Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
+ m - 1. Let y(f) = -5n(f) - 2x(f). Let j be (-10)/(-6) - 2/(-6). Calculate y(j). -3 Let j be 2/(-14) + 9/((-189)/(-87)). Let c be -9 - j/4-3. Let w(k) = -k. What is w(c)? 6 Let o(b) be the second derivative of -1/2b*2 + 3/4b*5 - 16b - 1/6b4 + 0 + 1/3b3. Determine o(1). 14 Let b = 1556 - 1545. Let g(x) = x3 - 12x2 + 11x + 14. Give g(b). 14 Let m(g) be the first derivative of -7g2 + 3g - 236. Determine m(1). -11 Suppose -127f + 126f = 3. Let v(g) = -2g - 4. What is v(f)? 2 Let c(s) = -s2 + s + 3. Let k(p) = 3p*2 - 2p - 7. Let l(m) = -5c(m) - 2k(m). What is l(-1)? -1 Let c(u) be the first derivative of u*2/2 + 2u + 1. Suppose 4a = -p - 15, -15p = -a - 11p + 9. Determine c(a). -1 Let s(c) = c2 - 9c - 6. Let n be 0/(12/(-3)) - -2. Suppose -4 = -nz + 14. Determine s(z). -6 Let v(r) = r - 5. Suppose 2j - 5 = -4f + 1, -12 = -4j - 5f. Let x(d) = d - 7. Let i(q) = jx(q) - 4v(q). What is i(4)? -5 Let h(l) = -9 - l2 - 2108l + 2103l - 6. Determine h(-6). -21 Let k = -4 + 3. Let p(s) be the third derivative of -s8/20160 - s7/2520 - s6/720 - s5/15 - 5s2. Let z(h) be the third derivative of p(h). Give z(k). 0 Let q(r) = r3 + 3r2 - 3r + 1. Let b(u) be the third derivative of -3/8u4 - 3u*2 + 0 + 1/60u*5 + 0u - 2/3u3. Let m be b(9). Give q(m). -3 Let y(w) = -w3 + 5w*2 - 2w - 4. Let s = -5 + 34. Let m = -25 + s. Give y(m). 4 Let g be (40/(-44))/(-5) - 1043/(-11). Let d(v) = 91v - 2 - gv - v*2 + 3. Calculate d(-3). 4 Let j(l) = 30 + 6l - l*2 - 28l*3 - l - 4l + 29l3. Give j(0). 30 Let g(h) = -h - 1. Let m be g(-2). Suppose 0 = 3k - 4n - 14, 5k = -0n + n + 12. Let c(q) = 5q*k + 1 - 4q*2 - 2q + 5q3 + 0q*3. What is c(m)? 5 Let v(z) = 16z - 70. Let w be v(4). Let r(d) = -3d - 8. Give r(w). 10 Suppose 4l - 2b - 20 = -b, -4l + 4 = 3b. Let f(g) be the second derivative of -1/6g*3 - 2g + 1/12g4 + 0 - 5/2g*2. Give f(l). 7 Let q = 10 + -6. Let a(z) = 7 + z + 11z*2 - qz + 9z - 2z3. Let l be a(6). Let x(g) = -g3 + 6g2 + 7g + 4. Give x(l). 4 Suppose 2w = -3w + 10. Suppose 0 = 4o - wo. Let k(v) = v*2 + v - 6. Calculate k(o). -6 Let s(v) = -11v*2 + 8 - 27v - v*3 + 2v*3 + 45v - 19v. What is s(11)? -3 Let s(z) = -z2 - 10z - 2. Let f be s(-7). Let l = 15 - f. Let w(v) = -7v2 - 7v + 1. Let h(d) = -4d2 - 4d + 1. Let r(g) = 5h(g) - 3w(g). Give r(l). 14 Let r(c) = -c*2 - 3c + 12. Let s = -33 - -28. Let u be r(s). Let n(m) = -m*3 - 2m + 2. Determine n(u). -10 Suppose -3n + 2u - 4 = 0, -2n - 3u - 24 = n. Let b(q) = -q*2 - 4q - 2. What is b(n)? -2 Let d(s) = -s*3 - 2s*2 + s + 4. Suppose -5h = 3u - 5 - 5, 4u - 4 = -2h. Suppose 7 - h = -5y + 5t, -3y - 2t = 13. What is d(y)? 10 Let g(c) = 3c + 4. Let i be g(0). Suppose -4o - 5b - 5 - 1 = 0, -3o - ib = 5. Let u(l) = -6l2 - l. Give u(o). -7 Let j(h) = -h3 + 5h*2 + 8h + 4. Let p be 9 - ((3 - 0) + -3 - -3). Determine j(p). 16 Let a be (-13)/(-221) + (-103)/17. Let l(i) = -2i2 - 11i - 9. Determine l(a). -15 Let v(w) be the first derivative of -6w2 + w + 15 + 5w*2 + 8w + 5w. Give v(10). -6 Suppose 2r - s = -7, -1 = -3s + 8. Let x = r + 5. Let g be x/(-2) - 10/(-20). Let c(y) = y2 - y - 1. Determine c(g). 1 Let p be 133/28 + (-5)/(-20). Let k(f) be the third derivative of 1/30f*p + 1/6f*3 + 0 - 1/24f*4 - 2f*2 + 0f. Give k(1). 2 Suppose 2k + 8 = -2k + 4p, -5k - p - 10 = 0. Let b(a) be the third derivative of 1/8a4 - 2a*2 + 0 + 0a + 1/30a5 + 1/2a*3. Give b(k). 5 Let b(w) = 17w*2 - 15w + 1. Let v be b(1). Let m(o) = -4o - 2. Determine m(v). -14 Let u(t) = 286t*2 - 285t2 - 10 - 11 + t3. What is u(0)? -21 Let q = 81 - 77. Let y(a) = 13a2 + 9a - 9. Let u(r) = 7r2 + 5r - 5. Let x(b) = qy(b) - 7u(b). What is x(2)? 13 Suppose 2v + 2v + 9 = -c, -13 = 3c + 5v. Suppose -r - 6 = 9m - 10m, 5r - 3m + 28 = 0. Let a = r + c. Let u(d) = -2d - 7. Give u(a). 5 Let i(u) = u3 - u2 - u. Let v(r) = 9r*3 - 11r*2 - 8r + 1. Let m(w) = 7i(w) - v(w). Suppose -4f = 5s - 1 + 14, 2f - 11 = s. Give m(f). -16 Let z(r) = -1292r. Let n(s) = 54s. Let u(d) = 95n(d) + 4z(d). Determine u(-1). 38 Suppose -10l = -14l + 4. Let h(j) be the second derivative of -j*4/12 + 15j. Determine h(l). -1 Let m(b) = 11b - 4. Let h(y) = 40y - 124. Let v be h(3). Calculate m(v). -48 Let l(z) = z*2 - 5z - 4. Let q(o) = -3o2 + 11o + 9. Let s(f) = -13l(f) - 6q(f). Let c(k) = -10k2 + 2k + 5. Let p(y) = -3c(y) - 7s(y). Give p(1). -5 Let j(v) be the third derivative of v*6/120 - 4v*5/15 - 17v4/24 - v3/2 - 19v2. Let g be j(17). Let x(z) = 4z - 1. What is x(g)? -13 Suppose -2 = -2q, -6q - 5 = 3s - 2q. Suppose 0p - 7p = -35. Let k(u) = 154u2 - 76u*2 - 77u2 + u3 - 2 - pu. Give k(s). -5 Let a(c) = 5c*3 - 2c*2 - 10c + 12. Let q(n) = -4n3 + n2 + 9n - 11. Let o(z) = -5a(z) - 6q(z). Let x be -213/((-117)/18). Give o(x). -10 Let w(l) = 0l + 3 + 0 - 5l. Let b(i) = -68i + 139. Let v be b(2). Determine w(v). -12 Let v(l) = -l*3 + 3l*2 + l + 3. Let c = -33 - -87. Let q be -4 + (1 - c/(-3)). Suppose -r = 3u - q, -16 + 2 = -2r - 2u. Give v(r). 6 Let y(f) be the second derivative of -f*5/20 + 3f4/4 - f3/6 + 13f2/2 - 3f - 81. Determine y(9). 4 Let t(o) = o*2 - 6o - 9. Let g be (2 - (-5)/(-3)) + (-143)/(-39). Suppose 40 = gv - 4w, -4v + 3w + 0w + 37 = 0. Calculate t(v). -2 Let r(j) be the third derivative of 12j*2 + 1/12j*5 + 0j + 0 + 1/3j3 + 1/120j*6 - 5/24j4. Determine r(-6). -4 Let m(a) = -a2 + 21a + 42. Let l be m(23). Let k(z) = 12z + 6. Give k(l). -42 Let z(o) = -o*2 + 7o + 9. Let k be (-14)/((-8)/24 - 10/6). Determine z(k). 9 Suppose 34u - 21u = 91. Let p(r) be the second derivative of -r*5/120 + 11r4/24 + r3/6 - r. Let n(g) be the second derivative of p(g). Give n(u). 4 Let k be 9/5(-9 - -14). Let q(l) = -8l - 3l + 9 + l2 + 2 - 1. Determine q(k). -8 Let j(z) = 2z*2 + 4z - 1. Let v be 7 - (-3 + 1 - -5). Let y be v/8 + (-29)/2. Let k = -17 - y. Give j(k). 5 Let h = -442 - -887/2. Let u(g) be the first derivative of 7g - 6 - hg*2 - 1/3g*3. Give u(-5). -3 Let k(q) = -3q + 5. Let p(m) = -2m2 - 11m - 5. Let r be p(-5). Determine k(r). 5 Let s(l) be the third derivative of l*6/720 - 5l*4/8 - 14l*2. Let w(c) be the second derivative of s(c). Suppose 0 = 4z - 3z + 4. Give w(z). -4 Suppose s + 3s = 36. Let m be 3/s - (-2)/(-6). Let i(u) = -15u2 - 11u + 22. Let q(w) = 7w2 + 5w - 11. Let a(d) = 6i(d) + 13q(d). What is a(m)? -11 Suppose 12i = 7i + 400. Let t(k) = 1 - 76k2 + ik*2 + 2 - 3k. Suppose -3n + 5n = 4. Give t(n). 13 Let m(q) be the second derivative of q3/6 - q2 - 2q. Suppose 3s - 11c = -6c, -c = -3. What is m(s)? 3 Let q = 2 + -5. Let p(t) be the first derivative of -t*2/2 - 4t + 23. Give p(q). -1 Let l(x) = 2x + 99x*2 - 1 + 67x*2 - 148x*2. What is l(-2)? 67 Let f = -6 - -8. Suppose z - 29 = -3k, -3k + 52 = fk - 2z. Let m(s) = s + ks*2 + 2s + 2 - s*2 - 8s*2. Determine m(-2). 0 Let d(m) = -2m + 26. Suppose 5u - 76 = -2b - 2b, 3u - 3b = 51. What is d(u)? -6 Let x(y) be the third derivative of -1/120y*6 + 1/2y*3 + 1/24y*4 + 1/60y*5 + 0y + 0 + 30y2. Calculate x(3). -12 Let x(p) = 2p*2 + 7p - 1. Let v be x(-4). Suppose w + s - 16 = -vs, s + 5 = 2w. Let h(r) = r*3 - 4r*2 + 2r + 2. Give h(w). 10 Let a = 1607 + -1615. Let x(q) = -q*2 - 9q - 3. Calculate x(a). 5 Let j = -166 - -171. Let g(a) = a*3 - 4a2 - 1. Give g(j). 24 Let j(u) = -u2 + 5u + 7. Suppose 5i - 227 = -4a, 3i + 2i + a = 233. Suppose 0 = 5r - i + 22. Give j(r). 7 Let g(l) be the first derivative of -l*4/4 + 4l*3/3 + 2l*2 + 3l + 2. Suppose t + 32 = -5v - 216, 98 = -2v - t. Let k = v - -55. Calculate g(k). -2 Let y(z) = 2z - 4. Let m(a) = 4a - 9. Let i(f) = 3m(f) - 7y(f). Determine i(3). -5 Let a(h) = 19h2 + 2h + 1. Let o(y) = -4y2 + 35y + 2. Let n be o(9). Let x be 8/28 + 1/n9. What is a(x)? 18 Let f(s) = 2s + 13. Let v be (-6)/(-16) + 595/(-136). Calculate f(v). 5 Let l(j) be the first derivative of -j*4/4 + 3j3 + j2 - 9*j - 41. Calcul	{ "pile_set_name": "DM Mathematics" }
-0x + x for x. -1 Let f(m) = 2m*2 + 2m - 4. Let s be f(-3). Let z(y) = -4y + 18. Let u be z(4). Solve -s = 2o + uo for o. -2 Suppose 7 = -q + 2q. Let h(x) = -x + 9. Let w be h(q). Solve 0 = wi - i - 2 for i. 2 Let f = -17 - -17. Solve -6m + m + 25 = f for m. 5 Let q = 10 - 9. Suppose 19 = 4h - 3p, -6 = -h + p - q. Solve 2s = -2s - h for s. -1 Suppose -i + 0 = 2. Let m be -24(24/(-9) - i). Let f = m + -5. Solve -9 = 5c + f for c. -4 Let x be 5 - -2 - (-4 + 8). Suppose 13 = 2a - x. Solve -3r - r + a = 0 for r. 2 Let g = 8 - 5. Solve -gz = -2z + 2 for z. -2 Suppose 2w = 5 + 3, 2r = 3w. Solve g = -g + r for g. 3 Suppose -134 = 2l + 36. Let u = 121 + l. Suppose 0 = t + 2t - u. Solve 0 = 5a - 3 - t for a. 3 Let n be ((-16)/10)/(12/(-30)). Let z(u) = -u*2 - 5u - 1. Let j be z(-3). Suppose 4t - l + 5l = -12, nt = -jl - 17. Solve -3f = tf for f. 0 Suppose 0 = -5i + 6 + 4. Solve -4g = i + 2 for g. -1 Suppose -5l = -26 - 39. Let g = l + -11. Solve -4 - g = -3s for s. 2 Suppose -i + 2d = -d + 12, 3i + 4d - 29 = 0. Let x(b) = b3 - 8b*2 - b. Let u be x(8). Let t = u - -9. Solve p + t + i = 0 for p. -4 Let x = -4 + 8. Suppose -2g + 5z = -61 + 23, xg = -2z + 52. Suppose -2c = -g - 2. Solve a - c = -a for a. 4 Let t(g) = g. Let l be t(3). Let o = 2 + 1. Let q = l - o. Solve q = z + 1 for z. -1 Let z be (2 - -3)/(-5 + 6). Solve -u + z = -6u for u. -1 Suppose -3i + 6i - 9 = 0. Suppose -2o + 5 = io. Let p(r) = -r2 - 9r - 9. Let k be p(-6). Solve 0 = -5j + k + o for j. 2 Let n(u) = 1 + u2 + 4u2 - u3 - 2u + 0u. Let a be n(2). Let h = a + -5. Solve 0 - 12 = -hm for m. 3 Let o be ((-8)/(-6))/(4/12). Suppose -ou - 4 = -32. Let i(y) = y*2 - 5y - 9. Let f be i(u). Solve 0g = g + f for g. -5 Suppose 0 = 3a - 7a + 24. Suppose -3i = -0i - a. Suppose iz + 8 = 3w - 0w, -z - 1 = -w. Solve 2q - 20 = wq for q. -5 Let v(o) = o*3 + 16o*2 - o - 15. Let h be v(-16). Let q be (1 - 6)/(0 - h). Solve 0 = 4w + q + 3 for w. -2 Let d(k) = -3k3 - 7k*2 + 2k*3 - 4 - 3k*2 - 10k. Suppose -3b - 37 + 10 = 0. Let s be d(b). Solve 3y = s + 4 for y. 3 Suppose 2 = 3l + f - 0, -3l + 2f = -5. Solve -4y = -l - 11 for y. 3 Let a = -1 - -16. Suppose -8y = -3y - a. Solve -yn - 20 = 2n for n. -4 Suppose 4j - 3r + 8 = 44, -2j + 24 = -3r. Solve -v - v = j for v. -3 Let k = -4 + 11. Suppose 0 = 3w - k - 5. Solve -d - wd = -25 for d. 5 Let p be 1 - -1 - (0 - 0). Let n = -7 - -3. Let s = -4 - n. Solve s = -pi + i for i. 0 Let p = 5 - 1. Suppose 4q = 7a - 2a - 25, -5q - pa + 20 = 0. Suppose 1 = 4h + 5, q = 3i - 2h - 8. Solve -5o + i = -8 for o. 2 Suppose 12 = -4p - 0p. Let a be (2 - 12/p) + -4. Solve -3h = ah + 10 for h. -2 Let s(m) = m*2 - m - 1. Let w(f) = -5f*2 - 2f + 3. Let b(c) = 4s(c) + w(c). Let g be b(-5). Let j = g - 2. Solve a = 2a - j for a. 2 Let k = -2 + 8. Suppose -3u - 2m - k = 0, -2 = 2u + 5m + 2. Let q = 0 - u. Solve 0 = -5x - q - 8 for x. -2 Let g = -2 - -23. Let d be (-60)/(-14) - 6/g. Suppose -2h - 2h + 12 = 0. Solve hl - dl = -4 for l. 4 Let h(l) = 4l - 1. Let u = 6 + -7. Let z be h(u). Let j be ((-4)/(-10))/(z/(-50)). Solve 0 = 6d - 2d - j for d. 1 Suppose 0u + 3y + 30 = 5u, -u = y - 6. Let n = -5 + u. Solve -2g - n = -7 for g. 3 Let m be (-1)/(-8) - 658/(-112). Suppose -4d + 2 = -14. Solve -m + d = -h for h. 2 Let a(h) = 5h3 - h2 + 2h - 1. Let i = -6 - -10. Suppose 4n - i + 0 = 0. Let w be a(n). Solve -25 = -wy - 0y for y. 5 Let t = 9 + 2. Solve t = 5r + 36 for r. -5 Suppose 4b = -0b + 8. Solve by + 6 = 4 for y. -1 Suppose 0 = 4g - 7g - 6. Let a = g + 5. Solve -af - 3 = -0 for f. -1 Let b(k) = k2 - 4k - 9. Let f be b(-2). Solve a - fa - 2 = 0 for a. -1 Suppose 0 = 3w - 5b + 5, 2b - 4 = b. Suppose w = -l + 10. Solve 3s = 2s - l for s. -5 Let g(q) = -5q2 - q. Let n be g(-1). Let m be n + 6 - (-1 + 1). Suppose -w = -mh + 1, 3h + 2 = 3w - 1. Solve s = -hs for s. 0 Suppose 0 = -s - q - q + 12, 9 = -3s + 3q. Solve -t + s = -2 for t. 4 Let r = -90 - -102. Suppose -3 = 3m - 4m. Solve r - 3 = -mh for h. -3 Let u(l) = l*3 - 2l*2 - 7. Let t be u(5). Let v = -46 + t. Suppose 2o = -3f + 6o + v, -o = -2f + 8. Solve 2n + 12 = -fn for n. -3 Let m be 2/(-9) - (-195)/27. Solve -m = 4w + 5 for w. -3 Let u = -26 - -63. Suppose 5i - 1 + 7 = -2k, u = 3k - 4i. Let t be 3/(-6)(-2 + 2). Solve -5w + kw + 8 = t for w. -4 Let c(z) = -z2 - 10z + 2. Let m be c(-10). Solve -q - m = 2 for q. -4 Suppose 0 = -13q + 90 - 25. Solve -qs = -8 - 12 for s. 4 Let z(k) be the first derivative of -k4/12 - k3 - 3k2 + 2k + 2. Let c(u) be the first derivative of z(u). Let v be c(-4). Solve -va = -6a for a. 0 Let h = -45 - -60. Solve 0 = 3r + 3 - h for r. 4 Let t(w) = -w3 - 8w*2 - w - 6. Let o be t(-8). Suppose 3s - 9 = h, os = -0s - h + 6. Let m be (s + -2)/(2/8). Solve -16 = -3r - m for r. 4 Let j = 4 - 1. Let a(i) = 2 + 4i + j - 4. Let n be a(1). Solve 0b = -nb for b. 0 Suppose 0 - 2 = g. Let j(i) = -i*3 + 2i - 1. Let r be j(g). Suppose b - 3 = 7. Solve 0 = -ru + u - b for u. -5 Suppose -d - 6 = -13. Solve -f - 2 + d = 0 for f. 5 Let z(m) = -m3 + 3m*2 + 9m + 6. Let r be z(5). Solve -r = 3q - 13 for q. 4 Let m be (-8)/(-21/1). Suppose -3y + 11 = -7. Let s(b) = -b3 + 7b*2 - 6b + 2. Let a be s(y). Solve mn = 5n - a for n. 2 Let c = 74 - 66. Solve -w = -5w + c for w. 2 Let j be (1 - -3) + -2 + 18. Let p(s) = -s2 - s. Let n(c) = -3c + 1. Let q(u) = n(u) + p(u). Let i be q(-3). Solve ik - j = -0k for k. 5 Let s be 18-3(-3)/9. Let x = s - 13. Solve -xp - 6 = 4 for p. -2 Let k be (-1)/(-2)(-3 + 3). Solve k = i - 6i - 20 for i. -4 Let m(d) = -d3 + 7d*2 - 4d - 4. Let c be 0 - (3 + -6 - 3). Let f be m(c). Solve 3i - f = -2 for i. 2 Let y = 14 + 6. Solve -3q = q - y for q. 5 Let g be (-28)/(-126) - (-212)/18. Let q be (-1 + 26)g/15. Solve 0i + 4i + q = 0 for i. -5 Suppose 0 = 4i - 7 - 13. Solve -f = -if + 4 for f. 1 Suppose 3v + 4i = 5i + 19, 7 = -v - 3i. Solve -5x = -v - 0 for x. 1 Suppose -50 = -4z + 2. Let u = 15 - z. Solve 0 = -0p + p + u for p. -2 Let t(a) = -a*3 + 5a*2 + 10a - 9. Let h be t(6). Let m be 6/h + 8/5. Let l be -5 + m + 5 + -1. Solve 0 = -p + l + 4 for p. 5 Let m be (-18)/24 + (-11)/(-4). Solve -w = mw for w. 0 Suppose -3 - 15 = -2l. Let t = l + -7. Suppose -3v - j + 20 = -tj, 2v - 25 = 3j. Solve vq = 3q + 8 for q. 4 Suppose h = 4h - 15. Suppose -2z = -b - h, -2z = b + z - 10. Let t = 4 - 4. Solve t = 2k - 9 - b for k. 5 Let g be (64/40)/(2/5). Suppose -2s = 3x - s - 10, -gs + 24 = 4x. Solve xu = 6u + 16 for u. -4 Let j = 10 + -9. Let g be j3 + (-18 - 5). Let m = g + 35. Solve -c + m = -4c for c. -5 Let h be 8(-2 + (-15)/(-6)). Let k(t) = -t3 + 3t*2 + 3t + 4. Let w be k(h). Suppose w = -4m - 3i + 66, -4m + 3i + 69 = m. Solve 4a + a - m = 0 for a. 3 Let b be (-2)/(-3) + (-43)/(-3). Let v be (-5 - -9)/(1 - -1). Suppose 2m + 2q - 4 = 0, 2m - v - 11 = q. Solve mh - 5 - b = 0 for h. 4 Let i = -11 + 20. Let q = 6 - 4. Suppose -qj + i = -1. Solve -3 = -jc + 2 for c. 1 Let t be (-24)/(-9)(-18)/(-8). Let v = t + -2. Let y(a) = -2a - 1. Let c be y(-1). Solve vp + 5 - c = 0 for p. -1 Suppose -q + 5k = 2q - 9, -9 = -3q + k. Let g = 11 + -6. Solve q = -go + 2o for o. -1 Let z(j) = j3 - 7j*2 - 3. Let n be z(7). Let f = n + 5. Solve 1 = fi - 1 for i. 1 Let u = -30 - -32. Solve n - u = -0n for n. 2 Suppose -6u + 3u = -0u. Solve u = -4n + 4 - 8 for n. -1 Suppose 4d = -d + 30. Suppose dl - 12 = 3l. Suppose -ls = -s. Solve sb - b = -3 for b. 3 Let g = -1 - -7. Let n be (2/4)/(1/g). Solve 5q + n - 13 = 0 for q. 2 Let h be 0/(-2)(-1)/(-2). Suppose h = -4f + 3f. Suppose 3u + 2 - 8 = f. Solve 4 = -ua + 10 for a. 3 Let l(m) = 2m + 10. Let o be l(-3). Solve 0r + r - o = 0 for r. 4 Let j(z) = z + 7. Let b be j(10). Solve 4q + b = -3 for q. -5 Suppose -5g + 30 = -0g - 5o, -4o - 10 = -2g. Let k = 12 - g. Suppose 0p + 19 = 3p - kh, -5p + 19 = -2h. Solve -1 = -4v + p for v. 1 Let h(y) = 5y2 - y3 + 2y*3 + 0 - y - 5. Let f be h(-4). Suppose -n + 3n - 12 = -3b, 0 = 4b + 2*n - 16. Solve -	{ "pile_set_name": "DM Mathematics" }
base 11, what is 2 - -1129a? 112a1 In base 7, what is 2 + -13004165? -13004163 In base 13, what is -3a911 - 1? -3a912 In base 11, what is 10364 - -75? 10429 In base 8, what is -10306 - 202? -10510 In base 5, what is -1301213 + -14? -1301232 In base 2, what is 100110 - -1010000101100? 1010001010010 In base 5, what is 123 - -114221? 114344 In base 14, what is -1411899 + 4? -1411895 In base 12, what is 503784 + 4? 503788 In base 5, what is -43113 - 42? -43210 In base 11, what is 963 + 119? a81 In base 5, what is 24131 + 1402? 31033 In base 16, what is -3 - 2c2a? -2c2d In base 6, what is -1044 + 2451? 1403 In base 14, what is -90ba - -b? -90ad In base 9, what is -106 + -1883? -2100 In base 7, what is 2152455 - 1? 2152454 In base 4, what is -33 + -303002? -303101 In base 3, what is -211 + 202001121? 202000210 In base 4, what is -221223130 - -3? -221223121 In base 9, what is -20132 - 8? -20141 In base 3, what is -2102020221 - -1101? -2102012120 In base 12, what is -76b15 + -8? -76b21 In base 6, what is -5 + 453531? 453522 In base 2, what is -1100000 - -10100111010011? 10100101110011 In base 3, what is -1020222120 + -122? -1021000012 In base 2, what is -10 - -110110101110? 110110101100 In base 16, what is -151c + 34? -14e8 In base 15, what is 107c + 8? 1085 In base 2, what is -10111101 - 10111010? -101110111 In base 2, what is 10 + 1000011110101001001? 1000011110101001011 In base 8, what is 50 + 107? 157 In base 13, what is -2 + -494bb6? -494bb8 In base 9, what is 16 + -1674? -1657 In base 2, what is 1010011100 - 11101010001? -10010110101 In base 6, what is 30530 + 2? 30532 In base 8, what is -362406 - 1? -362407 In base 8, what is 70007 - -13? 70022 In base 14, what is a9b84 - -5? a9b89 In base 16, what is -503 + -9b? -59e In base 7, what is 160300 - -5? 160305 In base 5, what is -1244311 + -22? -1244333 In base 5, what is -141121 - -42? -141024 In base 10, what is 53 - -439? 492 In base 12, what is 0 + 642b? 642b In base 6, what is 11 + 3455315? 3455330 In base 12, what is -231 - -35? -1b8 In base 10, what is 195 + -10? 185 In base 3, what is 11 - 10120110010012? -10120110010001 In base 6, what is -544503 - 54? -545001 In base 3, what is 10110210 + 2? 10110212 In base 10, what is 9 - 4861? -4852 In base 12, what is -b6 + -6a76? -6b70 In base 7, what is 12 + -50613? -50601 In base 9, what is -3384 + -400? -3784 In base 8, what is 4052 + 2072? 6144 In base 7, what is -2403 - -200? -2203 In base 8, what is -41776 - -2? -41774 In base 15, what is 40 + 11e? 15e In base 3, what is 10 + -12122212111? -12122212101 In base 14, what is 6 + -c8a77? -c8a71 In base 5, what is 10 - -1321331? 1321341 In base 12, what is 314a + 9a? 3228 In base 15, what is -27975 + 3? -27972 In base 16, what is 2a + -16f2? -16c8 In base 3, what is 222101000 + 11? 222101011 In base 11, what is 1 - 27671? -27670 In base 3, what is 1021 - -20221002021? 20221010112 In base 15, what is -8a105 + -1? -8a106 In base 8, what is 17221 - -3? 17224 In base 10, what is -4 - -20291? 20287 In base 12, what is 24 + 490? 4b4 In base 12, what is 5b6 - 36? 580 In base 4, what is 11102132232 + 2? 11102132300 In base 10, what is 2 - -67238? 67240 In base 10, what is 1 + 13038? 13039 In base 6, what is -210143 - 14? -210201 In base 13, what is -11 + -38a9? -38ba In base 10, what is -296 + -5618? -5914 In base 7, what is 145 + -223364? -223216 In base 10, what is 7152 - 5? 7147 In base 15, what is 3 + 546bb? 546be In base 10, what is -9018 + 25? -8993 In base 7, what is -2 - -51244? 51242 In base 5, what is -224 + 1240? 1011 In base 12, what is -3560 - -1? -355b In base 3, what is 2 + -22122122? -22122120 In base 14, what is 935 + 690? 11c5 In base 14, what is 221 + -764? -543 In base 3, what is 1011000 + -1012002? -1002 In base 14, what is 2 - 3d? -3b In base 11, what is -1 + -1a900? -1a901 In base 9, what is -1 - 62485? -62486 In base 6, what is 2550 + -11000? -4010 In base 11, what is -18 + -3911? -3929 In base 11, what is -451 - 110? -561 In base 9, what is 2 - 138338? -138336 In base 14, what is -d8 + 1278? 1180 In base 8, what is 0 - 16533? -16533 In base 4, what is 0 - -10311222? 10311222 In base 13, what is -13455a - 1? -13455b In base 16, what is aa8 - -5d? b05 In base 14, what is -d3 - -241d? 232a In base 8, what is 5 + 100016? 100023 In base 16, what is 52f7 + -4? 52f3 In base 3, what is -121202 + -1111022? -2010001 In base 7, what is 40 + -1642? -1602 In base 9, what is -81033 + 1? -81032 In base 10, what is 83 + -155? -72 In base 15, what is 3 + e893d? e8941 In base 2, what is 1011110110111010011 - -10? 1011110110111010101 In base 2, what is 110111110000100000 + -100? 110111110000011100 In base 2, what is 110 + -100010000111? -100010000001 In base 14, what is 34504b - 3? 345048 In base 13, what is 557 + -68? 4bc In base 12, what is 16 - -261b? 2635 In base 11, what is 3 - 159? -156 In base 13, what is -3 - -3132? 312c In base 13, what is 7 + 62857? 62861 In base 3, what is -1 + -12010102121? -12010102122 In base 7, what is 6300442 + -4? 6300435 In base 6, what is -105 + -121200? -121305 In base 13, what is -22 + 235? 213 In base 10, what is -1324 + -2536? -3860 In base 15, what is 1 + -d02c? -d02b In base 9, what is 134838 - -3? 134842 In base 2, what is -11011011110111 + -1101? -11011100000100 In base 2, what is 110010100010001011 - 0? 110010100010001011 In base 12, what is 66 + -177? -111 In base 9, what is 0 + 64661? 64661 In base 13, what is -264 + -125? -389 In base 14, what is -4 - -5100? 50da In base 5, what is 3001 - 41? 2410 In base 12, what is 2 + -7118? -7116 In base 4, what is -33020122 - 3? -33020131 In base 14, what is 3 + -61066? -61063 In base 6, what is -1 + -451154? -451155 In base 4, what is -220101 - 20121? -300222 In base 11, what is 2 - 2501a3? -2501a1 In base 5, what is 2 + 41233? 41240 In base 14, what is da213 - 1? da212 In base 14, what is -12599 + -5? -125a0 In base 3, what is 1 - 1112201? -1112200 In base 13, what is 3901 + 6? 3907 In base 16, what is -1 + -4c23e? -4c23f In base 16, what is -4bc - 3f? -4fb In base 13, what is 1b2 - -100? 2b2 In base 14, what is -13 + 4758? 4745 In base 3, what is 1021 - 10011001? -10002210 In base 14, what is d11 + 11c? 102d In base 8, what is 12 - 217035? -217023 In base 10, what is -374816 - -3? -374813 In base 4, what is 333 + -310122? -303123 In base 16, what is -1 - -e4bf6? e4bf5 In base 10, what is -3 + 640020? 640017 In base 6, what is -1105 - -100115? 55010 In base 3, what is 1 + 112022001111? 112022001112 In base 2, what is 100 + -1101001001110110? -1101001001110010 In base 13, what is -6ab7b + -b? -6ab89 In base 9, what is -6 + 7636? 7630 In base 8, what is 4306 + -424? 3662 In base 14, what is 33 - 214? -1c1 In base 8, what is 6 - -50244? 50252 In base 6, what is -204 + 2414? 2210 In base 13, what is 15 + -10b7a? -10b65 In base 2, what is 111011011111 + 1? 111011100000 In base 7, what is -32530 - -20? -32510 In base 5, what is 332213044 - 2? 332213042 In base 5, what is -2331 - 43424? -101310 In base 2, what is 1001011101001 + 11? 1001011101100 In base 8, what is -113701 - 2? -113703 In base 7, what is 1042636 + 3? 1042642 In base 13, what is 4 + 11b6c? 11b73 In base 16, what is 0 + -3112c? -3112c In base 16, what is -39a96a - -2? -39a968 In base 5, what is -1010 - 111? -1121 In base 3, what is 11210022200 + 2? 11210022202 In base 10, what is -12340 - -82? -12258 In base 11, what is 823897 + -5? 823892 In base 8, what is -36 + 27071? 27033 In base 7, what is -1054 + -45? -1132 In base 2, what is 1111011 + 100100010? 110011101 In base 15, what is 3038 - -15? 304d In base 4, what is -220122 + 2002? -212120 In base 4, what is -2332 + -1002320? -1011312 In base 16, what is e2b - -1c? e47 In base 10, what is 1753323 - -5? 1753328 In base 8, what is 10530 - 67? 10441 In base 12, what is -1b + -1604? -1623 In base 12, what is 3 + 3398? 339b In base 6, what is -12 - -140300? 140244 In base 7, what is 110620 + 241? 111161 In base 9, what is 16 - -447? 464 In base 9, what is 1311 + -7? 1303 In base 11, what is -7 + 484a8? 484a1 In base 16, what is 199e3 - -9? 199ec In base 9, what is -12 - 20154? -20166 In base 16, what is 1 + -1944? -1943 In base 9, what is 5 - -183378? 183384 In base 4, what is 333233 - 22? 333211 In bas	{ "pile_set_name": "DM Mathematics" }
positive. c*(383/6) Simplify (uuu(1/8)u)/(u/(u/(uu(-24)uuu)))(uu*15u)/(uu(1/10)uu) assuming u is positive. u(1481/40) Simplify (((qq(-7))/((q(-7)q)/q))/((q1q)/(q3/q)))(-49) assuming q is positive. q*(-49) Simplify ((jj5)/(j/j21))(-45) assuming j is positive. j(-1170) Simplify (d/d*(-4/21)d(7/6))38 assuming d is positive. d(627/7) Simplify (d(1/6)d(dd4/d)/dd*(2/5)d/d8)(-26) assuming d is positive. d(949/15) Simplify (l(1/20))*18(l(-10)/l)(-8) assuming l is positive. l(889/10) Simplify (((w/(w/(w/((w(2/7)w)/ww))))/ww)/w)22/((ww*(-1/6)w)/w)35 assuming w is positive. w(-2413/42) Simplify (((y(3/10)/y)45)48)49 assuming y is positive. y(-74088) Simplify ((m/(m(-3)/mm))/m17)/(m(2/7)/mmm)16 assuming m is positive. m(-235/7) Simplify (z/(z(1/5)z)z)/(zz*(-2/29))(zz6)/z(3/2) assuming z is positive. z(1557/290) Simplify (((a/(a/a(-3/35)))/a)(-6/5))(-1/24) assuming a is positive. a(-19/350) Simplify (h(-8/5))(-3)(hhh/h*(-2/11)h)(3/7) assuming h is positive. h(2538/385) Simplify (r/(r*(-3/7)rr))(1/17)r(-14)/(r/(r/((r/(r(1/7)r))/r)r)) assuming r is positive. r(-1415/119) Simplify (z/z(5/4))/(z/z*10z)z/(z/z(7/6))z(-2/19) assuming z is positive. z(2009/228) Simplify (t(-14/9)/(t/t9))43 assuming t is positive. t(2494/9) Simplify ((v*(-1)/vv)*(-3/8)v/(v/(v*1v)v)vvvv(v(-7)/v)/v)(-24/5) assuming v is positive. v(87/5) Simplify (i(-3))(-6)/((i/i(5/6))/i10) assuming i is positive. i(167/6) Simplify (g(1/27))15/((((g/(gg(-3/23)g))/g)/g)/g(((g/((g/g(4/19))/gg))/g)/g)/g) assuming g is positive. g*(28375/3933) Simplify (gg/(gg/(g(1/5)g)g)g(-2/3))/((g(-2/5)g)/(g(-5/3)/g)) assuming g is positive. g(-56/15) Simplify ((rr*(-17/2)rr)(-2/89))40 assuming r is positive. r(440/89) Simplify (((g(ggg/g0)/g)/g0)(-1/17))(-47) assuming g is positive. g(141/17) Simplify (u(4/3)uu*(-34/5))/(uuu(1/10)uu((uu(2/7)u)/u)/uu) assuming u is positive. u(-2069/210) Simplify ((l(-2/7)l/((ll/(ll*(-2/7)/ll))/l))/((l/(lll*(-7))l)/(ll(-4))))(-1/8) assuming l is positive. l(67/56) Simplify ((((((hh*(-2)h)/h)/hhh)/h)/(h(h(-3/4)/h)/hh))/((h*0/h)/(hh/h(-9))))(3/20) assuming h is positive. h(141/80) Simplify (((b/(b2bb))/b(-11))(-4/13))(2/23) assuming b is positive. b(-64/299) Simplify u*(-2/3)(uu(-4))/u(uu(-2))(-32) assuming u is positive. u(82/3) Simplify (ww*(-3/2)(ww(-1/6)w)/ww(-3/7)w2)(-9/4) assuming w is positive. w*(-30/7) Simplify (ll*0/ll)*(-2/7)l/(ll3l)l/l(-8) assuming l is positive. l(33/7) Simplify (q(2/3)/q(3/7)(q*1q)(5/4))(-4/15) assuming q is positive. q*(-46/63) Simplify (k(kkk*(-3)kk)/kk)*9/((k(kk(-1)kk)/k)/k)39 assuming k is positive. k(-21) Simplify (x13/x(-9)xx/(x(-13)x)xx/(x/(x/(xx13/x))))(-7) assuming x is positive. x(-175) Simplify ((l0)(-15)/(l(2/3))(1/41))(-6) assuming l is positive. l(4/41) Simplify (((uu(4/3))(-6/13))(-2/67))(-1/11) assuming u is positive. u(-28/9581) Simplify (k(-1))*(-17)/(kk(k/(k/k25))/kkk33) assuming k is positive. k(-43) Simplify (dd*(-4)d)35/(d(3/8)dd*(-2/5)d) assuming d is positive. d*(-2879/40) Simplify (((p/(ppp(1/2)))/p(-1/16))/(p(-2/3))(-2/63))49 assuming p is positive. p(-30877/432) Simplify (((n(4/7))(-35))(4/5))(-36) assuming n is positive. n576 Simplify ((w1)(-21/5)(w0)(4/7))(1/6) assuming w is positive. w(-7/10) Simplify a(-7)/(a(3/5)aa)(a(-1)/a)(-1/7) assuming a is positive. a(-326/35) Simplify (u/(u/(u(u*(-12/7)/u)/uu)u)u/u(1/2))/(u1/(u/(u*(1/3)u)uu)) assuming u is positive. u(-65/42) Simplify (x3/(x14/x))(3/7) assuming x is positive. x(-30/7) Simplify (b/(b/b14))/bbb/b*(-2/49)b((b/(b/b(-1)))/bb)(3/31) assuming b is positive. b(24219/1519) Simplify ((m(-2/7))(-9)((mmm(-2/7)m)/mm)(-2/67))36 assuming m is positive. m(42048/469) Simplify ((h(hh(4/9))/hh)/h(-2))(-9) assuming h is positive. h(-40) Simplify (m/(m/m(-3/5))m/((((mmm(-4)/mm)/m)/m)/m)(m/(m/((((mm*(2/9)m)/mm)/m)/m)))(1/5))(-39) assuming m is positive. m(-637/3) Simplify ((oo(oo*(7/3)ooo)/o)/((o/(oo/o(-1/15)o))/oo))/((o/(o/o31))/o)(-16/5) assuming o is positive. o(527/5) Simplify (i/(i(i(i/i(4/17)i)/i)/ii)i/(ii/(i/(i(27/5)/iii))))/(i(-1)/(i(-2/61)i)) assuming i is positive. i(-32134/5185) Simplify m(-30)/(m*0mm)mm(-2/11)m(-28) assuming m is positive. m(-651/11) Simplify ((mm(2/3)mm/m(-2/9))/(m(-6/13)(m/(mm(-2)))/m))32 assuming m is positive. m(12544/117) Simplify p/(p/(p(-3/14)p))p(5/12)/pp*(-27/4)p(1/7) assuming p is positive. p(-269/42) Simplify (p4/p)(11/9)/((p/((p/p*(1/6))/p))/pp(-1/2)) assuming p is positive. p4 Simplify n/n*8n/n*(2/15)(n*(8/3)/n)/nn/((n/n9)/n) assuming n is positive. n(68/15) Simplify ((ll/l(-6)l)/(ll(-3/10)l))/((l/l*(-2/5)l)/ll(-10/7)) assuming l is positive. l(513/70) Simplify (h(-2/23)/h30)/(h0h(h(2/17)h)/h) assuming h is positive. h(-12201/391) Simplify x/(x16/xxx)x(-11)/x(x/((x/x*(-11))/x)x)(-1/5) assuming x is positive. x(-131/5) Simplify (v*(1/4)v*(-5)v*4v6)(-2/85) assuming v is positive. v(-21/170) Simplify s/(s/s(-22))s(1/8)s(sss(-22))(-6) assuming s is positive. s(793/8) Simplify (((bb(-2))/b(-5))(2/159))9 assuming b is positive. b(24/53) Simplify (l(2/89)l/(l/(l/(ll*(-26))))l)/((lll/l*(-9/4)ll)/(l/(l/l9))) assuming l is positive. l(10243/356) Simplify ((l(3/7)l*(-6))/(ll/(l/(l/(ll(2/5)l)))ll(l/(l/(l5/l))l)/l))(-5/18) assuming l is positive. l(391/126) Simplify (a(aa/(aa(-1/2)a))/a)(-45)/(a(-10))(1/19) assuming a is positive. a(-835/38) Simplify (yyy/(y1/y))(-13/2)/((yy(-1/12))/y9) assuming y is positive. y(-137/12) Simplify ((f23/(f(-5/6)/f))(-12))(1/4) assuming f is positive. f(-149/2) Simplify ((j(-13)jj)/(j(j/j*13)/jj))/((j/(((jj(-3/5))/j)/j))/j(14/9)) assuming j is positive. j(-47/45) Simplify (ss/((s*(-7/5)/s)/s)ssss(-1/4))/((s/s14)/ss/s(3/7)) assuming s is positive. s(3021/140) Simplify (t(2/11))19t15/t(-12) assuming t is positive. t(335/11) Simplify (o8o)*(-29/3)o*(-22)/ooo/(oo*(3/8)/o)o assuming o is positive. o(-859/8) Simplify (j(-13)j(j*(-17)j)/j)/(j*(-16)(j/j(-14))/j) assuming j is positive. j(-27) Simplify (s(3/2)/s)(-2/177)/(s(-2/15)/(s(-1/18)/s)) assuming s is positive. s(-4927/5310) Simplify (h(1/3)/(h/h*(-1/2))h*(-2/11)/(hh2))(39/2) assuming h is positive. h(-3731/44) Simplify (s17)(-1/11)/(s(6/5))(-40) assuming s is positive. s(511/11) Simplify ((t*6t)/(tt(-2)/ttt))/(t(-4))(-1/13) assuming t is positive. t(87/13) Simplify ((x(-2/7)/x)24(xx(-2)x)(37/2))(2/103) assuming x is positive. x*(-432/721) Simplify ((mm(-9))/m)(-43)m(-1)/(mm*8m) assuming m is positive. m376 Simplify o8/((o*(-1/9)o)/o)o12/(oo/o*14ooo) assuming o is positive. o(262/9) Simplify ((n(2/15)/n)/((n/((n(n/n44nn)/nn)/n))/n))22 assuming n is positive. n(-13816/15) Simplify ((n*(4/5)/(n/(nn/n*0)n))(-2/5))(32/5) assuming n is positive. n(-256/125) Simplify (d(-4/7)/ddd/(d*(1/2)d)(d(1/4)d)(8/3))(-15/7) assuming d is positive. d(-475/98) Simplify ((q/q(-1)q)/q(-3))/(q/q(5/8)q*(-6/7)q) assuming q is positive. q(307/56) Simplify (s(-1/9))*9(s/(s((s(-1/4)ss)/s)/s))23 assuming s is positive. s(19/4) Simplify (p/(pp/(p/(pp(1/3))p)))(3/26)/(p1)(-2/101) assuming p is positive. p(-49/2626) Simplify (c/c12)/(c/c9)c8c/(c(2/39)/c) assuming c is positive. c(271/39) Simplify (l*(2/71)((((llll24llll)/l)/l)/l)/l)(2/35) assuming l is positive. l(3838/2485) Simplify l/((l(1/2)/l)/l)((((ll*13)/l)/	{ "pile_set_name": "DM Mathematics" }
s the tens digit of p(-21)? 0 Let u be 3/(-4)(-120)/18. Suppose 83 = -uk - 17. Let o = k - -154. What is the tens digit of o? 3 What is the ten thousands digit of (-7 + (-571040)/60)-3? 2 Suppose 4d = -2j - 0d - 644, -1634 = 5j + 4d. Let k = 545 + j. What is the units digit of k? 5 Let o = -11669 + 17562. What is the tens digit of o? 9 Suppose -5b - 991 = -3j, 0 = -3j - 4b + 1391 - 445. Suppose -15v + 248 = -j. What is the tens digit of v? 3 Suppose 13j = -1761 + 357. What is the units digit of j((-704)/12)/11? 6 Let q(k) = -474k + 4576. What is the ten thousands digit of q(-46)? 2 Let j(t) = -1078t3 + 3t*2 + t. Let a = 394 + -395. What is the units digit of j(a)? 0 Let k(p) = -2p*3 + 14p*2 - 2p + 10. Let y be k(7). Let h(a) = -3a3 + 4a*2 + 6a + 11. What is the tens digit of h(y)? 4 Let j = 80 + -56. Suppose 2g + j = 6g. What is the hundreds digit of -12 + 5 - (-816)/g? 1 What is the hundreds digit of 39/(-3) + 39 + 16838? 8 Suppose 0 = -21i - 2i + 81765 + 40020. What is the thousands digit of i? 5 Let s(n) = 3n*2 + n - 26. Let h be s(-5). Suppose 42l + 964 = hl. What is the units digit of l? 2 Suppose -w + 11 - 6 = 0. Let c be 3/(-2) + (-1)/(8/(-36)). Suppose -2i - 72 = -cu + 519, -985 = -5u - wi. What is the tens digit of u? 9 Suppose -t - 27 = -7j, -2t + j + 3j = 4. What is the hundreds digit of 1489t/2(-31)/(-124)? 4 Suppose 3t = 5o + 10065 + 6766, -3t + o + 16847 = 0. What is the units digit of t? 7 Let y be (-12)/(1/((-134)/3)). Suppose 0 = -b - 4j + 8j + 114, 4b - y = -4j. What is the hundreds digit of b? 1 Suppose -k - 15 = -5z, -2k = -3z + 5 + 4. Suppose -zr + 2097 = -5c, 21r = 18r + 3c + 2103. What is the units digit of r? 4 What is the tens digit of 4/((-2)/(-1)) + (-12 - 7 - -17558)? 4 Suppose -41147 = -5q + 2f + 18831, 23990 = 2q - f. What is the thousands digit of q? 1 What is the thousands digit of (2 + 1507)/(5 - (-235)/(-50))? 5 Let b(u) = -u*3 - 6u*2 - 4u - 7. Let v be b(-5). Let f = v + 32. Suppose -h + 5j - f = -129, -5h + 5j = -465. What is the tens digit of h? 8 Let g = 9812 - 252. What is the hundreds digit of g? 5 Suppose -3k = 186c - 187c + 27003, 4k = -4c + 108012. What is the units digit of c? 3 Let y = -4506 - -6339. What is the units digit of y? 3 Let j = 43 - 49. Let o be ((-4)/j)/(-3 - (-22)/6). What is the units digit of o - -98 - (-12 - -10)? 1 Let j = -60 - 45. Let l = -74 + j. Let s = -30 - l. What is the tens digit of s? 4 Suppose 2o + 4 = r, -o + 35 = 5r + 4o. Let c be (-1 - -2)/(r/32)-3. What is the units digit of c(5 - 86/8)? 2 Suppose d - 11 = 13. Let m(q) = -2q + 0q + 2q + q + d. What is the units digit of m(0)? 4 Let d(f) = -20600f + 1848. What is the ten thousands digit of d(-2)? 4 What is the units digit of (-1107)/(-2)(-60738)/(-477)? 9 Let v be (7/28)/((-2)/24). What is the units digit of (-23 - (-2 + 0))(v - 1)? 4 Let x(g) = 53433g*3 + 2g*2 + 8g - 11. What is the tens digit of x(1)? 3 Let a = -1149 + 1923. Let y = a - 365. What is the units digit of y? 9 Let n(d) = 54d + 273. Suppose 0 = -98f + 101f + 5h - 64, -4f = -4h - 32. What is the units digit of n(f)? 5 Suppose -3g = 2k - 58891, 0 = 427k - 423k + 3g - 117797. What is the hundreds digit of k? 4 Suppose 18v - 33772 + 4216 = 0. Let w = v - 841. What is the tens digit of w? 0 Let j be ((-52)/(-8))/(3/(-162)). Let a = j + 386. What is the tens digit of a? 3 Let x(o) = 904o - 1493. What is the ten thousands digit of x(18)? 1 Suppose -6k + 107432 = -3k - 2g, 0 = -4g + 20. What is the thousands digit of k? 5 Suppose -2m - 5a = m - 467, 0 = 5m + 2a - 753. Let q(j) = 3j*2 + 85j + 11. Let u be q(-29). Let t = m - u. What is the tens digit of t? 8 Suppose -678 = 5w + 1597. Let v = 863 + w. What is the hundreds digit of v? 4 Let j(r) = r3 - 9r*2 + 23r - 28. Let q be 34/153 + -20(-14)/36. What is the units digit of j(q)? 2 Suppose -x + 5x = 4h + 8, 32 = 4x + 2h. Suppose -j - y = 10, 4y + x - 36 = 3j. Let o = 74 + j. What is the units digit of o? 4 Let v = 5521 + -3847. Suppose 0 = -9b + v + 1557. What is the units digit of b? 9 Suppose -m + 32576 = 3m - 2h, -2m - h + 16292 = 0. What is the hundreds digit of m? 1 Let t be (-796)/(-3) - (0 + 9/27). Let s = 462 + t. What is the units digit of s? 7 Suppose -180 = -p - 11p. What is the hundreds digit of (-2)/3 + -2(-4130)/p? 5 Suppose 0 = 4k - 4p - 202616, 7k - 11k + 5p + 202617 = 0. What is the hundreds digit of k? 6 What is the tens digit of 12/(-8) + -12 + 6667/2? 2 Let r(q) be the first derivative of 58/3q3 - 22 - 3/2q*2 + 3q. What is the units digit of r(2)? 9 Let j(u) = -341u + 10385. What is the thousands digit of j(-33)? 1 Let y(a) = -a2 - 10a - 18. Let d be y(-8). Let x(v) = -8v - 3. Let c be x(d). Let u(h) = 4h - 16. What is the tens digit of u(c)? 3 Let s be ((4 + -3)1)/(1/(-18)). Let d be 608/144 + 4/s. What is the units digit of 1/d + 9030/40? 6 Suppose 2t + 107t = -29539. Suppose -3a - 409 = 2b, -a - 2b = -4a - 425. Let g = a - t. What is the hundreds digit of g? 1 Suppose 5f - 50280 = 5j - 0j, -4f = -j - 40242. What is the ten thousands digit of f? 1 Let v = 912 + -901. Let d(x) = -2x + 32. Let u(r) = -1. Let w(q) = d(q) - 6u(q). What is the tens digit of w(v)? 1 What is the hundreds digit of ((-1)/(-4))/(-1) + (-6 - 1786/(-8))? 2 Suppose -3o + 4o - 68 = -4w, -84 = -4w - 5o. Suppose g = -3t - 1 + w, t = g + 5. Suppose 4y + 5j - 85 = 288, -3j - 9 = g. What is the tens digit of y? 9 Suppose 4167147 = 24y + 255y - 2653008. What is the tens digit of y? 4 Suppose 2 = -a, p + 0p - 41 = 4a. Suppose -32v - 959 = -pv. What is the hundreds digit of v? 9 Let z = 244 + -225. Suppose -4j + zp = 15p - 48, 0 = 5p - 5. What is the tens digit of j? 1 Let j(v) = -10v + 47. Let c be j(4). Let f(d) = d2 - 2d - 7. Let i be f(-5). What is the units digit of 720/i - (-2)/c? 6 Let n = 2006 + -1198. Let a = 1450 - n. What is the tens digit of a? 4 Suppose 304b = 302b + 814. Suppose 2k + 6 + 0 = 0, 5k = s - b. What is the tens digit of s? 9 Suppose -2c + 16 = 8. Suppose -2k - 4h + 922 = 0, 5k = -6h + ch + 2273. What is the hundreds digit of k? 4 Let r = 10842 - 8156. What is the hundreds digit of r? 6 Suppose 28773t - 28771t - 14900 = 0. What is the hundreds digit of t? 4 Suppose -208i = -2824496 - 2414816. What is the hundreds digit of i? 1 What is the hundreds digit of -6 - (828/(-1) - (-11 + 12))53? 9 Let q = 525 - 519. What is the hundreds digit of (-2 - 81)/(-7 - (-41)/q)? 4 Let d be 3(1/1 + -2). What is the tens digit of (-38)/12 - d - (-11555)/30? 8 Let x(h) = -2h*3 + 18h*2 + 209h + 134. What is the tens digit of x(-25)? 0 Let r(a) = 65a2 + 29a - 167. What is the thousands digit of r(6)? 2 Let d = 32887 - 14853. What is the hundreds digit of d? 0 Let s be 631 - (-12)/99/6. Suppose 48v - 51v + s = 0. What is the units digit of v? 1 Let o be 8/((-40)/(-25)) + -5. Suppose o = 68v - 137818 + 49962. What is the tens digit of v? 9 Let h = -82 - -90. Let g be (h/10)/((-2)/20) - 3. Let r(k) = k*3 + 12k*2 + 11k + 11. What is the tens digit of r(g)? 1 Let g = -42 - 3. Let y = g - -61. Suppose -7c + yc = 279. What is the tens digit of c? 3 Let m be -2(-4 - (3 + 3)). Let h be 58/m1. Suppose -hb = 3q - 41, 2b = 3q - 17 + 64. What is the tens digit of b? 2 Let j be (36/15)/((-6)/(-2025)). What is the units digit of (927/5)/((j/100)/27)? 8 Suppose -38v = 21v - 553479. What is the thousands digit of v? 9 Suppose 774434 = -30o + 138o - 149290. What is the tens digit of o? 5 Let v(j) = -9j + 1. Let m be v(-3). Let x be -153/(-9) - -1. Suppose -m - x = -n. What is the tens digit of n? 3 Suppose 13w - 333 = 18. Suppose 15293 = wj - 1825. What is the tens digit of j? 3 Suppose 9h = 6577 + 1073. Suppose 3r = c - 423, -5r = c - 3c + h. What is the units digit of c? 5 Let w be (-88)/(-132)(5 - 2). Suppose -m = 2m - 5c - 739, 0 = wm + 4c - 478. What is the units digit of m? 3 Let b be (-2 - 6/(-5))-5. Suppose bd + 363 = d. What is the tens digit of (-22)/d - 282/(-22)? 1 What is the thousands digit of 4/(-6) - (25 + 368088/(-63))? 5 Suppose 0 = 6n - 2n - 4. Let l = n + 81. What is th	{ "pile_set_name": "DM Mathematics" }
sqrt(245) + -3 + sqrt(245))*2. -196sqrt(5) + 1029 Simplify ((sqrt(1800)1)/(2sqrt(900)) + -1)-6. -3sqrt(2) + 6 Simplify (sqrt(144)/(sqrt(12) + sqrt(144)/(sqrt(24)/sqrt(2))))/((sqrt(220)/(sqrt(11)-1))/sqrt(5)). -sqrt(3)/2 Simplify ((42sqrt(147))/sqrt(7))/((sqrt(315)-6)/sqrt(5)). -4sqrt(3)/9 Simplify 1 + sqrt(14)/(sqrt(4)/sqrt(2)) + sqrt(168)/sqrt(6) + 1 + -2sqrt(343)-3. 2 + 45sqrt(7) Simplify -3(0 + ((sqrt(170)1)/sqrt(10) - (sqrt(17) - (sqrt(17) + (-4sqrt(68)/sqrt(4))2)))). -816 - 3sqrt(17) Simplify -3-4((sqrt(2800) + 0)*2 + 3). 33636 Simplify ((-2sqrt(44))2 + ((sqrt(11) - (sqrt(11) + 0 - sqrt(11))2) + sqrt(11))-2 + -1)1. -4sqrt(11) + 175 Simplify 1(((sqrt(17) - (sqrt(17) - sqrt(17)2)) + sqrt(17))-1 + sqrt(1088)2 - (sqrt(102)/sqrt(6)5 + -2))*2. 32sqrt(17) + 1092 Simplify (sqrt(288)/(sqrt(8) - (sqrt(8) - sqrt(128))-2))/(-1sqrt(1728)2). sqrt(3)/120 Simplify sqrt(24)/(sqrt(12) - 6sqrt(1200)) - -4sqrt(98)4. 6607sqrt(2)/59 Simplify (-3(sqrt(7) - (sqrt(7) - (sqrt(7) + 3 + sqrt(35)/sqrt(5)))) + -4)*2 + 3. 156sqrt(7) + 424 Simplify ((sqrt(153) + -4sqrt(153)4)/(sqrt(1089)-5))2. 153/121 Simplify ((4 + sqrt(126)/sqrt(2))1 + -3 + -1 + sqrt(1008))*2. 1575 Simplify (4(sqrt(847) - (sqrt(847) - (0 + sqrt(847))))*2 - (-3(0 + sqrt(847)))*2)4. -16940 Simplify (sqrt(11) - (sqrt(99) + 0 + sqrt(99))) + -5 + sqrt(11) + 0 + sqrt(33)/(2sqrt(192) + sqrt(192) - sqrt(3)) + -5. -91sqrt(11)/23 - 10 Simplify -5(-2sqrt(1176)-2)/(sqrt(588)-25). 2sqrt(2) Simplify ((sqrt(1900)-3 - sqrt(1900))2 - (0 + sqrt(190)/sqrt(10)))6. -6sqrt(19) + 182400 Simplify (4(sqrt(18) - sqrt(1458)-3))/((sqrt(90) + sqrt(90)1)/sqrt(10) + sqrt(81)6). 28sqrt(2)/5 Simplify -3-1(sqrt(78)/(-1sqrt(294) - sqrt(294)) + -4)-4. 6sqrt(13)/7 + 48 Simplify ((2sqrt(204)/sqrt(4) + (1sqrt(510))/sqrt(10))/(sqrt(108)14))2. 17/64 Simplify 6(-5 + (-4(4 + -1 + sqrt(108)))2) + -5. 3456sqrt(3) + 11197 Simplify (sqrt(396)/(sqrt(225)-5))23. 132/625 Simplify 2 + (0 + sqrt(275))*2 + sqrt(11) + -5 + -5 + (sqrt(539) + -2sqrt(539) + -1)*2. 15sqrt(11) + 807 Simplify 2(-5 + -2 + sqrt(272) + 1)2. -96sqrt(17) + 616 Simplify (26(sqrt(343) + 2 + (sqrt(336)/sqrt(8) + sqrt(42) + sqrt(42))/sqrt(6))-5)2. 144000sqrt(7) + 2534400 Simplify 0 + sqrt(17)-14 - ((sqrt(102) + sqrt(102)1)/sqrt(6) + 0). -6sqrt(17) Simplify -2 + 5 + sqrt(5)-1 + 3 + 1 + 4. -sqrt(5) + 11 Simplify (sqrt(2592) + (sqrt(2592)-3 + sqrt(2592))-3)/((sqrt(441) + sqrt(441)-3 - sqrt(441))-6). 2sqrt(2)/3 Simplify ((-3 + sqrt(171) + 4)-1)2-5 + -5. -865 - 30sqrt(19) Simplify -1(4 + 3sqrt(891) - (sqrt(891) + 2)-3)*2. -32176 - 1080sqrt(11) Simplify -5-4(2 + sqrt(147) + 2 + 0). 80 + 140sqrt(3) Simplify -2 + (-3(sqrt(7) + 1) - (sqrt(196)/sqrt(4))/sqrt(7))5 + 0. -20sqrt(7) - 17 Simplify (4 + (sqrt(486) + (-1sqrt(486) - sqrt(486)))/(6((sqrt(3) - (sqrt(3) - sqrt(3)2)) + sqrt(3))))2. -4sqrt(2) + 33/2 Simplify ((sqrt(136) - (sqrt(136) - (sqrt(136)4 - sqrt(136))4) - sqrt(136))/(1sqrt(968)))2. 17 Simplify 4(-2 + sqrt(363) + (sqrt(363) - (sqrt(363) + 3)) + 5). 44sqrt(3) Simplify (sqrt(88) + 3-2sqrt(88) + sqrt(88))/(sqrt(8) + (sqrt(8) - -1sqrt(392)) - sqrt(8)) + 5. -sqrt(11)/2 + 5 Simplify (sqrt(1584) + 2)*2 + -1(sqrt(99))*2 - (-1(sqrt(1584) + 0)*2 + -1). 48sqrt(11) + 3074 Simplify 4 + 6(sqrt(76)/sqrt(4)-1 + 2) + 1. -6sqrt(19) + 17 Simplify (sqrt(320) + sqrt(320) + 1 + 2)24 + 2(sqrt(320) + 1 + sqrt(320)) + 3 + sqrt(320)1 + sqrt(320). 432sqrt(5) + 5161 Simplify (sqrt(3159)3)/(-2(sqrt(3) + sqrt(12) + sqrt(3))). -27sqrt(13)/8 Simplify (5(-1 + (sqrt(147) + -1 - sqrt(147))-5 + -1 + sqrt(147)-2 + 5))2. -5600sqrt(3) + 16300 Simplify (22sqrt(119)-4)/((sqrt(196)/(sqrt(4)2))/sqrt(7)). -32sqrt(17) Simplify (sqrt(70)/(sqrt(28)/sqrt(4)) + -2sqrt(640) + sqrt(640))/(((sqrt(18) + sqrt(162))-1)/sqrt(9)). 7sqrt(5)/4 Simplify -3 + 2sqrt(45) + (-2(sqrt(5) - (0 + sqrt(605))))*2. 6sqrt(5) + 1997 Simplify 6(3sqrt(72))/((sqrt(4)-1 - sqrt(4))-3 + sqrt(4)). 54sqrt(2)/7 Simplify -1 + -1 + -1 + (4(-1 + sqrt(2)) + sqrt(2))3 + 0. -15 + 15sqrt(2) Simplify -4(0 + (4-1sqrt(33))/(sqrt(1584) - -1sqrt(1584))). 2sqrt(3)/3 Simplify ((sqrt(1539) + -1)2 - ((sqrt(19) + -2 + sqrt(19))2 + -4)) + 5 + 5. -10sqrt(19) + 1474 Simplify (1 + 0 + (2sqrt(99)-3 + sqrt(99) + sqrt(99))/(sqrt(9) - (2sqrt(99))/sqrt(11)))2. 8sqrt(11) + 177 Simplify (sqrt(5000) - sqrt(5000)1)/(5sqrt(10)4 + sqrt(10)). 0 Simplify ((sqrt(396)/sqrt(99) + sqrt(36) + sqrt(36) + sqrt(900) + (sqrt(900) - (sqrt(900) + sqrt(900)2 - sqrt(900))) + sqrt(900))/(sqrt(24)/sqrt(18)-5))2. 1452/25 Simplify (-4 + 3((sqrt(76) - (5 + sqrt(76) + sqrt(76)-4 + sqrt(76))) + sqrt(76) - (4 + 5sqrt(76) + sqrt(76))))*2. 744sqrt(19) + 3697 Simplify (0 + sqrt(17))-1 + 1sqrt(425) - (-5(sqrt(2448)-2 + sqrt(2448))-2)2. -244800 + 4sqrt(17) Simplify (2sqrt(882))/(sqrt(45)/sqrt(125)). 70sqrt(2) Simplify ((sqrt(65) + -2sqrt(65) + sqrt(65))4 - 6sqrt(65)1)/(1-3(sqrt(5) + 2sqrt(5))). 2sqrt(13)/3 Simplify -5(-2sqrt(891))*2 - ((0 + sqrt(891) - sqrt(891))3)*2 - (-4 + sqrt(891) + 1 + sqrt(891) + 0 + sqrt(891)). -17817 - 27sqrt(11) Simplify -5-5(sqrt(52))*2 - (-3sqrt(26)/sqrt(2) - sqrt(13))-1. -4sqrt(13) + 1300 Simplify ((sqrt(85) - (sqrt(85) + sqrt(85) + (sqrt(85) - -2sqrt(85)-6) + sqrt(85)))/(sqrt(180)3))2. 17/4 Simplify 1 + (1 + (3 + sqrt(500)2 - sqrt(500)) + 0)*2 + 4. 80sqrt(5) + 521 Simplify (sqrt(55) + sqrt(605)/sqrt(44))/(sqrt(11)-1-6 - sqrt(11)). 3sqrt(5)/10 Simplify (0 + (0 + (sqrt(108) + sqrt(108) + sqrt(108) + 1(-2 + sqrt(108)) + sqrt(108))-4)2)6. -11520sqrt(3) + 259584 Simplify ((5(-2sqrt(104) + sqrt(104)) - sqrt(104))/(1sqrt(32)) + 0)*2. 117 Simplify (((1sqrt(72) + sqrt(72))-1)21 - (3 + 0 + sqrt(72) + sqrt(72) - ((sqrt(72) - (1sqrt(72) + sqrt(72) - sqrt(72))) + sqrt(72) + 3))2) + 3. 219 Simplify ((0 + sqrt(171) + sqrt(171))-2 + sqrt(171) + sqrt(171) + (sqrt(171) + -1)-5 + (0 + sqrt(171) + 5 - (sqrt(171)-2 + 1)))*2. -216sqrt(19) + 2817 Simplify -2sqrt(171)-2 - ((sqrt(190) - (sqrt(190) - sqrt(190)2 - sqrt(190)))/sqrt(10) - (sqrt(19) - (-1sqrt(19) + sqrt(19) + 3))*2). 3sqrt(19) + 28 Simplify -5(sqrt(198) + sqrt(198) + 2sqrt(198)-2)/(4sqrt(6)/sqrt(3)-5). -3sqrt(11)/2 Simplify (-1(-61(sqrt(1872) - (0 + sqrt(1872)) - sqrt(1872))2 + 5))*2. 1440sqrt(13) + 269593 Simplify (1(0 + sqrt(200)) + (sqrt(200) - (sqrt(200) + -4)4))*2. -640sqrt(2) + 1056 Simplify (-5((-3 + sqrt(2448) + -5 - sqrt(2448)) + 5))2. 225 Simplify (-3(2 + sqrt(1008)))*2 + sqrt(77)/((sqrt(88) + -3sqrt(88))/sqrt(8)) + 5. 863sqrt(7)/2 + 9113 Simplify ((6sqrt(104)/sqrt(8))*2 - (((sqrt(325)-6 - sqrt(325))*2 - sqrt(325)) + sqrt(325) - sqrt(325))) + 4. -15453 + 5sqrt(13) Simplify (-5(sqrt(16) - sqrt(4)) - sqrt(4) - (sqrt(256) + sqrt(256)-1))/(sqrt(300)/sqrt(6)6 - sqrt(50)). -6sqrt(2)/25 Simplify ((sqrt(228) + -1sqrt(228)1 + sqrt(228))1)/(sqrt(1452)-3-4). sqrt(19)/132 Simplify -3 + (1-4sqrt(77))/(-2sqrt(175)). -3 + 2sqrt(11)/5 Simplify (2-1sqrt(84) + (sqrt(84) - 6-1sqrt(84)))/(2sqrt(1728) - (sqrt(108) + sqrt(108) + sqrt(108)1)). sqrt(7)/3 Simplify -1 + (-1-1sqrt(1300))2 - ((sqrt(1300) + sqrt(1300) + -3 + -4 + sqrt(1300) - sqrt(1300)) + sqrt(1300) + -5)2. -10545 + 720sqrt(13) Simplify (-5 + (sqrt(2736) - sqrt(2736)-2)2 - ((sqrt(2736) - -6sqrt(2736)-1) + sqrt(2736) + sqrt(2736) + sqrt(2736) + 5))*2. -1920sqrt(19) + 175204 Simplify ((sqrt(168)/sqrt(8) + sqrt(21))/sqrt(7) + 5)2 - (sqrt(192) + 1 - (sqrt(12)/sqrt(4))2-4). 12sqrt(3) + 24 Simplify 0 + (sqrt(156)-1-3 - sqrt(156))/(sqrt(1200)-1 + sqrt(12) + sqrt(12)). -sqrt(13)/4 Simplify (-3 + (-1 + sqrt(1539))4 + sqrt(1539) + (sqrt(1539) + -3 + 2 - sqrt(1539)))*2. -720sqrt(19) + 38539 Simplify (-2 + 4sqrt(1100)1 + 4(sqrt(1100) - 1sqrt(1100)) + 0)*2. -160sqrt(11) + 17604 Simplify (1 + -5(-1 + sqrt(242)) + sqrt(242) + 2sqrt(242)3 + -3)2. 132sqrt(2) + 977 Simplify (1((sqrt(792)-2 - sqrt(792))-5)/(-2sqrt(50) - (sqrt(242) + -1sqrt(242))))2. 891 Simplify (sqrt(24) - sqrt(216)/(sqrt(63)/sqrt(7)))/(sqrt(72) + ((sqrt(72) - (sqrt(72)-3 -	{ "pile_set_name": "DM Mathematics" }
4 - 3j*2 + 2 in the form nj*4 + m + fj*2 + tj + hj3 and give h. 1 Express -4u + 11u - 2u - 3u - 2 + 4u*3 as ju + su3 + qu2 + f and give f. -2 Express l2 + 2l - 3l*2 + 2l*3 + 5l*4 - 4l*4 in the form yl*2 + ol*3 + cl*4 + il + u and give i. 2 Rearrange (-c4 - c4 - c*4)(0 + 3 - 4) + 3c4 - 3c*4 + 2c*4 to n + ic*4 + qc*2 + xc + lc3 and give i. 5 Rearrange -z + z + z2 + (-1 + 1 + 2)(5z - z2 - 5z) + (4z - 2z*2 - 4z)(8 - 3 - 3)(3 - 2 + 1) to the form s + pz + iz*2 and give i. -9 Express 3z*3 + 2z*4 - 3z*3 + 6 - 9z*4 - 9 - 1 + (-5 + 2 + 1)(3z4 + 3z*4 - 5z*4) in the form kz*2 + pz*4 + lz + d + rz3 and give d. -4 Rearrange (3 + 2b - 3)(-2 - 8 - 14) to the form s + cb and give c. -48 Express -1 + t*2 + t + 111t*4 - 117t*4 + 0t*2 as nt*2 + at*3 + g + lt*4 + ot and give n. 1 Rearrange (2 + 2i + 3i - i)(2 + 2i - 4 + 1) to xi + v + fi*2 and give v. -2 Rearrange -2 + 37g + 2 - 44g + g2 to the form jg*2 + d + tg and give t. -7 Express 18b2 + 8 + 26b*2 - 50b*2 as q + hb + mb2 and give m. -6 Express (-18n + 1 - 12n - 1)(-5n2 + 3n2 + n2) in the form mn2 + vn + o + dn3 and give d. 30 Rearrange 8n*2 + 2 - 9n*2 + 7 + 5 to s + wn*2 + kn and give w. -1 Rearrange (-t - 1 + 1)(2t + 0t + 0t)(-3t2 + t2 + 5t2) to the form o + gt*2 + rt*4 + nt*3 + mt and give o. 0 Express (13 - 2 + 11 - 2)(8z - 16z + 14z) in the form j + nz and give n. 120 Rearrange -w2 - w4 - w4 + 4 - 1 + 3 to the form zw*2 + fw*4 + qw*3 + gw + n and give n. 6 Express 1 + 2m + 1 - 4m + (0 + 1 + 0)(0m + 2m + m) in the form vm + q and give q. 2 Rearrange -5i2 + 8i*2 + 7i*2 to the form ai*2 + fi + d and give a. 10 Express 519r2 - 555r*2 - 2r + 4 - 5 in the form jr2 + hr + l and give l. -1 Express (-4i - 2i + 3i)(-i + 6i3 + i) as pi*2 + ui*3 + x + di*4 + hi and give d. -18 Express -2g3 + 147g - 5g4 + 4g*4 + 3g*3 + 1 - 148g + g*2 as n + ig*2 + sg*3 + hg + lg4 and give l. -1 Express (-5s + s + s)(2s*2 - 4s + 0s2 - s2) in the form fs + z + ps3 + ws2 and give w. 12 Express 0 + 0 + l3 + 2 + 2l2 as bl*3 + v + wl + pl2 and give b. 1 Express (5 - 1 - 2)(-2p + 1 - 1 - 7p - p + 3p + (-2p - 1 + 1)(4 + 0 - 3))(1 + 2p - 1) in the form mp*2 + op + q and give m. -36 Rearrange (4q + 3q - 5q)(-46q - 26q + 10q) to the form gq + nq2 + d and give d. 0 Express 5m + m*3 + 4m*3 - 4m + 2m in the form i + xm*2 + um + vm3 and give v. 5 Express (2l + l + 0l)(-2826 + 67l3 + 2826) as yl*3 + tl*2 + cl + d + fl4 and give f. 201 Rearrange (-3g + 2g + 2g + (4 - 4 - 1)(2 - 2 - 2g) - 2g + 5g - 4g)(-2g2 - 2g*2 + 2g*2) to the form rg*2 + vg + k + cg3 and give c. -4 Rearrange -88i + i*2 + 0i*2 + 86i + 2i2 to the form ui*2 + xi + d and give u. 3 Rearrange -1 - 36s + 71s - 40s to the form x + qs and give q. -5 Rearrange (-6g + 0g + 4g)(4g + 10 - 9 - 6g + (-g + 0g + 3g)(-1 + 1 + 2)) to the form zg + h + lg2 and give z. -2 Rearrange (-3l + l*2 - 2 + 3l)(-1 + 11 + 5)(1 - 3 + 0) to ql2 + b + nl and give b. 60 Express (5q2 + 4q*2 - 3q*2 + (-1 - q + 1)(q + q - q) + 2q2 - 4q*2 + 5q*2)(-3q + 8q - 3q) as m + lq + bq3 + rq*2 and give b. 16 Rearrange 30c + 32c - 18c + 4c to the form a + jc and give j. 48 Rearrange 0 + 0 - o*3 - 3 + 3 + 3o*3 + (-3o + o + 4o)(4o2 + 4o*2 - 5o*2) - 4o*3 + 0 - 1 + 2o*3 to mo*2 + so + xo3 + j and give j. -1 Express 2r*4 - 28r - 3r2 + 2r*2 + 30r + 3 + 0 in the form ir4 + g + ar*3 + tr + fr2 and give f. -1 Rearrange t - 2t*3 - t + 5t*2 + 4t*3 to zt*3 + ot*2 + kt + q and give o. 5 Express 2k4 + 0k*4 + 0k*4 + (-3k*3 - 3k*3 + 2k*3)(3k + 4k - 5k) in the form pk*3 + z + gk*2 + sk*4 + fk and give s. -6 Rearrange (-1 + 1 - v)(-1 + 132v + 28v2 - 134v + 0) to f + mv + ov*3 + av*2 and give m. 1 Rearrange (1 + 2p2 + 0 + p2 + (1 + 4 - 4)(-2p*2 + 2p - 2p))(-6p + 2p + 3p) to the form m + up*3 + np*2 + ap and give n. 0 Express (0 + 0 + 2)(1 - 3 + 1)(-17c + 14c - 30c) as qc + v and give q. 66 Rearrange -2t - 18t*2 + 57 - 57 to the form st*2 + zt + q and give z. -2 Rearrange 89j2 - 12j + 36j2 - 5j + 18j to s + rj + gj2 and give g. 125 Express k4 - 9 - 4k*3 + 7 + 8k*3 - 2k*2 + 12k - 3k3 in the form sk*3 + n + hk*4 + ak + gk2 and give s. 1 Express -27m*4 - 65m*2 + 65m2 + (-m2 - 3m3 + m2)(-2m + 2m - 2m) in the form gm*3 + ym*2 + h + fm + cm4 and give c. -21 Rearrange 11a + 5 - 5 + 20a to the form k + ua and give u. 31 Express (q*2 + 13q*2 - 7q*2)(2q + 2q - 2q) + (2q2 - q2 - 2q2)(0 - q + 0) as y + jq2 + gq*3 + tq and give g. 15 Express 23l - 4l + 15l in the form yl + n and give y. 34 Rearrange 4v3 + 3 - 5v*3 + 2v*3 - 4v + 0v to h + qv*2 + av + lv3 and give q. 0 Express f3 + 0f*3 - 2f*2 + 4 + 3f*3 in the form mf*3 + df + g + if2 and give g. 4 Rearrange -b + 8b - 2 - 4b + 7b to yb + w and give w. -2 Rearrange -t3 + 0 + 8 + 2t*2 + 0 + t to y + jt*3 + mt*2 + dt and give j. -1 Rearrange (-2 + 2l + 1 - 3l)(5l*2 - 5l*2 + 5l*2) to h + ul*2 + dl*3 + zl and give d. -5 Express (-3l2 + 4l*2 - 3l*2)(-3l - 4l*2 - 7l + 6l2) as xl*4 + p + dl*3 + ml*2 + ql and give x. -4 Rearrange 0i + 10i - 10i + 5i to the form t + ai and give a. 5 Express (-3l - 4l + 2l)(-11 + 2 + 14) in the form f + ml and give m. -25 Express -21k3 + 155 + 2k*3 - 154 in the form j + nk*3 + qk + zk2 and give q. 0 Rearrange (4 - 3 - 2)(5x2 + 11x*2 - 5x*2) + (2x2 + x2 - 4x2)(-3 + 2 - 1) to the form rx + i + tx*2 and give t. -9 Rearrange -m + 2 + 4m + 0m + m - 1 + 1 + (3 + 1 - 2)(-m - 3m + 2m) - 2 - 3m + 2 to the form bm + i and give b. -3 Express -3g3 - 10g*2 + 2g + 4g2 + 8g*2 in the form zg + fg2 + mg*3 + b and give f. 2 Rearrange 4v*3 - 3v - 2v3 - 36v*2 + 38v*2 - 2 to wv + kv3 + u + tv*2 and give w. -3 Rearrange -12 - 3u*2 + 12 to wu*2 + m + ku and give w. -3 Express -10 + p*2 - 2p*3 - 2p*2 + 2p*4 + p + 10 as mp*2 + lp*4 + fp*3 + hp + j and give f. -2 Express (-20 + 2m + 0m + 18)(3m - 2m - 4m) in the form d + am2 + vm and give v. 6 Express (114 - 114 - 34y)(2y - 3y + 2y) in the form ky*2 + ay + l and give k. -34 Express (u + 3u - 2u)((5 - 1 - 7)(0 - 1 + 3) + (2 + 3 - 3)(5 - 2 - 1)) as s + yu and give y. -4 Express (3 + 1 + 3)(f + 3f + 0f) as tf + n and give t. 28 Rearrange (2 + 13 - 3)(4 - 3 + 0)(v - v - 4v) to k + yv and give k. 0 Rearrange (3 - 2 + 0)(-2y - 2y + 2y - 4)(0y - y + 4y) to the form dy*2 + xy + u and give d. -6 Rearrange -6v - v + 8v - 7v to the form a + yv and give y. -6 Rearrange -2j + 3j*2 + 2j + 5j3 to sj + hj3 + ij*2 + r and give r. 0 Express 0k*3 - 3k*3 - 4k*3 + 10k*3 + 19k in the form fk2 + d + ak + zk3 and give a. 19 Express (a + 4a - 3a)(a + 9a2 + 4a - 10a2) in the form ra + ha2 + g + xa3 and give x. -2 Rearrange -r4 + r*4 - 2r*4 - 2r - 2r2 to wr*2 + gr + dr3 + kr*4 + f and give w. -2 Express (-3a*2 + 3a*2 + 2a*3)(-a + 6a - 2a) - a3 + a4 + 2a3 + 2a*2 - 3a*3 as t + pa + wa3 + ia*2 + ga*4 and give w. -2 Express -3v3 - v3 + 1 + 0v3 + 15v*4 + 5v*3 - 2v*2 - v as lv + av4 + k + fv*2 + rv*3 and give f. -2 Rearrange 3a*4 - 4 + 4 + (-2 - 3 + 7)(9a4 + 11a*2 - 11a*2) to the form ya*2 + xa + ta4 + n + ia*3 and give t. 21 Rearrange 17t*2 - t - 11t*2 - 4t*2 + 2t*3 to zt + ut3 + mt*2 + i and give z. -1 Rearrange (-3u + 3u - u + (u + u - u)(-4 + 3 + 0))(-3 - 23u + 25u + 8) to the form au + m + ou2 and give a. -10 Rearrange 110t - 4t - 60t to jt + d and give j. 46 Express 185k - 229k + 160k as i + tk and give t. 116 Rearrange (1 - 1 + 2)(-58 + 9s2 + 58) - s + 4 + 3s**2 + 1 - 7 to	{ "pile_set_name": "DM Mathematics" }
-dw - 9 = 0, -4n + 67 = -3w - 454. List the prime factors of n. 2 Let i = 6874 - 1047. What are the prime factors of i? 5827 Let d(g) = 4g*3 + 11g*2 + 10g - 9. Let u(h) = 11h3 + 31h*2 + 29h - 26. Let r(y) = 17d(y) - 6u(y). List the prime factors of r(4). 131 Let m be (7 - 7)/((-2)/(-1)). Suppose 3l - 22 + 34 = m. List the prime factors of 9/18 + (-294)/l. 2, 37 Suppose -44o + 15064232 = 114o + 4803870. What are the prime factors of o? 7, 9277 Let y = 106501 - 62011. What are the prime factors of y? 2, 3, 5, 1483 Suppose -f + 3f + 4s - 15686 = 0, 7833 = f + 4s. What are the prime factors of f? 7853 Let l(y) = -y*3 - 17y*2 + 17y + 62. Let m be l(-18). Suppose 5p - 2t - 1428 = 0, -m - 504 = -2p + 4t. What are the prime factors of p? 2, 71 Suppose 4p - 3b + 36 = 11, b = -4p - 29. Let d(r) = -90r + 182. What are the prime factors of d(p)? 2, 7, 29 Let p = 523 + -378. Suppose pc = 150c - 2300. List the prime factors of c. 2, 5, 23 Suppose -x + f - 15 = 0, 0 = 4f + 4 + 8. Let t = -15 - x. Suppose 0 = -5q + tm + 166, 4q + 3m + 0m - 122 = 0. List the prime factors of q. 2 Let n = 5246 + 8224. What are the prime factors of n? 2, 3, 5, 449 Let u be 15(-3 - -6)/(-3). What are the prime factors of (-3 - 108/u)/(19/1045)? 3, 7, 11 Let r(z) = 40z*2 - z - 4. Let k(f) = f + 0f2 + f2 - 15f + 38. Let q be k(4). List the prime factors of r(q). 2, 79 Suppose -19v + 152539 = -152563. What are the prime factors of v? 2, 7, 31, 37 Let d = 18300 - 10758. What are the prime factors of d? 2, 3, 419 Suppose 239068 = 10i + 49i. Let v = i - 2586. What are the prime factors of v? 2, 733 Suppose 63917 + 50067 = 16u. What are the prime factors of u? 2, 13, 137 Suppose 2o - 5v - 48955 = 0, -4152v = o - 4156v - 24491. What are the prime factors of o? 5, 67, 73 Let n be (72/(-20))/(2/(-225)). Let m = n - 20. List the prime factors of m. 5, 7, 11 Let o(q) = 473q*2 + 493q + 3. List the prime factors of o(-5). 3, 3121 Suppose -72u - 100449 = -80u + 17847. List the prime factors of u. 3, 31, 53 Let q = 508 - -723. Suppose -q = -3x + 233. What are the prime factors of x? 2, 61 Suppose 26j = j + 14750. Let p = j - 405. What are the prime factors of p? 5, 37 Let t be 171 - (6/(-2))/(5 - 2). Suppose -264 = 171q - tq. List the prime factors of q. 2, 3, 11 Suppose 3h = 6t + 9063, -4h + 1862 = 3t - 10266. List the prime factors of h. 13, 233 Let a(w) = -14w + 12. Suppose -3p - 3f = -6p - 45, -4f = 12. Let b be a(p). Let t = -163 + b. What are the prime factors of t? 101 Let n(u) = -5u - 1. Let f = 61 - 62. Let p be n(f). Suppose 3w + t - 507 = -2w, 0 = 2w + pt - 192. List the prime factors of w. 2, 3, 17 Let d(m) = -3896m3 + m2 + 21m + 36. List the prime factors of d(-2). 2, 15583 Suppose -o = -7b + 31817, -b + 12o + 4541 = 14o. What are the prime factors of b? 3, 5, 101 What are the prime factors of 40186 + (22 - 1) - 6/(-2)? 2, 5, 4021 Let u = -69 - -69. Suppose u = 3d - 2t - 0 + 3, 4d + 5 = 3t. List the prime factors of 582/88/d. 2, 29 Suppose -8v + 99200 = 8v. Suppose -46w + v = -36w. What are the prime factors of w? 2, 5, 31 Let b = -230 - -636. Let t = b - -362. What are the prime factors of t? 2, 3 Suppose 0g + 1915 = -4u - g, 4g = u + 483. Let z = -294 - u. What are the prime factors of z? 5, 37 Let j = 37671 - 22433. List the prime factors of j. 2, 19, 401 Suppose 41 = 3q + 2a, 4q - a + 27 = 6q. Suppose 4912 = qs - 5059. List the prime factors of s. 13, 59 Suppose 96 = 4f + 8f. Suppose 23t - 15t - f = 0. List the prime factors of ((-196)/(-1) + -5)/t. 191 What are the prime factors of 9/(-81)-30(4 + 1319)? 2, 3, 5, 7 Suppose -409 = 3m + 14. Suppose 4k - 980 = 28. Let o = k + m. List the prime factors of o. 3, 37 Let g be (-6 + 156/30)-10. Suppose 15y = gy + 1785. What are the prime factors of y? 3, 5, 17 Suppose 2g + 4v = -4163 + 20533, -4v = 3g - 24561. What are the prime factors of g? 8191 Let g(u) = -9u2 - 9u + 14. Let z be g(5). Let v = 396 - z. What are the prime factors of v? 2, 163 Let n be 8/10 + (-336)/(-105). Suppose 3030 - 658 = nc. List the prime factors of c. 593 Suppose -f - 5 + 15 = 0. What are the prime factors of (0 - 3)/((420/(-6706))/f)? 479 Let g be 10 - (3 + 10) - 8/(-1). Suppose -3w + 6o - 10o = -2118, gw - 2o - 3556 = 0. List the prime factors of w. 2, 5, 71 Let a(d) = d*2 - 14d + 90. Let n = 60 + -55. What are the prime factors of a(n)? 3, 5 Let b(l) = -7l - 10. Let w = 22 - 7. Suppose 16q - 11q + w = 0. What are the prime factors of b(q)? 11 Let h(o) = 159o*2 + 1. Suppose 43z - 2 = 42z. Suppose -3s - 2u - 5 = 0, -zu - u = 4s + 7. List the prime factors of h(s). 2, 5 Suppose -12 = -4u, 11 = 2q + u + 2u. What are the prime factors of q/(-6 + 3801/633)? 211 Suppose -q - 25 = -4t + 4q, 2q + 10 = 0. Suppose -3u + tn - 346 = -2n, 0 = 2u + 3n + 222. Let v = 192 + u. List the prime factors of v. 2, 3, 13 Let u be (-2)/(93/99 - 1). Let j = u + -30. Suppose jy = 5y - 226. List the prime factors of y. 113 List the prime factors of 14(-16855)/(-110) - 16/88. 3, 5, 11, 13 Let j(u) = 15u*2 - 4u + 660. What are the prime factors of j(-18)? 2, 3, 233 Suppose -2k + 12147 - 3622 = -13761. What are the prime factors of k? 11, 1013 Let b be 4/(-5)(-1 + 17/2). Let p(c) = -c*2 - 11c - 30. Let t be p(b). Suppose t = 2u - 5k - 295, -2k + 400 + 90 = 3u. List the prime factors of u. 2, 5 Let a(d) = d3 - d2 - d - 3. Let i be a(-4). Suppose 3p - f + 6f + 519 = 0, 543 = -3p + 3f. Let z = i - p. What are the prime factors of z? 3, 11 Let d(u) = -32u2 - 7u + 27u2 + 18u2 - 15 - u3. What are the prime factors of d(10)? 5, 43 Suppose 0 = -11n + 6n + 20. Let x be 1/23/240. Suppose nt - 2t - 42 = x. List the prime factors of t. 3, 7 Suppose -2b + 1352 = 4z, -5b + 3z = 8z - 3395. Let j = 1201 - b. List the prime factors of j. 3, 173 Suppose 5j - 157 = b, 9b = 4j + 5b - 132. What are the prime factors of ((-34)/(-6))/(j/1674)? 2, 3, 17 Suppose w = 0, -4w + 25 = 4n + 49. List the prime factors of n(-5)/(-255) + 22854/51. 2, 7 What are the prime factors of (168/(-924))/((-2)/183986) + (0 - -5)? 3, 11, 13 Suppose 0 = 3u - 272w + 268w - 114438, -u + 38114 = 4w. What are the prime factors of u? 2, 19069 Suppose 5c - 27 = 4q, 2q + 4c = 1 + 5. Let i = q + -4. What are the prime factors of (-7 + i)(30/(-4) - -1)? 7, 13 Let d be (-9 + 1427)(-3)/(-6). Let z = -237 + d. Suppose -z = -4h - 4h. List the prime factors of h. 59 Suppose 3q - 12 = 9. Suppose qm - 2m - 4v = 900, 5v = -2m + 393. List the prime factors of m. 2, 23 Let o be (-8)/((-40)/25) + 474. Let v = 527 - o. What are the prime factors of v? 2, 3 Let p(z) = -8z + 74. Let i be (63/(-45) - 4/(-10))10. What are the prime factors of p(i)? 2, 7, 11 Let u be -1 + -1 + 1456 + 56/(-8). Let c = u - 635. What are the prime factors of c? 2, 7, 29 Suppose 183594 = 119f - 113f. List the prime factors of f. 37, 827 Let i(c) = -5c3 + 3c + 1. Let o be i(-2). Suppose -2t + o = -19. Suppose 0 = 2z + t - 169. List the prime factors of z. 71 Suppose 6y - 46 = -16. Suppose 18 = ya - 27. What are the prime factors of a? 3 Suppose 5d - 133 = m - 51, -5d = -5m - 370. Let b = 48 + m. What are the prime factors of (0 - -25)/(1 - (-18)/b)? 2, 5 What are the prime factors of (-52675)/(-645)(2 - 0 - -7)? 3, 5, 7 Let u(w) = 155w2 + 33w - 18. List the prime factors of u(-19). 2, 5, 5531 Let t = 7 - 12. Suppose 0 = -5c + 2x + 6, 2x + 2 = -3c + 6x. What are the prime factors of (t - -35)(c/3 - 0)? 2, 5 Let b = 181 + -72. Suppose 104 - 308 = 4w. Let k = w + b. List the prime factors of k. 2, 29 Let r = -12 - -1013. Suppose d - 4y = r, -3y - 5975 = -5d - 919. What are the prime factors of d? 1013 Suppose 0 = -2b + 3c - 51 - 441, -5b - 1180 = 5c. Let f be 1/2 + 22/(-4). What are the prime factors of b/f - (-2)/1? 2, 5 Let p be (-6)/(-9)15/(-1). Suppose 23 + 49 = 3c. List the prime factors of ((2 - -1) + -8)c/p. 2, 3 Let m = 12044 + -2912. List the prime factors of m. 2, 3, 761 Suppose -2k = -7y + 338363, 4y - 102862 = -3k + 90509. List the prime factors of y. 3, 41, 131 Suppose 31 = -27t + 85. What are the pr	{ "pile_set_name": "DM Mathematics" }
0? -12, -1, 525 Factor -5w2 - 46065w + 46070. -5(w - 1)(w + 9214) Factor 7v3 - 656v*2 + 10900v + 3168. (v - 72)(v - 22)(7v + 2) Solve 4k*4 + 284k*3 - 10428k*2 + 67140k + 178200 = 0 for k. -99, -2, 15 Solve -1296x3 - 9710784x*2 + 1078988x - 29972 = 0 for x. -7493, 1/18 Factor -104y3/9 + 4396y*2/9 - 15680y/3 + 1372. -4(y - 21)2(26y - 7)/9 Determine w so that 4w*4 + 43994w*3 - 286082w*2 + 528222w - 198090 = 0. -11005, 1/2, 3 Determine v so that -2v3/7 - 76277v*2/7 - 38137v/7 + 38138/7 = 0. -38138, -1, 1/2 Solve -5m3 + 172075m*2 - 172060m - 344140 = 0. -1, 2, 34414 Let 3b2 + 22638b - 158613 = 0. Calculate b. -7553, 7 Factor 320y5 + 2160y*4 + 5325y*3 + 5710y*2 + 2460y + 360. 5(y + 2)3(8y + 3)2 Solve o2/5 - 106282o/5 + 318837/5 = 0 for o. 3, 106279 Find c such that -c*2/3 - 16488c - 203890608 = 0. -24732 Factor -2v2 + 344v - 10742. -2(v - 131)(v - 41) Find n, given that -16n4 - 5316n*3 - 42500n*2 + 86712n - 38880 = 0. -324, -10, 3/4, 1 Let p*4/2 - 4575p*3/2 - 36651p*2/2 - 59573p/2 - 13749 = 0. What is p? -6, -1, 4583 Factor 4d3/9 + 2536d*2/9 + 836d/3 - 1688. 4(d - 2)(d + 3)(d + 633)/9 Find g, given that -g3/2 + 163g*2/6 - 229g + 220/3 = 0. 1/3, 10, 44 Determine f so that 9f5/2 - 168f*4 + 2571f*3/2 + 1104f*2 - 1290f - 936 = 0. -1, -2/3, 1, 12, 26 Find o such that o*5 + 865o*4 - 3472o*3 + 3476o*2 = 0. -869, 0, 2 Find r, given that 4r*2 + 2861800r + 511868702500 = 0. -357725 Determine y, given that 201y2/2 - 594y - 54 = 0. -6/67, 6 Factor -8s4 + 96056s*3 - 288528146s*2 + 1152960168s - 1152576072. -2(s - 2)2(2s - 12003)2 Determine i, given that i4 + 206i*3 + 1151i*2 - 9734i + 13200 = 0. -200, -11, 2, 3 Determine l, given that 4l4 - 1116000l*3 + 77839883992l*2 + 155683116000l + 77842116004 = 0. -1, 139501 Factor -i*3/2 - 496i*2 + 1987i/2 - 497. -(i - 1)*2(i + 994)/2 Factor -2b3 - 324b*2 - 12450b - 140000. -2(b + 25)2(b + 112) Factor o*3/4 + 67o*2/4 - 410o + 2175. (o - 10)*2(o + 87)/4 Factor k*4/4 + 53k*3/4 + 897k*2/4 + 5239k/4 + 2197/2. (k + 1)(k + 13)2(k + 26)/4 Determine b, given that 3b4 - 11715b*3 + 35118b*2 = 0. 0, 3, 3902 Determine a, given that 6a*5/13 - 146a*4/13 - 658a*3/13 + 90a*2 + 188a/13 - 560/13 = 0. -5, -2/3, 1, 28 Find r such that -4r3 + 18628r*2 + 93296r - 261072 = 0. -7, 2, 4662 Factor 2b3/13 + 188b*2/13 - 1618b/13 + 1428/13. 2(b - 7)(b - 1)(b + 102)/13 Determine d so that 3d*4 + 201d*3 + 1689d*2 - 1785d - 33516 = 0. -57, -7, 4 Factor r*3/5 + 168r*2/5 - 26895r + 13125086/5. (r - 163)*2(r + 494)/5 Solve -2z4/9 + 10270z*3/9 + 10274z*2/3 + 30826z/9 + 10276/9 = 0. -1, 5138 Factor i*2/6 - 68371i/6 + 45578. (i - 68367)(i - 4)/6 Factor 3x*5 - 273x*4 - 891x*3 + 4281x*2 - 4812x + 1692. 3(x - 94)(x - 1)*3(x + 6) Let 5u4 - 7955u*3/6 + 575885u*2/6 - 1047900u + 171990 = 0. Calculate u. 1/6, 13, 126 Factor 4785p2 + 19131p - 36. 3(p + 4)(1595p - 3) Let -2b*5/15 + 38b*4/5 - 2104b*3/15 + 11624b*2/15 + 6176b/5 - 5632/3 = 0. What is b? -2, 1, 16, 20, 22 Factor -15g2 - 1705280g + 1136860. -5(g + 113686)(3g - 2) Factor -s4/10 + 61291s*3/5 - 245161s*2/10 + 12258s. -s(s - 122580)(s - 1)*2/10 Factor 2o*2 - 792o + 5446. 2(o - 389)(o - 7) What is l in l*4/2 + 9l*3 - 67l*2/2 - 36l + 126 = 0? -21, -2, 2, 3 Let -2x5 + 3480x*4 - 1524172x*3 + 8995992x*2 + 10523646x = 0. Calculate x. -1, 0, 7, 867 What is c in -c*3/2 + 17c*2 - 112c + 208 = 0? 4, 26 Factor 2k4 + 868k*3 - 7046k*2 + 11480k - 5304. 2(k - 6)(k - 1)*2(k + 442) Factor 27q2/2 + 1578q - 5040. 3(q + 120)(9q - 28)/2 Factor -6y*3 - 633y*2 - 2739y - 1212. -3(y + 4)(y + 101)(2y + 1) Factor -4s5 + 96s*4 - 344s*3 + 496s*2 - 324s + 80. -4(s - 20)(s - 1)4 Determine g, given that g4/3 - 2324g3/3 + 4637g*2/3 + 16250g/3 + 3096 = 0. -1, 4, 2322 Solve -15k3/2 + 235k*2/4 + 140k + 295/4 = 0. -1, 59/6 Solve 4r2/7 + 1656r/7 + 119412/7 = 0. -321, -93 Find i such that -i*3/4 + 413i*2/4 + 1479i/2 - 1890 = 0. -9, 2, 420 Determine o, given that -2o4/5 + 26o*3/5 - 14o*2/5 - 114o/5 - 72/5 = 0. -1, 3, 12 Find s, given that -72s2 - 23826s + 19905 = 0. -1327/4, 5/6 Let 4r2 - 71952r - 71956 = 0. What is r? -1, 17989 Let -3q2/4 + 489q/2 - 65007/4 = 0. Calculate q. 93, 233 Factor s*4 + 657s3. s3(s + 657) Let -c3/2 + 3c*2/2 + 45c/2 + 81/2 = 0. Calculate c. -3, 9 Factor 2k3 + 115k*2 - 2016k - 7029. (k + 3)(k + 71)(2k - 33) Factor 2m*2/5 - 24822m/5 + 74448/5. 2(m - 12408)(m - 3)/5 Factor 4r4 + 648r*3 + 6740r*2 + 14352r - 21744. 4(r - 1)(r + 6)*2(r + 151) Suppose -3t5 - 3123t*4 + 56946t*3 - 254214t*2 - 56943t + 257337 = 0. What is t? -1059, -1, 1, 9 Factor 2m4 - 1740m*3 - 32m*2 + 27840m. 2m(m - 870)(m - 4)(m + 4) Determine h, given that -h*5/7 + 346h*4/7 + 13014h*3/7 + 17440h*2 + 84779h/7 - 220218/7 = 0. -17, -2, 1, 381 Factor -3x2 + 490x - 163. -(x - 163)(3x - 1) Suppose -2h3/9 - 74056h*2/9 + 148166h - 666828 = 0. Calculate h. -37046, 9 Let -3y3 - 6570y*2 + 6573y = 0. What is y? -2191, 0, 1 Suppose i*3 - 683i*2 - 1370i = 0. What is i? -2, 0, 685 Let 6265009w2 + 20024w + 16 = 0. What is w? -4/2503 Find o, given that 4o2 + 1668o - 10152 = 0. -423, 6 Solve -3c4/5 + 2445c*3 - 231297c*2/5 + 425931c/5 - 206856/5 = 0 for c. 1, 17, 4056 Factor 2k3/9 + 26k*2/3 - 722k/9 + 470/3. 2(k - 5)(k - 3)(k + 47)/9 What is z in 3z*4/5 + 129z*3/5 - 858z*2/5 + 1176z/5 = 0? -49, 0, 2, 4 Suppose 16q3/5 - 9622q*2/5 + 6462q - 10764/5 = 0. Calculate q. 3/8, 3, 598 Factor -c*3/3 - 35c*2/3 - 362c/3 - 952/3. -(c + 4)(c + 14)(c + 17)/3 Factor -3u3/7 - 984u*2/7 - 53295u/7 + 4825722/7. -3(u - 46)(u + 187)*2/7 What is l in 4l*2 + 1653328l + 170843342224 = 0? -206666 Solve v*3/3 - 1429v*2/3 - 955v + 1431 = 0 for v. -3, 1, 1431 Let 2m2/7 - 1326m/7 + 20704/7 = 0. Calculate m. 16, 647 Factor 11u3/3 + 193u*2/3 - 261u + 105. (u - 3)(u + 21)(11u - 5)/3 Factor 2v*3 - 18280v*2 - 2v + 18280. 2(v - 9140)(v - 1)(v + 1) Let -3s*4 + 579s*3 - 7164s*2 - 2315316s + 2321904 = 0. What is s? -52, 1, 122 Suppose 3g2/4 - 78042g + 2030184588 = 0. What is g? 52028 Factor -3q2 - 38628q + 38631. -3(q - 1)(q + 12877) Determine z so that -4z4 - 206z*3 + 6456z*2 - 15016z + 5920 = 0. -74, 1/2, 2, 20 Let -9410s3 + 9425s*2 - 15s = 0. What is s? 0, 3/1882, 1 Factor -4k4 - 1132k*3 + 4k*2 + 1132k. -4k(k - 1)(k + 1)(k + 283) Let p*4 + 56602p*3 + 801003200p*2 + 1601780000p = 0. What is p? -28300, -2, 0 Factor 2u3/7 + 1178u*2/7 + 1172u/7 - 336. 2(u - 1)(u + 2)(u + 588)/7 Determine x, given that 190x*5/11 - 52x*4 - 1894x*3/11 + 20x*2/11 = 0. -2, 0, 1/95, 5 Let 882x*5 + 598822x*4 - 637822x*3 + 12282x*2 + 28556x - 2720 = 0. What is x? -680, -2/9, 1/7, 1 What is z in 2z4 - 858z*3 - 18684z*2 - 96920z - 126000 = 0? -14, -5, -2, 450 Let 2v3/13 + 68550v*2/13 + 587422086v/13 + 587353538/13 = 0. Calculate v. -17137, -1 Solve -i*4/7 + 1208i*3/7 - 371992i*2/7 + 4334304i/7 - 12873744/7 = 0. 6, 598 Factor 2p4/5 + 34p*3/5 - 452p*2/5 + 416p/5. 2p(p - 8)(p - 1)(p + 26)/5 Let -2u2/11 - 112u/11 - 1550/11 = 0. What is u? -31, -25 Factor 224a4 + 7932a*3 + 22452a*2 + 22004a + 7260. 4(a + 1)3(56a + 1815) Let 2g*5/5 - 139g*4/5 - 1003g*3/5 + 1088g*2/5 + 796g - 2128/5 = 0. Calculate g. -7, -2, 1/2, 2, 76 Let 2j3/5 - 644j*2/5 + 6128j/5 + 34944/5 = 0. Calculate j. -4, 14, 312 Factor 3i4 - 8370i*3 + 25089i*2 - 16722i. 3i(i - 2787)(i - 2)(i - 1) Factor -16k2 + 63972k - 15992. -4(k - 3998)(4k - 1) What is z in z5/6 + 31z*4/6 + 305z*3/6 + 1025z*2/6 + 209z + 84 = 0? -14, -12, -3, -1 Determine h, given that -2h3/3 + 574072h*2/3 - 2296264h/3 + 2296256/3 = 0. 2, 287032 Solve 98v3/11 - 5882v*2/11 + 120v/11 = 0. 0, 1/49, 60 What is n in -2n3/9 - 232n*2/9 + 320n/3 = 0? -120, 0, 4 Supp	{ "pile_set_name": "DM Mathematics" }
rt(55) - sqrt(55)1-2))/(sqrt(35)/sqrt(112)) - ((3 + 3sqrt(99))2 + -5). -895 - 38sqrt(11) Simplify ((sqrt(396) + sqrt(396)2)/sqrt(11) - sqrt(396)/(-2sqrt(11)))/(sqrt(96)/(sqrt(392)-5 - sqrt(8) - sqrt(8))). -259sqrt(3)/2 Simplify (2(sqrt(2940) - sqrt(60)))/(1sqrt(1200)) + (sqrt(50) + (-3sqrt(50)-2 - sqrt(50)))/(sqrt(10) + ((sqrt(60)/sqrt(3) + sqrt(20))/sqrt(2) - sqrt(10))). 21sqrt(5)/5 Simplify ((5(2sqrt(68) + 4))2 - ((1sqrt(68) + -3)-4)2)-6 + -4. -35812 - 5952sqrt(17) Simplify 5 + (-534sqrt(12) - (1 + sqrt(12)-1)2-2). -128sqrt(3) + 31 Simplify ((-2 + sqrt(1539) + 4 + (sqrt(1539) - 3sqrt(1539)))-3 - (1 + (sqrt(1539) - (sqrt(1539) + sqrt(1539) + 2)-1)4))2. 2430sqrt(19) + 124884 Simplify (sqrt(42) + (sqrt(504)-2)/sqrt(12))/(sqrt(486) + sqrt(486)-2 + sqrt(486) + sqrt(486)) - (-4 + (sqrt(14)/sqrt(2) + 4)4). -12 - 37sqrt(7)/9 Simplify 1 + sqrt(13) + ((sqrt(91)-4 - sqrt(91))/sqrt(7))2 + 3 + (4 + 1 + sqrt(1300) + 2)2. 141sqrt(13) + 1678 Simplify 0 + -1(6(sqrt(171)1 - sqrt(171)) + (sqrt(171) - (sqrt(171) - (2sqrt(171) + sqrt(171))))-3)/(sqrt(27)/(-3-3sqrt(3))). 81sqrt(19) Simplify ((3 + sqrt(475)2)-1 - ((sqrt(76) - (-1 + sqrt(76))) + -2 + -4))*2-1. -1904 + 40sqrt(19) Simplify 2((1 + sqrt(637) + 0)*2 + sqrt(637) + 5 + -1sqrt(637) + 3 + (3 + sqrt(637) + 0)*2)4. 448sqrt(13) + 10336 Simplify 1 + (3(sqrt(144)22 + sqrt(144)))/((-3sqrt(192) - sqrt(192))2). -15sqrt(3)/16 + 1 Simplify -4 + ((sqrt(42)/(-2sqrt(7)) + (sqrt(6) - ((sqrt(6) + sqrt(6)1)-2 + sqrt(6) - sqrt(6))))/(5(sqrt(90)/sqrt(6))/sqrt(5)))2. -119/50 Simplify ((6-1sqrt(272) + 0 + sqrt(272)-2 - (sqrt(272) + -3)64) + -4)*2. -17408sqrt(17) + 283152 Simplify sqrt(44)/sqrt(4) + -3 + (sqrt(11) + sqrt(11) + (1 + sqrt(539) - sqrt(539)))*2 + -1 + sqrt(1331) + 0 - (4 + -4(1 + sqrt(44) + -3)*2). -16sqrt(11) + 229 Simplify ((sqrt(70) - ((sqrt(70)-1 + sqrt(70))3 + sqrt(70)))/sqrt(7))/(63sqrt(5)-2) + 1. 1 Simplify 5((2((sqrt(117) + -1)2 - sqrt(117)))*2 - ((4 + (sqrt(117) + 2 + sqrt(117) - sqrt(117)) - sqrt(117)) + -3)). -240sqrt(13) + 2405 Simplify (1-1-22(sqrt(475) + -1 + 4))*21 + 4. 480sqrt(19) + 7748 Simplify (((sqrt(15) + sqrt(135))1 - (sqrt(1815) - sqrt(1815)-1))/(3(sqrt(21)-2 + sqrt(21))/sqrt(7)) + -5)2. -60sqrt(5) + 205 Simplify -6(((2sqrt(66))/sqrt(3))/sqrt(11) + -1 + ((1 + sqrt(18))*2 - (sqrt(2) + -5)1)). -138 - 42sqrt(2) Simplify (0 + 1sqrt(180) - (sqrt(180) + sqrt(180)-1 + -2) - (5 + (sqrt(180) + 2 + 1)2)) + 0. -192 - 30sqrt(5) Simplify (6((2sqrt(468)-5 - (-2sqrt(468) + sqrt(468) + -1)) + 0 + (sqrt(468) - (sqrt(468)1 + 2))))2. 3888sqrt(13) + 1364724 Simplify (sqrt(7) + sqrt(448) + -3 - sqrt(168)/sqrt(6))*2 + (sqrt(168)/(sqrt(12)/sqrt(2)))/((sqrt(44) + sqrt(88)/sqrt(2))/sqrt(11)). -83sqrt(7)/2 + 352 Simplify ((sqrt(38) - (sqrt(38) + 4sqrt(190)/sqrt(5)))2)/(2(sqrt(2) + sqrt(2) + (sqrt(2) + sqrt(24)/(sqrt(12)-3) - sqrt(2))))-5. 12sqrt(19) Simplify (((sqrt(143) + ((sqrt(143)2 - sqrt(143)) + sqrt(143))-2)25)/(5sqrt(275)-2-1)-1-6)2. 4212/25 Simplify (-2sqrt(84)23)/(-4-4sqrt(432)). -sqrt(7)/8 Simplify (sqrt(1440)1)/(sqrt(72)/sqrt(4)) + 2 - ((-1sqrt(720))*24 - ((-2sqrt(5)-1)2 + (sqrt(55)/(sqrt(22)/sqrt(2)))2)). -2853 + 4sqrt(5) Simplify (2(-3 + 2(1sqrt(1728) + -2 - (2(-1sqrt(1728) + sqrt(1728)) - sqrt(1728))) + -2))*2. -6912sqrt(3) + 110916 Simplify (-4(sqrt(88)/sqrt(200) - (2sqrt(891) + 1)))*2. 2848sqrt(11)/5 + 1394496/25 Simplify (2 + 1 + sqrt(242) - (sqrt(242) - (-5 + sqrt(242)1)))2 + (-5 + 2 + sqrt(242))-1 + 0 + 4. -55sqrt(2) + 253 Simplify (-4 + (-5 + sqrt(147) + -1)2 + 2 + 0)3. -252sqrt(3) + 543 Simplify ((sqrt(14)/(sqrt(2) + -2sqrt(2)))*2 + 4 + sqrt(28) - (sqrt(28)/sqrt(4)-1 + sqrt(7))-6) + -2. 2sqrt(7) + 9 Simplify ((2sqrt(180) + -5 + sqrt(180) + -2 + (sqrt(180) - sqrt(180)2) + 5(0 + 0 + sqrt(180)))2 + -1)2. -1176sqrt(5) + 17736 Simplify -1(((-3((sqrt(91) - (sqrt(91) - (sqrt(91) + (sqrt(91) - sqrt(91)-1)) - sqrt(91))) + sqrt(91))-6)/(-5-1sqrt(7)1))*2 + 4 + 4). -4220 Simplify ((sqrt(6655) - (sqrt(6655) + 1sqrt(6655)))3 - sqrt(6655))/((sqrt(5) + sqrt(10)/sqrt(2))-4 + (sqrt(5) - sqrt(125)-2 - sqrt(5) - sqrt(5))) + 1. -44sqrt(11) + 1 Simplify (5 + -63sqrt(112)4 - (sqrt(112) + sqrt(112)-5 + -5 + ((5sqrt(112) + sqrt(112))1 - sqrt(112))))*2. -5840sqrt(7) + 596948 Simplify (-2 + (2(sqrt(11) - (sqrt(539)-1 + sqrt(539)) - (5sqrt(33)/sqrt(3) + sqrt(11))) - (1 + -2sqrt(11)3)3))*2. -80sqrt(11) + 729 Simplify ((-5sqrt(56))/sqrt(7)16)/(3sqrt(4)3 - sqrt(36)/(sqrt(63)/sqrt(7))). -15sqrt(2)/4 Simplify (((sqrt(162) - (sqrt(162) + -1 + sqrt(162) + sqrt(162))) + 2 + (sqrt(162) - (2 + sqrt(162)-1)))2 - ((1 + sqrt(2))2 + 3sqrt(2) + 4)2) + 5. -60sqrt(2) - 80 Simplify 2 + (sqrt(20)/(sqrt(36)/sqrt(9)) + (3sqrt(20) + sqrt(20))2 - (-1 + ((sqrt(495)1)/sqrt(9))/sqrt(11))). 323 Simplify (5 + ((-3(sqrt(448) - (sqrt(448) + -4 + sqrt(448) - sqrt(448))))2 - (1 + 4sqrt(448)))-3)6. -2544 + 576sqrt(7) Simplify 3-3(sqrt(76) + (sqrt(76)15)2 + -4 - (3(sqrt(76) + -1)5)2)6. -48708sqrt(19) + 833166 Simplify (-4 + (-6-3sqrt(2057) - (sqrt(2057) - (sqrt(2057) + (sqrt(2057) + 0 + sqrt(2057))5)) - (1 + 6-4(1 + sqrt(2057)))))*2. 21736sqrt(17) + 5562489 Simplify (((sqrt(99) - 1sqrt(99)1 - sqrt(99)) + (sqrt(99)2 + sqrt(99) + sqrt(99) + sqrt(99))-1)3)/((sqrt(36) - sqrt(144)/(sqrt(4)-1))/(sqrt(256)-2)). 144sqrt(11) Simplify 0 + (3(-2-2sqrt(243) - (sqrt(243) + (sqrt(243) - (sqrt(243) + (4 + sqrt(243) + -1 - sqrt(243)))))) + -3 + 5)2. 1782sqrt(3) + 19804 Simplify (-4-1sqrt(119) + (3sqrt(119) + sqrt(119) - sqrt(119))-2)/(1sqrt(175) + sqrt(686)/sqrt(2))-4. 2sqrt(17)/3 Simplify (5(sqrt(208) + 3-2sqrt(208) - sqrt(208)))/(sqrt(2916)2) + 0 + 3. -10sqrt(13)/9 + 3 Simplify (sqrt(300)-11 + 61sqrt(300))/(-2-1(sqrt(6) - (sqrt(66) + sqrt(66)-2 + sqrt(66))/sqrt(11))). 25sqrt(2)/2 Simplify (sqrt(170) + sqrt(170)23 - (-2sqrt(170) - sqrt(170))3)/((-2sqrt(1620))/sqrt(2)). -8sqrt(17)/9 Simplify (41sqrt(1375) + -2sqrt(1375)1)/(-2(sqrt(20)/sqrt(64) + sqrt(45)/sqrt(144))). -10sqrt(11) Simplify ((-5(sqrt(1100) + sqrt(1100)3 + sqrt(1100))1 + 1 - (6(sqrt(1100) + -1)3 + -2))3)*2. -162540sqrt(11) + 18309069 Simplify (0 + (sqrt(21)/sqrt(3) + -1)-1 + sqrt(42)/(-2sqrt(6))-4 + 5)2. 12sqrt(7) + 43 Simplify -2(0 + ((sqrt(612)2 + 1 + -5 - (-1 + sqrt(612)-1 - ((1sqrt(612) - sqrt(612)) + -2)))-3)2). -99594 + 3240sqrt(17) Simplify 3 + (-1 + -5(((sqrt(300) + -1)26 - sqrt(300)) + (sqrt(300) + 0 + sqrt(300) + -2 + sqrt(300) - sqrt(300))*2))-44. -16800sqrt(3) + 240819 Simplify (-3sqrt(190)-5 - sqrt(190)-26)/(sqrt(640) + sqrt(640) + (sqrt(640) - 1(sqrt(640)-2 - sqrt(640))) + -1sqrt(640)-2 + sqrt(640) + sqrt(640)) + 3. 27sqrt(19)/80 + 3 Simplify (2-2(2sqrt(85)2 - ((sqrt(85) - sqrt(85)-2)3 + sqrt(85))))/(((sqrt(100)-2)/sqrt(10))/(sqrt(128)3)). -288sqrt(17) Simplify (-1sqrt(720)-3 + (3sqrt(720) - sqrt(720))3 - 563sqrt(720))2. 4723920 Simplify ((sqrt(3520)-12 + 4(sqrt(3520) + 2sqrt(3520) + sqrt(3520)))/((sqrt(280)/(sqrt(8) - (sqrt(8) + sqrt(32)/sqrt(4))))/sqrt(7) - 61sqrt(245)))2. 137984/1849 Simplify (-1(4 + 1 + sqrt(98) + sqrt(98) + (sqrt(98) - (sqrt(98) + (sqrt(98) - -2sqrt(98)) - sqrt(98))-4)))*2 - ((sqrt(98) + 4sqrt(98))1-2 + 4). 1120sqrt(2) + 22071 Simplify (sqrt(52) + (1sqrt(416))/sqrt(8) - sqrt(3328)3)/(-1((1sqrt(100) - sqrt(100)) + sqrt(100))1). 22sqrt(13)/5 Simplify (62(sqrt(152) + sqrt(152)1-6))/(6sqrt(512)13). -5sqrt(19)/12 Simplify (((sqrt(1331)-2 - sqrt(1331))-2 - (sqrt(1331) + 1 + sqrt(1331))2)*2 - (1((1 + sqrt(1331))-3 + 0))2) + -2. -6662 - 286sqrt(11) Simplify (32(-3 + 0 + sqrt(1331) + 4 + (sqrt(1331) - (-1 + sqrt(1331) + 0) - sqrt(1331))) + 1)*2. 169 Simplify -2 + (sqrt(396) + 2sqrt(396)-2 - 3sqrt(396)3)2 + (3 + 2sqrt(396))2 + (0 + 2 + sqrt(396) + sqrt(396))2. 120sqrt(11) + 60203 Simplify (6((32sqrt(95))/(sqrt(5) + -4sqrt(5)-1) + 5 + 0))*2. 432sqrt(19) + 47124/25 Simplify -6(sqrt(704) + 1 + sqrt(704)) + (sqrt(704) - (-2sqrt(704)1 + sqrt(704))*2) +	{ "pile_set_name": "DM Mathematics" }
to the nearest integer? 13 What is 23381 to the power of 1/3, to the nearest integer? 29 What is 10090 to the power of 1/3, to the nearest integer? 22 What is 58 to the power of 1/6, to the nearest integer? 2 What is the eighth root of 462 to the nearest integer? 2 What is 21225 to the power of 1/7, to the nearest integer? 4 What is the third root of 1769 to the nearest integer? 12 What is the square root of 341 to the nearest integer? 18 What is the fourth root of 10830 to the nearest integer? 10 What is the eighth root of 8526 to the nearest integer? 3 What is 53871 to the power of 1/3, to the nearest integer? 38 What is the square root of 5419 to the nearest integer? 74 What is the fourth root of 3446 to the nearest integer? 8 What is the sixth root of 4872 to the nearest integer? 4 What is the square root of 176809 to the nearest integer? 420 What is 1146 to the power of 1/3, to the nearest integer? 10 What is the square root of 30093 to the nearest integer? 173 What is 34097 to the power of 1/3, to the nearest integer? 32 What is the third root of 2248 to the nearest integer? 13 What is 19616 to the power of 1/3, to the nearest integer? 27 What is 32516 to the power of 1/2, to the nearest integer? 180 What is 16769 to the power of 1/3, to the nearest integer? 26 What is 97588 to the power of 1/8, to the nearest integer? 4 What is 217 to the power of 1/3, to the nearest integer? 6 What is 506 to the power of 1/8, to the nearest integer? 2 What is the square root of 1681 to the nearest integer? 41 What is 154 to the power of 1/2, to the nearest integer? 12 What is the square root of 1613 to the nearest integer? 40 What is 9026 to the power of 1/2, to the nearest integer? 95 What is the cube root of 4729 to the nearest integer? 17 What is 1427 to the power of 1/3, to the nearest integer? 11 What is 6896 to the power of 1/3, to the nearest integer? 19 What is the cube root of 4992 to the nearest integer? 17 What is 5799 to the power of 1/7, to the nearest integer? 3 What is the square root of 87602 to the nearest integer? 296 What is the cube root of 16105 to the nearest integer? 25 What is the cube root of 9499 to the nearest integer? 21 What is 1827 to the power of 1/3, to the nearest integer? 12 What is 4102 to the power of 1/3, to the nearest integer? 16 What is the square root of 383 to the nearest integer? 20 What is 456 to the power of 1/2, to the nearest integer? 21 What is 7087 to the power of 1/6, to the nearest integer? 4 What is 38851 to the power of 1/2, to the nearest integer? 197 What is 63040 to the power of 1/2, to the nearest integer? 251 What is 3246 to the power of 1/2, to the nearest integer? 57 What is 1308 to the power of 1/8, to the nearest integer? 2 What is 16171 to the power of 1/9, to the nearest integer? 3 What is the fourth root of 2172 to the nearest integer? 7 What is the ninth root of 36759 to the nearest integer? 3 What is the fifth root of 2810 to the nearest integer? 5 What is the square root of 78043 to the nearest integer? 279 What is 64969 to the power of 1/6, to the nearest integer? 6 What is the third root of 1106 to the nearest integer? 10 What is the eighth root of 242 to the nearest integer? 2 What is 3056 to the power of 1/3, to the nearest integer? 15 What is 38065 to the power of 1/3, to the nearest integer? 34 What is the square root of 5037 to the nearest integer? 71 What is the ninth root of 45735 to the nearest integer? 3 What is the square root of 57001 to the nearest integer? 239 What is 3984 to the power of 1/3, to the nearest integer? 16 What is the cube root of 47090 to the nearest integer? 36 What is the third root of 685 to the nearest integer? 9 What is the seventh root of 6242 to the nearest integer? 3 What is the cube root of 1016 to the nearest integer? 10 What is the seventh root of 670 to the nearest integer? 3 What is the fifth root of 2161 to the nearest integer? 5 What is the sixth root of 932 to the nearest integer? 3 What is the square root of 3076 to the nearest integer? 55 What is the fourth root of 3138 to the nearest integer? 7 What is 23094 to the power of 1/4, to the nearest integer? 12 What is the third root of 464 to the nearest integer? 8 What is the square root of 15660 to the nearest integer? 125 What is 7015 to the power of 1/3, to the nearest integer? 19 What is 33121 to the power of 1/9, to the nearest integer? 3 What is the square root of 18609 to the nearest integer? 136 What is 90259 to the power of 1/5, to the nearest integer? 10 What is 1048 to the power of 1/2, to the nearest integer? 32 What is 21510 to the power of 1/4, to the nearest integer? 12 What is 821 to the power of 1/9, to the nearest integer? 2 What is the third root of 22341 to the nearest integer? 28 What is the square root of 143139 to the nearest integer? 378 What is the cube root of 1483 to the nearest integer? 11 What is 5123 to the power of 1/2, to the nearest integer? 72 What is 8327 to the power of 1/7, to the nearest integer? 4 What is the cube root of 155 to the nearest integer? 5 What is the seventh root of 5221 to the nearest integer? 3 What is 60722 to the power of 1/4, to the nearest integer? 16 What is the sixth root of 2182 to the nearest integer? 4 What is 479 to the power of 1/3, to the nearest integer? 8 What is the cube root of 496 to the nearest integer? 8 What is the seventh root of 611 to the nearest integer? 3 What is the sixth root of 50142 to the nearest integer? 6 What is 4848 to the power of 1/8, to the nearest integer? 3 What is 4686 to the power of 1/7, to the nearest integer? 3 What is the seventh root of 14390 to the nearest integer? 4 What is 68028 to the power of 1/2, to the nearest integer? 261 What is 1090 to the power of 1/3, to the nearest integer? 10 What is the third root of 594 to the nearest integer? 8 What is 1653 to the power of 1/5, to the nearest integer? 4 What is the square root of 614 to the nearest integer? 25 What is the ninth root of 9302 to the nearest integer? 3 What is 625 to the power of 1/3, to the nearest integer? 9 What is the tenth root of 45251 to the nearest integer? 3 What is the eighth root of 17056 to the nearest integer? 3 What is the fifth root of 8155 to the nearest integer? 6 What is the third root of 304 to the nearest integer? 7 What is the third root of 100 to the nearest integer? 5 What is 2063 to the power of 1/3, to the nearest integer? 13 What is 92749 to the power of 1/2, to the nearest integer? 305 What is 981 to the power of 1/2, to the nearest integer? 31 What is the square root of 24285 to the nearest integer? 156 What is 30186 to the power of 1/6, to the nearest integer? 6 What is 2409 to the power of 1/10, to the nearest integer? 2 What is 11552 to the power of 1/3, to the nearest integer? 23 What is 846 to the power of 1/6, to the nearest integer? 3 What is 6 to the power of 1/3, to the nearest integer? 2 What is 26716 to the power of 1/3, to the nearest integer? 30 What is 1874 to the power of 1/3, to the nearest integer? 12 What is 1351 to the power of 1/10, to the nearest integer? 2 What is 37 to the power of 1/2, to the nearest integer? 6 What is 508 to the power of 1/2, to the nearest integer? 23 What is the ninth root of 1460 to the nearest integer? 2 What is the tenth root of 982 to the nearest integer? 2 What is the cube root of 54951 to the nearest integer? 38 What is 875 to the power of 1/5, to the nearest integer? 4 What is the eighth root of 904 to the nearest integer? 2 What is the cube root of 507 to the nearest integer? 8 What is the cube root of 657 to the nearest integer? 9 What is the square root of 55282 to the nearest integer? 235 What is 18703 to the power of 1/2, to the nearest integer? 137 What is 19158 to the power of 1/3, to the nearest integer? 27 What is the cube root of 2064 to the nearest integer? 13 What is the fifth root of 13175 to the nearest integer? 7 What is 845 to the power of 1/2, to the nearest integer? 29 What is 302 to the power of 1/2, to the nearest integer? 17 What is 1960 to the power of 1/3, to the nearest integer? 13 What is the eighth root of 5553 to the nearest integer? 3 What is the sixth root of 7574 to the nearest integer? 4 What is the square root of 1	{ "pile_set_name": "DM Mathematics" }
common factor of 75075 and 781935? 1155 Calculate the greatest common factor of 1609982 and 67496. 22 Calculate the highest common factor of 5196096 and 351528. 2328 What is the highest common divisor of 350 and 1707125? 175 What is the greatest common factor of 56718021 and 57? 57 What is the greatest common divisor of 30280 and 2566987? 757 What is the greatest common divisor of 3610 and 666406? 722 What is the greatest common factor of 45 and 13634667? 9 What is the highest common factor of 109 and 188081? 1 Calculate the greatest common divisor of 414 and 3866070. 138 What is the highest common factor of 1094 and 39428307? 547 Calculate the greatest common divisor of 946 and 3592754. 22 What is the highest common divisor of 338424653 and 4385? 877 Calculate the greatest common factor of 53002269 and 45. 9 Calculate the greatest common factor of 822 and 6810544. 274 What is the greatest common divisor of 42278 and 206? 2 What is the highest common divisor of 28853 and 29403? 11 Calculate the greatest common divisor of 1088 and 1065376. 32 Calculate the greatest common factor of 586943 and 648445. 1337 What is the greatest common factor of 396042812 and 748? 748 Calculate the highest common factor of 13437 and 110169. 9 What is the highest common divisor of 7667331 and 290318? 1631 Calculate the greatest common factor of 273 and 279045. 39 Calculate the greatest common factor of 174019413 and 15. 3 Calculate the greatest common divisor of 49208 and 800. 8 Calculate the highest common divisor of 1746 and 75126306. 582 Calculate the highest common factor of 361246778 and 4701. 1567 Calculate the greatest common factor of 56637764 and 28. 4 What is the highest common divisor of 7153 and 1317923? 23 Calculate the highest common divisor of 184 and 427995500. 92 Calculate the highest common factor of 36 and 509077776. 12 Calculate the highest common factor of 386200940 and 20. 20 What is the highest common factor of 138602456 and 17210? 3442 Calculate the highest common factor of 1064307 and 3874. 149 Calculate the greatest common divisor of 40093759 and 172. 43 What is the greatest common factor of 56226 and 834? 6 What is the greatest common divisor of 26465 and 139040? 395 What is the highest common factor of 29288 and 1182664? 56 What is the greatest common factor of 26030032 and 336? 112 What is the highest common factor of 227882 and 522? 58 What is the highest common factor of 2665935 and 57195? 45 What is the highest common divisor of 72 and 50690313? 9 What is the highest common divisor of 25280497 and 18821? 649 What is the highest common factor of 78150979 and 6679? 6679 Calculate the greatest common factor of 93618 and 14. 14 Calculate the greatest common factor of 10069939 and 46850. 937 What is the greatest common divisor of 208495 and 38073? 1813 What is the highest common divisor of 82 and 4104223? 41 What is the highest common divisor of 49480874 and 430? 86 What is the highest common factor of 5073694 and 2570? 514 Calculate the highest common factor of 192 and 7152984. 24 Calculate the greatest common factor of 14 and 3754926. 14 Calculate the greatest common factor of 94638312 and 4926. 4926 Calculate the greatest common factor of 2021 and 824697. 43 Calculate the highest common divisor of 262 and 24507087. 131 Calculate the highest common factor of 30680 and 1720498. 26 Calculate the highest common factor of 46208 and 97831. 361 Calculate the greatest common factor of 13475 and 8369075. 275 What is the greatest common factor of 128 and 1844888? 8 What is the greatest common divisor of 15168 and 1064841? 237 Calculate the greatest common divisor of 12684 and 1489313. 1057 Calculate the greatest common divisor of 284160 and 7770. 1110 Calculate the highest common factor of 1065 and 3691457205. 1065 What is the greatest common divisor of 5534592 and 3132? 348 What is the highest common divisor of 137356609 and 338? 169 Calculate the highest common divisor of 232740025 and 26600. 3325 Calculate the highest common factor of 185227713 and 198. 99 What is the greatest common factor of 127118571 and 54723? 1479 What is the greatest common factor of 24791120 and 719? 719 Calculate the greatest common divisor of 7025550 and 98. 14 What is the greatest common divisor of 926965 and 1527760? 845 What is the highest common factor of 8723968 and 256? 256 Calculate the highest common factor of 1720008 and 48. 24 Calculate the greatest common divisor of 2860 and 24243648. 572 What is the greatest common divisor of 56542 and 471682? 34 Calculate the greatest common factor of 29080 and 7480. 40 Calculate the greatest common factor of 2 and 5946478. 2 Calculate the highest common factor of 1096 and 3113599. 137 Calculate the greatest common divisor of 39143300 and 14. 14 Calculate the greatest common divisor of 223665 and 608595. 195 Calculate the greatest common divisor of 105 and 106223915. 35 What is the highest common divisor of 5473247 and 13? 13 What is the greatest common factor of 4621 and 2724287445? 4621 Calculate the greatest common divisor of 332 and 20828. 4 What is the highest common factor of 5606 and 4891588178? 5606 Calculate the highest common divisor of 1712 and 4563443. 107 Calculate the highest common divisor of 6 and 2091974. 2 Calculate the highest common factor of 214827492 and 528. 132 What is the highest common factor of 243789341 and 29? 29 Calculate the greatest common factor of 5771 and 154657. 29 Calculate the highest common divisor of 92554 and 372603. 77 What is the highest common divisor of 4251455 and 3835? 65 What is the highest common factor of 63626 and 73109? 29 Calculate the greatest common divisor of 4897258 and 68. 34 What is the highest common divisor of 278400 and 33553? 29 Calculate the greatest common factor of 74637684 and 1224. 612 Calculate the greatest common divisor of 1065 and 10022640. 15 What is the greatest common factor of 35828 and 528294? 338 Calculate the greatest common factor of 300 and 16279500. 300 Calculate the highest common divisor of 6072408 and 1944. 648 What is the greatest common factor of 844 and 11121388? 844 Calculate the greatest common factor of 1590695 and 91715. 415 Calculate the highest common factor of 79362395 and 7. 7 What is the highest common divisor of 267621 and 111? 111 Calculate the highest common factor of 6876 and 14724. 36 Calculate the greatest common divisor of 2176 and 15428656. 272 What is the highest common factor of 81003000 and 4? 4 What is the highest common factor of 2499 and 207564? 147 Calculate the highest common factor of 23166 and 81796. 286 Calculate the highest common divisor of 213 and 12836587. 71 Calculate the highest common divisor of 3959 and 8137885. 107 Calculate the highest common factor of 14238 and 3796461. 1017 What is the highest common factor of 106390 and 4210? 10 Calculate the greatest common divisor of 8601 and 516906. 141 What is the greatest common factor of 11344288 and 47678? 1538 Calculate the greatest common factor of 15379340 and 4230. 470 What is the greatest common factor of 292962268 and 387? 43 Calculate the greatest common divisor of 1320 and 7846152. 24 What is the highest common factor of 5730 and 108195? 15 Calculate the highest common divisor of 220 and 3839060. 20 Calculate the greatest common factor of 300274 and 2158. 26 What is the highest common divisor of 87780 and 48660? 60 Calculate the highest common divisor of 158254 and 1509318. 2362 What is the highest common factor of 266 and 102871377? 133 Calculate the greatest common divisor of 846 and 38370518. 94 What is the greatest common divisor of 663 and 90489759? 51 What is the highest common factor of 29987604 and 1188? 108 Calculate the highest common divisor of 121 and 2153987. 11 What is the highest common divisor of 3029 and 6132793? 233 Calculate the greatest common factor of 8962516 and 64. 4 What is the greatest common divisor of 4976 and 3108671408? 4976 What is the highest common divisor of 1631919 and 381593? 8119 What is the greatest common factor of 4819 and 17429454? 79 Calculate the highest common factor of 16134 and 12930. 6 What is the greatest common divisor of 231 and 10358502? 231 What is the greatest common factor of 96 and 5269	{ "pile_set_name": "DM Mathematics" }
r be g(-15). Let d = 11 + r. Calculate x(d). 0 Let y(k) = 18k3 - k + 340k*2 + 9k*3 + 1 - 341k*2. Calculate y(1). 26 Let r be ((-4)/(-50)10)/(10/(-25) - 0). Let n(i) = -i*3 - 3i*2 + i + 4. What is n(r)? -2 Let p(b) = -20b. Let l be -22(-8)/(14 + 2). Suppose 16t = lt + 5. Give p(t). -20 Let o(n) = -18n - 35. Let x(q) = 61q + 104. Let m(z) = 10o(z) + 3x(z). Determine m(14). 4 Let s(m) = m2 + 11m + 24. Let u be s(-12). Suppose 3o - 32 = x, -x - u = o - 3o. Let t = x + 40. Let w(l) = l. Determine w(t). -4 Let c(m) = -8 - 14m - 12m + 28m. Suppose -3s = 4t - 10, 3s = -123t + 118t + 8. Calculate c(s). 4 Let o(d) be the third derivative of 1/40d5 - 31/24d*4 - 1/720d*6 + 0 + 0d*3 + 0d + 15d2. Let u(i) be the second derivative of o(i). Give u(0). 3 Let m be (-3 - 1)(6 - (-20)/(-5)). Let i(c) = -c*2 - 6c + 2. Calculate i(m). -14 Let n(d) = -44 + d*2 + 7d*3 + 2d*3 + 81d - 6d2 - 90d - 10d3. Give n(-5). 1 Let r(s) = s3 - 13s*2 + 12s + 5. Let n = -360 + 188. Let d = 184 + n. What is r(d)? 5 Let i be (5 + -3)1/1. Let h(m) = -5 - 50m*2 + 0 + 56mi + 4. Calculate h(-1). 5 Let q(a) be the second derivative of -a5/20 - a4/12 + a3/6 + 3a2 + a. Suppose 45131 = 43b + 7549. Let g = b - 874. Calculate q(g). 6 Let x(w) be the first derivative of w*2/2 - w - 42. Let o = -28 + 69. Suppose -11b - 8 = -o. Determine x(b). 2 Let d(i) = i*3 - 17i*2 + 8i + 580. Let x be d(9). Let l(h) be the second derivative of -1/6h3 + 0h*2 + 0 - 24h + 1/12hx. Give l(0). 0 Let f(b) = -13b*2 + 7b - 6. Let k(w) = 7w2 - 4w + 7. Let a(y) = -6f(y) - 11k(y). What is a(0)? -41 Suppose 63k = 169 - 117 + 137. Let d(z) = -z2 + 6. Calculate d(k). -3 Suppose -4b - 483l + 478l = 11, -4b - l - 31 = 0. Let v(r) = -3r - 37. Determine v(b). -10 Let h(s) = -s + 2s2 - s2 + 2s2. Let d(i) = -i2 + 46i - 167. Let f be d(42). Let o be f/(-4) - 35/(-28)1. Give h(o). 2 Let k = 103 + -99. Suppose 4c = o - 375, 96 = -c + ko - 6o. Let s be (-32)/(-80) - c/(-10). Let m(x) = x3 + 9x*2 - x + 8. Determine m(s). 17 Let k(l) = 183l + 132. Let d(s) = -85s - 66. Let b(a) = 13d(a) + 6k(a). Calculate b(-8). -10 Suppose 3y = 4t + 46 - 53, 4y + 10 = 5t. Let j(l) = -9l - 18. Give j(y). 27 Let c(o) = -2o2 + 36o - 134. Let z be c(13). Let h(d) = -4d2 - 20d - 3. What is h(z)? 13 Suppose -r + 18 - 12 = 3v, 2r = -5v + 11. Let f(j) = -j3 + 4j*2 - 5j + 5. Calculate f(r). -1 Let s(v) be the second derivative of -v*3/6 + 9v*2 - 133v + 1. Determine s(9). 9 Let j(y) = 52y3 + 40y*2 + y + 36. Let x(r) = 19r*3 + 14r*2 + 12. Let b(o) = -4j(o) + 11x(o). Determine b(7). 9 Let t = -194 + 197. Suppose 0 = 8g - 4g - tk + 52, 2g + 5k + 26 = 0. Let l(q) = q + 16. Calculate l(g). 3 Let t(c) = c*3 + 11c*2 - 11c + 15. Let k(j) = j*2 + 24j + 32. Let o be (-4)/(-10)(-52 + -3). Let x be k(o). Determine t(x). 3 Suppose 26 = 2g - 4p, -11p = 3g - 8p + 6. Let i(s) = 3s3 - s2 + 2s - 7. Calculate i(g). 71 Let u(c) = 20c2 - 3745c + 3730c + 1 - 12c*2 - 11c2. Calculate u(-5). 1 Let g(y) = y + 8. Let s = 112 - 122. Let j(x) = -x2 + x + 105. Let p be j(s). Calculate g(p). 3 Let j(s) = 15s3 + 4s*2 + 4s + 4. Let l(k) = -1 - 398k2 + 201k*2 - k + 196k*2. Let q(p) = j(p) + 4l(p). Determine q(1). 15 Let p(a) = 3a + 10. Let i(q) = -3q - 14. Let t(y) = 4i(y) + 6p(y). Let k(d) = d*2 + 7d + 2. Let c be k(-6). Give t(c). -20 Let z(u) = 307 - 705 + 393 - 31u. Determine z(1). -36 Let c be 1/24(7/(-7) + 3). Let q(k) be the third derivative of 0 - ck4 + 0k + 1/3k3 - 13k2. Determine q(5). -8 Let s(q) = -q3 + 15q2 - q + 28. Let m be s(14). Suppose -35n = -49n - m. Let h(r) = -r - 13. What is h(n)? 2 Let h(t) = 3t - 58. Suppose -544 = 27g - 976. What is h(g)? -10 Let r(f) = f3 - 3f*2 - 4f. Suppose -144 = -6y + 66. Let v = y + -40. Let z be (-22)/v - (-30)/(-75). Determine r(z). 0 Let c(q) = q3 - 6q*2 + 8q - 61. Suppose -33y - 31 + 229 = 0. Let b be c(y). Let d(l) = l + 18. Calculate d(b). 5 Let y be 10 + (8624/42)/(-22). Let g(i) be the second derivative of 0 + 1/12i*4 - 14i + yi3 - i2. Give g(-6). 10 Suppose -10p + 282 = -278. Let i be (-519)/8 - 7/p. Let u be (-10)/i - (-11)/13. Let g(o) = -3o2 + 2o - 1. Give g(u). -2 Let w(b) = -8b + 2. Suppose 5 = -2y - 17. Let z(t) = 3t2 + 34t + 12. Let v be z(y). Give w(v). -6 Let m be (-87)/(-58)((-28)/6 - -2). Let w be (5 + 32/m)/((-15)/10). Let v(j) = 2 - 1 - 4j + 0. Determine v(w). -7 Let z(m) = -3m - 70. Suppose -4i - 3r + 66 = -7i, 5i - r = -102. Let l be z(i). Let g(p) = -p2 - 10p + 14. What is g(l)? 14 Let x(d) = -98 + d*3 + 30 + 9 + 16d*2 + 6d*2 + 23 + 19d. Calculate x(-21). 6 Let g(c) = -30c2 + 3c - 17. Let x(h) = -7h2 + h - 4. Let z(q) = -2g(q) + 9x(q). Suppose -5y - 1 = -i - 6, -5i + 27 = y. Calculate z(y). -8 Let k(n) = -n3 + 3n*2 - 135n + 413. Let i be k(3). Let t(f) = -f - 6. Determine t(i). -14 Suppose 11 = 2b - 5r + 21, 2b = -3r - 10. Let s(z) be the second derivative of -z*5/20 - 5z*4/12 - 7z*2/2 - 3z. What is s(b)? -7 Let s(k) = 3k2 + 8k - 26. Let q(w) = -8w2 - 14w + 46. Let r(z) = -4q(z) - 7s(z). Calculate r(-2). 42 Let c(a) = a*2 - 8a + 15. Let k(u) = -1. Let m(q) = c(q) - k(q). Calculate m(10). 36 Let p(h) be the third derivative of h5/30 + h4/3 + 2h3 - 5h*2 - h - 126. Calculate p(-2). 4 Suppose 9h + 20h = 71253. Let t be (-8)/22 - h/231. Let d(l) = l2 + 12l + 2. Calculate d(t). -9 Let a(w) = 4w2 - 15 + 1447w - 3w2 - 3w*2 + 0w*2 - 1452w. Give a(-6). -57 Let l be 40 + (5 - (5 + -1)). Let c = l + -58. Let o(d) = -d*2 - 18d - 22. Let s be o(c). Let a(r) = r*2 + 7r + 7. Determine a(s). -3 Let j(q) be the second derivative of 3q5/20 + q4/4 + 2q3/3 + q2/2 + 14q - 9. Give j(-3). -65 Let k(c) = 12c + 2. Let n(l) = -18l2. Let r be n(1). Let v be (r - -124)/((-2 + 1)-1). Let d = -104 + v. Determine k(d). 26 Let r(x) be the second derivative of 8x3/3 - x2/2 + 9x - 2. Let m = -1096 - -1097. Calculate r(m). 15 Let x(n) = -3n2 + 41n + 17. Suppose -165o = -161o + 8, -52 = -3k + 5o. Give x(k). 3 Let r(c) = 8c2 - 11c + 0c + c3 + 10c + 5c + 20. What is r(-8)? -12 Let o be (-2312)/(-32) + 1 + (-2)/8. Let a(q) = 7q*2 - oq*2 + 1 + 68q*2. Suppose -5 = 3n + 4. What is a(n)? 19 Let a = -188 + 195. Suppose -5n + 5v = a + 8, -n - 4v = 18. Let i(m) = -m3 - 5m*2 + 9m + 9. Give i(n). -9 Let i(c) be the first derivative of c*3/3 - 3c*2 + 22c + 21. Let l be i(5). Suppose -l = 8z - 1. Let t(u) = -3u*3 - 4u*2 - 4u - 2. Calculate t(z). 14 Let o(d) = 79d + 19. Let n(b) = b2 + 237b + 66. Let g(q) = -3n(q) + 8o(q). Determine g(-26). -20 Suppose 4f + 10 = 22. Let w(u) be the second derivative of 7u*3/6 - 4u*2 + 2u. Let o(x) = -20x + 23. Let p(c) = 4o(c) + 11w(c). Calculate p(f). -5 Suppose -7 - 1 = 4r - 4i, -4i = -r + 7. Let y(j) = 1613 - 1613 - 4j. Let p(v) = v. Let m(w) = -3p(w) - y(w). Give m(r). -5 Let r = 80 - -45. Let w(c) = -48c + 51c - r + 127. Give w(-5). -13 Let l(i) = 2i2 + 48i + 2. Let x be l(-26). Suppose -104 - x = 21a. Let w(o) = -o3 - 10o*2 + o + 6. Determine w(a). -4 Let i(h) be the second derivative of 9h + 1/12h4 + 0 - 2h*2 + 3/2h*3. Give i(-5). -24 Let z(v) = -11v + 11. Suppose -175 - 24 = -32f + 57. Determine z(f). -77 Suppose -22k = -20k - 26. Suppose -56 + 4 = -kh. Let i(m) = -m*3 + 5m*2 - 4m + 2. What is i(h)? 2 Let r(d) = d*3 - 3d*2 + 47d - 216. Let o be r(4). Let v(w) = w*2 + 9w - 57. Give v(o). -21 Let u = -159 - -211. Let o = 46 - u. Let q(j) = 5 + 2j - 3 - 3j - 4. Calculate q(o). 4 Let z(p) be the first derivative of -p*4/4 - 5p*3/3 + 13p*2/2 + 7p + 11133. What is z(-7)? 14 Suppose -j + 3x + 14 = -x, -2j = -4x - 12. Let z be (j/3)/(355/90 - 4). Let l be 8/z(-33)/(-2) - 1. Let d(v) = -v*2 + 10v + 1. Calculate d(l). 1 Let o(h) = h*3 - 4h*2 + h - 1. Let w(q) = 2q2 - q + 1. Suppose 11 = b + 10. Let n be w(b). Let y be o(n). Let a(i) = i2 + 4i - 9. Calculate a(y). 12 Let z(m) = -57 + 5m*3 - 2m + m - m*2 + 59 - 6m3. Let v(k) = -k3 +	{ "pile_set_name": "DM Mathematics" }
nearest 10. 321820 What is 0.00000675930999 rounded to 6 decimal places? 0.000007 Round -251312.29 to the nearest one hundred thousand. -300000 What is -0.000001630730691 rounded to 7 dps? -0.0000016 Round -15.9394722 to 0 dps. -16 Round 1568.7690646 to 0 dps. 1569 Round 9595.7855 to the nearest integer. 9596 Round -1589.939428 to 1 decimal place. -1589.9 What is -433186.02 rounded to the nearest 100? -433200 What is 0.04101476433 rounded to 2 decimal places? 0.04 What is 148.317459 rounded to the nearest 10? 150 What is -112.70974 rounded to the nearest 10? -110 Round -8372.35279 to the nearest one thousand. -8000 Round 3630604.074 to the nearest one thousand. 3631000 Round -0.00000015410995 to 6 dps. 0 Round 128803.3193 to the nearest 1000. 129000 What is -0.00072505758 rounded to seven dps? -0.0007251 Round 0.0000013215481 to 6 decimal places. 0.000001 Round -520510906.8 to the nearest ten thousand. -520510000 Round 22.3262639 to the nearest 10. 20 What is 6.0781429 rounded to 1 decimal place? 6.1 Round 0.109177715 to 2 dps. 0.11 What is -0.0001865636295 rounded to five decimal places? -0.00019 What is 0.007273419465 rounded to 4 dps? 0.0073 What is -1.070562691 rounded to two dps? -1.07 What is 0.00172169631 rounded to 6 dps? 0.001722 Round -43.90471 to zero dps. -44 Round 1114837.42 to the nearest 100. 1114800 What is 13081353100 rounded to the nearest one million? 13081000000 Round 1170877.02 to the nearest 100. 1170900 What is 4202739 rounded to the nearest 10000? 4200000 Round -94.80612798 to one dp. -94.8 Round 47429.87573 to the nearest one thousand. 47000 Round 65125201 to the nearest 1000000. 65000000 Round 0.009434295617 to six dps. 0.009434 What is 338035.9959 rounded to the nearest 100000? 300000 Round 0.03031858239 to 4 dps. 0.0303 Round -24.7876539 to the nearest integer. -25 What is 2531610.66 rounded to the nearest 1000? 2532000 What is -47565364.9 rounded to the nearest one million? -48000000 What is -2037338.326 rounded to the nearest one thousand? -2037000 What is 0.00687362984 rounded to 7 dps? 0.0068736 What is -17.92201951 rounded to 0 decimal places? -18 What is 0.0113945227 rounded to 3 decimal places? 0.011 Round 0.00000245161629 to six dps. 0.000002 Round -5430.16964 to the nearest one hundred. -5400 What is -552846.23 rounded to the nearest one hundred? -552800 What is -47094179.07 rounded to the nearest 1000000? -47000000 What is 99.0571979 rounded to the nearest 10? 100 What is -7021.870139 rounded to the nearest 1000? -7000 Round -141353024 to the nearest ten thousand. -141350000 What is 4076630660 rounded to the nearest 1000000? 4077000000 Round 22.0532345 to zero decimal places. 22 What is -2442417.15 rounded to the nearest one hundred thousand? -2400000 Round 71388789840 to the nearest one million. 71389000000 Round -0.0188070603 to five decimal places. -0.01881 Round 0.052200525 to two decimal places. 0.05 Round -983761716 to the nearest one hundred thousand. -983800000 Round -2.916949808 to 3 decimal places. -2.917 What is 0.000377425072 rounded to 4 decimal places? 0.0004 What is 0.00046992678 rounded to six dps? 0.00047 Round 354.6099 to one dp. 354.6 What is -0.1731691 rounded to 2 decimal places? -0.17 Round -3543.48187 to 1 decimal place. -3543.5 What is -69118.44 rounded to the nearest 100? -69100 Round -2854251459 to the nearest one million. -2854000000 Round -0.25117903 to 4 decimal places. -0.2512 What is 4232731.38 rounded to the nearest ten thousand? 4230000 What is 0.016210411 rounded to six decimal places? 0.01621 Round -0.81721528 to 2 dps. -0.82 Round -8257517.9 to the nearest 100000. -8300000 Round 38852.9996 to zero dps. 38853 Round 2.9271387 to 1 decimal place. 2.9 What is 6380.19044 rounded to the nearest 100? 6400 Round 2.00815828 to four decimal places. 2.0082 Round 321.16135 to 1 dp. 321.2 Round 2.74082704 to 1 decimal place. 2.7 Round -5155220.72 to the nearest 100000. -5200000 What is 292067.405 rounded to the nearest 10000? 290000 Round -0.170642515 to five dps. -0.17064 Round 7613.4335 to the nearest 1000. 8000 What is -0.1105865329 rounded to two dps? -0.11 Round -9967905960 to the nearest 1000000. -9968000000 Round 0.00001810013734 to 6 dps. 0.000018 Round 3985.593721 to the nearest 10. 3990 Round -0.0525079265 to four dps. -0.0525 Round 1.93502959 to 4 dps. 1.935 Round -0.119207024 to 5 decimal places. -0.11921 Round 0.1631138512 to 5 dps. 0.16311 Round 19809286.43 to the nearest one thousand. 19809000 Round -6683554.2 to the nearest one million. -7000000 Round 134932.1717 to the nearest one thousand. 135000 Round 0.289675034 to five dps. 0.28968 Round 0.33434502 to two dps. 0.33 What is -2740.33133 rounded to the nearest 100? -2700 Round -1785464145 to the nearest one million. -1785000000 What is 0.000000540700338 rounded to 7 dps? 0.0000005 What is -243.178306 rounded to 2 dps? -243.18 What is -612319.78 rounded to the nearest 100? -612300 Round -0.001902419884 to five dps. -0.0019 Round -4789877.95 to the nearest one hundred thousand. -4800000 Round -0.01770740281 to three dps. -0.018 Round -0.289709646 to five dps. -0.28971 What is 9366934.779 rounded to the nearest one thousand? 9367000 What is 2088635.578 rounded to the nearest 100? 2088600 What is -2.427852601 rounded to 2 dps? -2.43 What is 69.1110673 rounded to 1 dp? 69.1 What is 14900669.51 rounded to the nearest 100? 14900700 Round -347769467.5 to the nearest 100000. -347800000 Round 0.016753055 to 3 dps. 0.017 What is -116.738809 rounded to the nearest ten? -120 What is 119515.339 rounded to the nearest 100? 119500 What is -12466386400 rounded to the nearest one million? -12466000000 Round -69460394.4 to the nearest 100000. -69500000 What is 0.00002237308907 rounded to 6 decimal places? 0.000022 What is 0.38870441 rounded to two decimal places? 0.39 Round -42949534 to the nearest one hundred thousand. -42900000 What is -1.09203995 rounded to one dp? -1.1 Round -833938.01 to the nearest 1000. -834000 Round -2135.6031 to the nearest 1000. -2000 Round 184086.46 to the nearest one hundred. 184100 Round 0.0027112352 to four dps. 0.0027 Round 0.0000000189346301 to 7 decimal places. 0 Round -0.0004815572632 to 7 dps. -0.0004816 What is -44448186860 rounded to the nearest one million? -44448000000 Round 872477.211 to the nearest 1000. 872000 Round 3535845428 to the nearest one million. 3536000000 What is 2126627950 rounded to the nearest one hundred thousand? 2126600000 What is 26465163.8 rounded to the nearest one million? 26000000 What is 223622.313 rounded to the nearest ten thousand? 220000 What is -6887803.665 rounded to the nearest ten thousand? -6890000 What is 52614036.26 rounded to the nearest 100000? 52600000 Round 0.000057126379 to 7 decimal places. 0.0000571 Round -0.0000058393883 to 7 decimal places. -0.0000058 What is -19226.15536 rounded to the nearest one hundred? -19200 Round 38570.037 to the nearest 1000. 39000 Round -549.8119856 to one dp. -549.8 What is -165454.448 rounded to the nearest ten thousand? -170000 What is 381025.052 rounded to the nearest one hundred thousand? 400000 Round -3834355 to the nearest 100000. -3800000 What is -0.0067595914 rounded to five dps? -0.00676 What is 62280.1197 rounded to the nearest 100? 62300 Round -909.39295 to the nearest ten. -910 What is -0.0000012021463 rounded to seven decimal places? -0.0000012 What is -816.118754 rounded to the nearest 100? -800 Round 775599270 to the nearest 1000000. 776000000 What is 1.438212249 rounded to four dps? 1.4382 What is -1033.99875 rounded to the nearest 10? -1030 What is 115733.2854 rounded to the nearest 10? 115730 What is 0.0007060380503 rounded to 7 decimal places? 0.000706 What is -60409.317 rounded to the nearest ten? -60410 Round 0.00100125794 to five dps. 0.001 Round -7059.368 to the nearest one thousand. -7000 Round -0.00002079343096 to 7 dps. -0.0000208 What is -26.609678508 rounded to 3 decimal places? -26.61 What is 64.4692447 rounded to the nearest ten? 60 Round 184.8742907 to 1 decimal place. 184.9 Round 1087.891418 to one decimal place. 1087.9 Round 0.0000067011023 to 6 decimal places. 0.000007 Round -3243.7266 to one dp. -3243.7 Round 0.00036253589 to four decimal places. 0.0004 Round 1911.950803 to the nearest	{ "pile_set_name": "DM Mathematics" }
rest integer? -32 What is 0.00149 rounded to three decimal places? 0.001 What is 0.23934 rounded to two dps? 0.24 What is -728210 rounded to the nearest one hundred thousand? -700000 What is 29240500 rounded to the nearest one hundred thousand? 29200000 What is -760870 rounded to the nearest one hundred thousand? -800000 What is -64000 rounded to the nearest ten thousand? -60000 What is -245 rounded to the nearest ten? -250 What is 85190 rounded to the nearest 10000? 90000 What is 0.23431 rounded to 2 dps? 0.23 What is 163.52 rounded to the nearest ten? 160 Round -0.00893 to three dps. -0.009 Round 0.0000035114 to seven decimal places. 0.0000035 Round 0.18252 to 3 dps. 0.183 Round 0.00013706 to 5 decimal places. 0.00014 Round 0.000001197 to 7 dps. 0.0000012 What is -12.543 rounded to 1 dp? -12.5 What is -42547000 rounded to the nearest one million? -43000000 Round -0.00015286 to 4 dps. -0.0002 Round -0.0000041 to 6 dps. -0.000004 What is 0.00000409 rounded to six decimal places? 0.000004 Round -73950 to the nearest ten thousand. -70000 What is 0.000009379 rounded to 6 decimal places? 0.000009 What is -0.62228 rounded to one dp? -0.6 What is -100.5 rounded to the nearest ten? -100 What is -4.487 rounded to the nearest integer? -4 Round -0.035767 to four dps. -0.0358 What is -0.18528 rounded to one dp? -0.2 What is -11.37 rounded to the nearest integer? -11 Round 27.335 to 0 decimal places. 27 What is -0.00002761 rounded to six dps? -0.000028 What is -0.000045459 rounded to six dps? -0.000045 Round -1646200 to the nearest one hundred thousand. -1600000 What is -0.00012638 rounded to five decimal places? -0.00013 What is 0.00000672 rounded to five dps? 0.00001 What is -155400000 rounded to the nearest one million? -155000000 What is 26250 rounded to the nearest 10000? 30000 What is -738950 rounded to the nearest 100000? -700000 Round -0.0001001 to five dps. -0.0001 Round 129088 to the nearest one thousand. 129000 What is -0.000054694 rounded to six dps? -0.000055 What is -2.82694 rounded to two dps? -2.83 What is 0.15668 rounded to three decimal places? 0.157 Round -0.00000006783 to 7 decimal places. -0.0000001 What is -3850.6 rounded to the nearest ten? -3850 What is 0.030942 rounded to 4 decimal places? 0.0309 What is -0.0090923 rounded to four dps? -0.0091 What is -0.00056088 rounded to 4 dps? -0.0006 Round -320000 to the nearest ten thousand. -320000 Round 8683000 to the nearest 1000000. 9000000 Round 1175.1 to the nearest ten. 1180 Round 1010.8 to the nearest 100. 1000 What is -0.0513 rounded to two dps? -0.05 What is -1810000 rounded to the nearest 1000000? -2000000 Round 142840000 to the nearest one million. 143000000 What is -0.04685 rounded to 3 dps? -0.047 Round -0.068986 to three decimal places. -0.069 What is 0.0000044391 rounded to 7 decimal places? 0.0000044 What is 19900 rounded to the nearest 1000? 20000 What is -0.000040934 rounded to seven decimal places? -0.0000409 Round 0.00008335 to 6 dps. 0.000083 Round 295702 to the nearest 10000. 300000 What is -0.0014361 rounded to 4 dps? -0.0014 What is 0.00000825 rounded to 7 decimal places? 0.0000083 Round 0.0000479 to six dps. 0.000048 Round 0.00008429 to six dps. 0.000084 What is -104820 rounded to the nearest 10000? -100000 What is -1067900 rounded to the nearest ten thousand? -1070000 Round -0.00000094568 to 7 dps. -0.0000009 Round 0.0034626 to four decimal places. 0.0035 Round -42.89 to the nearest integer. -43 What is -0.0000080973 rounded to six dps? -0.000008 Round 497.52 to the nearest 100. 500 Round 52100000 to the nearest one million. 52000000 What is 11290 rounded to the nearest 1000? 11000 Round 2.8268 to 2 decimal places. 2.83 Round 7491000 to the nearest one million. 7000000 What is -0.71407 rounded to one decimal place? -0.7 What is -0.00938082 rounded to 3 dps? -0.009 Round -0.2809 to one dp. -0.3 What is 554420000 rounded to the nearest one million? 554000000 What is -56350 rounded to the nearest 10000? -60000 What is 16563000 rounded to the nearest 1000000? 17000000 What is 3414.4 rounded to the nearest 1000? 3000 What is 2230000 rounded to the nearest one hundred thousand? 2200000 Round -786300 to the nearest ten thousand. -790000 What is -0.00095 rounded to five decimal places? -0.00095 What is -0.035957 rounded to three decimal places? -0.036 What is -1149.1 rounded to the nearest integer? -1149 What is -4089 rounded to the nearest one hundred? -4100 Round 0.00001476 to seven dps. 0.0000148 What is 0.000031204 rounded to 6 dps? 0.000031 Round -1054000 to the nearest 100000. -1100000 What is -0.00013524 rounded to six dps? -0.000135 Round 3126900 to the nearest 10000. 3130000 What is -2586000 rounded to the nearest 100000? -2600000 Round -0.0000427 to 5 dps. -0.00004 What is -1634 rounded to the nearest one thousand? -2000 Round -57.75 to 0 decimal places. -58 Round 0.0027049 to 5 decimal places. 0.0027 Round 0.00895 to 4 dps. 0.009 What is 0.052 rounded to 1 decimal place? 0.1 What is 7450 rounded to the nearest 1000? 7000 Round 26890 to the nearest 10000. 30000 Round -835470 to the nearest 100000. -800000 What is -7.5667 rounded to 0 decimal places? -8 What is 75047.6 rounded to the nearest 10000? 80000 Round 0.00748 to 4 dps. 0.0075 Round 0.0006903 to 4 decimal places. 0.0007 Round -0.16 to one dp. -0.2 Round 889600 to the nearest 100000. 900000 Round 460000 to the nearest 100000. 500000 Round -26.035 to one decimal place. -26 Round 0.000029636 to 6 decimal places. 0.00003 What is -0.77362 rounded to three decimal places? -0.774 Round -20373 to the nearest one thousand. -20000 Round 0.00002279 to 6 decimal places. 0.000023 Round 0.26762 to two decimal places. 0.27 What is 63.1814 rounded to 0 decimal places? 63 What is -183300 rounded to the nearest 1000? -183000 What is 10620000 rounded to the nearest one million? 11000000 What is 0.00006466 rounded to 5 decimal places? 0.00006 What is -149280 rounded to the nearest 10000? -150000 Round -1.48 to one decimal place. -1.5 Round 1.294 to one decimal place. 1.3 Round -0.6108 to 2 decimal places. -0.61 Round -0.00000306 to seven dps. -0.0000031 Round 8.804 to the nearest integer. 9 What is -70000000 rounded to the nearest one million? -70000000 Round 0.00030234 to 6 dps. 0.000302 Round -18615000 to the nearest 100000. -18600000 What is 46.451 rounded to the nearest 100? 0 Round 5020 to the nearest 100. 5000 What is -0.0000001656 rounded to 7 decimal places? -0.0000002 Round 2950 to the nearest one thousand. 3000 What is -337700 rounded to the nearest ten thousand? -340000 What is 0.0795 rounded to two decimal places? 0.08 What is -0.0004544 rounded to 4 decimal places? -0.0005 What is -0.000977 rounded to four dps? -0.001 Round 384 to the nearest one hundred. 400 What is -0.002363 rounded to 4 decimal places? -0.0024 Round 0.03672 to two dps. 0.04 What is 2340 rounded to the nearest one thousand? 2000 What is -7.61 rounded to 0 decimal places? -8 Round -78580000 to the nearest 1000000. -79000000 What is 15195.5 rounded to the nearest 1000? 15000 What is 17.222 rounded to the nearest integer? 17 Round -0.0031848 to 5 dps. -0.00318 What is -9.57 rounded to the nearest ten? -10 Round 0.000033624 to seven dps. 0.0000336 What is -14533000 rounded to the nearest 1000000? -15000000 Round 1128.3 to the nearest 100. 1100 Round 0.00000005 to seven decimal places. 0.0000001 What is 2111 rounded to the nearest one thousand? 2000 What is -0.71232 rounded to one decimal place? -0.7 Round 0.00005964 to seven decimal places. 0.0000596 Round -0.00004919 to 7 dps. -0.0000492 Round -16710000 to the nearest 1000000. -17000000 Round 14.91 to the nearest integer. 15 What is -0.0001971 rounded to five decimal places? -0.0002 What is -20896 rounded to the nearest 1000? -21000 Round -102640 to the nearest 10000. -100000 Round 121000 to the nearest 10000. 120000 Round -31 to the nearest integer. -31 What is -0.12088 rounded to 2 decimal places? -0.12 What is 6840000 rounded to the nearest one million? 7000000 Round -323.1 to the nearest ten. -320 Round -3998 to the nearest one hundred. -4000 What is -3203000 rounded to the nearest one hundred thousand? -3200000 Round -64.49 to the nearest ten. -60 Round 5.5465 to one dp. 5.5 What is -970	{ "pile_set_name": "DM Mathematics" }
+ 5h2 + 3h*2. Suppose -4r - 18 = -2. Determine w(r). -26 Let y(n) be the second derivative of n*4/6 - 2n*3 - 13n*2/2 - 3591n. Give y(7). 1 Suppose 5 = 6w + 41. Let s(u) = -20u + 5. Let q(t) = 7t. Let g(l) = -15q(l) - 5s(l). What is g(w)? 5 Let f = -272 + 266. Let i(u) = -52u - 297. Let x be i(f). Let h(w) = -w*3 + 16w*2 - 16w + 20. Give h(x). 5 Let c(p) = -8p - 15. Let f(x) = 11x + 16. Let u(r) = -4c(r) - 3f(r). Let i be 2/((-1)/(-3)2). Let l(j) = -13. Let a(g) = iu(g) + 2l(g). Determine a(7). -11 Let x(w) = -2w*2 - 50w - 293. Let f be x(-15). Let a be (-8)/3 - 2/6. Let l(u) = u - 6. Let n(c) = c - 7. Let i(m) = an(m) + 2l(m). Calculate i(f). 2 Let k(r) be the third derivative of -r6/720 - r5/60 - 7r4/4 + r3/3 - 42r*2. Let z(m) be the second derivative of k(m). Calculate z(-3). 1 Let o(j) = j - 4. Let i(u) = -2u + 9. Let q(a) = -3i(a) - 7o(a). Let x(d) = 10d + 199. Let m be x(-20). Give q(m). 2 Let u(h) = -15h*2 - 5h - 176. Let k(s) = -13s2 - 5s - 153. Let d(o) = 7k(o) - 6u(o). Determine d(0). -15 Let a(r) = -r*3 + 8r*2 - 3r - 6. Suppose -5b - 3y + 28 = 0, 0y = y - 1. Suppose -2f = -9h + 13h - 16, 31 = bf + h. Determine a(f). 48 Let s be (-8)/52 - (-15070)/(-65). Let r = -233 - s. Let w(o) = 11o - 1. Give w(r). -12 Suppose -12g = -14g - 342. Let q = g + 171. Let u(v) = -v - 12. What is u(q)? -12 Let a(j) = -j*3 - 26j2 - j - 17. Let g = -38825 + 38799. Determine a(g). 9 Let g(r) be the second derivative of -r5/4 + r3/2 - r2 + 5r + 6. Let d be 63/189 - (-1 - (-1)/3). What is g(d)? -4 Let q(d) = -238d*3 - 501d*3 - 13d*2 + 740d*3 + 4d. What is q(13)? 52 Let s(q) = q*2 + 22q + 42. Let o be 12/(-9)(-280)/4236/(-16). What is s(o)? 2 Let a = -1 - 0. Let x(r) = 9r2 - 4r - 5. Let o(n) = 12n2 - 5n - 6. Let i be ((-10)/(-20))/(1/10). Let d(p) = io(p) - 6x(p). Give d(a). 7 Let n = 10119 - 20235/2. Let x(y) be the first derivative of -ny2 + 0y - y3 + 13. Give x(-2). -6 Let o(t) = -t2 + 5t + 8. Let s be 9-1(-55)/(-15). Let f = 35 + s. Suppose 18 = fr + r. Give o(r). 2 Suppose -66u - 30 = -142u + 70u. Let s(b) = 35b - 181. Give s(u). -6 Let x(h) = -325 + 297 - 874h2 + 876h*2 + 33h. What is x(-17)? -11 Let c(z) = -178z - 26. Let j(l) = 36l + 5. Let t(q) = 4c(q) + 22j(q). What is t(-1)? -74 Let v(o) = o*3 + 14o*2 + 17o + 37. Let u be v(-12). Suppose -21m + 68 = -u. Let s(q) = q3 - 10q*2 + 8q + 5. What is s(m)? -4 Let w(a) = -77a3 - 21 + 75a*3 - 32a*2 + 25a + 6a2 - 26a + 7. Calculate w(-13). -1 Let l(g) = g*3 + 3g*2 + 2g + 3. Let y = 171 - 156. Suppose -91u + 86u = y. Determine l(u). -3 Let a be 861/273 + (-4)/26. Suppose -4u - 32 = 2b, 9u - ab = 10u + 13. Let d(g) = -g - 7. Calculate d(u). 0 Suppose 3m = -2m + 15. Let c(p) = 148 + p + 2 - 157. Determine c(m). -4 Let b(d) = 5d*2 - 7d + 1. Let l(a) = a*2 - a + 1. Let w be -2((-243)/(-6) + -1 - 0). Let k = -75 - w. Let v(t) = kl(t) - b(t). Give v(3). 3 Let f(p) = 6p*2 + 5p + 7. Let z(r) = 5r2 + 5r + 6. Suppose 66 = 4a + 46. Suppose 7 = -2b - 1. Let k(j) = az(j) + bf(j). Give k(-4). -2 Suppose 8 - 44 = -6q. Let h(a) = 13 + 19 - 24 + a - 2a. Calculate h(q). 2 Let j be (-17 + 2)(4/10)/(-1). Suppose -2q = 5v - 10, q + 4v = jv - 4. Let s(r) be the first derivative of r2/2 - 2. What is s(q)? 0 Let t = 27 - 21. Let y be t/(36/15)2. Suppose -5 = 9l - y. Let z(s) = -s2 - s + 4. Give z(l). 4 Let m(b) be the second derivative of -25b*3/6 - 145b*2/2 - 132b. Give m(-5). -20 Let v(p) = -15p + 12p - 4 + 44. Let o be v(11). Let f(n) be the first derivative of -n*4/4 + 8n*3/3 - 7n*2/2 - 6n - 2. Determine f(o). -6 Let g(x) = -51x + 3357. Let y be g(66). Let l(u) = -7u - 28. Give l(y). 35 Let w(b) be the second derivative of -b*5/20 - 13b*4/12 + 7b*3/3 - 5b*2 - 2b + 1331. Give w(-14). -10 Let j(q) = q + 3. Let d(a) = -a*2 + 15a - 20. Let i be d(15). Let m = i + 24. Suppose -4k - 3o - 29 = 0, 22 = 5k + mo + 58. What is j(k)? -5 Let j = 21728/3 - 7242. Let p(l) be the third derivative of 0l + 5/24l*4 - 22l*2 - jl*3 + 0 - 1/60l5. What is p(3)? 2 Let c(t) = t2 + 8t - 13. Suppose 0 = 6w - 32 - 4. Suppose w = 2z + 26. What is c(z)? 7 Let h(w) = -w3 - 2w*2 + 1. Suppose 4b + 12 = 2d, -3d - 12b + 7b + 7 = 0. Let v be 6/d(31 + -33). What is h(v)? 10 Let v(c) = 7c - 18. Let s = 3761 - 3758. Determine v(s). 3 Let o(k) = 5k2 - 49k - 8k3 + 10k + 20k + 3k + 13k. Give o(1). -6 Let q(r) = -8r - 9. Let b = -8303 + 8310. Calculate q(b). -65 Let x = 33 + -15. Suppose 7 = 4z - o, -5z - 2o = -7 - x. Let k(f) = -8f*2 + 6f*3 - 8f*3 + 3f*3 - 4f*2 + 9f*2 + 4. Give k(z). 4 Suppose 0 = 2f - 5d - 47, -44f + 40f + 31 = -d. Let x(m) = -m3 + 7m*2 + 6m - 13. Give x(f). 59 Let m be (-34)/7 - (-4)/(-28). Let k(x) be the first derivative of -6x - 1/4x*4 - 3x*2 - 25 - 2x*3. Give k(m). -1 Let y(c) = 33c*2 + 2c - 110. Let v(p) = 29p2 + 4p - 109. Let z(u) = -8v(u) + 7y(u). Give z(4). 14 Let k(v) = -v*2 - 8v + 3. Let r be 171/(-6)128/(-24). Suppose -4d = -5a - 431, 0 = 4a + d + r + 197. Let i = a + 80. What is k(i)? 10 Let c = 16195 + -16182. Let d(s) = s*3 - 13s*2 - 12. Calculate d(c). -12 Let r(k) = 5k. Let l(a) = 28a + 41. Let z(t) = l(t) - 5r(t). Give z(-12). 5 Let d(p) = -p + 33. Let j be d(34). Let c(b) = 12b2 - 6b + 8. Let t(n) = 11n2 - 5n + 7. Let r(s) = -6c(s) + 7t(s). Determine r(j). 5 Let f(t) be the third derivative of -t*7/2520 + 7t6/720 - t5/60 - t*4/3 - 4t*2 + 5. Let o(s) be the third derivative of f(s). Calculate o(5). -3 Let y(g) = g - 1. Let c(h) = 10h - 20. Let n(v) = -2c(v) + 18y(v). Give n(0). 22 Let z(t) = 15t + 2. Let n be 1 - (0 + 0)(-1)/5. Calculate z(n). 17 Let x(b) be the first derivative of b6/120 - b5/15 - b3/2 + b2 + 25b - 18. Let d(h) be the second derivative of x(h). Calculate d(4). -3 Let m(y) = -y3 + 0y*2 + 5y*2 - 8y*2 + 115y - 15y2 - 117y + 10. Calculate m(-18). 46 Let p be (-42)/5 + (-12)/(-30). Let k(f) = f*3 - 6211f*2 + 6219f*2 - 7 - 21f + 17f. Calculate k(p). 25 Let n(o) = 33o - 658. Let x(y) = -353y + 1432. Let l be x(4). What is n(l)? 2 Let o(b) = b - 2b*2 - 10 - 4817b*3 + 2398b*3 + 2415b*3. Give o(3). -133 Let f be -1 + 3/((-6)/(-4)). Let o(y) = -2y + 1 - 120y2 + 259y*2 - 123y*2. Give o(f). 15 Let s(m) = -2m*2 + 17m + 6. Let d(l) = 2l3 + 24l*2 + 11l - 112. Let r be d(-11). Determine s(r). -3 Let a = -44 - -37. Let f(o) = o*2 + 9o + 15. Let n be f(a). Suppose 4l - 3 = v, -3l - l + 5v = n. Let h(k) = k + 1. Determine h(l). 2 Let n(o) be the second derivative of -o5/20 - o4/4 + o3/6 + 5o*2/2 + 54293o. Let l be -1 - (-1)/((-2)/6). Give n(l). 17 Let s be ((-20)/80)/((-3)/(-24)). Let m(o) = -o*3 + 2o*2 - 6. What is m(s)? 10 Let g(t) be the first derivative of 35t*3/3 + 71t*2 - 3t + 2160. Give g(-4). -11 Let b(o) = -o*3 - 13o*2 - 15o - 14. Suppose -168 = -3w - f + 830, w = 2f + 342. Let l = -346 + w. Determine b(l). 22 Let s be (456/(-1824))/(1/60). Let l(k) = 9k + 90. Determine l(s). -45 Let q be (4(-9)/6)/1. Let o(c) = -29c - 13. Let d(g) = -13g - 6. Let m(b) = 2b2 - 9b + 13. Let k be m(3). Let p(y) = ko(y) - 9d(y). Determine p(q). -4 Let m(r) be the third derivative of -r5/60 - r4/4 + r*3/3 - 2r*2. Let z be (-18 - 12 - -31)-4. Give m(z). 10 Suppose -4z = m - 35, 84m - 88m - 60 = -4z. Let o(g) = -g*2 + 9g + 21. Determine o(z). 11 Let q(y) = 26y - 157. Let v be q(6). Let l(g) = 6g*2 - 4g - 2. Give l(v). 8 Let i(h) = 10h + 8h - 74 + 10h - 26h. Calculate i(37). 0 Let h(q) = q*3 + 48q*2 + 285q - 18. Let r be h(-7). Let b(c) = -c*3 - 4c*2 + 3c + 7. Determine b(r). -5 Let i(z) = -z*3 - 2z*2 + 42z + 108. Let q be i(-3). Let v(d) = d*3 + 9d*2 + d - 8. What is v(q)? -17 Let a(t) = t + 31. Suppose 5v - 5h + 65 = 0, 11h - 6h + 52 = -4v. Determine a(v). 18 Let s(r) = -r*2 - 15r - 20. Let t be (-3 - 3) + 3/(-1) - (27 + -24). Calculate s(t). 16 Let p(j) be the third derivative of -5j4/24 - 5j*3/6 + 17j*2. Let s(k) = 4k + 10 + 15k - 10k. Let n(q) = 5p(q) + 3s(q). Gi	{ "pile_set_name": "DM Mathematics" }
smallest value in 1/9, x, -0.12? -0.12 Let s = -21125/8393 + 406/109. Let k = 2/839 + 5851/9229. Let d = k - s. Which is the second biggest value? (a) -5/3 (b) d (c) 0.2 b Suppose 0 = -3z - 5l - 3, -2z + 20 = -2l - 2l. Let c = 2.6 + -0.6. What is the smallest value in -1/3, c, z? -1/3 Suppose -2k - 3l - 12 = -5l, -14 = 3k - l. Which is the biggest value? (a) k (b) -0.4 (c) 1.3 c Let t = -0.2 - -0.08. Let p = t + 0.22. What is the second smallest value in p, 2/7, 0.3? 2/7 Let w = 1 - -4. Let a be (w + -2)(-6)/81. Suppose k - 3g + 27 = -4k, 4k = g - 16. What is the biggest value in k, -1/3, a? a Let u = 81 + -242/3. Let w = 0.1 + -0.2. Let v = w + 0.6. What is the biggest value in v, -1, u? v Let k = 0.7 + -3.9. Let c = -2.8 - k. What is the third biggest value in c, 1/5, -5? -5 Suppose -2w = 4b + 198, -4b + 0b + 2w - 218 = 0. Let t be 1/2 + b/72. What is the smallest value in 2/7, 0.5, t? t Let v = -0.2 - -0.4. Let i(m) = 3m3 - m2 + 1. Let f be i(1). Suppose -t - 2t + 4l = 7, l + 5 = ft. What is the second biggest value in t, v, -0.4? v Let m = 21 - 23. Let d = 1 + m. Let q = -566/7 + 81. Which is the second smallest value? (a) q (b) d (c) 2 a Let q = -7 - -3. Let i = q - -4. Let g = i + 0.3. Which is the third smallest value? (a) 4/7 (b) g (c) 2/7 a Let y = 0.63 + -0.63. Which is the smallest value? (a) 0.1 (b) y (c) -2 c Let f(x) = x - 3. Let h be 7(-1)/(-3)3. Let a be f(h). Let g(u) = u*2 + 6u - 1. Let s be g(-6). What is the third biggest value in -0.4, a, s? s Let q = 135 + -145.1. Let p = -10 - q. What is the second biggest value in -5, p, 3? p Let h = -0.43 + 0.03. What is the smallest value in h, 2/39, 1? h Let g(z) = -z - 4. Let f be g(-9). Which is the third biggest value? (a) 9 (b) f (c) 3 c Let k = -2/83 + -148/747. Let p be ((-1)/2-3)/6. What is the biggest value in 5, k, p? 5 Let f = -29 + 117/4. Which is the second biggest value? (a) -5 (b) f (c) 3 b Suppose 2 + 9 = 3f + x, -5x = -3f + 17. What is the third biggest value in 5, -1, 0, f? 0 Let n be (-535)/(-35) - 2/7. Suppose 9 = 3k - s, 3s - n = -0k - 5k. What is the third smallest value in -5, 0, k? k Let p be (-3)/(-3) - 5/4. What is the smallest value in p, 2/25, 5? p Let n = 0.1 - -0.9. Let p = 0.4 - 0.2. Which is the smallest value? (a) n (b) p (c) 0.4 b Let t = 137 + -139. What is the second smallest value in -12, -5, t? -5 Suppose 1 = -f + 2f. Suppose -5x = -3u + 14, 4x + f = 5u - 5. Which is the third smallest value? (a) 3/7 (b) x (c) 3 c Let m = 0.2 - 0.28. Let r = -0.52 - m. Let z = r + 0.04. What is the second biggest value in 4/9, z, -1? z Let m = -0.6 - -2.6. Let y be ((-5)/(-25))/((-1)/4). What is the third biggest value in y, 0.3, m? y Let f(r) = r3 + 4r*2 - 3r + 6. Let x be f(-5). Which is the third biggest value? (a) -0.4 (b) 0.08 (c) x c Let l be (0/4)/((-7 + 2)/5). Let d = -0.12 - -0.06. What is the smallest value in l, d, -2? -2 Let x = 42 + -290/7. Which is the biggest value? (a) 0.4 (b) x (c) -0.2 b Let q be 13/(-3) + (-4)/6. Let h = q - -3. Which is the second biggest value? (a) -0.2 (b) -5 (c) h c Let p(l) = -l*3 - 7l*2 + 2l + 2. Let y be p(-7). Let n = 23/2 + y. Let o = -0.8 + 1.3. Which is the second biggest value? (a) 0 (b) n (c) o a Let q be ((-4)/8)/(27/78). Let k = q + 5/3. Which is the biggest value? (a) k (b) 1/4 (c) -1/19 b Let l be (0 - 3)-1 + -15. Which is the smallest value? (a) l (b) -0.3 (c) 0.5 (d) 0.2 a Let f = 8 - 13. Let z = 4 + -10. Let l = -8 - z. Which is the third smallest value? (a) f (b) -2/11 (c) l b Let h(n) = n2 + n - 2. Let j be h(2). Suppose jq = 3q - 3. What is the third smallest value in -4, -2/3, q? -2/3 Suppose 2 = -k, 4r - 3k = 5 + 9. Which is the fourth biggest value? (a) -0.5 (b) 0.3 (c) 0.1 (d) r a Let x = -2.7 - -3. Let h = 7 - 8. Let p = -6 - h. Which is the second smallest value? (a) p (b) x (c) -2/9 c Let d be ((-1 + 3)3)/16. Which is the biggest value? (a) -3 (b) -8 (c) d c Let w = -0.076 - -3.076. What is the third biggest value in w, -7, -1, 2/7? -1 Let y = -4.07 - -0.07. Which is the third biggest value? (a) y (b) -6/11 (c) -5 c Let q = 2 + -1.7. What is the second biggest value in q, -2/9, 2/3? q Let u be (2/(-18))/((-10)/(-30)). Suppose 0 = -2m + 2b - 3b - 1, 5m = 2b - 16. Let i be m/3 - (-2)/12. What is the biggest value in 4, i, u? 4 Let n = -12.1 - -13.1. Which is the fourth smallest value? (a) n (b) 3/13 (c) 1/4 (d) 3 d Let t = 9/4 + -3. Suppose 3g + 4 = 8i - 10i, 4 = 4g + 5i. What is the biggest value in 1, g, t? 1 Suppose -3n = -n - 2. Which is the second smallest value? (a) 0.13 (b) n (c) -0.3 a Let f = -7.6 - -3.3. Let w = f + 4. What is the third smallest value in 4/9, w, 3? 3 Suppose -4g + 2g = 0. Let c(y) = -y + 5. Let x be c(g). Let f be ((-2)/(-3))/(x/(-3)). What is the second biggest value in f, 1, 2? 1 Let m = -11 + 8. Let d = 7 + -3. What is the second smallest value in m, d, -1/3? -1/3 Let d(q) = 13q*2 + q - 5. Let h be (1/2)/((-2)/16). Let u be d(h). Let l = 1789/9 - u. Which is the third biggest value? (a) -0.5 (b) l (c) 0.5 a Let l = 3 - 2. Let y = -1.2 + l. Let i = -0.2 - y. What is the biggest value in 4, 0.4, i? 4 Let y = -68785 + 5296812/77. Let j = 54/11 - y. Let g = -5.2 + 0.2. Which is the third biggest value? (a) g (b) j (c) 0 a Let l = -69.2 - -82. Let q = 13 - l. Which is the biggest value? (a) q (b) 0.5 (c) -1/2 b Let j = -35 - -35.28. Let k = 0.08 + -0.1. Let n = j - k. What is the second smallest value in -2, n, 0.5? n Let m = -93/2 - -47. Which is the third smallest value? (a) 1 (b) 5 (c) m b Suppose 12l - 5 = 11l. Let n = 0 + 0. Which is the biggest value? (a) l (b) 2 (c) n a Let f = -5 + 8. Let j be f - 3 - 15/3. Let t = -0.4 - 1.6. Which is the third smallest value? (a) j (b) t (c) 3 c Let s = 2.3 + 0.7. Let b = 1.2 - 0.2. Let n = b - s. What is the biggest value in 0.5, n, -5? 0.5 Let v be ((-1)/2-2)/1. Let r = -2162/15 + 198469/1380. Let g = r - -3/46. Which is the second biggest value? (a) g (b) v (c) 0.3 c Let r = -81 - -79. Let n be 12 + 36/(-20). Which is the second biggest value? (a) -5 (b) r (c) n b Let h be 2/4 - 1/4. Let j = 0.3 - 0.8. Let o = 0.4 + 4.6. What is the third smallest value in j, h, o? o Let t = 5 + -4.6. Let f = 0.72 - 0.7. Let g = 0.52 - f. Which is the second biggest value? (a) t (b) g (c) 1 b Let y = 3.75 + 0.25. Let u be 1 - (-2)/(-4)-3. What is the second biggest value in u, y, 3? 3 Let b = 0.03 + 0.47. Let h be (1/(-6))/((-2)/(-4)). What is the biggest value in b, h, -2/9? b Let g = -239/36 - -27/4. Let z be 2/(-5) - (-69)/(-15). Which is the third biggest value? (a) 1 (b) z (c) g b Let q = -0.29 - -16.29. Let s = -15.6 + q. What is the biggest value in -2/9, s, -1/7? s Suppose -230 = 4m + 122. Let f = m - -442/5. Suppose -3b = 3w + 6, 4w + 8 = -3b - 2b. What is the second biggest value in f, -4, b? b Let s = -1/70 - -3/10. What is the smallest value in s, 3, -0.2, 2? -0.2 Let b = -0.21 - -2.41. Let c = b - 4.2. What is the second smallest value in c, -1, 1/3? -1 Suppose -a = -4k - 0a - 5, -3a = -k + 7. Let h be -25/8 - k. What is the third smallest value in h, 0.2, 2/21? h Let i = -0.06 - 3.94. Suppose 0r = -2r - g + 18, 0 = -5r - 2g + 45. Let m be (6/r)/((-2)/(-3)). Which is the third biggest value? (a) i (b) m (c) 2/5 a Let n(f) = f3 + f2 + 4f - 4. Let o be n(0). Which is the biggest value? (a) 2/9 (b) 4/3 (c) o (d) -0.18 b Suppose 1 + 9 = 5d. Let p = 3 + -3.3. Let o = 0 - p. What is the smallest value in d, 3, o? o Let g = -248/663 + 10/39. Let v = 0.51 - 0.31. What is the third smallest value in 1, v, g? 1 Let a = -6 + 1. Suppose q + 12 = -3q. Let t be 1(15/4)/3. What is the third biggest value in a, q, t? a Suppose -2v = -7 + 1. Let s = 80.5 + -80. Which is the second biggest value? (a) s (b) v (c) -0.1 a Let o = 0.04 + 0.26. Let s be -9 - 9/((-9)/3). Let q be ((-2)/s)/((-3)/45). Which is the biggest value? (a) q (b) 0.5 (c) o b Let k be (-8)/12(-4)/(-6). Let h = -6.7 - -7. Which is the second smallest value? (a) h (b) k (c) -4 b Suppose 4l - l - 24 = 4t, -23 = t - 5*l. Which is the fourth biggest value? (a) 0.3 (b	{ "pile_set_name": "DM Mathematics" }
(c) 16 c Let r = 351 + -1055/3. What is the biggest value in -1, r, -0.2? -0.2 Let p = 2 + -1. Let v = 125.8 - 125. Let z = p - v. Which is the third smallest value? (a) -4 (b) z (c) -0.1 b Let n = -0.274 + 0.324. What is the biggest value in 0.1, n, -4, 5? 5 Let p be ((-42)/(-140))/(6/(-8)). Let i = 6 + -9. Which is the third smallest value? (a) i (b) p (c) 2/11 c Let o(g) = -2g2 - 25g + 10. Let k be o(-13). Which is the third smallest value? (a) 0.1 (b) 2/13 (c) 0.2 (d) k b Let o = -26.5 - -26.5. Which is the third smallest value? (a) 0.07 (b) -0.1 (c) o a Let p = 24.5 - 18.5. Which is the fourth smallest value? (a) -3 (b) p (c) 2/5 (d) 0.3 b Suppose k + 55 = 5v, -k - 105 = 2k - 3v. Let s = k + 35. Which is the biggest value? (a) 0.4 (b) 0.2 (c) s c Let z(i) = 19 - i - 19. Let y be z(-4). Let x = 37 - 110/3. Which is the second smallest value? (a) x (b) -0.04 (c) y a Let w = -290 + 289.6. What is the smallest value in 0, -2/11, w? w Let s = -5035 - -5037. Let u = -0.24 + -0.06. What is the fourth smallest value in 1/4, s, u, -3? s Let o = 5934/7 - 846. What is the biggest value in o, -3, -0.5? o Let y be 8/(-9) - (-58)/87. Let t be (-16)/24 + 2/2. What is the third biggest value in y, 1.8, t, -4? y Let n = -1805/7 - -257. Which is the second smallest value? (a) -2.1 (b) n (c) 1/5 (d) 3/4 b Let l = -1339/7 + 191. Let g = -0.0489 - -7.0489. What is the second biggest value in 1, l, g? 1 Let j = 0.83 - -0.27. Let r = -4.47 - -0.57. Let z = r - j. What is the second biggest value in z, -0.2, -3/2? -3/2 Let q = 9/40 - 57/40. What is the fourth smallest value in q, -3/5, -0.4, 4? 4 Let j(m) = -m3 + 29m*2 - 29m + 25. Let c be j(28). What is the second smallest value in 5, c, -0.2? -0.2 Let t = -0.95 + 2.95. Let i = -3.96 - -4. Let z = 0.44 - i. What is the second smallest value in -2/9, t, z? z Let y = 138 + -143. What is the smallest value in y, -11, 5, -1/2? -11 Let j = 23.495 + -0.095. Let q = -23 + j. Which is the third biggest value? (a) -0.2 (b) q (c) 5 a Let k = -5.67 - -3.67. Which is the fourth smallest value? (a) 4 (b) 0.3 (c) k (d) -4 a Let s = 0.371 + -0.071. Let r = -0.34 + 0.04. Let m = -218 - -3708/17. Which is the biggest value? (a) s (b) r (c) m a Let j = -168 + 168.5. Let f = 0.5 - 0.1. What is the smallest value in -1/6, f, 3, j? -1/6 Let g(n) = -2n - 4. Let c be g(0). Let d be (-1)/c(-10 + 12). Let w(y) = -2y + 3. Let r be w(4). What is the smallest value in 3, r, d? r Let g = 396.9 + -397. Which is the third biggest value? (a) 131 (b) g (c) 3 b Let k = 97.31 + -4.31. Which is the third biggest value? (a) -1/2 (b) k (c) 0 a Let f = 0.6 - 0.6. Suppose -3x + 5p + 5 = 4p, -4x + 11 = 3p. Let u = 71/33 + -20/11. What is the second biggest value in f, x, u? u Let j = -96/5 + 20. What is the second smallest value in j, 1/13, 2, 0.4? 0.4 Let q = -32.6 + 31.3. Which is the fourth biggest value? (a) 2 (b) -3/7 (c) -0.5 (d) q d Let v = 334 - 332. What is the second smallest value in 4, v, 0, -2? 0 Let y = -100.1 + 99.7. What is the third biggest value in y, -2, -5, -13? -5 Let b = -3.9202 + -0.0798. What is the second biggest value in 0, 2/43, b? 0 Let m(u) = -131u - 9. Let l be m(-1). What is the biggest value in 2, -4, l? l Let z = 324 - 323.9. Which is the fourth smallest value? (a) 1/3 (b) -3 (c) z (d) 5 d Let l = -59.9 + -2.1. Let b = 61.9 + l. What is the third smallest value in -1, -2/13, b? b Let w = 0.107 - -4.893. Which is the biggest value? (a) 2/3 (b) -4 (c) 1/10 (d) w d Let m = -472 - -471. Let o be 2/4(4 - 2). What is the third biggest value in -0.2, o, m? m Let k = 118.5 - 118. Suppose 0q + 3q = -4h, 5h + 2q - 7 = 0. What is the second biggest value in 2/7, h, k, -1/5? k Let k be (-231)/(-12) - 2/8. Suppose -5u + 3i - k = 0, -i = 2u - u + 7. Let m = -1007 + 1006. What is the third smallest value in u, -2, m? m Let h = -19.487 + 19.4. Let c = h - 0.013. What is the fourth biggest value in 0.1, c, 2/3, -3? -3 Let c be (15 + -13)/(4/405). What is the smallest value in -2, 0.1, 0.021, c? -2 Let r be (-3 - -4)/(12/(-18)3). What is the second smallest value in 14, r, 0.5? 0.5 Suppose 3o = 4o - 6. Suppose 0y = -oy - 12. Let m = -3.1 + -1.9. Which is the second smallest value? (a) m (b) y (c) 5 b Let f = 106 - 104. Let o = -0.17 + -2.83. Which is the second biggest value? (a) f (b) o (c) 2/3 (d) 0.6 c Let n(r) = 2r + 22. Let b be n(-11). Let i be (-60)/88 - (-2)/4. What is the fourth smallest value in -2/15, i, -0.2, b? b Let q = -0.54 - -2.54. What is the fourth biggest value in 1/10, -0.1, 4/5, q? -0.1 Let a = 425 - 405. What is the smallest value in 0, 5, a, -4? -4 Let d = -2.18 + 2.19. What is the smallest value in d, -16, -5? -16 Let f = -5 - -5.5. Let q = -13 - -17. What is the second smallest value in f, q, -4? f Let p = 3 - 13/5. Which is the third smallest value? (a) p (b) 0.1 (c) -5 (d) -0.2 b Let j = -0.16 + 0.04. Let q = 22 - 21.58. Let i = q + j. Which is the third biggest value? (a) -2 (b) -0.1 (c) i a Let t = -22598/77 - -2055/7. Let x = 0 - 7. What is the third biggest value in 7, x, t, 5? t Let p = 3.1 + -0.1. Let k = 1.65 + 0.15. Let s = k + -2. What is the third smallest value in s, p, -0.4? p Suppose -15 = -4r - 3. Suppose 5v = -4x - 22, 0 = 2x - 3x - r. Suppose c + 1 = -6q, -5 = -5q - 2c - 14. What is the third biggest value in v, -0.05, q? v Let h(l) = -l3 + 10l*2 + 12l - 14. Let k be h(11). Let g be 5/(-15)13 - -6. Which is the fourth smallest value? (a) 3 (b) -0.1 (c) k (d) g a Let k = 15 - 19. Let w be k/(-3 + 2) - 0. Which is the smallest value? (a) -5 (b) -0.1 (c) w a Let v be (-1)/(-2) - (-4)/(-8). Suppose -2j + v = -6. Let y = 1274/11 - 116. Which is the smallest value? (a) -5/6 (b) j (c) y a Let y = 26 + -131/5. Let r = -0.664 - -0.964. Let u be 2/4(-1)/2. Which is the third biggest value? (a) y (b) r (c) u c Let f = 6 - 5.7. Let z = -0.183 - 0.017. Let l = z - 0. Which is the second biggest value? (a) 0.9 (b) l (c) f c Let o = 393 - 390. Let p = 0 + 0.1. Let r(d) = d2 - 7d. Let u be r(7). What is the second smallest value in u, p, o? p Let m = -150 - -152. What is the smallest value in 0.02, 3, m, 2/13? 0.02 Let d = 34/3 + -250/21. Let w = -275 - -275. Which is the biggest value? (a) d (b) w (c) 4 c Let g = 3 + -5. Let z = 20678 - 20682. Which is the second biggest value? (a) -0.2 (b) -2/21 (c) g (d) z a Let h = 2.01 - 0.01. Let x = -6458 - -6463. Which is the third biggest value? (a) -2 (b) x (c) h a Suppose 0 = 2p - 4, 2x + 3p - 5 - 19 = 0. Let f be (x - 11)5/2. What is the third biggest value in f, -14, 0.3? -14 Let o(f) = -f + 15. Let d be o(-6). Suppose 4w + d = 3y - 2y, -y = w + 4. What is the second biggest value in 0.1, y, -8? 0.1 Let g = 0.274 + -1.674. Which is the second smallest value? (a) -0.01 (b) 1 (c) g a Let h = -360 - -340.1. Let t = -20 - h. Let r(v) = v - 5. Let z be r(5). What is the biggest value in z, t, 5? 5 Suppose 5x - 2x = 0. Let q = 10 + 21. Let k = q - 31.1. Which is the third smallest value? (a) k (b) x (c) -4 b Let o = -497 + 497.2. Let r = -4 + 1. Which is the third smallest value? (a) o (b) r (c) -2/5 (d) 0.4 a Let g = 28.8 + -29.3. Which is the second smallest value? (a) -5 (b) g (c) -18 (d) -2 a Let z be (8/14)/(4/(-2)). Let g = 0.27 + 10.73. Let r = -12 + g. Which is the second biggest value? (a) r (b) z (c) 0.5 b Let d = -0.28 - 0.14. Let r = 0.61 + d. Which is the second biggest value? (a) 3 (b) r (c) -1 b Let s = 1564 + -1570. Which is the fourth biggest value? (a) -2 (b) -0.06 (c) s (d) -0.3 c Let u = 59 + -53. Let t = -19 + 19.4. Which is the second smallest value? (a) t (b) 5 (c) u b Let z be -1 - (696/28)/(-3). Let l = 276/35 - z. What is the third smallest value in l, 7, -0.5? 7 Let s be (6/273)/(100/(-450)). Which is the smallest value? (a) 0 (b) 75 (c) s (d) -5 d Let r = 1469/9 - 163. Let y = -2 - -3. Let w = 1.9 - y. What is the third smallest value in -0.3, r, w? w Let b be (-2)/126-1. What is the second smallest value in 2, 2.87, b? 2 Let g = 1142 + -1142. Which is the second biggest value? (a) 4 (b) g (c) 3/4 (d) 2/5 c Let d = -97 - -95.98. Let g = d +	{ "pile_set_name": "DM Mathematics" }
8? 14 What is the highest common divisor of 48 and 24? 24 What is the highest common factor of 429 and 286? 143 What is the greatest common divisor of 3483 and 162? 81 What is the greatest common divisor of 266 and 56? 14 What is the greatest common divisor of 8856 and 41? 41 What is the highest common factor of 2 and 1878? 2 What is the highest common divisor of 38 and 418? 38 What is the greatest common divisor of 19323 and 19? 19 What is the highest common factor of 236 and 33394? 118 What is the greatest common divisor of 61470 and 90? 90 Calculate the greatest common divisor of 54 and 4563. 27 What is the greatest common divisor of 470 and 230? 10 Calculate the highest common divisor of 2660 and 105. 35 Calculate the greatest common divisor of 392 and 21. 7 What is the greatest common divisor of 2472 and 1030? 206 Calculate the greatest common divisor of 16 and 1664. 16 What is the highest common factor of 20 and 10460? 20 Calculate the greatest common divisor of 2167 and 22. 11 Calculate the highest common factor of 21 and 13349. 7 Calculate the highest common factor of 770 and 242. 22 Calculate the highest common factor of 216 and 1314. 18 What is the highest common factor of 13 and 91? 13 Calculate the greatest common divisor of 351 and 153. 9 Calculate the greatest common divisor of 1 and 173. 1 Calculate the greatest common factor of 126 and 2898. 126 What is the greatest common factor of 96 and 456? 24 Calculate the greatest common factor of 230 and 92. 46 Calculate the greatest common divisor of 204 and 374. 34 What is the greatest common divisor of 182 and 1729? 91 Calculate the greatest common divisor of 208 and 2600. 104 What is the highest common divisor of 35 and 560? 35 What is the greatest common divisor of 925 and 148? 37 Calculate the highest common divisor of 5566 and 22. 22 Calculate the greatest common divisor of 628 and 8. 4 What is the greatest common factor of 2813 and 291? 97 What is the highest common divisor of 725 and 25? 25 What is the highest common divisor of 30 and 14010? 30 Calculate the greatest common divisor of 66 and 30. 6 Calculate the highest common divisor of 56 and 2548. 28 Calculate the highest common divisor of 2478 and 84. 42 Calculate the greatest common divisor of 18 and 315. 9 What is the highest common factor of 620 and 80? 20 Calculate the highest common divisor of 116 and 4. 4 Calculate the greatest common factor of 163 and 2. 1 What is the highest common divisor of 276 and 24? 12 What is the greatest common factor of 80 and 540? 20 Calculate the greatest common factor of 252 and 36. 36 What is the highest common factor of 21551 and 23? 23 Calculate the greatest common divisor of 244 and 1830. 122 Calculate the greatest common divisor of 38 and 361. 19 What is the highest common divisor of 57 and 437? 19 What is the highest common divisor of 100 and 380? 20 What is the greatest common factor of 9132 and 60? 12 Calculate the greatest common divisor of 182 and 1261. 13 What is the highest common divisor of 962 and 52? 26 What is the highest common divisor of 73 and 146? 73 What is the highest common divisor of 22 and 66? 22 What is the greatest common divisor of 6 and 4? 2 What is the highest common divisor of 21 and 519? 3 Calculate the greatest common factor of 1953 and 189. 63 What is the greatest common divisor of 275 and 125? 25 Calculate the highest common divisor of 201 and 51. 3 What is the highest common factor of 306 and 153? 153 What is the greatest common factor of 62 and 2? 2 Calculate the greatest common divisor of 69 and 33. 3 Calculate the highest common factor of 378 and 56. 14 What is the highest common factor of 153 and 816? 51 What is the greatest common factor of 141 and 24? 3 What is the highest common factor of 5984 and 416? 32 What is the greatest common factor of 42 and 558? 6 Calculate the greatest common divisor of 30 and 36. 6 Calculate the highest common divisor of 32 and 2872. 8 Calculate the greatest common factor of 441 and 525. 21 What is the greatest common factor of 12636 and 9? 9 Calculate the highest common factor of 3397 and 86. 43 What is the greatest common divisor of 128 and 304? 16 Calculate the greatest common divisor of 12 and 2811. 3 Calculate the greatest common factor of 348 and 957. 87 Calculate the greatest common factor of 145 and 87. 29 Calculate the greatest common divisor of 5071 and 11. 11 Calculate the greatest common factor of 185 and 111. 37 What is the highest common factor of 342 and 144? 18 Calculate the greatest common factor of 7486 and 114. 38 What is the greatest common factor of 508 and 127? 127 Calculate the greatest common divisor of 130 and 158. 2 Calculate the highest common divisor of 8 and 188. 4 What is the highest common factor of 46 and 5658? 46 What is the greatest common factor of 836 and 572? 44 What is the greatest common factor of 55 and 16? 1 What is the greatest common factor of 2636 and 4? 4 What is the greatest common factor of 27 and 24? 3 What is the highest common divisor of 11 and 2981? 11 Calculate the highest common factor of 1122 and 4386. 102 Calculate the greatest common divisor of 32 and 6176. 32 Calculate the greatest common factor of 10 and 82. 2 Calculate the greatest common divisor of 962 and 52. 26 Calculate the highest common divisor of 46 and 354. 2 Calculate the greatest common divisor of 213 and 568. 71 Calculate the highest common divisor of 91 and 533. 13 What is the highest common factor of 11233 and 47? 47 What is the greatest common factor of 150 and 60? 30 What is the greatest common factor of 43 and 19? 1 What is the greatest common divisor of 84 and 189? 21 Calculate the highest common divisor of 30 and 27. 3 Calculate the greatest common divisor of 2556 and 162. 18 Calculate the greatest common factor of 10 and 30. 10 What is the greatest common divisor of 1888 and 118? 118 Calculate the highest common divisor of 1648 and 515. 103 What is the highest common divisor of 32 and 10? 2 Calculate the greatest common divisor of 474 and 6. 6 Calculate the highest common divisor of 1011 and 60. 3 Calculate the greatest common factor of 300 and 15780. 60 Calculate the greatest common divisor of 26 and 180. 2 What is the greatest common factor of 27 and 2133? 27 What is the highest common divisor of 1 and 11? 1 Calculate the highest common divisor of 30 and 5145. 15 Calculate the greatest common factor of 395 and 135. 5 What is the greatest common divisor of 117 and 27? 9 What is the greatest common factor of 4688 and 144? 16 Calculate the highest common factor of 9 and 26. 1 What is the greatest common factor of 1 and 22? 1 Calculate the greatest common factor of 26 and 546. 26 What is the highest common divisor of 198 and 1892? 22 What is the greatest common divisor of 28 and 28? 28 Calculate the highest common divisor of 18 and 334. 2 What is the greatest common divisor of 645 and 45? 15 Calculate the greatest common factor of 45 and 153. 9 What is the highest common divisor of 110 and 22? 22 What is the greatest common divisor of 29 and 116? 29 Calculate the highest common divisor of 176 and 35552. 176 What is the greatest common divisor of 384 and 6? 6 What is the greatest common divisor of 3284 and 20? 4 Calculate the highest common factor of 484 and 22. 22 What is the highest common divisor of 13 and 377? 13 Calculate the greatest common factor of 39917 and 223. 223 Calculate the highest common divisor of 13 and 65. 13 What is the highest common factor of 61 and 1586? 61 What is the greatest common divisor of 60 and 96? 12 What is the highest common divisor of 87 and 12209? 29 Calculate the greatest common divisor of 11358 and 18. 18 What is the greatest common factor of 99 and 18? 9 What is the greatest common factor of 407 and 74? 37 What is the greatest common divisor of 13 and 1313? 13 What is the greatest common divisor of 18 and 90? 18 Calculate the greatest common divisor of 70 and 1610. 70 What is the highest common divisor of 320 and 100? 20 Calculate the greatest common divisor of 34 and 289. 17 Calculate the highest common factor of 648 and 5130. 54 What is the highest common factor of 7 and 7364? 7 What is the highest common divisor of 89 and 11? 1 Calculate the highest c	{ "pile_set_name": "DM Mathematics" }
culate the highest common divisor of 21 and 78258761. 7 What is the greatest common divisor of 108913001 and 1181? 1181 Calculate the highest common divisor of 685359 and 360972. 2439 What is the greatest common factor of 64054705 and 2222? 1111 What is the greatest common divisor of 4848 and 19855590? 606 Calculate the greatest common factor of 26 and 14812954. 26 What is the greatest common divisor of 306 and 233070816? 102 What is the greatest common factor of 1176 and 46061274? 294 What is the highest common divisor of 107520 and 46464? 384 Calculate the greatest common divisor of 3316 and 11998946. 1658 Calculate the greatest common factor of 243295466 and 17170. 3434 Calculate the greatest common divisor of 645579036 and 4824. 2412 Calculate the highest common factor of 32305768 and 1166. 22 Calculate the greatest common divisor of 1117423440 and 10. 10 What is the greatest common factor of 14920147 and 4356? 121 Calculate the highest common factor of 2058 and 83982178. 686 Calculate the highest common divisor of 12876 and 1033188. 444 Calculate the highest common divisor of 3365440 and 13000. 520 Calculate the greatest common factor of 365704938 and 10836. 774 Calculate the highest common factor of 53576 and 2972744. 1448 Calculate the highest common factor of 450828 and 95256. 252 Calculate the greatest common factor of 88 and 49815810. 22 What is the greatest common divisor of 1477 and 65100? 7 Calculate the highest common divisor of 7195895 and 1047140. 6385 What is the greatest common divisor of 10456 and 1967296? 8 What is the highest common factor of 3327681 and 651? 21 Calculate the greatest common factor of 27238616 and 8. 8 What is the greatest common divisor of 502 and 40602011? 251 Calculate the greatest common divisor of 401607 and 729. 9 Calculate the highest common factor of 81305 and 85547. 707 What is the highest common factor of 970 and 83379454? 194 What is the greatest common divisor of 196970823 and 714? 357 Calculate the highest common factor of 575131605 and 120. 15 Calculate the greatest common divisor of 59566 and 4199. 13 Calculate the greatest common divisor of 2510 and 321389185. 1255 Calculate the greatest common factor of 1696811742 and 36. 18 Calculate the greatest common divisor of 323 and 366263. 19 What is the greatest common divisor of 17850 and 10999? 17 Calculate the greatest common factor of 452867215 and 5. 5 Calculate the greatest common factor of 1367847 and 630. 9 Calculate the highest common factor of 743845 and 236375. 155 Calculate the greatest common factor of 58128 and 2164176. 336 What is the highest common divisor of 80 and 288102? 2 What is the highest common factor of 30941 and 689? 1 Calculate the highest common factor of 104 and 15213614. 26 Calculate the greatest common divisor of 1357680 and 20320. 80 Calculate the highest common factor of 39411 and 261. 261 What is the greatest common factor of 219989223 and 5137? 467 What is the greatest common factor of 27323316 and 24166? 562 Calculate the greatest common divisor of 14080 and 71365888. 2816 Calculate the greatest common factor of 14922 and 699912. 18 What is the highest common factor of 271862 and 14438726? 1502 Calculate the highest common factor of 66243 and 701409. 213 What is the highest common factor of 7291 and 2247625734? 7291 What is the highest common divisor of 592487 and 6996? 53 Calculate the greatest common divisor of 13554 and 18189. 9 Calculate the greatest common divisor of 37976 and 160871083. 4747 What is the highest common divisor of 172 and 1126252? 4 Calculate the greatest common factor of 2840 and 145414. 2 Calculate the highest common divisor of 16472 and 363312. 232 What is the greatest common divisor of 1084 and 286865966? 542 Calculate the greatest common factor of 4528442 and 8696. 2174 Calculate the highest common divisor of 2292 and 2173389. 573 Calculate the highest common divisor of 8523 and 10656. 9 Calculate the highest common factor of 5273825 and 3315. 85 What is the greatest common factor of 108 and 158932? 4 What is the highest common divisor of 178809 and 14809777? 3137 What is the highest common divisor of 57417356 and 32252? 2932 What is the greatest common factor of 1203828 and 44376? 516 Calculate the greatest common divisor of 352920 and 5610. 510 What is the highest common divisor of 141747 and 366? 3 Calculate the highest common divisor of 16073485 and 15. 5 Calculate the greatest common divisor of 75 and 19658130. 15 What is the greatest common divisor of 1405764328 and 2864? 1432 What is the highest common divisor of 26078580 and 21780? 1980 What is the greatest common factor of 189296 and 152? 8 What is the greatest common factor of 22422428 and 434? 14 What is the greatest common divisor of 4171 and 25990318? 43 Calculate the highest common divisor of 318 and 38935178. 106 What is the highest common divisor of 86549 and 953258? 1219 What is the highest common factor of 309558529 and 343? 343 Calculate the highest common divisor of 464542694 and 46970. 9394 Calculate the greatest common divisor of 44266964 and 3756. 1252 Calculate the highest common divisor of 10328669 and 754. 377 Calculate the highest common divisor of 34000299 and 555. 111 Calculate the greatest common factor of 230974262 and 36049. 2773 What is the greatest common divisor of 59904 and 7022080? 6656 What is the greatest common factor of 5100 and 1306824? 204 Calculate the greatest common factor of 1549062 and 5904. 738 What is the highest common divisor of 89378364 and 18324? 6108 Calculate the greatest common divisor of 1404 and 307386. 18 What is the highest common divisor of 3357529 and 3185? 49 Calculate the greatest common divisor of 160822 and 89006. 382 What is the greatest common factor of 218496 and 14208? 384 What is the greatest common factor of 77310 and 5760? 90 What is the greatest common factor of 31 and 26085322? 31 What is the greatest common factor of 671 and 46219151? 671 Calculate the highest common factor of 584 and 54476104. 584 Calculate the greatest common divisor of 66501 and 348104. 821 Calculate the greatest common divisor of 235 and 145641955. 235 Calculate the highest common factor of 1470 and 2815295. 245 Calculate the greatest common divisor of 8007769 and 77. 77 What is the greatest common factor of 34565 and 511345? 155 What is the greatest common divisor of 11938752 and 336? 336 What is the highest common divisor of 9 and 48538193? 1 Calculate the greatest common divisor of 640 and 64965. 5 Calculate the greatest common factor of 46 and 186896988. 46 What is the greatest common divisor of 3331 and 61933283? 3331 Calculate the highest common factor of 30 and 3322908. 6 What is the highest common divisor of 6014674 and 4541? 239 What is the greatest common divisor of 71445 and 774620? 55 Calculate the greatest common divisor of 5716161 and 5841. 99 Calculate the greatest common factor of 48147989 and 481. 37 Calculate the greatest common divisor of 832 and 2993600. 64 What is the highest common factor of 1311 and 18121079? 437 Calculate the greatest common factor of 292945 and 46535. 205 Calculate the highest common factor of 560 and 28860944. 112 What is the greatest common factor of 28553145 and 7725? 1545 What is the highest common divisor of 5445 and 65623140? 5445 Calculate the highest common divisor of 45935823 and 14865. 2973 What is the highest common factor of 6 and 17072280? 6 Calculate the highest common factor of 34775 and 2054507. 1391 What is the highest common factor of 1769885412 and 2148? 2148 Calculate the highest common divisor of 11834 and 42334. 122 Calculate the highest common factor of 2844 and 648864. 36 Calculate the highest common divisor of 109400 and 714382. 1094 Calculate the greatest common factor of 58560 and 7664000. 320 Calculate the highest common factor of 1734596 and 3172. 244 What is the greatest common factor of 9366809 and 333? 37 Calculate the greatest common divisor of 1750375 and 19. 19 Calculate the highest common factor of 313177 and 7738. 53 What is the highest common factor of 2006 and 39229336? 2006 Calculate the greatest common divisor of 81536 and 40082. 98 What is the highest common factor of 11754801 and 6? 3 What is the highe	{ "pile_set_name": "DM Mathematics" }
197, 1979 What are the prime factors of 4087831? 11, 19, 19559 What are the prime factors of 3199068? 2, 3, 19, 1559 What are the prime factors of 1525242? 2, 3, 254207 What are the prime factors of 255942? 2, 3, 59, 241 What are the prime factors of 58089? 3, 17, 67 What are the prime factors of 341134? 2, 281, 607 List the prime factors of 1152640. 2, 5, 1801 What are the prime factors of 3715340? 2, 5, 185767 List the prime factors of 2995451. 17, 23, 47, 163 List the prime factors of 3280022. 2, 151, 10861 List the prime factors of 370912. 2, 67, 173 What are the prime factors of 6405876? 2, 3, 107, 1663 What are the prime factors of 2969346? 2, 3, 23, 21517 List the prime factors of 12175696. 2, 13, 58537 What are the prime factors of 169993? 19, 23, 389 List the prime factors of 174216. 2, 3, 7, 17, 61 List the prime factors of 37671. 3, 29, 433 What are the prime factors of 242416? 2, 109, 139 List the prime factors of 720676. 2, 11, 1489 What are the prime factors of 6767336? 2, 23, 36779 What are the prime factors of 353038? 2, 7, 151, 167 What are the prime factors of 203666? 2, 101833 List the prime factors of 101031. 3, 7, 17, 283 What are the prime factors of 17255350? 2, 5, 7, 7043 What are the prime factors of 12510565? 5, 2502113 What are the prime factors of 15719735? 5, 953, 3299 List the prime factors of 1401275. 5, 23, 2437 List the prime factors of 282862. 2, 233, 607 What are the prime factors of 4938011? 13, 61, 479 List the prime factors of 326177. 439, 743 What are the prime factors of 2684481? 3, 373, 2399 List the prime factors of 368313. 3, 11, 11161 List the prime factors of 447143. 23, 19441 What are the prime factors of 1571685? 3, 5, 104779 List the prime factors of 259821. 3, 9623 What are the prime factors of 709097? 709097 What are the prime factors of 10167544? 2, 1270943 What are the prime factors of 35939? 83, 433 List the prime factors of 3190157. 19, 8837 List the prime factors of 246879. 3, 27431 List the prime factors of 11918778. 2, 3, 97, 20479 List the prime factors of 3063063. 3, 181, 5641 List the prime factors of 997118. 2, 17, 29327 What are the prime factors of 735276? 2, 3, 71, 863 What are the prime factors of 1069718? 2, 13, 41143 List the prime factors of 740174. 2, 61, 6067 List the prime factors of 1314890. 2, 5, 131489 List the prime factors of 889905. 3, 5, 41, 1447 What are the prime factors of 6339576? 2, 3, 43, 6143 What are the prime factors of 1004004? 2, 3, 167 What are the prime factors of 3121476? 2, 3, 269, 967 List the prime factors of 25111630. 2, 5, 23, 47, 101 List the prime factors of 1810162. 2, 53, 17077 What are the prime factors of 788771? 29, 59, 461 List the prime factors of 12924284. 2, 17, 190063 What are the prime factors of 1754901? 3, 194989 What are the prime factors of 80501? 79, 1019 What are the prime factors of 6348719? 13, 37, 67, 197 List the prime factors of 42670. 2, 5, 17, 251 List the prime factors of 131701. 131701 List the prime factors of 506691. 3, 56299 List the prime factors of 1102450. 2, 5, 17, 1297 List the prime factors of 248624. 2, 41, 379 List the prime factors of 11209095. 3, 5, 223, 1117 List the prime factors of 468090. 2, 3, 5, 7, 743 List the prime factors of 1813246. 2, 19, 47717 What are the prime factors of 27449118? 2, 3, 17, 9967 List the prime factors of 806448. 2, 3, 53, 317 What are the prime factors of 15162493? 15162493 List the prime factors of 19850777. 19850777 List the prime factors of 674219. 7, 13, 31, 239 What are the prime factors of 2577199? 139, 18541 List the prime factors of 27849481. 11, 23, 10007 What are the prime factors of 13300497? 3, 7, 70373 What are the prime factors of 2883306? 2, 3, 53, 9067 List the prime factors of 311645. 5, 157, 397 List the prime factors of 2929750. 2, 5, 11719 List the prime factors of 194255. 5, 38851 What are the prime factors of 6474545? 5, 7, 11, 67, 251 What are the prime factors of 2047235? 5, 331, 1237 What are the prime factors of 7951410? 2, 3, 5, 17, 5197 List the prime factors of 493691. 11, 37, 1213 What are the prime factors of 1646890? 2, 5, 7, 3361 List the prime factors of 67881. 3, 11, 17 List the prime factors of 23883845. 5, 4776769 What are the prime factors of 1742923? 7, 13, 107, 179 What are the prime factors of 3819098? 2, 223, 8563 What are the prime factors of 61234? 2, 17, 1801 What are the prime factors of 1162305? 3, 5, 23, 1123 List the prime factors of 537595. 5, 79, 1361 List the prime factors of 316792. 2, 7, 5657 List the prime factors of 69420. 2, 3, 5, 13, 89 What are the prime factors of 335835? 3, 5, 17, 439 List the prime factors of 5733718. 2, 47, 181, 337 List the prime factors of 438435. 3, 5, 9743 What are the prime factors of 105127? 11, 19, 503 What are the prime factors of 119248? 2, 29, 257 List the prime factors of 18253965. 3, 5, 19, 3371 What are the prime factors of 598819? 13, 73, 631 What are the prime factors of 365290? 2, 5, 36529 What are the prime factors of 1521313? 17, 109, 821 What are the prime factors of 300200? 2, 5, 19, 79 List the prime factors of 2343564. 2, 3, 65099 List the prime factors of 5333509. 19, 280711 What are the prime factors of 62533? 62533 List the prime factors of 6472811. 563, 11497 What are the prime factors of 2481241? 7, 354463 What are the prime factors of 2250048? 2, 3, 11719 What are the prime factors of 16756486? 2, 37, 367, 617 List the prime factors of 3428585. 5, 685717 List the prime factors of 2358128. 2, 19, 7757 List the prime factors of 17961426. 2, 3, 7, 47, 337 List the prime factors of 3721998. 2, 3, 7, 23, 3853 What are the prime factors of 363168? 2, 3, 13, 97 List the prime factors of 14343887. 269, 53323 List the prime factors of 177218. 2, 88609 What are the prime factors of 15957630? 2, 3, 5, 13, 23, 593 What are the prime factors of 3825306? 2, 3, 17, 463 What are the prime factors of 10186636? 2, 2546659 List the prime factors of 4292179. 83, 51713 What are the prime factors of 8162152? 2, 1020269 List the prime factors of 3119240. 2, 5, 29, 2689 What are the prime factors of 3435865? 5, 19, 59, 613 What are the prime factors of 976344? 2, 3, 17, 2393 What are the prime factors of 1862363? 491, 3793 What are the prime factors of 370181? 7, 52883 List the prime factors of 1251735. 3, 5, 83449 What are the prime factors of 6817141? 541, 12601 List the prime factors of 338165. 5, 47, 1439 List the prime factors of 847298. 2, 423649 What are the prime factors of 2120391? 3, 7, 13, 863 List the prime factors of 186977. 7, 26711 What are the prime factors of 25863252? 2, 3, 2155271 What are the prime factors of 6159201? 3, 2053067 List the prime factors of 1684274. 2, 19, 127, 349 What are the prime factors of 1109039? 389, 2851 List the prime factors of 4641952. 2, 7, 17, 23, 53 List the prime factors of 4289687. 19, 31, 7283 List the prime factors of 1269868. 2, 167, 1901 List the prime factors of 1110019. 1110019 List the prime factors of 1071537. 3, 357179 List the prime factors of 3537145. 5, 707429 List the prime factors of 339692. 2, 163, 521 What are the prime factors of 76361? 19, 4019 What are the prime factors of 896739? 3, 271, 1103 List the prime factors of 1178680. 2, 5, 79, 373 List the prime factors of 722664. 2, 3, 10037 What are the prime factors of 221737? 221737 What are the prime factors of 277789? 277789 What are the prime factors of 11316765? 3, 5, 754451 What are the prime factors of 257342? 2, 223, 577 What are the prime factors of 30179176? 2, 3772397 List the prime factors of 2347719. 3, 11, 71143 What are the prime factors of 1136694? 2, 3, 13, 19, 59 List the prime factors of 182623. 7, 3727 List the prime factors of 2558219. 2558219 What are the prime factors of 128949? 3, 53, 811 List the prime factors of 48078. 2, 3, 2671 List the prime factors of 160585. 5, 32117 List the prime factors of 2288813. 89, 25717 List the prime factors of 1707141. 3, 569047 What are the prime factors of 343871? 11, 43, 727 List the prime factors of 885630. 2, 3, 5, 53, 557 What are the prime factors of 907380? 2, 3, 5, 71 What are the prime factors of 79987? 79987 What are the prime factors of 5596225? 5, 223849 List the prime factors of 954592. 2, 23, 1297 What	{ "pile_set_name": "DM Mathematics" }
1) Let a = 191/112 - 9/16. Let r(q) = -q*3 - 12q*2 - 30q + 35. Let g be r(-7). Find m, given that -2/7m3 - 6/7m - am2 + g = 0. -3, -1, 0 Let b(y) be the first derivative of -2y*3/3 + 5y*2 - 81. Factor b(n). -2n(n - 5) Let z = -2 - -10. Suppose 6v - 8v = -z. Determine f, given that 2f*3 - 10f4 - f3 + 9fv = 0. 0, 1 Let t(y) = -6y - 27. Let i be t(-5). Factor 15j2 - 2j4 - j4 - 2j4 - 10j*i. -5j*2(j - 1)(j + 3) Find i such that 280i - 223i2 + 118i*2 - 180 + 3i*3 + 2i*3 = 0. 1, 2, 18 Let z = 59 + -53. Let u = z - 4. Let 22/5r*u - 26/5r*3 + 6r*5 - 22/5r*4 - 4/5r + 0 = 0. Calculate r. -1, 0, 1/3, 2/5, 1 Let j(h) be the third derivative of -h*6/360 + 2h*4/9 - 255h*2. Factor j(p). -p(p - 4)(p + 4)/3 Let v(w) be the second derivative of w6/165 + w5/55 + w4/66 - 572w. Factor v(j). 2j2(j + 1)2/11 Let p = 22679 - 22677. Factor -sp + s + 0 + 1/4s3. s(s - 2)2/4 Let y(f) be the second derivative of f4/12 - 13f3/2 - 20f*2 - 2f + 2. Determine m so that y(m) = 0. -1, 40 Suppose j - 3j - 4d + 256 = 0, -143 = -j + d. Let 2a - 2a*4 - 2a - 136a5 + ja*5 = 0. Calculate a. 0, 1 Let m(z) be the first derivative of -8 - 9z*4 - 1/3z*6 + 6z + 14/5z5 - 13z*2 + 44/3z*3. Solve m(c) = 0. 1, 3 Let f be (-6)/15100/(-18)(-231)/(-154). Find d such that -2/3d*2 + fd - 8/3 = 0. 1, 4 Let c(w) be the first derivative of -w*4/6 + 34w*3/9 - 40w*2/3 - 200w - 182. Factor c(d). -2(d - 10)2(d + 3)/3 Suppose 14 = -2d + 4t, -4t = -24d + 20d - 8. Find p such that -1/4pd + p2 - p + 0 = 0. 0, 2 Let n(c) be the third derivative of 0c - 44c*2 - 7/2c*5 - 4c*3 + 13/2c*4 - 49/40c*6 + 0. Factor n(g). -3(g + 2)(7g - 2)*2 Find m, given that -18m*2 + 32m - 19 + m*3 - 6 + 43m - 17 - 16m = 0. 1, 3, 14 Let l be (40/(-180) + 32/63)/(15/105). Determine x so that -4/15 - 14/15x - 2/5xl = 0. -2, -1/3 Let w(s) be the second derivative of -s4/84 - 2s*3/21 - 2s*2/7 - s + 15. Solve w(r) = 0. -2 Let s(g) = -24g*5 - 14g*4 + 84g*3 + 60g*2. Let b(n) = -5n*5 - 3n*4 + 17n*3 + 12n*2. Let v(w) = -14b(w) + 3s(w). Suppose v(x) = 0. Calculate x. -2, -1, 0, 3 Let x(t) be the second derivative of -t6/120 + t5/80 + t4/16 - t3/24 - t2/4 - 4t - 97. Let x(w) = 0. What is w? -1, 1, 2 What is v in -25/2v2 - 25/2v + 15 - 5/2v4 + 25/2v3 = 0? -1, 1, 2, 3 Let y(w) be the third derivative of -w8/13440 - 13w4/24 + 42w2. Let u(l) be the second derivative of y(l). Suppose u(o) = 0. What is o? 0 Let r(k) be the second derivative of k8/560 - k*6/120 + 4k*3/3 + 10k. Let a(v) be the second derivative of r(v). Solve a(p) = 0 for p. -1, 0, 1 Let x(n) = 7202n4 + 1368n*3 - 528n*2 + 32n + 9. Let o(r) = 1801r4 + 342r*3 - 132r*2 + 8r + 2. Let t(d) = 9o(d) - 2x(d). Solve t(s) = 0 for s. -2/5, 0, 2/19 Let y(l) be the second derivative of -l*7/42 + 11l*6/10 - 363l*5/20 + 1331l4/12 - l + 2. Factor y(m). -m2(m - 11)3 Let p = 23 - 19. Let -3m*5 + 0m + 0m - 180m*3 + 144m*3 + 24m*2 + 18m*p = 0. What is m? 0, 2 Let a(h) be the second derivative of 0 - 1/6h*3 - 1/12h*4 + 0h2 + h. Determine u, given that a(u) = 0. -1, 0 Let y = 39 + -49. Let u(g) = -g3 - 8g2 + 19g - 7. Let j be u(y). Factor -2/7a5 + 0 + 0a*j + 2/7a - 4/7a2 + 4/7a*4. -2a(a - 1)3(a + 1)/7 Let i(a) be the second derivative of a6/45 + a5/6 + a*4/2 + 7a*3/9 + 2a*2/3 + a + 56. What is c in i(c) = 0? -2, -1 Let d = -12 + 8. Let g = 7 + d. Factor -z - 2z3 - 1 + z2 + 0z3 + 3z*g. (z - 1)(z + 1)2 Let x(r) be the third derivative of -r7/210 + 97r6/120 - 831r*5/20 + 6815r*4/24 - 2209r*3/3 + 237r*2. Suppose x(s) = 0. What is s? 1, 2, 47 Let b be ((-8)/2 + 7)9. Factor -118i - i4 - 6 + 97i - bi2 - 15i*3 - 2i*4. -3(i + 1)*3(i + 2) Let o(x) be the third derivative of 2x6/15 - 11x5/30 - x4/6 - 26x3/3 + 27x*2. Let h(y) be the first derivative of o(y). Factor h(q). 4(q - 1)(12q + 1) Let z = 1073957/80547 + 1/26849. Factor zx2 - 4/3x*5 + 20/3x*4 + 4/3 - 40/3x*3 - 20/3x. -4(x - 1)5/3 Let c(w) = w2 - 3w - 9. Let t be c(7). Let l = t + -16. Factor -45r4 + 10r*2 - 13r*2 + 24r*3 - lr*4. -3r*2(4r - 1)2 Find p such that 24/7p*4 - 3/7p*5 - 78/7p*2 - 39/7p*3 + 192/7p - 96/7 = 0. -2, 1, 4 Let q(p) be the third derivative of -p*2 + 0p + 1/108p5 + 0p*3 + 0 + 1/54p*4. Suppose q(i) = 0. What is i? -4/5, 0 Let l(x) be the first derivative of 0x*2 - 1/42x*6 - 1/7x*4 - 27 - 4/35x*5 + 0x*3 + 0x. Factor l(v). -v*3(v + 2)2/7 Let q(w) = -w3 - w + 1. Let z(i) = i*4 + 15i*3 + 33i*2 + 9i - 54. Let c(b) = -20q(b) - 5z(b). Factor c(u). -5(u - 1)(u + 2)(u + 5)2 Let k(d) be the third derivative of -d8/784 + 4d7/245 - d6/40 - 25d2 - 6. What is j in k(j) = 0? 0, 1, 7 Let y = 301 + -178. Factor -v4 - 5v*3 - y - 7v*2 - 124 - 3v + 247. -v(v + 1)2(v + 3) Factor 0 + 12/5v - 14/5v*2 + 4/5v*3. 2v(v - 2)(2v - 3)/5 Let 25/2i*4 + 0i + 0 - 1/2i5 - 143/2i*3 - 169/2i*2 = 0. What is i? -1, 0, 13 Factor -20/7k*2 + 30/7 - 38/7k. -2(2k + 5)(5k - 3)/7 Let q(p) be the third derivative of 10p2 + 0 - 7/6p*4 + 0p - 1/70p7 - 17/120p*6 - 4/3p*3 - 17/30p*5. Solve q(y) = 0 for y. -2, -1, -2/3 Let q(w) = -2w*3 + 4w*2 + w + 3. Let h be q(2). Suppose 10c - 15 = h. Factor 8/13 - 2/13sc - 6/13s. -2(s - 1)(s + 4)/13 Factor 6 + 63/2b2 + 5/2b*4 - 33/2b*3 - 47/2b. (b - 4)(b - 1)2(5b - 3)/2 Let d(m) = 17m*2 - 4553m + 519833. Let b(q) = -8q2 + 2277q - 259917. Let i(t) = 7b(t) + 3d(t). Factor i(g). -5(g - 228)2 Let u(q) = 5q*4 - 20q*3 - 50q*2 + 70q. Let l(x) = 2x3 - x2. Let f(s) = 5l(s) - u(s). What is g in f(g) = 0? -2, 0, 1, 7 Let n(b) = 3133b2 - 1151b - 47. Let l(t) = 1044t2 - 383t - 16. Let g(o) = 17l(o) - 6n(o). Factor g(a). -5(5a - 2)(42a + 1) Let n = -33 - -29. Let f be n - (9/(-5) - 3). Let -fy - 14/5y*4 + 6/5y*5 + 6/5y*2 + 0 + 6/5y*3 = 0. Calculate y. -2/3, 0, 1 Let 84d*3 + 2d*4 - 1255d*2 + 1495d*2 + 22 + 56 + 236d = 0. Calculate d. -39, -1 Let z be 17/(612/24) - 0. Suppose -8/9 - zj3 + 8/9j + 10/9j2 = 0. What is j? -1, 2/3, 2 Let i(o) = -25o*2 - 135o - 145. Let b(m) = -2m2 - 11m - 12. Let j(c) = -35b(c) + 3i(c). Factor j(t). -5(t + 1)(t + 3) Suppose 4/9g2 - 8/9g + 2/9g4 - 2/3 + 8/9g*3 = 0. Calculate g. -3, -1, 1 Suppose 4 = 3q - g, 3g + g = 5q - 9. Let x = q - -6. Determine h so that -h*4 - 7h*4 - xh*4 - 21h*2 + h + 5h + 27h3 + 3h*5 = 0. 0, 1, 2 Let j = 87 - 83. Let c(f) be the third derivative of 1/120f*5 + 0 + 0f*3 + 4f*2 - 1/96f*j - 1/480f*6 + 0f. Find d, given that c(d) = 0. 0, 1 Suppose n - 2y = 124 - 20, -4n + 466 = 2y. Let v = n + -1252/11. Find h such that -2/11h*2 - 4/11h - v = 0. -1 Let k(d) be the second derivative of -d8/2240 - d7/840 + d6/240 + d5/40 - d*4/4 - d. Let o(u) be the third derivative of k(u). Factor o(f). -3(f - 1)(f + 1)2 Let p(q) be the second derivative of q4/12 + 7q*3/3 + 51q*2/2 - 24q. Let k(u) = -2u2 - 28u - 103. Let w(v) = -2k(v) - 5p(v). Factor w(f). -(f + 7)2 Let b(f) be the first derivative of f5/25 - f4/20 - f3/5 + f*2/10 + 2f/5 - 151. Factor b(k). (k - 2)(k - 1)(k + 1)2/5 Let g(r) be the third derivative of -r6/160 + 3r5/40 - 30r*2. Factor g(i). -3i*2(i - 6)/4 Factor -9/2k4 - 16k - 97/4k3 - 1/4k*5 - 36k*2 + 0. -k(k + 1)*2(k + 8)2/4 Let z(t) be the second derivative of -t6/120 - 3t5/20 - 9t*4/8 - 8t*3/3 + 17t. Let k(w) be the second derivative of z(w). Find h such that k(h) = 0. -3 Let r(u) be the third derivative of 1 - 4/15u5 + 0u*3 + 1/6u*4 + 0u - 3u2. Factor r(z). -4z(4z - 1) Let v(j) be the third derivative of j6/300 + j5/150 - 2j4/15 - 4j*3/5 + 2j*2 - 10. Factor v(q). 2(q - 3)(q + 2)2/5 Let x(a) = -a4 + a3 - a - 1. Let j(v) = 2 + 3v + 0v - 9v*3 + 19v*2 - 21v*2 - 2v*4. Let b(y) = j(y) + 2x(y). Factor b(d). -d(d + 1)2(4d - 1) Let i(p) be the first derivative of 2p	{ "pile_set_name": "DM Mathematics" }
0m = 23m - g. Suppose -m = -6d + 2d. Is d a multiple of 13? False Let f = -80 - -76. Is -4(-1 - (-195)/f) a multiple of 9? False Suppose 39d - 850833 = 639878 + 498484. Is d a multiple of 102? False Suppose 3f - 704 = -3l + 20797, 35829 = 5f - l. Is f a multiple of 5? False Let i be ((-18)/2)/((-6)/4). Let v be 1/(6/16)i. Suppose 6p - p = 2j + 56, 4j + v = 2p. Does 8 divide p? False Let c(b) = 3b3 + 113b*2 + 115b - 28. Let o(r) = -r*3 - 38r*2 - 39r + 9. Let y(d) = 2c(d) + 7o(d). Is 12 a factor of y(-39)? False Suppose 109026 = -255a + 524676. Is a a multiple of 326? True Let z be (-9)/(-4)576/216. Suppose 0 = -7c - zc + 4797. Is c a multiple of 32? False Let o = -14536 + 18356. Does 15 divide o? False Let g(x) = -4x - 28. Let i be g(-8). Suppose -277 = iq - 325. Does 2 divide q? True Does 4 divide (-2 - -403) + -6 - (-1 - 2)? False Let o(u) = 14u + 27. Let f be o(-2). Does 12 divide (1/f)/((-5)/3180)? True Does 55 divide 4511/33 + 7080? True Suppose n - 835 = 4k + 9356, 2k = -5n + 51065. Is 11 a factor of n? False Suppose x - 497 = 3t, -3t + 2x = 126 + 373. Is (-4)/(t/(-602) + 10/(-35)) a multiple of 86? True Let y = -26187 - -40209. Does 82 divide y? True Is -983(-9)/((-54)/(-12)) a multiple of 21? False Suppose 323z = 365z - 107478. Is 5 a factor of z? False Let j(m) = -m3 + 6m*2 + 9m - 10. Let l be j(7). Let f be l/(-6) + 212/9. Suppose x = 5g - 4 + 2, -58 = -4x - fg. Is 13 a factor of x? True Suppose -5v + 5m = -30140, 353m + 12060 = 2v + 352m. Does 8 divide v? True Let i(f) be the second derivative of 3f*3 + 4f*2 + 2f - 29. Suppose 0 = -4h + 6 + 6. Is 7 a factor of i(h)? False Suppose 22 = 17g - 29. Let p be 823(35/(-10) + g). Let h = p + 285. Does 18 divide h? True Let d = -586 - -3128. Is d a multiple of 14? False Suppose 2f = 3h + 9351, 0 = 66f - 69f - 5h + 13998. Does 22 divide f? False Suppose 3m + 4p = -m + 5100, p = -2m + 2549. Does 49 divide m? True Suppose 2q - 628 = -4i - 2q, -4i + 5q + 601 = 0. Suppose 0n - 189 = 3n. Let g = n + i. Is g a multiple of 23? False Let b = -92 + 103. Let h be -6(93/(-33) - 2/b). Suppose 5l = h + 87. Is l a multiple of 3? True Suppose 5r = 4q + 18, -3r - 40q = -44q - 14. Suppose 4m + 91d - 587 = 92d, rd = 4m - 582. Is 4 a factor of m? True Let l be 4(178/8 - -2). Suppose -7d = -43 - l. Is 10 a factor of d? True Suppose 0 = -36g + 164024 - 6020. Does 57 divide g? True Suppose -8v + 4798 = -26224 - 8602. Does 25 divide v? False Let i(u) be the first derivative of -u3/3 - 7u*2 + 5u - 3. Let r be (-1 + 2)/((-2)/20). Is i(r) a multiple of 15? True Let r be (840/(-32))/(3/(-472)). Suppose 0i - r = 14i. Let d = 438 + i. Is d a multiple of 11? True Let p be (534 + 12/4)(-1)/(-3). Suppose -2x + 73 + p = 0. Is x a multiple of 21? True Let o(b) be the third derivative of -5b4/12 - 34b*2. Let d be o(0). Suppose d = 14q + 4q - 5112. Does 30 divide q? False Let u(a) be the third derivative of a6/120 - 23a*5/60 + 11a*4/8 - 14a*3/3 + 64a*2 - 2a. Is u(22) a multiple of 6? False Let f be -10(1 + 78/(-10)). Let l = 1417 - 1447. Let r = l + f. Is 38 a factor of r? True Let i(w) = -w3 - 40w*2 + 28w - 38. Let c = -361 + 320. Does 33 divide i(c)? True Let z = 850 + -848. Suppose 529 = d - s, 5d - 776 = zs + 1884. Is d a multiple of 34? False Suppose -12s + 7s = -20, 3a - 8989 = 5s. Is a a multiple of 11? True Let w(z) be the third derivative of -73z4/12 - 33z*3 - 147z*2. Is w(-8) a multiple of 9? False Let q be 21 - 23 - 57/1. Let a be (-18)/(-15)(-25)/(-10) - q. Let t = 20 + a. Does 41 divide t? True Suppose -2z = -5g - 21, 0 = 5g - 32z + 28z + 27. Let b(i) = 90i*2 + 13i + 35. Is 26 a factor of b(g)? True Suppose -220i - 1820200 + 3327413 + 3318267 = 0. Does 11 divide i? True Let h(l) = -15l*3 + 12l*2 + 11l - 6. Is h(-6) a multiple of 123? False Let r = -7 - -9. Suppose -5q = -rx - 0 - 14, 0 = -4q - x + 19. Suppose -20 = 5a, 2a - a = qj - 152. Does 37 divide j? True Suppose -52n - 54345 + 79213 = -134304. Is 15 a factor of n? False Suppose 1100 = -10z + 21z. Let j = z + 145. Does 49 divide j? True Let g(o) = o2 + 7o - 10. Let t(x) be the first derivative of -3x2 + 9x + 6. Let w be t(3). Does 3 divide g(w)? False Let f be -1 + 2 - ((-3)/(-3) - 2). Suppose -fh + t = -420, -t = -4h + 3h + 208. Is h a multiple of 27? False Let f be -5 + -51(10 - 12). Suppose -2o = -fr + 220 + 66, r - 4o = 68. Does 50 divide r? False Let q(g) = 15g2 - 4g*3 - g - 8g*3 - 31 + 13g*3. Is q(-9) a multiple of 16? True Let z(h) = 522h*2 + 39h - 8. Is z(-4) a multiple of 16? False Is 15 a factor of (-4)/6 + 4 + 389455/33? True Suppose -6s - 6489 = 15s. Let u = -200 - s. Is 33 a factor of u? False Suppose -43m - 29998 = -823219. Does 13 divide m? True Suppose 0 = -13s + 693 - 2266. Let p = s - -150. Does 2 divide p? False Suppose 2159 = 25d - 16d - 4n, 4d + 3n - 993 = 0. Is d a multiple of 9? True Is 85 a factor of (5/(-10))/((24/372608)/(-3))? False Let x(h) = -5h*3 - 3h*2 - 2h - 8. Let r be x(-3). Let v = r - 104. Is 8 a factor of 6/15 + (-1236)/(-10) - v? False Is 53 a factor of (-64)/(-96) - ((-26894)/6 + 4)? False Let h = 46612 + -30794. Is 129 a factor of h? False Let f = -39 + 39. Suppose 3d - 205 - 599 = f. Let i = -70 + d. Does 9 divide i? True Suppose -151f + 7568 = -129f. Is f even? True Let p(r) = r3 - 5r*2 - 12r - 4. Let q be p(7). Suppose 3z = 2w - 367, -5w + 955 = -5z + qz. Does 29 divide w? False Is 3 a factor of ((-4869)/5)/3505/(-303)? False Suppose 10c - 33994 = 53584 - 23828. Is c a multiple of 15? True Let u = -9 + 14. Let j = -6 + u. Does 24 divide (3 - 3) + j + 72? False Let n = -1890 - -2706. Does 16 divide n? True Let c = -3344 - -3797. Is 3 a factor of c? True Let y(w) = -w2 - 11w - 27. Let b be y(-6). Suppose -3o + 2o - 15 = -bf, -2f + 10 = -5o. Suppose o = 4i - 612 + 36. Is 36 a factor of i? True Let b = -1863 + 6087. Is b a multiple of 24? True Suppose 5k - 4f = 801, 5k + 6f - 3f = 773. Suppose 25m = 30m + 70. Let s = k - m. Is 18 a factor of s? False Does 53 divide (-3)/((-15)/(-10)) - -3 - (-131016)/8? False Suppose 3v - 81d - 7544 = -85d, 4v + 5d - 10059 = 0. Is 37 a factor of v? True Let b be ((-4)/86)/((-9)/204). Let s = 66 - b. Is 5 + -6 + s + 2 + 63 a multiple of 7? False Let n be (-8)/(-12)(-27)/(-2). Suppose 12d - 264 = nd. Is 4 a factor of d/3(-6)/(-4)? True Let a(o) = 52o - 19. Let y = 12 + -12. Suppose -l - 2w + 10 = y, -3w + 10 = -0l - l. Is a(l) a multiple of 32? False Let d be (-7934)/(-26) + (-3 - (-37)/13). Suppose x - s = d + 52, -2x = -4s - 714. Is x a multiple of 17? True Let u(k) = -506k - 666. Does 7 divide u(-5)? False Let f = 4029 + -1149. Suppose 0 = -27n - 5n + f. Is 9 a factor of n? True Let x(c) = -27c2 - c - 10. Let g be x(-3). Let f = g - -355. Is f a multiple of 21? True Let w = -42 - -59. Suppose -3k = -3a - 3, -2a + 3k = -2k + w. Suppose ai = 3n - 77, 3n - 3i - 2i - 82 = 0. Is 2 a factor of n? False Suppose 18b - 5o = 15b + 30223, 0 = 2b - 2o - 20158. Is b a multiple of 41? True Suppose -39q + 55910 + 353239 = 0. Does 13 divide q? True Let x(a) = 22a*3 - 4a*2 + 2a - 7. Let l be x(4). Suppose -7b + 2b + l = 0. Let w = b + -101. Does 42 divide w? True Suppose -9x + 2x + 56 = 0. Let f(c) = 4c2 + 11c - 28. Is f(x) a multiple of 36? False Let g(h) = h*2 + 10h + 21. Let b be g(-8). Suppose bd - 1134 = -119. Suppose 0 = -5r + 232 + d. Is 12 a factor of r? False Let u = -18 - -24. Suppose -uc + 395 + 883 = 0. Is c a multiple of 24? False Let u = 1449 - 254. Suppose -25z = -25420 + u. Is z a multiple of 51? True Suppose -62780 - 126413 = -31n. Is 11 a factor of (n/68)/(1 + (-6)/8)? False Let d be -3104/8-1. Let f be (248/(-12) - -3)/((-4)/(-12)). Let t = f + d. Is t a multiple of 21? False Let i(a) = 6a*2 + 40a + 21. Let g be i(-24). Let y = -1375 + g. Does 34 divide y? False Let z = 386 - 394. Is -3 - (184/(-6))/(z/(-180)) a multiple of 13? False Suppose 15 = 2y - a, -5y + 4a = -3y - 30. Suppose 5j - y = 0, -8i + 4i - 2j + 202 = 0. Is 44 a factor of i? False Suppose 36l - 31l = 3*a + 1789	{ "pile_set_name": "DM Mathematics" }
-8? -8 What is the closest to 2 in 0.1, -5, 0.3, -0.3, 272.6? 0.3 What is the nearest to 2 in 0.5, 1, -23, -2/11? 1 What is the closest to 16 in -0.4, 19.97, -2? 19.97 Which is the closest to 2/3? (a) 15 (b) 2/3 (c) 76209 b What is the nearest to -5.2 in 2/5, -0.2, 1, 2/91? -0.2 What is the closest to 0 in -1/10, -1, -2, -14, 0.5? -1/10 Which is the nearest to 1? (a) -0.1 (b) -10/7 (c) -2 (d) -0.03 (e) -0.0806 d What is the nearest to -0.12 in -2, 0, 2/23, 24, 0.03? 0 What is the closest to -2/5 in -0.5, -1.6, 1/2, -23, 0.7? -0.5 Which is the closest to 0.1? (a) 9 (b) 4 (c) -105 b Which is the nearest to 12.86? (a) 1/5 (b) 1/4 (c) 4 (d) 0.8 c Which is the closest to 1/19? (a) -1 (b) 3/2 (c) -13/5 a What is the closest to -945 in -48, 4, 1? -48 Which is the nearest to -83/18? (a) 4 (b) 0.3 (c) 1 (d) -1 d Which is the nearest to 1.8? (a) -0.3 (b) -261 (c) -0.1 (d) 0.5 d Which is the closest to 0.4? (a) 3/467 (b) -5 (c) -0.3 a What is the nearest to 0.008 in 0, 20, 1/7, -0.5? 0 What is the nearest to 0 in 4, 0, -8996, 0.4? 0 What is the closest to 419/28 in -7, 0, 0.2, 0.3, -0.2? 0.3 Which is the nearest to -87? (a) 2/3 (b) 0.9 (c) -0.3 c Which is the closest to -1? (a) -0.5 (b) -4.4 (c) -7 (d) 0 a Which is the nearest to -1/3? (a) 19 (b) -1/5 (c) -4 b What is the nearest to -13856 in -3/5, 1, 4? -3/5 Which is the nearest to -11? (a) 8 (b) -14 (c) -3 b What is the nearest to 0 in 2/23, 19/132, 2/15? 2/23 Which is the closest to -1? (a) -2.315 (b) 0.1 (c) -4 (d) 0.2 b Which is the closest to 108? (a) 0.02 (b) 2/3 (c) 0.4 (d) 0.01 (e) 5/2 e What is the nearest to -0.1 in -5/3, -9, 1/4, 256? 1/4 Which is the nearest to 3? (a) 3/8 (b) -1.4 (c) 1.9 (d) -2/15 c What is the closest to 14 in -0.008, -6/5, -0.4, 1/4, 4? 4 What is the closest to -820 in 19, 3, -5, 2? -5 Which is the nearest to 0.1? (a) -3/2 (b) -1/5 (c) 4 (d) 6 (e) -3029 b What is the nearest to 46 in 81/32, -0.3, -0.4? 81/32 What is the closest to -1.011 in -5, 1/3, -34, -3? 1/3 What is the closest to -1/2 in -4, 1806540, 2? 2 What is the closest to -1/120 in -2/5, 5, 0, -1? 0 What is the closest to -0.3 in 4.5, 143, -0.2, -3, -2/9? -2/9 What is the closest to -46 in 0.8, 2, -2, 0.5, -5? -5 Which is the closest to -6? (a) 44 (b) 0.2 (c) 7 (d) -1/9 d Which is the nearest to -76? (a) -2/3 (b) 7/17 (c) 6 (d) 3/4 a What is the closest to 1/4 in 0, 348, 0.3? 0.3 What is the closest to 0 in 0.4, 9/8, -1, -1/3, 2/95? 2/95 What is the closest to 74 in -62, 2, 1/6? 2 Which is the nearest to 0? (a) 0.44 (b) -0.5 (c) -7.5 a What is the nearest to 2/9 in -3/5, -23, 0.1? 0.1 What is the closest to -0.3 in -2, -37, -4, -0.01, 2/5? -0.01 Which is the closest to 0? (a) 5 (b) 12 (c) 20795 a Which is the nearest to -0.3? (a) -6/7 (b) 0.2 (c) 0 (d) -15 c What is the nearest to -32 in 4/5, -0.098, 0.1, -2/3, -4? -4 Which is the nearest to 0.7? (a) 90 (b) 0.3 (c) 4 (d) -2/9 b Which is the nearest to -0.1? (a) 23 (b) 0.5 (c) 4 (d) -0.3 (e) -5/6 d Which is the closest to -2/3? (a) 0.1 (b) -225 (c) 25 (d) 5 a What is the closest to -2 in -5, -67, 16? -5 What is the closest to 0 in 0, -2/15, -3, -4, -4/3? 0 Which is the nearest to -25? (a) -2/3 (b) 4 (c) -2 (d) 0.02 c Which is the nearest to -7/4? (a) -0.19 (b) -0.5 (c) 117 (d) 2 b Which is the closest to -6/5? (a) 413 (b) -0.4 (c) 13 b Which is the nearest to -2/11? (a) -1 (b) 3 (c) -4/9 (d) 6 c Which is the closest to 5? (a) 0.1 (b) 2/11 (c) -2.04 b Which is the nearest to 11? (a) -4 (b) -0.5 (c) -1 b What is the nearest to -2/5 in -2, 0.03, -0.3, 0.1? -0.3 Which is the nearest to 1/3? (a) -4/5 (b) -10 (c) -2 (d) 3 (e) -135 a What is the closest to 70 in 1, -3, 2/9? 1 Which is the closest to 1? (a) -3/5 (b) 18/11 (c) -8 b What is the closest to 9 in 0.5, 12, 146? 12 Which is the nearest to -15.58? (a) -37 (b) 3 (c) 0.2 c What is the closest to 188 in 0.4, -8, -5? 0.4 What is the nearest to 0.1 in 2/237, 4/7, -2/3, -0.095? 2/237 What is the nearest to 2/21 in -4/5, 2, -8046? -4/5 What is the nearest to 3 in 0.4, 734, -0.3, -4? 0.4 What is the nearest to 2/7 in 85, 5, 6? 5 What is the nearest to -0.2 in 4/37, 2, 0.5, -1, -13? 4/37 Which is the nearest to -3/110? (a) -12 (b) 3 (c) -2/3 (d) 2 c Which is the closest to 0.1? (a) 2/3 (b) -0.12 (c) 0.1 (d) 2/35 c What is the nearest to -5 in 0.5, -25/7, -2/17? -25/7 What is the nearest to 1 in -2, 6/7, -1020? 6/7 What is the closest to 0.1 in -3, 0.1, -127, -1/2, 0? 0.1 Which is the nearest to 2? (a) 4/7 (b) 6 (c) -5 a What is the closest to -27 in -2/5, 0.1, -24? -24 What is the nearest to 0 in -0.04, 4/9, -2, -3/17? -0.04 What is the closest to -197 in 0.4, 3/2, 0.3, -3? -3 Which is the nearest to -6? (a) 2 (b) -1.07 (c) 5/2 (d) 0.4 b What is the nearest to 0.2 in -0.2, 0.5, 79, 6/7? 0.5 Which is the nearest to -1? (a) 1/5 (b) 3 (c) 195 (d) -2 d What is the closest to 55 in 4, 8, -6/11, 1/5? 8 Which is the nearest to 3? (a) -4 (b) -2/301 (c) 9 (d) -5 b Which is the closest to -6.3? (a) 1/4 (b) 1 (c) -4/7 (d) 26 c Which is the closest to -1? (a) 11 (b) -1 (c) 2/13 (d) -1/7 (e) -5/171 b Which is the closest to 14? (a) -0.34 (b) -2 (c) 0.2 c Which is the nearest to -1? (a) -4/3 (b) -1876 (c) 2/11 a Which is the closest to -0.6? (a) -5/3 (b) -2/37 (c) -2/3 c What is the closest to 4 in -10, -1/5, 1, 5? 5 Which is the closest to 2/3? (a) 2/3 (b) -25 (c) 2 (d) -0.223 a Which is the nearest to 0.2? (a) -0.6 (b) 1648 (c) -18 a What is the nearest to 1/4 in 6, -5, 5, -96? 5 What is the nearest to 2/7 in 24/7, 0.09, 4, -27? 0.09 Which is the closest to 0.1? (a) -4 (b) 0.07 (c) 0.2 (d) -0.202 b Which is the closest to 2? (a) 59 (b) -15 (c) -24 b Which is the nearest to -45? (a) 4/15 (b) 0.02 (c) 3 (d) -2 d Which is the closest to -1? (a) 0.1 (b) 3 (c) 14 (d) 0 (e) 12/19 d What is the closest to 0.1 in 2/23, 11/3, -3/7, 5? 2/23 What is the closest to 1 in 2, -0.581, 2/17? 2/17 Which is the closest to 82.8? (a) 1 (b) -3/5 (c) 5 c Which is the nearest to -8? (a) 0.04 (b) -25 (c) 1 (d) 4 (e) 0 e Which is the nearest to -6? (a) -2/11 (b) 2/7 (c) 2/39 (d) 5 (e) -1/52 a Which is the closest to -1/4? (a) -377 (b) 1 (c) -4 (d) 0.3 (e) 2/13 e What is the closest to 0.31 in 5, 1/3, 1/14, -39? 1/3 What is the closest to -0.1 in -0.73, 0.4, 4/7, -14? 0.4 What is the nearest to -2/5 in 31.692, -1/5, -3/7? -3/7 Which is the nearest to -0.041? (a) 2 (b) 1/9 (c) -5/2 (d) 0.01 d Which is the closest to -7? (a) 0.08 (b) -0.5 (c) 0.5 (d) -0.1 b What is the closest to 1 in 1.4, -4, 38, -4/7? 1.4 What is the closest to -4/11 in -5, 0.4, -2/9, -0.22? -2/9 Which is the nearest to -4? (a) -4.71 (b) -3 (c) 0.3 (d) 5 a Which is the nearest to -2/493? (a) 21 (b) -2 (c) 0.3 c What is the nearest to 3 in -0.4, 4740, 0? 0 Which is the nearest to 0.1? (a) -3 (b) 0.106 (c) 2/31 b What is the closest to 0.36 in -0.4, -2, -488? -0.4 What is the closest to 0 in 21007, 4, -2? -2 What is the closest to -93 in -0.58, 1/4, 3? -0.58 Which is the nearest to 2? (a) 2/9 (b) 108 (c) 10/17 (d) 0.4 (e) 8 c Which is the closest to -0.1? (a) 11765 (b) 0.09 (c) 4 b Which is the nearest to 0.1? (a) 0 (b) 3/7 (c) 414 (d) 9 (e) 2/5 a What is the closest to 74 in 5, -1, 0.5, -0.4, 0.03? 5 What is the closest to -33/4 in 1/7, -5, -11, -9/5, -0.3? -11 What is the closest to -6/13 in -1/6, -71, 23? -1/6 Which is the nearest to -2? (a) 45 (b) 165 (c) 5 (d) -6 d Which is the closest to -2/7? (a) 42369 (b) 1/5 (c) 5 b What is the nearest to -0.1 in 2, 0.0528, 1? 0.0528 What is the nearest to 1/54 in 1, -2, 1/4? 1/4 Which is the nearest to 16/7? (a) -3/7 (b) 161 (c) -12 a What is the nearest to 3 in 1/24, 0.08, -5, -18? 0.08 Which is the closest to -2/15? (a) 0.02 (b) -1 (c) 3 (d) 52 a Which is the closest to 0? (a) 2 (b) 3 (c) -5366 a Which is the closest to 2/5? (a) -2/19 (b) 5 (c) 403 (d) 3 (e) 0.2 e What is the closest to -0.9 in 0, -38, 2/19? 0 What is the nearest to 1 in -906, -3/25, 5? -3/25 Which is the nearest to -2/3? (a) 517 (b) -6/7 (c) -4 b Which is the closest to 1875? (a) -1/3 (b) 0.2 (c) 15 (d) -3 c Which	{ "pile_set_name": "DM Mathematics" }
ded by 56? 42 Calculate the remainder when 258540 is divided by 1780. 440 What is the remainder when 11817785 is divided by 25803? 11 What is the remainder when 22711885 is divided by 7570627? 4 What is the remainder when 13152045 is divided by 13152031? 14 Calculate the remainder when 106704 is divided by 106509. 195 What is the remainder when 46620751 is divided by 282550? 1 What is the remainder when 95429193 is divided by 33? 24 Calculate the remainder when 147839 is divided by 309. 137 Calculate the remainder when 484247 is divided by 1625. 1622 Calculate the remainder when 2478938 is divided by 206578. 2 Calculate the remainder when 2656795 is divided by 331989. 883 What is the remainder when 19106929 is divided by 830736? 1 Calculate the remainder when 77395 is divided by 653. 341 Calculate the remainder when 22441598 is divided by 32. 30 Calculate the remainder when 189723 is divided by 11850. 123 What is the remainder when 1970204 is divided by 394038? 14 Calculate the remainder when 16836 is divided by 16790. 46 Calculate the remainder when 500653 is divided by 4814. 4811 What is the remainder when 291321329 is divided by 4515? 4499 Calculate the remainder when 551699 is divided by 1059. 1019 Calculate the remainder when 62479 is divided by 49. 4 What is the remainder when 1075072844 is divided by 1307? 1301 Calculate the remainder when 566474 is divided by 62409. 4793 What is the remainder when 1527316 is divided by 669? 658 Calculate the remainder when 22039866 is divided by 1807. 1694 What is the remainder when 174539 is divided by 18881? 4610 Calculate the remainder when 579808 is divided by 8653. 57 Calculate the remainder when 34883 is divided by 1102. 721 What is the remainder when 8313 is divided by 1214? 1029 What is the remainder when 381780 is divided by 53? 21 What is the remainder when 623119 is divided by 44? 35 Calculate the remainder when 30321 is divided by 15038. 245 Calculate the remainder when 12101469 is divided by 1728772. 65 Calculate the remainder when 560135 is divided by 37341. 20 Calculate the remainder when 3481477 is divided by 114. 31 What is the remainder when 2108105 is divided by 702? 701 Calculate the remainder when 127356702 is divided by 1202. 1196 Calculate the remainder when 40472 is divided by 662. 90 Calculate the remainder when 9184440 is divided by 15462. 12 Calculate the remainder when 50994 is divided by 50835. 159 What is the remainder when 7820429 is divided by 378? 365 What is the remainder when 5168102 is divided by 738266? 240 Calculate the remainder when 397919 is divided by 394. 373 What is the remainder when 33735514 is divided by 5096? 5090 Calculate the remainder when 32810 is divided by 15751. 1308 What is the remainder when 6426053 is divided by 637? 634 What is the remainder when 9992 is divided by 873? 389 Calculate the remainder when 2975135 is divided by 1664. 1567 Calculate the remainder when 5634887 is divided by 804981. 20 Calculate the remainder when 266153 is divided by 9175. 78 What is the remainder when 4570072 is divided by 56420? 52 What is the remainder when 43004805 is divided by 264? 261 Calculate the remainder when 34505170 is divided by 4058. 4054 Calculate the remainder when 602918 is divided by 71. 57 What is the remainder when 2201045 is divided by 2262? 119 What is the remainder when 7756438 is divided by 120? 118 Calculate the remainder when 111264 is divided by 55317. 630 What is the remainder when 2273589 is divided by 447? 147 Calculate the remainder when 230040 is divided by 107. 97 What is the remainder when 39673 is divided by 39614? 59 Calculate the remainder when 3700962 is divided by 772. 766 What is the remainder when 4172129 is divided by 563? 299 Calculate the remainder when 2176 is divided by 635. 271 What is the remainder when 194239 is divided by 1351? 1046 What is the remainder when 63688 is divided by 2387? 1626 Calculate the remainder when 114866 is divided by 16371. 269 Calculate the remainder when 416741 is divided by 4295. 126 Calculate the remainder when 15146970 is divided by 15146935. 35 What is the remainder when 10422168 is divided by 165431? 15 What is the remainder when 151178009 is divided by 172? 157 What is the remainder when 2254969 is divided by 45099? 19 What is the remainder when 78912 is divided by 39228? 456 Calculate the remainder when 284791 is divided by 1705. 56 What is the remainder when 3031478 is divided by 310? 298 Calculate the remainder when 45729050 is divided by 244. 34 Calculate the remainder when 168838 is divided by 2715. 508 Calculate the remainder when 577505 is divided by 174. 173 What is the remainder when 2184339 is divided by 14959? 325 What is the remainder when 45057212 is divided by 15019051? 59 Calculate the remainder when 127812125 is divided by 8437. 12 Calculate the remainder when 5044396 is divided by 13001. 8 Calculate the remainder when 104693 is divided by 30. 23 Calculate the remainder when 883418 is divided by 1686. 1640 Calculate the remainder when 9227734 is divided by 16. 6 What is the remainder when 17404456 is divided by 1434? 1432 Calculate the remainder when 231241 is divided by 32750. 1991 Calculate the remainder when 15121778 is divided by 1014. 1010 Calculate the remainder when 2931627 is divided by 386. 343 What is the remainder when 4100149 is divided by 4952? 4845 What is the remainder when 3461482 is divided by 32350? 32 What is the remainder when 582869 is divided by 4380? 329 What is the remainder when 1045738 is divided by 58? 56 What is the remainder when 99082237 is divided by 32? 29 What is the remainder when 478006 is divided by 51? 34 What is the remainder when 1488859 is divided by 16360? 99 What is the remainder when 104281 is divided by 47? 35 Calculate the remainder when 5560250 is divided by 30218. 138 What is the remainder when 7216064 is divided by 416? 128 What is the remainder when 166162 is divided by 41388? 610 Calculate the remainder when 459441 is divided by 459437. 4 Calculate the remainder when 404831 is divided by 5618. 335 Calculate the remainder when 5978464 is divided by 501. 31 What is the remainder when 143683 is divided by 61? 28 Calculate the remainder when 141549 is divided by 3709. 607 Calculate the remainder when 763888 is divided by 40114. 1722 Calculate the remainder when 366411 is divided by 211. 115 Calculate the remainder when 4147984 is divided by 3050. 3034 What is the remainder when 2751304 is divided by 377? 335 Calculate the remainder when 302036 is divided by 100660. 56 What is the remainder when 3505382 is divided by 20380? 22 What is the remainder when 241020 is divided by 29638? 3916 What is the remainder when 6602400 is divided by 943200? 0 Calculate the remainder when 9802356 is divided by 1006. 898 What is the remainder when 57632277 is divided by 58? 55 Calculate the remainder when 173752559 is divided by 60. 59 Calculate the remainder when 305499348 is divided by 34. 32 What is the remainder when 1260338 is divided by 3902? 3894 Calculate the remainder when 419724 is divided by 4034. 188 Calculate the remainder when 18121558 is divided by 214. 38 Calculate the remainder when 12128667 is divided by 14269. 17 What is the remainder when 343971 is divided by 1323? 1314 What is the remainder when 750596 is divided by 3459? 3452 Calculate the remainder when 196743 is divided by 1428. 1107 Calculate the remainder when 7557799 is divided by 9971. 9752 Calculate the remainder when 3966311 is divided by 93. 47 What is the remainder when 3407048 is divided by 15? 8 Calculate the remainder when 489832 is divided by 539. 420 Calculate the remainder when 2440001 is divided by 20. 1 What is the remainder when 4151206 is divided by 310? 306 Calculate the remainder when 152389535 is divided by 2198. 2195 What is the remainder when 317683 is divided by 1138? 181 Calculate the remainder when 36253008 is divided by 1697. 1694 What is the remainder when 443956 is divided by 110970? 76 What is the remainder when 30383158 is divided by 2262? 2236 What is the remainder when 49012 is divided by 16090? 742 Calculate the remainder when 732463 is divided by 45778. 15 Calculate the remainder when 31448 is divided by 449. 18 Calculate the remain	{ "pile_set_name": "DM Mathematics" }
w - 8. Let i be s(6). Suppose 0 = -5u + 4q - i, 4u + q = 3q - 8. What are the prime factors of 1/(u + 10/4)? 2 Let s = -29 - -43. List the prime factors of s. 2, 7 List the prime factors of 1/1-2 - 292/(-2). 2, 3 List the prime factors of (1 - 1 - 1)/(1/(-59)). 59 Suppose 69 = 3g - 3. Suppose -7o = -3o - g. What are the prime factors of o? 2, 3 Let w be (-19 + 1)(-16)/12. What are the prime factors of 1 + (w - (2 - 1))? 2, 3 Let o(v) be the third derivative of v6/120 - 2v*2. Let n(a) = -3a*3 - 4a*2 - 6a + 1. Let z(d) = -n(d) - 4o(d). List the prime factors of z(5). 2 Let z(a) = 2a*2 + 3a - 7. What are the prime factors of z(5)? 2, 29 Let p = -5 - -1. Let j = 7 + p. Suppose -2x + 30 = -js, -x - 3x + 76 = -2s. List the prime factors of x. 3, 7 Suppose -15 = -0v - 3v + 3u, -5v = 5u + 5. List the prime factors of 13/v - (-12)/8. 2 Let m = -61 - -88. Suppose -2z + m = z. Suppose 0 = -g + z + 3. List the prime factors of g. 2, 3 Suppose 0 = 7k - 12k + 350. List the prime factors of k. 2, 5, 7 Let f(y) = -y*3 + 7y2 + 8. Let z be f(7). Let k(u) = u2 + 4u + 2. Let h be k(-2). Let o = z + h. What are the prime factors of o? 2, 3 Let r = -8 - -19. What are the prime factors of r? 11 Let l(j) = 2j*3 - 9j*2 - 2j - 1. What are the prime factors of l(5)? 2, 7 Let a = 10 + -6. What are the prime factors of 10/4 + (-2)/a? 2 Let l = -1 - -9. Let m = 29 - l. What are the prime factors of m? 3, 7 Let q = 65 + -20. What are the prime factors of q? 3, 5 What are the prime factors of (-65)/1(-2)/2? 5, 13 Let l = 8 + -8. Let n be (-168)/7 + (l - -1). Let x = n + 38. List the prime factors of x. 3, 5 Suppose -2c = -0 - 12. Let g = c - -11. List the prime factors of g. 17 Let c be (-2)/5 + (-54)/15. Let s(z) be the third derivative of -z4/6 + z3/3 + 6z2. List the prime factors of s(c). 2, 3 Let o(x) = -x3 - 12x*2 - 2x + 8. Let w be o(-12). Suppose -3n - 4c + 93 = c, -n = 2c - w. List the prime factors of n. 2, 13 Let u be ((-1)/2)/(1/(-2)). Let d = 21 - u. List the prime factors of d. 2, 5 Let u(t) = 3t - 3. Let x(j) = -7j2 - 7j + 4. Let b(o) = 6o2 + 7o - 4. Let f(h) = 6b(h) + 5x(h). Let g be f(-8). List the prime factors of u(g). 3 Suppose y = -r - 32 - 57, 4y - 2r + 332 = 0. Let c = -36 - y. What are the prime factors of c? 7 Suppose -2u = 3u - 20. Suppose -uq = -2 - 10. What are the prime factors of (-3)/((-15)/4 + q)? 2 Suppose 5c - 44 = -a, 4c - 6c = -2a + 40. List the prime factors of a. 2, 3 Let d = 40 + 51. What are the prime factors of d/14 + (-3)/2? 5 Suppose 0 = -3i - 114 - 111. Let h = -44 - i. Let b = h + -17. What are the prime factors of b? 2, 7 Let h(s) = -s*3 - 8s*2 - 7s - 2. Let g(t) = t*3 - 6t*2 - 2t + 5. Let k be g(6). Let n be h(k). Let r = 0 - n. List the prime factors of r. 2 List the prime factors of ((-5 - 2) + 1)-1. 2, 3 Let q(t) = 51t*2. Let c be q(1). Suppose 4r = -3v + c, -r + 4v = -v + 16. What are the prime factors of r? 3 Suppose 5w = -0y + 2y, -3y + 3w + 9 = 0. Let k(s) = -4s*3 - 3s + 6s2 + ys*3 + 1 - 5s. What are the prime factors of k(-7)? 2 Let l(h) = -2h + 1. Let c be l(-1). Suppose -cx - 3 = -4p, -x = 3p - 4x. Suppose f = -3q - 4 + 29, -pq = -3f + 15. What are the prime factors of f? 2, 5 Suppose -5r + 0r = -3w - 262, 0 = -5r - 4w + 234. List the prime factors of r. 2, 5 Let o = -19 - -46. List the prime factors of o. 3 Let z = -26 - -14. Let q = z - -18. Suppose 2 = -b + q. List the prime factors of b. 2 Suppose -2w - 1 = -3, -2t - 4w = -112. What are the prime factors of t? 2, 3 Let l(c) = c*2 + 4c - 3. Let b be l(2). Let u = b + -3. What are the prime factors of u? 2, 3 Suppose 3u = r + r + 77, -20 = -u - 5r. Let g = u - 8. What are the prime factors of 1/(g/(-9) - -2)? 3 Suppose -2r = r - 4u, -r = -5u. Suppose r = g - 3t - 35, -3g = -7g + 2t + 110. Suppose -5x + g = -24. List the prime factors of x. 2, 5 Suppose 0 = 5j - 33 - 62. Let u = j - 14. What are the prime factors of u? 5 Let h(p) = p3 + 4p2 + p. Let y be h(-4). Let g(c) be the third derivative of -c5/60 - c4/6 + c3/2 + c*2. What are the prime factors of g(y)? 3 Let j(l) = 5l - 9. List the prime factors of j(9). 2, 3 Suppose 2m + 15 = 7m. Suppose -t + m = -2t, 3y = -2t - 72. Let s = 36 + y. List the prime factors of s. 2, 7 Let z = -3 + -1. Let d(h) = -5h - 6. Let s be d(z). Suppose s = -4x + 46. What are the prime factors of x? 2 Suppose -2k = k - 48. Let c be (-9)/3k/(-6). Let p = c + -4. List the prime factors of p. 2 Suppose 5r - 16 = -6. Let g(k) = 2k3 - 2k*2 + k - 1. List the prime factors of g(r). 3 Let g = 10 + -15. List the prime factors of 6/g(-120)/16. 3 Let d(h) = 5h2 + 2h. Let c be d(-2). Suppose -2f + 12 = -j, 40 = 5f + 4j - c. What are the prime factors of f? 2 Let k = -175 - -252. What are the prime factors of k? 7, 11 Suppose 3x + 4v + 14 = 0, 5v - 4v = -4x + 3. Suppose -5u = -3t + 22, 0u = -2u + x. List the prime factors of t. 3 List the prime factors of (-3)/5 + (-834)/(-15). 5, 11 Suppose 5s + 3u - 873 = 0, -4s - 5u - 365 + 1053 = 0. What are the prime factors of s? 3, 59 Suppose 2j = -5d - 3 + 19, 0 = -4d + j + 5. Suppose dv = -3x - v + 78, -2x = -4v - 22. List the prime factors of x. 3, 7 Let a = -621 + 973. List the prime factors of a. 2, 11 Let r = 51 - 31. List the prime factors of r. 2, 5 Suppose -34 + 128 = 2f. List the prime factors of f. 47 List the prime factors of (-4)/(48/(-321)) - 9/12. 2, 13 Suppose -3b = -4d - 8, 15 = 3b + 5d - 2. Suppose -3l = bp - 22, 2l + l + 2p = 14. What are the prime factors of 141/(4 - l)? 7 Let s = -9 + 24. Let u = s - 6. What are the prime factors of u? 3 Let o be 4 + 1(-1 + 0). Let v(m) = m + 12. Let c be v(-5). Let f = c - o. List the prime factors of f. 2 Let t(g) = -g*2 + 4g. Let y be t(4). Suppose -x = -1 - y. What are the prime factors of 5 + -2x + 2? 5 List the prime factors of 198/(-15)(-165)/6. 3, 11 Suppose 0b - b + 66 = 0. Let j = -6 - -7. Suppose -5q - j = -b. What are the prime factors of q? 13 Suppose 0r + w + 2 = -3r, -3r + 4w = 22. Let t be 0 + (r - (-71 - 1)). Suppose -6x + x + t = 0. What are the prime factors of x? 2, 7 Let q(i) = 7i*2 + i. Suppose 2p - 4 = -2j, 0 = 4p - 2p - 3j + 1. Let d be q(p). List the prime factors of 4/d(1 - -13). 7 List the prime factors of 81/3(-1 - -2). 3 Suppose y = -4z - 0y - 8, -5y + 8 = 4z. What are the prime factors of (-13)/(-2z/(-12))? 2, 13 Let d(y) = y - 7. Let x be d(11). Suppose -2w - 3p = -29, 0 = xw - 0p + 2p - 78. List the prime factors of w. 2, 11 Let g(p) = 6p + 8. List the prime factors of g(10). 2, 17 Let r(x) be the first derivative of x4/4 + 2x*3/3 - 5x*2/2 - 2x - 2. List the prime factors of r(-3). 2 Let l(g) = g*3 + 5g*2 + 3g + 6. Let y be l(-5). Let q = 13 + y. Suppose 6j - 4j + 4w - 24 = 0, 0 = -2w + q. List the prime factors of j. 2 Let p be (-4)/(-22) - (-332)/(-11). Let r = 42 + p. What are the prime factors of r? 2, 3 What are the prime factors of ((-3)/(-3) - 2/(-1))15? 3, 5 Let a(h) be the third derivative of -h6/120 + h5/12 + 3h4/8 - h3 + 3h2. List the prime factors of a(6). 2, 3 Let j(a) = a + 2. Let f be j(11). Let m = 28 - f. List the prime factors of m. 3, 5 Let j = -35 + 45. List the prime factors of j. 2, 5 Let x(q) = 5q + 17. Let n(i) = 11i + 34. Let c(p) = -6n(p) + 13x(p). List the prime factors of c(0). 17 Let p(z) = 4z*3 - 6z*2 - 4z + 1. What are the prime factors of p(3)? 43 Let w be 292/(-8)-1. Suppose -4c + 127 = w. What are the prime factors of c? 2, 13 Suppose 6n - 69 - 69 = 0. List the prime factors of n. 23 Let o be (6/(-4))/((-3)/64). Suppose -o = -5v + 8. What are the prime factors of v? 2 Suppose -3g + 3v = 2g - 45, 0 = -5v - 25. Let y = 13 - g. What are the prime factors of y? 7 Suppose 5h + 272 = 3d, -4d + 2h + 328 = 4h. List the prime factors of d. 2, 3, 7 Let s = -1 + 1. Suppose -4h - c + 14 = -sh, 0 = 5h + c - 17. List the prime factors of h. 3 Let f(v) = -6v. List the prime factors of f(-5). 2, 3, 5 Let s = 1 + 34. Let a = s + -14. List the prime factors of a. 3, 7 Suppose 50 + 12 = -2z + s, 5z + 145 = 5*s. What a	{ "pile_set_name": "DM Mathematics" }
nd s, given that -20s2 + 34s*2 - 12s*2 + 4s - 2s3 = 0. -1, 0, 2 Let h(t) be the third derivative of t5/160 - t4/16 + 3t*3/16 - 20t2. Determine x so that h(x) = 0. 1, 3 Let z(k) be the first derivative of -k6/24 + k5/10 - k4/16 - 3. Let z(j) = 0. What is j? 0, 1 Let q(s) be the first derivative of -s5/50 + s4/30 - s - 3. Let u(x) be the first derivative of q(x). Factor u(z). -2z2(z - 1)/5 Let s = 37 - 36. Let o be s42/4. Suppose 1/5x + 1/5x*o - 1/5 - 1/5x*3 = 0. Calculate x. -1, 1 Let x be -1 + 3 + -1 + 1. Solve -2j - 5j4 + 4j*2 + 2j*5 + xj*4 - 2j4 + j4 = 0. -1, 0, 1 Suppose 2o - 20 = -m, -o - 5m + 25 + 3 = 0. Let n = -5 + o. Factor -u5 + u2 - u - 5u2 + 0u*3 + 2u*4 + 2u*n + 2. -(u - 2)(u - 1)*2(u + 1)2 Let a(r) be the third derivative of r6/480 - r*5/240 + 8r*2. Let a(c) = 0. What is c? 0, 1 Let q be (6 + -7)/(3/(-4)). Let k(z) be the first derivative of -7/2z*4 + 32/9z*3 + 6/5z*5 + 2 + 0z - qz2. Factor k(f). 2f(f - 1)(3f - 2)2/3 Suppose -4/13t*2 + 2/13t*3 + 0 + 2/13t = 0. Calculate t. 0, 1 Let p(i) be the third derivative of i6/780 - i4/52 - 2i3/39 - 23i*2. What is t in p(t) = 0? -1, 2 Let x be 4/36 - 2/(-9). Solve 0 + 1/3l + xl2 = 0 for l. -1, 0 Let h(g) = g2 + 7g - 6. Let c be h(-8). Solve p + 1/2pc + 0 = 0 for p. -2, 0 Let a be 1/(((-35)/(-10))/7). Factor 24/7k - 50/7k4 - 8/7 - 60/7k*3 + 22/7k*a. -2(k + 1)*2(5k - 2)2/7 Factor -2x*2 - 1/2x*3 + 2x*4 + 1/2x*5 + 0 + 0x. x*2(x - 1)(x + 1)(x + 4)/2 Let s = -2 - -4. Let h be 0 + s + 28/(-16). Let -1/2f2 + 1/2f*3 + 1/4 - 1/4f*5 - hf + 1/4f4 = 0. What is f? -1, 1 What is c in c - 2c - 6 + 6 + c*2 = 0? 0, 1 Let d(g) be the second derivative of -2g5/15 - g4/18 + 4g3/9 + g2/3 - 8g. Factor d(q). -2(q - 1)(q + 1)(4q + 1)/3 Let t(m) = m3 - m2 + 1. Let v(j) = -j*2 + j + 1. Let k(u) = 4t(u) - 4v(u). Find c such that k(c) = 0. -1, 0, 1 Factor 2y*2 + 2y*2 - 4y + y - 5y2. -y(y + 3) Suppose -4i = -2i - s - 8, -2i = s. Let g = 2038/3 + -677. Let -1/3 + p3 - gp*i + 5/3p = 0. What is p? 1/3, 1 Let d(c) = c*3 - 11c*2 + 22c + 19. Let z be d(8). Determine b so that 6/5 + 6/5b2 - 12/5b*4 - 12/5b*z + 3b - 3/5b5 = 0. -2, -1, 1 Let l(m) be the second derivative of m5/150 - m4/45 + m3/45 + 2m. Factor l(f). 2f(f - 1)*2/15 Let r(f) = -f - 6. Let m be r(-9). Let k = m - 0. Factor n - 3n*3 - 2n3 - nk + 5n3. -n(n - 1)(n + 1) Suppose 0 = 5o - 0 + 15. Let z = o - -7. Solve 2/5d5 - 2/5d*z + 2/5d - 2/5 - 4/5d3 + 4/5d*2 = 0 for d. -1, 1 Let i be (-2)/44 - -2. Suppose -2v = -iv. Find j, given that v + 8/3j - 8j*2 - 4j*4 + 2/3j*5 + 26/3j3 = 0. 0, 1, 2 Let a(d) = d + 1. Let j(w) be the first derivative of w3 + 11w2/2 + 5w + 2. Let c(t) = -5a(t) + j(t). Factor c(x). 3x(x + 2) Let q(c) be the second derivative of -c6/15 - c5/10 + c4/2 + 5c*3/3 + 2c*2 - 8c. Suppose q(p) = 0. Calculate p. -1, 2 Suppose 2/7n2 + 0 + 0n = 0. Calculate n. 0 Let w(r) be the first derivative of r7/840 - r6/180 + r5/120 - r3 - 4. Let s(u) be the third derivative of w(u). Factor s(x). x(x - 1)2 Let w = -1/372 + 559/372. Factor -5/2j*2 + 9/2 - 1/2j*3 - wj. -(j - 1)(j + 3)2/2 Suppose 2 - 26 = -3l. Let g = -5 + l. Solve -13mg - 3/2m*5 + 7m*4 + 12m*2 + 1 - 11/2m = 0 for m. 2/3, 1 Let r(p) = 4p2 + 44p + 3. Let g be r(-11). Factor -12 + 6q - 3/2q*g + 3q*2. -3(q - 2)*2(q + 2)/2 Suppose -p = -5p - 8, -6 = -3a + 3p. Let 0u + a + 0u2 - 2/7u*3 = 0. Calculate u. 0 Let y be (2/(-4))/(-5 + (-203)/(-42)). Solve 1/3p*5 + 1/3p*y + 0p*2 + 0 + 0p + 2/3p4 = 0 for p. -1, 0 Suppose -2h = -c + 11, 3h - 19 = -5c - 3. Let u(f) be the third derivative of 0 - f*2 - 1/3f*3 + 0f + 0f4 + 1/30f*c. Let u(g) = 0. What is g? -1, 1 Let f = 10 - 6. Factor 2r*3 - 2r*3 - 5r*2 + 3r*f - 3r*5 + 2r*2 + 3r*3. -3r*2(r - 1)*2(r + 1) Let m(w) = w4 + w3 + w*2. Let g(s) = 7s*4 - 3s*3 + 11s*2 + 8s - 8. Let y(l) = g(l) - 5m(l). Determine d so that y(d) = 0. -1, 1, 2 Determine f, given that 5f + 3f - 3 - f2 + f5 - 5f3 - 1 + f4 = 0. -2, 1 Let y(h) be the first derivative of -h*3/9 - 5h*2/3 - 25h/3 + 16. Factor y(n). -(n + 5)*2/3 Let g be 3 + 17/(-15) + (-12)/(-90). Suppose -4/5a + 14/5ag + 8/5a*3 + 0 = 0. Calculate a. -2, 0, 1/4 Let j(c) be the third derivative of -2c7/105 - c6/6 - 3c5/5 - 7c*4/6 - 4c*3/3 - 7c*2. Suppose j(s) = 0. What is s? -2, -1 Suppose -h - 3 = -4h. Factor 2b + h - 12b*3 - 1 - 4b*2 + 14b*3. 2b(b - 1)2 Let u(z) = 7z*4 - 3z*3 - 11z*2 - 10z - 4. Let a(q) = -3q4 + q3 + 5q*2 + 5q + 2. Let v(l) = -10a(l) - 4u(l). Factor v(p). 2(p - 2)(p + 1)*3 Let h = -127 - -509/4. Let m(j) be the first derivative of 1 + 1/5j*5 + 0j - hj4 + 0j*2 + 0j3. Factor m(w). w3(w - 1) Let x(f) be the first derivative of 0f*3 + 1/30f*5 + 1/24f6 + f2 + 3 + 0f4 + 0f. Let q(m) be the second derivative of x(m). Factor q(a). a*2(5a + 2) Let m(q) = -3q*2 + q. Let h = -5 + 3. Let i(j) = 10j*2 - 3j. Let w = 3 + -10. Let t(p) = hi(p) + wm(p). Let t(s) = 0. Calculate s. 0, 1 Let c(k) be the first derivative of 2k5/5 + 3k*4/2 + 2k3 + k2 - 2. Let c(s) = 0. Calculate s. -1, 0 Let t(z) = 22z3 - 18z*2 - 72z - 24. Let v(q) = -7q3 + 6q*2 + 24q + 8. Let a(l) = -3t(l) - 8v(l). Find d such that a(d) = 0. -1, -2/5, 2 Let p(u) = 3u + 2. Let w be p(-1). Let h be w/4 + 91/28. What is z in 60/7z*2 - 50/7z*h + 16/7 + 72/7z = 0? -2/5, 2 Let s(d) be the third derivative of -d5/30 + d4/3 - 4d3/3 + 10d2. Determine h so that s(h) = 0. 2 Let p(j) = -j - 1. Let q be p(-3). Factor s3 - s*4 - 3s*q + 3s2. -s3(s - 1) Let l(b) be the third derivative of b10/16800 + b9/10080 - b5/60 - b2. Let g(m) be the third derivative of l(m). Factor g(v). 3v*3(3v + 2) Let c(s) be the first derivative of -1/10s*4 + 1/50s*5 + 2/15s*3 + 0s*2 + s + 1. Let f(o) be the first derivative of c(o). Factor f(t). 2t(t - 2)(t - 1)/5 Let l(y) be the second derivative of y7/5040 + y6/1440 - y5/120 - y4/6 - 5y. Let w(q) be the third derivative of l(q). Suppose w(o) = 0. What is o? -2, 1 Let w(q) be the first derivative of -q6/3 - 8. Factor w(v). -2v*5 Factor 1/5d*5 + 2/5d2 + d3 + 0d + 4/5d4 + 0. d2(d + 1)2(d + 2)/5 Factor -10u2 + 3u*2 + 10u*4 + 36u*3 - 8 + 41u*2. 2(u + 1)*2(u + 2)(5u - 2) Suppose 27x = -32x + 51x. Let 0y + 2/7y3 + 2/7y*4 + 0 + xy*2 = 0. What is y? -1, 0 Suppose -4x = x. Suppose 0b + 4b - 4 = x. Determine t, given that -b - 2t2 - 2 - 1 + 6t = 0. 1, 2 Let n(h) be the first derivative of -2h6/21 - 4h5/7 - h4 - 4h3/7 + 5. Determine i, given that n(i) = 0. -3, -1, 0 Let g be 6/18 - 2/(-3). Let d(n) be the first derivative of -g + 1/5n*2 - 2/15n*3 + 0n. Find v such that d(v) = 0. 0, 1 Let c(m) be the first derivative of m*4/6 + 8m*3/9 - 19m*2/3 + 28m/3 + 48. Factor c(a). 2(a - 2)(a - 1)(a + 7)/3 Let i be (0 - 9/3)/(-1). Find l such that -l2 - 7l + 10l - il = 0. 0 Let z(c) be the first derivative of c7/2520 - c5/360 + c*3/3 + 2. Let w(a) be the third derivative of z(a). Factor w(p). p(p - 1)(p + 1)/3 Let i = 1 + -5. Let m be (i/(-50))/((-10)/(-100)). Determine x so that m + 2/5x*2 + 6/5x = 0. -2, -1 Let u be 72/(-48) + (-19)/18 + 3. Factor -2/9d4 - 4/9d*3 + 2/9 + ud + 0d2. -2(d - 1)(d + 1)3/9 Let t(j) be the second derivative of -2j*6/75 + 4j5/25 - j4/3 + 4j3/15 + 3j. Let t(r) = 0. Calculate r. 0, 1, 2 Let w be 110/(-1540)1/((-2)/24). Factor 2/7 + 6/7q*2 + 2/7q*3 + wq. 2(q + 1)3/7 Let r = -12 + 16. Let o(q) be the second derivative of 0 - 1/6q*r - 1/2q*3 - 1/2q*2 + 2q. Factor o(g). -(g + 1)(2g + 1) Let j(b) be the first derivative of b*6/12 - 4b*5/5 + 11b*4/4 - 4b*3 + 9b*2/4 + 7. Determine w so that j(w) = 0. 0, 1, 3 Solve -9 - 14 + 8 - 12 - 18p - 3p2 = 0. -3 Let u be (-3)/(-21) + (-83)/(-7). Suppose 0 = -g - 5g + u. Find b such that 0 + 2b4 - 6/5b*5 + 4/5	{ "pile_set_name": "DM Mathematics" }
order. 2405, 4, 2, -4 Sort 0, -3, -19, -26, 10338, 4 in ascending order. -26, -19, -3, 0, 4, 10338 Sort -14, 1, 1430, -2, -40. -40, -14, -2, 1, 1430 Sort -1, -7, 101, 476, 2, 4. -7, -1, 2, 4, 101, 476 Put 603, 71, -1.51, 3, -0.5 in descending order. 603, 71, 3, -0.5, -1.51 Sort -185, -1, -80, -4, 1, 5 in increasing order. -185, -80, -4, -1, 1, 5 Sort 1, -3, -4, -17337, -1, 29. -17337, -4, -3, -1, 1, 29 Sort 0.5, -4/9, 14933/433. -4/9, 0.5, 14933/433 Sort 164, -4, 8, -1, -224, 0 in ascending order. -224, -4, -1, 0, 8, 164 Sort -34, -13/33, 114. -34, -13/33, 114 Sort 1, -4/3401, 4 in descending order. 4, 1, -4/3401 Sort -142918, -0.12, 3/4, 5, 2. -142918, -0.12, 3/4, 2, 5 Put 1, 2, -0.2, -2/1275, 12, 0.3 in decreasing order. 12, 2, 1, 0.3, -2/1275, -0.2 Put 1, 0, -549, 675 in descending order. 675, 1, 0, -549 Sort 2/29, 456, -427 in increasing order. -427, 2/29, 456 Put 0.4, 3, 210750, 7, -2 in increasing order. -2, 0.4, 3, 7, 210750 Sort -32, 4, -6, 3, 1, -5, 3131 in descending order. 3131, 4, 3, 1, -5, -6, -32 Sort -1, -27, -303, -3, 18 in descending order. 18, -1, -3, -27, -303 Put -76, 0.5, 1/131, 5/13 in descending order. 0.5, 5/13, 1/131, -76 Sort 507, 3, 6, -1, 40 in decreasing order. 507, 40, 6, 3, -1 Sort 15, -3, -0.0742, 1/4 in increasing order. -3, -0.0742, 1/4, 15 Put 151, 1, 208093 in descending order. 208093, 151, 1 Sort 0, -8598, 6, -60, -1, -5, 3 in ascending order. -8598, -60, -5, -1, 0, 3, 6 Put -82, 4281, -1712 in decreasing order. 4281, -82, -1712 Put 30373237, 3, 0 in increasing order. 0, 3, 30373237 Put 7, -417, -7298 in descending order. 7, -417, -7298 Put 5, 4, 10, -4, 88, -53 in decreasing order. 88, 10, 5, 4, -4, -53 Sort -5, -6, -9, -7, 0, -1 in ascending order. -9, -7, -6, -5, -1, 0 Put -3, 422, 2, 0, -3/5, 139/6 in decreasing order. 422, 139/6, 2, 0, -3/5, -3 Put -1, -3, -4, 12227487 in descending order. 12227487, -1, -3, -4 Sort -1.8, -1/1805, -70 in descending order. -1/1805, -1.8, -70 Sort -6, -67, 1478, -5 in ascending order. -67, -6, -5, 1478 Put 0, 3, -2, 5, 78416, -5 in increasing order. -5, -2, 0, 3, 5, 78416 Sort -3, 1.599, -9, 161 in increasing order. -9, -3, 1.599, 161 Sort 1/2, -3775/6, 3, 0.4, -0.5 in ascending order. -3775/6, -0.5, 0.4, 1/2, 3 Sort 15, -9, 1, -318, -12, 2. -318, -12, -9, 1, 2, 15 Put -4, 168, -80, 0, 598 in descending order. 598, 168, 0, -4, -80 Put 3, -4, 102, -7, -5, 97, 5 in descending order. 102, 97, 5, 3, -4, -5, -7 Put -484, -3, 1, 0, 21, -1, 15 in decreasing order. 21, 15, 1, 0, -1, -3, -484 Put 3, 1, 2, -11849033 in decreasing order. 3, 2, 1, -11849033 Put 11984, 0.4, 0, 2, -15 in increasing order. -15, 0, 0.4, 2, 11984 Put 65, 4, 910, 1 in descending order. 910, 65, 4, 1 Sort 185, -7, -6, -1/3, 3/2, -2 in decreasing order. 185, 3/2, -1/3, -2, -6, -7 Sort 4, -0.3, -9, -160/1283, 0.05 in increasing order. -9, -0.3, -160/1283, 0.05, 4 Sort 1, -23.5411, -0.03 in ascending order. -23.5411, -0.03, 1 Sort -1486621, 1/9, 3, -0.5, 0.3 in decreasing order. 3, 0.3, 1/9, -0.5, -1486621 Sort -3, -127, 3, -12, -21, -4. -127, -21, -12, -4, -3, 3 Put 12, -56840, -9, 3, 0, 4 in decreasing order. 12, 4, 3, 0, -9, -56840 Sort 9867, 2, -3, 8, -2, 1, 5 in decreasing order. 9867, 8, 5, 2, 1, -2, -3 Sort -168, -85927, 3, 2 in ascending order. -85927, -168, 2, 3 Put 0.97, 5/13, 2, 24 in descending order. 24, 2, 0.97, 5/13 Sort 2, -7, -2/9, -75/16016, 0, 5 in ascending order. -7, -2/9, -75/16016, 0, 2, 5 Put 4, 34, 3, -10579 in decreasing order. 34, 4, 3, -10579 Put 686, 1.27, 2/5, 4, 1/3, -0.1 in decreasing order. 686, 4, 1.27, 2/5, 1/3, -0.1 Put 2/3, -7/10, -9, 1, 169, 3 in increasing order. -9, -7/10, 2/3, 1, 3, 169 Sort -111, -696, 5, -1, -2, 1, -3 in decreasing order. 5, 1, -1, -2, -3, -111, -696 Put -4, -30, 43, 1719 in increasing order. -30, -4, 43, 1719 Sort -1/203255, 1/5, -2/11, 1/3, -2. -2, -2/11, -1/203255, 1/5, 1/3 Sort -95, -1, -42825, -3/2 in ascending order. -42825, -95, -3/2, -1 Put 8256, -2, 4, 2, -58 in descending order. 8256, 4, 2, -2, -58 Put -3, 619, 45, 12 in descending order. 619, 45, 12, -3 Put -2, 3, -5, 53, 17, 0, 1010 in increasing order. -5, -2, 0, 3, 17, 53, 1010 Sort -4, -7383.2, 48 in decreasing order. 48, -4, -7383.2 Sort -2, 2, 4/9, -6, 318, 1/2, -5 in ascending order. -6, -5, -2, 4/9, 1/2, 2, 318 Put -206, -1, 342873 in decreasing order. 342873, -1, -206 Put 1/100, 1, 0.7, -1, 2/877 in ascending order. -1, 2/877, 1/100, 0.7, 1 Sort 13, -1347, -3, -2, -20, -7. -1347, -20, -7, -3, -2, 13 Sort -2, 1707, 5, 6, -4, 0 in decreasing order. 1707, 6, 5, 0, -2, -4 Put -69/29, -2/7, 3, 1/2, 4/3 in ascending order. -69/29, -2/7, 1/2, 4/3, 3 Sort 55, -0.4, 546562.8, -3 in decreasing order. 546562.8, 55, -0.4, -3 Sort 121828, -3, 3, -4, -1, 0. -4, -3, -1, 0, 3, 121828 Sort -146, -31, -5, 5/2, -43. -146, -43, -31, -5, 5/2 Put -11, 9, -4, -3, -5, 115, 4 in descending order. 115, 9, 4, -3, -4, -5, -11 Put 4, -3, -87111, -5 in increasing order. -87111, -5, -3, 4 Sort -4, -5, 78, 8, -342. -342, -5, -4, 8, 78 Sort -3/7, 4, -413/95 in increasing order. -413/95, -3/7, 4 Put -3/2, -0.3, 0, 15026, -4 in increasing order. -4, -3/2, -0.3, 0, 15026 Put 1, 0.03, 0.5, 1/5, -4, -121 in decreasing order. 1, 0.5, 1/5, 0.03, -4, -121 Put 10, -4, -14, -14951 in descending order. 10, -4, -14, -14951 Put -10, 19, 76891, 0 in decreasing order. 76891, 19, 0, -10 Sort -2, -22, 1, 70, 35, 0, -3 in descending order. 70, 35, 1, 0, -2, -3, -22 Sort 5, 3, 988, -3, -2, -231, -31 in increasing order. -231, -31, -3, -2, 3, 5, 988 Put 142, 14, 2, -13 in decreasing order. 142, 14, 2, -13 Put -7, 0, -1, 170, 2, 258, -5 in increasing order. -7, -5, -1, 0, 2, 170, 258 Put -5, 40, -133, 5, -4, 0 in decreasing order. 40, 5, 0, -4, -5, -133 Sort -36, 118, -16, -254 in descending order. 118, -16, -36, -254 Sort -6, -5, -19, -7, -11, -2 in decreasing order. -2, -5, -6, -7, -11, -19 Put -14, 2, 528, -4, -3, -570 in increasing order. -570, -14, -4, -3, 2, 528 Sort -391/4, -0.419, -11 in decreasing order. -0.419, -11, -391/4 Put 5, -3, 889, -139 in ascending order. -139, -3, 5, 889 Put -48, 0, 6800 in increasing order. -48, 0, 6800 Put 29, 118, -0.1, -1/4, -0.19 in increasing order. -1/4, -0.19, -0.1, 29, 118 Sort -1169, -5, -4, 2, -1131, -1, 5 in ascending order. -1169, -1131, -5, -4, -1, 2, 5 Put 0.08, -19.127, -44/53 in increasing order. -19.127, -44/53, 0.08 Put -6, -53, -1, -2, -36, -5, -7 in decreasing order. -1, -2, -5, -6, -7, -36, -53 Put -4/5, 2, -76805, -1/4, 1/7 in decreasing order. 2, 1/7, -1/4, -4/5, -76805 Sort 0.2, 41/55, 7.27 in increasing order. 0.2, 41/55, 7.27 Put -6/7, 1158, -1.5, 0.3, -5 in descending order. 1158, 0.3, -6/7, -1.5, -5 Sort -19, 344, -1, 2, 0, 1 in decreasing order. 344, 2, 1, 0, -1, -19 Sort -3/55, 2, -290/41 in decreasing order. 2, -3/55, -290/41 Put -1, -2, -4, -100999, 4, 2, -34 in decreasing order. 4, 2, -1, -2, -4, -34, -100999 Put 13, 4, -2874, -3, -4, 1, 3 in decreasing order. 13, 4, 3, 1, -3, -4, -2874 Sort -12534, 5, 9995 in descending order. 9995, 5, -12534 Put -2285591, 0, -4/11 in descending order. 0, -4/11, -2285591 Put -4, -2, 15, 0, 1, 3, 3908 in ascending order. -4, -2, 0, 1, 3, 15, 3908 Put 56603, 1421, 1 in increasing order. 1, 1421, 56603 Sort -1/8, -2/19, 2/95987, 0 in decreasing order. 2/95987, 0, -2/19, -1/8 Put 0, 3382, -1, 14, -2, 1, 3 in increasing order. -2, -1, 0, 1, 3, 14, 3382 Sort 600, -970, 2, 0, -3 in decreasing order. 600, 2, 0, -3, -970 Sort -3/5, 4351, -27, -2/141. -27, -3/5, -2/141, 4351 Sort 128, 1, -9411 in decreasing order. 128, 1, -9411 Sort 0, 5, -464, -4, -1, 1 in decreasing order. 5, 1, 0, -1, -4, -464 Sort 2, -8.8, -9, 1145. -9, -8.8, 2, 1145 Put 5, 4, -2, 53293491 in ascending order. -2, 4, 5, 53293491 Sort 1, 1/2, 84, -26287 in ascending order. -26287, 1/2, 1, 84 Put 3, -5, 2, 84, -6, -165, -4 in decreasing order. 84, 3, 2, -4, -5, -6, -165 Put -4, -25, 25359 in descending order. 25359, -4, -25 Sort 360, -2, -24634 in decreasing order. 360, -2, -24634 Sort -44, -4, -7, 2, 1074 in ascending order. -44, -7, -4, 2, 1074 Sort -19, -4, 0, -2, -5, -40, 3 in decreasing order. 3, 0, -2, -4, -5, -19, -40 Sort -1/4, -656363, 8/15 in increasing order. -656363, -1/4, 8/15 Sort 2, 0, -2, 4, 9, -48050. -48050, -2, 0, 2, 4, 9 Sort -0.09, 91.17, 0.32 in d	{ "pile_set_name": "DM Mathematics" }
illilitres? 1250 Convert 9824.993km to nanometers. 9824993000000000 Convert 826742.3um to millimeters. 826.7423 Convert 7445.98 hours to seconds. 26805528 What is thirteen fifths of a hour in minutes? 156 Convert 83555.73 centuries to millennia. 8355.573 What is 92.32427 litres in millilitres? 92324.27 Convert 32640.2ns to microseconds. 32.6402 What is 18/5 of a litre in millilitres? 3600 How many grams are there in 57/2 of a kilogram? 28500 What is thirteen twelths of a decade in months? 130 How many meters are there in eighty-one quarters of a kilometer? 20250 How many millilitres are there in 0.6137563l? 613.7563 What is 367.77483s in days? 0.004256653125 How many millilitres are there in 22712.7 litres? 22712700 What is thirty-two fifths of a century in decades? 64 How many milligrams are there in nineteen quarters of a gram? 4750 What is 3/7 of a week in hours? 72 What is 90838.38 months in years? 7569.865 How many millimeters are there in 5/8 of a meter? 625 What is 74/5 of a micrometer in nanometers? 14800 How many centimeters are there in 3/25 of a kilometer? 12000 How many milliseconds are there in 14253.34s? 14253340 What is 3/10 of a gram in milligrams? 300 What is 38/7 of a week in minutes? 54720 What is 559.748 weeks in nanoseconds? 338535590400000000 What is 7/8 of a litre in millilitres? 875 How many milligrams are there in one quarter of a gram? 250 Convert 1642949.1 minutes to days. 1140.936875 How many millilitres are there in three tenths of a litre? 300 What is 19/4 of a minute in seconds? 285 How many nanometers are there in seventeen quarters of a micrometer? 4250 How many milligrams are there in three fifths of a gram? 600 Convert 68.27815 kilometers to meters. 68278.15 How many milliseconds are there in 783354.8 microseconds? 783.3548 What is 5.691192 kilometers in millimeters? 5691192 What is 92.64271l in millilitres? 92642.71 What is three fifths of a millennium in months? 7200 How many kilograms are there in 59011.03ug? 0.00005901103 Convert 66.4358 centuries to millennia. 6.64358 Convert 756540.4 micrometers to nanometers. 756540400 How many millilitres are there in 0.957436l? 957.436 Convert 8.53382ml to litres. 0.00853382 What is 3894.178 millennia in centuries? 38941.78 What is 790131.6 minutes in seconds? 47407896 What is 17/6 of a year in months? 34 How many millimeters are there in 13/5 of a centimeter? 26 What is five sixths of a millennium in months? 10000 Convert 596020.1ug to nanograms. 596020100 How many nanograms are there in 57/5 of a microgram? 11400 How many grams are there in fourty-nine quarters of a kilogram? 12250 What is 94.58475l in millilitres? 94584.75 How many months are there in twenty-nine sixths of a century? 5800 Convert 2782.548 nanometers to meters. 0.000002782548 How many centimeters are there in 6/25 of a kilometer? 24000 How many grams are there in 15/4 of a kilogram? 3750 How many minutes are there in twenty-five quarters of a hour? 375 How many micrograms are there in one twentieth of a gram? 50000 What is 6/5 of a litre in millilitres? 1200 How many years are there in fifteen quarters of a millennium? 3750 What is 0.5204092 millilitres in litres? 0.0005204092 How many micrograms are there in 12/25 of a milligram? 480 Convert 7857.112m to micrometers. 7857112000 What is 799.4391mm in nanometers? 799439100 How many decades are there in 1/10 of a millennium? 10 How many decades are there in 8.177749 millennia? 817.7749 Convert 858.2912ml to litres. 0.8582912 How many millilitres are there in 57/5 of a litre? 11400 What is three fifths of a kilometer in centimeters? 60000 How many years are there in 12/25 of a century? 48 What is twenty-one eighths of a centimeter in micrometers? 26250 Convert 530.5219ug to nanograms. 530521.9 What is 471.3192ms in minutes? 0.00785532 What is 0.0943873 years in centuries? 0.000943873 How many millilitres are there in 1/4 of a litre? 250 What is seventeen halves of a gram in milligrams? 8500 How many seconds are there in sixteen fifteenths of a day? 92160 Convert 341.6759 litres to millilitres. 341675.9 Convert 1385.327ns to seconds. 0.000001385327 What is 86.88um in meters? 0.00008688 Convert 1170.099 months to millennia. 0.09750825 Convert 3074.383kg to tonnes. 3.074383 What is 474516.4 centuries in millennia? 47451.64 How many millilitres are there in five eighths of a litre? 625 How many decades are there in 7081.292 millennia? 708129.2 How many decades are there in fourty-three halves of a millennium? 2150 Convert 39.29529 millennia to centuries. 392.9529 What is 6/5 of a microgram in nanograms? 1200 What is 240718.14 seconds in hours? 66.86615 How many seconds are there in 7/15 of a minute? 28 How many years are there in 17/2 of a decade? 85 What is 128465.25 seconds in minutes? 2141.0875 How many months are there in 7/2 of a millennium? 42000 How many years are there in 11/2 of a decade? 55 What is 27/5 of a millennium in months? 64800 Convert 53459.92cm to meters. 534.5992 How many millennia are there in 23234.454 months? 1.9362045 What is 19/4 of a litre in millilitres? 4750 Convert 73494.8nm to meters. 0.0000734948 How many kilograms are there in 96525.37 grams? 96.52537 How many millilitres are there in 3925.466 litres? 3925466 What is 97125.12t in micrograms? 97125120000000000 Convert 93493.85mg to micrograms. 93493850 Convert 443.8432 days to hours. 10652.2368 Convert 58.45578 years to months. 701.46936 How many millilitres are there in 0.8212014l? 821.2014 What is 9546.283 nanometers in micrometers? 9.546283 How many nanograms are there in 3/32 of a milligram? 93750 What is one fifth of a litre in millilitres? 200 What is 40541.79 decades in centuries? 4054.179 What is 3/25 of a kilogram in grams? 120 What is twenty-two ninths of a hour in seconds? 8800 How many millimeters are there in three eighths of a meter? 375 What is 782.5521 years in months? 9390.6252 What is 7/6 of a minute in seconds? 70 What is seven halves of a decade in years? 35 How many grams are there in five quarters of a kilogram? 1250 Convert 49.22247 decades to centuries. 4.922247 What is 38813.65 litres in millilitres? 38813650 How many months are there in 11/2 of a decade? 660 How many months are there in eleven tenths of a decade? 132 What is 6/5 of a litre in millilitres? 1200 How many micrometers are there in eighteen fifths of a centimeter? 36000 How many meters are there in 1/10 of a kilometer? 100 How many micrograms are there in 17/2 of a milligram? 8500 Convert 32627.4 minutes to nanoseconds. 1957644000000000 What is 0.0436835 kilograms in milligrams? 43683.5 What is three sevenths of a week in hours? 72 How many minutes are there in 2063300.4 nanoseconds? 0.00003438834 What is 7/8 of a milligram in micrograms? 875 What is 17/2 of a litre in millilitres? 8500 Convert 40.55044g to milligrams. 40550.44 What is twenty-one fifths of a litre in millilitres? 4200 What is 1506.4116 milliseconds in minutes? 0.02510686 What is 8.0966 tonnes in kilograms? 8096.6 Convert 0.2844841 nanoseconds to microseconds. 0.0002844841 What is 1/5 of a litre in millilitres? 200 How many millimeters are there in 0.4272164 meters? 427.2164 What is 2/7 of a week in hours? 48 What is 26/5 of a minute in seconds? 312 How many milliseconds are there in 1/4 of a second? 250 Convert 601170.3 millennia to months. 7214043600 How many litres are there in 0.5206909ml? 0.0005206909 What is twenty-nine halves of a micrometer in nanometers? 14500 How many millimeters are there in 859601.8 meters? 859601800 What is seven sixteenths of a week in minutes? 4410 What is twenty-six fifths of a meter in centimeters? 520 What is 734037.6m in nanometers? 734037600000000 What is fifty-four fifths of a decade in months? 1296 Convert 6882.61 centuries to months. 8259132 How many milligrams are there in twenty-seven fifths of a gram? 5400 How many kilometers are there in 42337.39 meters? 42.33739 How many months are there in thirteen fifths of a millennium? 31200 How many millilitres are there in one quarter of a litre? 250 What is 22.1337 milliseconds in hours? 0.00000614825 Convert 0.0507502ug to kilograms. 0.0000000000507502 How many hours are there in one quarter of a week? 42 Convert 870520.7mg to mic	{ "pile_set_name": "DM Mathematics" }
+ z) - 537z - 525z + 2 + 886z as jz + l and give j. -175 Rearrange -791 - 5s + 4s - 1166 - 119 - 42 to the form n + gs and give n. -2118 Rearrange (1108g + 1388g - 543g)(0 - g + 0g + 1)(0 - 6g + 0) to lg3 + yg*2 + ug + q and give y. -11718 Express (-5t3 - 89t*3 - 275t*2 + 91t*3)(3 - 3 + 4t) as pt*4 + ut + qt3 + dt*2 + x and give p. -12 Rearrange (-4k*2 + 6k*2 + 0k*2)(-2k2 + 1 - 1) + 296558 + k4 - 296558 + 9k*2 + 7k*3 to the form vk*4 + n + zk + lk3 + xk*2 and give z. 0 Rearrange -70b*2 - 32b*2 + 123b*2 - b to the form jb*2 + v + lb and give j. 21 Rearrange -6v + 3v + 342 - 170 + 356 + 153 to the form xv + t and give t. 681 Rearrange (3v - 4v - 4v)(2 + 3 - 3) - 2v + 20v + 6v + 0v - 5v + v to m + wv and give w. 10 Rearrange (-63w + 69 - 309w - 69 - 280w)(-82w*2 - 2w*2 - 31w*2) to rw*2 + dw + b + hw3 and give h. 74980 Express -7 - 12 + 126z + 38z + 19 as xz + s and give x. 164 Rearrange 2652y + 2 - 86y*3 + 84y*3 + 4y2 + y2 - 2657y to the form ly*3 + ry + s + by2 and give r. -5 Rearrange 3g*3 + 6g*4 - 2g - 111g4 + 56g*4 + 4g*2 - 135g*4 - 3g*2 to dg*2 + x + sg*3 + lg*4 + ig and give s. 3 Rearrange 2b3 + 67 + 229b - 68 - b*3 + 3b*2 to tb*2 + wb + ib3 + j and give i. 1 Express (-3 + 3 - 4v)(476v + 162v + 285v) - 6v2 + 2v*2 + 2v*2 + (-3v + 6v - 5v)(v + 1 - 1) in the form gv*2 + xv + k and give x. 0 Rearrange -362 - 64 - 775 - 20s - 599 + 15s to g + ts and give g. -1800 Rearrange (2 + 7 - 3)(8 + 6 - 4)(-2j - j + 2j + (-2 - 2j + 2)(4 - 6 + 0))(3 + 0 + 2) to the form q + hj and give h. 900 Rearrange -5 + 305v*3 + 114v*2 + 2v*4 - 58v*2 - 57v*2 - 385v + 384v to the form bv*2 + rv*3 + s + fv + cv4 and give b. -1 Rearrange -67y*4 + 109y + 131y4 + y2 - 65y*4 to the form my*3 + ky*2 + zy + s + py4 and give z. 109 Rearrange n + 4n - n - 9047n2 - 1 + 7764n*2 - 2n to the form jn2 + pn + a and give j. -1283 Rearrange -4k3 - 5k + 16k - 1 - 4k - 5k to ok*2 + q + lk*3 + nk and give l. -4 Rearrange -2o2 + 308 - 305 + 10o - 13o + 8o*4 to no*3 + lo + do2 + r + to*4 and give l. -3 Express -1189m*2 - 1282m*2 - 670m*2 in the form a + fm + rm2 and give r. -3141 Express (a + 0a + a)(-4 + 3a + 4) + (1536a2 - 3155a*2 + 1489a*2)(1 - 1 + 2) as ma + n + va*2 and give v. -254 Express -2v*2 + 4v - 12v2 + 3v - 11v + 12v*2 - 8 as iv + z + nv2 and give i. -4 Express (6h - 18h - 1 - 55h*2 + 14h)(16089 + 106h - 16089)(-h - h + h) in the form jh*4 + qh*2 + wh + g + zh3 and give z. -212 Express 3j + 2j - 74j*2 - 8j*3 + 31j*2 + 9j + 40j2 in the form mj*2 + q + lj*3 + oj and give m. -3 Express -979 + 536 + 447 - 5f + 3f*2 - 6f*3 as l + vf*3 + pf*2 + sf and give s. -5 Rearrange (-4i + 4i + 2i)(5i - 5i - i*2 + (32i + 25i + 38i)(-23 + 23 + 16i)) to the form ti2 + ri*3 + o + gi and give r. 3038 Express 50h2 - 683h + 220h + 238h + 233h in the form zh + xh2 + o and give x. 50 Express 1075t + 66509 - 66509 - 5 - 3t + 5 + (-2 - t + 2)(2 + 4 - 4) as jt + u and give j. 1070 Express (z - 2 + 2)(4z - 6z - z)(3477 - 5115 - 7639)(-5 + 3 + 3) as sz + d + rz*2 and give r. 27831 Express -44f - 7 - 441f3 + 46f + 114f3 in the form w + pf*2 + af + qf3 and give a. 2 Rearrange (1330 - 736 - 736)(0l + 4l - 2l) to v + sl and give s. -284 Rearrange -q - 595q3 - 3q - 80q2 + 294q*3 + 300q*3 to the form bq + i + yq3 + hq*2 and give h. -80 Express -395j + 198j - 2 + 213j + 200j - 3 in the form wj + x and give x. -5 Rearrange (-681y - 504y + 1483y)(2 + 0 + 0)(1 - 3 + 1)(-1 + 3 + 0) to ry + c and give r. -1192 Express -698r - 2277 + 2273 - 136r as u + qr and give q. -834 Express -1001 - 3400 - 17o + o + 17o in the form i + mo and give i. -4401 Rearrange -923 - y3 - 2y - 288 + 111 to h + xy2 + iy + qy3 and give q. -1 Express 76p*3 - 9 + 10558p - 10558p as cp + bp3 + w + jp2 and give w. -9 Rearrange -z2 + 21z3 - 2z + 2z3 + 7z*3 - 7 + 2z*4 + 0z - 14z3 to oz*4 + hz*3 + t + yz*2 + qz and give t. -7 Rearrange -25 - k*3 + 0k - 66k + 66k - 2k2 to u + tk*2 + yk*3 + dk and give u. -25 Rearrange 37452n - 2n*2 - 184 + 0n*2 - 37461n to gn2 + q + an and give q. -184 Rearrange 64528s2 - 63893s*2 + 5s - 3s to as + q + fs2 and give f. 635 Rearrange -10713z + 10722z + 5z*3 - 4z*3 - 2z*2 to the form lz*3 + f + hz*2 + bz and give h. -2 Rearrange (-v*2 - 2v*2 + 6v*2 + (2v - 2v - 2v)(0v + 4v - 3v))(4529 - 10533 - 12222 - 4452 + 2526) to pv + g + tv2 and give t. -20152 Express -4p*3 + 8p - 29p + 5p + 18p + 3p2 - 24 - p4 as fp + mp*2 + bp*4 + zp*3 + t and give m. 3 Express (0z*2 - 2z*2 + 4z*2)(4 - 4 - 4z2) + (-z3 + 3z*3 + 0z*3)(-569z - 994z - 703z) as lz*3 + jz*2 + kz*4 + w + fz and give k. -4540 Express -9n3 + 395n - 95n + 7n*3 - 146n + n*2 as x + yn*3 + vn*2 + ln and give l. 154 Express (-2z + 0 + 0)(-205z + 45 + 446z - 222z) in the form yz*2 + bz + d and give b. -90 Rearrange -2299429n3 - 4n*4 - 3n*2 + 6n*4 - 1 + 2299426n*3 to bn*3 + vn + d + fn4 + pn*2 and give p. -3 Rearrange 98 + 99 - 290 - n + 834n*2 + 2n*3 + 93 to the form hn + qn2 + in*3 + k and give q. 834 Express 0n*4 - 90n*2 + 1 - 2n*4 + 92n*2 - 24n + 2n + 11n*3 + 3n*3 as gn + u + jn4 + dn*2 + yn*3 and give u. 1 Express -253 - 157d*2 + 0d*2 + 133 + 127 + 19d*2 in the form ad*2 + ld + b and give b. 7 Rearrange 14862 - 14859 - 3u + 2u4 - u3 - 3u4 + 126u*2 to p + vu*3 + mu*4 + au + wu2 and give m. -1 Rearrange -122 - 5z - 80 - 277 - 76 + 3z to f + uz and give u. -2 Rearrange 97 + 42u3 + 727521u - 727521u to the form du*3 + hu*2 + o + zu and give d. 42 Rearrange 13x + 21 + 2x*2 - 10609x*3 - 2x*2 + 10613x*3 to yx*3 + wx*2 + h + vx and give w. 0 Express (i - 2i - i)(-371 + 36 - 591 - 171) as n + qi and give q. 2194 Rearrange 0t - t + 2t + (5 + 1 - 4)(3t - 2t + t) - 1444t - 1 + 809t - 5 to the form mt + b and give m. -630 Rearrange -87v + 214v - 127v - 2682v2 to the form iv*2 + t + dv and give i. -2682 Rearrange (-253t + 150t - 157t)(-16t - 64t + 8t) to the form dt + mt2 + j and give m. 18720 Express 11427d - 3114d + 14025d in the form gd + v and give g. 22338 Rearrange -5a - 143a3 - 129a*3 - 2a*2 + 3a + 56 + 271a3 to na + fa2 + y + sa*3 and give y. 56 Rearrange -5358 - 5262 + 10620 - 14619v*2 to the form xv*2 + sv + h and give x. -14619 Rearrange 4g - g2 + 238 + 14 + 3g - 7g to the form ug + w + ng2 and give w. 252 Rearrange 1 - 332j*2 - 3j - 337j2 + 671j*2 + 6j*3 - 3 to the form lj*2 + fj*3 + bj + m and give m. -2 Express (36 + 20 - 23)(1 + 3 + 2)(-13q - 8q + 2q) as dq + l and give d. -3762 Rearrange 36 + 96922z - 193861z + 96917z to nz + i and give i. 36 Rearrange (-3h3 - 7h*4 + 3h*3)(928 - 1771 + 1304) to the form ph2 + rh*4 + u + ch + th3 and give r. -3227 Rearrange 7939d - 12396d - 8667d to the form bd + n and give b. -13124 Express (60r + 444r + 212r - 2)(-3r + 3r + 3r) as lr + k + ar*2 and give a. 2148 Express 4o*3 - 2o*3 - 907 + 0o*3 + 56131o - 56131o as fo*2 + ho + s + wo3 and give w. 2 Express -2 + 231b + 1361b + 538b + 2 as a + wb and give w. 2130 Rearrange (-9 - 7r + 9)(3r + 6 - 6)(-17 + 17 - 13r)(-4 + 5 + 4) to gr*2 + u + mr*3 + sr and give m. 1365 Express 62z + 67z - 57z2 - 125z as tz2 + u + lz and give l. 4 Rearrange (-66 + 108 - 2a - 62)(-1 + 5 - 3)(-213 - 238 + 508) to the form x + fa and give x. -1140 Rearrange (a - 7a + 2a)(2 - 1 - 2)(116 - 590 + 210) to g + ia and give i. -1056 Express (1 - 6 + 3)(0z + 4z - z) + 892z - 54z + 431z as i + wz and give w. 1263 Rearrange (-6 - 14 + 12)(-2i*2 + 4i*2 + 5i*2) + (-257i + 257i + 30i*2)(-1 + 1 + 1) to the form pi2 + ki + d and g	{ "pile_set_name": "DM Mathematics" }
at is 2147b2 (base 12) in base 15? a5ebe 431052 (base 10) to base 13 12127b What is -189a (base 13) in base 9? -5034 -526a9 (base 12) to base 14 -2b597 -6644411 (base 7) to base 2 -11000111101011111100 Convert 1101011100111000001 (base 2) to base 8. 1534701 What is -5986710 (base 10) in base 7? -101612652 Convert -221132201 (base 4) to base 16. -297a1 What is -1b80d0 (base 15) in base 14? -26d845 -30332132 (base 4) to base 3 -2200220112 41c0e (base 15) to base 12 a0865 10111010011111011011 (base 2) to base 13 2098c0 -8827220 (base 9) to base 4 -102011302311 166111 (base 10) to base 16 288df What is 3a358 (base 12) in base 8? 234164 -5441464 (base 9) to base 7 -33553216 629372 (base 11) to base 7 11365542 -228385 (base 9) to base 14 -380c4 What is 827d2 (base 14) in base 13? b0126 What is 603453 (base 10) in base 12? 251279 What is -500474 (base 8) in base 7? -1252406 -2713347 (base 8) to base 5 -143301102 -200134333 (base 5) to base 11 -498192 Convert 1211110211 (base 3) to base 15. aa47 What is -202102111002011 (base 3) in base 8? -51320724 What is 1627348 (base 9) in base 16? dcc37 What is -410300110 (base 5) in base 14? -30d474 -32232150 (base 6) to base 4 -3220223202 Convert 11000111100111001 (base 2) to base 11. 6a870 What is 17274406 (base 8) in base 15? 548a38 Convert 3184366 (base 12) to base 2. 100011110010000011111110 Convert -11022212111012 (base 3) to base 10. -2300351 2a9c07 (base 16) to base 3 12020212112021 -2b341c (base 16) to base 7 -33031530 What is -bb7 (base 13) in base 8? -3731 What is -9a315 (base 14) in base 9? -628663 a162305 (base 11) to base 8 104424661 Convert -309b05 (base 14) to base 13. -455812 1013004 (base 5) to base 3 211210220 53781 (base 11) to base 3 10222011212 73a914 (base 11) to base 12 4921ba Convert 639cce (base 15) to base 4. 102011210102 -22022222200210 (base 3) to base 14 -833c21 Convert 670367 (base 10) to base 11. 418725 Convert 231505032 (base 6) to base 11. 246798a Convert a7a496 (base 11) to base 9. 3221763 Convert 222d1 (base 14) to base 10. 82895 -100100112010 (base 3) to base 7 -1364463 Convert 5cd3 (base 16) to base 10. 23763 Convert 473301 (base 10) to base 14. c46b3 6238a24 (base 11) to base 9 22636125 Convert -b045 (base 13) to base 8. -57240 What is 132211055 (base 6) in base 4? 22002003023 What is -1101110111100110 (base 2) in base 5? -3304211 What is 142143 (base 6) in base 11? a122 Convert -3601100 (base 7) to base 5. -104013211 Convert -a70879 (base 15) to base 14. -10ad35d 402565 (base 7) to base 2 10000101001101110 What is -30231301313 (base 4) in base 9? -6240308 a35617 (base 11) to base 14 3138a4 Convert -3265534 (base 9) to base 5. -422141433 Convert 1930306 (base 12) to base 4. 110023002312 -66610 (base 12) to base 8 -410754 Convert -1001212102 (base 3) to base 13. -976a What is 11120321012 (base 4) in base 15? 1cd888 -d607a (base 15) to base 3 -1021110201021 Convert 111200202 (base 3) to base 7. 41051 e1480 (base 16) to base 7 10562145 d040 (base 15) to base 9 66236 What is 3287276 (base 10) in base 3? 20012000021222 Convert 10000100010001111111 (base 2) to base 15. aa818 Convert 41ca53 (base 16) to base 14. 80341d Convert 422266 (base 7) to base 16. 11c9e What is -1d425 (base 15) in base 5? -11023220 Convert 1000111111001011001000 (base 2) to base 14. 4547d6 b5212 (base 12) to base 9 401135 What is 501088 (base 11) in base 5? 201303212 Convert 4103126 (base 8) to base 15. 165d2b What is 3051624 (base 7) in base 9? 616460 -455604 (base 7) to base 9 -133403 Convert -3f7634 (base 16) to base 4. -33313120310 What is -36556641 (base 8) in base 9? -16132400 What is -1381665 (base 9) in base 12? -309212 What is 92028 (base 10) in base 14? 25776 What is -14458c (base 15) in base 3? -1211121200120 -362702 (base 10) to base 6 -11435102 What is -11111100001001101 (base 2) in base 13? -469bb -46613454 (base 7) to base 2 -1111101010000101111101 What is -12a4891 (base 11) in base 15? -2e5945 What is -d22d (base 14) in base 10? -36105 What is -39b00 (base 12) in base 6? -1411200 308563 (base 11) to base 6 14333123 What is 2465125 (base 8) in base 3? 1021200022210 What is 2002101222120 (base 3) in base 6? 35444023 3356323 (base 8) to base 6 31250003 7440212 (base 9) to base 7 45565241 What is -21314343 (base 6) in base 4? -2122111113 232489 (base 13) to base 16 cb7ac -1004033111 (base 5) to base 12 -81392a 503170a (base 11) to base 14 127ac20 -100010000010101000 (base 2) to base 3 -21002021011 Convert 4240432420 (base 5) to base 15. bb33c5 -4232211 (base 5) to base 12 -3506b Convert 28c69 (base 14) to base 16. 18b6d -c863a (base 14) to base 12 -1b4238 Convert -157612 (base 9) to base 16. -17cae What is b8bba (base 12) in base 8? 733676 What is -7077a (base 15) in base 11? -223576 -245412513 (base 6) to base 13 -ca1b74 Convert -14500511 (base 6) to base 16. -7b71b -311541153 (base 6) to base 13 -1175478 What is 2041032440 (base 5) in base 9? 7866485 What is 1022123321 (base 4) in base 12? 128535 -312111320 (base 4) to base 12 -a8988 11a94 (base 13) to base 10 32569 Convert -3744520 (base 8) to base 11. -647324 -321c45 (base 14) to base 16 -19dee5 What is -201222020220120 (base 3) in base 11? -5a9a64a 245a00 (base 11) to base 12 168a17 -321334003 (base 5) to base 2 -101001010111011101111 Convert 2a531 (base 11) to base 13. 168a6 What is -334210 (base 8) in base 14? -2d156 Convert 202012320 (base 4) to base 3. 21002122020 43412210 (base 5) to base 3 200221101121 7b0628 (base 12) to base 8 7411200 24052440 (base 7) to base 5 1021134342 Convert -1251105 (base 10) to base 7. -13430352 -3814232 (base 9) to base 12 -84173b 312240324 (base 5) to base 7 13652123 What is -456294 (base 16) in base 14? -865216 What is 14430605 (base 7) in base 4? 11032030211 What is 2013012100 (base 4) in base 6? 15505504 What is 6a39463 (base 11) in base 12? 414bb23 -111301010 (base 4) to base 8 -256104 What is -1415011 (base 10) in base 9? -2586024 -5052032 (base 6) to base 11 -154525 What is -4d638 (base 14) in base 10? -190562 -146107 (base 9) to base 15 -1b8da -84f14 (base 16) to base 6 -15400552 What is 202501453 (base 6) in base 14? 66c757 Convert 22201010021112 (base 3) to base 14. 88679d What is -80863 (base 11) in base 3? -20000002111 What is -538298 (base 13) in base 6? -110002535 Convert 1357164 (base 8) to base 2. 1011101111001110100 Convert 271660 (base 10) to base 3. 111210122111 Convert -654 (base 7) to base 2. -101001101 -1f8bf (base 16) to base 11 -89099 2d6f7 (base 16) to base 3 100110021201 What is -2b1bb6 (base 13) in base 4? -10003001202 What is 5a10a36 (base 11) in base 5? 10140443310 What is -7ad3d (base 16) in base 11? -313a95 -20222020001 (base 3) to base 13 -4a5c0 12123311 (base 5) to base 7 653651 Convert -3b879 (base 13) to base 5. -12030202 What is 110110111111011001110 (base 2) in base 6? 102342142 What is -133311100012 (base 4) in base 11? -478a454 Convert b80744 (base 13) to base 10. 4313950 What is 22122121101 (base 3) in base 16? 2993b What is -101020311031 (base 4) in base 5? -2122230441 Convert -362df6 (base 16) to base 8. -15426766 223491 (base 11) to base 16 56e79 138999 (base 13) to base 5 110214244 49152c (base 15) to base 13 956034 -9148460 (base 10) to base 9 -18183285 Convert -2798640 (base 10) to base 9. -5235010 338c19 (base 13) to base 7 13235325 22436241 (base 8) to base 9 10134701 1132030031 (base 4) to base 16 5e30d Convert -6373c3 (base 14) to base 4. -30310311233 What is -1110111100110001101 (base 2) in base 5? -111133434 41a1b (base 13) to base 5 12240110 What is -144446 (base 7) in base 13? -c99b -381cc (base 16) to base 7 -1645035 -45a4a4 (base 15) to base 8 -14536765 Convert -100100010100111011011 (base 2) to base 9. -2213775 a4a87 (base 13) to base 6 10203143 -4122001 (base 5) to base 3 -10102002011 122220122112112 (base 3) to base 9 18818475 What is -a3c5 (base 15) in base 3? -1202110212 -2331a4 (base 12) to base 14 -10a044 What is 27a50 (base 16) in base 9? 266666 Convert -ade20 (base 15) to base 8. -2070531 What is 1a6aa (base 14) in base 10? 67182 What is -121120020022011 (base 3) in base 16? -86524f What is -21545 (base 11) in base 5? -2000032 -2925 (base 11) to base 7 -14005 -20506 (base 13) to base 9 -87464 Convert -2577830 (base 12) to base 9. -1478000	{ "pile_set_name": "DM Mathematics" }
990078.1 kilograms? 990.0781 How many nanograms are there in 0.2897664g? 289766400 Convert 0.1953597g to tonnes. 0.0000001953597 How many nanometers are there in 733595.2 millimeters? 733595200000 How many millilitres are there in 8.114394 litres? 8114.394 How many nanograms are there in 5/4 of a microgram? 1250 How many hours are there in 39.48867 weeks? 6634.09656 What is 856321.1ug in tonnes? 0.0000008563211 What is 16/9 of a hour in seconds? 6400 How many grams are there in 21/4 of a kilogram? 5250 Convert 5.500434 centuries to months. 6600.5208 What is 333.364 minutes in nanoseconds? 20001840000000 Convert 36072.78 micrometers to meters. 0.03607278 What is 79.2754 decades in months? 9513.048 What is 1/6 of a minute in seconds? 10 Convert 583.74027ms to hours. 0.000162150075 Convert 539.9828 hours to nanoseconds. 1943938080000000 How many microseconds are there in 73908.82 days? 6385722048000000 What is one sixteenth of a meter in micrometers? 62500 Convert 425174.2 tonnes to milligrams. 425174200000000 What is 1/10 of a millimeter in nanometers? 100000 What is 21/2 of a litre in millilitres? 10500 How many grams are there in seven quarters of a kilogram? 1750 What is seventy-six fifths of a decade in years? 152 How many micrograms are there in 3/32 of a gram? 93750 How many milligrams are there in fourty-three quarters of a gram? 10750 What is 719.5528 tonnes in nanograms? 719552800000000000 What is 58442.47 years in millennia? 58.44247 How many tonnes are there in 0.6610335mg? 0.0000000006610335 What is thirteen quarters of a litre in millilitres? 3250 How many milligrams are there in 15883.81 kilograms? 15883810000 What is twenty-five quarters of a kilometer in meters? 6250 What is 309.313us in seconds? 0.000309313 Convert 0.1871675 millilitres to litres. 0.0001871675 How many centimeters are there in 61552.99m? 6155299 Convert 91.53687 nanometers to kilometers. 0.00000000009153687 Convert 0.97668 years to decades. 0.097668 How many micrograms are there in 3/50 of a milligram? 60 How many milliseconds are there in fourty-five eighths of a second? 5625 How many millimeters are there in fourty-three halves of a meter? 21500 What is 9586.479 millennia in years? 9586479 What is 277430.85 microseconds in hours? 0.000077064125 Convert 65.71865 centuries to millennia. 6.571865 What is twenty-five halves of a microgram in nanograms? 12500 What is 11/8 of a week in hours? 231 Convert 9250.298km to meters. 9250298 What is 15/4 of a tonne in kilograms? 3750 What is one tenth of a micrometer in nanometers? 100 How many nanograms are there in six fifths of a microgram? 1200 How many millilitres are there in eleven quarters of a litre? 2750 Convert 402.6523m to nanometers. 402652300000 Convert 6.736672ml to litres. 0.006736672 How many decades are there in thirty-seven halves of a millennium? 1850 What is nine tenths of a decade in years? 9 How many tonnes are there in 467645.7kg? 467.6457 Convert 150868.1um to centimeters. 15.08681 Convert 515.9704 litres to millilitres. 515970.4 How many tonnes are there in 926380.7ug? 0.0000009263807 How many kilograms are there in seventy-five quarters of a tonne? 18750 Convert 99158.48 milligrams to micrograms. 99158480 How many grams are there in 7/4 of a kilogram? 1750 What is 25/8 of a decade in months? 375 Convert 4.732037ml to litres. 0.004732037 What is 48/5 of a minute in seconds? 576 What is 51/4 of a day in hours? 306 What is 2.357579ml in litres? 0.002357579 How many millennia are there in 5238.267 centuries? 523.8267 How many years are there in 3/10 of a decade? 3 Convert 272.613 nanograms to grams. 0.000000272613 How many millilitres are there in 1/10 of a litre? 100 What is 35553.36 centuries in millennia? 3555.336 How many grams are there in 0.2551538 kilograms? 255.1538 What is 17/10 of a litre in millilitres? 1700 How many nanometers are there in 27/5 of a micrometer? 5400 How many milligrams are there in 1121.769 grams? 1121769 How many litres are there in 292031.6ml? 292.0316 How many seconds are there in seventy-two fifths of a hour? 51840 Convert 5.257356nm to centimeters. 0.0000005257356 What is 9.1619s in nanoseconds? 9161900000 How many litres are there in 516.265 millilitres? 0.516265 How many milliseconds are there in 0.534882 hours? 1925575.2 Convert 869804.3cm to millimeters. 8698043 What is 0.4843713mg in kilograms? 0.0000004843713 What is 5/4 of a litre in millilitres? 1250 How many days are there in 3924790.2s? 45.4258125 What is 5085.874 millennia in decades? 508587.4 What is 3/32 of a tonne in grams? 93750 How many centimeters are there in 62078.16 millimeters? 6207.816 What is 8.381845mm in meters? 0.008381845 What is twenty-one fifths of a litre in millilitres? 4200 What is five sixths of a century in months? 1000 How many milligrams are there in 0.5385054ug? 0.0005385054 How many milliseconds are there in 478762.6 weeks? 289555620480000 What is 0.7809743 seconds in nanoseconds? 780974300 Convert 415291.9 micrometers to centimeters. 41.52919 How many minutes are there in 1/6 of a hour? 10 Convert 89.48748ug to tonnes. 0.00000000008948748 What is 30945.07 hours in minutes? 1856704.2 What is 77/5 of a decade in months? 1848 How many months are there in five quarters of a year? 15 How many litres are there in 50892.88ml? 50.89288 How many centimeters are there in one fifth of a kilometer? 20000 What is 3.777799 years in centuries? 0.03777799 How many milligrams are there in 0.8976215 kilograms? 897621.5 What is eleven halves of a millennium in centuries? 55 How many days are there in 4/7 of a week? 4 How many decades are there in 53/4 of a millennium? 1325 What is 1/4 of a litre in millilitres? 250 How many minutes are there in 0.2076143 days? 298.964592 Convert 2715.949km to meters. 2715949 How many tonnes are there in 32107.37 kilograms? 32.10737 What is three tenths of a milligram in micrograms? 300 What is three eighths of a litre in millilitres? 375 What is one quarter of a microgram in nanograms? 250 How many millimeters are there in 1/5 of a centimeter? 2 How many months are there in seven thirds of a millennium? 28000 How many months are there in 9/10 of a century? 1080 Convert 56.30995ml to litres. 0.05630995 Convert 30.57113 litres to millilitres. 30571.13 Convert 7.902623 seconds to nanoseconds. 7902623000 Convert 5096.931 centimeters to meters. 50.96931 What is 0.010213kg in tonnes? 0.000010213 What is 12638.991 months in millennia? 1.05324925 What is 8833.4cm in kilometers? 0.088334 What is 43.07501 millilitres in litres? 0.04307501 Convert 2879.457 hours to seconds. 10366045.2 What is seventy-five halves of a microgram in nanograms? 37500 How many months are there in 4/75 of a century? 64 How many months are there in seven quarters of a year? 21 How many years are there in 1.0515312 months? 0.0876276 What is 2.021125l in millilitres? 2021.125 Convert 7.224997cm to millimeters. 72.24997 How many minutes are there in 1/24 of a day? 60 What is 3.436076l in millilitres? 3436.076 What is 5815.795 weeks in microseconds? 3517392816000000 How many millilitres are there in 22.73421l? 22734.21 What is 3/10 of a decade in months? 36 What is twenty-three eighths of a microgram in nanograms? 2875 What is 25/4 of a meter in millimeters? 6250 Convert 6.080344 microseconds to nanoseconds. 6080.344 What is 7/4 of a centimeter in micrometers? 17500 What is 9.654495 centuries in years? 965.4495 How many litres are there in 24.6634ml? 0.0246634 Convert 8603.86 decades to months. 1032463.2 How many centimeters are there in 0.6432645 kilometers? 64326.45 What is 7/2 of a day in hours? 84 Convert 45501.95l to millilitres. 45501950 What is 29/2 of a millimeter in micrometers? 14500 What is seven thirds of a minute in seconds? 140 How many litres are there in 70186.26ml? 70.18626 Convert 563.4901 years to centuries. 5.634901 What is 492671.7 grams in nanograms? 492671700000000 How many micrograms are there in 15/4 of a milligram? 3750 What is 25800.85ml in litres? 25.80085 Convert 33.58937 litres to millilitres. 33589.37 What is 5/4 of a millisecond in microseconds? 1250 What is 85401.77ml in litres? 85.40177 What is 1/10 of a tonne in grams? 100000 How many decades are there in 670.736	{ "pile_set_name": "DM Mathematics" }
de 932151071? False Is 21 a factor of 1680166383? True Is 583 a factor of 788216? True Is 21 a factor of 87464835? False Is 18649668 a multiple of 3? True Is 4640 a factor of 275038998? False Does 11 divide 353761429? False Is 18 a factor of 385858206? True Does 147 divide 3895457370? True Does 18 divide 163561896? True Does 20 divide 30571100? True Is 450840480 a multiple of 460? True Is 3420909847 a multiple of 286? False Does 2270 divide 152058220? True Is 510 a factor of 195356418? False Is 3269820 a multiple of 3? True Does 1443 divide 61320906? False Is 31789289 a multiple of 161? True Is 5013348956 a multiple of 274? True Is 750 a factor of 2403713250? True Is 29 a factor of 47412448? True Is 22 a factor of 214340781? False Does 176 divide 491165136? True Is 370 a factor of 3086938490? True Is 611 a factor of 346738529? False Is 582306243 a multiple of 57? True Is 94 a factor of 10098376? False Is 2483 a factor of 308055878? True Does 292 divide 57292944? False Is 207 a factor of 41177282? False Is 29800964 a multiple of 652? True Does 131 divide 205329777? False Is 11400 a factor of 2460816501? False Is 28107764 a multiple of 2698? True Is 245 a factor of 221599743? False Is 3 a factor of 132625774? False Is 1188 a factor of 1210298738? False Does 2679 divide 144813345? True Is 36 a factor of 186653130? False Is 185978484 a multiple of 2862? True Is 12 a factor of 897057566? False Is 153186453 a multiple of 177? False Is 2441 a factor of 15509851? False Is 113 a factor of 46194604? False Is 55718635 a multiple of 3065? True Does 80 divide 55507040? True Does 24 divide 242942760? True Does 316 divide 785781304? False Is 36163503 a multiple of 27? True Is 667 a factor of 83502396? False Is 131264838 a multiple of 513? False Does 28 divide 102728612? True Is 35401094 a multiple of 302? False Is 14514780 a multiple of 49? True Does 18 divide 8172970470? True Is 144 a factor of 683645753? False Is 26 a factor of 336323988? True Is 1534 a factor of 40025703? False Is 781 a factor of 1255396582? True Does 6 divide 2175559? False Does 463 divide 665115262? False Is 101 a factor of 512467940? True Is 71894155 a multiple of 51? False Is 27074348 a multiple of 29? False Is 2165328 a multiple of 198? True Is 403 a factor of 130416442? True Is 125016960 a multiple of 690? True Does 2260 divide 16487168? False Is 243519367 a multiple of 28? False Is 4656133 a multiple of 19? False Does 1747 divide 288678361? False Is 42133399 a multiple of 338? False Is 58 a factor of 285451640? True Is 11885 a factor of 3596112551? False Is 3618 a factor of 3788585082? True Is 1934 a factor of 3450256? True Is 112 a factor of 902435184? True Is 2695148323 a multiple of 4751? False Does 1423 divide 5027459? True Does 328 divide 612549076? False Is 24189150 a multiple of 10? True Is 18702271 a multiple of 49? True Does 244 divide 1319134702? False Is 203152488 a multiple of 168? True Is 136 a factor of 149326896? False Is 6718592 a multiple of 64? True Is 140 a factor of 24066840? True Is 14402131 a multiple of 270? False Does 248 divide 674554296? True Does 329 divide 16435759? False Does 5269 divide 3459120? False Is 185774323 a multiple of 66? False Is 4 a factor of 1011205848? True Is 1580318 a multiple of 2? True Does 906 divide 544399092? True Is 801356159 a multiple of 3776? False Is 22 a factor of 86395827? False Does 611 divide 12248106? True Is 450 a factor of 12127556? False Is 6057304 a multiple of 9? False Is 89437573 a multiple of 92? False Is 10153194 a multiple of 3951? False Does 110 divide 8815243? False Does 7 divide 33460826? True Is 2052384089 a multiple of 34? False Is 8 a factor of 140983863? False Does 3602 divide 646133964? True Does 38 divide 141751628? True Is 766772369 a multiple of 11? True Is 344 a factor of 278034945? False Does 190 divide 565042140? True Is 4237062752 a multiple of 26? True Is 24 a factor of 1235904? True Is 1759 a factor of 61278264? False Does 2101 divide 131980618? True Does 743 divide 3313780? True Is 461552697 a multiple of 232? False Does 272 divide 185982448? True Does 16 divide 57645072? True Is 36068928 a multiple of 1344? True Does 623 divide 13665584? False Does 81 divide 607110331? False Is 1928662856 a multiple of 3541? False Is 136295152 a multiple of 41? True Is 1983 a factor of 61452204? False Is 199722808 a multiple of 1832? True Is 73777456 a multiple of 304? True Is 156 a factor of 269182368? True Is 914252 a multiple of 34? False Is 1584 a factor of 158504206? False Does 24 divide 17700168? True Does 1387 divide 133728992? True Does 63 divide 492883839? True Does 146 divide 476504872? True Does 451 divide 135454693? True Is 185 a factor of 3919190590? True Is 13 a factor of 374843404? True Does 185 divide 31866840? False Does 13 divide 1142944192? True Is 316315360 a multiple of 2104? True Is 1063 a factor of 27145831? True Is 1346766666 a multiple of 42? True Does 2102 divide 144233133? False Is 370653493 a multiple of 198? False Is 91 a factor of 629565391? True Is 7 a factor of 191214658? False Does 60 divide 15462900? True Is 1965064912 a multiple of 43? True Does 1320 divide 224329059? False Is 8 a factor of 59201640? True Is 111 a factor of 110719275? False Does 193 divide 65731460? False Does 8 divide 16295664? True Does 16 divide 138238337? False Is 132199546 a multiple of 15? False Is 602686288 a multiple of 16? True Is 353 a factor of 52988830? True Does 7 divide 2441581? False Does 451 divide 1278990392? False Does 2453 divide 27726259? True Is 60 a factor of 277555444? False Does 413 divide 55546043? False Is 148 a factor of 46896760? True Does 175 divide 22596000? True Is 2 a factor of 9588324? True Is 191 a factor of 55857387? False Is 127073653 a multiple of 196? False Does 5 divide 12229874? False Is 77359298 a multiple of 1102? True Is 447669026 a multiple of 9712? False Is 144219690 a multiple of 1026? True Is 113 a factor of 109304212? False Does 5 divide 11793503? False Is 4333 a factor of 682139857? True Is 138 a factor of 70278432? True Is 177 a factor of 253580438? False Is 16583736 a multiple of 598? True Is 4068531 a multiple of 43? True Does 3 divide 9452729? False Is 29 a factor of 62358048? False Does 7 divide 20596528? False Does 85 divide 114860937? False Is 115 a factor of 1252235? True Is 360107527 a multiple of 1633? True Is 30 a factor of 127718280? True Does 5410 divide 868295670? False Does 2 divide 114919387? False Does 207 divide 593376823? False Is 280569251 a multiple of 36? False Is 828 a factor of 63116784? True Is 5065324 a multiple of 836? True Is 147 a factor of 1113480721? False Is 512886528 a multiple of 192? True Is 12 a factor of 21730788? True Is 102609104 a multiple of 208? True Is 534 a factor of 6472804? False Does 19 divide 11737554? True Is 1184487024 a multiple of 168? True Does 83 divide 536422609? True Is 6 a factor of 4664106? True Is 22045198 a multiple of 1719? False Is 3538525645 a multiple of 5105? True Is 1059528672 a multiple of 46? True Does 13 divide 293868913? True Does 325 divide 21904675? True Is 4285 a factor of 1892924460? True Does 113 divide 43124190? True Is 785 a factor of 45189310? True Is 7723505 a multiple of 353? False Does 247 divide 39172318? False Does 29 divide 199431931? False Is 11 a factor of 6928405? True Does 3 divide 42367387? False Is 3295 a factor of 3537234105? False Is 24 a factor of 6873984? True Is 625 a factor of 701800? False Is 2364 a factor of 120479694? False Does 69 divide 11595124? False Is 1353 a factor of 52180311? False Is 42 a factor of 3650890469? False Is 61908 a multiple of 924? True Is 958713942 a multiple of 398? True Is 2941 a factor of 1162015569? True Is 4 a factor of 1986697? False Is 17 a factor of 11342611? False Is 80 a factor of 55615615? False Is 10231764 a multiple of 172? True Does 14 divide 1925385? False Is 14 a factor of 52954072? False Is 2826565 a multiple of 2905? True Is 25 a factor of 153719885? False Does 40 divide 38312240? True Is 271 a factor of 26345920? False Is 445 a factor of 920572985? False Does 47 divide 24865773? True Is 74071530 a multiple of 14? False Is 55 a factor of 5592019? False Is 4 a factor of 63257853? False Is 13 a factor of 671432034? True Is	{ "pile_set_name": "DM Mathematics" }
*2 + 3h2) + h3 + 0h3 - 4h*3. -9h*3 Expand -143 + 143 + 90t + (-1 + 2 - 2)(-3t + t + 3t). 89t Expand ((-2 + 2 - 2)(-3 - 3 + 5) - 26 + 9 + 10)(s - 4s + 4s). -5s Expand (5k - 9 + 9)(-1 - 2 + k + 1). 5k*2 - 10k Expand (0l2 - 2l*2 + 0l2 + l + l2 - l + 2l2 + 3l - 3l + (2l - 2 + 2)(1 - 1 + 2l) + (-3l + 5l - l)(-3l + 4l + 0l))(3l - 4l + 3l). 12l3 Expand (1 + 2 - 1)(0 - 4 - 18)(-4 + 4 + 2)(1 - 2 + 0)(c5 + 0c5 + c5). 176c5 Expand (-68 + 68 + 2l)(0l + 3l - 5l). -4l2 Expand (4 + 0 - 3)(1 + 3 - 3)(-5b + 5b + 5b*2). 5b*2 Expand (-1 + 2j + 1)(0j4 + j4 + j*4) + 26j*5 + 11j*5 - 26j*5. 15j*5 Expand (-36 - 12v + 36)(-5v + 4v - v) - 2v*2 + 0v*2 + 4v*2 + v. 26v*2 + v Expand (-1 - a + 1)(-2a - 3a + 3a)(0a2 - 3a*2 + 9a*2). 12a*4 Expand (-5d*2 + 2d + d*2 + 3d*2)(-d*2 - 4d + 4d). d4 - 2d*3 Expand (-2d2 + d2 - 2d2)(0 + 0 - 3)(-d + d + 2d). 18d3 Expand -w2 + 0 + 0 + (8w - 14w - 26w)(0w + 0w - 2w) + (-w + 6w - 4w)(-2w - 1 + 1) + 1 - 1 - w*2. 60w*2 Expand (-1 + 1 - g)(-3 - 2 + 0) - 4g - 10 + 10. g Expand -w4 + 4w4 - w4 + (2w4 - 5w*4 + 2w*4)(0 + 0 + 1). w*4 Expand (2f*4 + 0f4 - f4)(-4f + 0 + 0) + 2f5 - 5f*4 + 5f*4 + (f + 2 - 2)(3 - 2f4 - 3). -4f*5 Expand 2v - 4v + 3v + (v + 6v - 3v)(-5 + 4 + 0). -3v Expand d*5 + 2d*5 - 5d5 - d2 - 3d5 + d2 + (1 + 2d - 1)(-d4 + 3d*4 - 3d4) + d5 - d2 + d2 - 6d3 + 6d*3 + 3d*5. -3d*5 Expand (i + i - 3i)(-1 + 1 - 2i) + 16i2 + 1 - 16i*2 + 4i*2. 6i2 + 1 Expand (b2 - b2 - b2)(b3 + 33 + b3 - 19). -2b*5 - 14b*2 Expand (56n*2 - 14n*2 + 50n*2)(-n + 2n - 2n). -92n3 Expand (4 + 0 - 2m - 6)(1 + 0 - 2). 2m + 2 Expand (4p3 + 5p*3 - 6p*3)(-2 - 3p + 2). -9p*4 Expand (35y - 35y - 4y*3)(-5 + 6 + 1) + 2y3 + 0y3 - y3. -7y3 Expand (-52t*3 + 2t*4 + 52t*3)(-4 - 1 - 5). -20t4 Expand (4r*2 - 4r2 + r2)(-2r*2 + 4r*2 + 0r*2) + 9r - 2r4 - 12r + r4. r4 - 3r Expand (0h4 - h4 - 2h4)(8h - 2h + 0h). -18h*5 Expand 2a*3 + 2a*3 - 6a3 + (a2 + 4a - 4a)(2210 - 57a - 2210). -59a3 Expand -10i5 - 17 + 17 + i5 - 3i5 + 0i5 + (-i + i3 + i)(-3i*2 + 2i*2 + 0i2) - i5 + 4i5 - i5. -11i*5 Expand (5 - 5 - 1 - 1 + 1 - 2 + (0 - 2 + 1)(-1 - 1 + 4) + 3 + 1 - 1)(-2 + 3 + 0)(4p5 - 16p*4 + 16p*4). -8p*5 Expand ((4v - v - v)(4v - 2v + 0v) - 3v2 + 13 - 13 + v2 - 3v*2 + 3v*2)(2 - 2 - v*2). -2v*4 Expand (3g - g + 2g)(-g + 0 + 0)(2 - 2 + 1). -4g*2 Expand 3n*4 - 2n*4 + 2n*4 + 2n*4 - 3n*4 + 3n*4 + (3n*2 - 2n*2 + 0n*2)(-n2 + n2 + 3n2). 8n*4 Expand (-2t + 4t - 4t)(-2t*2 + 2t2 + t4). -2t5 Expand (1 - 1 + 2c*2)(5c - 3c - 4c) + (-2c*2 + 8c*2 - 2c*2)(-1 + 2c + 1). 4c*3 Expand (-12n*3 - 14n*3 + 8n*3 + (0n + 2n - n)(1 - 2n2 - 1))(2 - 3 + 2). -20n3 Expand (0 + 0 - 3)(2s2 + 1 - 1) - 2 - s2 - s - 5 + 3. -7s*2 - s - 4 Expand (-5 + 2 + 2f - 4f)(5 + 1 - 4). -4f - 6 Expand (8a*3 + 0a*3 - 4a*3)(4a + 0a - 5a) - 2a*4 + 0a*4 + 3a*4. -3a*4 Expand (61k + 87k - 247k)(2k - 1 + 1). -198k2 Expand (z - 3z + 3z)(-3 + 2z + 3)(-6 + 6 - 4z). -8z*3 Expand 3j - 3j + j2 + j3 - j3 + 4j*3 - 2j*3 + (-2j*2 + 5j*2 - 5j*2)(2j + 0j - 3j) - j3 - j + j. 3j3 + j2 Expand m*5 - 4m5 + m5 + (0m + 2m - m)(-2m + 2m - 4m*4). -6m*5 Expand (2f + 1 - 1)(3 - 4 - 2)(4 - 3 + 2 + (3 - 2 + 1)(0 - 2 + 0) - 5 + 1 + 2). 18f Expand (3 - 3 - 2s2)(5 - 5 - 4s3) + 4s5 + s5 - 3s5. 10s*5 Expand (0o*2 + 0o2 - o3)(-88 + 88 + 7o) + (-2 - 2o + 2)(-2o3 + 2o - 2o). -3o*4 Expand (-o + 0o + 3o)(2 + 0 - 3) - 10o - 11 + 11. -12o Expand -u*3 + 2u*3 - 3u*3 + (u + 2u*2 - u)(-u - u + 10u)(1 + 0 + 1). 30u3 Expand (4 + 3 - j + 18)(2j + 2 - 2)(-j*3 + 5j*3 - 2j*3). -4j*5 + 100j*4 Expand -3j*3 + 2j*3 + 4j*3 + (-j + j + 2j)(-2j*2 + 5j*2 - 2j2) + (j3 + j - j)(-5 + 4 + 2). 6j*3 Expand (-3 + 2 + 3)(5u - 3u - 3u) + 0u - 2u + 0u - 5u + 3u + u. -5u Expand (-3 - 1 + 0)(-4z2 + 2z*2 + 4z*2)(-2z + 4z + 0z). -16z*3 Expand (0s - 3s + 0s)(-3 - 1 + 1) + 4s - 2s - s + 8s - 2s - 8s. 8s Expand (-10m - 4m + 13m)(1 - 3 + 1)(-4m2 + m2 + 2m2). -m3 Expand (-2i - 3 + 3)(94 - 10 + 24). -216i Expand ((-63 + 119 - 49)(3 + 3 - 4) + (-4 + 1 + 1)(2 - 1 + 0))(d + 0d + 0d). 12d Expand (6 - 11 + 15)(0b2 + 12b2 - b2). 110b2 Expand 8a*5 - 5a*5 - 5a*5 + (-5a + 3a + 3a)(3a*4 + 4a*4 - 6a4). -a5 Expand (-1 + 1 + 5f)(-2f3 - f3 + 2f*3) + 0f*4 - 3f*4 + 4f*4 + (0 + 2 - 4)(-2f4 + f2 - f2) + 2f*4 - 4f4 + f4. -f*4 Expand (0d3 + d3 - 2d2 + 0d*2 + (-2d - 1 + 1)(2d*2 + 4d*2 - 4d*2) + 1 - 1 - 2d3 + d3 + 4d2 - 4d*2)(-3d - 3d + 5d). 4d*4 + 2d*3 Expand (4v*2 + 0v2 - v2)(-2v + 7v - 3v)(2v*2 + 0v + 0v). 12v*5 Expand (2 - 2 + 2c)(-7c*4 + 0c*4 - 14c*4). -42c*5 Expand (11 - 4 - 1)(2v - 3v - v) + (-4 + 4 + 2v)(2 - 1 + 0). -10v Expand -13 - 27r*3 + 28r*3 - 14 + (-r + 0r + 2r)(3r2 - 2r*2 + 0r*2). 2r*3 - 27 Expand (3v - v - 14v)(2 - 4 + 5) + (-3v + 5v - 3v)(4 + 0 - 3) + 4v + 0v - 2v. -35v Expand (-2o3 + 0o*3 + 0o*3)(2o + 3 + 1 - 4o). 4o4 - 8o*3 Expand 2o*5 + 1 - 1 + (3o*2 - 4o*2 + 0o*2)(-o*3 + 0o*2 + 0o2) + (o3 + 12o3 - 2o*3)(-2o2 + 2o2 + o2). 14o5 Expand (2u*2 + 12u - 12u)(7 - 7 + 6u)(4u - u2 - 4u). -12u5 Expand (-2 + 4 - 3)((-o + 2 - 2)(-2o*2 + 2o2 - o4) + 167 - 167 - 28o5) + 5o*5 + 0o*5 - 3o*5. 29o*5 Expand (3 - 3 + 2u)(-3u*3 + 0u*3 + 0u3) - u4 + 5u4 - 5u*4. -7u*4 Expand (2 - 4 + 1)(0a - a + 0a)(0 - 3 + 5). 2a Expand (-n*3 - 2n*2 + 2n*2)(12n - 3n - 4n) - 4n2 + n4 + 4n2. -4n*4 Expand (3u - 3u2 - 3u)(2 + 3 - 4). -3u*2 Expand (4k - 2k - k)(-1 + 3 - 3 + 0 + 3 - 2 + (2 - 1 + 0)(-4 + 4 + 1) - 5 + 1 + 5). 2k Expand (2 - 2o - 2)(5o + 2o - 10o)(-3o3 + 4o*3 + 0o*3). 6o5 Expand y4 - y*2 - 2y + y*4 + 0y*2 + (-1 + y + 1)(-7y3 + 2y*3 + 2y3). -y4 - y*2 - 2y Expand (-29a - 46a + 145a)((-1 - 4 + 4)(a + a - 4a) + 3a + a - 2a). 280a2 Expand (m2 - 6m*2 - 3m*2)(3 - 3 - m)(4 - 2m - 4). -16m4 Expand (-3i*3 - 4i + 5i + 5i*3)(1 - 7i2 - 1). -14i*5 - 7i*3 Expand (6 - 2s - 6 + (2s + 2s - 3s)(3 - 6 + 2))(59 + 8 + 10). -231s Expand -4s + 0s - 6s - s + s - 2s + 0 + 0 - 2s - 2 + 2s + 2 + (0 + 1 + 0)(-1 + s + 1). -11s Expand 0k - 4k + 2k + (-2 + 2 + 1)(5k - 5k + k) - 3k + k + 3k + (3k - 6k + 4k)(9 - 1 - 3) + 2k + 2k - 2 - 3k. 6k - 2 Expand (-r + 1 - 1)(-26 - 11 + 11). 26r Expand (-u + 2u - 2u - 28)(-4u*3 + 3u3 - u3). 2u4 + 56u*3 Expand (5y*2 - 2y*2 + 0y*2)((3 - 3 - 2)(3y + 2y - 2y) - y + 0y + 3y). -12y3 Expand (0 + 1 - 3)(3d - 2d + 0d) + (3d + 0d - 2d)(1 + 0 - 2) - 3d + 8 + d + 12. -5d + 20 Expand 0 - 2v*4 + 0 - 2v*4 - 4v*4 + 4v*4 + (-3v3 + v3 + 0v3)(-5v + 2v + 0v). 2v*4 Expand (-6w*3 + 4w*3 - 14w*3)(-4 + 0 + 5) + w2 - w2 - w*3. -17w*3 Expand 7m*4 + 0m*4 + 2m4 + (-m3 - m*3 + 4m*3)(1 + m - 1) - 3m4 + 2m*4 + 3m*4. 13m*4 Expand (-3u4 - u4 + 7u4)(u + 1 - 1) + (u3 - u3 + u*3)(-u*2 - 3u*2 + 2u*2) + 4u*2 - 4u2 - u5 - 5u5 + 2u*5 + 2u5. -u5 Expand (3p + 3p - 5p)(73 + 62 - 103). 32p Expand (-g + g - g)(-g2 - g2 + g*2) + 2g*3 + 1 - 1 + 1904 - 1904 - 41g*3. -38g*3 Expand ((0 - 1 - 1)(-3j + 6j - 2j) - 2j + j + 6j)(-1 + 4j3 - 3j*3 + 3). 3j*4 + 6j Expand 6b3 - 3b*3 - 2b*3 + (2b - 3b + 3b)(b2 + b2 - b2) - 3b*3 + 13b*3 + 2b*3. 15b*3 Expand (3m*2 - 4m*2 + 2m*2)(-m*2 - 2m2 + m2 - 1). -2m4 - m2 Expand -10d + 14d - 26d + (3d + 3 - 5 - 4d	{ "pile_set_name": "DM Mathematics" }
-3, s, 1 Let j = -3.851 - 0.149. Put 3, j, 5, 0.5 in descending order. 5, 3, 0.5, j Let q = -197/5 + 39. Let a = 1.5 + -1.7. Sort a, q, -2 in decreasing order. a, q, -2 Suppose 32 = 2x + 28. Let m = 0.53 + -0.03. Sort 5, m, x in decreasing order. 5, x, m Let n = -18.9 - -5.9. Put n, -4, -1, -0.3 in ascending order. n, -4, -1, -0.3 Let o(d) = -d2 + 7d + 9. Let x be o(7). Let f = -4 + x. Suppose -q + 3h - f = 0, 5q - h - 15 = -40. Sort 1, q, 4 in decreasing order. 4, 1, q Suppose -4b = b + 15. Put 5, b, -0.2 in decreasing order. 5, -0.2, b Let h be 2/(-10) + 116/(-20). Let i = 6 + h. Sort i, 1, -3 in ascending order. -3, i, 1 Let j = -3 + 2.9. Let y be (-2)/8 + 0 - -1. Let b = -8.6 + 9. Sort y, j, b in decreasing order. y, b, j Let t be 2/(-6)(-18)/2. Suppose -2o + 4 = -0o - 2f, -to - f + 2 = 0. Suppose -o = -5q - 6. Put 0.1, 1, q in descending order. 1, 0.1, q Let c = 97 - 96. Sort 4, -16, c, -3 in descending order. 4, c, -3, -16 Let v be (16 - 20)/(1 + -2). Sort v, -2/5, 3, -3 in decreasing order. v, 3, -2/5, -3 Let l = -10 - -15. Let d = -4 + 1. Suppose -2k + 2 = -0k. Sort k, d, l. d, k, l Let g = -11 - -16. Suppose w = r - 1, w + w = gr - 14. Suppose -ro - 16 = -0o. Sort o, -8, 2 in decreasing order. 2, o, -8 Let s = -1.009 - -0.009. Put -0.04, -0.3, s in increasing order. s, -0.3, -0.04 Let y be 1/((2/(-4))/(-1)). Suppose -h + y = h. Suppose -7 = 2d + 5z - 2, 3z = -3. Put h, -1, d in increasing order. -1, d, h Let f be ((-10)/(-300)3)/((-2)/4). Let m = 6458/17 + -380. Sort m, f, 3 in descending order. 3, m, f Let s(c) = -c*2 - 6c - 5. Suppose -3i - 12 = -0i. Let l be s(i). Let a be -1 - -2l/(-6). Sort 5, -5, a. -5, a, 5 Let f = 4 + -5. Let d be 13 - (-1 - f). Suppose -4 = -4c, -9 = 2h - 0h - 5c. Put h, d, 5 in descending order. 5, d, h Let b = -482/5 - -96. Sort -2, 5, b. -2, b, 5 Let p = -49 + 57. Put p, 2, -5 in decreasing order. p, 2, -5 Suppose -4i + 6 + 5 = -5v, 3i + 18 = -5v. Sort 0, v, 5 in decreasing order. 5, 0, v Let z = 3 + -3.05. Let n = 2 + 0.05. Let b = n + z. Sort b, -1/4, 0.3 in increasing order. -1/4, 0.3, b Suppose 4h - 6 = -5i, h - 6 = 5i + 2h. Put -22, -4, i, -3 in increasing order. -22, -4, -3, i Let m = -22 + 22.4. Sort 14, m, 0 in descending order. 14, m, 0 Let p = 8.1 - 8. Let n(l) = -l + 8. Let z be n(8). Let k be 10/(-6) + (2 - z). Put -4, p, k in decreasing order. k, p, -4 Suppose 10u = 7u + 15. Suppose -5m - 5n = 10, -5m + 3m + un + 31 = 0. Sort m, 4, 2 in decreasing order. 4, m, 2 Let c = 1/3 + -13/12. Suppose t + 3 = 4f, 0 = -4t + 4f - 0 - 12. Sort c, t, 0 in ascending order. t, c, 0 Suppose 0 + 4 = 2x. Let y be 1/x(1 + 1). Let k(t) = -5t2 + 1. Let p be k(y). Put 0.3, p, 5 in decreasing order. 5, 0.3, p Let g = 27 + -14. Let j = g - 11. Sort 5, -3, j in increasing order. -3, j, 5 Let d = 12 + -21/2. Sort -0.4, d, 0.5. -0.4, 0.5, d Let j be 2/3 - 3/(-9). Let d = 4 + -2. Suppose 4x - 10 = 2. Put x, d, j in descending order. x, d, j Suppose 0 = 2v - 0v - 10. Let q = 1 - -2. Suppose 2s = -5i + 28, -2 = -2s + 4i - 10. Put s, v, q in increasing order. q, s, v Suppose 2g = -g - 15. Let u = -3 - g. Sort -1, 0, u in increasing order. -1, 0, u Let y = -6 + 6.1. Let v = -455/6 + 76. Sort 4, v, y in ascending order. y, v, 4 Let q be 39/26(-10)/3. Sort 4, -3, q in decreasing order. 4, -3, q Let z = -1 + 3. Put 1, 4/5, z in decreasing order. z, 1, 4/5 Let b = -4 + 6. Let h be (-1)/(-2)b - -3. Let q = -56 - -56. Put q, h, -2 in decreasing order. h, q, -2 Let d = -3 - 0. Let x = d + 3. Let b = x - -0.1. Put b, -5, 1/4 in ascending order. -5, b, 1/4 Let o = -0.06 + -7.94. Sort 1/2, -1/8, o in decreasing order. 1/2, -1/8, o Let a be 1/((-2)/(-8)) - 7. Suppose 22 = 5o - 13. Suppose -o + 3 = 2i. Sort -5, i, a in descending order. i, a, -5 Let y = -39 - -35. Suppose x + 7 = -4x + 2v, -4x - v - 16 = 0. Put y, -1, x in descending order. -1, x, y Let b = 7 + -6. Suppose -4m - 3 = b. Let f = 11 - 16. Put f, m, -4 in ascending order. f, -4, m Let l = -17 - -24. Let r = l - 7.3. Suppose 4i - i + 3y = 18, 5i - 2y - 2 = 0. Sort i, r, -1 in ascending order. -1, r, i Let y = -2.1 - -2. Let v = 14 + -14.3. Sort 0.3, v, y. v, y, 0.3 Suppose 8w - 4w + 8 = 0. Let j be 6/(-4)w/3. Suppose 3k + 21 = 2l + 7, -2l - 14 = 4k. Sort j, 0, k in ascending order. k, 0, j Suppose 2 = -4x + 14. Suppose -4i = 3m + 4, 3i - 18 = m + 2m. Suppose -xf = if. Sort f, -4, -1. -4, -1, f Let v = 51 - 51. Let k be 0/2 + -21. Put k, -3, v in increasing order. -3, k, v Let z = 0.1 - -1.9. Put z, -0.5, -5 in ascending order. -5, -0.5, z Let w = -2 - -2.2. Let l = -3.02 - -3. Let p = 0.28 - l. Sort w, 3/7, p in descending order. 3/7, p, w Let x = 144.6 + -145. Put 5, 3, 1, x in increasing order. x, 1, 3, 5 Let s = 438/5 + -88. Let m(r) = -20r. Let y be m(-1). Suppose -y = -6q + q. Sort s, -4, q in increasing order. -4, s, q Let i = -10 - -7. Let z be (i/(-6))/(1/(-10)). Put 5, -2, z in decreasing order. 5, -2, z Let s = -2 + 2.2. Let z be (10/(-18))/(2/3). Put 1/6, s, z in ascending order. z, 1/6, s Let u be (3/3)/(40/16). Suppose 26 - 18 = -2n. Put n, 7, u in decreasing order. 7, u, n Let b be (-8)/(-44) - (-24)/(-11). Sort 0.4, b, -4, 0 in decreasing order. 0.4, 0, b, -4 Let r(s) be the first derivative of s2/2 + 2s + 3. Let m be r(-2). Sort -4, 4, m in ascending order. -4, m, 4 Let n(t) = -9 - t*2 - 2t*2 - 10t + 2t2. Let z be n(-7). Suppose -z = -2o - o. Put o, -2, -3 in increasing order. -3, -2, o Let z(n) be the second derivative of n*4/12 - 3n*3/2 - 7n*2 + n. Let r be z(10). Let g be (-2)/(4/2 + -1). Put g, 3/2, r in descending order. 3/2, g, r Let b be 2/(-6)3/(-4). Let c be (-9)/(-12)(-1 + 21/45). Put b, 2, c in ascending order. c, b, 2 Let p be ((-4)/6 - (-10)/6)5. Suppose 2o - 20 = 6o. Put o, p, -2 in decreasing order. p, -2, o Suppose 4l = 5 - 1. Suppose -x - 9 = -4p, -l = x - 4. Suppose -3g + 12 = p. Sort 0, g, -2 in decreasing order. g, 0, -2 Let x(g) be the third derivative of 1/120g*6 + 0g + 0 - 1/3g3 + 1/12g*5 + 4g*2 + 1/8g*4. Let d be x(-4). Sort d, -3, -4 in increasing order. -4, -3, d Let x(o) = 3o*2 - 1. Let u be x(-1). Suppose -u + 8 = 2n. Suppose -r - 8 = -n. Sort -0.3, r, -2/5 in ascending order. r, -2/5, -0.3 Let a be (-1 + -2)3/9. Put 10, -2, a in increasing order. -2, a, 10 Suppose 2a - f = -7, 5f - 5 + 42 = -2a. Let b be (-11 - 1)2/a. Suppose -b + 14 = 2r. Put r, -5, -3 in increasing order. -5, -3, r Let h = 2.96 + -3. Let t = h + 0.01. Let f = 4.97 - t. Put -3, -1/5, f in ascending order. -3, -1/5, f Let v = -30 + 89/3. Let p be (-264)/390(-10)/4. Let i = -400/221 + p. Put v, -4, i in ascending order. -4, v, i Let c = -0.3 + 0.2. Let a = -11 - -7. Sort a, -1, c. a, -1, c Let c(a) = -a2 - 6a - 1. Let z be c(-7). Suppose 0 = 3u + u - 3x + 48, 3x = 0. Let w = u - z. Sort w, -2, -1. w, -2, -1 Let i = 0.1 + -0.4. Sort i, 0.5, -2 in descending order. 0.5, i, -2 Suppose 4g - 15g = 22. Put -15, g, 2, -1 in increasing order. -15, g, -1, 2 Let l = -101 + 106. Sort -5, 1, l in decreasing order. l, 1, -5 Let v(j) = -2j + 7. Let l be v(5). Let z = 3 + 4. Suppose -4 = 2f - 5i, -z = -f - 0i - 2i. Sort -5, l, f in decreasing order. f, l, -5 Let s(l) = l*3 + 6l*2 + 5l - 5. Let o be s(-5). Let p = o - -8. Suppose 1 - 5 = k. Put k, -5, p in descending order. p, k, -5 Let v(d) = d*2 - 3d - 11. Let k be v(5). Sort k, 0, 5 in decreasing order. 5, 0, k Let s = 22 - 14. Suppose 1 - 3 = 2w - 4t, w + 5t + s = 0. Let b be (2/9)/(10/30). Put b, w, 0 in decreasing order. b, 0, w Let o(s) = s - 5. Let m be o(5). Suppose c + 3c - 24 = 0. Put m, -2, c in decreasing order. c, m, -2 Let o = 1.3 - -3.5. Let g = o - -0.2. Let i = -7 + 5. Sort i, -4, g in decreasing order. g, i, -4 Suppose -c + x = 4x + 9, c - 3x - 15 = 0. Suppose 0 = -4t - c + 7. Let a(l) = 3l3 + l2 + l + 1. Let y be a(-1). Sort y, t, 2 in decreasing order. 2, t, y Let m = 16 + -16. Let d = -0.6 - -0.3. Let u = d - -1.3. Sort u, m, 0.5 in decreasing order. u, 0.5, m Suppose 23m - 26m = -15. Sort -8, 0, 1, m in decreasing order. m, 1, 0, -8 Let b = 4 - -2. Let m = -10.7 + 0.7. Let a = b + m. Sort -3, -1/7, a. a, -3, -1/7 Let x = -0.4 - 0.1. L	{ "pile_set_name": "DM Mathematics" }
Which is smaller: c or 45/2? 45/2 Let z = 52 - -37. Let h = z - 106. Does h = -2/9? False Let j = -8549 + 8548. Let l be 45(-2)/7(-70)/(-3). Is j greater than l? True Let k(i) be the third derivative of 0 + 0i + i3 - 7/8i*4 - 16i*2 + 1/60i*5. Let m be k(20). Which is smaller: -11 or m? m Let x = 0.101 - 5.101. Let b = -2015/198 - -193/18. Which is greater: x or b? b Suppose -3o = -2o - 2i + 2, 2i - 14 = 3o. Let n be (-110)/(-15)(o/(-8))/(-3). Is -2 > n? False Let g(q) = q3 - 11q*2 - 3. Let c be g(11). Suppose -j + 4 = -4w - 40, 0 = j. Let i be w/c(-42)/7. Which is smaller: i or -21? i Let n be 2/(-5) - (-6)/15. Let k(t) = t + 1. Let g(q) = -q. Let i(w) = -g(w) - 2k(w). Let p be i(-1). Is p greater than n? False Let t = -104487/13 - -8037. Is t bigger than 19/7? False Suppose -10 = -4q + g, -5q + 6 = 28g - 26g. Suppose -3p - 111 = -qj + 58, 4j - 20 = 0. Is p greater than -52? False Let s = -2997 - -2981. Is -35 smaller than s? True Let p = -0.2 - -0.1. Let b = -227.5 + 239. Let d = -22.5 + b. Are p and d unequal? True Let p = -119.2 - -9.2. Let d = p - -109.93. Let h = 4 + 2. Are d and h non-equal? True Let q = -9992 - -9992. Does q = 4719? False Let t = 25.953 - -12.047. Which is smaller: t or -23.8? -23.8 Let x = -74/2005 + 710422/126315. Which is bigger: x or 5? x Let i(x) = 20x + 58. Let v be i(-2). Suppose 10s = vs + 48. Which is bigger: s or 8? 8 Let v = 199 - 388. Let f = 83 + v. Which is bigger: 0 or f? 0 Let c(r) = 2r - r2 - 7273 + 5r + 14r + 7261. Let g be c(20). Suppose -2u + 0u = -h - 15, -2u + 3h + 13 = 0. Is u at least as big as g? True Let u = 2/397 + -405/1588. Does 1847 = u? False Let b be (-69/4)/(1/(-112)). Let k = -1516 + b. Suppose -2 - 14 = 2q. Is q < k? True Let o = -8260 - -8131.1. Are -0.2 and o unequal? True Suppose 0 = a + c - 15, c - 30 = -2a - 0c. Let s(m) = m3 - 16m*2 + 18m - 21. Let k be s(a). Which is greater: 23 or k? k Let o be 4(6 + 271/(-45)). Let d = -3691/30 - -123. Let p = d - o. Which is smaller: -1 or p? -1 Let l = 6574 + -6586. Is 1.97 not equal to l? True Let w = 57 - 45. Suppose u + 2m - 5 = 0, wu - 7u + m - 16 = 0. Let b = -13 - -7. Are b and u equal? False Suppose 110l = -1028 - 1172. Let z = 1.3 + -0.3. Is z greater than or equal to l? True Suppose -4r + 3 = -1. Let p = 452.55 + -452.41. Which is smaller: r or p? p Let r = 3511 + -3613. Is -3 >= r? True Let h(r) = 19r - 9 + r2 - 16 + 20r - 13r. Let p be h(-27). Suppose 0g + 2g + pm + 2 = 0, -4m + 16 = -g. Is 2 < g? False Suppose -z - 17 = -0z. Let f = 106 + -102. Suppose -4r + 52 = -fa - 12, a + 8 = 3r. Is a at most as big as z? True Let x be 5(35/(-7) - (-4 + 1)). Let z be (x/90)/(4/18). Is z at least -110? True Let a(p) = -14p + 13 + 18p - 5p. Let d be a(11). Let g be 14/(d/(-9) + 32/(-18)). Is g bigger than -8? True Let s(j) = -3j*2 - 77j - 1372. Let z be s(-23). Which is smaller: z or -1185? z Let u = -416 - -716. Let w = u + -299. Which is greater: 111 or w? 111 Let r(v) = -v*2 + 6v. Suppose -2p = -2o - 22, 0 = -3p - o + 15 - 2. Let g be r(p). Is g bigger than -20/19? True Let i = 269 + -263. Suppose iy + 1617 = -y. Are -231 and y unequal? False Let n(z) = -z + 59. Let v be n(0). Let m = 5512 + -5452. Is v less than or equal to m? True Let v = 3/241238 - -1935452465/723714. Which is smaller: 2673 or v? 2673 Let y be ((-19794)/4)/(-6 + 2 + 0). Let g = y - 1226. Which is bigger: 10 or g? g Let w(o) = 3o3 + 7o*2 + 118o - 624. Let r be w(5). Which is greater: r or 510? r Let n = 13.5 - -40.5. Let h = n + -53.855. Let l = h + -0.102. Which is greater: l or 1? 1 Let m be -161/(-1)(-3996)/(-90)10. Do m and -0.2 have different values? True Let n = 1 + 25. Let m(d) = -d2 + 28d + 40. Let l be m(n). Suppose 5t - 112 = -l. Is -3 greater than or equal to t? False Let z(b) be the third derivative of b5/60 - 35b*4/24 + 131b3/6 + b2 + 19b. Let s be z(31). Which is greater: -4 or s? s Let d be 4/14 - (-10)/(-35). Suppose 2w - 14 + 10 = -2z, 4w + 3z - 5 = d. Is 1/268 at most w? False Let b be (-2)/38 + 1152/7448. Are b and -1 equal? False Suppose u + 49 = -5o, 118 = 5u + 138. Which is greater: o or 102? 102 Let j be 8/(-14) - (-20536)/4284. Let d(f) = -2f + 19. Let z be d(8). Which is smaller: z or j? z Suppose h - 6h = 2o - 16, -o = -4h - 8. Let y be ((-2)/o)/((-1)/76). Is 20 equal to y? False Let v = -820 + 404. Which is bigger: -419 or v? v Let l(a) = -a2 + 5a + 8. Let s be l(6). Suppose sm = -3h - 22, 4m + 36 = h + 6. Let y be 8/m(43 - 2). Is -40 bigger than y? True Suppose -85o + 79o = -1908. Are o and -0.2 non-equal? True Let u be ((-1)/(-2))/(253/(-88)). Let l be (-2 + (-55)/(-20))/((-2)/(-8)). Suppose 3s = g + l, 2s = s - g - 3. Is s bigger than u? True Suppose -3m + m + 6 = 0, d = m + 5. Let q = -628 - -1057. Let t = q - 415. Which is smaller: t or d? d Let x be ((-55)/(-8))/(5/(-20)). Let n be 5 + (-2 - -14)/4. Let i be (-217)/n + 8/64. Is i less than x? False Let b = -154.83 + 156. Let q = b + -1.17. Which is smaller: q or -0.25? -0.25 Let z = -53/9 + 26/3. Suppose 0 = 2k + j - 2j - 7, 3j - 19 = -4k. Is k at least as big as z? True Let r be (-2 - 9/1) + 1. Suppose 2h + 4 = 0, 2h = -2x - h + 4. Suppose -6g = -4g - 5q + 18, -xq = -3g - 27. Which is smaller: r or g? r Let m = 189958 - 146837564/773. Which is bigger: m or -1? m Let g(f) = -f3 - f2 + 93f - 91. Let x be g(1). Let q be (1/15)/((-62)/(-6)). Which is bigger: x or q? q Let i(p) = p*2 + p. Let u(v) = 4v*2 - 2v - 7. Let n(z) = -5i(z) + u(z). Let h be n(-9). Let q be ((-6)/(-15))/((-3)/(-30)) - h. Is 28 greater than q? False Let w(b) = -40b + 175. Let t be w(10). Let l = t - -169. Which is smaller: l or -54? l Suppose 5o + 2r + 14574 = 0, 5o + 6r + 8706 = 2o. Is -8753/3 smaller than o? False Let g = -60.6 + 4.6. Let q = g + 86. Let m = -26.6 + q. Is 1 > m? False Suppose -12672 = 18x - 36x. Let q = x + -705. Which is greater: q or 8/187? 8/187 Let w be 1/(-2 - (7/3)/(-1)). Suppose -65 = 4a + 5i, wa + 25 = a - i. Let q be (2 + a/3)/(2/(-9)). Do q and 7 have different values? True Let d(n) = -n*2 - 9n - 8. Let a be d(-7). Let v be 21/(-14) + 45/a. Let o(q) = 3q - 17. Let m be o(v). Is m <= -3/31? False Let n = -1.0901 - 1385.7099. Let s = -1387 - n. Suppose -26 = -2m + 4m. Which is greater: m or s? s Let d be (6/(-10))/((-3)/(-15)) + 0. Let n be (3/(d/1))/1. Let k be (-6)/(7 + n) - (0 + -2). Which is greater: -6/13 or k? k Suppose -4p = -j + 4j - 9, 2p + 3j = 3. Suppose pw - 6w + 18 = 0. Let i be 21/(-12)(24 - 28). Which is smaller: i or w? w Let f be -5(-5)/((-10)/14). Let m = -34 - f. Let y be (2/(-24)m)/(1/(-70)). Which is smaller: y or 7? y Let l(x) = -x*3 + 33x*2 + 54x + 98. Let u be l(35). Which is smaller: -460 or u? u Let w = 863/9 + -74219/774. Which is bigger: w or -1? w Let b(r) = -r*2 + 3r. Let j(a) = -a*2 - 3a + 7. Suppose 4n + 3i + 13 = 0, 0 = -4n + 2i - 4i - 14. Let v be j(n). Let s be b(v). Is -1/13 < s? True Let h = 174 + -195. Let n be (14/h)/(4/(-9)). Is n > 1? True Let g(c) = c2 - 2c - 58. Let t be g(9). Suppose tb = 4x - 24, 14b - 11b + 2x = -32. Suppose -7 = 5s + l + 31, 2s - 4l + 2 = 0. Is s > b? True Let x = 3/10 - -1/5. Let r(q) = -1912q - 23038. Let b be r(-12). Which is bigger: x or b? x Let w(z) = 6z*2 + 2z + 7. Let v be w(6). Let g = -175 + v. Which is smaller: g or 58? 58 Let j = -164 - -398. Let o = 233.91 - j. Are o and -0.02 nonequal? True Let j = -17/104 + 499/1144. Which is smaller: j or 4/5? j Let h = -563 + 823. Which is greater: 262 or h? 262 Suppose -28k + 4 = -32k. Let v = k - 7. Let x(y) = y*3 - 10y*2 + 17y - 17. Let j be x(8). Which is bigger: j or v? v Let a(x) = -14x3 - 80x*2 - 14x + 2. Let q be a(-8). Which is smaller: 2161 or q? 2161 Let c = -19178 - -10336. Is -8842 less than c? False Suppose 22z = 25z + 9. Let c = -79 + 72. Is z greater than c? True Let s = -3855 + 3758. Is s at least -98? True Suppose 0 = 5w - 3u - 12, -5u - 20 = -4w - 0u. Which is bigger: -2/22027 or w? w Let g(p) = -p - 1. Let u be g(-11). Suppose 2t + 6 - u = 0. Suppose -tc + o - 1 = 0, -3c + 0 = 3o - 12. Which is bigger: c or 7/8? c Let n(v) = 376v - 2	{ "pile_set_name": "DM Mathematics" }
uppose 45 = 13y - 8y. Suppose -4z - 3j = -y, 3z + 3j = 6 + 3. Is x(z) a composite number? False Suppose -17 = -4b - 3a, -5b - a + 26 = -2a. Suppose 1104 = -4l + 6960. Suppose -w + 289 = 4v, -bw - v = -0w - l. Is w prime? True Let j(c) = -5c - 66. Let v be j(-13). Is (v/12-4)/(2/9930) composite? True Let h(i) be the third derivative of 47i6/720 + 11i5/120 - i4/3 + 7i2. Let p(b) be the second derivative of h(b). Is p(6) prime? True Suppose -8d = -3r - 7d + 4913, 4d = -8. Is r composite? False Let j = -9 + 9. Suppose 2i + i + 120 = j. Let y = i + 86. Is y a composite number? True Suppose 209 = 4i - 3b, -i - 2b + 14 = -41. Suppose -u + 0u + i = 0. Is u a prime number? True Is 21169 - (13 - (12 - 7)) composite? True Let r be (92/(-161))/((-1)/7). Suppose -1446 = 3t - rc - 3657, 2211 = 3t + c. Is t a composite number? True Let b(w) = w3 + 3w*2 + 2. Let r be b(-3). Suppose r = -4v + 38. Suppose 6p + 267 = vp. Is p a composite number? False Let v = 0 + 7. Suppose 0a + 4a = s - 19, 4a + v = -3s. Suppose -sb = m - 31, 2b - 61 = 5m - 148. Is m prime? True Let o be -3777 + 0 + 2. Let j be (-2)/(-4) + o/18. Let i = j - -565. Is i a prime number? True Suppose -5t - y + 0y + 3975 = 0, 3t - 3y = 2367. Suppose 3p + 4h - h = -1215, 0 = 2p - 2h + t. Let b = p - -567. Is b prime? False Let b(a) = -a*3 + 6a*2 - 2a + 7. Let t be b(6). Let m(p) = 11 - 2 - 543p + 538p. Is m(t) a composite number? True Suppose 0 = 4x, 4l - 5x = -9x + 147892. Is l a prime number? True Suppose 5a = m - 35, -6m + 15 = -2m + 5a. Let x be 68/11 + m/(-55). Suppose 3v + x - 63 = 0. Is v a prime number? True Let c = -1858 - -4915. Is c a composite number? True Let u = -25 - -37. Let b be -2 - (-9 + u/4). Suppose 4v - 36 = -bl, 0 = -2v + 6v - 3l - 50. Is v composite? False Let n(p) = 1 + 4 + 2p - 1 + 34p*2 + 2p. Let f be n(-3). Suppose f = -2r + 4r. Is r a prime number? True Let f = -589 + 2826. Is f prime? True Is -92((-228)/16 - -5) prime? False Let b = 124 + -316. Let z = 1501 - b. Is z prime? True Let f = 2 - 8. Is (-500)/f + 2/(-6) a prime number? True Let h be 351/182. Let i = 32 - h. Suppose 52 = im - 11m. Is m prime? True Let p(k) = 59k*2 + 11k - 2. Let t be p(2). Let z = 1605 - 828. Let q = z - t. Is q composite? False Suppose -i - 5z = 2i - 31, -2z + 8 = -i. Is i - (29061/(-15) + (-8)/(-20)) a composite number? True Suppose -2q = -3q + 7. Suppose -9f + 20 = -7. Is 726/21 + f/q composite? True Let x be (-738)/(-12)(-16)/(-6). Suppose -5k - 4l - 8 = 0, -2l - 5 + 1 = 0. Suppose -x = -ky - 2y. Is y a prime number? False Suppose -19 = -5q - 5y + 2y, -2q = 5y. Suppose 5p = -qk + 2705, -2p - 2705 = -7p - k. Is p a prime number? True Suppose 3i + 2c + 1432 = 572, -3i - 855 = 3c. Let w = 297 - i. Is w a composite number? False Let k be 1(-6 - -4) + 412. Suppose -8i - b + k = -3i, 246 = 3i + b. Is i a composite number? True Is (-18010973)/(-553) - 4/7 a prime number? True Let k(m) = 47m*2 + 91m + 107. Is k(-21) composite? True Let k(o) = 22o2 + 11o - 10. Let b be k(8). Let a be (16 - 4)/4 + b. Suppose 3p - a = -538. Is p a composite number? False Is 9/((-27)/(-140757)) + -12 composite? True Suppose a + 1113 = -4j, -5a + 2j = -3j + 5615. Let g = a - -2272. Is g composite? False Is (-5 + -1 - -717) + 2 prime? False Let p(s) = s2 - 8s + 13. Let c be p(4). Is 0c/15 - -127 a composite number? False Let b(i) = -i3 + 17i*2 - 34i - 13. Let c be b(15). Let m be (0 + 152)/(-11). Let y = c - m. Is y a composite number? False Let m(v) = 36v - 3. Let o be m(2). Let a = 106 - o. Is a composite? False Let q(c) be the third derivative of -c*6/120 - 3c*5/10 - 5c*4/12 + 25c3/6 + c2. Is q(-18) composite? True Is 2338 - (-16 - -13)10/(-6) composite? False Let p(y) = -843y - 1. Is p(-1) a prime number? False Suppose -520 = -2a - 3a. Let g = 147 - a. Suppose 0 = 3j - 148 + g. Is j a prime number? False Let a = 52884 - 36437. Is a composite? False Let h be 2/110/4. Suppose -hx + 3349 = -4c + 546, -2240 = -4x + 4c. Is x prime? True Let n = 16 + -11. Suppose -12 = np + 8. Is (p/(-6))/(3/711) a composite number? True Suppose 599 = 5h - 3c - 184, -2h + 5c + 298 = 0. Is (14/(-21))/((-2)/h) prime? True Is (187383/(-28))/((-12)/16) prime? True Suppose 0 = -5r, -4u + 0u = -3r - 32. Let y(q) = 3q - 18. Let s be y(u). Suppose -4v + 1951 = 5l, sv + 5l - 2440 = v. Is v a prime number? False Let h(c) = -33c + 8. Let x(p) = 34p - 7. Let k = -14 - -10. Let i(g) = kh(g) - 3x(g). Is i(10) a composite number? True Suppose -11a = -9a. Let r = a + 9. Let l(d) = 12d + 1. Is l(r) prime? True Suppose -5a - 65 = 4d, 0d + 2d + 10 = 0. Let i(q) = -q3 - 9q*2 - 3q - 12. Is i(a) composite? True Let r = 48572 + -32449. Is r prime? False Is 12678/2128/12 a composite number? True Suppose 3o - 4n - 9488 = 2817, -5o + 20513 = -2n. Is o prime? False Suppose -4j = -s - 298494, 0j - 2j + 2s + 149250 = 0. Is j prime? True Suppose 10542 + 1579 = 23g. Is g a composite number? True Is ((-54)/(-189))/(2/496559) a prime number? True Suppose r - b = 2931, -2r + 0b = 5b - 5876. Is r prime? False Suppose 4u + 4m + 24 = 0, -9u + 2m - 28 = -7u. Let v(b) = b2 - 25b - 13. Let j(q) = -q*2 + 12q + 6. Let z(r) = -5j(r) - 3v(r). Is z(u) composite? False Is 2797/(4/(72/6)) prime? False Let n be (-9027)/36 - 1/4. Let s = 504 + n. Is s prime? False Let p(y) be the second derivative of -y5/20 - y4/3 + y*3/2 - 5y*2/2 - 4y. Let b be p(-5). Suppose 8x = 5w + 3x - 830, 2w = -bx + 311. Is w prime? True Suppose -2u - 3731 - 3897 = 0. Is ((-14)/(-5))/(-7) - u/10 composite? True Suppose 0 = -3x + 2g + 19559, 0 = 3x - 6g - 5182 - 14369. Is x composite? False Suppose -5o + 17 = -2o - d, 0 = 2o + 5d. Suppose 1326 = oi + 4c - 249, -344 = -i + 5c. Is i prime? False Suppose 3w = -2q + 80, -12 = -3w - 4q + 70. Let i = -22 + w. Suppose io = -940 + 2936. Is o a composite number? False Let y(t) = -3t2 - 5t - 3. Let c be y(-2). Is (-3945)/c + 1 + -3 prime? True Suppose -4j + 14 + 2 = 0. Let p(u) = -51u*3 - 7u*2 - 16u - 21. Let z be p(-5). Suppose z = 5n + jf, -1 - 3 = f. Is n a prime number? False Suppose -5n + 24 = -9n. Let i(r) be the second derivative of -4r3/3 - 11r*2/2 - r. Is i(n) a prime number? True Suppose -71727 = -r - 2k, -174k - 215216 = -3r - 173k. Is r a prime number? False Is 13/((-91)/(-42)) + (-35195)/(-1) a prime number? True Let z(b) = b2 + 47b - 129. Is z(30) a prime number? False Suppose 0 = -376s + 373s + 225195. Is s a prime number? False Suppose 2j + 10 = 4a, -j - a + 6a = 17. Suppose 2x = 5o - 2493, -jx = -2o + 954 + 52. Is o a prime number? False Let f be (23556/130)/((-2)/(-10)). Let a = f - 173. Is a prime? True Let y = 10337 + -1962. Let m be (-1)/(y/2095 + -4). Is (-10 - -11)/(1/m) prime? True Let v(s) = 131s - 31. Let q be v(3). Suppose -f + 191 = -q. Is f composite? True Suppose 2d = -6 + 34. Let i(p) = -p + 1. Let x(v) = 9v + 15. Let j(b) = 4i(b) + x(b). Is j(d) composite? False Let g(l) = -93l3 - l2 - l. Let t(a) = -a*3 + 4a*2 - 5a + 1. Let m be t(2). Is g(m) composite? True Let p(u) = 1361u3 - u2 - 13u + 40. Is p(3) a prime number? True Let o = 23 - 22. Suppose o = 6y - 11. Suppose -yp + 4p = 148. Is p a composite number? True Let i = -4 - -7. Suppose -iu = 2u - 10. Suppose -ux - 305 = -3x. Is x prime? False Let v(z) = 389z - 17. Let f be v(-3). Let g = -679 - f. Is g a prime number? False Suppose 4l - 2 = 2l. Let f be l/(4/10)2. Suppose y - 2 - 2 = -3t, t = -f. Is y prime? True Let y(t) = 3t - 26. Let f be y(10). Suppose 2s = fq + 112, 2q - 53 = -s + 5q. Is s a prime number? False Is (481716/(-18))/(5/(-5)) composite? False Let f(v) = v*2 + 10v - 2. Let r be f(-8). Let c be (-81)/r - 6/4. Suppose -110 = -cd + 517. Is d a composite number? True Let x(g) = 27g*2 - 13g - 10. Let q be x(8). Is -5(q/(-10))/3 a prime number? True Let o = 5907 - -898. Is o a composite number? True Let c(v) = -26v*2 + 13v - 9. Let p(r) = r - 1. Let y(o) = c(o) - 6*p(o). Let f be y(7). Is (-2 - f)/(1 - -1) prime? True Let p(o) be the second deriva	{ "pile_set_name": "DM Mathematics" }
imes 11.68 -3.504 -0.2914 times -4 1.1656 -0.319-0.4 0.1276 What is the product of -0.3 and -1.67? 0.501 Calculate -0.4-1.39. 0.556 What is 2219 times 0.4? 887.6 Calculate 461. 244 1670 -0.8 -1336 Multiply -9 and -4.1. 36.9 10 * 0.712 7.12 Work out -22.5 * 0.3. -6.75 -5 * 3.4 -17 158 times 1 158 0.1 * -1.39 -0.139 Calculate 2.3-0.22. -0.506 9 106 954 What is -11 times 20? -220 Multiply -0.4 and -265. 106 0.26 times 90 23.4 Work out 2 * -81. -162 Calculate -260.7. -18.2 24 0.3 7.2 What is the product of 20 and -34? -680 -4 * 194 -776 -8.99 * -0.2 1.798 Work out -9 * 6. -54 Product of 19730 and -2. -39460 Work out 1.9 * 2. 3.8 Calculate -3135. -405 -302 times -0.5 151 Product of -0.046 and -0.4. 0.0184 What is -1.47 times -0.09? 0.1323 1 times 0.7 0.7 -4.24 -0.5 2.12 Multiply 14 and -198. -2772 -1 times 145 -145 Work out 0.7 * -0.42. -0.294 Work out -31 * -0.051. 1.581 What is 1.48 times 0.061? 0.09028 Multiply -0.19 and 67. -12.73 -0.0471 times 0.2 -0.00942 2 * -71 -142 0.044-155 -6.82 2.41 times -1 -2.41 1 -0.14 -0.14 Multiply 5 and 2.56. 12.8 -0.34337 -1301.1 234 times 2 468 Calculate 1469-0.02. -29.38 Multiply 119 and 55. 6545 What is -28 times -6? 168 0.1 times -0.025 -0.0025 -3-0.16 0.48 Work out 5 51. 255 What is the product of -0.4 and -532? 212.8 -50.9309 -4.6545 Calculate 0.3-0.49. -0.147 Work out -463 * 0. 0 -2 times -779 1558 1195 595 Multiply 6 and -0.149. -0.894 Product of -507 and -2.1. 1064.7 Multiply 1.01 and 5. 5.05 0.5-0.0318 -0.0159 -4243.4 -1822.8 Calculate -578. -390 What is the product of -2.91 and 4? -11.64 2.013 * -0.3 -0.6039 -215 times 0.1 -21.5 55 * 0.4 22 What is -341 times 13? -4433 Work out -7 * 72. -504 Product of 0 and -412. 0 Product of 0.1 and -2.91. -0.291 What is the product of -17 and 27? -459 0.1-6040 -604 Work out -0.21 3.1. -0.651 What is 88.9 times 19? 1689.1 What is the product of 54 and -1? -54 -5 * 6.8 -34 Calculate -0.11-5.34. 0.5874 0.057740 2.308 0.01277 * -1 -0.01277 Calculate 142.9. 40.6 What is the product of 2 and 0.6? 1.2 7 times 5299 37093 -128 times -10 1280 What is 7 times 0.14? 0.98 What is the product of -0.5 and 49? -24.5 What is the product of 7 and -1.1? -7.7 Work out -0.5 -0.004. 0.002 Calculate -0.8148. -118.4 280.06 1.68 Multiply 2158 and -3. -6474 What is 0.297 times -2? -0.594 2.06 times -3 -6.18 -51-4 204 Multiply 3 and 0.52. 1.56 Product of 0.4 and 0.0285. 0.0114 -5 135 -675 9 * 206 1854 What is the product of 0.1 and 5.53? 0.553 0.5 times -0.4 -0.2 12 times 0.041 0.492 Calculate 55-3.6. -198 -1759 times 0.8 -1407.2 What is the product of 34 and -4? -136 Calculate 1630.1. 16.3 Work out 0.0173 * 2. 0.0346 0.146 0.84 0.01377 3.77 -0.03 times -0.02004 0.0006012 -0.06 * 1 -0.06 Calculate 41000. 4000 -34 -1.05 35.7 -1.7-0.14 0.238 -171 times -6 1026 -1-37 37 Calculate -0.01-5. 0.05 Multiply 0.8 and 5.4. 4.32 What is the product of 0.049842 and 0? 0 Work out 3.5 -3. -10.5 Product of 8.9 and -3.5. -31.15 -0.4 times -165 66 Work out 98 * 5. 490 What is the product of -0.6 and -0.087? 0.0522 Calculate 0.115-0.3. -0.0345 Multiply 0.1 and 5.4. 0.54 9 0 0 -136 * -24 3264 Work out 0.002 * -0.1. -0.0002 Product of -0.2 and -0.27. 0.054 -274 * 0.5 -137 105 times -19 -1995 Work out 33 * -4. -132 Work out 5 * -0.241. -1.205 -1.369 * 0.3 -0.4107 Calculate -7.7-0.53. 4.081 What is the product of -1.1 and -0.04? 0.044 -92.8 -3 278.4 Multiply -0.2 and -4.3. 0.86 Work out -110 * -5. 550 -17 times -27 459 Work out 30 * -0.6. -18 0.43-6 -2.58 -4429 times 0.4 -1771.6 Calculate 762. 434 19490 9310 Multiply 0.1 and -2350. -235 -39 0.02 -0.78 -210.95 -19.95 What is 53 times 2? 106 Multiply -0.249 and -8. 1.992 What is the product of 162 and -17? -2754 Calculate -518. -90 -3 times 2367 -7101 4 times -0.81 -3.24 -0.1 times 2020 -202 What is 0.2 times 0.056? 0.0112 -0.03409 * -0.3 0.010227 0.13 times 53 6.89 What is the product of 14.7 and -1.4? -20.58 90.42 3.78 Work out 0.1 -18. -1.8 Product of -36 and -0.4. 14.4 Product of 298.3 and -2. -596.6 1.2 * 22 26.4 113 * -1 -113 1.1 times 0.038 0.0418 Multiply -137 and -0.061. 8.357 -1919 * -0.1 191.9 1.50.41 0.615 Calculate -130.44. -5.72 11-0.05 -0.55 Multiply 335 and -0.001. -0.335 -0.1-0.041 0.0041 53.8 times 0.3 16.14 Work out 4 * 4.88. 19.52 What is the product of -0.3 and -0.0003? 0.00009 30643 9192 What is 336 times 2? 672 Multiply -600 and 0.4. -240 Multiply 602 and 4. 2408 What is the product of 11055 and 1? 11055 Work out -1316 -3. 3948 -27 times -0.078 2.106 Multiply -0.3 and 2.5. -0.75 0.03-0.066 -0.00198 Product of -0.43538 and 4. -1.74152 What is 0.3 times -0.153? -0.0459 What is -20 times 20? -400 Work out 0.09798 0.5. 0.04899 What is 350 times -1? -350 What is the product of 276 and 5? 1380 Product of 0 and -4.17. 0 -817 * -5 4085 Work out 129 * 3. 387 What is -1 times -5? 5 What is -0.02 times -825? 16.5 What is the product of -8136 and -1? 8136 Work out 180 * 0. 0 -8 * -0.62 4.96 Work out -23 * -343. 7889 Multiply 1.23 and 0.088. 0.10824 Calculate -4.8-36. 172.8 0.815.2 12.16 What is -80 times 16? -1280 Multiply -10 and -8.64. 86.4 What is 4407 times -0.3? -1322.1 Work out -89 * -2. 178 -20.84-0.4 8.336 Multiply 496 and 0.4. 198.4 What is the product of 160 and 0.1? 16 -1780 0.11 -195.8 Multiply -1 and 1601. -1601 Multiply 111 and 0.4. 44.4 -210.2 -4.2 20.0341 0.0682 What is the product of -0.09 and -0.16? 0.0144 -8.1 * 0 0 Calculate 62-0.098. -6.076 What is 18 times 7? 126 What is the product of -0.2 and 0.328? -0.0656 Multiply -0.2 and 126. -25.2 0.5 times -442 -221 Calculate -111.3. -14.3 Calculate -0.460. -24 Product of -0.1 and 0.07. -0.007 Work out 0.5 -0.084. -0.042 What is the product of -22 and 5? -110 0.25 times -0.37 -0.0925 Calculate -0.4-46.65. 18.66 Work out -58.55 2. -117.1 Work out 1 * 14. 14 Calculate 16.51.6. 26.4 Multiply 5 and 354. 1770 Calculate -0.1172. -0.234 What is the product of -0.4 and 1? -0.4 Product of 81.8 and -0.3. -24.54 0.4-0.46 -0.184 Work out -0.2 -0.0551. 0.01102 Product of 2524 and -0.1. -252.4 Work out 0.273 * -1. -0.273 -22.9 times -21 480.9 3458 * 4 13832 Calculate 0.1322. 0.264 0.1 -6 -0.6 Calculate -97214. -13608 Multiply -0.1 and -0.21. 0.021 What is 0 times -798? 0 -1250.156 -19.5 What is the product of -22 and -243? 5346 Calculate 00.47. 0 What is -4 times 0.23? -0.92 Multiply -39 and 4. -156 -4163 -5 20815 0.93 * 5 4.65 Work out 0.1 * 154.9. 15.49 836 498 Calculate 0.31. 0.3 0.028 times -39 -1.092 What is -19 times 47.7? -906.3 Multiply 1.4 and 8. 11.2 Multiply -0.2 and 0.4. -0.08 What is the product of 542 and 5? 2710 -2.4 * -3.7 8.88 What is 62 times 0.3? 18.6 0.6 * 4.1 2.46 Multiply 31 and 100. 3100 47 * 10 470 9 times 0.09 0.81 Calculate -0.04627. -0.3234 -16470.1 -164.7 Product of -28 and -6. 168 Calculate 0.31932. 579.6 -2.82 -2 5.64 Multiply 5.16 and 4. 20.64 0.22 times -0.0434 -0.009548 -482 times -5 2410 Product of 1 and -230. -230 4480.14 62.72 What is 78 times -0.5? -39 What is the product of -0.1 and 30? -3 What is 31 times -0.46? -14.26 Multiply -0.3 and 2261. -678.3 -86-0.6 51.6 -0.06 * -31.6 1.896 What is 2.4 times 62? 148.8 3-1006.6 -3019.8 Product of 0.4 and -0.32. -0.128 0.093 -30 -2.79 0.21315 263 Work out 15 -17. -255 -4 * 0.1225 -0.49 What is the product of -15820 and 0.1? -1582 Work out 3 * -0.027. -0.081 What is -9 times -0.16? 1.44 Product of 133 and -1. -133 Product of 3.26 and -0.4. -1.304 Calculate -0.5-2.44. 1.22 -5 -178 890 Product of 1428 and 5. 7140 Product of 0 and 5.8. 0 What is the product of 11355 and -0.3? -3406.5 Product of 0.29 and 134. 38.86 Calculate -0.4-1.57. 0.628 Product of -1317 and -0.4. 526.8 -3.1 76 -235.6 Work out -0.07 * -1.7. 0.119 Calculate 0.263. 12.6 Product of 0.2143 and 2. 0.4286 What is 8 times 0.14? 1.12 31.3 3.9 Calculate -23410.2. -468.2 -7 times -0.5 3.5 Multiply 178 and 0.2. 35.6 -3128 -1 3128 -3-511 1533 -0.17-2 0.34 What is the product of -208.3 and -0.4? 83.32 What is -4.32 times -0.3? 1.296 207 times 7 1449 Work out -0.1 * -0.27. 0.027 -4 * -65.2 260.8 9 times 157 1413 Product of 7 and 0.19. 1.33 2.353 * 1 2.353 What is the product of -0.2 and -0.377? 0.0754 Calculate 0.5*-147. -73.5 What is the p	{ "pile_set_name": "DM Mathematics" }
ase 15 6e What is 511 (base 15) in base 5? 14031 Convert -1796 (base 13) to base 6. -24115 What is 202 (base 11) in base 15? 114 Convert 82 (base 11) to base 9. 110 What is 1b8 (base 12) in base 9? 345 What is 2c19 (base 15) in base 13? 440a 21982 (base 10) to base 13 a00c Convert -331 (base 12) to base 15. -214 40221 (base 5) to base 2 101000000001 -24598 (base 10) to base 12 -1229a -1c4a2 (base 13) to base 5 -3240413 -43565 (base 7) to base 8 -25255 What is 5043 (base 6) in base 3? 1112000 What is -451 (base 14) in base 4? -31113 Convert 761 (base 11) to base 14. 494 Convert -205530 (base 6) to base 2. -100000110111110 Convert 13 (base 16) to base 11. 18 10100001011011 (base 2) to base 3 112011122 What is 94dd (base 15) in base 13? 1143a What is -788 (base 9) in base 8? -1207 Convert 101355 (base 7) to base 12. a049 What is 152250 (base 8) in base 2? 1101010010101000 Convert 2050 (base 6) to base 11. 390 What is -1c2 (base 15) in base 6? -1515 -3613 (base 8) to base 5 -30211 What is -303132 (base 4) in base 7? -12414 Convert 212350 (base 8) to base 10. 70888 What is 1621 (base 8) in base 6? 4121 101 (base 10) to base 9 122 -16252 (base 7) to base 13 -2125 What is 41624 (base 7) in base 11? 7787 What is d7 (base 16) in base 14? 115 What is -3614 (base 7) in base 3? -1211102 Convert 13020 (base 4) to base 7. 1221 What is 20084 (base 11) in base 5? 1414444 Convert -5178 (base 12) to base 9. -13152 Convert -2103331 (base 4) to base 11. -7129 14b (base 14) to base 12 19b 3365 (base 8) to base 10 1781 Convert 110010100111010 (base 2) to base 9. 38483 Convert -30022222 (base 4) to base 6. -1022414 What is 15610 (base 8) in base 11? 5328 Convert -6b0 (base 12) to base 2. -1111100100 What is 10105 (base 7) in base 14? c75 1b9e (base 16) to base 14 2810 Convert 1121011 (base 3) to base 14. 5d3 1543 (base 6) to base 2 110100111 What is -11010 (base 2) in base 11? -24 What is 100001010 (base 2) in base 5? 2031 Convert -10101001000100 (base 2) to base 7. -43355 Convert -2282 (base 12) to base 11. -2983 -101 (base 5) to base 9 -28 What is 1435 (base 10) in base 6? 10351 Convert 32672 (base 8) to base 2. 11010110111010 -1111000011 (base 2) to base 11 -7a6 225 (base 6) to base 4 1121 Convert -244 (base 13) to base 9. -477 -1120221102 (base 3) to base 9 -46842 Convert -647 (base 8) to base 15. -1d3 10220020 (base 3) to base 6 21053 Convert -55a0 (base 11) to base 3. -101002222 -20340 (base 6) to base 5 -41344 Convert -2723 (base 10) to base 15. -c18 What is -122302 (base 4) in base 5? -23324 8146 (base 13) to base 11 12415 What is 575 (base 8) in base 16? 17d -3022303 (base 4) to base 6 -140031 e0 (base 16) to base 3 22022 Convert -112210222 (base 3) to base 9. -15728 Convert 29b (base 16) to base 15. 2e7 Convert -21201 (base 6) to base 5. -43011 What is -1336 (base 7) in base 13? -30a -634 (base 8) to base 15 -1c7 6568 (base 14) to base 4 10102000 9123 (base 14) to base 11 177a8 -3216 (base 11) to base 2 -1000010011100 Convert 23013 (base 4) to base 3. 222100 -142501 (base 6) to base 8 -32405 4112 (base 6) to base 8 1614 -55638 (base 9) to base 7 -212534 -10103 (base 4) to base 6 -1135 What is 22552 (base 7) in base 10? 5770 What is 33 (base 8) in base 16? 1b Convert ba4 (base 14) to base 5. 33200 Convert -131521 (base 6) to base 4. -2330221 What is 32013 (base 5) in base 12? 1299 What is -35 (base 9) in base 5? -112 -117 (base 9) to base 14 -6d What is -104131 (base 5) in base 10? -3666 3021 (base 14) to base 16 2045 What is -359e (base 15) in base 6? -124435 -155650 (base 8) to base 7 -322641 Convert -23740 (base 13) to base 16. -fdb4 18a0 (base 15) to base 16 14cd 4749 (base 15) to base 13 6b7c Convert 1010211212 (base 3) to base 9. 33755 Convert -687 (base 9) to base 10. -565 What is -3225 (base 7) in base 14? -5bc Convert 24133 (base 5) to base 6. 12145 -110111000111000 (base 2) to base 3 -1102201001 What is -95a (base 13) in base 14? -820 What is 201432 (base 5) in base 8? 14534 Convert 70b (base 13) to base 6. 5310 What is 11582 (base 10) in base 5? 332312 Convert -22302032 (base 4) to base 5. -2403144 -5075 (base 14) to base 15 -4168 Convert -6020 (base 9) to base 16. -1128 What is -62d (base 14) in base 5? -14332 Convert -38520 (base 10) to base 14. -10076 -16 (base 10) to base 8 -20 What is 775 (base 11) in base 6? 4145 11100010111 (base 2) to base 3 2111020 Convert -128376 (base 9) to base 10. -78315 246 (base 9) to base 15 d9 What is 410 (base 6) in base 2? 10010110 Convert 2012020 (base 3) to base 15. 719 What is 100001110111 (base 2) in base 8? 4167 What is 1180 (base 14) in base 13? 150a What is -10011101010000 (base 2) in base 14? -394c Convert 210 (base 6) to base 2. 1001110 Convert -a37 (base 15) to base 9. -3137 What is -24 (base 6) in base 14? -12 Convert 101034 (base 5) to base 10. 3269 What is 5662 (base 10) in base 9? 7681 What is 346 (base 8) in base 6? 1022 What is 64e0 (base 16) in base 13? b9a6 Convert 60b8 (base 12) to base 13. 4a24 What is 7a8 (base 13) in base 12? 921 1aa (base 11) to base 8 361 What is -537 (base 11) in base 16? -285 What is -106224 (base 7) in base 4? -10220211 Convert 44c (base 15) to base 4. 33030 4889 (base 13) to base 8 24015 Convert -4 (base 6) to base 2. -100 20110 (base 8) to base 3 102100002 Convert 1553 (base 10) to base 12. a95 What is -213123 (base 4) in base 3? -10110110 What is -10010000011111 (base 2) in base 9? -13614 What is -86c (base 13) in base 9? -1872 What is -2372 (base 13) in base 6? -35042 What is -10 (base 13) in base 11? -12 What is 305 (base 7) in base 13? b9 -346d (base 15) to base 2 -10101101111000 What is -13a (base 13) in base 2? -11011010 What is 23591 (base 12) in base 2? 1011100101111101 What is 2a2b (base 12) in base 3? 20202122 What is -704 (base 13) in base 4? -102203 1111101110 (base 2) to base 9 1337 -145 (base 16) to base 5 -2300 Convert -202211 (base 3) to base 9. -684 What is 1441220 (base 5) in base 13? 11040 What is 1534 (base 8) in base 12? 5b8 720 (base 9) to base 16 249 What is 17533 (base 8) in base 2? 1111101011011 102110200 (base 3) to base 12 4a09 Convert -2dc6 (base 14) to base 15. -2675 What is -736 (base 9) in base 7? -1515 What is -11113203 (base 4) in base 9? -33140 Convert 97 (base 16) to base 11. 128 3304 (base 7) to base 12 824 -1203030 (base 4) to base 13 -2b74 Convert 6460 (base 7) to base 14. ba0 5372 (base 10) to base 7 21443 Convert e90 (base 16) to base 15. 1188 Convert -101000001010 (base 2) to base 8. -5012 Convert -1381 (base 15) to base 3. -12201111 Convert 223020 (base 5) to base 12. 4691 Convert 13323 (base 7) to base 11. 2778 -112200002 (base 3) to base 2 -10100111000110 -2430 (base 7) to base 15 -403 Convert 222222 (base 3) to base 5. 10403 What is -3a1 (base 14) in base 2? -1011011001 -6a1 (base 14) to base 15 -5cc What is 355 (base 10) in base 3? 111011 Convert 36916 (base 10) to base 8. 110064 -10010 (base 4) to base 9 -318 Convert -7787 (base 12) to base 9. -20104 Convert 38aa (base 11) to base 10. 5081 40 (base 12) to base 13 39 -4223 (base 5) to base 2 -1000110011 5082 (base 9) to base 11 2881 What is -1648 (base 12) in base 15? -bb8 Convert -a9cb (base 13) to base 3. -1012110020 Convert -21005 (base 6) to base 13. -1385 Convert 2201221 (base 3) to base 15. 8d1 -3043040 (base 5) to base 3 -2112021100 -6357 (base 10) to base 2 -1100011010101 -529 (base 11) to base 13 -39c 526 (base 16) to base 9 1724 -232112 (base 4) to base 14 -111c What is 101010001101 (base 2) in base 16? a8d Convert 28d (base 16) to base 8. 1215 Convert 483 (base 9) to base 14. 207 Convert 111323 (base 4) to base 16. 57b Convert -6cd9 (base 14) to base 15. -5972 1556 (base 7) to base 8 1165 Convert b67 (base 16) to base 6. 21303 What is -26 (base 13) in base 4? -200 Convert -3b8 (base 13) to base 2. -1010010010 What is 625 (base 12) in base 7? 2414 What is 200102 (base 3) in base 7? 1310 What is -15089 (base 11) in base 12? -10469 What is ac2 (base 13) in base 11? 1430 -1212 (base 5) to base 13 -110 2012332 (base 4) to base 11 6543 8cc1 (base 13) to base 16 4d31 Convert 1a19 (base 13) to base 8. 7505 What is -30231 (base 5) in base 2? -11110010101 Convert -1416 (base 8) to base 10. -782 6a2 (base 12) to base 9 1315 Convert -314e (base 15) to base 12. -6048	{ "pile_set_name": "DM Mathematics" }
et x(w) be the second derivative of w5/20 + w4/4 - 7w3/2 + 11w*2/2 + 2w + 32. List the prime factors of x(8). 547 Let n = -27948 - -49776. List the prime factors of n. 2, 3, 17, 107 Let p(k) = k*2 + 19k + 29. Let w be p(-20). List the prime factors of -2 + w/35 - 273/(-5). 2, 3 Let x(k) = 35k2 + 181k + 1208. List the prime factors of x(-47). 2, 547 Let r(q) = 2q3 - 8q*2 + 9q - 5. Let l be (-10)/(-6)(-6)/(-2). Let v be r(l). List the prime factors of (-63)/(-5) - (-36)/v. 13 Suppose d + 5z = 1021, 6d + 1015 = 7d - z. Suppose -9y + d = 53. List the prime factors of y. 107 Suppose 3h - 47 = -8. Suppose 18g - hg = 1000. List the prime factors of g. 2, 5 Let q = -114 + 114. Suppose -2b - 12m + 25 = -15m, q = 2b + 2m. Suppose 2z + z + bo - 461 = 0, -3z - o = -469. List the prime factors of z. 157 Suppose -106417 - 120433 = -26b. What are the prime factors of b? 5, 349 Let l = -9376 + 12514. List the prime factors of l. 2, 3, 523 Let o(z) = -z + 9. Let m be o(13). Let y(q) = -2 - 17q - 6q + 1. List the prime factors of y(m). 7, 13 Let v(j) = -j3 + 2j*2 + 7j + 6. Let t be v(-2). List the prime factors of (-3198)/(-24) + (-2 - (-14)/t). 7, 19 Suppose 0 = -10i + 47128 + 6506 + 65876. What are the prime factors of i? 17, 19, 37 Let p be -1 + ((-30)/(-18))/(1/3). Let x(o) be the first derivative of 7o*2/2 - 14o + 3. What are the prime factors of x(p)? 2, 7 Let b(l) = l*2 + 5l - 37. Let r be b(-9). Let j = 417 + r. What are the prime factors of j? 2, 13 Let q(h) = 9h2 - 17h - 29. Let o(m) = -2 - 3m2 + 7 - m2 + 9m + 9. Let g(y) = -5o(y) - 2q(y). List the prime factors of g(9). 3, 17 Let b(o) = -955o3 - 16o*2 + 36o + 117. List the prime factors of b(-3). 2, 3, 5, 19 Let w = 859 - -650. Suppose -t = -3d - 1004, 2t + 3d = 490 + w. List the prime factors of t. 7, 11, 13 List the prime factors of (4215/(-9))/((-7)/(-12)2/(-28)). 2, 5, 281 Let h(d) = -d*3 - 17d*2 + 20d + 125. What are the prime factors of h(-23)? 17, 167 Let y be (16 - 20)62/(-8). Suppose 11343 = -12l + yl. What are the prime factors of l? 3, 199 Let j be (-1 + 3)-1 - -819. Let y = -51 + j. Suppose y = 12i - 374. List the prime factors of i. 5, 19 Let j = -9986 - -19351. List the prime factors of j. 5, 1873 Suppose 5o + 495 = 6o + 5t, 0 = 3o + 4t - 1463. List the prime factors of (-6 + o/(-10))(2 - 4). 109 Let u = -9124 - -15995. What are the prime factors of u? 6871 Suppose -3p - 2p - 6705 = -5f, 5 = -5p. Suppose 2b = -5 + 13, 5h - f = -5b. List the prime factors of h. 2, 3, 11 List the prime factors of 27/6(-279664)/(-252). 2, 11, 227 Suppose 2r + 2a - 92 = 0, 4r + 3a = -r + 234. Suppose -h + 8 = n - 15, 3h - n = 49. Let w = h + r. What are the prime factors of w? 2, 3, 11 Let u = 49 + -35. Let q = u - 20. Let c = q - -14. What are the prime factors of c? 2 Let m(r) = -6r + 87. Let h(p) = -2p + 29. Let x(y) = 8h(y) - 3m(y). Let l be x(12). What are the prime factors of (-2)/((40/372)/l)? 3, 31 Suppose -4g + 3u + 133 = 4u, -3g - 4u + 116 = 0. Let x be (-81)/4g/(-6) + -1. Suppose k = -40 + x. What are the prime factors of k? 67 Suppose -126b + 711378 = 135625 - 2364583. What are the prime factors of b? 2, 2917 Let r(s) be the second derivative of -s5/30 + s4/24 + 30s*3 + 2s*2 - 11s. Let m(z) be the first derivative of r(z). List the prime factors of m(0). 2, 3, 5 List the prime factors of (-5 - 0) + 24 + 1766 + -6. 3, 593 Let v(z) = 6494z + 122. What are the prime factors of v(2)? 2, 3, 5, 19, 23 Let n(c) = 12c*2 + 58c - 10. List the prime factors of n(15). 2, 5, 89 Let q = 175 - 162. List the prime factors of (q/13)/((-1)/(-445)). 5, 89 Let y(s) = -s*3 + 12s*2 + 10s - 4. Let g be y(13). Let p = 52 + g. Suppose -6r + 399 = -p. What are the prime factors of r? 2, 17 Suppose 98r - 126290 - 158596 = 0. What are the prime factors of r? 3, 17, 19 Let d(m) = -129m2 + 23 - 92 - 9m + 130m2. List the prime factors of d(22). 7, 31 Suppose -6o + 3h = -3o - 228, 0 = -2h + 8. Let d = 62 - o. Let s = 34 - d. List the prime factors of s. 2, 13 Let n(d) be the third derivative of 0 + 0d - d*4 - 7/6d*3 - 1/60d*5 - 2d*2. List the prime factors of n(-21). 2, 7 Let v(l) = -21l*3 - 2l*2 + 6. What are the prime factors of v(-5)? 29, 89 Let g(b) = 6b*2 + 5b + 2. Let i be g(4). Suppose -j = 4x - 29 + 353, 5x + 404 = -j. Let y = x + i. List the prime factors of y. 2, 19 Let l(c) = c*3 + 13c*2 + 11c - 10. Let v be l(-12). Suppose 2p = -vp + 16, -4k + 628 = 5p. Suppose -k + 717 = 5w. List the prime factors of w. 113 Let c = 2513 + 1437. List the prime factors of c. 2, 5, 79 Let t(w) be the third derivative of w5/120 + 7w4/8 + w3/2 + 16w2. Let s(v) be the first derivative of t(v). List the prime factors of s(5). 2, 13 List the prime factors of (-367932)/(-144) + 4/(-48). 5, 7, 73 Let v = 41365 + -18741. List the prime factors of v. 2, 7, 101 Let j(r) = 2r*3 - 11r*2 + 79r + 1. List the prime factors of j(16). 29, 229 Suppose -18 = 20p - 26p. Suppose -3x = 9, px = -i + 18 + 5. What are the prime factors of i? 2 Let f = -4620 - -9639. List the prime factors of f. 3, 7, 239 Let b = -28871 + 53157. What are the prime factors of b? 2, 12143 Let h be 4/18 + (-27842)/(-18). Suppose 3439 = 5j - 3s - h, -4s = 8. Suppose 3m + 3m - j = 0. What are the prime factors of m? 2, 83 What are the prime factors of (22015 - 1) + 280/(31 - 59)? 2, 5501 Suppose -f - 368937 = -4r, 6r - 11r + 3f = -461173. What are the prime factors of r/(-107)(-2)/(0 + 2)? 2, 431 Let s be (-649020)/70 + 6/(-21). List the prime factors of (-4)/30 + -4 + s/(-15). 2, 307 Suppose 485r - 11103967 = 9986258. List the prime factors of r. 3, 5, 13, 223 Suppose -3l + 35177 = -4k, 3k = -2l + 7l - 58632. List the prime factors of l. 3, 1303 Let y(j) = 7779j2 + 292j + 885. List the prime factors of y(-3). 2, 3, 5, 389 Let d(y) = -193y - 22. Let k be d(2). Let h = -181 - k. List the prime factors of h. 227 Suppose 0 = 22b - 21b - 6. Suppose 15 = -by + 81. Suppose -7x + yx - 228 = 0. What are the prime factors of x? 3, 19 Let m(y) = -y + 7. Let c be m(-15). Let h = c + -19. Suppose -hp - 2r + 80 = 0, r - 102 = -4p + 3r. List the prime factors of p. 2, 13 Let v = 3152 - 47. Let j = v + -1710. List the prime factors of j. 3, 5, 31 Let s(o) = -51o3 + 33o*2 + 385. List the prime factors of s(-11). 11, 6569 Let y(n) = 84n*2 - 26n - 116. Let o be y(-5). Suppose -22v + o = -20v. What are the prime factors of v? 7, 151 Let d(n) = -232n + 119. Let b be d(-6). Suppose -2v + 1548 = -3t + 549, -b = -3v + 2t. What are the prime factors of v? 3, 13 What are the prime factors of -41094(14 + 340/(-24))? 3, 761 Suppose 0 = -129l + 15317 + 164380. What are the prime factors of l? 7, 199 Suppose -5j - 3a = -57726, -3a - 14750 = -j - 3212. What are the prime factors of j? 2, 3, 13, 37 Suppose -5q + 4 - 19 = -4h, -25 = -4h - 5q. Suppose 2w + 3c = -w - 96, 4w - hc = -110. Let r = 36 + w. What are the prime factors of r? 2, 3 Suppose -z + 4 = h - 0z, h + 5z + 16 = 0. Let m be h/6 + 3 - (-3)/6. Suppose 3b - m = 4, -5s + 4b + 683 = 0. What are the prime factors of s? 139 Let o(y) = 9y*2 + 4. Let x be o(-2). Suppose -l - v + x = 3v, 2v + 50 = 3l. Let c = l + 63. List the prime factors of c. 83 Suppose 17409 = 5o + 2u, 12u = -3o + 8u + 10451. Suppose 5r + 2f - o = 0, -5f = -r + 4r - 2100. List the prime factors of r. 5, 139 Let r be (22)/((-8)/(-580)). List the prime factors of r/(-12)60/(-10). 5, 29 Let s(a) = 128a + 9. Suppose -5g = -3 - 7. Let h be s(g). Suppose h = -4y + 713. List the prime factors of y. 2, 7 Let n(m) = -m*3 - 15m*2 + 14m - 29. Let h be n(-16). Suppose -ht - 7 = 4f + 15, 5f = 3t - 14. List the prime factors of 198/(-55)55/t. 3, 11 List the prime factors of (4/(-6))/((-79)/1013649). 2, 7, 13, 47 Let k = 19892 - 3327. What are the prime factors of k? 5, 3313 Suppose -42k + 6 = -40k. Suppose -5d - 16 = -4l, -kd - 8 = -3l + 4. Suppose -168 = -c - 3j, -4c + 4j - 9j + 686 = d. List the prime factors of c. 2, 3, 29 Let g = 171 - 167. Suppose 3z - 6 = 0, -gz + 1289 = 3u - 0*z. List the prime factors	{ "pile_set_name": "DM Mathematics" }
r of t and w. 35 What is the common denominator of ((-4)/(-40) - 0)/(4(-44)/408) and 83/80? 880 Let p = 499 - 426. Suppose -6s + 11 = -p. Suppose 4c + 78 = 5l, -5l + c - 4c = -64. What is the lowest common multiple of l and s? 14 Let i(f) = -f*3 - 5f*2 - f - 3. Let o be i(-5). Suppose -o + 9 = 4k - 5t, k = 3t. Calculate the least common multiple of (-23 + 31 - (-1 + 4)) + 47 and k. 156 Let q = -10993757/132 - -83287. Find the common denominator of 68/231 and q. 924 Let l = -230 + 470. Suppose l = 8n + 7n. Calculate the least common multiple of 254 and n. 2032 Let r(p) = -168p2 - 3117p + 40. Calculate the least common multiple of 5142 and r(-18). 5142 Let i(x) = 7x - 28. Let u be i(4). Calculate the common denominator of 65/8 and (0 - (u - 2))2/(-48). 24 Calculate the smallest common multiple of 2016 and (-35)/5 + -5 + -9 + 133. 2016 Calculate the smallest common multiple of 5534 and (-75)/(-50) - 15/(-2). 49806 Let h = 13 + -11. Suppose -58 = hd - 0d. Let s = 39 + d. What is the least common multiple of s and 6? 30 Suppose -4z - 17z + 502 = 82. What is the smallest common multiple of 10788 and z? 53940 Let f = 142 - 1558/11. Find the common denominator of (119/272)/(6/(-104)) and f. 132 Let k(l) = l*2 + 15l - 10. Calculate the smallest common multiple of ((1 - -4)-1)/(10/(-36)) and k(-16). 18 What is the common denominator of (-234)/52(-4 + (-354)/(-63)) and 13/518? 518 Let q = 1336450501178933/409518926908680 + -2/20050867945. Let k = q - -24/851. Find the common denominator of (6/(-32))/(4/(-208)) and k. 24 Let g = -78459/20 + 3922. Let s = -267396479/498 + 536941. Calculate the common denominator of s and g. 4980 Let x = 23246 + -22376. Calculate the least common multiple of 1421 and x. 42630 Let m = 71709199/76335 + -20/15267. Let x = m - 943. Find the common denominator of x and 54/5. 5 Let h = -30210/4799 - -12992011507/2063824347. Let k = h + 74572479301/19782438. Let g = -3769 + k. What is the common denominator of g and 21/20? 460 Let q = -2479752 + 32593860305/13144. Calculate the common denominator of 113/6 and q. 39432 What is the common denominator of 1549/456 + -3 + (8/(-3) - -2) and -11/9? 1368 What is the common denominator of 124/74 - (26 - 24) and 79/222? 222 Let n = 35339 - 35324. What is the lowest common multiple of 348 and n? 1740 Calculate the common denominator of 68/(-1462)1/12 and -55/2. 258 Let y = 2727 - 73640/27. Find the common denominator of -79/216 and y. 216 Calculate the common denominator of 2 + -8 + 532/(-5328)-58 and -11/4. 1332 Let w = -408/209473 + 7496735206/628419. Let t = 11928 - w. Find the common denominator of t and 65/27. 297 What is the common denominator of 7/45 and (11100966/16660)/129 - (-1 + 6)1? 4410 Calculate the common denominator of 38/55 and (15571/825 + 30/(-5) - 7) + -6. 825 Let v = 556 - 353. Let m = -197 + v. Calculate the smallest common multiple of m and 6. 6 Let f be ((-13569)/362 + -2)/6. Let m be (12/(-30))/((-2142)/15 + -2). Let s = f - m. What is the common denominator of s and -23/28? 84 Suppose -5h + 4152 = -7248. Find the common denominator of 2 + 2-1 - h/(-200) and -61/60. 60 Let y = 10/3041 - -202587/352756. Find the common denominator of 83/16 and y. 464 Calculate the smallest common multiple of -8 - (138 - -11)/(4 - 5) and 111. 5217 Let d = 8779 - 8405. Calculate the lowest common multiple of 2992 and d. 2992 Let y = -643823/3 - -5048161/24. Let m = 4277 + y. What is the common denominator of m and 121/204? 408 Let u = -32352589/266 - -121626. What is the common denominator of u and -39/38? 266 Let o be (6/264)/(28460/(-1252970)). Let i = o + 17/1423. What is the common denominator of i and -127/110? 440 Let q = -6814751/1344 - -35492/7. What is the common denominator of q and 61/232? 5568 Let d(n) = 30n*2 + n + 2. Let t be d(-2). Calculate the common denominator of (-1641)/90 - 9/15 and (-5532)/t - (-4)/(-10). 6 Let n(w) be the first derivative of 2w*3/3 + 15w*2/2 - 4w - 1296. Let i be (-2)/(-3) - (-78)/(-9). Calculate the lowest common multiple of 13 and n(i). 52 Let z = 1662 - 1350. Calculate the smallest common multiple of 21 and z. 2184 Let a = 15/397 - -42179/7940. What is the common denominator of a and -1/3430? 6860 Suppose 0 = -2v + 4058 - 4040. Calculate the least common multiple of 258 and v. 774 Let h = -747799 - -2742926769/3668. Find the common denominator of h and -97/32. 29344 Let q(n) = -4653n*2 - 32n + 159. Let g be q(6). Let v = -20104747/120 - g. Find the common denominator of v and 73/40. 120 Let a = -21 - -39. Let m be (-8)/(1104/(-247446)) + (-4)/46. Let r = m + -1643. Calculate the smallest common multiple of a and r. 450 Let p(o) = -o*2 + 22o - 57. Let g be p(4). Suppose 0 = -3k + g + 15. What is the smallest common multiple of k and 6? 30 Let r(f) be the first derivative of -6f*2 - 78f + 6. Calculate the least common multiple of r(-7) and 3. 6 Suppose 3 = 2v - 5v. Let x be (-2 - -24)/(v/(-1) + 1). Suppose -7q + 8q = x. What is the smallest common multiple of q and 5? 55 Let x(u) = 44u3 + 2u*2 + 4u + 2. Let w be x(-2). Find the common denominator of 77/72 and (7/(w/45))/((-6)/(-17)). 360 Suppose 10n + 2v - 903 = 1125, -2v = 4n - 804. Calculate the smallest common multiple of 28 and n. 1428 Let t(y) = 2186y + 42. Let s be t(3). Find the common denominator of -25/22 and (-1 - -3) + 4 + (-46260)/s. 110 Let d(y) = 2709y - 4415. Calculate the least common multiple of 6496 and d(3). 25984 Suppose -4 = 49w - 50w. Suppose 4f + 6i = wi + 1248, 2f = -4i + 612. Calculate the lowest common multiple of f and 2. 314 Suppose 0 = 4x + 4a - 21368, 3x + 25a - 30a - 16010 = 0. What is the lowest common multiple of x and 801? 16020 Let i(s) = -19s - 16. Let x be i(-3). Suppose -2n - 2l + 26 = 0, -4l - x = -3n + 33. Calculate the smallest common multiple of n and 6. 18 Let p = 5774 - 5756. Calculate the smallest common multiple of p and 306. 306 What is the lowest common multiple of -7(36/54 - 338/3) and 490? 3920 Let r(j) = -2j - 17. What is the smallest common multiple of (14/(-14))/(-1)19 and r(-10)? 57 Let f(j) = j*3 + 15j*2 + 5j - 36j2 + 0j*3 + 15j*2 - 20. Calculate the smallest common multiple of f(6) and 1. 10 Calculate the least common multiple of 87/9 - (1 + -3 + (-5)/(-3)) and 440. 440 Suppose -66n + 18 = -63n. Find the common denominator of 1 + 5 - 3 - (-4)/(-48) and (-13)/(-26)17/n. 12 Suppose -1383 = -3w + 6. Let d = w + -1426/3. Let r = -195149/60312 + -7/2872. Find the common denominator of d and r. 21 Let h(y) = -11y + 38. Let r be h(3). Suppose -3d - 8 = -rd. What is the least common multiple of d and 44? 44 Suppose 63 = -59q + 66q. What is the lowest common multiple of 81 and (30/q)/(((-130)/135)/(-13))? 405 Find the common denominator of 119/228 and ((-49)/(-21))/((-110)/(-75)). 2508 What is the common denominator of ((-18)/(-4))/9 + (96/44)/8 and 45/296? 3256 Let i(f) = f*2 + 9f - 61. Let o be i(4). What is the common denominator of 3/o + 4175/3150 and -111/70? 630 What is the common denominator of 57/16 and (332/16)/(260/(-91)) - -8? 80 Let r = 10968 - 10929. What is the least common multiple of 210 and r? 2730 Let n be (-4 - (-64)/(-3))177 - 3. Let y be (323382/(-20))/(36/(-10)). Let p = y + n. Calculate the common denominator of 61/12 and p. 12 Let n = 3896 + -46807/12. What is the common denominator of -11/8 and n? 24 Let q(v) = -v3 + 105v*2 - 89v - 1539. Calculate the smallest common multiple of 2535 and q(104). 17745 Let i be 2221402/22980-3794/12764. Let g = i + 5375/19146. Let h = g - -1/1915. What is the common denominator of 19/2 and h? 10 What is the least common multiple of 670 and (-243)/(-54)(-804)/(-9)? 2010 Let z = -3133 - -3877. What is the least common multiple of z and 84? 5208 Suppose 5m + 80 + 76 = 3u, 0 = u + 5m - 72. Calculate the common denominator of (-274)/(-48) - u/19 and 28/1810/7. 72 What is the common denominator of 13/12828 and 1422/2370130/(-72)? 12828 Suppose -4b + 0 = 3b - 476. What is the smallest common multiple of b and 10? 340 Suppose -4l = 4u - 5l - 583, 732 = 5u + 2l. Suppose 0y - 4y = 2f + 268, 4y = f + u. What is the common denominator of f/(-16)10/15 and -33/52? 52 Let	{ "pile_set_name": "DM Mathematics" }
r when 123 is divided by (-4)/1f/(-12). 11 Calculate the remainder when (-5)/(-10) + (-969)/(-6) is divided by 19. 10 Let i(s) = -4s + 1. What is the remainder when 245 is divided by i(-10)? 40 Let u be 2 + 2 - (-2 - -4). Suppose 0 = -ud + 8 - 2. What is the remainder when 11 is divided by d? 2 Let r(o) = 5o*2 + 13o + 1. Let i(n) = -5n2 - 12n - 1. Let w(c) = -3i(c) - 2r(c). Calculate the remainder when w(-4) is divided by 11. 8 Let t(f) = 3f - 1. Let m be t(0). Suppose -2p + 31 + 111 = 3s, -s + 42 = -2p. Calculate the remainder when s is divided by 16 + 1/m + (-12)/(-12). 14 Suppose -15a = -189 - 201. Suppose -s = -9 - 7. Calculate the remainder when a is divided by s. 10 Let g(o) = o3 - 66o*2 - 136o + 73. What is the remainder when g(68) is divided by 92/6 - 1/3? 13 Suppose 2x + 6o = 10o + 44, 5x = -o + 66. What is the remainder when 529 is divided by x? 11 Let r be (-1 + -1)(-180)/40. Suppose -6y = ry - 690. What is the remainder when y is divided by 7? 4 Let i(x) = 2x*2 + 19x + 3. Calculate the remainder when 932 is divided by i(-11). 32 Let i = -18 + 18. Suppose i = -r - 0w - 2w + 15, -27 = -3r + 3w. Let j = r + -7. Calculate the remainder when 13 is divided by j. 1 Suppose 4n = 3j + 72, 4j + 7 - 51 = -4n. What is the remainder when 96 is divided by n? 6 Let n = 0 - -2. Suppose nf = -6 + 14. Suppose 0 = 2o + 5j - 35, 0 = -2o + 2j + 7 + 7. What is the remainder when o is divided by f? 2 Let r(n) = n2 + 4n + 6. Let u be r(-2). Suppose -ut = 5m - 163, 2m + m - 102 = 3t. What is the remainder when 64 is divided by m? 31 Let h(t) = -8t + 12. Let q be h(-7). Calculate the remainder when 118 is divided by q/(-2)2/(-4). 16 Let p = -7 - -19. Suppose -2z = -5x + 13, 14 = -x + 5x + 2z. Suppose -81 = -2r + 2s - 7, 117 = xr - 5s. Calculate the remainder when r is divided by p. 10 Let h = 566 - 458. Calculate the remainder when h is divided by 28. 24 Let a(g) = -3g - 12. Let c(w) = -2w*2 + 3w + 4. Let s be c(3). Let q be a(s). Let k = q + 8. What is the remainder when 41 is divided by k? 8 Suppose 0 = -2x + 1 + 7, -12 = -3b - 3x. Suppose b = 6m - m - 340. Calculate the remainder when m is divided by (-2)/3 - (-355)/15. 22 Let w(v) = 37v3 - 2v*2 + 4v - 8. What is the remainder when w(2) is divided by 58? 56 Let x = -67 - -70. Let f(r) = 2r2 + 2r - 15. Suppose 0 = -0s - s + 3v + 5, 3s = 5v + 31. What is the remainder when s is divided by f(x)? 8 Let g(y) = -6y + 27. Let o be g(-6). Suppose -o = -5k - 4k. Let d = 36 - 11. Calculate the remainder when d is divided by k. 4 Suppose 3a = 2n + n + 255, 5n = -3a + 271. Let m = 53 + -43. Calculate the remainder when a is divided by m. 7 Let w be -21/8-28. Suppose 0 = 5v + 38 + w. Let j(k) = -k*2 - 9k + 5. What is the remainder when 13 is divided by j(v)? 3 Let m(y) = 24y3 + 2y*2 - 2y + 1. Let z(s) = s*3 + 7s*2 + 5s + 7. Let i be z(-5). Let p = 79 - i. What is the remainder when p is divided by m(1)? 22 Let t(m) = -7m + 11. Let r be t(6). Suppose -2k + 35 - 3 = 2i, -i + 21 = -4k. Calculate the remainder when r(-3 - -2) + 2 is divided by i. 16 Suppose 274 = 11j - 1. Let k = 62 - j. Suppose 0 = -5c + 2f + 44, -c - 5 = -7f + 2f. What is the remainder when k is divided by c? 7 Suppose 732 = 12j - 204. Calculate the remainder when 310 is divided by j. 76 Let t = -25 + 42. Let n(m) = 8m - 6m + 1 + m2 - 47m*3 + 0m. Calculate the remainder when n(-1) is divided by t. 13 Let w(a) = -14 - 71a + a2 + 71a. Calculate the remainder when 65 is divided by w(-6). 21 Suppose 26z - 23z - 201 = 0. Suppose -5c - 17 = -z. Suppose -23 = -5m + 162. Calculate the remainder when m is divided by c. 7 Let z = 129 + -48. Calculate the remainder when 163 is divided by z. 1 Let b(q) = -51q3 - q - 2. Let a be b(-1). Suppose 7c - a = -8. Calculate the remainder when c is divided by 3. 0 Suppose -5j - 4g = -342, -13j - 270 = -17j - 5g. Calculate the remainder when 277 is divided by j. 67 Let y = 158 - 145. Suppose -5v = -4l - 229, -4v + 208 = -2l + 5l. Calculate the remainder when v is divided by y. 10 Let g = 1137 + -1119. What is the remainder when 125 is divided by g? 17 Let t = 151 + -46. Suppose 3 = -2r + 13. Calculate the remainder when t is divided by -3 + 6 - r - -29. 24 Let q(z) = z2 - 3z*2 + 4z*3 - 7z*3. Let t = -46 - -44. What is the remainder when 46 is divided by q(t)? 14 Suppose h - 57 = -4a, -2a - 67 = -3h + 146. What is the remainder when 125 is divided by h? 56 Suppose -5a + 0w - 20710 = -2w, 0 = 4a - 4w + 16580. What is the remainder when (1(-1)/2)/(46/a) is divided by 16? 13 Suppose -i = 4 - 49. Suppose -i = -5r + 4q, 0 = -2r - 3r + 2q + 35. Calculate the remainder when 17 is divided by r. 2 Let f = -46 - -198. Suppose -16j + f = -8j. Calculate the remainder when 55 is divided by j. 17 Let d = 1060 - 788. Calculate the remainder when d is divided by 66. 8 Let l = -81 - -92. What is the remainder when 84 is divided by l? 7 Suppose 0 = -7z + 2z + 35. Let p be ((-6)/(-5))/((-39)/1430). Calculate the remainder when (-2)/(-11) + ((-7056)/p)/9 is divided by z. 4 Let m(y) = -y - 33. Let o be m(-5). What is the remainder when 88 is divided by 28/(-8)6/(-7) - o? 26 Suppose 6 - 38 = -2r. Calculate the remainder when 285 is divided by r. 13 Let h be (-1)/((-1)/3 - 0). Suppose -hl - 5x = -71, -3l + 29 = -4x - 6. Calculate the remainder when 67 is divided by l. 16 Suppose 10u - 5u - 1676 = -2t, -4t + 3308 = -u. What is the remainder when t is divided by 44? 36 Let z = 371 - 349. What is the remainder when 569 is divided by z? 19 Suppose 3f - 40 = -3b + 14, f + 2b - 19 = 0. Calculate the remainder when 27f/34 is divided by 2. 1 Let h = 264 - 255. Calculate the remainder when h is divided by 2. 1 Let q = 165 + -149. What is the remainder when 238 is divided by q? 14 Suppose 7t = 11t. Suppose -y + ty + 6 = -c, 5y = 3c + 26. Calculate the remainder when 14 is divided by c + (-3 - -2) - -7. 2 Let j(f) = -f3 - 6f*2 - 8f - 10. Let t be j(-5). Suppose 8x + 24 = tx. Calculate the remainder when (4/(-3))/(x/132) is divided by 6. 4 Let b be 108/15 + 2/(-10). Suppose br - 30 - 61 = 0. Let a(n) = 5n*2 + n + 1. Calculate the remainder when a(2) is divided by r. 10 Suppose 159 = 15a - 456. What is the remainder when (-1224)/(-10) - 4/10 is divided by a? 40 Let y(w) = 14w + 23. Let r(m) = -14m - 24. Let g(o) = -3r(o) - 4y(o). Calculate the remainder when g(-7) is divided by 27. 24 Suppose 3m - 2z - 47 = 0, 5m + z - 91 = -2z. Suppose -115p + 9791 - 2316 = 0. Calculate the remainder when p is divided by m. 14 Let k = 186 + -105. Suppose 4l = -5b + k, -4b = -0b - l - 69. Suppose 2j + b = q, -5q + 76 = -3j + 2j. Calculate the remainder when q is divided by 6. 3 Suppose 0 = d - 5l + 1 - 46, 10 = 5l. Suppose 0 = 30k - 28k - 126. Suppose -4q + k - 7 = 0. Calculate the remainder when d is divided by q. 13 Suppose p + p - 50 = 0. Let o(x) = -42x. Let v be o(-1). Suppose -6z + 0z + v = 0. What is the remainder when p is divided by z? 4 Let c = 272 + -153. Let g = 125 - c. What is the remainder when 8 is divided by g? 2 Let a be (0 + 2)(-20)/2. Let v = a - -14. What is the remainder when (6 - 16)v/4 is divided by 6? 3 Suppose -b + 25 = -8. Let t(o) = -o3 - 5o*2 + 4o - 5. What is the remainder when b is divided by t(-6)? 5 Let n = -1557 - -1567. Calculate the remainder when 139 is divided by n. 9 Suppose 0 = -5w + 3u + 343, -2u = 31w - 30w - 79. Calculate the remainder when 424 is divided by w. 69 Let m = 373 - 565. Suppose 0 = 8g + 2 + 38. What is the remainder when 28 is divided by (-2)/g + m/(-20)? 8 Let y = -62 + 47. Calculate the remainder when 133 is divided by (-3 - 188/(-60)) + (-508)/y. 31 Suppose -8l = -5k - 4l + 170, 0 = 2l. Let u(z) = -5z - 1. What is the remainder when k is divided by u(-2)? 7 Let r = -175 + 475. What is the remainder when r is divided by 26? 14 Suppose -414f + 397f + 1547 = 0. Calculate the remainder when f is divided by 33. 25 Suppose 4p + 35 - 199 = 0. Suppose 0 = -0o + o. Suppose g = 4d + p, og - 99 = -3g + 4d. What is the remainder when 55 is divided by g? 26 Let v(d) = d3 - 8	{ "pile_set_name": "DM Mathematics" }
ominator of 87/35995652 and -81/24604. 35995652 What is the smallest common multiple of 118478240 and 2096960? 236956480 Calculate the common denominator of -77/276 and -55/10342042. 62052252 What is the smallest common multiple of 12160750 and 455? 158089750 What is the common denominator of 73/4981390 and -26/2490695? 4981390 What is the common denominator of 34/20550915 and 37/7425? 102754575 What is the common denominator of -13/51952358 and 37/2? 51952358 What is the smallest common multiple of 113794 and 2387? 271626278 Find the common denominator of 191/301120920 and 161/828082530. 3312330120 Calculate the common denominator of 131/30 and -131/867450. 867450 Find the common denominator of -73/19125768 and 155/210383448. 210383448 What is the lowest common multiple of 12622707 and 232218? 176717898 What is the smallest common multiple of 5395570 and 207? 48560130 What is the lowest common multiple of 33091733 and 5755084? 132366932 What is the least common multiple of 700 and 2424? 424200 Find the common denominator of -1/2939474 and 3/11757896. 11757896 Find the common denominator of -25/29249616 and -31/235884. 29249616 Calculate the lowest common multiple of 15080 and 6541240. 85036120 Calculate the lowest common multiple of 316635 and 6270. 633270 What is the smallest common multiple of 4428568 and 3? 13285704 What is the least common multiple of 30675273 and 71575637? 214726911 Calculate the smallest common multiple of 10686 and 281535. 7319910 Calculate the common denominator of 67/3109110 and -163/5550. 15545550 Calculate the common denominator of -109/11018628 and 35/5584. 44074512 What is the smallest common multiple of 58 and 7146678? 207253662 What is the lowest common multiple of 195 and 4230048? 274953120 Calculate the common denominator of 81/723284 and 79/158994. 787656276 Calculate the lowest common multiple of 16846489 and 44. 67385956 What is the smallest common multiple of 172908720 and 86454360? 172908720 Calculate the common denominator of 87/554 and -53/130744. 130744 Calculate the smallest common multiple of 338509 and 338. 114416042 Calculate the lowest common multiple of 1520 and 1097877. 87830160 Calculate the common denominator of -145/66 and 41/7739604. 85135644 Calculate the least common multiple of 247368 and 382296. 4205256 What is the smallest common multiple of 12087328 and 44? 12087328 What is the lowest common multiple of 332 and 10808744? 897125752 Calculate the smallest common multiple of 920360 and 484400. 9203600 Calculate the common denominator of -7/11262 and 37/13500. 25339500 Calculate the common denominator of -23/214092 and 169/2028240. 38536560 What is the common denominator of -43/415044 and -74/202419? 49390236 What is the lowest common multiple of 2 and 2963310? 2963310 Calculate the least common multiple of 2544433 and 93413. 277343197 Calculate the common denominator of 47/26750 and 111/17370808. 2171351000 Calculate the least common multiple of 3864355 and 65. 50236615 What is the lowest common multiple of 1633239 and 369? 66962799 Calculate the smallest common multiple of 65584 and 254138. 2033104 What is the lowest common multiple of 423392 and 29478668? 235829344 What is the common denominator of -12/6895 and 41/5836? 40239220 What is the least common multiple of 3699421 and 23035? 18497105 Find the common denominator of 29/31392 and 13/11608. 45549792 What is the lowest common multiple of 8670700 and 8? 17341400 What is the lowest common multiple of 23044336 and 141666? 69133008 Calculate the common denominator of -65/303534 and -37/3267. 3338874 Calculate the lowest common multiple of 71833 and 78922174. 2288743046 Calculate the smallest common multiple of 8606783 and 721. 60247481 Calculate the common denominator of 69/912274 and 17/456137. 912274 What is the smallest common multiple of 1666602 and 21798? 288322146 Calculate the smallest common multiple of 12816472 and 96. 153797664 What is the common denominator of 27/121293208 and -151/193656? 363879624 What is the common denominator of -21/5680 and -89/11140? 3163760 Calculate the common denominator of 31/1122 and 59/703494. 703494 Calculate the common denominator of -38/3443 and -51/3005. 10346215 Calculate the smallest common multiple of 10857 and 5082. 238854 What is the least common multiple of 164700 and 279990? 2799900 Calculate the common denominator of -63/200345 and 109/47140. 801380 What is the least common multiple of 145901644 and 6? 437704932 Calculate the lowest common multiple of 30 and 20440. 61320 What is the smallest common multiple of 32340 and 81270? 12515580 What is the least common multiple of 108 and 12663648? 12663648 What is the common denominator of 143/21833172 and 65/196498548? 196498548 Find the common denominator of 71/116572296 and -19/108. 1049150664 Calculate the smallest common multiple of 2474329 and 519090. 74229870 Calculate the least common multiple of 90916128 and 48. 90916128 What is the common denominator of 13/349600 and 137/7050? 49293600 What is the lowest common multiple of 147768 and 467932? 2807592 What is the least common multiple of 2379729 and 1110? 23797290 Calculate the lowest common multiple of 45 and 727569. 3637845 Calculate the lowest common multiple of 3892740 and 30. 3892740 What is the common denominator of -7/2089980 and 31/103? 215267940 Calculate the least common multiple of 36495355 and 22225. 1277337425 Find the common denominator of -151/8266692 and 31/16422. 190133916 Find the common denominator of -13/730 and -39/164615. 329230 What is the common denominator of 62/666177 and 127/546? 121244214 Calculate the lowest common multiple of 13461280 and 865368. 121151520 Calculate the common denominator of -107/174 and 101/15142988. 45428964 Calculate the least common multiple of 42420 and 8208270. 16416540 What is the smallest common multiple of 77 and 82202? 6329554 Calculate the least common multiple of 363609620 and 36. 3272486580 Calculate the common denominator of -91/37848792 and -41/1281. 264941544 What is the common denominator of 52/2725 and 61/64500? 7030500 Calculate the least common multiple of 380367 and 19779084. 19779084 What is the lowest common multiple of 6381474 and 12276? 38288844 Find the common denominator of -107/54203664 and 89/280848. 54203664 Find the common denominator of -107/74913300 and 61/18216. 149826600 What is the lowest common multiple of 124625793 and 3? 124625793 Find the common denominator of -103/370622 and 23/3453. 1111866 What is the common denominator of -41/17835552 and 65/9504? 196191072 Calculate the least common multiple of 1919640 and 2172. 347454840 Calculate the least common multiple of 341 and 560108. 6161188 What is the common denominator of 69/82528888 and 67/64? 660231104 What is the lowest common multiple of 330722 and 107? 35387254 What is the smallest common multiple of 30044039 and 2036884? 120176156 Calculate the common denominator of 83/227930 and -139/1080. 24616440 What is the common denominator of 9/329 and 46/1289163? 9024141 What is the common denominator of 31/96 and 55/32504? 390048 Calculate the lowest common multiple of 15255 and 1130. 30510 Find the common denominator of -55/68614 and -103/27334762. 355351906 Calculate the lowest common multiple of 3572 and 233016. 10951752 What is the common denominator of -79/31037682 and 21/979? 341414502 Calculate the lowest common multiple of 26768 and 550340. 526125040 Calculate the smallest common multiple of 772992 and 1328580. 42514560 What is the least common multiple of 2370 and 8409550? 25228650 What is the least common multiple of 26414379 and 8804793? 26414379 What is the lowest common multiple of 226160109 and 1? 226160109 Calculate the smallest common multiple of 8 and 1961887. 15695096 What is the common denominator of 145/8712636 and -169/510? 43563180 What is the common denominator of -167/112854 and -107/2422? 19523742 Calculate the least common multiple of 15978 and 85. 1358130 Calculate the lowest common multiple of 1405 and 81605. 22931005 Calculate the least common multiple of 2248064 and 41448680. 663178880 What is the common denominator of 161/255120 and -47/51024? 255120 Calculate the smallest common multiple of 32121918 and 17845510. 1	{ "pile_set_name": "DM Mathematics" }
0))*2 + sqrt(5))2 - sqrt(605)2. -20sqrt(5) + 160 Simplify sqrt(1539) + (-1sqrt(1539)1)*2. 9sqrt(19) + 1539 Simplify -1 + (sqrt(13)1 + 4 - (sqrt(208)-1 - sqrt(13))) + 4. 7 + 6sqrt(13) Simplify -6(4 + sqrt(720))*2. -4416 - 576sqrt(5) Simplify (sqrt(110) - (sqrt(110) + 2sqrt(110)-6 + sqrt(110)))/(3-1sqrt(10)). -11sqrt(11)/3 Simplify (sqrt(832) + 0 - sqrt(624)/sqrt(48))2. 637 Simplify (sqrt(190) + -21sqrt(190) + sqrt(190) + sqrt(190))/(sqrt(810) - -2sqrt(810)). sqrt(19)/27 Simplify (2 + sqrt(252) + -1sqrt(7)1)*2. 20sqrt(7) + 179 Simplify ((sqrt(135)/sqrt(3))/sqrt(9) + ((sqrt(15)-1)/sqrt(3))2)-2. -10 - 2sqrt(5) Simplify ((sqrt(13) + sqrt(52)/sqrt(4)-5)*2 + sqrt(13))5. 5sqrt(13) + 1040 Simplify sqrt(51)/((sqrt(12) + sqrt(24)/sqrt(2))/sqrt(4)) - (sqrt(2057) + sqrt(2057) + -2sqrt(2057) + -2)*2. -4 + sqrt(17)/2 Simplify sqrt(20)/(sqrt(90) + -4sqrt(90)). -sqrt(2)/9 Simplify (sqrt(95)/(sqrt(20) + sqrt(5)) + -2)-2. -2sqrt(19)/3 + 4 Simplify (sqrt(14)/(-3sqrt(2)))2 + -3. -20/9 Simplify 4 + (sqrt(30)/(sqrt(80)/(-2sqrt(8)) + sqrt(10)))*2 + 3. 19 Simplify (sqrt(50)/(sqrt(10)/sqrt(2)))/(5-2sqrt(5)). -sqrt(2)/10 Simplify ((sqrt(147)/sqrt(3))/sqrt(7) - sqrt(28)4)*2. 343 Simplify sqrt(88)/(sqrt(200) + sqrt(200)3 + sqrt(200)). sqrt(11)/25 Simplify (sqrt(1216) + 0)*2 - (sqrt(19) - (sqrt(19)-3-5 - sqrt(19)))2. -1995 Simplify -3(sqrt(175) + 0 + 3 - (sqrt(175) + 0)3)2. -2127 + 180sqrt(7) Simplify -3 + (sqrt(228)/(sqrt(12) + (sqrt(12) - sqrt(300))))*2 + 2 + 2. 28/9 Simplify ((sqrt(78)-3)/sqrt(6) + sqrt(13))*2 + sqrt(13) + (sqrt(39)/(sqrt(3)-4))*2. sqrt(13) + 845/16 Simplify (-1sqrt(25))/sqrt(5) + (sqrt(5) - sqrt(20))-4. 3sqrt(5) Simplify -3 + -3sqrt(11) + 6sqrt(22)/sqrt(2). -3 + 3sqrt(11) Simplify sqrt(91)/(sqrt(126)/sqrt(2))4. 4sqrt(13)/3 Simplify -2((sqrt(68)/sqrt(4))*2 + 3). -40 Simplify (sqrt(20) - sqrt(60)/sqrt(3))/sqrt(10) - (sqrt(2) - 1sqrt(2)1). 0 Simplify ((sqrt(280)-1 + sqrt(280) + sqrt(280))/sqrt(10))/(sqrt(256) + (sqrt(256) - sqrt(256)-1)). sqrt(7)/24 Simplify sqrt(50) + 2 + 5 + 5 + sqrt(2). 6sqrt(2) + 12 Simplify (-3sqrt(242))21. 2178 Simplify (6(sqrt(468) + ((0 + sqrt(468) - sqrt(468)) + sqrt(468))1)-6)2. 2426112 Simplify -4((2sqrt(80) + sqrt(80))-4)*2. -46080 Simplify ((sqrt(1008) - (sqrt(1008) + 0)) + 3)-1 + -1. -4 Simplify -2 + ((sqrt(1008) + 0)-1 - (0 + sqrt(1008) + 5))2. 240sqrt(7) + 4055 Simplify -1sqrt(9)/(1sqrt(363)). -sqrt(3)/11 Simplify sqrt(12)/(4(sqrt(4) - sqrt(36))). -sqrt(3)/8 Simplify sqrt(95)/(sqrt(30)/sqrt(6)) + 2. 2 + sqrt(19) Simplify (sqrt(28)-5 + sqrt(7) + sqrt(35)/sqrt(5) + 1 + sqrt(7))*2. -14sqrt(7) + 344 Simplify (5 + (-5sqrt(931))2)5. 116400 Simplify (sqrt(14) + sqrt(126)-3)/sqrt(7). -8sqrt(2) Simplify ((4sqrt(63)-1)/sqrt(9)4)2. 1792 Simplify (sqrt(76) + sqrt(76)-1)/sqrt(4) + sqrt(19) - (sqrt(19) - (sqrt(19) - (sqrt(684) + 3))). -5sqrt(19) - 3 Simplify (sqrt(5)-2 + 3)*2 - (sqrt(125) + -3). -17sqrt(5) + 32 Simplify ((5-1sqrt(136))/(5(sqrt(8) + sqrt(32)/sqrt(4)) - sqrt(8)))2. 425/81 Simplify 4(sqrt(238)/sqrt(7) + sqrt(34))/sqrt(2) + -1. -1 + 8sqrt(17) Simplify -1((sqrt(700) - -4(sqrt(700) + 0))2 + 5). -17505 Simplify (-1 + (sqrt(1088) - (sqrt(1088)-2 + 0)) + -1)*2. -96sqrt(17) + 9796 Simplify sqrt(16)/(5sqrt(800)). sqrt(2)/50 Simplify 1(0 + -5 + sqrt(38)/sqrt(2))*2. -10sqrt(19) + 44 Simplify sqrt(5) - 2(3 + sqrt(5)) - sqrt(60)/(sqrt(12)3). -6 - 4sqrt(5)/3 Simplify 4-1sqrt(720). -48sqrt(5) Simplify (sqrt(4)-2-1)/(sqrt(288) + (sqrt(288) + sqrt(288)-2 - sqrt(288))). -sqrt(2)/6 Simplify (-4(sqrt(3) + -1(sqrt(3) - sqrt(108))))2. 1728 Simplify 3 + 5 + sqrt(32) + 0. 4sqrt(2) + 8 Simplify 1 + 1 + sqrt(245) + 5. 7 + 7sqrt(5) Simplify (5sqrt(36))/((1sqrt(10))/sqrt(5)) + -2. -2 + 15sqrt(2) Simplify 3-4((sqrt(11) + -3(sqrt(11) + sqrt(99)))2 + sqrt(44)/sqrt(4) + -1). -15960 - 12sqrt(11) Simplify (sqrt(252)/(sqrt(8)/sqrt(2)))/(sqrt(9)2-5). -sqrt(7)/10 Simplify (3sqrt(7)51)2. 1575 Simplify (2sqrt(209)-3)/(2sqrt(11)2). -3sqrt(19)/2 Simplify (((sqrt(100) - (sqrt(100)-3 - sqrt(100))) + sqrt(100))/sqrt(10))/(sqrt(180)-5). -sqrt(2)/5 Simplify ((sqrt(720) - sqrt(45))/sqrt(9))*2 + sqrt(5) + (sqrt(20)/sqrt(4)5)*2. sqrt(5) + 170 Simplify (sqrt(1458) + (sqrt(1458) - 1sqrt(1458) - sqrt(1458)) + sqrt(1458))/sqrt(6)1. 9sqrt(3) Simplify (((sqrt(88) - -1sqrt(88)) + sqrt(88))6)/sqrt(8). 18sqrt(11) Simplify (sqrt(125) + 0 + sqrt(125) + -4)2. -80sqrt(5) + 516 Simplify ((sqrt(70) + sqrt(70) + 1sqrt(70))-6)/sqrt(10). -18sqrt(7) Simplify -5((-3 + sqrt(20))*2 - sqrt(5))5. -725 + 325sqrt(5) Simplify (sqrt(343) - (1 + sqrt(343)))-4-1. -4 Simplify (((sqrt(468) - (sqrt(468) - -2sqrt(468)-6)) + sqrt(468))-2)*2. 316368 Simplify 2sqrt(21)/(sqrt(28) - sqrt(7))3. 6sqrt(3) Simplify (-23sqrt(30))/((sqrt(250) + sqrt(250) + (sqrt(250) - sqrt(250)3) - sqrt(250)) + sqrt(10)). 3sqrt(3)/2 Simplify -5sqrt(52)/sqrt(4) + (sqrt(1573) - (sqrt(1573) - (3 + sqrt(1573))) - sqrt(13)). 3 + 5sqrt(13) Simplify (sqrt(70)-2)/sqrt(10) - -2(sqrt(7) - sqrt(14)/sqrt(2)). -2sqrt(7) Simplify sqrt(11) + ((sqrt(11) + sqrt(176))-4 - sqrt(11))*2 + 1 + sqrt(275) + sqrt(275). 11sqrt(11) + 4852 Simplify (sqrt(405) + (sqrt(405) - (sqrt(405)-2 + 1)) - sqrt(720)2-6)2. -360sqrt(5) + 162001 Simplify -3(-2 + 3sqrt(13) + (sqrt(13) + 0)3). -18sqrt(13) + 6 Simplify 2sqrt(48)6. 48sqrt(3) Simplify sqrt(98)-2 + 2. -14sqrt(2) + 2 Simplify ((sqrt(30) + (-2sqrt(270))/sqrt(9))/(sqrt(384)-2 - sqrt(384) - sqrt(384)))2. 5/1024 Simplify (sqrt(1053)-2 + sqrt(1053))*2-3. -3159 Simplify 4 + (sqrt(9)/sqrt(3) - sqrt(3))*2 + (2sqrt(3) + -1 - sqrt(3)). sqrt(3) + 3 Simplify -3 + (61sqrt(539)-4)2. 310461 Simplify (((2sqrt(117) - sqrt(117) - sqrt(117))4 - sqrt(117))/(-2(sqrt(81) - sqrt(9))))2. 13/16 Simplify sqrt(88)/(sqrt(8) + sqrt(56)/sqrt(7)) + -1. -1 + sqrt(11)/2 Simplify (sqrt(76) + sqrt(76) + -2)2 + sqrt(19) - (sqrt(19) + -2 + 1). -16sqrt(19) + 309 Simplify -4 + 2sqrt(2299). -4 + 22sqrt(19) Simplify ((sqrt(104) - (sqrt(104) - (sqrt(104) - -1sqrt(104)1))) + sqrt(104))/(sqrt(8) - sqrt(24)/sqrt(3)6)-5. 3sqrt(13) Simplify (-2(sqrt(13) + sqrt(26)/sqrt(2)))23. 624 Simplify (sqrt(200)13 - sqrt(200))*2 + 1 + 2. 803 Simplify (sqrt(272) - (-2sqrt(272) - sqrt(272))1 - -4(sqrt(272) - (sqrt(272) + -1)))*2. 128sqrt(17) + 4368 Simplify 4 + -1 + -2sqrt(19). -2sqrt(19) + 3 Simplify -3 + (sqrt(44)/(-4sqrt(4)1))2 + 4. 27/16 Simplify ((sqrt(56)/sqrt(4) - sqrt(14))/sqrt(7) - sqrt(2))2 - (sqrt(242) + sqrt(242) + 1 + sqrt(242))2 - (5 + sqrt(2) + (sqrt(32) + -2)2). -2218 - 51sqrt(2) Simplify (sqrt(36)/(sqrt(192) + sqrt(3)))2. 4/27 Simplify ((0 + sqrt(11))5 - sqrt(11)) + sqrt(132)/sqrt(300). 21sqrt(11)/5 Simplify -2 + sqrt(3)5 - (6sqrt(192))2. -6914 + 5sqrt(3) Simplify -5(-4 + sqrt(11) + 0). -5sqrt(11) + 20 Simplify 3 + sqrt(2)-2 + sqrt(2) + -5(sqrt(4)/sqrt(2))*2 - (2sqrt(2)5 - (sqrt(32) + 1)). -7sqrt(2) - 6 Simplify (sqrt(76)/sqrt(144) - (sqrt(114)/sqrt(2))/sqrt(3))*2. 475/36 Simplify (sqrt(2) + sqrt(54)/sqrt(3) + -2sqrt(2) + -4)*2. -16sqrt(2) + 24 Simplify 1 + sqrt(567) - (0 + sqrt(7) + 0). 1 + 8sqrt(7) Simplify ((sqrt(14) + (sqrt(2688) + sqrt(42))/sqrt(3))/sqrt(7))2. 200 Simplify sqrt(11)-2-1 + (sqrt(11) - (-4 + (sqrt(44)/sqrt(4))2 + sqrt(11))). -7 + 2sqrt(11) Simplify -3 + 2 + sqrt(44)/sqrt(4) + sqrt(11) + -5. -6 + 2sqrt(11) Simplify 3 + -4 + (sqrt(17) - sqrt(17)2) + (1 + sqrt(68) + 2)*2. 11sqrt(17) + 76 Simplify (-5(-1sqrt(190) + sqrt(190)))/sqrt(10). 0 Simplify (6(sqrt(17)-2 + -4))*2. 576sqrt(17) + 3024 Simplify 3(sqrt(288)/(sqrt(12)-1))/(1sqrt(48)/sqrt(4)). -3sqrt(2) Simplify 4(sqrt(17) + 0 + 1). 4 + 4sqrt(17) Simplify 2(-3 + sqrt(4)/sqrt(2) + sqrt(2) - (sqrt(128)/sqrt(4))2)5. -350 + 20sqrt(2) Simplify -1 + (sqrt(200))2. 199 Simplify -4 + sqrt(99)2 - ((6(sqrt(99) - ((sqrt(99)1 - sqrt(99) - sqrt(99)) + sqrt(99))))/sqrt(9))*2. -400 + 6sqrt(11) Simplify (1(sqrt(832) + -1 + 0) + -1)2. -32sqrt(13) + 836 Simplify 4sqrt(208) + sqrt(13) + (sqrt(13) - -5sqrt(468) - sqrt(13)). 47*sqrt(13) Simplify sqrt(112) + (sqrt	{ "pile_set_name": "DM Mathematics" }
40 + 485a3/3 + 2a*2 - 328a. What is the derivative of c(x) wrt x? -2259x2 Find the third derivative of -18g*3 + 71g*5 + 2916 - 2g + 2g - 3682 - g2 wrt g. 4260g2 - 108 Let p(u) = -u2 - 7u. Let l be (66/77)/((-1)/7). Let g be p(l). What is the third derivative of -14j*5 - 19j*2 - gj*2 + 13j*2 wrt j? -840j*2 Let s(q) = q + 20. Let j be s(-16). Suppose 5f - jo = 118, 6f - 96 = 2f + 4o. What is the third derivative of 8i5 + fi*5 - 25i*5 + 37i*2 wrt i? 300i*2 What is the first derivative of 660s*2 - 664 - 39877s + 79762s - 39883s wrt s? 1320s + 2 Let h = -3001 + 3001. Let w(c) be the first derivative of -14 + 0c + 7/4c4 + 16/3c*3 + hc*2. What is the third derivative of w(t) wrt t? 42 Let c(b) = -8b*4 - 44b*3 - 2b*2 - 4b + 366. Let m(g) = -g4 + g3 + g*2 + 2g - 1. Let x(t) = -c(t) - 2m(t). Differentiate x(l) with respect to l. 40l*3 + 126l*2 Suppose 0 = 82n - 55 - 109. Let q(c) be the second derivative of 0c4 + 0 + 7/20c*5 - nc*2 - 3c + 0c3. Differentiate q(k) with respect to k. 21k*2 Let x(w) = -8w + 9. Let d(a) = -7a + 7. Let m(r) = 7d(r) - 6x(r). Let b be m(-12). What is the derivative of -bh - 9h - 25 - 26h wrt h? -42 Differentiate 783 - 397m + 80 - 126m - 85 + 221 wrt m. -523 Let a(s) be the first derivative of -1909s6/6 - 1177s*3/3 + 908. Find the third derivative of a(v) wrt v. -114540v*2 Let n = 3802 - 3802. Let r(d) be the first derivative of 0d*2 + 0d*4 + 0d + nd5 + 19 + 2d*3 + 7/6d*6. What is the third derivative of r(b) wrt b? 420b*2 Let w(c) = -1326c*3 - 4c + 249. Let o(h) = 6626h3 + 22h - 1243. Let r(s) = 2o(s) + 11w(s). Find the first derivative of r(f) wrt f. -4002f2 Let j = 14 - -28. Let y = -39 + j. What is the first derivative of -4oy - 4 - 5 + o4 + 4o3 wrt o? 4o*3 Let h(i) = -3i*3 - 32i*2 + 10i - 8. Let a be h(-11). Find the third derivative of -79f3 + 14209f*2 - 14342f*2 + 220f*a wrt f. 846 Let g(l) be the third derivative of -46/3l*3 + 14l*2 - 5l + 27/8l4 + 0 - 1/30l*5. Differentiate g(v) with respect to v. -4v + 81 Let x(u) = 4710u2 - 8605u + 120. Let s(n) = 2356n2 - 4303n + 64. Let i(z) = -15s(z) + 8x(z). Find the second derivative of i(q) wrt q. 4680 Suppose -6r + 960 = 300. Differentiate -18v*3 - 4v*3 + 22v*3 + r - 48v*4 wrt v. -192v3 Let k(h) = h3 - h*2 - h. Let n be k(2). Suppose 59 = nv + 23. Find the third derivative of -21c2 - 2c*3 - vc*2 + 11c*2 wrt c. -12 Let r be 4 + 0 + ((-27)/(-3) - -3). What is the third derivative of -6h + 8h - 111h*3 + 2h*2 + rh*2 wrt h? -666 Let i(b) be the third derivative of 25/4b*4 - 41/2b*3 + 0b - 2 - 58b2. What is the derivative of i(p) wrt p? 150 Let z(m) be the third derivative of 0m - 1/10m5 + 5/2m*3 + 51 - 2m*2 + 0m*4. What is the first derivative of z(w) wrt w? -12w Let a(u) = 14u2 + 4u - 11. Let m be a(-3). Differentiate -13l2 - 55 + m - 62 + 5l*2 wrt l. -16l Suppose 108h - 114h = 0. What is the second derivative of hd - 5 + 8 + 4d*2 + 3 + 2d wrt d? 8 Let l be 24/(-9)15/(-10). Suppose 0 = -3v + 4v - l. Find the third derivative of -42p*4 + 14p*4 - 15p*v + 14p*2 wrt p. -1032p Let l(y) = -1194y - 1492. Let s(g) = g. Let k(n) = -l(n) - s(n). What is the derivative of k(d) wrt d? 1193 What is the third derivative of 14v*4 + 74v*2 - 2 + 2v - 94v2 + 74v*2 + 10v*2 - 70v*3 wrt v? 336v - 420 Suppose -688 = -161t - 205. Let i(g) be the first derivative of -1/2g*4 + 0g*2 + 0g + 26 + 7gt. Find the third derivative of i(s) wrt s. -12 Let t(u) = 2u*2 - u - 1. Let r(i) = -10i*2 + 1494i - 3107. Let n(p) = r(p) + 3t(p). Find the first derivative of n(a) wrt a. -8a + 1491 Let i(r) be the third derivative of 193r5/60 - r4/24 + 125r*3 - 1044r*2. Differentiate i(d) with respect to d. 386d - 1 Let z be ((-1)/2)/(27/(-108)). Find the first derivative of 14x2 + 43 - 8x*2 - 12x*z + 26 - x wrt x. -12x - 1 Let p(d) = d*3 + 31d*2 - 34d - 51. Let t be p(-32). What is the third derivative of 11o6 + 3o*5 + 3o + to5 + 4o*2 - 18o*5 wrt o? 1320o*3 - 120o*2 What is the second derivative of 1638h + 39h2 - 91h*2 + 29h*5 + 52h*2 wrt h? 580h3 Let j(g) = -g3 + 4g2 - 3g. Let v be j(2). Find the third derivative of 15nv + 34 + 10n*3 + 14n*3 - 34 wrt n. 144 Let o = -17 + 5. Let w be (44/o - -3)12/(-4). Find the second derivative of 11p2 + 31p*3 - 27p + wp2 - 13p*2 wrt p. 186p Let j(b) be the third derivative of 1429b4/12 + 883b*3/6 - 2121b*2. Differentiate j(c) wrt c. 2858 Let k(v) be the second derivative of -947v*5/20 - 109v*4 - 187v. Find the third derivative of k(p) wrt p. -5682 Let t(o) = -3o4 - 2o*3 - 2o*2 - o - 2. Let g(d) = 56d*4 + 26d*3 - 58d*2 + 13d - 2034. Let w(v) = -g(v) - 13t(v). Differentiate w(n) wrt n. -68n*3 + 168n Let k(z) = -2185z3 + 15z - 5886. Let d(g) = 3279g3 - 24g + 8829. Let h(u) = -5d(u) - 8k(u). What is the first derivative of h(o) wrt o? 3255o2 Suppose -7u + 48 = -120. Suppose 3d - 4z - 35 = u, 33 = d - 4z. Find the first derivative of 15 + 36s - ds - 16s wrt s. 7 Let z(s) be the first derivative of 131s8/28 + 17s*4/4 + 301s - 211. Let h(b) be the first derivative of z(b). Find the third derivative of h(u) wrt u. 31440u3 Let l(n) = n2 - n + 1. Let t be (6/(-4))/(28/(-56)). Let z(w) = 39w*2 - 3w + 33. Let j(c) = tl(c) - z(c). What is the first derivative of j(y) wrt y? -72y Let o(d) = -2d2 + 17d - 19. Let g be o(7). What is the third derivative of -152a3 - 120a*g + a - 169a*2 + 256a*2 wrt a? -912 Let t(n) = 5n*3 - 3n*3 + 5n*2 - 4n2 - n3. Let x(f) = f*3 - 16f*2. Let k(h) = -6t(h) - 3x(h). Find the third derivative of k(s) wrt s. -54 Let c = 520 + -443. Find the third derivative of -31o*2 - 101o*2 - co + 66o6 + 8o*6 + 77o wrt o. 8880o3 Let u(k) = -18 + 9k*2 - 4k*2 - 4k*2 - 2k. Let l be u(-10). Find the first derivative of -6 - 24f4 + 102f*2 - lf*2 wrt f. -96f*3 Let u(f) = 4 + 6 - 14f*3 + 8f*2 + 13f*3 + 3 - f. Let i be u(8). What is the third derivative of -6b*2 + 0b*i + 3b*5 + 12b*2 wrt b? 180b*2 Let c(w) be the third derivative of 19/8w*4 + 0w*7 + 0w*3 + 1/24w*8 + w + 72w*2 + 0w*5 + 0 - 1/60w*6. Find the second derivative of c(n) wrt n. 280n*3 - 12n Let s(r) = -r*2 + 10r - 21. Let w be s(6). Suppose 13 = wf + f + k, -k = -3f + 1. Differentiate fl2 - 2 - 8l*2 - 5l*2 - 5 wrt l. -22l Let p(v) be the first derivative of -2147v3/3 + v2/2 + 806v + 2652. What is the second derivative of p(h) wrt h? -4294 Let b(q) be the second derivative of -q7/42 - q6/30 + 5q5/4 + 31q4/4 - q3/3 + q*2/2 - 5938q. Find the third derivative of b(t) wrt t. -60t2 - 24t + 150 Let u = 10 - 13. Let t be u/(-3)(-8)/(-2). Find the third derivative of -28r*2 + 0r*t + 0r*4 + 51r*2 + 2r*6 wrt r. 240r*3 Let l(h) = -124h*2 + 117h - 4072. Let o(t) = -31t2 + 27t - 1019. Let b(u) = -6l(u) + 26o(u). What is the derivative of b(s) wrt s? -124s Let j(w) be the first derivative of -1319w*2/2 - 375w + 1414. Find the first derivative of j(r) wrt r. -1319 Let a(l) be the second derivative of -5/42l7 - 1/30l*6 + 0l*2 + 0l*5 - 49l - 29/12l4 + 0 - 1/3l*3. What is the third derivative of a(p) wrt p? -300p*2 - 24p Let y(x) be the third derivative of 0x + 0x*5 + 31/336x*8 + 0x*7 - 12x*2 + 0x*6 + 0x*3 + 0 - 17/24x*4. Find the second derivative of y(j) wrt j. 620j*3 Let q(o) be the second derivative of 61o6/30 + o4/4 + 1259o2/2 - 205o + 4. What is the first derivative of q(d) wrt d? 244d3 + 6d Find the second derivative of -414f5 - 2f*2 - 71f - 148f + 0f*2 + 2f*2 wrt f. -8280f*3 Let x(h) be the third derivative of 273h*6/5 - 2h*5/15 + 33h*4/8 - 5906h*2. What is the third derivative of x(r) wrt r? 39312 Suppose 3h - 8 = -2. Suppose 2z - 3k = 9, hz = -3z + 4k + 19. What is the third derivative of -1 + 1 - 161c*3 + 166cz - c2 wrt c? 30 Suppose 17c - 16c - 9 = 0. What is the third derivative	{ "pile_set_name": "DM Mathematics" }
+ 20086824v3/5 + 401018304v*2/5 + 694407168v/5 + 33226752 = 0. -416, -20, -8/5, -2/7 Find j such that -3j3 + 3288j*2 + 14635908j + 87696432 = 0. -1724, -6, 2826 Solve -3c2 - 11442c - 4911759 = 0. -3321, -493 Factor 3b2/4 + 7563b/2 + 283062. 3(b + 76)(b + 4966)/4 Factor -3u3/4 + 388437u*2/2 + 16319646u. -3u(u - 259042)(u + 84)/4 Factor -3f*2 + 58358802f - 283812480906267. -3(f - 9726467)2 Determine t so that -72944283t*2 + 65089200t - 14520000 = 0. 2200/4931 Determine d, given that 21104836d5 - 41133306988d*4 + 20062727802844d*3 - 20004182738308d*2 - 17429067680d - 3794704 = 0. -1/2297, 1, 974 Factor 5m3 + 2358730m*2 - 2358735m. 5m(m - 1)(m + 471747) Factor 4r*2 - 23628r - 79961440. 4(r - 8312)(r + 2405) Find w such that 117w5 - 2192w*4 - 402729w*3 + 711152w*2 + 1471452w + 208080 = 0. -51, -10/9, -2/13, 3, 68 What is b in 6b3/11 - 307852b*2/11 - 718374b/11 + 1026220/11 = 0? -10/3, 1, 51311 Determine g, given that -5g5 - 562010g*4 - 1685960g*3 + 2809990g*2 + 1685965g - 2247980 = 0. -112399, -4, -1, 1 Solve -7r3 + 24365r*2 - 5896684r - 1686756 = 0 for r. -2/7, 262, 3219 Factor 2l2/9 + 530626l/9 + 5306060/9. 2(l + 10)(l + 265303)/9 Suppose 28c4 - 113132c*3 + 497824c*2 + 10656192c - 4649472 = 0. Calculate c. -8, 3/7, 12, 4036 Factor -2z2/5 - 518172z/5 - 3730320. -2(z + 36)(z + 259050)/5 Determine z, given that z*5 - 283z*4/4 + 1593z*3 - 27935z*2/2 + 46438z - 135975/4 = 0. 1, 7, 75/4, 37 Factor -2f2 - 163109008f - 3325568561343008. -2(f + 40777252)2 Find g, given that -961g*5/5 + 52173g*4 - 635642g*3/5 + 505714g*2/5 - 143157g/5 + 13181/5 = 0. 7/31, 1, 269 Suppose -3w4 + 1795584w*3 - 268673233896w*2 - 1074714482688w - 1074721665072 = 0. What is w? -2, 299266 Solve 2x5 + 11686x*4 - 11732x*3 - 257104x*2 + 187200x + 1122048 = 0. -5844, -4, -2, 3, 4 Factor 5n3 - 1290n*2 - 5135480n + 30858240. 5(n - 1148)(n - 6)(n + 896) Factor 3x*2 - 1327188x + 62371209. 3(x - 442349)(x - 47) Solve 89w3/3 - 78651w*2 - 2806970w/3 + 149128 = 0 for w. -12, 14/89, 2663 Factor -l*2/4 + 1455l/4 + 29089. -(l - 1531)(l + 76)/4 Determine x, given that -2x*3 - 1590598x*2 + 46129024x = 0. -795328, 0, 29 Determine j, given that -2j4/9 + 862j*3/9 + 30004j*2/3 - 563968j/9 + 761024/9 = 0. -92, 2, 4, 517 Suppose -5u2 + 11332900u - 45331520 = 0. Calculate u. 4, 2266576 Solve -j*3/10 + 525817j*2/10 + 1051637j/10 + 525819/10 = 0 for j. -1, 525819 Determine i so that 6i3 + 170i*2/3 - 356i/9 - 2320/9 = 0. -29/3, -2, 20/9 Determine d, given that -d*4/2 - 2711819d*3/2 - 1838497351725d*2/2 - 9192435234129d/2 - 5515451377947 = 0. -1355907, -3, -2 Factor 2c3/3 + 340c*2/3 + 10478c/3 + 3380. 2(c + 1)(c + 39)(c + 130)/3 Factor -m4/7 - 170628m*3/7 - 7278137332m*2/7 + 4159228128m - 4159325632. -(m - 2)*2(m + 85316)2/7 Factor n3 - 180193n2 - 180194n. n(n - 180194)(n + 1) Solve 111042b3 - 666249b*2 - 1776690b - 48 = 0. -2, -1/37014, 8 Solve 40s2/7 - 15374s/7 - 23151/7 = 0. -3/2, 7717/20 Factor -2b2 - 134050b - 6028200. -2(b + 45)(b + 66980) Factor 4h3 - 9205740h*2 + 5296626073500h - 26482900224500. 4(h - 1150715)2(h - 5) Suppose 3b3/8 + 808419b*2/4 + 1616829b/8 - 1616835/4 = 0. Calculate b. -538945, -2, 1 Factor -4r3 - 56684r*2 - 208063680r - 50872738032. -4(r + 263)(r + 6954)*2 Determine w so that 2w*2/3 - 1666860w + 1041908347350 = 0. 1250145 Factor 338i2/9 + 12205i - 1625/9. (i + 325)(338i - 5)/9 Let 4q3/3 + 189496q*2/3 + 568436q/3 - 757936/3 = 0. What is q? -47371, -4, 1 Let -3b2 + 1137619698b - 107848214773134267 = 0. What is b? 189603283 Factor 525s2 + 2583524s - 4921. (s + 4921)(525s - 1) Solve -i*5/2 + 7729i*4 + 185701i*3 + 1284874i*2 + 4087127i/2 + 936661 = 0. -11, -1, 15482 Factor 4z2 - 735856z - 1471728. 4(z - 183966)(z + 2) Find a such that 28a5 + 202324a*4 + 2597972a*3 + 9320012a*2 + 5885664a - 1038672 = 0. -7213, -6, -1, 1/7 Solve -20l5 - 5308l*4 + 30952l*3 + 162744l*2 + 38700l - 87804 = 0 for l. -271, -3, -1, 3/5, 9 Let -4056v4 - 174436v*3 - 1960252v*2 - 1802220v - 12348 = 0. What is v? -21, -1, -7/1014 Factor 3b2 + 1653982674b + 227971557157682523. 3(b + 275663779)2 Find u such that -u2/6 + 76745u/3 + 8444975/6 = 0. -55, 153545 Suppose -3p3 - 1264932p*2 - 2529855p - 1264926 = 0. Calculate p. -421642, -1 Let -5z5/6 - 29195z*4 + 262790z*3/3 + 145985z*2 - 525575z/6 - 116790 = 0. Calculate z. -35037, -1, 1, 4 Suppose -159a3 - 74557002a*2 - 8740166120352a + 329817695616 = 0. Calculate a. -234456, 2/53 Factor 2t2/3 + 2231318t - 13387932. 2(t - 6)(t + 3346983)/3 Factor 2m2 + 48139690m + 96279372. 2(m + 2)(m + 24069843) What is r in 4r2/7 + 210996r/7 = 0? -52749, 0 Factor -3k2/5 + 43496994k/5 - 157665707253003/5. -3(k - 7249499)2/5 Let -r3/9 + 4996016r*2/9 + 9992035r/9 + 4996018/9 = 0. Calculate r. -1, 4996018 Determine r so that 28r5/3 - 2269196r*4/3 - 14590820r*3 - 82684420r*2/3 + 95652752r/3 + 11024432 = 0. -17, -3, -2/7, 1, 81062 Factor -2t2/11 + 8693356t/11 - 9446804817842/11. -2(t - 2173339)2/11 Find m such that 2m*5/7 + 19928m*4/7 - 26m*3/7 - 259088m*2/7 - 239136m/7 = 0. -9964, -3, -1, 0, 4 Solve 722u3 - 7370442u*2 - 4655232u - 735048 = 0. -6/19, 10209 Factor f*4/3 + 5267014f*3/3 + 21068044f*2/3 + 7022680f. f(f + 2)2(f + 5267010)/3 Factor 2q3/5 + 90345786q*2/5 - 180691578q/5 + 18069158. 2(q - 1)2(q + 45172895)/5 Factor 2p2/17 - 1448424p/17 - 2896856/17. 2(p - 724214)(p + 2)/17 Find g, given that -5g4 - 12645g*3 - 151120g*2 - 251700g = 0. -2517, -10, -2, 0 Determine b, given that -14b4 - 4512b*3 - 287784b*2 - 636928b - 158592 = 0. -236, -84, -2, -2/7 Solve n*4/5 - 10972n*3/5 - 1138022n*2/5 - 29933124n/5 - 5761215 = 0 for n. -51, -1, 11075 Factor 225602t3 + 10t*2. 2t*2(112801t + 5) Find h, given that 5h*3 - 2628080h*2 - 21025285h + 170827800 = 0. -13, 5, 525624 Find d such that 25d3/2 + 4692d*2 + 972261d/2 + 8364843 = 0. -177, -534/25 Factor n*2 + 469n - 102222. (n - 162)(n + 631) Factor -4z*3 + 1203376z*2 + 89066252z + 1647826968. -4(z - 300918)(z + 37)*2 What is d in 4d*4 + 792d*3 + 27644d*2 - 178488d - 763200 = 0? -150, -53, -3, 8 Let 2o4 - 4412o*3 + 2374608o*2 + 65299392o - 298909440 = 0. What is o? -30, 4, 1116 Find f such that -2f3/7 - 16879704f*2/7 - 67518792f/7 - 67518784/7 = 0. -8439848, -2 Solve 4o2 - 37024o + 185020 = 0 for o. 5, 9251 Suppose -270p2 - 3868851p - 300909 = 0. What is p? -14329, -7/90 Determine o, given that -o*4/7 - 1575691o*3/7 - 620698168323o*2/7 + 1862114989003o/7 + 2482811581636/7 = 0. -787847, -1, 4 Let x*4 + 4153344x*3 + 4153334x*2 - 37380096x - 37380087 = 0. What is x? -4153343, -3, -1, 3 What is w in -36w5 - 5875476w*4 - 239741453548w*3 - 878985408844w*2 - 506077325152w - 79906636848 = 0? -81602, -3, -1/3 What is v in -493045v3 - 2465235v*2 + 2958220v + 60 = 0? -6, -2/98609, 1 Factor -36z3 - 7699704z*2 - 5133124z - 855520. -4(z + 213880)(3z + 1)2 Determine b, given that -b4/3 + 50b*3/3 + 473b*2/3 - 150b - 1392 = 0. -8, -3, 3, 58 Determine b so that 2b3 - 11136b*2 + 11122b + 66804 = 0. -2, 3, 5567 Suppose 5x2 + 1215x - 512720 = 0. What is x? -464, 221 Find o such that -2o5/3 - 2564962o*4/3 - 822374910230o*3/3 + 2467140120482o*2/3 - 2467145250416o/3 + 822382605128/3 = 0. -641242, 1 Let i*3/2 - 11888i*2 - 7636611i/2 - 304560207 = 0. Calculate i. -159, 24094 Factor -h*3/10 - 5861h*2/10 - 1143724h - 743040840. -(h + 1821)(h + 2020)2/10 What is l in 4l*2 - 20740976l + 26886755339536 = 0? 2592622 Let -i*3 - 28825i*2 + i + 28825 = 0. Calculate i. -28825, -1, 1 Find z, given that -2z*2/9 + 13594z/3 - 26578516/9 = 0. 674, 19717 Determine j so that -j3/5 + j2/5 + 1142j - 22792/5 = 0. -77, 4, 74 Factor 5f*3 + 8830f*2 + 816320f - 1668000. 5(f - 2)(f + 100)(f + 1668) Determine d, given that -d5/2 + 6427d*4/8 + 46735d**3/8 +	{ "pile_set_name": "DM Mathematics" }
+ 1 What is the z'th term of -261063, -261061, -261059, -261057, -261055, -261053? 2z - 261065 What is the v'th term of -55, 75, 349, 773, 1353, 2095, 3005? v3 + 66v*2 - 75v - 47 What is the k'th term of -1676, -1624, -1572, -1550, -1588, -1716, -1964? -5k3 + 30k*2 - 3k - 1698 What is the x'th term of 430, 1726, 3884, 6904, 10786, 15530, 21136? 431x2 + 3x - 4 What is the k'th term of -57884, -57881, -57878? 3k - 57887 What is the x'th term of -3385, -3280, -3107, -2866, -2557, -2180? 34x*2 + 3x - 3422 What is the z'th term of 13675, 13713, 13751, 13789, 13827? 38z + 13637 What is the i'th term of 1179991, 2359982, 3539973, 4719964? 1179991i What is the d'th term of -4, 9, 20, 29, 36, 41, 44? -d*2 + 16d - 19 What is the c'th term of -27143, -27128, -27109, -27086, -27059, -27028? 2c2 + 9c - 27154 What is the w'th term of -71, -20, 87, 262, 517, 864, 1315? 2w3 + 16w*2 - 11w - 78 What is the b'th term of 46, -5, -202, -617, -1322, -2389, -3890, -5897? -12b3 - b2 + 36b + 23 What is the y'th term of -1616, -3227, -4838, -6449, -8060, -9671? -1611y - 5 What is the i'th term of -1052, -1102, -1146, -1178, -1192, -1182, -1142, -1066? i3 - 3i*2 - 48i - 1002 What is the u'th term of -130, -391, -782, -1303, -1954? -65u2 - 66u + 1 What is the d'th term of -974925, -974929, -974935, -974943, -974953? -d*2 - d - 974923 What is the q'th term of -2156, -8911, -20168, -35927? -2251q*2 - 2q + 97 What is the f'th term of -2676, -2671, -2662, -2649, -2632, -2611, -2586? 2f2 - f - 2677 What is the p'th term of 701, 708, 741, 794, 861, 936? -p3 + 19p*2 - 43p + 726 What is the g'th term of -115, -134, -127, -94, -35, 50, 161? 13g2 - 58g - 70 What is the o'th term of 31018, 62057, 93096, 124135, 155174, 186213? 31039o - 21 What is the n'th term of 885, 1588, 2289, 2988, 3685? -n2 + 706n + 180 What is the r'th term of 2425, 2435, 2445, 2455, 2465, 2475? 10r + 2415 What is the v'th term of 16, 34, 24, -26, -128, -294, -536, -866? -2v*3 - 2v*2 + 38v - 18 What is the h'th term of -9349, -19260, -29171? -9911h + 562 What is the n'th term of -473, -807, -1141, -1475? -334n - 139 What is the g'th term of -96, -237, -378, -519, -660? -141g + 45 What is the w'th term of -107, -843, -2873, -6857, -13455, -23327? -110w*3 + 13w*2 - 5w - 5 What is the y'th term of 2075, 2082, 2093, 2108, 2127, 2150, 2177? 2y2 + y + 2072 What is the l'th term of 41920, 83842, 125764, 167686, 209608? 41922l - 2 What is the a'th term of 187, 195, 201, 205, 207? -a*2 + 11a + 177 What is the k'th term of -47216, -47214, -47212, -47210? 2k - 47218 What is the s'th term of -1, -5, -7, -7, -5, -1? s2 - 7s + 5 What is the t'th term of 3630, 3494, 3358, 3222, 3086? -136t + 3766 What is the u'th term of 2608013, 2608012, 2608011, 2608010, 2608009, 2608008? -u + 2608014 What is the q'th term of 262, 931, 2054, 3637, 5686, 8207, 11206? q3 + 221q*2 - q + 41 What is the j'th term of -2431, -4864, -7297, -9730? -2433j + 2 What is the a'th term of 85504, 85501, 85498, 85495, 85492, 85489? -3a + 85507 What is the i'th term of 56, 107, 146, 167, 164, 131? -i3 + 58i - 1 What is the y'th term of -18113, -36246, -54379, -72512? -18133y + 20 What is the g'th term of 18724, 18719, 18714, 18709, 18704, 18699? -5g + 18729 What is the i'th term of -1958, -1890, -1800, -1676, -1506, -1278, -980, -600? 2i3 - i2 + 57i - 2016 What is the v'th term of 2697, 5379, 8061, 10749, 13449, 16167? v*3 - 6v*2 + 2693v + 9 What is the l'th term of -10, -50, -90, -112, -98, -30, 110, 340? 3l3 - 18l*2 - 7l + 12 What is the w'th term of 78200, 156388, 234550, 312674, 390748, 468760, 546698? -2w3 - w2 + 78205w - 2 What is the b'th term of 836, -1005, -2858, -4729, -6624, -8549, -10510, -12513? -b*3 - 1834b + 2671 What is the j'th term of -51823, -103648, -155473? -51825j + 2 What is the u'th term of -4047, -8075, -12103, -16131? -4028u - 19 What is the u'th term of 5386, 21421, 48108, 85447, 133438? 5326u2 + 57u + 3 What is the j'th term of -631, -620, -593, -544, -467? j*3 + 2j*2 - 2j - 632 What is the a'th term of -316, -1087, -2372, -4171, -6484? -257a2 - 59 What is the j'th term of 542, 988, 1434, 1880? 446j + 96 What is the i'th term of 186602, 373202, 559802? 186600i + 2 What is the n'th term of 10160, 20328, 30490, 40640, 50772, 60880? -n3 + 3n*2 + 10166n - 8 What is the c'th term of -86051, -172101, -258149, -344195? c*2 - 86053c + 1 What is the v'th term of 11231, 44931, 101099, 179735, 280839, 404411, 550451? 11234v2 - 2v - 1 What is the g'th term of 270530, 270529, 270528? -g + 270531 What is the x'th term of -908, -1897, -2882, -3863, -4840? 2x2 - 995x + 85 What is the d'th term of -65010, -130016, -195024, -260034, -325046, -390060? -d*2 - 65003d - 6 What is the a'th term of -41848, -41906, -41964, -42022, -42080? -58a - 41790 What is the j'th term of -1594, -1524, -1444, -1348, -1230, -1084, -904, -684? j3 - j2 + 66j - 1660 What is the s'th term of -25824, -25826, -25830, -25836, -25844, -25854? -s*2 + s - 25824 What is the b'th term of -363, -453, -543, -633, -723? -90b - 273 What is the m'th term of 4955, 5690, 6439, 7208, 8003, 8830, 9695? m3 + m2 + 725m + 4228 What is the x'th term of -16329, -16263, -16197, -16131, -16065? 66x - 16395 What is the p'th term of 564, 644, 858, 1272, 1952? 11p3 + p2 + 552 What is the d'th term of 153, 377, 601, 825, 1049, 1273? 224d - 71 What is the p'th term of -6669, -13392, -20113, -26832, -33549? p*2 - 6726p + 56 What is the b'th term of -80803, -161609, -242415, -323221, -404027? -80806b + 3 What is the o'th term of 1115, 1203, 1291? 88o + 1027 What is the c'th term of 645, 1250, 1831, 2376, 2873, 3310? -2c3 + 619c + 28 What is the z'th term of -2196, -4426, -6700, -9018, -11380? -22z2 - 2164z - 10 What is the d'th term of 132, 229, 288, 309, 292, 237? -19d2 + 154d - 3 What is the g'th term of 1208, 1061, 654, -145, -1468? -22g3 + 2g*2 + g + 1227 What is the s'th term of 919, 933, 953, 979, 1011, 1049? 3s*2 + 5s + 911 What is the b'th term of -543, -1269, -1995, -2721? -726b + 183 What is the m'th term of -10254, -20310, -30366, -40422, -50478, -60534? -10056m - 198 What is the u'th term of 212956, 425915, 638874, 851833, 1064792, 1277751? 212959u - 3 What is the s'th term of -207, -863, -1963, -3513, -5519, -7987? -s3 - 216s*2 - s + 11 What is the r'th term of -45, -331, -1117, -2655, -5197, -8995, -14301, -21367? -42r*3 + 2r*2 + 2r - 7 What is the w'th term of 477, 549, 649, 783, 957, 1177, 1449? w*3 + 8w*2 + 41w + 427 What is the m'th term of 3071, 12130, 27229, 48368, 75547, 108766, 148025? 3020m2 - m + 52 What is the b'th term of 6432, 12833, 19230, 25623, 32012? -2b*2 + 6407b + 27 What is the a'th term of -33, -317, -1083, -2577, -5045, -8733, -13887, -20753? -41a3 + 5a*2 - 12a + 15 What is the c'th term of 28, 83, 146, 193, 200, 143? -4c3 + 28c*2 - c + 5 What is the c'th term of -6170, -12338, -18506, -24674? -6168c - 2 What is the j'th term of 820, 1626, 2420, 3202, 3972, 4730? -6j2 + 824j + 2 What is the s'th term of -5552, -11197, -16832, -22457, -28072, -33677? 5s2 - 5660s + 103 What is the m'th term of 248, 841, 1434, 2027? 593m - 345 What is the c'th term of -214, -442, -674, -910, -1150, -1394, -1642? -2c*2 - 222c + 10 What is the u'th term of -30, -85, -172, -303, -490, -745? -2u3 - 4u*2 - 29u + 5 What is the b'th term of -7759, -7730, -7675, -7588, -7463, -7294, -7075? b*3 + 7b*2 + b - 7768 What is the z'th term of 2112, 4238, 6364, 8490, 10616? 2126z - 14 What is the a'th term of -271, -548, -783, -952, -1031? 4a3 - 3a*2 - 296a + 24 What is the i'th term of 77, -239, -843, -1735, -2915, -4383, -6139? -144i2 + 116i + 105 What is the l'th term of -265899, -531797, -797695, -1063593, -1329491, -1595389? -265898l - 1 What is the z'th term of -108, -523, -1198, -2091, -3160, -4363? 7z*3 - 172z*2 + 52z + 5 What is the u'th term of 145, 526, 1141, 1996, 3097, 4450, 6061? u*3 + 111u*2 + 41u - 8 What is the l'th term of 56511, 113020, 169529, 226038, 282547, 339056? 56509*l + 2 What is the n'th term	{ "pile_set_name": "DM Mathematics" }
lculate the highest common factor of f and 1. 1 Let p = 9 + -5. Let v be 0 - 0 - (-1 + -46). Suppose py - v = 5. What is the highest common divisor of 91 and y? 13 Suppose 0 = 5y - 4 - 6. Suppose 2 = yb - 0. What is the highest common factor of 1 and b? 1 Let k = -11 - -28. Let f = -12 + k. Suppose 5n + 2b - 3b - 830 = 0, -fn - b + 820 = 0. Calculate the greatest common factor of n and 15. 15 Suppose 2c - 42 = -4z, 2z - z - 5 = 0. What is the greatest common factor of 77 and c? 11 Suppose -12l + 11l = -5. What is the greatest common factor of l and 1? 1 Let l(i) = 3i3 - 6i*2 + 5i + 1. Let w be l(4). Calculate the greatest common factor of w and 13. 13 Suppose 2h - 11 = 3h. Let g = 26 + h. Suppose 5p + 36 - 426 = -3w, -138 = -w + p. Calculate the highest common factor of w and g. 15 Suppose -2v + 39 = -27. Suppose 0 = 4p + 4s, -4p + 3 = p + 4s. What is the highest common divisor of v and p? 3 Suppose 5x - 9 = -4. Let a be (-5 + x - -8) + 19. What is the highest common factor of 69 and a? 23 Suppose -2t - 5y = -107 - 104, 0 = 2t - 4y - 220. Calculate the greatest common divisor of 12 and t. 12 Let d be 10/466/55. Suppose 0 = 5s + dz - 373, -7s + 2z + 393 = -2s. What is the highest common divisor of 11 and s? 11 Let f(c) = 3c2 - 5. Let o be f(6). Suppose d - o = -3x, -2x - 3x + 157 = -2d. Let j = x - 19. What is the highest common divisor of 7 and j? 7 Let s be 29 + -14/(-2). What is the greatest common factor of 31 and s? 31 Suppose 4b - 5t - 193 = 0, -b + 25 - 8 = 5t. Let j = 12 + b. Suppose -5s - 4 = -j. What is the greatest common factor of 80 and s? 10 Let z(v) = -v*3 - 4v*2 + 5v + 1. Let q be z(-5). Let n be 910 + 0/q. Let p = 109 + -73. Calculate the greatest common divisor of p and n. 18 Let w = 199 + -45. What is the highest common divisor of 14 and w? 14 Let q(p) = -p3 + 6p*2 - p - 6. Let v be q(6). Let z = v - -20. Let u be (44/16)/(2/z). What is the greatest common divisor of u and 1? 1 Suppose -4j + 44 + 4 = 0. Calculate the greatest common factor of j and 48. 12 Let t(b) = -b*3 + 6b*2 + 5b + 5. Let v be t(6). Let h(z) = -z*2 - 9z - 6. Let o be h(-5). Calculate the highest common divisor of o and v. 7 Suppose -2b + b = -3x - 171, 489 = 3b - x. Calculate the greatest common divisor of 108 and b. 54 Let f(p) = -2p3 + 9 + p3 - 6p + 12p*2 - 5p*2. Let d be f(6). Let q be 141/4 + d/(-36). Calculate the greatest common factor of q and 5. 5 Let z = 0 - -2. Let a(w) = -7w + 1. Let t be a(1). Let o be t/15 - (-42)/5. Calculate the greatest common divisor of z and o. 2 Let i(c) = -2c3 + 2c + 2. Let d be i(-2). Calculate the greatest common factor of 7 and d. 7 Let g(o) = -o*2 + 5o + 6. Let a be g(6). Let i = 190 + -82. Suppose ac = -3c + i. Calculate the greatest common divisor of c and 18. 18 Suppose -m = -0m - v - 17, -4v + 92 = 4m. Calculate the highest common divisor of m and 30. 10 Suppose -3g + 9 + 12 = 5x, 2g - 4x + 8 = 0. Let y be -91/(g + -3). Let z be (60/(-18))/((-2)/27). What is the highest common factor of y and z? 9 Suppose -5i + 21 = 1. Calculate the greatest common divisor of 36 and i. 4 Suppose -4a - a = -d - 57, 20 = 2a + d. What is the greatest common divisor of 33 and a? 11 Suppose -2r = -3r + 3. Let p = r + 1. Suppose 3y - 197 = d, pd + 10 + 316 = 5y. Calculate the highest common divisor of y and 22. 22 Let f = 93 + -67. Suppose 0 = 4o - 200 + 44. What is the highest common divisor of o and f? 13 Suppose 4a + 34 = 3i, 72 = -5a + 2i + 26. Let g be (0 + -2)/(4/a). What is the highest common divisor of g and 45? 5 Suppose -2n + 3z = 6, 3z = 2n - 2z + 10. Suppose -2r + 46 + 42 = n. Let s = 79 - r. Calculate the highest common divisor of 7 and s. 7 Let c(w) = 8w*2 - 2w - 2. Let x be c(2). What is the greatest common divisor of x and 26? 26 Let p be (-4 + 2)/((-1)/16). What is the highest common factor of 8 and p? 8 Suppose g - 5 = -0g. Suppose 3z - 15 = 2z. Suppose 3o - 4c = -0c - 3, gc = z. Calculate the highest common factor of o and 21. 3 Let r(p) = 2p*2 - 2p - 4. Let i be r(4). What is the highest common factor of i and 20? 20 Let y(q) = 7q2 - q + 1. Let v be y(1). Suppose 3d = vd. Suppose -t + 0t + 24 = d. Calculate the highest common divisor of t and 36. 12 Let w be 482/4 - 1/2. What is the highest common divisor of w and 24? 24 Let r be (-4)/((-2)/6-2). Let d be (4/r)/(4/(-162)). What is the greatest common divisor of 9 and d? 9 Let t = 40 - 24. Suppose -3r + 3h + t = -2h, 0 = -5r - 4h + 76. Calculate the greatest common divisor of r and 60. 12 Let r be 6/14 - (-2 + (-3835)/35). What is the greatest common factor of 14 and r? 14 Let a(w) = w*3 - 13w*2 + 15w - 15. Let d be a(12). What is the highest common divisor of d and 7? 7 Suppose -3g + 5b + 2 = 0, 10 = 2b - 0b. Suppose -2s + 5m = 243, 2s + 2m = -0m - 208. Let x = -46 - s. What is the highest common factor of x and g? 9 Suppose -f - 316 = -5f. Suppose 3r = -2w - 33 + f, 4r = -4w + 68. Let b be (-12)/15 + (-216)/(-45). Calculate the greatest common factor of r and b. 4 Let s be (26/3)/(4/6). Calculate the greatest common factor of 117 and s. 13 Let p = -14 + 39. Calculate the highest common divisor of p and 1. 1 Let o be 1926/24 + 1/(-4). Calculate the highest common factor of o and 16. 16 Let g(z) = -z - 5. Let d be g(-5). Suppose -18 = -4y + x, -y = -dy - 3x - 10. Calculate the highest common divisor of 8 and y. 4 Suppose -5l - 5f = -6f - 166, -5f = 2l - 61. Let v be 55/30 - 2/(-12). Suppose -vo - 2o + 88 = 0. What is the greatest common factor of l and o? 11 Let c(p) = -p*3 + 17p*2 + 39p - 5. Let s be c(19). Let b be 6/(-15) + 553/(-5). Let z = 1 - b. What is the greatest common factor of s and z? 14 Let y(j) = 10j2. Let i be y(2). Let m be 0 + 0 + 5 - -1. Let n = m + -1. What is the highest common divisor of i and n? 5 Suppose -4g = 2x - 4x + 32, g = 5x - 80. Calculate the highest common divisor of 2 and x. 2 Suppose 0y + 2 = y. Let g = 8 - y. What is the highest common divisor of 3 and g? 3 Let q be 2/(-4)(-9 + 1)/4. Calculate the greatest common divisor of q and 1. 1 Let d(f) = -3f - 8. Let q be d(-8). Let k be q/10(-30)/(-4). Calculate the greatest common divisor of k and 132. 12 Let k(i) = -i2 + 8i - 13. Let c be k(3). What is the highest common divisor of c and 22? 2 Let b be (-99)/446/9-6. What is the greatest common divisor of b and 1? 1 Let d(i) be the first derivative of -i*4/4 - 4i*3/3 + 3i*2 + 2. Let t be d(-6). What is the greatest common factor of 24 and t? 12 Suppose 0 = -4j - m + 2 + 20, 5j = 4m + 17. Suppose g + 2g = 48. Suppose 3x - jx + g = 0. What is the greatest common factor of 32 and x? 8 Suppose -2c - 19 = -5u, -3u = u - c - 17. Let q = u - -8. Suppose 3j = 70 + 203. What is the highest common divisor of q and j? 13 Let b(q) = 18q - 4. Let v be b(10). What is the highest common divisor of 16 and v? 16 Suppose 8 = 3b - 2b + 3i, -4i + 64 = 4b. Let j = -222 - -402. What is the greatest common divisor of j and b? 20 Let a(c) = c2 - 16. Let p be a(7). Let v(j) = -3j - 10. Let g be v(-7). What is the highest common factor of g and p? 11 Let u(l) = l + 13. Let q be u(-12). Let j = 2 + q. What is the greatest common divisor of j and 6? 3 Suppose -4o = -2b - 0b + 128, -4 = -2o. Let g = -19 - -87. Suppose 0 = 3s - 7s + g. What is the greatest common factor of b and s? 17 Suppose 5c = 8c - 624. Suppose 3o = o + c. Calculate the greatest common divisor of o and 26. 26 Let a = -25 + 29. What is the highest common factor of a and 16? 4 Let m(g) be the first derivative of g3/3 + 5g*2/2 - g + 5. Let c = -10 + 4. Let n be m(c). Calculate the greatest common divisor of 45 and n. 5 Suppose 0u = -2u + 18. Calculate the highest common factor of u and 27. 9 Let z(p) = 8p + 58. Let r be z(-7). What is the highest common divisor of 2 and r? 2 Let f = 213 + -53. Calculate the highest common factor of 64 and f. 32 Suppose 4r - 388 = 2h, 0r + 3h = -r + 90. Calculate the greatest common divisor of 12 and r. 12 Let l(c) = -c**2 + c - 3. Let m be l(-3). Let k be (25/m)/((-2)/132). Calculate the highest common factor of 10 and k. 10 Let n =	{ "pile_set_name": "DM Mathematics" }
Let o(k) be the third derivative of w(k). Is o(-10) a multiple of 20? True Let d(m) = -8m - 51. Let h be d(-7). Let o be h + 1788/30 + 2/5. Suppose 35j - 30j - o = 0. Is 9 a factor of j? False Suppose -2192h = -2148h - 609840. Does 45 divide h? True Suppose -5i = -30, 467i + 6582 = r + 468i. Does 12 divide r? True Let l(p) = p3 - p2 - 2p + 2. Suppose -8 = -4f + 3r, 2r + 2 = -f + 2f. Suppose -i = -f - 3. Does 12 divide l(i)? False Let h = 24 - 47. Let z(p) = -5p - 48. Let j(y) = 10y + 96. Let q(d) = 3j(d) + 7z(d). Is 19 a factor of q(h)? False Suppose 5t - 37168 = -2n, -3t = -131n + 132n - 18584. Suppose 24d - 47d = -n. Is d a multiple of 28? False Suppose -10v + 1937 + 2343 = 0. Suppose -j - v = -6j + 3b, -3j - 4b = -251. Suppose j = 3w - 5n, 4w + 5n = w + 95. Does 4 divide w? False Let h(k) = k + 4. Let g be h(5). Suppose -2o = -go. Is 20 a factor of 9 - -35 - (-2 - o)? False Let s(l) = -20 + l3 - 18l*2 - 7l + 30l2 - 6l*2. Is 13 a factor of s(-6)? False Suppose 18 = -5s - 2. Let t be 2(-1 - (s - (1 + -3))). Suppose 9c - 4c - 3m = 880, -2c + 336 = tm. Is 21 a factor of c? False Let u(s) = 2654s - 380. Is 121 a factor of u(13)? True Let f(o) = -o - 21. Let y be f(-12). Let b be -4 - (-3)/(y/(-177)). Let d = b + -35. Does 4 divide d? True Let l(u) = 83u + 13553. Is 52 a factor of l(-102)? False Let w(x) = x*2 + x + 7x*2 + 23x*2. Let p be w(1). Suppose -p = -v + 5q, 2q - 23 = -v + 2. Is 9 a factor of v? True Let i be 12/18 + 22/3. Suppose -v = -iv. Suppose vy - 3y + 36 = 0. Is y a multiple of 2? True Let n(a) = 197a + 53. Let p be n(-19). Let i be p/72 - (-2)/8. Let w = i - -138. Is w a multiple of 35? False Suppose 5i - 4x - 3610 = 23262, -5x + 21473 = 4i. Does 68 divide i? True Let j = 6038 - 5494. Does 22 divide j? False Let f(k) = -k + 18. Let m be f(13). Suppose -160 = -4l + 4y, -my - 112 = -2l - l. Suppose l = q + q. Is 11 a factor of q? True Suppose -4j + 3266 = -386. Let n = -636 + j. Is n a multiple of 35? False Let m(r) = -36r3 - 4r*2 - 2r + 1. Let w be m(-1). Let a be w/25 - 6/(-10). Suppose 0z - 42 = -2z - ai, 3z = -4i + 63. Is 3 a factor of z? True Let n(o) = -11 - 3o*2 + 25 - 19 + 0o*3 + 31o*3 + 6o. Is n(2) a multiple of 6? False Does 67 divide 6960756/76 - (8/12)/((-19)/3)? True Let z(o) be the first derivative of o*3/3 - 27o*2/2 - 9o + 106. Does 9 divide z(36)? True Suppose -d - 442q + 20514 = -446q, 3d + 2q - 61458 = 0. Is 65 a factor of d? False Let n(m) = 4m + 3590. Does 18 divide n(52)? True Suppose 5d + 2p = 7714, 18d + 3073 = 20d + 5p. Is 4 a factor of d? True Let n(a) = -3a2 - 25a + 52. Let g be n(10). Is 19 a factor of (39 + -7)g/(-8) - 3? False Let f(l) = l3 + 8l*2 + 7l + 4. Let i be f(-7). Suppose -4q = -ix + 412, -255 = 4x + q - 652. Suppose 3g - x = 8. Is g a multiple of 9? True Suppose -h - 2y = -0h - 45, -2y - 230 = -4h. Is 23 a factor of 5 - 285/h - 9464/(-22)? False Let s(a) = -a*3 - 7. Let k be s(4). Let o = 13 - k. Is 18 a factor of o? False Let d(s) = 467s + 214. Let p(n) = -157n - 71. Let i(u) = 3d(u) + 8p(u). Does 33 divide i(6)? False Suppose p + 7p = 48. Suppose -a - 40 = -pa. Let q(z) = -z3 + 10z*2 - 14z. Is q(a) a multiple of 8? True Let t = -336 + 330. Let h be (-2)/(4 - 2) + 2. Does 4 divide 13 + th/2? False Suppose 277 = -2x + 4g - 465, 1849 = -5x + 4g. Let w = x - -813. Does 37 divide w? True Let x(r) = 1939r + 1260. Does 46 divide x(4)? True Let q be (0 - 1904/20)/((-2)/(-10)). Let c = 848 + q. Does 12 divide c? True Suppose 2b - w = 746, b = 4b - 2w - 1119. Is b a multiple of 9? False Let n(f) = -2f*3 - 6f*2 + 4f + 3. Let b be n(1). Is 687 - (-2 + -4 - b) a multiple of 64? False Suppose 4a + w + 5266 = 34413, -5a = -2w - 36424. Is a a multiple of 37? False Let y(a) = -217a + 889. Let j(h) = 24h - 99. Let b(d) = -28j(d) - 3y(d). Does 18 divide b(-19)? True Let v = -23 - -27. Suppose -vf + t - 6 = -23, -2 = 2t. Suppose -w + 205 = fw. Does 11 divide w? False Suppose 28d - 381 = 123. Let w(c) = 3c*2 - 33c + 25. Is w(d) a multiple of 27? False Let v = 503 - 296. Suppose 4b = -5l + 310, 3b + l - 31 - v = 0. Is 10 a factor of b? True Suppose -2z = 5x - 5z - 170, 2x + 4z = 94. Suppose -xj - 78 = -43j. Is 3 a factor of j? False Let q(z) = -204z + 4289. Is q(-140) a multiple of 107? True Let o(k) = -63k*3 + 8k*2 - 32k - 247. Does 31 divide o(-7)? False Suppose 260t = 247t + 171496. Is 34 a factor of t? True Let b be (-1)/(-2)318/(-3). Let w be 9/2(-3 - b/3). Suppose -26 + w = 2a - h, -3a + 4h + 70 = 0. Is a a multiple of 4? False Let l = 38 - 74. Let j(x) = -2x - 16. Is j(l) a multiple of 7? True Let u be (-6)/(-24) + (-64806)/24. Does 15 divide ((-18)/(-27))/((-3)/u)? True Let a = 150 + -151. Does 13 divide 1(-12)/a20/6? False Let q be -7 - (-5 + 2 - -2). Let c(r) = 1 - 40r + 7r - 3 - 2. Does 28 divide c(q)? False Let l(z) = 4z3 - 15z*2 - 75z - 3. Does 17 divide l(20)? True Let j be 6/(-2) - (-9)/(-27)4035. Let x = -766 - j. Is 12 a factor of x? False Let n = -27941 + 38441. Is n a multiple of 60? True Suppose 9 + 209 = 2g. Let b be 405/18 + 2/4. Let u = b + g. Is 33 a factor of u? True Let h(q) = -q*2 - 14q - 18. Let t be h(-13). Let l be 3 + 1791/t - 1/(-5). Let p = 544 + l. Does 27 divide p? True Let g = -302 - -304. Suppose 25 = 5v, 0v + gv = 2t - 230. Does 13 divide t? False Suppose 4n - 3h = 7n - 109056, 109014 = 3n - 3h. Is 15 a factor of n? True Let h(f) = 15f*2 - 20f + 39. Is 3 a factor of h(7)? False Let t(f) = f*3 + 16f*2 - 2f + 8. Let j be t(-16). Let x = 36 - j. Does 21 divide ((-12)/16)/(-3) + (-83)/x? True Suppose 0 = -5x + 3x + 4. Suppose 6b = xb. Suppose b = a + a - 58. Is 15 a factor of a? False Suppose 3t + 15 = 0, 67j = 64j + 2t + 10690. Is 40 a factor of j? True Does 54 divide (1242/755)/(1/15)? True Suppose 0 = -2u - 69 + 81. Suppose -ud = -161 - 559. Is d a multiple of 10? True Let d be ((-4401)/36)/((-6)/16). Let v = 477 - d. Suppose 2o - v = 109. Does 24 divide o? False Let c = 945 - -1035. Is 99 a factor of c? True Is 31 a factor of 97644/(-8)12/(-18)? False Let s = 248 - 243. Suppose a + 4k = 34, 0 = sa - a + 5k - 125. Is a a multiple of 3? True Does 10 divide (25/(-5) - (4 + 5-2))500? True Let q(v) = v*3 + 7v*2 + 7v + 2. Let n be q(-5). Suppose 5g = ng - 7g. Suppose g = -8x - 105 + 489. Does 4 divide x? True Suppose -3n = m + n - 3, -3m = -n - 9. Suppose o - 636 = 4t, 6o + mt = o + 3180. Does 12 divide o? True Is 11 a factor of -5(-3)/60 - (223956/(-48) + -6)? False Let h be (-21 - -1)/((-1)/41). Suppose 389n = 370n + 152. Suppose 3d = nd - h. Is 47 a factor of d? False Suppose 11h - 40 = 9h. Suppose 0 = -0x - 2x + 2u - h, 4x + 35 = -u. Is 4/(-12) - 111/x a multiple of 3? True Suppose -10589 + 925 = -2h. Does 16 divide h? True Suppose -781 = j - 3s, 0s = 5j + 2s + 3837. Let k = -150 - j. Is 12 a factor of k? False Suppose m + 0m - 87 = -a, -159 = -2a - 5m. Let p = a - 90. Is 7 a factor of (-8)/(-2) + 17 + p + -2? True Let b be (-55)/30 - 1/6. Let p be 698/(-2) + 1 + b. Does 20 divide (1/((-15)/18))/(21/p)? True Let s(r) = r*3 - 8r*2 - r + 52. Let f be s(7). Is 11 a factor of f - (-349 + -2)/1? False Is (-6)/((-315)/(-25578)(-6)/20) a multiple of 4? True Suppose -5r + 13330 = -2a, 382a = -2r + 377a + 5361. Is 116 a factor of r? True Let c(t) = t2 - 66t + 949. Does 4 divide c(21)? True Let s(d) = -d*3 + 38d*2 - 18d + 251. Is s(35) a multiple of 20? False Let n = -175 - -168. Does 41 divide 492 - (0 - 0/n)? True Let a be 24/(-56) + 34/14 + 1. Suppose 222 = 4t + 2k, 0 = -4t - k - ak + 216. Does 19 divide t? True Let r(o) = -36o - 131. Let l be r(-5). Suppose -lz - 7296 = -81z. Is 57 a factor of z? True Suppose 0 = 230i - 228i - 5p - 11054, -i - 4p = -5566. Is i a multiple of 18? False Let j be -6 - 42/(-3) - -464. Suppose 5f - j - 3 = 0. Is 3 a factor of f? False Suppose -4j + 0i - 5i = 7, j + i = -1. Does 13 divide 462/(-11)j/(-4)? False Suppose 4g - 41176 = -4l, -6l - 41113 = -4g - l. Does 81 divide g? True Is 13 a factor of 37331 - (0/(-6) - (8 + -3))? True Suppose -206*b + 2	{ "pile_set_name": "DM Mathematics" }
Let t = -92 - -63. Let g = 70 + t. What are the prime factors of g? 41 Let g be 82 + 4/6-3. Let k be g/6 - (-4)/6. Suppose 4r + 12 = 0, 3b - 2r = k + 4. List the prime factors of b. 2 Let m(b) = -b. Let z be m(1). Let l = z + 1. Suppose -3v - 2j - 2j + 39 = l, 5v - 4j = 65. List the prime factors of v. 13 Suppose -l + 2i - 29 = 0, 5l - 3i + 84 = 2l. Let y = 38 + l. List the prime factors of y. 11 Let i(x) = -x3 + x2 + 2x + 2. Let u(j) = -j*2 - 8j - 2. Let c be u(-8). What are the prime factors of i(c)? 2, 5 Let z(b) = 2b2 + 9b + 2. List the prime factors of z(-6). 2, 5 Suppose 2y - 2 = 2b - 3b, 5y = 5b - 25. Let x be y/4 - 125/(-20). Suppose -4 = -xt + 5t. What are the prime factors of t? 2 Let y(c) = c3 + 12c*2 + 9c - 22. List the prime factors of y(-9). 2, 5, 7 Suppose 10u = 780 + 480. What are the prime factors of u? 2, 3, 7 Let z(k) = k3 - k2 - 3k + 3. Let s be 2/(-6) - 1/(-3). Suppose -2y + 9 - 3 = s. List the prime factors of z(y). 2, 3 Let n be (4 + -1)/((-3)/(-9)). Let d = n - 9. Suppose 15 = 5g - d. What are the prime factors of g? 3 Suppose -3h - 10 - 8 = 0. Let s(v) = -v + 0 - 4 - v - v. What are the prime factors of s(h)? 2, 7 List the prime factors of (-6)/24 - ((-1707)/(-4))/(-3). 2, 71 Let r = -16 - -24. Suppose r = 2h - 4. Let v = -1 + h. List the prime factors of v. 5 What are the prime factors of ((-918)/(-8))/3 + 42/56? 3, 13 Let v = 3 - 6. Let a be v/(2 + (-39)/24). What are the prime factors of (a - 1)(0 - 1)? 3 Suppose 5k = 2k + 3. What are the prime factors of 11 - (k - 0)1? 2, 5 Let b = -15 + 21. Suppose 3 + b = l. What are the prime factors of l? 3 Let p = 122 - 10. Suppose 4x - 6y + 9y - p = 0, 5x - 4y = 171. List the prime factors of x. 31 Suppose d - 6 = -0d - 4w, -4d - 5w + 13 = 0. Suppose -da = 0, 0y + 26 = -2y + 4a. Let v = -8 - y. List the prime factors of v. 5 Let o be (-2 - -12)1. Suppose -3p - 4 - 2 = o. What are the prime factors of (-10)/(-1) - (p - -3)? 3 Suppose 5m - 8 = m. Suppose -ma = a - 9. Suppose -18 = -3c + a. What are the prime factors of c? 7 Let j = -14 - -13. Let v(z) = -27z3 + z2 + z. List the prime factors of v(j). 3 Suppose -h = -5h + 240. Suppose -6n - h = -4n. Let a = -20 - n. List the prime factors of a. 2, 5 Let b(l) = -l2 - 7l - 2. Let s be 3 + -3 + 0 + -6. Let v be b(s). Let q = v - 1. What are the prime factors of q? 3 Let o(m) = -5m2 + 2m - 4. Let c(f) = -f*2 - f - 1. Let d(a) = -4c(a) + o(a). Let l be d(5). Suppose -lh + 0h + 60 = 0. What are the prime factors of h? 2, 3 Let j(p) = 4p2 - p. Let m be j(1). Suppose -mh + 40 = 2k - 3, 4k - 4h - 36 = 0. List the prime factors of k. 2, 7 Let n be 5 - ((-1)/(-1) - -2). Suppose b = -nb + 45. What are the prime factors of b? 3, 5 Let q = 5 - 1. Suppose -4 = t, 2j + 28 = qj - 4t. What are the prime factors of j? 2, 3 Let i be (5 + 4)/(-3) + 12. Suppose -i = -d + 7. What are the prime factors of d? 2 Let k(f) = 3f - 5. What are the prime factors of k(7)? 2 Let x(l) = -3l + 5. Suppose 0 = -5u + 17 - 47. What are the prime factors of x(u)? 23 Let f(p) = -p*2 - 7p + 6. Let q be (6/8)/((-2)/16). What are the prime factors of f(q)? 2, 3 Let z(u) = 2u2 + 3u - 9. List the prime factors of z(-7). 2, 17 Let h(x) = -x*2 + 5x + 6. What are the prime factors of h(5)? 2, 3 Let m be ((-1)/(-1))/((-3)/51). Let i = m + 35. List the prime factors of i. 2, 3 Let x = 11 - 18. Let n be (-316)/28 - 2/x. Let m = n + 21. What are the prime factors of m? 2, 5 Let l be 32/3 - -5. What are the prime factors of ((-7)/(-3))/(l/21)? 7 Let c(g) = g + 3g + 11 - 5g. Let o = -98 + 98. What are the prime factors of c(o)? 11 Suppose 4c = -3j - 2j + 34, 0 = -3j - c + 19. List the prime factors of j. 2, 3 Let j(m) = -m2. Let h be j(0). Let i(l) be the first derivative of l4/4 - l3/3 + l2/2 + 12l + 1. What are the prime factors of i(h)? 2, 3 What are the prime factors of (-8)/(-1 - 1)(7 + 3)? 2, 5 Suppose r + 4r - 755 = 5h, 4r - 568 = -5h. List the prime factors of r. 3, 7 Let z = 1 + 3. Suppose 0 = -zb - 3 + 31. What are the prime factors of b? 7 Let g(d) = 3d - 6. Let p be g(6). Let m be (-2)/3 + 32/p. Suppose -v + mv - 10 = 0. What are the prime factors of v? 2, 5 Let p(l) = -65l - 5. What are the prime factors of p(-1)? 2, 3, 5 Let y = 6 + -1. Let d = y + 2. What are the prime factors of d? 7 Let j be 153 - (-11 + 14). Suppose -j + 20 = -5q. List the prime factors of q. 2, 3 Let l be 4/(-10) + 7/5. Let z(g) = 2g + 1. Let j be z(l). What are the prime factors of (-22)/(-6) + j/9? 2 Let p(c) = c*2 - 4c - 1. Let t(j) = -2j2 + 8j + 1. Let d(i) = -5p(i) - 3t(i). Let g be d(4). Suppose r = 6 - g. What are the prime factors of r? 2 Let v = 113 + -38. List the prime factors of v. 3, 5 Let y(u) = 3u2 + 2u + 11. List the prime factors of y(-6). 107 Let j = -20 + 84. What are the prime factors of j? 2 Suppose 0j + 21 = -3j - 3k, 2j + 4k = -8. What are the prime factors of j/3(-54)/30? 2, 3 Let a = 23 - 9. What are the prime factors of a? 2, 7 Let z = 81 + -57. What are the prime factors of z? 2, 3 Suppose 2j - 2717 = -9j. List the prime factors of j. 13, 19 Let i(x) = -x*2 - 13x - 7. Suppose 4m + 40 = 4. Let c be i(m). Suppose y - 27 = -4o, 0 = 5o - 2y - c - 21. List the prime factors of o. 2 Suppose 4p = -8, -4r + 3p = 10 - 0. Let s be 1/r2-10. Suppose -sn = -n - 16. List the prime factors of n. 2 Let x be 4/(-12) + 326/6. List the prime factors of x/(-12)2/(-3). 3 Let v = -17 - -23. List the prime factors of v. 2, 3 Let q = 1 + -2. Let r(f) = f2 - f. List the prime factors of r(q). 2 Let w(t) = t3 - 3t*2 - 3t - 1. Let p be w(4). Suppose -m + 23 + p = 0. Let j = m - 18. List the prime factors of j. 2 What are the prime factors of (-16)/(-10)50/2? 2, 5 Suppose 5v + 12 = v, -4f + 262 = -2v. What are the prime factors of f? 2 Let b(u) be the second derivative of -u*5/20 + 5u*4/12 + 7u3/6 + u2/2 - 4u. List the prime factors of b(6). 7 Suppose 4w + 0w + 92 = 0. Let n = -42 - w. Let c = n + 32. What are the prime factors of c? 13 Suppose 3p = 7p - 96. Suppose m - 4b = 7, p = -3m - 4b + b. Let g(s) = -s*2 - 6s + 6. What are the prime factors of g(m)? 11 Let s(l) = -57l. Let b be s(-1). What are the prime factors of (-8)/44 + b/11? 5 Let h(z) = -z + 5. Let y be h(7). What are the prime factors of y + 2/(-2)-12? 2, 5 Let f(y) = y*3 + 5y*2 + 3y + 2. Let w be f(-4). Let s = 10 - w. Suppose -r = -s + 2. What are the prime factors of r? 2 Let n = -76 + 86. List the prime factors of n. 2, 5 Let y = -9 - -13. Let f be (35/(-21))/((-1)/3). Suppose -3j - y = -fj. What are the prime factors of j? 2 Let j(s) be the first derivative of -s*3/3 - 5s*2/2 + 8s - 1. Let i be j(-6). Suppose -iy + 10 = -22. List the prime factors of y. 2 Let o be (-12)/28 - (-93)/21. Suppose 52 = 2m + 4f, -3m - 2m = of - 106. What are the prime factors of m? 2, 3 Suppose 12 = -4k, 4k - 6 = -3y + 2k. List the prime factors of y. 2 Suppose 7x + 120 = 12x. List the prime factors of x. 2, 3 Let i = 6 + -4. Let b be i(-3)/6 - -5. Suppose 0 = x - bx + 15. List the prime factors of x. 5 Let c(s) = s*2 + 2s + 5. List the prime factors of c(-3). 2 Suppose -3y - 96 = -5y. Let x(v) = 3v2 - v. Let o be x(1). Suppose 0 = -oi - 12 + y. List the prime factors of i. 2, 3 What are the prime factors of 8/36-1 - 742/(-18)? 41 Let t be (8 + -2)/((-4)/(-2)). Suppose 0 = 3o - 1 - 2. Let x = t - o. What are the prime factors of x? 2 Let d(l) = -62l + 17. List the prime factors of d(-2). 3, 47 Let o be (18/4)/(1/2). Suppose u = 2u - o. Let i = 19 - u. What are the prime factors of i? 2, 5 Let s(o) = -1 + 7o2 - 4o + 12o2 + 2o. List the prime factors of s(-1). 2, 5 Suppose -3l + 2d = -33, d - 33 = -l - 3l. Suppose -l - 67 = -4y. List the prime factors of y. 19 Let h(z) = 6z - 6. Let a be h(4). Suppose 6t + a = 3t. List the prime factors of (2/t)/(3/(-45)). 5 Suppose 3f - 33 = 3. List the prime factors of f. 2, 3 Let m(g) = g*2 - g - 1. Let l be 3/1(-1)/(-3). Let i(z) = -5z2 - 3z. Let n(u) = li(u) + 4m(u). List the prime factors of n(-6). 2 Let c(u) = u*3 - 4u*2 - 5u + 7. Let o be c(5). Su	{ "pile_set_name": "DM Mathematics" }
{n: 1, b: 3, o: 1, s: 2, i: 5}. What is prob of sequence snbs? 1/1980 What is prob of sequence bb when two letters picked without replacement from {b: 3, q: 1}? 1/2 What is prob of sequence wke when three letters picked without replacement from swkwoweekweeeeeeoeo? 4/323 Calculate prob of sequence ed when two letters picked without replacement from {e: 1, r: 2, d: 3, w: 1, v: 10}. 3/272 Calculate prob of sequence mou when three letters picked without replacement from cmxcmmcaxcou. 1/440 Two letters picked without replacement from {o: 2, e: 4, g: 1, v: 1, t: 1}. What is prob of sequence gv? 1/72 Calculate prob of sequence ll when two letters picked without replacement from lluge. 1/10 Two letters picked without replacement from bssssb. What is prob of sequence sb? 4/15 Calculate prob of sequence nni when three letters picked without replacement from nnninnnnninnnni. 66/455 What is prob of sequence st when two letters picked without replacement from tstssotsooosss? 3/26 What is prob of sequence bb when two letters picked without replacement from {a: 1, k: 4, b: 3, v: 3, e: 4, z: 5}? 3/190 What is prob of sequence cm when two letters picked without replacement from tttmmtttccmdmmmdmtm? 8/171 Calculate prob of sequence okqh when four letters picked without replacement from {h: 5, q: 1, i: 2, k: 1, o: 1}. 1/1008 Calculate prob of sequence guzg when four letters picked without replacement from tuuuzuguugqgquqtngzu. 8/4845 Calculate prob of sequence gmrk when four letters picked without replacement from mmkrrmrrmmmkgmrmmmfr. 1/969 What is prob of sequence ffff when four letters picked without replacement from {z: 3, f: 1, b: 3, j: 3}? 0 Calculate prob of sequence ttn when three letters picked without replacement from {x: 4, t: 3, n: 1}. 1/56 Two letters picked without replacement from {r: 2, t: 4, k: 3, z: 2}. What is prob of sequence rk? 3/55 Three letters picked without replacement from camrlmcgaamaaca. Give prob of sequence rag. 1/455 Calculate prob of sequence fxjf when four letters picked without replacement from {f: 5, x: 2, j: 4}. 2/99 Three letters picked without replacement from {d: 6, q: 2}. Give prob of sequence qdq. 1/28 Calculate prob of sequence ze when two letters picked without replacement from {t: 1, z: 2, h: 4, o: 1, e: 4, g: 6}. 4/153 Calculate prob of sequence nn when two letters picked without replacement from nbvnbvbv. 1/28 Three letters picked without replacement from piypp. What is prob of sequence ppi? 1/10 What is prob of sequence sx when two letters picked without replacement from {x: 5, s: 3}? 15/56 Four letters picked without replacement from dddlldlddl. Give prob of sequence lddl. 1/14 What is prob of sequence oo when two letters picked without replacement from qooqoooooooooqqqooq? 26/57 Three letters picked without replacement from ffccmmfmnim. Give prob of sequence fmm. 2/55 Two letters picked without replacement from nnciicci. What is prob of sequence cc? 3/28 Calculate prob of sequence bab when three letters picked without replacement from baebb. 1/10 Two letters picked without replacement from iikkikkk. What is prob of sequence ik? 15/56 What is prob of sequence rv when two letters picked without replacement from {r: 4, v: 3, j: 7, n: 1, f: 2}? 3/68 Calculate prob of sequence pi when two letters picked without replacement from {i: 7, x: 10, p: 1}. 7/306 What is prob of sequence hs when two letters picked without replacement from mhshmmshshmshmmhh? 7/68 Calculate prob of sequence ezee when four letters picked without replacement from eeeeezz. 1/7 Calculate prob of sequence soh when three letters picked without replacement from {s: 5, o: 1, h: 1, b: 5}. 1/264 Calculate prob of sequence tttb when four letters picked without replacement from {b: 2, a: 1, t: 4}. 2/35 Four letters picked without replacement from {h: 15, n: 3}. Give prob of sequence hnhn. 7/408 Calculate prob of sequence hhe when three letters picked without replacement from rhrrrheheeree. 5/286 Two letters picked without replacement from {i: 6, v: 2}. Give prob of sequence ii. 15/28 Two letters picked without replacement from ylylyy. Give prob of sequence yy. 2/5 Four letters picked without replacement from kffkkf. What is prob of sequence kfkf? 1/10 Calculate prob of sequence dd when two letters picked without replacement from xxxxxdxxd. 1/36 What is prob of sequence xoq when three letters picked without replacement from tttqutuoxtxxt? 1/572 Calculate prob of sequence rd when two letters picked without replacement from {z: 9, d: 1, r: 3, c: 3, i: 1, m: 2}. 1/114 Calculate prob of sequence ddv when three letters picked without replacement from {q: 3, p: 3, k: 4, d: 3, v: 4, n: 3}. 1/285 Four letters picked without replacement from {t: 1, k: 2, p: 7, d: 1, i: 6, z: 2}. Give prob of sequence kipk. 7/7752 What is prob of sequence yyh when three letters picked without replacement from mymmyymyymmmymhmmmh? 10/969 Calculate prob of sequence xxax when four letters picked without replacement from axxaxxaxxx. 1/8 What is prob of sequence lll when three letters picked without replacement from {o: 3, y: 5, l: 5}? 5/143 Four letters picked without replacement from {c: 4, e: 1, x: 2, n: 7, q: 4}. Give prob of sequence cnce. 7/6120 Two letters picked without replacement from wwtwtw. Give prob of sequence wt. 4/15 Two letters picked without replacement from {p: 1, l: 1, x: 1, n: 2}. Give prob of sequence ln. 1/10 What is prob of sequence ut when two letters picked without replacement from {v: 1, u: 1, t: 1}? 1/6 Two letters picked without replacement from xxxaxxaxxxxxxxxxxxx. What is prob of sequence aa? 1/171 Calculate prob of sequence tpv when three letters picked without replacement from {t: 1, p: 1, d: 1, v: 1, s: 1}. 1/60 Calculate prob of sequence huz when three letters picked without replacement from uihuunnxuzuzz. 5/572 Two letters picked without replacement from wwwvwvwwvw. Give prob of sequence vv. 1/15 Two letters picked without replacement from {v: 5, i: 5, x: 6, c: 3, u: 1}. Give prob of sequence vu. 1/76 Three letters picked without replacement from {r: 5, d: 7}. Give prob of sequence rdr. 7/66 What is prob of sequence xn when two letters picked without replacement from xxgxnfnxgxgfcx? 6/91 Calculate prob of sequence jbtj when four letters picked without replacement from {b: 8, j: 10, t: 1}. 5/646 What is prob of sequence bwh when three letters picked without replacement from {y: 7, b: 2, w: 4, h: 2, z: 4, p: 1}? 2/855 Calculate prob of sequence cfr when three letters picked without replacement from pfsspycyr. 1/504 What is prob of sequence ye when two letters picked without replacement from {x: 2, u: 2, d: 1, e: 1, k: 1, y: 1}? 1/56 Calculate prob of sequence ftz when three letters picked without replacement from zfffggfffgtffzfzzgfg. 1/171 Calculate prob of sequence sj when two letters picked without replacement from {j: 3, s: 1, l: 5, k: 1}. 1/30 What is prob of sequence oos when three letters picked without replacement from xscvrro? 0 What is prob of sequence jj when two letters picked without replacement from jiji? 1/6 Two letters picked without replacement from {c: 4, n: 4, l: 6}. Give prob of sequence cc. 6/91 What is prob of sequence ch when two letters picked without replacement from hchhchhhhhchhchhcch? 13/57 Calculate prob of sequence qmz when three letters picked without replacement from {q: 9, z: 2, m: 2}. 3/143 Calculate prob of sequence jx when two letters picked without replacement from {x: 2, p: 2, j: 2}. 2/15 Two letters picked without replacement from {h: 2, l: 2, s: 1, z: 1, o: 1}. What is prob of sequence zh? 1/21 Two letters picked without replacement from uulllyllyu. Give prob of sequence uu. 1/15 Calculate prob of sequence qqmq when four letters picked without replacement from {f: 2, p: 2, v: 1, m: 1, q: 6}. 1/99 Four letters picked without replacement from eeoeeyoeu. What is prob of sequence euee? 5/252 Three letters picked without replacement from {c: 6, m: 5, v: 1, i: 1, r: 2}. What is prob of sequence ric? 2/455 Two letters picked without replacement from {p: 1, q: 3, x: 1}. Give prob of sequence qx. 3/20 Calculate prob of sequence zddf when four letters picked without replacement from {z: 6, e: 1, d: 6, f: 4}. 3/238 Two le	{ "pile_set_name": "DM Mathematics" }
is b rounded to one decimal place? 0.6 Let d = -89929 - -244929. What is d rounded to the nearest 100000? 200000 Let f = 28932270 - 28932279.0999345. Let r = 9.1 + f. Round r to 5 decimal places. 0.00007 Let i(k) = -6982k2 - 41k + 593. Let q be i(11). What is q rounded to the nearest 100000? -800000 Let u = 4374.318 - 4371. Round u to the nearest integer. 3 Let n = -47 - -75. Suppose 5q = 3o - n, -3o + 5q = 2q - 24. Let w be (-120)/(o/(-9)3/2). Round w to the nearest 100. 100 Let v = -0.026749 - 8.665851. What is v rounded to one decimal place? -8.7 Let x = 2742165269.29978 - 2742297744. Let p = x + 132410.7. Let c = p - -64. Round c to four decimal places. -0.0002 Let f = 83 - 86.9. Let y = f + 5.9. Let g = y + -2.0001. Round g to four dps. -0.0001 Let t = 34.3175 + -0.0175. Let s = t + -34.300000318. Round s to seven decimal places. -0.0000003 Let j = 65.25886 - 64.73. What is j rounded to 3 decimal places? 0.529 Let l = 93.844 + -94. Let a = 1923 + -1922.8633. Let h = a + l. Round h to 3 decimal places. -0.019 Let a = -0.00306 - -0.36036. Round a to one dp. 0.4 Let d = 793.52 + -824. What is d rounded to 0 dps? -30 Let b = 29107 + -29106.999974994. Round b to six dps. 0.000025 Let b(s) = 792s2 + 103s - 4835. Let w be b(45). Round w to the nearest ten thousand. 1600000 Let c = 9.8825 - 11.84. Round c to 2 dps. -1.96 Let n = 144605 + -78805. Suppose -43l + n = -33l. Round l to the nearest one thousand. 7000 Let f be (-9 + 133)(-753871)/(-4). Suppose 3o = -d + f, 5o + 3d - 16900008 - 22049995 = 0. Round o to the nearest 1000000. 8000000 Suppose 6c = 5c + 4a + 236, -4c = -2a - 1014. What is c rounded to the nearest 10? 260 Let r be ((-7)/1 - (-7 - 6)) + 10823/(-1). Round r to the nearest one hundred. -10800 Let b = -5.1 + 1.6. Let u = -3.408 - b. Let z = u + -0.0981. What is z rounded to two dps? -0.01 Let w = -7.097 - -7.097021275. What is w rounded to seven decimal places? 0.0000213 Let m = 1009.0001966 - 1009. What is m rounded to four dps? 0.0002 Let c be -136800(-51)/(510/(-2020)). What is c rounded to the nearest 100000? -27600000 Let z = 2883 - 1704. Let j = z - 798. Let q = -380.99998741 + j. Round q to 6 dps. 0.000013 Suppose 3u + 327 = 54. Let q = -722 + u. Let x = q + 571. Round x to the nearest 10. -240 Let b(s) = 2. Let j(z) = 167039z - 146. Let i(r) = -5b(r) + j(r). Let y be i(4). What is y rounded to the nearest one hundred thousand? 700000 Let l be ((-2)/(-4))/(33(-15)/(-9891090)). Round l to the nearest one thousand. 10000 Let s = 166.646 + 7.314. What is s rounded to the nearest 10? 170 Let p = -8633 + 2241.4. Round p to the nearest 1000. -6000 Let m = -15.169334 + 15.19. Round m to three decimal places. 0.021 Let k = 598691 - 598690.988200446. Let h = -0.0118 + k. Round h to 7 dps. -0.0000004 Let r = 1.73814332 - -0.57170538. Let w = r + -2.31. What is w rounded to 5 decimal places? -0.00015 Let f(x) = -x*2 + 3x + 33. Let r be f(-4). Suppose 26l = 29l - 4m + 30090020, -30090025 = 3l - rm. What is l rounded to the nearest one million? -10000000 Suppose -9u - 840662 = -280412. Let k be 32(175/(-15))/(4/u). Round k to the nearest one million. 6000000 Let g = 18 - -15. Let k be g/(4 - 4407279/1101819). Let c be -3 + (-75)/(-20) - k/(-12). What is c rounded to the nearest one hundred thousand? -1000000 Let k(p) = -703998p + 10. Let c = 50 - 55. Let f be k(c). Suppose -9q + q = -f. Round q to the nearest 100000. 400000 Suppose 0 = -a + 5a - 3g + 242, -g - 188 = 3a. Let d = 770 - a. Round d to the nearest 100. 800 Let s = -1037965.1 - -1038765.0151. Let p = s - 800. Round p to two decimal places. -0.08 Let w be 109 + 1/(2 - 1). Suppose 2g + w = 2x, 3g + 3x + 165 = -0x. Let s be (32/10)/((-11)/g). What is s rounded to zero dps? 16 Let a = 0.01535 - 0.012567. Round a to 3 dps. 0.003 Suppose 4i - 1540 = 2i. Suppose i - 2374 = -2s. Suppose -2122 = -3y - s. Round y to the nearest one hundred. 400 Suppose -7n + 11n = -5138508. Let d = n + 2140627. Round d to the nearest 10000. 860000 Let v = 0.0664 - 117.5664. Let d = v - -115.303. What is d rounded to one dp? -2.2 Let p = 192 - 2089. Let y = p - -1793.3. Round y to the nearest ten. -100 Let w = 2.62 - -121.38. Let v = 122 - w. Let m = v - -5.9. Round m to zero decimal places. 4 Suppose 5u = 5h + 10, 2h + 0u - u = 0. Suppose -hr - 499 = -5y, 4r - 6r - 4 = 0. Suppose 105n - yn = 2106. What is n rounded to the nearest ten? 350 Suppose -4h = o - 40, -2o + h - 14 = -58. Let g be (9/o)/3 + (-300000005)/40. What is g rounded to the nearest one million? -8000000 Let s = 87 + -243. Let m be (-1 - 83/2)s. Round m to the nearest one thousand. 7000 Let q = -792751.0362 + 792335. Let l = -1413 - -997. Let m = q - l. What is m rounded to 2 decimal places? -0.04 Suppose -3q - 8w - 11 = -3w, -4q = -2w - 20. Suppose 19l = qf + 15l - 13100, 4f = 5l + 17465. Round f to the nearest one thousand. 4000 Let v(m) be the second derivative of 137m4/12 - 44m*3/3 + 14m*2 + 29m + 5. Let r be v(22). Round r to the nearest 10000. 60000 Let u = 1.90861 - 1.972. Let t = -0.0661 - u. Round t to four dps. -0.0027 Let c = -232063744.5000251 - -232063733. Let t = c - -11.5. Round t to 5 dps. -0.00003 Let m = -606 + 634. Let g be ((-16)/m)/(-2) - (-2352000016)/(-56). What is g rounded to the nearest 1000000? -42000000 Let o = -437 - -891. Let h = -454.0976 + o. Round h to 3 decimal places. -0.098 Let x = -6.01 - -458.01. Let l = -451.999998048 + x. What is l rounded to 7 decimal places? 0.000002 Let w = -2866242847 + 2864797072.551. Let u = -1447146 - w. Let h = u + 1371. Round h to two decimal places. -0.55 Suppose -2i - 22i + 159831600 = 114i. Round i to the nearest one hundred thousand. 1200000 Let w = -409.4 - -409.4000014398. What is w rounded to seven decimal places? 0.0000014 Let t = 9.32 - 0.32. Let c = t - 6.4. Let x = 2.8 - c. What is x rounded to 1 dp? 0.2 Let u = -14089.2 + 10616. Round u to the nearest one hundred. -3500 Let k = 4778 + -4612.95. What is k rounded to 0 decimal places? 165 Let q = 27 - 20. Suppose -6750 = -12o + qo. Suppose -f + o = 4x + 4f, 1028 = 3x - 4f. What is x rounded to the nearest one hundred? 300 Let v be 18 - (0/3)/(-1). Let o = v + -21. Let f be 11040004/(-12) - (2/2)/o. Round f to the nearest 100000. -900000 Let f = -0.1504 + 7.2204. Let i = 3 + 5.5. Let l = i - f. Round l to the nearest integer. 1 Let u = -1117 - 566. Let c be (2722/(-8))/((-26)/(-312)). Let o = u - c. What is o rounded to the nearest 100? 2400 Let c = -640.132753 + 640.08. Round c to two dps. -0.05 Suppose -s - 6w + 518989 = -7w, 1037976 = 2s - w. Let y = s + -799987. What is y rounded to the nearest one hundred thousand? -300000 Let b = 6181047.9783 + -6181385. Let r = b - -337. What is r rounded to 3 decimal places? -0.022 Let d = -291375895652.000000786 + 291375894949. Let g = -703 - d. Round g to seven decimal places. 0.0000008 Let l = 224.85 - 237. Let f = 12.17955 + l. Let w = f + -0.031. Round w to four decimal places. -0.0015 Let z = -82 - -146. Let m = -19 + z. Let d = -44.954 + m. What is d rounded to 1 dp? 0 Let n = 17 + -16.967. Let r = -6.807 - n. Round r to 1 decimal place. -6.8 Let s = -4097.000000837 + 4097. Round s to seven decimal places. -0.0000008 Let d = -110 + 109.69. Let r = d + 0.272. What is r rounded to two decimal places? -0.04 Let r = 0.11496 + -0.113368. What is r rounded to three decimal places? 0.002 Let b(r) = r - 9. Let a be b(-4). Let l = 4 - a. Let s be 18987 + l - (4 + 0). Round s to the nearest 10000. 20000 Let q = -235 + 235.99. Let p = 860.275 + -861. Let m = q + p. Round m to two dps. 0.27 Let a = -2.103851 - -24.604071. Let i = -22.5 + a. What is i rounded to 3 decimal places? 0 Let m(t) = 85539t3 + 7t*2 - 6t + 23. Let n be m(8). Suppose -v + n = 9216391. What is v rounded to the nearest one million? 35000000 Let f be (-8 + 116/16)/((-6)/32). Suppose fj + 864 = -3u, 2u - 5j = u - 269. What is u rounded to the nearest one hundred? -300 Let j = -11207.999918767 - -11208. Round j to 5 decimal places. 0.00008 Let s = 5591012 + 3350977. Let q = s + -5546008. Let t = -9004019 - q. What is t rounded to the nearest one million? -12000000 Let w = -19.9 - -0.9. Let o = -18.	{ "pile_set_name": "DM Mathematics" }
4o4 - 59o*2 + 17o + 2 wrt o. -184268496o What is the first derivative of 17ac3 + ac*2 - 3591a - 340c3 - 3c - 314 wrt a? 17c3 + c2 - 3591 What is the first derivative of -37966100sz - 263498s + 49 wrt z? -37966100s What is the third derivative of -26a*4j*3 - 5519a4 - a3 - 4a2j*3 - 161a*2 - 11030 wrt a? -624aj3 - 132456a - 6 What is the derivative of 21188u2 - 28u - 14336362 wrt u? 42376u - 28 What is the third derivative of 1844799j*3k*3 - 4j*3m - 56j2k*3m - 2j2 - 97jm + 21 wrt j? 11068794k*3 - 24m What is the second derivative of -22prt2 + 2prt + 99pr - 6pt*2 - rt*2 + 109rt + r - 355t*2 - 10t wrt t? -44pr - 12p - 2r - 710 What is the derivative of -252696491q2 - 352132647? -505392982q Find the second derivative of -7mp*2 + 269mp - m - 2504295p*2 + 147p + 14 wrt p. -14m - 5008590 What is the second derivative of 27353441i*3t*3 - 28325420i*3t wrt t? 164120646i3t What is the second derivative of 974857408l2 + 10754l - 8426 wrt l? 1949714816 Find the third derivative of 276439a4 + 230a*3 - 638a*2 + 144706 wrt a. 6634536a + 1380 Find the second derivative of -9716254y2 + 51396456y. -19432508 What is the third derivative of -479211856jk*3 - 28479jk2 + 47k*2 + 16k wrt k? -2875271136j Find the second derivative of t2x*3 - 8t*2x*2 - 406170t*2 - 7tx2 - 335x*3 - 41x + 5 wrt t. 2x3 - 16x*2 - 812340 Find the second derivative of -1702838q*5 - 3q*4 - 2q*2 + 1223369q - 4 wrt q. -34056760q3 - 36q*2 - 4 Differentiate 40444801u*3 - 3u*2 - 109495395. 121334403u*2 - 6u What is the derivative of -112437375t3 - 165783917? -337312125t*2 What is the third derivative of -1405497n*5 + 11n*4 - 42393535n*2 wrt n? -84329820n*2 + 264n What is the first derivative of -795kp - 877k - 8472006p wrt k? -795p - 877 Find the third derivative of -514w*4 - 126602w3 - w2 - 717w + 434 wrt w. -12336w - 759612 Find the first derivative of 4k2oz3 + 5k*2oz2 + 383k*2w - 7k2 + 572kowz3 - 2koz*3 + 201koz*2 - 3ow - 5 wrt w. 383k*2 + 572koz*3 - 3o What is the first derivative of 29mo - 431702m - 2o - 407111 wrt m? 29o - 431702 What is the third derivative of -18624hm2t*2 + 3hmt*3 - 28hmt - 7ht*2 + 4941375m*2t3 + m2 wrt t? 18hm + 29648250m2 Find the third derivative of -49460935c*3 - 437c*2 - 382c + 2 wrt c. -296765610 Find the third derivative of 202298568i4 - 77276i*2 - 3i - 100 wrt i. 4855165632i What is the derivative of -453709626b*2 + 391941252 wrt b? -907419252b Find the first derivative of -97072l2u*2 + 4l*2u - l*2 - 1019101 wrt u. -194144l*2u + 4l2 Find the second derivative of -58020737g*2 - 9853g - 573 wrt g. -116041474 What is the second derivative of 2859102w2 - 2w - 2580771 wrt w? 5718204 What is the first derivative of -53507689i + 36038034? -53507689 Find the second derivative of -496v*3 - 1573v*2 + 12040373v wrt v. -2976v - 3146 What is the second derivative of 15573351a*2 + 26942144a? 31146702 Find the second derivative of -97778q3 + 2481q*2 - 97510774q - 4. -586668q + 4962 What is the second derivative of 369c*3k - 2c3s - 722c2s*2 - 91cks*2 - 2cs2 + 37cs - ks + 2 wrt c? 2214ck - 12cs - 1444s2 What is the derivative of 198601644bft*3 - 78ft3 - ft - 7711t - 6 wrt b? 198601644ft3 Find the first derivative of 170719193mx - 57696x - 201 wrt m. 170719193x What is the third derivative of -193js3w + js3 + 3js2w + 522343jw - 5260s3w wrt s? -1158jw + 6j - 31560w What is the second derivative of -9813830k2 - 17268k + 1? -19627660 Find the third derivative of 6734589m5 - 16712869m*2 - 2. 404075340m*2 Find the third derivative of -125952599o*5 - 376378990o*2 wrt o. -7557155940o*2 Find the first derivative of -14880209j + 45713735 wrt j. -14880209 Find the third derivative of -5051127z6 + 7z*2 + 51z - 79 wrt z. -606135240z3 Find the third derivative of 39822008or4 + 216or2 - 169or + 7o + 6r2 - 2 wrt r. 955728192or What is the first derivative of -1034972577r - 1155267661? -1034972577 Find the second derivative of 30h4 - 145155h*3 + 7241768h. 360h2 - 870930h What is the derivative of -178d2g*2 + 2d*2 + 2308dg2 - 14705250d + g wrt g? -356d2g + 4616dg + 1 Differentiate 802018h3 - 62h*2 + 215541414. 2406054h*2 - 124h Find the second derivative of -144217579p2 - 11p - 12337162. -288435158 What is the third derivative of 35454813s3 + 2626096s*2 - s + 3 wrt s? 212728878 What is the third derivative of -67054624d*2g*2r3 + d2g2r - 787dg*2r*2 + dg*2r + 3dg - 11dr2 + g2r2 - 1 wrt r? -402327744d*2g*2 Find the third derivative of 1257576t*2y*3 - 23t*2y + ty3 - 3y*3 + 1764y*2 - 689y wrt y. 7545456t2 + 6t - 18 Find the second derivative of 2i2ry + 5i*2y*3 - 681792i*2 + iry3 - 3iry + 6iy*3 - 1464i - ry3 + 4y*3 wrt i. 4ry + 10y*3 - 1363584 What is the third derivative of -7973181f*3 + 3f*2 + 799f - 35? -47839086 What is the third derivative of 2p3t*2 + 75086p*3ty - 68p*3t - 241p2t*2y + p*2t*2 + 55309pty wrt p? 12t2 + 450516ty - 408t Find the third derivative of -4482451x4 + 3x*2 - 17565769x + 2. -107578824x Find the third derivative of -gw*6 - 6669891gw4 + 299gw2 - g + 1157w*2 wrt w. -120gw3 - 160077384gw Find the first derivative of 34435299m*2 - 14874913 wrt m. 68870598m Find the second derivative of 35424x3 - 520x*2 - 8x - 475578 wrt x. 212544x - 1040 Find the third derivative of 39398686p*3 + 48925222p*2 wrt p. 236392116 What is the first derivative of 25709134al2x + 10al*2 - 28988a wrt x? 25709134al*2 Find the first derivative of 8i*3 - 25497i*2 - i + 46270933. 24i*2 - 50994i - 1 What is the second derivative of 12705880y2 + 178740y - 2? 25411760 Find the second derivative of 167132881i5 - 237340i + 127. 3342657620i3 Find the first derivative of 82917t*2 + 10054447. 165834t What is the third derivative of -9519786j4 - 68424j*2 - 44j wrt j? -228474864j What is the second derivative of -662335b*2hy2 + 71b*2ty - 63bht - bhy*2 + 22bhy + 5bh - 2hty + 4ty2 + ty - 3y2 wrt b? -1324670hy2 + 142ty Find the first derivative of -2999645c*3 - c - 8550761. -8998935c*2 - 1 What is the second derivative of 97867297x*2 - 9384x - 6651? 195734594 Find the second derivative of 294516862q4 - 252763191q. 3534202344q2 Find the second derivative of c4 - 6424247c*3 + 3287247c wrt c. 12c2 - 38545482c Find the first derivative of 451608w3 - 2w*2 - 2w - 36925855 wrt w. 1354824w2 - 4w - 2 Find the third derivative of 75a3gs - 119291a*3s*2 - 4a*3s + 7426a2gs2 + a2s*2 - 84ags*2 + gs*2 wrt a. 450gs - 715746s*2 - 24s What is the third derivative of 15145404z3 + 28703909z*2? 90872424 Differentiate 19258932bn + 650n + 4885 with respect to b. 19258932n What is the third derivative of 13890b6 + b5 - 794b3 - 7419470b*2 - b? 1666800b*3 + 60b*2 - 4764 Find the third derivative of 522k*4 + 17909k*3 - 55515368k*2 + 2k wrt k. 12528k + 107454 What is the third derivative of 181475766n*6 + 551n*2 + 80n + 906? 21777091920n3 Find the third derivative of -2828n*6 - 114n*4 - 3n*3 + 10n*2 - 13220n wrt n. -339360n3 - 2736n - 18 What is the second derivative of 5h2l2 + h2l + 695299h*2 + 2hl2 + 9811731l*2 + 2l + 1 wrt h? 10l2 + 2l + 1390598 Find the first derivative of 9610476v3 + 598513. 28831428v*2 What is the third derivative of -302183957x*3 - 37284194x*2 + 10x wrt x? -1813103742 Differentiate 12333768l2 - 10631894 with respect to l. 24667536l Find the third derivative of 414d3x*3 - 58379d*3 - 2d*2x*3 - 31d*2x*2 - 16dx3 + 76x3 - x2 wrt d. 2484x3 - 350274 What is the second derivative of -82r*4s + 10446r3sy + 2rs + 159r*y +	{ "pile_set_name": "DM Mathematics" }
be the first derivative of -x - 2n3 + 1/2n*4 + 8n + 0n2. Find s, given that i(s) = 0. -1, 2 Let d = -72 - -41. Let j = d + 35. Let -4a*5 + 10a*3 - 8 + 8 + 4a*2 - 6a*5 - 4a*j = 0. Calculate a. -1, -2/5, 0, 1 Let s(r) be the first derivative of -8 - 8/3r - 5/6r4 + 1/9r*6 + 2/15r*5 + 8/3r*2 - 2/9r*3. Factor s(w). 2(w - 1)*3(w + 2)*2/3 Let o(x) be the first derivative of 2x*6/15 - 2x*4/3 + 2x*2 - 16x + 9. Let m(w) be the first derivative of o(w). Solve m(l) = 0 for l. -1, 1 Factor 1/11f2 - 17/11 - 16/11f. (f - 17)(f + 1)/11 Let x(s) = 2s*2 + 4s + 12. Let l(a) = a*2 + 22a + 41. Let n be l(-20). Let c(h) = -h + 2. Let w(b) = nx(b) - 6c(b). Factor w(i). 2i(i + 5) Factor -435 + 315 + 60n + 10n*2 + 236n. 2(n + 30)(5n - 2) Solve 4/5f*2 + 16 - 84/5f = 0 for f. 1, 20 Factor 3x - 4x*4 - 3 + 4x*2 + 3 - 6x + x + 2x5. 2x(x - 1)3(x + 1) Let u be 14/7 - (2 + -2). Factor -4ku + 2k*2 + 6k + 4 - 4. -2k(k - 3) Let d(a) be the first derivative of 1922a3/3 - 248a*2 + 32a - 237. Factor d(u). 2(31u - 4)2 Let t(w) be the third derivative of -w8/20160 - w*7/1260 - 13w*5/60 + 12w*2. Let d(l) be the third derivative of t(l). Factor d(c). -c(c + 4) Let j(a) be the first derivative of a*5/8 + 21a4/32 + a3/6 + 282. Factor j(n). n*2(n + 4)(5n + 1)/8 Let h(f) be the third derivative of -f*5/270 + 4f*4/27 - 64f*3/27 - 77f*2. Find n, given that h(n) = 0. 8 Suppose -4l + 17 = -7. Suppose 3a - l = -0a. Factor -30g2 - 5g - ag4 - 35g*3 - 13g*4 + 5g*2. -5g(g + 1)2(3g + 1) Let q be (-55)/(-2) + 2/4. Let f = q + 6. Factor 21s*5 - 6 - 5s*4 - 12s*3 + fs*2 - 9s + 8s2 - 31s*4. 3(s - 1)*3(s + 1)(7s + 2) Suppose 0 = 5m - 5d + 10, -5d = 31m - 35m - 14. Factor -2/9p*2 + 0p*3 + 1/9p + 0 + 2/9pm - 1/9p*5. -p(p - 1)*3(p + 1)/9 Let b(x) be the third derivative of -x*5/150 - 7x*4/30 - 13x3/15 + x2 - 5. Factor b(d). -2(d + 1)(d + 13)/5 Let s = 59 - 411/7. Let c = -86 - -604/7. What is p in 0p2 + sp + 0 - cp3 = 0? -1, 0, 1 Find h, given that -12h*2 - 64 - 68 - 16h*3 + 16h + 130 + 14h4 = 0. -1, 1/7, 1 Let w(y) be the second derivative of 5/3y*4 + 0y*2 + 16y - 5/4y5 + 0y*3 + 1/6y*6 + 0. Factor w(z). 5z*2(z - 4)(z - 1) Let c(t) be the second derivative of -t5/70 + 4t4/21 - t3/3 + 4t - 27. Factor c(l). -2l(l - 7)(l - 1)/7 Let m be 2(2 - (-3 + 3)). Find a, given that -a + 0a + 7a + ma - 2a2 - 8 = 0. 1, 4 Let k(g) be the first derivative of -2g*5/115 - 5g*4/46 - 8g*3/69 - 221. Determine t, given that k(t) = 0. -4, -1, 0 Let g = -371/26 + 205/13. What is y in 2y*2 - 11/2y - g = 0? -1/4, 3 Let r = 19 - 49. Let l = r - -30. Factor 0u + 0u*2 - 3/5u*5 - 3/5u*4 + lu*3 + 0. -3u*4(u + 1)/5 Let y be -2 + (-63)/9 - (-952)/88. Determine j, given that yj - 2/11j*2 - 50/11 = 0. 5 Factor -3/2v*2 - 21v + 0. -3v(v + 14)/2 Let l(r) = -11r2 - 13r - 2. Suppose 0k = k - 2. Let b(y) = 0y - 1 - 6y - 4yk - y2. Let i(s) = -9b(s) + 4l(s). Suppose i(m) = 0. Calculate m. -1 Let t be (1 - (1 - 0))/((-161)/7 + 24). Factor -3g + t - 9/2g*2 - 3/2g*3. -3g(g + 1)(g + 2)/2 Let c(t) = -t*2 + 2t - 5. Let q(j) = 1. Suppose -3k - 6 = -g + 3, -2g + 2 = -2k. Let o(v) = kq(v) - c(v). Find w, given that o(w) = 0. 1 Suppose -3/4 + 13/8g2 - 7/8g*4 + 19/8g - 19/8g3 = 0. What is g? -3, -1, 2/7, 1 Let p(t) = -t2 - 4t + 1. Let x(o) = -13 + 7 + 7. Let i(c) = -2p(c) + 10x(c). Let i(m) = 0. Calculate m. -2 Let c = -32 - -43. Let l = c + -8. Factor -lh3 - h2 - 9h*2 + 4h*2. -3h*2(h + 2) Factor -4z - 16/11 - 10/11z*2. -2(z + 4)(5z + 2)/11 Let o(j) be the second derivative of -j7/357 - j6/51 + 12j5/85 - 2j*4/51 - 32j*3/51 - 3j - 25. Suppose o(u) = 0. Calculate u. -8, -1, 0, 2 Let j = 38 + 8. Let p be -4 + 1 + (-2)/(-20)j. Suppose -2/5d*2 - p + 8/5d = 0. Calculate d. 2 Let f be (-435)/(-300) + (-25)/20. Let 0 - x*2 - fx*4 + 4/5x*3 + 2/5x = 0. What is x? 0, 1, 2 Let u(t) be the second derivative of -t*5/5 - 14t*4/3 - 128t*3/3 - 192t*2 + 14t - 3. Factor u(r). -4(r + 4)2(r + 6) Let k be (36/42)/(6/56). Let u be (-12/k)/(180/(-288)). Suppose 0 - 2/5o + uo2 = 0. What is o? 0, 1 Suppose 7p - 3p = 132. Let y be 2p/(-12)-2. Suppose -9g4 - g3 - 8g5 + yg4 + g3 = 0. Calculate g. 0, 1/4 Find d, given that -128/3 - 32d - 2/3d*3 - 8d*2 = 0. -4 Suppose -11 - 9 = -5w. Suppose -38uw - 24u + 80u4 - 44u*4 + 2u*3 + 16u*2 = 0. Calculate u. -3, 0, 2 Determine k, given that 147k + 161 - 4k2 - 31 + 20 + k2 = 0. -1, 50 Suppose -11 = -6p + a, a = -0p - p + 3. Determine x, given that -3/7x*5 + 9/7x*4 - 27/7 - 30/7x*p - 9x + 18/7x3 = 0. -1, 3 Let i(d) be the second derivative of -5d*7/42 + 2d*6/3 + 5d*5/4 + 247d. What is l in i(l) = 0? -1, 0, 5 Let n = -29 - -48. Let t = -19 + n. Factor t + 1/5b3 + 0b + 2/5b2. b2(b + 2)/5 Let l(w) be the third derivative of w*5/20 - 15w*4/8 - 8w*3 + 73w*2. Solve l(f) = 0 for f. -1, 16 Let p(u) = -14u*5 - 10u*4 - 22u*3 - 8u*2 - 6. Let v(s) = 12s*5 + 10s*4 + 21s*3 + 8s*2 + 5. Let k(x) = 5p(x) + 6v(x). Factor k(b). 2b*2(b + 1)(b + 2)2 Let x(f) = -f2 + 2f - 1. Let h(g) = -3g2 + 6g - 11. Let l(c) = h(c) - 5x(c). Determine z so that l(z) = 0. -1, 3 Determine h, given that -32h*4 + 508/3h*3 + 52h - 64/3h5 - 16/3 - 488/3h*2 = 0. -4, 1/4, 1 Let v be 1/6 - (-8 + (-4775)/(-750)). What is g in -3/5g + vg2 + 0 = 0? 0, 1/3 Let y(d) be the second derivative of -d7/462 + d6/165 + 9d*5/55 + 2d*4/3 + 32d*3/33 - 5d - 2. Let y(b) = 0. What is b? -2, 0, 8 Suppose -g - 80 = -0g. Let a = g + 402/5. Solve -2/5 + 4/5b + 0b2 + ab*4 - 4/5b3 = 0 for b. -1, 1 Let o(n) be the first derivative of -n4/4 + 10n3/3 - 4n*2 + 2n - 13. Let w be o(6). Solve 98 - w - 2q3 = 0 for q. 0 Suppose -7c - 257 = 373. Let t be (4/c)/((-9)/90). Solve -10/9y2 + t + 10/9y + 2/3y4 - 10/9y*3 = 0 for y. -1, -1/3, 1, 2 Factor 2/5y*3 + 34/5y + 16/5y2 + 4. 2(y + 1)(y + 2)(y + 5)/5 Let f(y) = -8y4 + 20y*3 - 22y*2 + 10y - 6. Let i(k) = k4 - k3 - k*2 + k + 1. Let d(o) = f(o) + 6i(o). Determine q so that d(q) = 0. 0, 1, 2, 4 Let x(z) be the first derivative of -1/18z3 - 2 + 6z + 1/12z2 - 1/24z*4. Let v(y) be the first derivative of x(y). Find t, given that v(t) = 0. -1, 1/3 Let c(s) be the first derivative of 2s*6/3 + 29s*5/5 + 43s*4/4 - 19s*3/3 - 47s*2/2 - 10s + 123. Suppose c(a) = 0. What is a? -5, -2, -1, -1/4, 1 Let n = 53 + -58. Let p be 2/(-3)3/n. Factor -2/5j*2 + pj + 4/5. -2(j - 2)(j + 1)/5 Suppose 0 + 3 = -3t. Let g(w) = w3 + 3w*2 + 6w + 3. Let m(q) = q*2 - q - 1. Let i(j) = tm(j) - g(j). Find o such that i(o) = 0. -2, -1 Let b(u) be the second derivative of -u*5/4 + 5u*4/4 + 15u*3 - 135u. Suppose b(v) = 0. What is v? -3, 0, 6 Let k = 161 + -159. Determine c, given that 8ck - 3c*2 + 47 - 17 - 21c - 14c = 0. 1, 6 Suppose -5h = -4a + 6a, 0 = a. Suppose 5/3w2 - 5/3 + hw = 0. What is w? -1, 1 Let y(k) = -3k3 - 27k*2 + 63k - 45. Let b(a) = 4a3 + 53a*2 - 125a + 91. Let n(g) = 3b(g) + 5y(g). Factor n(f). -3(f - 4)(f - 2)*2 Suppose 0 = -2c - 5q + 6, 3c + 3q - 9 = q. Determine h so that -10h + 10 - 5h + 15h*c - 5h*4 - 17h*2 + 12h*2 = 0. -1, 1, 2 Let d(v) be the second derivative of 0 + 0v*3 + 1/60v*5 + 0v*4 + 3v + 7/2v2. Let a(l) be the first derivative of d(l). Factor a(k). k2 Let j(b) = -b - 3. Let r(m) = -m2 - m + 1. Let z be r(2). Let t be j(z). Suppose 5o*2 + 2o*2 + 2o + 6o3 - o2 + to4 = 0. What is o? -1, 0 Let p(u) be the first derivative of u4 + 12u3 + 28u2 - 542. Let p(o) = 0. What is o? -7, -2, 0 Let x(u) = u3 + u - 2. Let m(s) = -91s3 + 168s*2 + 269s + 26. Let c(g) = -m(g) - 4x(g). Factor c(t). 3(t - 3)(t + 1)(29t + 2) Let i(j) be the second derivative of 0j*3 + 0j*2 - 1/210j*7 + 1/60j*4 - 1/150j*6 + 1/100j*5 + 0 - 21j. Find y, given that i(y) = 0. -1, 0, 1 Let o(w) = w2 - w - 3. Let x be o(3). Factor y2 + y*	{ "pile_set_name": "DM Mathematics" }
Let c(g) = g*3 - 4g*2 + 5g - 2. Is 3 a factor of c(b)? False Let f be 2/8 + (-118)/(-8). Suppose 2w + f = 55. Suppose c + c = w. Does 5 divide c? True Let w(s) = -s + 8. Let y be w(6). Suppose yi + 30 = 3i. Suppose u + 2u = i. Does 10 divide u? True Suppose 0 = -8o - 8o + 1504. Is 19 a factor of o? False Let p(g) = -g*3 + 4g*2 + 7g - 2. Let m be 38/(-14) - (-6)/(-21). Let n be 6/m - -7 - 0. Is p(n) a multiple of 8? True Suppose 0 = -3v + 9. Let n be 2243/6 - v. Suppose 5g = -3 + n. Is g a multiple of 15? True Suppose -l + 3 = -3. Let z be 2 + -41 + 3. Is 13 a factor of (-3)/l(-53 + z)? True Suppose 0 = 5t - 9t + 696. Is t a multiple of 20? False Let v = -84 + 132. Is v a multiple of 15? False Let g(w) = w3 + 7w*2 + 2w - 2. Suppose -o - 2o + 35 = -4r, -5o = 3r - 10. Is g(r) a multiple of 19? True Let f(z) = -4z2 + 3z - 1. Let g be f(-3). Let h = 25 + g. Is 10 a factor of -2 - ((-1 - 0) + h)? True Let n = 0 + 0. Let a = -6 - n. Let j(p) = -p*3 - 6p*2 - 2p - 6. Does 5 divide j(a)? False Suppose -4g = 4y - 172, -3y + g = 2y - 227. Is y a multiple of 12? False Let j be (4/6)/((-10)/45). Let f be (-4)/(4/j) - -2. Does 5 divide (6 + -4)f/2? True Let y(z) = 3z + 3. Let q be (2/4)/((-2)/(-20)). Let w be y(q). Let c = w - -2. Does 10 divide c? True Let g = -50 - -77. Let i = 2 - 2. Suppose -2k - k + g = i. Is k a multiple of 5? False Let g(m) = 25m*2 + 4. Does 33 divide g(-2)? False Suppose -4 - 2 = -2l. Let y(s) = -s*3 + 5s*2 - 3s - 4. Is y(l) a multiple of 2? False Let i(v) = -194v2 + 5 + 99v*2 + 97v*2 - 4v. Suppose k + k - 8 = 0. Is 11 a factor of i(k)? False Suppose 5f - 50 = 35. Is f a multiple of 17? True Suppose -2 = g, -3x + 9 = -2g - 1. Suppose 0j = b + 4j + 8, j + 11 = 2b. Is 1/(b/22)x a multiple of 7? False Let f be (-1 + 166)(-2 + 3). Suppose 3a - f = -3x, -x = -3x + 10. Does 15 divide a? False Suppose 3o + o + 371 = t, -6 = -2t. Does 9 divide 1/(-5) + o/(-10)? True Suppose -r - 9u + 13u + 132 = 0, 0 = 2u - 2. Is 8 a factor of r? True Let w(h) = 2h + 2. Let z(y) = -y2 - 7y + 4. Let u be z(-7). Let m be w(u). Suppose 0 = -mr + 5r + 155. Is r a multiple of 12? False Is 9 a factor of (-2664)/(-38) - (-8)/(-76)? False Let m(r) = -r*3 - 3r*2 + 6r + 4. Let t be m(-4). Let v be -2(-3)/(-12)t. Let z = v - -7. Is z a multiple of 9? True Let t = 3 - 0. Suppose th - 5h = 0. Does 13 divide (h + -5)(-26)/5? True Let m(c) = 118c*2 - 6c + 2. Does 13 divide m(1)? False Let m = 26 + -14. Does 5 divide m? False Let h(t) = -2t3 - 3t*2 + 3t + 2. Let r be h(-3). Suppose -2 + r = 3c. Is 6 a factor of c? True Suppose w - 2n + 6 + 3 = 0, 0 = 4n - 20. Let v be -3 + w - (-10)/1. Does 11 divide (22/v)/((-5)/(-20))? True Suppose 3r - 4r + 32 = 0. Suppose v = 4v - 3t - 87, 0 = v - 2t - r. Is v - (1 + 1) - 2 a multiple of 14? False Let p be 291(1 + 0). Let x = 12 - p. Let o = x + 69. Is 26 a factor of o? True Let u(d) = -d*2 + 5d - 2. Let c be u(3). Does 3 divide ((-2)/c)/((-8)/96)? True Let k be (-7)/(14/8) + -2. Is 31 a factor of 237/k(-2 - 0)? False Let j = 774 - 402. Does 62 divide j? True Suppose -a + 3136 = 15a. Does 14 divide a? True Suppose 0y + 2y + 3k - 29 = 0, -4y + 5k + 25 = 0. Does 2 divide y? True Let i be 0/((6 + -2)/2). Suppose i = -2j - j + 18. Is 6 a factor of j? True Let g = 6 + -3. Let u be ((0/g)/1)/(-1). Is 10 a factor of u - -21 - (2 - 2)? False Let d = -3 - -5. Suppose 2 = -2f + 5o - do, 2 = 2f - 5o. Does 5 divide 78/f(-4)/6? False Suppose -27 = -4l + 1. Let t = 11 - l. Is 2 a factor of t? True Let i be 8/28 + 72/(-7). Let l(c) = -2c - 7. Is l(i) a multiple of 6? False Let b(n) = -n*2 - 7n. Let j be b(-7). Let s(u) = -u*3. Let w be s(j). Suppose w = -z - z + 8. Is z a multiple of 2? True Suppose 5h - 570 = -h. Is (h/(-20))/((-2)/8) a multiple of 12? False Suppose 2k - 5k + b + 103 = 0, 0 = 4b - 8. Suppose v - q - k = 0, -5v + 2q + 84 = -82. Does 32 divide v? True Let o = -48 + 188. Suppose 5v - o = 5t, v - 2v = 4t - 23. Does 10 divide v? False Suppose 2x + 4k - 106 = -3x, -2k = 5x - 98. Is x a multiple of 6? True Suppose 3a + 40 = 5q, 4q - 2a = -0q + 32. Does 4 divide q? True Let o = -2 + 1. Is 35 - (-1 + 5 + o) a multiple of 17? False Let a = -7 + 10. Suppose -ac = -0c. Suppose -4w + 9w - 105 = c. Is w a multiple of 8? False Does 19 divide 9/(-24)-4(1 + 75)? True Suppose x + 0 = -o - 2, -4o = -5x - 19. Let g be (-2)/x + 228/9. Suppose 3h - g = -w + 5, 0 = 5w + 2h - 142. Is w a multiple of 14? True Let w = 156 - 46. Is w a multiple of 5? True Let m(f) = -f*3 + 14f*2 - 21f - 12. Does 6 divide m(12)? True Suppose -4w + 3 = -5. Suppose -5m = f + 2f - 40, -f = -wm - 6. Does 10 divide f? True Let u be (-4)/3(-63)/(-14). Let r = 13 + u. Is 5 a factor of r? False Let g(h) = h3 - 5h*2 + 4h + 4. Let n be g(4). Suppose 3f = 12, 5f + 15 = ns - 13. Does 12 divide s? True Let k = -23 - -36. Is 3 a factor of k? False Is 14 a factor of 1 - ((-2247)/15 + (-1)/5)? False Let c(v) = -v2 - v - 1. Let b(k) = 5k*2 + 4k + 1. Let r(g) = -b(g) - 2c(g). Let d be r(-3). Let h = 32 + d. Is h a multiple of 6? True Suppose 0 = -x + 2 + 10. Is x a multiple of 12? True Let v be 2/(34/(-6)). Let u = v - -15. Is u a multiple of 12? False Suppose -24 = 2q - 3n, -36 = 4q - 2n - n. Suppose -4z - 4 = 5p - p, 0 = -2p + 5z - 9. Does 3 divide (3 + p)/((-1)/q)? True Let t(l) be the second derivative of 5l3/6 - 7l*2/2 + l. Suppose 0 = -3s - 5r + 6, -r + 6r + 22 = s. Is 14 a factor of t(s)? True Let n(p) = -5p - 82. Is n(-26) a multiple of 12? True Suppose -3r - 6 = 5q, -4r + 0 = q - 9. Suppose -24 = 7l - rl. Is 10 a factor of (15/(-10))/(l/64)? False Let b(f) = f*2 + f. Let o be b(0). Suppose y - 6 + 1 = 0. Suppose yl - l - 8 = o. Is l even? True Let m(q) = -q + 62. Does 31 divide m(0)? True Suppose -h = -2h. Suppose -13 = -z - 5m, hm + 3m + 75 = 4z. Is z a multiple of 15? False Let z be ((-1)/(-3))/(2/18). Suppose 2h = 4h - zt - 136, -5h = -t - 314. Is 16 a factor of h? False Suppose 5s - 336 = s. Is 22 a factor of s? False Suppose 7f - 123 - 66 = 0. Suppose 0 = -3v - 0v + 21. Let m = f + v. Is m a multiple of 12? False Let r = 145 + -97. Let f = r + -12. Is 16 a factor of f? False Let r = 9 + 5. Suppose 5d + 4 - r = 0. Is d even? True Let x(o) = -o*3 - 9o*2 - 8o + 4. Let f be x(-8). Suppose 0 = fn - 3 - 9. Suppose -8 = -s + 3z + n, -2s = z - 22. Is s a multiple of 10? False Is 18 a factor of 3 - (12/3 - 59)? False Let u = 1 + 3. Suppose -5a - 5r - 205 = 0, 2a - ur + 2 = -68. Let l = a - -83. Is l a multiple of 22? True Let x be (3 - 0)(-1 + 4). Suppose -q + 3 = -4v, x = 4q - 3. Suppose 4f - 3f - 18 = v. Is 9 a factor of f? True Suppose 3g = -4g + 70. Does 10 divide g? True Suppose -11 + 31 = 2w. Let t = w - -23. Does 13 divide t? False Let g = 318 + -166. Is g a multiple of 38? True Let n(p) = -p - 4. Let q be n(-8). Suppose 10 = 4b + 5h - 61, 0 = b - qh - 2. Is 14 a factor of b? True Suppose 5u + v - 232 = 4v, -3u + 136 = -5v. Is u a multiple of 42? False Does 5 divide 3/(-6(-4)/40)? True Suppose -3r = 2r - 420. Does 4 divide r? True Let u = -5 + 9. Let b = 1 + u. Suppose 2y = ba + 3y - 148, 4y - 112 = -4a. Is a a multiple of 15? True Let m be 37/7 + 4/(-14). Suppose l + 2r - 3r = 6, mr - 25 = 0. Is 11 a factor of l? True Let u = -44 + 47. Is 3 a factor of u? True Let k(s) = -13s + 4. Does 30 divide k(-2)? True Suppose 4r - 1 = 15. Let b(u) = 27u + 3. Let c be b(r). Suppose 0 = 6y - 3y - c. Does 17 divide y? False Let o(u) = u*3 - 4u + 3. Let h be o(2). Let y be (4/(-5))/(4/10). Let v = h - y. Is 5 a factor of v? True Suppose 5a + 0w = -3w + 865, 0 = 3w + 15. Is 44 a factor of a? True Suppose 3 = 3o + t - 13, -2o - 8 = -4t. Let w = o - -2. Suppose 0l - w = -3l. Does 2 divide l? True Suppose -4i = -5i. Suppose -2n - r + 55 = i, 3r - r = -5n + 136. Does 10 divide n? False Suppose -2t + 7t - 465 = 0. Let g = t - 45. Is g a multiple of 24? True Let p(q) = -15q + 3. Is 27 a factor of p(-7)? True Let v = -154 + 376. Is 37 a factor of v? True Suppose 516 - 1296 = -6n. Is 26 a factor of n? True Let l(v) = 7*	{ "pile_set_name": "DM Mathematics" }
llest value in v, -4, -2? v Let g = 2.086 + -0.086. What is the fourth biggest value in g, 2/35, 5, -0.3? -0.3 Let s = -16 + 10. Let l = 5 + s. Let o = l + -3. What is the second smallest value in 1/2, o, 4? 1/2 Let l = -4.907 + 0.007. Let s = 5 + l. Let h = 137/95 - 16/19. What is the second biggest value in s, h, 2/7? 2/7 Let k = 0.7 - 3.5. Let f = 3 + k. Let d = -1.2 + f. Which is the second biggest value? (a) d (b) 0.1 (c) -3 a Let k(d) = d*3 - 5d*2 + 5. Let w be 15/2(-24)/(-36). Let a be k(w). What is the second biggest value in -2, a, -0.1? -0.1 Let s be -3(0 - (0 - 1)). Let f = 4.6 - 6.6. Let u = 1.2 + -1. What is the third smallest value in u, s, f? u Let d be 3/(-2(-6)/(-8)). Let w = -240 - -2159/9. Which is the third biggest value? (a) 4 (b) d (c) w b Let q = 0.22 + -0.42. Let a = -4 + 3.6. What is the third biggest value in q, 1/5, a? a Let u = 3 - 3.1. Let v = u - -0.3. Let m = v - 0.3. What is the biggest value in m, -0.4, 1? 1 Let u be 11/3 + 1/3. Let w = 0.12 + -0.62. Which is the third smallest value? (a) u (b) w (c) -2/13 a Let g = 0.009 + 0.391. Let u = -2 - -2.1. Which is the smallest value? (a) g (b) -2 (c) u b Suppose -5u - 3 + 23 = 0. Let w be (u/50)/15. Which is the third biggest value? (a) -5 (b) w (c) -2 a Let m = -5 + 1. Let b = -0.54 - -0.14. What is the second smallest value in m, b, -3/5? -3/5 Let d = -0.36 - -0.32. Which is the third smallest value? (a) 1/2 (b) -0.1 (c) d a Let g = -86 - -257/3. Let f = -0.2 - -0.16. Let u = -0.34 - f. Which is the third biggest value? (a) 3 (b) g (c) u b Let z be 4((-28)/8)/7. What is the third smallest value in -19, -3, z? z Let r = -114 - -116. What is the fourth smallest value in -2, r, -7, -0.4? r Let p = 0.16 + 0.14. Suppose 5 + 13 = 3q. Let h be q/(-24)(1 - 0). Which is the smallest value? (a) h (b) p (c) 1/2 a Let o = 5443729/270025 + -1/10801. Let b = o + -5498/175. Let p = -57/5 - b. What is the third smallest value in 0.3, p, 4? 4 Let s = 27 - 22. Which is the second biggest value? (a) 0.3 (b) 2/9 (c) s a Let q = -0.173 - -3.173. What is the third biggest value in q, -4/5, 0.5, 0.03? 0.03 Let o = -20 + 36. What is the third smallest value in -2, -0.3, o? o Let m = -0.3 + 0.61. Let z = m + -0.01. What is the second biggest value in z, -3/8, -3/4? -3/8 Let g = -11 - -10.7. Which is the second smallest value? (a) g (b) 2 (c) -2/9 c Suppose 3r + 0 + 3 = 0. Which is the third biggest value? (a) r (b) -5 (c) 0.2 b Let s(z) = z*2 - z + 2. Let l be s(0). Let q be (-12)/(-4) - l/(-1). Which is the biggest value? (a) q (b) 4 (c) 3 a Let h(v) = v + 7. Let p be h(-4). Suppose r + 2r - pg + 12 = 0, 15 = 5r + 2g. Let w = -30 + 34. What is the second biggest value in r, -1/7, w? r Suppose n - 3n - 4 = 0. Let t be (1 + -3)/(n/(-4)). What is the second biggest value in t, 3/2, -2? -2 Let y(l) = -l*3 + 16l*2 - 4l + 64. Let o be y(16). Let k be 41/(-3)(-276)/(-14). Let j = 269 + k. What is the second biggest value in o, -2, j? j Let s = -2.04 - 0.16. Let b = 1 + -0.2. Let l = b - s. What is the second biggest value in l, -3, 4? l Let k be 114/(-42) + 2/(-7). What is the third smallest value in k, -1, -0.5? -0.5 Suppose -7k - 4 = -3k. Which is the second biggest value? (a) 1/4 (b) k (c) 3 (d) -0.4 a Let r = 0.8 - 3.8. What is the third smallest value in 5/4, r, 5? 5 Let q be (5/(-75))/(((-36)/(-40))/(-3)). What is the biggest value in 2, 2/11, -2, q? 2 Let t = 2.02 + -0.02. Let n = -0.2 + -2.7. Let k = n + -0.1. Which is the smallest value? (a) t (b) k (c) 5 b Let x = 0.03 + -0.13. What is the biggest value in 0.1, 0.7, x? 0.7 Let n = -2 - -1.97. Let r = n + 0.07. What is the second biggest value in -0.3, -5, r? -0.3 Let k = -15.3 - -16. Let y = 1.1 - k. Let o be 16/(-40) + (-8)/(-5). What is the third smallest value in y, 2/13, o? o Let x = 3.9 - -1.1. Let w = x + -5.2. Let k = -0.4 - w. Which is the second biggest value? (a) -2 (b) k (c) 5 b Let q be ((-55)/15 - -3)-1. Which is the smallest value? (a) q (b) -4 (c) 5 b Let x = -7.5 + 2.5. What is the second biggest value in 42, x, 5? 5 Let w = 2 + -2. Let r be (9 + 44)/(-4 + 1). Let i = r + 17. What is the second biggest value in w, i, 2/7? w Let q = -9.04 - -0.04. Let l = q - -4. Let t = l + 4. Which is the third smallest value? (a) 3 (b) t (c) -3 a Let h be 0 + (23/(-1) - 1). Let l be (-18)/h(-1)/(-3). What is the second biggest value in l, 0.1, 1/2? l Suppose -5h = 10 + 5. Let n be 0/h - -41. What is the smallest value in n, -0.2, 2/3? -0.2 Let s = -2.58 - -2.4. Let v = s + 0.08. Let h = -0.2 + -3.8. What is the biggest value in v, -3/8, h? v Let x = -81 - -81. What is the fourth smallest value in x, 3/4, -0.1, -1/4? 3/4 Let o be ((6/(-3))/(-14))/(12/(-7)). What is the third biggest value in o, -5, 13? -5 Let f(d) = -d - 6. Let s be f(-6). Let n(c) = c3 - 6c*2 + 5c + 3. Let j be n(5). Let y be j/(-10)4/3. What is the biggest value in -3/2, s, y? s Let r = 0.02 + -4.02. Let z = 0.4 + -0.8. Which is the third biggest value? (a) r (b) z (c) -1/6 a Suppose 0 = 4t + 68 - 4. Let d be -15(t/12 + 1). Which is the third biggest value? (a) d (b) -3 (c) -5 c Let w be (2/4)/(14/(-4)). Let t = -39 - -13. Let u = t - -25.7. What is the third smallest value in w, -0.2, u? w Let g be 5/(-60)(-2 + 2 - 2). Let t = 0.5 + -1. Let p = 1.5 - -0.5. Which is the biggest value? (a) t (b) p (c) g b Let y = -1 + 6.9. Let f = y + -0.9. Which is the biggest value? (a) f (b) -5 (c) -0.3 a Let s = 0.51 - 0.11. Let k = 2.6 + s. What is the biggest value in 0, -0.5, k? k Let s(m) = -m*2 + 6m + 8. Let y be s(7). Let h = -4 + 2. What is the third biggest value in h, 0.3, y? h Suppose -3v - v = 3i + 9, 5i + 15 = 3v. Which is the third smallest value? (a) -0.1 (b) 3/4 (c) i (d) -0.3 a Let s be (2/5)/(5/25 - -1). Which is the smallest value? (a) s (b) -0.6 (c) -0.4 (d) -4 d Let j = -5 + 4.92. Let f = j + 2.08. What is the biggest value in 0.2, f, -4? f Let h = -17 - -29. Let q = h + -12. What is the biggest value in q, -0.2, -5? q Let f = -2.1 - -2. Let r = -3249/2 + 1590. Let w = r + 33. Which is the second biggest value? (a) -2/11 (b) w (c) f a Let d = 70 - 208/3. Let f = 3.35 - -0.65. Which is the second biggest value? (a) d (b) f (c) 0.1 a Let i = -11 + 23. Let j = -10 + i. Let k = 2.7 - 3. Which is the smallest value? (a) k (b) 0 (c) j a Let k(z) = 3z + 14. Let y be k(-3). Which is the third smallest value? (a) y (b) 1 (c) 1/8 (d) 2/5 b Suppose -3 = h + 1. Let o = -7 + 5. Let n = 0 - o. Which is the second biggest value? (a) h (b) n (c) 2/7 c Let u(j) = j3 - 4j*2 + 3j - 3. Let i be u(3). Let f = 0 - 1. Which is the second biggest value? (a) f (b) 0.1 (c) i a Let n = 24 - 28. Let x = 2.7 + -3. What is the third biggest value in 0.2, n, x? n Let i be (-1)/3(-33)/(-44). Let p be ((-24)/(-104))/(6/4). Which is the second biggest value? (a) i (b) 0.3 (c) p c Let s = -0.3 - -0.3. Let r = 16 + -4. Let w = r - 7. Which is the third smallest value? (a) s (b) w (c) 0.5 b Let w = -7 - -6. Let m = -4 - -4.06. What is the smallest value in w, m, 0.5? w Let d = 14 + -13.3. Let t = d + -0.3. Let g = -18 + 16. What is the second biggest value in 4, t, g? t Suppose 8t + 8 = 6t. Which is the third biggest value? (a) 1 (b) t (c) 5 (d) -1/2 d Let z = 208.06 - 206. Let x = 0.06 - z. What is the second smallest value in x, 0.5, 4/3? 0.5 Let v = 18 - 28. Let u = 7 + v. What is the biggest value in 5, -0.4, u? 5 Let q be -2 + (-7023)/(-4) + 1. Let g = -1728 + q. Let w = g - 27. What is the biggest value in w, -0.5, 1? 1 Let y = 0.1 - -0.4. Let s be (-4)/6 + (-112)/(-132). What is the second biggest value in -2/13, y, s? s Let a = -87.07 - -87. What is the second smallest value in 2/11, 4/5, a? 2/11 Let g = -12 - -12.2. What is the second smallest value in g, 2/21, 4? g Suppose 31 = -9p - 50. Let l(k) = k*2 - 3k + 2. Let i be l(2). Which is the biggest value? (a) p (b) -1 (c) i c Let a = -13 + 15. Suppose -2l + 15 = -5l. Let y be 2/l - (-14)/10. What is the smallest value in -0.5, y, a? -0.5 Let h = -1 - -2. Let k = -1 + -2. Let v = -1 + k. Which is the second smallest value? (a) v (b) -2 (c) h b Let q be 1*-1 - 13/(130/(-28)	{ "pile_set_name": "DM Mathematics" }
2t3 - 21t - 19 What is the l'th term of -54, -196, -340, -486? -l*2 - 139l + 86 What is the q'th term of 3234, 3230, 3224, 3216, 3206? -q2 - q + 3236 What is the y'th term of -56, -42, -26, -14, -12, -26, -62? -y3 + 7y2 - 62 What is the l'th term of 114, 233, 354, 477, 602, 729? l2 + 116l - 3 What is the d'th term of 56, 291, 676, 1205, 1872, 2671, 3596, 4641? -d*3 + 81d2 - d - 23 What is the k'th term of 45, 54, 65, 78, 93, 110? k2 + 6k + 38 What is the y'th term of 618, 619, 620, 621, 622, 623? y + 617 What is the d'th term of -12, -31, -64, -111, -172? -7d*2 + 2d - 7 What is the f'th term of 689, 728, 837, 1052, 1409, 1944, 2693? 6f3 - f2 + 684 What is the a'th term of 33, 81, 151, 255, 405, 613? 2a3 - a2 + 37a - 5 What is the b'th term of -140, -192, -338, -626, -1104, -1820, -2822, -4158? -8b3 + b2 + b - 134 What is the m'th term of 11, 36, 61, 86, 111, 136? 25m - 14 What is the s'th term of -324, -303, -280, -261, -252? -s3 + 7s*2 + 7s - 337 What is the t'th term of 579, 596, 611, 624, 635, 644? -t*2 + 20t + 560 What is the x'th term of 1031, 2063, 3093, 4121, 5147? -x*2 + 1035x - 3 What is the i'th term of -123, -146, -189, -258, -359, -498, -681, -914? -i*3 - 4i*2 - 4i - 114 What is the q'th term of 2974, 2975, 2976, 2977, 2978, 2979? q + 2973 What is the o'th term of -6, -26, -60, -108, -170? -7o2 + o What is the x'th term of -193, -197, -203, -211, -221? -x2 - x - 191 What is the s'th term of -3072, -3065, -3046, -3009, -2948? s3 - 3073 What is the f'th term of 23, 69, 145, 251, 387, 553? 15f2 + f + 7 What is the v'th term of -11, -27, -45, -65? -v2 - 13v + 3 What is the b'th term of -34, -110, -226, -382, -578? -20b*2 - 16b + 2 What is the g'th term of 109, 155, 273, 499, 869, 1419, 2185, 3203? 6g3 + 4g + 99 What is the z'th term of 132, 121, 100, 63, 4, -83, -204? -z3 + z2 - 7z + 139 What is the z'th term of -21, -2, 123, 408, 907, 1674, 2763? 9z3 - z2 - 41z + 12 What is the v'th term of 21, 28, 39, 54? 2v*2 + v + 18 What is the q'th term of -127, -129, -131, -133, -135? -2q - 125 What is the t'th term of -79, -95, -111, -127, -143? -16t - 63 What is the m'th term of -2878, -5764, -8672, -11614, -14602, -17648, -20764? -2m3 + m2 - 2875m - 2 What is the o'th term of -6054, -6056, -6060, -6066, -6074, -6084? -o2 + o - 6054 What is the j'th term of -38, -83, -130, -179? -j2 - 42j + 5 What is the i'th term of 5, 14, 27, 44, 65, 90? 2i2 + 3i What is the d'th term of 129, 165, 205, 249, 297, 349? 2d2 + 30d + 97 What is the n'th term of -179, -174, -159, -128, -75? n3 - n2 + n - 180 What is the n'th term of -78, -156, -234, -312? -78n What is the m'th term of -112, -109, -106, -103, -100? 3m - 115 What is the o'th term of -33, -67, -101, -135, -169? -34o + 1 What is the g'th term of 168, 249, 342, 453, 588, 753, 954? g3 + 74g + 93 What is the f'th term of 1272, 1261, 1236, 1191, 1120, 1017, 876, 691? -f3 - f2 - f + 1275 What is the k'th term of 207, 228, 251, 276, 303? k*2 + 18k + 188 What is the z'th term of -139, -153, -179, -223, -291? -z*3 - 7z - 131 What is the z'th term of -227, -219, -205, -185, -159? 3z2 - z - 229 What is the c'th term of 453, 451, 449, 447, 445, 443? -2c + 455 What is the p'th term of -496, -993, -1490, -1987? -497p + 1 What is the o'th term of -209, -219, -237, -263, -297? -4o*2 + 2o - 207 What is the r'th term of 183, 363, 543? 180r + 3 What is the z'th term of -13, -36, -97, -214, -405, -688, -1081? -3z3 - z2 + z - 10 What is the s'th term of -106, -221, -360, -535, -758? -2s3 - 101s - 3 What is the n'th term of -939, -936, -933, -930, -927? 3n - 942 What is the l'th term of 105, 136, 169, 204, 241, 280? l2 + 28l + 76 What is the o'th term of -18, -67, -150, -273, -442, -663? -o*3 - 11o*2 - 9o + 3 What is the d'th term of -1199, -2395, -3587, -4775, -5959, -7139? 2d2 - 1202d + 1 What is the z'th term of 33, 62, 89, 114, 137, 158? -z*2 + 32z + 2 What is the d'th term of 30, 76, 122, 168, 214, 260? 46d - 16 What is the u'th term of 314, 1254, 2820, 5012? 313u*2 + u What is the f'th term of 49, 179, 497, 1087, 2033? 14f*3 + 10f*2 + 2f + 23 What is the n'th term of 42, 18, -16, -66, -138? -n3 + n2 - 20n + 62 What is the c'th term of -2157, -2158, -2159? -c - 2156 What is the y'th term of -186, -373, -556, -735, -910? 2y*2 - 193y + 5 What is the o'th term of 1079, 2156, 3233, 4310, 5387? 1077o + 2 What is the t'th term of 611, 612, 613, 614? t + 610 What is the n'th term of -14, -36, -108, -254, -498, -864, -1376, -2058? -4n3 - n2 + 9n - 18 What is the r'th term of -224, -234, -270, -344, -468, -654? -2r3 - r2 + 7r - 228 What is the d'th term of -60, -36, -12, 12, 36? 24d - 84 What is the b'th term of -51, -55, -59, -63? -4b - 47 What is the u'th term of -128, 75, 414, 889, 1500, 2247? 68u2 - u - 195 What is the n'th term of 238, 991, 2240, 3979, 6202? -n3 + 254n2 - 2n - 13 What is the z'th term of 199, 213, 241, 289, 363, 469, 613? z3 + z2 + 4z + 193 What is the o'th term of -482, -483, -484, -485, -486? -o - 481 What is the t'th term of 978, 976, 974, 972, 970, 968? -2t + 980 What is the r'th term of -436, -879, -1322? -443r + 7 What is the x'th term of 30, 95, 254, 555, 1046, 1775? 8x3 - x2 + 12x + 11 What is the a'th term of 83, 101, 137, 197, 287, 413, 581? a3 + 3a*2 + 2a + 77 What is the k'th term of -93, -41, 11, 63? 52k - 145 What is the q'th term of 2, -10, -30, -58, -94? -4q*2 + 6 What is the n'th term of -156, -158, -160, -162, -164, -166? -2n - 154 What is the t'th term of 49, 107, 165? 58t - 9 What is the m'th term of -35, -35, -49, -83, -143, -235, -365? -m3 - m2 + 10m - 43 What is the n'th term of 3318, 3319, 3320, 3321, 3322? n + 3317 What is the x'th term of -44, -89, -142, -203, -272? -4x2 - 33x - 7 What is the k'th term of -27, -60, -119, -210, -339? -k*3 - 7k*2 - 5k - 14 What is the a'th term of -12, -44, -128, -288, -548, -932? -4a3 - 2a*2 + 2a - 8 What is the w'th term of 109, 436, 979, 1738? 108w2 + 3w - 2 What is the y'th term of 7, 16, 37, 76, 139? y*3 + 2y + 4 What is the p'th term of 8454, 8465, 8490, 8535, 8606, 8709, 8850, 9035? p3 + p2 + p + 8451 What is the v'th term of 33, 66, 121, 210, 345, 538, 801? 2v3 - v2 + 22v + 10 What is the g'th term of 1090, 2165, 3226, 4267, 5282, 6265, 7210? -g3 - g2 + 1085g + 7 What is the q'th term of 353, 707, 1061, 1415? 354q - 1 What is the m'th term of 28, 33, 42, 55, 72, 93? 2m2 - m + 27 What is the x'th term of 11, 14, 21, 32, 47, 66, 89? 2x*2 - 3x + 12 What is the j'th term of 3, -28, -89, -192, -349, -572, -873, -1264? -2j3 - 3j*2 - 8j + 16 What is the h'th term of -181, -182, -183? -h - 180 What is the r'th term of -12, 46, 202, 504, 1000, 1738? 8r3 + r2 - r - 20 What is the n'th term of 8, 9, 4, -13, -48? -n3 + 3n*2 - n + 7 What is the c'th term of 428, 828, 1228, 1628, 2028, 2428? 400c + 28 What is the l'th term of 222, 230, 240, 252? l*2 + 5l + 216 What is the d'th term of -13, -11, 7, 47, 115, 217, 359? d*3 + 2d*2 - 11d - 5 What is the n'th term of 926, 925, 924, 923, 922? -n + 927 What is the n'th term of -5, 6, 21, 40, 63, 90? 2n2 + 5n - 12 What is the x'th term of -2840, -5676, -8512, -11348, -14184? -2836x - 4 What is the m'th term of -9527, -9526, -9525? m - 9528 What is the k'th term of -318, -1272, -2862, -5088? -318k*2 What is the a'th term of -79, -67, -47, -19, 17, 61? 4a2 - 83 What is the q'th term of 789, 3165, 7119, 12645, 19737, 28389, 38595, 50349? -q3 + 795q2 - 2q - 3 What is the f'th term of 105, 353, 775, 1377, 2165, 3145, 4323? f*3 + 81f*2 - 2f + 25 What is the t'th term of -856, -849, -842, -835, -828, -821? 7t - 863 What is the n'th term of 1352, 2701, 4044, 5375, 6688, 7977, 9236? -n3 + 3n*2 + 1347n + 3 What is the h'th term of 18, 77, 176, 315, 494, 713? 20h2 - h - 1 What is the s'th term of -963, -961, -959, -957, -955, -953? 2s - 965 What is the t'th term of -1018, -1017, -1016, -1015, -1014, -1013? t - 1019 What is the q'th term of 260, 256, 258, 272, 304, 360, 446? q*3 - 3q*2 - 2q + 264 W	{ "pile_set_name": "DM Mathematics" }
cond derivative of 48n - 11/10n*5 + 0n*3 + 0 + 1/15n*6 + 13/6n*4 + 0n*2. Find the third derivative of d(h) wrt h. 48h - 132 Let w(j) be the first derivative of -j*8/48 - 13j*4/12 - 4j*3/3 + 7. Let q(p) be the third derivative of w(p). Differentiate q(l) with respect to l. -140l*3 Let x be (14/21)/(4/3). Let k(l) be the second derivative of 0l*3 + 1/12l*4 - xl*2 + 5l + 0. Find the first derivative of k(a) wrt a. 2a Let f(u) be the second derivative of 11u*8/336 + 11u5/60 + u2 + 15u. Let w(g) be the first derivative of f(g). Find the third derivative of w(h) wrt h. 660h*2 Let y(o) = 140o*3 - 55o*2 - 2. Let w(c) = 281c*3 - 111c*2 - 5. Let d(r) = -2w(r) + 5y(r). Find the third derivative of d(b) wrt b. 828 Let r(c) be the third derivative of -c5/120 - c4/24 + 7c*3/6 - 10c*2. Let u(h) be the first derivative of r(h). Differentiate u(q) with respect to q. -1 Suppose 14d = 13d. Find the second derivative of dn*4 + 0n4 + n4 - 13n + 32n wrt n. 12n2 What is the second derivative of 45760 + 42s - 45760 + 78s3 wrt s? 468s Let b(p) = 2p2 - 38p + 148. Let w(h) = -h*2 + h - 3. Let g(z) = -b(z) + w(z). Find the first derivative of g(s) wrt s. -6s + 39 What is the second derivative of -22 + 22a + 22a*2 - 45a + 21a + 11a2 wrt a? 66 Let w(k) be the third derivative of -k10/15120 + k6/180 + k5/3 + 3k2. Let s(j) be the third derivative of w(j). Differentiate s(r) with respect to r. -40r*3 Let g(o) be the first derivative of 25 + 17/5o*5 + 0o*4 + 0o + 0o3 - 29/2o*2. What is the second derivative of g(c) wrt c? 204c*2 Let d(m) be the first derivative of 15 - 13/4m*4 + 0m*2 + 0m*3 - 16m. Find the first derivative of d(a) wrt a. -39a2 What is the third derivative of 14 + 27245q*2 - 54473q*2 + 27249q*2 + 904q3 wrt q? 5424 Let v(g) = -g3 + 2g - 12. Let r be v(-4). Find the third derivative of -5b + 2b + 9b*4 + 3b + rb2 wrt b. 216b Let q(s) = -29s4 - 2s*2 - 200. Let i(a) = 29a*4 + 3a*2 + 199. Let y(b) = -2i(b) - 3q(b). What is the derivative of y(u) wrt u? 116u*3 What is the third derivative of 38g - 63g4 + 4g*2 - 37g + 29g2 wrt g? -1512g Let l(m) be the third derivative of 0 + 0m3 + 11m*2 + 1/6m*7 + 0m + 0m4 + 0m*6 + 7/60m*5. What is the third derivative of l(v) wrt v? 840v Let y(m) = 24m + 14. Let g be (8/(-3))/((-28)/42). Let f(c) = 24c + 14. Let v(i) = gy(i) - 3f(i). Differentiate v(a) wrt a. 24 Let i be (-4 + -25)/(5/(-5)). Find the second derivative of -63d - id*5 + 33d + 32d wrt d. -580d*3 Let v(s) be the first derivative of 9s*5/5 + 11s*3 + 875s + 809. What is the derivative of v(d) wrt d? 36d3 + 66d Suppose -5z + 3z + i + 49 = 0, 3z - 72 = 3i. Suppose -5q + z = 5. What is the first derivative of 1 - 6 - s4 + 0s*q wrt s? -4s*3 Suppose -4x - 20 + 0 = -2l, x + 3 = 0. Find the third derivative of -98a*4 + 208a*l - 90a*4 - 8a*2 wrt a. 480a What is the second derivative of 9533p5 - p - 9956p*5 + 2p - 62 wrt p? -8460p3 Let n(o) = 2o - 5o + 0o - 3. Let p be n(-2). Find the third derivative of 11g5 - 3g*2 + 0g*2 - 5g*2 - pg*5 wrt g. 480g*2 Let f(a) be the third derivative of -9a*2 + 0a*4 + 3/10a*5 + 0a + 31/6a3 + 0. What is the derivative of f(z) wrt z? 36z Suppose 4w + 2v = 26, 0w - 37 = -5w - v. Find the first derivative of -1 + w - 15k2 + 5 wrt k. -30k Let a(i) be the third derivative of -163i7/210 - i4/24 + 125i*3/6 - 319i*2. Differentiate a(d) wrt d. -652d*3 - 1 What is the derivative of -502 - 336g - 247 + 962g wrt g? 626 Let n(p) = p3 - 5p*2 - 4p + 3. Let g be n(5). Let l = g + 28. What is the third derivative of la6 + a2 - 166a*4 + 166a*4 wrt a? 1320a*3 Let l(z) = -7z*4 - 68z*2 - 9z - 5. Let h(x) = 6x4 + 68x*2 + 12x + 4. Let n(a) = 5h(a) + 4l(a). Find the second derivative of n(k) wrt k. 24k2 + 136 Let q = -20 + 25. What is the derivative of 5b - qb3 - 4 + 4b - 9b wrt b? -15b*2 Suppose 7k = 5k - 14. Let n = 11 + k. Find the third derivative of 3u*2 - 3u*2 + 6u4 + u2 + nu2 wrt u. 144u Let f(s) be the second derivative of 0 + 5/4s4 + 9s*2 + 0s*3 + 7s. What is the derivative of f(a) wrt a? 30a Let o be 34 + -4 + 4 + -4. Find the second derivative of -15f*2 + f - 30 + o wrt f. -30 Let a(s) be the first derivative of 0s*4 + 22/5s*5 + 0s*2 + 3 + 0s + 2/3s3. Find the third derivative of a(g) wrt g. 528g Let p(c) be the first derivative of c*4/4 + 31c*3/3 + 115c*2/2 - 83. Find the second derivative of p(r) wrt r. 6r + 62 Let d(b) be the first derivative of -4b5/5 - 35b4/4 - b2 + 93b - 429. What is the second derivative of d(c) wrt c? -48c*2 - 210c Let y(z) = z. Let s(r) = -5r2 + 9r - 19. Let g(p) = -s(p) - y(p). Let l(f) be the first derivative of g(f). What is the derivative of l(o) wrt o? 10 Let y(a) be the first derivative of 7a4/4 - a3 + 52a + 59. Differentiate y(h) with respect to h. 21h2 - 6h Let u(m) = -8m2 + 6m + 7. Suppose -5h + 10 = -j + 24, 2j + h = -16. Let v(a) = 7a2 - 5a - 8. Let p(f) = jv(f) - 5u(f). Differentiate p(w) wrt w. -4w Let g be (-2 + 1 - 2) + 17. Let q = g + -12. What is the second derivative of -6z - qz4 - 2z*4 + 6z*4 + 2z*4 wrt z? 48z*2 Let i(d) be the third derivative of 41d*6/120 + 7d*5/60 - 211d*3/3 + 193d*2 - d. What is the first derivative of i(u) wrt u? 123u*2 + 14u What is the first derivative of 9 + 42z2 + 7 + 15 - 4 wrt z? 84z Let p(j) = -3j + 3. Let a be p(0). What is the derivative of 22c*3 - 3c*a + 2c*3 - 9 wrt c? 63c2 Let o(r) be the second derivative of -r11/6930 - r7/1260 + r4/4 - r. Let m(a) be the third derivative of o(a). Find the third derivative of m(y) wrt y. -960y3 Let t(c) be the first derivative of -c5/30 - c3 + 19c*2/2 + 16. Let m(x) be the second derivative of t(x). Differentiate m(u) wrt u. -4u What is the derivative of -499f - 126 + 248f - 140f2 + 251f + 3f3 wrt f? 9f*2 - 280f Let l be -12(5/3 + -2). Suppose -5x + 30 = 5c, x + 4c = lx + 10. What is the second derivative of -2g + 5gx - 3g*2 + 0g wrt g? 4 Let w be ((-14)/21)/((-4)/18). Suppose 5t - wc - 24 = -0t, -4t = 3c - 3. What is the third derivative of 0j*4 + 6j*2 + 6j*4 - tj*4 + 0j*4 wrt j? 72j Let v = -1 + 4. Let p be 36/162(-10)/(-5). Differentiate 3jv - 2j*3 + p - 12 wrt j. 3j*2 Let q(u) = 2u*2 + u - 2. Let o be q(2). Suppose -13f = -of - 10. Differentiate jf + j2 - 2 - 2 - j2 wrt j. 2j Let f(h) be the third derivative of 22h2 - 1/6h*3 + 1 + 0h - 19/8h4. Differentiate f(s) wrt s. -57 Let a = -12 - -12. Suppose j = -5o + 3, 0 = 4j - aj - 2o - 12. Find the third derivative of -jz*5 - 7z*5 + 20z*5 - 9z*2 wrt z. 600z*2 What is the second derivative of 28 - 87 + 28 + 31 - 193r + 16r3 wrt r? 96r Let d(h) = -270h3 + 6h*2 + 9h. Let f(a) = -90a3 + 2a*2 + 3a. Let x(w) = -4d(w) + 11f(w). What is the third derivative of x(y) wrt y? 540 Suppose 3 + 6 = 3t. Suppose -6 = -p - 3. Find the second derivative of -tx - 74 - px2 + 74 wrt x. -6 Let x = 0 - -2. Let d be -4 - (-5 + -3 + 1). Find the second derivative of 2a*d + 0a*3 + 4a - 2a3 - xa*4 wrt a. -24a*2 Suppose 5t + t - 24 = 0. What is the second derivative of -23w + 30w - 16wt + 4w*4 wrt w? -144w*2 Let i(s) = -6s*3 - 6s*2 + 15. Let w(n) = 3n*3 + 6n*3 - 16n*3 - 6n2 + 15 + n2. Let a(h) = -5i(h) + 6w(h). What is the derivative of a(p) wrt p? -36p2 Suppose 0c + c - 5 = 0. Differentiate 12 - 16 + cb4 + 12b*4 with respect to b. 68b*3 Suppose 6 = -2g - 2b, 0 = g - 2b - 3b - 27. What is the third derivative of 2 - 111m*2 + 138m*2 - g + 15m*3 wrt m? 90 Suppose -g - 5d = 10 - 4, d + 18 = 4g. Find the second derivative of 9t - 16t + 13t*2 - gt wrt t. 26 Let s(m) = -68m3 + 7m*2 - 5m - 14. Let h(b) = -102b3 + 10b*2 - 7b - 21. Let w(u) = 5h(u) - 7s(u). What is the third derivative of w(r) wrt r? -204 Let r(z) be the third derivative of 0 + 0z4 + 0z - 3/2z3 + 1/5z*5 - 11z**2. What is the d	{ "pile_set_name": "DM Mathematics" }
False Is 84039 a multiple of 241? False Is 7316210 a multiple of 11? True Is 17 a factor of 23082894? False Is 13156475 a multiple of 25? True Is 718956 a multiple of 581? False Is 70 a factor of 277844? False Is 84 a factor of 9221016? True Is 1363094 a multiple of 8? False Is 6 a factor of 6908208? True Does 98 divide 181300? True Does 7 divide 20920? False Is 329685 a multiple of 16? False Does 168 divide 6680016? True Is 7 a factor of 456478? False Does 17 divide 665159? True Does 25 divide 88325? True Does 185 divide 974395? True Is 186984 a multiple of 56? True Is 34 a factor of 772143? False Does 74 divide 475524? True Is 6181414 a multiple of 10? False Is 156 a factor of 252252? True Does 112 divide 266672? True Is 1615860 a multiple of 15? True Is 887747 a multiple of 217? True Is 95 a factor of 379855? False Does 2 divide 70956? True Is 99572 a multiple of 31? True Does 107 divide 803496? False Is 10220004 a multiple of 14? False Is 142 a factor of 190280? True Does 46 divide 97566? True Is 274 a factor of 1483436? True Is 560 a factor of 7721563? False Does 6 divide 17922? True Is 9 a factor of 1335139? False Does 1391 divide 8937175? True Is 690615 a multiple of 2? False Is 342654 a multiple of 39? True Is 201842 a multiple of 86? True Is 12083475 a multiple of 2195? True Does 77 divide 7189182? True Is 1564947 a multiple of 287? False Is 6968844 a multiple of 82? False Is 71 a factor of 13206? True Does 99 divide 60489? True Is 6 a factor of 40308? True Is 1122513 a multiple of 173? False Is 2306527 a multiple of 811? False Does 32 divide 12285376? True Is 19 a factor of 3984832? True Is 226991 a multiple of 298? False Is 1262500 a multiple of 250? True Does 773 divide 193117? False Is 560 a factor of 692720? True Does 22 divide 6137692? True Does 48 divide 3607443? False Does 108 divide 144504? True Is 15 a factor of 3103935? True Is 11 a factor of 7792516? False Is 16 a factor of 159824? True Does 95 divide 5352424? False Is 7500950 a multiple of 410? True Does 16 divide 1319465? False Does 3 divide 4161? True Does 26 divide 12271? False Does 131 divide 27250? False Is 19 a factor of 224975? False Is 28430 a multiple of 10? True Does 8 divide 19808? True Is 285 a factor of 75251? False Does 190 divide 60047? False Does 875 divide 32968250? True Does 67 divide 8509? True Is 1593686 a multiple of 24? False Does 10 divide 153633? False Is 40 a factor of 639497? False Is 502512 a multiple of 696? True Does 16 divide 1575712? True Is 244320 a multiple of 15? True Is 1384379 a multiple of 116? False Is 11184 a multiple of 9? False Is 887030 a multiple of 20? False Is 140146 a multiple of 887? True Is 581 a factor of 3693998? True Is 89 a factor of 441183? False Does 2 divide 285199? False Is 5371904 a multiple of 8? True Is 2088380 a multiple of 140? True Is 102 a factor of 248835? False Does 11 divide 59642? True Is 53 a factor of 179723? True Does 126 divide 132930? True Does 12 divide 353400? True Does 26 divide 45188? True Is 286480 a multiple of 5? True Is 17 a factor of 4521048? True Does 3 divide 1996014? True Does 7 divide 21324? False Is 2417339 a multiple of 5? False Does 1243 divide 3471699? True Is 479550 a multiple of 230? True Is 8 a factor of 638292? False Is 114 a factor of 3374628? True Is 45 a factor of 1539064? False Is 110672 a multiple of 20? False Is 184 a factor of 96790? False Does 22 divide 11036278? True Is 21 a factor of 10269698? False Is 15 a factor of 345484? False Does 3 divide 11606? False Is 803 a factor of 1018204? True Is 189600 a multiple of 200? True Is 31928 a multiple of 307? True Is 2501558 a multiple of 131? False Is 33473 a multiple of 2? False Does 392 divide 3148942? False Is 28743208 a multiple of 1528? True Is 938030 a multiple of 53? False Does 20 divide 157500? True Is 1212274 a multiple of 917? True Is 100 a factor of 489800? True Is 171 a factor of 340119? True Is 6450822 a multiple of 1548? False Is 1002881 a multiple of 144? False Does 36 divide 398628? True Does 231 divide 210247? False Is 3900820 a multiple of 22? True Does 14 divide 21981153? False Is 309205 a multiple of 244? False Does 368 divide 532864? True Does 122 divide 237248? False Does 19 divide 1590835? False Does 70 divide 7980? True Does 23 divide 7424906? True Does 65 divide 149565? True Is 3614988 a multiple of 156? True Does 10 divide 7548? False Is 173700 a multiple of 18? True Does 4 divide 4072? True Is 97 a factor of 4171? True Is 51 a factor of 107814? True Does 8 divide 90331? False Does 127 divide 59385? False Is 111078 a multiple of 363? True Is 5 a factor of 16264? False Is 117880 a multiple of 40? True Is 33 a factor of 619344? True Is 1133 a factor of 1589599? True Is 21 a factor of 134299? False Is 38 a factor of 246050? True Is 860 a factor of 145340? True Is 21850 a multiple of 5? True Is 1128 a factor of 331632? True Is 144350 a multiple of 5? True Is 1032 a factor of 3558336? True Does 1074 divide 4618200? True Is 3244364 a multiple of 608? False Is 49669 a multiple of 15? False Is 7134 a multiple of 3? True Is 2910483 a multiple of 9? True Is 243786 a multiple of 246? True Is 702 a factor of 1255176? True Is 177152 a multiple of 173? True Does 7 divide 239370? False Is 2339798 a multiple of 16? False Is 30 a factor of 388656? False Does 22 divide 472829? False Does 152 divide 12408825? False Is 51 a factor of 3964179? True Is 258209 a multiple of 333? False Is 23678 even? True Does 79 divide 21229? False Does 55 divide 7629233? False Is 16 a factor of 1151360? True Is 553231 a multiple of 4? False Is 149832 a multiple of 3? True Is 5445370 a multiple of 98? True Is 50 a factor of 258195? False Is 29 a factor of 201637? True Is 3339819 a multiple of 431? True Is 44 a factor of 13007764? True Is 37 a factor of 263343? False Does 429 divide 601442? False Is 317170 a multiple of 46? True Is 164220 a multiple of 2? True Does 214 divide 758630? True Is 81996 a multiple of 3? True Is 7 a factor of 2183363? True Is 24 a factor of 1612888? False Does 109 divide 1721988? False Is 137632 a multiple of 374? True Does 176 divide 2012912? True Is 24489 a multiple of 282? False Is 6381750 a multiple of 25? True Does 183 divide 4917075? False Is 684095 a multiple of 38? False Does 47 divide 286418? True Does 564 divide 107417? False Is 604 a factor of 3640308? True Is 71 a factor of 1653424? False Is 1928680 a multiple of 13? True Is 1804930 a multiple of 158? False Is 72216 a multiple of 531? True Does 21 divide 39849? False Is 24 a factor of 649536? True Does 82 divide 55960? False Is 99 a factor of 81477? True Is 4507924 a multiple of 123? False Is 1409989 a multiple of 19? False Is 661301 a multiple of 2? False Does 20 divide 865560? True Is 2269790 a multiple of 706? True Is 601979 a multiple of 161? True Is 338 a factor of 14900730? True Is 1347108 a multiple of 3? True Is 37 a factor of 43623? True Is 12 a factor of 1378296? True Is 39 a factor of 1055184? True Is 853910 a multiple of 226? False Does 134 divide 429803? False Does 2 divide 23433? False Is 424 a factor of 1342090? False Is 3 a factor of 19154? False Does 9 divide 690786? True Is 18981 a multiple of 333? True Does 19 divide 147725? True Does 11 divide 80022? False Is 2826936 a multiple of 84? True Is 13 a factor of 400380? False Does 20 divide 2724477? False Is 27 a factor of 1022247? True Is 6303723 a multiple of 479? False Does 897 divide 5762328? True Is 1269 a factor of 3767661? True Is 5942016 a multiple of 32? True Is 147392 a multiple of 4? True Is 3478335 a multiple of 21? True Is 33 a factor of 65632? False Is 4635954 a multiple of 27? True Does 2 divide 170583? False Is 45 a factor of 1651948? False Is 11594 even? True Is 188880 a multiple of 28? False Does 107 divide 566137? True Is 393 a factor of 464919? True Is 38262 a multiple of 31? False Does 22 divide 473682? True Does 129 divide 348429? True Does 22 divide 939911? False Is 2626563 a multiple of 14? False Is 16 a factor of 19768995? False Is 787 a factor of 6271513? False Is 201 a factor of 160291? False Is 152 a factor of 845120? True Does 150 divide 107740? False Does 16 divide 1124509? False Is 6950944 a multiple of 32? True Is 6218 a multiple of 2? True Is 3137102 a	{ "pile_set_name": "DM Mathematics" }
4. Which is smaller: l or -65/3? l Suppose -c + 3 = 4r - 15, 2r = -5c. Let v = 6436 + -6443. Which is greater: c or v? c Suppose o + 3z + 103 - 303 = 0, -4z - 800 = -4o. Which is smaller: 201 or o? o Let v = -408 + 452.6. Let h = -30.5 + v. Let d = h + -14. Which is smaller: 8 or d? d Suppose -8p + 13p - 50 = 0. Suppose 0 = -pi + 7i - 351. Let g be (-116)/i - (-4)/(-18). Is 2 at most as big as g? False Let k = -2 - -2.02. Let f = -47 - -46. Is k >= f? True Suppose c - 9 - 56 = 4a, 2c = 5a + 79. Let z(l) = -4l - 1. Let i be z(4). Is i at least a? True Let p = -16/17 + 1. Let k be ((-12)/4 + 3)(2 + -3). Is k at least as big as p? False Let r = 1.2 - 1. Let d = -8.3 - -8. Let z = d - -0.31. Is z greater than r? False Let h(i) = -i2 + 3i - 2. Let q be h(2). Let y be (-295)/690 - (-23)/138. Which is greater: q or y? q Suppose -78 = 5x + x. Let g be (42/x)/(-3) + -1. Is g at most 0? False Let f be (2/32)/((-55)/30)4. Which is smaller: f or 0? f Suppose 30w - 524 = 736. Do w and 38 have different values? True Suppose -56 = 7w - 28. Is w greater than -27/5? True Let h = 56.2 - 58.2. Which is smaller: -0.1 or h? h Let y = -1.9 + -3.1. Let f = y + 4.9. Which is smaller: f or 20/9? f Let n = 1492 + -4477/3. Is n less than 1/80? True Let z = -0.511 - 109.489. Is 0.01 bigger than z? True Suppose 0 = -3a + 2t - 77 + 27, 0 = 4a - 3t + 66. Let o be (-14)/a + (-4)/54-3. Is 3/5 greater than o? False Let d = 27989/12 + -2258. Let g = d - 74. Which is smaller: g or 0? 0 Let x = 233 + -3493/15. Which is greater: x or 2/45? x Suppose 4g = -2z + 7z - 42, -z - 4g - 6 = 0. Suppose -2v = 4l - z + 20, -2v = -5l - 31. Is 30/7 at most as big as v? False Suppose 6b + 3w = 8b + 35, 3b + 60 = 2w. Is -165/8 > b? True Let m = 36/11 + -211/88. Is m at least -2? True Suppose 5h - 124 = 2g + 44, 4h + 150 = -2g. Is -82 bigger than g? False Let c(x) = x*3 + 1. Let m be c(0). Is 3/82 bigger than m? False Suppose 2l = 8, 0 = -5t - 2l + 11 + 2. Suppose 4a - t - 11 = -4k, -3k - 1 = -2a. Let x be 2 + 1 - (5 - a). Which is greater: x or -4/7? x Let m(x) = 19x2 + 2x + 11. Let a be m(-2). Is a less than 82? False Let d = 1119 - 1090. Are d and 30 non-equal? True Let j be 540/(-70) + 4/(-14). Let a = -5 - j. Suppose i = 1 + a. Which is smaller: i or 3? 3 Suppose -22m + 19m = -3. Suppose -32 = 3q + m. Let t be 45/10(-16)/6. Are q and t nonequal? True Let x = 0.489 - 0.819. Is x less than or equal to -5? False Let i = 232 - -1600. Is 1831 at least as big as i? False Let m(v) = v*3 - 32v*2 - 28v + 293. Let l be m(33). Which is smaller: 1 or l? 1 Suppose 4q - 3c = 165, -5q + 209 = -0q - c. Let h be (-9)/(-27)q/(-8). Is -1 equal to h? False Let h = 29.67 + -0.67. Let c = 29.21 - h. Do c and 1/2 have the same value? False Let t = -38 - 25. Let n = -64 - t. Is n not equal to 36? True Suppose -4h = 3j, -4j - h + 19 = -2h. Suppose 0n = jn + 8. Suppose -3s = -5c + 18 + 16, -3s = -4c + 29. Which is smaller: s or n? s Suppose 2a + 5y = 4y, 0 = -5y - 10. Which is greater: a or 17/12? 17/12 Let k = 1640 - 1760. Which is smaller: -117 or k? k Let k be 3/24(-9 + 17). Let t be (-56)/(-48) + k/3. Which is smaller: 8 or t? t Let g be (-66)/9((-492)/(-8))/(-1). Which is bigger: 452 or g? 452 Let f = 202 + -275. Is -72 less than f? False Suppose 4t - 3t = 0. Suppose t = 2d + 22 + 10. Let j = 9 + d. Are -8 and j nonequal? True Let o be (6/4)/(657/(-24)). Which is smaller: o or 1? o Let d be (-125)/103/((-3)/(-2)). Let k = d - 32. Which is bigger: k or -56? -56 Suppose -2w + 191 = -3v + 123, 5v + 2w + 108 = 0. Let i(f) = 2f + 2. Let z be i(2). Let q be ((-33)/v)/(z/(-4)). Is 6/17 > q? True Let j = -1105 + 18793/17. Which is smaller: j or -1/2? -1/2 Let y be -2 + 35/(-28) - (-1 - 2). Which is bigger: y or 5/8? 5/8 Let k = 308 + -2461/8. Let w(l) = -l + 3. Let c be w(3). Are c and k equal? False Let x be (-1)/(-3)9 + 12. Let s be -29 - x/(5/(-2)). Which is smaller: s or -29? -29 Let n(k) = k*3 + 26k*2 + 24k - 35. Let a be n(-25). Let c = 1 + a. Which is smaller: 1 or c? c Let x = 221/3 + -56. Which is smaller: x or 19? x Let m = -21/823 - 324157/4115. Which is greater: m or -80? m Let w(x) = -x*3 - 4x*2 + x + 2. Let i be w(-4). Let r = -12.8 - -25. Let b = r - 12.4. Which is smaller: i or b? i Let a = -61/42 + -3/14. Which is smaller: -1 or a? a Let z be (-12)/14 - (4264/56 - 7). Do -71 and z have the same value? False Suppose 5d + 12 + 13 = 3u, -20 = u + 4d. Let o(k) = 4k + 12. Let j be o(u). Is 10 less than j? True Let f = -0.156 - -1.896. Let m = 0.24 - f. Do m and -3 have the same value? False Suppose -27n + 16n = 44. Is n equal to -8? False Let c = 531 - 543. Is -8 smaller than c? False Let j be (-603)/((-2 - 1) + 0). Which is smaller: j or 203? j Let m = 23 + -21.9. Let d = 13.9 + m. Let q = d + -10. Is q < -1? False Suppose 7 = -k - 2. Which is smaller: k or -19/2? -19/2 Let j = -15 + 13. Let t = j - -5. Suppose -tv + 5q - 25 = 2v, 3q = 5v + 35. Which is smaller: -11 or v? -11 Suppose -9 = 2h + 13. Let m = -8 - h. Let d be (2/(-1))/((-6)/m). Which is smaller: 7/5 or d? d Let y be 0/3 - (4 + -3)-1. Let z be 357/(-27) - (-2)/9. Which is smaller: y or z? z Let g = 33 - 33. Let k be 6/(-6)(3 + 0). Let f be 54/58 + k/3. Are f and g unequal? True Let r = 32 + -2. Let m = 16 - r. Is m at least -15? True Suppose -2x + 7 = h, 0x + 9 = 3x. Suppose -3a = -2a + h. Are -6/11 and a unequal? True Suppose 35d - 4 = 31d. Let w be 14 - (-2 + d) - 1. Which is bigger: 13 or w? w Suppose 0f - 2u + 20 = 4f, 20 = 4f + 3u. Let k(r) = -r + 8. Let l be k(f). Suppose -o - l = -6. Which is bigger: 2 or o? o Let a = -23/9 + 1849/720. Let p(w) = -w3 - 19w*2 - 18w - 1. Let g be p(-18). Is a greater than g? True Suppose -s = s. Suppose 31 = -3x + 2l, 2x = -3l + 1 - s. Let d(g) = -9g - 107. Let t be d(-11). Do x and t have the same value? False Suppose 3s + 3 + 12 = h, -3 = h. Let r be ((-20)/(-2))/((-3)/s). Let d = -21 + r. Is 0 less than d? False Let b be (-141)/94(0 + 24/207). Does b = -0.2? False Let f = -18 - -18. Suppose v + fv - 2 = 0. Suppose 5a - 25 = -3w, vw - 4a = -0w - 20. Is w < -2/13? False Let z = -34 - -18. Let u be (12/z)/(61/(-5)). Is 2 equal to u? False Let u = -11.97 - 0.03. Let b = u + 12.2. Let l be (-8)/(-12) + (-14)/3. Which is smaller: l or b? l Let c = 126 - 125. Let w be (27/6(-4)/(-6))/c. Is w >= 30/11? True Suppose -5t + t = 0. Suppose -v = 3f - 66, t = -3f + 5f - 3v - 33. Let o be ((-126)/(-15))/((-6)/(-15)). Is o less than or equal to f? True Let a = -1.4 + 1.2. Let l = -0.172 - a. Which is bigger: l or -1? l Let n be 12/(-105)5 - (-12)/21. Let f(m) = -m + 7. Let v be f(7). Is n != v? False Let i = 493 + -502. Which is bigger: i or 95? 95 Let u(j) = -j3 + 6j*2 + 11j + 20. Let f be u(6). Which is greater: f or 84? f Let h = -1 - -8. Suppose -4b + 6 = -hb. Let y be 30/16 + (b - 0). Which is bigger: y or -1? y Let b = 231/19 - 2168/133. Which is greater: b or -2? -2 Let l be (24/342)/((-5)/((-15)/(-2))). Let w = 50/7 + -48/7. Is l smaller than w? True Let l = -31.54 - -32.54. Let h = 20 - -2. Is h not equal to l? True Suppose -9t - 6 = -6t. Let y be 8/t - -1 - 72865/(-24245). Is y bigger than 1? False Let b(j) = -4j2 + 49j - 28. Let x be b(12). Which is smaller: x or -11? x Let p(t) = -15. Let l(h) = h - 1. Let j(w) = -l(w) - p(w). Let m be j(7). Let u be -1 - ((-12)/(-4) + 0) - -12. Which is greater: m or u? m Let t = 1.5345 - 0.0345. Do -5 and t have different values? True Let v = -1 - -3. Let w = v + -1. Let y be w/(-2) + 24/(-16). Which is smaller: y or -0.2? y Let x be 25/(-50) + (-9)/(-6). Is x <= -5/143? False Suppose -2 = 2c - 5i + 3i, -4c - 4i - 4 = 0. Let r = 13/15 + -49/45. Is c smaller than r? True Let y be ((-2)/3)/((-10)/(-45)). Let v(c) = c2 + c - 4. Let h be v(y). Suppose 1 = 2q - 3a + 7, 0 = -a + h. Is 1 != q? True Let z(b) = -2b + 28. Let i be z(13). Suppose 0 = iw - 0w + 6. Is -16/7 greater than w? True Let l be 8/252(-56)/(-12). Which is smaller: l or -1? -1 Suppose 4z - 45 - 23 = 0. Suppose -3 = 3s + 12, 0 = 3w + 4s + z. Is 1/19 != w? True Suppose 9c - 15c = -4c. Let j be 4 - 5 - (-6 + c)/(-1). Which is	{ "pile_set_name": "DM Mathematics" }
45046/24 - 6/9. Let y = j - 19943/12. Let n = 1007/6 - y. Calculate the common denominator of 103/18 and n. 18 Let g = -2261945/13 + 174080. Let m = g + -5309/78. What is the common denominator of m and 59/12? 12 Let b(y) = y*2 - 2y + 14. Calculate the smallest common multiple of b(0) and 14. 14 Let u(q) = -q*3 + 5q*2 + 6q. Let d be u(5). Let k = d + -27. Let j(f) = -f*3 + 4f*2 + f. What is the least common multiple of k and j(4)? 12 Let u be (-12)/(-2)1/2. Let f(c) = c*2 - c + 8. Calculate the common denominator of f(-6) and ((-64)/(-30))/(u/30). 3 What is the common denominator of 2/(-2)(-73)/(-48)-3 and -41/20? 80 Suppose 4k = v + 14, -2v + 3k - 10 = 4k. Let j = -5 - v. Find the common denominator of 17/6 and j/(-4)(-166)/(-4). 24 Let u = 5 - 3. Suppose -4l + 165 = -5h, -4l = uh - 51 - 135. Let s = 10497/7505 - -2/1501. Calculate the common denominator of s and l. 5 Let z(m) = -m*2 + 5m - 3. Let b(g) = 2g2 - 2g - 2. Suppose -o + 4 = -4u, -5u + o + 6 = -3o. Calculate the smallest common multiple of b(u) and z(3). 30 Let i(k) = k2 + 3k + 2. Let s(r) = r - 5. Let h be s(-7). Let j = h - -18. Calculate the lowest common multiple of j and i(3). 60 Let n = -4 - -8. Suppose -5c + 22 = -i + 4i, ni + 4c = 24. Suppose 5m - 12 = 88. What is the lowest common multiple of i and m? 20 Let v(z) = -2z. Suppose -2g - 4c - 26 = 3g, -3c = g + 3. Let d(p) = -p*3 + 2p*2 + p. What is the smallest common multiple of v(g) and d(-2)? 84 Let w = -44 - -119. Find the common denominator of -41/6 and (w/(-10))/(21/4). 42 Find the common denominator of 2/(8/59) + 3/1 and -109/10. 20 Suppose -12 = 4v - 7v. Let b be 10/(-4)(-18)/(-15). What is the common denominator of v and (-4)/(-6)(-2)/b? 9 Suppose 6j - j + 21 = u, 5j - 59 = -4u. Calculate the least common multiple of 6 and u. 48 Let m = 708/95 + -16999/3135. What is the common denominator of m and -83/12? 132 Suppose 2b + 8 = -2m, 20 = -0m - 4m - 2b. Calculate the common denominator of 6/(-36)m/2 and 35/18. 18 What is the common denominator of 2303/(-12)(-1)/2 and -25? 4 Let o be (0 - 0) + 108/(-4). Find the common denominator of -50/11 and -15(o/(-12) - 1). 44 Let g be (-10)/(-244)(3 + 21). Let t = 5421/488 - g. Let a = -2467/2 + 1262. Find the common denominator of a and t. 8 Let u be 3 + 0 - (-243)/20. Let n = u + 13/5. Find the common denominator of n and -83/14. 28 Let c be 110/3 + 6/(-9). Suppose -c = 3o - 5o. Let n(p) = -4p - 2. What is the lowest common multiple of o and n(-4)? 126 Let x(t) = 21t3 + t2 + t - 1. Let j = -7 + 10. Suppose -jw = 2w - 5. Calculate the lowest common multiple of x(w) and 16. 176 Let o be (-22)/(-8) + (-2)/(-8). Calculate the common denominator of o - ((-1380)/8)/(-5) and 76/3. 6 Let i = 5405/3 - 491909/273. Let v = -5258/819 - i. What is the common denominator of v and 3/2? 18 Let g = -63 - -43. Let n = -14 - g. What is the least common multiple of n and 10? 30 Suppose -y + 20 = 18. What is the least common multiple of y and 6? 6 Let x be (-2 + -3)12/6. Let i = 0 - x. Calculate the smallest common multiple of 11 and i. 110 Let t = 13148 + -394261/30. Find the common denominator of -49/27 and t. 270 Let n be (-175)/(-28)2134. Let b = n - 3275/2. Calculate the common denominator of -43 and b. 2 Let g be 3/6(3 - -5). What is the common denominator of 93/14 and 31/(-84) - g/(-14)? 84 Let u(a) = -a*2 - 7a + 4. Let o be u(-5). Suppose -o + 2 = -2t. What is the smallest common multiple of 4 and t? 12 What is the common denominator of -73/10 and 1/4 - (7684/(-720))/(-17)? 90 Let m be -4 + 2(-9)/(-6). What is the common denominator of m/7 + 8350/(-840) and 49/10? 60 Let v be (15/100)/(6/(-289612)). Let o = v - -7233. Calculate the common denominator of o and -17/18. 90 Let g(v) = -v*2 + 5v - 2. Let c be g(3). Suppose r - ch + 86 = 6r, 5r = -2h + 88. Calculate the lowest common multiple of r and 10. 90 Let b = -10 + 6. What is the common denominator of -53/5 and 128/(-60) + b/6? 5 Let f = 14/139 + -5864/55461. Let y be 1/(-2) + 6830/(-532). Let l = y - f. Calculate the common denominator of -53/7 and l. 21 Let d = -673373/35754 + 1/5959. What is the common denominator of d and ((-10)/(-18))/((-7)/(-77))? 18 Let q be 3 - (1 + (-1 - 1)). Suppose -29 = -o - qk, -o + 3k = -k + 11. What is the least common multiple of o and 4? 36 What is the smallest common multiple of 4 and 110/6 - 14/42? 36 Let n = 273624319/4653 - 58806. Let b = 21995/4653 + n. Find the common denominator of b and ((-4)/(-10)-103)/(-4). 110 Let z be 2/(-8) + (-50)/(-8). Suppose 0 = -zy + y + 65. Suppose 2a + 5 = y. Calculate the lowest common multiple of 10 and a. 20 Suppose 4z - m - 64 = 0, -3z = -0z + m - 41. Suppose -r = 4a - z - 16, 155 = 5r - a. Let n = 47 - r. What is the smallest common multiple of n and 2? 16 Let a(o) = -o*3 - 2o*2 - 3o - 2. What is the smallest common multiple of a(-2) and 16? 16 Let b(t) = -6t2 - 2t - 2. Let s be b(-4). Suppose -171 = 5w + 2x, -5w + 3x - 167 = 7x. Find the common denominator of -17/8 and 2/2 + w/s. 72 Let t(b) = 0b2 - 5 - 2 - b2 + b + 8b. What is the smallest common multiple of 5 and t(6)? 55 Let u = -55/51 - -2383/1122. What is the common denominator of u and -101/4? 44 Suppose 0o = 5o - 5. Calculate the least common multiple of o and 1. 1 Find the common denominator of (3/2)/(3/71) and 65/6. 6 Suppose -3l + 12 = 3x, 0x - 16 = -5l - 3x. Calculate the least common multiple of l and 18. 18 Let q = -11 - -14. Let w be 29/3 - 4/6. What is the least common multiple of 2 and (11/3)/(q/w)? 22 Let q = -6 - -14. Calculate the common denominator of -111/20 and -1 + (7/q)/7. 40 Suppose 0 = -0j + 2j + l - 15, -3l + 5 = -2j. What is the common denominator of 121/10 and (-37)/j4/8? 10 Let n = -1467/4 + 4607/12. Calculate the common denominator of n and -81/14. 42 Let j = 951/2 - 459. Let f = 54 - j. Calculate the common denominator of f and 39/4. 4 Let c = -567/5 + 2413/20. Let m(s) = -46s*2 - 2s + 1. Let o be m(1). What is the common denominator of 2/5 - o/(-10) and c? 20 Suppose 0 = -t - 5c + 8, -3t = 2t + 5c - 40. Calculate the smallest common multiple of t and 48. 48 Let x = -2 + 7. Suppose -5n - 2s + 36 = 0, s + 21 = xn - 2s. Suppose a = na + 195. Calculate the common denominator of a and -53/5. 5 Let d(f) be the third derivative of f5/60 - 5f*4/24 - 4f*3/3 + 4f*2. Calculate the lowest common multiple of 14 and d(8). 112 Let z = -185 + 731/4. Calculate the common denominator of z and 43/7. 28 Let h = 16403/5 + -3293. What is the common denominator of h and 31/8? 40 Let y(v) = 3v*2 - 20v - 47. Let k(c) = -c*2 + 7c + 16. Let w(x) = -17k(x) - 6y(x). Calculate the lowest common multiple of 9 and w(0). 90 Let f be 1(3/(-3) + 1). Suppose 2n + 3n - 80 = f. Calculate the least common multiple of 10 and n. 80 Calculate the common denominator of 5/20(-66 + 0) and ((-77)/(-5))/(2/5). 2 Let t = -20231707/1155 + 245157/14. Let h = t + 1/66. Let k = -2/4851 - 22174/4851. What is the common denominator of h and k? 35 Let v = -7/15 - -167/15. Let i = 641/30 - 46/5. Find the common denominator of v and i. 6 Calculate the common denominator of (-1 - 13)/(36/17) and ((-6)/16)/((-63)/(-1876)). 18 Let c be (-8)/((-8)/(-396)1). Let r = -3568/9 - c. Calculate the common denominator of r and -97/10. 90 Suppose 0 = 3c - 2w - 250, -4c + 2w = c - 418. Suppose -3o = o - c. Let v = o - 9. What is the smallest common multiple of v and 2? 12 Let z(w) be the second derivative of -w*3/6 - 2w*2 - w. What is the common denominator of z(0) and -5/11? 11 Suppose 5n - 5h + 1 = 3n, 0 = 5n - 2h - 8. What is the lowest common multiple of 22 and n? 22 Suppose 2c - 33154 = -3b, -2b + 3c - 4c + 22101 = 0. Let d = b + -132673/12. Let l = 2/43 - -39/86. Calculate the common denominator of l and d. 12 Calculate the common denominator of 17/9 and (2 + 44/(-56))2. 63 Let b = 45 + -40. Calculate the smallest common multiple of b and 4. 20 Let l be (9/(-6))/((-3)/20). Let t = l - 7. What is the lowest common multiple of 9 and t? 9 What is the common denominator of 11/8*(-12)/30 and (99/(-10))/1 + 0? 20 Let r be (30/4)/(10/40). Let d(n) = n + 4. Let g be d(-6). C	{ "pile_set_name": "DM Mathematics" }
least as big as -1? True Suppose 0 = -3b + z + 7, -2z + 25 = 4b + 9. Suppose 4i - 3r - 19 = 5, 0 = br. Suppose i = -0a - 2a. Is -3 < a? False Suppose -12q = -8q + 4. Let k = -109/3 + 36. Are k and q non-equal? True Let l = -1/129 - -154/3225. Which is smaller: -2/7 or l? -2/7 Let i(z) = z. Let c(m) = 7 - 2m2 + m2 - 4m - 3. Let u(q) = c(q) - 3i(q). Let o be u(-7). Which is greater: 1 or o? o Suppose 30 = 2s + 3s. Let q = 130 + -126. Is q bigger than s? False Suppose -3 = 2u + 2u + j, 0 = 4u - j - 3. Suppose 0 = -ui + 3i + 6. Let k be (-3)/i4/6. Which is greater: 2/15 or k? k Let z = 1/5 + -19/45. Are z and -1 nonequal? True Suppose -5u + 7 = 4c, -u + 5c = -6u + 10. Is u != -4/29? True Suppose -i = 3t - 2i - 5, 2t = -4i + 22. Let a be 17/3 + (-9)/t. Which is smaller: 4 or a? a Suppose -5t - 4t = -4t. Is t bigger than -4/25? True Let n be 34/((7 - 11) + (0 - -14)). Is 3 < n? True Let x = 9 + -2. Suppose -4r - 2j + 0 + 2 = 0, 5r - 2j = x. Which is greater: 1/4 or r? r Let j be 2 + -1(-9)/(-3). Is -0.8 < j? False Let t be -3(-7)/(-6) + (-2)/(-4). Is -2 at most t? False Suppose -3z = 3b - 18, 2b = -b + 2z - 7. Which is smaller: -6/25 or b? -6/25 Let f be ((-3)/((-3)/(-4)))/3. Is f less than or equal to 0? True Suppose 0 = 3k + 4m + 112, 3m - 37 + 4 = k. Let w = -141/4 - k. Suppose -2 = -6g + 4g. Is g greater than w? True Let f(o) = o3 - 3o*2 + o. Let x be f(1). Let l be (-3)/2x/3. Which is smaller: -2/9 or l? -2/9 Let s = -8 - -8. Let p be 2 + (-7)/(-9) + -3. Which is greater: s or p? s Let j(l) = l*2 + 7l + 12l - 8l + 0l2 + 11. Let x be j(-9). Is -7 equal to x? True Suppose 0 = -5h - 14 - 16. Which is smaller: -3 or h? h Let c = -137/187 - -14/17. Let u be 0/((-4)/(1-2)). Is u at least as big as c? False Let y(l) = 11l*2 - 3l + 2. Let z be y(3). Let g be (2/z)/(3/(-12)). Suppose -13d = 2 - 2. Is g != d? True Let y = 22/9 + -514/63. Which is bigger: y or -7? y Let a = 1 - 5. Let i = 2 + a. Let g = i - -1. Which is greater: 2/9 or g? 2/9 Suppose g + 5a = -2g + 65, a = -3g + 49. Is g greater than 16? False Let o = -11.2 - -11. Which is smaller: o or 0? o Let y(r) = 2r - 5. Let v be y(3). Are v and -3/40 unequal? True Let j(n) = -1 + n - 2n + 0n. Let p be j(5). Let k(q) = q3 + 5q*2 - 7q - 5. Let o be k(p). Which is smaller: o or -2/21? -2/21 Suppose -2 = 5h + 3. Let r = -3.8 + 1.8. Is h greater than or equal to r? True Let j = -0.1 - -0.05. Are 1 and j equal? False Let m = 671/3 - 226. Which is smaller: m or -3? -3 Let k be (-9)/(-2)8(-7)/84. Let n = 4/213 - 238/71. Is k bigger than n? True Suppose -3k + 15 = 5i, -2i - 3i + 5 = k. Suppose 8j = 7j + 18. Suppose -kl + j = -t, -2t + 3 = -2l - 5t. Is 4 at most as big as l? False Let r be (9/45)/((-1)/5). Are 2/25 and r non-equal? True Suppose -4x = -4o - 1 - 7, -x = -4o + 1. Do 0.3 and o have the same value? False Let l = -16 + 8. Let q = -11 - l. Is q > 1? False Let t(k) = 10k - 2. Let v be t(-2). Is v less than or equal to -21? True Suppose 0 = 4w - w - 6. Is w greater than or equal to 2? True Let p be 2 + (-17 - -1)/4. Let b be p/((-3)/(27/(-42))). Which is smaller: 0 or b? b Let n = -4 - -5. Is 2 greater than or equal to n? True Let q be (-2)/14 + (-33)/63. Which is greater: q or -0.05? -0.05 Let d be (-4)/(-10) - (-4)/(-10). Suppose -3z + 3 = d, v + 4v + 2z = 22. Suppose 11 + 5 = -vw. Which is bigger: w or -3? -3 Suppose 0 = 7n - 13n - 252. Does n = -41? False Let l = 28 + -28. Which is bigger: l or -1/7? l Suppose 5l - 3l = 8. Suppose -3t + 2 = -10. Is t at most l? True Let j = -64 - -56. Which is greater: j or -6? -6 Let x = 0.5 + -1.5. Is 5 greater than or equal to x? True Let z be -2(-1)/(-2)-3. Suppose -zd = d. Suppose 4v - 5i = 25, -5v = 2i - 7i - 25. Is v at most d? True Suppose 4x + x + 2g = 16, 0 = 4x - 3g - 22. Which is bigger: x or 5? 5 Let w(b) = b3 - 3b*2 - 10b - 6. Let l be w(5). Suppose 2t = 42 + 18. Suppose -r = 4r + t. Is l less than or equal to r? True Let m = -12 + 7. Let t = m + 3. Let y be (1/5)/(6/(-15)). Does y = t? False Let a(c) = -c*2 - 6c + 4. Let m be a(-7). Let t = m + 7. Suppose 7f = 2f + 10. Which is smaller: t or f? f Let f be 2/1 + 76/5. Let b = -764/45 + f. Is b at least -1? True Let t = 50 + -49. Let s = -0.1 + 0.1. Let p = 1 - s. Is p at most as big as t? True Let w be (2 + -1)/((-5)/10). Is w < -1? True Let i = 1 + 0. Which is smaller: 1/16 or i? 1/16 Suppose 5b = -15 - 0. Which is greater: -5 or b? b Let o = 11 - 13. Is -2 bigger than o? False Let g(p) = 4p + 0p2 + 4p + 4 + p*2. Let h be -5 + (-2 + 4)-1. Let s be g(h). Which is bigger: s or 2? 2 Let w(k) be the second derivative of -k*3/6 - 9k*2/2 - 2k. Let x be w(-6). Suppose 0b + 3b = -12. Which is greater: b or x? x Suppose -8 + 3 = -5n. Suppose 0 = 4m - 0x + x - 20, -2x = 8. Suppose -m = -d - 2d. Which is smaller: d or n? n Let r be 2/6 + (-1924)/(-15). Let j = r + -129. Is 0.3 != j? True Suppose -5l = -49 + 19. Let c(a) = a*3 - 6a*2 + 6a - 1. Let m be c(5). Which is smaller: m or l? m Let l(v) = 10v2 - 5v - 4. Let d be l(-8). Let s be 3 - (0 + d/228). Is 0 smaller than s? True Let n(r) = -r*2 + 6r - 4. Let b be n(5). Suppose 0 + b = a. Let c be -1(-3 - 172/(-60)). Do a and c have the same value? False Let x = 0.09 - 1.09. Which is greater: x or -2.3? x Let m = -5583/8 + 699. Does 1 = m? False Let q = -27 + 27.8. Is -4 bigger than q? False Let o(s) = -s3 + 8s*2 - 12s + 31. Let d be o(7). Which is greater: d or -34/7? d Let j = 4/241 - -294/11327. Let p = 51/94 - j. Is p at most as big as 1? True Suppose 3r + r = 3t, t - 5r = 0. Is t < 5/9? True Let f(b) = -b3 + 5b*2 + 8b - 9. Suppose 0 + 24 = 4d. Let v be f(d). Is v at least as big as 4? False Let z = -6 + 5. Which is greater: z or 2/49? 2/49 Let s = -92/95 + 7/19. Which is greater: s or -1? s Let o = 134/3 + -44. Suppose -3y = 6y - 8y. Which is smaller: y or o? y Let d be (323/76 - 2/8) + -42. Is -38 at most as big as d? True Let v(b) = -b*2 + 3b - 3. Suppose -2w - w + 6 = 0. Let c be v(w). Which is greater: c or -3? c Let i = -7.4 - -7.1. Is 0 smaller than i? False Suppose -13s + 18 = -4s. Which is smaller: s or 5? s Suppose -2a = -5u - 20, u + 3a = -u + 11. Which is smaller: u or -4? -4 Suppose u - 4 = -0u + b, 27 = 3u + 2b. Let d = -6 + 10. Suppose -dt - 23 = -u. Which is smaller: t or -3? t Let q = -55 - -50. Is -5 != q? False Suppose 5d - 7d = 0. Is -6/13 at least as big as d? False Let p be (-4)/22 + (-204)/330. Let r = 21/20 + p. Does 0 = r? False Let v = 0.4 + 5.6. Let k = v + -6. Is 1 >= k? True Let r = -0.07 - -0.02. Let z = 2.95 - r. Is 0 equal to z? False Let s = 5 + 0. Which is greater: s or 2/7? s Let j = 4898038/21 - 233301. Let a = j + 61. Which is bigger: a or 0? 0 Let s(h) = -h - 15. Let q be s(-10). Let d = 6 + q. Which is smaller: d or 10? d Let h = 16 + -15.2. Let v = -1.1 + h. Suppose -5s = -x + 1 + 6, 0 = 5s - 4x + 13. Which is bigger: v or s? v Suppose -4l + 12 = -24. Let p = l - 17/2. Is p > 2? False Suppose -p + 0p + 5 = 0. Suppose 4x = -pg + 23, -g + 0g + 9 = 3x. Are 5/6 and x non-equal? True Suppose 4d - n = -4n + 1363, 0 = 3d - n - 1019. Suppose d = -c + 5c. Let s = 427/5 - c. Are 2/3 and s unequal? True Let k = 76 + -78. Let y = -1 + 0. Let h be 3(1/y + 0). Are h and k unequal? True Let q be (-1)/4-12. Let x = -0.13 - 5.87. Let c = -5.8 - x. Is q at least as big as c? True Suppose 3m = 2v + 30, 3m + 2 + 10 = 0. Let q be 12/v(-7)/6. Which is smaller: q or -8? -8 Let h be 6/21 - (-2)/(-7). Is -2/85 at most as big as h? True Suppose -20 = 4r, 3l = 4r - 2r - 5. Let v = l - -5. Suppose -9 = -3t - v. Is t smaller than 4? True Let b = -5 + 2.8. Let y = b - -2. Is 0.1 not equal to y? True Let t(w) = w2 - 4w. Let f be t(4). Suppose -4b + 3c - 44 = 0, fb - 4c + 24 = -b. Let s be (-12)/b4/(-10). Do s and 0 have the same value? False Let o(x) = 0x*3 + 10x - 10x2 + 5x*3 - x + 1 - 4x*3. Let u be o(9). Does u = 0? False Let k be (18/8)/((-1)/(-4)). Let t be (k/6)/(6/8). Suppose 3a = -n - tn - 21, -5a - 5 = -5n. Is n > -3? False Let o = 1 + 3. Suppose on + 4 = 5n. Suppose 0 = 5u - 3*c - 44 + 14, -u = c	{ "pile_set_name": "DM Mathematics" }
1108061839. 251, 1277, 3457 What are the prime factors of 2185585794? 2, 3, 7, 283, 20431 List the prime factors of 5814633079. 31, 41, 4574849 What are the prime factors of 82105220? 2, 5, 37, 181, 613 What are the prime factors of 2866785545? 5, 13, 44104393 List the prime factors of 91553919. 3, 103, 127, 2333 List the prime factors of 28406233. 28406233 What are the prime factors of 111588300? 2, 3, 5, 37, 1117 List the prime factors of 2545295666. 2, 4363, 291691 What are the prime factors of 5936683413? 3, 1978894471 What are the prime factors of 99326725? 5, 1249, 3181 What are the prime factors of 227310363? 3, 7, 709, 727 What are the prime factors of 7311428? 2, 17, 19, 5659 What are the prime factors of 3450802590? 2, 3, 5, 38342251 What are the prime factors of 1656695125? 5, 13253561 List the prime factors of 1272772159. 1272772159 List the prime factors of 5723717878. 2, 29, 757, 130363 What are the prime factors of 49767061? 19, 1039, 2521 What are the prime factors of 12178843? 71, 337, 509 List the prime factors of 568728596. 2, 19, 7483271 List the prime factors of 5231200852. 2, 167, 7831139 What are the prime factors of 169443217? 9281, 18257 List the prime factors of 2802500682. 2, 3, 199, 2347153 What are the prime factors of 679365989? 25717, 26417 List the prime factors of 1287045408. 2, 3, 11, 19, 23, 2789 What are the prime factors of 369650856? 2, 3, 17, 906007 List the prime factors of 329735102. 2, 1453, 113467 What are the prime factors of 1515230942? 2, 151, 5017321 What are the prime factors of 134921110? 2, 5, 13492111 List the prime factors of 1732192645. 5, 17, 20378737 What are the prime factors of 1303298591? 7, 17, 1063, 10303 What are the prime factors of 3289564047? 3, 7, 11, 29, 181, 2713 List the prime factors of 618016122. 2, 3, 151, 75793 What are the prime factors of 25152330? 2, 3, 5, 7, 119773 What are the prime factors of 309924341? 359, 863299 What are the prime factors of 3003301557? 3, 19, 1951463 List the prime factors of 4269992537. 337, 967, 13103 What are the prime factors of 33466591? 17, 157, 12539 List the prime factors of 2357862661. 7, 11, 29, 1055917 List the prime factors of 4404532852. 2, 1101133213 What are the prime factors of 34798697? 5749, 6053 What are the prime factors of 1013447821? 19, 53, 353, 2851 List the prime factors of 3296084859. 3, 3833, 31849 List the prime factors of 3423373581. 3, 167, 6833081 What are the prime factors of 76811032? 2, 17, 191, 2957 What are the prime factors of 183754849? 183754849 What are the prime factors of 697276379? 109, 6397031 What are the prime factors of 50709005? 5, 19, 41, 47, 277 What are the prime factors of 258726460? 2, 5, 2909, 4447 List the prime factors of 4045821599. 67, 5623, 10739 What are the prime factors of 245301762? 2, 3, 23, 941, 1889 List the prime factors of 296951486. 2, 13, 11421211 List the prime factors of 265655521. 265655521 What are the prime factors of 102543081? 3, 34181027 What are the prime factors of 1529673974? 2, 17, 73, 616307 List the prime factors of 42106988. 2, 7, 11, 136711 What are the prime factors of 54717768? 2, 3, 7, 4021 What are the prime factors of 3003010058? 2, 37, 40581217 List the prime factors of 704836972. 2, 7, 3596107 What are the prime factors of 238511079? 3, 26501231 List the prime factors of 227756412. 2, 3, 13, 17, 28627 List the prime factors of 4527017466. 2, 3, 709, 1064179 List the prime factors of 349975620. 2, 3, 5, 739, 877 What are the prime factors of 1631468235? 3, 5, 108764549 List the prime factors of 360644189. 10369, 34781 What are the prime factors of 94907738? 2, 37, 73, 17569 What are the prime factors of 4197921363? 3, 61, 71, 35899 What are the prime factors of 4791832? 2, 571, 1049 What are the prime factors of 1936265883? 3, 12821, 50341 What are the prime factors of 531794088? 2, 3, 7, 31, 101, 337 What are the prime factors of 1733189138? 2, 577, 1501897 What are the prime factors of 46543735? 5, 7, 167, 7963 List the prime factors of 559202695. 5, 661, 169199 What are the prime factors of 30547025? 5, 89, 13729 What are the prime factors of 76950891? 3, 17, 29, 41, 47 List the prime factors of 1366289337. 3, 7, 17, 317, 12073 What are the prime factors of 76131173? 23, 457, 7243 List the prime factors of 32971751. 3371, 9781 List the prime factors of 483067641. 3, 7, 23003221 What are the prime factors of 447043892? 2, 111760973 List the prime factors of 62415546. 2, 3, 397, 26203 What are the prime factors of 279151329? 3, 41, 1213, 1871 List the prime factors of 85038630. 2, 3, 5, 509, 5569 What are the prime factors of 92247863? 151, 610913 What are the prime factors of 1663356036? 2, 3, 138613003 What are the prime factors of 146580245? 5, 7, 31, 53, 2549 List the prime factors of 2853488885. 5, 13, 43899829 List the prime factors of 30454849. 30454849 List the prime factors of 98394333. 3, 3919, 8369 What are the prime factors of 345985598? 2, 7, 17, 85513 What are the prime factors of 99881535? 3, 5, 13, 31, 41 List the prime factors of 708607. 23, 30809 What are the prime factors of 3309956069? 7, 472850867 List the prime factors of 51896205. 3, 5, 1153249 List the prime factors of 41801651. 41801651 List the prime factors of 1048802497. 17333, 60509 What are the prime factors of 257779652? 2, 13, 4957301 What are the prime factors of 98561473? 98561473 What are the prime factors of 800661372? 2, 3, 7, 23, 73, 811 List the prime factors of 312910530. 2, 3, 5, 131, 79621 List the prime factors of 99900755. 5, 17, 31, 1223 List the prime factors of 260451084. 2, 3, 17, 1276721 What are the prime factors of 266299703? 31, 167, 51439 What are the prime factors of 978049396? 2, 19, 12869071 List the prime factors of 553943159. 7, 11, 7194067 List the prime factors of 647064857. 647064857 List the prime factors of 3100541935. 5, 101, 6139687 What are the prime factors of 174444880? 2, 5, 23, 113, 839 List the prime factors of 42908713. 263, 163151 List the prime factors of 605987644. 2, 17, 8911583 What are the prime factors of 641708134? 2, 149, 601, 3583 List the prime factors of 1348259417. 271, 4975127 List the prime factors of 469433150. 2, 5, 29, 43, 7529 What are the prime factors of 115864373? 67, 179, 9661 List the prime factors of 5569167483. 3, 11, 659, 85363 What are the prime factors of 16511048? 2, 2063881 What are the prime factors of 10602612? 2, 3, 311, 947 What are the prime factors of 529056047? 13, 43, 461, 2053 What are the prime factors of 7076040? 2, 3, 5, 58967 What are the prime factors of 113947858? 2, 56973929 List the prime factors of 62131297. 62131297 What are the prime factors of 891263749? 547, 1629367 List the prime factors of 49495101. 3, 16498367 What are the prime factors of 1010476461? 3, 599, 562313 What are the prime factors of 6612327? 3, 244901 What are the prime factors of 1820891368? 2, 227611421 List the prime factors of 63825127. 79, 97, 8329 List the prime factors of 11314272. 2, 3, 19, 6203 What are the prime factors of 2718030722? 2, 11, 123546851 What are the prime factors of 929247725? 5, 7, 19, 23, 29, 419 List the prime factors of 11885936. 2, 571, 1301 List the prime factors of 1460409262. 2, 13, 1831, 30677 What are the prime factors of 98706925? 5, 3948277 List the prime factors of 145385302. 2, 19, 449, 8521 List the prime factors of 373177997. 131, 2848687 List the prime factors of 3820631317. 59, 64756463 What are the prime factors of 384566036? 2, 31, 3101339 List the prime factors of 912042716. 2, 13, 2729, 6427 List the prime factors of 39092965. 5, 1453, 5381 What are the prime factors of 66380056? 2, 1931, 4297 What are the prime factors of 4368853836? 2, 3, 43, 521, 5417 What are the prime factors of 3722742389? 439, 8480051 List the prime factors of 6623612554. 2, 13, 103, 2473343 List the prime factors of 43932549. 3, 31, 472393 List the prime factors of 57715770. 2, 3, 5, 7, 274837 What are the prime factors of 3312323780? 2, 5, 165616189 What are the prime factors of 758806807? 11, 2659, 25943 What are the prime factors of 114504280? 2, 5, 11, 197, 1321 List the prime factors of 344763953. 239, 1442527 What are the prime factors of 2604992534? 2, 2399, 542933 List the prime fact	{ "pile_set_name": "DM Mathematics" }
d give i. -258 Rearrange -3 + 867o - 868o + 81 + 3o2 - 4o*2 to the form fo + lo2 + a and give a. 78 Rearrange 2t*2 + 0 + 1 + 0t*2 + (t + t - 4t)(-t + 0t + 3t) + 3t - 3t + 3t*2 + 2t*2 + 6t*2 + 5t*2 to ct + l + ft2 and give l. 1 Express (-h2 + 0h*2 - 3h*2 + (-1 + 2h*2 + 1)(-3 + 0 + 1) + 26h - 26h - 15h2)(-3 + 5 + 1) in the form a + kh + wh*2 and give w. -69 Express (28x*2 + 11 + 11 - 21)(-15x + 0x + 5x) in the form m + dx + nx3 + fx*2 and give n. -280 Express (0j*2 + 2j*2 + 2j*2)((-5 + 1 + 2)(-3j + 4j + j) - 2 + 2j + 2)(2j + j - j - 2) in the form pj2 + ij*3 + aj*4 + k + qj and give a. -16 Express (-5o2 + 29o - 29o)(3o + 0o - 4o)(-4o + 5o + 0o)(-1 + 2 - 3) as io + fo*4 + uo*2 + co*3 + s and give f. -10 Express (5m + m - m)(4m + 0 + 0) + (-2m + 2m - 2m2)(-1 + 1 + 1)(-2 + 1 - 2) in the form xm*2 + z + km and give k. 0 Rearrange 144j - 74j - 70j - j2 - 140 to gj*2 + w + sj and give g. -1 Rearrange (-92 - 2367s + 1181s + 1183s)(-2s2 + 6s*2 - 2s*2) to qs + ds2 + as*3 + o and give a. -6 Express j - 2j + 6j + 0j - 173 - 3j as f + zj and give z. 2 Express 6a - 168 + 168 + 3a as da + z and give z. 0 Rearrange 450d + 91 + 83 - 174 to c + sd and give s. 450 Rearrange -2q*3 - 61q - 220q - 1 + 37q - 48q + 2 to sq*2 + wq + uq3 + o and give u. -2 Express (-y - 3y + 2y)(3y - 3y - y)(17y - 41y + 14y) as gy3 + wy + uy2 + d and give g. -20 Rearrange -27 + 14w + 0w3 - w + 6w*4 + 0w*3 - 11w to qw + vw*4 + gw*3 + hw*2 + s and give s. -27 Rearrange (-2 - 1 + 1)(127o3 + 70o*2 - 70o*2) to the form wo*3 + ro + lo2 + g and give w. -254 Rearrange 4n + 13n - 1 + 9 - 3n - 4n to the form cn + s and give c. 10 Rearrange (2g2 - 2g*2 - 3g*2)(-264 + 37 - 1) to hg2 + xg + u and give h. 684 Rearrange -i*3 - 13i*3 + 2i + 5i3 + 3 - 46 + 6i*3 + 2i*2 to q + hi*2 + fi + bi3 and give q. -43 Rearrange (0w*3 - 3w*3 + 4w*3)(-6w + 0w + 3w) - w4 + 0 + 0 + 7458 - 7458 + 6w - 2w4 to the form lw*2 + xw*4 + t + mw*3 + gw and give x. -6 Express 20z - 4 + 18z - 7z4 + 2 - 37z as jz + vz*3 + n + pz*4 + hz*2 and give j. 1 Rearrange -3 + 1 + 3 - 1 + 147u to vu + q and give v. 147 Express n2 + n3 + n4 + 76n + 96n - 201n in the form xn2 + m + gn + on4 + yn*3 and give m. 0 Express -15 + 50i*3 - 52i*3 - 46 in the form vi + p + zi3 + wi*2 and give p. -61 Rearrange (1 + 5 - 5)(-3c3 + c3 + 3c*3)(279 - 22 + 2) to pc2 + dc*3 + s + ac and give d. 259 Rearrange -9j + 2j*3 + 17j + 18j - 26j*4 + 28j*4 to the form gj*3 + cj*4 + h + zj + kj2 and give c. 2 Express (11 + 12 + 15 + 35)(p*4 + 0 + 0) as ip*2 + np*4 + qp + dp3 + c and give n. 73 Express (-3d*2 + 2d*2 + 0d*2)(2d - 2 + 2)(2 - 1 - 2)(0 + 2 - 1)(80 + 66 - 36) in the form l + ad3 + ud*2 + kd and give a. 220 Express (5i2 + 6i2 + i2)(4 - 6 - 1)(2i + 16 - 16) in the form m + qi*3 + ni + bi2 and give q. -72 Express (218p - 15p2 - 218p)(-p2 - 2p + 2p) as y + mp*2 + cp*4 + kp*3 + sp and give c. 15 Rearrange (3 - 3 - f + (6 - 3 - 2)(f + 0f + f) - 4f - 16f - 21f)(-2f + 2f - f) to g + kf + lf*2 and give l. 40 Express 6a*4 - 8a*4 + 3a + 3a4 + a - 1 + 9a*2 as sa*3 + xa*4 + wa + z + oa2 and give z. -1 Rearrange -21y + 1 + 4y + 16y + 1 + 2 to qy + o and give q. -1 Express 7 - c + 13 - 50 - 36 as ac + x and give x. -66 Express (4z - 5z - 7z)((2z3 + z - z)(2 + 6 - 5) + z3 - z3 + 2z3) as yz*3 + xz*2 + lz + tz4 + j and give t. -64 Rearrange 61 + 3p*2 - 5p2 - 70 + p3 to the form c + hp3 + mp*2 + op and give m. -2 Express 182v - 54v - 476v - 417v as sv + d and give s. -765 Rearrange (-9 - 11 + 1)(-8l3 + 5l*3 + 12l3) + l3 + 0l + 0l + (-2l2 + l2 + 2l*2)(-5 + 5 + l) to ul + bl*3 + nl*2 + i and give i. 0 Express (-1 - 1 - 1)((2 + 5 - 4)(14c + c + 0c) + (-4 + 4 + 2)(c - 3c + 0c)) in the form v + xc and give x. -123 Rearrange -676j*3 + 154j*2 + j - 15j*2 - 139j*2 to t + nj*2 + xj + hj3 and give h. -676 Express (-26p - 202p - 29p)(6p + 0p - 4p) as x + np2 + ap and give n. -514 Rearrange 0 + 0 + 20745h - 21032h to m + ph and give p. -287 Rearrange -v2 + 35v*2 - 3v*2 to the form kv + i + sv2 and give s. 31 Rearrange 3l*3 - 3l*2 + 7l*3 + 1 + 4l + 19l4 + 0l*2 - 10l*3 to the form ol*2 + i + ml*3 + zl*4 + wl and give z. 19 Express (7 - 6 - m + 3m)(-6m2 + 4m*2 - 3m*2) in the form qm + o + nm2 + gm*3 and give g. -10 Rearrange ((0 + 13 + 8)(-3 + 5 - 1) + 1 - 5 + 3)(0 + 0 - 3g)(-2 + 2g + 2)(3g2 - g2 + g*2) to kg*3 + lg*4 + a + vg + og2 and give l. -360 Express 338 + 36y - 337 + y*2 + 4y*3 - 6y*3 as q + dy*2 + zy*3 + ry and give r. 36 Rearrange (194 - 388 - 63u + 192)(-2 + 3 - 3) to the form v + xu and give v. 4 Express -58h2 - h3 - 63h2 - 37h + 120h2 as wh + dh2 + oh*3 + v and give d. -1 Rearrange 20s - 7 + 12s4 - s - 17s + s*3 to p + zs*2 + ds*3 + rs*4 + as and give a. 2 Express 3564d - 3564d - 2d2 - 1 - 9d*3 as kd*3 + v + sd + yd2 and give y. -2 Rearrange z - 690 - 2z + 125 to fz + y and give f. -1 Rearrange 72c*2 - 15379 + 15379 - 2c2 + c - c + c2 - c + c + (-c + 0c - c)(-c - 5c + 4c) to the form yc2 + dc + p and give y. 75 Express 101k - 55k + 116k as qk + c and give q. 162 Express 0i + 0i + 2i + (0 + i + 0)(-1 + 1 + 1) + 0i - 2i + 5i - 2128 + 2128 + 56i in the form ai + m and give a. 62 Rearrange -65k*3 + 13k*3 - 45k*3 - 96k*3 + 39k*3 + (2k - 2k - k)(9 - 9 + 4k2) to the form f + qk*3 + yk*2 + wk and give q. -158 Express -8a2 - 2a*4 + 6a*3 - 2a + 22a2 + 5a*3 - 6a*3 in the form oa*3 + ba*2 + ua*4 + za + y and give o. 5 Rearrange 31 + 6b - 9b - 4b + 15b - 2b to the form ib + y and give i. 6 Rearrange (-3k4 + 5k*4 - 17k*4)(1 - 1 - 2) - 2k4 + 10 - 10 - 2k*3 + 2k3 + k4 to the form ck + z + wk*4 + vk*3 + nk*2 and give w. 29 Express (4o*2 - 2o2 + o2)(8o - 17o + 10o + 104)(1 - 2 + 2) in the form z + so*3 + wo + po2 and give w. 0 Rearrange -a - 9a*2 - 2 + 52a*3 - 41a*2 - 54a*3 to the form ra + h + pa3 + ua*2 and give h. -2 Express 0c + c - 2 + 2c3 + 10c*2 + 2c*4 - 5c*2 as h + yc + kc3 + zc*4 + wc*2 and give z. 2 Express (0 + 2f + 0)(0f*2 - 6f2 + f2) + 2f3 - f3 - 2f*3 + 4f*3 + 2f*3 - 8f*3 in the form yf + p + wf3 + if*2 and give w. -13 Express 0d*2 + 2d*2 + 816 - 815 - 775d in the form i + zd + od*2 and give o. 2 Express 3s - 3 - 3797s3 - 6s*2 + 3800s*3 + 0 as z + bs*3 + js*2 + fs and give b. 3 Rearrange -24349 + 24349 - 6r + 75r to or + l and give o. 69 Rearrange (2i + 13 - 13)(1 - 6 + 4) + (-25i + 28i + 16i)(3 - 5 + 5) to x + bi and give b. 55 Express 71m - 2m4 + 2 - m3 + m*2 - 19m - 19m as um + w + km2 + am*4 + im*3 and give k. 1 Rearrange 647g - 330g - 548 - 316g to pg + i and give p. 1 Express -s4 + 67s*3 + 66s*3 - 16s - 131s3 in the form j + is*3 + os*4 + xs + ts2 and give x. -16 Express 5 - 5 - a + (2 - 1 - 2)(7a - a - 2a)(27 + 52 - 19) in the form ma + f and give m. -241 Express ((2 + 0 - 4)(5f + 17f + 7f) + 0f + f + 0f)(0 - 2 + 1)(1 + 3 - 2) as jf + x and give x. 0 Express (1 + 1 - 1)(-2 + 2 + 2a) + 0 + a + 0 + 2a - 5a - 8a + 10 in the form u + ka and give u. 10 Rearrange (-43 - 894 - 511 + 111 - 25)(2m3 - 3m*3 + 2m*3) to hm*2 + om + am3 + c and give a. -1362 Express 8b*4 + 5b + b*2 + 8b*4 - 25b*4 + 13b*4 as ob*2 + pb + nb4 + cb*3 + a and give o. 1 Express -c + 2c3 + 11 - c3 + c*2 - 2 as sc + f + wc2 + pc*3 and give w. 1 Express 2 + 2 - 3 - 3 - 88f in the form jf + b and give b. -2 Rearrange (-141k*2 + 141k*2 + 15k*3)(23k - 12 - 61k + 36k) to the form xk*2 + wk*4 + j + yk + dk3 and give d. -180 Express 12d	{ "pile_set_name": "DM Mathematics" }
reasing order. -3, 2/9, 3/4, 4 Sort 2/11, 5/6, 106/7 in ascending order. 2/11, 5/6, 106/7 Put 152, 10, -5, 3 in increasing order. -5, 3, 10, 152 Sort 4, 64, -3, -2 in increasing order. -3, -2, 4, 64 Sort -4, 3, 0.4, -2.6. -4, -2.6, 0.4, 3 Put -1, 1, -313 in ascending order. -313, -1, 1 Put 9, -1/3, -0.1, -1 in decreasing order. 9, -0.1, -1/3, -1 Sort -5, 2, 40 in decreasing order. 40, 2, -5 Sort 1/4, 98, -1 in descending order. 98, 1/4, -1 Sort 4, 170, 2/5 in descending order. 170, 4, 2/5 Put -1, -185, 4 in ascending order. -185, -1, 4 Put 283, -4, -1 in decreasing order. 283, -1, -4 Put 22, -12, 0.4 in increasing order. -12, 0.4, 22 Sort 5, -70/29, -1 in increasing order. -70/29, -1, 5 Sort -2, 377, 1 in descending order. 377, 1, -2 Sort 2738, -1, 0 in descending order. 2738, 0, -1 Sort 4, -19, -5, 1, 2 in increasing order. -19, -5, 1, 2, 4 Put 4, 0.2, -2, -0.5, 4.7 in ascending order. -2, -0.5, 0.2, 4, 4.7 Sort -2.3, -0.3, -10, 0. -10, -2.3, -0.3, 0 Put -10, -0.39, -14, 1 in increasing order. -14, -10, -0.39, 1 Put 15, 5, -5, -0.02, -1 in decreasing order. 15, 5, -0.02, -1, -5 Put 4, 0, 1, 5, -2 in descending order. 5, 4, 1, 0, -2 Sort 2, -3, 35. -3, 2, 35 Put -25, -4, -5 in descending order. -4, -5, -25 Sort 3/8, 3, 1/4, -5 in decreasing order. 3, 3/8, 1/4, -5 Put -27, -20, 3, -1 in descending order. 3, -1, -20, -27 Sort -2/179, -3, -13. -13, -3, -2/179 Sort 0.5, 1/3, -0.7, -6 in decreasing order. 0.5, 1/3, -0.7, -6 Put -2, 3, -3, -1 in decreasing order. 3, -1, -2, -3 Put 0, -1/4, -4/5 in descending order. 0, -1/4, -4/5 Sort 1/2, -19, -0.3. -19, -0.3, 1/2 Sort -3/4, -2/55, 1/5, -5 in increasing order. -5, -3/4, -2/55, 1/5 Put 3, 0.777, 0.3 in increasing order. 0.3, 0.777, 3 Put 4, 27, -2, 1, -4 in decreasing order. 27, 4, 1, -2, -4 Put -1, 65, -0.03 in ascending order. -1, -0.03, 65 Put 0, 35, -1, -4 in decreasing order. 35, 0, -1, -4 Put 0, 33, 5, -3 in decreasing order. 33, 5, 0, -3 Sort -1, -97, -5, 3 in decreasing order. 3, -1, -5, -97 Sort -14/5, 4, 3/8 in descending order. 4, 3/8, -14/5 Put -0.13, 1/2, -4 in decreasing order. 1/2, -0.13, -4 Put -3, -5, -0.5, -0.168, 0.4 in descending order. 0.4, -0.168, -0.5, -3, -5 Sort 0, 1/39, 7. 0, 1/39, 7 Sort -11/49, 1/3, 5 in ascending order. -11/49, 1/3, 5 Sort 121, 8, 1. 1, 8, 121 Sort -2, 14, 0.06 in descending order. 14, 0.06, -2 Put 1, -1, -55 in ascending order. -55, -1, 1 Put -3, -5, 110 in increasing order. -5, -3, 110 Sort 1, -3, -1986 in decreasing order. 1, -3, -1986 Sort -2, -2/9, 3, -30, -0.4 in increasing order. -30, -2, -0.4, -2/9, 3 Sort -3/7, 338, 5 in increasing order. -3/7, 5, 338 Sort -12, -1, 0, -6 in decreasing order. 0, -1, -6, -12 Put 0, -4, 1, 4 in descending order. 4, 1, 0, -4 Sort -7, 3, 6, 0.2. -7, 0.2, 3, 6 Put 0.5, -3/8, -2/3 in increasing order. -2/3, -3/8, 0.5 Put -4, 7, 1/3, -76/9 in increasing order. -76/9, -4, 1/3, 7 Sort 43, 3, -5. -5, 3, 43 Put 0.3, -0.2, -93, 2/9 in descending order. 0.3, 2/9, -0.2, -93 Put -5, 212, -4 in decreasing order. 212, -4, -5 Sort 2/13, 2/15, 8/11 in ascending order. 2/15, 2/13, 8/11 Put 6, -0.4, 18/7 in increasing order. -0.4, 18/7, 6 Sort 33078, 1, -4 in ascending order. -4, 1, 33078 Sort 1, 0, 2/13, 8/3 in decreasing order. 8/3, 1, 2/13, 0 Put -3/4, -1/10, 1/3, 3, -0.9 in increasing order. -0.9, -3/4, -1/10, 1/3, 3 Sort 421, -7, 1 in increasing order. -7, 1, 421 Sort 1/6, -1/18, 2/9 in ascending order. -1/18, 1/6, 2/9 Sort -8.4, 1/5, 1/16, -4 in increasing order. -8.4, -4, 1/16, 1/5 Sort -0.08, 0.4, -2, -1/2 in ascending order. -2, -1/2, -0.08, 0.4 Put -0.7, -1/5, -1, -0.1 in decreasing order. -0.1, -1/5, -0.7, -1 Put -2, -3, 5, 44 in decreasing order. 44, 5, -2, -3 Sort -0.24, -4, -0.06, 0.01. -4, -0.24, -0.06, 0.01 Sort -1, -2, 46 in decreasing order. 46, -1, -2 Put -0.54, -3, 0.2, -0.4 in ascending order. -3, -0.54, -0.4, 0.2 Put 0.1, 1/26, 0 in increasing order. 0, 1/26, 0.1 Put -3/140, -5, 0.6 in increasing order. -5, -3/140, 0.6 Put 2/19, 0.5, -4, -0.46 in descending order. 0.5, 2/19, -0.46, -4 Sort 11, -5, -51. -51, -5, 11 Sort 3, -1, 14 in decreasing order. 14, 3, -1 Sort -5, 0.14, -0.6, -0.3. -5, -0.6, -0.3, 0.14 Put -0.2, 1/2, -2/23, 1/4 in descending order. 1/2, 1/4, -2/23, -0.2 Sort 0.5, -5, -2/3, 2 in decreasing order. 2, 0.5, -2/3, -5 Put 0.03, 15, -21, 0.2 in descending order. 15, 0.2, 0.03, -21 Sort 3/2, -18, -60 in descending order. 3/2, -18, -60 Put -1, 4, 34, -2 in increasing order. -2, -1, 4, 34 Put 1, -55, -4, -2 in decreasing order. 1, -2, -4, -55 Sort 4, 5, -12. -12, 4, 5 Put -22, 2/7, -1, -0.5 in decreasing order. 2/7, -0.5, -1, -22 Sort 6, -0.4, -12/5 in ascending order. -12/5, -0.4, 6 Put 2, -47, 7 in descending order. 7, 2, -47 Sort -11, 3, 4. -11, 3, 4 Put -3048, 4, 0, -2 in increasing order. -3048, -2, 0, 4 Put -20, -2, 6, 3 in increasing order. -20, -2, 3, 6 Sort 4, 71, 0, 1, -3. -3, 0, 1, 4, 71 Sort -4, -3, -18 in descending order. -3, -4, -18 Put -116, 2, -2 in increasing order. -116, -2, 2 Put -128, 0.3, -2 in decreasing order. 0.3, -2, -128 Put -5, -1, -15 in decreasing order. -1, -5, -15 Put -3/2, -4, 1/2, 14.7 in descending order. 14.7, 1/2, -3/2, -4 Sort 5, -2/5, 11/5, -1 in decreasing order. 5, 11/5, -2/5, -1 Put 0, 6, 1 in ascending order. 0, 1, 6 Sort 0, -4, -2, 4 in decreasing order. 4, 0, -2, -4 Sort 5, -8, -0.381 in descending order. 5, -0.381, -8 Put -4, -0.5, 57/28, 1 in ascending order. -4, -0.5, 1, 57/28 Put -2, 12, 8, -5, -7 in decreasing order. 12, 8, -2, -5, -7 Sort -4, -225, 4, -2 in descending order. 4, -2, -4, -225 Sort 1, -5, 14. -5, 1, 14 Sort -4, -8, -13, 0 in descending order. 0, -4, -8, -13 Sort -31, 7, -3. -31, -3, 7 Put -1/8, 161, -0.02 in decreasing order. 161, -0.02, -1/8 Put -18/77, 9, 5 in decreasing order. 9, 5, -18/77 Sort -1, 2, -54, 3 in descending order. 3, 2, -1, -54 Put 3/7, 0, 7 in increasing order. 0, 3/7, 7 Sort -8, 8, -1, 0 in descending order. 8, 0, -1, -8 Sort -4, 4, -0.45 in decreasing order. 4, -0.45, -4 Put -3/2, 2/19, -3/5 in descending order. 2/19, -3/5, -3/2 Sort -8, 5, -1, 1. -8, -1, 1, 5 Sort 2, -18, -3/4 in decreasing order. 2, -3/4, -18 Put -0.05, -1, 11/14 in descending order. 11/14, -0.05, -1 Put 10, -2, 0, -5 in descending order. 10, 0, -2, -5 Put -6, -5, 0.04, -4 in increasing order. -6, -5, -4, 0.04 Sort -32, -4, -9, -3, -1. -32, -9, -4, -3, -1 Sort -6, 108, 4 in descending order. 108, 4, -6 Sort -3, -4, 171. -4, -3, 171 Sort 1/2, -4, 5/4, -2/9 in ascending order. -4, -2/9, 1/2, 5/4 Put 4/9, -0.04, -3, 0.19, 2/5 in ascending order. -3, -0.04, 0.19, 2/5, 4/9 Put -44, 18, 11 in increasing order. -44, 11, 18 Put 0.1, 2174, 4 in ascending order. 0.1, 4, 2174 Sort -1, 19, -2/17, 2/3 in descending order. 19, 2/3, -2/17, -1 Put 3, -1/2, 13/3, 1/3 in descending order. 13/3, 3, 1/3, -1/2 Sort -20, -4, 5, 4 in descending order. 5, 4, -4, -20 Put 3, 8, -4 in descending order. 8, 3, -4 Sort -2, -1, 10, -4 in ascending order. -4, -2, -1, 10 Put -15, -3, 0, 5 in descending order. 5, 0, -3, -15 Put 166, -13, -1 in ascending order. -13, -1, 166 Put 0, -4, -5, -0.0336 in increasing order. -5, -4, -0.0336, 0 Sort -5, 4, 1, 5 in decreasing order. 5, 4, 1, -5 Put 52, 205, 5 in ascending order. 5, 52, 205 Sort -3/10, -32, 2/3. -32, -3/10, 2/3 Sort -30, -6, 4, -10 in ascending order. -30, -10, -6, 4 Put 12, 0.3, 0, -7 in ascending order. -7, 0, 0.3, 12 Put 4, -1, -2, 3/14 in increasing order. -2, -1, 3/14, 4 Put 20/187, 2/9, 5, 1 in descending order. 5, 1, 2/9, 20/187 Sort 9/5, -3, 18, 2 in decreasing order. 18, 2, 9/5, -3 Sort -0.57, 1/3, -2, -2/9. -2, -0.57, -2/9, 1/3 Sort 65, 4, -5, -3 in descending order. 65, 4, -3, -5 Sort -1, -4, 5, -6 in descending order. 5, -1, -4, -6 Put 4, -1, 41 in decreasing order. 41, 4, -1 Put -16, 1, 12, 5 in decreasing order. 12, 5, 1, -16 Sort -6/19, -5/4, -4, -0.1, 0.5 in descending order. 0.5, -0.1, -6/19, -5/4, -4 Put -15, -2, 3, -5 in decreasing order. 3, -2, -5, -15 Sort 7, -2, 4. -2, 4, 7 Sort 0.3, -12, 2/13, -7 in ascending order. -12, -7, 2/13, 0.3 Sort -5, 2, 2/9, 0, 4 in increasing order. -5, 0, 2/9, 2, 4 Sort -4, -13, 14, 3 in decreasing order. 14, 3, -4, -13 Sort 2, 82, 5 in descending order. 82, 5, 2 Sort 4, -1, 8, -2 in increasing order. -2, -1, 4, 8 Sort 9, -5, 30 in decreasing order. 30, 9, -5 Sort -1, 1,	{ "pile_set_name": "DM Mathematics" }
n halves of a litre? 5500 What is 63907.78 centuries in decades? 639077.8 Convert 2.139266 years to centuries. 0.02139266 How many millilitres are there in 2/125 of a litre? 16 How many centimeters are there in 509678.8m? 50967880 How many millimeters are there in twenty-six fifths of a meter? 5200 What is 0.9814285 millilitres in litres? 0.0009814285 Convert 74295.39ng to tonnes. 0.00000000007429539 How many millilitres are there in thirteen eighths of a litre? 1625 How many hours are there in 63.850338ns? 0.000000000017736205 What is 5/4 of a microgram in nanograms? 1250 What is 9341.332l in millilitres? 9341332 How many months are there in twenty-five halves of a century? 15000 What is 1/16 of a week in minutes? 630 How many years are there in 47/4 of a millennium? 11750 Convert 0.8877787 millilitres to litres. 0.0008877787 How many micrograms are there in 32241.89t? 32241890000000000 Convert 44947.47mm to micrometers. 44947470 How many centuries are there in 98927.82 millennia? 989278.2 What is 2/15 of a week in minutes? 1344 How many months are there in 34.2884 decades? 4114.608 What is 158.792508 hours in weeks? 0.9451935 How many months are there in six fifths of a century? 1440 How many seconds are there in 768014.2 weeks? 464494988160 What is 11/2 of a litre in millilitres? 5500 What is 2/125 of a kilometer in centimeters? 1600 Convert 281481.4ug to milligrams. 281.4814 What is 37/5 of a litre in millilitres? 7400 What is 6.425768cm in millimeters? 64.25768 What is seventeen quarters of a meter in millimeters? 4250 What is 0.5849249 micrograms in milligrams? 0.0005849249 What is 8.256915 nanograms in micrograms? 0.008256915 What is 895216.2 millimeters in micrometers? 895216200 Convert 69582.9 seconds to nanoseconds. 69582900000000 What is 1/5 of a litre in millilitres? 200 How many decades are there in 90.879 centuries? 908.79 How many nanometers are there in twenty-one fifths of a micrometer? 4200 What is fourty-seven quarters of a year in months? 141 Convert 258.90468 seconds to minutes. 4.315078 How many centimeters are there in one tenth of a kilometer? 10000 Convert 42.68702 tonnes to kilograms. 42687.02 How many microseconds are there in 48/5 of a millisecond? 9600 Convert 9366.813km to micrometers. 9366813000000 What is three sevenths of a week in hours? 72 How many hours are there in 0.4140513 weeks? 69.5606184 How many decades are there in one fifth of a century? 2 What is 1/5 of a meter in centimeters? 20 What is 11/2 of a litre in millilitres? 5500 What is 0.7416743 years in millennia? 0.0007416743 What is 39739.63 weeks in nanoseconds? 24034528224000000000 How many minutes are there in 204.59307 milliseconds? 0.0034098845 How many decades are there in 18/5 of a century? 36 What is 308.2782 decades in millennia? 3.082782 What is 39395.7774 minutes in weeks? 3.90831125 Convert 2.117965m to nanometers. 2117965000 How many centimeters are there in 12/25 of a kilometer? 48000 How many months are there in 220187.5 centuries? 264225000 Convert 54286.58ms to nanoseconds. 54286580000 What is 21/5 of a microgram in nanograms? 4200 What is 889217.7 centimeters in kilometers? 8.892177 What is 27/2 of a litre in millilitres? 13500 How many millilitres are there in 512.9923 litres? 512992.3 What is 11/4 of a meter in centimeters? 275 Convert 16.301868 months to years. 1.358489 How many millilitres are there in 13/8 of a litre? 1625 How many years are there in 6/25 of a millennium? 240 How many millilitres are there in 82607.17l? 82607170 Convert 0.2855211 microseconds to nanoseconds. 285.5211 Convert 782.935ml to litres. 0.782935 How many litres are there in 9.212198ml? 0.009212198 How many months are there in 1/4 of a century? 300 How many months are there in 21/4 of a century? 6300 What is 7/2 of a milligram in micrograms? 3500 How many decades are there in 6/25 of a millennium? 24 How many millilitres are there in 6/25 of a litre? 240 How many millilitres are there in one fifth of a litre? 200 What is 9/10 of a century in months? 1080 How many millennia are there in 22.7437 years? 0.0227437 How many decades are there in 0.782613 months? 0.006521775 Convert 4735.588 years to centuries. 47.35588 How many micrometers are there in 3.404166 centimeters? 34041.66 How many nanometers are there in 3/25 of a micrometer? 120 What is 3667.563nm in millimeters? 0.003667563 What is 0.1796199 seconds in nanoseconds? 179619900 What is 2549.525 years in months? 30594.3 What is 67/3 of a minute in seconds? 1340 What is 3/32 of a millimeter in nanometers? 93750 How many centuries are there in three fifths of a millennium? 6 What is seventeen quarters of a tonne in kilograms? 4250 What is nine tenths of a kilogram in grams? 900 What is sixty-one quarters of a litre in millilitres? 15250 What is three tenths of a decade in months? 36 What is 27/2 of a kilogram in grams? 13500 What is sixty-four fifths of a tonne in kilograms? 12800 What is seven eighths of a litre in millilitres? 875 How many millimeters are there in eleven halves of a meter? 5500 How many milligrams are there in fourty-five quarters of a gram? 11250 What is 3/5 of a milligram in micrograms? 600 How many millilitres are there in 55.34961 litres? 55349.61 What is 48/5 of a litre in millilitres? 9600 How many years are there in 64/5 of a decade? 128 What is 95.67422 litres in millilitres? 95674.22 What is eleven eighths of a millennium in months? 16500 How many nanograms are there in 45546.02mg? 45546020000 Convert 2209.12t to kilograms. 2209120 What is 411530.4 decades in years? 4115304 What is 27/2 of a litre in millilitres? 13500 Convert 0.4950413 years to millennia. 0.0004950413 How many litres are there in 619.649ml? 0.619649 What is 61.20815 grams in kilograms? 0.06120815 What is five quarters of a micrometer in nanometers? 1250 Convert 8951.332 weeks to microseconds. 5413765593600000 Convert 407.3069kg to grams. 407306.9 What is 0.6124924 decades in months? 73.499088 How many seconds are there in 11/2 of a minute? 330 Convert 0.2042628 centuries to millennia. 0.02042628 How many kilometers are there in 0.0291622cm? 0.000000291622 How many centimeters are there in 949.042um? 0.0949042 What is 71.3489 centimeters in kilometers? 0.000713489 How many nanograms are there in 9/10 of a microgram? 900 How many minutes are there in 3/10 of a day? 432 What is 5/6 of a century in months? 1000 How many millennia are there in 262.8781 decades? 2.628781 How many months are there in three eighths of a millennium? 4500 How many nanoseconds are there in 3/40 of a microsecond? 75 How many minutes are there in 1/6 of a day? 240 What is 2193.9345 microseconds in hours? 0.00000060942625 How many nanograms are there in thirty-seven fifths of a microgram? 7400 What is 234352.1 nanograms in micrograms? 234.3521 What is 47689.09 days in hours? 1144538.16 Convert 7.859059 kilometers to nanometers. 7859059000000 What is 7.72336 kilometers in nanometers? 7723360000000 Convert 0.8288817 months to millennia. 0.000069073475 How many tonnes are there in 3.742967kg? 0.003742967 How many months are there in 3/32 of a millennium? 1125 How many millimeters are there in 1486.789 meters? 1486789 What is 18/5 of a litre in millilitres? 3600 How many seconds are there in 3/28 of a week? 64800 Convert 99803.27 micrograms to nanograms. 99803270 What is 57721.06l in millilitres? 57721060 What is 62.4401 millimeters in nanometers? 62440100 What is 255250.3ug in tonnes? 0.0000002552503 How many kilograms are there in fifty-two fifths of a tonne? 10400 How many minutes are there in seven eighths of a day? 1260 What is 68846.71 milligrams in kilograms? 0.06884671 Convert 606.2752 micrometers to centimeters. 0.06062752 How many weeks are there in 20.760432 hours? 0.123574 How many millilitres are there in 7772.127 litres? 7772127 How many centimeters are there in 40032.6 nanometers? 0.00400326 What is three tenths of a tonne in kilograms? 300 How many months are there in nine sixteenths of a millennium? 6750 Convert 213087.5cm to meters. 2130.875 Convert 90317.4 litres to millilitres. 90317400 How many micrograms are there in 3/10 of a milligram? 300 Convert 0.65342mg to nanograms. 653420 How many nanometers are there in 4	{ "pile_set_name": "DM Mathematics" }
ast as big as 18? False Suppose 4r = 4i + 6648, -2i - 11r - 3317 = -6r. Is -1661 at most i? True Suppose 3u + 5n = -10 - 28, 4n = -5u - 59. Let t(w) = -w3 + 28w*2 - 1. Let s be t(28). Let v be u + 2 + (s - -2). Is v smaller than -7? True Let z = 15500 + -12120. Which is greater: 3377 or z? z Let t(n) = 2n*3 - 33n*2 - 90n + 31. Let s(r) = r*3 - 17r*2 - 45r + 16. Let g(a) = -7s(a) + 3t(a). Let c be g(22). Which is greater: c or 21? 21 Let q = -50839 + 314540891/6187. Let w = 352631/86618 - q. Is 4 > w? False Let p(s) = -12 - 28s + 3s*2 + 0 - 3s*2 + 2s*2. Let z be p(15). Let i be z/8 - (3 - 1). Is i >= -1? True Let d = -75.3 - -75.856. Let x = d + 89.444. Which is smaller: x or 0.2? 0.2 Suppose -1651v + 11988 = -1669v. Is v less than -664? True Let t = 279870973/149 + -1878321. Let s = t + 70654/1937. Let c = 44 - s. Does -12 = c? False Suppose -1198 + 2710 = 109v - 1431. Which is smaller: v or -4? -4 Suppose 29f + 3j - 933 = 28f, 15 = -3j. Is -2/5 bigger than f? False Let z(o) = 10o2 - 80o - 425. Let c be z(-5). Which is smaller: 227 or c? c Let h(g) = -4g3 - 9g*2 - 46g - 217. Let m be h(-4). Which is smaller: m or -11? -11 Let f = -1.4 - -0.4. Let q = -32711 - -359813/11. Which is smaller: q or f? f Let o = -11136.608 - -11138. Is 0.3 greater than or equal to o? False Let m = -9896.98 + 9897. Is m > 1103? False Let v be 25290/(-80) - (-3)/(-48)-2. Which is greater: v or -2222/7? v Let g = 5057/42 - 779/6. Is 8 greater than g? True Let d = -24242 - -24158. Which is smaller: -5.1 or d? d Let z(r) = -31r + 214. Let i be z(7). Let o be (-35)/21 - -3 - 1178/i. Is o equal to 394? True Let m = 869 + -866. Let b be 3m + 6 + -16. Is -1/355 greater than b? True Suppose 0 = -3s + 7s. Let x = 298861 + -31978131/107. Is s less than x? False Suppose 4j + 125 + 231 = -4n, 5j + 431 = 2n. Let z = -51 - j. Let r = 34 - z. Which is bigger: 19 or r? 19 Let v = -0.02 - 0.38. Let j = v - -0.6. Let y be -3018/546/(-4). Which is greater: j or y? y Let y be (-36)/(-10) + (99/(-15) - -6). Suppose -40 = -4x - 2g, yg - 11 - 25 = -3x. Let p be 18/(-144) + (-15)/x. Is -15 greater than p? False Let k be ((-18)/(-9))/(-78)-1. Is k at least 0? True Let f be ((-78)/21)/((-52)/182). Suppose 2 = -0p + 2p, -3p + 113 = -5b. Let t = -5 - b. Is f > t? False Let u = -6893.1 - -6890. Which is smaller: -83 or u? -83 Let f be 1/(1 - -6)(-280)/(-24). Is -5 less than f? True Let q be 3729/3503 + (-4)/62. Which is greater: q or 16/1543? q Let y = -2719.09 - 15.91. Which is smaller: 0 or y? y Let z = -2 - -15. Let v = 33 - z. Let o = 2056 + -2055. Which is smaller: o or v? o Let a(d) = 0d*3 + 3d + 9 + d2 - d3 - 17. Let s be a(0). Is -8 smaller than s? False Let n(d) = -2d3 + 34d*2 - 105d + 5. Let j be n(4). Which is greater: 22/71 or j? j Suppose -5z + 4025 = -320. Let r = z - 16506/19. Is r bigger than 1? False Let f = 374.2 - -36.8. Let t = 410.055 - f. Let i = t - -0.9. Is -0.1 equal to i? False Let y(s) = -48s - 4123. Let b be y(-86). Let l = 0 - -4. Let t = l - 0. Does t = b? False Let x be 34/11942/(-102) - 30/34. Is x less than -4/377? True Let m(v) = 117v - 270. Let n(t) = 9t - 21. Let c(l) = 4m(l) - 54n(l). Let s be c(5). Are -37 and s non-equal? True Let o = -213757/2 + 104651. Suppose 55369 + 110487 = 73w. Let n = o + w. Is n greater than 44? True Let v = -53.948 + -0.052. Let g = -0.091 - -0.173. Let f = g + -0.182. Is v equal to f? False Let v(j) = 29j2 - 697j + 23. Let b be v(24). Which is greater: 16/1111 or b? 16/1111 Let f(q) = 10q2 + 13q - 3. Suppose 0 = -x + 3j - 18, -4 = 16x - 14x + 2j. Let k be f(x). Are 278 and k unequal? True Suppose -31 = 4n + 9. Let l be ((-1 - 20)/(-1) - -3)-3. Let f = l + 60. Which is smaller: f or n? f Suppose 0 = -961y + 977y - 1152. Is y less than -2? False Suppose 0 = -100v + 99v + 789. Let u = v - 2335/3. Is 12 >= u? True Let h be (-3)/(-6) - (-4)/(-8). Suppose -20k + 4 - 4 = h. Which is smaller: -24/43 or k? -24/43 Let s be -72((-9)/(-4) - 3). Suppose 116 = 5k - s. Let g be 8 - 150/(-4)(-1 + (-55)/(-33)). Is k < g? False Let o be -1 + 10 + (-6 - 651/287). Let t = 1.01 + -0.01. Is o != t? True Let u = -66.6 - -51.2. Let j = u + 17.4. Let i be (-46)/(-63) + (-4)/14. Which is bigger: i or j? j Suppose 2635f + 3v = 2633f + 6, 2v = 4f + 4. Which is greater: f or -3/80? f Suppose 12h = 9h - 138. Let m = h - -50. Let y be 21/(-3) + m + 6 + 0. Which is greater: y or -2/15? y Let a be 12 - (-2)/(-8)20. Let u be a/3003423 - 1. Let b = 1 - 2. Which is greater: b or u? u Let u = 1039 - 1091. Which is smaller: -103/2 or u? u Let y be (-9)/(-6)20/(-15). Let c(b) = b*3 - 3b*2 + b. Let z be c(2). Let t be (40/(-6) - z) + 3. Which is smaller: t or y? y Let c = -896 + 900. Let d be -10(-68)/(-312) + (6 - c). Which is greater: 0 or d? 0 Let c(d) = 8d + 73. Let i be c(-33). Let w = i - -218. Is w at least as big as 20? True Let g = 3204 - 73710/23. Let q(y) = 2y - 6y - 18 - 6 + 3y. Let k be q(-22). Is k < g? True Let i be (1 - (-6)/(-8))(-168)/(-196). Suppose -4u = -10 + 26. Let g be (0(-4)/u)/1. Which is greater: i or g? i Let z be (-3)/((-135)/(-6)) + ((-1856988)/144315 - -13). Is 0 <= z? False Let x = 22127/4 + -1305145/236. Do 0 and x have different values? True Let n be (-1)/2 - (-3)/18. Let w(t) = 41t - 47. Let u be w(-3). Is u equal to n? False Let l(f) = -f2 - f3 + 47f + 36 + 16 - 19f2 + 2. Let m be l(-22). Which is bigger: m or -93/8? -93/8 Let g(m) = m2 - 8m - 33. Let z be g(-3). Let o be (-40)/((-1)/(1/(-1))) + z. Which is smaller: -36 or o? o Let i(z) = 2z + 15. Let s be i(-4). Suppose -255 = -2w + sw. Suppose v - 153 = 4v. Is w less than v? False Let z(a) = -62a - 5708. Let b be z(-92). Is b <= -75/22? True Let t(n) = -n*2 + 51n - 488. Let y be t(37). Which is smaller: y or 31? y Let n be ((-490980)/280)/((-3)/(-6)). Which is bigger: -3510 or n? n Suppose a = 5n - 515, 6a - 3a + 5n + 1505 = 0. Let s be (2 - -2) + a/3753. Suppose 7 = -3r - 4c, -2r - 3c + 2 = -7r. Is s at most as big as r? False Let b = 24 - 48. Let x = b - -23. Let d = 0.046 + 0.234. Which is smaller: x or d? x Let w(y) = 72y - 28. Let m be w(4). Let h = 261 - m. Is h less than 7/10? False Let q(l) = -l3 - 18l*2 - 15l + 4. Let h be q(-17). Let z be (h/72)/((-30)/16). Which is smaller: z or 0.004? 0.004 Let a be 1 + (-210)/198 - (-238)/3927. Let i(h) = -h*3 - 5h*2 + 8h + 6. Let c be i(-6). Let b be 24/(-33)c/4. Which is bigger: b or a? b Let v be (-48)/(-26) - (-2)/13. Let p be ((-2)/v)/(15/(-117)). Let o = -530/3 - -176. Do p and o have the same value? False Let l = 263.43 - 266. Let j = -1.57 - l. Let n be ((-5)/(-555))/16. Does j = n? False Let o be 3/(88/(-18) - (9 - 14)). Let l be 5(-6)/5218/o. Is 0 equal to l? False Suppose -3q = -5u - 0u + 33383, 0 = -2q - 5u - 22247. Which is greater: 2/5 or q? 2/5 Suppose 2b = 449 + 1005. Let a(n) = n*2 - 3809n - 110574. Let q be a(-29). Is b < q? True Let i = 137 - 136.995. Let d = -1.975 + 2. Let p = d + i. Which is smaller: p or 2? p Let k(y) = -3y + 19. Let f(b) = -3b + 17. Let n be f(4). Let o be k(n). Suppose -oh = -3x + 11, 2 = -2h - h + x. Which is smaller: -1 or h? -1 Let c be 4/5 - 90/50. Let n be (0/c)/(-3 - -1). Suppose 5y = -ny - 35. Is y at least as big as -7? True Let c(u) = -u + 9. Let t be c(12). Let h be ((-4)/24)/(t/(-18)). Let n be (-2)/(-5) - (-6)/(-15). Which is smaller: n or h? h Let n(d) = -d3 - 296 + 282 + 2d + 2d + 4d2. Let y be n(3). Let k(s) = s2 - s - 2. Let u be k(2). Is u <= y? True Suppose b + 2g + 6 = -40, -2b = -3g + 78. Let w(j) = -18j - 6. Let v be w(-3). Let k = v + -90. Is b greater than or equal to k? True Let z = -78.095 + 78. Let t = z + -0.905. Let k be 0 - 14(-4)/88. Which is greater: k or t? k Let n be (-15 - -2773)4/14. Which is smaller: 786 or n? 786 Let y be 4/(-2) - (-2 + 1). Let f be 133/(-28)(2 + (-996)/16). Let b = f + -286. Which is bigger: b or y? b Let a be 26/39 + 74/6. Suppose 0 = -q - 3s + 16, -3s + a = -16q + 14q. Which is bigger: -1/127 or q? q Let a(z) = -z3 - 19z*2 - 33z + 18. Let p be (6/9 + -1)/((-5)/(-255)). Let w be a(p). Are -1/10 and w nonequal? True Suppose z	{ "pile_set_name": "DM Mathematics" }
-1 Suppose -10c + 666 = -16c. Is c at most -112? False Let b = -41 + 29. Let l be (1/2)/(3/b). Is l bigger than -2? False Let u = -74 + 77. Does u = 13? False Suppose 2 = -4k - 18. Let s be (2/k)/((-1)/5). Which is smaller: 3/4 or s? 3/4 Let l be (-2)/((16/(-10))/(-4)). Let a be (-3 - l) + -3 + 2. Suppose 0 = -3j - 2j. Is a greater than or equal to j? True Let i = 18 + -16. Let v(g) = 4g*3 - 4g*2 - g. Let s(p) = -3p*3 + 3p*2 + p. Let n(k) = 3s(k) + 2v(k). Let h be n(-1). Are h and i unequal? True Let c = -17.66 + -0.34. Let f = c - -17.94. Does 0 = f? False Suppose 6q - 5q + 4 = 0. Let w be 21/3q/(-14). Is 1 <= w? True Let r(d) = -d*3 + d + 1. Let t be r(0). Let z = 22.15 + -22. Let v = z + -0.15. Are v and t equal? False Let h be (4 - 87/18)2. Do -3 and h have the same value? False Let w(m) = -m*2 - 6m + 2. Let g be w(-5). Which is greater: g or 1? g Let u be (-6 - (-17)/3) + 22/39. Which is smaller: 1/3 or u? u Let s(z) = -5z + 5. Let o be s(3). Which is bigger: -11 or o? o Let a(v) = -v + 9. Let y be a(7). Suppose yh = -h. Is h smaller than -2/5? False Let k = -5 + 14. Let s be 6/(-4)(-6)/k. Which is smaller: 2/23 or s? 2/23 Let b(h) = h3 + 5h*2 + 5h + 3. Let a be b(-4). Which is greater: a or -1/12? -1/12 Let n be (4/(-222))/(-4(-7)/(-42)). Is n at least as big as 0? True Suppose 2t + 12 = -3t + a, -a = -4t - 10. Suppose -5p = -2p + 9. Let j = p + 0. Which is bigger: j or t? t Let v be 0/(2/(-1)) - 11. Let j = v + 8. Suppose 0c + 6 = -3c. Is c <= j? False Let i = 0.2 - 1. Let l = -1 - i. Let n = -0.38 + 0.08. Which is bigger: n or l? l Let o = 132/13 + -1002/91. Which is smaller: o or -1? -1 Let g = 4.553 + 0.047. Let y = g + -5. Let h = y + 2.4. Which is smaller: 1/3 or h? 1/3 Let g be (-4)/(-8) + (-1)/2. Let a = 1/76 - -449/532. Is g at most as big as a? True Let t = -10/697 + 3/41. Which is bigger: t or -1? t Suppose 3o + o + 4 = 0. Let y be -1 - -2(0 + o). Let s = -4 - y. Which is smaller: 2/23 or s? s Suppose 0t - 3t - 24 = 3h, 4 = 3h - 4t. Let i be h/22 - (-2)/(-110). Suppose 3y - 3 = 0, 5g + 2y = -0 - 3. Are i and g nonequal? True Let d(z) = z + 11. Let g be d(-10). Suppose 5r = -4m - 13, -3m = -2r - r - 24. Let x = m + -2. Is g > x? False Let p = -31 + 31. Is p smaller than -2/15? False Suppose 0 = -2d + 4, d = -5t - 4d + 35. Suppose -3m - m + 16 = 0. Is t <= m? False Suppose -39w + 40w - 2 = 0. Is 1 greater than w? False Suppose 2z = -3z + 5. Let j = 31537/54 + -584. Which is greater: j or z? z Let m be 0 - 1/(-3)0. Let j(c) = c2 - c + 1. Let n be j(0). Is m greater than n? False Let n = 39 - 23. Suppose -5u + n = 5v + 1, -3v = -2u - 14. Does u = 0? False Let b be (1 - 1)/3 - -1. Let k be b - 0/(-1 + 5). Which is smaller: 1/4 or k? 1/4 Let h = -8 + 12. Suppose -ha + a - 9 = 0. Suppose -5c - 14 = 4o - o, -3c - 18 = 5o. Is o < a? False Suppose -4 + 4 = t. Are -1/42 and t nonequal? True Let a be 1 + (2 - 1)-1. Suppose a = 4x - 1 - 15. Suppose -3 = -xm - 7. Which is greater: -2 or m? m Let q = -14 - -22. Let n = -6 + q. Let k be 0/n(3 + -2). Is k less than or equal to 0? True Let u = -14 + 25. Let l = 11 - u. Let q = 3 + -4. Which is bigger: l or q? l Let y = -2 + 6. Suppose 3w = yw + 1. Do -4 and w have the same value? False Let k = 28 - -80. Let s = 104.98 - k. Let m = s - -0.02. Which is bigger: 1 or m? 1 Let m = 60.2 - 60. Is 0.2 at most m? True Let t = -9 + -6. Is t less than -16? False Suppose 0 = -7m + 8m - 1. Which is greater: m or 1/150? m Let h(v) = 5v2 - v. Suppose 0a + 22 = -3n - 4a, 5n + 6 = a. Let y = n + 3. Let s be h(y). Is 2 < s? True Suppose -4y - 3n - 2n = 8, -2 = y - n. Let w be 2 - y/((-16)/14). Which is greater: -1 or w? w Suppose -3z - 5 = 2z. Let g = z - 4. Suppose 3n + 30 = -3n. Is g <= n? True Suppose -3 = -b + 6. Suppose -2z = -1 - b. Is 5 < z? False Let w = -0.1 + 0.1. Suppose -5c + 32 = -c + 4k, 5c = 4k + 49. Let p = -10 + c. Which is smaller: w or p? p Suppose 5n + 5k = 5, -4n - 1 = 3k - 6. Suppose -g + 4 = -3g. Which is greater: n or g? n Let l = -0.6 + -7.4. Let a = 8.1 + l. Let r = 0 + a. Which is greater: r or -0.2? r Let i(w) be the first derivative of 3w4/2 - 2w3/3 + w2/2 - 2. Let l be i(1). Let q be -6 + l - (2 - 0). Is -2 bigger than q? True Let z be 6/(-14)(-42)/(-24). Suppose 2 = -0f - f. Let s be f/(2 - 1 - -1). Are z and s equal? False Let b = 1.84 + -2. Let h = 0.06 - 0.1. Let j = h + b. Which is smaller: j or -0.1? j Suppose -r = 2r. Is r less than or equal to 2/25? True Let z = -8 + 12. Let x = z - 7. Let c = -6 - x. Which is smaller: c or -0.1? c Let k be 3/(-12) + (-33)/44. Which is greater: k or 2/9? 2/9 Let p be (2 - (-79)/(-11)) + 2/11. Is -1/3 at least p? True Let u = 4.9 - 34.9. Let v = u - -29.7. Let b = -2.9 - -3. Which is bigger: b or v? b Let s be ((-2)/(-132))/(524/18996). Let n = s - 1/262. Suppose 2r - 2 = r. Which is smaller: r or n? n Let j be ((-3)/(-2))/(18/(-6)). Let u(p) = 5p2 - 37p + 28. Let r(i) = -i*2 + 9i - 7. Let v(l) = -9r(l) - 2u(l). Let h be v(-8). Does j = h? False Let t = 10.1 + -7. Let x = t - 1.1. Which is bigger: 0.1 or x? x Let i(d) = -d - 1. Let w be i(-2). Let p be (-2w/6)/(-1). Is p <= -2/7? False Let d = 3 + -9. Let k be d/(-18) - 8/15. Is k at least as big as -1? True Let f = 0.3 + 0.2. Let z be (0/(-1))/(-5 + 3). Which is smaller: z or f? z Let o = -8 - -6. Let h be (-2 - 2) + 2 + 60/25. Which is smaller: h or o? o Let o = 1.8 - 8.8. Is 1/3 less than o? False Let q(s) be the third derivative of s5/60 + 7s4/24 + s3 + 4s2. Let t be q(-5). Which is greater: -3 or t? -3 Let p be ((-2)/4)/(2/(-96)). Suppose -p = -5m - 9. Suppose -4s + 5 = -5f - 4, -7 = mf - 4s. Is f at most -1/8? True Let j be 5/75 + (-2)/(-6). Let w be (4 - (-6)/(-2))/(-1). Which is greater: w or j? j Let d = -3 + 5. Suppose -4 = -dz - 2z. Which is smaller: 0 or z? 0 Suppose 0 = 3c - c - 6. Suppose 5m = -7 - c. Suppose -2i - 8 - 13 = 5f, -4f = -3i + 3. Is i not equal to m? True Suppose 4y = -2v, 9 = -5y + 2y + 3v. Is -2/19 less than y? False Let b be 17 + -11 + -1. Suppose 6 = 4o + 46. Let x = o + b. Are 5 and x non-equal? False Let l = 0 + -1. Let k be (4/7)/((-1290)/(-105)). Which is greater: l or k? k Let k = -42 - -43. Let m be ((-9)/24)/(1 + 0). Which is bigger: m or k? k Let i(g) = -g3 - 3g*2 + 4g + 5. Let p be i(-4). Let x be (15/(-6))/(p/(-4)). Is x less than 12/7? False Let j be (-1)/(-3) - 14366/78. Let l = j + 184. Do 1 and l have the same value? False Suppose -2q + 3k = -3, k - 2 = 1. Is q smaller than 8? True Let q = 83 - 22. Let f be q/4 + (-2)/8. Let a = f - 11. Is a at least as big as 5? False Let u = 170 + -1532/9. Suppose -2s = -5j - 23, 2j - 13 = -2s + 5j. Is u bigger than s? True Let f = -3 + 3. Suppose 0 = -5g - 5 - f. Does -1/2 = g? False Let n be 5/(5/4)1. Let r = -3/14 - 1/28. Which is bigger: n or r? n Let z be (-3)/(2/(8/(-30))). Let t = -0.2 - -0.23. Let y = -0.33 + t. Are y and z equal? False Let k = -31 - -12. Let s = 21.2 + k. Let o = 0.2 - s. Which is greater: -1 or o? -1 Let d be -2 - (15/(-24) + -2). Which is smaller: 2 or d? d Let p = -1.6 + -4.4. Let k = -103.1 + 103. Which is bigger: p or k? k Let v(p) = p2 - p + 11. Let z be v(0). Is z bigger than 11? False Let f = -2 + 25. Which is smaller: 22 or f? 22 Let n = -5/68404038556 + -360863324150738/2880298623483. Let a = n - -5/4716. Let r = 125 + a. Which is smaller: 0.1 or r? r Suppose -10 = b + 4b. Let y(r) = r*3 - 4r2 + r + 4. Let s be y(3). Is b equal to s? True Let n(v) = -v3 - 4v2 - v - 4. Let r be n(-4). Suppose r = 3s - 0s. Is s at most -3/4? False Let p = -175782/5 + 865087/25. Let m = 553 + p. Which is smaller: -1 or m? -1 Let l be 1 + 0 + -2 + 0. Let f = -0.9441 - 0.0559. Is f at least as big as l? True Let p = -2 + 4. Let v be (12/(-8))/(1/p). Let d = 4 + v. Which is smaller: 0 or d? 0 Let x be 2 + -2 - (6 + -3). Let b be (x - 0)/(6/4). Which is bigger: -3 or b? b Let i = -2.95 - 0.05. Let o = -5 - i. Which is smaller: o or 0.4? o Let t = 65.7 + -66. Is -2 less than t? True Suppose h + 2 = 3. Let u be (-3)/2(-1)/(-9). Which is bigger: h or u? h Let l = -3 + 3. Let s(j) = -j - 4. Let i be s(l). Is i at least	{ "pile_set_name": "DM Mathematics" }
icked without replacement from {h: 1, f: 7, w: 1, s: 10}. Give prob of sequence hfw. 7/5814 Three letters picked without replacement from {u: 2, e: 1, w: 1, z: 1, r: 5}. Give prob of sequence zer. 1/144 Three letters picked without replacement from {b: 3, m: 3}. Give prob of sequence bmm. 3/20 Calculate prob of sequence eb when two letters picked without replacement from {i: 2, u: 1, b: 1, s: 1, e: 1, n: 2}. 1/56 Two letters picked without replacement from {t: 1, r: 1, v: 1, e: 1, k: 1}. What is prob of sequence ev? 1/20 Two letters picked without replacement from {b: 1, a: 1, j: 1, z: 1, h: 1}. What is prob of sequence zj? 1/20 Three letters picked without replacement from liliihiiilhlflihil. What is prob of sequence hfi? 1/204 Four letters picked without replacement from {e: 1, b: 1, n: 3, z: 1, l: 1}. Give prob of sequence nzbe. 1/280 Two letters picked without replacement from {h: 4, f: 1, w: 1, d: 2, u: 1}. What is prob of sequence ud? 1/36 What is prob of sequence uljl when four letters picked without replacement from {l: 4, u: 1, j: 5, g: 3}? 1/286 Calculate prob of sequence ij when two letters picked without replacement from {j: 4, i: 5, c: 2}. 2/11 Two letters picked without replacement from ippip. What is prob of sequence ip? 3/10 What is prob of sequence jj when two letters picked without replacement from tjttjjjjtjjt? 7/22 Two letters picked without replacement from {k: 2, b: 3, o: 2, l: 5}. Give prob of sequence bl. 5/44 What is prob of sequence jj when two letters picked without replacement from {o: 3, j: 2, z: 1, m: 2, q: 3, k: 1}? 1/66 Calculate prob of sequence rq when two letters picked without replacement from {r: 2, q: 7}. 7/36 Calculate prob of sequence gq when two letters picked without replacement from {q: 1, g: 1, y: 1, b: 2}. 1/20 Four letters picked without replacement from gwwgzwwkwkwgwk. Give prob of sequence zkwk. 1/572 Four letters picked without replacement from {h: 3, c: 1, u: 3}. Give prob of sequence uhcu. 3/140 Four letters picked without replacement from {m: 5, h: 3}. Give prob of sequence hhmm. 1/14 Three letters picked without replacement from kkktxkx. Give prob of sequence kxk. 4/35 Three letters picked without replacement from {a: 1, w: 6, k: 3, c: 1, b: 1}. Give prob of sequence kbw. 3/220 What is prob of sequence cefo when four letters picked without replacement from {x: 1, c: 1, f: 1, e: 1, o: 2, q: 2}? 1/840 Three letters picked without replacement from hesgd. What is prob of sequence ghd? 1/60 Two letters picked without replacement from {m: 1, x: 6, w: 7}. Give prob of sequence mw. 1/26 Calculate prob of sequence eq when two letters picked without replacement from {e: 1, f: 1, p: 1, q: 1, u: 1}. 1/20 Calculate prob of sequence czep when four letters picked without replacement from {e: 2, c: 3, s: 3, x: 1, p: 1, z: 2}. 1/990 Two letters picked without replacement from yyygygxyktyskyysysy. Give prob of sequence ty. 5/171 Two letters picked without replacement from ybxbhbe. What is prob of sequence ex? 1/42 Two letters picked without replacement from {c: 3, y: 2, i: 1, b: 7, l: 3, o: 1}. Give prob of sequence bo. 7/272 Three letters picked without replacement from {f: 2, q: 1, r: 2, z: 1, k: 1}. Give prob of sequence kzq. 1/210 Four letters picked without replacement from {r: 1, m: 1, a: 7, v: 8, e: 2, n: 1}. What is prob of sequence veev? 14/14535 Three letters picked without replacement from {f: 3, k: 6, u: 1, s: 5, q: 3, j: 1}. Give prob of sequence ffj. 1/969 Calculate prob of sequence yzh when three letters picked without replacement from {h: 1, y: 1, z: 1}. 1/6 Three letters picked without replacement from {f: 1, u: 1, h: 1, n: 1, c: 1}. What is prob of sequence hcf? 1/60 Calculate prob of sequence rqs when three letters picked without replacement from {s: 1, d: 1, c: 1, q: 2, r: 2, i: 1}. 1/84 What is prob of sequence jjjm when four letters picked without replacement from {y: 5, s: 1, t: 1, f: 2, m: 1, j: 3}? 1/2860 Two letters picked without replacement from {k: 1, b: 5, n: 9, s: 5}. Give prob of sequence bs. 5/76 Two letters picked without replacement from bzlbuvu. Give prob of sequence ub. 2/21 Calculate prob of sequence gggm when four letters picked without replacement from {g: 4, y: 1, m: 8, l: 5}. 2/765 Four letters picked without replacement from {s: 12, k: 1, g: 5}. What is prob of sequence ssss? 11/68 Calculate prob of sequence ehvp when four letters picked without replacement from heuvcpuvppv. 1/880 Calculate prob of sequence vuua when four letters picked without replacement from vvvua. 0 Three letters picked without replacement from {f: 8, q: 2, e: 1, m: 1, l: 3, k: 1}. Give prob of sequence fll. 1/70 Four letters picked without replacement from {t: 12, y: 1, c: 3}. What is prob of sequence tctt? 33/364 Calculate prob of sequence vmev when four letters picked without replacement from {v: 2, s: 3, e: 1, m: 4}. 1/630 Two letters picked without replacement from {t: 2, m: 6, j: 9}. Give prob of sequence jj. 9/34 Calculate prob of sequence nlnf when four letters picked without replacement from {l: 2, f: 1, z: 3, n: 4}. 1/210 Two letters picked without replacement from {m: 1, b: 1, z: 1}. Give prob of sequence bm. 1/6 Calculate prob of sequence rg when two letters picked without replacement from {w: 3, s: 2, r: 2, g: 5}. 5/66 Three letters picked without replacement from rreezrzgeezeez. Give prob of sequence zgr. 1/182 Calculate prob of sequence kk when two letters picked without replacement from bbzirkzbzrbbbi. 0 Three letters picked without replacement from {n: 13, d: 5}. Give prob of sequence nnd. 65/408 Calculate prob of sequence fxo when three letters picked without replacement from {x: 1, i: 2, t: 5, f: 3, o: 1}. 1/440 Calculate prob of sequence axj when three letters picked without replacement from {y: 4, j: 3, a: 4, x: 6, e: 2, d: 1}. 1/95 Calculate prob of sequence zp when two letters picked without replacement from pjjsz. 1/20 Calculate prob of sequence jzp when three letters picked without replacement from {w: 2, z: 1, p: 2, j: 4, l: 1}. 1/90 Calculate prob of sequence ul when two letters picked without replacement from hdhhhulyudydydll. 1/40 Calculate prob of sequence rr when two letters picked without replacement from {r: 6, x: 12}. 5/51 Two letters picked without replacement from hrhhfrbfhf. Give prob of sequence rr. 1/45 Two letters picked without replacement from {p: 5, h: 1, i: 4, q: 1, v: 1}. What is prob of sequence hi? 1/33 What is prob of sequence uuc when three letters picked without replacement from {u: 4, p: 6, c: 5}? 2/91 Calculate prob of sequence dmu when three letters picked without replacement from {u: 2, j: 1, m: 2, c: 1, d: 4}. 1/45 Two letters picked without replacement from repnpeprppreupsenss. Give prob of sequence su. 1/114 Three letters picked without replacement from {d: 1, e: 1, i: 2, a: 5}. What is prob of sequence eia? 5/252 What is prob of sequence eeg when three letters picked without replacement from seeeegstsseesees? 1/60 Four letters picked without replacement from {g: 1, j: 4, r: 1, t: 1, u: 5}. Give prob of sequence tjuj. 1/198 Two letters picked without replacement from {v: 6, u: 3, c: 1, g: 2, m: 7}. Give prob of sequence uu. 1/57 Two letters picked without replacement from tbbbbbbnbbbfbnrerrf. Give prob of sequence eb. 5/171 Four letters picked without replacement from ccwwvcvwcvvwccvcv. Give prob of sequence vccw. 3/170 Four letters picked without replacement from {f: 2, u: 6, y: 11}. What is prob of sequence yyyy? 55/646 Three letters picked without replacement from dbdbddddbddddb. Give prob of sequence ddd. 30/91 What is prob of sequence pxx when three letters picked without replacement from xxxxxxxxpppxpxpxxxxx? 35/228 Four letters picked without replacement from ggygggygygfygg. What is prob of sequence fggg? 3/143 What is prob of sequence claa when four letters picked without replacement from {c: 7, l: 7, a: 2}? 7/3120 Two letters picked without replacement from ujjujejjjujuejujju. What is prob of sequence ue? 2/51 Three letters picked without replacement from klzlzbz. Give prob of sequence llb. 1/105 Four letters picked without replacement from {u: 1, f: 1, y: 4, t: 3, v: 7}. Give prob of sequence futy. 1/3640 Calculate prob of se	{ "pile_set_name": "DM Mathematics" }
divided by 32? 26 Calculate the remainder when 7988 is divided by 1128. 92 What is the remainder when 15902 is divided by 274? 10 Calculate the remainder when 49896 is divided by 1612. 1536 What is the remainder when 39546 is divided by 24? 18 What is the remainder when 17636 is divided by 44? 36 What is the remainder when 12597 is divided by 12591? 6 Calculate the remainder when 754 is divided by 17. 6 What is the remainder when 883 is divided by 78? 25 Calculate the remainder when 15398 is divided by 405. 8 Calculate the remainder when 255489 is divided by 119. 115 Calculate the remainder when 1395 is divided by 843. 552 Calculate the remainder when 2525 is divided by 1517. 1008 Calculate the remainder when 15897 is divided by 25. 22 Calculate the remainder when 21432 is divided by 126. 12 Calculate the remainder when 25715 is divided by 45. 20 What is the remainder when 2393 is divided by 93? 68 Calculate the remainder when 10333 is divided by 1432. 309 Calculate the remainder when 51677 is divided by 49. 31 Calculate the remainder when 3732 is divided by 232. 20 What is the remainder when 272075 is divided by 79? 78 What is the remainder when 43929 is divided by 4? 1 Calculate the remainder when 5488 is divided by 2739. 10 Calculate the remainder when 6901 is divided by 3085. 731 What is the remainder when 13581 is divided by 421? 109 Calculate the remainder when 12648 is divided by 3162. 0 Calculate the remainder when 698258 is divided by 6. 2 What is the remainder when 378820 is divided by 15? 10 Calculate the remainder when 19927 is divided by 3873. 562 What is the remainder when 15146 is divided by 106? 94 Calculate the remainder when 450207 is divided by 12. 3 Calculate the remainder when 8933 is divided by 63. 50 Calculate the remainder when 195875 is divided by 12. 11 What is the remainder when 1485 is divided by 529? 427 Calculate the remainder when 11291 is divided by 3754. 29 What is the remainder when 15666 is divided by 263? 149 What is the remainder when 234330 is divided by 133? 117 What is the remainder when 156330 is divided by 39082? 2 Calculate the remainder when 16230 is divided by 8080. 70 Calculate the remainder when 7892 is divided by 1117. 73 Calculate the remainder when 30173 is divided by 228. 77 What is the remainder when 2890 is divided by 593? 518 What is the remainder when 37528 is divided by 391? 383 What is the remainder when 107022 is divided by 58? 12 What is the remainder when 1144 is divided by 16? 8 Calculate the remainder when 14379 is divided by 77. 57 What is the remainder when 23972 is divided by 7? 4 Calculate the remainder when 371894 is divided by 426. 422 Calculate the remainder when 9583 is divided by 290. 13 What is the remainder when 9108 is divided by 120? 108 What is the remainder when 12546 is divided by 6238? 70 Calculate the remainder when 9666 is divided by 3210. 36 What is the remainder when 37753 is divided by 75? 28 What is the remainder when 9566 is divided by 4780? 6 Calculate the remainder when 145286 is divided by 245. 1 Calculate the remainder when 379 is divided by 127. 125 Calculate the remainder when 3772 is divided by 1876. 20 What is the remainder when 25786 is divided by 48? 10 What is the remainder when 28566 is divided by 441? 342 Calculate the remainder when 1575131 is divided by 6. 5 What is the remainder when 109006 is divided by 35? 16 Calculate the remainder when 24509 is divided by 8. 5 Calculate the remainder when 2520 is divided by 316. 308 Calculate the remainder when 82063 is divided by 97. 1 What is the remainder when 10733 is divided by 1006? 673 Calculate the remainder when 27807 is divided by 36. 15 What is the remainder when 247143 is divided by 9? 3 Calculate the remainder when 10750 is divided by 51. 40 Calculate the remainder when 5182 is divided by 402. 358 What is the remainder when 53675 is divided by 31? 14 Calculate the remainder when 10906 is divided by 234. 142 Calculate the remainder when 4126 is divided by 822. 16 Calculate the remainder when 93058 is divided by 74. 40 Calculate the remainder when 47000 is divided by 120. 80 Calculate the remainder when 536637 is divided by 416. 413 Calculate the remainder when 76944 is divided by 11. 10 Calculate the remainder when 371066 is divided by 729. 5 Calculate the remainder when 332291 is divided by 1288. 1275 What is the remainder when 326135 is divided by 60? 35 Calculate the remainder when 4725457 is divided by 681. 679 Calculate the remainder when 472973 is divided by 5. 3 Calculate the remainder when 3781 is divided by 404. 145 Calculate the remainder when 9477 is divided by 360. 117 Calculate the remainder when 2331 is divided by 1450. 881 What is the remainder when 539499 is divided by 325? 324 What is the remainder when 9482 is divided by 1417? 980 Calculate the remainder when 12159 is divided by 69. 15 Calculate the remainder when 1200 is divided by 225. 75 What is the remainder when 645654 is divided by 638? 636 What is the remainder when 31615 is divided by 207? 151 What is the remainder when 14332 is divided by 3568? 60 Calculate the remainder when 1074 is divided by 65. 34 Calculate the remainder when 165597 is divided by 36. 33 Calculate the remainder when 28122 is divided by 56. 10 What is the remainder when 739 is divided by 30? 19 What is the remainder when 386 is divided by 27? 8 What is the remainder when 1517 is divided by 12? 5 Calculate the remainder when 18513 is divided by 2000. 513 What is the remainder when 14332 is divided by 2859? 37 What is the remainder when 30162 is divided by 471? 18 What is the remainder when 10487 is divided by 1164? 11 Calculate the remainder when 48253 is divided by 208. 205 Calculate the remainder when 2921 is divided by 931. 128 What is the remainder when 14230 is divided by 2826? 100 Calculate the remainder when 11125 is divided by 2190. 175 What is the remainder when 13645 is divided by 371? 289 Calculate the remainder when 20041 is divided by 211. 207 What is the remainder when 1968 is divided by 593? 189 What is the remainder when 602667 is divided by 84? 51 What is the remainder when 230188 is divided by 76726? 10 Calculate the remainder when 601 is divided by 108. 61 Calculate the remainder when 321599 is divided by 200. 199 Calculate the remainder when 713 is divided by 100. 13 What is the remainder when 44813 is divided by 5600? 13 Calculate the remainder when 114533 is divided by 409. 13 Calculate the remainder when 296927 is divided by 83. 36 Calculate the remainder when 8830 is divided by 586. 40 Calculate the remainder when 16798 is divided by 886. 850 What is the remainder when 12186 is divided by 127? 121 Calculate the remainder when 402 is divided by 366. 36 Calculate the remainder when 197842 is divided by 183. 19 Calculate the remainder when 14057 is divided by 265. 12 What is the remainder when 22723 is divided by 92? 91 Calculate the remainder when 334687 is divided by 16. 15 Calculate the remainder when 60778 is divided by 62. 18 Calculate the remainder when 1880 is divided by 148. 104 What is the remainder when 2851 is divided by 23? 22 Calculate the remainder when 117324 is divided by 19. 18 Calculate the remainder when 9089 is divided by 1298. 3 Calculate the remainder when 11442 is divided by 1798. 654 What is the remainder when 11306 is divided by 180? 146 What is the remainder when 2105 is divided by 301? 299 What is the remainder when 7945 is divided by 441? 7 What is the remainder when 38972 is divided by 6462? 200 What is the remainder when 11675 is divided by 10875? 800 What is the remainder when 12481 is divided by 430? 11 What is the remainder when 3304 is divided by 162? 64 Calculate the remainder when 35134 is divided by 439. 14 What is the remainder when 161932 is divided by 88? 12 Calculate the remainder when 40843 is divided by 35. 33 What is the remainder when 43425 is divided by 579? 0 What is the remainder when 1194 is divided by 399? 396 Calculate the remainder when 2266 is divided by 78. 4 Calculate the remainder when 27728 is divided by 483. 197 What is the remainder when 5155 is divided by 5106? 49 Calculate the remainder when 4368 is divided by 217. 28 Calculate the remainder when 19323 is divided	{ "pile_set_name": "DM Mathematics" }
3 + 18. Let m be f(0). Let t = -2463 + 2475. Let x = m - t. Give h(x). 8 Let r(d) = d3 - 29d2 + 121d - 3516. Let p be r(29). Let n(s) = -s*3 - 7s*2 - 5s - 4. Calculate n(p). 31 Let q(l) = -6l2. Let b be ((-3)/2)/(3/(-8)2). Give q(b). -24 Let j(k) = -2k2 + 137k - 322. Let z be j(66). Let u(o) = o*2 - 7o - 3. Give u(z). 5 Let k(j) = -j*3 - 5j*2 - 3j - 19. Suppose 12 = 10a - 14a, -2i + 5a = -5. Calculate k(i). -4 Let j(p) = -p*2 + 7p - 26. Let l be j(4). Let f be l/4(-60)/105. Let b(d) = 3d - 3 - 3 - d*2 + 3. What is b(f)? -1 Let v(l) = 10l + 495 + 502 + 500 - 2001 + 491. Give v(3). 17 Suppose -3b = -5y + 6, -21y - 4b = -26y + 3. Let o(f) = -7f - 7. What is o(y)? -28 Let v = 31 + -26. Let t be 1/(9/30)(11 - v). Let r be (t/4 + -7)/((-3)/(-6)). Let l(y) = 2y*2 + 5y - 1. Determine l(r). 11 Suppose -2t + 57 = 5o, -14o - 90 = -4t - 16o. Suppose -3k - 2u + 13 = 0, -23u + tu - 36 = -4k. Let v(g) = g - 6. Determine v(k). 1 Let n = -498 - -502. Let o(l) = 5l - 21l + 14l + nl. Let y(v) = -3v - 1. Let r be y(-2). What is o(r)? 10 Let u(q) = q2 - 37q + 208. Let t be ((-3)/(-12))/(81/108)39 + -4. Calculate u(t). -44 Let y(x) = -x2 + 5x - 1. Let j be 1-37 - (-7 - -6). Let n = j - -40. Give y(n). 3 Let q(m) = -9m - 184. Let r(w) = -20w - 412. Let h(a) = 9q(a) - 4r(a). Let k(v) = v - 5. Let z be k(5). Determine h(z). -8 Let r(m) = m - 3. Suppose 3z + b - 29 = 0, 17 = 3z + 10b - 15b. Suppose -4q - 21 + z = 0. Determine r(q). -6 Let z(k) = k*3 - 9k*2 + 7k + 5. Suppose 0 = 10p - 3p - 28. Let s be p - -81(-2)/(-4). Calculate z(s). -3 Suppose 4t - 254 = 3y, 5 = -3y - 3t - 214. Let d = y - -133. Let w(z) = -10 - 57z + dz + 9. What is w(6)? -13 Let n(g) be the third derivative of g*5/30 - 23g*4/8 - 4g*3 + 107g*2. Let i be n(35). Let w(d) = -3d + 33. Determine w(i). 0 Let o(s) = -11s + 576. Let h be o(53). Let n(p) be the third derivative of p6/120 + p5/10 - p4/3 + p3/6 - 11p*2. What is n(h)? 8 Let p(g) be the first derivative of 9g*2/2 + 50g + 179. Determine p(-8). -22 Let p(o) = -25o2 - 224o - 11. Let j(i) = -8i2 - 64i - 3. Let n(z) = 7j(z) - 2p(z). Give n(-1). -5 Let n(b) = -8b - 68. Let y(v) = -14v*3 - 126v*2 + v - 4. Let d be y(-9). What is n(d)? 36 Let v(o) = 3o + 2. Let w be v(0). Suppose -5f - w + 7 = 0. Let c be f - (-4)/(4/(-2)). Let n(b) = 7b*3 - 2b - 1. Determine n(c). -6 Let w be (-26 - -19)(-12)/(-14). Let m be (-1 - w/2)/(14/(-28)). Let f(p) = p3 + 2 + 5p + p*2 - p + 3p*2. What is f(m)? -14 Suppose 3y - 2y = -4g + 14, 5g + y = 17. Suppose 4 = gq - 14. Let b(s) be the first derivative of -s*4/4 + 2s*3 - 3s*2/2 + 4s - 1. Give b(q). -14 Let w be -20 + 38 + -23 + 2. Let a(h) = -h*2 + h - 8. Let j(o) = o - 7. Let c(s) = -4a(s) + 5j(s). What is c(w)? 30 Let s(a) = 2. Let g be -4 + 2 + -3 + 4. Let l(k) = -k2 + 13k - 4. Let z(b) = gl(b) + 2s(b). Calculate z(11). -14 Let k(c) = -2c2 - 16c + 3. Suppose 2d + 65 = f + 52, -2f + 34 = -5d. Determine k(d). 3 Let s(n) = -n2 + 4n. Let b(k) = 3k2 - 12k + 1. Let f be ((-567)/54)/((-3)/2). Let y(c) = fs(c) + 2b(c). Let l be 13 - 9 - (-1 - 0)-1. What is y(l)? 5 Let t(q) be the third derivative of 11q4/24 + q3/2 + 112q2 + 8q. Give t(3). 36 Suppose 0 = -2h + 18h - 48080. Let d(k) = -hk3 + 17 + 3004k*3 + 2k - k. What is d(0)? 17 Suppose 253 = 49b + 253. Let q(o) = o2 + 3o + 59. What is q(b)? 59 Let x(u) = 15u2 - 31u + 164. Let l(h) = -2h2 - 4. Let k(s) = -7l(s) - x(s). Calculate k(26). -6 Let h = 67 + -49. Let r(s) = 1 + 42 - h - 3s. What is r(10)? -5 Let n be -61/21 - 900/(-14). Let u = -51 + n. Let y = u - 8. Let k(d) = -d*2 + 6d - 2. Determine k(y). 3 Let j(p) = p3 + p2 + 5p. Suppose 2u + 13g - 85 = 0, 23u - 27u - 2g = -2. Give j(u). -33 Let n = 99 + -76. Let z(i) = 22 - 37 + n + 8i + i2. What is z(-6)? -4 Let w(r) = 5r + 10 + 0 + 2r - 32. Let v(b) = 3b - 11. Let a be (-440)/(-50) + 2/10. Let u(q) = av(q) - 4w(q). Give u(-7). -4 Let b(p) = 19p - 61. Let r(k) = -47k + 1649. Let y be r(35). Calculate b(y). 15 Suppose -g = 2g + 9. Let y(b) be the first derivative of -b5/60 - b4/12 - b3/2 - 95b2/2 - 20. Let u(r) be the second derivative of y(r). What is u(g)? -6 Let g(w) be the third derivative of -w8/10080 - w7/720 - w6/180 - 61w5/30 - 67w*2. Let a(t) be the third derivative of g(t). Determine a(-4). -8 Let s(w) = 2w*2 + 123w + 241. Let q be s(-2). Let c(v) = 4 - 4 - 5 + 6 - 11v. Determine c(q). -32 Let i(o) = -53o - 2 - 59o - 54o + 3o2 - 5o*2 + 185o. What is i(7)? 33 Suppose -4y + a + 10 = 4a, 0 = y + 3a + 2. Let z(m) = -6m*2 + 6m - y + 1 + 3m2. Give z(2). -3 Let t(b) = 3b + 1. Let m(z) = z + 1. Let k be 228/(-38)(0 - (-2)/(-3)). Let n(x) = km(x) - 2t(x). Determine n(3). -4 Suppose -2r - 10 = 5t, -2t + 20r - 15r - 4 = 0. Let w(k) = -2k3 - 4k*2 + 7. Determine w(t). 7 Let w(z) = -5z*3 + 4z*2 - 3z - 32. Let p(i) = -6i3 + 4i*2 - 4i - 41. Let t(o) = -4p(o) + 5w(o). Let s be (-3 - 0)8/(-6). Give t(s). 8 Let q(r) = 102r + 173. Let p(k) = -52k - 96. Let w(s) = 9p(s) + 5q(s). Suppose -2 + 5 = 3d. Determine w(d). 43 Suppose 72 + 78 - 138 = -4b. Let p(t) = 62t + 183. What is p(b)? -3 Suppose 3a = -93 + 117. Let t(p) = 8p2 - p3 + p + 6p + 1 - 10p. What is t(a)? -23 Let k(t) = -5t + 5. Suppose 0 = -o + 6 - 3. Suppose j = -2q + 9, -oj + 17 = -3q + 4q. Suppose -5d + 3i = -29, i + 22 = jd - 1. What is k(d)? -15 Let h = 160 + -162. Let i = 37 + -34. Let y(t) = -2 - 3t2 - 3t - 6t2 + it*2. Give y(h). -20 Let t be 390/(-429) - 486/(-99). Let b(s) = 3 + 5 - 2s - 1. Determine b(t). -1 Let d(n) = -n*3 + 2n*2 + n + 3. Suppose 6y - y = 25. Suppose 2x + 3x = y. Let u(f) = 2f3 + f2 + f - 1. Let a be u(x). Give d(a). -3 Suppose 8s - 8 - 1440 = 0. Let r = s + -172. Let g(o) = -o*3 + 9o*2 - 2o + 7. What is g(r)? -11 Let u(f) = f + 1. Let s be -11 - ((-4)/18 - 25/9). Let w be s/(-20) - (-222)/(-30). Calculate u(w). -6 Let y(x) = -13x2 - 17 - 16 + 32. Let v be (-165)/55 - (-6 - -2). Calculate y(v). -14 Let o(r) = -51r*2 + 27r - 51. Let w be o(2). Let z = 202 + w. Let a(h) = 31h3 - 2h*2 + 2h - 1. Determine a(z). 30 Let w(j) = j*2 + 57j - 1069. Let o be w(-72). Let h(c) = -c*2 + 2c + 72. Give h(o). -27 Let h(d) = 6736 - 6d + 4d*2 + 4d - 3420 - 3393. Give h(5). 13 Let z(i) = -2i + 10i - 85 + 45 + 42 + 5i. What is z(2)? 28 Suppose -5t + 55 = 5p, -19 = t - 8p + 3p. Let l(b) = 16b*2 - 1 - 25b*2 - 2b + 10b2. Determine l(t). 23 Let c be ((-1 + 5/(-10))10)/(-3). Let w(n) = -16n + 84. Calculate w(c). 4 Let w(l) = -22l + 63l3 - 43l - 142l3 + 18l*2 + 1 + 78l3. What is w(5)? 1 Let j(z) be the second derivative of z3/3 + z*2/2 + 4z + 18. Suppose -2q + 28 = 5u, -2u + u - q = -5. Let r be (8 - 7)/((-2)/u). Calculate j(r). -5 Let z(u) = 6u*3 - 4u*2 - 5u - 5. Let f(w) = 4w3 - 5w*3 - 2w*2 + 2w2 + w + w2. Let o(n) = 5f(n) + z(n). Suppose p - 4p = 0. Give o(p). -5 Let q be (-20)/45(-2 + -16). Let j(h) = -h3 + 6h*2 + 15h - 10. Give j(q). -18 Let c(u) = -u*3 - 10u*2 + 10u - 11. Let m = 290 - 288. Suppose 4b + 0 = x - 41, mb - 5x = -7. Determine c(b). 0 Let s(l) = -6 - 16650l - 3l2 + 16654l + 2l2. What is s(0)? -6 Suppose -3w - 3k = -84, 34 = -4w + 5w + 4k. Let d(s) = w - 79 + 25 + 26 - s. Determine d(8). -10 Let u be ((-27)/(-2))/((-7 - -11)(-8)/(-64)). Let j(d) = d2 - 23d - 74. Calculate j(u). 34 Let u(o) be the third derivative of o*4/8 - 5o*3/2 + 3596o*2. What is u(10)? 15 Let z be (-17 + 20)/(12/16). Let f(a) = 17a*3 + 0a - za - 2 + 14a*3 - 30a*3. Determine f(-3). -17 Let i(v) = 23 + 16 - 2v + 23 - 29 + 3v. Give i(-39). -6 Suppose 2u = 229f - 234f - 37, 3u = f - 47. Let x(k) = k + 1. Let m(p) = p - 13. Let y(o) = m(o) - 2x(o). What is y(u)? 1 Let s be 350/(-60) + 6 + (-11)/(-6). Let j = 168 - 96. Let r(n) = n*3 + jn*2 - 78n*s - 6 + 7n - 4n. Determine r(5). -16 Suppose 49f + 146 = -103 + 4. Suppose 0p + p - w = 0, 0 = -5p + 4w + 2. Let d(m) = m3 + m2 - 7 + 4m**p + 0. Determine d(f). -7 Let	{ "pile_set_name": "DM Mathematics" }
= -5x - 75. Solve -33 = -xt - 53 for t. -5 Let l be (-1)/207/21. Solve -4 = -r - lr for r. 4 Let f(a) = 5a + 6. Let m be f(5). Suppose my - 33y = 0. Solve yh + 1 = h for h. 1 Suppose 0 = -4c - 0c - 16. Let w = c + 6. Suppose -2t + t + 3a = -18, -3t - 4a = -w. Solve 0 = -3d + d - t for d. -3 Suppose 0 = -20a + 31a - 2178. Solve -5l = -193 + a for l. -1 Let i(w) = 3w*2 - w - 1. Let p be i(2). Suppose pg = 5g. Suppose g = f + 8 - 10. Solve -2l + 12 = fl for l. 3 Let v = 0 + 17. Let y = -12 + v. Suppose -5l - 2 = -4u + 14, -yu + 20 = 5l. Solve 0m + um = -4 for m. -1 Suppose -10y + 9y + 12 = 0. Suppose -13h + 10h = -y. Let w be (h/3)/((-17)/(-51)). Solve -5b + b = w for b. -1 Let r(x) = x + 10. Let g = -4 - 2. Let s be r(g). Solve t - 20 = -st for t. 4 Let l(m) = 5 + 5 - 3. Let d(z) = z + 1. Let h(s) = d(s) + l(s). Let a be h(-6). Solve -af + 7 + 1 = 0 for f. 4 Let c(z) = z + 13. Let n be -4(2-4)/(-4). Let y be c(n). Suppose 4h - 3 = y. Solve hf + 15 = -3f for f. -3 Let k(v) = -v - 4. Let j be k(-15). Solve 13w - 2 = j for w. 1 Let m = 26 - 21. Let q be (-3 - -4) + -2 + 2. Let l be (-2 - -5) + -1q. Solve -y + l = m for y. -3 Let i(m) = m + 21. Let u be i(-14). Let d(x) = 3x - 5. Let v be d(u). Let y be (84/(-10))/(v/(-40)). Solve -y = 4h - 5 for h. -4 Let z(w) be the second derivative of w5/20 + 7w4/6 + w3/3 + 33w2/2 + 26w. Let i be z(-14). Suppose 3 = 4a - 5. Solve -3f - af = i for f. -1 Let d = -197 + 139. Let n = d - -58. Solve 3b = -nb + 6 for b. 2 Let g be 11 - (5/(-5) - -7). Solve -4b - g = b for b. -1 Suppose 0 = 7i - i + 48. Let q(f) = f2 + 6f - 14. Let s be q(i). Solve su = -6 - 2 for u. -4 Let i(a) = 5a*2 + 20a + 33. Let f(u) = u*2 + 3 + 3u + 5 + 2u. Let v(r) = 9f(r) - 2i(r). Let g be v(6). Solve 2m + 3m + 20 = g for m. -4 Let u = 137 - 131. Solve h - u = -2 for h. 4 Let w be (-56 - 8)/(-4) + -7. Solve -wc + 4c = -10 for c. 2 Let z be 8/(-6) - 132/(-18). Let t be 9/(9/(-4)) + z. Solve 0 = 6n - tn - 12 for n. 3 Suppose -2k = 2v + 22, -4v + 37 = -5k - 0. Let r(a) = -a3 - 8a*2 + 10a + 11. Let q be r(k). Solve 3 = -qf + 1 for f. -1 Suppose 9 = j - x + 3, -20 = -4j + 2x. Solve jg - g - 15 = 0 for g. 5 Let s = 356 + -301. Solve sv - 53v = 4 for v. 2 Let l be 7 - -12 - 1/((-1)/2). Suppose -2m + l = 5. Solve 5b + m = 23 for b. 3 Let s(r) = -3r3 + 2r*2 + 6r + 5. Let z be s(-1). Suppose 60 = -2u + 7u. Solve zd = 4 - u for d. -2 Suppose -11t + 9t = -332. Suppose -t = -3z - 139. Solve -2o = 5 - z for o. 2 Let a = 2 + 12. Let c = a - 24. Let h be (-46)/c - (-6)/15. Solve -hn - 5 = -0n for n. -1 Let y = 47 + -66. Let k = y + 29. Solve -k = 2z - 4z for z. 5 Let y be 105/4 - (-30)/40. Solve -17f = -yf for f. 0 Suppose -t - 4y + 3y = -16, 3y + 12 = t. Solve -ti + 12 = -11i for i. 3 Suppose 2d + 16 = a, -6a + d - 7 = -8a. Solve 9j = aj for j. 0 Let m(j) = j + 5. Let o be m(7). Suppose -i = 2 - 7. Suppose n - 6 = -if + 4, -f = -4n - 2. Solve x + o = -fx for x. -4 Let l(m) = -18m2 + 77m - 17. Let x be l(4). Solve 2c = 3c - x for c. 3 Let c be (-5)/(5/(-22)) - 0. Suppose 3o - c + 7 = 0. Let z = 7 - o. Solve -4g = -zg for g. 0 Let o(y) = y2 - 3y - 2. Let k be o(4). Suppose kp + p - 15 = 0. Suppose pc - 4c = 0. Solve 4g + 9 + 3 = c for g. -3 Suppose -6u + 7 + 83 = 0. Solve 0 = -uf + 10f for f. 0 Suppose -3w = -4r - 6w + 85, 4w = 4r - 92. Suppose r = 4g + 10. Solve 6y - gy = -3 for y. -1 Let y = 359 + -334. Solve -k = -6k - y for k. -5 Suppose -6 = -x - 3. Suppose -xr + 44 = -b, -r - 5b + 3 = 15. Solve 3l - r = -1 for l. 4 Let z = 73 - 69. Solve 0 = 9l - zl - 5 for l. 1 Suppose -11x - 146 = 635. Let z = x + 74. Solve -zp = -7p for p. 0 Let z = -99 - -99. Solve z = -0w - 3w for w. 0 Suppose -3w = 14 - 5. Let v(t) = 8t + 24. Let s be v(w). Solve 0h - h - 3 = s for h. -3 Let x be (0 - 60/16)/(6/(-16)). Let j be x/(-40) + (-2)/(-8). Solve jl = l - 5 for l. 5 Suppose 4 = -3y + 13. Suppose 3c - 18 = -3w, -3w + 0c = -4c + y. Solve wi + 0i = 3 for i. 1 Suppose -15 = 2w - 7w. Suppose wi + i - 16 = 0. Solve 2x - i = 4x for x. -2 Let f = -322 - -35. Let n be -3 + (f/(-21) - 2/3). Solve 10m - n = 5m for m. 2 Let j = 33 + -33. Suppose -s + 4x + 12 = 0, 2x + 2x + 12 = j. Solve s + 4 = 4o for o. 1 Let k(l) be the third derivative of -l4/24 + 13l*3/6 + 11l*2. Let d be k(10). Solve 2 = -5q + dq for q. -1 Suppose -12 = -2z - 2b, -3b = 5z - 5b - 44. Suppose 5p - 9d - 9 = -10d, 4d + 6 = p. Solve z = -6y + py for y. -2 Let g(a) = a*2 + 7a + 8. Let i be g(-6). Suppose -iv = -v - 8. Suppose -k = -5k, 0 = -4o + 2k + v. Solve 6z = oz for z. 0 Suppose f + 3h - 6h + 40 = 0, -5f - 170 = -5h. Let x = -29 - f. Solve -3j + 1 = -x for j. 1 Let h(y) = 2y*3 - 3y*2 - 5y - 4. Let z be h(3). Solve 4 + z = -4o for o. -3 Let p be 0 - (-2)/(2 - 0). Let z = p - 1. Let b(t) = 9t3 - t2 - t + 1. Let k be b(1). Solve -o - o - k = z for o. -4 Let w be (2 + -4 - -2)/(-2). Let n = w - -6. Let j = 451 - 447. Solve -n = y - j for y. -2 Let f = -3 - -4. Suppose -5a - 3q = 0, 10q + 20 = 6q. Solve f = -2n - a for n. -2 Suppose 2h - 6h + 112 = 0. Let b be h/216/8. Solve -3 = -w + b for w. 4 Suppose 16l + 5l = 273. Solve 12c - lc + 3 = 0 for c. 3 Let m = 1412 + -1398. Solve -5 = mt - 19 for t. 1 Let g = 13 + -6. Suppose 0 = 3h + 2h - 5m - 35, -2m + g = 5h. Suppose q = -2q + 24. Solve qx = hx for x. 0 Suppose 0 = 215s - 225s + 1020. Solve 97 = -5b + s for b. 1 Let r(a) = a*3 - 2a*2 + a + 13. Let t(i) = -3i*3 + 7i*2 - 2i - 39. Let d(x) = 11r(x) + 4t(x). Let j be d(6). Solve -z - j = -2z for z. 5 Let a(p) = 61p - 7. Let n(h) = 31h - 3. Let m(y) = 2a(y) - 5n(y). Let k be m(-1). Let j be (k/6)/(1/3). Solve j = -4d + 1 for d. -4 Let n(j) be the third derivative of -j6/120 - j5/15 + 5j4/24 - 5j*3/3 + 7j*2. Let s be n(-5). Let i be s/((-6 - 0)/3). Solve y - 16 = iy for y. -4 Let t be 16/(-48) + (-62)/(-6). Let k be t/(-3)(-9)/3. Let i be ((-1)/(-2))/((-13)/(-156)). Solve -iy + k = -y for y. 2 Let g(v) = -2v3 - 5v*2 - 3v + 3. Let k be g(-2). Suppose -45 = -c - 3c - kl, 35 = 2c + 5l. Solve -cw + 8 = -3w for w. 4 Suppose -4w = -4m + 12, -7w + 12 = -4w + 4m. Solve w = 6b - b - 25 for b. 5 Let s = 1 + -1. Suppose -7 = 2g + 1, 2v - g = 22. Let w = v + -7. Solve wu + 6 + s = 0 for u. -3 Let k(g) = 9 - 8 - 4 - 6g. Let z be k(-2). Suppose 3x - f = 4, 2x + 9 - 1 = -2f. Solve 3i - z + 0 = x for i. 3 Suppose 13 = 5q - 42. Let d = 70 - 64. Let o be (-6)/(-4) - ((-21)/d + 0). Solve oy + q = -4 for y. -3 Let x = 10 - -8. Let o = x - 12. Let j = -909 - -911. Solve -oc = -jc for c. 0 Let j be 1 + 28 + (-3)/3 + -3. Solve 0b + 5b = -j for b. -5 Suppose 4 = -x - 3k, 2x + 4k + 0 = -2. Suppose -3f - f + 2t = -6, 2f - 6 = 4t. Solve -f + x = -w for w. -4 Let k be (56/(-21))/(44/(-99)). Solve -9l - 12 = -kl for l. -4 Suppose b = 7 + 4. Suppose 4m + n + b = -9, 0 = -3m + n - 22. Let t = m + 10. Solve -tp = -p - 6 for p. 2 Let r(q) = -q*2 + 4q + 1. Let z be r(4). Let n be (-4)/14 - z232/(-28). Solve 0 = m + m - n for m. 4 Let r(p) = -5p*3 - 8p*2 - 6p. Let m be r(-1). Solve 11c - mc + 40 = 0 for c. -5 Suppose -2 = 3o + 4. Let r be 34/o(4 - 5). Let y = -15 + r. Solve -yj + j = 0 for j. 0 Suppose 6y = -5y + 6y. Solve -2r - r - 12 = y for r. -4 Suppose -4f - 4r - 2 = 2, 0 = -f + 2r + 11. Let x be 4/2 - (-845 + 0/(-1)). Let d be (-11)/(x/(-14)) - (-31)/11. Solve -dh + 0 = -f for h. 1 Let i(h) = 4h*2 + 9h - 4. Let m be i(-3). Solve 2j + 8j = mj for j. 0 Let s(h) = 19h + 6. Let b be s(-1). Let n be (11 + b)/(2/(-4)). Solve 0 = 2d - nd + 6 for d. 3 Let o = -912 - -976. Solve ok - 50k = 42 for k. 3 Let o = 219 + -209. Solve -9v + 5 = -ov for v. -5 Let y(n) = n*3 + 64n*2 + 128n + 266. Let m be y(-62). Solve 0 = 3v + 3v + m for v. -3 Let q be 71/2 + 3/6. Let p be q/(-18) + 1 + 10. Solve 11 + p = -4z for z. -5 Suppose 28h - 5g = 23h + 155, -5g = -2h + 53. Solve -39 = -m - h for m. 5 Let b(o) = -o*3 + 9o*2 - 24o + 70. Let d be b(7). Solve -5*f - 9 + 4 = d for f. -1 Let r = 74 - 70.	{ "pile_set_name": "DM Mathematics" }
= -1 + 5. Let k = x - 4.2. Let y = k + 0.4. Which is the smallest value? (a) 5 (b) -4 (c) y b Let p = 52.7 - 53. Let u = 1 + -0.9. What is the biggest value in u, p, 0? u Let v = -0.6 + 1. Let t = 662.97 - 660. Let b = t + 0.03. What is the smallest value in v, b, 0.3? 0.3 Let w = -4 + 2. Let v = w - -0.4. Let u = v + 2. What is the third biggest value in u, -0.5, -2/7? -0.5 Let j = 0.4 - 0.3. Let f = -0.3 + j. Let p = 1/18 + -41/90. What is the biggest value in -1/3, p, f? f Suppose -g + 6 - 2 = 0, 3q - 20 = -5g. Which is the second biggest value? (a) -3 (b) q (c) -6 a Let f = 0.7 + 1.3. Which is the smallest value? (a) f (b) -5 (c) 3 (d) -0.1 b Let g = -0.09 - 1.91. Let y = -4 - -3.9. Let i = -0.4 - -0.2. Which is the second smallest value? (a) i (b) y (c) g a Suppose 2y - 10 - 2 = 0. Let s(v) = -v3 + 7v*2 - 6v + 5. Let j be s(y). What is the third smallest value in -5/4, -2, j? j Let d = -0.15 + 0.45. What is the biggest value in d, -9, -1? d Let n = 0.06 + -0.36. Let f = n + 0.4. Let u = f + -0.3. What is the smallest value in 0.1, u, -2/17? u Let p = -5 + 6. Let k = 14 - 18. Which is the third biggest value? (a) k (b) p (c) -5 c Let f = 0.02 - 0.01. Let w = 2.01 - f. What is the smallest value in 1, 0.3, w? 0.3 Let h = -977/5 + 196. Let l = -0.0587 - 0.0413. Which is the second smallest value? (a) h (b) 0.3 (c) l b Let k = -0.04 + -3.96. Let b be ((-9)/(-6))/((-3)/(-16)). Suppose -b = -6f + 4f. What is the biggest value in -2/11, f, k? f Let p be ((-6)/(-60))/((-1)/(-6) - 0). Let u = 0.2 + 0.3. Which is the biggest value? (a) p (b) -4 (c) u a Let y = -13.07 - -13. Let s = y + 0.18. Let n = -3.89 - s. What is the third smallest value in 5, -1, n? 5 Let w = 5.11 - -0.59. Let q = w - 6. Which is the second smallest value? (a) 0.4 (b) q (c) -4 b Let q = -617/4 - -155. Which is the second smallest value? (a) q (b) 1 (c) 6 b Let h = 94 + -91. What is the second biggest value in 0.3, 25, h? h Let j = 1.2 + -1.5. What is the biggest value in -3, -7, j? j Let s = 0.04 + -0.24. Let f = 94 + -472/5. Which is the biggest value? (a) s (b) f (c) -5/3 a Suppose 2x = 5x - 3, 5r - 5x + 5 = 0. Suppose 5m + 0m + 50 = r. Let p = m + 9. Which is the biggest value? (a) 5 (b) 1/3 (c) p a Let l = 42.946 - 43. Which is the third smallest value? (a) l (b) -3 (c) -4/3 a Let d = -3 - -4. Let l = -0.3 - -0.4. What is the third smallest value in -0.5, d, l? d Suppose -45 + 5 = 5z. What is the biggest value in z, 0.3, -3/2? 0.3 Let m = -0.1 - -0.3. Let s = m - 1.2. Let i = -10 + 5. What is the biggest value in 1/11, i, s? 1/11 Let q = 262/253 - 28/23. Let c = -10 - -5. What is the biggest value in q, c, 0.1? 0.1 Let h = -3/7 - -47/77. What is the smallest value in 3, -0.04, h? -0.04 Let g = -32 - -27. What is the second biggest value in 4/5, g, 3? 4/5 Suppose 5q - 5 + 10 = 5j, 0 = -3q + 4j. What is the fourth smallest value in q, -6, -1, 2? 2 Let s = -0.02 - -2.02. Let w = -0.9 - -0.89. Let r = 0.1 + 0. Which is the second biggest value? (a) s (b) w (c) r c Suppose -5d + z + 17 = -z, 25 = d + 5z. Let v = 80 - 398/5. What is the third smallest value in v, d, 0? d Let h = 11 + -11. Let d = -3 - h. What is the second smallest value in -0.3, d, -0.2? -0.3 Let m = -34.5 + 35. Let k = 3 - 0. Which is the biggest value? (a) m (b) k (c) 0.1 b Let h = 3 + -2.6. Suppose 2d - 12 + 4 = 2r, 2r = 5d - 14. Which is the second biggest value? (a) d (b) -5 (c) h c Let l be (16/7 + -2)/1. What is the fourth smallest value in l, 6, -4, -1/8? 6 Let a = -34.6 + 47. Let f = a - 14. Let b = f - -2. What is the second biggest value in -2, b, -3? -2 Let a = 15 - 59/4. What is the second biggest value in a, -4, 2? a Let a = -5 + -6. Let m = -12 - a. Let u = 7/12 + -29/36. What is the third biggest value in u, -0.2, m? m Let w(d) be the first derivative of -d3/3 + 4d*2 - 8d + 2. Let l be w(7). Let f be 0/2 + 4/14. Which is the second biggest value? (a) 1 (b) f (c) l b Let h = -3.045 + 0.045. What is the biggest value in -5, h, -2/11, 3? 3 Let f = -0.2 - -0.6. Let d = f + 3.6. Which is the biggest value? (a) -0.5 (b) d (c) -2 b Let n = -4.439 - -0.039. Let c = n - -0.4. Let g = 0.97 - -0.03. What is the third biggest value in c, g, 3/4? c Let l be (2 - 1) + (-113)/121. Let u = 2/363 - l. Let y = -80/231 - u. What is the third smallest value in 2/3, 2, y? 2 Let i = -1.3 + 1.4. Let z be 5/(-6) + (-1)/(-3). Let f = 1.9 + -2. Which is the second biggest value? (a) i (b) f (c) z b Let w be (-1)/(-2)(-8)/(-2). Let h be 2/(-7) + (2 - w). Which is the smallest value? (a) -4 (b) -0.5 (c) h a Suppose j + 4 = 4y, -5j + 2y - 10 - 46 = 0. Let w be 1/(5/j) + 3. Which is the smallest value? (a) w (b) 1 (c) -2 c Let w(c) = 4c - 1. Let f be w(3). Let q be 7/14 + f/(-30). Let b = 4.02 + -0.02. What is the biggest value in 0.1, q, b? b Let z = -4.5 + 4.3. Which is the biggest value? (a) z (b) 0.016 (c) 4 c Let d = 9 - 5. Let r = 9.8 - -3.7. Let x = 13 - r. Which is the second biggest value? (a) -3 (b) d (c) x c Let y(q) = q2 + 11q + 25. Let v be y(-8). What is the second biggest value in -2/21, 0.4, v? 0.4 Let n = 4.17 + -0.17. Let h(f) = f*2 - 6f + 4. Let x be h(4). Which is the second smallest value? (a) n (b) x (c) -3 c Let s = -0.9 - -0.2. Let q = s + 1. What is the biggest value in -2, 0.2, q? q Let t = 0.07 + 1.93. What is the second biggest value in 4, t, 0.2? t Let n = -4.6 - -8.6. What is the third biggest value in 0.03, n, -0.2? -0.2 Let j = -4.1 + 4. Suppose 6n - 3n + 1 = -4f, -n = 3f + 7. Which is the second biggest value? (a) -0.5 (b) j (c) n b Let r = -2.86 - 0.14. What is the second smallest value in r, 3/5, 1/8? 1/8 Let a = -0.753 - -0.053. What is the smallest value in 5, a, 2? a Let f = 0.4 + -1.4. Suppose -4m = -l - 13, 3m - 2m - 3l = -5. Let o be 8/20 + 17/(-30). Which is the second smallest value? (a) f (b) m (c) o c Let n = -44 + 45. Let t = 4 + -6. What is the second smallest value in t, -5, n? t Let n = -13 - -8. Let q = 0.6 - -2.4. Let a = q + -2.6. What is the third smallest value in a, -4, n? a Let c = -102 + 107. What is the second smallest value in 2/13, 2, -2/17, c? 2/13 Let u(i) = -8i2 + 18i + 11. Let t(r) = 3r2 - 6r - 4. Let a(n) = -11t(n) - 4u(n). Let y be a(-6). What is the smallest value in 4, 0.1, y? y Let z = 0 - -0.1. Let u = z - 1.1. Let d be ((-2)/3)/((-2)/(-3))-1. Which is the third biggest value? (a) -1/3 (b) u (c) d b Let l = 2.5 + 0.5. Let s = l + -3.4. Let a = 0 + s. What is the biggest value in 5, -2, a? 5 Let l(v) = -2v - 6. Let z be l(-5). Which is the biggest value? (a) 3 (b) z (c) 3/4 (d) 3/7 b Let i = -2 + 6. Let t be ((-2)/i)/(15/6). Which is the third smallest value? (a) 5 (b) 0 (c) t a Let l = 0.051745 - 244.941745. Let s = 241 + l. Let k = -0.11 + s. Which is the third biggest value? (a) k (b) 2 (c) -0.3 a Let l = -20 + 18. What is the second smallest value in l, -2/3, -0.8? -0.8 Let n = -0.04 - 1.96. Let z = 2 - 12/7. Which is the smallest value? (a) n (b) 2/11 (c) z a Let f = 1.3 + -4.3. Let h = -9 + 5. What is the second smallest value in h, -5, f? h Let i be 4/26 + 32/(-39). Let y = -0.37 + -0.03. What is the smallest value in -1/6, i, y? i Let f(z) = z*2 - 11z + 4. Let c be f(11). Suppose -s - 12 = -5u - 1, cu - s - 8 = 0. What is the smallest value in -0.2, -2, u? -2 Let r = -7 - -3. Let h = 0.2 - -1.8. Which is the biggest value? (a) h (b) r (c) -2 a Let k = -106.4 + 106. Let m be 101(-1)/2. What is the second smallest value in m, k, 5/4? k Let d = -2.23 + -0.77. What is the fourth smallest value in 0, 8, -0.1, d? 8 Let o = -0.2 - -0.2. Let n = -0.0373 + -1.9627. Which is the third biggest value? (a) n (b) 0.1 (c) o a Suppose -q + 3x = -1, q + 2x - 6 = 5. Let o = q + -6. Let d = 0 + 0.1. Which is the second biggest value? (a) d (b) -4 (c) o a Let l = -86.89 - -90.9. Let n = -0.01 + l. Let u = 0.1 + -0.6. Which is the second biggest value? (a) 2/7 (b) u (c) n a Let z be ((-1)/(-4))/((-3)/(-16)). Let w = 26 + -38. Let k = w + 59/5. Which is the second biggest value? (a) z (b) -0.3 (c) k c Let z(p) = -p*3 + 5p*2 - 3p - 5. Let h be z(4). Let l be h/2*112/70. Which is the smal	{ "pile_set_name": "DM Mathematics" }
= 2v for v. 2 Solve -27b = 5n + 142, -10n - 50 = -5n - 2b + 63 for n. -23 Solve 8z + 44k = z + 47k - 7, 6z - 2k = 10z - 22 for z. 2 Solve -4x = -4s - 4, -136x - 12 = -138x + 5s - 0s - s for x. -4 Solve 0x + 169 = 3x + 3p - p, -857p + 860p = -2x + 261 for x. -3 Solve -10 = 4a + b, -5a - 45b - 370 = -3a - 81b for a. -5 Solve -17z - 5s + s = -12z - 49, 26z + 7s = 24z + 52 for z. 5 Solve -11q = -39v + 19v + 16v + 75, v + v + 3q + 10 = v for v. 5 Solve -5h + 5i = 100, -2h = -376082i + 376075i + 35 for h. -21 Solve -5n - 10 = o, 62582n + 8 = 62578n - 57o + o for n. -2 Solve 3188 = -5z - l + 3167, -4z - 16 = l for z. -5 Solve -5b + 2s = -40, 4b - 44 = 96364s - 96360s for b. 6 Solve 67o - 71o + 5d - 47 = 0, -27o - 131d = -132d + 88 for o. -3 Solve 116m - 32 = 118m - b, 0 = -2m + 5b - 16 for m. -18 Solve 2r - 6017 = -3g - 6019, -3g - 28r + 24 = -26 - 0 for g. -2 Solve 0 = 2f - t + 23, 333106t + 93 = 3f + 333113t for f. -4 Solve -5y + 205 = -5f + 320, -4y + 75 - 17 = 26f for y. -18 Solve 2i = -2x + 122, -i - 247x + 65 = -493x + 243x for i. 62 Solve 5x + 46j + 234 = 22j - 13j, -5x + 5j + 60 = 0 for x. 5 Solve 13y + 3i = 9y + 53, -3y + 15i = 127i - 369 for y. 11 Solve -10k - 5z + 636 = 96k - 131, 3k = -2z + 31 for k. 7 Solve -a - 9f = 42, a - 792f + 790f = 13 for a. 3 Solve -4h = 4i + i - 64, 13h + i - 208 = -2i for h. 16 Solve 7t + p + 4 = 0, -49t + 52t - 7p + 96 = -16p for t. 1 Solve 7s + 27 = 2q - 39 + 7 - 8, -3s + 19 = 2q + 2 for q. 16 Solve 2h = 5f - 4h + 5h + 10, -67f + 8 = -71f + 4h for f. -2 Solve -2030a + 14n + 159 = -2031a, 0 = -4n - 44 for a. -5 Solve 5m + 43w + 73 = -33w + 75w, -3m - 51 = -3w for m. -15 Solve -248 = -16l - 122955s + 122953s, 76 = 4l + 4s for l. 15 Solve 4s - 13c + 104 = -c, -2s = c - 11621 + 11673 for s. -26 Solve d - 350 = -31b - 8b + 41, -2b + 5d - 390 = -405 for b. 10 Solve 70g + 285 = 5z, -5g - 2z + 34 + 26 = 45 for g. -3 Solve 65f + 4l + 12 = 67f, 156l = 4f - 764 for f. -4 Solve -4a - 1958u = -1962u + 16, a + 4 = 3u for a. -4 Solve -4u = -366k + 371k + 11, 4u + 12 = -3k + 7 for k. -3 Solve -g - 2g = 2g + 5u - 35, 2 = -31g + 30g + u - 1 for g. 2 Solve 5d = 11q - 0q + 270 - 138, 5d + 2q = -24 for d. 0 Solve -9 = 3o + 6q, 0 = 172o - 167o + 5q + 19 + 6 for o. -7 Solve 2z - 13 = -5t + 6, 4t = 2z - z - 18825 + 18835 for z. 2 Solve 621z + 12 = -2p + 1239z - 622z, -2z - 22 = 3p for p. -8 Solve 2j + 3d = 18, 2d - 1319 + 2657 - 1390 = -8j for j. 6 Solve -5d = -b + 23, -9d + 7d + 7d + 64b - 66b + 31 = 0 for d. -3 Solve 0l - w - 7 = 3l - 4, 0 = 133l - 135l + 21w - 2 for l. -1 Solve 48o = -2d - 212 + 526, d - 5d + 199 - 41 = 2o for o. 5 Solve f + k - 9 = 0, 18f = 21f - 5k - 11 + 8 for f. 6 Solve 0 = -5f - 20, -55f = -4d - 99f + 41f for d. 3 Solve -3j - 15 = -5y, 12y - j + 80530984 - 80530989 = 0 for y. 0 Solve -32o + 52o = 5y + 41o + 115, 13 = -2y + 3y - 3o for y. -2 Solve 0 = -109n + 110n + 2u - 12, -2n = 5u - 19 - 9 for n. 4 Solve -16l + 2 + 68 = -11l, -4v + 8l - 109 = -3v for v. 3 Solve -2d + p = 15, 0 = -5d + 23705p - 23713p + 29 + 7 for d. -4 Solve 4o = -4, 26z + 7o + 17 = -8 - 86 for z. -4 Solve -5x = 5z + 130, -19x - 8 = -9z + 14z - 5z + z for z. -27 Solve -71 = 3z + 9z - 2j + 149, -106 = 6z + j for z. -18 Solve -9640v + 19278v + 5o + 9 = 9640v, 3v + 3o = -18 for v. -3 Solve -3h = -h + 2q + 30 + 2, -49h + 44h - 52 = -2q for h. -12 Solve 0 = -3t + 5h + 68, -t - 5h = 14t + 72 - 22 for t. 1 Solve 8c - 18 = 6c + 5k + 2, -4c = -2k - 40 for c. 10 Solve 26 = 2f - 5i, -194 - 80 = f - 3f + 67i for f. 3 Solve -134 = -2n - 3m, 0 = -2n - 28m - 6 + 8 + 12 + 20 for n. 73 Solve 0d = b + 15d - 7d - 19, 2d = -6b - 4 + 72 for b. 11 Solve -3 = m, 3m + m - 2 = -b - 0b - 16 + 2 for b. 0 Solve 2d - 33 = 3m - 24, -6m + 4d + 17 = -40m - 85 for m. -3 Solve -38i + 42i + 2a = 20, i - 3a + 2 = 0 for i. 4 Solve 5g + 17 = -n, 8519n = 4g + 8518n + 10 for g. -3 Solve 11 = y - 4r, -341y + 175y - 7r = -168y + 22 for y. 11 Solve -5z + 3h + 40 + 22 = 41, -5h - 13 = -6z + 15 for z. 3 Solve 1680y = -3v - 6720, -3v - 457y = -458y - 4 for v. 0 Solve 0 = -5i - 746r + 748r + 67, r = 2i - 27 for i. 13 Solve -4v + 12 = -m, -v + 434 - 205 - 226 = 3m for v. 3 Solve -6k = -3x - 246, 975k + 82 = 977k + 3x for k. 41 Solve 2d = -r + 92, 34 - 35 = -21d + 19d + 89 for r. 2 Solve -3m - i - 8132 = -8m - 8108, -8m - 888 = 37i for m. 0 Solve 0 = -4p - 3n - 71 - 93 + 75, 2n = -4p - 62 for p. -2 Solve -5m + 301036u - 301039u = -6, m + u = 0 for m. 3 Solve -73 = -2p + 248n - 243n, -11p - 5n = 86 for p. -1 Solve 2c + 4u - 140 = -152, -2c = u for c. 2 Solve 2s - 213g + 217g - 38 = -4, 2g - 15 = s for s. 1 Solve 4v - 12n + 11n - 158 - 167 = -338, -4n = v + 16 for v. -4 Solve -34a - 3d - 204 = -11a, -85a = -82a - 3d + 30 for a. -9 Solve 5u - 259i - 1 + 19 = -256i, 6 = 6i for u. -3 Solve -3c + 116 = -4n, 249n - 98 = 208n - 5c for n. -2 Solve 4y + 7706 - 15246 = 2q - 7666, 0 = -4y - 5q + 245 for y. -5 Solve -7w + 115 = -3g, -2g + 40w - 35w - 175 = -93 for g. -1 Solve 4i = -w + 20 + 26, 47w + 24i - 35i + 208 = -18 for w. -2 Solve 27z + 4z + 371 + 576 = 79, -2z = -c + 50 + 7 for c. 1 Solve -3y = 3z - 15, 726589y - 726594y + 5 = z for z. 5 Solve m - 5d + 16 = -1 + 18, 18m + 74 = -2d for m. -4 Solve 2h + t + 28 = -t, 1434t = 4h + 1437t + 8 + 13 + 24 for h. -3 Solve -i + 4u = 58, 0 = 49406i - 49414i - 2u + 12 for i. -2 Solve 3j = -2s - 20, -4189 + 4099 = 3j + 12s for j. -2 Solve 3l + 3k - 3365 = -3344, 7k + 5 = 2l for l. 6 Solve -41i + 24 = -39i + 4v, 9i + 2v - 92 = 0 for i. 10 Solve 2u - 4h = h + 5, 17h + 25 = -15h + 7h for u. 0 Solve -12v = -y + 106, -2y - 48 = -v - 104 + 51 for v. -9 Solve 1423 = 457v - 4g, -v + 11g + 42 = 8g for v. 3 Solve 5c - 5m - 10 = 0, 438c - 435c - 58m + 54m = 3 for c. 5 Solve 2z = 2w - 86, 237272w - 237277w = -4z - 175 for w. 3 Solve -5c - 39v + 74v + 131 = 32v, -15c + 3v + 111 = 0 for c. -2 Solve -21 = -5j - 4k, j - 24 = -176k + 173k for j. -3 Solve -v - 5n + 29 = 0, 12203v - 12200v + 5n - 47 = 0 for v. 9 Solve 2x - 16s - 1064 = -1136, 0 = 7x - 2x + s + 57 for x. -12 Solve -2r - 310 = 3r - 5s, 33s + 49s = 87s - 10 for r. -60 Solve -5s + 10 = 5f, 37s - 38s + 16657f = 16653f + 33 for s. -5 Solve 0 = -163y + 159y + 5r - 10r - 2, 2r = 4y - 12 for y. 2 Solve -23u = 23u - 45u - 3, -q + u = 4 for q. -1 Solve -3d = 3g - g - 4, 4 = 2438d - 2443d + 2g for d. 0 Solve 0 = -3n + 5o - 22, 118616 = 5n - 3o + 118642 for n. -4 Solve 0z + z + 4k - 2k - 24 = 3z, k - 4593 = 510z for z. -9 Solve -4t - 54l - 40 = -128, -60t + 3l - 6 = -124t + 64t for t. -5 Solve 4v - 4j - 88 = 0, 95 = 4v - 1002j + 2045j - 1040j for v. 23 Solve 316l - 319l + 191 = 5v, -7v = -4l - 292 for l. -3 Solve -4b - 151 = -5z - 236, 5 = -4z - b for z. -5 Solve 62 = 3v - v - 4x, -2v + 4317x + 548 = 8609x - 4323x for v. -5 Solve -s - 4571 + 641 = 357a, -5s + a = 6a + 70 for s. -3 Solve -20s + 100 = 4q, 2s - 11s - 4q = 47 - 81 for s. 6 Solve 787v + 4g = 3144, 2v - 4g - 5 - 5 = -v + 6 for v. 4 Solve 0t - 269w = -2t - 1107 - 4731 + 721, -w = -2t - 25 for t. -3 Solve 5u + 178l - 85l - 5 = 98l, -3u - 14l = -71 for u. 5 Solve -r + 5d = 28, 2535 - 2539 = -2d for r. -18 Solve -512 = 3n - 3r - 395, 2n = -2n + 3r - 152 for n. -35 Solve 34s + 89 + 51 = 35s - 48i, -2i = s - 5i - 5 for s. -4 Solve 0 = -t + 3j + 30, j + 293 - 80 = 10t for t. 21 Solve -5d = -2l + 15, 9d = -8d + 12d - 3l + 10 - 0 for d. -1 Solve 3o + 10586 = 2s + 10604, 2s - 4o = -22 for s. -3 Solve 14j - 9d - 12d + 23d + 13 = 11j, -3d - 15 = 0 for j. -1 Solve -1663f - 45 = -1668f, 2c = 5f - 53 for c. -4 Solve p = -3a - 1568 + 1548, 5a = -6p - 42 for p. -2 Solve -2n - 3w + 22 = -2w, 15n + 6w - 199 = -12w + 19w for n. 13 Solve 8c = -q + 81, 14c + q + 11 = 5c + 10c + 2q for c. 10 Solve g - n	{ "pile_set_name": "DM Mathematics" }
0 What is -673.94 rounded to the nearest one thousand? -1000 What is -0.0000249 rounded to 6 dps? -0.000025 Round -66.572 to zero decimal places. -67 What is -1231.3 rounded to the nearest 100? -1200 Round 0.005304 to 3 decimal places. 0.005 Round 1693700 to the nearest ten thousand. 1690000 Round -4.847 to zero dps. -5 Round -7732000 to the nearest one hundred thousand. -7700000 Round -8300 to the nearest one thousand. -8000 Round -0.289 to 1 decimal place. -0.3 What is 0.00003763 rounded to six dps? 0.000038 Round 1281730 to the nearest one hundred thousand. 1300000 Round -0.00000066601 to 6 decimal places. -0.000001 What is 0.37102 rounded to 2 decimal places? 0.37 Round -8112 to the nearest 1000. -8000 What is -0.00152172 rounded to five dps? -0.00152 Round 0.000025353 to 5 dps. 0.00003 What is -47640 rounded to the nearest 1000? -48000 What is 0.000033922 rounded to six dps? 0.000034 Round -10.341 to the nearest 10. -10 What is 53200000 rounded to the nearest one million? 53000000 What is -39550000 rounded to the nearest 1000000? -40000000 Round -0.014401 to 2 decimal places. -0.01 What is -84.029 rounded to the nearest 10? -80 Round 25677 to the nearest one thousand. 26000 Round 15.0678 to zero decimal places. 15 What is 8530 rounded to the nearest 1000? 9000 Round -0.0000066988 to seven dps. -0.0000067 Round 10328700 to the nearest one hundred thousand. 10300000 Round -0.0000059189 to six decimal places. -0.000006 Round -0.000053575 to five decimal places. -0.00005 Round -153.38 to 0 decimal places. -153 Round 93.545 to one decimal place. 93.5 Round 20875300 to the nearest one million. 21000000 Round 44660 to the nearest ten thousand. 40000 What is -1589 rounded to the nearest one hundred? -1600 Round -753500 to the nearest ten thousand. -750000 What is 0.000034909 rounded to 5 decimal places? 0.00003 What is -0.0000025553 rounded to seven dps? -0.0000026 What is -15531000 rounded to the nearest 1000000? -16000000 Round -15.8 to the nearest 10. -20 What is -0.14544 rounded to three decimal places? -0.145 What is 2242.3 rounded to the nearest 10? 2240 Round 2532400 to the nearest ten thousand. 2530000 What is -14788300 rounded to the nearest one million? -15000000 Round -15.12 to one decimal place. -15.1 What is 0.499 rounded to 1 dp? 0.5 Round -0.000027524 to five decimal places. -0.00003 Round 0.00008134 to 5 dps. 0.00008 Round 0.000155 to four dps. 0.0002 Round -627400 to the nearest 10000. -630000 What is 0.0000061011 rounded to six dps? 0.000006 Round 0.00007042 to 5 decimal places. 0.00007 What is 0.002421 rounded to 4 dps? 0.0024 Round 0.0000147426 to 7 decimal places. 0.0000147 What is 2333000 rounded to the nearest one hundred thousand? 2300000 Round -0.0000124 to six dps. -0.000012 Round -602000 to the nearest 100000. -600000 Round -0.000009538 to 6 decimal places. -0.00001 Round 0.0005557 to 4 decimal places. 0.0006 Round 0.42758 to 2 dps. 0.43 Round -108.911 to 0 dps. -109 Round -18803000 to the nearest 1000000. -19000000 What is 3436.35 rounded to the nearest one hundred? 3400 Round -0.0124453 to 3 decimal places. -0.012 What is 169.16 rounded to 0 decimal places? 169 What is -147000 rounded to the nearest one thousand? -147000 What is -0.000000172 rounded to 7 dps? -0.0000002 What is -0.00054 rounded to 4 dps? -0.0005 Round -0.011788 to four decimal places. -0.0118 Round -0.00000602 to six dps. -0.000006 What is -0.00004847 rounded to 5 decimal places? -0.00005 Round 1137900 to the nearest one hundred thousand. 1100000 Round -0.000053277 to seven decimal places. -0.0000533 What is 590180 rounded to the nearest 100000? 600000 What is 1861000 rounded to the nearest 100000? 1900000 Round 0.000391 to 4 dps. 0.0004 What is -2255 rounded to the nearest 10? -2260 Round -0.000025219 to 6 decimal places. -0.000025 What is 121.3 rounded to the nearest ten? 120 What is 52870 rounded to the nearest 10000? 50000 Round 1250700 to the nearest one hundred thousand. 1300000 What is 0.8218 rounded to two dps? 0.82 Round 0.00000713 to four dps. 0 Round 0.00082191 to four decimal places. 0.0008 What is 5270000 rounded to the nearest 1000000? 5000000 Round 1.764 to 2 dps. 1.76 Round 26.9 to the nearest 10. 30 Round 0.000973 to 4 dps. 0.001 What is 0.804 rounded to 2 decimal places? 0.8 Round 0.02933 to 3 dps. 0.029 What is 0.1116 rounded to two decimal places? 0.11 What is 0.0173918 rounded to 2 decimal places? 0.02 What is 0.0000000385 rounded to seven decimal places? 0 What is 0.000002414 rounded to seven dps? 0.0000024 What is -8877000 rounded to the nearest 100000? -8900000 Round 0.4612 to two decimal places. 0.46 What is -332000 rounded to the nearest 100000? -300000 What is -4.8955 rounded to 2 decimal places? -4.9 Round -0.00182 to 3 decimal places. -0.002 What is -0.0004644 rounded to five decimal places? -0.00046 Round -101.47 to the nearest ten. -100 What is 0.0000008703 rounded to 7 decimal places? 0.0000009 Round -0.0081221 to 4 decimal places. -0.0081 What is 0.000000216 rounded to seven dps? 0.0000002 What is 1947 rounded to the nearest 100? 1900 Round 23.69 to the nearest 10. 20 What is -0.000304 rounded to 5 dps? -0.0003 What is -0.00001583 rounded to 6 decimal places? -0.000016 What is -0.0001051 rounded to 4 decimal places? -0.0001 What is 0.00017784 rounded to 5 dps? 0.00018 What is 35.683 rounded to the nearest integer? 36 Round 80.09 to zero dps. 80 What is 186.43 rounded to the nearest integer? 186 What is -5106.4 rounded to the nearest 100? -5100 Round -87260 to the nearest 1000. -87000 What is -0.0016902 rounded to 4 dps? -0.0017 Round 0.0000035211 to seven dps. 0.0000035 What is 2.87184 rounded to one dp? 2.9 Round 3920000 to the nearest one million. 4000000 Round 730730 to the nearest 100000. 700000 What is 0.2405 rounded to one dp? 0.2 What is 0.009 rounded to 2 dps? 0.01 Round -789.43 to the nearest one hundred. -800 Round -1070.51 to the nearest one hundred. -1100 Round -454320 to the nearest 10000. -450000 Round -2408000 to the nearest 100000. -2400000 Round -2500 to the nearest ten thousand. 0 Round 23.431 to the nearest ten. 20 What is 0.00011159 rounded to 6 decimal places? 0.000112 Round 106 to the nearest 100. 100 What is 0.5279 rounded to one dp? 0.5 Round -0.001373 to 4 dps. -0.0014 Round -60043000 to the nearest 1000000. -60000000 What is 1181 rounded to the nearest one hundred? 1200 What is 1350.21 rounded to zero dps? 1350 Round 44.5 to the nearest one hundred. 0 What is -8014.7 rounded to the nearest 10? -8010 Round 41.65 to the nearest integer. 42 What is 0.043116 rounded to 3 dps? 0.043 What is 0.028103 rounded to 3 dps? 0.028 Round -8933 to the nearest one hundred. -8900 Round -0.0000793 to 4 dps. -0.0001 What is 25.9952 rounded to one dp? 26 Round 0.000000404 to 7 dps. 0.0000004 Round -0.005062 to 4 decimal places. -0.0051 Round -636000 to the nearest 100000. -600000 Round -413.296 to the nearest ten. -410 What is -0.00012812 rounded to six decimal places? -0.000128 Round 0.0000185819 to 7 decimal places. 0.0000186 What is 16883 rounded to the nearest 1000? 17000 What is -811 rounded to the nearest 1000? -1000 Round -186000 to the nearest one hundred thousand. -200000 Round 15830 to the nearest ten thousand. 20000 Round -14940 to the nearest 100. -14900 Round -1865.85 to the nearest 10. -1870 Round 0.024892 to three dps. 0.025 Round -131.3 to the nearest 100. -100 Round 10.768 to one dp. 10.8 What is -72499 rounded to the nearest ten thousand? -70000 Round -634787000 to the nearest 1000000. -635000000 Round -0.00007411 to five decimal places. -0.00007 Round 9.26 to the nearest 10. 10 Round -409.6 to the nearest ten. -410 Round 442100 to the nearest ten thousand. 440000 Round -667400 to the nearest 10000. -670000 What is -0.53342 rounded to 3 decimal places? -0.533 What is -57300000 rounded to the nearest one million? -57000000 What is 0.00000209228 rounded to seven decimal places? 0.0000021 Round -5420 to the nearest one thousand. -5000 Round 4.937 to 1 dp. 4.9 What is 0.01555 rounded to three decimal places? 0.016 Round 129810 to the nearest one thousand. 130000 What is 5.57 rounded to one dp? 5.6 What is 177220 rounded to the nearest 1000? 177000 Round -21.54 to the nearest integer. -22 What i	{ "pile_set_name": "DM Mathematics" }
0 - -1 - 9 - (865 - 899). 26 What is the value of (6 - (-3 + -3 + 8)) + (-22 + 0 - 0)? -18 What is -487 - -476 - (-4 + 9 - (-43 + -3 - 1))? -63 What is the value of 0 - 51 - ((27 - 13 - (-4 + 30)) + 10)? -49 Calculate 18 - ((-8 + 18 - 36) + -8). 52 What is 18 - (8 - (20 + 11 + -20) - -8)? 13 (1 - -10) + (29 - (15 - -8)) + -26 -9 What is -64 + -2 - (28 + (1 + -17 - (-75 + 98)))? -55 What is the value of -138 + 34 - (-8 - -2 - (-38 - -51))? -85 What is the value of (-387 - -386) + -3 + 39 + 2? 37 What is -46 + (0 + 22 - (22 - 9)) + -13? -50 Evaluate (6 - -11) + (-17 - (-77 + 31)). 46 -71 + (58 - 7) + -2 + 40 18 Calculate (-37 - 9) + 0 + -9 - (3 - 20 - -5). -43 Calculate 146 - ((-26 + 4 + 12 - 5) + (3 - -26)). 132 Calculate (3 - 4 - (-1 + 4)) + (117 + -65 - 36). 12 (-20 + (-16 - -37) - -5) + (97 - 2) 101 0 + (10 - (29 + -3 + -10)) + -23 -29 -16 - -1 - (12 - 6) -21 What is (-16 - -6) + (64 - (15 - 14) - 24)? 29 (-14 - -31 - (29 - 2)) + 32 22 Calculate (627 - 589) + (2 - (2 - 18)). 56 What is 0 + 5 + -2 + 5 - (289 - 292)? 11 Calculate (28 - (-18 - -31)) + (29 - 2). 42 -3 + -169 + (-7339 - -7421) -90 Calculate 0 + -1 + 49 + -21 + -62 + -12. -47 Evaluate -10 + (155 - 46 - 54). 45 -1 + (3 - 23) + (-1106 - -1079) -48 Evaluate (-9 - 1 - 2) + (43 - 18) + 9 + -7. 15 What is the value of (-188 - -192) + (13 - 6)? 11 What is (-151 - (-87 + -32)) + -1 + 63? 30 What is -23 + (-1 + -12 - -31) + -3? -8 -158 - 6 - ((-16 - -11) + 1 + -20) -140 -1 - (13 + -1) - (-68 - -38 - 27) 44 Evaluate -5 + 9 - 5 - 4 - -66 - (355 + -345). 51 Evaluate -146 - (-98 + (-134 - -103)). -17 (-1 - 64) + (-35 - (-88 + 33) - 9) -54 Evaluate (36 + -53 - (0 - 1)) + -57. -73 What is the value of -20 + (14 - 61 - -103)? 36 (5 - 2) + -1 + -60 + 59 + -7 -6 -49 + (-189 - -217) - (0 - 60) 39 What is 13 - (20 + 0 + -321 + 323 + 21)? -30 Evaluate 28 - (-109 + (42 + 41 - 39)). 93 Calculate 7 + 19 + -9 + (-15 - -34). 36 What is the value of ((5 - -53) + 2 - 18) + 10? 52 0 + -9 - (19 + -24 + -8) - -8 12 What is (-4 + 2 + 7 - 11) + 10 + -1? 3 Evaluate -4 + 54 - 4 - 81. -35 Evaluate -39 + (-14 - 1) + (6 - -11). -37 What is -10 + (7 + -14 + -8 + 18 - -14) + -116? -109 Evaluate (-1 - 11) + 12 + -23 - (8 + 7). -38 What is the value of (-173 - -50) + (2 - 3) - (-1 - (24 - 10))? -109 Evaluate (-32 - (-12 + 25 + -13)) + 76. 44 49 - ((12 - 33) + 20) 50 What is -85 - (-13 - 15 - 14)? -43 Calculate 21 + 5 + -12 - 1 - ((57 - 1) + -10). -33 What is the value of -48 + 0 - (373 + -417)? -4 Calculate -1249 + 1160 + 6 + 2. -81 8 - -3 - (77 + -87) - 37 -16 -16 + 54 + 2 + -1 + 36 75 Calculate -43 - 0 - 17 - (3 - -6). -69 -6 + -3 + 14 + (23 - 18) + -61 -51 What is the value of 23 + -63 + 129 + -87? 2 Calculate (12 + (11 - 49) - (-12 + 0)) + -14. -28 -8 + (-9 + (-6 - (-12 - -7)) - -9) -9 What is the value of 22 + 18 + -11 + -7? 22 Evaluate 40 + (-21 - -19 - (2 - 11 - -1)). 46 What is 25 - (0 + 5 - (34 + -40))? 14 Evaluate 17 + -2 + 3 + -5 + 42. 55 Calculate 2 + -18 - (-54 - (-4 + -47)). -13 Calculate -10 - (58 + 94) - -75. -87 Calculate -10 + 2 + (5 - -1) + (-5 - -12) - 33. -28 Calculate (-12 + 1 - (6 + -28)) + -102 + -6 + -3. -100 Calculate (-786 - -721) + (2 - (-2 - -2)) + 1 + 5. -57 Evaluate 38 + (21 - -3 - 44 - 11). 7 Calculate 110 + (-5 - -22 - 36) + -4 + (-2 - 3). 82 What is the value of -23 + (-22 - -3 - -40) + -22? -24 Evaluate (122 - (25 - 22 - -12)) + -10. 97 What is -30 - (-15 - 6) - (5 + (-3 - -1))? -12 Calculate (-14 - -9) + 1 + 17 - (-36 + 29). 20 Calculate 83 + -65 - (3 - -37) - (0 - 2). -20 What is the value of 0 + 1 + 2 + 14 - (-5607 + 5600)? 24 Evaluate (69 + -35 - 32) + (13 - -1 - 0). 16 Evaluate (25 - 2 - (56 + -44 + 0)) + (66 - -3). 80 What is the value of 9 + (-8 + -3 - ((-16 - -1 - 4) + 5))? 12 -11 + (-9 - (-13 - -19 - (-4 - -22))) -8 Calculate 10 - (143 - (49 - -225)). 141 Calculate 20 + (11 - (-2 + -7 - -3)) + -7. 30 Calculate 75 + 0 + (1 + 3 - (20 - 3)) - -1. 63 What is 12 + (92 - (71 + -18)) + (2 - -14)? 67 -51 + 79 + -39 + 19 8 Calculate 9 - (13 + -4 + -3 - -8) - (-102 - -9). 88 Calculate -29 + (-12 - (-70 + 16)). 13 What is (22 - 0) + 26 + -22 + -6 - 128? -108 (129 - 119) + -40 + (-2 - -3) -29 What is the value of (8 - 16) + 25 - ((-5 - -17) + 78)? -73 Calculate -33 + (-9 - -78 - (-176 - -192)). 20 What is 0 + -4 - -17 - (34 - 15) - (-12 + 24)? -18 What is the value of 93 - 180 - (-30 - 6)? -51 Calculate 20 + -40 + -17 + 42 + (0 - 62). -57 What is the value of (-205 - -56) + 28 + 156? 35 Calculate (110 - 223) + 102 - -128. 117 Evaluate 8 - 10 - (2 - (3 - 2)) - (-8 + 31). -26 Calculate (21 - 0) + (-101 + 44 - -6) + 103. 73 -4 - (39 + (-99 - -51)) 5 5 - (-17 + -2) - (48 + (6 - 73)) 43 What is 29 + 28 - 20 - -1? 38 Calculate -127 + 223 + -95 + -2 + (0 - 0) + -26. -27 (-7 - 1 - (-803 - -799)) + (2 - -8) 6 Calculate 9 + 6 + (-2 - -2) + 26 + -22. 19 What is -8 + 7 - -119 - 1 - (2 + 2)? 113 Calculate 49 + 32 + -3 + -20. 58 (-9 - 50) + 33 + -20 -46 What is -24 - (-3 - (-19 + 28))? -12 What is the value of 6 + 3 + (-5 - -12 - 8) + 53? 61 28 - (13 - (-36 + (-9 - -24))) -6 What is the value of 2 + 12 + (8 - 51 - (-15 + -46))? 32 What is the value of (0 - 60) + (44 - 73) + (0 - -27)? -62 Evaluate 66 + (-18 - -1 - (-18 + -43 + 64)). 46 Evaluate -17 + (-72 - -4) + -13 + (-1 - (10 - -4)). -113 Calculate (-232 - -168) + 8 + -18 + 9 + -11. -76 (33 - 3 - 4 - -1) + (20 - (-64 + 93)) 18 What is ((-6 - -14 - 19) + 8 - -13) + (46 - 1)? 55 What is the value of (54 - (1 - 2) - (237 - 247) - 12) + -8? 45 Evaluate 14 - ((-3 - -2) + -8 - ((69 - -1) + -82)). 11 What is ((-14 - -8) + 1 - 8 - -17 - -37) + -3? 38 What is the value of 275 + -202 + (2 - 57)? 18 What is the value of 27 + -2 + -153 + 170? 42 (0 - 41) + 1714 + -1672 1 What is (-110 - -38) + (16 - 5) - -21? -40 Calculate -2 + 15 - -17 - (8 - -14). 8 (2 - 14) + 3 + (71 - 38 - 73) -49 Evaluate -32 + 15 + -15 + -10 - (0 + -6). -36 Calculate -36 - -73 - (-1 - 8). 46 Evaluate -18 + ((-10 - -56) + 24 - -31). 83 What is -7 + 0 + -10 + 12 + -2 + 7? 0 What is 49 - (64 - 15 - -17)? -17 -2710 + 2632 - (-2 + -41) -35 What is the value of (46 - (8 + 41)) + 58? 55 What is the value of (3 - -17) + (-117 - -129)? 32 What is the value of 57 + (8 - (49 + -69 + -20))? 105 Evaluate 129 - (-79 - (-1 + -146)). 61 What is 1 + -45 - ((2 - 40) + (-2083 - -2108))? -31 What is 117 + -46 + (-117 - -53)? 7 (24 + 1 - 3) + (2838 - 2900) -40 What is 16 - (11 + (18 - 50)) - 48? -11 -146 + 42 + 27 + 53 -24 Calculate (41 - (29 + -10)) + (-66 - 16). -60 What is the value of 48 + -82 + 94 - 125? -65 28 + (-95 - (-52 + 30)) -45 What is the value of -69 + (-5 + 3 - (-49 + 41 + (11 - -2)))? -76 What is (-38 - 2) + 101 + -5? 56 What is the value of -20 - -1 - (-122 - (61 - 177)) - (-143 + -1)? 131 Evaluate -115 + 127 + (-3 - 0) + (-1 - 58). -50 Calculate (-14 - (7 - (49 - 9))) + -9. 10 Evaluate 8 - (-4 - -1 - ((-3 - -23) + -36 + 11)). 6 -47 + 46 + -41 + 3 -39 -5 + (11 + -1 - 24) + -9 - -13 -15 (-223 - -236) + 5 + (-80 - -1) -61 Calculate -1 + 4 - 1 - (57 - 78). 23 What is -8 + -9 + -44 - -42? -19 What is the value of 90 - 0 - (12 + (-1 - -16 - (-382 - -413)))? 94 76 - (16 + 67) - (-31 - -4 - -4) 16 Calculate (11 - 11) + 6 + 0 - -1 - (-45 + 3). 49 What is -19 + (15 - ((10 - 15) + -12))? 13 (-62 - ((-7 - 1) + 12 + -7)) + -18 + 3 -74 (-5 + -138 - (61 - 88)) + 30 -86 1785 + -1733 + (1 - 4) - 0 49 10 + -26 + 12 - (10 + (-20 - -5)) 1 What is -4 + (172 + -82 - 87)? -1 Calculate (26 - 2) + 4 + (-23 - (-17 - 3)) + 10. 35 What is (-12 - -6 - 66) + (61 - (27 + 16))? -54 What is -65 + (-14 - -66) + (1 - -2) + 89? 79 Calculate 678 + -650 - (0 + 73). -45 Calculate 17 + -8 + -8 + 9 + 28. 38 What is the value of -178 - -226 - (-23 + -28)? 99 (-11 - 3) + 2 + -1 + -158 + 177 + -62 -56 Calculate -617 + 577 - (-1 - -10 - 13). -36 What is the value of -51 - ((-107 - -99) + (6 - (0 + -4)))? -53 Calculate -24 + 3 + 56 + (-1 - -74). 108 0 + 10 - (-52 + 57) - (-10 + 3) 12 Calculate 59 + (-36 - -11 - 7) + 34. 61 Calculate -1 + (-1 - 0) - (-27 - (-39 + 8)). -6 What is the value of (-536 - -446) + 72 - (1 - (-2 - (-1 - -1)))? -21 Evaluate -32 - 3 - (-17 + 48) - -19. -47 What is 3 + 0 + 0 + (-18 + -1 - -25)? 9 (23 - 18) + -9 - (54 - (-2 + 1)) -59 21 - (132 + -117 + 9 + -1) -2 Calculate -2 + -28 + -1002 + 996. -36 What is 27	{ "pile_set_name": "DM Mathematics" }
5 Let h be 524/6 + 2/3. Let j be (-4)/22 + 1600/h. Solve -2l + 14 = -2f, -3f + j = -5f + 4l for f. -5 Let u = 178 + -169. Suppose -2 = -4t + 34. Solve 7c - 4c + 3d + u = 0, t = -2c - 5d for c. -2 Suppose -4 = 2f + 5j + 2, j = -2. Suppose -y - y = -fm, -3m + 2y + 2 = 0. Solve 0 = -z - 4w - 1, -4z - mw = -2z + 2 for z. -1 Let y(o) = 4o + 29. Let i(v) = -v3 - 13v*2 - 12v - 6. Let f be i(-12). Let p be y(f). Solve -pq + 3g - 5 = 0, -g + 2g + 1 = 3q for q. 2 Suppose 4f - 7 = 3h + 8, -4f - 2h + 10 = 0. Let m be ((-33)/(-9) - f)/((-1)/(-3)). Solve 2k + 8 = mc, 0 = -c + 3k + k + 7 for c. 3 Let n be 13 + 8/(8/(-7)). Solve g = -2g + 3p + 9, 0 = -3g + 2p + n for g. 0 Suppose 0 = -2k + 76 - 68. Solve 4d - 5z = 3, -4d + 0z = -kz for d. -3 Let v(c) = -c3 + 4c*2 + 9c + 7. Let i be v(6). Let s = 18 + i. Solve g + 2g + 20 = 5h, -2h + g + s = 0 for h. 1 Suppose 16s + 15 = 21s. Solve -4l = -3z - 4, 2z + 2l + sl = 28 for z. 4 Suppose 33b - 38b - 10 = 0. Let i be b - 0 - -4 - -2. Solve 5x = -ip - 26, 3x + 0p + 2 = p for x. -2 Suppose 5d + 4u - 40 = 0, 7 + 3 = 2u. Solve w = 3f + d, 2w + 2f - 12 = -w for w. 4 Let n be (-2)/9 + (-368)/(-36). Let a be 15(n + -8). Suppose -3g + a = -g. Solve -gr = -2r - 5m - 2, 3r = 3m for r. -1 Let v(g) = -g*2 - 6g + 4. Let b be v(-5). Let k(r) = 4r - 6. Let y be k(b). Let p be (-45)/y - 22/(-4). Solve pw - 20 = -n, -2n = -3w + 7w - 24 for w. 4 Let v(w) be the third derivative of -w5/60 + w4/4 + 2w*3 - 9w*2. Let z be v(7). Let n be (0 - 3)/((-3)/z). Solve -6u + 4 = d - u, 5u + 20 = nd for d. 4 Suppose 2v + 4w + 9 + 3 = 0, -v - 5w = 6. Let n be (-4)/v - (-16)/(-24). Solve nt - t = z + 7, t + 2z = -10 for t. -4 Suppose 0z = 25z - 125. Solve -5v + zb - 5 = 0, -3v + 2b - 2 + 4 = 0 for v. 4 Let u be ((-1)/3)/(((-10)/15)/2). Suppose -3h = -5i + 12, -4i - u = -4h - 17. Solve -5l - n + 14 = i, -6 = 2l - 3l + 3n for l. 3 Suppose 24r - r - 12r = 0. Solve 0 = -5d - 10, r = 6h - h + 2d - 16 for h. 4 Let u(w) = -2w3 - 12w*2 + 5. Suppose 24 = -7o + 3o. Let t be u(o). Solve 5a - tk = -k, a - 5k + 21 = 0 for a. 4 Suppose -4u + 13 = 1. Suppose ud - 31 = -5p, p - 1 = 2p - 3d. Solve -4 = 5h + 2t - 18, 4h - 31 = pt for h. 4 Let l(b) = -b3 - 7b*2 - 7b + 8. Let t be l(-6). Let a = t + -5. Solve -3g - 11 = -5k, 0 = -3g - 0g + a for k. 4 Let y(f) = 10f - 39. Let d be y(4). Solve -5c - 5r = -6 - 19, -4c = -3r + d for c. 2 Let b = 208 - 203. Let i = 6 - 2. Solve o = -iu + 24, -u - 2 = -3o + b for u. 5 Let q(f) = f2 + 3f + 3. Let m be q(-3). Suppose 3t = 6t - 6. Solve 2u - 21 = -th - mh, -3u + h = 11 for u. -2 Suppose 4 = -l - r + 3, -15 = -3l + 3r. Solve 4v = -16, lm + 5v + 21 = m for m. -1 Suppose 12j - 11j = m - 8, 0 = -3m + 5j + 28. Solve -4r + 3a = m, 4r + 7 = 2a + 3 for r. 0 Let s(q) be the third derivative of q4/2 + 11q*3/6 + 18q*2 - 2q. Let u be s(0). Solve 0c = 5n - 4c + u, 0 = n - 3c + 11 for n. 1 Suppose 0i - 48 = 3i. Let y(h) = -h*3 - 15h*2 + 16h + 3. Let p be y(i). Solve 4g + pb = -11, g + 0g - 2b = 11 for g. 1 Suppose 5s = 3o - 4, 0 = 4s - o - 2o + 2. Let x = -2 + -3. Let r = s - x. Solve 2v = -4, -w = rw - 3v - 10 for w. 1 Suppose 2g + 5 = 5p, -1 + 4 = p. Solve 0 = gj + 2c - 7, -3j + 2 = -j + c for j. 3 Let i(c) = -c*3 + 9c*2 + 9c + 13. Let z be i(10). Solve zr = -3v + 18, v + 3 = -v + r for v. 1 Suppose 12 = 5w + 2d, 4w - 8w = -3d - 28. Suppose 4c = -2b + 16, -5c - 5 = 5b - 35. Solve 14 = 5s + 2y, -4y = bs - 0y - w for s. 4 Let d(r) = -r + 3. Let s = -8 + 14. Let x be d(s). Let y be (-1)/(14/(-4) - x). Solve -3o - c = 2o, -27 = yo - 5c for o. -1 Let j(n) = -n*3 - 7n*2 - 5n + 10. Let m be j(-6). Solve 5w + 2t + t + 35 = 0, mt + 8 = 3w for w. -4 Let i = 134 + -129. Solve 0 = 3r + 3, 2l - 4r = il - 5 for l. 3 Let k(l) = 3l2 + 7l - 16. Let y be k(5). Let f = -92 + y. Solve 0 = i - 0z + z - 9, -2i - f = -2z for i. 4 Let c be (-33)/(-12) + (-1)/(16/12). Solve 0 = -5j - 3q + 13, -cj - 3q - 22 = -4j for j. 5 Let z(u) = -u + u*2 - 2 + u + u. Let r = 37 + -41. Let o be z(r). Solve 5y = -o, -y - 3 = -d + 2y for d. -3 Let l = -37 + 33. Let j be 12/(-30) - -4 - l/10. Solve -5v + 4s = 15, jv - 5s + 23 = 2v for v. 1 Let k be (1 - 1)/(-9 + 10). Suppose 4i + m - 9 = k, m - 5 = i - 3i. Solve c = 3b - 4, -3c = -ib + 3b + 12 for c. -4 Let y(p) = -p + 2. Let a(j) = -j*3 - 5j*2 - 2j + 7. Let h be a(-5). Suppose hf = 14f. Let u be y(f). Solve -ux = 5g - 17, -2g + 0g = 3x - 9 for x. 1 Let m(n) = -n3 + 12n*2 + 15n - 23. Let t be m(13). Solve 3p = -i - 4, -16p - t = -2i - 11p for i. -1 Let w = 25 - 62. Let f = -37 - w. Solve 4s - 6 = -3r + 17, -4s - r + 13 = f for s. 2 Let d = 25 + -21. Suppose dy + y = 125. Solve 3q - 15 = -0, 4q = u + y for u. -5 Let z be 184/18 - (1 - (-21)/(-27)). Suppose -5b = -z, 0 = -d + b + b + 1. Solve -5i - 1 = -3x, 0 = -dx - 17 + 2 for i. -2 Suppose 3b + 3a = 66, -3b + 4b - a - 12 = 0. Let s(m) = m - 14. Let p = 17 - 1. Let q be s(p). Solve 3x = 2h - 4, 3h + qx = 2 + b for h. 5 Let f(h) = h3 + h2 - h. Let m be f(-1). Suppose 0 = 2u - 5 - m. Suppose 18 - 78 = -3l. Solve 0 = -uc - 9, o - l = 2o + 5c for o. -5 Let s be -6 - (63/(-9) - 3). Solve 2x - sn - 2 = 0, 4x - 4n + n = 9 for x. 3 Let r be 3(-1 - -4)/3. Solve -rh - 3 - 7 = -f, 8 = 2h + 3f for h. -2 Let l be (-4)/4(13 + 1/1). Let x = 18 + l. Solve -x = n, -n - 20 = -c + 4n for c. 0 Suppose -3s - s + 228 = 0. Suppose s + 3 = 5p. Solve -a + 8 = 5t, 3a - 2t + 5t - p = 0 for a. 3 Let i = 318 + -219. Let x = i + -94. Let a(p) = 3p - 1. Let f be a(1). Solve fd = -g + 3g, -4d = -xg - 4 for d. -4 Let f be (-4)/(-10) + 96/60. Suppose p + f = 4. Solve 5a + 16 = -q, q = a + pq for a. -4 Let b = 7 + -5. Let j be (-4)/6 - b/6. Let z be 1 - j - (-1 - -1). Solve v = -m + z, -2v - 2v = -2m + 10 for m. 3 Let i be -3 - -6 - (0 + 1). Suppose -v - 4 = -y - iy, -5v - 20 = 4y. Solve -2 = 4t + 4n + 34, -n - 4 = y for t. -5 Suppose 0 = 8c - 5c - 9. Suppose 3o - 4o + c = 0. Solve 3t + o = -i + 4, -3t + 5 = 5i for t. 0 Let h be -3 + 2 + 1 + -12. Let u(c) = -4c - 41. Let d be u(h). Solve -a = 3p - d + 23, 0 = 2a + 8 for p. -4 Suppose 2p + 6 = 2u, 0p + 2p + u = 6. Let i(o) = o - 4. Let n be i(6). Let z be ((-2 + n)p)/2. Solve -6 = -h - 5m, zm + 2 = h + m for h. 1 Let f be 2/(-6) - 938/(-402). Solve 0 = fs + u - 3, 0 = -17s + 14s - 5u + 8 for s. 1 Suppose 0o = -4o - 104. Let p = -21 - o. Solve -2f + 0f + 2m = -6, -3f + 2m = -p for f. -1 Let a be 2/18 + (-52)/(-18). Suppose 7 = -4i + 5o, -i - o - a = -4i. Solve -8 = 4y - 2n, 8 = -iy - 2y + 3n for y. -2 Let b be (2-4 - 1)/(3/2). Let q be b/2 - (2 - (-1 - -6)). Solve q = -4o + w - 6, 2o + 10 = 3w + 2 for o. -1 Let l(w) = w - 5. Let k be l(-6). Let v = k - -14. Suppose 5x - 97 = v. Solve -8 = 2f, d - 2d + 4f = -x for d. 4 Let r be 134/9 + 1/9. Let l = r + -12. Solve 2y - 2f - 4 = 0, 0 = -4y + lf - f + 2 for y. -1 Let d = -13 + -2. Let j be (-4)/6828/(-24). Let u = d + j. Solve 16 = -4v + b, b = 3v - uv - 29 for v. -5 Let r = -16 - -6. Let m = r + 22. Let h = -6 + m. Solve -2b = o + 3, ho = 2o - 4b - 16 for o. -5 Suppose -4h - 10 + 32 = 5r, 0 = -2r + 5h - 11. Solve -ru = 2o, o - 8 = u - 0o for u. -4 Let z be (2/3)/((-38)/(-285)) + -3. Solve -z - 1 = -3g - 3i, -3i + 11 = 5g for g. 4 Let m(d) = d2 - 10d + 11. Suppose 27 = 2f - 4g - 3, -36 = -3f + 3g. Let c be m(f). Solve -8a + 4a + 8 = 0, 0 = 4z - 5a + c for z. 2 Suppose n = -n + 16. Suppose -nk = -7k. Solve 3m + 1 = 2b, -m + kb + 2b - 3 = 0 for m. 1 Let o = 12 + -14. Let h be o + (1/2 - -2)2. Solve -ha - w = 0, -2a + 5w = w for a. 0 Let s be (-1 - (3 - 1))5/1. Let z(k) = k + 18. Let x be z(s). Solve xu - 15 = 3p, 4p + 4u = -8 - 4 for p. -4 Let i = 16 + -13. Suppose 0 = if - 2f. Suppose f = -2u - 1 + 5. Solve -3w + 0w - 5g = -11, -w + ug = 11 for w. -3 Let o(p) = p*3 - 2p*2 + 3p + 2. Let k(j) = -j3 + j2 - j - 1. Let r(n) = 2k(n) + o(n). Let t be r(0). Solve 3 = -2v -	{ "pile_set_name": "DM Mathematics" }
when four letters picked without replacement from {r: 3, f: 8}? 14/55 What is prob of picking 1 c and 1 a when two letters picked without replacement from bcca? 1/3 Two letters picked without replacement from mwrncnrvcvcmmvnnvcmr. Give prob of picking 1 n and 1 w. 2/95 Three letters picked without replacement from zhzbzzzhzzhhb. Give prob of picking 1 z and 2 b. 7/286 Calculate prob of picking 2 o and 1 n when three letters picked without replacement from {b: 3, t: 3, z: 1, x: 1, n: 7, o: 2}. 7/680 Two letters picked without replacement from {s: 2, b: 9, i: 3, u: 4}. Give prob of picking 2 s. 1/153 What is prob of picking 1 u and 1 i when two letters picked without replacement from umujicbci? 1/9 Four letters picked without replacement from kkkrwwkwkr. What is prob of picking 1 k and 3 w? 1/42 What is prob of picking 1 g, 1 h, 1 q, and 1 s when four letters picked without replacement from {h: 1, j: 1, c: 1, g: 1, s: 1, q: 2}? 2/35 What is prob of picking 2 l and 2 w when four letters picked without replacement from {w: 7, l: 5}? 14/33 Calculate prob of picking 1 v, 1 s, and 2 d when four letters picked without replacement from {s: 8, v: 2, d: 7, p: 2}. 28/323 Four letters picked without replacement from {n: 4, z: 1, j: 1, b: 2}. What is prob of picking 1 z, 1 n, 1 j, and 1 b? 4/35 What is prob of picking 1 g and 1 j when two letters picked without replacement from {g: 3, f: 3, n: 1, j: 1, k: 3}? 3/55 Calculate prob of picking 1 d and 2 f when three letters picked without replacement from {z: 3, k: 5, c: 1, f: 2, d: 6}. 3/340 Calculate prob of picking 2 o when two letters picked without replacement from {c: 15, o: 3}. 1/51 Four letters picked without replacement from lrlrll. Give prob of picking 2 r and 2 l. 2/5 Calculate prob of picking 2 i when two letters picked without replacement from iiiiiii. 1 Calculate prob of picking 1 x, 1 g, and 1 e when three letters picked without replacement from gkwex. 1/10 Three letters picked without replacement from {r: 8, c: 4, o: 2, x: 1}. What is prob of picking 1 c, 1 r, and 1 o? 64/455 Three letters picked without replacement from ziiiiiunzzzzizizii. What is prob of picking 1 u and 2 i? 3/68 What is prob of picking 2 g when two letters picked without replacement from {u: 7, o: 2, g: 7, y: 2}? 7/51 Calculate prob of picking 3 c and 1 p when four letters picked without replacement from {p: 9, c: 10}. 90/323 Four letters picked without replacement from wbbffxbwwwwbbwwwwb. Give prob of picking 1 w, 2 b, and 1 x. 3/68 Two letters picked without replacement from {r: 1, f: 1, c: 1, d: 4, z: 1}. What is prob of picking 1 r and 1 z? 1/28 Three letters picked without replacement from bmbbbuummbumbub. What is prob of picking 2 m and 1 u? 24/455 Three letters picked without replacement from {b: 4, d: 2}. What is prob of picking 1 b and 2 d? 1/5 Two letters picked without replacement from oorostprptnprptornrp. What is prob of picking 1 r and 1 s? 1/38 Three letters picked without replacement from {j: 1, h: 3, l: 3, o: 1, b: 1, p: 2}. Give prob of picking 1 h, 1 b, and 1 j. 1/55 What is prob of picking 2 o when two letters picked without replacement from omoofoooo? 7/12 What is prob of picking 1 b, 1 r, and 1 v when three letters picked without replacement from bbrrrrbbrrbvrbrrbrb? 80/969 What is prob of picking 2 q when two letters picked without replacement from eqqgq? 3/10 Calculate prob of picking 2 d when two letters picked without replacement from {m: 7, d: 4}. 6/55 Calculate prob of picking 1 j and 1 z when two letters picked without replacement from zjzjzzhjthhz. 5/22 Two letters picked without replacement from nqzzdnoqdqqizid. What is prob of picking 2 z? 1/35 Four letters picked without replacement from {b: 1, i: 1, d: 4, l: 11, s: 2}. What is prob of picking 1 d, 2 s, and 1 l? 11/969 Four letters picked without replacement from iiwisiiiiiiiwiw. What is prob of picking 3 w and 1 i? 11/1365 What is prob of picking 1 j and 1 s when two letters picked without replacement from {s: 2, x: 2, j: 2, b: 2}? 1/7 Calculate prob of picking 2 l when two letters picked without replacement from bllollollblbobo. 1/5 Two letters picked without replacement from ykykkck. Give prob of picking 1 k and 1 y. 8/21 Calculate prob of picking 3 z when three letters picked without replacement from {b: 4, c: 1, g: 2, y: 3, z: 4}. 1/91 Calculate prob of picking 2 s and 1 b when three letters picked without replacement from {p: 1, b: 3, z: 1, s: 7}. 63/220 Three letters picked without replacement from adqqkqakjk. Give prob of picking 1 a and 2 k. 1/20 Two letters picked without replacement from {j: 2, s: 1, t: 2, u: 1}. Give prob of picking 1 s and 1 j. 2/15 Two letters picked without replacement from {a: 5, w: 7, r: 2}. Give prob of picking 1 r and 1 w. 2/13 Two letters picked without replacement from vvvthvthvh. Give prob of picking 2 v. 2/9 Two letters picked without replacement from qwbsbssqsj. Give prob of picking 1 b and 1 w. 2/45 Two letters picked without replacement from {g: 2, w: 2, u: 2, h: 1, z: 1, y: 1}. Give prob of picking 1 y and 1 g. 1/18 Four letters picked without replacement from {m: 3, h: 1, b: 3, y: 3}. Give prob of picking 1 y and 3 m. 1/70 What is prob of picking 1 p, 1 k, and 1 a when three letters picked without replacement from {a: 2, p: 1, c: 1, k: 1, y: 1, v: 1}? 2/35 What is prob of picking 3 z and 1 r when four letters picked without replacement from {z: 5, s: 4, r: 2}? 2/33 Calculate prob of picking 1 w and 1 u when two letters picked without replacement from {e: 1, f: 1, h: 1, u: 1, w: 1}. 1/10 What is prob of picking 3 b when three letters picked without replacement from {b: 3}? 1 Two letters picked without replacement from {d: 2, f: 11}. Give prob of picking 2 f. 55/78 What is prob of picking 2 w when two letters picked without replacement from aaaaaaaawaawwa? 3/91 Calculate prob of picking 1 u and 1 f when two letters picked without replacement from qfluqqi. 1/21 What is prob of picking 1 z, 2 x, and 1 c when four letters picked without replacement from {o: 1, l: 5, p: 3, c: 1, z: 3, x: 2}? 1/455 Three letters picked without replacement from {a: 6, d: 2}. What is prob of picking 3 a? 5/14 Three letters picked without replacement from ajabjjbbbg. Give prob of picking 2 b and 1 g. 1/20 Calculate prob of picking 1 m and 1 l when two letters picked without replacement from {l: 2, y: 3, m: 3}. 3/14 What is prob of picking 1 i, 1 f, 1 m, and 1 d when four letters picked without replacement from fmmfgiidv? 4/63 Two letters picked without replacement from dgligggl. Give prob of picking 2 g. 3/14 What is prob of picking 2 p, 1 j, and 1 d when four letters picked without replacement from {p: 3, m: 2, j: 1, d: 1}? 3/35 Two letters picked without replacement from xxdxdxxxx. Give prob of picking 2 x. 7/12 Three letters picked without replacement from guupguuuuugigpusgggg. What is prob of picking 3 g? 14/285 Four letters picked without replacement from {t: 1, g: 2, n: 2, e: 1, u: 4}. Give prob of picking 2 n and 2 u. 1/35 Calculate prob of picking 1 x and 1 c when two letters picked without replacement from cxccccxcccxxx. 20/39 Two letters picked without replacement from ndqn. Give prob of picking 1 n and 1 d. 1/3 Calculate prob of picking 1 l and 1 d when two letters picked without replacement from dmadddqlal. 8/45 Three letters picked without replacement from kekkkkeekkk. What is prob of picking 2 k and 1 e? 28/55 Calculate prob of picking 4 s when four letters picked without replacement from {b: 5, s: 4, g: 2}. 1/330 What is prob of picking 1 q, 1 t, and 2 u when four letters picked without replacement from uuuuottutouoquouf? 3/85 Four letters picked without replacement from {l: 5, k: 3, w: 1, g: 3}. Give prob of picking 2 g, 1 k, and 1 w. 1/55 What is prob of picking 2 v when two letters picked without replacement from {i: 3, u: 2, p: 3, b: 2, c: 1, v: 1}? 0 Four letters picked without replacement from {u: 4}. Give prob of picking 4 u. 1 Calculate prob of picking 1 y, 1 u, and 2 p when four letters picked without replacement from uuypuqqpywuwyy. 16/1001 Calculate prob of picking 2 h, 1 s, and 1 q when four letters picked without replacement from qqqllhlqqsbmmmmmhh. 1/204 Two letters picked without replacemen	{ "pile_set_name": "DM Mathematics" }
470642? False Is 19839202 a multiple of 260? False Does 3 divide 82021? False Is 23040 a multiple of 10? True Does 16 divide 7461440? True Does 22 divide 806748? False Is 70278 a multiple of 422? False Is 27 a factor of 1589274? True Does 190 divide 152051? False Does 11 divide 3909723? False Is 85 a factor of 13457514? False Is 8 a factor of 96621? False Is 952 a multiple of 4? True Is 54252 a multiple of 2? True Is 4834567 a multiple of 1365? False Does 65 divide 1761760? True Is 855535 a multiple of 431? True Is 2772247 a multiple of 55? False Does 36 divide 113796? True Is 4 a factor of 409396? True Is 332520 a multiple of 102? True Does 73 divide 349524? True Is 1795119 a multiple of 489? True Does 403 divide 1286376? True Does 23 divide 586408? True Is 2290662 a multiple of 13? False Is 1124 a factor of 16454827? False Is 359 a factor of 785492? True Is 64960 a multiple of 20? True Does 245 divide 14524676? False Is 206281 a multiple of 235? False Does 49 divide 648796? False Is 54 a factor of 168480? True Is 64 a factor of 1956618? False Is 346 a factor of 455682? True Does 35 divide 5703425? True Is 103955 a multiple of 17? True Is 699639 a multiple of 4? False Is 1150501 a multiple of 240? False Is 627 a factor of 4471663? False Does 18 divide 74782? False Does 170 divide 2383857? False Is 164 a factor of 102636? False Does 416 divide 2993609? False Is 472163 even? False Does 219 divide 8913957? True Is 175521 a multiple of 123? True Is 33338 a multiple of 158? True Does 88 divide 2009157? False Is 8111320 a multiple of 59? True Does 197 divide 3493992? True Does 5 divide 599455? True Is 3245161 a multiple of 283? True Is 128 a factor of 403712? True Is 113 a factor of 899509? False Is 9948605 a multiple of 1033? False Is 2299992 a multiple of 24? True Does 64 divide 229568? True Does 10 divide 168279? False Is 137624 a multiple of 11? False Is 15 a factor of 2062127? False Does 401 divide 188069? True Is 150533 even? False Is 5 a factor of 670993? False Does 11 divide 3845486? False Is 141491 a multiple of 203? True Does 375 divide 18744750? True Does 11 divide 154110? True Is 1256969 a multiple of 298? False Is 636 a factor of 15668496? True Does 30 divide 384360? True Does 67 divide 44622? True Does 16 divide 335306? False Is 479374 a multiple of 706? True Is 17 a factor of 55764? False Is 62 a factor of 133796? True Is 149994 a multiple of 36? False Is 157 a factor of 362668? False Is 473 a factor of 2768376? False Is 29918179 a multiple of 274? False Is 21 a factor of 1169047? False Does 36 divide 19391004? True Is 194886 a multiple of 178? False Is 323 a factor of 1106598? True Is 7149909 a multiple of 767? False Does 31 divide 6237126? False Is 2467881 a multiple of 27? True Is 10 a factor of 507580? True Is 3546315 a multiple of 327? True Is 23265 a multiple of 165? True Does 50 divide 4672032? False Does 1393 divide 5144455? False Does 98 divide 67098? False Is 3827725 a multiple of 11? True Is 16230 a multiple of 30? True Is 118515 a multiple of 58? False Is 15161 a multiple of 25? False Does 10 divide 1158859? False Is 208 a factor of 131388? False Is 38 a factor of 723368? True Is 11 a factor of 564652? True Does 175 divide 837725? True Is 72 a factor of 51840? True Is 5 a factor of 18075? True Is 259 a factor of 1578605? True Does 205 divide 184748? False Is 97 a factor of 156461? True Is 1609 a factor of 20337760? True Is 32 a factor of 8192? True Is 171 a factor of 4415532? False Does 47 divide 3167706? True Is 21 a factor of 3257456? False Is 777 a factor of 9972018? True Does 13 divide 1840982? True Is 25 a factor of 12337025? True Is 23622 a multiple of 170? False Is 593924 a multiple of 7? False Is 86 a factor of 45752? True Does 82 divide 8906613? False Is 439620 a multiple of 510? True Is 64 a factor of 8316? False Is 19815 a multiple of 9? False Does 193 divide 410125? True Does 19 divide 180728? True Is 42 a factor of 1220982? True Is 1463160 a multiple of 24? True Is 60 a factor of 56284? False Is 9 a factor of 48951? True Is 527806 a multiple of 24? False Is 658240 a multiple of 340? True Is 229 a factor of 1287209? True Is 9 a factor of 61065? True Does 5 divide 115160? True Is 44208 a multiple of 36? True Does 16 divide 21488? True Is 12 a factor of 338340? True Is 373 a factor of 3977299? True Does 23 divide 184544? False Does 19 divide 1110683? True Is 7 a factor of 402097? False Is 171 a factor of 63783? True Does 106 divide 145688? False Is 329 a factor of 129311? False Is 6301056 a multiple of 488? True Is 31568046 a multiple of 2575? False Is 14 a factor of 206742? False Does 11 divide 162481? True Is 57 a factor of 8241219? False Is 318 a factor of 154528? False Is 15299 a multiple of 14? False Is 15 a factor of 43335? True Is 214 a factor of 1510840? True Is 15 a factor of 4124100? True Does 6 divide 82980? True Does 433 divide 413034? False Is 9 a factor of 3207123? True Is 93 a factor of 474940? False Is 12397683 a multiple of 198? False Does 25 divide 400425? True Does 591 divide 1780817? False Is 152525 a multiple of 45? False Is 14 a factor of 947288? False Does 13 divide 2701112? False Does 31 divide 8193? False Is 717 a factor of 15733131? True Does 3 divide 1890831? True Is 363 a factor of 936233? False Does 14 divide 1705449? False Does 19 divide 1059820? True Is 28581252 a multiple of 59? True Is 148488 a multiple of 14? False Does 29 divide 1267938? True Is 394 a factor of 10929954? True Does 8 divide 33184? True Does 41 divide 2999232? True Is 838936 a multiple of 497? True Is 2 a factor of 252817? False Is 7575 a multiple of 303? True Is 101 a factor of 4067085? False Is 3664 a multiple of 16? True Does 18 divide 12816? True Is 215215 a multiple of 7? True Is 28 a factor of 3575597? False Is 38654128 a multiple of 38? False Does 37 divide 13653? True Is 11 a factor of 48473? False Is 197775 a multiple of 7? False Is 75056 a multiple of 309? False Is 130 a factor of 34710? True Does 311 divide 12499090? True Is 507 a factor of 2151708? True Does 88 divide 89746? False Is 27 a factor of 8296? False Does 652 divide 387298? False Does 35 divide 1534015? True Is 17 a factor of 1954932? True Is 557450 a multiple of 50? True Is 22768 a multiple of 4? True Does 208 divide 21424? True Is 297709 a multiple of 82? False Is 200834 a multiple of 58? False Is 4062229 a multiple of 7? False Is 647 a factor of 11318618? True Is 2440838 a multiple of 17? False Is 66 a factor of 11674? False Is 36 a factor of 14980870? False Does 23 divide 75302? True Is 8336 a multiple of 19? False Does 6 divide 82320? True Is 869549 a multiple of 10? False Does 10 divide 169400? True Is 2264864 a multiple of 273? False Is 875476 a multiple of 27? False Does 390 divide 1535696? False Does 275 divide 132000? True Does 1187 divide 4673219? True Is 29171 a multiple of 14? False Is 235368 a multiple of 168? True Does 92 divide 562034? False Is 15962 a multiple of 23? True Does 14 divide 864122? True Does 798 divide 1172270? False Is 964774 a multiple of 11? False Is 121992 a multiple of 12? True Does 28 divide 2363749? False Does 25 divide 1271227? False Does 11 divide 21924? False Is 9634933 a multiple of 11? True Is 226687 a multiple of 91? False Does 314 divide 157628? True Is 16 a factor of 179872? True Is 21 a factor of 19550142? False Is 753301 a multiple of 12? False Does 95 divide 23417310? True Is 53 a factor of 14416? True Is 219 a factor of 294337? False Does 40 divide 114922? False Is 466 a factor of 5027674? True Does 245 divide 380240? True Does 16 divide 2898471? False Does 5 divide 53765? True Does 44 divide 34630? False Is 273 a factor of 107155? False Does 331 divide 247588? True Is 63654 a multiple of 206? True Does 5 divide 38770? True Is 11 a factor of 711218? False Is 8449680 a multiple of 190? True Is 3 a factor of 55715? False Is 16249546 a multiple of 23? True Is 46 a factor of 21514? False Is 14130378 a multiple of 244? False Is 2013540 a multiple of 185? True Is 16 a factor of 8394032? True Does 46 divide 140116? True Is 78 a factor of 112022? False Does 1251 divide 7952607? True Does 8 divide 2777501? False Is 7071911 a multiple of 29? True Is 3504818 a multiple of 30? False Is 16606752 a mul	{ "pile_set_name": "DM Mathematics" }
241 List the prime factors of 888708358. 2, 2239, 198461 List the prime factors of 700656031. 700656031 List the prime factors of 1156154741. 7, 165164963 List the prime factors of 30414526. 2, 79, 192497 List the prime factors of 678903407. 7, 13, 7460477 What are the prime factors of 1165252216? 2, 17, 19, 450949 What are the prime factors of 183674529? 3, 431, 47351 What are the prime factors of 102071092? 2, 113, 225821 List the prime factors of 50192671. 719, 69809 What are the prime factors of 5036508686? 2, 11, 59, 3880207 List the prime factors of 186140386. 2, 29, 3209317 What are the prime factors of 1369005231? 3, 11, 41485007 What are the prime factors of 70179593? 11, 6379963 List the prime factors of 742840755. 3, 5, 17, 31, 93971 What are the prime factors of 1603872447? 3, 173, 3090313 List the prime factors of 60729861. 3, 20243287 List the prime factors of 50549140. 2, 5, 2527457 What are the prime factors of 7083331? 7083331 List the prime factors of 180871577. 31, 37, 71, 2221 What are the prime factors of 1021559768? 2, 97, 103, 12781 What are the prime factors of 233899095? 3, 5, 103, 151391 List the prime factors of 6793699008. 2, 3, 463, 76423 What are the prime factors of 300655783? 2477, 121379 What are the prime factors of 1354438454? 2, 761, 889907 What are the prime factors of 719986118? 2, 359993059 What are the prime factors of 2498213640? 2, 3, 5, 13, 41, 139, 281 What are the prime factors of 50864620? 2, 5, 181, 14051 List the prime factors of 209356825. 5, 197, 42509 List the prime factors of 203376824. 2, 7, 3631729 List the prime factors of 34426177. 449, 76673 List the prime factors of 1645932550. 2, 5, 181, 181871 What are the prime factors of 68826513? 3, 7, 1481, 2213 What are the prime factors of 286764045? 3, 5, 41, 466283 What are the prime factors of 4018758248? 2, 17, 19, 1555247 What are the prime factors of 22955583? 3, 7, 79, 101, 137 List the prime factors of 942167778. 2, 3, 17, 37, 249647 List the prime factors of 7072146769. 19, 1531, 243121 List the prime factors of 109901031. 3, 3533, 10369 List the prime factors of 12589819. 11, 1144529 What are the prime factors of 10207502? 2, 5103751 What are the prime factors of 64503912? 2, 3, 11, 244333 List the prime factors of 32801328. 2, 3, 7, 10847 List the prime factors of 56413322. 2, 7, 59, 163, 419 What are the prime factors of 419599436? 2, 104899859 List the prime factors of 212203212. 2, 3, 13, 1360277 List the prime factors of 36000657. 3, 7, 11, 51949 List the prime factors of 36054505. 5, 7210901 What are the prime factors of 60577378? 2, 30288689 List the prime factors of 200821072. 2, 12551317 What are the prime factors of 86462636? 2, 13, 37, 44939 List the prime factors of 1729644785. 5, 11, 277, 10321 List the prime factors of 20958898. 2, 47, 222967 List the prime factors of 344796320. 2, 5, 11, 195907 What are the prime factors of 188557683? 3, 109, 191, 3019 What are the prime factors of 203135479? 19, 3181, 3361 What are the prime factors of 554919473? 12953, 42841 List the prime factors of 26300843. 59, 223, 1999 List the prime factors of 9453393. 3, 19, 59, 937 List the prime factors of 5327423112. 2, 3, 11, 131, 154043 What are the prime factors of 52235493? 3, 113, 154087 List the prime factors of 250155693. 3, 59, 61, 7723 List the prime factors of 13370768. 2, 835673 What are the prime factors of 279726146? 2, 7, 1747, 11437 What are the prime factors of 488101646? 2, 191, 1277753 List the prime factors of 114717981. 3, 7, 181, 30181 List the prime factors of 24758816. 2, 773713 What are the prime factors of 35517383? 11, 47, 68699 What are the prime factors of 6372010183? 7, 11, 19, 23, 409, 463 What are the prime factors of 5056984927? 113, 44752079 What are the prime factors of 640651829? 61, 10502489 What are the prime factors of 2086462311? 3, 695487437 What are the prime factors of 130628009? 41, 127, 25087 What are the prime factors of 7191415? 5, 7, 11, 18679 List the prime factors of 839758724. 2, 7, 17, 1764199 List the prime factors of 78612311. 31, 2535881 List the prime factors of 5744649803. 89, 229, 3167 What are the prime factors of 102209324? 2, 7, 3650333 List the prime factors of 3509220. 2, 3, 5, 11, 13, 409 List the prime factors of 305738631. 3, 11, 343141 List the prime factors of 100402612. 2, 17, 19, 77711 What are the prime factors of 11526810? 2, 3, 5, 384227 List the prime factors of 269752660. 2, 5, 13487633 List the prime factors of 899799608. 2, 112474951 What are the prime factors of 16329092? 2, 13, 314021 What are the prime factors of 121409827? 7, 11, 83, 157 What are the prime factors of 17493067? 17493067 What are the prime factors of 15564525? 3, 5, 139, 1493 List the prime factors of 312426149. 7, 53, 191, 4409 What are the prime factors of 65707272? 2, 3, 29, 31469 What are the prime factors of 7071479081? 1129, 6263489 What are the prime factors of 365954757? 3, 7, 59, 295363 List the prime factors of 58342849. 3821, 15269 List the prime factors of 670908025. 5, 337, 79633 What are the prime factors of 24003166? 2, 11, 1091053 List the prime factors of 15721878. 2, 3, 2620313 List the prime factors of 102631720. 2, 5, 17, 150929 List the prime factors of 121817376. 2, 3, 17, 139, 179 What are the prime factors of 727256514? 2, 3, 73, 503, 3301 List the prime factors of 194976445. 5, 47, 829687 List the prime factors of 37112066. 2, 809, 22937 List the prime factors of 3764135993. 3764135993 What are the prime factors of 870611000? 2, 5, 7, 277, 449 What are the prime factors of 4841970412? 2, 19, 63710137 List the prime factors of 441794462. 2, 220897231 What are the prime factors of 786151182? 2, 3, 19, 6896063 What are the prime factors of 3563688? 2, 3, 83, 1789 List the prime factors of 52498819. 37, 41, 34607 List the prime factors of 2288190251. 163, 359, 39103 What are the prime factors of 8885862? 2, 3, 54851 What are the prime factors of 54404238? 2, 3, 7, 1295339 List the prime factors of 56164997. 7, 541, 14831 What are the prime factors of 2692160597? 7, 19, 2891687 What are the prime factors of 4592677314? 2, 3, 765446219 What are the prime factors of 455667962? 2, 9679, 23539 List the prime factors of 61241201. 7, 8748743 What are the prime factors of 2653048397? 20533, 129209 List the prime factors of 498491430. 2, 3, 5, 16616381 What are the prime factors of 778323338? 2, 13, 53, 10657 List the prime factors of 11969818. 2, 7, 67, 1823 What are the prime factors of 600013721? 41, 14634481 List the prime factors of 424562653. 424562653 What are the prime factors of 54443016? 2, 3, 84017 What are the prime factors of 7720364255? 5, 1544072851 List the prime factors of 4418744836. 2, 11, 31, 3239549 List the prime factors of 658500313. 79, 8335447 List the prime factors of 2993745202. 2, 7, 213838943 What are the prime factors of 213286981? 17, 23, 37, 641 What are the prime factors of 125781003? 3, 617, 22651 List the prime factors of 43564314. 2, 3, 7260719 List the prime factors of 56602246. 2, 2273, 12451 What are the prime factors of 241809? 3, 80603 List the prime factors of 63060591. 3, 11, 1910927 What are the prime factors of 2327456832? 2, 3, 19, 137, 4657 List the prime factors of 19806634. 2, 23, 430579 List the prime factors of 43027653. 3, 347, 41333 List the prime factors of 97333131. 3, 7, 131, 35381 What are the prime factors of 360264324? 2, 3, 7, 349, 12289 What are the prime factors of 31119368? 2, 7, 23, 37, 653 List the prime factors of 1166044083. 3, 1097, 354313 What are the prime factors of 457722871? 71, 6446801 What are the prime factors of 938842137? 3, 34771931 List the prime factors of 21806303. 163, 133781 What are the prime factors of 309225? 3, 5, 7, 19, 31 What are the prime factors of 199699342? 2, 5581, 17891 List the prime factors of 278494638. 2, 3, 31, 1497283 What are the prime factors of 65032319? 11, 5912029 What are the prime factors of 340464840? 2, 3, 5, 1213, 2339 List the prime factors of 118706767. 17, 37, 41, 4603 What are the prime factors of 1617238728? 2, 3, 7, 458401 What are the prime factors of 462356444? 2, 11, 31, 419, 809 List the prime factors of 11629785. 3, 5, 17, 59, 773 What are the prime factors of	{ "pile_set_name": "DM Mathematics" }
at is the fourth smallest value in -0.6, 10, 0.3, 7? 10 What is the second biggest value in 2, 4, 40, -0.01, -5? 4 What is the smallest value in 33.1, -0.3, -1/9, 1, 0? -0.3 Which is the smallest value? (a) 0.002 (b) -0.5 (c) -0.08 b What is the second smallest value in -1/11, 3, 6? 3 What is the second smallest value in 1163, 0.2, -5? 0.2 What is the fourth smallest value in 5/6, -0.1, 2, -0.2? 2 What is the smallest value in 41, 4/3, 3/4? 3/4 What is the third smallest value in 0.4, -1/6, 6? 6 Which is the fourth smallest value? (a) 0.5 (b) -0.6 (c) -0.3 (d) 7 d Which is the third smallest value? (a) 0.05 (b) -27 (c) -2/17 (d) 0.5 (e) 3/5 a Which is the smallest value? (a) -2 (b) -3/4 (c) -0.0794 (d) 5/3 a Which is the biggest value? (a) 0.14 (b) -3 (c) -7 (d) -0.01 a What is the third biggest value in 2/135, -5, -0.04? -5 Which is the biggest value? (a) -0.5 (b) -2/15 (c) 1 (d) 0 (e) -4 c Which is the second smallest value? (a) -1/5 (b) -3/5 (c) -3 (d) -1/2 (e) 4/3 b Which is the biggest value? (a) 3.69 (b) -7 (c) 0 a What is the third biggest value in 0.14, 3, 7/2, -0.8? 0.14 Which is the third smallest value? (a) -6 (b) 0.05 (c) 3 (d) -37 (e) 2 b Which is the fourth smallest value? (a) 1 (b) 0 (c) -5 (d) 28/5 d What is the second biggest value in -2/13, 0.05, -1/5, -0.4? -2/13 Which is the smallest value? (a) -3 (b) 5 (c) -0.063 a Which is the second biggest value? (a) -0.1 (b) 2/3 (c) 1/3 (d) 2 b Which is the biggest value? (a) 6 (b) 19 (c) 0 b What is the smallest value in -0.3, 0.1, 1.3? -0.3 Which is the biggest value? (a) -0.12 (b) -5 (c) 21/2 (d) 0.4 c Which is the third biggest value? (a) 6.1 (b) -9 (c) 13 b What is the fourth smallest value in 0.1, -2, 4, 0.08? 4 Which is the fourth smallest value? (a) 5/4 (b) 44 (c) 0 (d) 7 b Which is the second biggest value? (a) 0.51 (b) -0.09 (c) -0.5 b What is the biggest value in -0.2, -1.3, 2, 0.1? 2 What is the fourth biggest value in -128, -4, 2/13, 3? -128 What is the third biggest value in 0.16, -4, -2/9? -4 What is the biggest value in 0.1, 1, 3, -0.4? 3 Which is the third smallest value? (a) 0.3 (b) -11 (c) -1.6 (d) -3/2 d What is the smallest value in 30, -0.3, 18, 1/3? -0.3 Which is the smallest value? (a) 3/4 (b) 2 (c) -1.7 c What is the second smallest value in -4, 3, 3/5? 3/5 What is the smallest value in 2/5, -7, -2/11, -0.3? -7 What is the third biggest value in 0.1, -5, -109/5? -109/5 What is the biggest value in 4, -377, 2/5? 4 What is the fourth smallest value in 0.2, 78, 0.4, -4? 78 What is the second biggest value in -3/4, 1/5, 133, 0, -2/5? 1/5 Which is the second smallest value? (a) -0.4 (b) -2/13 (c) 7/25 b What is the second biggest value in -0.05, -2/13, 2/11? -0.05 What is the third smallest value in -10, 0.6, 0.4, 3? 0.6 What is the second biggest value in 0.3, -1/8, 1, -0.06? 0.3 What is the third smallest value in -3, 13, -0.5, 1.9? 1.9 Which is the second biggest value? (a) 5 (b) -56 (c) 2 (d) -1 c What is the third biggest value in 2/29, -1, -4? -4 Which is the third biggest value? (a) 5 (b) -1/6 (c) 252 b Which is the biggest value? (a) 3 (b) -18 (c) 1/9 (d) 0.3 a Which is the smallest value? (a) 3/2 (b) 0.4 (c) -67 c What is the second biggest value in -5, 5, -2/4399, 0, -0.5? 0 What is the third smallest value in 3, -1/3, 31? 31 What is the biggest value in -0.2, 1.5, -0.5, 0.1? 1.5 What is the biggest value in -5, 55/3, -0.3, 0.4, -8? 55/3 Which is the smallest value? (a) -34 (b) -0.5 (c) -1/3 a Which is the third biggest value? (a) -3 (b) -0.08 (c) 347 a Which is the third biggest value? (a) 97 (b) -0.1 (c) -0.15 c Which is the second biggest value? (a) 3 (b) -87 (c) -0.3 (d) -2/11 d What is the biggest value in -0.62, -4, -0.1, 2/11? 2/11 Which is the smallest value? (a) 3 (b) 0.4 (c) 12 (d) 2/9 d What is the smallest value in 17, -12, 9? -12 Which is the third biggest value? (a) 0.5 (b) -3 (c) -19 c Which is the third biggest value? (a) -0.6 (b) -4 (c) 32 b Which is the third biggest value? (a) -5 (b) -0.21 (c) 1/6 a What is the fifth smallest value in 1, -2, 3/80, 3, 2? 3 Which is the second biggest value? (a) -10 (b) -2/3 (c) -7 c Which is the fourth smallest value? (a) 8/3 (b) 0.43 (c) 1/4 (d) 0.4 a What is the biggest value in 0.03, -3, 5, -0.2, -4? 5 Which is the second smallest value? (a) -13/74 (b) -0.3 (c) 0 a Which is the fourth biggest value? (a) 5/2 (b) 4 (c) 0.3 (d) 69 (e) 0.4 e Which is the fourth biggest value? (a) 3 (b) -2/3 (c) 1 (d) 0.4 b What is the biggest value in -0.4, 1/63, 0.42, 3/5? 3/5 Which is the third smallest value? (a) -2/7 (b) -258 (c) -2/3 a What is the second smallest value in 0.5, -5, -1, -0.12? -1 Which is the third smallest value? (a) 35 (b) 3/8 (c) 1/4 (d) -1/3 (e) -0.2 c Which is the fourth smallest value? (a) 1 (b) -2/485 (c) 0 (d) -3/2 a What is the smallest value in 72, 0.1, 2/17? 0.1 What is the second biggest value in -2/23, 3/2, -4/9, 1/5? 1/5 What is the third biggest value in 1/6, 0.2, -0.92? -0.92 Which is the fifth biggest value? (a) 95 (b) -1 (c) 0.3 (d) -3 (e) 3 d Which is the third biggest value? (a) -3 (b) 2 (c) -0.22 (d) -0.2 (e) -4 c What is the fifth biggest value in -2/3, -0.052, -5, -0.3, 3/2? -5 What is the fourth smallest value in -15, -7, -4, -2? -2 Which is the fourth biggest value? (a) -0.3 (b) -2 (c) 3 (d) -5 d Which is the second smallest value? (a) -24 (b) 1.3 (c) 0.1 c Which is the second smallest value? (a) -0.4 (b) 1/4 (c) -5 (d) -20/23 (e) 0.5 d What is the third smallest value in -2/7, -2/51, -1/12? -2/51 Which is the biggest value? (a) -17 (b) -3 (c) 1 (d) -5 c What is the fourth biggest value in 2, 0.07, 4/7, -1, -3? -1 Which is the second smallest value? (a) -0.4 (b) 69 (c) 1.8 c Which is the smallest value? (a) -0.1 (b) -2/11 (c) 3 (d) 2/9 b What is the third smallest value in 0.1, 2.18, -5/3? 2.18 What is the smallest value in -0.1, 423, 3/8, -2/9? -2/9 Which is the smallest value? (a) 0.08 (b) -0.1 (c) -2 (d) 33 c Which is the fourth smallest value? (a) -1/22 (b) -5 (c) 1 (d) 27/2 d What is the fourth smallest value in -0.2, 4, -6, -13? 4 Which is the second smallest value? (a) 2 (b) -1/8 (c) 4 (d) -86 b Which is the third smallest value? (a) -3 (b) 6.8 (c) -2/23 b What is the second biggest value in 42, 0.4, -0.5, -3/4? 0.4 What is the smallest value in -0.08, 0.11, 0, 0.5? -0.08 Which is the smallest value? (a) 1.3 (b) -7 (c) 4 (d) -2 b What is the smallest value in 1, 4, 1/2, -0.5? -0.5 What is the smallest value in -3.5, 2, 1? -3.5 What is the third smallest value in -3, 1/3, -1/3, 7? 1/3 What is the second biggest value in -16, -3, -1/7, 1/3? -1/7 Which is the third smallest value? (a) -2/43 (b) 5 (c) -0.2 (d) 0.1 (e) -2 a What is the second smallest value in -2/3, -0.2, -6, 0.41, 5? -2/3 Which is the fourth biggest value? (a) -5 (b) -3/68 (c) -3 (d) 3 (e) -4 e Which is the smallest value? (a) 1 (b) -2 (c) -110 c Which is the fourth smallest value? (a) -12 (b) 5 (c) -2 (d) 0 (e) 2 e Which is the third smallest value? (a) 5 (b) 2.8 (c) 0.05 (d) -0.3 b What is the second smallest value in 0.05, 32/5, -2/25, -5? -2/25 Which is the third smallest value? (a) 1 (b) 5 (c) 8/7 b What is the fifth biggest value in 0, 0.1, 4, -5, -23/14? -5 What is the second biggest value in 5, 0.5, 0.2, -2/9? 0.5 What is the third smallest value in 3/8, -0.01, 2? 2 Which is the second biggest value? (a) -6 (b) 0.176 (c) 2/11 b What is the biggest value in -0.2, -4, -2/23, -1, 2/7? 2/7 What is the second biggest value in -3/7, 0.8, -5, 2/11? 2/11 What is the second biggest value in -2087, 0.2, 1? 0.2 What is the second smallest value in 3, -4, 0.2, 0.39? 0.2 What is the biggest value in 6, -1/4, -1, 0, -3/4? 6 What is the third biggest value in -1/4, 3/2, 1.81? -1/4 Which is the smallest value? (a) 119 (b) 0.3 (c) -4 (d) 1/2 c What is the fourth smallest value in 11, 4, -0.16, -3? 11 What is the second smallest value in 1, -1.9, 4? 1 What is the smallest value in -3, -2, -0.48, -2/9, -18? -18 Which is the second biggest value? (a) -5 (b) -1 (c) 1/690 b Which is the s	{ "pile_set_name": "DM Mathematics" }
z. -7 Suppose k + 13r - 9r = -3, -5r = -k + 6. Let c = -36 + 40. Suppose -18 = u - cu. Solve -v - u = -k for v. -5 Suppose -208 = 2474h - 2490h. Solve 0 = -d - hd + 56 for d. 4 Let q(h) = h3 - 5h + 2. Let o be q(0). Suppose 31c - 60 = o. Solve -ci = 8i - 20 for i. 2 Let i = -32 + 37. Let a = -403 - -403. Solve -5z - i = -az for z. -1 Let i be (15/6 - 2)40. Suppose -32f = -28f - 16. Let d be (-1 - (2 + -5)) + f + -2. Solve dt - 8 = -i for t. -3 Suppose -15c - 8c = -7c - 288. Solve -38l = -32l - c for l. 3 Suppose 350 = 4m - 82. Let d = m + -102. Solve -2 - d = -2y for y. 4 Suppose 283a - 5860 - 488 = -775a. Let p(h) = h. Let d be p(3). Solve -ay = 9 + d for y. -2 Suppose -4f = -8f + 3x + 934, -2f + 2x = -468. Let b = f + -228. Suppose -s - 3m - 10 = 0, -5s - 4m - 3 - 3 = 0. Solve -6 = -sg - b for g. 1 Let d = 1158 - 1150. Solve 0 = 4m + d + 12 for m. -5 Suppose -4p + 5p - 6 = 0. Let z be -6 + 3 + (-4 - -7). Suppose zf = -2f + p. Solve 5b - 8 = -f for b. 1 Let q = -72 - -76. Suppose -qv + 12v = 24. Solve -vx - 8 = 1 for x. -3 Let v = -246 - -251. Suppose -5 = q - 2r, -3q - 4 = -vr + 6. Solve 0 = 3m + 2 - q for m. 1 Let r(g) = 66 + 4g*3 + 4g - 62 - 8g3. Let w be r(-1). Let f = -15 + 47. Solve -f = wx - 12 for x. -5 Suppose 30b + 27 = 35b + 4l, -2b - 2l = -12. Let g be -7(-8b/6 + 3). Solve -8i + g = -i for i. 1 Suppose 0 = -15k - 104 - 346. Let q be (-112)/(-10) - (-6)/k. Solve -5 = 3a - q for a. 2 Suppose -17j + 20j = -2y - 13, -16 = -y + 3j. Let n be (-87)/(-15) + -4 + y/5. Solve -na - 5a + 14 = 0 for a. 2 Suppose -4g - 16 = 0, -3h + 13g - 1988 = 15g. Let n = h - -700. Solve 0y - n = 8y for y. -5 Suppose -10 = 2d, 2t + 21 = 3t + 5d. Suppose -48 = -k - t. Solve 7l - 16 = -k for l. 2 Let f be (6 - (-77)/(-14))/(3/30). Suppose -2m + 7 = 2b - m, fb - 7 = m. Solve -bv = 2v for v. 0 Let q(v) = -10v2 - 211v - 74. Let m be q(-20). Solve -47f + m = -42 for f. 4 Let x = -1 - 23. Let w = 37 + x. Suppose 9r + 16 = wr. Solve 5l - 6l = r for l. -4 Suppose -4i + 3m = -4, 0 = 3i + m + m + 14. Let g = 4 + i. Let f(s) = -2s3 + 5s*2 + 13s - 28. Let p be f(3). Solve -8 - p = gt for t. -5 Suppose 2639 = 2v - 5k, 48v - 45v - 4046 = -5k. Solve -1288 = 7j - v for j. 7 Let s = -4 - -8. Suppose -st + 2 = 2l - 4, 3l = 4t - 31. Let i = -4024 + 4024. Solve ib + b = t for b. 4 Suppose 164v - 218v = 0. Solve v = -36g + 276 - 96 for g. 5 Let o be 44/(-6) - -6 - 368/(-24). Solve -2y - oy + 32 = 0 for y. 2 Suppose 0 = 2g + 2w + 3w + 7, 4w = -12. Suppose 27 = 5c - 3s + 4, -s + 15 = 4c. Suppose 2m + z = 0, -5m - cz - 12 = -3m. Solve -g = -mb - 0b for b. 2 Suppose -3g - 10 - 6 = 5v, -5v - 12 = g. Let u be 0/(g/(-2)1). Suppose 441a - 609a + 207 = -129. Solve ux = ax for x. 0 Let u(n) = 6n - 322. Let f be u(54). Solve -fa = -2a + 2a for a. 0 Let p(y) = 2y3 - 4y + 9. Let x be (-12 + 9 - -5) + -2. Let n be p(x). Suppose -2h - 1 = -r, -1 = -2h + r - 2r. Solve -4g - 25 + n = h for g. -4 Let p = -8 - -11. Let f be (-2)/7 - 4/(-56)4. Suppose f = -9m - 4m + 78. Solve -mc + pc = -12 for c. 4 Let w = -54 - -173. Let u = w - 108. Solve -p + 9 = u for p. -2 Let t = 513 - 481. Let s = -624 - -627. Solve -t = 7p + s for p. -5 Let c be 1636/(36/81 - 28/(-18)) - 1. Solve 0 = 7u - 796 + c for u. -3 Suppose -2v = -7v + 15. Let j(a) = 2a*2 - 12a + 20. Let n be j(6). Let m be 3/4 + (-15)/n + 2. Solve -vh = mh for h. 0 Let v be -11 + 195/(-13 - -26). Solve -7j + 44 = vj for j. 4 Suppose s = -47 + 50. Suppose sy + 0y = 4y. Suppose 3q + 18 = 5q. Solve y = -2v + q - 1 for v. 4 Suppose 125m - 126 = 83m. Solve -ml + 483 = 501 for l. -6 Let g = 749 + -745. Let h(k) = -k3 - 2k*2 - 3k + 3. Let c be h(-3). Let l = c - 9. Solve 0n + l = -gn for n. -3 Let l = 34 - 34. Suppose -5f = -2t - 86, -3t + lt - 171 = 3f. Let x = 57 + t. Solve 5 = 3k - x for k. 3 Let k = -1879 - -1890. Solve 0 = ky + 1 - 12 for y. 1 Let y(i) = i3 - 13i*2 - 14i + 4. Suppose -3d - 65 = -17. Let o be 110/8 - 4/d. Let m be y(o). Solve p = -mp + 15 for p. 3 Suppose 2x - 4 = -4g - 32, g = x + 11. Let d be (-2)/(-8)x/(-3). Let p be d/(-2) + (-3)/(-6). Solve -2s = -ps for s. 0 Let j be ((-3)/(-6) - 4)-8. Suppose -2p + 4h = -38, 2h + 105 - j = 3p. Let u = p - 29. Solve u = -w + 5w + 8 for w. -2 Suppose -88 = -9c + c. Let s be (2 - -2)(-2 - c/(-4)). Suppose 45 = 3j + sp, 21 = 3j - 0j - 5p. Solve 5n - 2n = -j for n. -4 Let g(l) = -2l2 + 23l - 54. Let v(x) = x*2 - 11x + 28. Let h(b) = 3g(b) + 5v(b). Let y be h(12). Solve -9 = yz - 11 for z. 1 Suppose -404x = -390x - 2688. Solve x = -59u + 83u for u. 8 Let p be (-6)/1010/(-3). Suppose 5g = pg + 24. Solve -5n = -gn for n. 0 Suppose 0 = 5i - 3l + 248, -l + 4l = -2i - 116. Let p be (-112)/i - 2/13. Suppose 11 = pn - 5. Solve -v = 3v + n for v. -2 Let i = -21304 - -21325. Solve -879 = -iv - 837 for v. 2 Let d(k) = -16k - 41. Let x(j) = -15j - 40. Let m(h) = -5d(h) + 6x(h). Let c be m(-4). Solve 6b - cb = 0 for b. 0 Let m = 6245 - 6241. Solve -488 = md - 464 for d. -6 Suppose -705 + 222 = -107s + 801. Solve 21h - 19h - s = 0 for h. 6 Suppose 498 - 489 = 3k + 4a, -3k - 3a = -9. Suppose -i - 2i = 0. Suppose -5q = 15 + 5, 2m + 5q = -16. Solve -kg - mg = i for g. 0 Suppose -25f = 2f - 162. Solve -fr + 29 = -1 for r. 5 Suppose -15f = -435 - 3660. Let h = f + -269. Solve 0 - h = 2v for v. -2 Let m be 5/((-5)/4) - (0 + -4). Suppose k - 3o + 12 = -mk, 3k + 1 = 2o. Solve kr - 2 = r for r. 1 Suppose -8j = -14j + 126. Let m be -3 - j/(-6) - 11/(-2). Solve -mc = -4c + 8 for c. -4 Suppose -4j + 2c = c + 409, 2j + 200 = -4c. Let i = -48 - j. Let y be i/(-126) - 31/(-7). Solve -2m + 2 = -y for m. 3 Let g(m) = 60 - 11m2 - 169 - 3m*3 - 21m + 2m3. Let b be g(-10). Let y = 0 + 2. Solve 0 = -k + yk + b for k. -1 Suppose -2910g = -2881g - 377. Solve gu = 231 - 205 for u. 2 Let c(z) = -2482z + 12416. Let f be c(5). Solve 419g - 413g = -f for g. -1 Let t be (-56)/(-6)(-36)/(-24). Let g be 4 + (-21)/t + 1/(-2). Suppose 8 = -0o - o - 2i, -3i - 19 = -2o. Solve g = -os - 2 for s. -2 Suppose -5l = t - 9l - 46, -40 = -t + 3l. Solve 0 = -tw - 9w + 31 for w. 1 Suppose 33j - 8741 = -5771. Solve 128x = 113x + j for x. 6 Let n(i) = i*3 - 8i*2 + 15i. Let p(b) be the first derivative of b*3 + 2b - 16. Let a be p(1). Let o be n(a). Solve od = -d + 5 for d. 5 Suppose -10v + 33 = -277. Suppose 39s - 56 = vs. Solve 13i - s = 6i for i. 1 Suppose -98v + 307 - 115 = -102. Solve 30y - v = -63 for y. -2 Let j = -115 + 120. Suppose 5i - k = -j - 0, 0 = -i - k + 5. Solve c = -ic for c. 0 Suppose 3c + 4x - 184 = 0, 0 = -c - 110x + 113x + 44. Solve -c = 108t - 115t for t. 8 Suppose -15 = -b - 4b. Suppose -26d + 4m + 4 = -24d, -3d + m = -6. Solve -di = bi for i. 0 Let q(d) = -d3 - 15d*2 + 26d + 164. Let i be q(-16). Suppose i = 5y - 6. Solve 1 = -ya + 7 for a. 3 Let z(v) = -7v2 - 6v - 31. Let u be z(-4). Let b = u - -123. Solve 0 = t - 0 + b for t. -4 Let z = 4 - 10. Let k be (-8)/z - (2/6 - 3). Suppose -b + q = 2q - 7, -24 = -3b - kq. Solve 3j - 2j = -b for j. -4 Let l be 15/2126/(-315). Let x be l/(-6)(2 + -2). Solve -3h - 5 - 1 = x for h. -2 Let q = 70 - 70. Let c = -242 + 257. Solve q = -o - 2o - c for o. -5 Let c(w) = -5w - 150. Let n be c(-30). Let f be n/(-3 - (-5 + 0)). Solve f = -7r - 50 + 15 for r. -5 Suppose 998 = 4f - u, -95 = -2f - u + 395. Solve f = -15y + 233 for y. -1 Let u(r) = 5r + 21. Let q be u(-5). Let m be 1/q + 1067/44. Solve -5g - 1 = m for g. -5 Let v(r) be the third derivative of -r5/60 - r4/3 + 35r3/3 + 128r*2. Let p be v(-13). Solve pl - 7l - 10 = 0 for l. -5 Suppose 19v - 58 = 37. Suppose 7l + 7 = vl - 3k, -2l + 4k = -14. Let n(m) = m3 + 3m*2 - 6m - 5. Let d be n(-4). Solve l + 2 = dy for y. 1 Suppose 1343 = 4l - l - 1723. Solve -2 = 1020j - lj for j. 1 Let o be ((-10)/(-4))/(3/6). Suppose -j + 44 = 9. Suppose 0 = -4t - j + 35. Solve ov - 5 = -tv for v. 1 Suppose -16r + 8 = -12r. Suppose -2c + 4i - 4 = 0, 11i = 4c + 7i +	{ "pile_set_name": "DM Mathematics" }
588449805956. 4(u + 804433)2 Solve o5 - 81o*4 + 903o*3 + 2393o*2 - 3216o = 0 for o. -3, 0, 1, 16, 67 Find w, given that 4w3 + 42476w*2 + 932444w - 974924 = 0. -10597, -23, 1 Factor h*3/4 - 1479h*2 + 129645h/4 + 67781/2. (h - 5894)(h - 23)(h + 1)/4 Factor j*3/3 - 150j*2 - 13879j - 81466/3. (j - 529)(j + 2)(j + 77)/3 Find y such that 1458y4 - 1890y*3 + 464y*2 - 32y = 0. 0, 4/27, 1 Solve -10b4/9 - 9826b*3/9 + 29578b*2/9 + 9826b/9 - 9856/3 = 0 for b. -4928/5, -1, 1, 3 Determine d so that -2d4/9 + 4078d*3/9 + 16342d*2/9 + 1366d/3 - 2724 = 0. -3, -2, 1, 2043 Factor -4k2 + 170908k/9 + 88648/3. -4(k - 4749)(9k + 14)/9 Determine y, given that -10y*5 - 1985y*4 + 7155y*3 + 17135y*2 - 7145y - 15150 = 0. -202, -3/2, -1, 1, 5 Factor -4t2 - 459736t. -4t(t + 114934) Suppose 2y3/7 + 6474y*2/7 + 12942y/7 + 6470/7 = 0. Calculate y. -3235, -1 Factor -388131591125w2 - 11144600w - 80. -5(278615w + 4)*2 Let -2r*4/5 - 150r*3 + 4566r*2/5 - 2306r/5 - 1524 = 0. Calculate r. -381, -1, 2, 5 Factor 5h3 + 85h*2 - 1890h + 1800. 5(h - 12)(h - 1)(h + 30) Find v, given that -6v*4/5 + 942v*3/5 + 2934v*2/5 - 8478v/5 - 5184 = 0. -3, 3, 160 Factor -2m2/5 + 674284m - 284161820410. -2(m - 842855)2/5 Determine v so that -2v*4/17 + 200v*3/17 - 5770v*2/17 + 2420v - 35568/17 = 0. 1, 9, 38, 52 Determine r so that r*3 - 106r*2 + 511r - 606 = 0. 2, 3, 101 Suppose -4c3/5 + 1036c*2/5 + 632c - 4192/5 = 0. What is c? -4, 1, 262 Factor j*3 + 1525j*2 + 427047j - 124698573. (j - 173)(j + 849)2 Suppose -2h*3/7 + 338272h*2/7 - 2043404502h + 4086615708 = 0. Calculate h. 2, 84567 Factor l*3 - 117l*2/7 + 158l/7 + 2952/7. (l - 9)(l + 4)(7l - 82)/7 Suppose 3b*5/5 + 3972b*4/5 + 1294698b*3/5 - 2655732b*2 + 22657323b/5 - 10677336/5 = 0. Calculate b. -667, 1, 8 Determine v, given that -3v5 + 4002v*4 + 28107v*3 + 72354v*2 + 80436v + 32184 = 0. -2, -1, 1341 Determine r, given that -51r3 - 206799r*2/5 + 211926r/5 - 4872/5 = 0. -812, 2/85, 1 Solve -2s3/9 + 298s*2/9 + 4516s/9 + 2608/3 = 0. -12, -2, 163 Factor k*4 - 499k*3 + 82775k*2 - 4563125k. k(k - 175)2(k - 149) Factor -2t4 - 30430t*3 + 60866t*2 - 30434t. -2t(t - 1)*2(t + 15217) Determine n, given that 2n3/7 - 3504n*2/7 + 59022n/7 - 55520/7 = 0. 1, 16, 1735 Factor 2m2/11 - 4754140m/11 + 2825230892450/11. 2(m - 1188535)2/11 Solve v4 - 125v*3 + 602v*2 - 232v - 960 = 0. -1, 2, 4, 120 Suppose -2g5/9 - 34g*4/9 + 2390g*3/9 + 226g*2/9 - 5612g/3 + 1584 = 0. What is g? -44, -3, 1, 2, 27 Determine i so that -i*3 - 14i*2 + 1081i - 1066 = 0. -41, 1, 26 What is y in 3y5 - 117549y*4/2 + 288149190y*3 - 2733289791y*2 + 5751086535y + 7189776075/2 = 0? -1/2, 5, 9791 Solve r*5/3 - 239r*4/6 - 941r*3/3 - 2945r*2/6 + 1516r/3 + 1016/3 = 0. -4, -1/2, 1, 127 Solve s*2/7 + 8s/7 - 180/7 = 0. -18, 10 Factor -7p3/9 + 415p*2/9 + 1168p/9 + 620/9. -(p - 62)(p + 2)(7p + 5)/9 Let -4i*5/3 - 280i*4/3 - 5116i*3/3 - 21016i*2/3 - 31312i/3 - 15136/3 = 0. What is i? -43, -22, -2, -1 Solve 16j5 + 216j*4 + 273j*3 - 178j*2 + 24j = 0 for j. -12, -2, 0, 1/4 Find u, given that u*4/3 - 20u*3/3 - 1405u*2/3 - 13240u/3 - 3952 = 0. -19, -12, -1, 52 Find a, given that 5a3/3 - 3605a*2/3 + 28595a/3 - 17825 = 0. 3, 5, 713 Suppose -m*3/2 + 331m*2/2 - 643m/2 - 4935/2 = 0. Calculate m. -3, 5, 329 Factor 2u2/17 - 2634u/17 - 64368/17. 2(u - 1341)(u + 24)/17 Find r, given that 2r3/7 - 802r*2 + 11220r/7 = 0. 0, 2, 2805 Suppose -2z2/11 - 3844z/11 - 19170/11 = 0. Calculate z. -1917, -5 Factor 3k3/5 + 198k*2 + 4857k/5 - 1170. 3(k - 1)(k + 6)(k + 325)/5 Factor -3h*5 - 5364h*4 - 2413719h*3 - 14289858h*2. -3h*2(h + 6)(h + 891)2 Find f, given that -12f*2/7 + 4257f/7 + 1065/7 = 0. -1/4, 355 What is z in z*2/5 - 175466z/5 + 7697079289/5 = 0? 87733 Let -2w3/11 - 3108w*2/11 - 18562w/11 + 21672/11 = 0. Calculate w. -1548, -7, 1 Factor a*3/4 - 391503a*2/4 + 587251a/2 - 195750. (a - 391500)(a - 2)(a - 1)/4 Suppose -r*2/6 + 55r/3 - 875/2 = 0. Calculate r. 35, 75 Factor 4p2 + 7122440p + 3170571972100. 4(p + 890305)2 Solve -4w*5/5 - 623w*4/5 + 12069w*3/10 - 4681w*2/2 - 4625w/2 - 825/2 = 0 for w. -165, -1/2, -1/4, 5 Factor 2f2/15 + 1504f/15 - 40456/15. 2(f - 26)(f + 778)/15 Suppose 4q4 - 52q*3 - 736q*2 + 14320q - 57600 = 0. Calculate q. -16, 9, 10 What is h in -h*2 - 2153h - 15022 = 0? -2146, -7 Solve -3i2/4 + 120i = 0. 0, 160 Let -4p5 + 180p*4 - 1612p*3 - 8532p*2 - 11488p - 4752 = 0. What is p? -2, -1, 22, 27 Let -5k4 + 140k*3 - 265k*2 + 130k = 0. Calculate k. 0, 1, 26 Suppose 2l3 - 4456l*2 + 31094l = 0. Calculate l. 0, 7, 2221 Factor 3c2/2 - 849c/2 + 28815. 3(c - 170)(c - 113)/2 Factor 2r2 + 20424r + 163264. 2(r + 8)(r + 10204) Factor -2c2 + 528c + 3240. -2(c - 270)(c + 6) Factor 2d4 - 74d*3 + 242d*2 + 714d + 396. 2(d - 33)(d - 6)(d + 1)2 Factor -j2/2 - 3839j - 14737921/2. -(j + 3839)*2/2 Suppose -3h*5/7 + 105h*4 - 56568h*3/7 + 1059864h*2/7 + 23341776h/7 + 41979696/7 = 0. Calculate h. -11, -2, 86 Determine v so that v*2 - 46v - 840 = 0. -14, 60 Suppose h*3 - 21181h*2 + 42359h - 21179 = 0. Calculate h. 1, 21179 Factor 4b2 - 6191400b + 2395839622500. 4(b - 773925)2 Factor -3c*4/5 - 4383c*3 + 43842c*2/5. -3c*2(c - 2)(c + 7307)/5 Find m such that -123m*2/4 - 117m + 960 = 0. -320/41, 4 Find o such that 3072o4 - 337152o*3 + 9334512o*2 - 4604232o + 572907 = 0. 1/4, 437/8 Suppose 3k4 + 243k*3 - 8985k*2 + 65025k + 74250 = 0. Calculate k. -110, -1, 15 Suppose -276v2 + 270200v + 3916 = 0. Calculate v. -1/69, 979 Factor -2w3 - 174w*2 - 828w - 656. -2(w + 1)(w + 4)(w + 82) Factor -4c*4/7 - 24c*3 - 1364c*2/7. -4c*2(c + 11)(c + 31)/7 Solve -2k*5/3 - 42k*4 + 1008k*3 + 55224k*2 - 964224k - 3359232 = 0. -54, -3, 24 Factor -2s3/11 - 1420s*2/11 - 335650s/11 - 2401000. -2(s + 220)(s + 245)2/11 Find z such that -z4 + 186z3 - 8480z*2 - 31434z + 1461681 = 0. -13, 13, 93 Factor -t*4 - 200t*3 - 4422t*2 - 8248t - 4025. -(t + 1)*2(t + 23)(t + 175) Factor 50a*3 - 10895a*2 + 20565a - 9720. 5(a - 216)(a - 1)(10a - 9) Factor 3u2/2 - 768u - 266739/2. 3(u - 649)(u + 137)/2 Let r*4 + 381r*3 - 23812r*2 + 292020r + 1573200 = 0. Calculate r. -437, -4, 30 Suppose 2s5 + 3514s*4 + 1462388s*3 - 71320300s*2 + 786106282s + 858885458 = 0. What is s? -901, -1, 23 Factor 4v2 - 748v + 29344. 4(v - 131)(v - 56) Determine h, given that -h*2/8 - 2758h - 15213128 = 0. -11032 Let 6x5 + 363x*4 + 1218x*3 + 1203x*2 + 342x = 0. What is x? -57, -2, -1, -1/2, 0 Solve -4u4 - 244u*3 + 6248u*2 + 13440u = 0. -80, -2, 0, 21 Solve -5c3 + 180225c*2 - 1624322835c + 4871346615 = 0 for c. 3, 18021 Suppose -2b3/3 - 5596b*2 - 268174b/3 - 217828 = 0. What is b? -8378, -13, -3 Suppose -5h3/2 + 258595h*2 - 13374274805h/2 = 0. Calculate h. 0, 51719 Solve r*3/4 - 33647r*2/4 - 50475r/2 = 0. -3, 0, 33650 Solve 33n3 + 6165n*2 - 19932n + 3420 = 0 for n. -190, 2/11, 3 Find n such that 3n4 + 1167n*3 - 1170n*2 = 0. -390, 0, 1 Factor 3n*4 + 107781n*3 + 1289957967n*2 + 5133567924039n - 113563982339742. 3(n - 22)(n + 11983)*3 Factor 3l*4 - 63l*3 - 2745l*2 - 21225l - 47250. 3(l - 45)(l + 5)*2(l + 14) Find g, given that 6g2 + 271083g + 135540 = 0. -45180, -1/2 Factor c*3 - 106417c*2 + 2831410496c - 14154392180. (c - 53206)*2(c - 5) Factor 2a2 - 3734a + 135420. 2(a - 1830)(a - 37) Find j, given that -3j2/7 - 85200j/7 - 604920000/7 = 0. -14200 Factor -j*2/5 + 39268j/5 + 15708. -(j - 39270)(j + 2)/5 Factor -9y*3 - 700y*2 - 10932y + 2464. -(y + 22)(y + 56)(9y - 2) Let -3m*5 + 27m*4 + 27m*3 - 363m*2 - 360m = 0. What is m? -3, -1, 0, 5, 8 Determine n so that 2n2/5 - 2954244n/5 + 1090944701442/5 = 0. 738561 Suppose -2i2 + 409596i - 20971110402 = 0. What is i? 102399 Factor b*3/9 + 14b*2/9 - 97b/9 - 1430/9.	{ "pile_set_name": "DM Mathematics" }
t is the y'th term of -1119, -2198, -3259, -4296, -5303, -6274, -7203, -8084? y*3 + 3y*2 - 1095y - 28 What is the i'th term of 10, 10, 8, 4, -2, -10, -20? -i*2 + 3i + 8 What is the u'th term of -11, -24, -49, -92, -159, -256, -389, -564? -u*3 - 6u - 4 What is the u'th term of 39, 53, 67, 75, 71, 49, 3? -u*3 + 6u*2 + 3u + 31 What is the v'th term of 79, 72, 55, 22, -33, -116, -233? -v3 + v2 - 3v + 82 What is the q'th term of -302, -372, -440, -506, -570, -632? q2 - 73q - 230 What is the g'th term of 15, 28, 51, 90, 151, 240, 363? g3 - g2 + 9g + 6 What is the g'th term of -26, -47, -68, -89, -110? -21g - 5 What is the x'th term of -2357, -4716, -7075, -9434? -2359x + 2 What is the s'th term of 33, 32, 31, 30, 29? -s + 34 What is the k'th term of -16, -46, -112, -232, -424, -706, -1096, -1612? -3k*3 - 9k - 4 What is the z'th term of 5, 2, 1, 2, 5, 10, 17? z*2 - 6z + 10 What is the q'th term of 175, 176, 177, 178? q + 174 What is the h'th term of -1, -88, -317, -760, -1489? -12h3 + h2 - 6h + 16 What is the q'th term of 612, 622, 638, 660? 3q2 + q + 608 What is the f'th term of -18, -29, -40, -51, -62? -11f - 7 What is the j'th term of 1, 14, 39, 82, 149, 246, 379? j*3 + 6j - 6 What is the g'th term of -475, -949, -1425, -1903, -2383, -2865, -3349? -g*2 - 471g - 3 What is the n'th term of 126, 333, 540, 747, 954? 207n - 81 What is the k'th term of -89, -79, -65, -47, -25, 1? 2k*2 + 4k - 95 What is the k'th term of 466, 934, 1402, 1870, 2338, 2806? 468k - 2 What is the s'th term of 21, 15, 9? -6s + 27 What is the q'th term of -164, -331, -498, -665, -832, -999? -167q + 3 What is the s'th term of 3, 30, 81, 162, 279? s3 + 6s*2 + 2s - 6 What is the z'th term of -278, -566, -856, -1148, -1442? -z*2 - 285z + 8 What is the t'th term of 2107, 4216, 6325, 8434, 10543, 12652? 2109t - 2 What is the d'th term of 140, 142, 144, 146, 148? 2d + 138 What is the y'th term of -1999, -3998, -5997, -7996? -1999y What is the l'th term of -122, -118, -112, -104, -94? l2 + l - 124 What is the h'th term of 98, 88, 74, 56, 34? -2h*2 - 4h + 104 What is the x'th term of -265, -259, -263, -283, -325? -x3 + x2 + 10x - 275 What is the z'th term of 5, 15, 41, 89, 165, 275, 425, 621? z3 + 2z*2 - 3z + 5 What is the y'th term of 45, 56, 57, 42, 5, -60, -159? -y3 + y2 + 15y + 30 What is the l'th term of 135, 142, 145, 138, 115, 70? -l3 + 4l*2 + 2l + 130 What is the r'th term of 205, 420, 635, 850, 1065, 1280? 215r - 10 What is the z'th term of 53, 65, 81, 101, 125, 153, 185? 2z*2 + 6z + 45 What is the x'th term of 29, 66, 105, 146, 189, 234? x*2 + 34x - 6 What is the w'th term of 15, 67, 155, 279, 439? 18w2 - 2w - 1 What is the j'th term of -43, -87, -133, -181, -231, -283, -337? -j*2 - 41j - 1 What is the j'th term of -138, -278, -416, -552, -686, -818? j*2 - 143j + 4 What is the r'th term of -1579, -1578, -1577? r - 1580 What is the p'th term of -15, -25, -47, -87, -151, -245, -375? -p*3 - 3p - 11 What is the f'th term of 89, 191, 289, 383? -2f2 + 108f - 17 What is the n'th term of -1701, -1697, -1691, -1683? n*2 + n - 1703 What is the u'th term of -40, -68, -96, -124? -28u - 12 What is the j'th term of 35, 36, 37, 38, 39, 40? j + 34 What is the o'th term of 144, 138, 126, 108, 84? -3o2 + 3o + 144 What is the r'th term of -20, -105, -248, -449, -708, -1025, -1400? -29r2 + 2r + 7 What is the h'th term of -371, -382, -393, -404, -415, -426? -11h - 360 What is the n'th term of -445, -435, -425? 10n - 455 What is the y'th term of -60, -119, -182, -249? -2y2 - 53y - 5 What is the g'th term of -35, -61, -85, -107, -127? g*2 - 29g - 7 What is the l'th term of 2, 0, -4, -10, -18, -28, -40? -l*2 + l + 2 What is the n'th term of -31, -98, -209, -364, -563, -806, -1093? -22n2 - n - 8 What is the c'th term of 234, 181, 130, 81, 34, -11? c2 - 56c + 289 What is the z'th term of -425, -411, -373, -299, -177? 2z*3 - 427 What is the f'th term of 2170, 2177, 2188, 2203, 2222, 2245, 2272? 2f*2 + f + 2167 What is the b'th term of -91, -64, -37, -10, 17, 44? 27b - 118 What is the k'th term of 1095, 1102, 1109, 1116, 1123, 1130? 7k + 1088 What is the v'th term of 1671, 1677, 1683? 6v + 1665 What is the b'th term of 82, 66, 50? -16b + 98 What is the k'th term of 18, 41, 64, 87, 110? 23k - 5 What is the y'th term of -938, -953, -1002, -1103, -1274? -3y3 + y2 + 3y - 939 What is the c'th term of 17, 49, 107, 203, 349? 2c3 + c2 + 15c - 1 What is the k'th term of -10, -70, -130, -190, -250? -60k + 50 What is the o'th term of -6, -18, -32, -48, -66? -o2 - 9o + 4 What is the r'th term of -285, -347, -409, -471, -533? -62r - 223 What is the f'th term of -917, -927, -949, -989, -1053, -1147? -f3 - 3f - 913 What is the s'th term of 13499, 26999, 40499, 53999, 67499? 13500s - 1 What is the y'th term of -40, -89, -140, -193, -248? -y2 - 46y + 7 What is the y'th term of -76, -74, -72? 2y - 78 What is the i'th term of 93, 184, 295, 432, 601, 808, 1059, 1360? i3 + 4i*2 + 72i + 16 What is the s'th term of -31, -54, -113, -226, -411, -686, -1069? -3s3 - 2s - 26 What is the h'th term of -2, -12, -20, -26, -30, -32? h*2 - 13h + 10 What is the n'th term of -15, -3, 17, 45, 81, 125, 177? 4n2 - 19 What is the f'th term of 34, 63, 92? 29f + 5 What is the a'th term of -22, -23, -28, -37, -50, -67? -2a2 + 5a - 25 What is the m'th term of 83, 79, 75, 71, 67? -4m + 87 What is the y'th term of -188, -364, -540? -176y - 12 What is the u'th term of 73, 61, 33, -17, -95? -u*3 - 2u*2 + u + 75 What is the p'th term of -7, -30, -69, -124, -195, -282, -385? -8p*2 + p What is the l'th term of 53, 471, 1623, 3875, 7593? 61l3 + l2 - 12l + 3 What is the v'th term of -54, -63, -78, -99, -126, -159, -198? -3v2 - 51 What is the l'th term of -215, -214, -205, -182, -139? l3 - 2l2 - 214 What is the d'th term of 32, 128, 288, 512? 32d*2 What is the l'th term of -192, -384, -576? -192l What is the c'th term of -134, -120, -94, -56? 6c2 - 4c - 136 What is the o'th term of -605, -610, -615, -620? -5o - 600 What is the t'th term of -68, -70, -80, -104, -148, -218, -320, -460? -t3 + 2t*2 - t - 68 What is the v'th term of -54, -109, -168, -231, -298? -2v*2 - 49v - 3 What is the i'th term of 110, 121, 138, 161, 190? 3i2 + 2i + 105 What is the p'th term of -13, -29, -45, -61, -77? -16p + 3 What is the i'th term of 1600, 1598, 1596? -2i + 1602 What is the v'th term of 80, 162, 258, 374, 516, 690, 902? v3 + v2 + 72v + 6 What is the z'th term of 2, -2, 18, 74, 178? 2z*3 - 18z + 18 What is the s'th term of 36, 45, 56, 69, 84? s*2 + 6s + 29 What is the y'th term of 227, 460, 683, 890, 1075? -y3 + y2 + 237y - 10 What is the l'th term of -72, -70, -52, -12, 56? l3 + 2l*2 - 11l - 64 What is the k'th term of 2663, 2668, 2683, 2714, 2767, 2848, 2963, 3118? k3 - k2 + k + 2662 What is the x'th term of 308, 303, 296, 287, 276, 263? -x*2 - 2x + 311 What is the r'th term of 83, 174, 277, 392, 519? 6r2 + 73r + 4 What is the y'th term of 155, 665, 1515, 2705, 4235, 6105, 8315? 170y2 - 15 What is the s'th term of -11, -27, -57, -107, -183, -291, -437, -627? -s3 - s2 - 6s - 3 What is the k'th term of 1582, 1589, 1600, 1615? 2k2 + k + 1579 What is the m'th term of 23, 53, 89, 137, 203, 293, 413? m3 - 3m*2 + 32m - 7 What is the o'th term of -1244, -1235, -1226, -1217, -1208? 9o - 1253 What is the j'th term of 253, 508, 763, 1018? 255j - 2 What is the t'th term of -120, -225, -332, -441? -t*2 - 102t - 17 What is the c'th term of 279, 285, 295, 309? 2c2 + 277 What is the z'th term of 64, 72, 80? 8z + 56 What is the l'th term of -38, -157, -488, -1139, -2218, -3833? -18l3 + 2l*2 + l - 23 What is the a'th term of 3611, 3612, 3613, 3614, 3615, 3616? a + 3610 What is the s'th term of 1114, 1112, 1110, 1108, 1106, 1104? -2s + 1116 What is the g'th term of -14, -43, -90, -149, -214, -279, -338, -385? g*3 - 15g*2 + 9g - 9 What is the b'th term of -232, -463, -696, -931, -1168, -1407, -1648? -b*2 - 228b - 3 What is the t'th term of 346, 696, 1046, 1396, 1746, 2096? 350*t - 4 What is the s'th	{ "pile_set_name": "DM Mathematics" }
pose 0 = -2v - 10, -w - 9 = -3f - v. Suppose 1 = 4n - n + 4s, 5n = fs + 25. Solve c = nc - 4 for c. 2 Suppose 8 = -g + 12, -260 = -2i - 5g. Suppose 0 = -29h + 49h - i. Solve -h = -4l - 22 for l. -4 Let w be (20/(-6))/((-4)/6). Suppose 2q = 4, -2n - 1220q = -1216q - 20. Solve 0 = x - nx - w for x. -1 Suppose 12s + 600 + 1464 = 0. Let q = s + 174. Solve qc + c = 15 for c. 5 Suppose 0 = 30f - 1243 - 407. Solve f - 47 = -2w for w. -4 Let n(o) = 3o*2 - 20o - 5. Let u be n(7). Suppose 3p = -y - 6, 3 + 1 = y - up. Solve y = 4v + v for v. 0 Suppose 36h = 23h + 52. Suppose 2 = 2r - 0s + 2s, -5r + 4s - 4 = 0. Suppose -30 = -5p - 5l, 0 = -rp + p + 2l - 7. Solve 6a + h = pa for a. -4 Let g be ((-12)/8)/((-2)/4). Suppose -3w + 1093 = -6x + x, x = -5w + 1859. Let i = -369 + w. Solve -2u + i = -gu for u. -2 Let h(i) = 3i + 11. Let n be h(-3). Suppose -177q + 185q = -0 - 0. Solve q = -np + 3p + 4 for p. -4 Let f = 7944 - 7815. Solve 33w + 69 = -f for w. -6 Suppose -462c - 32c = -131c - 3993. Solve ci - 83 = -6 for i. 7 Let u be 2/9 + 2/(-9). Suppose u = 19n - 21n. Suppose n = 2a + 15 - 19. Solve -10 = 3w + aw for w. -2 Suppose 32 = -2o - 4f, 76o - 77o + 8 = -f. Solve o = 2b - 125 + 107 for b. 9 Let n be (4/14)/(0 + (-4)/(-56)). Suppose n = 3s - 11. Solve 0 = h - 2h + s for h. 5 Let o be 1/2((5 - -3) + -6). Let u be (-2 - (-8 + 4))/o. Solve 0 = 2f + u - 12 for f. 5 Let b(c) = 41c - 856. Let z be b(21). Solve zj = j + 20 for j. 5 Let w(y) be the third derivative of y5/20 - 5y*4/24 - 4y3/3 + y2 - 36. Let j be w(3). Solve 10r = jr - 12 for r. -2 Let b = -395 - -515. Suppose b = -13y + 53y. Solve yf + f = 4 for f. 1 Let r be 132/12 + -28 + 17. Solve r = -9j + 11 - 2 for j. 1 Let k = -218 + 190. Let t be k/(-49) - 38/(-7). Solve -6 = 3x + t for x. -4 Suppose -33t = 5c - 28t - 15, 3t = -9. Suppose ca = -281 + 287. Solve -3s + a = -8 for s. 3 Let m be 16/10 - (-4)/10. Let y be 3 - ((-31)/(-93) + (-5)/15). Solve -mi + yi = 3 for i. 3 Let r(p) = -2p - 15. Let x be r(13). Let g = x + 44. Let o(v) = v*2 + 5v - 19. Let u be o(g). Solve u = 5k - 0 for k. 1 Let n(u) = 283u - 847. Let l be n(16). Solve 3o = l - 3663 for o. 6 Suppose 0 = 2l - 5i - 16, -l - 10i + 8 = -13i. Solve 6z + lz - 70 = 0 for z. 5 Suppose -5r - 3 = -3. Suppose r = -9b - 9b + 9b. Solve b = -5f - 0f - 10 for f. -2 Let u(o) = o3 + 4o*2 + 8o + 7. Let f be u(-2). Let c be (-12 + 11)(f + 0 + -1). Solve 0p = -cp + 10 for p. 5 Let x be (-8241)/(-1353) + (-1)/11. Solve 0 = 41a + xa + 329 for a. -7 Let f be -4 - (2920/5)/(-4). Let g = -142 + f. Solve g = -l + 3l - 8 for l. 4 Let s be (-2)/(-11) - (-1200)/660. Let g be (4/6)/(0 - s/(-45)). Solve 2h = -h - g for h. -5 Let r(s) = 70s + 1480. Let u(h) = -19h - 370. Let i(l) = -2r(l) - 9u(l). Let o be i(-10). Solve -56 + o = -4y for y. -1 Let x be (-33)/2(-4 + 8). Let u = -67 - x. Let s be 4 - u - (-8 - -10). Solve -4l - s = -7l for l. 1 Let g = 2963 - 2897. Solve 0 = 13n + 20n + g for n. -2 Let k(l) = -l3 + 7l + 9. Let n be k(-2). Suppose 0 = -x - nx + 8. Solve 0 = -t - 1 - x for t. -3 Suppose 10q - 1112 + 1032 = 0. Solve 0 = qs - 29s + 84 for s. 4 Let y be ((-16)/(240/75))/(2/(-10)). Suppose 0 = -4a + 2a. Solve a = -yo + 20o - 25 for o. -5 Let o be ((-3)/4)/(9/(3-204)). Solve 48p + 9 = op for p. 3 Let h(k) = -k3 + 13k*2 - 2k + 12. Let f be h(13). Let t be 3/(-2) - (7 - (-105)/f). Let a be 1 - 5 - 4/t. Solve -p + 6p - 15 = a for p. 3 Suppose 3h = 20h. Suppose 3l = 3v - 5v - 2, 5l + 20 = h. Solve 10j - v = 5j for j. 1 Let l = 5506 + -5494. Solve -26 = -19f + l for f. 2 Suppose -3j = 68 - 104. Suppose -3g = c - 6g - 11, 0 = -3c + 4g + 43. Let f = c - j. Solve y - fy = 4 for y. -1 Suppose -60 + 12 = 2t + 4l, 0 = -l. Let a be (15/(-9))/(8/t). Solve 3j - 8 = -aj for j. 1 Let g be (-2)/(-6)(-27)/(-3). Suppose 22f + 14 = 94 + 30. Solve gc = -f + 20 for c. 5 Let k be (50310/(-18))/(-5) - 7. Solve -7q = k - 587 for q. 5 Suppose -1220 - 2322 = -9h + 1390. Solve 551i - 15 = hi for i. 5 Let w be -1 - 4(-1)/1. Let s be 220/(-176) + (-102)/(-24). Suppose wx = -sv - 1 - 5, 4v + 10 = -3x. Solve 7t - 20 = xt for t. 4 Suppose 35n = -617 + 2198 + 1534. Solve 8i = -n + 105 for i. 2 Suppose f = 208 - 85. Suppose -5m + 117 = -f. Let s be (-8)/2 + (-5)/((-10)/m). Solve -4j + s = 4 for j. 4 Let x = -407 - -200. Let u = x + 208. Solve 0 = -4j + 5 - u for j. 1 Let a = 2554 + -2536. Solve -ax - 27 - 9 = 0 for x. -2 Let m be (-3 + -8 + -2)-1. Suppose 10b + mb = 21b. Suppose 0 = -d - 2o - 8, 2o = 4d - o - 23. Solve dn + n + 9 = b for n. -3 Suppose -32j + 6 = -29j + 5s, -2j + 4 = s. Let b(g) = 2 + 2 - 9g2 + 8g*2 + g. Let i be b(j). Solve 0u = -iu for u. 0 Let z(c) = -c3 + 10c*2 - 22c + 23. Let j be z(7). Solve -j = 2w + 2w for w. -4 Suppose -5y + 84 = -4a, 179y + 4a + 20 = 180y. Solve 25f = yf for f. 0 Let o be (-3)/(2506/(-500) + 5). Let j = 253 - o. Solve -jv = 1 + 5 for v. -2 Let g = -158 - -250. Suppose 1 = 93x - gx. Solve x + 6 = -7q for q. -1 Let a be (-16)/(-6)(374292/24)/37. Solve af - 63 = 1133f for f. -7 Let b(t) = -t + 2. Let i(n) = n*3 - n + 2. Let c(g) = -3b(g) + 4i(g). Let p be c(1). Suppose -a - 3 = ps - 5, 5a + s - 10 = 0. Solve -m = -am + 1 for m. 1 Suppose -82m = -81m - 23. Suppose -5s = -2 - m. Solve -9 = -sv + 6 for v. 3 Suppose 521 + 223 = 4k. Let o be k/62/2. Let m = -21 + o. Solve 4z - m = -z for z. 2 Let t = -481 + 460. Suppose y = 4y - 69. Let v = y + t. Solve -vb = -5b for b. 0 Let f = -10 - -14. Let a be (-8 + -10)(-1)/3. Let k be a/12 - 3/(-6). Solve -13 + k = fz for z. -3 Let d = 0 - 113. Let z = -7462 + 7586. Let b = z + d. Solve -3l = -b - 1 for l. 4 Let l(j) = 2j*2 + 3j - 21. Let t be ((-9)/24)/(16/(-128)). Let c be l(t). Solve -cq - 11 = -41 for q. 5 Let n(r) = 17r*2 - 30r + 44. Let g be n(2). Solve 0 = -6h + g - 34 for h. 3 Let i(o) = 150o + 91. Let c be i(-4). Let r = -502 - c. Solve rp - 4p = 0 for p. 0 Suppose 383 = 3s - a, -s + 6s - 637 = a. Let o = -132 + s. Let x be 0/(5/(o/3) + 5). Solve -5u = -xu - 25 for u. 5 Suppose -548a + 550a - q = 61, 0 = 2a + 3q - 81. Solve -7u + 5 = a for u. -4 Suppose 2d + 152 = -3r, -d - 114 = 2r - 6d. Let a be -510/(-325) - 200/r. Solve -2c + 6 = ac for c. 1 Let z = -31 + 37. Suppose 0 = 6h - 9h + z. Let c be 0 + -6(-1)/h. Solve -s = -cs for s. 0 Suppose 963f - 784f - 1381 + 307 = 0. Suppose -5c + 3u = 4u - 61, -2c + 42 = -4u. Solve ch = 10h - f for h. -2 Let a(s) = -s3 - 1. Let u(z) = -3z*3 + 23z*2 + 24z + 37. Let x(j) = 4a(j) - u(j). Let h be x(-22). Solve -hm + 6 + 0 = 0 for m. 2 Let n = 6167 + -6069. Solve -na + 65 = -85a for a. 5 Let q(x) = -4x2 + 6x - 3. Let w be q(-5). Suppose 1301t - 1305t = 488. Let y = t - w. Solve -yn = -7n - 16 for n. 4 Suppose -175 = -f + 3w, f + 3w = 2w + 155. Suppose -60 = 5c - f. Solve 0 = 2x - 6x + c for x. 5 Suppose -3666 = -54y - 3342. Solve 15s + 81 - y = 0 for s. -5 Let d = 170 + -178. Let a(n) = -n*2 - 6n + 17. Let l be a(d). Solve 3s - 2s = l for s. 1 Suppose 0 = -30r - 35r + 3356 + 3859. Solve -ro - 24 = -105o for o. -4 Suppose 0 = 5r + i + 280 - 338, 3i = 9. Solve 48 = -rx - x for x. -4 Suppose 4a + 74 = 2a. Let l = -36 - a. Suppose -3d + 7 = l. Solve d - 4 = j for j. -2 Let z be (186/682)/(3/33). Solve zv = -18v - v for v. 0 Suppose 15 = -5v + 8v. Let q be -3((-50)/(-15))/v. Let h be -9(q - -3)-1. Solve -hn = -4n - 25 for n. 5 Suppose -4q + 96 + 68 = 3j, -j + 23 = -5q. Suppose -4x + j = 5l, x + 9 = -l + 5l. Suppose -1 = u + f - x, 3u - 13 = 2f. Solve 10n - 20 = un for n. 4 Let y be (-4 - 3168/27)3. Let l be 2(-1)/18 - y/36. Solve -z + l = z for z. 5 Let o = 476 - 470. Let f be -1 + 1 - (-4 - -4). Solve 5t - ot = f for t. 0 Let l = -127 + 94. Let d = l - -37. Suppose dw - 45 + 12 = -5q, -5q - 2w + 29 = 0. Solve qz = 2z - 3 for z. -1 Let l be 10 - (7 + -1) - (8 - -4). Let s be (l/16 - -2)2. Solve -2 = q + s for q. -5 Suppose -125 = -t + f, -82t + 80t = f - 238. Solve -ti = -26i - 570 for i. 6 Let k be (624/(-36) + 17)*-27	{ "pile_set_name": "DM Mathematics" }
the third biggest value in 380, -1/6, 1/2, 7, 1? 1 What is the biggest value in 17, 0.219, -3/5, -1, -13, 2/3? 17 What is the fourth smallest value in -0.9195, 3, 2, -2, 0.3, -8, -4? -0.9195 What is the smallest value in 4332.87, 3/5, 44? 3/5 Which is the sixth biggest value? (a) -0.7 (b) -0.4 (c) -14 (d) -10 (e) -2 (f) 1 (g) 4/55 d Which is the biggest value? (a) 95 (b) -0.2 (c) -0.06 a What is the fourth smallest value in 8, 5/6, 1/2, -9, -1, -21/2, 1/15? 1/15 What is the fourth smallest value in 2/1103955, -4, 1/3, 4, 0.3? 1/3 Which is the sixth biggest value? (a) -3 (b) -1/3 (c) 0.7 (d) 5 (e) 442 (f) 0 a What is the third smallest value in -2/165, -0.3, -3, -4, -702, 1.2? -3 Which is the second smallest value? (a) -0.288 (b) 2 (c) 1107 b Which is the second smallest value? (a) -2/15 (b) 0 (c) 14/11293 b Which is the fourth smallest value? (a) -50/11 (b) 14.8 (c) 5 (d) -22 b What is the fourth smallest value in -6/7, 2/159, 0.767, 0.793? 0.793 What is the third biggest value in 0.1, 4502, 203? 0.1 Which is the second smallest value? (a) 1/2 (b) -3 (c) 150 (d) 2/5 (e) 0 (f) 3 (g) 4/685 e What is the fourth smallest value in 116, 5, 2, -0.5, 7, -4/7, 1/46? 2 What is the second smallest value in -48042961, -5/3, -1? -5/3 Which is the fifth smallest value? (a) 0.04 (b) -40 (c) -2 (d) 0.5 (e) 13/22 e What is the second smallest value in 5/8, 1, -4/19, 23, 1/9? 1/9 Which is the biggest value? (a) 2 (b) 38/3 (c) 274 (d) -0.149 c Which is the fifth biggest value? (a) -10/29 (b) 3 (c) -2/21 (d) -0.04 (e) -3/2 (f) 24 a What is the fourth smallest value in 1/7, 2271, 1, -2/9, -65/8? 1 Which is the third smallest value? (a) -0.5 (b) -1/21 (c) 546 (d) 0.084 d What is the fifth smallest value in -1/2, -0.4, 1/6, 49, -0.22, -280, 0? 0 What is the fifth smallest value in 4, 1274, -1/2, -0.02, -1665? 1274 What is the smallest value in -0.5, -4, -50, -30.8308? -50 Which is the third biggest value? (a) -0.6 (b) 5 (c) 25 (d) -29 (e) -2 (f) -0.42 f Which is the fourth biggest value? (a) -6 (b) 2 (c) 2299 (d) -8441 (e) -1/2 a Which is the third biggest value? (a) -1.6 (b) 1/4220 (c) -572 c Which is the second smallest value? (a) 51 (b) -33/2 (c) -5 (d) 2.8 c What is the seventh smallest value in 255, 0.1, 0, -2/5, 0.2, -6, 3? 255 What is the fourth smallest value in -0.1, 1053, -0.5, -2/17, -3? -0.1 What is the smallest value in 370, -3, -11, -4, 3, 69.3? -11 What is the fourth biggest value in -6, 0.01, -6/5, -5, 1.7011? -5 Which is the third biggest value? (a) 327 (b) -6/205 (c) 0.3 (d) 21 c Which is the biggest value? (a) -30 (b) -7 (c) -0.265 (d) 11 (e) -5 (f) -2 d Which is the third smallest value? (a) 2627 (b) 0.2 (c) -0.10536 a Which is the third biggest value? (a) -0.222 (b) -4 (c) -5 (d) 1 (e) 2 (f) 2/29 f Which is the third smallest value? (a) 8 (b) 5 (c) 0.07 (d) -1/6 (e) 0.3 (f) 19 (g) 1/22 c What is the smallest value in -1, -6, 0.0538, 2/3, -4.405? -6 What is the smallest value in 26, 1/5, 14/17, -2/239? -2/239 Which is the fourth biggest value? (a) -5 (b) -1/3 (c) 22.9674 (d) 14 (e) 3 b What is the biggest value in -83/4, -26479, -0.01? -0.01 What is the second biggest value in 2.2, 1.5, -0.5, 10/57, 2/51? 1.5 Which is the second smallest value? (a) -1/8 (b) -12 (c) 0.02 (d) 3 (e) 5 (f) 28 (g) 0.57 a What is the fourth smallest value in -1.1, -8, -13, 11/3, -2? -1.1 What is the biggest value in -9821, -2/11, 0.3, -902? 0.3 Which is the second biggest value? (a) -1/3 (b) -75/14 (c) 3 (d) 23 (e) -3 (f) -0.3 c Which is the second smallest value? (a) -3 (b) -2/61 (c) -15352 a Which is the fourth smallest value? (a) -0.3 (b) 2/13 (c) 41 (d) 944 (e) -0.01 (f) -3 b What is the third smallest value in 1915, 20137, -0.1? 20137 What is the biggest value in 4, -1/5, 2, -77557478? 4 What is the third biggest value in 10.5, -28, 0, -1/4, -10, -2, -0.3? -1/4 Which is the second biggest value? (a) 0.4 (b) -3140/7 (c) -1 (d) -0.3 (e) 5/4 (f) 1 f Which is the fourth smallest value? (a) -4 (b) 2 (c) 387 (d) 36/7 (e) -0.3 d Which is the fifth biggest value? (a) -4 (b) -11 (c) -1 (d) 7/3 (e) 5 (f) 2 (g) -124 a Which is the smallest value? (a) -1706/3 (b) 4/5 (c) 185/16 a What is the biggest value in -1, -35892, -3223? -1 Which is the smallest value? (a) -1/7 (b) 7/3 (c) -2 (d) 1/4 (e) 3 (f) -25/2 f Which is the smallest value? (a) 532 (b) -1 (c) -0.6 (d) -4/5 (e) 8 (f) 5 b What is the biggest value in -6, -10, 107, 2.2, 1? 107 Which is the second smallest value? (a) -82561 (b) 6/67 (c) 5 b Which is the second smallest value? (a) -3375 (b) 1.4 (c) 784 (d) -5 d What is the fourth smallest value in -69281, -2/7, -2/5, 7, 0? 0 Which is the third smallest value? (a) -1/3 (b) 1/3 (c) -1/8088 (d) 5 (e) -40 c Which is the third smallest value? (a) -4 (b) 5 (c) -0.07 (d) -9052.1 c What is the smallest value in -0.3, 0.2, 52.4, -2580? -2580 Which is the fourth biggest value? (a) 2/7 (b) -0.5 (c) 3 (d) 0.5 (e) -294 (f) 1 (g) 11 d Which is the sixth biggest value? (a) 185 (b) 5/4 (c) -2/5 (d) 0.13 (e) 2/3 (f) 2.2 c Which is the smallest value? (a) -2065 (b) 41/21 (c) -4 a Which is the third smallest value? (a) -4 (b) 0.4 (c) -292.98726 b What is the fourth smallest value in -16/3, 3/220, -1, 0.061? 0.061 What is the fifth biggest value in -411, 3, 2/9, 896, -1, 1/3, 1? 2/9 Which is the third biggest value? (a) -1 (b) 2 (c) 402691 (d) -2 (e) 0.5 (f) -9/2 e What is the third smallest value in -14, -6, -2105/8? -6 Which is the fourth smallest value? (a) -1/3 (b) 2/7 (c) 3 (d) -190.6 (e) -2/13 (f) 5 b Which is the third smallest value? (a) 0.3 (b) 3 (c) 6 (d) 1 (e) -86 (f) -0.3 a What is the seventh biggest value in 1, -1, 1/2, -1/5, -4, 183, -297? -297 What is the second biggest value in -1, -0.3, -1570, 0.0083? -0.3 Which is the second smallest value? (a) -0.3 (b) -0.067 (c) -974.69 (d) 6 a Which is the fourth smallest value? (a) 41 (b) 0.5 (c) -22/5 (d) -0.05 (e) -5 (f) 43 (g) -3 d Which is the fourth biggest value? (a) -4/15 (b) -2 (c) -1/11 (d) 31110 (e) -1/4 (f) -4 a Which is the fourth smallest value? (a) -9 (b) 5.614 (c) 0.55 (d) -2 b Which is the second smallest value? (a) 2/5 (b) -132/19 (c) -48/7 (d) 0.01 (e) 2/3 (f) -2/11 c What is the biggest value in 92, -1/9, -235, 0.1, -72, 3/2? 92 What is the fifth smallest value in -1427, 2/3, 0.6, -1/2, 28/11? 28/11 Which is the second smallest value? (a) 2/3 (b) 105 (c) 153/82 c Which is the seventh smallest value? (a) 0 (b) -3690 (c) -4 (d) 1 (e) 5 (f) 0.3 (g) -20/23 e Which is the fifth smallest value? (a) 3/5 (b) 170/19 (c) -5 (d) -6/25 (e) 0 (f) 2/27 a What is the fifth smallest value in 1/2, 2/19, 3/8, 0.3, 1268/7, 3/4, -3/4? 1/2 Which is the smallest value? (a) 54 (b) -94/41 (c) 0 (d) 3/22 (e) 0.2 b What is the second biggest value in 13/1979, -0.23, 2/15, -0.8? 13/1979 What is the fifth biggest value in 2, -8, 0.2, 3/43, 803, -2, 0.3? 3/43 Which is the fifth smallest value? (a) -16 (b) -390 (c) -18.3 (d) 0 (e) 0.4 e Which is the fifth biggest value? (a) 3 (b) -0.04 (c) -2/3 (d) 1008 (e) -1/20 c Which is the smallest value? (a) -69 (b) 24 (c) -3/4 (d) 27 (e) -4 a What is the third smallest value in 2/145, 324, -2, -0.814? 2/145 Which is the second biggest value? (a) 12 (b) -451 (c) 0.4 (d) 10 (e) -3 d What is the fifth biggest value in 0.0113, 2, -3, -1, 12.3, 0.2? -1 What is the second smallest value in 1/7, 0.4242086, -13? 1/7 What is the fourth biggest value in -1/5, -3, 2/7, 11, 0.03, 0.57, -1? 0.03 What is the sixth smallest value in 6, 9585, -0.5, 4, -1/6, -18? 9585 What is the third biggest value in 11539, 2, -0.3, -6/5, -0.0577? -0.0577 What is the sixth biggest value in 5, -3/4, -0.3, 3, -10, 21.3? -10 What is the biggest value in 3914, 0.71, -2/17, -1/7? 3914 Which is the fifth smallest value? (a) 2 (b) -4/3 (c) 23 (d) -0.1 (e) 53 (f) -3/7 (g) -0.7 a What is the second smallest value in 5, -0.3, 16.0157, -5, 1/4? -0.3 What is the second biggest value in 27/2, -11, 4? 4 Which is the fifth smallest value? (a) 14/9 (b) -2/15 (c) -	{ "pile_set_name": "DM Mathematics" }
. Let u = i - 0.017. What is the third smallest value in u, 1/6, d? 1/6 Let j = -10.988 - -11.188. What is the biggest value in -1/7, j, -1/5, -4? j Let z = 1.769 - 1.68. Let g = z - 0.589. Which is the third biggest value? (a) -2/7 (b) -0.1 (c) 1 (d) g a Let p = -0.20936 - -237.20936. Which is the second smallest value? (a) -5/2 (b) 5 (c) p (d) 0.01 d Let j = 5 - 7. Let u = -2.1 - j. Let n(r) = -145r2 + 1165r - 37. Let f be n(8). What is the fourth biggest value in 0.1, f, u, -2/9? -2/9 Let n = 573 - 543.9. Let m = n + -28.1. Let y = -0.1 + 0.11. Which is the second biggest value? (a) 5 (b) m (c) y b Let l = -2.2 + 0.2. Let m = -1 - -1.4. Let j be (1284/9416)/(46/(-40) + (-6)/(-15)). Which is the smallest value? (a) m (b) l (c) -1 (d) j b Let h = 5.67 + -0.67. What is the fourth biggest value in 3/2, -0.3, h, 12? -0.3 Let m(h) = -h*2 - 28h + 67. Suppose 7v + 232 = 22. Let u be m(v). What is the second biggest value in 2/9, -2, u, 22? u Let b = -420 - -424. Let y = 73 + -126. Let k = y - -53. What is the third biggest value in -2, b, k, -3/8? -3/8 Let o = -31.36 + 34.36. What is the second smallest value in -3, o, 0, 0.2? 0 Let x = 27.2 + -176.2. Let m = 144 + x. Let p = 0.4 - 0.3. What is the second smallest value in p, m, -3? -3 Let w = -46.5 - -50. Let n = -8.5 - -17. Let f = w - n. What is the biggest value in -2/11, -0.07, f? -0.07 Let o = 0.2 - 0.7. Suppose 0 = -4n + 2j - 122, 6n = n - 27j + 172. What is the second biggest value in o, -2/5, n? o Let c = 166.1 - 170.1. What is the fourth biggest value in c, -2, 17, 1? c Let j = 1023.5 - 1024. What is the biggest value in 1/3, -1, j, 14, 1/4? 14 Let o = -130.7 - -130.9. What is the second smallest value in 1, -69, o? o Let l be -1(1 - -43 - (4 - -1 - 5)). What is the third smallest value in l, -2/3, -28, -2? -2 Let h be 4 + (1 - (-3)/(-3)). Let z = -455 - -259. Let x = z + 193. What is the smallest value in 0.2, x, -2/7, h? x Let n = 0.4 - 0. Let f = 335 - 367.6. Let i = 33.9 + f. What is the fourth smallest value in -0.2, n, -4, i? i Let h = 47.6 - 47.2. Suppose -c - 59 = 34. Let y be -41 + c/(-21). What is the second biggest value in y, h, -1/3, 1? y Suppose -3w - 4r = -185, 0 = -4w - 7r + 6r + 225. Suppose -57n + wn + 8 = 0. What is the biggest value in -4, 0.4, n? n Let x = -0.4 + 0.9. Let y = 0.14613 + 1.85387. Which is the biggest value? (a) y (b) x (c) -5 a Let m = 35.00618 + -0.00618. What is the fourth smallest value in 0.2, -0.2, -5/7, m? m Let v = -0.608 + 5.594. Let o = v - -0.114. Let i = o + -4.9. Which is the second smallest value? (a) i (b) 0.3 (c) 4 b Let j = 0.0674 + -2.0674. Let d = 10 - 39/4. What is the second smallest value in d, -1, j? -1 Let o = -91.315 + -0.685. Let r = 0.116 + 111.884. Let l = o + r. What is the biggest value in l, 2/9, 0.1? l Let x be (1/((-2)/(-4)))/(-17). Let y = 535 + -63. Let b = 473 - y. What is the fourth biggest value in x, 0.1, b, -1? -1 Let n = -44553/5 - -8911. What is the third biggest value in n, 0.2, 3356? 0.2 Let f = -5/16 - -129/80. Let q = -59/30 + f. Which is the second smallest value? (a) -1 (b) q (c) -2/5 b Let q = 50414 + -50413.9. Suppose 0 = -3t + 3l - 1 - 2, -5t + 31 = 4l. Which is the smallest value? (a) t (b) q (c) -2/9 c Let h = -14 + 19. Let r = -34.59 + -7.36. Let o = r - -42. Which is the smallest value? (a) o (b) h (c) -5 c Suppose -8n - 47 = -47. Which is the third smallest value? (a) -10 (b) n (c) -2 (d) 2 (e) 5 b Let b = -0.0349 + -1.9651. What is the third biggest value in -1, 4/31, b, 0, -1/4? -1/4 Let v = 3.907 + 0.093. Let k = 16 + -13. Let q = -0.3 - 0.2. Which is the fourth smallest value? (a) k (b) v (c) 3/5 (d) q b Let s(w) = -w + 35. Let x = 79 + -57. Let p be s(x). Suppose -pz + 11z = 0. Which is the smallest value? (a) -5 (b) z (c) 4 a Let s = 12 + -7. Suppose 14 = 4d + 467u - 477u, 4d - 28 = -4u. Let n = 13 - 14. What is the second biggest value in n, d, s? s Let d = 1.35 - 0.9. Let j = d + -0.05. Let m be (2/(-28))/(12/198 - 364/(-1617)). Which is the second biggest value? (a) -2/3 (b) j (c) m c Let q be 2/13 + (-126)/(-26) + (-4 - -2). Which is the third biggest value? (a) q (b) -4 (c) 0.017 (d) 2/5 c Let k = 8.296 - 7.796. Which is the fifth smallest value? (a) k (b) 35 (c) -5 (d) -1 (e) 2 b Let z be (-27)/(-6)(-26)/(-234). Which is the second smallest value? (a) 19/2 (b) -4 (c) 2 (d) z d Suppose 5q - 16 = 9q. Let f = 2976.1 - 2976. What is the biggest value in q, -0.4, f, 0.9? 0.9 Let w = 13504 - 13503. Suppose -3y - v - 16 = -6v, 4y - v = -27. Which is the smallest value? (a) w (b) y (c) 0 b Let g = -0.079788 - -0.079788. Let q = -400/9 - -44. What is the fourth smallest value in -1, 3, g, q? 3 Suppose 4x + 0x + 3j = 70, -x = -5j - 6. Let i = -49/3 + x. Let y = -39 + 38.8. Which is the smallest value? (a) y (b) i (c) 3/2 b Let l = 17/23 + 7/115. What is the third biggest value in -22, 0.4, l? -22 Let i = 193/2 + -99. Let f = -188 - -1501/8. What is the fourth smallest value in f, 0.1, 1/6, i? 1/6 Let a = -60.1 + 60. Let f = -0.24 + -2.16. Let j = -0.6 + f. What is the second biggest value in j, a, -0.2, 0.06? a Let z be 81/252 + 36/(-63). What is the third smallest value in 4, 253, z? 253 Let t = 6 + 0. Let o = 10 - t. Let z = 0.03764 + -3.03764. What is the third biggest value in o, z, 5? z Let j(t) = 50t - 222. Let z be j(9). Which is the biggest value? (a) -0.4 (b) z (c) -0.03 b Let m = -219.6 + 217. Which is the second biggest value? (a) m (b) 4/5 (c) 3 (d) -3 b Suppose -1 = -2p - 3. Suppose -3q - 28 = -16. Let d be 17/(-10) + (-2)/q. What is the second biggest value in p, d, -4? d Suppose 63s = 78s - 8565. Let k = s - 571. Which is the smallest value? (a) k (b) -0.4 (c) 8 b Let i = 0.562 - 53.462. Let d = i - -56.9. Which is the second biggest value? (a) 5 (b) d (c) 10 a Let n = 236641/15 - 15776. What is the second smallest value in -1, n, 127? n Suppose 7j = j. Suppose 5z - 2y + 5y - 5 = 0, 4z = 5y - 33. What is the fourth biggest value in 0.2, 5, z, j? z Let k = 1.751 + -1.951. Let i = -1.7 - 0.3. Which is the third smallest value? (a) i (b) 0 (c) k b Let p = 115 + -105. Suppose 0 = pg - 0g + 10. Let y = 733/5 - 146. Which is the biggest value? (a) 0.5 (b) g (c) 1/4 (d) y d Let u = 10263.5 + -10264. Which is the biggest value? (a) u (b) -0.4 (c) 3.4 (d) -4 c Let r = -66825 - -66825.128. Let w = -19/46 - -1/2. Which is the third biggest value? (a) -4 (b) w (c) -3 (d) r c Let b = -56/2127 - 84713/4963. Let q = -50/3 - b. What is the third biggest value in q, 2, 3? q Let g = 49/30 - -13/15. Let w = 107 - 111.31. Let q = -0.31 - w. Which is the third smallest value? (a) g (b) q (c) -5 (d) -4 a Let p be (-22)/(-143) + 2 + (-54)/13. Let u = 2370 - 2373.047. Let j = u + 0.047. Which is the biggest value? (a) j (b) p (c) 2/19 c Let u be (198/1848)/((-12)/(-266)) - (-3)/(-8). What is the second smallest value in -6/5, -4, u, 0.1? -6/5 Let q = 132 - 132.7. Let f = -13 + 17. Let r = f - 1. Which is the third smallest value? (a) 0.4 (b) 3/8 (c) q (d) r a Let i be ((-9)/(79650/20))/(1/5). What is the biggest value in -2/3, -2/5, i? i Let w = 1.111 + 1.109. Let z = 2423/5 + -484. Which is the third biggest value? (a) z (b) w (c) -0.5 c Let k = -52.941 - -53.341. Let w = -42/5 + 1349/160. Which is the second biggest value? (a) w (b) 3 (c) k (d) 1/8 c Let j = 12170 - 12171. Which is the second biggest value? (a) j (b) -2 (c) 2.2 (d) -0.2 d Let f = 5215 + -5212. Which is the third smallest value? (a) -1/7 (b) 2/15 (c) f (d) 3/4 (e) -17 b Let x = -1/109 + 126/1853. Let l = x + 29/85. Which is the fourth smallest value? (a) 5/2 (b) -2/7 (c) -5 (d) l a Let t = 3276.7 - 3277. What is the second biggest value in -4, -0.4, -1, -3/29, t? t Let p be (1/86)/((-29)/58). Which is the biggest value? (a) p (b) -3/4 (c) -4/3 (d) 0.2 (e) -2/5 d Let d = 8 + -14. Let l be (84/(-630) - 46/(-120))-2. What is the fourth smallest value in 12, l, d, 4? 12 Let t be (-23)/((-138)/(-12)) - (24/(-20))/1. What is the third biggest value in -5, t, 1/7? -5 Let y = 5.159 - 9.159. Which is the smallest value? (a) -26 (b) 0.3 (c) y (d) 0.5 a Let v	{ "pile_set_name": "DM Mathematics" }
5 = -12b for b. 5 Solve -k - 6 = -3k for k. 3 Solve 3a = 1 - 4 for a. -1 Solve 36 = 6s - 0s for s. 6 Solve 255 = -106o + 21o for o. -3 Solve -9i = -10i - 2 for i. -2 Solve -27f = -19f for f. 0 Solve -17n - 24 = -92 for n. 4 Solve 0 = 4a - a - 12 for a. 4 Solve -34f + 122 = -48 for f. 5 Solve 457 = 33o + 193 for o. 8 Solve 132r - 139r = 7 for r. -1 Solve -3359 + 3311 = -16j for j. 3 Solve -104 = -15h + 2h for h. 8 Solve 0 = 13o - 7o - 42 for o. 7 Solve -6q - 132 = -28q for q. 6 Solve -5a + 6a = -4 for a. -4 Solve 2t - 157 = -169 for t. -6 Solve 24k - 21k + 6 = 0 for k. -2 Solve -34w = -41w + 7 for w. 1 Solve -11d + 15d + 16 = 0 for d. -4 Solve -15 = -f - 10 for f. 5 Solve 43y + 19y = 248 for y. 4 Solve -50r - 6r + 112 = 0 for r. 2 Solve 5l - 132 = -127 for l. 1 Solve 5l - 670 + 690 = 0 for l. -4 Solve 69 - 186 = -13r for r. 9 Solve 3w + 6 = -0 for w. -2 Solve -18b + 15 = -21b for b. -5 Solve -2l = -19 + 15 for l. 2 Solve 13 = -3c + 1 for c. -4 Solve -28z = 309 - 169 for z. -5 Solve 10t = 17t - 14 for t. 2 Solve -58o = -16o - 42 for o. 1 Solve 0 = 227z - 206z + 126 for z. -6 Solve -2g + 732 = 752 for g. -10 Solve -5v = -33 + 13 for v. 4 Solve 13o - 20 = 9o for o. 5 Solve 5 = g - 2g for g. -5 Solve -402y = -399y - 21 for y. 7 Solve 17j + 290 = -41j for j. -5 Solve -11h - 15h = 130 for h. -5 Solve -11w = 4w - 9w for w. 0 Solve 130y = 66y - 256 for y. -4 Solve 8j - 3j - 20 = 0 for j. 4 Solve -4l - 8l + 60 = 0 for l. 5 Solve 43p = 39p - 8 for p. -2 Solve -14s - 19 = -33s for s. 1 Solve -x - 8 = 3x for x. -2 Solve -10a = a - 55 for a. 5 Solve 42t = 48t for t. 0 Solve -s - 6 = s for s. -3 Solve m = 2m - 3m for m. 0 Solve -q = 5q - 12 for q. 2 Solve 0 = 395a - 397a + 2 for a. 1 Solve 34a - 49 = -117 for a. -2 Solve -t + 0 - 7 = 0 for t. -7 Solve -4x - 63 + 31 = 0 for x. -8 Solve 0 = 2a + 35 - 41 for a. 3 Solve -6c + 16c = 70 for c. 7 Solve 11m = 15m - 4 for m. 1 Solve -18w = 28w + 184 for w. -4 Solve -37 = 10j + 23 for j. -6 Solve -3v + 14 - 17 = 0 for v. -1 Solve -20f - 4 + 84 = 0 for f. 4 Solve -28a - 3 = 109 for a. -4 Solve 3o = 5 - 17 for o. -4 Solve j = -16j - 102 for j. -6 Solve 2a = 47 - 55 for a. -4 Solve -345o + 192 = -369o for o. -8 Solve 1784 = 14f + 1658 for f. 9 Solve -792 = 72m + 16m for m. -9 Solve 243q - 254q - 88 = 0 for q. -8 Solve 0o = 9o + 18 for o. -2 Solve 8j - 48 = -4j for j. 4 Solve -57 = -9l - 57 for l. 0 Solve -210n = -208n - 14 for n. 7 Solve -j + 17 = 23 for j. -6 Solve 105q - 97q = 8 for q. 1 Solve 6 = 16u + 54 for u. -3 Solve 0 = 33c - 13c + 40 for c. -2 Solve -23r + 6 = -21r for r. 3 Solve 3v - 13v + 20 = 0 for v. 2 Solve -z + 7 = 8 for z. -1 Solve 17x + 61 = -7 for x. -4 Solve -79i + 88 = -57i for i. 4 Solve -4 - 1 = 5y for y. -1 Solve 82j = 78j for j. 0 Solve 75a = 129a for a. 0 Solve 0 = 1135t - 1143t - 24 for t. -3 Solve t - 13t - 48 = 0 for t. -4 Solve 8 = 120l - 124l for l. -2 Solve 3n = -147 + 132 for n. -5 Solve -8i = -4i for i. 0 Solve 33 = 27d + 60 for d. -1 Solve -330 + 369 = -13g for g. -3 Solve 174a + 1222 + 170 = 0 for a. -8 Solve -28p + 29p = 2 for p. 2 Solve 0 = -132t + 130t + 10 for t. 5 Solve -108q + 96q + 72 = 0 for q. 6 Solve -441n + 24 = -437n for n. 6 Solve -51z + 36 = -57z for z. -6 Solve 47w + 0 + 0 = 0 for w. 0 Solve 12 = 33t + 111 for t. -3 Solve -7i + 0 = 28 for i. -4 Solve -37 = 2q - 27 for q. -5 Solve 0 = 20r - 4r - 96 for r. 6 Solve -646 + 652 = -6f for f. -1 Solve 45f = 30f + 30 for f. 2 Solve 157u = 159u + 4 for u. -2 Solve -21m + 44 = -61 for m. 5 Solve -19a + 28a - 45 = 0 for a. 5 Solve -12b + 25b = 0 for b. 0 Solve -39 = 5h - 69 for h. 6 Solve 11 = 3b - 4 for b. 5 Solve 8o + 3073 = 3057 for o. -2 Solve 70g = 49g + 189 for g. 9 Solve -6b = -2b + 16 for b. -4 Solve 30z - 93 = -33 for z. 2 Solve -13c = -2c - 55 for c. 5 Solve 37 = 9p + 10 for p. 3 Solve 12r - 9 = 15r for r. -3 Solve -8m + 40 = 2m for m. 4 Solve 0 = -8z + z + 35 for z. 5 Solve -7z + 3 = -4z for z. 1 Solve -10 + 4 = -2k for k. 3 Solve -239 = -4a - 231 for a. 2 Solve -24p = -18p + 18 for p. -3 Solve -12t = 6t + 72 for t. -4 Solve 4g + 0 = -4 for g. -1 Solve i - 13 = -6 for i. 7 Solve 138g + 24g - 324 = 0 for g. 2 Solve -78 = -35v - 218 for v. -4 Solve -6b + 7 = 1 for b. 1 Solve 34q - 69q = -175 for q. 5 Solve -11 = 5g + 9 for g. -4 Solve -24 = -20h + 44h for h. -1 Solve -5a + 7 = -23 for a. 6 Solve 0 = -26p - 107 - 75 for p. -7 Solve 38 = 10m + 18 for m. 2 Solve -3d = -6 + 21 for d. -5 Solve -20 = 2r + 2r for r. -5 Solve 61 = -n + 63 for n. 2 Solve 6 = -3y + 3 for y. -1 Solve 0 = 6q + 8 + 16 for q. -4 Solve o - 10 = -o for o. 5 Solve 0d = -12d + 48 for d. 4 Solve 400t = 403t - 21 for t. 7 Solve 245q = 238q + 35 for q. 5 Solve -16 = 17c - 33 for c. 1 Solve 0 = -52b + 56b - 24 for b. 6 Solve 40 = -219i + 211i for i. -5 Solve 23u = -13u - 108 for u. -3 Solve -3f = -322 + 337 for f. -5 Solve -15p + 1 = -14p for p. 1 Solve -2r = 7 - 1 for r. -3 Solve -26t = -22t + 4 for t. -1 Solve 18 - 6 = 4b for b. 3 Solve -2z - 2486 = -2502 for z. 8 Solve -5l = 51 - 41 for l. -2 Solve 82d + 18 = 79d for d. -6 Solve -10 = 78s - 73s for s. -2 Solve 4s - 26s = 176 for s. -8 Solve 885z - 440 = 830z for z. 8 Solve -10h + 3 = -13h for h. -1 Solve 0 = 4x + 134 - 138 for x. 1 Solve 326u = 327u - 1 for u. 1 Solve 6y = 14y - 56 for y. 7 Solve 3r - 25r = 110 for r. -5 Solve -130t - 150 = -100t for t. -5 Solve 113z = 122z + 45 for z. -5 Solve 12t = t + 33 for t. 3 Solve 26z - 61 = 121 for z. 7 Solve 4u = 9u + 15 for u. -3 Solve 0 = -12s + 27 + 21 for s. 4 Solve -10 = -11h + 12 for h. 2 Solve -168 - 119 = 41l for l. -7 Solve -f + 3 = 3 for f. 0 Solve -4c - 4 = -6c for c. 2 Solve -10d = 51d - 183 for d. 3 Solve -3i + 10 = 7 for i. 1 Solve 0 = -16d + 69 - 21 for d. 3 Solve 3u = -47 + 41 for u. -2 Solve 6 = -5p + 16 for p. 2 Solve 3m + 6 = 3 for m. -1 Solve 2 = 10l - 68 for l. 7 Solve -2d + 15 = 3d for d. 3 Solve 13d - 26 - 39 = 0 for d. 5 Solve 0 = -33b + 7b - 52 for b. -2 Solve 10 = 6q - q for q. 2 Solve -31a - 24a + 19a = 0 for a. 0 Solve 6 = -9m + 6m for m. -2 Solve 8 = 6y - 4 for y. 2 Solve 6a - a = -6a for a. 0 Solve -11 = -5c - 1 for c. 2 Solve 5z = 3z + 2 for z. 1 Solve -343w + 30 = -353w for w. -3 Solve 0 = -86n + 71n - 75 for n. -5 Solve -54p = -62p + 32 for p. 4 Solve x = 12x - 6x for x. 0 Solve -91 = 24p - 11p for p. -7 Solve 30c - 165 = 63c for c. -5 Solve 0 = -42t + 51t - 54 for t. 6 Solve 21r + 2 = -40 for r. -2 Solve -4q + 5 = 17 for q. -3 Solve -3h = -14h + 77 for h. 7 Solve -32b + 10b + 22 = 0 for b. 1 Solve 0 = 5p + 3 + 7 for p. -2 Solve -x + 5x + 12 = 0 for x. -3 Solve -35x - 1200 = 85x for x. -10 Solve -g = -7g for g. 0 Solve -36x = 43x - 79 for x. 1 Solve 0 = -70u + 68u + 4 for u. 2 Solve -79u + 84u = -20 for u. -4 Solve 42 = -144t + 137t for t. -6 Solve -7k + 88 = 74 for k. 2 Solve 18x - 3x - 90 = 0 for x. 6 Solve -8o - 5 - 35 = 0 for o. -5 Solve -219c = -228c + 9 for c. 1 Solve 5g - 9g - 12 = 0 for g. -3 Solve 0 = -311b + 306b for b. 0 Solve 178 - 166 = 6s for s. 2 Solve 0 = 2c - 14 + 4 for c. 5 Solve -69v = -65v - 4 for v. 1 Solve 18 - 14 = 4k for k. 1 Solve -6w + 5 - 17 = 0 for w. -2 Solve -3q = 3q for q. 0 Solve 20r - 28r - 40 = 0 for r. -5 Solve 156t = 158t for t. 0 Solve -69v - 76v = -1015 for v. 7 Solve -31i + 9i + 44 = 0 for i. 2 Solve -b + 3b = 8 for b. 4 Solve -12z + 16z = 8 for z. 2 Solve 6p - 12p = 0 for p. 0 Solve -14 = -133t + 119t for t. 1 Solve -28 = -5r - 13 for r. 3 Solve -3638 + 3602 = 6d for d. -6 Solve -1 = -2r - 5 for r. -2 Solve 38 = -w + 40 for w. 2 Solve 0 = 4i - 13 + 21 for i. -2 Solve 0 = 121v + 223 + 19 for v. -2 Solve 0 = -16x + 17 - 113 for x. -6 Solve -6i = -15 + 27 for i. -2 Solve 0 = 5p + 39 - 14 for p. -5 Solve 2a + 8 = 16 for a. 4 Solve 49z + 22z = 639 for z. 9 Solve 12c - 9 = -57 for c. -4 Solve 135l - 339 = 22l for l. 3 Solve 0 = -40x + 58x - 90 for x. 5 Solve 9t = -10t + 76 for t. 4 Solve 47a = 62a + 105 for a. -7 Solve -11*l = -	{ "pile_set_name": "DM Mathematics" }
or of 139/131652 and 151/17172? 394956 Calculate the common denominator of 85/15462 and 68/99. 170082 What is the lowest common multiple of 764360 and 10670? 8407960 What is the common denominator of 55/1786 and 41/22? 19646 What is the smallest common multiple of 184980 and 813912? 4069560 Calculate the common denominator of -97/48288 and 19/16. 48288 Calculate the lowest common multiple of 144705 and 30. 289410 Calculate the lowest common multiple of 1286 and 59492. 38253356 What is the common denominator of -59/260 and -21/777244? 3886220 Calculate the least common multiple of 5089 and 11. 55979 Calculate the common denominator of -19/2728 and -131/1182588. 2365176 Calculate the common denominator of 19/15170 and -1/647759. 6477590 Calculate the common denominator of -85/352 and 15/1936. 3872 What is the least common multiple of 192 and 567616? 1702848 What is the common denominator of 95/4108 and 80/3081? 12324 What is the common denominator of 99/26260 and 91/8080? 105040 What is the common denominator of 173/502080 and -76/135? 4518720 Calculate the lowest common multiple of 3340 and 10. 3340 Calculate the common denominator of 21/22 and 21/62780. 690580 Calculate the least common multiple of 143 and 689. 7579 What is the least common multiple of 20636 and 8400? 6190800 Calculate the least common multiple of 20480 and 1341440. 2682880 What is the least common multiple of 12656 and 18080? 126560 Calculate the common denominator of 1/632708 and -5/12. 1898124 What is the least common multiple of 18356 and 468? 165204 What is the least common multiple of 133 and 84322? 84322 What is the lowest common multiple of 3550 and 182? 323050 Find the common denominator of -23/11816 and -89/154. 129976 What is the common denominator of 81/6668 and -31/34? 113356 Find the common denominator of 46/37 and -71/1683. 62271 Calculate the least common multiple of 73152 and 22. 804672 Calculate the smallest common multiple of 5886 and 3270. 29430 What is the smallest common multiple of 73944 and 2844? 73944 Calculate the common denominator of 139/52500 and 143/52500. 52500 Calculate the least common multiple of 471132 and 22191. 6124716 Calculate the lowest common multiple of 146745 and 704376. 3521880 What is the common denominator of -111/70 and -33/51086? 255430 Calculate the least common multiple of 2303388 and 16. 9213552 What is the lowest common multiple of 16947 and 16947? 16947 Find the common denominator of -7/161559 and 5/21. 1130913 What is the lowest common multiple of 97440 and 252? 292320 Find the common denominator of -25/7 and 59/79970. 559790 What is the common denominator of -19/56562 and -63/2266? 5825886 Calculate the lowest common multiple of 9546 and 67983. 5030742 Calculate the common denominator of 103/2970 and 89/8460. 279180 Find the common denominator of -103/30 and 167/17934. 89670 What is the smallest common multiple of 3944 and 321232? 9315728 Find the common denominator of 12/293041 and -109/251178. 1758246 What is the smallest common multiple of 286 and 64592? 839696 Calculate the common denominator of 77/63072 and 97/30. 315360 Calculate the lowest common multiple of 147234 and 1060. 1472340 Calculate the lowest common multiple of 60093 and 49167. 540837 What is the least common multiple of 17424 and 20328? 121968 Calculate the least common multiple of 608894 and 208. 4871152 What is the common denominator of -137/2064 and -67/5504? 16512 Find the common denominator of -83/14430 and -9/104. 57720 Find the common denominator of 25/2793 and -47/627. 30723 What is the least common multiple of 29699 and 27952? 475184 What is the smallest common multiple of 808980 and 1294368? 6471840 Find the common denominator of 1/155392 and -5/4. 155392 What is the lowest common multiple of 13656 and 30? 68280 What is the least common multiple of 15 and 28191? 140955 What is the lowest common multiple of 308 and 955080? 10505880 Calculate the least common multiple of 528380 and 2906090. 5812180 What is the least common multiple of 60 and 21744? 108720 What is the smallest common multiple of 206649 and 87? 5992821 What is the least common multiple of 390 and 110? 4290 What is the common denominator of 53/206385 and 187/150? 2063850 Find the common denominator of 36/1679 and -11/73. 1679 Calculate the smallest common multiple of 63 and 301944. 6340824 Calculate the lowest common multiple of 408 and 11762. 2399448 Find the common denominator of -43/314 and 53/65970. 10357290 What is the least common multiple of 2795 and 95116? 6182540 Calculate the lowest common multiple of 19200 and 4560. 364800 What is the common denominator of 41/3161 and -1/25070? 727030 Calculate the smallest common multiple of 4312 and 231. 12936 Calculate the common denominator of -82/2625 and -113/4200. 21000 Calculate the common denominator of -53/503440 and 43/9280. 2013760 Find the common denominator of -35/85454 and 103/20. 854540 What is the common denominator of 56/1131 and -53/4524? 4524 What is the smallest common multiple of 15827 and 456? 379848 Calculate the least common multiple of 921 and 71. 65391 Calculate the common denominator of -121/11232 and -103/10. 56160 Calculate the smallest common multiple of 20 and 1017120. 1017120 Calculate the common denominator of -59/440 and 43/8470. 33880 Find the common denominator of 25/312 and 59/3198. 12792 What is the common denominator of -25/671 and 76/126819? 126819 Calculate the common denominator of 79/628992 and 89/389376. 8176896 What is the common denominator of 79/46155 and -98/3315? 600015 Calculate the common denominator of -191/6240 and 13/320. 12480 Find the common denominator of 133/288 and 41/73200. 439200 Find the common denominator of -4/21 and 117/4228. 12684 Calculate the lowest common multiple of 112970 and 286. 112970 What is the lowest common multiple of 4 and 33652? 33652 Calculate the least common multiple of 313380 and 3482. 313380 What is the least common multiple of 9 and 27806? 250254 What is the common denominator of -8/3105 and 4/3? 3105 Calculate the lowest common multiple of 5883 and 1013837. 3041511 Calculate the common denominator of 59/84237 and -37/18. 505422 Find the common denominator of -123/65410 and 2/32705. 65410 What is the least common multiple of 2260375 and 29425? 24864125 Find the common denominator of -22/69 and 44/4887. 112401 What is the common denominator of -97/126364 and 105/368? 11625488 What is the lowest common multiple of 27951 and 484? 111804 What is the least common multiple of 36837 and 90046? 810414 Calculate the least common multiple of 14744 and 688. 1267984 What is the least common multiple of 36 and 232560? 232560 Calculate the common denominator of 15/255332 and 55/14922. 2297988 What is the common denominator of 57/700 and 57/280? 1400 What is the common denominator of -83/2 and -47/2171? 4342 What is the smallest common multiple of 170 and 130730? 130730 Calculate the common denominator of 139/42 and -121/654. 4578 Calculate the common denominator of 65/234758 and -103/642. 704274 Calculate the lowest common multiple of 21510 and 14340. 43020 What is the common denominator of -36/55 and 31/547? 30085 Calculate the least common multiple of 1398 and 101355. 202710 What is the common denominator of -29/16 and -37/1298140? 5192560 Calculate the smallest common multiple of 10 and 18785. 37570 What is the smallest common multiple of 1746 and 36084? 108252 What is the least common multiple of 24 and 35820? 71640 Find the common denominator of 17/639 and 29/3195. 3195 What is the smallest common multiple of 10850 and 121520? 607600 What is the common denominator of -111/22876 and 13/152? 45752 What is the lowest common multiple of 328257 and 27? 984771 What is the common denominator of 17/6945 and 58/45? 20835 Find the common denominator of -75/16856 and 117/2408. 16856 Calculate the least common multiple of 605214 and 90. 3026070 What is the common denominator of -12/7 and 58/94241? 94241 Calculate the least common multiple of 989 and 433. 428237 What is the common denominator of -83/572 and -121/8060? 88660 What is the least common multiple of 3500 and 27000? 189000 What is the common denominator of -4/7177 and -9/11? 78947 Calculate the common denomina	{ "pile_set_name": "DM Mathematics" }
+ 1. Let q(n) = 2p(n) - 2x(n). Factor q(g). -2(g - 1)2(g + 1)*2 Suppose -3y = 3t + 6, -2y + y = -3t - 6. What is v in -8v - 15v3 + 12v*2 + 11v*3 + yv*3 = 0? 0, 1, 2 Let i be (30/(-4) + 3)/(2(-15)/10). Factor 15/8 - im - 3/8m*2. -3(m - 1)(m + 5)/8 Let w(t) be the second derivative of -t6/30 - 11t*5/20 - 31t*4/12 - 7t*3/2 - 8t + 8. Factor w(l). -l(l + 1)(l + 3)(l + 7) Let b(d) = -d2 - 11d + 2622. Let n be b(46). Determine o so that -1/2o - 3/4o*4 + 1/4o*5 + n + 3/4o*2 + 1/4o*3 = 0. -1, 0, 1, 2 Let n = -115 + 117. Let i(f) be the first derivative of 16/15f*3 - 13/10f*4 - 4/5f - 4 + 7/5fn - 24/25f*5. Find o, given that i(o) = 0. -1, 1/4, 2/3 Let v = 17003 + -119017/7. Factor 6/7i*2 - 2/7 - 8/7i*3 - 8/7i*4 + vi. -2(i + 1)2(2i - 1)2/7 Let n(k) be the first derivative of 2k*5/25 - 2k*4/5 - 8k*3/15 + 16k*2/5 - 108. Factor n(z). 2z(z - 4)(z - 2)(z + 2)/5 Let n(t) = 46t + 3406. Let x be n(-74). Suppose 24 + 2/3yx + 8y = 0. What is y? -6 Let y(o) be the third derivative of 0o - 1/60o*5 + 0o*3 + 26o*2 + 0 + 1/3o4. Solve y(v) = 0. 0, 8 Let n(k) = -k2 + 5k + 17. Let x(t) = -t3 - 9t*2 + 10t + 7. Let b be x(-10). Let f be n(b). Factor 0v + 2/3v*4 - 2/3v*5 - 2/3v*2 + 2/3v*f + 0. -2v*2(v - 1)*2(v + 1)/3 Suppose 4c = -4 + 16. Factor 3d*c - 106d*5 + 109d*5 - 3d*3. 3d*5 Let n(j) be the third derivative of 0 + 0j*4 + 1/392j*8 + 0j - 2/35j5 + 0j*6 - 5j*2 + 3/245j*7 + 0j*3. Find k such that n(k) = 0. -2, 0, 1 Let z = -14087/4 + 98705/28. Factor -2/7l*4 - 8/7 - 12/7l*3 - 26/7l*2 - zl. -2(l + 1)2(l + 2)2/7 Let g(h) be the first derivative of h8/2520 + h7/1260 - h6/135 - h*5/45 - 2h*3 - 22. Let a(v) be the third derivative of g(v). Solve a(r) = 0 for r. -2, -1, 0, 2 Suppose -1613k = -1600k. Factor kt*2 + 3/5t*5 + 0 - 9/5t*4 + 6/5t*3 + 0t. 3t3(t - 2)(t - 1)/5 Let w = 2983 + -8944/3. What is h in -5/3h*2 + 10/3h - w = 0? 1 Suppose 0 = 3p + 2b - 177 - 9, -4p = b - 253. Factor -4l*4 - 5l*3 + 32l*2 + 3l*4 - 9l*4 - 3l*3 + 32 + pl - 2l5. -2(l - 2)(l + 1)(l + 2)*3 Suppose 60y = -2p + 64y - 8, 5 = -2p + 3y. What is h in 3/10h - 9/10h*p + 1/5 = 0? -1/3, 2/3 Let i(y) be the second derivative of 0y*2 - 1/18y*4 + 31y + 1/3y3 + 0. Find u, given that i(u) = 0. 0, 3 Let f(z) be the first derivative of -14z*3/11 + 2z*2 - 2z/11 - 48. Find v, given that f(v) = 0. 1/21, 1 Let t(b) = -b + 3. Let p be t(1). Factor 26i - 21i - 5ip + 0i*2 + 10i. -5i(i - 3) Let b(r) be the first derivative of r*5 - 15r*4/4 - 10r*3/3 + 30r*2 - 40r - 127. Factor b(m). 5(m - 2)2(m - 1)(m + 2) Factor 0 + 0b - 3/2b4 + 1/2b3 + b2. -b*2(b - 1)(3b + 2)/2 Let n(c) be the first derivative of c7/3780 - c6/1620 - c*5/270 - 7c*3 + 14. Let y(o) be the third derivative of n(o). Solve y(x) = 0 for x. -1, 0, 2 Determine n, given that -2n - 4/3 + 2n2 + 14/3n*3 + 2n*4 = 0. -1, 2/3 Factor 816/7i + 1496/7i3 - 1684/7i*2 - 144/7 - 484/7i*4. -4(i - 1)*2(11i - 6)2/7 Let w(g) = -g3 + 3g - 2. Suppose -3z - 1 = -4. Let l be w(z). What is r in lr - 1/5r2 - 4/5r3 + 0 = 0? -1/4, 0 Let n(s) be the third derivative of s7/840 - s*6/80 - 3s*5/80 + 7s*4/48 - 84s2 + 2. Suppose n(w) = 0. What is w? -2, 0, 1, 7 Let b(j) be the third derivative of -j7/1470 - j*6/60 - 23j5/420 + j4/12 + 4j3/7 - 172j*2. What is y in b(y) = 0? -12, -2, -1, 1 Let p = 3687 - 3685. Factor -2/5o*2 - 2/5o*3 + po - 6/5. -2(o - 1)2(o + 3)/5 Let q = 27/2 - 943/70. Let l(a) be the second derivative of 0a2 - qa*5 - 1/105a*6 + 0 + 4a + 1/42a4 + 2/21a*3. Suppose l(y) = 0. What is y? -2, -1, 0, 1 Let t(d) = 14d + 21. Let r(x) = -5x - 7. Let y(k) = 11r(k) + 4t(k). Let g be y(-4). Factor -7c*3 - 8c*3 + 12c*3 + 3c*4 + 3c*5 - gc*2. 3c*2(c - 1)(c + 1)2 Let s(o) be the first derivative of 1/4o*4 + 13 + 0o*2 + 0o + 0o3. Let s(t) = 0. Calculate t. 0 Suppose 5i - 12i = 13i. Let q(t) be the second derivative of -1/16t4 + 0t*3 + i + t + 0t*2. Factor q(h). -3h*2/4 Let d be (-10)/(-35) - 38/(-14). Factor 24u*3 - 21u*d - 2u*2 + 0u4 - u4. -u*2(u - 2)(u - 1) Let y(d) be the first derivative of d6/40 + 3d5/16 + d4/2 + d*3/2 + 32d + 11. Let k(q) be the first derivative of y(q). Factor k(j). 3j(j + 1)(j + 2)2/4 Let c = 1606 - 1603. Let s(b) be the first derivative of -4/3b*c - 8b*2 - 8 - 16b. Suppose s(g) = 0. What is g? -2 Suppose 20n + 5 = 21n. Suppose -k = -nf + 2, 2f - 3 = -1. Find s such that 0s - 2/7s*5 + 4/7s*k + 0 - 2/7s*4 + 0s*2 = 0. -2, 0, 1 Let g be (60/(-33))/(120/(-220)). What is a in -4 + 26/3a - ga2 = 0? 3/5, 2 Let b(h) be the first derivative of 5h*4/8 + 5h*3/3 - 25h*2/4 - 15h - 422. Factor b(x). 5(x - 2)(x + 1)(x + 3)/2 Suppose -23t + 39 + 145 = 0. Let r(d) be the first derivative of 0d - 3/10d*4 - t - 2/3d*3 - 2/5d*2. Factor r(a). -2a(a + 1)(3a + 2)/5 Determine j so that 2/3 + 2/15j*2 + 4/5j = 0. -5, -1 Let u(i) be the second derivative of i6/765 + i5/255 + i*4/204 - 19i*3/6 + 26i. Let h(b) be the second derivative of u(b). Factor h(r). 2(2r + 1)*2/17 Determine h, given that 0h + 2/5h5 + 18/5h*3 - 12/5h*4 - 8/5h2 + 0 = 0. 0, 1, 4 Let c(t) be the third derivative of -t7/105 + t6/24 + t5/6 + 20t2. Let h(u) = -5u*4 + 10u*3 + 20u*2. Let i(a) = 5c(a) - 3h(a). Solve i(o) = 0. -1, 0, 2 Let y(p) be the first derivative of 3p*6/10 - 102p*5/25 + 63p*4/5 + 72p*3/5 - 202. Suppose y(q) = 0. What is q? -2/3, 0, 6 Let h(b) be the third derivative of 11b*6/480 + 9b*5/20 - 5b*4/24 + 12b*2. Factor h(u). u(u + 10)(11u - 2)/4 Suppose -4i = -0i. Suppose -3r - 3f + 6 = 0, -19 = -2r + f - 12. Factor -1/2b*2 + 0b + i - 1/4br. -b2(b + 2)/4 Suppose 2a - 5a = -5t - 1, 0 = -a + 2t. Find n, given that 19n3 + 7n*2 - 3n*a - 15n*3 = 0. -1, 0 Factor 2m*2 + 0 + m - 5/4m*3. -m(m - 2)(5m + 2)/4 Let k(p) be the third derivative of -p7/560 + p6/320 + p5/40 - p4/16 - 14p2. Factor k(d). -3d(d - 2)(d - 1)(d + 2)/8 Solve 3p*3 - 140p + 16 - p*3 + 6p*4 + 132p + 0p3 - 28p*2 = 0 for p. -2, -1, 2/3, 2 Suppose -37x - 28x = -130. Determine t so that 6/11t*x + 6/11t + 2/11t3 + 2/11 = 0. -1 Suppose 0 = -3s + 19 + 38. Suppose 31 = 5g - s. Factor -gw*3 + 8w + 13w3 + 3 + 9w*2 + w. 3(w + 1)*3 Solve -40/9 + 2/9c*2 + 2/9c = 0. -5, 4 Let f(d) = 34d3 + 100d*2 + 154d + 60. Let k(v) = -509v - 11 - 1 + 478v - 7v3 - 20v*2. Let g(a) = -3f(a) - 14k(a). Factor g(w). -4(w + 1)*2(w + 3) Let k(f) be the first derivative of 0f - 2/3f*3 + 13 + 1/4f*4 + 1/2f*2. Factor k(x). x(x - 1)*2 Let q(k) be the second derivative of 0 + 1/8k*2 + 1/12k*3 + 1/48k*4 + k. Let q(v) = 0. Calculate v. -1 Let y(c) = -4c + 12. Let b be y(3). Let j(v) be the third derivative of 0 + 0v + bv*4 + 1/90v*5 + 5v*2 + 0v*3. Factor j(s). 2s*2/3 Let a(z) = -13z*3 - 20z*2 + 1073z - 210. Let f(h) = -41h3 - 60h*2 + 3216h - 630. Let t(p) = -17a(p) + 6f(p). Factor t(j). -5(j - 6)(j + 7)(5j - 1) Let v = 7 + -4. Let g = 97/7 + -284/21. Factor 2/3u2 + 0u + 0 + guv. u2(u + 2)/3 Factor 0 + 0q + 0q*2 - 8/9q*4 + 4/3q*3 - 4/9q*5. -4q*3(q - 1)(q + 3)/9 Let i = -130062/11 + 11824. Factor 18/11c*3 + ic + 0 - 12/11c2. 2c(3c - 1)*2/11 Suppose 5k - 5l = 500, 2l - 145 = -k - 48. Suppose 5z - 513 + 3 = 0. Determine u so that -z + k - 3u + u + u*2 = 0. -1, 3 Let i(t) be the first derivative of 9t*4/4 - 11t*3/3 - 8t*2 + 4t - 7. Factor i(m). (m - 2)(m + 1)(9m - 2) Let k(f) be the second derivative of f6/6 - 9f*5/2 - 205f*4/3 - 225f*3 - 625f*2/2 + 189f. Find o, given that k(o) = 0. -5, -1, 25 Let v be (-68)/(-20) + 132/(-330). Solve 2/5s + 2/5s*4 - 2/5s*2 + 0 - 2/5s*v = 0. -1, 0, 1 Let r be 188/2303(8 - 1). Let u(m) be the first derivative of 4/7m - 1 + 4/21m*3 + rm*2. Find v such that u(v) = 0. -1 Let k(b) be the second derivative of 3b5/20 + b4/3 - 14b*3/3 + 8	{ "pile_set_name": "DM Mathematics" }
ch that 25k2 - 81076585k - 48645960 = 0. -3/5, 3243064 Determine u so that -2u4/11 + 12348u*3/11 - 6722u*2 - 456612u/11 + 1110240/11 = 0. -5, 2, 9, 6168 Determine w so that 22w3 - 7904w*2 + 33290w + 28400 = 0. -8/11, 5, 355 Factor -16w3 + 11934736w*2 - 11934724w + 2983680. -4(w - 745920)(2w - 1)2 Let -3g*4 + 756g*3 + 20025g*2 - 533706g + 512928 = 0. Calculate g. -39, 1, 16, 274 Solve 5g5 - 2240g*4 + 46860g*3 = 0 for g. 0, 22, 426 Factor 856980z*2 + 39052620z + 444907445. 5(414z + 9433)*2 Suppose -3d*2 - 68240109d + 204720354 = 0. Calculate d. -22746706, 3 Let -147725q3/4 + 2953435q*2/4 - 3687800q - 26625 = 0. What is q? -213/29545, 10 Factor -2v2/9 - 37904v/9 - 10774010/3. -2(v + 895)(v + 18057)/9 Factor 3a3/5 + 22925166a*2/5 + 8759286397191a - 1927087390758948/5. 3(a - 44)(a + 3820883)*2/5 Determine b so that -2b*5/11 - 31976b*4/11 - 5798b*3 + 2653844b*2/11 + 2682120b/11 - 56398608/11 = 0. -15986, -7, 6 Find t such that t*4/9 + 4496t*3/9 - 7t*2/9 - 31466t/9 + 8992/3 = 0. -4496, -3, 1, 2 Factor -l*2/4 - 9580813l/2 - 91791977740969/4. -(l + 9580813)*2/4 Factor 4r*3 + 3611052r*2 - 28888608r + 57777344. 4(r - 4)2(r + 902771) Factor -5k3 + 415290k*2 + 125k - 10382250. -5(k - 83058)(k - 5)(k + 5) Find n, given that 52n*3 + 44848n*2 + 11499728n + 747130880 = 0. -382, -1280/13 Find w such that -w*3/4 + 2309w*2/4 + 312743w/2 + 155794 = 0. -244, -1, 2554 Factor 4g2 + 1208460g + 10875816. 4(g + 9)(g + 302106) What is m in -m*2/3 + 26616m - 878207/3 = 0? 11, 79837 Factor -904792854436u3/7 + 1809559075104u*2/7 + 7609620u + 56. -4(u - 2)(475603u + 7)2/7 Factor 3l*2 + 16572l + 592704. 3(l + 36)(l + 5488) Factor -2g3/11 + 11808248g*2/11 - 17429340103688g/11. -2g(g - 2952062)*2/11 Factor -2a*4 + 4003564a*3 - 2671419449160a*2 + 594176223406348436a + 594178894829801162. -2(a - 667261)3(a + 1) Let -2m5/7 + 584m*4/7 + 32330m*3 + 4062148m*2/7 - 612720m = 0. What is m? -207, -20, 0, 1, 518 Determine x so that -x*2 + 86194189x + 86194190 = 0. -1, 86194190 Factor 2h2/15 - 17992h/15 + 35864. 2(h - 8966)(h - 30)/15 Factor 2c3 - 1833920c*2 - 1833922c. 2c(c - 916961)(c + 1) Factor -g2/3 - 2122g/3 - 10585/3. -(g + 5)(g + 2117)/3 What is v in -2v*3 - 4253654v*2 - 2261698670790v - 2261694417138 = 0? -1063413, -1 Solve -2r3 + 188r*2 + 118r - 236592 = 0 for r. -31, 53, 72 Factor 5d3 + 509194880d*2. 5d*2(d + 101838976) Factor -2s2/7 - 5109528s/7 + 10219064/7. -2(s - 2)(s + 2554766)/7 Solve -105y3 - 68155y*2 - 7488790y - 712600 = 0 for y. -509, -140, -2/21 Suppose 9t5/4 + 1965t*4/4 + 2691t*3/4 - 809457t*2/4 - 67743t + 134805 = 0. Calculate t. -215, -22, -1, 2/3, 19 Suppose -3k4/7 + 250587k*3/7 - 747169755k*2 - 109939476375k/7 - 104709037500/7 = 0. Calculate k. -20, -1, 41775 Determine i, given that 2i4/7 + 43364i*3/7 + 33554430i*2 - 1881824400i/7 = 0. -10845, 0, 8 Let 840j5 - 48404j*4 + 73224j*3 + 176028j*2 + 52216j - 1344 = 0. Calculate j. -1, -2/5, 1/42, 3, 56 Factor -12g3 + 6495g*2 - 76644g + 228636. -3(g - 6)2(4g - 2117) What is o in -2o*2/11 + 60841736o/11 - 462714604936712/11 = 0? 15210434 Let 4c2 + 25472228c - 178305792 = 0. Calculate c. -6368064, 7 Suppose -5v3 - 6845190v*2 - 150591760v = 0. Calculate v. -1369016, -22, 0 Solve x*2 - 477854x - 477855 = 0 for x. -1, 477855 Determine w, given that -2w3/7 - 15008w*2 + 20562758w/7 + 41545724/7 = 0. -52723, -2, 197 Solve 3b2 - 490581b + 11281776 = 0 for b. 23, 163504 Solve -n*5/5 - 12213n*4/5 - 61023n*3/5 + 207557n*2/5 + 256368n/5 = 0 for n. -12208, -7, -1, 0, 3 Factor 4i2 - 135214120i - 135214124. 4(i - 33803531)(i + 1) Let 388j2 + 68987548j - 2844848 = 0. Calculate j. -177803, 4/97 Solve 3t3/4 - 318591t*2/2 - 3185973t/4 - 637197 = 0. -4, -1, 212399 Factor 5x3 - 24145x*2 - 948720x - 2628720. 5(x - 4868)(x + 3)(x + 36) Factor -2v*3 - 364516v*2 - 84096474v. -2v(v + 231)(v + 182027) Factor -3a*3 - 3448a*2 - 4572a + 22960. -(a - 2)(a + 1148)(3a + 10) Factor m2/3 - 441933m - 22538872/3. (m - 1325816)(m + 17)/3 Factor -3j*3 + 77376j*2 - 499075164j + 1995062832. -3(j - 12894)2(j - 4) Solve -n*4 - 459n*3 - 3020n*2 + 65088n = 0 for n. -452, -16, 0, 9 Factor -268l2/9 + 912802l/9 + 6812/3. -2(l - 3406)(134l + 3)/9 Find y, given that y2/5 - 485351898y/5 + 58891616223050601/5 = 0. 242675949 Find x, given that x*5 - 373x*4 + 33145x*3 - 844183x*2 + 6878098x - 6066688 = 0. 1, 17, 82, 256 Let 2u5/11 + 1126u*4/11 - 37900u*3/11 - 66898544u*2/11 + 201130496u/11 + 267990016/11 = 0. Calculate u. -392, -1, 4, 218 Solve 23q2/4 - 329201q - 858795/4 = 0. -15/23, 57253 Determine p, given that -2p2/13 + 33096p/13 - 231574/13 = 0. 7, 16541 Factor -3t2/8 - 16249029t/4 + 97494201/8. -3(t - 3)(t + 10832689)/8 Find j, given that -5j3 + 540240j*2 - 635282695j + 634742460 = 0. 1, 1188, 106859 Factor -k*3/5 + 167162k*2/5 + 133732k + 668664/5. -(k - 167166)(k + 2)2/5 Solve -4v*5 - 5432v*4 - 150388v*3 + 5011248v*2 - 9377424v = 0. -1329, -49, 0, 2, 18 Let 3i2 - 44430i + 5506875 = 0. What is i? 125, 14685 Factor -3o2 + 1648067328o - 226343826468421632. -3(o - 274677888)2 Determine s, given that -4s*4 + 149100s*3 - 3575892s*2 - 7599100s - 3874104 = 0. -1, 26, 37251 Factor m*2/4 + 323133m/4 + 17120431/2. (m + 106)(m + 323027)/4 Let 2i*4 - 663724i*3 + 55048270058i*2 + 2974058304984i + 40156320219912 = 0. Calculate i. -27, 165958 Factor 3l3/5 - 244707l*2/5 + 18095997l/5 - 66939993. 3(l - 81495)(l - 37)2/5 Factor i3 - 2067i2 - 189468i - 370660. (i - 2155)(i + 2)(i + 86) Factor -2w2/9 - 8146w/9 + 4413940/3. -2(w - 1245)(w + 5318)/9 Factor -r*2 - 73567614r - 1353048457413249. -(r + 36783807)2 Solve a5/8 - 11a4/4 - 909a*3/4 - 5129a*2/2 - 59431a/8 - 20355/4 = 0. -23, -10, -3, -1, 59 Let z*5/11 + 389z*4/11 - 3653z*3/11 - 28249z*2/11 + 332z + 27860/11 = 0. Calculate z. -398, -5, -1, 1, 14 Solve 4u5/9 - 2492140u*4/9 + 43130428588u*3 - 43130151684u*2 = 0 for u. 0, 1, 311517 Let -3g*3 + 708024g*2 - 41774124015g - 83551080150 = 0. What is g? -2, 118005 Suppose m*4/5 - 3721m*3/5 + 1623727m*2/5 + 9842937m/5 + 2962944 = 0. What is m? -3, 512, 3215 Find k such that -4k2 + 1453424k + 5813760 = 0. -4, 363360 Find o such that 2o2/3 - 1500o - 45200/3 = 0. -10, 2260 Determine s so that 2s3/5 - 127558s*2/5 - 13287256s/5 - 26064264/5 = 0. -102, -2, 63883 Let 18328n3 - 206238n*2 + 50942n - 132 = 0. Calculate n. 6/2291, 1/4, 11 Factor -4554813675q2 - 92814630q - 472827. -3(38965q + 397)*2 Solve -2a*5/3 - 998a*4/3 - 11208a*3 - 126656a*2/3 + 3084928a/3 - 1792736 = 0 for a. -463, -22, 2, 6 Solve g*2/4 + 10501g/2 + 1163568 = 0. -20778, -224 Find w such that -w*5/7 + 27w*4 + 6431w*3/7 - 77985w*2/7 + 29450w = 0. -38, 0, 5, 217 Solve 961c4/9 + 598331c*3/3 - 2037222c*2 + 780096c + 26051616 = 0. -1878, -3, 204/31 Find c such that 6c5 + 396800c*4 - 7011466c*3 + 35720964c*2 - 38103232c - 16934656 = 0. -66151, -1/3, 2, 8 Find n, given that -4n2 + 243036n + 22636944 = 0. -93, 60852 What is z in -4z2 - 38802648z - 77605280 = 0? -9700660, -2 Find r, given that -539r3 - 2075174r*2 - 92400r = 0. -3850, -24/539, 0 Suppose 36n5 + 2584n*4 - 8040n*3 + 2800n*2 + 8004n - 5384 = 0. What is n? -673/9, -1, 1, 2 Find u such that 4u3 - 97440u*2 - 78439924u + 78537360 = 0. -781, 1, 25140 Factor -2s2/15 + 1582154s. -2s(s - 11866155)/15 What is f in -2f5 - 26026f*4 - 84577918f*3 + 593347426f*2 + 84577920f - 593321400 = 0? -6510, -1, 1, 7 Factor 2o3/7 + 18292o*2/7 + 255786o/7 + 821880/7. 2(o + 5)(o + 9)(o + 9132)/7 Solve c3/2 - 44097c*2/2 + 22048c = 0. 0, 1, 44096 Solve -5a4 - 8460920a*3 - 3579392205840a*2 - 28634731523840a - 57269192299520 = 0. -846088, -4 Find s, given that -s*5/2 + 411s*4 - 34955s*3 + 768990s*2 + 1751831s/2 - 1610361 = 0. -2, 1, 47, 729 Suppose 3g	{ "pile_set_name": "DM Mathematics" }
the greatest common divisor of 6 and 1182. 6 What is the greatest common divisor of 72 and 312? 24 Calculate the highest common factor of 238 and 68. 34 What is the highest common factor of 8868 and 60? 12 Calculate the highest common factor of 2030 and 770. 70 What is the highest common factor of 1269 and 1504? 47 Calculate the highest common divisor of 216 and 144. 72 Calculate the greatest common factor of 134 and 4690. 134 Calculate the highest common divisor of 1037 and 102. 17 What is the greatest common factor of 6893 and 113? 113 What is the highest common factor of 850 and 34? 34 What is the greatest common factor of 4389 and 836? 209 What is the highest common factor of 8335 and 5? 5 Calculate the greatest common factor of 858 and 234. 78 What is the greatest common divisor of 780 and 4? 4 Calculate the highest common factor of 3430 and 1190. 70 Calculate the highest common factor of 44 and 852. 4 What is the highest common divisor of 220 and 16? 4 What is the highest common divisor of 186 and 3534? 186 What is the highest common factor of 7198 and 2242? 118 Calculate the highest common divisor of 20604 and 68. 68 Calculate the greatest common factor of 477 and 9. 9 Calculate the highest common factor of 12 and 10932. 12 What is the highest common factor of 45 and 555? 15 What is the highest common divisor of 41676 and 276? 276 Calculate the greatest common divisor of 47 and 47. 47 Calculate the greatest common divisor of 1107 and 540. 27 Calculate the highest common divisor of 336 and 483. 21 What is the highest common divisor of 703 and 608? 19 Calculate the greatest common factor of 12 and 276. 12 Calculate the highest common factor of 11 and 19217. 11 What is the highest common factor of 354 and 20709? 177 Calculate the greatest common divisor of 84 and 3054. 6 Calculate the greatest common divisor of 24 and 67. 1 Calculate the highest common factor of 54 and 54. 54 Calculate the greatest common factor of 740 and 140. 20 Calculate the highest common divisor of 1540 and 280. 140 Calculate the highest common factor of 34866 and 117. 117 Calculate the highest common factor of 567 and 441. 63 Calculate the greatest common factor of 33000 and 24. 24 What is the highest common factor of 301 and 43? 43 Calculate the greatest common divisor of 16489 and 44. 11 Calculate the greatest common divisor of 909 and 808. 101 What is the highest common divisor of 550 and 22? 22 What is the greatest common divisor of 2520 and 1064? 56 Calculate the highest common factor of 513 and 741. 57 Calculate the greatest common factor of 44 and 32. 4 What is the highest common factor of 745 and 2533? 149 Calculate the highest common divisor of 7 and 4963. 7 Calculate the greatest common divisor of 4 and 718. 2 Calculate the highest common divisor of 226 and 84298. 226 Calculate the greatest common divisor of 2 and 3. 1 What is the greatest common factor of 1603 and 7? 7 What is the highest common factor of 295 and 472? 59 Calculate the greatest common factor of 14596 and 820. 164 What is the greatest common divisor of 264 and 552? 24 Calculate the greatest common divisor of 72 and 180. 36 What is the greatest common factor of 351 and 13? 13 What is the greatest common factor of 500 and 60? 20 Calculate the greatest common divisor of 36 and 1116. 36 Calculate the greatest common factor of 1269 and 94. 47 What is the highest common divisor of 92 and 115? 23 What is the greatest common factor of 13 and 702? 13 What is the highest common factor of 924 and 60? 12 Calculate the highest common factor of 240 and 135. 15 What is the greatest common divisor of 527 and 17? 17 What is the greatest common divisor of 912 and 208? 16 Calculate the greatest common factor of 26 and 169. 13 Calculate the highest common divisor of 481 and 259. 37 What is the greatest common divisor of 100 and 12550? 50 What is the highest common factor of 70 and 13930? 70 What is the highest common factor of 4 and 452? 4 Calculate the greatest common factor of 63 and 441. 63 What is the highest common divisor of 217 and 155? 31 Calculate the highest common divisor of 4164 and 60. 12 Calculate the highest common factor of 1353 and 33. 33 What is the greatest common factor of 3700 and 25? 25 Calculate the highest common factor of 3525 and 282. 141 Calculate the highest common factor of 240 and 1830. 30 Calculate the highest common divisor of 58586 and 22. 22 Calculate the highest common factor of 53 and 583. 53 What is the highest common factor of 24 and 588? 12 Calculate the greatest common divisor of 40069 and 34. 17 Calculate the greatest common divisor of 5425 and 425. 25 Calculate the highest common factor of 195 and 645. 15 What is the greatest common factor of 117 and 180? 9 Calculate the greatest common divisor of 56775 and 75. 75 Calculate the highest common factor of 18 and 1629. 9 Calculate the highest common divisor of 1971 and 81. 27 What is the highest common divisor of 66 and 102? 6 What is the highest common factor of 506 and 230? 46 Calculate the highest common factor of 11 and 22. 11 What is the highest common divisor of 1737 and 45? 9 Calculate the highest common factor of 207 and 30843. 207 What is the highest common factor of 18540 and 9? 9 Calculate the highest common divisor of 847 and 77. 77 What is the greatest common divisor of 195 and 650? 65 What is the greatest common divisor of 1924 and 12? 4 Calculate the greatest common divisor of 826 and 56. 14 Calculate the greatest common divisor of 930 and 10. 10 Calculate the highest common factor of 45 and 81. 9 Calculate the greatest common factor of 143 and 253. 11 What is the highest common divisor of 351 and 81? 27 Calculate the greatest common factor of 4 and 227. 1 Calculate the greatest common factor of 2712 and 30. 6 What is the greatest common factor of 3013 and 69? 23 What is the greatest common factor of 205 and 492? 41 What is the highest common factor of 588 and 56? 28 What is the highest common factor of 18 and 261? 9 Calculate the greatest common divisor of 3509 and 58. 29 What is the greatest common factor of 344 and 16? 8 Calculate the greatest common factor of 15 and 1055. 5 Calculate the greatest common divisor of 25 and 5675. 25 Calculate the greatest common factor of 2911 and 284. 71 Calculate the highest common factor of 935 and 22. 11 What is the greatest common factor of 8601 and 611? 47 Calculate the greatest common factor of 88 and 572. 44 Calculate the highest common divisor of 16 and 6. 2 Calculate the highest common divisor of 37 and 1. 1 Calculate the highest common divisor of 1411 and 85. 17 Calculate the highest common divisor of 6 and 402. 6 What is the highest common factor of 44 and 55? 11 What is the greatest common divisor of 1134 and 168? 42 What is the greatest common factor of 468 and 30? 6 Calculate the highest common divisor of 3546 and 90. 18 Calculate the greatest common factor of 37842 and 68. 34 What is the highest common divisor of 30887 and 67? 67 Calculate the greatest common divisor of 17811 and 27. 9 Calculate the highest common factor of 2190 and 949. 73 What is the greatest common divisor of 245 and 147? 49 Calculate the greatest common factor of 480 and 1704. 24 Calculate the greatest common divisor of 247 and 65. 13 Calculate the greatest common factor of 93 and 775. 31 Calculate the greatest common factor of 180 and 1152. 36 What is the greatest common factor of 30 and 45? 15 What is the greatest common divisor of 228 and 817? 19 What is the highest common divisor of 153 and 3009? 51 What is the greatest common factor of 80 and 265? 5 What is the highest common factor of 19 and 57? 19 Calculate the highest common divisor of 222 and 962. 74 Calculate the highest common divisor of 14 and 1211. 7 Calculate the greatest common divisor of 95 and 76. 19 What is the greatest common divisor of 10 and 5670? 10 Calculate the greatest common factor of 114 and 25878. 114 Calculate the highest common divisor of 778 and 8. 2 Calculate the greatest common divisor of 33015 and 31. 31 What is the greatest common factor of 5 and 20? 5 What is the highest common factor of 64 and 52? 4 Calculate the highest common divisor of 9 and 33. 3 Calculate the greatest common factor of 1078 an	{ "pile_set_name": "DM Mathematics" }
pose 2b + 5g + 117 = cb, 5g + 244 = 2b. What are the prime factors of b? 127 Suppose 0m = 2m - 2098. Suppose -153 + m = 4x. List the prime factors of x. 2, 7 List the prime factors of ((-6)/7)/(-27/499604). 2, 3, 2549 Suppose -14y = -9y - 25. Suppose -4t - d = 946 + 336, yt + d = -1603. Let b = t + 466. List the prime factors of b. 5, 29 Suppose -2d + 4d + y = 585, -5d + 1425 = -5y. Suppose -q = -2l - d, l + 1441 = -9q + 14q. List the prime factors of q. 2, 3 Let i be (-2 - 3)-11. Let w be 86/18 - (-1 + 49/63). Suppose -wb = -ih - 650, -2b + h = 2b - 529. What are the prime factors of b? 7, 19 Let c = 9 + -78. Let d = -59 - c. Suppose 13k - 273 = dk. What are the prime factors of k? 7, 13 Let s = 1450 - 690. Suppose -204 = 2j - s. List the prime factors of j. 2, 139 Let a be ((-8)/(-4))/(-8)-411. Suppose -5 = -4u + a. Suppose uv - 72 = 4y, 0v + 3v - 52 = y. List the prime factors of v. 17 Let w be (-40)/(-18) - 4/18. What are the prime factors of (-180)/30 + 2766/(w - 0)? 3, 17 Suppose 0i + i - 69 = 0. Let f = -73 + i. What are the prime factors of (7/f)/((-4410)/(-552) - 8)? 7, 23 Suppose 5r + 2088 = 2g, r = -3g + 4g - 1044. Let i(f) = 17f*2 - 27f + 9. Let m be i(5). Suppose g = 5d + m. What are the prime factors of d? 149 Suppose 360z = 376z - 355232. List the prime factors of z. 2, 17, 653 Let f = 50 - 59. Let r be 5 - 3/1f/(-9). Suppose 4c = -4b + 356, -rb = -4b + 4c + 166. What are the prime factors of b? 3, 29 Suppose 1519 = 7w - 39d + 36d, 0 = 2w - 4d - 412. What are the prime factors of w? 2, 5, 11 Let s(v) be the second derivative of v*4/12 + 35v*2/2 - 31v. List the prime factors of s(16). 3, 97 Let o = -2009 + 3389. Suppose -o = -10s + 7s. Suppose 11t - s = t. What are the prime factors of t? 2, 23 Let s(a) = a3 - a2 - 2a + 432. Let z(x) = x*2 + 8x + 7. Let i be z(-7). List the prime factors of s(i). 2, 3 Suppose -2y - 8260 = -4t, 4y - 6y - 2071 = -t. What are the prime factors of t? 2063 Suppose 240d - 281d = -308074. What are the prime factors of d? 2, 13, 17 Let c(u) = 2u2 + 11u + 28. Let k be c(-3). List the prime factors of 362 - -1 - (8 + k + -21). 3, 11 Let t be (333/(-6))/((2/1)/(-36)). Let n = t + -500. List the prime factors of n. 499 Suppose 3n + 2c + 6 = 0, -2c + 0 = -n + 6. Suppose f = -2b + 344, nf - 3f = 6. What are the prime factors of b? 173 Suppose 5 = -2f + 11. Suppose 0 = -5o + 2t + 26, -4t + 13 = 4o - 3t. Suppose -fu = -ou + 3. List the prime factors of u. 3 List the prime factors of (4((-28)/(-294) + 100514/(-84)))/(-2). 2393 Suppose 51820 = -507i + 508i + 4y, -27 = 3y. What are the prime factors of i? 2, 7, 463 Let w(d) = 5d*2 - 9d - 146. Let g be w(24). Suppose 0x - 1888 = -3x - a, -4x = 2a - g. What are the prime factors of x? 17, 37 Let t = -5822 + 16846. What are the prime factors of t? 2, 13, 53 Let q(j) = j*3 + 15j*2 + 6j - 263. Let v be q(-13). Suppose h + 4h = 265. Let i = h + v. What are the prime factors of i? 2, 5 Let x = -14 - -14. Let y(g) = 223g - 404. Let w be y(5). Suppose 9z + xz = w. What are the prime factors of z? 79 Let t be 2/3 - 1390/(-3). Let b be 12/(-3)-1 - 467. Let k = b + t. List the prime factors of k. 2, 5 Suppose 1831503 + 3226551 = 158v. What are the prime factors of v? 3, 3557 Let w = 6559 + 2313. What are the prime factors of w? 2, 1109 Let r(q) = 305q*2 + 109q - 701. List the prime factors of r(7). 43, 349 Suppose -3f = -2y + 19, 0 = -5y - 3f + 7 + 9. Suppose 12 = -z + 4b - 22, -yz + 4b = 186. Let w = z - -72. What are the prime factors of w? 2, 17 Suppose -3m - 364 = -c, 3c - 1128 = 4m - 7m. Suppose 501 = 4d - 5l, 4l - c = -3d + 5l. What are the prime factors of d? 2, 31 Let t be (-168)/66 - -2 - 1930/11. Let z = t + 313. What are the prime factors of z? 137 Suppose 62 = -25h + 162. Suppose 0 = 5x + hw - 1816, 0x = 2x + 4w - 736. List the prime factors of x. 2, 3, 5 Let b(u) = u*2 - 9u + 19. Let g be b(6). Suppose 3k - 2k + v = -g, 10 = 2k - v. Suppose 5r - 26 = -2m + r, 54 = km + r. List the prime factors of m. 19 Suppose -5q + 64 = -a, -q - 11 = a + 35. Let r be 3108/a + (-4)/7. Let n = 23 - r. What are the prime factors of n? 3, 29 Suppose 0 = 4z + 1498 - 1510. List the prime factors of (6/5)/z(1190 + 5). 2, 239 Suppose 5r - r - 22094 = 2u, 4r + 7u = 22049. List the prime factors of r. 5521 Let g = 45404 + -8090. What are the prime factors of g? 2, 3, 691 Suppose -54h = -102964 - 329954. What are the prime factors of h? 8017 Let f = -763 + 4522. List the prime factors of f. 3, 7, 179 Let d(b) = b*3 + 57b*2 + 281b - 64. List the prime factors of d(-44). 2, 5, 7, 13 Let x(l) = 22l2 + 14l + 65. Suppose -8d - 10 = -6d. What are the prime factors of x(d)? 5, 109 Suppose 8 = 4m, -m = -4y - 0m + 418. Let r = 175 + y. List the prime factors of r. 2, 5, 7 Let x be ((-45)/6)/((-1)/6). Suppose x = 3a - 2a. Let k = a - 37. List the prime factors of k. 2 Let l = -1425 - -568. Let x = l - -1605. List the prime factors of x. 2, 11, 17 Suppose 4c + 6t = 3t, 2t = 0. Suppose -2x + 5v = -cx - 13, 0 = -4x - 4v + 96. Suppose -9d = -xd + 820. List the prime factors of d. 2, 41 Suppose 0 = -23j + 18j + 2860. Let c = -1755 + j. List the prime factors of 104/(-40) - -3 - c/5. 3, 79 Let w(g) = 5g - 6g + 0g - 4 - 8. Let z be w(3). What are the prime factors of z/(-1) - (2 - (-1 - -2))? 2, 7 Let k(s) = -8s - 2. Let t be k(8). Let g(q) = 13q2 - 7q + 27. Let w be g(4). Let v = t + w. What are the prime factors of v? 3, 47 Let z be 4/3 + 2752/6. Suppose z = 9y - 467. What are the prime factors of y? 103 Let k = 17732 + -12495. What are the prime factors of k? 5237 Suppose 2x + 8 = 0, 0 = -3n - 9x + 4x - 92. List the prime factors of n/((9/(-21))/((-100)/(-14))). 2, 5 Suppose -5l = -5m + 180, -2l - 2l - 5m - 180 = 0. Let j = -35 - l. Suppose 9u - 800 = ju. What are the prime factors of u? 2, 5 Let y = -43 - -45. Suppose -w - 23 = 5j, -yw + 6w + j - 3 = 0. Suppose wz - 132 = z. What are the prime factors of z? 2, 3, 11 Suppose -p = -x + 62776, -2x + 48852 = 5p - 76679. What are the prime factors of x? 62773 Suppose 6h - 4 = 4h. Suppose 2k + v - 5v - h = 0, 0 = -v. Let z(f) = 106f2 + 4f - 3. What are the prime factors of z(k)? 107 Let i(o) = -o*3 - 4o*2 - 4o - 11. Let z be i(-4). Suppose 2k = -zc + 2734, 4c = 4k + 5c - 5504. What are the prime factors of k? 3, 17 Let f = -44647 + 116424. List the prime factors of f. 71777 Suppose -2p + 4g = -p - 2, -2p + 2g + 4 = 0. Suppose pd - 2v = -0v + 1726, d + 5v = 845. What are the prime factors of d? 2, 5, 43 Suppose -36a + 406321 = 12s - 31a, 2a - 33849 = -s. What are the prime factors of s? 33863 Let y be (3 + -11 - 4)(-5)/15. Suppose 14a + ya - 3618 = 0. What are the prime factors of a? 3, 67 Suppose 1972 = 17i - 6987. Let q = -307 + i. What are the prime factors of q? 2, 5, 11 Let z(s) = s2 + 2s - 4. Let a be z(2). Let t(j) = 43j2 + 17j - 41. What are the prime factors of t(a)? 5, 11, 13 Let g(z) be the third derivative of z*5/10 + 47z*4/8 + 7z*3/3 + 2z*2 - 11z. List the prime factors of g(-27). 7, 83 Let b = 1655 + -2621. Let m = b - -1579. What are the prime factors of m? 613 Suppose -16 = 4b, 9262 = 3u - 26b + 31b. What are the prime factors of u? 2, 7, 13, 17 What are the prime factors of (-983)/((-2630)/290 + 9)(1 + 1)? 29, 983 List the prime factors of 52/364 - ((-3996)/7 - -2). 569 Let t = -252 - -248. What are the prime factors of t + 10 + -5 - -642? 643 Suppose 7 = 4i + 3i. Let x = 2 + i. Suppose 4q - 4f = 256, 134 = 2q + xf - 19. What are the prime factors of q? 3, 23 Let u(z) = -2z*2 + 57z + 116. Let h be u(-2). Let m(l) = -11l + 0 - l2 + l - 13. What are the prime factors of m(h)? 11 Suppose 152s = 115s + 660117. What are the prime factors of s? 3, 19, 313 Let i(c) be the first derivative of 23c*4/4 + 4c*3/3 - 3c*2/2 + 12c - 155. List the prime factors of i(3). 2, 3, 5, 11 Suppose 5r + 3c = 342869, -79c - 68593 = -r - 82c. List the prime factors of r. 191, 359 Suppose 21c = 25c + 2920. Let y be (c/15)/((-4)/54). Suppose -g = l - 129, 5l - y = -0l - g. Wh	{ "pile_set_name": "DM Mathematics" }
tor of 208 and 12573951. 13 Calculate the greatest common factor of 50419 and 80591. 397 What is the highest common divisor of 14784 and 2175789? 231 What is the greatest common divisor of 494078 and 310? 62 Calculate the greatest common divisor of 8 and 700927. 1 What is the highest common factor of 593673 and 6? 3 What is the greatest common divisor of 619801 and 686? 343 What is the greatest common divisor of 347 and 79643093? 347 What is the greatest common divisor of 534270 and 55? 55 What is the greatest common divisor of 176330 and 59990? 70 Calculate the greatest common divisor of 167535 and 622863. 459 Calculate the greatest common divisor of 558 and 194892939. 279 What is the greatest common factor of 2667 and 1945005? 381 Calculate the highest common factor of 160444 and 3376. 4 Calculate the greatest common factor of 79161 and 177. 3 Calculate the highest common divisor of 399 and 6952290. 57 Calculate the greatest common divisor of 659716 and 4192. 524 Calculate the greatest common factor of 6994876 and 56854. 1834 Calculate the greatest common divisor of 1360122 and 18. 6 What is the greatest common divisor of 1625 and 369681? 13 What is the greatest common factor of 5012529 and 37417? 71 Calculate the greatest common factor of 810028727 and 134. 67 Calculate the greatest common divisor of 121 and 1469962329. 121 What is the greatest common divisor of 30836 and 29497? 13 Calculate the highest common factor of 38863 and 158497446. 3533 Calculate the highest common factor of 58617406 and 16099. 947 What is the greatest common factor of 10293780 and 5250? 210 What is the greatest common factor of 72861 and 3282168? 489 What is the highest common factor of 39387551 and 2261? 133 Calculate the highest common divisor of 486240987 and 51. 51 What is the highest common factor of 720 and 221970? 30 What is the greatest common factor of 192140963 and 259? 259 What is the greatest common divisor of 1715901 and 6357? 489 What is the highest common factor of 726 and 2418790? 242 Calculate the greatest common divisor of 4110 and 1424937. 411 Calculate the greatest common divisor of 11264127 and 1237323. 6411 What is the greatest common factor of 18594774 and 1584? 198 Calculate the highest common divisor of 504431 and 6213. 19 What is the greatest common divisor of 2436 and 162041908? 812 What is the greatest common divisor of 182004 and 1002153? 87 What is the highest common divisor of 13826310 and 4650? 930 Calculate the greatest common divisor of 825 and 129484905. 165 What is the greatest common divisor of 1962 and 806346? 18 Calculate the greatest common factor of 1156765610 and 195. 65 Calculate the greatest common divisor of 500554384 and 1942. 1942 What is the greatest common factor of 125723 and 1274? 13 What is the highest common factor of 517117965 and 494? 247 Calculate the highest common factor of 24930 and 3354. 6 Calculate the highest common factor of 179454 and 32576339. 2719 Calculate the highest common factor of 6156 and 1075356. 324 Calculate the greatest common divisor of 885848529 and 174. 87 What is the highest common divisor of 47448 and 24390? 18 Calculate the highest common divisor of 9504930 and 555. 555 What is the highest common divisor of 679952 and 1352? 104 What is the greatest common divisor of 2772551 and 194? 97 What is the greatest common factor of 1499904 and 3328? 256 What is the highest common divisor of 391 and 10288544? 23 What is the greatest common factor of 14744120 and 185920? 3320 Calculate the highest common divisor of 1208 and 2717292716. 604 Calculate the highest common divisor of 16601875 and 292900. 2525 What is the highest common factor of 273 and 1585647? 21 What is the highest common divisor of 349 and 386? 1 What is the highest common factor of 208 and 30049? 1 Calculate the greatest common factor of 716 and 4986403. 179 Calculate the highest common divisor of 1582 and 1195201. 791 Calculate the highest common factor of 461338 and 43193. 919 What is the highest common divisor of 25490091 and 3069? 1023 Calculate the highest common divisor of 106 and 14564983. 53 Calculate the greatest common divisor of 9469 and 1921. 17 What is the greatest common divisor of 200867903 and 26571? 8857 Calculate the greatest common divisor of 13 and 3005533. 1 Calculate the highest common divisor of 33678144 and 41622. 5946 What is the highest common divisor of 6163074 and 1891? 61 Calculate the highest common factor of 16 and 988723352. 8 What is the greatest common factor of 315 and 4858665? 105 Calculate the greatest common factor of 3060704 and 14544. 1616 Calculate the highest common divisor of 59458 and 584598. 434 Calculate the highest common divisor of 3381 and 7488033. 147 What is the greatest common factor of 829404 and 24? 12 What is the highest common factor of 231889 and 626881? 211 What is the greatest common factor of 225712009 and 17? 17 What is the highest common factor of 72 and 91644248? 8 What is the highest common factor of 230658 and 23182168? 2078 What is the highest common divisor of 96093 and 9111040? 3559 Calculate the highest common divisor of 15048 and 768526440. 5016 Calculate the highest common factor of 39305021 and 1981. 1981 What is the highest common factor of 4477002 and 54? 6 What is the highest common divisor of 30839109 and 399? 399 What is the highest common divisor of 112 and 1484140? 28 Calculate the greatest common factor of 720126 and 150. 6 What is the greatest common factor of 4622500 and 125? 125 Calculate the highest common factor of 2997 and 135070128. 333 Calculate the highest common factor of 4400 and 5551600. 400 What is the highest common divisor of 1007 and 1832189? 19 What is the highest common divisor of 39450584 and 1258? 74 What is the greatest common divisor of 15 and 5808355? 5 Calculate the greatest common divisor of 160 and 350876720. 80 Calculate the greatest common divisor of 219 and 653734345. 73 Calculate the highest common divisor of 612 and 3574811. 17 Calculate the greatest common factor of 16327 and 25723. 29 What is the greatest common factor of 4616 and 270499331? 577 What is the greatest common divisor of 35788 and 3801697? 389 Calculate the highest common factor of 9615 and 126240. 15 What is the highest common divisor of 849 and 47332316? 283 What is the highest common divisor of 216 and 33527646? 18 What is the greatest common divisor of 18698549 and 2056? 257 Calculate the greatest common divisor of 25 and 14782810. 5 What is the greatest common factor of 544 and 269992? 8 What is the greatest common divisor of 393885 and 6300? 45 What is the greatest common factor of 16528029 and 10251? 3417 What is the greatest common factor of 858 and 5520801? 429 Calculate the greatest common factor of 202422 and 2629. 11 Calculate the highest common factor of 180288 and 121444. 1252 What is the greatest common factor of 4424 and 21018187? 79 What is the greatest common divisor of 9032 and 85141277? 1129 Calculate the highest common divisor of 860 and 311872. 4 What is the highest common factor of 1412680224 and 288? 96 What is the greatest common divisor of 1018523 and 55? 11 Calculate the greatest common factor of 1054 and 18736834. 62 What is the highest common factor of 31674206 and 202? 202 What is the highest common divisor of 3713 and 206585? 79 Calculate the highest common divisor of 366235 and 4539. 89 What is the greatest common factor of 1586 and 35613142? 122 Calculate the greatest common factor of 502690 and 2998398. 5914 Calculate the greatest common factor of 16265 and 9695. 5 What is the highest common divisor of 5791227 and 1956? 489 Calculate the highest common factor of 196219 and 10516. 239 Calculate the greatest common factor of 139240 and 988840. 2360 Calculate the highest common factor of 2451852 and 36828. 1116 What is the greatest common factor of 278663 and 221353? 11 Calculate the greatest common divisor of 104102784 and 32. 32 What is the greatest common factor of 64872 and 2156676? 636 What is the highest common divisor of 2104 and 343941406? 526 Calculate the highest common factor of 54800217 and 95841. 4167 What is the greatest common factor of 2160 and 29828? 4 Calculate the highest common factor of 783120 and	{ "pile_set_name": "DM Mathematics" }
/(jjj0)))/j)(2/55))*(-50)(j1)(-2/67)j3/(jjj/(jj/(j*(1/2)j))jj) assuming j is positive. j*(-4935/1474) Simplify ((kkkkk/(k/k2))/k(-2))(-2/5)(((kk(-1/3)/kkk)/k)27)31 assuming k is positive. k(2774/5) Simplify ((j(j*42j)/j)*22(j/(jj/(jj*(-3/4)))j)/(jjj/j(-1/10)))23 assuming j is positive. j(433849/20) Simplify ((k(-1/3))(-2/129))(11/2)/((k*(2/25)/k)/kkk(-1/5))(-17) assuming k is positive. k(-183937/9675) Simplify ((p1/p3)/(ppp/p(-1/4)p)*15)/(pp/(p/(p*(2/7)/p))(pppp(-1/7)p)/p)(-23) assuming p is positive. p(183/28) Simplify (((p/(pp(3/4)/p)p)/ppp10)/((p(-39)p)/(p/p26)))(-29/2) assuming p is positive. p(-2813/8) Simplify (((ooo(o/(o*(2/9)o))/o)/o(5/6))/(o(1/4))*18)/((ooo(-1))(-4/21)o/(oo1)o*(5/6)o) assuming o is positive. o*(-529/126) Simplify ((a(a/(a/(a/(a/(a(-1/2)/a)))))/a)50((a(1/2)a)/aa)(-4/7))/((a((aa(-1)/a)/a)/a)(1/6)aa(-2/7)a(-4/7)) assuming a is positive. a(-227/3) Simplify (a23/(a/(a/(a/(a(-1/9)a)))))/(a(-6)/a(2/3)) assuming a is positive. a(266/9) Simplify ((((jj/j*(-2/7)jjj)/j*(2/17))/(((jj*(-3/4)/j)/j)/jj0))(9/5))(32/7) assuming j is positive. j(271368/4165) Simplify (t*2tt/(t/(t/((t5t)/t))))*(-47)(t*6t6/t)/((t6/t)/((t((t/t(4/7))/t)/t)/t)) assuming t is positive. t(360/7) Simplify (((bbb10)/b)/bbbb/b(-6/5))(-50)/(b4/((b/b(-2/11))/b)b(3/2)b/b8) assuming b is positive. b(-15583/22) Simplify k*(-3)/(k((k/(k/k*(-2/5)))/k)/kk)(kk*0k)*(-3/7)((kkk/k*2)/kk(-1/4))(-26) assuming k is positive. k(213/70) Simplify s(-1)s(-5/3)/s(s1)(-29)(s(1/5)/(s/((ss(-2/3))/s)))(7/6) assuming s is positive. s*(-1547/45) Simplify g/(g/(g/(gg*2/g)))(g*3/g)/gg/(gg4)g*(-1)/g((g1)(-7/3))(-2/25) assuming g is positive. g(-436/75) Simplify (((oo(1/8)oo)/((o(-10)o)/o)(oo/((((o/o3)/o)/o)/o))/o4)8)(-48) assuming o is positive. o(-6192) Simplify (((f5f)/fff/f(-2/15))/(f(-3)ff(-6)))/((f/((ff*(-4)f)/f))(-2/33))(-1/2) assuming f is positive. f(2477/165) Simplify (p/(p/(p(1/10)/p)p)p/p1)/(p2p)31((((ppp/(p*(-2/9)/pp))/p)/pp)/(p(-9)/p))/(p(-2/3))(-46) assuming p is positive. p(-10201/90) Simplify (qq*(3/4)q(2/7))(-8)/((q*(1/5)q/(q(-6)/q))/(q1qq/(qq((q*(-3)/q)/q)/qqqq)qq)) assuming q is positive. q(-647/35) Simplify (((r/(r(3/17)/r)r)/(rr(-27)))(-28))(-28) assuming r is positive. r(384160/17) Simplify ((u(-24))(-12)/(uu/(u(-20)u)u)(-23))(-2/193) assuming u is positive. u(-1588/193) Simplify (i(2/7)/i)31(i*(2/7)i)*(-2/17)(i1)13i(-1)(ii/(i(i/(ii6)ii)/i))/i assuming i is positive. i(-90/17) Simplify ((m2)(-7/8))(-23)/((m/(m/(m(-2)m)m))/(m/(m(1/2)/m)))30 assuming m is positive. m(581/4) Simplify ((f(3/11)/f)43(f(-3)/f)37)(-20/7) assuming f is positive. f(39440/77) Simplify (((l(l/(l(-1/4)/l))/l)(1/28)l*(1/2)/l(l/l*(2/3))/ll)(2/59))(-43/5) assuming l is positive. l(1247/49560) Simplify ((i(7/6))*(-17)/((i(i*7i)/i)/(iiii(-1))))32 assuming i is positive. i(-2480/3) Simplify ((f(-7)/f)(-9/7)/((f((ff/(ff/(f/f*(3/4))f))/ff)/ff)/f24))(8/5) assuming f is positive. f(1906/35) Simplify (c(1/9)((c(-6)c)/c)/c)*(4/11)(c/(c*(1/2)/c)c(-2/19))/(c(-2)/(cc3c)) assuming c is positive. c(22157/3762) Simplify ((j/(j(-3)/j))*(4/21)(jj/j(-1/2))(1/27))(42/13) assuming j is positive. j(395/117) Simplify (((b(5/2)b)/b(bbb(-9))/bb)/((b(b/(b(b(-2/5)/b)/b))/b)/(b/(b(3/5)b))))(-7/5) assuming b is positive. b(21/2) Simplify ((k/((kk*(2/3)k)/k))(3/13))(2/43)(k/(kkkk*(2/11)k)k(-2/7))(-7/2) assuming k is positive. k(149165/12298) Simplify (((mm*0)/(m/(mm*(3/8))m)(m/m(2/5))(-22))(-2/11))35 assuming m is positive. m(3591/44) Simplify (i1/i(7/5))(-16/3)(i*(-1/3)i/(i/(i1/i)))/(i1i(-7)) assuming i is positive. i(39/5) Simplify ((b2/b)/(bb*1/bb)(b/b(-2/3))(-4/11))/(b(-2/3)bbb*(-4)/bb)45 assuming b is positive. b(3907/33) Simplify ((((kkk(-24))/k)/k)(-1/35)(kk*(-7/2)k)5)(5/8) assuming k is positive. k(-477/112) Simplify ((r(1/24)/((r/r*(4/17))/rr))/((rr(-1/37))/rr(-17)/r))24 assuming r is positive. r(261221/629) Simplify ((p1)(2/15)/((p/(p(-2/7)p))/p)(-11))(-3/32) assuming p is positive. p(811/1120) Simplify ((i(-2)/(i/(ii/i*5)))/((((iii/i(-1/5))/i)/ii)/i(-4)))/((i(2/3))*(-6/7)(i(-1))(-35/6)) assuming i is positive. i*(-3667/210) Simplify ((ii*(1/11)i)12/(i(-9)i)(-12/5))39 assuming i is positive. i(12636/55) Simplify m(-6/7)/(m(-4)/m)(m*0/m)/(m(m*(-8)/m)/mmmm)(mmm/m(-2)m)(-9)/(m/(m(-4/7)m)m(-1/10)/m) assuming m is positive. m(-3103/70) Simplify (d/(dd(-3)/d))/(dd*2)(dd1)/((d/d1d)/d)(d(-4)/(d(2/3)d))/((d/d*(-3/2))/dd1/d) assuming d is positive. d(-25/6) Simplify ((r(1/2)/r)(-3/16)/(((r/(rr(-10)))/r)/rr(-20)/r))(2/37) assuming r is positive. r(419/592) Simplify ((r/r19r(rr(-1/31))/r)/(r45r(1/2)))(-13) assuming r is positive. r*(50401/62) Simplify (a/(aa2))(-5)(a2a)*1((a((aa*(-3))/a)/a)/(aa/(aa(-4/3)a)))/(((aa(-2/17))/a)/(a(4/9)a)) assuming a is positive. a(1565/153) Simplify ((h/(h/h(-5/4)hh))*8(h/((hh(-1/4))/h))(4/9))11 assuming h is positive. h(-2519/9) Simplify ((tt(-2))/t)/t(-2)(t1)(2/63)((t/(t(t/(t/(tt*(-2/5))))/tt)t)/tt)(2/107)/(t/(t/((t0t)/t))t(5/3)) assuming t is positive. t(-54853/33705) Simplify ((b/b(2/5))(26/5))*(-28/5)((b(-1/4))(-18/5))(-39) assuming b is positive. b(-13143/250) Simplify ((h(hh*(-3/7)h)/h)(2/41))(1/8)/(h*(-1/10)h*(-3/5)(h1)27) assuming h is positive. h(-150907/5740) Simplify (t(-10)ttt(t*3t)/t)*(-2/21)(t*(1/2)t)49/(t(1/4))3 assuming t is positive. t(6143/84) Simplify (((g(1/4))(23/2)/((g*8g)/(ggg/g(-9))))(24/5))(6/31) assuming g is positive. g(846/155) Simplify (q*(-14)/(qq/q*(-1/13)q)(q(1/8))(3/5))(-1/24) assuming q is positive. q(2947/4160) Simplify (((a/(a/((a(3/8)/a)/a)))(-29)/((aaa/(a6a))/(aaa/((a(a/(a/(aaa14))aa)/a)/aa))))48)26 assuming a is positive. a*45084 Simplify (((rrr/(rr0))(2/49)(r/(r8/rrr)r)/rr((rr(1/10)/r)/r)/rr)42)(3/4) assuming r is positive. r(-34479/140) Simplify (h(-2/29)/h*(-14)h4/(h17/h))44 assuming h is positive. h(2464/29) Simplify ((g(-2/3))(-18))*(1/43)(g*(-2/7)g)(4/17)/(g/(g/(g/g(2/7)g)))(-18) assuming g is positive. g(160184/5117) Simplify ((u(3/2)/u)30)(-1/9)/(((u/u(2/15))/(u/(u/(u(u((u(1/3)/uu)/u)/uuuu)/u))u))/(u(-6)/((u(2/13)/uuuu)/u))) assuming u is positive. u(-413/65) Simplify (zz*(-2)zzz(-8)/z)/(z/((z/z(-9))/zz))11 assuming z is positive. z91 Simplify ((ww(w/(ww*(-2)))/w)/(ww(1/7)))(-10)/(((ww(-2/5)/w)/w)20)(8/3) assuming w is positive. w(1178/21) Simplify (b41/bb*(-39)b(-13)/((b/b48)/b))14 assuming b is positive. b504 Simplify ((((dd/d8)/d(10/3))(-2/89))10)(1/40) assuming d is positive. d(14/267) Simplify (((w(1/3))(3/16)(w*(2/5)w)/(w/w*(2/33)w))(3/4))(-7/5) assuming w is positive. w(8813/17600) Simplify (d/(d(-2/5)d)dd13)(-19)/(dd*(-1/2)dd/(dd/(d/(d(d/(d10/d))/d))))(-1/7) assuming d is positive. d(-19057/70) Simplify (o7/o(-1/12))/((o/o1)/o)(-10)(o(-2)/o(-5/2))/(o(-2/7))(-30/7) assuming o is positive. o*(-2141/588) Simplify ((nnn/n(6/7)nnn*(2/39)/nnn)(-23))(-1/5) assuming n is positive. n(32614/1365) Simplify nn*(-5)n(n/(n1/n))/nn(n1/n)(-44)((n(-1/4))(4/7))(-23/3) assuming n is positive. n(-19/21) Simplify ((b*(-1)/bbbbb(1/3))/(b(1/3))38)/((b1)(-2/119)/(b(1/5))(-43)) assuming b is positive. b(-35551/1785) Simplify (((d(d*(-1/6)d)/d)/d)/(d(d(dd(	{ "pile_set_name": "DM Mathematics" }
ue in y, d, r? y Let m = -1 - -1. Let d be (-1)/3 + ((-2150)/570 - -4). Which is the second smallest value? (a) m (b) -0.2 (c) d c Let t = 101 + -108. Which is the biggest value? (a) 5 (b) -1 (c) t a Let y be (-72)/16(-1)/(-3). Let p = 2.929 - -0.131. Let k = 0.06 - p. What is the third smallest value in -2/9, k, y? -2/9 Let k = -0.8 + 0.81. Let y = k + 3.99. Let h = 5 - 4.7. Which is the second smallest value? (a) y (b) 1/8 (c) h c Suppose -12 = -3y, 24 = 4t + 3y - y. Let b = 0.1 + 0.4. Let v = -3.5 - b. What is the smallest value in t, -3/5, v? v Suppose 103y - 98y - 10 = 0. What is the fourth smallest value in -5, 0.2, 0.4, y? y Let r = 1446180456426/23 + -124313672267920983/1977080. Let h = r + -3/10745. Let v = h + 118. Which is the smallest value? (a) 3 (b) 0.1 (c) v c Let w = -2/169 - 1167/1352. Let o be 3/(-3) - (-37)/24. Let f = o + w. Which is the third smallest value? (a) 2 (b) 0 (c) f a Let j = -0.1 - -0.1. Let w = -0.1 + j. Let i = 16.5 - 17. Which is the second biggest value? (a) i (b) 0.5 (c) w c Let o = 15.5 - 15. What is the second smallest value in o, 4, 3? 3 Let u = 509/6 - 85. Let j = 2 + -8. Let p = -1 - j. What is the second biggest value in 3/4, p, u? 3/4 Let n = -131/5 - -27. Let f be (-27 + 1-2)/(-30). Let j = n - f. Which is the third biggest value? (a) 4 (b) j (c) 1/9 b Let g be 2/6 + (-20)/6. Let t = 3.89 - -0.11. Which is the biggest value? (a) 2/11 (b) t (c) g b Let m be 27/(-6) - (-2)/4. What is the biggest value in 1, 2, -0.4, m? 2 Let w = -15.3 - -15. Which is the third biggest value? (a) 5 (b) 2/5 (c) w c Let n = 0.38 - 17.38. Which is the second smallest value? (a) -5 (b) 4 (c) n a Let l(f) = 7f*2 + 44f + 6. Let z be l(-6). Which is the fourth biggest value? (a) -0.5 (b) z (c) -4 (d) -2/13 b Let f be (-156)/459 - (-6)/51. Let w be -3 + (-1 - -2) - -2. Let z = -1 + 5. Which is the second biggest value? (a) z (b) f (c) w c Let l = 0.14 - -0.36. Let s = 2.3 + -1.9. Which is the third biggest value? (a) l (b) -4/3 (c) s b Let i be 1/(-1)6/((-48)/8). Which is the second smallest value? (a) 2/13 (b) i (c) -0.19 a Let z(x) = x3 - 3x*2 + 3x - 1. Let m be z(3). Suppose -7 = t - m. Which is the second biggest value? (a) 7 (b) t (c) 2/7 b Suppose 11 = 14x + 81. Let q = -0.1 - -0.1. Which is the second smallest value? (a) 3 (b) x (c) q c Let w be (1 - 48/10) + 4. Let l = -11 - -6. Which is the second smallest value? (a) l (b) 1 (c) w c Suppose -4i = 21 - 85. Suppose 3o - 14 = 2x - 3x, -2o + i = 2x. Which is the second biggest value? (a) 0.2 (b) x (c) 2/3 c Let h = 33 - 32.8. What is the second biggest value in 0, -3, 9, h? h Let t = -158/15 - -31/3. What is the biggest value in 1, t, -2/5? 1 Suppose 0 = -5j + 20, 0 = 2y + j + 3 - 17. Which is the third smallest value? (a) y (b) 1/2 (c) 2/3 a Let j = -7 + 7. Suppose -15 + j = -3h. Let f = 2 + -1.5. Which is the biggest value? (a) f (b) 1 (c) h c Let i = 5 + -3. Let v = -3.8 + 0.8. Let t = v + i. Which is the second smallest value? (a) 1/2 (b) -3 (c) t c Let g be 27/15 + 1/5. Let w = -10 - -15. What is the third biggest value in g, -2/21, w? -2/21 Let d = 148 - 147.6. What is the third smallest value in 0, 1/4, 0.04, d? 1/4 Let s = 0.035 + -5.035. Let j = -1 - -1.1. Which is the second biggest value? (a) 0.2 (b) s (c) j c Let n be (1/(-2))/(10/60). Let b = -9 - -15. Let i = -10 + b. What is the third biggest value in 1, n, i? i Let x = -0.06 + 0. Let o = x - 0.34. What is the third biggest value in -4, -3, o? -4 Let h = -8 - -5. Let r be (h/(-15))/(4/(-10)). Let o = -0.3 - -0.7. What is the smallest value in 5, r, o? r Let w = -13 + 5. Let f = 8 + w. What is the second biggest value in 3, -0.4, f? f Let n = -0.33 + -0.07. Which is the second biggest value? (a) n (b) -20/3 (c) -1/2 c Let l = 1.72 + 0.18. Let m = l + -2.8. Let y = m - -0.5. Which is the third biggest value? (a) 2/21 (b) 0.4 (c) y c Let x(n) = -2n + 20. Let s be x(9). Let o = -3 + 2.95. Which is the biggest value? (a) s (b) -0.3 (c) o a Suppose 0 = 10g - 14g + 12. Let d = 0 + -5. Which is the biggest value? (a) g (b) d (c) -2 a Let k = 20 - 21. What is the second smallest value in k, -0.1, 2? -0.1 Let g be 6/(-14)(-2)/(-3). Let p = -0.332 + 0.032. Which is the third biggest value? (a) -0.1 (b) p (c) g b Let x = 9/16 - 151/240. Let a = x - -2/3. What is the second biggest value in 3, a, -4/5? a Let k = 0.3 - -1.7. Let h = -6 + k. What is the biggest value in h, 3, 5? 5 Let q = 0.8 + -0.3. Suppose g + 2t - 12 = -0t, 3t - 8 = g. Which is the biggest value? (a) q (b) -1 (c) g c Let o be (-3)/(-2 - (-22)/12). Let y = -171 + o. Let a = 3215/21 + y. What is the third biggest value in 2, 0, a? 0 Let f = 230 - 3908/17. Which is the biggest value? (a) f (b) -2 (c) 3/4 c Suppose 0 = 3i + 4p - 0 + 16, -p - 4 = -2i. Let t = i - 0. Let n be (t - 9/(-12))-4. What is the second biggest value in n, 1, 1/3? 1/3 Let i be -3(-4)/1322. Let j = 0.06 - 0.06. What is the second biggest value in 1/5, i, j? i Let r be (-6 - 392/(-63)) + 5/(-9). What is the biggest value in 1/5, -0.3, r? 1/5 Let j(q) = 3q - 2. Let g be j(2). Let h = -18 + 19. Which is the second biggest value? (a) g (b) h (c) -1 b Let q = -0.1 + 0.3. Let o be (6/(-30))/(2/4). Let h be (-2)/105/2. What is the third smallest value in o, h, q? q Let c = 2.02 - 0.02. Let l be 02/(-10) + (-2)/(-5). What is the smallest value in 1/7, c, l? 1/7 Let o be ((-1)/2)/(10/8-1). Which is the second smallest value? (a) 2 (b) 2/23 (c) o (d) -4 b Let n = -11 + 7. Let p = n - -4.2. Let w = -1 + 0.8. Which is the second biggest value? (a) w (b) 1 (c) p c Suppose 5f = n + 95, -3n = -2f + 5f - 75. Let h be (f/3)/(-5) - -2. What is the third biggest value in h, 0.3, 1/5? 1/5 Let t = 0.9 - 0.52. Let g = 0.4 - t. Let m = -0.38 - g. Which is the third smallest value? (a) 1 (b) -3 (c) m a Let l = 2.2 + -1.2. Let p = -0.9 - -1.1. What is the second biggest value in 2/3, l, p? 2/3 Let u = 1.9 + -5.9. Let h = 0.4 - -0.1. Which is the biggest value? (a) -2/7 (b) u (c) h c Let g = -6.7 - -7. Let l be (-2)/(-4)4/(-11). Which is the second biggest value? (a) l (b) g (c) -1 a Suppose z + 72 = 3z. Suppose j + z - 8 = 0. Let q be (-54)/j + 3/(-2). What is the third biggest value in 0.2, -2/15, q? -2/15 Let o = 0.18 + 0.04. Let j = -5.22 + o. Which is the biggest value? (a) -1 (b) j (c) 5 c Let v = 144 - 717/5. Let h = -12 + 11.2. Let q = 1.1 + h. What is the third biggest value in v, 1/8, q? 1/8 Let m = -130.7 - -131. Which is the biggest value? (a) -2/9 (b) m (c) 0 b Let x = 10 + -15. Let h = 4 - 3.8. What is the second smallest value in -3, h, x? -3 Let i be (2/(-5))/((-216)/(-30) + -6). Which is the second smallest value? (a) 0.5 (b) 5 (c) i a Let t = -118.9 - -112. Let y = 0.9 + t. Let n = -6.2 - y. Which is the smallest value? (a) n (b) 0.5 (c) 4 a Let u = 0.8 - 1. Which is the smallest value? (a) u (b) 4 (c) 0.5 a Suppose 0 = 6d - 2d - 4z + 20, 5d + 13 = -z. What is the smallest value in d, 3, -5? -5 Let g = -1 + 5. Suppose -4d - 4 = 4. Let q be (-3)/(-9) + 38/(-42). Which is the third biggest value? (a) d (b) g (c) q a Let c be 4/663 + -2. Let j be (-6)/(-21) + c/(-91). Suppose 3m + 2 = 11. What is the second smallest value in m, j, 0.3? 0.3 Suppose -37 = -x + 5y - 0y, -26 = -3x - 2y. Let z = x - 38/3. Which is the second smallest value? (a) 3 (b) -0.2 (c) z b Let s = 14 - 16.4. Let f = s - -0.4. Suppose 3u = -u. Which is the smallest value? (a) -1 (b) f (c) u b Suppose -3s = -4d - 9, -2s - 5 = -0s + d. Which is the third biggest value? (a) s (b) -2/7 (c) 3/2 a Suppose -3v + 3 = 0, 5v - 7 - 8 = -5q. Which is the smallest value? (a) -5 (b) 8 (c) q a Let l = 1 - 0.9. Let u = 51 - 51.2. Which is the biggest value? (a) l (b) -4 (c) u a Let j be (1/3)/((-5)/(-5)). Which is the second smallest value? (a) 1 (b) j (c) 2/11 b Let j be 23/(-207)3/(-2). Which is the smallest value? (a) j (b) -2 (c) 3/7 b Let m be (-1 - 2) + -2 - -3. Let s be 3 - (0 - -1) - 2. What is the smallest value in 1/4, m, s? m Suppose -2s + 0*s = 10. Which is the third biggest value? (a) -0.2 (b) s (c) 2 b Let a =	{ "pile_set_name": "DM Mathematics" }
*3 + 0w*2 + 3 + 2w*2 + 0 + 7w as h + lw4 + aw*2 + tw + pw3 and give a. 2 Rearrange (-r + r + r)(3960r2 + 2877r*2 + 1476r*2) to the form zr + f + hr2 + xr*3 and give x. 8313 Rearrange -4 + 4 + 2y - 118 + 118 + 47y + (2y + 5y - 5y)(-3 + 1 + 4) + y + 3 - 3 - 3y - y + 3y to the form b + vy and give v. 53 Express -61334y - 61304y + 3 - 2y2 + 2y*3 + 122684y + y*4 in the form ny + dy2 + j + ry*3 + ty*4 and give t. 1 Express (-a + 184 + 2198 + 1009)(-3a + 7a + 5a)(2 + 0 - 1)(-3 + 3 + 2) in the form q + wa*2 + ha and give w. -18 Express -4w2 - 128w + 13w2 + 126w + (2w + 1 - 1)(58w + 175 - 175) + 3w*2 - 3w2 - w2 in the form aw2 + zw + u and give z. -2 Express 7 + 3 + 3 + 13d + 0d + 1 as h + yd and give h. 14 Express 115r*2 - 63r*2 + 1 - 30r + 7r3 + 0 - 51r*2 as b + zr*3 + lr*2 + cr and give b. 1 Express -3p3 - 2p*3 + 6p*3 + 563p - 563p + 64p*3 + (0p*2 + 0p2 + p2)(0 - p + 0) as ip*3 + ap + f + qp2 and give i. 64 Rearrange 159u*2 + 161u*2 - 624u*2 - 20 + 157u*2 + 149u*2 + 2u*3 - 2u to m + ru3 + qu + hu2 and give m. -20 Express -3u - 106 - 174 - 15 + 16 - 84 as f + vu and give v. -3 Rearrange -101377 - 101324 + 54c + 202648 to the form f + ac and give f. -53 Express 786z - 6945z - 5292z as oz + k and give o. -11451 Rearrange (-786x*2 + 786x*2 + 816x*4)(7 + 37 + 2) to d + ix3 + vx*4 + zx + tx2 and give v. 37536 Express 3 - a - 3 + (-6 + 2 + 3)(-6a + 3a + a) - 4 - 5a + 4 + 18a - 28a + 13a + (-3 - 3 + 10)(8a - 2a - 2a) as r + ga and give g. 15 Rearrange (3 - 3 + 2)(k - 5k - 4k) + (-k - 7k + 6 + 6k)(-1 + 2 + 0) + 0k + k + 1 + 0k to the form uk + w and give w. 7 Express 30 - 67 - 95i + 37 + 1424i in the form pi + s and give s. 0 Express -3297b*4 - 5b*2 + 6b*2 - 29 - 56 - 49 + 3326b*4 as nb*2 + vb*4 + c + qb*3 + rb and give n. 1 Rearrange -910d + 37 - 890d + 1797d - d2 to the form id + c + rd2 and give i. -3 Rearrange 4j*3 + 5161j*2 + 5170j*2 - 2j*3 + 863j*4 - 10331j*2 + 2 + 2j to hj4 + uj + nj3 + tj*2 + l and give u. 2 Express 108s*2 - 5s*3 - 19433s + 9709s + 9724s in the form os3 + t + is*2 + xs and give i. 108 Rearrange 1147w4 - w + 1157w*4 - 6 - 2w*2 - 2287w*4 to v + nw*3 + hw*4 + tw*2 + cw and give v. -6 Express -195 - 196 - 203 - l*3 + 336l*2 + 592 in the form o + dl*3 + pl + wl2 and give d. -1 Rearrange (-509 - n + 6n + 501)(4 - 2 + 0) + (2n + 2n - 3n)(-1 + 3 - 3) to ln + h and give l. 9 Rearrange -1226f + 8f2 - 123 - f2 - 3f2 + 1226f to sf2 + l + cf and give l. -123 Rearrange -3b + 3b + 3b2 + 5b*2 - 4b2 + b2 + (-46b - 9b + 11b)(8b - b + 6b) to the form zb + ob*2 + u and give o. -567 Express (3m*2 - 2 - 4m*2 + 3)(-63 - 53 + 107 - 10m2) as f + jm + pm2 + dm*3 + km*4 and give d. 0 Express ((-3 + 2 + 3)(-3 - 2h2 + 3) - 1 + 1 - h2)(301859 - 301859 - 3795h) as z + lh + fh3 + ah*2 and give f. 18975 Rearrange 35n*2 - 33n*2 + 18n - 5n4 + 21 + 2n*3 - 16n to the form wn + k + gn*2 + pn*3 + in*4 and give i. -5 Rearrange -8 - 526s*2 + 7 + 574s*2 + (0s + 3s + 0s)(5 - 5 + s) + 0 + 0 + 2s*2 to r + ws*2 + zs and give r. -1 Rearrange -42l4 + 0 + 79l*4 + 0 + 2l*2 - 45l*4 + 10l + 2l3 to nl + z + pl2 + al*4 + xl*3 and give a. -8 Express -115 + 101f*3 - 41f*2 + 13f*3 + 115 - f - f in the form cf*3 + i + uf + gf2 and give u. -2 Rearrange 4085o - 1829 + 5482 - 1827 - 1829 - 1530o to the form xo + k and give k. -3 Rearrange (-2348 - 839 - 2095 + 1218)(h4 + h4 - h4) - h4 + h - h to the form sh*4 + wh*3 + uh + g + lh2 and give s. -4065 Rearrange (0 + 1 + 0)(-154 - 42 + 43)((1 + 1 + 0)(x - 3x + 0x) + 2x - 1 + 1) - 2x + 3x + 2x to dx + t and give d. 309 Express -6599 - 384x*2 - 569x*2 + 6599 as sx + t + jx2 and give j. -953 Express 476d - 187d - 4 + 28d*2 + 2 + 5d*2 - 202d in the form bd2 + gd + n and give g. 87 Rearrange 6t3 - 10t*3 + 7t*3 + (3t - 1 + 1)(0t + 0t - t2) - 15t*3 - 8t3 - t3 to the form ht2 + w + xt*3 + it and give x. -24 Express 127 + 130 - 258 + 751o in the form fo + d and give d. -1 Express -23 - 716x - 336x + 561x in the form ix + n and give i. -491 Rearrange 1640q - 3 + 0 - 1 - 1231q to the form p + fq and give p. -4 Rearrange 12888t - 12888t + 2 + 24t*2 to f + nt*2 + zt and give f. 2 Rearrange -17 - 3948p3 + 1555p*3 + 3p - 2p + 31 - 12 to vp*2 + u + xp*3 + fp and give x. -2393 Express -9q + 6q - 3q - 5q + (-1 - 1 - 2)(-14q - 3q - 4q) as aq + l and give a. 73 Express r2 + 14r - 34r + 12 - 2r*2 - 5r - 2r3 in the form q + hr + dr2 + nr*3 and give d. -1 Express (s + 1 - 1)(13s + 10 + 17s - 24s)(3 - 3s - 3) in the form ts*3 + qs + ps2 + c and give t. -18 Rearrange -66h + 66h + h2 - 638 - 600 + 0h*2 to the form th + xh2 + j and give x. 1 Express -24 - s3 + 3s*2 - 98 + 64s + 2s + 121 as rs*3 + y + js + zs2 and give r. -1 Rearrange -g3 - 4g*3 + 4g*3 + (3g2 + g2 - 7g2)(-g + 13g + g) + 0g*3 + 0g*3 + 7g*3 to the form xg*2 + tg*3 + mg + p and give t. -33 Express (18 + 38 + 11)(-24u - 76u + 16 - 16) in the form b + ku and give k. -6700 Express (-6102 - 941 - 676 - 2694 - 6718)(0a3 - a3 + 2a3) as ua + ha2 + ca*3 + i and give c. -17131 Rearrange (-6 + 6 - 2b)(1927 + 336b - 1927 + b + 0b - 2b + (2b + 0b + 0b)(3 - 5 + 3) + 2b + b + 4b) to u + ab2 + gb and give a. -688 Express 15192x2 + 18x*3 + 15190x*2 + 27x - 2x4 - 30382x*2 as sx*3 + lx*4 + zx + g + bx2 and give z. 27 Rearrange (0c*2 - 2c2 - c2)(-88 + 16c + 88)(8c + 9c - 15c) to pc4 + s + lc + oc3 + dc*2 and give p. -96 Rearrange -3h3 - h3 + 3h3 + (2 + h - 2)(4h + h + h)(-2h + h + 5h)(0 + 2 + 0)(0 + 1 + 3) to the form wh + z + ch*3 + uh*2 and give c. 191 Rearrange (-3u*4 + 2u*4 + 2u*4)(-28 - 58 + 15)(-2 - 4 + 26) to pu*4 + fu*3 + hu*2 + k + nu and give p. -1420 Rearrange (-1 - 1165b - 1130b + 53063b3 + 2295b)(2 - 4 + 2b + 3) to the form z + qb3 + vb + xb4 + cb*2 and give x. 106126 Rearrange (60 + 30g + 33g - 60g)(-2 + 5 - 1)(29g - 6g + 32g) to ug + d + yg2 and give u. 6600 Express -6b*2 - 4b + 5b2 + 0b + (-5b + 4b + 3b)(-4b + 0b + 2b) - 26b + 29b2 + 26b in the form nb + ib*2 + z and give n. -4 Express 0o + 0o + 2o*4 + (4 + 2 + 83)(-2o2 - o + o)(-10 + 2o2 + 10) in the form do + mo2 + j + lo*3 + wo*4 and give w. -354 Rearrange (2 - 1 + 0)(-5r - 3r + r)(-r + 111 - 111)(-12 + r*2 - 4r*2 + 2r*2) to x + qr*3 + kr*4 + tr + or2 and give o. -84 Express (-4y*3 + 10y*3 - 3y*3)(-521 + 909y - 434y - 470y) in the form gy*2 + f + jy*3 + ry*4 + sy and give r. 15 Express 2a2 - 2a*2 - 2a3 + (-3 + 3 + a3)(-4 + 2 + 3) + (0 - 1 - 10)(-639 + 97a3 + 639)(-3 - 1 + 2) as z + wa2 + ca*3 + fa and give c. 2133 Express (5 - 4 - 16)(-3r + 2r - r)(-25 + 15 + 6 + 39) in the form f + ar and give a. 1050 Rearrange (-38 + 11x + 38)(-2 + 2 + 2)(2 - 6 + 3)(-6 + 4 + 6)(-2 - 1 + 16) to yx + f and give y. -1144 Rearrange (-2q*2 - 9 + 9)(-86q + 112q - 155q) + (3 - q - 3)(9q2 - q2 - 4q*2) to lq*3 + x + aq*2 + hq and give l. 254 Express -8b2 + 23b*2 - 12b*2 + 70 + 9 - 6b*2 + 2b as p + vb2 + qb and give q. 2 Rearrange (5q - 6q + 4q + 3)(-9552 - 9872 + 20410) to gq + c and give g. 2958 Rearrange 182l*2 + 10l - 1075l2 - 33l + 23l to the form b + ol + il2 and give i. -893 Express (3 - 2 + 0)(2l2 - 5l*2 + 0l*2) - 4 + 2 + 5 - 3 + 5738l*2 + 229l*2 in the form ul + v + bl2 and give v. 0 Express (1 + 3 - 2 + (0 - 1 + 4)(0 - 3 + 2) + (0 - 3 + 4)(0 - 2 + 1) - 7 - 10 + 4)(-22b2 + 37b*2 - 34b*2) as w + xb*2 + db and give x. 285 Express 2796 - 2796 - 5y4 - 190y*3 + 0y*4 - 3y*2 in the form wy + t + by4 + my*2 + sy*3 and give b. -5 Express (-51b**	{ "pile_set_name": "DM Mathematics" }
167nw*3 + nw*2 + 1457nw + 3n + 46281w3 - 11w*2 - 7w wrt n? 167w3 + w2 + 1457w + 3 Find the second derivative of 2s2v*3 + 10s*2v + 2s2 - 569s + 7400v4 + 380v*2 - 72v + 2 wrt v. 12s2v + 88800v2 + 760 Find the second derivative of -45h*5 + 2755587h*4y*3 - hy*3 - 30hy2 - 3323h - y3 - y2 wrt h. -900h3 + 33067044h*2y*3 Find the third derivative of -2z*5 + 2412z*4 + 12898z*3 + 183179467z*2 wrt z. -120z*2 + 57888z + 77388 What is the first derivative of 4721086b + 39552964? 4721086 Find the second derivative of 3776936k*5 + 2k4 + k2 + 11k - 936147. 75538720k*3 + 24k*2 + 2 Find the third derivative of 18v*6 - 159567v*5 + 21398078v*2 wrt v. 2160v*3 - 9574020v*2 What is the derivative of 22850904as2 + 4as - 58940524a wrt s? 45701808as + 4a Find the first derivative of 10504w*3 + 3w*2 + 188w + 39992877 wrt w. 31512w2 + 6w + 188 What is the first derivative of -l*4 + 3l*3 + 823l*2 - 69l - 1325855 wrt l? -4l3 + 9l*2 + 1646l - 69 Find the third derivative of 5385w5 + 78w*3 - 25w*2 - 2w - 99920 wrt w. 323100w2 + 468 What is the second derivative of -22g*2pt + 405g*2p - 9520g2 - 274572801gpt - g wrt g? -44pt + 810p - 19040 Find the first derivative of -57798r*2 - 238r + 14070913. -115596r - 238 What is the third derivative of 364w*5 + 5w*4 - 109522w*3 + 19w*2 - 63w - 16788 wrt w? 21840w2 + 120w - 657132 Find the third derivative of 2431f6 + 17f*5 - 355f*3 + 176716210f*2 wrt f. 291720f*3 + 1020f*2 - 2130 What is the third derivative of -219949685b*4 + 5b*2 - 66587840 wrt b? -5278792440b What is the third derivative of 101220398s3 + 462428381s*2 wrt s? 607322388 Find the third derivative of -4461925p*3 - 3594384p*2. -26771550 Find the third derivative of 38534088k*3 + 2k*2 - 25783k + 325. 231204528 What is the first derivative of 74485120r - 29049163 wrt r? 74485120 Find the third derivative of 210733227y*3 - 4y*2 - 25993441y. 1264399362 Find the second derivative of -1838488q2z*4 + 112q*2z + 1657q2 - 4z wrt z. -22061856q2z*2 Find the second derivative of -4f*2lt - 14572f*2l + 1210f2t + f*2 + 69fl - 29514ft wrt f. -8lt - 29144l + 2420t + 2 Find the second derivative of -27567c*5 + 5480c*2 + 1797383c + 36 wrt c. -551340c3 + 10960 Differentiate 96302631z + 13632283. 96302631 What is the third derivative of 355299459al*3 + 5al2 - 1092al + a - 3l*2 - 114 wrt l? 2131796754a Differentiate 188545178k2 + 160306594. 377090356k Find the second derivative of 15680279u3 + u + 8133876 wrt u. 94081674u Find the second derivative of -34q5 + 21897q*2 - 28999927q wrt q. -680q3 + 43794 Find the second derivative of -987c*3 - 347367c*2 + 199481970c. -5922c - 694734 Find the third derivative of -72o*5 - 5o*4 + 3124o*3 + 19o*2 - 65094o. -4320o2 - 120o + 18744 Find the third derivative of 12280346r6 - 2r*2 + 420477r + 2 wrt r. 1473641520r3 Differentiate -962d*3g - 20649121d3 + 295d*2g + 2d2 + 3g with respect to g. -962d3 + 295d*2 + 3 Find the first derivative of 41655961g*2 - 277812723 wrt g. 83311922g What is the second derivative of 145v4 + 17v*3 - 1375v*2 - 157561457v wrt v? 1740v2 + 102v - 2750 Find the second derivative of -40153020c4 - 96937041c wrt c. -481836240c2 What is the second derivative of 575k*3n*2s*3 - 28k*3s + 47k2ns - 10k*2n - 1670kn*2s*2 + 2ks - 2k + n*2 wrt s? 3450k*3n*2s - 3340kn*2 What is the derivative of 13k*2 + 809422k + 23832736 wrt k? 26k + 809422 What is the second derivative of -4h*2my - 3h*2y*2 + 609hmy*2 + 658hmy + 2hm + 14hy*2 - 16y*2 + 106y wrt y? -6h2 + 1218hm + 28h - 32 Find the third derivative of 196626899y3 - 2269920y*2 + 28 wrt y. 1179761394 What is the derivative of -37cstz + 164cs + 433ct2z - st2 + 2stz + 2st + 15sz - 2t2 - 4425z wrt c? -37stz + 164s + 433t2z Find the third derivative of -v*6 - 2062953v*4 + 1346018v*2 + 9v. -120v3 - 49510872v Find the third derivative of 1075419jy*4 + 39jy2 - 82jy - 7j + 15y5 + y2 + 2 wrt y. 25810056jy + 900y*2 Find the third derivative of -148885p*3q*2 + 69p*3q + 163p2q + 4pq + 6773q2 wrt p. -893310q*2 + 414q Find the first derivative of 2cfh - 2239cf + 176620ch - 1147c - 99fh + 4f - h + 6 wrt h. 2cf + 176620c - 99f - 1 Differentiate -17596021y - 27415679 with respect to y. -17596021 What is the first derivative of 2567i4z*2 - 5917i*4z - z*2 - 87863z + 23 wrt i? 10268i3z*2 - 23668i*3z Find the second derivative of -16k4 + 6k*3 + 155675k*2 + 5k + 10474901. -192k2 + 36k + 311350 Differentiate -11677893sy + 415700s - 11 with respect to y. -11677893s What is the third derivative of 96592j5 - 288j*3 - 113j*2 + 140301j wrt j? 5795520j2 - 1728 What is the derivative of -19487811n + 19192431? -19487811 What is the second derivative of 1398a3 + 51917a*2 - 594601616a wrt a? 8388a + 103834 What is the second derivative of -279820518z*2 - 604406304z? -559641036 What is the first derivative of 9c4 - 5723994c*2 + 162097346 wrt c? 36c*3 - 11447988c Find the second derivative of -418645773i3 - 667281415i. -2511874638i Find the third derivative of -3j*2z*4 + 4j*2z*2 - 430j*2 + 2203793jz3 - jz - z*2 + 3z wrt z. -72j2z + 13222758j Find the second derivative of -2242384d*2g*2u*2 - 2d*2gw - 30dg2u - 2dguw - dgu + g*2u*2w - 2g2uw - g2u + 13g2 wrt u. -4484768d*2g*2 + 2g*2w What is the third derivative of 10922876bq*3 - 2bq2 + 57791q*2 wrt q? 65537256b Find the second derivative of 98128027g3 + 2028g - 4434 wrt g. 588768162g Find the second derivative of -48249392j*2 - 88471055j wrt j. -96498784 What is the third derivative of 3244491c3d*4 - 2c*3 - 3806c*2d*2 + 10851c + 11d4 wrt d? 77867784c*3d + 264d What is the third derivative of -2y*4 - 144504608y*3 + 6804y*2 - 5876y wrt y? -48y - 867027648 What is the second derivative of 8t*3 - 17851t*2 + 10541089t wrt t? 48t - 35702 Find the first derivative of 987764879j*4 - 758918122 wrt j. 3951059516j*3 What is the derivative of 209902f*3 + 2f*2 - 1730613 wrt f? 629706f*2 + 4f Find the third derivative of 3y6 + 1789346y*3 - 69395y*2 + 150y wrt y. 360y3 + 10736076 Find the second derivative of -260402975y*2 + 5751y + 15780. -520805950 What is the second derivative of -88942768d3 - 30747914d - 3 wrt d? -533656608d Find the third derivative of 3434o*4 + 5o*3 + 7600o*2 - 52. 82416o + 30 What is the derivative of -31519756a4 + 32303967? -126079024a3 Differentiate h3w2x - h*3 - 4949266w*2 - 14645074x wrt x. h*3w*2 - 14645074 Find the third derivative of 592960583z*4 - 2283428z*2 + 5 wrt z. 14231053992z What is the first derivative of -3rw*2 - 193rw - 4007595r - 3w2 + w wrt w? -6rw - 193r - 6w + 1 Find the first derivative of 7847w*3 + 11259w*2 - 120039172. 23541w*2 + 22518w What is the derivative of -279212943d - 96435930? -279212943 What is the first derivative of -468452720cv2 - 102458182v*2 wrt c? -468452720v*2 What is the second derivative of 682l*4 - 207l*3 + 29l*2 + 674830l - 7? 8184l2 - 1242l + 58 What is the second derivative of 15l3 - 1950l*2 + 708426l? 90l - 3900 Find the third derivative of -11701c*4 - 700c3 + c2 - 233c + 9222. -280824c - 4200 What is the second derivative of -891448u4 + 3u*3 - 11172471u + 1? -10697376u2 + 18u Find the second derivative of -62741352o2 - 51547359o. -125482704 Find the third derivative of 295797k4 + 14k*3 + 11651k*2 + 213k + 1. 7099128k + 84 Differentiate -94my2 - 4359163m + 40484y4 with respect to y. -188my + 161936y*3 What is the second derivative of -4880l*3 + 18991l*2 - 10l - 350857 wrt l? -29280l + 37982 Find the third derivative of -18n*3t*2 - 12456386n*3 + 19n*2t - 2n*2 - 269	{ "pile_set_name": "DM Mathematics" }
alse Does 724 divide 442298? False Is 6 a factor of 596922? True Is 15 a factor of 91022? False Does 150 divide 19264200? True Does 17 divide 13176? False Does 17 divide 2620686? True Does 180 divide 339656? False Is 320112 a multiple of 36? True Is 138 a factor of 73140? True Does 8 divide 1401299? False Is 92561 a multiple of 3? False Is 6654021 a multiple of 29? True Does 23 divide 654465? True Is 131429 a multiple of 5? False Does 67 divide 451848? True Is 2605116 a multiple of 6? True Is 28 a factor of 928850? False Is 173154 a multiple of 9? False Is 36 a factor of 5866230? False Is 47 a factor of 2945067? True Is 50 a factor of 72000? True Is 12030363 a multiple of 229? False Is 89 a factor of 348717? False Is 7 a factor of 23407? False Is 2321249 a multiple of 133? True Does 35 divide 533126? False Is 1210 a factor of 5157137? False Is 8 a factor of 1173245? False Is 10 a factor of 608940? True Is 15020264 a multiple of 35? False Does 447 divide 1118841? True Is 2671248 a multiple of 303? True Is 80568 a multiple of 27? True Is 4541229 a multiple of 431? False Is 13 a factor of 4990375? True Is 95529 a multiple of 6? False Is 420 a factor of 25372203? False Does 431 divide 383159? True Is 214 a factor of 7694171? False Is 68921 a multiple of 187? False Does 195 divide 5157131? False Is 2224743 a multiple of 709? False Does 4 divide 99144? True Is 1752519 a multiple of 401? False Is 419 a factor of 878643? True Does 542 divide 3390752? True Is 97045 a multiple of 18? False Is 716704 a multiple of 135? False Is 73 a factor of 5329? True Is 32 a factor of 6142944? True Does 28 divide 509350? False Is 762 a factor of 221603? False Is 38 a factor of 958781? False Is 30300 a multiple of 27? False Is 37 a factor of 444322? False Does 423 divide 29120166? True Is 39 a factor of 135207? False Is 64 a factor of 252352? True Does 87 divide 88044? True Is 244 a factor of 5749128? True Is 32151 a multiple of 7? True Is 102 a factor of 361794? True Is 115 a factor of 10746865? True Is 392 a factor of 2669128? True Is 20 a factor of 138480? True Is 153 a factor of 5456286? True Is 264 a factor of 91178? False Does 765 divide 2283837? False Is 292201 a multiple of 13? True Is 94625 a multiple of 29? False Is 94 a multiple of 4? False Is 20552761 a multiple of 7? False Is 458402 a multiple of 478? True Is 11102039 a multiple of 13? True Is 270802 a multiple of 46? True Is 288017 a multiple of 2? False Does 263 divide 324805? True Is 328476 a multiple of 6? True Is 45 a factor of 30240? True Does 19 divide 6660659? True Is 8482664 a multiple of 19? True Does 653 divide 2217588? True Is 12953808 a multiple of 71? True Is 363 a factor of 6102030? True Is 32 a factor of 18551232? True Does 9 divide 319858? False Does 22 divide 106260? True Does 409 divide 570964? True Is 410 a factor of 6032269? False Is 967860 a multiple of 19? True Does 18 divide 1852597? False Does 48 divide 17841? False Does 8 divide 144421? False Is 2263322 even? True Is 616896 a multiple of 454? False Does 12 divide 9522? False Does 251 divide 44929? True Is 24324 a multiple of 21? False Does 212 divide 1680312? True Is 29 a factor of 401788? False Does 81 divide 171343? False Does 43 divide 6098260? True Does 43 divide 3728940? False Is 700639 a multiple of 8? False Does 22 divide 951544? True Does 9 divide 4887? True Is 25 a factor of 96050? True Does 9 divide 3397629? False Does 15 divide 95475? True Is 135929 a multiple of 37? False Is 13 a factor of 1303500? False Is 36 a factor of 4602808? False Is 1261 a factor of 8479900? False Does 18 divide 157500? True Does 334 divide 10859274? False Is 72 a factor of 933192? True Is 46480 a multiple of 35? True Is 4 a factor of 34200? True Does 24 divide 1159229? False Is 789640 a multiple of 152? True Is 23 a factor of 22876181? False Does 13 divide 1760431? False Is 12 a factor of 3905? False Is 334 a factor of 163994? True Does 28 divide 460852? True Does 95 divide 42453? False Does 45 divide 990? True Is 32 a factor of 5734432? True Is 8831172 a multiple of 138? True Is 83 a factor of 36852? True Is 87230 a multiple of 10? True Does 258 divide 920665? False Is 7 a factor of 12794294? False Is 42785 a multiple of 13? False Is 17 a factor of 64685? True Is 34348 a multiple of 124? True Is 4495008 a multiple of 96? True Is 12 a factor of 614772? True Is 48 a factor of 1407489? False Is 14 a factor of 379504? False Is 431899 a multiple of 65? False Does 73 divide 470717? False Is 88 a factor of 112376? True Is 10489038 a multiple of 294? True Is 72 a factor of 123264? True Is 43 a factor of 304010? True Is 7550168 a multiple of 8? True Is 57117 a multiple of 93? False Is 563 a factor of 2246933? True Is 24379776 a multiple of 11? False Does 108 divide 141675? False Does 43 divide 210270? True Is 1071 a multiple of 148? False Is 216253 a multiple of 33? False Is 31 a factor of 597345? False Is 3126948 a multiple of 33? True Does 3 divide 135339? True Is 567 a factor of 1285490? False Is 649012 a multiple of 1472? False Does 71 divide 5616810? True Does 28 divide 602142? False Is 40463 a multiple of 60? False Is 3939916 a multiple of 188? True Does 83 divide 403463? True Does 15 divide 561480? True Is 102 a factor of 79662? True Does 29 divide 161385? True Is 7 a factor of 307146? True Does 152 divide 44232? True Does 26 divide 6304766? True Is 111 a factor of 8525149? False Is 125950 a multiple of 50? True Does 50 divide 2555355? False Is 8457246 a multiple of 9? True Does 177 divide 1509768? False Is 4179 a multiple of 109? False Is 2813163 a multiple of 113? False Does 722 divide 23944889? False Is 29 a factor of 8078849? True Does 90 divide 146160? True Does 6 divide 404076? True Is 101 a factor of 3698712? False Does 1058 divide 1119757? False Does 97 divide 336105? True Is 939952 a multiple of 13? True Is 587825 a multiple of 90? False Is 26 a factor of 3323101? False Does 82 divide 1303718? True Is 140287 a multiple of 21? False Is 9 a factor of 2486403? True Is 1519492 a multiple of 52? True Is 4766894 a multiple of 7? False Is 193 a factor of 535575? True Does 329 divide 1315902? False Is 10 a factor of 80511? False Does 15 divide 9002775? True Does 4 divide 103159? False Is 90 a factor of 2184930? True Does 33 divide 140580? True Is 1339974 a multiple of 87? True Does 72 divide 718593? False Is 5755003 a multiple of 11? False Is 556798 a multiple of 102? False Is 1784 a multiple of 8? True Is 185203 a multiple of 24? False Is 19 a factor of 412946? True Is 48 a factor of 950736? True Does 1126 divide 10539360? True Does 117 divide 118989? True Is 28 a factor of 404034? False Is 211 a factor of 242957? False Does 19 divide 4620? False Does 64 divide 665664? True Is 2981375 a multiple of 61? True Is 200 a factor of 154400? True Does 72 divide 307055? False Is 229804 a multiple of 52? False Is 756632 a multiple of 293? False Does 241 divide 216940? False Is 8 a factor of 126248? True Is 286762 a multiple of 7? True Is 335 a factor of 776947? False Is 45 a factor of 744759? False Is 682 a factor of 39487? False Is 77216 a multiple of 127? True Is 70 a factor of 27021501? False Is 18727157 a multiple of 18? False Is 3 a factor of 19269? True Is 34 a factor of 539099? False Is 404514 a multiple of 9? True Does 2 divide 749014? True Does 28 divide 4322752? True Does 516 divide 3150180? True Does 94 divide 506378? True Is 1186 a factor of 4173382? False Does 20 divide 144960? True Is 1100993 a multiple of 23? False Is 11402 a multiple of 4? False Is 210292 a multiple of 15? False Does 12 divide 366840? True Is 108251 a multiple of 143? True Is 16 a factor of 3261792? True Does 26 divide 61386? True Is 155 a factor of 3294525? True Is 62033 a multiple of 4? False Is 211600 a multiple of 20? True Is 289 a factor of 112710? True Is 5567011 a multiple of 22? False Does 333 divide 4179816? True Is 5647005 a multiple of 245? True Is 347 a factor of 258863? False Is 93104 a multiple of 176? True Is 2061858 a multiple of 23? True Does 17 divide 4870993? True Is 2 a factor of 2463? False Is 193797 a multiple of 14? False Is 16965 a multiple of 13? True Does 18 divide 143779? False Is 988735 a multiple of 39? False Is 3 a factor of 42497? Fals	{ "pile_set_name": "DM Mathematics" }
20, -8 = q - 2y. Suppose q = 21w - 23w + 12. What is the units digit of w? 6 Suppose 3g - 17 - 10 = 0. Let q be 30/g6/4. Suppose f + 7 = qs - 8, 0 = f. What is the units digit of s? 3 Let n be (-40)/140 - (-46)/14. Suppose -2o + 6 = 4f, no + 5 - 2 = -3f. Suppose t - f = -5j, -3t - 2j + 55 - 17 = 0. What is the units digit of t? 4 What is the units digit of 6/(-1) - (1 - 382)? 5 Suppose 9o - 17885 - 1168 = 0. What is the hundreds digit of o? 1 Let k be 2/(13/11 + -1). Let w = 13 + k. Suppose 0 = -z + 2i + 32, 0i - 4i + w = 2z. What is the units digit of z? 2 What is the thousands digit of 15/(-3) + (-8491)/(-7)? 1 Suppose 0 = -p - 8m + 6m + 1616, 0 = -2p - m + 3232. What is the units digit of p? 6 Suppose 4l = -0l + 556. Suppose 6p - 55 + l = 0. Let r = -9 - p. What is the units digit of r? 5 Let z(o) = -4o2 + 2o + 4o3 + o - 1 - 1. Let d = 15 - 13. What is the tens digit of z(d)? 2 Suppose -189s + 175s = -52458. What is the units digit of s? 7 Suppose -13d = 7d + 1440. Let f = d + 350. What is the hundreds digit of f? 2 Let i = -31 - -23. Let y(m) = -10m + 24. What is the units digit of y(i)? 4 Suppose -d - d + 558 = s, -3s + 2d + 1682 = 0. What is the units digit of s? 0 Let y(o) = -101o + 54. What is the tens digit of y(-2)? 5 Let x = 12 - 10. Suppose -3g + xn + 218 = 0, -g + 3n = 3g - 292. What is the tens digit of g? 7 Let a(g) = g3 + 9g*2 + 9g - 10. Suppose -4v + 2k - 24 - 2 = 0, -4v - 32 = 4k. What is the tens digit of a(v)? 2 Suppose 20q - 2440 = 15q. What is the tens digit of q? 8 Let q(l) be the second derivative of -l*5/20 + 2l*4/3 - 2l*3/3 + 3l*2 - 2l. What is the tens digit of q(5)? 6 Suppose h - 2l = -12 - 4, 0 = h + 4l + 22. Let w be (h/12)/(1/(-70)). Let v = w + -57. What is the units digit of v? 8 Suppose -i + 18 = 3i - m, -5i = -5m - 15. Let j(v) = 2v*2 + 4v - 11. What is the tens digit of j(i)? 5 Let b(m) = 2m + 4. Suppose -3f + 14 = -d, 0 = 5f + 3d - 4d - 20. Let v be b(f). What is the tens digit of 8/(-6)(-135)/v? 1 Let w = -513 - -683. What is the tens digit of w? 7 Let j(s) = s*3 + 11s*2 - 15s + 13. Let t be j(-12). Suppose 2m + p - t = 15, 3m - 96 = 5p. What is the units digit of m? 2 Let g(d) = -29 + 3d - 2d - 4d + 37. Let h be g(-8). Let b = -9 + h. What is the units digit of b? 3 Let m be -5 - (-5)/((-40)/32). Suppose -3 = 3j - 33. Let u = j + m. What is the units digit of u? 1 Let o = -1697 + 2677. What is the hundreds digit of o? 9 What is the tens digit of (-2)/(-1) - (7 - 105)? 0 Let g(p) = -4p*2 + 4p*2 - 3p*2 + 4 + 2p*2 - 3p. Let d be g(-4). Suppose 4u + u - 160 = d. What is the tens digit of u? 3 Suppose -33i - 8008 = -46i. What is the tens digit of i? 1 Suppose -4w + 5w = 3q - 472, -2q + 298 = -4w. Suppose 3g = p + 503, 0 = -g + p - 5p + q. What is the tens digit of g? 6 What is the hundreds digit of (22 + -21 - 107/(-6))6? 1 Let a(q) = 16q*2 + 3q - 2. Let w(v) = -2v + 1. Let y(d) = a(d) + w(d). What is the tens digit of y(-3)? 4 Suppose -z = z + g + 153, 0 = -3z - 2g - 228. Let l = 6 - z. What is the tens digit of l? 8 Let t = 3966 + -1571. What is the tens digit of t? 9 What is the hundreds digit of (224/4)/((-24)/(-5024))? 5 Let n(f) = -12f + 3f - 39f + 8 + 8f. What is the units digit of n(-2)? 8 Let b(w) = 4w3 - 138w*2 - 43w + 18. What is the units digit of b(35)? 3 Suppose -5x = -3s + 373, -5s + x = -7s + 227. Suppose 4q = s + 8. What is the tens digit of q? 3 What is the tens digit of ((-8840)/(-476))/(1/14)? 6 Let q(p) be the first derivative of -2p*2 + 3p - 2. Let m be q(2). Let i(g) = -g*3 - 5g*2 - 5g + 6. What is the units digit of i(m)? 1 Let f = 181 - 306. Let y = -78 - f. What is the units digit of y? 7 What is the tens digit of ((-48)/14)/(4/(-98))? 8 Let y(g) = -g*3 - g + 1. Let h be y(1). Let u be 3 + h/1 + 13. Let k = 5 + u. What is the tens digit of k? 2 Suppose 4f + 24 - 64 = 0. Suppose -fi + 613 = -1407. What is the tens digit of i? 0 Suppose 4l - 5l + 3 = 0. Suppose -lw = -w. Suppose w = 4o + 10 - 94. What is the units digit of o? 1 Suppose 9126 = 31b - 22b. What is the hundreds digit of b? 0 Let p(w) = -w3 - 8w*2 - 10w + 43. What is the units digit of p(-8)? 3 Suppose -4u - 2m + 22470 = 0, 4m = -u + 7m + 5635. What is the units digit of u? 0 Let k be (-5 + 2)(-203)/21. Let r be (-4 + 2)/(-1) - k. Let z = -16 - r. What is the units digit of z? 1 Let a = 1474 + -155. What is the thousands digit of a? 1 What is the tens digit of (27 - 7)/5 + 594? 9 Let v(p) = -p2 + 5p - 8. Let b(r) = r + 2. Let k be b(2). Let y be v(k). Let n(g) = 3g2 + 3g - 4. What is the tens digit of n(y)? 3 Suppose -45668 - 39386 = -43l. What is the tens digit of l? 7 Let h = -4260 + 6134. What is the thousands digit of h? 1 Let c = -16 + 10. Let o be (13/(-78))/(1/c). What is the tens digit of -3 - (o - (0 + 15))? 1 Suppose -6b + 5b + 3y + 186 = 0, -2y - 544 = -3b. What is the tens digit of b? 8 Let a(s) = s2 + s - 3. Let l(h) = -h2 - 8h - 2. Let q be l(-7). Suppose -qk - 28 = -2i, 0k = 2k + i + 4. What is the units digit of a(k)? 9 Suppose -3 = 5l + 27. What is the tens digit of (-9)/l - 774/(-12)? 6 Suppose 0 - 4 = -2o. Suppose 4x = -w - ow - 37, -4x = 2w + 42. Let c = x + 32. What is the tens digit of c? 1 Suppose -174i + 175i = 378. What is the units digit of i? 8 Let k(t) = -3t - 4t - 2t + 4t - 2 + 4t. Suppose 0 = 3z + 5 + 4. What is the units digit of k(z)? 1 Let j = 9 + -9. Suppose 0 = -ju - u + 34. Suppose 0m + 5b = 3m - u, -5b + 38 = m. What is the tens digit of m? 1 Suppose 3b - 3746 = 1222. What is the units digit of b? 6 Suppose 0 = -3d + 3g + 153, 2d - 3g - 10 = 97. What is the units digit of d? 6 Let w(q) = q3 + 14q*2 - q - 11. Let z be w(-14). Suppose -l + 63 = zf + 2l, -3f + 39 = -3l. Suppose 2p - 29 - f = 0. What is the units digit of p? 3 Let r(v) be the third derivative of v*4/8 + 31v*3/6 + 5v*2. What is the units digit of r(-9)? 4 Let t = -1 - -1. Suppose t = -5u + 3u - 4. What is the units digit of u(20/8 + -3)? 1 Let o be -3 + 0/4 + 24. What is the tens digit of 163 + (3/(-9) - 77/o)? 5 Let h = 6 - 9. What is the units digit of (1/(-4 - h))/((-2)/26)? 3 Let s(w) = 562w2 - 3w + 1. What is the tens digit of s(1)? 6 Let h(u) = 76u + 361. What is the hundreds digit of h(25)? 2 Let v = -12 - -8. Let o be 404/8 - 6/v. Suppose -39 = -y - 2y + p, -2p = -4y + o. What is the tens digit of y? 1 What is the tens digit of 9(731/51)/(1/6)? 7 Suppose 3b + 3892 = 2m, -2516 = 4m + 5b - 10344. What is the thousands digit of m? 1 What is the hundreds digit of 5337 + 60 + -52? 6 Suppose -3h + v - 2 = -h, 2v = -3h + 4. Suppose -15o + 14o + 126 = h. What is the tens digit of o? 2 Let n = 71 - 186. What is the tens digit of (-2)/4 + n/(-2)? 5 Let v(f) = -9f + 166. What is the tens digit of v(-11)? 6 Let i(m) = 20m - 32. What is the units digit of i(14)? 8 What is the tens digit of 3/6 + 1404/8? 7 Let h(s) = 4s - 23. Let q be h(12). Let z = -13 + q. Suppose 0 = 4y - 5w - 207, z = -3w + 3. What is the tens digit of y? 4 Let t = 832 - 481. What is the tens digit of t? 5 Let u(t) = -32t - 16. Let l be u(-9). Suppose 5f + l = 797. What is the units digit of f? 5 Let j = -11 + 13. Suppose 12 = 2i - s, 0 = ji + 4s - s + 4. Suppose 0u = -iu + 56. What is the units digit of u? 4 Let w(a) be the first derivative of -3a2/2 - 4a + 9. Let o be w(-4). Suppose -4n + on = 176. What is the units digit of n? 4 Let b = -6 + 9. Suppose 2u - 19 = -4f + b, 4u + 5f = 32. Suppose 2n - 41 = -uq, -2q + 5q = -4n + 67. What is the units digit of n? 3 Suppose -5o = -9 + 44. Let q(i) = i*2 + 7i + 14. Let w be q(o). Suppose 3g = w - 2. What is the units digit of g? 4 Suppose 5w - 25 = -q, -8 - 18 = -2q + 2w. Suppose 0 = qv - 10v - 70. What is the tens digit of v? 1 Suppose l + 20 = -4l, 3b - 188 = -4l. Let h = b + -20. What is the units digit of h? 8 Let b = -41 - -537. What is the units digit of b? 6 Suppose -2w - d = -7294, -5w + 5d + 7282 = -3w. What is the thousands digit of w? 3 Suppose -1121b + 1136b = 8175. What is the tens digit of b? 4 Suppose 0 = -3d - 0*d - 3	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.