Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
smaller: c or x? x Let u = -786 + 1182. Let i = u - 271. Which is bigger: i or 126? 126 Let q = 28 - 43. Let y = -47 - q. Which is smaller: -33 or y? -33 Let w = -1.8 + 2.9. Let g = w - 1. Let m = -0.3 + g. Are m and 2 unequal? True Let k(y) be the third derivative of y*6/120 - 2y5/15 + y4/4 + y*3 - 6y*2. Let h be k(7). Which is greater: h or -6/7? -6/7 Suppose 0 = 2s, -12 + 22 = 5n - 5s. Let j be ((-2)/7)/((-1)/5). Which is smaller: j or n? j Let s(p) = p*3 - 8p*2 - 12p - 12. Let u be s(9). Let m be 13/u2/(-13). Is 1 equal to m? False Let r be (6988/(-8) - 5)2/(-7). Is 0 > r? False Let d(v) = v*3 + 12v*2 + 15v + 10. Let c be d(-11). Let l be (c/15)/((-32)/(-12)). Let k = 5/4 + l. Is -3/7 > k? False Let n = 3104 + -28030/9. Is -11 != n? True Let f = 2 - 1. Let w = 14275 + -14198. Which is greater: w or f? w Suppose 0 = g + 3y - 181 + 7, g - 174 = 2y. Let v be 2/13 + g/(-117). Which is bigger: v or 0? 0 Suppose 0 = 3l, 12n - 7n + 3l + 5 = 0. Are n and 1/338 unequal? True Let p be ((-6)/16 - 0) + 0. Let g be 2/(1/(-4) - (-14)/(-8)). Let k be ((-2)/g-1 + 2)/3. Which is smaller: k or p? p Let i be (-49)/(-5) - (-12)/60. Suppose 0g = -3g + 15, -4l + 2g = -i. Let j be l/10 - 38/60. Is j less than -1? False Let r(o) = -11o + 69. Let h be r(6). Suppose -10 = -i + 3i. Let n = i + h. Which is smaller: -5/4 or n? n Suppose -4o + 426 = -3m, -2m + 95 = o + 3m. Suppose 0 = 52k - 57k - o. Which is smaller: -18 or k? k Let t be 2/(-42)109035/(-75). Let u = 500/7 - t. Let g be 4/(-8) - 21/(-6). Which is smaller: g or u? u Let d(g) = 7g3 - g - 2. Let z be d(2). Let r be 11/z - 2/(-8). Let i be (5 - 1) + (10 - 14). Are i and r nonequal? True Let s = -69.4 + 68.4. Is 36 greater than or equal to s? True Let q be -161(10 - 11). Suppose 5y - 16 + q = 0. Which is bigger: y or -10? y Suppose -4h + 3y + 18 = -h, -5h = 2y - 23. Let r(q) = q*3 - 5q*2 - 2q + 9. Let z be r(h). Let j be (-8)/5 - 4/10. Is z <= j? False Suppose 5b + 0q = -4q - 60, 39 = -3b - 3q. Let p be -2(-2 + -2)/b. Let c = 6 + -8. Which is bigger: p or c? p Let t be (117/(-11691))/(-13)30. Do 0 and t have the same value? False Let l(t) = -3t - 2. Let a(k) = 2. Let m(o) = 6a(o) + 2l(o). Let v be m(8). Let d be (-2)/(-8) - (-2)/v. Which is smaller: d or -1? -1 Let a = 8 - 0. Let z be a/220(5 - 10). Which is bigger: 1 or z? 1 Suppose 0x + 2o = 4x - 10, 4o = -x + 7. Suppose 19 = -xi + 4p, 3i - i + 6 = p. Let d = -2127/25 - -85. Is i not equal to d? True Let o = 91 + -84. Let d(f) = 16f2. Let q be d(-1). Suppose -os = -3s - q. Is 13/4 not equal to s? True Let r be -1 - 5/(5/2). Let b = -1 + r. Let j = -23 + 20. Which is smaller: j or b? b Suppose 3m - 7m + 12 = 0. Let l(q) = 2q*2 - 8q - 10. Let k be l(6). Suppose m = -o - k. Is -16 > o? True Suppose -24 = -2x + 40. Let l = x + -28. Suppose 4s = -t - t, ls = 2t. Which is smaller: s or 30? s Let t = 71 - 70. Which is smaller: -2/177 or t? -2/177 Suppose -19 - 7 = 5a + 3z, 4z + 16 = -4a. Let w(m) = m*3 - 2m*2 + m - 1. Let o be w(2). Let s = a + o. Which is bigger: s or -3? -3 Let g be (-10)/(1 - 12/8). Let u(d) = -2d*2 + 20. Let w = -7 - -7. Let j be u(w). Is g less than j? False Let k = -52.6 - -43.9. Is 2 less than k? False Let c = -3113/14 - -445/2. Is c less than -11/6? False Suppose -2c - 50 = 3c. Let z = c + 13. Let m be -2 - (0 + (z - 6)). Is m equal to 12/7? False Let t = -590 - -589.6. Let i = -0.88 + 1. Do t and i have the same value? False Let q = 9 + -15. Let z(y) = 24y - 989. Let j be z(41). Is q less than or equal to j? True Let w be 6/(-18) - 364/(-12). Suppose w = -5d + 115. Which is smaller: d or 18? d Let l(k) = -k2 + 31k - 84. Let p be l(28). Is p at least as big as -7/8? True Let j be ((-66)/(-36))/(3/427). Is 4 >= j? True Let q = 13 - 22. Let s = 6 + q. Let o = -1 - s. Does 2 = o? True Let a = -3 + 1. Let s be a + (-2)/(-6)-131. Let y = 46 + s. Which is bigger: 0.2 or y? y Let w = 30.7 - 30. Let b = -0.6 + w. Which is smaller: b or 10? b Suppose 4k - 3k + 1 = 0. Let d be -22 - 2/k. Let i be 1 - ((d - -3) + -2). Which is smaller: 3 or i? i Let f = 5.1 + -0.1. Let z = f + 0. Is z equal to -1/4? False Let w be ((-2)/(-6))/((-6)/(-90)). Suppose -3c + 4 - 1 = 0. Which is bigger: w or c? w Let h(m) be the first derivative of -m*3/3 - 3m*2 + m - 6. Let j be h(-4). Let n be (-10 + j)-41. Is 4 bigger than n? False Let o = 50 + -17. Let j = o + -167/5. Which is greater: -0.5 or j? j Let n = 665 - 435. Let t = -238.95 + n. Let r = -0.05 + t. Which is smaller: 2 or r? r Suppose 0a = 5a + 35. Is a greater than -8? True Let s(f) = 4f - 2. Let b be s(0). Do -2 and b have the same value? True Let x(h) = h + 1. Let k(v) = -8v3 + 2v*2 + 4v + 3. Let y(t) = k(t) - 4x(t). Let n be y(-1). Is 11 at least as big as n? True Let f(i) = i2 - 9i + 12. Let x be f(3). Let u be (((-10)/21)/(-5))/((-28)/x). Do u and 1 have different values? True Let z(x) = -19x3 + 2x + 1. Let w be z(-1). Suppose -7d + wd + 737 = 0. Which is smaller: -66 or d? d Suppose -3i - 3j = -5j - 41, 3i + 5j = 13. Let r be (i/(-22))/((-2)/16). Let a be 1/r + 175/(-28). Is a greater than 0.3? False Suppose 409 + 193 = 14d. Is 44 greater than or equal to d? True Let d be (4 + (-164)/20)-15. Suppose -h = -3z + 2h - d, -z = h + 19. Is 0.1 at least as big as z? True Let r = -2 - -5. Suppose -3a + 618 = rz, 0 = 4a + 5z - 660 - 160. Let h be (12/a)/((-2)/(-10)). Is 0.3 smaller than h? False Let x = 40.983 - 41. Let m = -3.983 + x. Is m != 1/3? True Suppose -1927n - 18 = -1926n. Which is greater: n or -52/3? -52/3 Let k = 6.9 + -7. Let l = 44 - 34. Which is smaller: k or l? k Let j = -22 + 21.93. Let o = -0.03 + j. Which is bigger: -2/7 or o? o Let t(m) = -m3 + m2 + 6m - 8. Let q be t(2). Let d = 0.2 - 1. Let f = 0.2 - d. Is q greater than f? False Let w(f) = 3 - 2 + f*3 + 0f*2 + 4f*2. Let l be w(-4). Suppose -3q + y = -4y, -q + l = -2y. Is -3 greater than q? True Let m = 12 - 10. Suppose 0 = -9i + mi - 35. Which is greater: i or -27/7? -27/7 Let x be (-2 + 1)/(6/(-42)). Let o(f) = 7 - 3 + f*2 - xf + f. Let d be o(5). Which is smaller: d or 2/5? d Let x be (-4 + 1)(-33)/99. Which is smaller: x or -2/3895? -2/3895 Suppose 0 = -l - 2r - 2r + 19, 5l - 5r + 30 = 0. Let f be (-111/22)/(-2). Which is smaller: l or f? l Suppose 43o + 1440 = 75o. Is o at least as big as 30? True Let z = 965 - 966. Which is smaller: z or 1/34? z Let y = -9.8 + 9.68. Which is greater: y or 6? 6 Let q = -125 + 126. Are q and -10/3 unequal? True Let s = 15.32 + -0.32. Let l = -12.2 - 1.8. Let w = l + s. Which is smaller: -5 or w? -5 Suppose -x - 11 - 2 = 0. Let o = x - -52. Let c be (-11)/(-13) + 6/o. Is -3/7 at least c? False Let w = -187 - -401/2. Is w greater than 15? False Suppose -3f - 60 = 3d, f + 5d = -2f - 56. Which is greater: f or -265/12? f Let a be (2 - -1 - 5)-3. Suppose -ay + 15 = -3y. Suppose w = -5o - 23, o + 5 = -yw + 10. Is w smaller than -1? False Let v = 3.9 + -7.1. Let f = -3.3 - v. Do 3 and f have the same value? False Let s be -1 + -7 + 429/48. Which is smaller: s or 2? s Let m = -0.52 - 0.08. Let d be (-2)/(-11) - 1126/22. Let r = d + 53. Are m and r non-equal? True Let d = -24.97 + -0.03. Let k = -37 - d. Let j = k - -15. Is 2 equal to j? False Suppose -5x - 6j + 306 = -2j, j = 3x - 187. Let z = 411 - 348. Which is smaller: z or x? x Let g be -4 + 108/26 + (-148)/(-52). Let z be (-1)/((5 - 4) + g). Which is smaller: 1 or z? z Let s = -79 + 125. Let k = s - 51. Which is bigger: -21/5 or k? -21/5 Let j = -45 - -44.5. Let a be 14/610/(-35). Does j = a? False Let f = -340 + 780. Is 0 less than or equal to f? True Let o = -1509 - -1534. Are o and 37 equal? False Let s(r) = 3r - 10. Let d be s(5). Suppose 0 = 3m - 5m + 4y + 10, 5y + 5 = -dm. Let g be (20/28 - 4) + 4. Which is smaller: g or m? g Let d = 134 + -1075/8. Let x = 4809/13 - 370. Which is smaller: x or d? d Let p be 350/(-14)98/(-5). Is p < 490? False Suppose 0 = -2p + 3p - 4. Suppose -pj = 3j + 168. Which is greater: j or -23? -23 Let y(i) = -8i*2 - 342i + 22. Let v be y(-44). Is v at most -418? True Let b = -25/2 + 13. Let t = -26.96 - -46.96. Which is	{ "pile_set_name": "DM Mathematics" }
117332u + u3 + 3u*3 - 1464u*2 - 576453. 4(u - 181)*2(u - 4) Let r(z) be the third derivative of -z*8/560 + 2z7/175 - z6/100 - z*5/25 + 3z*4/40 + 118z*2 + 11z. Determine b, given that r(b) = 0. -1, 0, 1, 3 Let i(n) be the second derivative of -n*4/6 + 11n*3 - 32n*2 - 448n. Factor i(b). -2(b - 32)(b - 1) Let f(a) = -a*2 - 20a + 131. Let h be f(-25). Factor 14z2 - 4z*2 - hz*3 - 2z*4 - 2z*5 + 4z*5 - 4z + 0z4 + 0z*4. 2z(z - 1)3(z + 2) Let c be (5 + 0 + 0)/(16 - 17). Let i be 8/3 - c/15. Factor 32k3 - 31k*i + 5k*2 + 3k - 3 - 6. (k - 1)(k + 3)2 Let l(s) be the second derivative of -s6/15 - 33s*5/5 - 291s*4/2 + 2376s*3 - 11664s*2 - 25s - 14. Let l(f) = 0. Calculate f. -36, 3 Let p(w) = -w*3 + 7w*2 + 2w + 12. Let n be p(7). Factor na2 - 56a3 - 6 - a3 + 82a2 - 45a. -3(a - 1)2(19a + 2) Let 15776/9z + 15555136/9 + 4/9z2 = 0. Calculate z. -1972 Let q be 1-8 - 19008/(-1936). Let g = -48/47 + 904/517. Determine p so that -4/11 - 16/11p4 + qp*2 + 2/11p + gp3 - 10/11p5 = 0. -1, 2/5, 1 Let m(u) be the second derivative of u6/15 - 59u5/10 - 187u*4/6 + 59u*3/3 + 186u*2 + 1093u - 1. Let m(n) = 0. What is n? -3, -1, 1, 62 Let m(o) = 53o2 + 951o - 8. Let j(s) = 18s2 + 312s - 3. Let t(d) = 8j(d) - 3m(d). Factor t(z). -3z(5z + 119) Suppose -35t = -0t + 2t - 74. Let i(h) be the third derivative of 0h + 3h*t + 0 - 1/600h*5 - 7/60h*3 + 1/30h*4. Determine y so that i(y) = 0. 1, 7 Let x = -8 + 11. Let 1020k + 456kx + 24k*3 - 1285k*2 + 17k*4 - 260 + 28k*4 = 0. Calculate k. -13, 2/3, 1 Let h be ((-2 + 1)/((-1)/3))/1. Let b = -2177 - -2177. Factor b - 4/3j*h - 2/3j*5 + 0j*2 + 0j + 2j4. -2j*3(j - 2)(j - 1)/3 Let l(a) be the second derivative of -a8/420 - 2a*7/105 - 2a*6/45 + 89a*3/6 + 22a. Let k(q) be the second derivative of l(q). Factor k(w). -4w2(w + 2)*2 Let n = 59 + -52. Suppose 3w - 27 = -3g + nw, 3 = w. Factor -gc2 - 17c*2 - 6 + 15c*2 - 24c*2 + 45c. -3(c - 1)(13c - 2) Let q(j) be the third derivative of 5j*8/336 - 4j*7/21 - 5j*6/12 + 2j*5/3 + 15j*4/8 + 1799j*2. What is w in q(w) = 0? -1, 0, 1, 9 Let l be 9 - ((-4)/(-16)8 - -4). Factor -155i2 + il - 150 - 10i*3 - 11i*3 - 305i. -5(i + 2)(i + 5)(4i + 3) Factor 355216/3s + 0 + 118008s*2 + 1/3s*4 - 397s*3. s(s - 596)*2(s + 1)/3 Suppose 30v = 31v - 31. Find k such that -56k - vk + 36 + 136k2 - 92k - 22k3 - 43k = 0. 2/11, 3 What is g in 0 + 33/2g - 3/4g2 = 0? 0, 22 Let u(z) be the third derivative of z6/60 - 91z5/90 - z4/12 + 91z*3/9 + 452z*2. Factor u(r). 2(r - 1)(r + 1)(3r - 91)/3 Factor 0c + 1/4c3 + 41/4c2 + 0. c2(c + 41)/4 Let s be 4 + 1/(2/1234). Factor sy*2 - 617y*2 + y + 3y. 4y(y + 1) Let x(z) be the third derivative of z*5/80 - 57z*4/32 + 65z*3/2 + 2216z*2. Find b such that x(b) = 0. 5, 52 Let m be 2 + -2 + -5 + (-91)/((-2548)/280). Suppose 0g*3 + 2/15g*4 + 2/15g*m + 0g + 0g2 + 0 = 0. Calculate g. -1, 0 Factor 1/4h*2 - 1067/2h + 1138489/4. (h - 1067)*2/4 Let u = 235 + -234. Let i(n) = 3n*4 - 4n*3 - 23n*2 + 25n + 1. Let a(h) = h4 - h2 + h + 1. Let t(k) = ua(k) - i(k). Factor t(y). -2y(y - 4)(y - 1)(y + 3) Let p(c) be the first derivative of 7c + 12 - 1/4c3 + 0c*2 + 1/40c*5 + 1/12c*4. Let h(m) be the first derivative of p(m). Factor h(b). b(b - 1)(b + 3)/2 Let b(n) = n2 - 20n + 35. Let h be b(18). Let s be (-4 - (-23)/5)/(h/(-5)). Solve -18y + 15 + 12 + 6y*2 - sy*2 = 0 for y. 3 Let c(y) be the first derivative of -2/3y*3 + 0y + 1/18y4 + 14/9y*2 + 2. Factor c(b). 2b(b - 7)(b - 2)/9 Let h(m) be the first derivative of 2m3/21 + 64m*2/7 + 696m/7 + 8728. Suppose h(n) = 0. What is n? -58, -6 Let v be 7 - 4 - (-1)/3. Let b(u) = -32u + 2. Let q be b(0). Factor -vg*3 + 8/3g - 2/3g4 + 16/3 - 4g*q. -2(g - 1)(g + 2)3/3 Let f(r) be the third derivative of -r6/360 + 19r*5/90 + 361r*4/18 - 27436r*3/9 + 2r*2 - 56r + 2. Solve f(w) = 0 for w. -38, 38 Let v(q) = 268q2 - 1140q - 6075. Let x(f) = -93f2 + 380f + 2025. Let u(i) = 8v(i) + 23x(i). Determine c, given that u(c) = 0. -5, 81 Let m(v) be the first derivative of v5/5 - v4 + 4v3/3 + 967. Factor m(i). i2(i - 2)*2 Let n(f) be the first derivative of -4f*3/3 + 197f*2 - 196f - 959. Find o, given that n(o) = 0. 1/2, 98 Let o be 13 + (-1984)/434. Let u = -48/35 - o. Factor u - 2/5h + 1/5h2. (h - 1)2/5 Let y = 499756 - 7489162/15. Let c = y - 478. Solve 4/5a*4 - 26/15a*2 - 14/15a*3 + ca + 8/15 = 0. -1, -1/2, 2/3, 2 Suppose -27b - 148 = -64b. Suppose -4a + a - u = -4, ba - 17 = u. Find q, given that -2/9qa - 8/9 + 0q + 2/3q2 = 0. -1, 2 Let p(m) = -5m*4 + 80m*3 - 889m*2 + 3244m - 3886. Let q(g) = g*4 + 5g3 - g2 - 2g - 1. Let v(j) = -p(j) - 2q(j). Determine d, given that v(d) = 0. 3, 12 Let a = -730103/5 + 146021. Suppose 0 + 10k3 + 336/5k*2 + ak*4 + 288/5k = 0. What is k? -12, -1, 0 Suppose -k - 3 = 0, -v + 3v - 4k = -18. Let l = 38 - v. Factor -6g + 0g - 3g3 + lg*2 - 44g*2. -3g(g - 2)(g - 1) Let -3/8g5 - 81/8g*3 + 21/4g*2 + 48g + 36 - 15/4g4 = 0. What is g? -4, -3, -1, 2 Solve 3/5h*5 + 38/5h*4 - 8/5h*2 - 6 - 106/5h*3 + 103/5h = 0 for h. -15, -1, 1/3, 1, 2 Let a(p) be the third derivative of -46p2 + 4/105p*7 + 0p*4 + 0 + 1/15p*5 + 0p + 0p3 + 1/168p*8 + 1/12p*6. Factor a(l). 2l*2(l + 1)*2(l + 2) Solve -2i5 + 28i*4 + 9i*2 - 9i - 15i + 370 + 36i*3 - 97i*2 - 10i - 310 = 0. -2, -1, 1, 15 Solve 3630 + 147/2p2 - 15p*3 + 3718p - 1/2p4 = 0. -22, -1, 15 Solve -1/5k*2 + 782/5 - 781/5k = 0. -782, 1 Factor -1688q - 994q + 171q2 + 548q*3 - 546q*3 + 12798 - 49q*2. 2(q - 9)*2(q + 79) Let q(g) = g*3 - 13g*2 - 49g + 18. Suppose -72a + 1120 = -2a. Let p be q(a). Suppose -1/6n3 - 5/6 - 1/2n*p + 3/2n = 0. Calculate n. -5, 1 Solve 80 - 32/3s + 1/3s*2 = 0 for s. 12, 20 Let l = 4 - 1. Let r = -1766/17 - -3583/34. Factor 0k + 3/4k5 + 0k*4 - rk*2 - 9/4k*l + 0. 3k*2(k - 2)(k + 1)2/4 Let m = -163 - -166. Solve 20 - 8b*m + 3b*3 + 0b*3 - 2b*2 - 13b*2 = 0 for b. -2, 1 Let p(n) = -3n*5 - 171n*4 - 1569n*3 + 5627n*2 - 5928n + 2004. Let w(s) = -3s4 + s2 - 3. Let f(h) = p(h) - 8w(h). Let f(v) = 0. What is v? -26, 1 Let j = 713522 + -713518. Factor -3/5uj + 6/5u + 0 + 9/5u2 + 0u*3. -3u(u - 2)(u + 1)*2/5 Let z(x) be the third derivative of 13/6x*4 + 20x*3 - 1/15x*5 + 0 + 0x - 132x2. Let z(i) = 0. Calculate i. -2, 15 Let j(w) be the first derivative of w4/24 - 55w*3/9 + 261w*2 - 972w - 4615. Factor j(h). (h - 54)*2(h - 2)/6 Let u(w) = w*3 - 7w*2 + 57w - 177. Let i be u(4). Let x(f) be the first derivative of 5f2 - 5/3f*i - 1 - 5f. Solve x(o) = 0. 1 Let a(t) be the first derivative of -80/9t - 2/27t*3 - 67 - 22/9t*2. Factor a(n). -2(n + 2)(n + 20)/9 Suppose -2 = -u + o, o - 552 = 2u - 554. Solve 13/6m2 + 1/6m*4 + 4/3m*3 + u + m = 0. -6, -1, 0 Suppose -14j + 27 = -1. What is v in -5vj - 5v - 4v + 3v + 2v2 = 0? -2, 0 Factor 85443f - 632 + 9f2 - f2 - 82917f. 2(f + 316)(4f - 1) Let l(m) be the first derivative of -5m*4 - 5m*3/3 + 232. Factor l(g). -5g*2(4g + 1) Suppose -38 = -3f + 2z, 3f - f - 29 = 5z. Solve 16g - fg2 + 6g*4 + 9g*3 - 43g*3 + 12g*3 = 0. -1, 0, 2/3, 4 Suppose 2w - 16 = 5g - 0g, 0 = 6w - 48. Let d(m) be the second derivative of g + 1/20m*4 - 12/5m*2 - 35m - 1/5m3. Factor d(y). 3(y - 4)(y + 2)/5 Let u be (-15)/65 - (-11 + (-4168)/(-416)). Suppose -uv + 5/2 - 1/4v2 = 0. What is v? -5, 2 Let t(g) be the first derivative of -96g + 3/4g4 - 109 - 6g*2 + 8g*3. Factor t(l). 3(l - 2)(l + 2)(l + 8) Let l(x) be the third derivative of x*6/1260 + 2x5/105 + x4/12 - 22x3/3 - 2x*2 + 10x. Let b(k) be the first derivative of l(k). Factor b(h). 2(h + 1)(h + 7)/7 Let x(y) be the third derivative of -y*5/90 + 1162y*4/9 - 5400976y*3/9 + 4253y**2. Let x(p) = 0. Calculate p. 2324 Let a(f	{ "pile_set_name": "DM Mathematics" }
0600v wrt p. 36725676pv What is the first derivative of 6607x*4 + 78x*3 + 6101354 wrt x? 26428x*3 + 234x*2 Find the third derivative of -36332478r*3 - 15r*2 + 10r - 1904. -217994868 Find the second derivative of -318m2y*2 + 28150m*2 + 10my2 + 5469512y*2 wrt m. -636y*2 + 56300 What is the first derivative of -3z*3 + 25z*2 + 1051z - 5362365? -9z2 + 50z + 1051 Find the second derivative of 1165q4 + 24343q3 + q2 - 462604295q - 2 wrt q. 13980q*2 + 146058q + 2 Find the first derivative of 345978005z - 351454838 wrt z. 345978005 What is the third derivative of 7905115k*3n - 3k2 - 5k + 212059n wrt k? 47430690n What is the third derivative of 4737138k3 - 771759k*2 wrt k? 28422828 Find the third derivative of 84500881r*6 - 2r*3 + 296118820r*2 wrt r. 10140105720r*3 - 12 Differentiate -31198r*2 + 822r + 108331705 with respect to r. -62396r + 822 Find the third derivative of -30421340t*3 + 23228882t*2 wrt t. -182528040 Differentiate -120922n*2q + 33n2t - 6nq*3 + 52152q*3t with respect to t. 33n2 + 52152q3 Differentiate b2 + 257669432b + 414955906 wrt b. 2b + 257669432 Find the third derivative of 12938755l3s*6 - 3l*3s*2 + 2318l*3 - 4s wrt s. 1552650600l3s*3 What is the first derivative of 44143401iw2 + 17285246w*2 wrt i? 44143401w*2 What is the third derivative of -3l*5 - 121125632l*3 + 20686l*2 + 1855? -180l*2 - 726753792 Find the second derivative of -22811n*3 + 224n*2 + 7841543n wrt n. -136866n + 448 Find the second derivative of -79316107c*3 - 38626188c. -475896642c Find the third derivative of -31955321z*5 - 4z*4 + 8z*2 + 12982374z wrt z. -1917319260z2 - 96z What is the derivative of -158l2 + 542328l - 2603421? -316l + 542328 Differentiate -16303948v*3 - 6v*2 + 216594746 wrt v. -48911844v*2 - 12v Differentiate -3km*2 + 2km + 208178k + 8m2 + 2m - 38532 with respect to k. -3m2 + 2m + 208178 Find the second derivative of 691f3 - 4436f*2 - 9631737f. 4146f - 8872 Differentiate 12d*3n - 6d3 - 173dn3 + 1857d + 8n3 with respect to n. 12d*3 - 519dn2 + 24n*2 Find the second derivative of -6381491s*3t + 2s - 74605436t wrt s. -38288946st Find the third derivative of -88b6 + 39b5 + b3 - b*2 - 89b + 38670 wrt b. -10560b3 + 2340b*2 + 6 Differentiate -81m*3pu + 5547m*3p + 143m3x + 9px + 127943ux with respect to p. -81m3u + 5547m3 + 9x Find the first derivative of 26414059l + 13677927 wrt l. 26414059 Find the third derivative of 16401769g*5 + 184g*2 - 2282g wrt g. 984106140g2 What is the third derivative of 4052605j*3 - 15j*2 - 2j + 54104? 24315630 Find the second derivative of 1012dj*2n + 3djn - 4dj - dn*3 - 2dn2 + 330j*2n*3 - 2j*2n + 2jn*3 - 275n*3 wrt j. 2024dn + 660n*3 - 4n Find the third derivative of 6378f3s*2 - 505f*3 + 67f*2s*2 + 2f*2 - 507f + 8s wrt f. 38268s*2 - 3030 What is the third derivative of -179779399s*3 + 339908634s*2? -1078676394 Differentiate 27389495jox*3 - 1122077ox3 + 43 with respect to j. 27389495ox3 What is the third derivative of -4a*6 + 11807642a*4 - 12866694a*2? -480a*3 + 283383408a What is the third derivative of 4u6 + 23878299u*3 + 14u*2 + 3927596 wrt u? 480u*3 + 143269794 What is the first derivative of 41jn3 - 2jn2 - jn + 12018j - 1042n*3 - 1144n*2 + 41n wrt j? 41n3 - 2n*2 - n + 12018 Find the second derivative of -4p*4 + 4p*3 + 71814p*2 + 1453558p + 2. -48p2 + 24p + 143628 What is the derivative of -14142501d3 - 248362910? -42427503d*2 What is the third derivative of -10362064g*4 + 205g*2 + g + 47? -248689536g Differentiate -1447353506j2 - 1272071975 with respect to j. -2894707012j What is the second derivative of 42943257g4 + 4g + 1145399? 515319084g2 Find the third derivative of 627134k*5 + 275k*3 - 1042523397k*2. 37628040k*2 + 1650 Differentiate 424337124l + 276296095. 424337124 Differentiate 498372191c2 + 396139023 wrt c. 996744382c Find the second derivative of 128425f5 + 11f*4 + 36140754f wrt f. 2568500f3 + 132f*2 Find the third derivative of -20129198f*3 - 56612608f*2 wrt f. -120775188 What is the third derivative of 22s*2t*2y*2 - 14s*2ty3 + s2y*2 - 534847st3y*3 - 4sty + sy + 5t*3y*2 + 2t*2y - 952ty*2 wrt y? -84s*2t - 3209082st*3 Find the second derivative of 3i*4u + 52151i3u - 19i2u + 335657iu - 3u wrt i. 36i*2u + 312906iu - 38u Find the first derivative of -94534498a*2 - 106895797 wrt a. -189068996a What is the derivative of 5851679o - 432776? 5851679 Find the second derivative of 3346392v*3 - 3v*2 + 154485800v. 20078352v - 6 Find the second derivative of -3281329k*5 + 2k*3 + 2k*2 + 20737k - 1194 wrt k. -65626580k3 + 12k + 4 Find the third derivative of 92284b3w*2 + 160b*3 + 735b*2w2 + b2w - 2344bw2 wrt b. 553704w*2 + 960 What is the second derivative of -1326210q*2 + 2q + 577828? -2652420 What is the second derivative of -4r5 + 11612450r*2 + r + 1547244? -80r3 + 23224900 What is the first derivative of -s4 + 14453142s3 - 3s + 211456336? -4s3 + 43359426s*2 - 3 Find the second derivative of -2b*3s5 - b3s - 1252b*2s + 6b2 + 2b + 2143262s5 - 2s wrt s. -40b3s*3 + 42865240s*3 Find the third derivative of 328c*6 - 3c*5 - 9761c3 - c2 - 85661662c + 2 wrt c. 39360c*3 - 180c*2 - 58566 Differentiate 22859555w*2 + 46536608 wrt w. 45719110w What is the second derivative of -1710902g5iw - 3g*2w - 70gi + 2g + 4518iw - i wrt g? -34218040g*3iw - 6w What is the second derivative of -9358116b4 - 5429723b? -112297392b2 What is the first derivative of 5725or + 490087125o + 1020r wrt r? 5725o + 1020 Differentiate 3665888kv + 1360868v + 2 with respect to k. 3665888v Find the third derivative of 26p6 + 480485p*3 - 2792605p*2. 3120p*3 + 2882910 What is the first derivative of 519n*3z + 35370854n3 + 58716z wrt z? 519n3 + 58716 What is the first derivative of 2c*2 + 3720877c + 5337712 wrt c? 4c + 3720877 Differentiate 20512346hn2 + 505826h + 8 with respect to n. 41024692hn Find the third derivative of -2t4 - 12801691t*3 + 9879t*2 - 7528t. -48t - 76810146 What is the second derivative of 32132482h*3 - 6h*2 + 56779502h + 5 wrt h? 192794892h - 12 Find the second derivative of 13193710r*5 + 63051111r. 263874200r3 Differentiate 91315664n*2 + 18876479. 182631328n Find the third derivative of 4320124i3 + 20993573i*2 wrt i. 25920744 What is the second derivative of -17m*2w*3 + 119m*2w - 4211mw*3 + 2216w + 3 wrt w? -102m2w - 25266mw Find the first derivative of -4906cg*2t + cgt + cg - 136ct2 + 26812184g*2 wrt t. -4906cg2 + cg - 272ct What is the third derivative of 217568350n4 + 229437451n*2 wrt n? 5221640400n Find the third derivative of 121528i4 + 53i*3 + 11945480i*2 wrt i. 2916672i + 318 Find the second derivative of 88244036o2 - 434o - 18643. 176488072 Find the third derivative of 30kl*2u*3 - kl*2u*2 + kl*2u + 25ku - 87085l2u*5 - 43l*2u - 3u2 + 1 wrt u. 180kl2 - 5225100l*2u*2 What is the second derivative of -17222o*4 + 11794o*3 - 1503o - 2786? -206664o2 + 70764o Find the third derivative of -dk3n*3 + 3164425dk3n*2 + 3dk2n + 5dkn3 + 13047dkn2 + n2 + 2 wrt k. -6dn*3 + 18986550dn2 What is the second derivative of -548n*5 + 62369n*3 - 3n*2 + 2n - 144305036 wrt n? -10960n3 + 374214n - 6 Find the second derivative of -962943684t2 - 3860t + 102708 wrt t. -1925887368 What is the second derivative of -60413620j2 - 63942453j? -120827240 What is the derivative of 405334c4 - 26c*2z + 15163z + 1292 wrt c? 1621336c*3 - 52cz Find the second derivative of -52f*4 + 439434f*3 - 1302566f + 48 wrt f. -624f2 + 2636604f Find the third derivative of g*3x*2y + 2586875g3x2 + g3y - 5250g*2x*2y - 47490gx*	{ "pile_set_name": "DM Mathematics" }
What is the remainder when 120 is divided by 35? 15 What is the remainder when 57 is divided by 22? 13 What is the remainder when 240 is divided by 73? 21 Calculate the remainder when 395 is divided by 16. 11 Calculate the remainder when 6556 is divided by 7. 4 What is the remainder when 881 is divided by 9? 8 What is the remainder when 29 is divided by 16? 13 Calculate the remainder when 478 is divided by 40. 38 What is the remainder when 208 is divided by 14? 12 What is the remainder when 662 is divided by 170? 152 What is the remainder when 5092 is divided by 18? 16 What is the remainder when 1208 is divided by 38? 30 What is the remainder when 192 is divided by 28? 24 What is the remainder when 399 is divided by 82? 71 Calculate the remainder when 130 is divided by 112. 18 What is the remainder when 85 is divided by 26? 7 What is the remainder when 404 is divided by 37? 34 Calculate the remainder when 399 is divided by 10. 9 Calculate the remainder when 78 is divided by 41. 37 What is the remainder when 7207 is divided by 103? 100 Calculate the remainder when 282 is divided by 84. 30 Calculate the remainder when 1916 is divided by 274. 272 Calculate the remainder when 466 is divided by 59. 53 What is the remainder when 3928 is divided by 262? 260 What is the remainder when 1215 is divided by 32? 31 Calculate the remainder when 338 is divided by 85. 83 What is the remainder when 200 is divided by 156? 44 Calculate the remainder when 56 is divided by 47. 9 What is the remainder when 210 is divided by 72? 66 Calculate the remainder when 191 is divided by 64. 63 Calculate the remainder when 1416 is divided by 153. 39 What is the remainder when 206 is divided by 42? 38 What is the remainder when 6339 is divided by 45? 39 What is the remainder when 421 is divided by 128? 37 What is the remainder when 310 is divided by 26? 24 Calculate the remainder when 41 is divided by 17. 7 What is the remainder when 468 is divided by 128? 84 What is the remainder when 140 is divided by 82? 58 Calculate the remainder when 471 is divided by 376. 95 What is the remainder when 298 is divided by 15? 13 What is the remainder when 526 is divided by 260? 6 What is the remainder when 3934 is divided by 123? 121 What is the remainder when 2878 is divided by 16? 14 What is the remainder when 326 is divided by 8? 6 What is the remainder when 1121 is divided by 69? 17 Calculate the remainder when 404 is divided by 137. 130 What is the remainder when 256 is divided by 131? 125 What is the remainder when 153 is divided by 22? 21 What is the remainder when 35927 is divided by 29? 25 Calculate the remainder when 2023 is divided by 80. 23 What is the remainder when 907 is divided by 13? 10 What is the remainder when 1407 is divided by 128? 127 What is the remainder when 486 is divided by 26? 18 Calculate the remainder when 35 is divided by 12. 11 What is the remainder when 89 is divided by 23? 20 Calculate the remainder when 137 is divided by 46. 45 What is the remainder when 1402 is divided by 61? 60 Calculate the remainder when 1992 is divided by 27. 21 What is the remainder when 2000 is divided by 34? 28 Calculate the remainder when 1014 is divided by 33. 24 What is the remainder when 149 is divided by 15? 14 Calculate the remainder when 4319 is divided by 216. 215 What is the remainder when 124 is divided by 116? 8 What is the remainder when 1031 is divided by 117? 95 Calculate the remainder when 384 is divided by 11. 10 Calculate the remainder when 186 is divided by 17. 16 What is the remainder when 83 is divided by 8? 3 Calculate the remainder when 1251 is divided by 157. 152 What is the remainder when 359 is divided by 25? 9 What is the remainder when 186 is divided by 41? 22 Calculate the remainder when 507 is divided by 169. 0 What is the remainder when 196 is divided by 33? 31 Calculate the remainder when 12 is divided by 2. 0 What is the remainder when 762 is divided by 109? 108 What is the remainder when 83 is divided by 16? 3 Calculate the remainder when 374 is divided by 86. 30 What is the remainder when 1945 is divided by 11? 9 Calculate the remainder when 149 is divided by 33. 17 Calculate the remainder when 36 is divided by 10. 6 What is the remainder when 238 is divided by 27? 22 Calculate the remainder when 1911 is divided by 42. 21 Calculate the remainder when 142 is divided by 42. 16 What is the remainder when 627 is divided by 45? 42 Calculate the remainder when 782 is divided by 385. 12 What is the remainder when 1323 is divided by 656? 11 Calculate the remainder when 431 is divided by 190. 51 Calculate the remainder when 135 is divided by 68. 67 Calculate the remainder when 168 is divided by 43. 39 What is the remainder when 8695 is divided by 77? 71 Calculate the remainder when 104 is divided by 28. 20 Calculate the remainder when 670 is divided by 75. 70 Calculate the remainder when 87 is divided by 45. 42 What is the remainder when 3582 is divided by 128? 126 Calculate the remainder when 42 is divided by 4. 2 What is the remainder when 1194 is divided by 92? 90 What is the remainder when 154 is divided by 59? 36 Calculate the remainder when 2757 is divided by 120. 117 Calculate the remainder when 562 is divided by 47. 45 Calculate the remainder when 2499 is divided by 831. 6 Calculate the remainder when 88 is divided by 26. 10 Calculate the remainder when 141 is divided by 46. 3 Calculate the remainder when 1209 is divided by 22. 21 What is the remainder when 107 is divided by 18? 17 What is the remainder when 368 is divided by 342? 26 Calculate the remainder when 85 is divided by 13. 7 What is the remainder when 100 is divided by 28? 16 What is the remainder when 368 is divided by 34? 28 Calculate the remainder when 786 is divided by 59. 19 What is the remainder when 56 is divided by 47? 9 Calculate the remainder when 464 is divided by 43. 34 Calculate the remainder when 77 is divided by 29. 19 Calculate the remainder when 470 is divided by 90. 20 Calculate the remainder when 837 is divided by 12. 9 What is the remainder when 9 is divided by 6? 3 Calculate the remainder when 83 is divided by 17. 15 What is the remainder when 6 is divided by 3? 0 What is the remainder when 999 is divided by 77? 75 What is the remainder when 34 is divided by 2? 0 What is the remainder when 239 is divided by 169? 70 What is the remainder when 80 is divided by 33? 14 Calculate the remainder when 118 is divided by 15. 13 Calculate the remainder when 47 is divided by 11. 3 Calculate the remainder when 212 is divided by 101. 10 Calculate the remainder when 673 is divided by 70. 43 What is the remainder when 136 is divided by 27? 1 Calculate the remainder when 25786 is divided by 5. 1 Calculate the remainder when 526 is divided by 48. 46 What is the remainder when 538 is divided by 23? 9 Calculate the remainder when 258 is divided by 22. 16 Calculate the remainder when 599 is divided by 12. 11 Calculate the remainder when 772 is divided by 31. 28 Calculate the remainder when 387 is divided by 34. 13 What is the remainder when 141 is divided by 43? 12 Calculate the remainder when 44 is divided by 7. 2 Calculate the remainder when 749 is divided by 247. 8 What is the remainder when 1715 is divided by 172? 167 Calculate the remainder when 37 is divided by 30. 7 Calculate the remainder when 1550 is divided by 32. 14 Calculate the remainder when 3065 is divided by 510. 5 What is the remainder when 148 is divided by 33? 16 Calculate the remainder when 45 is divided by 6. 3 What is the remainder when 691 is divided by 152? 83 What is the remainder when 14739 is divided by 97? 92 What is the remainder when 69 is divided by 35? 34 What is the remainder when 60 is divided by 45? 15 What is the remainder when 2119 is divided by 265? 264 Calculate the remainder when 2085 is divided by 1034. 17 Calculate the remainder when 6509 is divided by 14. 13 Calculate the remainder when 1026 is divided by 117. 90 What is the remainder when 4605 is divided by 9? 6 What is the remainder when 41 is divided by 37? 4 Calculate the remainder when 39 is divided by 21. 18 Calculate the remainder when 14021 is divided by 51. 47 Calculate the remainder when 906 is divided by 192. 138 Calculate the rem	{ "pile_set_name": "DM Mathematics" }
q = -6 + i. Suppose qg - 60 = -g. List the prime factors of g. 2, 3 Suppose 6x - 78 = 18. Suppose s = -s + x. What are the prime factors of s? 2 Suppose 4o - 8o - 120 = 0. Let q = -3 - o. List the prime factors of q. 3 Suppose -s - 2 = -9. List the prime factors of s. 7 Suppose 0 = 2j + 5m - 450, 2m = 4j + 3m - 918. Suppose 0 = -5q + 3l + j, -230 = -5q - l - l. What are the prime factors of q? 2, 23 Let h(p) = 2p - 3. Let v be h(4). Suppose -6b + 15 = -b. Suppose bt + v = 4t. What are the prime factors of t? 5 Let b = 17 - 10. Suppose -3q = b + 11. Let v = q - -11. What are the prime factors of v? 5 Suppose -6q + 13 = -4q - f, -1 = q + f. List the prime factors of q. 2 Let n(f) = f2 - 5f + 7. Let g be 11/(-3)-15. What are the prime factors of n(g)? 7 Let u = 3 - 3. Let p be 0 + 5 + (-1 - u). Suppose 5v = pv + 12. What are the prime factors of v? 2, 3 Suppose 0 = 5j - 2x - 10, 4x = 4j - 7 - 13. Let m be 6/(8/4)1. Let f = j + m. List the prime factors of f. 3 Let c(i) = i3 - 6i*2 - 1. Let o be c(6). Let j be o + 0 + 0 + 3. Suppose p = jp - 6. What are the prime factors of p? 2, 3 Let r = 26 + 3. List the prime factors of r. 29 Suppose 4b = 5c - 2, 0 = -0b + 3b + c - 8. Suppose ba - 2 = 4. What are the prime factors of a? 3 Let l = 42 - 30. Let r be l - (2 - 2) - 0. Suppose 4a - r = 0, 0q - 2q + 4a = 6. What are the prime factors of q? 3 What are the prime factors of 0 - -1 - 612/(-12)? 2, 13 Suppose -5m = -3m. Suppose m = -4v + 5o + 180, v + 8o = 5o + 28. What are the prime factors of v? 2, 5 Suppose 5o - 133 = -0p + 2p, 4o - 105 = 3p. Suppose -4s - 23 = 2q + q, 0 = -5s - 2q - o. Let h = s - -12. List the prime factors of h. 7 Suppose 0o = 4o - 84. Let w = o + -3. What are the prime factors of w? 2, 3 Let q = -4 - -6. Suppose 1 = qu - 5k, -u - u + 22 = 2k. List the prime factors of u. 2 Suppose 3k = -11 + 26. Suppose 0 = -x - 2l - 2, -kx + 7 = 5l + 2. What are the prime factors of x? 2 Suppose -488 + 124 = -4z. List the prime factors of z. 7, 13 Suppose -r + 2k + 9 = 0, -2r - 5k + 38 = r. Let j = r - 8. Suppose 0m = jv - 4m - 52, -4v = -m - 52. What are the prime factors of v? 2, 3 Let x(i) be the second derivative of i3/6 + 5i*2/2 - i. Let u be x(-5). Suppose 4a + 0a - 36 = u. What are the prime factors of a? 3 Let b be (-4)/(-18) - (-50)/18. Suppose 2l - 12 + b = -3z, -4z = 4l - 24. What are the prime factors of 8/(-36) + 47/l? 5 Suppose 5b + 3i = 21 - 7, 5i + 26 = 4b. Suppose 3f - 14 + 5 = 0. Suppose 2w - 9 = 2o - 33, b = 2o + fw. What are the prime factors of o? 2 Suppose 3b + 32 = b. Let z be 4/(b/6)-32. Suppose -3j + 5j - 57 = -5h, -4h + z = 4j. What are the prime factors of h? 11 Suppose 25 = 5h - 5t, -3h - t + 6 = -5. Suppose -3l + 44 = -5l - 4n, -hl + 5n - 127 = 0. Let a = 50 + l. What are the prime factors of a? 2, 11 Let g(u) = u2 + 11u - 32. List the prime factors of g(10). 2, 89 Let y(r) = 2r2 - 7r - 8. Let a be y(6). Suppose 20 = 3s - u, 2u = -2s + 7u + a. Let t = 10 - s. List the prime factors of t. 2 Suppose 2t + 350 = 9t. What are the prime factors of t? 2, 5 Suppose -4o - f = -3o - 45, -5f = 5. List the prime factors of o. 2, 23 Let r(s) = -10s + 54. List the prime factors of r(4). 2, 7 Let v = 28 - -42. List the prime factors of v. 2, 5, 7 Let d = -13 + 9. Let a be d/(-3)(-9)/(-6). Suppose ao + 2p - 32 = 0, -2p + 28 + 26 = 4o. What are the prime factors of o? 11 Suppose -2s - 6n + 4n = -12, s = -4n + 15. Let g(c) = -sc + 7 + 4 - 3 + 2c. What are the prime factors of g(-8)? 2 Suppose 20 = 2v + 3v. List the prime factors of v. 2 Suppose 0 = 10z + 264 - 1264. List the prime factors of z. 2, 5 Let h(m) = -2m3 + 5m*2 + 7m - 7. List the prime factors of h(-5). 3, 37 Suppose 4f - 6 = 10. Suppose 3t = 2c - fc + 93, 5c + 5t - 220 = 0. List the prime factors of c. 3, 13 Suppose 2g - 6 = 2. Suppose -3f + 49 = -gk, f + 0k - 43 = -4k. Let u = 38 - f. List the prime factors of u. 3, 5 Suppose 6y - 4y = -56. Let m = 39 + y. Let g = -5 + m. What are the prime factors of g? 2, 3 Let f = -5 - -6. What are the prime factors of (f - 0)-1 + 14? 13 Let n be 26 + (1 - (0 - -3)). What are the prime factors of 149/4 - 6/n? 37 Let x = 4 - 4. Suppose 3w - 2c + 7c - 17 = 0, 5w + 5c - 25 = x. Suppose -2v = -wv + 16. What are the prime factors of v? 2 Let k(a) = -2a*3 - a. Let m = -3 + 1. What are the prime factors of k(m)? 2, 3 Let p be (-22)/2(5 + -7). Suppose 0 = 2g - 4a - 4, -g - 5a + p = g. List the prime factors of 100/6 + g/18. 17 Let t = 15 - 11. Suppose -2g - ty + 3y = -17, 0 = -4g - 5y + 49. What are the prime factors of (4/g)/(6/45)? 5 Let t(b) = 7 + 2 + 2b2 - 10b - 2b2 + 2b*2. What are the prime factors of t(6)? 3, 7 Let d(l) = 0 + 4l - 3 + 2l3 - l + 1. What are the prime factors of d(2)? 2, 5 Let j = 13 - 8. Let d = j - 2. What are the prime factors of d? 3 Suppose 5f + 145 = 15. Let g(j) = j*2 + j + 8. Let b be g(-6). Let p = b + f. List the prime factors of p. 2, 3 Suppose -4r + a = -0r - 88, 3r - 2a - 71 = 0. Let i be (-1)/(-7) + (-108)/r. List the prime factors of (-8)/(-40) - 84/i. 17 Let i be (3 - -5)-1-13. Suppose 5g = i - 9. What are the prime factors of g? 19 Let w(p) = 13p - 1. Let x be w(1). Suppose -4i - x - 24 = 0. What are the prime factors of (-11)/(-3) + (-3)/i? 2 Let d(h) = -h3 - h2 + 4h + 1. List the prime factors of d(-3). 7 What are the prime factors of (50/8)/((-6)/(-24))? 5 Suppose 5a = 0, 3o - o + 5a = -12. List the prime factors of (2 - (-82)/o)-3. 5, 7 List the prime factors of (-1 - 4)(-79)/5. 79 Let d = 3 - -12. Suppose 0n + d = 3n. List the prime factors of n. 5 Suppose 0 = -2n - 3j - 4, 3n = 4n - 5j - 24. Suppose 2b + 0b = -nh + 90, 0 = h + 3b - 20. List the prime factors of h. 23 Suppose -6u + 9u = 0. Suppose 3a + ua = -t + 79, 0 = 4t + 20. List the prime factors of a. 2, 7 Suppose -4f - 3l + 606 = 0, -f - 3l = -0l - 156. List the prime factors of f. 2, 3, 5 Let k(u) = -u*2 - u - 1. Let a(v) = -8v*2 - 2v - 7. Let n(h) = -a(h) + 6k(h). Let c = 5 + -2. What are the prime factors of n(c)? 7 Let v(u) = 1. Suppose -4j - 2 = -10. Let c(y) = -y - 8. Let n(w) = jv(w) - c(w). What are the prime factors of n(0)? 2, 5 Let j(l) = 3l*3 - 3l*2 + 4l - 3. Let x be j(2). Suppose -3g - x + 59 = 0. List the prime factors of g. 2, 7 Let i = 14 + 12. List the prime factors of i. 2, 13 Let k be (-222)/((-12)/18). List the prime factors of (-12)/k + 732/33. 2, 11 Let g(p) = -2 - 6 + 3 + 4 + p*2. Let d = 2 - 4. What are the prime factors of g(d)? 3 Suppose -4d + 15 = -5. Suppose -dh + 69 = -1. What are the prime factors of h? 2, 7 Suppose -12 = -5n - 4y, 0n + 2n + 15 = 5y. Let v = 3 - n. Suppose -g = 2t, 5t + 33 = vg - 0t. List the prime factors of g. 2, 3 What are the prime factors of 6/(54/90)? 3 Let k be 1/3 - 10/3. Let z(r) = -4r + r*2 + 2 - 3r + 8r. List the prime factors of z(k). 2 Suppose -12 = -p - 6. List the prime factors of ((-5)/(-3) + 3)p. 2, 7 Suppose 114 - 90 = 2a. List the prime factors of a. 2, 3 Suppose 46 = 4v + 14. List the prime factors of v. 2 Let x = 7 - 0. Suppose 2f = xf. Suppose f = -2l + 8 + 14. What are the prime factors of l? 11 Let m be (-30)/(-135) + (-1346)/(-18). Suppose 0 = 5x + 5y - m, -3x - 2x + 75 = -y. List the prime factors of x. 3, 5 Suppose 0 = 4x + 1 - 29. Let t = x + -9. Let r(o) = 4o2 + 2o + 1. What are the prime factors of r(t)? 13 Let p(d) = 96d + 1. What are the prime factors of p(1)? 97 Let h(i) be the first derivative of i2 + 12i - 5. List the prime factors of h(6). 2, 3 Suppose 2k - 32 = 148. Suppose 0 = -2o - 2b + 2 - 16, -o + 4b + 13 = 0. List the prime factors of ((-1)/o)/(3/k). 2, 5 Suppose b = 5b. Let w = 2 - b. List the prime factors of w. 2 Let c = 8 - 5. Suppose 0z - 5z - ct = -23, 4z - t = 15. List the prime factors of z. 2 Let l(d) = -5d - 2. What are the prime factors of l(-3)? 13 Let b = 9 - 6. Suppose -4c + 16 = 0, -bv + c + c + 10 = 0. Let m = 11 - v. What are the prime factors of m? 5 Let q be 0/(-7)(-1)/1. Let s be (q - 0 - -3) + -1. Suppose -5 + 23 = sx. What are the prime f	{ "pile_set_name": "DM Mathematics" }
o 0.1? (a) 1 (b) -3 (c) 13 (d) -146/5 (e) 2 a What is the nearest to 2/9 in 8/11, -2/9, -12, 0, -6? 0 What is the closest to -2 in -1, 1187, 2? -1 What is the closest to 2/5 in 1/11, 100, 0.3, -4/7? 0.3 Which is the nearest to -0.06? (a) 23 (b) 8 (c) -2/3 (d) -0.03 d What is the closest to -1 in 1, -2, -323, 0.5, 6/19? -2 What is the closest to 0.22 in 0, -0.5, 5, -2/9, 73? 0 Which is the closest to 2/11? (a) -0.57 (b) 0.197 (c) -0.1 b Which is the closest to -0.1054? (a) 0.5 (b) -2/5 (c) 261 b Which is the nearest to 1? (a) 18 (b) -2 (c) 4/7 (d) -10 (e) 0 c What is the nearest to 11 in -0.3, 2.5, 2, 45/4? 45/4 Which is the nearest to 243? (a) -0.19 (b) -1 (c) 0.2 c What is the nearest to -2 in -3, -119, 1, 76, -2? -2 What is the nearest to 11 in -2, -11, 0.23? 0.23 What is the closest to -2/329 in 3/11, 0.4, -0.3, -4, 1? 3/11 Which is the nearest to 0.1? (a) 5 (b) 0.15 (c) -511 (d) -0.2 b Which is the closest to 9/40? (a) 2 (b) -0.3 (c) 1/3 (d) 4 (e) 0 c What is the nearest to -0.1 in 3/8, 0.2, 0, 2.19? 0 What is the nearest to -51.1 in 7, -4/5, 2/9, -1? -1 Which is the nearest to 7/10? (a) -0.1 (b) -40 (c) 5 (d) -1/3 a What is the nearest to -2/23 in 0.324, -2/9, -17, -0.5? -2/9 What is the nearest to 0 in 510, 5, 0.4, -2/3? 0.4 Which is the nearest to -47? (a) 35 (b) -2 (c) -0.3 b What is the nearest to 0 in -3, -76/7, 6/19, 2/5? 6/19 What is the nearest to 3 in -3, -4, 195, 4? 4 What is the nearest to -24 in 2/7, -0.14, 8? -0.14 Which is the nearest to -1/5? (a) -4 (b) -3 (c) -8629 (d) -1 d What is the closest to -0.1 in -0.3, 1, 2/49, -160? 2/49 What is the closest to 3/8 in 3, 16/13, -1/16? -1/16 What is the nearest to -0.1 in -262/23, 3, 0.4, -4, -1/12? -1/12 Which is the nearest to 0.2? (a) 3 (b) -52 (c) 8 (d) 2 (e) 1/4 e What is the closest to 0.2 in -1/3, 0.9, 2/5, -101, 1/4? 1/4 What is the nearest to 1/5 in -2, -5/4, -6563? -5/4 Which is the nearest to 2/5? (a) -0.2 (b) 16.93 (c) -238 a What is the nearest to -1/10 in -137, -0.2, 0.04, 0.03, -1/6? -1/6 What is the nearest to -14 in 48, -1/4, -0.041, 4? -1/4 Which is the closest to 4? (a) 0.2 (b) 2/5 (c) 23 (d) 2 d Which is the closest to 16? (a) 3/4 (b) 1384 (c) 5/6 c What is the closest to 90 in 4, -1/4, -21, -2? 4 Which is the nearest to 3/5? (a) -7 (b) 72 (c) -2.7 c What is the closest to 1/4 in 25/48, -0.3, 32? 25/48 Which is the closest to -0.18? (a) -5 (b) 2/9 (c) -0.16 c What is the nearest to -9/5 in -911, -5, -4? -4 What is the nearest to 4 in -1, 2.3, 0.4, 358? 2.3 What is the closest to -5/3 in -0.4, -343, -11/5, -1? -11/5 What is the nearest to 293 in 16, 0, -1? 16 What is the closest to -1/4 in 11, -4/3, -0.73, -3? -0.73 Which is the nearest to 0.2? (a) -4/7 (b) -118 (c) 1 (d) -15 a Which is the closest to -15? (a) 74 (b) 4 (c) 2 (d) 10 c What is the nearest to 2/3 in 0.5, 6, 278/13? 0.5 What is the nearest to -0.05 in 0.5, 4, 8, 4/7? 0.5 Which is the closest to 1/4? (a) -17 (b) 2/13 (c) 1/7 (d) -5 b What is the closest to -33 in 6/7, 2/5, -5, -1, 1056? -5 What is the nearest to -24 in -44, 0, 0.2, 1? -44 Which is the closest to 2? (a) -2/7 (b) -2113 (c) -0.1 (d) -0.05 (e) -2 d Which is the closest to -3? (a) 1/7 (b) 2.266 (c) 2/7 a Which is the closest to -3/236? (a) 1/5 (b) 0.3 (c) 0 (d) -1 c Which is the nearest to -232? (a) -8 (b) 0.5 (c) -0.2 a What is the nearest to -62 in -0.1, -4, 0.17, 7, 5? -4 What is the nearest to -0.06 in -1, 58, 2, -353, -2? -1 Which is the nearest to 32? (a) 7.87 (b) 1/4 (c) -0.5 (d) -3 (e) 1/2 a Which is the closest to 9? (a) -1/2 (b) -10 (c) 0.3 (d) -11/5 (e) 1 e Which is the nearest to -1? (a) 12 (b) 2/7 (c) -3/5 (d) -9/10 d Which is the closest to 469? (a) 136 (b) 1/3 (c) 0.4 a What is the closest to -20/13 in -0.21, -1, 5? -1 What is the nearest to 0 in -1, -2/71, -4, -59/5? -2/71 What is the closest to 5 in 3, 3/11, 0.3, 2/35? 3 Which is the closest to 2/11119? (a) 3 (b) 4 (c) 1/10 c What is the closest to -2/49 in 1, 0, 11, -32/5? 0 What is the nearest to 227 in 1/25, 5, -2/7, 0.3, -0.3? 5 Which is the nearest to -99? (a) 2/7 (b) 4 (c) 12 (d) 2 a What is the closest to -2/5 in -8/3, -46/7, -2/9, -2? -2/9 Which is the closest to 1? (a) -2 (b) 1 (c) -33 (d) 3 b Which is the nearest to 1.567? (a) 7 (b) -0.5 (c) -0.4 (d) 0.1 d Which is the nearest to 0.1? (a) -3 (b) 1/13 (c) 0.2 (d) 43 b Which is the nearest to 3/4? (a) 0.5 (b) 2/11 (c) -3/8 (d) -3 (e) -0.0842 a What is the closest to 1 in -3, -4, 0, 90.15? 0 Which is the nearest to -3/16? (a) -0.2 (b) 2 (c) -0.3 (d) 94 (e) -2/17 a Which is the nearest to 0.3? (a) -1/4 (b) 1 (c) 2 (d) -3/7 (e) -20 a Which is the nearest to -2/9? (a) 0.2 (b) -0.02 (c) -5 (d) -1 b What is the nearest to 2 in -1.7, -168, 2/9, -0.3? 2/9 What is the nearest to -28 in 3/115, -2, 2/7, -2/9? -2 Which is the closest to 2? (a) 2/925 (b) 0.5 (c) -0.7 b What is the nearest to 213641 in 2/9, -2/13, 4? 4 What is the closest to 1/2 in -140, 203, -2/17? -2/17 Which is the nearest to -1/1089? (a) -0.1 (b) -0.4 (c) 2 a What is the closest to -114 in 3/5, -2/7, 379? -2/7 What is the nearest to 1 in 1.36, 8, 2/3, -0.1? 2/3 What is the nearest to -1/5 in -1/3, 2, 3, -0.11, 0? -0.11 What is the nearest to 1/3 in 1/9, 2, 5958, 2/7? 2/7 What is the closest to -19 in 4/9, 200, 5/3, -5? -5 What is the closest to 0 in 1, 0.2, 78/67? 0.2 What is the closest to -1 in 2/3, -8, -2/3, -525? -2/3 What is the nearest to -0.3 in 1/9, -23, -1/2, -8? -1/2 Which is the closest to 2? (a) -0.5 (b) 0.021 (c) -5 (d) -46 b Which is the nearest to -1? (a) -1 (b) 42/13 (c) 3 (d) 83/4 a What is the closest to -0.3 in -57, -3, 0.5, 546? 0.5 What is the nearest to 0.2 in 1/8, -0.1, 1.628, -0.5? 1/8 What is the closest to 8 in 4, -32, -0.4, 2, 7? 7 Which is the closest to 2? (a) -5 (b) -178 (c) -0.11 (d) 0.5 (e) -1/2 d Which is the nearest to 0.1? (a) -1 (b) -733 (c) 2 a What is the closest to -0.1 in -2/3, -1/68, -12, 3? -1/68 What is the nearest to -27858 in -3, -0.1, -4? -4 Which is the closest to 6? (a) -3 (b) -19 (c) -5 (d) 0 (e) 3 e What is the nearest to -2053 in -0.12, -1/3, 2/5? -1/3 What is the closest to -4 in -23, 0.1, -72, -5, -2/7? -5 What is the nearest to 10/7 in -0.08, -2/15, 1, 5? 1 What is the closest to 1 in -3/7, 4, -0.04, 859, 0.4? 0.4 What is the closest to -0.5 in 5, -30, 20? 5 What is the closest to -1/4 in -0.4, 3/13, 0.03, 2/13, 117? -0.4 What is the nearest to 2/7 in 1, -2.1, -2.03? 1 What is the nearest to 0.07 in -0.34, 3.33, 2/9? 2/9 What is the closest to -2 in -985, -3, -13, 0? -3 Which is the closest to -0.1? (a) -12 (b) 3 (c) -15 (d) 0 (e) -7 d What is the closest to 0.7 in -1.19, 0, -10? 0 Which is the nearest to 3? (a) -0.5 (b) -24 (c) 4/5 (d) -1077 (e) 4 e What is the closest to 8 in -2, 0.1, -5, -1? 0.1 Which is the nearest to -132.4? (a) 3/11 (b) -2/13 (c) 1 (d) 3 b Which is the nearest to -0.19? (a) -1/2 (b) 3 (c) 0.2 (d) 0.3 (e) -1 a Which is the nearest to 1? (a) 5/11 (b) -1.3 (c) 0.4 (d) 0.6 d Which is the nearest to 2? (a) -5 (b) 1 (c) 23 (d) 1/6 b Which is the nearest to -6? (a) 2177 (b) 1/14 (c) -1/4 c Which is the closest to -0.06? (a) -0.178 (b) -0.6 (c) -3 a Which is the nearest to -1/4? (a) -1/5 (b) 2619 (c) -1 (d) 0.44 (e) 0 a What is the nearest to 24/5 in 5, -6, 0.2? 5 Which is the nearest to -3? (a) -8035 (b) -5/4 (c) 0 (d) -2/9 (e) -0.07 b Which is the closest to 0.09? (a) 1/83 (b) 4 (c) -3 (d) 2/11 (e) -6 a Which is the closest to 0.1? (a) 3 (b) -1.4 (c) 42.7 (d) 1 d Which is the nearest to -1/16? (a) -4/3 (b) -4 (c) 4/3 (d) 0.1 (e) 2/3 d What is the closest to 1/2 in 4, -1, 3, 0.3, 931? 0.3 Which is the nearest to 0.1? (a) -6 (b) 8 (c) -6/11 (d) -157 (e) -0.3 e Which is the nearest to 34612? (a) 2 (b) -4 (c) -5 (d) 4 d What is the nearest to 1 in -2, -1962, -2/7? -2/7 Which is the closest to -73.6? (a) -3/10 (b) -2/9 (c) -3/4 c What is the closest to 4/9 in -1, 1/27, 1/4, -142? 1/4 Which is the nearest to 11? (a) 0.4 (b) -2 (c) -0.5 (d) 26 a Which is the closest to 0.7? (a) 346 (b) 5 (c) 1 c What is the nearest to -1 in -0.5, -7/4, 0.2, 2, 5?	{ "pile_set_name": "DM Mathematics" }
. Let s = i + 51. Is (-3)/(((-36)/(-1228))/s) a prime number? True Let c = -73 - -372. Suppose -v - s + 108 = 0, -5s = -v - 2v + 300. Let x = c - v. Is x a prime number? False Suppose -13 = -3m - m + b, -2m - 5b = -1. Let p be m18 - (21 - 20). Suppose 0 = 52g - pg + 211. Is g prime? True Let l be (-314)/(-13) - 54/130. Suppose -9j = -lj + 36285. Is j a composite number? True Let o(d) = 1935d - 7. Suppose 0 = 5p + 2 - 12. Is o(p) a prime number? True Suppose -2p = -4c - 6, -3p = -c - 13 + 4. Suppose 3j + pj + 48 = 0. Is (3 + -4 - -7)/(j/(-268)) a prime number? False Suppose 54a = -9a + 378. Let g(t) = 498t2 - 1. Let n be g(-1). Suppose -b + n = a. Is b a composite number? False Let o = 437 + -177. Suppose -266w + 42474 = -ow. Is w a prime number? True Is ((-144561)/(-6) - 2/4) + 4 prime? True Suppose 2h - 381026 = 22g - 25g, -3h = -g - 571517. Is h prime? True Suppose 0 = -6o - 3o + 361206. Suppose 5i = -5s - 0i + 40110, 0 = -5s + i + o. Let b = s + -4779. Is b composite? True Suppose 0w + 6 = 3w. Is 6 - (-3244 + (w - 3)) prime? True Suppose a + 7d = 3d - 3252, 6486 = -2a + d. Let v = a - -7205. Is v prime? False Let s(b) = 29b2 - 3b + 1541. Is s(-41) a composite number? True Let s be 232171/6 + 6. Suppose -s = -4k + 314. Is k a prime number? True Let u(j) be the third derivative of 7j5/60 + 19j4/12 - j3/6 + 18j2. Let a(d) = d3 + d - 18. Let w be a(0). Is u(w) prime? True Is (-1241650)/(-7) - (351/63 + -6) a composite number? False Is 336437/(7 - (-15)/(-4)120/75) a prime number? True Suppose -2f - f = q, 3f = 4q. Suppose qj = j - 3013. Is j a composite number? True Suppose 7630998 = 7t + 1783513. Is t a composite number? True Let n(p) = -14462p - 9165. Is n(-8) a prime number? True Let s(b) = -73b + 10. Suppose 0 = -4p + 8, 5p - 12 + 2 = 2i. Suppose z - 3 = i, 3d - 3z + 7 = -23. Is s(d) a composite number? False Let s be (-359976)/20 - 2/10. Let t = -6410 - s. Is t prime? False Suppose -3q + 5k + 66 = 15, 0 = 3q + 5k - 51. Is (q/((-459)/185202))/(2/(-3)) prime? True Let f(r) = r*2 - 12r - 62. Let b be f(16). Is (249/b)/(((-483)/70)/(-23)) a prime number? False Let x(p) = 1285p2 - 108p - 15. Is x(-8) composite? False Suppose 7463 + 4681 = 2u. Let p = u - -265. Is p a composite number? False Suppose -4a + 5t + 1940589 = 0, 0a + 4t + 1940584 = 4a. Is a a prime number? False Let b(s) = 3s2 - 91s + 535. Is b(49) a composite number? True Let j(s) = 7s2 - 2. Let o(z) = -5z*2 - 3z. Let m(x) = -j(x) - 2o(x). Let i(a) = a3 + 5a*2 + 3. Let r be i(-5). Is m(r) a prime number? True Suppose 415064 = 45v + 59v. Is v prime? False Let p = 33793 - 8136. Let k = -13728 + p. Is k prime? False Let a(q) = -18q*3 - 24q*2 - q - 1. Let r be a(8). Let t = -4280 - r. Is t a composite number? False Suppose 5l = -3r - 8, -l = -3r - 3l - 14. Is r/(-39) + (-145299)/(-13) a composite number? False Suppose -120h - 112h + 36442758 = 26h. Is h prime? False Suppose 140m - 2280046 = 2165094. Is m prime? True Is 1673982/21 - ((-108)/(-21))/(-9) - -5 composite? True Let n(x) = 37x*2 - 36x - 15. Let v(h) = -9h2 + 9h + 4. Let l(s) = -2n(s) - 9v(s). Is l(-5) a prime number? False Let r(w) = -w*3 - 6w*2 + 12w - 8. Let d be r(-8). Let l = d - 21. Is l a composite number? False Let v(c) = -50c3 + 3c*2 + 1. Let l be v(3). Let b be (-8)/2 - 205(-3 - -2). Let f = b - l. Is f a prime number? True Let b = -146 - -150. Suppose 0 = 5h + 3u - 8545, -3h + bu = -1625 - 3502. Is h composite? False Let r(w) = 461w + 1620. Is r(79) a prime number? True Let j(v) = 4v + 68. Let t be j(15). Is (622/3)/(t/2112) a prime number? False Suppose 7r - 16 - 12 = 0. Suppose r - 46 = -6i. Suppose -436 = iy - 2585. Is y a prime number? True Let b be 242 - (4/12 - (-42)/(-18)). Suppose 0v = v - 5t - b, -5v - 2t = -1301. Is v composite? True Suppose -2101788 - 795626 = -32h + 6h. Is h a prime number? True Let q(x) = -10x*3 - 2x*2 - 4x + 4. Let t be q(9). Let a = -4233 - t. Is a a composite number? False Suppose -3g + 366366 + 489672 = 3g. Is g prime? True Is (-8710796)/(-28) - ((-234)/(-126) + -1) a prime number? True Let q = 780 - 427. Is q(5 + -2)(2 - 1) prime? False Let o(c) = -11c + 9587. Suppose -q - 2 = -5b, -4b + 7q - 4q + 6 = 0. Is o(b) a prime number? True Let k(i) = 2i - 6. Let c be k(4). Suppose 2w - 3478 = -2v, 5w - cv + 5078 = 13745. Is w a prime number? False Suppose -8y + 10y + 6 = 0. Let i be (793/y - -4)/((-1)/3). Suppose 0r + i = r. Is r a composite number? True Let u(y) = 7 - 5y + 5y + 24 - 10y. Let g be u(-4). Is g - (-9)/36/(-9) composite? True Suppose -8y + 76 = 11y. Is 28/y + -9 + 2787 a composite number? True Suppose -3c + 4q + 244 = c, -2c + 5q = -107. Let g = -566 + c. Let m = g + 879. Is m a prime number? True Suppose p - 15 = 5w, 0w + 3w + 27 = -3p. Let t be (2/(-8))/((11/w)/(-11)). Is (-579)/(-3) + -1 + (t - 0) prime? True Is (((-1639270)/(-50))/((-2)/10))/(-1) a prime number? True Let g = 68 - 66. Suppose 5r = -4u + 2769, 4u + 842 + 288 = gr. Is r a composite number? False Let a(m) be the second derivative of -m4/6 + 7m*3/3 - 5m*2/2 - 9m. Let o be a(9). Is -2 + 1 + (-1 - o) a composite number? True Let u(t) = -6t + 5 + 3t - 36. Let x be u(-11). Suppose -4z = -h + xh - 459, 4h - 2z - 1926 = 0. Is h prime? True Let c(b) = b*3 + 12b*2 + 11b + 7. Let k(d) = d*2 + d - 1. Let n(z) = -c(z) - 3k(z). Let v be n(-14). Is 2/(v + (-4)/(-8818) + 4) a prime number? True Let g = -55 + 55. Suppose n + g + 4 = 0. Is 10 + n + 122 + 2/(-2) a prime number? True Let h(q) = 24q3 - 4q*2 + 25q - 20. Is h(9) a prime number? True Let t = -14 + 17. Let d(r) = -27 - r - r*2 - 6r*t + 5r*3 + 1178. Is d(0) prime? True Let v(i) = -155i*3 - 50i*2 - 193i - 1. Is v(-6) prime? False Let k = 366 + -363. Suppose 32m - 4927 = -z + 30m, -14821 = -kz + 2m. Is z a composite number? False Suppose 3d = -5p + 5633, -3d + 1623 + 632 = 2p. Let i = p + -791. Is i prime? False Is 657032/(-10)1505/(-172) a prime number? False Suppose -2m + 11 = -5. Suppose -2x = -m + 4. Is (((-6)/9)/(x/1623))/(-1) a prime number? True Suppose -13y + 325891 + 165119 = 0. Suppose 5m = -5q + y, -7556 = 3q - 4q + m. Is q prime? False Suppose -172 = 17f - 155. Is (1/(-1))/(f/16671) - 0 a composite number? True Let j = 23072 + -19413. Is j a composite number? False Let x = -2935 + 4522. Let p = 13389 + -13387. Is 6/6(x + p) a prime number? False Let h = 39238 + -17245. Is h a composite number? True Let i(u) be the third derivative of -u6/60 + u5/60 - u*4 - 7u*3/3 - 118u*2. Is i(-13) composite? False Suppose -4c - 148 - 134 = p, -5p - c = 1334. Let b = 53 - p. Is -1(-4 - -6) + b prime? True Is -4049(-2 - (-6 - -11)) a prime number? False Suppose 1065092 + 343089 = 60o - 1818199. Is o prime? True Let w(t) = -305981t - 363. Is w(-1) composite? True Let n = -4855 - -7507. Suppose 0 = 2m - 3472 + 510. Let x = n - m. Is x a composite number? False Suppose f = 2t - 4, -f - 4f - 4t = 76. Is ((-18)/27)/((-4)/f)-541 a composite number? True Let z(y) = 108y2 + 65y + 143. Is z(-20) a prime number? True Suppose -2a + o - 6o + 370016 = 0, 0 = -4o + 24. Is a a composite number? False Let g(s) = 0 + 29s*2 + 6s + 0 + 3 - 2s. Let n be g(-1). Suppose 0 = 28z - 24z - n. Is z composite? False Suppose 5569086 + 1367729 = 38i - 2835759. Is i a prime number? False Let y be 24/(-72) + (-4)/(-3)4. Suppose 0 = -5x + o + 30158, 78x - 75x - 18108 = yo. Is x composite? True Let o be (18 + -16)/((-2)/(-17)). Let k = 19 - o. Suppose m + i = ki + 247, -5m + i + 1251 = 0. Is m prime? True Let v be (28/(-8)2)/(-1). Suppose -v - 97 = -8t. Suppose 3g + 22430 = tg. Is g composite? False Suppose -5l + 0l + a + 18010 = 0, l - 3621 = 4a. Suppose -5t + 3m = -l, t - 203 - 522 = 3m. Is t composite? False Let z = 8885 - 5614. Is z composite? False Suppose 3f + 3p = -6, 0 = -5f - 3p + 2p - 6. Let m be 13/((-26)/(-8)) + f + -1. Suppose -a - mq + 131 = -0q, 5q - 20 = 0. Is a a prime number? False Let g(y) = -y3 + 6y*2 + 15y + 8. Let r be g(8). Suppose 0 = -rp + p - 613. Suppose 0 = 3c - 2*a - p,	{ "pile_set_name": "DM Mathematics" }
12m + 3m + (-4m + 3m + 2m)(-3 + 2 + 3) + 3m - 3m + 2m to lm + a and give l. -21 Express (-5 - 2 + 3)(-2g - 2g - 8g) + g - 5g + 3g in the form jg + w and give j. 47 Express (15 - 6h - 15)(-2h3 - h3 - h*3) as kh*4 + s + dh*2 + ih + lh3 and give k. 24 Express ((-2z + z + 0z)(-4z - 2z + 7z) + (-3 + 4 - 2)(2z2 - 1 + 1))(-6z + z - 8z) in the form vz3 + bz + uz2 + w and give v. 39 Rearrange 89z4 - z3 - z*2 - 4z + 3 - 88z4 + z3 to uz + qz3 + v + oz*2 + pz*4 and give o. -1 Rearrange 16o + 8o - 15o to k + fo and give f. 9 Express -11p*2 + 16p*2 + 12p*2 + (1 + 2p - 1)(4 + 2p - 4) - p*2 + 5p*2 - 5p*2 in the form mp*2 + h + fp and give m. 20 Express (-b - 5b + 3b)(-16b - 6b - 16b) as nb2 + c + sb and give n. 114 Rearrange -3 + 8 - 2s - 4 + 5 to the form u + rs and give u. 6 Rearrange (-2i + 3i - 3i)(-1589 + 1589 - 122i2) to the form vi*3 + qi + ci2 + x and give v. 244 Express 27 + 3m - 3m - 2m - 8 as om + t and give t. 19 Rearrange 3 + 26g + 1 - 5 to lg + f and give f. -1 Rearrange 9f - 2f - 3f + (1 + 4 - 3)(-3f + 4f + 3f) + 0f + 0f + f + (-2 + 2 - 1)(1 - 1 - 2f) to the form n + pf and give p. 15 Express -3w + 47w4 + 4w - 2w3 - 43w*4 - 2w*2 in the form fw*4 + vw*3 + q + aw*2 + rw and give v. -2 Express -5h2 - 7h - 32h2 + 7h in the form bh + j + mh*2 and give m. -37 Express (-3 + 3 + 2n)(-476n - 93 + 0 + 474n) in the form tn + g + kn2 and give t. -186 Rearrange 0o - 2o + o + (o - 3o + o)(4 - 3 - 3) to co + i and give c. 1 Rearrange (6 + 2 - 1)(-v + 7 - 7) to the form yv + b and give y. -7 Express s*2 - 10s*2 + 11s*2 - 2s*3 as is + p + gs3 + ns*2 and give g. -2 Rearrange -2 + 57u*3 + 43u*3 + 3u*2 - 65u*3 to vu*2 + qu + g + yu3 and give v. 3 Express (3 - 3 - 2g*2)(1 + 1 - 3) - 14g2 + 25g*2 + 67g*2 in the form lg*2 + n + wg and give l. 80 Express 3o2 - 5o*3 + 2o*2 + 19o*3 - 13o*3 - 4 in the form u + no*3 + mo*2 + vo and give m. 5 Rearrange 15u2 + 6u*2 - 2u*2 + 17u*2 to hu + v + ku2 and give k. 36 Rearrange 9 - 18 - 6q + 12 to tq + a and give t. -6 Express -33n*4 + 2n + 240 - 240 + 11n4 + 3n*3 in the form hn*4 + sn + mn3 + fn*2 + r and give h. -22 Rearrange -6h + 1 - 4h3 + h4 + 18h - 12h to rh*2 + o + uh*4 + jh*3 + ph and give u. 1 Express 2g - 2g*3 - 2g - 4g + 5g + 3g4 - 1 - g2 in the form cg*3 + sg + bg4 + og2 + d and give s. 1 Rearrange 0 - 1 - b2 - 7 to zb2 + q + jb and give z. -1 Rearrange 3a + 4a*2 + 6a - 8a to v + xa*2 + qa and give q. 1 Rearrange -6 - 4 + 21b3 - 18b*3 + 2 to rb*3 + lb*2 + s + zb and give s. -8 Express (-2u - 2u + 6u)(-19 - 13 - 4) + 2u - 2u - 2u + 2 as x + gu and give x. 2 Rearrange l - 2l - 12l*2 + 55l*3 - 54l*3 + 3l to the form tl2 + zl + sl3 + o and give t. -12 Rearrange 3s*3 - 1 - 8 - 3 + 4 to us + vs3 + g + qs*2 and give g. -8 Rearrange (-9o - 11 + 2o + 4o)(9o + 3o - 2o) to g + yo2 + bo and give y. -30 Express 3b3 - 5b*3 - 4b2 + b2 - 6b3 in the form mb*2 + o + cb + ib3 and give m. -3 Express 0t + 6 + t - 8 - 26t in the form zt + b and give z. -25 Express (l - 6l - 3l + (2 - 5 + 1)(-3l - 4l + 5l) - 2l + 2l - 2l)(2l - 4l + l) in the form g + jl + il*2 and give i. 6 Express 0x*2 - 7 + 2x + 0x2 + 4 - x3 in the form dx*3 + jx + a + vx2 and give v. 0 Express (14 - 26 - 3n + 14)(6 - 1 - 3)(2n2 - 4n*2 + 4n*2) in the form mn + g + kn2 + an*3 and give k. 8 Rearrange 3i + 0i - 2i + (3 + 1 + 0)(-2 + 1 + 6 + 2i) to b + ji and give j. 9 Express -38b + 43b + 33b - b in the form hb + l and give h. 37 Express p + 2p*2 - 3p - 2p3 + 11 - 4p - 13 in the form vp3 + ap*2 + lp + k and give k. -2 Express 18 - 2a + 17 + 11 as ra + i and give i. 46 Express 11u2 - 3u*2 + 18u*2 + 2u*2 as v + cu + qu2 and give v. 0 Express (0u3 - u3 + 8u3)(1 - 4u - 1) as pu*2 + wu*3 + h + ru*4 + cu and give r. -28 Rearrange 2x3 + 2x - 2 - 4x - 10 to the form sx + v + gx2 + px*3 and give v. -12 Rearrange (-2s + 0s + s)(2 - 2s - 2)(-5 + 0 + 3) to the form z + bs2 + rs and give b. -4 Express -2 - 30v + 2 as lv + f and give l. -30 Rearrange (0 - 1 + 2)(s - 3s + 4s) + (1 + 6 - 1 - 3 + 6 - 1 + (12 - 7 - 3)(4 - 2 + 0))(0s + 4s - 2s) to the form vs + y and give v. 26 Express 2a + 4a3 - 2 + 4a*4 + 0 - 3a*4 - 6a*3 - 2a*2 as ka*3 + za + xa2 + ma*4 + b and give x. -2 Rearrange (5 + 16 + 2)(-4a - 5a + 4a) + 2a + 4a - 5a + (1 - 2 - 1)(-a + 6a - 4a) - 4a + 0a + 2a to the form f + la and give l. -118 Rearrange 7054 - 200x*3 - 7054 + 711x*3 + (-4 + 2x*3 + 4)(0 + 3 - 4) to px2 + yx*3 + l + nx and give l. 0 Express z - 10z2 - 1 - 3z*2 - z in the form b + pz + vz2 and give v. -13 Express -1 + n3 - 2n + 1 + (-3 + 3 + 2n)(n*2 - 5n*2 + 2n*2) + 4n*3 - 5n*3 + 8n*3 as pn*3 + vn + g + dn2 and give d. 0 Express 2i*4 + 5i*3 + 2i4 - i2 + 4i3 - 5i*4 as vi + zi3 + q + ai*2 + ci*4 and give c. -1 Rearrange -4x - x*4 - 76x*2 + 76x*2 - 2x*3 - 1 to p + nx*2 + rx*4 + sx*3 + hx and give r. -1 Rearrange -3 + 2n + 5 + 6 to cn + g and give g. 8 Rearrange -2i + 18i + 3i + 8i to the form o + ri and give r. 27 Rearrange (-n + n + 2n)(-1 + 3n*2 + 1) to p + zn*2 + vn*3 + yn and give y. 0 Rearrange -4m + 0m + 2m + (-5 - 15 + 8)(-m + 4m + m) to the form z + km and give k. -50 Express (3 + 2 - 6)(0 + 0 - g2 - 3 + g2 + 3 + (3g - 4g + 2g)(g + 2 - 2)) + g - 3g*2 - g in the form b + ag*2 + rg and give a. -4 Express (-10 + 10 - 10g + (4g - 3g + 0g)(-3 + 1 + 0))(1 - 1 - g*2) in the form pg*2 + mg*3 + qg + w and give m. 12 Rearrange (-9 - 3 - 3)(-7w + 2w + 3w) to the form d + yw and give y. 30 Express (3 + 4i - 3)(8 + 53i*2 - 52i*2 - 25) in the form ci + t + wi3 + pi*2 and give w. 4 Express y + 2 - 2 + (1 - 2 + 2)(4y - 2y + 0y) + 7y - 10y + 6y in the form h + ly and give l. 6 Express 3a - 6 - 2a4 - a3 + 9a*2 + 3a*3 + 8 in the form ra*2 + ha*4 + g + la*3 + ba and give l. 2 Rearrange -q*4 + 58q - 2q3 + q3 - 56q + 7q4 + 2 to the form yq*2 + fq*3 + uq + i + tq4 and give i. 2 Rearrange -53m*2 - 2813m + 2813m to the form ym*2 + dm + p and give y. -53 Rearrange -16g3 - 2g*4 + 16g3 + (-g2 - 2g2 + 2g*2)(-g2 + g2 - 3g2) to sg*2 + lg*4 + ug + hg3 + q and give q. 0 Express (1 - 2 + 3)(f*4 - 1 + 1) + 2f4 + f4 - 4f4 - 285 - 15f*4 + 285 as bf*4 + wf + vf3 + q + kf*2 and give b. -14 Rearrange 2u + 11 - 16u2 - 33u*2 - 11 to g + su + nu2 and give s. 2 Express (-2y - 2y - 2y)(2 + 4y*2 - 2 + (-3y*2 + 3y*2 + 2y*2)(0 - 3 + 4)) in the form d + gy2 + sy*3 + ly and give s. -36 Express -2 - m*2 + 5m + m*4 + 3 - 3m as w + rm4 + sm*2 + gm + zm3 and give r. 1 Rearrange 0i - 7i2 + 1597 - i - 1598 to the form hi*2 + o + ui and give h. -7 Express -11 + z*3 - 4 - 3 + 0 in the form qz + f + sz3 + xz*2 and give s. 1 Express (97 + 82d - 97)(2 - 3 - 1)(4 - 3 - 2)(-3 + 2 - 1) in the form pd + x and give p. -328 Express (2l2 - 3l*3 - 2l*2)(38 + 52 - 9) in the form cl2 + ol*3 + m + vl and give o. -243 Rearrange 4 - 1 + 3 - 4 + 75f2 to the form nf*2 + mf + y and give y. 2 Rearrange (-5r + 5r - 2r)(1 + r - 1) + r - 2r2 - r - 36r*2 + 4r*2 - 5r*2 to vr*2 + y + br and give v. -41 Rearrange 5x + x - 37x to the form i + ax and give a. -31 Express (-2 + 1 - 3)(-1 + 1 + 1 + (2 - 2 + 1)(-1 + 0 + 4))(-7c + 2c + 3c) as f + qc and give q. 32 Express -17s2 - 414s + 414s - 48s*2 as ls + os2 + p and give o. -65 Express -5u3 + u3 - 2u3 + u3 - 5u*3 + 3u*3 + (0 - 2 + 4)(-9u3 + 2u*3 + 2u*2 + 10u*3) in the form hu*2 + nu*3 + d + qu and give n. -1 Express -7i + 4i - 7i + 24 - 16 as ai + b and give b. 8 Rearrange (-24x2 + 28 - 28)(2x2 + 2x**2	{ "pile_set_name": "DM Mathematics" }
e 0 = v - iv. Let z(f) = -f3 + 3f*2 + 2f + 7. Let m be z(4). Sort v, -9, m. -9, m, v Let d = -20 - -23. Let t be ((-8)/(-2) - d)1. Let g = t - 4/3. Sort g, -1/2, -2. -2, -1/2, g Suppose -4a = -5i - 10, -53a + 48a + 8 = -4i. Sort -24, -1, a. -24, -1, a Let v = -0.23 + 0.286. Let o = v + 3.944. Put o, -10, 0.4 in descending order. o, 0.4, -10 Suppose 5q - q - 48 = 0. Let w be ((-2)/6)/(q/8). Suppose -4x - 4z + 0z + 4 = 0, 4z = 3x - 31. Sort w, x, -0.2 in descending order. x, -0.2, w Suppose 21k - 637 = -469. Put k, 0, 1 in increasing order. 0, 1, k Let h = -224 - -192. Put 3, -4, h in ascending order. h, -4, 3 Let q be 1 - 2 - -12. Let x(h) = 4h - 1. Let v be x(-1). Let p be (v - 0)5/5. Put -3, q, p in decreasing order. q, -3, p Let q = -0.44 - -19.44. Let v = -46 + 65.2. Let c = q - v. Sort c, 4, 1/14 in decreasing order. 4, 1/14, c Let v(d) = -d*3 - 2d*2 + d. Let k be v(-2). Let y = 31 - 43. Let q = y - -12.5. Sort k, -3, q in decreasing order. q, k, -3 Let h be ((-10)/(-21))/((-5)/1665). Let z = 159 + h. Put z, -3, 5 in decreasing order. 5, z, -3 Suppose 0 = 4a + 2a - 12. Suppose a = 3v - 1, -3v = -o + 1. Put 3, o, 0.5 in ascending order. 0.5, 3, o Suppose -c - 2c = 2d - 217, -5d + 4c = -485. Let k = d + -98. Let h = -1 - -2. Sort h, k, -4 in descending order. k, h, -4 Let b(t) = -24t + 4. Let k be b(8). Let p be 21(k/(-64) + -3). Put p, -1, 5, -3 in descending order. 5, p, -1, -3 Let x = 22.016 + -0.016. Let l = x + -24. Put 0.2, 36, l in descending order. 36, 0.2, l Let n = 379.8 - 380. Sort 0.5, n, 18 in descending order. 18, 0.5, n Suppose -8w - 8 = -10w. Suppose -2 = -3q + h, 2 = wq - 3h + 2h. Sort 4, -4, q. -4, q, 4 Let g = -309.6 - -310. Sort -2/13, -0.4, -9/8, g. -9/8, -0.4, -2/13, g Let v = -5.1814 + 0.1814. Sort 6, v, -13/3. v, -13/3, 6 Let o = 7.5 - 11. Let n = -4.5 - o. Put 2/9, n, 0.5 in descending order. 0.5, 2/9, n Let g = -0.068 - -0.068. Let c = 0.66 - -0.04. Let z = c - 0.2. Put z, 0.3, g in increasing order. g, 0.3, z Let w(r) = 5r3 + r2 - r - 1. Let f be w(-1). Let q = 14 + f. Let d be (-9)/q - 12/(-8). Sort 1/2, d, 2/7. 2/7, 1/2, d Let p = 2 + -2.077. Sort p, -3, -1 in decreasing order. p, -1, -3 Let x(m) = 5m + 14. Let z(t) = t2 - t + 1. Let i(j) = x(j) - z(j). Let s be i(9). Let n be (4/2)/(s/(-21)). Sort -2, n, 1 in decreasing order. n, 1, -2 Let t = 4.866 - 4.666. Let n = -0.05 - -0.05. Put n, t, 2/49, -4 in descending order. t, 2/49, n, -4 Let g(f) = -f3 - 8f2 - 12f + 4. Let t be g(-6). Sort 3, -5, -2, t in increasing order. -5, -2, 3, t Suppose o + 11 = 4o + 2r, -5o + r + 14 = 0. Let i be 27/6 - o/2. Sort 5, i, -1 in descending order. 5, i, -1 Let k = -2.35 + 2.1. Let n = k + 0.05. Put 2, n, -2/5 in descending order. 2, n, -2/5 Let t(s) = -15s - 217. Let f be t(-14). Sort f, -24, -2 in descending order. -2, f, -24 Suppose m - 4g = -5 - 4, 0 = g - 3. Sort 9, m, 0 in descending order. 9, m, 0 Let v be 0/(4 - (1 + 1)). Let i be (1/(-1))/(v - 1). Put 0, 3, i in increasing order. 0, i, 3 Suppose k = 2s - 11, 7s - 3s = 4k + 28. Let j be 3 + 176/(-13) - k. Sort j, -2/5, 0.7 in ascending order. -2/5, j, 0.7 Suppose -1 = 4r - 9. Let i be 30/(-7 - -4)r. Let n be (i/30)/((-10)/3). Put 1/4, n, -0.4 in decreasing order. 1/4, n, -0.4 Let m = -3 + 17. Let v = 16.735 + 0.265. Let c = m - v. Sort 4, c, -1/8 in decreasing order. 4, -1/8, c Let f be (-2)/721/9. Let p = -99.2 + 97.2. Sort f, 2/5, p in increasing order. p, f, 2/5 Let i be ((-3)/2)/((-195)/(-130)). Sort 1, i, -5, -4. -5, -4, i, 1 Let w be 6 + -5 + (-26)/22. Suppose 3d = -3d - 24. Sort w, d, 0.3. d, w, 0.3 Let q(z) = -z2 - 3z + 3. Let h be q(-3). Let y(n) = -n + 1. Let k be y(5). Sort k, 0, h in descending order. h, 0, k Let r be (2/4)/1 + (-147)/(-42). Sort r, 2, -6. -6, 2, r Let d = 302 - 301.5. Let i = 0.4 + -0.7. Let y = i + 0.1. Sort y, d, 5 in descending order. 5, d, y Let q be ((-48)/(-8))/(1-2). Let h(s) = -s3 - s2 - 4s - 3. Let d be h(q). Let k = d - 26. Put 5, 2, k in ascending order. k, 2, 5 Let r(n) = 2n + 13. Let s be r(-5). Suppose -2f - 1 = -i, -2f + s = -3i + f. Sort -2, i, 4 in decreasing order. 4, -2, i Let x be -2 - (-22 - -2) - 0. Suppose -81b + z - 17 = -78b, 5z - 5 = -b. Sort x, b, -1. b, -1, x Let d = -916 + 915.7. Suppose y - 3y + 10 = 0. Let f = 0 + y. Put d, 0, f in decreasing order. f, 0, d Let g = -345.7 - -346. Let f(x) = x*3 - 4x*2 - 6x + 2. Let h be f(5). Sort h, -5, g. -5, h, g Let l = -5.477 - -7.51. Let s = -0.033 + l. Let h = 8 - 3. Put -4, s, h in descending order. h, s, -4 Let i = -60 + 782/13. Put i, 3, -2, -1/798 in increasing order. -2, -1/798, i, 3 Suppose -2d = 3r - 1 - 5, -3d - 6 = -3r. Sort 33, r, -1, 1. -1, 1, r, 33 Let i = 13.9 + -13.8. Let t = -794/5 - -158. Sort t, 8, i in increasing order. t, i, 8 Let q = 843 + -843. Let u(a) = 2a2 + 3a + 2. Let h be u(-3). Let j = h + -15. Put j, -3, q in increasing order. j, -3, q Let g be (6 - 7)/(1/(-1)). Let r(m) = 7m3 - 2m*2 + 3m - 2. Let y be r(g). Put -5, y, 1 in descending order. y, 1, -5 Let i(v) = -v + 27. Let z be i(26). Put -1, 3, z in decreasing order. 3, z, -1 Let a = 2 + -2.01. Let j = 484 - 484.3. Sort j, 5, a, -1 in descending order. 5, a, j, -1 Suppose -2o + z - 2 = 3z, 2 = -3o - 2z. Let k be 1 + o - (0 - -4). Put 0, k, -2, 3 in decreasing order. 3, 0, -2, k Let w = -14 + 16. Suppose h = 6h - wh. Put -12, h, 2, 3 in descending order. 3, 2, h, -12 Let k(g) = 11g - 248. Let b be k(23). Sort b, -4, -3, 3 in descending order. b, 3, -3, -4 Suppose 0 = -14y + 170 - 198. Sort -1, 2, -3, y in increasing order. -3, y, -1, 2 Suppose -1977i = -1971i + 42. Sort -4, i, 2 in descending order. 2, -4, i Suppose t = 3g + 82, 6t + 182 = 8t + 3g. Sort t, 1, 3 in descending order. t, 3, 1 Let y = -94.6 - -95. Put 2/11, y, -1.6, -0.06 in decreasing order. y, 2/11, -0.06, -1.6 Let d = 0.153 - 3.133. Let g = -0.02 + d. Let h = -37/24 + 5/3. Sort g, 5, h in increasing order. g, h, 5 Let c = -24 + 30. Let a = c + -6.4. Sort -2, 0, a in increasing order. -2, a, 0 Suppose 4s + 2t = 16, 2t + 29 - 33 = 2s. Sort -0.2, s, 0.04, 4 in decreasing order. 4, s, 0.04, -0.2 Let a = 0.11213 + 0.08787. Let y = 2 - 3. Put -0.5, 0.3, a, y in descending order. 0.3, a, -0.5, y Let j(z) = 36z - 32. Let m be j(1). Sort -2, -4, m, 15 in decreasing order. 15, m, -2, -4 Let o = -36 - -30. Let c(k) = k2 + 5k - 6. Let l(t) = -3t2 - 15t + 17. Let x(f) = 11c(f) + 4l(f). Let p be x(o). Put -2/15, 0.3, p in descending order. 0.3, -2/15, p Let b = -43 - -13. Let m = 30.4 + b. Sort m, -5, -2/7. -5, -2/7, m Let d be (-10)/10 - (-1 + 1 + 3). Put -65, -5, d in descending order. d, -5, -65 Let h = -101 - -100.8. Put h, -179, 0.3, -1 in decreasing order. 0.3, h, -1, -179 Let z = 6 - 5. Let a be (-6)/(-3) + z + -14. Let o = -8 - a. Put -1, 4, o in increasing order. -1, o, 4 Let o(a) = -a*3 - 19a*2 - 20a - 51. Let j be o(-18). Put -2, j, 5 in descending order. 5, -2, j Let t = -30.5 - -30. Let h = 0.3 + t. Let b = h - -0.3. Put -3/4, 1, b in descending order. 1, b, -3/4 Let y(b) = -2b2 - 16b - 25. Let z be y(-5). Sort -18, 0, z, 1 in decreasing order. z, 1, 0, -18 Let q = -765/2 + 452. Let b = q - 69. Sort b, -5, -2/7, 1 in descending order. 1, b, -2/7, -5 Let x = 51.1062 + -0.1062. Sort -5, x, -4 in descending order. x, -4, -5 Let r be -2 + -11 + (6 - 3). Put r, -3, 3 in ascending order. r, -3, 3 Let r(k) = 2k + 1. Let n be r(1). Let m = -16 - -19. Suppose 6z + 12 = mz. Put 0, n, z in ascending order. z, 0, n Let a = 9 - 1. Let u = -49/45 - -11/9. Suppose 4m = 4j - 16, m - 3j + 6j = 0. Sort a, u, m. m, u, a Suppose 3q - 5q - 94 = -5d, 4q + 5d = -248. Let n be 2/8 + 0 - q/76. Sort 2, n, -11 in increasing order. -11, n, 2 Let g(r) = -16r + 47. Let k be g(3). Let y = 43/138 - -12/23. Sort -1/3, k, y, 3/7 in increasing order. k, -1/3, 3/7, y Let w = -300 - -299. Let v = -37.5 - -37. Sort 1, v, 3, w in increasing order. w, v, 1, 3 Let g(y) = y2 - 30y + 191. Let r be g(21). Put -12, r, 0 in ascending order. -12, 0, r Suppose 5u + 525 = -0u. Let i = u - -103. Let n be (22)/22. Sort i, 5, n in ascending order. i, n, 5 Let y = -13 + 9. Suppose 10 = -3l + 8l. Let o = 203 + -206	{ "pile_set_name": "DM Mathematics" }
. Give prob of picking 1 s and 1 f. 1/36 Three letters picked without replacement from bbbtbtbytytttbtb. What is prob of picking 1 y and 2 b? 3/40 Calculate prob of picking 1 g and 1 w when two letters picked without replacement from wwgcwbxccb. 1/15 Two letters picked without replacement from yyyfyyryylllluy. What is prob of picking 1 r and 1 y? 8/105 Four letters picked without replacement from {n: 1, j: 9, e: 2, d: 4}. What is prob of picking 2 n and 2 e? 0 Two letters picked without replacement from ffffffffffffvff. Give prob of picking 2 f. 13/15 Two letters picked without replacement from nnn. Give prob of picking 2 n. 1 Three letters picked without replacement from {j: 4, z: 1, x: 3, h: 4, k: 6, w: 2}. Give prob of picking 3 h. 1/285 Four letters picked without replacement from {r: 4, p: 7}. What is prob of picking 4 p? 7/66 Four letters picked without replacement from zcrzrcczc. What is prob of picking 1 r and 3 z? 1/63 Two letters picked without replacement from zgzwwzzwzgzzg. What is prob of picking 1 z and 1 w? 7/26 Three letters picked without replacement from {c: 19, t: 1}. What is prob of picking 1 t and 2 c? 3/20 What is prob of picking 2 k when two letters picked without replacement from {s: 2, d: 3, n: 2, k: 4, b: 2, m: 2}? 2/35 Calculate prob of picking 1 k and 1 c when two letters picked without replacement from {c: 2, k: 4}. 8/15 Calculate prob of picking 1 w, 1 j, and 1 p when three letters picked without replacement from {j: 3, g: 4, p: 1, z: 5, b: 3, w: 1}. 3/680 Four letters picked without replacement from iiiiii. Give prob of picking 4 i. 1 Three letters picked without replacement from llmmllnnnnnlnnnnlnln. Give prob of picking 3 n. 11/76 Calculate prob of picking 1 c and 1 y when two letters picked without replacement from aaccyyymaaayaa. 8/91 Three letters picked without replacement from {k: 1, d: 4, b: 2, i: 2, a: 1}. What is prob of picking 1 d, 1 a, and 1 k? 1/30 Three letters picked without replacement from wxwxxxxxxxxxwxwwwxw. Give prob of picking 2 w and 1 x. 84/323 Calculate prob of picking 2 s, 1 a, and 1 o when four letters picked without replacement from ogogaguoooassoyasgoa. 28/1615 Calculate prob of picking 3 w when three letters picked without replacement from ywwywwwwywwwywwwww. 91/204 Two letters picked without replacement from {r: 3, s: 2, i: 3, m: 1, c: 1, e: 1}. Give prob of picking 1 c and 1 m. 1/55 What is prob of picking 1 l and 1 a when two letters picked without replacement from oawalawlwaawaaaaaaw? 22/171 What is prob of picking 1 e and 2 r when three letters picked without replacement from {a: 4, l: 6, r: 4, q: 1, e: 5}? 1/38 Three letters picked without replacement from {m: 1, z: 1, j: 1, u: 1, l: 1}. What is prob of picking 1 j, 1 u, and 1 m? 1/10 What is prob of picking 1 v and 1 n when two letters picked without replacement from gvkvgkxxvvvsgkn? 1/21 Calculate prob of picking 1 z and 1 f when two letters picked without replacement from {z: 7, f: 2}. 7/18 Calculate prob of picking 3 j and 1 h when four letters picked without replacement from eejhjehzeeeeegejg. 1/1190 Two letters picked without replacement from {n: 4, g: 1, o: 4, q: 1}. Give prob of picking 1 q and 1 g. 1/45 Two letters picked without replacement from {a: 1, h: 1, f: 1, l: 2, y: 1, i: 1}. What is prob of picking 1 a and 1 l? 2/21 Two letters picked without replacement from {g: 5, m: 15}. Give prob of picking 1 g and 1 m. 15/38 Calculate prob of picking 2 t when two letters picked without replacement from {u: 3, t: 2}. 1/10 Calculate prob of picking 2 n when two letters picked without replacement from {z: 2, n: 11}. 55/78 Calculate prob of picking 3 b when three letters picked without replacement from alblbhabaaablabaaa. 5/408 Three letters picked without replacement from {r: 2, m: 5}. Give prob of picking 2 r and 1 m. 1/7 Two letters picked without replacement from {n: 1, i: 1, o: 1, g: 2, l: 1, z: 2}. What is prob of picking 1 n and 1 z? 1/14 Calculate prob of picking 1 e and 3 a when four letters picked without replacement from eeeterreeradeerdee. 0 Four letters picked without replacement from amacgamag. What is prob of picking 3 a and 1 c? 2/63 Calculate prob of picking 1 u and 3 o when four letters picked without replacement from {u: 12, o: 6}. 4/51 Three letters picked without replacement from {v: 11, g: 2}. What is prob of picking 1 v and 2 g? 1/26 Calculate prob of picking 2 j when two letters picked without replacement from {g: 16, j: 4}. 3/95 Two letters picked without replacement from {a: 3, m: 1, r: 3, t: 13}. What is prob of picking 1 m and 1 r? 3/190 Calculate prob of picking 1 p and 1 z when two letters picked without replacement from {z: 1, p: 1, h: 2}. 1/6 Calculate prob of picking 1 g and 1 n when two letters picked without replacement from {e: 1, g: 1, j: 2, n: 1, l: 1, o: 1}. 1/21 What is prob of picking 2 f when two letters picked without replacement from fyfqylqrffrlzrzffff? 28/171 Two letters picked without replacement from {i: 6, x: 1, m: 4, c: 3}. Give prob of picking 1 x and 1 i. 6/91 Three letters picked without replacement from xvvttxvxhtv. What is prob of picking 1 t, 1 v, and 1 x? 12/55 What is prob of picking 1 p, 1 t, and 2 r when four letters picked without replacement from xxtyyxxxpytrtryy? 3/1820 Two letters picked without replacement from jjzzjj. What is prob of picking 2 j? 2/5 Three letters picked without replacement from {q: 3, s: 1, d: 1, h: 3, p: 2, i: 3}. Give prob of picking 1 i, 1 d, and 1 h. 9/286 Calculate prob of picking 1 n and 2 h when three letters picked without replacement from gghhhgghhxnhhgghhx. 3/68 Calculate prob of picking 1 x and 3 k when four letters picked without replacement from xkxekxxxexexkkxek. 4/119 Three letters picked without replacement from {v: 8, u: 3, p: 5, a: 1, f: 2}. Give prob of picking 2 f and 1 u. 1/323 Calculate prob of picking 1 d and 1 b when two letters picked without replacement from lylbdylbydly. 2/33 Two letters picked without replacement from {j: 6, r: 2}. Give prob of picking 2 r. 1/28 Three letters picked without replacement from kikinnnknnkiii. What is prob of picking 1 n and 2 i? 25/182 What is prob of picking 1 o and 2 e when three letters picked without replacement from {c: 1, h: 4, y: 3, o: 1, n: 3, e: 5}? 1/68 Calculate prob of picking 1 n and 3 j when four letters picked without replacement from {p: 2, c: 1, k: 1, j: 12, n: 2}. 22/153 Calculate prob of picking 1 f and 2 k when three letters picked without replacement from {e: 2, k: 2, t: 3, f: 6}. 3/143 What is prob of picking 1 b, 2 e, and 1 p when four letters picked without replacement from {b: 10, e: 2, p: 2}? 20/1001 Four letters picked without replacement from babbbababa. What is prob of picking 2 a and 2 b? 3/7 Four letters picked without replacement from uurfffrfufrfu. Give prob of picking 1 r and 3 f. 12/143 Two letters picked without replacement from aaaaggyppggagagaaya. Give prob of picking 1 p and 1 y. 4/171 What is prob of picking 1 b and 2 n when three letters picked without replacement from bmnmmnnnnnmmnmbvm? 21/340 Four letters picked without replacement from {u: 4, s: 2, w: 2}. What is prob of picking 2 u, 1 s, and 1 w? 12/35 Two letters picked without replacement from {t: 2, u: 1, v: 1, n: 4, b: 1}. Give prob of picking 1 t and 1 n. 2/9 What is prob of picking 1 n and 1 w when two letters picked without replacement from nweaseee? 1/28 What is prob of picking 1 h and 1 b when two letters picked without replacement from hmbhhhmbbmmbmbmhhmh? 35/171 What is prob of picking 1 i and 1 x when two letters picked without replacement from {i: 6, m: 2, x: 7}? 2/5 What is prob of picking 1 o and 2 r when three letters picked without replacement from {o: 4, h: 3, v: 4, r: 5}? 1/14 Four letters picked without replacement from uumrurumymmruary. What is prob of picking 2 m and 2 y? 3/910 Two letters picked without replacement from xxxbxxxbxbxx. What is prob of picking 1 b and 1 x? 9/22 Three letters picked without replacement from {s: 5, w: 5, k: 1}. What is prob of picking 1 k and 2 w? 2/33 Three letters picked without replacement from {u: 6, y: 3, a: 3, e: 3}. What is prob of picking 2 e and 1 u? 18/455 What is prob of picking 1 o and 1 r when two letters picked without re	{ "pile_set_name": "DM Mathematics" }
of 2307? False Is 4188 a factor of 728188500? True Is 48308892 a multiple of 789? True Is 28 a factor of 43479296? True Is 197 a factor of 2016442947? True Is 2914 a factor of 1457000? True Does 40 divide 845782080? True Is 665195535 a multiple of 8? False Does 296 divide 1131137475? False Does 245 divide 4369380? False Does 11 divide 56658415? True Is 4514436 a multiple of 267? True Does 113 divide 98478326? False Is 1301430636 a multiple of 2252? False Is 56214620 a multiple of 2321? True Is 139934 a multiple of 31? True Is 9 a factor of 16655364? True Is 82365268 a multiple of 12? False Is 1479280480 a multiple of 4242? False Does 2320 divide 335806080? True Is 5286878978 a multiple of 133? False Is 3 a factor of 10490385? True Is 152906870 a multiple of 10? True Does 61 divide 32163849? False Is 25 a factor of 109657925? True Does 2628 divide 65167825? False Does 11 divide 18900717? True Is 117 a factor of 3068594919? True Is 157264410 a multiple of 670? True Is 125 a factor of 255530346? False Does 610 divide 25734070? True Is 396906786 a multiple of 34? True Does 177 divide 6673431? True Does 50 divide 917264213? False Is 19 a factor of 77877371? True Is 814 a factor of 380345570? True Is 1705336823 a multiple of 1676? False Does 323 divide 18961519? False Does 99 divide 48597244? False Does 10 divide 18244160? True Does 2830 divide 1109793133? False Does 29 divide 7478121? False Is 1144978565 a multiple of 730? False Does 38 divide 66770066? True Is 22179484 a multiple of 604? True Is 184135120 a multiple of 130? True Does 45 divide 115893945? True Is 262 a factor of 8866604? True Is 100997256 a multiple of 186? True Is 40 a factor of 590293640? True Is 278 a factor of 334618230? False Is 49564663 a multiple of 4866? False Is 28 a factor of 8755589? False Is 5 a factor of 56217520? True Does 884 divide 462493396? False Is 53092942 a multiple of 1162? True Does 221 divide 86597082? True Is 112893326 a multiple of 14? True Is 56 a factor of 46410896? True Is 20668200 a multiple of 570? True Does 3869 divide 67575954? True Is 326 a factor of 1254064624? True Does 392 divide 109453883? False Is 3482 a factor of 100372038? False Does 720 divide 1060166061? False Does 38 divide 19125993? False Does 671 divide 29188103? False Is 82 a factor of 2506518852? False Does 2 divide 5390304? True Is 5976786 a multiple of 211? True Is 317 a factor of 64833647? False Does 67 divide 23663954? False Is 20 a factor of 16235151? False Does 571 divide 782343659? True Is 287 a factor of 994350532? True Does 1003 divide 142881362? True Is 4192475937 a multiple of 13? True Is 16276761 a multiple of 27? True Does 9 divide 66009456? True Is 5577903 a multiple of 14? False Is 100084318 a multiple of 56? False Does 113 divide 5895436? True Does 272 divide 200257824? True Is 15 a factor of 4918780? False Is 224380051 a multiple of 15? False Is 164 a factor of 3836829? False Is 52419378 a multiple of 121? True Is 17 a factor of 715122909? False Is 326 a factor of 144861995? False Is 22454643 a multiple of 129? True Is 2 a factor of 36660549? False Is 45556680 a multiple of 8268? True Is 34748000 a multiple of 30? False Is 13633570 a multiple of 1899? False Does 438 divide 605383014? True Is 77 a factor of 1048509? True Is 9 a factor of 13255533? True Is 1053 a factor of 19950138? True Does 46 divide 486819164? False Is 18135306 a multiple of 23? False Is 39993300 a multiple of 10? True Is 22123932 a multiple of 12? True Is 18 a factor of 16851312? True Does 1039 divide 333976160? True Is 968622671 a multiple of 27? False Is 2515 a factor of 109020220? True Is 25 a factor of 273278148? False Is 14 a factor of 28955540? False Is 1148606967 a multiple of 843? False Does 203 divide 14269073? True Does 13 divide 111723313? True Is 172 a factor of 328282812? True Is 6288821539 a multiple of 11? True Does 22 divide 29060790? True Is 2858239744 a multiple of 131? True Is 811516315 a multiple of 5095? True Is 26 a factor of 406398918? False Does 4345 divide 1217364720? True Does 270 divide 11037600? True Does 383 divide 74550567? True Is 27 a factor of 1421481139? False Does 67 divide 36377112? False Is 13 a factor of 1316552451? False Is 2546 a factor of 81683318? True Is 11321910 a multiple of 171? True Does 787 divide 11182483? True Is 35827680 a multiple of 96? True Is 108997435 a multiple of 4361? False Does 791 divide 198900089? False Does 17 divide 371474735? True Does 7520 divide 732703680? True Does 268 divide 71565112? True Does 26 divide 147135586? True Is 16504970 a multiple of 2? True Is 40 a factor of 403401612? False Is 237 a factor of 147410862? False Is 3781812935 a multiple of 144? False Does 32 divide 42113412? False Does 2122 divide 15371768? True Is 3391 a factor of 99382930? False Is 90731200 a multiple of 280? True Is 214 a factor of 13682689? False Is 53 a factor of 6128902? False Does 43 divide 1606437? True Is 344287241 a multiple of 191? True Is 517060620 a multiple of 1432? False Does 50 divide 3456790700? True Is 338 a factor of 3055756262? True Is 2456 a factor of 120854987? False Is 644 a factor of 41068524? True Does 2239 divide 208720154? False Does 112 divide 128580974? False Does 11 divide 57254153? True Is 125 a factor of 38742375? True Is 10801560 a multiple of 98? True Is 3674 a factor of 1748768890? True Does 185 divide 953643920? True Is 1619076955 a multiple of 571? False Does 18 divide 234583023? False Is 467 a factor of 996737932? False Is 54 a factor of 16157448? True Is 2228573025 a multiple of 225? True Is 29 a factor of 121175669? False Does 52 divide 107495492? True Does 465 divide 1796815? False Is 1879 a factor of 42863748? True Is 4912612404 a multiple of 104? False Is 170 a factor of 91226384? False Is 73 a factor of 394012161? False Is 112 a factor of 1257736480? True Does 349 divide 16428465? False Is 1155302841 a multiple of 539? True Is 1533 a factor of 185129745? False Does 145 divide 610647384? False Does 223 divide 35641198? True Is 307 a factor of 110763822? False Does 17 divide 15839430? False Is 26 a factor of 5773113? False Is 278 a factor of 14709814? True Is 18 a factor of 114200915? False Does 13 divide 25774125? True Is 1015624914 a multiple of 3162? True Is 13 a factor of 562499643? False Is 110215057 a multiple of 1564? False Is 1624966222 a multiple of 38? True Is 57747690 a multiple of 15? True Is 1453 a factor of 934411223? True Does 44 divide 31855780? True Is 28905100 a multiple of 433? False Is 55478342 a multiple of 5? False Is 10 a factor of 209022421? False Is 37335330 a multiple of 5? True Is 626 a factor of 212734832? True Is 121613376 a multiple of 427? False Does 18 divide 199401426? True Is 29 a factor of 59680869? True Is 370 a factor of 33860180? True Is 953404286 a multiple of 1747? True Is 5 a factor of 53849277? False Is 112 a factor of 5055456? True Is 4 a factor of 3806582? False Does 2 divide 101777989? False Is 152163264 a multiple of 2112? True Does 3726 divide 722117430? True Is 558140333 a multiple of 19? True Is 172618752 a multiple of 2287? False Is 22392471 a multiple of 195? False Does 14 divide 2918033052? False Does 4 divide 2551674311? False Is 5677 a factor of 437918103? True Does 28 divide 2265701743? False Is 15 a factor of 35615877? False Is 3 a factor of 1504077? True Is 61 a factor of 1653610765? False Is 12 a factor of 220098954? False Is 21470972 even? True Does 4940 divide 486614700? True Is 52 a factor of 450380060? True Is 20118150 a multiple of 9? True Is 5067 a factor of 973624050? True Is 51 a factor of 3428827? False Is 13 a factor of 46682735? False Is 954859702 a multiple of 153? False Is 13726360 a multiple of 76? True Is 54887404 a multiple of 22? True Is 132001358 a multiple of 11? False Is 208 a factor of 20116891? False Does 127 divide 4911058? False Does 310 divide 10922921? False Is 1110 a factor of 1343850802? False Does 1372 divide 30419984? True Is 138 a factor of 33165518? False Does 95 divide 288377924? False Is 90 a factor of 72317520? True Is 16975236 a multiple of 556? True Does 1489 divide 78951247? True Is 678 a factor of 10069606? False Does 136 divide 77390392? True Is 354421595 a multiple of 54? False Does 446 divide 756862? True Is	{ "pile_set_name": "DM Mathematics" }
ainder when 1079 is divided by 86? 47 What is the remainder when 23 is divided by 5? 3 Calculate the remainder when 1364 is divided by 199. 170 Calculate the remainder when 171 is divided by 83. 5 What is the remainder when 1814 is divided by 55? 54 What is the remainder when 350 is divided by 22? 20 Calculate the remainder when 623 is divided by 19. 15 What is the remainder when 759 is divided by 267? 225 What is the remainder when 18668 is divided by 49? 48 Calculate the remainder when 124 is divided by 61. 2 What is the remainder when 244 is divided by 115? 14 Calculate the remainder when 51 is divided by 41. 10 What is the remainder when 488 is divided by 238? 12 Calculate the remainder when 1429 is divided by 119. 1 Calculate the remainder when 22 is divided by 22. 0 What is the remainder when 151 is divided by 18? 7 What is the remainder when 965 is divided by 16? 5 What is the remainder when 2239 is divided by 56? 55 Calculate the remainder when 303 is divided by 17. 14 What is the remainder when 106 is divided by 45? 16 Calculate the remainder when 127 is divided by 3. 1 Calculate the remainder when 980 is divided by 26. 18 Calculate the remainder when 417 is divided by 47. 41 Calculate the remainder when 13155 is divided by 92. 91 Calculate the remainder when 503 is divided by 56. 55 What is the remainder when 29 is divided by 10? 9 Calculate the remainder when 524 is divided by 45. 29 Calculate the remainder when 2898 is divided by 27. 9 Calculate the remainder when 686 is divided by 176. 158 What is the remainder when 3 is divided by 1? 0 Calculate the remainder when 3267 is divided by 26. 17 Calculate the remainder when 215 is divided by 55. 50 What is the remainder when 158 is divided by 92? 66 Calculate the remainder when 164 is divided by 10. 4 Calculate the remainder when 671 is divided by 163. 19 Calculate the remainder when 20 is divided by 12. 8 What is the remainder when 14533 is divided by 85? 83 What is the remainder when 101 is divided by 41? 19 Calculate the remainder when 21581 is divided by 198. 197 What is the remainder when 100 is divided by 7? 2 What is the remainder when 208 is divided by 36? 28 What is the remainder when 30 is divided by 29? 1 What is the remainder when 537 is divided by 43? 21 What is the remainder when 234 is divided by 59? 57 What is the remainder when 264 is divided by 124? 16 Calculate the remainder when 3118 is divided by 1026. 40 What is the remainder when 108399 is divided by 406? 403 What is the remainder when 535 is divided by 79? 61 Calculate the remainder when 15742 is divided by 4. 2 What is the remainder when 152 is divided by 55? 42 What is the remainder when 151 is divided by 30? 1 What is the remainder when 737 is divided by 15? 2 What is the remainder when 2603 is divided by 22? 7 What is the remainder when 4103 is divided by 171? 170 What is the remainder when 382 is divided by 11? 8 Calculate the remainder when 195 is divided by 18. 15 What is the remainder when 1476 is divided by 10? 6 Calculate the remainder when 61 is divided by 14. 5 Calculate the remainder when 798 is divided by 100. 98 Calculate the remainder when 55 is divided by 22. 11 Calculate the remainder when 417 is divided by 106. 99 What is the remainder when 6730 is divided by 34? 32 What is the remainder when 12609 is divided by 97? 96 What is the remainder when 421 is divided by 47? 45 What is the remainder when 1278 is divided by 61? 58 What is the remainder when 2537 is divided by 845? 2 What is the remainder when 459 is divided by 19? 3 Calculate the remainder when 1138 is divided by 31. 22 Calculate the remainder when 103 is divided by 27. 22 Calculate the remainder when 76 is divided by 32. 12 Calculate the remainder when 215 is divided by 10. 5 Calculate the remainder when 13 is divided by 7. 6 What is the remainder when 142 is divided by 24? 22 Calculate the remainder when 3379 is divided by 169. 168 What is the remainder when 1197 is divided by 50? 47 Calculate the remainder when 71 is divided by 41. 30 What is the remainder when 133 is divided by 59? 15 Calculate the remainder when 325 is divided by 320. 5 What is the remainder when 47 is divided by 33? 14 Calculate the remainder when 17851 is divided by 113. 110 Calculate the remainder when 220 is divided by 17. 16 What is the remainder when 296 is divided by 50? 46 Calculate the remainder when 287 is divided by 24. 23 Calculate the remainder when 3375 is divided by 7. 1 Calculate the remainder when 20 is divided by 14. 6 What is the remainder when 652 is divided by 315? 22 Calculate the remainder when 1139 is divided by 52. 47 Calculate the remainder when 275 is divided by 36. 23 What is the remainder when 6310 is divided by 12? 10 Calculate the remainder when 874 is divided by 88. 82 What is the remainder when 572 is divided by 64? 60 What is the remainder when 16684 is divided by 18? 16 What is the remainder when 101 is divided by 34? 33 What is the remainder when 2922 is divided by 43? 41 What is the remainder when 79 is divided by 17? 11 What is the remainder when 65 is divided by 51? 14 What is the remainder when 1307 is divided by 117? 20 Calculate the remainder when 1801 is divided by 19. 15 What is the remainder when 161 is divided by 15? 11 Calculate the remainder when 57 is divided by 16. 9 Calculate the remainder when 171 is divided by 35. 31 Calculate the remainder when 1596 is divided by 41. 38 What is the remainder when 398 is divided by 99? 2 What is the remainder when 41 is divided by 16? 9 What is the remainder when 900 is divided by 41? 39 What is the remainder when 1599 is divided by 229? 225 What is the remainder when 58 is divided by 41? 17 Calculate the remainder when 4908 is divided by 45. 3 Calculate the remainder when 875 is divided by 88. 83 What is the remainder when 309 is divided by 62? 61 Calculate the remainder when 122 is divided by 42. 38 Calculate the remainder when 358 is divided by 19. 16 What is the remainder when 303 is divided by 22? 17 What is the remainder when 367 is divided by 64? 47 Calculate the remainder when 67 is divided by 27. 13 Calculate the remainder when 333 is divided by 21. 18 Calculate the remainder when 467 is divided by 170. 127 What is the remainder when 500 is divided by 42? 38 Calculate the remainder when 1553 is divided by 771. 11 Calculate the remainder when 514 is divided by 40. 34 Calculate the remainder when 1281 is divided by 638. 5 What is the remainder when 6839 is divided by 10? 9 What is the remainder when 87 is divided by 31? 25 Calculate the remainder when 106 is divided by 46. 14 Calculate the remainder when 168 is divided by 9. 6 What is the remainder when 121 is divided by 60? 1 Calculate the remainder when 296 is divided by 11. 10 Calculate the remainder when 3498 is divided by 577. 36 Calculate the remainder when 148 is divided by 8. 4 Calculate the remainder when 789 is divided by 39. 9 Calculate the remainder when 740 is divided by 75. 65 Calculate the remainder when 789 is divided by 134. 119 What is the remainder when 1503 is divided by 26? 21 What is the remainder when 179 is divided by 40? 19 Calculate the remainder when 222 is divided by 78. 66 Calculate the remainder when 601 is divided by 149. 5 What is the remainder when 296 is divided by 31? 17 What is the remainder when 164 is divided by 34? 28 What is the remainder when 172 is divided by 7? 4 What is the remainder when 1514 is divided by 38? 32 Calculate the remainder when 3345 is divided by 134. 129 Calculate the remainder when 131 is divided by 28. 19 Calculate the remainder when 140 is divided by 49. 42 What is the remainder when 279 is divided by 18? 9 Calculate the remainder when 79 is divided by 50. 29 What is the remainder when 151 is divided by 22? 19 What is the remainder when 677 is divided by 18? 11 Calculate the remainder when 411 is divided by 59. 57 What is the remainder when 2539 is divided by 423? 1 Calculate the remainder when 191 is divided by 39. 35 Calculate the remainder when 3145 is divided by 123. 70 Calculate the remainder when 137 is divided by 28. 25 What is the remainder when 1355 is divided by 64? 11 Calculate the remainder when 992 is divided by 73. 43 Calculate the remainder	{ "pile_set_name": "DM Mathematics" }
ulate the remainder when 42259 is divided by 14086. 1 Calculate the remainder when 8190 is divided by 1016. 62 Calculate the remainder when 1063086 is divided by 10. 6 Calculate the remainder when 139401 is divided by 27879. 6 Calculate the remainder when 6702 is divided by 2888. 926 Calculate the remainder when 40152 is divided by 17. 15 Calculate the remainder when 10291 is divided by 22. 17 What is the remainder when 33413 is divided by 619? 606 Calculate the remainder when 16124 is divided by 4024. 28 What is the remainder when 107187 is divided by 90? 87 Calculate the remainder when 70677 is divided by 380. 377 What is the remainder when 12164 is divided by 1369? 1212 Calculate the remainder when 55482 is divided by 235. 22 What is the remainder when 48459 is divided by 12061? 215 Calculate the remainder when 556 is divided by 14. 10 What is the remainder when 41327 is divided by 13731? 134 Calculate the remainder when 2608 is divided by 237. 1 What is the remainder when 37810 is divided by 39? 19 What is the remainder when 1318524 is divided by 439506? 6 What is the remainder when 407577 is divided by 97? 80 Calculate the remainder when 136653 is divided by 936. 933 Calculate the remainder when 346 is divided by 60. 46 What is the remainder when 7838 is divided by 1206? 602 What is the remainder when 7231 is divided by 7210? 21 Calculate the remainder when 253 is divided by 82. 7 What is the remainder when 9279 is divided by 111? 66 Calculate the remainder when 616016 is divided by 247. 245 Calculate the remainder when 6742 is divided by 74. 8 Calculate the remainder when 16480 is divided by 48. 16 What is the remainder when 1082700 is divided by 157? 28 What is the remainder when 11655 is divided by 49? 42 What is the remainder when 2698 is divided by 1272? 154 What is the remainder when 6611 is divided by 45? 41 What is the remainder when 44401 is divided by 21? 7 What is the remainder when 154372 is divided by 95? 92 Calculate the remainder when 39459 is divided by 1793. 13 What is the remainder when 117465 is divided by 172? 161 What is the remainder when 9765 is divided by 4? 1 Calculate the remainder when 163 is divided by 12. 7 Calculate the remainder when 1573 is divided by 113. 104 What is the remainder when 13209 is divided by 352? 185 What is the remainder when 3444248 is divided by 250? 248 What is the remainder when 31681 is divided by 31670? 11 What is the remainder when 7347 is divided by 210? 207 What is the remainder when 1764 is divided by 450? 414 What is the remainder when 75424 is divided by 75385? 39 What is the remainder when 10158 is divided by 922? 16 Calculate the remainder when 424 is divided by 94. 48 What is the remainder when 364 is divided by 253? 111 Calculate the remainder when 81086 is divided by 1126. 14 Calculate the remainder when 722 is divided by 717. 5 Calculate the remainder when 2301 is divided by 942. 417 Calculate the remainder when 20412 is divided by 888. 876 Calculate the remainder when 68247 is divided by 5. 2 What is the remainder when 648 is divided by 285? 78 What is the remainder when 503 is divided by 66? 41 Calculate the remainder when 17132 is divided by 41. 35 What is the remainder when 452277 is divided by 557? 550 Calculate the remainder when 2102182 is divided by 1204. 1202 What is the remainder when 553135 is divided by 630? 625 Calculate the remainder when 286954 is divided by 36. 34 What is the remainder when 1103234 is divided by 33? 11 What is the remainder when 17052 is divided by 13? 9 What is the remainder when 1152908 is divided by 55? 53 What is the remainder when 51865 is divided by 387? 7 Calculate the remainder when 12739 is divided by 710. 669 What is the remainder when 358 is divided by 31? 17 What is the remainder when 12140 is divided by 13? 11 Calculate the remainder when 876 is divided by 307. 262 Calculate the remainder when 123140 is divided by 168. 164 Calculate the remainder when 223686 is divided by 44736. 6 Calculate the remainder when 2066 is divided by 513. 14 Calculate the remainder when 47756 is divided by 120. 116 Calculate the remainder when 23497 is divided by 373. 371 What is the remainder when 75207 is divided by 82? 13 What is the remainder when 371969 is divided by 1141? 3 What is the remainder when 42388 is divided by 54? 52 What is the remainder when 10781 is divided by 19? 8 Calculate the remainder when 3664 is divided by 523. 3 What is the remainder when 831757 is divided by 135? 22 Calculate the remainder when 5194 is divided by 43. 34 What is the remainder when 1632 is divided by 246? 156 Calculate the remainder when 24369 is divided by 9. 6 What is the remainder when 107508 is divided by 71? 14 What is the remainder when 31250 is divided by 10412? 14 Calculate the remainder when 295367 is divided by 372. 371 Calculate the remainder when 112015 is divided by 12441. 46 Calculate the remainder when 62592 is divided by 62584. 8 What is the remainder when 16775 is divided by 2095? 15 What is the remainder when 153677 is divided by 80? 77 Calculate the remainder when 88869 is divided by 161. 158 What is the remainder when 887 is divided by 31? 19 What is the remainder when 55990 is divided by 73? 72 What is the remainder when 132896 is divided by 269? 10 Calculate the remainder when 34894 is divided by 401. 7 What is the remainder when 70908 is divided by 128? 124 What is the remainder when 3191 is divided by 805? 776 Calculate the remainder when 13224 is divided by 154. 134 Calculate the remainder when 1195 is divided by 409. 377 What is the remainder when 808940 is divided by 7354? 0 Calculate the remainder when 46853 is divided by 248. 229 What is the remainder when 723056 is divided by 32? 16 What is the remainder when 4330 is divided by 3? 1 What is the remainder when 1207 is divided by 569? 69 What is the remainder when 5835 is divided by 1919? 78 What is the remainder when 740 is divided by 513? 227 What is the remainder when 9534 is divided by 6874? 2660 What is the remainder when 8968 is divided by 1585? 1043 What is the remainder when 7388439 is divided by 183? 180 What is the remainder when 8051 is divided by 503? 3 Calculate the remainder when 5973 is divided by 1988. 9 Calculate the remainder when 106852 is divided by 3955. 67 Calculate the remainder when 4884 is divided by 16. 4 Calculate the remainder when 9602 is divided by 177. 44 Calculate the remainder when 17239 is divided by 15. 4 What is the remainder when 837545 is divided by 1782? 5 What is the remainder when 15736 is divided by 71? 45 Calculate the remainder when 1675 is divided by 410. 35 Calculate the remainder when 308273 is divided by 1614. 1613 Calculate the remainder when 2294 is divided by 15. 14 What is the remainder when 3331 is divided by 28? 27 Calculate the remainder when 124974 is divided by 103. 35 Calculate the remainder when 924 is divided by 451. 22 What is the remainder when 18711 is divided by 197? 193 Calculate the remainder when 188 is divided by 157. 31 Calculate the remainder when 21581 is divided by 696. 5 Calculate the remainder when 36100 is divided by 1094. 1092 What is the remainder when 31853 is divided by 204? 29 What is the remainder when 1120 is divided by 17? 15 Calculate the remainder when 9732 is divided by 174. 162 Calculate the remainder when 8051 is divided by 608. 147 What is the remainder when 15635 is divided by 15585? 50 Calculate the remainder when 2377 is divided by 542. 209 Calculate the remainder when 11725 is divided by 59. 43 What is the remainder when 20591 is divided by 144? 143 What is the remainder when 110395 is divided by 10035? 10 What is the remainder when 24319 is divided by 236? 11 Calculate the remainder when 15770 is divided by 1970. 10 Calculate the remainder when 2316 is divided by 452. 56 What is the remainder when 69570 is divided by 34561? 448 What is the remainder when 292641 is divided by 132? 129 What is the remainder when 218790 is divided by 2701? 9 Calculate the remainder when 17252 is divided by 480. 452 What is the remainder when 56852 is divided by 37? 20 What is the remainder when 8418 is divided by 1201? 11 Calculate the remainder when 226017 is divided by 8. 1 What is the remainder when 7	{ "pile_set_name": "DM Mathematics" }
i(n) = 5n2 + 4n - 13. Give -4b(r) + 9i(r). r*2 - 13 Let j(k) = -k. Let g(c) = 18c + 2. Determine -g(d) - 5j(d). -13d - 2 Let y(p) = -2p3 - 4p*2 + 48p + 3. Let j(u) = -u*3 - 3u*2 + 49u + 2. What is -3j(i) + 2y(i)? -i3 + i2 - 51i Let g(d) = 7d*3 - 7d*2 + d. Let l(j) = -6j*3 + 6j*2 - j. Determine -4g(z) - 5l(z). 2z*3 - 2z*2 + z Let a(k) = -4k*3 - 2k*2 - 3k - 1. Let t(l) = -7l3 - 3l*2 - 5l - 2. Let r be (1/1)/((-12)/(-24)). Suppose 8 = -2f - r. What is fa(i) + 3t(i)? -i3 + i2 - 1 Let h(p) = p. Let a(z) = -2z3 - z2 - z + 1. Let k be a(1). Let r(n) = -4n + 3. Let j = -1122 - -1121. Determine jr(f) + kh(f). f - 3 Let r(q) = -15q. Let j(y) = 46y. What is -2j(a) - 7r(a)? 13a Let l(v) = v*3 + 21v*2 - v - 27. Let q be l(-21). Let m(s) = 2s*2 + 6. Let w(o) = 3o*2 + 7. Calculate qm(f) + 5w(f). 3f2 - 1 Let o(l) = -l3 - 17l2 + 2l + 27. Let w be o(-17). Let v(t) = -16t. Let n(m) be the first derivative of -5m*2/2 + 2. Give wn(j) + 2v(j). 3j Let w(s) = -6s3 + 2s*2 - 3s. Suppose -5b = 7b + 36. Let z(v) = v*3 + v. Calculate bz(k) - w(k). 3k3 - 2k*2 Let f(v) = -2v*2 - 17v + 8. Let r(b) = b*2 + 6b - 3. Suppose 9j + 160 - 61 = 0. What is jr(z) - 4f(z)? -3z*2 + 2z + 1 Suppose -4z = -3z + 4y - 5, 5z + 3y = 25. Let q(d) = -d. Let w(g) = 6g + 2. Calculate zq(p) + w(p). p + 2 Let k(t) = t + 5. Let g(o) = 3 + 3 - 7 + 0. Let y(h) = -2h*3 - 2h + 1. Let i be y(1). Determine ik(m) - 15g(m). -3m Let z(q) = -47q - 5. Let f(n) = -94n - 9. Determine 6f(b) - 11z(b). -47b + 1 Let q(u) = 8u3 - 17u*2 - 78u. Let p(f) = -3f3 + 6f*2 + 26f. Calculate -17p(z) - 6q(z). 3z3 + 26z Let a(h) = -3 + 4h3 + 17h2 + h3 - 9h - 10h*2. Let s(p) = 2p*3 + 3p*2 - 4p - 1. Calculate 3a(b) - 7s(b). b3 + b - 2 Let v(i) = -i2 - i + 1. Suppose -4f + 13 = -5w, -4f = -4w - 11 + 3. Let r be v(f). Let h(j) = -1. Let c(z) = z - 5. What is rh(m) + c(m)? m Let p(w) = 5w2 + 1. Let m(q) = -q2 + 1. Let g(v) = -4m(v) - p(v). Let a(r) = r2 + 3. Determine -10a(h) - 6g(h). -4h*2 Let c(u) = 10u - 5. Let z(g) = -10g + 4. What is 2c(k) + 3z(k)? -10k + 2 Let t(w) be the second derivative of 0 - 1/3w3 - 11w + 3/2w2. Let f = 20 - 28. Let h(o) = -3o + 5. Determine ft(g) + 5h(g). g + 1 Let h(v) = 24v2 + 2v - 2. Let m(j) = -25j2 - 3j + 3. What is 3h(y) + 2m(y)? 22y2 Let b(v) = -4v*3 - 2v*2. Let m(s) be the third derivative of 0 + 0s*4 + 1/30s*5 + 1/40s*6 + 0s*3 + 4s*2 + 0s. Give 5b(h) + 6m(h). -2h3 + 2h*2 Let m(k) = 4k*3 + 5k*2 + 6k. Suppose -2g + 5 = -y, -5y + 2g + 14 = 5g. Let i(o) = -o3 - o2 - o. Determine ym(t) + 6i(t). -2t3 - t2 Let t(f) = 4f*2 - 3. Let u(d) = -5d*2 + 4. Let g be ((-6)/(-9))/(2/(-9)). Determine gu(o) - 4t(o). -o2 Let b(y) = -3y. Let a(z) = -2 - 1 + 2 + z. Let p(q) = -q*2 + 6q + 8. Let x be p(7). Let h be ((-1)/x)/(1/(-2)). Calculate ha(c) + b(c). -c - 2 Let z(g) = 4g*2 - 5g. Let r(b) be the first derivative of 2b3 - 7b*2/2 + 2. Let f = 12 + -7. Give fr(c) - 7z(c). 2c2 Let v(d) = -d3 + 4d - 4. Let u(b) be the first derivative of -b4/2 + 7b*2/2 - 7b - 3. Suppose -3w - 2w = 35. What is wv(f) + 4u(f)? -f3 Let l(k) be the third derivative of -k4/6 - 2k3/3 + 8k*2. Let f(c) = 17c + 17. What is -2f(q) - 9l(q)? 2q + 2 Let g(v) = 5v*3 + 17v2. Let n(a) = 2356 - a3 - 4a2 - 2356. Give 2g(k) + 9n(k). k3 - 2k*2 Let c(z) = -3z*2 - 5z + 5. Let d(l) = -l*2 - 2l + 2. Give -2c(k) + 5d(k). k*2 Let t = 3 - 0. Let f(b) = -b + 1. Let u(v) = -2v - 6v + 3v + 2. Calculate tf(d) - u(d). 2d + 1 Let p(g) be the first derivative of -2g3/3 - 7g - 6. Let h(m) = m*2 + 4. Give 7h(n) + 4p(n). -n2 Let y(t) = -3t*2 + 5t - 2. Suppose 0 = 5m + 191 - 1. Let v be m/(-6) - (-2)/3. Suppose 3o - 16 = -v. Let q(k) = -2k2 + 3k - 1. Give oy(s) - 5q(s). s*2 - 1 Let u(d) = d - 8. Let s(h) = h - 7. Calculate -5s(y) + 4u(y). -y + 3 Let c(h) = -h2 + h - 1. Let d = 16 - 10. Let v be (-4)/1 + 1 + 2. Let m(f) = -2f*3 - 7f*2 + 6f - 6. Calculate dc(o) + vm(o). 2o3 + o2 Let u(d) = -2d*2 - 9d*2 - 5 + 6d + 10 + 8d2. Suppose -7s + 16 = -3s. Let g(t) = -t2 + t + 1. Let q = -1 - 0. Give qu(i) + sg(i). -i2 - 2i - 1 Let t(i) = -i*2 + 3i + 2. Let b(x) = 3x2 - 9x - 7. Determine 3b(p) + 8t(p). p*2 - 3p - 5 Let d(k) = 55k2 - 65. Let n = -50 + 115. Let z(h) = -5h*2 + 6. Calculate nz(q) + 6d(q). 5q*2 Let j(m) = -7m*2 - 5m. Let s(c) = -4c2 - 3c. Suppose f + 2f = -2q + 3, 2q - 2f = 8. Calculate qj(l) - 5s(l). -l*2 Let m(n) = 7n + 6. Let q(h) = -h - 1. Suppose -5c - 3 = -2c. Determine cm(f) - 6q(f). -f Let a(y) = -8y3 + 4y*2 + 2y + 3. Let v(j) = j3 - j2 - 1. Give -a(x) - 6v(x). 2x*3 + 2x*2 - 2x + 3 Let o(z) = -2z3 + 8z2. Let a = -12 + 17. Let s(t) = -t3 + 5t2. Determine ao(p) - 8s(p). -2p*3 Suppose 3h = -3m + 3, 27 = m - 4h + 1. Let w(q) = -6q2 - 17q - 17. Let t(s) = -s*2 - 3s - 3. What is mw(n) - 34t(n)? -2n2 Let r(x) = 2x*2 + 2x + 2. Let c(n) = -4n2 - 5n - 5. Suppose 2b - 3z = 18, 5z + 26 = -0b + 3b. Suppose -6 = -6t + b. Calculate tc(h) + 7r(h). 2h2 - h - 1 Suppose -7 = 5h + 18. Let l(b) = 6b. Let d(z) = -z. Calculate hd(c) - l(c). -c Suppose -3c = -8c - 20. Let n(k) be the third derivative of k6/60 + k4/4 + 2k3/3 - k2. Let d(t) = t + 1. Determine cd(v) + n(v). 2v3 + 2v Let n(r) = -6r - 1. Suppose -4p + 71 = -9. Suppose -2t - p = 3t. Let z(o) = 11o + 2. Give tz(f) - 7n(f). -2f - 1 Let w(o) = -o - 8o - 10o*2 - 7o*2 + 5 - 1. Let p(g) = -8g*2 - 4g + 2. Calculate -7p(y) + 3w(y). 5y2 + y - 2 Suppose 5y - 5j - 15 = 0, 5y - 31 = -2j - j. Suppose -y = -3z + 2z. Let t(l) = 3l*3 - 7l + 4. Let x(v) = 5v3 - 11v + 6. What is zx(r) - 8t(r)? r*3 + r - 2 Let h(g) = 44g*3 + 11g*2 + 11g + 11. Let k(y) = 11y3 + 3y*2 + 3y + 3. Give -3h(r) + 11k(r). -11r3 Let u(t) = 50t + 8. Let s(i) = -17i - 3. What is 8s(n) + 3u(n)? 14n Let n(a) = -2a. Let q(m) = 19m - 16m - 2m. Determine -3n(c) - 8q(c). -2c Let m(a) = a - 1. Suppose -i + 5d = -15, 0i + 5i - 33 = 4d. Suppose v = 2g + 2v + 3, -2v = -ig - 12. Let p(y) = y3 - 3y + 4. What is gp(w) - 6m(w)? -2w3 - 2 Let i(o) = 11o2 + 8. Let k(j) = 5 - j2 - 7j2 + 15j*2. Suppose 0 = -g + 2g + 2n - 12, 5n = 5g - 30. Give gk(h) - 5i(h). h2 Let s(i) be the first derivative of -i - 14. Let t(o) = 2o + 10. Calculate -12s(j) - t(j). -2j + 2 Let b(s) = s3 + s2 - 1. Let o(q) = 2q2 - 4. What is 2b(j) - o(j)? 2j3 + 2 Let k(h) = 4h + 5. Let o(l) = 10l + 12. Suppose -3t + 48 = t. Determine tk(z) - 5o(z). -2z Let f(k) = -40k + 5. Let q(x) = -79x + 9. Determine 5f(m) - 3q(m). 37m - 2 Let u(s) = 5s2 - 7s + 1. Let l(g) be the second derivative of -g4/3 + g3 - g*2/2 + 7g. What is 7l(z) + 6u(z)? 2z2 - 1 Let m(f) = 9f*2 + 7f + 9. Let d = 0 + 5. Let j be d/3(2 - -1). Let p(x) = -13x*2 - 10x - 13. What is jp(a) + 7m(a)? -2a2 - a - 2 Let p(g) = 4. Suppose 2v = r - 54, 2v + 3v - 4r = -132. Let a(x) = -x2 - 28. Calculate vp(n) - 4a(n). 4n2 Let v(d) = -d3 - d*2 - d. Let q be 2/7 - (-26)/7. Let h = -2 + q. Let f(p) = 12p*h + 2 + 11p*3 + 0 + 3p*3 + 14p - 2p. What is -f(w) - 12v(w)? -2w3 - 2 Let s(t) = 4t*3 - 5t*2 + 3t - 1. Let u(a) = -3a3 + 6a*2 - 3a + 1. What is -6s(p) - 5u(p)? -9p3 - 3p + 1 Let u(q) = -5q + 16. Let y(v) = 14v - 48. Calculate -11u(w) - 4y(w). -w + 16 Let p(f) = 5f2 + f - 5. Let i(s) be the third derivative of s5/15 + s4/12 - 2s*3/3 - 10s*2. Determine 3i(m) - 2p(m). 2m*2 + 4m - 2 Let n(r) = r*2 + 7r - 4. Let i(h) = -2h2 - 13h + 7. Determine -6i(s) - 11n(s). s*2 + s + 2 Let v(c) = -3. Let h(x) = -x + 1. Let n = -66 - -67. Give nv(y) + h(y). -y - 2 Let r(z) = -4z - 6. Let i(f) = -3f - 5. Calculate 6i(v) - 5r(v). 2v Let m(n) = -19 + n2 + 19 + 10n*2. Let z(o) = -5o*2. Suppose 2s + 4p + 3 = -25, 0 = 5s - 2p + 10. Give sm(w) - 9*z(w). w	{ "pile_set_name": "DM Mathematics" }
ator of -76/9 and 97/94? 846 What is the common denominator of -7/7729 and -47/262? 15458 What is the smallest common multiple of 1821 and 15? 9105 What is the least common multiple of 952 and 56? 952 What is the least common multiple of 966 and 966? 966 What is the common denominator of 32/209 and 21/76? 836 What is the smallest common multiple of 1572 and 30? 7860 Calculate the smallest common multiple of 4 and 200. 200 What is the least common multiple of 11 and 145? 1595 Find the common denominator of -83/248 and 85/52. 3224 Calculate the least common multiple of 6 and 11121. 22242 Calculate the smallest common multiple of 599 and 1198. 1198 What is the common denominator of -21/592 and -29/16? 592 Find the common denominator of 49/1630 and 62/3. 4890 What is the common denominator of -29/4 and 41/1162? 2324 Find the common denominator of 41/30 and -139/558. 2790 Calculate the smallest common multiple of 216 and 243. 1944 What is the common denominator of 26/125 and -13/200? 1000 What is the lowest common multiple of 63 and 81? 567 Calculate the least common multiple of 32 and 394. 6304 What is the common denominator of 62/5075 and 127/70? 10150 What is the least common multiple of 201 and 2881? 8643 Find the common denominator of -35/2776 and -93/104. 36088 Calculate the smallest common multiple of 45 and 18. 90 What is the common denominator of -83/6 and -47/573? 1146 Find the common denominator of 131/6 and 49/320. 960 Find the common denominator of -16/27 and -7/10. 270 Calculate the least common multiple of 39 and 3. 39 Calculate the common denominator of -115/4938 and 47/45. 74070 What is the common denominator of -24/305 and 23/55? 3355 Calculate the smallest common multiple of 253 and 966. 10626 Calculate the common denominator of -151/270 and -11/210. 1890 Calculate the smallest common multiple of 154 and 88. 616 What is the lowest common multiple of 4 and 2274? 4548 Calculate the least common multiple of 126 and 33. 1386 Calculate the least common multiple of 81 and 81. 81 Calculate the common denominator of -73/22582 and -30. 22582 Calculate the common denominator of 91/345 and -44/5865. 5865 Find the common denominator of -13/539 and 3/121. 5929 What is the smallest common multiple of 23 and 3? 69 What is the common denominator of -7/774 and -75/28? 10836 What is the common denominator of -157/3330 and -79/108? 19980 What is the common denominator of 32/135 and 49/3? 135 What is the smallest common multiple of 540 and 20? 540 Find the common denominator of -45/1156 and -57/2890. 5780 What is the common denominator of 97/438 and 85/6? 438 Calculate the common denominator of 49/240 and 19/920. 5520 What is the lowest common multiple of 165 and 66? 330 What is the smallest common multiple of 20 and 50? 100 Calculate the smallest common multiple of 63 and 294. 882 Find the common denominator of 97/1402 and -45/701. 1402 Find the common denominator of 79/258 and -33/344. 1032 What is the lowest common multiple of 80 and 48? 240 What is the least common multiple of 22 and 94? 1034 What is the common denominator of 103/12 and -83/26? 156 What is the least common multiple of 72 and 360? 360 Calculate the smallest common multiple of 64 and 96. 192 Find the common denominator of -57/70 and -125/42. 210 Calculate the common denominator of -47/10 and -3/26. 130 What is the common denominator of -29/2 and 115/222? 222 Calculate the smallest common multiple of 135 and 6. 270 Calculate the common denominator of 85/8 and -91/20. 40 What is the least common multiple of 184 and 18? 1656 What is the smallest common multiple of 168 and 8? 168 Find the common denominator of 65/112 and 127/42. 336 Find the common denominator of -71/2420 and -193/330. 7260 What is the smallest common multiple of 18 and 36? 36 What is the common denominator of 23/1168 and 99/32? 2336 Find the common denominator of 19/20 and -91/180. 180 What is the smallest common multiple of 12 and 708? 708 What is the common denominator of 97/6 and 55/522? 522 Calculate the lowest common multiple of 786 and 258. 33798 Calculate the lowest common multiple of 4 and 38. 76 What is the lowest common multiple of 435 and 9? 1305 Find the common denominator of -103/720 and 157/4680. 9360 Find the common denominator of -15/14 and 17/3190. 22330 What is the common denominator of -7/198 and -46/297? 594 What is the smallest common multiple of 4 and 1390? 2780 Calculate the lowest common multiple of 5393 and 11. 59323 What is the common denominator of 119/20 and -83/8608? 43040 What is the common denominator of -8/11 and -1/4237? 46607 What is the smallest common multiple of 7 and 1? 7 Find the common denominator of 53/30 and 3/220. 660 What is the lowest common multiple of 12 and 687? 2748 What is the common denominator of 35/2 and -33/872? 872 Calculate the smallest common multiple of 3 and 4. 12 Calculate the common denominator of -18/11 and 83/190. 2090 What is the least common multiple of 4885 and 7? 34195 Calculate the common denominator of 89/15 and 145/252. 1260 What is the lowest common multiple of 27 and 2928? 26352 Calculate the least common multiple of 11139 and 33. 122529 What is the least common multiple of 644 and 184? 1288 What is the least common multiple of 385 and 8? 3080 What is the lowest common multiple of 3012 and 84? 21084 What is the least common multiple of 272 and 68? 272 Calculate the smallest common multiple of 678 and 9. 2034 Calculate the common denominator of 131/138 and 71/18. 414 What is the lowest common multiple of 36 and 582? 3492 Calculate the common denominator of 7/424 and -83/2. 424 Calculate the smallest common multiple of 72 and 21. 504 What is the lowest common multiple of 248 and 14? 1736 What is the least common multiple of 80 and 16? 80 Calculate the common denominator of -47/220 and 101/176. 880 What is the least common multiple of 1 and 4026? 4026 Find the common denominator of -43/402 and 16/737. 4422 Calculate the common denominator of -53/870 and 5/1566. 7830 What is the lowest common multiple of 115 and 55? 1265 Calculate the common denominator of -61/3554 and -79/4. 7108 What is the smallest common multiple of 44 and 330? 660 Calculate the lowest common multiple of 556 and 44. 6116 Calculate the smallest common multiple of 56 and 210. 840 Calculate the smallest common multiple of 72 and 27. 216 Calculate the least common multiple of 805 and 138. 4830 Find the common denominator of -28/11 and -109/10. 110 What is the common denominator of -19/309 and 47/824? 2472 Find the common denominator of -28/75 and 149/30. 150 What is the least common multiple of 185 and 180? 6660 What is the common denominator of 5/21 and -32/35? 105 What is the least common multiple of 72 and 60? 360 Calculate the common denominator of -97/28 and 93/128. 896 Calculate the least common multiple of 27 and 4854. 43686 Calculate the lowest common multiple of 45 and 48. 720 Find the common denominator of -25/106 and -79/20. 1060 Find the common denominator of 163/660 and 58/1485. 5940 What is the common denominator of -137/12 and 1/192? 192 Calculate the smallest common multiple of 665 and 30. 3990 What is the least common multiple of 748 and 132? 2244 What is the common denominator of -123/3380 and 47/6084? 30420 Find the common denominator of -151/132 and -41/3. 132 Calculate the common denominator of -32/75 and -161/90. 450 What is the smallest common multiple of 231 and 48? 3696 Calculate the smallest common multiple of 5 and 100. 100 What is the lowest common multiple of 64 and 16? 64 What is the lowest common multiple of 96 and 36? 288 What is the smallest common multiple of 75 and 150? 150 Calculate the common denominator of 61/3 and 52/333. 333 Calculate the least common multiple of 4 and 5. 20 Calculate the common denominator of 131/282 and -79/6. 282 What is the smallest common multiple of 605 and 165? 1815 Calculate the least common multiple of 220 and 6. 660 Calculate the lowest common multiple of 36 and 16. 144 Calculate the least common multiple of 17 and 79. 1343 What is the smallest common multiple of 90 and 660? 1980 Calculate the common denominator of -41/88 and -111/20. 440 What is the lowest common multiple of 630 and 2961? 29610 Calculate the lea	{ "pile_set_name": "DM Mathematics" }
+ 5 + l - 5) in the form dl + ql*2 + v and give q. 10 Rearrange -c + 6c*4 - 5c4 - c3 + 11c2 + 3c*3 - 2 - c to the form vc*4 + dc*2 + oc + kc3 + l and give d. 11 Rearrange (-86v + 86v + 28v*2)(v - 4v + 2v + 2) to the form x + ov + mv*3 + sv*2 and give s. 56 Express 57r + 15r + 10r as tr + u and give t. 82 Express -z3 + 78z*2 + 2z - 4z4 - 78z*2 as vz + jz4 + mz*2 + tz*3 + s and give m. 0 Rearrange -9j*2 - 1 - 1 + 34j*2 to the form i + uj*2 + vj and give u. 25 Rearrange -3g2 + 33g - 4g2 + 6g*2 + 0g*2 to the form mg + ug2 + q and give q. 0 Rearrange 12g*2 - 60 + 60 + 37g*2 to dg + t + kg2 and give d. 0 Express -f + 2 + 2f3 + f4 + 2 - 3 - 3 in the form i + cf + df*3 + xf*2 + rf*4 and give c. -1 Express (0v + 0v + 2v)((-29 - 9 - v + 0v)(2v + 0 + 0) - 3v2 + 2v*2 + 2v*2) in the form sv + iv3 + n + wv*2 and give i. -2 Rearrange (-13 - 3 + 4)(4l - 2l - 5l)(-l*3 - l + l) to the form vl + al2 + b + ol*3 + zl*4 and give z. -36 Rearrange -3j*3 + 0j*2 + 0j*2 + (0j*2 + 3j*2 + 0j*2)(4j - 2j - 3j) to the form rj*3 + cj*2 + nj + f and give r. -6 Express 53g - 4g*2 - 53g in the form x + fg2 + lg and give f. -4 Rearrange 65d2 - 17d*2 - 198 + 198 to y + bd + pd2 and give y. 0 Rearrange (-3 + 3 + 2d)(-2 + 2 + 2)(1 + 3 + 0)(-4d*2 + 2d*2 + 4d*2) + 25d - 25d - 8d*3 to the form q + pd + hd2 + ad3 and give a. 24 Rearrange f2 - 3f - 5f*2 - 7f*2 to xf*2 + a + df and give x. -11 Rearrange (n + n - n - 3 + 3n + 3 + (3n - 2n + n)(3 - 3 + 1) - 3n + 3n - 3n)(-2 + 1 + 0)(-1 - 1 + 4) to the form xn + d and give x. -6 Rearrange -117v4 + 90v*4 - 129v*4 + (0v - 3v + 4v)(-v3 - v3 + 3v*3) to jv*3 + pv + nv4 + u + gv2 and give j. 0 Rearrange -s2 + 0s + 6s - s to the form rs2 + f + hs and give h. 5 Rearrange 20d + 0 + 0 + 19d to the form md + q and give m. 39 Rearrange ((3y - 38 + 47 - y)(4 - 4 - 2y2) - y3 - 3y3 + 3y*3)(2y + 0y - 5y) to py + a + sy2 + ry*3 + ty*4 and give s. 0 Rearrange (-2c*2 + 2c*2 + 2c*2)((-3 + c + 3)(1 - 2c - 1) + 28c2 - 4c*2 + 25c*2) to wc*3 + hc + yc4 + mc*2 + j and give y. 94 Express (-6 + 6 - 3i)(0i - 2i + i)(5i - 12i - 2i) as si*3 + b + xi*2 + wi and give s. -27 Express -2b - 4b*3 - 7 - 4b*2 + 7 + 6b*3 in the form n + wb*2 + ub*3 + mb and give n. 0 Express (-58 - 17i + 16i + 33)(0 + 3 - 5) in the form ri + g and give g. 50 Rearrange (9 + 6 - 6k - 16)(5 - 2 - 1) to j + vk and give v. -12 Express -5 - 3v - 5 + 4v + 11 + v2 in the form zv*2 + qv + j and give j. 1 Rearrange -5 + n*2 + 0n*2 - 6n*2 - 3 to the form xn + b + yn2 and give b. -8 Rearrange 2 + 2m - 2 + (2 - 2 - 2m)(4 - 4 - 3) to b + tm and give t. 8 Rearrange (2a - 5a - 5a)(-1 + 1 + 2a)(a - a - 2a) to ya3 + w + za + pa2 and give w. 0 Express (-b + b + b2)(0b + 3b + 0b)((-2 - 1 + 2)(3 + 0 - 5) + (1 - 4 + 1)(2 - 2 + 1) + 3 - 1 - 4) as ob2 + sb*3 + tb + k and give s. -6 Express (b3 + b3 + 0b3)(5 + 0 - 4) - 36 - 4b3 + 36 as ib + mb2 + t + zb*3 and give z. -2 Express (-146 + 146 - 19r*2)((-2 + 2 + 2r)(-r + r + r) + 2r2 + 0 + 0) in the form sr*4 + kr + cr3 + hr2 + m and give s. -76 Rearrange -r3 + 3r3 - 3r*3 + 2r*3 - 2r3 - r3 + (3 - r - 3)(-5r*2 + 2r2 + r2) + 3r3 - 8r + 8r to dr*2 + v + fr + nr3 and give n. 3 Rearrange 0t*2 + 2t*4 + t + 36t*3 - 2 + 0t*2 - 33t*3 to the form gt + b + pt3 + rt*4 + wt*2 and give b. -2 Express -1 + 6l*4 + 0l*2 - 454l*3 + 2l*2 + 453l*3 as il*3 + tl*4 + v + xl*2 + rl and give t. 6 Express -17 + 13h2 - 23 + 41 in the form b + kh + dh2 and give d. 13 Express (-2 + 2a + 2)(-2a - 6a - 3a)(1 - 1 - 1) as pa*2 + ka + d and give p. 22 Rearrange 2l2 + 98l3 + l4 + 5 - 100l3 - 2l*4 to sl + hl3 + yl*2 + bl*4 + w and give y. 2 Rearrange (-40 + 40 + 8z)(3 + 2z - 3) + (2 - 4 + 0)(-5z2 + z2 + 2z2) to the form v + wz*2 + qz and give w. 20 Rearrange 2c3 + 2c*2 - 2c*2 + (c + 5c - 4c)(c2 + c2 - 4c2) - 2c*2 - 3c*3 + 7c3 - c3 to the form mc + qc*3 + f + hc*2 and give h. -2 Express 7h - 7h + 22h as oh + v and give o. 22 Express -2w*2 + 3w*3 + 3w*2 + 0w*2 - 2w*2 + 1 as zw + xw3 + vw*2 + a and give v. -1 Rearrange 8 + 16u - 7 - 1 to nu + d and give n. 16 Express (1 + 0 + 1)(42h + 150h + 32h) as v + gh and give g. 448 Express -16 + 16 + 13o - 3o + 3o + 2o - 3 - 2o + 3 + (-1 + 2 + 1)(1 + 2o - 1) - 2 - o + 2 in the form bo + t and give b. 16 Rearrange (0g + 0g + g)(0g + g - 2g) + 3g*2 - 4g + 4g + 2g to ag + jg*2 + w and give j. 2 Express 23t*4 + 1 - 4t - 25t4 - 8t*2 + 6t*2 in the form ct*3 + ot*2 + ft*4 + ut + w and give w. 1 Rearrange (-y2 + y2 - y*3)(-23 + 5 - 1) to jy2 + q + ly + ky3 and give k. 19 Express -r2 - 2 + 2 + (4 - 2 - 1)(-14r2 - 11r*2 - 3r*2) as kr*2 + yr + s and give k. -29 Rearrange 3k2 + 7k*2 - 4k*2 + 3 - 2 to f + zk + gk2 and give f. 1 Express 2 - 12q - 3q2 + 0q*2 - 9q + q*2 in the form vq*2 + j + lq and give j. 2 Rearrange 5r2 + 5r - 10r + 2 + 8r to the form nr + i + pr*2 and give n. 3 Rearrange (-2 + 2 - 2l)(2l + 0 + 0) - 19l - 5l*2 + 24l - 15l + 2l*2 - 5l2 + l2 to p + il2 + bl and give i. -11 Rearrange 108d3 - 3 - 114d*3 + 0 to the form yd*2 + kd + h + xd3 and give h. -3 Rearrange 21c*3 - 41c*3 + 31c*3 + (0c*2 - 4c*2 + 2c*2)(3c + 3c - 3c) to the form pc*2 + qc + g + ic3 and give i. 5 Rearrange -3b + 8b + 15b to the form rb + k and give r. 20 Express 4 + x - 4 + (-3 + 4 + 1)(-8x - 12x - 2x) in the form yx + l and give y. -43 Express (3z + 2z - 4z)(-1 + 4 - 2)(13 - 7 - 64) as f + mz and give m. -58 Rearrange (4z + 33z + 2 - z)(1 + 0 + 1) to the form c + yz and give c. 4 Rearrange -3p + 2p - 6 + 3 + p + 0 + 0 + (2 + 4 - 4)(4p - 2p - 4p) + 5p - p + p - 3p - p + 5p to k + wp and give k. -3 Rearrange (t - 2t - t)(0 - 4 + 2) + (-t - 4t + 6t)(-6 + 5 - 8)(-1 + 2 - 2) to q + ot and give o. 13 Rearrange (8a - 3a - 2a)(-31 + 1 - 38) to ua + t and give u. -204 Express (-73v + 73v + 24v2)(0 + 1 + 0) + 2v2 - 3v*2 + 0v*2 in the form fv + lv2 + i and give l. 23 Express (-77l + 10802 - 10802)(2 - 3 + 3) in the form rl + v and give r. -154 Express -4v2 + 11v*2 - 7v*2 + 13v*2 as qv + fv2 + w and give f. 13 Rearrange 12v*4 - v - 13v*4 - 21 - 30 to mv + h + uv3 + nv*4 + fv*2 and give n. -1 Rearrange -4 + 3 + g - 2g3 + g4 - 5g2 + 4g*3 to the form vg*3 + kg*2 + yg + fg4 + n and give n. -1 Rearrange i - 118i*2 + 120i*2 + i to ui + v + hi2 and give u. 2 Express -c4 + 2c - 2c + (2c - c - 3c)(0 + 0 + 2c3) + (0c + 0c + 3c*3)(-3 - 2c + 3) as vc + pc3 + qc*4 + k + dc*2 and give q. -11 Rearrange -24l*2 + 3l*2 + 21l*2 - 110l*4 + (4 - 4 + 2l*4)(1 - 2 + 3) to kl4 + b + ol + vl3 + wl*2 and give k. -106 Rearrange -9k*4 + 2 - 2k*3 + 4k*4 + 4k*4 + k + 0 to j + pk + rk4 + ok*2 + zk*3 and give p. 1 Rearrange -22c + 38c + 41c to the form h + nc and give n. 57 Express (3p*2 + p - p)(-2p + 0p - p)(0p + 2p - p) as k + jp + yp3 + xp*2 + mp*4 and give m. -9 Express (734q - 734q - 6 - q2)(4q2 + q2 - 3q*2) in the form wq*4 + l + cq + kq2 + mq*3 and give k. -12 Rearrange (100 - 50 - 3)(-2v + 2v + 2v + (3v - v - 3v)(-4 + 4 - 2) - 2 + v + v + 5) to gv + i and give i. 141 Rearrange 71 - 71 - 10k4 + k + k2 to wk4 + x + ik*3 + lk*2 + rk and give r. 1 Express 2o3 - 29o + 14o + 3o*4 - 1 + 11o as no + j + fo*4 + ho*2 + wo3 and give h. 0 Rearrange -b2 - 3b2 + 6b*2 - 5b*2 + 8 - 8 + (0 + 3 - 1)(2b2 + 0b + 0b) to the form cb*2 + hb + l and give c. 1 Rearrange (52 - 69 + 87)(2k + 2k - 3k)(-2k + k*2 + 2k) to the form ok3 + xk*2 + ak + p and give o. 7	{ "pile_set_name": "DM Mathematics" }
*4 + x + hf and give v. 1 Rearrange 26a2 - 7a*3 - 4a*2 - 5a*3 - 64 + 28a*2 - a + 66 to ya + i + wa3 + sa*2 and give y. -1 Rearrange (-13 + 13 + 29)((2 - 2 - 2)(2n - 2 + 2) + 19n - 12n + 2 + 9n) to gn + r and give r. 58 Rearrange 191n + 197n + 197n - 807n + 205n - 95 to z + qn and give q. -17 Rearrange (k - 6k + k)(k - k + 2k2 + (13k - 2k + 0k)(-16k + 5k - 31k)) to bk + ik*3 + ck*2 + m and give i. 1840 Express 2n - 2n - 2n*2 + (-173n + 66n + 9n)(-4 - 2n + 4) + 4n2 - 2n*2 - 16n*2 in the form o + mn + jn2 and give o. 0 Rearrange (o - 2o - o + (4 - 3 - 2)(0o - 4o + 0o))(6 + 22 - 7)(2 - 1 + 2) to the form y + go and give g. 126 Rearrange -1748i*2 + 73 + 78 - 151 to the form yi + di2 + v and give d. -1748 Express x4 - 6x*4 + 2x*4 + (-62x - 55x + 118x + 1)(1 - x3 + 5 - 2) as z + cx*2 + gx + vx4 + hx*3 and give h. -1 Rearrange -1 - 2c3 + c3 - 39c + 27c + 9c + 2c*2 - 3c*4 to fc*2 + gc*4 + pc*3 + s + tc and give g. -3 Rearrange -55z + 2200 - 25z + 81z to nz + f and give n. 1 Express -1468p - 406p*3 - 1488p + 2956p + 5p*2 in the form op + m + yp2 + cp*3 and give c. -406 Express (0 - 2 + 4)(-53r + 53r - 4r2 + (19r - 11 + 11)(-2 + r + 2)) in the form yr*2 + nr + v and give y. 30 Express 2z2 + 30 + 2z*3 + 109113z - 109113z + (-3 - 6 - 2)(-2z3 - 2z*2 + 0z*2 + 0z*3) as bz*2 + hz*3 + qz + x and give x. 30 Express (-7j3 - 7j*3 + 3j*3)(0 + 0 - j) - 22606 + 22606 - 14j + 3j*4 in the form qj*2 + o + gj + kj3 + aj*4 and give g. -14 Rearrange -26834n + 3076n - 12386n - 6920n to the form qn + h and give q. -43064 Express (-w + 2w + 0w)(-156 - 8w + 50 + 388 - 15w + 478) in the form u + lw + tw2 and give l. 760 Rearrange 9i + 0i3 - 3i*3 + 14i + 31i2 - 15i to x + mi + ci*3 + ni*2 and give n. 31 Express (154 - 465 - 2647)(-p*2 - 2p*2 + 5p*2)(-3p + 4p - 3p) in the form kp + qp3 + n + xp*2 and give q. 11832 Rearrange 1736o - 915o - 149 - 812o to the form co + s and give c. 9 Express -4s - 12s2 - 1120 + 2289 - 1145 in the form gs*2 + h + ks and give h. 24 Express (29 + 3 + 1)(4b - 3b + b)(32b + 57b - 24b + 2b + 0 + 0 + (-b - 1 + 1)(2 - 1 - 2) - 3b - b + 5b) as qb + hb2 + r and give h. 4554 Express -2749 + 8183 - 2631 + 4j - 2634 as vj + t and give v. 4 Express (5 + 0 - 3)(-g - 1 + 1) - 2 + 2 - g + 3g - 3g - g - g + 4g - 2g - 2 + g + 2 + (1 - 6 + 1)(-18g - 353g - 461g) as bg + l and give b. 3326 Rearrange -1975o + 410o + 822o to the form u + lo and give l. -743 Express 67g + 341g2 - 359g*2 + 5g*3 - 70g as ig2 + fg + a + tg3 and give f. -3 Express 31 - 17 - 10 - 4 + 4454p as n + qp and give q. 4454 Express -26m + 5m3 + 54m - 157m - 143m in the form jm + c + ym*3 + hm*2 and give y. 5 Express (-112 + 227 + 22a - 116)((62 - 148 + 59)(-3 + 1 + 0) - 1 + 4 - 1) as t + qa and give q. 1232 Express (-2z + 2z + 2z)(-187 - 317z*2 + 325z*2 + 333)(-4z + z + 0z) as vz2 + rz + cz4 + d + lz*3 and give v. -876 Rearrange (-4 - 2o + 4)(0 - 3 + 4) - 8o + 4 + 14o - 21o + 78 + 13o - 78 to the form yo + d and give y. -4 Express 68363f + 25 - 32 - 70135f + (-3 + 3 + 1)(-f + 2f + 0f) in the form vf + o and give v. -1771 Express -19 - 363y - 4 + 168y - 6 + 143y in the form by + n and give n. -29 Rearrange (-110 - 2785 + 94)(h2 + 21h - 21h) to ah + bh2 + t and give b. -2801 Rearrange 2 + 4075m + 4241m - 7691m to um + f and give f. 2 Rearrange -27b - 11b + 19b + (33b + 16b - 6b)(1 - 3 - 3) - 5b + 0b + 3b to wb + i and give w. -236 Express 59 + 722 - 47 + 161 - 2f in the form r + uf and give u. -2 Express -115x2 - 4x*3 - 2566x + 2573x + 112x*2 in the form mx*2 + zx + n + jx3 and give j. -4 Rearrange -366y - 385y - 987y - 2 - y + 2 + (2 + 0 - 4)(1 - y - 1) - 2 + 2 - 3y to the form t + dy and give d. -1740 Rearrange -5704m + 767m - 1157m + 97m to the form ym + v and give v. 0 Rearrange (0 - 2 + 3)(3m2 - m2 - 4m2) + 87m*2 + 20343m - 20343m to bm + h + im2 and give i. 85 Express -4f + 129f + 3 - 601f*2 - 5 + 612f*2 as p + qf + zf2 and give q. 125 Express 2804w*3 - 2w + 0w2 + 2837w*3 - 5636w3 - 1 - w2 as hw3 + yw + v + zw2 and give z. -1 Rearrange (2672 - 3s - 2644 + 7s - s2)(-4 + 1 + 2)(-2 - 3 + 4)(-36s + 10s - 57s) to rs*3 + qs + ns2 + m and give q. -2324 Express (-3v - v + 6v)(0v - 7v + 4v)(-630v - 627v - 886v + 105v) in the form av3 + xv*2 + kv + j and give a. 12228 Rearrange 2397k + 288 + 289 + 293 - 1158 + 291 to nk + a and give a. 3 Express 576 - 553 - 2q - 2q + (-2 + 2 + 2q)(-1 + 5 - 5) - 3 + 3q + 1 + 10q in the form d + oq and give o. 7 Express (7h + 0h - 5h)(1411h*3 - 91h*2 - 705h*3 - 708h*3) as fh*3 + i + rh*2 + zh*4 + jh and give f. -182 Express -72h - 105h + 78h + (-2 + 24 - 4)(3h - 2h - 2h) as oh + z and give o. -117 Rearrange (-1 + 3 - 6)(4x + x - 6x) - 4x + 0x - 11x + (0 - 1 - 1)(-12x + 17x + 13x) to the form cx + h and give c. -47 Rearrange -791g + 27g2 + 1534g - 2 - 735g to the form d + bg + cg2 and give d. -2 Express (-203 - 205 + 318)(-3a + 104a*2 - 5a - 4a + 12a) in the form ma2 + l + ka and give m. -9360 Express (-10d - 4 - 2 + 14d)(d + 4d - 3d)(60d2 + 6 - 6) as b + ad + kd2 + zd*3 + rd*4 and give r. 480 Rearrange -464o + 464o - 41o*2 - 328o*3 to the form xo + po2 + io*3 + j and give i. -328 Express 0 + 20044r - 7 - 20043r - 261r*3 in the form z + lr*3 + hr + wr2 and give z. -7 Rearrange 3427r + 2612r + 2884r - 1732r + 586r to tr + p and give t. 7777 Express 4831b*2 - 15129b*2 - 14776b*2 + 1894b*2 in the form gb + r + jb2 and give j. -23180 Rearrange 5187 - 13n*2 - 5n*2 + 5173 - 10363 - 39n*3 to sn + rn3 + f + zn*2 and give z. -18 Rearrange (38h - 37h + 3h - 92)(5h + 6 - 6)(-2h - 2h + 3h)(-1 - 3 + 2) to the form a + dh*3 + uh*2 + rh and give u. -920 Express ((2 + 2 - 3)(-1 - 2 + 2) + 0 + 1 + 1)(-3d2 + 4d*2 - 16d*2 - 6) as v + ld*2 + wd and give l. -15 Express (6 + 0 - 4)((1 - 1 + 2)(-2x - 2x + 3x) + x + 1 - 1 + 0x - 2x - 6x) + (-4x - 2 + 2)(-15 - 4 - 9) as b + fx and give f. 94 Rearrange (-4g + 3g - 4g)(-2627 + 2622 + g + 24g) + (g - g - 2g2)(-17 - 15 + 30) to the form sg + qg*2 + c and give c. 0 Rearrange -8 - 6 + 16 + 142k + 4k - k - k + (0k - 4k - 2k)(9 - 5 - 1) - k + 3k - k to the form j + lk and give l. 127 Rearrange -513j*2 + 1536j*2 - 2j4 + j4 - 4j + 23 - 513j*2 - 507j*2 to lj*2 + gj + fj4 + p + aj*3 and give f. -1 Rearrange (-c + 7 - 11 + 2)(-47 - 240 - 29) to the form vc + k and give k. 632 Express (y4 + 0y*4 - 3y*4)(-4298 + 353 - 2090 + 916) as s + ly4 + gy + iy2 + jy*3 and give l. 10238 Express (m - 2m + 3m + (2 - 3 + 8)(3 + 3m - 3))(5m - 47m + 80m) in the form lm + v + fm2 and give f. 874 Express (-1 - 4 + 2)(-10h + 6h + 3h) + (-2 - 1 + 5)(5h + 19h + 11h) as nh + o and give n. 73 Express (3 + 2j2 - 3)((10 + 4 + 2)(-22j + 3j + 11j) + 0j + 5j + 0j) as sj*2 + aj*3 + qj + g and give s. 0 Rearrange -34106n + 274380 - 274380 to z + fn and give f. -34106 Express 17t3 + 2t*2 - 35 - 24t + 49t - 24t - 8t3 - 6t*3 as i + ot*3 + pt + xt2 and give o. 3 Rearrange (-1 + 4 - 2)(-31 - 41 + 29)((-2j*3 - 2j*3 + 3j*3)(-5 + 5 - 2) + 5j3 + 27j*3 + 28j*3) to fj + zj2 + n + vj*3 and give v. -2666 Rearrange (2 + 56q - 125q + 55q)(-333 + 2q*2 + 333) - 1 + 1 + 3q*3 to aq*3 + nq + p + fq2 and give f. 4 Express -7w + 7 - 2w2 + 108w*3 + 9w - 86w3 in the form hw*2 + mw + bw3 + c and give m. 2 Express 19g*2 + 258g - 123 + 120 - 17g2 - g4 + 3g*4 as t + pg*4 + ng*2 + vg*3 + ag and give n. 2 Express (-724c2 - 3996c*2 - 5938c*2)(-2 + 2 + 1) as uc + mc*2 + i and give m. -10658 Express -3m3 + m3 + 3m3 + (-452m - 37m2 + 452m)(6m + 5m - 8m) in the form d +	{ "pile_set_name": "DM Mathematics" }
*3 and give f. -3 Rearrange 6q*2 - 8246q + 8248q - 7q*2 + 800 to the form uq + b + yq2 and give y. -1 Express 188l*3 - 13l*2 + 19l*2 - 1 - 9l - 7l2 + 16l as i + bl3 + wl*2 + nl and give n. 7 Rearrange (89 + 123 + 51 + 18 + 37)(371 - 371 + 12v) to b + ov and give o. 3816 Express (-417 + 417 + 4c)(c - 5c + 2c + c - 2 + 2 + (4c - c - c)(5 - 1 - 3) - 6 + 6 - 14c) in the form hc2 + rc + d and give h. -52 Express -8145i4 - 2479i*4 - 894i*4 + (1 - 1 - 2i*2)(i2 + i2 + 0i2) - 2i*4 + 0i*2 + 0i*2 as si*3 + l + ji + pi4 + qi*2 and give p. -11524 Express -45082 - 45076 + 90141 - 102v as hv + b and give h. -102 Rearrange 9t + 1 - 5928t2 + 11836t*2 - 5935t*2 to wt + p + vt2 and give v. -27 Rearrange (-3 + k + 3)(2 - 3 - 3)(-k2 + 2k*2 + 0k*2 - 7132k + 7132k - 318k*2 + (-3k + 2 - 2)(-k + 1 - 1)) to b + sk*3 + ck*2 + mk and give b. 0 Rearrange 10383 + 6916n + 12267 - 6915n - 3212 to the form pn + c and give p. 1 Rearrange -6847 + 3424 - 3159m + 3423 to i + xm and give x. -3159 Rearrange -8 + 23g - 4 + 31g + 22g + 10g to vg + a and give v. 86 Express (3n - 3n + n)(63n*2 + 2n*2 + 9n*2) + 3 - 1616n + 1616n + n3 + 2n*2 as k + vn*3 + cn + fn2 and give v. 75 Express 3u + 1150u3 + 5u - 1 - 2559u3 - 5u + 856u3 in the form iu*2 + cu + n + fu3 and give c. 3 Rearrange -33o - 3o3 - 2o*3 - 31o - 27o + 92o to t + fo2 + yo*3 + qo and give q. 1 Rearrange ((-2p - 1 + 1)(-1 + 5 - 2) + p + p - 5p)(-5 + 3 + 1)(-7 + 42 + 6) to the form yp + s and give y. 287 Rearrange (-3 + 4 - 3)(35 + 24 - 7)(5 - 4 + 2)(8 + 2t - 8) to the form g + lt and give l. -624 Express 1021z*3 - 3609z*3 - 10304z*3 + (0 + 0 + z)(z*2 + 4z*2 - 4z*2) as nz*2 + u + bz*3 + az and give b. -12891 Express (3v3 - 164v*2 + 163v*2 + 11v*3)(23691 - 23691 + 212v) as mv + pv4 + t + xv*2 + bv*3 and give p. 2968 Rearrange 43 + 2i*3 - 81 + 10i - 24i2 + 26i*2 + 33 to the form hi + gi2 + p + xi*3 and give g. 2 Express (-152369 + 152369 + 8840l)(5l*2 - 5l2 + l2) as pl3 + tl + cl2 + u and give t. 0 Rearrange (-10s - 11s + 18s)(2 + 1 + 0) + (0 + 0 - 3s)(3 + 3 - 2) to rs + f and give r. -21 Rearrange (x2 - x2 - 4x2)(125 - 77 - 76 + 1 - 3 + 3 + (3 - 2 - 2)(4 + 2 - 5)) - 3x*2 + 4x*2 - 4x*2 to the form a + ix + px2 and give a. 0 Express 11916w - 11916w - 5331w*2 as qw*2 + tw + i and give t. 0 Express 4d - 3d - 3d + (-15 + 14 + 12)(1 - 2d - 1) + (20d - 5d + 15d)(3 - 4 + 2) as x + yd and give x. 0 Rearrange 93 + 350k2 + 3k - 351k2 - 92 + 359 + 137 to the form mk + g + fk2 and give m. 3 Express 15h*2 + 3h*2 - 2h*2 + (-22 + 17 + 30)(h - h + 2h)(-15 + h + 15) as rh + s + yh*2 and give s. 0 Express -10h + 7 + 5h - 5945h*2 + 14h + 5921h2 in the form nh*2 + ah + v and give n. -24 Express 4d - 36d*2 - 11d - 86d2 + 21d*2 as id*2 + h + xd and give i. -101 Rearrange -5m2 + 0m2 + m2 + (2228m - 1245m - 1376m)(3 + 3m - 3) to am*2 + vm + u and give a. -1183 Rearrange 3 - 2o2 - 3o*4 - 3 + (-481o*3 + 705o*3 - 346o*3)(-3o - 2 + 2) + 1 - 1 - 2o + 2o4 to j + ao*4 + ro*2 + zo + uo3 and give z. -2 Express -1056z - 2419z + 175 - 175 as pz + m and give p. -3475 Express -19 - 99h2 - 455070h + 455070h as nh + x + ch2 and give c. -99 Rearrange (6r*2 - 5r*2 - 2r*2)(-38744 + 4421 + 3089) to the form h + vr + ur*2 and give u. 31234 Rearrange 4p*2 + 4p*2 - 7p*2 + 761 - 30 to fp*2 + c + tp and give t. 0 Rearrange 929b2 + 2308b + 1735b2 - 2308b to jb2 + fb + x and give j. 2664 Express (-28 - 29 - 12 - 777f + 80)(0 - 2f2 + 0) in the form cf*2 + o + jf*3 + xf and give c. -22 Rearrange (-1965z + 1965z + 46z3)(79z + 76z - 112z) to n + yz*2 + pz*4 + fz + dz3 and give p. 1978 Rearrange (-32 + 156 + 4)(23 - 23 - 6d + (2 - 2 + d)(2 + 0 - 1) + 0d - d + 3d + 1 - 1 + 2d) to k + ad and give a. -128 Rearrange (2c + 68606 + 602c*2 - 137248 + 68627)(-2 - 1 - 1) to the form k + yc + tc*2 and give k. 60 Express 9 - 9 - 2239b - 1108b + 952b as a + hb and give h. -2395 Rearrange -2499s*3 + 18278 + 18278 - 2s*2 - 36558 to p + hs*2 + ys*3 + fs and give h. -2 Rearrange 2k3 - 2k*4 + 84k - 313k - 39 + 228k to the form xk4 + gk + tk3 + z + rk*2 and give x. -2 Rearrange -49z*2 + 5z*2 - 12z*2 - 62z*2 - 12z - 39z2 to the form p + jz*2 + rz and give j. -157 Express (1 - 2 + 0 + 2h)(-36 + 861407h2 - 861404h*2 - 246) as uh*3 + q + zh + ih2 and give u. 6 Express 37792 - 12m - 37736 + 4m as am + s and give s. 56 Express -307 + 1561x - 305 + 227 + 385 as b + hx and give h. 1561 Express (-16 - 476 - 107)(4 - 14 - 14)(4m + 6 - 6) as y + dm and give d. 57504 Rearrange -3 + 1044j2 - 30j*3 - 9j*3 + 2608j*2 + 16j*3 + 24j*3 to wj*2 + mj*3 + tj + o and give m. 1 Express 152x3 - x2 - 19x*3 - 3 + 16x*3 + 3 in the form jx*2 + bx*3 + n + wx and give b. 149 Rearrange (0z + 0z - 2z)(4z - 4z - z) + (121 - 3z - 121)(-312z - 899z + 75z) to gz + w + vz2 and give v. 3410 Express (-f + f2 + f + (0 + 1 + 0)(-f + f + 6f2))(446 - 456 + 924) as pf2 + w + vf and give p. 6398 Express 182h3 + 107h*3 + 33h*3 + (-10 + 7h - 9h + 0h)(-10h*2 + 21 - 21) as sh*2 + zh*3 + j + yh and give y. 0 Rearrange q*3 + 956q - 1907q + 951q + 211q2 to the form v + oq*3 + tq*2 + wq and give w. 0 Rearrange -24b2 + 4b + 61b2 - 2 + 22b*2 + 5b*2 + 4b*2 to q + lb + sb2 and give q. -2 Express -2u*2 - 5u*2 + 5u*2 + (14u + 15u - 10u)(-8u + 93u + 20u) + 4 - 4 - u*2 as fu + w + mu2 and give m. 1992 Express -33268n + 33268n - 7n2 - n2 + 69 as y + wn2 + dn and give y. 69 Express 7782 - 26u2 + 32u*2 - 7900 as ju*2 + mu + r and give m. 0 Express 2q + 4q - 2q - 4 + 3q - 3q - 5q + (-2 - 1 - 2)(3q - 3 + 3) - 2q + q + 3q in the form y + vq and give y. -4 Rearrange 0r*2 + 4r3 + r2 + 13819 - 13829 to the form lr3 + w + hr + br2 and give h. 0 Rearrange k + 18k*3 + 2993k*2 - k - 21k*3 - 2995k*2 - 1051 to the form bk + jk2 + uk*3 + o and give j. -2 Express -1 - 8816q*2 + 1 - 244q*2 - 5662q*2 as lq*2 + sq + v and give l. -14722 Rearrange -11x2 + 11297 - 11297 to the form y + tx + bx2 and give b. -11 Rearrange g2 - 2g*2 - 5g*2 + (5 - 5 + 2)(10g2 + 5g*2 - 4g2) + g2 - 2g2 + 8g*2 to the form tg*2 + dg + w and give t. 23 Rearrange (4808 - 2392 - 243w - 2412)(2 - 6 + 1) to c + aw and give c. -12 Rearrange -4613b + 4560b - 4b*2 - 2 + 0b2 + b3 + 0b3 + 5b*2 to the form lb*3 + j + ib*2 + zb and give j. -2 Express 6i3 + 972i - 970i + 620 - 5i*3 + 2i*4 in the form zi + g + hi4 + pi*2 + ai*3 and give z. 2 Express (-2 + 3w + 7w + 2w)(19w - 31w + 25w) + (0 - 1 - 1)(-6w*2 + 2w*2 + 3w*2) in the form lw*2 + qw + j and give l. 158 Rearrange (0h + 2h - 5h)(1093 + 3809 - 6734 - 7374 - 3445) to k + wh and give w. 37953 Express (-4v*3 - 3v*3 + 5v*3)(0 + 3 - 5) + (-2 - 3 + 4)(13 + 9 - 20 - 4v)(6 + 6v*2 - 6) in the form i + sv*2 + fv + dv3 and give s. -12 Rearrange (1925 + 671 - 1429)(18 - 18 + 6a) to wa + b and give w. 7002 Express -334l - 2796l - 638l as dl + q and give d. -3768 Express 137x - 136x - 4x2 + 57x*4 + 0x*2 in the form p + kx*2 + ox + yx4 + mx*3 and give o. 1 Rearrange (-3s + 19s - 3s)(-29s + 99s + 197s) to cs2 + ts + b and give c. 3471 Express 1033r - 2 - 2 - 2r*2 + 4 as ar + pr2 + j and give j. 0 Rearrange (2 + 11 - 4)(-18k - 24k + 18k) to the form m + wk and give w. -216 Express 1948y2 + 1934y*2 - 2y*4 - 5825y*2 + 1943y*2 + 422y*3 + 3y in the form ry + ty*2 + s + gy*4 + by*3 and give g. -2 Rearrange -433r*2 - 540r*2 - 493r*2 + 1353r*2 to the form j + xr + wr2 and give w. -113 Express -36b + 17b2 + 81b + 72b3 - 18b*2 + 133b - 71b3 as zb*3 + qb + yb*2 + t and give y.	{ "pile_set_name": "DM Mathematics" }
t a = l - -92. Let s be 2/(a/(-105)) - (1 + 0). Which is smaller: s or 1? s Let c be ((-9548)/(-49))/(2/7). Let d = c - 749. Is -67 smaller than d? False Let f = 9.444 + -9.49. Let h = 5.8 + -6. Is h greater than f? False Let j = 4/125 - -424/2375. Let f be (-330)/264 - 434/(-8). Suppose 47y - 6 = fy. Is j < y? False Let g(s) = 4s + 13. Let l(m) = -12m - 40. Let c = 22 - 29. Let b(k) = cg(k) - 2l(k). Let d be b(-4). Which is smaller: d or 3? 3 Let m = -657 - -2643/4. Let b = -5/4 + m. Which is smaller: -5 or b? -5 Let u = 6715 + -6702. Let p(q) = -q*3 + 8q*2 - 5q. Let y be p(7). Suppose 1 = z - y. Is u > z? False Let g = -157949/5 + 1086173/35. Which is smaller: g or -557? -557 Let z = -17916 - -10075. Let q = 1262395/161 + z. Which is greater: 1 or q? 1 Let j be 1120/(-210) + (-5)/3. Is -111/16 < j? False Let y = -67 - -86. Let w = -88 - y. Let s = w - -107. Which is smaller: s or -0.7? -0.7 Suppose 0w - 4w = 4p + 8, 5w - 20 = 5p. Let s = 169531/5334 - 445/14. Is w at most as big as s? False Let g = 28910 - 28489. Is 4/3 > g? False Let q = 14511/10568 - -5/2642. Let c = 0 + 3. Suppose -7y + 4 = -cy. Which is smaller: y or q? y Let x be (-4)/(-22) + 3173/(-209). Let l(s) = -4s*2 + 2s + 1. Let b be l(2). Let m = b - x. Is 4 less than m? False Let y = 70 - 87.18. Let i = y - 1.92. Let q = i + -5.9. Is -2/7 <= q? False Let h = 2/1891 + 77523/7564. Let r = -3.7 + 1.7. Is h at least as big as r? True Let m be 522/(-890) - ((-468)/(-65))/(-12). Is m greater than or equal to 1? False Let i = -5367.19 - -5341. Let u = 0.19 + i. Let s = 0.04 - 0.14. Which is bigger: s or u? s Let o be (-174)/4219/179. Let i = o - -2/179. Is -7.4 greater than or equal to i? False Let y be ((-154)/(-66))/((-1)/3). Let m be (108/63)/(1/y). Let g be (-1)/(((-5)/15)/((-2)/m)). Which is smaller: g or 22? g Let y be (-2)/((-5)/(-255)-3). Let z = -1851 + 1886. Which is smaller: y or z? y Suppose -3d = -3y - 6d + 18, -2 = 3y - 2d. Suppose s = -1, s = 4m - 79 + 238. Let g be y + m/18 - 2047/(-8280). Is g less than -1? False Suppose 4g - 28 = 3u, -5g + 67 = 4u + 32. Suppose 2j + 46 + 18 = 0. Is j > u? False Let n be 0 - (6/12)/(9654/36). Which is smaller: n or -1? -1 Let x = -1914/59 + -5593/295. Let h = 25 + -76. Is x equal to h? False Let y = -2116 - -2115. Which is greater: y or -123/68? y Let k = 0 + 0. Let r be (12/10)/((759/220)/(-23)). Is k != r? True Let z = 23952 + -21118. Which is smaller: z or 2837? z Let a = 88.16 + -89. Let t = 1.73 + a. Let d = -1.29 + t. Is 6 > d? True Let m be (-3795)/2550 + (-5)/(10/(-4)) - 1. Which is smaller: 1 or m? m Let b(k) = -k3 - 4k*2 - 2k + 4. Let d be b(-3). Let g be (-30004)/35256 - 5/(-6). Which is bigger: d or g? d Suppose 0 = 23b + 13b - 612. Suppose 2x = -w + 8, -12 = -5x + 2x + 4w. Let o be (9/x)/(1/8). Which is smaller: o or b? b Suppose 4q = 2r + 10, -4q - 8r = -4r + 20. Which is bigger: q or 1/3436? 1/3436 Suppose h - 2h + 17 = 4f, 0 = -5h + 5f + 10. Let b be (h/453)/((-8)/126). Which is smaller: -5 or b? b Let i(v) = -2v2 - 135v - 138. Let f be i(-1). Is -101/28 at least as big as f? True Let j(p) = -p*3 - 9p*2 - 5p - 9. Let y be j(-6). Let l = -783/2 + 913/3. Let t = y - l. Is t != -0.12? True Let x = -7 + 14. Suppose -x = -3c - u + 2u, 0 = 2u - 10. Suppose -3g + c = 4. Is 5.8 at most g? False Let g = 6443713/10 - 642605. Let h = 1770 - g. Let q = -16/5 + h. Is -8 at most as big as q? True Let z = -7.97 + 765.97. Let v = z + -753. Are -1/9 and v nonequal? True Suppose 25u + 5x = 22u - 55, -3u = -x + 25. Let k(l) = -l*2 - 21l - 125. Let w be k(u). Which is greater: w or -164/11? -164/11 Let z = 3/45634 + -53756897/684510. Which is bigger: -79 or z? z Let k = 9 + -6. Let z(c) = 2c2 + 62c + 66. Let j be z(-30). Suppose -kl = x + 2x - j, -2 = x - l. Which is smaller: x or -1? -1 Let x(j) = j*3 - 26j*2 - 83j + 66. Let c be x(29). Suppose 0 = 5z, -z - 910 = -2u - 3u. Is c at most u? True Let w = 12973 - 16186. Which is smaller: w or -3212? w Let q be (-1682)/26 + -54. Is q equal to -84? False Let o = -250 + 5946. Which is smaller: 0 or o? 0 Let m(t) = 10t + 144. Let p be m(-14). Suppose -3r + 152 = -pl, -5r + 109 - 6 = -3l. Which is greater: l or 2? 2 Let n = -0.22836 + 1491.92836. Is 0 >= n? False Let i = -56 + 54.7. Let x = -71.7 + i. Does 2/7 = x? False Let p = -0.1 + 0.2. Let s = -169032 - -168822. Which is greater: s or p? p Let j = 0.108 + -0.016. Let s = 14.092 - j. Are s and -0.1 equal? False Suppose -18 = -j + 3j + 4g, -2j = g + 21. Let m = 34 - 45. Let a = j - m. Is a at most as big as 1/14? True Suppose -14a = 19a - 2a + 10230. Which is smaller: -296 or a? a Suppose 2 = -84y + 85y. Let i be (5 - 19/y)(-1)/(-228). Is i >= 1? False Suppose k = 7 - 2. Let b be (k + -3 + 0)(-2)/(-4). Which is smaller: b or 5/12? 5/12 Let z = 3829.15 + -3711. Let y = 0.15 - z. Which is greater: 1 or y? 1 Suppose -3j = -52 + 28. Let q be (-1235)/(-4108) - 2/j. Suppose -2u = 7u. Is u greater than q? False Let l(w) be the first derivative of -w4/4 + w3 + w*2/2 + 19. Let p be l(3). Suppose 0 = ps + j - 47, 4s - j - 38 = 2s. Are 17 and s equal? True Let i = 1018 - 406. Let b = i - 1879/3. Which is smaller: b or -14? b Suppose 0 = 4x - w - 2w - 26, -3x + 3w + 21 = 0. Suppose xu - 32 = u. Suppose 0 = -11g - 2g + 91. Which is greater: g or u? u Let s = 157 + -155. Let l be (-57)/(-9) + ((-4)/3)/s. Is 5 at most l? True Let s = 2607.53 + -2595. Let o = -0.567 + 0.097. Let c = s - o. Which is greater: c or 0.2? c Let z be 10/668(-32)/40. Is z greater than 0? False Suppose -169f + 166f - 14 = 5u, -6f + 3u = 15. Let h = 23 - 39. Let c = -16.26 - h. Which is smaller: f or c? f Let w = -29765 + 29766.7223. Is w < 2/3? False Let l = 263 - 268. Let r be 79/(-44) - l6/15. Is r less than 1? True Let w(s) = 3s2 - s - 28. Let g be w(-7). Let l be (27/(-12))/(g/624). Suppose 0 = -2a + 8, -7y + 4y + a - 40 = 0. Is y greater than or equal to l? False Let n = -74 + 80. Let s = -6.04 + n. Let d = 11 - 12. Which is smaller: d or s? d Let h = -352/13 - -65785/2431. Is h greater than or equal to 0? False Suppose 14u - 6u = 2f + 4834, 0 = 4u - 5f - 2421. Is u greater than 604? False Let k = 14 + 34. Suppose -9r - 11r - 1000 = 0. Let w = k + r. Is 0 bigger than w? True Let l = -325 + 309. Let k be -146/l - (-55 + 60). Is -2 >= k? False Let r = -0.78 - -6.08. Let k = 26.7 + r. Let o = 31 - k. Are o and -0.7 equal? False Suppose 1266 = -2d + 6d - 3l, -2l - 1579 = -5d. Let s = d - 360. Which is bigger: -44 or s? -44 Let b be 8835/(-6) + 161/46. Which is smaller: b or -10280/7? b Let z be 1 - 9/(63/(-28)). Suppose -5w - 2b - b + 86 = 0, -zb = 4w - 74. Which is greater: w or 17? 17 Let a = -393201/5 + 78643. Let n = -6 - -8. Which is greater: a or n? a Let s be (-6)/8 - (-482469)/356. Which is smaller: 1 or s? 1 Let z = 25 + -55. Let x(g) = 6g + 1065. Let n be x(0). Let v = n + -3193/3. Is v greater than or equal to z? True Let o(f) = 1622f. Let x be o(0). Suppose t + t + 3v = -221, -3t = 4v + 332. Let n = -1119/10 - t. Is x at most n? True Suppose 3s = m - 29, 5s = -4m + 3m - 11. Let k = m - 8. Suppose kl - 32 = -2. Which is smaller: l or -4? -4 Suppose 2r - 21 = -1. Let g be -14/r - -112. Let u = -112 + g. Do -5 and u have different values? True Let p be 94/(-18) - (-10)/45. Suppose -2y - y = 3j + 492, 0 = 2y + 4j + 334. Let x = -171 - y. Which is smaller: p or x? x Let c be ((-860)/(-6))/((-78)/117). Let b be (-16)/6 + c/(-43). Is b >= 1? True Let j(o) = o3 - 2o*2 - 2o + 1. Let n be j(4). Let q be 75/(-6)8/((-88)/22). Is q <= n? True Let m be -2((-15358)/196 - -5). Which is bigger: m or 146? m Suppose -f - 2 = -3h, 3h - 3 = 4h - 4f. Let b(u) = -u*3 + 8u*2 - 7u - 1. Let p be b(7). Let j be (1 - h) + p + 0. Which is bigger: -2/5 or j? -2/5 Let t be (-2)/4126. Let w(r) = -2r + 2. Let v(x) = 6x*2 - 27x + 8. Let a(c) = v(c) - 2w(c). Let u be a(3). Is u > t? True Let f = -663.43 + 4.43. Let q = f - -654. Is q < 2/35? True Suppose -7r = 1528 + 474. Let s = -202 - r. Does s = 84? True Let t = 23727 - 23727. Let i be 58/(-26) + (5 - 3). Which is smaller: i or t? i Suppose 5m - 10 = 4p, 11*m =	{ "pile_set_name": "DM Mathematics" }
number? True Is 29167651 a prime number? True Is 3521482793 a prime number? False Is 8075720671 prime? False Is 2411968879 prime? True Is 9960571 a composite number? True Is 2618711279 a composite number? False Is 14104211635 a prime number? False Is 10498642201 composite? True Is 38640639577 a composite number? True Is 6826744909 a prime number? True Is 130046401 prime? False Is 13312493 a prime number? True Is 1203703099 a prime number? False Is 35044351 a prime number? False Is 115261663559 prime? False Is 7043171309 a composite number? False Is 110580896369 prime? False Is 960347671 composite? False Is 2333301233 a composite number? False Is 269645407 prime? False Is 105835397807 a composite number? True Is 5928021713 a prime number? True Is 1492624201 prime? False Is 530254453 a composite number? True Is 421787077 a prime number? False Is 4494207503 a prime number? False Is 584873203 a prime number? True Is 19636951973 prime? True Is 33108074941 a composite number? True Is 127714646687 composite? True Is 94373177 a prime number? True Is 2109498613 composite? True Is 517993885 a composite number? True Is 133192299241 prime? True Is 316949993 a composite number? False Is 3063890647 prime? True Is 785391641 a composite number? False Is 8778421 composite? False Is 134184683837 prime? False Is 506911073 a prime number? True Is 2256592781 prime? True Is 3935085043 composite? True Is 3607504619 composite? True Is 421728859 a composite number? False Is 4024592197 composite? False Is 3273976833 a prime number? False Is 24323917601 prime? True Is 4447243803 a composite number? True Is 2027013649 composite? True Is 8148325849 a composite number? True Is 105535906171 a composite number? True Is 14939066741 a prime number? True Is 13025210113 prime? True Is 19436713 a prime number? True Is 22415460043 prime? True Is 2040235667 a composite number? False Is 577562237 prime? False Is 682378133 composite? False Is 8133511979 composite? True Is 1396326551 composite? True Is 64349112131 a prime number? True Is 396857561 prime? True Is 2043476791 prime? False Is 3122666351 a prime number? False Is 287536003 a composite number? False Is 2252715287 prime? False Is 2539601443 composite? True Is 1212823763 composite? False Is 24245147739 a prime number? False Is 808020029 a prime number? True Is 9095417 composite? False Is 2165155999 prime? True Is 2390011891 a prime number? False Is 17052648001 a composite number? True Is 3094507189 composite? False Is 130608773 prime? False Is 10344857089 prime? False Is 72733347501 a composite number? True Is 6639116437 a composite number? True Is 40768267 a composite number? False Is 106939933 a prime number? True Is 85026978529 a prime number? False Is 1716993907 prime? False Is 3245649931 a composite number? True Is 3581865853 a prime number? False Is 10660719233 a prime number? False Is 2038700561 a composite number? True Is 4827550271 composite? False Is 9216588193 a composite number? True Is 225431321 a prime number? True Is 322897021 composite? False Is 2295989039 a prime number? True Is 137893499 a prime number? False Is 2012426777 a composite number? True Is 775871977 a prime number? False Is 2208958429 a prime number? True Is 4343533465 a prime number? False Is 190426289 a prime number? False Is 20602392841 a prime number? False Is 11770542253 prime? True Is 27791057705 composite? True Is 21144141509 composite? False Is 4762304903 composite? False Is 50877487319 a composite number? False Is 7101531601 a composite number? True Is 2072746561 a composite number? False Is 1462793543 prime? False Is 25985439553 composite? False Is 276125357 a prime number? False Is 3051460537 a prime number? True Is 446075411 composite? True Is 1230845017 a prime number? True Is 1946971241 prime? True Is 586181957 a composite number? False Is 6367158227 a composite number? False Is 166962726849 a composite number? True Is 426180071 prime? True Is 18788980781 composite? True Is 744512039 composite? True Is 11729285861 composite? False Is 12983173873 a composite number? False Is 6532036349 prime? False Is 119759365397 a composite number? True Is 7069181831 a composite number? False Is 17703736619 prime? True Is 1167551493 a prime number? False Is 4236658682 composite? True Is 9130044589 composite? False Is 1595334347 composite? False Is 1195061939 a prime number? False Is 367340977 a prime number? False Is 19705371031 composite? True Is 9170205521 composite? True Is 261387797 a prime number? False Is 3135285787 composite? True Is 10685861209 a composite number? False Is 128878895729 composite? False Is 21266292221 prime? False Is 7377125603 a composite number? False Is 650933993 a composite number? True Is 56716846337 composite? False Is 7460597809 a prime number? False Is 402838081 a composite number? True Is 953265185 a composite number? True Is 4450009793 composite? True Is 91661849 a composite number? False Is 677772941 prime? True Is 88322807 composite? True Is 274954800773 a composite number? True Is 1687853717 prime? False Is 30262129819 composite? False Is 5211614359 composite? True Is 426489431 a prime number? False Is 10407876343 prime? False Is 584256889 a composite number? False Is 14847615389 a prime number? True Is 1823699117 a prime number? True Is 408414317 composite? True Is 211656505 prime? False Is 4701977851 a composite number? True Is 22474618109 prime? True Is 858196081 composite? False Is 32137296337 a composite number? False Is 317885803 a composite number? False Is 782538919 a prime number? False Is 1883010169 a composite number? False Is 1802380301 prime? False Is 1115764557 prime? False Is 4303669847 composite? False Is 819498083 prime? True Is 1351224149 a composite number? True Is 248643541 composite? False Is 8099105689 prime? False Is 1228056215 a prime number? False Is 1024425353291 prime? True Is 454228447 a prime number? False Is 14557421777 a prime number? True Is 203184788683 composite? False Is 118864919 a prime number? True Is 301990609 composite? True Is 34666449955 a composite number? True Is 91266887 a composite number? True Is 2973199 composite? False Is 11128860179 a prime number? True Is 1644396185 prime? False Is 175802919 prime? False Is 142076089 a composite number? True Is 91204851679 a prime number? False Is 19438574731 a prime number? False Is 2929282129 a composite number? True Is 112297067 a prime number? True Is 107790876241 prime? True Is 87155929 prime? False Is 197040911 prime? True Is 7400009263 a prime number? False Is 23059565547 composite? True Is 9264549589 composite? False Is 1265159921 composite? False Is 847599119 a prime number? True Is 36346816321 prime? True Is 2026163011 a composite number? False Is 5048755147 a composite number? True Is 48078629 composite? False Is 762016337 a prime number? False Is 1475381231 a prime number? False Is 6653453551 composite? False Is 14672649529 composite? True Is 8591409941 prime? False Is 969134189 a prime number? False Is 3729001259 a prime number? True Is 8103241693 composite? False Is 638635279 composite? False Is 13352673107 a composite number? True Is 855349402 prime? False Is 355097471 composite? False Is 8503990789 prime? False Is 16694663207 prime? False Is 42786504617 a prime number? True Is 111565591 a prime number? True Is 25308772003 a composite number? False Is 264211529 a composite number? False Is 45960701 composite? False Is 27268170843 prime? False Is 472098773 a composite number? False Is 2939228639 prime? False Is 31583930667 a prime number? False Is 461036897 prime? True Is 27857128361 a composite number? False Is 214661152099 composite? False Is 2753492653 composite? True Is 73068182299 a prime number? False Is 8828808553 prime? True Is 358017971 a prime number? True Is 1693924837 composite? True Is 492816239 prime? False Is 1052793211 a composite number? True Is 1530540341 composite? True Is 3084515237 prime? True Is 401289491 a composite number? False Is 6178946669 a composite number? True Is 1480940203 prime? False Is 3322427267 a composite number? True Is 78621551 prime? True Is 8176640411 a composite number? True Is 29153115309 composite? True Is 1389849089 a prime number? True Is 528344779 prime? True Is 9	{ "pile_set_name": "DM Mathematics" }
187. Calculate the remainder when v is divided by 20. 17 Suppose 0 = -16l + 22l + 168. Let s = l - -49. What is the remainder when ((-124)/10)/(1/(-5)) is divided by s? 20 Suppose 2r = 6, 7v - 26 = 5v - 4r. Let u(k) = k*3 + 5k*2 + 2k - 1. What is the remainder when u(-3) is divided by v? 4 Let c(x) = 3x2 - 52x - 6. Calculate the remainder when c(21) is divided by 34. 21 Suppose 2d - 119 = -3j - 18, 3d = -2j + 139. What is the remainder when 213 is divided by d? 41 Suppose 8 = 5t + 3y, 0 = 4t - 3t - 2y + 1. Suppose 13c + 130 = 39c. What is the remainder when c is divided by t? 0 Calculate the remainder when 281 is divided by (-105)/(-10) - 9 - (-41)/2. 17 Let x = -9 - -18. Suppose 5z - 246 + x = -l, 0 = 2z - 5l - 84. What is the remainder when z is divided by 12? 11 Let x = 0 + -1. Let d = x - -30. Suppose 5y - 4y - d = b, 3y = 2b + 84. What is the remainder when y is divided by 14? 12 Let r(o) = o*3 + 7o*2 + 3o. Let a = -25 + 21. Calculate the remainder when r(a) is divided by 19. 17 Let c = 8 - 5. Suppose 2b = -2k + b + 112, -ck + 169 = 2b. Calculate the remainder when k is divided by 29. 26 Calculate the remainder when 97 + ((-30)/3 - -15) is divided by -1 - (1 + 4-7). 24 Suppose 0a - m = -3a + 32, 5m = a - 20. Let q(p) = -20p3 + 7p + 6. Calculate the remainder when q(-1) is divided by a. 9 Let c = 910 - 900. Let d = -7 + 42. Calculate the remainder when d is divided by c. 5 Suppose 4o + 2d + 2d = 140, 5o + 4d - 180 = 0. Suppose 12 = 3n, 4z + n - o = 5n. Let f = 147 - 92. Calculate the remainder when f is divided by z. 13 Suppose 49u - 57u + 24 = 0. What is the remainder when 227 is divided by u? 2 Let a be (10 + -5)/((3 - 4) + 2). Suppose -2w + 30 + 45 = 5p, 0 = -5p - a. What is the remainder when 119 is divided by w? 39 Let o(n) be the third derivative of 5n*4/6 - 3n*2. Let j be o(1). What is the remainder when (44/(-10))/((-2)/j) is divided by 15? 14 Let n = -5 - -13. Suppose -nv + 105 = 9. Calculate the remainder when 22 is divided by v. 10 Let v be -14 - -13 - (2 + -53). Let y = v + -9. What is the remainder when y is divided by 9? 5 Suppose 3k - 24 = 3m, -3m = -3k - m + 20. Let u = -1 - -3. Suppose -24 - u = -l - 2x, -kx - 78 = -3l. What is the remainder when l is divided by 7? 5 Let d(g) = -g2 + 9g - 2. Let q(p) = 8p. Let x be q(10). Let j = x - 33. What is the remainder when j is divided by d(7)? 11 What is the remainder when 374 is divided by 141(5/10 - -1)? 17 Let w = 2 - -17. Calculate the remainder when (40 - 16)6/4 is divided by w. 17 Let c = 20 + -11. Suppose cm - 290 = -m. What is the remainder when 82 is divided by m? 24 Calculate the remainder when 108 is divided by (-1(-10)/(-4))/((-15)/18). 0 Let t(p) = 82p - 215. What is the remainder when 338 is divided by t(3)? 28 Let z = 67 + -62. Suppose o + 20 = 2c, -5c + 8c - 23 = zo. Calculate the remainder when 98 is divided by c. 10 Let s be 96/9(-3)/2. What is the remainder when (-6)/(-2) + (-15 - s) is divided by 1? 0 Let a = -265 - -273. What is the remainder when 44 is divided by a? 4 Let h = 885 + -252. Calculate the remainder when h is divided by 53. 50 Suppose 4m = 57 + 55. Let k = m + -16. Suppose q - 8 = 37. What is the remainder when q is divided by k? 9 Suppose -k - 100 = -5g, 4g - 17 - 64 = k. Calculate the remainder when g is divided by 4. 3 Let u be 0 - (4 - (0 + 6)). Let n(w) = 0w - 2w + 14 + 2w + uw. What is the remainder when n(7) is divided by 10? 8 Let l be ((-2)/2)/(2/86). Let w(r) = -34r*2 - 5r - 2. Let m be w(-1). Let v = m - l. Calculate the remainder when 47 is divided by v. 11 Suppose -59u + 3u + 120848 = 0. Calculate the remainder when u is divided by 72. 70 Let r(h) = h*3 + 5h*2 - 24h + 6. What is the remainder when 23 + (1 + -2)2 is divided by r(-8)? 3 Let x(o) = -o2 - 8o + 7. Let u be x(-8). Suppose uj - 2j - 20 = 0. Calculate the remainder when 41 is divided by (-15)/(-2) - 2/j. 6 Suppose -19v + 52 + 62 = 0. Calculate the remainder when 18 - (0 - v/3) is divided by 12. 8 Let l(t) = 17t*2 + 2t + 10. What is the remainder when l(-4) is divided by 11? 10 Suppose 59v - 47v = 1644. Calculate the remainder when v is divided by 72. 65 Let s(f) = -79f2 - 5f - 3. Let l(n) = -118n2 - 8n - 4. Let v(d) = 5l(d) - 8s(d). Calculate the remainder when v(2) is divided by 29. 27 Calculate the remainder when 18 is divided by 6/(-20) - (-5618)/1060. 3 Let h(i) = 13i - 21. Let g be h(5). Let a = 56 - g. Suppose c + 5v = 27 - 7, -3c = 3v - 60. Calculate the remainder when c is divided by a. 8 Suppose 0 = -572q + 567q + 1075. Calculate the remainder when q is divided by 24. 23 Suppose -2o + 5t - 3 - 2 = 0, -4o - t - 43 = 0. Let d(c) = -11c. What is the remainder when d(-1) is divided by (-34)/o + 8/(-20)? 2 Let n(f) = 3f - 5. Let w(c) be the first derivative of c2 - 4c - 5. Let m be w(5). What is the remainder when 25 is divided by n(m)? 12 Let t = -1 + 5. Suppose 0 = 4i + 5j - 229, i + j - 4j = 70. Let m = i - 46. What is the remainder when m is divided by t? 3 Let t = -98 - -328. Suppose -5p - 50 = -t. What is the remainder when 179 is divided by p? 35 Suppose 9g - 926 - 469 = 0. What is the remainder when g is divided by 80? 75 Let k = -1 + 4. Suppose kc + 6 = 75. What is the remainder when c is divided by 16? 7 Let h(f) be the second derivative of f*4/12 + 2f*3/3 - 5f*2/2 - 37f. Calculate the remainder when 18 is divided by h(-6). 4 Let f(y) = -y*2 + 21y + 11. Let s be f(12). Suppose 0 = -3i + 2l - 116, 77 + s = -5i + 4l. What is the remainder when 33 is divided by i/(-5)(-5)/(-2)? 15 Let k(h) = -h3 + h + 18. Let w be 6/(-4 + 186/47). Let n = 212 + w. What is the remainder when n is divided by k(0)? 17 Let r(d) = -d2 - 10d + 61. What is the remainder when 15 is divided by r(-14)? 0 Let n be 9/(-2)(-14)/21. Suppose 5v - u - 271 = 0, -nv = v - 3u - 208. What is the remainder when v is divided by 14? 13 Let v(m) = -2m + 8. Let o be v(4). Suppose o = -5t + 204 + 161. Suppose 0 = 5g - t + 8. Calculate the remainder when 36 is divided by g. 10 Let h = 535 + -760. Calculate the remainder when 33 is divided by (8/10)/((-10)/h). 15 Let z(j) = j3 + j2 - j. Let x(i) = i2 - 13i + 26. Let v be x(11). Suppose a - p - 22 = 45, vp + 76 = a. What is the remainder when a is divided by z(3)? 31 Let r be (-1)/(2/26-1). Let p(x) = 6x - 16. What is the remainder when p(r) is divided by 8? 6 Suppose -2b = -3j + 1144, 384 = j - 61b + 63b. Calculate the remainder when j is divided by 6. 4 Suppose 2x - 4 = -2t - 0, -t = 2x - 9. Calculate the remainder when (-3 + -1 - -24)2 is divided by x. 5 Suppose -3o + 52 = 4a, 5a = -4o + 67 + 1. What is the remainder when 60 is divided by o? 0 Let j(f) = 17f + 74. Suppose 290 = 5a + 5o, -5o - 159 = -3a + 55. What is the remainder when a is divided by j(-4)? 3 Let d = 1330 + -312. What is the remainder when d is divided by 60? 58 Suppose -4a = -11 - 49. Let x(m) = m3 - 21m*2 + 56m - 32. What is the remainder when a is divided by x(18)? 3 Suppose 7r - 5r = -4g + 590, 3r + 4g = 887. What is the remainder when r is divided by 23? 21 Let m(r) = -22r + 80. Calculate the remainder when 389 is divided by m(3). 11 Let t be (3/9)/((10/(-66))/(-5)). Suppose -5q + q - v + 33 = 0, 40 = 5q + v. Calculate the remainder when t - (2 + -3)2 is divided by q. 6 Let h = 69 - 46. Let a(v) = -4 + 3v + 14 - 5v. Calculate the remainder when a(-17) is divided by h. 21 Let g(d) = -45d + 189. What is the remainder when g(-18) is divided by 77? 75 Let n(s) = -3s2 + 18s + 11. Calculate the remainder when n(5) is divided by 10. 6 Let y = -78 - -86. Calculate the remainder when 37 is divided by y. 5 Let w = -54 + 75. Let b = w + 8. What is the remainder when b is divided by 11? 7 Let p = 427 + -130. What is the remainder when p is divided by 23? 21 Let p(o) be the second derivative of -o5/20 + o4/2 - 5o3/6 + 3o*2/2 + 3o. Calculate the remainder when p(5) is divided by 3. 0 Suppose 106 = 2d - 4j, 4d + 2j = 106 + 66. Calculate the remainder when -5((-2)/(-25))/((-9)/d) is divided by 1. 0 Let n = 61 + -31. Suppose 0z = 3z - n. Suppose -h + 29 = -5p, -2*	{ "pile_set_name": "DM Mathematics" }
-5y + 19 = 2i - 0i, -2i = -xy + 16 for i. -3 Suppose 0 = 8w - 2w - 36. Solve wx - 20 = x, -2z = x - 2 for z. -1 Let v = 3 - -4. Suppose 6g = vg. Solve 3j = 4d + 28, j - 4d - d - 24 = g for j. 4 Suppose 2k - 3 = k. Suppose 6y = ky + 6. Let i be 0 + y + -3 + 2. Solve -4q = a + 1 - 3, -3q + i = a for q. 1 Suppose 2f = -3b - 2b + 46, 3f = 5b + 44. Suppose c = 2a, a = 5c - 0a - f. Solve 0 = -3u + 2u - w + c, -2w = u - 3 for u. 5 Suppose 0 = -q + 2i + 5, i - 6 = -2q - 1. Let s(g) = g + 9. Let u be s(-6). Solve -uz - qw + 15 = -z, z + 3w - 15 = 0 for z. 0 Let c = 32 + -28. Solve -cp = -0p, 0 = 2b - 5p - 8 for b. 4 Suppose 7 = 4w - 5. Solve 2o + u + u + 2 = 0, -9 = wo - 3u for o. -2 Let k(t) = -t - 5. Let u be k(-9). Let w be u - (6 - 3) - -2. Solve -r - 16 = -3v, wr + 23 = 5v - v for v. 5 Let j be (-3 - -7) + 0/(-3). Let q(n) = -n + 8. Let l be q(6). Let s be (-1 + 1)/(l-1). Solve s = -4c - j, 3k - 3c = c - 8 for k. -4 Let t(g) be the third derivative of -g5/60 + g4/6 - g*3/2 - 4g*2. Let x be t(2). Solve -5b - 15 = 2n, 4n - x + 13 = -4b for b. -3 Let i(d) be the first derivative of -d4/4 + 8d*3/3 - 7d*2/2 + 2d + 1. Let f be i(7). Solve -l + fj + 3j = 16, 2j = 5l - 12 for l. 4 Suppose -5n - 25 = -t, n - 1 = 5t - 30. Let k be 82/8 - n/(-16). Let o = 21 - k. Solve -4g + 4 = 5p, -4g - p - o = 1 for g. -4 Let l be (213/(-2))/(-1). Suppose c + 4 = 3a + 2c, 3a = 4c + 14. Suppose l - 1 = at. Solve 4w - 6 = -2m, m - 5w = -tw + 1 for m. -1 Suppose 4o = -4, 3d - 2o = -7o + 55. Solve 5a = -4s - 45, -2s + d = -3a - 3s for a. -5 Let n(b) = b + 4 - 3b2 + 5b*3 - 5 - 4b*3 + 4. Let q be n(3). Solve qs = 4h + s - 37, 2h = -s + 1 for h. 3 Let y(u) = -u*3 + 19u*2 - 18u + 4. Let o be y(18). Solve 5a = a + 20, -2a = -ok - 2 for k. 2 Let f(u) = u3 + 8u*2 + 2u + 4. Let p be f(-8). Let n = -8 - p. Solve -5c = -20, c - 23 = -d - nc for d. 3 Suppose 4m + 8 = -m + 4b, 0 = -3m - 5b + 10. Solve m = 2j - 4v + 14, -j + 3v = -0v + 10 for j. -1 Let y = -8 + 10. Let c be 2/12y0. Suppose 3t = 4f - 60, -f + 4t + ct = -28. Solve f = x - 4u, -4u = 3x + u - 2 for x. 4 Let z be (1 + -1)5/15. Solve 4a + 25 = 5u, z = -6a + a + 4u - 20 for a. 0 Let p(s) = -s. Suppose 7 = -2b - 1. Let j be p(b). Solve 3c = -f - j, 0c + 5 = -c - 4f for c. -1 Let l = 25 - 9. Suppose -2i = -0i + 6. Let g = -3 - i. Solve -3o + 4 + 10 = b, g = 3o - 5b + l for o. 3 Let u(l) = -2l + 1. Let y be 4/(16/(-12)) - -2. Let t be u(y). Let h be 1-38/(-6). Solve -3 - 17 = -tp - hw, w = p + 5 for p. 0 Let a = 111 + -107. Solve 4 = -2p - an + 2, 0 = -4n for p. -1 Suppose 0 = -r - 3o - 31 + 7, 52 = -3r - 4o. Let x be (-1)/(-3) - 68/r. Let g = x - 4. Solve -5w = -gp + 25, -2w + w - 18 = -3p for p. 5 Let k(c) = c3 + c2 + 20. Let u be k(0). Solve 4l - u = t, -5t + 2t = 5l - 25 for t. 0 Let o(i) = i*3 + 5i*2 + 4. Let s be o(-5). Solve -5k - 17 = sn - 0n, 2k = 3n + 7 for n. -3 Let l(o) = 1 + o*2 - 7o + 9o - 3o. Let z be l(0). Suppose 5k - 48 = j, 5k + 8 = -5j + 38. Solve 5q + d - k - 4 = 0, 4q + z = 3d for q. 2 Let w = 0 + 2. Solve -5q = 4b - 11, q + wq = 4b - 19 for q. -1 Let s = -67 + 100. Let n be (1-2)/((-6)/s). Let f = n - 7. Solve -2t + 2k + 6 = 0, -fk + 7k = -2t + 16 for t. 5 Let z(f) = f*2 - 8f + 3. Let y be z(7). Let p be ((-2)/y)/(2/44). Let u = 18 - 8. Solve -5x - 12 = i + p, 0 = 5i - u for x. -5 Let i = -109 - -121. Solve -2z + 0z - 5q = i, -4q - 8 = 0 for z. -1 Let j(l) = -4l3 - l. Let u be j(-1). Suppose -4c = 2q + q - 13, 5c + 45 = uq. Solve 2k = z + q, -4z - z - 28 = -3k for k. 1 Let z be (-4)/(-2) + (1 - 0). Solve 4 = zx + 10, -5d - x + 23 = 0 for d. 5 Let b = -8 - -18. Solve -3j - 5o + b = 0, 4o + 17 = 5j - 12 for j. 5 Let d be (-24)/20(1 + -6). Let l(f) = f + 4. Let h(z) = -z - 1. Let b(q) = -2h(q) - l(q). Let x be b(d). Solve xc = -3i + 2c - 9, -4i - 5c = 12 for i. -3 Let i = 83 + -81. Solve 0 = -iv + 4h - 20, 2v + 4h - 8 = h for v. -2 Suppose -5k - 11 = 2o, 4o - 9 = -k - 4. Suppose -5f + 4y = 2y - 26, -oy = 3f - 6. Solve 0 = -2g + fx + 6, 4g = 4x - 2 - 2 for g. -5 Let u(n) = n2 - 7n + 9. Let z be u(6). Solve 5f = 2c - 1, -3f = -zc - c + 9 for c. 3 Let z = -11 - -11. Solve -u + 0b - 6 = -b, z = 5u + 2b + 23 for u. -5 Let c be -1-14 - 0. Suppose -4q = 4i - 61 + 13, 2q - ci = 0. Solve -5h + qf = 3f + 20, -5h + 3f = 16 for h. -2 Let g(b) = b*2 - 3b + 1. Let l be g(7). Solve 5n = -4r - 0n - l, r + 16 = -3n for r. -1 Suppose 3x - 2 = 4t, -5t = -0x - 2x - 1. Solve -4a + 2s - 6 = -x, 4s = -3a + 8 for a. 0 Let p(b) = -b2 + 8b + 12. Let q be p(9). Let m be q4/(-6) - 0. Let t be 0 - (0 - -10)/m. Solve -2g - 20 = 2g, 0 = tv - 4g for v. -4 Let l(t) = -t2 + 6t - 1. Let w be l(6). Let r be (-1 - w) + 0/(-1). Solve 0 = 4j - y + 9, y + ry = -2j - 3 for j. -2 Let p(l) = -l3 - l2 + 2l + 2. Let x be p(-2). Solve -t - 30 = -5c, 2c = -xc - t + 15 for c. 5 Suppose 0n - 5n - 40 = 0. Let f = 10 + n. Solve 4u = fv + 6, 3v - 5u + 7 + 2 = 0 for v. -3 Let p(d) = 4d*2 + 5d + 6. Let q be p(-4). Suppose -3f - 25 = -2z, 5f = 7z - 2z - q. Solve -4 = -4y - 3g, -4y + zg + 7 - 35 = 0 for y. -2 Let f be (-1)/((-2)/4) - -2. Let o = 10 - 5. Suppose 3h + 5a = 14 + 25, 3a + 99 = oh. Solve -h = d - fy, y - 1 = 4 for d. 2 Suppose 4 = -4m - 3x - 10, -10 = 3m + 2x. Let f be m/4-8 - 1. Suppose -fs - 10 = -8s. Solve -b = 2c - s, -5c + 12 = -c + 4b for c. -1 Suppose 0 = -4v - 0v. Let t = -19 - -14. Let o = 13 + t. Solve vm - w = -m + o, w = -3 for m. 5 Suppose p - 5m = 14 + 4, 0 = 5p - 4m - 111. Solve -5c - p = -i, -10 = 4c + i + 3 for c. -4 Let p(t) = 4t - 1. Let d be p(2). Solve -5g = 2i - 4g + 5, g - d = i for i. -4 Let j be 0 + (-3 + -4)-2. Let w be j/49 - 30/7. Let n = w + 8. Solve -nq + 3z = -32, 4q - 3 - 37 = 5z for q. 5 Let s(u) = u2 - 19u + 35. Let j be s(17). Solve -7 = -5z + 3c + j, 0 = -3z + 3c + 6 for z. 1 Let c(y) = y - 2. Let p be c(5). Suppose -33 = pv - 99. Solve 0 = 5w - 20, 4w - v = -i - i for i. 3 Let r be 4 - 7/((-7)/(-2)). Solve -6 = -4c - rs, -4c + 2s + 26 = -0s for c. 4 Let b(p) = -p + 17. Let u be b(14). Solve -3x - 3 = -0, 2j - 5 = -ux for j. 4 Let u be -2 + (-27)/(3 + 0). Let h = u - -5. Let t be (2 + -3)/(2/h). Solve 0 = -3j - 9, -5 - 10 = -3g + tj for g. 2 Let d = 9 + 0. Let z(r) = -r*3 - 2r*2 + 5r + 2. Let b be z(-3). Let i be ((-7)/b)/((-1)/(-4)). Solve p = 3h - d, h - i = -3p + 2p for p. 3 Let f(o) = o - 1. Let i = 3 + 0. Let n be f(i). Suppose nq + 3q - 15 = 0. Solve -5w - 2l - 16 = 0, -qw - 3 = -l - 0l for w. -2 Suppose o - 4 = -2. Let c = -7 - -10. Solve ou + 3 = 3x, -x - 2 = -3u - c for u. 0 Suppose 4 = 2w - 0w. Let q be 68/8 + w/(-4). Suppose -j - j = -q. Solve -6 = -i + 5p, -2p = ji + 2p for i. 1 Let c(i) = -i*2 + 14i - 8. Let z be c(6). Solve -5d - 3q - z = 0, 2d = -4q + 3q - 15 for d. -5 Suppose 0 = 2j - 5j + 15. Solve -4b + 9b + 13 = l, jb = -5l - 25 for b. -3 Suppose 0 = -8t - 7 + 31. Solve -m = -3m + 5p - 30, -tp = -12 for m. -5 Let u = -87 - -89. Solve -6h - 20 = -ug - h, 0 = g + 4h + 3 for g. 5 Let u be -3 + 3 + 41. Solve 3o + 24 = -um + 1, -o + 3 = -4m for o. -5 Suppose 3c = -2c + 10. Suppose 0 = cd + 3m - 4 - 5, 0 = -d - 4m + 7. Solve -4 = 5l + 4z + 1, -4l + 27 = -dz for l. 3 Let s = -3 + 3. Suppose 0 = -3n + n + 10. Let z(t) = t*3 + 3t*2 - 4t - 4. Let m be z(-3). Solve -2y + m = 6, s = -4x + ny + 7 for x. 3 Let p be 4 - -320/15. Let l be 176/10 + (-2)/(-5). Suppose -l = -2z - 4s, -p = -3z - 4s + 25. Solve -9 = r + 4y, -4y - z = -r - 0r for r. 3 Let k = -2 + 6. Let b = 5 - 2. Suppose bu - 4 - 2 = 0. Solve -5h + 3 = -kr, r - uh + 9 = 2r for r. 3 Let v(n) = -2n - n3 + 7 + 22 - 41 - 14n*2. Let t be v(-14). Solve -4r = -l + 22, t = -2l + r - 5r for l. 2 Suppose -5r + 2c = -21, -3r - 2 + 8 = c. Solve 2u - x = 11, -3u - x + 6 = -r for u. 4 Let a = 4 + -1. Solve ao - 2 = -3h + h, -2 = 2h + o for h. -2 Let u be 3*1 + -8 + 7. Let y = 1 + u. Solve -l + h = -7,	{ "pile_set_name": "DM Mathematics" }
- 25k2. Solve c(h) = 0 for h. 1 Let c(j) be the first derivative of 1/9j*3 + 0j + 1/6j2 - 2. Determine y, given that c(y) = 0. -1, 0 Let m(h) = -3h*2 - 27h - 15. Suppose 4l = -l + 10. Let x(c) = c2 + 7c + 4. Let n(y) = lm(y) + 9x(y). Factor n(w). 3(w + 1)(w + 2) Factor -2/3x2 + 4/3x + 0. -2x(x - 2)/3 Let d(i) = -3i2 - 9i - 4. Let b be -2 - (0/1)/1. Let w(r) = 21r2 + 63r + 27. Let m(y) = bw(y) - 15d(y). Factor m(o). 3(o + 1)(o + 2) Let t(q) = -3q4 - 18q*3 + 8q*2 + 10q - 1. Let d(x) = x*3 + x - 1. Let o(s) = 4d(s) + t(s). Suppose o(n) = 0. Calculate n. -5, -1, 1/3, 1 Let k(l) be the first derivative of -l6/30 - l5/10 - l*4/12 + 3l*2/2 - 3. Let d(n) be the second derivative of k(n). Factor d(v). -2v(v + 1)(2v + 1) Let g(k) = k3 - 5k*2 + 10k - 12. Let i be g(3). Factor 4/7w - 2w*2 + i. -2w(7w - 2)/7 Suppose 2 = 2s + 3w - 4w, 4w - 8 = 0. Let m(q) be the first derivative of 1/2qs - 1/6q*3 - 1/2q - 3. Find i such that m(i) = 0. 1 Factor -3q5 - 3q + 1 - 1 + 12q3 - 6q*3. -3q(q - 1)2(q + 1)*2 Let q be -2 - (-3 + 3/(2 - -1)). Factor 0 + 4/7n*3 - 2/7n*4 - 2/7n*2 + qn. -2n2(n - 1)*2/7 Let o be ((-9)/(-3) - 5) + 5. Let h be (o1)/(33/22). Determine i, given that 2/3ih + 0i + 0 = 0. 0 Let f = 80/7 + -1012/91. Factor 0v - 2/13v*2 + 0 - fv*3 - 2/13v*4. -2v*2(v + 1)2/13 Let m(u) be the third derivative of u7/12600 - u6/3600 - u5/300 + u*4/12 - 2u2. Let x(p) be the second derivative of m(p). Find w such that x(w) = 0. -1, 2 Let g(f) be the second derivative of -f7/210 + f5/30 - f3/6 - f*2 + 3f. Let v(m) be the first derivative of g(m). Factor v(q). -(q - 1)*2(q + 1)*2 Factor 4j + 3j4 - j - 9j*3 + 8j*5 - 5j*5 + 3j - 3j2. 3j(j - 1)2(j + 1)(j + 2) Let f be (-24)/(-7) - (-41)/574. Factor -fo*3 + 0 - 3/2o*4 - 5/2o*2 - 1/2o. -o(o + 1)2(3o + 1)/2 Factor x3 + 0x + 1/4x4 - 5/4x2 + 0. x2(x - 1)(x + 5)/4 Let w(b) be the second derivative of b4/4 + b3/2 + 14b. Factor w(s). 3s(s + 1) Let b(o) be the second derivative of -o6/120 - o5/120 - o3/3 - 2o. Let l(p) be the second derivative of b(p). Suppose l(g) = 0. Calculate g. -1/3, 0 Let t(n) = -8n4 + 4n*3 + 30n*2 - 16n + 2. Let z(b) = -8b4 + 4b*3 + 29b*2 - 16b + 3. Let c(v) = -3t(v) + 2z(v). Factor c(w). 4w(w - 2)(w + 2)(2w - 1) Factor 4w - 5w4 - 5w*3 + w + 0w + 15w2 - 10. -5(w - 1)*2(w + 1)(w + 2) Let t be 2/4 - (-45)/10. Let 3k*2 - 2k - k - k*4 + tk = 0. Calculate k. -1, 0, 2 Let a(b) = b*2 - b - 12. Let z be a(-3). Let v(y) be the third derivative of -1/18y*4 + 0y + 2/9y3 - 3y*2 + z + 1/180y5. Factor v(h). (h - 2)2/3 Let l(q) be the first derivative of 4q3/3 - 6q*2 - 5. Determine b so that l(b) = 0. 0, 3 Let t be (47/(-987))/((-2)/481). Let 8/7m4 + tm*2 + 0 - 2/7m*5 - 12/7m*3 - 2/7m = 0. Calculate m. 0, 1 Let a(g) be the third derivative of -g8/7560 - g7/3780 + g6/1620 + g5/540 + 2g3/3 + 4g*2. Let s(t) be the first derivative of a(t). Factor s(h). -2h(h - 1)(h + 1)*2/9 Let w = -3742/13 + 288. Suppose 3j - 4j + 2 = 0. Solve -2/13l*4 + 0 + 0l*3 + 0l + 0lj - wl*5 = 0 for l. -1, 0 Suppose 0o = -o + p + 16, -o - 5p + 10 = 0. Determine l, given that -75/2l*2 + 125/4l*3 - 2 + ol = 0. 2/5 Let g(y) be the second derivative of -y7/210 - y6/50 - y5/50 + y4/30 + y3/10 + y2/10 - 4y. Factor g(v). -(v - 1)(v + 1)*4/5 Let p be (-9)/(-6)4/3. Determine k so that -2kp - 2k + 4k + 0k*2 = 0. 0, 1 Let p(k) = -5k*3 - 7k*2 + 3k + 3. Let t(h) = -11h3 - 15h*2 + 7h + 7. Let b(s) = 7p(s) - 3t(s). Determine l, given that b(l) = 0. -2, 0 Let a(i) be the second derivative of -1/42i4 + 0i*2 + 0 - 1/21i*3 + 3i. Factor a(h). -2h(h + 1)/7 Let m(i) = -3i3 - 7i*2 - 7i + 1. Let a(y) = 6y3 + 14y*2 + 15y - 3. Suppose -12 = 5h + 13. Let j(o) = hm(o) - 2a(o). Factor j(x). (x + 1)2(3x + 1) Suppose -49 = -3y - 2z, 4y - z - 52 = 3z. Suppose y = -j + 6j. Factor 4p5 - 6p*5 - 2p - 3p3 + 7p*j. -2p(p - 1)2(p + 1)*2 Suppose -2t - 2 = 6a - 8a, -2t - a = -7. Factor 4/9 - 8/9n*t - 14/9n. -2(n + 2)(4n - 1)/9 Factor 0 + 2/5n*3 - 2/5n*2 + 0n. 2n2(n - 1)/5 Suppose -21 + 1 = -4x. Let f = 24 - 22. Factor 2n*x + n - 3n + fn3 + 2n*3 - 4n*5. -2n(n - 1)2(n + 1)*2 Let k be 1(-1)/(-2)0. Let q(m) be the first derivative of -2 - 1/5m*5 + 1/2m*4 + 0m*2 + km - 1/3m3. Factor q(h). -h2(h - 1)*2 Suppose -5g + 2 + 4 = 4n, n - 9 = -5g. Suppose -13 = -5c - 3q, -c + 6 = -q - 3. Solve -cmg + 4m + 5m3 + m2 - 4m3 = 0 for m. 0, 2 Let u(l) = -l2 + l - 14. Let j be u(0). Let z(d) = -5d3 + d2 - 5d + 3. Let t(f) = 11f3 - f2 + 11f - 7. Let v(p) = jz(p) - 6t(p). Factor v(a). 4a(a - 1)*2 Suppose 0k = -k + 3. Factor 7n - n - 2n + 7n2 - n2 + 2n*k. 2n(n + 1)(n + 2) Let u(c) be the second derivative of c7/140 + c6/80 - c*2/2 - 6c. Let y(f) be the first derivative of u(f). Factor y(x). 3x3(x + 1)/2 Let h(y) be the first derivative of y*6/30 - 3y*4/10 + 8y*3/15 - 3y*2/10 + 2. Factor h(z). z(z - 1)*3(z + 3)/5 Let f(h) = -h4 - h3 + h. Let d(l) = -3l4 - 6l*3 - 5l*2. Let t = -3 + 0. Let m(j) = td(j) + 6f(j). Determine y so that m(y) = 0. -2, -1, 0 Let v(z) be the second derivative of 1/3z*3 + 1/3z4 - z2 + 1/21z7 - 1/15z*6 - 1/5z*5 + 0 + 2z. Solve v(c) = 0. -1, 1 Let z be ((-2)/(-5))/(2/10). Let s be (31)/(-13 + 9) - -1. Factor 1/4a*z - sa - 1/2. (a - 2)(a + 1)/4 Let m(b) be the third derivative of -b8/33600 - b7/4200 - b6/1800 + b4/6 - b2. Let i(o) be the second derivative of m(o). Solve i(q) = 0. -2, -1, 0 Factor -41a*2 - 3a*3 + 24 + 0a - 6a + 26a*2. -3(a - 1)(a + 2)(a + 4) Let p(k) = 5k5 + 5k*4 - 5k3 + k2 - 3k + 3. Let c(a) = 6a*5 + 6a*4 - 6a*3 + 2a*2 - 4a + 4. Let b(t) = 3c(t) - 4p(t). Factor b(f). -2f2(f - 1)(f + 1)2 Let f(d) be the second derivative of -d4/42 + d3/21 - 42d. Determine y so that f(y) = 0. 0, 1 Let i be 5 - (3 + 3/(-1)). Let -l*4 + 2l*4 + 0l*3 - il + 3l - 1 + 2l*3 = 0. What is l? -1, 1 Suppose -4h = -0h - 2l - 14, -7 = -5h - l. Factor -2/5m*h + 0 - 2/5m. -2m(m + 1)/5 Let g(x) be the third derivative of -3x5/160 - 5x4/64 - x3/8 + 21x2 - 2. Factor g(u). -3(u + 1)(3u + 2)/8 Let o(w) be the third derivative of -w7/5040 - w6/480 - w*5/120 + 7w*4/24 - 7w*2. Let v(u) be the second derivative of o(u). Solve v(c) = 0 for c. -2, -1 Let j(s) be the second derivative of -s + 0 - 1/20s*5 - 1/2s*3 - 1/2s*2 - 1/4s4. Factor j(k). -(k + 1)3 Let 12 - 3/2s5 - 42s + 57s2 - 75/2s*3 + 12s*4 = 0. Calculate s. 1, 2 Suppose -2h = b - 5h - 3, 0 = 3h. Let i(c) be the third derivative of 1/210c5 - 1/42c4 - c2 + 1/21cb + 0 + 0c. Determine r, given that i(r) = 0. 1 Let o(q) be the first derivative of -4q5/5 + q4 + 4q*3 - 2q*2 - 8q - 20. Factor o(p). -4(p - 2)(p - 1)(p + 1)2 Factor -3/2g*2 + 0 - 3/8g. -3g(4g + 1)/8 Suppose 2o - 3o = -3. Factor 0a*3 - 2a*2 + 3a*2 + 4a + a*2 - 2a*o. -2a(a - 2)(a + 1) Let x be (-7)/(-245)14 - (-1)/5. What is k in -1/5k*3 + 2/5k + 0 + 3/5k2 - xk*4 - 1/5k*5 = 0? -2, -1, 0, 1 Let o = -265 + 2917/11. Suppose 6/11d*3 - 6/11d*4 + 0d - od2 + 0 + 2/11d*5 = 0. Calculate d. 0, 1 Suppose 2o - 4o = -14. Let m = 10 - o. Factor -2v + 4v2 - 7v*3 + 0v*3 + 10v*m + 8v*4 + 11v*3. 2v(v + 1)2(4v - 1) Let n(w) = -w2 + 7w + 10. Let p be n(8). Let z(u) be the first derivative of -4up - 1 - 5/3u*3 - 1/4u*4 - 4u. Determine d, given that z(d) = 0. -2, -1 Let h be (2 + -1)884/12. Let p = -73 + h. Factor 0 + 0d + 4/3d3 - 2/3d*2 - pd*4. -2d*2(d - 1)*2/3 Suppose -k = -0k + 4. Let s = k - -6. Factor -q + 0qs - 2 + 4 - q2. -(q - 1)(q + 2) Let i = -75 - -78. Factor f*2 + 0f - 1/2fi + 0. -f2(f - 2)/2 Suppose 6 - 15 = -3r. Factor -2/9v*r + 4/9v*2 + 0v + 0. -2v2(v - 2)/9 Let f(l) = -l3 - l2 + 2*l + 2. Let t be f(-2). Let m(a) be th	{ "pile_set_name": "DM Mathematics" }
- -12) + (5 - 1). 1 -1 - ((2 + 1 - 3) + 1) -2 Calculate (-3 + -5 - -4) + (2 - 2). -4 Evaluate 11 + -10 - (2 - 1) - 5. -5 What is 10 - (15 + -8) - (6 - 1)? -2 What is (9 - 12) + 7 + -1? 3 What is the value of 1 - (8 + 2 + -5)? -4 What is the value of 17 + -4 + (2 - -1 - 6)? 10 Calculate 0 + (-6 - (-5 - -2)). -3 -1 + -2 - (33 - 36) 0 What is (1 - (-1 - -3 - -1)) + -4? -6 What is the value of 2 - (-4 + 12 + -3)? -3 Calculate 0 - 5 - (-2 + -1). -2 Evaluate 5 + 2 + 1 + -1. 7 What is -9 - (-10 - 4 - -10)? -5 Evaluate (1 + 0 - -1) + -5 + 6. 3 (8 - 20) + (0 - (-1 + -3)) -8 Evaluate 11 - 9 - (6 - 3). -1 Calculate 1 + 3 + (-3 - (-2 + -3)). 6 Calculate 3 - (8 + -8 + 1). 2 What is -1 + 13 - (24 - 19)? 7 Calculate -7 - -3 - (-8 - -9). -5 What is the value of 2 + 2 + (10 - 11)? 3 Calculate -7 - ((-7 - -5) + -2). -3 Calculate (-3 - -10) + (-3 - 1). 3 Calculate -6 - 1 - 1 - -8. 0 Evaluate 9 + -13 + 8 - (0 - 1). 5 (2 - (1 - 2) - -6) + -5 4 -1 + -2 + (4 - -1 - 3) -1 Evaluate (2 - (11 - 4)) + 3. -2 Calculate (-2 - -1) + 8 + -6. 1 (1 - 1 - (12 + -11)) + 5 4 What is the value of 1 - 6 - (24 - 35)? 6 Evaluate (-10 - -5) + 8 + -6. -3 Evaluate (-8 + 8 - (1 + -3)) + 0. 2 Evaluate -6 + 9 - (4 - (6 - 8)). -3 2 + 5 + (-9 + 2 - -6) 6 Evaluate 0 + 7 + (-4 + 3 - 2). 4 What is the value of -4 + 3 + -3 + 2? -2 Calculate (-5 - -3) + (-8 - -10). 0 What is the value of -1 - -1 - (4 - -2 - 10)? 4 What is the value of 0 - 2 - (-72 - -62)? 8 What is the value of (54 - 41) + -15 + -3? -5 2 + (5 - 9) + -2 -4 -4 - 0 - -6 - 1 - -3 4 What is (-4 - (0 - -1)) + 230 + -227? -2 What is the value of (10 - 7 - 10) + (1 - -13)? 7 -2 - (-17 + 15 - (2 - 1)) 1 What is the value of 4 + (1 - -4 - 5)? 4 4 + 6 + -28 + 6 + 6 -6 3 - 1 - (33 + -30) -1 What is the value of -2 + (10 + -1 - (13 - 9))? 3 Evaluate (-2 - (-7 - -6)) + 1 - -3. 3 Calculate 2 + (5 - -2 - 8). 1 What is (29 - 27 - (4 + -1)) + 6? 5 -20 - -18 - ((-2 - 3) + -1) 4 Calculate 6 - (6 + -4 + 3 + 0). 1 Calculate 0 + 1 - (-61 - -69). -7 What is -7 + 4 - (-15 - -12)? 0 Evaluate 2 + -2 + -10 + -4 + 10. -4 What is the value of 5 + -4 + 4 + -1? 4 Calculate 3 - (3 + 1 + (13 - 16)). 2 -6 + (18 - (14 + 2 + -9)) 5 What is the value of -27 - (13 + -23) - -12? -5 Evaluate -3 + (5 - 3) + 1. 0 What is the value of (-8 - -1) + 9 + -5? -3 What is -2 + -3 + (-2 - -3 - -3)? -1 What is the value of 7 - 4 - 5 - -4? 2 What is 3 + 1 - (-1 + (9 - -4))? -8 Evaluate (-3 - (0 - 2)) + (1 - 5). -5 What is (2 - -1) + -39 + 37? 1 What is the value of -9 + 1 + (-38 - -42)? -4 What is -12 + (9 - 2) - -6? 1 What is the value of -6 - -5 - -1 - 1? -1 What is 1 - (3 + -4) - 3? -1 What is the value of -4 + (-5 - 3) + 16? 4 7 + -8 + 1 + (0 - -1) 1 Evaluate -10 - (2 + -8 + 9 + -9). -4 What is the value of 9 - (-9 + 9) - 3? 6 Evaluate 10 + 1 + 3 + -17 + 8. 5 5 + 9 + -4 + -5 5 Evaluate -3 + (-3 + 1 - (8 - 13)). 0 What is 7 + (2 - 5) + -7? -3 What is the value of -2 + 0 - (3 + -20 + 10)? 5 Calculate 1 + -3 + (4 - 2). 0 -5 + (2 - 4) + -2 - -4 -5 Evaluate 5 - (4 + -3) - 8. -4 Calculate -2 + (5 - 7) - -5. 1 What is 9 - -2 - (54 - 49)? 6 Evaluate 1 + 2 - (0 - (5 + -6)). 2 Evaluate 8 + 2 + (0 - 9). 1 What is the value of -4 - -1 - (52 - 57)? 2 What is the value of 0 - (-9 + 3) - 7? -1 What is 7 - (0 + 1) - 6? 0 What is the value of -1 - -7 - (-51 + 62)? -5 Calculate -6 + -4 + (9 - 1) + 0. -2 What is 0 + -6 + 2 + 0? -4 Evaluate -4 + 5 + -5 - (-1 - 0). -3 Evaluate (18 + -14 - (5 - 2)) + -6. -5 Evaluate -4 - (4 - 6) - -3. 1 Calculate (-4 - -3 - 1 - 0) + 0. -2 (3 - (-4 - -7)) + 0 + -1 -1 Calculate 4 - (-5 + (-4 - -17)). -4 What is the value of -5 - 9 - -9 - -1? -4 What is the value of -8 + -1 + 7 - (0 - -5)? -7 What is -95 - -86 - (-10 - 0)? 1 Evaluate 1 + -3 + -3 + 4. -1 (1 - 3 - -7) + -4 1 Calculate 1 + -6 + (-5 - -5). -5 Calculate -1 + -2 + 0 + 12 + -5. 4 Calculate 8 + ((-1 - 0) + -1 - 2). 4 What is the value of -7 - (0 - 6) - 0? -1 Calculate 4 - (2 - (-4 - -4 - -1)). 3 What is the value of 4 - (-5 - (6 - 17))? -2 What is -1 + 3 + 16 + -17? 1 What is the value of 1 + 0 + (0 - (5 - 8))? 4 What is the value of 1 + -5 - (3 + -7 - -2)? -2 Evaluate 29 + -23 - (-2 + 2). 6 Evaluate 10 - 5 - -2 - (-2 + 6). 3 Evaluate 9 + (-5 - 1) - -1. 4 Calculate 3 + (2 - 14 - -4). -5 Calculate (-4 - -9) + (-4 - -2). 3 8 + (-8 - 2) - (2 - 1) -3 What is 7 - (2 - 1) - (-7 + 11)? 2 3 + -3 - 8 - -8 0 Calculate 0 + 2 + -6 + 8. 4 3 + -2 - 8 - (-97 + 94) -4 Calculate -6 + 6 + 1 + -6 + 1. -4 Calculate 2 + (4 - (-3 - -4)) + -9. -4 1 + -2 + -8 + 10 1 What is -5 - (2 - 5) - (-6 - 0)? 4 Evaluate -3 + -4 - -3 - -7. 3 Calculate 8 + -9 + 6 + -10. -5 -1 + 0 + 6 + -12 + -1 -8 What is -11 + 13 + (1 - 0)? 3 Evaluate -5 + 6 - (-1 + -3). 5 Calculate 11 - ((20 - 10) + -3). 4 -8 + 0 - -14 - (-1 + 5) 2 Calculate 2 - 0 - (3 - -1). -2 Calculate -5 + (4 - -1) + -4. -4 Calculate -8 + -1 + 6 + 2. -1 7 + -8 + 10 + -7 + 2 4 Evaluate 4 + -3 - 2 - -8. 7 Evaluate -11 + -5 + (10 - 1). -7 What is the value of -12 + 4 + 16 - 4? 4 What is 0 - (-3 + 5 - -3)? -5 4 - (-2 + (-3 - -1) + 4) 4 Calculate (3 - -8) + (-3 - 15). -7 Evaluate (-1 - (6 - 7)) + -2. -2 What is 4 - ((6 - 3) + 0)? 1 Evaluate (-2 - (5 + -9)) + -5 + 7. 4 -11 - (-1 + -1 + -4) -5 (-5 - -5) + 2 + 1 3 What is the value of 2 + -6 + 0 + (-1 - 0)? -5 8 + (0 - 17) + 4 -5 What is the value of -5 + (13 + -3 - 6)? -1 Evaluate (7 - 3) + -2 + 3. 5 What is the value of -64 - -69 - (1 + -1 - -12)? -7 Calculate -2 + -3 + 16 + -10. 1 -4 - 0 - (1 - (1 - 1)) -5 Evaluate -6 + 10 + (-9 - -1 - -2). -2 Evaluate 7 - (-1 + 3 + 4). 1 Calculate 14 - (14 + -2) - 1. 1 Evaluate -12 - -1 - -6 - (-1 - 0). -4 What is the value of (1 + -2 - (-23 - -21)) + 1? 2 -4 + (0 - 3) + 2 -5 Evaluate (-3 - 4 - -7) + 2 + -7. -5 Evaluate (-23 - -23) + 0 + -2. -2 Calculate -7 + (-7 - -17 - 5). -2 1 - 5 - (-2 - (0 - -4)) 2 Calculate 79 + -77 - (-2 - 0). 4 What is the value of -2 + (-1 - (-4 + 0)) + 4? 5 Evaluate -4 + (14 - 5 - 4) - -3. 4 What is (-5 - -4) + -3 - (-1 - -1)? -4 1 - 2 - (-20 + 24) - -7 2 Evaluate 5 + (0 - (-7 + 8 + -3)). 7 Calculate (5 + -1 - 2) + -5. -3 What is the value of (8 - (7 - -8)) + 8? 1 (4 - 1) + (-25 - -21) -1 What is 2 + 11 + 90 + -96? 7 What is the value of 0 - 3 - (4 + 0 - 2)? -5 (3 - 2) + (-2 - 2) - 2 -5 Evaluate -19 + 6 + 13 - -8. 8 -7 + -7 + (9 - -9) 4 What is the value of (0 - -1) + -2 - (-19 + 13)? 5 -5 + 0 - (0 - 9 - 1) 5 Evaluate (7 - 0) + 7 + -9. 5 Evaluate 1 - -2 - (19 + -11). -5 (5 + 0 - 13) + 3 -5 What is the value of (-5 - -3 - -4) + (-14 - -13)? 1 -2 + 2 - (5 + -1) -4 0 - (5 - 5 - 0) - -2 2 Calculate (14 - 14) + (-2 - 1). -3 Evaluate -1 + -4 + -1 + 2. -4 Calculate -8 - -6 - (1 - 1 - 4). 2 -2 + 1 - (4 - 1) -4 What is 3 + -4 + (-1 - -1)? -1 Calculate (-1 - 0) + -11 + 3 + 4. -5 84 + -70 - (-1 + 10) 5 What is the value of (-1 - (-3 - -4)) + 1? -1 Calculate -30 - -24 - (2 + -3). -5 -1 - (1 - 1 - -2) - 2 -5 What is 11 - (-15 + 23) - (3 + 1)? -1 0 + (-3 + 0 - (2 + -3)) -2 Evaluate 19 + 1 + (-4 - 7). 9 Calculate -9 + 25 - 5 - 7. 4 What is the value of 3 - (0 - (9 - 4) - -6)? 2 What is the value of 1 - 0 - (1 - (1 - 1))? 0 Calculate 2 + -4 + 0 + (-3 - -4). -1 -12 + 6 + -3 + -5 + 7 -7 Evaluate (2 - (0 + 0)) + -9 + 3. -4 Calculate -8 - -7 - 7 - -11. 3 What is -26 - -28 - (-2 - -1)? 3 What is 2 + 4 + (-8 - -5)? 3 -1 - (1 + -1) - (69 - 72) 2 What is -10 - (-7 + 0) - -12? 9 -3 + (-6 - -6) + 3 0 -3 - (-1 - (-8 - -1)) - -5 -4 What is -5 + 4 + 3 - 0? 2 What is 9 - (8 + -1 + 10)? -8 4 + -1 + (-6 - -1) + -1 -3 What is the value of -4 + -1 + -1 + 8? 2 Calculate (6 - 8 - -2) + 2 + 1. 3 What is the value of -2 + (4 - 1 - 1) - 4? -4 What is the value of 0 - -4 - (26 + -21)? -1 Calculate -6 + (1 - -5) - -3 - 8. -5 Calculate 3 - -2 - 2 - (2 + -2). 3 What is -5 + (-9 + 4 - -5)? -5 Calculate (-4 + 1 - (-15 - -4)) + -2. 6 Evaluate 3 + -1 + (17 - 17). 2 Evaluate -2 + (-4 - 1) + 9. 2 Evaluate -5 - (-2 + 7 + -7 + -3). 0 -12 - (6 + -12) - -10 - 9 -5 Evaluate -2 + -1 - (3 - (3 + 2)). -1 What is the value of 2 + -5 - -3 - 2? -2 Calculate 37 + -29 + (-13 - 0). -5 What is (-1 - -3) + 0 + (1 - 1)? 2 What is -3 + (-2 - -10) - (2 - 0)? 3 Evaluate -4 + -9 + 20 + -1. 6 Evaluate (-2 - (-5 - -2)) + 3 + 1. 5 Calculate (-4 + 3 - -2) + -3. -2 Calculate (-1 - -7) + (-11 - 0) + 5. 0 Evaluate -3 - (-10 - (6 + -10)). 3 What is -9 - (-2	{ "pile_set_name": "DM Mathematics" }
5)/g)/g)28/(g24g(-26)/g))(-1/52) assuming g is positive. g(181/260) Simplify (((qqq(1/3)/qqq)/q)23/(qq(-2/5))(-37))/((q/q(2/9))22(q/(qq*(-3/5)))/q((qq/q(-4/11)q)/q)/q) assuming q is positive. q(28607/495) Simplify (((f/(f(-10)f))/((f/(f((f*14/f)/ff)/ff)ff)/f))/(f/(f/(f(1/8)/f)))(10/9))(9/7) assuming f is positive. f(827/28) Simplify (h(2/5)hhh)*(3/5)(hh(-1/4))(1/66)(h*(-1/5)h(-2/3)/h)/(h(-1))(-24) assuming h is positive. h(-157181/6600) Simplify (h(-4)/h(-9))*(-21/5)(h*(-6)hh1/h)/((h(6/11)h)/(h/((hhh/((h*5h)/h)hh)/h))) assuming h is positive. h*(-281/11) Simplify (j(jj/(jj*(-6)/j))/jj*(-7)j*(-1/4)j((jjj2jjj)/j)/j)/(((jjj*(-4/7)jj)/j5)/(j0)(3/29)) assuming j is positive. j(233/28) Simplify ((v7/v)/v(-2/3))(-5/6)v*1/(v/(((v/(v/(v/(vv/v*4vv)))v)/v)/v))v5v(-1/2)/v assuming v is positive. v(-37/18) Simplify (b*(1/6)b8)(-33)(b/((b(b*(-2/9)/b)/bb)/b))*34b(b(-3)b)/b(bb/(bb((b*(-1/4)/b)/b)/b)b)/bbb assuming b is positive. b*(-6865/36) Simplify (((xx(-1/3))/x)/x)/x(-2)(x(-1))43(x2/(x(-1/5)x))(-12) assuming x is positive. x(-851/15) Simplify ((p1pp(-2/43)/p)/(pp(3/2))12)(-3/2) assuming p is positive. p(3747/86) Simplify (n*0n/n*(-8)n*0n(-3/2))/(n(2/17)/((nnn*(-3/4)n)/n))34 assuming n is positive. n46 Simplify ((y/(yy(-5))y(-9/2))/(y(2/15)/y)(29/2))(-2/65) assuming y is positive. y*(-392/975) Simplify (nnn/(n(2/3)/n)nnnnn*(2/5)nnnn)17/((n1)(2/71))(-21) assuming n is positive. n(213062/1065) Simplify ((((h6h)/hhh)/(h/(hh/((((h/(h/(h/(h(-17)h))))/h)/h)/h))))/(((h/(h*(-2/11)h))/h)/h(2/3)))(1/70) assuming h is positive. h*(-58/1155) Simplify ((xx*1x)*22xx(2/7)(x*3x)/xx)/(x/x(-3)x(2/5))20 assuming x is positive. x(-117/7) Simplify (l(-1/3)l(-1/8)/l(l1)(-36))/(l*(-4)(l/(ll(-2))l)/l(l/l(1/9))/l(-4)) assuming l is positive. l(-2905/72) Simplify ((((yy/y(-1))/(((y(-12)y)/y)/y))/(yyy(-6)y(-11)))(3/26))(-41) assuming y is positive. y(-3813/26) Simplify (w(-1/2))(1/62)/(w1)(-12)((w2/w)(-1/4))50 assuming w is positive. w(-63/124) Simplify (h(-4)hh(-2)hh/h6hh0)/((h/(hh(-1/2)/h))(1/41)(h(h*(2/7)h)/hh)/(((h/h9)/h)/h)) assuming h is positive. h(-11665/574) Simplify ((cc*(-1/6)c)*(-27)c*(1/18)/((ccc14/ccc)/c))(-3/23) assuming c is positive. c(589/69) Simplify ((cc(-31))/(c/c19)(c(4/17))(-12/5))(-19) assuming c is positive. c(20292/85) Simplify (c(1/7)/ccc(-2/13))(-50)/((c/(c/c0c))*25/(cc*5c*(1/3)c)) assuming c is positive. c(8977/273) Simplify (((r/(r/r(-2/5)))/r(r(-18)r)/r)/(rr(-2/7)/rrrrr(-7)))8 assuming r is positive. r(-4232/35) Simplify (h4)41h(4/3)/h25 assuming h is positive. h*(421/3) Simplify (((t/(ttt1/t))/ttt(9/4))/(t(1/10)/t(-2/27)))(21/5) assuming t is positive. t(4067/900) Simplify (r(-7/6))38/((rr36)/((r/(r/(r(3/7)/r)))/r)) assuming r is positive. r(-1741/21) Simplify (g/(g/g(1/4)))*(-5/12)g/(gg(-3/8)g)g(-1/6)g(g(1/2)g(1/3))(-11) assuming g is positive. g(-145/16) Simplify (((q/q(-1/5))/q)*0(((((q*(5/2)q)/q)/q)/q)/q)/(q4/q))/(q/q(-6)qq/(q/(q*7q))(q(-1/6)/q)(-39/5)) assuming q is positive. q(-143/5) Simplify (((p/p(2/5)p)/p(-3/5))/(((p/(p/(p/(p(-1/9)p)))p)/p)/(p/p(-8))))19 assuming p is positive. p(9481/45) Simplify (f(-3/5)/(f/(((ff(-5)ff)/f)/f)))(-2/11)((f/(f(2/3)/f))(-1/4))(-10/7) assuming f is positive. f(1726/1155) Simplify ((r/(rr(-3/11))rrr*(-1/2)r(-7)/r(2/23))23)(-39) assuming r is positive. r(104871/22) Simplify ((p14pp(3/7))/(p(-6)/pp(3/5)p))(10/13) assuming p is positive. p(1458/91) Simplify (x*3/xx(-3/2))(-8/17)(((x/((x(((x(xx*(-1/3)x)/xx)/x)/x)/x)/xx))/xx)(-7))(-4/15) assuming x is positive. x(296/765) Simplify ((k/k26)(-1/3)/((kk21)/k(-42)))40 assuming k is positive. k(-6680/3) Simplify ((b(-2/15)/b)/b(1/8)b(3/8)/(bb*(-4)))/((b(b*(-1)/b)/bb)*(-15)b*(3/8)bb(-6)) assuming b is positive. b(-991/120) Simplify (t(-1/2)tt/(t(-3)tt)tt)(-8)((t0/t)/(t3/t))/((t(tt*(-2/3)/tt)/t)/(tt/(t(-2)tt))) assuming t is positive. t(-112/3) Simplify ((r(2/3)r)*(4/21)(r/r0)/(r/(r/(r/(r/r(-8)r)))))/((r(-2))(-2/75)rr(1/9)r1) assuming r is positive. r(12841/1575) Simplify (((ccc*(4/21))/(c(c*(2/53)c)/c))/((ccc/(c/(((c/c(-5))/c)/c)))/c(-1/10)))(2/75) assuming c is positive. c(-55063/417375) Simplify (m*(-1/3)m5)(-3/7)(m(-3/4)mm1/m)/(m5/m(2/17)) assuming m is positive. m(-451/68) Simplify (((s/((s/(s(s/(ss(5/7)sss))/s))/s)ss(1/3))35)(2/19))(15/2) assuming s is positive. s*(-725/19) Simplify (((ttt(1/10)/t)/((t(-12)t)/t))/((tt(15/7)/t)/t)(-3/11))(2/71) assuming t is positive. t(10327/27335) Simplify ((h/h(-4/5))/((h(h/h(-1/4))/h)/h))20((h(-6)h)/h(-3/2))(-12) assuming h is positive. h73 Simplify s5s(ss(6/5)/s)/s(s(1/2))(-2/3)((sss/s(-1))/(s/(s(-2/3)s)s))(-7/5) assuming s is positive. s(13/5) Simplify (w(2/3)w)49/(w(-5/4)w(-8)w)(((ww/(w*3w))/w)/ww/w(-9))/(w(-4)/w3) assuming w is positive. w(1235/12) Simplify ((g(-2)/g)13)0/((g(-1/2))25((g/(g/(gg(-1)g)))/g)(-2/95)) assuming g is positive. g(25/2) Simplify ((s(1/15)/(s(-1)s))/(s3/s(-3)))/(((sssss(s*(-1)s)/sss)/ss)(-3/26)/(s(5/2)s(-1/4))) assuming s is positive. s(-2333/780) Simplify ((((d*10/d)/dd2)/(d(-2)/d)(-33))(-38))(2/87) assuming d is positive. d(6764/87) Simplify (((p/(p(p/((((pp*(1/3)/p)/p)/p)/ppp))/p))/p)/((ppp1)/p))31p/p*(2/3)ppp*(-2/7)(p(2/5))(13/4) assuming p is positive. p*(-23167/210) Simplify (bb25)/(b(-6/5)b)b*34b(-3/5) assuming b is positive. b(298/5) Simplify ((sss/s*(-12))/(((((((ss*(2/33)ss)/s)/s)/s)/s)/s)/s))(-3)/((s2)(-1/79)s(-8)/(s(-2)/s)) assuming s is positive. s*(-42401/869) Simplify ((nn/n*(-12)n(-2))/(n(-1/8)nn/(nn13)n))(-4/9) assuming n is positive. n(-185/18) Simplify (j/j*4jj(-6)/j)(-2/65)((jj(j*(-2/7)jj)/jj)17)(2/79) assuming j is positive. j(67414/35945) Simplify (b(-4)/(b(b(-10/9)bb)/b))(-5)bb/(bb*(2/7)b)bbb1bb(-1/4)b/b(-4) assuming b is positive. b(8293/252) Simplify (((((j/(j(j(2/9)/jj)/j))/j)/j(1/7))/(j(1/9)(jj*(-6/5)j)/j))(5/3))(-6/5) assuming j is positive. j*(58/105) Simplify (((xx*(1/7)xx(-2/21))(13/6))(-8/7))(-33) assuming x is positive. x(24596/147) Simplify (p(-24)/(p/(p((pp(1/11))/pp)/pp)pp))/(p1p/(pp(pp(-1/3)p)/ppp)p) assuming p is positive. p(-767/33) Simplify (c/c(-5)c*(-6/7)(cc/(cc/(cc(-1)cc)))(-43))/((c/(ccc7))/(c/c(-1/2)))(-10/7) assuming c is positive. c(-661/7) Simplify (s(-10/3)/(s/(s/(ss*10/s)))(s(2/3))(-23))(-10/3) assuming s is positive. s(860/9) Simplify ((mm(-2/3))/(mm*(-3/5))m*(-3/5)/((mmm(-2/7))/m))/((mm(1/4))28/((mmm/(m/m*2))/mm/m6)) assuming m is positive. m(-806/21) Simplify (((i/(ii(5/9)))/i)29i*(-2/5)/(iii27/iii))(-39) assuming i is positive. i(44174/15) Simplify ((t/(tt17))/t(-2/19)(t7)33)(-48) assuming t is positive. t(-195264/19) Simplify (ttt(-4)t(t(-2/9)tt)/ttt)(-35)/(t(-1)t(2/9)/t)41 assuming t is positive. t(32/3) Simplify (k(-9)(k/(kk*(4/11)))/k(k(-2/3))(9/4))/(((k/k(-1/4))/k)(-43)k0/k4) assuming k is positive. k(127/44) Simplify (((b/(((bb*(-2)/b)/b)/b))/(b/(b/(b/(bbbb*(-17))b))))/(b(-4))(-1/63))(-4) assuming b is positive. b(2788/63) Simplify (bb5b*(-6)b(b/((b/b0)/bb))*20)/(((b(b/(b/b0))/b)/b)(-19/3))(-21) assuming b is positive. b134 Simplify (ddd*0dd)(-1/47)/(d(1/2)/dd/(d/d*(-6/7))dd)d*4d/(d*2/d)(d**(-1/	{ "pile_set_name": "DM Mathematics" }
+ um3 + q + vm*2 and give v. -12 Rearrange -3q + q + 4q + 1 + (2 - 5 - 1)(2 - 2 - q) + 0q - 2q + 0q to h + oq and give o. 4 Express -3s - 9s*3 + 5s*3 - 4s*3 in the form q + ws*3 + ns + gs2 and give w. -8 Rearrange -39a*2 + 75a*2 - 2a - 36a2 - 55a*3 to ia + c + oa3 + va*2 and give o. -55 Express -3o*2 + 7o + 3 - 10o + 3o - 2o3 as ho + g + so2 + jo*3 and give j. -2 Rearrange 407 - 407 + 30m + 36m to am + u and give a. 66 Express -5 + 12 - 5 + 7i3 - 4 in the form yi*2 + ki + t + ui3 and give u. 7 Express 0m + 7m2 - 10m*2 + 6m as om + y + nm*2 and give n. -3 Rearrange (-10j + 4j + 4j + 1 - 2j - 1 + (3j - 7j + 3j)(-1 + 5 - 3) - 4j + 2j + j)(4 + 3 - 5) to cj + l and give c. -12 Express (m - m - m)(-4 - 6m + 4) + 61m - 7m2 - 61m + (m*2 + 4 - 4)(-2 - 2 + 6) as fm + o + pm*2 and give p. 1 Express 4k*2 - 89k + 2k2 + 86k - 3k2 in the form h + nk + tk2 and give n. -3 Rearrange (-12 - 69 - 19)(-d + 4d - d)(1 - 2 + 2) to cd + f and give c. -200 Express (-9c + 4c - 12c - 4c)(2c2 + 0c*2 - 8c*2) as uc*2 + i + pc*3 + sc and give p. 126 Express (3a2 + 2 - 2)(-2a2 + 3a - 3a)(-1 + 3 - 4) in the form ca2 + wa + va3 + za*4 + d and give z. 12 Rearrange (-2n - 16 + 15 + 17n)(-3 - 3 + 7) to un + p and give p. -1 Express 3a + 22 + 21 - 31 as ua + n and give n. 12 Rearrange 6c*3 + 0c*3 - 6 + 2c + 7 to the form kc2 + zc + jc3 + r and give j. 6 Express -1 + q3 - 51q*2 + 7q*2 + 1 in the form l + yq*2 + kq*3 + jq and give j. 0 Express 8 - 9 - 8m + 7m as um + o and give o. -1 Express -26k + 20k + 67k + 74k in the form pk + f and give p. 135 Express 0f2 + f2 + f2 + (1 + 2 - 4)(0f2 + f2 + f2) + 0f + 0f + f2 + (0 + 1 + 0)(-3f + 3f + 2f2) as yf + nf2 + t and give y. 0 Rearrange (0 + 2o + 0)(2 + 0 - 3 - 3o) - 21o2 + 19o*2 + 9 + 4 to the form m + so + jo2 and give m. 13 Express -q3 + 4q + 0q3 + 2q*3 + q as nq + kq3 + w + rq*2 and give n. 5 Express -15s*3 + 15s*3 - 4s*4 + (-3s*2 - 1 + 1)(3s2 + 2s*2 - 3s*2) in the form cs*4 + r + js*3 + fs + ks2 and give c. -10 Rearrange 6s - 2s4 - 7s + 3s4 - 2s*2 + 0s*4 to rs*3 + x + fs*2 + hs*4 + cs and give h. 1 Rearrange (2 + 0 + 13)(-3 + 3 - 1)(-j*3 + 0j*3 - 2j*3) to q + ij*2 + tj*3 + hj and give t. 45 Rearrange (29 - 16 + 3j - 18)(3 + 1 - 3)(-4 - 2 + 5)(23 - 8 + 1) to t + dj and give t. 80 Rearrange -18 - f2 + 3f*2 + 26 - 2f to wf + b + af*2 and give w. -2 Express 5o - 6o + 3o in the form ho + x and give x. 0 Express -2h + 5h + 5h*2 - 2h in the form kh + sh*2 + d and give s. 5 Express 5n - 2n - 4n in the form a + rn and give r. -1 Rearrange 3h - 2h3 - 5h*2 + 2h*3 + 3h*2 + 2h*3 to the form nh + f + qh3 + ph*2 and give n. 3 Rearrange -25z + 25z - 8z3 + (z2 - z2 - z2)(-5 + 5 + z) to y + pz + vz3 + fz*2 and give v. -9 Express -5a*2 + a - a + 529a - 9a2 - 529a + (-4a - a + 3a)(0 + 0 - a) in the form ba + f + la2 and give l. -12 Rearrange -2t - 3t4 + 7t2 + t2 - 6t2 + 5t to jt + vt*2 + bt*4 + h + mt*3 and give v. 2 Rearrange (2u + 4 + 2u - 3)(-u*3 - 3u*3 - 5u*3) to the form fu*3 + pu*4 + au*2 + hu + x and give p. -36 Rearrange -5q2 - q3 + 2 + q + 0q*2 + 3q*2 to the form uq*3 + x + pq*2 + hq and give u. -1 Express 3x + 0x2 + x2 - 2x - 2 in the form sx*2 + i + px and give i. -2 Express 20s + 3s + 9s + (2s - 2s - s)(1 - 3 + 0) + 0s + 0s - s + 0s - 4s + 2s as m + qs and give q. 31 Rearrange -2z - 2z*2 + 2z + (1 - 9 - 3)(2 - z2 - 2) + (z + 2z - 5z)(8z + 5z - 3z) to the form sz + gz2 + x and give g. -11 Rearrange 2n*2 + 0n*4 + n - 3n2 + n4 + 2n - n3 - 3 to the form kn*2 + zn*4 + y + bn + cn3 and give k. -1 Express (3i + i*2 - 3i)(i2 - 28 + 29 + 0i*2) in the form xi + ti2 + bi*4 + y + si*3 and give b. 1 Rearrange (-9o + 9o - 3o)(-3 - 1 - 1) to u + ro and give r. 15 Express 2k - 4k + k*4 + 4k*3 + 2k*2 - 5k*3 + 6 in the form d + sk + tk4 + uk*2 + fk*3 and give t. 1 Rearrange (-2t + 2t + 2t)(1 + 5 - 7 + (2 - 2 + 1)(-2 - 4 + 2)) to the form ot + x and give x. 0 Rearrange (3 + 3i - 3)(-2i - 2i2 + 2i) + 4i3 + 0 + 0 to the form fi + ji2 + hi*3 + l and give h. -2 Rearrange -4n*2 - 4 + 5 + 18n*2 + 10n*2 to the form o + un*2 + hn and give u. 24 Rearrange (4j2 - 7j2 - j2)(0j - 4j + 0j)(-4j - 3j + 5j) to dj4 + fj*2 + hj + v + qj3 and give f. 0 Rearrange (3b*3 - 3b3 - b3)(1 - b - b - 2) to db + ub3 + jb*2 + q + gb*4 and give g. 2 Rearrange (-o + 2o - 2o)(1 + o - 1)(o + 16o + 6o) to io + fo3 + do*2 + k and give f. -23 Rearrange 6t*3 - t - 6t*3 + 5t4 + t2 + 2 - 4t4 to the form ot*3 + gt*2 + pt + n + rt4 and give r. 1 Rearrange (2 - 4 + 1)(-2v3 - v3 + v3) + (-4v*3 + 2v*3 + 4v*3)(1 + 1 - 3) - 2v3 - 2v*3 + 5v*3 to bv*3 + u + av*2 + rv and give a. 0 Rearrange -5i4 + 6 + 12i*4 + 0 - 1 + 2i*3 to the form ki*4 + yi*3 + li + hi2 + r and give r. 5 Rearrange -t2 + 3t*3 - 4t*3 - 2t*2 - t to ut*3 + bt + y + wt2 and give b. -1 Express (-35t - 4 + 4)(t2 - 2t + 0t2 + 0t) as v + jt2 + ut*3 + ft and give u. -35 Express (4 - 4 + x)(1 + 0 - 4)(-94 - 22 + 8) in the form fx + t and give f. 324 Express -1 + 0z*3 - 2 + 3z3 - z2 - 2z3 as tz*2 + sz + kz3 + g and give g. -3 Rearrange (-8 + 3 + 32)(0k - 2k + k) to the form o + gk and give o. 0 Express (4p - 2p - 2p*2 - 4p)(1 - 4 + 4) as xp*2 + q + up and give x. -2 Rearrange 10a2 + 16a - a2 + a2 - 15a to da + la2 + u and give l. 10 Express z + 4 - 4 - 13z as bz + h and give b. -12 Express -16n*3 + 8n*3 - 3n*4 + 10n*3 - 2n + 2 as qn4 + bn*3 + r + on + pn2 and give p. 0 Rearrange (1 - 2 + 2)(-2 + 2i - 5 + 4) to n + ji and give n. -3 Express -c*3 - 2c*4 + 3c*2 - 2c - 7c2 + 3c*2 + 4c*2 in the form oc + wc2 + dc*4 + ic*3 + m and give i. -1 Rearrange 1 - 1 + 3 + 11m to the form r + pm and give p. 11 Rearrange (2j*4 + 0j4 - j4)(3 - 3 + 2) - 3j*4 - 11j + 11j - 3j + 3j + 3j*4 to the form pj*3 + nj*2 + sj + gj4 + w and give g. 2 Rearrange (-3 + 3 + 2t)(t2 - 5t - 2t2 + 13t*2) to the form ct + jt3 + at*2 + o and give j. 24 Rearrange (-m + m - 2m + (-3 + 4 - 3)(-m - m + 5m) + 3m - m - m)(-6m2 - 2m2 - m2) to the form um3 + fm + xm2 + l and give u. 63 Rearrange 13 - 24k + 10 - 22 to the form b + pk and give p. -24 Rearrange -2 + 2y + 0y + 16 + 2 to vy + i and give i. 16 Rearrange (4f - 4f + f + (2f - f - 3f)(2 + 0 - 1) + f - 4f + 2f)(-2 - 2 + 2)(-6 + 4 - 1) to the form gf + n and give g. -12 Rearrange (-8m2 - 14m*2 + 4m*2)(0 + 2m + 0) + (-2m*3 + 8m3 - m3)(4 + 4 - 7) to u + jm + zm2 + om*3 and give o. -31 Rearrange -2 + 7r3 + r4 + r - 15r - 9r*3 to the form br*3 + v + jr*4 + pr*2 + gr and give g. -14 Rearrange -26p2 + 101p*2 - 50p*2 to jp + sp2 + m and give s. 25 Express 16n*2 + 96n*3 - 197n*3 + 99n*3 + 3n*2 in the form v + hn + an2 + fn*3 and give v. 0 Express -61p*4 + 14p*4 - 43p*4 + (2p*2 - 6p*2 + 2p*2)(5p2 - 2p2 - p2) as gp2 + c + jp*3 + tp + zp4 and give z. -94 Express (3x*2 - 3x*2 + 2x*3)(1 + 0 + 0) - 1 + 1 - x*3 - 3x*3 + 5x*3 + 2x3 + x2 - x*2 - 2x*3 as dx + ox2 + f + rx*3 and give r. 3 Express 4i - 2i + 0i + 4i + 0i - 6i + (2i + 2i - 2i)(-1 + 6 - 6) in the form oi + y and give o. -2 Express 35v2 + 116v - 57v - 59v in the form x + bv2 + cv and give b. 35 Rearrange -2q2 + 0q*2 + 0q*2 + (-2 + 2q + 2)(-2q - 1 + 1) - 2q2 + 4q2 - q2 - q*2 + 2q2 + q2 to the form fq + xq*2 + g and give x. -3 Rearrange -7983j + 7983j + 2 - 40j*2 to kj + sj2 + d and give d. 2 Express (2r - 4r + r)(-3r - 2 + 2) + (-2r + 3r + r)(-2r - 2r + 5*r) in	{ "pile_set_name": "DM Mathematics" }
and 1 b. 1/14 Two letters picked without replacement from {b: 1, m: 2, o: 8, z: 3, r: 1, k: 5}. Give prob of picking 1 m and 1 o. 8/95 What is prob of picking 1 e, 2 f, and 1 s when four letters picked without replacement from {e: 4, f: 2, s: 2, c: 1}? 4/63 Three letters picked without replacement from {y: 7, b: 2, w: 4}. Give prob of picking 2 w and 1 y. 21/143 Calculate prob of picking 1 y, 1 f, and 2 t when four letters picked without replacement from dpytftflyptp. 4/165 Four letters picked without replacement from eaglhahxelha. Give prob of picking 3 a and 1 g. 1/495 Two letters picked without replacement from zzozoozmozoooozmo. What is prob of picking 1 m and 1 z? 3/34 Four letters picked without replacement from bbbbibiibibbbbbbib. Give prob of picking 4 i. 1/612 Four letters picked without replacement from {o: 10, i: 6, a: 4}. What is prob of picking 1 o and 3 i? 40/969 What is prob of picking 2 o and 1 z when three letters picked without replacement from ozzzozo? 12/35 Three letters picked without replacement from {w: 3}. Give prob of picking 3 w. 1 What is prob of picking 1 s and 1 v when two letters picked without replacement from sswrlvw? 2/21 Two letters picked without replacement from {w: 2, b: 6, x: 3, f: 3, d: 1, y: 4}. What is prob of picking 1 b and 1 d? 2/57 Calculate prob of picking 3 w and 1 u when four letters picked without replacement from {w: 8, y: 7, u: 1, l: 4}. 56/4845 Three letters picked without replacement from {r: 4, k: 9, y: 4}. Give prob of picking 2 r and 1 k. 27/340 Calculate prob of picking 1 g and 1 b when two letters picked without replacement from {b: 13, g: 3}. 13/40 Calculate prob of picking 1 i, 1 r, and 1 n when three letters picked without replacement from ninnvvninvvnddrnvdv. 14/969 Two letters picked without replacement from wqmmdoq. What is prob of picking 1 d and 1 m? 2/21 Three letters picked without replacement from eelllxeealfflwa. What is prob of picking 1 f and 2 a? 2/455 What is prob of picking 1 v and 1 w when two letters picked without replacement from {f: 5, v: 4, n: 2, w: 4}? 16/105 Calculate prob of picking 1 e and 1 b when two letters picked without replacement from {b: 12, e: 1, z: 7}. 6/95 Two letters picked without replacement from vdbvbbbvd. Give prob of picking 1 v and 1 b. 1/3 Calculate prob of picking 1 d and 1 r when two letters picked without replacement from {u: 4, r: 1, d: 3}. 3/28 Two letters picked without replacement from {j: 1, s: 2, e: 4, l: 2}. What is prob of picking 1 l and 1 e? 2/9 Calculate prob of picking 2 v when two letters picked without replacement from vjvj. 1/6 Calculate prob of picking 2 w and 2 n when four letters picked without replacement from {w: 2, v: 2, n: 6, d: 3}. 3/143 Four letters picked without replacement from {e: 6, t: 3, b: 4}. Give prob of picking 1 b and 3 t. 4/715 Two letters picked without replacement from {i: 5, j: 1, n: 1, s: 3, f: 3, k: 2}. Give prob of picking 1 k and 1 j. 2/105 Calculate prob of picking 3 d when three letters picked without replacement from {e: 8, d: 3}. 1/165 What is prob of picking 1 u and 1 h when two letters picked without replacement from hcyhchushuhhchhyh? 9/68 What is prob of picking 2 b when two letters picked without replacement from {b: 4, l: 6, r: 3, v: 3, d: 4}? 3/95 Two letters picked without replacement from {w: 2, z: 4, p: 1, i: 4, k: 3, d: 1}. Give prob of picking 1 k and 1 i. 4/35 Calculate prob of picking 2 z when two letters picked without replacement from zzzoqqfzgzoq. 5/33 Three letters picked without replacement from {s: 2, b: 1, q: 1, r: 3, e: 5}. Give prob of picking 1 q, 1 s, and 1 b. 1/110 Two letters picked without replacement from kakvkhkav. Give prob of picking 1 v and 1 a. 1/9 Three letters picked without replacement from {k: 1, t: 2, p: 1, u: 1}. What is prob of picking 1 u, 1 k, and 1 p? 1/10 Three letters picked without replacement from {p: 2, z: 2, v: 4}. What is prob of picking 1 v and 2 z? 1/14 Calculate prob of picking 1 k and 1 i when two letters picked without replacement from {i: 4, e: 2, k: 1, a: 1, u: 4, d: 2}. 4/91 What is prob of picking 2 v and 2 b when four letters picked without replacement from gbbqgvdgbvqgqbggdgg? 1/646 What is prob of picking 2 p and 2 j when four letters picked without replacement from pjjpjjjj? 3/14 What is prob of picking 1 m, 1 b, and 1 d when three letters picked without replacement from dddbdyqydddmdbodobo? 9/323 What is prob of picking 2 n and 2 f when four letters picked without replacement from nnnpffnfnnfnn? 168/715 What is prob of picking 2 h when two letters picked without replacement from {h: 2, l: 4, j: 7, t: 1}? 1/91 Two letters picked without replacement from rbrrdrbddr. What is prob of picking 2 b? 1/45 Four letters picked without replacement from {x: 1, p: 1, r: 2, n: 1, y: 1, q: 2}. Give prob of picking 1 q, 2 r, and 1 y. 1/35 Two letters picked without replacement from {m: 1, j: 2, x: 1, a: 3, q: 3, w: 2}. Give prob of picking 2 a. 1/22 What is prob of picking 1 d, 1 y, 1 i, and 1 s when four letters picked without replacement from cidcccdcsddyyysdidid? 42/1615 Calculate prob of picking 1 y, 2 l, and 1 u when four letters picked without replacement from {l: 2, y: 1, u: 1, f: 1, m: 1, d: 1}. 1/35 Three letters picked without replacement from iiiiiiiiyiyiyiiiiiiy. What is prob of picking 2 i and 1 y? 8/19 Three letters picked without replacement from vvfvvvzvyfz. What is prob of picking 1 v and 2 z? 2/55 What is prob of picking 1 m, 1 v, 1 h, and 1 d when four letters picked without replacement from {v: 2, u: 3, q: 1, m: 3, d: 1, h: 2}? 4/165 Calculate prob of picking 2 b and 1 e when three letters picked without replacement from {h: 3, e: 3, b: 3, n: 1, x: 1}. 3/55 Four letters picked without replacement from ggggggg. Give prob of picking 4 g. 1 What is prob of picking 2 t and 1 b when three letters picked without replacement from {t: 18, b: 2}? 51/190 Two letters picked without replacement from {s: 5, r: 3}. Give prob of picking 2 s. 5/14 What is prob of picking 2 x, 1 f, and 1 c when four letters picked without replacement from hfxcccccxcchfcshhxs? 4/323 Three letters picked without replacement from {a: 1, f: 5, l: 3, i: 1, n: 3}. Give prob of picking 1 a, 1 l, and 1 i. 3/286 Two letters picked without replacement from {k: 2, b: 1, x: 1, u: 1, g: 1, p: 2}. What is prob of picking 1 b and 1 p? 1/14 Calculate prob of picking 3 p and 1 k when four letters picked without replacement from chchhhhhhcapkchkapp. 1/1938 Calculate prob of picking 1 x, 1 g, and 1 k when three letters picked without replacement from {g: 2, k: 1, x: 1}. 1/2 Calculate prob of picking 2 k and 2 r when four letters picked without replacement from krrkkkkkrrkkkk. 270/1001 Calculate prob of picking 1 o and 1 x when two letters picked without replacement from ppooxbbpblxxxxo. 1/7 Two letters picked without replacement from {g: 2, w: 2, x: 4, m: 2, s: 2, i: 2}. What is prob of picking 1 i and 1 g? 4/91 Calculate prob of picking 3 z when three letters picked without replacement from {z: 10, d: 2}. 6/11 Four letters picked without replacement from rgrhzzhrrzrhz. Give prob of picking 3 h and 1 z. 4/715 Three letters picked without replacement from {g: 3, s: 3, x: 10, f: 3}. Give prob of picking 2 s and 1 x. 10/323 What is prob of picking 1 d and 1 q when two letters picked without replacement from {u: 1, m: 2, d: 2, b: 1, q: 2, a: 1}? 1/9 Two letters picked without replacement from {m: 2, q: 1, y: 1, o: 1, b: 2, h: 1}. Give prob of picking 1 y and 1 o. 1/28 What is prob of picking 2 y and 2 j when four letters picked without replacement from {y: 2, j: 3}? 3/5 Three letters picked without replacement from aufhsahshshsihah. What is prob of picking 2 a and 1 h? 9/280 Calculate prob of picking 1 h and 3 f when four letters picked without replacement from ffffffhfffff. 1/3 Three letters picked without replacement from {k: 3, v: 2, g: 3}. Give prob of picking 3 k. 1/56 Three letters picked without replacement from gbdfb. Give prob of picking 1 f, 1 g, and 1 d. 1/10 Calculate prob of picking 3 w and 1 o when four letters picked without replacement from {o: 6, w: 6}. 8/33 Calculate prob of picking 4 x when four letters picked without replacement from rzzzzzxxxx. 1/210 Wha	{ "pile_set_name": "DM Mathematics" }
f = d + -0.2. What is the third biggest value in g, f, 5? g Let h be (-5)/20 + (-65)/492. Let u = h + 2/41. Which is the smallest value? (a) 0 (b) u (c) -1/4 (d) -83 d Let u = 1974 + -7949/4. Suppose -4m = q + 4q + 7, -5q - 11 = 2m. Which is the second biggest value? (a) u (b) q (c) 4 b Let f(z) = 39z + 74. Let x be f(-2). Which is the biggest value? (a) -1 (b) 5 (c) 33 (d) 1/13 (e) x c Suppose -91 - 59 = -10o. Let h be (-1)/6 + o/45. Which is the second smallest value? (a) 5 (b) h (c) -2 (d) -0.1 d Let v = 85 - 85.21. Suppose 0s + 3s + 87 = -4y, -5 = s. Let z be (-36)/(-135)(-15)/y. What is the third smallest value in 5, v, z? 5 Let q = -3577 - -3577.2. What is the third smallest value in 508, q, -4? 508 Let a be (3/2)/((-78)/273 + (-60)/84). Let z = -2.4 + 0.4. Suppose j - 2 = 2. What is the biggest value in 3, j, z, a? j Let f = 0.099 + -47.099. Let n = -52 - f. Let t = 28 - 27.7. What is the second smallest value in 1, t, 2, n? t Let u(c) = 2 + c*2 + 4 - 11c + 1. Let s be u(3). Let v = 13 + -25/2. What is the second biggest value in -1, v, s? -1 Let z = 3883 - 3885. Which is the third smallest value? (a) -103 (b) 9 (c) z b Let u = -8764 + 8766. Which is the fourth biggest value? (a) -7 (b) -4 (c) -0.5 (d) 2/11 (e) u b Suppose 3 + 2 = -y + 5l, -3y = -4l + 4. Suppose y = g + 17 - 15. Which is the second smallest value? (a) 1/8 (b) 0 (c) g (d) -3/5 d Let v = -3548 - -3529. Which is the smallest value? (a) 17 (b) -1 (c) v c Let o = -827.3 - -832. Which is the third smallest value? (a) 2/21 (b) 3 (c) o c Let q = -31 - -3. Let z = -1.24 + 30.34. Let t = q + z. Which is the second biggest value? (a) 2/11 (b) t (c) 2/15 a Let q = -8 + 6. Let f = -3 + q. Let z = -3.68 + 4.08. Which is the biggest value? (a) -7 (b) z (c) f (d) 3 d Let k = -12.99 + 13.29. Let h(g) = -2g*3 - 22g*2 - 3g - 34. Let w be h(-11). Which is the fourth smallest value? (a) k (b) w (c) 1 (d) 1/5 c Let t = 0.5 + -0.5. Let o = -9848 + 10360.1. Let j = o - 512. What is the second smallest value in t, -0.4, j? t Let g be 8 + -10 + 4 + 16/(-10). What is the third biggest value in g, -45, -2/9? -45 Let y be 1 - (11/7 + 48/(-84)). Let p = 0.8 + -1.19. Let k = -0.01 + p. Which is the smallest value? (a) k (b) 2 (c) 2/7 (d) y a Let n(i) = -i*2 + 6i + 2. Let h be n(6). Suppose -hg = 2g - 24. Let q be -12 - (-14)/g. Which is the second biggest value? (a) 5 (b) -5 (c) q (d) -1/3 c Let k = -634 - -656. Suppose -kf = -15f + 35. Let y = 667/7 + -95. Which is the second smallest value? (a) -14 (b) 1 (c) y (d) f d Let g = -23.947 - 16.233. What is the third biggest value in -0.1, g, -3? g Let n be (7/5 + (-4)/10)(-3)/(-12). Let m(k) = -k*3 + 3k*2 + 6k - 4. Let p be m(4). Let c = 0.4 + -0.4. What is the third biggest value in n, 1, p, c? n Let j be (32 - (-464)/(-12))3/2. Which is the third smallest value? (a) 2 (b) -9 (c) j (d) 0.8 d Let r = 7 + -12. Let n = 2014.2 + -2014. Which is the biggest value? (a) r (b) -1 (c) n c Let o = -0.0327 - -0.9327. What is the second biggest value in -0.9, o, -0.1? -0.1 Let n = 129 - -29. Let o = -953/6 + n. Which is the biggest value? (a) o (b) 14 (c) -0.3 b Let z = -0.05404 + -3.24596. Let g = -0.69 - 0.31. Which is the smallest value? (a) -1/7 (b) z (c) g b Suppose 4v + 6 - 1 = 3q, 5v = q + 13. Let y(p) = -p*2 + 6p + 97. Let l be y(13). Suppose -j = lj - q. Which is the smallest value? (a) -5 (b) 0.4 (c) j a Let n be 1/((-6)/(4/2)). Let c be (-297)/(-594)3/(-6). What is the smallest value in c, 1/2, 0.2, n? n Let m(u) = -12u2 + 211u - 320. Let h be m(16). Which is the fourth biggest value? (a) h (b) 0.4 (c) 1/3 (d) 4 (e) 3 c Suppose -32z - 18 = 3t - 37z, -4z = -t - 13. Which is the fourth smallest value? (a) 1/4 (b) 5 (c) t (d) -112 b Let p = 70.116 - 0.116. Let n = p - 67. Which is the second smallest value? (a) n (b) -1 (c) 1 c Let k be 13706/55 + -62/(-15). Let t = k + -255. Let s = -21.89 - -22. Which is the third biggest value? (a) t (b) s (c) -4 a Let f(x) = x2 + 67x - 118. Let s be f(-69). What is the second biggest value in s, -1/4, 3/4, 5? 5 Let p = 0.216 + -151.216. Let t = p + 149. Which is the second smallest value? (a) 6/7 (b) t (c) -1/6 c Let t(x) = -x*3 - 43x*2 + 90x - 2. Let c be t(-45). What is the fifth smallest value in 0.1, 1, 3, -62, c? 3 Let z = 40.16 - 41. Let b = z + 0.54. What is the smallest value in b, 0.26, 0? b Let g(j) = -j*2 + 4j - 1. Let z be (-8)/(-2) + 1 + -2. Let x be g(z). Let f be 6/45 + (-2)/6. Which is the second smallest value? (a) f (b) x (c) 3 b Let b = -9383 - -18767/2. Let r = 28 - 36.2. Let k = -1.8 + r. What is the smallest value in b, 5, k? k Let s = 3059.313 - -7.687. What is the biggest value in -2, -0.5, s, 1? s Suppose 7s = -q + 2s - 281, 2s = -4. Let d = -271 - q. Which is the biggest value? (a) 0.1 (b) d (c) -2 a Suppose 297s - 227s = 210. Which is the fourth smallest value? (a) -0.321 (b) s (c) 4 (d) 1/2 (e) 5 c Let p = -0.09 + 0.09. Let m = 13 + p. Let s = 10 - m. Which is the smallest value? (a) s (b) 0.2 (c) 5 (d) 0.03 a Suppose -4o + 19 = 3m - 0o, -o = -4m. Let j(x) = -368x + 183x + 188x + 1. Let i be j(1). What is the smallest value in m, 3, i, -1? -1 Let f = -7 + 7.1. Let t = -1.4 + -0.6. Let l = 2125 - 2129. Which is the smallest value? (a) f (b) l (c) t b Let m = -0.006 + 243.006. Let w = 243 - m. Which is the third smallest value? (a) 0.3 (b) w (c) -36 a Let q = 0.2688 + 0.0312. Which is the third biggest value? (a) -22 (b) 1 (c) 6 (d) q d Suppose i - 41 = 4h, 5i - 36 - 25 = 4h. What is the fifth smallest value in -2, 0, 2/5, h, -5? 2/5 Let v = 182847 + -182847. Let x = -2.3 + 0.3. What is the biggest value in v, x, -1, 1/2? 1/2 Let w = -3679 + 3696. Which is the fifth smallest value? (a) 0.3 (b) -0.16 (c) w (d) 4/7 (e) 2 c Let o = -8.21 - -8.01. What is the biggest value in o, 0.4, 0.119, -2/17? 0.4 Let o = -569 + 939.3. Let n = o + -370. Let g = 2/243 - -721/972. What is the second smallest value in 0, n, g, 0.5? n Let c = -12/749 + 881/8239. What is the third smallest value in -5, c, -21? c Let d = -3156 - -3161. Which is the smallest value? (a) 1 (b) d (c) 8/5 a Let o = 29.7 - 30. Let z(b) be the first derivative of b3/3 - 4b*2 - 97b + 15. Let p be z(15). What is the third biggest value in -1/7, 0.5, p, o? -1/7 Suppose 161 + 155 = 4y. Let h = -41757 + 41756. Which is the third smallest value? (a) 0.3 (b) y (c) h (d) 0 a Let g = 4063 + -4058.901. Let v = g + -0.099. Let i be (3/6)/(1/(-2)). Which is the third smallest value? (a) -0.3 (b) v (c) i (d) 0.2 d Let z = -32 + 32.36. Let b = -4.36 + z. Let t = 416/5 - 83. What is the third biggest value in b, t, -2/3, 3/2? -2/3 Suppose 0 = j - 3w - 1, -w + 19 = 5j - 2w. Let i be 18/j - (-27)/(-18). Let q be ((-1)/(-3) - 0)/(i/6). What is the biggest value in q, 0, 2/15? q Let w = -16.35 - -16. Let y = 1.46 - 1.91. Let o = y - w. Which is the second biggest value? (a) -2 (b) o (c) -1 c Let z = -1/2047 - 4089/10235. What is the fourth smallest value in 4, 39, 6, 0, z? 6 Let v = 0.02516 - 0.32516. Which is the third smallest value? (a) v (b) -2 (c) 2 (d) -15 a Let o be (-6)/(-21)(14/21 + 4). What is the third smallest value in -0.1, 2233, o? 2233 Let p = -334864 + 334863.7. Let x = 150 - 597/4. What is the third biggest value in p, x, -0.6, -2? -0.6 Let n(o) = 133o*2 + 130o - 3. Let l be n(4). Which is the biggest value? (a) 0.1 (b) l (c) -4 b Let r = -414.3 + 414.7. Which is the third biggest value? (a) r (b) 5 (c) 2/7 (d) 6/11 (e) -3/16 a Let p = -45 + 111. Let k = p - 61. Let l = -92/5 - -19. Which is the second biggest value? (a) l (b) -5 (c) k a Let l = -0.00863 - -0.10863. Which is the second smallest value? (a) -1/11 (b) 3 (c) l (d) 0.008 d Let u = 3/184 + 899/1288. Let x = -29175/4 + 7294. Which is the biggest value? (a) -3/7 (b) u (c) x (d) -1 b Let v = 19.43 - 19.33. Which is the biggest value? (a) v (b) -2 (c) -1 (d) -5/3 a Let r = -27348 + 27343. Let u = 6 - 5.6. Which is the smallest value? (a) -0.2 (b) r (c) u (d) -0.02 b Let h be (-8 + -60 + 17)/(-3). Which is the biggest value? (a) -4	{ "pile_set_name": "DM Mathematics" }
563q - 12 - 3 + 9 as l + nq and give l. -2 Rearrange -3f4 - 4f*4 + 88f*2 - 86f*2 + 5f*4 + 75 to df*2 + uf*4 + s + hf*3 + qf and give u. -2 Express (39 - 19 - 17)(-2h - 1 + 1) - 1 - 2h + 4h - 1 in the form jh + m and give j. -4 Express (c + 2 + 4 - 10)(-c + c + c) - 2c2 + 11 + 0c*2 + 13 as ac + gc2 + o and give o. 24 Express (0a + a + 2a)((0 - 3 + 2)(0a - 3a + 5a) - 63 + 63 - 11a) as da*2 + ka + t and give d. -39 Express -2u2 - 405u - 424u + 637u + (-3u + 3u + u)(-1 + 1 - u) in the form n + au + tu2 and give t. -3 Rearrange -13y - 7y3 + 1 - 49y*3 + 2y + 5y + 7y - 2y2 to the form s + ry*3 + qy + gy2 and give s. 1 Rearrange 612x*4 - 1 + 2x*2 - 613x*4 - 5x*3 - 8x*3 + 0x*2 - x to bx + lx2 + g + ax*4 + yx*3 and give b. -1 Rearrange -705j*2 - 3 - 1 + 13j + 3 + 704j2 to wj + zj2 + f and give w. 13 Express 30u*4 + 14 - 14 - 2u*4 - 3u*4 + 4u*4 + (-2u*3 + 0u*3 + 0u*3)(u - 2u - 2u) as fu3 + pu*4 + qu + tu2 + a and give p. 35 Express 16 - 16 - 43u - 244u - 46u in the form s + yu and give y. -333 Express -367h*3 - 1 + 4 + 4h*2 + 735h*3 - 373h*3 in the form gh*3 + qh + x + bh2 and give g. -5 Rearrange -1 - 3 - 10 + 17 - 132y + 1 to ay + l and give a. -132 Express (40 - 10 - 10)(-28t - 3 + 3) as ht + u and give h. -560 Express 38 + 3k2 + 0k*2 - 11k*2 + 4k*2 in the form hk + c + ik2 and give c. 38 Rearrange (d - 6d + 4d)(1 + d - 1) + (3d + 4 - 4)(-1 + 1 + d) + 3 + 6d2 - 3 to yd + h + gd2 and give h. 0 Express 1855b*3 + 4b*2 - b - 1863b*3 - 1 + 1 in the form tb + gb3 + o + mb*2 and give m. 4 Express (11 - 7 + 18 + (0 - 1 + 0)(2 - 2 + 1))(2p*4 + 4p4 - p3 - 4p4) in the form zp*2 + fp*3 + ap*4 + l + ip and give a. 42 Rearrange (0 - 3 + 2)(-4n + 2n - 382 + 356) to the form s + qn and give s. 26 Rearrange -2 - 8j + 9j + 3j2 + 25 - 8j2 + j2 + 4j2 + (j + 1 - 1)(-5j + 3j + 4j) + j2 + j2 + 0j*2 to qj*2 + fj + b and give q. 4 Rearrange -2 - 3366o3 + 97o*2 - 299o*2 + 3368o*3 to the form jo + xo3 + yo*2 + w and give y. -202 Express 378 + 4l*2 - 3l*2 - 378 + 51l in the form a + wl2 + ml and give w. 1 Rearrange (-9 + 4 - 9)(-9 + 4 - 2)(0 + 0 - 2)(-d2 + 0d + 0d) to a + jd*2 + cd and give j. 196 Express (-288 + 512g + 144 + 144)(1 - 2 - 1)(0 + 2 - 3) as fg + y and give f. 1024 Rearrange (u - 2u2 - u + (7 + 11 - 11)(2 - 2 + 2u2) - 4u2 - u2 + 3u2)(-14u - u + u) to the form pu*2 + w + yu*3 + xu and give y. -140 Express -4 - 513r2 + 5r - 5r - 1 + 6 in the form c + zr + sr2 and give s. -513 Rearrange (f + 4 - 3 - 3)(2 - 2 - 1)((-4 + 4 + 1)(42 - 11 - 15) - 1 - 4 + 3) to b + rf and give b. 28 Rearrange 594g*2 - 1303g + 34g2 + 332g*2 + 1305g to the form og + s + ig*2 and give o. 2 Express 53i - 2 + 118i + 90i + (-1 + 0 + 0)(-5i - i + 3i) + 2 - 2 + i as x + ri and give x. -2 Express s + 18s2 + 21s*3 - 60s*3 - 44s*2 + 30s*2 in the form m + bs + us2 + ws*3 and give b. 1 Express (2m*2 + 3m*2 + 5m*2)(58 - 60 + 7m + 36m) in the form bm + d + lm*2 + rm*3 and give l. -20 Express -3 + 103i*3 - 2i + 24i3 - 14i*3 as xi + s + wi3 + di*2 and give s. -3 Rearrange (-2f - 2f + 2f)(-1855f + 88f - 196f + 2) to n + mf + rf*2 and give m. -4 Express -57c + 10455 - 10455 - 834c as w + ic and give i. -891 Rearrange (0x3 + x3 + x3)(2 + 12x + 1 - 1) + (7x2 - x2 - 2x2)(3x + 12x*2 - 3x) to zx3 + dx*2 + hx*4 + kx + t and give z. 4 Rearrange (3r + 0r - r)(0 + 0 - 2)(-1 + 0 - 1)(49 - 1 - 2) to the form k + nr and give n. 368 Rearrange (-1 + 1 + 1)((-4f*3 + 0f*3 + 2f*3)(f + 2f + 0f) - 22f2 + 22f*2 + 20f*4)(5 + 0 - 3) to vf3 + n + lf*2 + tf*4 + kf and give t. 28 Express -q - 28q - 19 + 12 + 8 + 4 in the form v + xq and give x. -29 Express (0 - 1 + 5)(-8 - 6 + 9)(0k + 3k + 3k) as u + dk and give d. -120 Express (2 - 2 + f*3)(2 + 0 - 1) + f*3 - 735 - 6f*3 + 765 in the form q + mf + df3 + if*2 and give d. -4 Rearrange 697 + 4j - 12j - 701 + (-3 - 4 + 5)(9 - 2 + 5)(-2j + 0j + j) to r + fj and give r. -4 Express (3 + 5w - 3)(2 + 25 + 74 + 16) as h + ow and give o. 585 Rearrange 66x - 1271 + 1271 to the form lx + c and give l. 66 Rearrange (-36 + 27 + 277 - 2y)(0y*2 - 2y2 - y2) to i + fy2 + ly + xy3 and give l. 0 Rearrange (-15h*2 - 83 + 83)(-h + 2h + 2h) + (2h - 2h + h*3)(1 - 2 - 6) to the form l + fh3 + ah + wh2 and give f. -52 Express 1 - 1 + 3y*4 + (0y + 3y - y)(-y + y - y*3) - 594y*4 + 1032y*4 - 570y*4 in the form my*4 + a + vy*3 + py + fy2 and give m. -131 Express 50r*2 - 74r*2 + 1 + 23r*2 + 2r - 2r4 in the form z + or*2 + ur*3 + tr*4 + kr and give k. 2 Rearrange ((o - 3o + o)(2 - 3 + 3) - 2o + 0o + 0o)(-5o3 + 7o*3 - 19o*3) to qo + lo4 + h + po*2 + go*3 and give l. 68 Express -159d - 224d + 76d - 213d as y + bd and give b. -520 Express (-6g - g + 0g)(-2 + 2g*2 + 2)(-5g + 4g + 3g) in the form j + lg*4 + rg + qg2 + vg*3 and give l. -28 Rearrange 6k*4 + 0 + 0 + (-2 + 7 + 2)(-3k4 + 3k4 - k4) to bk + o + ck*3 + wk*4 + nk*2 and give n. 0 Express 2 - 8o + 13o - 38o*2 - 4o - 3o4 - 2o*4 + 7o*4 in the form io*2 + fo*4 + qo*3 + bo + s and give i. -38 Rearrange (3u2 - 3u*2 - 2u*2)(3u - 781 + 4u*2 + 781) to the form cu*3 + wu*2 + zu*4 + d + fu and give c. -6 Rearrange 7r - 4r + 40r3 + 8 + 5r - 6r to c + jr*2 + sr*3 + mr and give m. 2 Rearrange (-f + 0f - 5f)(-f2 + 0f + 0f) - 24f*3 + 8f*3 - 8f*3 to the form sf + n + tf3 + jf*2 and give t. -18 Express (-r - 3r + 2r)(r*2 - 3r2 + r2) + (-2832r + 1417r + 1417r + 536r*2)(2r - 2r - 4r) in the form p + lr*3 + qr + gr2 and give l. -2142 Express -450u*2 - 89956 + 89956 as p + du*2 + ju and give d. -450 Rearrange (43 - 92 - 21)(-b3 + 6b*3 - 3b*3 + (-4b + 4b - 2b*3)(-4 - 1 + 4)) to the form pb2 + qb*3 + lb + f and give q. -280 Express (2d + 0d + 2d)(-3d3 + 9d*2 - 9d*2) + 4d*4 - 3d*4 + 10d*4 as md*2 + pd*3 + zd*4 + rd + i and give z. -1 Express 20u + 26u - 55u + 23u + 4 as pu + q and give p. 14 Express 1251 - 1251 - 81n + 104n2 - 11n*3 + 81n as o + rn3 + ln*2 + zn and give r. -11 Express 3167c2 - 1580c*2 - 1584c*2 - 1 - 6c*3 in the form gc*3 + sc + k + yc2 and give y. 3 Rearrange (167s + 4 + 194s - 4)(-3s + 3s - s*3) to the form d + xs*2 + as*4 + cs*3 + gs and give a. -361 Rearrange (2v2 + 4v*2 - 3v*2)(13 - 13 - 4v + v2)(-4 + 5 + 7 + (-5 + 0 + 2)(4 - 5 + 3)) to the form kv + gv4 + dv*2 + u + xv*3 and give x. -24 Rearrange (n - 4n + n)(5 - 4 - 2) - 2811 + 2811 + 71n + (-2 - 1 + 1)(-2n + 12 - 12) to the form pn + y and give p. 77 Express -5189 + 5189 - 1022y*2 + (-1 + y + 1)(5 - 2y - 5) as ay + cy2 + z and give c. -1024 Rearrange 6g*2 - 2g + 233g3 - 3g*2 + 4g*4 - 236g*3 to jg*3 + sg*2 + l + zg*4 + xg and give x. -2 Express (19u2 + 47u*2 + 103u*2)(-2 - 2u + 2) + 5u*3 + 6u*3 - 6u*3 as du + y + ru3 + zu*2 and give r. -333 Rearrange (-1 - 3 + 3)(-517 - 109 + 22)(-1 + 1 + h) to the form rh + b and give r. 604 Rearrange 6p2 - 3p*2 + 4p*2 + 2p2 + p2 + p*2 + (-2p + p + 2p)(4p + 7 - 7) - 3p*2 + 2p*2 + 0p*2 to the form ap*2 + np + r and give a. 14 Express -t*4 + 193t - 102t + 1 - 98t + 2t2 - 3 as mt*4 + at*3 + v + dt*2 + ot and give m. -1 Express 22t4 - t2 - 3 + 0t*3 + 2t*3 - 22089t + 22089t in the form mt*4 + yt*3 + it + st2 + g and give m. 22 Express 4u4 + 2 - u4 - 46u + 44u*3 + 31u*3 + 21u + 23u in the form qu + ku3 + iu*2 + o + tu*4 and give t. 3 Rearrange o - 1 - 56o*4 - 2o*2 - 4o*3 - 50o*4 + 110o*4 to the form fo*4 + qo*3 + to*2 + bo + r and give r. -1 Rearrange (-4z4 - 2z*4 + 5z*4)(-158 - 147 - 282) to the form xz2 + az**4	{ "pile_set_name": "DM Mathematics" }
f*4 - 82f*3/3 + 698f*2/9 - 386f/9 + 20/3 = 0. 1/3, 3, 10 Factor v*2 - 278v + 19321. (v - 139)2 Let k4 = 0. Calculate k. 0 Factor -y*2/11 - 1114y/11 - 310249/11. -(y + 557)*2/11 Suppose -3z*3/5 + 72z*2/5 - 429z/5 = 0. What is z? 0, 11, 13 Factor -h*2/8 - 71h/8 + 9. -(h - 1)(h + 72)/8 Find a such that -2a*2/7 - 12a - 82/7 = 0. -41, -1 Determine g so that -4g4 + 4g*3 + 36g*2 + 44g + 16 = 0. -1, 4 Solve 2u2 + 1868u + 436178 = 0 for u. -467 Find q such that -5q4 - 100q*3 - 405q*2 - 450q = 0. -15, -3, -2, 0 Find f, given that -f*4/7 + 9f*3/7 + 2f*2 - 36f/7 - 40/7 = 0. -2, -1, 2, 10 Determine k, given that -k*3/5 - 48k*2/5 - 489k/5 - 442/5 = 0. -34, -13, -1 Find s, given that -18s5 + 54s*4 + 84s*3 - 88s*2/3 - 208s/3 - 64/3 = 0. -2/3, 1, 4 Let t*5/4 + 9t*4/2 + 26t*3 + 68t*2 + 84t + 40 = 0. What is t? -10, -2 Find v such that v*2/4 - 97v/2 + 9409/4 = 0. 97 Let -25f5/2 - 14755f*4/2 + 28158f*3 - 33832f*2 + 15440f - 2376 = 0. What is f? -594, 2/5, 1, 2 Factor -l4 - l3 + l*2 + l. -l(l - 1)(l + 1)2 Determine u, given that -2u*4 + 48u*3 + 104u*2 = 0. -2, 0, 26 Suppose 10g*4/7 - 28g*3 + 1090g*2/7 - 1152g/7 - 648/7 = 0. Calculate g. -2/5, 2, 9 Let 4986289n2/6 - 4466n/3 + 2/3 = 0. Calculate n. 2/2233 Factor 2t3/9 + 58t*2/3 - 2t/9 - 58/3. 2(t - 1)(t + 1)(t + 87)/9 Factor -b3/3 + 31b*2/3 + 22b. -b(b - 33)(b + 2)/3 Factor -o*3/3 - 101o*2/3 - 392o/3 - 388/3. -(o + 2)*2(o + 97)/3 Factor p*3/8 - 2p*2 + 29p/8 - 7/4. (p - 14)(p - 1)2/8 Factor 7b*3 - 32b*2 + 27b + 18. (b - 3)(b - 2)(7b + 3) Let 8i*3/7 + 74i*2/7 + 178i/7 + 40/7 = 0. What is i? -5, -4, -1/4 Let 20f5 + 945f*4 - 3785f*3 + 2055f*2 + 765f = 0. Calculate f. -51, -1/4, 0, 1, 3 Suppose u*2/4 - 1046u + 1094116 = 0. What is u? 2092 Factor 2q2/17 + 82q/17. 2q(q + 41)/17 Suppose -x*5 + 4x*4 + 7x*3 - 34x*2 + 24x = 0. What is x? -3, 0, 1, 2, 4 Factor 3l3 + 6l*2 - 21l + 12. 3(l - 1)2(l + 4) Solve -2q5/13 - 158q*4/13 - 450q*3/13 + 478q*2/13 + 1684q/13 + 912/13 = 0. -76, -3, -1, 2 Let -w*5/4 + 7w*4/4 - 7w*3/4 - 19w*2/4 + 4w + 5 = 0. Calculate w. -1, 2, 5 Factor -4l2 + 88l. -4l(l - 22) Solve -5g5/3 - 420g*4 - 26875g*3 - 156250g*2/3 = 0. -125, -2, 0 Solve 2y*3/9 + 566y2/3 = 0 for y. -849, 0 Determine q, given that -q4 + 9q3 - 15q*2 - 25q = 0. -1, 0, 5 Factor a*3/4 + 37a*2/4 - a/4 - 37/4. (a - 1)(a + 1)(a + 37)/4 Factor -5w*3 + 8055w*2 - 4325535w + 774270765. -5(w - 537)3 Factor 5p*4/2 + 20p*3 + 25p*2/2 - 125p. 5p(p - 2)(p + 5)2/2 Factor i3/5 - i2 - i/5 + 1. (i - 5)(i - 1)(i + 1)/5 Find s such that 685s*2 - 695s + 10 = 0. 2/137, 1 Find v, given that -15v4/8 - 123v*3/8 - 3v*2 = 0. -8, -1/5, 0 Factor 5t*5 - 50t*4 + 180t*3 - 270t*2 + 135t. 5t(t - 3)*3(t - 1) Factor 2f2/19 + 508f/19 + 32258/19. 2(f + 127)2/19 Suppose -2f*3/23 + 214f*2/23 + 888f/23 = 0. What is f? -4, 0, 111 Find k such that 6k2/11 - 82k/11 - 8 = 0. -1, 44/3 Factor -5u2 - 55u - 120. -5(u + 3)(u + 8) Factor 2g2 + 572g + 40898. 2(g + 143)2 Determine k so that 3k*2 - 162k + 2139 = 0. 23, 31 Factor -3a3 + 30a*2 + 33a. -3a(a - 11)(a + 1) Solve -2j*2/9 - 26908j/9 - 90505058/9 = 0. -6727 Factor 2l3/5 + 98l*2. 2l*2(l + 245)/5 Factor v*3 + 24v*2 + 45v + 22. (v + 1)*2(v + 22) Determine b so that 6b5/7 + 64b*4/7 + 142b*3/7 - 100b*2/7 - 16b = 0. -7, -4, -2/3, 0, 1 What is g in -2g5/7 + 170g*4/7 - 3350g*3/7 - 11090g*2/7 - 11440g/7 - 3872/7 = 0? -1, 44 Let 4k4 - 108k*3 + 840k*2 - 400k - 12000 = 0. Calculate k. -3, 10 Factor -m*4 - 5m*3 - 8m*2 - 4m. -m(m + 1)(m + 2)2 Factor o2 + 119o + 1980. (o + 20)(o + 99) Find z, given that 2z3 + 246z*2 + 486z + 242 = 0. -121, -1 Find p such that p4/3 + p3 - 23p2/3 + 11p - 14/3 = 0. -7, 1, 2 What is q in q*2/2 + q - 3/2 = 0? -3, 1 Suppose 4a*5 - 20a*4 + 4a*3 + 52a*2 - 8a - 32 = 0. What is a? -1, 1, 2, 4 Find c, given that c*3/2 + 7c2/2 - c/2 - 7/2 = 0. -7, -1, 1 Factor a3 + 9a2/4 - 47a/2 - 6. (a - 4)(a + 6)(4a + 1)/4 Factor -g2 - 7g + 18. -(g - 2)(g + 9) Solve c2/2 - 23c/2 + 11 = 0. 1, 22 Factor -p*3/2 + 7p/2 + 3. -(p - 3)(p + 1)(p + 2)/2 Factor -g*3/4 - 53g*2/4 - 51g/2. -g(g + 2)(g + 51)/4 Suppose -q*4 + 2027q*3/5 + 1062q*2 - 2448q/5 = 0. Calculate q. -3, 0, 2/5, 408 Factor -h*2/6 - 10h/3 - 50/3. -(h + 10)*2/6 Let -7b*2/3 + 8b/3 - 1/3 = 0. Calculate b. 1/7, 1 Factor u*2/2 + 452u - 905/2. (u - 1)(u + 905)/2 Factor 21v3/2 - v2/4 - 25v/2 - 7/4. (v + 1)(6v - 7)(7v + 1)/4 Factor 2a*2 - 4532a. 2a(a - 2266) Let 12m5 - 20m*4 - 100m*3 + 180m*2 - 72m = 0. What is m? -3, 0, 2/3, 1, 3 Factor 2k5/7 - 4k*4/7. 2k*4(k - 2)/7 Factor -z5/2 - z4/2 + 21z3/2 + 45z2/2. -z2(z - 5)(z + 3)*2/2 Factor 18z3 + z2 - 72z - 4. (z - 2)(z + 2)(18z + 1) Suppose 75y4 + 3135y*3 - 678y*2 - 2028y - 504 = 0. What is y? -42, -2/5, 1 Factor -5t2 + 10t. -5t(t - 2) Suppose 4k3/3 + 56k*2/3 - 128k - 1920 = 0. What is k? -12, 10 Determine c, given that 2c5/9 + 20c*4/9 + 64c*3/9 + 64c*2/9 = 0. -4, -2, 0 Factor 2w*2/5 - 12w/5 - 14/5. 2(w - 7)(w + 1)/5 Suppose 2k3 + 20k*2 + 62k + 60 = 0. Calculate k. -5, -3, -2 Let 23i4 - 298i*3 + 792i*2 + 1162i + 49 = 0. Calculate i. -1, -1/23, 7 Determine q, given that 2q3 - 2454q*2 + 1003686q - 136835858 = 0. 409 Find u such that -4u2 - 1668u - 1664 = 0. -416, -1 Suppose -4k4 - 6232k*3 - 2421124k*2 + 4860960k - 2433600 = 0. What is k? -780, 1 Factor 2a4/5 - 24a*2/5 + 32a/5. 2a(a - 2)*2(a + 4)/5 What is q in -6q5/5 - 18q*4/5 - 12q*3/5 + 12q*2/5 + 18q/5 + 6/5 = 0? -1, 1 Determine s, given that 4s2/3 + 152s/9 - 352/9 = 0. -44/3, 2 Factor -w*2/3 + 919w/3. -w(w - 919)/3 Solve 2y*3/11 + 32y*2/11 + 58y/11 + 28/11 = 0. -14, -1 Determine c, given that 4c4/7 + 10c*3/7 + 8c*2/7 + 2c/7 = 0. -1, -1/2, 0 Factor n*4/3 - 208n*3 + 48672n*2 - 5061888n + 197413632. (n - 156)4/3 Factor -i2 - 378i. -i(i + 378) Factor -27w3/2 + 213w*2/2 - 165w/2 - 21/2. -3(w - 7)(w - 1)(9w + 1)/2 Suppose -2v5/5 - 122v*4/5 - 1186v*3/5 - 4438v*2/5 - 6972v/5 - 720 = 0. Calculate v. -50, -4, -3, -1 Suppose 6b3/7 + 30b*2/7 - 48b/7 - 72/7 = 0. What is b? -6, -1, 2 Suppose 2i3/11 - 354i*2/11 - 356i/11 = 0. Calculate i. -1, 0, 178 Factor -2k5/3 - 8k*4/3 - 10k*3/3 - 4k*2/3. -2k*2(k + 1)*2(k + 2)/3 Factor -5b5 - 25b*4 - 35b*3 - 15b*2. -5b*2(b + 1)*2(b + 3) Suppose v*3/2 - 774v*2 + 399384v - 68694048 = 0. Calculate v. 516 Factor -v*4/6 + 13v*3/6 - 23v*2/6 + 11v/6. -v(v - 11)(v - 1)*2/6 Factor -3k*3 - 4233k*2 - 1491072k + 1495308. -3(k - 1)(k + 706)*2 Factor -4p*5 - 1176p*4 - 115248p*3 - 3764768p*2. -4p*2(p + 98)*3 Factor 5o*3 - 130o*2 - 1325o - 1190. 5(o - 34)(o + 1)(o + 7) Find p such that 27p*4/4 - 921p*3/4 + 75p*2/4 + 921p/4 - 51/2 = 0. -1, 1/9, 1, 34 Suppose l*4/3 - 16l*3/3 + 88l*2/3 - 64l + 48 = 0. What is l? 2, 6 Factor q*4/10 - 11q3/10 - q2/10 + 11q/10. q(q - 11)(q - 1)(q + 1)/10 Factor 2n3/3 + 10n*2 + 32n - 128/3. 2(n - 1)(n + 8)*2/3 Factor 2o*3 + 990o*2/7 + 696o/7 - 40. 2(o + 1)(o + 70)(7o - 2)/7 Find t such that 2t2 - 140t - 142 = 0. -1, 71 Solve z*2 - 6626z + 10975969 = 0. 3313 Determine d so that -10d3/11 + 14d*2/11 - 4d/11 = 0. 0, 2/5, 1 Factor -l*5 - 8l*4 - 4l*3 + 80l*2 + 64l - 256. -(l - 2)*2(l + 4)*3 Find t such that -20t*3/3 + 905t*2/3 - 1105t/3 + 220/3 = 0. 1/4, 1, 44 Factor 3n3 + 28n*2 + 28n - 32. (n + 2)(n + 8)(3n - 2) What is f in f2/5 + 16f/5 - 17/5 = 0? -17, 1 Factor -2r2/7 - 296r/7 - 10952/7. -2(r + 74)2/7 Find t such that 66t*4/5 - 177t*3/5 - 69t*2/5 + 18t/5 = 0. -1/2, 0, 2/11, 3 Suppose -4g4 - 252g*3 - 472g*2 + 1008g + 1952 = 0. What is g? -61, -2, 2 What is f in f*5/4 + 35f*4/4 + 319f*3/4 + 649f*2/4 - 448f - 539 = 0? -22, -7, -1, 2 Factor	{ "pile_set_name": "DM Mathematics" }
g order. b, 0.1, -0.4, -4/7 Let l = 63 + -68. Put -6, 5, l in ascending order. -6, l, 5 Let j be (-2 - (-2 - 0))/2. Suppose 0 = -4q + 5u + 5, -u - 5 = -0u. Let z = -1 - q. Put 5, j, z in descending order. 5, z, j Let o(k) = 6k - 23. Let c be o(4). Put c, 0, -1 in ascending order. -1, 0, c Suppose -z = -h - h + 16, h = 5z - 1. Put 5, h, -3 in ascending order. -3, 5, h Suppose -5x - 26 = -1. Let n = 85 - 88. Let d = 0 - -4. Sort n, x, d in ascending order. x, n, d Let x = -15 - -20. Put x, -12, -4 in increasing order. -12, -4, x Let b be (-4)/18 - (-48)/(-27). Let s = -13 + 16. Suppose z + sz = 0. Put 2, b, z in ascending order. b, z, 2 Let b = -96.8 + 88. Let x = b - -9. Let z be (-2)/(-12-5). Sort -0.3, z, x in ascending order. -0.3, z, x Let g = -2.1 - -1.4. Let z = g + 0.6. Sort z, 5, -3 in descending order. 5, z, -3 Let z be (45/(-55) - 2/11)-13. Put z, -5, -3 in ascending order. -5, -3, z Let u = -2 + 1.6. Let z(d) = -35d2 + 2d + 1. Let w be z(-1). Let o be 0 + 2 + w/20. Put o, -3, u in increasing order. -3, u, o Suppose 0 = -5g + 10, 5g = -2p + 9 + 1. Put p, -1, -5 in decreasing order. p, -1, -5 Let j be (-36)/62/3. Put j, -1, 0 in ascending order. j, -1, 0 Let a = 28/5 + -6. Sort a, 0.1, -3 in increasing order. -3, a, 0.1 Let u(l) = -l*2 + 14l + 2. Let k be u(14). Sort k, -5, 10 in descending order. 10, k, -5 Let s = -12.5 - -12. Sort s, -3/2, -1 in descending order. s, -1, -3/2 Let c be 2/(-3) - 55/(-15). Put c, 2, 4, 0 in decreasing order. 4, c, 2, 0 Let n = -0.4 + 0.1. Let l = 0.03 + -0.23. Sort 4, n, l in ascending order. n, l, 4 Let q be -2 + 26/9. Let i = 0.73 - 0.7. Sort 0.1, i, q. q, i, 0.1 Let j be (-9(-1)/3)/(-1). Sort 1, 4, j in descending order. 4, 1, j Suppose l - 6l = 5s - 25, 3s = 0. Suppose 0r + r - l = 0. Let y = 4 - 6. Sort y, r, 0 in ascending order. y, 0, r Let z(c) = -c*3 + 8c*2 + 10c - 5. Let v be 105/1412/10. Let x be z(v). Sort 5, 7, x. x, 5, 7 Suppose 9 = 5u - 8u. Put -4, u, -10 in ascending order. -10, -4, u Suppose 2o - o = 2l, -4l + 16 = 2o. Suppose z - 7 = r, -4 - 8 = -z + lr. Suppose -5w = -5, z = -s + 4w + 3. Put -5, -3, s in ascending order. -5, -3, s Let s = 0.9 + 3.1. Sort 3/8, 2, s in increasing order. 3/8, 2, s Let j = 1.8 - 6.8. Put j, -0.3, -0.5 in descending order. -0.3, -0.5, j Suppose l = -4l, l + 16 = 4c. Suppose -3p = p + c. Put 4, -2, p in increasing order. -2, p, 4 Let u(q) = -q - 1. Let f be u(-3). Let c = 0 + f. Let a(y) = -y3 - 6y*2 - 5y + 5. Let i be a(-5). Put -2, c, i in ascending order. -2, c, i Let r = 95 + -90. Put -0.3, -2/7, 0.1, r in descending order. r, 0.1, -2/7, -0.3 Let j be (2 - 1)/(3/12). Let t be (2/j)/(7/(-2)). Let l be 17/33 + 2/(-6). Sort -1, t, l in increasing order. -1, t, l Let k = 17 - 23. Put 4, -3, k in descending order. 4, -3, k Suppose 3 = -3t + x, 5t = 5x - 4x - 3. Let y(i) be the first derivative of i*4/4 + 2i3 - i2 - 8i - 3. Let j be y(-6). Put j, 2, t in ascending order. t, 2, j Let o be -1(-2 - -1)2. Suppose 0 = -4s - 3x + 34, s - os + 16 = -3x. Suppose -4k - 2 = s. Sort -2, -1, k. k, -2, -1 Let o = -187 - -326. Let c = o + -698/5. Sort 2/11, 2/17, c in descending order. 2/11, 2/17, c Let r = -0.2 + 1. Let l = r + -0.3. Let n = -4 - 0. Sort n, l, 0.1 in descending order. l, 0.1, n Let k = -6 - -8. Suppose 2m + ki - 24 + 6 = 0, -3i = -12. Sort 2, m, -4 in descending order. m, 2, -4 Let h be 0 + (-4)/(-2) - 2. Suppose -3j - 3 = 5v, -2v - j + 6j + 5 = 0. Let w = 1 + v. Put 3, w, h in increasing order. h, w, 3 Let p = 2.04 + -0.04. Suppose f + 0 = 5. Sort p, -0.1, f in increasing order. -0.1, p, f Let y(m) = m3 - 7m*2 + 3. Let n be y(7). Suppose -nk - 1 = -25. Suppose 4c = -2d + 4d, -4c - k = 2d. Put 4, d, 0 in descending order. 4, 0, d Let v = 3 + 0. Suppose 5c + 3w + 3 = vc, 2w = -c - 3. Let r = 15 - 15. Sort c, r, -3/5. -3/5, r, c Let j = 14 - 9. Let h = 205 - 204. Put j, h, -3 in descending order. j, h, -3 Let m = -0.03 - 2.97. Sort -2/9, 0.1, m in increasing order. m, -2/9, 0.1 Suppose -3 = 3a - 0. Let j = a - -1. Let n be 18/(-21)(-14)/4. Sort 2, n, j in decreasing order. n, 2, j Let w be (-48)/(-20) - (-3)/5. Suppose 0 = -4j + 3j - 5i + 26, -w = 2j - i. Put j, -3, 0 in decreasing order. j, 0, -3 Let w be (-111)/21 + 4/14. Let l be 5/(-30)-6 - (-2 - 0). Let b(z) = z - 4. Let t be b(4). Sort t, w, l in increasing order. w, t, l Suppose -45 = -49w + 44w. Put 3/7, -4, 0.2, w in increasing order. -4, 0.2, 3/7, w Suppose -3n = -2n + 4. Sort 19, n, 1, 4. n, 1, 4, 19 Let f = 5 + -6. Sort 3, 4, f in decreasing order. 4, 3, f Let o = -9.2 - -9. Put o, 6/7, -0.4 in ascending order. -0.4, o, 6/7 Suppose 9p = -2p + 55. Put -49, p, 0 in descending order. p, 0, -49 Suppose 2o - o + 9 = j, 4o - 5j = -41. Put -14, o, 1, 0.3 in increasing order. -14, o, 0.3, 1 Suppose 0 = 5h + 11 + 9. Let b = h + 9. Suppose 0 = 4i - 3i - 4j - 12, -2 = -2i - 3j. Put i, b, -3 in descending order. b, i, -3 Let r = 40 + -37. Let i = -6 + 2. Put i, 5, r in increasing order. i, r, 5 Let r = -61 - -77. Put r, 2/3, -0.4 in ascending order. -0.4, 2/3, r Let d = -33 - -33.5. Suppose 0r - v = 5r + 5, -4r - 5v + 17 = 0. Let f be r + (-1)/5 + 2. Put d, -3, f in descending order. d, f, -3 Let o(r) = r2 - 5r + 1. Let k be o(4). Let c = -33 - -23. Let d = c + 9. Sort k, -5, d. -5, k, d Let u = 4 - 2. Suppose 0 = -v - v - u. Put 4, v, 1 in increasing order. v, 1, 4 Let u be (-167)/18 + (-6)/27. Let w = 10 + u. Sort w, 5, 1/4. 1/4, w, 5 Let x = 3 + 2. Suppose 15 = xa - 10. Let p be (-14)/10 + (6 - a). Put p, 0, -2 in increasing order. -2, p, 0 Let k(b) = -b2 + 7b - 2. Let i be k(6). Let s be 23/(-6) - i/24. Sort s, -1, 1. s, -1, 1 Let q = -1.9 - -2. Let z be (-95/(-570))/((-3)/4). Sort 1/8, z, q in increasing order. z, q, 1/8 Suppose -3 = -2f + 15. Put 1, -5, f in increasing order. -5, 1, f Let k be 2/(-9) + (1 - 1). Let h = -12 - -8. Sort 3, k, h in decreasing order. 3, k, h Let a = 3 - 3.2. Let m = 0.51 + -0.11. Sort m, -1/4, a in decreasing order. m, a, -1/4 Suppose -4 = -2s - 2p - 3p, 4s + 20 = 4p. Let b = 9 - 9. Let k = -4.08 + 0.08. Sort b, k, s in decreasing order. b, s, k Let h be (-1 + -5)1/(-2). Suppose s - 4f - 9 = 0, -hs - 5f - 6 = s. Let p be ((-1)/(-2))/(2/(-20)). Put -1, p, s in decreasing order. s, -1, p Let d be ((-4)/(-6))/(1/(-6)). Let m = -54 - -54.21. Let o = m - 0.31. Put o, 0.3, d in descending order. 0.3, o, d Let k = 6.28 - 6. Let q = 0.08 - k. Sort -5, q, 2/3 in descending order. 2/3, q, -5 Let y = 2 + -5. Let o = 5.2 - 1.2. Put o, y, -1 in ascending order. y, -1, o Suppose 2n = n, -4z + 16 = 2n. Let i = -5 - -8. Sort z, -0.4, i in decreasing order. z, i, -0.4 Suppose -3j + 4j + 1 = 0. Let b = 7 + j. Put -4, 4, b in increasing order. -4, 4, b Suppose 0 = 3y, 3r - 3y - 13 = 26. Let n be r/(-3) - (-4)/(-6). Suppose q + 1 = -0q. Sort q, -2, n. n, -2, q Let k(b) = -b*2 + 4b + 1. Let f be k(4). Suppose 3j - 2j = 0. Sort -2, j, f in increasing order. -2, j, f Suppose 4 + 5 = 3b. Suppose 10 = -0m - bm - 2x, -5m + 20 = -4x. Sort -5, m, 1 in descending order. 1, m, -5 Let g be ((-3)/(-78))/((-1)/(-4)). Sort -1/5, g, 1 in descending order. 1, g, -1/5 Let y be (-14)/(-3) + 8/24. Suppose 0 = -4l - 0l - 4, 3 = -2p - yl. Sort p, -4, -5 in increasing order. -5, -4, p Let l be (-1 - -1)/(-1 + -1). Let i be -1 - l - (-12)/9. Sort 0, i, 4/5 in ascending order. 0, i, 4/5 Let n = 5 - 7. Suppose 5p + 3w = 2p + 6, 5w = p + 28. Sort n, p, 5. p, n, 5 Let p be (96/(-60))/(4/(-10)). Sort p, -3, 1. -3, 1, p Suppose 10 = -0m + 2m. Suppose -q - 19 = 4b - 6, -5 = -3q - b. Suppose -3g + 9 = qp, 2g - 3p + 18 = p. Sort -3, m, g. -3, g, m Suppose 0 = -12z + 16z - 12. Sort z, -0.1, 10, 5 in descending order. 10, 5, z, -0.1 Let c(j) = 2j - 12. Let u be 1/5 + (-145)/(-25). Let o be c(u). Sort 1, o, 5. o, 1, 5 Let c = -9.5 + 14.4. Sort c, -2, 1/2 in decreasing order. c, 1/2, -2 Let x = -0.32 + 4.32. Let v = -0.2 + 0.3. Sort v, x, -5. -5, v, x Let b(f) = -f - 16. Let y be b(-13). Suppose 3t = t - 18. Let a be -3*(t/y - 4). Sort a, -4, -1. -4, -1, a Let f = 1.97 + -2. Let p = 2.03 + f. Let l = 9 + -8.9. Sort p, l, 3 in descending order. 3, p, l Let w	{ "pile_set_name": "DM Mathematics" }
ominator of 19/9 and -9/392? 3528 Calculate the common denominator of -55/14 and -76/1575. 3150 Find the common denominator of -5/1936 and -103/2662. 21296 Find the common denominator of -137/1992 and -67/4. 1992 What is the smallest common multiple of 658 and 98? 4606 Calculate the common denominator of 20/21 and 79/2346. 16422 Calculate the least common multiple of 24 and 248. 744 What is the smallest common multiple of 504 and 396? 5544 Calculate the common denominator of 5/24 and 103/42. 168 Calculate the common denominator of -29/153 and 50/21. 1071 Calculate the lowest common multiple of 9 and 832. 7488 Calculate the smallest common multiple of 2898 and 6. 2898 Calculate the least common multiple of 425 and 25. 425 Calculate the smallest common multiple of 9 and 144. 144 Find the common denominator of -27/80 and 99/4. 80 Calculate the smallest common multiple of 224 and 40. 1120 Calculate the common denominator of -23/6 and -107/12. 12 Calculate the least common multiple of 32 and 18. 288 Calculate the lowest common multiple of 3 and 12. 12 Calculate the common denominator of 47/6 and 7/1202. 3606 Calculate the lowest common multiple of 438 and 117. 17082 Find the common denominator of 15/32 and 9/124. 992 Find the common denominator of 97/10 and -19/16. 80 What is the common denominator of 9/65 and -27/559? 2795 Calculate the common denominator of 5/146 and -43/16. 1168 What is the smallest common multiple of 21 and 225? 1575 What is the common denominator of 53/20 and -61/1164? 5820 What is the smallest common multiple of 203 and 29? 203 Calculate the common denominator of 101/160 and 57/1168. 11680 Calculate the smallest common multiple of 200 and 450. 1800 Calculate the common denominator of -15/2 and -143/1590. 1590 Find the common denominator of -79/136 and 103/26. 1768 What is the lowest common multiple of 920 and 575? 4600 Calculate the smallest common multiple of 12828 and 9. 38484 What is the lowest common multiple of 1000 and 3100? 31000 What is the smallest common multiple of 21 and 208? 4368 What is the smallest common multiple of 294 and 24? 1176 What is the least common multiple of 252 and 462? 2772 Find the common denominator of 87/1750 and 51/250. 1750 Calculate the common denominator of 169/450 and 17/42. 3150 Calculate the common denominator of 4/175 and 16/35. 175 Calculate the common denominator of 51/3575 and -37/330. 21450 Calculate the common denominator of 21/338 and -69/26. 338 Calculate the common denominator of 16/9 and 17. 9 Calculate the least common multiple of 1005 and 30. 2010 Find the common denominator of -119/54168 and -59/18. 162504 What is the lowest common multiple of 525 and 25? 525 What is the lowest common multiple of 775 and 372? 9300 What is the common denominator of 35/852 and -50/309? 87756 Find the common denominator of 68/21 and 95/2364. 16548 Calculate the lowest common multiple of 1272 and 56. 8904 Find the common denominator of -37/2668 and -31/696. 16008 Calculate the common denominator of 13/46 and 73/104. 2392 Calculate the lowest common multiple of 826 and 944. 6608 What is the least common multiple of 110 and 14? 770 Calculate the least common multiple of 805 and 9. 7245 Find the common denominator of -173/240 and 73/32. 480 What is the lowest common multiple of 14 and 50? 350 What is the common denominator of -31/442 and -19/2006? 26078 What is the lowest common multiple of 289 and 136? 2312 Calculate the common denominator of 97/164 and 113/12. 492 Calculate the least common multiple of 41 and 7. 287 What is the smallest common multiple of 4104 and 12? 4104 Calculate the common denominator of 76/39 and 64/27. 351 Calculate the lowest common multiple of 3 and 156. 156 What is the least common multiple of 648 and 891? 7128 What is the smallest common multiple of 6618 and 16? 52944 What is the common denominator of 53/2739 and 53/12? 10956 Find the common denominator of 10/51 and 71/183. 3111 Calculate the least common multiple of 865 and 519. 2595 What is the common denominator of -82/21 and -1/231? 231 Calculate the least common multiple of 4 and 256. 256 What is the lowest common multiple of 6 and 1119? 2238 Find the common denominator of 49/48 and 95/2886. 23088 Calculate the common denominator of -57/20 and 87/182. 1820 What is the least common multiple of 4501 and 3? 13503 What is the least common multiple of 22 and 11? 22 Calculate the common denominator of 97/2070 and -137/378. 43470 What is the common denominator of 11/16 and 1/4588? 18352 Calculate the lowest common multiple of 286 and 12. 1716 Calculate the least common multiple of 66 and 6. 66 What is the least common multiple of 204 and 34? 204 What is the least common multiple of 32 and 64? 64 Find the common denominator of -43/54 and 38/27. 54 What is the smallest common multiple of 2 and 5? 10 What is the smallest common multiple of 2 and 58? 58 Find the common denominator of -5/12 and -59/14. 84 Find the common denominator of -75/8 and 3/34. 136 Calculate the smallest common multiple of 36 and 80. 720 Find the common denominator of 23/186 and 47/1581. 3162 What is the lowest common multiple of 24 and 48? 48 What is the smallest common multiple of 276 and 207? 828 Calculate the least common multiple of 372 and 56. 5208 Calculate the common denominator of 46/45 and -77/102. 1530 What is the common denominator of 17/48 and -83/306? 2448 Find the common denominator of 83/18 and -79/468. 468 Find the common denominator of -77/276 and 77/1196. 3588 What is the common denominator of 3/14 and -13/3? 42 What is the smallest common multiple of 8 and 8? 8 Calculate the common denominator of -137/280 and 41/10. 280 Find the common denominator of -53/21 and -137/648. 4536 What is the smallest common multiple of 10 and 232? 1160 What is the least common multiple of 406 and 522? 3654 What is the common denominator of -68/55 and -89/45? 495 What is the least common multiple of 1 and 3775? 3775 Calculate the lowest common multiple of 36 and 10. 180 Calculate the least common multiple of 1047 and 7. 7329 Calculate the common denominator of -76/9 and -19/4. 36 Calculate the smallest common multiple of 2891 and 196. 11564 Calculate the common denominator of -41/63 and -83/42. 126 Find the common denominator of 49/13 and 73/20. 260 What is the common denominator of -67/9 and 19/21? 63 What is the common denominator of 17/20 and -119/600? 600 Calculate the common denominator of 157/42 and -23/300. 2100 Calculate the smallest common multiple of 60 and 110. 660 Calculate the lowest common multiple of 1477 and 6. 8862 What is the smallest common multiple of 2730 and 1170? 8190 What is the common denominator of 79/40 and -91/20? 40 Find the common denominator of 55/6 and -34/259. 1554 Calculate the least common multiple of 134 and 64. 4288 Find the common denominator of -87/8 and -83/116. 232 Calculate the common denominator of 56/675 and -91/825. 7425 Calculate the lowest common multiple of 580 and 812. 4060 What is the least common multiple of 2288 and 132? 6864 Calculate the common denominator of -111/56 and 51/7. 56 Calculate the common denominator of 35/12 and -53/474. 948 Calculate the common denominator of -37/56 and 101/28. 56 Find the common denominator of 137/24 and -49/340. 2040 What is the smallest common multiple of 208 and 560? 7280 Find the common denominator of -26/235 and 37/105. 4935 Calculate the common denominator of 65/1458 and -101/30. 7290 Calculate the smallest common multiple of 10 and 12. 60 Calculate the least common multiple of 4 and 44. 44 Calculate the least common multiple of 1569 and 2. 3138 Calculate the common denominator of 26/145 and -35/4. 580 What is the smallest common multiple of 296 and 10? 1480 What is the least common multiple of 54 and 120? 1080 Find the common denominator of -121/24 and 49/6. 24 What is the least common multiple of 143 and 130? 1430 Calculate the common denominator of 83/500 and 111/800. 4000 What is the least common multiple of 42 and 8? 168 Calculate the smallest common multiple of 12 and 105. 420 Calculate the common denominator of 58/3385 and -38/35. 23695 Calculate the common denominator of 83/18 and -139/24. 72 Calculate the lowest common multiple of 568 and 781. 6248 Ca	{ "pile_set_name": "DM Mathematics" }
enominator of 61/301 and 54/97223. 97223 Find the common denominator of -173/210 and 145/6636. 33180 What is the common denominator of -10/6213 and 125/66? 136686 Calculate the least common multiple of 6948 and 44. 76428 What is the common denominator of 41/30 and -169/1125000? 1125000 Find the common denominator of -11/76140 and -29/8460. 76140 Calculate the common denominator of -83/28198 and 93/184. 112792 Find the common denominator of 16/553 and -20/7189. 7189 What is the smallest common multiple of 3249 and 306? 110466 Calculate the common denominator of 167/12408 and 49/20680. 62040 Find the common denominator of 79/67002 and 80/273. 469014 What is the lowest common multiple of 14152 and 2? 14152 What is the common denominator of -123/7280 and -1/2860? 80080 What is the smallest common multiple of 263458 and 182? 1844206 What is the lowest common multiple of 540 and 8880? 79920 What is the common denominator of -39/203 and 4/539? 15631 Calculate the common denominator of 55/4042264 and -23/22. 44464904 What is the common denominator of -93/1174108 and -47/52? 1174108 Calculate the smallest common multiple of 39987 and 62202. 559818 What is the common denominator of -19/5040 and -71/1512? 15120 Calculate the common denominator of -101/24 and 29/20076. 40152 What is the common denominator of -9/55888 and -13/24? 167664 Calculate the common denominator of 37/126 and -25/28882. 259938 Calculate the least common multiple of 6765 and 528. 108240 What is the common denominator of -76/1313829 and 83/57123? 1313829 Calculate the lowest common multiple of 4274 and 1777984. 1777984 Find the common denominator of -107/47376 and 1/84. 47376 Calculate the least common multiple of 50 and 3625. 7250 What is the least common multiple of 101818 and 8? 407272 What is the common denominator of 29/76890 and 107/51260? 153780 Find the common denominator of 77/17130 and -83/222. 633810 Find the common denominator of 5/14784 and -173/14784. 14784 What is the common denominator of 73/17928 and -35/632? 1416312 What is the least common multiple of 31380 and 900? 470700 What is the smallest common multiple of 1521 and 845? 7605 What is the lowest common multiple of 26096 and 328? 1069936 What is the least common multiple of 402 and 1216? 244416 Find the common denominator of -1/14676 and 26/25683. 102732 Calculate the common denominator of -3/2947 and -14/81. 238707 What is the lowest common multiple of 1530 and 1105? 19890 Calculate the smallest common multiple of 1317339 and 5944. 10538712 Calculate the smallest common multiple of 3267 and 7128. 78408 What is the common denominator of -83/3438 and 38/12033? 24066 What is the common denominator of 46/4167 and 133/78? 108342 Calculate the smallest common multiple of 4980 and 1308. 542820 Find the common denominator of 24/190705 and -93/7096. 1525640 What is the smallest common multiple of 12 and 17914? 107484 Calculate the common denominator of 31/214098 and 125/612. 1284588 What is the common denominator of 103/3978 and 191/670956? 2012868 Calculate the common denominator of -155/8736 and 49/6. 8736 Calculate the lowest common multiple of 13741 and 13741. 13741 Find the common denominator of 41/6 and 64/367275. 734550 Calculate the lowest common multiple of 734832 and 160. 7348320 What is the common denominator of -17/14 and 67/340764? 2385348 What is the common denominator of -52/631647 and -91/6? 1263294 Find the common denominator of -61/3218 and -39/4. 6436 What is the common denominator of 4/217 and 27/3262? 101122 What is the least common multiple of 14664 and 140? 513240 What is the common denominator of 41/56 and -61/1009876? 2019752 What is the common denominator of 145/108 and -101/24216? 217944 What is the least common multiple of 175113 and 38914? 350226 What is the common denominator of -71/133468 and 37/1342? 1468148 Calculate the least common multiple of 186839 and 5140. 3736780 Calculate the lowest common multiple of 495 and 4320. 47520 Calculate the least common multiple of 200304 and 2568. 200304 What is the common denominator of 45/18964 and -23/22? 18964 What is the common denominator of -5/21 and 4/2529? 17703 What is the least common multiple of 17124 and 8? 34248 Calculate the lowest common multiple of 820413 and 820413. 820413 What is the common denominator of 77/1429108 and 91/46856? 2858216 What is the smallest common multiple of 14250 and 19950? 99750 Calculate the smallest common multiple of 4824 and 200. 120600 What is the common denominator of 5 and 16/761? 761 Calculate the common denominator of 107/315 and 71/1575. 1575 Calculate the common denominator of -10/8379 and 155/33222. 1893654 Calculate the smallest common multiple of 1652 and 5978. 705404 What is the lowest common multiple of 68816 and 21505? 344080 Calculate the common denominator of -89/1044 and -61/740. 193140 What is the smallest common multiple of 261 and 18630? 540270 Find the common denominator of 103/4680 and 191/24570. 98280 What is the smallest common multiple of 149242 and 22071? 3134082 What is the common denominator of -1/258 and -143/672? 28896 Calculate the least common multiple of 13960 and 8376. 41880 Calculate the lowest common multiple of 665160 and 3615. 665160 Calculate the lowest common multiple of 35706 and 2705. 178530 Calculate the common denominator of -33/334190 and 81/290600. 6683800 What is the common denominator of -17/247155 and -73/45? 741465 Find the common denominator of 23/417252 and 32/13189. 4589772 Calculate the common denominator of -139/75528 and 85/8. 75528 What is the smallest common multiple of 29568 and 81312? 325248 What is the lowest common multiple of 35211 and 44? 140844 Find the common denominator of -54/5 and 89/73098. 365490 What is the common denominator of -23/144 and -187/15030? 120240 Calculate the lowest common multiple of 108 and 16416. 16416 Find the common denominator of -7/24 and -19/2682. 10728 Calculate the lowest common multiple of 26 and 53768. 53768 Calculate the common denominator of 197/1260 and 49/1005. 84420 Calculate the smallest common multiple of 7777 and 1414. 15554 Calculate the lowest common multiple of 1806 and 7998. 55986 Calculate the lowest common multiple of 2268 and 45. 11340 Calculate the common denominator of -31/9882 and -91/18. 9882 Calculate the least common multiple of 45120 and 192. 45120 What is the least common multiple of 40710 and 17700? 407100 Find the common denominator of -13/504 and 3/69800. 4397400 What is the lowest common multiple of 1148 and 420? 17220 Calculate the least common multiple of 100212 and 84. 100212 Calculate the least common multiple of 260220 and 30. 260220 Find the common denominator of 7/17985 and 41/16830. 1834470 Calculate the smallest common multiple of 1371056 and 16. 1371056 Calculate the least common multiple of 12165 and 210. 170310 Find the common denominator of -151/6384 and -85/2436. 185136 Calculate the least common multiple of 110 and 14465. 28930 Calculate the least common multiple of 1080 and 20400. 183600 Calculate the common denominator of -123/1090 and 101/7412. 37060 What is the lowest common multiple of 28014 and 41412? 952476 What is the smallest common multiple of 131346 and 36? 262692 Calculate the common denominator of -71/23058 and 29/35. 115290 What is the smallest common multiple of 18484 and 39? 720876 What is the lowest common multiple of 198 and 622116? 622116 What is the least common multiple of 73100 and 15050? 511700 What is the least common multiple of 20 and 52780? 52780 What is the common denominator of 10/17 and -26/225? 3825 Find the common denominator of -3/736 and 121/169280. 169280 What is the common denominator of 37/23177 and 139/1470? 695310 What is the smallest common multiple of 21048 and 207? 1452312 Calculate the lowest common multiple of 11 and 63442. 697862 Calculate the smallest common multiple of 1360 and 23528. 235280 Calculate the lowest common multiple of 836 and 2541. 193116 What is the lowest common multiple of 24 and 2176? 6528 Calculate the lowest common multiple of 13851 and 39. 180063 What is the least common multiple of 8032 and 20080? 40160 Calculate the lowest common multiple of 171066 and 30. 855330 What is the smallest common multiple o	{ "pile_set_name": "DM Mathematics" }
0.888759. Let g = 0.2 - 0.4. Which is the nearest to 2/5? (a) w (b) g (c) 4 b Suppose -75p = 29p + 208. What is the nearest to -72 in -1, p, 0.2, 5? p Let u = 0.091 + 4.409. Let x = -4.8 + u. What is the nearest to -26 in 2/15, 1/2, x? x Let z be (-2)/(-15)3/(-1). Let v = 1480/7 - 210. Let n = 3.0202 - 7.0202. What is the closest to 2/5 in z, v, n? z Let s = -201.08 - -33.08. Which is the nearest to s? (a) -4 (b) -2 (c) -1 (d) 2/13 a Suppose -5f + 2 = 3g, g + 2f - 6f = -5. Which is the nearest to g? (a) -1.8 (b) -1/4 (c) -7 b Let f = -26.6 + 11.6. Let v = 14.94 + 0.06. Let s = f + v. What is the nearest to 1 in 3, s, 4/7? 4/7 Let v = 25563 + -25567. Let q be (-2)/6 + 1/21. Which is the closest to 0.1? (a) q (b) v (c) -27 (d) -0.2 d Let f = 106/3 - 433/12. Let u = 0.029 + -0.429. What is the nearest to u in f, -1/3, 3? -1/3 Let i = 232 + -1161/5. Let n = 3.5 + -3.3. What is the closest to n in 3/4, -4, -25, i? i Let m = -0.5 - -3.5. Let i = 0.07 + -0.17. Let g = 9691 - 9694. Which is the nearest to i? (a) g (b) m (c) 0.3 c Let w(p) = 155p - 15500. Let l be w(100). Let n be (-16)/66/4. Let g = -1012/63 + 114/7. Which is the nearest to n? (a) g (b) l (c) -5 c Let s = 1882/3 + -5654/9. Let k = 0.2 + 3.8. Which is the closest to -2? (a) k (b) s (c) 0 b Let m = 2.321 - -2.679. Which is the nearest to 2/5? (a) -3 (b) m (c) -54 a Suppose 5n + 40 - 10 = -5i, n - 6 = i. Let m be i((-8)/(-6) + -1). Let h = 0 + 4. What is the nearest to m in 3, h, -0.3? -0.3 Let b = 2129239/40 + -53238. Let a = 61/8 + b. Let v = 0.72 + -0.22. What is the nearest to 0.1 in a, v, -7? v Let w be 18/(-22) - (-2)/2. Let o(z) = -4z + 125. Let t be o(10). Let k be 168/(-255) + 5/t. Which is the closest to 0.1? (a) w (b) -1/5 (c) k a Suppose 26248 = -421s - 13747. What is the closest to 2/3 in s, 27, -2? -2 Let p = -546.72 + 548.72. Let v = -451/45 - -49/5. What is the nearest to -1/2 in v, p, 8? v Let i(j) = 3j3 + j2 - 2j - 3. Let v be i(-1). Let y be v/(-5) - 44/165. Let m = -37 + 39. Which is the nearest to m? (a) y (b) 3/2 (c) 2/3 b Let h = -8605 + 8604. Which is the closest to 1? (a) -1/5 (b) -4 (c) 0 (d) h c Let i be 1 + 8 + -79124/168. Which is the closest to 2/7? (a) -1 (b) 3 (c) i a Suppose -23y - 4n = -28y + 9, 0 = 2y - 4n + 18. Let u = -6.4 + 6. What is the closest to 0 in -0.03, y, u? -0.03 Let g(b) = -b*3 - 5b*2 - 8b - 15. Let a be (35 + -31)-11. Let q be g(a). What is the closest to q in 2, 0.4, 24? 0.4 Suppose 0 = -3k + 2k. Let q be (0 + 0)/(-23 + 25). Let y = 6 + -6.1. Which is the nearest to k? (a) y (b) 0.4 (c) q c Let g = 258.2 - 338. Let j = -76.8 - g. Let u = -0.3 - 0.7. Which is the closest to u? (a) j (b) -2/21 (c) 1 b Let j = 5.63 + -4.23. What is the nearest to -0.1 in j, -2/13, -5, -1/2? -2/13 Suppose -2133a + 2132a = -5f - 23, 2a = 2f + 6. What is the nearest to -10.19 in 3/2, f, 5, 3? f Let c be (-17)/4 - (-7 + 3). Let h(d) = -d3 + 5d*2 + 5d + 5. Let g be h(6). What is the nearest to g in 5, -5, c? c Let w = -531.78 - -2.78. Let o = w + 533. Which is the nearest to -2/29? (a) -1/5 (b) 1 (c) o (d) 3 a Let s = 3854 + -3853.6. What is the closest to s in 0.5, -0.09, 2? 0.5 Let x = -20596 + 20596.032. What is the nearest to x in 2, -0.5, -1, -1.8? -0.5 Let g = -3827 + 3824. Which is the closest to 585? (a) 1/4 (b) 0 (c) -2/3 (d) g a Let f = 15/376 - -617/3384. What is the nearest to -7 in 4, f, 3, 0.4? f Let u be 2/3621(-11)/33. What is the closest to 1/2 in 0.2, -5, u? 0.2 Let l = 374 - 157. Let j = l + -221. Which is the nearest to 1/4? (a) 0.7 (b) 0.1 (c) j b Suppose -5r = -0l + l - 59, -3r = -3l - 21. Suppose -13m = -rm + 298. Let x = 1041/7 + m. What is the nearest to -2 in x, -2, -5/6? -2 Let a = 79409/4 - 19852. What is the nearest to a in 1/12, 4/3, -2/13, -2/7? 1/12 Let o = -0.1 + -0.1. Let m = -2151 - -34431/16. Let i = 167/144 - m. Which is the closest to i? (a) -1/3 (b) o (c) 5 b Let f = 7 + -3. Let i = 34129/3 - 11377. What is the nearest to 1 in f, -5/4, i? i Let w = 5563 + -5562.9. Which is the nearest to w? (a) -2/3 (b) 1/3 (c) 177 (d) 3 b Let w = 0.0204 - -4.9796. Let n be (0 - (-4 - 1)) + -1. Let l = -4.8 - 6.2. Which is the closest to l? (a) n (b) -4/7 (c) w b Let w = 4255 - 4245. Let o = -14 + 9. What is the closest to w in o, -3, -8? -3 Let h = 109/4 + -27. Let l = -26 - -19. Let t be (-7 - -11) + l + 34/12. Which is the nearest to -2? (a) -1 (b) t (c) h a Let k = -620.1 + 620. Which is the closest to -1? (a) 1/11 (b) k (c) -8/7 (d) -3 c Let m = 2.94 - -0.06. Let i be ((-4)/(-4))/((-21)/(-14)6). Let n = 11 + -11.1. Which is the nearest to n? (a) -4 (b) i (c) m b Let c = -3.2 + 3. Suppose 5d = -58t + 62t + 213, 0 = -4d + 4t + 168. Let v be (-18)/d - 12/(-30). What is the nearest to 1 in 1/3, c, v? 1/3 Suppose 28p + 14p - 78 = 3p. What is the closest to 1/4 in p, -1/22, 0.2? 0.2 Let r be (350/60)/(-5)(-4)/(-7). Which is the closest to r? (a) -0.1 (b) -3 (c) -2/9 (d) -4 c Let s = 4.723 - -0.277. Which is the nearest to -83? (a) s (b) -2/7 (c) -5 c Let j = -49/26 - -5/13. Let q = -5/13 - -22/91. What is the closest to 1 in q, 2, j? 2 Let k = 0.81 - -0.09. Let n = k + 0.1. Suppose 3b + 0t + 9 = 3t, -3b - 3t - 15 = 0. What is the nearest to n in -3, 0.3, b? 0.3 Let m = 11.501 + -13.501. What is the nearest to -0.019 in -3/2, -1/8, m, -0.8? -1/8 Let u = 2 - 3. Let g = -41291 + 41292. Which is the nearest to g? (a) -4 (b) u (c) -3 (d) 2 d Let b = 825 - 3301/4. Suppose 0 = -5q + 3n + 33, 4q - 2n = -0n + 26. Suppose 2 = 4p - q. What is the closest to b in -2/9, -2/7, p? -2/9 Let s = -0.45 - -392.45. Let i = s - 403. Which is the closest to -3? (a) -3 (b) i (c) -1 a Let a = 7419 - 7420. Let g = -15 - -40. What is the closest to -1 in -4, a, g? a Let y = 12 - 26. Let q be (8/56)/((-4)/y). Which is the closest to q? (a) 5 (b) 1/6 (c) 7/2 b Let n(j) = -j3 - 21j*2 + 240j + 226. Let i be n(-29). What is the closest to -1 in i, 3, 0, 5.3? 0 Let d be 16/(-20)(-20)/104. Let j be 110/(-22)(210/(-25) - -8). What is the nearest to -1/8 in -0.2, d, 0.5, j? -0.2 Let g = 8192/3 - 2731. What is the nearest to -24 in g, 3/2, -0.3, 4? g Let s be (-156)/(-26) - (108/21 + 0). Let w = -40 + 39.28. Let h = w - 0.28. What is the closest to h in -5, s, -3/7? -3/7 Let z be (130/(-13) + 6)/10. Let d = -0.08 + -4.92. What is the closest to 0.3 in z, -1/8, d? -1/8 Let y = -0.1 - -0.04. Let l = 116553/4 - 29329. Let n = 191 + l. Which is the nearest to y? (a) n (b) 4/3 (c) -0.5 a Let y = 27 - 345/13. Let a = -831.8 - -832. What is the nearest to a in 3, 0.5, y? y Let p = -60.13 + -0.87. Let i = 55.024 + -0.024. Let w = i + p. What is the nearest to w in -2, 1/4, 0.2? -2 Let m = 63 - 58. Suppose m = u - 5. Suppose 2 = 2c + u. What is the nearest to 0.2 in 4, c, -0.2? -0.2 Let x be (320/(-256))/((-10)/96). What is the closest to 1/4 in -0.01, x, -4/3, 4? -0.01 Let v = 50/103 - 544/1545. Let q = -2.03 - -0.03. Let r = -2.07 - q. Which is the closest to -1/4? (a) v (b) r (c) 2 b Let m = -3.7 + 0.7. Let o = 122.8341 - -0.2659. Let x = -123 + o. Which is the nearest to x? (a) m (b) -1/3 (c) -4 b Let y = -0.1 - -4.1. Suppose 6g - 74 = -37g - 117. Which is the closest to y? (a) 0 (b) g (c) -6 a Let j = -1103 - -1103.2. Which is the nearest to j? (a) -3 (b) 1/4 (c) 62 b Let k = -31/202 - 4/303. Suppose -4x - 37 = 5n, -5x = 12 + 3. What is the closest to n in 10, k, -2, -1? -2 Let p = 54.894 - -0.106. Let f = -54.917 - 0.083. Let t = f + p. What is the nearest to -0.13 in 2/7, -1/3, t? t Let x = -0.3 + 0. Let n be 222(-4)/(-32) + (-2)/(-8). Let r be (-10 - -6) + n/6 + -2. Which is the nearest to -0.2? (a) -6 (b) x (c) r b Let q = 218 - 233.3. Let k = -18.3 - q. Let t(y) = y. Let s be t(1). What is the closest to s in 2, -5, k? 2 Let v = 55.4 + -84.1. Let b = 28.8 + v. What is the nearest to b in 0.5, 5/4, -1? 0.5 Let i = 2.914 + -284.514. Let w = i + 282. Which is the nearest to -0.2? (a) w (b) 1 (c) -3/8 c Let w(l) = 2l*3 + 7l*2 - 13l + 17. Let g be w(-5). Which is the closest to 2? (a) -0.2 (b) 4 (c) -9 (d) g b Let n = -209 + 217. Which is the nearest to -0.04? (a) 0 (	{ "pile_set_name": "DM Mathematics" }
be -3 + (-12)/(-4) - d/10. Factor -4/5g4 + 4/5g*2 + 2/5g + 0 + 0g3 - hg*5. -2g(g - 1)(g + 1)3/5 Let w(o) be the second derivative of -o4/2 + 8o3/3 - 16o*2/3 + o. What is u in w(u) = 0? 4/3 Let u(r) be the third derivative of -47r5/50 + r4/30 - 141r2. Factor u(c). -2c(141c - 2)/5 Let k(r) = -2r - 11. Let s be k(-9). Let o = 9 - s. Factor -h2 - h2 + 0h*2 + oh*3 + 0h*2. 2h*2(h - 1) Let q(k) be the first derivative of 28 + k*4 - 4/3k*3 + 0k - 4k2. Factor q(a). 4a(a - 2)(a + 1) Let n(s) be the first derivative of 2s5/35 + 25s*4/14 + 332s*3/21 + 96s*2/7 - 576s/7 + 417. Determine k so that n(k) = 0. -12, -2, 1 Suppose -36 = -14x + 5x. Factor 8t + 3t*3 + 4t*2 - 10t*3 - xt4 - t3 + 0t3. -4t(t - 1)(t + 1)(t + 2) Let w = -24 + 25. Factor -2d*2 - 2 - d + w - d + 5. -2(d - 1)(d + 2) Let x(c) = -c4 - 17c*3 - 5c*2 + 12c + 11. Let j(v) = 9v3 + 3v*2 - 6v - 6. Suppose -p + 18 = 21. Let a(l) = px(l) - 5j(l). Factor a(s). 3(s - 1)(s + 1)3 Let i(z) be the second derivative of -z4/42 + 2z3/7 - 9z*2/7 + 163z. Factor i(u). -2(u - 3)2/7 Suppose p - 20 = -3p, 5p = 2l + 9. Let q be 17/(-12) + 2 - 2/l. Suppose -q + 2/3m2 + 0m + 0m3 - 1/3m*4 = 0. What is m? -1, 1 Let r be -4 + ((-3)/(132/(-133)) - -1). Let y = r + 5/22. Factor 0 - 1/2b + yb2 + 1/4b*3. b(b - 1)(b + 2)/4 Let i be (-951)/(-5) - 6/2408. Let x = i + -187. Let 0 - 1/4u + 1/4u*x - 5/8u*2 + 5/8u4 = 0. What is u? -1, -2/5, 0, 1 Let o(g) be the third derivative of g5/180 - 49g4/36 + 2401g*3/18 + 6g*2 + 7g. Factor o(z). (z - 49)*2/3 Let l be 0/(-13 + 3 - -11). Factor l + 0z - 9/2z3 + 3/2z*4 + 3z*2. 3z*2(z - 2)(z - 1)/2 What is c in 3c*2 + 0c*2 - 8c*2 + 7c + 3c + 40 = 0? -2, 4 Let s(k) be the third derivative of k6/360 - 11k*5/180 + 35k*4/72 - 25k*3/18 - 5k*2 + k. Solve s(t) = 0. 1, 5 Let r(j) be the third derivative of -12j + 1/30j6 + 7/6j*4 - 2j*2 - 2j*3 + 0 - 1/3j*5. Solve r(o) = 0. 1, 3 Let 4h*2 + 6h - 1/2h3 + 0 - 1/2h*4 = 0. Calculate h. -2, 0, 3 Let q be -1 + 5 - 1 - 4. Let j be 3 + 3 + q + -1. Factor -jo*2 + 7o*2 - 4o + 5o + 5o. 3o(o + 2) Let d(p) be the second derivative of 12p2 + 25/2p*6 + 0 + 165/4p*5 + 34p*3 - 27p + 105/2p4. Find x such that d(x) = 0. -1, -2/5 Let c = -67/87 - -643/609. Solve 0 + 4/7b*4 + 0b*2 - cb*3 - 2/7b*5 + 0b = 0. 0, 1 Let q(d) be the third derivative of d10/37800 - d8/4200 + d*6/900 + 5d*4/6 + 21d2. Let j(m) be the second derivative of q(m). Let j(g) = 0. What is g? -1, 0, 1 Let a(u) be the third derivative of -u5/120 + 3u3 + u2 - 477u. Factor a(z). -(z - 6)(z + 6)/2 Let i = 98 - 94. Let v(d) be the first derivative of -2/9d*3 + 1/6d*i + 1/15d*5 + 1 + 1/3d - 1/6d2 - 1/18d6. Factor v(s). -(s - 1)3(s + 1)2/3 Factor -45 - 9w*2 + 19w*2 + 23w - 4w2 + w - 9w*2. -3(w - 5)(w - 3) Let w(c) be the third derivative of -c6/60 + c4 + 16c*3/3 + 49c2. What is x in w(x) = 0? -2, 4 Let g(n) be the first derivative of n8/2240 - n6/160 - n5/80 - 26n3/3 - 11. Let a(m) be the third derivative of g(m). Factor a(q). 3q(q - 2)(q + 1)2/4 Let a(z) be the second derivative of z4/66 + 16z3/33 - 17z*2/11 + 44z + 2. Factor a(m). 2(m - 1)(m + 17)/11 Suppose -238 + 482 = -12g + 244. Let 0 + 8/3y*2 + gy - 4/3y3 = 0. What is y? 0, 2 Suppose 1 = -s + 5. Suppose k - s + 4 = 0. Suppose 3/5x*2 + k + 0x = 0. What is x? 0 Let k(n) be the third derivative of -n*8/1512 - 2n*7/315 - 13n*6/540 - 2n5/45 - n4/27 - 4n2 + 7n. Determine u so that k(u) = 0. -2, -1, 0 Let t(m) = 2m3 + m - 1. Let k(h) = -15h*3 + 16h*2 - 71h + 7. Let r(s) = 3k(s) + 21t(s). Let r(a) = 0. What is a? 0, 8 Let j(s) be the first derivative of 2/39s3 + 4 + 2/13s*2 + 2/13s. Suppose j(l) = 0. What is l? -1 Suppose k = -4k + 75. Suppose -17n - 12 - kn3 + 39n*2 + 28n - 23n = 0. Calculate n. -2/5, 1, 2 Suppose -r - 5c + 37 = 0, r - 2c - 30 + 42 = 0. Factor 1/4m*4 + 1 - m + 1/2m*3 - 3/4mr. (m - 1)2(m + 2)2/4 Let u = 1982 - 1982. Let h(o) be the second derivative of 0o*2 + 1/15o*3 - 2o + u - 1/60o4. Determine r, given that h(r) = 0. 0, 2 Suppose -1 = 3t + 2. Let r = t - -3. Factor 6k3 - 8k*4 + 4k - 33 + 18kr + 33. -2k(k - 2)(k + 1)(4k + 1) Let m(g) be the second derivative of 3g5/20 + 17g*4/4 + 26g*3 - 479g. Find a, given that m(a) = 0. -13, -4, 0 Let j(b) = -b*3 - 3b. Let r(x) = 9x3 - 24x*2 + 15x + 24. Let f(m) = 6j(m) + r(m). Solve f(i) = 0. -1, 1, 8 Suppose 187w*5 + 108w*2 - 378w*5 - 409w*5 + 940w*4 - 6w - 2w - 504w*3 = 0. Calculate w. 0, 1/5, 1/2, 2/3 Factor 0 + 2/5i*4 + 0i*2 + 8/5i - 6/5i3. 2i(i - 2)2(i + 1)/5 Suppose -3h + 9 = -3n, 3h = 4n + 2h + 3. Factor 7i*2 - 11i - 5i2 + ni*2 + 3i + 8. 2(i - 2)2 Suppose 7t + 6 = 10t. Let q be t/(-44)(80/(-5) - -4). Factor 0 + 2/11z4 - 2/11z - 6/11z3 + qz*2. 2z(z - 1)3/11 Factor 34p*2 - 21 + 64p*2 + 24p - 101p2. -3(p - 7)(p - 1) Let y(j) be the first derivative of -3j*2 + 1/4j*4 - 1/2j*3 - 5j - 1. Let r(d) be the first derivative of y(d). Solve r(s) = 0 for s. -1, 2 Suppose -7k - 9 + 30 = 0. Let -3h - 10h3 - 1 - 10h*2 - 5h*4 - kh*5 + 2h*5 - 2h = 0. What is h? -1 Let n(u) be the third derivative of u*7/42 - 23u*6/24 + 143u*5/12 - 605u*4/24 + 4u*2 + 4u. Factor n(x). 5x(x - 11)*2(x - 1) Let r = 188/45 - 617/180. Factor 1/4s5 + 1/4s*3 - rs*2 + 3/4s*4 + 0 - 1/2s. s(s - 1)(s + 1)*2(s + 2)/4 Let l = 9 + -15. Let q = l - -7. Suppose 12f + 10f*3 + 18f*2 + 3f*4 + 2f*3 + 2 + q = 0. What is f? -1 Let j = -23 - -28. Let z(r) = 3r*3 - 6r*2 - 15r. Let o(i) = 2i3 - 7i*2 - 14i. Let s(y) = jz(y) - 6o(y). Factor s(p). 3p(p + 1)(p + 3) Suppose 6f = 5f + 5. Let s(n) = -7n*2 - 2n - 1. Let m(o) = -6o2 - 2o - 1. Let v(b) = fs(b) - 6m(b). Factor v(k). (k + 1)2 Let c(z) be the first derivative of z3/3 - z*2 - 15z + 114. Find b such that c(b) = 0. -3, 5 Let p(t) = -2t3 + 40t*2 - 86t - 324. Let l(m) = -6m3 + 118m*2 - 259m - 972. Let v(z) = -4l(z) + 11p(z). Solve v(y) = 0 for y. -2, 9 Let r(n) = -3n2 - 18n - 22. Let k = -14 + 9. Let d(t) = -5t2 - 35t - 45. Let j(p) = kr(p) + 2d(p). Factor j(i). 5(i + 2)2 Suppose -159j + 164j = 105. Let m be -5 + 8 + -1j/9. Factor -1/3g5 + 1/3 - 2/3g*2 - 1/3g + mg3 + 1/3g4. -(g - 1)3(g + 1)2/3 Let u(a) be the second derivative of 1/7a*7 + 0 + 0a*2 - 3/4a*4 + 38a + 0a3 - 3/5a*5 + 1/10a*6. Determine m, given that u(m) = 0. -1, 0, 3/2 Let n(b) be the second derivative of 15b + 0 + 1/2b4 + 1/10b*5 + 0b*2 + 2/3b*3. What is y in n(y) = 0? -2, -1, 0 Let k(p) = -20p*5 + 52p*3 + 24p*2 - 8p. Let f(q) = q5 + q4 + q*2 + q. Suppose -9i = -10i - 24. Let r(j) = if(j) - k(j). Factor r(d). -4d(d + 1)*2(d + 2)*2 Suppose 7a = 5a + 8. Let c(t) = -t + 7. Let w be c(a). Find m such that -3m + 9m3 - 25m*w - 20m*2 - m = 0. -1, -1/4, 0 Let y(j) = -6j*3 - 2j*2 - 47j + 2. Let z be y(0). Let v be (20/7)/((-3)/(-9)). Factor -zm3 - 1/7m*4 - 50/7m + 125/7 - vm2. -(m - 1)(m + 5)3/7 Let p(c) be the second derivative of c9/30240 + c8/16800 - c7/1680 + c6/1200 - c3/3 - 12c. Let k(o) be the second derivative of p(o). Factor k(l). l2(l - 1)*2(l + 3)/10 Let n be (4/84)/((-1)/(-6)). Let h be 72/(-1008)(-2 - 2). Factor -hq*2 + 4/7q - n. -2(q - 1)2/7 Let m(n) be the third derivative of n7/1260 - n6/180 + n5/72 - n4/72 + 18n*2. Let m(h) = 0. Calculate h. 0, 1, 2 Let p be ((-141)/(-188))/((-21)/(-16)) + 6/(-21). Factor 0 - ps*4 + 0s - 2/7s2 - 4/7s*3. -2s*2(s + 1)*2/7 Let g(q) = -48q + 242. Let d be g(5). Let w(s) be the first derivative of 8 + 20/3s3 + 4s*d + 0s. Determine j, given that w(j) = 0. -2/5, 0 Let s(i) be the third derivative of i*5/150 - 7i*4/30 + 8i*3/3 - 4i*2 - 28. Factor s(t). 2(t - 10)(t - 4)/5 Let 40g*2 + 128/3 + 2/3g*4 + 28/3g*3 + 208/3g = 0. What is g? -8, -2 Let u(c) be the t	{ "pile_set_name": "DM Mathematics" }
- ((-17800)/(-17805) - 5))? False Let w(n) = n*2 - 128n + 5562. Does 6 divide w(56)? True Suppose 0 = -3c + 9, t + t = -3c - 669. Let v = t - -687. Is v a multiple of 52? False Let f(s) = s*2 - 8s + 18. Let g be f(6). Suppose 4r = 3h + 101, gr - 3r + 3 = 0. Is 32 a factor of (-3)/(-7) - (5060/h + 2)? False Let b be (-137)/(-9) + (-6)/27. Let c(i) = -i*3 + 14i*2 + 16i - 12. Let l be c(b). Suppose q + 2r = 88, 0 = -lq + 4r - 187 + 491. Is 32 a factor of q? True Suppose -4 = -2o, 35o - 18 = -2h + 31o. Suppose -5v + 271 = -4g - 295, -hg = 4v - 461. Is 4 a factor of v? False Let n be -6((-5)/(-2) - 3). Let a(q) be the second derivative of q5/10 - q4/2 + q*3 + 2q*2 - 14q. Is a(n) a multiple of 8? False Let g be 542/6(-9)/3. Let p = g + 329. Is p a multiple of 3? False Suppose 0 = 4d + 5s - 6181, 5d + 4s = 15d - 15502. Is d a multiple of 2? False Suppose 4f + 2u = 8, 3f - 4u + 0u = 28. Suppose -27 = -3d - 3j, -fd + d + 33 = 5j. Let l(q) = 7q - 9. Is 11 a factor of l(d)? True Let g = -3741 - -5402. Suppose 2b - 793 = 2k + 863, 0 = -2b + 3k + g. Suppose 0 = -5t + 27 + b. Does 8 divide t? False Let t = 1618 + -1189. Does 19 divide t? False Let w(c) = -16c*2 + 19c - 14. Let b(m) = 17m2 - 20m + 14. Let u(j) = -5b(j) - 6w(j). Does 18 divide u(4)? False Let v(m) = -m*2 + 3m + 42. Let z be v(-5). Suppose 8h - 9h + 14 = zy, 0 = h + y - 11. Is 4 a factor of h? True Let m(a) = -5a + 14. Let t(y) be the second derivative of -y*3 + 15y*2/2 - 14y. Let q(u) = 4m(u) - 3t(u). Does 6 divide q(-6)? False Let f = 4803 + 1005. Is 6 a factor of f? True Let i = 16 + -2. Let q = i + -11. Is 10/q(-342)/(-95) a multiple of 3? True Suppose -1026l + 1029l - 1809 = 0. Let b = l - -498. Is b a multiple of 65? False Let b(m) = 2m + 300. Let v(a) = -a*3 - 14a*2 + 18a + 9. Let o be v(-15). Does 17 divide b(o)? False Suppose -c - 2c - 5o - 5 = 0, -5c - 3o = 3. Suppose 4r - 4d = 16, r + cr + 2d = 4. Suppose -b + 12 = r. Is 8 a factor of b? True Let v = 5419 + -4627. Does 44 divide v? True Let a = 85 + 76. Let x be 6109/180. Suppose 5w + 121 = xp, 5w + 44 = 5p - a. Is p a multiple of 20? False Let j(o) = 4o2 + 2o - 2. Let k be j(5). Let a = k - 105. Suppose 10y - 294 = ay. Is 14 a factor of y? True Let g(x) = 74x - 55. Let p be g(-6). Let i = p - -1400. Is i a multiple of 17? True Let m be (-60)/454812/(-16). Suppose m = z - 731. Is z a multiple of 22? False Let a = -850 + 647. Is 80((-58)/a)/(4/7) a multiple of 5? True Let n = 181 - 399. Let w = 372 + n. Does 7 divide w? True Suppose 9 = 4c - 7. Suppose -242 = -2n - 2y, 5n - 6y = -2y + 560. Suppose -8m = -cm - n. Is 5 a factor of m? False Let a(s) = 2s*3 + 61s*2 - 34s - 56. Is a(-17) a multiple of 5? True Let f = -22 - -26. Suppose 1 + f = q. Suppose 4c + 74 = h, -qc + 191 = -4h + 8h. Does 4 divide h? False Let k(y) = -2y3 - 20y*2 + 9y*3 - 21y - 8y3 - 33 + 0. Let w be k(-19). Suppose 2o = -wt + 4o + 505, -4o = -5t + 515. Does 14 divide t? False Let t(s) = s*2 + 2s - 52. Let f be t(8). Let l(r) = -r*3 + 29r*2 - 23r - 28. Is l(f) a multiple of 4? True Suppose 19j - 11 + 68 = 0. Is 15 a factor of j + -4 + 390 - (6 - 3)? False Suppose -8 = -r - t, -4t = r - 1 - 10. Suppose 3 + 25 = rp. Suppose -h + ph = 5f + 54, 2h - 5f = 31. Is h a multiple of 6? False Let f be 108/162(-1 - (-4426)/4). Suppose -2t + f = -5m + 4m, -5m = 2t - 755. Does 10 divide t? True Let v = 76341 - 43605. Does 186 divide v? True Let c = 1 + 0. Let j(d) = -68d*2 + 2d - 6. Let l(z) = 69z2 - 2z + 7. Let h(p) = -6j(p) - 5l(p). Is 9 a factor of h(c)? False Suppose -4v + 36972 = 4m, -m - 4v = -9712 + 460. Suppose -73s + m = -61s. Is 10 a factor of s? True Suppose 227k - 230k = -15. Suppose 3t - 3474 = -kh, -3h = -5t - 2146 + 82. Is 11 a factor of h? True Let u = 411 + -357. Suppose 2z = -2g + 4186, 4g + 59z = uz + 8374. Is 13 a factor of g? False Suppose -29f = -32f + 723. Suppose 0 = -5x - 10, 4x + 0 = -l + f. Is l a multiple of 21? False Suppose 16 = 2v + 8. Suppose -11c + vc + 98 = 0. Let q(j) = 4j - 28. Is 14 a factor of q(c)? True Does 88 divide (-4340230)/(-250) + (-462)/(-150) + -3? False Let v(w) = w3 - w2 + w - 2. Let a = 4 + -21. Let k = a - -19. Is v(k) a multiple of 4? True Let w(o) = o*3 - 5o*2 + 2o - 7. Let i be w(5). Suppose 4d + 4u = 8, -2d + iu + 28 = -1. Is 9 a factor of (1 - 2)d(-28)/4? False Is (-1666)/17-78 + -18 a multiple of 82? True Suppose 15k + 3624 = 3l + 13k, 0 = 2l - k - 2418. Is l a multiple of 113? False Let h(s) = 96s + 27. Suppose 15i = 5i + 70. Does 22 divide h(i)? False Let x(c) = 42c + 88. Let d be x(-2). Suppose g = -5q + 440, -1694 = -dg - 73q + 75q. Is g a multiple of 17? True Let t = -59 + 148. Let z = 382 - 378. Suppose -3r + 4l = 30 - t, z = 4l. Is 8 a factor of r? False Let d(i) = -194i2 + 3i - 7. Let k be d(-5). Is (5 + -4)/(4(-3)/k) a multiple of 29? True Let j(k) = 2k*2 + 44k + 104. Is 2 a factor of j(-32)? True Let l = -5122 - -23102. Does 10 divide l? True Let a(f) be the second derivative of f*4/12 + 4f*3/3 + 8f2 + f + 7. Does 11 divide a(7)? True Let i(y) be the third derivative of y5/30 - 49y4/24 + 61y*3/6 - 27y*2 - 1. Does 12 divide i(26)? False Suppose 335r + 125020 = 363r. Is 28 a factor of r? False Let b be 1526/354/63. Suppose -p + 136 = -4h, -10h - b = -3p - 5h. Is p a multiple of 16? False Suppose -20k = -19k - 1664. Suppose 2r = 5v + r - k, -r + 1 = 0. Is v a multiple of 36? False Let d = -95 + 359. Is 11 a factor of (18/(-36))/(2/d)-11? True Suppose 9i - 5z = 6i - 22, 2z = -5i + 15. Let y = i + 799. Does 40 divide y? True Let f be -189 - 91/3. Let w = 232 + f. Is 14 a factor of w? False Let c(n) = 27n*2 + 214n - 2474. Is c(12) a multiple of 11? True Let d = 7 - 7. Suppose -2n = -4m - 28, d - 9 = 3m. Is (-244)/(-10)20/n a multiple of 11? False Let l be (-15)/(-5) + 0 - (-6)/2. Does 27 divide 54/(((-84)/(-49))/l)? True Let c(q) = 912q2 + 107q + 10. Does 63 divide c(-4)? False Let v be 2/(-4)(-2)/1. Let m be v/(-2) + (-35)/(-10) - -1. Suppose -41 = -2c + t - 4t, -mc = 3t - 97. Is 7 a factor of c? True Let v = -44 + 54. Suppose -7o + 3o + v = 3h, -5h + o = -32. Suppose -hl + 391 = 55. Does 16 divide l? False Let k be ((-32)/64)/(2/(-8)). Suppose 0 = 2q - 5s - 163, kq - 49 - 126 = s. Is q a multiple of 18? False Let f(x) = x2. Let r(i) = -42i*2 + 2i - 2. Let u(m) = -5f(m) - r(m). Let c be u(1). Suppose c = -6k + 505. Does 13 divide k? True Let c be (-183)/((-185)/(-95) - 2). Let g = c + -2298. Is g a multiple of 79? False Let p(v) = -v*3 + 14v*2 + 17v - 1. Let q be p(15). Suppose -5z - q = 11. Let r(j) = j2 + 4j + 4. Is r(z) a multiple of 18? True Suppose -788030 + 2040830 = 145h. Is 80 a factor of h? True Suppose -9691 + 42314 = 17y. Is 15 a factor of y/19 - (-1 + -1)? False Let h(z) = 8z + 96. Suppose 90 - 34 = 8o. Is 12 a factor of h(o)? False Let u(s) = -39s. Suppose 3w = -2f + 15, -3 = -5w - 0f + 4f. Suppose -2c - w = c. Is 6 a factor of u(c)? False Is 10 + (6/15 - 697920/(-75)) a multiple of 87? False Suppose 7 = -4g + 23. Suppose -3717 = -gd + 3x, 12d - 16d + 3716 = -4x. Is d a multiple of 30? True Let c(t) = 3t*2 - 31t - 273. Let i = -263 - -250. Does 49 divide c(i)? True Let j be (-40)/140 - (-194)/(-7). Let s be 3/(78/j + 3). Is (72/28)/(-6) + 174/s a multiple of 6? True Suppose 0 = 102r - 71r - 18104. Is 4 a factor of r? True Is (-18 + -186)/((-5)/((-370)/(-4))) a multiple of 7? False Let h(u) = -u3 - u2 + u + 40. Let i = -25 - -29. Suppose -iq = 2q. Is h(q) a multiple of 14? False Let d(q) = 13361q3 - q. Let b be d(1). Does 37 divide (-2)/9 - b/(-180)? True Let v be (-27 + 11)/(-4) + (-3)/(-1). Let s = -44 - -89. Suppose 0 = vt + s - 325. Is t a multiple of 40? True Let j be ((-30)/(-3)-2)/(10/(-995)). Suppose -7 = 5f - w - j, -3f + 1173 = 5w. Does 33 divide f? True Suppose -4u + 12 = -2u - 3j, -5u + 21 = -3j. Suppose 4 = k + 3k + 5w, 0 = -uk - w - 8. Is 6 a factor of 4 + 120k/(-6)? True Let n be -4((-315)/(-336))/((-3)/4). Suppose 5t - nd = 7t - 605, 0 = 2t	{ "pile_set_name": "DM Mathematics" }
i(g) = g*3 - 8g*2 + 10g - 3. Let p be i(7). Which is bigger: p or a? p Let y = -863 + 743. Which is smaller: y or 0? y Suppose -5d + 27 = -z, 2d - d + 57 = -5z. Is z less than or equal to 3? True Let g = -24.977 - -25. Let o = g - 0.323. Are 9 and o unequal? True Let m = 0.0287 - 0.0887. Which is smaller: 42 or m? m Let j = 7069 + -7107.69. Let z = 39 + j. Let k = z - 0.71. Which is smaller: k or 3/4? k Suppose 0 = -m - 6 + 10. Which is bigger: -4 or m? m Suppose -5d = -5y - 100, -3d + 68 = -0y + y. Are d and 18 unequal? True Let f = -101 - -67. Let k = -33 - f. Which is smaller: k or -7/8? -7/8 Let n(r) = -31r*2 - 3r + 3. Let z be n(-3). Let q = z + 385. Let p be q/220 - (-4)/(-10). Which is bigger: p or 1? 1 Let y(g) = g*3 + 4g*2 - 10g - 3. Let q be y(-6). Let j be 6/q + (-10)/(-25). Which is smaller: -2/91 or j? -2/91 Suppose -2n + 3n = -3z, -z - 3n + 8 = 0. Let y(j) = -25j2 + 1. Let k be y(z). Let b be 3/(-12) + (-22)/k. Which is greater: 0 or b? b Let a = -31 - -23. Let y be (-2)/(-3) + (-2)/3. Suppose -28 = -yu + 4u. Which is smaller: u or a? a Let t = 326592/8359 - 508/13. Is 0 != t? True Let p(c) = -c3 - 8c*2 + 10c + 3. Let v be p(-9). Let m be (v/(-5))/((-2)/(-35)). Let r be m - (-8 + 4) - 4. Which is smaller: 1 or r? 1 Let w = 288 - -216. Which is bigger: w or 505? 505 Let v(j) = -8j3 - j2 + 2j - 7. Let x be v(-3). Is 194 at most as big as x? True Let s = 11 - 4. Let p = 7.1 - s. Let d = 1.5 + -0.8. Are d and p equal? False Let a(m) = m*2 - 3m - 6. Let u be a(7). Let q be u/(-18) - (-10)/45. Which is smaller: q or 1/26? q Suppose -2c + 4k = -72, 0 = -5k + k - 16. Is c less than 2? False Let b(c) = -c3 - 27c*2 + 42c + 395. Let s be b(-28). Are -7 and s unequal? True Suppose 4h + 4s - 482 = 3s, 2s = -4. Let c = 122 - h. Which is greater: -3/14 or c? c Let a = -24.4 + 2.6. Let b = -22 - a. Which is greater: 4 or b? 4 Let p(k) = -k*3 - 5k*2 + 6k + 1. Let c be p(-6). Let z = c - 5. Let w(v) = -v - 6. Let f be w(-3). Is f equal to z? False Let w = 18068/111 - 488/3. Is 1 < w? False Let j(a) = -12a3 - 4a*2 - 3a - 1. Let h be j(-2). Let i = -3827/45 + h. Let w(u) = u*2 + 6u - 27. Let r be w(-9). Which is greater: r or i? r Let z = 139.4 - 15.4. Let h = z + -124.1. Let k = 0 + 1.5. Which is smaller: k or h? h Let p = 105798771/4895 - 108069/5. Let j = -2/89 + p. Let d(c) = -c2 - c + 1. Let f be d(-2). Is f less than j? True Let y(d) = d3 - 3d2 + d + 1. Let z be y(2). Let a(b) = -2b*2 - 4b*3 + 145b + b*2 - 146b. Let q be a(z). Are q and 2 unequal? True Let d(p) = 138p + 46. Let b be d(2). Is 1 less than b? True Let b be (-39)/(-144) - 14/42. Suppose -5n - 5 = -0n. Is n < b? True Let d(c) = c3 + 10c*2 - 12c - 9. Suppose 22 = 3p - 5p. Let u be d(p). Let n be 11/((-308)/48) + u. Is n less than or equal to 1? True Suppose 0 = 3z + 57 + 18. Let w be 10/z + 96/15. Is 9 greater than w? True Let a(n) be the first derivative of -n2/2 + n - 2. Suppose -4b + 2 = -3b. Let j be a(b). Which is greater: j or 2/27? 2/27 Let u = -0.84 + -32.16. Let p = 3/20 - 2/5. Which is smaller: u or p? u Let p(z) = -36z + 21. Let l be p(6). Let v be 102/l - -1 - 10/25. Let n(a) = -a*2 + 2a + 1. Let k be n(2). Which is bigger: v or k? k Let b = -609/4 - -153. Let r be (-4 + 77/14)/(-1). Is b <= r? False Let v = -71 - -71. Let r be v1/(-2)11. Which is bigger: 3/37 or r? 3/37 Let v = 43.007 - 43. Let x = v + -6.007. Which is smaller: 1/4 or x? x Let p(l) = -4l*2 + 1. Let v be p(1). Let c be v/1 - (-32)/24. Which is smaller: c or -1/2? c Let z = -690 - -668. Is z > -22? False Suppose 0j + 4j = 3k + 30, -21 = -3j + 3k. Let i = 53 - 52. Let l be -3(5 + -6 + i + -3). Does j = l? True Let i = -628 - -959. Suppose 4x + i = 5v, -x + 3v - 50 - 24 = 0. Is -88 at least x? True Let l be 12/60(1 - 0). Suppose 2u - 3 + 9 = 2m, -3m = u - 9. Suppose 11 = 2c - mc. Which is greater: l or c? l Let v = -851 + 848. Which is greater: -0.04 or v? -0.04 Suppose 3v - 42 = -3g, g = 4v - 18 - 58. Let t be 14 - v - (-7)/(-1). Which is smaller: t or -10? t Let r = 326 + -241. Which is smaller: 1 or r? 1 Let p be (-279)/231 + 4 + -3. Let s = -1389/385 - p. Suppose b = 4n + 18, 3n + 2n + 21 = 2b. Is s > b? False Suppose -4x + 0x = -8. Let h be 1/x - 15/78-7. Which is smaller: h or 1? 1 Suppose 0 = -8t + 5t - 39. Let x = 6 + -12. Let k = x - t. Is k > 8? False Let o be (-56)/(-78) - (-2)/(-6). Let k = -1118 + 1118. Which is bigger: o or k? o Suppose 0 = 49f - 61f - 3108. Is f less than or equal to -259? True Let g be (1/51)/((-2)/(-4)). Let b(t) = t*3 - 7t*2 - 22t + 35. Let y be b(9). Which is greater: y or g? g Suppose -5v + 3a + 1680 = -0a, 4v = -a + 1327. Which is smaller: 2/3 or v? 2/3 Suppose 18d = 4d - 14. Is d less than or equal to -2/2207? True Suppose a + 9 - 6 = r, -5a + 1 = -r. Let j = 392 + -22342/57. Which is bigger: j or a? a Suppose -2i - 3p + 11 = -8p, 2i = 4p + 8. Let b = 8 + 12. Is i at most as big as b? True Let o = 1 + 18. Let q = o - 17. Which is smaller: 2/29 or q? 2/29 Let p = -1/33 - 28/165. Let x = 0.4 + -3.4. Let v = x + 5. Which is bigger: v or p? v Suppose 12y - 16 = 8y. Suppose d = -d - y. Let r = 3 + d. Is r less than or equal to 4? True Suppose 2v = v + 4. Let j(d) = -d - 6 - 2 - 10d - v + d*2. Let k be j(12). Which is smaller: 2/7 or k? k Suppose 3a + 9 = 0, 5a + 270 = -h + 4h. Let s = 86 - h. Is -6 != s? True Let k = -206.5 - -211.9. Which is smaller: -0.04 or k? -0.04 Let w(j) = 5j2 + 10j + 15. Let n be w(-2). Let c = 17 - 3. Which is smaller: n or c? c Let u(l) = -6l + 30. Let c be u(8). Let k be -1 + (-9)/((-9)/(-14)). Which is greater: c or k? k Let x be ((-7)/(-133))/(4/(-36)). Are x and -1 unequal? True Let i = 3179/15 + -212. Let u(c) = -c3 - 37c*2 - 67c + 104. Let v be u(-35). Do i and v have the same value? False Let s = 1449 + -13024/9. Which is smaller: s or 2? s Let o(a) = -a + 1. Let w be o(-3). Suppose -2i + 5z = -5i - 22, -z = wi + 1. Let t be (-4)/90 + (-2)/5. Which is greater: t or i? i Let d(p) = p*2 + 61p + 225. Let v be d(-57). Is v > 79/2? False Let v(r) = -r*2 + 26r - 161. Let h be v(11). Let a be (-3)/(-6) + (-10)/(-4). Let g = a - h. Which is smaller: 2/11 or g? g Let d be 70/105 - (-1)/(-3)-4. Let b be -4 - (-3)/2d. Which is smaller: -9/4 or b? -9/4 Suppose 3t - 131 = -2v, -v + t = -5v + 287. Let l be (v/(-4))/((-1)/(-4)). Is -75 at least l? False Let d = -3 + 2.94. Let j = d + -1.94. Let c = -4232.1 - -4232. Which is smaller: c or j? j Let r be 12/(-8)16/12. Let f be r/((-28)/8 - -4). Which is smaller: f or -2? f Let m be 8/1020/(-8). Let c = 1370 - 17831/13. Which is smaller: c or m? m Let y = 3.1 + -2.85. Let d = 0.55 - y. Let w = d + -0.32. Is w equal to 1/2? False Let p be 12/(-30)66/4. Let b = p - -393/55. Is 1 >= b? True Let h = 0.023 - 76.023. Let s = h + 76. Which is smaller: -5 or s? -5 Let b(o) = o*3 - o - 23. Let m be b(0). Let f be ((-24)/(-9) - 4) + -1114/6. Which is bigger: f or m? m Let k be 2/((-18)/(-81)) - 239. Which is smaller: -232 or k? -232 Let g = 22 - 21.91. Let x = 1.19 - g. Is x less than -2/3? False Let t = 11 + -1. Suppose -7u + 9u = t. Suppose uk + 6 = 4k. Which is bigger: k or -5? -5 Let t(a) = -a*2 + 29a - 10. Let j be t(27). Which is smaller: 41 or j? 41 Suppose 3u - 4l = 493, 0 = 2u + 2u + l - 651. Let h be u/(-6) - 3/(-18). Let q be (h/90)/(6/5). Which is smaller: q or 1? q Let c(a) = a*3 + 7a*2 + a + 6. Suppose -41 = 3b - 4g, -5g - 39 = 2b - 10g. Let m be c(b). Is m bigger than 1/5? False Let j(k) = k*2 + 2k + 2. Let f be j(-2). Let a = 0 - -3. Let n be f/a(-6)/2. Which is greater: n or 9? 9 Suppose 10y - 160 - 590 = 0. Is 73 smaller than y? True Let i(v) = -v*2 - 3v + 6. Let a be i(0). Let j = -7 + a. Let y be -11/4 - 0. Which is smaller: y or j? j Let u = -0.313 - 2.687. Is -57 at most u? True Suppose -2a - 2u = 42, 5u = a + 7u + 24. Is -20 less than a? True Let u(j) = -17j - 54. Let v be u(-2). Let y be (-4585)/231 + 2/11. Which is smaller: y or v? v Let d(v) be the third derivative of v*5/60 + 11v*4/12 + 11v*3/6 + 7v**2. Let o be d(-20). Which is greater: o or -30? o Let o(m) = -m - 14. Let	{ "pile_set_name": "DM Mathematics" }
et p be f(-6). Round p to 4 decimal places. 0 Let o = -0.99999904 + 1. Round o to six dps. 0.000001 Let f(w) = 31406w2 + 12w + 6. Let m be f(-11). Round m to the nearest 1000000. 4000000 Let g = -0.3 + -13.7. Let d = g + 13.999912. What is d rounded to five decimal places? -0.00009 Let r(j) = -10j3 + j2 + 3j + 3. Let d be r(-3). Let h(u) = 1528 + 65 - u - d. Let f be h(0). What is f rounded to the nearest one hundred? 1300 Let d = 924 + -881.3. Round d to zero dps. 43 Let k = 57 + -53.8. What is k rounded to zero dps? 3 Suppose -d + 0d - 3f - 3 = 0, d - 4 = 4f. Suppose 4n + 828519 - 7788519 = d. Round n to the nearest one hundred thousand. 1700000 Let v = -1 - -0.999928. What is v rounded to five dps? -0.00007 Suppose 6w = 3w + 120000045. Suppose 5y = 3a - w, 24000010 = -y - 2y + 2a. Round y to the nearest one million. -8000000 Let i = -1467.9 + 1476.109. Let d = 0.109 - i. Let q = d + 8.09937. Round q to 4 dps. -0.0006 Let r = 16.8 + -18. Let z = 1.188 + r. Round z to 2 dps. -0.01 Let n = -27915240.34299404 - -0.34299404. Let t = n + 27915238.8000107. Let a = t + 1.2. Round a to 6 dps. 0.000011 Let g = -2.8 - -0.6. Let p = 1.88 + g. What is p rounded to one decimal place? -0.3 Let d = 5873 + -15007. Let i = d + 9143.001. Let o = i - 9. What is o rounded to three dps? 0.001 Let j = 165 + -138.6. Round j to the nearest integer. 26 Let h = 13 - 12.9904. Round h to 3 dps. 0.01 Let n = 31 - 167. Let r = 13906 + -14040.82. Let k = n - r. Round k to 1 decimal place. -1.2 Let z = -217.9999476 - -218. Round z to 5 dps. 0.00005 Let p = 1.617137 - -56104.702863. Let i = -55881.32113 + p. Let h = i - 225. What is h rounded to 4 dps? -0.0011 Suppose y = 4y. Suppose 4q + 2157506 - 8557518 = y. Suppose -z = -s + 101837 + 218162, 5z + q = -3s. What is z rounded to the nearest 100000? -300000 Let d = -3.1000014 + 3.1. Round d to 7 decimal places. -0.0000014 Let m = -5.53 + 33.63. Let j = 28.3048 - m. Let d = 0.2 - j. Round d to 3 dps. -0.005 Let i(k) = -k + 5. Let b be i(0). Suppose -bj = 297901 + 92099. What is j rounded to the nearest 10000? -80000 Let o = -89 + 69. What is o rounded to the nearest one hundred? 0 Let n(m) = -m3 + m2 + 250. Let i(g) = -g + 2. Let z be i(2). Let q be n(z). Round q to the nearest one hundred. 300 Let q = 23.8 - 20. Let w = q + -7.5. Let g = -3.699966 - w. What is g rounded to five dps? 0.00003 Let f = 0.3 + 12.7. Let j = f + -14.76. Round j to one decimal place. -1.8 Let f = -49.999528 + 50. What is f rounded to 4 decimal places? 0.0005 Let t = 0.09 - 0.0898. What is t rounded to 4 dps? 0.0002 Let c = -697.384 + 702. Let f = -0.016 + c. Let h = f + -3.93. What is h rounded to 1 decimal place? 0.7 Suppose -4o - 3q - 23767 = -69538, 0 = -3o + q + 34312. Let j = -5639 + o. What is j rounded to the nearest 1000? 6000 Let v = 9 - 8.3. Let m = 0.61 - v. Let i = m + 0.0900009. What is i rounded to 6 dps? 0.000001 Let m = -21.3999911 + 21.4. Round m to six dps. 0.000009 Let i = 1.8 - 1.2. What is i rounded to one decimal place? 0.6 Suppose r - 1410760 = 7882654. Suppose 27706586 + r = 5x. What is x rounded to the nearest one million? 7000000 Let j = -4.95392 - -4.743941. Let g = j - -0.21. Round g to five dps. 0.00002 Let w = -107 + 106.9999708. What is w rounded to 6 dps? -0.000029 Suppose 0 = 2a + i - 726, -2a + 686 = 4i - 34. Let q = 10 - 7. Suppose h + qh = -a. Round h to the nearest 10. -90 Let x = -4467 - -501. Let p = 1966 + x. What is p rounded to the nearest 1000? -2000 Suppose -2l - 308 = -o, -4o - 618 = -l - 1829. Round o to the nearest one hundred. 300 Let b = 76.857 - 77. Round b to 2 dps. -0.14 Let d = 0.46857 - -0.2567. Let v = d + -0.84526957. Let x = 0.12 + v. What is x rounded to seven decimal places? 0.0000004 Suppose 0 = -4v + 2o + 2o - 148, -4o - 97 = 3v. What is v rounded to the nearest 10? -40 Let h = -1.524 + -0.076. What is h rounded to one dp? -1.6 Let w = -1 + 2.3. Let f = 1.3000056 - w. Round f to 6 decimal places. 0.000006 Let q = 3922 + -3749.96. Let n = q - 169. Let y = n - 4. What is y rounded to 1 decimal place? -1 Let q = 109.672 + -109. Let f = -0.79 + q. What is f rounded to two decimal places? -0.12 Let z = 3.087 + -3.1. Let x = -50.013 - z. Let v = x - -50.000094. What is v rounded to five dps? 0.00009 Let l = -1.1 + -23.9. Let p = 4 + l. Let a = -21.00063 - p. Round a to four dps. -0.0006 Suppose 5o = -w + 36, 3w = 2o - 38 + 197. Suppose -8x - 4z = -3x - 64, 3z = -4x + w. Let d = 138 + x. What is d rounded to the nearest one hundred? 200 Let b(d) be the second derivative of 89d4 + d3/2 - 3d*2/2 - 3d. Let u be b(-3). Round u to the nearest one thousand. 10000 Suppose q + q = -82112. Let i = q - -4056. Round i to the nearest 10000. -40000 Let v = 0.05640229 - 0.0564. What is v rounded to seven dps? 0.0000023 Let l = 3.4 + -3.27. Let i = -0.12933 + l. What is i rounded to four decimal places? 0.0007 Let i = -717860 - -2667860. Round i to the nearest 100000. 2000000 Let z = -7052.9 + 855.9. Let p = z + 6197.39995. Let l = 0.4 - p. Round l to 5 decimal places. 0.00005 Let q = -17 + 52. Let l = q + -34.62. What is l rounded to 1 dp? 0.4 Let y be -219 + (1 - -1) + 1. Let n = 20784 - y. Round n to the nearest 10000. 20000 Let b be (6/12)/(1/(-2)). Let c be (3/4)/(b/(-4)). Suppose -cj + 2k + 20837 = -6763, -j + 9200 = -5k. What is j rounded to the nearest 1000? 9000 Let c = -1693 + 1110. Let a be c - (0 + -3 - 0). Round a to the nearest 100. -600 Let w = 0.273 - 0.27300855. What is w rounded to six decimal places? -0.000009 Suppose 0s + l = 2s - 3, 5s - l = 0. Let b be (3280/(-6))/(s/7500). Suppose -a - 4a + b = 0. Round a to the nearest 100000. 800000 Let z = -2.112 + 0.012. Round z to the nearest integer. -2 Let c = 0.145 - 0.053. Round c to 2 decimal places. 0.09 Let b = 27164275 + -27164286.999993. Let k = b - -12. What is k rounded to 6 dps? 0.000007 Suppose 5r = 53651647 - 651647. What is r rounded to the nearest one million? 11000000 Let v = -16.8 - -11.5. Let n = -11.6 - v. What is n rounded to the nearest integer? -6 Let z = -41.7 + 0.7. Let q = z - -37.6. Let o = q - -4.35. Round o to 1 dp. 1 Let h = 4 - -1. Suppose -2v + 10400 = 2w, -hv = -v. Round w to the nearest one thousand. 5000 Let k = 62 - 61.9999898. Round k to six dps. 0.00001 Let h = 48.7779 - 0.0779. Let d = 60.42 - h. Let b = 12 - d. What is b rounded to one dp? 0.3 Let x = -113 - -178.2. Round x to the nearest 10. 70 Let n = -59.0006 + 59. Round n to 3 dps. -0.001 Let t(k) = 4k - 3k - 1 - 1. Let g be t(4). Suppose -gc = c + 1770000. Round c to the nearest 100000. -600000 Let p = 3.3 - 0.4. Let g = -1852.142 - -1855. Let d = g - p. Round d to 2 decimal places. -0.04 Let k = 11567 + 32433. What is k rounded to the nearest ten thousand? 40000 Let l = -958210 + 958249.00019. Let r = -59 + 98. Let s = l - r. Round s to 4 dps. 0.0002 Let y = 8.69602 - 8.7. Round y to three decimal places. -0.004 Let f = -0.047 + -0.056. Round f to 1 decimal place. -0.1 Let a = 30170.085 - 30309. Let c = a - 0.085. Let v = c - -139.67. Round v to one dp. 0.7 Let m = -1.39 + -0.11. Let w = m + 1.50000006. Round w to 7 dps. 0.0000001 Suppose 0w = -3h + 5w + 6290, -4w - 8376 = -4h. Round h to the nearest 100. 2100 Let j = 2.1200172 + -2.12. What is j rounded to five decimal places? 0.00002 Let r = 43 + -45.44. Round r to 1 dp. -2.4 Let l = -47.00000054 - -47. Round l to 7 decimal places. -0.0000005 Let j = -200.99867 - -201. Round j to 4 decimal places. 0.0013 Let p = -0.21 + 0.3. Let l = 0.032 - p. Round l to two dps. -0.06 Let t = 15 + -10. Suppose -2p - t = 1. Let x(k) = 9k + 4. Let u be x(p). What is u rounded to the nearest ten? -20 Let r = -1.28 - -1.2799968. What is r rounded to 6 decimal places? -0.000003 Let z(r) = -5001r + 2. Let n = -2 + 7. Suppose -8 - 2 = -nk. Let o be z(k). What is o rounded to the nearest 100000? 0 Suppose -4x - a = 23, -2a = -0x + 2*x + 10. Let o be 387/6 - 3/x. Let i = 111 - o. What is i rounded to the nearest 10? 50 Let b = -13635 - -20645. Round b to the nearest one thousand. 7000 Let u = 0.73 - 0.7300032. What is u rounded to six decimal places? -0.000003 Let s be 13/((-325)/10) - (-27300004)/10. What is s rounded to the nearest 100	{ "pile_set_name": "DM Mathematics" }
-13695. Give gh(m) - 47o(m). -47m Let n(x) = 891 + 886 + 8x - 13x3 + 17x*3 - 1782 + 8x*2 - 67x*3. Let y(m) = 42m*3 - 5m*2 - 5m + 3. Give -5n(s) - 8y(s). -21s3 + 1 Let j(b) = -23b*3 + 7b*2 - 11. Let x(c) = -8c*3 + 2c*2 - 4. Suppose k - 5n + 28 = 49, 5k = n - 15. What is kj(h) + 11x(h)? 4h*3 - 6h*2 Let l(u) = 112u - 83. Let t(c) = -33c + 28. Give -2l(b) - 7t(b). 7b - 30 Let h(t) = -t3 - t2 - t - 1. Let j(s) = -4s3 - 188s - 2 - 188s - 3s*2 + 556s - 184s. Give 6h(o) - 2j(o). 2o*3 + 2o - 2 Let i(j) = 2j2 - 16j - 17. Let c be i(9). Let s(w) = w*2 + 0w*2 + 3 + c - 16w + 7w. Let y be s(9). Let n(k) = -1. Let d(q) = q - 2. Give yn(v) - d(v). -v - 2 Let a(x) = 95x. Let r(v) = -666v - 1. Calculate -15a(y) - 2r(y). -93y + 2 Let n(o) = -33o*2 + 29o + 2. Let j(b) = 17b2 - 14b - 1. What is 9j(m) + 4n(m)? 21m2 - 10m - 1 Let l(x) = -2x3 - 57x*2 + 32x + 91. Let j be l(-29). Let z(d) = -4 + 2d2 - 2d*2 + 3d*2. Let m(v) = 6v*2 - 7. Determine jm(y) - 7z(y). 3y2 Let p(n) be the second derivative of n4/12 - n*3/6 + n. Let l be (41)/(-2434/(-408)). Let j(g) = -4g*2 + 3g - 2. Determine lp(m) + j(m). -2m2 + m - 2 Let i(p) be the first derivative of -p2/2 - 2p + 179. Let q(y) = -2y - 5. Let m = 19 + -13. Determine mq(r) - 14i(r). 2r - 2 Let l(z) = 2386z - 1. Let f(b) = 9524b - 4. Give 3f(q) - 11l(q). 2326q - 1 Let z(i) = -777i2 + 147i - 147. Let a(n) = 244 - 730 - 32n2 + 241 + 4n + 11n2 + 241. Determine -147a(r) + 4z(r). -21r*2 Let c(d) = 999d*3 + 4d*2 + 8d - 2. Let p(l) = 642356l3 + 2574l*2 + 5148l - 1287. Determine 2574c(n) - 4p(n). 2002n3 Let g = -6642 + 6639. Let w(f) = -15f*2 + 11f - 7. Let p(o) = -8o2 + 6o - 4. Determine gw(q) + 5p(q). 5q2 - 3q + 1 Let a(q) = -q. Let x(d) = 2411d - 1. Determine -a(f) - x(f). -2410f + 1 Let g(m) = -21m - 7. Let u(b) = -b3 + 25b*2 - 94b - 126. Let d be u(20). Let o(i) = 21i + 6. What is do(w) - 5g(w)? -21w - 1 Let v(q) = -q*2 + q + 1. Let w = 49 - 39. Suppose 3u - 8u = -w. Suppose 0 = 2p - p - u. Let a(t) = -t*3 - 7t*2 + 6t + 6. Determine pa(b) - 14v(b). -2b3 - 2b - 2 Let t(o) = -o3 - 1. Let w(n) = n3 - n*2 + 5. Let p be (-4)/(-6) + (-2800)/(-840). Determine pt(z) + w(z). -3z3 - z2 + 1 Let d(u) = u2 - u - 1. Let s(w) = -2w*3 - 4w*2 + 21w + 3. Calculate 4d(k) + s(k). -2k*3 + 17k - 1 Suppose -6o + 3o = 2r - 377, 3o - 371 = -5r. Let d = o - 132. Let u(w) = 2w + 12. Let s(a) = -3a - 18. What is ds(m) - 7u(m)? m + 6 Let y(j) = -10j + 4. Let b(c) = c - 1. Let u be (265/530)/((14/(-24))/(-7)). Determine ub(g) + y(g). -4g - 2 Let z(m) = 42m2 - 7m + 7. Let n be 20/((-240)/(-18))28/(-6). Let q(a) = -21a*2 + 3a - 3. Determine nq(c) - 3z(c). 21c2 Let k(b) = -4b*2 + 65b. Let y = 2785 - 2776. Let a(l) = l*2 - 16l. Calculate ya(x) + 2k(x). x*2 - 14x Let u(k) = -k*2 - 24k + 7. Let a(z) = 2z2 + 35z - 13. What is -5a(t) - 8u(t)? -2t2 + 17t + 9 Let a(o) = 87o - 20. Let q(j) = 170j - 42. Determine 5a(l) - 3q(l). -75l + 26 Let s(m) = 4m + 3. Let v(p) = -p + 9 + 8p + 4p. Let c be 12/(-11)(46 - (-13920)/(-261)). What is cs(d) - 3v(d)? -d - 3 Let t(w) = 4w + 3. Let l(m) = 7m + 5. Let u(b) = -3l(b) + 5t(b). Let g(a) = -37052a + 74120a - 37067a - 1. Determine -g(z) - 3u(z). 2z + 1 Let d(q) = 33q + 85. Let x(c) = 32c + 78. Give -2d(g) + 3x(g). 30g + 64 Let w(u) = 17u*3 + 6u*2 + 75u - 24. Let d(a) = -a*2 - a + 4. What is 6d(g) + w(g)? 17g3 + 69g Let h(a) = 16a3 - 26a + 11. Let c(w) = -3w3 + 5w - 2. Let n(d) = 2d2 + 16d + 103. Let f be n(-9). Suppose 33p = 22p - f. What is pc(s) - 2h(s)? s*3 - 3s Let v(n) = -16n + 4. Let s(l) = 66l - 19. Let g(k) = 2s(k) + 9v(k). Let q(t) = -1. Let j(c) = 60c + 5. Let h(w) = j(w) - 6q(w). Give 11g(r) + 2h(r). -12r Let g(r) = r. Let m(b) = 15b + 3. Suppose -28n - 24n + 53n + 1 = 0. Calculate nm(k) + 5g(k). -10k - 3 Let k(n) be the third derivative of -n*2 + 1/6n*4 - 48 + 0n - 2/3n3. Let g(v) = 3v - 3. Calculate -3g(s) + 2k(s). -s + 1 Let w(f) = 18 - 10 - 2 + 3 + 6f. Let a(x) = -16 + 2x + 6 + 13. Calculate -11a(r) + 4w(r). 2r + 3 Let v(c) = -1356c*3 + 16c*2 + 8c - 8. Let a(t) = -903t3 + 10t*2 + 5t - 5. Calculate 8a(p) - 5v(p). -444p3 Let s(v) = 15v*3 - 866v*2 + 2v + 2. Let a(x) = -31x3 + 1730x*2 - 5x - 5. Calculate -2a(r) - 5s(r). -13r3 + 870r*2 Let u(f) = 2746f*3 - 3f*2 + 3f + 3. Let j(n) = -8236n3 + 8n*2 - 8n - 8. What is -3j(h) - 8u(h)? 2740h3 Let q(z) = -15z*2 + 2z - 2. Let p(g) = -5 - 12g - 11g - 29g2 - 11g - 12g + 51g. Determine -2p(o) + 5q(o). -17o2 Let l(c) = 68c - 28. Let v(q) = -87q + 28. Give -5l(m) - 4v(m). 8m + 28 Let m(q) = 2q2 + 5q - 2. Let a(b) = 4 - 1 + 1 + 49b2 - 9b - 111b2 + 59b*2. Determine -3a(v) - 5m(v). -v2 + 2v - 2 Let k(j) = -26j3 + 63j + 6. Let f(g) = -g*3 - g + 2. Give 3f(w) - k(w). 23w3 - 66w Let y(o) be the first derivative of -13o2/2 - 11o - 168. Let n(s) = 9s + 7. What is 8n(d) + 5y(d)? 7d + 1 Let z(q) = 8q3 - q + 4. Let n(w) = -7w3 + w2 + 2w - 3. Let r(j) = -4n(j) - 3z(j). Let o(l) = -5l*3 + 5l*2 + 6l. What is 2o(c) + 3r(c)? 2c3 - 2c*2 - 3c Let u(g) = 2g2 + 80g. Let o(v) = -5v2 - 199v - 1. Give 5o(f) + 12u(f). -f*2 - 35f - 5 Let b(d) = -d - 13. Let j(l) = 53l - 104. Determine 6b(p) - j(p). -59p + 26 Let i(f) = 606f + 3. Let n(z) = 202z + 1. Give -6i(l) + 19n(l). 202l + 1 Let w(c) = -3c3 + c + 2. Let p(z) = 22z*3 - 200z*2 - 6z - 12. What is -p(l) - 6w(l)? -4l*3 + 200l*2 Let i(x) = -107x + 4. Let z(g) = 1. Give -i(m) + 6z(m). 107m + 2 Let x be (-1 - -78)(0/(-6) - -10). Suppose xd - 772d = -8. Let q(g) = g3 + 4g*2 - 3g. Let j(o) = o3 + o2 - o. Give dj(l) - q(l). 3l*3 - l Let x(o) = 8o*3 - 66o*2 + 11o. Let n(t) = -9t3 + 129t*2 - 11t. Calculate -2n(z) - 3x(z). -6z3 - 60z*2 - 11z Let q(y) = -3y + 4. Let i = 57 - 129. Let c = -73 - i. Let h(u) = -u. Calculate cq(m) + 4h(m). -m - 4 Let x = 130 - 30. Let m = x + -98. Let a(j) = -2j + 1 - m - 5 + 5 + j2. Let g(r) = -r2 + r. What is -a(h) - 3g(h)? 2h*2 - h + 1 Let o(v) = 14v*3 - 8v*2 + 8v + 17. Suppose 0 = -3s - 3l + 15 - 33, 4s + 38 = 3l. Let x(g) = 5g3 - 3g*2 + 3g + 6. Determine sx(u) + 3o(u). 2u3 + 3 Let y(j) = 6j*2 + 507. Let n(h) = -7h*2 - 506. Determine 4n(f) + 5y(f). 2f*2 + 511 Let r(k) = -3k3 - k2 + 7. Let t = 33 - 47. Let z be 52/14 + (-4)/t. Let y(s) = 4 - 4s3 + z - 158s + 158s - s2. Determine 6r(q) - 5y(q). 2q3 - q2 + 2 Let o(j) = -j*2 - j + 1. Let b(x) = 49x*2 - 13x - 3. Determine -b(a) - 2o(a). -47a*2 + 15a + 1 Let k(u) = 272u - 13u*2 + 4 + 1 - 2 - 266u + 3. Let l(p) = 26p2 - 13p - 13. Suppose 3v + 2v + 10 = 0, -2q - 5v - 36 = 0. Determine qk(b) - 6l(b). 13b2 Let g(s) be the second derivative of 5s*3/6 - 3s*2 + s. Suppose -2r = 2r + 24. Let y(p) = -241 + 734 - 248 - 240 - 4p. Determine ry(z) - 5g(z). -z Let b(q) = 204q + 2. Let x(k) = 621k + 8. Calculate 7b(z) - 2x(z). 186z - 2 Let o(v) = -7v - 1. Let c be o(-1). Let w(z) = -z + 11. Let q be w(0). Let i(s) = -30s - 1 + 26s - 13s + 16. Let j(t) = 9t - 8. Determine ci(u) + qj(u). -3u + 2 Let w(r) = 29r*3 - 21r*2 - 49r - 26. Let s(x) = -5x3 + 4x*2 + 9x + 5. Calculate -11s(z) - 2w(z). -3z3 - 2z*2 - z - 3 Let g(v) be the third derivative of -5v*4/24 - 7v*3/6 + 5v*2 - 2v - 854. Let t(m) = -6m - 7. What is 4g(a) - 3t(a)? -2a - 7 Let q be 20/6 - ((-30)/165 - 32/66). Let b(p) = p*2 + 3p - 2. Let z be (-6)/8(3 - 7). Let u(n) = -n2 - 2n + 2. Give qu(k) + zb(k). -k*2 + k + 2 Let b(x) = 1906597x + 67760. Let s(d) = 844d + 30. Determine -3b(n) + 6776s(n). -847n Let a(f) = -209f + 14. Let s(q) = -192q + 15. Determine 5a(m) - 6s(m). 107m - 20 Let d(m) = 32 - 70 + 38 - 1. Let j(q) = 4q - 24. What is -24d(o) + j(o)? 4o Let y(g) = 7g3 - 25g*2 + 11g + 4. Let u = 33718 - 33712. Let b(o) = 2o3 - 6o**2 +	{ "pile_set_name": "DM Mathematics" }
9, what is -4141 - 78? -4230 In base 8, what is 240046 + 124? 240172 In base 11, what is -1064 - -7? -1058 In base 10, what is 2911676 - -5? 2911681 In base 3, what is 210 + -1121101? -1120121 In base 11, what is -7936 - a3? -7a29 In base 5, what is 1033323 - 33? 1033240 In base 15, what is 28 - 12c4? -129b In base 3, what is 2 + 1011210212000? 1011210212002 In base 16, what is -d5 - -2f5? 220 In base 12, what is -4b - 4354? -43a3 In base 9, what is -2562623 - 2? -2562625 In base 6, what is -114224 + -22? -114250 In base 10, what is -76 - 521? -597 In base 10, what is 22751 + 2? 22753 In base 13, what is 4336a + 4? 43371 In base 13, what is 65b - -19? 677 In base 8, what is 3 - -253576? 253601 In base 7, what is -22450 + 53? -22364 In base 5, what is 2420 + 10? 2430 In base 15, what is 1 - 134a? -1349 In base 14, what is 3a52 - -6? 3a58 In base 5, what is 20 + 1433? 2003 In base 15, what is -4 - -316e? 316a In base 10, what is 274 + 9794? 10068 In base 12, what is -11b1 + 6? -11a7 In base 15, what is -54080 - -6? -54079 In base 9, what is -5488 + 500? -4888 In base 10, what is 11256 + -2? 11254 In base 6, what is 5 + 525021? 525030 In base 14, what is 5a56d - 2? 5a56b In base 11, what is 158269 + 4? 158272 In base 5, what is 343 + -213? 130 In base 10, what is -2919 - 33? -2952 In base 13, what is -3 + 7474c? 74749 In base 13, what is 0 - -28aba? 28aba In base 3, what is -1102 + 12121110? 12120001 In base 12, what is -18960 - 5a? -189ba In base 3, what is -2110001212 + 111? -2110001101 In base 7, what is 1366033 - 3? 1366030 In base 10, what is 193 - -673? 866 In base 4, what is 10 + -3013001? -3012331 In base 13, what is 1 - -151bc6? 151bc7 In base 16, what is 4 + 7dcf? 7dd3 In base 15, what is 1 - ca04? -ca03 In base 15, what is -309a7 + -5? -309ac In base 5, what is 3 + -213210121? -213210113 In base 16, what is 2 - -151a9? 151ab In base 9, what is -78 + -65473? -65562 In base 11, what is -1232 + 76? -1167 In base 5, what is -3324 - -123? -3201 In base 7, what is -365 + -641? -1336 In base 5, what is -1 + 13442144? 13442143 In base 4, what is -132 + -22? -220 In base 8, what is -713534 + -1? -713535 In base 10, what is 2 + 198340? 198342 In base 6, what is -41410 + 0? -41410 In base 7, what is 230 - 3624? -3364 In base 7, what is -3256 - 3344? -6633 In base 5, what is -433 - 1134? -2122 In base 11, what is -427 - 72? -499 In base 13, what is -772c - -9? -7723 In base 14, what is -12 + -81d62? -81d74 In base 2, what is -1110011000101011011 + 11? -1110011000101011000 In base 15, what is 5526 + -19? 550c In base 3, what is -1212022210 + -22? -1212100002 In base 16, what is 1096 + f? 10a5 In base 6, what is -145 - -253341? 253152 In base 7, what is -3123 - -26? -3064 In base 12, what is -451 - a59? -12aa In base 10, what is -2707 - 70? -2777 In base 2, what is -11101 - -1001011111111? 1001011100010 In base 12, what is -10b - -2297? 2188 In base 9, what is -8 - -58207? 58188 In base 16, what is -18 - 2a1? -2b9 In base 3, what is 10 - 10110202221? -10110202211 In base 14, what is c + -16d9? -16cb In base 12, what is 6 - 147a? -1474 In base 3, what is -2 + -101200102101? -101200102110 In base 11, what is 3058 - -88a? 3937 In base 13, what is b8 - -27a? 365 In base 3, what is 121 + -1100100? -1022202 In base 16, what is -7 + bbec? bbe5 In base 4, what is 0 + 2200020? 2200020 In base 2, what is 1010001 + -10101010110? -10100000101 In base 8, what is 564312 + 14? 564326 In base 13, what is -1845 - -10c? -1736 In base 14, what is -bba + 3? -bb7 In base 10, what is 2 - 14940? -14938 In base 4, what is -22 + -1202230? -1202312 In base 12, what is -14 + 163b? 1627 In base 2, what is 10011011101 + 100001? 10011111110 In base 8, what is -233 - 427? -662 In base 3, what is 202012210 - -21201? 202111111 In base 9, what is 22 - -6853? 6875 In base 13, what is -5 + a30c9? a30c4 In base 3, what is -1001001200 - 1? -1001001201 In base 13, what is 6c385 + 1? 6c386 In base 7, what is 54253 - -12? 54265 In base 13, what is -111314 - -8? -111309 In base 5, what is -202414 - -434? -201430 In base 13, what is 3 + 18a5b9? 18a5bc In base 14, what is -b + -d01? -d0c In base 9, what is 0 - 735086? -735086 In base 5, what is 13 + -11110? -11042 In base 3, what is 102111 + -2021020? -1211202 In base 11, what is 480a - -2a? 4839 In base 2, what is 100 + -1000110001011110? -1000110001011010 In base 11, what is 1a401 - 2? 1a3aa In base 14, what is 8819 + 50? 8869 In base 4, what is -1323310322 + 1? -1323310321 In base 13, what is -5 - 2a255? -2a25a In base 4, what is -11020 - 3302? -20322 In base 14, what is -949 + 96? -893 In base 2, what is 100 + -1100101110001? -1100101101101 In base 14, what is -ca7 - 29? -cd2 In base 13, what is -60 + -3c22? -3c82 In base 11, what is -5156 + 21? -5135 In base 14, what is cd7a + 0? cd7a In base 10, what is -1746975 - 3? -1746978 In base 16, what is -5 + -38b1? -38b6 In base 9, what is 154608 - 1? 154607 In base 10, what is 1223266 - -5? 1223271 In base 11, what is 168 - 803? -646 In base 6, what is -3504103 + 31? -3504032 In base 14, what is -6bc65 + -3? -6bc68 In base 14, what is -823 + -c? -831 In base 11, what is 17 + -642? -626 In base 6, what is 14405 - -111? 14520 In base 9, what is -232 - 12? -244 In base 10, what is 1510 + -997? 513 In base 6, what is -330145 - -3? -330142 In base 16, what is 7 + 1016? 101d In base 5, what is 3 - 40430? -40422 In base 11, what is -105 + -1809? -1913 In base 15, what is -1 - 38e60? -38e61 In base 9, what is -217 - -105? -112 In base 11, what is 5 + 144666? 144670 In base 4, what is -1032300 - -11? -1032223 In base 9, what is -146846 - 2? -146848 In base 14, what is 8b - -137? 1c4 In base 16, what is 114f - -2? 1151 In base 14, what is 13c + 5d5? 733 In base 16, what is 1fbf - 2? 1fbd In base 8, what is -24770 - 201? -25171 In base 4, what is 112103012 + -22? 112102330 In base 9, what is 245383 - 5? 245377 In base 4, what is -111001 + -32? -111033 In base 15, what is -3 - -3a4? 3a1 In base 14, what is -6c1 - -16? -6a9 In base 7, what is -23663 + -11? -24004 In base 11, what is 274a14 + -4? 274a10 In base 15, what is -15 + -86? -9b In base 5, what is 1402141 - 10? 1402131 In base 4, what is 0 - -101133302? 101133302 In base 8, what is -22741327 + 1? -22741326 In base 13, what is -1c595 + 6? -1c58c In base 7, what is 2 + -11255? -11253 In base 8, what is 15773 + 333? 16326 In base 11, what is -615 - -a2? -523 In base 9, what is 475 - -2333? 2818 In base 10, what is -48075 + 3? -48072 In base 2, what is 0 - 110111110111001? -110111110111001 In base 7, what is -3320312 + -5? -3320320 In base 8, what is 4 + -1201531? -1201525 In base 5, what is 2421 - -4414? 12340 In base 2, what is -10011 - 1110010011? -1110100110 In base 14, what is -532 - 1c? -550 In base 5, what is 12 - 1424100? -1424033 In base 14, what is -3 + 5500? 54db In base 8, what is 3 - 27024? -27021 In base 6, what is -13 - 4204520? -4204533 In base 14, what is 17 + -1dc8? -1db1 In base 5, what is -3 - -11314310? 11314302 In base 9, what is 288243 - 0? 288243 In base 5, what is -1 - 33221? -33222 In base 5, what is 11 - 302210? -302144 In base 12, what is 1673 + 2? 1675 In base 9, what is -1 - -14451? 14450 In base 12, what is 981 - 57? 926 In base 16, what is -2 + 477? 475 In base 3, what is 1110120 - 21221? 1011122 In base 16, what is 1dd + -560? -383 In base 10, what is 215898 + -4? 215894 In base 5, what is 1321003 + 11? 1321014 In base 5, what is -3 + -340312? -340320 In base 3, what is -11 + -21210102122? -21210102210 In base 5, what is -10 - -1322314? 1322304 In base 16, what is 5 - 8614? -860f In base 8, what is -34 - -43625? 43571 In base 10, what is 6 - -91853? 91859 In base 15, what is a5b27 + 6? a5b2d In base 2, what is -10001 + -1110100100001? -1110100110010 In base 11, what is -33931 + 6? -33926 In base 13, what is -9b - -610? 542 In base 6, what is -101235402 - 4? -101235410 In base 8, what is -10 + 50061? 50051 In base 7, what is -1 + -1155162? -1155163 In base 13, what is -8 - 1416? -1421 In base 7, what is -3035 + 23? -3012 In base 11, what is 40 - -72593? 72623 In base 2, what is 1101100101001110 - -10? 1101100101010000 In base 3, what is -2112201121 + 0? -2112201121 In base 4, what is 2 + 12313210133? 12313210201 In	{ "pile_set_name": "DM Mathematics" }
g for s. 4 Let r(x) = x*2 - 37x + 104. Let o be r(34). Let c = 91 - 86. Solve -l = -cm - 16, -ol + 4 = -4m + l for m. -4 Let d = -2809 - -2811. Solve -t = -3r + dt - 12, 4t = 2r + 10 for r. -3 Suppose -o - 2 + 10 = 0. Suppose 30d = 34d - o. Suppose 7b - 5b - df - 12 = 0, -4f = 4b - 8. Solve 0 = -4q - 4v - 4, -2q - 7 = -bv + 13 for q. -4 Suppose 3y = 2l + 10, -10y + 2l = -15y + 22. Solve 4a = -2r - 7 + 11, a = -yr - 13 for r. -4 Suppose -4l = -l - 15. Suppose 4x + 2o + o - 23 = 0, 0 = 5x - lo + 15. Suppose -35f - 594 = -89f. Solve 10 = 5p, f = 3m + xp - 8 for m. 5 Let t = -7895 - -7902. Solve a + 2s - t = 0, -2a + 5s + 27 - 22 = 0 for a. 5 Let y = -639 + 655. Solve g - 15w + 12w - 7 = 0, -5g - y = 2w for g. -2 Let a = 1972 - 1970. Suppose 4u + 5t = -3, 3u + 4t = -u. Let c(o) = o3 - 2o*2 - 2o - 1. Let v be c(u). Solve -5m + vk + 7 = -ak, 5m = k - 2 for m. -1 Suppose -146b - 58b + 1428 = 0. Solve -40p + 2 = -38p + 4k, -3p - k - b = 0 for p. -3 Let f be 30/20 - (-9)/(-6). Suppose 7b - 9b = 4a - 16, f = -3b + a + 10. Solve -4u = bs - 24, 2u = -5s + 4s + 8 for u. 2 Suppose -z - 5 = -2z. Suppose 1341 = m - p, -p - 3031 + 351 = -2m. Let h = m + -1318. Solve -zl + 3l + 5 = -5b, 2b = -3l - h for b. -3 Suppose -16414l = -16459l + 97 + 38. Solve -5 = -9t + 14t + 5y, 3t + 3 = ly for t. -1 Let s = 65 + -55. Suppose 3w - s = -o, 5o + 0o + w = 36. Suppose -od - 20 = -48. Solve 3t - 3f - 6 = -3, df + 8 = 3t for t. -4 Let b = -4007 + 4011. Solve -24 = -4g - 2u, 4g - bu = -4 + 28 for g. 6 Let i = 51 - 40. Suppose -2x = -i + 1, -2g = -5x + 21. Suppose 0 = 18z - 21z + 6. Solve -zo - 4v = g, -4 = 4o - 3v + 7v for o. -1 Let s be 0(-9 - (-342)/36). Solve z + 1 = 3c, 5c + z + sz = 15 for c. 2 Let z be (3 + -2)(2 + 6). Suppose h + 87 = 5j - 2h, 0 = -2h - 8. Let l = -6 - -11. Solve 4q + z = 4f + 36, -5q - lf = j for q. 2 Let t(a) = -a2 - 11a - 16. Let z be t(-8). Solve -3b + 5v = -z - 7, -5b + 25 = 4v for b. 5 Suppose 0 = j + 2z + 1, -175z + 170z + 5 = 5j. Let k(b) = -b. Let x be k(-3). Solve -g - xp - 16 = 0, p = 4g - jg - 4 for g. -1 Suppose 2v = -15v + 51. Suppose -9k + 13k + 6 = d, 0 = vd + 2k - 4. Let x = 20 - 15. Solve -xi = -0g - 5g + 35, di - 3g = -19 for i. -2 Let j be (3 - 3)/21 - -1. Let o = 6 - 1. Let h = o + -3. Solve hq + j = p, -4 = 2p + q + 4 for p. -3 Let k be 240/10 - 7 - (6 + 2). Solve -4z + ki = 11i + 2, 3z = 3i - 15 for z. -2 Let f(h) be the second derivative of -h*4/2 + 25h*3/3 - 8h*2 + 96h. Let y be f(8). Solve y = -4l - 4s + 12 - 28, -10 = 2l + 4s for l. -3 Let o = 3 - 0. Suppose -27j + 863 = -2107. Let l = j - 108. Solve -ok - 3y + 3 = -ly, 4y + 3 = 3k for k. 1 Let k be 89/36 - (-1 + -4). Suppose -o - k - 1 = -3b, o - 8 = -5b. Let c = -18 + 38. Solve bm - 2i - 18 = -3m, 2m - 4i = c for m. 2 Let b(t) = 2t3 + 4t*2 - 10t + 12. Let g be b(2). Suppose g = -169u + 175u. Solve -18 = 2l - l - 5y, 4l - y = u for l. 2 Let o(g) = -100g - 2360. Let l be o(-24). Solve -3k = -6k - 2s + 7, 5s + l = 4k for k. 5 Suppose -48w + 6 = 6. Suppose w = 5u - 114 + 94. Let f be (-15)/(-9) + (-2)/(-6). Solve fg + 6 = 2o, 0 = 3g + 2g + uo + 24 for g. -4 Let t(z) = -1912z + 5739. Let v be t(3). Solve -9 - 2 = vx - 2n, -4x - 3 = -5n for x. -7 Let l be 780/(-104)8/(-6). Solve 5c = -k + 3k - l, 0 = -3c - k + 5 for c. 0 Suppose 3562 = -19v - 7v. Let f = v + 141. Solve fx + 10 = -4z - 14, -2z - 3x - 16 = 0 for z. -2 Suppose 133j = -141j + 257j + 102. Solve 5n - 13 = -3p, n + 9p = jp + 5 for n. 2 Suppose 176 = 14n + 8n. Suppose 0 = np - 40. Solve -pj = 2w + 3w, -3w - 7 = -4j for w. -1 Suppose 80b = h + 82b - 6, -2b - 18 = -5h. Let k be 1/(2/12-1). Let c be (2 - h)k/3. Solve -5z - 3s = 2, -cs + 1 = 4z + s for z. -1 Let d be ((-117)/780)/(7 - (-705)/(-100)). Solve g = 6, 0g = -i + dg - 13 for i. 5 Let r(f) = 21f + 128. Let l be r(-6). Let x be 6 + 2 - l - 2. Solve -2w - 4p - x = -0w, 2w - p - 11 = 0 for w. 4 Let l be -2 - ((-5)/2 + (-846)/188). Solve 45r + 4 = 47r + 5g, r = -lg + 7 for r. -3 Let j(r) = -2r*3 + 25r*2 + 13r. Let v be j(13). Suppose -u = -2, 13t - 16t - 2u + 4 = v. Solve -4d = -3i - 10 - 7, -3i + d - 11 = t for i. -3 Suppose 63x - 445 = -130. Solve 3l = -5p - 11, xl + 4p - 6p = 23 for l. 3 Suppose w + 46 = -2. Let j be (-42)/(-9) - 16/w. Solve 2 - 8 = 2l, -g = -jl - 12 for g. -3 Let s = 28714 + -28703. Solve 15 = h - 5q + s, 4 = h - 2q for h. 4 Let w be (-1854)/(-270) + (-2)/(-15). Let j be 0 + w/2 + 65/(-130). Solve 5a - 4f + 1 = 0, jf - 2f = 4a - 8 for a. 3 Let t be 82/630. Suppose -77s = -ts + 81. Suppose 6n = s - 3. Solve 4k + 2 = 2y + 2k, 0 = 2y + nk - 8 for y. 2 Suppose -2q - 6 = a, -4q - 15 = -3a + q. Let w = 278 + -273. Solve -20 = 5p + 5i, a = -i + wi + 12 for p. -1 Suppose 3h - 4 = n - 27, 2h - 38 = -2n. Suppose -w + 2 = 2g - 3w, 4g - n = -4w. Solve 0l + 12 = -gl + 3y, 10 = 5y for l. -2 Suppose -24f + 64 + 32 = 0. Solve -5h + fs + 25 = 0, -4s - 62 + 39 = -3h for h. 1 Let s(q) = q. Let o(n) = 5n - 11. Suppose 7l - 23 = 30l. Let v(j) = lo(j) + s(j). Let w be v(1). Solve 0 = 5c - 2x - 11, 0 = 5c - 4x - w - 10 for c. 1 Let f(y) = 3y2 + y3 + 8y2 + 25 - 20y - 8y2 + 6y*2. Let d be f(-11). Solve 4v = 3q - d, 6 = 3q - 3v - 2v for q. -3 Let n = 6115 - 6113. Solve nl - 5k + 24 = 0, -4l - 4k = -0k - 8 for l. -2 Let f(n) = -13n - 138. Let w be f(-11). Let l(a) = -a*2 - 35a + 202. Let i be l(w). Solve -u - u - 2x + 4 = 0, iu + 4x - 2 = 0 for u. 3 Let o(i) = -3i*2 - 2i - 7. Let s(d) = -d - 1. Let w(l) = -o(l) + 4s(l). Let m be w(1). Let z = m - 2. Solve 17 = -3k + z, -5k = -5p + 5 for p. -4 Suppose -u - 54 = 3y - 55, -u = -y - 9. Solve 5d - 3s = -2s - 14, -d - 4s - u = 0 for d. -3 Let o be 19 + 1/1 + -1. Let l be (4/(-60))/(22/(-330)). Solve r - l = 4, o = -w + 4r for w. 1 Let z(q) = -q - 6q + 0 + 1. Let w be z(-1). Suppose -4l = w - 28. Solve 0j - 3j - 5u + 4 = 0, lj + 3u + 4 = 0 for j. -2 Suppose 7b - 125 = -104. Suppose 0 = 4z + 2j - 14, bz - 34 = 4j - 7. Solve -zr = 15, 5r + 2 = 2k - 7 for k. -3 Let d = 8218 - 8214. Solve 3q = 4f - 5, 0 = 3q - 4q + df - 7 for q. 1 Let z(x) = 5x2 + 49x + 258. Let d be z(-6). Suppose 463 - d = 11v. Solve v = -5h + l, 5h - 3h + 22 = 3l for h. -5 Suppose 2c - 2 = -2j, 2j = -5c + 19 - 8. Let v be (-14 + 13)/(1/(-3)). Solve ch + 3w = -0h - 24, vw = -15 for h. -3 Suppose 8 = 2h, 4c - h - 1 - 7 = 0. Solve 3k = -3s + 18, 2s - 3k + c = -2k for s. 1 Let d(h) = h*2 + 51h. Let g be d(-51). Solve 3w + m + 5 = g, w + 21 = -5m + 38 for w. -3 Suppose 4a + 0a - 64 = 4l, 2l - 5a + 26 = 0. Let f be -1 - 1 - -2 - 22. Let d = l - f. Solve 4t - 2t = -dk - 26, -k = 5t + 29 for t. -5 Suppose 55m - 3 = 56m, -2m + 4 = 2s. Suppose -sz + 20 = 3v - 7v, 2z - 2v = 10. Solve 15 = -3t - 2p - 2p, z = -5p for t. -5 Let c(d) = 7 - 9525d + 9525d - d*2. Let r be c(-2). Suppose 5o - 30 = k, -4o + 3k - 6 = -5o. Solve -on - 3m = -3n + r, -n = 4m + 13 for n. 3 Suppose 1282p = 1325p. Solve -4l = 4m + m, -2m = p for l. 0 Let t(h) = h*3 + 10h*2 - 14h + 7. Let c be t(0). Solve -9 = 2q + 3u, cq - 34 = 4q + 5u for q. 3 Let m be (-13)/(-52)-81. Let h(f) be the second derivative of f4/3 + f3 + f2/2 - f. Let g be h(m). Solve -gy = 3z - 4, -8 = z + 4z + y for z. -2 Let b = 77 + -71. Suppose bg + 0g = 30. Solve -3a + 3 = -gs - 14, 5s - 7 = -3a for s. -1 Let k be -10(13/65)/((-2)/4). Solve 0 = kx + 3c + 1, -3x - 32 = -0x - 4c for x. -4 Let t(k) = -157k - 468. Let d be t(-3). Solve n + 4u - 8 = 0, -u + 6 = -dn + 2u for n. 0 Suppose 0 = q - 3q + 10. Let p = -22 + 39. Suppose -3d = -4d - 21d + 110. Solve -z - qf = -0f - p, -df + 23 = -z for z. -3 Let v(y) = -y2 - 21y - 108. Let s be v(-9). Suppose s = 4b + 748 - 804. Solve -6z + 3z = -5q - 10, -3z + b = -q for q. 1 Let b = 108 + -110. Let d be 105/25 - b/(-10). Solve dy - 12 = -4a, -4a - 4y = y - 14 for a. 1 Suppose -693 = 9d - 720. Solve -14	{ "pile_set_name": "DM Mathematics" }
emainder when 1112 is divided by 36. 32 Calculate the remainder when 1768 is divided by 387. 220 Calculate the remainder when 74 is divided by 61. 13 Calculate the remainder when 7386 is divided by 493. 484 What is the remainder when 131 is divided by 66? 65 What is the remainder when 490 is divided by 41? 39 Calculate the remainder when 5 is divided by 3. 2 Calculate the remainder when 2087 is divided by 173. 11 Calculate the remainder when 3725 is divided by 69. 68 Calculate the remainder when 82 is divided by 57. 25 What is the remainder when 667 is divided by 19? 2 Calculate the remainder when 609 is divided by 68. 65 Calculate the remainder when 1193 is divided by 46. 43 What is the remainder when 3799 is divided by 25? 24 Calculate the remainder when 142 is divided by 31. 18 Calculate the remainder when 446 is divided by 414. 32 What is the remainder when 507 is divided by 85? 82 What is the remainder when 72 is divided by 33? 6 Calculate the remainder when 2833 is divided by 4. 1 What is the remainder when 633 is divided by 168? 129 Calculate the remainder when 245 is divided by 23. 15 Calculate the remainder when 1422 is divided by 15. 12 Calculate the remainder when 203 is divided by 41. 39 Calculate the remainder when 1295 is divided by 108. 107 Calculate the remainder when 1972 is divided by 41. 4 Calculate the remainder when 484 is divided by 470. 14 Calculate the remainder when 76 is divided by 50. 26 What is the remainder when 2041 is divided by 31? 26 What is the remainder when 72 is divided by 14? 2 What is the remainder when 881 is divided by 9? 8 What is the remainder when 180 is divided by 91? 89 Calculate the remainder when 7679 is divided by 160. 159 What is the remainder when 87 is divided by 48? 39 Calculate the remainder when 444 is divided by 427. 17 Calculate the remainder when 5994 is divided by 315. 9 Calculate the remainder when 577 is divided by 172. 61 What is the remainder when 18 is divided by 10? 8 What is the remainder when 3365 is divided by 41? 3 What is the remainder when 799 is divided by 7? 1 What is the remainder when 65 is divided by 18? 11 What is the remainder when 920 is divided by 107? 64 Calculate the remainder when 431 is divided by 8. 7 What is the remainder when 157 is divided by 55? 47 Calculate the remainder when 119 is divided by 28. 7 Calculate the remainder when 63 is divided by 4. 3 Calculate the remainder when 394 is divided by 131. 1 What is the remainder when 307 is divided by 24? 19 Calculate the remainder when 124 is divided by 50. 24 What is the remainder when 103 is divided by 26? 25 Calculate the remainder when 242 is divided by 28. 18 What is the remainder when 43 is divided by 27? 16 What is the remainder when 119 is divided by 100? 19 What is the remainder when 120 is divided by 42? 36 What is the remainder when 89 is divided by 5? 4 Calculate the remainder when 12849 is divided by 42. 39 What is the remainder when 239 is divided by 27? 23 What is the remainder when 145 is divided by 14? 5 What is the remainder when 8535 is divided by 44? 43 What is the remainder when 978 is divided by 49? 47 What is the remainder when 1439 is divided by 34? 11 What is the remainder when 66 is divided by 17? 15 Calculate the remainder when 625 is divided by 20. 5 What is the remainder when 115 is divided by 24? 19 Calculate the remainder when 203 is divided by 44. 27 Calculate the remainder when 129 is divided by 39. 12 Calculate the remainder when 22218 is divided by 27. 24 Calculate the remainder when 81 is divided by 33. 15 Calculate the remainder when 91 is divided by 37. 17 Calculate the remainder when 171 is divided by 90. 81 What is the remainder when 606 is divided by 303? 0 What is the remainder when 138 is divided by 24? 18 What is the remainder when 1263 is divided by 158? 157 Calculate the remainder when 3068 is divided by 9. 8 What is the remainder when 126 is divided by 49? 28 What is the remainder when 956 is divided by 150? 56 Calculate the remainder when 83 is divided by 43. 40 Calculate the remainder when 66 is divided by 51. 15 What is the remainder when 130 is divided by 70? 60 Calculate the remainder when 537 is divided by 18. 15 Calculate the remainder when 27 is divided by 10. 7 Calculate the remainder when 655 is divided by 340. 315 What is the remainder when 1445 is divided by 119? 17 Calculate the remainder when 250 is divided by 57. 22 What is the remainder when 446 is divided by 25? 21 What is the remainder when 1027 is divided by 135? 82 What is the remainder when 184 is divided by 74? 36 Calculate the remainder when 64 is divided by 26. 12 Calculate the remainder when 110 is divided by 19. 15 Calculate the remainder when 1220 is divided by 244. 0 What is the remainder when 228 is divided by 42? 18 What is the remainder when 454 is divided by 35? 34 Calculate the remainder when 159 is divided by 49. 12 What is the remainder when 2889 is divided by 79? 45 Calculate the remainder when 38 is divided by 12. 2 What is the remainder when 108 is divided by 57? 51 What is the remainder when 205 is divided by 30? 25 What is the remainder when 1843 is divided by 168? 163 Calculate the remainder when 2922 is divided by 17. 15 What is the remainder when 1198 is divided by 135? 118 What is the remainder when 752 is divided by 248? 8 Calculate the remainder when 962 is divided by 19. 12 Calculate the remainder when 73 is divided by 27. 19 What is the remainder when 384 is divided by 95? 4 What is the remainder when 354 is divided by 24? 18 What is the remainder when 173 is divided by 87? 86 What is the remainder when 1563 is divided by 92? 91 Calculate the remainder when 675 is divided by 98. 87 What is the remainder when 154 is divided by 27? 19 What is the remainder when 36670 is divided by 169? 166 What is the remainder when 88 is divided by 18? 16 Calculate the remainder when 12391 is divided by 3096. 7 Calculate the remainder when 129 is divided by 6. 3 Calculate the remainder when 409 is divided by 405. 4 What is the remainder when 1500 is divided by 101? 86 What is the remainder when 77 is divided by 58? 19 What is the remainder when 2009 is divided by 168? 161 Calculate the remainder when 14 is divided by 3. 2 What is the remainder when 515 is divided by 110? 75 Calculate the remainder when 1308 is divided by 69. 66 Calculate the remainder when 4188 is divided by 321. 15 What is the remainder when 10580 is divided by 18? 14 What is the remainder when 7481 is divided by 2? 1 Calculate the remainder when 1219 is divided by 135. 4 Calculate the remainder when 269 is divided by 121. 27 Calculate the remainder when 1301 is divided by 219. 206 Calculate the remainder when 2199 is divided by 71. 69 What is the remainder when 504 is divided by 20? 4 Calculate the remainder when 52 is divided by 30. 22 Calculate the remainder when 331 is divided by 37. 35 What is the remainder when 3425 is divided by 1134? 23 Calculate the remainder when 44 is divided by 12. 8 Calculate the remainder when 383 is divided by 334. 49 Calculate the remainder when 29018 is divided by 6. 2 Calculate the remainder when 111 is divided by 25. 11 Calculate the remainder when 621 is divided by 25. 21 What is the remainder when 338 is divided by 100? 38 Calculate the remainder when 798 is divided by 776. 22 What is the remainder when 38373 is divided by 156? 153 What is the remainder when 3479 is divided by 579? 5 Calculate the remainder when 151 is divided by 23. 13 Calculate the remainder when 539 is divided by 63. 35 Calculate the remainder when 642 is divided by 82. 68 What is the remainder when 2745 is divided by 145? 135 What is the remainder when 6337 is divided by 6? 1 Calculate the remainder when 1720 is divided by 46. 18 Calculate the remainder when 113 is divided by 23. 21 Calculate the remainder when 742 is divided by 62. 60 Calculate the remainder when 2913 is divided by 20. 13 Calculate the remainder when 578 is divided by 73. 67 Calculate the remainder when 880 is divided by 49. 47 Calculate the remainder when 294 is divided by 61. 50 What is the remainder when 272 is divided by 90? 2 Calculate the remainder when 453 is divided by 57. 54 Calculate the remainder when 3601 is divided by 68.	{ "pile_set_name": "DM Mathematics" }
a) -1 (b) t (c) p b Let w = -2843/8502 + 3/2834. What is the nearest to 1 in -2/9, w, -2, 18? -2/9 Let s = -2 + 1. Let w = -6 - s. Let v be 1332/1110 - (2 + (-8 - -8)). Which is the closest to v? (a) w (b) 2/7 (c) -1/2 c Let h = 429/4 - 107. Let z be (22/44)/(1/3). Let c = -17/20 - -3/5. What is the nearest to c in h, z, 0.08? 0.08 Let d = 38 + -37.9. Let l = -2.94 + -0.06. Let s be 12 - -3145/(-35). Which is the nearest to d? (a) l (b) s (c) 9 b Suppose 4v - 3z - 59 = 0, -3z + 12 = v + 1. Let k = v + -8. Suppose 3u + k = 21. What is the nearest to 1 in -1/4, u, -1? -1/4 Suppose -5i + 22 - 12 = q, 5q - 2i - 23 = 0. Which is the closest to 9/4? (a) 1/5 (b) 0 (c) 1/6 (d) q a Let s = 23.6 - 6.6. Let y = s - 16. Which is the closest to y? (a) -2 (b) -9 (c) 5 a Let y = -783/8 - -98. Let w = -9 + 9.69. Let r = 1.09 - w. What is the nearest to y in r, 0.2, 3? 0.2 Suppose 43 + 94 = -76q - 15. Which is the nearest to -1/4? (a) q (b) -2/17 (c) -1/3 (d) -310 c Let w = 14.92 - 15.3. Let p be 25/(-18)2 + 3. Which is the nearest to p? (a) w (b) -1/5 (c) -3/4 b Let h = -10.861 + 10.561. Which is the nearest to -25? (a) -7 (b) 12 (c) h a Let r = -77 - -76.76. Let j = r + -0.06. Which is the nearest to -5? (a) j (b) -1/3 (c) 1 b Let i = 201 + -202. Let c = 320 - 318. Let j = 4.7 + -5. What is the closest to 2 in i, j, c? c Let k = -7.3 - -6.648. Let n = k - -0.352. Which is the nearest to 3? (a) n (b) 0.2 (c) 5 c Let i = 33 + -33. What is the closest to 2 in i, 1.4, -0.4? 1.4 Let c = 7977 + -247289/31. What is the nearest to 0 in -14/3, 6/7, c, -0.5? c Let y = 0.06 - 0.06. Let m be ((-28)/168)/(7/18). Which is the closest to y? (a) -8 (b) m (c) 3 b Let o = -12470 + 12485. What is the closest to 0.3 in -1, -4/7, o, 1? 1 Let g = -6039/21112 + 1/3016. Which is the nearest to g? (a) -13 (b) -0.5 (c) 5 b Let w = 13003 + -13003.1. Let h be ((-2)/16)/(2/12). Which is the closest to w? (a) h (b) 4 (c) -2 a Let p = -15678 - -15674. Which is the closest to -1/2? (a) 1 (b) -0.111 (c) p b Let m be 12 - (122/(-25))/(258/(-645)). Let c be -1 - 2/((-36)/14). What is the closest to m in -0.3, 0.5, c, -1/9? c Let u(z) = 22z2 - 4z - 4. Let p be u(2). Suppose -p = 16q + 3q. What is the nearest to 0.11 in -5, q, 0.1? 0.1 Let k = 6.754 - 36.254. Which is the closest to 1/6? (a) 0.5 (b) -1 (c) k a Let t = 10.1 - 9. Let n = -1.4654 - -1.353. Let d = 5.1124 + n. Which is the nearest to t? (a) -1 (b) -3 (c) d a Let w = 221 - 65. Let g = -187.5 + w. Let d = g + 32. Which is the closest to 1? (a) d (b) 0 (c) 6/11 c Let w = -7401 - -7405. Which is the closest to -1/10? (a) -3 (b) 1/6 (c) w (d) 0.2 b Let z = 69 - 70. Let s be 0/4 + (z - 3). Let n = 12 - 11. Which is the closest to n? (a) -2 (b) s (c) -10 a Let z = -49 - -48.6. Let n = 4.7 + -0.7. Let f = -8550 + 8549. Which is the closest to f? (a) z (b) n (c) -1 c Let b = -0.5 + 0.422. Let i = b + -0.072. Let k = -0.65 - i. What is the nearest to 7 in -2/25, k, 4? 4 Let i = -11.4 - -11.7. Let k be -137 + 143 - ((-126)/(-16) + -2). Which is the nearest to i? (a) k (b) -5 (c) 6 (d) 5 a Let l = -0.13 - -0.07. Let u = -0.46 - l. Let y = -0.150019 - -3.150019. What is the nearest to 0.1 in y, 2/3, u? u Let k be (-2)/4(-274)/685. What is the closest to 0 in 69, -0.1, k, -1/4? -0.1 Let c be (-2)/(-4) - (-22)/(-28). Suppose o - 8 = -7o. Let m be (o + 1)(-1)/6. What is the nearest to c in 5, m, -3? m Suppose -7d + 2288 = -5d. Let w be (50/d)/((-12)/(-24)). Let y = w + -7/26. What is the nearest to -1 in 4, y, -0.03? y Let g = -34287.4 - -34287. Let v = 0.1 + -73.1. What is the nearest to 0.1 in g, 0.3, v? 0.3 Let g be (18 + 7974/(-441))-7. Let j = -0.3 + 0.3. What is the nearest to j in -13, g, -0.5? -0.5 Let k = -0.344 - -1.344. Let o be (-39)/(-78) - (2 + -8)/(-3). Let l be 2((-2)/12)/1. What is the nearest to 2 in k, o, l? k Let f = -41254 - -41259. Which is the nearest to 12? (a) 0 (b) f (c) 4.1 (d) 0.4 b Suppose -18 = 4f + 4w + 2, 5f - 4w = -34. Let t be (4 - (-35)/(-10))4/f. Let u = 5.1 - 0.1. What is the closest to -0.2 in -1, u, t? t Let k = -6.1 + 1.1. Suppose 0 = -341z + 2z + 59 + 280. Which is the closest to 0? (a) 0.1 (b) k (c) z a Let p = -316 + 316.0522. Let z = p + -0.1522. Which is the closest to z? (a) 0.5 (b) 2/5 (c) -0.06 (d) -0.01 c Let j = 972.76 - -18.24. Let s = j - 1031.9. Let d = s + 41. Which is the closest to 1/2? (a) 2 (b) 5 (c) d c Suppose 93 = 24n - 219. Let i be (-6 - 46)/n - (-26)/7. Let h = 4 + -9/2. What is the closest to 1 in 1/7, h, i? 1/7 Let y be ((-3)/2)/(138/92). Let h be 5(-2)/18 + (22 - 21). Let w = 3 + -4. Which is the closest to y? (a) w (b) -1/5 (c) h a Let w = 103 - 30. Let b = 70 - w. What is the nearest to 0 in 0.07, b, -0.4? 0.07 Let x be 1 - (357/(-14))/(-17) - (-28)/24. What is the nearest to -1 in x, -3, -4, 61? x Let d = 58 + -59. Let l = d + 0.8. Let z be (-12)/93/9. Which is the nearest to -0.1? (a) l (b) 1/7 (c) z a Let d = 27 - 20. Let y be (18/108)/(d/6). Let n(k) = -k2 - 8k - 15. Let s be n(-5). Which is the closest to s? (a) -0.2 (b) -15 (c) y c Suppose 5k + 18 = 9k + 2g, 3k = 3g + 9. Which is the closest to k? (a) 3 (b) -3/7 (c) 0.1 a Let z = -3.2318 - -3.4318. What is the closest to -3 in z, -4, -9, 2? -4 Let s = -5354 - -1290312/241. Let k = 1679/964 - s. Let g be (1/2)/((-6)/3). Which is the closest to g? (a) k (b) -2 (c) -3/5 c Let t = -0.26 - -0.352. Let u = t - 0.092. What is the closest to u in 4, 2/17, 0.1? 0.1 Let z = -48 - -54. Let x be (z/10)/3 + 41/1845. Let j = 2.8 + -3. Which is the closest to j? (a) -2/19 (b) -1/2 (c) x a Let h = -315.0774 - -0.0774. Let u = h + 318. Let n be ((-2)/(-12))/(35/20). What is the closest to n in u, 2, -1/2? -1/2 Let x be (9 + (-132)/15)(-1 - 0/(-2)). What is the closest to -2/3 in x, -3, 3/4? x Suppose -2v + 7 = -3h, 1276v + h + 17 = 1273v. What is the closest to 1 in 2/5, 0.13, v, 0.3? 2/5 Let o = 54.922 - 55. Let u = 37.922 - o. Let z = u + -39. What is the nearest to 2 in -1/8, -2/7, z? -1/8 Let w be (0 - (-37)/44) + (-528)/704. Which is the nearest to 92/3? (a) 0.5 (b) w (c) 0.4 (d) -5 a Let j = -1.424 + 0.424. Which is the nearest to 49? (a) j (b) -4/7 (c) 3 (d) -4 c Let h = 0.58 + -0.3. Let f = -106.72 - -107. Let g = h - f. Which is the closest to g? (a) -2 (b) -4 (c) 0.1 c Let i = -304.5 - -21.5. Let n = 283.2 + i. What is the closest to n in 0.6, 4, 0.2? 0.2 Let p = 804 + -804.122. Let l = 0.222 + p. Let y = 112/3 + -1226/33. Which is the closest to 0.1? (a) -11 (b) y (c) l c Let s be (2 - 11)((-8)/162)/((-364)/(-546)). Let q be (6/(-14))/(0 + -1). Let g = -0.03 + 3.03. What is the closest to 0.2 in g, q, s? q Let y = 1.06596 - 0.06596. What is the closest to 1/2 in y, -0.4, 1/23, 2/7? 2/7 Let m = -1 + 1.5. Let y = -1.8 - -2. Let u = 7751.7 + -7751.9. What is the nearest to u in y, 5/4, m? y Let l = -10 - -9. Let z = 1.0046 - 0.0046. Which is the nearest to -1.9? (a) z (b) 3 (c) l c Let q = 9.0035 + -9.2035. Let d = 7 + -10. Which is the nearest to -32? (a) d (b) -2/13 (c) q a Let q be (96/(-7))/(82/287). Which is the closest to 1/4? (a) -1/4 (b) q (c) 0.5 c Let n = -1.86 + 1.89. Let h = -35790/23 - -1556. What is the nearest to -0.05 in n, -0.5, h? h Let z = 1 + 1. Let n = -527989 - -527989. Which is the closest to n? (a) z (b) 91 (c) 1/5 c Let l = -5.536 + 462.536. What is the nearest to l in -2/19, -5, -0.3? -2/19 Let s(g) be the first derivative of g4/4 + g3 + g2/2 + 3g - 122. Let a be s(-3). What is the closest to -32 in -1/2, a, -3? -3 Let w = 3858 + -50152/13. Let d = -0.02 - -1.02. Let l be (2 + 6/(-2))*-1. Which is the closest to l? (a) w (b) 0.4 (c) d c Let f = 13540 - 13538. Which is the nearest to -1606? (a) 0.1 (b) f (c) -1/10 c Let t = -3777.1 + 3777. Which is the closest to 1? (a) -0.5 (b) 39 (c) t c Let f = 0.10832 + -0.20832. Which is the closest to 118.7? (a) 5 (b) -3 (c) f a Let n = 6.1 + -7.4. Let v = n - 2.7. Which is the closest to -47? (a) v (b) -2/9 (c) 3 a Let r = -2.54 - 54.46. Let u = r + 57.4. Which is the closest to 2? (a) u (b) -2/9 (c) 2/9 a Let y = -4302/14077 - -40/2011. What is the nearest to y in -7, 3	{ "pile_set_name": "DM Mathematics" }
= 25z + 8z. Round z to the nearest 100000. -2500000 Let x = 11279648 + -4141648. Round x to the nearest 100000. 7100000 Let d = 3288 + -3278.51. What is d rounded to 0 dps? 9 Let m be (-1)/(-9) + (-1222433088)/(-108). Let q = -60005000 - -34886175. Let y = q + m. What is y rounded to the nearest one million? -14000000 Let f = -21.09 + 9.14. What is f rounded to zero decimal places? -12 Suppose -14x = -11x + 48. Let g(m) = 1037499m - 16. Let v be g(x). What is v rounded to the nearest one million? -17000000 Let o = -12640.853710412 + 12637.25371. Let a = 3.6 + o. Round a to 7 decimal places. -0.0000004 Suppose 0j = -12j + 36. Let o be 34695 - (-30)/18j. Round o to the nearest 10000. 30000 Let z be ((-6)/4)/(16/3424). Let h = -631 + z. What is h rounded to the nearest one hundred? -1000 Let q = 235.9431 - -0.0569. Let c = q + -235.9666. Round c to two decimal places. 0.03 Let w = 5952.86291 - 5953. Round w to 2 decimal places. -0.14 Let k(n) = 372444n2 + 2n + 54. Let b be k(-9). What is b rounded to the nearest 100000? 30200000 Let j = -1.584 - -1.5807144. Round j to 4 dps. -0.0033 Let v = -1.82 + 3.24. Let l = v + -2.029. What is l rounded to 2 dps? -0.61 Let t = -285.9322 + 286. Let x = t + -0.067800279. What is x rounded to 7 decimal places? -0.0000003 Let n = 1867.4 + 2057.8. Round n to the nearest one thousand. 4000 Let c = 294.531 + -0.531. Let y = c + -298.63. Round y to zero dps. -5 Let p = -347 - -347.333. Let m = 0.079 + p. Round m to two decimal places. 0.41 Let v = -0.1047 - 8.4253. Let y = v - -8.528192. Round y to 3 decimal places. -0.002 Let o = 80990421.25001126 - 80990422. Let n = o - -0.75. Round n to 6 decimal places. 0.000011 Let o = -214.7 - -39.7. Let h = -276 - o. Let l = 100.43 + h. Round l to one decimal place. -0.6 Let i = 2.4074246 - 2.4054. Round i to five decimal places. 0.00202 Let r(c) = 2c - 40. Let k be r(20). Suppose k = -3q + 7q + 4. Let i(b) = -420b3 - b2 - b. Let f be i(q). What is f rounded to the nearest 100? 400 Suppose 43a - 41a - 678000 = 0. Suppose 0 = -47l + 50l - a. Round l to the nearest 10000. 110000 Let a = 26760.000063014 - 26760. Round a to six dps. 0.000063 Let m(z) = -5z - 60. Let i be m(-12). Suppose i = -3o + 2f + 1389, 8f = 12f. What is o rounded to the nearest 100? 500 Let o = 3.504 - -2161.496. Let x = 2145.54 - o. Let s = x + 21.8. Round s to the nearest integer. 2 Let r = -4938.5 + 4938.533383. What is r rounded to three decimal places? 0.033 Let s = 2171.8007 - 2162.33. Round s to one dp. 9.5 Let d = -6787.22 - -6890. What is d rounded to 0 decimal places? 103 Let f = -0.222 - -4111.222. Let j = -3562.4 + f. Let o = -637 + j. What is o rounded to the nearest ten? -90 Let x be (16 - 159/10)-4 + (-2202448)/5. Round x to the nearest one thousand. -440000 Let o = 10341548 - 5968548. What is o rounded to the nearest one hundred thousand? 4400000 Let n = 6492.92 + -6671. Round n to 0 dps. -178 Suppose -116b = 96868776 - 529745976. Round b to the nearest ten thousand. 3730000 Let r = 14639.8 + -15386.91. Round r to the nearest 100. -700 Let n = -38 - -37. Let k = n - 3.2. Let l = -4.19999975 - k. What is l rounded to 7 decimal places? 0.0000003 Let y = 8605.999999251 - 8606. What is y rounded to 7 dps? -0.0000007 Let k = 526.1 - 526.102353. Round k to 4 dps. -0.0024 Let c = 316 - 300.4. Let f = 14.805 - c. Round f to one decimal place. -0.8 Suppose -1201l - 2158480 = -1205l. Round l to the nearest 100000. 500000 Let u(d) = -5d + 11. Let z be u(0). Suppose -90 = -zq + 2q. Suppose -qo = o - 616000. What is o rounded to the nearest 10000? 60000 Let g(s) = -s3 - 4s*2 + 6s + 4. Suppose -31 + 6 = 5x. Let j be g(x). Let i be (3/6)/(j/8)-3775. Round i to the nearest 1000. 15000 Let c = 298.6 + -13.6. Let l = c - -548. Let k = 833.00349 - l. What is k rounded to 4 decimal places? 0.0035 Let p = 12.2117 - -6157.4883. Round p to the nearest 1000. 6000 Let p(d) = -57d2 - 26d - 255. Let x be p(13). What is x rounded to the nearest 1000? -10000 Let m = 206.1 - 77.1. Let b = -85.4 + m. Round b to 0 decimal places. 44 Let c be 1(-1)/(-1)5. Suppose 5w - 91704778 - 214295207 = -5u, 0 = -cw + 5u + 306000015. What is w rounded to the nearest 1000000? 61000000 Let n be (21333456 + -2)/(2/23). Suppose 3z - 96665279 = n. Suppose 4u + z = -2u. Round u to the nearest one million. -19000000 Suppose -205 = -4l - 1277. Round l to the nearest one hundred. -300 Let z = 2.66144 + -0.11144. What is z rounded to the nearest integer? 3 Let h = 0.0694 - 1.0474. Let w = -91.178 - h. What is w rounded to the nearest integer? -90 Let m = 359.9427 - 0.2427. Let o = 362.623 - m. What is o rounded to one decimal place? 2.9 Let k = -1790462523.79999724 + 1790462575. Let x = -51.2 + k. Round x to six decimal places. 0.000003 Let l = 11.8161 + 0.5339. Round l to 1 decimal place. 12.4 Let o = 103 + -39. Let n = -756.7 + 829. Let t = n - o. Round t to 0 decimal places. 8 Let h = -96.0429 - -96.1. Let n = 0.0569751 - h. What is n rounded to 5 dps? -0.00012 Let n = 0.1868 + -0.180445. What is n rounded to four dps? 0.0064 Let b = -15.2 + -3. Let i = b - -18.20682. Round i to three dps. 0.007 Let g(i) = -171i - 2785. Let p be g(15). Round p to the nearest one thousand. -5000 Let p = 0.0943482 + -802.4413482. Let l = 803 + p. What is l rounded to two decimal places? 0.65 Let l be (-2)/3-21-4465927. Let y = l - 9077022. What is y rounded to the nearest one million? -72000000 Suppose -5j = 35s - 38s + 12, 0 = 2j + 4s - 16. Suppose 0 = -3i - ji - 4t - 1053020, -2t = i + 351010. Round i to the nearest ten thousand. -350000 Let r = -0.0386 + 23.0486. What is r rounded to 0 dps? 23 Let n = -641034 + 30877. Let t = n + -464945. Let p = t + 631102. Round p to the nearest 100000. -400000 Let n = 19.1 + -20.628. Round n to zero dps. -2 Let t = 896063014.09999001 - 896063165.1. Let r = 151 + t. What is r rounded to seven decimal places? -0.00001 Suppose 0 = -12a - 43324338 - 26122985 + 12839723. Round a to the nearest one hundred thousand. -4700000 Let g = 2160.8967470349477 - -0.1032519340523. Let k = g + -2161. What is k rounded to 7 dps? -0.000001 Let j = -0.586 - -70.386. Let u = j + -63. Let l = u + -6.8025. Round l to 3 decimal places. -0.003 Let b = 1269429 - 754433. Suppose b = q + 2c, q + 0c - 514992 = -4c. What is q rounded to the nearest 1000000? 1000000 Let x = 3.01588 + 0.07712. Let a = x - 2.92. Let b = -0.17081 + a. What is b rounded to three decimal places? 0.002 Suppose 0 = -280p + 278p + 28. Suppose 0 = -pi + 2790082 - 13010082. What is i rounded to the nearest one hundred thousand? -700000 Let p(j) = 3j + 6. Let g be p(0). Suppose -3x + 65544119 + 103655881 = 0. Suppose -gv = -4v + x. Round v to the nearest 1000000. -28000000 Let t be (17 + -18)/((2/37969742)/1). Let b = -6340886 - 33643985. Let i = t - b. Round i to the nearest one million. 21000000 Let p = -444.43 + 444.43118147. Round p to 4 decimal places. 0.0012 Let c = -12.02026 + 0.15926. Let l = -10.31 - c. What is l rounded to 2 dps? 1.55 Let r = 33849 + -33849.0091645. What is r rounded to four decimal places? -0.0092 Let x = 291.6 + -291.4754. What is x rounded to 3 dps? 0.125 Suppose -3n = 2j - 3j + 289664, 5n = 2j - 579330. Let u(y) = -178697y - jy - 4 - 806629y - 12. Let z be u(4). Round z to the nearest 1000000. -5000000 Let v(c) = -60484c*2 + 4c - 1. Let o be v(2). Let m be 1/4 + o/36. Let f be 0 + m(-3122 + -3). Round f to the nearest 1000000. 21000000 Let y be (-6)/(-4)48/36 - -4. Suppose -yc + 368200 = -4c. Round c to the nearest ten thousand. 180000 Let b = -11113 - -11114.7903. Round b to 2 dps. 1.79 Let i = -0.344088 - -0.2310271. Let s = i - -21.1134129. Let k = s + -21. Round k to 4 dps. 0.0004 Suppose 21a - 45906613 = 11675387. What is a rounded to the nearest one million? 3000000 Let b = 1090193 + -684978. Suppose -b = 2d + 2499081. Let l = 82148 + d. What is l rounded to the nearest 100000? -1400000 Let y = -0.086 + 798.086. Let d = 797.999998994 - y. Round d to seven decimal places. -0.000001 Let b = -838.6500058261 - -838.65. Round b to six decimal places. -0.000006 Let f = -8768968 - -3208268. What is f rounded to the nearest ten thousand? -5560000 Let a	{ "pile_set_name": "DM Mathematics" }
et p(t) = -t*2 + 0t - 4t3 - 2t - t + 4t + 1. Is p(-1) a prime number? True Let i = -15 - -32. Suppose i = 2a - 29. Suppose 4f - 3x = 93, 0 = 5f - 5x - 143 + a. Is f a prime number? False Suppose -2d = -5p - 2462 - 1916, 8 = 2p. Is d composite? True Let u(j) = -j3 - 14j*2. Let z be u(-14). Suppose 435 = -zf + 3f. Is f a composite number? True Suppose 4q - 5x - 25 = 12, 35 = 5q - 4x. Suppose qj = -j - 4. Is (j + 0)(-17 + -4) a composite number? True Suppose 0 = 3d + d - 36. Suppose 2z = 1 - d. Is (2/z + 1)46 composite? False Let b(m) = 2m - 1 + 2m2 - 5 - m2 + 2. Is b(7) a composite number? False Let a be 0 + 0 + -2 + 2. Suppose a = -r - 2r + 357. Suppose -4t - h + r = 2h, 2h = 5t - 120. Is t prime? False Suppose 0 = -4l - 179 + 2191. Is l a prime number? True Suppose 4a - 5a - 5u = 0, 0 = -5a - 5u. Let n be a/2 - (-8)/(-4). Is ((-8)/16)/(n/40) a prime number? False Let w = 62 - -69. Is w a composite number? False Let v(r) = 6r - 7. Let t be v(4). Let g = -4 + t. Is g composite? False Let n be 3 + -1 + 243/3. Let x = 123 - n. Suppose -x = -c - 5. Is c a composite number? True Let l(t) = -t. Let p be l(-2). Suppose 3y - 2 = 5x - 39, -px + 18 = -2y. Suppose 0u + xu - 265 = 0. Is u a prime number? True Let d = 5 + -3. Suppose 206 = 3u + df, 0 = -3u - f + 144 + 58. Suppose 250 = 5i + v, 2i - 2v - u = 22. Is i composite? True Suppose 0 = 10u - 208 - 2702. Is u composite? True Suppose 5x = x - 16. Let f = 1 + -3. Is (-74)/x + (-1)/f prime? True Suppose 0 = 4k + 4y - 228, 0y = 5k - 2y - 299. Is k a prime number? True Let n be (4/(-2))/((-5)/10). Let x(t) = -5 + 0t - nt + 2t. Is x(-12) a prime number? True Let s(g) = g*3 - 8g*2 + g - 5. Let y be s(8). Suppose yb - 2b = 337. Is b composite? False Let t = -473 + 844. Is t a prime number? False Suppose 2z + 0z = 246. Is z prime? False Let o = -7 + 3. Is 2(-2)/(o/161) composite? True Suppose -s - 2s = 3t - 24, -4t - 8 = -4s. Suppose 3h = ta - 18, -49 = 4h - 5a - 20. Let x(v) = 24v2 + v. Is x(h) a prime number? True Let f be (-9)/(-6)(-16)/(-6). Suppose -2s - f = -0. Is 233 - (-2)/s a composite number? True Let v = -3 - -2. Let y(a) = 55a2 + a + 1. Let s be y(v). Let x = s + -2. Is x a composite number? False Let t(s) = s2 + 2s - 2. Let m be t(-3). Let p(j) = 88j2 + j. Is p(m) composite? False Suppose -2p = -5v + 1979, 4v + 0p = 2p + 1582. Is v composite? False Suppose -940 = -2h - 2p, -2h - 2p = 3h - 2341. Is h a composite number? False Suppose 4c - 36 = 4f, -5f + 0c - 33 = -c. Let k(z) = z2 + z - 1. Let v be k(0). Is (-3)/(f/176) + v prime? False Is -5 + 3 - (0 - 23) composite? True Suppose -3j + 2193 = 156. Is j composite? True Let m(a) = -8a2 + a. Let n be m(1). Let z(p) = -p2 - 14p - 3. Let k be z(n). Let j = 79 - k. Is j composite? True Let q be (-26228)/(-20) - 4/10. Is 2/(-7) + q/7 prime? False Let x(z) = 20z2 - 3z + 11. Is x(-6) a prime number? False Suppose 0 = -3m + 6, u + 2m + 9 = -0u. Let b = 1 - u. Is b composite? True Suppose -5g = -5h + 15, 0 = 5h - 3g - 0g - 23. Let d(j) = 33j + 6. Let p be d(h). Is p/6(-2 - -4) a composite number? False Let g be (-256)/12(2 - -1). Let b = -21 - g. Is b a prime number? True Let t be (0/2)/(-5 + 6). Let c be 4 - t/(2 + -1). Suppose 3s - 4d = 30, 0 = -3s - cd + 6 + 24. Is s composite? True Suppose 0 = -3z + 1577 + 2434. Is z a composite number? True Suppose -y - t - 31 = -6y, 0 = -2y + 5t + 17. Suppose 8 = yz - 2z. Suppose -zj = 4x - 144, -5x + 2x + 115 = -2j. Is x a composite number? False Suppose 0f - 4i + 1188 = 4f, 0 = -f - 3i + 305. Is f a composite number? False Let s(b) = -50b - 3. Let v be s(-2). Suppose -4x + 8 = -0x. Let n = v - x. Is n prime? False Suppose -4o = -4 - 4. Suppose 4h + r - 6 = 2r, h = or - 2. Is (4 - 4/h) + 20 prime? False Let p = 226 + -17. Is p prime? False Suppose -2 = -5x + 4x. Suppose -4v = 2j - 7j + 5, xv + 4j = 4. Suppose -15 = -va - a. Is a composite? True Suppose 17c - 25c = -5064. Is c a composite number? True Suppose -z + 1 = -2. Suppose -l + 5c = -287, -zc + 49 = 4l - 1122. Suppose 0 = -4v + l + 504. Is v a composite number? False Let c(z) be the first derivative of 5z*3/3 + 2z + 3. Is c(3) a prime number? True Let j be -2(0 - (-1)/2). Is 39 - (j + -2 - -5) a composite number? False Let a = 8 + -6. Suppose -t + 13 = -at. Let k = t + 71. Is k a composite number? True Let v = 3 + -42. Let p = v - -92. Is p composite? False Let i = -1 + 3. Let d(c) = 2c2 - c - 2. Let j be d(2). Suppose -5q + 391 = 2v, iv - 311 = -jq + v. Is q a composite number? True Let m = -12 + 18. Is 147 - 1 - (-18)/m a composite number? False Suppose 0 = 6g - 2g. Suppose -4s + 16 = 0, 3s + 70 = 2b - gs. Suppose -5a + b = -3f, -2a + 6 = -5f - 18. Is a composite? False Suppose -2c - 18 = 5a, -a - 4 = -2c + 2. Let v(m) = -2m2 - 15m - 5. Let y(p) = p*2 + 7p + 2. Let s(n) = -2v(n) - 5y(n). Is s(a) a prime number? False Let u = -697 - -1045. Suppose -11p + 5p + u = 0. Is p prime? False Let m(k) = k - 9. Let r be m(9). Suppose 5x - 4f = 457, -2x = -rx + f - 175. Is x composite? False Suppose 3x + c = 4c + 2115, -3x - 2c = -2095. Is x a composite number? False Let n(x) be the third derivative of -x6/120 - x5/60 + x*4/12 - 7x*3/6 + 4x*2. Is n(-5) prime? True Let b be 1 + 13 + 0/2. Let w be ((-6)/(-4))/(3/42). Let a = b + w. Is a composite? True Suppose 10 = 2b, k - 5b + 37 = 13. Suppose 0 = 4i - k - 11. Is (0/i - -51) + 2 a composite number? False Suppose 842 + 337 = 9h. Is h composite? False Is 183/2 - (-11)/(-22) a composite number? True Let i be (-2)/9 + (-261)/(-81). Suppose 607 = 5s - 3f, -s - 2s - if = -345. Is s prime? False Suppose -5s - 32 = -12. Let v(l) = 3 + 26l - 89l - 4. Is v(s) a prime number? True Let l(p) = p*2 - 4p - 4. Let v be l(6). Let b = 8 - v. Suppose 5a = -ba + 35. Is a a prime number? True Let p(f) = -4f + 69. Is p(0) a prime number? False Let p(n) = 101n*2 - 2n + 4. Is p(3) a composite number? False Let g(y) = y*3 - 4y*2 - 2y + 7. Let d be g(5). Suppose 0 = 2u - 128 + d. Is u composite? False Let l(a) be the first derivative of 25a*2 - 2a - 1. Let x be l(2). Let d = x - 61. Is d a prime number? True Suppose -u + 6u + 415 = 0. Let y = u + 150. Is y a prime number? True Let b(u) = -u3 + 6u*2 - 5u - 3. Let q be b(5). Let w(t) = -71t + 4. Is w(q) a composite number? True Let s be 2/10 + 2502/15. Let x = s + -6. Suppose 2p = 2b + 88, 0 = -4p - 0b + b + x. Is p a prime number? False Suppose 4f - 5 = 3. Suppose -23 - 111 = -fi. Is i a composite number? False Let j(i) = 2i*2 + 18i - 10. Let r be j(-13). Let b = r + 519. Is b prime? True Let v be (-2)/(1 + (-87)/93). Let a = 3 - v. Is a composite? True Let y(n) = 3n2 + 30n + 26. Is y(-21) a composite number? False Is 2/(-8) + 342/24 a prime number? False Suppose -5t = -4t + 248. Let w = -99 - t. Is w prime? True Suppose -5 = -4x - 1. Let t = 176 - x. Suppose -4b - 1 + 17 = 0, 0 = 5g - 5b - t. Is g composite? True Let h(t) = 5t2 - 4t + 2. Let y = 31 + -22. Let c(k) = -k*2 + 8k + 11. Let f be c(y). Is h(f) composite? True Let r(f) = -4f - 5. Let p be r(-3). Suppose 0 = 3o + 82 - 292. Let n = p + o. Is n a composite number? True Let t(k) = k - 3 + 2k + 2k*2 - 4k + 8k. Let o be t(-8). Suppose 0f + o = 3y + 2f, -f = 0. Is y a composite number? False Suppose 0 = 4w + 2x - 1 - 1, -3x - 2 = w. Let b be 3w3/(-9). Is b(0 - 37) a composite number? True Let i = -245 - -168. Let n = i + 128. Is n a prime number? False Let d(p) = 152p - 1. Let i(r) = 153r - 1. Let o(t) = 3d(t) - 2i(t). Is o(1) composite? False Let n(j) = -2j + 1949. Is n(0) composite? False Suppose 6 = 2x - 4. Suppose -xz + 2z = -477. Is z prime? False Suppose 89 = -b - n, b = n - 3n - 88. Let h = 184 + b. Is h a prime number? False Let w be (-3)/12 - 242/(-8). Let c = -12 + w. Let y = c - -19. Is y a composite number? False Let v(y) = y*3 + 4y*2 - 3y - 3. Let a be 0 + -4 + 3 + 5. Is v(a) prime? True Let w = 3 - 1. Suppose -f + 2b = 4b + 7, 20 = 5f - b. Suppose -4q = fc - 182, -q + 57 = -7c + w*c. Is q a composite numbe	{ "pile_set_name": "DM Mathematics" }
+ 1) - 1 - 4 + 6)(v4 + 6v - v*2 + 2v*4 - 5v) to the form tv4 + g + zv*3 + rv + pv2 and give p. -2 Rearrange 12c*3 - 19c*3 - 98c*3 + 2c*2 to the form tc*3 + p + yc + dc2 and give d. 2 Rearrange 700d - 700d + 2012d*2 to the form ud + rd2 + o and give r. 2012 Rearrange (-1 + 6m + 1)(-m + 3 - 3)(-93m + 121 - 121 - 230m) to q + am + om*2 + vm*3 and give v. 1938 Rearrange (5 + 2g + 6g - 6g)(81g - 22g - 35g) - 4g2 + 0g2 + g2 to the form lg2 + sg + x and give l. 45 Rearrange 26s + s + 2765s*2 + 2763s*2 - 5526s*2 to g + ts + ws2 and give t. 27 Express 1930d + 1952d - 3861d as jd + y and give y. 0 Express 320b - 106b + 376b - 62b as u + pb and give u. 0 Express (38t + 52t - 5t)(-6t2 + 2t*2 - 3t*2)(0t - 4t + 2t) as q + bt*2 + kt + dt3 + zt*4 and give z. 1190 Express -11j + 17 - 1 + 9j + 6j*2 + 2 + 1 as xj + g + bj2 and give g. 19 Rearrange 6s3 + s2 - 428s + 863s - 434s to the form zs*2 + fs + b + ns3 and give z. 1 Rearrange -23g*2 + 3g*3 - 6g*2 + 9g*2 - 7g*2 to the form ag*2 + og + qg3 + v and give a. -27 Express -b2 + 45 - 5b - 45 - b + 2b2 + b - 2b*2 + 0b*2 + 0b*2 + (-1 + 0 + 0)(9b2 + 4b*2 - 12b*2) in the form lb + kb2 + x and give l. -5 Rearrange 5 - 125k*4 + 8 + 2k*3 - 6 - 6 to gk*3 + sk*2 + d + lk*4 + fk and give l. -125 Rearrange 732v + 807v - 221v - 35v to lv + i and give l. 1283 Express (2i - i + i)(-53 + 17i*2 + 53) - 3i*3 + 2i*3 - 2i*3 + (-7i*2 + i - i)(-4 + 4 - 2i) as ki*3 + yi + p + ui2 and give u. 0 Rearrange 4u*2 + 6 + 12u3 - 11 - u4 + 3 to ru4 + qu + iu3 + mu*2 + t and give t. -2 Rearrange (5 - 20 - 9)(-3c + 6c + c*2 - 2c) to the form qc + lc*2 + v and give l. -24 Express 18f4 - f4 - 6f4 + (4f2 - f2 - 2f2)(2f2 - 1 + 1) + 3f*4 - 4f*4 - 5f*4 as wf + kf2 + v + jf*4 + af*3 and give j. 7 Rearrange ((-2 + 7 - 3)(2r - 2 + 2) - r - 2r + 5r)(810r + 70r*2 - 799r + 9r2) to hr + tr3 + fr*2 + b and give f. 66 Rearrange ((2 - 2 + 2)(x + x - x) + 2x - 84x - 31x)(0x2 - x2 + 0x*2) to nx*3 + yx*2 + i + lx and give n. 111 Express (4c - 4c + 2c)(-226c + 270c + 3 + 216c) + 0 + c2 + 0 as yc*2 + k + nc and give n. 6 Express 4422885 - 446a2 - 4422885 in the form i + ba*2 + wa and give b. -446 Express 50i - 54i - 117i as w + ki and give k. -121 Express -12i + 15i + 20i + 101 + 3i - 101 + 2i - i - 2i + (0 + 0 - 2i)(-4 + 1 + 2) as fi + a and give a. 0 Rearrange -16d - 16d - 119d + (-3 + 2 + 3)(-5d + 3d - 4d) to cd + w and give c. -163 Express 20z*3 - 133 - 130 + 394 - 130 in the form vz*3 + kz + t + bz2 and give v. 20 Rearrange 33 - 12j - 120j - 33 + 9j to nj + y and give n. -123 Express -9r*3 + 0 + 0 - 216r + 220r in the form kr + cr2 + o + ir*3 and give i. -9 Express (0y + y + y)(11y - 14y - 9y)(3 - 2 + 11) as n + dy*2 + ly and give d. -288 Rearrange 2119q4 + 1 - 1060q*4 - 1061q*4 - 3q2 - q3 + 3q to f + kq*3 + rq + jq2 + wq*4 and give r. 3 Express (7w - w + 5w)(-2 + 2 - 2w) + 0w*2 - 3w*2 - 3w*2 - 4w2 + w2 + 2w2 + 4w*2 - 3w*2 + 2w*2 in the form sw*2 + mw + y and give s. -26 Rearrange -2y + 3y + 2y + (-y + y - 2y)((-1 + 7 + 0)(1 + 4 - 1) - 2 + 0 + 3) to h + vy and give v. -47 Express (0z + 3z + 2z)(6z - 6z + 6z*3) + 0z4 - z4 - z*4 + 0z*3 - 3z*4 + 0z*3 as cz*2 + t + lz*4 + dz + gz3 and give l. 25 Express (9 - 3 + 6)(-14v - 12v - 7v) in the form u + bv and give b. -396 Rearrange -n - 1231 + 223n2 + 1231 to vn + f + bn2 and give b. 223 Express 7698 - 3848 - 3850 - 393z*2 as b + lz*2 + vz and give l. -393 Express 214c + 4563 - 4563 in the form nc + r and give n. 214 Rearrange 58p3 - 12p*3 - 4 - 24p*3 + 0 to the form hp*3 + gp + yp2 + v and give h. 22 Express 1 - 96v*3 + 37v*3 + 35v*3 + 27v*3 + 2v*2 + 2v in the form wv + y + kv*3 + xv*2 and give k. 3 Express 3 + 887o*2 - 49o*2 - 116o*2 - 3 as s + do*2 + qo and give d. 722 Express -n*2 - 422 + 855 - 431 + 7n + 26n3 + n2 in the form dn*3 + sn + b + yn2 and give s. 7 Rearrange 9s*4 - 10s*4 - 8s*2 - 2s*3 - 3s + 9s2 + 2 to the form ls*3 + d + cs*2 + ms + us4 and give d. 2 Express (2t*2 + 3t*2 - 6t*2)(1337 - 612 - 565) as r + nt + mt*2 and give n. 0 Express -1 - 245s*3 - 238s*3 - 2s + 2s4 + 481s*3 - 11s*2 as ns*2 + fs + q + xs3 + js*4 and give f. -2 Rearrange 3i*2 - 8i2 + i2 - 2i + 14 + 2i*2 to the form r + vi + ui2 and give u. -2 Rearrange ((-2 + 4 - 3)(5 - 5 + g) + 3g - 3g - 2g + 1 - 1 - g)(117 + 1750 - 297) to the form cg + h and give c. -6280 Express 7f - 23f + 9f - 29f2 as g + bf*2 + xf and give b. -29 Rearrange (1 - 4 - 2)(98 - 198 + 368g - 92g + 100) to h + og and give o. -1380 Express -g*3 - 2g*2 + 2g*3 + 0g2 + 22 - g - g4 + 11 as k + mg4 + cg*3 + og*2 + rg and give c. 1 Express (3u3 - 9u*3 + 0u*3)(-2542 + 1356 + 1313) as xu + ku*3 + fu*2 + y and give k. -762 Rearrange 48b*4 - b + 4b*3 - 55b*4 - 6b*2 + 7b*2 to nb*2 + ub*4 + db + kb3 + l and give u. -7 Express -2a*4 - 46a*2 - 8a*3 + 7a*3 - 5a*2 in the form la*2 + sa + wa4 + ma*3 + c and give l. -51 Rearrange -15 + 4 + 5 - 1 + 5w - w to the form r + uw and give u. 4 Express (2l + 3l - 3l)(-2l + 0l + l + 0l + 2l - l - 2 + 2 - l + (2 - 2 - l)(2 - 3 + 3) + 120 - 120 - 21l) as jl + sl2 + m and give s. -48 Express 888s + 4s2 + 2s*3 - 2s*2 - 896s in the form x + is2 + ds + ks3 and give k. 2 Rearrange 107s + 8 - 8 - 204s - 210s to w + ys and give y. -307 Rearrange (-1 + 4j*2 + 1)(0 - 2j + 0 + (-2 + 0 + 1)(-j - j - j) + 2j + 2j - 2j + 0j + 0j - j) to rj + fj2 + nj*3 + x and give n. 8 Express 0o + 1 + 16 + 2o4 + o3 - 1 - 4o in the form p + ro2 + ao*3 + go + so4 and give p. 16 Express (-1 - 3 + 3)(0c + 7c - c) + 0c + 3c + 7c - c + c - 2c in the form kc + f and give k. 2 Rearrange -263q - 260q + 760q - 268q to mq + n and give m. -31 Express 23 - 21x - 39 - 22x + 23 as jx + r and give r. 7 Express 39x*3 - 221x*2 + 37x*3 - 114x*3 + 39x*3 as ix + gx2 + a + sx*3 and give s. 1 Rearrange -3d - d*3 - 2d*4 + 3d*2 + 10d - 8d + 5d*2 to fd + y + gd4 + jd*2 + hd*3 and give f. -1 Rearrange (-3 + 10 + 2)(-o + 0o - 4o)(0 + 4 - 3) + 0o - 2o - 2o to vo + l and give l. 0 Express -2s*3 + 0s*3 + 293s*2 - 149s*2 - 156s*2 in the form gs*3 + i + qs*2 + ks and give q. -12 Express (10i2 - 5i*2 + 8i*2)(33i + 11i - 5i) as ai*2 + j + hi*3 + bi and give h. 507 Express 5q + q - q + (-19 + 1 - 12)(6q - q - 2q) as uq + g and give u. -85 Express 4 - a2 - 2 + 12a*3 + 13a*3 + 9a - 7a + 0 in the form ha*3 + ga + l + wa2 and give h. 25 Rearrange (-6 - 10 + 6)(-1 - 3 + 3)(-1239 + 1239 - 75t)(-4t*3 + 5t*2 + 3t*3 - 4t*2) to the form ct*2 + kt*3 + v + lt*4 + qt and give l. 750 Rearrange -88c4 - 30c + 5c3 + 90c*4 - 3c3 + c2 + 0c3 to the form mc*3 + pc + qc4 + rc*2 + i and give r. 1 Rearrange (-315 + 117 - 193)(-2 + 2 - d)(3d*3 - 2d*3 + 0d*3) to the form zd*3 + jd + id4 + kd*2 + b and give i. 391 Express 78008 - 78008 + 114a in the form ja + u and give j. 114 Express -6r*4 + 0 - 287r + 286r + 3r*4 - 4 in the form nr*3 + wr*2 + j + pr + qr4 and give q. -3 Rearrange -78v*3 + 12v*3 - 268v + 269v - v2 to the form j + gv + bv3 + dv*2 and give g. 1 Rearrange (-40 + 40 - 4x*2 - 2x)(-93x + 862 - 862) to the form lx + fx*3 + r + ox*2 and give f. 372 Rearrange 0q - 30q2 + 2q + q + 2q - 3q to the form nq + b + cq*2 and give c. -30 Express (g - g - 4g)(15g*2 - 12g*2 - 2 + 2g - 4) + 3g3 + g3 + 0g*3 as xg*3 + n + rg*2 + fg and give f. 24 Rearrange 2 - 4140r2 + 4139r*2 + 3r + 417r3 - 2 - r to hr*2 + yr + or3 + i and give y. 2 Express 122i*2 + 34i - 123i	{ "pile_set_name": "DM Mathematics" }
4)(f - 2)(f + 2765) Find t such that -120t5 + 5976t*4 + 84621t*3/2 - 145521t*2/4 + 39543t/4 - 882 = 0. -7, 1/4, 3/10, 56 Solve 3o5/2 - 975o*4/2 - 28473o*3 - 353847o*2 + 1590111o/2 - 824499/2 = 0 for o. -27, 1, 377 Suppose -3w4/5 + 1176w*3/5 - 107976w*2/5 - 1425312w/5 - 4406832/5 = 0. Calculate w. -6, 202 What is b in -4b5 + 104b*4 + 8b*3 - 11872b*2 + 23324b - 11560 = 0? -10, 1, 17 What is m in -4840m5 - 17292m*4 + 12076m*3 + 12560m*2 - 10176m + 1792 = 0? -4, -1, 4/11, 7/10 Suppose -5p2 - 1875p + 1880 = 0. Calculate p. -376, 1 Let -8q2/7 + 500296q/7 - 7821752738/7 = 0. Calculate q. 62537/2 Determine a, given that 2a4/3 - 680a*3/3 + 56422a*2/3 + 234608a/3 + 59168 = 0. -3, -1, 172 Factor o*3 + 3799o*2 + 45480o + 136332. (o + 6)*2(o + 3787) Factor -r*3 - 116r*2 - 855r + 972. -(r - 1)(r + 9)(r + 108) Factor l*3/7 - 65l*2/7 - 304l + 21056. (l - 56)*2(l + 47)/7 Find q such that 3q2/4 + 1311q + 572907 = 0. -874 Determine u so that 2u4 + 130u*3 - 544u*2 + 552u = 0. -69, 0, 2 Solve -2v3 - 226v*2 - 8432v - 104040 = 0 for v. -45, -34 Solve -2z4/7 - 974z*3/7 + 16038z*2/7 - 29146z/7 + 2012 = 0. -503, 1, 14 Determine x so that -12x2 + 228656x - 152432 = 0. 2/3, 19054 Let -2f3 - 20642f*2 - 53271840f - 53251200 = 0. What is f? -5160, -1 Suppose 4j2 - 40740j + 610200 = 0. What is j? 15, 10170 Find h, given that 4h3 - 220h*2 - 10752h - 76032 = 0. -24, -9, 88 Factor 4g5 + 1008g*4 + 8868g*3 + 29336g*2 + 42864g + 23328. 4(g + 2)3(g + 3)(g + 243) What is d in 3d*5 - 1926d*4 + 37176d*3 + 89808d*2 - 148752d - 328416 = 0? -2, 2, 22, 622 Let -4a5 - 8a*4 + 10620a*3 - 10576a*2 - 21200a = 0. What is a? -53, -1, 0, 2, 50 Solve 2y2/11 - 824460y/11 + 84966786450/11 = 0. 206115 Let x*5/5 + 52x*4/5 - 7778x*3/5 + 23012x*2/5 - 22903x/5 + 7616/5 = 0. Calculate x. -119, 1, 64 Factor i*4 - 3246i*3 + 2630881i*2 + 5271504i + 2637376. (i - 1624)*2(i + 1)2 Factor s2/9 - 36146s/9 + 326633329/9. (s - 18073)2/9 Solve -x4/5 + 4056x*3/5 - 822555x*2 - 36504x/5 + 37015056/5 = 0 for x. -3, 3, 2028 Factor r*2/9 + 101r/3 - 304/9. (r - 1)(r + 304)/9 Factor -s3/4 + 476s*2 + 156657s/4. -s(s - 1983)(s + 79)/4 Determine t, given that -2t3 + 626t*2 + 298768t + 24075816 = 0. -142, 597 Solve -r*3/6 - 4273r*2/3 = 0 for r. -8546, 0 Factor 5y*2 - 103625y - 103630. 5(y - 20726)(y + 1) Determine a so that -2a3 - 596a*2 + 3030a = 0. -303, 0, 5 Factor -2z2/7 + 42132z/7 - 221888178/7. -2(z - 10533)2/7 Determine l, given that -4l*4/5 - 472l*3/5 - 1092l*2 = 0. -105, -13, 0 Factor -4k*2/11 + 12106k - 66582/11. -2(k - 33291)(2k - 1)/11 Solve 5x*3/6 + 7780x*2/3 - 5x/6 - 7780/3 = 0. -3112, -1, 1 Factor 3w3 + 273w*2 + 5904w + 19440. 3(w + 4)(w + 27)(w + 60) Let -9k*3/4 + 5237k*2/4 - 1162k = 0. What is k? 0, 8/9, 581 Find r such that -4r3 - 1208r*2 - 16796r + 431288 = 0. -286, -29, 13 Factor -4w2/5 + 2372w/5 + 2392. -4(w - 598)(w + 5)/5 Factor -5n2 + 3625890n - 657353914605. -5(n - 362589)2 Determine k, given that -10k*5/3 - 398k*4 - 6176k*3/3 - 760k*2 = 0. -114, -5, -2/5, 0 Solve -3j*2 - 1884j/5 - 8721 = 0. -95, -153/5 Solve -25u3 + 760u*2 + 35460u + 67680 = 0. -24, -2, 282/5 Factor g*3/7 - 23599g*2/7 + 10112g + 94384/7. (g - 23596)(g - 4)(g + 1)/7 Factor -5n3 + 48n*2 + 137n + 84. -(n - 12)(n + 1)(5n + 7) Factor -2j*4/13 - 746j*3/13 + 18672j*2/13 - 11648j + 406528/13. -2(j - 8)3(j + 397)/13 Factor -d*4 + 8934d*3 - 19918321d*2 - 159775656d - 319837456. -(d - 4471)*2(d + 4)*2 Suppose -4l*2 + 161728l - 1634746624 = 0. Calculate l. 20216 What is h in h*2/8 - 601h + 4807/8 = 0? 1, 4807 Factor 98g3/9 - 2436g*2 + 415936g/3 - 2408704/9. 2(g - 2)(7g - 776)2/9 Factor -4i*4 - 844i*3 + 25704i*2. -4i*2(i - 27)(i + 238) Factor 3b*4 - 2556b*3 + 552015b*2 - 3220722b. 3b(b - 423)*2(b - 6) Factor 2y3/3 - 926y*2/3 + 9110y/3 - 7550. 2(y - 453)(y - 5)*2/3 Solve -6q*4 + 159q*3/2 - 399q*2/2 - 468q + 594 = 0 for q. -2, 1, 6, 33/4 Factor 3r2 + 5577r + 99414. 3(r + 18)(r + 1841) Suppose 5i5 + 1015i*4 + 49925i*3 - 165275i*2 - 310030i + 424360 = 0. Calculate i. -103, -2, 1, 4 Let -3j3 - 1863j*2 + 46008j - 278640 = 0. What is j? -645, 12 Factor 2w3 - 7934w*2 + 7808702w + 118922430. 2(w - 1991)2(w + 15) Find u such that -3u2 + 639u - 3726 = 0. 6, 207 Factor 3q3 + 13050q*2 - 12q - 52200. 3(q - 2)(q + 2)(q + 4350) Let 3v*4 + 513024v*3 + 21933315066v*2 + 43865091072v + 21932289027 = 0. What is v? -85503, -1 Find l such that -5l5 - 8790l*4 - 3898205l*3 - 30765000l*2 - 61250000l = 0. -875, -4, 0 Factor -4r2/3 + 4468r/3 + 7480. -4(r - 1122)(r + 5)/3 Find w, given that -w*3 - 49w*2 + 1333w + 68413 = 0. -43, 37 Determine u so that 2u2 + 121708u + 121706 = 0. -60853, -1 Find n such that 11n3 - 221n*2/2 + 181n - 8 = 0. 1/22, 2, 8 Solve 2b5 - 52b*4 - 552b*3 + 14608b*2 + 30976b = 0. -16, -2, 0, 22 Factor -28p3 - 596p*2 - 1680p - 432. -4(p + 3)(p + 18)(7p + 2) Let 37y3/5 + 638918y*2/5 + 2758234908y/5 + 149091912/5 = 0. What is y? -8634, -2/37 Factor 3u5/2 - 55749u*4. 3u*4(u - 37166)/2 Factor -u*4/2 + 5581u*3/2 - 30635u2. -u2(u - 5570)(u - 11)/2 Let -3i3 - 3999i*2 + 8019i + 12015 = 0. Calculate i. -1335, -1, 3 Factor -6m2/5 + 3002184m/5 - 375546198744/5. -6(m - 250182)2/5 Let -t4 - 351738t*3 - 30930256897t*2 - 61859458584t - 30929553424 = 0. Calculate t. -175868, -1 Factor 5z2 + 55810z + 155737805. 5(z + 5581)2 Factor 5l*2/3 + 18320l/3 - 36700. 5(l - 6)(l + 3670)/3 Let -2z2 - 216z - 5110 = 0. What is z? -73, -35 Factor 2w2/5 - 125104w + 625518/5. 2(w - 312759)(w - 1)/5 Let 76j3/7 - 7456j*2/7 + 67664j/7 - 7040/7 = 0. What is j? 2/19, 10, 88 Determine s, given that s*3 - 77496s*2 + 1501407504s = 0. 0, 38748 Determine i so that -2i3/11 + 266i*2/11 + 5068i/11 + 4800/11 = 0. -16, -1, 150 Let -2b3 - 48b*2 + 1368b - 6048 = 0. What is b? -42, 6, 12 Suppose -4d4 + 1332d*3 - 6208d*2 - 114624d - 272896 = 0. Calculate d. -4, 13, 328 Suppose -13i2/4 - 101i - 31/4 = 0. Calculate i. -31, -1/13 Solve 5s2/3 + 610s/3 + 400 = 0. -120, -2 Determine g, given that 1243225g3/2 - 1246570g*2 + 13389g/2 - 9 = 0. 3/1115, 2 Let 4p5 - 396p*4 - 6324p*3 + 1029884p*2 - 1023168p = 0. What is p? -48, 0, 1, 73 Suppose 7a4/5 + 78329a*3/5 + 43823397a*2 - 6260805a = 0. What is a? -5595, 0, 1/7 Factor 3b2 - 16071b + 64236. 3(b - 5353)(b - 4) What is c in -c*5 - 173c*4 - 6463c*3 + 88837c*2 - 201112c - 296240 = 0? -92, -1, 5, 7 Determine u so that u*4 - 36u*3 - 3819u*2 + 3854u = 0. -47, 0, 1, 82 Factor 2n2 - 9698n - 87444. 2(n - 4858)(n + 9) Factor 3u2 + 1065u + 1062. 3(u + 1)(u + 354) Find n such that -10n5 + 122n*4 - 366n*3 - 146n*2 + 1024n + 672 = 0. -1, -4/5, 3, 4, 7 Factor -p*2/5 + 4594p/5 - 280984/5. -(p - 4532)(p - 62)/5 Let -2v*4/5 - 10008v*3/5 + 20022v*2/5 - 10012v/5 = 0. Calculate v. -5006, 0, 1 Find z such that -z*4/4 - 827z*3/4 + 7545z*2/4 + 17567z/4 + 2299 = 0. -836, -1, 11 Determine x so that 4x5/7 - 8480x*4/7 + 645676x*3 - 26813848x*2/7 - 38656x + 20429696 = 0. -2, 4, 1057 Factor q*3 + 540q*2 - 541q. q(q - 1)(q + 541) Let -3l4/8 - 89l*3/2 + 50923l*2/8 + 10702l + 8585/2 = 0. Calculate l. -202, -1, -2/3, 85 Solve -625j5 - 50525j*4 + 8096j*3 - 324j2 = 0. -81, 0, 2/25 Let m5 + 348m4 - 11830m*3 + 124432m*2 - 369171m - 505780 = 0. Calculate m. -380, -1, 11 Factor -a*2/11 + 108402a/11 - 541985/11. -(a - 108397)(a - 5)/11 Factor z2/2 + 12742z + 81179282. (z + 12742)*2/2 Solve -2k*5 - 172k*4 - 958k*3 + 172k*2 + 960k = 0 for k. -80, -6, -1, 0, 1 Factor 4p2/7 + 10456p + 73188/7. 4(p + 1)(p + 18297)/7 Suppose -3h3 + 4899h*2 - 201021h + 883005 = 0. Calculate h. 5, 37, 1591 Find i such that -2i3/13 + 1536944i*2/13 - 3073882i/13 + 1536940/13 = 0. 1, 768470	{ "pile_set_name": "DM Mathematics" }
*2 + 2z2. -z2 Collect the terms in 22 - 49 + 27 - 2a. -2a Collect the terms in -h*3 - 4h + h*3 + 17h - 6h3. -6h*3 + 13h Collect the terms in -6 + 6 + 15a2. 15a*2 Collect the terms in 9g*2 - 5g*2 - 8g*2 - 24g. -4g2 - 24g Collect the terms in 16o2 - 16o*2 + 2o3 - o3. o*3 Collect the terms in 4a*3 + 9a*3 - 14a3. -a3 Collect the terms in 6 + 0 + 0 - 2v - 7. -2v - 1 Collect the terms in 3z2 + 3z*2 + 7z*2 + 5z*2. 18z*2 Collect the terms in 8r*2 + 37 - 10r*2 - 37. -2r*2 Collect the terms in 168336o - 336673o + 168335o. -2o Collect the terms in -84i*3 + 131i*3 + 219i*3. 266i*3 Collect the terms in -8x*3 - 2x*3 - 16x*3. -26x*3 Collect the terms in 0j + 3j - 4j + 4j. 3j Collect the terms in 2l2 - 2l*2 + 0l*2 + 8l*3. 8l*3 Collect the terms in -64f*2 + 134f*2 - 75f*2. -5f*2 Collect the terms in 88z + 90z - 59z*3 - 178z + 63z3. 4z*3 Collect the terms in -2u - 9u - 5u + 13u. -3u Collect the terms in -9h3 - 7h*3 - 30h*3. -46h3 Collect the terms in 22061 + 22067 - n3 + 3n3 - 44128. 2n*3 Collect the terms in 1 + 74m*2 - 113m*2 - 1. -39m*2 Collect the terms in -800r*2 - 1293r*2 + 80r*2. -2013r*2 Collect the terms in 1 + 1 - 3l - 3 + 16l. 13l - 1 Collect the terms in 20k + 30k + 17k - 2 - 3k. 64k - 2 Collect the terms in 6l*3 + 3l3 - l3. 8l3 Collect the terms in 1 - 36a - 1. -36a Collect the terms in 110g + 103g + 104g - 418g + 103g. 2g Collect the terms in -q + q + 2q + 0q. 2q Collect the terms in 71d - 271d + 64d + 66d + 65d. -5d Collect the terms in 167r + 97r*2 - 167r. 97r2 Collect the terms in -10c + 3c - 14c. -21c Collect the terms in -f2 - 2f*2 - 8 - 29 - 5. -3f*2 - 42 Collect the terms in -24 + 9 - 2l*2 + 15. -2l*2 Collect the terms in -40h*3 - 31h*3 + 73h*3. 2h*3 Collect the terms in -32i*3 - 22i*3 + 52i*3. -2i*3 Collect the terms in 28a*3 - 116a*3 - 71a*3. -159a*3 Collect the terms in -2m + 10m - m - m. 6m Collect the terms in 68z2 - 36z*2 - 28z*2. 4z*2 Collect the terms in 13m*2 + 0 + 1 - 1. 13m*2 Collect the terms in -3y*3 - 6070 + 6070. -3y3 Collect the terms in t3 - 28231 + 28231. t*3 Collect the terms in -3n*3 + 19n*3 - 6n*3 - 3n*3. 7n*3 Collect the terms in -643y*2 - 631y*2 + 1269y*2. -5y*2 Collect the terms in -273s - 275s - 268s + 818s. 2s Collect the terms in -7k2 - 5k2 - k2 - 24k2. -37k*2 Collect the terms in 55m3 + m2 - 1 + 1 + 52m3. 107m3 + m2 Collect the terms in -3y2 + 5y*2 - 517 + 1005 - 488. 2y*2 Collect the terms in 8782750r + 3r2 - 8782750r. 3r2 Collect the terms in -1039f*2 + 1039f*2 - 15f*3 + 6f*3 + 7f*3. -2f*3 Collect the terms in -r - 5r - 7r. -13r Collect the terms in 0 - 2 + 0 + 0u2 + 2u*2. 2u2 - 2 Collect the terms in 2550 - 2550 + p2. p*2 Collect the terms in 1 + 6x - 6x + 17x*2 + 255x*2. 272x*2 + 1 Collect the terms in -44x - x*3 - 27x - 54x. -x3 - 125x Collect the terms in -151s - 107s + 88s. -170s Collect the terms in 10a - 47a + 17a + 18a. -2a Collect the terms in 2 - 342s + 347s + 1. 5s + 3 Collect the terms in -5 + 0l3 - 7 + 10 + 4l*3. 4l*3 - 2 Collect the terms in 5m*2 - 5m*2 - 217m*3. -217m*3 Collect the terms in 2u*2 - 2u*2 - 110u*3 + 111u3. u3 Collect the terms in 3p3 - p3 - 4p*3 + 5p*3. 3p*3 Collect the terms in 3y*2 - 6y*2 + 8y*2 + 11y*2. 16y*2 Collect the terms in -34q*3 + 29q*3 - 74q*3 - 36q*3. -115q*3 Collect the terms in 4z3 - z3 + 3z3. 6z*3 Collect the terms in -10y - 2y2 + 6y - 10y. -2y*2 - 14y Collect the terms in -93o + 118o + 119o. 144o Collect the terms in -1235r2 + 616r*2 + 618r2. -r2 Collect the terms in -555h3 - 524h*3 + 1076h*3. -3h*3 Collect the terms in -48c*3 - 7c*3 - 129c*3 - 20c*3. -204c*3 Collect the terms in -4 - 4 - 4 - 12 - 2z. -2z - 24 Collect the terms in -31w*3 - 27w*3 + 57w3. -w3 Collect the terms in h*3 + 11 - 19h*3 - 11. -18h*3 Collect the terms in 26c*3 - 16c*3 - 21c*3. -11c*3 Collect the terms in 867z - 1 + 2 - 1. 867z Collect the terms in -v3 + 1 + 7 - 7 - 1. -v3 Collect the terms in -854705 + 2m*2 + 854705. 2m*2 Collect the terms in -2848 + 44a*2 + 2848. 44a*2 Collect the terms in -370c*3 - 371c*3 - 366c*3 + 1110c*3. 3c*3 Collect the terms in -34 + 71 - 37 + 6l. 6l Collect the terms in -13 + 8 - 68r + 5. -68r Collect the terms in -5q*3 - 39q*2 + 41q*2 - 9q*3. -14q*3 + 2q*2 Collect the terms in -34q*2 - 59q*2 + 28q*2. -65q2 Collect the terms in o2 + 34o3 - o2 - 66o*3 + 33o3. o3 Collect the terms in 3v2 - 127 + 0v*2 + 127. 3v*2 Collect the terms in -14d + 2d + 3d. -9d Collect the terms in -590l2 - l3 + 590l2. -l3 Collect the terms in 60090r - 120182r + r2 + 60092r. r*2 Collect the terms in 3 - 3 - 86h*2 + 21h*2. -65h*2 Collect the terms in -1 + 1 + 24a*2 + 0a*2. 24a*2 Collect the terms in -8u - 21u + 35u + 70u. 76u Collect the terms in 4p - 6p + 0p - 2 + 0p - 7p. -9p - 2 Collect the terms in 32y2 - 10y*3 - 15y*2 - 17y*2. -10y*3 Collect the terms in 175q - 59q - 61q - 17q3 - 55q. -17q3 Collect the terms in -59w*2 + 109w*2 - 54w*2. -4w*2 Collect the terms in 2f*3 + 4f*3 - 2f*3 - 2f*3. 2f*3 Collect the terms in z - 9z + 7z. -z Collect the terms in 6u - 9u - 9u - 3u. -15u Collect the terms in 24b2 + 22 - 22. 24b*2 Collect the terms in -158t*2 + 311t*2 - 154t2. -t2 Collect the terms in -1181 + 1181 - 4z. -4z Collect the terms in 7h - 7h + 7h. 7h Collect the terms in 28b - 99b + 34b - 14 + 34b. -3b - 14 Collect the terms in -2r - 4r - 8r. -14r Collect the terms in 2k + 6k - 2k + 3k2 - 6k. 3k2 Collect the terms in f - 19f*3 - f - 198f*3. -217f*3 Collect the terms in 123y*2 - 5y*2 - 21y*2. 97y*2 Collect the terms in -10y*3 + 0y*3 - 6y*3 + 12y*3. -4y*3 Collect the terms in -15g*2 - 10g + 11g + 5g*2 - 27g*2. -37g*2 + g Collect the terms in 0j + 2j - 4 - 5j. -3j - 4 Collect the terms in 28y + 5y + 35y. 68y Collect the terms in -4z + 116z3 + 4z. 116z3 Collect the terms in -25 - 24 + 80 - r - 31. -r Collect the terms in -46y - 49y + 182y - 37y - 36y. 14y Collect the terms in -87m*2 - 1 + 110m*2 + 1. 23m*2 Collect the terms in -154 + 70n*3 + 154. 70n*3 Collect the terms in -71v*3 + 77v*3 - 117v*3 - 89v*3. -200v*3 Collect the terms in 13255 - 3n*3 - 13255. -3n*3 Collect the terms in 25n3 - n2 - 23n3 + n2. 2n*3 Collect the terms in 3n*3 - 3n*3 - 2n*3 + 12n*3. 10n*3 Collect the terms in 11m + 16m - 28m. -m Collect the terms in -434y3 + 222y*3 + 215y*3. 3y*3 Collect the terms in 21h - 41h + 16h. -4h Collect the terms in -20w*2 - 11w*2 + 11w*2. -20w*2 Collect the terms in -6v - 4v - 6v - 6v. -22v Collect the terms in -4z + 3z + 2z + 2z - 2z. z Collect the terms in 9y - 9 - 49y + 37y. -3y - 9 Collect the terms in -4y + 43y2 - 2y + 6y. 43y*2 Collect the terms in 13f*3 + 3f*3 + 2f*3 + 9f*3. 27f*3 Collect the terms in 12i*3 - 19i*3 + 10i*3. 3i*3 Collect the terms in -169f*2 - 9 + 82f*2 + 2f*3 + 87f*2. 2f*3 - 9 Collect the terms in -116g*3 + 48g*3 - 35g*3 - 563g*3. -666g*3 Collect the terms in -149785y*2 + 74900y*2 + 74893y*2. 8y*2 Collect the terms in 14y*2 - 13y*2 - 10y*2. -9y*2 Collect the terms in 10 - 264a*2 - 10. -264a*2 Collect the terms in -6 + 4x - 7x + 7x - 6x. -2x - 6 Collect the terms in 7m + 89 - 170 + 81. 7m Collect the terms in 54 + 5s - 54 + 5s. 10s Collect the terms in -3h + 0h + 5h + 5h - 5h. 2h Collect the terms in 7u + 12u + 6u - 22u. 3u Collect the terms in -2c3 + 224c - 44 + 44. -2c3 + 224c Collect the terms in 0l2 - 5l*2 + 3l*2 + 3l. -2l2 + 3l Collect the terms in 171t - 80t - 91t + 4t*2. 4t*2 Collect the terms in 4o*3 + 11o**3	{ "pile_set_name": "DM Mathematics" }
12c2 - 26c - 5. List the prime factors of m(5). 2, 3, 5 List the prime factors of (-4456)/12-1 + (-16)/12. 2, 5, 37 Let z(a) be the second derivative of 41a5/20 - a3/6 - 20a. List the prime factors of z(1). 2, 5 Let v(z) = 6z*2 - 4z - 2. Let b be v(-4). Suppose 2w - 9 = 3. What are the prime factors of b/4 + w/4? 29 Let j(d) = -760d + 8. Let y be j(-1). Suppose -y = -3o + 2g, o = 4o - 4g - 768. What are the prime factors of o? 2 Let r(l) = l*3 + 6l*2 + 8l + 166. Let v(x) = 2x3 + 11x*2 + 15x + 331. Let p(k) = -11r(k) + 6v(k). What are the prime factors of p(0)? 2, 5 Suppose 17564 = 19c - 8580. What are the prime factors of c? 2, 43 Let f(l) = 62l + 1532. List the prime factors of f(0). 2, 383 Suppose -78 - 50 = -4p - 2k, 169 = 5p - 2k. Let v = 80 - p. List the prime factors of v. 47 Let d(i) = -i*2 - 10i - 4. Let f be d(-9). Suppose fy - 16 = -2s, 3y = -2y - 4s + 12. Suppose 2v = g - y, 1 = v - 2v. List the prime factors of g. 2 Let z be 3(-2)/65. Let l(o) = -3o + 1. What are the prime factors of l(z)? 2 Let f = 4 + -2. Suppose -fk = k. Suppose kd - 3d + 55 = -2s, 5d + 4s = 55. What are the prime factors of d? 3, 5 Let f be (-16)/((-7 + 3)/(-4)). Let c = f + 12. List the prime factors of 5(3 - 23)/c. 5 Let f(o) = -o3 + 11o*2 - 15o - 9. Let k = -17 - -26. Let x be f(k). Let u = x + 36. List the prime factors of u. 2, 3 Let x(g) = -g*2 + 14g + 20. Let k be x(15). Suppose 0 = j - k - 15. List the prime factors of 1212/j + (-2)/(-5). 61 Let d(x) = x*2 - 15x - 99. List the prime factors of d(-8). 5, 17 Let p(x) = x*2 - 7x - 37. Let c be p(13). Suppose -4v = -0v + 80. Let s = c + v. What are the prime factors of s? 3, 7 List the prime factors of 110/(-4)((-792)/10)/11. 2, 3, 11 Let s(o) = -o2 + o. Let m be s(1). Let p be (-3)/(12/(-76)) + m. Suppose -16 - p = -5g. List the prime factors of g. 7 Let t(j) = j*3 - 4j*2 + 3j - 1. Let p be t(2). Let f(y) = -y*3 + 2y + 2. List the prime factors of f(p). 23 Let m = 1226 - -182. List the prime factors of m. 2, 11 Suppose 2o + 0o + 1651 = 5c, 4c - 3o = 1325. What are the prime factors of c? 7, 47 Let y(u) be the second derivative of u4/12 - u3 + 26u. Suppose 0p + 8 = p. What are the prime factors of y(p)? 2 Let a(n) be the first derivative of -n2/2 + 2n + 2. Let c be a(-3). Suppose -3j = cu - 173, -5u - 6j + j + 175 = 0. What are the prime factors of u? 2, 17 Suppose 58d - 59d + 3 = 0. Let q(n) = 9n3 + n2 + 3n - 4. What are the prime factors of q(d)? 257 Let q(d) = -d*2 - 18d + 6. Let x be q(-11). Let n = 73 + x. What are the prime factors of n? 2, 3, 13 Suppose 4m - 24 = -2p, -5p + 0p + 4m = -18. Suppose -p = -6j + 3j. Suppose -5u = 4n - 105, 6n - jn = -u + 21. What are the prime factors of u? 3, 7 Let p(t) = -t3 + 9t*2 - 11t + 16. Let k be p(8). Let v(z) = -16z - 32. List the prime factors of v(k). 2, 3 Let p(g) = -8 + 3g*3 + 20 - 3g*2 - 2g - 11 + 3g. Suppose 2b - 2 - 2 = 0, -4b + 23 = 5o. What are the prime factors of p(o)? 2, 29 Suppose -3t + 2m = 263, 2t + 3m = -2t - 328. Let q = 148 + t. What are the prime factors of q? 3, 7 Let f(z) = z2 + 9z - 10. Let w be f(7). Let b = 1 + 2. Suppose -bs + 9 + w = 0. List the prime factors of s. 37 Let r = -22 - -26. Suppose g = -rj + 156, 2j = -5g + 55 + 5. What are the prime factors of j? 2, 5 Let f be 53 + ((-20)/(-6) - 1/3). Let j = 14 + f. List the prime factors of j. 2, 5, 7 Let a be -126 - (-2 + 7 + (-6)/2). Let d = -63 - a. What are the prime factors of d? 5, 13 Let i = 11 + -9. Suppose 4v - v - iz - 189 = 0, 5v = -z + 302. What are the prime factors of v? 61 Suppose 2m - 5k + 159 = 0, 6m = 2m + 5k - 343. Let f = m + 175. List the prime factors of f. 83 Suppose 4z - 16 = -4o, 3z + o = -0o + 14. Let d = -10 + 13. Let r = z - d. What are the prime factors of r? 2 What are the prime factors of 1921 + -2 + 52/13? 3, 641 Suppose -2s - 2k = -202, -9k + 289 = 3s - 13k. Let v = 131 + s. List the prime factors of v. 2, 5, 23 List the prime factors of (-2)/(-4) - ((-13836)/8 + -5). 5, 347 Let a(l) = 4l*2 + 4 + 2 - 28l + 28l. What are the prime factors of a(3)? 2, 3, 7 Let v = 32 + 0. Suppose -88 = -j - v. List the prime factors of j. 2, 7 Suppose 2f + 118 - 2342 = 0. What are the prime factors of f? 2, 139 Let d(a) = -a*3 - 10a*2 - 13a + 9. What are the prime factors of d(-11)? 3, 7, 13 Let k(q) = 92q - 587. What are the prime factors of k(56)? 5, 11, 83 Let g = 36 + -25. Let t = g + -11. Suppose 5x - p = 94, -3p + 3 = -tp. List the prime factors of x. 19 Let m(d) = -98d2 - 2d - 1. Let o be m(-1). Let z = -60 - o. What are the prime factors of z? 37 Suppose -2k + 32 = 5p - 20, -2k + 40 = 4p. Let v = p + -29. Let l = -10 - v. What are the prime factors of l? 7 Suppose 3921 = 32q - 12367. What are the prime factors of q? 509 Let r(h) = 26h*2 + 130h + 18. List the prime factors of r(-8). 2, 3, 107 Suppose 5d + y - 740 = 0, 0y = 4d + y - 592. Suppose -60z - d = -64z. What are the prime factors of z? 37 Let f(r) = 2r*2 + 4r - 2r - 5r + 4. What are the prime factors of f(7)? 3 Let f(s) = -s*2 - 3s + 27. Let n be f(-17). Let d = n - -323. What are the prime factors of d? 2, 7 Suppose -d = -m + 2 - 1, -5m - 2d = 16. What are the prime factors of -3 - (-2 - (13 - m))? 2, 7 Let f(m) = m*3 + 12m*2 - 2m - 10. Let y(a) = 4a + 2. Let p be y(-3). List the prime factors of f(p). 2, 3, 5, 7 Suppose -3p + 2515 + 2723 = 0. List the prime factors of p. 2, 3, 97 List the prime factors of 7/(-14) + 6898/4. 2, 431 Let i = 712 - 496. What are the prime factors of i? 2, 3 Let o(t) = 5t + 4. Suppose -4v - 3r = -26 + 97, 4v - 3r + 41 = 0. Let z be (1 - (-36)/(-28))v. List the prime factors of o(z). 2, 3 Let t be 0 + 0 + -34. Suppose 0 = -5v + 15, -m + 5v = m - 61. Let y = m + t. What are the prime factors of y? 2, 13 Let h = -64 + 166. Suppose h = -21w + 24w. List the prime factors of w. 2, 17 Let s(w) = -w - 8w*3 + 37 + 13w*3 - 6w*3 - 9w*2. List the prime factors of s(-9). 2, 23 Suppose -10r + 8r - 2628 = -4s, -4s + 2640 = -5r. Suppose 4f - z - 874 = 0, -3f + z + s = -0f. What are the prime factors of f? 3, 73 Let s(y) = -4y*3 - 3y*2 - y + 1. Let m be s(-2). Let w = 23 - m. Suppose 3j + 3k = 72, w = -5j + 5k - 0k + 100. List the prime factors of j. 2, 11 List the prime factors of 1(1655/(-15) + 5)-3. 2, 79 Suppose 16z + 655 = 5823. What are the prime factors of z? 17, 19 What are the prime factors of 141/(-235) + ((-8208)/10)/(-3)? 3, 7, 13 Suppose -19i + 18i + 274 = 0. Suppose 3n - i = 209. List the prime factors of n. 7, 23 Suppose -3d - 4y = -9, 3d + 0y = 4y + 9. List the prime factors of d. 3 Let v(x) be the third derivative of x5/60 + 3x*4/8 - 3x*3/2 - 16x2. List the prime factors of v(-11). 13 List the prime factors of 40476/42 + (-8)/(-28). 2, 241 Let t be 14/((-4 - -4) + 1). Let k = t - -150. List the prime factors of k. 2, 41 Let d(l) = l3 + 11l2 + 6l - 40. What are the prime factors of d(-8)? 2, 13 Let h(y) = -7y + 5. Let c(f) = -f + 5. Let t be c(0). Suppose -tz = -0z + 20. List the prime factors of h(z). 3, 11 Let r = 25 + -59. Let i = -31 - r. What are the prime factors of i? 3 Let s(m) = 110m*2 + 37m. List the prime factors of s(-4). 2, 13, 31 Let s = -11083 - -15669. List the prime factors of s. 2, 2293 Let k = -263 + 408. Suppose 0 = 9w - 4w - k. List the prime factors of w. 29 Let o = -42 + 16. Let s = o + 30. Suppose sa = -4 + 108. What are the prime factors of a? 2, 13 Let t = -102 - -144. List the prime factors of t. 2, 3, 7 Suppose -247j + 4956 = -243j. List the prime factors of j. 3, 7, 59 Suppose -4o - 570 + 3694 = 0. Suppose -211 = 3s - o. What are the prime factors of s? 2, 5, 19 Let g(r) = -40r + 10r - 2 + 10 - 39. What are the prime factors of g(-4)? 89 What are the prime factors of (-989902)/(-354) + 2/(-6)? 2, 3, 233 Let l(c) = 2c*2 + 6c + 4. Let m be l(-4). Suppose -h - 3h = m, 4w = 5h + 39. List the prime factors of (w - 16)(-1 + -5). 2, 3, 5 Suppose 3m - 51 - 13 = -2c, -4c = 2m - 40. Let u be (-9 - -1)/(m/55). Let y = -10 - u. List the prime factors of y. 2, 5 Let d	{ "pile_set_name": "DM Mathematics" }
. What is the fourth biggest value in 2/3, 0.2, -5, a? -5 Let x be 2/4 - 2/(-8). Suppose -5z - v - 72 = 3v, -2v = z + 18. Let i be ((-8)/z)/(4/(-30)). Which is the third smallest value? (a) i (b) x (c) -0.4 b Let z = 7 - 12. Let r be 6/(-8) - (-115)/20. What is the second biggest value in r, z, 1/3? 1/3 Let j = -47 - -43. Which is the second biggest value? (a) -9 (b) -1 (c) j c Let v = 40 + -23. Let y = 14 - v. What is the biggest value in 4, y, -2/15? 4 Let a = -10 - -13. What is the third biggest value in -0.2, a, -0.5? -0.5 Suppose 4r + 6 + 6 = -4w, 0 = -4r - 2w - 12. Let l be 01/(2/1). Which is the third smallest value? (a) l (b) 2 (c) r b Suppose 10v + 2 = 8v. Let o be (v/(-1))/(6 - -1). Let c = 1.94 + -2. What is the second biggest value in c, o, 4? o Let u = -9 - -9.1. Let n = 1 - 2. Let q be ((-5)/(-3))/n + 1. Which is the biggest value? (a) u (b) q (c) -4 a Let h = 2/15 + -3/10. Which is the third smallest value? (a) 5 (b) h (c) 0.4 (d) 1/7 c Let z = 20 + -18. Which is the second biggest value? (a) -5/4 (b) 5 (c) z c Let l = 3.35 + -0.35. Let c = -1.1 + 5.1. Let m = 4 + -2. What is the third smallest value in l, c, m? c Let z be (-1)/1 - 9/18. Which is the smallest value? (a) 0.1 (b) -0.5 (c) z c Let c = 15.8 - 15.4. What is the smallest value in 17, 1, c, -1? -1 Let k = -83.7 + 84. Which is the second biggest value? (a) -3/4 (b) 3 (c) k (d) 5 b Let t = -1 + 1.1. Let n = 7 - 6.6. Let r = n + t. What is the biggest value in 4, r, -2/15? 4 Let v = -0.24 - -0.04. Which is the third smallest value? (a) 0.1 (b) v (c) -2/13 (d) 0.2 a Suppose 0 = y + 3d + 12, -2 - 18 = 4y + 5d. Suppose -4x - x - 15 = y. Let p be (x - -4)(-2)/5. What is the smallest value in p, 3, 0.4? p Let r = -1.05 + -3.95. Which is the second biggest value? (a) -42 (b) r (c) -5/3 (d) -1/3 c Suppose 4x = -0t + t, x + t = 0. Let k be 21/6 - (-2)/((-4)/6). What is the third smallest value in k, -0.4, x? k Let o = -2.3 + 2.5. Let i = -0.2 + 1.2. Which is the second smallest value? (a) i (b) o (c) 2/9 c Let c = -1 + 1. Let m = c - -0.1. Let v = 508/11 + -46. What is the biggest value in v, 1, m? 1 Let p be (-4)/6 - 2/6. Let w be (1 + -6)(-1)/2. Let t = -11/4 + w. Which is the smallest value? (a) p (b) t (c) 1/7 a Let i = 0.138 + -0.538. Let p = 25/33 - 12/11. Which is the second smallest value? (a) 3 (b) i (c) p c Let q = 19381 + -96591/5. Let h = 63 - q. Let k be (-110)/33 - -41. Which is the second smallest value? (a) k (b) h (c) -1 b Let t = -1 - -2. Let o = 1.5 - t. Let k = 3 + -3.2. What is the third biggest value in 4/5, k, o? k Suppose 2p - 4d - 18 = 0, p + d + 2d = -6. Let w be (-3)/(-1) + (-602)/204. Let q = -2/17 - w. Which is the third biggest value? (a) q (b) -6 (c) p b Let m = -34.9 - -35. What is the third smallest value in 4, m, -5? 4 Let k = 5.4 - 2.4. Let z be 758/43/6. Let t = -94 + z. Which is the smallest value? (a) t (b) k (c) 0.5 c Let u = 1.5 - 2. What is the third smallest value in u, -5, -3/4? u Let l = 13 - 23/2. Let w = 3.8 - 4. Let o = 2 - 13/5. Which is the third biggest value? (a) l (b) o (c) w b Let k = -0.7 + -0.3. Let d = -1.1 + 0.1. Let m = -1 - d. Which is the second biggest value? (a) 2/3 (b) m (c) k b Let l = -44625/4 + 11064. Let c = -93 - l. What is the biggest value in c, -5, 1/6? 1/6 Let n = -6 + 2. Let p = -2 - n. Let j be 93/33 - (0 - -3). What is the second smallest value in -1, j, p? j Let k = -17 - -27. Let q = 5 - k. Let g be (-1)/2 + (-18)/(-28). What is the second smallest value in q, g, 5? g Let i = -33.5 - -33. Which is the second biggest value? (a) i (b) -2/9 (c) -5 a Let m = 4 + -3.8. Let q = -4.2 - -6. Let b = m + q. What is the smallest value in -2/13, 4, b? -2/13 Suppose -5i - 80 = 4z - 31, 5z + 3i + 45 = 0. Which is the second biggest value? (a) 1 (b) z (c) -2 c Let x be 12/9 - 4/(-6). Let j be 1 + 0 - 12/x. Let l = -0.4 - -0.1. Which is the third biggest value? (a) 3 (b) j (c) l b Let r = 4.67 - 4.4. Let a = r - -2.13. Let b = a + -0.4. What is the biggest value in 4, -1, b? 4 Let n = -33/4 + 17/2. Let g = -7 - -11. Suppose 3v - 5 = g. Which is the second smallest value? (a) n (b) v (c) -3 a Let x = 4.79 + -2.8. Let f = 0.01 + x. What is the third biggest value in f, -0.4, 4? -0.4 Let p = -33.99 + 32. Let d = p - 0.01. Let q = d - 1. What is the second biggest value in 3/5, 2, q? 3/5 Let m be (-4 + 25/(-5))/((-66)/(-4)). What is the third smallest value in -3, -3/7, m, -0.2? -3/7 Let l = -124.99 - -124. Let g = l + -0.01. Which is the smallest value? (a) 5 (b) g (c) -2 c Let q = 3 + -14. Let h = 6 + q. What is the third biggest value in -2/3, h, 1/2? h Let n = -11.9 + 1.9. Let i = n + 9. Which is the third biggest value? (a) 4/3 (b) 0.2 (c) i c Let h = -21.4 - -18. Let p = -3 - h. Which is the biggest value? (a) -1 (b) p (c) -0.1 b Suppose 2b - 15 = 5b, b = 4r - 21. What is the third biggest value in 0, -8, r? -8 Let d be (10 + -13)(-5)/(-3). What is the fourth smallest value in d, 4/3, -4, -3? 4/3 Let j = -0.24 + 7.24. Let g = 2 - j. What is the second smallest value in 3, 5, g? 3 Let b = -18.5 + 20. Let p = -1.5 + b. What is the third biggest value in 0.5, -1, p? -1 Let n = -39 - -41. Which is the second biggest value? (a) n (b) -4 (c) -1 c Let x = 19.71 - 26.6. Let n = -0.11 + x. Let l = n - -8. What is the third smallest value in -1, l, 0.2? l Let j be (3/6)/((-7)/4). Let g = -997/5 - -200. What is the biggest value in 5, j, g? 5 Let k be (-2 + (-19)/(-10))-2. Suppose -3s - 2s - 130 = 0. Let n = s + 180/7. What is the second smallest value in -1/5, n, k? -1/5 Let i be 4 + (0/(-4) - 0). Suppose -2n - 5 = -c, 2n = -2n - 4c + 20. Let j = -4.02 + 0.02. What is the third smallest value in n, j, i? i Let b be 6/(-10) - (-33)/30. Let g = 5 - 7. What is the biggest value in b, g, 2? 2 Let d be (-3)/(-4)(-5)/(-3). What is the second smallest value in 2, -1/3, d? d Suppose -2i - 4w + 17 = -w, -3i + 3w = 12. Suppose 0m - m - i = 0. What is the third biggest value in -4/7, -4, m? -4 Let i = 261 - 237.4. Let h = 29 - i. Let m = 5 - h. Which is the smallest value? (a) m (b) 3/8 (c) -5 c Let f be 1/12 - (-6)/9. Let x be -8 + 3 + 25. Which is the third smallest value? (a) 3/8 (b) f (c) x c Let q = 5 - 7/2. Suppose -u - 5 = -3l + 9, 5l = -3u. Which is the third biggest value? (a) 1 (b) l (c) q a Let q = 1.6 + -1.2. What is the third smallest value in -5, q, -2/5? q Let w = -81 - -159/2. Let a = -1 - -1. What is the third smallest value in w, a, 3? 3 Let n = 0.8 - 0.3. Suppose 3o + 60 = 5t - 24, 0 = -4t + 2o + 66. Let k be t/20 + 49/(-76). What is the second biggest value in n, k, 5? n Let u = 26.9 + -27. Let q = -2.5 - -0.5. What is the third smallest value in u, 0, q? 0 Let h = -1 + 0. Let n be 18/(-27)(-12)/14. What is the second biggest value in 2, h, n? n Let u be 16/(-6)(-11062)/(-14). Let a = 2108 + u. Let z = 9/7 - a. What is the third smallest value in -1, z, 0.1? z Let k = 2 + 6. Let w = k - 8.09. Let v = w - 0.91. What is the second biggest value in v, 3, -3/2? v Let v = 0.11 + -0.31. Let f be (-3)/6 + 4/2. What is the second biggest value in v, f, 2? f Let x = -2.017 + 0.017. Which is the fourth smallest value? (a) 2/5 (b) x (c) 5 (d) -5 c Let w = 6.6 - 3.6. Which is the second smallest value? (a) -1 (b) 0.2 (c) w (d) -2 a Let l(n) = 3n - 17. Let m be l(5). Which is the fourth smallest value? (a) -0.4 (b) 5 (c) m (d) 2 b Suppose 0 = -3r + 2r - 18. Let n = -13 - r. Suppose 5o + 4 + 1 = na, -8 = 5o - 4a. What is the second biggest value in o, 4, -2/13? -2/13 Let h = -0.26 + -0.14. Let d = -0.3 - 1.7. Let z be (-2)/(-7) - 25/14. What is the second biggest value in h, z, d? z Let s = -0.39 - 0.01. Suppose -2u + 5q - 11 = 0, -u - 4q = -15 + 1. Which is the third smallest value? (a) -1 (b) s (c) u c Let p be 0 + -102/(-4). Let m be 0 - 75/(p + -2). Let l = 51/2 + m. Which is the third biggest value? (a) l (b) -2 (c) -0.3 b Let s = -1 - 2. Let k = 0.094 + -5.194. Let d = -0.1 - k. What is the biggest value in -4, d, s? d Let f be (-2 + 1)/(1/(-3)). Let j(t) = -t*2 + 4t. Let i be j(f). Let v be (i/(-18))/((-2)/(-4)). Which is the second smallest value	{ "pile_set_name": "DM Mathematics" }
-5)bb(2/7))(1/39) assuming b is positive. b(118/819) Simplify ((t/(t/(t(-1/6)tt)))/(tt(2/11)))/((ttt/(t/t(-1/3)))/(tt(3/4))) assuming t is positive. t(97/132) Simplify (j(3/14)/j)(-7/6)/(j/j*(2/15)j4) assuming j is positive. j(-79/20) Simplify (i/(iiii/(ii*(-3)/i))ii/(((i0/i)/i)/i)i)/(i*(2/7)i12) assuming i is positive. i(-86/7) Simplify l*24l*(-4/17)(l/(l*2l)l)11 assuming l is positive. l(217/17) Simplify (l(l(1/4)/l)/l)/l(-6/7)(l/(l/(ll*(1/13)))l)/((ll(5/2))/ll) assuming l is positive. l(-479/364) Simplify u(-9/2)((u/((u/(uu/(uuu*(1/7))))/u))/u)/uuu(u(-3/11))32 assuming u is positive. u(-1905/154) Simplify (((y(1/4)y)(-4/7))26)10 assuming y is positive. y(-1300/7) Simplify ((g(-7/6)g)/((gg(-2/151))/g))/(gg(1/13))(5/12) assuming g is positive. g(-1182/1963) Simplify ((l(1/8)l(-2/13))27)1 assuming l is positive. l(-81/104) Simplify ((v/v4vvv/v*8vv)/((vv*(-4))/((vv(-1/4))/v)))(-3/46) assuming v is positive. v(39/184) Simplify (z(-2/17))*(-4/7)z8/(z(-3/8)/z) assuming z is positive. z*(8989/952) Simplify (aa/a*(-9)a)*(-2/73)a*(-3/22)a3/a assuming a is positive. a(2465/1606) Simplify s*16/ss(sss/(s/s(-2/5)))/s(s3)(-39) assuming s is positive. s(-502/5) Simplify (a(-3/4))*(4/3)/(((aa/(aaa*0)a)/a)/a)(3/35) assuming a is positive. a(-32/35) Simplify ((k*(-2)k)/k)(7/8)/(k(-2/25)/(k/(k*11k))) assuming k is positive. k(-1267/100) Simplify ((p/((p(-5)/p)/p))/p)*(2/79)p*(-22)p/((p*(-1/22)p)/p) assuming p is positive. p(-36111/1738) Simplify (l(-1/5))*(-17)l(-9)/l18 assuming l is positive. l(-118/5) Simplify (b(-3/5))*(-6/11)(bb/b(-20/9)b)/(bb16) assuming b is positive. b(-5668/495) Simplify (t(-1/2)/t(-1/4)(ttt(-2/3))(3/7))(-27) assuming t is positive. t(-243/28) Simplify (((s/s11)/s(5/4))48)13 assuming s is positive. s(-7020) Simplify ((s0)36/((((((s(-2/7)/s)/s)/s)/ss)/s)/s(-2/9)))34 assuming s is positive. s(8704/63) Simplify (o((o/(o*(2/15)/o)o)/oo)/oo)/o*(-3)o*(-14)o/o17 assuming o is positive. o(-347/15) Simplify (a*(2/11)aa)(-1/8)a*(-5)a(aaa(-1/2))/aa assuming a is positive. a*(-61/22) Simplify (k/(kk*(-3)kk))4/(k(-1/12)k/k*(-9)kk) assuming k is positive. k(-95/12) Simplify (((uu/u*(-9))/(u/(u/(uu/(((uu(7/3)uu)/u)/u)u))))49)23 assuming u is positive. u*(38318/3) Simplify ((x/(xx*3/x)x)/(x(xx/(xx(1/10)))/xx)(x(-2)/x)/x(-7/3))(-26) assuming x is positive. x(1391/15) Simplify (ffffff*(1/24)ff16)/(f2/f)47 assuming f is positive. f(-599/24) Simplify (x(-26)/x)/(x(1/38)/x)(x/(x*(-10)x))/(xx(-4)) assuming x is positive. x(-495/38) Simplify dd*(-5)/dd/(d/d*(1/6))d*(-1)dddd(-14) assuming d is positive. d(-101/6) Simplify (c(6/7)/c)(-24)(cc(-1/7))/cc/(c/(c/c12)) assuming c is positive. c(-54/7) Simplify (((u((uu/(u/(uu(-5/6)u)))/u)/u)/u)/u)/(uu31)(u(-1/2)/u)(12/5) assuming u is positive. u*(-1093/30) Simplify ff*(1/4)/fff(1/6)/f(f/((f/f*(-2/3)f)/f))/ff/(ff(7/3)) assuming f is positive. f(-43/12) Simplify ((x*9/x)/xxx((x*(1/2)/x)/x)/xx)/((xx/(xxx(-3)))/x(-1/6)) assuming x is positive. x(13/3) Simplify ((((v/((v/v(-13))/v))/v)/v2)(-1/30))(-41) assuming v is positive. v(-41/2) Simplify (x6/xx/(xxxx22x))/(x/(x*28/xx)x/(x(-2/61)xxx)) assuming x is positive. x*(547/61) Simplify (((gg/((g*(-2/7)g)/gg))/gg)/(g/g*(-14)g))/(gg/g(4/11))13 assuming g is positive. g(-2771/77) Simplify (d8/d(-1/4))/(d4d)(-22/7) assuming d is positive. d(671/28) Simplify i*0/iiiii(-1)/ii((i(-3)/i)/i)(-2/7) assuming i is positive. i(17/7) Simplify (a/(a/a(4/3)))(-43)/((aa*(-17/3))/(aa*(-20)/aa)) assuming a is positive. a(-215/3) Simplify m(-10)m(11/2)mmm*(-1)m((mm/m*(5/2))/m)/mm assuming m is positive. m(-4) Simplify ((c(1/20)/(c/(((cc/c(-1/5)c)/c)/cccc)))(1/9))10 assuming c is positive. c(65/18) Simplify u(1/3)/uu*(-6/7)(uu(-16))/((uu/(u/(u/(u/(u/(uuu/u*(-2/51))))))u)/u) assuming u is positive. u(-5528/357) Simplify q6q(-12)(q(3/7))(-30) assuming q is positive. q(-132/7) Simplify (b2bb)(-1/24)/(b/(b10/b)bbb(-2/13)) assuming b is positive. b(467/78) Simplify (kk/(k*(-1/15)k))(-37)/(k/(k(-3/8)k))(-6) assuming k is positive. k(-2233/60) Simplify (p(-2))(-31)/(p4(pp(-4/7))/p) assuming p is positive. p(410/7) Simplify (n(-12)/(nn*20))/(nn(-11))(-1/3) assuming n is positive. n(-109/3) Simplify ((n/n(-11))/n)(-1/6)/(n7n/(n/((n(-23)n)/n)nn)) assuming n is positive. n*(97/6) Simplify ((zz6)(-6))37 assuming z is positive. z(-1554) Simplify ((f/(ff/f(1/42)))(1/69))(-2/85) assuming f is positive. f(41/123165) Simplify ((a(-2)/(aa*(-5)a))/(((a/a*2)/aa)/(a/a*(-2/19)a)))(-3/19) assuming a is positive. a(-234/361) Simplify (n*(-6)n*11)/((nn*10)/nn)(-1/7) assuming n is positive. n(46/7) Simplify (a(-4/15))(-1/13)(a/(a/(a/a(-2/3))))39 assuming a is positive. a(12679/195) Simplify o(5/6)/ooo(-15)o*(5/7)/(o/(oo/o*(-3/7)oo)) assuming o is positive. o(-421/42) Simplify ((y/y(3/26)y)/y)*(-24)y/y*(3/7)yyy26 assuming y is positive. y(668/91) Simplify ((((vv/(vv/(v*4v)v))/v)/(v(vvv(-2/9))/v))/((v/(v(-1/5)v))/v(-4/3)))(-30) assuming v is positive. v(28/3) Simplify (s/s(2/13))/s(-1/26)(ss(-6/11)/s)31 assuming s is positive. s(-4583/286) Simplify (q(-5)/(q(2/13)q))/((q*(1/16)q)/q(2/23)) assuming q is positive. q(-34107/4784) Simplify m/m*(-4)(m*(-1/15)m)/m(mm*(-7)m)12 assuming m is positive. m(-826/15) Simplify (h(-5))35/((h/(h/(hh/(h/h(2/9)))))/h)2 assuming h is positive. h(-1579/9) Simplify y13/y3(y*(-1/7)y)(-45) assuming y is positive. y(-200/7) Simplify ((i/i*(-2/11)ii1/i)/(((ii*5i)/i)/ii(-1/2)))33 assuming i is positive. i(-153/2) Simplify (u(-1/24)/(u/u2))/((u(-5)/u)/u)(-7/11) assuming u is positive. u(-923/264) Simplify (u7/(u/(u/u(2/43))))/(u(8/9)uu15) assuming u is positive. u(-3845/387) Simplify (((kk(-3/8))/k)/k(-1/32))/(k(-1)/k)(-4) assuming k is positive. k(-267/32) Simplify (d(-1/2)/(d/(d/(d*3dd))))/(d(-15)/(d((d*(4/3)d)/d)/d)) assuming d is positive. d*(65/6) Simplify ((uu/(u*(-7)/u))/((uu(-2/113))/u))29 assuming u is positive. u*(32828/113) Simplify ((xxx(3/7)xx)/(x(-2/17)x)x(-13)/(xx*(-5/2)x))7 assuming x is positive. x(-2131/34) Simplify ((c(1/2))(-36)(ccc6c)/c(2/11))(-35) assuming c is positive. c*(3535/11) Simplify ((vv(((((v/(v/(v/((((v(2/5)vv)/v)/v)/v))))/v)/v)/v)/v)/vvv)23v*(-3/5)v(-7))(1/5) assuming v is positive. v(31/25) Simplify l25l/l(1/3)(ll29)/(l(-28)l) assuming l is positive. l(248/3) Simplify (h/(h0h))(-1/29)/((h(hhh/(h(hh*11)/hh))/h)/(h/(h/(h/(h*(3/10)h)))h)) assuming h is positive. h(107/10) Simplify u(13/3)u*(9/2)/uu(u18)4 assuming u is positive. u(485/6) Simplify (o(-1)o(-2/15))/((o/o(-6)o)/((o/((o(-3)/o)/o)o)/o)) assuming o is positive. o*(-47/15) Simplify yy*(-4/7)yyy*(-12)/yyy(-7)yyy*10y assuming y is positive. y*(-25/7) Simplify (oo*(-5/3)o)31/(o(3/13)/(o/o(-18))) assuming o is positive. o(1135/39) Simplify ((a(-3/4)/a(2/3))(-4/33))33 assuming a is positive. a(17/3) Simplify (q(-12)/(q(-2/13)/q))/((q(-16)q)/q(5/7)) assuming q is positive. q(443/91) Simplify (((n/n6)/nn(-5))/((n/n(-2/13))/n2))(-28) assuming n is positive. n*(3696/13) Simplify (gg*(-8)gg/g(-2/29))/((g/(gg/g*(-1)g))/g)(-39) assuming g is positive. g(-4667/29) Simplify (jj(-1/6)j*(-1/16)j)/((j/j*(3/5))/jj8/j) assuming j is positive. j(-1111/240) Simplify (aa(-2/17)a)*14(a(-11))12 assuming a is positive. a(-1796/17) Simplify (d(2/33)/d*(-3)(d/((d/(dd*(4/5)	{ "pile_set_name": "DM Mathematics" }
tive of 5611212l4 - 88232l + 32 wrt l? 67334544l2 Find the second derivative of -3787125n*5 + 10n*4 - 182376727n wrt n. -75742500n3 + 120n*2 Differentiate -339m*2r*2 + 5m*2 - 2mr - 10425m - 752r wrt r. -678m*2r - 2m - 752 Differentiate 15969501r*2 - 25298232 with respect to r. 31939002r Find the third derivative of -1730424d3l*2 + 2d*3 - 2d*2l*2 + 6d*2 + 3dl2 + 17055l wrt d. -10382544l2 + 12 What is the second derivative of -1167356919c*2r*2 + 355cr2 + 2658c - 2r2 wrt c? -2334713838r*2 Find the second derivative of 18883345i*3 + 488889i. 113300070i What is the third derivative of ry*4 + 3270ry3 + 498209ry2 + 2ry + y4 + 202y*3 + 8y*2 + 4 wrt y? 24ry + 19620r + 24y + 1212 Find the first derivative of 603125443r - 406164848 wrt r. 603125443 Find the second derivative of -7504p2s*3 - 555p*2s*2 + 3738037ps3 - ps*2 wrt p. -15008s*3 - 1110s*2 What is the second derivative of -19761554gh2 - 2gh + 105582g + h*3 - 2h - 2 wrt h? -39523108g + 6h Differentiate -2h2 + 26ho + 472154h + 195237806o wrt h. -4h + 26o + 472154 What is the derivative of -d2o - 200004d2 - 15do - 262231209o wrt d? -2do - 400008d - 15o Find the second derivative of -11085390r2 - 4805954r. -22170780 Find the third derivative of -1043825522i3j*2 + 6i*2j*2 + 5i*2j - 3ij*2 - 526i - 32j - 3 wrt i. -6262953132j*2 Differentiate -3262734y*3 + 3y*2 - 13y + 291815139. -9788202y2 + 6y - 13 What is the second derivative of -147121ks*3 - 34ks2 - 2897855ks - 34k - 2s3 - 1 wrt s? -882726ks - 68k - 12s Find the second derivative of -67744h*4 - 135h*2 + 3004h - 115. -812928h2 - 270 What is the third derivative of -86fn5 - 3fn4 - fn*2 + 4f - 199n4 + 1324n*2 - 188n + 2 wrt n? -5160fn*2 - 72fn - 4776n Find the first derivative of 3780467kz + 17122802k wrt z. 3780467k Find the second derivative of 101514393s3 - 110197695s wrt s. 609086358s Find the first derivative of -5bo2 - 272667bo - 16b - 2972o2 - 11576 wrt b. -5o*2 - 272667o - 16 Differentiate -5470918v3yz + 3vy + 13yz - y - 757196 with respect to v. -16412754v*2yz + 3y Find the third derivative of 97a2f*3 - 41379068a*2f*2 + 4af3 - 5153f*3 wrt f. 582a*2 + 24a - 30918 Differentiate -48571427w + 84063161. -48571427 Differentiate 127649dg3 + 37d + 24330g3 + 54g with respect to d. 127649g3 + 37 What is the second derivative of 29f*2o*2 + 3f*2o - f*2 - 12098fo2 - 2fo - 5o*2 - 3o + 167 wrt o? 58f2 - 24196f - 10 What is the third derivative of -3d2r*4 + 2d*2r*2 - 22d*2r + 144dr - 1060133r5 + 4r*2 wrt r? -72d*2r - 63607980r2 What is the third derivative of 4524962u*4 - 117u*3 - 388608907u*2 wrt u? 108599088u - 702 What is the second derivative of -67682032z5 + 127279804z wrt z? -1353640640z3 Find the second derivative of -10478666h*5 + 12601916h. -209573320h3 Differentiate 699560f - 1400179. 699560 What is the derivative of 72aj*2x + aj2 - 1068aj - ax + 535a - 18x - 555 wrt j? 144ajx + 2aj - 1068a What is the second derivative of 24668996x2 - 27587531x? 49337992 What is the first derivative of 449170q4 + 2q*3 + 5977803 wrt q? 1796680q*3 + 6q*2 What is the first derivative of 359127882j - 116288429? 359127882 Find the second derivative of -264695943h2 + 127461923h wrt h. -529391886 Differentiate 5g3s*2v - 8181g3s - 140gs*3 - 163228s*3v with respect to v. 5g3s*2 - 163228s*3 What is the third derivative of 43v*3x*3 - 2810940v*3 - 49v*2x*3 + 6v*2x*2 - 4v*2x - 2v + 2x*3 - 216x*2 wrt v? 258x*3 - 16865640 What is the derivative of -33685785l - 591132671 wrt l? -33685785 What is the second derivative of -24186306g2j*3 + 3g*2j - 4g2 - 6gj5 - 5gj + 32g + 15j + 2 wrt j? -145117836g*2j - 120gj*3 Find the third derivative of -2615484t*4 + 276850t*2 - 3t + 5 wrt t. -62771616t Find the third derivative of -u6 - 4043u*4 + 1578u*3 - 402u*2 + 20u + 79 wrt u. -120u3 - 97032u + 9468 What is the third derivative of -6531530j5 - 772940j*2 wrt j? -391891800j*2 What is the second derivative of 51209976i*3o*4 + 19164i*3o - 2o5 - 35o wrt o? 614519712i3o*2 - 40o*3 Differentiate 47981263d + 48099221. 47981263 What is the third derivative of 2167j3o*3 + 9j*3o + 13j2o*2v + 7jo*2v - 5jo*2 + 5jov - 413o3v wrt o? 13002j3 - 2478v What is the derivative of -70558915i + 24493841? -70558915 What is the third derivative of 105930637j3 + j2 + 73894139? 635583822 What is the first derivative of 19759890i + 131380771 wrt i? 19759890 What is the third derivative of -12759743a*5 + 442a*2 + 13a - 5? -765584580a2 Find the third derivative of 4811146i*3o*3 - 41i*2o + 126i - 2o*3 + 8o - 1 wrt i. 28866876o3 Differentiate -14137966l*4 - 8129079. -56551864l*3 Find the first derivative of -13752825t*2 - 23189192 wrt t. -27505650t Find the third derivative of 782s3wx - s3w + 51s3x + 8s3 + 2s*2wx + 7s*2w + 5s2x + 2swx + 12sw - 8sx - 23 wrt s. 4692wx - 6w + 306x + 48 What is the derivative of -11360468a*2s + 6a2 - 9513213s wrt a? -22720936as + 12a What is the third derivative of -29968609l*4s*2 - 5l*2s + l*2 + 929ls - s2 - 2s - 1 wrt l? -719246616ls2 What is the second derivative of -x5 - 129569145x2 + 124x + 1664129 wrt x? -20x3 - 259138290 Find the first derivative of -109tx2 + 76tx + 233305623t + 61x2 - 2x wrt x. -218tx + 76t + 122x - 2 What is the first derivative of -203100861i3 + 643018553? -609302583i*2 Find the third derivative of -3d*5 - 4d*4 + 15469d*3 + 4d*2 + 23d + 3046 wrt d. -180d2 - 96d + 92814 What is the second derivative of -6993247r4 + 2504593r - 1 wrt r? -83918964r2 Find the third derivative of -24841806m*6 + 18531166m*2 wrt m. -2981016720m*3 Find the second derivative of -26h*2vy + 11h*2v - 127761h2y - 1203hvy + 649hv + 10hy - v wrt h. -52vy + 22v - 255522y What is the third derivative of -38767t*6 + 113t*5 + 169t*2 + 6897t - 4 wrt t? -4652040t3 + 6780t*2 Find the second derivative of 2241529o*4 - 581o + 33. 26898348o2 Differentiate -1222561320k*4 + 283650027. -4890245280k*3 What is the derivative of 4q*3 + 730782q + 4009971? 12q2 + 730782 What is the second derivative of -76b*3 + 333984b*2 + 3b + 14438239? -456b + 667968 Find the second derivative of -4289019i*2 + i - 21341 wrt i. -8578038 What is the third derivative of 4645886j*3 + 2j*2 - 230j + 4158? 27875316 What is the first derivative of 333125590vy + 3y + 12750404 wrt v? 333125590y Find the second derivative of -10903750af*2 + 4462af + 5a + f + 9 wrt f. -21807500a Find the first derivative of -16378179j*3 - 20129807. -49134537j*2 Find the third derivative of -82866661m*3 + 18m*2 - 146800m wrt m. -497199966 Find the third derivative of 60987145i3 + 140621i*2 - 2i + 8. 365922870 What is the third derivative of -12z5 + 9628849z*4 + 7702z*2 + 562z wrt z? -720z2 + 231092376z What is the third derivative of -111580d3v*4 + 23d*3v - 590640dv*2 + 13v*5 wrt v? -2677920d*3v + 780v2 Find the second derivative of 368116425u*2 + 133974658u. 736232850 What is the first derivative of 133860191j2 - 2j - 317968114 wrt j? 267720382j - 2 Find the second derivative of -11396097jn3 - 33516jn - 225j wrt n. -68376582jn What is the second derivative of 52352193a3v*3 + 2av - 112a - 25081v3 wrt a? 314113158av3 Find the third derivative of 36794461t*4 + 2t*2 + 118702802. 883067064t Find the second derivative of 10j3 + 2598j*2 - 3219972j wrt j. 60j + 5196 What is the second derivative of -52534610f*2 - 31599f + 200 wrt f? -105069220 Differentiate 2d4 - 2522694d*3u + 2d2 - 1734254u + 3 with respect to d. 8d3 - 7568082d*2u + 4d Find the second derivative of 9751345r*2 - 13481321r. 195	{ "pile_set_name": "DM Mathematics" }
+ 753j2. 56j*2 + 1 Collect the terms in 0n*3 + 158n - 343299 + 343299 - 158n + 2n*3. 2n*3 Collect the terms in -101 + 53 + 48 + 9i + 6i. 15i Collect the terms in 26p - 36p - 26p + 54p. 18p Collect the terms in 2304001 - 2304001 + s. s Collect the terms in -50699n + 101405n + 5n*2 - 50706n. 5n2 Collect the terms in 5 + 42f*3 - 5 + 606f*3. 648f*3 Collect the terms in -17 + 42 - 25 + 312m*3. 312m*3 Collect the terms in -99y*3 + 17y*3 + 36y*3 + 27y*3. -19y*3 Collect the terms in -17828u*3 - 22u*2 + 8917u*3 + 8915u*3 - 3u*2. 4u*3 - 25u*2 Collect the terms in 124492 - 124492 - 15v*2. -15v*2 Collect the terms in -12u*3 + 7u*3 + 4u*3 + 0u*3 - 11u*3. -12u*3 Collect the terms in 715r + 48 - 715r - r2. -r2 + 48 Collect the terms in -8y*2 - 3330 + 9y2 + 3310. y2 - 20 Collect the terms in -3n + 28n - 37 - 282 + 319. 25n Collect the terms in 76z - 2z3 - 145z + 80z. -2z*3 + 11z Collect the terms in 15c - 3429c*3 + 24c - 48c + 9c. -3429c3 Collect the terms in -140j + 300j - 164j + 12. -4j + 12 Collect the terms in -5g - 28g2 + 0g*2 - 43g*2. -71g*2 - 5g Collect the terms in 0l3 + 123l*2 - 2l*3 - 498l*2 - 39l*2. -2l*3 - 414l*2 Collect the terms in 94m*3 - 14m*3 + 234m*3 + 226m*3. 540m*3 Collect the terms in -24212f - 3f3 + 24212f. -3f3 Collect the terms in -54 + 54 - 1664z + 1704z. 40z Collect the terms in 1859560076 + 11q - 1859560076. 11q Collect the terms in 303h + 311h - 610h. 4h Collect the terms in 6t3 - 48424t*2 + 48424t*2. 6t*3 Collect the terms in 3y*2 + 6546184y - 6546184y. 3y*2 Collect the terms in 4d + d - 5344 + 2659 + 2685. 5d Collect the terms in -18 - 278u + 6 + 7 + 5. -278u Collect the terms in 12t*3 + 50t*3 - 53t*3. 9t*3 Collect the terms in -236h*3 + 1250h*3 + 113h*3. 1127h*3 Collect the terms in -5438163 + 16m*2 + 5438163. 16m*2 Collect the terms in -66y*3 - 160167 + 160167 + 70y*3. 4y*3 Collect the terms in 40794i - 4 - 40795i + 25. -i + 21 Collect the terms in 66f + 67f + 67f + 71f - 333f + 66f. 4f Collect the terms in -13w2 + 8w*2 - 3w - 2w2 - 148w*3 + 3w. -148w3 - 7w*2 Collect the terms in -13s*2 + 3s + 2s - 7s - 3s2 - 42. -16s*2 - 2s - 42 Collect the terms in -z + 4z - 10z + 2z + 0z. -5z Collect the terms in 11x*2 - 200x*3 - 7x*2 - 4x*2. -200x*3 Collect the terms in -2836q*3 - 2q + 4q + 467q*3. -2369q*3 + 2q Collect the terms in -2051 - 1244o3 + 2051 - 1321o*3. -2565o*3 Collect the terms in 40v - 740 + 1377 - 637. 40v Collect the terms in 2350h*2 + 2344h*2 - 3 - 4672h*2. 22h*2 - 3 Collect the terms in 32 - 2 - 12 + 263p - 2 - 12. 263p + 4 Collect the terms in -16 + 17 - 3n + 3n - 130n*2. -130n*2 + 1 Collect the terms in -274k*2 - 258 - 856k*2 + 258. -1130k*2 Collect the terms in 39711u - 19821u - 19699u. 191u Collect the terms in -580v*2 + 361 + 2437v*2 - 363. 1857v*2 - 2 Collect the terms in -34q - 17q - 15q*2 + 45q*2. 30q*2 - 51q Collect the terms in -40 - 4t + 83 - 43 + 2t3 + t2. 2t3 + t2 - 4t Collect the terms in 3k3 - 2k*3 + 335k*2 + 3k*3. 4k*3 + 335k*2 Collect the terms in 4n*3 - 3231399n*2 + 1615693n*2 + 1615706n*2. 4n*3 Collect the terms in -51a*2 - 10a - 10a + 2a + 19a - a. -51a*2 Collect the terms in 0 - 8x + 2 + 1 - 1. -8x + 2 Collect the terms in -33 - 9 - 39j - 6j2 - 40 + 4j*2. -2j*2 - 39j - 82 Collect the terms in 38 + 2593z - 38 + 10z*3 - 2593z. 10z3 Collect the terms in -2p - 2012699 + 75p2 + 2012699. 75p*2 - 2p Collect the terms in -300 - 341 + 1006 + 4w2 - 365. 4w*2 Collect the terms in -108870l*2 + 1 + 108857l*2 - 1. -13l*2 Collect the terms in 4f - 23 + 95 - 31. 4f + 41 Collect the terms in -5u*3 + 18u*3 + 48u*3 + 32u*3 - 16u*3. 77u*3 Collect the terms in 127744l*2 - l - 127737l*2 + l. 7l*2 Collect the terms in 3277a - 3277a + 226a*3. 226a*3 Collect the terms in 895798 - 895798 + 184c. 184c Collect the terms in 383m*2 - 1817m*2 + 1432m*2. -2m*2 Collect the terms in -7 - 107s*2 + 8 - 33 + 130s*2 - 26s*2. -3s*2 - 32 Collect the terms in -9t - 19t + 28t - 5 + 47t2. 47t*2 - 5 Collect the terms in 338a*2 - 631a*2 + 293a*2 - 8a*3. -8a*3 Collect the terms in 17608i + 300081i + 81948i + 7825i. 407462i Collect the terms in -15268 + 15268 - 189j. -189j Collect the terms in -2r3 + 108316158 - 108316158. -2r*3 Collect the terms in 43s - 44s - 233s. -234s Collect the terms in 80u - 182u + 88u - 4 + 4. -14u Collect the terms in 10a*2 - 19 + 19 + 25a*2 - 20a*2 - 13a*2. 2a*2 Collect the terms in -27x*2 + 46x - 56x + 10x - 10x3. -10x*3 - 27x*2 Collect the terms in 55q + 63q - 14q - 21q. 83q Collect the terms in -88356p2 + 44173p*2 + 44166p*2. -17p*2 Collect the terms in -54 + 18 + 18 + 18 - 14y*2. -14y*2 Collect the terms in -19j*2 - 14j*2 + 29 + 53j*2 - 29. 20j*2 Collect the terms in 13o - 294 - 3o - 15o. -5o - 294 Collect the terms in 174 + 5u - 697 + 48. 5u - 475 Collect the terms in 1279c + 2850c + 2768c - 1512c. 5385c Collect the terms in -2l + 41l*2 - 22l*2 + l + 20l*2. 39l*2 - l Collect the terms in -1015 - 11w - 6w + 9w. -8w - 1015 Collect the terms in 2b + 26706b2 - 26706b*2 + 65b*3. 65b*3 + 2b Collect the terms in 14n3 - 329226128n*2 + 329226128n*2. 14n*3 Collect the terms in 64 + 8489n*2 - 64 - 630n*2. 7859n*2 Collect the terms in 0 + 0 + 53131c*2. 53131c*2 Collect the terms in -91v + 210v + 103v - 24. 222v - 24 Collect the terms in -11z - 168z + 349z - 166z. 4z Collect the terms in -88a + 135a + 79a + 32a. 158a Collect the terms in -35o + 376o + 54o + 3o2 + 575o. 3o2 + 970o Collect the terms in -22766k3 + 19 - 19 - 8729k*3. -31495k*3 Collect the terms in 2y - 119181 + 6y - 3y - 3y. 2y - 119181 Collect the terms in -32n2 - 31n*2 + n + 62n*2 - 160n*3. -160n3 - n2 + n Collect the terms in 213r3 + 5r + 1013r3 + 2 + 137r*3 - 7r. 1363r3 - 2r + 2 Collect the terms in -75 - 12i + 19 - 72i*2 + 12i. -72i2 - 56 Collect the terms in -12 - 20 + 35 - 2321y. -2321y + 3 Collect the terms in 379b*3 + 397b*3 + 400b*3 + 2b - 2b - 1180b*3. -4b*3 Collect the terms in 15n + 18n + 7n - 52n. -12n Collect the terms in 4q3 + 2595 + 5q*3 - 2602 - 4q*3. 5q*3 - 7 Collect the terms in 0 + 0 - 35377z. -35377z Collect the terms in -10m + 0m - 10m + 19m - 6m. -7m Collect the terms in -170264h*2 + 17h*3 - 4h*3 + 170269h*2. 13h*3 + 5h*2 Collect the terms in -486z + 1984z - 483z - 496z - 499z. 20z Collect the terms in 674z + 9z2 - 837z + 163z. 9z*2 Collect the terms in -143b + 956b + 770b - 58b. 1525b Collect the terms in 305g2 - 26441g + 26441g - 5g*3. -5g*3 + 305g*2 Collect the terms in 2j - 153 - 246 + 88 - 161. 2j - 472 Collect the terms in -704o*2 - 201640 + 201640. -704o*2 Collect the terms in 2o*3 + 1915 + 9o*3 - 3830 + 1915. 11o*3 Collect the terms in 0f - 21f + 1168 - 1170 + f - f. -21f - 2 Collect the terms in 1269y + 1141y - 2308y. 102y Collect the terms in -9 + 116i2 + 28i + 27i + 4i - 118i2. -2i*2 + 59i - 9 Collect the terms in 34786420 - 34786420 + y3. y3 Collect the terms in -2m + 71 + 9 + 0m. -2m + 80 Collect the terms in 30367202 - 30367202 + 18z. 18z Collect the terms in 85570v*3 + 7 - 7 - 85648v*3. -78v*3 Collect the terms in -268q + 816q - 272q - 273q. 3q Collect the terms in 3f - 6184884 + 6184884 - 10f*2 - 3f. -10f2 Collect the terms in 254a + 5 + 7 - 539a - 12. -285a Collect the terms in 54728c3 - 109428c*3 + 54715c*3. 15c*3 Collect the terms in 3y*2 - 2177541 + 2177541. 3y*2 Collect the terms in 5q + q*3 - 2339 - 5q + 2339. q*3 Collect the terms in 20333i - i*2 - 120 - 20333i. -i*2 - 120 Collect the terms in 0q2 - q2 + q*2 - 353q*3 + 2q + 365q3. 12q*3 + 2q Collect the terms in -888767*c - 12 + 15 - 3 + 888756	{ "pile_set_name": "DM Mathematics" }
vative of 3326f3 + 134f*2 + 4569856f? 19956f + 268 What is the third derivative of 106668k*3 + 72694k*2? 640008 What is the derivative of -3l*3r - 1668l3 + 32211l*2r2 + l2 + 3 wrt r? -3l3 + 64422l*2r Find the second derivative of -108333dk*3q*2 - 10dk2q + 2k3q - 1891q wrt q. -216666dk3 What is the second derivative of 4gl3 - 9gl2 - 5gl - 8066l*3 - 461435l wrt l? 24gl - 18g - 48396l What is the derivative of -64i2o*2p*2 - 4i*2 - 240o*2p - 2o2 + 2499o wrt p? -128i2o*2p - 240o2 Find the first derivative of 8901j*3y - 2j2y - j - 48320y wrt j. 26703j*2y - 4jy - 1 What is the derivative of 3411fw - 58816f + 6w wrt w? 3411f + 6 Differentiate -139773r - 215305. -139773 What is the derivative of -75724v2 + 43166 wrt v? -151448v Find the first derivative of 4kno2 - kn + 5k + 23no3 + 8no2 + 57n wrt o. 8kno + 69no2 + 16no What is the third derivative of 11f*5g - 8f5 - 75f*3g + f*2g + 8f - 65g wrt f? 660f2g - 480f2 - 450g What is the third derivative of 5092897o6 - 2020o*2 + 2o + 455 wrt o? 611147640o3 What is the third derivative of 2a*2p*3t + 4a2p3 + a2p2t - 2a2p + 58ap*3 + 34a wrt p? 12a2t + 24a2 + 348a Differentiate 8g2 - 175g + 48644 with respect to g. 16g - 175 Find the first derivative of 2bj3 + bjk - 397bk - 2b - 73j3k + 50jk - k wrt b. 2j3 + jk - 397k - 2 Find the third derivative of 212b*3u*4 + 22b*3u*2 + 29b*2u*4 - 3b*2u2 - u2 + 4 wrt u. 5088b3u + 696b2u Find the second derivative of -6595328w2 - w - 92661 wrt w. -13190656 Differentiate 33230l*3m - 6l3 - 2l + 77 with respect to m. 33230l3 Find the second derivative of 75k*2o*2v2 - k2ov*2 + 84ko2v*2 + 3kov*2 - 425v*2 wrt o. 150k*2v*2 + 168kv2 What is the derivative of -11b*2 - 8037b + 225398 wrt b? -22b - 8037 Find the first derivative of -y4 + 891633y*2 + 3091198. -4y*3 + 1783266y Find the third derivative of 1487371fi*4 - fi2 + f + i2 - 16230i wrt i. 35696904fi What is the derivative of 16467c*4 + 33352? 65868c*3 What is the second derivative of -826742v*3 - 801330v? -4960452v What is the second derivative of 348199s*5 - 288025s wrt s? 6963980s3 What is the second derivative of -63105h*5 - 6h*3 - 33996h wrt h? -1262100h3 - 36h Find the first derivative of 995157l4 - 3552166. 3980628l*3 What is the first derivative of -2f*4v + 4453f2v - 156863v wrt f? -8f*3v + 8906fv Find the second derivative of -3612d5x - 9d3x - d*2x - 2dx - 698d + 2x wrt d. -72240d3x - 54dx - 2x Find the second derivative of -573y*3 - 128y*2 - 575697y wrt y. -3438y - 256 What is the second derivative of -13o*2q*2 - 1118o*2 + 2oq2 - 20q*2 - 16q wrt o? -26q2 - 2236 What is the second derivative of 241571m*2 + 834371m? 483142 Find the first derivative of -31024b2g - bg - 21796g wrt b. -62048bg - g Find the first derivative of -131979a4 + 151286. -527916a*3 Find the second derivative of 359c*3h2 + c3h - 3c*3 - 27c*2h*2 + 42c*2 - 2h*2 + 11h wrt h. 718c3 - 54c*2 - 4 What is the derivative of -11962gt - 12842t wrt g? -11962t What is the first derivative of -6fjq + 2fju - 3fj - 43fu + 6647j + q - 4u wrt f? -6jq + 2ju - 3j - 43u What is the second derivative of -a5 + 75743a*2 - 7133a + 47? -20a3 + 151486 What is the second derivative of 26379g*3 - 10g*2 + 931747g wrt g? 158274g - 20 Find the second derivative of h2u*2 - 580936h*2u - 44hu*2 - 3hu + 18h - u*2 + u wrt h. 2u*2 - 1161872u Find the third derivative of 186411g5 - 187172g*2. 11184660g*2 What is the third derivative of -1453235q*3t*2 - 3q*2t*2 - 469q*2t + 96q2 - 2qt2 - 2t*2 wrt q? -8719410t*2 What is the derivative of 517346n*3u + 40n3 + 3n*2 - 547n - u - 1 wrt u? 517346n3 - 1 What is the third derivative of 3462i*6u*2 + 45i*3u*2 - 7i*2u*2 + 82i*2 - 4u*2 - 3 wrt i? 415440i*3u*2 + 270u*2 What is the third derivative of 5997h*3k*3w3 + h3k2w*2 - 2h*3k*2w - h*2k*2w*2 - hk*3w*3 + 3962hk2w*3 + 2k*2w*3 wrt k? 35982h*3w*3 - 6hw3 Differentiate -115732r*3 - 79450. -347196r*2 What is the derivative of -12h*2k + 2h2 - 3hk - h - 6k - 17 wrt k? -12h2 - 3h - 6 Find the first derivative of -25181v - 42918 wrt v. -25181 What is the third derivative of 40a*3ir2 + 10a*3ir - 5a3 - a2ir*2 + 133a*2ir - 2a*2i - air*2 wrt a? 240ir2 + 60ir - 30 What is the derivative of 15d*2r*3 + 2d*2u - 710d2 - 3678r*3u + 3r2u - 6ru wrt d? 30dr*3 + 4du - 1420d Differentiate -2p2r + 14p2 + 133046pr + 19p - 290 wrt r. -2p2 + 133046p Differentiate -403358c2 + 2c - 3831155 with respect to c. -806716c + 2 Find the first derivative of 63r*2z*2 + 3r*2z - 1235rz*2 + 114298z*2 + 2z + 1 wrt r. 126rz*2 + 6rz - 1235z*2 Find the third derivative of -3966660d*6 - 2d*2 - d - 344006 wrt d. -475999200d3 What is the derivative of l4 - 44l3 - 70l*2 + l + 1420912? 4l*3 - 132l*2 - 140l + 1 What is the second derivative of 52a4z - 10a2z + 2a2 - 112az + 593 wrt a? 624a*2z - 20z + 4 Find the second derivative of 1862o*2t2 + o2t - 9o*2 - 71ot3 - 1380ot - t5 - 9t wrt t. 3724o2 - 426ot - 20t*3 What is the third derivative of 886417g*6 - 539808g*2 wrt g? 106370040g*3 Find the third derivative of 44383q5 - q3 - 55630q2 wrt q. 2662980q*2 - 6 What is the second derivative of 16y*4 + 2y*3 + 743y*2 - 511383y? 192y2 + 12y + 1486 What is the derivative of -2c3l + 7c3 + 495c + 2327l + 1 wrt l? -2c*3 + 2327 What is the third derivative of 4o*4 - 3272o*3 - 2016o*2 + 36o - 2 wrt o? 96o - 19632 Find the third derivative of 2811t*3 + 2t*2 - 72t - 16. 16866 What is the third derivative of 28467g2l*3 - 3g*2l + gl5 + 2397l*2 wrt l? 170802g*2 + 60gl2 Differentiate gn*2 + 112639gn - 871638g wrt n. 2gn + 112639g Differentiate 20v4 - v3 - 163v + 24100. 80v*3 - 3v*2 - 163 What is the third derivative of nr*2t*3 + nr*2t - 21nr*2 - 106nrt*3 + 12nrt*2 + 960r*2t3 - r2t - t2 wrt t? 6nr2 - 636nr + 5760r2 What is the derivative of -b3c + b3 - 666bc + 4063b - c wrt c? -b*3 - 666b - 1 Find the third derivative of -12356p2w*4 + 5000p*2w*2 + 3pw5 - 24pw2 wrt w. -296544p*2w + 180pw*2 Find the first derivative of -754283g*3 - g + 693926. -2262849g*2 - 1 Find the third derivative of -132k*3v*3w + 3k3v + 39k3 + 23k*2v*3w - k*2v*2w + 32kv*2w - 2v2 wrt v. -792k*3w + 138k2w What is the third derivative of -26574a4 - a3 - 2a*2 + 28768a + 6 wrt a? -637776a - 6 What is the second derivative of -2k*3r - 304691k2 - kr + 51432r wrt k? -12kr - 609382 Find the third derivative of 26445cz3 - 1550cz2 + 39z*3 + 226z*2 wrt z. 158670c + 234 Find the third derivative of -34623fx*3 - 13fx + 6f + 2x4 + 2x*3 + 198x*2 wrt x. -207738f + 48x + 12 Find the first derivative of -11n*4 + 1414n*3 + 15n + 463889 wrt n. -44n3 + 4242n*2 + 15 What is the derivative of 4b*2 + 10972b + 183796 wrt b? 8b + 10972 Differentiate 10qt2 + 1744q - 3t3 + 273t*2 - 3t + 37 with respect to t. 20qt - 9t2 + 546t - 3 Find the third derivative of -2r5 - 606r*4 - 30r3 - r2 - 51389r. -120r*2 - 14544r - 180 What is the second derivative of bh2 - 115bh - 74512h*2 - 741h wrt h? 2b - 149024 What is the second derivative of 274448m*3 - 95570m - 1 wrt m? 1646688m Find the third derivative of -21173d*6 + 2d*5 - 70552d*2. -2540760d*3 + 120d*2 Find the second derivative of 5171d*2g*3 - 3d*2g*2h*3 + 2dg - 6dh3 - 6g*3 - 2g*2 + 45gh3 wrt d. 10342g*3 - 6g*2h*3 Differentiate 525010a*3h - a*3o + ho + 74h - 7*o + 171 with respec	{ "pile_set_name": "DM Mathematics" }
1, -228, -239, -254? -273 What comes next: -488, -980, -1474, -1970? -2468 What is the next term in 4881, 9759, 14637, 19515, 24393, 29271? 34149 What is the next term in 210, 217, 232, 261, 310, 385? 492 What comes next: 5190, 5196, 5204, 5214? 5226 What is next in 1166, 2279, 3378, 4457, 5510, 6531, 7514? 8453 What comes next: -14, -33, -62, -101, -150? -209 What comes next: 54, 7, -114, -345, -722, -1281, -2058, -3089? -4410 What is next in 20, 69, 142, 233, 336, 445, 554, 657? 748 What comes next: 26, 98, 198, 326, 482, 666? 878 What comes next: -10, -36, -74, -130, -210, -320, -466, -654? -890 What is next in -11, -7, -3, 1, 5, 9? 13 What is the next term in -49, -33, -1, 53, 135, 251? 407 What is next in 163, 329, 507, 703, 923, 1173, 1459, 1787? 2163 What is the next term in -35, -126, -275, -482, -747, -1070, -1451? -1890 What is the next term in -57, -113, -169, -225? -281 What is next in -10828, -10830, -10832, -10834, -10836, -10838? -10840 What is the next term in 2, 5, 12, 23, 38, 57? 80 What is next in -286, -560, -816, -1048, -1250? -1416 What comes next: 29, 53, 77, 101? 125 What is the next term in -114, -117, -120? -123 What comes next: -330, -658, -986? -1314 What is next in -627, -625, -623, -621? -619 What is the next term in 8261, 8264, 8267, 8270, 8273, 8276? 8279 What is next in 0, 9, 22, 39, 60, 85, 114? 147 What comes next: 6, 56, 182, 420, 806? 1376 What is the next term in -128, -229, -396, -629? -928 What is next in -555, -1114, -1673, -2232, -2791? -3350 What is the next term in 54, 141, 260, 417, 618, 869, 1176? 1545 What comes next: -170, -675, -1516, -2693, -4206? -6055 What comes next: 356, 1436, 3236, 5756, 8996? 12956 What comes next: 11, 13, 9, -1, -17, -39, -67? -101 What comes next: -81, -57, -33, -9, 15? 39 What is next in -1, -24, -75, -166, -309, -516, -799? -1170 What comes next: 184, 340, 504, 682, 880? 1104 What comes next: 21, 85, 189, 333, 517, 741, 1005? 1309 What comes next: -8, -9, 14, 73, 180, 347, 586? 909 What is the next term in -111, -235, -359, -483, -607, -731? -855 What is next in -12, -25, -60, -129, -244? -417 What comes next: -31, -61, -125, -235, -403? -641 What is next in -21, -60, -169, -384, -741? -1276 What comes next: 1449, 1447, 1445, 1443? 1441 What is next in 27, 63, 101, 141, 183, 227, 273? 321 What is next in 28, 23, 16, 7? -4 What is next in -337, -325, -279, -181, -13, 243? 605 What is the next term in 231, 434, 623, 792, 935, 1046? 1119 What is the next term in 7, 29, 65, 115, 179? 257 What is the next term in 3, 13, 25, 39, 55, 73? 93 What comes next: 62, 121, 180, 239, 298? 357 What comes next: -114, -230, -346? -462 What is the next term in 176, 359, 532, 689, 824, 931, 1004? 1037 What is the next term in -682, -688, -706, -742, -802, -892, -1018? -1186 What is next in 0, 13, 26, 33, 28, 5, -42, -119? -232 What is next in -39, -164, -373, -666? -1043 What comes next: 203, 231, 255, 275, 291, 303, 311? 315 What is the next term in 227, 237, 259, 299, 363? 457 What is the next term in -17, -17, -15, -11, -5, 3, 13? 25 What comes next: -456, -446, -430, -408, -380, -346, -306? -260 What is next in 84, 100, 128, 174, 244, 344, 480, 658? 884 What comes next: 227, 437, 647? 857 What is next in 906, 874, 832, 774, 694, 586? 444 What is the next term in 3203, 6399, 9595, 12791, 15987, 19183? 22379 What is the next term in -97, -91, -89, -91, -97, -107, -121? -139 What comes next: 50, 47, 44, 41, 38, 35? 32 What comes next: -271, -550, -829, -1108, -1387? -1666 What is the next term in -4, -11, -20, -31, -44, -59, -76? -95 What is the next term in -2555, -2554, -2553, -2552, -2551? -2550 What comes next: 247, 496, 745, 994? 1243 What comes next: -10, -9, -20, -49, -102, -185? -304 What comes next: 122, 247, 372, 497? 622 What is next in 892, 890, 888, 886? 884 What is the next term in 184, 183, 182, 181? 180 What comes next: 192, 188, 182, 174, 164? 152 What is next in -12, -21, -38, -69, -120, -197? -306 What comes next: -125, -303, -483, -665? -849 What is the next term in -1184, -2371, -3558? -4745 What comes next: -91, -324, -713, -1258, -1959, -2816, -3829? -4998 What comes next: -952, -949, -936, -907, -856, -777, -664? -511 What is next in 90, 71, 26, -57, -190? -385 What is the next term in 11, 83, 275, 647, 1259, 2171, 3443, 5135? 7307 What is the next term in -50, -102, -164, -242, -342, -470, -632? -834 What comes next: -60, -112, -156, -192, -220, -240, -252? -256 What is next in 60, 66, 72? 78 What is next in 125, 213, 351, 533, 753, 1005? 1283 What comes next: -25576, -51152, -76728, -102304, -127880, -153456? -179032 What is next in -12235, -12236, -12237? -12238 What is next in 40873, 40875, 40877, 40879, 40881, 40883? 40885 What is the next term in 192, 377, 538, 663, 740, 757, 702, 563? 328 What is the next term in -31, -34, -47, -76, -127? -206 What comes next: 4, 23, 50, 91, 152, 239? 358 What comes next: 9, 12, 13, 12, 9? 4 What is next in -2, -3, 0, 7, 18? 33 What comes next: 8, 4, 4, 14, 40? 88 What is next in 311, 561, 821, 1097, 1395, 1721, 2081? 2481 What comes next: 55, 99, 137, 169, 195? 215 What comes next: 124, 119, 114? 109 What comes next: -60, -140, -220, -300? -380 What is the next term in -51, -185, -401, -693, -1055? -1481 What is the next term in -4243, -8487, -12733, -16981? -21231 What comes next: -878, -910, -992, -1148, -1402, -1778, -2300, -2992? -3878 What is the next term in 225, 448, 671, 894? 1117 What is next in 960, 1917, 2888, 3879, 4896, 5945? 7032 What is next in 45, 86, 127, 168, 209? 250 What is next in 246, 245, 244, 243, 242? 241 What comes next: 1, -18, -39, -62? -87 What comes next: 28, 43, 58, 73, 88? 103 What is the next term in -1, -5, -9? -13 What is the next term in 7, -7, -25, -47? -73 What is the next term in 13, 18, 43, 100, 201, 358, 583? 888 What comes next: -140, -581, -1316, -2345, -3668, -5285? -7196 What comes next: 51, 127, 203? 279 What comes next: -6, -14, -22, -30, -38, -46? -54 What comes next: -7, -31, -67, -115, -175? -247 What comes next: 23, 57, 119, 221, 375, 593, 887, 1269? 1751 What is the next term in 96, 127, 166, 207, 244? 271 What is next in 1025, 1027, 1027, 1025, 1021, 1015, 1007? 997 What is next in 798, 1596, 2394, 3192? 3990 What is the next term in 2, 25, 60, 107, 166, 237? 320 What is next in -24, -3, 66, 207, 444? 801 What comes next: 12, 18, 24, 30? 36 What is next in 8, -11, -34, -67, -116? -187 What is the next term in 107, 202, 295, 386, 475, 562, 647? 730 What comes next: 38, 48, 58, 68? 78 What is next in -596, -605, -628, -671, -740? -841 What is the next term in 3879, 3908, 3947, 4002, 4079, 4184, 4323? 4502 What is the next term in -96, -61, -14, 51, 140, 259, 414? 611 What is the next term in -10, -47, -110, -199? -314 What comes next: -40, -86, -148, -232, -344? -490 What is the next term in 27, 29, 31, 33, 35? 37 What is the next term in 4219, 8439, 12657, 16873, 21087? 25299 What comes next: 64, 42, 6, -44, -108, -186? -278 What comes next: -57, -46, -35? -24 What is the next term in -329, -326, -323? -320 What is the next term in -351, -348, -345? -342 What is next in 685, 689, 705, 739, 797, 885? 1009 What is next in 75, 324, 745, 1344, 2127, 3100? 4269 What is the next term in -5, 2, 15, 34, 59, 90? 127 What is the next term in -10, -37, -94, -193, -346? -565 What comes next: 24, 51, 72, 75, 48, -21? -144 What is the next term in 8, -24, -68, -130, -216, -332, -484, -678? -920 What is next in -33, -55, -75, -93, -109? -123 What comes next: 1, -3, -9, -17? -27 What comes next: 6, 6, 10, 18, 30, 46, 66? 90 What comes next: -13, -129, -439, -1039, -2025, -3493? -5539 What is next in -13044, -26089, -39134, -52179, -65224? -78269 What comes next: 14, 12, 6, -4, -18? -36 What is the next term in 157, 193, 243, 313, 409, 537, 703? 913 What is the next term in -138, -128, -104, -60, 10, 112, 252? 436 What comes next: 46, -39, -180, -377, -630, -939? -1304 What is the next term in -42, -58, -92, -150, -238, -362, -528, -742? -1010 What is the next term in -5133, -10261, -15387, -20511, -25633, -30753? -35871 What is the next term in -23, -26, -29, -32? -35 What comes next: 131, 253, 365, 461, 535, 581, 593? 565 What comes next: 5561, 11119, 16675, 22229, 27781, 33331, 3	{ "pile_set_name": "DM Mathematics" }
))/sqrt(11). 158sqrt(3) + 2704 Simplify (1sqrt(396))*2 + 0 + sqrt(891) - (6sqrt(275)2)2. -39204 + 9sqrt(11) Simplify ((-4sqrt(1053)1 - sqrt(1053)) + sqrt(1053) + -3 + -2 + sqrt(1053))*2. 270sqrt(13) + 9502 Simplify (-1sqrt(440)1)/(sqrt(10)35) + -4. -4 - 2sqrt(11)/15 Simplify (((4 + sqrt(176) - (sqrt(11) + (sqrt(396) - 2sqrt(396)))) + -1)-5)2. 1350sqrt(11) + 22500 Simplify -6(4 + 2 + 1 + sqrt(2736) + ((sqrt(2736) + -1 - sqrt(2736)) + 4 - sqrt(2736))). -60 Simplify (-6(5 + (sqrt(245) + 1)-2) + -2)2. -3360sqrt(5) + 35680 Simplify -5 + 4 + 1(1 + sqrt(343)) + 6(sqrt(343)-1)22. 7sqrt(7) + 4116 Simplify ((1 + sqrt(1700))4 + -5 + (sqrt(1700) + (sqrt(1700) + -1)6)2)*2. -4680sqrt(17) + 550969 Simplify 6(4 + 3 + sqrt(468) + 3 + 3). 78 + 36sqrt(13) Simplify -1-2((sqrt(1053) + 3 - sqrt(1053)) + -1)*2 + -2. 6 Simplify (4 + sqrt(1377)1 - (1 + sqrt(1377) + 2)*2) + -2. -1384 - 45sqrt(17) Simplify 5(sqrt(2420) + ((sqrt(2420) - (sqrt(2420)-4 + sqrt(2420))) + sqrt(2420) - sqrt(2420)) - sqrt(20))/(-45sqrt(4)). -27sqrt(5)/2 Simplify ((sqrt(200) + -1 + sqrt(200) + -1 - -2sqrt(200)6)-3-5)2. -126000sqrt(2) + 8820900 Simplify (sqrt(1331)1 - sqrt(1331))-5 - 4sqrt(1331)4. -176sqrt(11) Simplify 2(0 + sqrt(2448) + sqrt(17)) - (1sqrt(1700)-1 - sqrt(1700)). 46sqrt(17) Simplify (-6sqrt(405)2 + sqrt(405) - (5(sqrt(405) + (sqrt(405) + sqrt(405) + -2 - sqrt(405))))*2)1. -40600 + 1701sqrt(5) Simplify (1 + (0 + sqrt(1216) + 5 - sqrt(1216))6 + (sqrt(1216) - (-1 + sqrt(1216)))1 + 0)2. 1024 Simplify -2 + sqrt(153)-5 + -1 + -3 + -2. -15sqrt(17) - 8 Simplify sqrt(891)-1 + 0 + -3 + 1 + (sqrt(891)3)24. -9sqrt(11) + 32074 Simplify -2(5 + 5((2sqrt(176) + -1)*2 - (sqrt(176) + sqrt(176) + sqrt(176)2 + -5 + sqrt(176) + sqrt(176)))). -7110 + 400sqrt(11) Simplify 14(((sqrt(84) + -1sqrt(84) + sqrt(84) + sqrt(84))6)/sqrt(12) - (2 + (sqrt(1008))2)). -4040 + 48sqrt(7) Simplify (4sqrt(16)-2)/sqrt(8) + ((sqrt(8))*21 - sqrt(18)1). -11sqrt(2) + 8 Simplify (-3sqrt(972)-4)/((sqrt(9) - sqrt(9)1)1 - ((sqrt(9) - -4sqrt(81)) + sqrt(9))). -36sqrt(3)/7 Simplify ((sqrt(286)/((sqrt(352)/sqrt(8))/sqrt(4)))/(2sqrt(162)-3 + sqrt(162)))*2. 13/2025 Simplify (((3sqrt(550) - sqrt(550))/sqrt(11))/(sqrt(490)-1 + sqrt(10))5)*2. 125/9 Simplify 2 + (-5-1sqrt(65) - (sqrt(65) + (sqrt(65) - (sqrt(65)1 - sqrt(65))))-1)/(sqrt(2000)2 + sqrt(2000)). 7sqrt(13)/60 + 2 Simplify (-2sqrt(40)1 - sqrt(320)/sqrt(72))/(1(sqrt(1152)2 - sqrt(1152))). -7sqrt(5)/36 Simplify (2sqrt(85)-5)/sqrt(5) - ((sqrt(119) + sqrt(119)4)-5)/sqrt(7). 15sqrt(17) Simplify 2((5 + -2 + sqrt(5) - (sqrt(80)-3 + sqrt(80)))-2)*2. 432sqrt(5) + 3312 Simplify ((sqrt(192) - (sqrt(192) + -1sqrt(192) + -2)) + 3)2 - (-1 + 1sqrt(192) + 4). 72sqrt(3) + 214 Simplify ((12sqrt(77) - (-1sqrt(77) - sqrt(77))-5)/(-4sqrt(44)1))2. 7 Simplify 5 + (sqrt(847) + 1 + -2)2 + (sqrt(847) + -2 + 3 - sqrt(847) - sqrt(847)). -33sqrt(7) + 854 Simplify sqrt(637) + -3sqrt(637) + 3 + -2(sqrt(1300) + 2). -34sqrt(13) - 1 Simplify (sqrt(156)/(sqrt(60)/sqrt(5)-2))*2 + 3(3sqrt(1872) + sqrt(1872) - sqrt(1872))2. 202189/4 Simplify 5 + -3 + (sqrt(8) - -2sqrt(16)/sqrt(2))35. 2 + 90sqrt(2) Simplify (2-2sqrt(425) + 3 + (sqrt(425) - -5(sqrt(425) + 0)) + sqrt(425)1 + 5)2. 240sqrt(17) + 3889 Simplify (1sqrt(80)2)/(sqrt(16)/(sqrt(4)1)). 4sqrt(5) Simplify (-1(((sqrt(91) - sqrt(91)-1 - sqrt(91)) + sqrt(91))-4 - sqrt(91)))/(((sqrt(1701)2 - sqrt(1701)) + sqrt(1701) + sqrt(1701))/sqrt(3)). sqrt(13)/3 Simplify ((sqrt(133)-2 - sqrt(133))-2 - (sqrt(133) - 2sqrt(133))2)/(((sqrt(70) - 2sqrt(70))-5)/sqrt(10)). 8sqrt(19)/5 Simplify (sqrt(180)/sqrt(108))/(sqrt(3) + (sqrt(216)/sqrt(9) + sqrt(24) + sqrt(24) + sqrt(24))/sqrt(8)). sqrt(5)/15 Simplify (5 + (sqrt(52)/(sqrt(12)/(sqrt(3) + sqrt(18)/sqrt(6))) - sqrt(91)/sqrt(7)-2-3))2. -40sqrt(13) + 233 Simplify (-1sqrt(85)-1 - (sqrt(85) + -1sqrt(85) + sqrt(85))-5)/((sqrt(35) + sqrt(70)/sqrt(2))/sqrt(7)-3) + -2. -sqrt(17) - 2 Simplify (sqrt(525)/sqrt(3) - sqrt(35)/(sqrt(5) + sqrt(25)/sqrt(5)))2-25. -2835/2 Simplify (1sqrt(171)4 + 1 + (sqrt(171) + sqrt(171) + -1 - sqrt(171) - sqrt(171))2 + sqrt(171))6. 12 + 90sqrt(19) Simplify (sqrt(468) - (sqrt(468) + (sqrt(468) - (sqrt(468) + -3)) + -2)) + (sqrt(468) - (-3 + sqrt(468)-3 + sqrt(468))). 2 + 18sqrt(13) Simplify (-3-5-1sqrt(88))/((sqrt(64) + sqrt(64) + ((-2sqrt(64) + sqrt(64))-4 - sqrt(64) - sqrt(64)))/sqrt(8)). -15sqrt(11)/4 Simplify (-3(4(sqrt(500)-2 + sqrt(500)) + 2 + 2sqrt(500))4)*2. -11520sqrt(5) + 288576 Simplify -1sqrt(51)/sqrt(3) + -2sqrt(17) + 0 + 2 + (sqrt(17) - sqrt(1088)-1). 2 + 6sqrt(17) Simplify ((-25sqrt(130))/(-1sqrt(90)) + 4)2. 80sqrt(13)/3 + 1444/9 Simplify sqrt(110)/(sqrt(10)11)-6 + ((-3sqrt(11))*2-6 - ((sqrt(44)/sqrt(4) + sqrt(11))*2 + 1)). -639 - 6sqrt(11) Simplify (3 + -1sqrt(275)6)*2 - (3 + 4(sqrt(275) + sqrt(275) + 1)). -220sqrt(11) + 9902 Simplify (4 + -1sqrt(1088))*2 + (sqrt(1088) + -3)3. -40sqrt(17) + 1095 Simplify 0 + 2sqrt(17)3 - (6sqrt(2057)-2)2. -296208 + 6sqrt(17) Simplify (-1sqrt(99)-3)/(1sqrt(900)) + (1sqrt(88)4)/(sqrt(8) - sqrt(1152)2). 29sqrt(11)/230 Simplify (-3 + -3 + 1 + 5 + (sqrt(363)-3)*2)4. 13068 Simplify (sqrt(2448) + 2)*2 + 0 - (0 + sqrt(425) + 4-2sqrt(17))2. 48sqrt(17) + 2299 Simplify 6(sqrt(637) + (sqrt(637) - (sqrt(637) - 5sqrt(637))) + sqrt(637) + 1 - sqrt(637))*2 - (-4 + (sqrt(637) + (sqrt(637) + sqrt(637)-2)2)2). 504sqrt(13) + 136965 Simplify 5((sqrt(500) - (-5 + sqrt(500)-1)*2) + (sqrt(80)1)*2-1). -3025 - 450sqrt(5) Simplify ((sqrt(117)1 - sqrt(117))-6 - sqrt(117))/sqrt(9) + ((0 + sqrt(637))4 + sqrt(637) - sqrt(637))*2. -sqrt(13) + 10192 Simplify (1 + sqrt(832) + (sqrt(13) - (sqrt(65)2)/sqrt(5)))*2 - sqrt(117)/(1sqrt(576) - sqrt(9)). 97sqrt(13)/7 + 638 Simplify 5 + 3 + (4sqrt(36)/sqrt(2))/sqrt(6)-6. -24sqrt(3) + 8 Simplify ((sqrt(110)-1 + sqrt(110))4 - (-2sqrt(110)-4 + sqrt(110)))/(sqrt(160)-2 - (sqrt(120) + -2sqrt(120))/sqrt(12)). 9sqrt(11)/7 Simplify (sqrt(42)/sqrt(2)4)/(sqrt(9)/sqrt(3)-1) - 1(sqrt(175)-15)*2. -4375 - 4sqrt(7) Simplify (((1sqrt(882) - sqrt(882))-6)/(sqrt(81)/(sqrt(9)-1) - (sqrt(9) - (sqrt(9) - sqrt(9)2))-4))2. 0 Simplify ((sqrt(320) - (sqrt(320) - ((sqrt(320) - (sqrt(320) + -1)) + sqrt(320) - sqrt(320))2)) + 4 - sqrt(320)) + 3 - (5(-2 + sqrt(320)2))2. -32092 + 1592sqrt(5) Simplify -3 + (sqrt(19)1)2 + (sqrt(57)/sqrt(3))2 + -1 + sqrt(19) - (sqrt(19) + sqrt(133)/sqrt(7))2-22. sqrt(19) + 338 Simplify (2 + (-1sqrt(17) - sqrt(17) - sqrt(17))*2)-4 + ((sqrt(187) - -2sqrt(187))1)/sqrt(11). -620 + 3sqrt(17) Simplify (2sqrt(78)2 - -1(sqrt(78)1 - sqrt(78) - sqrt(78)))/((sqrt(480)/(sqrt(8)-3))/sqrt(10)). -9sqrt(13) Simplify -3 + -1sqrt(11) + 3 + -3 + (sqrt(88)/sqrt(8))*2 + sqrt(11). 8 Simplify (-6(3 + sqrt(567) + -5 + -4))*2. -3888sqrt(7) + 21708 Simplify 1sqrt(8) + 4 - 2(-1sqrt(50) + sqrt(50))2. 2sqrt(2) + 4 Simplify (3 + 2((1 + -3sqrt(539) - sqrt(539)) + 4))*2. -1456sqrt(11) + 34665 Simplify (6(-42sqrt(98) - (sqrt(242)2 + -2)))*2. -11232sqrt(2) + 438192 Simplify ((2sqrt(1872) + 5 - sqrt(1872)) + sqrt(1872) + sqrt(1872))2-2 + (-2(sqrt(1872)2 + sqrt(1872))-1)2. -720sqrt(13) + 33646 Simplify (sqrt(20)/(sqrt(144)-2 - sqrt(4)) + sqrt(720)-1 + 2)*2. -628sqrt(5)/13 + 123921/169 Simplify ((sqrt(78) - (sqrt(78) + (sqrt(78) - (sqrt(78) - 1sqrt(78)))))-2 + 4sqrt(78)-2)/(4sqrt(60)/(sqrt(30)/sqrt(3))). -3sqrt(13)/2 Simplify (-1 + sqrt(20) - (-1 + -1sqrt(5))) + -1 + 1 + sqrt(5) + 5 + sqrt(5). 5 + 5sqrt(5) Simplify (sqrt(396))*21 - ((sqrt(77)/sqrt(7) + -5 - sqrt(11))1)2. 371 Simplify (((sqrt(5760) - (sqrt(5760) + sqrt(5760)2)) + sqrt(5760))/sqrt(8) - ((1sqrt(55) + sqrt(55))/sqrt(11) + sqrt(20)/sqrt(4)-5))*2. 405 Simplify (-1 + ((sqrt(800) + -3sqrt(800) + sqrt(800) + sqrt(800))*2 - sqrt(800))-4)2. -2 + 160sqrt(2) Simplify (0 + -11sqrt(1088) + sqrt(1088) + sqrt(1088))*2 + 4. 1092 Simplify (sqrt(250)3)/(sqrt(2)-5-1). 3sqrt(5) Simplify ((sqrt(720)24)/(1sqrt(900)-4))*2. 16/5 Simplif	{ "pile_set_name": "DM Mathematics" }
vided by 7. 4 Calculate the remainder when 124883 is divided by 477. 386 Calculate the remainder when 79741 is divided by 26. 25 What is the remainder when 199781 is divided by 34? 31 Calculate the remainder when 17280 is divided by 1232. 32 What is the remainder when 316768 is divided by 13? 10 Calculate the remainder when 83830 is divided by 12. 10 Calculate the remainder when 8436 is divided by 148. 0 Calculate the remainder when 670 is divided by 660. 10 Calculate the remainder when 1417 is divided by 198. 31 What is the remainder when 380794 is divided by 28? 22 Calculate the remainder when 87879 is divided by 43874. 131 What is the remainder when 577 is divided by 57? 7 Calculate the remainder when 2682864 is divided by 370. 364 Calculate the remainder when 462022 is divided by 36. 34 Calculate the remainder when 29122 is divided by 7256. 98 What is the remainder when 116060 is divided by 186? 182 Calculate the remainder when 32414 is divided by 612. 590 Calculate the remainder when 50783 is divided by 16819. 326 What is the remainder when 15483 is divided by 377? 26 Calculate the remainder when 106844 is divided by 255. 254 What is the remainder when 462381 is divided by 169? 166 Calculate the remainder when 553180 is divided by 8135. 0 What is the remainder when 1512 is divided by 1452? 60 Calculate the remainder when 92925 is divided by 794. 27 Calculate the remainder when 27177 is divided by 19. 7 Calculate the remainder when 3466 is divided by 170. 66 Calculate the remainder when 54824 is divided by 86. 42 What is the remainder when 941969 is divided by 218? 209 Calculate the remainder when 6700 is divided by 216. 4 What is the remainder when 417994 is divided by 36? 34 Calculate the remainder when 75118 is divided by 79. 68 What is the remainder when 42425 is divided by 92? 13 Calculate the remainder when 1426 is divided by 59. 10 Calculate the remainder when 21245 is divided by 462. 455 What is the remainder when 101174 is divided by 16? 6 Calculate the remainder when 316299 is divided by 572. 555 What is the remainder when 54107 is divided by 328? 315 What is the remainder when 59705 is divided by 1454? 91 What is the remainder when 81370 is divided by 465? 460 Calculate the remainder when 88709 is divided by 1344. 5 What is the remainder when 91446 is divided by 205? 16 Calculate the remainder when 369894 is divided by 13. 5 What is the remainder when 56118 is divided by 230? 228 Calculate the remainder when 22484 is divided by 7488. 20 What is the remainder when 84956 is divided by 80? 76 Calculate the remainder when 5731 is divided by 811. 54 Calculate the remainder when 6667 is divided by 41. 25 Calculate the remainder when 477553 is divided by 387. 382 Calculate the remainder when 3859 is divided by 555. 529 Calculate the remainder when 168089 is divided by 13. 12 What is the remainder when 646 is divided by 74? 54 Calculate the remainder when 126780 is divided by 14. 10 What is the remainder when 34927 is divided by 142? 137 What is the remainder when 7150 is divided by 511? 507 Calculate the remainder when 91529 is divided by 714. 137 Calculate the remainder when 1705 is divided by 655. 395 What is the remainder when 6753263 is divided by 95? 93 What is the remainder when 3460196 is divided by 38? 30 Calculate the remainder when 90706 is divided by 424. 394 Calculate the remainder when 13596 is divided by 545. 516 Calculate the remainder when 56967 is divided by 61. 54 Calculate the remainder when 10731 is divided by 10716. 15 Calculate the remainder when 11401 is divided by 176. 137 Calculate the remainder when 4306 is divided by 187. 5 What is the remainder when 7293 is divided by 3642? 9 Calculate the remainder when 7889 is divided by 7. 0 What is the remainder when 7052 is divided by 3522? 8 What is the remainder when 6682 is divided by 1334? 12 What is the remainder when 1018192 is divided by 613? 612 Calculate the remainder when 30188 is divided by 14. 4 Calculate the remainder when 2167 is divided by 988. 191 What is the remainder when 3431 is divided by 2114? 1317 What is the remainder when 9360 is divided by 164? 12 What is the remainder when 69694 is divided by 16? 14 What is the remainder when 16709 is divided by 486? 185 Calculate the remainder when 60952 is divided by 4353. 10 Calculate the remainder when 1481 is divided by 167. 145 What is the remainder when 33284 is divided by 46? 26 What is the remainder when 4138025 is divided by 1698? 1697 What is the remainder when 5556 is divided by 2776? 4 Calculate the remainder when 92864 is divided by 81. 38 What is the remainder when 23780 is divided by 175? 155 Calculate the remainder when 997 is divided by 580. 417 Calculate the remainder when 65958 is divided by 25. 8 Calculate the remainder when 46299 is divided by 46. 23 What is the remainder when 69590 is divided by 4? 2 Calculate the remainder when 9629 is divided by 1136. 541 What is the remainder when 301459 is divided by 52? 15 What is the remainder when 108328 is divided by 169? 168 Calculate the remainder when 287035 is divided by 238. 7 Calculate the remainder when 4416 is divided by 353. 180 Calculate the remainder when 8385 is divided by 8380. 5 Calculate the remainder when 2482 is divided by 774. 160 What is the remainder when 45936 is divided by 39? 33 Calculate the remainder when 750 is divided by 158. 118 Calculate the remainder when 46915 is divided by 297. 286 Calculate the remainder when 40736 is divided by 40702. 34 Calculate the remainder when 275231 is divided by 91723. 62 What is the remainder when 51960 is divided by 114? 90 Calculate the remainder when 121706 is divided by 9. 8 Calculate the remainder when 38321 is divided by 50. 21 What is the remainder when 84 is divided by 51? 33 Calculate the remainder when 4105 is divided by 1022. 17 Calculate the remainder when 45967 is divided by 417. 97 Calculate the remainder when 3857 is divided by 11. 7 What is the remainder when 47958 is divided by 181? 174 Calculate the remainder when 188505 is divided by 276. 273 What is the remainder when 6706 is divided by 485? 401 What is the remainder when 131973 is divided by 376? 373 Calculate the remainder when 4841 is divided by 113. 95 Calculate the remainder when 7357 is divided by 2407. 136 Calculate the remainder when 3086148 is divided by 87. 84 What is the remainder when 307885 is divided by 102604? 73 What is the remainder when 84 is divided by 80? 4 What is the remainder when 34361 is divided by 29? 25 What is the remainder when 202575 is divided by 101278? 19 What is the remainder when 3532 is divided by 77? 67 What is the remainder when 3994 is divided by 2678? 1316 Calculate the remainder when 33397 is divided by 16695. 7 Calculate the remainder when 404798 is divided by 320. 318 Calculate the remainder when 1332 is divided by 240. 132 What is the remainder when 17972 is divided by 11? 9 Calculate the remainder when 884 is divided by 250. 134 Calculate the remainder when 41343 is divided by 209. 170 Calculate the remainder when 75017 is divided by 20. 17 What is the remainder when 2721 is divided by 381? 54 What is the remainder when 5716 is divided by 673? 332 What is the remainder when 136447 is divided by 190? 27 Calculate the remainder when 885 is divided by 400. 85 Calculate the remainder when 85102 is divided by 49. 38 What is the remainder when 6513 is divided by 326? 319 Calculate the remainder when 131863 is divided by 65924. 15 Calculate the remainder when 13632 is divided by 18. 6 Calculate the remainder when 76 is divided by 32. 12 Calculate the remainder when 29467 is divided by 225. 217 What is the remainder when 5323 is divided by 138? 79 What is the remainder when 223766 is divided by 756? 746 Calculate the remainder when 6210 is divided by 6187. 23 Calculate the remainder when 144745 is divided by 386. 381 Calculate the remainder when 25026 is divided by 2274. 12 What is the remainder when 3049 is divided by 1482? 85 Calculate the remainder when 19497 is divided by 527. 525 What is the remainder when 752134 is divided by 462? 460 What is the remainder when 79221 is divided by 5657? 23 What is the remainder when 673003 is divided by 15? 13 Calculate the remainder when	{ "pile_set_name": "DM Mathematics" }
1(-5)/((-20)/(-12)). Let k be -6((-40)/12 - p). Determine z, given that -1/4zk + 0z + 1/4 = 0. -1, 1 Let w(d) = -3d2 - 2d + 5. Let z(o) = 3o2 + o - 4. Let g be (-108)/26 - 8/(-52). Let j(v) = gw(v) - 5z(v). Suppose j(q) = 0. What is q? 0, 1 Let h(w) = w + 10. Let t be h(-8). What is o in 2o + 0o2 - to*2 + 4o2 = 0? -1, 0 Factor -k4 + 2k2 - 2k + 3k + 3k*3 - 4k2 - k2. -k(k - 1)3 Let z = -143 - -207. Solve -6m*3 + 88m*2 - 42m*3 + 16 + 7m*4 - zm + 2m4 = 0 for m. 2/3, 2 Suppose -4/3q + 0 - 2/3q2 = 0. What is q? -2, 0 Factor -2/17p*2 - 6/17 - 8/17p. -2(p + 1)(p + 3)/17 Let i be 0/((-2)/(-4)-2). Suppose y - 4y = -6. Factor 0 + ia + 0a*y + 2/7a*3. 2a*3/7 Suppose 0 = 3h - n - 2n + 12, 3n + 2 = -4h. Let m be ((-4)/45)/h10. Factor 2/9 + 2/9u2 + mu. 2(u + 1)2/9 Let v(c) be the second derivative of 7c*6/225 + 37c*5/150 + 59c*4/90 + 7c*3/9 + 2c*2/5 - 2c + 4. Suppose v(s) = 0. Calculate s. -3, -1, -2/7 Let v(l) be the second derivative of -l*7/21 + 2l6/15 + l5/10 - l*4/3 + 23l. Solve v(u) = 0 for u. -1, 0, 1, 2 Let u(p) be the first derivative of -3 - 1/12p6 - 1/4p*2 + 0p + 2/3p3 - 3/4p*4 + 2/5p*5. Let u(d) = 0. What is d? 0, 1 Suppose -4f = 4t - 76, -3f + 55 = -5t + 14. Suppose 23 + f = 4g. Suppose -gm2 + 0 - 2m - 25/2m3 = 0. What is m? -2/5, 0 Let c(d) be the first derivative of -d6/24 + 3d4/16 + d3/6 - 9. Determine s, given that c(s) = 0. -1, 0, 2 Let q(l) be the first derivative of -l*5 + 5l*4 + 5l*3/3 - 10l*2 + 11. Factor q(n). -5n(n - 4)(n - 1)(n + 1) Factor 20o - 8 + 12 - 32o4 - 6 + 80o*3 - 66o*2. -2(o - 1)*2(4o - 1)2 Suppose 3f + 0f - 6 = 0. Suppose -g - 3 = -fg. Solve u*2 + 0u5 + u3 + 0u5 - u4 + 0ug - u5 = 0. -1, 0, 1 Let p(h) be the second derivative of h7/420 + h6/300 - 3h5/200 - h4/120 + h3/30 - 9h. Find v, given that p(v) = 0. -2, -1, 0, 1 Let v(n) be the third derivative of -n6/2160 + n5/360 - n*3/6 + 3n*2. Let y(k) be the first derivative of v(k). Factor y(r). -r(r - 2)/6 Let u(c) be the third derivative of c6/420 - c5/105 - c*4/84 + 2c*3/21 + 5c*2. Find g such that u(g) = 0. -1, 1, 2 Suppose 5 - 30 = 5u. Let g be (-28)/u + (-6)/10. Factor -8/11vg - 14/11v - 50/11v3 - 38/11v*2 - 2/11 - 32/11v*4. -2(v + 1)*3(2v + 1)2/11 What is w in 4w + 3w2 + 2 + 1/8w4 + w3 = 0? -2 Let v(s) be the third derivative of -1/735s7 + 1/210s*5 + 0s + 0 - 1/420s6 + 0s*3 + 1/84s4 + s2. Determine h, given that v(h) = 0. -1, 0, 1 Let 1/4y2 + 3/4y + 1/2 = 0. Calculate y. -2, -1 What is c in 0c - 32/3c*4 + 2c*5 + 12c*2 + 0 + 10c3 = 0? -2/3, 0, 3 Let q(a) be the third derivative of a6/200 - a5/25 + a4/10 - 27a2. Suppose q(p) = 0. Calculate p. 0, 2 Suppose -w + 1 = -1. Let -2 + 7 + 4h + 3 - 4hw = 0. Calculate h. -1, 2 Let c(s) = -s3 + 6s*2 - 6s. Let z be c(5). Let x = 9 + z. Solve -2d5 - 3dx + d5 + d4 - d3 = 0 for d. -1, 0 Let x(s) be the first derivative of -2/3s3 - 5 + 0s + s*4 - 2/5s*5 + 0s*2. Find i such that x(i) = 0. 0, 1 Let j = 251 + -251. Let i(x) = -x. Let a be i(-3). Solve 3/4d*4 - 1/2d + j + 1/2da - 3/4d*2 = 0 for d. -1, -2/3, 0, 1 Let x(j) be the first derivative of 7j*5/20 + 4j*4/3 + 11j3/6 + j2 - 3j + 5. Let b(v) be the first derivative of x(v). Factor b(t). (t + 1)2(7t + 2) Let w(v) be the second derivative of -v6/108 + v5/60 + v4/18 + v3/2 + 2v. Let p(i) be the second derivative of w(i). What is s in p(s) = 0? -2/5, 1 Let n(m) be the first derivative of -3m5/10 - 13m*4/6 - 16m*3/3 - 4m*2 - 2m - 3. Let d(j) be the first derivative of n(j). Factor d(u). -2(u + 2)2(3u + 1) Let d(w) = -2w*3 - 14w*2 - 5w - 31. Let i be d(-7). Solve 2ti - 2t*2 + 2/3t*3 - 2/3t + 0 = 0. -1, -1/3, 0, 1 Let r(n) be the third derivative of n6/900 - n5/450 - n4/180 + n3/45 + 15n2. Factor r(i). 2(i - 1)*2(i + 1)/15 Let a(r) be the first derivative of r*6/2 + 3r*5/5 - 3r*4/2 - 2r*3 + 3r*2/2 + 3r - 20. Factor a(t). 3(t - 1)2(t + 1)*3 Let z be 80 + (-8)/(2 - -2). Let x = -232/3 + z. Suppose 0 + 2/3h*3 + 0h + xh2 = 0. Calculate h. -1, 0 Suppose -4w + 6 = -6. Suppose -wq + 0q = 0. Factor 1/2l3 - 1/2l*2 + 0l + q. l*2(l - 1)/2 Let -24c - 3c*3 - 8 - 42c + 21c - 19 - 21c*2 = 0. Calculate c. -3, -1 Let o(j) = -3j*3 - 4j*2 - 7j + 7. Let z(i) = -5 + 2i + i3 + i2 - 4 + 7. Let f(r) = -2o(r) - 7z(r). Factor f(k). -k2(k - 1) Let f = 1098 + -7684/7. What is k in f + 4/7k + 2/7k*2 = 0? -1 Let p(l) be the second derivative of 0 - 15/56l*7 - 1/10l*6 + 7/24l*4 + l - 7/24l*3 - 1/4l*2 + 13/20l*5. Solve p(v) = 0. -1, -1/3, 2/5, 1 Let i = 1/77 - -3/11. Let q be (-6)/28-6 - 1. Factor 0 + 0o2 - qo + io3. 2o(o - 1)(o + 1)/7 Let o be ((-260)/(-75) + -4)-10. Let y(p) be the first derivative of 2p - 7p2 + op*3 + 8p*4 - 2. Determine g so that y(g) = 0. -1, 1/4 Let a = -18 + 19. Let k(f) be the first derivative of 0f - 1/9f3 + 1/6f*2 + a. Factor k(b). -b(b - 1)/3 Let h(x) be the second derivative of x + 0 + 1/6x4 - 3/50x*5 + 0x*2 - 1/15x*3 - 3/25x*6. Factor h(k). -2k(k + 1)(3k - 1)2/5 Let s(u) be the first derivative of 2 - 1/9u*3 - 1/12u*4 + 0u*2 + 0u. Factor s(r). -r*2(r + 1)/3 Let s = -43 - -47. Let l(f) be the third derivative of -1/60f6 - 1/42f*5 + 0 - 3f*2 + 1/42f*s + 0f + 0f3. Solve l(z) = 0. -1, 0, 2/7 Let g(u) be the second derivative of -u6/90 - u5/12 - u4/4 - 7u3/18 - u2/3 - 4u. Let g(z) = 0. What is z? -2, -1 Let x = -6 + 7. Let r(b) be the first derivative of 0b - 1/2b4 + b2 - 2/3b*3 - x + 2/5b*5. Factor r(g). 2g(g - 1)2(g + 1) Let -3g - 4g*2 + 3g*2 + 0g = 0. What is g? -3, 0 Let y(n) be the second derivative of -80n7/63 - 8n*6/45 + 91n*5/30 + 5n*4/9 - 11n*3/9 - 2n*2/3 + 3n. Suppose y(z) = 0. Calculate z. -1, -1/4, 2/5, 1 Determine i, given that 6/17i3 - 2/17i*4 + 0 - 2/17i*5 + 4/17i + 10/17i2 = 0. -1, 0, 2 Let a(v) be the third derivative of -v8/112 + v7/70 + v6/8 - v5/20 - v4 - 2v*3 - 13v*2. Factor a(l). -3(l - 2)*2(l + 1)*3 Suppose -5q = -k, -4k = q - 2q. Let x(f) be the third derivative of 3f2 + 1/30f*5 + 1/6f*4 + 0f + 0 + qf3. Determine t, given that x(t) = 0. -2, 0 Let v(c) be the second derivative of -5c*4/12 - 5c*3/6 + 5c*2 + 14c. Suppose v(a) = 0. What is a? -2, 1 Let v(n) be the first derivative of n*4/16 + 5n*3/12 + 3n*2/4 - 9. Suppose v(m) = 0. What is m? -3, -2, 0 Determine p, given that 0p*2 + 3 + 9/2p - 3/2p3 = 0. -1, 2 Let o(s) be the third derivative of -s7/315 - s6/180 + 14s*2. Factor o(b). -2b*3(b + 1)/3 Let p(c) be the first derivative of 0c + 2c2 - c4 - 6/5c5 + 2c3 - 1. Let p(g) = 0. Calculate g. -1, -2/3, 0, 1 Let b(p) be the third derivative of -p7/1540 - p*6/180 - 2p5/165 + p4/33 - p3 + p2. Let r(t) be the first derivative of b(t). What is z in r(z) = 0? -2, 1/3 Let c(u) be the second derivative of 0 + 2u4 + 16u*2 - 8u*3 + 4u - 1/5u5. Solve c(v) = 0. 2 Let k(a) be the third derivative of 0a + 0a3 + 0a*4 - 2a*2 - 1/420a*7 + 0 - 1/120a*5 + 1/120a*6. Solve k(m) = 0 for m. 0, 1 Let k(c) be the second derivative of -1/8c*2 - 3c - 1/48c4 + 0 - 1/12c3. Factor k(b). -(b + 1)2/4 Determine h so that 11h - 3h - 5h2 + 3h - 20 + 14h = 0. 1, 4 Let k = 32555/42 - 4169/6. Let y = k + -80. Factor -2/7j*5 + 0 + 4/7j*4 - 4/7j*2 + 0j*3 + yj. -2j(j - 1)*3(j + 1)/7 Suppose 2x - 11 = -7. Let m(w) = 2w - 6. Let f be m(4). Find s such that -fs3 - 3s + 4s2 - s + 0s*x + 2s = 0. 0, 1 Let l(u) be the third derivative of u6/24 + u5/12 - 5u4/24 - 5u*3/6 + 9u*2. Factor l(p). 5(p - 1)(p + 1)2 Suppose -2j + 5d + 7 = -0j, -j + 5d - 9 = 0. Suppose j = -3h + 94. Suppose -2 + 6y - 3y - 6y4 - hy*2 + 2y*2 + 9y + 20y3 = 0. What is y? 1/3, 1 Factor -3/2i*3 + 3/2i - 3i2 + 3/4i*4 + 9/4. 3(i - 3)(i - 1)(i + 1)*2/4 Let r(g) be the first derivative of 1 - 1/24g*4 + 1/6g**3	{ "pile_set_name": "DM Mathematics" }
rob of picking 4 i. 1/204 Calculate prob of picking 2 z and 1 r when three letters picked without replacement from {r: 6, z: 4}. 3/10 Two letters picked without replacement from {i: 7, l: 5}. What is prob of picking 1 i and 1 l? 35/66 What is prob of picking 2 g and 2 p when four letters picked without replacement from noopgpmg? 1/70 Two letters picked without replacement from aaaaaaasassdsssadss. Give prob of picking 1 s and 1 d. 16/171 Calculate prob of picking 2 n when two letters picked without replacement from znnzzzn. 1/7 Three letters picked without replacement from {u: 6, z: 3, a: 2, i: 1, c: 1}. What is prob of picking 1 c, 1 a, and 1 i? 1/143 Three letters picked without replacement from {a: 8, e: 3}. What is prob of picking 3 e? 1/165 What is prob of picking 1 q and 1 i when two letters picked without replacement from lqxlxlxili? 2/45 Calculate prob of picking 1 n and 2 o when three letters picked without replacement from hsnooddx. 1/56 What is prob of picking 2 e when two letters picked without replacement from {e: 11, v: 1, i: 1}? 55/78 What is prob of picking 1 o, 1 s, 1 p, and 1 g when four letters picked without replacement from {o: 1, g: 4, s: 5, h: 1, p: 3}? 60/1001 What is prob of picking 2 w, 1 z, and 1 v when four letters picked without replacement from zwwzvwiziizviv? 36/1001 Two letters picked without replacement from oroooorroorooooroooo. Give prob of picking 2 o. 21/38 Four letters picked without replacement from qqqqqqqcqcq. What is prob of picking 4 q? 21/55 Four letters picked without replacement from {n: 13, s: 3, x: 2}. Give prob of picking 2 x, 1 n, and 1 s. 13/1020 Two letters picked without replacement from {u: 1, i: 1, d: 1, q: 1, b: 1}. Give prob of picking 1 d and 1 i. 1/10 What is prob of picking 1 x and 1 p when two letters picked without replacement from xxnkppkkkppnpnnnoxx? 20/171 Calculate prob of picking 2 l and 2 q when four letters picked without replacement from lllqqqltl. 5/21 Two letters picked without replacement from {g: 1, e: 6, k: 3, y: 3, j: 1, b: 1}. Give prob of picking 2 e. 1/7 Four letters picked without replacement from okodozkoodkd. What is prob of picking 1 z and 3 k? 1/495 Calculate prob of picking 1 m and 2 x when three letters picked without replacement from {e: 1, x: 4, l: 2, m: 2, n: 3}. 3/55 Three letters picked without replacement from {h: 5, l: 3, f: 8}. Give prob of picking 2 f and 1 l. 3/20 Two letters picked without replacement from ddddddddd. Give prob of picking 2 d. 1 Calculate prob of picking 2 o when two letters picked without replacement from {o: 3, y: 2}. 3/10 What is prob of picking 2 u when two letters picked without replacement from unsusnsss? 1/36 Three letters picked without replacement from {c: 1, u: 3, n: 2, e: 1}. What is prob of picking 2 u and 1 n? 6/35 What is prob of picking 2 f and 1 b when three letters picked without replacement from {b: 3, f: 2}? 3/10 What is prob of picking 1 l and 2 f when three letters picked without replacement from {j: 6, l: 3, k: 4, f: 6}? 15/323 Two letters picked without replacement from {c: 1, w: 2, z: 2, e: 2, g: 1}. Give prob of picking 1 g and 1 z. 1/14 What is prob of picking 1 q and 1 w when two letters picked without replacement from qwbib? 1/10 Four letters picked without replacement from {w: 2, x: 1, m: 4, n: 3}. Give prob of picking 1 n, 1 w, and 2 m. 6/35 Calculate prob of picking 1 y and 1 z when two letters picked without replacement from bzncbngynggz. 1/33 Four letters picked without replacement from jjqkkjjbvbjjvbbwj. Give prob of picking 2 k and 2 j. 3/340 Calculate prob of picking 2 x when two letters picked without replacement from {o: 5, x: 3}. 3/28 What is prob of picking 1 a and 3 o when four letters picked without replacement from ooaaooaoaooa? 35/99 Calculate prob of picking 3 w when three letters picked without replacement from iwdijdiwawiidia. 1/455 Calculate prob of picking 1 w and 1 h when two letters picked without replacement from rccrwchcwccrrwrwcc. 4/153 Four letters picked without replacement from eeeeeeebewebee. What is prob of picking 4 e? 30/91 Calculate prob of picking 2 a when two letters picked without replacement from {a: 10}. 1 Calculate prob of picking 2 o, 1 j, and 1 i when four letters picked without replacement from ojjijoiooooooiiooo. 11/51 Calculate prob of picking 1 g, 1 z, and 1 r when three letters picked without replacement from rrzrrgrzgg. 1/4 Four letters picked without replacement from nwnnnwwwnnnnnnnnwnn. What is prob of picking 2 n and 2 w? 455/1938 Three letters picked without replacement from xaxcxsaxaxascsbaa. What is prob of picking 1 s, 1 a, and 1 b? 9/340 Calculate prob of picking 3 e and 1 q when four letters picked without replacement from {q: 7, e: 4, w: 2}. 28/715 What is prob of picking 4 r when four letters picked without replacement from {r: 4, m: 2}? 1/15 Three letters picked without replacement from vkiiekheeekkivjiev. Give prob of picking 1 i, 1 e, and 1 j. 5/204 Three letters picked without replacement from {p: 2, m: 4}. Give prob of picking 2 m and 1 p. 3/5 What is prob of picking 1 i, 1 l, 1 b, and 1 q when four letters picked without replacement from bbycqybcyiqcbll? 16/1365 Two letters picked without replacement from gupgdddgudpugdzg. Give prob of picking 1 p and 1 z. 1/60 Three letters picked without replacement from {v: 10, n: 1, y: 3, x: 3, p: 2}. What is prob of picking 1 p and 2 y? 2/323 Four letters picked without replacement from {i: 1, r: 1, x: 1, g: 1, h: 2, p: 1}. What is prob of picking 1 h, 1 g, 1 r, and 1 i? 2/35 What is prob of picking 1 m, 1 h, and 2 l when four letters picked without replacement from mmhhlmlm? 4/35 Two letters picked without replacement from ylllyy. What is prob of picking 2 y? 1/5 Calculate prob of picking 1 o and 1 d when two letters picked without replacement from osoxxodxnn. 1/15 Four letters picked without replacement from hbbqybbbhhhyb. What is prob of picking 2 b and 2 h? 18/143 What is prob of picking 1 o and 1 v when two letters picked without replacement from cvovaboocbcavoabcoov? 12/95 What is prob of picking 3 o and 1 z when four letters picked without replacement from zoozsoz? 3/35 Two letters picked without replacement from {o: 4, g: 4, s: 2}. What is prob of picking 2 g? 2/15 Two letters picked without replacement from gggzittg. What is prob of picking 2 g? 3/14 Calculate prob of picking 1 z and 1 u when two letters picked without replacement from uuuuuuuzzuuu. 10/33 Two letters picked without replacement from {k: 2, r: 2}. What is prob of picking 1 k and 1 r? 2/3 Four letters picked without replacement from ottocccctctt. What is prob of picking 2 o and 2 c? 2/99 Calculate prob of picking 2 e and 2 b when four letters picked without replacement from bbbbebe. 2/7 Two letters picked without replacement from {i: 2, h: 4}. Give prob of picking 2 i. 1/15 Calculate prob of picking 3 u when three letters picked without replacement from xuuxuxdxxxxuxx. 1/91 Two letters picked without replacement from {v: 5, c: 2, s: 1, j: 5, o: 2, h: 1}. What is prob of picking 1 h and 1 v? 1/24 Two letters picked without replacement from {t: 1, s: 1, x: 1, h: 1, n: 1}. Give prob of picking 1 s and 1 n. 1/10 Two letters picked without replacement from {z: 2, n: 1, q: 1}. What is prob of picking 1 z and 1 n? 1/3 Two letters picked without replacement from {d: 1, x: 1, a: 4, z: 1, c: 2}. Give prob of picking 1 x and 1 z. 1/36 Calculate prob of picking 1 l and 1 f when two letters picked without replacement from {f: 7, d: 3, r: 2, l: 7, k: 1}. 49/190 Two letters picked without replacement from {w: 8, z: 5, k: 5}. What is prob of picking 2 z? 10/153 Calculate prob of picking 1 b and 1 j when two letters picked without replacement from bbjwjjbjjb. 4/9 Two letters picked without replacement from vjehh. Give prob of picking 1 j and 1 v. 1/10 What is prob of picking 2 x when two letters picked without replacement from {q: 6, x: 2}? 1/28 What is prob of picking 2 x when two letters picked without replacement from {o: 7, x: 7}? 3/13 Three letters picked without replacement from jjii. Give prob of picking 1 i and 2 j. 1/2 What is prob of picking 4 n when four letters picked without replacement from {n: 7}? 1 What is prob of picking 1 j	{ "pile_set_name": "DM Mathematics" }
)-1))/1. 11 Calculate (-29)/580((-10)/(-6))/(22/99). -3/8 What is the value of ((45/25)/3)/(378/(-140))? -2/9 What is the value of ((-850)/1360)/(10/8)? -1/2 What is the value of (-21/6)/(-720/420)? 1 What is (160/(-56))/((-375)/3150)? 24 What is (-28)/1022/(-231)15? 4 (7/(-42))/(((-198)/(-3432))/(9/2)) -13 Evaluate 39/(-104)(-168)/(-315). -1/5 ((-8)/(-112))/((-315)/(-294)) 1/15 ((456/(-19))/12)/(-11) 2/11 Calculate (-2)/(-4)128/(-832). -1/13 Calculate 3/35196/(-3). -2/13 (11/(165/(-20)))/((-56)/421) 1 Calculate (-2)/((-16)/52)(-168)/(-364). 3 Evaluate 2/(-4)(-1773)/591. 3/2 What is (4(-1)/(-3))/(23/((-15525)/(-60)))? 15 Evaluate (3(-3)/(-15))/(1/151). 9 What is (-15)/6(-357)/255? 7/2 What is ((-2)/((-18)/(-21)))/(194/582)? -7 What is ((-66)/(-24))/((-9)/36)? -11 Calculate 2/4(640/20)/8. 2 (-2)/(-5)(-462)/924 -1/5 What is the value of (-7)/((-70)/(-24))20/(-12)3? 12 What is the value of (2/6)/((-57)/(-209)7/(-63))? -11 What is the value of ((2475/(-30))/(-33))/(1(-30)/(-21))? 7/4 What is the value of ((10/(-75))/2)/(30/((-56430)/(-19)))? -33/5 Evaluate (((-374)/88)/17)/(6/(-9)-3). -1/8 What is the value of ((-4341)/20258)/((-4)/(-14)4)? -3/16 What is the value of ((-4)/4)/(69/1932)? -28 (7/(-21))/(226/12) -1/13 What is the value of 66/(-12474)-6312/(-46)? -2/23 What is 21/126-6-12? 12 Calculate ((4/6)/(32/(-16)))/((-50)/90). 3/5 What is the value of 4590/5508(-18)/40? -3/8 245/12(-47)/(7520/(-384)) 18 What is the value of (-80)/(-12)(-2370)/(-1975)? 8 Evaluate 47/(2397/170)18/5. 12 (33/(429/(-221)))/(2/2) -17 What is (4/15)/4(-104)/(-3900)125? 2/9 Calculate -13833/2376-12. 23 What is 18/93624? 2/13 (-5)/(-6)963/1070 3/4 ((-39)/(-4095))/(1/3) 1/35 (-5)/(-20)32/(-12) -2/3 What is (((-138)/115)/(4/15))/(24/32)? -6 What is ((30/(-45))/1)/((-10)/(-36)3)? -4/5 Evaluate ((120/(-16))/3)/(-1)(-90)/25. -9 Calculate 7/(((-18)/30)/(9/30)). -7/2 Evaluate (225/6)/15(8/(-1))/(-120). 1/6 What is 2/(-4)2(-11)/(121/(-22))? -2 Evaluate ((-13)/(-78)45/10)/(1/(-4)). -3 Evaluate ((-1)/4)/((-3)/(-16))16/96. -2/9 Calculate 9/61/(-2)(-24)/48. 3/8 (3/(-6))/((-1)/22) 11 What is ((-135)/(-525))/(99/1617)? 21/5 Evaluate 8/(-12)31/2. -1 What is the value of (10/(-8)(-452)/1130)/(2/(-32))? -8 28/(-8)(-1248)/(-182) -24 What is ((-15)/(-9))/(((-3850)/(-132))/5)? 2/7 Calculate ((-10725)/(-1375))/((-39)/(-60)). 12 (-2)/281385/2770 -1/28 Calculate -6-8(-231)/396. -28 526/(-1365)(-11)/(396/81) 3/14 Calculate 156/(-130)7400/222. -40 What is the value of (-4446)/98822/(-9)? 11 Evaluate (4(-35)/(-84))/(9/(135/(-20))). -5/4 Evaluate (-1161)/58052/(-1). 2/5 (-12)/39168-88 1/51 What is (1968/1230)/((-36)/(-6)-1)? -4/15 Calculate 4/(-24)310/6012. -1 What is the value of (-11)/(5280/8)(-69)/(-23)? -1/20 What is the value of (((-1)/((-11)/4))/(1006/5533))/(-2)? -1 ((-35)/(3185/78))/((-4)/6) 9/7 Calculate (-2817/(-1666))/(12/(-6)). -1/7 What is (-11/3)/(140/168)? -2/5 What is the value of 486/(-594)3/9? -3/11 Evaluate (-9)/120(-12)/12(-12)/18. -1/20 Evaluate 102822/8624. 5/7 What is the value of (-2)/((112/(-72))/7)? 9 Calculate (((-13024)/64)/(-37))/(1/2). 11 Calculate (-12)/1024(-330)/352. 27 What is 9/(-13)34/102? -3/13 Calculate ((-2112)/(-320))/(15/50). 22 Evaluate 4/10-16360/3456. -2/3 6(-2)/(-84)112/3 4/7 (-36)/(-4536)42(-9)/10 -3/10 Calculate (-2)/(-14)(-12)/((-420)/(-4165)). -17 Calculate ((-102)/(-10))/(-1651/(-680)). 17/2 -21(-4)/1540-10(-22)/16 3/4 -1((-5)/((-510)/4))/((-4)/12) 2/17 What is (6-2(-2)/6)/((-152)/(-6))? 3/19 Evaluate (35/(1680/(-32)))/((-2)/(-6))8. -16 39/9750-40(-10)/12 2/15 What is 10/149(-33)/1980? -3/28 What is the value of (10/8)/((-150)/2520-7)? 3 What is the value of (-280)/(-7)(-29)/116? -10 Evaluate (12/(-14))/((-134)/(-737)(-33)/(-42)). -6 What is the value of ((-18)/42(-16)/(-6))/((-2)/7)? 4 What is the value of (((-200)/1)/5)/((-44)/22)? 20 18/5211/(264/16)-1 -3/13 What is 16/80(-1)/10? 0 What is the value of 12/(6994/(-807)-13)? 6/13 What is the value of ((-52)/65)/(((-6)/(-7))/((-40)/168))? 2/9 ((-900)/(-81))/206(-3)/(-1) 10 ((-35)/421)/(2/12) -5 What is (8/3)/(33/22)(-9)/(-60)? 4/15 Evaluate (-48)/(-27)9/(-42)7. -8/3 Calculate (-3)/((-1758)/(-1465)(-5)/(-2)). -1 Calculate (-2415)/(-30)18/207. 7 Evaluate (-1)/2-914/(-189). -1/3 Evaluate 28/(20/(-6)27/45). -14 Calculate (13/(-182))/(2/24). -6/7 What is ((-24)/(-9))/((-710)/3195)? -12 (5104/232)/(23) 11/3 What is the value of (-8)/66(4272/32)/89? -2/11 Calculate (7/(-14))/((91/(-112))/(2/(-24))). -2/39 ((-3)/4)/(1519/30380) -15 (3/6)/((-39)/78) -1 (15(-1)/(-16))/(207/(-276)) -5/4 Calculate 12(-8)/60((-27)/6)/(-9). -4/5 Calculate 10(-45)/10803/(-40)-4. -1/8 (-20)/(-750)5((-9)/6)/1 -1/5 Calculate (-1)/((-5)/8)(-131)/(44933/490). -16/7 What is the value of ((-1)/21)/(21/(-98)2)? 1/9 ((-12)/144)/(((-6)/90)/(3/3)) 5/4 Evaluate ((40/10413)/1)/(1/2). 10 Calculate (-38)/(-95)340/32. 17/4 What is ((-2)/(-84))/(((-1932)/(-294))/(-23))? -1/12 Evaluate (48/28)/(330/(-140)2/3). -12/11 Calculate (50/(-8)14/35)/(73/(-438)). 15 (4/(-30))/(1260/17325(-77)/(-2)) -1/21 Calculate ((-5)/50-4)/(((-170)/200)/(-17)). 8 What is 3927/(-154)12/(-90)? 17/5 What is the value of (2/9)/(639/(-80514))? -28 What is the value of (2/((-40)/190))/((-17)/34)? 19 Evaluate (-3)/9(20/(-30))/(6/117). 13/3 What is the value of ((-240)/(-75))/(24/(-60))? -8 Calculate (-42)/(-63)(-48)/28. -8/7 (72/8)/((6/(-9))/(18/27)) -9 Calculate (34/17)/(12/(-54)). -9 What is the value of ((-57)/(-171))/(3/27)? 3 What is (116/(-24))/((84/(-414))/(-7))? -23 (12/(-33))/((-18)/(-1))-3 2/33 What is the value of 36/836/(-243)? -2/3 ((-4)/8-1)/(20/(-20)) -1/2 3/((15/8)/((-13)/(-520)2)) 2/25 What is the value of ((-40)/48)/(30/162)? -9/2 Evaluate ((-140)/6315/(-2))/(2/(-3)). -25 What is the value of ((-21)/5)/((-14)/((-1680)/(-36)))? 14 Evaluate (52)/((3300/48)/(-55)). -8 (-60)/725/(-25)-3 -1/2 What is (-24)/105635/(-2898)? 14/3 What is the value of (-25)/(-2)-114/110? -5 ((-2418)/(-281325)55)/(4/22) 13/5 What is 321/(-428)276/9? -23 (-127/(-12))/((-183)/976) -12 What is the value of (((-191)/1146)/(2/18))/((-3)/10)? 5 What is the value of (6/(-24)4)/(((-100)/15)/20)? 3 Calculate (-2)/(16/(-2))1/(4/(-60)). -15/4 Evaluate (7/(-14))/(3/((-2262)/(-13))). -29 What is the value of ((-124)/310)/(3/90-28)? 3/7 What is (12042/(-22077))/(6/(-154))? 14 Evaluate (-1)/(4/16)(-41)/1353015. 2/11 Calculate ((-10)/10)/(66(-3)/(-108)). -6/11 Evaluate 6(-20)/(-320)-40. -15 What is the value of (96/640-2)/(6/170)? -17/2 Calculate ((-10)/((-48)/(-160)4))/((-2)/(-6)). -25 Calculate (54/20)/((-2)/(-4)-18). -1/9 What is -52217/23375? -2/25 Evaluate 65/1042904/(-330). -11/2 Calculate 620/496(-8)/(-105)3. 2/7 What is -324/(-36)7/2? 7 Evaluate (80/220)/(2/11). 2 What is the value of ((66/(-77))/((-102)/28))/1? 4/17 What is 325/585(-4)/10? -2/9 Calculate ((-20)/(-135))/(28/84). 4/9 Calculate ((-72)/(-576))/((-6)/(-224)4). 7/6 What is the value of 141/(-94)(-7)/336/(-42)? -3 (3/(-22)-33)/30 3/20 Evaluate (16/88)/(((-490)/(-77))/7). 1/5 Evaluate (1412/(-2824))/(23/(-2)). 1/23 What is 1100/25(-1)/4? -1 What is the value of ((-8)/72)/((-2)/198)? 11 What is (29/(-87))/((-4)/18)(-3)/(-72)? 1/16 What is the value of (-6)/130(-6708)/(-516)? -3/5 What is ((-11)/(-1936)22)/(11/(-3))? -3/8 Evaluate ((-352)/616)/(45/(-140)). 16/9 Evaluate (448/384(-6)/(-28))/((-2)/(-2)). 1/4 ((-6)/(-6)(-2)/8)/(42/(-56)) 1/3 Evaluate (((-3)/((-18)/(-10)))/(-5))/((-77)/33). -1/7 Calculate (6(-4)/828)/((-2)/3). 1/23 Evaluate ((24/26)/(-3))/(((-238)/17)/(-14)). -4/13 Calculate ((-3)/6)/(4/((-120)/(-50))). -3/10 Calculate (-20)/(-84)(-43)/(860/48). -4/7 Calculate (-35)/(-10)(-6)/(51/(-17)). 7 What is (-4)/7(-6048)/(-576)? -6 Calculate (-1)/(-9)6(-39)/650-5. 1/5 Evaluate (-34/176-2)/((-2)/(-16)). 12/11 8/(-374)(-231)/126 2/51 Calculate 210/6440(-28)/(-21). 1/23 ((-200)/(-60))/((-20)/24) -4 (-267)/13350/2 0 Evaluate (((-140)/(-5))/(-4))/((-17)/(-17)). -7 Evaluate (-6)/204928/(-924). 8/5 Calculate (-28)/(-4)11(-106)/106. -7 What is 8((-120)/(-5))/48? 4 What is (4-1)/((-20)/5(-219)/(-6))? 2/73 Calculate ((-7)/(14/19))/	{ "pile_set_name": "DM Mathematics" }
)) + -2 - sqrt(175))*2. -179 + 25sqrt(7) Simplify (-3-3(sqrt(2057) + 2))*2. 3564sqrt(17) + 166941 Simplify 4 + (sqrt(175) - (4 + sqrt(175) + (-1 + sqrt(175))*2 - sqrt(175))). -176 + 15sqrt(7) Simplify -5(sqrt(4)/sqrt(2) + 3). -15 - 5sqrt(2) Simplify (sqrt(8)3 + sqrt(2) - sqrt(8)/sqrt(4)-4)-5. -55sqrt(2) Simplify ((sqrt(2448) + 1)*2 - sqrt(2448)) + sqrt(187)/sqrt(539). 85sqrt(17)/7 + 2449 Simplify (sqrt(304)-4 + sqrt(304) + -4)-5. 20 + 60sqrt(19) Simplify sqrt(52)/sqrt(4) + -5 - (sqrt(325) + -2)2. -334 + 21sqrt(13) Simplify -3sqrt(16)/(sqrt(128)-1)1. 3sqrt(2)/4 Simplify (sqrt(7488)-2)/sqrt(4). -24sqrt(13) Simplify (sqrt(48) + -2sqrt(48))3. -12sqrt(3) Simplify (sqrt(17) + sqrt(17)-1 + 4 - sqrt(34)/(sqrt(2)-2))21. 4sqrt(17) + 81/4 Simplify ((sqrt(2736) + -1 - sqrt(2736))-3 + -2 + 1 + sqrt(2736))*2. 48sqrt(19) + 2740 Simplify (((sqrt(198) + 1sqrt(198))/sqrt(6))/(-3sqrt(176)))*2. 1/12 Simplify (-5(sqrt(500) - (sqrt(500) + -2)) - sqrt(500))*2. 200sqrt(5) + 600 Simplify (1 + 4-1sqrt(200))*2. -80sqrt(2) + 3201 Simplify 6(sqrt(17) - (sqrt(85) - ((2sqrt(85) - sqrt(85)) + sqrt(85)))/sqrt(5))*2. 408 Simplify (6(sqrt(75) + 2)3)2. 6480sqrt(3) + 25596 Simplify ((3(sqrt(88) + (sqrt(88) - sqrt(88)1 - sqrt(88)) - sqrt(88)))/(-1sqrt(648)))2 + -3. -16/9 Simplify (sqrt(2600) + (sqrt(2600) - (-1sqrt(2600) + sqrt(2600) + sqrt(2600))))/sqrt(128). 5sqrt(13)/4 Simplify ((sqrt(252) + -1)-5)2 + (4 + (sqrt(224)/sqrt(4))/sqrt(8))2. -292sqrt(7) + 6348 Simplify ((sqrt(119) - (sqrt(119) - (sqrt(119) + sqrt(119) + sqrt(119) + sqrt(119)-2)))-4)/((-1sqrt(14))/sqrt(2) - sqrt(7)). 2sqrt(17) Simplify -5(sqrt(13) - (sqrt(13) - (2 + -2sqrt(13)))). -10 + 10sqrt(13) Simplify 4 + (-3(-3 + (2sqrt(63))/sqrt(9)))*2. -108sqrt(7) + 337 Simplify (sqrt(19) + (sqrt(95)-1 - sqrt(95))/sqrt(5))2 + sqrt(76)/sqrt(4)2. 2sqrt(19) + 19 Simplify ((1sqrt(270) - sqrt(270) - sqrt(270))/sqrt(10) - sqrt(27))/sqrt(9). -2sqrt(3) Simplify ((sqrt(153) + (sqrt(153) - (sqrt(153) - (1sqrt(153)2 - sqrt(153)))) + sqrt(153) - sqrt(153))/(sqrt(144) - -1sqrt(144)))*2. 17/16 Simplify 0 + sqrt(700) + 0 + -3. -3 + 10sqrt(7) Simplify (sqrt(143) + sqrt(143)-2-2)/sqrt(11). 5sqrt(13) Simplify 2 + -3(sqrt(72) + 0)2. -214 Simplify ((sqrt(75) + 1 - sqrt(75)) + -1)2. 0 Simplify -3(1 + sqrt(272)). -12sqrt(17) - 3 Simplify -3 + (sqrt(1872) + -1sqrt(1872) - sqrt(1872) - sqrt(1872))2. 7485 Simplify -6((5-2sqrt(1100) - sqrt(1100)) + -4)*2. -798696 - 5280sqrt(11) Simplify (0 + -6(-1 + sqrt(288) + sqrt(288)) + 3)2. -2592sqrt(2) + 41553 Simplify (-1sqrt(220))/sqrt(11)2. -4sqrt(5) Simplify 4(sqrt(110)/sqrt(2))/sqrt(5). 4sqrt(11) Simplify sqrt(25)/(1sqrt(500)). sqrt(5)/10 Simplify ((0 + sqrt(432) + sqrt(432))*2 - sqrt(432)) + -1. -12sqrt(3) + 1727 Simplify 4 + (1 + sqrt(637)-2)2 + 4. -28sqrt(13) + 2557 Simplify 1sqrt(7) + -4 + (sqrt(77) - (sqrt(77) + (sqrt(77) - sqrt(77)-1)))/sqrt(11). -4 - sqrt(7) Simplify sqrt(275)26. 60sqrt(11) Simplify sqrt(405) + 3 + (0 + sqrt(405))2 + sqrt(405) - (4 + sqrt(80)/sqrt(4))2. 2sqrt(5) + 372 Simplify 3(0 + sqrt(1008)) - (5 + -2sqrt(1008)). -5 + 60sqrt(7) Simplify ((sqrt(80)2 - sqrt(80))/sqrt(10))/(sqrt(100)1). sqrt(2)/5 Simplify (4-3(0 + sqrt(7) + sqrt(7)))2. 4032 Simplify (-1 + -4 + sqrt(1250) + 1)2. -200sqrt(2) + 1266 Simplify 3 + sqrt(1700) + (-2sqrt(2448))2. 10sqrt(17) + 9795 Simplify (-4sqrt(175) + 1)2 + -3. -40sqrt(7) + 2798 Simplify ((sqrt(7) + 2 + sqrt(7) - sqrt(7))33)*2. 324sqrt(7) + 891 Simplify (6(sqrt(80) + 0 + -4))2. -1152sqrt(5) + 3456 Simplify sqrt(27) + -1 + (sqrt(75) + 1sqrt(75))2. 3sqrt(3) + 299 Simplify (sqrt(2) - (sqrt(30)/sqrt(3))/sqrt(5)) + (sqrt(60)/sqrt(5))/sqrt(6). sqrt(2) Simplify (5(-2 + sqrt(19)) + sqrt(19) + -2)2. -144sqrt(19) + 828 Simplify sqrt(7) + sqrt(1008)-1 + 5. -11sqrt(7) + 5 Simplify 1((sqrt(1331) - (sqrt(1331) - (sqrt(1331) + sqrt(1331)-1-3)) - sqrt(1331))2 + (((0 + sqrt(1331) - sqrt(1331))4 + sqrt(1331))*2 - sqrt(1331))). -11sqrt(11) + 13310 Simplify ((2sqrt(1500))/((1sqrt(25))/sqrt(5)))*2. 1200 Simplify (((sqrt(209) - 1sqrt(209)1 - sqrt(209)) + sqrt(209) - sqrt(209)) + sqrt(209))/(sqrt(891) + 1sqrt(891) - sqrt(891)). 0 Simplify (sqrt(117)/sqrt(9)-4)2 - -1sqrt(325). 5sqrt(13) + 208 Simplify sqrt(3) + sqrt(243)-3 + 4. -26sqrt(3) + 4 Simplify 1 + ((sqrt(304) - (2 + (sqrt(304) - (sqrt(304)-2 + sqrt(304))) + sqrt(304)))-4)2. 512sqrt(19) + 19521 Simplify (-1sqrt(5)11)2. 5 Simplify (0 + 1 + -2sqrt(1100))4. -80sqrt(11) + 4 Simplify sqrt(14)/(5-2sqrt(7)). -sqrt(2)/10 Simplify (sqrt(176)-32)*2. 6336 Simplify (-6sqrt(110)2 - sqrt(110))/(sqrt(10) + (-43sqrt(10) + sqrt(10) - sqrt(10))). 13sqrt(11)/11 Simplify (sqrt(1008) + 5 + (sqrt(1008) + 1 + sqrt(1008))*2)-1. -4038 - 60sqrt(7) Simplify 0 + sqrt(42)/((4sqrt(48))/sqrt(8)). sqrt(7)/4 Simplify (sqrt(126)/(1sqrt(9)))/sqrt(7). sqrt(2) Simplify -1-4sqrt(275)-3. -60sqrt(11) Simplify (-1sqrt(468) + 3)*21. -36sqrt(13) + 477 Simplify 4(sqrt(126)3)/sqrt(7). 36sqrt(2) Simplify 1(sqrt(1008) + 4sqrt(1008) + 2)*2. 240sqrt(7) + 25204 Simplify sqrt(63)/(sqrt(9)-2) + -1 + 1. -sqrt(7)/2 Simplify sqrt(10)/(sqrt(5) + (sqrt(5) + sqrt(5) + sqrt(125))-5)2. -sqrt(2)/17 Simplify (-6(-1 + sqrt(288) + -2 + sqrt(288) + 5))*2. 3456sqrt(2) + 41616 Simplify ((sqrt(11) + 1)-3 - (1 + sqrt(44))) + -1 + sqrt(176) + (-5 + -1sqrt(11))*2. 9sqrt(11) + 31 Simplify (sqrt(91)/(sqrt(7) + (sqrt(847) - sqrt(847)-2) + sqrt(847)))2. 13/2025 Simplify 6-1sqrt(3)2. -12sqrt(3) Simplify ((-5sqrt(110)-2 - sqrt(110)) + sqrt(110) + sqrt(110))/(sqrt(250)1). 11sqrt(11)/5 Simplify (sqrt(128) + (sqrt(128) - (-1 + sqrt(128) - sqrt(128)) - sqrt(128))2 - sqrt(2)) + sqrt(72). 1 + 13sqrt(2) Simplify (4 + (sqrt(8)/sqrt(4)5 - sqrt(2)))-2. -8sqrt(2) - 8 Simplify -11sqrt(1100) + sqrt(1100)-2 + 2 + -5. -30sqrt(11) - 3 Simplify -5(4 + sqrt(3))*2 + (sqrt(60)/sqrt(5))/sqrt(4). -95 - 39sqrt(3) Simplify (sqrt(520)/(sqrt(10) - sqrt(60)/(sqrt(6)2)))2 + -5. 203 Simplify 0 + (sqrt(2448) + 0)5. 60sqrt(17) Simplify sqrt(117)/(sqrt(27)/sqrt(3)) - ((sqrt(13) + -3 - sqrt(13))25 + sqrt(13)). -45 Simplify (-3 + 0 + sqrt(176))*2 + sqrt(176) + 3 + 1sqrt(176). -16sqrt(11) + 188 Simplify (sqrt(80)2 + -4)*2-1. -336 + 64sqrt(5) Simplify ((sqrt(272) - 1sqrt(272)) + 4)*2. 16 Simplify -3sqrt(132)/(sqrt(12) - sqrt(12)-1). -3sqrt(11)/2 Simplify sqrt(168)/sqrt(6) + -4. -4 + 2sqrt(7) Simplify ((4 + sqrt(16)/sqrt(8) + sqrt(2))-2)*2-1. -96 - 64sqrt(2) Simplify (sqrt(1700) + 1 + (sqrt(1700) - (sqrt(1700) + 1)))2 + sqrt(1700) + -1 + sqrt(1700) + -1. 20sqrt(17) + 1698 Simplify sqrt(612) + 2sqrt(612) - sqrt(612) - -2(sqrt(153))*2. 12sqrt(17) + 306 Simplify (3(3 + sqrt(76)))22. 216sqrt(19) + 1530 Simplify (sqrt(5) - (sqrt(320) + 0))2 - sqrt(10)/sqrt(50). -sqrt(5)/5 + 245 Simplify ((-2(sqrt(5) + sqrt(20)/sqrt(4)))*2 - (sqrt(5) + sqrt(5) + -1)-3) + 3. 6sqrt(5) + 80 Simplify (sqrt(567)-2)*2 + 4 + sqrt(21)/(sqrt(3)26 + sqrt(3)). sqrt(7)/13 + 2272 Simplify 6(sqrt(76) + -2)*2. -48sqrt(19) + 480 Simplify 1(sqrt(38)/sqrt(2) + 4). 4 + sqrt(19) Simplify (sqrt(204)/(sqrt(12)2 - sqrt(12)))*2 + 5. 22 Simplify (-1 + (sqrt(19) - (2sqrt(228))/sqrt(12))-4)-4. -16sqrt(19) + 4 Simplify (-4 + ((sqrt(44)/sqrt(4) + sqrt(11))3 + -3 + sqrt(176))-2)2. -80sqrt(11) + 4404 Simplify sqrt(150)/sqrt(3)2. 10sqrt(2) Simplify 1 + -5(sqrt(2448) + 0) + 2. -60sqrt(17) + 3 Simplify -1(sqrt(3) - (-5 + sqrt(243) + sqrt(243))). -5 + 17sqrt(3) Simplify (((sqrt(84) - -2sqrt(84))4)/((2sqrt(96))/sqrt(8)))2 + 5. 257 Simplify (-3 + 0 + 4(sqrt(288) - (sqrt(288) + 0)))*2. 9 Simplify (sqrt(17) - (-1 + sqrt(17))-2) + (-1sqrt(68) - sqrt(68))/sqrt(4) + sqrt(17). -2 + 2sqrt(17) Simplify 3 + (-1sqrt(605)-5)*2 + 5. 15133 Simplify 6((sqrt(242) + (sqrt(242) - 2sqrt(242))2 - sqrt(2)) + -1 + sqrt(2) + 3). 66sqrt(2) + 1464 Simplify (4(sqrt(425) + 3 - sqrt(17)))25. 1920sqrt(17) + 22480 Simplify sqrt(11)3 + 0 + 4 + -5. -1 + 3sqrt(11) Simplify (5sqrt(150)/sqrt(6))/((sqrt(180)/sqrt(3))/sqrt(12)). 5sqrt(5) Simplify 4sqrt(2448) -	{ "pile_set_name": "DM Mathematics" }
n 53187 is divided by 1516. 127 What is the remainder when 42137741 is divided by 186? 185 What is the remainder when 9137894 is divided by 340? 54 Calculate the remainder when 1637543 is divided by 1757. 19 Calculate the remainder when 262167 is divided by 214. 17 What is the remainder when 1200201 is divided by 399656? 1233 What is the remainder when 32066 is divided by 386? 28 What is the remainder when 188416739 is divided by 4444? 27 What is the remainder when 165165 is divided by 41000? 1165 What is the remainder when 120389603 is divided by 13376621? 14 What is the remainder when 18127435 is divided by 51? 46 Calculate the remainder when 6513409 is divided by 68. 29 Calculate the remainder when 14406964 is divided by 256. 52 Calculate the remainder when 541045 is divided by 25. 20 What is the remainder when 24165757 is divided by 6049? 2 Calculate the remainder when 1468984 is divided by 489254. 1222 Calculate the remainder when 222529 is divided by 73233. 2830 Calculate the remainder when 76426 is divided by 19092. 58 What is the remainder when 217602 is divided by 4236? 1566 What is the remainder when 2102735 is divided by 568? 567 Calculate the remainder when 15959 is divided by 9530. 6429 What is the remainder when 161299938 is divided by 161299928? 10 Calculate the remainder when 980714 is divided by 25136. 410 What is the remainder when 2845334 is divided by 872? 870 What is the remainder when 884782129 is divided by 2132? 2129 What is the remainder when 7477 is divided by 3568? 341 What is the remainder when 11251321 is divided by 5625646? 29 Calculate the remainder when 10413319 is divided by 131. 129 What is the remainder when 248282 is divided by 109? 89 Calculate the remainder when 466088075 is divided by 7553. 7551 Calculate the remainder when 19483483 is divided by 19483477. 6 Calculate the remainder when 7610295 is divided by 31. 12 Calculate the remainder when 23622658 is divided by 45. 43 What is the remainder when 31096 is divided by 2390? 26 What is the remainder when 138807 is divided by 374? 53 Calculate the remainder when 330514 is divided by 100. 14 Calculate the remainder when 9398248 is divided by 1044249. 7 What is the remainder when 1529639 is divided by 518? 503 What is the remainder when 1189084 is divided by 1265? 1249 Calculate the remainder when 5486 is divided by 5052. 434 Calculate the remainder when 145441 is divided by 1479. 499 What is the remainder when 10269383 is divided by 1137? 1136 What is the remainder when 1664429 is divided by 183? 44 Calculate the remainder when 3479668 is divided by 133833. 10 What is the remainder when 238277 is divided by 78? 65 Calculate the remainder when 283290 is divided by 297. 249 What is the remainder when 36410 is divided by 777? 668 Calculate the remainder when 717052 is divided by 119496. 76 Calculate the remainder when 83326819 is divided by 813. 10 What is the remainder when 887225 is divided by 443591? 43 What is the remainder when 335471 is divided by 6467? 5654 Calculate the remainder when 361782 is divided by 454. 398 What is the remainder when 800012 is divided by 58? 18 What is the remainder when 241702 is divided by 5386? 4718 What is the remainder when 1085781 is divided by 61? 42 Calculate the remainder when 30977328 is divided by 4. 0 What is the remainder when 842284986 is divided by 43? 40 What is the remainder when 4411418 is divided by 18? 14 What is the remainder when 39706026 is divided by 11593? 1 What is the remainder when 1079198 is divided by 2466? 1556 What is the remainder when 237605 is divided by 4003? 1428 What is the remainder when 391529 is divided by 78304? 9 Calculate the remainder when 3999545 is divided by 66659. 5 Calculate the remainder when 1341135 is divided by 973. 341 What is the remainder when 131499778 is divided by 1263? 7 What is the remainder when 3238 is divided by 2244? 994 What is the remainder when 26148 is divided by 2571? 438 What is the remainder when 1357107 is divided by 982? 965 Calculate the remainder when 195742 is divided by 13633. 4880 Calculate the remainder when 2247238 is divided by 61. 59 What is the remainder when 547649 is divided by 273824? 1 What is the remainder when 29496 is divided by 16633? 12863 Calculate the remainder when 12275552 is divided by 17073. 65 What is the remainder when 31483089 is divided by 27? 9 Calculate the remainder when 68194 is divided by 9737. 35 What is the remainder when 517627 is divided by 517603? 24 Calculate the remainder when 3648871 is divided by 165857. 17 What is the remainder when 12362 is divided by 785? 587 Calculate the remainder when 2533464 is divided by 6239. 430 What is the remainder when 96452609 is divided by 415744? 1 Calculate the remainder when 205551 is divided by 33914. 2067 What is the remainder when 58501 is divided by 6428? 649 What is the remainder when 1736475 is divided by 72352? 27 What is the remainder when 342355 is divided by 339? 304 Calculate the remainder when 1436510 is divided by 359106. 86 Calculate the remainder when 49934655 is divided by 8. 7 Calculate the remainder when 664731 is divided by 221572. 15 Calculate the remainder when 44817974 is divided by 3383. 3373 What is the remainder when 251513 is divided by 20693? 3197 Calculate the remainder when 1732422 is divided by 35355. 27 Calculate the remainder when 6910006 is divided by 691000. 6 What is the remainder when 111095 is divided by 780? 335 What is the remainder when 56240567 is divided by 943? 47 Calculate the remainder when 6177 is divided by 1668. 1173 What is the remainder when 438180 is divided by 218671? 838 Calculate the remainder when 458444 is divided by 195. 194 What is the remainder when 1447068841 is divided by 1779? 1777 Calculate the remainder when 25660214 is divided by 334. 330 What is the remainder when 10943981 is divided by 150? 131 Calculate the remainder when 6929 is divided by 712. 521 What is the remainder when 43278 is divided by 2878? 108 Calculate the remainder when 1895883 is divided by 394. 349 What is the remainder when 5074557 is divided by 325? 7 Calculate the remainder when 8183940 is divided by 2671. 2667 Calculate the remainder when 1585837185 is divided by 1108. 1105 Calculate the remainder when 735691 is divided by 933. 487 What is the remainder when 14937028 is divided by 14? 8 Calculate the remainder when 5659157 is divided by 5659141. 16 What is the remainder when 543539 is divided by 1210? 249 What is the remainder when 28200631 is divided by 4700099? 37 What is the remainder when 1070934 is divided by 2910? 54 Calculate the remainder when 19483024 is divided by 405894. 112 Calculate the remainder when 152141 is divided by 103. 10 What is the remainder when 11363398 is divided by 1429? 1419 What is the remainder when 2209 is divided by 549? 13 What is the remainder when 384295 is divided by 2805? 10 What is the remainder when 1204746 is divided by 3460? 666 What is the remainder when 231103 is divided by 2199? 208 Calculate the remainder when 46244 is divided by 2543. 470 Calculate the remainder when 2062657 is divided by 245. 2 What is the remainder when 129027 is divided by 24577? 6142 What is the remainder when 37729425 is divided by 1886471? 5 Calculate the remainder when 1238185 is divided by 88439. 39 What is the remainder when 733000 is divided by 344? 280 What is the remainder when 214331 is divided by 1246? 19 Calculate the remainder when 229887 is divided by 19147. 123 What is the remainder when 5506283 is divided by 6125? 6033 Calculate the remainder when 167744488 is divided by 30. 28 What is the remainder when 390668 is divided by 55711? 691 Calculate the remainder when 46932 is divided by 44286. 2646 Calculate the remainder when 577467 is divided by 1617. 198 What is the remainder when 140567 is divided by 61? 23 Calculate the remainder when 69409 is divided by 23007. 388 Calculate the remainder when 1587807 is divided by 7. 4 What is the remainder when 775393 is divided by 230? 63 What is the remainder when 1027797 is divided by 177? 135 What is the remainder when 2494460 is divided by 4797? 20 Calculate the remainder when 68791 is divided by 13732. 131 What is the remainder when 798935 is divided by 1314? 23 W	{ "pile_set_name": "DM Mathematics" }
is next in 2512, 5277, 8034, 10777, 13500, 16197, 18862? 21489 What comes next: -1227, -874, -293, 510, 1529, 2758, 4191? 5822 What is the next term in 134822, 1078714, 3640708, 8629856, 16855210? 29125822 What is next in 77968, 77853, 77738, 77623, 77508, 77393? 77278 What is next in -167, -1800, -4975, -9764, -16239, -24472? -34535 What comes next: -213860, -855545, -1925010, -3422249, -5347256, -7700025, -10480550? -13688825 What is next in 190, 2523, 8838, 21127, 41382, 71595? 113758 What is next in -591, -2017, -3325, -4515? -5587 What is next in 351, 1607, 3719, 6687? 10511 What is the next term in 177607, 354065, 529383, 703567, 876623, 1048557? 1219375 What is next in 14438919, 57755665, 129950241, 231022647, 360972883? 519800949 What is next in 329115, 1316432, 2961955, 5265684? 8227619 What comes next: 48, 160, 70, -336, -1172, -2552? -4590 What comes next: -36307, -72578, -108871, -145192, -181547, -217942, -254383? -290876 What is next in 1050, 11358, 40188, 96798, 190446, 330390? 525888 What is next in 53920, 107826, 161686, 215500, 269268, 322990, 376666? 430296 What is next in -31249, -125067, -281431, -500341, -781797? -1125799 What comes next: -2140482, -2140519, -2140556, -2140593? -2140630 What is next in -3523, -7485, -12397, -18733, -26967, -37573? -51025 What is the next term in 750126, 750117, 750120, 750141, 750186, 750261, 750372, 750525? 750726 What is the next term in -181949, -181918, -181859, -181766, -181633, -181454, -181223? -180934 What comes next: 360453, 721039, 1081625, 1442211, 1802797, 2163383? 2523969 What is next in 10609, 42557, 95951, 170887, 267461? 385769 What is next in 18695840, 18695847, 18695854? 18695861 What is next in -2093667, -2093660, -2093649, -2093634, -2093615, -2093592? -2093565 What comes next: 25574, 31588, 41610, 55640? 73678 What is the next term in 188820, 189383, 189950, 190521? 191096 What is next in -10376263, -10376207, -10376151, -10376095? -10376039 What is the next term in 779716, 3118865, 7017446, 12475459, 19492904? 28069781 What is the next term in -26889, -53803, -80715, -107625? -134533 What comes next: -1032, -3264, -6740, -11460, -17424, -24632, -33084? -42780 What comes next: 8678651, 8678663, 8678691, 8678741, 8678819? 8678931 What is next in -74083211, -74083212, -74083227, -74083262, -74083323? -74083416 What comes next: 622, 4658, 15584, 36832, 71834, 124022, 196828? 293684 What comes next: -456, -2316, -5428, -9792, -15408, -22276? -30396 What is the next term in 5644, 8093, 10536, 12973, 15404, 17829? 20248 What is the next term in -53798, -52291, -49780, -46265, -41746, -36223, -29696? -22165 What is next in -14826872, -14826874, -14826876? -14826878 What is the next term in -6963874, -13927752, -20891636, -27855526, -34819422, -41783324, -48747232? -55711146 What is next in 5176663, 5176927, 5177367, 5177983, 5178775? 5179743 What comes next: 31201, 124762, 280683, 498964? 779605 What is the next term in -525, -1208, -2075, -3126, -4361, -5780? -7383 What is the next term in -2109, -20259, -69523, -165459, -323625? -559579 What is next in 29694083, 59388165, 89082247, 118776329, 148470411, 178164493? 207858575 What is the next term in -11574, -41908, -92470, -163266, -254302? -365584 What is the next term in -66920, -267772, -602526, -1071182, -1673740, -2410200, -3280562? -4284826 What is the next term in -1439, 3560, 11893, 23566, 38585, 56956, 78685? 103778 What comes next: 31482, 63400, 95330, 127278, 159250, 191252? 223290 What is next in 13865, 25907, 34277, 37139, 32657, 18995? -5683 What is next in -2741, -13505, -31445, -56561, -88853? -128321 What is next in -70389, -70276, -70121, -69924, -69685, -69404? -69081 What is the next term in -200037, -400119, -600199, -800277, -1000353, -1200427? -1400499 What is the next term in -992734, -1985512, -2978290, -3971068, -4963846, -5956624? -6949402 What is next in -21549, -43811, -66073, -88335, -110597? -132859 What comes next: 2172346705, 2172346706, 2172346707, 2172346708, 2172346709, 2172346710? 2172346711 What comes next: 5306284, 5306286, 5306290, 5306296, 5306304, 5306314? 5306326 What comes next: 4401922, 8803837, 13205750, 17607661, 22009570? 26411477 What comes next: 571215, 571298, 571377, 571452? 571523 What is the next term in -9098, -9191, -9282, -9371, -9458, -9543, -9626? -9707 What is next in -9364, -18837, -28310, -37783, -47256? -56729 What is the next term in 266534, 533155, 799830, 1066559, 1333342? 1600179 What is the next term in -202397, -404793, -607191, -809591, -1011993? -1214397 What is the next term in -35697, -35642, -35561, -35454? -35321 What is next in 5309503, 10619007, 15928511, 21238015, 26547519? 31857023 What is next in 4585, 8989, 13235, 17323, 21253? 25025 What comes next: 11336, 45049, 101232, 179879, 280984, 404541? 550544 What comes next: -5190, -5020, -4860, -4716, -4594, -4500, -4440, -4420? -4446 What is the next term in -1709, -6437, -14201, -25001, -38837? -55709 What comes next: -19021, -18812, -18173, -16888, -14741, -11516, -6997, -968? 6787 What comes next: 170720, 170796, 170872? 170948 What is the next term in -5793, -24251, -55015, -98085? -153461 What is next in 1409, 11351, 38345, 90917, 177593, 306899, 487361? 727505 What is the next term in -8728, -1092, 6542, 14174, 21804, 29432, 37058? 44682 What is next in -3323, -25772, -86589, -204956, -400055, -691068? -1097177 What comes next: -134906, -269757, -404608, -539459? -674310 What comes next: -506560, -506567, -506580, -506599, -506624, -506655, -506692? -506735 What comes next: -281, -148, -15, 118? 251 What comes next: -6780, -12299, -17812, -23319, -28820, -34315? -39804 What is next in -2015, -8618, -19789, -35528, -55835, -80710? -110153 What comes next: 40516, 156824, 350662, 622024, 970904, 1397296, 1901194, 2482592? 3141484 What comes next: -118539, -474047, -1066559, -1896075? -2962595 What comes next: -313789, -313320, -312533, -311422, -309981, -308204, -306085, -303618? -300797 What is the next term in 346, 731, 1060, 1333, 1550, 1711? 1816 What is the next term in -474298, -474739, -475180, -475621? -476062 What is next in 12275, 12453, 12629, 12803, 12975? 13145 What comes next: 834115, 3336364, 7506777, 13345348, 20852071, 30026940, 40869949, 53381092? 67560363 What comes next: -3993296, -3993334, -3993384, -3993452, -3993544? -3993666 What comes next: -17114, -16605, -15738, -14489, -12834? -10749 What is next in 107568, 107465, 107362? 107259 What is the next term in -457, -3586, -12065, -28570, -55777, -96362? -153001 What is the next term in -133654, -133510, -133366, -133222, -133078? -132934 What is next in -1541, -1725, -2187, -3053, -4449, -6501, -9335, -13077? -17853 What is the next term in -178617, -714405, -1607369, -2857509, -4464825? -6429317 What comes next: -1537, -4024, -6511? -8998 What is the next term in 5118, 41319, 139866, 332025, 649062, 1122243? 1782834 What comes next: 22874, 22788, 22704, 22622, 22542, 22464, 22388? 22314 What comes next: 3029, 4843, 9783, 19409, 35281, 58959? 92003 What is next in -260841856, -260841857, -260841858, -260841859, -260841860, -260841861? -260841862 What comes next: 25472, 25483, 25496, 25505, 25504, 25487? 25448 What is next in -1242421, -1242430, -1242443, -1242460, -1242481? -1242506 What is next in 1011055471, 1011055472, 1011055473, 1011055474, 1011055475, 1011055476? 1011055477 What is next in 166376, 333469, 500562, 667655, 834748, 1001841? 1168934 What is the next term in 274, 65, -144, -353, -562, -771? -980 What is next in 2481303, 2481280, 2481257? 2481234 What comes next: 29576459, 59152918, 88729377? 118305836 What is next in 17982774, 35965560, 53948346, 71931132, 89913918? 107896704 What is next in -424, -1491, -2560, -3631, -4704? -5779 What is the next term in -24310, -24165, -24022, -23881, -23742, -23605? -23470 What comes next: -11990687, -11990677, -11990663, -11990645, -11990623? -11990597 What comes next: -1660, -3197, -4748, -6313, -7892, -9485? -11092 What is the next term in -47831, -47381, -46945, -46529, -46139, -45781, -45461, -45185? -44959 What comes next: -9066, -38006, -86242, -153774? -240602 What is next in 29498432, 29498431, 29498428, 29498423? 29498416 What is the next term in 768, 25	{ "pile_set_name": "DM Mathematics" }
False Let q = -20 - -21. Let t = -12 + 6. Let w = 6.1 + t. Is q less than w? False Let k(p) = -14p + 2. Let w be k(-11). Let n be 82-810/w. Let j = n - -42. Is j equal to 1? False Let z = 157 - 231. Let o be 0/(-1) + z/4. Let i = o + 18. Which is smaller: 0 or i? i Suppose -2h - h + 12 = 0. Suppose -85 = -hp - 21. Let u = p - 18. Which is smaller: -1 or u? u Suppose 5j + 3g = 15, -g = -j - 0g - 5. Is j >= 0? True Let h = 17 - 33/2. Suppose 2n + 1 + 14 = 5g, -3n = 2g - 6. Suppose 5s - 5 = -gf, 7f - 4f = -3s + 3. Does s = h? False Let c = 0.028 + -0.228. Is c <= -207? False Suppose 4u = 71 + 9. Let c be 161 - (-11)/(99/54). Which is smaller: c or u? u Let f be 15/20 + (-1)/(-4). Suppose 448 = -5p - 367. Let b = -484/3 - p. Which is smaller: b or f? f Let k(p) = -5p2 - 63p - 38. Let b be k(-12). Is -9/5 > b? True Suppose -107x = -106x - 5d - 37, -5d + 20 = 0. Which is bigger: x or 54? x Let l = -9 + 2. Let m(h) = 5h + 4. Let d be m(-2). Is l > d? False Let b = -42 + 66. Suppose 0 = 5d - 3d - b. Is d < 10? False Let g = 9.3 + 17.5. Let l = -24 + g. Let c = l + -0.8. Is c greater than or equal to 0.2? True Suppose 2u - 3k = -7k - 16, 6 = -3u + 3k. Let f be 6-1 + 224/40. Is f greater than or equal to u? True Let t(k) = -k3 + 20k*2 + 4. Let m be t(20). Suppose mh = -5y - 16, 0 = -2h + 3y - 14 - 16. Is h greater than or equal to 2/3? False Let d = 3.1 - 11.1. Let o = d + 7.81. Let y = o + -0.11. Is y < 0.1? True Let g be 3 - (2 + -1) - 7828/(-570). Let y = g + -92/5. Suppose 20 = -20j + 15j. Which is smaller: j or y? j Let q = -42 + 37. Let y = q + 68/15. Which is greater: y or -1? y Suppose 0n + 3 = 4s - n, -5s + 4n - 10 = 0. Do s and 11/14 have the same value? False Let b be ((-9)/(-9))/((-1)/(-2)-1). Which is bigger: -9/2 or b? b Let n(m) = -m*3 - 10m*2 - m - 5. Let o be n(-10). Suppose -op - 3a + 34 = 0, a + 0a - 18 = -3p. Is p <= -0.2? False Let o be (-179 + -4)/((-24)/(-16)). Is o != -122? False Let s be 392/(-15) - 16/2400-20. Suppose -2y - 7 = 47. Does y = s? False Suppose 73 + 134 = -23b. Let j = 11 + -6. Let f be ((-1)/j)/(24/(-30)). Which is smaller: f or b? b Suppose 0 = 6k - k + 2x - 2, 16 = -4x. Suppose p = 1 - k. Which is smaller: -7/3 or p? -7/3 Let r(w) = -w - 5. Let b be r(-3). Let u be b/2(-1 - 0). Let x be (-28)/(-10) + (3 - 5). Which is smaller: u or x? x Suppose -6t + 18 - 6 = 0. Suppose 0 = -3i - 5 + t. Let k be (((-6)/5)/3)/(-8). Which is smaller: i or k? i Let r be (-245)/(-190) + 4 + (-25)/5. Is 1 at least as big as r? True Let s = -2 - -2. Let k = -19 - -43. Let x = -24.07 + k. Which is smaller: s or x? x Let u = 47 - 30. Suppose w - u = -20. Which is bigger: -1 or w? -1 Suppose 0 = 5i - 5h + 25, -7h - 11 = i - 2h. Let n be ((-3)/(-9))/((-8)/i). Let a = -290 + 289. Which is greater: n or a? n Let j = 133/9 + -26. Which is smaller: -11 or j? j Let u be -4 + (6/(-9))/(2/(-9)). Let n be (-2)/9 - -94u/(-72). Which is greater: 1 or n? n Let q = -40 - -53. Let k = -19 - -36. Suppose qv = kv. Which is smaller: v or -4? -4 Let b(s) = -2s + 9. Let n be b(7). Let u be (-2)/(n/((-195)/6)). Do u and -15 have the same value? False Let w be -107/((-31815)/(-18)). Which is smaller: w or 0? w Let o(u) = 3u*2 + 3u - 1. Let g be o(3). Suppose -5t + g = 5x, -2 = -t - 1. Suppose 14 = -2f - s + 3, -3f = -2s + x. Are -3 and f equal? False Let v = -0.2 + 0.3. Let l = -0.1892 + 0.1692. Is l < v? True Let s = -337 - -336. Is s >= 0.0084? False Let w be 100/(-150)21/2. Which is smaller: -16 or w? -16 Let a be (-2)/(-13) - -4(-3)/78. Let p be -3 + a - 66/(-27). Is p smaller than -2? False Let x be (-170)/(-14) - 6(-2)/(-84). Let i be (-11)/(-33) - -1(-1)/x. Is i equal to -2/33? False Let f = -3 - -3. Let b be (-1 - 0)/((-274)/(-20)). Let c = b - -1500/1781. Which is smaller: c or f? f Let j be 1 - 1 - (2 + -4). Suppose 0 = x + t - 2, -x - t - t = 2. Suppose 4v - 3k = x, 5v - 2v - 5 = 2k. Which is smaller: j or v? j Suppose 2q - 41n - 2 = -43n, -4q = -3n - 4. Is q <= 3/862? False Let b = 59.9 - 60. Let z = -552 + 19322/35. Is z greater than or equal to b? True Suppose 2 = 3d + 26. Let w be (2/(d/(-12)))/(-1). Is -2 less than or equal to w? False Let f be 12/(-8) - (4788/(-8))/(-9). Is f less than -68? False Suppose 6g - 184 - 2672 = 0. Is g greater than or equal to 474? True Let u be (((-24)/(-7))/(-3))/(2/(-7)). Let g = 3 - u. Which is smaller: -3/29 or g? g Let o = 54 + -54.082. Let x = 59.918 - o. Which is bigger: x or 0? x Let k = -4 + -6. Let x = -149 + 158. Let v = x + k. Which is smaller: v or 9/4? v Suppose 0 = -5k - 2g + 135, -g - g = 3k - 85. Let t = k + -40. Which is bigger: t or -14? -14 Let w = 1015690/283 + -3589. Let u = -5401/2264 + w. Let b = u - -225/88. Which is bigger: 1 or b? 1 Let l = 19423/39 + -498. Which is greater: 1 or l? 1 Let j = 1027.99 - 1042. Let p = -14 - j. Which is smaller: p or 0? 0 Let p(c) = -3c - 6. Suppose 2n + 9 = -4k - 1, 0 = 4n - 4. Let v be p(k). Let s = -3 + v. Is s at most 0? True Let j(r) = -r - 1. Let z be j(-2). Let u be (-2 - 2)(-146)/(-7). Let a = 83 + u. Which is smaller: a or z? a Let n be (3/66)/(1/(-2)). Let w = 1624 - 1619. Is n smaller than w? True Let b = 44 + -40. Let m be (b - 7) + 68/22. Which is bigger: m or -0.3? m Suppose -7w + 2w = 5t, 4w + 3t = 0. Suppose 4j + j + 5h - 20 = 0, h - 2 = w. Suppose 2v + 18 = u, 2u = -jv + 4v + 34. Which is smaller: 17 or u? u Let g(x) = -x*2 - 15x + 15. Let a be g(-15). Let w = a + -15. Suppose w = b + b. Which is smaller: b or 3/4? b Let t(k) = k*2 - 8k - 21. Let n = 6 + 3. Let p be t(n). Let g be 13/12 - (-9)/p. Which is greater: -1/4 or g? g Let j = -1.364 - -8.194. Let r = j - -0.17. Let i = 7.2 - r. Which is smaller: i or 0.1? 0.1 Suppose -2f - 5a + 245 = 0, -3f - 13a + 320 = -15a. Let h be ((-2)/4 - f/(-160))1. Let l = -2 - -2. Is l >= h? False Let j(r) = -5r - 3. Let b be j(-7). Let x = b - 35. Which is smaller: -1 or x? x Let c be (352/(-308))/((-10)/217). Is 24 at most as big as c? True Let u(h) = -3 - 2 - h + 0 + 8 + h3. Let t be u(0). Which is greater: t or 4? 4 Let o(y) = -y3 + 7y*2 + y - 4. Let j be o(7). Let x be (-3)/(-6) - (-19)/2. Suppose -3i = -13 + x. Is j at least as big as i? True Let r = 0.4 + -1.4. Let d = r - -1. Let i = 0.7 + -0.6. Which is smaller: d or i? d Let q(h) = 5h2 + 55h - 3. Let x be q(-11). Is x bigger than -43/10? True Let r = 12769410 + -120096301378/9405. Let o = r + -2/209. Let l(p) = -p*3 - 6p*2 - 11p - 6. Let w be l(-3). Is w bigger than o? True Let t(a) = 2a + 11. Let i be t(-5). Let u be (45/(-10) - -4)i. Which is bigger: -1 or u? u Let u(j) = j - 1. Let o be u(0). Suppose -2h = 3 + 1. Let m = h - o. Which is smaller: 3 or m? m Let d = 1.1 + 0.7. Let h = d + 10.2. Let n = h + -12.08. Are 1/3 and n equal? False Let g(r) = -r2 - 10r + 12. Suppose 65 = -4j + 21. Let a be g(j). Let w be (-5)/(-30)a-5. Which is smaller: 0 or w? w Let j(d) = d2 - 11d - 24. Let o be j(13). Suppose -ow = -3w + 1. Is 1/16 >= w? False Let j(w) = w*2 - 8w + 9. Let z be j(7). Suppose 3h = zs - 8, -5s = -2h - 14 + 5. Let q = 38 + -109/3. Is q at least as big as s? True Let u be (-3 - -12) + (2 - -70). Which is smaller: 79 or u? 79 Suppose 3u + 13 = 4y - 160, 267 = -5u - 4y. Let q = -56 - u. Is q at least as big as -1/3? False Let d = -1 - 2. Let h be -2 + d + (-633)/(-12). Let f = -48 + h. Is f < 0.6? True Let n(w) = 7w2 - 10w + 102. Let z be n(-8). Is 631 bigger than z? True Let t be 1/((-18)/66) + 2/(-6). Which is greater: t or -32? t Suppose -6 = 3g - 0g. Let w be 2/(-30) - 1920/3600. Which is greater: w or g? w Let l = -0.47 + 24.47. Let q = -25.2 + l. Which is bigger: q or 0.2? 0.2 Let o(x) = 14x + 44. Let t be o(3). Are 83 and t non-equal? True Let v = 1414 + -1410. Which is bigger: v or 37/12? v Let j be (-5)/((-10)/(-8)) - (22 - 20). Which is greater: j or -1? -1 Suppose -f - 11 = 2d, -4d + 2f - 13 = -3. Suppose -4r = -4 - 4. Suppose -r = -a + 2a. Do a and d have the same value? False Suppose 0 = -3p - 2f + 61, -4f - 47 = -2p + f. Let m be 3/p + 4/(-28). Let y = -2 - m. Which is greater: y or -7/4? -7/4 Let f be (-5 - -2)/(-2 - -1). Suppose -2*b +	{ "pile_set_name": "DM Mathematics" }
(a) -1 (b) 38 (c) 3/25 b Which is the second smallest value? (a) 2 (b) 2/3 (c) 11/4 (d) -1 (e) -4 d Which is the third biggest value? (a) -28 (b) -2 (c) 0.3 (d) -162 (e) -0.5 (f) 1 e Which is the second smallest value? (a) -3 (b) -16 (c) 5251 a What is the third smallest value in -67, 2, 26.5, 0? 2 What is the third smallest value in 1, -865/2, 6/11, 5? 1 Which is the fourth biggest value? (a) 4 (b) -2 (c) -15 (d) -38 d What is the smallest value in 2, -7/9, -0.07, 1, -0.1? -7/9 Which is the fourth smallest value? (a) 586 (b) 8 (c) -1/3 (d) -4 a Which is the third biggest value? (a) -2/3 (b) -0.02 (c) 0.816 a What is the second biggest value in 1, 1671, -0.87? 1 Which is the fourth biggest value? (a) -9750 (b) 1/5 (c) -5 (d) 4/5 a What is the fourth biggest value in -1, 1/5, -2.7, 20, -10? -2.7 What is the biggest value in -0.3, 2/17, -6, 0.02, 0.4, -49? 0.4 What is the fourth biggest value in 5, 0, -8/5, 1568? -8/5 What is the third biggest value in -1/4, 0.4, 0.26, -0.014, 2, -17? 0.26 What is the second biggest value in -0.2, -131490, 3? -0.2 Which is the fifth biggest value? (a) -1.1 (b) -0.5 (c) 0 (d) -4 (e) -155 (f) -4/9 d What is the second biggest value in -113, -0.5, -1, -1/3, 1/3? -1/3 What is the third biggest value in -4, 2.286, -0.4, 1/9? -0.4 What is the fourth smallest value in -0.6, 5, -2, -1, -0.3, 33/13? -0.3 What is the fourth smallest value in -0.02, 2/47, 1/5, 0, 2/41? 2/41 Which is the second smallest value? (a) 4 (b) -0.3 (c) 150 (d) -0.4 b What is the fourth smallest value in -10, -8/7, 0, -101? 0 Which is the third biggest value? (a) -11.282 (b) 42 (c) -0.1 a Which is the third biggest value? (a) -93 (b) 30/17 (c) 0.2 a What is the fourth biggest value in 2/11, -2/13, -7, -1275? -1275 What is the second biggest value in 0.2, 2/17, 1, -19, 0.22? 0.22 What is the biggest value in 1, 22, -2/161, -1? 22 What is the biggest value in -1/3, 3, 3/5, -19/161? 3 Which is the third smallest value? (a) -1/298 (b) -42 (c) -5/8 a What is the second smallest value in -2/13, -12/5, -1.6, -9? -12/5 Which is the second smallest value? (a) -8 (b) 2/61 (c) -2 (d) -4 (e) 1/3 d Which is the second smallest value? (a) 2/7 (b) 2/45 (c) -1914 (d) -4/7 d What is the third smallest value in 1/119, -29.2, -0.2? 1/119 Which is the second smallest value? (a) 0.18 (b) -7 (c) 417 (d) -3/4 d Which is the second biggest value? (a) 0.5 (b) 404 (c) -5 a What is the third smallest value in -2, -0.5, 127? 127 What is the fifth biggest value in -94, -2/5, -0.03, -9, -0.3, 4? -9 Which is the fifth biggest value? (a) -10 (b) 11/7 (c) 0.1 (d) 5 (e) -3 a What is the biggest value in 11/3, -22, 0.4, -1.6, 0.5, 0? 11/3 Which is the smallest value? (a) 5 (b) -344 (c) 0.4 b What is the fourth biggest value in -0.022, 5, 31, -2? -2 Which is the second smallest value? (a) 0.1 (b) -3/7 (c) 22/3 (d) -69 b Which is the third biggest value? (a) -5 (b) 11.95 (c) 27 (d) 3/5 d What is the smallest value in 1842.97, 0, -0.3? -0.3 What is the third smallest value in 1, 365, 0.1, -47, 4/5? 4/5 Which is the fifth smallest value? (a) 1/9 (b) -2 (c) 1/2 (d) 22/5 (e) 49 e Which is the second biggest value? (a) 4.6 (b) -4261 (c) -3 c What is the second smallest value in 1/3, -28, 2806? 1/3 Which is the third smallest value? (a) 0.5 (b) 15 (c) 111.3 c What is the fourth smallest value in 22, -0.2, -41, -2/9? 22 Which is the fourth biggest value? (a) -32.6 (b) 2/13 (c) -1 (d) 0.049 a Which is the second smallest value? (a) -12 (b) -0.5 (c) -0.3 (d) -97 (e) 0.3 a What is the biggest value in -10, -9, -4, 0.0842? 0.0842 What is the fifth smallest value in -15, 3, 22, -1, 15? 22 What is the biggest value in 3, -4, 14/3, 2? 14/3 Which is the third biggest value? (a) 1 (b) 3 (c) -1112/5 (d) -1/33 (e) 1/2 (f) -0.4 e Which is the third smallest value? (a) -1 (b) 0.00691 (c) -0.2 (d) 3 b What is the third biggest value in -2, -1/3, 1650/31, -0.2? -1/3 Which is the second smallest value? (a) -19950 (b) 46 (c) 2 c Which is the fifth smallest value? (a) 5 (b) -90 (c) -4 (d) -1 (e) -5/6 a What is the fourth biggest value in -1/3, 0, 0.05, -0.06515? -1/3 Which is the second biggest value? (a) 10 (b) -0.1 (c) 1.2 (d) 19 a What is the second biggest value in -1/8, -0.5, 213, 13? 13 Which is the fourth smallest value? (a) 10.79 (b) 0.4 (c) 1/4 (d) -0.7 a Which is the fourth biggest value? (a) 0 (b) -0.3201 (c) -4 (d) -1 c What is the fourth biggest value in 5, 54, -1/8, -32? -32 What is the third smallest value in 0.318, 3/4, -1/145? 3/4 What is the third biggest value in -0.5, -32, 1/1334? -32 What is the second biggest value in 0.2, 0.5, 3/2, -17, -1/4? 0.5 Which is the third smallest value? (a) -0.08 (b) 0.1 (c) -56 (d) 0 (e) 1.3 (f) -2 a What is the second smallest value in 4/7, -0.1, -277, -36? -36 What is the second smallest value in 0.4, -10/99, 0.15? 0.15 What is the second smallest value in 15, 2257, -0.4? 15 Which is the smallest value? (a) -12.3 (b) 2 (c) 2/9 a Which is the fifth biggest value? (a) 2/15 (b) 5 (c) -6 (d) 0.3 (e) -20 e Which is the fourth smallest value? (a) 0.2 (b) -3/8 (c) -1.93 (d) -2/7 a Which is the third biggest value? (a) 28.4 (b) -0.89 (c) 4 b What is the third biggest value in 1, -7, -224? -224 What is the third biggest value in -5, -30, 2/7, 297? -5 Which is the biggest value? (a) 4.59 (b) 7 (c) -5 b What is the third biggest value in -97, 10, 0.08? -97 Which is the second smallest value? (a) 17521 (b) -0.06 (c) 1/7 c What is the biggest value in 1, 1/5, 0.5, 42672? 42672 What is the third biggest value in 53, 15, 121? 15 Which is the second biggest value? (a) -0.1296 (b) 54 (c) -3 a What is the biggest value in -1/4, -4, 0, 0.4, -64? 0.4 What is the smallest value in -2, -303, -1/5, 0.9? -303 Which is the second biggest value? (a) -0.3 (b) -2 (c) 0.16 (d) 62 c What is the fourth smallest value in -1.9, 0.3, 196/5, 2? 196/5 Which is the sixth biggest value? (a) 0.5 (b) -3 (c) 9 (d) -0.08 (e) 3 (f) 1/6 b Which is the second smallest value? (a) -0.1 (b) -3.4 (c) 0.15 (d) 2.2 a Which is the fourth biggest value? (a) 18 (b) -5/53 (c) 1/4 (d) 3 b What is the third smallest value in 0, -1, 55, -0.2, 2, -52? -0.2 What is the third smallest value in 10, -0.1, 2, -16, 4, 0.6? 0.6 What is the biggest value in -1/4, -25, 18/11, 4? 4 What is the second biggest value in 2, 0.099, 99? 2 What is the second biggest value in 0.1107, -5, 5, -2? 0.1107 What is the third smallest value in 1126/3, -2, -1/4, -0.08? -0.08 Which is the second smallest value? (a) -12/13 (b) 120 (c) -3 a What is the smallest value in -3, -14338, 0.03? -14338 What is the second biggest value in 1/4, 1, 21/2, 146/3? 21/2 What is the biggest value in 0, 2/11, 4, -71.6? 4 Which is the biggest value? (a) -325 (b) -118 (c) -28 c Which is the second biggest value? (a) 0.11 (b) -0.1 (c) -2/9 (d) 2 (e) -27 a What is the second biggest value in -4, 0.02, 4/17, 5/8, 1? 5/8 Which is the biggest value? (a) 24.6 (b) 2/287 (c) 0.4 (d) -4 a Which is the biggest value? (a) 2/11 (b) 619 (c) -3 (d) -6/11 (e) 1 (f) -0.5 b Which is the biggest value? (a) -3/2 (b) 22 (c) -4 (d) 0.5 (e) -16 b What is the second smallest value in 2, -3, -8/23, -7/3? -7/3 Which is the second smallest value? (a) -2/11 (b) 0.1 (c) -1 (d) 22.23 (e) -0.5 (f) -4 c Which is the fourth smallest value? (a) -5 (b) 0.11 (c) -626 (d) 3 d Which is the second smallest value? (a) 12 (b) 113 (c) -3 a What is the fourth biggest value in 3, 4, -1/2, 50/13, -1/9? -1/9 What is the third smallest value in 1, 0.007, 4932.1? 4932.1 Which is the biggest value? (a) -3 (b) 3 (c) 1529460 c Which is the third biggest value? (a) 7 (b) -4 (c) -350 (d) -1/7 (e) 3/2 (f) 3 e What is the third smallest value in 21/20, -82.4, -2, -4, 0.2? -2 Which is the fourth biggest value? (a) -4 (b) -0.3 (c) -124 (d) -493 d What is the fourth biggest value in -1/3453, 2, -0.7, 3? -0.7 Which is the fourth smallest value? (a) -26 (b) 0.091 (c) -3 (d) 0.5 (e) 0 (f) 5 b Which is the second biggest value? (a) 5 (b) -65 (c) 4 (d) -1 (e) -4/9 c What is the	{ "pile_set_name": "DM Mathematics" }
est to 1 in t, 5, 4/3? 4/3 Let d be (2715/270 - 10)2/1. What is the closest to -3 in 0.2, d, -1/6, -0.2? -0.2 Suppose -o - 6 + 8 = 0. Suppose -os - s = 5k - 110, 0 = -3k - s + 66. Let z be (-116)/154 + 4/k. Which is the closest to 1? (a) 2 (b) z (c) 0.2 c Let c = 0.041 - -3.859. Let g = c - 3.1. What is the closest to g in 4, -0.5, 1/3? 1/3 Let i = 1/243 - 1961/4131. Which is the nearest to i? (a) 3 (b) -3 (c) -1 c Let l(y) = -y + 9. Let n be l(9). Suppose 4a + 192 = -na. Let w be -2 + (a/14)/(-2). What is the closest to 0.2 in -0.3, w, -1/4? -1/4 Suppose -5s + 4h = 25, -5s + 44h = 45h. Let l = -4.3 - -3. Let p = l - -1. Which is the closest to -2? (a) s (b) p (c) -2 c Let o = -5 - -5. Let u = o + 0.2. Let q = -19 - -18.9. What is the closest to u in 2, q, 3? q Let u(g) = g3 + 9g*2 + 8g. Let y be u(-8). Let h = 7/20 - 13/30. Let k = 5/12 - h. Which is the nearest to k? (a) y (b) 0.2 (c) -2/7 b Let a be -8 - 105/(-14)32/40. What is the nearest to a in -5, 4, -0.02? -0.02 Let a = -0.6 - 4.4. Let l = -5.3 - a. Let c = 17.02 - 17. What is the nearest to c in 0.5, l, 2/15? 2/15 Let k = 0.564 - 0.564. What is the nearest to 3 in -1, 3, k, -0.4? 3 Let o = 52 - 52.1. Let d = 0.99 - -0.01. Let n = d - 0.6. Which is the nearest to o? (a) -1/6 (b) -1 (c) n a Let l = 0.262 - 0.262. Which is the closest to -1? (a) l (b) 1 (c) 3 (d) 0.3 a Let i = -1517 + 1517.1. What is the nearest to 0 in i, 1, -0.52? i Let m = -4/269 - -281/807. Which is the closest to 4? (a) 1/4 (b) m (c) 0.4 c Let q = 1068/5 + -214. Which is the closest to -1/2? (a) -5/4 (b) -1 (c) q c Let w be (-36)/20 + (-1)/5. Let x be (w + 0)-2 - 3. Let r be (-4 - 33/(-9))x. Which is the nearest to -0.2? (a) -1 (b) -0.4 (c) r c Suppose 25 = 5p, p + 15 = 18n - 23n. What is the nearest to -2 in n, 3, -0.4? -0.4 Let t = -0.617 - -2.617. What is the nearest to -1/4 in -3/2, -32, 3/2, t? -3/2 Let z = -12 + 12.01. Let o = z + -3.01. Let d = 1/8 - -9/56. Which is the closest to 2/9? (a) 1 (b) o (c) d c Let z = 29 + -28. What is the nearest to z in 0.3, -2, 5? 0.3 Let n be (-33)/36 - 2/(-3). Let m = -0.848 - 12.152. What is the nearest to n in m, 2/11, 1/5? 2/11 Let x = 1526.5 - 1526. Which is the closest to 0.2? (a) x (b) 1 (c) 0.053 c Let m = 78 + -75. Suppose -3t = -2t - m. Which is the nearest to 0.1? (a) -0.4 (b) t (c) 1 a Let o(w) = -2w - 4. Let l be (-4)/(-14) - (-396)/(-63). Let q be o(l). Suppose 8 = -qu + 6u. Which is the closest to -2? (a) -1 (b) 4/3 (c) u a Let s = -2/3523 - 3519/7046. Which is the closest to s? (a) -0.2 (b) -2 (c) 3.1 a Let v be 2886/(-108) - (-2)/9. Let y = 27 + v. What is the nearest to y in 0.1, 0.2, -2? 0.2 Let y = 965.6 - 966. Let f = -0.04 - -0.44. What is the nearest to -1 in y, -6/7, f? -6/7 Let z = 4.4 + -2.2. Let x = -15 + 13.8. Let k = z + x. What is the nearest to k in -1/2, 5, -2? -1/2 Let o = -0.79 + 7.89. Let i = o + 58.9. Which is the closest to -0.1? (a) -2/9 (b) i (c) 0 c Let v = -123/185 - 1/555. Which is the closest to v? (a) -0.3 (b) 5/2 (c) 0 a Let z = -0.1 - -0.1. Suppose -2n - 4j - 44 = -9j, 5n + 4j = -176. Let h = 98/3 + n. What is the closest to h in -0.5, 5, z? z Let k = -45 - 10. Let v = -57 - k. What is the nearest to v in 1, 1/4, 1/2? 1/4 Let p = -559 - -559.4. Which is the nearest to 4/51? (a) 0.2 (b) p (c) 0 (d) -5 c Let m be (-178)/20(7 - 5). Let l = 18 + m. Let s = 2.8 - -0.2. Which is the nearest to 2? (a) -0.1 (b) l (c) s c Suppose -5v + 41 = -2s, s + v + 27 = -3s. Let t = -6 - s. Let h be ((-18)/(-20))/((-60)/50). What is the closest to -5 in t, 0, h? h Let u = -146 - -231. Let k be (-265)/u + 3 - (-33)/(-153). What is the closest to k in -1/4, 0.5, 2/3? -1/4 Let t = 3667/27615 + 1/1841. Let k be 3(5/(-3))/1. Which is the nearest to -1? (a) t (b) k (c) 0.4 a Let l = 8 - 8.5. Which is the nearest to l? (a) 0 (b) 1/2 (c) -3 a Let i = 0.1 - 4.1. Let o = -0.4476 + 0.3476. What is the closest to o in -0.3, 0.5, i? -0.3 Suppose 3j = 2h + 19, -13 = 7j - 8j + 2h. Let d(x) = x*2 - 4x - 5. Let s be d(5). Which is the nearest to s? (a) 6 (b) j (c) 0.2 c Let r = -3 - -2.8. Let k = -1.972 + -0.028. Which is the nearest to -1? (a) k (b) r (c) 2/11 b Let q = -26 - -37. Suppose -43 = 5u - 48. Let z be q/(-44)(-2 + u). What is the closest to 3/5 in 0.1, 1, z? z Suppose 2z - d = -14, -33 = 5d - 13. What is the closest to 0.1 in -2/11, z, -5, 3? -2/11 Suppose -2v - 4l - 10 = 0, 2l - 8 = -4v + 2. Let o = -1.076 - -0.076. Let i = -1/90 + -4/45. Which is the closest to o? (a) 1/8 (b) i (c) v b Let w = -2014.97 - -2015. Let t = -6/23 - -1/92. What is the closest to w in 0.1, t, -5? 0.1 Suppose j - 15 = 11. Suppose -5s - j = -0q + 2q, -3q - 3s - 21 = 0. Which is the nearest to 1? (a) -0.3 (b) 0.08 (c) q b Let t = 8.74 - 7. Let y = 0.26 + t. Which is the nearest to 1? (a) -0.1 (b) y (c) -3 b Let m = 157 - 166.1. Let f = -9 - m. Suppose 0 = -z - 9 + 7. Which is the nearest to z? (a) 2/11 (b) -1 (c) f b Let i = 30.3 + -30. Let b = -4/5 - 7/10. What is the closest to -1 in 0.5, i, b? b Let u = -20 + 19.5. Let i = -415/2 + 210. Which is the closest to 4.2? (a) 0 (b) u (c) i c Let v be (-66)/(-27) + 16/(-36). What is the nearest to -1/3 in -2/33, 3, v? -2/33 Suppose -2n = 38 - 36. Let x be 1 - (-54)/45n/2. Let v(u) = 4u*3 + 2u - 1. Let h be v(1). What is the closest to 0 in x, 2/11, h? 2/11 Let j = 0.05 - -3.95. Let t = -32.7 + 33. Suppose 2q - 3u = -25, 2u + 3 - 13 = 0. Which is the nearest to 1/5? (a) q (b) j (c) t c Let s be (-2)/(-6) - (-2)/(-42). Let g = 32.921 - -0.079. Let n = g + -33.2. What is the closest to s in 0.06, n, 2/9? 2/9 Let s be ((-32)/112)/((-8)/(-14)). Which is the nearest to 0.1? (a) 2 (b) 9 (c) s c Let w be (2 - 12/2)/(-10). What is the nearest to w in -5, 1/3, 5? 1/3 Let r be (-393)/1048 + 9/4 + -2. Which is the closest to 1/5? (a) r (b) -9 (c) 0.3 (d) -4 c Let l be (-4)/(8/30 + 24/(-40)). Let p be (-39)/(-52) - 3/l. What is the closest to 1 in p, 5, -0.2? p Let i = 228.7 - 229. What is the nearest to 0.2 in i, -5, -3/5? i Let k = 4.94 - -0.06. Let t be (-8 - 517/(-66))-14. What is the nearest to 2 in k, 2/7, t? t Let o(w) = -9w - 8. Let x be o(-1). Which is the closest to 0.2? (a) -1 (b) 2/5 (c) -4 (d) x b Let x = 1083 + -1083.1. What is the closest to -1/2 in x, -0.06, 5? x Suppose 15m + 22 - 7 = 0. Which is the closest to m? (a) 1/3 (b) 0.14 (c) -4 (d) -2 d Let u = -0.206 + -22.194. Let g = u + 22. What is the closest to -2/29 in g, -4, 3? g Let m(x) = -x*3 - 5x*2 + 8x + 7. Let n be m(-6). Let i be (288/10)/(56/(-120)). Let w = i + 62. Which is the nearest to w? (a) 5 (b) -4 (c) n b Let l be 15/(9000/105) - 6/16. What is the nearest to 1 in -0.5, l, 1/4? 1/4 Let v = -2 - 2. Let y = 0.1 + 0.05. Let m = y + 0.85. Which is the nearest to m? (a) v (b) 1/6 (c) 1/3 c Let h = 9.6 + -6.6. Let d = -0.08 + -3.92. Let s = -4 - -3. Which is the nearest to s? (a) 4 (b) h (c) d c Let s = -226 - -222. Which is the closest to 2? (a) 0.5 (b) 5 (c) s (d) -5 a Let x be 393/(-21) - 6/21. Let v = x - -191/10. Let a = -8 + 7. What is the nearest to 1 in 0.3, v, a? 0.3 Let g = 0.3 + 3.7. Let k = -5 + 7. Let l = k + -5. Which is the nearest to l? (a) 0 (b) 0.4 (c) g a Let t = 27 - 27.3. Let n = -0.56 - -0.89. Let x = n + 0.07. What is the nearest to 0.1 in t, x, -0.5? x Let u = 85 + -84.85. Let m = u - 0.65. What is the closest to -1 in 6, 2, m? m Let o = -0.1 + 0. Let v = -31 + 31.13. Let a = v + 1.87. What is the closest to o in 4/3, a, -0.2? -0.2 Let w = 60.7 + -61.7. Which is the closest to w? (a) 0.5 (b) -3 (c) 20 a Let d = -0.48 - -0.48. What is the closest to 0 in d, -2/3, -17, -3? d Suppose -r = 0, 3t - r + 6r = -3. Which is the nearest to -2/3? (a) t (b) 3 (c) 2/11 a Let j = -19 + 27. Let i be (j/(-16))/((-2)/16). Which is the nearest to 3? (a) i (b) -1 (c) -0.4 a Suppose 0 = 2x - 16 + 2. Suppose -5p = -5o, 4 = xp - 3*p. What is the nearest to o in -1, -5, -0.2? -0.2 Let f = -28 - -29. Let i = -6 - -6. Let u = 0 + i. Which is the nearest to f? (a) 2/3 (b) u (c) 1 c Let z = -11.08 + 0.08. Let g = 22 + z. Let j = g - 11. What is the nearest to 2/3 in -	{ "pile_set_name": "DM Mathematics" }
31887? -31902 What is the next term in 55, 316, 751, 1360, 2143? 3100 What comes next: -50, -66, -104, -164? -246 What is next in -107, -463, -1131, -2171, -3643, -5607, -8123? -11251 What comes next: -3393, -6975, -10557? -14139 What is the next term in -26614, -106441, -239486, -425749, -665230? -957929 What is the next term in -1054, -2004, -2738, -3148, -3126, -2564, -1354, 612? 3442 What is the next term in -18, -182, -498, -966, -1586, -2358? -3282 What is next in -1213, -2373, -3533, -4693? -5853 What is next in 20873, 41818, 62763, 83708? 104653 What comes next: 473537, 947074, 1420609, 1894142, 2367673, 2841202, 3314729? 3788254 What is next in -1083, -1165, -1251, -1341, -1435? -1533 What is next in 15582, 15571, 15552, 15525, 15490, 15447? 15396 What is next in -580, -653, -836, -1183, -1748, -2585, -3748? -5291 What is next in 9458, 18649, 27840, 37031, 46222? 55413 What is the next term in -3269, -3289, -3321, -3371, -3445? -3549 What comes next: 25602, 102838, 231564, 411780, 643486? 926682 What is next in 661, 1317, 1979, 2653, 3345, 4061, 4807, 5589? 6413 What is the next term in 333, 350, 363, 372, 377, 378? 375 What comes next: -22105, -44204, -66303, -88402, -110501, -132600? -154699 What is the next term in -366, -848, -1318, -1776, -2222, -2656, -3078? -3488 What is the next term in 4255, 8531, 12805, 17077, 21347? 25615 What is the next term in -11089, -22178, -33267, -44356, -55445, -66534? -77623 What is the next term in 6881, 6820, 6749, 6662, 6553, 6416, 6245, 6034? 5777 What is next in 205627, 411258, 616889, 822520? 1028151 What comes next: 555, 392, 227, 60? -109 What is next in 16311, 32609, 48905, 65199, 81491? 97781 What comes next: 675, 620, 491, 252, -133, -700, -1485? -2524 What comes next: 35, 69, 169, 359, 663? 1105 What comes next: -6604, -6640, -6690, -6760, -6856, -6984, -7150? -7360 What is next in 4269, 4270, 4267, 4260, 4249, 4234, 4215? 4192 What is next in -6976, -6977, -6976, -6973, -6968, -6961? -6952 What is the next term in -82, -432, -1046, -1924, -3066, -4472, -6142? -8076 What comes next: -1337, -1313, -1289, -1265, -1241? -1217 What comes next: -234174, -234176, -234178, -234180, -234182? -234184 What is next in -43760, -43810, -43894, -44012? -44164 What is next in 77, 167, 277, 407, 557, 727, 917? 1127 What is next in -2681, -5398, -8143, -10916, -13717? -16546 What comes next: 6011, 12032, 18053, 24074, 30095? 36116 What is next in -29704, -59412, -89122, -118834? -148548 What comes next: -11101, -22207, -33311, -44413, -55513? -66611 What is next in -99, -964, -1827, -2688? -3547 What is the next term in 2238, 4479, 6722, 8967, 11214, 13463, 15714? 17967 What is next in -99, -153, -201, -237, -255? -249 What is the next term in 606, 1660, 3170, 5142, 7582, 10496, 13890, 17770? 22142 What is the next term in 930, 1352, 1774? 2196 What is the next term in -12897, -12792, -12685, -12576? -12465 What is next in 1765, 1725, 1671, 1597, 1497, 1365? 1195 What is the next term in -2755, -5587, -8419, -11251? -14083 What comes next: -17070, -34136, -51194, -68238, -85262, -102260? -119226 What is next in -383, 513, 1411, 2311, 3213, 4117? 5023 What is the next term in -4528839, -9057679, -13586517, -18115353, -22644187? -27173019 What is next in 2034, 3070, 4106, 5142? 6178 What is next in 849, 1747, 2681, 3645, 4633? 5639 What is the next term in 89, 113, 137, 161, 185, 209? 233 What is the next term in -541, -1043, -1539, -2029, -2513, -2991, -3463? -3929 What is the next term in 39118, 156453, 352006, 625777, 977766, 1407973, 1916398? 2503041 What comes next: -189035, -378072, -567111, -756152, -945195? -1134240 What comes next: -683, -1345, -2007, -2669, -3331, -3993? -4655 What is next in 38710, 38705, 38698, 38689, 38678, 38665, 38650? 38633 What is the next term in -10671, -42687, -96047, -170751? -266799 What is next in 2760, 5509, 8258, 11007? 13756 What is next in 44285, 88571, 132857, 177143, 221429? 265715 What comes next: 362, 376, 428, 536, 718? 992 What is the next term in -202363, -404728, -607093, -809458, -1011823, -1214188? -1416553 What is next in -887, -1350, -1799, -2228, -2631, -3002? -3335 What is the next term in 489, 622, 821, 1068, 1345, 1634, 1917? 2176 What is next in 2398, 9458, 21226, 37702, 58886, 84778, 115378? 150686 What is the next term in 65378, 261519, 588420, 1046081, 1634502? 2353683 What is next in -6, 31, 128, 327, 670, 1199? 1956 What is next in 277, 15, -693, -2069, -4335, -7713? -12425 What comes next: 401, 906, 1425, 1964, 2529, 3126? 3761 What is next in -66, -30, 292, 1044, 2370, 4414, 7320, 11232? 16294 What comes next: -3813, -7627, -11435, -15243, -19057, -22883? -26727 What is the next term in -1169770, -2339538, -3509306? -4679074 What is the next term in -72159, -288630, -649415, -1154514? -1803927 What comes next: 4550, 5183, 5816? 6449 What comes next: -422, -1632, -3656, -6500, -10170, -14672? -20012 What is the next term in -377, -2866, -9603, -22712, -44317? -76542 What comes next: -202, -384, -522, -592, -570? -432 What is next in 1994822, 1994823, 1994824, 1994825, 1994826, 1994827? 1994828 What is next in 232794, 465591, 698388, 931185? 1163982 What is next in -1138, -2337, -3594, -4909, -6282? -7713 What is the next term in -12680, -12681, -12690, -12713, -12756, -12825, -12926, -13065? -13248 What comes next: -106, -949, -3280, -7855, -15430, -26761, -42604, -63715? -90850 What is next in 3288, 3476, 3790, 4230? 4796 What is next in 1336399, 1336398, 1336397, 1336396, 1336395, 1336394? 1336393 What comes next: -284, -991, -2082, -3551, -5392, -7599, -10166? -13087 What is the next term in 166114, 166115, 166116, 166117, 166118? 166119 What is the next term in 1125, 2507, 3895, 5289? 6689 What is the next term in -1463590, -2927180, -4390770, -5854360? -7317950 What comes next: 2280, 2582, 3086, 3792, 4700, 5810? 7122 What is next in 2211, 2202, 2189, 2172, 2151, 2126? 2097 What comes next: 212, 245, 294, 365, 464, 597? 770 What is next in -8, -18, -32, -50, -72, -98? -128 What is next in 666, 1022, 1378, 1734? 2090 What is next in -38, -74, -48, 70, 310? 702 What comes next: -28914, -57830, -86744, -115656? -144566 What comes next: 11156, 22311, 33476, 44657, 55860, 67091, 78356, 89661? 101012 What comes next: 972, 1976, 2986, 4002, 5024, 6052? 7086 What comes next: 192, 208, 224, 240, 256? 272 What is the next term in 20010, 40022, 60034, 80046, 100058? 120070 What is the next term in 64268, 64269, 64270, 64271? 64272 What is the next term in -2741, -2719, -2697, -2675? -2653 What is the next term in -1076, -1116, -1158, -1202, -1248? -1296 What is the next term in -61237, -61242, -61245, -61246, -61245, -61242? -61237 What is the next term in -2195, -2193, -2189, -2183? -2175 What is next in 147, 542, 1189, 2088, 3239, 4642? 6297 What is next in -26930, -26932, -26934? -26936 What comes next: -264280, -264284, -264288? -264292 What is the next term in 343, 616, 889? 1162 What is the next term in -24445, -97385, -218951, -389143, -607961? -875405 What is the next term in 7681, 7625, 7569, 7513, 7457, 7401? 7345 What comes next: -3002, -2950, -2880, -2798, -2710? -2622 What is the next term in -5151, -5142, -5133? -5124 What comes next: -959, -961, -957, -947? -931 What is the next term in -1992, -3929, -5890, -7881, -9908? -11977 What is next in 14419, 57726, 129937, 231058, 361095, 520054, 707941? 924762 What is the next term in -12440, -24881, -37320, -49757, -62192, -74625? -87056 What comes next: 74, 335, 778, 1403, 2210? 3199 What is next in 13805, 13807, 13809? 13811 What comes next: -739, -1456, -2151, -2824? -3475 What comes next: -3258, -6497, -9736? -12975 What comes next: 32783, 65542, 98301, 131060? 163819 What is next in -693, -766, -839, -912, -985, -1058? -1131 What is the next term in -245, -569, -893, -1217, -1541? -1865 What is next in -176, -1254, -3246, -6152, -9972, -14706, -20354? -26916 What is next in 3792, 3819, 3846, 3873, 3900, 3927? 3954 What is next in 12652, 25301, 37950? 50599 What comes next: 1708, 1517, 1328, 1141? 956 What is the next term in 2074133, 4148264, 6222395, 8296526, 10370657? 12444788 What is next in -504, -1018, -1532, -2046? -2560 What is next in 19201, 76814, 172835, 307264, 4801	{ "pile_set_name": "DM Mathematics" }
-1116b What is -2013234 (base 6) in base 3? -11211210111 42734 (base 12) to base 8 252630 What is -18359 (base 11) in base 14? -952c Convert -3217 (base 14) to base 9. -12765 What is ac55 (base 13) in base 16? 5e04 Convert 4151252 (base 6) to base 14. 53476 What is 2230223011 (base 4) in base 9? 1287164 What is 1512730 (base 9) in base 7? 10046163 Convert -120358 (base 13) to base 15. -8719a What is -230220501 (base 7) in base 15? -1374a13 What is -1999a (base 16) in base 11? -71866 What is 47e83 (base 16) in base 2? 1000111111010000011 -7701134 (base 9) to base 2 -1111110001010101111111 Convert 143ab8 (base 13) to base 9. 832534 What is -296ec (base 16) in base 5? -20412313 What is 1000101001011010010101000 (base 2) in base 11? a266532 Convert -33021130301 (base 4) to base 10. -3970865 Convert -120001221010 (base 3) to base 8. -1103314 Convert -10242141 (base 5) to base 6. -1511323 2036117 (base 14) to base 9 31523120 -86710 (base 12) to base 8 -532174 -40cb0a (base 16) to base 6 -231002414 1506360 (base 7) to base 6 4212043 Convert -147303 (base 8) to base 11. -3684a Convert 59661 (base 11) to base 13. 30198 Convert -1234627 (base 8) to base 14. -8cb0b Convert 2633b (base 13) to base 15. 15ee1 3113230103 (base 4) to base 8 3275423 -711791 (base 13) to base 6 -132221022 What is -19a05 (base 15) in base 13? -2bb83 Convert -50520 (base 11) to base 2. -10010000001101000 Convert 578803 (base 9) to base 2. 1010100111000000111 -2548081 (base 9) to base 14 -282936 Convert -1100110011001011 (base 2) to base 7. -305564 -10301603 (base 7) to base 6 -30425032 What is -6ac6e (base 16) in base 9? -735843 What is -1023252 (base 6) in base 5? -3100000 -20402353 (base 6) to base 4 -2100122331 What is 1c10a (base 14) in base 4? 101131332 Convert -34041015 (base 6) to base 16. -fbea3 What is 39556 (base 13) in base 2? 11001111110000100 What is 2121121212 (base 3) in base 2? 1100100100011101 What is 21111002101012 (base 3) in base 12? 13b9aab What is -170870 (base 11) in base 2? -1000000100110000111 -2205526 (base 8) to base 3 -1010010001211 -1465503 (base 7) to base 2 -110001001000011110 What is 233203103302 (base 4) in base 12? 421192a Convert -13334024 (base 5) to base 2. -100001011000111100 Convert -12467347 (base 8) to base 7. -32431406 What is -1212210200010 (base 3) in base 14? -1c05ac What is 1000355 (base 7) in base 12? 58238 Convert -5611503 (base 8) to base 13. -40c438 What is -45334362 (base 7) in base 16? -3c24e4 -3022103 (base 6) to base 3 -21021012110 What is -413413532 (base 6) in base 14? -d497c4 -1433023314 (base 5) to base 8 -16373070 What is 353bb (base 12) in base 9? 117868 -29339 (base 14) to base 5 -11232132 -6845783 (base 9) to base 7 -43243410 Convert -1432264 (base 7) to base 8. -570616 What is -55a2 (base 11) in base 16? -1ccc Convert 105240 (base 10) to base 7. 615552 Convert -34202512 (base 6) to base 4. -3332202230 What is 373387 (base 9) in base 7? 1626451 Convert -5046412 (base 7) to base 6. -20510144 Convert -10599 (base 11) to base 7. -62523 What is 1086048 (base 10) in base 12? 444600 What is -958658 (base 12) in base 3? -11102210110112 Convert 165776 (base 13) to base 11. 349a17 -26116414 (base 7) to base 9 -4418121 -4345322 (base 6) to base 7 -1560503 Convert -10111333 (base 4) to base 8. -42577 What is 2931747 (base 13) in base 3? 220121202101120 What is 7e13 (base 16) in base 10? 32275 Convert 24421214 (base 5) to base 16. 38cec 1230023320 (base 5) to base 9 5526631 Convert -29a20 (base 16) to base 4. -221220200 Convert -5323314 (base 6) to base 2. -111111011101111110 Convert 92e606 (base 16) to base 12. 328331a -1105344 (base 7) to base 15 -2a600 19295 (base 13) to base 2 1011111010011010 Convert 2220221210212 (base 3) to base 7. 16131605 What is -169170 (base 10) in base 14? -45918 -13230302 (base 5) to base 10 -133202 Convert b51122 (base 12) to base 4. 22312001222 111110000000001 (base 2) to base 3 1121112202 Convert -11230430 (base 5) to base 14. -29250 What is 66647 (base 16) in base 13? 118b86 Convert 228008 (base 14) to base 13. 321747 Convert 888060 (base 13) to base 12. 10b1486 -863121 (base 9) to base 11 -321234 Convert -320272 (base 8) to base 12. -518a2 Convert -4b2405 (base 12) to base 7. -13301414 -499c91 (base 14) to base 3 -11202020120110 What is 2021041 (base 6) in base 11? 66265 31032511 (base 6) to base 9 1607157 Convert 22040223 (base 5) to base 11. 11a885 25e33 (base 15) to base 16 1d9eb Convert -6244735 (base 8) to base 11. -a32185 What is 125154 (base 7) in base 10? 23412 What is 617374 (base 8) in base 16? 31efc What is -c48304 (base 16) in base 10? -12878596 What is -110211113 (base 4) in base 11? -58387 Convert -1626495 (base 11) to base 3. -12020000120120 Convert -3a467a (base 12) to base 6. -32340234 What is -2fa31 (base 16) in base 10? -195121 Convert bc84e6 (base 15) to base 5. 4300114431 Convert 276b42 (base 14) to base 6. 45115142 -256d4 (base 15) to base 8 -351572 Convert 172135 (base 8) to base 11. 43000 Convert 383b9c (base 15) to base 8. 12221300 What is -12200222212222 (base 3) in base 9? -5628788 Convert 110122011210 (base 4) to base 5. 2332142412 45394 (base 13) to base 3 20101122101 Convert 202520 (base 8) to base 2. 10000010101010000 Convert 2132130100 (base 4) to base 3. 1012222020011 Convert -12013332 (base 4) to base 16. -61fe -30a222b (base 12) to base 16 -8be8c3 What is -11210002121101 (base 3) in base 8? -11542717 What is 34c080 (base 14) in base 4? 12313133300 Convert 27827 (base 13) to base 7. 425261 What is 111010011010111101 (base 2) in base 15? 4ad7d What is -1408301 (base 9) in base 12? -313901 What is 70348 (base 12) in base 8? 434350 What is 12a45a (base 16) in base 15? 191ed2 Convert -22455255 (base 7) to base 2. -111011111010111001110 Convert -82502 (base 10) to base 14. -220d0 Convert -3451316 (base 8) to base 12. -393292 Convert -404101 (base 6) to base 8. -76405 Convert 20000210222 (base 3) to base 6. 2313255 3b2fb (base 16) to base 13 86463 What is -99a426 (base 11) in base 8? -6053252 4144320340 (base 5) to base 13 1a19475 -6558 (base 11) to base 7 -34142 Convert -8735620 (base 9) to base 6. -244254543 What is 2220030211 (base 4) in base 5? 134021213 Convert -46f416 (base 16) to base 5. -2142300011 -1013a0b (base 12) to base 7 -34420202 Convert 218262 (base 14) to base 13. 30a3a8 Convert 133a40 (base 12) to base 11. 1a777a Convert -13212211 (base 5) to base 10. -132181 12a11 (base 11) to base 4 10201131 Convert -4825 (base 9) to base 5. -103322 -4423a (base 12) to base 13 -32089 Convert 110000101111101001111 (base 2) to base 11. 9a1058 2111212201 (base 3) to base 15 e9dd 144020 (base 15) to base 4 3232020231 -105524 (base 6) to base 2 -10001101011100 -154838 (base 10) to base 6 -3152502 What is -d5e9 (base 16) in base 13? -1bc05 Convert 3351361 (base 7) to base 3. 210010111221 Convert 372ef (base 16) to base 2. 110111001011101111 Convert 474225 (base 9) to base 2. 1000101101000101000 -65776223 (base 8) to base 12 -48a75ab Convert 10321110232 (base 4) to base 7. 13623421 What is 232534242 (base 6) in base 4? 100202213102 Convert -1432566 (base 7) to base 9. -323740 What is -111230302 (base 4) in base 16? -15b32 What is 37b122 (base 13) in base 2? 101000110101100111010 Convert 44184 (base 13) to base 15. 26809 56981 (base 12) to base 2 11100001011110001 9f62d (base 16) to base 11 406546 What is -10000110011010101 (base 2) in base 4? -100303111 Convert -10331432 (base 7) to base 6. -30522025 -1010110111101111100 (base 2) to base 3 -200002122100 Convert -1001201211110 (base 3) to base 5. -121044311 -21982c (base 13) to base 11 -4a1302 What is ad54 (base 15) in base 4? 20332102 What is 3fee4d (base 16) in base 11? 2401925 -71592 (base 10) to base 11 -49874 -218886 (base 9) to base 6 -2451253 -a1a054 (base 13) to base 11 -2140661 What is 1935598 (base 10) in base 11? 1102275 2606c (base 14) to base 9 152088 Convert -1d83cd (base 14) to base 10. -1059953 What is -2022002021120 (base 3) in base 13? -33a2a8 -17d95 (base 16) to base 11 -67435 2973a (base 14) to base 16 19228 What is -206370 (base 8) in base 10? -68856 What is 817786a (base 11) in base 4? 313012330303 Convert 2120012 (base 6) to base 10. 103688 What is -7913 (base 10) in base 12? -46b5 -130441024 (b	{ "pile_set_name": "DM Mathematics" }
4, 2, 0 Sort -0.2, 2/13, 5, 0.3, 9123, -16 in decreasing order. 9123, 5, 0.3, 2/13, -0.2, -16 Put -1, -39, -3759, 4 in decreasing order. 4, -1, -39, -3759 Sort -1, 6671, -0.10711 in descending order. 6671, -0.10711, -1 Sort 22, 978, -474/13 in ascending order. -474/13, 22, 978 Put 4, -5, 86, -132, -47 in increasing order. -132, -47, -5, 4, 86 Put -0.4, -13412, 29, -27 in descending order. 29, -0.4, -27, -13412 Sort 8, -0.103, -5, 3, 1/5, -2/161 in descending order. 8, 3, 1/5, -2/161, -0.103, -5 Sort 4, -6, -4, -2, -61, 2. -61, -6, -4, -2, 2, 4 Sort 1/5, 24.5, 2, 4, -6.25, 0.4 in decreasing order. 24.5, 4, 2, 0.4, 1/5, -6.25 Sort 5, -61, 0, -2, 4, -8 in decreasing order. 5, 4, 0, -2, -8, -61 Sort -1859, 2, 3, -2771 in ascending order. -2771, -1859, 2, 3 Put -4, 11707, -147 in descending order. 11707, -4, -147 Sort 0.2, 1, 7, 570, -2.06 in decreasing order. 570, 7, 1, 0.2, -2.06 Sort -3, -29, -23, 965, -5 in descending order. 965, -3, -5, -23, -29 Sort -1, -0.013, -10/3, -0.5, 0.007 in ascending order. -10/3, -1, -0.5, -0.013, 0.007 Put -2, 76, 3, -26, -4, 20 in increasing order. -26, -4, -2, 3, 20, 76 Sort -37, 1, 2, -5, -3, -91, -2. -91, -37, -5, -3, -2, 1, 2 Put -1, -5, -9800, -4, -39, 3, 2 in ascending order. -9800, -39, -5, -4, -1, 2, 3 Put 2, 11, -118, 5715, -4 in decreasing order. 5715, 11, 2, -4, -118 Sort 1, -3, -4, 37, -267, 35 in ascending order. -267, -4, -3, 1, 35, 37 Put -4, 5, 66, 866, -5 in increasing order. -5, -4, 5, 66, 866 Sort -0.07, 1.2, -3, 1, -10/297 in descending order. 1.2, 1, -10/297, -0.07, -3 Put -17983, -20, -8 in decreasing order. -8, -20, -17983 Put 13, 329849, 0.5 in decreasing order. 329849, 13, 0.5 Sort -3, 8, -943, -50. -943, -50, -3, 8 Sort -4, 43, 2, -7278 in descending order. 43, 2, -4, -7278 Sort 143, 5, -4, -56, -203, -3 in decreasing order. 143, 5, -3, -4, -56, -203 Put -132, 8, -4179 in increasing order. -4179, -132, 8 Put -2, -0.14, 30219 in descending order. 30219, -0.14, -2 Put 1/5, -0.3, -4, -5, 0, 15, -8 in descending order. 15, 1/5, 0, -0.3, -4, -5, -8 Sort -2, 3, 437/205, 1/5 in decreasing order. 3, 437/205, 1/5, -2 Sort -305, -3, 3, 2, -1, 4, -6 in ascending order. -305, -6, -3, -1, 2, 3, 4 Put 50, -31094, -0.3 in ascending order. -31094, -0.3, 50 Put 16, -2, -4, -3, 11, 5, 50 in increasing order. -4, -3, -2, 5, 11, 16, 50 Sort 12301, 2207, 2 in decreasing order. 12301, 2207, 2 Put 0.5, -2/7, 2, 20114, 0.1, 27 in descending order. 20114, 27, 2, 0.5, 0.1, -2/7 Put -33, 5, 8, -8, -3, -95 in increasing order. -95, -33, -8, -3, 5, 8 Put 11/115, 0.1, 47, 4/5, -1.6, 0 in descending order. 47, 4/5, 0.1, 11/115, 0, -1.6 Sort 415/3, -2/15, -4/9, -0.035. -4/9, -2/15, -0.035, 415/3 Put 3201, -35, 5, 3, 0, 2, -13 in descending order. 3201, 5, 3, 2, 0, -13, -35 Put 4, -4, 0.8, 26253, -1.6, -1 in ascending order. -4, -1.6, -1, 0.8, 4, 26253 Sort -1236, 1000, -50 in decreasing order. 1000, -50, -1236 Put 1, 579, 2, -32, -17 in descending order. 579, 2, 1, -17, -32 Sort -2/9, 22, 4, -2/15, -4, 4096 in decreasing order. 4096, 22, 4, -2/15, -2/9, -4 Put 7.48, 17.4, 0, 13 in ascending order. 0, 7.48, 13, 17.4 Put -137, -13/5, 3/1759, 3/2 in descending order. 3/2, 3/1759, -13/5, -137 Put 47, 0.13, -5, -8, -25 in descending order. 47, 0.13, -5, -8, -25 Put 8, 127780, -1 in increasing order. -1, 8, 127780 Sort 3, 4, -3, 1572, 0, -4 in increasing order. -4, -3, 0, 3, 4, 1572 Put -19, 0.4, 2, 5, -30/11 in ascending order. -19, -30/11, 0.4, 2, 5 Sort -1, 26, 3, 0, 226, -3, -10 in decreasing order. 226, 26, 3, 0, -1, -3, -10 Put 40070139, -1/10, 2 in descending order. 40070139, 2, -1/10 Sort 5, -34, -4, -242265 in increasing order. -242265, -34, -4, 5 Sort 19.5, 64, -1, 0.3, 0.2, 2/23 in ascending order. -1, 2/23, 0.2, 0.3, 19.5, 64 Sort -92, 184, -20, -2, 3, -1 in descending order. 184, 3, -1, -2, -20, -92 Sort 41/10, 2/43, -5, 2, -2, -1/5 in descending order. 41/10, 2, 2/43, -1/5, -2, -5 Put -6, -2/5, -5836, -2, 18 in descending order. 18, -2/5, -2, -6, -5836 Sort -2, 1, 0, -686. -686, -2, 0, 1 Sort 149.3, -0.2, 0.072, 0, 149 in decreasing order. 149.3, 149, 0.072, 0, -0.2 Sort -8, -23014, -14, 10 in descending order. 10, -8, -14, -23014 Sort -1/3, -45, 51, -4, 8 in descending order. 51, 8, -1/3, -4, -45 Put 2186, -2, -1, -4, 8, -5 in decreasing order. 2186, 8, -1, -2, -4, -5 Sort 4/5, 4, 20, 1585 in increasing order. 4/5, 4, 20, 1585 Put -15, -20, 5, 3, 0, -65 in decreasing order. 5, 3, 0, -15, -20, -65 Sort 12, -1, -3, 5, 4, -6 in descending order. 12, 5, 4, -1, -3, -6 Put 57, -3, -267, -95 in descending order. 57, -3, -95, -267 Put -15, 58, -2, 16374, -5 in decreasing order. 16374, 58, -2, -5, -15 Sort -0.0194618, -2/3, 1. -2/3, -0.0194618, 1 Sort -254, -2, 96, -3, 4, 1 in decreasing order. 96, 4, 1, -2, -3, -254 Put -92, 7, 4, -23, 5, 10 in decreasing order. 10, 7, 5, 4, -23, -92 Sort 1682, 3, 5, 81, 4. 3, 4, 5, 81, 1682 Sort 0.48, 0, -1, 0.049, -20, -2/7 in increasing order. -20, -1, -2/7, 0, 0.049, 0.48 Put -2, 4, 9132068, 3, -1 in descending order. 9132068, 4, 3, -1, -2 Sort 3/11, -11, 30.3, 15, -3/4, 5. -11, -3/4, 3/11, 5, 15, 30.3 Put -6, 14099, 3 in increasing order. -6, 3, 14099 Put -8, 1, 3/8, -0.5, 3, -77.214 in descending order. 3, 1, 3/8, -0.5, -8, -77.214 Sort -0.07, -21/149, 5, 3/8 in decreasing order. 5, 3/8, -0.07, -21/149 Sort -1, 1, -3, 8, 325, 7 in descending order. 325, 8, 7, 1, -1, -3 Put 4, 1, -213, -4, 0, 2, -16 in descending order. 4, 2, 1, 0, -4, -16, -213 Put -3, 3, 4038679, 13, -4 in ascending order. -4, -3, 3, 13, 4038679 Sort -796, 4, 5, -451 in increasing order. -796, -451, 4, 5 Put -3, -5, 25, -6, -12, 7, 1 in ascending order. -12, -6, -5, -3, 1, 7, 25 Sort 5, -5, -1, -33286 in descending order. 5, -1, -5, -33286 Put -2, -6, -0.3, -54, -1/5, -2/5 in ascending order. -54, -6, -2, -2/5, -0.3, -1/5 Put 10, -3321, 172 in decreasing order. 172, 10, -3321 Put -7, -4102, 192, 9 in descending order. 192, 9, -7, -4102 Sort -5, -29, -2, -572, -51. -572, -51, -29, -5, -2 Put 4, -2, -757, -11, 103 in increasing order. -757, -11, -2, 4, 103 Sort 84, -44, 9, 0, -130 in ascending order. -130, -44, 0, 9, 84 Sort 2/7, -0.5, 0.3, -37, 62, 0 in decreasing order. 62, 0.3, 2/7, 0, -0.5, -37 Sort -3, 2, 175, -4, 46, 23 in descending order. 175, 46, 23, 2, -3, -4 Sort -15, -54, 38766 in descending order. 38766, -15, -54 Sort 154.1, 2, -373/8 in descending order. 154.1, 2, -373/8 Sort -16892, -1, 71 in decreasing order. 71, -1, -16892 Put -22, 0, -5, -1, 4, 123, 9 in decreasing order. 123, 9, 4, 0, -1, -5, -22 Sort -3915, 32418, -4. -3915, -4, 32418 Sort -34, 99331, -3 in descending order. 99331, -3, -34 Sort -3178, -2, 65, -8 in decreasing order. 65, -2, -8, -3178 Sort -4892, -43, 28, 0 in decreasing order. 28, 0, -43, -4892 Sort -14, -1, 2, 3, 4, -189, 21 in descending order. 21, 4, 3, 2, -1, -14, -189 Put -5, -13/478, -253 in descending order. -13/478, -5, -253 Put 3, -1692096, -3 in decreasing order. 3, -3, -1692096 Put -1.11, 5, 15, 0.0511, 4/7 in descending order. 15, 5, 4/7, 0.0511, -1.11 Sort 117717, -4, 5, 3, -11 in increasing order. -11, -4, 3, 5, 117717 Put 14, 7, -19221, 0, 3 in descending order. 14, 7, 3, 0, -19221 Put 4/275, 121, -2.2 in descending order. 121, 4/275, -2.2 Sort 5, 0, 940, -120 in descending order. 940, 5, 0, -120 Sort -4, -19, 301, 1, -5, 4 in increasing order. -19, -5, -4, 1, 4, 301 Put 4, 2125, -2, 5, -88, -3 in decreasing order. 2125, 5, 4, -2, -3, -88 Sort -3, -5, 9, -162, 0, -4, 7490. -162, -5, -4, -3, 0, 9, 7490 Sort -323, -9, -5, -32, -4 in decreasing order. -4, -5, -9, -32, -323 Put 89, 22, -1, -37 in decreasing order. 89, 22, -1, -37 Sort 14, 9, -61, -3, -7, -5, 3 in increasing order. -61, -7, -5, -3, 3, 9, 14 Sort 9, 2.48596, -3 in decreasing order. 9, 2.48596, -3 Put -5, -20750, -3, -2596 in descending order. -3, -5, -2596, -20750 Put -25/4, -1/32439, -2 in decreasing order. -1/32439, -2, -25/4 Sort 0.3, 1476110, -3, -11, 5 in decreasing order. 1476110, 5, 0.3, -3, -11 Sort -4, -5, -12, 2, -101, -24, -21. -101, -24, -21, -12, -5, -4, 2 Sort 0.7703, 0.1, 22/43 in ascending order. 0.1, 22/43, 0.7703 Put -15/2, -648, -0.3 in descending order. -0.3, -15/2, -648 Sort 2, -2, 11, 5, 198, 39 in decreasing order. 198, 39, 11, 5, 2, -2 Sort 0.04863, 1/8, 62, -1.07 in desce	{ "pile_set_name": "DM Mathematics" }
) + sqrt(396) + -1 + sqrt(396))) + 5)) + -2)*2. -768sqrt(11) + 25408 Simplify -1(-1 + -1 + (sqrt(192)2 + sqrt(192) - (sqrt(3) + (sqrt(3) - sqrt(108)-2)))2). -298 Simplify -2((sqrt(176) - ((sqrt(176) - (sqrt(176) - (sqrt(176) + -2))) + 4 + sqrt(176) - sqrt(176) - sqrt(176)))3)2. -3240 + 288sqrt(11) Simplify -2(sqrt(432)3 + -4 - (-2 + ((1sqrt(432))2 - sqrt(432)))). -96sqrt(3) + 868 Simplify (1 + 6(sqrt(108) - 1(sqrt(108) + 1sqrt(108)))-4)*2. 288sqrt(3) + 62209 Simplify ((sqrt(120) + -1sqrt(120))/sqrt(10)1)/((sqrt(288)2)/sqrt(8)) + 2. 2 Simplify -4 + -1((sqrt(77)-1 - sqrt(77))/sqrt(7) + -1sqrt(11) + 4)*2. -119 + 24sqrt(11) Simplify 3 + (((1sqrt(242) + -3)2 - sqrt(242)) + sqrt(242) - (-4 + -2sqrt(242))) + (2 + 2(sqrt(242) - (sqrt(242) - sqrt(242)2) - sqrt(242)))*2. 44sqrt(2) + 1230 Simplify (-2 + sqrt(475)-3 + sqrt(475)-4 + sqrt(475) + 3)*2. -60sqrt(19) + 17101 Simplify (sqrt(243) + (sqrt(243) - (-1 + sqrt(243))))4 - (-5sqrt(243)2)2. -24296 + 36sqrt(3) Simplify (sqrt(180) + sqrt(180)2 - sqrt(180))-3 + (sqrt(180) + sqrt(180)-3 + 5 - sqrt(180)). -54sqrt(5) + 5 Simplify (-4sqrt(10)-3)/sqrt(5) - sqrt(12)/(sqrt(6)-32). 73sqrt(2)/6 Simplify (-5 + (sqrt(637)-4 - sqrt(637)) + -1 - ((sqrt(637) - (sqrt(637) - 3sqrt(637)-1)) + 2))*2. 224sqrt(13) + 2612 Simplify 2(0 + (sqrt(242)2 + sqrt(242))-5). -330sqrt(2) Simplify -2((sqrt(560) - (sqrt(560) + 2sqrt(560) - sqrt(560))) + sqrt(35))/(sqrt(252) - -1sqrt(252)). sqrt(5)/2 Simplify 4 + (2 + (0 + sqrt(325))6 - (-1 + (sqrt(325)2 - sqrt(325) - sqrt(325)) + 5))2. -120sqrt(13) + 11708 Simplify ((sqrt(65)1 - sqrt(65))-5 + 4-1sqrt(65))/(-6(sqrt(245) + sqrt(245)-1 - sqrt(245) - sqrt(245))). -sqrt(13)/21 Simplify (5sqrt(77)2 - sqrt(77) - sqrt(77))/(sqrt(7) - sqrt(1225)/sqrt(7)) + -1. -2sqrt(11) - 1 Simplify 0 + (sqrt(252) - (sqrt(252)2 + -4))*2. -48sqrt(7) + 268 Simplify (sqrt(133)2-5 + (sqrt(133) - (6sqrt(133)1 - sqrt(133))))/(sqrt(343) + (sqrt(343) - (5-2sqrt(343) + sqrt(343)))). -2sqrt(19)/11 Simplify (3sqrt(72)-2 - sqrt(72))/(sqrt(60)/sqrt(40) - sqrt(12)/sqrt(2)1). 28sqrt(3) Simplify (3 + sqrt(180)-1 + -1 + sqrt(180) + 5)*2. 49 Simplify 1(-5 + sqrt(4)/(sqrt(2) + sqrt(8)/sqrt(4)) - sqrt(4)/sqrt(2)-43). -5 + 25sqrt(2)/2 Simplify -1(((sqrt(147) - (-3 + sqrt(147)-2 + sqrt(147) + sqrt(147) - sqrt(147))) + sqrt(147))2 + -1 + -5) + -3. -1329 - 126sqrt(3) Simplify (3 + (sqrt(425) + 4)*2 + -5 + -5)5. 200sqrt(17) + 2170 Simplify sqrt(1331) + 6(sqrt(1331) + 1sqrt(1331) + sqrt(1331))2 + sqrt(1331) - sqrt(88)/sqrt(18). 64sqrt(11)/3 + 71874 Simplify (-1sqrt(288))2 + -2 + 1 + sqrt(2) + sqrt(32) + -2. 5sqrt(2) + 285 Simplify 2((sqrt(132)/(sqrt(36)/sqrt(3)) - sqrt(11))22 + 4)-3. -24 Simplify 1((2 + (-1sqrt(7) - sqrt(7) - sqrt(7)) + -4 + sqrt(7) + 1)-3-4)2. 576sqrt(7) + 4176 Simplify ((-1 + sqrt(2299))-4-1 - (sqrt(2299) + 0 + -1 + 3))*2 + 5. -396sqrt(19) + 20732 Simplify 4 + ((sqrt(320) - (sqrt(320) - (sqrt(320) + -1) - sqrt(320))3 - sqrt(320))1)*2. -144sqrt(5) + 2893 Simplify (sqrt(270)/((4sqrt(24) - sqrt(24)) + sqrt(6)) + 2)-1. -2 - 3sqrt(5)/7 Simplify 4(sqrt(720) + sqrt(720) + 1 + sqrt(720)) + 4(sqrt(720) + -1)2. 48sqrt(5) + 2888 Simplify (1sqrt(400)2)/((sqrt(1568)-2)/sqrt(4)). -5sqrt(2)/7 Simplify (-2(5 + sqrt(153)) - (sqrt(34)/(sqrt(4)/sqrt(2) + sqrt(2) + sqrt(2) - sqrt(2)) + sqrt(17) + 3))6. -45sqrt(17) - 78 Simplify 4 + 4(sqrt(13) + (sqrt(325))*2) + (2sqrt(832) + 4)*2. 132sqrt(13) + 4648 Simplify ((4(sqrt(1694) - (sqrt(1694) + 1sqrt(1694) - sqrt(1694))))/(-3(sqrt(2) - (sqrt(98) + sqrt(98)-2))))2 + 0. 0 Simplify ((sqrt(34) - (sqrt(544) + sqrt(34)))/sqrt(2))2 + 3sqrt(68) + (sqrt(51) + sqrt(51) + sqrt(408)/sqrt(128))/(sqrt(30)/sqrt(160)). 15sqrt(17) + 272 Simplify (((sqrt(126) - (sqrt(126) + sqrt(126)1 - sqrt(126)))5)/(-1((sqrt(7) - sqrt(14)/sqrt(98)) + sqrt(7))))2. 0 Simplify (-32sqrt(114)2)/(sqrt(6) + sqrt(6)-2-5 - sqrt(48)/(-1sqrt(8))). -sqrt(19) Simplify (sqrt(168)-2-2)/((-1sqrt(288))/sqrt(12)). -4sqrt(7) Simplify (3(sqrt(99)1 + sqrt(99))-6)/(sqrt(63)/(sqrt(7) + sqrt(112)-4 - sqrt(7))). 576sqrt(11) Simplify sqrt(117) - ((2sqrt(117)-1 - sqrt(117))*2 + sqrt(117)) - (sqrt(117) + sqrt(117)1 + -2)*2 - (sqrt(624)/sqrt(192))/(-5sqrt(16)). -1525 + 961sqrt(13)/40 Simplify (sqrt(10)1-2)/((sqrt(55)1)/sqrt(11)). -2sqrt(2) Simplify ((sqrt(30) - sqrt(750))-1)/(sqrt(54)/(sqrt(9)1)). 4sqrt(5) Simplify 5((2sqrt(27) - sqrt(27))4 - (sqrt(21)/(sqrt(14)/sqrt(2))-3)*2). -135 + 60sqrt(3) Simplify (sqrt(19) - (sqrt(171))*2)-26 + 4sqrt(1539)-1. -48sqrt(19) + 2052 Simplify (-6(sqrt(88) - (sqrt(88) - (sqrt(88) - 5-2sqrt(88)))))/(sqrt(64)/(sqrt(48)/(sqrt(24)/sqrt(4)))). -66sqrt(11) Simplify (3 + (sqrt(117)2)/sqrt(9) + sqrt(143)/(sqrt(11) - sqrt(11)4))*2. 10sqrt(13) + 406/9 Simplify ((-1 + sqrt(325) + -1)4 - (sqrt(325)-1-1 - sqrt(325) - sqrt(325))-5)*2. 80sqrt(13) + 389 Simplify -4(-5 + sqrt(153)) + (sqrt(1088) - 4(4 + sqrt(1088)))*2. 756sqrt(17) + 10068 Simplify 2 + (sqrt(605) + (sqrt(605) - (3 + sqrt(605))) - sqrt(605))*2 + (5sqrt(605)-6 + sqrt(605))2 + sqrt(605). 11sqrt(5) + 508816 Simplify 3 + (((sqrt(192) + (sqrt(192) + -1 - sqrt(192)) + sqrt(3))2 - sqrt(3)) + 2 - (sqrt(108) - (sqrt(108) - ((sqrt(108) + 0 - sqrt(108)) + -5)2)))-2. -439 + 38sqrt(3) Simplify (sqrt(200) - ((sqrt(200) + -1)3 - sqrt(200)))2 + (-5 + -1sqrt(200))*2 - ((1-1sqrt(200))2 + sqrt(200)1 + 2). 30sqrt(2) + 232 Simplify (2 + (-2sqrt(114)-5)/(-3sqrt(6)6))2. -20sqrt(19)/9 + 799/81 Simplify (-1sqrt(192)2-45 + -5)*2 + -3. -3200sqrt(3) + 307222 Simplify (-1 + (4 + (-3 + sqrt(300) - sqrt(300)) - sqrt(300)) + 2)*2 + -3. -40sqrt(3) + 301 Simplify 1(sqrt(1872) - (sqrt(1872) + (-5sqrt(1872))*2)) + (sqrt(65)/sqrt(5) + 0 - (sqrt(208) + sqrt(13))-3). -46800 + 16sqrt(13) Simplify ((1sqrt(17) + -3)*2 - sqrt(17)) + sqrt(68)/sqrt(4) + 2 + 4(sqrt(425) - (sqrt(425) + 1)). -6sqrt(17) + 24 Simplify 4(2(sqrt(1100) + 1) + 1 + 1)2 + -4. 640sqrt(11) + 17660 Simplify 1((0 + sqrt(704) - sqrt(704) - sqrt(704)) + sqrt(704) + 0 + sqrt(11) + 5 - (-4(sqrt(275)1 - sqrt(275)))2). sqrt(11) + 5 Simplify ((-2sqrt(104)3 - sqrt(104))/((sqrt(8) - (sqrt(8) + (sqrt(288) - (sqrt(288)2 + sqrt(288))))) + sqrt(8)) + 2 + -3)*2. 14sqrt(13)/13 + 62/13 Simplify 1(-1sqrt(1944) + sqrt(24) - -4sqrt(216))/((sqrt(200)-2 - sqrt(200))-4). sqrt(3)/15 Simplify (-6(-1sqrt(112) + -4) + (3sqrt(112)4 - sqrt(112))6)*2. 13824sqrt(7) + 581184 Simplify -2((sqrt(968) - (sqrt(968) - sqrt(968)2))/(1sqrt(4)5))*2 + -3. -2011/25 Simplify (3 + (sqrt(243) + 3 - sqrt(243)) + 2)-4. -32 Simplify -4 + (5 + 2 + sqrt(13) - sqrt(13) - sqrt(26)/(sqrt(32) - sqrt(2) - sqrt(2) - sqrt(2)) - (-3 + sqrt(13) + -1)3). -4sqrt(13) + 15 Simplify (1sqrt(360) + -1sqrt(360))/(sqrt(32)/sqrt(4)4 - (sqrt(88)1)/sqrt(11)). 0 Simplify 4((sqrt(228)/sqrt(108) - sqrt(76)/(sqrt(4)2)) + sqrt(76) + 0 + sqrt(304) + -5). -20 + 70sqrt(19)/3 Simplify ((sqrt(76) + 0)-1 + sqrt(76)25)*2 + -1 + (sqrt(76) - (((sqrt(76) - (sqrt(76) - 2sqrt(76))) + sqrt(76))-2)2). 2sqrt(19) + 3419 Simplify 2 + (0 + (-5(-1 + sqrt(3)) - sqrt(24)/sqrt(200)))2. -52sqrt(3) + 2703/25 Simplify -1(sqrt(1008) + 2 + -2 + sqrt(1008) + sqrt(1008) - sqrt(1008) - (-4 + (sqrt(84)/(sqrt(48)/sqrt(4) + sqrt(12)))2)). -24sqrt(7) - 9/4 Simplify 4 + (sqrt(39)/sqrt(3) + -1 + sqrt(13))*2 - sqrt(91)/(sqrt(28)/sqrt(36)). -7sqrt(13) + 57 Simplify -4(-1sqrt(684) + -4 - (2 + sqrt(684))4)2. -68976 - 2880sqrt(19) Simplify 5 + ((sqrt(77) + (sqrt(77) - sqrt(77)-2)-3 - sqrt(77))/(sqrt(704) + 2sqrt(704)))2 + -1. 319/64 Simplify -4(0 + -3sqrt(891) + -5 + sqrt(891) + 3)2. -14272 - 288sqrt(11) Simplify 0 + (-5(sqrt(320) + (sqrt(320) - (-1sqrt(320) - sqrt(320)))) + sqrt(320))/sqrt(10) + 4. -76sqrt(2) + 4 Simplify (1(sqrt(637) - -2sqrt(637)6) + -5(1 + sqrt(637)) + sqrt(637) + (sqrt(637) + 0)-6)*2. -210sqrt(13) + 5758 Simplify ((sqrt(117) + 3)-2 + sqrt(117) + sqrt(117) + (sqrt(117) - (5 + -3sqrt(117))))*2. -264sqrt(13) + 1993 Simplify (3 + sqrt(1700) + 0 - (sqrt(1700)1 + 1) - -5(sqrt(1	{ "pile_set_name": "DM Mathematics" }
) + 3k(g). Let r(z) = 0. What is z? -1, -2/3, 0 What is b in 3b*2 - 3b*3 + 3b - 1 + 0 + 0 - 2 = 0? -1, 1 Let z(b) = 4b4 - 20b*3 + 32b*2 - 13b + 3. Let q(m) = -8m4 + 40m*3 - 64m*2 + 27m - 5. Let f(v) = 3q(v) + 5z(v). Factor f(n). -4n(n - 2)*2(n - 1) Let r(m) be the second derivative of -1/60m5 + 0 + 0m*2 + 1/36m*6 + 3m + 1/18m3 - 5/72m*4. Factor r(i). i(i - 1)(i + 1)(5i - 2)/6 Let g(y) = 19y - 473. Let j be g(25). Factor 1/4tj - 1/4 + 0t. (t - 1)(t + 1)/4 Let k(q) = -3q*2 - 9q + 5. Let m(s) = -s*2 - s + 1. Let v(b) = k(b) - 5m(b). Factor v(o). 2o(o - 2) Suppose 0 = 2d - 4y - 20, -5y - 9 = -2y. Suppose -2j = 2u - 14, dj + j - 19 = 3u. Factor -6c2 - 5 - 3c - jc + 3. -2(c + 1)(3c + 1) Factor -4 + 3z + 0z*2 - 2z*5 + 7z - 4z2 + 8z*4 - 8z*3. -2(z - 2)(z - 1)3(z + 1) Let j(u) be the second derivative of u9/22680 - u8/15120 - u7/3780 + u6/1620 + u*4/4 - 2u. Let r(a) be the third derivative of j(a). Solve r(h) = 0. -1, 0, 2/3, 1 Let c(j) be the first derivative of 0j2 - 1/24j*4 + 1/60j*5 + 0j + 2/3j3 - 2 - 1/360j6. Let l(v) be the third derivative of c(v). Factor l(o). -(o - 1)2 Let j be 3 + -4 - (2 + 0). Let h = 0 - j. Factor -1/5g4 + 1/5g + 0 + 1/5g2 - 1/5g*h. -g(g - 1)(g + 1)2/5 Let x(j) be the third derivative of j6/1800 - j5/600 - j3/6 + 4j*2. Let i(m) be the first derivative of x(m). Factor i(d). d(d - 1)/5 Let s(o) be the second derivative of -o*3/6 + 6o*2 + 5o. Let x be s(9). Let -2a2 - 2/3a + 0 + 2a4 + 2/3a*x = 0. Calculate a. -1, -1/3, 0, 1 Let q be 1/2(86/(-30) - -3). Let n(f) be the second derivative of 0 + qf6 - f - 1/3f*3 + 0f*2 - 1/6f*4 + 1/10f*5. Factor n(u). 2u(u - 1)(u + 1)*2 Factor -7s*2 + 5s*2 + 3s*2 + 1 - 2s. (s - 1)*2 Suppose 2v + 5 = x, 0 = v + 6x - 3x + 20. Let u be (v/(70/(-4)))/1. Factor un4 + 0n + 0 + 4/7n3 + 2/7n*2. 2n*2(n + 1)2/7 Let u(n) = -n2 + 7n + 15. Let m(z) = -2z*2 + 6z + 16. Let i(g) = -3m(g) + 4u(g). Factor i(v). 2(v + 2)(v + 3) Let f(y) be the first derivative of -2y5/25 + y4/10 + 2y3/15 - y2/5 - 8. Factor f(n). -2n(n - 1)*2(n + 1)/5 Let p be 2/(-30)-51 + -3. Determine t, given that -12/5t*2 + 8/5t*3 + 8/5t - 2/5t4 - p = 0. 1 Let x = 745/988 + -1/247. Find b such that 3/4b*4 + 9/2b*2 + x + 3b*3 + 3b = 0. -1 Let d(v) be the second derivative of -5v7/21 - v6/15 + 8v*5/25 - 2v*4/15 + 3v. Let d(h) = 0. Calculate h. -1, 0, 2/5 Let z be ((-9)/(-2))/(-3)-2. Suppose zv + 0v = 15. Factor 30k*v + 6k*3 + 27k*4 + 7 - 7. 3k*3(2k + 1)(5k + 2) Let y(l) be the first derivative of 2/3l*3 + 14/25l*5 - 1/5l*2 + 0l + 3 - 2/15l6 - 9/10l*4. Determine z, given that y(z) = 0. 0, 1/2, 1 Suppose 4l = -4t + 16, -7t + 5 = -2t. Let 3r2 + r2 - 5r - lr = 0. What is r? 0, 2 Let i(g) be the first derivative of -2 - 4g3 + 0g - 3/4g4 - 6g*2. Solve i(z) = 0. -2, 0 Let g(s) be the third derivative of -2s*2 + 0 - 1/448s*8 + 0s*3 + 0s*5 + 0s + 0s6 + 0s*4 - 1/280s*7. What is k in g(k) = 0? -1, 0 Let n be 23/(-12)-1. Factor -u + 3/2 - nu*2. -(u - 1)(u + 3)/2 Factor -1/2t2 - 3/2t + 0. -t(t + 3)/2 Let h(l) = -28l*5 - 24l*4 - 4l*3 + 8l*2 + 8l - 8. Let c(t) = -t5 + t4 + t - 1. Let f(i) = -8c(i) + h(i). Factor f(u). -4u*2(u + 1)*2(5u - 2) Let 12z*3 - 7z*3 + 16 + 30z - 5z3 - 2z*3 + 12z2 = 0. What is z? -1, 8 Let t(l) be the second derivative of -l7/2100 - l6/450 - l5/300 + l*3/3 + 2l. Let r(y) be the second derivative of t(y). Factor r(v). -2v(v + 1)*2/5 Let x(i) = -7i*2 + 2. Let o(g) = -6g*2 + 2. Let f(b) = 5o(b) - 4x(b). Factor f(s). -2(s - 1)(s + 1) Factor 3/4h - 3/4h2 + 3/2. -3(h - 2)(h + 1)/4 Let g(k) = -k3 - 4k*2 + 3k - 2. Let o be g(-5). Factor 2s4 - os3 - 11 + s2 + 3 + 0s2 + 8s + 5s2. 2(s - 2)*2(s - 1)(s + 1) Let f(l) be the third derivative of -l8/2520 + l7/756 - l6/1620 - l5/540 + l3/3 + 6l*2. Let x(j) be the first derivative of f(j). Factor x(v). -2v(v - 1)2(3v + 1)/9 Let k be -22 + (0 - 2 - -5). Let m = k + 96/5. Factor mz - 2/5z2 + 1/5. -(z - 1)(2z + 1)/5 Let z = 111/4 - -11/4. Let n = z - 29. Factor 1/4 + no2 - o3 - o + 1/4o4. (o - 1)4/4 Factor -5/2z*4 + 1/3z*2 + 0z - 1/6z3 + 0. -z2(3z - 1)(5z + 2)/6 Find i, given that -2i*3 + 21i - 12i - 14i + 7i3 = 0. -1, 0, 1 Suppose 2z = 3r - 16, 2z - 1 = 1. Suppose -5d - 7 = -rd. Factor -d + 7 + l2. l2 Suppose 2y + 2 = 5d, -d - 11 = -2y - 5. Let -4r + 2r3 + yr = 0. Calculate r. 0 Suppose 2t = -0t - 5v + 4, -3v = -3t + 6. Suppose 5f - 4f4 - 6f*3 + tf*3 - 5f - f*5 = 0. What is f? -2, 0 Let v(y) be the first derivative of 0y + 0y2 - 2/15y*3 + 1/2y*4 + 2. Solve v(h) = 0. 0, 1/5 Let n = -18 - -92/5. Suppose 2/5j*2 - nj*4 + 0j*3 + 0j + 0 = 0. Calculate j. -1, 0, 1 Factor 1/5a2 - 1/5a*5 + 1/5a*3 + 0a - 1/5a4 + 0. -a2(a - 1)(a + 1)2/5 Determine k, given that 32/5 + 16/5k*3 + 64/5k + 2/5k4 + 48/5k*2 = 0. -2 Let m be 5(-1)/5 + 5. Solve -2/7xm + 0 - 2/7x*3 + 2/7x + 2/7x2 = 0 for x. -1, 0, 1 Let o(n) be the second derivative of -n8/3360 + n7/1260 + n4/12 - 3n. Let b(a) be the third derivative of o(a). Let b(j) = 0. Calculate j. 0, 1 Let n be 2/4(9 - 9). Find r such that 3/2r*3 - 1/2r*2 + 2r*4 + nr + 0 = 0. -1, 0, 1/4 Let l(g) = -g*3 - 3g*2 + 8g + 5. Let t be l(-5). Let k be -2 + 2 + 3/t. Find b, given that -1/5 - 1/5b3 + kb + 1/5b2 = 0. -1, 1 Factor 10a*2 + 12a - 19a - 5a*3 + 2a. -5a(a - 1)*2 Suppose -2w - 3w - 3 = -r, 3 = -3w + r. Solve w - 4/5q2 + 4/5q*4 + 0q*3 - 2/5q + 2/5q5 = 0 for q. -1, 0, 1 Let l(p) be the third derivative of p6/30 - p4/2 - 4p*3/3 - 4p*2. Find n such that l(n) = 0. -1, 2 Let k be -2 + -7 + 6/3. Let n = k - -12. Let -5 + 10c*2 - 10c*4 + n - 4c + 4c3 = 0. What is c? -1, 0, 2/5, 1 Let z(d) = d3 + 9d*2 - 10d + 2. Let c be z(-10). Let g be -1 + 0 - 1 - -2. Factor -1/2o3 + 0o*4 + 0 + go*c + 1/4o*5 + 1/4o. o(o - 1)2(o + 1)*2/4 Let p(a) = -2a*2 + 5a + 4. Let b(o) = -o*2 + o + 1. Let f(w) = -3b(w) + p(w). Factor f(i). (i + 1)*2 Let h be 3 - 4(-3)/(-12). Suppose -2y - 7 = 3c, -4y + hc = -13 - 13. Determine i, given that -1/2iy + 0 - 1/2i*3 + 0i*2 + 0i = 0. -1, 0 Let t(p) be the third derivative of p8/35 + p7/7 + 11p6/40 + p5/4 + p4/8 - 5p3/6 - p2. Let f(k) be the first derivative of t(k). Factor f(h). 3(h + 1)2(4h + 1)2 Suppose -3s + 0s - 17 = -m, 0 = -4s - 20. Suppose 3 = -5o + 13. Factor 0b + 4 - 2b2 + 2b*3 - m - ob. 2(b - 1)2(b + 1) Let c(k) = -k3 + k2 + k - 1. Let b(l) = -3l3 + 3l*2 + 4l - 4. Let v(m) = b(m) - 4c(m). Factor v(z). z2(z - 1) Let q be 51/7 + (4 - 11). Factor -4/7y + 0 - qy*2. -2y(y + 2)/7 Let m(g) be the third derivative of -1/60g*5 - 3g*2 + 0g*6 + 0g*3 + 0g + 0 - 1/672g8 + 1/210g*7 + 1/48g*4. Solve m(q) = 0 for q. -1, 0, 1 Let q = 15585/7 - 2232. Let i = -57/14 - q. Factor 1/2c*3 - 1 - 1/2c + ic2 - 1/2c*4. -(c - 2)(c - 1)(c + 1)2/2 Let r(o) = 2o*3 + 2o*2 - 2o + 3. Suppose u - 4u = 6. Let f be 4/8(u - -12). Let y(v) = v*3 + 2v*2 - v + 4. Let g(w) = fy(w) - 6r(w). Factor g(h). -(h - 1)(h + 1)(7h + 2) Let c be ((-9)/(-6) - -1)10/75. Factor 0i + 0i2 + ci*4 + 1/3i3 + 0. i3(i + 1)/3 Let 2/5u*2 - 4/5u + 2/5 = 0. What is u? 1 Let n(b) be the first derivative of 2b6/39 - 2b*5/13 + 3b*4/26 + 2b3/39 - b2/13 - 7. Factor n(a). 2a(a - 1)*3(2a + 1)/13 Let d(h) be the first derivative of -3 - 3/2h*2 + 0h*5 + 0h - 1/420h6 + 1/28h*4 - 2/21h*3. Let x(t) be the second derivative of d(t). Factor x(s). -2(s - 1)*2(s + 2)/7 Let r(v) be the second derivative of -2/3v3 - 3v + 0 - 2v2 + 11/12v*4 + 1/21v7 + v5 + 11/30v6. Find q such that r(q) = 0. -2, -1, 1/2 Suppose 0 = -2n + 6n - 2v + 220, 2v = n + 52. Let x be 4/6 - n/(-147). Suppose 0 + 4/7u - xu2 = 0. What is u? 0, 2 Let s(g) = g4 - g3 + g*2 + g. Let	{ "pile_set_name": "DM Mathematics" }
(b) -1 (c) -4 (d) -2 a Let i(f) = 2f2 + 122f + 238. Let a be i(-59). What is the nearest to 0.1 in a, 0.4, -1/3, 0.133? 0.133 Let j(u) = u*2 - 9u + 6. Let o be j(8). Let n = -4.8 - -5. Let l = 11614/11 + -1056. What is the nearest to n in l, -1/5, o? l Let p = 0.1 - -0.3. Suppose 18t + 4g + 4 = 16t, -4t + 40 = -4g. Let h be ((-4)/t)/((-25)/(-15)). Which is the nearest to -1/4? (a) p (b) 3 (c) h c Let h = -42.11 + 44.1. Let x = h + -1.79. Which is the closest to -1/4? (a) -2/9 (b) -1 (c) x (d) 86 a Let f = 21.72 + -21.22. Let y = 3.2 + -3.1. What is the nearest to y in -1/4, -1, 2, f? -1/4 Let m = -2.0797 + 0.0797. Which is the closest to m? (a) 2 (b) 37 (c) -2/7 c Let i = 0.63962 - 0.13962. What is the nearest to 2/3 in 42, i, 0.4? i Let y = -4/7 + -2/21. Let d = -2059.3 - -2059. Which is the closest to y? (a) -2/7 (b) d (c) 6 b Let f = -13454 + 13450.9955. Let v = 0.0045 + f. What is the nearest to 1 in v, 2, -2/7? 2 Let l be (-32)/(-176) - 74/44. Let k = 0.7 - -0.3. Let f = k + 3. What is the nearest to 1 in l, f, 1? 1 Let w = 25.8 - 26. Let j be (-43)/473 - 147/(-110). What is the closest to w in -0.1, j, 3? -0.1 Let t = 34596/7 + -4942. Let w = -3 + 4. Which is the closest to w? (a) -2/13 (b) t (c) -0.04 b Suppose -11j + 12j = -4z + 12, -4 = -4z - 3j. Which is the nearest to 0.2? (a) z (b) -0.042 (c) -0.4 (d) -5 b Let b = -383.7 - -367.7. What is the nearest to 0.2 in 2, b, 4/5? 4/5 Let h(w) = w2 + 13w + 9. Let f be h(-13). Let d be 2/(-2) + f/7. Let g = -763 + 759. Which is the closest to 1/3? (a) 5 (b) d (c) g b Let t(k) = -2k - 405 + 512 - 14k. Let u be t(7). What is the nearest to 2 in 0.3, u, -2/17? 0.3 Let n = 231.5 - 229.5. What is the closest to 0 in n, -10/7, 5, -3? -10/7 Let t = -0.2682 - 0.7318. Which is the nearest to 1? (a) 0.3 (b) 2/9 (c) t (d) 8 a Let x(m) = -235m + 473. Let d be x(2). Which is the nearest to 1/29? (a) d (b) 0 (c) 0.1 b Let p = -595 - -599.2. Let v = 73.7 - 78. Let t = p + v. What is the nearest to t in 0.16, -5, -4? 0.16 Let r(w) = -w - 1. Let x be r(-3). Let m be (-17 + 2)(10/6 + -2). Suppose -c - 3z + m = -0z, 3z - 6 = 0. What is the nearest to c in x, -1, 0.2? -1 Let y = -22042 - -22044. Which is the nearest to 1? (a) 104 (b) y (c) -0.13 (d) 4 b Let o be ((1 - 0)1)/(-2). Let m = -632 + 410. Let i = 221.91 + m. What is the nearest to i in o, 3, 2? o Let o = -274/69 + 76/23. What is the nearest to 1 in 4, o, 2/11, 12/7? 12/7 Let i(x) = x*3 + 43x*2 + 17x + 736. Let r be i(-43). Which is the closest to -39? (a) -16 (b) -4 (c) r a Let h(i) = i - 7. Let v be h(7). Let m = 37.13 + -33.13. Which is the nearest to 1/2? (a) v (b) -1/9 (c) m a Let w be (-35)/1022((-18)/15)/(-2). Let b = -1907/438 - w. What is the nearest to -2 in -4, b, 0.2? -4 Suppose 0 = 6m + 7 + 11. Let y = 13/4 + m. Let j(u) = 8u + 124. Let l be j(-15). What is the nearest to 0 in y, l, 0.3? y Let n = 45/2 + -23. Let s = -1035 + 1525. Let x = s - 486. Which is the nearest to 1? (a) x (b) 0 (c) n b Let c = -10049.8 + 10050. Suppose 0i = -4i - 52. Let o = i - -9. What is the closest to -1 in c, 4, o? c Let b = 2/23 - -19/46. Let d be 36/(-1053)36/(-8). What is the nearest to d in 4, b, -4? b Let z = 2.6 - -0.4. Let o = 38 + 154. Let h = 197 - o. Which is the nearest to 1/7? (a) h (b) -0.1 (c) z b Let q = 14072 - 14072.036. Which is the nearest to 0.2? (a) 3 (b) 1/8 (c) q b Let h = 85/88 - 19/88. Let r = 11.36 - 11. Let d = r + -0.06. Which is the closest to 0? (a) d (b) h (c) 3/5 a Let j = -876/49 - -83612/4655. What is the nearest to j in -3, -1/2, 1, 0.06? 0.06 Let v = -110.08 + 110.48. Which is the nearest to -2? (a) -3 (b) v (c) 2 (d) -45/8 a Let j(k) = 18k - 19. Let l be j(1). What is the closest to l in 11, -50, -3? -3 Let v = -2.3 - 16.5. Let i = v - -18.3. Which is the closest to 2/5? (a) i (b) 5 (c) -1 a Let v = -4 - -1. Let c be 28/686 + 255/2499. What is the nearest to v in -1, c, 8? -1 Let r = 2.208 + -1.208. Which is the nearest to r? (a) -3 (b) -0.3 (c) 3 (d) 0.006 d Let n = -4 + 3. Let k = -3.9 - -4. Let w be 334/561(-88)/(-56). What is the nearest to k in 2/9, n, w? 2/9 Let t = 26753 + -26730. What is the nearest to -5/4 in 2, 5, t? 2 Suppose -4y = -2o + 6o + 664, y = -3o - 506. Let x be (16/o)/(26/130). What is the closest to x in -5, -1, 4? -1 Let u = -4813 + 4811. What is the closest to u in 0.1, -162, 0? 0 Let r = 241 - 369. Let h = r + 189. Which is the nearest to -1? (a) 1 (b) h (c) 0.3 c Let y = 0.2 + 0.2. Let k = 3.851 - 3.751. Let u(h) = -3h + 35. Let t be u(10). Which is the nearest to k? (a) y (b) -1/3 (c) t a Let x(q) = 2q2 + 157q - 833. Let l be x(5). Which is the closest to l? (a) -2/9 (b) 2.1 (c) 6 (d) 1/2 b Suppose 14f - 161 + 119 = 0. Which is the closest to -3? (a) 21 (b) f (c) -2 c Let m = -33 + 37. Let s(b) = -3b*3 - 8b*2 - 11b - 6. Let k be s(-5). Let f = 227 - k. What is the closest to f in 1/4, m, 5? m Let d = 2660 - 2655. Which is the nearest to 0.1? (a) d (b) -4 (c) -303 b Let z = -18842.9 + 18843. Let g be 3/(-2)(-6)/63. What is the closest to z in 2/7, g, 2, -1? g Let i = -4/15947 - 47825/63788. What is the closest to -25.4 in i, -1/6, -1? -1 Let a = 301306261/1617993 + -1/179777. Let n = -186 + a. Suppose 0 = -224p + 292p - 272. What is the closest to 1 in -4/3, p, n? n Let g = -190/17 + 743/68. Suppose -5y = 5j - 15, 0 = 3y + j - 0j - 5. What is the nearest to 0.2 in -6, y, g, 3/5? 3/5 Let s be 19/(-133) + 25/28. Let h = 813 + -813.4. Which is the closest to 0.2? (a) h (b) -17/4 (c) s c Let v be 4 - (-88)/(-32) - (-5)/10-3. Let f = 1.56 - 0.16. Let o = -0.6 - f. What is the closest to o in 2/3, v, -0.3? -0.3 Let h = -0.2 - 0. Let w be (-1 + (-2)/(-6))/((3230/(-153))/(-19)). What is the nearest to h in 1, 4, w? w Suppose 2u = -0r - 5r + 205, -3u + 342 = -4r. Let p = u - 219/2. Which is the closest to -2? (a) p (b) 2/11 (c) -4 c Let y = 27 + -23.68. Let r = 0.32 - y. Which is the closest to r? (a) 0.4 (b) -0.15 (c) 0.2 b Let y = 17886 - 17885.7. What is the closest to -2/7 in -14, 1.7, y? y Let q = 711 + -3549/5. What is the nearest to -5 in 0.4, q, -3, 0? -3 Let m(g) = -42g + 2593. Let b be m(62). What is the nearest to -1 in -1, 0.08, 2, b? -1 Let y be 163-3 + -103 + 106. Let j = y - -137. Which is the nearest to 0.1? (a) j (b) 2 (c) -2 (d) -1 d Let k be -2 + (-15)/(-9) + -1. Let x = -146.52 + 145. Let t = x + 1.58. Which is the nearest to t? (a) 5 (b) -1/5 (c) k b Let m = 144 - 337. Let n = 192 + m. Which is the closest to n? (a) -0.4 (b) -5 (c) 4 a Let z = -34732/86855 - 2/17371. What is the nearest to 3.61 in 1/7, -2, z, 5? 5 Let f(a) = a*3 - 2a*2 + a + 2. Let w be f(-1). Let z be 1/(-2)w111. Let o be (2/(-24))/(z/3 + -4). What is the closest to 2 in o, 3, 2/3? 3 Let t be -5 - 16/20-10. Let b = 28/13 - 58/39. What is the nearest to 1 in -3/7, t, b? b Let u = -1.86 + 167.86. Let n = u + -165.7. Which is the nearest to -1/4? (a) 5 (b) -4/3 (c) -5 (d) n d Let k be 6/8 + (-191 - -191). What is the closest to -0.2 in 5, k, 225? k Suppose 42 = s - 8j, -s - 4j - 36 = -6. What is the nearest to -2 in 5, s, -1/6, 3? -1/6 Let k = 150.349 + -0.349. Let w = 152 - k. Which is the nearest to 0? (a) w (b) 2/13 (c) 5 b Let r = -11 - -6. Let y = -0.699 + 1.199. Which is the closest to -1/2? (a) 9 (b) y (c) r b Let o = 0.41206 - 0.61206. Let p be 0 + (3/2 - 1). Which is the closest to 10? (a) p (b) o (c) 10 c Let t be (16/10)/(-2 + (-33)/(-15)). Let u be -2(4 - 36/t)/4. Let j = -12.74 - -13. What is the nearest to u in -5, j, 5/3? j Let v = -583/228 - -160/57. What is the closest to v in 4, 1/5, -1, -0.7? 1/5 Let u(z) = 15*z - 98. Let f be u(11). Which is the closest to -5? (a) 1 (b) -1 (c) f b Let b = 2.63 - 2.13. Let s be -5 + 1 - (-1 + (-58)/18). What is the closest to s in -5, b, -1? b Let d = 30.3806 - 0.3806. Which is the closest to 1? (a) d (b) -5 (c) 1 c Let z = -0.6662 + 0.5662. Which is the closest to -5? (a) 0 (b) 5 (c) z (d) 2.4 c Let t = 1 - 1.1. Let d = 21597.97 - 21598. What is the closest to t in 1, d, 0? d Let m = -24 - -21.9. Let p = m - -2. Let v = -0.781 - 0.219. What is the closest to p i	{ "pile_set_name": "DM Mathematics" }
7 Let b(k) be the first derivative of k*4/8 - 4k*3 - 11k*2/2 + 4. Let n(o) be the second derivative of b(o). List the prime factors of n(13). 3, 5 Let n(p) = -12p*2 + 26p + 3. Let z be n(-8). Let u = -342 - z. List the prime factors of u. 631 Suppose 6m + 1736 = -5308. Let h = m + 1944. List the prime factors of h. 2, 5, 7, 11 Let z(h) = h2 - 7h - 60. Let g be z(12). Suppose -3n + gn = -q + 428, 2n + 432 = q. List the prime factors of q. 2, 5, 11 Let v = 34 + -29. Suppose -3d = vm - 1167, -5d = -m - d + 215. What are the prime factors of m? 3, 7, 11 Let i = -4 + 11. Let b(x) = 4x - 4. Let n be b(i). Let u = -7 + n. List the prime factors of u. 17 Suppose 0 = -9q - q + 319721 + 45809. What are the prime factors of q? 11, 3323 Let o(w) = -6217w - 3035. What are the prime factors of o(-11)? 2, 3, 7, 389 Let s be (0 - 6/4)/(9/(-18)). Suppose 0 = sb - 12. Suppose 6y - y + 5u = 755, by = u + 579. What are the prime factors of y? 2, 73 Let k = -7 - -14. Let w(l) = 42l - 28. Let i be w(k). What are the prime factors of (i/(-4))/(-7)(0 - -2)? 19 Suppose -11s + 7s + 1424 = 0. Suppose 1928 = 5d + 4w, 5d - w = 1562 + s. List the prime factors of d. 2, 3 Suppose 52349 = 2v - h, -238v + h = -234v - 104697. What are the prime factors of v? 2, 23, 569 Let a(y) = 356y - 24. Let i be a(14). Let k = i + -3365. List the prime factors of k. 5, 11, 29 Suppose 47 - 102 = -5c. Suppose cz = 327 + 69. List the prime factors of z. 2, 3 Let p = 10 + -14. What are the prime factors of (-18)/(1 + p) - -116? 2, 61 Suppose 2f + 2908 = -3m, f - 5m + 680 = -761. Let s = f - -2646. What are the prime factors of s? 5, 239 Let r(u) = 17u*2 + 23u + 229. What are the prime factors of r(-8)? 11, 103 Let o(g) = 11g - 73. Let d be o(8). Suppose 0 = 81r - 83r + 794. Suppose -dx + 1778 = -r. List the prime factors of x. 5, 29 Let l(i) = -i*3 - 8i*2 - 13i - 1. Let x be l(-3). Let b(d) = -d*2 - 14d - 23. Let g be b(x). Suppose -gu + 1197 = -19u. List the prime factors of u. 3, 19 Suppose -5l = 5t - 89300, -5305 = -l + 4t + 12585. What are the prime factors of l? 2, 8933 Let u(q) = -2q*2 - 13q + 9. Let w be u(-7). Suppose 2t - 3t - 1724 = -4h, 0 = 5h + wt - 2142. List the prime factors of h. 2, 5, 43 Let a(m) = 67m*2 - 81m + 9. Let h be a(7). Suppose -5651 = -12v + h. What are the prime factors of v? 2, 349 Let r = -352 + 560. Suppose -2k = 4q + r, q + 2k = -0k - 55. List the prime factors of (q/34)/((-125)/122 - -1). 61 List the prime factors of (-129)/(-344) + (-118585)/(-40). 5, 593 Let j = 26990 - 1461. What are the prime factors of j? 7, 521 Let b(x) = 3x*2 + 3x + 7. Let y be b(-2). Suppose -ym + 7663 - 1488 = 0. What are the prime factors of m? 5, 19 Let k(f) = 24f*2 - 3f + 64. Let w be k(7). Suppose wg - 6080 = 1214g. What are the prime factors of g? 2, 19 Suppose 0 = 4y - 0y + 3u - 7811, 0 = u - 1. Suppose -31n = -39n + y. What are the prime factors of n? 2, 61 Suppose -3i + 12 + 0 = 0. Suppose 2 = g - 4. Suppose -2l - 20 = -gl, -3d - il = -110. List the prime factors of d. 2, 3, 5 Let x(p) = 3p2 + 6p + 2. Let r be x(-2). Suppose -rf - 3q + 33 = 3f, 3f - 19 = -q. Suppose 0 = -fs + 5s + 11. What are the prime factors of s? 11 Let k be -1 + 13 - 385/55. Suppose -2r = -2 - 8. Suppose 0y = b + 2y - 12, -kb = -ry. What are the prime factors of b? 2 Let o(l) = l3 - 9l*2 - 40l - 15. Let x be o(13). Let c = 512 - x. What are the prime factors of c? 7, 53 Suppose -59q + 52935 + 851183 + 635959 = 0. What are the prime factors of q? 3, 7, 11, 113 Let h = -11868 - -17274. List the prime factors of h. 2, 3, 17, 53 List the prime factors of (4315/(-7))/((-240)/1680). 5, 863 Let u(c) = c2 + c + 4. Let b be u(0). What are the prime factors of -790b2/20-2? 2, 79 Let d(b) = 469b2 + 26b - 47. List the prime factors of d(5). 2, 3, 41 Suppose -3n = -6a + 1845, -270a + 3n = -266a - 1225. Let p(v) = -v + 8. Let o be p(0). Suppose 2j - a = -oj. What are the prime factors of j? 31 Suppose 0 = 132i - 64i - 125528. What are the prime factors of i? 2, 13, 71 Let o be (-4224)/56 + 3 - 4/7. Let n = o - -192. List the prime factors of n. 7, 17 Suppose 47q - 50412 - 65725 = 0. List the prime factors of q. 7, 353 Suppose 2u = -5b + 74, 4u + 9 - 45 = -3b. Let s be 3 + (b/(-10))/((-4)/(-10)). List the prime factors of (s/(-2))/(24/336). 7 Suppose 2k + 8 = -2k, 2l + k + 4 = 0. Let z(o) = -99o*2 - 1. Let w be z(l). Let a = 280 + w. What are the prime factors of a? 2, 3, 5 Let w = -290 + 312. Suppose 2286 = wo - 16o. What are the prime factors of o? 3, 127 Let f(g) = 63g - 137. Let i be f(5). Let m = 183 - i. What are the prime factors of m? 5 Suppose -4c = 4k - 68968, 76c - 71c - 68971 = -4k. List the prime factors of k. 17239 Let r(k) = -678k - 286. What are the prime factors of r(-5)? 2, 97 Let f = 25360 + -13645. List the prime factors of f. 3, 5, 11, 71 Let s(d) = d*3 + 2d*2 + d + 4. Let k be s(-2). Suppose ki + w + 249 = 0, -4w + 6w = -i - 120. Let u = i - -193. List the prime factors of u. 67 Suppose -g - 3g - 25 = -5l, -3l + 2g = -13. Let b(h) = 2h + 1. Let f be b(l). Suppose r - fx - 59 = 0, 0r + 2x = 5r - 360. List the prime factors of r. 2, 37 Suppose -4c + 21016 = 2t, 5c + 9061 = t - 1426. What are the prime factors of t? 2, 59, 89 Let v(r) = 24r3 - 16r*2 + 32r + 3. List the prime factors of v(6). 3, 1601 Let u = -3551 - -3981. Let r(c) = c*2 + 6c - 3. Let w be r(-6). What are the prime factors of uw/(15/(-2))? 2, 43 Suppose 3n - 40905 = 4z + 6720, -4n + z + 63513 = 0. List the prime factors of n. 3, 67, 79 List the prime factors of 3688932/340 + (-6)/15 + 3/5. 2, 5, 7, 31 Suppose 5g = 2h - 8, 0g + 4g + 5 = 3h. Let o = h - -27. Suppose d = -c + o, -2c = -0c - d - 40. What are the prime factors of c? 2, 11 What are the prime factors of 43160/(-104)64/(-5)? 2, 83 Let f(v) = 5v - 22. Let s be f(5). Suppose 0 = p + m - 328, -p - p + 658 = sm. What are the prime factors of p? 2, 163 Let x(i) = 14i2 + 78i + 410. What are the prime factors of x(-31)? 2, 59, 97 Suppose 6g - 90 = -4t + 4g, -3t + 35 = -5g. List the prime factors of (2092/t)/((-23)/(-115)). 523 Suppose 41 = 2q - 7. Let m = q + -24. Let n(f) = f*2 + f + 29. List the prime factors of n(m). 29 Suppose -4k + 152180 = 2j, 0j = -4k - 3j + 152178. What are the prime factors of k? 2, 3, 17, 373 Let k = 3436 - -1903. List the prime factors of k. 19, 281 Let p = 36 - 0. Let d = p - 42. What are the prime factors of 3/9(-216)/d? 2, 3 Let s(j) = -6j + 6. Let z be s(-8). Suppose x + z = -x. What are the prime factors of (-331)/(-9) - 6/x? 37 Let p(h) = -4h - 12. Let d be p(-3). Suppose -u + 583 = x, -x + 2u = -dx - 574. Suppose -145 + x = 5g. List the prime factors of g. 3, 29 Suppose 11d + 1050 = 3l + 8d, 5d - 1750 = -5l. Let c be 15/((6/33)/2). Let r = l - c. List the prime factors of r. 5, 37 Let q = 572 - 214. Let l = 746 - q. List the prime factors of l. 2, 97 Suppose 18746r = 18743r + 103230. List the prime factors of r. 2, 3, 5, 31, 37 Let s be (-1275)/(-21) - 2/(-7). Let b(v) = -v3 - 4v*2 + 77v + 4. Let o be b(-11). Suppose -2p - oy + s = p, -2y = -p + 7. List the prime factors of p. 3, 5 Let k(m) = 11m*2 - 20m. Let f = -10 + 15. What are the prime factors of k(f)? 5, 7 Suppose z = 18 - 4. Suppose 10 = 4p - z. Suppose 2r - p = 0, r + 202 = -3n + 604. What are the prime factors of n? 7, 19 Let t = 1588 + -844. Let o = t - 288. List the prime factors of 9/(-6)o/(-6). 2, 3, 19 Let d(y) = 17y2 + 10y - 12. Let u(k) = -3k - 68. Let q be u(-25). What are the prime factors of d(q)? 3, 11 Suppose 3 = -l - 1, -3v - 5l - 56 = 0. What are the prime factors of 2/(103/546 + 2/v)? 7, 13 Suppose 5r - 893 = -2k, -4k + 2282 = k - 4r. Suppose g = v - k, 11g = -5v + 7g + 2279. What are the prime factors of v? 5, 7, 13 Let z(j) = -672j - 372. List the prime factors of z(-12). 2, 3, 641 Let v(x) = -29x*3 + 3x*2 - 7x - 4. Let n(r) = -31r3 + 4r*2 - 9r - 5. Let i(j) = -6n(j) + 7v(j). What are the prime factors of i(-3)? 419 Suppose -2o - 2m - m + 11 = 0, o + 2*m = 8. Let f = -1703 + 1700. List the prime factors of	{ "pile_set_name": "DM Mathematics" }
r) = -8r + 6. Suppose -y = 3q - 12, 0 = -5q - 2y - 0y + 20. Determine qx(j) - 3p(j). -5j + 3 Let v(m) = -5m2 - 11m + 6. Let j(u) = 6u2 + 12u - 6. Let w(y) = 6j(y) + 7v(y). Let i(z) = -z*2 + 6z - 7. Determine -5i(p) - 6w(p). -p*2 - 1 Let x(v) be the third derivative of -13v6/60 - v4/6 - 2v3/3 + 82v*2. Let q(c) = 27c*3 + 5c + 5. Determine -4q(g) - 5x(g). 22g3 Let v = 2976 + -3138. Let i(u) = -u + 1. Let m(r) = 9r*2 + 81r - 81. Determine vi(h) - 2m(h). -18h2 Let d(k) = -2024 + 3910 - 1886 + k. Let v(h) = 2h - 35. What is -4d(z) + v(z)? -2z - 35 Let u(f) = 2f2 - 363f + 16346. Let q be u(83). Let t be -5(12/10)/(-3). Let b(n) = -6n*2 + 2n. Let y(i) = -12i2 + 5i. What is qb(m) + ty(m)? 6m2 Let o be 0 - (552/40 - 6)6. Let b(c) = -c + 7. Let f(h) = -h - 1. Calculate of(x) + b(x). 2x + 10 Let t(d) = -2. Let c(w) = w - 3. Suppose -11b + 18 = -29b. Let r(k) = bc(k) + 2t(k). Let a(x) = -4x - 6. Calculate a(j) - 5r(j). j - 1 Let l(y) = -6y*2 - 5y - 3. Let z(p) = -5p2 - 16p + 1. Let s(v) = -10v2 - 34v + 3. Let h(r) = 5s(r) - 11z(r). Determine -4h(a) - 5l(a). 10a2 + a - 1 Let a = -2 - -2. Suppose a = k + 3k + 20. Suppose -18c + 17c = 6. Let o(g) = 2g - 3. Let z(i) = -2i + 4. Give co(x) + kz(x). -2x - 2 Let p(c) = 10c + c + 11 + 3 + 3c. Suppose 4n + 2f - 35 = f, -5n - 3f + 49 = 0. Let d(r) = 1 + 7 - 1 + 5r - 2. Give nd(l) - 3p(l). -2l - 2 Let l(q) = -2q3 - q2. Let m(w) = 7w3 + 4w*2 + 9187. Give 4l(s) + m(s). -s*3 + 9187 Let h(y) = 2712y + 816. Let c(v) = 3v + 17. Determine -144c(j) + 3h(j). 7704j Let x(t) = 8t + 1. Let i be (4/(-2) + -12)40/(-80). Let q(z) = 15z + 2. Give ix(a) - 4q(a). -4a - 1 Let h(q) = 3q3 + 2q*2. Let o(i) = 2i*2 + 190i + 732. Let u be o(-91). Let g(v) = 10v3 + 7v*2. Give ug(b) - 14h(b). -2b*3 Suppose -8b = -3b. Suppose 0j + j = 5c + 1, j + 2c - 8 = b. Let q(v) = 5v. Let z(i) = 56i. Let f be 686/(-10) + (-66)/(-110). Calculate fq(u) + jz(u). -4u Let r(f) = 4f + 2. Let p(z) = 102z - 12. Determine p(a) - 20r(a). 22a - 52 Suppose 1 = w + z - 0, 2 = -w - 4z. Let q(f) = -f + 12f2 - 3 + 16f*2 + 4 - 29f*w. Let u(g) = 10g3 + g2 + g - 1. Give -q(k) - u(k). -10k3 Let h(i) = -i2 - 12i + 139. Let r(o) = o*2 + 3o - 1. Give h(t) + 3r(t). 2t*2 - 3t + 136 Let z(i) = 2712i2 + 21i - 12. Let t(c) = 679c2 + 5c - 3. What is 21t(m) - 5z(m)? 699m2 - 3 Let u(b) = -27b - 227. Let s(y) = -12y - 114. Calculate -7s(l) + 3u(l). 3l + 117 Let x(m) = -m*3. Let o(t) be the first derivative of -51t*4/4 + 1559. Determine -o(u) + 68x(u). -17u3 Let o(v) = 2475v - 4979v + 2480v. Let y(f) = 73f. Give -17o(k) - 6y(k). -30k Let k(u) be the first derivative of 4u3/3 - 3u*2 - 4u - 129. Let b be k(-1). Let v(d) = -4d + 3. Let m(t) = -5t + 3. Calculate bv(x) - 5m(x). x + 3 Let m(v) = 14v3 - 83v*2 + 4v - 3. Let j(t) = -t*3 + 1. Determine -3j(q) - m(q). -11q3 + 83q*2 - 4q Let x(s) = -10556s + 4 + 8 + 10569s - 11. Let i(f) = 14f + 1. Calculate 6i(o) - 5x(o). 19o + 1 Let z be (5 + -9)/(-28) - ((-414)/42 + 5). Let q(w) = -4w2 - 6w - 11. Let f(a) = -3a2 - 5a - 10. What is zf(b) - 4q(b)? b*2 - b - 6 Let q(s) = 23s - 9s - 4 - 14s + 2s2. Let b(z) = 4z*2 + 22z + 7z - 32z + 4z - 8 - 1. What is 2b(c) - 5q(c)? -2c*2 + 2c + 2 Let y(o) = -4o3 - 1. Let f(b) be the third derivative of 0b*5 + 1/24b*6 + 0b*4 + 1/6b*3 + 6b*2 + 4b + 0. Determine -3f(c) - 4y(c). c3 + 1 Let h(m) = -m2. Let v(g) = -24g2. Let y be 4/8(-3)/6 - 1805/(-20). Give yh(i) - 3v(i). -18i2 Let r(u) = -12u*2 - 134u + 85. Let t(j) = -13j2 - 133j + 68. Determine -4r(v) + 5t(v). -17v2 - 129v Let o(j) = 2j3 - 5j - 5. Let f(r) = 3r3 - 6r - 6. Let z = 5770 + -5776. Calculate zo(p) + 5f(p). 3p3 Let u(b) = -75b*2 - 91 - 208b*3 - 40b*2 + 24b*2. Let q(r) = 9r*3 + 4r*2 + 4. What is -91q(x) - 4u(x)? 13x*3 Let o(f) = -f. Let u(j) = 10j. Let l(q) = -44o(q) - 4u(q). Let y(n) = n. Let p be (-763)/218(-12)/(-21). Give py(m) - l(m). -6m Let m(t) = 17t + 20. Let l(o) = -4o - 5. Let i be 1098/1830 + 26/(-10). Give im(y) - 9l(y). 2y + 5 Let z(d) = 22d2 - 58d + 130. Let r(p) = 37p2 - 96p + 213. Let j(n) = 8r(n) - 13z(n). Let t(i) = 2i2 - 3i + 3. Determine 3j(y) - 14t(y). 2y2 Let y(w) = -666w - 18. Let t(b) = -334b - 7. Give 5t(m) - 2y(m). -338m + 1 Let s(p) = 2p2 + 2p - 4. Let a(c) = -c*2 + 1. Suppose -1 = 11w - 133. Suppose 9o = -wo - 84. Calculate oa(d) - s(d). 2d*2 - 2d Let i(z) = -29z + 42. Let x(w) = 13w - 23. Let f(k) = -3i(k) - 7x(k). Let r(c) = c. Calculate -f(q) - 6r(q). -2q - 35 Let w(z) = 21z - 17. Let g(x) = -70x + 17. Let v(t) = -9t + 2. Let j(d) = -2g(d) + 15v(d). What is 18j(s) - 4w(s)? 6s - 4 Let d(j) = j*2 - 4j - 13. Let b = 6995/2 + -3497. Let n(x) be the second derivative of -1/12x4 + 9/2x*2 + bx*3 + 8x + 0. Determine 5d(w) + 7n(w). -2w2 + w - 2 Let w(q) = -2590q - 36630. Let m(z) = -z - 22. What is 6660m(x) - 4w(x)? 3700x Let i(w) = -65w*2 - 3068w + 17. Let k(t) = -23t2 - 1021t + 6. Give -6i(y) + 17k(y). -y*2 + 1051y Let j(u) = -5u2 - 6u + 1. Let v(t) = -56t2 - 49t*2 + 2 + 148t*2 - 52t*2 - 11t. Let c(f) = -5j(f) + 3v(f). Let m(q) = -q - 1. Give c(g) - 2m(g). -2g2 - g + 3 Let w(v) = -v2 - 4v. Let z(c) = -317c*2 - 20c. What is 6w(i) - z(i)? 311i*2 - 4i Let f(q) = -4q3 - 4q*2 + 4q - 5. Let j(d) = 9d3 + 9d*2 - 9d + 9. Give -7f(s) - 3j(s). s3 + s2 - s + 8 Let r(a) = -2a2 + 190a + 5. Let u(c) = -3c2 + 192c + 6. Determine 4r(k) - 3u(k). k*2 + 184k + 2 Let x(f) = 2f - 14. Let l(q) = -q + 5. Let z(y) = -238y + 221. Let r be z(1). Give rl(t) - 6x(t). 5t - 1 Let t(n) = -6n*3 - 5n*2 + 3n - 5. Let w = -1758 - -1763. Let l(c) = 18c3 + 14c*2 - 8c + 14. Calculate wl(g) + 14t(g). 6g3 + 2g Let x = -113512 + 113511. Let k(u) = 45u. Let n(b) = 9b. Let g(w) = 2k(w) - 11n(w). Let p(i) = -i. Calculate xp(f) + g(f). -8f Let x(i) = 7i2 + 6i - 1910. Let s(j) = -8j2 - 7j + 2089. Calculate 6s(n) + 7x(n). n*2 - 836 Let q(l) = 2l*3 - 2l*2 - 1. Let c(j) = -10j*3 - 2j*2 - 3j + 4. Give -c(g) - 6q(g). -2g*3 + 14g*2 + 3g + 2 Let i(u) = -3696u3 + 308u*2 - 308u + 1232. Let w(t) = -t3 + t2 - t + 4. Calculate i(k) - 308w(k). -3388k*3 Let d(q) = 2q - 1. Let r(i) = -3i + 1. Suppose -j - 38 - 21 = 4u, -4u + 3j = 63. Let x be (-2)/15 - 77/u. Determine xr(f) + 6d(f). -3f - 1 Let n(d) = 13d*2 - 2d - 5. Let h(s) = -8s2 + s + 3. Let z(b) = -5h(b) - 3n(b). Let r(c) = -2c*2 - 4c + 5. Give r(i) + 4z(i). 2i*2 + 5 Let r(d) = 29d - 7. Let f = -3336 + 3322. Let j(c) = -14c + 3. Calculate fj(w) - 6r(w). 22w Let v(u) = -7u. Let d(g) = 39g*3 + 9g*2 - 63g - 9. Let m(o) = -d(o) + 9v(o). Let s(y) = -20y*3 - 5y*2 + 5. Calculate -5m(h) + 9s(h). 15h*3 Let a(g) = -96g*2 + 3g - 40. Let r(u) = 50u2 - u + 22. Determine 6a(t) + 11r(t). -26t*2 + 7t + 2 Let v(h) = -4h + 9. Suppose 0g - 4l - 42 = -2g, 0 = 3l + 15. Let j(b) = 7b - 17. Let r = -22 + 22. Suppose 2y = 12 - r. Give gv(z) + yj(z). -2z - 3 Let y(p) = -p. Let i(f) = 12. Let m(z) = -2z - 60. Let d(r) = -10i(r) - 2m(r). What is -2d(c) - 9y(c)? c Let q(v) = -30v*2 + 8v - 8. Let h(a) = 10a2 - 3a + 3. Let m(j) = -3j2 - 207j + 3. Let p be m(-69). Calculate pq(b) + 8h(b). -10b2 Let q(p) = 15p*3 - 11p*2 + 11p + 109. Let i(u) = 57u - 564. Let l be i(10). Let y(m) = 8m*3 - 6m*2 + 6m + 55. Determine lq(w) - 11y(w). 2w3 + 49 Let k(a) = -7a*3 + 589a*2 - 8a + 8. Let s(j) = -18j3 + 1767j*2 - 22j + 22. Determine -11k(g) + 4s(g). 5g3 + 589g2 Let o(w) = -w2 - 3w - 7. Let p = 34 - 24. Let h(c) = -3c*2 + 2c - p + 0c + 4c*2 + 14. Let f = -197 + 202. Give fh(d) + 3o(d). 2d*2 + d - 1 Let a(p) = -55p + 6. Let y(g) = -g + 3 - 65g - 15g + 2 + 26g. Determine 4a(v) - 5y(v). 55v - 1 Let z(y) = 4y2 + 197y - 6. Let p(o) = 17o2 + 788o - 25. Give -6p(s) + 26z(s). 2s	{ "pile_set_name": "DM Mathematics" }
5l. Suppose y + y - 225 = -b, 0 = 4y + ub - r. Is y prime? False Is (-3 + 7)(-1942)/(-8) a composite number? False Let l(s) = 252s3 - 3s*2 + 2s - 4. Is l(3) a composite number? False Is (-6)/(-24) - ((-6670)/8 - 1) composite? True Suppose -21b = -16b - 58385. Is b prime? True Let z = 714 - -67. Is z composite? True Let y = -271 - -578. Is y prime? True Suppose 0 = 2c - 3 - 1. Suppose -3 = -4g - cx + 3, -2x = 2. Suppose 5z = -gi + 68, 0 = 4i + 2 + 2. Is z a prime number? False Let k be ((-1)/3)/((-2)/(-12)). Let o be 2451/15 - (-2)/(-5). Let m = k + o. Is m composite? True Let k(y) be the first derivative of -y7/840 + y6/30 - 3y*5/40 - 3y4/8 - y3 + 3. Let o(l) be the third derivative of k(l). Is o(11) prime? True Let v(h) = 42h2 + 2h - 17. Is v(5) a composite number? True Suppose 3f - 5r = -0r + 5847, -5f - r = -9745. Is f prime? True Let r(l) = -l*2 + 6l + 5. Let t be r(6). Suppose -s - 380 = -tx, 3s + 144 = 2x + s. Is x composite? True Suppose -4x = -5d - 2751, 4x - d - 2667 - 88 = 0. Is x a composite number? True Let j(u) = u*2 + 2u + 2. Let v be j(-3). Suppose 2l + vh = 276 - 18, 3l = 2h + 349. Is l a prime number? False Let n be (-306)/1520/(-4). Suppose -4v + n = -646. Is v a composite number? True Let o be 2/(1 - (-2)/(-4)). Suppose -3w + 9 = u, ow - 23 = -5u - 0w. Let x(t) = 2t3 + t2 - 2t - 4. Is x(u) composite? False Let f(m) = -m*3 + 10m*2 - 2m + 20. Is f(9) composite? False Let c(r) = 6r + 2. Let j(y) = -2y - 1. Let m(w) = -3c(w) - 8j(w). Is m(-2) prime? False Suppose -2p = -4t - 522, -p - 3t + 253 = -t. Is p prime? True Let w(o) = -o. Let b(y) = -28y - 2. Let s(f) = -b(f) + 4w(f). Is s(3) prime? False Let s be (-714)/(-24) + (-2)/(-8). Suppose -113 = -t + s. Is t prime? False Let k(r) = 3r - 1. Let d be k(3). Suppose 0 = -2b + s + 65, b + b - 4s = 50. Let y = d + b. Is y a prime number? True Let j = 23 + -20. Let k be (-2)/4 + (-14)/(-4). Let q = k + j. Is q a prime number? False Let y be 6/(-21) + (-44)/(-7). Suppose 3c - 2w - y = w, 5c - 34 = -3w. Let s(a) = 2a2 - 3a - 4. Is s(c) prime? True Is (-3 - -252)2 + -1 a prime number? False Let c be 57/(-9) + (-2)/(-6). Let k = c + 6. Suppose -4b = 2g - 512, 3b + kg - 391 = -5g. Is b composite? False Suppose -3s + 13 + 5 = 0. Is (-1 - (-9)/s)442 a composite number? True Let y(b) be the third derivative of 8b4 - b3/3 + 8b*2. Is y(2) a composite number? True Let c = -2 + 20. Suppose 6 = -3h + c. Suppose h + 26 = 5i. Is i composite? True Let z(t) = 19t*2 - 7t - 33. Is z(-4) a composite number? True Let j = 422 + -211. Is j a prime number? True Suppose 0 = -0x - 5x + 10. Suppose 146 = xv - 276. Is v a prime number? True Let x be 2/(-5) + (-33)/5. Let l(n) be the third derivative of n5/10 + 5n*4/24 - 4n*3/3 + 11n*2. Is l(x) prime? True Let v be 12/((-18)/(-4) + -3). Suppose 6 = 2z - v. Is z a prime number? True Let l(i) = 34i - 1. Is l(1) a prime number? False Let b(v) = 37v + 1. Let k be b(1). Suppose 3n + k = 4a - 177, -103 = -2a - 3n. Is a composite? False Suppose 3g - 15 = 8g. Let u(r) = 14r2 - 2r + 1. Is u(g) a composite number? True Let v(m) = -m*3 - 5m*2 - 5m - 5. Let t be v(-4). Is t/(-12/422) prime? True Let l be 6/2 + 0 + 100. Let q = l + -50. Is q a composite number? False Let y = -30 - -51. Let g be 5(122/(-10) + -1). Let q = y - g. Is q composite? True Let s be (-363)/(-4) - (-3)/12. Suppose -s = -x + 337. Suppose x = 4q - 16. Is q a composite number? True Let a = 2815 - 1144. Is a composite? True Suppose -3 = -4q - 11, 4q - 579 = -m. Is m a prime number? True Is -1(3 - (-490)/(-1)) composite? False Let x be (10 - (-3 - -4)) + 1. Suppose -4c + x = -18. Is c composite? False Suppose -5j + 12 = -0p - p, -4j = 4p - 24. Is (-6)/3 + 124 - p a prime number? False Let y(a) = 371a*2 + 3a - 1. Is y(1) a composite number? False Let u(s) = -s*3 + 9s*2 + 4s + 1. Let g(k) = -k*2 - 7k + 8. Let j be g(-7). Is u(j) a prime number? True Suppose 2p = 4p - 4. Is 1/(p/(-62)-1) a prime number? True Suppose 3p = 5q - 151 + 870, 4q = -4p + 916. Is p composite? False Let l(t) = 3t. Let b be l(-10). Let f = b + 53. Is f a composite number? False Suppose 3s - 9 = -2w + w, -2w + 4s - 2 = 0. Is (2 - 3) + 384/w a composite number? False Suppose -4p + 12 = -p, 5w - 3p - 1643 = 0. Is w a prime number? True Is 2884/6 - (-4)/12 a composite number? True Is (-2)/(-4)(2 + 656) prime? False Let v(a) = a*2 + 1. Let o be v(1). Is 39 + -3 + o + -1 a prime number? True Let a(q) = 3q + 3. Let m be a(-5). Let p be (45/(-4))/((-3)/m). Let u = 154 + p. Is u prime? True Let p = -129 - 25. Is (p/3)/((-2)/3) composite? True Let w be (-2)/(4/(-6))1. Let b(k) = -3k + 1 - 4k + wk. Is b(-8) a composite number? True Let r(t) = t - 6. Let w be r(3). Is (w + 113 + 1)1 a composite number? True Let g be 1/(22/(-92)). Let o = 0 - g. Is o a prime number? True Let v be (0 + -30)8/(-6). Suppose 0 = -7x + 3x + v. Is x composite? True Let r(w) = -2w*3 - 6w*2 + 5w - 3. Let g be r(-7). Suppose 0 = -3s - 63 + g. Is s composite? False Let l(x) = 7x*2 + 11x - 2. Let q(v) = 4v2 + 6v - 1. Let p(y) = -6l(y) + 11q(y). Let j = 2 - 6. Is p(j) composite? True Let g(f) be the third derivative of -f6/120 + f5/12 + f4/12 + f3/6 - 4f2. Let l be 7/(-2) + (-3)/(-6). Is g(l) a composite number? False Suppose -4f + 6 = -2. Suppose 5j + 2b = 2909, -2j + 7b = fb - 1152. Is j prime? False Suppose -p = 5 - 8. Let x = -159 - -73. Is 15/p + -2 - x a prime number? True Suppose j + 5r - 2939 = -2j, -5r - 2959 = -3j. Is j a prime number? True Is -6 + 2 - (-2 + -295) composite? False Suppose 8c - 6c + 2h - 12 = 0, -5c - 3h + 30 = 0. Suppose -22 = -j - 2r + cr, -16 = -4r. Is j a composite number? True Let h = 5 - 1. Suppose -hw = 144 - 24. Is 2 - (w + -2) - -1 a prime number? False Let o(k) be the first derivative of 4k2 - 6k - 1. Is o(4) a prime number? False Let i = -236 + 499. Is i a composite number? False Suppose 375 = -3t - 2t. Let o be (t/6 - -3)-4. Suppose -g = -3g + o. Is g prime? True Suppose -4t + 7l = 4l - 1811, l = -4t + 1791. Is t prime? True Suppose -2y = 2i - 3i + 9, -i - y = -6. Let l = -7 + i. Suppose -15 = -5k - lk. Is k a prime number? True Let o(m) = -m3 - 3m*2 + 3m - 2. Let d be o(-4). Let b be d/(-8)5-220. Suppose q + 4q = b. Is q a composite number? True Suppose 8a + 4a = 2820. Is a a composite number? True Suppose -5t + 20997 = 4t. Is t prime? True Suppose -3r - 33 = 4h - 2r, 2r = -h - 10. Let g be 1 + (-4)/(h/202). Let w = 265 - g. Is w prime? True Let s(d) = 2d*2 + 8d - 5. Let h be 37/5 + (-4)/10. Suppose 2f + 3c + h = -10, 2f - 4c = -10. Is s(f) a prime number? True Let g(w) = 5w + 6. Let p be g(6). Let u = p - 14. Is u prime? False Let b be -1 - (-6 - (-1 + 1)). Suppose n - 2x = 397, -3n + 0x = bx - 1158. Suppose 0 = 3z, -5g - 2z = -1046 + n. Is g composite? False Is (-165 + -1)/(2/(-5)) prime? False Let k(c) = -c + 6. Let q be k(8). Is (-55)/2(0 + q) composite? True Let m(c) = -c2 + 7c. Let w be m(7). Let i = 3 - w. Suppose iu - 4l = -11, -2u = u + 2l - 19. Is u a composite number? False Let b = 1192 + -671. Is b a prime number? True Let z be ((-6)/5)/((-2)/5). Is (z - (-155)/4)4 a composite number? False Let i = -842 - -1256. Is ((-1)/(-3))/(2/i) a composite number? True Let j = -10 - -9. Let o(p) = -389p3 - p2 + 1. Is o(j) composite? False Let h = -27 + 42. Suppose -12d + hd = 759. Is d prime? False Suppose -5 = 5p - 0. Is 3 - -10(0 - p) prime? True Let i = -27 - -64. Is i a prime number? True Let p be (1 + -2)-3 - 3. Suppose p = -7j + 2j + 45. Is 2(-2)/(-2) + j composite? False Is 11 + (9 + -3 - 2) prime? False Suppose 2n - 432 = -72. Suppose -4g = -n - 416. Is g composite? False Let o(r) = -r*3 + 9r*2 - 8r + 1. Let z be o(8). Let g be (10/(-6))/(z/(-3)). Suppose 0 = gc + 271 - 866. Is c a prime number? False Let u(l) = 76l*2 - 10l + 5. Is u(6) composite? True Suppose -5y = 2m - 2, 5y + 7 + 3 = 0. Let d(a) = -5 + 4a*2 - 6a*2 + 8a + a**2. Is d(m) composite? False Suppose 0 = i + 13 + 26. Let r = 7 + -69. Let n = i - r. Is n	{ "pile_set_name": "DM Mathematics" }
. Is v at most as big as -7/2? False Suppose 5b = 142 + 18. Suppose 3k + b = 8. Let v be ((-2)/6)/(k/246). Is 10 less than or equal to v? True Suppose -6r = -24 + 42. Let v(k) = -6k*3 - 2k*2 - 18k - 29. Let u be v(r). Is u < 170? True Suppose -57 = -6t - 33. Let p be (-769948)/1680 + t/14. Let i = p + 458. Which is smaller: i or -1? -1 Let g = 355 - 307. Suppose -go = -50o + 254. Are 126 and o unequal? True Let w = -5397 + 5409. Let g = 4 - -2. Let n be 1g(0 + 2). Are w and n nonequal? False Suppose 466 - 6 = 20d. Let j = -13 + 9. Is j smaller than d? True Let l be (3/820)/(3 - 6). Let i = -2667/1640 - l. Is -2 less than or equal to i? True Let n = -22 - -16. Let y(q) = 5q - 7. Let c be y(2). Let i(u) = -2u*2 + 10u - 17. Let v be i(c). Which is bigger: n or v? v Let c(p) = p*2 + 5p - 6. Let v be c(-6). Suppose 3t + 19 - 763 = 3k, 2t = 5k + 505. Let f be t/(-280) - 3/(-8). Which is smaller: f or v? f Let y(h) = h*3 + 34h*2 + 3h + 152. Let s be y(-34). Suppose c + 3p = s, 0 = -12c + 14c - 2p - 132. Is c bigger than 2/9? True Let s = -50 + 141. Suppose -r = 3p - 79, -286 = -5r + 3p + s. Let u(t) = 13t - 2. Let o be u(6). Is o < r? False Suppose w - 5m + 1 = -19, -5m + 20 = 5w. Suppose -4c + 24 = 4k, -5c - 3k + k = -24. Suppose -t = w, 4r + 3t - ct = 16. Which is smaller: 39/8 or r? r Let s(z) = z*2 + 3z - 2. Let h be s(1). Let i = -683.836 + 684. Which is smaller: h or i? i Let x(u) = -u*2 + 6u - 6. Let w be x(4). Let o be (-8)/48((-28)/10 + w). Suppose 2t = 3t + 1. Which is smaller: t or o? t Let g = 2875 + -3000. Is g smaller than -123? True Let p = -1685 + -6907. Which is smaller: p or -8593? -8593 Suppose -171591 = -49s + 70s. Let i = s - -1070406/131. Does i = 1? False Let w be (-38)/(-57) - 4/6. Suppose w = u - 4h - 12, 2h = 6h + 8. Let o be (5/(-15))/(2 - u)2. Is -15 at most o? True Let k(w) = -w2 - 20w - 3. Let s(t) = 21t. Let d be s(-1). Let v be k(d). Let i = v + 38. Is i bigger than 12? True Let p = 273 + -262. Let s = 10.12 - -0.78. Let q = p - s. Which is greater: -2/15 or q? q Suppose -2v = y + 2v - 670, -5v = -3y + 2095. Let w = -779 + y. Let p = 3 - 2.9. Which is smaller: w or p? w Suppose 336 = -31i + 10i. Let v be 18/i + (-1078)/84 + 13. Which is smaller: -1 or v? -1 Let o = 3372.2 - 3383. Do o and 1 have different values? True Suppose 0 = 2g - 2j - 16, 3g - 2j + j - 18 = 0. Suppose 0m = 3m - 2b + 2, -gm + 2 = 2b. Which is smaller: -2/735 or m? -2/735 Let d be (20/75)/((10/(-3))/(-5)). Which is smaller: -1687 or d? -1687 Let z(x) = x*3 - 4x*2 + 2x + 1. Let m be z(2). Let n be ((-2 + 1)m)/((-8)/(-56)). Let c be (n/(-14) - (0 - -1))2. Which is greater: c or -37/7? c Let d = -2787 - -3001. Is 206 smaller than d? True Let x = -6180 + 6192. Which is smaller: x or -0.6? -0.6 Let t = -5/1191 + -6739/2382. Which is smaller: t or -0.31? t Suppose 0 = -7r + 3c + 370, -3c - 291 = -5r - 19. Which is smaller: r or 115? r Suppose 5s = d - 29, 5s + 20 = 4d + s. Is d < -3/865? True Let s be -4 + 3 - (-1)/2. Let j(f) = -9f + 81. Let h be j(9). Let m be -4 - (h/(-1) - (-42 + 9)). Is s > m? True Suppose -34k + 37k - 5r = -472, 2k = 4r - 318. Suppose p - 464 = 3w - 4p, -4w = -p + 596. Does w = k? False Let m = 484.09 - 481.7. Is m equal to 8? False Let s(v) = -v*2 + 40v - 201. Let k be s(6). Suppose 3a - r = k, -a - 4r - 12 = -0a. Which is greater: 9/35 or a? 9/35 Suppose 4a + 4n = 5 - 41, 0 = 3a + n + 15. Which is bigger: -144/37 or a? a Suppose 5m = -t + 16834, -2 = 3t - 14. Which is smaller: 3367 or m? m Let v = 36 - 47. Let j = 277/25 + v. Which is smaller: 1 or j? j Let t = 0.47 + -0.46. Let s = -502 + 524. Which is bigger: s or t? s Let p(d) = 3d3 - 354d*2 - 3d + 354. Let n be p(118). Is n > 12/6149? False Let f = -593/6 + 4133/42. Is 4292 not equal to f? True Let r(q) be the second derivative of -25q3/6 + 59q*2/2 + 12q. Let t be r(5). Which is smaller: -67 or t? -67 Let m be 12/(-2)(-33)/6050. Let h = m + 7/55. Is -1 != h? True Let c = 160 - 82. Let x(i) = -i2 - 13i + 24. Let v be x(-18). Let o be c/v + 8/44. Do o and -4/17 have different values? True Let u = 105.7 + -123. Let y = -32.4 - u. Let g = 15 + y. Which is greater: -4.1 or g? g Let q(r) = -3r + 33. Let l be q(13). Let f be (-266)/84 + (-7)/l + -1. Which is greater: -11/4 or f? -11/4 Let b = 5703 + -4367. Is 0.1 >= b? False Let y(a) = 3a + 4. Suppose -2p - p + 12 = 0. Suppose pw + 1 = 3w. Let i be y(w). Which is bigger: i or 2/19? i Let x = -10610 + 10423.43. Let n = x + -4.43. Which is smaller: n or 1/5? n Let b be (-938)/(-804) + (-13)/6. Is 2/2021 at least as big as b? True Let s = 1613/6 + -2669/10. Which is smaller: 0.1 or s? 0.1 Suppose 3n = -5a + 23, 0 = -5n + 4a + 2 - 13. Let f be (5 + (320/(-12))/5)/n. Is 2/57 at least f? True Let s(k) = -6k - 3. Let d be s(-1). Suppose 13 = -q + t - dt, -5t - 45 = 5q. Let m be (q - -7) + (-2 - 0). Is m > -4/45? True Let y = -9663 + 7883. Is y greater than or equal to -2/19? False Let l = 1083 - 108. Let w = 28047/437 + -21344608/20539. Let z = l + w. Which is smaller: 1 or z? z Suppose -4d + 5k = 36, -4k + 642 - 714 = 4d. Does 96 = d? False Let z = 712 - 1705. Are z and -993 non-equal? False Let s be (-11 + 20/(-24))(1 + -4). Is -1 != s? True Let x = 6.2168 + -5.8968. Let n = 0.2 + 0.2. Is n at least as big as x? True Suppose 0 = -2g - 19g - 2562. Let q be (-14)/(-4) + 9/6 + g. Do -117 and q have different values? False Let q(h) = -6h2 + 48h + 10. Let o be q(8). Let m be 2 - 2 - o/((-1050)/45). Suppose -3l - 2 = -5. Which is smaller: m or l? m Let w = 7.023 + -7. Let q = -73.314 - -73. Let m = -0.214 - q. Is w smaller than m? True Let a be 132/(-1122) - 137/(-34)4. Suppose ar + 5r = -441. Do -20 and r have the same value? False Let g(o) = 6o2 + 471o + 1574. Let t be g(-75). Suppose 0 = r - 0r - 214. Is t not equal to r? True Let b(i) = -13i - 62. Let o be b(-5). Suppose -4h - 2l = 34, -oh + 2l + 2 = -2l. Which is smaller: h or -27/5? h Suppose 268u = 292u - 6240. Which is greater: -4 or u? u Let x = 10502.93 + -10294. Let i = 209 - x. Is i not equal to 4? True Let o(b) = -36b*2 + 48b + 351. Let j be o(-8). Is -2337 >= j? True Let v = 3799.96208 - 3800. Which is smaller: 0.1 or v? v Let q(z) = -105z - 13441. Let k be q(-128). Let t be 1/101(0 + 3). Does t = k? False Let g be -1 + 1 - -2 - (-1 + -3). Suppose 2q + 4t + 194 = 0, -4t + 186 = -2q - gt. Is -90 at most as big as q? True Suppose -723l - 1411592 = -169l. Is -2549 at least as big as l? False Let d = -67 + 69. Suppose -58 + 12 = -dk. Suppose 0y - 22 = -y. Which is smaller: y or k? y Let u be ((-2)/5)/(784/(-1811012)). Let f = u + -924. Is f < -1? False Let i = -70/74533 + 8468004/9175086833. Which is smaller: 1 or i? i Suppose -4p + 29 + 3 = -v, 0 = 3p - v - 25. Suppose 3n = -4i - 99, pi - 4n + 68 = 4i. Is i <= -24? True Suppose 0 = 5z - 4w - 108, -3z = 4w - 0w - 52. Let v = -1.621 + 1.721. Which is greater: z or v? z Let s(b) = -2b*2 - 2b + 3. Let v be ((-2)/(-12))/((-3)/(-18)). Let l be s(v). Let a be 4 - ((-729)/(-105) - 3). Which is bigger: l or a? a Let l = -84 - -84.046. Let b = l - 0.146. Let u = -111 + 92. Is u > b? False Let s = -1463 + 1496. Are s and 58 unequal? True Suppose 11b = -1085 - 1368. Let j = -279 - b. Is j equal to -57? False Suppose -5c - 10 = -5b, -4b - b = -2c + 2. Let w be ((-1)/3)/((-3)/54b). Let s = w - -4. Is s bigger than 5/13? True Let a be 122/8543/2. Suppose 0 - 1 = u. Which is greater: a or u? a Let c be 2028/(-564) + 154/42. Is c >= -1? True Let j(z) = -2z*3 - 5z*2 + 6z + 13. Let d be j(-4). Suppose 3p + 5t = -2p + 360, 4t - 214 = -3p. Suppose -2k = -0k - p. Is d < k? False Let h = -17435/46 + 771/23. Is -345 >= h? True Let v = -726 - -426. Let s = v - -303.5. Let b = -1.1 - -0.1. Is b less than or equal to s? True Let g = -8976 + 8976. Which is greater: 2710 or g? 2710 Let i(r) = 15r*2 - 80r + 347. Let l be i(5). Which is greater: 321 or l? l Let c = 8.7 - -43.3. Let q = -52 + c. Is 1/23 greater than q? True Suppose 0 = 17v + 2449 - 1395. Which is smaller: -64 or v? -64 Suppose -4v + 18 = -58. Suppose -2*j + j + 8 = 0. Suppose j	{ "pile_set_name": "DM Mathematics" }
hat is the closest to -3/110 in 2/5, -0.1, 5? -0.1 Which is the closest to -0.4? (a) 2/9 (b) -3 (c) -1 (d) 2 c Which is the closest to 2? (a) -6 (b) -1 (c) 0.4 (d) -14 c Which is the closest to 90? (a) 2 (b) -0.4 (c) 16 c What is the closest to 6 in 5/2, -1, -0.1? 5/2 What is the closest to 0.1 in -2/9, -2/19, -2/7? -2/19 Which is the nearest to -2? (a) -3 (b) 0.2 (c) 0.01 (d) 0.23 a Which is the closest to -2? (a) 0.4 (b) 1/9 (c) -2/15 (d) 23 c Which is the nearest to 1.46? (a) 0.08 (b) -3 (c) -4 a Which is the closest to -31? (a) -2/5 (b) -0.04 (c) 1/4 (d) -4 d What is the nearest to -1 in -6.8, 2, -0.3? -0.3 Which is the closest to -0.2? (a) -1/7 (b) 5 (c) -6 a Which is the nearest to 1? (a) 3.1 (b) 2/7 (c) 3 (d) 4/9 d Which is the nearest to 0? (a) 11 (b) -1/2 (c) 0.1 (d) -3/4 c What is the closest to -2 in 1/4, 7, -3, 0.4? -3 What is the nearest to 3/20 in -97, 1, 0.2? 0.2 Which is the closest to 0.1? (a) -3 (b) -0.5 (c) 63/4 b What is the nearest to 2 in -0.4, 3/4, 2, -13? 2 What is the closest to 3 in -2/7, 0.5, 3, -2? 3 What is the closest to -0.2 in 3/7, -2/7, -14, 1? -2/7 What is the closest to 0.1 in -1, -0.033, -0.5? -0.033 What is the nearest to -0.3 in -1, -54, -2, 1/8? 1/8 What is the closest to 0 in 579, -1/3, 3, -0.2? -0.2 What is the nearest to 4 in 7.1, 0.3, -1, 2? 2 What is the closest to -2/15 in -0.098, -5, -1/2, 0? -0.098 Which is the nearest to -2? (a) 1 (b) -4/5 (c) -3/4 (d) -45 b Which is the nearest to 0? (a) 6/17 (b) 1/3 (c) -0.2 c What is the nearest to 1 in 0.03, 1/17, 2, -0.3? 1/17 Which is the closest to 2/9? (a) 2 (b) 0 (c) -3/5 (d) 18 b Which is the nearest to 1/3? (a) 0.5 (b) 1 (c) -2 (d) -2/11 a What is the closest to -84 in -5, 1/5, 1? -5 Which is the closest to 5/6? (a) 0.2 (b) -5 (c) 0.07 (d) -3 a What is the nearest to 0 in -3, 0, 0.04, -7? 0 Which is the closest to -0.1? (a) 1 (b) -0.1 (c) -311 b What is the closest to 2/7 in 0, -417, 3? 0 Which is the nearest to 0? (a) -3 (b) -19 (c) -1/4 (d) 0.1 d Which is the closest to 0? (a) 0 (b) -1/25 (c) 4/5 a What is the nearest to 1 in -2/13, 6, -3, 0.4? 0.4 What is the closest to 2/7 in -17, 0.4, 12, -3? 0.4 What is the closest to 0.1 in -43, -1/7, -4, 0.1? 0.1 Which is the nearest to 1? (a) -36 (b) -6/5 (c) 0.3 (d) 4/5 d Which is the nearest to -0.1? (a) -0.5 (b) 1/3 (c) 4 (d) -3 a What is the nearest to 1/46 in -5, -0.09, -1? -0.09 What is the nearest to -1 in -14, -3, -117? -3 Which is the closest to 0? (a) 0.5 (b) -2 (c) -5 (d) -3 a What is the closest to -0.94 in 0.6, -5, 0.3, 5? 0.3 Which is the nearest to 1? (a) 0 (b) 4 (c) 2/33 c What is the closest to -2/141 in 1/3, -3/8, -0.2? -0.2 What is the closest to 1/4 in 5, 2/3, 1, 4? 2/3 What is the nearest to 4 in 1, -1/7, 0.5, -0.08? 1 What is the closest to 4 in -5/2, -1/4, -1/23, 2/17? 2/17 Which is the closest to -1? (a) -3/32 (b) 5 (c) 3/8 a What is the nearest to 1.5 in -13, -0.2, -2? -0.2 What is the closest to -1 in -71, -0.1, 2/3, 2? -0.1 Which is the closest to 2/7? (a) 3/4 (b) 5 (c) -0.3 (d) 41 a Which is the closest to -0.3? (a) 2/3 (b) 0.5 (c) -1 (d) 4 c Which is the closest to -75? (a) 3/2 (b) -4 (c) 168 b What is the nearest to 2 in 5, 4.8, -7? 4.8 Which is the nearest to 0.01? (a) 2/13 (b) 1 (c) 3 (d) -2/5 a Which is the closest to 1? (a) -0.2 (b) 0.02 (c) -1/9 b What is the nearest to 3 in 2, -35, -1/5? 2 What is the closest to 2 in 16, 0.4, -2/7, -11? 0.4 Which is the closest to -2/9? (a) 9 (b) 1/4 (c) -18 b Which is the nearest to -6? (a) -3 (b) -3/2 (c) -0.3 (d) -4 d What is the nearest to 1 in -24, -0.5, -4, -8? -0.5 What is the closest to 2/3 in 0.3, -0.03, -111? 0.3 What is the closest to -10 in 0, -5, 3? -5 Which is the nearest to -0.1? (a) -1/7 (b) -3 (c) -53 a What is the closest to 3/5 in 0.7, 2, -7? 0.7 Which is the nearest to -4? (a) -0.4 (b) 0.4 (c) 2/71 a What is the nearest to 0.2 in 0.02, -3, 0.5? 0.02 What is the closest to 1/3 in -0.1, 1, -81, -2/19? -0.1 Which is the closest to 17? (a) 0 (b) 0.1 (c) 0.4 c What is the nearest to 0.5 in 1/5, 0.12, -0.02? 1/5 What is the nearest to -1.5 in -0.4, -4, 1/4, -11? -0.4 Which is the nearest to -1? (a) 4 (b) -4 (c) -0.5 (d) 2/27 c What is the closest to 7 in 3/7, -0.07, 5? 5 Which is the closest to 86/9? (a) 0.4 (b) 2/9 (c) 4/5 c What is the closest to -2/5 in 2, -6, -0.1, -0.3? -0.3 What is the closest to -1 in 2/13, 5, 0.2? 2/13 What is the nearest to 5/2 in -0.4, 1, 2, -26? 2 What is the closest to 0.02515 in -1, 0.3, -2? 0.3 What is the closest to -0.177 in -8, 4, 2/5? 2/5 What is the closest to -1/4 in 28, 0.4, 0.1? 0.1 What is the nearest to 11 in -2/7, 5, 0.5? 5 What is the nearest to 0.1 in 1/3, -3/8, 3.8, -2/7? 1/3 Which is the closest to 0.3? (a) -1/4 (b) -5 (c) 4 (d) -1.4 a What is the closest to 1 in -2/3, 0.1, 0.4? 0.4 Which is the closest to 1/42? (a) 6/5 (b) -2 (c) 1/6 (d) -0.5 c What is the closest to 0.03 in 0.4, 5, 18, 3? 0.4 Which is the nearest to -0.1? (a) 14 (b) 5 (c) -4 (d) -3/5 d What is the closest to 0.1 in 4, 1/21, -2, 2/7? 1/21 Which is the nearest to 0.33? (a) 0.4 (b) 2 (c) 3/2 (d) -3 a What is the nearest to 1 in -10/7, 2, 90, 0.3? 0.3 What is the nearest to -1 in -4, -1, 3, -1/552? -1 Which is the closest to 0? (a) 5/7 (b) 2/19 (c) -2 (d) -2/5 b What is the closest to 0.1 in -1, -2/9, -1/3, 0.2? 0.2 What is the nearest to -1 in -3, 44, -3/2? -3/2 Which is the closest to -10? (a) -2/7 (b) 1/7 (c) 3/5 (d) -1/3 d Which is the closest to -1/5? (a) 0 (b) -9 (c) 2 (d) -5 a Which is the closest to -0.6? (a) 19 (b) 2/5 (c) 3/5 b Which is the nearest to 0? (a) -0.15 (b) 1 (c) 4 (d) -2/3 a Which is the closest to 1? (a) 0.5 (b) -5/2 (c) 1 (d) -2/7 c What is the closest to 0.1 in -4/5, -1, 1/2, 4? 1/2 Which is the closest to -99? (a) 2 (b) 3 (c) 3/7 c What is the closest to -2 in 5, 1, 2/69? 2/69 Which is the nearest to 2/3? (a) 1/2 (b) -2/17 (c) 3 (d) 29 a Which is the closest to 134.4? (a) 0.2 (b) -1/3 (c) 2/5 c Which is the nearest to -0.1? (a) 16/25 (b) 3/5 (c) 7 b What is the nearest to -0.1 in 2/11, 1, -121? 2/11 Which is the nearest to 0? (a) -2/5 (b) 22 (c) 9 a Which is the nearest to 0.4? (a) 4 (b) 2 (c) -0.06 c Which is the nearest to -2? (a) 3/5 (b) -0.4 (c) -3 (d) -97 c What is the closest to 1/5 in -0.4, 59, -1/2? -0.4 Which is the nearest to 0? (a) -0.1 (b) 1/8 (c) -2 (d) 0.3 a What is the nearest to -1 in -0.2, 3, 1/4, -4/9? -4/9 What is the closest to 2 in 0.8, 0.4, 22? 0.8 Which is the nearest to 14? (a) -0.5 (b) -0.1 (c) -0.3 b What is the nearest to -2/7 in 1/2, 2, 5? 1/2 What is the nearest to -5/9 in 2/9, -5/2, -1/7? -1/7 Which is the closest to 1? (a) 1 (b) 5 (c) -6482 a What is the nearest to 1/33 in 25, -0.1, -0.3? -0.1 What is the nearest to 2/5 in 4/5, 0.2, -7/4, -3? 0.2 What is the nearest to -0.1 in -4, 0.1, 0.3, 4? 0.1 What is the closest to 0 in -2/23, 29, 0.3? -2/23 Which is the closest to -1? (a) 6.4 (b) -5 (c) -2 c What is the nearest to -0.11 in 0.4, 3, -3, -0.1? -0.1 What is the closest to 0.1 in 3, -4, -0.7? -0.7 Which is the closest to 3? (a) -3/2 (b) -0.5 (c) -1/25 c What is the nearest to -0.3 in -22, 5, -4? -4 What is the closest to -1/4 in 5/3, -11/9, 8/7, -2? -11/9 What is the closest to -0.5 in 1/2, -33, -4? 1/2 Which is the closest to 1/3? (a) -4 (b) 0 (c) -3/5 (d) 7/3 b What is the closest to 1 in -4/3, 3/4, 4? 3/4 What is the closest to 4 in 23, 4, -0.4, 3/4? 4 What is the closest to 1 in 2/5, 1, -0.2, 1/5? 1 What is the closest to 0.1 in 0.12, 0.4, -14? 0.12 Which is the closest to -2/7? (a) -1 (b) 0.3 (c) 2/9 (d) -1/5 d Which is the closest to 2/3? (a) 1/5 (b) -0.5 (c) -1/4 (d) -1/11 a Which is the nearest to 2/5? (a) 0.1 (b) -2 (c) 0.03 (d) -7 a What is the closest to 0 in -0.4, 142, 0? 0 What is the nearest to -1 in 2/3, 0.3, -13, 3? 0.3 Which is the closest to 0? (a) -0.1 (b) -5 (c) -30 (d) 1 a Which is the nearest to -5/7? (a) -1 (b) -1/3 (c) 0.4 a Which is the closest to 2/5? (a) -0.5 (b) -25 (c) -0.4 c Which is the nearest to -2? (a) -5 (b) -6 (c) -1/5 (d) -2/5 d Which is the closest to -2/7? (a) -6 (b) 4 (c) 2 (d) -1	{ "pile_set_name": "DM Mathematics" }
3329. What is h rounded to the nearest one hundred? -2100 Let x = 100.4 - 32.1. What is x rounded to the nearest 10? 70 Suppose -146c + 427506 = -1380558. What is c rounded to the nearest one hundred? 12400 Let b = -299.1 - -313. Round b to 1 dp. 13.9 Suppose -15 = -y - 2y. Suppose -1191 = -yl - 0h - 3h, 0 = 4h - 8. Let c = 477 - l. What is c rounded to the nearest one hundred? 200 Suppose -2b + 2 = -22. Let f(i) = 2i*2 - 11i + 1. Let m be f(5). Let y = b + m. Round y to the nearest 10. 10 Let g = -706 - -706.000001993. What is g rounded to seven dps? 0.000002 Let n(q) = q*2 + 8q + 19. Let j be n(-6). Suppose -12556333 + 44056333 = -js. Round s to the nearest 1000000. -5000000 Let z be 1002841/35 - (-6)/15. Suppose 6c + 6183 = z. Suppose 4n - 5o + 0o - c = 0, -n - 5o + 905 = 0. Round n to the nearest 100. 900 Let i = 17959 + -8863. Suppose 5v + 4k = -13 - 7, 3k + 15 = 5v. Suppose -2h + 3696 - i = v. Round h to the nearest one thousand. -3000 Suppose -4i = 16 - 40. Suppose 2y - iy + 31200 = 0. What is y rounded to the nearest 1000? 8000 Let b = 3.8 - 4.13. Let z = 24 - 24.229. Let w = b - z. Round w to 2 decimal places. -0.1 Let y(j) = j*2 - 2j + 0j2 - j2 + 17 + 3j*2. Let r be y(7). What is r rounded to the nearest 10? 150 Let g = -237.898971 - -237.9. Round g to four decimal places. 0.001 Let w = -415 - -415.00393. Round w to 3 dps. 0.004 Suppose -l - 5x = -43765, -30l = -29l + 2x - 43768. What is l rounded to the nearest 1000? 44000 Let v = -702 + 701.8519. What is v rounded to 2 dps? -0.15 Suppose 5b - 10 = 0, -5b + 15216368 + 3133642 = 5m. Round m to the nearest one million. 4000000 Let a = 2190.9998291 - 2191. Round a to 4 dps. -0.0002 Let d = -1.71 - -1.7100000291. Round d to 7 dps. 0 Let n(q) = q + 1. Let o(w) = -20w2 - 5w - 25. Let r(c) = 5n(c) + o(c). Let d be r(8). What is d rounded to the nearest 1000? -1000 Let d = -1346350.261 - -2695.261. Let t = d + 1343655.18999948. Let g = t + -0.19. Round g to seven dps. -0.0000005 Let o = 73 + -72.9608. Let f = 219 + -219.03. Let c = o + f. Round c to three dps. 0.009 Let i = -2.92 + 406.92. Let x = i + -397.56. Let j = 7 - x. What is j rounded to 1 dp? 0.6 Let v = -0.4444055 + -1850745.5555945. Let q = -1850740.799884 - v. Let x = -5.2 + q. Round x to five decimal places. 0.00012 Suppose -86u + 95u = 3366000. Round u to the nearest 100000. 400000 Let i = 1.06 - 1. Let a = -10.431697 - -10.4917. Let u = a - i. Round u to 6 decimal places. 0.000003 Let o = 146.816 - 146. Round o to 1 decimal place. 0.8 Let r = -465 - -473.14. What is r rounded to zero decimal places? 8 Let k = -106.12181 - -88.121646. Let z = 18 + k. Round z to five decimal places. -0.00016 Let h = -1.68 + 28.09. Let d = 26 - h. What is d rounded to 1 dp? -0.4 Let v = -7041 + 15711. Round v to the nearest 1000. 9000 Let m = -17821 + 17821.20013. Let y = m - 0.2. What is y rounded to 4 decimal places? 0.0001 Let b = -30 - -15. Let l = -425049.00052 + 425064. Let q = b + l. What is q rounded to 4 dps? -0.0005 Let q be (-4 - 0)/((-16)/(-12)) - -935303. What is q rounded to the nearest 100000? 900000 Let m be 4/6 - (-290280082)/(-123). What is m rounded to the nearest one million? -2000000 Let b(m) = -11m*3 + 3m - 2. Let v be b(1). Let l be (v/15)/((-3)/(-81000)). What is l rounded to the nearest 10000? -20000 Let t = 1033 - 1063.1. Round t to the nearest ten. -30 Let u = 278 + -277.99995522. Round u to 6 dps. 0.000045 Suppose -2s - 3c + 46 = 0, -2c = 4s - s - 79. Suppose -49 = -4n - s. Let f be -50003 - (-6)/(n + -3). Round f to the nearest ten thousand. -50000 Let i = 8 + -4. Let q = i + -2.7. Let f = -1.29983 + q. Round f to five decimal places. 0.00017 Let m = 57 + -38. Let v = m + -19.12. Let r = 0.12013 + v. What is r rounded to four decimal places? 0.0001 Let q = -5 - 13. Let f = 19.75 + q. Let o = -1.75121 + f. What is o rounded to four decimal places? -0.0012 Let t(o) be the third derivative of -2779o*5/60 + 3o*4/8 + 3o*3 - 13o*2. Let g be t(9). What is g rounded to the nearest ten thousand? -230000 Let a = 948 + -956.53. Let b = -8.4566 - a. What is b rounded to two decimal places? 0.07 Let c = 219.879 + -220. What is c rounded to 2 decimal places? -0.12 Suppose -12i = -27i. Let w = 0 + 2. Suppose 0h - 52512 = 5y - 4h, -wh + 6 = i. Round y to the nearest 1000. -11000 Let t = 0.1 + -0.31. Let b = 17.3845 - 17.6. Let h = t - b. Round h to three dps. 0.006 Let o = -18 + 21. Let q = o + -1.85. What is q rounded to one decimal place? 1.2 Suppose 128i = 115i + 10322. Round i to the nearest one hundred. 800 Suppose -5u + 127326 - 22376 = 0. Round u to the nearest 1000. 21000 Let k = 2408662 - 3566662. What is k rounded to the nearest 100000? -1200000 Let u = 23 + -23.28. Let a = u + 0.12. Round a to 1 decimal place. -0.2 Let a(k) = -2k - 95925k*2 - 2512k*2 + 5k + 4 - 12. Let h be a(-8). Round h to the nearest 1000000. -6000000 Let d = -203 + 202.99998871. What is d rounded to seven dps? -0.0000113 Let p = 207.906 + 0.094. Let j = p - 208.00131. Round j to four dps. -0.0013 Let h = 1.22483024 + 0.14131586. Let n = h + -25.3661641. Let g = n - -24. Round g to 5 decimal places. -0.00002 Let z = -2315222 - -2315454.0298. Let s = -590 - -358. Let a = s + z. Round a to three decimal places. 0.03 Let u(c) = c*2 + 8c + 17. Let x be u(-5). Suppose 0 = xf + 10, 9723918 + 8476067 = -2q + 3f. What is q rounded to the nearest one million? -9000000 Let b = 4214 - 4214.4778. Round b to 2 dps. -0.48 Suppose -1 = 4p - 17. Suppose -641596 = -pm + 258784. Let q = -44905 - m. What is q rounded to the nearest 100000? -300000 Let x = 18427 + -5061. Suppose n - x = -5i - 276346, 2n + 4i = -525984. What is n rounded to the nearest ten thousand? -260000 Suppose 752276 = 5q + 192251. Let k(w) = -w2 + 11w - 6. Let n be k(10). Suppose -i = -1, -nu - q = -8i + 3i. Round u to the nearest 10000. -30000 Suppose -2c + 6 + 22 = 5g, 3c - 24 = -3g. Suppose 3v = -v, 53300 = -a - gv. Round a to the nearest ten thousand. -50000 Let a = -67716.1659 - -67764.9. Let h = -48.7 + a. Let r = -0.038 + h. Round r to 3 dps. -0.004 Let b = -2809.993994 - -2810. What is b rounded to 3 dps? 0.006 Let w = 8 + -5. Let n be 0 + -1 + 566490 + -2. Suppose wo = -333513 - n. Round o to the nearest 100000. -300000 Let h = -0.0718 - -0.0953. Round h to two decimal places. 0.02 Let n = 1200 - 1200.000071. What is n rounded to 6 decimal places? -0.000071 Let u = -399433 - -822182. Let p = u + -422496.157. Let s = p + -253. What is s rounded to 2 decimal places? -0.16 Let x be (-1 + -4 - -1880)/((-11)/(-52624)). What is x rounded to the nearest 100000? 9000000 Let t = 57 + -37. Let h = -18 + t. Suppose -k = hq + 8005, q + 3q - 2k = -15990. What is q rounded to the nearest 10000? 0 Let f = 6954.006562 - 6954. Round f to three dps. 0.007 Let o(k) = 12076k + 32. Let z be o(-7). Round z to the nearest 1000. -85000 Let g = -30 + 20.5. Let z = g + 7. Let f = 3.52 + z. What is f rounded to 1 dp? 1 Let z(c) = -8c3 + 3c*2 + 23c + 16. Let q be z(-11). Let k = q - 17754. Round k to the nearest one thousand. -7000 Let k(m) = -221992m - 8. Let x(p) = 73997p + 3. Let w(a) = -4k(a) - 11x(a). Let y be w(1). Round y to the nearest ten thousand. 70000 Let v = 50.1 - 48.722. What is v rounded to one decimal place? 1.4 Let l = -30802023.1 + 30802051.0999989. Let d = 27.36 + 0.64. Let g = l - d. What is g rounded to six decimal places? -0.000001 Let k = -4.992 - -5. Let z = k + -0.00800254. What is z rounded to 7 dps? -0.0000025 Let o = 1.84 + -2.899. Round o to 1 decimal place. -1.1 Let m = -0.47992554 + 138.48047054. Let l = m - 138. Round l to 4 decimal places. 0.0005 Let i(l) = 26l3 + 4l*2 - 6l - 3. Let d = 1 + -7. Let p be i(d). Let a = -25439 - p. What is a rounded to the nearest 1000? -20000 Let y = 116.4175 + -0.1175. Round y to the nearest 10. 120 Suppose -3o + 2 = -2s - 1, 2o = -4s + 34. Let p be 960002/s - (-12)/(-36). What is p rounded to the nearest 100000? 200000 Let u = -40.076 + 0.076. Let s = u - -46.5. Round s to zero dps. 7 Let b = -298.1 - 11.9. Let o = 309.99999857 + b. Round o to six dps. -0.000001 Let q(d) = -d*2 - 13d - 20. Let c be q(-11). Suppose c*k =	{ "pile_set_name": "DM Mathematics" }
= 236. Let q(f) = f*2 - 10f - 15. Calculate the remainder when s is divided by q(13). 22 Let i(y) = y + 5. Let g(n) = n + 11. Let c be g(-8). Suppose -v = cv - 76. Calculate the remainder when v is divided by i(5). 9 Suppose -2268 = -2c + 20c. Let t = c + 133. Calculate the remainder when 20 is divided by t. 6 Let i(f) = f3 + 12f*2 + 33f + 100. What is the remainder when i(-9) is divided by 6? 4 Let i(j) = 65j - 310. Calculate the remainder when i(6) is divided by 17. 12 Let b = 756 + -319. Calculate the remainder when b is divided by 34. 29 Let t = 38 + -38. Suppose -6a - 107 + 545 = t. What is the remainder when a is divided by 19? 16 Let u = 6 - 0. Suppose -o - u = -83. Suppose 2y + t + 19 = 71, -78 = -3y + 3t. What is the remainder when o is divided by y? 25 Suppose -2y + 4 = 4s, 8s = -5y + 3s + 30. Calculate the remainder when 37 is divided by y. 7 Let l(j) = -12j3 - 6j*2 - 6j - 3. Calculate the remainder when l(-3) is divided by 72. 69 Suppose 7n = -17 + 41 + 95. What is the remainder when (-41)/(-4)41 is divided by n? 7 Let k(o) = o2 - 10o - 7. Let m be k(11). Let y(z) = z*2 + 2z - 3. What is the remainder when 61 is divided by y(m)? 19 Suppose -5 = n - 1, -5n + 7 = 3r. Let h = 134 + -156. Calculate the remainder when 440/h(-8)/10 is divided by r. 7 Let m be (-2 - -5)/(-3)(-3 + -80). Let w = m - 2. Calculate the remainder when w is divided by 12. 9 Let i be -1 + -1(0 + 1). Calculate the remainder when (12/5)/(i/(-10)) is divided by (-38/(-72))/((-2)/(-48)). 4 Let v(z) = -16z - 329. Calculate the remainder when v(-22) is divided by 6. 5 Calculate the remainder when 69/1(-2120)/(-159) is divided by 71. 68 Let u(n) = n*3 + 4n*2 - 6n + 2. Let k(b) = -64b - 1. Let t be k(-1). Let q be (-1)/(-4) - t/12. Calculate the remainder when u(q) is divided by 5. 2 Let b be (-15)/(-2)(-8)/(-6). Let y(f) = -3f2 + 30f + 12. Calculate the remainder when (6/5)/(3/50) is divided by y(b). 8 What is the remainder when 307 is divided by -4 + (-1 - -9) + 20? 19 Let n(y) = -22y3 + 5y*2 + 11y + 4. Calculate the remainder when n(-2) is divided by 26. 22 Let t = -22 - -28. Let p(l) = 7l - 23. Suppose -4i - u = -214, 0 = -0u - 2u - 4. What is the remainder when i is divided by p(t)? 16 Let z = 556 + -392. What is the remainder when z is divided by 17? 11 Suppose 139 = 35z + 34. Let d(p) = 2p - 7. Let w be d(5). Suppose 0 = za - 4a - 4h + 16, -a = wh - 20. Calculate the remainder when a is divided by 7. 4 Suppose -6s + v + 61 = -s, 2v + 44 = 4s. Suppose 2g + 0c + c - 51 = 0, -3c + 130 = 5g. Calculate the remainder when g is divided by s. 10 Let m(r) = 2r + 1. Let h be m(-4). Let s(n) = -n*3 - 6n*2 + 6n - 16. Let i be s(-7). Let l = h - i. Calculate the remainder when 2 is divided by l. 0 Suppose 2q + 2q - 94 = -g, 0 = g + q - 88. Calculate the remainder when 250 is divided by g. 78 Suppose -5f - t = -263, -f + 3t = 2f - 165. Let d(i) = 3i*2 + 7i + 8. What is the remainder when f is divided by d(-4)? 25 Suppose -5z + 7 = -2g - 12, g = z - 2. Suppose 25 = 5v, -2k + 3k - zv - 33 = 0. What is the remainder when k is divided by 20? 18 Let u(y) = 2y2 - 3. Let t be u(-5). Suppose t = 3m - 4s + 6s, -5m = 5s - 85. What is the remainder when 24 is divided by m? 11 Let s = 100 - 95. Suppose -4b + 66 = 14. Suppose 6 + b = i. What is the remainder when i is divided by s? 4 Let k(s) = -26s*2 + 86s - 2. Calculate the remainder when 263 is divided by k(3). 21 Let m be -3 - -5 - (-2)/(-2). Calculate the remainder when m(0 + (-2 - -7)) is divided by -1 - 2/(-4)6. 1 Let t be 22/6 + 4/(-6). Suppose -s - 36 = -2v + 3s, 4s + 12 = 0. Suppose -to = v - 72. Calculate the remainder when o is divided by 7. 6 Suppose 13b - 14b + 22 = 0. Suppose -b = -t + 37. Calculate the remainder when t is divided by 12. 11 Let t(k) = -2k + 1. Let c be (7 - (-4 + 7)) + -2. Suppose -u + 81 = cu. Calculate the remainder when u is divided by t(-7). 12 Suppose -3t + 4t = 210. Suppose -45 = -5v + t. Calculate the remainder when v is divided by 9. 6 Let w = 53 - 37. Suppose wa - a = 585. What is the remainder when 154 is divided by a? 37 Let c(j) = 102j - j3 - 102j - 2j2 + 3. Suppose 9 = -4v + q, -4v + 2q = -6v - 12. Calculate the remainder when c(v) is divided by 5. 2 Let n = 29 - 17. Suppose 2c + n = 4c. What is the remainder when c/9 + (-736)/(-12) is divided by 16? 14 Let d be -165(42/(-10) - -3)1. Suppose 0x - 11x + d = 0. Let q = 36 + -2. What is the remainder when q is divided by x? 16 Let s = 193 - 160. Calculate the remainder when 64 is divided by s. 31 Suppose 0y + 76 = 2y. Suppose -7q = -6q - 10. What is the remainder when y is divided by q? 8 Suppose a + 4b - 151 - 279 = 0, 1260 = 3a - 3b. What is the remainder when a is divided by 47? 46 Suppose -x = -16 - 3. Let p = -10 + x. Suppose 2n - 41 = -3o, -4n + 2o - o = -103. What is the remainder when n is divided by p? 7 Suppose 5g - 180 = -5q, 4g + 3q - 363 + 215 = 0. What is the remainder when 106 is divided by g? 26 Let s be 2/(-10) + (-2)/(-10). Suppose -4x + m + 33 = 0, -2x + 9 + 5 = 2m. Let i = s + x. Calculate the remainder when i is divided by 5. 3 Suppose 2o - 20 = -m, -o = 3m + 4o - 63. Suppose 2 = b - 101. What is the remainder when b is divided by m? 25 Suppose -3k + 6k - 309 = 0. Calculate the remainder when k is divided by 298/14 + (-3)/((-147)/(-14)). 19 Let w(v) = -5v + 6. What is the remainder when 143 is divided by w(-6)? 35 Suppose 0 = 5s - 10b + 14b - 95, -135 = -5s + 4b. Calculate the remainder when 89 is divided by s. 20 Let n = -2040 + 2263. What is the remainder when n is divided by 7? 6 Suppose -12 - 60 = -6q. Suppose -9n + qn - 15 = 0. What is the remainder when n is divided by 2? 1 Suppose -4t = t - 205. Let h(d) = 2d2 + 4d - 42. What is the remainder when t is divided by h(4)? 5 Suppose -5g = -3h - 93, -3h = g + 2 - 17. Let l(x) = -x2 - 2x. Let n be l(-2). Suppose 10 = -nc + c. Calculate the remainder when g is divided by c. 8 Suppose 3i - q + 3q - 2 = 0, 4q = 2i - 12. Let n(z) = 6z + 1. What is the remainder when 24 is divided by n(i)? 11 Suppose -4a + 11 = 2d - 1, 4d + 8 = 0. Suppose 0 = -v - v + 20. Calculate the remainder when v is divided by a. 2 Let v = 41 - 35. Let s = -3 + v. Suppose -30 = -2p + 2f, 0f = -p + 4f + 27. What is the remainder when p is divided by s? 2 Suppose 7h + 315 = -2h. Let m = h + 43. What is the remainder when 46 is divided by m? 6 Let b be (-12)/(-1)(-13)/(-2). Suppose 4c - 104 = 3y, 2y = -3c - y + b. Suppose 0 = g - 3g + c. What is the remainder when 23 is divided by g? 10 Let c be (-4)/26 + 3836/91. Suppose 3k = k + c. Suppose 0 = x - 9 - 3. What is the remainder when k is divided by x? 9 Let v = -4 + 6. Suppose -7 = -u - 5a + 2, -7 = 3u - va. What is the remainder when 4(u - -2) - -30 is divided by 12? 10 Suppose -2k = 3k - 3f + 748, -2k + 4f - 288 = 0. What is the remainder when 2/(-6)(-22 + k) is divided by 30? 28 Let n(d) = -d*3 + 9d*2 + 14d - 5. Suppose -139c - 16 = -143c. Calculate the remainder when n(10) is divided by c. 3 Let f(y) = -y - 3. Let c be f(-8). Suppose 231 = cz + 11. Calculate the remainder when 173 is divided by z. 41 Suppose 0c - 4c = -60. Let b be 5/10 + 162/(-4). Calculate the remainder when b/(-1) - 0 - -2 is divided by c. 12 Let j(b) = b3 + 7b*2 - b - 3. Let l be j(-7). Let g be ((-16)/(l/1))/2. What is the remainder when 119 is divided by 1 + 31 + 4/g? 29 Let w(s) = 4s2 - s2 + 0s2 + 2s - 2 - 2s2. Let z(l) = -l3 + 4l*2 - 7. Let r be z(3). What is the remainder when 23 is divided by w(r)? 5 Suppose 0 = -12a + 3a + 36. Suppose -2d = -a + 2, 0 = -2r - 2d + 46. Calculate the remainder when r is divided by 6. 4 Suppose 19p - 495 - 1253 = 0. Calculate the remainder when p is divided by 19. 16 Suppose -5a - 34 - 56 = 0. Let w = 30 + a. What is the remainder when 22 is divided by w? 10 Calculate the remainder when ((2 - 0)1)/((-9)/(-261)) is divided by 8. 2 Suppose -5o + 11l = 16l - 40, o - 2l = 8. What is the remainder when 21 - (3 + -4 + 2) is divided by o? 4 Let x(j) be the first derivative of 2j*3/3 - 11j*2/2 + 18j -	{ "pile_set_name": "DM Mathematics" }
ppose 4l = -4h + 44768, 0 = 4h + 39l - 41l - 44762. What is the remainder when h is divided by 91? 89 Let o = -1749 - -1760. What is the remainder when 10643 is divided by o? 6 Suppose -166k + 329k - 161k = 352. Calculate the remainder when k is divided by 82. 12 Suppose -45x + 917 + 3414 = -1159. What is the remainder when 377 is divided by x? 11 Let f = 581 - 518. Calculate the remainder when f is divided by 18. 9 Let y = -299 + -23. Let t = y - -502. Calculate the remainder when t is divided by 46. 42 Suppose -2y + 485 = 2r - r, 1005 = 4y - 5r. What is the remainder when 1211 is divided by y? 231 Suppose -5m + 92i - 89i = -69, -48 = -5m - 4i. Let q(a) = -14a + 185. Calculate the remainder when 2 - (-1 + 1 + -45) is divided by q(m). 13 Suppose -3f - 23u + 24u = -434, 566 = 4f + 5u. What is the remainder when f is divided by 7? 4 Let r = 9082 + -9077. Suppose z + 0z = -4p - 1, -z = -2p + 1. Calculate the remainder when r is divided by z/(1/(-8)2). 1 Let h(q) be the first derivative of q*4/4 + 8q3/3 + q2/2 - 48q + 34. What is the remainder when 285 is divided by h(-6)? 15 Let v(h) = 14h*2 + h + 4. Let z be v(-3). Let l = z + -113. Calculate the remainder when 167 is divided by l. 13 Let u(m) = 6m*2 + 207m + 12. What is the remainder when u(-36) is divided by 18? 12 Let v = -5 - -60. Suppose -5m - 2k = -4k - 163, -73 = -3m - 5k. What is the remainder when v is divided by m? 24 Let b = 4423 - 2702. What is the remainder when b is divided by 38? 11 What is the remainder when 165 is divided by 14 + (14(-10)/35)/((-8)/6)? 12 Let q = 164 - 332. Let s = 187 + q. Calculate the remainder when 74 is divided by s. 17 Let v be (132/24)/11 - (-30)/4. Suppose -vb + 57 + 87 = 0. Calculate the remainder when 55 is divided by b. 1 Suppose 2i - 124 = 2x, 3x = -2i - 2x + 89. Let o = 113 + -102. Suppose -ot - 15 = -12t. Calculate the remainder when i is divided by t. 12 Let c = -570 + 755. Calculate the remainder when c is divided by 46. 1 Let k(d) = d*3 - 58d*2 + 655d - 15. What is the remainder when 1354 is divided by k(15)? 4 Calculate the remainder when -1 - -2054 - (2220/(-10))/37 is divided by 206. 205 Suppose -36j - 93j - 2167 = -9391. Calculate the remainder when j is divided by 23. 10 Suppose 131p = 14650 + 808. Calculate the remainder when p is divided by 9. 1 Let x(b) = -b2 - 16b - 13. Let a be x(-15). Suppose 0 = -u + a + 3. Suppose ud + 0d - 125 = 0. Calculate the remainder when d is divided by 8. 1 Calculate the remainder when (376/(-8) - 2)/((-5)/70) is divided by ((21 - -4) + 1)/2. 11 Let k be (-6 - -4 - -3)-263. Let o = 328 + k. Calculate the remainder when o is divided by 3. 2 Suppose 0 = -5a - 2h + 324, 0 = 3a - h + 56 - 257. What is the remainder when ((-2)/(-6))/((a/(-1044))/(-11)) is divided by 18? 4 Suppose 3g = -0g + 2n + 33, 0 = -3n. What is the remainder when ((-4)/2)/(508/(-3302)) is divided by g? 2 Suppose 798 = -9c + 294. Let d = 63 + c. Let k(t) = -t - 5. What is the remainder when k(-17) is divided by d? 5 Suppose -30r + 58r - 7504 = 0. Calculate the remainder when r is divided by 70. 58 What is the remainder when (12575 - 0) + ((-32)/48)/(3/(-18)) is divided by 44? 39 Let q(f) = f*3 + 20f + 23. Calculate the remainder when q(0) is divided by -2 + 2 - (-2 + 1). 0 Let z = -19159 + 19816. What is the remainder when z is divided by 20? 17 Suppose -3y = -3m - 6303, 2m - 8398 = -2y - 2y. Suppose 17v - y = 263. Calculate the remainder when v is divided by 28. 27 Suppose -19h = 9h + 11928. Let k = -360 - h. Calculate the remainder when 461 is divided by k. 65 Suppose 0v - 3v = -5x + 1021, 0 = -12x - 3v + 2481. What is the remainder when x is divided by 135? 71 Suppose -3y + y + b + 81 = 0, 5y - 201 = 3b. Let n(g) = -g*3 + 21g*2 - 92g - 17. Calculate the remainder when n(10) is divided by y. 37 Let k(d) = 2d + 3. Let r(f) = 6f - 38. Let x(s) = 4k(s) - r(s). Let a be -2(2 + 57/6). What is the remainder when 21 is divided by x(a)? 1 Let z(v) be the third derivative of -v*6/120 + 7v5/12 - v4/24 + 21v3/2 + 99v*2. What is the remainder when z(35) is divided by 11? 6 Let x(y) = 2y*3 + 96y*2 - 78y - 109. What is the remainder when x(-48) is divided by 130? 125 Suppose 2d - 740 = -5w, -5d - w + 1730 + 51 = 0. What is the remainder when d is divided by 149? 57 Suppose -5s + 174 = -26. Let d(t) = 5t - 41. Let c be d(9). Suppose 2j = -0j - q + 19, cq = -5j + s. Calculate the remainder when 35 is divided by j. 11 Let b be 3/(18/9 - 634/318). Let y = 623 - b. What is the remainder when y is divided by 49? 48 Let i(w) = -2w*3 - 12w*2 - 15w - 50. Suppose 0t = -4t + 308. Calculate the remainder when i(-7) is divided by t. 76 Let a = -989 + 1845. Suppose 0 = -2g - 5l + 802 + 62, 2g - a = -3l. What is the remainder when g is divided by 47? 46 Suppose 37w + 18149 = 91w - 4261. Calculate the remainder when 422 is divided by w. 7 Let n = -125 - -199. What is the remainder when -9 - ((-1)/(5/(-15)) + 32/(-8) + -170) is divided by n? 14 Suppose 44 = -m + 3s, 3s - 73 = 10m - 8m. Let k(o) = -o*3 - 27o*2 + 58o + 15. What is the remainder when 1 + 4 + -2 + 39 is divided by k(m)? 12 Suppose -8 = -h - 6. Let u be (-34)/((h/4)/(5/10)). Let w = u - -49. Calculate the remainder when 28 is divided by w. 13 What is the remainder when (957444/184)/(5/((-10)/(-3))) is divided by 13? 11 Let f = 16 - 53. Let d = f - -41. Suppose dz - 6z = -14. What is the remainder when 39 is divided by z? 4 Suppose 180 = -15i + 19i. What is the remainder when i is divided by ((-5)/2513)/((-5)/(75/3))? 6 Suppose -56 = -4o + 4. Let i be 3/o - 57/(-15). Calculate the remainder when 33 is divided by -3 + -1 + i + 7. 5 Suppose 4d - 63 = d. Suppose -81 = -6x + d. Suppose 9 = -j + x. Calculate the remainder when 35 is divided by j. 3 Let c(m) = 3444m + 154. Calculate the remainder when c(1) is divided by 40. 38 Suppose 4d - 43 + 3 = 4f, 5 = 4d + 3f. Suppose -r - 1 = 0, 155k = 157k + 4r - 100. Calculate the remainder when k is divided by d. 2 Suppose 3q - c = -16, 2q + 3c + 22 = q. Let r = -4 - q. Suppose -13 = -n + 3k, rn = 2k - 0k + 39. Calculate the remainder when n is divided by 3. 1 Let y = 758 + 3628. What is the remainder when y is divided by 77? 74 Suppose 0 = -9v - 9v + 37676 + 27754. What is the remainder when v is divided by 35? 30 Suppose -95p + 100p - 95 = 0. What is the remainder when 56 is divided by p? 18 Suppose -l = 4r - 6, 2r + 4l + l + 6 = 0. Suppose -rx - 6 = 126. Let f = x + 128. What is the remainder when f is divided by 13? 10 What is the remainder when (1 - (4 + 906) - 26/(-13))-1 is divided by 130? 127 Let d = -5276 + 5416. Calculate the remainder when d is divided by 42. 14 Suppose 70i + 449 - 12979 = 0. What is the remainder when i is divided by 4/(-18) + (-814)/(-18)? 44 Suppose -63s - 351 = -62s. Let t = -324 - s. What is the remainder when 181 is divided by t? 19 Let v be 4/(-6) + (-19818)/(-81). Suppose -5f + v = -2k, 0 = -10k + 6k - 8. What is the remainder when 183 is divided by f? 39 Suppose 5i + k + 6 = 0, 4i = i + 3k. Suppose 55r - 62r = -5f + 57, -2f - 2r + 18 = 0. What is the remainder when (-50)/i(-1)/(-2) is divided by f? 5 Let a(r) = r*2 - 7r - 2. Let x(n) = -n*2 - 11n. Let o be x(-10). Suppose w - ow + 72 = 0. Calculate the remainder when 28 is divided by a(w). 4 Let s = -273 + 322. What is the remainder when 7542 is divided by s? 45 Let f(w) = -w2 + w + 49. Let r = -40267 + 40284. What is the remainder when f(0) is divided by r? 15 Suppose 1873 - 695 = 19k. Suppose 0o - 61 = -4o - 3u, -5o + k = -u. What is the remainder when 116 is divided by o? 12 Suppose 583 - 187 = 23b + 109b. Calculate the remainder when 124 is divided by b. 1 Let g = 58 - 53. Suppose 0 = -3r - 3n + gn + 756, 0 = 2r - 5n - 515. Calculate the remainder when r is divided by 51. 46 Calculate the remainder when (((-2)/(-9))/((-3)/(-1494)))/((-440)/(-38280)) is divided by 90. 88 Suppose 11068 = 417j - 447j + 63568. What is the remainder when j is divided by 40? 30 Suppose 12q = 19*q - 301. Let a = -228 - -399. What is the remainder when a is divided by q? 42 Let t(n) = -n	{ "pile_set_name": "DM Mathematics" }
(-36)3/(9/(-2))? 9 Suppose 0 = 32v - 1448024 - 13192. Calculate the remainder when v is divided by 43. 40 Suppose y - 14 - 33 = 0. Let u(d) = -4d3 - 69d*2 - 14d + 29. Let m be u(-17). Let z(f) = 14f + 312. What is the remainder when y is divided by z(m)? 3 Suppose 0 = 5g + 21 - 141. Let r be 2/(-8) + -5 + 246/g. Suppose 0 = -ry - y + 888. Calculate the remainder when y is divided by 30. 28 Let a = 509 + -489. Suppose 0k = -4i + k + 159, -4k + a = 0. What is the remainder when 76 is divided by i? 35 Let d(w) = -13w - 3. Let u(p) = p3 - 30p*2 - 1542p + 330. What is the remainder when u(57) is divided by d(-3)? 15 Let a = 403 + -349. Let r = a - -87. Calculate the remainder when r is divided by 49. 43 Suppose 0 = -3c + 614 + 220. What is the remainder when c is divided by 77 - 0 - 305/61? 62 Let y = 2257 + -2240. Calculate the remainder when 59 is divided by y. 8 Let r = -72 + 75. Suppose f - 77 = -4m, -2m + rf = 30 - 79. What is the remainder when m is divided by 13? 7 Let b = 887 + 188. Calculate the remainder when b is divided by 77. 74 Suppose -6l = 3l - 81. Suppose lf = 10 + 89. Suppose 0 = -3b - 3i + 54, 3i + 5 - f = 0. Calculate the remainder when 60 is divided by b. 12 Suppose -41n - 110 = -42n - 4b, -3b - 264 = -2n. What is the remainder when 137 is divided by n? 11 Suppose 0 = g + 5h - 1793, 46g - 50g - 2h = -7136. What is the remainder when g is divided by 4? 3 Suppose 20 = 5i, d - 3d + 48 = 2i. Suppose 2j - 22 = d. Let k(y) = 54y + 6. What is the remainder when k(1) is divided by j? 18 Let p = -1830 - -1897. Calculate the remainder when p is divided by 56. 11 Let h(z) = -13z2 + z + 5. Let m(n) = 11n*2 - n - 5. Let a(u) = -6h(u) - 7m(u). Calculate the remainder when 326 is divided by a(6). 44 Let v be (-6)/(-21) - -365/7. Suppose -2w = 4b - v, -w + 3w - b = 1. What is the remainder when 6 is divided by w? 0 Suppose 2f - 5f = 9. Let w = -111 - -117. Calculate the remainder when (1 - -2)(-15)/f is divided by w. 3 Let w = -136531 + 136696. Let q = -30 + 86. Calculate the remainder when w is divided by q. 53 Suppose 123 = -19y + 18y. Calculate the remainder when 77 is divided by y/(-9)(4 + -1 - 0). 36 Calculate the remainder when (-213202)/(-484) + (-10)/(-4) is divided by 27. 11 Let m(r) = 39r - 574. What is the remainder when 534 is divided by m(16)? 34 Let h(z) = -3z - 32. Let w be h(-6). Let x = -18 - w. Let l(a) = -37a + 1. Calculate the remainder when l(x) is divided by 38. 35 Suppose 0 = -2d - 932 + 1100. Suppose 282 - d = 9s. Calculate the remainder when 39 is divided by s. 17 Let t(a) = -a*2 - 9a - 5. Let z be t(-1). Suppose -14l + zl = -1716. What is the remainder when l is divided by 23? 18 Suppose -15q + 59 = -1531. What is the remainder when 177 is divided by q? 71 Let s be 8 + (-12 - -3) + 8. Let n(f) = 32f - 75. Calculate the remainder when n(s) is divided by 30. 29 Let k(l) = -2l2 + 14323 - 7211 - 7168 + 31l. What is the remainder when 121 is divided by k(13)? 4 Suppose -111 = -4y + 201. Suppose -r = -4a - 45, -4r + 3 = -1. Let j = y + a. Calculate the remainder when j is divided by 10. 7 Let t = -5 - -2. Let j be (-23)/t + 19/57. Suppose r = -jr + 342. What is the remainder when 111 is divided by r? 35 Let x(r) = r*2 + 105r - 2465. Calculate the remainder when 385 is divided by x(20). 0 Suppose 4u = -q + 1420 + 3882, 5u = 4q + 6617. What is the remainder when u is divided by 17? 16 Suppose 6h + 44 = 422. Suppose 5d - 2f - 69 = 0, 6d - 10d - f + h = 0. What is the remainder when 15 is divided by d? 0 Suppose -5k + 0k - 3x = -1823, -360 = -k + 4x. Suppose o = 4o - 3r - 360, r + k = 3o. Calculate the remainder when o is divided by 62. 60 Let c = 6166 - 5477. What is the remainder when c is divided by 298? 93 Suppose -2o = -8, 3t + 4o - 328 = 6o. Let s = 150180 + -149950. What is the remainder when s is divided by t? 6 Let a = 6977 + -6965. Let d be 16/7 - (-2)/(-7). Suppose 3j = 2n + 110, 84 = dj - 6n + 2n. Calculate the remainder when j is divided by a. 10 Suppose 162j + 85j - 1702579 = 1383192. What is the remainder when j is divided by 147? 145 Let i(n) be the first derivative of 9n2/2 - 17n - 507. Suppose 3 = -4z + 19. What is the remainder when 35 is divided by i(z)? 16 Suppose 3k = 3l - l - 36, -90 = -5l + 4k. Let s = 29 + -96. Let w = -35 - s. What is the remainder when w is divided by l? 14 Let l be 6/(-15) + -27(-2)/10. Let a(b) = -11 + 6b2 - lb*2 - 2b + 14. What is the remainder when 53 is divided by a(-3)? 17 Let r(o) = -515o + 1510. Let n(b) = -47b + 137. Let d(c) = -45n(c) + 4r(c). What is the remainder when d(8) is divided by 6? 3 Suppose -3506 = -3v - 5r, -3v + 32r + 3521 = 34r. Calculate the remainder when v is divided by 118. 115 Let n = -6963 - -7262. Calculate the remainder when n is divided by 109. 81 Let b = 87 - 547. Let u = -415 - b. Calculate the remainder when 76 is divided by u. 31 Suppose 4s - 5h - 40 = -2h, 0 = -s - 2h + 10. Let f = -138 + 140. Suppose fy = sy - 360. What is the remainder when 177 is divided by y? 42 Suppose -62q = -57q - 195. Suppose w = 1 + 4. Let l = 15 - w. Calculate the remainder when q is divided by l. 9 Let u(q) = 6q + 14. Let i = 8 + -6. Suppose -4b = im - 2b - 18, -4b + 20 = 0. What is the remainder when u(m) is divided by 10? 8 Let c(a) = 31a - 269. Calculate the remainder when 501 is divided by c(11). 69 Let w(i) = -282i + 2224. Calculate the remainder when w(-89) is divided by 33. 31 Let y be (-56)/10 - (-544)/340. Let h(u) = u*3. Let k(o) = -7o3 + o2 + 3. Let q(z) = 6h(z) + k(z). What is the remainder when q(y) is divided by 14? 13 Suppose 8g + 2g = 230. Suppose -g = -3i - 2. What is the remainder when 113/5 - (-3 + (-72)/(-20)) is divided by i? 1 Suppose 4c = 3c - 2n - 10, -23 = 3c - n. Let v(j) = -j*3 - 6j*2 + 5j - 14. Calculate the remainder when v(c) is divided by 16. 10 Let z(u) = 151u + 317. Suppose -5i + 40 = -160. What is the remainder when z(0) is divided by i? 37 Let j(r) = 5r3 - r2 + r + 9. Suppose 24 = 5q - 61. Suppose 0 = qd - 12d - 15. Calculate the remainder when j(d) is divided by 36. 30 Let c(b) = b*3 + 19b*2 - 50b - 64. Let j = -111 + 90. What is the remainder when 321 is divided by c(j)? 9 Let a(g) = g*3 - 50g*2 + 51g - 97. Suppose 6o - 3o - 14 = 2l, 2l - 34 = -5o. Suppose -o = 2v - 4v. What is the remainder when v is divided by a(49)? 0 Let w(u) be the third derivative of -u5/60 - 17u*4/24 + 10u*3/3 + 4u*2 + 6u. Calculate the remainder when 323 is divided by w(-16). 35 Suppose 25m - 2696 = 29. Calculate the remainder when m is divided by 13 + (3 - 1) + -1. 11 Let p = -6 - -8. Suppose 3b - 37 = -3a - 10, 4b = 20. Calculate the remainder when a is divided by p. 0 Suppose 77d + 3066 = 91d. What is the remainder when d is divided by 77? 65 Let p = 336 - 196. Suppose -w - 13w = -p. Calculate the remainder when 257 is divided by w. 7 Suppose 252 = -3u + 3x, 5x - x + 8 = 0. Let v = -60 - u. What is the remainder when (-219)/(-6)(-5 - -7) is divided by v? 21 Suppose y + 19 = 3m, -4m + 2y + 30 = m. Suppose -4j - 101 = -8u + 5u, 4u - 113 = j. Calculate the remainder when u is divided by m. 3 Calculate the remainder when 86 is divided by (-20)/12 + (-5402)/(-111). 39 Suppose 3u - 5d - 67 = 0, 3u - d + 50 = 109. Let k(x) = 7x + 1. What is the remainder when u is divided by k(1)? 3 Let v(f) = 58f + 1. Let k(l) = -8l*3 - 9l - 439 + 7l3 - 8l2 + 447. Calculate the remainder when v(1) is divided by k(-7). 15 Let p(q) = -q2 + 5q + 41. Let s be p(9). Suppose -2b + 9 = -3f, -5b = sf - 2 - 8. What is the remainder when (6/5)/(30/675) is divided by b? 0 Let o = 340 + -321. Suppose -6h + 2h = -444. Calculate the remainder when h is divided by o. 16 Let v(h) = 7h*2 + 172h + 170. Calculate the remainder when v(-32) is divided by 34. 32 Let o = -1513 - -2312. Calculate the remainder when o is divided by 20. 19 Suppose -t = -j - 3 - 15, -3t + 4j = -59. Let d(z) = z*2 - 7z - 13. Let h be d(9). Suppose -hm + 138 = -2m. What is the remainder when m is divided by t? 7 Suppose -i + z + 221 + 5 = 0, -5i + 1130 = 2z. Suppose -5601	{ "pile_set_name": "DM Mathematics" }
aller: 10 or u? u Suppose -188y = -186y + 228. Which is bigger: y or -111? -111 Suppose 0 = 2z + 2o + 3 + 5, 2o + 14 = -5z. Let k be z/(-8) - 0/1. Do -7 and k have different values? True Let p be (-1)/(-2 - -6)-8. Suppose -2k - p = l, -26 = 3l - 0l - 4k. Let f be (-69)/9 + (-2)/(-3). Which is smaller: f or l? f Let j(z) = z3 + z2 - z - 2. Let h be j(0). Let u = -23 - -25. Suppose 10 - 14 = ug. Is g at most h? True Let x = 3 - 217. Which is smaller: -1/3 or x? x Suppose 5a - 119 = -2n - 2255, 436 = -a + 4n. Which is smaller: a or -427? a Suppose -3c - c + 8 = 0. Let r(f) = 3f - 31. Let p be r(11). Suppose d + 0d - 13 = -3z, -pz = -5d + 14. Is c less than or equal to z? True Suppose -620 = r - 2m, -888 - 1613 = 4r - m. Is r at most as big as -625? True Suppose -4n + 11 = -f, -3n - 1 = 3f - 28. Suppose -21 = -4o - 5b, 4o - b - b = -14. Is f bigger than o? True Let x = 1309 - 1591. Which is greater: -284 or x? x Suppose -4i - 2m = -2 - 24, -36 = -4i - 4m. Which is smaller: i or -7? -7 Suppose 5v - b = -80, -3v + 4b = 9b + 48. Is v less than 0.2? True Suppose 0y = 5y - 4i - 10, 5y - 10 = i. Let a(c) = c3 - 45c*2 - 47c + 46. Let x be a(46). Which is greater: x or y? y Let k be 81(-6 - (-28)/6 - -2). Is k <= 51? False Let p = 2679.851 + -2683. Let o = 0.149 + p. Let r = 0.05 + -4.05. Are o and r unequal? True Suppose 0 = -22z + 48z. Which is greater: 1/454 or z? 1/454 Let d(c) be the first derivative of c4/4 + 8c*3/3 - 3c*2/2 - 8c + 3. Let r be d(-8). Let j = 29 - r. Is j greater than or equal to 12? True Let w = 4 - 8. Let j be 6/2(w - -5). Suppose -5z + 40 = 4p - 11, jz = -p + 18. Is p bigger than 10? False Let u = 1 - 2. Let b = 0.25 - -0.09. Let c = -0.04 + b. Which is smaller: u or c? u Suppose 0 = 5r, o - 2r - 1 - 3 = 0. Let z be 3 + 5/20 + (-13)/4. Suppose -5k + 1 + o = z. Is k greater than or equal to 2/19? True Let p = 547782/235 - 2331. Is p at most 0? True Let t = 169648/154718535 - 2/82959. Is 0 greater than or equal to t? False Let t = 0.42 + -0.1. Let r = t + -0.22. Is -3 equal to r? False Suppose -64 = -8x - 8x. Which is bigger: x or -62? x Let u = -17 - -22. Let v be -7 + 3 + 40/u. Is 14/5 less than or equal to v? True Let o be 6(3 - 0 - 357/126). Let n = -24/23 + 1798/1679. Do n and o have the same value? False Let a = 34811/8188 - 3/2047. Let w = 8 + -4. Which is smaller: a or w? w Suppose -10 = 5l, -2l + 18 = 5z - l. Is 23 < z? False Let h be (-1 - (-3624)/75) + -3. Let l = h - 44. Which is greater: l or -1? l Suppose -9 - 21 = -l. Suppose -6 = 4t - 3w + 54, -2t = -w + l. Which is bigger: -13 or t? -13 Suppose -3n + 5 + 85 = 0. Let b be 32/n - 4/6. Which is smaller: b or -0.4? -0.4 Let k = 19 + 40. Let l = -777/13 + k. Is l > -1? True Let r(s) = -2s + 31. Let n be (4/6)/(10/180). Let g be r(n). Which is smaller: g or 3? 3 Suppose 78 = -5i + 18. Do i and -10 have different values? True Let x(n) = n3 - 6n*2 - 4n + 6. Let j be x(8). Suppose -20 - j = -2h - 5d, -h - 3d = -62. Let u be h/21(-2)/(-88). Are u and 0 unequal? True Let g = 21.8 + -22.8. Which is smaller: 303 or g? g Let a be (297/(-5) + 3)(-25)/10. Which is smaller: a or 139? 139 Let p = -1 + -1. Let l = -2301.1 - -2301. Is p at least l? False Let s be ((-110)/(-11) + -15)3/1227. Which is greater: s or -1? s Let z(r) = -16r + 112. Let t be z(7). Which is smaller: 1/88 or t? t Let v be (6 + -5 + 0)/(-951). Is v greater than 1? False Let y = -0.34 + -0.06. Let s = 1 + 1. Suppose n = 5z - 3, 0 = -sn - z - 3 + 8. Which is greater: y or n? n Let o be ((-32)/28)/((-47)/(-9) + -5). Are 1/4 and o non-equal? True Suppose 7z - 2z = 10. Suppose -z = -f - 10. Suppose 54k - 49k = -3g - 38, 2g = 3k. Is f < g? True Suppose -4p - 39 = -35. Which is greater: 10/47 or p? 10/47 Suppose -892 = -5l - 362. Suppose -3j - l = x, -3x - j - 530 = 2x. Are -106 and x nonequal? False Let a be (1 - -5)(-2)/(-4). Let y be ((-42)/(-12))/(3/(-48)). Let v = -51 - y. Is a less than v? True Let c be (43)/3 - 0. Let m(b) be the second derivative of b5/20 - 5b*4/12 + 2b3/3 + b2 + 9b. Let k be m(c). Which is smaller: k or 2/9? 2/9 Let l = -2.6 - 1.4. Let w = l - -13. Let n = w - 9. Is n bigger than 4/3? False Let a = 561 + -560.858. Is -1 at least as big as a? False Let c = 60248/13 + -4637. Let v = 216445 + -14069194/65. Let g = v - c. Which is greater: -3 or g? g Suppose 0 = -3w - 3t + 18, 0 = 5w - 7t + 6t. Suppose -4x + 20 = 0, -4d = 3x - 6x + 47. Is w less than d? False Let h = 3715/2 - 1856. Let q = -9.8 + 12. Let u = q + -2. Are u and h equal? False Let s = 1733 - 1803. Which is smaller: s or -72? -72 Let u(i) = -i*3 - 38i*2 - 68i + 147. Let a be u(-36). Let k = -4 - -7. Is k at least as big as a? True Let a = 7.645 + 2.345. Let k = 0.01 + a. Let i = k + -9.95. Which is smaller: i or 0.1? i Let k be ((-1)/68)/(6/(-425508)). Let r = k + -1043. Is -1 less than r? True Suppose -6h - g = -h + 18, -3h - g = 12. Which is smaller: h or -38/9? -38/9 Let k = -44.75 - -45. Let r = k - -0.35. Is r >= -5? True Let t be 69/115 + ((-26)/(-40) - -1). Is t at most 1? False Let s = -241 + 228. Is -10 at least as big as s? True Let t = -3 - -3.1. Let k = 0.3 - t. Let x = -5681.8 + 5682. Is k greater than or equal to x? True Let b = 9 + -6. Let d be (-18)/(-4) + -1 + (-13)/(-26). Which is smaller: d or b? b Let d be (8/252-1)/((-8)/20). Which is bigger: d or 0? d Let g = 22 + -27. Let f be (g - -12)(4/1 - 3). Let b(v) = v*2 + 4v + 6. Let m be b(-4). Which is smaller: m or f? m Suppose 0 = -2v + 7v - 15. Let g be v + (-25)/(-9) - 4. Which is bigger: g or 3? 3 Suppose 4n = -2g + 18 + 12, 2n - 10 = 0. Let y be 24(g + -2 + -2). Let c = y - 44. Is -20 at least c? True Suppose 0 = -0x - x. Suppose xy - 30 = y - 5f, -2y - f - 71 = 0. Let n be (2/(-20))/(14/y). Which is smaller: -6 or n? -6 Let t be 20/22 + 20/220. Is t bigger than 165/7? False Let n be (-68)/16(-3)/((-6)/(-8)). Let f = n + -1. Do f and 16 have the same value? True Suppose 0 = -27v + 16v + 16v. Let l = -40/19 + 1421/684. Is v <= l? False Let l = 202 - 141. Let q = -163/2 + l. Let b = q + 21. Which is smaller: 1 or b? b Let l = 2003 - 1980. Which is bigger: l or 155/7? l Let v be (1 + 5)/(224/160). Which is smaller: 13 or v? 13 Let o = 407.59 + -412. Let g = -4.4 - o. Let l be 1/5-3 - 0. Which is greater: l or g? g Suppose -15 = 5u, -5q - 10 + 1 = 3u. Let k be (-12)/(-56)(-2)/40. Let y = 79/56 + k. Is y greater than q? True Let q(s) = s*2 + 2s + 5. Let f be q(-4). Let u(c) = -c*2 - 200c + 10. Let z be u(0). Which is smaller: f or z? z Let p(g) = 4g - 147. Let t be p(-27). Is -254 < t? False Suppose m + 404 = 5m. Let c = m - 53. Let l be ((-10)/c)/(2/(-4)). Which is bigger: 0 or l? l Let c = 6.26 + -6. Let f = -1.933 + 0.193. Let r = f - c. Are -2 and r unequal? False Let c = 9 - 29. Let r(v) = -v*3 - 3v*2 - 2v + 1. Let g be r(-2). Which is bigger: g or c? g Let c(a) = -3a + 29. Let w be c(9). Suppose 5i - d - 5 - 9 = 0, -3i - d = -w. Which is smaller: 4/5 or i? 4/5 Let c = -4313/3 + 1437. Is -20 > c? False Let h = 856 + -5976/7. Suppose -5w = -4w - 14. Suppose 3k - 23 = 2l + 2l, 4k - 2l - w = 0. Which is smaller: h or k? k Suppose 14f + 3026 = -2924. Which is smaller: -426 or f? -426 Suppose 0 = -d - 5k - 7, 3d - 5k = -4k + 11. Is 17/7 greater than d? False Let k(m) = m3 - 6m*2 - 15m - 7. Let b be k(8). Suppose 0 = 2g - 4j + 12 - 0, 2j = 5g + 22. Let c be 0/2 + g/(-6). Is b at least c? True Let r be (-4 + 0)/(435/522 + (-2)/6). Suppose -3i = -3g, -6i + 2i = 2g - 12. Which is bigger: r or g? g Suppose 387 = -45t + 2t. Which is smaller: t or -3/5? t Let r = 52 + -73. Let c be 15/r + 2/(-7). Let o = 3711/10 + -371. Are c and o unequal? True Let v(g) = -g3 - 6g*2 + 7g + 4. Let a be v(-7). Suppose 5c + am - 30 = 0, 0c - 5m + 21 = -2*c. Let q = 469 - 5153/11. Which is bigger: c or q? c Let n = 328 + -332. Which is greater: 1/309 or n? 1/309 Let l be 155/(-225) - 28/(-35). Which is bigger: l or -0.18? l Let c = -45.5949 + -0.2451. Let d = c - -46. Is -1 greater than d? False Let i = -0.45 + 0.75. Is i smaller than 24? True Let l = 267 - 338. Is l != -71? False Suppose	{ "pile_set_name": "DM Mathematics" }
b(q). Calculate v(6). 0 Let q(o) = -o3 - o2 - 1. Suppose -2z = -4j - 3z - 17, 0 = 2z + 10. Let a(b) = -b - 3. Let p be a(j). Calculate q(p). -1 Let g(d) = -2d - 4. Suppose -3z - 30 = -2m - 5, 4z + 45 = 5m. Determine g(m). -14 Let o(v) = 7v*2 + v - 1. Suppose 3q - 42 = -3s + 4s, -4s - 3q - 123 = 0. Let j be (-18)/(-22) - 6/s. Determine o(j). 7 Let f(d) = 0d2 - 1 - 6d*2 - 2d + d. Calculate f(-1). -6 Let d = 24 + -7. Suppose -2u = -u + v + 2, v = 4u - d. Let p(s) = s*3 - 4s*2 + 3s + 1. Calculate p(u). 1 Suppose -2w = -5j - 0w + 36, -5j + 3w + 39 = 0. Suppose -2x - j = -4x. Let z(u) = -u2 - u + 2u*2 - 3u. Determine z(x). -3 Let g(h) be the second derivative of -h4/12 - h3/6 - h*2/2 - 2h. Let w be g(-1). Let x(p) = -8p3 + p. Determine x(w). 7 Let l(p) = 7p - 111p2 + 0 - 2 + 110p*2. What is l(3)? 10 Suppose -3 = 3i - 3a, 2 = 3i + 2a + 5. Let r(x) = 0x3 - x3 + 1 + 2x3 - x2. Calculate r(i). -1 Let h(j) = j2 + 8j + 8. Let u = -11 - -4. Let m be h(u). Let p(k) = -12k2. What is p(m)? -12 Let j = 2 + 0. Suppose -1 - j = m. Let b(t) = -t2 - 3t - 3. Determine b(m). -3 Let x be 32/2010/4. Suppose -2z + 2k - 3k = 0, -xk = 0. Let p(u) = -u + zu + 2u. Determine p(0). 0 Let w(i) = 7i*3. Suppose 3v = 2d + 3d - 8, -2d = -2. Give w(v). -7 Suppose 4y - 16 = -4a, 2a - 3 = a - 2y. Suppose d + 4 = ad. Let k(c) = -c - 2 + 0c + d + 0. Give k(-2). 1 Let t(r) = -r2 - 3r + 3. Suppose 0 = -2j + j + 2. Determine t(j). -7 Suppose -j = -5j - 4f + 8, 0 = 4j + f - 17. Let d(p) = -3 - 2p2 + 0 - 4p + 3p2. Give d(j). 2 Suppose 0 = 4k - 2k + 8, 5t + k = 16. Suppose q + 2 = t. Let a(i) = 0 + qi2 - 4 + 5 - 7i2. What is a(-1)? -4 Let p(m) be the second derivative of -m5/20 - m3/6 - m2 - 3m. What is p(0)? -2 Let c(i) be the third derivative of -3i6/40 + i5/30 - i*3/6 - 7i*2. Calculate c(1). -8 Suppose -6y = -y + 25, 20 = 2i - 2y. Let a(r) = r*3 - 6r*2 + 4r + 5. Determine a(i). 0 Let j(a) be the first derivative of -a3 - a2 - a - 17. Calculate j(-1). -2 Let u(o) = -3o + 1. Let h(v) = -4v. Let a(p) = 5h(p) - 6u(p). What is a(-4)? 2 Let j(a) be the first derivative of a5/20 + a4/3 - a*3/6 - 2a*2 - 2a + 3. Let r(i) be the first derivative of j(i). What is r(-4)? 0 Let q(u) = -7u - 3 + 10u*2 - 68u*3 + 67u3 - 5. Determine q(9). 10 Let j(x) = x3 - 5x2 + x. Suppose -o - 20 = -5c, -c + 2o + 28 = -3o. Suppose 2f + 19 = 5h, h = 2f - cf + 8. Give j(h). 5 Let m(h) = -3h - 1. Let x be m(0). Let g(s) = -5s2 - s - 1. Calculate g(x). -5 Let s(g) = -g3 - 5g2 + 3g - 6. Suppose 4r - 2 = -y, 0y = 2y - 3r + 18. Give s(y). 12 Let f be 4/(-10) - (-6)/(-10). Let z = -3 + 5. Let q(x) = x + x - 2x + 3x*z - 1. Determine q(f). 2 Let o be (25/(-10))/((-2)/4). Let q(t) = 26t - 13t - 15t + 1. What is q(o)? -9 Let s(f) = -1 + 25f2 + 3 + 4f - 23f2. Give s(-2). 2 Let s(y) be the third derivative of y4/24 + y3/3 - 10y*2. What is s(-6)? -4 Let u(r) = 3r - 3r + 0r + r. Let b(t) = -t*3 - 6t*2 - 4t + 1. Let h be b(-5). What is u(h)? -4 Let d be (-12)/(-9)(-9)/2. Let m(u) = 7u3 + u2 + 5u - 8. Let j(w) = -15w3 - w2 - 10w + 16. Let v(y) = -6j(y) - 13m(y). Calculate v(d). 2 Let p(g) be the third derivative of -g6/120 + g5/20 + 5g4/24 - g3/6 - g*2. Let k be (-3 - 1)(1 - 2). Give p(k). 3 Let j(i) be the second derivative of i*4/12 - 2i*3/3 + 2i*2 - 2i. Let b(n) = n*3 - 2n*2 + 4. Let g be b(2). Calculate j(g). 4 Let q(g) = 5g*3 + 6g2 + 7. Let n(w) = w3. Let o(b) = -4n(b) + q(b). Give o(-6). 7 Let y = 3 + 1. Let r = y + -7. Let p(n) = 5n*3 + 4n*2 - 3n - 6. Let q(z) = 4z3 + 3z*2 - 2z - 5. Let i(s) = -5p(s) + 6q(s). Give i(r). 0 Let f(m) = -m - 9. Suppose 0 = l + 2 - 7. Let s be 6 + 5 + 4/(-4). Suppose -3a = l + s. What is f(a)? -4 Let l(j) = -j3 + 10j*2 - 10j + 4. Suppose -25 - 47 = -8t. Determine l(t). -5 Let h(z) be the third derivative of -z5/10 - z4/24 - z3/3 + z2. Let k(y) be the first derivative of h(y). What is k(-1)? 11 Let l(v) = -v3 - 6v*2 + 1. Suppose 4p + 4n = -28, p + 3n - 4n = -5. Let x be l(p). Let m(b) = 4b*3 - 2b*2 + 2b - 1. What is m(x)? 3 Let l(c) = -2c + 5c2 - c - c2. Let k = -53 - -55. Calculate l(k). 10 Let l(p) = -212 + 212 - p3 + p2 + 0p3. Determine l(1). 0 Let c(d) = 3d2 - d - 9. Let v(z) = -z2 + z - 1. Let a(t) = -c(t) - 2v(t). Let m(w) = w3 - 2w + 1. Let j be m(1). What is a(j)? 11 Suppose 2c = -5j + 10, 5c + 4 = 3j + 29. Let s(o) = 2o - 4o + 4o - c + o. Let n(y) = y + 1. Let q be n(3). What is s(q)? 7 Let w(f) = -f3 - 6f*2 - 4f + 6. Suppose 0 = 9h - 7h + 6. Let b = -8 - h. Determine w(b). 1 Suppose -2i = 5t + 32, t - 2i + 9 = -5i. Let p(u) = -u*2 - 8u - 8. What is p(t)? 4 Let w(v) = -v*3 - 5v*2 - 5v - 2. Suppose 22 = -5z - o, 0 = -3o - 7 + 1. Determine w(z). 2 Let k(t) = 2t - 6. Let i = -11 - -31. Suppose 0x = -3p - 4x + 2, -i = -4p - x. Calculate k(p). 6 Let w(i) be the third derivative of i5/60 - 5i4/24 + i3/6 + i*2. Suppose 0 = -159l + 150l + 54. Give w(l). 7 Let y(p) be the third derivative of p4/12 - p3/6 - 15p2. What is y(-3)? -7 Let j(x) = -x3 + 13x2 + 2x - 18. Let y be j(13). Let d(g) = -3g + 25. Let c(m) = 2m - 17. Let i(q) = yc(q) + 5d(q). Determine i(0). -11 Suppose h + 3h - 2f = 16, 2h + 3f - 24 = 0. Suppose 2c = -3i - 7, 0 = -i - c - h + 5. Let o(v) = -v*2 - 5v - 1. Give o(i). -1 Let v(t) = -3 + 3t - 1 + 1 - 2t. Suppose 3n + 5l = 25, 16 = 4n - 0l - 2l. Give v(n). 2 Suppose 4z = -2b + 5z + 11, 5b + 5z - 35 = 0. Let w(q) = -5q - 1. Let s(a) = 12a + 2. Let t(k) = 2s(k) + 5w(k). Give t(b). -7 Suppose -2i + 36 = 2i. Let d(u) = -2u + 11. Give d(i). -7 Let l(o) = o. Let q = 0 - -5. Suppose 0 = 2y - qf - 7, -6f = y - 5f - 7. Let s(p) = 7p + 1. Let b(t) = yl(t) - s(t). Determine b(-4). 3 Let c(s) be the third derivative of -s6/120 + s5/12 - s4/8 - s3/3 - 7s*2. Determine c(5). -17 Suppose 4i + 5y + 1 = 0, 0y = -4i - 3y + 1. Let n be (-6)/(-2) + -2i. Let j(l) = -8l + n + 7l + 2l. What is j(-2)? -1 Suppose -6 = -0r - 2r. Let j be (-4)/(-8)(r - -1). Let i = 7 - j. Let c(f) = -f3 + 6f*2 - 3f - 4. Calculate c(i). 6 Suppose -2j + 5r = -34, 0j + j - 15 = 2r. Let w be 2/j - 46/14. Let n(o) = -3o + 0o + 13 + 2o - 10. What is n(w)? 6 Let d(s) be the third derivative of -s6/120 + s5/12 - s4/24 - s3/2 - 20s2. What is d(4)? 9 Let o(x) = x2 + 10x + 9. Let k be o(-8). Let y(a) = -6a*2 - 1. Let f(n) = -11n*2 - 2. Let q(v) = ky(v) + 4f(v). Give q(2). -9 Let x(z) be the third derivative of z5/60 + z4/6 - z3 + 7z*2. Let o = 9 + -14. Let y = o - 0. Determine x(y). -1 Suppose 2r = -3 - 5. Let u(w) = -2w2 - 12w - 3. Let y(j) = -2j2 - 11j - 2. Let v(s) = -6u(s) + 7y(s). Calculate v(r). -8 Let s be (-4)/2 + 4 + (0 - 0). Let k(a) be the first derivative of a*2/2 - 2a - 2. Calculate k(s). 0 Let j(m) = -2m + 1. Let y(z) = -z3 - 3z2 + 1. Let d be y(-1). Let b be j(d). Let q(a) be the second derivative of a3/3 + 3a2/2 - 2a. Calculate q(b). 9 Let t(r) = r*3 + 4r*2 - 5r + 3. Let y(p) = 2 - 2 + 1 - 3p. Let b be y(-4). Suppose 6 = -2j + w, 4j + b = 3w + 5. What is t(j)? 3 Let m(q) be the second derivative of -q7/2520 - q6/144 + 7q5/120 - 5q*4/12 - 4q. Let o(g) be the third derivative of m(g). What is o(-5)? 7 Let p(b) = -15b - 7b + 8b. What is p(1)? -14 Let w(v) = -v2 - 7v + 9. Let h(m) = -8m2 + 2m + 2. Let i be h(-1). Determine w(i). 1 Suppose 0 = u - 2u - 3n + 3, -4n = -5u - 42. Let f = -31 - -37. Let q(i) = -2 - 3i3 + 0i - 4 + 4i3 - fi + 5i2. Calculate q(u). -6 Let t = -2 - -2. Let k(x) = 7x*2 - 2x + tx2 + 3x - 1. Let i(v) = v*2 + 9v + 1. Let r be i(-9). Calculate k(r). 7 Suppose 2d + d + 12 = 0. Let w(j) = 6j2 + 5. Let b(g) = -g2 + g. Let h(v) = 5b(v) + w(v). Calculate h(d). 1 Let g(c) = -20c + 27c - 1 + 2 + 0c2 - c2. What is g(7)? 1 Let n(j) = 4j + 8j*2 - 2j*2 - 7j*2. Suppose -g + 5 = -3b, 5g - 18 - 7 = -2b. Determine n(g). -5 Let h be ((-12)/(-36))/(1/6).	{ "pile_set_name": "DM Mathematics" }
m of 64044, 256220, 576518, 1024938, 1601480? 64061y2 - 7y - 10 What is the o'th term of 277, 741, 1599, 3079, 5409, 8817? 38o3 - 31o*2 + 291o - 21 What is the r'th term of 1868, 325, -8024, -26581, -58748? -567r3 - r2 + 2429r + 7 What is the y'th term of 7142469, 7142468, 7142467? -y + 7142470 What is the b'th term of -41436428, -82872867, -124309314, -165745769, -207182232, -248618703? -4b2 - 41436427b + 3 What is the h'th term of -696609, -696818, -697149, -697596, -698153, -698814, -699573, -700424? h*3 - 67h*2 - 15h - 696528 What is the m'th term of -128032, -127983, -127944, -127921, -127920, -127947, -128008, -128109? -m3 + m2 + 53m - 128085 What is the j'th term of 434, 381, -230, -1399? -279j*2 + 784j - 71 What is the v'th term of -7112, -31567, -72334, -129419, -202828, -292567, -398642? -v*3 - 8150v*2 + 2v + 1037 What is the v'th term of 2555, 2698, 2921, 3212, 3559, 3950, 4373? -2v3 + 52v2 + v + 2504 What is the i'th term of 831073, 831091, 831111, 831133, 831157? i2 + 15i + 831057 What is the z'th term of 141108, 278008, 414910, 551814, 688720? z2 + 136897z + 4210 What is the i'th term of -10909, -24883, -62809, -136663, -258421, -440059, -693553, -1030879? -1996i3 - 2i - 8911 What is the s'th term of -5636699, -11273450, -16910201? -5636751s + 52 What is the j'th term of -333399, -1333389, -3000041, -5333355, -8333331? -333331j*2 + 3j - 71 What is the r'th term of 42121, 171273, 387457, 690673, 1080921? 43516r2 - 1396r + 1 What is the m'th term of 32064, 64107, 96150, 128193, 160236, 192279? 32043m + 21 What is the h'th term of 45494, 45859, 46228, 46601, 46978, 47359, 47744? 2h*2 + 359h + 45133 What is the y'th term of 343147, 343122, 343097, 343072? -25y + 343172 What is the d'th term of -80437, -154998, -229559, -304120, -378681? -74561d - 5876 What is the a'th term of -47683, -54671, -61659, -68647? -6988a - 40695 What is the b'th term of 52, -2650, -10236, -25148, -49828, -86718, -138260? -407b*3 + 147b + 312 What is the j'th term of 11610291, 11610288, 11610285, 11610282, 11610279, 11610276? -3j + 11610294 What is the t'th term of -537918, -537905, -537890, -537873, -537854, -537833? t2 + 10t - 537929 What is the o'th term of -1780, -39, 5230, 14027, 26352, 42205, 61586? 1764o2 - 3551o + 7 What is the i'th term of 5744, 5200, 4656, 4112, 3568, 3024? -544i + 6288 What is the z'th term of -43312935, -43312930, -43312925, -43312920? 5z - 43312940 What is the m'th term of 161138, 644940, 1451278, 2580152, 4031562? 161268m2 - 2m - 128 What is the a'th term of -55711, -55112, -54511, -53908, -53303, -52696? a*2 + 596a - 56308 What is the r'th term of -45, 66, 297, 690, 1287, 2130, 3261, 4722? 7r3 + 18r*2 + 8r - 78 What is the r'th term of 33607, 70373, 107139? 36766r - 3159 What is the p'th term of -20926, -20860, -20694, -20380, -19870, -19116, -18070? 8p*3 + 2p*2 + 4p - 20940 What is the m'th term of 12426, 23248, 34070, 44892, 55714? 10822m + 1604 What is the h'th term of 6325822, 6325817, 6325812, 6325807, 6325802? -5h + 6325827 What is the a'th term of -19031, -43699, -84803, -142337, -216295, -306671, -413459, -536653? a*3 - 8224a*2 - 3a - 10805 What is the c'th term of 3348, 3300, 3164, 2898, 2460, 1808? -7c3 - 2c*2 + 7c + 3350 What is the k'th term of -25843, -104145, -234641, -417325, -652191, -939233? k*3 - 26103k*2 + 259 What is the y'th term of -5877, -12078, -18941, -26796, -35973, -46802, -59613? -55y3 - y2 - 5813y - 8 What is the y'th term of -1757, -9201, -22371, -41267? -2863y*2 + 1145y - 39 What is the l'th term of 2674257, 2674281, 2674307, 2674335? l*2 + 21l + 2674235 What is the u'th term of 54249, 55282, 56313, 57342, 58369? -u*2 + 1036u + 53214 What is the g'th term of 4507, 36138, 122011, 289252, 564987, 976342? 4521g3 - 5g*2 - g - 8 What is the f'th term of 3593, 6602, 9619, 12644, 15677, 18718? 4f*2 + 2997f + 592 What is the n'th term of 18747, 37679, 56595, 75489, 94355, 113187, 131979? -n*3 - 2n*2 + 18945n - 195 What is the k'th term of -1016249785, -2032499570, -3048749355, -4064999140, -5081248925? -1016249785k What is the i'th term of -121159469, -242318943, -363478417, -484637891, -605797365? -121159474i + 5 What is the l'th term of 23943549, 23943550, 23943551, 23943552, 23943553? l + 23943548 What is the t'th term of -2507768, -5015537, -7523306, -10031075, -12538844, -15046613? -2507769t + 1 What is the l'th term of 384854, 384876, 384912, 384962, 385026, 385104? 7l*2 + l + 384846 What is the g'th term of 135806135, 271612270, 407418405, 543224540, 679030675, 814836810? 135806135g What is the c'th term of -9182, -16103, -23002, -29867, -36686, -43447? 2c3 - c2 - 6932c - 2251 What is the p'th term of -55455, -55388, -55333, -55290, -55259? -6p2 + 85p - 55534 What is the n'th term of -110, 605, 1782, 3409, 5474, 7965, 10870, 14177? -2n3 + 243n*2 - 351 What is the n'th term of -275627189, -275627196, -275627207, -275627222, -275627241, -275627264, -275627291? -2n*2 - n - 275627186 What is the u'th term of 120323770, 240647540, 360971310, 481295080? 120323770u What is the w'th term of -815439, -3261735, -7338859, -13046781, -20385471, -29354899, -39955035, -52185849? 5w3 - 815444w2 + w - 1 What is the g'th term of -55638, -111230, -166756, -222210, -277586, -332878, -388080, -443186? g3 + 27g2 - 55680g + 14 What is the v'th term of -396, -393, -336, -183, 108, 579, 1272, 2229? 7v3 - 15v*2 - v - 387 What is the s'th term of -9358, -76275, -257910, -611623, -1194774, -2064723, -3278830? -9560s3 + s2 + 201 What is the h'th term of 1535, 1919, 2237, 2489, 2675, 2795? -33h2 + 483h + 1085 What is the l'th term of -35135, -66618, -98101, -129584, -161067, -192550? -31483l - 3652 What is the l'th term of -7, 155, 431, 827, 1349, 2003, 2795, 3731? l3 + 51l*2 + 2l - 61 What is the o'th term of -92004, -367802, -827390, -1470768, -2297936? -91895o2 - 113o + 4 What is the m'th term of -24, -670, -2430, -5862, -11524, -19974, -31770, -47470? -93m3 + m2 + 2m + 66 What is the k'th term of -437500, -1749851, -3937054, -6999109? -437426k2 - 73k - 1 What is the q'th term of -1216909, -1216906, -1216903, -1216900? 3q - 1216912 What is the b'th term of 31173, 124802, 280841, 499284, 780125, 1123358, 1528977, 1996976? -b3 + 31211b*2 + 3b - 40 What is the y'th term of -6715504, -6715501, -6715498, -6715495, -6715492, -6715489? 3y - 6715507 What is the m'th term of -6832, -27424, -61742, -109786? -6863m*2 - 3m + 34 What is the u'th term of -3517066, -3517126, -3517190, -3517258, -3517330, -3517406, -3517486? -2u2 - 54u - 3517010 What is the v'th term of -9243800, -9243786, -9243786, -9243806, -9243852, -9243930, -9244046, -9244206? -v3 - v2 + 24v - 9243822 What is the p'th term of 78831, 78843, 78853, 78861, 78867, 78871? -p2 + 15p + 78817 What is the k'th term of 788, 3574, 8218, 14720, 23080? 929k2 - k - 140 What is the h'th term of 61888, 62033, 62178? 145h + 61743 What is the s'th term of 1900780, 1900787, 1900806, 1900843, 1900904? s*3 + 1900779 What is the d'th term of 2811890, 5623857, 8435824? 2811967d - 77 What is the r'th term of -7187591, -7187873, -7188167, -7188479, -7188815, -7189181, -7189583? -r*3 - 275r - 7187315 What is the k'th term of 6499049, 12998099, 19497149? 6499050k - 1 What is the s'th term of -5967, -5595, -4949, -4005, -2739? 4s*3 + 113s*2 + 5s - 6089 What is the w'th term of 1258, 11328, 38664, 91900, 179670, 310608, 493348? 1439w3 - w2 - 180 What is the q'th term of -6972, -55396, -186836, -442800, -864796, -1494332, -2372916? -6918q*3 + 2q - 56 What is the t'th term of -2155, -3818, -5541, -7330, -9191? -t*3 - 24t*2 - 1584t - 546 What is the d'th term of 19614637, 39229277, 58843917? 19614640d - 3 What is the q'th term of -25987464, -25987462, -25987460, -25987458, -25987456? 2q - 25987466 What is the v'th term of 14675526, 14675528, 14675530, 14675532, 14675534? 2v + 14675524 What is the x'th term of 656, 1856, 3934, 6890, 10724, 15436, 21026? 439x*2 - 117x + 334 What is the b'th term of -3432, -3492, -3550, -3606, -3660, -3712	{ "pile_set_name": "DM Mathematics" }
is the closest to 0.1? (a) -2/7 (b) 13/2 (c) 0.2 c Which is the closest to -0.15? (a) -2 (b) -0.7 (c) 0.2 c Which is the nearest to -19.9? (a) 1/3 (b) -5 (c) -0.4 b Which is the closest to -2/5? (a) -5 (b) 2 (c) -30 (d) 0.4 d Which is the closest to 0? (a) 4 (b) 0.4 (c) -0.5 (d) -11 b What is the nearest to -2/5 in 0.03, 0.2, -0.4, 0.4? -0.4 Which is the nearest to -0.1? (a) -7 (b) -0.2 (c) -0.1 (d) -2 c What is the closest to 0.5 in -3, 0.4, 3/4, 5? 0.4 What is the nearest to 1 in 75, -4, -5? -4 What is the nearest to 0.04 in 1/3, 0.4, -4? 1/3 What is the nearest to 0.5 in -5, 2/5, 0.1? 2/5 Which is the nearest to 6? (a) 1 (b) -5 (c) -1/3 (d) -1/8 a Which is the closest to -1/4? (a) -2 (b) -4 (c) -1/10 (d) -5 c What is the nearest to -1/4 in 3, -2, -1, 127? -1 What is the nearest to 3 in -15, 1/5, 2, 3? 3 What is the nearest to -0.1 in -0.1, 0, 5? -0.1 What is the nearest to -499/2 in 4, 0.2, 5? 0.2 Which is the closest to 0.2? (a) -0.2 (b) -2/15 (c) 8/5 (d) -5 b What is the nearest to 1/8 in 4, 0.17, 2/5? 0.17 What is the nearest to -2/5 in 4, -0.2, 0.2, 1? -0.2 What is the closest to 0.122 in 4/9, 0.2, 4? 0.2 What is the closest to 3/4 in 7, -2/9, 5, 0? 0 Which is the closest to 0? (a) 9 (b) 2/3 (c) 0.5 c What is the nearest to 1/10 in -1, -8/7, -2/13, 4? -2/13 What is the closest to 0.1 in -2, -2/7, 261/4? -2/7 Which is the closest to 0.3? (a) -840 (b) 0.5 (c) -1 (d) 2/11 d Which is the closest to -30/11? (a) -0.2 (b) -0.3 (c) -4 c Which is the closest to -1.9? (a) -3 (b) -55 (c) 3 a Which is the nearest to 2/3? (a) 0.03 (b) 1/2 (c) 2 (d) -4/5 b Which is the closest to -7? (a) 0.3 (b) 0.1 (c) -0.098 c What is the closest to 1 in 2/11, 0, -2.26? 2/11 Which is the nearest to 1? (a) -81 (b) 0 (c) -2/3 (d) -0.4 b Which is the nearest to -3/13? (a) 0.4 (b) 0.5 (c) 3 a What is the nearest to 4 in -1/6, 0, 9, -4? 0 Which is the nearest to -0.1? (a) 2/15 (b) 5 (c) -0.3 (d) 0.2 c What is the closest to -16 in 4, 2/7, 5, -3? -3 What is the closest to 2 in -0.5, -4, -6/5? -0.5 What is the closest to -1/2 in 1/3, -5, 0.04, -0.04? -0.04 What is the closest to 4/5 in 5, -7, 2? 2 Which is the closest to -2? (a) -10 (b) 0 (c) -2/11 c What is the nearest to 0.6 in 0.035, -4, 0.2, -0.4? 0.2 Which is the closest to 508? (a) -0.2 (b) -3/2 (c) -3 a What is the closest to -2/23 in -0.1, 4, -6? -0.1 Which is the nearest to 0? (a) -1.6 (b) -15 (c) -2 a Which is the nearest to 1? (a) 2/9 (b) 0 (c) -2/51 (d) -2 a Which is the closest to 2? (a) -2/9 (b) 4 (c) 5 b What is the closest to 1 in -5, -2/15, 2/3, -1/7? 2/3 Which is the nearest to 14.6? (a) 1/4 (b) 1/2 (c) 1 (d) 0.3 c What is the nearest to -1/14 in 5/4, -0.09, 0? -0.09 Which is the nearest to 0? (a) -3/7 (b) 3 (c) -1/6 c What is the nearest to -12 in -2/15, 0.3, 1, -0.1? -2/15 Which is the closest to 0.06? (a) -23/41 (b) 2 (c) 5 a Which is the nearest to 2? (a) 0.07 (b) -0.13 (c) 1/7 c What is the closest to 0.1 in 3, -5, 11? 3 What is the nearest to -128 in 2, 1/2, 2/9? 2/9 What is the closest to 0.2 in 0.2, -5, -3/8, 1/9? 0.2 What is the nearest to 0.1 in -1/3, 2/5, 210? 2/5 What is the nearest to 0.01 in -1, 2/7, -0.0163? -0.0163 Which is the closest to 0.04? (a) -1.1 (b) -2/11 (c) 4 b Which is the nearest to -248? (a) 0 (b) 0.3 (c) 0.2 a Which is the closest to -1? (a) 4/7 (b) 0.2 (c) -5 b Which is the closest to 5? (a) -2/13 (b) -0.1 (c) -2/7 (d) -0.21 b What is the nearest to -13 in 2, -2, 58/5? -2 What is the closest to 2/5 in -4, 3/13, -2/15? 3/13 Which is the nearest to -50? (a) 0.2 (b) 8 (c) 1/2 (d) 3 a Which is the closest to 1? (a) 1/5 (b) -3/7 (c) -8 a What is the closest to -17 in -3, -4, -0.08? -4 What is the closest to 2/5 in 28, -1, 2/3, 1/2? 1/2 Which is the nearest to -0.2? (a) -1 (b) -6/5 (c) 1 (d) 6 a What is the nearest to -1/5 in -10, -2/9, 5, -5? -2/9 What is the closest to -3/5 in -22, -0.2, -2/3? -2/3 Which is the closest to 1/70? (a) 1/3 (b) 2 (c) 1 a What is the closest to -0.3 in 4, 2/7, -5? 2/7 Which is the closest to 0? (a) 2/5 (b) 0.3 (c) -39 b What is the nearest to -6 in -5, 1/9, 0.3? -5 Which is the nearest to -2/45? (a) 0 (b) 2/19 (c) -3 a Which is the closest to 1? (a) -1/2 (b) 2/19 (c) 4 b What is the nearest to -1/3 in 3, -31, -50, 2? 2 What is the closest to 2/25 in 3/2, 0.4, -3, 2? 0.4 Which is the closest to 0.1? (a) -0.2 (b) 21 (c) 0 (d) -4 c Which is the closest to -106? (a) -2/11 (b) -1/6 (c) 1/6 (d) -4 d What is the nearest to -2/13 in 15, 3, -5, -6? 3 Which is the nearest to 1? (a) 2/3 (b) -2 (c) -449 (d) -0.2 a Which is the nearest to 0.2? (a) 2/5 (b) 1/5 (c) 0.1 (d) 0.5 b What is the nearest to 52 in -1, 1, -2/13? 1 What is the nearest to 106 in 0.8, 2/7, 0.3? 0.8 Which is the closest to -0.2? (a) 1 (b) -0.04 (c) -0.1 c What is the closest to 1 in 5, -3.5, 0.1? 0.1 What is the nearest to 0.1 in 2/9, -0.3, 2, -2? 2/9 What is the closest to 2/179 in 5, -0.2, -3? -0.2 Which is the closest to 4/7? (a) -0.1 (b) -1/4 (c) 6 (d) -2/3 a Which is the closest to 2? (a) -0.5 (b) 1.15 (c) -2/7 b Which is the nearest to 2? (a) 3 (b) -11 (c) 1.9 (d) -0.4 c What is the nearest to -0.06 in 3, 5, -4? 3 Which is the nearest to 0.1? (a) 1 (b) -1/23 (c) 0.4 b What is the nearest to 16/7 in 3, -3, -4? 3 What is the closest to 0.1 in 0.1, -4, -2/5, 0.4? 0.1 Which is the nearest to -1/3? (a) 8 (b) -0.4 (c) 2/3 b Which is the closest to 0.1? (a) -43 (b) 5 (c) -3 c What is the nearest to 0 in -0.021, -1, -12/11? -0.021 Which is the closest to 105? (a) -0.5 (b) 0.3 (c) -0.3 (d) 0.5 d Which is the closest to -13.5? (a) 0.4 (b) -3 (c) -5 c Which is the nearest to 14? (a) -1 (b) -0.3 (c) 5 (d) -5 c What is the closest to -4/5 in -0.1, 1, -5, 1/4? -0.1 Which is the closest to -0.3? (a) -0.4 (b) 1.2 (c) -4 a Which is the nearest to 0.1? (a) 4 (b) 33 (c) 0.3 c What is the nearest to 0 in -19, 0, -8? 0 Which is the nearest to -138? (a) -2/43 (b) -2 (c) -0.1 b What is the nearest to 1 in -1/12, 4, -1/3, 28? -1/12 What is the nearest to -0.1 in -5, -1, -954? -1 What is the closest to -2/5 in 0.4, -3/7, 2/9, 0.12? -3/7 What is the nearest to 0.3 in 0.1, -2, -3, 1? 0.1 What is the nearest to 2 in -27/8, -0.5, 3? 3 What is the closest to -8 in -2, -0.2, -11/3, -1/3? -11/3 Which is the closest to -1? (a) 0.03 (b) -47 (c) 2/7 a What is the closest to 1 in -2/13, -2, 2, 4/5? 4/5 Which is the closest to -0.1? (a) -0.4 (b) 20 (c) -156 a Which is the closest to 11? (a) 5 (b) -1 (c) 2/15 a Which is the nearest to 7? (a) -2 (b) -0.1 (c) -0.5 (d) -4 b Which is the closest to -219? (a) 3/2 (b) -5 (c) 1 b What is the closest to -3 in 1/2, -1, 0, -0.4? -1 What is the nearest to -2/7 in -0.4, -0.1, -1, 2/99? -0.4 What is the closest to -1/2 in 2/13, -1/22, 4? -1/22 What is the closest to -1 in -5, -160, -1? -1 Which is the nearest to -0.037? (a) 5 (b) 3 (c) 22 (d) 4/5 d What is the nearest to 10 in 6, 1, -4, 2/7? 6 Which is the closest to -1? (a) 0.5 (b) -18 (c) -2/5 c What is the nearest to 180 in 1, -3, 2/13, -0.04? 1 What is the nearest to 0 in 120, -3, -0.5, -1? -0.5 What is the closest to 1 in 1/7, -0.7, -0.5, 2/35? 1/7 What is the nearest to -0.13 in -0.5, 0, 3, 2? 0 What is the closest to 4/3 in -2, -1/4, -4/25? -4/25 Which is the closest to -4? (a) -5/3 (b) 3 (c) -1/2 a What is the closest to -9 in -3, -5/11, 0.5? -3 What is the closest to 0.2 in -2/23, -0.0441, 0.3? 0.3 What is the nearest to -0.631 in -2/9, 0.4, 1? -2/9 What is the nearest to 0.2 in 0, 2, -3, -1.5? 0 Which is the nearest to 0.9? (a) -1/4 (b) -9 (c) -1/5 (d) 0.4 d Which is the nearest to 5? (a) 0.4 (b) -0.3 (c) -1/4 (d) -87 a Which is the closest to -5? (a) 3 (b) -7 (c) -2 (d) 1/4 b What is the nearest to -15.7 in -2/5, -4/5, 3? -4/5 Which is the closest to -2/7? (a) 4 (b) -0.005 (c) 5 b Which is the nearest to 1/63? (a) 3 (b) 4 (c) 1/5 c Which is the nearest to -2? (a) 2 (b) -36 (c) -2 c What is the closest to 1/6 in 0.04, 4, 1/17? 1/17 Which is the nearest to 3? (a) -0.4 (b) -5 (c) -12 (d) 3 d Which is the nearest to 23? (a) -1/5 (b) -0.4 (c) -0.1 (d) 2/75 d Which is the closest to 2/7?	{ "pile_set_name": "DM Mathematics" }
13 - 4 + (-1 + 3 - 4)(-2 - 3 + 3) + 2 - 3 + 0)(0d + d + d) as i + fd and give f. 12 Express -86 + 2w2 - 6w + 86 in the form gw2 + xw + n and give g. 2 Rearrange -3y3 + 2y*3 - y + 3y*3 + 19y*3 + 2y2 + y4 to the form zy3 + gy*4 + x + wy*2 + sy and give s. -1 Express 2z + 0z*3 - 15 - 5z + 13 + 13z3 as nz*2 + yz*3 + i + lz and give l. -3 Rearrange 0r2 + 0r*2 + 3r*2 - 2r*2 - 4r*2 + 2r*2 - 3r*2 + 2r*2 + 2r*2 + (-4 + 2 + 3)(r2 + r2 - 4r2) to f + vr*2 + pr and give v. -2 Rearrange 4 + 5m3 - 4 + (0m - 4m - 2m)(0 + 0 - 2m2) - m3 + 3m - 3m to the form um + jm*3 + xm*2 + q and give q. 0 Rearrange ((4y + 0y - 5y)(3 - 4 + 0) + 0y + 2y - 4y)(11 + 9 - 8 + (2 + 4 - 4)(-2 - 2 + 5)) to the form d + vy and give v. -14 Express (-2 + 2 + a)(24 + 1201a - 1202a + 3) as h + xa2 + pa and give x. -1 Rearrange 2o4 + 1 - 23o*2 + 49o*2 + 2o - 28o2 + 2o*3 to y + qo + ko4 + co*2 + uo*3 and give k. 2 Express (-5f*3 + 3f*3 + 3f*3)(-1 + 1 + f) + (-2f + 2f*2 + 2f)(0f + f + f)(-4 - f + 4) in the form l + nf*4 + yf*3 + pf*2 + of and give n. -3 Express (2 + 0 - 4)(0 - 2k + 0)(k3 - 2k*3 - 3k*3) in the form i + rk*2 + ck*3 + zk*4 + ak and give z. -16 Express 7 - 2h - 7 as kh + n and give k. -2 Rearrange 2g3 + 5g*2 - 55 + 6g*2 - 3g*2 + 51 to the form ng + f + tg3 + og*2 and give o. 8 Express -4c*2 - 6 + 0 + 2c + 7 + (-3c + 0 + 0)(c - 2 + 2) in the form lc + f + ac2 and give l. 2 Rearrange -1 + g3 - 4 - 10g2 + 10g*2 to the form d + lg*3 + vg*2 + kg and give d. -5 Rearrange 0z - 3z - 4z + 0z to the form oz + r and give o. -7 Rearrange 16c*2 + 70 - 70 to the form qc*2 + xc + y and give y. 0 Rearrange (7 + 12 - 4)(-1 + 5 - 2)(0v + 0v + 2v3) to the form wv*3 + iv + d + bv2 and give w. 60 Rearrange (0 + 0 - t + (4t - 2t - 3t)(6 - 2 - 2) - t - t + t)(t - 2t + 6t) to the form vt2 + yt + n and give v. -20 Rearrange (-3 + 0 + 2)(0 - 3 + 2)((-3f2 - f2 + 3f*2)(40f - 164f + 58f) - f3 + 6f*3 - 4f*3) to the form sf + uf3 + mf*2 + i and give u. 67 Rearrange (-2v - 2 + 2)(-2 - 1 + 1)(-1 + v + 2 + 2) to c + lv2 + av and give a. 12 Rearrange 35t - 18t - 16t + 1 + 8 to k + ht and give k. 9 Rearrange 41u + 0 - 7 + 7 to the form z + hu and give h. 41 Express -x3 - x2 - 1 + x*3 + 2x*3 + 0x*4 - 2x*4 as sx + v + ax2 + nx*4 + dx*3 and give n. -2 Express (0r - r + 3r)(1272 - 1272 - r*2)(-r + 2r + 0r) as kr2 + l + pr*3 + fr*4 + vr and give l. 0 Rearrange -3 + 2 - 10w + 1 to yw + u and give y. -10 Express (8 + 2 - 4)(-4 + 5 - 2)(4 - 4 - 2v) in the form dv + a and give d. 12 Rearrange -5q3 - 2q*4 + 11q*3 - 2q - 2q3 to the form b + aq + oq2 + cq*3 + nq*4 and give n. -2 Express -7g - 5g3 - g2 - 1 + 3g + 4g as jg + yg3 + b + sg*2 and give y. -5 Rearrange -10b*2 - 3b + 9b2 + 0b + 0b - 2 + 3b*4 to the form y + lb + nb2 + jb*4 + tb*3 and give j. 3 Express (-15 - 4 - 1)(-4 + 4 - h*2) as ch*2 + v + xh and give c. 20 Express (-6 - 10 + 12)(3 - 8q - 3) in the form s + rq and give r. 32 Express 8 - 6 + 5i2 + i3 - 9 in the form ui + ai*2 + k + qi3 and give k. -7 Rearrange -q2 - 2q3 + 3q*2 + 4 - 7 to hq*3 + o + wq + fq2 and give o. -3 Rearrange k2 - 4k + 4k + (-1 + 1 + k)(2k - 3k + 2k) + 117 - 107 + 0k*2 - 3k*2 - 2k to hk2 + q + mk and give h. -1 Express 3t3 - 36t*4 + 17t*4 + 17t*4 - 1 as qt*3 + kt*4 + bt*2 + f + mt and give f. -1 Rearrange 9 - 3 - 7 + 3h2 - 2 - 2h*4 to yh*4 + m + oh + ah3 + uh*2 and give m. -3 Express (4 - 4 + 2)(c - 2 + 2) + (-2c + 0c - 2c)(1 + 2 - 4) + 15c + 13c - 31c + 2c - 1 + 1 + (-3 + 2 + 0)(2c + 2c - 3c) as d + kc and give k. 4 Rearrange -9q + 4q - 5q - 5q2 to the form v + yq*2 + bq and give y. -5 Express -13r3 + 2r + r*3 + 3r2 + r2 + 11r3 as fr*3 + o + ir + vr2 and give o. 0 Express x3 + x2 + 2x*2 + 4x2 + x3 as kx + qx*2 + dx*3 + f and give d. 2 Rearrange (-12 - 19 + 8)(w*2 - 37 + 37) to s + xw + vw2 and give v. -23 Rearrange 24i - 24i - 2i*2 - 16 to the form vi*2 + yi + g and give g. -16 Rearrange -4l3 + 3l*3 - 3l*2 - 8l*2 to the form k + zl*3 + dl*2 + hl and give z. -1 Rearrange (4p - 4p + 5p2)(0 - 5 + 6) + 6p + 7p*2 - 6p + 0p to the form np*2 + jp + v and give n. 12 Rearrange (-2m + 5m + m)(2m*2 + 2m - 2m)(0 + 3 - 2) to pm + dm*2 + z + xm*3 and give x. 8 Express (0 + 1 - 2)(148t - 78t - 179t) in the form d + at and give a. 109 Express -26b - 79b + 28b in the form j + lb and give l. -77 Rearrange -43x - 3x*2 - 4x*2 + 3x*2 + 44x + 2 to the form kx + rx*2 + c and give c. 2 Rearrange (-4 + 2z + 4 - z + z + z + 4z + 2z - 4z + (-3 + 3 - z)(2 + 2 - 5) + 0z + 3z - z)(-1 + 2 - 2 + (2 - 2 - 1)(-3 + 1 - 5)) to wz + g and give w. 48 Rearrange (2n + 117 - 96 - n)(-5n*2 + 3n2 + n2) to the form wn3 + rn + un2 + c and give w. -1 Rearrange 3n2 - n2 + 0n2 + (3n - 2n - 3n)(-3n + 2n - n) + (-2n + 2 - 2)(-n - 2n + 0n) to xn + zn2 + m and give z. 12 Express -2l3 - 2 + 2 + (-l2 - 2l2 + l2 + (0 + 2l + 0)(l - l - 3l))(13l - 25l + 14l) in the form rl2 + wl*3 + ol + k and give w. -18 Express -167 - c3 - c3 - 2c + 161 + c2 in the form zc*2 + vc*3 + fc + r and give z. 1 Express (-z - 4 + 3 + 4z)(7z - 5z - 9z)(4 - 5 - 1) in the form gz2 + rz + n and give g. 42 Rearrange 30g3 - 7g + 4g + 20 - 21 to s + pg*3 + vg + jg2 and give j. 0 Express 3l*3 + 7l - 4l2 - l3 - l - 4l in the form zl + ul*3 + w + bl*2 and give b. -4 Rearrange (0 + 2 + 4)(6w - 2w - 3w)(4 - 2w - 4) to the form cw*2 + v + rw and give c. -12 Rearrange (z*2 + 2z2 + z2)(-z - z + 0z) - 2z - 2z*3 + 3 - 3 + 4z*3 - 4z*3 - 2z*3 to the form wz + yz2 + qz*3 + f and give w. -2 Express 30i - 25i2 - 30i in the form h + mi + gi*2 and give m. 0 Rearrange -222 + 0x*2 + 3x2 - x2 + 35x3 + 220 to the form b + sx*2 + wx*3 + dx and give w. 35 Rearrange -7n + 2n - 12n to tn + y and give t. -17 Express 3q2 - 7q2 + q2 - q*2 - 7 as hq + cq2 + b and give b. -7 Express -1 - 2d - 2d4 + 120d2 - d3 - 120d2 as r + pd + bd2 + qd*3 + cd4 and give c. -2 Rearrange (h2 - 3h2 + 3h*2)(5h2 + 37 + 102 - 4h*2) to the form i + rh + wh4 + qh*2 + ah*3 and give w. 1 Express (5 + 6 + 2)(-2 + 2 + 1)(-9 + r + 9) as qr + h and give h. 0 Express -46d + 2d*2 - 26 + 13 + 13 as rd + q + ud2 and give r. -46 Rearrange 51z - 583 + 583 to the form r + sz and give s. 51 Express (-5 - 14 - 4)(3 + s - 2s - 2) as os + j and give o. 23 Rearrange 0f3 + f3 - 10f*2 + 6f*2 + (0f - 2f - f)(3f2 + f2 - 3f*2) - 3f3 + f3 + 0f3 to w + tf*2 + gf + af3 and give a. -4 Express 53m*2 + 4m*3 + 7m*3 - 49m*2 - 2m*3 - 2 in the form o + hm*3 + zm + ym2 and give o. -2 Express -4g + 0g + 0g*4 - 2g*4 + 24g*3 - 22g*3 in the form zg*2 + y + vg*3 + jg*4 + bg and give b. -4 Express (-13o3 + 0o*3 - 10o*3)(11 - 11 + o) in the form xo2 + io + po3 + co*4 + n and give c. -23 Rearrange -5z + 2 - 2 + (-2 + 2 - z)(-3 + 3 - 2) + (2z + 2z - 3z)(-4 + 0 + 3) to bz + o and give b. -4 Express -3d + 23d*3 - 24d*3 + 4d + d*2 + d in the form a + td + hd2 + qd*3 and give q. -1 Express 9t*2 + 7t*2 - 30 + 29 as kt + q + ut2 and give u. 16 Rearrange (0k - 7 + 4 - k)(2k + 2k - 6k) to the form ik + g + ak*2 and give a. 2 Rearrange (4m - 2m - 4m)(-1 + 3 - 3)(-2 + 3 + 0)(2m - m - 3m) to the form o + um*2 + sm and give u. -4 Express 5j - 12j + 6j as n + zj and give z. -1 Express (-t*3 + 4t*3 - 4t*3)((6t - 3t + 0t)(-1 + 7 - 2) - t + 4 - 4) as vt2 + rt + ut3 + ct*4 + x and give v. 0 Rearrange (-z + 4z - 2z)((0z2 - 2z*2 + 0z*2)(-3z + 5z - 4z) + 2 - 3z*3 - 2) to qz*4 + hz + iz2 + x + uz**3 a	{ "pile_set_name": "DM Mathematics" }
60c + 50 Let g(z) be the second derivative of -1/12z*4 + 26z + 0z3 + 0z*2 + 2. Let u(t) = 11t. Determine g(u(x)). -121x2 Let t(i) = -8i*2. Let z(w) = -18880331w. Determine t(z(v)). -2851735189356488v2 Let t(l) = -40l - 1. Let h(f) = -84844f. Determine t(h(y)). 3393760y - 1 Let j(t) = 2t - 2. Let i(y) = -14y*2 + 2y. Let w(p) = -i(p) + j(p). Let o(f) = -2f. Determine o(w(v)). -28v*2 + 4 Let r(w) = 6w*2. Let h(k) be the first derivative of 5k*3/3 - 31k + 2. Let z(m) be the first derivative of h(m). Give r(z(s)). 600s2 Let b(m) = -4m*2. Let x(y) be the first derivative of -150y*3 - 5 + 144y*3 - 2. Calculate x(b(d)). -288d*4 Let j(i) = -75231i - 8. Let y(s) = -71s2. What is j(y(b))? 5341401b*2 - 8 Let z(t) = -10461570t. Let v(k) = 2k2. Determine z(v(w)). -20923140w*2 Let k(n) = 2n*2. Let l be 520/104(-3)/(-5). Let d(q) be the first derivative of -11/3ql + 0q*2 + 0q + 15. Give k(d(r)). 242r4 Let k be (-6)/1642. Let s(d) = 17d*2 + 4d - 4. Let f(v) = -v*2 - v + 1. Let y(n) = ks(n) - 12f(n). Let q(h) = -2h*2. Calculate y(q(t)). -156t*4 Let c(y) = -405328y + 784. Let i(t) = -1553t + 3. Let z(x) = 3c(x) - 784i(x). Let q(v) = -3v*2. Determine q(z(b)). -7375872b*2 Let q(y) = -y - 129 + 0y + 127. Let z(a) = -16a - 24. Let x(j) = -12q(j) + z(j). Let h(d) = 18 - 18 - 10d. Calculate x(h(m)). 40m Let z(c) = 6c + 4c - 3c + 3c - 9c. Let u(a) be the second derivative of 68a*3/3 - 18a. Calculate u(z(f)). 136f Let o(a) = 285a*2. Let y(v) = -7v*2 + 14v - 2. Let q(w) = -10w2 + 21w - 3. Let n(u) = 2q(u) - 3y(u). Determine o(n(b)). 285b4 Let c be 50/12 + (119/42 - 3). Suppose -c + 0 = -2r. Let z(o) = 168o2 - 104o*2 - 90or. Let p(l) = -l2. Calculate p(z(u)). -676u4 Let v(z) = 36z + 20. Let r(i) be the first derivative of -i*2/2 - i - 6. Let j(b) = -60r(b) - 3v(b). Let u(w) = -2w*2. Calculate u(j(k)). -4608k*2 Let z(d) = -1170d + 23d2 - 1175d + 2344d. Let h(l) = 10l. Determine h(z(n)). 230n2 - 10n Let b(z) = -3z + 5590. Let r(o) = 835o - 1. Determine r(b(q)). -2505q + 4667649 Let l(a) = -2252a. Let b(z) be the third derivative of -z*5/20 - 5z*2 + 152z. What is b(l(m))? -15214512m2 Let y(c) be the second derivative of c3/6 + 8c*2 - 2c. Let u(r) be the third derivative of -r*5/60 - 7r*2 - 26r + 1. Give y(u(w)). -w*2 + 16 Let g(u) = 572u2 + u + 3. Let s(v) be the first derivative of v2 - 172. What is g(s(f))? 2288f2 + 2f + 3 Let j(x) = 127399x2 + 5x. Let g(f) = -2f2. Determine j(g(y)). 509596y*4 - 10y2 Let i(r) be the third derivative of r4/12 + 43r3/6 - 369r*2. Let a(j) = -j. Calculate i(a(k)). -2k + 43 Let b(t) = -t*2 + 2952 - 1492 - 1460. Let u(n) = -224n. Give b(u(d)). -50176d2 Let n(y) = -212y*2 - 2. Let l(w) = 3w*2 + 276. Let o(c) = -25c*2 - 2415. Let r(p) = -35l(p) - 4o(p). Calculate n(r(a)). -5300a*4 - 2 Let c(j) = 2j*2. Let n = -24 - -39. Let a = n + -13. Let h(m) = -13m*a + 34m*2 - 47m*2. What is h(c(s))? -104s*4 Let a(q) = 1175q - 1. Let u(l) = -18l2 + l - 1. Determine u(a(n)). -24851250n*2 + 43475n - 20 Let l(u) = 21u2 - 19u*2 + 8u*2 + 13u*2 + 23u2. Let t(h) be the third derivative of -h4/8 + 16h2. Calculate t(l(c)). -138c*2 Let p(q) = 3q*2. Let h(k) = 64k + 21k + 1008k. Give h(p(n)). 3279n2 Let o(b) = -6229b. Let v(f) = 2f2 - 1906539 + 1906539. Calculate o(v(l)). -12458l*2 Let x(k) = 178623k*2 + 669k - 669. Let h(f) = -2135f2 - 8f + 8. Let j(y) = -669h(y) - 8x(y). Let c(d) = d*2. Calculate c(j(m)). 447561m*4 Suppose 14m + 12290 = 16m. Let l(r) = -1 - mr + 5 + 6137r - 4. Let c(n) = 2n*2. Determine c(l(g)). 128g*2 Let f(d) = -2d + 5723. Let p(m) = -2913m2 + 2m. Determine f(p(g)). 5826g2 - 4g + 5723 Let o(i) be the first derivative of 5i2/2 - 31862. Let h(c) = 6c. Let q(t) = 15t. Let n(z) = -18h(z) + 6q(z). Determine o(n(l)). -90l Let o(a) = -44a2 - 48a + 10. Let h(v) = 15v2 + 15v - 3. Let z(x) = -16h(x) - 5o(x). Let u(n) = n. Calculate u(z(b)). -20b2 - 2 Let u(p) = 283p*2 - 570p*2 + 286p2. Let i(a) = a3 - 14a2 - 14a - 5. Let s be i(15). Let l(q) = 17q + 22q + sq. Calculate u(l(b)). -2401b*2 Let h(y) = -69y. Let p(k) = 3k2 + 21k - 20. Let t be p(-9). Let l(a) = -1 + 1 + ta - 32a. What is h(l(q))? -138q Let f(i) = -42i*2. Let x(h) = 179 + 10h - 387 + 208. Calculate x(f(s)). -420s2 Let z(m) be the third derivative of 0 - 1/12m*5 + 0m + 101m2 + 0m*3 + 0m*4. Let t(a) = 2a*2 - 3a + 3a. What is t(z(u))? 50u*4 Let r(w) = -13w + 2. Let j(s) = 582s2 + 278. Give r(j(f)). -7566f*2 - 3612 Let c(x) = 28x - 97. Let g be c(4). Let h(n) = -gn - 6n + 5n. Let t(o) = -6o. Give t(h(v)). 96v Let j(k) = 718 + 14k - 366 - 360. Let v(t) = -27t + 18. Let l(p) = 7j(p) + 3v(p). Let u(s) = 2s. Give u(l(i)). 34i - 4 Let c(o) = 2o*2 - 10o + 5. Let j(b) = -2b2 + 4b - 2. Let v(q) = -4c(q) - 10j(q). Let y(z) = -10z. Determine y(v(t)). -120t*2 Let k(r) = -9r*2. Let w(x) = 8 + 16x - 12 - 2x + 14x - 6x. Give k(w(l)). -4356l*2 + 1584l - 144 Let q(o) = -29o2. Let h(w) = -w - 3. Let i(s) be the second derivative of -s2/2 + 71s. Let a(v) = -4h(v) + 12i(v). Calculate a(q(t)). -116t2 Let j(b) be the second derivative of 49b + 3/2b3 + 0b*2 + 0. Let v(x) = -4 + x + 4. What is v(j(k))? 9k Let s(a) = a - 11. Let u(v) be the first derivative of -v*4/24 - 149v2 + 190. Let b(o) be the second derivative of u(o). What is s(b(k))? -k - 11 Let i(s) = s2. Let k(l) be the third derivative of -27713l4/24 - 16l*2 + 92. Calculate k(i(q)). -27713q*2 Let y(i) be the first derivative of 200i*3 - 3546. Let f(l) = -2l*2. Determine y(f(p)). 2400p*4 Let v(r) = 1766r*2. Let a(k) = 160k*2 - 200k + 50. Let u(s) = 13s2 - 16s + 4. Let o(m) = 4a(m) - 50u(m). What is v(o(d))? 176600d4 Let f(j) = 474j2 + 1. Let s(o) = o2 - 499659o + 499659o + 0o2. What is f(s(a))? 474a4 + 1 Let b(j) be the first derivative of -j3/3 - 7940. Let h(r) = -8r + 1 - 14r - 2. Give h(b(p)). 22p2 - 1 Let s(q) = -5q + 0q + 3q. Let m(h) be the second derivative of -5h3/3 + h2/2 - 18h + 523. Give s(m(x)). 20x - 2 Let s(k) = -151764k + 1. Let q(n) = n - 4. Calculate q(s(c)). -151764c - 3 Let g(m) = 16m + 2. Let x(v) be the second derivative of 13v4/12 + 787v. Give g(x(f)). 208f2 + 2 Let h(g) = -5405g*2 + 2736g*2 + 2676g2. Let s(c) = -c2 + 11c. What is s(h(p))? -49p*4 + 77p*2 Let j(r) = 147r. Let d(m) = -15m2 + 6130 - 6130. Give j(d(w)). -2205w2 Let x(t) = -t2. Let f(k) = -11450122k. Calculate f(x(s)). 11450122s*2 Let c(j) = -2j + 144. Let v(h) = -103h + 3. Give v(c(g)). 206g - 14829 Let q(r) be the first derivative of r*3/3 - 1. Let k be ((-1)/2 - 57/38)-2. Let u(w) = -kw2 + 8w*2 - 12w*2. Calculate q(u(n)). 64n4 Let k(d) be the third derivative of -d4/24 + 1432d2. Let y(x) = 2x*2 + 87x. Calculate k(y(b)). -2b2 - 87b Let i(t) = 109630t. Let n(a) = 3918a. Calculate i(n(c)). 429530340c Let x(d) = 4d + 7d + 156 - 157 + 0d. Let f(g) = -2g2. Calculate x(f(t)). -22t*2 - 1 Let q = -523 - -531. Let n(w) = -26w*2 + 12w. Let t(f) = 78f2 - 32f. Let y(j) = qn(j) + 3t(j). Let h(o) = -7o. What is y(h(z))? 1274z*2 Let s(h) = -6h*2 - 10h - 50. Let f(k) = 7k2 + 12k + 60. Let v(l) = -10f(l) - 12s(l). Let x(i) = -6363i. Determine x(v(m)). -12726m*2 Let v(s) = -2s. Let h(r) be the third derivative of -13r8/10080 + 14r*5/15 - 35r*2. Let w(o) be the third derivative of h(o). What is v(w(n))? 52n*2 Let n(h) = 13h. Let m(k) be the third derivative of -1/6k4 + 34k*2 - 2k + 0 + 0k3. What is n(m(p))? -52p Let a(i) = -7018857i. Let t(s) = -3s. Calculate t(a(w)). 21056571w Let q(w) = -748w*2 + 3 - 2 - 1727w + 1728w - 235w*2. Let c(l) = 2l*2. Determine q(c(u)). -3932u*4 + 2u*2 + 1 Let w(k) be the second derivative of 1/6k*3 - 2 - 2k + 0k2. Let h(v) = -135v. Give h(w(t)). -135t Let r(w) = 27w*2 + 12. Suppose -10k - 995 = -1005. Let l(j) = 3j - 3j + j*2 + 1. Let q(u) = kr(u	{ "pile_set_name": "DM Mathematics" }
t k = -1.2 - -0.7. Let p = 5 + -1. Sort k, p, 2/17 in decreasing order. p, 2/17, k Let l = 1.2 + -21.8. Let p = -21 - l. Put p, -3/2, -5 in decreasing order. p, -3/2, -5 Let v be 1/((-3)/2) - (-2 + 3). Put 0.4, 1, 1/2, v in decreasing order. 1, 1/2, 0.4, v Let i = -16.2 + 12. Let h = 4 + i. Let y = 9 - 5. Sort -5, y, h in descending order. y, h, -5 Let j = 1 + 1. Suppose -3 - 1 = jl. Put 2, -4, l in descending order. 2, l, -4 Let s(b) = b3 + 4b*2 + 3b + 1. Let c be s(-3). Sort c, 18, -2 in ascending order. -2, c, 18 Let w = -20.86 + 23. Let q = 0.14 - w. Sort 1/3, -2/11, q in decreasing order. 1/3, -2/11, q Suppose 3h - 4s - 75 = 0, -4h - 4s + 93 = h. Suppose -3j - h = 2o, o - 3j = -4j - 8. Put 2, o, 1/4 in descending order. 2, 1/4, o Let n(j) = -4j3 + 2j + 3. Let q be n(-1). Let b(r) = -r - 5. Let g be b(-4). Let v = g - -5. Sort v, q, 1 in descending order. q, v, 1 Suppose -3u - r = -5r, 0 = -4u + 5r + 1. Sort -5, -8, u. -8, -5, u Let j = -13 + 13.57. Let q = -0.17 + j. Let x = -0.3 - -0.4. Put q, 5, x in descending order. 5, q, x Let g = 16 - 17. Put g, -3, -0.2 in decreasing order. -0.2, g, -3 Suppose -3h - 18 + 27 = 0. Put 4, h, 0 in decreasing order. 4, h, 0 Let t = -98.2 + 98. Let b = 3.4 + -3. Sort t, b, -2/3. -2/3, t, b Suppose 4s - 24 = s. Sort s, 4, 0.1 in descending order. s, 4, 0.1 Let v be (-3)/12 - 1/(-2). Let h = 0.2 + -0.1. Sort -1, v, h in increasing order. -1, h, v Suppose 2t + 3t - 25 = 0. Let w be -8(-4 + (-27)/(-6)). Let j be (-16)/w - (-12)/(-3). Sort 4, j, t. j, 4, t Suppose -2k + 43 = 5u, -2u + 5k + 32 = u. Put u, 1, 4 in decreasing order. u, 4, 1 Let d = 18 - 17.86. Let p = 0.26 + d. Sort -2/5, p, 3 in ascending order. -2/5, p, 3 Let j(t) = -t2 + 10t - 11. Let n be j(9). Sort 3, -1, n in descending order. 3, -1, n Let d = -0.049 - -0.339. Let k = d + -0.59. Let t = -3 + 1. Put k, t, 0 in ascending order. t, k, 0 Let u = 15 - 16. Sort -0.5, -4, u in descending order. -0.5, u, -4 Let j be 2/(-28)4/1. Let g = 5 - 3. Suppose 0 = -3k - a - 9, -a - 11 = gk - 5. Put j, -0.2, k in decreasing order. -0.2, j, k Let y = -3.4 + 5.4. Sort y, -2, 0.3 in decreasing order. y, 0.3, -2 Let k(j) = -j3 - 9j*2 + 9j - 10. Let a be k(-10). Suppose 0 = 5f + 5 - a. Sort f, -2, 0. -2, f, 0 Let z be (-28)/(-6) - 2/(-6). Let r = z + -7. Sort r, -4, 0 in decreasing order. 0, r, -4 Suppose p + 2 = 13. Let j = p + -6. Let n(w) = 3w*2 + 2w - 1. Let a be n(1). Sort a, -1, j. -1, a, j Let a = 0.3 + 0. Let z = 22.5 - 16. Let t = 7 - z. Sort 1, t, a in decreasing order. 1, t, a Suppose -5 = -5t + 10. Put -4, -5, t in descending order. t, -4, -5 Let p be -1 + -1 + -1 + -1. Let f be 10/p - 3/6. Suppose 2o + 2o = -4. Sort f, o, 1. f, o, 1 Let y be (2 + -2)/(5 - 4). Sort -5, y, 0.2. -5, y, 0.2 Let f be 3638/(-126) + (-2)/6. Let t = f + 262/9. Sort 4, t, -2/5 in ascending order. -2/5, t, 4 Let x(l) = 3l - 1 + 3l2 + 0l3 + l3 + 2. Let p be x(-2). Suppose 4u = -3a + u - 6, 2u = 0. Sort p, -3, a in ascending order. -3, a, p Let d be 6/(-9)(7 - 1). Sort 0.4, 2, 3/2, d in descending order. 2, 3/2, 0.4, d Let p = 13.08 - -0.32. Let y = 13 - p. Let m = -0.3 - -2.3. Put y, -0.1, m in descending order. m, -0.1, y Suppose -3s + 8s - 20 = 0. Suppose 0j = -sj + 4. Put -4, 0, j in increasing order. -4, 0, j Let g = 25 - 28. Suppose -3a + 4b - 67 = 2a, a = b - 13. Let s be 6/5(-10)/a. Put g, s, -5 in increasing order. -5, g, s Let i be 8/(-40) - 26/(-5). Let n = -38 + 41. Put n, -1, i in descending order. i, n, -1 Let j = -0.1 - -1.1. Put -1, -3/5, j in decreasing order. j, -3/5, -1 Let f(z) = 2z - 29. Let o be f(13). Let p be (-2)/(-3)(-3 + 15). Suppose 2w + u = 12, -p = -4w + u + 10. Sort -5, o, w in ascending order. -5, o, w Let s(q) = 3q2 + q. Let r be s(-1). Let k(u) = 2u*2 - 3u - 3. Let f be k(3). Suppose -11 = 2w - 3d, 0d + rd = f. Put 0, 1, w in increasing order. w, 0, 1 Let l = 223 - 2005/9. Put 0, 0.1, l in descending order. l, 0.1, 0 Let s(b) = 2b2 - b - 2. Let j be s(2). Let z = -2 + j. Let w(o) = -o3 - 3o*2 - o - 1. Let u be w(-2). Put z, -1, u in descending order. z, -1, u Let r = -0.004 - -0.104. Let u = -0.2 + 0.2. Sort -3, r, u. -3, u, r Suppose -2n + 4n - 6 = 0. Put -1, n, 1/4 in ascending order. -1, 1/4, n Let y be (0 + 2)(6 - 3)/3. Put y, -4, 5, 0 in decreasing order. 5, y, 0, -4 Let o = -1 + -7. Let q = -7 - o. Sort q, 3, -0.4 in decreasing order. 3, q, -0.4 Let p = -0.1 + -0.9. Let a = 7 + -4. Let i = 1 - -1. Put i, a, p in increasing order. p, i, a Let w = 0.2 - -0.2. Let x = -0.5 + w. Let u = 0.5 + x. Sort 2/11, u, -0.3. -0.3, 2/11, u Let m = -1 - 2. Let h = -3.04 - m. Let w = h - 0.26. Put -5/4, w, 4 in increasing order. -5/4, w, 4 Let m be 4220/(-26)(-4)/8. Let f = m - 81. Put -4, f, 1 in increasing order. -4, f, 1 Let n = -2.7 - 6.3. Sort n, -3/4, -1, -4 in descending order. -3/4, -1, -4, n Let s = -101/2 + 699/14. Sort s, -0.4, -1/5 in descending order. -1/5, -0.4, s Suppose 218 = -7w + 85. Put 4, -1, -3, w in descending order. 4, -1, -3, w Let y be (1/(-6))/((-4)/18). Let v be 3 + 26/22 + -4. Put y, v, 2/9 in descending order. y, 2/9, v Suppose -2l - c + 38 = 0, -4l + 4c = c - 66. Suppose -4b - 2 = -l. Sort b, -4, 3. -4, 3, b Let w = -10 - -6. Let u = 0.08 - 5.08. Sort -0.2, w, u. u, w, -0.2 Let t be 5/(-2)(-6)/(-3). Suppose 58 - 61 = -3p. Sort 5, t, p. t, p, 5 Suppose 3 = 3z + 4h + 1, 0 = z + 5h - 8. Sort -71, -5, z. -71, -5, z Suppose -2r - 3 = -3r. Suppose 5f + r - 44 = 4j, 2f = -j + 6. Let b(q) = q*2 + 3q - 13. Let i be b(-6). Put -3, i, j in ascending order. j, -3, i Let u be 10/35 + 26/7. Let n = -7 + 12. Put n, -1, u in increasing order. -1, u, n Let b be (-1)/((140/8)/5 + 0). Let t = 2.4 + -2. Sort b, t, 2 in ascending order. b, t, 2 Suppose 0 + 5 = w. Let a(s) = s*3 - 4s*2 - 5s + 3. Let d be a(w). Suppose -u = -dr - 4 + 1, 4u + 5r + 5 = 0. Sort 3, u, 1. u, 1, 3 Let y be 22/(-121) - (-18)/(-22). Sort 0, 5, y in descending order. 5, 0, y Suppose 5b = x - 4, 0x = -x - 3b - 4. Let n be x - ((-2)/2)/(-3). Let a = -5 - -3. Sort a, n, -3/8 in ascending order. a, n, -3/8 Let q = -1.4 + 1.7. Let k = 0.3 - 0.2. Sort 0.5, k, q. k, q, 0.5 Suppose 0 = 6r + 30. Let j be 1/(-3) - 8/3. Sort j, 3, r in ascending order. r, j, 3 Let i = 2.8 - 3. Let s = 0.3 - -0.3. Let c = 3.4 + s. Put c, i, 0 in ascending order. i, 0, c Suppose f + 4n - 5 = 0, 0 = 2f - f + 3n - 3. Put 1, 3, f in decreasing order. 3, 1, f Let z be 2(-1)/(-2) + -4. Let h(l) = l2 + 8l + 7. Let w be h(-7). Suppose i - 3k + wk = -15, -5i + k = 5. Sort -1, z, i. z, -1, i Let i = 5 + -3. Suppose -im - 2 = -0m. Let t = m + 1. Put t, 3, -1 in descending order. 3, t, -1 Let h(y) = 2y*2 - 6y + 4. Let w be 2/7 - (-78)/21. Let n be h(w). Suppose -5x = -2x + n. Put x, -4/5, -0.1 in descending order. -0.1, -4/5, x Suppose -9n + 16 = -29. Sort 1, n, 9 in descending order. 9, n, 1 Suppose -16 + 26 = 2j. Sort j, -5, 0.04, 2/5 in ascending order. -5, 0.04, 2/5, j Let o = -10 + 6. Let n be 8/(-4) + 1/1. Suppose 5y - 2s - s - 37 = 0, 5y - 21 = -s. Put n, o, y in increasing order. o, n, y Suppose 5y = -3n - 8, n + 0y - 8 = y. Suppose 2q + r = n, 0 = 3q + r - 0 - 8. Sort -9, q, 1. -9, 1, q Let q = -0.4 + -0.5. Let j = q + 1.9. Sort -2, -4, j in increasing order. -4, -2, j Let r = 4 - 5. Suppose 8j + 0j = 40. Sort r, -4, j. -4, r, j Let t = 2/57 + -175/114. Sort -4, 0.1, t in ascending order. -4, t, 0.1 Let l = -3 + 9. Let f = 21.5 + -21.1. Sort l, 1/3, f in decreasing order. l, f, 1/3 Suppose 4 = 5w + 19. Suppose -3f = 7 - 19. Let h(r) = r*3 - 4r*2 + 2r - 5. Let p be h(f). Sort -2, w, p in decreasing order. p, -2, w Let b = 3 - 2.99. Let z = b - -0.19. Let t = z - -0.3. Put 0.3, 3, t in decreasing order. 3, t, 0.3 Let t = -38 - -42. Sort 0, 0.2, t, -0.3 in descending order. t, 0.2, 0, -0.3 Suppose 8 = -15l - 7. Put -5, 19, l in decreasing order. 19, l, -5 Let s be 26/(-8)2. Let q be 7 + -4 + 1 + -11. Let w = -12 - q. Sort -4, s, w in ascending order. w, -4, s Let y = 54 + -57. Sort 3, y, -2 in increasing order. y, -2, 3 Suppose 4t + t - 13 = k, 0 = -4k - 2t - 8. Let v = -2 + -3. Sort k, v, 4. v, k, 4 Let s = -2.3 - -1.8. Sort s, -4, 4 in incre	{ "pile_set_name": "DM Mathematics" }
g order. 699, 10, 0.4, 0.12 Sort -0.2, -0.07013, 2/5, -0.086 in increasing order. -0.2, -0.086, -0.07013, 2/5 Put 12314, 5, -2, 99 in increasing order. -2, 5, 99, 12314 Sort 7, -24, 17, -78 in decreasing order. 17, 7, -24, -78 Put -1/9, -286, -19, -1/30, 1 in ascending order. -286, -19, -1/9, -1/30, 1 Sort 3, -5, 4, 33308149 in increasing order. -5, 3, 4, 33308149 Put -6/25, -1/27, 0, 7.5 in decreasing order. 7.5, 0, -1/27, -6/25 Sort 2, -10, 1, -521725, -2 in increasing order. -521725, -10, -2, 1, 2 Sort -40/17, 4, -202198 in descending order. 4, -40/17, -202198 Sort 387, -0.33, 3/361 in increasing order. -0.33, 3/361, 387 Sort -0.223, 3, -1, -1/2, -2/5 in decreasing order. 3, -0.223, -2/5, -1/2, -1 Sort 5, 14, 659, -542 in decreasing order. 659, 14, 5, -542 Put 213, 4, -388, -1 in increasing order. -388, -1, 4, 213 Put 2, 12, -144, 1, 9, -22 in ascending order. -144, -22, 1, 2, 9, 12 Sort 1/179, -3/5, -38433 in increasing order. -38433, -3/5, 1/179 Put -1294, 21370, 5 in descending order. 21370, 5, -1294 Sort -2, 2, -23, 0, -1754, -8, -3. -1754, -23, -8, -3, -2, 0, 2 Sort 62.6, 2, 5, -3, 7, -0.2, 23 in decreasing order. 62.6, 23, 7, 5, 2, -0.2, -3 Sort 129, -7, -2, -16, -1369, 2 in ascending order. -1369, -16, -7, -2, 2, 129 Put 1/34, 5, -4, -1, -12/115 in descending order. 5, 1/34, -12/115, -1, -4 Sort 6399, 3, 9, 1033. 3, 9, 1033, 6399 Put 11, -5, 1, -2965, -1, 0 in descending order. 11, 1, 0, -1, -5, -2965 Sort 9, 4, 429, 1137. 4, 9, 429, 1137 Put -3, -4, 6, -1, 3, 966 in increasing order. -4, -3, -1, 3, 6, 966 Put 1/24, 445, 4, -1.107, 0.2 in decreasing order. 445, 4, 0.2, 1/24, -1.107 Sort 3, -1482415, 1 in descending order. 3, 1, -1482415 Sort -213, -1, -98.4, 1. -213, -98.4, -1, 1 Put -10, -11, 55, -2, 1, 73, 3 in decreasing order. 73, 55, 3, 1, -2, -10, -11 Put -0.08, 2/15, 1382 in increasing order. -0.08, 2/15, 1382 Sort -2/3, 3994, 1.8, 0.09, 2/9 in descending order. 3994, 1.8, 2/9, 0.09, -2/3 Sort 3/5, 4/31, 0.33, 2 in descending order. 2, 3/5, 0.33, 4/31 Put 2, 4, -2/15, 10, 66.63, -3 in increasing order. -3, -2/15, 2, 4, 10, 66.63 Put 435494.02, 0.1, -2 in decreasing order. 435494.02, 0.1, -2 Sort -1, -52, 55, -4, 3, -10, -11. -52, -11, -10, -4, -1, 3, 55 Sort -1, -102, 1, -2, 9, -71 in descending order. 9, 1, -1, -2, -71, -102 Put 4, -2, 0, -10, 219, -4, 2 in descending order. 219, 4, 2, 0, -2, -4, -10 Sort 519, -3027, -1, -2/5 in decreasing order. 519, -2/5, -1, -3027 Sort -16, 4, -4, -281, 1, 5 in increasing order. -281, -16, -4, 1, 4, 5 Sort 0.0025, -0.36, -227, -2 in decreasing order. 0.0025, -0.36, -2, -227 Put 5, -3, -6, -175880, -5 in increasing order. -175880, -6, -5, -3, 5 Put 301, 12, -5, -7, -111 in descending order. 301, 12, -5, -7, -111 Put 3, -216498, 1, 2 in decreasing order. 3, 2, 1, -216498 Put 0.1, -21859, 241 in increasing order. -21859, 0.1, 241 Sort -6, 299, 384, 0 in decreasing order. 384, 299, 0, -6 Sort -35, -20, 667, 6, 0 in ascending order. -35, -20, 0, 6, 667 Sort -21, -42290, 1/3, -25 in descending order. 1/3, -21, -25, -42290 Put 0.12, -5, 2/13, -8068, -1, -24 in increasing order. -8068, -24, -5, -1, 0.12, 2/13 Put 143, 15, 2, -101 in decreasing order. 143, 15, 2, -101 Put 3/8, 347, 8875 in decreasing order. 8875, 347, 3/8 Put -1/2, -5, -6/11, -34332 in descending order. -1/2, -6/11, -5, -34332 Sort 0.1, 6/17, 281021 in increasing order. 0.1, 6/17, 281021 Put 2, 9, -1/8, -0.19, 8058/11 in descending order. 8058/11, 9, 2, -1/8, -0.19 Put -0.7, 1/2, -572, -555, 0, 6 in decreasing order. 6, 1/2, 0, -0.7, -555, -572 Sort 16, 181, -2, -4, 0, 1 in increasing order. -4, -2, 0, 1, 16, 181 Put -3, 0.3, 353378155 in decreasing order. 353378155, 0.3, -3 Sort -6, -0.5, -1/8, 1/8, -38, 1/23 in decreasing order. 1/8, 1/23, -1/8, -0.5, -6, -38 Sort -9499, 0, -48, 5. -9499, -48, 0, 5 Put -37, 171, 32, -10 in descending order. 171, 32, -10, -37 Sort 0, -3084374, 2, -4, -2, 1 in ascending order. -3084374, -4, -2, 0, 1, 2 Sort -4, -3005, 3, 4, 137. -3005, -4, 3, 4, 137 Sort 22, 0, 166, 2, -2 in ascending order. -2, 0, 2, 22, 166 Sort -3469, -2, 24, -5. -3469, -5, -2, 24 Sort 3, -5, 1, 5, -1, -1262, 4 in ascending order. -1262, -5, -1, 1, 3, 4, 5 Put -802, 4, -40, 50, 0 in ascending order. -802, -40, 0, 4, 50 Put -5, -0.1, -2/27, 0.1904 in decreasing order. 0.1904, -2/27, -0.1, -5 Sort 5, -11187, -0.5, 1, -5, 2, -41 in decreasing order. 5, 2, 1, -0.5, -5, -41, -11187 Put 206203, 157, 3, -4, -5 in ascending order. -5, -4, 3, 157, 206203 Put -3, 205421, -11 in descending order. 205421, -3, -11 Put -107, -5, -1, 8, -18, 31, 3 in increasing order. -107, -18, -5, -1, 3, 8, 31 Sort -44, 33, 1/3, -1/27, 0.3 in increasing order. -44, -1/27, 0.3, 1/3, 33 Sort 0.5, -1, 16/7, 9458, -3. -3, -1, 0.5, 16/7, 9458 Put 2, -446, -8, -1, -6, -17 in decreasing order. 2, -1, -6, -8, -17, -446 Sort 1.43, 0.2, 6, 2854. 0.2, 1.43, 6, 2854 Put 29/46, 5, -2/9, 5/2 in descending order. 5, 5/2, 29/46, -2/9 Sort 0, -0.4, 0.2, 1, 65, 23, 28 in increasing order. -0.4, 0, 0.2, 1, 23, 28, 65 Sort -1, 3, -10, -78995, 1. -78995, -10, -1, 1, 3 Put 31490, -0.1, 88/3 in descending order. 31490, 88/3, -0.1 Put -49, -4, -6, -2, -1, 1, 2449 in increasing order. -49, -6, -4, -2, -1, 1, 2449 Put 82, 5, -5, -71, 3, 0, -3 in ascending order. -71, -5, -3, 0, 3, 5, 82 Sort 197, 0, -8161, 1, 9, 2 in increasing order. -8161, 0, 1, 2, 9, 197 Sort -79, 5, 780, 43 in increasing order. -79, 5, 43, 780 Put -2, 810504, -29 in decreasing order. 810504, -2, -29 Sort 242212, 0, 1, -5, -3. -5, -3, 0, 1, 242212 Sort 4/3, -1/2, -7911/23 in descending order. 4/3, -1/2, -7911/23 Put 6, -5, -2, -286, -1, 4 in descending order. 6, 4, -1, -2, -5, -286 Sort 418, -1, -244, -30, 5. -244, -30, -1, 5, 418 Sort -5, 0, 4, 18630 in ascending order. -5, 0, 4, 18630 Put -142184, -23, -5 in increasing order. -142184, -23, -5 Put -3, -456, 0.1, 0.3, -1/283 in descending order. 0.3, 0.1, -1/283, -3, -456 Sort -3, 3, -60947, 17, 4 in ascending order. -60947, -3, 3, 4, 17 Sort 10, -10, 197, -0.7. -10, -0.7, 10, 197 Put -1, 17, 9, 66, 64 in increasing order. -1, 9, 17, 64, 66 Sort -6, 0.5, 7, 4, 539 in ascending order. -6, 0.5, 4, 7, 539 Sort 0.8, 6, 4, 1/183, 14 in descending order. 14, 6, 4, 0.8, 1/183 Sort -3, 1, -49, -12, 50, 3, -4 in descending order. 50, 3, 1, -3, -4, -12, -49 Sort -10, -23, -5, 9915 in increasing order. -23, -10, -5, 9915 Sort 0.0765, -1, -239 in descending order. 0.0765, -1, -239 Put 5, -5, 35458, 136 in decreasing order. 35458, 136, 5, -5 Sort 99, -4/736159, -0.3 in decreasing order. 99, -4/736159, -0.3 Put 1, -1, -27021 in decreasing order. 1, -1, -27021 Put 2669, 3, 2/5, 3747 in decreasing order. 3747, 2669, 3, 2/5 Put 23/32, -1.7, -4 in increasing order. -4, -1.7, 23/32 Put -4, 5, -5, -1, 4420626 in ascending order. -5, -4, -1, 5, 4420626 Put -11, -15, -1046, -1, 1 in increasing order. -1046, -15, -11, -1, 1 Put 0.3, 86, 0.036, 0, 2/3, -3 in decreasing order. 86, 2/3, 0.3, 0.036, 0, -3 Sort 2, -5, 2906, 4, 5, 36 in increasing order. -5, 2, 4, 5, 36, 2906 Sort 142, 3, -15, -1, 4, -13 in ascending order. -15, -13, -1, 3, 4, 142 Sort 2232, 329, -62. -62, 329, 2232 Put -41, 1, 5, 1639695 in decreasing order. 1639695, 5, 1, -41 Sort 4, -5, 0, -26067391 in decreasing order. 4, 0, -5, -26067391 Put 3, -2, -3, 29, 4, -4, 462 in decreasing order. 462, 29, 4, 3, -2, -3, -4 Put -598, -4133, -12 in ascending order. -4133, -598, -12 Sort 20885, -5, 10, -1 in descending order. 20885, 10, -1, -5 Sort -3, 8, 4, 223, 3 in descending order. 223, 8, 4, 3, -3 Sort -3/14, -1, -3, -1/2, -33388. -33388, -3, -1, -1/2, -3/14 Sort 8, 5, 0, 1, 3, -2301, -3 in decreasing order. 8, 5, 3, 1, 0, -3, -2301 Put 2/11, 3, -0.2, -3, 18/4967 in increasing order. -3, -0.2, 18/4967, 2/11, 3 Sort 13, -5, 2, -4, -6, -150, 5 in descending order. 13, 5, 2, -4, -5, -6, -150 Put 5, 1, 0, 10, -484, 9, 6 in descending order. 10, 9, 6, 5, 1, 0, -484 Put -2, 13, 4, -3, -10, 3, 752 in decreasing order. 752, 13, 4, 3, -2, -3, -10 Put -349, 12, 1, 2, -1 in ascending order. -349, -1, 1, 2, 12 Put 31, 0.4, 0.085, 3, 47, -1 in increasing order. -1, 0.085, 0.4, 3, 31, 47 Sort 2, 3.3, -0.7, 0.09, -2, 7. -2, -0.7, 0.09, 2, 3.3, 7 Sort 3/2, 1, 1/22, -49, 5, 2, -0.3 in descending order. 5, 2, 3/2, 1, 1/22, -0.3, -49 Sort -0.	{ "pile_set_name": "DM Mathematics" }
vide 11543 by -17. -679 What is -363 divided by -166? 363/166 -98280 divided by -351 280 What is 0 divided by 10568? 0 What is 36914 divided by 2? 18457 Divide 1117 by 150. 1117/150 -100 divided by 146 -50/73 Divide 800 by -157. -800/157 Divide 10427 by -13. -10427/13 Divide -1645732 by 411433. -4 -5 divided by 14574 -5/14574 What is -563244 divided by 11044? -51 Calculate 26438 divided by -23. -26438/23 What is 6386 divided by 389? 6386/389 -10046 divided by 12 -5023/6 What is -22575 divided by 903? -25 Calculate 216372 divided by -5694. -38 Calculate -86561 divided by -9. 86561/9 -1 divided by 27361 -1/27361 What is 1087590 divided by -3? -362530 3376 divided by -1 -3376 What is -5 divided by 9640? -1/1928 Calculate 2380 divided by 4. 595 What is 0 divided by -15712? 0 What is -22261 divided by -17? 22261/17 Calculate -67467 divided by -22489. 3 Calculate 325509 divided by 4. 325509/4 Calculate 98241 divided by 5. 98241/5 986631 divided by -69 -14299 Calculate 25179 divided by -109. -231 Divide -497405 by 5. -99481 Calculate -16010 divided by -3202. 5 Calculate 15408 divided by -17. -15408/17 153768 divided by 6 25628 Calculate -1779 divided by -88. 1779/88 Divide -10 by 111745. -2/22349 What is 55594 divided by -154? -361 Divide 3 by -2907. -1/969 Calculate -9744 divided by 6. -1624 Calculate -61386 divided by -1. 61386 -32 divided by 818 -16/409 78023 divided by -451 -173 What is -74010 divided by -4934? 15 What is -333 divided by -1174? 333/1174 Divide -6123 by 2041. -3 Calculate -4804 divided by -128. 1201/32 Calculate -265026 divided by -6. 44171 What is 142 divided by -110? -71/55 -5625 divided by -2 5625/2 Calculate 1951290 divided by -3. -650430 Divide -222176 by 262. -848 Divide 17525 by -6. -17525/6 49608 divided by -1378 -36 Divide 4360 by -10. -436 Divide 63291 by 26. 63291/26 What is 4 divided by -91566? -2/45783 What is 243380 divided by -5660? -43 Calculate 2857091 divided by 197. 14503 What is 165440 divided by 4? 41360 Calculate -159577 divided by 89. -1793 What is 50344 divided by 217? 232 Divide 1105867 by -1. -1105867 Divide -21703 by -11. 1973 Divide -146778 by -1439. 102 119 divided by 6009 119/6009 Calculate 28713 divided by -51. -563 What is 20494 divided by -1? -20494 296826 divided by -4866 -61 28 divided by 94 14/47 Calculate -23766 divided by 6. -3961 Divide 372355 by -3. -372355/3 Calculate 78820 divided by 3. 78820/3 -626530 divided by -313265 2 -200318 divided by 200318 -1 What is -12144 divided by -8? 1518 Calculate 2 divided by 991040. 1/495520 Calculate 843642 divided by 2. 421821 14 divided by -6190 -7/3095 What is 41251 divided by -7? -5893 -1709397 divided by 569799 -3 What is 0 divided by 29796? 0 Calculate 5316300 divided by -5. -1063260 Calculate 4410 divided by 25. 882/5 Calculate 131 divided by -2002. -131/2002 Divide 15240 by 6. 2540 109376 divided by 32 3418 365514 divided by 3 121838 What is 8146 divided by -22? -4073/11 -1590 divided by 2 -795 Calculate 6 divided by 15725. 6/15725 Divide 241791 by 3. 80597 What is 200 divided by -17? -200/17 Divide -735 by 17. -735/17 Divide -3 by -376370. 3/376370 Calculate -11 divided by -4573. 11/4573 Calculate -75474 divided by 4193. -18 Calculate -1272198 divided by 3. -424066 What is -14944192 divided by 2? -7472096 -360441 divided by -261 1381 -7946 divided by 274 -29 Calculate -6534 divided by -6. 1089 What is 124269 divided by 1801? 69 Divide -1603125 by 1425. -1125 -597333 divided by 3 -199111 Divide 14914 by -44. -7457/22 Calculate 1143372 divided by 906. 1262 Calculate 354 divided by 9. 118/3 Calculate 34 divided by 179. 34/179 Divide 564232 by -4. -141058 What is 203454 divided by -3? -67818 5548 divided by 2774 2 Calculate -39556 divided by 899. -44 Divide 405787 by -3. -405787/3 Calculate 43 divided by 56104. 43/56104 Calculate 12756 divided by 14. 6378/7 0 divided by 4306 0 Calculate 3 divided by -709007. -3/709007 Divide -110943 by 7. -15849 What is 61192 divided by 5? 61192/5 Calculate -14476378 divided by 2. -7238189 2563496 divided by 640874 4 Calculate -268 divided by -752. 67/188 Divide -140787 by -1. 140787 Divide 97655 by -5. -19531 -6800 divided by -35 1360/7 What is -78964 divided by -76? 1039 -4 divided by -3874 2/1937 Divide 107676 by 54. 1994 What is -21391 divided by -26? 21391/26 3 divided by -30407 -3/30407 Divide 12 by 703. 12/703 What is 7428 divided by -1238? -6 Divide 5 by -58298. -5/58298 What is 288 divided by -233? -288/233 192142 divided by 8354 23 -461 divided by 294 -461/294 Divide 410136 by -6. -68356 Calculate -16 divided by 10452. -4/2613 225 divided by -835 -45/167 Calculate -382 divided by -1370. 191/685 -54956 divided by 44 -1249 Divide 45 by 47745. 1/1061 Divide -1896908 by 36479. -52 -15639 divided by 15639 -1 Divide 9816 by 585. 3272/195 What is -15 divided by 100815? -1/6721 390978 divided by -214 -1827 0 divided by 3995 0 What is -196686 divided by 446? -441 -14 divided by 2403 -14/2403 -1218 divided by -2787 406/929 What is -12832760 divided by -4? 3208190 Divide 117592 by 1. 117592 26 divided by -2984 -13/1492 -2712 divided by 3 -904 What is -2130022 divided by 2? -1065011 What is -43 divided by 10? -43/10 What is -673948 divided by 6358? -106 Calculate 4336384 divided by -20848. -208 Divide -5 by -999938. 5/999938 315 divided by 1 315 9627189 divided by 1 9627189 What is 4140436 divided by -67876? -61 Divide 20190 by 3365. 6 Divide -385168 by -2128. 181 Divide 226768 by 5. 226768/5 Divide -6938005 by 5. -1387601 5029 divided by -47 -107 Divide -20 by -28. 5/7 Calculate 2181456 divided by -4. -545364 -194270 divided by -4 97135/2 Divide -8113 by -1159. 7 Divide 2255 by 427. 2255/427 17690220 divided by -4 -4422555 What is -231 divided by -183? 77/61 Calculate -5 divided by 1. -5 Divide -11 by -392. 11/392 Calculate -5 divided by 46754. -5/46754 -45024 divided by 8 -5628 3566952 divided by 891738 4 What is -1784 divided by -56? 223/7 What is 1 divided by 166980? 1/166980 Divide -10719 by -13. 10719/13 What is -274335 divided by -5? 54867 -913674 divided by -174 5251 What is -8 divided by 405445? -8/405445 What is 6 divided by -52002? -1/8667 Divide -118302 by -19717. 6 -5913 divided by 9 -657 Divide -101716 by 4. -25429 -5479 divided by -107 5479/107 What is -1684596 divided by -4? 421149 Calculate 127974 divided by -1. -127974 Divide -539 by -149. 539/149 Divide -36305 by 5. -7261 Calculate -70 divided by 2792. -35/1396 Calculate 102 divided by 708. 17/118 Calculate 2832 divided by 2. 1416 9093 divided by 61 9093/61 What is 195286 divided by 2? 97643 Calculate -20 divided by -313. 20/313 Calculate -295 divided by -56. 295/56 Divide -2951882 by -2. 1475941 Divide 8730 by 10. 873 -184 divided by -327 184/327 9806 divided by -4903 -2 Calculate -4 divided by 479615. -4/479615 What is -2861084 divided by 4? -715271 Divide -351044 by -149. 2356 What is -387844 divided by -2063? 188 -525144 divided by -262572 2 156 divided by -78 -2 308 divided by -899 -308/899 Divide 789659 by 23. 34333 -5 divided by -9740 1/1948 What is -231060 divided by 3851? -60 Calculate -2736 divided by -33. 912/11 Divide -723384 by 6698. -108 Divide 2713 by 6. 2713/6 Calculate -67485 divided by 6135. -11 Calculate -26077 divided by -89. 293 Calculate 0 divided by 2181. 0 Divide 1658 by -11. -1658/11 Calculate -70 divided by 29513. -70/29513 -5628692 divided by 1407173 -4 What is -9672 divided by 31? -312 11136 divided by 232 48 What is 6729 divided by -6729? -1 Calculate 1184 divided by 46. 592/23 13247 divided by -13247 -1 Calculate 3 divided by -19979. -3/19979 Divide 125440 by -4. -31360 Calculate 338646 divided by -42. -8063 What is 973470 divided by -6? -162245 Divide 157 by -563. -157/563 Divide -139 by 524. -139/524 Calculate 4 divided by -10319. -4/10319 Calculate 83624 divided by -2. -41812 Divide -11 by 511183. -11/511183 -1378818 divided by 459606 -3 -816060 divided by 35 -23316 What is 2190300 divided by 50? 43806 Calculate -390 divided by 198. -65/33 What is 292660 divided by 4? 73165 Calculate 3 divided by 1432629. 1/477543 -11 divided by -9247 11/9247 11832 divided by 4 2958 What is -246217 divided by 1? -246217 What is 1 divided by -39388? -1/39388 Divide 7 by 26909. 7/26909 -898 divided by -62 449/31 What is 51840 divid	{ "pile_set_name": "DM Mathematics" }
6 Let c = -5729 + 68701/12. Let z = -9703/984 + 9/328. Find the common denominator of c and z. 12 Let z = 2 - -1. Suppose -248 = -0p - 4p - 4c, c = zp - 178. What is the common denominator of 3/p-1-23 and 105/22? 220 Let a(o) = o + 9. Calculate the smallest common multiple of 22 - 1 - (-1 - 0) and a(5). 154 Suppose 5q - 2v = -18 + 78, -3v + 15 = 0. Let f = -2/175 + -498/175. Find the common denominator of f and q. 7 Let o = -4997 + 8263. Let n = o + -2322. Let p = -2777/3 + n. What is the common denominator of p and 37/3? 3 Let y(h) = -2h*2 - 59h + 1. Calculate the lowest common multiple of y(-28) and 85. 85 Let k(j) = j*2 + 1. Let b be 6/(-4) + 1/2. Let g be k(b). Calculate the common denominator of (g - 291/24) + 2 and -37/18. 72 Suppose -7v = -5v - 576. Suppose -3c + v = 99. What is the lowest common multiple of 20 and 14/c + (-70)/(-9)? 40 Let k = -6127/2 + 750788/245. Let z = k + -2/49. Find the common denominator of -1/10 and z. 10 Let y(x) = 35x - 19. What is the least common multiple of 248 and y(1)? 496 Let r = -223145/12 - -18585. Find the common denominator of r and -115/12. 12 Let a = -1/37629 - -133996877/301032. Let b = -441 + a. Calculate the common denominator of b and 50/3. 24 Let j = -4226 + 2853. Let w = 8267/6 + j. Let o = 8545/4 + -2126. Calculate the common denominator of w and o. 12 Find the common denominator of 107/112 and (-6)/10 - (0 - (-655)/200). 112 Suppose 6r = -187 + 823. What is the smallest common multiple of r and 4? 212 Let p(f) = -f*2 + 5f - 2. Let b be p(6). What is the common denominator of ((-4)/b)/((-1)/32) and (77/66)/(3/8)? 9 Let y(g) = 39g + 4 - 49g - 4g2 + 0g*2. Let r(s) = -5s*2 - 11s + 5. Let i(o) = 5r(o) - 6y(o). Calculate the smallest common multiple of i(5) and 2. 2 What is the lowest common multiple of 81 and (-209)/(-11)(1 - -2) + -3? 162 Calculate the common denominator of ((610/(-9))/5)/6 - -3 and -80/99. 297 Let l = 120 - 69. Let g = l + -35. What is the lowest common multiple of 4 and g? 16 Calculate the lowest common multiple of 290/35 + 4/(-14) and 56. 56 Let m(k) = 2k*2 + 19k - 23. Let n be m(-11). What is the common denominator of 1732/(-960) - n/75 and (-2)/6 - 614/(-132)? 176 Let s(m) = m3 - m2 + m + 22. Suppose -31 = -25a + 10 + 9. Calculate the least common multiple of a and s(0). 22 Let h = 33/382 - 289643/7640. Let j = h + 273/8. Find the common denominator of -5/3 and j. 30 Let s = -2 - -24. Let y be (-3)/(-2)(-17 - -19). Suppose 0 = 3g - 12, -20 = -2j + g + yg. Calculate the smallest common multiple of j and s. 198 Suppose 0 = 7l - 2l - 320. What is the common denominator of 40/7 and 6928/l? 28 Let i = -3641/2 - -1862. Let b = -5 + -1. Find the common denominator of i and (1674/96)/(b/4). 8 Find the common denominator of 37/228 and (206/8)/((-117)/(-78)). 228 Suppose 105 = 16f - 13f. Suppose -5d + 235 = -f. Calculate the common denominator of 5/6 and (-6)/(-27) + 147/d. 18 Suppose b = 6b. Let n be (13 - -5)2 + -1. Suppose 5w + bw + 11 = 2i, 3w = -4i + n. What is the smallest common multiple of i and 6? 24 Let i = -9/50 - -257/25. Let b be 1246 + (7 - 2) + -2. Let g = 9967/8 - b. Calculate the common denominator of i and g. 40 Let s = -124 + 225. Calculate the smallest common multiple of s/9 + 8/(-36) and 11. 11 Suppose 8 = 5m - 2. Suppose -4f + 92 = -0r + 4r, 47 = 4r - 5f. Suppose 4q = mq + r. Calculate the least common multiple of q and 2. 18 Let n = -1110 + 1128. Calculate the smallest common multiple of n and 72. 72 Suppose 6 = -2p + 2. Calculate the common denominator of 71/8 and (p/(-32))/(1 - 1188/1168). 40 Let u(d) = -d3 + d2 + 74d + 12. What is the least common multiple of u(9) and 7? 210 Let c be (-1)/(-3) - 14892/45000. Let h = c + 30613/5000. Calculate the common denominator of (-35)/(-95) - (0 - 1) and h. 152 Let q = 3985/372 - -15/124. What is the common denominator of 38/9 and q? 18 Suppose 26q - 28q + 92 = 0. What is the smallest common multiple of 10 and q? 230 What is the common denominator of 12/271 - 5 and -23/57? 171 Suppose 53 = 5t - n - 9, 2t - n = 26. Suppose 2i - u - 14 = -4, 2u + 26 = 5i. Calculate the smallest common multiple of t and i. 12 Suppose 2l + 0l - 29 = -5u, 0 = -l - u + 16. Let y = l - 7. Calculate the lowest common multiple of -10((-65)/25 - -3) + 10 and y. 30 Let z(x) = -8x - 21. Calculate the least common multiple of z(-6) and 9. 27 Find the common denominator of 19/264 and (-1)/((-18)/(-672)) - (-2)/(-12). 264 Let b = 2/121 + -7175/2178. Calculate the common denominator of 68/81 and b. 162 Let m be ((-77)/(-44))/(514/256 - 2). Calculate the lowest common multiple of m/(-12)((-3)/(-6) - 2) and 4. 28 Let w = 282446086 + -8474157643/30. Let x = 25833 + w. Find the common denominator of x and 30/(-4)14/10. 30 Let o = 15 + -11. Let t(k) = -k*3 + 19k + 20 - 19k2 + 2k + 0k3 + 6. Calculate the lowest common multiple of t(-20) and o. 12 Let g be 6/18 - (-2)/(-6). Suppose gz + z - 82 = -4a, a - 4 = 0. What is the smallest common multiple of 3 and (z/9)/((-4)/(-6))? 33 Suppose 0 = -2i - 3i + 60. Suppose 4m = -3n + 52 + i, -3n = 2m - 38. What is the smallest common multiple of 11 and m? 143 Let n = -34 - -37. What is the common denominator of ((-125)/(-20))/(22/8) and n? 11 Calculate the common denominator of (966/(-272) - (40 - 45)) + -1 and -101/340. 680 Suppose 7t - 12 = 3t. Suppose j = -tj + 108. What is the least common multiple of 15 and j? 135 Let n(u) = -u - 14. Let y be n(-16). Let b(k) = 4k - 2. Suppose 3m + 0s - s = 81, 0 = 3m + 5s - 63. What is the smallest common multiple of m and b(y)? 78 Let k be 2/16 - (-1262229)/(-58824). Let t = k - 1/1634. Find the common denominator of t and 40/9. 9 Suppose -21 = -4v + 43. Find the common denominator of 63/2 and 36/34(-8)/v. 34 Suppose -14 - 2 = -4c. Suppose 2h + 3h - 80 = -5m, ch + 3m - 68 = 0. Let i = -216 + 240. What is the lowest common multiple of h and i? 120 Let g be 3 + (1 - (3 + -4)). Suppose 14 = c - gz, 0c + c + 4z = 50. What is the least common multiple of c and -1(-1)/1 - -19? 340 Suppose 19p - 114 = 76. Suppose 2f - 54 = -f. What is the smallest common multiple of f and p? 90 Let h = 3687 - 239601/65. Find the common denominator of -107/6 and h. 390 Let w be -1 - (-11)/(33/144). Suppose -4a - a = -2m + w, -m + 51 = 3a. What is the common denominator of 69/8 and (-11)/28m/9? 56 Suppose -207 + 11 = -2j. Let p = j + -59. Find the common denominator of (p/54)/(3/(-33)) and 31/10. 90 Suppose -24z = -268 + 28. Calculate the smallest common multiple of 100 and z. 100 Let d = -1/20685 + -572279/124110. Calculate the common denominator of d and 0 - 819/70 - (-1 - 0). 90 Let p = -46650862 + 27057492033/580. Let d = p - -566/29. Find the common denominator of 186/42 - 2/4 and d. 140 Suppose -12 - 248 = 5v. What is the common denominator of (-41)/(-11) + v/13 and 47/10? 110 Let o = 4 + -2. Suppose 100 = -ox + 7x. Suppose 4k + 18 = 3w, 6w - 24 = 2w + 3k. Calculate the lowest common multiple of x and w. 60 Let y = -664 + 14621/22. Let k = 2/83725893 + 2866690846963/145013246676. Let b = 8/433 - k. Find the common denominator of y and b. 44 Suppose 2j + 4x + 46 = 5j, -4j = -x - 44. Let k(y) = y3 + 16y*2 + 12y - 35. What is the least common multiple of j and k(-15)? 10 What is the common denominator of 59/286 and -5 + (-93 + -2)/(5 + 1)? 858 Let h(b) = -b*2 + 6b + 3. Let l be 13 - (13 + -16). Let z be h(l). Calculate the lowest common multiple of 48 and (-40)/(-24) + 1/z. 48 Let n = 2/4093 - -159611/32744. Suppose 0 = -18v + 14v - 40. What is the common denominator of n and (-44)/v(200/28)/(-5)? 56 Let y(r) = 2r3 - 10r*2 + 6r + 4. Let l be y(6). Suppose 59c + l = 66c. Calculate the least common multiple of 24 and c. 48 Calculate the least common multiple of 63 and 340/6 + 4/(-6). 504 Suppose -1 = -2t - 5, 0 = -4c + 5t - 14. Let k be (-6)/4c/1613. Let n = k + -85669/32260. Find the common denominator of 83/20 and n. 20 Let h(b) = b*3 + 4b*2 + 4b - 8. Let l be -3 - 3/(3 + -2). Let w be h(l). What is the lowest common multiple of (w/(-39))/((-2)/(-12)) and 10? 80 Suppose -3s + 21 = 2b, -2*b - 10 = -4. Let a = 15 - s. Calculat	{ "pile_set_name": "DM Mathematics" }
10825? -198t + 111617 What is the j'th term of -8889, -17769, -26639, -35493, -44325? j3 - j2 - 8884j - 5 What is the z'th term of 11011878, 11011881, 11011894, 11011923, 11011974? z3 - z2 - z + 11011879 What is the r'th term of -45116426, -45116425, -45116422, -45116417, -45116410? r*2 - 2r - 45116425 What is the f'th term of 317, -32, -901, -2524, -5135, -8968? -39f3 - 26f*2 + 2f + 380 What is the o'th term of -1591, -2156, -2651, -3040, -3287, -3356? 6o3 - o2 - 604o - 992 What is the y'th term of 102, -538, -2644, -6948, -14182, -25078? -122y3 - y2 + 217y + 8 What is the h'th term of 820, 2973, 6462, 11287, 17448? 668h2 + 149h + 3 What is the n'th term of -979, -10146, -35697, -85828, -168735, -292614, -465661, -696072? -1366n3 + 4n*2 + 383n What is the n'th term of 44639, 48837, 55841, 65657, 78291? n*3 + 1397n2 + 43241 What is the f'th term of 11812068, 23624272, 35436478, 47248686, 59060896? f2 + 11812201f - 134 What is the h'th term of 33512, 57699, 81888, 106079, 130272, 154467? h2 + 24184h + 9327 What is the t'th term of 1093, 1308, 1501, 1672, 1821, 1948? -11t2 + 248t + 856 What is the t'th term of -2819110, -5638123, -8457126, -11276113, -14095078, -16914015, -19732918, -22551781? t3 - t2 - 2819017t - 93 What is the r'th term of 5018159, 5018161, 5018163, 5018165, 5018167, 5018169? 2r + 5018157 What is the y'th term of 563, 1756, 3595, 6086, 9235, 13048, 17531, 22690? y*3 + 317y*2 + 235y + 10 What is the r'th term of 685, 2686, 6017, 10678, 16669, 23990? 665r2 + 6r + 14 What is the h'th term of 239156, 239074, 239004, 238952, 238924, 238926? h*3 - 89h + 239244 What is the w'th term of 268, 1542, 4474, 9724, 17952, 29818? 110w3 + 169w*2 - 3w - 8 What is the n'th term of 8756967, 8756939, 8756913, 8756889, 8756867? n*2 - 31n + 8756997 What is the u'th term of -22024522, -22024539, -22024554, -22024567, -22024578? u*2 - 20u - 22024503 What is the k'th term of 32166, 32752, 33336, 33912, 34474, 35016, 35532? -k*3 + 5k*2 + 578k + 31584 What is the i'th term of 4500, 17963, 40352, 71667, 111908, 161075, 219168? 4463i2 + 74i - 37 What is the z'th term of 333014, 665311, 997604, 1329893, 1662178, 1994459? -2z2 + 332303z + 713 What is the m'th term of -1917, -3083, -2715, -45, 5695? 128m3 - m2 - 2059m + 15 What is the h'th term of 496746, 993490, 1490236, 1986984, 2483734, 2980486, 3477240? h*2 + 496741h + 4 What is the a'th term of 5704389, 5704387, 5704385, 5704383, 5704381? -2a + 5704391 What is the g'th term of -1882092, -7528404, -16938930, -30113670, -47052624, -67755792, -92223174? -1882107g*2 + 9g + 6 What is the r'th term of 15704, 62375, 140008, 248603, 388160, 558679, 760160? 15481r2 + 228r - 5 What is the g'th term of 164028, 328076, 492132, 656196, 820268, 984348, 1148436? 4g2 + 164036g - 12 What is the s'th term of -348259, -349787, -351315, -352843, -354371? -1528s - 346731 What is the i'th term of 2975, 1824, -3431, -12784, -26229, -43760, -65371, -91056? i3 - 2058i*2 + 5016i + 16 What is the d'th term of 792152, 792135, 792118, 792101, 792084? -17d + 792169 What is the c'th term of -9313, -37059, -83287, -147997, -231189? -9241c*2 - 23c - 49 What is the g'th term of -78052, -77808, -77564, -77320, -77076, -76832? 244g - 78296 What is the a'th term of 2887522, 2887513, 2887498, 2887477, 2887450, 2887417, 2887378? -3a*2 + 2887525 What is the t'th term of -65403402, -130806802, -196210202, -261613602, -327017002, -392420402? -65403400t - 2 What is the s'th term of -21224, -87809, -199758, -357071, -559748, -807789? -22682s2 + 1461s - 3 What is the g'th term of 39288, 24433, 9578, -5277? -14855g + 54143 What is the q'th term of -32933469, -32933466, -32933463, -32933460? 3q - 32933472 What is the w'th term of 91923, 91929, 91935, 91941? 6w + 91917 What is the w'th term of 3480, 4038, 4594, 5148, 5700, 6250? -w2 + 561w + 2920 What is the h'th term of -10955796, -21911585, -32867372, -43823157, -54778940? h*2 - 10955792h - 5 What is the i'th term of 6540, 6336, 5986, 5496, 4872, 4120, 3246? i*3 - 79i*2 + 26i + 6592 What is the d'th term of 10224, 10841, 11878, 13341, 15236, 17569? d*3 + 204d*2 - 2d + 10021 What is the t'th term of 1206257, 1206214, 1206171, 1206128, 1206085? -43t + 1206300 What is the q'th term of -13428, -53410, -120046, -213336, -333280? -13327q2 - q - 100 What is the q'th term of 31653, 35143, 40967, 49131, 59641, 72503, 87723? q3 + 1161q2 + 30491 What is the f'th term of 11343, 23920, 36517, 49140, 61795, 74488, 87225? f3 + 4f*2 + 12558f - 1220 What is the b'th term of 20568, 41513, 62458, 83403? 20945b - 377 What is the m'th term of 248, -28, -488, -1132, -1960? -92m*2 + 340 What is the i'th term of -99469, -198931, -298393? -99462i - 7 What is the h'th term of -2457, -10646, -24291, -43392? -2728h2 - 5h + 276 What is the g'th term of -25103152, -25103154, -25103156, -25103158? -2g - 25103150 What is the c'th term of -5203586, -10407174, -15610762? -5203588c + 2 What is the h'th term of -5425, 6838, 19103, 31370? h*2 + 12260h - 17686 What is the z'th term of -40679, -162611, -365831, -650339, -1016135, -1463219? -40644z2 - 35 What is the v'th term of 91000, 105989, 120978, 135967? 14989v + 76011 What is the o'th term of -2363, -9351, -20911, -37025, -57675, -82843, -112511? 3o3 - 2304o*2 - 97o + 35 What is the y'th term of 14782196, 14782198, 14782200, 14782202, 14782204, 14782206? 2y + 14782194 What is the t'th term of 3419, 6576, 9477, 12122, 14511, 16644? -128t*2 + 3541t + 6 What is the x'th term of -124994, -250880, -376766, -502652, -628538, -754424? -125886x + 892 What is the c'th term of -1258560, -2517043, -3775530, -5034021, -6292516? -2c*2 - 1258477c - 81 What is the t'th term of -4736, -4744, -4906, -5300, -6004? -13t3 + t2 + 80t - 4804 What is the s'th term of -1558436, -1558428, -1558420, -1558412, -1558404, -1558396? 8s - 1558444 What is the b'th term of 41809, 83761, 125723, 167701, 209701, 251729, 293791? b3 - b2 + 41948b - 139 What is the c'th term of 401, 541, 855, 1343, 2005? 87c2 - 121c + 435 What is the g'th term of -374, -2579, -8420, -19715, -38282, -65939? -303g3 - 84g + 13 What is the o'th term of -423470, -847302, -1271132, -1694960? o*2 - 423835o + 364 What is the o'th term of 2177, 2059, 1913, 1739? -14o2 - 76o + 2267 What is the g'th term of -36851802, -73703603, -110555404? -36851801g - 1 What is the q'th term of -208898, -208899, -208900, -208901, -208902? -q - 208897 What is the l'th term of 15625, 62507, 140699, 250201, 391013, 563135? 15655l*2 - 83l + 53 What is the t'th term of -104154190, -104154192, -104154194? -2t - 104154188 What is the g'th term of -67587, -67635, -67683, -67731, -67779? -48g - 67539 What is the q'th term of -2223, -8769, -19621, -34755, -54147? 4q3 - 2177q*2 - 43q - 7 What is the y'th term of -81360831, -325443339, -732247519, -1301773371, -2034020895, -2928990091? -81360836y2 + 5 What is the l'th term of 8212, 16409, 24620, 32845, 41084, 49337, 57604? 7l*2 + 8176l + 29 What is the v'th term of -27974, -28929, -29884, -30839, -31794, -32749? -955v - 27019 What is the j'th term of 2638, 11548, 26266, 46684, 72694, 104188? -18j*3 + 3012j*2 - 356 What is the y'th term of -18806, -76157, -171742, -305561? -19117y*2 + 311 What is the y'th term of 1182789, 2365462, 3548135, 4730808? 1182673y + 116 What is the t'th term of -31071597, -31071592, -31071587? 5t - 31071602 What is the f'th term of 1271565, 2542852, 3814125, 5085378, 6356605, 7627800, 8898957? -f3 - f2 + 1271297f + 270 What is the t'th term of 514901, 2059625, 4634165, 8238521? 514908t2 - 7 What is the d'th term of 1693, 7065, 16127, 28879, 45321? 1845d*2 - 163d + 11 What is the c'th term of -3844549, -3844548, -3844547, -3844546? c - 3844550 What is the k'th term of -448, -1000, -1558, -2122, -2692, -3268? -3k2 - 543k + 98 What is the l'th term of -23005, -45971, -68937, -91903, -114869, -137835? -22966l - 39 What is the y'th term of -28832924, -28832940, -28832956, -28832972, -28832988, -28833004? -16y - 28832908 What is the v'th term	{ "pile_set_name": "DM Mathematics" }
975 + 2p - 3p)(7p*2 + 3p*2 - 3p*2). -7p*3 - 1806p*2 Expand (c + 0c - 3c)(-4c + 2c*2 + 4c) + 79210c2 - 79227c*2 - 3c - 3c - c3. -5c*3 - 17c*2 - 6c Expand (-5 + 1 + 0)(-3165n*2 + 280n*3 + 3165n*2). -1120n*3 Expand (6h*3 - 8h*3 - 19h*3)(4h2 - 2h*2 + 0h*2) + (-2h + 2h + 3h)(-2h4 - h4 + 2h4) + 0h*3 + 0h*3 + 4h*5. -41h*5 Expand (3 - 2 + 0)(-m + 3 - 3) - 19m - 442 + 442 + (-3 - 9 - 1)(2 + m - 2). -33m Expand (k - k + 2k)(0k - 6k + 4k) - 3k2 + k2 + 4k*2 - 159316 + 159316 - 70k*2. -72k*2 Expand (10q*3 + 50q*3 + 18q*3)(0 + 3 + 0) + 2q - 2q + 3q3. 237q*3 Expand (-2g + 3g + 0g)(7 - 8g*3 + 16 - 21). -8g*4 + 2g Expand (271a - 243a + 363a)(4 - 4 - a) - 4a2 + a2 + 2a*2 + (-6a + 3a + a)(-2a + 4a + 0a). -396a2 Expand -w5 - 3w3 + 3w3 - w + w5 + w + (-4w2 - 4w*4 + 4w*2)(5w + 0w - 4w) + 2w5 - w5 + w*5 - w - 2w*5 - 2w*4 + 2w*4. -4w*5 - w Expand (18 - 50 - 12)(-2 - 4 + 5)(5 - 5 + u). 44u Expand (-k - k + k)(-16 + 13 + 12)((0k - 3k + k)(1 + 0 + 0) - 3k + 4k - 2k). 27k2 Expand (-17 + 2 + 0)(3c - 3c + c)(19c - c*3 - 100c + 37c). 15c*4 + 660c*2 Expand (0a*2 + 5a*2 - 3a*2)(-133 + 20a + 46a + 134). 132a3 + 2a2 Expand (-l2 + l*2 - 3l3 - l3 + 2l3 + 2l*3 - 3l*3 + 4l3 + l3 + (4l2 - l2 - 5l*2)(-l + 0 + 0))(4l + 5l - 4l)(-4l + 3l + 2l). 20l5 Expand (5h*3 - 3h*3 + 0h4 + h4)(-44h - 45h + 15h + (0 - 2 + 0)(-2 + 2 + h) + 0 + h + 0). -75h*5 - 150h*4 Expand (2 - 8 + 2)(-h*2 - 9 + 3h*3 + 9). -12h*3 + 4h*2 Expand (-2u - 3u + 2u)(-4u2 - u2 + 6u2 + (0u - 2u + 0u)(2 - 2 - 2u) + 5u - 5u + u*2). -18u*3 Expand (102h - 172h + 184h)(-1 + 2 - 3). -228h Expand (-2w - 2 + 2)((0 - 2 - 2)(3 - 3 - w) + 3w + 0w + 0w). -14w2 Expand -3y4 + y4 + 3y4 + ((4y - 115 + 115)(10 + 8 - 5) + 0y + 2y + 0y)(0y - 3y + 2y)(2y*2 - 3y2 - y2). 109y4 Expand (0 - 3 + 2)(2t + t - 6t) + 57t + 4t + t. 65t Expand (-54b2 - 201 - 205 + 412 - b3)(-b2 + 4b*2 - 4b2). b5 + 54b4 - 6b*2 Expand -16 - 13h + 16 + (-2 - 35 - 3)((-2 - 5 + 5)(-h + 3h - 3h) - h - 2 + 2 + 0 - 2h + 0). 27h Expand (p + p + p)(38p*2 - 48p*2 - 52p*2). -186p*3 Expand (15c*2 - 8c*2 + 11c*2)(-78c + 28c*3 + 154c - 78c). 504c*5 - 36c*3 Expand 4z - 3z - 5z + 3z - 3z + z + (-2 + 3 - 3)(-3z + 2z + 0z) - z - 2z + z + (2 - 4 + 3)(10z + 7z - 3z). 11z Expand (48s - 171s + 63s)(-3 - 7s + 3)(3s2 - 6s2 - s2). -1680s4 Expand (-3s + 6s - s)(-3s4 + 3s - 3s) + (0s + 4s + 3s + (3s - 5s + 0s)(-4 + 5 - 3))(-6s*4 + 3s*4 - 3s*4). -72s*5 Expand (3x + 2x - 3x)(-1 + 0 - 1)((-3 + 3 - 2x)(2x + x - x) + 45x - 16x2 - 45x). 80x3 Expand (-3d*2 + 15d - 15d)((-6 + 3 + 2)(d3 + 0d*3 + 0d*3) + 2 - 2d*3 - 2) + (1 - 3d*2 - 1)(d + 7d3 - 3d - 6d3). 6d*5 + 6d*3 Expand (1 + 2m - m + m)(1 - 1 + 4m) - 4m2 + 20m*2 - 85m*2. -61m*2 + 4m Expand (-1 + 48 + 22)(-n - 2n + n)(-2n*2 + 5n*2 - 2n*2)(4n - 4n + n). -138n4 Expand (-2m - 4 + 4)(2m - 2 + 2) + 31m2 - 2m*2 + 36m*2 + (2m*2 + 0m*2 + 0m*2)(-3 + 0 + 2). 59m2 Expand (-40z - 22z - 5z)(0 + 2 - 3)(-3 + 0 + 0) + (6 - 4 + 0)(5z + z - 4z). -197z Expand 5p3 - 6p*2 + 6p*2 + (4p*2 + 2p*2 - 5p*2)(0p - 3p + 4p) + 79 - 79 + 15p*3. 21p*3 Expand (-y + 8y + 8y)(3794 - 3794 + 7y4 + 5y*3). 105y*5 + 75y4 Expand (l3 + 2l4 - l3)(5l + 1 - 1) + (2 - 7 - 3)(l*5 - 4l*5 + 5l*5). -6l*5 Expand (-26 + 4b + 21 - 2b)(2b3 + 4b*3 - 4b*3). 4b*4 - 10b*3 Expand -1 + 1 - 2k4 + k4 + 2k4 - 4k*4 + (-2k2 + k3 + 2k2)(-2k + 0k - 3k) + 3k*2 - 3k*2 + 2k4 + k4 - 4k4 + k4. -8k*4 Expand -4p*5 - 6p*2 + 6p*2 + (-5 + 5 + 5p*3)(-3p2 + 6p*2 - 2p*2) + (0p*3 + 0p3 + p3)(0p*2 - 3p2 + p2) + 2p5 + 4p*5 - 7p*5. -2p*5 Expand (-1 - o + 1 + 4o - o - o + (0 - 2 + 3)(-1 + 1 + 3o))(-8o*2 - 16 + 2 + 4). -32o*3 - 40o Expand (-1 - 1 + 3)(g + 5g - 5g) - 15g + 72g + 34g. 92g Expand (-5s2 - s2 - s*2)(-243 + 2s3 + 243 + 11s*2). -14s*5 - 77s*4 Expand (2t - 4 + 4)(-16 + 25 + 33). 84t Expand (-1 + n + 1)(4n*3 - 2n*3 + 0n*3) - 2n*4 + 9n - 41n4 + 24n*4. -17n*4 + 9n Expand (3x + x - 8x)(-7 + 4 + 1)((8 - 4 - 3)(3 + 3 - 5) + (-2 + 5 - 4)(-3 + 2 + 0) + 2 + 2 - 3). 24x Expand (-9 + 9 - 6o)(4 + 4 - 14) - 4o + 2o + 4o + (o - 5 + 5)(2 + 1 - 1) - o + 3o + 0o - 2o + o - o. 40o Expand (-q - 2q + 4q)(-8q - 126 - 116 + 247). -8q*2 + 5q Expand ((-2t + t + 3t)(2 + 1 - 1) + t + 0t + t)(-43t + 39 - 18 - 22). -258t2 - 6t Expand (0p4 + 2p*4 + 3p4 + (-p2 + p2 - p2)(-p2 + 2 - 2))(-123 + 103 + 182 + 226). 2328p4 Expand (1 - 4 + 2)(-279 + 140 + 139 - 302i). 302i Expand -6u4 - u4 - u4 + 9u*3 - 9u*3 + 3u*4 + (2u*2 + 0u*2 + 0u*2)(2u - 2u*2 - 2u) + (-u - 1 + 1)(4u*3 + 5u*3 - 5u*3). -13u*4 Expand -3 + 3 + 4t + (-17 + 0 - 13)(2t - 2 + 2) - 3t + 3t - t. -57t Expand (6s2 + s2 - 3s2)(98s3 - 8s*3 + 21s*3). 444s*5 Expand (-2 + 5 - 1)(73q + 19q - 29q)(2q + 3q - 4q). 126q*2 Expand (0h + 0h - h)(-408 + 80 - 145). 473h Expand (-2 + 2 + 2i)(-4 - 2i*3 + 4) + 4i*2 - 4i2 - i4 - 285i4 - 3298i*3 + 3298i*3. -290i*4 Expand 3i2 + i3 - 3i2 + (-3i*2 + 2i*2 + 3i*2)(-3 + i + 3) - i*3 + 20i*2 - 27i*2 + 3i*3. 5i*3 - 7i*2 Expand (36i*2 - 4i*2 + 25i*2)(1 + 8 - 2)(-2i*3 + 1 - 1). -798i*5 Expand (4g + g*2 - 4g)(-14891g*2 - 471g*3 + 14891g*2). -471g*5 Expand (-3506x + 1144x + 1407x)(4x - 5x + 3x)(3x + x - 2x). -3820x*3 Expand -5n - 1 + 1 + 3n + 5n - 9n + (1 + 5 - 4)(-2 + 2 - 2n). -10n Expand (1644 - 572 + 546 + 989)(y2 - 4y*2 + 5y*2). 5214y*2 Expand (-94f*2 - 97f*2 - 64f + 188f2)(3 - 4 + 2). -3f2 - 64f Expand (-22r - r3 + 17r + 4r)((2r - r + r)(-6 + 3 + 1) - 3r + r + r). 5r*4 + 5r*2 Expand (4h - h - h)(-3h*3 - 2h*3 + 4h3) + h3 + 4h3 - 99h*4 + 95h*4. -6h*4 + 5h*3 Expand (-2s - 3 + 3)(6 - 4 + 3)(9s + 60 - 60). -90s*2 Expand (-3 + 5 - 3)(0y + 2y + 0y)(-5y2 - 9y*2 + 4y*2). 20y*3 Expand (-31 - 135 - 9)(-u2 + u2 - 2u5). 350u*5 Expand (-4h - 4h + 3h)(-13 + 13 - 28) - 3h + h + h. 139h Expand -5t*4 + 4t*4 + 2t4 + t4 - 3t4 + t4 + (-1 - 2t + 1)(17t*3 - 5t*3 + 4t*3). -32t*4 Expand (-t - 4t + 4t)(2t3 - t + t) + 4 - 4 + 2t*4 - 2t*4 - 3 + 3 + (3 - 3 + 2t*3)(2 - 2 - 2t) + t - 2t*4 - t - 2t4 - t2 + t*2. -10t*4 Expand ((-1 + 1 + 1)(3 - 1 - 4) + 0 + 1 - 2)((3y*2 - 4y*2 + 0y*2)(-4 + 3 + 3) + 3523 - 3523 + 211y2). -627y*2 Expand -3 + 3 - 2m + (0 - 5 + 3)(-4 + 2m + 4) + 3m + 3m - 5m - 3m + 0 + 0 - 2m + 3m - 2m + (-4 + 11 + 1)(-17 + 17 + 7m). 47m Expand -113a - a2 - 22a*3 - 9a*3 + 100a + (a*2 + 2a*2 - 6a*2)(-4a + a + 4a). -34a3 - a2 - 13a Expand ((0b - b + 2b)(3 + 1 - 2) + 5b - 3b + 0b + 3b + 2b - 6b)(32 - 2b3 - 32). -6b*4 Expand 3 - 3 + h + (4h - 4h + h)(2 - 5 + 4) + (-2 - 2 + 2)(21 - 21 + 24h) - 3 + 3 - 2h. -48h Expand (-4d - d + 2d)(0d*2 + 0d*2 - 4d*2) - 14d*3 + 3d*3 - 15d*2 + 16d2. d3 + d*2 Expand ((0 + 2 - 1)(-5 - 1 + 4) + 265 + 280 + 167)(4x - 4x - x4). -710x*4 Expand (94 + 557 + 1688 + 2899)(-5c2 + c2 + 2c*2 + (-4c - c + 3c)(c - 4 + 4)). -20952c2 Expand (-122 - 23143r + 447 + 23141r)(-4r + 5r + 0r). -2r*2 + 325r Expand 4g5 - 4g*5 + 4g*5 + (-4 - 1 + 2)(-29g5 + 3g - 3g). 91g*5 Expand -28p + 5p4 + 28p + (2p2 - p2 - 2p*2)(-5p + 6p*2 + 5p) + (6 - 6 + 3p3)(3p - 6p + 2p) + p4 - p3 + p3. -3p*4 Expand (-1 - 1 + 0)(2 + 4t2 - 1 - 2t*2 - 3t*2 + 5t*2 - 4t*2 + (3t - 3t + t2)(3 - 4 + 0) - 4t + 4t - t*2). 4t*2 - 2 Expand (-4 - 4 + 2)(10	{ "pile_set_name": "DM Mathematics" }
. Let q be k(0). Suppose -3p = -p - 5c - 97, q = -3p - 3c + 93. Let u = 69 - p. Is u composite? True Let x(g) = 3g + 1. Let q be x(1). Let w(s) = 2s + 12. Let o be w(-7). Is 21 - (q + o/1) prime? True Suppose 2q = -k + 6k + 2219, 1127 = q + k. Suppose -4x + 3x + q = 3t, -4t + x + 1489 = 0. Is t a composite number? False Suppose 0q = 6q - 978. Is q a prime number? True Let q(d) = d*2 - 9d - 6. Let f(b) = 1. Let x(r) = 6f(r) + q(r). Let a be x(9). Suppose ag - 44 = -2g. Is g prime? False Let z(q) = q3 + q2 - 5q + 14. Is z(7) a prime number? False Let b = 191 + -22. Is b a composite number? True Suppose -4y - 7 = -5y. Suppose 4w - 224 = yi - 3i, -206 = -4w - 2i. Is w prime? True Suppose -5q - 4x + 1035 = 0, 2q - 3x = -x + 432. Is q prime? True Suppose 4l + 6 - 18 = 0. Let q be l + 6 - 3 - 3. Suppose -2w - qw + 166 = b, 2w = -10. Is b a prime number? True Suppose -t + 3n = -283, -n - 548 = -2t - 4n. Is t composite? False Let b(f) = f*3 + 11f*2 - 6f - 5. Let i be b(-11). Let q = i + 18. Is q composite? False Let m(s) = -3s3 + 2s*3 + 6s - 3 + 6s2 + 0s*3. Let d be m(7). Is (-146)/d - 4/(-10) a prime number? False Suppose 0 = -5a + 5t + 6575, -3a - t - 280 + 4225 = 0. Is a composite? True Let n(z) = 2z2 - 2z - 5. Let p = 1 + 4. Is n(p) a composite number? True Suppose 3q = -o + 89, 3o + 2q - 307 = 3q. Suppose -5l - 3f + o = 0, -l + 0l = -f - 17. Suppose -p - 5h = -3p + 26, -5p + h = -l. Is p prime? True Let j(c) = -18c + 14. Is j(-6) composite? True Is ((-126)/(-4) + 2)2 a composite number? False Let i(k) = k*2 + 8k - 7. Suppose 4l - 21 = m, -2m = -5l - 0l + 24. Is i(l) composite? True Let f(o) = 24o - 1. Is f(3) a composite number? False Suppose 8 = -2r + 2. Let i = r - -25. Is i composite? True Let u(r) be the third derivative of -11r4/24 + r3/6 + 6r*2. Is u(-8) prime? True Suppose -4y - 2 = -10. Let f = y - -3. Suppose 0 = -5n + 2c + 103, 0n = -2n - fc + 47. Is n composite? True Let f be (4/(-4))/((-1)/2). Suppose z - o = 5z - 2162, fz = o + 1084. Is z a prime number? True Let v(w) = 5w*2 + 16w - 5. Let t(u) = -4u2 - 15u + 5. Let d(k) = 6t(k) + 5v(k). Let s be d(9). Let p(y) = -5y + 3. Is p(s) a composite number? False Suppose 0a - a + 3o + 29 = 0, -5a + 2o = -158. Let s be (-4)/2 + 710/10. Let g = s - a. Is g prime? True Suppose 2y + 0y = -4. Let o be 0 + 2 + (-130)/y. Suppose -x + 4a = -0a - o, -3x + 3a = -228. Is x prime? True Let w(b) be the third derivative of b6/24 - b5/12 + b4/12 - b3/6 + b2. Suppose 5d - 2 - 1 = -4o, 18 = 3d - 3o. Is w(d) prime? False Let z(i) = -i + 87. Let q(s) = 3s - 262. Let r(v) = -4q(v) - 11z(v). Suppose 0 = -3k - k. Is r(k) a composite number? True Suppose -2w + 794 = 252. Is w composite? False Let y(q) = 10q - 5. Suppose -3h = x - 16, -h + 3h - 8 = -2x. Is y(h) prime? False Let h(a) = 648a - 37. Is h(5) prime? True Suppose 5w - 1632 = 773. Is w a prime number? False Suppose -4179 = 10w - 54949. Is w a prime number? True Let o(d) = -30d + 6. Let r be o(-3). Suppose -116 = -4j + r. Is j composite? False Is (446(-5)/10)/(-1) a prime number? True Suppose 0 = -2g + 3g + 3s - 3, 4g - 2s - 26 = 0. Let z be (3 - 1) + 12/g. Suppose -4j + 2o + 31 + 53 = 0, 0 = zo + 16. Is j a composite number? False Suppose -2p = p - 15. Suppose 387 = pa - 8. Is a composite? False Let z = 6 - 1. Suppose g - za - 123 = 0, 5a = -g - g + 216. Is g a prime number? True Is (-30)/4434/(-21) a prime number? False Let k(d) = 473d - 5. Is k(2) prime? True Suppose -3c = -6c + 3. Let x be -100 - (0 + (-1 - c)). Let n = x - -237. Is n a composite number? False Suppose 2064 = v - 3u + 377, 5u + 3376 = 2v. Is v composite? False Suppose 2s - 24 = -3k - 9, -5s - 2k + 21 = 0. Suppose 129 - 309 = -sv. Let u = v - 23. Is u prime? True Suppose 0 = g - 0g - 77. Is g a composite number? True Is 5298/15 - 1/5 prime? True Is (-27788)/(-12)-1-3 a composite number? False Suppose -4v + 5 = -3. Suppose 0 = 4x - vo - 3o - 1, 2o + 6 = 3x. Suppose -j = -xl + 35 + 36, 0 = -5l + 3j + 80. Is l prime? True Is 15762/4(-2 - 16/(-6)) composite? True Let x(d) = 13d + 1. Suppose -2p - 9 = p. Let f be x(p). Let q = 63 + f. Is q prime? False Let t(w) = w2. Let p(k) = -4k*2 + 5k + 1. Let j(c) = -p(c) + 5t(c). Let o(b) be the first derivative of j(b). Is o(5) a prime number? False Let m(y) = y3 - 8y*2 + 9y - 7. Let o be ((-4)/(-12))/(1/27). Is m(o) a prime number? False Suppose -3g - v + 16 = 0, -4g - 2v = 3v - 25. Let c(p) = 5p - 7 + 6p - gp + 2p*2 + 2p. Is c(6) a prime number? True Let s = 15 - 10. Is ((-10)/s)/(4/(-74)) a composite number? False Suppose -4397 = -5h - 4r, -5h + 2r + 1876 = -2503. Is h a prime number? True Suppose 0 = -3w - 0w. Suppose w = -3a + 58 + 23. Suppose 3q - a = 204. Is q prime? False Let l be 0/((-2 + -1)/3). Suppose -2j = -4y + 18, -2y - 2j = -ly - 6. Suppose 0 = 5w - yw - 15. Is w composite? True Let q be (-11 + 6)93/(-5). Suppose 3h - q = 60. Is h prime? False Suppose 4m - 5 - 3 = 0. Suppose -10 = -mi - 4, 5d - 5i - 260 = 0. Let b = d + -36. Is b a composite number? False Let x(d) = 6d2 - 1. Let s be x(1). Let p(w) = -w3 + 7w2 - 6w - 6. Let t be p(5). Let f = t - s. Is f a composite number? True Let y = -276 + 639. Suppose 22 - 92 = -t. Suppose y = r + t. Is r a prime number? True Let i(n) = n*3 - 5n*2 - n + 7. Let w be i(5). Suppose t = -0h + wh + 5, -h = t - 17. Is t a prime number? True Suppose 4c = -3o + 2c + 727, -473 = -2o + c. Is o a prime number? True Suppose 5 = -5d, 20 = 5z + 3d + 2d. Suppose -zi = -5y - 170, -y - y + 8 = 0. Let s = i + -25. Is s prime? True Let q(r) = -r - 8. Let u be q(-4). Let o = 6 + u. Suppose 282 - 75 = 4p + i, -3p + 169 = -oi. Is p a composite number? False Let c(s) = -18s + 1. Let p be c(-2). Suppose 5z - p = 4z. Is z prime? True Suppose 2i = -5q + i + 3980, 3q - 2i - 2401 = 0. Is q prime? True Let c(l) = 2l + 2. Let y be c(-3). Is ((-186)/(-5))/(y/(-10)) prime? False Is (0 + 1)/(((-8)/(-293))/8) a composite number? False Is (14 - 11)/(2/58) a prime number? False Let x(w) be the second derivative of -w*4/12 + 121w*2/2 - 3w. Is x(0) prime? False Let m(k) be the second derivative of -k*7/840 + 7k6/360 - k5/120 + k4/8 - k3/3 + 2k. Let x(q) be the second derivative of m(q). Is x(6) prime? False Let s(c) = 155c*2 + 7c + 2. Let u(x) = -78x2 - 4x - 1. Let a(z) = 6s(z) + 11u(z). Is a(-2) composite? False Let q(a) = -28a2 + a + 3. Let g(o) = -42o*2 + o + 4. Let t(i) = 5g(i) - 8q(i). Suppose 0 = j + 2j - 9. Is t(j) a composite number? False Is (-2 + 3)/(6/894) composite? False Suppose 4t + 31 = p, -2t - 94 = -4p - t. Is p composite? False Suppose 5g = r - 5r + 318, r + 2g = 81. Is r a composite number? True Let s = 3370 + -1933. Is s prime? False Let w(k) = k*3 + 4k*2 - 6k - 3. Let m be w(-5). Suppose 3d = -md - 10. Let t = d + 57. Is t prime? False Suppose -2n = o + 42, 3 = 2o - 4n + 103. Let t(m) = -m + 4. Let u be t(3). Is o/(-4)(u + 1) a composite number? False Let z(d) = 2d3 + d2 - d + 1. Let w be (1 - -3)/2 - 1. Let m be z(w). Suppose 0 = -mj + j + 50. Is j composite? True Let u = -3 - -23. Suppose -70 = -5a - u. Is a a composite number? True Let o be 3/(-3) + 0 - -3. Suppose 71 = f + ox, 5f = 5x - 20 + 435. Is f a prime number? True Suppose 4y - 6 = -5i, y - 2 = -i - 1. Suppose 6u - iu + 8 = 0. Is 875/15 + u/(-3) a prime number? True Suppose -2r = -0r + 10. Let v = 27 + r. Is v prime? False Is 10 + 22 + 1(-1 + 0) a composite number? False Let k be 2 + -10 + (-12)/4. Let l = k + -8. Let h = -9 - l. Is h a composite number? True Suppose 0 = s - 3q - 1043, 4s - 1157 = -3q + 3030. Is s composite? True Suppose 3g + 63 = 2x + 194, 4g - 3x = 173. Let b = g + -15. Suppose 0 = 5l - 23 - b. Is l a composite number? False Suppose 0 = 3i + 2 - 68. Is i a prime number? False Suppose u - 18 = 6u + 3m, u = m - 2. Is u/(-5 - 1)938 a prime number? False Let q be (-6)/27 + 38/9. Suppose 0 = -qi + 693 - 241. Let b = i + -64. Is b composite? True Let d(r) = -r*3 - 4r*2 - 4r. Let v be d(-3). Suppose	{ "pile_set_name": "DM Mathematics" }
/70211 Divide -92 by 383553. -92/383553 Divide 88915350 by -101. -880350 What is 7466616 divided by 3? 2488872 What is -7205094 divided by -277119? 26 Divide -118313141 by 1. -118313141 Divide -81218524 by 4. -20304631 Calculate -312878 divided by 27. -312878/27 121 divided by -382076 -121/382076 Calculate -2 divided by 1499562. -1/749781 Divide 11756478 by 734. 16017 Divide 2 by 7508740. 1/3754370 Divide -1881 by 100199. -171/9109 Divide 65090 by -23. -2830 What is 116704 divided by -14588? -8 Divide 132103650 by 22017275. 6 What is 267 divided by 2779? 267/2779 Calculate -438 divided by 36139. -438/36139 Divide 4 by -7814883. -4/7814883 Calculate -144671244 divided by 6. -24111874 -35685768 divided by 1486907 -24 Divide 4 by -33769002. -2/16884501 Calculate 12031 divided by -1609. -12031/1609 27 divided by 270059 27/270059 Calculate 33323810 divided by 130. 256337 Calculate 20608982 divided by 4. 10304491/2 Calculate 8 divided by 1840048. 1/230006 -15 divided by 13806079 -15/13806079 Divide -1471491107 by 2. -1471491107/2 -101263 divided by 34 -101263/34 Calculate 3349476 divided by 842. 3978 Divide 3537833 by -1. -3537833 What is -359751920 divided by -8993798? 40 Divide 4 by -223382. -2/111691 What is -86110 divided by -35? 17222/7 -810633694 divided by -2150222 377 Calculate -7463220 divided by -865. 8628 What is -471321180 divided by 20? -23566059 Divide 7694720 by -192368. -40 Calculate -3444524 divided by -3. 3444524/3 Calculate -239996244 divided by -4. 59999061 What is -4367754 divided by -727959? 6 What is -2414540 divided by -2? 1207270 Calculate -27 divided by -2284029. 3/253781 Calculate -378881616 divided by -24. 15786734 Calculate -9 divided by 1715080. -9/1715080 What is -1259 divided by -3855? 1259/3855 Calculate -376306968 divided by -47038371. 8 Calculate 703922186 divided by -63992926. -11 Divide 41439075 by -25. -1657563 336365892 divided by 15732 21381 Divide 24555 by -164. -24555/164 Calculate 2 divided by -30757230. -1/15378615 -2145652 divided by 698 -3074 Calculate 26066141 divided by -1. -26066141 Calculate 38034 divided by -1469. -38034/1469 Calculate 118909826 divided by 1. 118909826 Calculate 3 divided by 33540594. 1/11180198 Divide -9 by 1644801. -3/548267 What is 70594 divided by 234? 35297/117 1353086 divided by -676543 -2 What is -8441850 divided by 1406975? -6 Divide 23526393 by 6. 7842131/2 What is 50 divided by 303964? 25/151982 -87634330 divided by -43817165 2 What is 20239036 divided by 15? 20239036/15 What is 997 divided by 7474? 997/7474 Divide 638213 by 62. 638213/62 -90713329 divided by 1 -90713329 Divide 2019655 by -3. -2019655/3 Divide -138323968 by 140288. -986 Calculate 80 divided by 83554. 40/41777 1744807 divided by -458 -1744807/458 Calculate 1190 divided by -15824. -595/7912 Calculate -143727488 divided by -8. 17965936 Divide -3579336 by 5448. -657 What is -710952 divided by 18? -118492/3 Divide -39774 by 969. -13258/323 Calculate 14026780 divided by 4. 3506695 What is 2121430 divided by 4? 1060715/2 Calculate 22222 divided by 647. 22222/647 Divide 5482 by 1078. 2741/539 Calculate -4492092 divided by -4. 1123023 -11450034 divided by 3 -3816678 -457842 divided by 3 -152614 -1320 divided by 28742 -660/14371 Calculate -243483552 divided by 81161184. -3 Divide 19427 by 7541. 19427/7541 Divide -1016088768 by 72. -14112344 What is 92640132 divided by 23160033? 4 What is -527 divided by -51488? 527/51488 Calculate 10079300 divided by 2450. 4114 Calculate -1200604 divided by 1200604. -1 24813940 divided by 3754 6610 What is -15 divided by -922387? 15/922387 17004246 divided by -42 -404863 What is -33258912 divided by -3? 11086304 -27130396 divided by -43618 622 What is -3947460 divided by 328955? -12 What is -14804820 divided by -2118? 6990 2 divided by -3722839 -2/3722839 What is 1 divided by 399311? 1/399311 -265097331 divided by 35617 -7443 Calculate -143159982 divided by -19299. 7418 Calculate -8 divided by -11659103. 8/11659103 Divide -5441100 by 272055. -20 What is 2 divided by -19255450? -1/9627725 -12839226 divided by 72538 -177 15678704 divided by -3 -15678704/3 Calculate 42958 divided by -148. -21479/74 What is 26251 divided by 270? 26251/270 What is -59064563 divided by -19? 59064563/19 28585069 divided by -28585069 -1 What is 23555 divided by 376? 23555/376 Divide 2253628 by 59306. 38 What is -300372 divided by 453? -100124/151 29974892 divided by 18244 1643 337392 divided by 792 426 Divide 158588 by 1252. 39647/313 Divide 283205040 by 5553040. 51 What is 6383476 divided by 3? 6383476/3 Divide -1882 by 29644. -941/14822 Divide -582320 by -290. 2008 1908918 divided by -18 -106051 Calculate 671099524 divided by 346. 1939594 Calculate 1223217 divided by -407739. -3 Calculate -79 divided by -118042. 79/118042 -35676340 divided by 1274155 -28 Divide 3789072 by -1263024. -3 What is 221752 divided by -31? -221752/31 412781754 divided by -130174 -3171 Calculate 52194755 divided by 5. 10438951 Divide -74051090 by -1. 74051090 300039744 divided by 6 50006624 -20273958 divided by 38839 -522 -53220356 divided by -94 566174 -8882678 divided by 13082 -679 Calculate 289527922 divided by -113. -2562194 Calculate 1829 divided by 25023. 1829/25023 -803170 divided by -401585 2 Calculate 31351115 divided by 16685. 1879 Calculate -2614164 divided by -653541. 4 Calculate -13438511 divided by 263. -51097 Calculate -33401330 divided by 29. -1151770 What is -12999842 divided by 1? -12999842 Divide -5 by -1874105. 1/374821 What is -1730334 divided by 47? -1730334/47 629 divided by -112703 -629/112703 -4260 divided by -5952 355/496 859090 divided by 10 85909 Divide -793776582 by 9. -88197398 What is -55892328 divided by -136? 410973 Calculate 855046315 divided by 1. 855046315 18526209 divided by -1425093 -13 Calculate 4302 divided by 657. 478/73 Calculate 3858 divided by 932. 1929/466 -238927568 divided by 484 -493652 What is -1375270496 divided by -6? 687635248/3 Divide -2775 by -2923. 75/79 Divide -3220 by 107357. -3220/107357 Divide -36 by -12798790. 18/6399395 Calculate 12452625 divided by 498105. 25 -378359589 divided by -126119863 3 What is -11868825 divided by -95? 124935 What is -23356595 divided by -76579? 305 Divide 4469390 by 535. 8354 33735388 divided by -46 -733378 10 divided by -2406733 -10/2406733 -328773217 divided by 4 -328773217/4 What is 19655442 divided by 6? 3275907 Calculate -247997900 divided by -2479979. 100 16099030 divided by -3219806 -5 Calculate -126115351 divided by -5587. 22573 Calculate 0 divided by 2040647. 0 Calculate 10619474 divided by 6. 5309737/3 Divide 13629330 by -31770. -429 What is -7194296 divided by -24638? 292 -2 divided by 357604158 -1/178802079 What is -191 divided by -3146980? 191/3146980 What is 10075569 divided by 479789? 21 What is -529494875 divided by -75642125? 7 Calculate -21957606 divided by 510642. -43 Divide -1724 by 2647. -1724/2647 Divide -11475290 by 3470. -3307 Calculate -137021292 divided by 8060076. -17 -3981410 divided by -58 68645 Divide -5779630 by -577963. 10 Divide -14877640 by 7438820. -2 What is -281300390 divided by -550490? 511 38934684 divided by 37764 1031 What is -24812777 divided by -2? 24812777/2 What is 38307291 divided by 2937? 13043 Divide -5968425 by -2. 5968425/2 89671824 divided by 88 1018998 Divide -59393245 by -11878649. 5 Divide 48499592 by -4. -12124898 Calculate 63345392 divided by 719834. 88 1069 divided by 19599 1069/19599 Divide -136134136 by -136134136. 1 What is 3 divided by 1516404? 1/505468 Divide -238405 by 508. -238405/508 What is -130154700 divided by 188630? -690 What is 1314965 divided by -1? -1314965 What is -12085813 divided by 13? -12085813/13 What is 14080 divided by 526? 7040/263 What is -12505416 divided by 2814? -4444 What is 67521624 divided by 16880406? 4 What is -21745244 divided by 17? -1279132 What is -15 divided by 19506? -5/6502 Calculate 4 divided by -25909468. -1/6477367 9961104 divided by -1245138 -8 What is 244 divided by -23390? -122/11695 Divide 3707652 by 39. 95068 What is 154519208 divided by 77259604? 2 What is 2725032 divided by 20037? 136 105228747 divided by -5317 -19791 Divide -81069 by -8. 81069/8 Calculate 12132230 divided by 551465. 22 22445025 divided by 5 4489005 Divide -17196 by	{ "pile_set_name": "DM Mathematics" }
r. 4, k, 1, -3 Let s = 0.3 + -0.7. Let h = 0 - s. Let w = -0.9 + h. Sort 1, -3/7, w. w, -3/7, 1 Let c be 8/39/6. Suppose 3y = -ch + 13, h - 4h + 5y = -17. Let u = -2 - -1.5. Sort -0.2, u, h. u, -0.2, h Suppose -5z = 2b - 17, z + 4z = 5b + 45. Suppose -4w = 4k + 68, -2k - 19 = 2w - zw. Let o = k - -9. Sort 3, o, -4 in descending order. 3, -4, o Let q = 2/185 + 356/1295. Suppose -40 = -3o - 5b, -o - b - 4b + 30 = 0. Let x be 13/o - (-2)/(-1). Sort 0.2, x, q in decreasing order. x, q, 0.2 Let s = 36.078 - 0.078. Let h = s - 51. Let o = -11 - h. Put o, 0, -0.4 in increasing order. -0.4, 0, o Let q = 6 + -5. Let o = 0.7 - q. Sort 3, 1, o in ascending order. o, 1, 3 Let w = 3 - 2.8. Let y = 7 + -4. Put -1, y, w in increasing order. -1, w, y Let u = 196 - 194. Sort -0.08, 1, 1/4, u in descending order. u, 1, 1/4, -0.08 Suppose 1 - 12 = -5v - f, -4f - 4 = -4v. Put 3, -5, v in ascending order. -5, v, 3 Let c = -0.01 + -4.99. Put c, -4, 1 in decreasing order. 1, -4, c Suppose 20 = 2n + 2n. Let a(j) = j*3 + 7j*2 - 7j + 8. Suppose -2p + 6 = 22. Let u be a(p). Put -2, n, u in decreasing order. n, u, -2 Let p = 189/376 - 6/47. Sort p, -0.3, -0.2 in increasing order. -0.3, -0.2, p Let y(p) = -7p - 8. Let i(k) = 3k + 4. Let u(q) = 5i(q) + 2y(q). Let z be u(-5). Put 1, z, 0 in descending order. 1, 0, z Let d be (9/(-6))/(-3)3. Put -15, 2/5, -0.2, d in decreasing order. d, 2/5, -0.2, -15 Let w = 0.08 + -3.08. Let a = -2.8 - w. Let g = -669/10 - -67. Sort a, 0, g in increasing order. 0, g, a Let l = -0.33 - -0.2. Let b = l - -0.13. Put 4/3, b, -2 in increasing order. -2, b, 4/3 Let o = 10/23 - 24/161. Sort o, -4, -0.2. -4, -0.2, o Suppose -3w + 24 = -5h, -w - 2h - 3 = -0h. Sort 0.3, -0.1, w, 2/9. -0.1, 2/9, 0.3, w Let r = 26 + -27. Sort r, -8, 4 in decreasing order. 4, r, -8 Suppose 0z + z + 1 = 0. Let f(v) = 3v - 77. Let l be f(24). Let i(k) = -k + 5. Let h be i(0). Put z, l, h in descending order. h, z, l Suppose -7 = 5w + 3. Put 1, w, -3, 6 in decreasing order. 6, 1, w, -3 Let a = 14 - 18. Sort -1/4, a, -2 in decreasing order. -1/4, -2, a Let g(z) = 4z + 2. Let s be g(1). Put 5, 1, s, 3 in decreasing order. s, 5, 3, 1 Let i = -0.46 + 0.26. Sort 5, -0.5, i, -4. -4, -0.5, i, 5 Let v = 0.36 + -0.29. Sort v, 5, -3/2. -3/2, v, 5 Suppose -4h - 3 - 3 = 3q, 2h = -q - 4. Suppose qs = 5 - 1. Put s, -1, -5 in decreasing order. s, -1, -5 Suppose -4y + 5 = 1. Suppose 0 = q - 49 + 51. Sort y, -1, q. q, -1, y Let d be (2 + -51)1. Suppose 1 = -3l - 3j - 2, 2j + 2 = -4l. Sort l, 2, d. d, l, 2 Suppose -4g + 16 = 4z, 3g + 2g = 3z - 20. Sort 13, g, -4 in descending order. 13, g, -4 Let w be 390/(-54) + 4/18. Let n be (-3 + 3 + -2)/w. Sort n, 1/3, 0.1. 0.1, n, 1/3 Let g(d) = -10d2 + 0 - 9d + 3 + 2 + 2d3 - d3. Let k be g(9). Let c = 1411/9 + k. Sort 0.4, -4, c in descending order. 0.4, c, -4 Let a = -32 + 27. Let c = 0.06 - -0.24. Let n = -0.7 - c. Sort 4, n, a. a, n, 4 Let b be (-34)/8 - 1/(-4). Let a be (-24)/b + 1-1. Suppose 3u + 13 = u - v, 2u - 4v = 2. Put u, -2, a in decreasing order. a, -2, u Suppose -4x - h - 4 = 6, 0 = 3x + 5h + 16. Let z(l) = -3l3 - 2l2 + 2. Let m be z(1). Put -5, m, x in descending order. x, m, -5 Let k(c) = c2 + 8c + 9. Let v be k(-7). Suppose -5 - 1 = -2b. Suppose 10 = -0y - 2y. Put v, b, y in decreasing order. b, v, y Let h be 3 + 2/10-13. Sort 2/9, h, 2 in ascending order. 2/9, h, 2 Let u = 6.6 + -8. Let i = u - -1. Let o be 44/(-33)3/(-10). Sort o, i, -0.5. -0.5, i, o Suppose f + 3f = -5s - 154, 3s = 3f + 129. Let a = f - -23. Sort -4, a, 4. a, -4, 4 Let o = -352 - -2468/7. Suppose 0 + 5 = -4v - d, -2v + 5d - 19 = 0. Let q be 1-35/(-15). Put q, v, o in decreasing order. q, o, v Let s = 169.1 + -169. Sort -3, -1/4, 0.2, s in decreasing order. 0.2, s, -1/4, -3 Suppose -3w - 21 = -0w + 5g, 0 = 2w - 3g + 33. Let p be 40/w(-12)/(-10). Let i be 1/1 + (-3 - -3). Put p, 5, i in increasing order. p, i, 5 Let x = -0.06 + -0.34. Let s = 2.2 + 2.8. Sort 1, s, x in descending order. s, 1, x Let r = -2 + 1. Let v be (6 + -4)-12. Sort r, v, -2 in decreasing order. r, -2, v Suppose 5o + 7 - 12 = 0. Suppose -5l - h - 14 = 3, -2l + 2h - 14 = 0. Sort -2, o, l in ascending order. l, -2, o Let f be 011/2. Suppose f = n + n. Put n, 2, 4 in increasing order. n, 2, 4 Suppose -3f + 5k = -34, 4f + 3k = 4k + 68. Put 1, 5, f, -5 in decreasing order. f, 5, 1, -5 Let g = -4 + 6. Let v = 4 + 16. Suppose 0 = 2n + 2z + 4, gn + z = 7n - v. Sort 5, 1, n. 1, n, 5 Let x(t) = -t. Let r be x(-3). Let o be r1/(-3)1. Let c be (-3)/7 - (-77)/(-49). Put c, o, 4 in increasing order. c, o, 4 Let i = -49 + 45. Sort -2, i, -0.5 in decreasing order. -0.5, -2, i Let o(b) = 3b - 46. Let t be o(17). Put t, 2, 0, 21 in descending order. 21, t, 2, 0 Let a be 1(0 - -3) + 1. Let y be (-2)/4 + (-45)/(-6). Let b = -8 + y. Put b, a, -4 in increasing order. -4, b, a Let k = 0.154 + -0.014. Sort -0.3, -2, k, -0.2 in decreasing order. k, -0.2, -0.3, -2 Let p(d) = d + 5. Let a be p(-8). Put -4, a, -5, 4 in ascending order. -5, -4, a, 4 Suppose -3l - 4b = -1, -1 = 4l + 2b + b. Suppose 0 = -4s + s - 6. Put s, l, -4 in increasing order. -4, s, l Suppose -5n - 9 = 16, 9 = 3a - 3n. Sort -3, a, 3 in increasing order. -3, a, 3 Let w = -26 - -27. Sort w, 2, -4 in descending order. 2, w, -4 Let j = 0.23 - 4.23. Let f = 141/2 + -73. Sort f, j, -2. j, f, -2 Let h be (-4 - (-206)/44) + 2/(-4). Sort -3, h, 5, -4 in increasing order. -4, -3, h, 5 Let o be (-8)/(-6)3 - -3. Suppose -p = -6 - o. Sort p, 1, -4. -4, 1, p Let f = -12 - -11.9. Sort 0.3, f, 3/4 in decreasing order. 3/4, 0.3, f Let x = 8 + -8. Sort 0.5, -4, x in descending order. 0.5, x, -4 Suppose 3m + 5 = 2m. Put 0, m, -2, -6 in increasing order. -6, m, -2, 0 Let z be (-8)/109/(-12). Put -3/4, z, 0 in decreasing order. z, 0, -3/4 Let y(d) = -d - 3. Let f be y(-6). Suppose 4z - j + f = 3z, 0 = -4z + j - 3. Suppose -3g = -zg - 12. Sort 2, g, 5. 2, g, 5 Let v(u) = u2 - u + 10. Let q be v(0). Suppose 3n - 2 = q. Let p(y) = 2y - 3. Let t be p(3). Sort n, 1, t in descending order. n, t, 1 Let g = -122 + 119. Sort 18, g, -2. g, -2, 18 Let u = -34 + 33.5. Let x = -0.31 - -0.3. Let n = x - -5.01. Put u, 0.5, n in descending order. n, 0.5, u Let a be (-2)/7 - (-30)/7. Let g be a/(-6)6/4. Sort g, -5, 4 in decreasing order. 4, g, -5 Let k(j) = -j*3 + 5j*2 - j + 2. Suppose -l + 4l - 2p = 1, l + 3p + 7 = 0. Let m = l - -6. Let u be k(m). Sort u, 0, 3 in ascending order. u, 0, 3 Suppose -6i + 22 + 2 = 0. Sort i, -9, 5. -9, i, 5 Let x = -0.59 - -2.59. Sort x, 0.2, 3, -4. -4, 0.2, x, 3 Suppose 0 = -u - u - 12. Let g be (u/(-2))/(-3)-5. Let i(m) = m*2 + 8m + 3. Let s be i(-8). Put g, s, -0.1 in descending order. g, s, -0.1 Let o = 8 - 6. Let f = -0.8 - -1.7. Let b = f + -0.4. Sort o, -0.1, b in decreasing order. o, b, -0.1 Let i be (-9)/6 - -2 - -1. Suppose -3n + 5 = p, 3n - n = -2p + 2. Let f = p - -3. Sort i, f, 5/2 in ascending order. i, f, 5/2 Let v(c) = -c + 12. Let k be v(7). Sort -5, 4, k. -5, 4, k Suppose -2o + 8 = q, 0 = 3q + 5o - 2o - 18. Put q, 1, -3 in increasing order. -3, 1, q Let j(a) = -a - a2 - 7 - 4 + 10. Let m be j(-2). Sort m, 4, 0.3 in ascending order. m, 0.3, 4 Let y(k) = -k2 - 6k - 5. Let z be y(-6). Let l = z + 3. Sort l, -2/11, 0.1 in decreasing order. 0.1, -2/11, l Let g be (1 - (-3)/(-9))3. Suppose 9 = 5c - 4u + u, 5u + 15 = c. Let k be 1 + (c - 2 - -4). Sort g, 4, k in increasing order. g, k, 4 Let x be -2(-2)/(-4) - 0. Let a(m) = m + 2. Let l be a(-6). Let j(v) = -v + 11. Let r be j(16). Put l, x, r in ascending order. r, l, x Let p(q) = q. Let u be p(3). Sort -2, u, 5, 4 in ascending order. -2, u, 4, 5 Let z(h) = 19h - 1. Let n be z(1). Suppose 14i - ni = 20. Put i, -2, 3 in descending order. 3, -2, i Let z(f) = 3f - 4. Let u be z(3). Suppose -2d - ui = -21, d - 12 = 2d - 5i. Put d, 1, -4 in descending order. d, 1, -4 Let w = 3 + -1. Put w, 0.12, 0.2 in ascending order. 0.12, 0.2, w Suppose -2j + q + 0 = -9, 0 = -4j - 5q + 11. Let h(v) = v*2 + v + 1. Let w be h(-2). Put w, j, -1 in ascending order. -1, w, j Suppose 3n - 5n - 4 = 0. Let b(i) = -3i - 2. Let p be b(n	{ "pile_set_name": "DM Mathematics" }
4, -282, -434? s*3 - 22s*2 - s + 148 What is the d'th term of -15797, -15722, -15647? 75d - 15872 What is the z'th term of 1885, 3727, 5497, 7159, 8677, 10015? -6z3 + 1884z + 7 What is the n'th term of 194, 816, 1850, 3296, 5154? 206n2 + 4n - 16 What is the y'th term of 232, 259, 84, -299, -896, -1713, -2756, -4031? -y*3 - 95y*2 + 319y + 9 What is the z'th term of 2925, 6040, 9153, 12264? -z*2 + 3118z - 192 What is the i'th term of -102, -257, -438, -657, -926, -1257? -2i3 - i2 - 138i + 39 What is the j'th term of 53, 455, 1549, 3683, 7205, 12463, 19805, 29579? 58j3 - 2j*2 + 2j - 5 What is the z'th term of 334, 657, 1196, 1951, 2922? 108z2 - z + 227 What is the v'th term of 50518, 49981, 49454, 48943, 48454, 47993, 47566? v3 - v2 - 541v + 51059 What is the c'th term of -1365, -1239, -1113, -987, -861? 126c - 1491 What is the p'th term of -30185, -30206, -30225, -30242? p2 - 24p - 30162 What is the v'th term of -435, -1700, -3795, -6714, -10451, -15000? v*3 - 421v*2 - 9v - 6 What is the x'th term of 56929, 56946, 56975, 57022, 57093, 57194? x*3 + 10x + 56918 What is the z'th term of -2150, -2040, -1930, -1820, -1710? 110z - 2260 What is the n'th term of -4404, -8757, -13110, -17463, -21816, -26169? -4353n - 51 What is the p'th term of -356, -360, -364, -368, -372, -376? -4p - 352 What is the y'th term of 17, 73, 181, 347, 577, 877? y3 + 20y*2 - 11y + 7 What is the o'th term of 395, 561, 1025, 1931, 3423, 5645, 8741? 24o3 + 5o*2 - 17o + 383 What is the c'th term of 5601, 5766, 5945, 6144, 6369, 6626? c3 + c2 + 155c + 5444 What is the y'th term of -475, -1753, -3883, -6865? -426y2 - 49 What is the q'th term of -61, -190, -387, -658, -1009, -1446, -1975? -q3 - 28q2 - 38q + 6 What is the d'th term of -23211, -23192, -23171, -23148, -23123? d*2 + 16d - 23228 What is the h'th term of 151, 524, 1131, 1972, 3047? 117h2 + 22h + 12 What is the c'th term of -388, -1499, -3364, -5995, -9404? -2c3 - 365c*2 - 2c - 19 What is the u'th term of 2590, 2727, 2938, 3217, 3558? -u*3 + 43u*2 + 15u + 2533 What is the o'th term of -116, 221, 788, 1585? 115o2 - 8o - 223 What is the i'th term of -18788, -37585, -56382? -18797i + 9 What is the x'th term of 4631222, 4631220, 4631216, 4631210, 4631202? -x2 + x + 4631222 What is the z'th term of -4825, -4833, -4851, -4885, -4941, -5025, -5143? -z3 + z2 - 4z - 4821 What is the o'th term of -63961, -63948, -63919, -63868, -63789? o*3 + 2o*2 - 63964 What is the j'th term of 308, 316, 338, 374, 424? 7j*2 - 13j + 314 What is the o'th term of 21704, 21709, 21704, 21683, 21640, 21569? -o3 + o2 + 9o + 21695 What is the a'th term of 780150, 780151, 780152, 780153? a + 780149 What is the j'th term of -9515, -18999, -28485, -37973, -47463, -56955, -66449? -j2 - 9481j - 33 What is the v'th term of 241725, 241727, 241729, 241731, 241733? 2v + 241723 What is the q'th term of 133578, 267152, 400724, 534294, 667862, 801428? -q2 + 133577q + 2 What is the b'th term of 3049, 3382, 3713, 4042, 4369? -b*2 + 336b + 2714 What is the l'th term of 27888, 55751, 83616, 111483? l*2 + 27860l + 27 What is the g'th term of -3, -30, -83, -180, -339, -578, -915, -1368? -3g3 + 5g*2 - 21g + 16 What is the v'th term of 138459, 553769, 1245945, 2214981, 3460871, 4983609, 6783189? -v*3 + 138439v*2 + 21 What is the k'th term of -3020, -12093, -27214, -48383, -75600? -3024k*2 - k + 5 What is the v'th term of 1709484, 3418969, 5128454? 1709485v - 1 What is the w'th term of 225960, 225964, 225968, 225972? 4w + 225956 What is the g'th term of 28, -169, -704, -1745, -3460, -6017, -9584? -28g3 - g2 + 2g + 55 What is the j'th term of -3657, -14644, -32963, -58620, -91621, -131972, -179679? -j3 - 3660j2 + 4 What is the z'th term of 3170, 3066, 2964, 2864, 2766, 2670, 2576? z2 - 107z + 3276 What is the y'th term of -20316, -81272, -182868, -325104? -20320y*2 + 4y What is the p'th term of 84, -793, -1670, -2547, -3424? -877p + 961 What is the o'th term of 87, 390, 863, 1518, 2367, 3422, 4695? 2o*3 + 73o*2 + 70o - 58 What is the k'th term of -103, -1238, -3165, -5914, -9515, -13998, -19393? -5k3 - 366k*2 - 2k + 270 What is the o'th term of 1039, 887, 731, 571, 407, 239? -2o2 - 146o + 1187 What is the l'th term of 629, 1603, 2925, 4595, 6613, 8979? 174l2 + 452l + 3 What is the y'th term of 889, 1765, 2635, 3499, 4357? -3y2 + 885y + 7 What is the r'th term of 4611, 9240, 13885, 18546, 23223, 27916? 8r2 + 4605r - 2 What is the f'th term of -16926, -33857, -50788? -16931f + 5 What is the n'th term of 4015, 8032, 12049, 16066? 4017n - 2 What is the l'th term of 11548, 11723, 11898? 175l + 11373 What is the b'th term of -28417, -28412, -28397, -28366, -28313? b3 - b2 + b - 28418 What is the t'th term of 658, 1266, 1850, 2398, 2898? -2t*3 + 622t + 38 What is the d'th term of -1661, -3383, -5113, -6851? -4d2 - 1710d + 53 What is the y'th term of -2454, -2607, -2760, -2913, -3066, -3219? -153y - 2301 What is the f'th term of -194, -792, -1798, -3212? -204f*2 + 14f - 4 What is the a'th term of 26742, 53498, 80254, 107004, 133742, 160462? -a*3 + 6a*2 + 26745a - 8 What is the b'th term of -25, -65, -191, -445, -869, -1505, -2395, -3581? -7b3 - b2 + 12b - 29 What is the g'th term of 1320066, 2640132, 3960198, 5280264, 6600330? 1320066g What is the i'th term of -680, -2734, -6142, -10892, -16972? 2i*3 - 689i*2 - i + 8 What is the l'th term of -47137, -188563, -424273, -754267, -1178545? -47142l*2 + 5 What is the m'th term of -2025, -3900, -5775? -1875m - 150 What is the h'th term of -10672, -21345, -32018, -42691? -10673h + 1 What is the c'th term of 9615, 9611, 9605, 9597? -c2 - c + 9617 What is the w'th term of 6130, 12256, 18382? 6126w + 4 What is the o'th term of 9701, 9783, 9865, 9947? 82o + 9619 What is the v'th term of 106, 636, 1496, 2668, 4134, 5876, 7876? -3v*3 + 183v*2 + 2v - 76 What is the n'th term of 1722, 6030, 13216, 23286, 36246, 52102? n*3 + 1433n*2 + 2n + 286 What is the b'th term of 166317, 166312, 166305, 166296, 166285, 166272, 166257? -b*2 - 2b + 166320 What is the v'th term of -51, 23, 369, 1125, 2429, 4419, 7233, 11009? 23v3 - 2v*2 - 81v + 9 What is the a'th term of 835, 805, 751, 661, 523, 325, 55, -299? -2a3 - 16a + 853 What is the o'th term of 277, 639, 1001? 362o - 85 What is the j'th term of -11310, -22623, -33936, -45249? -11313j + 3 What is the a'th term of -90, -411, -1262, -2907, -5610, -9635, -15246, -22707? -44a3 - a2 - 10a - 35 What is the q'th term of -6272, -24614, -55184, -97982? -6114q2 - 158 What is the g'th term of -776, -1715, -2660, -3617, -4592, -5591, -6620? -g3 + 3g*2 - 941g + 163 What is the c'th term of 2326, 2354, 2408, 2500, 2642, 2846, 3124? 2c3 + c2 + 11c + 2312 What is the w'th term of 511, 444, 373, 298, 219, 136, 49? -2w2 - 61w + 574 What is the r'th term of 645, 5079, 17073, 40407, 78861, 136215, 216249? 630r3 + 24r - 9 What is the g'th term of 44320, 44324, 44328, 44332, 44336, 44340? 4g + 44316 What is the d'th term of 7244, 14490, 21736? 7246d - 2 What is the y'th term of -439, -844, -1215, -1534, -1783, -1944? 3y3 - y2 - 423y - 18 What is the j'th term of -18174, -36349, -54524? -18175j + 1 What is the i'th term of 106153, 106151, 106149, 106147? -2i + 106155 What is the p'th term of 91, 112, 133, 154, 175, 196? 21p + 70 What is the h'th term of 38386, 76766, 115146, 153526, 191906, 230286? 38380h + 6 What is the p'th term of 40, 1199, 3122, 5803, 9236, 13415? -p*3 + 388p*2 + 2p - 349 What is the q'th term of 445075, 445074, 445073? -q + 445076 What is the x'th term of -998, -1050, -1102, -1154, -1206, -1258? -52x - 946 What is the b'th term of 11205, 11206, 11207, 11208? b + 11204 What is the q'th term of 688, 703, 726, 757? 4q*2 + 3q + 681 What is the j'th term of 3374, 3284, 3194, 3104? -90j + 3464 What is the b'th term of 31902, 255207, 861314, 2041623, 3987534, 6890447, 10941762? 31900b3 + b2 + 2b - 1 What is the u'th term of -474458, -474455, -474452, -474449, -474446? 3u - 474461 What is the m'th term of 102, 222,	{ "pile_set_name": "DM Mathematics" }
+ 98. Which is the nearest to -3? (a) 1/6 (b) h (c) -0.4 c Let g = -0.165 + 129.165. Let m = g - 123.1. Let a = 6 - m. What is the closest to -1 in a, 2, 2/5? a Let l = -1.814 + 1.614. Let q = -0.41 + -0.09. Which is the nearest to 1? (a) 0 (b) q (c) l a Let p be (-8)/6021 - -4. Let l = 7.84 + -7.64. What is the closest to l in 0.06, 1/11, p? 1/11 Let l = 28.7 + 9.2. Let v = -36 + l. Let k = -3 - -3. Which is the nearest to k? (a) 2/5 (b) -0.1 (c) v b Let j = -5580 + 5583. What is the nearest to -0.4 in j, 2/7, -9? 2/7 Let k = -44 - -43.7. Let w = 86 + -86.2. Let q be (-3)/(3/10)3/6. What is the closest to -1 in q, k, w? k Let h = 43.8 + -43.8. Let n = -424 + 8058/19. Which is the closest to -2/17? (a) h (b) -3/2 (c) n a Suppose -5y - 3h = -9, 19 = 4y - 2h + 25. What is the nearest to 2 in y, -2, 1/2, -0.01? 1/2 Let u = -25.627 - -25.727. What is the nearest to u in 4, 1/7, 1/27, 35? 1/7 Let r = 365.9 - 366. Let s = -97 + 101. What is the closest to r in 0.1, 7, s? 0.1 Let x(l) = 206l3 - 3l*2 - 3l - 1. Let p be x(-1). Let d = 214 + p. What is the nearest to 0.2 in d, 5, 2? 2 Let f = -5.1 - -5. Suppose 3l = -5w - 22, 5w - 879l + 874l = -70. Which is the closest to w? (a) -2/11 (b) f (c) -2 c Let t = -4.1966 + 1.1966. What is the closest to 0 in 0.8, 0.02, 0, t? 0 Let d = -0.195 - -9.895. Let j = 9.3 + d. Let y = j - 20. Which is the closest to 2? (a) -5 (b) y (c) 1/4 c Let y = 2.44 - 4.18. Let h = -1.68 - y. Which is the closest to h? (a) 2/11 (b) -5 (c) 2/5 a Suppose -5j - 603 + 1866 = -t, -759 = -3j + t. Let s be (6 + 1 + 0)72/j. Which is the nearest to 2? (a) 0.4 (b) s (c) 2/3 b Let m be (-28)/(-10) + -4 + 25/125. What is the nearest to 2/5 in m, -0.04, 0.3, 4? 0.3 Let r = -17684 + 477473/27. What is the nearest to -1 in -0.2, -0.3, r? -0.3 Let t(f) = -2f2 + 44f - 234. Let w be t(13). Which is the closest to -2/3? (a) w (b) -6 (c) -2/105 c Let z = 1649/25284 + -11/588. Which is the nearest to 0.05? (a) z (b) 8 (c) 0.5 a Suppose 3d - 3k = 81, 2d + 83 = 5d - 5k. Let u = d + -77/3. Let w = 3629.1 - 3629. Which is the closest to w? (a) -1/4 (b) -3 (c) u c Let d = 10031 + -10031.1. Which is the closest to d? (a) 1 (b) -0.3 (c) -34 b Let m = -2.77 - 0.23. Let i be 13/13 - 127/21. Let z = -0.2 + 0. What is the nearest to i in m, z, 3? z Let w = -18.23 + -391.17. Let p = 371.46 + w. Let s = 38 + p. What is the closest to 0 in s, 2/17, -0.5? s Let o = 248 - 667. Let z = -420 - o. Let p = 2/7 - -1/21. Which is the nearest to p? (a) 3 (b) -5 (c) z c Let v be 2 + (-2)/4 + (-9)/6. Which is the nearest to 0? (a) -1/3 (b) 3/11 (c) 1/5 (d) v d Let v(l) = -l*3 - 41l*2 + 88l + 87. Let c be v(-43). Let k = -2.76 - -0.76. What is the closest to k in -1, -0.06, c? -1 Let q = 308 - 23. Let x = q + -283. Which is the nearest to 0? (a) -4 (b) 8 (c) x c Let p = -1 - -3. Let z = -1104 + 1103. Let d = -0.3 - -0.2. What is the nearest to d in -2/5, z, p? -2/5 Let i = -24.75 - -22.05. What is the closest to i in -4, 1/3, 0? -4 Let b = -0.82 + 1.88. Let i = 0.06 - b. Let v = 4.5 + -0.5. What is the nearest to i in v, 5, -2? -2 Let y = 4 - 7. Let i = -100 - -87.9. Let k = -17.1 - i. Which is the closest to 1/2? (a) -4 (b) k (c) y c Suppose -3v - 18 = -f, -237f - 23 = -238f + 4v. Let t = -2 - -1.9. Which is the nearest to -1? (a) 0 (b) t (c) f b Let g = 553.11 - 5.11. Let v = -573 + g. Let x = 0.3 + 0.7. Which is the nearest to v? (a) x (b) 5 (c) 4 a Let x = -4.8 + 23.1. Let z = x + -18.3. Let k = -1.97 + -0.03. Which is the nearest to z? (a) 5 (b) 3 (c) k c Suppose -2t - 2o - 2o = 48, 0 = -4t + o - 69. Let y = t - -145/8. Let v = 1586 + -1585. What is the closest to v in 0.1, y, 1? 1 Let o = -241/3 - -79. Let h be (455/(-23))/7 - (-6)/2. Let p = -15/46 - h. Which is the nearest to p? (a) -0.3 (b) o (c) 3/8 a Let n = 684 - 685. Let m = 0.06 + -0.03. Let j = -4.03 + m. Which is the closest to 0? (a) 0 (b) j (c) n a Let f = 396 - 401. Let u = -10 - -21. Let t = 12 - u. Which is the nearest to 4/5? (a) f (b) -0.1 (c) t c Let h = 2.9 - 25.9. Let a = 23.1 + h. Let t = 137/3 + -46. What is the closest to a in 1, t, 2/5? 2/5 Let v be (1/(-6))/(2/(-6)). Let j = 12/71 + -1402/7455. Let p = -323/420 - j. Which is the closest to -0.3? (a) v (b) -0.3 (c) p b Let h be (-72)/(-30) - 2/5. Suppose i = -hu + 7 - 0, 0 = -i - 3u + 12. What is the closest to 0.1 in 2, i, 1/2? 1/2 Suppose -286x + 339x - 8321 = 0. What is the nearest to 0.1 in x, 12, -4? -4 Let n = -9.0508 - -7.0508. Let q = -0.5 + 1. Which is the closest to 0.04? (a) n (b) -4 (c) q c Suppose -2s - 2t = -2, -3t - 2t + 11 = -s. Let y be s - (-2 + (-12)/(-10)). Let b = -48.898 - -48.798. What is the nearest to b in 0.4, -13, y? y Let o = -0.22 + 110.22. Let v = -4646 - -4536. Let k = o + v. Which is the closest to 0.2? (a) k (b) 4 (c) -1/2 a Let g = -6 - -8. Let c = 2.1 - g. Let r = -49327/123315 + 1/123315. What is the closest to c in 4/5, 0.1, r? 0.1 Let q = -22575 - -22577. Which is the nearest to q? (a) -2 (b) 0.2 (c) -1/793 b Let h = 3 + -4. Let u = -395.14 + 10.74. Let t = u - -384. What is the closest to -3/7 in 0, t, h? t Let c(f) = f*2 - f - 11. Suppose -4 = -d - 0d. Let z be c(d). Let r = 5.4 - 5.2. What is the closest to z in r, 5, -2? r Let r(s) = 131s2 + 8s - 7. Let t be r(1). Let i = t + -137. Let k = 0 + -0.4. Which is the closest to i? (a) 4 (b) k (c) -4 c Let k = 43 + -7.3. Let j = 36 - k. Which is the nearest to -0.3? (a) -8 (b) j (c) -5 b Let i = -4221.7 + 4219. Which is the nearest to 0.1? (a) -2/7 (b) 0 (c) i b Let d = 0.0786 - -413.9214. Let p = -410 + d. Which is the closest to -0.3? (a) -7/2 (b) p (c) -6/5 c Let m = 55.311 + -54.311. Let o = 0.3 + 0.2. Let d = 4.8 + -5. What is the closest to 15 in d, m, o? m Suppose 11q - 9q - 12 = g, 0 = -2g - 3q - 10. Which is the closest to 1? (a) g (b) 0 (c) 1/9 c Let t = 12 + -12.4. What is the closest to 4/9 in 1, -15, t, -2/3? 1 Let y = 0.00947 - -0.49053. Which is the closest to 0? (a) 3 (b) y (c) 0.0989 c Let t = 111 - 110.894. Let x = -0.606 + t. Which is the closest to 4? (a) 0.5 (b) 2 (c) x b Let p = 1/71822 + 10916801/10270546. Let g = 10/11 - p. What is the closest to -1 in g, -2, -1/6, -1/5? -1/5 Let k = 4.458 + -2.458. What is the closest to k in -3, 48, 31? -3 Let t = -3/149 + 462/745. Which is the closest to 18? (a) 1 (b) 6/11 (c) t a Let r(i) = 118i + 114. Let j be r(-1). Let g = 23 + -44. Let w = -17 - g. Which is the closest to -5? (a) j (b) w (c) 2 a Let k = -14500 - -14499.8. What is the nearest to 0.1 in 2/13, -67, k? 2/13 Let s = -54 - -69.8. Let o = s - 15.9. Which is the closest to 1? (a) -4 (b) o (c) -5 b Let x = -142 + -279. Let v = x + 420. What is the nearest to v in 3, 1/3, 42/13? 1/3 Let y = 10 + -3. Let a = -54 - -62. Let l = a - y. What is the nearest to -2 in -1/5, 5, l? -1/5 Let o = 2247 + -1986.2. Let x = o + -261. Which is the closest to -2? (a) -1/4 (b) x (c) 2 a Suppose m + 143 = -31. Let w = m - -524/3. Let l = -0.2 + -0.3. Which is the closest to w? (a) l (b) 1/3 (c) 48 b Let z be (-12)/970(-390)/156. Let x = -179/485 - z. What is the closest to 0.2 in -3, x, 2, -4? x Let i(x) = -x*3 + 17x*2 - 3x + 46. Let q be i(17). Let r = -9 - -8.9. What is the closest to r in q, 0, 0.09? 0 Suppose 5s + 5x = 20, 1 = 5s + 2x - 19. Let p be s/8(-5 + (3 - -2)). Which is the nearest to p? (a) 10 (b) -1/3 (c) -2 (d) 1/7 d Let l = -1257/5 - -252. Which is the nearest to -18? (a) 5 (b) -1/28 (c) l b Let u = 277771/80 - 3472. Let w = 15/16 - u. Which is the closest to 0.1? (a) 0.5 (b) w (c) 1 a Let p be ((-16)/(-168))/((-136)/112 + 1). Which is the closest to -151? (a) 1/4 (b) -2 (c) p b Suppose -5p - 9 = -5r - 4p, -r = 5p + 19. Let u be (-1299)/(-2165)(-10)/(-18). What is the nearest to r in -18, 0, u? u Suppose 2x = 0, -t - 5x + 1 = -2. Let u = 3/10 - 7/15. Let s = -1/30 + u. Which is the closest to -1/3? (a) t (b) -0.12 (c) s c Let r = -196.2 + 160. Let k = 38.2 + r. Let v = -0.2 + 0.4. Which is the closest to v? (a) 0.2 (b) k (c) 0 a Let s = -16/33 - 2/11. Let f = 16721 + -16721. Which is the nearest to f? (a) 5 (b) s (c) 17 b Sup	{ "pile_set_name": "DM Mathematics" }
u, -12673u = -q - 6334u - 6343u + 75 for q. 63 Solve -432n + 9 = -3z - 437n, 4n = 12 for z. -8 Solve -3c = 4u - 6 - 6, -103c - 124 = -20u - 102c for u. 6 Solve 12o + 21772 - 21715 = -r, -4r = -2o - 22 for r. 3 Solve 4r = 2n - 86, 4n - 905 + 848 = 3r for r. -23 Solve 1320o + j + 2 = 1322o, -7j = -o - 4j - 4 for o. 2 Solve -t - 6353m + 26 = -3171m - 3180m, -5t - 11m = -143 for t. 0 Solve f = -36s - 5, f + 68s - 70s = -5 for f. -5 Solve 3u + 6 - 201 = -2u, -2k - 37 = -22k - 3u for k. -4 Solve -5m - 676248q - 30 = -676253q, -8 = -2m - 2q for m. -1 Solve 8d = -5s - 64, -133114d - 4s = -133109d + 47 for d. -3 Solve -33z + 46z + 912 = 25t, -5t + 78 = 3z - 2z - 108 for z. 1 Solve -1602v - 1 = -1607v - s, -v + 4s = -17 for v. 1 Solve 3k - 6k = -22j + 2, 5k + 170 = -15j + 10j for k. -30 Solve -3z + 9 = 0, -2g - 20z + 7z + 9 = -9z - 9 for g. 3 Solve z - 9 = 5w - 14, 4w - 2408z = -2409z - 23 for w. -2 Solve -69 = 5u + c, -9489c = 12u - 9490c + 152 for u. -13 Solve -18s - t = 82, -2t = -3s - 0s + 1516 - 1547 for s. -5 Solve -3y = -u - 2, -44400y + 44411y - 12 = -u for u. 1 Solve -184129 + 184255 = 2r - 14x + 2x, -2r - x = 3x + 31 + 19 for r. -3 Solve -2a - 71s + 612 = 2811, 5a - 4s = 129 for a. 1 Solve -4b - 18i + 14i + 108 = 0, 4b = 496i - 497i + 99 for b. 24 Solve -6l + 2l + 82y - 80y - 5 + 21 = 0, 3y + 24 = -3l for l. 0 Solve -2d - 6 = c, -5c - 7129d + 26 = -7133d for c. 2 Solve -76i - 29 = -79i - 7y, -y + 5y = -5i + 10 for i. -2 Solve -11a + 47 = 3d, -3156d - a = -3163d + 3 for d. 1 Solve -4o = -16r - 162 + 170, -3o + 5o - r = -5 + 1 for o. -2 Solve 5p + 0 = 3t + 27, -10p - 36 = -3p + 6p + 4t for p. 0 Solve -2l + 58885c - 11 = 58888c, 3l + 8 = 4l - 3c for l. -1 Solve -3d + 181 = -5i + 106, 0 = 9i + d - 25 for i. 0 Solve 3v = -94d - 132, -2d = -2007v + 2010v + 132 for v. -44 Solve 10l - 14 = -3u, 3u + 600l = 598l - 2 for u. -2 Solve -20n + 240 = 0, 58b + 3n - 121 - 105 = -100b + 14 - 25 - 21 for b. 1 Solve -k + 1317929 = 3j + 1317981, 5k + j = -8 for k. 2 Solve j + 681z = 5j + 685z - 32, -2z + 23 = -10j + 115 for j. 9 Solve 0 = -5v + 12780a - 12784a - 224, -5v = -16v - 3a - 516 for v. -48 Solve 2j + f - 5f - f + 23 = -4f - 2, 7j + 234 = -143f for j. -13 Solve -y + 981 = -2q - 989 + 1986, 0 = -3q - 6y + 9 for q. 7 Solve 5925n = 3w + 5924n + 7, 7w - 5n + 3 = 0 for w. -4 Solve -18210r + 3a - 44 = -18217r, r + 3a - 68 = 0 for r. -4 Solve 6b + 2y - 690 = -11y - 20y + 81, 0 = 2b - y + 19 for b. 2 Solve 0 = -h + 2y - 29, 0y + 70 - 121 = 2y - 77 for h. -3 Solve -4v + 2f = -22 + 44 - 10, 2v - 3f = -6 for v. -3 Solve -7206q = -6976q + 690, -15 = -2d - 3q for d. 12 Solve 945h - 946h + 73 = 4a, 16a - 254 = -3h + 33 for h. 5 Solve 15q - 10q + 136 = -58n, -6q - 4n = -q + 26 + 2 for q. -4 Solve -2d = -0d + 21 - 11, s - 3d + 15 = 4s for s. 10 Solve -5i = -3v + v - 293, -98v + 2i + 67 = 325 + 248 for v. -4 Solve 2r + 76411z - 76408z = -14, 5z + 45 = r for r. 5 Solve 9i - x = 7i - 13, 7i + 379 - 405 = -2x for i. 0 Solve 67 = 4q + 61s - 60s, 0 = -6q - 111s - 447 for q. 18 Solve -4g = 4l - 48, -11g + 15g - 3l = -2l + 4l - 24 for g. 4 Solve 4s - 6t + t + 73 = 0, s + 13t - 17 = -3s - 0t + 8t for s. -7 Solve 3m = 11l + 274 - 194, 4l = 3m + l - 48 for m. 12 Solve -2y = 4b + 86, -3b + 8y = 2319 - 2283 for b. -20 Solve 33 = -5z - w, -5 - 57 - 6 = 11z + 2w for z. -2 Solve 2l + 103498w = 103502w - 20, -3l + 9w - 39 = 0 for l. -4 Solve 9k = 2u + 119 + 95, 5u + 3k = 7k - 91 for u. 1 Solve 10v + 30 = 0, -3h - 5v + 40 + 77 = -6h for h. -44 Solve 4l - 14 = 10t, 0 = l - 5t - 9440 + 9429 for l. -4 Solve 5x + 3y - 2 = -y, 2x - 6x - 26 = -x + 16y for x. 2 Solve 47f + r + 4r = 44f + 25, -27r + 32r + 5 = 0 for f. 10 Solve 3t - 1076o + 1080o = -47, -3t - 2o = 25 for t. -1 Solve 0 = 4c - 27m - 509, 3c + 3m + 466 = -m + 387 for c. -1 Solve -7m + 43s - 79s + 22 = -41s, 3m - 3s = 12 for m. 1 Solve 2q = 2p - 2, -56p = -53p + 6q + 6 for p. 0 Solve z - 60 = -4k, 41k + 21z = -10k + 22z + 710 for k. 14 Solve 18d - 5p + 205 = 0, -d - 6p + 1529 = 1396 for d. -5 Solve -84 = -440z + 873z - 431z - 4x, 3z + 2x - 50 = 0 for z. 2 Solve 4b - 3074479d - 56 = -3074495d, 0 = 2b - 3d - 5 - 1 for b. 6 Solve 2o = o + 21m - 43, -510o + 509o = -3m + 7 for o. -1 Solve -24z + 28z - 2x + 10 = 0, -2002z + 2x = -2004z + 16 for z. 1 Solve 6r + 69552 = -2p + 69544, 0 = -3p + 4r - 25 for p. -7 Solve -4 = 44v - 42v, 0s - s - 3v - 4 + 0 = 0 for s. 2 Solve -4v + h + 4h = -3, -23577v + 23581v = 3h - 3 for v. -3 Solve -g = -s + 138499 - 138492, 0 = -4g - 5s + 8 for g. -3 Solve 59s - 44s - 222 = -3n, -16s + 17s = -3n + 264 for n. 89 Solve 0 = -5z - b - 140, 5b = -508z + 503z - 10 - 150 for z. -27 Solve -z + 60 = -4u, -98z + 72u - 76u = -336 for z. 4 Solve 3c = 4r - 0 - 25 + 3, -74 = 13c + 7r - 3r for c. -6 Solve 4g = 2y - 92, 3y + 5g + 2607 - 2503 = 0 for y. 2 Solve -158l + 154l = 2o + 170, -134o + 446 = -l for o. 3 Solve 8c + 16c - 3159k + 20 = -3158k, 0 = -3k - 84 for c. -2 Solve -5p + 135 = -3r, 2r - 64052p = -64112p + 1430 for r. -5 Solve 3277u + 4h + 66 = 6558u - 3279u, -14 = -u + h for u. -5 Solve -4t = 16, -4t - 340 = -4x + 12t + 7t + 58t for x. 4 Solve -2c - 2c = s + 18, 469c - 467c - 5s = 90 for c. 0 Solve 304c - 298c + 14 = 2h, -5h + 3c + 1 - 14 = 0 for h. -5 Solve 1103j - 1106j = 9, -36j - 19 = 4g - 31j for g. -1 Solve r - 13 = 5q, -8q - 14 = 11902r - 11907r for r. -2 Solve g + 3g - 2s = -g + 95, -4s - 36 - 99 = -31s for g. 21 Solve -5t + 21 = -d, -71266t - d + 9 = -71262t - 6 for t. 4 Solve -21a + 3c + 102 = 0, -125a = -311a + 185a + 4c + 1 for a. 5 Solve -o - 3o + 27t = -70, 4t = 263o - 264o - 4 for o. 4 Solve 7c = -150h + 154h + 12c + 12, 6h = -3c - 18 for h. -3 Solve 24r - 26r + 6z = -30, z = 5r - 118 - 27 for r. 30 Solve 2t - d + 2 = 6t + 7, 214t - 3d + 889 = 0 for t. -4 Solve -t - 4u + 186718 = 186677, 0 = 5t - 3u - 228 for t. 45 Solve -n - 2i = -0n + 3027 - 1492 - 1506, -5n = 4i + 67 for n. -3 Solve u - k - 14 = 0, 61637u - 2k - 253 = 61610u for u. 9 Solve 382u - 405u + 101 = -4o, 0 = -3o + 3u - 33 for o. -8 Solve -3t - 75 = -4k, -102t + 106t + 113 = k for t. -29 Solve 3t - 2t = -3v - 14, 40t - 45t = -22v + 107 for t. -17 Solve -100v - 94v + 293v + 13j - 41 - 16 = 97v, -16v = -5j - 129 for v. 9 Solve 9a - 12 = 3c, 13a = 5c + 19a - 11a for c. 2 Solve -g = -66p + 527 - 466, -3g + 3p = -12 for g. 5 Solve -318 = -5z + 4r - 240, -8 = 2r + 26 for z. 2 Solve 4m - 92 = 8o, -215m + 8o = -212m - 75 for m. 17 Solve 97l = 983p - 1961p + 983p - 147, l = -2p + 19 for p. 10 Solve 32 = -4i, 4k - i - 49838 + 49826 = 0 for k. 1 Solve -j - 10 = -3o, -3j - 175o + 95o - 66 = -98o for j. 2 Solve -2d - 14 = 0, 3n + 3d + 32 = -19 + 33 for n. 1 Solve 4y = -2v - 4, -3v + 228 = -y + 241 for v. -4 Solve -3p + 3s = -27, 33s - 17s = p + 20s + 16 for p. 4 Solve 44 = -3s - a, -25 - 44 = 3s + 5a - 5 for s. -13 Solve 6n - 68 = -4d + 3n - 2n + 2n, -2d + 116 = 22n for d. 14 Solve -4o - 14 = 3j + 1, -8j + o + 234 = 274 for j. -5 Solve -36a + 11a - 26 = 5y - 17a, -24 = 7y + 5a for y. -2 Solve 2d - 5 - 24 - 1 = -8v + 5v, 6d - 7v + 38 = 0 for d. 3 Solve -22i = -4s + 102, 2i + 85s - 73s - 102 = 0 for i. -3 Solve 0 = 3l + 2y - 26, y = 11l - 35633 + 35546 for l. 8 Solve 43d = 41d + 6t + 68, 31 = -d - d - 3t for d. 1 Solve 8r - 2i - 186 = 0, -435r + 5i + 6 = -436r + 24 for r. 23 Solve -5x = 3v - 12, 3365x - 27 = 3362x - 4v for x. -3 Solve 0 = 4v - 5f + 4f + 15, -7393v + 7388v = -5f for v. -5 Solve -4p - 339870c + 65 = -339873c, -3c = p - 5 for p. 14 Solve 318d = 4p + 315d + 77, 0 = -5p + 3d - 97 for p. -20 Solve -2v + 29z + 48 = 0, -4v - v + 0v = z - 80 + 107 for v. -5 Solve 6x + v - 83 = -257, 73v - 168v + 145 = -5x - 97v for x. -29 Solve -q = 4b - 12, -2b + 4455 = 3q + 4459 fo	{ "pile_set_name": "DM Mathematics" }
+ -1). -40sqrt(13) + 4612 Simplify (0 + ((sqrt(130) - (sqrt(130) - sqrt(130)3))5)/((sqrt(200)/sqrt(5))/sqrt(4)))2. 2925 Simplify (2sqrt(84)-3)/(-4sqrt(63) - (sqrt(7) + sqrt(7)-2-3 + sqrt(7))). 3sqrt(3)/5 Simplify (-5 + (sqrt(567) + 1 - sqrt(567)) + -4 - (3 + -1sqrt(567) + -3))*2. -144sqrt(7) + 631 Simplify (sqrt(528) - -2sqrt(528)-1)/((sqrt(12) - (-1sqrt(12) - sqrt(12)))-4 - sqrt(12)). 2sqrt(11)/13 Simplify (sqrt(15)/(sqrt(10)/sqrt(2))-3 + 1 + 2sqrt(6)/sqrt(18) + 0)2. -14sqrt(3)/3 + 52/3 Simplify (6(sqrt(36) + (sqrt(2916)2 - sqrt(36))))/(1(sqrt(108)-1 - sqrt(12))). -27sqrt(3) Simplify (sqrt(76) - (2((sqrt(76) - sqrt(76)2) + sqrt(76) - sqrt(76)) - sqrt(76)))/(sqrt(28)/(-3sqrt(7))). -12sqrt(19) Simplify (sqrt(63)/sqrt(441) + 0 + sqrt(28)/sqrt(4))2 - ((-1sqrt(35)-1)/(sqrt(5) + (sqrt(5) - (-6(sqrt(5)2 - sqrt(5)) - sqrt(5)))))2. 5135/567 Simplify (sqrt(3456)-1)/((sqrt(288) - (sqrt(288) - sqrt(288)2)) + sqrt(288)). -2sqrt(3)/3 Simplify (4(2 + 2 + 3 + sqrt(567) + sqrt(567) + 1))2. 4608sqrt(7) + 37312 Simplify (((-5 + sqrt(1872) + 0)*2 - sqrt(1872)) + (sqrt(1872)-2)*25)-1. -39337 + 132sqrt(13) Simplify -3 + ((sqrt(152) - sqrt(152)21)/sqrt(8) - ((1sqrt(19)5)*2 + 4)). -482 - sqrt(19) Simplify 6((sqrt(1377) + 0 + sqrt(1377) + sqrt(1377))1 + 4)-6. -972sqrt(17) - 144 Simplify (31sqrt(88)1)/(6sqrt(128)1). sqrt(11)/8 Simplify (sqrt(2) - -1(sqrt(2)-1 - sqrt(2))) + 0 + (sqrt(50) - (-1 + sqrt(50))2)2. -21sqrt(2) + 54 Simplify -5 + 3(sqrt(1980)-4)/sqrt(5). -72sqrt(11) - 5 Simplify (3(sqrt(190) - -52sqrt(190)))/(4-2sqrt(490))1. -33sqrt(19)/56 Simplify ((5 + (sqrt(80) - (-1 + sqrt(80)) - sqrt(80)) - (sqrt(80) + 1 + 0)) + -5)*2 + 2. 322 Simplify sqrt(550)/sqrt(275)5 - (sqrt(8)/(sqrt(24)/sqrt(6)) + sqrt(8) + -5). 2sqrt(2) + 5 Simplify ((sqrt(70) + (sqrt(70)-1 - sqrt(70)))2 - (sqrt(70) - (sqrt(70)2 + sqrt(70)))-6)/((1sqrt(1000) - sqrt(1000)) + (sqrt(640) + sqrt(40))/sqrt(4)). -14sqrt(7)/5 Simplify ((1sqrt(9)2-3)/(3sqrt(12)/sqrt(4)1))*2. 12 Simplify (((sqrt(800) - (sqrt(800) - (sqrt(800) + sqrt(800) + sqrt(800)1 - sqrt(800)) - sqrt(800)))/sqrt(2))/(sqrt(24)/sqrt(3)6 + sqrt(8) + 2sqrt(968)))*2. 450/841 Simplify (sqrt(130)1 - sqrt(130) - sqrt(130))/sqrt(10) + sqrt(117)/sqrt(441) + (sqrt(143)/(sqrt(11)-2) - sqrt(78)/(sqrt(42)/sqrt(7))). -33sqrt(13)/14 Simplify (2(sqrt(22) + (-2sqrt(22)4 - sqrt(22))))/(1(sqrt(11) + sqrt(44)/sqrt(4))-6). 4sqrt(2)/3 Simplify (sqrt(150)/sqrt(250) + (sqrt(15) - sqrt(240))2)/(3sqrt(189)/sqrt(7)). -29sqrt(5)/45 Simplify (((-1 + sqrt(637))-6)*2 - sqrt(637)-3-1)-2. -45936 + 1050sqrt(13) Simplify (5(1 + sqrt(847)))*2 - ((-1 + sqrt(7))-2 + sqrt(28)-2). 556sqrt(7) + 21198 Simplify (0 + -6sqrt(1539)1)2 + (-2 + sqrt(38)/(sqrt(2) - sqrt(16)/sqrt(200)))2. -5sqrt(19) + 887003/16 Simplify (1sqrt(30)/sqrt(5) - sqrt(6))/sqrt(3) - (-2 + (sqrt(22)-6)/sqrt(11)). 2 + 6sqrt(2) Simplify ((sqrt(8) + 3(sqrt(8) - sqrt(8)-2 - sqrt(8)) + (sqrt(72)/sqrt(3) + sqrt(24))/sqrt(3))/(-6sqrt(196)1 - sqrt(196)))*2. 162/2401 Simplify (4 + sqrt(63) - sqrt(49)/(sqrt(7) - -1sqrt(7)))2 - (5 + (sqrt(343) - (-1 + sqrt(343)))2). 20sqrt(7) + 215/4 Simplify (sqrt(1134) + (sqrt(1134) - (sqrt(1134)-2 - sqrt(1134) - sqrt(1134))6) + sqrt(1134))/(-4sqrt(10)/sqrt(180)). -729sqrt(7)/2 Simplify (-1 + sqrt(500))2 + 3 + (5sqrt(80) - -1sqrt(10)/sqrt(2)). sqrt(5) + 504 Simplify -1 + (sqrt(4050) - (sqrt(4050) + ((sqrt(4050) - ((sqrt(4050) + 0 - sqrt(4050)) + sqrt(4050))) + 4)2)). -17 Simplify ((-3sqrt(800))/(sqrt(50)/sqrt(5)3))2. 80 Simplify ((sqrt(3) - (sqrt(3) + 2sqrt(3)2 - sqrt(3))) + -2sqrt(27))*2 - sqrt(12)/((sqrt(36) - (sqrt(36) - sqrt(180)/sqrt(5)))/sqrt(9)). -sqrt(3) + 243 Simplify sqrt(11) + (sqrt(1331)1)2 + (sqrt(891) + sqrt(891) + 1)2 + (-1sqrt(1331) - sqrt(1331)) + 3. 15sqrt(11) + 4899 Simplify (sqrt(1728) - -1sqrt(1728))/sqrt(9) + ((sqrt(9)/sqrt(3))2-3 - sqrt(3)) + sqrt(3)2-5 + sqrt(3). -9 + 6sqrt(3) Simplify 5((sqrt(847)2 - sqrt(847))5 - (-5 + sqrt(847) + sqrt(847)3))2. 550sqrt(7) + 4360 Simplify (6(2 + sqrt(34)/sqrt(2) + 3 + 5 + sqrt(425) + 4))2. 6048sqrt(17) + 29088 Simplify (sqrt(121)14 - sqrt(121))/(sqrt(99)1). sqrt(11) Simplify (sqrt(8)2 + sqrt(8))5 - ((sqrt(128) + 2)2 + -5). -127 - 2sqrt(2) Simplify (-5sqrt(48)/sqrt(8))/(sqrt(30)/(-4sqrt(10))). 20sqrt(2) Simplify -11(1 + 1 + 2sqrt(75) + 3)*2. -325 - 100sqrt(3) Simplify ((-1 + sqrt(1458) + -1 + sqrt(1458) + 0 + -3)5)2. -13500sqrt(2) + 146425 Simplify (sqrt(342) - (sqrt(342) + 3sqrt(342)-4 - sqrt(342)))/(-3(sqrt(2) + sqrt(14)/(sqrt(7)-2))). -26sqrt(19) Simplify (-5-4(0 + sqrt(68) + (sqrt(68) - ((sqrt(68) + 1 - sqrt(68)) + sqrt(68))) + -3)5)*2. -160000sqrt(17) + 840000 Simplify 0 + (sqrt(864)-1 - sqrt(24))/(sqrt(12) + 3sqrt(768)). -7sqrt(2)/25 Simplify -1 + (sqrt(32) - (sqrt(32) + -1)) - (sqrt(32) + (sqrt(224)/sqrt(7))2)-2. 8sqrt(2) + 64 Simplify (sqrt(36)/(-5(sqrt(3) + -3sqrt(3))))/((sqrt(66) - ((3sqrt(66)-5 - sqrt(66)) + sqrt(66) - sqrt(66)) - sqrt(66))/sqrt(11)). sqrt(2)/160 Simplify (sqrt(51) - sqrt(4131)-4 - sqrt(51))/(3sqrt(108)). 2sqrt(17) Simplify ((sqrt(19) + 1(sqrt(19) + 1) + 2 + (-31sqrt(95))/sqrt(5))2 + -4)5. -30sqrt(19) + 120 Simplify (-4(-1(2sqrt(91) - sqrt(91))/sqrt(7) - ((3sqrt(26) - sqrt(26))-5 - sqrt(26))/sqrt(2)))*2. 20800 Simplify ((sqrt(297) - -1sqrt(297)4)/(sqrt(21)/((sqrt(112) - (sqrt(112) + (sqrt(112) - 2sqrt(112)) - sqrt(112))) + sqrt(112))))*2. 356400 Simplify ((sqrt(78) - -41sqrt(78)) + sqrt(78) - sqrt(78))/sqrt(6) + (-2sqrt(1053) + 4)*2. -139sqrt(13) + 4228 Simplify ((sqrt(240)-4 - sqrt(240))/sqrt(12))/(4sqrt(36))-5. 25sqrt(5)/12 Simplify -2((sqrt(143) - (sqrt(143) - 1(sqrt(143) - -1sqrt(143)))) + 61sqrt(143))/((sqrt(176) - sqrt(176)2) + sqrt(1331)1). -16sqrt(13)/7 Simplify 0 + (5sqrt(108))2 + (sqrt(108)1-2)2. 3132 Simplify (sqrt(4500) - (sqrt(4500) + 21sqrt(4500)))/(3(sqrt(9) - sqrt(36)-4)). -20sqrt(5)/27 Simplify (-5sqrt(459)-5)/(sqrt(432) - (sqrt(432) - -1sqrt(432)) - ((sqrt(3) - (sqrt(36)2 - sqrt(36) - sqrt(36))/sqrt(12)) + sqrt(3) + sqrt(3))). -5sqrt(17) Simplify ((sqrt(396) - (sqrt(396)-2 + 2 + sqrt(396)) - (-1 + sqrt(396))-3)-4)*2. -4800sqrt(11) + 158800 Simplify ((2 + sqrt(153) + 0 + sqrt(17) + sqrt(17))6)2 - (sqrt(136)-2-2 + sqrt(136))/(-1sqrt(648)). 6485sqrt(17)/9 + 15444 Simplify ((sqrt(847)-2 - sqrt(847))-5 - (6(2sqrt(7))2 + -5))-4. -660sqrt(7) + 652 Simplify sqrt(500) + sqrt(500)1 + (sqrt(320) + sqrt(320)1 + sqrt(320))2 + sqrt(45)/(sqrt(90)/(sqrt(10)-4)). 16sqrt(5) + 2880 Simplify -4 + sqrt(162) + 1 - -6(sqrt(162) + (sqrt(162) - (sqrt(162) - 2sqrt(162))))2 - ((sqrt(162) - (-3 + 1 + sqrt(162))) + -1). 9sqrt(2) + 8744 Simplify 1 + ((sqrt(1216)-2)2 + -4)6. 29161 Simplify -3(-1sqrt(931) - sqrt(931))*2 + (-4 + sqrt(931) + sqrt(931)1)*2 + 5 + 5((sqrt(931)2)2 + sqrt(931)). -77sqrt(19) + 11193 Simplify (-4 + ((-1 + sqrt(68))-6 - (0 + sqrt(68) + 2 + sqrt(68) + sqrt(68))))2. 5508 Simplify (3(-6-2sqrt(228) + sqrt(228)))/(sqrt(588) + sqrt(588)-1 - ((sqrt(972) - sqrt(972)1) + sqrt(972))). -13sqrt(19)/3 Simplify (sqrt(171)/(sqrt(90)/sqrt(360)) - (2 + 0 + sqrt(19) + 3))2. -50sqrt(19) + 500 Simplify -4(sqrt(114) - (sqrt(114) - (sqrt(114)-3 - sqrt(114))1))/((sqrt(180)/sqrt(3))/sqrt(10)). 16sqrt(19) Simplify -5 + -6(-1(1 + sqrt(432) + sqrt(432)) - -5(sqrt(432) + 3)). -216sqrt(3) - 89 Simplify 1sqrt(32) + sqrt(18)/(sqrt(225) + sqrt(9)) - sqrt(6)/(sqrt(3) - -3sqrt(108)). 469sqrt(2)/114 Simplify (-4 + sqrt(931) + -2 - (sqrt(475) + 0)-3)*2. -264sqrt(19) + 9232 Simplify (sqrt(972)5 - (sqrt(12)/sqrt(4) + 5 - (sqrt(3) - 2sqrt(3)1))) + -3. -8 + 88sqrt(3) Simplify -2 + (((sqrt(15) - (sqrt(15) - sqrt(735)3))/sqrt(5))2 - (sqrt(3) + (((-2sqrt(108) - sqrt(108)) + sqrt(3))*2 - sqrt(3)) - sqrt(27)-3)). -9sqrt(3) + 454 Simplify -1(((-2 + sqrt(847) - sqrt(847))1 + 3 + (sqrt(847) - 1sqrt(847)))-1)2. -1 Simplify ((3-2sqrt(153)-3)/(sqrt(324) - 2sqrt(324)-6))*2. 153/169 Simplify sqrt(133)/sqrt(7)-6 + 4 - (5 + sqrt(95)/sqrt(5) + -5). -7*sqrt(19) + 4 Sim	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.