) in base 14? -4b046 Convert 31440000 (base 5) to base 2. 1000000101100101000 What is 111010101011001 (base 2) in base 11? 20630 What is 5553026 (base 7) in base 14? 13ba86 Convert 422716 (base 8) to base 3. 21011001222 What is -111001100110110101001 (base 2) in base 4? -13030312221 -7eef6 (base 16) to base 6 -15051022 Convert -403400 (base 9) to base 13. -84861 113310000030 (base 4) to base 2 10111110100000000001100 Convert 1a74340 (base 12) to base 16. 55dbe0 4728a (base 11) to base 7 402616 What is -3631561 (base 7) in base 9? -773204 -5df4d (base 16) to base 13 -106226 Convert -10000101101011010011 (base 2) to base 6. -15422523 What is 89183 (base 10) in base 9? 145302 What is -216013156 (base 7) in base 14? -1a4059d Convert 10001101011101110001 (base 2) to base 4. 2031131301 Convert 1022200212100 (base 3) to base 10. 702657 Convert -26363500 (base 8) to base 11. -3364747 What is -33220234 (base 5) in base 11? -187aa3 Convert -66850 (base 10) to base 8. -202442 Convert -11000121222010 (base 3) to base 16. -20a015 Convert 2b2b (base 16) to base 3. 120011022 -25234203 (base 6) to base 5 -202013111 -127886 (base 9) to base 11 -5366a What is 777830 (base 10) in base 15? 105705 Convert 2073770 (base 8) to base 10. 555000 Convert -41338 (base 11) to base 12. -2aa8b 45665352 (base 7) to base 8 17203514 Convert -7768d2 (base 14) to base 16. -3dd3b8 -3c4d23 (base 14) to base 12 -848417 Convert 30180 (base 12) to base 14. 18a88 Convert c1f96 (base 16) to base 2. 11000001111110010110 What is -6340a (base 16) in base 8? -1432012 110201201022100 (base 3) to base 13 152b482 -822763 (base 10) to base 11 -512177 What is 1961a (base 16) in base 6? 2121150 What is -572160 (base 8) in base 16? -2f470 Convert -100010010111101101001000 (base 2) to base 14. -12a774c -55b741 (base 12) to base 5 -322233110 Convert 72868 (base 10) to base 13. 27223 What is 2215815 (base 13) in base 8? 47641000 Convert 2671995 (base 11) to base 12. 1666487 What is -2289091 (base 10) in base 4? -20232313003 Convert -28a8 (base 11) to base 4. -322210 Convert -264055 (base 8) to base 4. -112200231 403486 (base 11) to base 10 648775 94618 (base 12) to base 16 2f774 Convert -3315104 (base 6) to base 9. -272274 -2456061 (base 7) to base 6 -10441520 Convert -142ee0b (base 15) to base 9. -30381632 -11110100001010000011 (base 2) to base 14 -1c0655 Convert -132340 (base 7) to base 12. -12487 What is -2bb4a9 (base 12) in base 3? -1101212121010 24f7b (base 16) to base 11 a3844 -1240514 (base 11) to base 16 -20d98f 10110101000110000 (base 2) to base 4 112220300 Convert d1c49 (base 16) to base 6. 30225453 What is 8590633 (base 11) in base 10? 15110274 Convert 10101111110010100010010 (base 2) to base 7. 66650542 What is -12210001220 (base 3) in base 4? -123301233 What is -19bbd (base 15) in base 7? -465613 What is 5464 (base 15) in base 2? 100010111001101 Convert 19d41 (base 16) to base 15. 2152d What is -15761602 (base 8) in base 16? -37e382 Convert -6233313 (base 9) to base 2. -1100101100101101100101 Convert 12772011 (base 9) to base 3. 102212102000101 What is b50575 (base 12) in base 16? 2b5c29 What is 3211022400 (base 5) in base 10? 6735975 Convert 2314112 (base 5) to base 11. 29434 Convert -5b93ac (base 13) to base 10. -2191058 Convert 1be79f (base 16) to base 5. 432010032 What is 512c76 (base 13) in base 3? 10120002201020 -1140221 (base 6) to base 10 -59701 43102412 (base 5) to base 9 612664 525373a (base 11) to base 9 18370521 Convert -8935067 (base 10) to base 7. -135642521 What is -422032443 (base 5) in base 16? -1abcb8 65b45 (base 12) to base 7 1100456 Convert -35c4d (base 15) to base 13. -600c1 What is -163380 (base 9) in base 16? -18a35 What is 5919b (base 13) in base 15? 333d5 What is -155144401 (base 6) in base 9? -6230141 Convert 5160162 (base 8) to base 9. 2514707 -a27345 (base 11) to base 8 -6225561 What is -8d93b (base 16) in base 3? -1002110110202 211221210112 (base 3) to base 4 1232103320 Convert 1160723 (base 8) to base 9. 536805 Convert 321411135 (base 6) to base 9. 11613735 6114 (base 16) to base 15 756c Convert 5d240 (base 16) to base 9. 641283 What is 111436 (base 9) in base 5? 4113241 Convert 1000110101001001 (base 2) to base 14. d277 What is -127672 (base 8) in base 7? -245104 334818 (base 10) to base 11 209610 What is -570e (base 16) in base 12? -10a92 Convert -7dcd84 (base 14) to base 16. -419bf8 What is -1441340033 (base 5) in base 7? -44525641 What is -5404320 (base 6) in base 7? -2153445 -728080 (base 11) to base 10 -1167375 Convert 1722480 (base 12) to base 13. cb1903 -10a9	{ "pile_set_name": "DM Mathematics" }
hdx. 1/91 What is prob of sequence rx when two letters picked without replacement from {r: 1, u: 1, e: 1, x: 1, y: 4}? 1/56 Two letters picked without replacement from jkjjjqjjjqjjkqkjjqkj. Give prob of sequence qj. 12/95 Calculate prob of sequence jnnj when four letters picked without replacement from zzjwjwnzzjzwwzzzwzjz. 0 Two letters picked without replacement from {w: 3, n: 2, s: 1, l: 1, h: 1, e: 3}. Give prob of sequence sw. 3/110 Calculate prob of sequence giys when four letters picked without replacement from gssgigssosiyr. 1/572 Two letters picked without replacement from wqwqwwq. What is prob of sequence qw? 2/7 Four letters picked without replacement from eneemnmiem. What is prob of sequence memn? 1/105 Calculate prob of sequence bpq when three letters picked without replacement from uqbupubbubb. 1/198 Four letters picked without replacement from {p: 1, s: 2, k: 6, g: 3, e: 3, i: 4}. What is prob of sequence sepk? 1/2584 Four letters picked without replacement from {z: 1, u: 3, b: 11}. Give prob of sequence uuzb. 11/5460 Calculate prob of sequence aa when two letters picked without replacement from yyayyaaaaa. 1/3 What is prob of sequence nby when three letters picked without replacement from nwnyb? 1/30 Calculate prob of sequence fffe when four letters picked without replacement from effffeefffefe. 14/143 What is prob of sequence bnvv when four letters picked without replacement from bjnnvjnnvnwn? 1/990 Calculate prob of sequence zzz when three letters picked without replacement from {z: 3, g: 2}. 1/10 Four letters picked without replacement from {r: 2, p: 2, f: 2, c: 1, m: 1, h: 1}. What is prob of sequence rhcm? 1/1512 Four letters picked without replacement from pdppeegdpdgdepgpgdeg. What is prob of sequence ddep? 4/969 Three letters picked without replacement from {w: 1, o: 2, r: 5, h: 8, v: 3, q: 1}. Give prob of sequence who. 2/855 What is prob of sequence lp when two letters picked without replacement from {p: 1, a: 3, e: 4, l: 2, w: 2}? 1/66 Two letters picked without replacement from bxxxcccbccxcc. What is prob of sequence bc? 7/78 Calculate prob of sequence fh when two letters picked without replacement from {w: 1, c: 1, z: 1, h: 2, j: 1, f: 2}. 1/14 Three letters picked without replacement from {f: 1, g: 1, i: 1}. Give prob of sequence fgi. 1/6 Calculate prob of sequence ud when two letters picked without replacement from nddddunfnd. 1/18 Two letters picked without replacement from {z: 1, a: 1, y: 1, g: 2, n: 1, i: 1}. What is prob of sequence gn? 1/21 Calculate prob of sequence voiv when four letters picked without replacement from {i: 3, o: 1, v: 2, w: 1, b: 4}. 1/1320 Four letters picked without replacement from ecockvcovkveeeol. Give prob of sequence vcoc. 9/7280 Four letters picked without replacement from {e: 1, o: 2, g: 2, r: 1, b: 1, m: 2}. Give prob of sequence goob. 1/756 Four letters picked without replacement from {k: 1, n: 4, t: 5, f: 1, l: 1}. Give prob of sequence fnkt. 1/594 Calculate prob of sequence kn when two letters picked without replacement from kakkkakanakkkkca. 3/80 Calculate prob of sequence ax when two letters picked without replacement from xhbaycc. 1/42 Two letters picked without replacement from {y: 1, w: 2, n: 1, c: 2}. Give prob of sequence yn. 1/30 Four letters picked without replacement from ffefffffeeffffffffff. Give prob of sequence effe. 4/285 Calculate prob of sequence by when two letters picked without replacement from {b: 4, y: 3}. 2/7 Three letters picked without replacement from {x: 2, o: 4, l: 2}. What is prob of sequence xxl? 1/84 Four letters picked without replacement from {s: 6}. What is prob of sequence ssss? 1 Two letters picked without replacement from rauucawrxawaxw. What is prob of sequence rc? 1/91 What is prob of sequence osof when four letters picked without replacement from {s: 3, x: 1, o: 3, f: 3, u: 1}? 3/440 Calculate prob of sequence nn when two letters picked without replacement from {y: 6, n: 4}. 2/15 What is prob of sequence rnf when three letters picked without replacement from {n: 2, j: 1, f: 2, r: 11, q: 3}? 22/2907 Three letters picked without replacement from {v: 7, b: 3}. Give prob of sequence vvb. 7/40 Calculate prob of sequence tptt when four letters picked without replacement from {p: 4, t: 7}. 7/66 Calculate prob of sequence rw when two letters picked without replacement from {r: 4, w: 3, z: 7, j: 4}. 2/51 Four letters picked without replacement from {e: 13, u: 3}. Give prob of sequence ueue. 3/140 Four letters picked without replacement from psbpsbsubppusb. What is prob of sequence pppp? 1/1001 Four letters picked without replacement from ectbten. What is prob of sequence tceb? 1/210 Calculate prob of sequence py when two letters picked without replacement from {p: 9, y: 3}. 9/44 Three letters picked without replacement from {a: 2, j: 2, z: 3, q: 2, h: 4}. What is prob of sequence zha? 2/143 Two letters picked without replacement from lbilbbblillqllqql. Give prob of sequence il. 1/17 Two letters picked without replacement from uuquuqqu. What is prob of sequence qq? 3/28 Three letters picked without replacement from {u: 3, v: 15}. What is prob of sequence vvv? 455/816 Calculate prob of sequence kob when three letters picked without replacement from {y: 4, b: 10, k: 3, o: 3}. 1/76 Two letters picked without replacement from weswzzo. What is prob of sequence so? 1/42 Three letters picked without replacement from hahkwhg. Give prob of sequence agw. 1/210 What is prob of sequence qxrr when four letters picked without replacement from {q: 2, p: 2, r: 2, x: 8}? 4/3003 Four letters picked without replacement from oppgt. Give prob of sequence pgpo. 1/60 Three letters picked without replacement from {b: 1, n: 2, z: 4}. What is prob of sequence znn? 4/105 Three letters picked without replacement from {y: 2, c: 17}. What is prob of sequence ccc? 40/57 Two letters picked without replacement from {r: 6, u: 3, h: 2, a: 4, b: 3}. What is prob of sequence hu? 1/51 Calculate prob of sequence co when two letters picked without replacement from {f: 1, i: 1, o: 2, b: 1, c: 2}. 2/21 Calculate prob of sequence oho when three letters picked without replacement from hhooooohoohhohhohoho. 11/76 What is prob of sequence sud when three letters picked without replacement from aasdsdaau? 1/126 Three letters picked without replacement from hbbhhbbhbhbhhb. What is prob of sequence hbh? 7/52 What is prob of sequence gguu when four letters picked without replacement from ugguggguuuggu? 21/286 Two letters picked without replacement from {v: 1, a: 2, n: 1, m: 1}. Give prob of sequence am. 1/10 What is prob of sequence iti when three letters picked without replacement from iiiitiiiiiiii? 1/13 Calculate prob of sequence kvss when four letters picked without replacement from {b: 2, s: 2, d: 2, m: 2, v: 4, k: 3}. 1/1365 Three letters picked without replacement from ggmgwnzgnm. What is prob of sequence gzw? 1/180 What is prob of sequence lr when two letters picked without replacement from {r: 4, l: 3}? 2/7 What is prob of sequence kkx when three letters picked without replacement from {k: 12, x: 1, q: 3}? 11/280 Calculate prob of sequence tkx when three letters picked without replacement from xetkoek. 1/105 What is prob of sequence ttpt when four letters picked without replacement from {n: 1, f: 1, z: 1, t: 1, p: 1}? 0 What is prob of sequence bmrr when four letters picked without replacement from {j: 2, u: 3, r: 3, m: 1, b: 1, q: 2}? 1/1980 What is prob of sequence ss when two letters picked without replacement from {s: 5, l: 2}? 10/21 What is prob of sequence mxx when three letters picked without replacement from {s: 1, m: 1, x: 2}? 1/12 Calculate prob of sequence zzh when three letters picked without replacement from dzzzdzdhdz. 1/36 Four letters picked without replacement from pshshcpoplls. Give prob of sequence ohph. 1/1980 Calculate prob of sequence xogo when four letters picked without replacement from xoxxxoogxo. 1/84 What is prob of sequence ooo when three letters picked without replacement from wooowooowowoowoowoo? 286/969 Two letters picked without replacement from jsojscoddssocsj. What is prob of sequence sc? 1/21 Four letters picked without replacement from luguouuuuvuv	{ "pile_set_name": "DM Mathematics" }
ch is the nearest to 4? (a) -3741 (b) 86 (c) 14 c What is the nearest to -1/3 in -4/7, 95, 26.5, 29? -4/7 Which is the closest to 15/7? (a) 2/11 (b) 45 (c) 0.3 (d) -16 (e) 0.4 e What is the nearest to 5 in 209, 1.4, -0.2, 5, 0? 5 What is the closest to 0.1 in 43, -2/55, 5, -1.5, 8? -2/55 What is the closest to -91 in 0, -2/11, -5, 3/8, -0.3? -5 Which is the closest to -0.07? (a) 0.013 (b) 24/7 (c) -4/15 a What is the closest to 7 in 111, 2, -48, -1/6, -3? 2 What is the closest to -0.03 in 1, -0.05, 4, 2, 0.392? -0.05 Which is the closest to 71? (a) -5 (b) 2/5 (c) 804 b What is the nearest to 723 in -2, -1/2, 3/10, 1, 4? 4 What is the nearest to -1 in 3, -1526918, -1? -1 Which is the nearest to -13/6? (a) -33 (b) -3 (c) 4 (d) 0.1 b Which is the nearest to -20? (a) -9/4 (b) -10 (c) -0.2 (d) 1/3 (e) 3 (f) 1/32 b Which is the closest to 814.9? (a) 0.1 (b) -4 (c) 6 c What is the closest to 1/3 in 3, 446, 5, 10.267? 3 What is the nearest to -1/3 in 1, 0, 43, 2, -3/547, 0.14? -3/547 What is the nearest to 1 in -4, -0.094, -1, 0.08, 0.1, -4186? 0.1 Which is the closest to -0.1? (a) -11/42 (b) -0.0124 (c) -6 b Which is the nearest to -1? (a) -0.2 (b) 1/3 (c) -5 (d) 675 (e) 6/19 (f) -0.4 f What is the closest to -1/3 in 20, 2, 2/21, 2/225, 29? 2/225 Which is the closest to 353? (a) 17 (b) 41 (c) -4/5 (d) -6/11 b Which is the nearest to 3/8? (a) 0.3 (b) -1/8 (c) -1078 (d) 0 (e) -2/247 (f) -2/7 a Which is the nearest to -2? (a) -22 (b) -1186 (c) -34 a Which is the closest to -2.7? (a) 0 (b) 0.12 (c) 33/10 (d) 1/4 a What is the closest to -2/5 in -1, -5, 328535, -0.2, -0.1? -0.2 What is the nearest to -5/189 in 39/7, 0.1, -1? 0.1 Which is the closest to -0.096? (a) -1/4 (b) -2 (c) 19 (d) 4/7 (e) 1 a What is the nearest to -9/4 in 5, -54112, -1? -1 What is the nearest to 3.08 in 945/2, -4, -2? -2 Which is the nearest to 5? (a) 353/49 (b) -5 (c) -0.1 (d) 2/5 a Which is the nearest to 3? (a) 3/8 (b) -1/7 (c) 2 (d) -5 (e) -2/211 c What is the closest to 0.3 in -25.37, -115/9, 0? 0 Which is the nearest to 0.15? (a) -3 (b) -4/59 (c) -94 (d) -5 b What is the closest to -0.07 in -485, -0.3, 40, 4, -0.5? -0.3 What is the nearest to -2139 in 3, 10, 919? 3 What is the nearest to 0 in -6/59, 3, -6/11267? -6/11267 Which is the closest to -45? (a) -2 (b) 3352 (c) 0.03 (d) -5 d Which is the nearest to 1? (a) -18/13 (b) 1/2 (c) 14 (d) -0.1 b What is the closest to 3631 in -0.4, 2/9, -0.38? 2/9 Which is the closest to -1? (a) 90/11 (b) -3 (c) -0.4635 (d) -5 (e) 0 (f) 0.5 c Which is the closest to -0.1? (a) 1 (b) 9 (c) -2 (d) -2/11 (e) -15/4 (f) -37 d What is the nearest to -2/7 in -0.06, 2/11, -2/9, -2, -30? -2/9 What is the closest to 2 in -3/5, -0.06, 6960.1, -2/11? -0.06 Which is the closest to -1? (a) -11 (b) -9379 (c) 1 (d) 1/4 d What is the nearest to -34914 in 6/7, -85, 0.1? -85 What is the closest to 0.2 in -0.08, 1.9, 5, 0.3, 31? 0.3 Which is the nearest to 0.22? (a) 49/23 (b) 10 (c) 7/2 a What is the nearest to -7 in -1, 94/237, -2, 5? -2 Which is the nearest to -4/17? (a) 2 (b) 34626 (c) -0.21 c What is the nearest to 1 in 3/4, 0.07, -645312? 3/4 What is the nearest to 1/4 in 0.3, -0.03, -304708? 0.3 Which is the closest to 31? (a) -8 (b) -632 (c) 1/19 c Which is the closest to 1287/10? (a) 10 (b) 6/19 (c) -2 a What is the nearest to 259/3 in -92, 2, -0.2, 2/9, 5? 5 Which is the closest to 4637? (a) 26 (b) -0.46 (c) -4 a Which is the closest to -0.3? (a) -0.5 (b) -0.02 (c) 1/3 (d) 0.0208 (e) 30 a Which is the closest to 42808? (a) 3 (b) 5/3 (c) -1/2 a What is the nearest to -2/7 in 752/5, -0.7, 20? -0.7 Which is the closest to -2? (a) 17 (b) 18.7 (c) 0.2 (d) -714 c What is the nearest to 2/7 in -66, 16.7, -1/2, -56? -1/2 What is the nearest to 637 in 0.08, -0.46, -0.2, 2, -0.3? 2 What is the closest to 22 in 7.19, -0.1, 0.3, 0.21, -0.5, 3? 7.19 Which is the nearest to -35? (a) -2736 (b) 1/5 (c) 5 (d) -4/9 (e) -3 e What is the closest to -52045 in -0.01, -5, 1/5, -0.1, -4/11? -5 What is the closest to 0 in 1/6, 3, 0.1, -83.7, -6, -854? 0.1 What is the closest to -0.07 in 0.092, -0.0606, -1? -0.0606 Which is the closest to 69? (a) -9 (b) 467 (c) 0 c Which is the closest to -2/19? (a) -0.2 (b) -0.9 (c) -5 (d) 4 (e) -542/5 (f) -1/6 f What is the closest to -0.1 in 0, -2/9, 0.005, -14536, 4? 0 Which is the closest to -29? (a) -2 (b) 0 (c) -265680 a What is the closest to 1/3 in -3, 5, -3/10, 0.3, -0.04, 14142? 0.3 Which is the nearest to -2? (a) -4 (b) -17 (c) 0.2 (d) 8/3 (e) 55708 a Which is the closest to -0.093? (a) 5 (b) 0.2 (c) 43/4 (d) -8/9 (e) -2/23 e Which is the closest to 1/3? (a) -0.1 (b) -49 (c) -4 (d) 42 (e) -0.3 a What is the closest to 7 in -284914, -0.1, -3, 0.2, 5? 5 Which is the closest to -1218? (a) -1/6 (b) 4/25 (c) -31 c What is the nearest to 6.8 in -24, -5, -6, -0.436? -0.436 What is the nearest to 1/4 in -1/16, -1/18, 0.39, 2? 0.39 What is the nearest to -4 in -0.958604, 4, 3, 0, -2/3, -3? -3 Which is the nearest to 1/25? (a) -100 (b) 1/3 (c) -11110 b Which is the nearest to -1/310? (a) 3/4 (b) 3693/2 (c) 4 (d) 1 (e) 2 (f) 0.3 f Which is the nearest to 14/37? (a) 90 (b) 0.5 (c) -0.2 (d) 3 (e) -8 b Which is the nearest to -1/3? (a) 0.5 (b) -2/7 (c) -0.258 (d) -14554 (e) -5/2 b Which is the nearest to -2/5? (a) -2 (b) 2.03 (c) 22 (d) -19 (e) 2 a Which is the nearest to -2? (a) 1/10 (b) -1 (c) 100 (d) 3/5 (e) -5/9 b What is the closest to 1/2 in -1/2, -1/3, 52, 184? -1/3 What is the nearest to -16 in -3, -403/2, 5, 2/15? -3 What is the closest to 22 in -1/4462, -2, 12? 12 Which is the nearest to 95/12? (a) 3/13 (b) -4 (c) 1.31 c Which is the nearest to -5? (a) 33 (b) -1/5 (c) -0.08492 b Which is the closest to 1.2? (a) -4 (b) 1/4 (c) 0.3 (d) 18 (e) 51 (f) 1 f Which is the closest to -1/2? (a) -1.6 (b) 1.2 (c) 16536 a What is the closest to 0.28 in 246901, -7, 1? 1 What is the nearest to -1 in 1/4, 3/4, 1, -188, 2/3, -214/9? 1/4 Which is the nearest to 1/3? (a) -1/6 (b) -5/54 (c) 632/7 b Which is the nearest to 1.5? (a) 1/99 (b) 0 (c) 28 (d) -3 a What is the closest to -29385 in 5, -5, 1/145, -8? -8 Which is the nearest to -3? (a) -70 (b) -1027 (c) 2/11 c What is the closest to 29 in 0.04, 5, 9309/4? 5 Which is the nearest to 5428? (a) 2 (b) 0 (c) 2388 c What is the closest to -1/3 in -5, 1.3, 986? 1.3 Which is the closest to 4189? (a) -2/141 (b) 0 (c) -0.2 (d) -2 (e) 0.2 (f) -3 e What is the nearest to -6/2179 in 2, -1, -8, -15? -1 What is the nearest to 3/10 in -0.5, 452.3, -1/3, -2/19? -2/19 Which is the closest to 58? (a) 0.15 (b) 0.84 (c) -0.2 (d) -3 b Which is the nearest to -2/7? (a) -67298 (b) -4/9 (c) -0.4 c What is the closest to 0 in 2884408, 1, 4/5? 4/5 Which is the closest to -1? (a) -4 (b) -45 (c) -1025 (d) 0.9 d What is the nearest to 1/6 in -0.42, 1, 4.33, -0.5, -6/7, -0.1? -0.1 What is the nearest to -2 in -1, 36, 0.5, 0.05, -19, -54? -1 Which is the nearest to -1734? (a) 6 (b) 1/3 (c) -4 (d) -20 (e) -2/3 d What is the nearest to 0.1 in 2, -9/10, -0.4, -1.1, -3/5? -0.4 What is the nearest to 162 in 3/2, 0.1, -2/15, 2/883, -4? 3/2 Which is the nearest to 1? (a) 10 (b) -178.6 (c) -10 (d) -35 a Which is the closest to -13? (a) -0.02 (b) 0.3 (c) 1 (d) -82 (e) 11 a What is the nearest to -0.2 in 0.06, 14/227835, 2/15, 0.3, 3? 14/227835 What is the closest to -49/688 in 8, 2/9, 80? 2/9 Which is the nearest to 244/23? (a) -180 (b) 4 (c) 0.1 (d) -4/3 b What is the closest to 3/16 in -81.5, -2, 2/19? 2/19 Which is the closest to -1? (a) 0.1 (b) 9444 (c) -0.2 (d) 4/9 (e) -2/11 (f) -2/7 f Which is the nearest to -0.2? (a) 3/2 (b) -51805 (c) 2 (d) -4 (e) -0.64 e What is the nearest to -1 in -4, 4, -1, 2213, 0.4, 10? -1 What is the nearest to 1 in 6261.8, 0.6, -1/3, 0.1, 3? 0.6 Which is the closest to -0.04? (a) 3 (b) 63 (c) 0.1302 c What is the nearest to -1/4 in 1, 5/22, -6, -1.811, 0.1? 0.1 Which is the nearest to 36? (a) 4 (b) -14 (c) -1/4 (d) -121 (e) -0.3 a What is the nearest to 69 in 2/75, 4, 1/3, 1, 1/2? 4 What is the closest to -1 in -13, 578, -2/11, 4, 8? -2/11 Whi	{ "pile_set_name": "DM Mathematics" }
-7). Let n be 3/27d1. Let j(g) = -2g2. Let r be j(1). Put n, r, 5 in ascending order. r, n, 5 Suppose 12 = -m + 5m. Sort -3, m, -0.2. -3, -0.2, m Let a = 1 - -1. Put 4, 0, a in ascending order. 0, a, 4 Suppose i - 44 = 6i + 3p, 0 = -3i + p - 32. Put 5, i, -3/8 in increasing order. i, -3/8, 5 Suppose 3p - 3 = -5t + 12, -2p - 2t = -6. Suppose p = -n - 5v + 1, -9 = 3n + 4v - v. Let k = -14 + 72/5. Sort 0.1, n, k in ascending order. n, 0.1, k Let p(f) = -f*2 - 3f + 24. Let d be p(4). Suppose 4 = -3m - 5. Sort m, 5, d in increasing order. d, m, 5 Suppose 2a - 3i = -8 - 0, 3a + 5i + 50 = 0. Put a, -4, -1 in descending order. -1, -4, a Suppose 38 = 10r - 2. Put 49, r, -4 in increasing order. -4, r, 49 Let q be 51/24 - 1/8. Put -3, q, 1, 10 in increasing order. -3, 1, q, 10 Let l = 0.2 - 0. Let g = -0.6 + 0.2. Let j = 3 - 1. Sort j, g, l. g, l, j Let f be 11 - 6 - (-2 + 6). Let o = 7 - 7. Put f, o, 3 in descending order. 3, f, o Let m = -0.588 + 0.088. Let i = -1 + 5. Sort m, 2/3, i in decreasing order. i, 2/3, m Suppose -2f + 5d - d = -8, 3d + 6 = -4f. Sort -0.04, f, 0.3 in increasing order. -0.04, f, 0.3 Let t(r) = 2r2 - 2. Let f be t(-2). Suppose -5d + 2d - 15 = 0. Sort d, f, -3 in descending order. f, -3, d Suppose 0 = -6a - 2a + 104. Let w be (-3)/(-5) + (12 - a). Sort w, -2/7, 5/2 in ascending order. w, -2/7, 5/2 Let s(a) = -3a + 27. Let u be s(9). Put u, -1, -3 in descending order. u, -1, -3 Let o = 272.94 + -266. Let c = o + -7. Let f = c - -2.06. Put f, -1, -2/7 in descending order. f, -2/7, -1 Let v(s) = 2s + 12. Let l be v(-8). Suppose 5d = -20 + 30. Sort d, -1, l in descending order. d, -1, l Let n = -0.1 - 0.4. Suppose -h = -5 + 2. Put -4, h, n in ascending order. -4, n, h Let x = -6 + 5.7. Let a = x + 1.3. Let j = 3.12 + 0.88. Put a, j, 2/5 in increasing order. 2/5, a, j Suppose 5l - 55 - 190 = -5r, 0 = 2l + 4r - 104. Suppose 4u + 82 = 5v, u + l = 3v - 3u. Let f = v + -87/5. Put 0.5, -3/5, f in decreasing order. f, 0.5, -3/5 Suppose 5g + 2t + 10 = 5t, -10 = -2t. Sort 4, g, -3 in descending order. 4, g, -3 Let q = 11 + -5. Let x = q - 6.3. Sort -3, 3, x in decreasing order. 3, x, -3 Let u(g) = -g*2 + 3g - 2. Let a be u(3). Let v = 1.2 + -0.4. Let h = v - 1.8. Sort 3, h, a in decreasing order. 3, h, a Let z(d) = d3 - d2 - d - 4. Let n be z(0). Suppose -k + 17 = 3a, -3a - 5k - 13 + 50 = 0. Sort a, n, -5. -5, n, a Let n = 5 - 3. Let c = 1.7 - 2.1. Put n, 1, c in decreasing order. n, 1, c Let i = 2.3 + 9.7. Let m = i - 15. Sort 3/7, m, 5/3 in decreasing order. 5/3, 3/7, m Let t(a) = -a2 + a + 2. Let n be t(-2). Suppose o = 2i + 10, -3i + 0 = 5o - 11. Let d be 0/(i - (-1)/1). Sort 3, d, n. n, d, 3 Let p = 3386930/7 + -483078. Let t = p - 772. Let n = 33/14 + t. Sort -1/4, n, 2/5 in decreasing order. 2/5, -1/4, n Let y(l) = -9l3 - 2l*2 - 2l - 1. Let m be y(-1). Let h be (-36)/m - 2/(-4). Sort -1/3, 1, h in decreasing order. 1, -1/3, h Let z = 1.51 + -1.21. Sort -1.3, -2/9, z, -0.3 in increasing order. -1.3, -0.3, -2/9, z Let q = 5 - 8. Let p(r) = r*2 + 26r - 29. Let d be p(-27). Let f be 02(-1)/4. Put f, q, d in ascending order. q, d, f Let t(w) = w*3 - 6w*2 + 3. Let l be t(6). Put 5, -9, 0, l in decreasing order. 5, l, 0, -9 Let c be 5 + 1 - (-3 + 1 + 0). Put -3, c, 1 in descending order. c, 1, -3 Suppose 4c = 3c. Sort c, -0.5, 0.4 in ascending order. -0.5, c, 0.4 Let q = -2 + -2. Sort 5, q, -2. q, -2, 5 Let g = 0.01 + 1.99. Let o = -41 + 66. Suppose 18j + o = 13j. Sort j, -0.2, g. j, -0.2, g Let u = 4 + -1. Let j(h) = -h3 + 4h*2 - 4. Let b be j(u). Sort b, -4, 0. -4, 0, b Suppose 7i + 5 = -4j + 12i, 3j = 4i - 5. Let l = 76 - 226/3. Sort j, l, 4. l, 4, j Let s = 39 - 66. Let a be (s/30)/(6/(-10)). Sort -4, 3/8, a. -4, 3/8, a Let w = 19 + -65. Sort -3, w, 4 in ascending order. w, -3, 4 Let h = -8 + 4. Let m(g) = 5g2 - 25g + 9. Let j(l) = -l*2 + 6l - 2. Let z(q) = 9j(q) + 2m(q). Let v be z(-4). Sort v, 1/4, h. h, v, 1/4 Let j = 2.1 + -2.2. Sort 2, 4, j in descending order. 4, 2, j Let j(k) = 3k - 1. Let s be j(0). Put 0, s, 1 in decreasing order. 1, 0, s Suppose -4j - 16 = 2n - 6, 4n = -2j - 8. Put -3, n, -2 in decreasing order. n, -2, -3 Let z = -4 - -3.8. Put -5, -4, z in increasing order. -5, -4, z Let x = -7 - -4. Let t = x + 2. Sort 1, 3, t in descending order. 3, 1, t Let c = 799/10 + -80. Sort 2/7, -3, c, -3/4 in ascending order. -3, -3/4, c, 2/7 Let r = 5.4 + -0.4. Let o = 5 - r. Let g = -2 + -3. Sort g, o, 4 in increasing order. g, o, 4 Let u(s) = s + 3. Let j be u(4). Let o = j + -11. Suppose 0 = -5q - 2h - 15, -4q - 2 = 4h + 10. Sort q, o, -5. -5, o, q Suppose -5x + 2 = -18. Let z = -5 + -10. Let t = z - -16. Put -1, t, x in descending order. x, t, -1 Suppose 2s - 6p + 20 = -p, -p + 4 = -4s. Sort s, 2/7, -3/4, -3/2 in decreasing order. 2/7, s, -3/4, -3/2 Suppose d = -2w + 6 - 1, -w = -4. Let b be 1/d - (-6)/(-9). Let i = b - -2. Put 3, i, -2 in ascending order. -2, i, 3 Suppose -95 = -9r - 77. Let l = 0.4 + 0.1. Sort l, r, -1/3 in ascending order. -1/3, l, r Let o(a) = -2a + 6. Let c be o(5). Let n = 0 + c. Suppose -8 = -0u - 4u. Put n, u, -5 in decreasing order. u, n, -5 Let x = -1/3 - -2/3. Sort 1, x, 2 in descending order. 2, 1, x Let j = -10 - -5. Put j, -2, 2 in decreasing order. 2, -2, j Suppose 2 = -c + 3w - w, 3c - 4w = -12. Let q = c + 3. Put q, 2, -4 in increasing order. q, -4, 2 Let n = 108.89 + -100.1. Let x = -0.21 - n. Let a = x - -12. Sort a, 0.3, -0.2 in ascending order. -0.2, 0.3, a Let o = 5 + -5. Let c be 1-2(-5)/2. Suppose -2l - 6 = -cl. Put l, -1/4, o in ascending order. -1/4, o, l Suppose -5h + 4h = -22. Suppose 2o = -16 + h. Sort 5, -5, o. -5, o, 5 Suppose 24 = 5f + 4g - g, 0 = -5f - 5g + 30. Suppose 3l + l - 2d = 0, 4d + 10 = fl. Let s be (-1 + 0)/(1 - 0). Sort l, 4, s in increasing order. l, s, 4 Let c be (-5 - -2) + -1 + -1. Let o(x) = x - 2. Let h be o(3). Sort -4, c, h in decreasing order. h, -4, c Suppose 0 = -8s + 18s - 10. Suppose 0 = 5v - v. Suppose -2o + 4 = 6b - 3b, v = -3o - 12. Sort b, s, -1 in descending order. b, s, -1 Let d(t) = -t3 + 2t*2 + 3t - 3. Let o be d(2). Let i = 2.4 + -2.1. Sort 0.5, o, i in increasing order. i, 0.5, o Let y = 34 + -10. Let d = y + -21. Sort d, -1/3, 2/3. -1/3, 2/3, d Let b(q) = -q*3 + 5q*2 + 2q - 7. Let o be b(5). Sort o, 12, 2. 2, o, 12 Let b(a) = a - 2. Let t be b(7). Suppose -2k = 4p + 2k - 4, -tp - 2k = -5. Put p, -2, 5 in increasing order. -2, p, 5 Suppose -2u = -3q - 8, -3q - 3 - 1 = -u. Put -4, q, -7 in descending order. q, -4, -7 Suppose 2s = 0, -2b + 2s - 1 + 5 = 0. Let u be 8/6(-1 - b). Sort u, 2, 4. u, 2, 4 Let w be 12/(-3 + 0) - 16/(-3). Sort w, 3, -2, -3 in ascending order. -3, -2, w, 3 Let s = -5 + 5.7. Let a = -0.39 + -0.51. Let b = a + s. Sort -3/4, 5, b in ascending order. -3/4, b, 5 Let n(a) be the second derivative of a4/12 - a. Let k be n(1). Let j be ((-2)/(-11))/(0 + k). Sort 2, 1, j in ascending order. j, 1, 2 Suppose -15 + 2 = -p. Let f = p + -20. Let m = 3 + f. Put 1, 5, m in descending order. 5, 1, m Let b(l) = -l2 - 4l + 8. Let t be b(-6). Put 5, -2, t in increasing order. t, -2, 5 Let r = -3 - -3. Suppose r = 3p + p. Let h be (-1)/(1/(-5) - p). Sort 3, 2, h in decreasing order. h, 3, 2 Let c(s) = -s + 8. Let v be c(-11). Let t = -16 + v. Let b = -6 + 8. Put -2, t, b in increasing order. -2, b, t Let o be (0 + 2)-1 - 105/(-55). Sort 1/8, o, 0.4. o, 1/8, 0.4 Suppose 21s = 16s - 5. Let r = 4 + -6. Sort s, r, 1 in ascending order. r, s, 1 Suppose 3s - 4i = s + 12, 5s - i - 12 = 0. Suppose -h + sh + 4f = -1, -5 = 5f. Sort -1, h, 1. -1, 1, h Let i = 0.7 + -0.2. Let b = i + -0.5. Let j = -1711/7 + 245. Sort b, 4, j in ascending order. b, j, 4 Suppose -s - 3 + 2 = 0. Let c be 16/28s + 1. Sort c, 7, 0 in decreasing order. 7, c, 0 Suppose -21l = -20l + 3. Put l, 13, 3 in ascending order. l, 3, 13 Suppose 53 + 4 = 3l. Let x = -17 + l. Let g = -0.4 - -0.7. Sort 0.4, g, x. g, 0.4, x Let b be (6/27)/(1/(-6)). Sort -0.07, 0, b in decreasing order. 0, -0.07, b Let o(a) = -a3 + 7a*2 - 5a - 4. Let j be o(6). Suppose 34l = 30l - 20. Sort l, j, -3 in decreasing order. j,	{ "pile_set_name": "DM Mathematics" }
+ 4h - 3. Let u(n) = 14n*4 + 4n*3 - 14n*2 - 4n + 4. Let r(v) = 3u(v) + 4w(v). Factor r(i). -2i(i - 1)(i + 1)(5i + 2) Let t(l) be the third derivative of -l5/90 + 2l*4/9 - 4l*3/3 - 42l2. Suppose t(z) = 0. What is z? 2, 6 Let w(a) be the third derivative of a7/2520 - a6/540 + a5/360 - a*3/2 + 2a2. Let q(f) be the first derivative of w(f). Let q(c) = 0. What is c? 0, 1 Let t(h) be the second derivative of -h8/5040 + h7/1260 - h5/180 + h4/72 - h3/2 - 7h. Let b(q) be the second derivative of t(q). Factor b(l). -(l - 1)3(l + 1)/3 Suppose -6g = -13 - 5. Find b such that -2/3b*g + 2/3b - 2/3b2 + 2/3 = 0. -1, 1 Let v(x) be the third derivative of -3x*7/385 - 7x*6/55 - 83x*5/165 + 35x*4/33 - 25x*3/33 - 36x*2. Factor v(r). -2(r + 5)*2(3r - 1)2/11 Let x = -476 + 1907/4. Solve 3/8w*2 + xw*4 - 9/8w*3 + 0w + 0 = 0 for w. 0, 1/2, 1 Let c(o) = 3 + 3o3 - o2 - 5 + o - 3o. Suppose 4q = -0q + 28. Let g(y) = -10y3 + 4y*2 + 7y + 7. Let m(d) = qc(d) + 2g(d). Factor m(x). x*2(x + 1) Let g = 11/12 + -2/3. What is w in 0 - gw3 - 1/2w*2 - 1/4w = 0? -1, 0 Let q(l) be the first derivative of -l5/120 + l4/12 - l*3/3 - 3l2/2 - 3. Let d(a) be the second derivative of q(a). Factor d(f). -(f - 2)2/2 Let g(f) be the third derivative of -f8/112 + f6/20 - f*4/8 - 9f*2. Factor g(h). -3h(h - 1)2(h + 1)*2 Suppose f - 3f + 4g = 0, 0 = 4g - 16. Let r be -4 - (-4)/f11. Factor 1/2w*2 - rw + 1/2w4 - 1 + 3/2w*3. (w - 1)(w + 1)*2(w + 2)/2 Let w(v) be the second derivative of v4/4 - v3/2 - 3v2 + 10v. Factor w(u). 3(u - 2)(u + 1) Let r(n) = 4n - 9. Let h be r(4). Find t, given that 2 - 14t - 3t3 + 4 + 24t*2 - ht - 6t3 = 0. 2/3, 1 Let -64f*4 - 12f*2 + 10f*3 + 8f - 4f2 + 62f*4 = 0. Calculate f. 0, 1, 2 Let v(d) be the second derivative of 4d7/105 - d6/75 - 2d5/25 + d4/30 + 11d. Find f, given that v(f) = 0. -1, 0, 1/4, 1 Let g(i) be the first derivative of -i7/14 + i6/2 - 27i5/20 + 7i4/4 - i3 + 6i + 3. Let z(c) be the first derivative of g(c). Factor z(k). -3k(k - 2)(k - 1)*3 Factor 0x + 3x2 - 4 - 2x - x*3 + 4. -x(x - 2)(x - 1) Factor 0 - 4/9s + 2/9s3 - 2/9s*2. 2s(s - 2)(s + 1)/9 Let b(i) be the third derivative of 1/28i8 + 0 - 3/40i*6 + 1/20i*5 - 3i*2 + 0i + 0i7 + 0i*4 + 0i*3. Factor b(m). 3m*2(m + 1)(2m - 1)2 Let p(j) be the first derivative of j6/15 - 2j4/3 - 5j + 3. Let l(u) be the first derivative of p(u). Factor l(b). 2b2(b - 2)(b + 2) Let t(b) be the third derivative of -b5/12 + 5b*4/24 + 5b3/3 - b2 + 5. Factor t(w). -5(w - 2)(w + 1) What is i in 6/7 + 111/7i2 - 144/7i*4 - 24/7i*3 + 51/7i = 0? -2/3, -1/4, 1 Let z(l) be the third derivative of -1/630l7 + 0 + 0l + 0l6 + 1/60l*5 - 1/36l*4 + 0l*3 + 2l*2. Factor z(f). -f(f - 1)*2(f + 2)/3 Let r(y) = 35y - 628. Let f be r(18). Factor -4/5u*f + 0 + 3/5u*4 + 0u*3 + 0u + 1/5u5. u2(u - 1)(u + 2)2/5 Let a(o) = 3o*5 + 81o*4 + 414o*3 - 1767o*2 + 1926o - 684. Let i(f) = f*2 + f + 1. Let g(n) = a(n) + 9i(n). Find y, given that g(y) = 0. -15, 1 Find o, given that -4/5o + 2/5o*2 + 0 = 0. 0, 2 Suppose -3l + 5t + 25 = 0, -2t + 2 = -0. Factor -4 - 4p2 + p + 2 + lp*2 - 5p. 2(p - 1)(3p + 1) Let h(n) be the first derivative of 0n + 0n2 - 1/5n*3 + 3/20n*4 - 5. Solve h(z) = 0. 0, 1 Let o(f) = 16f*3 - 24f*2 - 9f - 7. Let r(y) = 8y3 - 12y*2 - 5y - 3. Let v(i) = -3o(i) + 7r(i). Factor v(p). 4p(p - 2)(2p + 1) Let i(c) be the third derivative of -1/140c5 - 1/280c*6 + 0 + 0c + 0c3 + 0c*4 + 2c*2. Suppose i(d) = 0. What is d? -1, 0 Let p be -2 + 1 - -3 - -1. Determine c so that 0c + 2 + 2cp - 4c + 6c3 - 6c*2 + 0c + 8c4 = 0. -1, 1/2 Let j(t) be the first derivative of 1/26t*4 + 0t - 2 + 1/13t2 - 4/39t*3. Factor j(m). 2m(m - 1)2/13 Let y = 9495 + -47659/5. Let i = 37 + y. Factor -1/5x + 0 - ix2. -x(x + 1)/5 Let c = -117 + 117. Factor 0n - 8/9n*5 + 0n*2 - 2/9n*3 + c - 10/9n*4. -2n*3(n + 1)(4n + 1)/9 Suppose 0 = j + 6 - 9. Let s(d) be the first derivative of 0d + 0d*2 + 3 - 1/12dj. Factor s(n). -n2/4 Let j = 46 - 33. Suppose -ju = -10u. Find i, given that -1/2i3 + ui*2 + 0 + 0i = 0. 0 Let u(l) be the second derivative of -1/6l4 + 1/10l*6 + 1/2l*3 - 1/2l*2 + 0 + l - 1/10l*5 - 1/42l7. Factor u(n). -(n - 1)4(n + 1) Suppose -11v*3 + 6v*2 + 12v - 2v4 + 5v4 - v3 - 9 = 0. Calculate v. -1, 1, 3 Let i(p) be the first derivative of p*4/2 - 4p*3 + 12p*2 - 16p - 5. What is w in i(w) = 0? 2 Let c(x) be the third derivative of -x6/60 - x5/30 + x*4/6 - 4x*2 - 1. Find r such that c(r) = 0. -2, 0, 1 Suppose 0 = 5l - 5q + 10, -4l - 4q = -9q + 12. Suppose -lx + 20 = 3x. Let -3u2 - 5u*4 + u + u - 3u - 3u3 + xu4 = 0. What is u? -1, 0 Let l(f) = f3 + 6f2 + 4f - 2. Let p be l(-5). Let c(h) = -h*3 + 2h*2 + 4h. Let g be c(p). Determine r so that 2/7r + 0 + 4/7r*2 + 2/7r*g = 0. -1, 0 Suppose -2v = -3g - 6, -g - 5v = -4g - 15. Let r(q) be the third derivative of -1/24q*3 + g + 0q + 0q4 + 1/240q5 + q2. Solve r(n) = 0. -1, 1 What is a in 4a4 - 4a*2 - 2a - 2a4 + 2a*5 + 2a*4 = 0? -1, 0, 1 Let q(i) be the first derivative of 4i*5/5 - 3i*4 + 4i*3 - 2i*2 - 5. Find v such that q(v) = 0. 0, 1 Suppose -i + 2m + 7 = -0i, -5i - 2m + 23 = 0. Suppose -z + i - 2 = 0. Factor -1/2k + 0 + 1/2kz + k4 - k2. k(k - 1)(k + 1)(2k + 1)/2 Suppose 2d - 3v - 30 = 0, -2d + 26 = v - 20. Suppose -3a = -4j + d, -3j - 3a - 3 = -j. Factor u*4 - 1/2u5 + 0 - u2 + 0uj + 1/2u. -u(u - 1)3(u + 1)/2 Let w(x) = 5x2 - x + 4. Let g(z) = 4z*2 - z + 3. Let u(o) = 4g(o) - 3w(o). Factor u(q). q(q - 1) Let n(a) = a*3 + 7a*2 + 4. Let p be n(-7). Suppose -4w + 12 = -p. Determine i, given that -i*4 + wi*4 + 2i*3 - 5i*3 = 0. 0, 1 Let v(y) be the first derivative of -4y*3/15 - 4y*2 - 20y + 8. Find r such that v(r) = 0. -5 Suppose -3x = 1 - 7. Suppose -m = xm - 9. Solve a*m + 0 + 1/2a + 3/2a2 = 0 for a. -1, -1/2, 0 Let h(q) be the first derivative of q8/4200 + q7/525 + q6/180 + q5/150 - q3 - 3. Let b(z) be the third derivative of h(z). Factor b(k). 2k(k + 1)2(k + 2)/5 Let m(t) = -t + 8. Suppose 4w + 7 = 5w - r, 0 = -2w - 3r - 1. Let x be m(w). Factor -4 + 3kx + 3 - 4k*4 + 2k2. -(k - 1)2(k + 1)2 Factor 8d - 60d3 - 30d*2 - 62d - 21d + 57d*3. -3d(d + 5)2 Let b(j) be the first derivative of -j4/4 - 2j3/3 + j2/2 + 2j + 7. Find o, given that b(o) = 0. -2, -1, 1 Let i(f) be the second derivative of f6/2 + f5/4 - 25f*4/12 - 5f*3/6 + 5f*2 + 9f. Find r such that i(r) = 0. -1, 2/3, 1 Solve 2/5r2 - 8/5 - 1/5r*3 + 4/5r = 0. -2, 2 Let i(f) be the second derivative of -2f6/15 + 2f5/5 + f4/3 - 4f3/3 - 3f. Factor i(p). -4p(p - 2)(p - 1)(p + 1) Factor -159x2 + 8 - 160x*2 + 309x*2 + 3x*3 + 4x. (x - 2)*2(3x + 2) Let k(l) be the first derivative of -2l*5/65 + 2l*4/13 + 10l*3/39 + 8. Factor k(c). -2c*2(c - 5)(c + 1)/13 Let c(d) be the first derivative of -d5/90 + d4/54 + d3/27 - d2/9 - 2d - 3. Let g(y) be the first derivative of c(y). Determine x so that g(x) = 0. -1, 1 Let y = -6 + 7. Let b = 1 + y. Factor -2 - 2 + r*b + 4 - 2r. r(r - 2) Let x(r) be the first derivative of 3/8r*4 + 0r*3 + 3 + 0r*2 + 0r. Factor x(n). 3n3/2 Let b = -15 - -18. Let o(v) be the second derivative of 0 + 2/15v*5 + 2v - 7/18v4 + 2/9v*b + 1/3v*2. Suppose o(q) = 0. What is q? -1/4, 1 Let i(a) be the third derivative of 2a*7/105 + 2a*6/5 + 18a*5/5 + 18a*4 + 54a*3 - 3a*2. Determine o so that i(o) = 0. -3 Let h(g) be the second derivative of -2g*6/15 - 9g*5/5 - g. Factor h(m). -4m*3(m + 9) Let k(j) be the second derivative of 2/9j4 - 4j - 1/30j5 + 0j*2 - 4/9j*3 + 0. Suppose k(i) = 0. Calculate i. 0, 2 Let m = -6417146/7 - -918408. Let u = 1676 - m. Solve 4/7j - 8/7j4 - 10/7j*2 - uj*3 + 0 = 0. -2, -1, 0, 1/4 Factor 0k +	{ "pile_set_name": "DM Mathematics" }
1 Let c = -469 - -568. Calculate the remainder when c is divided by 10. 9 Let m(q) be the third derivative of 0 + 2q2 + 3/2q*3 + 1/60q*5 - 5/24q*4 + 0q. Calculate the remainder when m(6) is divided by 4. 3 Let a = 649 + -479. What is the remainder when a is divided by 31? 15 Suppose -5g - 145 + 347 = 3r, -r = -2g - 71. Suppose -51 + 3 = -2o. Calculate the remainder when r is divided by o. 21 Let k(b) = 6b - 300. Calculate the remainder when k(53) is divided by 1. 0 Calculate the remainder when 233 is divided by (-57)/95 + 1192/20. 56 Suppose -4h = -2s - 2, 3s + 2h = 8s - 11. Suppose 6w - 4w - 4 = 0. Suppose sq - 70 = -wq. What is the remainder when 55 is divided by q? 13 Suppose -7a + 21 = -21. Calculate the remainder when 14 is divided by a. 2 Let l(p) be the second derivative of -p3 + 21p*2/2 + p. Let o be ((-7)/(-2))/(2/(-4)). What is the remainder when l(o) is divided by 11? 8 Let m = 0 + 1. Suppose -7n - 20 = -17n. What is the remainder when m/(0 + 1/7) is divided by n? 1 Let g(l) = -l3 + 5l*2 + 6l - 7. Calculate the remainder when (1/((-9)/33))/(1/(-12)) is divided by g(5). 21 Let z(p) = p3 + p2 + p + 99. What is the remainder when z(0) is divided by 43? 13 What is the remainder when -4 + (-6616)/(-24) - (-12)/(-18) is divided by 68? 67 Let u be (22 - 1)4/(-12). What is the remainder when 3 + u + 21 + 1 is divided by 5? 3 Let x be (0 - 6-8)(-6)/(-9). Suppose 0 = g + 25 - x. Calculate the remainder when 89 is divided by g. 5 Let r = 80 - 74. Suppose -rf + 20 = -2f. Calculate the remainder when 8 is divided by f. 3 Suppose -6s + 1479 = 11s. What is the remainder when s is divided by 24? 15 Suppose 26z - 8722 = 12z. Calculate the remainder when z is divided by 30. 23 Let u = 40 + -69. Calculate the remainder when (6 - u) + 4 + 0 is divided by 14. 11 Let k(p) = -3 - 10p*2 - 3 - 2 + 11p2. What is the remainder when 111 is divided by k(4)? 7 Let t(f) = f3 + 5f2 - 17f + 1. What is the remainder when 31 is divided by t(-7)? 9 Calculate the remainder when 323 is divided by 18/(-9)1-9. 17 Suppose d - 6 = -2d. Suppose -3j + 76 + 45 = l, dj = l - 101. Calculate the remainder when l is divided by 22. 21 Suppose -255 = -66x + 49x. Calculate the remainder when 297 is divided by x. 12 Suppose -3m + 468 = 6m. Calculate the remainder when 86 is divided by m. 34 Let g(i) = 5i - 157. Calculate the remainder when 41 is divided by g(36). 18 Let d(k) = -k*3 + 4k*2 + 3k - 2. Let i be d(4). Suppose il = 14l - 120. Suppose -g + 22 = -l. Calculate the remainder when g is divided by 18. 16 Let v(y) = -y3 - y2 + 7y - 2. Calculate the remainder when v(-5) is divided by 32. 31 Let z(c) = -c3 + 27c*2 - 27c + 52. Suppose 529 = 3y + 154. What is the remainder when y is divided by z(26)? 21 Suppose l - 3o - 137 = 0, -3o = 14l - 16l + 265. Calculate the remainder when l is divided by 35. 23 Suppose 5 = 2j - 1. Suppose -5t = -25, -4t - 37 = -jq - 9. Suppose -2i + 100 = -4a, a - 45 = -i - 1. Calculate the remainder when i is divided by q. 14 Let x = 96 - -16. Calculate the remainder when x is divided by 36. 4 Let t(w) = 1. Let x(z) = 11z - 13. Let h(f) = -4t(f) + x(f). Calculate the remainder when h(6) is divided by 17. 15 Let t = 151 - 94. Let a = t + -9. Calculate the remainder when a is divided by ((-2142)/196 - -10)-14. 9 Let s(d) = d*2 - 5d - 6. Let p(c) = c3 + c2 - 4c - 3. Let k be p(-4). Let b be (14/5)/((-14)/k). What is the remainder when 23 is divided by s(b)? 7 Suppose 0 = 60r + 34 - 874. Calculate the remainder when 2015 is divided by r. 13 Suppose 0 = -g + 5q + 31, -g - 3q = -q - 45. Suppose 4s - 78 = 2k, g = 5s + 4k - 24. Calculate the remainder when 66 is divided by s. 15 Suppose 4s - 5s = -14. Suppose 2m + 5g + 11 = 5m, 4m - 3g = 33. Suppose 0 = -3l + m - 0. What is the remainder when s is divided by l? 2 Suppose b = -0b - 56. Let i = b + 78. Calculate the remainder when 43 is divided by i. 21 Let k(a) = -a3 + 21a*2 + 2a - 18. What is the remainder when 141 is divided by k(21)? 21 Suppose 7a + 763 = 14a. Calculate the remainder when a is divided by 29. 22 Suppose -c - 810 = -3c. What is the remainder when c/10 + (2 - 1)/(-2) is divided by (-21)/24/(-3)? 12 Suppose -2a + 3y + 63 = 0, a + 4y - 8y - 44 = 0. Let t be 3/((-1)/(2/(-2))). Suppose -tl = -108 - 33. Calculate the remainder when l is divided by a. 23 Let a = 14 - -1. Let f(n) = n3 - 2n2 - 9. Let y be f(0). Let z = y - -15. What is the remainder when a is divided by z? 3 Let i(b) = b2 + 2b + 16. Calculate the remainder when i(-8) is divided by 13. 12 Let m = 34 - 30. Suppose mn = 8n - 160. Calculate the remainder when 317 is divided by n. 37 Let q(l) = 37l*2 + l. Let g be q(1). Let b = g + -26. Calculate the remainder when (-5 - -2)-1 + 66 is divided by b. 9 Let y = -26 - 1. What is the remainder when 19 is divided by 2/9-1 - 303/y? 8 Let v be 596/3 + 1/3. Suppose 4h = l + v, -5l + 144 - 404 = -5h. Calculate the remainder when (84/h)/((-2)/(-42)) is divided by 13. 10 Suppose 14n = 19n - 120. Calculate the remainder when 58 is divided by n. 10 Suppose -32 - 33 = -5y + 2x, -3y + 13 = 4x. Calculate the remainder when 29 is divided by y. 7 Let w = -20 - -33. Suppose -150o = -147o + 12. Calculate the remainder when w is divided by o/12 + (16/(-3))/(-1). 3 Let v(z) = 2z + 387. Calculate the remainder when v(19) is divided by 107. 104 Let z(i) = 14i - 207. Calculate the remainder when z(25) is divided by 24. 23 Let a(d) be the first derivative of d*4/2 - 4d3/3 - d2/2 - 34. Suppose -2r = -3r + 3. Calculate the remainder when a(r) is divided by 4. 3 Suppose -4092 = -90q + 24q. Calculate the remainder when 367 is divided by q. 57 Suppose -31y + 77y = 4830. What is the remainder when y is divided by 15? 0 Suppose -3u = -2c + 38, 3c - 92 = -c + 2u. What is the remainder when (((-6)/(-5))/(-2))/(-3 - (-5497)/1840) is divided by c? 23 Suppose -8z + 9z - 3r - 30 = 0, 2r = 5z - 163. What is the remainder when 132 is divided by z? 0 Calculate the remainder when 158 is divided by 150/(-5)12/(-18). 18 What is the remainder when 116 is divided by 18/1 + 5(7 + -8)? 12 Suppose -3a + 7a - 52 = -d, -2d + 152 = -4a. What is the remainder when d is divided by 30/(2/1) - (9 + -12)? 14 Suppose 0 = 5z + 2a + 3a - 295, -3z - 2a + 180 = 0. Suppose 2 - z = -6s. What is the remainder when s is divided by 4? 2 Let f = 270 - -231. Calculate the remainder when f is divided by 14. 11 Suppose -19 + 6 = -t. Suppose 3o = -4m + 40, 3 = -4o - t. Calculate the remainder when 23 is divided by m. 10 What is the remainder when (-414)/34/(-4) is divided by 16? 10 Let q = -9 + 17. Suppose 0 = 17l - 19l + 90. What is the remainder when l is divided by q? 5 Suppose 5d + 2q + 100 = 0, -3q - 47 = d - 8q. Let j = d + 24. Suppose -jo + 65 = -63. What is the remainder when o is divided by 11? 9 Calculate the remainder when 230 is divided by 41 - 35 - (-2 - -4 - 58). 44 Let x be (-6)/14 + (-51)/(-21) + -6. Let p(r) = -r*3 - 2r*2 + r + 2. Let z be p(-3). What is the remainder when 11 is divided by -6x/z2? 5 Let m be 2 - 9/((-36)/8). What is the remainder when ((-1788)/9)/(-4) + m/(-6) is divided by 26? 23 Let t = 15 + -32. Let d = 22 + t. Calculate the remainder when 19 is divided by d. 4 Let m = 847 + -813. Calculate the remainder when 62 is divided by m. 28 Suppose 4o - 108 = -3t, 4o + 5t - 110 - 6 = 0. Suppose 20 = 188w - 184w. What is the remainder when o is divided by w? 4 Let t = -23 + 97. Suppose 2i = t + 82. Suppose 4r = -3u + i, u - 40 = -r - r. Calculate the remainder when r is divided by 11. 10 Let f = -361 - -390. What is the remainder when 130 is divided by f? 14 Let j = 3 - 2. What is the remainder when 132 is divided by (9j)/((-7)/(-21))? 24 Let z(h) = h3 + 5h*2 - 2h. Let k be z(-5). Let q(v) = 5v - 1. Let t = -319 + 332. What is the remainder when q(k) is divided by t? 10 Calculate the remainder when 67 is divided by (-84 + 39)/(3/(-2) + 0). 7 Suppose 0 = -8h + 5h + 12. Suppose hz - 2z = 24. What is the remainder when 22 is divided by z? 10 Let b be ((-4)/2 - -3)-3. Let v(u) = 4u*2 + u. Let o = 4028 + -4021	{ "pile_set_name": "DM Mathematics" }
uming r is positive. r*(30/7) Simplify zzz(-6)z*(3/7)(zz/(zz(-2/5)))/(z/(z/z7)) assuming z is positive. z*(-321/35) Simplify (ff*1/f)/(ffff*(-3))(f(2/7))(-36) assuming f is positive. f(-65/7) Simplify k(-1)k(-1/3)(k1)(-20/7) assuming k is positive. k*(-88/21) Simplify (f(f/(f*6f))/ff/(ff/((f*(-5)ff)/f)))/(f(2/7)/f)(-18) assuming f is positive. f(-167/7) Simplify f/(f/((f(4/13)/f)/f))f/f(-10) assuming f is positive. f(121/13) Simplify ((ff(2/7))(15/11))(-16/9) assuming f is positive. f(-240/77) Simplify ((k/(k/(k7k))k)/k)/(kk*(-1/3))k0/k0 assuming k is positive. k*(22/3) Simplify (bb9)/((b/b(-7))/b)(b1)50 assuming b is positive. b53 Simplify (gg/((gg(-2)gg)/gg)g)(-2/57)(g*(2/23)g)/(ggg/g(-9)) assuming g is positive. g(-14399/1311) Simplify (cc(-34))10 assuming c is positive. c(-330) Simplify (((((y/(y/(yyy/(yy*(-2/35))yy)y))/y)/y)/yy)/yy)/(y(y(4/25)/y)/y) assuming y is positive. y(332/175) Simplify (j6/jjj/j(-1/3))/(j5j(-2/3)) assuming j is positive. j3 Simplify j*(-25)/jj/j30 assuming j is positive. j(-55) Simplify (o(-6/5))(-39) assuming o is positive. o*(234/5) Simplify ooo(35/3)ooo(1/6) assuming o is positive. o(95/6) Simplify (((qq((qq/q3q)/q)/q)/q)/q)/(q(qq*(-9)/qq)/q) assuming q is positive. q6 Simplify (f(2/11)/(f*(-3/4)/f))/((fff(-3/8))/((ff(-1/8)/f)/f)) assuming f is positive. f(-9/11) Simplify (z18/z)/z(2/45) assuming z is positive. z(763/45) Simplify (y(1/3)/(y(yy9)/y))15 assuming y is positive. y(-145) Simplify o(-12)o(-7/4) assuming o is positive. o(-55/4) Simplify (d/(d/d(-4))dd/d7)(-45) assuming d is positive. d405 Simplify ((q(2/9)q)(11/3))(-3) assuming q is positive. q*(-121/9) Simplify uu*(3/5)uu/(u/(u/(uu*(-7/4)u))) assuming u is positive. u*(67/20) Simplify ((k/((kk*(-1))/k)k)(1/5))(-4/5) assuming k is positive. k*(-12/25) Simplify (tt*(1/9)t(-4)/t)/(t(-1/2)t/t(-4)) assuming t is positive. t(-151/18) Simplify (z((z(z/(z(-6/5)/z))/zz)/z)/z)/zz7 assuming z is positive. z(46/5) Simplify (a(-2)/a)/aaa(-1/12) assuming a is positive. a(-37/12) Simplify (o/o9oo1o)44 assuming o is positive. o(-220) Simplify m25/(m/m18) assuming m is positive. m42 Simplify (a(-3)/aa/a0)/(a(aa/((a(1/2)/a)/a))/a)19 assuming a is positive. a(-139/2) Simplify ((u/(u/u8))/((u(u*(-5/2)u)/u)/u))/(u*(2/25)u(-2)) assuming u is positive. u(621/50) Simplify (n/(nn/((n/(n/n(-1)))/nn)))*(2/53)(n(-2/5))(1/34) assuming n is positive. n*(-393/4505) Simplify ((((ff*21/f)/f)/ff)/ff)/fff(-26) assuming f is positive. f(-6) Simplify (w/(w(-3/4)w))2 assuming w is positive. w(3/2) Simplify s(-3/4)/s(-47) assuming s is positive. s(185/4) Simplify (u/u(-5))27 assuming u is positive. u162 Simplify (p/p(-1))(-49) assuming p is positive. p(-98) Simplify (v/v2)(2/21) assuming v is positive. v(-2/21) Simplify (q/(((q/q*(-2/7))/q)/q)q)/((q(q(-8)/q)/qq)/q)((q(-1)q)/q)22 assuming q is positive. q(-72/7) Simplify z(-5)/(z(-11)z) assuming z is positive. z5 Simplify g/g(2/13)g13 assuming g is positive. g(180/13) Simplify (m/(mm(-16)))(-44) assuming m is positive. m(-704) Simplify (v/(vvvv(v/v(-9/2))/v))/(vv/v*(-24)v) assuming v is positive. v*(-69/2) Simplify (zz*18)/(zz/z1) assuming z is positive. z18 Simplify j/j*(-3/7)jj(j/j(-1))/j assuming j is positive. j(31/7) Simplify (x/(xxx*(2/3)x))(7/2)/((x(-1/4)x)/x)(-2/5) assuming x is positive. x(-283/30) Simplify (b(4/7)/bb(-3/10))(-18/5) assuming b is positive. b(459/175) Simplify (m(1/4))9/((m6/m)/mm6) assuming m is positive. m(-31/4) Simplify (i(-1/3)/i((i((i/i0)/i)/i)/i)/i)/(ii(-1/4))(-11) assuming i is positive. i*(59/12) Simplify (ll*(1/2)(l*(-2/5)l)/lll)/(l*(-2/9)ll/(l(l/l*2l)/l)) assuming l is positive. l(119/90) Simplify (b(-1/5)/b)37 assuming b is positive. b(-222/5) Simplify (v/v*(1/16)v)/vv(2/95) assuming v is positive. v(1457/1520) Simplify w(-24/7)/((w(-32)/w)/w) assuming w is positive. w(214/7) Simplify (d(-1/7))(-1/10) assuming d is positive. d(1/70) Simplify (a/(a/((a(-4)/aa)/a)))(-39) assuming a is positive. a195 Simplify ww/(ww/((w/((ww(9/8))/w))/w))w(w/(w0/w))/ww assuming w is positive. w(15/8) Simplify (a0a)/(a/(aa*(-2/9)a))a/(aa*(-1))a(-7) assuming a is positive. a(-38/9) Simplify (u/(u/(uu/((u(-12)u)/uu)u)))/(u*(9/2)u) assuming u is positive. u(17/2) Simplify b24/bb(4/15)b assuming b is positive. b(364/15) Simplify i/(i(-23)/i)(ii/i(2/39))/i assuming i is positive. i(1012/39) Simplify (o1/(o/o(-2/7)))(2/127) assuming o is positive. o(-4/889) Simplify (zz20/zz)(-2/11) assuming z is positive. z(-42/11) Simplify (yy(2/5))(-26)y(-2/19)/(y(-1)/y) assuming y is positive. y(-3278/95) Simplify ((z(-2/13)z)/z(3/13))(-5) assuming z is positive. z(-40/13) Simplify m(mm(-17/2)m)/mm(-29)m assuming m is positive. m*(-69/2) Simplify (c/(cc(cc*(-9)c)/c)(cc*(-6)cc)/cc)0 assuming c is positive. 1 Simplify (w(2/7))(1/5)/((w/w(-4/7)w)/w1) assuming w is positive. w(-53/35) Simplify d(2/5)d*(-1)/ddd/d8dd(2/11)/d assuming d is positive. d(-408/55) Simplify ((oo(-1/2))/o)(2/153)o(-3/4)/(((oo/(o/(o*0/ooo)))/o)/o) assuming o is positive. o(-463/612) Simplify z(2/37)z/z8 assuming z is positive. z(-257/37) Simplify (l*(1/4)l)/(l/(l*(-4/7)/l)l) assuming l is positive. l(-65/28) Simplify (x(2/27)/(x*(4/9)xx))(-31) assuming x is positive. x(1984/27) Simplify ll/(((l*(2/19)/l)/lll)/l)l15/l assuming l is positive. l(321/19) Simplify (l/(llll(-1/4)ll))(-1/36) assuming l is positive. l(5/48) Simplify j(-24)/(j/(jjj(1/17))j) assuming j is positive. j(-407/17) Simplify x(-15)(x/(x/(x22/x)))/xx assuming x is positive. x6 Simplify l(1/8)/(l(ll*(-1/4)ll)/l)(ll/l(3/2))/l(-3) assuming l is positive. l(7/8) Simplify (j(1/16)j)/j(-5) assuming j is positive. j(97/16) Simplify p*(-1/4)/((pppppp*(-7)ppp)/p) assuming p is positive. p(-1/4) Simplify m(-12/5)/m13 assuming m is positive. m(-77/5) Simplify (h1)(-8/7)(h/(h(1/3)hh))(-44) assuming h is positive. h(1208/21) Simplify (((ddd6)/d)/d)/d(-2)(dd/(((ddd(-2/7))/d)/d))(-5/2) assuming d is positive. d(16/7) Simplify (c(9/4))(-46) assuming c is positive. c(-207/2) Simplify (r(6/7)rr)4 assuming r is positive. r(80/7) Simplify ((r(-1)/r)/r)(-30)/(rr*(-1)(r/(r/(rr(1/7)rr)r)r)/r) assuming r is positive. r(615/7) Simplify zz*(6/7)z/(z/(z*(-1/9)/zz)) assuming z is positive. z(110/63) Simplify ((c/(c/(c(-6/23)/cc)))/c)/c(14/9) assuming c is positive. c(-583/207) Simplify ((p(1/2))(3/5))21 assuming p is positive. p(63/10) Simplify i(5/6)iii/i*3i*(-1)/(i(i/i*(-5/6)i)/ii) assuming i is positive. i(-4) Simplify (v(v*9vv)/vv)/(v/(vv/(vv(10/9)))) assuming v is positive. v(98/9) Simplify aaa/(a/a*19)a(-35) assuming a is positive. a(-14) Simplify ((c1/c)(-2/9))(-44) assuming c is positive. 1 Simplify (y(-2/7)/y(-2/7))/(((y(-7)/y)/y)/(yy(-6)y)) assuming y is positive. y*5 Simplify (z/(z/(z((z/(((z/z*(-2/7)z)/z)/z))/z)/z)z))7 assuming z is positive. z(-9) Simplify (ll(l/(l(-5)l)l)/ll)/(l/(l*5/l))ll(-1)lll*(-6)/ll assuming l is positive. l7 Simplify i/(i1iii)ii/(ii(-9)) assuming i is positive. i7 Simplify (h(-1/2))(4/9)/((h(hh*1h)/hhhh)/(h/h(-1))) assuming h is positive. h(-38/9) Simplify ((d/d(-17))/d)/d(-9/5) assuming d is positive. d(94/5) Simplify (r(-1/7))(-2/55) assuming r is positive. r(2/385) Simplify ((q2)(2/9))(-49) assuming q is positive. q(-196/9) Simplify (ww*(-3/5)www*(-6)ww)(-17) assuming w is positive. w(136/5) Simplify (y((y*(-5/2)y)/y	{ "pile_set_name": "DM Mathematics" }
564 minutes before 6:51 AM? 9:27 PM What is 137 minutes after 8:34 AM? 10:51 AM How many minutes are there between 5:35 PM and 1:43 AM? 488 How many minutes are there between 7:47 AM and 3:58 PM? 491 How many minutes are there between 4:33 AM and 9:48 AM? 315 What is 110 minutes after 9:13 PM? 11:03 PM How many minutes are there between 4:36 AM and 1:03 PM? 507 How many minutes are there between 11:36 AM and 1:46 PM? 130 What is 194 minutes before 1:16 AM? 10:02 PM What is 238 minutes after 11:06 PM? 3:04 AM How many minutes are there between 8:30 AM and 2:29 PM? 359 How many minutes are there between 5:38 PM and 10:03 PM? 265 What is 663 minutes before 1:26 PM? 2:23 AM How many minutes are there between 9:02 PM and 4:49 AM? 467 What is 223 minutes after 7:06 AM? 10:49 AM How many minutes are there between 6:13 AM and 8:48 AM? 155 How many minutes are there between 8:37 AM and 6:49 PM? 612 How many minutes are there between 4:21 PM and 5:23 PM? 62 How many minutes are there between 7:23 PM and 12:38 AM? 315 What is 520 minutes before 11:51 AM? 3:11 AM How many minutes are there between 3:48 AM and 10:46 AM? 418 What is 462 minutes after 5:42 PM? 1:24 AM What is 591 minutes after 11:05 PM? 8:56 AM How many minutes are there between 11:13 PM and 12:05 AM? 52 How many minutes are there between 2:43 AM and 5:47 AM? 184 What is 27 minutes after 3:48 AM? 4:15 AM How many minutes are there between 3:28 AM and 6:06 AM? 158 How many minutes are there between 1:22 AM and 10:38 AM? 556 How many minutes are there between 6:27 PM and 7:07 PM? 40 How many minutes are there between 2:08 PM and 3:19 PM? 71 What is 586 minutes before 1:58 PM? 4:12 AM What is 557 minutes before 3:26 PM? 6:09 AM What is 387 minutes before 10:13 PM? 3:46 PM What is 647 minutes before 5:24 PM? 6:37 AM What is 549 minutes before 3:22 PM? 6:13 AM What is 236 minutes after 5:02 AM? 8:58 AM What is 277 minutes before 2:58 PM? 10:21 AM What is 211 minutes before 7:22 AM? 3:51 AM How many minutes are there between 7:56 AM and 2:24 PM? 388 How many minutes are there between 11:06 PM and 10:54 AM? 708 What is 36 minutes before 2:34 AM? 1:58 AM How many minutes are there between 8:53 AM and 4:45 PM? 472 How many minutes are there between 5:55 AM and 7:11 AM? 76 What is 568 minutes after 2:52 PM? 12:20 AM What is 191 minutes before 2:17 PM? 11:06 AM How many minutes are there between 10:29 AM and 7:27 PM? 538 How many minutes are there between 5:00 PM and 12:04 AM? 424 What is 572 minutes before 5:48 AM? 8:16 PM How many minutes are there between 3:41 AM and 4:33 AM? 52 How many minutes are there between 12:20 PM and 6:34 PM? 374 How many minutes are there between 3:45 PM and 7:36 PM? 231 What is 89 minutes before 6:36 PM? 5:07 PM How many minutes are there between 3:46 PM and 6:19 PM? 153 What is 62 minutes before 4:49 PM? 3:47 PM How many minutes are there between 8:06 PM and 2:40 AM? 394 What is 628 minutes after 10:56 AM? 9:24 PM What is 609 minutes after 12:18 AM? 10:27 AM What is 547 minutes before 3:24 PM? 6:17 AM How many minutes are there between 10:46 PM and 6:36 AM? 470 What is 485 minutes after 7:00 PM? 3:05 AM How many minutes are there between 4:19 AM and 10:50 AM? 391 How many minutes are there between 2:14 AM and 12:45 PM? 631 How many minutes are there between 4:44 AM and 5:26 AM? 42 How many minutes are there between 2:49 PM and 3:27 PM? 38 How many minutes are there between 7:56 AM and 10:52 AM? 176 What is 419 minutes after 7:15 AM? 2:14 PM What is 101 minutes after 4:14 PM? 5:55 PM What is 235 minutes after 5:49 PM? 9:44 PM What is 51 minutes before 6:32 AM? 5:41 AM What is 260 minutes after 3:18 PM? 7:38 PM What is 488 minutes after 7:32 AM? 3:40 PM What is 156 minutes after 5:40 AM? 8:16 AM How many minutes are there between 3:52 PM and 12:00 AM? 488 What is 503 minutes after 1:19 AM? 9:42 AM What is 332 minutes after 8:42 PM? 2:14 AM How many minutes are there between 2:17 AM and 11:41 AM? 564 What is 371 minutes before 2:09 AM? 7:58 PM What is 482 minutes after 12:22 AM? 8:24 AM How many minutes are there between 3:15 AM and 3:14 PM? 719 What is 406 minutes after 5:15 PM? 12:01 AM What is 126 minutes before 4:46 AM? 2:40 AM How many minutes are there between 10:21 AM and 9:05 PM? 644 How many minutes are there between 10:04 PM and 7:45 AM? 581 What is 139 minutes after 10:07 PM? 12:26 AM What is 687 minutes after 10:41 AM? 10:08 PM What is 286 minutes before 9:05 PM? 4:19 PM What is 144 minutes before 10:04 AM? 7:40 AM What is 359 minutes after 3:26 AM? 9:25 AM How many minutes are there between 4:22 PM and 4:02 AM? 700 What is 490 minutes after 6:49 AM? 2:59 PM What is 324 minutes after 3:00 AM? 8:24 AM What is 77 minutes after 6:38 AM? 7:55 AM What is 585 minutes before 2:37 AM? 4:52 PM What is 456 minutes before 8:36 PM? 1:00 PM What is 715 minutes after 5:54 AM? 5:49 PM How many minutes are there between 7:55 PM and 2:22 AM? 387 How many minutes are there between 4:26 PM and 10:03 PM? 337 How many minutes are there between 3:45 AM and 10:33 AM? 408 What is 625 minutes before 3:11 AM? 4:46 PM How many minutes are there between 5:31 PM and 6:48 PM? 77 How many minutes are there between 7:18 PM and 12:59 AM? 341 How many minutes are there between 6:45 AM and 2:37 PM? 472 What is 453 minutes after 3:47 PM? 11:20 PM What is 291 minutes after 5:25 PM? 10:16 PM What is 514 minutes after 11:35 PM? 8:09 AM What is 154 minutes after 4:56 PM? 7:30 PM What is 152 minutes after 6:45 AM? 9:17 AM What is 641 minutes after 3:18 PM? 1:59 AM How many minutes are there between 2:42 PM and 3:41 PM? 59 How many minutes are there between 3:14 AM and 1:55 PM? 641 What is 49 minutes after 3:12 AM? 4:01 AM How many minutes are there between 7:12 PM and 9:57 PM? 165 How many minutes are there between 1:32 PM and 3:57 PM? 145 How many minutes are there between 10:32 AM and 1:08 PM? 156 How many minutes are there between 10:16 AM and 11:07 AM? 51 What is 298 minutes after 2:46 AM? 7:44 AM What is 332 minutes after 7:44 AM? 1:16 PM What is 624 minutes before 7:02 AM? 8:38 PM How many minutes are there between 4:05 AM and 12:26 PM? 501 What is 117 minutes before 11:27 AM? 9:30 AM What is 254 minutes before 2:18 AM? 10:04 PM How many minutes are there between 7:14 AM and 9:26 AM? 132 What is 578 minutes after 11:34 PM? 9:12 AM How many minutes are there between 11:25 PM and 10:42 AM? 677 How many minutes are there between 6:25 AM and 6:45 AM? 20 How many minutes are there between 10:15 PM and 7:03 AM? 528 What is 145 minutes after 7:50 PM? 10:15 PM What is 69 minutes before 4:24 PM? 3:15 PM How many minutes are there between 5:19 AM and 1:12 PM? 473 What is 170 minutes before 1:56 AM? 11:06 PM How many minutes are there between 1:39 PM and 5:37 PM? 238 What is 91 minutes before 3:41 AM? 2:10 AM How many minutes are there between 9:07 PM and 9:45 PM? 38 What is 496 minutes before 8:14 PM? 11:58 AM How many minutes are there between 1:47 PM and 2:07 PM? 20 How many minutes are there between 7:10 AM and 3:32 PM? 502 How many minutes are there between 7:17 AM and 6:14 PM? 657 What is 552 minutes after 4:45 AM? 1:57 PM What is 618 minutes before 7:42 PM? 9:24 AM What is 514 minutes after 4:50 PM? 1:24 AM What is 394 minutes before 7:37 AM? 1:03 AM How many minutes are there between 10:24 AM and 6:11 PM? 467 How many minutes are there between 7:37 AM and 4:05 PM? 508 How many minutes are there between 11:16 AM and 4:47 PM? 331 What is 195 minutes before 7:55 AM? 4:40 AM What is 665 minutes before 11:27 PM? 12:22 PM How many minutes are there between 2:42 PM and 7:51 PM? 309 What is 485 minutes after 9:53 PM? 5:58 AM How many minutes are there between 9:14 AM and 1:57 PM? 283 What is 620 minutes after 11:08 AM? 9:28 PM What is 69 minutes after 6:26 AM? 7:35 AM How many minutes are there between 1:34 PM and 12:31 AM? 657 What is 660 minutes before 1:56 PM? 2:56 AM How many minutes are there between 4:50 PM and 2:45 AM? 595 How many minutes are there between 1:03 AM and 8:28 AM? 445 How many minutes are there between 2:45 AM and 12:23 PM? 578 What is 665 minutes after 4:31 PM? 3:36 AM What is 39 minutes after 1:39 PM? 2:18 PM What is 672 minutes after 5:08 PM? 4:20 AM How many minutes are there b	{ "pile_set_name": "DM Mathematics" }
x be z(-2). Solve x = gi + 2i for i. 0 Suppose -4i = 5t - 31, 2i = -7t + 4t + 17. Solve 48 = to + 54 for o. -2 Suppose -h = -9 + 7. Let g(m) = m - 1. Let w(d) = -d*3 + 4d. Let o(i) = hw(i) - 4g(i). Let q be o(-1). Solve -4 = 3p - qp for p. -4 Let l = 39258 - 39258. Solve -3w - 1 + 16 = l for w. 5 Suppose -412 = -50x - 53x. Suppose f + 0 = 5. Suppose -xc = 2z - 6c - 12, -5z - fc = 0. Solve 0 = 2r + r - z for r. 1 Let a be (-11)/(17 - 936/54). Solve 52f = -af - 510 for f. -6 Suppose 3k + 14w - 9w = 136, -4w + 20 = 0. Solve k = -26t - 197 for t. -9 Let g(h) be the third derivative of -h6/120 - h5/30 + h*4/24 - 5h*3/3 - 33h*2. Let x be g(-3). Let u be x/6 - ((-46)/6 + 1). Solve 0 = uq - 3q for q. 0 Let k = 6866 + -6866. Solve k = 3b + 4b - b for b. 0 Suppose -3i + 3h - 3 = 0, -13i = -11i - 5h + 14. Solve 0 = -id - 20 + 20 for d. 0 Let r be 92/22 - ((-383)/77 - -5)7. Solve rw + 32 = 36 for w. 1 Suppose 21p - 50 = 16p. Let k be 580/100 + (-8)/p. Solve -2 + 12 = -kj for j. -2 Suppose -175y - 1176 = -182y. Solve 151h = yh for h. 0 Let f(l) be the first derivative of -l*4/4 - 16l3/3 - l2/2 - 16l - 8. Let u be f(-16). Suppose uq = -q. Solve d - 1 + 5 = q for d. -4 Let k = -1 + 1. Suppose 3o + 0o - j = 8, -10 = -4o + j. Let f = o - k. Solve -fc + 6c = 0 for c. 0 Suppose 3a + 9 = 6a. Let d = 7114 - 7112. Suppose 2i - 2f + 0 = 4, -i = -4f - 8. Solve ds + s + a = i for s. -1 Let l(o) = -4o*3 - 2o*2 - 12o - 13. Let k be l(-2). Solve 38q - 3 - k = 0 for q. 1 Let d be ((-132)/(-14))/11133. Solve 21p - d = 2p for p. 6 Let w(f) = -f*3 - 14f*2 - 13f + 8. Let d be w(-13). Suppose 3n + 4a + 13 = 60, -n - 87 = 16a. Solve -dv + n = -3v for v. 5 Suppose 4k - 2208 = 16k. Let n = 187 + k. Solve 3 = 2u - n for u. 3 Suppose 0 = -4k - 4c + 28, -18 + 15 = -k - 2c. Suppose -x + 16 = k. Solve xz + z - 18 = 0 for z. 3 Let y = 26814 - 26688. Solve yr - 133r + 49 = 0 for r. 7 Let p(o) = 2o3 - 33o*2 - 14o - 5. Let g be p(17). Solve 128 = -14x + gx for x. 4 Suppose -650 = -9p - 92. Suppose -66f + 16 = -pf. Solve 0 = -fi + 1 - 13 for i. -3 Suppose 5w + 4i - 22 = 0, 2 = -5w + 2i + 2i. Suppose 0 = -2m - wd + 57 - 13, -2d = -2. Solve 0 = -6r + mr - 75 for r. 5 Suppose 27 = -g - 32. Let v = -39 - g. Suppose 3c + 1 = s - 2s, -5c = 2s + 1. Solve -v = -sf + 6f for f. -5 Suppose -14n - 14 = -15n. Suppose -d + n + 1 = 0. Let j be (d/(-2))/(4/(-8)). Solve 4r + j = -r for r. -3 Let c = 4391 + -4330. Solve 0 = -8l - c + 37 for l. -3 Suppose -4s + 2q = 18, -3s = 5q + 8 - 1. Let r be -6 + (s - -6)5. Solve -r = -6j + 2j for j. 1 Let m = -31637 - -31672. Solve 75 - 355 = ms for s. -8 Let w(p) = p3 - p2 - p + 1. Let m(a) = -4a3 + 5a*2 + 6a - 6. Let h(n) = -m(n) - 3w(n). Let o be h(3). Let z = 30 - 15. Solve ou + 0u = z for u. 5 Let b(p) = -169p + 1195. Let f be b(7). Solve -7v = -5v + f for v. -6 Let u(b) = 215b + 1087. Let i be u(-5). Solve 4k - 12 - i = 0 for k. 6 Suppose 3g = -u + 20, 3u + g = 5u - 5. Suppose -3m + 43 = k, uk = 5m - 0m + 115. Suppose -5f + h + 11 = 1, 0 = f + 5h - k. Solve f = -4s - 9 for s. -3 Let i be (-1)/(-3) - (-35)/(-30)-10. Suppose -3d + i = j, 3d + 0j - 9 = -2j. Suppose 0 = dr + 4r. Solve -5 = 5k - r for k. -1 Let b(d) = -d*2 - 9d + 84. Suppose l + 2 = 4g, 57 = -6l + 3l - 5g. Let p be b(l). Solve 0 = 2f + p - 8 for f. -3 Suppose 850 = -5z + 860. Solve -z = -2l - 4 for l. -1 Let l be (-168)/78 - (-10)/65. Let a be 6/9l/(6/(-9)). Solve s - a = 2 for s. 4 Let g be (-2)/(3/(-3)) + -2. Let d be 1/(2/(-54)-3). Let h be (-6)/d + (g - 16/(-6)). Solve -l - h = 2 for l. -4 Let o be (-95)/((-253)/(-22) + -12). Solve 14f - 52f - o = 0 for f. -5 Suppose -w = -16d + 9947, -295d + 291d = 3w - 2503. Solve 13v - 648 = -d for v. 2 Let r be -10 + 7 + 8 - 3. Solve -76 + 76 = rw for w. 0 Let o be ((-38)/4 - 11/(-22))-2. Let r be 272/24o/12. Solve -4a + r = 37 for a. -5 Let s = -2 - -10. Suppose -9 = sa - 41. Let u be 25((-2)/(-5) + (-6)/(-15)). Solve 0f = af + u for f. -5 Suppose -5v + 5y + 5 = 0, -v - 9y + 9 = -8y. Solve 12s - v = -41 for s. -3 Let f = 17572 - 17566. Solve -551v = -553v - f for v. -3 Let q be (-48)/(-2)(-51)/(-204). Solve -qz - 3z + 18 = 0 for z. 2 Suppose -2k - 3 = -13. Suppose -2a = -ka - 3. Let m be a + (6 - 2) - -2. Solve 2h - m = 5 for h. 5 Suppose 14p + 486 = 3x + 11p, 21p - 888 = -5x. Solve xb + 28 = 179b for b. 2 Suppose 24 + 129 = -o - 4p, -612 = 4o - 2p. Let l = o - -161. Solve li - 10i + 6 = 0 for i. 3 Suppose -2q + 3s + 30 = -3q, -5s = -5q - 190. Suppose -3n + 0n + 188 = -4x, -3x + 5n = 152. Let t = q - x. Solve -4v = -6v - t for v. -4 Suppose x = 3f + 47, -177x + 182x - 4f = 158. Solve -69 = -xk - 17 for k. 2 Let f be 6/(-4) + (-11)/(-2). Suppose 3j = 2090 - 2081. Solve j = -fn + 11 for n. 2 Let g = 1236 - 1199. Solve 6 + 31 = -gi for i. -1 Let z be (-2 - 1) + 9 - 3. Suppose 0 = 3907n - 3903n - 8. Solve -n = -zx + 2x for x. 2 Suppose -22 + 194 = 172m. Suppose -2 - 4 = -3g. Solve m = gn + 3 for n. -1 Suppose 3k + k + 80 = 0. Let j = k - 2. Let f = j - -25. Solve c - f = 1 for c. 4 Suppose 371c - 40 = 367c. Solve -c = 9k + 44 for k. -6 Let l = 14365 - 14305. Let t be 0 + 10/(-2)-1. Suppose ty - l = -y. Solve -yi = -9i - 5 for i. 5 Let s be 17/3 - (-9)/271. Suppose 81 = sm + 39. Solve 0 = 3u - 5 - m for u. 4 Let i(j) = j*2 + 4j - 3. Let k be i(-5). Let c(t) be the first derivative of -t*3/3 - 4t*2 - 9t + 56. Let n be c(-5). Solve k = 2l + n for l. -2 Suppose 40m + 4 = 204. Suppose g + 6 = -2k, -2g + 0g + 12 = -2k. Solve ma = ga + 3 for a. 1 Suppose 0 = -p - r + 6, -3p - 21 = -8p - 2r. Let d be (2 - 0)3121/651. Solve di = 5i - p for i. 1 Let h(s) = -5s + 16 + 23 + 17 - 58. Let l be h(-2). Solve -4 = -2u - l for u. -2 Let c be 60(2 + (-117)/65). Solve -c = -2l - 2l for l. 3 Let o(a) = a*2 + 12a - 59. Let y be o(4). Let g(n) = -n*2 + 6n - 1. Let l be g(5). Suppose -8 - 4 = -lj. Solve -y - 10 = jc for c. -5 Let w(c) = 3c + 38. Let x be w(-16). Let a(t) = t2 + 10t - 20. Let l be a(x). Let q be 2 - 15/(l/4). Solve -qg + 2 = -18 for g. 4 Suppose -9v - 319 = -364. Let u be (288/20 + 0)10. Let h be (u/(-45))/(4/(-10)). Solve 0 = vc + 3 - h for c. 1 Let h(y) = -y*3 - 3y*2 + 7y + 6. Let z be h(-5). Suppose 18q - zq = -9q. Solve 0x + 2x - 8 = q for x. 4 Let o be 281/2810 - (3/15)/((-4)/1598). Solve o = 17g - 73 for g. 9 Suppose -2c + 13 = -3a, 3c - 3a - 8 = 2c. Suppose -c = -5h, -6p - 5 = -8p + h. Solve 5i + 8 = -pi for i. -1 Let j(b) = -41b3 - 2b*2 - 3b - 1. Let y be j(-1). Solve -22c = -yc - 95 for c. -5 Let s = -3432 + 3434. Solve 84 = sl + 74 for l. 5 Let x = 816 - 438. Let t = 380 - x. Solve -t - 2 = 2f for f. -2 Let j(d) = 80d - 2367. Let s be j(33). Solve -9 = -66g - s for g. -4 Let o be (-2)/(-7) + 8/(-28). Suppose n - 4 - 2 = o. Suppose 0 = 5u - 10, 2c - 9u = -6u + 22. Solve -n = -4j + c for j. 5 Suppose 5j = p + 31 - 20, 0 = -p - 2j + 10. Suppose -pc - 63 = -4f + f, -4c = 0. Solve 0 = 32b - 39b - f for b. -3 Let a be -16 + 30 + 5 + -19. Solve 28 = -7o - a for o. -4 Let b(z) = -5z*2 - 53z + 42. Let a be b(-10). Solve 9v + 3v = a for v. 6 Suppose -33v + 360 = -9v. Solve 9 = -vb - 21 for b. -2 Let l(s) = 121s + 1054. Let u be l(-8). Solve 82 = 21q - u for q. 8 Suppose 65c = 5o + 60c - 70, -5o + 2c = -58. Solve -os = 72 - 102 for s. 3 Suppose 5u + 777 = 377. Let d(a) = 4a2 + 3a - 1. Let f be d(-5). Let l = u + f. Solve 15 = j + lj for j. 3 Let r be -1 - ((-3)/((-1083)/(-10792)) - 4/38). Solve 47 - r = -3n for n. -6 Let k(h) be the second derivative of h4/4 + h3/3 + h*2 - 11h. Let b be k(-1). Suppose -8g - 18 = -50. Solve -bc - g = -1 for c. -1 Let j = 66 - 57. Let d(x) = -x*2 + 12x - 15. Let y be d(j). Solve -yw - 4 = -14w for w. 2 Suppose -11i + i - 540 = 0. Let v = 36 + i. Let m be ((-12)/v)/((-2)/(-21)). Solve 6 = mo - 10o for o. -2 Let w be (-133)/(-15) + 2/15. Suppose 845 = 76b + 237. Solve wj = bj for j. 0 Let v = 6842 - 6632. Solve 49q + v = 7q for q. -5 Suppose -89*c	{ "pile_set_name": "DM Mathematics" }
8 18e1 (base 15) to base 6 40534 Convert -321668 (base 13) to base 10. -1174298 4c6757 (base 14) to base 8 12021071 What is 5564003 (base 7) in base 6? 22425245 Convert -76705 (base 15) to base 4. -1123312031 Convert 40b19b (base 13) to base 7. 15555162 Convert -27f40 (base 16) to base 9. -268431 What is 10411032303 (base 5) in base 2? 101011100101000101001110 What is -6352242 (base 7) in base 15? -102d59 Convert 214320 (base 9) to base 13. 46257 Convert -154a639 (base 11) to base 5. -1134240313 -1110111 (base 5) to base 7 -110402 What is 204520034 (base 6) in base 12? 125001a Convert 62a21 (base 15) to base 10. 312781 What is 75b35 (base 12) in base 11? a6849 What is 111142043 (base 5) in base 6? 14301441 What is 13111200033 (base 4) in base 5? 443014322 What is 20210110202 (base 3) in base 4? 200221313 -17dde8 (base 15) to base 5 -244121033 -101000101010100000 (base 2) to base 13 -5aa74 11011101111000101010 (base 2) to base 15 12e447 Convert 233212021313 (base 4) to base 3. 212110220021212 303040452 (base 6) to base 10 5184176 What is 6494 (base 14) in base 5? 1024003 Convert -c10198 (base 13) to base 14. -84a363 10210010211 (base 3) to base 10 74461 What is 12501929 (base 10) in base 15? 116e41e Convert -521137 (base 8) to base 11. -108785 -11673 (base 13) to base 16 -7c7a -1341870 (base 11) to base 12 -9380b2 What is -1627167 (base 12) in base 16? -452a1f Convert -5480a (base 11) to base 15. -18857 Convert 172336 (base 9) to base 7. 623052 1121832 (base 9) to base 12 252162 What is -133024131 (base 5) in base 8? -2443602 764252 (base 12) to base 13 5079a7 What is -300071 (base 12) in base 15? -eb321 Convert -cbf8 (base 16) to base 8. -145770 Convert 1240416 (base 7) to base 2. 100111010100110100 Convert -101110101100011111101011 (base 2) to base 6. -1114210415 What is -302312223 (base 4) in base 14? -55ca7 Convert 2610013 (base 8) to base 16. b100b What is ba674 (base 14) in base 6? 13401154 What is 65067 (base 10) in base 9? 108226 What is -236784 (base 9) in base 5? -14032143 What is 2423320 (base 7) in base 11? 1a0881 What is 1306064 (base 8) in base 3? 200110201122 -122021001101112 (base 3) to base 15 -c1302b What is 122323000 (base 4) in base 15? 22a17 What is 20353013 (base 7) in base 5? 414214201 89584 (base 14) to base 7 2555124 Convert 46426510 (base 7) to base 2. 1111100010101110100110 Convert -1455b6 (base 14) to base 3. -1022212221001 What is 221530022 (base 6) in base 8? 17225136 Convert 21110203 (base 4) to base 7. 216211 -3a9b0 (base 12) to base 6 -1422340 What is -253824 (base 12) in base 11? -385642 2330341214 (base 5) to base 14 9c8619 3536a3 (base 12) to base 6 30204323 What is -2110342 (base 6) in base 11? -70029 What is 5002154 (base 7) in base 11? 3725a2 Convert 101a4 (base 14) to base 4. 21131210 What is 2240042224 (base 5) in base 12? 1813192 Convert -3f00 (base 16) to base 2. -11111100000000 What is 201211000301 (base 4) in base 13? 1a926c1 4150335 (base 7) to base 4 1321331331 45530 (base 10) to base 4 23013122 2a03482 (base 12) to base 9 16833328 -10414002233 (base 5) to base 11 -6523976 Convert -101033211 (base 4) to base 14. -1ba4d What is -94b2e (base 16) in base 14? -11bd70 Convert 5a590 (base 15) to base 13. a11c3 -c54a07 (base 14) to base 10 -6658911 What is -b43ab (base 14) in base 11? -277320 1043665 (base 7) to base 14 34c35 1100111110010110100 (base 2) to base 15 85e7a -7707366 (base 9) to base 13 -b1bb20 Convert -1032431 (base 10) to base 16. -fc0ef -10001110100111000110101 (base 2) to base 14 -899033 What is -30b2a9 (base 13) in base 6? -40222535 What is 40113102 (base 5) in base 12? 1332b8 Convert -303122033 (base 5) to base 12. -4abb95 Convert -12205541 (base 6) to base 7. -3213163 2112a (base 11) to base 3 1120012111 Convert -2a0249b (base 12) to base 2. -100000010010100000110111 What is 8a26b7 (base 14) in base 5? 2200143302 Convert c5585 (base 15) to base 5. 130010000 What is -2001342010 (base 5) in base 11? -2247749 What is 7928779 (base 10) in base 5? 4012210104 Convert 13037324 (base 8) to base 13. 7a6aa5 23110013 (base 4) to base 16 b507 What is -8a524 (base 13) in base 8? -752705 What is -85c58 (base 14) in base 7? -2515041 Convert 274884 (base 9) to base 6. 3332121 What is 10303520 (base 7) in base 11? 548654 d40f5 (base 16) to base 9 1563437 Convert -1ba70 (base 15) to base 7. -523461 Convert 213230130221 (base 4) to base 13. 2204405 -507ae (base 16) to base 15 -67a16 What is 65895 (base 12) in base 14? 36d45 12121112021 (base 3) to base 10 110464 -74856 (base 10) to base 16 -12468 Convert 11000010100000111101100 (base 2) to base 9. 12884265 Convert 3211032202 (base 5) to base 2. 11001101100101010101000 Convert 13795 (base 10) to base 14. 5055 Convert d0b240 (base 14) to base 2. 11010110010011100001000 What is 10100110120 (base 3) in base 10? 65949 Convert -10011010011111111000 (base 2) to base 13. -19206a 130134131 (base 5) to base 13 191002 What is -11000011222 (base 3) in base 4? -103100102 Convert 56475 (base 12) to base 13. 402a1 What is -8d656c (base 14) in base 4? -102120221110 -285845 (base 9) to base 13 -61805 Convert -13832425 (base 9) to base 16. -68d884 What is -46d90b (base 15) in base 16? -33af19 Convert 5b8855 (base 13) to base 12. 897196 220363 (base 9) to base 5 13202040 What is 20450332 (base 6) in base 15? bc0de Convert 8eeb (base 16) to base 11. 25541 10010011011111010011 (base 2) to base 8 2233723 201254105 (base 7) to base 13 2565b03 What is bb8a (base 16) in base 12? 2394a What is -a9216b (base 12) in base 15? -37da02 Convert -323466 (base 8) to base 16. -1a736 What is 22535141 (base 6) in base 16? aa305 Convert -22021322 (base 4) to base 15. -c4ce Convert -2551719 (base 11) to base 4. -100320001210 Convert 539871 (base 10) to base 8. 2036337 1e4b4a (base 16) to base 7 22606130 -9788e (base 16) to base 13 -189691 Convert 276747 (base 9) to base 15. 35124 Convert 21030413 (base 5) to base 16. 2a722 Convert 15a0f (base 16) to base 2. 10101101000001111 What is 21000220121 (base 3) in base 15? 2b04a What is 28b55 (base 15) in base 11? 8a304 -4321545 (base 6) to base 3 -101211010202 What is -b3607 (base 12) in base 6? -5004011 233631364 (base 7) to base 8 67125477 What is 1021000010010 (base 3) in base 10? 669306 -90d515 (base 14) to base 11 -2831256 -445521355 (base 6) to base 11 -4641725 Convert -201020121 (base 4) to base 6. -2524133 10dd78 (base 14) to base 7 4616511 Convert 2452116 (base 8) to base 10. 676942 Convert -11270764 (base 8) to base 5. -1112012004 2233433000 (base 5) to base 11 28a41a5 What is -296d84 (base 14) in base 6? -50513024 -32223103 (base 4) to base 5 -3410430 What is -1356141 (base 7) in base 10? -182211 Convert -585420 (base 9) to base 6. -11312200 Convert 101000100011110111101 (base 2) to base 3. 2111112011101 What is 1a5b9 (base 14) in base 11? 46379 Convert -3875053 (base 11) to base 4. -121212233203 What is -23610125 (base 8) in base 5? -2311302100 Convert -30674724 (base 9) to base 3. -1000202111210211 Convert -12550221 (base 6) to base 16. -66385 Convert -443131040 (base 5) to base 9. -3556333 Convert -a911c (base 15) to base 9. -1007410 2a1fc (base 16) to base 12 83a24 What is -21300022 (base 4) in base 5? -2234241 Convert -1001012102211 (base 3) to base 4. -2013201100 Convert -12cd54 (base 15) to base 9. -1627207 Convert -35084d (base 14) to base 6. -102422341 2100221011220 (base 3) to base 15 19ccc6 Convert 11eb9 (base 16) to base 12. 36589 What is 145211 (base 6) in base 10? 14119 What is -442628 (base 9) in base 14? -6c506 What is -130888 (base 10) in base 9? -218481 What is 12333323 (base 4) in base 12? 1470b -103301010 (base 4) to base 7 -455022 Convert 2403432402 (base 5) to base 2. 10101000110001011110000 What is -7e01 (base 15) in base 6? -323544 What is -2363360 (base 8) in base 3? -1012222011222 213245230 (base 6) to base 16 39ffd2 What is -242457 (base 9) in base 12? -70714 What is -6b022 (base 14) in base 3? -111020121221 What is -245721 (base 9) in base 2? -100100010001011101 What is -2303004330 (base 5) in base 10? -5125590 -204303052 (base 6) to base 10 -3569864 Convert -2232322 (base 4) to base 5. -324234 30c905 (base 15) to base 12 93ab7b What is -141d0d (base 15) in base 8? -3542774 What is 30211222002 (base 4) in	{ "pile_set_name": "DM Mathematics" }
-2s3 + 3s*2 + s - 2. Let k be f(2). Let n be k/(-16) - 38/(-8). Determine r(n). -8 Let r be 0 - (3 + (-20)/4). Let v(k) = -6k*2 - 15k - r + 3k + 13k - k*3. What is v(-6)? -8 Let y(p) = 3p*2 - p - 4p*2 - 4 - 5p + 0p. Calculate y(-5). 1 Let j be (-12)/82/(-3). Let k(n) = j - n + n + n. Determine k(-7). -6 Let y(a) be the second derivative of a*3/6 + 5a*2/2 + 2a. Suppose 2k - 6k + 12 = 0. Let g(c) = -c*2 + c + 1. Let o be g(k). Calculate y(o). 0 Let w(f) = 19f + 12f + 14f + 1 - 48f. Let r = -2 - 0. What is w(r)? 7 Let d(v) = -v2 + 6v - 3. Suppose c = 6 + 4. Let a be 4/(-18) + 129/(-27). Let x = a + c. Calculate d(x). 2 Let z be (-2)/(-6) - (-219)/(-9). Suppose 2b = -3h + 4, -3b + 4b - 2 = h. Let a be ((-8)/z)/(b/(-30)). Let i(o) = o*2 + 3o - 1. What is i(a)? 9 Let t(c) = -c*2 + 6c - 6. Let p be 2 - 41/(-1). What is t(p)? -6 Let t(y) = -y3 + 8y*2 + y - 2. Suppose -55 = -2r - 4i - 19, 4r + 2i = 42. Determine t(r). 6 Let m(q) = -80q - 4 - q*3 + 8q*2 - 7 + 90q. Give m(9). -2 Let q(w) = -3w2 - w - 1. Suppose -4s = -8 + 12. Calculate q(s). -3 Let h(w) = w3 + w2 - 2w + 1. Suppose -5c + 6t + 17 = 3t, 0 = 2c - 2t - 10. Let o be (-2 - -1) + c + 1. Let r = 0 + o. Calculate h(r). 1 Let y(f) = -3 + 0f - 2f + 1. Let q(t) = -t*3 - 13t*2 + 15t + 10. Let l be q(-14). Give y(l). 6 Let g be (-32)/(-18) - (-4)/18. Let c(f) = -1 - gf + f - 7. Suppose 15 = 3q - 4h - 1, -16 = q + 4h. Determine c(q). -8 Let a = -131 - -129. Let q(d) = -2 - 2d + d2 + 2d. Calculate q(a). 2 Let a(m) = 2m + 5. Let d(o) = o. Let f(r) = -a(r) + 3d(r). Suppose 4s + 6 = 18. Let c = s - -2. Calculate f(c). 0 Let w = -67 - -66. Let g(p) = 25p*3 - 20p*2 - 20. Let a be -3(-1)/(-3)-20. Let k(n) = n3 - n2 - 1. Let b(c) = ak(c) - g(c). Determine b(w). 5 Let h(b) = b3 - b2. Suppose 3y = 4o + 4y - 4, -2o - 12 = 4y. Calculate h(o). 4 Let a(r) = r + 1. Let k = -4 - -1. Let b be (k/2)/(15/(-50)). What is a(b)? 6 Let z(y) = 3y*3 - 62y*2 - 20y - 21. Let w be z(21). Let h(s) = -2 + s - 2 - 1 + s2. Calculate h(w). -5 Let u = 15 + -18. Let s(t) be the third derivative of t6/120 + t5/15 + t4/8 + t3/3 - t2. Give s(u). 2 Let s(z) = -1709 + 1709 - z*2 + 3z. Calculate s(3). 0 Let t(j) = -5j2 + 6j*2 + 7j - 2j - j + 1. Determine t(-4). 1 Let j(m) = -m2 - 8m + 4. Let r be j(-8). Suppose s + 3 = r. Let v be (-1)/(0 - s) + -2. Let p(y) = 3y3 + 2y + 1. What is p(v)? -4 Suppose 17 = -3r - 7. Let z = r + 14. Let f(x) = x - 3. What is f(z)? 3 Let m(s) = -s3 - 8s*2 - 6s + 8. Let o be m(-7). Let b(v) = -11v3 - 2v*2 + v. Determine b(o). -12 Let k(f) = 4f + f*2 + 3 + 1 - 2f + 4f. Suppose 319 = 5s + 129. Suppose -4x = -5q - s, 4q = 2x + 3x - 34. What is k(q)? 4 Let b = 2 + 3. Suppose -a = 5y - 17, -5y + 11 = a - 2y. Let q(v) = b - 1 - 3 + va - v. Give q(-2). 7 Let l(g) = -g + 9. Let w be l(6). Suppose 0 = c - w. Let s(f) = f3 - 4f2 + 3f + 2. What is s(c)? 2 Let t(l) = 0l - 17 - l + 22. What is t(-4)? 9 Let r(i) = 2i*2 + 5i - 4i2 + 0 + 3 - i3 - 2. Calculate r(-4). 13 Let w(u) = u3 - 3u2 + 3. Let f(c) = -c3 - 5c2 + 4c - 1. Let r be f(-6). Let b = -11 + r. Suppose b = 3d - 3 - 6. Give w(d). 3 Suppose 0 = -3t - 2k - 2 - 3, -5t - 7 = 2k. Let x(w) be the third derivative of -1/12w*4 - 1/6w*3 + 4w*2 - 1/10w*5 + 0 + 0w. What is x(t)? -5 Let z be (1 - (1 - -18)) + -2. Let n be 68/z + (-2)/(-5). Let s(r) = -4r + 1 - r2 + 0r + 2. Calculate s(n). 6 Let x(r) = -r*2 + 2r - 3. Let j(m) = m*3 - 4m*2 + 3m. Let z be j(2). Let f = z + 4. What is x(f)? -3 Let i(k) = -k*3 + 8k*2 + 9k - 4. Suppose 42w - 44w = -18. Determine i(w). -4 Let a(z) = 0z - 8z + 6z. What is a(3)? -6 Let a(j) = 0 - j + 0j - 2. Suppose -24 = -0o - 2o. Let p = -14 + o. Calculate a(p). 0 Let k(s) be the third derivative of -1/8s4 + 2s*2 + 1/60s*5 + 0s + 2/3s3 + 0. Let v = -5 - -8. Determine k(v). 4 Suppose 0 = -5y + 115 - 170. Let o(s) = -s - 18. Calculate o(y). -7 Let w(x) = -x3 + x2 + 8. Let m(y) = -y + 4. Let s be m(3). Let o be (0 + 0)/(s + -3). What is w(o)? 8 Let w(d) = -d + 10. Suppose 2u - 5 - 11 = 0. Let s be w(u). Let a(c) = c2 - 2c + 2. What is a(s)? 2 Let z be 0/(-2) - (-4 - -4). Suppose z = -2u + 3u - 2. Suppose -10 = -4w - ui, -3i = 2w - 0w + 1. Let x(y) = y3 - 5y*2 + 5y - 3. Calculate x(w). 1 Let l = -12 + 14. Let m(g) = g*3 - 4 + 10 - 2g*l - 1 + 5g*2 - 3g. What is m(-4)? 1 Let t(k) be the second derivative of k3/2 - k2 + 4k. Let y be t(2). Let g(j) = 3j - 6. Determine g(y). 6 Let n(u) = 5u2 + 2u - 6. Let b(k) = k*2 + k - 1. Let q(l) = -4b(l) + n(l). Let p(y) = -2y + 3. Let h be p(2). Let g be -1 + -2 - h - 0. Calculate q(g). 6 Let p(y) = 6 - 2y*3 + 0 - 7 + 6y*3. Suppose 5k = 3g + 2, 2k + 2g - 4 = -0. Determine p(k). 3 Let z(p) = -p + 4. Let j(c) = 4c - 6. Let d be j(5). Let s be (4/7)/(4/d). Suppose -sa + 4 = -a. Calculate z(a). 0 Let p(w) = w - 12. Let i(f) = -5f + 46. Let j(q) = 2i(q) + 9p(q). Determine j(-8). -8 Let t be (6/9)/((-5)/(-30)). Suppose 0 = -ts - 2s + 6. Let q(k) = 11k + 1. Calculate q(s). 12 Let c(d) = -d + 3. Let g be -3 - (3 - 6) - 0. Let u be c(g). Let l(a) = 3a - 3a + ua - 4a - 2. Give l(-5). 3 Let k(m) be the second derivative of -m5/20 + 7m4/12 + m3/6 - 5m2/2 - 4m. Let g = 8 + -1. Determine k(g). 2 Let u(d) = -d*2 + 11d - 7. Let t be u(11). Let c(a) = a*3 + 7a*2 - 2a - 3. What is c(t)? 11 Let i(w) = 32 - w + 34 - 68. Suppose 3u - h + 17 = 0, 1 = u - 0u + 3h. Give i(u). 3 Let k(w) be the first derivative of 2w*2 - 3w - 1/3w3 + 1. Calculate k(4). -3 Let k(j) = j - 16. Let o be k(13). Let x(f) = f2 - f - 4. Calculate x(o). 8 Let f(c) be the second derivative of -c5/20 - c4/12 + c3/2 - c2 - c. Let u be (-44)/(-33) - 4/(-6). Determine f(u). -8 Let b = -47 - -38. Let j(y) = -y - 17. Calculate j(b). -8 Let y = -16 + 11. Let o(v) = -v2 - 4v + 7. Let t be o(y). Suppose -5x - 12 = -tx. Let m(l) = l*2 + 2l - 2. Determine m(x). 6 Let p be 5/(-10) + (-9)/(-2). Let x be (-10)/p - 1/(-2). Let i(a) be the third derivative of -a6/120 - a5/20 - a*3/3 - 2a2. Give i(x). -6 Let l = -9 + 13. Let b(c) = -c2 + c + 3. Give b(l). -9 Suppose -3q - 2l - 18 = 0, 5q - 2l + 13 = -17. Let a(f) = f*3 + 7f*2 + 5f. Calculate a(q). 6 Let v(n) be the second derivative of -n*3/2 - 3n*2 + 5n. Let x(a) = 8a + 17. Let j(o) = -11v(o) - 4x(o). Calculate j(-4). -6 Let a(d) = d - 4. Let x(h) = -h2 - 3h + 2. Let k be x(-3). Determine a(k). -2 Let n(c) be the first derivative of -c*2/2 + 4c - 2. Suppose 0 = y - 1 - 2, 4y = 4i. What is n(i)? 1 Let b(n) = 6n3 - 2n + 1. Let a = 37 - 36. Give b(a). 5 Let w(z) be the second derivative of -1/3z3 - z2 + 0 + 1/15z*5 - 1/60z*6 - 2z - 1/24z4. Let c(i) be the first derivative of w(i). What is c(2)? -4 Let q(v) = -5v - 1. Suppose -4c - 4 = 4j, -c = -5j + 7 - 18. Calculate q(j). 9 Let h(k) = 2k - 1. Suppose -3x + 3 = -4x. Let n be x - (1 + 0)-6. Determine h(n). 5 Let l = -1 - -2. Let g be -1l + -4 + 5. Let i(x) = 0x3 + x3 - 4x + gx2 - 4 - 3x*2. Give i(4). -4 Suppose 14 = 7l - 2l - 2r, 2l = -2r. Let g(y) = 2 - 2y2 + y2 - y + ly*2. Determine g(0). 2 Let m(k) = -6k2 - 2 + k2 - 8k + 0k. Let s(l) = -4l2 - 8l - 1. Suppose 4r - 6 = 5r. Let p(d) = rs(d) + 5m(d). Determine p(6). 8 Suppose -4q - 2y = 26, 6y - y = 5. Let k(i) = i3 + 6i*2 - 5i + 9. Determine k(q). -5 Let y(p) = 2p - 1. Let w be -2 + 3 + 2 + 1. Suppose x - 5u - 27 = 0, 16 = -3u + w. Suppose -5g - x - 3 = 0. Calculate y(g). -5 Let w(v) = -v*2 + 2v + 3. Let s be w(3). Let o = s - -3. Suppose 4 + 1 = -b, 2b = -ox - 16. Let m(r) = -r3 - r2 + 4r + 3. Give m(x). -1 Let x(f) = f - 1. Let s be ((-2)/(-8))/(5/20). Let g be (1 + 3)/(s + -2). Calculate x(g). -5 Let h(z) be the second derivative of -1/3z*3 + 2z - z2 + 0. Let d(k) = k + 1. Let x be d(-3). What is h(x)? 2 Let g(t) be the first derivative of -t2/2 - 6t - 7. Let c be g(-10). Let d(w) = -w3 + 5w*2 - 5w - 1. Give d(c). -5 Let u(l) = -3l2 + 6l - 1. Let q(y) be the first derivativ	{ "pile_set_name": "DM Mathematics" }
/r*(1/12))/rr*(-5/2)r assuming r is positive. r(-19/12) Simplify (s(-25/2)/s)/(ss/(ss*23)s) assuming s is positive. s(15/2) Simplify (g/g13)(5/8) assuming g is positive. g(-15/2) Simplify (((n*(-3)/n)/nn)/n(3/2))(-17/5) assuming n is positive. n(187/10) Simplify (j/(((j3/j)/j)/j))/(jj3/j)j/j*(-2/5)j(1/6) assuming j is positive. j(-13/30) Simplify (ff(-2)/f)/(f(2/9)f)f3ffff(-4/13)/ff assuming f is positive. f(289/117) Simplify ((q/(q(1/9)q))/q(-12))(-3/14) assuming q is positive. q(-107/42) Simplify (p(-1/9)/p(1/7))/(((p/((p/p(-6))/p))/p)/p(-3/8)) assuming p is positive. p(2707/504) Simplify (s1/((s8/ss)/s))/((ss(-1/4)/ss)/(sss(-3/4))) assuming s is positive. s(-11/2) Simplify (v/(v*0/v)(v/(v*(-4)v)v)/vvvvv)/(v2v((v(2/17)v)/v)/vvvv) assuming v is positive. v(83/17) Simplify (u/(u/u(-3/4)))(-2/33) assuming u is positive. u(1/22) Simplify (v(-2)/v)/((v/(v((v*(2/25)v)/v)/v))/v) assuming v is positive. v(-73/25) Simplify w19www(-6) assuming w is positive. w15 Simplify h4/(h/(h/h(-3/16))hh) assuming h is positive. h(35/16) Simplify ((a/((aa*(1/11))/a))/aa/a(-2/11))(-2/57) assuming a is positive. a(-8/209) Simplify d(-6/5)/((dd(-1)/dd)/d) assuming d is positive. d(-1/5) Simplify r/r(3/10)r/r(-2/7)(r0)(11/2) assuming r is positive. r*(139/70) Simplify ((j(j/j*(3/4))/j)/(jj((jj/j*1)/j)/jj))/((j/(j/(jj(1/4)j)j))/(j(7/5)/jj)) assuming j is positive. j(-8/5) Simplify q(-1/16)q(-42) assuming q is positive. q(-673/16) Simplify (((t(8/9)/t)/t)/t)/((ttt/(t(-8)t)t)/tt) assuming t is positive. t*(-118/9) Simplify www(2/17)ww(-17) assuming w is positive. w(-236/17) Simplify v(8/7)v(-2/139) assuming v is positive. v(1098/973) Simplify ((v1)(-14/5))(-24/5) assuming v is positive. v(336/25) Simplify ((a0)(15/2))(-25/3) assuming a is positive. 1 Simplify ((y/(y(-19)/y))/y)/yy(11/3) assuming y is positive. y(68/3) Simplify ll*(-6)lll*(2/7)/l(l(ll*(-2/19)l)/l)/(((l/((ll/l3)/l))/ll)/l) assuming l is positive. l*(-508/133) Simplify (dd(12/7))/(d(-30)dd) assuming d is positive. d*(215/7) Simplify (zz*(-13))/(zz(-2)) assuming z is positive. z(-11) Simplify p(p(-22)ppp)/pp(8/9)/p assuming p is positive. p(-172/9) Simplify l(1/12)/(l(-3/7)l)l(2/13)/l(-4) assuming l is positive. l(4003/1092) Simplify (bb*(-11/5)b)/(b/(b*(-2/25)bb)) assuming b is positive. b(18/25) Simplify o(14/9)/o8 assuming o is positive. o(-58/9) Simplify ii/(ii(9/11)i)i(3/14) assuming i is positive. i(-93/154) Simplify (r(2/3))40(r/((r/(r/r(1/5)))/r))/r(2/5) assuming r is positive. r*(421/15) Simplify ((pp*(1/55)p)/p)(-34) assuming p is positive. p(-1904/55) Simplify y/((yyyyy*(-4/11))/y)yyy*(-3/11)yy assuming y is positive. y(23/11) Simplify (a6/(a/(aa(1/3))))(-22) assuming a is positive. a(-418/3) Simplify n(4/7)/nnn*(-2/5)n(-8)/(n/(n/((n(-8)/n)/n))n) assuming n is positive. n(41/35) Simplify ((d/d2)/d(-6))/(d(d/(d/(d/((d/(d/d*(1/6)d))/d)d)))/dddd(-7)) assuming d is positive. d(37/6) Simplify ((j/(j/(j*(6/11)/jj)))/(j*(2/27)jjj))(-44) assuming j is positive. j(3004/27) Simplify (y(-1/2))(-22/7)(y(1/3))(1/2) assuming y is positive. y(73/42) Simplify j(-1)j(1/7) assuming j is positive. j(-6/7) Simplify (((h(h/(h/h1))/h)/h)/(h5/h))/(h(1/11)/(h/((h/(hh7))/h))) assuming h is positive. h(54/11) Simplify ((ff(2/7)/f)/((((((ff/(f/f*(-3/8)))/f)/f)/ff)/f)/f))/(f*(-4/9)f0) assuming f is positive. f(2069/504) Simplify ((v/v*(2/11))/(v/(vv(1/4))))(2/9) assuming v is positive. v(47/198) Simplify ((x(-2/13)/x)/(x*(-1/5)x))49 assuming x is positive. x(-6223/65) Simplify ((gg/(g5/g)g)/gg10)23 assuming g is positive. g184 Simplify j(-7)(j*(-1/7)j)/jjj*4/j((jj3)/j)/j assuming j is positive. j(-8/7) Simplify (q/q(-4/13)q)/qq(qqq*(4/9))/qq assuming q is positive. q*(556/117) Simplify (g(g*5g)/g)(-1/49) assuming g is positive. g(-6/49) Simplify ((d*(-4/3)/d)/((dd*(-10)d)/d))(-16) assuming d is positive. d(-320/3) Simplify (j/(j*(-6/13)j))/((j/j*(8/3)j)/j) assuming j is positive. j(83/39) Simplify (j(-14/9)jjj)(-36) assuming j is positive. j(-52) Simplify k(4/17)/k(-33) assuming k is positive. k(565/17) Simplify ((l(2/5))(3/46))(13/3) assuming l is positive. l(13/115) Simplify (f(-2/13)ff(-2/7))/(f0)(1/46) assuming f is positive. f(51/91) Simplify u(3/11)/uuu(-2/45)u assuming u is positive. u*(608/495) Simplify (hhh/h(-3/4)h)/(h/(h/h*(-4/7)))h(-9)/h(2/9) assuming h is positive. h*(-983/252) Simplify r/(r(r/r*19)/r)(r*(1/8)/r)/rr assuming r is positive. r(145/8) Simplify (h/h(1/4))(-8)/(h1)(14/5) assuming h is positive. h(-44/5) Simplify (x(-2/9))(-5/3) assuming x is positive. x(10/27) Simplify (u(3/16))36 assuming u is positive. u(27/4) Simplify (x10/x(-1/11))(3/7) assuming x is positive. x(333/77) Simplify (v/v*0)/(vv*(-8)v)(v1)(-4/15) assuming v is positive. v(101/15) Simplify ll*(-1/5)ll/l(1/4)l(l/((llll(l/(l(-5/2)/l)l)/l)/l))/(l/l(-5)) assuming l is positive. l(-179/20) Simplify ((hh(1/4)h)/h)*(11/5)(h/(h*(-1/2)hhh))/(h/(hh(-2))) assuming h is positive. h(-3/4) Simplify (uu/u(2/9))/u(-6)(u/(u5/u))/((u/u9)/u) assuming u is positive. u(124/9) Simplify ((u/(u/((u/u(-4))/u)))/u)/(uu/((u(uu/u*11)/u)/u))((((u/u*(-1/10))/u)/u)/u)/uu/u(-1/3) assuming u is positive. u(-317/30) Simplify (b*3b)/b*(-7)b/(((b/(b/(bb/(bb*8b)b)))/bbb)/b)b(bb/b(-3))/b assuming b is positive. b24 Simplify ((o/o(-1/4))/o)(6/13)(oo(-1/2))18 assuming o is positive. o(237/26) Simplify ((m3m)/(m(m/(m((m(2/19)m)/m)/m))/mm))(-12/11) assuming m is positive. m(-480/209) Simplify (u(-5)/u0)/(((uu*(2/3)u)/u)/u)(-21) assuming u is positive. u9 Simplify (i(((ii/(i*(-2/7)i))/i)/i)/i)(32/7)/(i0ii)15 assuming i is positive. i(-1630/49) Simplify (a/(a/a(-1/3)))(2/9)/(a*(2/7)/aa(-2/11)) assuming a is positive. a(1709/2079) Simplify (d(-8)/d)(-45) assuming d is positive. d405 Simplify m43m(m(m/m(-38)m)/m)/m assuming m is positive. m*83 Simplify ((aa(-8))6)(4/9) assuming a is positive. a(-56/3) Simplify (w0)(11/3) assuming w is positive. 1 Simplify ((dddd(-16))/dd(1/12))(-7/4) assuming d is positive. d*(1169/48) Simplify tt*1(tt/(t6/t))/tt((t/(t/(tt/(tt11/t)t)))/t)/(t*1t) assuming t is positive. t*(-12) Simplify (xx/x11)(-25) assuming x is positive. x*225 Simplify kk*(-5)k*(6/13)/kk assuming k is positive. k*(-46/13) Simplify ((sss(-22)s)/s)(-48) assuming s is positive. s960 Simplify xxx*(-9)x/x*(-4/5)x assuming x is positive. x(-21/5) Simplify (k(-1/4))(-3/5)/(k6/k5) assuming k is positive. k(-17/20) Simplify ((c*(2/11)c)/c(2/17))/((c/(c/((c/(c(-1)/c)c)/c)))/c(-3)) assuming c is positive. c(-923/187) Simplify (bb*(4/7)b)/(b/((bb(-15)b)/b)) assuming b is positive. b*(-87/7) Simplify ((gg4)/(g(8/3)gg))/((gg(1/8))/g(-4)) assuming g is positive. g(-115/24) Simplify (w(3/7)/w(-2/5))(-3/10) assuming w is positive. w(-87/350) Simplify v(2/77)/(vv(-1/64)) assuming v is positive. v(-4723/4928) Simplify (x*(3/7)xx(-18)xxxx)43 assuming x is positive. x(-3784/7) Simplify ((r/(r(-3)/r))/r(3/8))/(r(2/23)/r(-1/3)) assuming r is positive. r(2321/552) Simplify (cc*0cc)(-17/2)/((cc*(-6)/c)/(c(c/(c/c*(1/5)))/ccc)) assuming c is positive. c(-173/10) Simplify vv*(-3/16)/vv/(vv/v(1/4)) assuming v is positive. v(-15/16) Simplify l(-4)l*(-2/9)l*(-1/3)/lll0 assuming l is positive. l(-41/9) Simplify (pp/(p/p*8)pp/(p/(p(8/7)p)))/(p*(-2/3)/((p/(p(p*4pp)/pp)p)/p)) assuming p is positive. p(143/21) Simplify ((vvv(-1/6)v)/v(-5))(-7/11) assum	{ "pile_set_name": "DM Mathematics" }
-456.8. Let x = 370 + y. Let j = -35 - x. Round j to 0 dps. -4 Suppose -4 = -3x - z, 4x - 12 = -0x + 2z. Suppose 3m + 2m = r + 4350, 4m = -xr - 8756. Round r to the nearest one thousand. -4000 Let l = 232 + 20.6. Round l to the nearest ten. 250 Let o = 30330 + 758. Let c = o + -31041.046. Let m = 47 - c. Round m to two decimal places. 0.05 Let r = 42 + -123. Let g = r + 30. Round g to the nearest 10. -50 Let u = 1096129.62 - 1096073.619987. Let r = 56 - u. What is r rounded to 5 decimal places? -0.00001 Let c = 8866 - 8866.00006561. What is c rounded to 5 decimal places? -0.00007 Let l = -396433.1 + 377615. Let r = l - -18819.06941. Let y = -0.97 + r. Round y to 4 dps. -0.0006 Let t = 0.414998424 - 0.415. Round t to seven dps. -0.0000016 Let h = 10812.69 + -10932. Let x = h - 0.79. What is x rounded to the nearest ten? -120 Let k = -2.246 - 15.754. Let h = -78 - -88.4. Let t = k + h. Round t to 0 decimal places. -8 Let l(y) = y*2 - 14y + 12. Let x be l(12). Let k be 501/x - 2/8. Let b be ((-28)/k)/(4/(-258)). Round b to the nearest 10. -40 Let g = 2064022.7 + -2064033.6999945. Let u = g - -11. Round u to six decimal places. 0.000006 Let a = 1 + -91. Let h = a - -89.99999945. Round h to seven dps. -0.0000006 Let v be ((-204)/(-85))/((-4)/(160/6)). Let d(o) = -6o - 44. Let w be d(v). What is w rounded to the nearest ten? 50 Let b = 69 - 69.105. Let q = -15839.1349947 - -15839.03. Let o = q - b. What is o rounded to six dps? 0.000005 Let o = -23709.3545 + 23717. Let v = 142.0935 + o. Let b = -150 + v. What is b rounded to two dps? -0.26 Let l = -291.2 - -247. Let x = l + 55. What is x rounded to 0 dps? 11 Let a = 0.07093 - 0.44703. What is a rounded to 1 dp? -0.4 Let f = 106816603 - 106816742.999998. Let x = 140 + f. Round x to 4 dps. 0 Let f = 858 + -857.9999998184. What is f rounded to seven dps? 0.0000002 Let c = 152823533 + -36023534. Let t be c/(-4) - 5/20. Round t to the nearest 1000000. -29000000 Suppose -4k + 10 = s - 164, -k - 457 = -3s. What is s rounded to the nearest ten? 150 Let l = -422 - -779. Suppose -b = -3v + 3666, -2452 = -2v - 0b - 2b. Suppose -c + l = -v. What is c rounded to the nearest 100? 1600 Let i = 14.0416 + -0.1316. Round i to the nearest integer. 14 Let b = -11.5 - -10. Let t = -1.93 - b. Let d = -0.76 - t. Round d to 1 decimal place. -0.3 Let s be 7(-2 + 330 + 2). Let y = -1290 - s. What is y rounded to the nearest one thousand? -4000 Let n = -15283 - -15288.00048. Let l = -18 + 13. Let k = n + l. What is k rounded to four decimal places? 0.0005 Let s = -5080 - -12645. Let n = 12 - 12. Suppose n = 2t - 35565 + s. What is t rounded to the nearest one thousand? 14000 Let i = 15.92 + -16. Let t = -1858480 + 1858479.9200027. Let a = t - i. Round a to seven decimal places. 0.0000027 Let k = -37.015 + 37. Let b = k + 0.155. What is b rounded to 1 dp? 0.1 Let p = -55.9 - -75. Let w = 3.1 - p. Let i = w + 15.99999985. Round i to 7 dps. -0.0000002 Let o = -452 - -452.0000703. What is o rounded to 5 decimal places? 0.00007 Suppose s + 5p - 14370 = 0, -9s = -10s + 5p + 14320. What is s rounded to the nearest one hundred? 14300 Let f = 501.00001055 + -501. What is f rounded to six decimal places? 0.000011 Let h(j) = 14998j - 16. Let y = 16 + -24. Let k be h(y). What is k rounded to the nearest one hundred thousand? -100000 Let q = -36 - -46.5. Let w = q + -22.2. Let a = -13 - w. Round a to 1 dp. -1.3 Let z = 0.32 + 0.02. Let b = 0.33994 - z. Round b to four decimal places. -0.0001 Let s be (-7710)/5173/(-3). Suppose y = s - 12922. Round y to the nearest ten thousand. 80000 Let z = 64.1408 + -64. Let r = -0.14883 + z. Round r to three decimal places. -0.008 Let s(i) = 33310i*2 + 3i + 1. Let l be s(-2). Suppose 0 = x + 5n + l, 5 = -4n - 7. Let p = x - -237220. Round p to the nearest ten thousand. 100000 Let j be (-21)/(-35) + 1753/(-5). Round j to the nearest 1000. 0 Let u = -458.2 + 413. What is u rounded to the nearest one hundred? 0 Let v = 157.884 - 156.4. What is v rounded to 1 dp? 1.5 Let b = 98.72 - 95. Let a = -0.28 - b. Let c = 4.00003 + a. Round c to four dps. 0 Let o(w) = -56w3 + 27w*2 - 47w - 20. Let d be o(-12). Round d to the nearest one hundred thousand. 100000 Suppose -7q = -6q + 28481. Let u = q + 8181. What is u rounded to the nearest 1000? -20000 Let h = 0.11 - 0.3. Let q = 0.49716 + -0.687154. Let l = q - h. Round l to five decimal places. 0.00001 Let l = -721 + 749.2. Let v = 452642505.2000159 - 452642477. Let w = v - l. Round w to 6 dps. 0.000016 Let w be (91/(-21) - -7)(-501)/4. What is w rounded to the nearest 100? -300 Suppose -46761277 = 5u + 4838723. What is u rounded to the nearest one hundred thousand? -10300000 Let l = 3991 - 4097.11. What is l rounded to zero dps? -106 Let r = -48 + 82. Let t = 49 - r. Let m = 15.12 - t. What is m rounded to one dp? 0.1 Let f = -10 + 2. Let l = -8.00011 - f. Round l to four decimal places. -0.0001 Let i = 0.16 - -2.84. Let j = -2.99999998 + i. Round j to 7 decimal places. 0 Let a be -1 + (-1 - 18) - 1. Let q = a - 0. What is q rounded to the nearest 10? -20 Let p = 1412920 + -1412923.200095. Let g = -3.2 - p. Round g to 5 decimal places. 0.0001 Let b = -29 - -37. Let f = -8.058 + b. Let y = f - -0.0579969. What is y rounded to six dps? -0.000003 Let q = -30.59 + 0.59. Let k = 5257735.00041 - 5257705. Let i = q + k. Round i to 4 decimal places. 0.0004 Let k = 9.8 - 60.8. Let n = k + 65.7. Let l = n - 14.7000069. What is l rounded to 6 decimal places? -0.000007 Let t = -13.17 + 12.5. Let d = t - -1.12. What is d rounded to 1 decimal place? 0.5 Let z(h) = 2h3 - 7h*2 - 8h - 12. Let m be z(8). Let g be -254m-5. What is g rounded to the nearest 100000? 300000 Suppose -2x - 4n = -1680875 - 2435117, 0 = -n - 2. Round x to the nearest one hundred thousand. 2100000 Let w = 1342 - 1341.825. Round w to zero dps. 0 Let i be 50015 + 1/(1 - 0). Let s = i - 27616. Round s to the nearest one thousand. 22000 Let i = 0.1056 + -216.6056. Round i to the nearest 10. -220 Let g = -35.023 - -35. Let b = g + -48.977. Let s = -48.31 - b. Round s to one decimal place. 0.7 Let j = -41617 + 41647.999. Let h = -31 + j. Round h to 3 decimal places. -0.001 Let u = 63 + -37. Let z = 5 - u. Let f = -22.7 - z. What is f rounded to the nearest integer? -2 Let i = -7 - -6.9. Let a = 30.1 + i. Let p = 31.06 - a. Round p to one dp. 1.1 Let q = -68893.9067 + 68891. Let w = q - -2.9. Round w to three decimal places. -0.007 Let f = 103 + -137. Let q = f - -34.000003. What is q rounded to five decimal places? 0 Let q = -150.60000238 + 150.6. Round q to five decimal places. 0 Let y = 148.98 + -151. What is y rounded to one decimal place? -2 Suppose -h = 3, -1977 = 3d - 4h + 6093. What is d rounded to the nearest one hundred? -2700 Let j = 12.999936 - 13. Round j to 5 decimal places. -0.00006 Suppose -3h = -v + 22, 11 + 4 = -3h. Suppose 6c - 61000 = vc. Round c to the nearest one thousand. -61000 Let r be ((-6)/(-5))/((-1)/(-355)). Suppose 16 = -5t + 9t. Suppose -z + r = -tz. Round z to the nearest ten. -140 Let j = -133 + 28. Let f = j + 105.00000109. Round f to seven decimal places. 0.0000011 Let v = 70.3 - 199.1. Let o = 160 - 315. Let u = v - o. Round u to the nearest integer. 26 Let h = 279417 - 1194181. Let f = -483938 - h. Suppose -510012 = s - 3t, 0 = -s + t - f - 79178. Round s to the nearest 100000. -500000 Let y = -298397172 - -298397230.9999961. Let v = -50 - 9. Let g = v + y. Round g to 6 decimal places. -0.000004 Suppose 0 = 5j + 15, -4j - 18 = -0w - 3w. Let h = 18 - 9. Suppose -h = 3c, -5o = -o + wc - 239994. Round o to the nearest 100000. 100000 Let l = 5.7301074 + -5.73. What is l rounded to 5 decimal places? 0.00011 Let f(c) = 2c. Let j be f(3). Suppose 10 - j = v. Let q(d) = 41251d*2 - 3d - 4. Let l be q(v). What is l rounded to the nearest one hundred thousand? 700000 Let q = -3237 + 4982. Suppose 2m = 7m - q. Suppose -m = 4*f + 131. What is f rounded to the nearest 100? -100 Let d = -983 + 982.999995752. What is d rounded to seven decimal places? -0.0000042 Let y be (((-53400)/(-9))/(-4))/((-3)/(-72)). What is y rounded to the nearest one hundred thousand? 0 Let i = 35 + -17. Let c = -17.9997 + i. Round c to 4	{ "pile_set_name": "DM Mathematics" }
102? 3u2 + 2u - 18 What is the n'th term of -4, -12, -42, -106, -216, -384? -2n3 + n2 + 3n - 6 What is the u'th term of -30, -31, -32, -33, -34, -35? -u - 29 What is the p'th term of 292, 545, 782, 997, 1184, 1337, 1450? -p*3 - 2p*2 + 266p + 29 What is the y'th term of 53, 56, 59, 62, 65? 3y + 50 What is the a'th term of -42, -89, -134, -177? a2 - 50a + 7 What is the g'th term of -32, -43, -62, -89? -4g2 + g - 29 What is the x'th term of 10, 38, 84, 148, 230? 9x2 + x What is the m'th term of 1, -11, -37, -83, -155? -m3 - m*2 - 2m + 5 What is the k'th term of -237, -456, -675, -894, -1113? -219k - 18 What is the f'th term of -48, -86, -122, -156, -188, -218, -246? f2 - 41f - 8 What is the r'th term of 427, 857, 1287, 1717, 2147? 430r - 3 What is the u'th term of 426, 428, 430, 432, 434, 436? 2u + 424 What is the q'th term of -2323, -4645, -6967? -2322q - 1 What is the s'th term of -88, -212, -426, -736, -1148, -1668, -2302? -s3 - 39s*2 - 48 What is the k'th term of 73, 297, 685, 1249, 2001? 2k*3 + 70k2 + 1 What is the m'th term of -51, -31, -3, 27, 53, 69, 69, 47? -m3 + 10m2 - 3m - 57 What is the z'th term of -634, -1262, -1890, -2518, -3146, -3774? -628z - 6 What is the x'th term of -44, -99, -154, -209? -55x + 11 What is the l'th term of 42, 27, -10, -81, -198? -2l3 + l2 - 4l + 47 What is the k'th term of -120, -159, -198, -237? -39k - 81 What is the w'th term of -21, -70, -153, -270, -421, -606? -17w*2 + 2w - 6 What is the q'th term of -1727, -1726, -1725, -1724, -1723, -1722? q - 1728 What is the d'th term of 303, 605, 907, 1209, 1511? 302d + 1 What is the w'th term of -323, -639, -951, -1259? 2w*2 - 322w - 3 What is the n'th term of 178, 177, 176? -n + 179 What is the b'th term of 48571, 48570, 48569, 48568, 48567? -b + 48572 What is the p'th term of 30, 79, 146, 231, 334? 9p2 + 22p - 1 What is the g'th term of -25, -120, -289, -532, -849? -37g2 + 16g - 4 What is the g'th term of -38, -40, -44, -50, -58, -68? -g2 + g - 38 What is the m'th term of 581, 2317, 5203, 9233, 14401, 20701, 28127, 36673? -m3 + 581m2 + 1 What is the j'th term of -456, -945, -1434, -1923, -2412? -489j + 33 What is the t'th term of -58, -114, -170, -226, -282, -338? -56t - 2 What is the u'th term of -1596, -3182, -4766, -6348, -7928? u2 - 1589u - 8 What is the x'th term of 45, 154, 307, 480, 649? -4x3 + 46x*2 - x + 4 What is the l'th term of -28, -20, -4, 20? 4l*2 - 4l - 28 What is the c'th term of 4, 6, 8, 10, 12, 14? 2c + 2 What is the g'th term of -216, -252, -302, -372, -468, -596? -g3 - g2 - 26g - 188 What is the z'th term of 14, 34, 64, 110, 178, 274, 404, 574? z3 - z2 + 16z - 2 What is the l'th term of -33, -95, -199, -345? -21l2 + l - 13 What is the p'th term of 1, 13, 39, 85, 157, 261, 403, 589? p3 + p*2 + 2p - 3 What is the z'th term of -56, -49, -44, -41, -40, -41, -44? -z*2 + 10z - 65 What is the q'th term of -13, -14, -15, -16, -17? -q - 12 What is the s'th term of -29, -53, -77, -101? -24s - 5 What is the t'th term of 4, 27, 50, 73, 96? 23t - 19 What is the k'th term of 20, 95, 226, 413, 656? 28k2 - 9k + 1 What is the f'th term of -200, -403, -606? -203f + 3 What is the g'th term of -414, -822, -1228, -1632, -2034, -2434? g2 - 411g - 4 What is the t'th term of -151, -556, -1213, -2122, -3283, -4696? -126t2 - 27t + 2 What is the x'th term of 55, 107, 159, 211, 263, 315? 52x + 3 What is the i'th term of 355, 354, 351, 346, 339? -i2 + 2i + 354 What is the f'th term of 2543, 2548, 2567, 2606, 2671, 2768, 2903? f3 + f2 - 5f + 2546 What is the n'th term of 53, 54, 55? n + 52 What is the h'th term of 25, 27, 37, 61, 105, 175, 277? h3 - 2h*2 + h + 25 What is the u'th term of 135, 287, 439, 591, 743? 152u - 17 What is the c'th term of -3, -2, 9, 36, 85? c3 - c2 - 3c What is the p'th term of -13, -42, -97, -184, -309, -478, -697? -p3 - 7p*2 - p - 4 What is the o'th term of -37, -88, -173, -292, -445, -632, -853? -17o2 - 20 What is the b'th term of -112, -209, -304, -397, -488, -577, -664? b2 - 100b - 13 What is the f'th term of 53, 18, -17, -52, -87? -35f + 88 What is the y'th term of 348, 347, 346, 345, 344, 343? -y + 349 What is the s'th term of 115, 252, 483, 814, 1251, 1800? s*3 + 41s*2 + 7s + 66 What is the t'th term of 324, 635, 928, 1191, 1412, 1579? -2t3 + 3t*2 + 316t + 7 What is the m'th term of 1430, 1432, 1434, 1436, 1438, 1440? 2m + 1428 What is the d'th term of 3106, 3108, 3110, 3112? 2d + 3104 What is the f'th term of 6277, 6280, 6285, 6292, 6301? f*2 + 6276 What is the x'th term of 343, 690, 1033, 1372, 1707, 2038? -2x*2 + 353x - 8 What is the s'th term of 24, 10, 6, 18, 52, 114, 210, 346? s3 - s2 - 18s + 42 What is the c'th term of 6112, 6118, 6128, 6142, 6160? 2c*2 + 6110 What is the b'th term of 412, 411, 410, 409, 408, 407? -b + 413 What is the v'th term of 4827, 4834, 4845, 4860, 4879, 4902, 4929? 2v*2 + v + 4824 What is the b'th term of -9, -9, 7, 51, 135, 271, 471? 2b*3 - 4b*2 - 2b - 5 What is the w'th term of -20, 1, 64, 193, 412, 745? 4w3 - 3w*2 + 2w - 23 What is the s'th term of 6, 7, 8, 9, 10, 11? s + 5 What is the h'th term of 98, 80, 28, -76, -250? -3h3 + h2 + 100 What is the a'th term of 137, 134, 131? -3a + 140 What is the t'th term of -52, -60, -80, -118, -180? -t3 - t - 50 What is the k'th term of 22, 11, -12, -53, -118, -213, -344? -k3 - 4k + 27 What is the v'th term of -57, -118, -179, -240, -301, -362? -61v + 4 What is the p'th term of -1, 0, 3, 8, 15, 24? p*2 - 2p What is the y'th term of -6755, -13508, -20261, -27014? -6753y - 2 What is the h'th term of -33, -37, -49, -75, -121, -193, -297, -439? -h3 + 2h*2 - 3h - 31 What is the w'th term of 12, 33, 72, 135, 228? w*3 + 3w*2 + 5w + 3 What is the m'th term of 1320, 1321, 1322, 1323, 1324? m + 1319 What is the d'th term of 530, 535, 544, 557, 574? 2d2 - d + 529 What is the s'th term of -388, -317, -246, -175, -104, -33? 71s - 459 What is the r'th term of 535, 1073, 1613, 2155? r*2 + 535r - 1 What is the h'th term of 27, 49, 71? 22h + 5 What is the z'th term of -6, 4, 26, 66, 130, 224? z3 + 3z - 10 What is the p'th term of -73, -91, -135, -217, -349, -543, -811? -2p3 - p2 - p - 69 What is the h'th term of 63, 203, 425, 729, 1115, 1583? 41h*2 + 17h + 5 What is the s'th term of 10, 17, 26, 37, 50, 65, 82? s*2 + 4s + 5 What is the g'th term of -13, -26, -39? -13g What is the j'th term of 557, 1118, 1681, 2246, 2813, 3382? j2 + 558j - 2 What is the r'th term of 80, 79, 78, 77? -r + 81 What is the p'th term of 2, 137, 500, 1205, 2366? 19p3 + 2p - 19 What is the v'th term of -29, -122, -269, -464, -701? v*3 - 33v*2 - v + 4 What is the s'th term of 49, 182, 401, 706? 43s*2 + 4s + 2 What is the c'th term of 11, 20, 23, 20, 11, -4? -3c2 + 18c - 4 What is the q'th term of -5304, -10601, -15886, -21153, -26396? q*3 - 5304q - 1 What is the b'th term of 0, -21, -58, -111? -8b2 + 3b + 5 What is the p'th term of -10, -51, -118, -211, -330? -13p2 - 2p + 5 What is the q'th term of -16, -7, -12, -37, -88, -171, -292, -457? -q3 - q2 + 19q - 33 What is the h'th term of 59, 4, -137, -406, -845, -1496? -7h3 - h2 - 3h + 70 What is the j'th term of -159, -316, -475, -636, -799, -964? -j2 - 154j - 4 What is the r'th term of -21, -100, -231, -414, -649? -26r2 - r + 6 What is the n'th term of 2434, 2432, 2430, 2428? -2n + 2436 What is the l'th term of -155697, -155704, -155725, -155766, -155833? -l3 - l2 + 3l - 155698 What is the q'th term of -185, -355, -525, -695? -170q - 15 What is the s'th term of 180, 367, 552, 729, 892, 1035? -s*3 + 5s*2 + 179s - 3 What is the f'th term of -59, -72, -85, -98? -13f - 46 What is the v'th term of 93, 9, -131, -327, -579, -887? -28v*2 + 121 What is the c'th term of 192, 194, 196, 198? 2c + 190 What is the w'th term of -282, -1134, -2554, -4542, -7098? -284w2 + 2 What is the h'th term of 4, 47, 88, 127? -h2 + 46h - 41 What is the p'th term of -4, 1, 20, 59, 124, 221, 356, 535? p3 + p2 - 5p - 1 What is the w'th term of 0, -26, -54, -84? -w2 - 23w + 24 What is th	{ "pile_set_name": "DM Mathematics" }
y - 3. Does 7 divide x(l)? True Let l(b) = -b2 - 52b - 228. Let t be l(-41). Suppose -5g - 2c + 2759 = 0, 4g - 1977 = 2c + t. Is g a multiple of 26? False Let w(m) = -m*2 - 8m - 5. Let r(b) = -b*2 - 7b - 14. Let g be r(-5). Let o be w(g). Suppose -x + o = 1. Does 5 divide x? True Suppose 107f = 103f + 2480. Suppose 136d = 132d + f. Does 25 divide d? False Let n(c) = 14c - 387. Let k be n(14). Let b = 512 + k. Is 8 a factor of b? False Let b(j) = j2 - 5j - 2. Let p be b(-1). Suppose ps = -20, -2s - 380 = -4d + 630. Is d a multiple of 10? True Is 16 a factor of ((-1)/(-12)74)/((-89)/(-95586))? False Let o(f) = f*3 + 60f*2 - 24f + 1083. Is 42 a factor of o(-59)? False Suppose 4u = -2297 + 6601. Suppose d + 1 = 0, 2j - u = -2d - 2. Suppose 4c + 4n = 544, 0 = 4c + 4n - 6n - j. Is c a multiple of 24? False Suppose -48 - 4 = -u. Suppose -5o + u = 42. Suppose 0 = -13t + ot + 2244. Does 34 divide t? True Is 3 a factor of -18 + 2389 + -16 + 9? True Does 189 divide 393008/7 - (-2 - (11 - 24))? True Let g(a) = -a2 + 0a*2 + 4a + 2 - 15a. Let s be g(-7). Suppose -4b + x = -66, -2b + 0b - x + s = 0. Is b a multiple of 3? False Let g be (-725)/35 + ((-8)/14)/2. Let a = 21 + g. Suppose a = 24n - 20n - 696. Is 22 a factor of n? False Suppose -d + 4d + 3 = 3m, -5m + 5 = -3d. Let y be d4/16 - -43. Is 9 a factor of y/(-15) + 4074/30? True Let z(s) be the first derivative of 2s3/3 + s2/2 + 2s + 8. Let m(b) = -b*3 - 6b*2 - 44. Let g be m(-7). Is 57 a factor of z(g)? True Let m be 9/12 + (-16479)/(-12). Suppose -3b - 2043 = -3t, 3t - 5t - 4b + m = 0. Suppose 0l = -5i - l + 890, 4i = 5l + t. Is 11 a factor of i? False Suppose 6f - 4190 = 652. Is 59 a factor of ((-12)/16)/((-12)/32) + f? False Suppose -3o + 36479 = 4d, -d = -10o + 7o - 9146. Is 12 a factor of d? False Let x(m) = -22m*3 + 4m*2 + 14m. Let h be x(-5). Suppose w - 1743 = -2u, -3w + 709 + h = 4u. Is u a multiple of 87? True Suppose 0 = -5x + 5c + 4990, x = 3c + 487 + 523. Is x a multiple of 31? True Let a(h) = -h*3 - 11h*2 - 34h - 17. Let v be a(-13). Suppose -v = -3f - f + 5r, 808 = 4f + 4r. Is f a multiple of 7? False Let h = -160 + 287. Let n = h + -116. Suppose nf - 2040 = -9f. Is f a multiple of 17? True Let d(f) = -2f + 228. Suppose 36o - 40o + 132 = 0. Is d(o) a multiple of 8? False Is (-2)/(-4)((-29628)/(-66) + 0)11 a multiple of 7? False Let j be -13 - (-6)/(-9)3. Let i be 2 + (j/(-5) - 1). Suppose 5p - 117 = -4r + 29, 5r + ip = 178. Is 11 a factor of r? False Suppose 237 = 11v + 3262. Let l = v + 527. Is 6 a factor of l? True Suppose 135900 = 4z - 3y, 4y - 33937 = -16z + 15z. Is z a multiple of 169? True Let d be (-16030)/(-25) - 2 - (-12)/15. Suppose 26v = 36v - d. Is v a multiple of 9? False Let a(g) = -18g + 1887. Is a(-93) a multiple of 205? False Is 10 a factor of (2 + ((-51)/15 - -1))/((-177)/1053150)? True Suppose 518j = -1735 + 367443. Is 13 a factor of j? False Suppose 34r = 5r - 19430. Let q = -542 - r. Is 4 a factor of q? True Suppose 2g - 8g - 41g = -753504. Is g a multiple of 78? False Let f = -89 - -137. Suppose -260 = -15q - 11q. Suppose 2m - q = 0, -s - m + f = -4m. Does 15 divide s? False Let y(j) = -31j*3 + 6j*2 + 3j - 3. Let o be y(4). Let z be (-6)/(-33) - o/11. Suppose -176u + zu = -360. Does 15 divide u? False Let p(g) = -545g - 1175. Does 40 divide p(-7)? True Let k be (154/(-105))/(-11) + (-73)/(-15). Suppose 2r + 774 = kn + 29, -5n - 2r + 745 = 0. Does 11 divide n? False Suppose 26f = 32458 + 34388. Is 11 a factor of f? False Let q(s) = -44s2 - 13s + 21s + 48s*2 + 12. Does 5 divide q(-6)? False Let y = 168 + -82. Suppose yf + 2019 = 89f. Does 10 divide f? False Let b(c) = 162c - 2572. Does 24 divide b(67)? False Let s(j) = -j*3 + 5j*2 + 20j + 2. Suppose -353z + 362z + 45 = 0. Is 23 a factor of s(z)? False Let z = 13036 - -15252. Is z a multiple of 16? True Let m(c) = 5c3 + 275c*2 - 112c + 34. Does 8 divide m(-55)? False Let x(y) = y - 3. Let r be x(10). Suppose 233 = rc - 2294. Is 5 a factor of c? False Suppose -634f - 241704 = -658f. Is f a multiple of 28? False Let k = 2253 + -1085. Is 58 a factor of k? False Let n = -1091 + 4184. Does 3 divide n? True Suppose -5p = 2b - 21450, p + b - 5b - 4290 = 0. Is p a multiple of 11? True Let v = -1523 + 803. Does 24 divide (-52)/((15/v)/(2/4))? True Is 17 a factor of 14722/856/32223? True Is -2237/21(-8 + 2) a multiple of 24? False Let h(b) = -5b + 619. Let l(k) = 7k - 620. Let o(n) = 5h(n) + 4l(n). Does 12 divide o(0)? False Suppose -10d + 914 = -276. Suppose 4u - 161 = d. Is u a multiple of 25? False Let y(h) = -h2 - h + 1. Let n(a) = -a3 + 4a - 7. Let s(r) = -n(r) - y(r). Let p be s(-3). Is (-39)/(1/2p) a multiple of 13? True Let r(w) = 82w2 + 48w - 38. Does 27 divide r(-10)? False Let m(l) = l*2 - 132l + 173. Does 14 divide m(-121)? True Is (-1 - -8885)/(8(-33)/(-1980)) a multiple of 10? True Suppose 36q + 4q - 20880 = 0. Is q a multiple of 21? False Suppose -3l - f + 4126 = 0, -14l + f + 6882 = -9l. Is l a multiple of 8? True Let y(z) = 14z2 - 92z + 522. Does 43 divide y(-32)? True Let x = -2368 + 5464. Is 24 a factor of x? True Let r be (-7)/(-3) + 42/63. Suppose rl - 1979 = -617. Is l a multiple of 18? False Suppose -a + 69 = -125. Let k = a - -110. Is 19 a factor of k? True Let x(g) = 110g*2 - 24g - 136. Does 20 divide x(-4)? True Let g be (-150)/(-3)1 - -5. Let l = g - -127. Does 14 divide l? True Let z(i) = -37i + 0 + 72i + 90i - 3. Let u be z(1). Suppose 2g - g + 5h = u, 4h = g - 95. Is 11 a factor of g? False Let s(i) = 11i + 2 + i*3 + 12i*2 - 4i + 1. Let u(l) = -l3 - l2 + 6l - 11. Let g be u(2). Is s(g) a multiple of 27? False Let h(w) = -30w - 226. Let a be h(-33). Suppose 3v - a = 5p, 3v + 4p - 1057 + 329 = 0. Does 53 divide v? False Let l = -27780 - -51908. Suppose -5h + 37h = l. Is 58 a factor of h? True Does 2 divide 14 + 1095/3 - (-2)/1? False Suppose -16s - 4n - 41250 = -19s, -3s = -3n - 41247. Is 174 a factor of s? True Let y = 333 - -154. Let c = y + -334. Is 21 a factor of c? False Suppose 129j - 7040 = 2377 + 3354. Is j a multiple of 11? True Let m = 593 + -369. Let g = 30 + m. Is 27 a factor of g? False Let s(w) = -16w2 - 12w + 9. Let t(c) = -13c2 - 13c + 10. Let i(p) = -4s(p) + 5t(p). Is i(-15) a multiple of 4? True Let h be 18510/9 - (-3 - (-22)/6). Suppose -5z = -5x - 319 - h, -2z - 2x = -954. Is z a multiple of 14? True Let w(m) = 784m2 + 29m + 29. Does 49 divide w(-1)? True Let q = 14852 - -3481. Does 189 divide q? True Does 6 divide (40 + (3 - 13))96/10? True Let n be (-3)/5 - (-8)/5. Let s be 3 + (-5 - 1)/n. Is 10 a factor of (-4)/s(-19 - -79)? True Let i be (-76)/(-10) - (-4)/10. Let p(k) = 42 + 630k + k2 - 207k - 206k - 212k. Is 26 a factor of p(i)? False Suppose 0 = 59v + 63v - 120v - 9810. Does 109 divide v? True Let t = 37 - 84. Let f = -105 + 88. Let i = f - t. Does 4 divide i? False Let u be ((-3)/(-2))/(6/(-8)) + 1. Is 39 a factor of -6 + 1064 - (u + 6)? True Suppose p - 4b = 4411, 0 = 4p + 2b - 10352 - 7310. Suppose s = -q + 1417, -p + 1569 = -2q - 5s. Is 67 a factor of q? False Let x be ((-13995)/(-12))/5 + (-6)/(-8). Suppose -2q + 396 = 3q - 3c, -3q + 3c = -x. Is 27 a factor of q? True Suppose -3u - 4y + 11 = 0, 5u - 13y - 29 = -17y. Suppose 0 = 3t - u, 3t = -4x + 7t + 2480. Is 82 a factor of x? False Suppose 2b = -p + 5, 4b - 14 = 2p - 48. Let k(c) be the third derivative of c4/24 + 17c*3/3 + 505c*2. Is k(p) a multiple of 9? True Let r be (-84)/(-15) + 8/20. Suppose ro + 105 = 3o. Is 7 a factor of 82/(-5)o/14? False Let d(k) = -2k2 - 2k + 191. Let z be d(0). Suppose -4q = -4b - 523 + z, 0 = 3q - 5b - 247. Is q a multiple of 28? True Let o(l) = l*2 - 14l + 25. Let x be o(12). Let h be x + 58 + (-10 - -7). Let r = h + -18. Does 19 divide r? True Let q = -1711 + 1780. Is 4 a factor of q? False Suppose 6s - 21s = -3360. Let k = s + -194. Is 15 a factor of k? True Suppose 3x - 185 = -3u + 10279, -4*u = x - 3491. Is 11 a factor of x? True Let s = 38512 - 26456. Is 274 a factor of s? T	{ "pile_set_name": "DM Mathematics" }
and -11. 26.873 Subtract 1241.31 from -0.2. -1241.51 Add together 0.3 and -6.27. -5.97 Calculate -4722 + -0.0341. -4722.0341 Calculate 5685 - 0.4. 5684.6 What is 13.076 - 0.2? 12.876 What is the distance between -6.54 and 0.09583? 6.63583 What is -151.7 minus -1.068? -150.632 What is 0.1919 minus 3.8? -3.6081 What is the distance between -2 and -1420? 1418 What is 9019 less than -1? -9020 Add -125 and -12. -137 Calculate 315822 + -3. 315819 -0.4 - -5.7104 5.3104 Add together 0.2 and -43345. -43344.8 Add together 2569202 and -3. 2569199 What is -1 less than -310853? -310852 What is 85828.8 + 0? 85828.8 Work out 94 - -54.3. 148.3 What is -2540 - -0.464? -2539.536 What is -23 minus -0.263? -22.737 Put together 0.174 and 15. 15.174 What is the distance between 838 and 40? 798 Add together 41259.68 and -0.2. 41259.48 -0.43+-2183 -2183.43 Subtract -0.08 from -87. -86.92 Add together -4 and -762. -766 Work out -6 + 2727. 2721 Work out -0.35976 + 2. 1.64024 Sum 613 and 108.19. 721.19 What is 33 plus -1353? -1320 Work out 5.37 - -0.0273. 5.3973 What is 36 - -26004? 26040 What is 904.92 plus 0.038? 904.958 1.57+4 5.57 Work out -16400.4 + -6. -16406.4 Work out -2 - 8087.61. -8089.61 Subtract -58 from -320. -262 Work out -5 + 1292. 1287 Total of 2 and -9766. -9764 Work out 2 - 55.2. -53.2 Add 242 and -1.2. 240.8 Put together 0.1 and 232.4092. 232.5092 Calculate 0.028 - 0.3. -0.272 -1.6521+2 0.3479 -577 + 0.1 -576.9 Work out 0.02 + 1.1406. 1.1606 0.4 + -510 -509.6 Put together -22452 and 1. -22451 What is -0.4 plus -316? -316.4 What is 188 plus 49? 237 Sum 23 and -13.9. 9.1 What is 6921 + -26? 6895 0.3+-238.2 -237.9 What is the difference between -5.74 and 2? 7.74 Add together -0.1 and -1.232. -1.332 601359+0.03 601359.03 What is -4 take away 26212? -26216 Add together -0.4 and 24.91. 24.51 What is 6427.49 less than 2? -6425.49 -3108 + -2 -3110 -1 + -69571 -69572 Add -935.38 and 1. -934.38 Work out -2158 + 8. -2150 -3 + -0.425 -3.425 Add together 108.821 and 0.043. 108.864 -2.4 - -0.66732 -1.73268 What is -4 plus 4807? 4803 Total of -3 and 4373. 4370 Work out 2.99 - 35. -32.01 Calculate 30 + -1405. -1375 What is 15 plus -2.43? 12.57 What is 0.05627 take away -4? 4.05627 What is 0.4 - 80.88? -80.48 Add together 286.58 and 0.1. 286.68 What is -564066 - 0.2? -564066.2 Subtract -2 from 46343. 46345 -5.8 - 53.49 -59.29 Put together 7.3 and -3.029. 4.271 Subtract 8945 from 74. -8871 -0.4 - 41.013 -41.413 Calculate 1607172 + 1. 1607173 Calculate -0.28489 - 0.9. -1.18489 What is -103.3 less than 504? 607.3 Put together -1799 and 0.4. -1798.6 Calculate 13788 - 1. 13787 Calculate 0.5 + 8942. 8942.5 Work out -168524 - -0.6. -168523.4 Calculate -1364 - 166. -1530 Work out 1178.039 + -0.1. 1177.939 Work out 7466514 - 4. 7466510 What is 0.04972 take away 14.52? -14.47028 Sum -1.5 and 56. 54.5 Add -1.3 and 4523.4. 4522.1 What is the distance between 0.6 and -233? 233.6 Add 0.17 and -1971. -1970.83 What is 0.4434 + 34? 34.4434 What is 10701 - -39.4? 10740.4 Work out 163 + -616. -453 Sum 2111558 and 3. 2111561 -395 + 0.3 -394.7 What is the distance between -5086 and -4? 5082 Calculate 12 - 125. -113 29.74509 + -0.2 29.54509 Calculate 0.2 + -38105. -38104.8 0.0154 - 810 -809.9846 0.3 + 0.4273 0.7273 What is 4 - -1347? 1351 -2+0.019437 -1.980563 Work out 0.4964 + -107. -106.5036 Calculate 0.677 + -0.084. 0.593 Calculate -0.2 + -896. -896.2 What is -12 plus 5? -7 Calculate 10288 - -1. 10289 What is -94 less than 0.107? 94.107 Sum -4180 and -0.015. -4180.015 Work out 235545 + 0.09. 235545.09 Put together 0.31 and -17.1. -16.79 What is 3873 less than -0.057? -3873.057 Calculate -440 + 14. -426 7 - -0.24142 7.24142 What is -0.056643 + 0.2? 0.143357 737 + 1 738 What is -709017 less than -2? 709015 -3 + 746 743 What is the difference between 6.98 and -0.6? 7.58 What is -0.01 take away -5.279? 5.269 1.5 - 10358 -10356.5 Calculate 1243 + 0.1. 1243.1 Calculate -0.3 - 1154. -1154.3 Put together -0.05 and -10.42. -10.47 Put together -113.1 and -2. -115.1 What is 0.016 + -0.6? -0.584 -3 + 0.0553 -2.9447 What is 371263 - -4? 371267 Calculate 1 + 0.026478. 1.026478 What is 43683 plus -8? 43675 -1809.7 - -0.05 -1809.65 Calculate -2.7637 - -0.52. -2.2437 Sum -0.4 and 426.5. 426.1 Calculate -4293 - 0.3. -4293.3 What is 0.2 + 489? 489.2 What is 19.754 - -5? 24.754 Total of 0.49854 and -4. -3.50146 What is the difference between -29300 and -0.07? 29299.93 What is the difference between 0.3 and -11611? 11611.3 What is 32.86 - 5.59? 27.27 What is 5035 minus 0.197? 5034.803 Subtract 38 from -1436. -1474 What is 5 minus -44117? 44122 Add -16784 and 4.08. -16779.92 Work out -34 + 52.2. 18.2 16+16 32 Sum 10.79494 and 0.04. 10.83494 Add together 0.127 and 171. 171.127 What is the distance between -6.2 and -5? 1.2 Add -0.3 and 36417.8. 36417.5 Subtract -0.3 from 36842. 36842.3 What is -1855 take away 14.4? -1869.4 Subtract 3 from 511. 508 Work out 0.8 + 12868. 12868.8 What is -5 plus 835? 830 What is -100.5 - 421.9? -522.4 What is -2.2 + 5320? 5317.8 What is 12355422 + 0.4? 12355422.4 What is the distance between -15 and 0.016? 15.016 What is 0.02397 less than -1.7? -1.72397 What is 1.427 take away 0.1? 1.327 What is -0.7 + 968? 967.3 Sum 0 and -15.192. -15.192 Work out -6 + 21434. 21428 What is -0.097 + -736? -736.097 What is -0.31 take away 0.0093131? -0.3193131 Calculate -4159380 - 1. -4159381 Add together -214.782 and -0.3. -215.082 Sum -2 and -30093. -30095 What is -0.67 less than -2524? -2523.33 What is -99161 take away 4? -99165 What is the difference between 705 and 889? 184 What is 44.2 plus 0.628? 44.828 What is 0.0847 plus -0.03? 0.0547 What is -2.9093 take away -0.9? -2.0093 Total of 160.4 and -25. 135.4 Add -0.49 and -7. -7.49 What is the difference between -2.112 and 5? 7.112 What is -0.5 minus 7271? -7271.5 Add -5 and 44067.3. 44062.3 -0.24 + -199 -199.24 What is the difference between 103269 and -4? 103273 Calculate -8643 - -0.8. -8642.2 Work out 1.36 - 726. -724.64 Add 2 and 781. 783 What is the distance between 9.8193 and 2? 7.8193 What is -2.45 minus -0.16? -2.29 What is -180 less than -1429? -1249 Add -58 and 62102. 62044 Calculate -0.3 + -0.072717. -0.372717 Put together 0.27152 and 0.3. 0.57152 Calculate -51 - -53. 2 What is 49.358 plus -6? 43.358 What is the difference between 299 and -11? 310 Add together -0.314639 and -2. -2.314639 -95+10.1 -84.9 Sum -892 and -2260. -3152 -210.6 - -125 -85.6 Add together 425152 and -3. 425149 What is -2.59 less than -0.4? 2.19 What is -41 less than -0.58? 40.42 What is 48016 minus 0.3? 48015.7 What is 0.01 minus 106189? -106188.99 What is 0.1 take away -8.2? 8.3 What is the difference between -0.1 and 3776? 3776.1 Add together -7 and -3211. -3218 What is 49 minus -281? 330 What is the difference between -114 and 0.59371? 114.59371 What is 0.4 less than -20.3559? -20.7559 1.0799+0.041 1.1209 9318 + -0.26 9317.74 Calculate -0.03 + 708. 707.97 Total of -6.863 and -1. -7.863 Work out 0.89 + 0. 0.89 Add 76 and 30428. 30504 What is -0.20073 - 0? -0.20073 Total of 66.023 and -2. 64.023 What is the distance between 0.043 and -132.51? 132.553 2234 + -0.14 2233.86 2 - 223 -221 What is the difference between 14.1 and 28.37? 14.27 Add 30.8 and -547. -516.2 What is the distance between 2.229 and -28? 30.229 Calculate -5 - -11.04848. 6.04848 Add together 0.4 and 53415.3. 53415.7 Calculate 1 + -2.48. -1.48 Sum -5 and -2352. -2357 Add -16 and 6824. 6808 What is -7 - 1525? -1532 Sum -18.6 and 0.487. -18.113 Add together 0.1 and 1951.534. 1951.634 What is 0.4 - 1705789? -1705788.6 What is -318 less than -0.111? 317.889 Work out 0.2 - -167888. 167888.2 Put together 131 and -0.67. 130.33 Work out 5 - -1484411. 1484416 What is -0.23 + -15.27? -15.5 Total of 3.94 and 2.3. 6.24 Put together -18 and -273. -291 Put together -514112 and -0.1. -514112.1 What is 10.52 less than 13.7? 3.18 Add -3 and 931. 928 -3 + -11.33 -14.33 1152 + 0.09 1152.09 Sum 0.4 and 13589. 13589.4 Total of -105 and 93545. 93440 What is -2 less than 195.1? 197.1 Calculate 0.2427 - -0.5. 0.7427 -0.2 + 3.36 3.16 What is 4 - -0.0532? 4.0532 -15.9 - -3331 3315.1 What is the difference between -185 and 1.3? 186.3 0.05+-296732 -296731.95 What is -0.28 take away -1676? 1675.72 What is 5.931 less t	{ "pile_set_name": "DM Mathematics" }
sqrt(136) + -3sqrt(136)-2 + sqrt(136) - (sqrt(136)-2 - sqrt(136))1))/(sqrt(8)-2-1 + (sqrt(88) - 2sqrt(88))/sqrt(11)))2. 39168 Simplify (0 + 2-2-5((sqrt(99)-1 + sqrt(99) + sqrt(99))3 + -3))*2. -21600sqrt(11) + 360000 Simplify (3 + (sqrt(448)-4)/sqrt(4) + -5 + -1(sqrt(700) + -1 + 2 + sqrt(700) + 5))*2. 576sqrt(7) + 9136 Simplify (4 + (sqrt(11) - -3sqrt(11) - sqrt(11)) + (0 + sqrt(11))6 - (sqrt(891)-2 + sqrt(132)/(sqrt(48)/sqrt(4))))2 + 4. 208sqrt(11) + 7456 Simplify (2 + -2sqrt(52) + (sqrt(13) + -1 - sqrt(13))-6 + 4)*2 + (-1 + sqrt(1872) + (sqrt(130)/(sqrt(10)1))*2)2. -72sqrt(13) + 376 Simplify ((0 + 1 + sqrt(275) + sqrt(275) - sqrt(275)) + sqrt(275) + 4 + -1sqrt(275)-11)321. 30 + 90sqrt(11) Simplify ((3sqrt(190) + sqrt(190) - sqrt(190) - sqrt(190))/sqrt(10) - 1(sqrt(19) + -4 + sqrt(19) - sqrt(19))) + sqrt(19) + 1 + -1 + (sqrt(2736) + 0)*2 + -1. 2sqrt(19) + 2739 Simplify (3 + 1 + (-5sqrt(136)-2-2)/(sqrt(8)-15 + (sqrt(512)1 - sqrt(8))))*2. -80sqrt(17) + 1716 Simplify ((sqrt(99)-1 + 1)2 + sqrt(44)/(sqrt(64)1)-1)*2. -25sqrt(11) + 6939/16 Simplify -1 + ((1sqrt(108)5)*2 - (sqrt(108) + (sqrt(108)-1)*2 + 4 + sqrt(108))) + 5. -12sqrt(3) + 2592 Simplify (sqrt(176)/(sqrt(88)/(sqrt(16)/sqrt(2)) + sqrt(11)))/(sqrt(648)-24)-6. sqrt(2)/24 Simplify ((-3-2sqrt(204) + sqrt(204))/sqrt(12) + -3 + (sqrt(850)-1 - sqrt(850))/(sqrt(8)/sqrt(4)-5 + sqrt(2)))-5. -95sqrt(17)/2 + 15 Simplify 5 + 6(sqrt(147) + 5 + sqrt(147)) + 6(sqrt(3) - 6sqrt(48)). -54sqrt(3) + 35 Simplify (sqrt(153)/(sqrt(9)-1) + ((sqrt(425))*2 - sqrt(17))6 - (4 + ((sqrt(425)2)2 - sqrt(425))2))3. -2562 + 9sqrt(17) Simplify (((-2sqrt(180)-6)2 - (1 + sqrt(180) + -1)2) + 5 - (4 + (sqrt(180) + -1)1 + 5))-5. -128685 + 30sqrt(5) Simplify ((sqrt(171)41 - (sqrt(171) - (sqrt(171) + 4)-3)) + -5(sqrt(171) - -6(sqrt(171) + -2sqrt(171))) + -5)2. -2550sqrt(19) + 107164 Simplify -4 + -1-3sqrt(8) + (sqrt(72) + sqrt(72) + -2 + -4 - -3sqrt(72)-2)*2. 294sqrt(2) + 1184 Simplify (4sqrt(24)/(sqrt(16)/sqrt(2))-2 - (sqrt(3) + (sqrt(243) - (sqrt(243) + 2))*2 + 2(sqrt(3) + -1)*2))-1. 5sqrt(3) + 12 Simplify 5(0 + 0 + 1sqrt(80) + (sqrt(30) + (-1sqrt(330) + sqrt(330))/sqrt(11))/(sqrt(24)/sqrt(4)-1))2. 225 Simplify ((2 + 3sqrt(475))-6 - (sqrt(171) - 2(sqrt(171) + sqrt(171)2))/(sqrt(27)/sqrt(3)2))-5. 60 + 875sqrt(19)/2 Simplify (-1 + (sqrt(1620) + -1sqrt(1620))/((sqrt(70) + (sqrt(70)1 - sqrt(70)))/sqrt(7)) + 1)*2. 0 Simplify (sqrt(7344) - (sqrt(7344) + 1sqrt(7344)))/(sqrt(9)/sqrt(3)2) - ((-2sqrt(425) + sqrt(425))*22 - (-4 + -1 + sqrt(425) + sqrt(425))). -855 + 4sqrt(17) Simplify (-1-2sqrt(68)14)/(sqrt(396)/(-5sqrt(22)/sqrt(2))). -40sqrt(17)/3 Simplify -6(-3(sqrt(136) - (sqrt(136) - (sqrt(136) + 4-2sqrt(136) + sqrt(136))))-5)/(-5sqrt(64)/(1sqrt(72))). -324sqrt(17) Simplify (-2-3sqrt(68) + sqrt(68)1-5)/(-1sqrt(144)-5 - (sqrt(144) - sqrt(144)-16)). -sqrt(17)/12 Simplify ((1(sqrt(600)1 - sqrt(600)) + -3(sqrt(600) + (sqrt(600)-2 - sqrt(600)) - sqrt(600)))-3)/(sqrt(108)-2 - (sqrt(108)-3 + sqrt(108) + sqrt(108))). 45sqrt(2) Simplify 2((-3(-5 + (sqrt(13) - sqrt(325))) + ((sqrt(3328) - sqrt(3328)-4) + sqrt(52))/sqrt(4))2 + 0)2. 12720sqrt(13) + 293936 Simplify (1sqrt(130)-33)/(2(sqrt(10) - ((sqrt(60)/sqrt(2))/sqrt(3) - sqrt(10)))). -9sqrt(13)/2 Simplify (6(-5 + -2(sqrt(96)/sqrt(3) + sqrt(32)) + (5sqrt(128)/sqrt(4) - sqrt(32) - sqrt(32)) + -3))*2. 2304sqrt(2) + 3456 Simplify (-2sqrt(136)-1 + sqrt(136))/(sqrt(512) - (sqrt(512)2 + sqrt(512))) + (sqrt(1224)/sqrt(2) - (-2sqrt(85))/sqrt(5)). 125sqrt(17)/16 Simplify 4 + ((sqrt(19)-33)2 + (sqrt(57) - sqrt(1425))/sqrt(3) - ((0 + (sqrt(171) + -2 - sqrt(171) - sqrt(171)))2 + -2)). -16sqrt(19) + 1370 Simplify -4(2((2sqrt(1575)-3 - sqrt(1575))-1 + 5)3)*2. -11116800 - 151200sqrt(7) Simplify (-3sqrt(375)4 + (sqrt(375) - (-3sqrt(375) - sqrt(375))2))/(2(sqrt(6)/sqrt(2) + sqrt(3))62-3). 5sqrt(5)/48 Simplify (-3(6sqrt(448)-1 - (sqrt(448)1 + 4)) - (1(4 + sqrt(448)) + -4)-6)2. 5184sqrt(7) + 326736 Simplify (2(sqrt(117) - (sqrt(117) + sqrt(117)-3)) + 3(sqrt(117) - (sqrt(117)2 - sqrt(117))))/((sqrt(1089) - (1sqrt(1089) - sqrt(1089)))5-2). -3sqrt(13)/55 Simplify ((1sqrt(378))/sqrt(6) + sqrt(1008)-5 - (sqrt(7)4-3 - -5(sqrt(7) + 1)))25. 2500sqrt(7) + 87625 Simplify (1sqrt(500) + 4 + (0 + sqrt(500) + -2 + sqrt(500))*2 + -5(-2 + sqrt(500)) + sqrt(500) + 2)3. -330sqrt(5) + 6060 Simplify (-3 + ((sqrt(405) - (sqrt(405) + 1)) + 1 - -5-1sqrt(405)))*2 - ((2sqrt(405)-5 - sqrt(405) - (-1 + sqrt(405) + 0))2 + -5). -48182 + 486sqrt(5) Simplify (-5(sqrt(200) - (0 + sqrt(200)-1)))*2 + -4 + (1 + ((1 + sqrt(162))4 - sqrt(162)) + sqrt(162) + 3)*2. 576sqrt(2) + 22652 Simplify -4(3 + (-3sqrt(832)-2 - (sqrt(832) + (sqrt(832) - (1 + sqrt(832))6))*2) + 3) + -2 + 0. 1344sqrt(13) + 53366 Simplify 3(((sqrt(2057) - -2sqrt(2057)-6) + sqrt(2057) + sqrt(2057))2 + -5 - (3 + sqrt(2057)-2 + -2)*2)-2. -950298 - 264sqrt(17) Simplify ((5 + -2 + 3 + (sqrt(300)-3-1 - (sqrt(300) + 3(sqrt(300)2 - sqrt(300)) + sqrt(300))))1)*2. -240sqrt(3) + 1236 Simplify -3 + -5sqrt(162) + -1 - ((sqrt(162) - ((sqrt(162) + sqrt(162) + 0)-6 + sqrt(162)))*2 + -4 + 5). -23333 - 45sqrt(2) Simplify ((1 + sqrt(1100) + (sqrt(1100) - (-2sqrt(1100) + sqrt(1100)))2)-3 - 3(sqrt(1100) - (sqrt(1100) - (sqrt(1100) + 0 + sqrt(1100))))2-2) + 2. -30sqrt(11) + 13199 Simplify (6((5 + (sqrt(468) - 1sqrt(468)))-2 - -1(1 + sqrt(208))))2. -2592sqrt(13) + 10404 Simplify ((2(sqrt(8) - sqrt(8)-1) - sqrt(8) - sqrt(32)2)-3)/(sqrt(4) - sqrt(576) - (sqrt(1440) - sqrt(40))/sqrt(10)). -3sqrt(2)/16 Simplify 2 + (-5(sqrt(12)/(sqrt(6)-1) + 5)-1 + -2)5. -25sqrt(2) + 117 Simplify -5(6(sqrt(891) - (sqrt(891)-3)2 - sqrt(891))-6 + -3sqrt(891)-33). -1443420 - 1215sqrt(11) Simplify (3(2 + -6(-3 + (sqrt(208) - (sqrt(208) + -3 + sqrt(208) - sqrt(208))) - sqrt(208)) + 2(sqrt(208) - -5(sqrt(208) + 3sqrt(208)))))2. 6912sqrt(13) + 4313124 Simplify (3(-3 + (1 + sqrt(245) - sqrt(245))) + (6(sqrt(500) + sqrt(500) + -1 + sqrt(500)))*2 + -1 + ((-1sqrt(500))*2 + sqrt(500) - sqrt(500)))-4. -650116 + 8640sqrt(5) Simplify 6-3((sqrt(272) - (-2sqrt(272)4)2) + -1 + sqrt(272) + -1 + sqrt(272) + 3)2. -432sqrt(17) + 626652 Simplify (-4 + (((sqrt(320) + 1)-26)2 - (-3(sqrt(320) + 2)6)2) + -3)-4. 32256sqrt(5) + 235036 Simplify (sqrt(1053) - (sqrt(1053) - (sqrt(1053)-1-2)2) - sqrt(1053)) + -1 + 2 - (3((sqrt(13) + sqrt(13) + (sqrt(13)2 - sqrt(13)) + -1)1 + 0))*2. 45sqrt(13) + 3151 Simplify (sqrt(637)1 + sqrt(13) + (-2sqrt(130))/sqrt(10) + (sqrt(1872) + 1)-5-4)*2. 9840sqrt(13) + 787108 Simplify (((-3(1 + -3 + -1 + sqrt(3)) - 1sqrt(33)/((sqrt(22)2)/sqrt(2))) + 3)-5)*2. -2100sqrt(3) + 18075/4 Simplify ((-4 + 1sqrt(5))2 - (sqrt(80) - (sqrt(80) + -3))2) + 2 + (sqrt(50)/(sqrt(10) + -2sqrt(810)))*2. -8sqrt(5) + 4051/289 Simplify (sqrt(192)/sqrt(8)2 - (sqrt(864)-4 + sqrt(24)))/((-2sqrt(108) - sqrt(108) - sqrt(108))-2-2). -25sqrt(2)/48 Simplify ((sqrt(55)/sqrt(5) + 3)*2 - (0 + sqrt(539))) + (sqrt(33) - (sqrt(132) + 6sqrt(132)))/sqrt(3) + 4. -14sqrt(11) + 24 Simplify 2 + (-4 + 1 + ((1sqrt(96))/sqrt(2) + 0)3)2. -72sqrt(3) + 443 Simplify ((3sqrt(297)/sqrt(176) - -2(1 + sqrt(3888))) + -1)-2. -297sqrt(3)/2 - 2 Simplify (sqrt(225)/(sqrt(18)/sqrt(2)) + sqrt(25))/(sqrt(180) + sqrt(20)) + (1 + sqrt(125))-4 + sqrt(125) + (1(0 + sqrt(125)))*2 + 1. -59sqrt(5)/4 + 122 Simplify (-2(((sqrt(3000) - sqrt(3000)3 - sqrt(3000))-2 - sqrt(3000)) + sqrt(3000)))/(((-1sqrt(120))/sqrt(6))/(sqrt(128)1)). 960sqrt(3) Simplify 0 + ((6(0 + sqrt(242)) + sqrt(242) + (sqrt(242)1 + 2 - sqrt(242)))*2 - ((sqrt(20)/sqrt(2))/sqrt(5) - (sqrt(32)/sqrt(4))/sqrt(4))). 308sqrt(2) + 11862 Simplify 3 + (((sqrt(3)4 + 1)-2)*2 - ((sqrt(3)2)*2 + 0)1). 32sqrt(3) + 187 Simplify 1 + -2 + 0 + (sqrt(243) - (-1sqrt(243))*2) + 0 + 1sqrt(243) + 4 + -2 + 5. -237 + 18sqrt(3) Simplify (2(sqrt(187) + sqrt(187)-2))/((sqrt(55)/sqrt(5) + sqrt(11))-4) - ((sqrt(187) + sqrt(187)1)-5)/(-2*	{ "pile_set_name": "DM Mathematics" }
-12). Suppose -56 = f - 6f - 2o, 0 = 3f - bo - 42. What is the greatest common divisor of 3 and f? 3 Let y = -19 - -77. Suppose 172c - 173c = -y. Let r = -36 + c. Calculate the greatest common divisor of 11 and r. 11 Let j be (-1(4 + 1))/(-1). Suppose 12v - jv - 49 = 0. Suppose -vc - 22 = -36. Calculate the greatest common divisor of 6 and c. 2 Suppose -31k = -39k + 96. Suppose -ky + 2u - 232 = -17y, -3u + 228 = 5y. Calculate the greatest common divisor of 80 and y. 16 Let x be (-3 - 108/(-32))-54(-1045 + 45). Calculate the greatest common divisor of 162 and x. 162 Let d(j) = -29j + 268. Let t = -449 - -457. Let a be d(t). Calculate the greatest common factor of 900 and a. 36 Let b be (-78)/10 - (2/10 - 0). Let c = b + 40. Calculate the highest common divisor of 128 and c. 32 Let s be (-1)/2 + (-1)/(-2). Suppose 2k - 11 + 1 = s. Suppose g - 7 = -0m + 3m, 0 = 3g + km - 7. Calculate the greatest common divisor of 2 and g. 2 Let j be (18/(-30))/(10/(-3600)9). Let r = 268 + 188. What is the greatest common divisor of j and r? 24 Let b(g) = 3g2 + 3g + 4. Let x be b(-4). Let d be 25/(203/294 - (-12)/84). Calculate the greatest common divisor of d and x. 10 Let w = 44 - 59. Let q = 23 - w. Let l(j) = 6j - 4. Let t be l(7). Calculate the greatest common divisor of t and q. 38 Let q be -58(-4)/(-8)1/(-1). Suppose -30c + qc - 109 = 0. Let t = 153 + c. What is the greatest common factor of 11 and t? 11 Let y be (1957/(-57) - -4)-3. Suppose 7s = 2s + 35. What is the greatest common divisor of s and y? 7 Suppose -m = 2m - 15. Suppose -4y - 591 = -mx, x - 2x = -5y - 765. Let t = -99 - y. Calculate the greatest common divisor of 5 and t. 5 Let d = 20 - 22. Let j be 0 + (2/d - 1). Let h be 1 - (j/4 + (-26)/4). Calculate the greatest common factor of h and 16. 8 Let b = 713 + -703. Calculate the greatest common divisor of b and 215. 5 Let x = -40 + 66. Let g be ((-4264)/182)/((-4)/56) + 10. What is the greatest common factor of x and g? 26 Suppose -40i + 36i - q + 40 = 0, 2q = -2i + 8. Calculate the highest common factor of i and 3894. 6 Let x(v) = 153v + 4293. Let y be x(-28). Calculate the highest common divisor of y and 5061. 3 Let i = 10 - 14. Let d be (31/4)/(i/(-16)). Let c be (-496)/4(5 - 147/28). Calculate the highest common factor of c and d. 31 Suppose 89o + 348537 = 1423924. Calculate the highest common factor of 43 and o. 43 Suppose -9d - 403 = -1582. What is the highest common divisor of 3013 and d? 131 Let u be 427/(-61) + (-1 - -288). Suppose -5h = 5z - 185, 5z + 2h - 211 = -32. Calculate the highest common divisor of z and u. 35 Let f = 113 + -14. Let b = 122 - f. What is the highest common factor of b and 920? 23 Suppose 0 = 6c + 1829 + 499. Let z = 719 - c. What is the highest common factor of z and 41? 41 Let z = -2 + 1. Let w(o) = -17o + 47o*2 - 25o + 58o + 2 - 1 - 17o. Let r be w(z). What is the greatest common factor of 7 and r? 7 Let x = -2424 - -3075. What is the highest common divisor of 186 and x? 93 Let w = 14 + 3. Let g be -1 + (-68)/238 + 30/7. Suppose 3i = gh - 66, 36i - 34i - 75 = -5h. Calculate the greatest common divisor of w and h. 17 Let o = -114 - -116. Suppose 5b = -a + 72, -2a - 41 + 5 = -ob. Calculate the greatest common divisor of b and 60. 15 Let n be 1775/10 + (-3)/2. Let a be (10 - 9)/(553/(-112) + 5). Calculate the highest common divisor of a and n. 16 Suppose -253 + 699 = 17x + 310. What is the greatest common divisor of x and 298? 2 Let h = -18093 - -18533. Calculate the highest common factor of h and 1056. 88 Suppose -5u - 87o = -82o - 4805, u - 3o - 993 = 0. Calculate the highest common divisor of u and 684. 57 Suppose -32h + 21h = -2013. Suppose m = 5f - 31 - 209, -4f - m + h = 0. What is the highest common factor of f and 329? 47 Let k(u) = -3u*3 + 103u*2 - 21u - 64. Let q be k(34). Suppose 68z - 59z = q. Calculate the highest common divisor of 42 and z. 42 Let u be ((-66)/(-9))/(4/(-10)(-150)/90). What is the greatest common factor of u and 10021? 11 Let c = -2 - 4. Let f(s) = -35s - 314. Let i be f(-9). Let r be (57/9 - 4/c)i. Calculate the highest common factor of 21 and r. 7 Let b be (-80 - -82)(-1)/(-2). Let s = -68 - -87. Calculate the highest common factor of b and s. 1 Let y(m) = 10m3 - 4m*2 - 4m - 14. Let q be y(4). Calculate the highest common divisor of 105 and q. 21 Let t(m) be the first derivative of -23m3/3 - m2/2 - 2m + 13. Let q be t(-1). Let h = -18 - q. What is the greatest common factor of 4 and h? 2 Suppose 104n = 98n + 96. Suppose -3m + m - 2x = -6, -n = 4x. Let w = 4 + -3. What is the highest common factor of w and m? 1 Let w be (-2 - -1)0/2. Suppose f - k = 22, 5f + 2k - k - 122 = w. Calculate the greatest common factor of 636 and f. 12 Suppose 9o - 48 - 6 = 0. Suppose 183q - 663 = 166q. Calculate the greatest common factor of q and o. 3 Suppose 2x - 3g = 17, -12 = -x + 4g + 9. Let s be ((-4)/(-6))/(x/18). Calculate the greatest common factor of s and 16. 4 Let y(m) = m*3 - 77m*2 - 55m + 291. Let k be y(78). Calculate the greatest common divisor of k and 30. 15 Let z(g) be the second derivative of g*5/20 + 5g*4/6 + 5g*3/6 - 12g*2 - 30g. Let c be z(-9). What is the highest common divisor of 126 and c? 6 Let p(f) be the second derivative of 0 + 3/4f4 - 2f*3 + 21f - 1/20f5 + 0f*2. Let z be p(6). Calculate the highest common divisor of 9 and z. 9 Let u(y) = -97y - 15. Let o be u(-3). Suppose s = -s + o. Let n be s/7 + (-2)/(-7). Calculate the highest common factor of 40 and n. 20 Suppose 3j + 215 = 2q, 2q - j = -q + 312. Suppose q = 4d - 3r - 125, d - r = 56. What is the greatest common factor of d and 15? 15 Let x = -9 - 0. Let o = -1167 + 1181. Let q = x + o. Calculate the greatest common divisor of 40 and q. 5 Let h(l) = 4l + 41. Let d be h(-10). Let s be 1/((-62)/16 - (-3 - d)). Calculate the highest common divisor of 72 and s. 8 Let o be 468/27 - ((-11)/12 - 7/(-28)). What is the highest common divisor of 19746 and o? 18 Let y = 3192 + -1751. Suppose 5s = y + 1484. Calculate the greatest common factor of s and 90. 45 Let m = -4819 - -5644. Calculate the highest common factor of 375 and m. 75 Let x(v) = 2v*2 - 61v + 272. Let q be x(41). Calculate the highest common divisor of q and 22. 11 Let w(z) = 5z + 61. Let n be w(-27). Let p = n + 130. Calculate the greatest common divisor of p and 84. 28 Let x = 536 - -10. Let w = 560 - x. What is the highest common factor of w and 350? 14 Suppose -149 = -3d + 73. Let j = d + -138. Let n = j + 148. Calculate the highest common factor of 126 and n. 42 Let w = 3385 - 1143. Suppose 23z = w + 794. Calculate the greatest common divisor of z and 60. 12 Let w(n) = -n3 - 6n*2 - 6n + 5. Let a be w(-5). Let z be (-345)/(-25) + 2/a. Let h be 6 - (-18)/9 - -62. Calculate the greatest common divisor of h and z. 14 Let c(q) = -238q + 108. Let g be c(-12). What is the highest common divisor of g and 78? 78 Let c(s) = -s2 + 90s + 142. Let u be c(56). What is the highest common factor of 372 and u? 186 Let w = -57 + 61. Suppose -9 = 7k - 10k. Suppose wx - 289 = -ka, -3a - x + 95 = -2a. What is the highest common factor of 26 and a? 13 Let t(u) = 11 - 368u + 363u + 6u2 - u2. Let i be t(-10). Let f = -318 + i. Calculate the greatest common factor of f and 27. 27 Let b = -8980 + 9123. Calculate the highest common factor of b and 572. 143 Let g = 26404 + -25864. Calculate the greatest common factor of 260 and g. 20 Let i = -122 - -208. Let f = -83 + i. What is the greatest common factor of 411 and f? 3 Suppose 178w - 48024 = 155w. What is the highest common factor of w and 435? 87 Let w be (27 - 26)(10 - 0). Let g be (-15)/w + 387/2 + 3. Calculate the highest common divisor of 78 and g. 39 Suppose -4j - b + 32 = 0, 0 = -4j - 3b - 2b + 16. Suppose -7u + ju = -30. Let v = u - -34. What is the greatest common divisor of v and 76? 19 Suppose 42r - 29r - 1958 - 3307 = 0. Calculate the greatest common divisor of r and 567. 81 Suppose -4k + w + 5 = 0, -4k + 8w + 13 = 1. Let t = 28 + -1. Calculate the highest common factor of k and t. 1 Suppose 2k = 3k - 6k. Suppose k = 7r - 9r + 8	{ "pile_set_name": "DM Mathematics" }
z(g) = -12g2 + 5. Let l(k) = 14k*2 - 6. Let c(d) = 5l(d) + 6z(d). Let m(x) = -11x + 4. Determine c(m(p)). -242p2 + 176p - 32 Let j(i) = i2 - i2 - 2i2 - i2. Let l(r) = 2r. Determine j(l(f)). -12f2 Let x(o) = -8o. Let j(u) = -142u2 + u. What is j(x(m))? -9088m*2 - 8m Let w(n) be the third derivative of -n4/24 + n2. Let p(t) = 2t - 2. Let a(q) = 1. Let h be -4 + 3/3 + 5. Let m(g) = ha(g) + p(g). Give w(m(j)). -2j Let g(j) = -6j*2 - 9j + 9j + 11j*2. Let l(y) = y. Give l(g(m)). 5m2 Let i(l) be the first derivative of l3 + 3. Let v(x) = -x*2. Calculate i(v(o)). 3o*4 Let p(g) = -g. Suppose -3q + 29 = 4f, 4f - 11 - 8 = -5q. Let n(a) = 2a + 4. Let c(z) = -5z - 11. Let x(o) = fn(o) + 4c(o). Determine p(x(i)). -2i Let f(z) = -5z - 6. Let l(g) = -6g - 7. Let m(c) = 7f(c) - 6l(c). Let y(s) = -s. Let u(d) = -6m(d) - 7y(d). Let k(t) = t2. Determine k(u(r)). r2 Let d(f) be the second derivative of -f*4/12 - 8f + 2. Let m(a) = 26a. Let i(w) = 3w. Let q(k) = 30i(k) - 3m(k). Give q(d(x)). -12x2 Let t(c) = -16c*2 - 4c + 14c2 + 4c. Let g(l) = -l*2 - 1. Let n(a) = -3. Let b(k) = -3g(k) + n(k). Give b(t(z)). 12z4 Let v(i) be the first derivative of 2i*3/3 - 19. Let y(h) = -11h*2. Determine y(v(r)). -44r*4 Let p(u) = -2u*2. Let f(j) be the first derivative of 3j*3 + 17. What is f(p(s))? 36s4 Let i(w) be the second derivative of -w3/3 + 6w. Let c(q) = -2q*2 + 2 - 2. Determine c(i(s)). -8s*2 Let q(j) = 4j*2. Let z(w) = 23w - 25. Give z(q(y)). 92y2 - 25 Let f(z) = -31z - 5 + 5 + 29z. Let x(l) = -10l*2. What is f(x(o))? 20o*2 Let b(u) = 9u*2. Suppose -3o + 21 = -0o. Let y = o + -5. Let q(r) = -3 + r - yr + 3. Give b(q(t)). 9t2 Let t(v) = -2v. Let l(a) = 15381a2 - 2a. Calculate l(t(b)). 61524b2 + 4b Let c(f) = 93f2. Let r(o) = 2o*2. What is c(r(u))? 372u*4 Let h(r) = -985r. Let x(w) = -3w. Calculate h(x(m)). 2955m Let n(d) = 3337d. Let w(z) = -3z. Give n(w(o)). -10011o Let f(d) = -20d. Let o(c) = -2c2 + 3c - 3. Let u(v) = -3v2 + 5v - 5. Let q(i) = 10o(i) - 6u(i). What is f(q(y))? 40y2 Let u(f) = -f + 1. Let p(j) = 4j - 6. Let r(m) = p(m) + 6u(m). Let x(b) be the third derivative of -b4/6 - 32b*2. Give r(x(i)). 8i Let o(h) = h*3 + 7h*2 + 4. Let l be o(-7). Let q = l + -2. Let w(t) = -qt + 2t + t. Let u(i) = -2i. Determine u(w(g)). -2g Let u(m) = -2m. Let o = 5 + -5. Let a(r) = r - r*2 - r + or*2. Give a(u(f)). -4f*2 Let r(t) = t. Let y(o) = o + 3. Let d(s) = 1. Let c(h) = -3d(h) + y(h). What is r(c(l))? l Suppose -1 = -u + 3. Let i(v) be the first derivative of 2 + 3 - u + v*3. Let n(a) = -2a*2. Give i(n(g)). 12g*4 Let y(r) = -3r*2. Let c(u) = 11u*2. Let z(i) = 2i*2. Suppose -3t = j + 14, -2j + 0j - 10 = 3t. Let b(k) = tc(k) + 34z(k). Determine y(b(f)). -12f*4 Let d(j) be the first derivative of 3j*2 + 3 - 4 - 2j*2. Let v(n) be the first derivative of 2n*2 + 1. Calculate d(v(g)). 8g Let w(q) = 30q. Let d(p) = -13p. Give d(w(j)). -390j Let w(y) = -4y - 51. Let u(r) = -2r. Calculate u(w(c)). 8c + 102 Let x(p) = -6p2. Let d(t) = t2 - 3t + 3. Let b(m) = 6m2 + 9m + 18 - 1 - 26m. Let g(w) = 6b(w) - 34d(w). Determine x(g(h)). -24h*4 Let h(y) be the second derivative of 1/12y*4 - 3y + 0 + 0y3 + 0y2. Let i(l) = -l. What is h(i(p))? p2 Let i(b) = 6b2. Let v(q) = -q. Let a(j) = -2j*2 + 3j - 13 - j + 13. Let y(k) = a(k) + 2v(k). Give y(i(l)). -72l*4 Let z(s) = -91s*2. Let q(j) = -4j - 5. Give z(q(a)). -1456a2 - 3640a - 2275 Let x(g) = -g*2. Let s(n) = -304n*2. What is s(x(j))? -304j4 Let f(z) = z2. Let p(w) = -2w2 + 3w - 79. Let i(j) = -5j2 + 7j - 158. Let v(y) = 3i(y) - 7p(y). Determine v(f(g)). -g*4 + 79 Let o be ((-10)/(-8))/(1/4). Let t(g) = -3g + 5. Let a(j) = -2j + 3. Let b = -7 + 4. Let h(r) = bt(r) + oa(r). Let w(u) = -2u*2. Calculate w(h(c)). -2c*2 Let l(h) = h. Suppose -6i = -7i. Let d(g) be the second derivative of ig*3 - 1/3g*4 + g + 0 + 0g*2. What is d(l(x))? -4x*2 Let y = -7 + 8. Let m be y/(-31/(-9)). Let k(f) = -3f + 4f - mf + 0f. Let d(o) = 2o2. What is k(d(n))? -4n*2 Let b(p) = -4p*2. Let a(c) be the first derivative of -19c*2/2 - 55. Calculate b(a(l)). -1444l*2 Let a(t) = -t + 7. Suppose 0 = -5d + 14 + 1. Suppose -dq = 2 - 44. Let z(s) = 1. Let h(f) = qz(f) - 2a(f). Let g(l) = -l. What is h(g(w))? -2w Let l(h) = 316h2 - 1. Let k(m) = 27m. Calculate l(k(j)). 230364j2 - 1 Let k(p) = -p2. Let a(w) = 2w - 47. What is a(k(v))? -2v2 - 47 Suppose -2n = n - 108. Let x(d) = nd + d2 - 36d. Let k(q) = -12q. What is k(x(j))? -12j*2 Let v(k) = -2k. Let r(i) = i - 6. Suppose j - 7 - 1 = 0. Let c be r(j). Let d(n) = n + cn + 0n. Determine v(d(s)). -6s Let w(i) = -305i*2. Let p(q) = 5q*2. Calculate p(w(j)). 465125j*4 Let f(l) = 7l. Let r(t) be the second derivative of -t*4/12 - 9t. Calculate r(f(x)). -49x2 Let b(c) = 2c*2. Let q(n) = -254n*2 + 3. Determine q(b(z)). -1016z*4 + 3 Let x(g) = 3g*2. Let d(r) = -2058 + 9r + 2058. Determine x(d(h)). 243h2 Let x(o) = 8o + 6. Let l(d) = 4d2. What is x(l(i))? 32i2 + 6 Let w(o) = o3 - 3o2 - 4o + 5. Let g be w(4). Suppose 3n - 5 = 1. Let t(a) = -an - 7a*2 + ga2. Let z(b) = b2. Calculate t(z(v)). -3v4 Let v(b) = b. Let i(p) = 393p*2. Determine i(v(u)). 393u*2 Let z(d) = -2d. Let b(h) = h*2 - 4h - 1. Let r be b(5). Let f(a) = 4 + 7a - 10a - r. What is f(z(n))? 6n Let h(t) = -t2. Let w(z) = -12z*2 + 32z - 32. Let k(o) = -o*2 + 3o - 3. Let d(q) = -32k(q) + 3w(q). What is h(d(j))? -16j4 Let l(r) = -r2 - 3r. Let w(u) = u*2 + 5u. Let j(o) = 5l(o) + 3w(o). Let i(a) = 7a2. Calculate j(i(k)). -98k*4 Let j(k) = k - 2. Suppose -y + 14 = 5g, 4y + 20 = -g - 0g. Let b(n) = n - 3. Let x(i) = yj(i) + 4b(i). Let q(f) = f*2. Calculate q(x(w)). 4w*2 Let b(u) = 76u*2. Let v(y) = -4y*2 - 6y - 6. Let a(m) = -3m2 - 5m - 5. Let i(n) = 6a(n) - 5v(n). Give b(i(l)). 304l4 Let m(l) = -l. Let y(z) = -67z*2. Determine m(y(p)). 67p*2 Let a(s) = -9s*2. Let z(d) = 2d. Let g(v) be the third derivative of v4/3 - v2. Let p(u) = 2g(u) - 9z(u). What is p(a(l))? 18l2 Let x(j) = 3j*2. Let m(u) = 735u. Determine x(m(v)). 1620675v2 Let t(d) = 4d*2. Let j(f) = -5f*2 + f. Give t(j(m)). 100m*4 - 40m*3 + 4m*2 Let s(y) = 24y*2 + 2y + 48. Let j(w) = 2w2. What is s(j(z))? 96z*4 + 4z*2 + 48 Let q(s) = 4s + 11s - 26s + 3s. Let u(n) = -n. Calculate u(q(x)). 8x Let t(n) = 533n. Let h(v) = 19v. Let j(s) = -169h(s) + 6t(s). Let d(q) = q*2. Give d(j(r)). 169r*2 Let i(a) = 2920a. Let v(w) = -w*2. Give i(v(s)). -2920s2 Let h(m) = m2 - 6. Let u(y) = -3y2 - 2 + 6 + 13. Let f(b) = -17h(b) - 6u(b). Let d(s) = -s. Determine f(d(o)). o2 Let r(z) = 9 - z - 9. Let o be 15/(-3)(-6)/10. Let b(c) = oc - 4c + c + c. Determine b(r(u)). -u Let y(m) = -m*2 - 3m*2 + 2m*2. Let r(l) = -4l - 20. Let w(h) be the second derivative of -h*2/2 + h. Let t(c) = -r(c) + 20w(c). Determine y(t(v)). -32v2 Let o(d) = -2d. Let n(i) = 37i2 + 18i. Give n(o(v)). 148v2 - 36v Let p(n) be the first derivative of -4n3 - 3 + 5n*3 + 0. Let r(j) = j. Determine r(p(f)). 3f*2 Let q(w) = 3w. Let t(h) be the second derivative of h*4/4 - h. Calculate q(t(x)). 9x2 Let m(t) = -t2 - 4t2 + 9t*2. Let v(x) = 4x*2 - 5x2 - x2. Determine m(v(p)). 16p4 Let m(v) = 10v*2. Let l(p) = 48p. Determine l(m(h)). 480h2 Let s(j) = 56j. Let g(k) = -2k. Give s(g(a)). -112a Let b(d) = -1013d2. Let h(s) = -2s*2. What is b(h(u))? -4052u*4 Let a(t) be the second derivative of 3t*4/4 - 31t. Let p(k) = 5k2. Determine a(p(z)). 225z*4 Let o(l) be the first derivative of 5l2/2 + 9. Let m(j) = j2. What is m(o(u))? 25u2 Let j(i) = 61i*2. Let c(w) = -26w*2. Give j(c(k)). 41236k*4 Let g(b) = -4b. Let y(v) = 11v2 - 22v. Let q(m) = m. Let k(j) = 22q(j) + y(j). What is k(g(x))? 176x*2 Let d(m) = -2m - 360. Let x(s) = s*2. Calculate d(x(j)). -2j*2 - 360 Let w(o) = 6o*	{ "pile_set_name": "DM Mathematics" }
+ (sqrt(192) - sqrt(192)2) + -54-61sqrt(3) + -5. 176sqrt(3) + 586 Simplify 4(-4 + 5sqrt(800)-1 + sqrt(800)2 + 2)*2-4. -115264 - 3840sqrt(2) Simplify ((3 + 1(-5(sqrt(325) + 1 + sqrt(325) - sqrt(325))-4 + 1))4)2. 76800sqrt(13) + 2089216 Simplify ((sqrt(539) - (1 + sqrt(539)))-1 + (sqrt(539) + -1 + 2 - sqrt(539)) + (5(0 + sqrt(539)) + sqrt(539))5 + ((0 + -2sqrt(539))-4 + 3)6)*2. 21840sqrt(11) + 3279676 Simplify 5 + (2 + 5-4(-3 + sqrt(425)1 - (sqrt(425) + 0 + 3 - sqrt(425)))2)-1. -1200sqrt(17) + 9223 Simplify -4((-3sqrt(7) + sqrt(7))-1-4 + -3 + ((2 + (sqrt(7) + -1 - sqrt(7)) + sqrt(7))6)*2-2). 608sqrt(7) + 2316 Simplify ((0 + sqrt(36)/sqrt(2) + sqrt(4)/(sqrt(2) + sqrt(8)/sqrt(4)) + sqrt(128) + sqrt(128) + 0 + sqrt(128) + 1 + -1)3)*2. 27225/2 Simplify (((sqrt(66) + (sqrt(66) - (sqrt(66) + sqrt(66)4)) + sqrt(66))/sqrt(11) + 3-2sqrt(6))/(-4-1sqrt(192)-1))2. 1/8 Simplify (-3 + -2((sqrt(2) - (sqrt(32) + 0 + sqrt(32))) + sqrt(242) + -2 + sqrt(242) - sqrt(128)-4))2-5. -88365 + 940sqrt(2) Simplify -1 + (-1 + (-1 + (sqrt(5) + sqrt(5)1)-5)2 - ((sqrt(270)/sqrt(6) - sqrt(45))2 - (sqrt(30)/sqrt(6) + -3))). 21sqrt(5) + 496 Simplify (((sqrt(2800) - (1(sqrt(2800)-2 - sqrt(2800)) + sqrt(2800)))1)/((sqrt(320)/(sqrt(8)-1))/(sqrt(810)-2)))2. 2041200 Simplify (1-2sqrt(110) - (sqrt(110) + (sqrt(110) - sqrt(110)1) + sqrt(110) - sqrt(110))-6)/(-22(sqrt(1210)3 + sqrt(1210))). -sqrt(11)/44 Simplify ((2sqrt(192)3)*2 + sqrt(192) - sqrt(192)) + (2 + sqrt(192) + 3 - sqrt(192)) - (-2 + 5(sqrt(192) + -1 + 1))*2. 160sqrt(3) + 2113 Simplify (3sqrt(1100)23 + 3 + 1(sqrt(1100) - (1 + sqrt(1100)))*2 + sqrt(1100) + (2sqrt(1100) + sqrt(1100))-3)1. 4 + 100sqrt(11) Simplify 1 + (1 + sqrt(833)4 - -1sqrt(833)-5) + 4. -7sqrt(17) + 6 Simplify ((3 + (-1 + sqrt(2057) + -1 - (-2 + sqrt(2057) + 1))2-6)-6)*2 + -4. 8096 Simplify ((sqrt(288)-4-4 + sqrt(288) + 5 + 6sqrt(288) + -1)-6)2. 79488sqrt(2) + 5485248 Simplify (-1(-1 + sqrt(468))64 + (1sqrt(468)-2 - (-2sqrt(468) + sqrt(468) + -5)))*2. -8700sqrt(13) + 293341 Simplify 2((3 + (-1 + sqrt(2880) - sqrt(2880)) + sqrt(2880) - sqrt(2880))24 - (1 + ((-2sqrt(2880))2-4 - sqrt(2880)) + sqrt(2880))). 92190 Simplify -1 + (sqrt(2156)-11 - ((sqrt(396)2)/sqrt(9))2-3). -14sqrt(11) + 527 Simplify (sqrt(72)/(sqrt(576) + (sqrt(576) - ((sqrt(576) - sqrt(576)2) + sqrt(576))))5)/(3sqrt(150) + (sqrt(24) + sqrt(6))3). 5sqrt(3)/576 Simplify (4(1 + sqrt(1872))62)2 - (3 + 4 + (sqrt(637) - (-4 + sqrt(637)-1 + sqrt(637))))*2. 55142sqrt(13) + 4314634 Simplify ((sqrt(180)/sqrt(294) + (sqrt(4320)2 - sqrt(4320)))/((sqrt(972) + sqrt(972)1)/(sqrt(8)/(sqrt(4)1))))2. 36125/15876 Simplify (-3 + -1 + 5 + -6((sqrt(320) - (sqrt(320)1 + -4 + sqrt(320))) + sqrt(320))-6 + 5)*2. 22500 Simplify -1(3((0 + sqrt(180))2 + -5) + (5 + -2sqrt(180))-3). -510 - 36sqrt(5) Simplify 5 + (2sqrt(325)-5 - 6(sqrt(325) + 1))2 + (-1sqrt(325) - sqrt(325))*2 + -2 + 1 + -4. 960sqrt(13) + 84536 Simplify ((2-2sqrt(360))/(sqrt(12) + -62sqrt(12)))/(1sqrt(1000)-6-5). sqrt(3)/825 Simplify (sqrt(825)-4)/(sqrt(18)/(sqrt(30)/sqrt(5))) - (sqrt(66) - 1sqrt(66)-1)/(sqrt(216) + sqrt(216)1 + sqrt(216)). -181sqrt(11)/9 Simplify (-5 + -1 + -4((sqrt(162) + sqrt(162) + sqrt(162) + -1 + sqrt(162) + sqrt(162))3 + 0)-2)2. -64800sqrt(2) + 2333700 Simplify (sqrt(125) + -3(-2 + sqrt(125)) + -41sqrt(125) - (sqrt(125)11 + (0 + sqrt(125))-4))*2. -180sqrt(5) + 1161 Simplify (((sqrt(192) - (sqrt(192) + sqrt(192) + sqrt(192)-2)-1) + sqrt(192))/(5sqrt(128)))/((sqrt(8) + -1(sqrt(8) - sqrt(32)) + -3sqrt(8)1)-1). sqrt(3)/10 Simplify (((sqrt(76) + -4 - (sqrt(228)/sqrt(3) + sqrt(19)))4)*2 - ((3sqrt(133))/sqrt(7) - (sqrt(209)/sqrt(539) + sqrt(19))))2. 1766sqrt(19)/7 + 1120 Simplify ((24(sqrt(112) + 3) - (-3 + -5 + sqrt(112)-6))5)*2. 89600sqrt(7) + 574400 Simplify (-3sqrt(1372) - (sqrt(28) - sqrt(700))5)/(3sqrt(484) - 1sqrt(36)). -sqrt(7)/30 Simplify 4((-1 + 1 + sqrt(432) - sqrt(432))2 + sqrt(432)-2-2 + -6(sqrt(432) + 0)*2 + -5). -10388 + 192sqrt(3) Simplify (0 + (-5sqrt(325))225 + -1 + (1 + 4sqrt(325))*2)3. 120sqrt(13) + 259350 Simplify (sqrt(189)/sqrt(7) - sqrt(297)/sqrt(11)) + -6(sqrt(108) + 0)5. -180sqrt(3) Simplify (sqrt(176)-3 - sqrt(176)) + -1 + 2 - (((sqrt(704) + -1 - sqrt(704)) + -1)-1)*2. -16sqrt(11) - 3 Simplify ((5 + (sqrt(432) - (sqrt(432) + 0)) - sqrt(432)2-2) + ((sqrt(432) - (sqrt(432) + 1 - sqrt(432))) + -2 - sqrt(432) - 1sqrt(432)-1))*2-3 + -3. -32415 - 720sqrt(3) Simplify 2(5-2(sqrt(84) + 22sqrt(84)))/((2sqrt(108))/sqrt(9) + (sqrt(588) - -3sqrt(588))). -10sqrt(7)/3 Simplify 23(-4(5 + sqrt(8)/sqrt(4))4 - ((-3-1sqrt(2) - (sqrt(162) + 1)) + -5))2. 8880sqrt(2) + 34056 Simplify 2(sqrt(225)-2-5)/(-21(sqrt(3)4 - sqrt(3))). -50sqrt(3)/3 Simplify ((sqrt(720)-13 - (-3 + sqrt(720)-2)) + -3((sqrt(720) - (2 + -2sqrt(720))) + 5))*2-4. -288144 - 5760sqrt(5) Simplify (4 + -5 + (-4(sqrt(1700) + 2sqrt(1700) + 5) - (-1 + (sqrt(1700) + -2)2)))*2. 4480sqrt(17) + 333456 Simplify -6(1 + sqrt(242))2 + 2 - ((sqrt(2) - (-3 + -2sqrt(2)) - (-1 + sqrt(8))*2) + 2). -1452 - 139sqrt(2) Simplify 1-3((-1(sqrt(2904) + -2sqrt(2904) - sqrt(2904))-3)/(sqrt(16)/sqrt(18) + sqrt(8)26))2. -352836/1369 Simplify (-2(1 + (2 + 4 + (sqrt(931) + ((sqrt(931) + -1 + sqrt(931))5 - sqrt(931)) - (3 + (1 + sqrt(931) - sqrt(931)))))-3))*2. -16800sqrt(19) + 3352000 Simplify ((sqrt(612) - (sqrt(612) + -2)) + sqrt(612) - (-1sqrt(85))/sqrt(5)) + -6-1sqrt(833)1. 2 + 49sqrt(17) Simplify (-5 + sqrt(833)1 + 1 + sqrt(833)-2 + 2 + -1 + -1sqrt(68))*2. 54sqrt(17) + 1386 Simplify -3((4sqrt(72)-1 - sqrt(72)) + -2sqrt(72) + -2 + (-1 + -3sqrt(72))1)*2. -21627 - 1080sqrt(2) Simplify (((sqrt(2) + sqrt(18)-2 - sqrt(2))-6 + (sqrt(72)/(sqrt(12)/sqrt(4)))/sqrt(12) + 0)-2)2 + 3. 10955 Simplify -5 + (sqrt(63) + 0 - (sqrt(7) + 0)-6) + (sqrt(7)-5)2 + 5 + 1. 9sqrt(7) + 176 Simplify ((1sqrt(48)/sqrt(2)3)/(3sqrt(288)2 - (sqrt(288) - (sqrt(288) - (sqrt(288) + (-2sqrt(288) - sqrt(288))-5 - sqrt(288))))))*2. 1/108 Simplify 5 + (-1sqrt(833) + 4 + (sqrt(833) - -2sqrt(833)) + -4 + sqrt(833) + 5(sqrt(833) + 2 + sqrt(833)) + sqrt(833) + -5 + -2)*2. 588sqrt(17) + 163282 Simplify ((3sqrt(72)1 + sqrt(72))/(sqrt(36)/(sqrt(36)/sqrt(4))))/(-3(sqrt(294) - 2sqrt(294) - sqrt(294))-3). -2sqrt(3)/63 Simplify ((sqrt(9) + sqrt(36)2 + sqrt(36) - sqrt(9))4-6)/((sqrt(75) + sqrt(75)2)3 - (-2sqrt(75)2 + sqrt(75)))-1 + 4. 4 + 12sqrt(3)/5 Simplify -6(4 + -35(-6(sqrt(3200) - (sqrt(3200) + sqrt(3200) + -1 + sqrt(3200))) + (1 + sqrt(3200) + -2 + sqrt(3200) - sqrt(3200))))2. -730151286 + 10202400sqrt(2) Simplify (-5 + 3(((2sqrt(192) + sqrt(192))-6 - (sqrt(192) + -2sqrt(192))1) + (sqrt(192) + 4 + (sqrt(192) - (sqrt(192) + -1)))-5 + 1))*2. 81312sqrt(3) + 842281 Simplify (-2(-1sqrt(847))2 - (sqrt(847) + 2)2-5) + (-4(sqrt(847) - (2 + sqrt(847))) + 4(sqrt(847) + -2))2. 220sqrt(7) + 16113 Simplify 0 + (-5 + 2 + (sqrt(405) + 2 + -3 - (0 + sqrt(405) + -2 + sqrt(405))))*2. 36sqrt(5) + 409 Simplify 0 + (sqrt(99)/sqrt(3)4 + -4(sqrt(165)/sqrt(5) - sqrt(33)))/(sqrt(3) + (sqrt(3) + 1sqrt(3) + sqrt(3))2 - (sqrt(27)/(1sqrt(9)) - sqrt(3))). 4sqrt(11)/7 Simplify 1 + (sqrt(288) + sqrt(288)1 + sqrt(288))2-3 + (((sqrt(200) - (sqrt(200) + sqrt(200) + 5 + sqrt(200) + sqrt(200) + -3)) + sqrt(200))5)2. 2000sqrt(2) + 12325 Simplify (-5(3 + (sqrt(15)-4)/sqrt(5)) - ((5 + sqrt(12)/sqrt(4))4 + -5))4. -120 + 64sqrt(3) Simplify ((4-6(2sqrt(539) - sqrt(539)) - (-1 + 1 + sqrt(539) + 0)) + 4)*2. -1400sqrt(11) + 336891 Simplify (-1 + ((sqrt(637) + (-2 + sqrt(637) - sqrt(637)))5 + sqrt(637))-6)2 + 3 + 5. -504sqrt(13) + 126 Simplify -3 + (4(sqrt(175) + sqrt(175) + -4 + -2) - (-1(1 + sqrt(175) - sqrt(175)) - (sqrt(175) + (-1sqrt(175)-2 - sqrt(175)))))*2-1. -18032 + 2300sqrt(7) Simplify -3(((sqrt(396) + sqrt(396) + sqrt(396) + 2sqrt(396) + sqrt(396))/sqrt(9))/(-2sqrt(196)) + (3(sqrt(539) + -1) - (-2sqrt(539) + 2))). -726sqrt(11)/7 + 15 Simplify (5(sqrt(10	{ "pile_set_name": "DM Mathematics" }
d) = id + zd - d. What is o(h(b))? b*2 Let y(w) = -8w2. Let d(n) = n2 + 3n + 3. Let p(o) = -4o*2 - 8o - 8. Let h(u) = -8d(u) - 3p(u). What is h(y(x))? 256x4 Let f(q) = -q. Let z be (-10)/(-65) - 267/(-39). Let l(m) = -m - 2m + zm + 2m. What is f(l(x))? -6x Let o(i) = -20 + i - 15 + 35. Let l(n) = 3n + 4. Let v(c) = 4c + 5. Let w(b) = 5l(b) - 4v(b). Give o(w(k)). -k Let j(n) = 3n. Let c(i) = 6i2 + 2i + 2. Let h(s) = 7s2 + 3s + 3. Let a(v) = 3c(v) - 2h(v). Determine a(j(x)). 36x2 Let f(q) = -5q. Let l(w) = -w. Let a(z) = -f(z) + 2l(z). Let n(m) be the second derivative of -2m + 0 + 1/6m3 + 0m*2. What is a(n(s))? 3s Let u(k) = k*2. Let n(h) = -3. Let y(m) = -4. Let b(p) = 5n(p) - 4y(p). Let w(s) = s + 4. Let o(z) = 4b(z) - w(z). Give u(o(c)). c*2 Let b(l) = 4l - 4. Let n be b(2). Let f(p) be the second derivative of 0 + 1/3pn - p + 0p*3 + 0p*2. Let r(m) = -2m*2. Give f(r(d)). 16d*4 Let p(x) be the second derivative of 0x*3 - 1/6x*4 + 0x*2 + 4x + 0. Let v(g) = 5g. Calculate v(p(b)). -10b*2 Let s(z) = -7383z*2. Let r(y) = y. Determine s(r(w)). -7383w*2 Let t(m) be the third derivative of -2m*2 + 1/12m*4 + 0m*3 + 0 + 0m. Let f(x) = -x + 2x2 + x. Determine f(t(a)). 8a*2 Let q(s) = 40s*2 + 1. Let i(k) = k. Give q(i(z)). 40z2 + 1 Let v(r) be the first derivative of r2 + 3. Let b(s) = 2s2. Determine b(v(z)). 8z2 Let o(a) = a2. Let r(t) = -13t. Let m(h) = -81h. Let f(u) = -41u. Let p(n) = 9f(n) - 4m(n). Let k(i) = -5p(i) + 18r(i). What is o(k(g))? 81g2 Let t(o) = o. Let g(x) be the second derivative of x7/1260 - x*4/12 + 4x. Let c(r) be the third derivative of g(r). Give c(t(a)). 2a2 Let l be 3/((-6)/10)-1. Suppose -i + 10 = 3i - p, 5i - 4p - 18 = 0. Let q(n) = n + ln + in. Let v(o) = o. Determine q(v(c)). 8c Let c(o) = -4o2 + 4o*2 - 5o*2. Let g(a) be the first derivative of -2a*3/3 + 8. Give g(c(u)). -50u*4 Let y(d) = 4d*2 - 8d. Let m(j) = 2j2. Give y(m(g)). 16g*4 - 16g*2 Let i(w) = 42w. Let o(r) be the first derivative of r*2/2 + 5. Determine o(i(f)). 42f Let f(v) = 2v2 + 436. Let r(a) = a. What is f(r(g))? 2g*2 + 436 Let g(n) = 2n*2 + 4n. Let f(t) = t*2 + 3t. Let b(q) = -4f(q) + 3g(q). Let r(h) be the first derivative of 5h3/3 + 1. What is r(b(m))? 20m*4 Let u(x) = -3x. Let v(d) = -d + 12. Let i be v(9). Let n(t) = -6t. Let w be n(-1). Let f(a) = -wa + ia + a. Determine u(f(m)). 6m Let j(h) = -155h2 + 35. Let w(l) = 13l*2 - 3. Let q(f) = 3j(f) + 35w(f). Let x(n) = -3n*2. Determine x(q(a)). -300a4 Let u(x) be the third derivative of -x8/5040 + x*5/60 + 6x*2. Let c(i) be the third derivative of u(i). Let o(s) = -2s*2. Determine o(c(h)). -32h*4 Let i(h) = 21h*2 - 46h*2 + 27h*2. Let t(w) = -3w*2. Calculate t(i(y)). -12y*4 Let i(s) = 2s*2 + 14s. Let g(a) = -a*2 - 179. What is i(g(b))? 2b*4 + 702b*2 + 61576 Let j(t) = 177t. Let y(n) = 2n. What is j(y(i))? 354i Let d(r) be the second derivative of 19r4/12 - 14r. Let s(m) = -2m. Calculate d(s(j)). 76j2 Let x(w) = -w2. Let v(s) be the third derivative of 7s5/10 - 5s*2. Determine v(x(b)). 42b*4 Let y(h) = -6h + 6h + 5h. Let p(l) = l*2 - 2l*2 + 2l*2 + 0l*2. What is y(p(n))? 5n*2 Let h(l) = 8l*2. Let d(r) be the second derivative of 0r*3 - r - 3/2r*2 + 0 - 1/24r*4. Let c(w) be the first derivative of d(w). Determine c(h(s)). -8s*2 Let y(j) = -2j. Let o(l) be the first derivative of -23l2/2 - 7. What is o(y(g))? 46g Let d(h) = 6h. Let l(p) = -11 - 2p + 11. Determine l(d(u)). -12u Let u(k) = 16k - 33. Let r(h) = -3h + 6. Let a(c) = 22r(c) + 4u(c). Let j(p) = p2 - 3p - 3. Let q be j(4). Let o(g) = -3g - 1 + q. Calculate a(o(l)). 6l Let o(g) = -2g. Let r(u) = -9u*2. What is r(o(j))? -36j*2 Let f(g) be the first derivative of 2/3g*3 + 0g*2 - 3 + 0g. Let q(u) = -2u2. Calculate q(f(l)). -8l*4 Let x(u) = -3u*2. Let w(q) = -26q. Give w(x(l)). 78l2 Let k(b) = -3b2 + 17. Let o = 4 + -10. Let s(c) = c2 - 6. Let l(a) = ok(a) - 17s(a). Let t(n) = -2n2 + 2n - 2n. Calculate t(l(r)). -2r*4 Let h(i) = -15753i. Let y(z) = -2z2. Determine y(h(c)). -496314018c*2 Let w(j) = 24j - 4. Let n(v) be the second derivative of -v*3/6 + 23v. Give w(n(c)). -24c - 4 Let t(q) = -q + 2. Let y(s) = -s + 1. Let o(u) = t(u) - 2y(u). Let a(g) = -10g - 2. Give a(o(k)). -10k - 2 Let x(j) = -2j2. Let r(m) = -8m + 2. Let g(w) = 122 - 10w - 133 + 51w. Let a(u) = 2g(u) + 11r(u). Determine a(x(p)). 12p2 Let h(x) = 2x. Let g(w) = -1102w2. Give h(g(d)). -2204d*2 Let t(b) = -5b. Let d(o) = 6o - 22. Determine d(t(q)). -30q - 22 Let m(d) = 4d2 + 3d*2 - 6d2. Let r(g) = g2. What is r(m(z))? z*4 Let r(q) = 0q*2 - 2q*2 - 18q*2. Let s(h) = -2h. Determine r(s(x)). -80x2 Let r(u) be the third derivative of -u4/4 + 14u*2. Let s(h) = -h + 1. Let z(k) = k - 2. Let f(n) = 2s(n) + z(n). What is r(f(x))? 6x Let m(x) = -27x. Let y(p) = -p*2. What is m(y(h))? 27h*2 Let t(w) = 6w. Let m(y) = -11y + 62. Determine m(t(u)). -66u + 62 Let s(f) = -5f2. Let d(g) = 2281g*2. Give d(s(t)). 57025t*4 Let m(a) = a + 2. Let p(o) = 4o + 11. Let c(l) = -11m(l) + 2p(l). Let d(s) = 0s + 4s - 5s. What is c(d(h))? 3h Let m(c) = -c + 48. Let n(i) = 5i. Give m(n(w)). -5w + 48 Let c(f) = -f*2. Let w(m) = 7m*2 + 3m + 3. Let z(x) = -20x2 - 8x - 8. Let u(a) = -8w(a) - 3z(a). Calculate u(c(y)). 4y4 Let c(p) be the third derivative of -p5/60 + 2p*2. Suppose -z = -0z - 2. Let q(h) = h2 + h2 + zh2. Determine q(c(v)). 4v*4 Let d(s) = -12s. Let j(t) = 4 - 2t2 + 0t*2 - 4. What is j(d(p))? -288p*2 Let x(c) = c. Let l(w) = 6w - 23. What is l(x(r))? 6r - 23 Let j(z) = 28z - 54z + 32z. Let b(k) = -11k2. Calculate j(b(x)). -66x*2 Let t(k) = -27k*2. Let j(m) = 153m*2. Give t(j(w)). -632043w4 Let t(z) = z2. Let g(n) be the second derivative of -n + 0n3 + 0n*2 + 0 - 1/12n4. What is t(g(r))? r4 Let h(b) = b*2. Let x = -5 - -8. Suppose -n = 4o + x - 22, -4n + 12 = 0. Let j(u) = u + o - 4. Determine h(j(m)). m2 Let o(f) = -6f*2 + 58. Let k(c) = 2c*2. Give k(o(w)). 72w*4 - 1392w*2 + 6728 Let o(f) = -9255f*2. Let s(j) = 2j. Calculate o(s(p)). -37020p2 Let t(p) = -2p - 7. Let l(b) = -4b + 6. Let u(f) = -7f + 10. Let m(y) = -10l(y) + 6u(y). Calculate m(t(w)). 4w + 14 Let r(a) = 3a. Let t = 16 - 1. Let c(n) = 0n2 + t - 2n*2 - 15. Determine r(c(v)). -6v*2 Let c(s) = 18s. Let y(t) be the first derivative of -t*3 - 6. Determine y(c(u)). -972u*2 Let q(c) = -2c. Let x(p) = 16p - 6p - 7p. What is x(q(u))? -6u Let a(m) = -m + 2. Let v(o) = -11o + 10. Let u(r) = 5r - 5. Let d(q) = 5u(q) + 2v(q). Let w(t) = -5a(t) - 2d(t). Let j(f) = 18f. Give w(j(z)). -18z Let w(j) = -3j. Let c(d) = 91d*2 + 2d. Determine w(c(r)). -273r2 - 6r Let w(z) = 7z2 + z + 241. Let v(p) = -p. Give w(v(d)). 7d2 - d + 241 Let q(x) be the second derivative of -x3/6 + 42x. Let l(k) = 19k. Determine q(l(v)). -19v Let h(f) = 8f*2. Let i = -4 + 5. Let g(n) = 33n - 1 + i - 31n. Determine g(h(c)). 16c2 Let s(a) = a2 - 2a. Let o(c) = 2c + 2. Let w be o(1). Let g(q) = -q*2 + 3q. Let h(t) = wg(t) + 6s(t). Let d(r) = -r. What is d(h(i))? -2i2 Let q(j) = -3j - 3. Let d(h) = -3h2 + 6h*2 + 0 - 1 - h - 2h*2. Let i(s) = -3d(s) + q(s). Let c(r) = -r. Determine c(i(l)). 3l2 Let u(c) = -3c. Let b(q) be the first derivative of -2q3/3 - 2q*2 + 4q + 1. Let a(k) = -2k2 - 3k + 3. Let s(w) = -4a(w) + 3b(w). Calculate s(u(f)). 18f2 Let q(o) be the second derivative of -o5/30 + o2/2 + 3o. Let r(y) be the first derivative of q(y). Let n(p) = -p*2. Determine r(n(d)). -2d*4 Let v(s) = -2s*2. Let p(l) = -7l*2 - 2l*2 + 8l*2. Give v(p(n)). -2n*4 Let l(s) = s - 2. Let u be l(0). Let r be 2/((u/(-4))/1). Let a(w) = 2w*2 + 0w*2 - rw2 + w2. Let k(f) = -f2. What is k(a(h))? -h4 Let v(z) = 3z. Let a be 4/(-14) - 138/(-42) - -1. Let y(h) be the second derivative of -2h + 0h3 + 0h*2 + 0 + 1/6h**a. Wh	{ "pile_set_name": "DM Mathematics" }
e greatest common factor of 570229 and 308. 11 What is the greatest common divisor of 486 and 48028707? 243 Calculate the highest common factor of 5817205 and 5. 5 Calculate the greatest common factor of 1209748 and 24716. 668 What is the highest common divisor of 16303510 and 20? 10 Calculate the greatest common divisor of 355581944 and 1192. 1192 What is the highest common factor of 6219638 and 6? 2 What is the highest common factor of 704 and 214577? 11 Calculate the greatest common divisor of 6 and 280949. 1 Calculate the highest common divisor of 19 and 9856117. 19 What is the greatest common factor of 153 and 111114? 9 What is the greatest common factor of 156 and 5201716? 52 Calculate the highest common divisor of 960048 and 268686. 1062 Calculate the highest common factor of 85116 and 1353. 123 Calculate the highest common factor of 50 and 7096730. 10 What is the highest common divisor of 4732 and 58448? 52 Calculate the greatest common factor of 39 and 636878437. 13 What is the greatest common divisor of 1120430790 and 3827? 3827 Calculate the highest common factor of 3060450 and 22410. 270 Calculate the highest common divisor of 1396428510 and 30. 30 What is the highest common divisor of 223 and 229? 1 Calculate the greatest common factor of 3888 and 581584. 16 What is the greatest common divisor of 2912 and 7423624? 104 What is the greatest common factor of 1267275 and 225? 75 Calculate the highest common divisor of 74 and 210690469. 37 What is the greatest common factor of 3476 and 12129739? 79 What is the highest common divisor of 530070674 and 2039? 2039 Calculate the highest common factor of 3072 and 117922944. 384 What is the highest common divisor of 15093 and 626037? 129 Calculate the greatest common factor of 60744956 and 22789. 1753 What is the greatest common divisor of 264 and 222706011? 33 What is the highest common divisor of 8809605 and 1260? 315 What is the greatest common divisor of 651 and 6144572? 217 What is the greatest common divisor of 198 and 1487448? 18 What is the highest common divisor of 24729629 and 417? 139 Calculate the highest common factor of 18122 and 17516902. 442 What is the highest common factor of 50 and 2680613150? 50 Calculate the greatest common divisor of 565 and 35385611. 113 Calculate the greatest common factor of 11 and 3931384501. 11 What is the highest common factor of 1892736 and 64128? 384 What is the greatest common factor of 429323132 and 126? 14 What is the highest common divisor of 54 and 206783586? 18 What is the greatest common factor of 9 and 32098194? 9 Calculate the highest common divisor of 6920 and 5641530. 1730 Calculate the highest common divisor of 1902709 and 652469. 3907 What is the greatest common divisor of 9961032 and 492? 492 Calculate the greatest common factor of 138 and 34346268. 138 Calculate the greatest common factor of 13366 and 518503. 163 What is the highest common divisor of 1159 and 272470469? 1159 Calculate the highest common divisor of 787022075 and 1960. 245 Calculate the greatest common factor of 333 and 207102690. 333 What is the greatest common factor of 16 and 208213496? 8 Calculate the greatest common factor of 2187 and 22815. 27 What is the greatest common factor of 3804 and 25716? 12 Calculate the highest common divisor of 633446 and 12034. 22 Calculate the highest common divisor of 911337398 and 142. 142 Calculate the highest common divisor of 38150 and 2635. 5 Calculate the highest common divisor of 260219073 and 2955. 591 What is the highest common divisor of 2688 and 388612? 28 What is the greatest common divisor of 276 and 468036? 12 Calculate the greatest common divisor of 20221 and 121910. 73 What is the highest common factor of 915501 and 25379? 619 Calculate the highest common divisor of 90828745 and 35. 35 Calculate the greatest common divisor of 19712255 and 16395. 5465 What is the highest common factor of 883268 and 35998? 878 What is the highest common factor of 2528 and 190448? 16 What is the greatest common divisor of 504514 and 668414? 298 Calculate the highest common divisor of 52019348 and 1252. 1252 Calculate the highest common divisor of 2185535 and 1012385. 4345 Calculate the highest common factor of 2335137 and 189. 21 Calculate the greatest common divisor of 2850525 and 36153. 2781 What is the highest common divisor of 390012 and 1596? 84 What is the highest common factor of 963469 and 338? 169 Calculate the greatest common divisor of 130745 and 650170. 395 What is the highest common divisor of 730280720 and 320? 80 What is the greatest common factor of 99739 and 14909? 17 Calculate the greatest common factor of 358107 and 13746. 237 Calculate the greatest common factor of 65 and 134031261. 13 What is the greatest common divisor of 4094747 and 19703? 1159 What is the highest common factor of 484555120 and 280? 280 Calculate the greatest common divisor of 5114256 and 60760. 1736 What is the highest common divisor of 8693295 and 39? 39 What is the greatest common divisor of 5247837 and 1449? 63 Calculate the greatest common divisor of 1114346 and 23978. 1262 What is the highest common factor of 31028640 and 49440? 480 What is the greatest common divisor of 170 and 52911650? 170 Calculate the highest common divisor of 88 and 753197632. 88 Calculate the greatest common divisor of 11505895 and 11315. 365 Calculate the greatest common factor of 3957025 and 1225. 25 Calculate the greatest common factor of 7676963 and 66953. 943 Calculate the greatest common factor of 3726 and 2121309. 81 Calculate the highest common factor of 3584 and 288344. 56 Calculate the greatest common factor of 6555184889 and 11. 11 What is the greatest common factor of 41175 and 106647825? 4575 What is the greatest common divisor of 1532919 and 384462? 4929 Calculate the highest common divisor of 225660 and 1992. 12 What is the highest common divisor of 11 and 115601299? 11 Calculate the greatest common divisor of 1871 and 1251629773. 1871 Calculate the highest common divisor of 35357461 and 2006. 59 Calculate the highest common factor of 317400 and 8600. 200 Calculate the greatest common divisor of 3938487 and 4053. 21 What is the greatest common factor of 69468 and 158? 2 Calculate the highest common divisor of 450 and 1386675. 225 What is the greatest common divisor of 184010 and 18245? 5 What is the greatest common divisor of 1086 and 42173? 181 Calculate the greatest common factor of 242 and 5592334. 22 What is the greatest common divisor of 564517 and 39339? 47 Calculate the greatest common divisor of 3745725 and 615. 15 Calculate the greatest common factor of 212 and 5315741. 53 Calculate the greatest common factor of 17983 and 28273. 49 What is the highest common factor of 30 and 45685440? 30 Calculate the highest common divisor of 5022406 and 11373. 223 What is the greatest common factor of 62570 and 90732757? 6257 What is the highest common factor of 1914 and 537293295? 957 What is the highest common divisor of 14700 and 221025? 525 What is the greatest common divisor of 26064 and 42292098? 3258 What is the greatest common divisor of 112 and 582907024? 112 What is the highest common factor of 10571 and 21421651? 961 What is the highest common factor of 49476 and 199082? 1178 What is the greatest common divisor of 22 and 91529867? 11 What is the greatest common factor of 1101052320 and 90? 30 What is the highest common factor of 7 and 1672217? 1 Calculate the greatest common factor of 960 and 76999380. 60 What is the highest common factor of 324 and 6341004? 324 What is the greatest common divisor of 155344354 and 50270? 10054 Calculate the highest common divisor of 28249 and 9906871. 533 What is the highest common divisor of 153 and 716340968? 17 Calculate the greatest common factor of 227182875 and 375. 375 What is the greatest common divisor of 16 and 7543616? 16 Calculate the highest common divisor of 262 and 94679988. 262 Calculate the greatest common divisor of 3630068 and 156. 52 What is the greatest common factor of 1150163 and 63? 7 Calculate the highest common divisor of 5441744 and 242704. 1232 Calculate the greatest common divisor of 1285013450 and 14. 14 Calculate the highest common factor of 1904 and 2852872. 136 Calculate the	{ "pile_set_name": "DM Mathematics" }
59 Calculate the highest common factor of 4526758 and 94. 94 Calculate the highest common divisor of 21844 and 148844. 508 Calculate the highest common divisor of 1387 and 104044. 19 What is the highest common divisor of 2616 and 1822092? 12 Calculate the highest common factor of 38828544 and 238. 34 What is the highest common divisor of 270 and 358640? 10 Calculate the highest common divisor of 102 and 1143924186. 102 Calculate the greatest common divisor of 106701147 and 404. 101 Calculate the highest common factor of 302562 and 117594. 18 Calculate the greatest common divisor of 388 and 320196. 4 Calculate the highest common factor of 10605389 and 1356. 113 What is the highest common divisor of 34968617 and 593? 593 What is the greatest common factor of 135683924 and 5945? 1189 What is the greatest common divisor of 600777 and 4779? 81 What is the greatest common factor of 6866745 and 15? 15 Calculate the greatest common divisor of 5228740 and 5940. 220 Calculate the highest common factor of 6956692 and 8. 4 Calculate the highest common factor of 1300414518 and 234. 234 What is the highest common divisor of 1016 and 72911716? 508 Calculate the highest common divisor of 6643 and 2346001. 511 Calculate the greatest common factor of 228 and 5438313. 57 Calculate the highest common factor of 12350648 and 868. 124 What is the highest common factor of 658896 and 155184? 2544 What is the greatest common factor of 2122306 and 127999? 4129 What is the greatest common factor of 63696 and 14017101? 3981 What is the highest common factor of 288 and 177056? 32 Calculate the greatest common divisor of 20 and 51920500. 20 Calculate the highest common factor of 918350 and 6. 2 Calculate the highest common divisor of 1446 and 78373923. 723 Calculate the greatest common factor of 29116125 and 450. 225 What is the highest common divisor of 299070800 and 7616? 1904 Calculate the highest common factor of 83070 and 170001. 117 What is the greatest common factor of 5005 and 452543? 91 Calculate the greatest common factor of 1443 and 10259067. 39 What is the greatest common factor of 353730 and 336570? 390 What is the highest common divisor of 2432 and 502094? 38 What is the greatest common factor of 3057194 and 21? 7 What is the highest common factor of 26 and 229129732? 26 Calculate the highest common divisor of 1061004 and 438. 6 What is the greatest common divisor of 456 and 23304621? 57 Calculate the highest common divisor of 702 and 21704085. 351 What is the highest common divisor of 1535 and 55995? 5 Calculate the greatest common factor of 133080979 and 233. 233 Calculate the greatest common divisor of 3641449 and 490301. 5509 What is the greatest common divisor of 333111 and 2997? 111 What is the greatest common factor of 11600 and 2141900? 100 Calculate the greatest common factor of 896156066 and 3406. 3406 What is the highest common divisor of 6816 and 586020? 12 Calculate the highest common factor of 9313 and 4490117. 139 Calculate the greatest common factor of 3983146 and 17. 1 Calculate the greatest common divisor of 9559027 and 37433. 3403 Calculate the highest common factor of 135993 and 556413. 429 Calculate the highest common factor of 72611924 and 4312. 2156 Calculate the highest common divisor of 4064 and 9952. 32 What is the highest common divisor of 2197 and 58253? 13 Calculate the highest common divisor of 217381380 and 3060. 1020 Calculate the highest common divisor of 1583 and 2073430813. 1583 Calculate the highest common divisor of 1394 and 10279033. 17 Calculate the greatest common divisor of 1957638 and 62250. 498 What is the greatest common divisor of 145600 and 3164? 28 Calculate the highest common divisor of 1335 and 419537990. 445 What is the greatest common divisor of 641177 and 20704? 647 Calculate the greatest common factor of 117 and 77310207. 117 Calculate the greatest common divisor of 223607 and 3640997. 4219 Calculate the greatest common divisor of 10168176 and 76232. 5864 Calculate the highest common factor of 1254 and 15527424. 66 Calculate the highest common factor of 11149329 and 7089. 417 What is the highest common factor of 62588220 and 1360? 340 Calculate the greatest common divisor of 932495 and 9193. 29 What is the greatest common factor of 656994 and 1365? 39 Calculate the greatest common factor of 208131 and 983059. 1309 What is the greatest common divisor of 1005517 and 725? 29 Calculate the highest common factor of 2138922 and 497493. 2979 Calculate the greatest common factor of 25606 and 8386. 14 What is the greatest common divisor of 226088 and 51448? 472 Calculate the greatest common factor of 1020 and 102945. 15 What is the greatest common divisor of 468 and 72481428? 36 Calculate the highest common divisor of 261 and 9099591. 87 Calculate the highest common factor of 3501844 and 11268. 1252 What is the greatest common factor of 391588 and 4672716? 1756 What is the greatest common divisor of 22298369 and 2348? 587 What is the greatest common factor of 280470 and 384? 6 Calculate the greatest common divisor of 2919316 and 5027. 457 What is the highest common factor of 192773903 and 217? 217 What is the greatest common divisor of 10 and 1921690? 10 What is the greatest common factor of 129016194 and 798? 114 What is the greatest common divisor of 47 and 95388662? 47 What is the highest common divisor of 391851 and 37370975? 14513 Calculate the greatest common divisor of 136670 and 515540. 1730 Calculate the greatest common divisor of 198381 and 1923627. 2229 Calculate the greatest common divisor of 212528 and 9808. 16 Calculate the greatest common divisor of 24940 and 205550492. 4988 Calculate the greatest common factor of 5023315 and 5225. 1045 What is the greatest common factor of 47711322 and 783? 783 Calculate the highest common factor of 482 and 30455893. 241 Calculate the highest common factor of 26015 and 239080215. 2365 Calculate the highest common factor of 21556904 and 384. 8 What is the highest common factor of 17301 and 18590472? 219 What is the greatest common factor of 3078 and 748602? 162 What is the highest common factor of 1373526 and 96127? 991 Calculate the greatest common divisor of 3077865598 and 706. 706 Calculate the highest common divisor of 19347367 and 455. 13 What is the highest common divisor of 74558370 and 30? 30 Calculate the highest common factor of 223386720 and 1720. 1720 What is the greatest common divisor of 1190 and 18481414? 238 What is the highest common factor of 12065 and 28934029? 127 What is the greatest common factor of 14153350 and 5950? 850 Calculate the highest common divisor of 850 and 5512488. 34 What is the greatest common factor of 5715 and 649575? 45 What is the highest common factor of 17538 and 5626146? 222 Calculate the greatest common divisor of 9480 and 27186981. 237 What is the highest common factor of 30686 and 787518? 134 What is the greatest common factor of 46050 and 34950? 150 What is the highest common factor of 1523 and 333433? 1 What is the highest common factor of 120100 and 13658973? 1201 Calculate the highest common factor of 1404428780 and 1385. 1385 Calculate the greatest common factor of 10216 and 242. 2 Calculate the greatest common factor of 606 and 6029083698. 606 Calculate the highest common factor of 4862 and 4424794. 374 Calculate the greatest common divisor of 13 and 38557. 1 What is the greatest common divisor of 114 and 61602? 6 Calculate the highest common factor of 7005 and 1910280. 15 What is the greatest common factor of 50020 and 182146? 122 Calculate the highest common factor of 56788 and 142. 2 What is the highest common divisor of 4686958 and 5681? 19 Calculate the highest common divisor of 19296721 and 111. 37 Calculate the highest common factor of 43026 and 7575. 303 Calculate the highest common factor of 489426 and 40033. 301 Calculate the highest common divisor of 572133933 and 63. 63 What is the highest common divisor of 74 and 614712487? 37 What is the greatest common factor of 26962 and 46852? 442 What is the highest common factor of 99 and 1326980325? 33 What is the greatest common divisor of 3077 and 1639679? 181 Calculate the greatest common factor of 27364140 and 720. 180 What is the greatest common factor o	{ "pile_set_name": "DM Mathematics" }
*2 - 5r + 8. Let c(g) = -2h(g) - 5u(g). Give c(w). -9 Let d(c) = -548 + 9c + 277 + 268. Give d(-1). -12 Let l(a) = -1 - 2a2 + 5 + a3 - 2a3 - 23a*2 + 26a. Calculate l(-26). 4 Let r(p) be the first derivative of p5/30 + p4/24 - 4p3/3 + 10. Let b(v) be the third derivative of r(v). What is b(1)? 5 Let r(p) = 13p - 2p + 12 + 21 - 2p. Let f(h) = 5h + 17. Let q(w) = 11f(w) - 6r(w). Give q(8). -3 Let w(v) = v3 - 5v*2 + 3v - 1. Suppose -2f - f + 3 = 0. Let i be 1 - 4f/4. Let n be (2 - 7)(i + -1). Give w(n). 14 Let x(t) = 13t*3 - 57t*2 + 70t - 101. Let p(m) = 3m3 - 14m*2 + 18m - 25. Let b(h) = -9p(h) + 2x(h). Determine b(10). 3 Let s = 2 + 10. Suppose -2k - 3 = -3t - 1, -2t = 2k + s. Let j(z) be the third derivative of -z6/120 - z5/60 - z4/12 - z3/2 + 3z2. Give j(t). 5 Let w be (12/15)/(1/5). Let k(o) be the third derivative of -o6/120 + o5/12 - 5o4/24 - o3/2 - 509o2. What is k(w)? -7 Let t(h) be the first derivative of 2h - 7 - 1/3h3 + 0h2. Calculate t(2). -2 Let z = 377 - 372. Let t(h) = -h - 1. Give t(z). -6 Let s(n) be the second derivative of -n5/20 - 5n4/12 - 7n3/6 + n2 - 84n. Determine s(-5). 37 Let r(y) = -4y + 18. Let a(j) = 15j - 73. Let h(z) = -2a(z) - 9r(z). Let t(n) = -n + 3. Let g(m) = 2h(m) + 11t(m). Let q = 62 + -62. Give g(q). 1 Let s(c) = 15c - 233. Let m be s(17). Let y(j) = j - 19. What is y(m)? 3 Let j be (-11)/5 - (3 - 128/40). Let u(m) = -3m2 - m - 1. What is u(j)? -11 Let t(q) = -q. Let v(s) = -s3 - 5s*2 + s + 5. Let a be v(-5). Let h = 28 - 28. Suppose a = -hm - 6m - 6. What is t(m)? 1 Let d(l) be the first derivative of l2/2 + 2l + 720. Let m(a) = -a - 1. Let o be m(2). Let w = o - -9. What is d(w)? 8 Let g(s) = -3s2 - 13s. Let h(w) = w*2 + w - 1. Let u(p) = -g(p) - 4h(p). Let z = -9 - -18. Let m be u(z). Let c(k) = -k*2 + 6k - 2. Determine c(m). 6 Let i(s) = 9s - 23. Let j(u) = -5u + 12. Let b(c) = 6i(c) + 11j(c). Let w(a) be the first derivative of -3a2 + 3. Let d be w(-1). What is b(d)? -12 Let s(l) = l2 + 5l + 6. Let a be s(-5). Let q(u) be the third derivative of u6/120 - u5/12 - u4/4 + u3 - 3u2 - 13u. What is q(a)? 6 Let f(z) be the third derivative of z*5/60 - 3z*4/8 - 169z*2. Let m = -5 + 13. Give f(m). -8 Let s = 5 - 8. Let x be s(6/(-3) + 0). Let i(b) be the third derivative of -b6/120 + b5/10 - b4/24 + b3/3 - 8b2. What is i(x)? -4 Let t(f) = -3f + 6. Let y(p) = -p*3 + 7p*2 + 5. Let r be y(7). Suppose 0 = 2h - 25 + r. Suppose h = 2x + 2b, -5x = -0x + 3b - 23. What is t(x)? -6 Suppose 0s = 5f - 3s + 32, 28 = -3f + 4s. Let p(j) = 7j - 6. Determine p(f). -34 Let h be (-1)/(-5) - (-348)/60. Suppose hf - 10 = f. Suppose -2i + i + 1 = 2w, 0 = 2w - fi + 2. Let u(q) = q - 11. What is u(w)? -11 Suppose 4g - 16 = 3x - x, 0 = -3g + 3x + 18. Let s(i) = -3 - i*3 + 18i*g - 24i*2 + 0i*3. Suppose -4w - 6 = 18. What is s(w)? -3 Let j(y) = -29y + 7y - 2 + 6y2 + 12y - 5y2. Determine j(10). -2 Let h(p) = p2 + p + 2. Let u(a) = 6a*3 + a + 7a*2 + 5 - 9a - 5a3. Let c be u(-8). Suppose -cz + 5g = 2g + 7, 4z - 3g + 5 = 0. Calculate h(z). 4 Suppose 3r + 2r = 0. Let x(c) = 2c + 1 + r + c. Let d be 33/10 - 99/330. Determine x(d). 10 Let w(x) be the first derivative of 1/2x*2 + 6x + 4. Give w(-3). 3 Let o(k) = 19k3 - 20k*3 - 6 - 6k*2 + 7 - 4k. Give o(-5). -4 Let b(h) = -5h2 - 2h + 1. Let c(q) = 2q2 + 28q + 33. Let l(v) = 3v2 + 42v + 49. Let w(u) = -7c(u) + 5l(u). Let p be w(-13). Calculate b(p). -6 Let u be (16/(-26))/(-4) + (-629)/(-221). Let i(v) be the first derivative of 6v - 7 + 3/2v*2 - 1/3vu. Calculate i(5). -4 Let h(y) = y3 - 6y2 + 0y*3 + 4 + 0y*3. Suppose -m - 3n + 9 = 0, -3m - 1 = n - 4. Suppose m = 4u + x - 25, 0u + 4x = u - 2. Determine h(u). 4 Let b be 20 + (-2055)/105 + (-81)/(-7). Let p(q) = -2q2 + 22q + 16. Determine p(b). -8 Let l = -594 - -598. Let y(a) = -7a + a3 + 3 + 4a - 3a2 + 4a. What is y(l)? 23 Let v(r) be the first derivative of -r*4/4 - 9r*3 + 15r*2 + 56r + 568. Determine v(-28). 0 Let y be (-32)/(-12)65/(-10). Let b(t) be the first derivative of t*4/4 + 3t*3 + 5t*2 + 10t - 3. Calculate b(y). -6 Let r(p) be the second derivative of -7p4/12 - p3/6 + 190p. Let m be 4-2 + (2 - -1). Let g = m + 6. What is r(g)? -8 Let s(j) = 2j - 2 - 1 + 2. Let c(r) = r*2 - 2r - 5. Let b be c(-3). Suppose p + 9 = 3i, 0 = 5p - bp + 3i + 3. What is s(p)? 5 Let u(n) = n3 - n2 + 1. Let x(b) = 6b3 + 4b*2 + 8b + 11. Let t(h) = 5u(h) - x(h). Let w(f) = -12f + 16. Let v be w(2). Determine t(v). -6 Suppose -6x + 176 = -2x - 4k, -2x = 5k - 67. Let t = x - 29. Let u = t - 18. Let h(p) = -2p - 1. Give h(u). 11 Let l(f) = 8f3 + 2f2 - 1. Let b be 0/(-5) + 4 + -5. Let p be 2/((-4)/(b + 3)). Calculate l(p). -7 Let t(c) be the second derivative of -c8/6720 + c7/840 - c6/720 - c*5/60 + 5c*4/6 + 42c. Let z(m) be the third derivative of t(m). What is z(2)? 0 Let h(g) = g*2 - 5g + 4. Let u(k) = -7k - 1 + 0k + 5k - 8. Let l be u(-7). Suppose -3m + 4j + 22 = -j, 0 = -4m - lj + 6. What is h(m)? 0 Let y(u) be the second derivative of u3/2 - 6u*2 - 156u. Calculate y(12). 24 Let l(g) be the first derivative of -g*3/3 - 7g*2/2 - 8g - 2. Let b be l(-6). Let o(y) be the second derivative of -7y3/6 - y2/2 - 40y. Give o(b). 13 Suppose o + o = h + 6, 3h = -3o - 9. Let n(v) = -v*3 - 5v*2 - 4v + 1. Give n(h). 1 Let h(a) = -24a3 + 1. Let y = 9 - -5. Let g(i) = i3 - 14i*2 + 2i - 27. Let q be g(y). Give h(q). -23 Let v(u) be the first derivative of u*4/4 + 8u*3/3 + 3u*2 - 2u + 4. What is v(-7)? 5 Suppose 0 = -x - 4g + 39, 2x = 5g + 61 - 22. Suppose 8h - x = -11. Let m(d) = -4d2 + 2d - 6d + 2 + 7d*2. Determine m(h). 6 Suppose -r = -2r. Suppose v + 3m + 14 = r, -4v - 3m + m - 56 = 0. Let n = v + 10. Let z(p) = -p3 - 4p*2 + 3p + 5. Calculate z(n). -7 Let r(n) be the third derivative of -1/60n5 + 17n*2 + 1/6n*3 - 1/6n*4 + 0 + 0n. Determine r(-4). 1 Let x(f) = f - 3. Let i(j) = -j*2 + 14j + 12. Let d be i(15). Let u be 3 + d/21 - 2/(-14). Determine x(u). 0 Let d(m) = 29. Let u(r) = -r + 36. Let t(j) = 4d(j) - 3u(j). Calculate t(-10). -22 Suppose 0r = 4r + 20. Let z(b) = -b*3 - 4b*2 - 4b - 12. Let g be z(-4). Let i(k) = -gk - 230 - 225 - k2 + 456. Calculate i(r). -4 Let z(h) be the second derivative of -h4/4 + h3/2 - 2h*2 - 77h. What is z(3)? -22 Suppose -k - v + 22 = 0, 3v + 15 = k - 19. Let h be (4 + 11)6/(-5). Let b = k + h. Let t(n) = n - 1. What is t(b)? 6 Let p(w) = 71w2 - 8 - 43w*2 + 3 - 27w*2 - 11w. Calculate p(12). 7 Let n(a) = -4 + 16a - 9 + 12. What is n(-1)? -17 Let p(l) be the first derivative of -l3/3 + 2l*2 + 8l + 1. Suppose 4q = -0q + 24. Let r be p(q). Let f(z) = z. What is f(r)? -4 Let z(v) = -1 + 6v3 - 31v*2 - 32v*2 - 31v*2 + 97v*2. Calculate z(-1). -4 Suppose -32c + 169 - 393 = 0. Let b(k) = -2k + 7. What is b(c)? 21 Let c(l) = -3l*2 - 7l + 1. Suppose 15 = -5j - t, -5t + 6 = j + 9. Give c(j). -5 Let z(v) be the second derivative of v8/6720 + v7/1260 + v*5/30 - 11v*4/12 - 19v. Let p(x) be the third derivative of z(x). Calculate p(-3). -5 Let a(l) = -2l2 + 3l. Let x be -3 + -210 + 2. Suppose 7c - 4c + 144 = 0. Let g be 10/(-35) + c/x. Determine a(g). -2 Let p(a) = -3a + 3. Let q(b) = b - 1. Let k(t) = p(t) + 4q(t). Suppose 1 = -o + 3o - i, 0 = -o - 3i + 11. Calculate k(o). 1 Let a(k) = -k2 - 4k + 11. Suppose -8j = -3g + 45, 5j - 5 + 36 = -g. Give a(j). -1 Suppose 23y - 40y = -34. Let o(r) = -r - 3r - 3r + 1 + r. Give o(y). -11 Let q(b) = 11b - 1. Let z be (2/(-11) - 84/264)0. Suppose 9r - 12r + o + 1 = 0, 3r + o - 5 = z. What is q(r)? 10 Suppose -6g - 42 = -4g. Let d = g - -16. Let i be 0/((-12)/4 - d). Let h(j) = j - 9. Calculate h(i). -9 Let v(c) = c*2 + 9c - 3. Let a(z) = z*2 + 8z - 3. Let m(r) = -r*2 - 6r - 11. Let j be m(-5). Let w(x) = ja(x) + 5v(x). Determine w(-3). 3 Let n(s) = 3s + 6. Let v(j) = -4j - 7. Let u(f) = -f*3 + 7f*2 + 7f + 2. Let	{ "pile_set_name": "DM Mathematics" }
inder when 6458 is divided by 165? 23 What is the remainder when 7469 is divided by 58? 45 Calculate the remainder when 27247 is divided by 3391. 119 What is the remainder when 3337 is divided by 918? 583 What is the remainder when 379 is divided by 55? 49 Calculate the remainder when 7009 is divided by 352. 321 What is the remainder when 399 is divided by 15? 9 Calculate the remainder when 8223 is divided by 317. 298 What is the remainder when 6082 is divided by 276? 10 What is the remainder when 541394 is divided by 20? 14 What is the remainder when 264703 is divided by 53? 21 Calculate the remainder when 8652 is divided by 42. 0 Calculate the remainder when 12614 is divided by 4201. 11 What is the remainder when 8159567 is divided by 19? 17 What is the remainder when 5213 is divided by 4290? 923 Calculate the remainder when 3931090 is divided by 22. 20 What is the remainder when 474551 is divided by 255? 251 Calculate the remainder when 28378 is divided by 63. 28 What is the remainder when 10712 is divided by 159? 59 What is the remainder when 901 is divided by 773? 128 Calculate the remainder when 10873165 is divided by 166. 165 What is the remainder when 3149 is divided by 42? 41 What is the remainder when 177537 is divided by 60? 57 Calculate the remainder when 6478 is divided by 21. 10 Calculate the remainder when 97760 is divided by 202. 194 What is the remainder when 3289 is divided by 932? 493 Calculate the remainder when 26627 is divided by 104. 3 Calculate the remainder when 64286 is divided by 2571. 11 What is the remainder when 1697 is divided by 551? 44 Calculate the remainder when 5093 is divided by 133. 39 Calculate the remainder when 3098 is divided by 511. 32 What is the remainder when 4812 is divided by 4781? 31 What is the remainder when 2575 is divided by 840? 55 What is the remainder when 7011 is divided by 1749? 15 Calculate the remainder when 157257 is divided by 254. 31 Calculate the remainder when 12034 is divided by 188. 2 Calculate the remainder when 9024 is divided by 701. 612 Calculate the remainder when 18526 is divided by 2479. 1173 Calculate the remainder when 758 is divided by 26. 4 What is the remainder when 125278 is divided by 58? 56 What is the remainder when 136089 is divided by 66? 63 Calculate the remainder when 3012 is divided by 37. 15 Calculate the remainder when 543011 is divided by 6. 5 Calculate the remainder when 49000 is divided by 2722. 4 What is the remainder when 60737 is divided by 179? 56 Calculate the remainder when 6253 is divided by 186. 115 What is the remainder when 4619 is divided by 56? 27 What is the remainder when 29935 is divided by 76? 67 Calculate the remainder when 249998 is divided by 1282. 8 What is the remainder when 1664 is divided by 1652? 12 What is the remainder when 64596 is divided by 2162? 1898 What is the remainder when 1847560 is divided by 15? 10 What is the remainder when 245949 is divided by 122966? 17 Calculate the remainder when 52666 is divided by 3761. 12 What is the remainder when 439 is divided by 411? 28 What is the remainder when 182038 is divided by 148? 146 Calculate the remainder when 7444 is divided by 46. 38 What is the remainder when 5058 is divided by 1600? 258 What is the remainder when 3250 is divided by 1620? 10 Calculate the remainder when 9639 is divided by 2402. 31 What is the remainder when 1254 is divided by 246? 24 Calculate the remainder when 384 is divided by 73. 19 Calculate the remainder when 38491 is divided by 9. 7 Calculate the remainder when 34592 is divided by 427. 5 What is the remainder when 134586 is divided by 437? 427 What is the remainder when 8536 is divided by 39? 34 What is the remainder when 2767 is divided by 1349? 69 Calculate the remainder when 106239 is divided by 160. 159 Calculate the remainder when 14767 is divided by 102. 79 Calculate the remainder when 49941 is divided by 24967. 7 What is the remainder when 132959 is divided by 3692? 47 What is the remainder when 12891 is divided by 4262? 105 Calculate the remainder when 254 is divided by 19. 7 What is the remainder when 1928469 is divided by 10? 9 Calculate the remainder when 15787 is divided by 15770. 17 Calculate the remainder when 99776 is divided by 27. 11 Calculate the remainder when 3102 is divided by 15. 12 Calculate the remainder when 4001 is divided by 1163. 512 What is the remainder when 14991 is divided by 163? 158 What is the remainder when 60136 is divided by 439? 432 What is the remainder when 3591 is divided by 238? 21 Calculate the remainder when 7649 is divided by 826. 215 What is the remainder when 62100 is divided by 225? 0 Calculate the remainder when 11989 is divided by 480. 469 Calculate the remainder when 215221 is divided by 28. 13 What is the remainder when 2690 is divided by 274? 224 What is the remainder when 100 is divided by 42? 16 Calculate the remainder when 184649 is divided by 92317. 15 Calculate the remainder when 3057 is divided by 219. 210 What is the remainder when 38452 is divided by 4804? 20 What is the remainder when 2695348 is divided by 436? 432 Calculate the remainder when 3561 is divided by 4. 1 Calculate the remainder when 420590 is divided by 14. 2 What is the remainder when 2375158 is divided by 71? 66 What is the remainder when 6389 is divided by 3188? 13 Calculate the remainder when 77307 is divided by 63. 6 Calculate the remainder when 33990 is divided by 148. 98 Calculate the remainder when 11235 is divided by 1327. 619 Calculate the remainder when 6847 is divided by 130. 87 What is the remainder when 12795 is divided by 3838? 1281 What is the remainder when 13616 is divided by 1701? 8 What is the remainder when 13020 is divided by 334? 328 Calculate the remainder when 339552 is divided by 21. 3 What is the remainder when 13009 is divided by 297? 238 Calculate the remainder when 172714 is divided by 321. 16 Calculate the remainder when 78015 is divided by 18. 3 What is the remainder when 9717 is divided by 68? 61 Calculate the remainder when 1317846 is divided by 244. 2 What is the remainder when 52912 is divided by 58? 16 Calculate the remainder when 1435 is divided by 704. 27 What is the remainder when 217569 is divided by 473? 462 What is the remainder when 2229 is divided by 514? 173 Calculate the remainder when 3895513 is divided by 17. 14 What is the remainder when 350 is divided by 253? 97 Calculate the remainder when 2046790 is divided by 66. 64 Calculate the remainder when 13691 is divided by 907. 86 What is the remainder when 5875 is divided by 138? 79 Calculate the remainder when 96937 is divided by 19. 18 Calculate the remainder when 5976 is divided by 22. 14 Calculate the remainder when 1396462 is divided by 94. 92 Calculate the remainder when 1173607 is divided by 66. 61 What is the remainder when 320860 is divided by 45835? 15 What is the remainder when 27283 is divided by 51? 49 What is the remainder when 1346 is divided by 278? 234 What is the remainder when 1750 is divided by 82? 28 What is the remainder when 209904 is divided by 487? 7 Calculate the remainder when 6202 is divided by 11. 9 What is the remainder when 16866 is divided by 241? 237 Calculate the remainder when 424 is divided by 33. 28 What is the remainder when 5393 is divided by 128? 17 What is the remainder when 648262 is divided by 63? 55 Calculate the remainder when 3296 is divided by 55. 51 Calculate the remainder when 3594 is divided by 148. 42 Calculate the remainder when 56869 is divided by 56861. 8 What is the remainder when 160064 is divided by 687? 680 Calculate the remainder when 7554990 is divided by 166. 164 What is the remainder when 7928 is divided by 36? 8 What is the remainder when 9292 is divided by 1029? 31 What is the remainder when 13533 is divided by 4495? 48 What is the remainder when 30951 is divided by 659? 637 Calculate the remainder when 949 is divided by 92. 29 What is the remainder when 4001 is divided by 400? 1 What is the remainder when 152014 is divided by 623? 2 What is the remainder when 525851 is divided by 19? 7 Calculate the remainder when 204752 is divided by 102375. 2 Calculate the remainder when 594669 is divided by 624. 621 Calculate the remainder when 9688 is divided by 425. 338 Wha	{ "pile_set_name": "DM Mathematics" }
y 38690? 24 What is the remainder when 176244 is divided by 10334? 566 Calculate the remainder when 2194599 is divided by 196. 183 What is the remainder when 5265013 is divided by 66645? 58 Calculate the remainder when 228096 is divided by 2507. 2466 What is the remainder when 337297 is divided by 1520? 1377 What is the remainder when 5027343 is divided by 1675765? 48 What is the remainder when 642888 is divided by 236? 24 What is the remainder when 96670530 is divided by 131? 128 What is the remainder when 3304959 is divided by 1098? 1077 Calculate the remainder when 41505 is divided by 20576. 353 What is the remainder when 3533979 is divided by 1766966? 47 Calculate the remainder when 40502508 is divided by 43. 34 Calculate the remainder when 16396 is divided by 1499. 1406 What is the remainder when 41927 is divided by 41869? 58 What is the remainder when 55499 is divided by 1606? 895 What is the remainder when 1216843 is divided by 8112? 43 Calculate the remainder when 446354 is divided by 325. 129 Calculate the remainder when 7113125 is divided by 3556555. 15 Calculate the remainder when 111971702 is divided by 163. 156 What is the remainder when 961708 is divided by 6124? 240 Calculate the remainder when 2757352 is divided by 6963. 4 What is the remainder when 5254483 is divided by 501? 496 Calculate the remainder when 28387 is divided by 3129. 226 What is the remainder when 253076 is divided by 40070? 12656 Calculate the remainder when 1146106 is divided by 1085. 346 Calculate the remainder when 102025 is divided by 954. 901 Calculate the remainder when 9619865 is divided by 3206615. 20 What is the remainder when 42651 is divided by 21308? 35 Calculate the remainder when 5158741 is divided by 25412. 105 Calculate the remainder when 3146519 is divided by 2577. 2 Calculate the remainder when 8376394 is divided by 61. 57 Calculate the remainder when 16905 is divided by 3550. 2705 What is the remainder when 12053105 is divided by 342? 341 What is the remainder when 25157021 is divided by 11? 10 What is the remainder when 2218020 is divided by 2218003? 17 Calculate the remainder when 3527079 is divided by 390. 309 What is the remainder when 433788 is divided by 836? 740 Calculate the remainder when 3241836 is divided by 83. 22 What is the remainder when 233586 is divided by 264? 210 Calculate the remainder when 181277 is divided by 96. 29 What is the remainder when 1589723 is divided by 1788? 191 Calculate the remainder when 6231934 is divided by 264. 214 What is the remainder when 34157 is divided by 674? 457 What is the remainder when 98211051 is divided by 299? 16 What is the remainder when 81427428 is divided by 211? 207 Calculate the remainder when 78934812 is divided by 762. 756 What is the remainder when 561572 is divided by 1141? 200 What is the remainder when 2298645 is divided by 14? 13 What is the remainder when 241404450 is divided by 80468147? 9 What is the remainder when 932849 is divided by 450? 449 Calculate the remainder when 157937407 is divided by 301. 299 Calculate the remainder when 101876977 is divided by 268. 261 Calculate the remainder when 437314 is divided by 437273. 41 What is the remainder when 4780152 is divided by 1593378? 18 What is the remainder when 6420537 is divided by 5837? 5674 Calculate the remainder when 73279398 is divided by 108. 102 What is the remainder when 201882 is divided by 13444? 222 Calculate the remainder when 2089827 is divided by 834. 657 What is the remainder when 495312 is divided by 25? 12 What is the remainder when 50114094 is divided by 31? 21 What is the remainder when 324512 is divided by 1876? 1840 Calculate the remainder when 1935555 is divided by 1148. 27 Calculate the remainder when 39613916 is divided by 127. 76 What is the remainder when 566530 is divided by 29817? 7 Calculate the remainder when 121069837 is divided by 1081. 1080 What is the remainder when 178012041 is divided by 4178? 4173 What is the remainder when 3672998 is divided by 2739? 2738 What is the remainder when 396066 is divided by 695? 611 Calculate the remainder when 10986513 is divided by 2286. 2283 Calculate the remainder when 137050 is divided by 66472. 4106 Calculate the remainder when 665309 is divided by 20157. 128 What is the remainder when 161531 is divided by 79965? 1601 Calculate the remainder when 33398979 is divided by 158. 149 What is the remainder when 11068140 is divided by 2741? 2723 Calculate the remainder when 123398 is divided by 77. 44 Calculate the remainder when 48198399 is divided by 320. 319 What is the remainder when 1268489 is divided by 139? 114 What is the remainder when 4110524 is divided by 44? 0 What is the remainder when 560355 is divided by 343? 236 Calculate the remainder when 12980 is divided by 12815. 165 What is the remainder when 655792 is divided by 5419? 93 What is the remainder when 154386823 is divided by 745830? 13 What is the remainder when 5253713 is divided by 1649? 1648 Calculate the remainder when 4248520 is divided by 1014. 874 What is the remainder when 770170 is divided by 384696? 778 Calculate the remainder when 36510 is divided by 18185. 140 Calculate the remainder when 625925 is divided by 4503. 8 What is the remainder when 1055834 is divided by 175929? 260 What is the remainder when 4646820 is divided by 1322? 1312 Calculate the remainder when 18504 is divided by 8283. 1938 Calculate the remainder when 150923 is divided by 30. 23 What is the remainder when 379344 is divided by 1016? 376 Calculate the remainder when 2756041 is divided by 1378002. 37 What is the remainder when 4015967 is divided by 5? 2 What is the remainder when 15761572 is divided by 5959? 17 Calculate the remainder when 6505633 is divided by 2745. 2728 What is the remainder when 292767 is divided by 3527? 26 Calculate the remainder when 107569 is divided by 34153. 5110 What is the remainder when 325679 is divided by 203? 67 Calculate the remainder when 10499281 is divided by 423. 421 Calculate the remainder when 19363 is divided by 796. 259 Calculate the remainder when 3262030 is divided by 25. 5 What is the remainder when 16737219 is divided by 59563? 16 What is the remainder when 21333403 is divided by 10666700? 3 Calculate the remainder when 667293 is divided by 667275. 18 What is the remainder when 425247 is divided by 38654? 53 Calculate the remainder when 1275221 is divided by 28973. 409 Calculate the remainder when 130509975 is divided by 179. 1 Calculate the remainder when 53877 is divided by 53829. 48 Calculate the remainder when 384350 is divided by 47961. 662 What is the remainder when 6490 is divided by 181? 155 Calculate the remainder when 466428 is divided by 1829. 33 Calculate the remainder when 6356259 is divided by 1589064. 3 Calculate the remainder when 1047884 is divided by 10072. 396 Calculate the remainder when 1660616 is divided by 207572. 40 What is the remainder when 185513 is divided by 1315? 98 What is the remainder when 15316532 is divided by 143145? 17 What is the remainder when 421850 is divided by 2687? 2678 What is the remainder when 43021748 is divided by 6867? 6860 What is the remainder when 4446278 is divided by 1869? 1796 What is the remainder when 354718 is divided by 598? 104 What is the remainder when 2456540 is divided by 492? 476 What is the remainder when 19719434 is divided by 9859639? 156 What is the remainder when 297453 is divided by 740? 713 Calculate the remainder when 3768567 is divided by 29. 17 Calculate the remainder when 392888495 is divided by 169. 168 What is the remainder when 5280852 is divided by 26404? 52 Calculate the remainder when 50544 is divided by 551. 403 Calculate the remainder when 2998472 is divided by 749615. 12 Calculate the remainder when 768667 is divided by 583. 273 What is the remainder when 1596356 is divided by 370? 176 What is the remainder when 2460106 is divided by 291? 283 What is the remainder when 1005409 is divided by 396? 361 Calculate the remainder when 3632833 is divided by 458. 435 What is the remainder when 2375422 is divided by 791737? 211 Calculate the remainder when 66890385 is divided by 67. 64 Calculate the remainder when 61110 is divided by 2079. 819 What is the remainder when 42481 is divide	{ "pile_set_name": "DM Mathematics" }
b) 1 (c) d b Let h = -10.2 + 9.7. Which is the nearest to 0.2? (a) -1 (b) h (c) 6 b Let l = 1.4 + -1.2. Let u = -0.2 + 0. Let n = -3.1 + 3. What is the closest to n in l, -3/2, u? u Let l = -4 + 0. What is the closest to -1 in l, 4, 0? 0 Let o(q) = q*2 - 7q + 3. Let p be o(6). Let r = -3.5 + 3. Which is the nearest to -1? (a) r (b) -5 (c) p a Let m = 80 + -561/7. What is the closest to -0.3 in -1/3, 4, m? -1/3 Let d be (10/(-25))/(16/10). Which is the closest to -0.1? (a) -10 (b) d (c) -3 b Let v(i) = -i*3 - 17i*2 - 16i + 4. Let h be v(-16). Which is the closest to 2? (a) 0.5 (b) -0.1 (c) h a Let z = -0.4 + 0. Let b = 94.9 + -95. What is the closest to -1 in -3/5, z, b? -3/5 Let g be 714/(-24)14/4. Let o = g + 104. Which is the closest to 1? (a) o (b) 0.1 (c) 5 b Let o(g) = -g3 - 4g*2 + 3g - 7. Let b be o(-5). What is the nearest to -0.2 in -0.5, -0.3, b? -0.3 Let x = 0 + -0.1. Let t = x - 3.9. Let v(h) = h*3 + 3h*2 + 1. Let z be v(-2). What is the nearest to 0.1 in z, t, -6/5? -6/5 Let j = -0.7 + -0.3. Let f be (0 - 10/8)4. Let q be (-2)/6 + 0/(-2). Which is the nearest to j? (a) q (b) f (c) 0.1 a Suppose 4q + 5h - 10 = 0, -2h + 11 - 7 = 4q. Let r = 0.5 + 0. What is the nearest to -2/7 in q, -0.5, r? -0.5 Let s = -0.234 - -0.034. Suppose -5 + 20 = 3z. Suppose -4i + z = i. What is the nearest to s in i, -3/4, -4? -3/4 Let d = -0.36 - -0.56. Let h = -5/9 - -47/36. Let n be (-3)/2(2 - 4). Which is the closest to d? (a) -5 (b) n (c) h c Suppose 4f - 2 = -2q + 20, 0 = -2f - 2q + 16. Let m = 12 + -87/7. Which is the closest to -2/7? (a) f (b) m (c) 1 b Let z be (-4)/3(-21)/70. Which is the nearest to z? (a) 1/2 (b) 26 (c) -2 a Let g = 2/309 - 935/1236. Suppose -q + 4 + 1 = 0. Suppose -qs + s = 0. Which is the closest to s? (a) g (b) -3 (c) -0.1 c Suppose -3r + 15 = 2r. Let g = -34 + 33.9. Which is the closest to 0.1? (a) 5 (b) r (c) g c Let v be 4/(-2) + 29/24. Let h = -1/8 - v. Let r be 55/20 - 6/2. Which is the nearest to r? (a) 0.5 (b) 5 (c) h a Let x be 9/2 - 2/4. Let v(y) = 0 - 2 - y + 9 - 2. Let i be v(x). What is the closest to -0.1 in -0.3, 5, i? -0.3 Let m be -2 + -1 + 36/10. Let u = -47/10 - -21/5. Which is the nearest to 0? (a) 5 (b) u (c) m b Let i = 55 - 55.1. Which is the closest to 9? (a) 5 (b) i (c) 0.3 a Let n = 0.33 + -0.13. What is the nearest to 0 in 5, n, 1? n Let n(k) = 4k + 5. Let t be n(0). Let w = 3.91 - -0.09. Let x be 2 - (1 + (-8)/(-6)). What is the closest to x in -4, w, t? -4 Let d = 1.57 - 2. Let j = 0.03 + d. Let s be (-6)/(-40) - 2/5. Which is the closest to s? (a) 0 (b) 3 (c) j c Let p(q) = -q*3 - 3q*2 + q + 2. Let o be p(-3). Suppose 3y = -4v - 25, -4y + 0v - 8 = -v. Which is the nearest to 1/3? (a) o (b) 2/7 (c) y b Let v = -38.5 - -39. What is the closest to 1 in -1, -1/6, v? v Let o = 2/121 + 109/726. Let p(i) = 7i*2 - 4i + 6. Let j be p(2). Let w = j + -26. What is the closest to w in o, -1/2, 2? o Let j = -18 - -23. Which is the closest to j? (a) -0.3 (b) -2/7 (c) -0.2 c Let a = -0.5 - -0.8. What is the closest to 1 in a, -0.1, 0.5? 0.5 Let u = 0.064 + -0.474. Let m = -0.01 - u. Let g = m + 2.6. What is the closest to 1 in -2/3, -2, g? -2/3 Let b = 0.62 - 0.6. Let i = b + 0.38. What is the closest to 1 in 1, 0.5, i? 1 Let s = -8.31 - -8.3. Which is the closest to 0? (a) s (b) 0.2 (c) 1 a Let z = 0.18 - -0.22. Let y = 0.3 - z. What is the closest to y in -0.5, 0.2, 2? 0.2 Let p be -1(1 + 3 + 2). Let d(x) = x3 + 6x*2 + 2x + 9. Let r be d(p). Let l be -11 - 6/r. Which is the nearest to l? (a) -0.3 (b) 0.5 (c) -2/3 b Suppose 2w - 4 = 4. Suppose 4q = -z + 13, -5z - 2q = -4 + 11. Let r = 0.5 - 0.6. Which is the closest to r? (a) w (b) z (c) -0.4 c Let r be 42/(-68) - (-1)/2. Let h = 4.04 - 0.04. What is the nearest to 1 in r, h, 3? r Let h = -10/17 - -33/85. Let u = -2 + 2.1. Which is the nearest to u? (a) 1 (b) 0 (c) h b Let a be -2(-3)/(-3 + 0). Suppose -4t + 26 = -3m, -2t + 14 = m - 2m. Let s be (0 - 2)a/t. What is the closest to 1 in -2, s, -4? s Let v be 1/1 + (-27)/45. What is the closest to v in -2, -1/8, 3/4? 3/4 Suppose -2q = -x + 1, -4 + 19 = 5x. Let t(r) = r2 + r - 1. Let n be t(q). Which is the nearest to -1/4? (a) 2/5 (b) 3 (c) n a Let h be (6/(-4))/((-3)/(-8)). Which is the nearest to 2/5? (a) 1 (b) 4/7 (c) h b Suppose 28i - 23i + 5 = 0. Let r = -299/5 - -60. What is the closest to 1/4 in -0.1, r, i? r Let i = 3 + -5/2. What is the closest to -0.1 in -2, i, -0.3? -0.3 Let q(m) = -3m2 - m. Let x be q(-1). Let j be ((4/(-6))/x)/1. Which is the nearest to 1/4? (a) 3 (b) j (c) -0.4 b Let n = -2.2 - -2. Let d = 3 + -3.5. Let x = d - n. What is the closest to -1 in x, -4, -3/5? -3/5 Let a be ((-3)/4)/((-42)/(-16)). Let d = 0.3 - 0.24. Let i = d - 3.06. What is the closest to a in 1/10, i, -1/6? -1/6 Let h = -1.7 - -1.4. What is the nearest to -2/7 in 4, h, 3? h Let h = 38 + -37.9. What is the closest to 2/11 in h, -1/6, 2/13? 2/13 Let r(x) = x3 + 5x2 + 2x + 5. Let l be r(-5). Let t = 6 + l. Let n = 0.6 - 3.6. Which is the closest to t? (a) 1/4 (b) 3 (c) n a Let b = 2.88 + 0.32. Let p = b + -3. What is the closest to -0.2 in 4, p, -3/2? p Suppose -6m = -9m - 24. What is the nearest to m in -1, 1/4, -2? -2 Let g = 52/329 - -6/47. Let b = -6 - -11. What is the nearest to 1 in b, g, 4/5? 4/5 Let w(z) = z*3 + 7z*2 + 7z + 7. Let d be w(-6). Suppose b = 3l + 1 + d, 4b = -3l + 8. Let o = -3/7 + 11/42. What is the nearest to l in -0.3, 0.2, o? o Let t = -1 + 2. Let j be t(-2 - (-1 - -4)). Let s = 2/27 - -67/189. Which is the nearest to 1? (a) s (b) -3 (c) j a Let h be -2 - (-993)/(-21) - 2. Let n = h + 51. Let i = 16 + -15. Which is the closest to n? (a) -2 (b) -3/2 (c) i b Let v be -2 - 11/((-121)/24). What is the closest to -2/7 in 1, 4, v? v Let d be (1 - -2)(-7)/14. Let p = 25.9 + -27. Let i = p + 0.1. Which is the closest to i? (a) 4 (b) 1 (c) d c Suppose 3u = -2w + 9, -3u + 7 + 5 = 3w. What is the closest to 1 in 0, 0.1, w? 0.1 Let q = -2.14 - -0.14. What is the nearest to q in -3/8, -0.3, -1? -1 Suppose 0 = 16q - 12q. Which is the nearest to 1? (a) 3 (b) 1/7 (c) q b Let j = -0.1 + 0.2. Suppose 2h - 30 + 5 = -5c, 2h = 4c - 2. Let z be (12/(-8))/(1/(-2)). What is the closest to j in z, h, 1/5? 1/5 Let r = 98 + -682/7. Let t = -0.963 - 0.037. What is the nearest to 2 in r, t, 3? 3 Suppose 7d = 2d. Let i(x) = 1 + 0x + 0x + 2 - 2x. Let w be i(2). What is the closest to d in 0.5, w, -5? 0.5 Let o = 1.6 - 0.6. Which is the nearest to -1? (a) 3 (b) o (c) 0.3 c Let f = 43/190 + -1/38. Let h = -5.12 - -0.12. Let o = -3 + 2.9. Which is the closest to 1/2? (a) f (b) o (c) h a Let s = 32 + -31. What is the nearest to s in -4, 0, 4? 0 Let r = -2/227 - -460/681. Which is the closest to -1? (a) 4 (b) -0.5 (c) r b Let t = 133/6 + -22. Let u = -1.2 - -0.2. Which is the nearest to u? (a) t (b) 1/3 (c) 4/9 a Let o = 1.9 - 4.9. Which is the nearest to -1/3? (a) o (b) 0 (c) -4/3 b Let d = 13 + -119/9. Let c be 4/159/(-6). What is the nearest to c in d, -0.4, -5? -0.4 Let b = 24 + -14. Let x = 11 - b. What is the nearest to x in 4, -5, -3? 4 Let q be (3/(-4))/(9/4822). Which is the closest to 5? (a) -5 (b) 5 (c) q b Let p = 4 + -3. Which is the nearest to 0.1? (a) p (b) -0.4 (c) 2/3 b Let r = 0.07 + 0.03. Let u = 0.1 - -0.6. Let k = u - 3.7. Which is the nearest to r? (a) -2 (b) -2/9 (c) k b Let h = 16 - 23. Let s = h + 6.9. Which is the nearest to s? (a) 4 (b) -3 (c) -0.2 c Let d = 2.3 - 1.3. Which is the closest to -2/5? (a) -1/2 (b) d (c) -4/7 a Let t = 2 - 2.1. Let x(m) = m*3 - 3m*2 + 2m - 4. Let v be x(3). Let z be 6/(-18) + 1/v. What is the closest to t in -5, z, -0.2? -0.2 Let v = -0.4 + 0.4. Let w = v - -1. Which is the nearest to -0.1? (a) 0 (b) -0.1 (c) w b Suppose 5h + f - 3 = 0, -5f = -2*h - 0 + 12. Let r be (-4)/(-5) + 4/(-10). Which is the closest to r? (a) 4 (b) h (c) 0.1 c Let k = -12 + 7. Let m = -0.22 - 0.08. Let h = -0.2 + 0.3. Which is the closest to h? (a) k (b) -1 (c) m c Let q = -281 - -41871/149. Let z = 739/447 + q. Let m = 9 + -6. What is the closest to 1/7 in 0.5, m, z?	{ "pile_set_name": "DM Mathematics" }
50 is divided by 154? 96 Calculate the remainder when 68 is divided by 15. 8 What is the remainder when 72 is divided by 31? 10 What is the remainder when 2175 is divided by 34? 33 What is the remainder when 376 is divided by 128? 120 What is the remainder when 202 is divided by 64? 10 Calculate the remainder when 73 is divided by 24. 1 What is the remainder when 746 is divided by 12? 2 Calculate the remainder when 531 is divided by 27. 18 What is the remainder when 723 is divided by 244? 235 Calculate the remainder when 727 is divided by 163. 75 Calculate the remainder when 593 is divided by 149. 146 Calculate the remainder when 73 is divided by 16. 9 What is the remainder when 249 is divided by 5? 4 What is the remainder when 5230 is divided by 238? 232 What is the remainder when 1355 is divided by 169? 3 What is the remainder when 1271 is divided by 13? 10 What is the remainder when 3283 is divided by 73? 71 What is the remainder when 556 is divided by 33? 28 What is the remainder when 455 is divided by 12? 11 What is the remainder when 172 is divided by 3? 1 Calculate the remainder when 301 is divided by 155. 146 Calculate the remainder when 2771 is divided by 554. 1 Calculate the remainder when 3377 is divided by 31. 29 What is the remainder when 614 is divided by 41? 40 What is the remainder when 936 is divided by 24? 0 What is the remainder when 6439 is divided by 28? 27 What is the remainder when 136 is divided by 35? 31 Calculate the remainder when 2311 is divided by 28. 15 What is the remainder when 2491 is divided by 78? 73 What is the remainder when 1505 is divided by 491? 32 Calculate the remainder when 8694 is divided by 37. 36 What is the remainder when 441 is divided by 33? 12 What is the remainder when 858 is divided by 123? 120 Calculate the remainder when 27 is divided by 13. 1 Calculate the remainder when 158 is divided by 32. 30 Calculate the remainder when 42 is divided by 28. 14 What is the remainder when 464 is divided by 32? 16 Calculate the remainder when 117 is divided by 33. 18 Calculate the remainder when 12543 is divided by 9. 6 What is the remainder when 403 is divided by 45? 43 Calculate the remainder when 198 is divided by 25. 23 Calculate the remainder when 499 is divided by 7. 2 Calculate the remainder when 1521 is divided by 86. 59 What is the remainder when 211 is divided by 44? 35 What is the remainder when 25182 is divided by 32? 30 Calculate the remainder when 138 is divided by 17. 2 Calculate the remainder when 26 is divided by 6. 2 What is the remainder when 620 is divided by 89? 86 What is the remainder when 1630 is divided by 245? 160 Calculate the remainder when 76 is divided by 27. 22 What is the remainder when 26836 is divided by 122? 118 What is the remainder when 41 is divided by 19? 3 Calculate the remainder when 8853 is divided by 164. 161 What is the remainder when 597 is divided by 152? 141 What is the remainder when 1698 is divided by 63? 60 What is the remainder when 41 is divided by 22? 19 What is the remainder when 3711 is divided by 169? 162 Calculate the remainder when 70 is divided by 26. 18 What is the remainder when 534 is divided by 29? 12 Calculate the remainder when 359 is divided by 154. 51 Calculate the remainder when 419 is divided by 43. 32 What is the remainder when 616 is divided by 315? 301 Calculate the remainder when 629 is divided by 311. 7 What is the remainder when 3084 is divided by 1007? 63 What is the remainder when 779 is divided by 10? 9 Calculate the remainder when 89 is divided by 23. 20 Calculate the remainder when 874 is divided by 280. 34 What is the remainder when 416 is divided by 136? 8 What is the remainder when 48 is divided by 27? 21 What is the remainder when 160 is divided by 33? 28 Calculate the remainder when 123 is divided by 82. 41 Calculate the remainder when 777 is divided by 60. 57 Calculate the remainder when 332 is divided by 12. 8 Calculate the remainder when 65 is divided by 17. 14 Calculate the remainder when 682 is divided by 66. 22 Calculate the remainder when 413 is divided by 70. 63 Calculate the remainder when 28 is divided by 18. 10 Calculate the remainder when 63 is divided by 7. 0 What is the remainder when 16919 is divided by 235? 234 What is the remainder when 2092 is divided by 13? 12 Calculate the remainder when 93 is divided by 19. 17 Calculate the remainder when 3754 is divided by 53. 44 Calculate the remainder when 558 is divided by 134. 22 What is the remainder when 1313 is divided by 146? 145 Calculate the remainder when 380 is divided by 202. 178 Calculate the remainder when 230 is divided by 39. 35 What is the remainder when 739 is divided by 39? 37 Calculate the remainder when 1341 is divided by 64. 61 Calculate the remainder when 1595 is divided by 368. 123 What is the remainder when 621 is divided by 158? 147 What is the remainder when 388 is divided by 372? 16 Calculate the remainder when 88 is divided by 13. 10 Calculate the remainder when 308 is divided by 81. 65 Calculate the remainder when 4170 is divided by 97. 96 What is the remainder when 69 is divided by 9? 6 Calculate the remainder when 1774 is divided by 588. 10 Calculate the remainder when 343 is divided by 41. 15 What is the remainder when 4138 is divided by 20? 18 What is the remainder when 2099 is divided by 34? 25 What is the remainder when 645 is divided by 91? 8 What is the remainder when 676 is divided by 230? 216 Calculate the remainder when 4545 is divided by 1514. 3 Calculate the remainder when 334 is divided by 67. 66 What is the remainder when 129 is divided by 48? 33 What is the remainder when 187 is divided by 77? 33 What is the remainder when 198 is divided by 103? 95 Calculate the remainder when 1376 is divided by 13. 11 Calculate the remainder when 2069 is divided by 1022. 25 Calculate the remainder when 702 is divided by 230. 12 Calculate the remainder when 4135 is divided by 188. 187 What is the remainder when 343 is divided by 12? 7 What is the remainder when 80 is divided by 18? 8 Calculate the remainder when 336 is divided by 47. 7 What is the remainder when 375 is divided by 71? 20 Calculate the remainder when 277 is divided by 99. 79 Calculate the remainder when 8798 is divided by 13. 10 Calculate the remainder when 368 is divided by 302. 66 What is the remainder when 2280 is divided by 127? 121 What is the remainder when 71241 is divided by 179? 178 Calculate the remainder when 388 is divided by 15. 13 Calculate the remainder when 12 is divided by 9. 3 What is the remainder when 330 is divided by 46? 8 Calculate the remainder when 4177 is divided by 209. 206 What is the remainder when 67 is divided by 36? 31 Calculate the remainder when 33 is divided by 19. 14 Calculate the remainder when 726 is divided by 23. 13 What is the remainder when 209 is divided by 24? 17 Calculate the remainder when 1199 is divided by 100. 99 What is the remainder when 137 is divided by 83? 54 What is the remainder when 4143 is divided by 6? 3 Calculate the remainder when 12282 is divided by 148. 146 Calculate the remainder when 359 is divided by 19. 17 What is the remainder when 396 is divided by 132? 0 What is the remainder when 1363 is divided by 279? 247 Calculate the remainder when 62 is divided by 7. 6 Calculate the remainder when 1543 is divided by 43. 38 Calculate the remainder when 48 is divided by 17. 14 What is the remainder when 393 is divided by 199? 194 Calculate the remainder when 234 is divided by 35. 24 Calculate the remainder when 484 is divided by 478. 6 What is the remainder when 122 is divided by 86? 36 What is the remainder when 959 is divided by 86? 13 Calculate the remainder when 15 is divided by 9. 6 Calculate the remainder when 385 is divided by 15. 10 What is the remainder when 230 is divided by 49? 34 What is the remainder when 8708 is divided by 99? 95 Calculate the remainder when 846 is divided by 278. 12 Calculate the remainder when 1792 is divided by 296. 16 Calculate the remainder when 157 is divided by 48. 13 What is the remainder when 950 is divided by 20? 10 What is the remainder when 425 is divided by 74? 55 What is the remainder when 35773 is divided by 53? 51 What is the remainder when 1528 is divided by 93? 40	{ "pile_set_name": "DM Mathematics" }
4 AM and 8:57 PM? 643 How many minutes are there between 4:20 PM and 10:27 PM? 367 What is 538 minutes after 11:36 PM? 8:34 AM How many minutes are there between 8:31 AM and 12:14 PM? 223 What is 374 minutes before 1:47 PM? 7:33 AM What is 408 minutes after 6:21 PM? 1:09 AM How many minutes are there between 11:09 PM and 9:56 AM? 647 How many minutes are there between 2:04 AM and 10:59 AM? 535 How many minutes are there between 11:05 AM and 3:54 PM? 289 How many minutes are there between 2:43 PM and 2:52 PM? 9 What is 317 minutes before 6:49 AM? 1:32 AM What is 491 minutes before 12:22 PM? 4:11 AM What is 682 minutes before 2:12 AM? 2:50 PM How many minutes are there between 10:31 AM and 8:59 PM? 628 How many minutes are there between 4:40 AM and 9:38 AM? 298 What is 592 minutes before 1:58 AM? 4:06 PM How many minutes are there between 11:21 AM and 11:32 AM? 11 How many minutes are there between 7:14 AM and 9:01 AM? 107 What is 123 minutes before 4:48 PM? 2:45 PM What is 454 minutes after 9:44 AM? 5:18 PM What is 689 minutes after 7:09 AM? 6:38 PM How many minutes are there between 3:49 AM and 2:36 PM? 647 What is 692 minutes before 11:52 PM? 12:20 PM What is 532 minutes before 8:47 PM? 11:55 AM What is 96 minutes after 4:18 AM? 5:54 AM How many minutes are there between 9:07 AM and 5:57 PM? 530 How many minutes are there between 6:18 PM and 6:13 AM? 715 How many minutes are there between 8:23 PM and 9:22 PM? 59 What is 231 minutes after 6:49 PM? 10:40 PM How many minutes are there between 4:43 PM and 5:08 PM? 25 What is 439 minutes before 6:54 AM? 11:35 PM What is 142 minutes after 8:44 PM? 11:06 PM What is 700 minutes after 2:19 AM? 1:59 PM What is 714 minutes before 1:14 AM? 1:20 PM How many minutes are there between 1:10 AM and 8:14 AM? 424 What is 424 minutes before 2:51 PM? 7:47 AM What is 457 minutes after 4:03 AM? 11:40 AM What is 209 minutes before 9:36 PM? 6:07 PM How many minutes are there between 11:32 PM and 10:53 AM? 681 What is 264 minutes after 11:01 AM? 3:25 PM How many minutes are there between 3:10 PM and 10:53 PM? 463 What is 398 minutes before 1:41 AM? 7:03 PM How many minutes are there between 3:19 PM and 6:25 PM? 186 How many minutes are there between 5:40 PM and 4:49 AM? 669 How many minutes are there between 1:36 AM and 11:31 AM? 595 How many minutes are there between 12:44 PM and 8:07 PM? 443 How many minutes are there between 9:06 AM and 6:57 PM? 591 What is 501 minutes before 6:16 PM? 9:55 AM How many minutes are there between 10:40 AM and 11:15 AM? 35 What is 10 minutes after 1:50 PM? 2:00 PM What is 549 minutes after 10:18 PM? 7:27 AM What is 149 minutes after 12:28 AM? 2:57 AM What is 110 minutes after 8:39 AM? 10:29 AM What is 40 minutes after 3:53 AM? 4:33 AM How many minutes are there between 11:10 AM and 8:19 PM? 549 How many minutes are there between 10:03 PM and 9:15 AM? 672 What is 111 minutes after 4:53 AM? 6:44 AM How many minutes are there between 9:00 AM and 3:46 PM? 406 What is 320 minutes after 12:55 AM? 6:15 AM How many minutes are there between 3:28 AM and 6:01 AM? 153 How many minutes are there between 3:38 AM and 8:33 AM? 295 How many minutes are there between 4:46 AM and 4:04 PM? 678 What is 38 minutes before 5:20 AM? 4:42 AM How many minutes are there between 11:37 PM and 6:21 AM? 404 What is 291 minutes before 7:31 AM? 2:40 AM What is 167 minutes after 9:11 AM? 11:58 AM How many minutes are there between 11:04 AM and 12:35 PM? 91 How many minutes are there between 12:36 AM and 4:31 AM? 235 What is 714 minutes before 10:50 AM? 10:56 PM What is 197 minutes after 10:35 PM? 1:52 AM How many minutes are there between 2:14 AM and 11:57 AM? 583 What is 675 minutes after 6:02 PM? 5:17 AM What is 359 minutes before 8:41 PM? 2:42 PM How many minutes are there between 9:35 AM and 6:59 PM? 564 What is 309 minutes before 11:02 AM? 5:53 AM How many minutes are there between 4:35 AM and 10:47 AM? 372 What is 454 minutes after 12:06 AM? 7:40 AM What is 631 minutes before 7:25 PM? 8:54 AM How many minutes are there between 6:51 PM and 11:05 PM? 254 What is 406 minutes after 4:40 PM? 11:26 PM How many minutes are there between 10:23 AM and 2:47 PM? 264 What is 324 minutes after 2:14 AM? 7:38 AM What is 459 minutes before 12:08 PM? 4:29 AM What is 354 minutes before 7:22 PM? 1:28 PM What is 117 minutes before 12:01 PM? 10:04 AM What is 507 minutes after 1:53 AM? 10:20 AM How many minutes are there between 1:36 AM and 5:36 AM? 240 How many minutes are there between 4:53 AM and 4:55 AM? 2 How many minutes are there between 4:45 PM and 6:17 PM? 92 What is 327 minutes after 7:10 PM? 12:37 AM What is 249 minutes after 4:29 PM? 8:38 PM How many minutes are there between 3:33 AM and 3:44 AM? 11 How many minutes are there between 11:58 AM and 4:04 PM? 246 How many minutes are there between 10:39 PM and 6:18 AM? 459 What is 388 minutes before 7:44 AM? 1:16 AM How many minutes are there between 12:01 AM and 8:49 AM? 528 How many minutes are there between 1:29 AM and 3:57 AM? 148 What is 291 minutes after 11:29 PM? 4:20 AM What is 52 minutes after 7:14 PM? 8:06 PM What is 611 minutes before 8:02 AM? 9:51 PM How many minutes are there between 8:17 AM and 11:54 AM? 217 How many minutes are there between 12:15 PM and 5:07 PM? 292 What is 223 minutes before 4:33 PM? 12:50 PM What is 535 minutes before 11:12 PM? 2:17 PM What is 325 minutes before 5:12 PM? 11:47 AM What is 246 minutes before 10:17 AM? 6:11 AM How many minutes are there between 8:12 PM and 9:21 PM? 69 What is 612 minutes before 7:30 AM? 9:18 PM How many minutes are there between 1:14 PM and 4:37 PM? 203 What is 35 minutes after 1:38 PM? 2:13 PM What is 592 minutes after 9:50 PM? 7:42 AM What is 104 minutes before 5:17 PM? 3:33 PM What is 6 minutes after 8:44 AM? 8:50 AM What is 323 minutes after 1:24 AM? 6:47 AM What is 679 minutes after 11:51 AM? 11:10 PM How many minutes are there between 2:48 PM and 9:57 PM? 429 What is 705 minutes before 10:51 PM? 11:06 AM What is 90 minutes after 12:40 AM? 2:10 AM How many minutes are there between 11:36 PM and 4:00 AM? 264 How many minutes are there between 10:50 AM and 3:39 PM? 289 What is 678 minutes before 7:22 PM? 8:04 AM What is 42 minutes before 1:07 AM? 12:25 AM What is 51 minutes after 1:21 AM? 2:12 AM What is 644 minutes after 10:14 AM? 8:58 PM How many minutes are there between 4:31 AM and 5:25 AM? 54 What is 702 minutes after 12:58 AM? 12:40 PM What is 630 minutes after 10:02 AM? 8:32 PM How many minutes are there between 3:38 PM and 12:54 AM? 556 What is 664 minutes after 4:31 AM? 3:35 PM What is 158 minutes before 10:57 PM? 8:19 PM What is 345 minutes before 4:12 PM? 10:27 AM What is 560 minutes before 5:35 AM? 8:15 PM How many minutes are there between 6:30 PM and 6:02 AM? 692 What is 490 minutes after 10:28 PM? 6:38 AM What is 714 minutes after 9:13 AM? 9:07 PM What is 328 minutes before 5:11 PM? 11:43 AM What is 305 minutes after 9:57 AM? 3:02 PM What is 503 minutes before 5:51 PM? 9:28 AM How many minutes are there between 5:22 PM and 2:55 AM? 573 How many minutes are there between 2:01 AM and 8:43 AM? 402 What is 399 minutes before 8:35 PM? 1:56 PM How many minutes are there between 2:38 AM and 3:18 AM? 40 What is 429 minutes before 1:48 AM? 6:39 PM How many minutes are there between 9:58 AM and 7:36 PM? 578 What is 623 minutes before 10:45 AM? 12:22 AM What is 49 minutes before 2:23 AM? 1:34 AM What is 156 minutes after 4:18 AM? 6:54 AM How many minutes are there between 12:08 AM and 5:50 AM? 342 How many minutes are there between 3:12 PM and 9:50 PM? 398 What is 367 minutes after 12:59 PM? 7:06 PM What is 52 minutes after 9:22 PM? 10:14 PM How many minutes are there between 2:40 PM and 12:00 AM? 560 How many minutes are there between 12:27 AM and 10:45 AM? 618 What is 628 minutes after 7:44 AM? 6:12 PM What is 60 minutes before 10:01 PM? 9:01 PM What is 692 minutes before 9:22 PM? 9:50 AM How many minutes are there between 10:07 AM and 4:47 PM? 400 How many minutes are there between 1:03 AM and 5:15 AM? 252 How many minutes are there between 2:18 AM and 12:29 PM? 611 What is 324 minutes before 12:29 AM? 7:05 PM What is 605 minutes after 7:57 PM? 6:02 AM What is 266 minutes before 9:19 AM? 4:53 AM W	{ "pile_set_name": "DM Mathematics" }
/7, 0.3, 1.8, 19? -1/7 What is the nearest to -154 in 3, -2/77, 3.9, 2/7? -2/77 Which is the closest to 12? (a) -1/3001 (b) 3 (c) -752 (d) 2/19 b Which is the nearest to -1.6? (a) 5/3 (b) -37 (c) 0.4 (d) -2/5 (e) 6 (f) -2 f Which is the closest to 1/3? (a) -4 (b) 4 (c) 0.02882 (d) 5 (e) 1270 c Which is the closest to -0.1? (a) 2/15 (b) -503 (c) -1498 a Which is the closest to -2? (a) 45 (b) -3/3395 (c) -0.2 (d) 0 (e) 0.4 c What is the nearest to 357996 in 0.1, 1/4, 1? 1 Which is the closest to 5/7? (a) -5 (b) -3 (c) -4 (d) -128 (e) -1.03 (f) 3 e Which is the closest to 0.002? (a) 254 (b) 2 (c) 0.3 (d) 0.01 (e) -3/4 (f) 28 d Which is the closest to -6/5? (a) 0 (b) -1/119 (c) 9/154 (d) -3 (e) 5 b Which is the closest to -1/4? (a) 3 (b) 2 (c) -5.757 (d) 1/12 (e) 4 (f) -3/122 f What is the closest to -12 in 0.5, -2/15, -3, -0.2, -8381? -3 Which is the nearest to -1? (a) 3/2 (b) 22297 (c) -6 a What is the nearest to -0.3 in -5, -3.2, -124, -4? -3.2 What is the closest to -78 in 2/45, -2, -365? -2 What is the closest to 1/7 in -0.1, -186608.81, -1, -5? -0.1 Which is the closest to -3/8? (a) -1 (b) -142 (c) -10.81 (d) 1 a Which is the closest to 49785? (a) 2 (b) -0.4 (c) -0.5 (d) -5 (e) -0.01 a What is the closest to -2/5 in -1/4, 1/4, -61720.9? -1/4 What is the nearest to 29 in -0.4, -0.5, -5, -23, -3, 3.89? 3.89 What is the closest to -0.6 in -140313, 0.5, 2? 0.5 Which is the nearest to 1/8? (a) 0.2 (b) 0 (c) -2/7 (d) -162/52555 a What is the closest to -0.612 in 2/3, 5, 21/10, 0? 0 Which is the nearest to -0.04? (a) -6/17 (b) 2 (c) -26.2 a What is the closest to -20793 in 36, -1, 6/5? -1 What is the closest to -116 in 1, 4, 5/2, -1/2? -1/2 What is the nearest to 1/5 in 2/3, 1893723, 1/7, -2/9? 1/7 What is the closest to 0 in 2, 1/1772, 0.06, 21/4, 2/13, -0.3? 1/1772 Which is the nearest to 2/5? (a) 7/5 (b) 8 (c) -5 (d) 0.583 d Which is the nearest to 0.108? (a) 1.08045 (b) -4 (c) 2/11 c Which is the nearest to -0.1? (a) 23 (b) 0.1 (c) -0.1 (d) -1/3 (e) 1225/12 c Which is the closest to -2.02? (a) 9/7 (b) -7 (c) -0.1 c What is the nearest to 1 in 5, 15, 1.1, -17/3, 1/30? 1.1 What is the nearest to 5/3 in 0, 0.2, -2, 28.7? 0.2 What is the closest to 6898 in 0.62, -4, 4, -0.3? 4 What is the closest to 0.1 in 1/5, 0.01, -0.5, 3/10, -5/339? 0.01 What is the closest to 0.1 in -0.8, -0.2, 0.3725, 117? 0.3725 What is the nearest to 2 in -1, -467, 2, 4, 119? 2 What is the closest to -6/5 in -2, -25.39, -0.3, 5? -2 What is the nearest to -1 in -1/4, 36, -82, -1/54, -0.4? -0.4 Which is the nearest to 2? (a) 5/2 (b) -0.2 (c) 2801 (d) 1/6 (e) -2/29 a Which is the nearest to -0.1? (a) -4 (b) 0.4 (c) 5 (d) -18 (e) 239.1 (f) -0.17 f What is the nearest to 2/3 in 1/159, 0.044, -0.07? 0.044 Which is the nearest to -20? (a) -0.22 (b) 10 (c) -1/11 a What is the nearest to 0.007 in -2/27, 32, -0.4, -5, 4? -2/27 What is the closest to -1/4 in 1179, 36, -5/4? -5/4 Which is the nearest to 2/237? (a) 63 (b) 0.7 (c) -2 (d) -16 b Which is the closest to -1/17? (a) -7 (b) -2/5 (c) -1142 (d) -1 b Which is the nearest to -0.92? (a) 155 (b) -90 (c) 6 c What is the nearest to -2 in -9651, -2/3, 2, 1/88? -2/3 Which is the closest to 0.09? (a) -58 (b) -2/9 (c) -274/3 (d) 2 b Which is the closest to -0.4? (a) -6 (b) 1/3 (c) 4236 (d) 1/7 d Which is the closest to -0.1? (a) 0.1 (b) 51 (c) 10 (d) 2/431 d What is the closest to 65 in -4/7, 4953, 0.3, 1? 1 What is the closest to -5/4 in 95, 8, -2296, -2/3? -2/3 What is the closest to -766/7 in 0, 3/22, 0.3, -1/9? -1/9 What is the nearest to -0.5 in -2/5, -2/11, -0.1, -1, -2/151? -2/5 Which is the closest to 3/2? (a) -90 (b) -0.28 (c) 50 (d) 0 d What is the nearest to 0 in -0.058, -24, 7, -0.4? -0.058 What is the closest to 24.3 in 2, 0.3, 6, -0.038? 6 What is the closest to -0.03 in 0, -21, 0.2, -39.61? 0 What is the nearest to 3/47 in -355, -0.4, -3/2, 8, 1, 0.4? 0.4 What is the nearest to 1/4 in -1/2, 2/45, -5/3, -1/2408, -4? 2/45 Which is the nearest to 2? (a) -132 (b) -2/971 (c) -4/7 b What is the nearest to 0.3 in 2, 1, -1793, 61? 1 Which is the closest to 0.2? (a) -3 (b) 2 (c) -65 (d) 61/4 b Which is the closest to -0.2? (a) -1/17 (b) 4 (c) -11/2 (d) -0.4 a Which is the closest to -0.1? (a) -22 (b) -5 (c) -214/7 (d) 3 (e) 2386 d What is the closest to 4 in 1345, -2/125, 1/10? 1/10 Which is the nearest to 0.084? (a) -7 (b) 5 (c) 39 (d) -0.2 (e) -4 (f) 16 d Which is the closest to 2/5? (a) 1/4 (b) 3/7 (c) 549819 (d) 4 (e) -5 b What is the nearest to -22 in 0.0719, 0.5, -572, -4? -4 Which is the closest to -26? (a) -27 (b) -0.2 (c) 0.2 (d) -11 (e) 2/7 (f) -7 a Which is the nearest to -1245? (a) -104 (b) 1 (c) -976 c What is the nearest to -2/3 in -2, 5, 7, -2161, 16? -2 Which is the nearest to -1? (a) 4/3 (b) -4 (c) 4 (d) 3/304 (e) 505 d What is the closest to 14 in 104, 2/73, -2/5, 3, 146? 3 Which is the closest to 1/4? (a) -91 (b) 3/11 (c) 7.2 (d) -0.5 (e) -4 (f) 3 b Which is the nearest to -0.1? (a) 1/6 (b) -0.116 (c) -1 (d) 3/73 (e) 2/19 b Which is the closest to -2? (a) -0.4 (b) -50 (c) 109.4 a Which is the nearest to 11.8? (a) 4 (b) 1 (c) -1908 (d) 0 (e) 0.1 a What is the closest to -3 in 1/8, 0.3, -37138? 1/8 What is the closest to 63/13 in -48, -0.06, -5? -0.06 Which is the closest to -2/9? (a) 2 (b) 3281.4 (c) 8 a Which is the nearest to 2/3? (a) 2/31 (b) 190/3 (c) 4 (d) 67 (e) 20 a What is the nearest to 13 in -0.3, 5, -4205, 0.2? 5 What is the nearest to 3/8 in 5, 4, -2, -3/2, -1.05174? -1.05174 What is the nearest to -1/7 in 6/49, -6, 2299, -14? 6/49 Which is the nearest to -1? (a) -5249 (b) -799 (c) -1.5 c Which is the nearest to -9? (a) -0.5 (b) -0.06 (c) -29/3 (d) 9 c Which is the closest to -0.1? (a) 7 (b) -12327 (c) -0.1 (d) -0.4 c What is the closest to 1.831 in 2/89, 4, 3? 3 What is the closest to -0.1 in 3/4333, -106, -1, -2? 3/4333 Which is the nearest to -0.019? (a) 2/5 (b) 621 (c) 2/21 (d) 0.02 d Which is the closest to -0.2? (a) -72 (b) 7 (c) 264.2 (d) -0.2 d Which is the closest to 3/2? (a) 36 (b) -1 (c) -2/7 (d) -0.05 (e) 0.6 e What is the nearest to -10.3 in -5, 0, 1425.9, -3? -5 Which is the nearest to 0? (a) 10 (b) 6 (c) 0.054 (d) -4/5 c Which is the nearest to 1? (a) 1716 (b) 72 (c) 2 (d) -4 (e) -0.4 c Which is the closest to 5? (a) -1/13 (b) 2 (c) -3/82 (d) 6 (e) 14 d Which is the closest to 1? (a) -0.3 (b) 5 (c) 7.3 (d) -990.8 a What is the nearest to 1/4 in 4/161, 7, -0.2, 0.1, 4? 0.1 What is the closest to 2 in -5458167, 1, -3/2, 0.06? 1 What is the nearest to -1/3 in -3, 29, 1/4, 0.26, -2.2? 1/4 Which is the closest to 59.7? (a) -0.5 (b) -0.93 (c) -4 (d) 1 (e) 0 d What is the nearest to 0 in 218, 4, 10, -226/7, -3? -3 Which is the closest to -1/4? (a) -3 (b) -1/5 (c) -257 (d) -2/907 (e) 0.3 (f) 0 b Which is the closest to -0.1? (a) 0 (b) -1/6 (c) -0.1 (d) -0.4 (e) 2/17111 c Which is the nearest to -14? (a) 6 (b) -0.2 (c) 15 (d) 223 b What is the nearest to 4/669 in -3, 1, 2/11, -31? 2/11 What is the nearest to 0 in -4, 6/217, 1.28, -3, -989? 6/217 Which is the nearest to 2/3? (a) 0 (b) 1.221 (c) -1/7 (d) -4/239 (e) 1/16 b Which is the nearest to 4? (a) 0.4 (b) -27 (c) -7 (d) -0.17 (e) 0.2 (f) 0.9 f What is the closest to 81 in 29, 33.9, 3, -0.5, 0, -0.4? 33.9 Which is the closest to 2/3? (a) 620 (b) 3/4 (c) -0.036 (d) -3 b Which is the nearest to 2? (a) 6 (b) 2/3 (c) 4 (d) 134 (e) 0.4 b What is the closest to -1/6 in 1/17, -27.2, -0.01, 85? -0.01 Which is the nearest to 1/4? (a) 0.09 (b) -2 (c) -9 (d) -283 (e) 0.04 a What is the nearest to -0.1 in 1/4, 9529/6, 0.45? 1/4 What is the closest to 40 in 1, 1/6, 390, 3? 3 What is the nearest to -5222 in 35.5, 0.2, 0.3? 0.2 What is the closest to 6 in -3, -2/35, 11.73, 23, 5? 5 Which is the closest to -4? (a) -1/5 (b) -145 (c) 31.406 a What is the nearest to -138 in -6, 7, -5, -79, 0, -3/5? -79 Which is the closest to 1? (a) -14 (b) 78 (c) 0.3 (d) 0 (e) 27/8 c What is the closest to 2/23 in 11827, 4/7, 1? 4/7 Which is the closest to 0? (a) -202.1 (b) 0.5 (c) 0.2 (d) 1/	{ "pile_set_name": "DM Mathematics" }
i(v) = v + 8. Let y be i(-6). Solve zw = -s + 7, 4s + 6 = y for w. 4 Let l(z) = z*2 - 7z + 3. Let k be 2 - -8 - (2 + 1). Let w be l(k). Solve 5n + w = 2p, -4 = 2n - n + 3p for n. -1 Let d be (5/(-3))/(2/(-6)). Suppose d + 11 = 2r. Suppose 2n - r = -4t, -2n + 7 = 5t - 2. Solve -q = -2v - 3, -nv + 5v - q = -5 for v. -2 Let t = 3 + 0. Let m = 21 + -11. Let y = m - t. Solve -a = -k - 5, -2k - 3k = 3a - y for k. -1 Suppose 12 = -z + 16. Solve -f + 0 + z = -3b, 5b + 20 = -f for f. -5 Suppose 3d = 6d - 63. Solve 3j - 3z - 27 = 0, d = 6j - j + z for j. 5 Suppose 2w + w = 3x - 9, 2x = 5w. Solve 4g + 13 = -3i, i - 2 = xg - 0 for i. -3 Suppose 5 = 5i - 2h - 8, -5i = 2h - 17. Solve 4p - 20 = -6u + 4u, ip - 3u + 3 = 0 for p. 3 Let h be 14/(-4)(-26)/13. Solve 2m + 2 = -0f + 2f, h = f + 5m for f. 2 Let z = -62 - -87. Solve 4d + d + 5h = z, -5h = -5d + 25 for d. 5 Let k(w) = w3 - w2 - w. Suppose -12 = -2h - h. Suppose -ht - t = 0. Let v be k(t). Solve 4o = -3g - 23, g + vo + 7 = -o for g. -5 Suppose -2o + 5m = -14, -2o + 4m + 12 = -0m. Suppose ow + 0 = -16. Let a be (-3)/4 + (-46)/w. Solve t + t = -af - 29, 3t = -5f - 31 for f. -5 Let v be -1-13/3. Suppose v = 2q - 3. Solve -qj + 2 = -3d - 2, 0 = 2j - 5d for j. 5 Let l be (-1)/((-6)/(-8))21/(-14). Solve a + i + 1 = 0, -la = -5i - 31 + 12 for a. 2 Let y(q) = q3 + 2q*2 - 5q - 4. Let l = -6 + 4. Let h = l - 1. Let f be y(h). Solve -4a + 12 = -fu, 2a + a = -5u + 9 for u. 0 Let y = 3 + -1. Solve u = 4v + 2, 5u = 6u + 3v - y for u. 2 Suppose 3t - 3 = 15. Suppose -v - 10 = -tv. Solve 2y + 3x - 1 = 0, 3x = vy - 18 - 1 for y. 5 Let a be 6/(-4)(-10)/3. Suppose 5v - 5 = a. Solve -32 = s + 3s - 5q, -s - vq + 5 = 0 for s. -3 Let p = 2 + -6. Let b(w) = 2w + 6. Let k(y) = 2y + 7. Let j(s) = pb(s) + 3k(s). Let i be j(-3). Solve 2v + iq - 8 = 0, v + 3v - 4q + 4 = 0 for v. 1 Suppose 5h - 8 = 2. Solve -hb + 27 = -5t, 5 = -4t + 4b - 19 for t. -5 Let n = 14 - 14. Suppose 0 = -4k - 8, ny = 2y - 4k - 40. Solve j + 3j + 5r = -26, 0 = -5j + 2r - y for j. -4 Let t be (-7 - -6) + (3 - 0). Let k(b) = 2b3 + 4b*2 + 4b + 2. Let h be k(-2). Let q be (15/h + t)-6. Solve 32 = 4v + qx + 8, 4x - 10 = 2v for v. 3 Let y be (0/(-1))/(2/1). Let w = -45 - -48. Solve -d - 5 = 4m - 6d, y = -m + wd - 10 for m. 5 Let n(o) = o + 2o - 6 - 6o. Let y be n(-5). Let h = y + -5. Solve 0c + 2p - 24 = hc, 5 = -3c - 5p for c. -5 Suppose -3u + 4u = 0. Suppose u = l + 2l - 27. Solve z + 2z = 3i - l, 5 = -3z + i for z. -1 Suppose -5c = 3z, 0 = 3z - 4c + 6 - 33. Suppose o - 58 + z = 0. Suppose 0 = -b - 2b + x + 36, 5b = 4x + o. Solve 7 = j - l, -3j + 2j = -4l - b for j. 5 Let l = -5 - -8. Solve 19 = -3f + 2i - li, -4f + i = 16 for f. -5 Let t = -20 + 27. Suppose 2c = -3f + 22, 0 = c - 0c - 2f + 3. Solve 5m - c = 0, -4n + 3m + t = -10 for n. 5 Let q = 14 + -13. Let u be (11 + q)2/6. Solve -uf = -2c - 2c - 20, -2 = -2f for c. -4 Let z be (52/(-12) - -4) + 3/9. Solve 5t + 10 = 3q, z = 5q - 0q - 5t for q. -5 Suppose -3i = -2l + 4, -i = 3l + 2i - 6. Solve 0 = 2h + 3h + 4r + 3, lr - 6 = 0 for h. -3 Suppose -2v = 2g + 12, 5g + 0g - 42 = 3v. Let k(x) = x3 + 8x*2 - 10x - 6. Let h be k(v). Solve 5 = -4l - i + 4i, -hi = 2l + 7 for l. -2 Suppose 0s = 5k + 3s + 35, -35 = k - 5s. Let x be (-34)/(-10) + k/25. Suppose -xt = -4d + 1, 3 = -t + 3d - d. Solve 0 = -0h + h - t, -f + h = 9 for f. -4 Let d(l) = -4l - 1. Let m be d(-1). Solve 3f - 5i - 5 = 0, -mf = 2i + 6 - 4 for f. 0 Suppose -h = -0h. Suppose 3n = -hn + 12. Suppose 2u - 2w - 8 = 0, 4u + 2 + 0 = -5w. Solve -nr = d + d + 26, -2r - 4 = -ud for r. -5 Let x(i) = i + 6. Let f be x(-3). Solve 2v = -2b - 2, -2 = -3v + fb - b for v. 0 Suppose 2z - 4r + 1 = -1, 2z - 5r = -4. Solve 0 = -5q + 2v + 23, 21 = 5q - 2q - zv for q. 3 Let h be (-4)/(-2) + 1 - -1. Let a(y) = 3y - 6. Let s be a(h). Let d = s - 6. Solve -2i = 3b + 3i - 13, d = -3b - 2i - 2 for b. -4 Let v = 24 - 0. Solve -3x = -2r - 7, 5x - x + v = -4r for x. -1 Let i(n) = -n*3 - 2n*2 + 22n - 7. Let z be i(-6). Solve -2m = 4, -3h = 2m - zm - 15 for h. 3 Suppose 35 = u - 0u. Suppose u = n + 4n. Solve -z - 1 = -3q, q + 0z - n = -z for q. 2 Let m be -3 + (-42)/9-3. Let o(k) = -3k*3 - 1 + mk3 + k3 + k*2. Let f be o(1). Solve 6 = -2r - 4z, -f = 2r - 4z + 5z for r. -5 Let u = -5 + 6. Suppose 2i - 3h = -u, -2h = -4h + 6. Solve -2g + 4r = 20, ig + 16 = 3g + 4r for g. -4 Suppose -5h - i = -29, -2h + 9 = 7i - 4i. Let v be (-1)/((-2)/h)1. Solve f + 4f = 5l - 15, 6 = vf + 2l for f. 0 Let d be 14(5/2)/5. Suppose -3b + 15 = 3k, -d = -2k - b - 0b. Solve -kc - 18 = -4c - 2r, 4c + 2r - 26 = 0 for c. 4 Suppose 4j = 3h - 31, -4j = -3h - 6j + 7. Solve 11 + 5 = 2z + 5p, -hp + 7 = -z for z. 3 Suppose i = 4i. Suppose i = -5y - 4d + 5 + 5, -2 = -y + d. Suppose 0 = 3p + 2p. Solve 2f + 2 = yc - p, -4c + 22 = 2f for c. 4 Suppose -25 = -5z + n, -3n = 4z + z - 5. Let x be (-2 + 10/z)4. Suppose -2y - xy = 0. Solve y = d - 3, 5d - 10 = -2r + d for r. -1 Let j be (-276)/30 - (-1)/5. Let s = 13 + j. Let y be 3(-2)/(-3) + -2. Solve 0p - sw + 8 = 2p, y = 2p + 3w - 5 for p. -2 Let v = -4 - -9. Solve 17 = -3q + q - 3w, 17 = -vq + w for q. -4 Suppose -3t - 5g - 9 = 0, 2g = -t + 7g + 17. Let p(k) = k*3 - 2k*2 + k + 2. Let z be p(2). Solve 3w = 0, 4f - tw = w + z for f. 1 Let b = -1 - -6. Suppose 0 = 2i + bd - 19, 5i + 2d - 5 = 11. Solve -5f - a = -14, -2f - f + a + i = 0 for f. 2 Let a be (-297)/63 - (-4)/(-14). Let k = 1 + -1. Let o = k - a. Solve 16 = 4x - 0x - 4p, o = 5p for x. 5 Let d = 58 - 58. Solve 4z - 2n = -dn + 24, z = -n for z. 4 Let h(x) = x2 + 7x - 42. Let q be h(-11). Solve -b - 3 = -2n, n - 3 = -qn for b. -1 Let f = 2 - 21. Let m = f - -39. Solve -m = -5p, -3x + 8 + 8 = p for x. 4 Let c = 10 + -10. Let u(v) = 6 + v - v*2 + 1 - 3. Let r be u(c). Solve rl = -5s + 5, -4s - 11 = -3l + 16 for s. -3 Let o be (2/3 + -2)6. Let m be (-8 - -3)o/20. Solve -4c = 4d - c + 8, -d - m = 4c for d. -2 Let d = 7 + -3. Suppose -4 - 4 = -s. Solve -4r = dg - s, 5 = -4g - r + 4 for g. -1 Suppose 5y - 5 = -0y. Let b = -1 + y. Suppose -m = -bm. Solve n + 3x - 17 = m, -n + 3 = 3n - x for n. 2 Let p be (1/(-2))/(2/(-8)) + 2. Solve -3t + 14 = 3c - 4, pc - 16 = 4t for t. 1 Let t(n) = -n + 3. Let m be t(-6). Suppose 5u = 5l + 15, m = 4u - 5l + 2. Suppose 3i + i = 12. Solve 4s - 5s + 6 = 4o, is = -2o + u for o. 1 Let w = -21 - -29. Solve 4m + 4 = 4q, 2m + q - w = -1 for m. 2 Suppose -39 - 49 = -4d. Let w = -19 + d. Let i be 1(-2)/2 - -8. Solve -o + i = -0j - wj, -o = 4j for o. 4 Suppose -2s + 12 = 3g, 2s = -3g + 3s + 3. Let u be (-40)/4g/(-4). Solve -t + 15 = 4f, -ut = -2f - 0f + 35 for t. -5 Let p be (-3)/(-6) - (-61)/2. Let a = p + -12. Solve 3l = 6, 2f - 5l + a = -f for f. -3 Let c = 7 + -5. Let d(r) = -r3 - 8r*2 + 7r - 13. Let q be d(-9). Solve -3k - cs = -3, 11 = 2k + 2k + qs for k. -1 Suppose -z - 3k + 4 = 0, 7k - 2k = 5z - 20. Solve -4r + 11 = -4s - 9, -3s - 16 = -zr for r. 1 Let s(q) = -2q + 12. Let z be s(8). Let n = z + 6. Let j be (3 - 1)/(2/4). Solve -2d = -2w + n, -10 = jd + w + 14 for d. -5 Let o = -6 - -11. Suppose 0 = 2i + 1 - 17. Let l = 12 - i. Solve -ow = -2r + lr - 16, -w - r = -2 for w. 4 Let m(d) = -d2 + 3d + 28. Let y be m(7). Solve v - 3 = -0v, -5f + 2v + 9 = y for f. 3 Let n = 124 - 119. Solve 4g - 28 + n = -i, 3g - 12 = i for g. 5 Suppose 82c = 79c. Solve 4q + 2v = 4, 5q + v + c - 8 = 0 for q. 2 Suppose 2 = -2y + 3y. Solve -yh - l = 0, 2l - 16 = 4h - 0h for h. -2 Suppose -u = 2u - 12. Let p = 8 - u. Solve -px - 20 = 0, -x - 8 = -2b + 7 for b. 5 Let g(d) = d2 - 4d. Let f be g(3). Let c = 15 + f. Let o be 6/(-4)(-32)/c. Solve on + 4j + j = 37, 4n - j - 7 = 0 for n. 3 Let q be ((-9)/5)/(4/(-20)). Suppose -3i + 0i + q = 0. Solve -4v = -4m + 20, -v - iv - 20 = m for v. -5 Suppose -3o = -2v - 71, -4o - 2v + 25 + 79 = 0. Solve 5h -	{ "pile_set_name": "DM Mathematics" }
60787b + 4 What is the d'th term of 28925, 28983, 29045, 29117, 29205? d3 - 4d*2 + 63d + 28865 What is the i'th term of -15349, -14873, -14095, -13027, -11681, -10069, -8203, -6095? -2i3 + 163i*2 + i - 15511 What is the d'th term of 307, 993, 2119, 3673, 5643, 8017, 10783, 13929? -2d*3 + 232d*2 + 4d + 73 What is the j'th term of -1501616, -3003227, -4504838, -6006449? -1501611j - 5 What is the k'th term of 537827, 1075557, 1613287, 2151017? 537730k + 97 What is the r'th term of 1060919, 2121841, 3182763? 1060922r - 3 What is the y'th term of 39529, 40777, 42023, 43267? -y2 + 1251y + 38279 What is the r'th term of -41720, -166251, -373604, -663785, -1036800? -r*3 - 41405r*2 - 309r - 5 What is the a'th term of -1844, -7349, -16496, -29267, -45644? 3a3 - 1839a*2 - 9a + 1 What is the b'th term of 414, 3076, 10346, 24564, 48070, 83204, 132306? 390b3 - 36b*2 + 40b + 20 What is the x'th term of 80400632, 160801263, 241201894, 321602525, 402003156? 80400631x + 1 What is the y'th term of -37813, -37793, -37771, -37753, -37745, -37753, -37783? -y3 + 7y*2 + 6y - 37825 What is the p'th term of -66184, -66696, -67208, -67720? -512p - 65672 What is the v'th term of 67857, 135673, 203477, 271269, 339049, 406817, 474573? -6v*2 + 67834v + 29 What is the z'th term of 4701001, 18804004, 42309009, 75216016, 117525025, 169236036? 4701001z2 What is the j'th term of -23942302, -23942292, -23942278, -23942260, -23942238? 2j*2 + 4j - 23942308 What is the x'th term of -2773809, -2773820, -2773855, -2773926, -2774045, -2774224? -2x3 + 3x - 2773810 What is the s'th term of 139293, 278574, 417833, 557058, 696237? -2s3 + s2 + 139292s + 2 What is the y'th term of 26518020, 53036038, 79554056, 106072074, 132590092? 26518018y + 2 What is the z'th term of -41047478, -82094977, -123142476, -164189975, -205237474, -246284973? -41047499z + 21 What is the s'th term of -2080793, -2080796, -2080803, -2080814? -2s2 + 3s - 2080794 What is the h'th term of -10871, -22025, -33169, -44297, -55403, -66481, -77525, -88529? h3 - h2 - 11158h + 287 What is the k'th term of -271, -120, 523, 1658? 246k*2 - 587k + 70 What is the u'th term of -255775, -2046279, -6906217, -16370305, -31973259, -55249795, -87734629? -255786u3 - u2 + u + 11 What is the c'th term of 274, 461, 950, 1885, 3410, 5669? 24c*3 + 7c*2 - 2c + 245 What is the y'th term of -1868, -3509, -5146, -6779? 2y2 - 1647y - 223 What is the d'th term of -242, -1481, -3544, -6431? -412d2 - 3d + 173 What is the n'th term of 17005475, 68021903, 153049283, 272087615, 425136899, 612197135? 17005476n2 - 1 What is the l'th term of 3309461, 6618926, 9928391, 13237856, 16547321? 3309465l - 4 What is the v'th term of -12364, -12487, -12600, -12703, -12796, -12879, -12952? 5v2 - 138v - 12231 What is the n'th term of 2151549, 2151540, 2151531, 2151522, 2151513? -9n + 2151558 What is the r'th term of 17045, 33897, 50749? 16852r + 193 What is the y'th term of -2284, -9043, -20306, -36073, -56344, -81119, -110398? -2252y2 - 3y - 29 What is the p'th term of 39516, 74648, 109780, 144912, 180044, 215176? 35132p + 4384 What is the x'th term of -14655, -14435, -14205, -13965? 5x*2 + 205x - 14865 What is the l'th term of -9328, -11712, -18288, -31186, -52536? -355l3 + 34l*2 - l - 9006 What is the a'th term of 777795143, 777795144, 777795145, 777795146, 777795147, 777795148? a + 777795142 What is the q'th term of 41, 328, 931, 2006, 3709, 6196, 9623, 14146? 26q*3 + 2q*2 + 99q - 86 What is the p'th term of 18, -208, -940, -2460, -5050? -47p3 + 29p*2 + 16p + 20 What is the q'th term of 565, 1459, 2705, 4303, 6253, 8555? 176q2 + 366q + 23 What is the t'th term of 32852, 131313, 295414, 525155, 820536, 1181557, 1608218? 32820t2 + t + 31 What is the d'th term of 6242, 7756, 10286, 13832, 18394, 23972, 30566? 508d*2 - 10d + 5744 What is the n'th term of -79006, -78966, -78878, -78718, -78462, -78086, -77566, -76878? 4n3 + 12n - 79022 What is the b'th term of 7720, 8574, 9996, 11986? 284b2 + 2b + 7434 What is the f'th term of 19401, 25570, 31739, 37908? 6169f + 13232 What is the a'th term of -15802, -31467, -47132, -62797, -78462? -15665a - 137 What is the l'th term of -4477, -4330, -4173, -4000, -3805, -3582, -3325? l3 - l2 + 143l - 4620 What is the h'th term of -608, -640, -804, -1172, -1816? -12h*3 + 6h*2 + 34h - 636 What is the x'th term of -152765, -305508, -458239, -610958? 6x2 - 152761x - 10 What is the q'th term of 2149, 8897, 20663, 37873, 60953, 90329, 126427, 169673? 71q3 + 2083q*2 + 2q - 7 What is the b'th term of -16775, -120771, -403049, -952751, -1859019, -3210995? -14857b3 + b2 - 1919 What is the s'th term of -2012, -6177, -12450, -20831, -31320? -1054s*2 - 1003s + 45 What is the k'th term of 42853, 171434, 385751, 685810, 1071617? k*3 + 42862k*2 - 12k + 2 What is the h'th term of 713, 4402, 10605, 19322, 30553, 44298, 60557? 1257h2 - 82h - 462 What is the t'th term of 444438, 888856, 1333260, 1777650, 2222026? -7t2 + 444439t + 6 What is the f'th term of -86510, -84329, -82148? 2181f - 88691 What is the m'th term of -7803, -15967, -24131, -32295? -8164m + 361 What is the k'th term of 822, 1670, 2502, 3282, 3974, 4542, 4950, 5162? -6k3 + 28k*2 + 806k - 6 What is the n'th term of 1186, 2503, 3952, 5533, 7246, 9091, 11068? 66n2 + 1119n + 1 What is the g'th term of 28137704, 56275408, 84413112, 112550816, 140688520? 28137704g What is the d'th term of -22057, -43313, -64559, -85789, -106997, -128177, -149323, -170429? d3 - d2 - 21260d - 797 What is the z'th term of -766, -4338, -10292, -18628, -29346, -42446, -57928? -1191z2 + z + 424 What is the f'th term of -230752, -230731, -230702, -230665? 4f*2 + 9f - 230765 What is the o'th term of 19023209, 19023240, 19023271? 31o + 19023178 What is the j'th term of -65681, -65778, -65939, -66164, -66453? -32j*2 - j - 65648 What is the b'th term of 3980850, 3980859, 3980868, 3980877, 3980886? 9b + 3980841 What is the h'th term of 58342227, 58342232, 58342237, 58342242? 5h + 58342222 What is the o'th term of 42299985, 42299995, 42300007, 42300021, 42300037, 42300055, 42300075? o2 + 7o + 42299977 What is the w'th term of -7866, -7756, -7658, -7572? -6w2 + 128w - 7988 What is the p'th term of -60045, -120414, -180731, -240990, -301185, -361310, -421359? p*3 + 20p*2 - 60436p + 370 What is the g'th term of -14007, -12353, -10697, -9039? g*2 + 1651g - 15659 What is the n'th term of 661911, 1323839, 1985767, 2647695? 661928n - 17 What is the l'th term of 226268, 452794, 679320? 226526l - 258 What is the p'th term of -2386702, -4773390, -7160078, -9546766? -2386688p - 14 What is the m'th term of 17537, 19086, 20635, 22184? 1549m + 15988 What is the f'th term of -21760, -43877, -65994, -88111, -110228? -22117f + 357 What is the h'th term of 2207514885, 2207514883, 2207514881, 2207514879, 2207514877, 2207514875? -2h + 2207514887 What is the m'th term of 3174, 12836, 28946, 51504, 80510, 115964, 157866? 3224m2 - 10m - 40 What is the o'th term of -17146, -68291, -153536, -272887, -426350, -613931? -o*3 - 17044o*2 - 6o - 95 What is the t'th term of 51659227, 51659240, 51659253, 51659266, 51659279, 51659292? 13t + 51659214 What is the g'th term of 22315, 14900, 2545, -14750, -36985, -64160? -2470g*2 - 5g + 24790 What is the w'th term of -277528, -1107949, -2491972, -4429591, -6920800, -9965593, -13563964, -17715907? w*3 - 276807w*2 - 7w - 715 What is the h'th term of -125018903, -250037810, -375056719, -500075630, -625094543? -h*2 - 125018904h + 2 What is the j'th term of -172181, -344359, -516539, -688721? -j*2 - 172175j - 5 What is the x'th term of -24682, -26383, -28084, -29785, -31486, -33187? -1701x - 22981 What is the h'th term of 7967927, 7967984, 7968043, 7968104? h2 + 54h + 7967872 What is the a'th term of -9829, -24017, -38217, -52435, -66677, -80949, -95257, -109607? -a*3 - 14181a + 4353 What is the w'th term of 170050, 340101, 510144, 680179, 850206? -4w2 + 170063w - 9 What is the u'th term of -4467, -4482, -4525, -4608, -4743, -4942? -2u3 - 2u*	{ "pile_set_name": "DM Mathematics" }
h term of -48, -66, -84, -102, -120, -138? -18s - 30 What is the o'th term of -28, -20, -8, 8? 2o*2 + 2o - 32 What is the w'th term of 2413, 2415, 2417? 2w + 2411 What is the o'th term of -12, -46, -98, -168? -9o*2 - 7o + 4 What is the q'th term of -11, 3, 29, 67? 6q2 - 4q - 13 What is the a'th term of 95, 96, 97, 98, 99, 100? a + 94 What is the t'th term of -25, -28, -19, 8, 59? t*3 - 10t - 16 What is the n'th term of 60, 43, 22, -3, -32, -65? -2n2 - 11n + 73 What is the k'th term of -108, -216, -324, -432, -540? -108k What is the r'th term of 91, 136, 255, 484, 859, 1416? 6r3 + r2 + 84 What is the f'th term of -476, -960, -1446, -1934, -2424, -2916? -f*2 - 481f + 6 What is the w'th term of 9, 105, 277, 531, 873, 1309, 1845, 2487? w*3 + 32w*2 - 7w - 17 What is the a'th term of 18, 44, 80, 132, 206, 308? a3 - a2 + 22a - 4 What is the k'th term of 3, 13, 23, 33? 10k - 7 What is the t'th term of 23, 95, 217, 389, 611, 883? 25t2 - 3t + 1 What is the b'th term of 65, 201, 431, 755, 1173? 47b2 - 5b + 23 What is the v'th term of -9, -48, -107, -180, -261, -344, -423, -492? v*3 - 16v*2 + 2v + 4 What is the i'th term of 15, 174, 607, 1452, 2847, 4930, 7839? 23i3 - i2 + i - 8 What is the o'th term of -20, -19, -18, -17, -16? o - 21 What is the s'th term of 992, 1977, 2960, 3941, 4920, 5897, 6872? -s2 + 988s + 5 What is the y'th term of -203, -442, -681, -920? -239y + 36 What is the v'th term of -5, -70, -181, -338? -23v*2 + 4v + 14 What is the s'th term of 256, 254, 252, 250, 248, 246? -2s + 258 What is the d'th term of 65, 62, 59? -3d + 68 What is the b'th term of -29, -25, -21, -17, -13, -9? 4b - 33 What is the l'th term of -44, -49, -16, 73, 236, 491, 856, 1349? 3l3 + l2 - 29l - 19 What is the o'th term of -1612, -3224, -4836, -6448? -1612o What is the w'th term of 71, 66, 57, 44? -2w2 + w + 72 What is the l'th term of -10, -19, -28, -37? -9l - 1 What is the o'th term of 7, 3, -13, -41? -6o2 + 14o - 1 What is the p'th term of 77, 144, 263, 440, 681, 992? p*3 + 20p*2 + 56 What is the y'th term of -48, -90, -154, -240, -348? -11y*2 - 9y - 28 What is the l'th term of 115, 412, 913, 1624, 2551, 3700, 5077, 6688? l*3 + 96l*2 + 2l + 16 What is the f'th term of 9, 31, 63, 111, 181, 279? f3 - f2 + 18f - 9 What is the u'th term of -30, -65, -106, -153, -206, -265, -330? -3u*2 - 26u - 1 What is the v'th term of 100, 208, 328, 466, 628, 820, 1048, 1318? v*3 + 101v - 2 What is the i'th term of -162, -128, -92, -54, -14, 28, 72? i*2 + 31i - 194 What is the v'th term of -17, -36, -47, -44, -21? v*3 - 2v*2 - 20v + 4 What is the m'th term of -128, -254, -380? -126m - 2 What is the s'th term of -11, -33, -85, -185, -351, -601, -953, -1425? -3s*3 + 3s*2 - 10s - 1 What is the z'th term of -11, 257, 703, 1327? 89z2 + z - 101 What is the h'th term of 261, 261, 253, 231, 189, 121, 21? -h3 + 2h2 + h + 259 What is the k'th term of 1, -10, -19, -26, -31? k2 - 14k + 14 What is the s'th term of -17, -35, -59, -89, -125? -3s*2 - 9s - 5 What is the m'th term of 86, 77, 54, 11, -58, -159, -298, -481? -m3 - m2 + m + 87 What is the y'th term of -68, -129, -188, -245? y*2 - 64y - 5 What is the u'th term of -60, -116, -168, -216? 2u2 - 62u What is the r'th term of 1, 21, 61, 127, 225, 361, 541? r*3 + 4r2 + r - 5 What is the p'th term of 771, 773, 761, 729, 671, 581, 453, 281? -p3 - p*2 + 12p + 761 What is the i'th term of -62, -113, -164, -215? -51i - 11 What is the t'th term of -257, -514, -769, -1022, -1273, -1522, -1769? t2 - 260t + 2 What is the t'th term of -106, -91, -76, -61? 15t - 121 What is the q'th term of 82, 166, 250? 84q - 2 What is the f'th term of -63, -266, -601, -1068, -1667? -66f2 - 5f + 8 What is the t'th term of 19, 46, 73? 27t - 8 What is the q'th term of -177, -184, -207, -252, -325, -432? -q3 - 2q*2 + 6q - 180 What is the a'th term of 70, 322, 748, 1354, 2146, 3130, 4312? a*3 + 81a*2 + 2a - 14 What is the w'th term of -795, -802, -809, -816, -823? -7w - 788 What is the f'th term of -95, -94, -93? f - 96 What is the b'th term of 684, 691, 710, 747, 808, 899? b3 + 683 What is the b'th term of 166, 163, 160, 157, 154, 151? -3b + 169 What is the p'th term of 7, -1, -13, -29, -49? -2p2 - 2p + 11 What is the z'th term of -584, -2340, -5266, -9362, -14628, -21064? -585z2 - z + 2 What is the i'th term of 79, 139, 201, 265, 331, 399? i2 + 57i + 21 What is the q'th term of 209, 233, 257? 24q + 185 What is the h'th term of 752, 1445, 2126, 2789, 3428, 4037, 4610? -h3 + 700h + 53 What is the r'th term of 75, 73, 71, 69? -2r + 77 What is the w'th term of -145, -220, -295, -370, -445, -520? -75w - 70 What is the o'th term of 5, 23, 63, 137, 257, 435? 2o3 - o2 + 7o - 3 What is the z'th term of -1225, -2440, -3639, -4816, -5965, -7080, -8155, -9184? z*3 + 2z*2 - 1228z What is the q'th term of 130, 262, 394, 526? 132q - 2 What is the z'th term of 254, 249, 244, 239, 234, 229? -5z + 259 What is the i'th term of 1106, 1107, 1108? i + 1105 What is the k'th term of 144, 255, 352, 429, 480, 499, 480? -k3 - k2 + 121k + 25 What is the o'th term of -1422, -2842, -4262, -5682? -1420o - 2 What is the t'th term of -227, -435, -633, -815, -975, -1107? t3 - t2 - 212t - 15 What is the k'th term of -13, 35, 121, 251, 431? k3 + 13k*2 + 2k - 29 What is the a'th term of -147, -105, -43, 33, 117, 203, 285? -a*3 + 16a*2 + a - 163 What is the j'th term of 95, 190, 285, 380? 95j What is the g'th term of 90, 177, 274, 387, 522, 685, 882? g3 - g2 + 83g + 7 What is the s'th term of 4536, 4534, 4538, 4554, 4588, 4646, 4734, 4858? s3 - 3s*2 + 4538 What is the a'th term of 14370, 14367, 14364? -3a + 14373 What is the n'th term of 26, 90, 196, 344, 534? 21n2 + n + 4 What is the l'th term of 139, 137, 135, 133, 131, 129? -2l + 141 What is the v'th term of -259, -295, -363, -469, -619, -819? -v*3 - 10v*2 + v - 249 What is the x'th term of -3711, -7423, -11135? -3712x + 1 What is the z'th term of -61, 83, 323, 659, 1091, 1619, 2243? 48z2 - 109 What is the g'th term of 15, 33, 71, 135, 231, 365, 543, 771? g3 + 4g2 - g + 11 What is the c'th term of -21, -12, -5, 0, 3? -c2 + 12c - 32 What is the m'th term of 334, 708, 1098, 1510, 1950, 2424, 2938, 3498? m3 + 2m*2 + 361m - 30 What is the i'th term of -249, -246, -243? 3i - 252 What is the k'th term of -270, -309, -350, -393? -k2 - 36k - 233 What is the v'th term of 215, 344, 473, 602, 731, 860? 129v + 86 What is the g'th term of 1082, 1094, 1114, 1142, 1178, 1222? 4g*2 + 1078 What is the f'th term of -13, -66, -155, -280? -18f*2 + f + 4 What is the y'th term of -34, -42, -50? -8y - 26 What is the z'th term of -549, -1114, -1679, -2244, -2809, -3374? -565z + 16 What is the q'th term of 249, 501, 753, 1005? 252q - 3 What is the y'th term of -27, -26, -39, -78, -155, -282, -471, -734? -2y3 + 5y*2 - 30 What is the f'th term of 33, 68, 103, 138? 35f - 2 What is the p'th term of -319, -318, -315, -310, -303, -294, -283? p*2 - 2p - 318 What is the o'th term of -706, -707, -708? -o - 705 What is the t'th term of -53, -190, -429, -782, -1261, -1878, -2645? -2t3 - 39t*2 - 6t - 6 What is the k'th term of 859, 844, 821, 790? -4k2 - 3k + 866 What is the u'th term of 58, 55, 50, 43, 34? -u*2 + 59 What is the t'th term of 44, 69, 86, 95, 96, 89? -4t*2 + 37t + 11 What is the l'th term of 208, 209, 210, 211? l + 207 What is the w'th term of 15, 25, 35? 10w + 5 What is the z'th term of 534, 1062, 1588, 2112, 2634, 3154? -z2 + 531z + 4 What is the i'th term of 102, 107, 114, 123, 134? i*2 + 2i + 99 What is the g'th term of 9723, 9724, 9725? g + 9722 What is the w'th term of 19, 0, -17, -32? w*2 - 22w + 40 What is the p'th term of 1034, 2067, 3100, 4133, 5166? 1033p + 1 What is the q'th term of 24, 45, 104, 207, 360, 569? q3 + 13q*2 - 25q + 35 What is the r'th term of -4, -38, -96, -178, -284? -12r2 + 2r + 6 What is the v'th term of -8, -32, -90, -200, -380, -648, -1022, -1520? -3v3 + v2 - 6v What is the v'th term of -174, -348, -522, -696, -870? -174*v What is the o'th term	{ "pile_set_name": "DM Mathematics" }
rogqqqorqvogoqgrrqor? 1/38 Calculate prob of picking 3 k when three letters picked without replacement from {e: 14, k: 1}. 0 Three letters picked without replacement from {p: 3, t: 5, x: 5}. Give prob of picking 1 x and 2 p. 15/286 Four letters picked without replacement from fjaebzb. Give prob of picking 1 f, 2 b, and 1 j. 1/35 Two letters picked without replacement from {g: 2, v: 9, t: 4, f: 4}. Give prob of picking 2 t. 2/57 Two letters picked without replacement from xhihyyyihhpw. What is prob of picking 1 w and 1 y? 1/22 Two letters picked without replacement from {c: 1, u: 1, y: 3, d: 2, h: 3, o: 2}. Give prob of picking 1 y and 1 o. 1/11 Two letters picked without replacement from {k: 5, p: 3}. Give prob of picking 1 p and 1 k. 15/28 Calculate prob of picking 1 c, 2 s, and 1 r when four letters picked without replacement from {c: 4, x: 2, r: 3, v: 3, m: 2, s: 1}. 0 Four letters picked without replacement from zwazwwwzwwzzwzzzzwzz. What is prob of picking 1 a, 2 z, and 1 w? 88/969 What is prob of picking 4 o when four letters picked without replacement from ononnnnononnoonopnno? 14/969 What is prob of picking 4 z when four letters picked without replacement from ziizz? 0 Four letters picked without replacement from {d: 2, n: 1, b: 9, k: 4}. What is prob of picking 2 d, 1 n, and 1 k? 1/455 Calculate prob of picking 2 z when two letters picked without replacement from {y: 7, z: 7, h: 5}. 7/57 Two letters picked without replacement from {t: 9, d: 1, j: 9}. Give prob of picking 1 t and 1 j. 9/19 Three letters picked without replacement from iuquiqiiuiuii. What is prob of picking 2 q and 1 u? 2/143 Three letters picked without replacement from {e: 3, k: 2, z: 4, p: 1}. Give prob of picking 2 k and 1 z. 1/30 What is prob of picking 2 y when two letters picked without replacement from dyyddmmemyeye? 1/13 What is prob of picking 3 m and 1 o when four letters picked without replacement from {o: 15, m: 4}? 5/323 Calculate prob of picking 2 i and 2 l when four letters picked without replacement from {d: 2, i: 8, l: 5}. 8/39 Calculate prob of picking 2 e and 2 u when four letters picked without replacement from vceceeueueucvvcvevuc. 6/323 Two letters picked without replacement from kiikiui. What is prob of picking 1 u and 1 i? 4/21 Two letters picked without replacement from {g: 1, i: 1, q: 4, w: 2, z: 1}. Give prob of picking 1 z and 1 w. 1/18 Three letters picked without replacement from rgirq. What is prob of picking 1 i, 1 q, and 1 r? 1/5 What is prob of picking 1 x and 1 o when two letters picked without replacement from zaoszozgzszxgzzzzxz? 4/171 Calculate prob of picking 4 u when four letters picked without replacement from {v: 6, u: 7}. 7/143 Two letters picked without replacement from {x: 4, a: 2, j: 2, q: 5}. Give prob of picking 2 q. 5/39 Three letters picked without replacement from {f: 3, q: 2}. Give prob of picking 3 f. 1/10 Three letters picked without replacement from {w: 2, r: 2, c: 2, g: 3, b: 2, d: 1}. What is prob of picking 1 d and 2 w? 1/220 Three letters picked without replacement from {r: 3, p: 3, a: 8, x: 3}. What is prob of picking 1 r, 1 x, and 1 p? 27/680 What is prob of picking 1 e, 1 v, and 2 g when four letters picked without replacement from geevvvgg? 9/35 Two letters picked without replacement from gggdggddbgdgoggo. Give prob of picking 1 d and 1 o. 1/15 Three letters picked without replacement from lwqdzfw. Give prob of picking 1 d and 2 w. 1/35 Three letters picked without replacement from ppphppphp. What is prob of picking 3 p? 5/12 Three letters picked without replacement from eeeeeeegeeggeee. What is prob of picking 1 e and 2 g? 36/455 Two letters picked without replacement from {u: 17, o: 3}. What is prob of picking 1 u and 1 o? 51/190 What is prob of picking 2 i when two letters picked without replacement from qiqtitqtqqqqqtqtno? 1/153 Two letters picked without replacement from qskqkqqiqqsokq. Give prob of picking 1 q and 1 i. 1/13 Three letters picked without replacement from mmaaaaaamma. What is prob of picking 3 m? 4/165 Four letters picked without replacement from {m: 2, f: 5, y: 2}. Give prob of picking 1 f, 1 m, and 2 y. 5/63 What is prob of picking 1 g and 3 k when four letters picked without replacement from {g: 1, k: 9, a: 1}? 14/55 Three letters picked without replacement from jjmmmmjjdmjmjmmmdj. Give prob of picking 1 j and 2 m. 21/68 What is prob of picking 3 j and 1 i when four letters picked without replacement from {b: 1, t: 2, i: 4, j: 9, n: 1}? 12/85 Three letters picked without replacement from {q: 1, a: 2, v: 3, h: 1, c: 5}. What is prob of picking 2 a and 1 q? 1/220 Four letters picked without replacement from {w: 2, b: 2, a: 2, y: 1, n: 1, g: 7}. What is prob of picking 1 g, 1 w, 1 a, and 1 y? 4/195 Four letters picked without replacement from rmrrmrmmrr. What is prob of picking 3 r and 1 m? 8/21 What is prob of picking 2 a when two letters picked without replacement from yyyyyyyyyyyayyyayyy? 1/171 Three letters picked without replacement from oeeoosooooss. Give prob of picking 3 s. 1/220 Three letters picked without replacement from {i: 1, s: 1, r: 3, y: 4, q: 10}. Give prob of picking 2 q and 1 i. 15/323 What is prob of picking 3 e when three letters picked without replacement from {l: 1, e: 3, j: 1}? 1/10 Three letters picked without replacement from qytyquyqgyg. What is prob of picking 3 y? 4/165 Three letters picked without replacement from yfffyfyyyyyyfyyyfyy. What is prob of picking 3 f? 20/969 Two letters picked without replacement from {b: 6, p: 2, m: 7}. What is prob of picking 1 p and 1 b? 4/35 Three letters picked without replacement from {b: 10, s: 5, w: 1, k: 4}. What is prob of picking 1 w and 2 k? 1/190 Three letters picked without replacement from {u: 1, z: 1, n: 1, j: 2, h: 1, y: 1}. Give prob of picking 1 y, 1 j, and 1 u. 2/35 What is prob of picking 2 x and 1 g when three letters picked without replacement from {b: 9, q: 3, x: 2, g: 4}? 1/204 What is prob of picking 2 i and 2 o when four letters picked without replacement from {o: 2, i: 5, t: 1, p: 1}? 5/63 Calculate prob of picking 1 h and 2 o when three letters picked without replacement from {l: 6, h: 2, r: 4, f: 4, w: 1, o: 2}. 2/969 Calculate prob of picking 2 k, 1 u, and 1 y when four letters picked without replacement from kbybukukzyuk. 4/55 Four letters picked without replacement from {j: 4, a: 4, v: 1, b: 2, q: 3}. Give prob of picking 2 b and 2 j. 6/1001 Two letters picked without replacement from iawtwtuwwwwwwtwaaat. Give prob of picking 1 i and 1 u. 1/171 Two letters picked without replacement from {r: 8, s: 1, x: 2, k: 2, i: 1, t: 1}. What is prob of picking 1 r and 1 k? 16/105 Four letters picked without replacement from {p: 3, n: 2, e: 7}. Give prob of picking 1 n and 3 p. 2/495 Three letters picked without replacement from {r: 3, j: 3}. Give prob of picking 3 r. 1/20 Calculate prob of picking 1 n and 2 f when three letters picked without replacement from nfffnnf. 18/35 Three letters picked without replacement from {u: 4}. What is prob of picking 3 u? 1 Four letters picked without replacement from {u: 4, w: 3, n: 4}. What is prob of picking 1 n and 3 u? 8/165 Four letters picked without replacement from nyunuunsunnnn. What is prob of picking 2 n and 2 u? 126/715 Three letters picked without replacement from pplrpprrrrlpprpr. Give prob of picking 1 p, 1 r, and 1 l. 7/40 What is prob of picking 2 b and 2 y when four letters picked without replacement from {i: 5, j: 1, y: 5, b: 3, v: 1, z: 5}? 2/323 Three letters picked without replacement from vwwwollhhhhvlsl. Give prob of picking 2 h and 1 w. 18/455 Calculate prob of picking 1 u and 1 x when two letters picked without replacement from {u: 4, a: 1, x: 2}. 8/21 Calculate prob of picking 2 u when two letters picked without replacement from iuiuuiooooioo. 1/26 What is prob of picking 2 x and 1 o when three letters picked without replacement from hhxpxo? 1/20 Three letters picked without replacement from {a: 5, x: 3, i: 1}. What is prob of picking 3 a? 5/42 Three letters picked without replacement from {h: 6, w: 1, i: 2, e: 2}. Give prob of picking 2 h and 1 w. 1/11 What is prob of picking 2 h, 1 u, and 1 v when four letters picked without replacement fro	{ "pile_set_name": "DM Mathematics" }
f (-10)/(-45) - (-1)/(s/(-565))? True Let u = -15 - -20. Suppose -uw = 5f, 5w + 8 = 9w + 2f. Suppose -44 = -2l - wc, 8c - 12c = -2l + 44. Is l a multiple of 11? True Let j = 27 + -27. Let g(q) = q*3 - q + 225. Let a be g(j). Let o = -128 + a. Is 19 a factor of o? False Let n = -1154 - -1512. Let q be -10/2-1. Suppose 2h - n = -qh - 4t, 0 = 5h + 2t - 863. Is h a multiple of 24? False Suppose -5b = -6296 - 8689. Does 27 divide b? True Suppose -2074 = -5z + 1446. Suppose -z = -8r + 4224. Is r a multiple of 14? True Let d(i) = i3 - 3i*2 + 4. Let k be d(3). Let y = -2148 - -2237. Suppose ko - 7 = y. Does 8 divide o? True Suppose 10f + 75 = 275. Is 50 a factor of f/((-476)/1440 - 3/(-8))? True Let a = 4656 + 4829. Is a a multiple of 35? True Let h(s) = s2 + 5s - 136. Let a be h(11). Let u(b) = -3b2 + 123b + 17. Is u(a) a multiple of 85? False Suppose 4i - 18 = 6, 0 = 4y + 7i - 81750. Is y a multiple of 19? False Let i = -30 - -42. Let v(x) = 13x - 32. Is 4 a factor of v(i)? True Let i(y) = y*2 - 38. Let r be (0/2)/(-2(-6 - -5)). Let m be i(r). Let s = 158 + m. Is s a multiple of 24? True Suppose -2o - 98m + 14786 = -96m, m = o - 7399. Is o a multiple of 86? True Let m(q) = 3. Let h(f) = 2. Let w(b) = 8h(b) - 5m(b). Let r(n) = -n3 - 5n*2 + 2n - 2. Let i(d) = -r(d) - 4w(d). Is 5 a factor of i(-5)? False Let b(h) be the third derivative of h6/120 + h5/5 + 5h*4/12 + 20h*3/3 + 95h2. Is b(-11) even? False Let y(v) = -v2 - 4v + 23. Let c be y(-7). Let s = 5 + 32. Suppose -s = cz - 99. Is 9 a factor of z? False Suppose -2 + 12 = 2r. Suppose -3k + 12 = 0, 4a + r = -a + 5k. Suppose -21 = -2g + 5h, 3h + 62 = 2g + ag. Is g a multiple of 2? False Let o = -148 + 143. Is 24 a factor of (-4)/(o - (-1915)/385)? False Let v = 8275 - 4326. Does 152 divide v? False Suppose -6080 = -252v + 247v. Is 16 a factor of v? True Suppose -60u + 92u = 73632. Is u a multiple of 59? True Let c = -2 + -63. Let j = 43 - c. Let v = j + 27. Is v a multiple of 12? False Suppose -3g = 5c - 4, g - 4c + 5 = 4g. Suppose -gk + 1 = -11. Is (72/k)/(4/(56/3)) a multiple of 12? True Suppose 11h + 2150 = 34072. Suppose -9u + h = -500. Does 7 divide u? True Suppose w - 3 = -2t, 4t - 3w + 4 = -15. Let q be t/(-1 + -1)10. Suppose 0 = -2y - 4v + 238, qy - 643 = 3v - v. Is y a multiple of 21? False Let t(y) = -26y2 - 1862y + 47. Is 4 a factor of t(-70)? False Let l(n) = -73n - 112. Does 4 divide l(-5)? False Suppose -j + 12 = 2s, -6s + 5s = -2. Suppose -2h + 14 = 3q, 14 = 4q + 2h - j. Does 18 divide 8(6/q + -1 - -7)? True Suppose 27o + 103o = 819260. Is o a multiple of 23? True Suppose -178p - 528 = -884. Let j be ((-3)/(-2))/(3/4). Suppose jy - 338 + 94 = pz, -4z - 371 = -3y. Does 28 divide y? False Suppose 34r + 2245 = 39r. Suppose 0 = -5v - o + r, 3v - 5o = -2v + 455. Is 12 a factor of v? False Suppose 137f + 15 = 142f. Suppose 13h = 12h - f, 3c - 4h - 1920 = 0. Is c a multiple of 17? False Is 19 a factor of ((-7259)/(-420) - (-19)/(-228))/((-6)/(-2865))? False Let l = -1573 + 848. Let y = l - -1095. Does 37 divide y? True Let a be (-3 + 5/2)796/2. Let u = 360 + a. Suppose 4j - u = -5s + 2s, 102 = 3j - 4s. Does 38 divide j? True Let g(u) = -u*3 + 49u*2 + 82u + 192. Is 119 a factor of g(50)? False Let g be -910/15 - -286. Suppose g = -14d + 15d. Is d a multiple of 10? True Let v(d) be the second derivative of d4/12 + 13d*3/3 - 70d*2 + 59d. Does 79 divide v(-38)? True Is 25 + 15581 + 16 + (-3)/6-14 a multiple of 44? False Let k = -99 + 97. Let a = 117 - k. Does 11 divide a? False Suppose 76 = -18o - o. Let n(s) = 45s2 + 2s + 14. Is 11 a factor of n(o)? True Let u be (2/6)/((-17)/(-102)). Let l(m) = 2 - um3 + 4m*2 - 2m*3 + 3m*3 + 3m. Is l(4) a multiple of 6? False Suppose -54g + 50g - 3i = -1002, -285 = -g + 5i. Is 128 a factor of g? False Let k = -100 - -100. Suppose -3r = k, 860 = 5n + r - 0r. Is n a multiple of 10? False Suppose 1713f - 1708f = 16255. Does 25 divide f? False Suppose -23i - 2025 = -43i + 5i. Is 2 a factor of i? False Let u be 24/1470/20. Does 15 divide 100 + 15/3(-5 + u)? True Suppose -5f + 7 = -13. Is 6 a factor of ((-150)/f)/((-22)/264)? True Is ((4/30)/(8/(-40)))/(48/(-1361304)) a multiple of 7? True Let i(t) = -t2 + 30t - 6. Let r(c) = c*2 - 20. Let d be r(5). Suppose 4s - 2f = 50, -4f + d = s - 3. Is i(s) a multiple of 15? True Let y(l) = l*2 - 84l + 416. Is 37 a factor of y(83)? True Suppose -50j - 41j + 1272153 = -22j. Is j a multiple of 7? False Let p = 839 - 392. Let j = p + -397. Is j a multiple of 6? False Let n = 474 + -468. Suppose 150 - 5022 = -no. Is 33 a factor of o? False Let k be -103494/8-2. Is k/7 - (-9)/21 a multiple of 21? False Suppose 5z + 1887 = 557. Let i = 296 + z. Is 4 a factor of i? False Suppose -8y = -99 - 61. Let l be (y/(-6))/((-5)/15). Suppose -lj + 23 = -7. Is j a multiple of 3? True Let r = -6 + 2. Let i be (3(-3)/6)/(3/r). Suppose ig = -4t + 370, 0t - g + 455 = 5t. Is t a multiple of 18? True Suppose 0 = 2f + 4, t - 7f - 1724 = -9f. Suppose 16d - 11d + 1152 = 2a, -3a = d - t. Is 12 a factor of a? True Let r be (-12)/(-16) + 0 + 50/8. Suppose -r = -6g + 959. Is 23 a factor of g? True Suppose 5u + 94 = 3o, -5o + o + 3u = -118. Suppose -11q + 522 = -5q. Is 29 a factor of (q/6)/(-1(-2)/o)? True Let w(k) = 6k - 130. Let j be w(-18). Is 17 a factor of (1 + j/10)/((-816)/46240)? True Let m be (-1760)/159/(-2). Suppose -14x + 17x + m = 0. Does 4 divide (x/32)/(1/(-8))? True Let i = 289 - 184. Suppose -5c + 3g + 1294 = 0, 3g + 879 = 3c + i. Does 10 divide c? True Does 92 divide (65/10 - 4) + 4345/(-10)-47? True Let a = -196 - -224. Is a/(-6)(-84)/8 a multiple of 3? False Let x(s) = -s*3 + 5s*2 + 4s - 26. Let c be x(3). Suppose -5h + 1877 = ct, 0 = 5t - 7h + 3h - 2336. Does 6 divide t? True Let f(z) = 5z*2 + 61z + 28. Is 44 a factor of f(-25)? True Let x = -5147 + 9629. Is 54 a factor of x? True Let l(j) = 4j - 24. Let z be l(7). Suppose zh - 2f + 0f - 240 = 0, 5f + 20 = 0. Let x = h - 18. Is x a multiple of 7? False Let t be (19 + -13)/((-3)/(-2)) - 36. Let l = 46 + t. Let w(p) = 12p + 87. Is w(l) a multiple of 17? True Let w be 0((-5)/10 + 1)-1. Suppose w = -31j + 34j - 126. Does 42 divide j? True Suppose -9j - 1340300 = -94j - 15j. Is j a multiple of 356? False Let i be (-56)/84 - (-3670)/6. Suppose -404 = -2c + 4k, -3c - 5k = -6k - i. Is c a multiple of 51? True Suppose -5u - p = -323, 5u - 18p + 16p = 329. Does 8 divide u? False Let l(y) be the second derivative of 865y4/12 - 11y*3/6 + 5y*2 - 2y + 1. Does 16 divide l(1)? True Let p = -37948 + 57053. Is p a multiple of 128? False Let h(i) = -i*3 + 19i*2 + 22i + 3. Let a be h(20). Let r = a - -88. Is 33 a factor of r? False Let u = -9654 - -13830. Is u a multiple of 18? True Suppose 831 = 4m - 585. Let g = 681 - m. Is 24 a factor of g? False Suppose 73219 = 5s - 3t - 21507, 4t + 75776 = 4s. Is 19 a factor of s? False Let s be (-237)/(-8) + 63/168. Is 49 a factor of ((-66)/(-5))/(4/s)? False Suppose -5r = -2q - 8 + 3, -5r - 5q = -40. Suppose rn - 786 = -3n. Suppose -m + 54 = 5y, -3y = 4m - 0m - n. Is m a multiple of 7? False Does 104 divide ((-15)/(-20))/(153/(-24)) - (-17784354)/357? True Suppose 0 = 2h - x + 43 + 10, 2x + 34 = -h. Let v = h + 48. Is ((-6)/9)/((-2)/3) + v a multiple of 2? False Let a be (-4550)/(-18) - (-11)/(891/18). Suppose -5f + y - a = -1817, -300 = -f - 3y. Is 12 a factor of f? True Suppose -16z + 177766 + 72500 = 33994. Does 4 divide z? False Let b = 326 + -315. Suppose -182 = -bz - 2z. Is z a multiple of 3? False Suppose -5b + 12 = -4b. Let j be (18/b)/((42/(-40))/7). Let o(a) = 2a2 + 14a + 25. Is o(j) a multiple of 5? True Let u = -228 + 394. Let x = u - 138. Is 7 a factor of x? True Let q = 14290 + -7297. Is q a multiple of 13? False Let x be (20/(-15))/(4/(-6)). Let v be (-828)/(-8) - 3/x. Let q = -47 + v. Is q a multiple of 19? False Let n(z) = 130*z - 154. Let m = 98 - 91. Is n(m) a multiple of 27? True Let c be 10/((-40)/(-12)) - 161. Does 37 divide (3 - 4)/(2/c) - 5? True L	{ "pile_set_name": "DM Mathematics" }
0, -553, -506? -433 What is next in -87, -164, -277, -432, -635, -892, -1209, -1592? -2047 What is next in 973, 1789, 2603, 3415, 4225, 5033? 5839 What is next in -128, -544, -1692, -3938, -7648, -13188, -20924, -31222? -44448 What comes next: 576, 2309, 5200, 9249, 14456, 20821? 28344 What is next in 716253, 1432503, 2148753, 2865003? 3581253 What comes next: 469, 886, 1255, 1552, 1753, 1834, 1771, 1540? 1117 What is next in 5355, 10698, 16041? 21384 What is next in 9876, 9868, 9846, 9804, 9736, 9636, 9498, 9316? 9084 What is next in 105, 452, 1045, 1896, 3017, 4420, 6117? 8120 What comes next: -1189, -1268, -1347, -1426? -1505 What is next in -3668, -3742, -3880, -4094, -4396, -4798, -5312, -5950? -6724 What is next in 377, 754, 1159, 1604, 2101, 2662, 3299, 4024? 4849 What is the next term in -31, -59, -89, -115, -131, -131, -109? -59 What is the next term in -519, -1043, -1601, -2211, -2891, -3659? -4533 What is the next term in -2065, -8227, -18495, -32869, -51349? -73935 What is next in -225, -967, -2227, -4005? -6301 What is next in -1297, -5435, -12323, -21955, -34325, -49427? -67255 What is the next term in 9525, 19033, 28535, 38031, 47521? 57005 What comes next: -19, -30, -49, -76? -111 What comes next: -55348, -110693, -166038, -221383? -276728 What is the next term in -2308, -9279, -20894, -37153? -58056 What is next in -1858, -7325, -16412, -29119, -45446? -65393 What is next in 6685, 6684, 6679, 6670, 6657? 6640 What is the next term in 68586, 68588, 68590, 68592, 68594, 68596? 68598 What comes next: 9317, 18666, 28015, 37364, 46713? 56062 What comes next: 4710, 9415, 14114, 18807, 23494, 28175, 32850? 37519 What comes next: 13590, 54405, 122432, 217671? 340122 What comes next: -800, -1630, -2488, -3374? -4288 What comes next: 614, 1762, 2910, 4058, 5206, 6354? 7502 What is the next term in -13565, -27139, -40713, -54287, -67861? -81435 What comes next: -63747, -63763, -63779, -63795? -63811 What comes next: -29424, -29427, -29430, -29433, -29436? -29439 What is next in 5177, 5174, 5171? 5168 What comes next: 328, 364, 400? 436 What is the next term in 21925, 21811, 21699, 21589? 21481 What is next in 1472, 2991, 4510, 6029, 7548, 9067? 10586 What comes next: -7946, -15855, -23706, -31469, -39114, -46611? -53930 What is the next term in -347, -721, -1119, -1541? -1987 What is next in 9262, 9272, 9294, 9334, 9398, 9492? 9622 What is next in -137970, -137971, -137972, -137973, -137974? -137975 What is the next term in -26164, -52330, -78496? -104662 What is next in 96930, 96933, 96938, 96945, 96954? 96965 What comes next: 398, 622, 846? 1070 What is the next term in 28055, 56117, 84187, 112265, 140351? 168445 What is the next term in -33081, -33026, -32943, -32838, -32717? -32586 What is next in -11114, -22216, -33306, -44384? -55450 What comes next: -10, -23, -4, 65, 202, 425, 752, 1201? 1790 What is next in 649, 2880, 6599, 11806, 18501? 26684 What is next in -847, -3399, -7655, -13615? -21279 What is the next term in -2834, -2844, -2878, -2948, -3066? -3244 What comes next: -2144221, -2144218, -2144215? -2144212 What is next in -174, -770, -1768, -3168? -4970 What is the next term in 32420, 32443, 32466, 32489? 32512 What is next in 349, 1375, 3091, 5491, 8569, 12319, 16735, 21811? 27541 What is the next term in 30705, 61413, 92121, 122829, 153537, 184245? 214953 What is next in -12895, -12896, -12897, -12898, -12899? -12900 What comes next: 298397, 596791, 895187, 1193585, 1491985? 1790387 What is next in 8, 27, 116, 299, 600? 1043 What comes next: 530450, 530467, 530498, 530549, 530626, 530735? 530882 What is the next term in 181, -139, -453, -761? -1063 What is next in 2704, 2726, 2750, 2776, 2804, 2834? 2866 What comes next: 763, 553, -31, -1175, -3065? -5887 What comes next: -464304, -928608, -1392912, -1857216? -2321520 What is next in 2907163, 5814327, 8721491, 11628655, 14535819, 17442983? 20350147 What comes next: 64510, 129019, 193528, 258037? 322546 What is the next term in 216, 1329, 3146, 5673, 8916, 12881, 17574, 23001? 29168 What is next in -849, -885, -911, -921, -909, -869? -795 What comes next: 262, 308, 390, 508, 662? 852 What is the next term in -1026, -951, -872, -789, -702? -611 What comes next: 85, 107, 59, -95, -391, -865, -1553? -2491 What comes next: 392148, 392147, 392146, 392145? 392144 What is next in -151070, -302141, -453212, -604283, -755354? -906425 What is next in -65, 54, 173, 292, 411? 530 What comes next: -656, -1030, -854, 148, 2252, 5734, 10870, 17936? 27208 What is next in 13, 47, 125, 265, 485? 803 What is next in 831, 835, 849, 879, 931, 1011, 1125? 1279 What is the next term in 264128, 528255, 792382? 1056509 What is next in 670, 2738, 6204, 11068? 17330 What is next in 1255, 5355, 12189, 21757? 34059 What is next in 22467, 22482, 22519, 22590, 22707, 22882? 23127 What is the next term in -69409, -69419, -69435, -69457? -69485 What is the next term in -19086, -38167, -57248, -76329, -95410, -114491? -133572 What is next in -16957, -16956, -16955? -16954 What is next in 1912, 3587, 5264, 6943? 8624 What comes next: 1183, 1159, 1117, 1051, 955, 823? 649 What is next in -3142570, -3142569, -3142568? -3142567 What is the next term in -49, -127, -205, -283? -361 What is next in -1207930, -1207931, -1207932, -1207933, -1207934? -1207935 What is next in 50, 367, 1164, 2663, 5086, 8655, 13592? 20119 What comes next: -48564, -97117, -145670? -194223 What comes next: -219825, -219827, -219831, -219837, -219845, -219855, -219867? -219881 What is next in 717, 904, 1413, 2406, 4045? 6492 What is the next term in -1104, -1104, -1094, -1068, -1020, -944, -834? -684 What comes next: -141251, -141257, -141263, -141269, -141275, -141281? -141287 What is next in -1851, -1738, -1617, -1482, -1327, -1146, -933, -682? -387 What is the next term in -10716, -21359, -32002, -42645? -53288 What is next in -122, -273, -426, -581, -738, -897, -1058? -1221 What is the next term in 35, 57, 23, -115, -405, -895? -1633 What comes next: 477, 3409, 11369, 26871, 52429, 90557, 143769? 214579 What is the next term in -2365, -4816, -7267, -9718, -12169, -14620? -17071 What is next in 259, 492, 723, 952, 1179? 1404 What is the next term in 2450, 2459, 2470, 2483, 2498, 2515? 2534 What is next in -1674, -1666, -1660, -1656? -1654 What is the next term in 104747, 209495, 314243, 418991, 523739? 628487 What is next in 1892, 1659, 1426, 1193? 960 What is the next term in -139, -474, -1035, -1822, -2835, -4074, -5539? -7230 What is next in -464, -890, -1256, -1532, -1688? -1694 What is next in 10621, 21269, 31917, 42565? 53213 What is the next term in 54813, 54732, 54639, 54528, 54393, 54228? 54027 What is next in 40123, 40120, 40117, 40114? 40111 What comes next: 2293, 2308, 2323, 2338, 2353? 2368 What comes next: -1184, -1806, -2428, -3050, -3672? -4294 What is next in 1220, 5039, 11398, 20291, 31712, 45655, 62114? 81083 What is the next term in -12378, -49525, -111442, -198129, -309586? -445813 What comes next: -14327, -57300, -128917, -229178, -358083? -515632 What comes next: 16428, 32826, 49238, 65670, 82128, 98618, 115146, 131718? 148340 What is the next term in 41, 15, -33, -115, -243, -429? -685 What comes next: 142157, 142145, 142117, 142067, 141989, 141877, 141725, 141527? 141277 What comes next: -175453, -175460, -175471, -175486, -175505? -175528 What is the next term in -96332, -192662, -288992, -385322? -481652 What is next in -633, -1413, -2341, -3417, -4641, -6013? -7533 What is next in -3404, -6786, -10168, -13550, -16932? -20314 What comes next: -16317, -16270, -16223, -16176, -16129, -16082? -16035 What comes next: -3113, -5903, -8693, -11483, -14273, -17063? -19853 What is the next term in -723, -811, -895, -975, -1051, -1123? -1191 What is the next term in 18448, 18449, 18442, 18421, 18380, 18313, 18214? 18077 What is the next term in 2593, 2581, 2571, 2563, 2557? 2553 What comes next: 547, 941, 1335, 1729? 2123 What is the next term in -371, -687, -1137, -1715, -2415, -3231, -4157, -5187? -6315 What is the next term in 56, 103, 166, 257, 388, 571? 818 What is next in -8667, -17338, -26009, -34680, -43351, -52022? -60693 What is the next term in -8257, -8245, -8233, -8221, -8209, -8197? -8185 What is n	{ "pile_set_name": "DM Mathematics" }
-130. Which is the closest to 0? (a) m (b) -0.1 (c) -18 b Let t = -0.5 + 1. Which is the closest to 0.1? (a) -4 (b) -2 (c) t c Let k = -3 + 3. Let h = -0.3 - -0.4. Let m = -0.7 + 3.7. Which is the nearest to h? (a) m (b) -4 (c) k c Let p be 2/4 + 2383/14. Let x = 171 - p. Which is the nearest to 3? (a) -1 (b) 0 (c) x c Let u be (-2)/7 + 736/420. Let i = u + -4/5. What is the closest to 2/5 in -5, 4/5, i? i Suppose -10 = 4f - 2. Suppose 5j - 1 = -2d + 7, 2d - 8 = 4j. Which is the nearest to j? (a) -0.4 (b) f (c) -3 a Suppose -5x = 4h - 33 - 3, x = -2h + 12. Let a = x - 4. Suppose -2l + 5l - 3 = a. What is the closest to 0.2 in 3, 1/7, l? 1/7 Suppose d + 2d = -15. Suppose 8 + 4 = 3r. Let w be r/d5/(-14). Which is the closest to 1? (a) 5/3 (b) 1 (c) w b Let g = -9/2 + 4. Let y = 26 + -24. Which is the closest to 2? (a) g (b) y (c) -1/11 b Let j = 1/26 + 23/78. Let t = 13/7 + -131/63. Which is the closest to -2? (a) j (b) t (c) -1/6 b Let l be (-4)/26 + 324/78. Which is the nearest to 1? (a) 3 (b) l (c) -1/3 c Let l be 218/738 + 18/(-81). Let r = 32/123 + l. Which is the closest to r? (a) -0.5 (b) -4 (c) -0.2 c Let s = 6.3 - 6. Let k = -0.7 - s. Let u = 1.95 - -0.05. What is the nearest to k in 4, u, 5? u Let d = -13 - -13.5. What is the closest to 1/4 in d, 1, -0.4? d Let l(q) = -q3 - 3q*2 + 4q + 3. Let n be l(-4). Let m be n/(-6) + (3 - 2). Which is the closest to m? (a) -2 (b) -3/4 (c) 5 b Let y = -4.56 - -4.1. Let q = 0.06 + y. Let s = 0.4 + 0.1. Which is the closest to 1/4? (a) -4 (b) q (c) s c Suppose 5j + 4 = g, -5j = 12g - 8g + 9. Let v = -0.1 + 3.1. What is the nearest to g in 0.4, -0.4, v? -0.4 Let q = 2 - -2. Let s be -2(2 - (-15)/(-7)). Let j = -2/471 - -956/3297. What is the nearest to j in s, -4/5, q? s Let v = -18 - -37/2. Let o = -0.64 + 0.54. What is the nearest to o in v, -2, 0? 0 Let v = -18 - -19. Which is the closest to 2/7? (a) 2 (b) 1/5 (c) v b Suppose 2s - 60 = 14s. What is the closest to 4 in s, 2/5, 5? 5 Let k = -2.9 - -3. Let w = -26.3 + 26. What is the nearest to -1/4 in 2/11, k, w? w Let l = 2.4 - 4.4. What is the closest to l in -2/9, 5, -0.5? -0.5 Let z = -2.4 + 2. Let i(a) = a2 - 2a + 2. Let c be i(-5). Let b = 147/4 - c. What is the closest to 1 in b, -0.2, z? -0.2 Let w = 1.31 - 1.21. What is the nearest to w in 0.2, 10, 1/4? 0.2 Let d = -0.478 - -0.078. Let u = 0.1 + 0. What is the nearest to u in -5, d, 1? d Let m = 0.3 - -0.6. Let u = -1 + m. Let r be -1 - (-27)/(-15)-1. What is the nearest to u in -5, r, 0.2? 0.2 Let d = 2/117 + 76/117. Which is the closest to 0.1? (a) d (b) 8 (c) -1 a Let g = 0 + 2. Let f be (g/(-3))/((-5)/(-30)). Let i be ((-2)/12)/(f/18). Which is the nearest to -1? (a) 1 (b) -2 (c) i b Let q be (-2 + 10/2)/1. Suppose qr - 12 = a - 3, 4a + 6 = 2r. What is the nearest to 0 in a, 4, -1? a Let l be 4/10 + 224/(-385). Let f = -16 - -11. What is the closest to 1 in -1/2, l, f? l Let s = 6 + -6. Let p = s - -0.4. Which is the closest to 0? (a) 1/5 (b) 0.1 (c) p b Let s = -0.2 - 0.3. Let h = 1 + -0.5. Let b = 0.5 + h. What is the closest to b in s, -2/15, 5? -2/15 Let l = 0.09 + -0.04. Let s = l - -0.05. Which is the closest to -1? (a) -3 (b) 4 (c) s c Let p(q) = q + 2. Let j be p(-2). Let k be j/2 - 9/(-15). Let d = -3 - -3.1. Which is the nearest to 1/3? (a) 3/2 (b) k (c) d c Suppose r + 1 = -3y + 5, -5r + 2y + 3 = 0. What is the closest to r in 0.4, 0.5, 3? 0.5 Let p = -19/5 + 53/10. Which is the closest to 1? (a) 4 (b) p (c) 2 b Let j = 1.7 - 0. Let s = j - -1.3. Which is the nearest to -0.1? (a) s (b) 4 (c) -1/4 c Let k = -23 + 21. Which is the nearest to -0.2? (a) -5 (b) 0 (c) k b Let j = 14.2 + -14. Which is the nearest to 1? (a) -2/7 (b) 4 (c) j c Let j = 9.1 - 7. Let v = j + -0.1. Which is the nearest to -1? (a) v (b) -0.1 (c) -0.2 c Let m = -0.132 + 0.432. Let j = 1.9 - 1.1. Let n = -0.3 + j. What is the nearest to -0.1 in n, -0.1, m? -0.1 Let z(n) = n + 25. Let y be z(-11). Let i be 46/36 - 21/y. What is the closest to i in -3, -0.1, -1/5? -1/5 Let o = 0.09 + -0.09. What is the closest to o in -5, 0.5, -1? 0.5 Let g = -0.18 - -0.68. What is the closest to -2 in g, 0.4, -2? -2 Let v = -28 + 24. What is the closest to 2/3 in -1, 2/5, v? 2/5 Let h = -0.2 + -0.2. Let i = -143 - -1003/7. Let n = 0.2 - 0.3. What is the closest to i in h, -5, n? n Let y = 0.6 + -1. Let l = y - -0.4. Let a = -0.3 + -0.2. What is the closest to l in -5/4, -4, a? a Let g be 8/(-28) - (-8)/14. Which is the nearest to 0? (a) -0.1 (b) g (c) -4 a Let x(f) = f2 - 2f - 4. Let l be x(-2). Let o be (-3)/(-21) - l/28. Which is the closest to o? (a) 0 (b) -3 (c) 0.1 a Suppose d - 2d = 0. Which is the closest to -1? (a) -5 (b) -0.1 (c) d b Suppose -2k + 0k = -5j + 20, -4j - 2k + 34 = 0. Which is the nearest to j? (a) -2/3 (b) -1 (c) 3 c Let u = 1487 + -176954/119. Let r = -485/1071 - u. Let n = r - -7/9. Which is the closest to 1/3? (a) n (b) -1 (c) 0.5 a Let w = -0.5 - -1.4. Let h = -0.1 - w. Let z = 1 + h. What is the closest to z in 5, -3, -4? -3 Let i be (6/(-52))/(12/16). Which is the nearest to -1? (a) 1/5 (b) i (c) -4 b Suppose 0 = 2y + 2y - 20. Suppose 5k - 3 = -13. Which is the closest to k? (a) -2 (b) -1/6 (c) y a Suppose -3w = -5w. Let l = -1 + 4. Let j = l + 0. What is the nearest to -1 in w, j, -4/5? -4/5 Let i = 123 - 131.9. Let h = 9 + i. What is the nearest to h in -5, -3, -1? -1 Let k = 21/100 - -1/25. Let c be 0 - 0 - (-1 + -2). What is the nearest to 0.1 in k, c, -1/3? k Let w be 2/(-50)5/(-2). Let v(s) = s*2 - 10s + 6. Let m be v(9). What is the nearest to 0.1 in w, 1/5, m? w Let m = 0.1 - -0.1. Let z(i) = -i*3 + 5i*2 - 5i + 4. Let y be z(4). What is the closest to y in 0, -1, m? 0 Suppose -2k - 4d + 4 = 0, 2k - 5k + 2d - 18 = 0. Let i be (1/((-2)/k))/4. What is the nearest to 0 in i, -0.3, 0.4? -0.3 Let s = -10 - -1. Let n = s + 12. Let l = -2 + -3. Which is the nearest to n? (a) -0.5 (b) 2/7 (c) l b Let k = 23 - 25. Which is the nearest to 2? (a) 4 (b) k (c) 0.4 c Let u = -11/15 - -1/15. Suppose -2l = 2m - 0l + 10, 5m + 16 = 4l. Which is the closest to u? (a) 4 (b) 0.1 (c) m b Let q be (-1 - (-1)/5)/(-10 - -12). Which is the nearest to -0.1? (a) 8 (b) q (c) -0.5 b Let r = 0.7 + -0.3. Let x = -63.6 - -64. Which is the nearest to r? (a) -4 (b) 0.2 (c) x c Let w = -45/2 - -23. Let f(o) = o*2 + 5o - 5. Let d be f(-6). Let z = 2 - d. What is the closest to 2 in z, 0, w? z Let j(z) = 2z - 2. Let m be j(3). Which is the nearest to -1/7? (a) 0.5 (b) 1 (c) m a Let v be 4/6 + 6/(-9). Let k = -367/8 + 46. Let s be (0 - 2) + 1 + 0. Which is the closest to s? (a) k (b) v (c) -0.4 c Let p = -6 - -4. Let u = -2.4 - p. Which is the nearest to u? (a) -3/7 (b) 0 (c) 0.1 a Let x = -5.5 - -6. Let g = -0.06 - -0.06. Let l = -4 + g. What is the nearest to 2/5 in l, 5, x? x Let d be (13/(-91))/((-1)/1). Let b = 15 + -61/4. What is the closest to 0.3 in d, 3, b? d Suppose 4q + 66 = 3q. Let h = q - -328/5. Let d = 0 - -3. Which is the closest to 0? (a) 0.5 (b) d (c) h c Let l be (1 - (-3 - -1)) + 7. Suppose -4h = -2h - l. Suppose -2q - t - 3 = 0, -hq - 3t = -5 + 10. Which is the nearest to 0.1? (a) 7/5 (b) q (c) 5 a Let f = -17 - -19. Which is the closest to -1/6? (a) f (b) 2/3 (c) -0.2 c Let l = 3.92 - -0.08. Let b = 11 - 7. What is the nearest to l in -4, 0, b? b Let p = 3 - 8. Let v = -10 - p. Let o = 6/5 + -8/5. Which is the closest to -2? (a) v (b) -0.1 (c) o c Let v = 0.27 - 4.37. Let f = v - -4. Let x(u) = u*3 - 8u*2 - u + 9. Let q be x(8). What is the closest to f in q, 2/3, 5? 2/3 Suppose 0u - n = -4u + 8, 0 = -3n + 12. Let d be 1/(2u/(-30)). Let y = 0.2 - 0. Which is the closest to y? (a) -1/8 (b) 0.2 (c) d b Let z = 0.75 + 20.25. Which is the closest to 0.1? (a) -1/6 (b) 3/7 (c) z a Suppose -8 = -5j + 3j. Let n = 0.25 + -0.15. Let f = -0.3 - -0.6. Which is the nearest to n? (a) f (b) -1/2 (c) j a Let u be 3/(-27) + (-25)/(-63). Which is the nearest to -7? (a) u (b) -4 (c) 2/13 b Let m = 0.33 - 0.03. Let l be (-1)/(-1)(-29)/58. Which is the nearest to 2? (a) m (b) 4 (c) l a Let m = -0.05	{ "pile_set_name": "DM Mathematics" }
, given that z(n) = 0. 0, 2/7, 1 Determine v, given that 14v3 - 9v*3 - 10v*2 + 10 - 10v + 5v = 0. -1, 1, 2 Let j(o) = o2 + 15o*2 + 2 - 4o2 - o3 - 11o. Let a be j(11). Find d such that 1/2d*3 + 0d*a + 0 + 0d = 0. 0 Let x(v) be the third derivative of -v6/320 + v5/160 + v4/64 - v3/16 - 9v2. Let x(p) = 0. Calculate p. -1, 1 Let g(z) be the third derivative of -1/840z*7 - 2z*2 + 0 + 0z - 1/2z3 + 0z*6 + 0z*5 + 0z4. Let b(d) be the first derivative of g(d). Factor b(a). -a3 Let j(k) = -5k2 + 2k - 7 + 2 - k*3 + 2k*2. Let y be j(-4). Factor 0d - yd + d2 - 2 - d - 3d*2. -2(d + 1)*2 Let a be (-2)/8 - (-87)/12. Let i(q) = -6q*3 + 6q*2 - q - 6. Let m(z) = -5z*3 + 5z*2 - z - 5. Let l(d) = am(d) - 6i(d). Let l(y) = 0. Calculate y. -1, 1 Let j be (-3 + 3)/((-1)/1). Factor -3i*3 + ji + i*5 - 2i + 3i + i3. i(i - 1)*2(i + 1)*2 Let k(t) = 25t*2 - 43t - 23. Let b(l) = -25l2 + 44l + 24. Let n(m) = -3b(m) - 4k(m). Factor n(a). -5(a - 2)(5a + 2) Let f(l) be the second derivative of -l7/98 - l6/14 - 6l5/35 - l4/7 + 15l. Factor f(h). -3h*2(h + 1)(h + 2)2/7 Suppose -10 = -7b + 11. Let a = 133 + -395/3. Find n such that -an + 2/3n*2 + 0 + 2/3n*b = 0. -2, 0, 1 Let p(f) be the second derivative of 1/90f*6 + 0f*2 - 1/120f*5 + 0f*4 + 1/3f*3 + 0 + 4f. Let k(t) be the second derivative of p(t). Solve k(l) = 0. 0, 1/4 Suppose 12 = 3d, -3d + 8 = -4y - d. Factor 1/4o*3 + y + 0o*2 - 1/4o. o(o - 1)(o + 1)/4 Suppose 5k = 2n + 104, 2k + 34 = -2n + n. Let w be -12((-122)/n - 3). Factor -w - 18/7s*2 - 24/7s. -2(3s + 2)2/7 Let w(m) = -m3 - m + 2. Let l(z) be the first derivative of z4/4 - z3/3 + z*2/2 - z - 1. Let s(j) = -6l(j) - 3w(j). Factor s(d). -3d(d - 1)2 Let w = 9 - 9. What is d in -9d*2 + wd*2 + 9d*2 - 5d*5 - 3d*4 + 2d*3 = 0? -1, 0, 2/5 Determine u, given that 2/15u*4 + 8/15u*3 + 8/15u + 4/5u2 + 2/15 = 0. -1 Find b, given that 8/7b*3 + 4/7b - 12/7b5 - 20/7b*4 + 24/7b*2 - 4/7 = 0. -1, 1/3, 1 Let d = -316/3 - -106. Factor 0 + 0w + 4/9w3 + 0w*2 - dw*5 + 2/9w*4. -2w*3(w - 1)(3w + 2)/9 Suppose 9h - 5 = 13. Suppose 0 = 5m + 3 - 23. Find k such that -1/2km - 1/2k*3 + 0 + 0k + 0kh = 0. -1, 0 Let i(k) be the third derivative of k7/165 - 13k*6/330 + 13k5/330 + k4/22 + 15k2. Determine t so that i(t) = 0. -2/7, 0, 1, 3 Let f(z) be the second derivative of z5/120 - z3/36 - 7z. Factor f(v). v(v - 1)(v + 1)/6 Let d be 316/4 + 1 + -5. Find t, given that -87t + 6t*2 + dt + 12t2 + 2 = 0. 1/3 Factor -36y + 36y - 4y*5. -4y5 Let i(c) be the first derivative of c3/9 - 10c2/3 + 100c/3 + 63. Find w such that i(w) = 0. 10 Let s be (3 - 5)(1 + -2). Factor -2g*2 + 2g*3 - 2g*3 - sg*3. -2g*2(g + 1) What is a in -a*2 - 1 - 2a - a*3 - 2 + 3a + 4a = 0? -3, 1 Let q(l) = l3 + l2 + l. Let n(j) = -2j*3 - 1 - 21j*2 - 4j*3 - 2j*3 + 9j*2 - 9j. Let o(w) = n(w) + 4q(w). What is d in o(d) = 0? -1, -1/2 Let l = 2 - 2. Let h(r) be the second derivative of lr*2 + 2/15r*3 + 0 - 1/25r*5 - 1/10r*4 + 2r + 1/25r6. Let h(p) = 0. Calculate p. -1, 0, 2/3, 1 Let q = -1129/3 - -377. Let -8/3 + 8/3x - qx2 = 0. What is x? 2 Let j = 1510 - 294449/195. Let n(p) be the third derivative of 2/39p*3 + 3p*2 + 0p - 1/52p4 + 1/260p*6 + 0 - jp*5. Factor n(v). 2(v - 1)(v + 1)(3v - 2)/13 Let s(y) be the first derivative of -1/3y*2 + 0y + 3 + 7/9y3 - 1/4y*4 - 7/15y*5 + 5/18y6. Suppose s(d) = 0. What is d? -1, 0, 2/5, 1 Let f(w) be the second derivative of -w7/126 - 41w6/90 - 32w*5/3 - 1150w*4/9 - 7000w*3/9 - 5000w*2/3 - 50w. Factor f(i). -(i + 1)(i + 10)4/3 Let f be 4/(-1) - 12008/(-2840). Let g = f - 2/71. Solve -2/5v*2 + gv + 0 + 0v3 - 1/5v*5 + 2/5v*4 = 0. -1, 0, 1 Let s be 10/(-3)(11 + -5). Let p = -18 - s. Factor -2/5j - 4/5 + 2/5j*p. 2(j - 2)(j + 1)/5 Let h(m) be the second derivative of 0 + 0m*5 + 1/63m*7 - m + 0m*2 - 1/9m*3 - 1/9m*4 + 2/45m6. Find o, given that h(o) = 0. -1, 0, 1 Let x(a) be the third derivative of -a7/1260 - a6/180 - a4/12 - 6a2. Let c(y) be the second derivative of x(y). Factor c(o). -2o(o + 2) Suppose -3h + 0h = -18. Suppose -2f + 0v + 2v = h, -4f + 2v - 6 = 0. Suppose 1/4o3 + 1/4o - 1/2o2 + f = 0. What is o? 0, 1 Let s(y) be the third derivative of 2/15y*5 + 0 - 1/60y*6 + 1/3y*3 + 1/336y*8 + 0y + 8y2 - 7/24y*4 - 1/105y*7. Solve s(x) = 0. -2, 1 Factor 7q4 + q2 - 16q3 + 2q3 + q2 - q*5 + 10q + 5q - 9. -(q - 3)2(q - 1)*2(q + 1) Let l(t) = 8t2 + 31t + 2. Let b(v) = -v*2 + v - 1. Let o(k) = -4b(k) + l(k). Suppose o(j) = 0. Calculate j. -2, -1/4 Factor 102 + 15t2 - 5t*3 - 102. -5t*2(t - 3) Suppose -5r - 14 = 2u - 41, -3u = -2r + 7. Suppose -4y3 + 1 + 2y*4 - u + 6y3 = 0. What is y? -1, 0 Let v(m) be the first derivative of -m4/26 + 2m3/39 + m2/13 - 2m/13 + 15. Determine y, given that v(y) = 0. -1, 1 Let i = 14 + -10. Suppose 0 = -3h + w + 1, -3w - 2w = ih - 33. Determine a, given that 0a2 + 1/2a*4 + 3/2a*3 + 0 - ha = 0. -2, 0, 1 Let f(g) be the second derivative of g6/60 + g5/10 + 5g4/24 + g3/6 + 9g. Let f(w) = 0. Calculate w. -2, -1, 0 Let x be ((-189)/35 + 5)-5. Find t, given that 1/5 + 2/5t + 1/5tx = 0. -1 Suppose 8t = -6t. Find p, given that 0 + 1/3p*2 - 4/3p*3 + tp = 0. 0, 1/4 Let z(w) be the first derivative of -w8/2520 - w7/420 - w6/180 - w5/180 - w3 + 1. Let y(x) be the third derivative of z(x). Solve y(s) = 0. -1, 0 Let a(n) be the second derivative of n7/70 - 3n6/40 + 3n5/20 - n4/8 + 3n2/2 - 3n. Let u(y) be the first derivative of a(y). Factor u(l). 3l(l - 1)3 Let z(j) be the first derivative of -j7/420 + j6/240 + j2/2 + 3. Let w(p) be the second derivative of z(p). Factor w(a). -a*3(a - 1)/2 Suppose -47r - 1 - 2 + 0 + r2 + 45r = 0. What is r? -1, 3 Let n(m) = -m*3 - 31m*2 - 59m - 5. Let h(u) = -15u2 - 30u - 3. Let b(f) = -5h(f) + 3n(f). What is i in b(i) = 0? -3, 0 Let f(j) be the first derivative of 5j6/6 + 3j*5 + 15j*4/4 + 5j*3/3 + 4. Factor f(h). 5h*2(h + 1)*3 Let a(d) be the second derivative of 1/3d*3 + 0d*2 + 0 + 1/10d*5 + 2d + 1/3d4. Suppose a(k) = 0. What is k? -1, 0 Suppose -a = -2p - 4, p = 6p. Determine v so that 6v + 7v4 + 8v*3 - av*4 + 15v*2 + 4v*3 = 0. -2, -1, 0 Let k(h) be the second derivative of 25h*4/36 - 10h*3/9 + 2h*2/3 + h. What is m in k(m) = 0? 2/5 Let d be 1/3 + 8/3. Let q be (-2)/(-4) - (-138)/12. Factor -10i*4 - i - 6i*2 - 4i + 4i - di*5 - qi*3. -i(i + 1)*3(3i + 1) Let h = 151/222 + -1/74. Factor 0 - 2/3y*5 + 0y + 0y2 + 0y*4 + hy*3. -2y*3(y - 1)(y + 1)/3 Let v(h) = -15h*2 + 18h - 27. Let j(k) = -6k2 + 7k - 11. Let m be 62/5 - (-14)/(-35). Let t(y) = mj(y) - 5v(y). Factor t(x). 3(x - 1)2 Let t(f) = -2f*2 - 7f + 3. Let d(r) = 4r2 + 13r - 6. Let k(v) = 6d(v) + 11t(v). Let i(o) = -o - 1. Let z(l) = 3i(l) - k(l). Factor z(w). -2w(w + 2) Let f(n) = -n2 + 114n + 726. Let a(s) = -s*2 + 229s + 1451. Let d(i) = -6a(i) + 11f(i). Factor d(x). -5(x + 12)2 Factor -4/5 - 2/5s + 2/5s3 + 4/5s*2. 2(s - 1)(s + 1)(s + 2)/5 Suppose 4/3l - 5/6l*2 - 2/3 + 1/6l*3 = 0. What is l? 1, 2 Let b(k) be the first derivative of 2k*5/15 - 2k*3/3 + 2k*2/3 + 13. Factor b(g). 2g(g - 1)2(g + 2)/3 Let r be (-384)/(-288) - (5/(-3) + 1). Factor 1/2zr + 1 - 3/2z. (z - 2)(z - 1)/2 Let c(v) be the third derivative of v7/2940 - v6/252 + 2v5/105 - v4/21 - v3/6 + v2. Let p(r) be the first derivative of c(r). Factor p(y). 2(y - 2)2(y - 1)/7 Let h(z) = -z*2 - 17z - 27. Let o be h(-15). Let s(l) be the first derivative of 3 + 0l + 2/9l*o + 1/3l*2. Factor s(r). 2r(r + 1)/3 Let j(v) be the second derivative of 1/20v*5 - 1/42v*7 + 0 + 0v*2 - 1/12v*4 + 5v + 1/30v6 + 0v3. Factor j(r). -r2(r - 1)2(r + 1) Let g(x) be the first derivative of -x7/189 - x6/45 - x5/45 + x4/27 + x3/9 + x2/9 + 2*x +	{ "pile_set_name": "DM Mathematics" }
s 71/(-2)270/(-630)? 3/2 What is (-3)/(-42)16/3? 1/7 Calculate ((-145)/2610)/((-11)/12). 2/33 Evaluate (25/((-2450)/(-28)))/(10/14). 2/5 What is -303(-24)/270? 8 What is ((-24)/336)/((-2)/(-12))? -3/7 (9/(-8)44/(-33))/(-3) -1/2 Calculate ((-32)/24)/(252/(-27)). 1/7 What is (-24)/162(-3)/2? 2/9 635/120 3/4 What is the value of 1575/1264/5? 10 What is the value of ((-164)/861)/((-3)/(-9))? -4/7 Calculate 6/(-12)1/(18/8). -2/9 What is the value of (-30)/(-45)5/2? 5/3 Calculate 2/(-1)5/10. -1 Evaluate (-12)/4((-8)/6)/(-1). -4 Evaluate ((-5)/((-10)/(-6)))/(2/2). -3 ((-24)/(-2))/((-34)/(-17)) 6 10/60(-6)/(-16)12 3/4 Calculate 36/(-12)(-9)/(-513). -1/19 What is the value of ((-3)/(-4))/((-81)/(-72))? 2/3 -2-53/6 5 What is 2/8(-3)/(9/15)? -5/4 What is ((-1)/(21/30))/(20/(-140))? 10 What is ((-57)/(-190))/(7/((-70)/(-24)))? 1/8 What is the value of 42/18(-6)/844? -2/3 Evaluate (-304)/(-266)7/2. 4 Calculate -1615/(-45). 2 What is the value of (-3)/(-24)10(-8)/(-2)? 5 What is (4/(-4))/(6/42)? -1/3 What is (8/(-12)-1)/(24/(-60))? -5/3 Calculate 8(16/4)/81. 4 What is (128/(-24))/(-8)3/(-2)? -1 Calculate 0/(-7)-22/8. 0 What is (6/6)/(3/(-12))? -4 2/1(-4)/(-56) 1/7 What is 21/74/36? 1/3 Evaluate (-16)/3011/(308/(-21)). 2/5 What is 316/363/5? 4/5 Calculate (12/3)/(11/(-22)). -8 What is the value of (-594)/(88/8)2/(-12)? 9 5/((-9)/(-135)25) 3 Evaluate ((-1)/6)/(-13/6). 1/3 (-4)/3(-15)/(-120) -1/6 Evaluate ((828/(-115))/12)/(6/4). -2/5 (((-18)/16)/3)/((-306)/68) 1/12 10/(-14)7/(-35) 1/7 What is the value of 12/(-3)6/(614)? -2/7 2/(-4)(-12)/(-6) -1 What is 110/(-5)-1? 2 What is the value of ((154/33)/(-7))/4? -1/6 What is (-18)/(-4)(-12)/18? -3 Calculate 48/(-3)4/(24/3). -8 (-18)/(-9)1/6 1/3 What is (((-840)/(-32))/21)/(18/24)? 5/3 Evaluate (-19)/(19/(-2))1/(-6). -1/3 Evaluate (((-15)/8)/((-12)/(-16)))/(-2). 5/4 120/(-36)3(-1)/(-1) -10 What is ((-2)/(-5))/((-48)/(-12))? 1/10 (-27)/(-162)72/22 6/11 2/4((-2268)/14)/9 -9 What is (-1)/(1(5/5)/7)? -7 What is the value of (-6)/(-21)7-1? -2 Evaluate -220/606/(-20). 1/5 What is the value of (1244/4665)/(2/50-2)? -10/3 0((-105)/14)/15 0 ((-4)/6)/((-4)/18-1) -3 (-5)/(-10)10/(-4) 0 What is the value of (5/(-115))/((-8)/(-16))? -2/23 2/(2/(6/3)) 2 ((-12)/6)/(-42) 1/4 Evaluate ((-12)/(-21))/(-4(-2)/28). 2 What is 12/(-9)9/42? -2/7 Calculate 1/2(-242)/6. -4 What is the value of 9/66/7264? 8 Evaluate 5/(-10)8/(-6). 2/3 Evaluate 15318/(-265). -6 What is the value of (-3)/(27/4-2)? 2/9 What is the value of (-3)/(((-105)/10)/(-7))? -2 Evaluate (6/(-1))/(((-3)/(-2))/1). -4 (-2)/(-7)21/2 3 (-12)/(-6)14/(-12)3 -7 What is the value of 4/(-16)4/4? -1/4 10/(160/12)2 3/2 8/614/(2128/12) 2/19 What is the value of (-2)/1(198/(-72))/11? 1/2 20/2((-6)/6)/2 -5 What is the value of (-2)/(-5)(120/(-12))/(-1)? 4 Evaluate 15(-198)/(-165)1/(-3). -6 Calculate 2/2-81/2. -4 What is (8/(-6))/((-8)/(-12))? -2 Calculate (175/(-105))/((-20)/(-72)). -6 Calculate 0/((4/(-6))/((-24)/72)). 0 8/1(225/(-18))/(-25) 4 (-4)/5(-5)/(-140)21 -3/5 What is (680/408)/(1/3)? 5 What is (-56)/(-105)(-12)/(-16)? 2/5 What is the value of 4/268/32? 3 What is the value of -17(-55)/(-77)? -5 Calculate (112/32)/((-5)/(-10)). 7 What is 4/(-8)12-6? 6 Evaluate 2(-8)/(-24)10/(-8). -5/6 (26/(-13))/((-10)/4-4) -1/5 What is the value of (-10)/(-4)(-3)/(72/(-16))? 5/3 What is 2(10/12)/(-5)? -1/3 Evaluate (5/(-75))/((-2)/(-12))-10. 4 What is the value of 3/(-6)320/24? -5/4 (11(-7)/(-770))/(2/(-8)) -2/5 (17/(2040/(-16)))/(2/10) -2/3 What is the value of (30/5)/(120/(-200))? -10 What is the value of -18((-4)/9)/2? 4 What is the value of (-5)/3-7(-9)/42? -5/2 What is 0/((-35)/((-5)/(-1)))? 0 Evaluate 2-2111/148. -3 Evaluate ((-41)/287)/((-3)/3). 1/7 ((112/360)/7)/(3/15) 2/9 Calculate (4/(24/9))/((-4)/2). -3/4 What is the value of 2/(8/93)? 3/4 What is (245/(-49))/(5/(-2))? 2 What is ((400/70)/(-10))/(4/(-14))? 2 What is 1/((-10)/50)7/(-5)? 7 Calculate 94/(-1833)-1(-3)/1. -2/13 What is the value of (6/20)/(15/10)? 1/5 Evaluate (5/((-50)/4))/(4/5). -1/2 What is 6/5105/441? 2/7 What is (-2)/(-7)14/2? 2 Evaluate (-50)/15(360/(-16))/(-15). -5 Calculate (-32)/(-28)2/47. 4 (-6)/627/9 -3 (-32)/642/1 -1 (8/(-42))/(6/9) -2/7 Calculate 15/10-4(-1)/3. 2 Evaluate (-3)/1(-5)/3. 5 Calculate ((0/1)/5)/(1-3). 0 What is the value of ((-3)/((-9)/(-5)))/(270/(-486))? 3 What is the value of (-5)/(-4)(104/(-325))/(-4)? 1/10 Calculate (17/(-17))/((-9)/(-45)). -5 What is the value of ((-24)/(-12))/(4/(-2))? -1 Calculate (168/(-147))/(2/7). -4 (-10)/(-180)6/4 1/12 What is the value of (-6)/432/(-24)? 2 What is the value of 88/321(-2)/(-11)? 1/2 2/((-9)/(135/10)) -3 What is the value of ((-1)/(-1(-2)/(-2)))/(-1)? -1 (1/1)/((-30)/(-20)) 2/3 What is the value of (-9)/(-3)(-3)/184? -2 What is the value of ((-1)/(-2))/(((-396)/16)/(-11))? 2/9 Evaluate (-14)/6(48/126)/(-4). 2/9 What is ((-7)/2)/(82/164)? -7 (((-12)/(-3))/(-36))/(6/9) -1/6 ((-2)/(-8))/((-5)/206) -1/6 Calculate 2/(-2)4/(-2). 2 What is the value of (3/(-30))/((-20)/(-50))? -1/4 ((314)/(-3))/(68/34) -7 Calculate 1320/(-132)4/10. -4 (1/9)/((-12)/18) -1/6 Calculate 3/(-6)18/63. -1/7 Evaluate (12/104-2)/(54/36). -2/13 What is the value of ((2/(-4))/(28/(-140)))/15? 1/6 What is 8/18(-108)/24? -2 Evaluate (-44)/(-8)(-56)/(-154). 2 6/(-4)14/28 -3/4 What is 8/(56/1)-3? -3/7 Evaluate 23(-10)/90. -2/3 Evaluate 2(-3)/2-1. 3 What is (6/(-4))/3(-408)/(-34)? -6 Calculate (5(-4)/(-240))/((-1)/14). -7/6 Evaluate 15/((-6)/(-2))(-2)/55. -2/11 What is the value of 0/(6/((-10)/5))? 0 Calculate (-61)/(12/8). -4 (-18)/8(28/24)/7 -3/8 (-70)/909/(-21) 1/3 Evaluate ((-117)/(-10))/13(-8)/(-18). 2/5 What is the value of 2/((504/4)/6)3? 2/7 What is the value of (-7)/(350/(-15))(-5)/(-9)? 1/6 ((-120)/(-140))/((-15)/14) -4/5 Calculate (216/810)/((-44)/(-30)). 2/11 What is the value of ((9/(-3))/((-105)/(-14)))/1? -2/5 What is the value of (-3(-1)/(-24)4)/2? -1/4 What is 5/(-10)-18/20? 1/5 What is ((-30)/(-27))/(102/459)? 5 What is (-17(-57)/2584)/(3/(-1))? -1/8 What is ((-2)/(-1))/((-19)/(114/4))? -3 What is 3(37/(-296))/(3/(-4))? 1/2 20/1(-2)/(-20) 2 Evaluate (-5)/((-35)/28)(-2)/(-28). 2/7 135/(-18)(-6)/(-9) -5 Calculate 8/(-18)423/94. -2 Evaluate (-2)/(-28)((-35)/2)/(-5). 1/4 Calculate (11(-39)/(-572))/(6/(-40)). -5 Evaluate 30/12515/9. 2/5 Evaluate 470/(-1598)(-1)/(-5). -1/17 What is 24(-2)/(-4)? 4 What is the value of 3((-3)/(-3))/(6/4)? 2 Evaluate (-1)/2238/119. -1 What is 2/(914/63)? 1 (-11)/(-5)2/55 2/25 Evaluate (52/6)/(-13)2/(-2). 2/3 Calculate (8/(-60))/((-1)/(-40)4). -4/3 What is (39/78)/(2/8)? 2 What is the value of ((-8)/90)/((-6)/9)? 2/15 Calculate (9/18)/(((-210)/(-12))/(-7)). -1/5 What is (-4)/(-95/(-90))? -8 What is the value of ((-3)/12)/(72/(-32))? 1/9 What is (((-48)/7)/(-8))/(6/(-28))? -4 Calculate 310/1241/10. 1/4 What is the value of 1/((-6)/(-4)(-8)/(-36))? 3 What is the value of (-7)/(210/9)(-40)/4? 3 What is the value of (18/30)/(30/20)? 2/5 ((6/(-16))/1)/((-9)/6) 1/4 Calculate (-1)/(-4)24/16. 1/8 Evaluate 99/16550/3. 10 What is (-5)/(((-15)/(-3))/(-5))? 5 2/5(-45)/(24/(-8)) 6 Calculate (3/((-63)/28))/(-4). 1/3 Evaluate ((-6)/15)/(46/(-345)). 3 Evaluate (11/12)/(-11)3. -1/4 What is the value of (8/228)/((-2)/6)? -2/19 What is the value of (9/(-6))/(14/4)? -3/7 Calculate (0/(-1))/(-6)-1. 0 (5/(80/8))/(2/(-4)) -1 What is the value of ((-9)/(-30))/(2/5)? 3/4 Calculate ((-396)/231)/((-4)/141). 6 ((3/1)/45)/(9/27) 1/5 ((-9)/(-6))/(171/(-12)) -2/19 What is (-84/56)/(12/(-9))? 3/7 What is ((-6)/(-12)-2)/(9/15)? -5/3 Evaluate (-279)/(-217)-1(-14)/2. 9 (-328)/24654/(-8) 9 What is the value of ((-38)/57)/(3/(2/(-2)))? 2/9 2/4(-40)/(-70) 2/7 (2/(-3))/(208/(-78)) 1/4 Evaluate -84/(-176)-1. -2/11 What is the value of (-1)/((-14)/(-2))(-34)/(-17)? -2/7 What is (200/(-190))/(16/(-152))? 10 Evaluate (-2)/8((-32)/3)/4. 2/3 15/((-12)/(-20)-5) -5 Evaluate (-7)/143(-8)/(-114). -2/19 Evaluate ((-6)/3)/66/(-8). 1/4 Calculate ((-14)/245-14)/((-4)/(-10)). 2 What is 24/64-24? -3 Evaluate (-5)/1(-14)/(-14). -5 (-25)/5*(-3)/(-2) -3 What is 2/((20/(-15))/(-2))? 3 What i	{ "pile_set_name": "DM Mathematics" }
6. Let d be (-2 - -3)/(6/(-30)). Let x be a(d). Suppose x = 8c - 0c. Does 16 divide c? True Let p(g) = -81 - 2g + 71 - 8g + 142. Is p(-12) a multiple of 28? True Is 17 a factor of (-82 - 13)(4 + 2 + -40)? True Suppose 2k - 7z - 24238 = 0, 4z + 9061 = 2k - 15165. Is k a multiple of 30? False Suppose 0 = 2r - r - 432. Suppose 448p = 464p + 4624. Let y = r + p. Is y a multiple of 23? False Let x(k) = -65k + 4. Let m be x(3). Let l(q) = -2q*2 + 67q - 77. Let i be l(34). Let u = i - m. Is u a multiple of 20? True Suppose -10i + 7513 + 1006 = -8911. Is i a multiple of 33? False Let z(f) = -9f - 13. Let b = -55 + 51. Let i be z(b). Suppose 29 + i = 4t. Is t a multiple of 4? False Let q(x) be the first derivative of 25x3 - x2 + 15x - 113. Is 19 a factor of q(3)? True Let s(a) = -11a*2 + 9a - 2. Let p be s(3). Let l = p - -134. Is 6 a factor of l? True Let p = -48 - -53. Suppose -pu + 1064 = -u. Suppose 110 + u = 4t. Does 15 divide t? False Let d(m) be the first derivative of m*3/3 - 5m*2 + 3m + 17. Let z be d(10). Let q = z - -33. Is q a multiple of 12? True Suppose -1714 = -3j + 2q, -4q - 1197 + 4039 = 5j. Suppose 0k - 4k + 2y = -j, 2k - 276 = 4y. Does 5 divide k? False Is ((-732)/5)/((-48)/(-40)(-4)/304) a multiple of 38? True Let a(u) = 22u + 65. Let x be a(-13). Let d = -214 - x. Is d a multiple of 4? False Suppose -12606 = 33o + 33o. Let d = 290 + o. Does 3 divide d? True Suppose 0o = -16o + 336. Suppose 0b = -3b + o. Is 4/b + (-21276)/(-252) a multiple of 17? True Let o = 692 + -494. Suppose 17q - o = 3780. Does 13 divide q? True Let a(h) = 285h + 5. Let d be a(2). Suppose -5u = -2y - 1019, -3u = -y - d - 36. Does 7 divide u? True Let p be 2 + 3 + 360 + -4. Suppose 0h + 2z - 461 = -5h, 4h - z - p = 0. Is h a multiple of 7? True Let r be (0 - 0)/(6 - 1 - 6). Suppose ra + 5a + 15 = 0. Does 18 divide (464/(-4))/(-4) - a? False Let y be -3 + (-15)/5-2. Suppose ym - 7m - 4 = 0. Is m(-3 - 1 - 11) a multiple of 2? False Let d = -8059 - -16891. Does 42 divide d? False Suppose b - 48241 = -4j, -b = 2 - 7. Does 31 divide j? True Is 13 a factor of 351/(-18)((-15)/20 + (-2324)/16)? True Let d(m) = -m*3 - 3m*2 + 10m - 3. Let g be d(2). Does 17 divide (63/42)/(g/(-1492))? False Let j(l) = -2l3 - l2 + 4l - 4. Is j(-3) a multiple of 29? True Let p be 0(1 + (0 - 0)). Suppose -5z + 10z - 535 = p. Is z a multiple of 11? False Is 39 a factor of 1((-34401)/9)/(2/(-6))? False Suppose -624 = 37l - 89l. Is 6 a factor of l(16/40)/((-8)/(-190))? True Suppose -38917 = -5a - 3l, 3a - 23347 = 5l - 10l. Does 56 divide a? True Suppose 3h - 3w = 954, -230h + 234h = 5w + 1273. Is h a multiple of 5? False Let b(d) = d3 + 23d*2 - 45d + 164. Is b(-25) a multiple of 2? False Let v(b) be the third derivative of -b*5/60 - 5b*4/8 + 2b*3/3 + 3b*2. Let x be 0 - 94/6. Is 26 a factor of v(x)? False Suppose -415n - 249920 = -437n. Is n a multiple of 32? True Let x = 366 + -382. Let c = 134 - x. Does 3 divide c? True Let n = 87050 + -57712. Does 18 divide n? False Suppose 8g - 117367 = 152553. Is g a multiple of 20? True Suppose 0 = 61f - 4f + 3f - 140880. Does 10 divide f? False Let w = 2675 + 5677. Is w a multiple of 16? True Let m(w) = w*3 - 4w*2 + 7w + 6. Let j be m(5). Let o = j + -48. Suppose 3x - o = 3c - 672, 3x - 624 = -3c. Is c a multiple of 13? False Suppose -135247 = -39k + 87404. Is 11 a factor of k? True Is 2(-6 - 122529/(-22)) a multiple of 46? False Suppose -32g + 13g - 15g = -109106. Is 68 a factor of g? False Let f = 949 - 224. Is f a multiple of 5? True Does 60 divide 10200(-27 + 29 - (0 - -1))? True Let p = 6 - -10. Let y(z) = -62z + 3846. Let b be y(62). Suppose bu = pu - 1582. Does 27 divide u? False Suppose 3g + 43517 = 4h, 8h - 43519 = 4h + g. Is h a multiple of 68? True Let a = -16464 + 23971. Does 22 divide a? False Suppose 2949 = t - r - 370, -2t + 6637 = -r. Is 28 a factor of t? False Suppose 0 = -28b + 952 + 4144. Is b a multiple of 14? True Suppose 27c - 11111 = 2956. Does 74 divide c? False Does 86 divide ((-81434)/(-4) - 2)21/(-252)-16? False Let u(s) = -2s2 - s. Let a(t) = -2t*3 - 57t*2 + 48t - 18. Let v(k) = -a(k) - 3u(k). Is 31 a factor of v(-32)? True Let g = -4001 - -9910. Does 19 divide g? True Suppose -4w + 7134 = 2l, -89l + 85l + 14308 = -2w. Does 40 divide l? False Suppose 0 = -5h - 29 - 1. Let q(b) be the second derivative of -8b*3/3 + 3b*2/2 + 22b. Is 25 a factor of q(h)? False Let g(t) = -2t2 - t - 5. Let b be g(-5). Let o(c) = -c3 - 21c*2 - 59c - 7. Let k be o(-18). Let m = k + b. Is 33 a factor of m? True Let f(k) = 490k3 - 5k*2 + 3k - 5. Is f(2) a multiple of 113? False Let w(v) = 39v2 + 3v + 3. Suppose 3d = -c - 2 - 7, 0 = -c + d + 11. Is 19 a factor of w(c)? True Let j = 39 - 51. Let x be 3(1 - (1 + 8/j)). Suppose -2t + 66 = -xc, -t + 48 = -0t + 2c. Is t a multiple of 20? False Let x be 4/(-14) + (-37)/(1295/200). Is x + (-24)/(-4) + 148 a multiple of 12? False Let h be -6(-10980)/72(-1)/(-10)-2. Suppose -228 = -2z + 172. Is h/(-5) + (-10)/(z/12) a multiple of 4? True Is (0 - 12/(-15))/(48/112680) a multiple of 12? False Suppose -7q + 10q + 9746 = 5s, 0 = -s - 5q + 1966. Does 33 divide s? False Let k(d) = -d + 2. Let u = 71 - 72. Let m be k(u). Suppose -ms - s = -1012. Does 27 divide s? False Suppose -4q = c + 1677, 9c = q + 5c + 398. Does 2 divide q/57(-2 - (-5)/(-2))? False Let z = -40635 - -67739. Is 22 a factor of z? True Suppose 5n = -2f + 5, -15f + 5n = -13f + 25. Let d(a) = -2a - a + 13 - 12 + 12. Is 4 a factor of d(f)? True Suppose -117q - 46720 = -636400. Does 10 divide q? True Let x be 10400/4 - (4 + 0)-1. Is 44 a factor of 5/(-80)-4 - x/(-16)? False Suppose -7g + 2900 + 3554 = 0. Does 49 divide g + 6 + (3 - 0)? True Suppose 2r = -5s + 266, 4r + 144 = 3s - 0r. Suppose -2v + s = 288. Let w = v - -205. Does 14 divide w? False Suppose -10b + 574 + 556 = 0. Let h = 63 + b. Is h a multiple of 16? True Let w(i) be the third derivative of i*5/2 - 11i*4/24 + 47i*3/6 - 19i*2. Is w(4) a multiple of 23? True Suppose 3n - 2q + 14 = 0, 2n = 3q - 9 - 2. Let f be 1/n + 9/4. Is 6 a factor of (f - 26)1/(-2)? True Suppose -a = 3m - 4820, 5m - 8020 = 7a - 6a. Suppose s + m = 5b, 2b - 5s - 243 - 376 = 0. Is b a multiple of 14? True Suppose 0 = 2k - 34 + 22. Suppose -188 = -km + 70. Let y = m - 6. Is 19 a factor of y? False Suppose -4l + 3 = 3a, 0l = 3l. Let r(f) = 48f + 1. Let v(m) = -95m - 3. Let b(t) = 9r(t) + 4v(t). Does 6 divide b(a)? False Let d(f) = 14f - 1. Let p be d(-4). Let s(w) = -w*3 - 12w*2 + 21w - 5. Let k be s(-14). Let c = k + p. Is c a multiple of 9? True Let l(k) = -8k - 47k - 376 + 78k. Is 19 a factor of l(18)? True Suppose -13556u + 2149016 = -13497u. Is u a multiple of 6? False Suppose -68828 = -5s - 4y, 5y = -0 + 10. Is 74 a factor of s? True Suppose -4c + 3 + 17 = 0. Let n = c + -3. Is n/(-5) - (-322)/204 a multiple of 16? True Suppose 2o - 1393 = -5u, -4o + 3570 = o - 5u. Let q = o - 208. Does 46 divide q? False Let u(n) = 781n2 + 146n - 447. Is 9 a factor of u(3)? True Suppose -392 = -2l + 164. Let x = 680 - l. Is 31 a factor of x? False Let f = -16607 + 22979. Is f a multiple of 236? True Let q = -89 + -27. Let y = q - -284. Is y a multiple of 28? True Suppose 0 = s + 15 - 13. Let m(v) = -v2 + 1. Let b(i) = i2 - 2i + 22. Let t(a) = sm(a) - b(a). Is t(10) a multiple of 24? True Suppose m = 5f - 8, -3f + 5 + 11 = 5m. Suppose 66 = fs - 80. Suppose q = s + 5. Is q a multiple of 39? True Suppose -34g = -36g + 1516. Suppose -g = -27q + 835. Is 3 a factor of q? False Is 8/22 - (-310)/55 - -2697 a multiple of 51? True Let j = -3898 - -8840. Is j a multiple of 28? False Let i(q) = q*3 - 7q*2 - 9q - 21. Let g = -56 + 66. Does 27 divide i(g)? True Suppose -4j = 4b + 2060, 2j + 2j = 5b - 2096. Is 8 a factor of (4 - 25)/3 - j? True Let z = -786 + 1353. Suppose 8q - 729 = z. Is 9 a factor of q? True Let j be (7 + -4)5/((-10)/4). Is 9 a factor of 14/j - -2 - (-196)/21? True Suppose -t = 4i - 35868, t = 4i + 3t - 35864. Is i a multiple of 76? True L	{ "pile_set_name": "DM Mathematics" }
13 Let a(m) be the first derivative of 1/9m2 - 1/18m*4 + 0m - 292 - 1/45m5 + 1/27m3. Find f, given that a(f) = 0. -2, -1, 0, 1 Let o(u) be the third derivative of u7/420 + u*6/80 - 4u*5/15 + 5u*4/4 - 8u*3/3 - 61u*2 - 10u. Factor o(j). (j - 2)*2(j - 1)(j + 8)/2 Let b(t) be the second derivative of 3t*4/20 + 124t*3/5 - 249t*2/10 + 4492t. Factor b(y). 3(y + 83)(3y - 1)/5 Let t = 20 - 92/5. Let n(r) = 519r + 2081. Let m be n(-4). What is l in -16/5lm - tl - 114/5l3 + 76/5l*4 + 0 + 56/5l*2 = 0? 0, 1/4, 1/2, 2 Factor 392/9 + 242/9d*3 + 11770/9d*2 - 4304/9d. 2(d + 49)(11d - 2)2/9 Let z(n) be the second derivative of -1/100n*5 + 1/210n*7 + 4 + 7n + 0n6 + 0n*3 + 0n*4 + 0n*2. Find f, given that z(f) = 0. -1, 0, 1 Let i = 1418/7 + -202. Factor -2/7l*2 - 2/7l + i. -2(l - 1)(l + 2)/7 Let d be -6 + 2 + 6 - 0. Factor dl - 988l2 + l3 + l + 991l2 + 1. (l + 1)3 Let v = -138 + 144. Factor -20u*3 - 7u*4 - 2u*2 + vu*4 + 25u*3 - 8u. -u(u - 4)(u - 2)(u + 1) Let j(d) be the second derivative of -d7/21 - 406d*6/15 - 5508d*5 - 419175d*4 - 820125d*3 - 185d - 5. Solve j(w) = 0 for w. -135, -1, 0 Suppose -6720/11g - 8g*2 + 28800/11 + 2/11g*4 + 56/11g3 = 0. What is g? -20, 6 Let u(g) = g5 + g*3 - 2g*2 - g. Let y(h) = -4h - 6h5 + 12h*4 + 6 - 10 + 2h*5 + 8h*2. Let j(n) = -8u(n) - y(n). Factor j(d). -4(d - 1)(d + 1)*4 Let f(a) be the first derivative of -52/3a - 76/3a2 - 68 + 4/3a*3. Factor f(g). 4(g - 13)(3g + 1)/3 Let u(o) be the third derivative of o*5/12 + 35o*4/8 - 115o*3/3 - 1097o*2. Let u(s) = 0. What is s? -23, 2 What is l in 58/3 + 172/9l - 2/9l2 = 0? -1, 87 Let u = -41195 - -3831049/93. Let d = u + 70/31. What is k in -10k - 32/3k5 + 62/3k*3 - 44/3k*2 + 16k*4 - d = 0? -1, -1/4, 1, 2 Let u = -6560446/7 - -937282. Solve -1362944/7 - uo*2 + 2/7o*3 + 46464/7o = 0. 88 Let w = 172 - 172. Suppose -15 = -3a + 5d, 4a - a - 2d - 6 = w. Solve -4/7v3 + 4/7v + 0 + av2 = 0 for v. -1, 0, 1 Suppose m = -f + 2f - 25, 5f - 67 = 3m. Let w = 31 + m. Let 24 + 20d3 + 23d*2 - 9d*w - 18d*3 + 32d = 0. Calculate d. -3, -2 Find m, given that -369m3 + 166m*4 - 56m*4 - 58m*4 - 49m4 = 0. 0, 123 Let g(q) be the first derivative of q4/2 - 70q3/3 + 392q*2 - 2744q - 628. Find m, given that g(m) = 0. 7, 14 Factor 35v3 - 14v*4 - 75v*2 - 235115v*5 + 49v*4 + 235120v*5. 5v*2(v - 1)(v + 3)(v + 5) Let c = -1677 - -2962. Let f = -1282 + c. Factor 7/5v4 - 23/5v*f - 22/5v*2 + 0 + 8/5v. v(v - 4)(v + 1)(7v - 2)/5 Let v(w) be the second derivative of -2704/7w2 + 166w - 1/105w6 - 51/35w*5 - 2497/42w*4 + 1768/7w*3 + 0. Factor v(h). -2(h - 1)*2(h + 52)*2/7 Let u(a) be the first derivative of 5a*4/8 + 11a3/6 - a2/2 - 4a + 573. Find q, given that u(q) = 0. -2, -1, 4/5 Let w(p) = 4p*3 + 24p*2 - 10p - 21. Let n(v) = 11v3 + 70v*2 - 27v - 62. Let t(g) = -3n(g) + 8w(g). Factor t(b). -(b - 1)(b + 1)(b + 18) Let s(f) be the third derivative of -f*8/1680 - 24f*7/175 - 5597f*6/600 - 989f*5/10 - 1587f*4/5 + 3241f*2. Determine h so that s(h) = 0. -69, -4, -2, 0 Let h(b) be the first derivative of 12b + 1085b3 - 276 + 192b*2 + 2883/4b*4. Factor h(d). 3(d + 1)(31d + 2)*2 Let t be -64 + (-16371)/(-4080)16. Factor -20y - ty2 - 500. -(y + 50)2/5 Let c(m) be the second derivative of 2m - 1/120m*6 - 9/80m*5 - 9/4m*2 - 9 - 13/8m*3 - 29/48m*4. Factor c(y). -(y + 1)(y + 2)(y + 3)2/4 Let q(z) be the second derivative of -8/33z*4 + 0z*2 + 0 - 3/110z*5 + 1/33z*7 + 47z + 16/165z6 - 4/33z*3. Solve q(l) = 0. -2, -1, -2/7, 0, 1 Suppose 2t + 47 = -5w, -4t - 5w = 78 - 39. Factor -16838/13y*3 - 50/13y*5 + 52294/13y*2 + 10648/13 + 1610/13y*t + 3872y. -2(y - 11)3(5y + 2)2/13 Let d(a) be the second derivative of -65a + 0 - 3/5a2 + 1/20a*4 + 1/10a*3. Factor d(c). 3(c - 1)(c + 2)/5 Factor -63v*4 + 2592 - 77v*2 + 38v*4 - 28v*3 + 35v*4 - 355v2 + v5 - 432v + 4v*3. (v - 6)(v - 2)(v + 6)3 Let g = 94 - 82. Suppose 0 = 3p - 4i - 6, i + 8 = -8p + gp. Factor 5/3 - 10k + 40/3kp. 5(2k - 1)(4k - 1)/3 Let a(r) be the first derivative of -2r*5/5 - 21r*4/2 + 140r*3/3 - 48r*2 + 608. Factor a(l). -2l(l - 2)(l - 1)(l + 24) Let p(a) = a2 + 26a + 177. Let l be p(-13). Factor -lu + 241u*2 + 234u*2 - 474u2 + 16. (u - 4)2 Let x = -1059805/4 - -265066. Factor 3/4m3 + xm - 117/2m2 - 57. 3(m - 76)(m - 1)2/4 Let a(l) = l3 + 38l*2 + 41l + 144. Let r be a(-37). Let u be ((-56)/(-98))/(r/(-14)). Factor 1/2g + 0 - 3/2g*3 + ug*5 - 2g4 + g2. g(g - 1)2(2g + 1)2/2 Let a(d) be the first derivative of 1/7d*2 - 2/7d + 2/21d3 - 1/14d*4 - 13. Factor a(r). -2(r - 1)*2(r + 1)/7 Suppose 1689/4g + 3/4g*2 + 0 = 0. Calculate g. -563, 0 Determine x so that 23x*4 + 535x*3 - 660x*3 - 282x + 22x4 + 16x*2 - 5x*5 + 119x*2 + 232x = 0. 0, 1, 2, 5 Let r = -36590 + 73185/2. Find o, given that 1/2o4 + 0 + 0o + 2o2 + ro*3 = 0. -4, -1, 0 Find m such that 30/11m*4 + 0 - 30/11m*2 + 32/11m + 2/11m5 - 34/11m3 = 0. -16, -1, 0, 1 Let y(g) be the first derivative of -g4/16 - 7g3/2 - 60g*2 - 200g + 789. Factor y(m). -(m + 2)(m + 20)2/4 Factor -154/3y - 32/3y2 + 2/3y*3 - 40. 2(y - 20)(y + 1)(y + 3)/3 Let w(p) = 668p - 6678. Let h be w(10). Factor -2704/5 - 1/5v*h - 104/5v. -(v + 52)*2/5 Let f(k) = -21k*4 + 78k*3 + 52k*2 - 33k. Let d(s) = 10s4 - 38s*3 - 25s*2 + 17s. Let h(u) = -14d(u) - 6f(u). Suppose h(p) = 0. Calculate p. -1, 0, 4/7, 5 Let w = 2345/7039 + 4/21117. Factor 1/3 - 4/3n3 + 2n*2 - 4/3n + wn4. (n - 1)4/3 Let i(y) = y3 + 31y*2 - 2y - 7. Let x be i(-31). What is a in -2a + xa*2 - 1 + 57a*2 - 113a*2 = 0? -1 Suppose -4z + 0z = -2a - 16, a = -4z + 10. Determine w so that 5w*z + 4w*5 + 0w3 - w3 + 8w4 = 0. -1, 0 Suppose 0 = -8555d + 7743d + 3248. Solve -1 - 3/2c*3 + 31/8c*2 - 3/4c - 5/8cd = 0. -4, -2/5, 1 Let a be (11 + -11)(14/4 - 2)/3. Let u(b) be the second derivative of -1/14b4 + a + 1/14b*3 + 3/7b*2 - 3b - 3/140b5. Factor u(r). -3(r - 1)(r + 1)(r + 2)/7 Let i(y) = -y4 - y3 + y + 1. Let a(n) = -8n4 - 60n*3 - 132n*2 + 4n + 4. Let c(x) = a(x) - 4i(x). Suppose c(f) = 0. What is f? -11, -3, 0 Factor 54415 + 29020 + 174097c + 907c2 + 5c*3 - 13497 - 1003c*2 - 1772c2. (c - 187)2(5c + 2) Suppose 2k - 8 + 4 = 0. Determine s, given that -298s + 287s - 3s*2 + 4s*k - 12 = 0. -1, 12 Let h = 14830 - 14828. Suppose -4x + 0x = -p - 57, 0 = -x - 4p + 27. Suppose -11ih - 5i*3 - x - 27i*2 + 13i*2 - 35i = 0. Calculate i. -3, -1 Suppose 44 = -3c - 2b, 0 = -2b + 6b + 16. Let m be ((-12)/9)/(8/c). Factor 802 - 2xm + 18x - 802. -2x(x - 9) Suppose -2/13p2 + 0 - 106/13p = 0. What is p? -53, 0 Factor 2/11s3 - 120/11s + 34/11s2 + 0. 2s(s - 3)(s + 20)/11 Let o = 3707 - 3707. Let y(k) be the third derivative of 1/15k5 + 0k*4 + ok*6 - 1/3k*3 + 12k*2 + 0 + 0k - 1/105k7. Solve y(d) = 0 for d. -1, 1 Let o(x) be the third derivative of -1/12x*5 + 0x + 0 + 71x2 + 0x*3 + 5/6x*4. Factor o(u). -5u(u - 4) Let a(m) be the third derivative of 0m + 1/12m5 + 5m*2 + 0 + 25/3m*3 - 55/24m*4. Suppose a(o) = 0. Calculate o. 1, 10 Factor -5609 - 89u + 5189 - 15u - 4u*2. -4(u + 5)(u + 21) Let w(o) be the second derivative of -o5/50 - 37o*4/3 - 11284o*3/5 + 69192o2/5 + o - 137. Find p such that w(p) = 0. -186, 2 What is q in q2 - 4 + 1/7q3 - 4/7q = 0? -7, -2, 2 Let a(m) = -3m2 + 300m - 684. Let i(c) = c - 10. Let p(l) = a(l) - 12i(l). Factor p(f). -3(f - 94)(f - 2) Let r be (-90)/14273/(-130). Let 3/4g2 + r - 33/4g = 0. Calculate g. 2, 9 Factor 294 - 146f - 1/2f*2. -(f - 2)(f + 294)/2 Determine v, given that 41/2v2 - 3 + 4v*3 - 43/2v = 0. -6, -1/8, 1 Let w be (7(-76)/28)/(-3). Let n(x) be the third derivative of -11x*2 + 13/5x*5 - wx*4 + 8x*3 + 1/21x*7 - 11/20x*6 + 0x + 0. Fact	{ "pile_set_name": "DM Mathematics" }
4 + 12 = 0. Let u be (r/(-12))/((-2)/3). List the prime factors of (10/(-25))/(u/(-55)). 2, 11 Suppose 5b + 4n + 4 = 31, b = -2n + 9. Let u be 7/((-21)/(-18)) - b. Suppose 13 + 23 = uj. What are the prime factors of j? 2, 3 Suppose 29c + 136 = 27c. Let d = 78 + c. List the prime factors of d. 2, 5 Suppose 0 = n - 3n - 38. Let o = n - -26. Suppose 4v + p + 142 = ov, 93 = 2v + p. List the prime factors of v. 47 Let d = 18 - 24. What are the prime factors of (-28)/(-8) + d/(-4)? 5 Suppose -4096 = -u - 2469. List the prime factors of u. 1627 Let m(a) = 54a. Let k be m(-1). What are the prime factors of (1 - 0)/((-2)/k)? 3 Let x(v) = 12v*2 + 2. Let r be x(-2). Let s be 1r + 2 + 1. Suppose -3j + 1 + s = 0. List the prime factors of j. 2, 3 Let n(k) = -17k + 495. List the prime factors of n(-36). 3, 41 Suppose -2k - 1 = -0h + 3h, -5h - k + 10 = 0. Suppose 23 = ho - 79. List the prime factors of o. 2, 17 Suppose -4h + 4v = -0v - 704, h + 5v - 146 = 0. List the prime factors of h. 3, 19 Let i(k) = 24k + 39. List the prime factors of i(4). 3, 5 Suppose -70t = -69t. Suppose -s + 22 = -w + 4w, -s + 4w + 1 = 0. Suppose -3a + s + 38 = t. List the prime factors of a. 17 Suppose -12f = -2345 - 9907. List the prime factors of f. 1021 Let k = 773 + -765. Let g = -19 + 34. Let s = g - k. List the prime factors of s. 7 Suppose z + 5y = 199, -y + 6y = -5. List the prime factors of z. 2, 3, 17 Suppose 13r - 13300 = 28183. List the prime factors of r. 3191 What are the prime factors of (-3 - 8)(-229 + 6 - 2)? 3, 5, 11 Let u(n) = -n*3 - 17n*2 - 3n + 16. Suppose -5j - 196 = 2j. Let h = 11 + j. List the prime factors of u(h). 67 Let d be (3 - (-9)/(-6))2. Suppose v + dj = 1, 4v - 28 = -j + 9. Suppose 5o + 0o = v. List the prime factors of o. 2 Suppose -2d - 102 = -3d. Suppose 3q = d - 12. Suppose -4p = -202 - q. List the prime factors of p. 2, 29 Suppose -6m + 25 = 73. Let k(s) = -3s3 + 3s*2 + s + 4. Let j be k(3). Let c = m - j. What are the prime factors of c? 3, 13 Let p(d) = -8d - 6. Let s be 0(15/6 - 3). Suppose -2z + 6z + 44 = 4w, s = -4z + 5w - 49. List the prime factors of p(z). 2, 3, 7 Let m = -5670 - -10097. What are the prime factors of m? 19, 233 Let o = 556 - 319. What are the prime factors of o? 3, 79 Let p be 19/57 - (-2)/(-6). Suppose -65 = -d - 2k, p = -3d + 2k + 356 - 121. What are the prime factors of d? 3, 5 Let p(a) = 89a*2 + 5a + 4. Let j be p(-2). Suppose 3k = k + j. What are the prime factors of k? 5, 7 Let n = -78 - 0. Let l = n - -135. Suppose b = x - 9 - 0, 5x - b - l = 0. List the prime factors of x. 2, 3 Suppose 0 = a - 4, 0 = -4m + m + a + 791. List the prime factors of m. 5, 53 Let b(t) = -2t*3 - 4t*2 + t. What are the prime factors of b(-7)? 3, 7, 23 Suppose -4o = 18n - 15n - 2829, 0 = -5o + 5n + 3510. What are the prime factors of o? 3, 5, 47 Let k(c) be the second derivative of -c*4/12 + 5c3/6 + c2 + c. Let z be k(6). Let x(m) = m*3 + 6m*2 + 4m + 1. List the prime factors of x(z). 17 Let m = -221 - -357. Let u = m + -73. List the prime factors of u. 3, 7 What are the prime factors of (-6184)/(-11) + (-6)/33? 2, 281 Let p(k) = -k2. Let n(x) = x3 - 3x2 + 8x + 2. Let b(q) = n(q) + 4p(q). What are the prime factors of b(6)? 2, 7 Let b(q) = -12q*3 + 2q*2 + q + 2. Suppose 3g + 0g = h - 4, -4 = -g + 3h. List the prime factors of b(g). 2, 13 Suppose -6n + 963 = -2n + 3m, 3n - 744 = 5m. What are the prime factors of n? 3 Let y(x) = 97x*2 - 4x + 2. What are the prime factors of y(2)? 2, 191 Let n = 23 - 28. Let c(r) = -9r + 9. What are the prime factors of c(n)? 2, 3 Suppose 9 = 5j - 6. Suppose -588 = -js - 177. List the prime factors of s. 137 What are the prime factors of 3/(-4)(-4442 - 130)? 3, 127 List the prime factors of (4 - 3)/((-6)/(-3732)). 2, 311 Let n(w) = -6 + 8w - 2w*2 + 13w2 - 2 + w3. Let x = 22 + -32. List the prime factors of n(x). 2, 3 Let l(a) = -15a + 1. Let k(h) = -30h + 1. Let r(x) = 4k(x) - 7l(x). List the prime factors of r(-3). 2, 3, 7 Suppose 0 = -67x + 16796 + 39149. List the prime factors of x. 5, 167 Suppose 15 = -50q + 55q. Suppose -4w = -qo + 136 + 112, 4o - 356 = -w. List the prime factors of o. 2, 11 Let z(u) = -42u + 580. Let h be z(13). Let r = -6 + 13. Let f = r + h. List the prime factors of f. 41 Let p = 36 - 23. Let c be (13/(-6))/(p/(-78)). Let o = c + 4. What are the prime factors of o? 17 Suppose 55 = -5p + 4p. Let u be (p/(-4))/(16/128). Suppose -3l + u = -l. What are the prime factors of l? 5, 11 Suppose 13m - 83 = 34. Suppose -750 = -v - mv. What are the prime factors of v? 3, 5 Let x = -30 - -93. Let f = x - 60. List the prime factors of f. 3 Suppose -3g + 384 = -207. What are the prime factors of g? 197 What are the prime factors of 4/8(3 - -7) - -937? 2, 3, 157 Suppose -6r + 15 = -3r. Suppose 4x = rx - 2. What are the prime factors of ((-34)/3)/(x/(-3))? 17 Let a(i) = i*3 + 3i2 - i + 4. Let x be a(-4). Let b(f) = f3 + 7f2 - 11f - 9. What are the prime factors of b(x)? 3, 5 Let m(a) = 9a2 + 2a - 2. Let q be m(1). List the prime factors of 44 - (-3)/q-3. 43 Suppose 26b - 24b - 8 = 0. Let j be (-5 - b/(-1))10. Let w = j + 35. List the prime factors of w. 5 Let g = 16 - -9. What are the prime factors of 730/6 - g/(-75)? 2, 61 List the prime factors of (-3 - (-55)/20) + (-31854)/(-24). 1327 Suppose 3a + 42 - 39 = 0. List the prime factors of 3385/15 - a/3. 2, 113 Let g = 1474 - 1045. What are the prime factors of g? 3, 11, 13 Let k be ((-5)/3)/(6/108). Let t = k + 79. List the prime factors of t. 7 Suppose -3g - 219 = -q, q = 5 - 2. What are the prime factors of 1 + ((-10)/(-4))/((-4)/g)? 2, 23 Let n(s) = -6 + 7s - 2 + 2. List the prime factors of n(5). 29 Suppose 0 = 2g + 5s + 4540, 3g - 4s + 1042 = -5722. What are the prime factors of (-15)/(-6) + -3 - g/8? 2, 3, 47 List the prime factors of (21/(-35))/(2/(-20)). 2, 3 Let d = -2 - -5. Suppose do - 9 = -4r, 6r = 2o + r - 6. Suppose 2s = 3l - 6, 2 = -ol - 3s + 23. What are the prime factors of l? 2 Let w = 2759 + -1647. List the prime factors of w. 2, 139 Let d(h) = h3 - 2h*2 - 2h - 3. Let n be d(3). Let a be (-1 + n)(13 - -4). Let s = a - -39. List the prime factors of s. 2, 11 Let l = 3897 + -2734. List the prime factors of l. 1163 List the prime factors of 10 - (0 - 0 - (5 + 0)). 3, 5 Let q(i) = -109i - 7. Let v be q(11). What are the prime factors of (v/36)/(2/(-4))? 67 Let k(o) = 52o3 + o2 + 1. Let g be k(1). Let r = -40 + g. List the prime factors of r. 2, 7 Let g = -105 - -107. Let u be 670/8 + (-2)/(-8). Suppose -3h = 4j - u, -gh + 0j = 5j - 49. What are the prime factors of h? 2 Let b = -16 - -19. Let t be b/(-9) + (-488)/(-6). Suppose 75 + t = 4u. What are the prime factors of u? 3, 13 Suppose -11v - 5136 = -23v. List the prime factors of v. 2, 107 Let w(z) = z3 + 10z*2 - 10z + 14. Let r be w(-11). Suppose -71 = -rp + 94. List the prime factors of p. 5, 11 Let v be (3/9)/((-6)/(-36)). Suppose -61 = -4j - 3p, -3 - 25 = -vj - 4p. What are the prime factors of j? 2 Suppose 100k = 84k + 25744. What are the prime factors of k? 1609 Let s(h) = h2 - 2h + 2. Let c be s(2). Suppose -cq - 2z + 7z - 16 = 0, 0 = 3z - 6. List the prime factors of (-93)/9q - 1. 2, 3, 5 Let c = -163 - -145. List the prime factors of (-942)/(-4)(-12)/c. 157 Let i = 167 + -32. Let w = i - -45. Suppose 4j - 8j = -w. List the prime factors of j. 3, 5 Let p(h) = -38 - 1 + 0 + 4h. List the prime factors of p(17). 29 Let n(m) = -7m - 54. Let i be n(-8). Suppose -iz + 183 = -177. What are the prime factors of z? 2, 3, 5 Let w = -35 - -57. Let l(a) = -a2 + 26a - 55. What are the prime factors of l(w)? 3, 11 Let n = -135 + 135. Suppose n = 4w - 4m - 28, -2w + 4m + 40 = 3w. What are the prime factors of w? 2, 3 Suppose 4b + 61r = 60r + 3059, 5r + 749 = b. What are the prime factors of b? 2, 191 Let r(j) = -2j*3 + 2j*2 + 2j. Let o be r(2). Suppose 5p + 28 = 3y, -y + 10 = -5p + 4. List the prime factors of o/22 - (-420)/y. 2, 19 What are the prime factors of 862/510/4? 431 List the prime factors of 4337 + -2(-40)/20. 5, 607 Let l(s) =	{ "pile_set_name": "DM Mathematics" }
is prob of picking 2 x and 1 d? 1/204 Calculate prob of picking 2 m when two letters picked without replacement from mmooommm. 5/14 Calculate prob of picking 1 f and 2 n when three letters picked without replacement from {n: 4, o: 3, t: 1, f: 3}. 6/55 Two letters picked without replacement from jzjofqqz. Give prob of picking 1 z and 1 q. 1/7 Four letters picked without replacement from pzrpptrtpztgrt. What is prob of picking 1 r, 1 g, and 2 p? 18/1001 Four letters picked without replacement from uddsajjdduud. What is prob of picking 2 u and 2 d? 2/33 Three letters picked without replacement from spppreetett. What is prob of picking 1 p, 1 e, and 1 s? 3/55 Two letters picked without replacement from wjfcqccwfqqcwkkj. What is prob of picking 1 w and 1 k? 1/20 Calculate prob of picking 1 v, 1 b, and 1 e when three letters picked without replacement from {e: 4, c: 1, i: 1, v: 1, b: 5}. 1/11 What is prob of picking 2 f and 2 w when four letters picked without replacement from {f: 1, w: 3, e: 1, h: 2, g: 3}? 0 Calculate prob of picking 2 x and 1 z when three letters picked without replacement from {e: 2, x: 2, m: 2, z: 4}. 1/30 Three letters picked without replacement from {g: 2, p: 4, m: 3, b: 1}. What is prob of picking 2 p and 1 g? 1/10 What is prob of picking 4 f when four letters picked without replacement from ffoffofossssffso? 1/52 Calculate prob of picking 1 r, 1 t, 1 m, and 1 d when four letters picked without replacement from {d: 4, r: 1, t: 1, u: 1, m: 2}. 4/63 Four letters picked without replacement from nnnjnxnqq. Give prob of picking 1 x, 2 q, and 1 j. 1/126 Four letters picked without replacement from dddupddbdupdddpuaud. What is prob of picking 1 a, 1 u, 1 p, and 1 b? 1/323 Calculate prob of picking 1 h, 2 y, and 1 v when four letters picked without replacement from yggvygyygghgg. 6/715 Four letters picked without replacement from {r: 5, t: 4, b: 6, s: 5}. What is prob of picking 4 t? 1/4845 Three letters picked without replacement from vixixxiiivvixcxxx. Give prob of picking 1 v, 1 x, and 1 i. 63/340 Three letters picked without replacement from {t: 3, d: 3, u: 1, m: 5}. Give prob of picking 1 d, 1 m, and 1 u. 3/44 Two letters picked without replacement from {a: 6, p: 2, d: 1, m: 5, e: 5}. What is prob of picking 1 e and 1 d? 5/171 What is prob of picking 2 m, 1 b, and 1 j when four letters picked without replacement from mmjjmmbmjjm? 2/11 Calculate prob of picking 2 n when two letters picked without replacement from {c: 1, n: 2, p: 1, q: 1}. 1/10 Calculate prob of picking 1 d and 2 x when three letters picked without replacement from vdxxxddddduxxdxx. 21/80 Two letters picked without replacement from lhlhxxxl. What is prob of picking 1 h and 1 x? 3/14 Three letters picked without replacement from {w: 5, e: 2, s: 2, j: 5, m: 1, r: 2}. What is prob of picking 1 s, 1 e, and 1 w? 1/34 What is prob of picking 3 w when three letters picked without replacement from {t: 1, w: 3, g: 4}? 1/56 Four letters picked without replacement from ytsttytytsysys. Give prob of picking 3 t and 1 s. 40/1001 Two letters picked without replacement from aaccccccccccacacccc. Give prob of picking 2 c. 35/57 Two letters picked without replacement from nxxxxxxsyyns. What is prob of picking 2 s? 1/66 Two letters picked without replacement from uozuzozzzpoptzzuop. What is prob of picking 2 p? 1/51 What is prob of picking 2 f and 1 s when three letters picked without replacement from svsvsfvfvsvsss? 1/52 Calculate prob of picking 2 s when two letters picked without replacement from {s: 7, d: 2, o: 2}. 21/55 Four letters picked without replacement from {p: 8, v: 1, t: 4}. Give prob of picking 2 t, 1 v, and 1 p. 48/715 Four letters picked without replacement from {n: 9, a: 1, l: 9}. What is prob of picking 3 n and 1 a? 7/323 Three letters picked without replacement from {r: 1, q: 4, f: 2, o: 2}. Give prob of picking 2 f and 1 q. 1/21 Calculate prob of picking 1 y and 1 r when two letters picked without replacement from qbrypbbuqbybyqyb. 1/30 What is prob of picking 1 f, 1 n, and 1 t when three letters picked without replacement from {b: 2, n: 2, t: 8, f: 1}? 8/143 What is prob of picking 1 w and 2 x when three letters picked without replacement from {w: 5, x: 2}? 1/7 Three letters picked without replacement from {b: 1, j: 2, u: 1, o: 2, f: 1}. What is prob of picking 2 o and 1 j? 2/35 Four letters picked without replacement from clclclcclclc. What is prob of picking 4 c? 7/99 What is prob of picking 1 x and 2 a when three letters picked without replacement from {k: 3, r: 10, a: 2, x: 3}? 1/272 Calculate prob of picking 3 v and 1 q when four letters picked without replacement from vrqvv. 1/5 Two letters picked without replacement from kwznnk. Give prob of picking 1 k and 1 w. 2/15 Calculate prob of picking 2 b when two letters picked without replacement from {m: 5, z: 1, b: 3}. 1/12 Calculate prob of picking 1 x and 1 v when two letters picked without replacement from xxovoxlvnloxxonxox. 14/153 What is prob of picking 2 j and 2 k when four letters picked without replacement from {w: 2, k: 6, j: 5}? 30/143 Two letters picked without replacement from khvhhmaakh. Give prob of picking 1 h and 1 m. 4/45 Four letters picked without replacement from {d: 10, k: 1, o: 2, s: 3}. What is prob of picking 2 o, 1 d, and 1 s? 3/182 Three letters picked without replacement from zllzrzzzllz. Give prob of picking 1 z, 1 r, and 1 l. 8/55 Three letters picked without replacement from fctvctxtxttxttvx. What is prob of picking 1 f, 1 c, and 1 v? 1/140 Three letters picked without replacement from {y: 4, g: 2}. Give prob of picking 3 y. 1/5 What is prob of picking 3 o when three letters picked without replacement from {i: 1, o: 11, f: 6}? 55/272 What is prob of picking 1 r and 1 l when two letters picked without replacement from rplgplppplpig? 1/26 Two letters picked without replacement from jjjvbvmjvjmj. What is prob of picking 2 m? 1/66 What is prob of picking 2 b when two letters picked without replacement from bbybbbyyblbbyb? 36/91 Calculate prob of picking 3 x when three letters picked without replacement from qxxqxxxxxxxx. 6/11 Two letters picked without replacement from {t: 1, y: 2, z: 1, i: 4}. What is prob of picking 1 i and 1 z? 1/7 Calculate prob of picking 1 d and 1 x when two letters picked without replacement from vxhihduu. 1/28 Calculate prob of picking 1 v and 3 b when four letters picked without replacement from {b: 5, v: 7}. 14/99 Two letters picked without replacement from {v: 2, n: 2, k: 1, m: 5, g: 4}. Give prob of picking 1 k and 1 m. 5/91 Calculate prob of picking 1 u, 1 g, and 2 o when four letters picked without replacement from {o: 3, u: 1, g: 1}. 3/5 Calculate prob of picking 2 h when two letters picked without replacement from sfhiihiib. 1/36 Calculate prob of picking 2 d and 1 y when three letters picked without replacement from {d: 2, y: 1, j: 1, p: 1}. 1/10 Calculate prob of picking 1 y, 1 i, and 1 f when three letters picked without replacement from zyiilrifllzziz. 1/91 Two letters picked without replacement from cuclwlcucwcll. Give prob of picking 1 l and 1 w. 4/39 What is prob of picking 4 q when four letters picked without replacement from pqqqnnnnnnnnnq? 1/1001 Three letters picked without replacement from {t: 1, u: 2, i: 4, o: 3, z: 1}. Give prob of picking 1 u and 2 o. 2/55 Two letters picked without replacement from fiqec. Give prob of picking 1 c and 1 q. 1/10 Three letters picked without replacement from eyusiisyeiiuiuye. Give prob of picking 1 y and 2 u. 9/560 Calculate prob of picking 1 y and 2 z when three letters picked without replacement from tztpwyttttzzzwt. 6/455 Four letters picked without replacement from {w: 10, i: 4}. Give prob of picking 2 i and 2 w. 270/1001 What is prob of picking 1 g and 1 a when two letters picked without replacement from seasasaasxagsasex? 3/68 What is prob of picking 1 c and 1 q when two letters picked without replacement from qqaaoqociiqoqqi? 2/35 What is prob of picking 3 j and 1 i when four letters picked without replacement from addpjpddajaaddaiajad? 1/4845 What is prob of picking 2 k, 1 u, and 1 i when four letters picked without replacement from ikuououikokiuik? 32/455 Calculate prob of picking 2 h and 1	{ "pile_set_name": "DM Mathematics" }
lse Is 4391581 composite? True Is 34626343 prime? True Is 11797901 a composite number? False Is 19442717 a prime number? False Is 475291397 a composite number? True Is 619369 composite? True Is 239953405 a composite number? True Is 2219513 composite? False Is 306429821 a composite number? False Is 20939329 prime? True Is 31931059 prime? False Is 234085 a composite number? True Is 9823963 a prime number? False Is 1483903 a prime number? True Is 18827759 prime? True Is 58133221 prime? True Is 113156921 prime? True Is 37282771 a prime number? True Is 3657827 a composite number? False Is 3584759 a composite number? False Is 233823145 a prime number? False Is 29464217 composite? False Is 565399 a prime number? False Is 21523443 a prime number? False Is 123715105 prime? False Is 196969 a composite number? True Is 48293051 composite? False Is 43778981 a composite number? False Is 94439119 a prime number? True Is 99301963 prime? True Is 993477791 a composite number? False Is 171012157 a composite number? False Is 10690177 a prime number? True Is 2374483 a composite number? False Is 87884083 prime? False Is 414994963 a composite number? False Is 26643423 prime? False Is 25750009 a composite number? True Is 10152173 a composite number? False Is 344986753 a composite number? False Is 1202143 composite? True Is 6678898 composite? True Is 3643 a prime number? True Is 311622959 a composite number? False Is 535333361 a composite number? False Is 41421397 prime? False Is 11501261 composite? False Is 70542611 a composite number? True Is 27413087 prime? False Is 16887931 prime? True Is 9502937 prime? True Is 26003767 prime? True Is 789491 prime? True Is 326388191 composite? True Is 24771953 prime? False Is 4779013 prime? False Is 6751487 a prime number? True Is 5491909 a composite number? True Is 4975253 prime? True Is 305959741 prime? True Is 138316127 a prime number? False Is 7938149 a composite number? False Is 301778683 prime? True Is 103114897 composite? True Is 45402527 a composite number? True Is 5045029 a prime number? False Is 288632143 prime? False Is 8133989 a prime number? True Is 2469314 prime? False Is 88895809 a prime number? False Is 81925619 a composite number? False Is 8217917 composite? True Is 30257363 a prime number? False Is 60665219 a composite number? False Is 7592729 a composite number? False Is 12605843 prime? False Is 236721647 prime? False Is 9921383 a composite number? False Is 16745033 composite? False Is 33522466 prime? False Is 445363 prime? True Is 1772977219 composite? True Is 86994917 a prime number? True Is 109958663 a prime number? True Is 50748265 prime? False Is 1109653 a prime number? True Is 2822383 a composite number? True Is 2613515 a prime number? False Is 145886109 composite? True Is 4970893 prime? False Is 3232013 a prime number? False Is 19119619 composite? True Is 4274789 composite? False Is 1445657 composite? False Is 11001539 a prime number? True Is 1485047 prime? True Is 118974406 a composite number? True Is 14292181 a composite number? True Is 272180131 a composite number? True Is 69528387 a prime number? False Is 42228829 a composite number? False Is 90977837 prime? True Is 16654699 a composite number? True Is 370187911 prime? False Is 323101 a composite number? False Is 5915397 a prime number? False Is 4580809 a prime number? True Is 345313 prime? False Is 1383649 composite? True Is 2104985 prime? False Is 47450111 a composite number? True Is 1344055 prime? False Is 290260289 composite? True Is 1343123 a prime number? False Is 10834783 prime? False Is 56326393 a prime number? False Is 128116685 a composite number? True Is 124897 prime? True Is 9174253 prime? False Is 13913503 a composite number? True Is 16480019 a prime number? True Is 259880339 composite? True Is 54949409 a prime number? False Is 7557281 composite? False Is 546067849 a composite number? True Is 128282027 a composite number? True Is 1034983 a prime number? True Is 520099 a prime number? False Is 249923521 a prime number? True Is 55886899 composite? False Is 4485451 composite? False Is 4011103 a prime number? True Is 44509471 a composite number? True Is 7162733 composite? False Is 70809001 prime? True Is 1956085 composite? True Is 3221287 a prime number? False Is 520573 a composite number? True Is 6539957 a prime number? True Is 206434 composite? True Is 81788585 prime? False Is 9600679 prime? False Is 111086727 a composite number? True Is 17124181 prime? False Is 389507 prime? True Is 6615943 a composite number? False Is 27917447 a prime number? True Is 1437811 composite? True Is 46909181 prime? False Is 1201663 prime? False Is 8295503 prime? True Is 422005 prime? False Is 23868241 prime? True Is 35750849 a composite number? False Is 137656437 prime? False Is 4197478 prime? False Is 43561703 a composite number? False Is 1050031 a composite number? False Is 27091921 a prime number? True Is 20375699 composite? False Is 35396027 composite? False Is 63368047 a composite number? True Is 28741327 prime? True Is 1063586 a prime number? False Is 27524361 prime? False Is 11179271 composite? False Is 27471805 a composite number? True Is 2232317 prime? True Is 3386527 composite? False Is 1478315 composite? True Is 5122833 composite? True Is 2395889 a composite number? False Is 60530387 a prime number? False Is 22559029 prime? True Is 32439997 a prime number? True Is 776370453 prime? False Is 1194043 composite? True Is 3618137 composite? False Is 12898651 a prime number? False Is 54676127 a composite number? True Is 6032186 a prime number? False Is 131457695 composite? True Is 41681 composite? False Is 9260453 prime? True Is 1075561 a composite number? False Is 1848323 prime? True Is 12198217 a composite number? False Is 7146371 a composite number? True Is 31172567 prime? False Is 1637725911 a prime number? False Is 7616027 prime? True Is 1668923 prime? False Is 1359867 prime? False Is 974707 a prime number? True Is 6273151 a prime number? True Is 111045577 a prime number? True Is 20935307 composite? False Is 20236181 a prime number? False Is 2287058 a composite number? True Is 10583497 a composite number? False Is 41391751 prime? False Is 12013009 a composite number? False Is 67818299 a composite number? True Is 43833683 a composite number? False Is 440598661 composite? True Is 1617283 composite? False Is 55562527 prime? False Is 1645301 composite? True Is 41222 prime? False Is 8916329 composite? False Is 542440651 composite? False Is 453829 prime? False Is 4087801 a prime number? True Is 1430441 prime? True Is 56230817 a prime number? True Is 17437447 a prime number? True Is 32576731 a prime number? False Is 3429697 prime? True Is 77790233 composite? False Is 24397907 prime? False Is 6274799 a composite number? False Is 159332171 prime? True Is 331601 a composite number? True Is 274706507 a composite number? False Is 4585619 composite? False Is 14326847 prime? True Is 347401 a composite number? False Is 98074997 prime? True Is 307990741 a prime number? False Is 4318637 prime? True Is 441778889 composite? False Is 7096377 prime? False Is 60535429 a prime number? False Is 183970145 composite? True Is 15425437 composite? False Is 100151651 a composite number? False Is 1155845 a prime number? False Is 14161999 composite? False Is 112103777 a composite number? True Is 8696755 a composite number? True Is 56853393 prime? False Is 131694977 prime? True Is 43081373 prime? False Is 10173313 a prime number? True Is 4786531 a composite number? True Is 20442557 a prime number? True Is 40287669 prime? False Is 2171003 a composite number? False Is 1797617 composite? False Is 16176449 composite? False Is 63828031 a prime number? True Is 99723233 composite? False Is 17112883 composite? False Is 53018459 a composite number? True Is 2414119 a composite number? True Is 6421911 composite? True Is 533443811 a composite number? False Is 1055207 a composite number? True Is 883537 a composite number? False Is 1417573 a prime number? True Is 4834201 prime? True Is 8014261 a composite number? False Is 2999893 prime? False Is 48283877 prime? False Is 234449 prime? False Is 15456923 composite? False Is 157989173 composite? False Is 18356207 prime? True Is 16130189 a composit	{ "pile_set_name": "DM Mathematics" }
72 + 20/3? 8 What is the value of 1430/66 - 33/9? 18 (-1517)/((-328)/(-8))(-2 - -1) 37 45/(-56) - 45/(-105) -3/8 (4/32 - (-6)/16)20/(-9) -10/9 (-1 - 10) + ((-5)/11)/(18/(-450)) 4/11 Evaluate -11 - (12/33)/(16/(-1672)). 27 (22/(-55))/(527/85) -2/31 Evaluate 507/(-234) + (-16)/(-10) + (-6)/(-15). -1/6 Calculate 2/8 + -1(536/(-32) - -4). 13 Calculate 10/(-6)(-35)/(875/10). 2/3 What is the value of ((-3)/7)/((-15974)/(-3260) - 6/15)? -2/21 What is the value of ((12/(-6))/(4 - 3))/(24 - 2)? -1/11 What is 370/(-3045) - 14/203? -4/21 What is the value of ((-392)/(-1176))/(1/(-6))? -2 What is 1 + ((-1750)/(-90))/(-25)? 2/9 Calculate ((-468)/(-90) - 5) + (-3)/802. 1/8 What is 7 + (1/(-15) - (-31)/15)? 9 Evaluate (-3)/((-15)/(-1) - (-5358)/(-423)). -9/7 What is the value of (370/(-1110))/((1/12)/(162/(-24)))? 27 What is the value of (31692/(-13205))/(1(-1 - 1))? 6/5 What is (10/(-36))/(540/432)? -2/9 Calculate ((-26894)/(-612) + -44)/(-1 + 7/9). 1/4 What is ((-11)/5 - 34/85)/((-6)/30)? 13 What is ((-66)/3522)/((-2)/48)? 9 Evaluate (50/(-3))/((-545)/(-654)). -20 Calculate (-60)/(-7650)349/4. 3/5 Evaluate 12 + 1581/(-136) + ((-236)/800 - 0). 2/25 Evaluate (-3 + -4 + 8)(-15)/(-20). 3/4 What is the value of (119/98 - (-6)/21)140/(-42)? -5 What is (20/(-90))/(1/18)? -4 Evaluate (-6)/(-9)162/2700. 1/25 Calculate 4/3 + (-2695)/105 + 24. -1/3 What is the value of ((-24)/1 - 228512/(-9843)) + (-4)/(-6)? -2/17 What is the value of (-1659)/(-63) - 28 - (-8)/6? -1/3 Evaluate (-1 - 1) + (-4 - -6)/((-6)/(-18)). 4 What is 2 - ((-16)/(-30))/(420/315)? 8/5 What is the value of 7 + (-15 - -14)11? -4 What is -5819/(-2755) - 2/9038? -4/9 Calculate (-22)/((-91)/(-7) - 11). -11 Evaluate (3/11)/((-4368)/(-4004)). 1/4 What is ((-133)/(-21) - 7)(-12 + (-12)/4)? 10 What is 4/(-28) - (11325/3045 - 4)? 4/29 Calculate ((-152)/(-22))/(-1) + -29 + (35 - -1). 1/11 What is the value of (-4 + 3139/803)/(2/46)? -1/33 Evaluate (2/(-6))/1308/(-112)12. 11 What is the value of (-35)/(-70)(-8 + 2)? -3 What is 517/(-564)(0 + ((-150)/(-5))/(-5))? 11/2 (-3)/6611(-1)/(-22)4 -1/11 (-5)/(-91) - (-462)/(-1617) -3/13 What is the value of -1((-6)/(-8) + 44/(-16))? 2 What is the value of ((-872)/72 - -12)(7 + (-430)/70)? -2/21 Calculate (-3)/10 - (-36941)/6970. 5 Evaluate ((-420)/75 - -7) + (1 - 98/(-5)). 22 What is the value of (20 + -19)(-9 + 2)? -7 What is (7 - 204/30)-1(-13 - -3)? 2 (-8)/(-108)3 - 8/(72/5) -1/3 Evaluate (-354)/20 - (-699)/(-2330). -18 What is the value of (-6)/11 - 2216/(-3047)? 2/11 What is the value of (-85)/(-120) - (-110)/264? 9/8 ((-4)/68)/(157/(-61387)) 23 588/1617 + ((-24)/(-198))/((-4)/(-186)) 6 Calculate 4 - (-144)/(-171) - (-30)/(-190). 3 Evaluate (-3379)/(-872) - (-1)/8. 4 Calculate 2 + 1 - (14 - -8 - 3). -16 8/(160/44) + (-5 + 3)/1 1/5 Evaluate (136/272)/((0 + 5/40)/(-2)). -8 What is the value of 77/(-15) + (254 - 246) - (-1)/(-5)? 8/3 What is (-4)/(-5) - (-5494)/(-205)? -26 Evaluate 41/(-9) - 5995/(-1199). 4/9 Calculate 4892/139422 - (-752)/(-1938). -6/17 (((-2)/14)/(1/(-2)))/((-36)/504) -4 Calculate (-1116)/(-26784) + (-1202)/48. -25 What is (-21 - -19)/((-14)/(-133))? -19 Calculate (72/(-8))/(5/(-25) + (-34)/(-20)). -6 Evaluate (-15 - -13)/((1/9)/((-1)/6)). 3 Evaluate (-1)/(-6) + 41847/8658. 5 What is the value of (1 - 14) + (79 - 70)? -4 Evaluate ((-25)/125 - -11)(-100)/(-8). 10 341/248 + (-22)/8 7/8 What is the value of 266/(-76)(1 - 628/644)? -2/23 What is the value of (12/40)/((-170)/(-425))? 3/4 (83/415)/(-2 - (-136)/70) -7/2 Evaluate (13/(78/(-93)))/(-711/(-154)). -31 What is the value of ((-14)/1 - -15)/(4/(-128))? -32 Calculate 10140/(-390) + (0 - 3/(-1)). -23 Evaluate (-75)/1215/6 - (-48)/(-128). -16 Evaluate 780/(-39) - ((-4)/(-6))/((-16)/24). -19 Evaluate (-108)/(-90) - ((-14)/(-21) + (-2)/(-6)). 1/5 Evaluate (-539)/(-1015) + -23/(-2 + -85). 3/5 What is 16 - (-4)/(-14)(-61 - -40)? 22 Evaluate (-4 - (6 - 11))-13. -13 What is (-714)/(-204)48/(-21)? -8 Calculate (83 + 87)/((-29 + -6)/(-7)). 34 What is 264/(-594) - 4/(-6)? 2/9 ((-2759)/(-62) - 48)1/(-2) 7/4 Calculate 3 + (-301)/(-49) - 3/721. 1/7 -2 - ((-95)/6 - 2/32427) 14 What is (-8)/(-112)8 - (-39)/(-21)10? -18 What is ((-20)/200)/(2/168) - -9? 3/5 What is 21/70 + (5238/(-60))/(-9)? 10 Calculate ((-1925)/(-20))/(-5)3258/3801. -33/2 What is 76/280 + 3/(-42)8? -3/10 What is the value of (16/(-84))/((-152)/(-114))? -1/7 Calculate -2(((-80)/(-152))/(-10))/1. 2/19 Calculate 0/(2 - 20/(-5)) + (1 - 13). -12 -6(4 - (-98)/(-16))636/(-477) -17 What is the value of 8/28406/580? 1/5 205/164(2-1)/(6 - 21) 1/6 What is the value of (-1000)/90 + (260/(-90) - -3)? -11 What is the value of (-45)/(-20) - -3 - 12/48? 5 (-1376)/28140 + 302/15855 -2/67 What is 33/(-20) + 1132/(-20) + 57? -5/4 Calculate -20(-6)/132 - (-8 + 9). -1/11 26 - (-37)/(814/(-495)) 7/2 Evaluate (-3708)/(-324) - (-4 - -15). 4/9 (-22)/(-121) + ((-11479)/(-572) - 20) 1/4 (-40)/(-28)(-1 + (-17 - -11)) -10 (-2)/(-4) + 3(-78)/(-252) 10/7 Evaluate ((-14)/84)/(4 + 164/(-40)). 5/3 Evaluate (-216)/9020/8. -6 Evaluate (1/(-2))/(758/7580). -5 Calculate (0 - 7) + (4068/(-126) - -40). 5/7 What is 8/(-44) + 5 + (-925)/55? -12 What is (-3 - 219/(-52)) + (-41)/(2952/90)? -1/26 What is 8 + (0 - 2) + 422 + -429? -1 What is ((6 - 5) + -4)(-3 + 0) - 5? 4 What is the value of (-1850)/4884-22(-4)/30? -10/9 What is the value of -8((-1)/5)/(8 + 235/(-25))? -8/7 Evaluate (-1)/(-5) - (-38 + 84)5/25. -9 What is the value of (3423/105 - 32)/(1/3)? 9/5 What is the value of -5 + 364/65 + (-2)/1? -7/5 What is (-10)/1563372/4215? -2/39 What is (-955)/29 - ((-3100)/1798)/(-25)? -33 What is (-921 - -899) + (-1 - -17)? -6 What is -4 + (-6 - 17/((-748)/400))? -10/11 What is the value of (78 - 71) + (1 - 6)-1? 12 What is the value of 1-29 + (74 - 61) + (-3 - -2)? -17 ((-13)/364-8)/((-18)/14) -2/9 377/(-174)(248/(-42) - (-44)/(-462)) 13 Evaluate 16/264 + (-8)/((-2112)/644). 5/2 What is the value of ((25/(-40))/((-15)/6))/((-5)/(-20))? 1 Calculate 14/(-6) + 697/(-51) + 3. -13 Calculate (-22)/886(-2 + 4). -3 Calculate ((-7)/(-14))/((-45)/18)(4 - 3). -1/5 What is (-94)/(-517) + 5/(-209)? 3/19 What is the value of 177/(-236)(-2 + 102/45)? -1/5 What is the value of -8 + -1 - ((-8)/30 - (-6510)/(-775))? -1/3 What is the value of (-567)/(-231)594/(-81)? -18 2/(-20) - (380/(-285) + (-254)/(-60)) -3 100/(-800) - (87/(-7))/((-24)/21) -11 What is the value of 1(13 + 3 + -5 + 2)? 13 What is 1647/(-564) + 232/(-6)? -40 Evaluate (7/(42/216))/(49/49). 36 Calculate -110 + 245 + -219 - 9. 7 What is (3906/(-1674))/((-2)/(-4))? -14/3 ((-3)/10)/(3 + -7 - -1) 1/10 What is ((-17)/4)/((-2023)/(-578)(-1)/(-14))? -17 Calculate (1410/(-29140))/((-90)/93). 1/20 Calculate (-83)/(12201/(-1428)) + 40/(-4). -2/7 (0 + -4 + 24)/(-4 - (8 + -10)) -10 Calculate (5 + -1)3 + (-3420)/95. -24 30/4 - 700/100 1/2 What is the value of ((-9)/12)/((-3690)/(-504) + -7)? -7/3 What is the value of -23 + -6 + -9 + 732/36? -2/3 What is 2456/(-160) - (1782/12)/(-33)? -6/5 What is the value of (-3)/((-3)/(3 - (-18 + -4) - 5))? 20 Calculate 3675/3465 - 6/99. 1 (9 - (-752)/(-80))-40 16 Calculate (-20)/(-180)6/(-10). -1/15 What is (-10(-48)/(-240))/(4/14)? -7 What is the value of (2/20 - 4/(-30)3)2? 1 Calculate 54/(-126) - ((-3)/12 + 60/112). -5/7 (11932/665 + -18)-40 16/7 What is the value of (-448)/((-384)/24) + 6? 34 (-16 + 143/11)(8 + -7) -3 Evaluate -26 + 715/251. 13/5 Calculate 1204/(-392) - 96/(-18). -1/14 What is (81/(-63))/9 + (-21)/(-49)? 2/7 -9(11/1 + 6154/(-561)) -3/11 What is (192 - 193)/((-1)/(-5))? -5 Evaluate -17(-145)/87(-9)/15. -17 What is the value of 920/80 - (-235)/(-18)? -14/9 Calculate (-898 - -909) + 406/(-38). 6/19 What is the value of 1/(351/258) + ((-490)/26 - -19)? 8/9 What is 84/((-96768)/360)8/6? -5/12 Calculate (-33)/(-3) - (-3 - (-260)/18). -4/9 Evaluate -6((-25)/(-42) - 60/140). -1 Evaluate ((-2)/(-12)9)/(-4 - 107/(-26)). 13 Evaluate (-3)/((2 - 77/(-8)) + (86 - 92)). -8/15 Evaluate (36/15)/((189/(-315))/((-3)/(-2))). -6 What is 51/(-119) + (-8)/(-280)? -2/5 Calculate 916/264(-5)/(-10). 3/11 Evaluate 4/(-9) - 423/(-1620)(-40 + 35). -7/4 Evaluate ((-120)/(-10))/(-6)(188/(-40) - -4). 7/5 Calculate ((-40)/(-3))/((-12	{ "pile_set_name": "DM Mathematics" }
9. Let g be m(-6). Suppose 0h + h = 2o - 21, -5o = -h - 51. Solve -gc = -c + o for c. -5 Let o(u) = -u - 1. Let x(c) = c*3 + 10c*2 - 11c - 4. Let t be x(-11). Let q be o(t). Solve 13 - 4 = qm for m. 3 Suppose 3l + r + 7 = 0, 2l - 2r = -4r - 6. Let z be 2/(3/((-15)/l)). Suppose 38 = zd + 4b, -b - 8 = -5b. Solve -p - 1 = -d for p. 5 Let o(k) = -3k + 8 - 3k + 5k + 4. Let r be o(7). Solve -rl = 1 - 6 for l. 1 Let r(k) = 4 + 2k2 + 2k*3 + 4k*2 + 6k*2 + 13k - 3k3. Let u be r(13). Solve 2h + u = 6h for h. 1 Let c be (-5)/10-22. Solve 2x + 12 = c for x. -5 Suppose 0k = 5k + 10. Let x be (-5 - k/1) + 8. Let i = -4 - -6. Solve -xm + 6 = -im for m. 2 Suppose 1 = y - 4. Solve -x = -6x - y for x. -1 Let f(x) = x + 7. Suppose -3u - 2t = 13, -2t + 3t + 24 = -5u. Let k be f(u). Solve -2b + k = -6 for b. 4 Suppose -12d - 1 + 25 = 0. Solve -6 = dh + 4 for h. -5 Let a(q) = -q3 - q2 + 5q + 2. Let s be a(-3). Solve -2 + s = -3c for c. -1 Suppose b = -0b - 16. Let f be ((-20)/b)/((-1)/4). Let r = -3 - f. Solve 0o + 6 = -ro for o. -3 Let d be 3/(-2)(-16)/6. Suppose -5y + 19 = 3u + u, -dy = -5u - 48. Suppose yn = 4n. Solve -3g - 16 + 1 = n for g. -5 Let h(g) = 4g - 4. Let p(v) = -5v + 4. Let s(n) = -4h(n) - 3p(n). Let i be s(0). Solve -r + 1 = i for r. -3 Let x = 2 - -5. Suppose 2f - 5k + 20 + 1 = 0, -3f = 5k - 31. Let s(r) = -r*2 + 5r - 3. Let t be s(4). Solve fl = t + x for l. 4 Let q be (-6)/(4/2) + -3. Let d(n) = n2 + 3n + 2. Let x be d(q). Solve 0 = 7f - 3f - x for f. 5 Suppose 0 = -2p + 4o + 10, 0 = -p - 2o - o. Let t be (-1)/((-39)/38 + 1). Suppose -4s + 2h = -t, -5s + h + 23 = -17. Solve j - p + s = 0 for j. -4 Suppose 16 = 5n + 4p - 1, -4n + 30 = -5p. Solve 3q - n = 7 for q. 4 Suppose u = -2q + 3q - 3, 20 = 5u + 2q. Solve uf + 9 = 5f for f. 3 Let k be -22 - (-1 - (2 + -1)). Let s = -14 - k. Let r = 9 - s. Solve -rn + 5n = 4 for n. 2 Let l be (60/(-12))/(-1 - 0). Solve 0 = -0k + k - l for k. 5 Suppose -22v - 7 = -29v. Solve 1 + v = 2s for s. 1 Let u = -10 - -10. Solve 3a + a = u for a. 0 Let x be 0/2 + (21 - 18). Solve -xj + j + 8 = 0 for j. 4 Suppose 0o + 28 = 4b - 4o, 5b - 19 = o. Solve -bd + 8 = -d for d. 4 Suppose 6a - 49 = -3s + a, -3a - 46 = -4s. Let y = 18 - s. Solve -4 - 6 = yi for i. -2 Let n be (5/2)/(1/2). Let q be (-29)/(-9) - (-4)/(-18). Let i = 5 - q. Solve no + i = 3o for o. -1 Let f be 55/3 + (-8)/(-12). Let p = 21 - f. Solve 4r - pr - 8 = 0 for r. 4 Let s(n) = -n2 - 20n + 23. Let o be s(-21). Solve -oy = 3y for y. 0 Suppose -4p - 40 = -6p. Suppose -2c + p = 3c. Solve 0 = k + c - 0 for k. -4 Let f be (-10)/(-3) - 2/6. Let a = f - 3. Solve a = -3l - l - 12 for l. -3 Let b = -4 - -6. Suppose bv - 4 = v. Suppose 0 = 4o + x + 2x - 21, 0 = vo - x - 9. Solve 4 = -oy + y for y. -2 Let o(y) = -y*2 - 4y. Let h be o(-3). Solve 3j + h + 0 = 0 for j. -1 Suppose -6g + 14 = g. Let i be 0(1 - 2)/(-2). Let z = i + g. Solve -4r - 2 = z for r. -1 Suppose -4v + 20 = 4d, -v + 1 - 2 = -2d. Suppose -vo - 9 = -21. Suppose oy + 8 = 5n - 0, 4n - 5y = 1. Solve 1 = nh - 3 for h. 1 Let l = 13 + -4. Let i = l - 9. Solve -o + 1 + i = 0 for o. 1 Let z be 15/6 + 3/2. Solve -zc + 15 = -7c for c. -5 Let p be (28/(-5) - -2)/(3/(-10)). Solve -h - 3h = -p for h. 3 Let a = -13 - -27. Solve 0 = 5z - a - 11 for z. 5 Suppose 2j - 5j = -5w + 7, -4w + j = -7. Suppose -wk = -3k. Solve k = -0z - z for z. 0 Suppose -2g = -0g + 46. Let x be (-2)/(-5) - g/5. Solve -4p + x = -3p for p. 5 Let u(s) = -s*3 + 4s*2 - s + 2. Let n be u(2). Solve 0 = 5a - 33 + n for a. 5 Suppose p - 5 + 4 = 0. Solve p = -3d - 8 for d. -3 Let d(k) = 280k - 55. Let t = -177 - -122. Let z(p) = -20p + 4. Let q(x) = tz(x) - 4d(x). Let m be q(-1). Solve c - m = 6c for c. -4 Let m be (-2 - -22)(-2)/(-5). Solve -3k = -5k + m for k. 4 Let r be (-30)/(-8) + 4/16. Suppose 5o - 12 = -0o + 4m, rm - 28 = -5o. Solve -p - 1 - o = 0 for p. -5 Let i(t) = 4t3 + t2 - 4t + 2. Let s be i(1). Solve sg = 8g for g. 0 Let t(s) = -2s + 1. Let r be t(-2). Let i be -1 - -2 - (-13 - 0). Suppose -rn = 4k - 2, -5 = 5k + 3n - i. Solve x = 1 - k for x. -2 Suppose -2h - 4v + v - 41 = 0, -3v = -2h - 11. Let j = h + 13. Solve jr = -5r for r. 0 Let i(a) = 2a*3 + 4a*2 + 2a - 1. Let p be (1/2)/(3/(-12)). Let u be i(p). Let c be (u/(-3))/((-1)/(-12)). Solve 3o - c = -o for o. 5 Suppose -3t = -8t + 4r - 12, 5t + 9 = 3r. Solve 5h - 9 + 29 = t for h. -4 Let r be (-12)/(-9)3 - 3. Solve 4b = r - 5 for b. -1 Suppose 3p + 2j - 64 = 7j, 4p - j = 91. Suppose 0 = 2x - 10x + 104. Suppose p = 4w - 3v, -v = -w - 4v - x. Solve -wu - u - 12 = 0 for u. -4 Suppose 4v - 24 - 16 = 0. Suppose 3k + 1 = v. Solve -l = -0l - k for l. 3 Suppose 5r - 9 = s, -8 = -3r + 1. Suppose -sv + 2v = -60. Let j be ((-12)/v)/(1/(-5)). Solve 0m = -4m + j for m. 1 Let v(q) = -3q + 8. Let l be v(2). Solve lh = -0 - 8 for h. -4 Let p be ((-11)/((-66)/120))/2. Solve p = -4v + 2v for v. -5 Let x = 3 - 3. Let j be 0((-1)/(-2) - x). Suppose -4b - 14 + 38 = j. Solve -2u = u + b for u. -2 Let y = -3 + 6. Let h be (2/y)/(8/84). Let g(r) = 2r + 3. Let l be g(h). Solve 5c = 3 + l for c. 4 Let o(l) = -2l - 8. Let i be o(-6). Let z(t) be the second derivative of -t3/6 + t2 - 4t. Let w be z(-2). Solve 2x = wx - i for x. 2 Let j be (-21)/(-49) - (-36)/14. Solve 0y - j = 3y for y. -1 Suppose -5t + 16 = -4d + d, 4t + 4d = 0. Suppose 2x - 51 = -5i - tx, -9 = -3i + 3x. Suppose 4v - 21 = i. Solve -4b - v = 5 for b. -3 Let h be (13/26)/((-2)/(-16)). Solve -8 - 8 = hu for u. -4 Suppose -8i + 0i = -3i. Solve k + 0k - 3 = i for k. 3 Suppose -15 = -2v + 15. Solve -v = c + 4c for c. -3 Let c = -17 + 29. Suppose -4u + c = -5u + 2v, 5u - 3v + 25 = 0. Let y = 2 - u. Solve -4t = -2t + y for t. -2 Suppose 0 = -4t - t. Solve t = m - 2m + 3 for m. 3 Suppose -3s + x = -5, -15 - 17 = -4s - 5x. Solve -u = s - 4 for u. 1 Let r = 21 - 19. Solve -ro - 8 = 2o for o. -2 Suppose -4a + 16 = 4v, a + 0a = 5v - 2. Suppose 0 = -n - a + 8. Solve -nk + 3 = -6k for k. -3 Suppose 0j - 4 = -2j. Let u be (-5 - -3)-3 - 2. Let r = u + -3. Solve -r + 3 = jv for v. 1 Suppose -2b + 0 = -8. Let l be -1 + 1 + 1b. Let v be 0/2 - 3 - (2 + -20). Solve -v = ls - s for s. -5 Suppose -3z - 2x + 23 = 0, -4z - 3x + 32 = -0x. Solve -2r - 3r = -z for r. 1 Let c be (-2)/(-2 - 0) - (24 - 25). Let l = -9 - -13. Suppose 0f + 16 = lf. Solve 3y = c + f for y. 2 Suppose -3m - 1 = -10. Solve -z + 16 = mz for z. 4 Let k(s) be the first derivative of -s4/24 + s3/6 + s*2 - 1. Let r(p) be the second derivative of k(p). Let g be r(1). Solve -2v - 6 - 4 = g for v. -5 Let d(f) = f*3 - 4f*2 + 3f + 4. Let o be d(3). Let y be -12(-21)/3. Suppose 0 = -3n - 2u + y, -4u + 9u - 16 = 2n. Solve 0 = nc - c - o for c. 4 Let f(i) = -i*3 - 9i*2 + 9i - 7. Let w be f(-10). Solve wl + l = -8 for l. -2 Suppose -12 = 3x + 2o - 41, -5x + o = -57. Suppose -t + x = -4. Solve t = 5d - 10d for d. -3 Suppose 15 - 3 = 4t. Suppose 4p - 21 = -5h, -5p - 3h + 27 - 4 = 0. Suppose -pd - 12 = -0, 2m - 4d - 18 = 0. Solve -4y = -my - t for y. 3 Suppose 0 = -5z - 5s + 35, 2z + 5s = 2s + 19. Solve -zf + 8 = -4f for f. -4 Let c(o) = -o - 11. Let n be c(-14). Suppose y = -0y - 2d, 2d = ny. Solve -5i + 0 - 10 = y for i. -2 Suppose -5k + 35 = -7i + 4i, -3i = -3k + 27. Suppose 0 = -3c + 2d + 15, kc - 15 = 4d + 9. Solve -p = -4p - c for p. -1 Let k = 18 - -1. Let i = k + -11. Solve -4b - i = -2b for b. -4 Let w = 5 - -2. Suppose f - 5 = -2. Let c = 5 - f. Solve -1 - w = -cm for m. 4 Let a(g) = -9g + 1. Let l be a(-3). Let t(w) = w*3 - 6w*2 + 7w - 1. Let n be t(5). Suppose 0 = -j - 1 + n. Solve -5k + j = l for k. -4 Let a(f) = 6f + 36. Let z be a(-6). Solve zq + 10 = -5q for q. -2 Let u = 3 - 1. Suppose b - 2x = -u, -b + 0x + 2 = 2x. Suppose 4d - 20 = -bd. Solve -k - 16 = -dk for k. 4 Suppose 2m - 23 = -19. Suppose -m = -2a + a. Solve at = -2t for t. 0 Suppose 2 - 8 = -3v. Suppose 90 = -2u + 5u + vn, 4n = -5u + 150. Let	{ "pile_set_name": "DM Mathematics" }
comes next: 567, 593, 619, 645, 671, 697? 723 What is the next term in -251, -265, -305, -383, -511, -701, -965, -1315? -1763 What comes next: -12, -15, 0, 45, 132, 273, 480, 765? 1140 What comes next: -7887, -7889, -7891? -7893 What is next in -886, -888, -890, -892, -894, -896? -898 What is next in -53, -78, -117, -176, -261, -378, -533? -732 What is the next term in 78, 264, 574, 1008, 1566, 2248? 3054 What is the next term in -98, -78, -58, -38? -18 What is next in 1171, 1164, 1139, 1090, 1011, 896? 739 What comes next: 223, 234, 267, 334, 447, 618, 859? 1182 What is next in -1573, -1572, -1571, -1570, -1569? -1568 What is the next term in -39, -30, -21, -12? -3 What comes next: -16, -10, 0, 14? 32 What is the next term in 71, 145, 237, 353, 499, 681, 905? 1177 What comes next: -42, -41, -40, -39? -38 What comes next: -11, 30, 107, 226, 393, 614, 895? 1242 What is next in 6962, 6954, 6940, 6920, 6894, 6862? 6824 What is the next term in 17, 209, 739, 1775, 3485, 6037, 9599, 14339? 20425 What is the next term in -69, -312, -723, -1308, -2073? -3024 What is the next term in -351, -706, -1061, -1416? -1771 What comes next: 1164, 1154, 1142, 1128, 1112, 1094, 1074? 1052 What is the next term in -1896, -3794, -5692, -7590? -9488 What comes next: -1395, -1393, -1391, -1389, -1387, -1385? -1383 What is next in -242, -231, -202, -149, -66, 53, 214? 423 What is next in 2083, 4165, 6247, 8329? 10411 What comes next: -372, -373, -376, -381, -388? -397 What is next in 1287, 2580, 3887, 5214, 6567? 7952 What is next in -60, -49, -36, -21? -4 What is next in 83988, 83987, 83986, 83985? 83984 What is the next term in 89, 353, 787, 1385, 2141, 3049, 4103? 5297 What is the next term in 10, 18, 34, 64, 114? 190 What is the next term in -728, -1454, -2180, -2906, -3632, -4358? -5084 What is the next term in -15, -33, -47, -57, -63, -65, -63? -57 What comes next: -100, -134, -156, -160, -140, -90, -4, 124? 300 What is the next term in -27, -18, -3, 18? 45 What is next in 27, 27, 17, -9, -57, -133? -243 What comes next: 31, 49, 95, 181, 319, 521, 799, 1165? 1631 What comes next: -268, -503, -708, -883, -1028? -1143 What is the next term in -1, 1, 15, 47, 103, 189, 311? 475 What comes next: 254, 290, 326, 362, 398? 434 What is next in 29, 102, 223, 392? 609 What is next in -17, -28, -33, -32, -25, -12, 7? 32 What comes next: -287, -294, -303, -314, -327, -342, -359? -378 What is next in 16, 48, 126, 274, 516, 876? 1378 What is the next term in 4, -13, -54, -131, -256, -441? -698 What is next in 417, 1661, 3727, 6609, 10301, 14797, 20091? 26177 What is the next term in -533, -448, -219, 226, 959, 2052, 3577? 5606 What comes next: -140, -144, -148? -152 What comes next: -448, -455, -460, -463, -464, -463? -460 What is next in 10944, 10941, 10936, 10929, 10920, 10909? 10896 What is next in -55, -52, -49, -46, -43? -40 What is the next term in -1283, -2565, -3847, -5129, -6411, -7693? -8975 What is next in -199, -194, -179, -148, -95? -14 What is next in 23, 36, 49, 62? 75 What is next in 1067, 2137, 3207, 4277, 5347, 6417? 7487 What is the next term in -89, -161, -351, -719, -1325, -2229, -3491, -5171? -7329 What is next in 25, -2, -75, -218, -455, -810, -1307? -1970 What comes next: 68, 85, 102, 119, 136, 153? 170 What is next in 100, 103, 106? 109 What comes next: 918, 1837, 2772, 3729, 4714? 5733 What is next in 3712, 3717, 3732, 3763, 3816, 3897, 4012, 4167? 4368 What is the next term in 65, 60, 53, 44, 33? 20 What is next in 29, 47, 67, 89, 113, 139, 167? 197 What is next in 3, -14, -43, -84, -137, -202, -279? -368 What comes next: 5, 8, 11, 14, 17, 20? 23 What comes next: 44, 40, 36? 32 What is the next term in 48, 76, 88, 84, 64? 28 What comes next: -26, -12, 12, 46, 90, 144, 208? 282 What is the next term in -2, 5, 34, 97, 206, 373, 610? 929 What is the next term in -15, -12, -15, -30, -63, -120? -207 What is next in -162, -343, -538, -753, -994? -1267 What is the next term in 32, 54, 72, 86, 96, 102, 104? 102 What comes next: -903, -942, -991, -1056, -1143? -1258 What comes next: -182, -361, -536, -707, -874, -1037, -1196? -1351 What is the next term in -135, -130, -127, -126? -127 What is the next term in 188, 448, 734, 1058, 1432, 1868, 2378? 2974 What is the next term in 151, 155, 161, 169, 179? 191 What is next in 1078, 2156, 3234, 4312, 5390? 6468 What is next in 378, 391, 404? 417 What is the next term in 15207, 15206, 15205, 15204, 15203, 15202? 15201 What is next in 62, 49, 30, 5, -26? -63 What comes next: -9359, -9362, -9367, -9374? -9383 What is the next term in -372, -755, -1138? -1521 What comes next: 201, 397, 593, 789, 985? 1181 What is the next term in -117, -123, -133, -147, -165, -187? -213 What comes next: 61, 117, 173, 229? 285 What is next in 23, 24, 25, 26, 27? 28 What is the next term in 358, 371, 384, 397, 410? 423 What is the next term in -486, -978, -1480, -1992, -2514, -3046? -3588 What comes next: -94, -349, -756, -1315? -2026 What is next in -97, -87, -71, -49, -21, 13? 53 What is the next term in -2666, -2665, -2662, -2657, -2650, -2641? -2630 What is next in 27, 18, -11, -72, -177, -338, -567? -876 What is the next term in -64, -127, -190, -253? -316 What comes next: -163, -328, -493? -658 What comes next: -3627, -3628, -3629, -3630, -3631? -3632 What is the next term in 81, 163, 243, 321, 397? 471 What is next in 16, 37, 86, 175, 316, 521? 802 What is the next term in 28, 24, 28, 46, 84, 148? 244 What is the next term in 645, 637, 619, 585, 529, 445, 327, 169? -35 What is next in -23, -36, -43, -44? -39 What is next in 72, 145, 220, 297, 376? 457 What is next in -206, -419, -632? -845 What is the next term in 297, 1149, 2559, 4521, 7029? 10077 What is the next term in -77, -75, -71, -65, -57, -47, -35? -21 What comes next: 26, 42, 58, 74? 90 What is next in -232, -231, -230? -229 What is the next term in 242, 244, 246? 248 What comes next: -766, -765, -764, -763? -762 What is next in 1, -6, -15, -26, -39, -54? -71 What comes next: 37, 124, 269, 472, 733, 1052, 1429? 1864 What is next in 999, 1996, 2991, 3984, 4975? 5964 What is the next term in -487, -972, -1453, -1930? -2403 What is next in -343, -1381, -3111, -5533, -8647, -12453, -16951? -22141 What is the next term in 1244, 1240, 1236, 1232? 1228 What is next in -17, -73, -165, -293? -457 What is next in 36, 30, 26, 24, 24? 26 What is the next term in 512, 512, 510, 506, 500, 492? 482 What is next in -11, -35, -85, -173, -311? -511 What comes next: -216, -432, -648, -864? -1080 What is the next term in 15, 80, 203, 396, 671? 1040 What comes next: -9, -65, -173, -333, -545? -809 What is the next term in 1, -2, -5, -8? -11 What is the next term in -150, -64, 24, 114, 206? 300 What is next in 693, 1388, 2083, 2778? 3473 What is the next term in -235, -527, -819, -1111, -1403? -1695 What is the next term in 452, 453, 454, 455? 456 What is next in 11459, 22916, 34361, 45788, 57191, 68564, 79901, 91196? 102443 What is next in -1596, -1606, -1616? -1626 What comes next: 2, 5, 14, 35, 74, 137, 230, 359? 530 What comes next: 26, 43, 64, 89, 118, 151? 188 What comes next: 7, 8, 21, 52, 107, 192, 313, 476? 687 What is next in -290, -581, -872, -1163, -1454, -1745? -2036 What is the next term in -2499, -4991, -7483, -9975, -12467? -14959 What is next in 23, 43, 63, 83, 103? 123 What is the next term in -324, -646, -968, -1290, -1612, -1934? -2256 What comes next: 3780, 7562, 11344, 15126, 18908, 22690? 26472 What is next in 69, 58, 41, 18, -11, -46, -87? -134 What is next in -385, -745, -1107, -1471? -1837 What is next in -7, -36, -81, -148, -243, -372, -541? -756 What is next in 17, 154, 393, 740, 1201, 1782, 2489, 3328? 4305 What comes next: -90, -352, -784, -1386, -2158, -3100, -4212? -5494 What is next in 879, 1781, 2683, 3585, 4487, 5389? 6291 What is the next term in 2, -12, -62, -166, -342, -608? -982 What is next in 4, -19, -58, -113, -184, -271, -374? -493 What is next in -1343, -5338, -11987, -21284, -33223, -47798, -65003? -84832 What is the next term in -164, -328, -470, -578, -640, -644, -578? -430 What comes next: -140, -265, -376, -467, -532? -565 What comes next: 182, 180, 178, 176, 174, 172? 170 What comes next: -313, -292, -269, -244? -217 What comes next: -90	{ "pile_set_name": "DM Mathematics" }
isor of 960885 and 4716. 1179 Calculate the highest common divisor of 1072302 and 4662. 42 What is the highest common factor of 1054 and 2140302? 62 Calculate the greatest common factor of 3680007 and 149565. 177 Calculate the greatest common factor of 549606 and 9534. 6 Calculate the greatest common divisor of 657 and 2966428. 73 What is the greatest common divisor of 5619 and 74522924? 1873 Calculate the highest common factor of 1419549318 and 33. 33 What is the highest common divisor of 18 and 7689555? 9 What is the highest common divisor of 190 and 212328560? 10 What is the greatest common factor of 46956 and 14430? 78 What is the highest common factor of 10283 and 47686? 113 Calculate the highest common factor of 100843 and 1891. 31 Calculate the highest common divisor of 597789 and 132969. 381 What is the greatest common divisor of 31 and 152091487? 31 What is the highest common divisor of 1786035 and 225? 15 What is the highest common factor of 91509 and 832887? 1551 What is the highest common divisor of 1410 and 9888330? 1410 Calculate the greatest common factor of 94552 and 289008. 1784 Calculate the highest common divisor of 205 and 86565. 5 Calculate the greatest common factor of 27210 and 32548602. 5442 Calculate the highest common divisor of 4110720 and 6720. 960 What is the greatest common divisor of 59328 and 69840? 144 What is the highest common factor of 8269674 and 27132? 798 What is the greatest common factor of 4793624 and 304? 152 Calculate the highest common divisor of 2424176 and 56071. 1193 Calculate the greatest common factor of 90 and 5415090. 30 Calculate the highest common factor of 90510 and 335029230. 12930 Calculate the highest common factor of 3 and 10661238. 3 What is the highest common divisor of 3102 and 478456? 22 What is the highest common factor of 109788 and 9093? 21 What is the greatest common divisor of 37 and 215719879? 37 Calculate the highest common factor of 40071 and 357124. 703 What is the greatest common factor of 23797761 and 39? 39 What is the highest common divisor of 120991521 and 7? 7 What is the highest common divisor of 1717 and 181322? 17 What is the greatest common divisor of 231312 and 7373544? 1896 What is the highest common divisor of 370710 and 5310? 90 Calculate the highest common divisor of 123 and 1454847. 3 Calculate the highest common divisor of 105638 and 245510838. 8126 What is the highest common divisor of 1819 and 797521? 17 What is the highest common factor of 7128 and 379797? 33 Calculate the highest common factor of 2016 and 4555776. 96 What is the highest common factor of 329376 and 172584? 1128 What is the greatest common divisor of 2398 and 40911079? 1199 What is the highest common divisor of 8860 and 340040? 20 What is the highest common divisor of 1297422521 and 233? 233 What is the greatest common factor of 300689 and 188875? 1511 Calculate the greatest common divisor of 13068 and 162772632. 1188 What is the greatest common factor of 16325 and 17912443? 653 What is the highest common factor of 16610 and 280? 10 Calculate the highest common divisor of 449062 and 6554. 226 Calculate the highest common divisor of 585844 and 448987. 2401 What is the greatest common factor of 4056 and 103560? 24 What is the highest common divisor of 4428295 and 33855? 305 What is the highest common factor of 387000 and 76640? 40 What is the highest common factor of 423591 and 93219? 483 Calculate the greatest common factor of 1675 and 5997103. 67 Calculate the highest common factor of 33472 and 2472. 8 What is the greatest common factor of 3188141 and 8393? 1199 What is the greatest common divisor of 42476 and 252932? 148 Calculate the greatest common factor of 164 and 10362504. 164 Calculate the highest common divisor of 678990 and 127062. 78 What is the greatest common factor of 297 and 1037652? 33 Calculate the highest common factor of 964 and 36451973. 241 Calculate the highest common divisor of 25066530 and 810. 270 What is the highest common divisor of 119293188 and 18684? 2076 What is the greatest common factor of 2655 and 178740? 45 What is the greatest common factor of 237617 and 3937? 127 What is the highest common factor of 328422 and 41529? 381 Calculate the greatest common divisor of 938265 and 3427971. 2643 What is the greatest common divisor of 96109010 and 458? 458 Calculate the highest common factor of 1724661 and 3195. 639 Calculate the greatest common divisor of 60 and 1425460. 20 What is the highest common factor of 536097099 and 31242? 15621 What is the greatest common factor of 11700 and 3279390? 30 Calculate the greatest common divisor of 124916 and 71808. 748 What is the greatest common factor of 20 and 135481120? 20 What is the highest common factor of 460761251 and 85? 17 Calculate the greatest common factor of 45077270 and 70. 70 Calculate the highest common divisor of 698176 and 14. 2 Calculate the greatest common factor of 14777 and 123740487. 2111 What is the greatest common divisor of 73 and 5877449? 73 Calculate the highest common divisor of 3091956 and 14. 14 Calculate the highest common divisor of 3761813770 and 1895. 1895 Calculate the highest common factor of 62601370 and 390. 130 Calculate the greatest common factor of 225 and 73238100. 75 Calculate the highest common divisor of 268818 and 8448. 66 What is the greatest common divisor of 10611 and 31919067? 1179 What is the greatest common divisor of 9595116 and 23807? 179 What is the highest common divisor of 3394868 and 1415? 283 What is the greatest common divisor of 564875831 and 1612? 403 Calculate the highest common factor of 27385848 and 3015. 603 What is the greatest common divisor of 1221 and 11542? 1 What is the highest common divisor of 5179883 and 275621? 527 What is the greatest common factor of 14894271 and 21546? 1197 Calculate the greatest common factor of 1192306 and 45994. 3538 Calculate the highest common divisor of 2704 and 2797600. 208 What is the greatest common factor of 1661086 and 55342? 826 Calculate the greatest common factor of 95013 and 3888. 243 Calculate the greatest common divisor of 29095 and 1757085. 1265 What is the greatest common divisor of 1368 and 34020792? 1368 What is the highest common divisor of 9880 and 317314400? 520 What is the greatest common factor of 1376 and 109152? 32 What is the highest common divisor of 497622 and 2945544? 1182 What is the greatest common factor of 354125 and 124652? 2833 Calculate the greatest common factor of 140 and 62175520. 20 Calculate the highest common divisor of 4 and 36588406. 2 What is the highest common factor of 4749465 and 75? 15 What is the highest common divisor of 918374 and 5253? 17 What is the greatest common divisor of 6638554 and 3276? 26 Calculate the highest common factor of 66420113 and 39214. 2801 What is the highest common divisor of 20744250 and 1125? 375 What is the greatest common divisor of 70785 and 117888485? 7865 What is the highest common factor of 3822 and 602446? 26 Calculate the highest common divisor of 180 and 1171530. 90 Calculate the highest common factor of 581152 and 6248. 88 Calculate the highest common divisor of 1247407 and 1562890. 581 Calculate the greatest common factor of 601577670 and 584. 146 Calculate the highest common divisor of 13114751 and 39. 13 What is the highest common divisor of 356164375 and 700? 175 Calculate the greatest common divisor of 64024356 and 24420. 4884 Calculate the highest common divisor of 336880 and 1928. 8 What is the highest common factor of 8111975 and 1088? 17 What is the highest common divisor of 12 and 134926236? 12 What is the greatest common factor of 178325 and 86800? 175 What is the greatest common factor of 380784 and 912? 48 Calculate the greatest common factor of 15758305 and 5385. 1795 Calculate the highest common divisor of 33408 and 2712312. 2088 What is the greatest common divisor of 14093 and 106402979? 829 Calculate the greatest common divisor of 909540 and 305040. 1860 Calculate the greatest common factor of 7308 and 1419202. 58 Calculate the highest common divisor of 105 and 798360. 15 What is the highest common divisor of 411 and 9445876? 137 Calculate the highest common divisor of 1016767 and 11009. 101 Calculate the greatest co	{ "pile_set_name": "DM Mathematics" }
, 0.01, 2 in increasing order. 0.01, 2, 3, 5, 21 Put 2/93, 0.006, 2/27, 0.1 in increasing order. 0.006, 2/93, 2/27, 0.1 Put 1, 4, 10, 5, 2, -103 in ascending order. -103, 1, 2, 4, 5, 10 Put 8, 0.4, 6/7, -3/4, 3/2 in decreasing order. 8, 3/2, 6/7, 0.4, -3/4 Sort -3, 1862, 5, -20, -5, 4 in descending order. 1862, 5, 4, -3, -5, -20 Sort 24, 88, 34, -4, -1, 3. -4, -1, 3, 24, 34, 88 Put 50, 3, 1, -162 in descending order. 50, 3, 1, -162 Put 112, 1271, 4 in descending order. 1271, 112, 4 Put 0.049, 0.5, 3/19, 27 in decreasing order. 27, 0.5, 3/19, 0.049 Sort 4, 0, -4, -5, -9, 45 in ascending order. -9, -5, -4, 0, 4, 45 Put -67640, 0, 8 in increasing order. -67640, 0, 8 Sort -277, -3, -46 in decreasing order. -3, -46, -277 Sort 4, 1, -2, 620. -2, 1, 4, 620 Sort -10, -0.1, -1/5, 1.59, 0.3 in increasing order. -10, -1/5, -0.1, 0.3, 1.59 Put 13, -0.1, -9/32 in decreasing order. 13, -0.1, -9/32 Sort -2.308, 4, -3 in ascending order. -3, -2.308, 4 Put -0.12, -0.1, 1416 in decreasing order. 1416, -0.1, -0.12 Sort 5465, -4, -1, -13 in ascending order. -13, -4, -1, 5465 Put 8/9, 3/5, -4, -7, 9/2, 3 in increasing order. -7, -4, 3/5, 8/9, 3, 9/2 Sort 5, 3, 11, 4, 1 in descending order. 11, 5, 4, 3, 1 Sort 3, 1091, 2, -3, 5 in increasing order. -3, 2, 3, 5, 1091 Put 6, -0.36, -3/149, 4 in decreasing order. 6, 4, -3/149, -0.36 Sort 84, -9, -12, -3 in increasing order. -12, -9, -3, 84 Put 0.3, 1, -0.2, 0.13, 15 in descending order. 15, 1, 0.3, 0.13, -0.2 Sort 7/95, -1.8, 0.78. -1.8, 7/95, 0.78 Put -2, 3/8, -5, 22048 in decreasing order. 22048, 3/8, -2, -5 Sort -2, 2, 4, 2010, 0 in decreasing order. 2010, 4, 2, 0, -2 Put -1, -3, 1, 52, -5, 6 in increasing order. -5, -3, -1, 1, 6, 52 Put -16, 1, 19, -5, 4, -9 in ascending order. -16, -9, -5, 1, 4, 19 Sort -229303, -27, -1 in ascending order. -229303, -27, -1 Put -151, -14, -5, 2, 3 in ascending order. -151, -14, -5, 2, 3 Put 4.2, 6/35, 3, 0, -0.3, 1 in decreasing order. 4.2, 3, 1, 6/35, 0, -0.3 Sort 3, -63, 16, -4, -2 in decreasing order. 16, 3, -2, -4, -63 Sort 3, -3/5, 16/43, -9, -0.08 in decreasing order. 3, 16/43, -0.08, -3/5, -9 Put -4, 0, 33, -6, 12 in ascending order. -6, -4, 0, 12, 33 Put 1, -4, 10098, -5 in decreasing order. 10098, 1, -4, -5 Sort 8340, -0.4, -2. -2, -0.4, 8340 Sort 4, 3, 517, -5, -2, -4 in descending order. 517, 4, 3, -2, -4, -5 Put 0, -69, -5, 10 in increasing order. -69, -5, 0, 10 Sort 5, -5, 325, 428, 4 in descending order. 428, 325, 5, 4, -5 Sort -1, 18, -2/5, 191 in ascending order. -1, -2/5, 18, 191 Put 2, 35.4, 6656 in decreasing order. 6656, 35.4, 2 Sort -1/3, -0.5, -5, -4.5, -4, 0.2 in descending order. 0.2, -1/3, -0.5, -4, -4.5, -5 Sort -37, -3, -2, -5, -17 in descending order. -2, -3, -5, -17, -37 Put 206, 9, 0, 4, -3, -4 in descending order. 206, 9, 4, 0, -3, -4 Put 0, -13, 4, -31, -5 in descending order. 4, 0, -5, -13, -31 Sort 23, -79, 25, -7 in decreasing order. 25, 23, -7, -79 Sort -2, -4308, 5, 1. -4308, -2, 1, 5 Put -49308, -1, 4, -4, -5 in decreasing order. 4, -1, -4, -5, -49308 Sort -6, 4, 3, 22, -2, -3 in increasing order. -6, -3, -2, 3, 4, 22 Put -8, 1/3, 30, -4, 5, 1/6 in descending order. 30, 5, 1/3, 1/6, -4, -8 Put -1, -1357, 2/15, -1/16 in descending order. 2/15, -1/16, -1, -1357 Put -5, -3, -26, -2, 4 in decreasing order. 4, -2, -3, -5, -26 Sort -24, -52, -3, 1 in decreasing order. 1, -3, -24, -52 Sort 3, -27971, -8, -2 in descending order. 3, -2, -8, -27971 Sort 4, 40/7, -7/4, -2. -2, -7/4, 4, 40/7 Put -1, -0.05, -13.7, -499 in decreasing order. -0.05, -1, -13.7, -499 Put 5, 188, 23 in increasing order. 5, 23, 188 Sort 0.2048, 0.1, -2/9 in ascending order. -2/9, 0.1, 0.2048 Put -3, 981, -16 in ascending order. -16, -3, 981 Put 789, 0.3, 100 in descending order. 789, 100, 0.3 Sort -1643, 1, -2, 4, 3 in increasing order. -1643, -2, 1, 3, 4 Sort -5, -5802, -4/11. -5802, -5, -4/11 Put -4, 2, 5, -13, -105 in decreasing order. 5, 2, -4, -13, -105 Sort 2, 3, -5, 19434. -5, 2, 3, 19434 Put -4, 1, 544163 in decreasing order. 544163, 1, -4 Put -1, 0, 75, 0.7 in descending order. 75, 0.7, 0, -1 Sort 678, -8, 1, -2, -0.5 in ascending order. -8, -2, -0.5, 1, 678 Sort 2, 25, -6, 23 in decreasing order. 25, 23, 2, -6 Put 0, -3, -4, 10, 1266, 1 in ascending order. -4, -3, 0, 1, 10, 1266 Sort -612, -0.1, 0.1, -0.47, 1/7 in increasing order. -612, -0.47, -0.1, 0.1, 1/7 Put 1/15, 5, 0, 6, 1 in decreasing order. 6, 5, 1, 1/15, 0 Put -2, 99/5, 0, 2/5 in descending order. 99/5, 2/5, 0, -2 Sort 0.1, 0.02, -1774, -0.2, 6, -1 in descending order. 6, 0.1, 0.02, -0.2, -1, -1774 Sort 9, -45/7, 0.06. -45/7, 0.06, 9 Put 0.2, 10, -262/81 in descending order. 10, 0.2, -262/81 Sort -0.814, 12, -2, -0.2, -0.8 in descending order. 12, -0.2, -0.8, -0.814, -2 Sort 0, 39, 5, 289, 2. 0, 2, 5, 39, 289 Put -23, 1/44, -0.1, 6 in descending order. 6, 1/44, -0.1, -23 Put 2208, 0, -6 in decreasing order. 2208, 0, -6 Sort 1/6, 1, 4035/7. 1/6, 1, 4035/7 Sort 307, -4355, -3. -4355, -3, 307 Sort -8, 9, 16, -3, 6 in descending order. 16, 9, 6, -3, -8 Sort 2, 3, 47, -1 in ascending order. -1, 2, 3, 47 Put 0, 11077, -5 in ascending order. -5, 0, 11077 Sort -3, -4693, 0, -5 in ascending order. -4693, -5, -3, 0 Put 4, 2, 313 in descending order. 313, 4, 2 Sort -0.1, -2, -0.2, -3/20, -4 in decreasing order. -0.1, -3/20, -0.2, -2, -4 Put 1.2, 0.5, 4, 46, 3 in increasing order. 0.5, 1.2, 3, 4, 46 Put -3/2, 1/7, -16, -2/7, 2 in decreasing order. 2, 1/7, -2/7, -3/2, -16 Put -4, 0.3, -40282 in increasing order. -40282, -4, 0.3 Put 0.84, -0.03, 50 in descending order. 50, 0.84, -0.03 Put -2, 1, 0.5328 in increasing order. -2, 0.5328, 1 Put 0.1, -0.9, 9, 1, 3 in ascending order. -0.9, 0.1, 1, 3, 9 Put -6, -1, -3, 37, 10, 4 in descending order. 37, 10, 4, -1, -3, -6 Sort -1, -11, -5, 3, 36 in decreasing order. 36, 3, -1, -5, -11 Sort -2/69, 1, 38, 4 in ascending order. -2/69, 1, 4, 38 Sort 15064, -1/34, -0.4 in decreasing order. 15064, -1/34, -0.4 Sort 12/695, -3, -0.1. -3, -0.1, 12/695 Sort -137/3, 1/10, -4, -0.02 in ascending order. -137/3, -4, -0.02, 1/10 Sort -7, 511, 3, -3, -0.3. -7, -3, -0.3, 3, 511 Sort 5, -2, 1, 78, 1/5 in ascending order. -2, 1/5, 1, 5, 78 Put -0.06, -66, -1, -1/18, 3 in ascending order. -66, -1, -0.06, -1/18, 3 Put 0.1, -1/405, 1, -5, 0 in ascending order. -5, -1/405, 0, 0.1, 1 Sort 26, -1, -19996. -19996, -1, 26 Put 3, 116, -116, 1 in decreasing order. 116, 3, 1, -116 Sort 5, -11, -3662 in descending order. 5, -11, -3662 Sort -0.5, 273, -2/13, -2/11, 38/5. -0.5, -2/11, -2/13, 38/5, 273 Put 2, -0.4, 212, -2/17, 11 in descending order. 212, 11, 2, -2/17, -0.4 Sort -5, -3649, -2, 2/13. -3649, -5, -2, 2/13 Sort 0.5, -11/8, -6, 2/5, -5. -6, -5, -11/8, 2/5, 0.5 Put -5, 10, -33, -1262 in ascending order. -1262, -33, -5, 10 Put -2/1655, -0.1, -2/141 in ascending order. -0.1, -2/141, -2/1655 Sort -2042, 2, -28. -2042, -28, 2 Put -4, 2/5, -19, 4, 9 in decreasing order. 9, 4, 2/5, -4, -19 Sort -862, 35, 0.3 in descending order. 35, 0.3, -862 Sort -3, -2, 0.1, 2, 79 in ascending order. -3, -2, 0.1, 2, 79 Sort -9/22, -3/56, -17/3 in descending order. -3/56, -9/22, -17/3 Sort -8, -11777, 4 in decreasing order. 4, -8, -11777 Sort 1167, 4, 87/4 in decreasing order. 1167, 87/4, 4 Put 88, 3, -1182 in decreasing order. 88, 3, -1182 Sort -1, 16, 148, 0 in decreasing order. 148, 16, 0, -1 Put 49529, 4, -4, 3 in descending order. 49529, 4, 3, -4 Sort 2, 3, 1774, -4, -2 in descending order. 1774, 3, 2, -2, -4 Put -1.4, -4, -2/9, 1.08, 9 in decreasing order. 9, 1.08, -2/9, -1.4, -4 Sort 5, 16, 46 in descending order. 46, 16, 5 Sort -0.17, 2/31, 44. -0.17, 2/31, 44 Put 0.2, -12/65, -1, 0.4, -5 in increasing order. -5, -1, -12/65, 0.2, 0.4 Sort 414/5, 0.5, 0.2, 0.4. 0.2, 0.4, 0.5, 414/5 Sort 25, 1, -154, -3, -4 in ascending order. -154, -4, -3, 1, 25 Sort -93/148, -3, -1/3 in descending order. -1/3, -93/148, -3 Put -2, -5, 10, -22 in decreasing order. 10, -2, -5, -22 Sort 4, 0.1, -2, 28, -16. -16, -2, 0.1, 4, 28 Put -0.3, -1944, -0.5, -1 in increasing order. -1944, -1, -0.5, -0.3 Put 1, 80063, 0, -5, -4 in ascending order. -5, -4, 0, 1, 80063 Sort -330, 0.5, -0.4, -1. -330, -1, -0.4, 0.5 Sort 4, -2/13, -14, -28, -3, 5 in descending order. 5, 4, -2/13, -3, -14, -28 Sort -22, 0.4, 4, 234, 2. -22, 0.4, 2, 4, 234 Put -1.	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.