Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
n - 19 = 6. What are the prime factors of n? 5 Let k(v) = -v - 8. Let n be k(0). Let x = n - -23. Suppose 50 = 5t - x. What are the prime factors of t? 13 Let y = -3 + 0. What are the prime factors of (-21)/1458/y? 29 Suppose -3d + 4 + 2 = 0. Suppose 0s + 30 = 5w + ds, 3w = 2s + 2. List the prime factors of w. 2 Let f be 21 + (8 - 9). Let a(l) = 14l*3 - l. What are the prime factors of a(f)? 13 Suppose -4h = i - 0i + 17, 4h - 5i + 11 = 0. Let w = h - -6. Suppose wf - 13 - 17 = 0. What are the prime factors of f? 3, 5 Let s(t) = t*3 + 6t*2 - 8t - 4. Let a be s(-7). List the prime factors of (0 - (a + -4))17. 17 Let y = 20 + -13. Let r = 9 + y. What are the prime factors of r? 2 What are the prime factors of 3/(-12) + (-154)/(-8)? 19 Suppose 0 = -3o + 19 + 2. What are the prime factors of o? 7 Let x(j) = j*3 - 3j*2 - 6j + 6. Let l be x(4). Let t = l + 7. What are the prime factors of 10/(-25) + 62/t? 2, 3 Suppose -15q + 1650 = -4q. What are the prime factors of q? 2, 3, 5 Let j = -72 - -88. What are the prime factors of j? 2 Let d(i) = 3i - 3. Let o be d(2). Suppose -y = -0y + o. Let a = y - -6. List the prime factors of a. 3 Suppose 0 = 4d, 2k = -d + 17 + 29. List the prime factors of k. 23 Let z(h) = h*3 - 5 - 9h*2 - 2 + 14h - 4h. Let c be z(8). List the prime factors of (0 + -1c)-1. 3 Suppose b - 144 = -2b. Suppose f - 2z - b = 0, -3f + 2z = -z - 144. Suppose f = 4s - w, 0w + w - 7 = -s. List the prime factors of s. 11 Let q(c) = -c - 1. Let y be q(-1). Suppose -d + 2 + 12 = y. List the prime factors of d. 2, 7 Let s = -26 - -53. List the prime factors of s. 3 Let k = -116 - -212. List the prime factors of k. 2, 3 Suppose 0 = 4r - 211 - 69. List the prime factors of r. 2, 5, 7 Suppose -3j + j = 4, -2f - 3j + 72 = 0. List the prime factors of f. 3, 13 Suppose -4 + 34 = v - 4x, 0 = -4v - x + 103. List the prime factors of v. 2, 13 Suppose 0 = 2u + 2h - 10, 3h = -14 - 1. Let f = 14 - u. List the prime factors of f - -1-12. 2 Suppose -4v + 4n = 108, 5v + 2n + 61 = 2v. Let j = v + 45. List the prime factors of j. 2, 11 Let l(j) = 2j*2 - 6j - 7. What are the prime factors of l(7)? 7 Suppose 6l = 4l - 52. Let q = 4 - l. What are the prime factors of ((-2)/(-4))/(3/q)? 5 Let f be -46(4/8)/(-1). List the prime factors of f/3 - (-4)/(-6). 7 Let m = -5 - -29. Suppose -99 - m = -3n. What are the prime factors of n? 41 Let v be 3/3 - 5 - 2. List the prime factors of v/2(-5 + -1). 2, 3 Suppose 0 = 4y + 41 + 47. Let r = -11 - y. List the prime factors of r. 11 Let u be ((-4)/10)/((-1)/220). Let z = -61 + u. What are the prime factors of z? 3 Let g(o) = -5o + 5. Let c(i) = -10i + 10. Let u(m) = 6c(m) - 11g(m). Let h be u(-5). Suppose 4f - f = h. What are the prime factors of f? 2, 5 List the prime factors of 2 - ((-3 - -1) + -35). 3, 13 Let r(c) = c3 + 2c*2 + 1. Let f be r(-3). Let j = 11 + f. What are the prime factors of j? 3 List the prime factors of (396/(-16))/((-6)/16). 2, 3, 11 Let m(b) = 2b*2 + 6b - 13. What are the prime factors of m(8)? 163 Let n = 90 - -135. What are the prime factors of n? 3, 5 Let r = 1 + 0. List the prime factors of (17 - 0) + (r - 2). 2 Let w = -5 + 7. Let s(x) = -x*w - 8x2 - x3 - 6 + 0x - 10x. List the prime factors of s(-8). 2, 5 Let t(p) = -p*2 + 7p - 5. Suppose m - 18 = -2m. Let y be t(m). Let j = y + 1. List the prime factors of j. 2 Let g = 621 - 429. What are the prime factors of g? 2, 3 Let b = 70 - -53. List the prime factors of b. 3, 41 Let p(t) = t3 - 5t*2 - 4t - 4. Let u be p(6). Let o be (-5)/15 + 24/(-9). Let g = o + u. List the prime factors of g. 5 Let x(m) be the first derivative of m3 + m2/2 - 2m + 1. List the prime factors of x(-2). 2 Let s be (-3(-1)/(-1))/(-1). What are the prime factors of (-3)/s + 42/3? 13 Let c = 7 + -5. Suppose 0s = -cs + 4. Suppose -v + 24 = sv. What are the prime factors of v? 2 Let z = 3 + 0. What are the prime factors of z? 3 Suppose -4o = l - 10, -3o - 40 = -4l + 2o. List the prime factors of l. 2, 5 Let c be 19 + ((-3)/(-1))/3. Suppose -k + c = 4k. List the prime factors of k. 2 Let u(z) = -16z - 4. Let i be u(-4). Suppose i = 3a + q, 0a + 23 = 2a - 5q. What are the prime factors of a? 19 Let n be -21((-2)/(-6))/(-1). Let r(i) be the third derivative of i*4/8 - 5i*3/3 - 3i*2. List the prime factors of r(n). 11 Let m(z) = -7z - 22. What are the prime factors of m(-6)? 2, 5 Let l(s) = s - 3. Suppose -8 = -2w + 4. Let v be l(w). Suppose -28 = -vb - 7. List the prime factors of b. 7 Suppose 16d = 6d + 120. What are the prime factors of d? 2, 3 Suppose -3h + 2h = -5. Suppose 3j - 3v = -16 - 5, 2j = hv - 8. What are the prime factors of (-3)/64 - j? 7 Let g(z) be the first derivative of 1 + 3/2z*2 - 5z. What are the prime factors of g(4)? 7 Let b = 260 - 97. List the prime factors of b. 163 Let g(m) = -m*3 - 3m*2 + 3m - 1. Let w be g(-4). Suppose wv = -v. What are the prime factors of v/1 - (-12 - -4)? 2 Let l = -13 + 134. List the prime factors of l. 11 Let h(k) = k3 + k2 - 2k + 2. Let z be h(-3). List the prime factors of (36/z)/((-6)/20). 2, 3 Suppose -c + 23 = 5f, 5c - 4f = 2c + 12. What are the prime factors of c? 2 Let a = 3 - 0. Suppose 4b = -a + 23, -5s + 5 = b. Let z = s - -4. List the prime factors of z. 2 Let d = -4 - -21. List the prime factors of d. 17 What are the prime factors of 3 - (0 - (31 - 1))? 3, 11 Suppose -7f + 472 = -5f. List the prime factors of f. 2, 59 Let k be (1/(-1))/(2/10). Let r be (-3)/2(3 + k). What are the prime factors of 1r/((-3)/(-5))? 5 Suppose -5c - o + 5 = 0, 3o + 5 = 3c + 4o. Suppose 2w - w - 12 = -3n, 2w - 2n - 64 = c. What are the prime factors of w? 3 Let f(k) = 4k - 40. Let j be f(10). Let a(i) = -2i. Let l be a(-6). Suppose -g + 2g - l = j. List the prime factors of g. 2, 3 Suppose -2k = s - 137, k + 1 - 2 = 0. What are the prime factors of s? 3, 5 Suppose 0f = -4f + 48. Let o = 41 - f. What are the prime factors of o? 29 Let x = -17 + 19. Suppose -y - x = -4. What are the prime factors of y? 2 Let i = 397 + -270. What are the prime factors of i? 127 Suppose 0 = -h + 3h - 5l - 140, 0 = 3l + 12. List the prime factors of h. 2, 3, 5 Suppose 0 = -h - h + 2. Let s(o) = 7o3 + o2 - 1. Let r be s(-1). Let c = h - r. What are the prime factors of c? 2 Let u be 1/(-6) - (-4)/24. List the prime factors of u/((-3)/1) + 9. 3 Let b(m) = m*3 + 5m2 - m + 1. Let k be b(-5). Let u(i) = -i2 - 4i + 4. Let z be u(-5). Let v = z + k. What are the prime factors of v? 5 Suppose 3l - 40 = 80. What are the prime factors of 3/(-2)l/(-12)? 5 Suppose -o + 1 = -22. List the prime factors of o. 23 Suppose 72 = 2k - 442. What are the prime factors of k? 257 Let q = -19 + 21. Suppose 3a + qa = 150. List the prime factors of a. 2, 3, 5 Suppose -4u - u - 69 = -4f, 3u + f + 55 = 0. Let g = -10 - u. Suppose g = 2w - 7. What are the prime factors of w? 7 Suppose 9 = 5q + 4y, -5y = -4 - 1. What are the prime factors of (-2 - q)(-2)/3? 2 Suppose 0 = -t + 5 + 4. Let w = 15 - t. What are the prime factors of w? 2, 3 Let n(z) = -376z3 - 5z*2 + 1. What are the prime factors of n(-1)? 2, 3, 31 Let a be (-2 - -3 - 3) + 2. Let g(j) = -j + 5. Let u be g(a). Suppose -7 = 5m - 2, -4w + um + 69 = 0. List the prime factors of w. 2 Suppose f + 4k + 16 = 0, f - 14 = -0f + 2k. Suppose 0 = 3c + c - f. Let s = c - -1. List the prime factors of s. 2 Suppose 49h + 530 = 54h. List the prime factors of h. 2, 53 Let p(h) = 30h3 + h2 + h + 1. Let l be p(-1). Let j = l - -17. Let v = -5 - j. List the prime factors of v. 7 Let p be (-282)/(-22) + 2/11. Suppose -2v + i = 9, -v + 5i = v + p. List the prime factors of (v/(-6))/(1/12). 2 Let n = 53 - -31. Let k = n - 49. What are the prime factors of k? 5, 7 Let d(g) = -8g - 1. Let n be d(-2). Suppose 0l = 3l - n. Suppose 0r = -r + li + 5, 4i = 5r - 88. What are the prime factors of r? 2, 5 Let t(l) = l*3 + 2l*2 - 2l - 1. Let w be t(-2). Let v(k) = -6k + 2k*2 - wk*2 - k - 2. What are the prime factors of v(-4)? 2, 5 Let c = -7 - -17. What are the prime factors of c? 2, 5 Suppose -g = -4 + 2. Suppose -gp - 3 = -1. Let	{ "pile_set_name": "DM Mathematics" }
f = -65, 3f - 28 = -2k. What is the highest common divisor of k and s? 1 Let f be 485 + -30 + 3/1 + 1. Calculate the highest common factor of f and 27. 27 Let h = -10 + 12. Suppose 70 = 3x + 5v, -5v - 110 = -hx - x. Let o = -38 - -58. Calculate the greatest common factor of o and x. 10 Let p(t) = -10t - 22. Let m be p(-10). Let i = -38 + m. What is the greatest common factor of i and 8? 8 Let r(w) = -w*3 + 6w*2 - 2w - 1. Let q be r(5). Suppose a + 77 = 12a. Suppose -2 = -af + 96. What is the greatest common divisor of f and q? 14 Let n be (24/12)/((-2)/(-4)). Let v be 2 + -1(n + -7). Suppose 3f - 11 = -vm, 3f - 7 = 2f - 5m. What is the greatest common factor of 2 and f? 2 Suppose -10b = -9b - 5i - 76, 73 = b - 4i. Calculate the greatest common factor of b and 1037. 61 Suppose k + 2b = -2b + 47, 2k - 110 = -4b. Let h be 6 + (2 - 2 - -1). What is the greatest common divisor of h and k? 7 Suppose -3a - i + 33 = 0, 0 = 2a + 2i - 32 + 6. Let z(g) = -g2 - 17g + 10. Let r be z(-12). What is the greatest common factor of r and a? 10 Suppose 3l - 880 = -2l. Let p be (980/42)/((-4)/(-6)). Let y be (1 - p/25)-40. What is the highest common factor of l and y? 16 Suppose -16b + 110 = -15b - 5s, s = -2. Let z = -48 - -88. What is the highest common divisor of b and z? 20 Let w(f) = -12f - 612. Let i be w(-52). Suppose 2x + 24 = 3t, 39 = 4t - 0x - 5x. Calculate the highest common factor of t and i. 6 Suppose 0 = 22f - 5f - 3060. Calculate the greatest common factor of f and 20. 20 Suppose 4j = 2n - n - 170, -6n = 2j - 1020. Calculate the greatest common factor of 442 and n. 34 Let l be 9 - -1 - (-10)/(-5). Suppose -8w + 4w = -l. Let n(m) = -m + 6. Let a be n(4). Calculate the greatest common divisor of a and w. 2 Let t = -21 + 51. Let a(p) = p*3 + 12p*2 + 14p + 24. Let i be a(-11). Let z be 12/i(-5 - 4) + 3. Calculate the greatest common factor of t and z. 15 Let z be ((-288)/(-3))/(18/(-12)). Let i = z - -127. Calculate the greatest common divisor of i and 9. 9 Let b = -10 - -19. Let d = b - 4. Suppose 0 = s + 1 + 4, 4z + ds = 7. What is the highest common factor of 4 and z? 4 Suppose 0 = n + 3, o + 30n - 35n - 101 = 0. Calculate the highest common factor of o and 559. 43 Suppose 4j + 10 - 144 = -2f, -4f = 5j - 163. Suppose 0t = -y - 3t - 4, -3y + 3t = -48. Let d = j - y. What is the greatest common factor of d and 16? 8 Suppose -2k = 9j - 11j - 6, -5k = -3j - 25. What is the greatest common divisor of 172 and k? 4 Let o(u) = u*3 - 5u*2 + 6u - 2. Let f be o(6). Let h = -56 - -63. Suppose -7 = -2b + h. Calculate the highest common divisor of f and b. 7 Let r(x) = 2x*2 + 12x - 8. Let n be r(-9). Calculate the greatest common factor of 115 and n. 23 Let u = 23 + -74. Let x = u + 211. What is the highest common factor of 64 and x? 32 Let m(j) = -2j + 25. Let y be m(9). Let k(t) = -t2 + 18t - 17. Let f be k(y). What is the greatest common factor of f and 10? 10 Let p be (90/(-12))/(1/(-2)). Let s be (-3 - p/(-10))-60. What is the greatest common divisor of s and 10? 10 Suppose -5x = 3y - 41, 2 + 3 = 5x. Let l(w) = -w*3 - 10w*2 + 12w + 23. Let p be l(-11). What is the greatest common divisor of y and p? 12 Let g = -27 + 48. Let k = -2 + g. Suppose -y + 2o = y - 14, -5y + o = -k. Calculate the greatest common factor of y and 2. 1 Let h(v) = 9v - 57. Let j be h(17). Let s = j + -41. Suppose 0 = -3b - 3x + 5x + 37, 0 = -4x - 8. What is the highest common divisor of s and b? 11 Let b(r) be the third derivative of 20/3r*3 - 8r*2 + 0r + 0 - 1/24r4. Let o be b(20). Calculate the highest common divisor of 20 and o. 20 Let k(l) = -l - 9. Let r be k(-6). Let a be -1 + r - -1 - -179. Suppose 6b - 2b - a = 0. Calculate the greatest common divisor of 11 and b. 11 Suppose -4l - l + 15 = 0. Suppose -20 = 5q, -3x + 9 = -lq - 3. Suppose 3n + 19 - 55 = x. What is the highest common factor of 60 and n? 12 Let j(k) = -k*3 - 6k*2 + 13k - 9. Let u be j(-8). What is the highest common divisor of 48 and u? 3 Suppose -2u - 3u + 2q = -65, 0 = -4q. Suppose -10w + 96 + 34 = 0. Calculate the highest common factor of w and u. 13 Let y be (0/(-3))/(-2 - -1 - -2). Suppose -5v - 4g = 3 - 0, y = -2v - g. Calculate the highest common factor of 5 and v. 1 Let y = 330 - 298. Calculate the highest common divisor of 2 and y. 2 Suppose 83 = 5n + 2u, 5n + 3u - 82 = 5. Let b = n + -27. Let h = b - -28. Calculate the highest common divisor of h and 40. 8 Let p = 4047 + -2184. What is the highest common divisor of 27 and p? 27 Let t be (0/(-1) - -1)/(15/(-75)). Let l = t - -45. Calculate the highest common factor of l and 8. 8 Let g = -1570 - -1998. What is the highest common factor of 8 and g? 4 Let s = 1581 + -1569. What is the highest common factor of s and 68? 4 Suppose -5m - 4p + 1039 = 0, -m + 3p = -p - 227. Calculate the greatest common factor of m and 1. 1 Suppose 5r + 6 = 21. Suppose -65 = -rq - 2q. Let w(d) = d*2 - 4d - 6. Let a be w(8). Calculate the greatest common factor of q and a. 13 Let h(u) = 3u + u2 + 0u*2 - 1 + 3. Let t be h(-4). Suppose 4p - 372 = -108. What is the greatest common divisor of t and p? 6 Suppose 51 = 4i + 5d, -4i - d = -45 - 10. Calculate the highest common factor of i and 98. 14 Let r(g) = 2g*3 - 16g*2 + 4g - 12. Let u be r(8). Calculate the highest common factor of 40 and u. 20 Let i = -287 - -368. What is the greatest common divisor of i and 9? 9 Let w(l) = -l*3 - 4l*2 - 4l + 21. Let y be w(-6). Let h be (1 + 1)/(-2)-13. Calculate the greatest common factor of h and y. 13 Suppose 0 = 3r - r - 4. Suppose -q + 18 = rq. Let k = 540 + -510. What is the highest common divisor of k and q? 6 Let a(d) = -22d - 1 - 13d2 + 8 + 10d - d*3. Let n be a(-12). Let i be (3 - 4)/(2/(-2)). What is the highest common factor of n and i? 1 Let c be (2/(-3))/(30/(-1305)). Let u(v) = 257v - 13. Let h be u(4). Suppose 4k = -k + h. What is the greatest common divisor of k and c? 29 Let i = 137 - 132. Suppose ih = 3p - 0p - 11, h - 3 = -2p. Let x be ((-16)/6)/((-1)/3). Calculate the greatest common factor of x and p. 2 Suppose -5p + 5s + 10 = -5, -5s = -4p + 14. Let g(i) = 9i - 175. Let f be g(20). Calculate the greatest common factor of f and p. 1 Let c = 1195 - 781. What is the greatest common divisor of c and 46? 46 Suppose -5x + 15x - 430 = 0. Suppose -x = -p + 109. Calculate the greatest common divisor of 38 and p. 38 Let m(y) = -32y3 + y2 + 9y + 8. Let h be m(-1). Let b(n) = 11n + 30. Let t be b(6). What is the greatest common factor of t and h? 32 Let c be -4(0 - 2)5. Suppose -2f + c = 3s, -s + 5f = 4s - 25. Suppose 91 + 89 = 2w. What is the greatest common factor of s and w? 10 Let n(x) be the first derivative of -3x4/4 - x3/3 + x - 15. Let d be n(-1). Calculate the highest common factor of 24 and d. 3 Let u be (-2)/(-6)-1 - 6748/(-84). What is the highest common divisor of 15 and u? 5 Let v(u) = u*3 - 11u*2 - 2u - 90. Let a be v(12). What is the highest common divisor of a and 20? 10 Suppose -2k + 179 = 41. Let p be -1(-50 - -3) - 1. Calculate the highest common divisor of k and p. 23 Suppose -2i = 2i - 120. Suppose 12 = -3a + i. Suppose 5s = -4y + 100, -s - 135 = -as + 3y. Calculate the highest common divisor of 12 and s. 12 Let l = 12 - 12. Let u(y) = 4y + 11 + y*2 + 1 - 3y. Let i be u(l). What is the greatest common factor of 12 and i? 12 Let k = 75 + -71. Let s be ((-6083)/k)/(-11) + 2/(-8). Calculate the highest common factor of 92 and s. 46 Let k = 18 + -15. Suppose -4l + 16 = -7h + 3h, -h - kl = -12. Suppose 4 + h = -4t, z + t = 19. What is the greatest common factor of 4 and z? 4 Suppose 12g = 1635 + 2301. Calculate the greatest common factor of 41 and g. 41 Let v be 7/49 - (-12)/14. Let b = v - -1. Suppose n = bn - 23. What is the highest common divisor of n and 69? 23 Suppose -6p = -2p - 32. Let c = p + 1. Suppose -cl + 4l + 65 = 0. Calculate the greatest common factor of l and 52. 13 Let l be 105/(-315)15-1. Calculate the greatest common factor of l and 265. 5 Let q(t) = t. Let y be q(3). Suppose -4x = 4w - yw - 717, -x = 4*w - 168. What is	{ "pile_set_name": "DM Mathematics" }
0h) to lh + fh2 + n + vh*3 + th*4 and give t. 24 Rearrange -i - 255 - 72i*2 + 89 + 88 + 79 to the form ai + j + vi2 and give v. -72 Rearrange i4 + 2i + 159i2 - 4i*4 - 153i*2 to the form ki*2 + li + r + ji4 + oi*3 and give j. -3 Express -2 - 74u*2 + 28u + 66u2 + 22u in the form hu2 + t + nu and give h. -8 Express 2 + 59m - 3 + 2 + 0 - 246m as i + lm and give l. -187 Express -33i - 2i3 - 26i*4 + 20i*4 + 34i + 33i2 in the form ni + pi3 + ki*2 + ui*4 + h and give p. -2 Rearrange 58413 - 430m*4 - 58413 + (-2 + 2 + 2)(5m4 - 3m4 - m4) to the form dm + k + wm*2 + gm*4 + ym3 and give g. -428 Rearrange -u3 + 28u + u3 + u3 - 56 + 107 + 4u*2 - 50 to au + fu2 + ou*3 + w and give f. 4 Rearrange 41 + 336f*2 + 36 - 77 + f to hf*2 + if + v and give h. 336 Rearrange (3 - 6 + 0)(-4o*2 + 0o2 + o2 + (0 - o + 0)(22o - 32o + 33o)) to wo + k + fo*2 and give f. 78 Express -200b + 163b + 432b + 141b as xb + n and give x. 536 Rearrange -2j3 + 0j + 0j + 30j*4 + 27 - 28 to the form n + wj*2 + dj*4 + lj + rj3 and give n. -1 Express -1 + 228583d + 27d3 - 228583d + (4 + 4 - 5)(-2d - 2d3 + 2d) in the form rd2 + id + o + jd3 and give j. 21 Express (1 + 2 - 5)(2v + 4v + 0v) + (-5v + v + 2v)(-5 + 1 + 1) as t + iv and give i. -6 Express -1 - o - o3 - 5o*4 - 3 - 6 + 11 in the form co*3 + lo*2 + fo + k + go4 and give c. -1 Express 155 + 19g - 38g + 168 + 20g + 58 in the form rg + k and give k. 381 Express (-1 - 1 + 4)(1 + 2 - 4)(59j - 44j + 55j) in the form r + yj and give r. 0 Express (2 + 0 - 1)(-3g - 4g - 2g)(-148g2 + 2075g - 2075g) as ug*3 + y + hg*2 + rg and give r. 0 Express ((0 + 4 - 1)(5a - a + a) - 4a - 5a + a)(-2 + 2 + 2) as c + la and give l. 14 Rearrange -31u - 2u*2 + 6u*3 + 31u + (-16u + 2u - 13u)(-2u2 + 4u*2 + 0u*2) to wu + ku3 + fu2 + b and give k. -48 Express -26 - 12 - t2 + 63 - 14 in the form it2 + nt + o and give i. -1 Express -31 + 446z + 80 - 25 - 24 in the form k + uz and give u. 446 Express (5 + 3 + 0)(71k + 91k - 53k) as dk + f and give d. 872 Rearrange 719a*2 - 721a*2 - 22a*3 + 2a + 19a3 + 30 to i + ja*2 + da + qa3 and give i. 30 Express (-2d - 4d - 3d)(-2 + 1 + 0)(-3 + 0 - 5) in the form ud + m and give m. 0 Rearrange -u3 + 2u*3 + 5u*3 + (3u + u*2 - 3u)(-1 + 3 + 0)(140u - 263u + 54u) to the form pu*3 + b + cu*2 + hu and give p. -132 Rearrange (0q + 0q + 2q3)(0q + 7q - q) - 132q2 + 132q*2 + 18q*4 to the form pq + o + jq3 + dq*4 + lq*2 and give d. 30 Express 15y*2 + 19y*2 - 48y*2 + 17y*2 - 14y - 3y3 in the form oy*2 + by*3 + ty + a and give t. -14 Express 2l + l + l + (-4 + 0 + 5)(l - 5l - 3l) - 2l + 8 - 2 - 8 in the form t + ql and give q. -5 Rearrange (-q*2 + 3q*2 + 1 + 0)(-14 + 3 + 3 + 20q) to tq*3 + iq + l + vq2 and give i. 20 Express (-4 + 3 - 3)(1 + 0 - 3)(1 + 7 - 2)(-3 - 3p + 3 + (-3 + 2 + 0)(-2 + 2p + 2)) as a + hp and give h. -240 Rearrange -2w3 + w - w + (-3w - w + 2w)(2w2 + 2 - 2) - 642w2 + w3 + 640w2 - 5w*3 - 92w to the form kw2 + m + nw + tw3 and give k. -2 Rearrange 11y + 42y2 - 129y*2 - 2y*4 + 39y*2 + 35y*2 to the form my*4 + a + ly*2 + ry + dy3 and give l. -13 Rearrange 10m*2 - 2m*2 - 10m*2 + 0m - 77m4 - 3m + 6 - 3 to rm + n + cm*2 + bm*3 + jm*4 and give j. -77 Rearrange (17556959f*3 - 4562f*4 - 17556959f*3)(2 - 4 + 3) - 3f4 + f4 + 4f*4 to cf*2 + gf*3 + wf + o + xf4 and give x. -4560 Rearrange 2n + 2 - 2 + (5 + 0 + 0)(18n + 4n + 11n) to xn + r and give x. 167 Rearrange 59b*2 + b + 5b*2 + b + 38b*2 + 50b*2 to gb*2 + zb + r and give g. 152 Rearrange 12 - 40v - 37v + 22v + 10v to the form d + tv and give t. -45 Express -91w*3 + 44w*3 + 30w*2 + 3w*4 + 48w*3 in the form iw*4 + ow*3 + cw*2 + l + kw and give o. 1 Rearrange (-66i + 49i + 91i)(-3 - 2 + 3)(0i3 + i3 - 3i3) to the form di + z + ri4 + ki*2 + gi*3 and give r. 296 Express -3r*3 + 9r*3 + 64r + r*2 - 67r as n + ar2 + qr*3 + xr and give x. -3 Rearrange 234i2 - i + 242i*2 - 502i*2 to the form c + fi + vi2 and give f. -1 Express (2i*2 - 3i*2 + 0i*2)(5i2 + 54 - 54) - i4 - 4i*4 - 4i*4 in the form mi + n + fi3 + di*2 + ui*4 and give n. 0 Rearrange -1579 + 3162 + 4r*2 - 75r*3 - 1583 to the form l + ur*2 + kr*3 + wr and give k. -75 Express (-22j + 69j - 26j)(1 - 5 + 2) + (-2 - 2 + 2)(3j - j - 3j) in the form wj + m and give w. -40 Rearrange 51l2 - 9l*2 + 82l*2 + 62l*2 to jl + f + ol2 and give o. 186 Express k + 0 + 0 + 0k - k - k + (-2 - 1 + 2)(-3k - k + 5k) + k + k + 0k - 5k + 0k - 3k + (3 + k - 3)(-2 + 4 + 1) in the form mk + h and give m. -5 Express (-35 + 252t*2 - 251t*2 - 67)(-5t + 4t + 5t) in the form ht*2 + xt + l + qt3 and give l. 0 Express (-2p + p + 2p)(40p + 89p - 40p) in the form bp + up2 + f and give u. 89 Express -2l + 2l - 3l*3 + (5l*2 + 2l*2 - 5l*2)(l + 3l - 2l) + 2 + 2l3 - 2 - 16l*3 + 11l*3 - 36l*3 as h + wl*3 + bl*2 + al and give w. -38 Express (-422 + 151u + 422)(3 - 3 + 1)(u + u + 3u2 - u2) as d + ru + xu*3 + cu*2 and give x. 302 Rearrange -5g + 5g - 2g*2 - 76g + 76g + 14g*2 + (0 + 3 - 2)(-g*2 + 3g*2 + 0g2) - g2 - 5g2 + 5g*2 to the form sg + r + wg2 and give w. 13 Rearrange -4h - 40h2 - 3h + 5 + 42h2 + (-3h*2 + 4h*2 - 3h*2)(1 + 3 + 1) to the form oh + b + kh*2 and give b. 5 Express (5 + 0 - 2 + (-5 - 3 + 4)(5 - 1 - 2))(4c - 2c + c) + (-3 - 3 + 5)(3 - 3 - 2c) + 1 - 1 + 3c as qc + n and give q. -10 Express 1 - 5 + 25p + p - 44p - 61p in the form v + np and give n. -79 Express (-2y + 2y - 4y)(48 - 48 - 14y) in the form l + jy + ry*2 and give r. 56 Rearrange -792c*2 - 7c*2 + 197c*2 to the form h + sc + lc2 and give l. -602 Rearrange 6k*4 + 1 + 3k - k - 17k4 - 287k*3 + 285k*3 to the form d + zk*4 + pk + vk3 + jk*2 and give p. 2 Express 2v*2 - 2v*3 + 3 - 17 + 8190v - 8190v as z + hv + qv3 + bv*2 and give q. -2 Rearrange 6w*3 - 3w*3 - 4w*3 + (22243w - 22243w - 29w*2)(-w + w + w) + w3 - w3 + w*3 to the form ow + rw2 + iw*3 + n and give i. -29 Express -266t4 + t2 + 264t4 - 5t + 2 + 5t + 7t*3 as gt*2 + ft + p + zt3 + ot*4 and give g. 1 Express -10 - 4 - 2h + 6h2 - 5h2 - 7 - h3 + 15 in the form vh3 + z + xh*2 + mh and give x. 1 Express (-56c - 51c + 10c)(0 - 1 - 6) as b + jc and give j. 679 Rearrange 0h + 16 + 0h - 16h*2 + 28h*2 + 48h*2 to the form xh + l + uh2 and give u. 60 Rearrange -546n - 142 - 66n3 + 66n3 + n2 + 2n4 + 66 + 74 to the form i + cn*2 + wn*4 + bn + gn3 and give b. -546 Rearrange (10 - 20 + 7 + 21)(-3k + 3k + k*2) to the form zk*2 + s + nk and give z. 18 Express (8 - 19 - 22 - 3 + 5 + 0 + (3 - 4 - 1)(-4 + 0 + 2))(-l2 - l2 + l*2) as sl + k + pl2 and give p. 27 Express (1 + 3 - 5)(-2q + 3q - 2q + (-1 + 0 + 0)(-8q - 3q - 15q) + 0q + 3q + 0q) in the form zq + m and give z. -28 Express 41d - 1383437 + 1383437 - 4d2 - 21d*2 in the form xd*2 + vd + r and give x. -25 Rearrange 7 - 2r + 5r - 4r2 + 1 - 9 to p + yr + jr2 and give y. 3 Rearrange 24y*3 + 2y*4 - 7 + 2y*2 + 3 + 3 to the form ty*2 + xy*3 + w + oy*4 + by and give w. -1 Express (2h2 + 5 - 5)(-311h - 352h - 13h + 65h) in the form p + dh + th*2 + uh*3 and give u. -1222 Rearrange -7c*2 + 45 + 2 + 3c*3 + 1 + 5c*2 to the form i + hc*2 + qc + uc3 and give u. 3 Express (-3 + 3 - 2)(1 - 5r - 1) + 0r + 2r - 3r - 2r - 2r + 3r + 2r - 2r + 3r + 0r + 3r - r + (-2r + r + 0r)(0 - 2 + 3) as yr + c and give y. 12 Rearrange (6v + 13v - 8v)(-1 + 1 - 3)(-2 + 5 - 1 + (3 + 2 - 3)(7 - 4 - 1) + 1 + 0 + 1 + 2 + 4 - 2) to gv + o and give o. 0 Express -394a + a*3 - 50a*2 + 48a*2 + 494a in the form r	{ "pile_set_name": "DM Mathematics" }
= 12, -5 = -2c + 2r + 3 for c. 4 Suppose -4 - 40 = 4h. Let p = 15 + h. Solve 5r + 2 = -pl, 2l + r + 6 = 4l for l. 2 Let r be 5111(-18)/45. Let a be 24 + r - -16. Solve 0k + 10 = 4c - 5k, 4k + a = c for c. 0 Let d = 127 - 127. Solve u + dx = -x + 3, -4x = -20 for u. -2 Suppose 4a - 8 = k + 3, 0 = -3a. Suppose -b - 4z = -0z + 5, -3z = -b - 26. Let u = k - b. Solve 7j = 3p + 3j + 10, 2j = p + u for p. 2 Let l = 60 + -55. Suppose -4g + 17 = s, 2s + 0s + 5 = lg. Solve 0 = f - 2f - gq - 5, -5q = 5f + 15 for f. -2 Let p = 0 + -2. Let u be 2/((-2)/p) - -3. Suppose 25 = 5q + 4a + 18, 3q - 11 = a. Solve 4k + 18 = qc, k + 0c + uc - 7 = 0 for k. -3 Suppose -84 = y - 3y. Let v = -37 + y. Solve 0 = -w - 0u - 3u - 1, -3u = 2w + v for w. -4 Let a(p) = -7p + 9. Suppose v - 1 = -4o, 4o = o + v + 6. Let t be a(o). Solve 4z + tg + 16 = 0, -3z + 0g = -5g - 1 for z. -3 Let f(s) = -3s - 17. Let a be f(-7). Suppose a = 3r - 2. Solve p - rn = -3p + 4, -n = 2p - 2 for p. 1 Let l(q) = -3q - 11. Let d be l(-4). Suppose 3w = 5j + 51, -j - 9 = w - 2w. Let i be 3d + 36/j. Solve 4t - 5r + 1 = 0, 2t + it - 3r = 1 for t. -4 Suppose -15 = 3u - 3z, 0 = 3u - 5u + z - 5. Suppose -5j - 3d - d = -11, 5j + 5d - 10 = u. Solve n = -3, -n - 3 = jl - 5l for l. 0 Suppose 4g - 5g = 3f - 119, 5f - 199 = -g. Solve i - f = -3i + 5d, -2d - 8 = 0 for i. 5 Let v(c) = -c*2 - 47c + 265. Let x be v(5). Solve 0 = -j + x, -5o = -3j + 32 - 2 for o. -3 Let t(w) = w*3 + 7w*2 + 4w - 8. Let h be t(-6). Suppose s + 12 = hs. Solve -3v = j + s, -2j - 2 = 3v - 3 for v. -3 Suppose 2s = -2c, -s + 6s = c - 12. Suppose cf - 40 = -2f. Let j(g) = -20g + 257. Let z be j(12). Solve -5q - 15 = 5b + f, 3b + 4q + z = 0 for b. -3 Let d be (-6)/(6 + (-30)/4). Solve -dk - o - 7 = k, 2k - o = 0 for k. -1 Let x be (-384)/15 - 6/15. Let d = 29 + x. Let l be 4 - -3 - (4 - d). Solve -r + lr = -5s - 20, -4s - 9 = -3r for s. -3 Let d = 21 + -18. Suppose di - 74 + 65 = 0. Solve -3k + 19 = -2x, -2k + ik + 5x = -5 for k. 5 Let k = 33 + -31. Let w be k - (-8 + (-8)/(-2)). Let y be w + -7 + 12/2. Solve 5x = 2u - 20, yx - 5u + 35 = -0u for x. -2 Suppose 5m - 5i = 0, 2i = 5m + 4i. Suppose m = 5r - 247 + 127. Solve k = 3j + j + r, 2j - 3k + 22 = 0 for j. -5 Let c(s) = 2s + 4. Let f be c(-5). Let j be (-60)/84/f. Solve -10 = -3z - q, -2z = q - 3 - j for z. 2 Let z = 15 + -7. Let f be (-30 + 4 + -4)/(-2). Solve 3q - 5b = -f, 2b + z = -4q - 12 for q. -5 Let t(w) = w*2 + w - 2. Suppose -5 = -5k - 20. Let g be t(k). Solve 3m - n = 2 + 2, 6 = 2m - gn for m. 1 Let w be (-168)/(-9) + (-1)/(-3). Let s(k) = 2k + 11. Let j be s(-5). Let q be (0/3)/j - 0. Solve -a - 2a - w = 5c, -4c + 3a - 26 = q for c. -5 Let f(u) = u*3 + 10u*2 + 9u + 3. Let r be f(-9). Suppose 10v - r = 9v. Solve -3j = y - vy - 3, 5j - 5 = 3y for y. 0 Let i be ((-1)/1)/((-20)/(-1100)). Let a be (i/33)/(-1 + (-2)/(-3)). Solve 0 = -2r - 2q + q - 7, 0 = -ar + 5q - 10 for r. -3 Let s be (0(-7)/49)/1. Solve -4b + so = -o - 19, -3b + 12 = -3o for b. 5 Let w = -764 + 768. Solve -5r - 13 = 3z, -5z - 3r - w = 7 for z. -1 Let t be (-1)/(4/(-8))(-12)/(-24). Solve 2m - 3m + l - t = 0, 3 = 5m + 3l for m. 0 Suppose -x - 6 + 5 = 0, -16 = -2n + 4x. Solve -3b = 2q + 14, -2q = -2b - 0b - n for b. -4 Let z(w) = w3 + 9w*2 + 6w - 7. Let h be z(-8). Let m = -2 + 5. Suppose -my = -3 - h. Solve yd = 2d - a, -3d - 3a = -6 for d. -2 Let w(a) = -2a*2 - a + 1. Let k be w(-4). Let o = 30 + k. Solve 0 = -3g, -3n - 7g = -og + 12 for n. -4 Let b be (-81)/(-24) - (-3 - 54/(-16)). Solve 0i = -bi + 2g - 7, 3g - 13 = 5i for i. -5 Let r(g) = -2g - 7. Let d be r(-5). Let t be (-1130)/452 - (-26)/4. Solve 0 = -du - t + 19, -4c = u - 9 for c. 1 Suppose -5c - 2k = -50, 12 = 4c - 3k - 28. Solve 3t + 28 = 5d, -c = t + 4t - d for t. -1 Let c be 58/140 + 1691/133. Solve -m - 2m + 3f = -15, -2m = -3f - c for m. 2 Let u be -40(-4 - 152/(-40)). Solve -4i + 21 = -h - 1, -4h = u for i. 5 Let g be (-33 + 8)(-4)/(-10). Let n be ((-6)/g)/((-8)/40). Let j = n - -7. Solve 5f = -2h - 8, -2f + jf + 4h = 0 for f. -2 Let x be ((-38)/8)/((2/2)/(-24)). Let h be 3/((-63)/(-6)) + x/42. Solve 0 = -ho + u, -2u + 2 = -4o - 0o for o. 1 Suppose -5w = -4d + 15, 3w + 6 + 3 = -4d. Let b(p) = -p3 - p2 + 3p. Let a be b(w). Let f = -7 + a. Solve -t + 4q = 0, ft + 4q + 6 = 18 for t. 4 Let n(b) = 2b2 + 9b + 20. Suppose -16 - 4 = 2d - 5q, 5 = d + 5q. Let v be n(d). Solve -5o + 4k = -v, -21 - 4 = -5o - 4k for o. 5 Suppose -2w - 86 = 2g, -2w + 1 = -1. Let z = -39 - g. Solve 2 = -zu - j, 3u - 3j + 6 + 6 = 0 for u. -1 Let z = -19 + 83. Let s = -59 + z. Solve 2k = -sb + 33 - 7, b + 2 = 2k for b. 4 Let g(n) = -n - 7. Let z be g(-14). Let b be (-3 + (-75)/(-21))z. Solve 2 = 2i - 2, -bx - 22 = -3i for x. -4 Let j(o) = -1 - 2 - o + 4. Suppose -3i - 6 = -4l, 2l + 2l = 2i. Let u be j(i). Solve 0 = 2m + 3q + 25, 4m - um - 30 = 3q for m. -5 Let y(f) = -f - 6. Let m be y(-12). Suppose -6j + 4j = -m. Let h = 1 + 3. Solve -q - q = -5b - h, -12 = jb + 2q for b. -2 Suppose 0 = 881n - 902n. Solve 2p + 17s = 15s - 6, p + 5s + 3 = n for p. -3 Suppose 7q - 21 - 14 = 0. Let z(d) = -d*3 + 6d*2 - 4d - 5. Let k be z(5). Let r be (-84)/(-2)(-2)/(-3). Solve ko + r = -t + 5o, o = q for t. -3 Let y be 4 + (0 - -5) + 1-1. Suppose -5f + y = -12. Solve 2q + 10 = fr, q = -4r + 3 - 2 for q. -3 Let z be 20/8 + (-2)/(-4). Suppose zc - 22 = -0d - d, c = -4d + 11. Solve 14 = -2j - 4s, cj - 2j = -3s - 7 for j. 1 Let d = -304 + 306. Solve -4y - 8 = 4k, 4y + 0k - d = -2k for y. 3 Let g(i) = i3 + 16i*2 - 16i + 22. Let k be g(-17). Solve 4c = 4o + 20, -4o + 0c - kc = 2 for o. -3 Let h be 21/6 - 2/4. Suppose b = -u - hb + 6, 0 = 4u - 5b - 3. Solve -t - 5g = 24, ug = 4t - 0t - 14 for t. 1 Let v = 23 + -21. Let f(j) = j + 4. Let g be f(-7). Let d be ((-9)/15)/(g/15). Solve k + 0k - 4 = -vi, dk = 3i + 3 for k. 2 Suppose 3w + 0 = 9. Solve -4n - wd = 14, 3d = 2n - 0d + 16 for n. -5 Let i(k) = k + 2. Let q = -27 + 27. Let r be i(q). Solve 4n = -2m - 10, m + rm + 15 = -2n for m. -5 Suppose 3t - j - j = -1, 5t + 3j = 11. Suppose -2 - t = -3w. Let o be (-3)/w - -2 - -4. Solve -2n = -2d - 4, 0 = d + od - 2n + 8 for d. -2 Let j(k) = k + 13. Let v be j(-2). Suppose -2a - 4z + 26 = 0, 5a + 6z = vz + 5. Solve -o = -ad - 8, 2o = -4d - 0d + 2 for d. -1 Suppose f + 12 = -4m, -2f - 28 = 5m - 13. Let c = 74 - 68. Suppose cx - 3x = f. Solve k + q = -3, 3q + 1 + 11 = x for k. 1 Let u(c) = c + 6. Let i = -112 - -109. Let h be u(i). Suppose -5g - 2y = -10, 6y - y = -2g + 4. Solve -5l - 23 = -2l - ga, h = l + 2a for l. -5 Let x = -353 - -357. Let g be (-7 - 1)8/(-16). Suppose -4v + 7 + 1 = 0. Solve 0 = gf - 2j - 8 - v, xj - 20 = 0 for f. 5 Suppose -49 - 49 = -7q. Solve 5z - q = -t, -3t - 2z + 0z = -16 for t. 4 Suppose 0 = 4a - 43 - 57. Suppose -5h + 0h + 10 = 0. Let r be 0/((-6 + 3)/(-3)). Solve r = z - 3d + 15, hz + 0d - 5d = -a for z. 0 Suppose 6 = 2q + c, 0 = -0c - 3c + 6. Solve -3y + i = qi - 12, 3y + 5i - 12 = 0 for y. 4 Let x(n) = n - 19. Let h(i) = 1. Let o(v) = -5h(v) - x(v). Let b be o(11). Solve bj = 3r - 30, -35 = 4j - 4r + r for j. -5 Suppose 2r = -d - 1, 5r + d + 12 = 17. Solve -12 = -4o - ri, -o - 3i + 7 = 4 for o. 3 Let v(h) = -h3 + 3h*2 + 19h - 38. Let d be v(5). Solve b - d = -m, 3m + b - 15 = -0b for m. 4 Let r(v) = v + 21. Let a(t) = 1. Let l(b) = -6a(b) + r(b). Let u be l(-7). Solve q = 2y - 0 + 6, 2q - 3y = u for q. -2 Let y = 105 - 64. Let a = y - 36. Solve 3j = 5m - 6 - a, 7 = -5j - 3m for j. -2 Let z(h) = h*2 - h + 4. Let a be z(0). Let n be a/6(0 + 6). Suppose 4 = 4p - n. Solve pk + 3v = 10, 0k + 5 = k - 5v for k. 5 Suppose 5p = 3 + 7. Suppose 5t - 4t + 2i = -5, -t + i + 1 = 0. Let d be p - (0 + t + -1). Solve 0 = -dg + 5b + 20, 5b + 20 = -2g - 2g for g. 0 Suppose -b = -9 + 5. Suppose -b - 1 = -r. Solve -5t - 4l = 32, -4t + rl + 3 = -t for t. -4 Let w(	{ "pile_set_name": "DM Mathematics" }
alse Let c(l) = 107 - 35 + 10 + 7l2 + 72 - 18l. Is c(23) composite? True Let d(v) = 1770v - 1793. Is d(12) prime? True Let i = -32748 - -82667. Is i composite? False Suppose -46b + 3 = -45b. Suppose 5o = -i + 8o + 639, 2i = bo + 1272. Let u = 1418 - i. Is u a prime number? False Suppose 5d - 137 = -2a, 4a - 6d - 204 = -2d. Suppose -i + 26619 = 5n, -4i - 26599 = -61n + an. Is n prime? True Suppose 2f - 11302 - 193492 = 0. Is f composite? False Suppose b - 58067 = 2j - 1078091, -3b = -3j + 1530030. Is j composite? True Let u(t) = 17t3 + 5t*2 + 4t + 5. Suppose l - 4 = -2o + 4, 4l - 27 = -3o. Is u(l) composite? False Let y(h) = -h3 + 4h*2 + h - 2. Let d be y(4). Suppose -3q - g = -13, g + 0 + 7 = dq. Suppose 5n - qn = 419. Is n a prime number? True Let x(t) = 60t*2 - 5t - 7. Suppose 2r - 9 = -4c + 19, -4r = 16. Suppose -2h + c + 7 = 0. Is x(h) a composite number? False Let o be (-54)/(-10) - (-24)/40. Is 326948/189/o a prime number? True Suppose -2t + 6t + 2i - 568 = 0, 2i + 296 = 2t. Let s = t + -668. Let f = s + 831. Is f a prime number? True Let b(q) = 2386q + 663. Is b(61) composite? True Suppose -2q + 3a + 2 = -11, 4q - a - 11 = 0. Suppose -qz = 3i - 2393, -4i - 4z + 3566 = 378. Is i composite? True Let h = 151604 - 66913. Is h composite? False Let g = -13573 - -60672. Is g composite? True Let c = -45 - -527. Let g = 2240 - 2236. Suppose v = 5p - 11545, -p + 1827 = -gv - c. Is p a prime number? True Let v(q) = q3 + 3q*2 - 7q + 77449. Is v(0) a composite number? True Let m(k) = 23k2 - 83k + 1871. Is m(45) prime? True Let s(a) = -16a3 - 7a*2 - 85a - 41. Is s(-7) a composite number? True Let i(h) = -10 + 3 + 0 - 16 - 531h. Let y be i(-5). Suppose 3x = -5j + y, 2j - 4x = 256 + 802. Is j composite? True Let u(a) = -28707a + 726. Is u(-3) a composite number? True Let r(s) = -2s3 - 27s*2 - 14s + 16. Let p(g) = g*2 - 17g - 19. Let d be p(17). Is r(d) composite? False Let b(d) = 1300d + 88. Let r be b(-20). Is r/(-36)3 + (-3)/9 prime? False Let t = -47 - -51. Let u(r) = 3 - tr + 4r + 886r2 - 2. Is u(1) composite? False Suppose -9i - 18i = -3375. Suppose -if + 124f = -1114. Is f composite? True Let z(d) = -d3 - 6d*2 + 3d + 7. Let a = 16 - -2. Let b be 9/a - (-38)/(-4). Is z(b) a composite number? False Let g = -1294847 + 1930204. Is g a prime number? False Suppose 0 = 3t + 6, 0m = -m + 2t - 39. Let d = m + 40. Is d(0 - (-268)/(-6)) a prime number? False Let k be (-4)/(-10) + 416/(-65). Let i be (-4317)/(-9) + (-8)/k. Let j = i - 276. Is j composite? True Let x be 96400/12 - (-15)/9. Let d = -4394 + x. Is d prime? False Suppose 7i = 49334 - 18030. Let v(y) = 5y - 26. Let l be v(6). Suppose -4 = -5n + 1, -i = -lw - 4n. Is w a composite number? False Is (-18 - -9) + (25 - -22821) composite? True Is 800973/36 + 1/(-4) prime? False Let p(u) = 18u*2 + 29u + 138. Let y(h) = -14h2 - 29h - 139. Let f(q) = 5p(q) + 6y(q). Is f(-14) prime? False Suppose 0 = 4u + u + 30. Suppose 0 = -5x - 20, -4i - 2x + 132 = 2x. Let g = i + u. Is g prime? True Suppose 4v - 88 = -0v + 4m, 3v + 2m = 46. Let x = 103 - v. Suppose -633 = -xj + 82j. Is j composite? False Suppose -76 = -21v + 8. Suppose -y = r - 488, 0 = y - vr + r - 508. Is y prime? False Let v be 2/((56/12)/7). Suppose 0 = 4f - vf + l + 5, 0 = 5f - l - 5. Suppose f = 4s - 8025 + 301. Is s a composite number? False Let i = 7 + -13. Let p(z) = -2z2 - 11z + 12. Let t be p(i). Is (-21 + -1)((-183)/t - -1) a composite number? True Let v = 102 - 89. Suppose 16t = vt + 12681. Is t a composite number? True Suppose -138427 = -2p + 431960 + 76351. Is p composite? False Suppose 3k + 8127 = -0k. Let a = -9543 - -13366. Let l = k + a. Is l a composite number? True Let u(a) = a*2 - 4a - 16. Let m be u(8). Let o = 9 + m. Suppose 0 = 14f - of + 11891. Is f a composite number? True Let s be (-29188)/(-2)(-165)/(-66). Let c = 61144 - s. Is c a composite number? False Suppose 908v = 903v + 1533635. Is v composite? False Let n(m) = -3m*2 - 8m - 6. Let u be n(-2). Is (-839)/21u prime? True Suppose 8186o - 8182o - 349172 = 0. Is o a prime number? True Let s be (3 + 25134/9)/(1/3). Suppose 5n = -2u + s, n + 2n + 2u = 5029. Suppose -t + 191 - n = -3p, -5t = p - 512. Is p composite? True Let p(n) = -769 - 3n2 + 8n - 2n + 778. Let w be p(3). Suppose -2y + 21 + 7 = w. Is y a composite number? True Let v(t) = 54t2 - 7t - 4. Let i be -5(3 + (4 - 9)). Let f be (-26)/6 + i/(-15). Is v(f) a prime number? True Let l(b) = b3 + 8b*2 + 6b - 8. Let t be l(7). Let x = 42 + -34. Suppose xn - 9n = -t. Is n composite? False Suppose 5y = -25 - 20. Let n(i) = i2 + 3i - 57. Let p be n(y). Is p/(-5) + 7004/10 a prime number? True Suppose 0 - 80 = -5i. Suppose iq = 11q. Is 2620 + (-3 - q) - 2 a prime number? False Let x = 61 - -7. Let q(l) = 16l - 91. Let a be q(20). Let t = a - x. Is t composite? True Suppose -3d + 4z + 666 = 2662, 0 = 2d - 4z + 1332. Let n be d - 6/3 - 3. Let g = -376 - n. Is g prime? True Let u be 6/(-9) + 112920/9. Suppose 0 = 7t + 2t - u. Let v = 3551 - t. Is v a prime number? False Let n(o) = o*3 + 14o*2 - 2o + 2. Let x = 58 - 72. Let l be n(x). Is 20495/l - 2/12 prime? True Suppose 5i + 26637 = 4j, -i - 3 = 2. Suppose 15k - 26992 = j. Is k composite? False Let l = 256899 - 39712. Is l a prime number? False Let j(y) = -56y + 5413. Is j(-69) a prime number? True Let j(m) be the second derivative of -m*5/10 + 17m*4/12 + 4m3/3 + m2/2 - 21m. Let l be j(9). Is (10/l)/(-5) + (-8211)/(-4) composite? False Let d(o) = -8o - 9. Let z be d(-2). Let q(b) = -b*2 + 7b + 4. Let r be q(z). Is (2 - 1)r/((-8)/(-894)) a prime number? False Suppose 7563792 = 33f + 2731041. Is f a prime number? False Let s = 85056 + -60617. Is s prime? True Let s(z) = 389z + 97. Let o(r) = 194r + 48. Let v(b) = -5o(b) + 3s(b). Suppose -2g = 2i, -2i - 5g = -3 + 15. Is v(i) prime? True Let r be -1 + -5 - (-125 - -8). Suppose 222 = 2j - 4b, -3j - 3b = -4j + r. Is j a prime number? False Let j be 3/(0 - (-3 + 4)) + 3. Suppose 4v - 13 = k, -2v - 3k - 2k - 21 = j. Suppose h = 2 - 1, u - vh - 56 = 0. Is u composite? True Let t(g) = -47g2 + 3g - 5. Let u be t(6). Let a = 3238 + u. Is a a composite number? False Suppose 6354535 = 369u - 214u. Is u prime? False Let n(u) = 845u2 - 16u - 5. Let a be n(6). Suppose 0 = l + 5g - 5037, -2g = 5l + 5226 - a. Is l a prime number? False Let v be -4 + (-60)/(-16) - (-430830)/24. Suppose -4j + 3j + v = 4g, -5g + 22430 = 3j. Is g prime? False Let v = -424943 + 817432. Is v prime? True Suppose 2l + 0 - 8 = 0. Suppose -lu + 29 = -h, 4h + 2u = -u - 21. Is 2/h + (-1048)/(-18) - 1 a composite number? True Suppose j - 5 = b - 29, 2b = -5j + 55. Suppose bh = 42h - 55607. Is h a composite number? False Let b(f) = 31f3 - 4 + 0f - 3f2 + 5f + 10f - 4f + 0f2. Is b(7) a composite number? False Suppose 0c - 2c - 4x - 42 = 0, -c = 4x + 17. Is (4 - -8701)/(c/(-10)) a composite number? True Let s(g) = -1088g*3 - 5g*2 + 10g + 94. Is s(-5) a prime number? False Let x(t) = -28272t3 + t2 - t + 1. Is x(-2) a composite number? False Let f be (-20)/(-30) - 265258/(-21). Let y = f + -5673. Is y a prime number? True Let p = 40 + -35. Suppose y - 15458 = -2q + py, 0 = 2y + 8. Is q a composite number? True Suppose -73g = -15793420 - 9723657. Is g a prime number? False Suppose 265q = 225q + 305560. Is q prime? True Let v(x) = 5656x - 47. Is v(3) a composite number? False Is 108830/4(-210 - -212) composite? True Suppose 643907 = -14w + 6536493. Is w a composite number? False Let c(k) = -2k + 1477. Let m be 2 + 1 + 4 + -17 + 13. Suppose r + 2r = -mr. Is c(r) a composite number? True Let x(s) = s3 + 4s*2 - s - 4. Let v be x(-4). Let g(l) = -5l - 25. Let k be g(-7). Suppose kc - 5c - 2095 = v. Is c a composite number? False Suppose 2w = -2m + 210758, 5m - 510593 - 16294 = -w. Is m composite? True Let t = 111 + -109. Is (-5 - -9)/(t/2609) composite? True Suppose 4m - 167661 - 27967 = 0. Is m composite? False Let m(y) = 943y3 + 7y*2 - 7y + 51. Is m(4) a pri	{ "pile_set_name": "DM Mathematics" }
93x3 + 238x*3 + x. 670x*3 - 8x Collect the terms in -44413j2 - 130392j*2 + 174802j*2. -3j*2 Collect the terms in -8z - 104573z2 + 52292z*2 + 8z + 52281z2 + 91z*3. 91z*3 Collect the terms in 53 - 471y + 2328y - 473y - 463y - 461y - 478y. -18y + 53 Collect the terms in -43 + 7 - 606955b2 + 36. -606955b*2 Collect the terms in -1780z*3 - 1757z*3 - 1749z*3 + 5314z*3. 28z*3 Collect the terms in -244349 + 244349 + 88s*3 - 994s*3. -906s*3 Collect the terms in 34 - 74 - 249a*2 + 19 + 252a*2 + 21. 3a*2 Collect the terms in -245149659 + 245149659 + 42h*3. 42h*3 Collect the terms in -3d + 1204 - d2 + d2 + 4d2 + 2d. 4d2 - d + 1204 Collect the terms in 10x - 4 - 259x + 5x + 220x + 18x + 4. -6x Collect the terms in 0p - 107 - 24p - 30p. -54p - 107 Collect the terms in -609l*2 + 873l*2 + 352l*2 + 1746l*2. 2362l*2 Collect the terms in -993q + 158q - 696q - 1870q - 178q. -3579q Collect the terms in -10x + 2885 + 24x + 181x*2 - 14x - 2881. 181x2 + 4 Collect the terms in -251r - 194r + 0 + 0 + 693r + 60r. 308r Collect the terms in -30110 - 30120 + 122q + 90348 - 30118. 122q Collect the terms in 143n - 17 + 150n - 600n + 55 + 150n + 153n. -4n + 38 Collect the terms in -121i2 + 109i + 39i2 - 369i + 79i2 - 2. -3i*2 - 260i - 2 Collect the terms in 277b3 - 16996b*2 + 8504b*2 - 48b*3 + 149b*3 + 8492b*2. 378b*3 Collect the terms in 638v + 550v - 1547v. -359v Collect the terms in -360489464976 + 360489464976 + 3q*2. 3q*2 Collect the terms in 1402u*3 - 571 + 1113u*3 + 571. 2515u*3 Collect the terms in -42p*3 + 5p*3 - 18p*2 + 85 + 18. -37p*3 - 18p*2 + 103 Collect the terms in 21u*3 - 155826415154u*2 + 155826415154u*2. 21u*3 Collect the terms in 226 - 817 + 5u*2 + 228 + 233 + 130. 5u*2 Collect the terms in -14v - 11152 + 29v + 3v*2 - 15v. 3v2 - 11152 Collect the terms in 587h + 1344h + 621h. 2552h Collect the terms in -1478h - 24 + 40 - 13. -1478h + 3 Collect the terms in -560y*2 - 14y*3 + 557y*2 + 84 + 157 + 8y*3. -6y*3 - 3y*2 + 241 Collect the terms in -165c - 412507c2 + 412510c*2 + 165c. 3c2 Collect the terms in -32w*2 - 40w*2 - 138443 + 276883 + 105w*2 - 35w*2 - 138440. -2w*2 Collect the terms in -24493 + 6119 + 6104 + 6122 + 6128 + 8w. 8w - 20 Collect the terms in 345c - 185c - 293c - 144c - 234c. -511c Collect the terms in -3 + 20358g*3 + 1 + 2. 20358g*3 Collect the terms in 30 - 31 + 86v*3 + 729v*3. 815v*3 - 1 Collect the terms in 42 + 10939v - 25 - 17. 10939v Collect the terms in 1164k*2 + 9k*2 + 1083k*2 - 57k*2 + 1793k*2. 3992k*2 Collect the terms in -290676c*3 - 276507c*3 + 148560c*3. -418623c*3 Collect the terms in 142 - 623k*3 + 3276k*3 - 142. 2653k*3 Collect the terms in 4o*2 - 406o*3 - 388o*3 - 83o*3 + 110o*3. -767o*3 + 4o*2 Collect the terms in -35649 + 3b - 35938 + 71867. 3b + 280 Collect the terms in -3 - 20 - 5 - 2x - 10 + 50 + 3. -2x + 15 Collect the terms in -3 + 107g*3 - 24495g + 24495g. 107g*3 - 3 Collect the terms in 1703491 - 24i*2 + 5i*2 - 851720 - 851771. -19i*2 Collect the terms in -354q*2 + 1086q*3 - 302q*2 + 656q*2. 1086q*3 Collect the terms in 18y - 14y - 11y - 13y - 7y*2 - 9y - 12y + 36y. -7y2 - 5y Collect the terms in -118z2 - 13050z*2 - 18162z*2. -31330z*2 Collect the terms in 978p + 966p + 980p + 972p + 973p + 983p - 5853p. -p Collect the terms in 58m - 12m - 249m + 60m + 84m + 63m. 4m Collect the terms in 330 + 162 - 7t2 - 110 + t2. -6t2 + 382 Collect the terms in -24h + 521 + 224h + 76h. 276h + 521 Collect the terms in 44n - n*2 - 23n + 38n - 162. -n2 + 59n - 162 Collect the terms in 130569n - 130563n - 520 + 476. 6n - 44 Collect the terms in -9t*2 + 48t*3 - 18t*3 + 64t*3. 94t*3 - 9t*2 Collect the terms in 28 - 41889m - 40450m - 28. -82339m Collect the terms in -239561x2 - 156931x*2 + 5454820x*2. 5058328x*2 Collect the terms in 852o + o2 - o3 + 793o - 1504o. -o3 + o2 + 141o Collect the terms in -251856r*2 + 83845r*2 + 83751r*2 + 83909r*2. -351r*2 Collect the terms in 23 - 5u*2 + 4u - 12 - 9 - 13u2. -18u*2 + 4u + 2 Collect the terms in 14 + 6q - 92q*2 + 153q*2 + 205q*2 + 10q. 266q2 + 16q + 14 Collect the terms in 1553t + 195t + 674t + 1918t + 1874t. 6214t Collect the terms in 10595s2 + 652s*2 + 4349s*2. 15596s*2 Collect the terms in 19y*3 + 15y*3 - 87y*3 - 120y*3 + 7y*3. -166y*3 Collect the terms in 103479 + 103477 - 310433 + 24x*2 + 103477. 24x*2 Collect the terms in 122 - 262 + 146 - 5x. -5x + 6 Collect the terms in 2 - 308h + 3 + 98h + 224h - 6 + 69h. 83h - 1 Collect the terms in -348 - 371 + 2j + 1057 - 527. 2j - 189 Collect the terms in -4489640r - 4489623r + 13468869r - 4489568r. 38r Collect the terms in 1335203u*3 + 1335194u*3 - 4005613u*3 + 1335195u*3. -21u*3 Collect the terms in 5940001468i - 5940001468i - 4i*3. -4i*3 Collect the terms in 550153l*2 - 833617l*2 + 971308l*2 + 3145881l*2. 3833725l*2 Collect the terms in -96c - 100c + 121c + 68c + 10 - 4. -7c + 6 Collect the terms in -929645 - 9w2 + 2w*2 + 929646. -7w2 + 1 Collect the terms in -4792 - 1660 + 979 + 621 - 1160 + g. g - 6012 Collect the terms in 78 + 163 - 518 + 75 + b3 + 112. b*3 - 90 Collect the terms in 23045866c*3 + 0 + 0 - 23045631c*3. 235c*3 Collect the terms in 3595c + 4361c + 1042c + 1331c. 10329c Collect the terms in 63l3 + 4l - 171l3 + 0l + 9l2 + 65l*3 + 52l*3. 9l*3 + 9l*2 + 4l Collect the terms in 1129846q3 - 376616q*3 - 376617q*3 - 376609q*3. 4q*3 Collect the terms in 42w - 260w - 156w - 217w - 16w. -607w Collect the terms in 55721j*2 + 11924j*2 - 14511j*2. 53134j*2 Collect the terms in 3334691m*2 + 3332894m*2 - 6667582m*2. 3m*2 Collect the terms in -1661t*2 - 2222t*2 - 853t*2 + 0 + 0. -4736t*2 Collect the terms in -2h*2 + 5136 - 4065h*3 - 2570 - 2566. -4065h*3 - 2h*2 Collect the terms in -127 - 146558p + 6p3 + 146558p. 6p3 - 127 Collect the terms in 245c - 392c + 578c*2 - 577c*2 - 273c. c*2 - 420c Collect the terms in -43845x + 132028x - 44342x - 43827x. 14x Collect the terms in -1120 + 13j*2 + 1120 - 6j*2 - 4j*2 + 3780j*3 - 3767j*3. 13j*3 + 3j*2 Collect the terms in -1136s - 2846s + 275s - 323s + 260s. -3770s Collect the terms in 31398412x - 31398412x - 31 - 35x*2 + 31. -35x*2 Collect the terms in 3 + 9w*2 + 7328w + 0 - 7328w. 9w*2 + 3 Collect the terms in -2724617298n + 2724617298n - 33n*2 - 1 + 3. -33n*2 + 2 Collect the terms in -1502 + 2970 + 20d*2 - 13d*2 - 5d - 2d - 1468. 7d*2 - 7d Collect the terms in -r + r + 2r - r + 11972r*3 - 2r. 11972r3 - r Collect the terms in 79l*2 - 3l - 1105l3 + 14l*3 - 79l*2 + 3l. -1091l3 Collect the terms in 172500762n*2 - 86250326n*2 - 86250434n*2. 2n*2 Collect the terms in 101883503a*2 - 1095a - 101883506a2 + 1095a. -3a2 Collect the terms in -301 + 0l*2 + 3l + l2 + 135. l2 + 3l - 166 Collect the terms in 945b - 1778b + 485b - 6019b - 6634b. -13001b Collect the terms in 1871q - 82q3 - 945q - 926q. -82q*3 Collect the terms in 645f - 3f2 + 650f + 672f + 652f - 2326f - 293f. -3f2 Collect the terms in 6355n + 1256105 - 1256105. 6355n Collect the terms in -139559216c - 1 + 1 + 139559212c. -4c Collect the terms in 9688560l + 9688548l + 9688558l - 29065657l. 9l Collect the terms in -4u - 14669 - 3893 - 19595. -4u - 38157 Collect the terms in -226 + 412x*3 + 131 - 822x*3 + 408x*3. -2x*3 - 95 Collect the terms in 35035137 + 213s - 35035137. 213s Collect the terms in 9400z + 31 - 4675z + 17z*3 - 4728z. 17z3 - 3z + 31 Collect the terms in -15081r3 - 47425r*3 - 68613r*3. -131119r*3 Collect the terms in -274317471 + 274317471 + 41a*2. 41a*2 Collect the terms in -3 + 1558657y + 1417364y + 1. 2976021y - 2 Collect the terms in -9z*2 + 411941	{ "pile_set_name": "DM Mathematics" }
. 18 Let i = 9862 + -502913/51. What is the common denominator of 17/15 and i? 255 Let t be (-294)/(-4)(-48)/18. What is the common denominator of 3 - t/(-48)(-93)/(-63) and 23/12? 36 Let y be ((-298)/3052 - (-4)/14)2. Let g = y + -9052/16241. Calculate the common denominator of g and 53/6. 894 Find the common denominator of 53/108 and 8/40(-190)/66. 1188 Let i(v) = 21v2 - 9v - 4. Let z be i(4). Let j = 571/2 - z. Calculate the common denominator of j and -59/10. 10 Suppose 0 = -9h + 2h + 14. Let d = 15 - 9. What is the smallest common multiple of d and h? 6 Let a(c) = -c*2 + 2c + 5. Let u be a(3). Let k be (12/(-8))/((-6)/40). What is the smallest common multiple of 4 and k + u(-1 - -2)? 12 Find the common denominator of ((-10)/(-15))/(72/(-1863)) and -59/24. 24 Suppose 29 = -2i - y, -5y - 53 = 4i - 8y. Let b = i + 20. Let x = -8 + 11. Calculate the least common multiple of b and x. 6 Let c = -359/6 - -169/2. What is the common denominator of -33/17 and c? 51 Let o = 4959/28 - 1385/7. Find the common denominator of o and 26/1242/20. 20 Let j(q) = -q*3 - 6q*2 + 2q. Let h be j(-6). Let b = 22 + h. Calculate the lowest common multiple of 11 and b. 110 Suppose 10x + 3l = 7x + 666, -4x - l + 897 = 0. Calculate the lowest common multiple of 6 and x. 450 Let p be (-170)/(-3) + (-14)/21. Suppose -4z + p = 8. What is the least common multiple of z and 78? 156 Let u = -33 - -36. Suppose l + 92 = -ul. What is the common denominator of 28 and l? 1 Let z be 632/(-24)-31. Suppose -j = -4p - 42, -4j + 19 = -2p - z. What is the smallest common multiple of 16 and j? 176 Find the common denominator of (-153)/(-20) + (-21)/3 and 151/12. 60 Let s = -328 + 349. What is the lowest common multiple of 140 and s? 420 Let d be 2/(-4)2 - -4. Suppose 7 = 4f - df. Calculate the smallest common multiple of 2/((-4)/6) + 7 and f. 28 Let l(w) = -w*3 + 2w*2. Let r be l(2). Suppose v - 8 = -r. What is the least common multiple of v and 110/(-2)(-4)/10? 88 Let q(v) = -v*3 - 5v*2 - 5v - 3. Let j be q(-3). Calculate the lowest common multiple of 7 and 3 + 1 - (-9 - j). 7 Calculate the lowest common multiple of 12 and (-1320)/(-4)34/85. 132 Let q(d) = -50d - 116. Calculate the smallest common multiple of q(-8) and 9. 2556 Let g be 04/(-16) + (-6518)/(-7). Let s = g - 936. Find the common denominator of s and 63/16. 112 Let b = 67775458214986 + -50153824986632027/740. Let m = 19043866 - b. Let j = -104/37 + m. Find the common denominator of 83/22 and j. 220 Let z = -141 + 138. Calculate the lowest common multiple of 2z/24 - (-343)/28 and 40. 120 Suppose 447v = 452v - 10. What is the smallest common multiple of (-1)/(-3) - (-40)/6 and v? 14 Suppose -1 = 2m - 15. Let u(k) = -k3 + 6k*2 + 8k - 4. Let w be u(m). What is the least common multiple of 9 + w(2 - 3) and 11? 66 Suppose 0 = -601r + 551r + 4550. Calculate the lowest common multiple of r and 39. 273 Let y = -241 - -283. What is the lowest common multiple of 63 and y? 126 Let v = 6 + -3. Let t = v + -28. Let j = -4957/2 + 2481. Calculate the common denominator of j and t. 2 Let r be (4/(-5))/((-11)/(-55)). Find the common denominator of (-819)/(-196) + (-1)/r and 89/4. 28 Find the common denominator of 6/(-8)(-725)/203 and -15/7. 28 Let d = -10/623 + -19153/9968. Let g = -19 + 1417. Let n = -5495/4 + g. What is the common denominator of d and n? 16 Let s = 98 + -775/8. Find the common denominator of s and -107/486. 1944 Let w = 3936/3173 + -5/167. Calculate the common denominator of 83/10 and w. 190 Let l = 7/381 + 6181/2286. Calculate the common denominator of 3/22 and l. 198 Let p = -29 + 51. Calculate the smallest common multiple of p and -34(-3)/(6 + -3). 374 Let q(z) = -z2 - 6z + 8. Let y be q(-8). Let d(j) = -j + 2. What is the least common multiple of d(y) and 2? 10 Let d be 1/4 + 530/6. Let y be 780/9 - (6 - 4). Let a = d - y. Find the common denominator of a and -91/12. 12 Let g be -2 - (-10)/6 - 35/3. What is the lowest common multiple of (2/(-4))/(1/g) and 28? 84 Find the common denominator of ((-26)/6)/(((-1360)/24)/(-17)) and 79/21. 210 Suppose 10n = 5n. Suppose n = 2b - 7b + 60. Calculate the smallest common multiple of 14 and b. 84 What is the common denominator of (2 - (-6)/(-9))/(2/(-69)) and (-102)/(-4) + 3/(-9)? 6 Suppose 0 = -4p - 0p + 32. Calculate the common denominator of 9/((-90)/56) + -4 and (38/8)/(22/p). 55 Let h = 246708963703/96866644 + -1/24216661. Let t = -3699 + 1154. Let i = t + h. Find the common denominator of 43/8 and i. 56 Let g = -1550 + 30893/20. Find the common denominator of g and 51/4. 20 Let b be (-3)/((-18)/34) - (-3)/9. What is the smallest common multiple of b - (-6 - (-1 - 2) - -5) and 18? 36 Let t be 66/(-12)9134/(-16)2. Let d = -6269 + t. Find the common denominator of -97/4 and d. 8 Suppose 2c - 3w - 2 = 0, -2c + 0c + 2w = 0. Let g = c + 11. Suppose 13h - 45 = 33. What is the least common multiple of g and h? 18 Let i = 5 - -19. Suppose 0 = 2t + 5d - 0d - 48, 2d = 0. Suppose 4z - 32 - t = 0. Calculate the least common multiple of i and z. 168 Calculate the least common multiple of 30 and ((-20)/6)/(2475/(-162) - -15). 60 Let w = 1439 - 1019. Calculate the smallest common multiple of w and 7. 420 Let d be (-3733)/(-132) - (-10)/(-15). Let r = -5323 - -58645/11. Let h = d - r. Calculate the common denominator of -103/22 and h. 44 Let d(o) = 3o - 1700 + 3o - 4o + 116. Let a be d(0). Let m = a + 4802/3. Calculate the common denominator of m and -7/16. 48 Suppose -14 = -2j + z, j + j - 14 = -5z. Suppose -2w = -2f - 3f - 31, 2f = -2w - 4. Let u = f + j. What is the lowest common multiple of u and 4? 4 Let w = -1597 + 6425/4. Calculate the common denominator of w and 156/(-88) - 2/2. 44 Let v = 513/20 - 243/10. Find the common denominator of v and -4 + (2 + 669/(-258) - -4)/1. 860 Let r be (-136703)/(-20) + (8 - 6). Let h = r - 6835. What is the common denominator of h and -59/8? 40 Let r(u) = -u3 - 18u*2 - 18u - 13. Let c be r(-17). Find the common denominator of 69/4 and 5/c(-370)/(-200). 16 Let g be 7(-4 + (-124)/(-28)). Suppose 3v = -g + 15. What is the lowest common multiple of v and 6? 12 Let p be (-4)/22 - 664/(-22). Suppose -3s + k = 4k - 33, -4s + 3k = -p. Calculate the least common multiple of s and 5. 45 Let c(u) = -4u - 2. Let p be (0 + 3 - 2)-191. Let d = p + 93. What is the least common multiple of c(-5) and d? 18 Let x = 1423/12 + -121. What is the common denominator of 7/20 and x? 60 Let c = 43 + -29. Find the common denominator of 31/(-35) + 4/c and (-1568)/126 - 1-6. 45 Find the common denominator of 12/5 and (-642)/120 + (-4)/(-40). 20 Suppose 0 = -14p + 13p - 2x + 353, 2x + 712 = 2p. Calculate the lowest common multiple of p and 7. 2485 Calculate the common denominator of 17/333 and 71/((4 + -1)/(3/(-21))). 2331 Let z = 246 + -233. Find the common denominator of 19/4 and z. 4 Let p = 1083/7 + -23693/154. Find the common denominator of p and -33/10. 110 Let s = 52 + -31. Suppose 4a = -3k + 53, 3a - 4k = -0k + s. Let v(r) = 3r - 1. Calculate the smallest common multiple of v(3) and a. 88 Suppose 62p - 2622 = 478. What is the smallest common multiple of p and 90? 450 Let c = 52817/21 + -2516. What is the common denominator of c and -24/7? 21 Let f = -457/2 + 265. What is the common denominator of 8/(-20) - (-246)/165 and f? 22 Let a be -1 - 5/(-360)279/42. Let p = 2/21 + a. Find the common denominator of -127/18 and p. 144 Suppose 3b + 0b + 3a - 126 = 0, 3a - 169 = -4b. Calculate the lowest common multiple of b and 7. 301 Let f(c) = 20c - 1032. Calculate the least common multiple of 14 and f(70). 2576 Let k = -5144 + 46351/9. What is the common denominator of (-658)/(-244) - ((0 - 2) + 4) and k? 1098 Let k(o) = o*3 - 13o*2 + 3o - 7. Let a be k(13). Suppose -2y - 37 + 1 = -3r, -2r = -4y - a. What is the smallest common multiple of r and 4? 20 Let s = -156/23 + 1935/92. Calculate the common denominator of 49/32 and s. 32 Suppose 2a + 8 = -0a, 0 = 2i + 2a - 132. Let z = i + -17. Suppose -3g = 2s - 32, -s + z = 5g + 2s. What is the lowest common multiple of 5 and g? 10 Let i = -2101 - -6244/3. Let t = -327 + 10790/33. Find the c	{ "pile_set_name": "DM Mathematics" }
? False Does 13 divide 1850893486? True Is 306 a factor of 85057817? False Is 1583 a factor of 18749052? True Is 307 a factor of 268055208? True Is 534 a factor of 40205089? False Is 98812702 a multiple of 21? False Does 25 divide 366822725? True Is 11 a factor of 545766386? True Is 16447705 a multiple of 131? True Does 16 divide 6711788? False Is 24 a factor of 95153952? True Is 310094063 a multiple of 2242? False Is 46181989 a multiple of 296? False Is 7256489 a multiple of 7? False Is 24 a factor of 199647264? True Is 13542336 a multiple of 1383? True Is 31642024 a multiple of 2? True Is 63 a factor of 22290534? True Is 264095 a multiple of 31? False Is 53 a factor of 202448552? True Is 7 a factor of 7497427? True Is 642808 a multiple of 84? False Is 349 a factor of 1360455640? False Is 16745021 a multiple of 493? False Is 226 a factor of 204619561? False Does 74 divide 13385936? False Is 170 a factor of 1385429363? False Is 64081457 a multiple of 1368? False Is 19 a factor of 36109360? False Is 56014580 a multiple of 47? False Is 33 a factor of 17335024? False Is 2168481554 a multiple of 41? True Is 119894784 a multiple of 8? True Is 10 a factor of 128223107? False Is 1134155 a multiple of 9? False Is 85173252 a multiple of 14? False Does 169 divide 64310415? True Does 22 divide 67532652? True Is 19610055 a multiple of 1304? False Is 95 a factor of 745960855? False Is 32 a factor of 89060992? True Does 72 divide 3164021642? False Is 436389248 a multiple of 16? True Is 2633 a factor of 415271494? True Does 2897 divide 754044440? False Is 113 a factor of 21530568? True Does 1202 divide 30911834? True Is 106737218 a multiple of 27? False Is 32 a factor of 1197490560? True Is 111 a factor of 92545740? False Is 2 a factor of 1595748? True Is 19 a factor of 46170770? False Is 558820 a multiple of 20? True Is 2321885757 a multiple of 3130? False Is 90 a factor of 34533067? False Does 1425 divide 42860149? False Does 519 divide 43977448? False Is 6215203 a multiple of 237? False Is 5 a factor of 67066724? False Does 21 divide 70738681? False Does 98 divide 670616940? True Is 8 a factor of 32097570? False Is 85 a factor of 13749333? False Is 86 a factor of 657198145? False Is 107815818 a multiple of 10? False Does 13 divide 37398101? True Is 18555270 a multiple of 29? False Is 37 a factor of 198667864? False Is 49409997 a multiple of 29? True Is 780 a factor of 33030825? False Is 1110 a factor of 1520322787? False Is 137326887 a multiple of 10? False Is 517 a factor of 288475143? True Is 33 a factor of 157215333? True Is 1855276015 a multiple of 29? True Is 6130119 a multiple of 107? False Is 486772865 a multiple of 2? False Is 901 a factor of 670648538? True Does 2 divide 47941377? False Is 4180288 a multiple of 339? False Is 39 a factor of 11964934? False Is 286 a factor of 147714019? False Does 4495 divide 97478566? False Does 7 divide 15298661? True Is 356396514 a multiple of 21? False Is 2469855169 a multiple of 1283? False Does 9 divide 30549641? False Is 93 a factor of 932275435? False Is 658 a factor of 28949221? False Is 341 a factor of 45989755? False Is 5 a factor of 290422465? True Is 65 a factor of 20870980? True Does 5 divide 44847911? False Is 194674635 a multiple of 97? True Is 26 a factor of 38608154? True Is 20 a factor of 313086240? True Is 50885138 a multiple of 21? False Does 25 divide 28566452? False Is 709655348 a multiple of 482? True Does 375 divide 202180500? True Is 63 a factor of 360677868? False Does 111 divide 59162305? False Is 8078686 a multiple of 7? True Is 211037595 a multiple of 3999? False Is 1696 a factor of 224617310? False Is 465185252 a multiple of 263? False Is 208387047 a multiple of 11? True Does 94 divide 739322784? True Does 22 divide 21282756? True Does 57 divide 363740712? True Is 914677334 a multiple of 1303? True Is 34 a factor of 237245472? True Is 1338444 a multiple of 9? True Is 648 a factor of 948023352? True Does 313 divide 289221703? True Is 24 a factor of 1450377768? True Is 61 a factor of 277327430? False Is 6 a factor of 4097009? False Is 112 a factor of 56615664? True Does 8 divide 145068240? True Is 231 a factor of 1312758694? False Does 56 divide 6300392? True Does 21 divide 2393344737? True Is 467 a factor of 30174018? False Is 94486860 a multiple of 745? True Does 87 divide 52330954? False Is 70 a factor of 98562520? True Is 3241026 a multiple of 1139? False Is 781883478 a multiple of 19? True Is 7 a factor of 20901419? True Is 290 a factor of 7521440? True Is 2008 a factor of 278777046? False Is 1935 a factor of 326763450? True Is 306482610 a multiple of 105? True Is 1288117910 a multiple of 91? False Does 19 divide 25599251? True Does 15 divide 468522270? True Does 7 divide 57992893? True Is 151749990 a multiple of 595? True Does 98 divide 58787162? True Is 564 a factor of 167747136? True Does 9 divide 5941845? True Is 27 a factor of 2240173827? True Is 6908 a factor of 349171768? True Is 11 a factor of 103899884? True Is 13 a factor of 187873479? False Is 53867304 a multiple of 1233? True Does 202 divide 35267206? False Does 9 divide 4867430? False Does 106 divide 32326942? False Is 49 a factor of 46238311? True Is 5394114 a multiple of 130? False Does 79 divide 322459992? False Is 766964261 a multiple of 25? False Is 169606761 a multiple of 23? True Is 43 a factor of 1755984141? False Is 240 a factor of 1133771300? False Does 24 divide 392979480? True Is 220 a factor of 166967680? True Does 1159 divide 31026430? True Is 43 a factor of 2075886275? True Is 17787121 a multiple of 1507? True Is 27 a factor of 1629396594? True Is 87046479 a multiple of 117? True Is 29544984 a multiple of 2883? True Is 135513573 even? False Is 171 a factor of 36920232? False Is 884812628 a multiple of 13? False Does 926 divide 332832490? False Does 12 divide 51418327? False Is 967 a factor of 140527803? False Is 19819839 a multiple of 233? False Is 349 a factor of 135038957? False Does 2323 divide 3350342104? True Is 93385242 a multiple of 5? False Is 227156380 a multiple of 843? False Is 98 a factor of 2471793? False Is 13558282 a multiple of 646? False Does 50 divide 95848550? True Does 3 divide 524720253? True Is 252038032 a multiple of 1424? True Is 13 a factor of 194518753? True Is 982300554 even? True Does 429 divide 240408? False Does 214 divide 1594879174? False Is 972 a factor of 1432395576? True Does 614 divide 17194456? True Does 16 divide 2345897680? True Does 28 divide 1299267027? False Does 114 divide 121737294? True Is 52440629 a multiple of 91? False Is 5 a factor of 263650? True Is 22 a factor of 345266971? False Is 18 a factor of 15990264? True Is 40028566 a multiple of 440? False Does 4065 divide 2176678444? False Does 14 divide 3906057? False Does 43 divide 206659935? True Does 91 divide 241944612? True Does 610 divide 981702890? True Is 106 a factor of 1933347? False Does 132 divide 179438556? True Is 12 a factor of 43302787? False Does 66 divide 15226530? True Is 5727928 a multiple of 8? True Does 3181 divide 438915902? False Does 21 divide 38693697? True Is 36123992 a multiple of 1324? False Is 19248524 a multiple of 351? False Does 18 divide 92965105? False Is 27024128 a multiple of 123? False Is 29829897 a multiple of 204? False Is 33 a factor of 17773017? False Is 13056647 a multiple of 13? False Does 14 divide 146538168? True Does 464 divide 1534676130? False Does 21 divide 2176839? True Is 171 a factor of 378442916? False Is 729015540 a multiple of 2742? True Is 34763472 a multiple of 54? True Is 128 a factor of 35339453? False Is 3005 a factor of 1484552954? False Is 115711724 a multiple of 55? False Does 25 divide 249962278? False Does 1119 divide 105628005? True Is 5869326 a multiple of 19? False Does 141 divide 52175057? False Is 2576 a factor of 324346261? False Is 13 a factor of 148890534? True Is 73134412 a multiple of 26? True Does 295 divide 31584765? True Is 276750499 a multiple of 596? False Does 162 divide 2518938? True Does 30 divide 5117021? False Is 73 a factor of 19796432? True Is 1080288 a multiple of 186? True Is 1012201502 a multiple of 146? True Is 264619645 a multiple of 234? False Is 3033461 even? False Is 280178232 a multiple of 1067? False Is 67633	{ "pile_set_name": "DM Mathematics" }
, -0.088 Sort -2/11, -3, -0.111483. -3, -2/11, -0.111483 Sort 337, -50, 5. -50, 5, 337 Sort -1791, -23, -5 in decreasing order. -5, -23, -1791 Sort 41, 1, -1, 5, -5, -23. -23, -5, -1, 1, 5, 41 Put -86, 2, -368 in descending order. 2, -86, -368 Sort -0.2, 10, -236, 2/7, -1/6. -236, -0.2, -1/6, 2/7, 10 Sort -9, -4, 10, 0, 148 in ascending order. -9, -4, 0, 10, 148 Sort -5, -84, 46, 9 in ascending order. -84, -5, 9, 46 Put 5, 362263, 0 in increasing order. 0, 5, 362263 Sort 128, -5, 15, -3 in ascending order. -5, -3, 15, 128 Put 2763, -2, 1, 2, 6 in ascending order. -2, 1, 2, 6, 2763 Put 3013, 13, -29 in decreasing order. 3013, 13, -29 Sort -4, -2, -134, -22 in decreasing order. -2, -4, -22, -134 Sort 0.3, -2, -2/3, 1, -1021 in increasing order. -1021, -2, -2/3, 0.3, 1 Sort 2, -4, -5, 2888, 3 in ascending order. -5, -4, 2, 3, 2888 Put 0, 19, -1, 2/17, 0.06 in ascending order. -1, 0, 0.06, 2/17, 19 Put -7, 18, 28, 22 in increasing order. -7, 18, 22, 28 Sort 0.4, -146540, 0, -4, 2/13, -3 in decreasing order. 0.4, 2/13, 0, -3, -4, -146540 Sort -1/3, -10620, -4, 0.5, -0.1 in ascending order. -10620, -4, -1/3, -0.1, 0.5 Put 2, 3/4, 1/32, -4, -0.5 in descending order. 2, 3/4, 1/32, -0.5, -4 Sort -5, -11, 5, 2/373, -2 in increasing order. -11, -5, -2, 2/373, 5 Sort 5, 278067, 14 in ascending order. 5, 14, 278067 Sort -5, -1370, -6 in decreasing order. -5, -6, -1370 Put -2, -190, -3, -4 in descending order. -2, -3, -4, -190 Sort -5/3, 2, -0.4, -233356 in ascending order. -233356, -5/3, -0.4, 2 Sort 47, -2699, -5 in decreasing order. 47, -5, -2699 Sort -5, -2, 4, -139, -7. -139, -7, -5, -2, 4 Sort -0.3, 0.2, -1/2, 1, -4/355 in ascending order. -1/2, -0.3, -4/355, 0.2, 1 Sort 2693, 4, -3, -2 in increasing order. -3, -2, 4, 2693 Put -5, 4, 35, -32, -18, 0 in decreasing order. 35, 4, 0, -5, -18, -32 Put -2, 32, 12, 0, -1 in descending order. 32, 12, 0, -1, -2 Put 26, -3, -4, -64 in decreasing order. 26, -3, -4, -64 Put -5, -3, -5330 in increasing order. -5330, -5, -3 Sort 0.2, -0.01, 1/92, -0.3. -0.3, -0.01, 1/92, 0.2 Put -305/4, 0.2, -4 in descending order. 0.2, -4, -305/4 Put -666, 37, -1, 5 in descending order. 37, 5, -1, -666 Put 0, -61, -9, 4, 1, 3 in decreasing order. 4, 3, 1, 0, -9, -61 Put -83, -5, -10, -3, 4 in increasing order. -83, -10, -5, -3, 4 Put 2, 248, 0, -32 in decreasing order. 248, 2, 0, -32 Sort -1034, 3, -118, -5 in increasing order. -1034, -118, -5, 3 Sort 1, -6, 2, -5, -9, -111 in decreasing order. 2, 1, -5, -6, -9, -111 Put -19, -4, -531 in ascending order. -531, -19, -4 Sort 66, -27, 1/4, 17. -27, 1/4, 17, 66 Put 3, 219, 48, 2 in descending order. 219, 48, 3, 2 Sort -4, 0.16, -0.09, -1, 33, 1. -4, -1, -0.09, 0.16, 1, 33 Sort -0.3, -24, -1151, 1.2 in descending order. 1.2, -0.3, -24, -1151 Put -5628, -1/3, -5, 2/11, -4 in ascending order. -5628, -5, -4, -1/3, 2/11 Sort 4, -2, -4, -58, -10 in ascending order. -58, -10, -4, -2, 4 Sort 5, 0.3, 6/3559, -0.2. -0.2, 6/3559, 0.3, 5 Sort -1, 3/20, 5/7. -1, 3/20, 5/7 Sort 2, 419, 2037 in descending order. 2037, 419, 2 Sort 4, 5, 0, -1, 983, 2 in descending order. 983, 5, 4, 2, 0, -1 Sort 6, 5, -1/22, 0.8, 9 in ascending order. -1/22, 0.8, 5, 6, 9 Sort -57, 2, -1/6, -5, -2/9, -6 in descending order. 2, -1/6, -2/9, -5, -6, -57 Sort -3, 5, 6, -153, 2, -1 in descending order. 6, 5, 2, -1, -3, -153 Put 3, -4, -19, 2235 in descending order. 2235, 3, -4, -19 Put 1430, -0.2, 4/13 in increasing order. -0.2, 4/13, 1430 Put 12, 7, 1, 3, 201 in decreasing order. 201, 12, 7, 3, 1 Put -0.022, -3, -1.344 in descending order. -0.022, -1.344, -3 Put -5, -75, 2613 in descending order. 2613, -5, -75 Sort 54558, 4, -5, -1. -5, -1, 4, 54558 Sort 2, 33, 1, -15/64 in increasing order. -15/64, 1, 2, 33 Put 103865, -2, -4 in descending order. 103865, -2, -4 Sort 10, -3, 0, 118. -3, 0, 10, 118 Sort -112, 2, 1, -17, -1 in increasing order. -112, -17, -1, 1, 2 Put 1311, 5, -3 in descending order. 1311, 5, -3 Sort -4, -519, 39 in decreasing order. 39, -4, -519 Sort 3, -1268, 1, -3 in decreasing order. 3, 1, -3, -1268 Put -3/5, -9, 15 in ascending order. -9, -3/5, 15 Sort -2, 62, -797. -797, -2, 62 Put -22, 5, -13, -3, -187 in ascending order. -187, -22, -13, -3, 5 Put 0.4, -1/18, -104, 3/8 in increasing order. -104, -1/18, 3/8, 0.4 Sort -13, -463, -4 in increasing order. -463, -13, -4 Sort 3, -42, 430. -42, 3, 430 Sort -5, 1, 13341. -5, 1, 13341 Sort -10, -7, -12.93 in descending order. -7, -10, -12.93 Sort 5.2, -2, 59, -7, -1/5, 1/6. -7, -2, -1/5, 1/6, 5.2, 59 Put 5, 48, 283 in descending order. 283, 48, 5 Sort -16, 3, -5, -4847. -4847, -16, -5, 3 Put 2/13, -0.33, -2, -21 in ascending order. -21, -2, -0.33, 2/13 Sort 25, 5, 1, -5, -83, 0. -83, -5, 0, 1, 5, 25 Put -2, 2, 22530, 1, -5 in descending order. 22530, 2, 1, -2, -5 Put 0, -3, 3, -154, 2 in increasing order. -154, -3, 0, 2, 3 Sort 2, -2099, 3/7, -1, -2/13, -2 in increasing order. -2099, -2, -1, -2/13, 3/7, 2 Put 5/3, -3/4, -96, 5, 1/11 in decreasing order. 5, 5/3, 1/11, -3/4, -96 Put 2/19, 0.5, -4 in descending order. 0.5, 2/19, -4 Sort -93, -124, -5 in decreasing order. -5, -93, -124 Sort 5, -12, 1, -5, -2, -10 in descending order. 5, 1, -2, -5, -10, -12 Sort -10, 16, 2, -4. -10, -4, 2, 16 Put 5, 2/19, -363, 4 in ascending order. -363, 2/19, 4, 5 Sort 41, 0, -405 in descending order. 41, 0, -405 Sort -29, 6, -5, 0, -0.4 in decreasing order. 6, 0, -0.4, -5, -29 Sort 23, 4, 2, -35 in ascending order. -35, 2, 4, 23 Put -2, 121, 2/11, -3, 2/13 in ascending order. -3, -2, 2/13, 2/11, 121 Sort 45, -106, -4, -0.1, -0.02 in increasing order. -106, -4, -0.1, -0.02, 45 Sort 262, -9, -3, 2 in increasing order. -9, -3, 2, 262 Sort -173, -7, -4, -1, -5 in descending order. -1, -4, -5, -7, -173 Put 3, -839, 79, -5 in ascending order. -839, -5, 3, 79 Put 39, 12, 20, 0, -1 in increasing order. -1, 0, 12, 20, 39 Sort -5, -53, -8, 4, 7 in decreasing order. 7, 4, -5, -8, -53 Sort 7669, 0, 3, 4 in increasing order. 0, 3, 4, 7669 Put 6, -29, -3, -1, 23 in ascending order. -29, -3, -1, 6, 23 Put 89130, 4, 22 in descending order. 89130, 22, 4 Put -3, -5, 208697, 1 in decreasing order. 208697, 1, -3, -5 Put 6, 3493, -2, 3, 5 in descending order. 3493, 6, 5, 3, -2 Put 3.8, -21447, -3/4 in decreasing order. 3.8, -3/4, -21447 Sort 2, 4, -121 in ascending order. -121, 2, 4 Sort 58, 0.32, 0.3, -5, -0.3, -2/13 in ascending order. -5, -0.3, -2/13, 0.3, 0.32, 58 Sort 240, 0.05, -1, 3, 0.4. -1, 0.05, 0.4, 3, 240 Sort -628, -4, 5, 33 in decreasing order. 33, 5, -4, -628 Put 117, -2, 18 in increasing order. -2, 18, 117 Sort 55, -2, 4, 78, 5, -5. -5, -2, 4, 5, 55, 78 Sort -4, 75, -25, 1 in increasing order. -25, -4, 1, 75 Put -3085, 5, -3, -4 in descending order. 5, -3, -4, -3085 Sort -7, 0, 5, -5, -1 in increasing order. -7, -5, -1, 0, 5 Sort 3/2, 0, 128, -7, 3 in increasing order. -7, 0, 3/2, 3, 128 Put 13, -5, -2, 3, -249 in descending order. 13, 3, -2, -5, -249 Put -4, 0, 2, -9, 1, 46 in ascending order. -9, -4, 0, 1, 2, 46 Put -4, -15657, 0.08 in descending order. 0.08, -4, -15657 Sort 0.11, -51, -1/4, -5, -2 in increasing order. -51, -5, -2, -1/4, 0.11 Put -67, -0.06, -4, 4, 34/9 in increasing order. -67, -4, -0.06, 34/9, 4 Put -90, 0.5, 16, -5, 0.4 in ascending order. -90, -5, 0.4, 0.5, 16 Sort 5, -3, -40738 in descending order. 5, -3, -40738 Sort -2, -5, 19, -9, 26, 5 in ascending order. -9, -5, -2, 5, 19, 26 Put 0.2, 0.107, -0.279, -5 in descending order. 0.2, 0.107, -0.279, -5 Sort -4, 253, 0, 1, -5, 13 in descending order. 253, 13, 1, 0, -4, -5 Put -152, -197, 1 in increasing order. -197, -152, 1 Sort -2, 56, 5, 4. -2, 4, 5, 56 Put 984.35, 1.1, -2 in increasing order. -2, 1.1, 984.35 Put 13, 23, 5 in increasing order. 5, 13, 23 Put -2/21, -1/4, -0.02 in descending order. -0.02, -2/21, -1/4 Put 20, 25191, 2, 3 in increasing order. 2, 3, 20, 25191 Put 2, -15, 1, 182, 4, 3 in increasing order. -15, 1, 2, 3, 4, 182 Sort -3, -1, 44.2, -3/7, -2 in descending order. 44.2, -3/7, -1, -2, -3 Put -3065, -4, 5 in descending order. 5, -4, -3065 Sort -0.4, 2/21, 489, -0.3, -0.2 in increasing order. -0.4, -0.3, -0.2, 2/21, 489 Sort -52, -9, 12, -3, 0, -1 in descending order. 12, 0, -1, -3, -9, -52 Put -8, -173, 3, -2/3 in increasing order. -173, -8, -2/3, 3 Put 0, -10, -2769 in ascending order. -	{ "pile_set_name": "DM Mathematics" }
= -7t3 - 17t*2 + 55t - 31. Let f(g) = -g*3 - 3g*2 + 9g - 5. Let i(h) = qo(h) + 39f(h). Factor i(v). 3(v - 3)(v - 1)2 Let s(d) be the second derivative of d2 + 48d + 0 - 1/60d*4 + 3/10d*3. Factor s(k). -(k - 10)(k + 1)/5 Suppose 376/9a - 2/9a*2 - 17672/9 = 0. Calculate a. 94 Let v(m) be the second derivative of 4/25m*5 + 1/15m*6 + 1/30m*4 - 16m + 0 + 0m2 - 2/15m*3. Factor v(o). 2o(o + 1)2(5o - 2)/5 Let n = -170 + 174. Let j(u) be the first derivative of n - 1/6u*3 - 2u - u*2. Let j(r) = 0. What is r? -2 Let z(j) be the third derivative of 0j*4 + 4/15j*3 + 0 - 1/50j*5 - 12j*2 + 1/300j*6 + 0j. Factor z(b). 2(b - 2)2(b + 1)/5 Let t(h) = -4h5 - 6h*4 + 22h*3 + 12h*2 + 6h. Let a(z) = -z5 + z4 + z*3 + 2z*2 + z. Let b(n) = 6a(n) - t(n). Factor b(j). -2j3(j - 4)(j - 2) Suppose -7/4h + 1/2h2 + 1 + 1/4h*3 = 0. What is h? -4, 1 Let p = -11400 + 2063406/181. Let f = 284/2353 + p. Find g, given that -2/13g + fg2 + 0 = 0. 0, 1 Let m(t) be the second derivative of t4/12 + t3/6 - t2/2 + 2t. Let l = 23 + -24. Let p(u) = -2u2 - 2u - 1. Let v(b) = lp(b) - 5m(b). Factor v(r). -3(r - 1)(r + 2) Let m be (-40)/15 - -4 - (-4)/6. Let y be m(4 + -7)1/(-2). Factor -1/5p4 - 1/5p*y + 0 + 0p + 2/5p2. -p2(p - 1)(p + 2)/5 Suppose 1355u + 1377u + 78 = 2771u. Let q = 29 + -13. Solve 16/5 - qj + 20j*u = 0 for j. 2/5 Let g be 20/624/10. Solve -3k2 + 4k + 0 - 2 + g - k = 0. -1, 2 Suppose -4k - y = -16, 0k + 5 = -k + 2y. Factor -2j*3 - 12j + 4j3 + 9j*2 + 4 - 3j*4 + 4j*k - 16. -3(j - 2)*2(j + 1)*2 Let w be (5/14)/(-5)412/(-309). Let -2/21o + wo*3 + 8/21 - 8/21o*2 = 0. Calculate o. -1, 1, 4 Suppose 4b + 7 = z + 11b, b - 1 = 4z. Let a(j) be the third derivative of -1/5j4 + 0j - 16/75j6 + z + 1/15j*3 - 4j*2 + 8/25j*5. Factor a(c). -2(4c - 1)3/5 Solve 36f*2 - 8f*3 + 4f*4 + 8 + 4f*3 - 16f*3 + 0f*3 - 28f = 0. 1, 2 Suppose 16/9b3 + 6b - 8/9 + 26/3b2 = 0. Calculate b. -4, -1, 1/8 Suppose r + 4 = 7. Factor -67u*r - 9u - 2 + 70u3 - 4. 3(u - 2)(u + 1)2 Let z(r) = 6r - 6. Let j be z(26). Find i such that 36i2 - 4i*3 - 8i*2 + 20 + ji - 194i = 0. 1, 5 Let c(x) be the first derivative of -32/3x*3 - 1/15x*5 + 0x + 2 + 4/3x4 + 4x*2. Let w(q) be the second derivative of c(q). What is r in w(r) = 0? 4 Let n(a) be the third derivative of 1/4a*4 + 1/60a*6 - 1/3a*3 + 0a - 11a2 + 0 - 1/10a*5. Find g, given that n(g) = 0. 1 Let i(k) be the third derivative of -7k5/60 + k4/8 - k*3/6 - 13k*2. Let w(q) = -3q*2 + q. Let p(g) = 2i(g) - 5w(g). Suppose p(y) = 0. Calculate y. -2, 1 Let p(c) be the second derivative of -c7/42 - 7c*6/15 - 69c*5/20 - 35c*4/3 - 50c*3/3 + 86c + 2. What is d in p(d) = 0? -5, -2, 0 Let r(l) be the first derivative of -l + 1 + l*2 - 1/3l3. Factor r(a). -(a - 1)2 Let o(t) be the third derivative of t5/360 + t4/72 - 2t3/9 - 34t*2. Let o(u) = 0. What is u? -4, 2 Let m(h) = 2h*2 + 3h - 1. Let d be m(1). Let x be (3/(-2))/(1/(-2)). Solve -2k4 + 5k*3 + 3k*x + 36k*2 - 38k*2 - 4k*d = 0. 0, 1/3, 1 Let s be (6 + (4 - 1 - 2))1. Let g be 5s/105 + 2/(-6). Determine r, given that 0r + g - 1/2r4 - 1/2r2 + r3 = 0. 0, 1 Let s(g) = -5g4 + 7g*3 + 2g*2 - 9g + 3. Let a(o) = -o4 + o3 + 2o2 + o - 1. Let y(j) = 2a(j) + 2s(j). Solve y(u) = 0 for u. -1, 1/3, 1 Let r be (2 - 1) + 1 + -2. Let g = 66790 + -66788. Factor -4/13i*g + r - 2/13i*3 + 0i. -2i2(i + 2)/13 Let d(b) be the second derivative of -3/100b5 + 0 - 9b - 1/20b4 + 1/5b*3 + 0b*2. Factor d(j). -3j(j - 1)(j + 2)/5 Let a(b) = 135b2 - 1700b + 55. Let o(g) = -5g2 + 63g - 2. Let k(d) = -2a(d) - 55o(d). Let k(n) = 0. Calculate n. 0, 13 Find z, given that 21/2z - 147/2z*2 - 1/2 + 343/2z*3 = 0. 1/7 Let m be (-7)/(-4) - 7/(-28). Factor -6/19 + 2/19h*3 - 10/19h - 2/19hm. 2(h - 3)(h + 1)2/19 Find n, given that -50/7n + 2/7n3 - 50/7 + 2/7n*2 = 0. -5, -1, 5 Suppose 63/4d*2 + 441/4d + 3/4d3 + 1029/4 = 0. What is d? -7 Let n(x) = -x - 3. Let w be n(7). Let i = -8 - w. Find l such that 4l*4 + 78l3 - l2 + 2li - 74l3 = 0. -1/2, 0 Let q(o) be the second derivative of o4/6 - 25o3/3 - 54o*2 - 58o - 3. Find h, given that q(h) = 0. -2, 27 Let v(a) be the second derivative of 3/2a2 - 7a - a*3 - 3/80a*5 + 0 + 5/16a*4. Factor v(d). -3(d - 2)*2(d - 1)/4 Let o(n) = -n*3 + n. Let w(j) = -8j*3 + 60j*2 + 5j. Let l(v) = 5o(v) - w(v). Factor l(s). 3s*2(s - 20) Let b(n) = -n*2 - 2. Let z be b(-3). Let k = z + 13. Factor -2 + 2 - 2h*k - h - 3h. -2h(h + 2) Suppose -13 = -6d + 35. Suppose dh + 5 = 21. Factor 2/9s3 + 0 - 2/9s + 0sh. 2s(s - 1)(s + 1)/9 Suppose 2 = -4j - 2, z + 128 = -2j. Let h be -4(-1)/2 - (-224)/z. Suppose 4/9m*3 + 4/9m*2 - hm - 2/9m5 - 2/9 - 2/9m*4 = 0. What is m? -1, 1 Suppose -84/5x - 44/5 + 3/5x3 - 5x*2 = 0. What is x? -2, -2/3, 11 Let h = 53 + -54. Let j be 1/4 - h35/20. Factor -1/3a3 - 8/3a + 5/3aj + 4/3. -(a - 2)2(a - 1)/3 Let l(f) be the first derivative of f*5/5 + 8f*4/3 + 14f*3 + 36f*2 + 26f + 15. Let n(p) be the first derivative of l(p). Factor n(d). 4(d + 2)(d + 3)*2 Let u(n) be the second derivative of 0n*3 - 1/168n*7 + 0n*2 + 0n*5 + 18n + 0 + 1/12n4 - 1/40n6. Factor u(a). -a2(a - 1)(a + 2)*2/4 Suppose -187c + 678 = -74c. Let k(t) be the third derivative of -1/15t*5 + 1/30t*c + 0t + 10t2 - 1/6t*4 + 0 + 2/3t3. Let k(j) = 0. Calculate j. -1, 1 Let i(b) = b2 + 5b + 16. Let w be i(-4). Let l be w/(-20)(-12)/36. Factor -1/5r3 + 3/5r*2 + r - lr*4 + 2/5. -(r - 2)(r + 1)3/5 Let j(n) be the third derivative of n8/141120 - n*7/5040 + 5n*5/12 + 28n*2. Let z(s) be the third derivative of j(s). Factor z(u). u(u - 7)/7 Suppose 3p - p + 2s = 8, -5p + 4s + 29 = 0. Suppose 0 = 6a + 156 - 180. Factor 6i*3 + 4i*5 + 0i3 - ip + 9ia. 3i*3(i + 1)(i + 2) Let m(v) = v3 - 3v*2 - 3v - 3. Let g be m(4). Let h be 2g/(-6) + (-21)/(-9). Find c, given that -4/3c*h + 0 + 2/3c = 0. 0, 1/2 Let u be ((-84)/(-18))/(2/(-12)). Let f be (-114)/(-7) + u/98. Factor l*2 + l + 16 - f. l(l + 1) Let u be (-3)/(-12)(-11 - -12). Let v(q) be the first derivative of 1/5q*5 + 0q + 2 + 0q4 - 1/3q*3 - uq*2 + 1/12q6. Let v(t) = 0. Calculate t. -1, 0, 1 Let b(a) = -a - 1. Let n(z) = z3 + 58z2 + 846z + 5. Let y(h) = 5b(h) + n(h). Let y(p) = 0. Calculate p. -29, 0 Let t(s) be the second derivative of 0 + 5s - 4/5s2 + 2/3s*3 - 1/5s4. Determine z so that t(z) = 0. 2/3, 1 Let l(n) be the third derivative of -n8/25200 - n7/1575 - n6/225 + n*5/30 - 3n*2. Let u(r) be the third derivative of l(r). Solve u(k) = 0 for k. -2 Factor 243/8v*2 - 3/8v*3 - 630v + 600. -3(v - 40)2(v - 1)/8 Let l = 202 + -196. Let o(s) be the third derivative of 0s3 - 1/30s*5 + 1/18s*4 + 0 + 1/180sl + s2 + 0s. Factor o(k). 2k(k - 2)(k - 1)/3 Factor 31/3a2 + 68/3a + 4. (a + 2)(31a + 6)/3 Factor 72x - 69839 - 12x*4 + 69839 - 88x*3 + 188x*2. -4x(x - 2)(x + 9)(3x + 1) Let k = 58 - 53. Let b(z) = 8z2 - 20z. Let l(o) = 2o - 3o - 3o2 + 5o + 3o. Let t(w) = kb(w) + 14l(w). Factor t(r). -2r(r + 1) Let i be 5/(-9) - (-8)/(-36)-3. Let t(w) be the first derivative of -2/9w3 + 1/9w*4 + 0w + iw2 - 1. Suppose t(q) = 0. Calculate q. 0, 1/2, 1 Let w = -264 - -800/3. Let k(b) be the first derivative of wb + 2/9b3 + 4/3b*2 + 4. Find n, given that k(n) = 0. -2 Determine n, given that 18n*2 - 20 + 18n - 12n2 - 4n2 = 0. -10, 1 Let r(j) be the first derivative of j9/3024 - j8/840 + j7/840 - 8j3/3 + 14. Let z(y) be the third derivative of r(y). Factor z(a). a3(a - 1)2 Let q(r) = -r3 - r*2 + r. Let o be q(0). Suppose -3c + 12 = -oc. Factor -8p + 0p2 - 6p*4 + 12p*4 + 5p*5 + 17p*c + 30p*3 + 4p*2. p(p + 1)(p + 2)2(5p - 2) Suppose 5t - 3t - 18 = 0. Suppose tq + 2 = 20. Determine o, given that -2/21o4 - 2/21 + 0o + 0o3 + 4/21o**q = 0. -1, 1	{ "pile_set_name": "DM Mathematics" }
in thirteen fifths of a litre? 2600 How many nanoseconds are there in 429498.9 weeks? 259760934720000000000 Convert 0.5754039 micrograms to nanograms. 575.4039 Convert 43.29424 centimeters to micrometers. 432942.4 What is 11/2 of a litre in millilitres? 5500 How many kilograms are there in 882.4603 grams? 0.8824603 How many micrometers are there in twenty-seven fifths of a millimeter? 5400 What is 6/5 of a hour in seconds? 4320 How many seconds are there in 27511.73 nanoseconds? 0.00002751173 Convert 3835.15 millennia to years. 3835150 How many minutes are there in twenty ninths of a week? 22400 How many nanometers are there in 3/8 of a micrometer? 375 What is 77550.37 years in millennia? 77.55037 What is 87.65038 centuries in months? 105180.456 Convert 486546.03s to hours. 135.151675 How many minutes are there in 6010.743 hours? 360644.58 Convert 0.1053653l to millilitres. 105.3653 Convert 23.5441431 seconds to days. 0.00027250165625 What is 15/4 of a litre in millilitres? 3750 What is 2/9 of a week in minutes? 2240 How many decades are there in 824321.2 centuries? 8243212 How many millilitres are there in seventy-five halves of a litre? 37500 Convert 6529.252 microseconds to nanoseconds. 6529252 What is one twentieth of a milligram in micrograms? 50 What is 691.3182 micrograms in tonnes? 0.0000000006913182 What is 3/8 of a millennium in years? 375 What is 1.8669621 months in centuries? 0.00155580175 How many millilitres are there in thirty-three fifths of a litre? 6600 Convert 8.411699l to millilitres. 8411.699 What is 7489.013 weeks in microseconds? 4529355062400000 How many centuries are there in 51/2 of a millennium? 255 How many microseconds are there in 0.8094404 days? 69935650560 What is three fifths of a tonne in kilograms? 600 How many litres are there in 79.08446ml? 0.07908446 How many micrograms are there in thirty-three fifths of a milligram? 6600 What is 17/4 of a litre in millilitres? 4250 What is 54/5 of a hour in minutes? 648 How many grams are there in 3/25 of a kilogram? 120 How many nanograms are there in fifteen quarters of a microgram? 3750 What is seven halves of a litre in millilitres? 3500 What is 8.348417 millilitres in litres? 0.008348417 How many millilitres are there in 76/5 of a litre? 15200 Convert 5.623518 millilitres to litres. 0.005623518 Convert 2571.8847 months to centuries. 2.14323725 How many millilitres are there in 6/5 of a litre? 1200 What is 7534.205 years in millennia? 7.534205 How many micrograms are there in 7/4 of a milligram? 1750 Convert 2606779.2ms to minutes. 43.44632 Convert 953715.5 decades to millennia. 9537.155 What is 4731.596 weeks in microseconds? 2861669260800000 How many hours are there in 13/8 of a week? 273 How many litres are there in 0.6803707ml? 0.0006803707 How many meters are there in three tenths of a kilometer? 300 What is 0.6666416 litres in millilitres? 666.6416 How many years are there in eleven tenths of a decade? 11 How many meters are there in 21/4 of a kilometer? 5250 How many nanometers are there in 496745.2 meters? 496745200000000 Convert 8416.9 kilograms to grams. 8416900 Convert 6.795747 hours to weeks. 0.040450875 How many milligrams are there in 6719.727 nanograms? 0.006719727 How many millilitres are there in 21/8 of a litre? 2625 How many micrograms are there in 1/100 of a milligram? 10 How many microseconds are there in 5273.54 minutes? 316412400000 How many years are there in 26/5 of a century? 520 What is 32/5 of a kilometer in meters? 6400 How many kilometers are there in 70710.25 centimeters? 0.7071025 What is three eighths of a milligram in micrograms? 375 Convert 182168.703 milliseconds to days. 0.0021084340625 How many days are there in 23.0836338 seconds? 0.0002671716875 What is 3/25 of a gram in milligrams? 120 Convert 5.765354 hours to minutes. 345.92124 How many milligrams are there in seven eighths of a gram? 875 How many centimeters are there in three tenths of a meter? 30 What is 45.81467 centimeters in nanometers? 458146700 Convert 297.8609 millennia to centuries. 2978.609 What is 6/5 of a century in years? 120 How many kilograms are there in 7.02244ug? 0.00000000702244 Convert 0.709882 days to minutes. 1022.23008 How many weeks are there in 1362.919257 microseconds? 0.0000000022535040625 How many micrometers are there in 21/5 of a millimeter? 4200 Convert 7864.935 weeks to days. 55054.545 How many minutes are there in 2/45 of a week? 448 How many microseconds are there in 0.641163 milliseconds? 641.163 Convert 2.156202 decades to centuries. 0.2156202 How many decades are there in 8.080035 centuries? 80.80035 How many micrograms are there in 2.103651 kilograms? 2103651000 What is seven sixteenths of a millennium in months? 5250 How many decades are there in 51565.34 centuries? 515653.4 What is 69169.76 millennia in months? 830037120 How many kilograms are there in 9541.221t? 9541221 Convert 906.318km to centimeters. 90631800 How many weeks are there in 11958.83892ns? 0.0000000000197732125 Convert 0.8324375cm to kilometers. 0.000008324375 How many micrometers are there in 452841.1m? 452841100000 What is thirty-two fifths of a millennium in centuries? 64 What is 58481.16 months in decades? 487.343 What is one sixth of a day in minutes? 240 How many nanoseconds are there in 0.2739249 days? 23667111360000 Convert 800548.6ml to litres. 800.5486 Convert 46158.9 seconds to minutes. 769.315 How many months are there in 75954.82 decades? 9114578.4 How many months are there in six fifths of a millennium? 14400 How many nanograms are there in eleven halves of a microgram? 5500 What is eleven halves of a microgram in nanograms? 5500 What is 2.76426 millimeters in nanometers? 2764260 How many millimeters are there in eleven eighths of a meter? 1375 How many millilitres are there in 0.3162085l? 316.2085 How many millimeters are there in 12/25 of a meter? 480 Convert 4671.4mm to nanometers. 4671400000 How many centimeters are there in three tenths of a meter? 30 What is 3305.646ns in hours? 0.000000000918235 What is 18485.5 seconds in microseconds? 18485500000 How many kilograms are there in nine tenths of a tonne? 900 How many nanograms are there in 27/2 of a microgram? 13500 How many millilitres are there in 647.2264l? 647226.4 What is 17.5394 kilograms in grams? 17539.4 What is 270823.5 minutes in seconds? 16249410 How many hours are there in 1/4 of a week? 42 What is 2344.107ml in litres? 2.344107 What is 58.35112 centuries in decades? 583.5112 What is 2/45 of a day in seconds? 3840 What is 11/8 of a millennium in months? 16500 How many millimeters are there in three fifths of a meter? 600 How many grams are there in 17/4 of a kilogram? 4250 Convert 7963.65 years to centuries. 79.6365 What is 51/4 of a week in hours? 2142 How many days are there in 2.0142315 hours? 0.0839263125 Convert 150097.6 litres to millilitres. 150097600 How many millilitres are there in 1/4 of a litre? 250 How many kilograms are there in 0.0661629g? 0.0000661629 How many millilitres are there in 51186.1l? 51186100 What is 352.7656m in micrometers? 352765600 How many nanometers are there in 71.63289mm? 71632890 How many micrometers are there in 11/8 of a millimeter? 1375 How many meters are there in twenty-three eighths of a kilometer? 2875 What is twenty-seven quarters of a millennium in decades? 675 Convert 98829.57ug to milligrams. 98.82957 Convert 142.20813 months to years. 11.8506775 Convert 9.185638t to nanograms. 9185638000000000 How many millimeters are there in 5/8 of a meter? 625 What is 63344.49s in nanoseconds? 63344490000000 What is twenty-seven halves of a litre in millilitres? 13500 What is 43/3 of a century in months? 17200 What is 1/4 of a centimeter in micrometers? 2500 What is 41/2 of a week in hours? 3444 How many kilometers are there in 24952.77cm? 0.2495277 What is 1158.799km in nanometers? 1158799000000000 Convert 0.8947024 centuries to millennia. 0.08947024 Convert 6.660869 nanograms to tonnes. 0.000000000000006660869 How many litres are there in 37.71766ml? 0.03771766 What is seven thirds of a decade in months? 280 Convert 6.549247ml to litres. 0.006549247 How many decades are there in 3/5 of a millennium? 60 What is 13/4 of a milligram in micrograms? 32	{ "pile_set_name": "DM Mathematics" }
2h2 Collect the terms in -2 + 18t*3 + 25t*3 - 4 - 31t*3. 12t*3 - 6 Collect the terms in 23u*2 - 38u*2 - 2 + 0 - 58u*2. -73u*2 - 2 Collect the terms in -8l*2 + 8l*2 + 11l*3 - 15l*3. -4l*3 Collect the terms in -4 - 76f*2 + 71f*2 + 4. -5f*2 Collect the terms in -1 + 0p*2 + 43p + p*2 - 43p. p*2 - 1 Collect the terms in -3d*3 + 970d*2 - 974d*2 + 11d*3. 8d*3 - 4d*2 Collect the terms in -12607a - 12614a - 12614a + 37831a. -4a Collect the terms in -3704s2 - 2s*3 + 3704s*2. -2s*3 Collect the terms in 17n*3 + 2 + 12n*3 - 14n*3 + 14n*3. 29n*3 + 2 Collect the terms in 564a*2 - 1 + 1. 564a*2 Collect the terms in 2u + 1158 + 4u - 1158. 6u Collect the terms in -v - v - 101 - v. -3v - 101 Collect the terms in -11w - 1 - 43w + 0. -54w - 1 Collect the terms in -2255z - 8z*2 + 2255z. -8z2 Collect the terms in 272u + 357u - 620u. 9u Collect the terms in -7u + 3u + 11u - 10u. -3u Collect the terms in 14a - 33a + 8a + 13a. 2a Collect the terms in -51a*3 - 5a*3 - 154a*3. -210a*3 Collect the terms in 13256 - g - 6626 - 6630. -g Collect the terms in -59g*2 + 31g*2 + 42g*2. 14g*2 Collect the terms in 551z*2 - 1101z*2 + 553z*2. 3z*2 Collect the terms in -143l*3 + 287l*3 - 149l*3. -5l*3 Collect the terms in 0a*2 - 4a*2 + 4a*2 - 12a*3. -12a*3 Collect the terms in 2r - 5r + r2 + 3r. r*2 Collect the terms in -8x*2 - 2x*2 + 4x*2 - 5x*2. -11x*2 Collect the terms in 44i + 1 - 5 + 4. 44i Collect the terms in 74c*3 - 33c*3 - 33c*3. 8c*3 Collect the terms in -3h*2 - 7h*2 - 21h*2. -31h*2 Collect the terms in 166r*2 - 1 + 1 + 0. 166r*2 Collect the terms in -18f + 14f + 5f + 3f - f. 3f Collect the terms in -5y2 + 5y*2 + 20y*3 - 22y*3. -2y*3 Collect the terms in 5h*2 + 16h*2 + 15h*2. 36h*2 Collect the terms in -15z*2 + 17z*2 + 39z*2 - 3z*2. 38z*2 Collect the terms in 12j + 0j - j. 11j Collect the terms in -7h3 + 124h - 124h. -7h*3 Collect the terms in -5 - 10 - 7 + 22 - 22b*2. -22b*2 Collect the terms in 9y*3 + 59y*3 - 26y*3 + 46y*3. 88y*3 Collect the terms in 1439w*3 - 470w*3 - 494w*3 - 473w*3. 2w*3 Collect the terms in -8s - 5s + 7s + 6s - 8s*2. -8s*2 Collect the terms in -17q*3 + 96q*3 + 33q*3. 112q*3 Collect the terms in 3187l*2 - 7l*3 - 3187l*2. -7l*3 Collect the terms in 5d + 59d - 3d*2 - 64d. -3d2 Collect the terms in 2698d*3 - 1345d*3 - 1351d*3. 2d*3 Collect the terms in -4t*2 + 4t*2 - 2t*2 + 3t2. t2 Collect the terms in -83k2 + 353k*2 - 90k*2 - 92k*2 - 86k*2. 2k*2 Collect the terms in -2 + 1 + 1 + 12y. 12y Collect the terms in 2z2 - z2 - 4z2 + 6z*2 - 2z2. z2 Collect the terms in 161a2 - 161a*2 - 338a*3 + 336a*3. -2a*3 Collect the terms in 771906b + 3b3 - 771906b. 3b3 Collect the terms in -31f*3 - 200f*2 - 201f*2 + 401f*2. -31f*3 Collect the terms in 150l - 3 + 3. 150l Collect the terms in -1306 + 1306 - 8c. -8c Collect the terms in -2 + 0p*2 + 2 + 6p*2. 6p*2 Collect the terms in -53d*2 - 2 + 6d*2 + 6d*2. -41d*2 - 2 Collect the terms in -454g*3 + 824g*3 - 372g*3. -2g*3 Collect the terms in -7 - 14m*3 + 7 - 44m*3. -58m*3 Collect the terms in -26756 - 10p + 26756. -10p Collect the terms in -13 + 13 - 67z. -67z Collect the terms in 79t*2 - 79t*2 + 11t*3. 11t3 Collect the terms in -s2 - 7s + 18s - 11s. -s2 Collect the terms in p - 30p + 32p - 6p. -3p Collect the terms in 32 - 14 - 6h - 18. -6h Collect the terms in -20w - 53w + 3w. -70w Collect the terms in -5x*2 - 138 - 148 + 286. -5x*2 Collect the terms in 2988 + 9h*3 - 2988. 9h*3 Collect the terms in -12b*2 + 5b*2 + 6b2. -b2 Collect the terms in 23x + 81x + 61x - 33x. 132x Collect the terms in -3g*2 + 3g*2 + 235g - 2g2. -2g*2 + 235g Collect the terms in 9j3 - 9j + 9j - 51j*3. -42j*3 Collect the terms in 9p + 8p - 31p + 11p. -3p Collect the terms in -294v3 - 3610 + 3610. -294v*3 Collect the terms in -47814n + 47814n - n2 - n2. -2n*2 Collect the terms in -18z*2 + 10z*2 - 3z*2. -11z*2 Collect the terms in 0 - 1 + 1 + 6h*2. 6h*2 Collect the terms in -5l - 2l - 1 - 4l + 5l. -6l - 1 Collect the terms in 10v2 + 16v*2 + 12v*2. 38v2 Collect the terms in -v3 + v*3 + 9v*3 + 2v*3. 11v*3 Collect the terms in 17k - 17k + 107k*2. 107k*2 Collect the terms in -a + a - 119a*2 + 120a2. a2 Collect the terms in 3h3 - 16 - 5h*3 + 0h*3. -2h*3 - 16 Collect the terms in 38r - 3r2 - 9r*2 - 60r + 22r. -12r*2 Collect the terms in 316b - 6 + 3 + 0 + 1. 316b - 2 Collect the terms in -x + 43x*2 + 2x - x. 43x2 Collect the terms in 4 - 106s - 276s - 3. -382s + 1 Collect the terms in -24f3 + 61f*3 - 42f*3. -5f*3 Collect the terms in -11102 + 11102 + 17w*2. 17w*2 Collect the terms in -298128 + 298128 + 6g. 6g Collect the terms in 0p*2 - 6p*2 - 3p*2 + 0p*2. -9p*2 Collect the terms in 15 + 10j - 2 - 12j. -2j + 13 Collect the terms in 426p3 - 7 - 443p*3 + 7. -17p*3 Collect the terms in -14v*3 - 17v*3 + 0v*3 - 5v*3. -36v*3 Collect the terms in -1180n*2 + 1180n*2 - 2n*3 + 82. -2n*3 + 82 Collect the terms in 27p + 40p + 37p - p*3 - 104p. -p*3 Collect the terms in 2b - 4b + 2b + 3b2. 3b*2 Collect the terms in -65w + 4 + 5 - 4. -65w + 5 Collect the terms in -8382h + 5h2 + 8382h. 5h2 Collect the terms in -3714r - 17r2 + 3714r. -17r2 Collect the terms in -6h*2 + 27h*2 + 3h*2 + 26h*2. 50h*2 Collect the terms in 16s - 5s - s + 9s. 19s Collect the terms in i2 + 27i - 2i3 - i2. -2i*3 + 27i Collect the terms in g - 7 - 7 + 0g. g - 14 Collect the terms in -2x + 8x - 21x + 9x. -6x Collect the terms in -52 + 33c3 - 32c3 + 12. c3 - 40 Collect the terms in 2o + 0 + 12o + 1 - 1. 14o Collect the terms in 39 + 421n - 39. 421n Collect the terms in -2468y + 3y2 + 2468y + y*3 - 3y2. y3 Collect the terms in 1 - 11 + 6l3 + 19 - 4. 6l*3 + 5 Collect the terms in 17c - 189c + 17c. -155c Collect the terms in -186l*2 - 183l*2 + 354l*2. -15l*2 Collect the terms in 2h*2 + 109h - 109h. 2h*2 Collect the terms in 15q*3 + 3q*3 + 4q*3 + 12q*3. 34q*3 Collect the terms in 0 + 0 + 293a*3 - 289a*3. 4a*3 Collect the terms in 6n - 3 + 3 - 24n. -18n Collect the terms in 153r - 304r + 155r. 4r Collect the terms in 6 - 314t - 2t*2 - 2 - 4. -2t*2 - 314t Collect the terms in 13k2 + 16k*3 - 13k*2. 16k3 Collect the terms in c3 - 4c3 + 76c*2 - 38c*2 - 38c*2. -3c*3 Collect the terms in 103 - 52 - 51 - 2t. -2t Collect the terms in 14n + 8n - 22n + 11n3. 11n*3 Collect the terms in -o - 5o*3 + 12o*3 + 6o*3. 13o*3 - o Collect the terms in 4i*2 - 2i*2 - 5i + 5i + 310. 2i*2 + 310 Collect the terms in -4m*2 + 3m*2 - 2m*2 - 3m*2. -6m*2 Collect the terms in 240b - 240b - 61b*2 + 22b*2. -39b*2 Collect the terms in 38550 - 2y*3 - 38550 + 3y*3 + 2y*3. 3y*3 Collect the terms in 58w - 20w + 51w + 0w. 89w Collect the terms in -30t3 - 30t*3 - 27t*3 + 124t*3 - 34t*3. 3t*3 Collect the terms in -3i + 3i + 1211i*3. 1211i*3 Collect the terms in 1287p*3 + 1732p*3 - 1063p*3. 1956p*3 Collect the terms in -1043 + 1043 - 14o. -14o Collect the terms in 375t*2 + 7t*3 - 11t*3 - 375t*2. -4t*3 Collect the terms in -21d*3 - 9d*3 - 105d*3. -135d*3 Collect the terms in 4h + 9h - 5h + 3h. 11h Collect the terms in -5c2 - c3 + 11c*2 + 0c*3 - 6c2. -c3 Collect the terms in -226972h + 3h*2 + 226972h. 3h2 Collect the terms in 780 - 6p*2 - 780. -6p*2 Collect the terms in -12l*2 - 64l2 - l2. -77l2 Collect the terms in 478b + 466b - 945b. -b Collect the terms in -20k - 11k + 32k. k Collect the terms in -17d*3 + 15d*3 + 0d*3. -2d*3 Collect the terms in 36w + 13w + 23w - 51w. 21w Collect the terms in -58h2 + 83h*3 + 30h**2	{ "pile_set_name": "DM Mathematics" }
be 15 - (-10 - -2 - b). Let x = 10 + w. Is 10 a factor of x? False Let p(i) be the first derivative of i4/4 - i3/3 - 7i2 + 30i - 15. Does 16 divide p(4)? False Suppose 3q + 3 = 0, -3q = 3f - 7f + 10923. Is f a multiple of 14? True Let z = -658 - -636. Is (z/14)/(16/(-1232)) a multiple of 7? False Let g = -93 + 99. Let x(p) = -15p3 - 11p*2 + 30p*3 - 14p*3 - 4 - gp. Is 10 a factor of x(12)? False Let p(s) = 24s2 - 4s - 8. Is 4 a factor of p(9)? True Let i(h) be the third derivative of -5h4/24 + h3 + 12h*2. Let v be i(-18). Suppose u + 2u = v. Is u a multiple of 24? False Let a = 9716 + -4599. Is a a multiple of 17? True Let i(x) = 4x2 + 66x - 416. Let n be i(6). Let s be ((-5)/1)/((-5)/295). Let k = s - n. Does 18 divide k? False Suppose 0 = -3n + 15 - 3. Suppose 5a - 6 = n. Suppose 4s + 306 + 238 = 4k, -3s = ak - 272. Does 17 divide k? True Let v(g) = -26g3 - 12g*2 - 25g - 2. Is v(-2) a multiple of 13? True Suppose -887 = -4o + 3o + 4r, 0 = 3o + 2r - 2703. Suppose -7f = -109 - o. Suppose -i - f = -4i. Is 16 a factor of i? True Does 3 divide ((-42)/(-8))/((-47793)/(-87560) - 120/220)? False Let s = -829 - -5526. Does 43 divide s? False Let o = 98 - 94. Suppose 83 - 217 = -r + ov, 5r - 5v - 595 = 0. Is 57 a factor of r? True Suppose 2b + 364 = 3u, 7u - 12u + 612 = -2b. Suppose ud = 130d - 7104. Does 26 divide d? False Suppose i + 30 = -4k, 7i - 2i + 5k = -45. Let h = 3 + -2. Is 50h/i-2 a multiple of 5? True Let k = 4 - -235. Let c = 393 - k. Does 22 divide c? True Let y(j) = j2 + 5j + 12. Suppose 0p - 30 = -6p. Let r be (0 - -5) + p + -5. Is y(r) a multiple of 31? True Let z = -12 + 17. Let t(l) = 26l - 86. Does 9 divide t(z)? False Suppose 2c - 20664 = -3b, 5b = -c + 6862 + 3491. Is 279 a factor of c? True Let k(o) = -o*3 + 8o*2 + 11o + 6. Let y be k(9). Suppose 5t - 4m = 59 - 17, 0 = -3t + 3m + y. Suppose 7i + 99 = ti. Is i a multiple of 11? True Let j(n) = n*3 - 11n*2 + 7n - 28. Let u(v) = -v*3 - 6v*2 - 3v - 7. Suppose 2 = -2s, 2b + 5s - 7 = 4b. Let k be u(b). Does 14 divide j(k)? False Let d = -3398 + 3464. Does 3 divide d? True Suppose 0 = 12a - 9a. Suppose 0 = -f + 5b + 72, -2f + 2b - 6b + 200 = a. Suppose -5k = -3k - f. Is 23 a factor of k? True Let m be (255/(-2))/32. Suppose -30n + 445 - 2245 = 0. Let z = n - m. Is 11 a factor of z? False Let q(c) = c*3 + 5c*2 + 5c + 6. Let n be q(-4). Let i(d) = 35d - 171. Let k be i(5). Suppose r - 458 = -3v, kr - 131 = -nv + 181. Is 38 a factor of v? True Does 4 divide 135624/(-36)-9(-3)/(-18)? False Let j(h) = -21h - 14. Let o be j(-1). Does 5 divide (o + 3)/(2/13)? True Is ((-9)/6)/(1238906/(-95300) + 13) a multiple of 15? False Suppose -3c + 0c = -4x - 45, -c = -5x - 70. Let h = x + 12. Is 21 a factor of 1170/14 - h/7? True Let m = -468 - -2190. Suppose n = -i - 3i + m, -3i + 1294 = 2n. Is 37 a factor of i? False Suppose 5z - 4l = -56, 4z + 0l + 2l = -24. Let o(u) = -2u*2 - 12u - 12. Let x be o(z). Let g = 20 - x. Is g a multiple of 16? True Suppose 5z + 4k - 16276 = 0, 5z - 2k - 8453 - 7799 = 0. Does 3 divide z? True Let m be -26402/24 - (-2)/(-4). Let b = -389 - m. Is 20 a factor of b? False Let w be 1092/(-30)-3(-20)/(-6). Is 13 a factor of (1 - 1 - w/(-7))6? True Let t(n) = n*3 - 11n*2 - 18n + 18. Suppose -3b - 2m + 33 = 0, -b - m - 16 = -2b. Is t(b) a multiple of 7? False Let u = -21 - -21. Suppose -7v - 4v + 12870 = u. Suppose m = 19m - v. Does 10 divide m? False Let u(v) be the third derivative of 17v4/12 - 49v*3/6 + 58v*2. Is u(4) a multiple of 13? False Let p be 175/10(-4)/(-5). Suppose pu - 456 = 11u. Suppose 0 = t + 3t - u. Does 14 divide t? False Let x(w) = 445w*2 - 166w - 747. Is 11 a factor of x(-5)? False Suppose -22n = -29n + 21. Suppose -nw + 379 = 4o - 0o, 377 = 4o + w. Is o a multiple of 14? False Let u be (-3 - -3 - -1)2. Let a be 4u1/8 - -4. Suppose ak - 2p - 726 - 521 = 0, 501 = 2k - 3p. Is 32 a factor of k? False Let p = 10146 + -6080. Is p a multiple of 44? False Let t = -427 + 426. Is 47 a factor of 937 + (-1 - (-11 + 6)) + t? True Suppose -4c - 850 = -8j + 3j, 5j = -3c + 885. Suppose -2l - 5v + j = -4l, -5l - v = 489. Let n = -11 - l. Does 29 divide n? False Suppose -22t + 351120 = -22t + 57t. Does 154 divide t? True Is (-4710)/(-50)(-7 - -17) a multiple of 6? True Let q = 61 + -59. Let h be (6/9)/(q/(-27)). Is (-5)/(35/(-62)) - h/63 a multiple of 3? True Suppose 0 = -5g - 4p - 147, -3g + 2p = -8g - 141. Does 11 divide g/(-2)(-126)/(-27)? False Suppose 0 = 2n - 5u - 64, 4n = 2u - 13 + 141. Is 8 a factor of 2/(-4) - 4/(n/(-1156))? True Let l(v) = 2v2. Let f be l(1). Let q(x) = -208x + 24. Let o(z) = 44z - 5. Let m(n) = 11o(n) + 2q(n). Is 29 a factor of m(f)? False Suppose 4j = -5i + 20, 5i - 9j - 20 = -8j. Does 42 divide 527 - (-24)/i? False Suppose -3q + 265 = 5b + 32, -3b + 135 = 3q. Is 66 a factor of 363 - b/(14/(-2))? False Let f be ((-4)/6)/((-68)/36 - -2). Is 135/f12/(-9) a multiple of 3? True Let s(j) = -j*3 - 25j*2 - 12j - 72. Let f be s(-25). Let h = f + -192. Is 9 a factor of h? True Let r be 4 + -4 - (0 + -14). Suppose 2k - 169 = 3h, rk - 6h = -h + 333. Is 11 a factor of k? True Let y(b) = 53b - 265. Let q be y(5). Let x(f) = -8 + 25 + 3f - 3f + f - f*2. Does 2 divide x(q)? False Let b be 0 + 4/30 + 17/(3060/(-24)). Let i(n) = -n - 1. Let q(p) = -5p - 86. Let w(u) = 6i(u) - q(u). Is w(b) a multiple of 20? True Suppose -1239 - 616 = -7l + 420. Does 18 divide l? False Let z = 105 + -101. Suppose -5q = 5, 2x = zq - q + 115. Is x a multiple of 28? True Suppose 5 = 3i - 16. Let t be (i - 3 - -183) + (1 - 0). Does 21 divide t - 0 - (-1)/1? True Let b = -177 - -178. Does 45 divide (27/6)/(7/70b)? True Suppose -3l + 17l = -882. Is 13 a factor of (-18844)/l + 2/(-18)? True Let z = 26 - 21. Suppose -3p + c - 7 = 0, c = -p + zc - 6. Does 22 divide (p - 2) + 456/4? True Let q(r) = 13r*2 - 139 - 40r*2 - 7r + 18r2 + 10r2. Is 26 a factor of q(-31)? False Let t(v) = v3 - 5v2 + 5. Let i be t(0). Let w be -2 - (-3)/(9/156). Suppose 0 = -p + 2y + 15, -3p = 2p - iy - w. Does 2 divide p? False Let n(g) = -34g*3 - 13g*2 + 6g - 1. Let b be n(-4). Suppose -l = -3a + 2920, -a + 3a = -3l + b. Is 24 a factor of a? False Let f(k) = -19k - 53. Let l be f(-4). Suppose -y = 4 - 1. Is 9 a factor of l + (-1)/y3 + -1? False Suppose -2q + 1162 = -1474. Let s(d) = 2d3 + 50d*2 - 123d - 401. Let a be s(-27). Suppose 0 = w + aw + 2v - q, -4 = 4v. Is 47 a factor of w? False Let y = -60 - 314. Let g = 147 - y. Suppose 2m = 5p + 6m - g, p - m - 106 = 0. Is p a multiple of 35? True Let h(n) = n*2 + n - 152. Let m be h(-13). Suppose -3s - 3l + 657 = 0, -ms = -2l - 180 - 678. Is s a multiple of 12? True Let u = -441 + 441. Suppose -3n + g = 2n - 4144, u = n - g - 832. Is n a multiple of 6? True Let f = 1122 + 4088. Does 35 divide f? False Suppose 0u = -2u. Let r be 32/(-144) - (-2505)/(-27). Is 26 a factor of (11 - r)(u - -1)? True Let u(o) = 16o - 92. Let g(p) = 3p + 2. Let m(i) = 10g(i) + 2u(i). Is m(19) a multiple of 13? True Suppose 8v - 4v + 2x - 4376 = 0, -5x = -20. Let r = -651 + v. Does 49 divide r? True Let h be -4(-3)/6-2. Let c be (-3)/(h/(-4)) + 50. Let q = c - 23. Is 8 a factor of q? True Let u(h) = -28 + 20h - 5h*2 + 4h*2 + 25 - 12. Is 15 a factor of u(15)? True Suppose 4g = -5f + 188 + 280, 0 = 4f - 16. Suppose -4a = 3n + n - g, -a + 3n = -48. Is a a multiple of 2? False Let q = 107 + -104. Suppose -qz + 0z - z = 0. Suppose -2f + zf + 108 = 2x, -2f + 109 = 3x. Is 10 a factor of f? False Let w(k) = -2k2 - 2k + 2. Let o be w(0). Let s be (3/o)/((-12)/(-11904)). Suppose -2p = -18p + s. Is p a multiple of 31? True Let i = -1180 - -690. Let s = -326 - i. Is s a multiple of 10? False Is 22 a factor of (-170)/(-1) + (-1)/((-10)/40)? False Let f = -1657 - -1962. Let v(x) = 3x2 - x - 1. Let l be v(2). Suppose -8t - f = -lt. Does 34 divide t? False Let d(g) = -14g + 5g + g3 - 1043g*2 + 1045g*2 + 53. Is 64 a factor of d(6)? False Let t(b) = 35b*2 - 3	{ "pile_set_name": "DM Mathematics" }
2g3 - 3g*2 + g + 1. What is -11a(b) - h(b)? -b*3 - 197b*2 + 2b Let a(v) = -961933v2 + 786v - 655. Let h(c) = -14799c2 + 12c - 10. Calculate 2a(u) - 131h(u). 14803u2 Let f(b) = -14b*3 - 4b*2 + 10b + 2. Let i(x) = 13x3 + 3x*2 - 8x - 2. Give 3f(t) + 4i(t). 10t3 - 2t - 2 Let a(l) = -2l2 - 3l + 4. Let z(h) be the first derivative of 5h - 2h*2 - 2/3h*3 + 144. Determine 3a(j) - 2z(j). -2j*2 - j + 2 Let v = -27246 + 27247. Let j(w) = 1. Let l(a) = -3a - 3. Give vl(f) + 5j(f). -3f + 2 Let t(q) = -3q*2 - 4q. Let d(r) = 4r - 232. Let j be d(59). Suppose a = -3f + 8, ja - 3 + 19 = 0. Let b(i) = -5i*2 - 8i. Calculate fb(m) - 7t(m). m*2 - 4m Let i(q) = 17q2 - 269q + 19. Let v(f) = -19f2 + 267f - 22. Determine -8i(s) - 7v(s). -3s2 + 283s + 2 Let r(p) = -p - 29. Let x(t) = -1. Let o = 523 + -522. Determine or(u) - 5x(u). -u - 24 Let h = 8514 + -8038. Let r(j) = 868j + 238. Let y(o) = -11o - 3. Determine hy(z) + 6r(z). -28z Let q(h) = 2h - 9. Let t(k) = k - 4. Let y(c) = 4c + 27. Suppose 0n = -0n - 2n. Let z be y(n). Suppose 5p + 4p + z = 0. Determine pq(d) + 7t(d). d - 1 Let b(c) = -82c2 + c - 1. Let l(f) = -478f*2 - 105f - 7. Determine 6b(a) - l(a). -14a*2 + 111a + 1 Let c(i) = -20i2 - 7i - 26. Let f(a) = 6a2 + 2a + 8. What is 4c(m) + 14f(m)? 4m2 + 8 Let z(m) = -278187m. Let q(i) = -6785i. Determine 245q(l) - 6z(l). 6797l Let n = 12 - 6. Let t(c) = -c*3 - 6c*2 + 5c - 5. Let w(i) be the first derivative of -i*4/2 - 7i*3/3 + 3i*2 - 6i + 31809. What is nt(g) - 5w(g)? 4g3 - g2 Let b be (-3)/6 + 10/(-4). Let z be (-154)/(-30) + (-608)/4560. Let j(a) = 4a*2 + 11a - 4. Let t(w) = 2w2 + 6w - 2. Determine bj(n) + zt(n). -2n2 - 3n + 2 Let n(f) = 1. Suppose 0 = 3w + 711 + 489. Let z = w + 403. Let k(p) = p - 5. Give zn(u) + k(u). u - 2 Let m(r) = 2r2 - 6r + 3. Let v(s) = s*3 + 7s*2 - 18s + 10. Suppose -214u - 529 + 1347 = -680. What is um(q) - 2v(q)? -2q*3 - 6q + 1 Let m(o) = -64o2 - 3o + 3. Suppose -314g = 4x - 310g - 44, 3x + 7 = 2g. Let n(u) = -u2 + u - 1. Give xn(t) + m(t). -67t2 Let x(m) = 4m - 7. Let u = -2 - -5. Let n(o) = -2o + 6o - 2 - uo + 1. Let s = -1596 - -1602. What is sn(b) - x(b)? 2b + 1 Let w(u) = -u + 36. Let j(i) = 5i + 7. What is j(l) - 3w(l)? 8l - 101 Let o(u) = -15u - 1. Let x(s) = -76s - 698. Calculate 15o(i) - 3x(i). 3i + 2079 Let v = 32 + -32. Let m = v - 2. Let p(h) = h + 2. Let k(c) = -18c + 37c - 18c. Give mk(b) + p(b). -b + 2 Let h(g) = -g - 1. Let f(l) = 3l. Suppose 7i = 36 + 6. Suppose -4a = -3n - 7a - i, -2n = a + 1. What is nh(z) - f(z)? -4z - 1 Let h(i) = i3 + 4i + 3. Let t(k) = 45k3 - 24k - 59. Give 6h(f) + t(f). 51f3 - 41 Let u(d) = -d3 + d*2 + 2d - 1. Let a(o) = o*3 + 4o*2 + 12o + 21. Give a(n) - 6u(n). 7n*3 - 2n*2 + 27 Let z(d) = 15d*2. Suppose -3l = x + 13, 20 - 4 = -4x. Let v(r) = 16r*2. Calculate lz(w) + 2v(w). -13w*2 Let k(s) = -18s*3 + 6s*2 - 6s + 5. Let x(q) = 21q - 35q*3 + 32q - 6q2 + 17q*2 + 9 - 64q. What is 11k(z) - 6x(z)? 12z3 + 1 Let o(y) = -65y*2 - 9y + 67y2 + 34 - 29. Let r be o(1). Let l(b) = -10b - 2. Let k(i) = -i. What is rk(u) + l(u)? -8u - 2 Let b be (500/(-150))/(14/(-6) - -2). Let q(z) = -38z + 37z + 5 - b + 6. Let t(j) = 11j - 1. Determine 3q(s) + t(s). 8s + 2 Let t(s) = 11s - 1263. Let f(o) = 14o - 1579. Let k(l) = -4f(l) + 5t(l). Let p(b) = 3b*2 - 4b - 4 + 0b2 + 3. Calculate 4k(d) - p(d). -3d2 + 5 Suppose 0 = y + 7 - 3. Let z(f) be the first derivative of -2 + 3f + 0f3 + 3/2f*2 - 5/4f*4. Let g(d) = 6d*3 - 4d - 4. Determine yz(h) - 3g(h). 2h3 Let a(f) = -4f*3 + 9f*2 - 5f - 5. Suppose 19b - 48 + 35 + 108 = 0. Let v(n) = -2n*3 + 5n*2 - 3n - 3. Determine bv(i) + 3a(i). -2i3 + 2i*2 Let s(a) = 4a3 + a2 + a - 5. Let j(g) = 8696g3 - 8695g*3 + 3 - 2. Calculate 5j(p) + s(p). 9p3 + p2 + p Let x(z) = -48z - 1697. Let i(m) = 38m + 1696. Determine -5i(j) - 4x(j). 2j - 1692 Let z(p) = 8p2 - 7p - 4. Let n(g) = 19g2 - 18g - 7. Give 3n(k) - 7z(k). k*2 - 5k + 7 Let d(f) = f*3 - 11f2 + 6. Let g(u) = -121 + u2 - 6u2 + 4u*2 + 120. What is -d(j) - 6g(j)? -j*3 + 17j*2 Let h = 479 - -85. Let r(k) = -h + 14k + 564 - 4k. Suppose -93 = -17u + 9. Let c(f) = -f. Calculate ur(z) + 55c(z). 5z Let b(g) = -28 + 159g - 195g + 38g - 13. Let m(p) = -3p + 61. Determine 8b(n) + 5m(n). n - 23 Let c(q) = -18q. Let p be (-216)/18 - (-9 - 2). Let s(r) = -r. Calculate pc(k) - 4s(k). 22k Let i(p) = -5p2 - 3. Let s(n) = n3 + 16n2 + 62n + 18. Let a be s(-6). Let m(k) = -k*2 + 1. Determine am(w) + 2i(w). -16w*2 Let d(u) be the first derivative of -22u*3/3 + 3u*2/2 - 10099. Let r(c) = -11c*2 + 2c. Determine -3d(a) + 5r(a). 11a2 + a Let u(t) = 2251t + 6. Let o(d) = 11246d + 35. What is -2o(q) + 11u(q)? 2269q - 4 Let k(d) = -3d + 5. Let x(t) = -4t - 15. Let a be x(-9). Suppose -12f = -10f - 40. Let m(c) = 9c - fc + 8 - c + 13. Give ak(i) - 5m(i). -3i Let a(o) = -7821o*2 - 7o - 7. Let b(p) = -34920766p2 - 31256p - 31256. Give -31256a(y) + 7b(y). 7814y2 Let x(z) = 68z*3. Let r(k) = -34k*3. Suppose 168d - 148d - 100 = 0. Calculate dr(b) + 3x(b). 34b*3 Let r(l) = 6l*2 + 31l + 12. Let w(g) = 9g2 + 46g + 17. Determine -10r(d) + 7w(d). 3d2 + 12d - 1 Let q(v) = 29v - 235. Let n(i) = -34i + 236. Give 6n(t) + 7q(t). -t - 229 Let g(p) = 30p + 1129. Let q(h) = 70h + 2632. Determine 16g(c) - 7q(c). -10c - 360 Let s(m) = -24m - 40. Let y(b) = b + 1. Suppose 130j = 132j + 4n - 100, -5n = -25. Determine jy(z) + s(z). 16z Let h(s) = -s*2 + 1. Let q be (-72)/(-33) - -3 - (-50)/(-275). Let w(t) = -6t*2 - 2t + 5. Determine qh(x) - w(x). x2 + 2x Let c(z) = -2961z + 34. Let p(q) = 5921q - 57. Calculate 5c(y) + 3p(y). 2958y - 1 Let c(n) = -2n - 7. Let p(d) = 3d + 7. Suppose 22g = 21g - 5a - 5, 0 = -2g + 2a + 14. What is gc(z) + 4p(z)? 2z - 7 Let n(p) = -595p*2 + 190. Let r(d) = 65d*2 - 21. Give -6n(y) - 55r(y). -5y*2 + 15 Let s(l) = -8. Let p(y) = 10y + 69. Give p(g) + 9s(g). 10g - 3 Let z(d) = -28d + 568d*2 - 567d*2 - 2569 + 2570. Let y(q) = -3q*2 + 56q - 2. Determine 2y(p) + 5z(p). -p*2 - 28p + 1 Let i(q) = -2q + 10. Let g = -130 + 134. Let l(d) = 2 + 0 + g - 5. Calculate i(y) - 5l(y). -2y + 5 Let p(l) = -37l*2 - 7l + 15. Let f(q) = -29q2 - 7q + 14. Determine -3f(n) + 2p(n). 13n2 + 7n - 12 Let t(x) = -52x. Let z(k) = -96k - 2. Calculate 5t(n) - 3z(n). 28n + 6 Let a(m) = 2m*2 + 2. Let x(b) be the first derivative of -2b*3/3 - b - 2536. What is -4a(p) - 5x(p)? 2p*2 - 3 Let a(q) = 8q*2 + 65q - 54. Let i be a(-9). Let m(h) = -5h + 1. Let n be m(1). Let d(f) = -13f + 2. Let l(g) = -6g + 1. What is il(b) + nd(b)? -2b + 1 Suppose 5p - 400 = -11p. Suppose l - p = 5h - l, 5l = -h - 5. Let j(c) = -c*2 + c + 4. Let t(u) = u + 3. Determine ht(i) + 4j(i). -4i*2 - i + 1 Let q(z) = -47z*2 - 9. Let f(p) = 185p*2 + 36. Calculate 2f(a) + 9q(a). -53a*2 - 9 Let t(s) = 10s*3 + 42s*2 + 195s + 65. Let h(k) = -5k3 - 21k*2 - 90k - 32. Determine -13h(d) - 6t(d). 5d3 + 21d*2 + 26 Let i(g) = 4g*3 + 11g*2 + 8g - 11. Let k(p) = -14p - 468. Let b be k(-35). Let m(u) = u3 + 3u*2 + 2u - 3. Give bm(l) - 6i(l). -2l3 - 4l Let k(j) = 291j3 + 11j + 11. Let t(y) = 97y3 + 4y + 4. Give 3k(s) - 8t(s). 97s3 + s + 1 Let s(j) be the third derivative of j5/60 + j4/24 + j3/6 + 13j*2. Let m = -1138 - -1137. Let u(n) = -6n*2 - 4n - 6. Determine mu(z) - 4s(z). 2z2 + 2 Let q(p) = 80 + 3p + 5 - 2 - 83. Let v(c) = c*2 + 2c. Give -6q(f) + 9v(f). 9f2 Let t(n) = -7n - 1. Let i(l) = -l. Let p be 1 + -1 + 0 + 0. Let o = 2117 + -2114. Suppose 0 = 3f + 2f + d + 18, 2f - od + 14 = p. Give fi(r) + t(r). -3r - 1 Let w(a) = -2349a + 2. Let u(n) = -7050n + 6. Determine -6u(z) + 19w(z). -2331z + 2 Let f(w) = 4w + 4. Let t(l) = 4l - 110 + 58 + l - 4l + 53. What is -2f(s) + 7t	{ "pile_set_name": "DM Mathematics" }
- m - 4m. Solve -y + n = 110 for y. -5 Suppose 4p - 7p = 5n - 37, 4n + p - 31 = 0. Solve 5j + 2 = -n for j. -2 Let d = -1 - -11. Suppose 0l + 2h + 34 = 4l, l = 2h + d. Solve 5v - l = 7 for v. 3 Suppose -2 + 14 = 3d. Suppose -x = -k + 2x + 11, 6 = -3k - dx. Suppose -2a = ka. Solve o + 4o - 5 = a for o. 1 Let i(y) = -7y - 7. Let j(w) = -27w - 27. Let r(v) = -9i(v) + 2j(v). Let x be r(-1). Solve xd + 4d = 0 for d. 0 Let q = 69 + 8. Let w be 106/22 - (-14)/q. Suppose -11 = m + 5o - o, 0 = 4m + o - 31. Solve -wx + m = -16 for x. 5 Let m(d) = -3d. Let a be m(2). Let i(h) = -4h + 8. Let q be i(6). Let u = a - q. Solve 4z + 22 = u for z. -3 Let s(g) = 4g. Let m(l) = 5l + 1. Let z(c) = 3m(c) - 4s(c). Let q be z(3). Solve 0 = -qv + 3v - 6 for v. 2 Let w be 6/(-21) + 60/14. Suppose -n = 3n - w. Solve -q + 2 = -n for q. 3 Suppose 2h - 6f = -f + 16, h + 3f - 8 = 0. Let o be (-11)/((-220)/h)10/4. Solve -o = -n - 6 for n. -5 Let o(i) = i + 5i*2 + 12i*2 - 14 - 2i + i*3. Let w be o(-17). Solve -5b = 12 + w for b. -3 Let a be 120/54 - (-2)/(-9). Suppose 0 = -2d + 3d - 5d. Let o be -1 - 2/(4/(-14)). Solve -ot + at + 4 = d for t. 1 Let c(v) = v + 3. Let w(t) = t3 - 7t*2 - 6t - 19. Let f be w(8). Let j be c(f). Solve -b - 2b + 15 = j for b. 5 Let i(c) = 2c*3 - 6c*2 - 7c + 6. Let z be i(4). Let r be (4/z)/((4/5)/4). Solve 2x - 2 = r for x. 2 Suppose -v - 2x + 33 = 0, 5v = x + 3x + 123. Let b = v + -24. Solve 7 = -bi - 8 for i. -5 Let y = -30 + 120. Let v be y/(-12)(-16)/10. Solve 0 = -3l - v for l. -4 Let v(a) = 5a + 4a - a - 14 - 5a. Let y be v(6). Solve -d + 20 = yd for d. 4 Let u be (-136 - -128) + (10 - 0). Let w be 2/(-9) - (-4)/18. Solve w = -uq - q for q. 0 Let c = 53 + -51. Suppose 0 = -cn - 19 + 35. Solve n = 6w - 2w for w. 2 Suppose -u = 2, 16u + 17 = 5z + 15u. Solve 2x - zx - 3 = 0 for x. -3 Let p(a) = a*2 + 3a - 6. Let f be p(-5). Suppose -31o + 34o = 15. Solve ou + 4 = fu for u. -4 Suppose 2p - 9 - 41 = 0. Let u = p + -17. Let y be u/32 - 1/4. Solve y = 2w - 4 for w. 2 Let h = -244 - -247. Solve 10 - 1 = -hb for b. -3 Let z = 60 - 65. Let k(g) = 2g*2 + 9g - 3. Let b be k(z). Solve -3 = c + b for c. -5 Let s(v) = 5v2 + 4v - 3. Let h(c) = -c*2. Let i(j) = -6h(j) - s(j). Let t be i(3). Suppose tp = 2p. Solve -5u + 2u + 15 = p for u. 5 Suppose -213t + 205t = -72. Solve tm - 1 = 8m for m. 1 Let k be 33/7 + (-2)/(-7). Suppose 17m - 7 = 44. Suppose 4z - 2z - my - 20 = 0, 3z + ky - 30 = 0. Solve i - z = -5 for i. 5 Let t(a) = -11a2 + 46a + 63. Let b(u) = -5u2 + 23u + 31. Let v(r) = 13b(r) - 6t(r). Let f be v(-22). Solve -fh = 2h + 25 for h. -5 Suppose 25p = 39p. Solve 7h - 8h = p for h. 0 Let d be 140/40 + (-3)/(-6). Solve 4z - 6z - d = 0 for z. -2 Let a = 35 - 17. Let x be ((-8)/a)/(10/(-45)). Solve 5q - x = 8 for q. 2 Let b(y) = y2 - 10y + 3. Let t be b(4). Let o = 21 + t. Suppose k - 5k + 12 = o. Solve 5 = 4h - k for h. 2 Suppose 5f - 30 = -4r, r - 8 = -3. Suppose -3x = -3, -fl + l = -3x - 12. Solve 8h = 3h - l for h. -3 Suppose a - 4u + 15 = 0, 8a + 2u - 13 = 3a. Let o be 7/2 + (-2)/(-4). Solve -o = -x + a for x. 5 Suppose 4 = 2l + 2, 11 = 4h + 3l. Solve 0 = 3q + h + 1 for q. -1 Suppose -15v + 239 = 14. Solve -2t = -5t - v for t. -5 Let d = -95 + 99. Solve -2g - d = -4g for g. 2 Let l(f) = f*2 + 19 - 9f*2 + 37f + f*2 + 5f*2. Let h be l(19). Solve h = 2u - 6 for u. 3 Let l(c) = c*3 + 2c*2 - 5c - 2. Let v be l(-3). Suppose -106j = -112j + 18. Solve -2 - v = -jr for r. 2 Let d = -110 - -115. Solve -f - d = -2f for f. 5 Suppose -5n + 44 = -3x + x, -3n + 2x + 28 = 0. Solve 4 = -v + n for v. 4 Suppose -109y = -86y - 230. Solve -2m = 8m - y for m. 1 Let i(x) = -10x + x3 + 18 + 0x*2 + 0x*2 - 3x*2 - 4x*2. Let z be i(8). Solve -z = -0a - a for a. 2 Let y = 14 - 5. Solve -o = -4o + y for o. 3 Let p be 2/(-6) + (-250)/15. Let y = p - -14. Let u be 3/2(-4)/y. Solve -o = -3 - u for o. 5 Suppose 0 = 2v - 3 - 1. Suppose 0 = -4m + 3z + 47, 3m - vm - 18 = 2z. Suppose 96 = -5p + mp. Solve 4t + 12 = p for t. 5 Let o(g) = 2g*3 - 43g*2 - 29g + 160. Let q be o(22). Solve -5t = -11t + q for t. 1 Let x(f) = -f*3 + 3f*2 + 13. Let n be x(4). Let o be (-4)/(-22) + 6/99n. Solve o = a - 3a + 8 for a. 4 Let b be 14/8 - (-3)/12. Suppose -19q - 35 = -263. Solve p = -bp - q for p. -4 Suppose -l + 2m = -2l + 11, m = 2l - 2. Let h = -23 - -25. Suppose 0o = -hd - o + 3, 0 = 5d + o - 3. Solve 2i + li - 15 = d for i. 3 Let s = -59 + 92. Let a be (s/44)/((-1)/(-4)). Suppose an + u - 23 = -3u, -3n = 3u - 18. Solve -3 = g + n for g. -4 Let v = 56 - 24. Suppose 4m = 20, -4s + 0m - 4m + v = 0. Solve 0 = -sf + f + 6 for f. 3 Suppose -3d = 4b - 1, 2b = 4d - 7 + 35. Solve 0 = bi - 5i + 4 for i. 4 Suppose 4o - 2o - 20 = 2q, -3o + 5q + 20 = 0. Suppose -5t = 4y - 21, -4t + 1 - 5 = -2y. Let d be 1 - t - 1/(3/(-9)). Solve -df = -0f + o for f. -5 Suppose s - 3 = -1. Solve 2r + sr = -0r for r. 0 Suppose j + 5 = d, 0 = 2j - 3j - 4d + 20. Suppose j = w - 3w + 28. Let i be (-4)/w + (-60)/(-14). Solve iu = -u + 25 for u. 5 Let b(i) = i3 - i2 - 5i - 1. Let f be b(3). Let a(g) = g*3 - 2g*2. Let j be a(f). Solve 2u = -ju + 8 for u. 4 Suppose 0 = w - 6 + 8. Let r be (-2)/(-3)(-2)/(w/15). Solve -1 = -3i - r for i. -3 Let t(s) = 2s*2 - 3s - 5. Let p(u) = -7u - 2. Let y be p(-1). Let b be t(y). Suppose j - 5h + 6 = 0, j + 5h = -4j + b. Solve -n - 25 = jn for n. -5 Let k be (-214/(-4) - 4) + -1. Solve k = 8l - 6 for l. 1 Suppose 2j - 2o = 46, 0 = -5j - 78o + 74o + 106. Solve -8m + 19m - j = 0 for m. 2 Suppose -12 = -4o - 3x, 2o - 7x + 3x - 6 = 0. Solve -ou + 6 = -0 for u. 2 Let t(c) = c - 7. Let u be t(14). Let o(q) = q*2 - 9q + 14. Let z be o(u). Solve z = -n + 5n for n. 0 Let p(s) = s3 + s2 + 4. Let n be p(0). Solve -10b + n = -9b for b. 4 Suppose -6 = -n + 2. Suppose 49j = 51j - n. Suppose -3k - 3x = -jk + 5, -6 = -k + 4x. Solve 0 = kv + 2v for v. 0 Let r be (-2)/8-20/(-242). Solve -2d + 4d + 10 = r for d. -5 Let i(q) = q + 9. Let p be i(-9). Suppose -2o + 0 + 4 = p. Solve -og = g for g. 0 Suppose -5u + 7u - 12 = 0. Let y(o) = -o - 8. Let i be y(u). Let l = 18 + i. Solve -3f = -l - 2 for f. 2 Suppose -w = -o - 4, o = -5w + 14 - 0. Solve 14 = wp + 11 for p. 1 Let o be 38 + -24 + (-7)/(-1). Solve 0 = oi - 20i for i. 0 Let n(t) = -t*3 - 4t*2 + 4t - 1. Let p be n(-5). Let z(m) be the second derivative of m*3/6 - 11m. Let x be z(0). Solve -g + p + x = 0 for g. 4 Let i be -2(-12)/162. Suppose -5f = 4g - 11, if - 4 - 6 = g. Suppose -f = -n + 3. Solve 2z = -z - n for z. -2 Let b be 2/(-4)(-1 + -9). Let a be -2(10/4)/b. Let s be a/3(-18 - -6). Solve -3t = -2t - s for t. 4 Let n be (1 - 1)/(4/2). Let j be (-2 + -1)3/9-3. Solve nu - ju = 0 for u. 0 Let h(d) be the second derivative of -d5/20 + d4/12 - d3/3 + d2 - 32d. Let j be h(0). Solve -a + 0 = j for a. -2 Let a be ((-6)/2 + 3)/(-1). Let o = a + 2. Suppose -5u - 2j + 9 = -1, -3j = 3u - 15. Solve u = oy - y for y. 0 Suppose -4q + 9 = 3t, -t - 5q - 15 = -6t. Suppose -t = -5a - 4m, -24 = -4a + a + 5m. Let g be (-3)/(-3) - -13. Solve -f + af = -g for f. -2 Suppose -3m + 10 = -m - 2f, -25 = 4m + 5f. Let k = 2 + -1. Solve m = c + k + 1 for c. -2 Let o(m) = 8 + 0 + 6 + 2 + m. Let a(u) = -u3 + 3u*2 + 6u + 7. Let t be a(5). Let s be o(t). Solve 2y + 2 = sy for y. 2 Suppose 0 = -11y + 9y - 16. Let a(i) = i + 11. Let z be a(y). Suppose zt + 10 = 8t. Solve -8 - 2 = tg for g. -5 Let t(h) = -6h*3 + 2h*2 + h. Let p be t(-1). Suppose 2f + 15 = pf. Suppose 5q + 4m + 2 = -1, -q = 5m + 9. Solve -q = l - f for l. 2 Suppose -4d + 2d = 3q - 12, 3q + 3d - 9 = 0. Suppose 3m + 5y + 26 = qm, -5m + 2 = 2y. Suppose 4z = mz + 8. Solve zl = -2 - 6 for l. -2 Let d(b) = 92b*2 + 2 - 3 + 4b - 93b2. Let z be d(3). Solve zw - 4 = -0 for w. 2 Let o(z) = z*3 + 8z*2 - 28z - 238. Let c be o(-6). Solve -6f + c = 14 for f. -2 Let o(k) = 34k - 3. Let y be o(1). Let m = 37 - y. Solve j = -j + m for	{ "pile_set_name": "DM Mathematics" }
Let m = -13/36 + 1/9. Let h = -6 + 5.8. Let i = 2.8 - h. Sort -0.1, m, i in descending order. i, -0.1, m Let w = -0.2 + 0. Let h = 0 + w. Let y = h + 0.6. Sort 0.2, y, 0. 0, 0.2, y Let c = -0.048 - -6.148. Let a = c + -0.1. Let p = -5 + a. Sort p, 2, -4 in decreasing order. 2, p, -4 Let m = 2 + -1. Sort 4, m, 3 in decreasing order. 4, 3, m Let j = 2203/15 + -147. Sort 3, j, -2 in increasing order. -2, j, 3 Let u(d) = -d + 7. Let p be u(9). Let o be 2/(-1)(-1)/p. Let a be 2(-2 - o) + 6. Sort 0.4, a, 1 in increasing order. 0.4, 1, a Let v be 8/36 + (-188)/36 + 3. Suppose o = 3q - 8q + 22, -8 = -q - 2o. Suppose -qy = 4, 2 + 15 = 5f + 3y. Sort f, -4, v. -4, v, f Let d be -3 - 0 - 22/(-8). Put 1/7, -0.5, d, 2/7 in ascending order. -0.5, d, 1/7, 2/7 Suppose 5 = -3s - t, -13 = 5s - 2s + 5t. Sort 5, s, 1 in ascending order. s, 1, 5 Let l(h) = -h*3 - 8h*2 - h - 6. Let d be l(-8). Sort -6, -4, 4, d. -6, -4, d, 4 Let m = -343 + 2405/7. Suppose 9 - 61 = 3q + 5i, 5i + 25 = 0. Let h = q + 21/2. Sort -0.5, m, h. -0.5, m, h Let g be (-27)/5 - (-18)/45. Sort -2, 2, g in descending order. 2, -2, g Suppose 107b - 12 = 110b. Sort 2/23, 5, b, -0.5. b, -0.5, 2/23, 5 Let w(i) = -i*3 + 3i*2 + i - 7. Let v be w(3). Sort v, 3/4, 0.2 in descending order. 3/4, 0.2, v Let r = 3 - 0. Sort 4, -1, r. -1, r, 4 Let w = 1056430340 - 140507481243/133. Let l = w - -16887. Let z = 2/7 + l. Put z, -5, -2/5 in descending order. z, -2/5, -5 Suppose a + 3 = 7. Let j(t) = 3t*3 + 8t*2 - 3t + 5. Let g(h) = 5h3 + 15h*2 - 5h + 9. Let x(l) = -4g(l) + 7j(l). Let r be x(a). Sort r, 4, -4. r, -4, 4 Let n = 4.821 + 0.179. Let o = 3 - 2.8. Put n, 4, o in decreasing order. n, 4, o Suppose -10w + 20 = -6w. Sort 0.2, -1/5, w in ascending order. -1/5, 0.2, w Let o = 189 + -190. Suppose 2v = -5l + 40, -5v - 10 = -3v. Suppose -5f + lf - 5 = 0. Sort f, 2, o in ascending order. o, f, 2 Let x be (-3 - 38/(-10))/((-12)/30). Sort 4, 5, x in decreasing order. 5, 4, x Let m be (12/(-18))/((-4)/(-6)). Sort -3, 4, 0, m in descending order. 4, 0, m, -3 Let d(l) = -15l + 115. Let k be d(8). Let j be 4/((-2 - -1)1). Sort k, 4, j. k, j, 4 Suppose m - 2m = -1. Suppose -3t = -4t - 3. Sort t, m, 4. t, m, 4 Let i = 20 + -19.5. Sort 2/7, i, 1/6, -18 in descending order. i, 2/7, 1/6, -18 Let y = 9 - 0. Put 0, -2/7, y in descending order. y, 0, -2/7 Let f be 0 - 3/(-9)-6. Sort f, -3/2, 5 in decreasing order. 5, -3/2, f Let i be (-2)/(-9) - 957/(-3834). Let x = i + 2/71. Let f = -592/3 + 197. Sort x, f, 0.2. f, 0.2, x Suppose 2k = -l - 4, 3 = 2l - 2k - 1. Let o be 423/(-135) + (-4)/(-30). Sort -4, l, o in decreasing order. l, o, -4 Let z = -2242/5 - -448. Let w(l) = l - 5. Let b be w(3). Sort b, z, -2/7 in decreasing order. -2/7, z, b Let g(n) = -n3 + 5n*2 - n + 10. Let b be g(5). Suppose 4q - 6 + 22 = 0. Put b, 1, q in decreasing order. b, 1, q Suppose -11 = -21y + 10. Suppose -3m = -2 + 8. Put y, m, -0.4 in decreasing order. y, -0.4, m Let r = 0.03 - -1.97. Let g be (-1)/7-82/(-8). Put r, g, 6 in increasing order. g, r, 6 Let g = -15 - -26.6. Let m = 12 - g. Sort -0.08, -0.3, m. -0.3, -0.08, m Let i = 5 - 3. Suppose -5v + 5 = 0, -4v - i = 5g - 1. Put g, -3, -2 in descending order. g, -2, -3 Suppose 0 = -4q - 4f + 4, -2q + 5q + 15 = 3f. Put -0.5, -0.1, q in increasing order. q, -0.5, -0.1 Let y = 132.2 + -132. Let s = 4 + 0. Put s, -0.5, y in decreasing order. s, y, -0.5 Let l(x) = -x2 + x + 11. Let f be l(0). Let r = 6 - f. Let q(u) = u3 - u*2 + 1. Let t be q(1). Put -1, r, t in decreasing order. t, -1, r Let k be (-7)/3 - (-2)/6. Suppose -4g + 8g - 4 = 0. Sort g, -3, k. -3, k, g Let m = 1.1 - 1.7. Let k = 0.3 + m. Put k, 0.2, 5 in increasing order. k, 0.2, 5 Let f be (-1)/(-2 - (-5)/3). Suppose 1 + 2 = -fa. Let o = 6 - 11. Sort o, -1/6, a in descending order. -1/6, a, o Suppose -4a = -5 - 3. Let d = 0.5 - 1. Sort d, a, 2/3 in ascending order. d, 2/3, a Let m = -53 - -53.4. Let b be 1(4/18)/(-2). Sort m, b, -0.1 in descending order. m, -0.1, b Let c = -2 - -2.1. Let k = 21.41 - 0.41. Let h = -20 + k. Put h, -2, c in increasing order. -2, c, h Suppose 2 = s - 2. Suppose 3d - 4 = 5. Suppose s = -dj + 5j. Sort j, -2, -5. -5, -2, j Suppose d - 3y = -11, 3d - 1 - 16 = -y. Let h be 9/6(3 + -1). Suppose -3t = -4u + 2, -hu = 3t - 2t - 8. Put d, 5, t in increasing order. t, d, 5 Suppose -a - 5 = -0a. Put a, 5, -4, 1 in decreasing order. 5, 1, -4, a Let x = 10 + -3. Let y = x + -3. Let f = -2.4 + 2. Sort y, f, 1 in decreasing order. y, 1, f Let l be (-1)/(8/10)-12. Let v be 2/(3 - l/6). Let y = -3 - -5. Put y, v, -4 in ascending order. -4, y, v Let y = 2.2 - 2. Let p = -1.6 + 1.5. Put p, -5, y in increasing order. -5, p, y Suppose 3d + 0d = 3. Sort d, 0, 3 in descending order. 3, d, 0 Let y = 132/7 - 688/35. Let q(h) = -5h - 2h2 + h2 - 4h + 2h + 4. Let a be q(-7). Sort a, 5, y in increasing order. y, a, 5 Let m = -0.14 - -0.34. Suppose -13 = 3c + 5. Let l be 18/1216/c. Put 3, l, m in decreasing order. 3, m, l Let w = -0.34 + 0.04. Let r = -2 - -5. Let g = 0.213 + -3.213. Put g, r, w in increasing order. g, w, r Let o(w) = w3 + 6w*2 - 5w + 9. Let v be o(-7). Let z = -47 - -36.1. Let c = z - -11. Put v, 3, c in descending order. 3, c, v Let q(n) = n*2 - 5n - 14. Let f be q(7). Sort f, 7, -1. -1, f, 7 Suppose 5g - 5l + 5 = 0, 2g + 11 = l - 2l. Let h be (2 - 1)/(-1) + 3. Let k be (-4 + 1)h/(-3). Put k, g, -3 in decreasing order. k, -3, g Let m = 1.3 - 0.8. Put m, 1, 3 in decreasing order. 3, 1, m Suppose -3d = -5b - 9, -4b + 3 = -2d + 3d. Suppose -4p + 2t - 15 = dt, 2t = -p + 5. Put -2, 6, p in decreasing order. 6, -2, p Let m = 16.01 + -16. Let w be ((-3 - -4)-1)/(-4). Put 0.1, m, w in decreasing order. w, 0.1, m Let r be ((-2)/5)/(1/5). Let a be (2/1)/2 - r. Let d be (-115)/255 + 1/a. Put -3, d, -1/2 in ascending order. -3, -1/2, d Let l(u) = -2u. Let c be l(2). Suppose 11m - 57 = -35. Put 12, m, c in decreasing order. 12, m, c Let a = -8.68 + -0.32. Sort 3, 0.2, a in descending order. 3, 0.2, a Let f be -1 - (2/(-2))/1. Let z be 0/(-4) + -1 - 2. Put -5, f, z in increasing order. -5, z, f Let l(t) = -t3 + 9t*2 - 13t - 4. Let b be l(7). Put 1, 4, b in descending order. 4, b, 1 Let g(x) = x*2 + 3x - 1. Let n(b) = -b*2 - 3b + 7. Let v be n(-5). Let d be g(v). Let c = 0 + 1. Sort 0, d, c. d, 0, c Let t be 13(-2)/10. Let r = -11.3 - -11.6. Sort r, t, -1 in increasing order. -1, t, r Suppose 13 + 7 = 5b, 2b - 4 = 2c. Suppose cy = -2y + 12. Put -1, y, 1/4 in ascending order. -1, 1/4, y Let s be 15/4 - (66/24 - 3). Put 2, -3, s, -48 in ascending order. -48, -3, 2, s Let s = 934/57 - 49/3. Put -0.5, 0.5, s, 0.1 in decreasing order. 0.5, 0.1, s, -0.5 Let v = 17 + -21. Sort 0.4, v, 1 in decreasing order. 1, 0.4, v Suppose -5w + 10 = 2c - 13, 0 = -4w - 5c + 32. Let k be ((0 + 0)/3)/(-3). Suppose 8 + k = -2l. Sort l, w, -1. l, -1, w Let a be (2 - 4) + (-48)/(-21). Let u = -3 + 2.5. Let o = 5 + -2. Put u, o, a in descending order. o, a, u Suppose 2d = 3d + 1. Sort d, 1, -5 in increasing order. -5, d, 1 Suppose 2b + 220 = 4q, -54 = 2b - 2q + 160. Let u = -413/4 - b. Suppose -5 = 3f - 4f. Sort f, 1/3, u in descending order. f, u, 1/3 Suppose 0m + 4m + 2w + 22 = 0, 0 = m - w - 2. Let y be 20/3 - m/9. Let p = 9 - y. Sort p, -0.5, 3 in descending order. 3, p, -0.5 Let v be 8/(-44) - 312/(-22). Let p = 12 - v. Let f(c) = 3c - 1. Let n be f(2). Put n, 1, p in decreasing order. n, 1, p Let i be 60/(-14) - (-2)/7. Let j be (-94)/18 - i/18. Sort 0.1, j, -3 in descending order. 0.1, -3, j Let o = 0.2 + -0.3. Suppose 0 = 5r - 3q + 8 + 14, 0 = r + 3q - 10. Let m = 3.3 + -3. Sort r, o, m in decreasing order. m, o, r Suppose 2x = -0x + 12. Let k = 4 + -1. Let c = x - k. Sort 0, c, -1 in decreasing order. c, 0, -1 Let m be 2 + (5/(-20))/((-3)/(-32)). Put m, 2/15, -0.4, -6/11 in decreasing order. 2/15, -0.4, -6/11, m Suppose -16 = -2x + 2o, -5x - 8 = -2x + 5o. Suppose 0f - 5f + 70 = -2p, -3f + 42 = 5p. Suppose -3h = -2 + f. Put x, h, -2 in ascending order. h, -2, x Let v = -6.82 - 0.18. Let a = -10 - v. Let q = -10 + 21/2. Sort q, a, 3 in descending order. 3, q, a Let p(m) = m + 59.	{ "pile_set_name": "DM Mathematics" }
2 - 17x*2 wrt x? -2160x*3 Let r(q) = 580q*3 + 6q*2 - 332q + 18. Let p(d) = -387d3 - 4d*2 + 221d - 11. Let i(a) = -11p(a) - 7r(a). Find the third derivative of i(y) wrt y. 1182 Let x(b) = 3b2 - 11b - 11. Let j be x(-1). Suppose 4r - 10 = 26. What is the derivative of 8 + 4q*j - rq*3 - 8q*3 wrt q? -39q*2 What is the derivative of -42v*2 + 10v*2 - 33v*2 + 44v*2 - 5v - 1046 - 104v2 wrt v? -250v - 5 What is the second derivative of -215s + 429s*2 + 403s - 595s + 4 wrt s? 858 Let j = -243 - -310. Find the second derivative of -38d*4 - 11d - 65d3 - 43d*4 + 8d + jd3 + 4 - 11d wrt d. -972d2 + 12d Let i be (-3 + 5)1 - -4. Let x be (-2)/i + (-60)/(-18). Find the second derivative of -14f + 12f4 - 98f*x - 94f*3 + 192f*3 wrt f. 144f*2 Let a(c) be the third derivative of 2c*2 - 1 - 4c*3 + 0c - 7/6c4. Find the first derivative of a(w) wrt w. -28 Suppose 220 = 20v + 26 - 86. Let w(n) be the second derivative of -7/6n3 + 6n*2 + vn + 0. What is the first derivative of w(k) wrt k? -7 Let t(k) be the first derivative of -105 + 0k2 + 0k*4 + 256/3k*3 + 0k - 25/6k6 + 4/5k*5. Find the third derivative of t(i) wrt i. -1500i*2 + 96i Let f(c) be the first derivative of -c6/6 - c5/5 + 22c3/3 + 2c - 1527. What is the third derivative of f(q) wrt q? -60q2 - 24q Find the third derivative of 6v + 3284v*5 - 5v - 8560v2 + 6396v*2 wrt v. 197040v*2 Let h be (-2 - 1)(-10)/30. Let p(f) = f. Let o(k) = -27k5 - 59k. Let x(v) = ho(v) + 2p(v). Find the second derivative of x(l) wrt l. -540l3 Let z(t) = -272t3 + t2 + 1427t + 9. Let i(l) = 134l3 - l2 - 714l - 4. Let j(q) = 9i(q) + 4z(q). What is the second derivative of j(h) wrt h? 708h - 10 Let k(g) be the second derivative of -37g7/21 + 29g*3/3 - 7g*2/2 - 3g + 28. Find the second derivative of k(q) wrt q. -1480q3 Let p(w) be the second derivative of 4w*8/7 - 4w*6/15 + 55w4/6 + w2/2 + 1805w. Find the third derivative of p(b) wrt b. 3840b*3 - 192b Let q(o) be the third derivative of 0 + 7/30o5 - 1/6o*3 + 0o + 17/12o4 + 60o*2. What is the second derivative of q(a) wrt a? 28 Differentiate 296d + 1109d - 90d - 3433 with respect to d. 1315 Let i be (-4)/20 - (-19)/(-5). Let p be (-4 - (2 + i))-1. What is the second derivative of 42o - 8op - 35o - 2o2 wrt o? -20 Let h(l) = -197l - 5457. Let n(i) = 5710i + 158265. Let t(f) = 175h(f) + 6n(f). What is the derivative of t(a) wrt a? -215 Let a(m) be the second derivative of -m6/30 + 111m5/20 - m3/3 - 105m2/2 + 2m - 284. Find the second derivative of a(h) wrt h. -12h2 + 666h Let w(h) be the third derivative of h9/945 - h5/24 - 2h4 - 6h*2 - h. Let f(u) be the second derivative of w(u). What is the derivative of f(m) wrt m? 64m*3 Let l(g) be the third derivative of 0g*6 + 5/3g*4 + 0 + 0g + 1/2g3 + 0g*5 - 53/105g*7 - 138g*2. What is the second derivative of l(u) wrt u? -1272u*2 Suppose 6j = v + 7j - 6, 5j + 34 = 3v. Find the first derivative of 54n*2 - 104n*2 + v - 3 + 5 wrt n. -100n Let q(j) be the first derivative of 0j2 - 25/4j*4 + 0j - 131/3j3 + 53. Find the third derivative of q(s) wrt s. -150 Let w(n) be the first derivative of -28n*2 + 127n*2 - 8n*2 - 3n*3 + 172. Find the second derivative of w(o) wrt o. -18 Let z(p) be the first derivative of 0p*2 - 17 + 109/4p*4 + 0p*3 - 15p. Find the first derivative of z(n) wrt n. 327n2 Let q(x) be the first derivative of 1139x*3/3 + 2644x - 1783. Differentiate q(r) wrt r. 2278r Let j(f) = 9f*2 + 110f + 1534. Let t(x) = -23x2 - 220x - 3068. Let v(z) = -7j(z) - 3t(z). Find the first derivative of v(a) wrt a. 12a - 110 Let m(c) be the third derivative of 5c*9/168 - 3c*8/112 - 824c*5/15 + 144c*2 - 6c. What is the third derivative of m(s) wrt s? 1800s3 - 540s2 Let k(h) be the second derivative of -h6/30 + 587h5/5 + 4045h*2 + 5414h. What is the derivative of k(n) wrt n? -4n3 + 7044n*2 Let p(r) = 1338r + 5742. Let f(c) = 5390c + 22968. Let l(x) = -4f(x) + 18p(x). Differentiate l(y) wrt y. 2524 Let t(x) be the second derivative of -2x*6/15 - 133x*5/5 + 5x*4/12 - 50x3/3 - x2 + 134x - 9. What is the third derivative of t(p) wrt p? -96p - 3192 Let q(l) = 17l2 - 54l - 2284. Let y(x) = 19x2 - 54x - 2283. Let r(z) = 6q(z) - 5y(z). What is the first derivative of r(h) wrt h? 14h - 54 Let i(n) = 612n*2 - 147n - 15. Let t(g) = 609g2 - 133g - 16. Let d(q) = 6i(q) - 7t(q). Find the second derivative of d(z) wrt z. -1182 Let h(s) be the third derivative of -49s5/10 + 359s*3/3 - 928s*2. Find the first derivative of h(d) wrt d. -588d Let w(c) = 7988c2 - 36c - 10212. Let f(u) = -7u2 + 2u. Let o(a) = -18f(a) - w(a). What is the derivative of o(x) wrt x? -15724x Find the second derivative of -54j + 2516j*4 - 843j - 873j - 651j*4 wrt j. 22380j*2 Suppose 2l + 23 = 27. What is the third derivative of 401p - 401p - 25p3 + 25p*l wrt p? -150 Suppose -5d + 224 = 5z + 34, 0 = -4d + 5z + 179. Find the third derivative of 161g - 329g + 165g + 2g2 + dg*4 - 8g*2 wrt g. 984g What is the third derivative of 691l2 - 7l*4 + 7l*4 - 1040l*5 - 172l*5 - 7l*2 wrt l? -72720l*2 Let m = -293 + 295. What is the second derivative of -18w*m - 33w + 37w - 5 + 7 wrt w? -36 Suppose -29 = 64j - 65j. What is the third derivative of 25y*3 + jy*3 + 4y*3 + 68y*2 wrt y? 348 Find the second derivative of -3b*4 + 1418b*3 + 527b*2 - 1732 - 3b - 209b2 - 318b*2 wrt b. -36b*2 + 8508b Suppose -3z + 394 + 443 = 0. What is the second derivative of zm*2 + 33m - 2 - 208m2 - 4m wrt m? 142 Let z = 142 + -140. Find the second derivative of zh2 - 22h*2 + h + 30 - 7h*2 wrt h. -54 Let g(y) be the third derivative of 73y8/336 + y7/70 + 143y4/8 - 391y*2 + 2y. Find the second derivative of g(w) wrt w. 1460w3 + 36w*2 Suppose -g - b = -1601 + 254, 4g + b - 5382 = 0. What is the first derivative of 4l2 - gl*4 + 1348l*4 + 4l*2 - 142 + 11l*2 wrt l? 12l*3 + 38l Let t(o) be the first derivative of 1566o2 - 4514o + 3408. What is the first derivative of t(p) wrt p? 3132 Let l be 1 + -1 + 10/5 - 20. Let h = l + 32. Find the third derivative of -d*6 - 5d*2 - 14d*2 - hd*6 wrt d. -1800d*3 Suppose -13h + 1531 = 1232. Let z(f) be the second derivative of 0f3 + 0 - hf - 3/2f4 - 9/2f*2. Differentiate z(t) with respect to t. -36t Suppose 16m = 21m. Suppose m = -2i + 12 + 6. What is the second derivative of -5j*3 + 17j + 14j3 - 19j*4 - ij*3 wrt j? -228j*2 Suppose 0 = -55g + 61g - 12. What is the second derivative of -517s + s*g - 8s*4 + 129s + 272s wrt s? -96s*2 + 2 Suppose 29v - 2095800 = v. What is the second derivative of -70a - 74850a*3 + 14a*4 + va*3 wrt a? 168a*2 Find the first derivative of -2065 - 13d*3 - 31d*4 + 365 - 150 wrt d. -124d*3 - 39d*2 Suppose 4i + i = 180. Let r = i + -32. Find the third derivative of -k*2 + 4 - r + 5k*6 wrt k. 600k*3 Suppose i + 3x - 63 = 0, -4i = 3x - 116 - 181. Let a = -76 + i. What is the third derivative of 37p4 - 48p*a + 41p*4 - 78p*4 + 23p*5 wrt p? 1380p*2 Suppose -f = -t - 77 - 28, 4f + 4t - 444 = 0. Let a = f + -81. What is the second derivative of 9 - 36k + ak + 2k*2 - 9 wrt k? 4 Let w(l) = 4l*2 + 2l - 5. Let b be w(-2). What is the first derivative of 2g - g2 - 33 - 5g + bg - 18 wrt g? -2g + 4 Let a(c) be the third derivative of -67/3c3 + 0c - 4c2 - 30 + 1/60c*5 + 7/24c*4. Find the first derivative of a(o) wrt o. 2o + 7 Let b(j) be the second derivative of 263j7/7 - 13j4 - j2/2 + 5192j. Find the third derivative of b(p) wrt p. 94680p2 Let j(k) = -k3 - 6k2 - 12k - 9. Let u be (0 + 1)/(39/(-12) - -3). Let w be j(u). Differentiate -wq3 - 19 + 3q*3 - 3q*3 + 3 with respect to q. -21q*2 Let w(t) be the second derivative of -394t*5/5 + 28t*4 - 1195t. Find the third derivative of w(i) wrt i. -9456 Let u(m) be the second derivative of -13m6/15 + 3m*5/20 - 235m**3/	{ "pile_set_name": "DM Mathematics" }
the units digit of h? 7 Let j(l) = 79l2 + 2l. What is the tens digit of j(1)? 8 Suppose 13 = -u + 2i - 3, -8 = -4i. Let j = u - -22. What is the units digit of j? 0 Let o(c) = c*3 - 5c*2 + 2c - 2. Let b be o(4). Let u = b + 12. What is the units digit of u? 2 Let y = 511 - 300. What is the tens digit of y? 1 Let d(u) = -5u2 + u3 + 2u - 5u - 4u + 6. Let v be d(6). Suppose 0 = 3m - 4i - 50, 3i + 15 = v. What is the tens digit of m? 1 Suppose 5t - 428 = -r - 18, -3t + 3r + 228 = 0. Suppose t + 59 = 5i. What is the units digit of -21i/(-8)? 7 Suppose -30 = -2a - 8. What is the tens digit of a? 1 Let u be -177(-4)/61. Suppose 3j = 2j - 2, -3j + u = 4v. What is the units digit of v? 1 Let n be 52/(-6) + 6/9. Let s be 15/10-21. Let t = s - n. What is the units digit of t? 5 Suppose -5z - 3k = -15, -z - 3k + 15 = 2z. What is the units digit of 2(z + -1) - -10? 8 Let w(k) = k3 + 3k*2 + 1. Let m be w(-4). Let c = m + 27. Suppose 0 = -5y - d + 22, -3y + 4d + c = 2y. What is the units digit of y? 4 Let u(l) be the second derivative of l4/12 + 2l3/3 + l2 - 3l. What is the units digit of u(-5)? 7 Let s(g) = -2g*2 - 1 + 3g*2 - 2 - 3g. Let p be s(3). What is the units digit of -1 - 10p/3? 9 Suppose 5z = -14 - 6. Let y be 65/(30/(-8)). Let q = z - y. What is the units digit of q? 4 Suppose -c + 2w + 3w = 23, 0 = w - 5. Suppose i - 3i + 22 = cz, -i + 56 = 4z. Suppose -5x + z = 0, -x - 1 = -2r + 10. What is the units digit of r? 7 Let a(d) = d*3 + 8d*2 - 3. What is the units digit of a(-7)? 6 Let w = 103 + 15. What is the units digit of w? 8 Suppose 0 = -3b - 45. Let l = b - -30. What is the tens digit of l? 1 Let d(l) = -l*2 - l + 4. Let x be d(5). Let z = -10 - x. What is the tens digit of z? 1 Suppose 0k = -5k - p + 61, k + 2p - 14 = 0. Let a be (6/(-4))/(k/(-16)). Suppose -o = o - a. What is the units digit of o? 1 Suppose p = l, 2l + 6p = p + 21. Suppose 42 = lx - 78. What is the tens digit of x? 4 What is the tens digit of ((-13)/13)/((-2)/146)? 7 Let i be (-40)/6(1 + -4). Let o(p) = p*2 + 15p + 17. Let m be o(-14). Suppose 4b = 3b + 5u - i, mb - 10 = u. What is the units digit of b? 5 Suppose 2i - 10 = 0, -2s - s - 4i = -104. What is the units digit of s? 8 Let k be (-2 - 0/2) + 2. Suppose -4n + kn = -32. Suppose 2x = u + 7, 20 = -4u + n. What is the units digit of x? 2 Let k(i) = i + 3. Let u be k(3). Let x = u + -16. What is the units digit of 2/x - 61/(-5)? 2 Suppose 5u - 4h + 0h = 22, 0 = -u - 2h - 4. What is the units digit of 1/(u/4)4? 8 Let h(w) = -w*2 - 8w - 1. Let u be h(-6). Let v be (2-1)/(4/(-6)). Suppose -u = -3y + 5a, 3y + 2y + va - 7 = 0. What is the units digit of y? 2 Suppose -5y = 4p - 20, 0 = -p - 3p. What is the units digit of y? 4 Let v be 4/12 - 26/6. Let j = v + 7. What is the units digit of j? 3 Let o(p) = -p2 - 10p + 4. Let v be o(-10). Let c = 4 + -1. Suppose -cd + 5i = -18, -5d + i = -4 - v. What is the units digit of d? 1 Let q = 273 - 124. What is the tens digit of q? 4 What is the tens digit of -1(-2 - -120)/(-2)? 5 Suppose -g + 12 = -5t, -4g - 12 = -7t + 2t. Suppose m = 2m - 14. Let d = g + m. What is the units digit of d? 6 Let z = -405 - -579. What is the tens digit of z? 7 Let g(w) = 7w*2 - 2w - 1. Let o be g(-1). Let u = o - 11. Let l = u + 6. What is the units digit of l? 3 Let q be 360/(-27)6/(-4). Suppose -15c = -qc + 210. What is the tens digit of c? 4 Let m(i) = 19i*2 - 8i - 22. What is the units digit of m(-3)? 3 Let s(k) = k*2 - 10k + 16. Let f be s(8). Let a(r) be the second derivative of r*3/6 + 4r*2 - r. What is the units digit of a(f)? 8 Let f = 7 - 6. Suppose s - 2 = -f. What is the units digit of s? 1 Suppose -3d - 564 - 972 = -5v, 4d = -4v + 1216. What is the hundreds digit of v? 3 Let i(z) = -39z + 11. What is the hundreds digit of i(-3)? 1 Suppose 2h = 2o + 167 - 17, -324 = -4h - 2o. What is the units digit of h? 9 Let w = 76 + -21. What is the units digit of w? 5 Let u = 18 - 18. Suppose -3z = 6 - 18. Suppose -i - 5t = -ui + 19, -zt = 5i + 11. What is the units digit of i? 1 Let a(u) = 10u*2 - 3u + 2. What is the units digit of a(1)? 9 Let m(u) = -u - 4. Let b(v) = -3v - 9. Let z(f) = 2b(f) - 5m(f). Let s = 5 - 10. What is the units digit of z(s)? 7 Suppose 0 = o + 3o. Let w(m) = -4m2 - 3m + 24. Let h(a) = a*2 + a - 8. Let y(f) = -7h(f) - 2w(f). What is the units digit of y(o)? 8 What is the hundreds digit of 1845/12 + (-3)/4? 1 Suppose 3j = -15, -h + j + 37 = h. Suppose -4w + 0 = h. Let i(f) = -5f - 6. What is the units digit of i(w)? 4 Let q(h) = -h - h + 3h + 3. Let y be q(0). Suppose yd - 6d = -6. What is the units digit of d? 2 Suppose 4j - 744 = 2j. What is the tens digit of (-4)/(-14) - j/(-21)? 1 Let f(a) = -a3 - a2 - 2a - 5. What is the units digit of f(-3)? 9 Let d = 10 - 12. What is the units digit of (-3)/d(12 + -10)? 3 Suppose -y + 3k = -20, -10 = -y + k + 2. What is the units digit of y? 8 Let h(o) = -9o. Let b be h(-1). Suppose 0 = bg - 7g - 50. What is the units digit of g? 5 Let g(k) = k2 + 3k + 5. Let o be g(-2). Suppose -2v + 3 = t, 2t - o = -v + 9. What is the units digit of t? 7 Let f(x) = -6x + 12. Let j be f(11). What is the tens digit of (-2)/9 + (-2280)/j? 4 Suppose 4 - 34 = -5y. Let b = 2 + -4. Let m = b + y. What is the units digit of m? 4 Let v be -33/(12/(-16)). What is the units digit of (v/(-10))/(6/(-135))? 7 What is the tens digit of 61 + 3 + -6 + 0? 5 What is the units digit of -1 - 27/((-9)/3)? 8 Let w = 115 - 66. Let r = 71 - w. Suppose 3v + 65 = 5k - 0v, -2k + r = -2v. What is the units digit of k? 6 Let u = -6 + 11. Let s = u + -8. Let k(g) = -g*3 - 4g*2 - 5g - 4. What is the units digit of k(s)? 2 Let q(h) = -h + 8. Let y be q(12). Let x = y + 15. What is the tens digit of x? 1 Let b(y) = 3y - 5y*2 + 0y*3 - 2y + 3 + y*3. What is the units digit of b(5)? 8 Suppose -5z = -0z. Suppose 4o = -zo - 32. What is the units digit of o/(-12) - (-10)/3? 4 Suppose 4l + 60 = 9l. What is the tens digit of 32/l62? 3 Suppose 4f + 5 = -15. Let q(g) = 2g3 - 7 - 9g + g - g*3 + 4g*2. What is the units digit of q(f)? 8 Let h(p) = p - 2. Let i be h(4). Let o be 0/(2/i-2). Suppose 0 = -u + 5d - 8, 0 = -2d - od + 4. What is the units digit of u? 2 Suppose 3g - 231 = 2g + 3k, 466 = 2g - 5k. What is the units digit of g? 3 Let p(n) = n*2 - 4n - 2. Let t be p(2). What is the units digit of 1-64/t? 4 Let y be 1(-1 - -2) - -2. Let o be (-3)/y - (-2)/2. Suppose o = -2d + 25 - 9. What is the units digit of d? 8 Let v(c) = 50c2 - c. What is the hundreds digit of v(2)? 1 Suppose -4r + q + 1287 = 0, 5r - 5q = r + 1299. What is the hundreds digit of r? 3 Let w(b) = 9b + 26. What is the units digit of w(7)? 9 Suppose -2d - 4 = -d. What is the tens digit of d/(-18) - (-4620)/108? 4 Let x(j) = j*2 - 3j + 6. Let g be x(4). Let n be 5/(g/(-24)) - 0. Let z = 17 + n. What is the units digit of z? 5 Let z be (-6 + 6)/(3 - 1). Suppose o + 3 = 0, 12 = 3s - zo + 3o. What is the units digit of s? 7 Let r = -19 - -20. What is the units digit of r? 1 Suppose -j = -4 - 4. Suppose 3b = 7b - j. What is the units digit of b - 3 - 7/(-1)? 6 Suppose -5f + 20 = 15. Let n(s) = 44s - 1. What is the units digit of n(f)? 3 Let y(t) = -4t - 14. What is the tens digit of y(-6)? 1 Let a(o) = o*3 - 2o*2 - 4o + 3. Let t be a(3). Suppose -29 = -s + 3n, -3s + n + 38 + 25 = t. What is the tens digit of s? 2 Let i = 11 + 1. Suppose i = h - 2. What is the tens digit of h? 1 Suppose -138p + 745 = -133p. What is the units digit of p? 9 Let n be 147 - (6 + (-3 - 1)). Suppose 2 = 2h, -5m - 5h = -0h - n. What is the units digit of m? 8 Let y(i) = -6i - 8. Let d be y(-6). What is the tens digit of (-114)/(-8) + (-7)/d? 1 Suppose 0 = -2m + 10, 3m + 0m - 16 = -s. Let o = 0 + s. What is the tens digit of 19/2 - o/(-2)? 1 Suppose 5y - t - 24 = 0, t = 3y + y - 19. Suppose 0 = -2f + 4p, 4f + 3p = y + 6. Suppose -3 + 37 = fc. What is the tens digit of c? 1 Suppose 8 = 5p - 2. Suppose -5q - 2b + 122 = 20, -pq + 2b = -52. What is the tens digit of q? 2 Suppose 0*z	{ "pile_set_name": "DM Mathematics" }
w many micrograms are there in 0.843082 milligrams? 843.082 What is 8.733786 centuries in months? 10480.5432 Convert 0.5515082 meters to millimeters. 551.5082 How many nanometers are there in 7/2 of a micrometer? 3500 How many micrometers are there in seven halves of a millimeter? 3500 What is 27/5 of a millennium in centuries? 54 How many nanograms are there in 41.19611 grams? 41196110000 What is 879.371 meters in millimeters? 879371 What is 4/75 of a century in months? 64 Convert 551.7048 millilitres to litres. 0.5517048 What is 13/4 of a year in months? 39 What is one fifth of a millennium in months? 2400 What is 18.10905 months in decades? 0.15090875 What is 7446.04ng in milligrams? 0.00744604 How many meters are there in 79.96555km? 79965.55 What is twenty-five halves of a kilometer in meters? 12500 Convert 97903.1 microseconds to seconds. 0.0979031 How many milligrams are there in 3/5 of a gram? 600 How many decades are there in fourty-eight fifths of a millennium? 960 Convert 138787.7 micrometers to millimeters. 138.7877 What is 130.2511ml in litres? 0.1302511 Convert 742100.9nm to millimeters. 0.7421009 What is 0.7242689 tonnes in micrograms? 724268900000 How many days are there in 2277.99027 nanoseconds? 0.000000000026365628125 How many micrometers are there in 849.3315 centimeters? 8493315 What is 31/5 of a hour in minutes? 372 Convert 0.1862251 centuries to millennia. 0.01862251 What is 122080.4 centuries in millennia? 12208.04 Convert 17528.17 hours to minutes. 1051690.2 How many millilitres are there in 67/5 of a litre? 13400 How many weeks are there in 6.5132361 days? 0.9304623 How many milliseconds are there in eleven eighths of a minute? 82500 What is one fifth of a hour in seconds? 720 How many millimeters are there in seven halves of a meter? 3500 How many years are there in eleven tenths of a century? 110 What is 46/5 of a millimeter in micrometers? 9200 What is 46/5 of a gram in milligrams? 9200 What is 13/5 of a centimeter in millimeters? 26 What is 11/2 of a century in decades? 55 What is five quarters of a litre in millilitres? 1250 Convert 495.6209 micrograms to tonnes. 0.0000000004956209 What is thirteen fifths of a kilogram in grams? 2600 How many millilitres are there in one fifth of a litre? 200 How many millilitres are there in 31/2 of a litre? 15500 What is 1/5 of a litre in millilitres? 200 Convert 90236.41 hours to milliseconds. 324851076000 What is one fifth of a meter in millimeters? 200 What is 24.1108434 microseconds in days? 0.0000000002790606875 What is 0.4585568ml in litres? 0.0004585568 What is 1/4 of a tonne in kilograms? 250 How many millilitres are there in 47/4 of a litre? 11750 What is 31/5 of a hour in minutes? 372 What is 25/2 of a centimeter in millimeters? 125 What is nineteen quarters of a millennium in decades? 475 What is 13/4 of a microgram in nanograms? 3250 How many nanometers are there in 230229.1m? 230229100000000 What is 6120.78 millilitres in litres? 6.12078 Convert 832886.9 hours to minutes. 49973214 How many years are there in 179.02449 months? 14.9187075 How many litres are there in 349323.4ml? 349.3234 Convert 24.66204 millilitres to litres. 0.02466204 How many months are there in 47420.44 centuries? 56904528 Convert 33381.74l to millilitres. 33381740 Convert 6.137719 decades to millennia. 0.06137719 What is 7/3 of a year in months? 28 Convert 745.8282 litres to millilitres. 745828.2 Convert 0.7261673 milligrams to grams. 0.0007261673 What is 3/8 of a micrometer in nanometers? 375 Convert 3.6929466us to weeks. 0.0000000000061060625 How many centimeters are there in 83909.84 millimeters? 8390.984 What is three tenths of a tonne in kilograms? 300 What is 1/24 of a day in minutes? 60 What is 32/5 of a millimeter in micrometers? 6400 What is 1/10 of a litre in millilitres? 100 How many decades are there in 15049.5 centuries? 150495 What is 22696.026 months in centuries? 18.913355 What is 21/2 of a centimeter in millimeters? 105 What is 1/10 of a millimeter in nanometers? 100000 How many millimeters are there in 614.6195m? 614619.5 What is 0.389594mg in micrograms? 389.594 What is 198027.1 meters in micrometers? 198027100000 How many months are there in 1/24 of a century? 50 What is 27.21371mg in nanograms? 27213710 Convert 98.69827ns to microseconds. 0.09869827 What is 21/4 of a litre in millilitres? 5250 Convert 6489.982 decades to months. 778797.84 How many millilitres are there in 7.088762l? 7088.762 Convert 8497.754t to micrograms. 8497754000000000 How many meters are there in 16.62065um? 0.00001662065 How many meters are there in 3/10 of a kilometer? 300 What is 11615.88 meters in millimeters? 11615880 How many millilitres are there in 31589.3l? 31589300 What is fourty-five eighths of a milligram in micrograms? 5625 What is seven halves of a day in hours? 84 What is thirty-one halves of a litre in millilitres? 15500 What is 0.1951166 micrometers in nanometers? 195.1166 How many millilitres are there in 3/25 of a litre? 120 What is 760.5442 nanograms in milligrams? 0.0007605442 How many nanometers are there in 1/20 of a micrometer? 50 How many microseconds are there in 8/25 of a millisecond? 320 What is 9508.724m in centimeters? 950872.4 Convert 0.8996088g to milligrams. 899.6088 Convert 0.8103348 litres to millilitres. 810.3348 What is 17.10588cm in meters? 0.1710588 How many seconds are there in twenty-one halves of a hour? 37800 What is 3/50 of a second in microseconds? 60000 How many tonnes are there in 0.7484968kg? 0.0007484968 How many kilograms are there in 0.1114273t? 111.4273 Convert 542296.4 centimeters to micrometers. 5422964000 What is 17/2 of a litre in millilitres? 8500 Convert 377.2089 millennia to centuries. 3772.089 What is seven sixteenths of a kilometer in centimeters? 43750 How many millilitres are there in fifty-five halves of a litre? 27500 Convert 927.8701 meters to centimeters. 92787.01 Convert 186638.43 months to years. 15553.2025 How many decades are there in fifteen quarters of a millennium? 375 What is fourty-three quarters of a millimeter in micrometers? 10750 How many nanoseconds are there in 55.7303 hours? 200629080000000 What is 48822.58us in seconds? 0.04882258 What is one quarter of a litre in millilitres? 250 What is seven thirds of a minute in seconds? 140 What is 29/2 of a litre in millilitres? 14500 What is 1.0190073 months in millennia? 0.000084917275 How many millimeters are there in 1/5 of a meter? 200 What is 42.51396 centuries in months? 51016.752 What is 5/4 of a litre in millilitres? 1250 What is eleven quarters of a tonne in kilograms? 2750 What is 367462.3 years in centuries? 3674.623 How many grams are there in 72.72378ug? 0.00007272378 What is one sixteenth of a gram in micrograms? 62500 What is 6/5 of a centimeter in millimeters? 12 What is 21/8 of a meter in millimeters? 2625 What is 7808.824t in micrograms? 7808824000000000 What is 1/5 of a hour in minutes? 12 How many tonnes are there in 7839.472 grams? 0.007839472 How many grams are there in eighteen fifths of a kilogram? 3600 How many litres are there in 230.681ml? 0.230681 How many milliseconds are there in 80309.42 days? 6938733888000 What is 1/18 of a day in seconds? 4800 Convert 236.2733 grams to nanograms. 236273300000 Convert 94705.75m to centimeters. 9470575 How many centuries are there in 308.0173 decades? 30.80173 How many micrometers are there in thirty-seven halves of a millimeter? 18500 How many millilitres are there in fifty-one quarters of a litre? 12750 What is 4.164749um in kilometers? 0.000000004164749 Convert 66755.13 nanometers to kilometers. 0.00000006675513 How many millimeters are there in twenty-five halves of a meter? 12500 How many years are there in 4017.432 months? 334.786 What is 358.5956 litres in millilitres? 358595.6 Convert 47.5986 months to decades. 0.396655 What is 0.2958373 nanograms in tonnes? 0.0000000000000002958373 How many nanograms are there in 1.537543 kilograms? 1537543000000 How many millilitres are there in 9/10 of a litre? 900 How many kilometers are there in 336.7397 centimeters? 0.003367397 Convert 0.5323284 litres to millilitres. 532.3284 What is 6/5 of a kilogram in grams? 1200 What is 1/63 of a week in seconds? 9600 Conver	{ "pile_set_name": "DM Mathematics" }
+ 4 = i - 2g, 3i - g - 2 = 0. Suppose v + i = -p. Put 4, v, 0 in increasing order. v, 0, 4 Let l = -2.99 - 0.01. Let j = 4 + l. Let f = -0.31 + 0.01. Sort j, -5, f in ascending order. -5, f, j Suppose -5b - 3n - 27 = -5, 0 = -b - 2n - 3. Put 5, b, 3 in descending order. 5, 3, b Suppose -10t = -14t - 4. Let c = -1.1 - -0.1. Let f = c + 3. Put 2/9, f, t in decreasing order. f, 2/9, t Let t be (-2)/6 + (-171)/(-27). Suppose -a + 4 = -5g, 4g - t = 2a - 14. Let c(y) = -y*2 + 5y - 6. Let j be c(4). Sort g, j, -4 in decreasing order. g, j, -4 Let u(j) = -j - 5. Let g(k) = -4k - 19. Let q(d) = -4g(d) + 18u(d). Let n be q(-10). Let m be 15/n(-6)/(-3). Put 3, -5, m in decreasing order. m, 3, -5 Suppose -20 = -s - 0s. Suppose 0 = -4b + 2b + s. Put 1/5, -3/8, b in descending order. b, 1/5, -3/8 Let l(p) = -p2 + p + 2. Let t be l(4). Let b be 2/t - 9/5. Let u(v) = v - 2. Let h be u(2). Sort 3, h, b. b, h, 3 Let z(s) = -s2 - 3s + 2. Let v be z(-3). Suppose -2f + u = -3u - v, -5f - 6 = u. Let i = 23 - 27. Sort f, i, 0.1 in descending order. 0.1, f, i Let n = -0.26 + -0.74. Put n, -3, -2/19, 0.2 in descending order. 0.2, -2/19, n, -3 Let z = -3 - -3. Let t = z + 1. Put t, -4, 5 in descending order. 5, t, -4 Let l = 1 - -2. Suppose lv - 5 = 7. Suppose -7 = -k - 2. Sort k, -1, v. -1, v, k Let k be (-1)/6 + 455/(-42). Sort -2, -1, k in ascending order. k, -2, -1 Let k = 16.9 + -17. Put -2/11, -4, k, -0.07 in decreasing order. -0.07, k, -2/11, -4 Let j = -28 + 29.1. Let s = 2.9 + j. Let l = -1/39 - 4/13. Sort 1, s, l in ascending order. l, 1, s Let o be 4/(-14) - 37/(-7). Suppose 3n = 2d + 8, -3d + 8 = -od. Suppose z = 4t - 3t, n = -z + 2t + 5. Put 4, 3, z in ascending order. z, 3, 4 Let n = 7 + -6.93. Let q = n - -0.03. Put -2, -1/4, q in descending order. q, -1/4, -2 Suppose -4 = 7v + 31. Let n be 14/4(-12)/(-42). Sort n, 3, v in increasing order. v, n, 3 Let f = -21 - -34. Let a be f/3 - (-4)/6. Let c = 10 - a. Put 0, -3, c in decreasing order. c, 0, -3 Suppose 8 = -4n - 4. Suppose 2f - 3x = 0, f + 5x = -4f. Sort -4, n, f in decreasing order. f, n, -4 Let p be (-2 + -1 - 48/(-27)) + 1. Put -2/19, -4, p, 3 in increasing order. -4, p, -2/19, 3 Let z = -9 - -15. Put 4, 2/9, z in increasing order. 2/9, 4, z Let o be 16/(-42) + (-2)/(-3). Let b = -26 - -53. Let s = b + -28. Sort s, -3/4, o. s, -3/4, o Let r be (2/4)/(77/14). Sort 1, -2, r in increasing order. -2, r, 1 Let d be (2/(-6))/((-8)/(-6)). Suppose 5l - 4 = 21. Let m be 1/6(-20)/l. Sort d, m, 0 in increasing order. m, d, 0 Let l be (-2)/(3/6 + -3). Let i = 5.3 + -6. Let k = 0.4 + i. Sort -5, k, l in ascending order. -5, k, l Let d = -4 - -15. Let o = 6 - d. Put o, -2, 0.1 in decreasing order. 0.1, -2, o Suppose 0 = -5m + 10. Suppose 5j - 4z = 1, j + mj + 2z = -17. Let k be (j/(-4))/((-1)/(-4)). Put k, 4, -4 in decreasing order. 4, k, -4 Let x(o) = -3o - 2. Let m be x(-2). Let r be 1((-20)/(-1))/m. Sort 5/4, r, 0.1. 0.1, 5/4, r Suppose -2r = -4m + 2 - 22, 4m + 28 = 4r. Put m, -2, 4 in descending order. 4, -2, m Let x = 5 - 0. Let l = x - 4. Suppose 2d + l = 5f + 4d, 0 = 5d + 10. Sort -1, f, -4 in decreasing order. f, -1, -4 Let k be -1 + (4 - -63/(-6)). Suppose -6 + 0 = -2u, 8 = -5h + u. Sort h, k, -14 in decreasing order. k, h, -14 Let f = 11 - 6. Let b = -844/4521 - -2/411. Sort f, -3, b in decreasing order. f, b, -3 Let k(b) = -b*3 - 4b*2 - 2b - 4. Let a be k(-4). Suppose -23 = -3i + 2x + 3x, 2i + ax + 14 = 0. Put 3, i, -4 in increasing order. -4, i, 3 Suppose -3o - 2a = 19, -2a = 3o - 2o + 13. Sort o, 0.2, -1/11. o, -1/11, 0.2 Suppose c - 9 = -6. Let a(f) = -f + 7. Let y be a(5). Put y, -2, c in ascending order. -2, y, c Let c(g) = g*2 - 7g. Let u be c(7). Suppose -4m = 10 - 6. Put -5, m, u in descending order. u, m, -5 Let t = 24 - 27. Let q be ((-1)/t)/(12/180). Put 0, q, 4 in descending order. q, 4, 0 Let p = -126.2 - -126. Sort -1/17, p, 0 in decreasing order. 0, -1/17, p Suppose 46 = 2i - 5w, 0 = w + 4. Sort i, -5, 5, -4. -5, -4, 5, i Suppose -12 = -4t + q, -7t + 3t - 3q = -12. Let z = -1 - t. Let b(u) = -u2 - 3u + 4. Let v be b(-4). Put -3, z, v in increasing order. z, -3, v Let f = -4 + 0. Let u be (-3)/f - 23/4. Put 3, u, -2 in descending order. 3, -2, u Let d = -42 - -38. Put 1, d, 0 in descending order. 1, 0, d Suppose -9w + 5w - 20 = 0. Put -2, w, 1 in increasing order. w, -2, 1 Let y = 6.1 - 7.1. Sort -5, 0.5, y, 12 in descending order. 12, 0.5, y, -5 Let m = -171/905 - 2/181. Put 14, -5, m in ascending order. -5, m, 14 Let g be (1 - 0)(0 + -5). Suppose -3n = 9, -2n + 3 = -p - 5. Let l = p - -14. Sort l, g, 5 in decreasing order. 5, l, g Let m(i) = i3 + 4i*2 + 2. Let p be m(-4). Suppose -2t = -p + 10. Sort 5, -3, t in descending order. 5, -3, t Let t = -3.9 + -0.1. Sort t, 0, -0.1 in ascending order. t, -0.1, 0 Let o = -5 + 0. Suppose 2w - 5w = -4u - 6, 4w - 8 = 5u. Sort o, -4, w. o, -4, w Let p(j) = j + 5. Let z be p(-4). Suppose -z = -i + 1. Sort 1, i, 5 in descending order. 5, i, 1 Suppose -2k + 5 + 3 = -h, -k + 26 = 5h. Suppose -3 + k = -w. Put -1, -4, w in increasing order. -4, w, -1 Let z(w) = w3 - 3w - 1. Let b be z(-2). Let n be 1 - 0 - 18/3. Put 5, b, n in descending order. 5, b, n Let w be (2/(-3))/(6/(-45)). Let b = -1 - -5/2. Put b, -0.2, w in decreasing order. w, b, -0.2 Let o be ((-3)/9)/((-2)/6). Let t be (-2 + 1)(o + 0). Put 0, 0.2, t in ascending order. t, 0, 0.2 Let x = 0 - 0.5. Sort x, -0.1, 5. x, -0.1, 5 Let z = 17.7 - 17. Let d = z + -0.9. Put d, 2/3, -0.04 in ascending order. d, -0.04, 2/3 Suppose -3w = 4z + 20, 3w - w = -2z - 10. Sort z, -6, 5. -6, z, 5 Let z = 38 + -38. Let q = 4/5 - 53/60. Sort q, z, -0.5 in ascending order. -0.5, q, z Let w be (-1)/2 - (1 - 35/28). Sort -3, w, 14/3 in descending order. 14/3, w, -3 Let b be 58/(-265) - 2/(-5). Let j = b - -1/53. Let q = -1/4 - -7/12. Put j, 0.5, q in increasing order. j, q, 0.5 Suppose -5j = 7 - 32. Suppose -6t - 3 = -jt. Let u be (-2)/2(-2)/(-9). Sort t, 2, u in decreasing order. 2, u, t Let b = 19 - 20. Let p(z) = -2z*2 + 2z. Let c be p(2). Let k(s) = -s - 1. Let n be k(-1). Put c, b, n in ascending order. c, b, n Let c be (-9)/(-15) + (-4)/(-10). Suppose -2x + 3 = c. Suppose -2k = -6, -5h = 5k - 3k - 31. Put h, x, 0 in decreasing order. h, x, 0 Let k be (7/21)/((-1)/6). Put k, 2, -4 in decreasing order. 2, k, -4 Let r be ((-58)/(-28) - 2)/((-4)/24). Let v = -3.2 - -3. Sort v, -0.1, r in decreasing order. -0.1, v, r Let a = 0.55 - 0.05. Put a, 5, 6, -5 in ascending order. -5, a, 5, 6 Let r = -0.018 - -0.218. Suppose 4o - 9 = 11. Sort o, -1/6, r in descending order. o, r, -1/6 Suppose -w + 4w = -9. Put 6, w, 5 in increasing order. w, 5, 6 Let a(i) = -i + 8. Let t be a(6). Let d(h) = -2 + 1 + th + 0h. Let c be d(-1). Sort -2/11, 5, c. c, -2/11, 5 Let j be ((-5)/(-25))/((-8)/(-4075)). Let z = -102 + j. Put z, 0, -0.5 in descending order. 0, z, -0.5 Let a = 3 - 0. Suppose l - al - 4 = 0. Sort l, 5, -3. -3, l, 5 Suppose 4w - 17 = 19. Suppose v - w = -2v. Sort -5, v, 4. -5, v, 4 Let k = 25 + -26. Let m = 1 - 1.1. Let r = m - -0.2. Put r, 0.3, k in descending order. 0.3, r, k Let k be -1(2 + (-6)/3). Suppose k = -2n + 6n - 4. Let w be ((-14)/12)/1 + n. Sort 3, 3/2, w in descending order. 3, 3/2, w Let b be 2/5 + 54/(-10). Let u = 0.13 + 0.17. Sort 0, u, b in decreasing order. u, 0, b Let l be (-64)/84-3 + 2/(-7). Put 4, l, 1, 1/9 in decreasing order. 4, l, 1, 1/9 Let s = -13 + 12. Sort 1, s, -9 in increasing order. -9, s, 1 Let z = -0.36 - -0.04. Let f = z - -0.02. Sort -2/13, f, -4. -4, f, -2/13 Let p = -26 + 25. Sort -0.13, 5, p in descending order. 5, -0.13, p Suppose -3t - 16 = 2. Let r be (-5)/6-4 + 1/(-3). Sort 0.5, t, r in increasing order. t, 0.5, r Let v be 5(-2)/6(-8 - -5). Put 3, 6, v in descending order. 6, v, 3 Let x(t) = t*2 - 8t + 3. Let a be x(6). Let k = -460 + 460. Sort -3, k, a in increasing order. a, -3, k Suppose 0 = -0j + 4j - 4s + 12, 0 = -4j - 5s + 33. Put -2, -1, j in ascending order. -2, -1, j Suppose 3y - 3 = 9. Sort y, -2, 2 in descending order. y, 2, -2 Let x(o) = -o*3 + 4o**2 - 1. Let f be x(4). Sort 2, 0, f in decreasing order. 2, 0, f Let	{ "pile_set_name": "DM Mathematics" }
2 + 2) - 0). 4 What is (-32 - -27) + 1 + 0? -4 5 - ((-4 - -4) + -5 + 12) -2 What is 1 + -3 + 5 + -3 + 1? 1 What is 0 + 0 + 3 - (10 - 11)? 4 What is 7 - (2 - 3 - -4) - 0? 4 Evaluate -10 + 4 + 1 + (0 - -2). -3 81 - 92 - (-6 - (-4 + 2)) -7 Calculate (4 - 18) + 16 + -8. -6 What is the value of -3 + (13 - 0 - (-38 + 40))? 8 What is the value of -6 + -5 + 15 + -2 + -2? 0 Calculate (3 - (1 + 2) - -4) + 1. 5 What is 5 + (3 - 0) + -2? 6 -65 + 76 + -16 + -1 -6 What is 4 - (4 - 0 - (8 + -5))? 3 Calculate 0 + 3 - (-8 - -11). 0 -4 + (-1 + 0 - (-11 - -5)) 1 -23 + 25 + -2 + 2 + 1 3 2 + -7 + 7 - 11 -9 Evaluate 3 + (4 + -4 - -1) + 1. 5 What is -6 + 4 + 1 + -1? -2 1 - ((2 - -2) + -3) - -4 4 What is the value of -8 + 3 - (5 + (-1 - 16))? 7 What is the value of 10 + -5 - (-1 - -4)? 2 Evaluate 1 + 0 + (-10 - -6). -3 What is the value of (4 - -3 - (-2 - -14)) + 4? -1 -4 + 12 + -4 + (0 - 5) -1 What is 4 + -1 + 1 + -8? -4 Calculate (-15 - -6) + 10 - (2 - -1). -2 2 - (5 + -1 + 1) - 2 -5 What is (-2 + 1 - 0) + (1 - -2)? 2 Calculate (1 - 6) + -17 + 13. -9 (-7 - (-8 - 0)) + -4 -3 What is 2 + 2 + -6 - 0? -2 What is -11 + (-7 - -5 - -11)? -2 What is 6 + (-7 - (-4 - (-12 + 3)))? -6 What is the value of 0 + (1 - 3) + (-11 - -18)? 5 What is -4 - ((-2 - -1 - -5) + -9)? 1 -5 - -19 - 6 - 9 - -5 4 0 + -13 + -31 + 38 -6 Evaluate 20 - 5 - (-5 - (-6 + -6)). 8 What is -9 + 12 + -3 + -3? -3 What is the value of 10 - (1 - -2 - -2)? 5 What is 1 + (-7 + 1 - -3) - 0? -2 -2 + (-7 - 0) + 9 0 What is the value of 19 + (-5 - (17 - 11))? 8 Evaluate 13 + (-15 - (-8 + 0)). 6 What is (-2 - -12) + -5 + -3? 2 (20 - 18) + -11 + (-2 - -2) -9 Evaluate 5 + (-4 + 1 + 1 - -2). 5 -6 + 8 - (-4 + 7) -1 Calculate -4 + (3 - 5 - -11) + 1. 6 Calculate (0 - (0 - 1)) + -6. -5 Evaluate 5 + (1 - (-3 + 12)). -3 Calculate -4 - -7 - (7 + 0 - 0). -4 6 + -3 + (-1 - -1) + -2 1 What is the value of -1 + (7 + -27 - -12)? -9 Calculate -26 + 25 - (-6 + 1) - 5. -1 -3 + -1 + 6 + 7 9 Evaluate -4 - (-1 - (-1 + -2) - 1). -5 Calculate 2 + -1 - (-2 + (-4 - -11)). -4 What is (-3 + 4 - -1 - 3) + -1? -2 Evaluate -22 - -13 - (0 - 3) - -5. -1 What is (0 - (-2 + 13)) + 9 + -8? -10 Evaluate 6 - (3 + 0) - 0. 3 What is the value of 0 - -4 - ((16 - 5) + -6)? -1 -5 + 0 + 2 + 2 -1 What is -2 + 0 + 26 + -18? 6 1 - (0 - -1) - -3 - 4 -1 Calculate (5 - (-2 + 5)) + -5. -3 Calculate (10 - 4 - 3) + 3 + -1. 5 Evaluate 3 - (-4 + (-1 - -2) - -11). -5 What is the value of (-12 - -18) + 7 - 12? 1 Calculate (2 - -1) + (7 + -6 - 1). 3 3 - 4 - 3 - -1 -3 What is the value of (8 - 12) + 3 + -1? -2 Calculate 10 + (-1 - 4) + 0. 5 Evaluate -3 + -6 + (12 - 5) - -8. 6 What is the value of 5 - (11 + 8) - -8? -6 Evaluate -3 + (-1 + -2 - -5 - -3). 2 What is the value of 9 - (4 + -2 - (11 + -8))? 10 Evaluate 7 + -2 - (-3 - -6). 2 What is -2 + (-13 - -7 - -11)? 3 Calculate -1 - (1 + -3 - -2 - 6). 5 What is -3 + (-6 - -6 - -3) - 0? 0 Calculate 8 + 0 - (11 + -2). -1 Evaluate (-2 - (0 + (6 - -2))) + 4. -6 -4 - (-6 + 4 + -3) - 2 -1 What is -3 + -4 + 0 + 0 + 2? -5 -2 - (3 - (0 + 0)) -5 8 + (5 - 3) - 19 -9 Calculate -6 - (8 + (2 - 14) - 3). 1 What is 1 + 6 + -5 + (0 - 1)? 1 What is the value of 6 - (-1 + -2 - -6) - -1? 4 Calculate 1 - (7 + (-14 - -4)). 4 Evaluate 1 - 9 - (4 - 15). 3 Calculate -7 + 1 - (-66 - -63). -3 What is the value of 3 - (-11 - -4) - 2 - 3? 5 -5 + 6 + 0 + -6 -5 What is the value of -5 + (5 + -4 - -3)? -1 3 + (0 + -7 - (-8 - 0)) 4 What is 2 - -1 - (-6 + 7)? 2 Evaluate 2 + -1 + (-8 - 7) + 8. -6 What is -2 - (-16 + (-6 - -17))? 3 What is 2 - (-1 + -4 + 0 + 5)? 2 What is -3 + 1 + -3 + (0 - 0)? -5 Evaluate ((5 - 4) + -4 - -1) + 5. 3 Evaluate 11 + 14 + -20 + -5. 0 Evaluate (-8 - (4 + 1 + -10)) + -1. -4 What is the value of (2 - 2) + 3 + -4? -1 Evaluate -2 + (4 + 4 + -3 - 4). -1 Calculate -5 + (1 - 2 - -2) + 3. -1 1 + (3 - 4) - 2 -2 Evaluate -3 - (2 + -8 + 5). -2 Evaluate 5 - (0 - (-4 - 0)). 1 What is the value of 12 + 8 + -6 + -10? 4 Calculate -3 + (0 - -7) + -9. -5 Calculate -2 - ((4 - (0 + 2)) + -1). -3 Evaluate 0 + 2 + 0 + -26 + 25. 1 Evaluate -2 + 1 + (-20 - -19). -2 What is the value of 5 + (1 - (3 - 2))? 5 Evaluate -18 - -20 - (2 - 0). 0 Calculate -2 - (-3 - (2 + -1 + 2)). 4 What is the value of 5 - (-10 - (9 - 26))? -2 What is (-1 - 3 - 0) + 8? 4 Calculate (-13 - (11 + -22)) + 5. 3 What is the value of 1 + -2 + (2 + -2 - -6)? 5 What is 4 + ((-4 - -3) + -7 - -3)? -1 What is the value of -16 - (-8 - 8 - -8)? -8 Evaluate (-2 - 0 - 2) + 4 - 3. -3 What is 35 + -30 + -1 + (1 - 1)? 4 What is the value of 4 - (8 + 1 + -6)? 1 Calculate 1 - (-4 - (-8 - -5 - 3)). -1 -13 + (-7 + 22 - 9) -7 What is 4 + (-12 - (1 - 6) - -4)? 1 5 + 2 + -2 - 7 -2 What is the value of (0 - (0 - -3) - -2) + -4? -5 Calculate 18 + -20 + (-1 - 3 - 0). -6 What is the value of 7 - 21 - -12 - (-1 + -1)? 0 What is the value of -6 + (0 + 4 + 2 - 4)? -4 What is the value of -1 + -8 + 42 + -25? 8 -11 - (8 + -35) - 14 2 What is 3 - (8 + 0 - -1)? -6 13 - 22 - (0 - 4) -5 Calculate 1 + -5 + (31 - 32). -5 Calculate -3 - 5 - (1 - 9). 0 What is the value of 1 + -2 - (-7 - (-19 + 12))? -1 Calculate -2 + -2 + -2 + -2 + 10. 2 Calculate -8 + (4 - 9) + 8. -5 3 - 0 - (4 + -6) - 3 2 What is (-2 - (-3 + (-4 - -2))) + -3? 0 (1 - (0 + 4)) + -1 + 0 -4 What is -1 - -6 - (2 + (11 - 1))? -7 What is 2 + 5 + 0 - (-37 + 41)? 3 What is (-8 - -1) + 0 - -2? -5 What is -13 - -9 - (-10 + 5)? 1 What is -6 - 4 - -11 - (2 + 0)? -1 What is the value of (-2 - -5) + 0 - -4? 7 0 + 0 + (-8 + 9 - 3) -2 Evaluate -4 + 9 - (7 - 6). 4 Evaluate (-5 - 0 - -3) + 5. 3 Evaluate 7 + -4 - (1 - -1). 1 Calculate 11 - 10 - (-1 - 4). 6 (-5 + 6 - 5) + 8 + 1 5 8 + (-7 - 0) + (-2 - -1) 0 What is 13 + (-12 - 11 - -6)? -4 -3 + (-1 - -19) + -8 7 Evaluate 11 + -8 - (1 + 2) - 3. -3 Evaluate -8 + (4 - (-8 + 14) - 0). -10 Calculate (-10 - -8) + 4 - 2. 0 What is the value of -6 - 1 - (-38 + 35)? -4 Evaluate (-6 - -2) + (-1 - -1) - -3. -1 3 + -7 + 1 + 17 + -16 -2 What is 8 + (-9 - (0 - 4)) + -7? -4 What is the value of 0 - (-1 + (1 - -6))? -6 Calculate (2 - 1) + (5 - 1). 5 Evaluate -3 + 5 + -2 + -3. -3 What is (-1 - -1) + 3 + (0 - 0)? 3 What is the value of 2 + (12 - 2) + 3 + -9? 6 Evaluate -4 + -3 + 4 - (-2 - 2). 1 (17 - (28 - 11)) + 0 + -6 -6 What is (0 - -3) + (-1 - 3)? -1 What is the value of (-2 - -2) + (-9 - -4) + -1? -6 6 + (2 - (6 - 3)) 5 5 - 1 - (-11 + (-6 - -22)) -1 (8 - 6) + -32 + 22 -8 6 - -1 - (11 + (13 - 15)) -2 What is (7 - 5) + (3 - 1)? 4 What is (12 - (23 - 11)) + 8? 8 4 + -5 + 0 + -3 -4 Calculate 7 - (-5 + (3 - (8 + -11))). 6 Evaluate -2 + 4 + -9 + 0 - -2. -5 What is -2 + (1 - (-1 + 1 + 5))? -6 What is 2 - 3 - (31 + -34)? 2 What is 3 - (4 - (7 - 3))? 3 What is (-1 - 0) + 8 + -16? -9 Calculate (-2 - 1) + -8 + 13. 2 What is -5 - (8 - 11 - 5)? 3 What is the value of -3 + (7 + 0 - (12 + -12))? 4 Calculate 4 - (-1 + -5 + 11 - 4). 3 What is the value of -5 - -1 - (4 + -6) - 1? -3 What is 1 + -5 + (-5 - -8) + -4? -5 Calculate 3 - 0 - (8 + (-14 - -6)). 3 -8 + 1 + 9 + -11 -9 (6 - (8 + -2)) + -6 + 2 -4 Calculate (-8 - -8 - 10) + 5. -5 What is the value of 2 + (1 - (2 + -2 + 0))? 3 Calculate 6 + (5 - (4 + -1)). 8 (89 - 78) + (-5 - 0) 6 Evaluate 0 + -2 + (10 - (6 + 1)). 1 What is (-7 - -12 - 1) + -2 + 2? 4 What is 0 + 1 + (-4 - 5) + 4? -4 Calculate 6 + (-13 - (4 + -3)). -8 What is 5 + (-1 - 5) - (1 - 0)? -2 (3 + -4 - 3) + -16 + 15 -5 What is -12 + -6 + 8 + 8? -2 Evaluate 3 - -4 - -1 - 8. 0 Calculate 10 + -1 + -5 - 9. -5 -19 - (-2 + -19 + 7) -5 Calculate (0 - 1 - 3) + (10 - 2). 4 1 - (6 + -4 - 2) 1 0 + 4 + -2 + -5 -3 Evaluate (2 - 2) + (0 + -1 - -1). 0 What is the value of 7 + (-12 - (5 - 10)) - 4? -4 -14 - -7 - 3 - -10 0 Calculate 6 - (14 + -6 + -3). 1 What is the value of 1 - (0 + 0) - (3 - 3)? 1 What is -10 + 3 - (0 + -1 + -13)? 7 Evaluate (4 - (-2 + 5 + 5)) + 1. -3 What is the value of -2 + 7 - (-1 + (8 - 8))? 6 Calculate 0 + 5 + (0 - 2). 3 What is the value of (-4 - -6) + 8 + (-5 - 0)? 5 -5 + 5 + (0 - (3 - 3)) 0 3 - 5 - (1 - 2) -1 -1 + -3 - (8 - 18) - 4 2 Evaluate 0 - 2 - (-4 - (3 + -4)). 1 Evaluate -5 - (-4 - (7 + -3)). 3 What is (2 - 6) + 2 - (-1 + -1)? 0 What is 6 + 4 + (-10 - -5) + 0? 5 What is 3 + (1 - (-1 - -10))? -5 What is (1 - 6) + (-15 - -7 - -9)? -4 What is (0 - 3) + (-9 - (5 + -22))? 5 What is the value of 1 + -3 - -5 - (-5 + 8)? 0 Cal	{ "pile_set_name": "DM Mathematics" }
-5d - 0 - b. What is the units digit of 51/12 + 2/d? 4 Suppose 0d - 112 = -2d - 2n, -4d + n = -204. Suppose -2x - d = -6x. What is the tens digit of x? 1 Suppose t - 2t + 67 = 0. Suppose -2k - 23 = -q, 3q - 4k - t = -0k. What is the units digit of q? 1 Suppose -5i + 4m = 5m + 13, m - 5 = 4i. What is the units digit of (-261)/(-27) + i/(-6)? 0 Let j be 1(0 + 9/1). Suppose 13 = -3b + u - 1, 0 = b - 2u + 13. Let t = j + b. What is the units digit of t? 6 Suppose -3k + h + 487 = 0, -k = h + h - 160. What is the hundreds digit of k? 1 Suppose 4i = 2o - 3o + 29, -3o - 3i + 42 = 0. Suppose p + o = 13. What is the units digit of p? 4 Let q(k) = k3 - 5k*2 + 5k + 10. What is the tens digit of q(7)? 4 What is the units digit of (7/4)/(4/784)? 3 What is the hundreds digit of 1(28/10)/(1/50)? 1 Suppose 2c - 4q = -q + 9, -2q = 4c - 10. Let g be (-66)/(-7) + 3/(-7). Let d = g + c. What is the tens digit of d? 1 Suppose z + 2 = 2n - 2z, 0 = -5n + 5z + 10. What is the units digit of -3 + (3 - (n - 42))? 8 Suppose 0 = -3s - j + 497, -2s + 5j + 244 = -93. What is the units digit of s? 6 Let c(d) = 4d - 4. Let t be c(2). Let j(v) be the third derivative of v6/120 - v5/20 - 5v*3/6 + 2v2. What is the tens digit of j(t)? 1 Let h(c) = c2 - 2 + c + 3c + 4. What is the tens digit of h(-6)? 1 Suppose 3m = 2v + 424, 2m + 11v - 292 = 10v. What is the hundreds digit of m? 1 Let m be 1/2 + 34/(-4). Let x = m + 5. Let w = x + 9. What is the units digit of w? 6 Suppose -w - x + 253 = 0, 3w - 1220 = -2w + 4x. What is the units digit of w? 8 Suppose 4n - 50 = 122. What is the units digit of n? 3 Suppose 5s - 10 = 0, 4p - p + 10 = 5s. Suppose -3o = -ph + 4h - 3, 2h + 5o + 9 = 0. Let i(d) = -d*3 + 4d*2 - d - 4. What is the units digit of i(h)? 2 What is the tens digit of (-3 - (-454)/(-6))(-3)/2? 1 Suppose 0 = 4w - v + 3v + 84, 0 = 3w + 4v + 68. Let g = 1 - w. What is the tens digit of g? 2 Let p = 138 + -92. Let c be 2 - -1p - 0. Suppose c = 6t - 2t. What is the tens digit of t? 1 Suppose -4800 = -22r + 10r. What is the units digit of r? 0 Let h(y) = 2y*2 + 21y - 5. What is the tens digit of h(-12)? 3 Suppose 0 = 4o + 4, 3o + 40 = k. What is the units digit of k? 7 Suppose 5f - 3f - 9 = -5r, r - f = -1. Let c = r - 0. What is the tens digit of c/(-3)-151? 1 Let t(q) = 2q + 7. Let y(d) = d + 3. Let b(g) = -3t(g) + 7y(g). What is the units digit of b(4)? 4 Let n(j) = j*2 + 4j + 6. Suppose 3y - 4 = 2. Suppose ya - 2 = 2z + 2, 2a + 8 = -z. What is the units digit of n(z)? 6 Let c be (-1)/(42/15 + -3). Let b(v) = 7v + 1. What is the tens digit of b(c)? 3 Let x = 0 - 5. Let i(j) = -4j + 2. What is the tens digit of i(x)? 2 What is the units digit of (44/16)/(1/28)? 7 What is the tens digit of 3104/12 + (0 - 0)? 2 Suppose -7 = 2t - 2c + 1, 5c - 18 = 4t. Let a = 14 + t. What is the units digit of a? 2 Let t be 110/3 + (-26)/39. Let d = -21 + t. What is the units digit of d? 5 Let h(w) = w2 - 4w + 4. Let o be h(4). Suppose 0 = -g - og + 60. What is the units digit of g? 2 Let x(z) = -z3 - z2 - z + 3. What is the tens digit of x(-4)? 5 Let b(h) = -h + 26. What is the units digit of b(0)? 6 Let t(k) be the third derivative of -k5/60 + 7k4/24 - k3/6 + k*2. Let b be 2/(-9) + (-168)/(-27). What is the units digit of t(b)? 5 Suppose -13 = -4h - 5m - 6, -13 = -3h + 4m. What is the units digit of h? 3 Let n(k) = 0 + 3 + 4k*2 + k - 3k*2. Let b be n(0). Let l = b + -2. What is the units digit of l? 1 Let j = 32 + 46. What is the tens digit of j? 7 Suppose 4c + 4v = -12, -3c - 19 = -5v + 14. What is the units digit of (6/(-9))/(1/c)? 4 Let x(y) be the first derivative of y3/3 - y2 + y - 1. What is the units digit of x(4)? 9 Suppose -7m = -14m + 2450. What is the units digit of m? 0 Let j be (5/2 - 3)96. Let a = 90 + j. What is the units digit of a? 2 Let p be (3/60)/1. Suppose p = 5d + 25, -4d - 68 = -7q + 3q. What is the tens digit of q? 1 Suppose h - 5 = b, 3b = -3h + 1 + 2. Suppose 0 = 3r - h - 9. What is the units digit of r? 4 Let u(p) = -p*2 - 8p - 7. Let v be u(-6). Suppose -5q + 10 = -0q + 4f, 0 = vq + 5f - 5. What is the units digit of (-3)/q4/(-1)? 2 Let v(p) = -12p + 11. What is the units digit of v(-5)? 1 Suppose -v = -2v + 7. Let i = 6 + v. What is the units digit of i? 3 Let b = 578 + -243. What is the tens digit of b? 3 Let a(q) = q*3 + 7q*2 + 4q. Let l be a(-6). Let r be ((-2)/(-6))/(2/l). Suppose 9 = ri - i. What is the units digit of i? 9 Suppose 5w + s - 190 = 0, -w + 3s = -27 - 27. What is the units digit of w? 9 Suppose -10 + 46 = 4t. Suppose -2v + t = 1. Suppose 0 = vp + 5s - 12 - 13, 0 = 2p - 5s - 5. What is the units digit of p? 5 Let m = -259 + 386. What is the tens digit of m? 2 Let k(z) = 9z + 3. Suppose x - 2c = 9, c - 9 = -2x + 2c. What is the units digit of k(x)? 0 Let s be (-1)/2 - 140/(-8). Let t = 26 - s. What is the units digit of t? 9 Suppose -11 = -u - 4. Let l = 14 - u. Suppose -5b + 22 = l. What is the units digit of b? 3 Let b = 2 + 3. Suppose -ba = -8a + 72. What is the units digit of a? 4 Let n(m) = -4m2 - 7 + 2m*2 + 3m*2 + 0m*2 - 3m. What is the tens digit of n(6)? 1 Let v be (-50)/18 - (-4)/(-18). Let g be 5/26/v. Let m = 9 + g. What is the units digit of m? 4 Let z(c) = c2 - 6c + 2. Let w be (-4)/(-10) - 140/(-25). Let g be z(w). What is the units digit of g/(-2) - (3 - 12)? 8 Let u = -119 + 198. What is the tens digit of u? 7 Let p(x) = 2x - 3. Let y be p(-9). Let n = y - -29. What is the units digit of n? 8 Let t(g) = g2 + 6g + 1. What is the tens digit of t(-10)? 4 Suppose -u = 3s - 33, 3u + 5 = -4. What is the units digit of 4/s - 20/(-3)? 7 Let a = 239 - 129. What is the units digit of a? 0 Let j(x) = -5x2 + 3x + 7. Let v(z) = 4z2 - 4z - 6. Let w(i) = -3j(i) - 4v(i). What is the units digit of w(7)? 3 Suppose 0c - 16 = -2c. Suppose -c - 2 = -2l. What is the units digit of l? 5 Let a = 4 + 2. Suppose -ac + c = -15. What is the units digit of c? 3 Suppose 4 = 6t - 2. What is the units digit of t - (-2)/(-4)-6? 4 Suppose 3u + 29 - 200 = 0. What is the units digit of u? 7 Let h(u) = -u3 + 3u*2 + 7u - 3. Let s(a) = -4a3 + 11a*2 + 27a - 11. Let y(f) = 9h(f) - 2s(f). What is the units digit of y(6)? 3 Let m be ((-3)/2)/(6/(-8)). Let l(t) = -t - m + 2 + 4. What is the units digit of l(-4)? 8 Suppose -2f = -p + 72, -3f = -5p + 90 + 263. Let c = p - 50. What is the units digit of c? 0 Suppose 4t = -4g, -5g + 3g + 18 = -4t. Let a be (2/3)/((-4)/(-42)). Let c = a - g. What is the units digit of c? 4 Suppose -2y - 22 = t, -2y + 0y - 4t - 34 = 0. Let i be y/(-6)(-16)/(-6). Suppose -6 = -b - 2a, 0b - i = -2b + 4a. What is the units digit of b? 4 Let a be ((-2)/(-4))/((-2)/28). Let x(b) = -7b - 11. What is the units digit of x(a)? 8 Let q = -14 + 7. Let y(w) = -w*3 - 2w*2 + 4w - 7. Let i(t) = -3t3 - 7t*2 + 12t - 21. Let m(z) = 4i(z) - 11y(z). What is the tens digit of m(q)? 1 Let s(j) = -j*3 + 5j*2 - 3j - 4. Let a be s(3). Let l = a - 5. Suppose l = 3o - 5 - 13. What is the units digit of o? 6 Suppose 3r + 28 = v - 0v, -3v + 78 = -3r. What is the units digit of v? 5 Let q be -2 + -1 - -2 - -11. Suppose -w + 2b = -q, 2 = -w + 3b + 16. What is the units digit of (8/3)/(w/3)? 4 Let m = 3 + 3. Suppose 0 = r + 3y + m - 58, -143 = -4r + y. What is the units digit of r? 7 Let g(d) = -d3 + 7d*2 + 7d - 6. Let m be g(8). Let z = m - -6. Let c(b) = b*2 + 5b - 11. What is the units digit of c(z)? 3 Let x(p) = p*2 - 6p. Let c be x(6). Suppose -v - 1 + 2 = 0, 3u - 4v - 11 = c. Suppose f = 5 + u. What is the units digit of f? 0 Let z = 5 - 15. Let u(c) = -c*3 + 10c*2 + 14c - 13. Let p be u(11). Let w = z + p. What is the tens digit of w? 1 Suppose 755 = -2v + 7v. What is the units digit of v? 1 Suppose -l - 2 = -0. Let h(f) = -f*3 + 2f. What is the units digit of h(l)? 4 Let i(u) be the third derivative of u*4/24 + 5u*3/6 - 3u*2. What is the units digit of i(5)? 0 Let l be ((-10)/3)/1-18. Suppose -4t = -0t - l. What is the tens digit of t? 1 Let h be 9*((-2)/2)/(-3). Suppose -	{ "pile_set_name": "DM Mathematics" }
-4, -0.4, d, y Let a be (-2)/((-2)/8-2). Suppose -5q = 5v - 62 + 17, -v + 2q - 3 = 0. Suppose -19 = u + vt, 5u - 2t + 0 = 13. Sort a, 5, u in decreasing order. 5, u, a Let b(t) = -t3 + 4t*2 - 3t - 4. Let p be b(5). Let u = -45 - p. Put -3, u, 4 in decreasing order. 4, u, -3 Let n be (4/(-8))/((-1)/2). Let d be (n/(-3))/(12/(-144)). Suppose 3v + q - 9 = 0, -v + dq - 3 = -2v. Sort -3, -4, v. -4, -3, v Let b = 1075 + -1078. Sort 1/6, 0.07, 0.3, b in decreasing order. 0.3, 1/6, 0.07, b Let t = 14 - 12. Let m = t + 0. Let i = -3.33 + -0.67. Put i, m, -0.4 in increasing order. i, -0.4, m Let m be (3 + 0)((-56)/147)/8. Put -1, m, -5, -2/7 in increasing order. -5, -1, -2/7, m Let f(q) = q*3 - 31q*2 - 63q - 97. Let j be f(33). Let v = 3 - 6. Sort j, -4, v, 5 in increasing order. -4, v, j, 5 Let u = -0.5 + 0. Let k(p) = -1 - 175p2 - 2p*3 + 156p2 + p3 + 0p3. Let x be k(-19). Put -2/5, u, x in ascending order. x, u, -2/5 Suppose -6d + 4d = 0. Suppose -16 = -12f + 8f. Sort 3, d, f. d, 3, f Let k be (-2)/6 - (102/(-18) - -6). Put k, -5, 2/3 in descending order. 2/3, k, -5 Suppose 142j - 152j = -20. Sort 5, -2, j, -5 in ascending order. -5, -2, j, 5 Let w be (-7)/(-39) - (-24)/156. Let y = 31.2 - 31.4. Put -0.05, w, -3, y in descending order. w, -0.05, y, -3 Let u(i) = 2i3 - i2 + i - 1. Let j be u(1). Suppose 50 = 2c - 4s, -5s = 3c - 22 + 2. Suppose cm - 75 = -0m. Put j, 4, m in increasing order. j, 4, m Let a = 4 + 27. Let u = -63 - -36. Let w = u + a. Sort 4/5, w, -3 in increasing order. -3, 4/5, w Let v be 2((-533)/123)/((-2)/(-3)). Put v, -3, -1, 4 in descending order. 4, -1, -3, v Let v be (-648)/900(-10)/(-3). Put 0.1, v, 0.4 in descending order. 0.4, 0.1, v Let y = 17.4 - -0.6. Let s = y - 17.8. Sort 3/2, s, -0.3. -0.3, s, 3/2 Suppose 267v + 418 = 229v. Let n(y) = y2 - y - 3. Let l be n(3). Let w = -2 + l. Sort v, 0, w. v, 0, w Let f(t) = t3 + 6t2 + 5. Let m be f(-6). Suppose -7l + ml = -4l. Sort -5, l, 6, -4/7 in decreasing order. 6, l, -4/7, -5 Let d = 12.6 - 12.7. Sort -1, 2, -1/5, d. -1, -1/5, d, 2 Suppose -4l = 3a - 2 + 3, l = -2a + 6. Sort l, 3, 23. l, 3, 23 Let p be 0 + (0 - -56)/4. Suppose -4q - p = -5y, y - 2y - 2 = 4q. Let r = -1 + -3. Sort r, -2, y in descending order. y, -2, r Let b = -0.129 + 57.129. Let t = -26 + b. Let c = t - 28. Put -3, -2, c in increasing order. -3, -2, c Let h be 2/1 + -24 + -5. Sort h, -2/5, -0.5, 5. h, -0.5, -2/5, 5 Let c = -5239 - -5265.63. Let t = 0.63 - c. Let b = 26 + t. Sort 2/5, b, 4 in increasing order. b, 2/5, 4 Let i = 0.01 + -5.01. Let u = 14 - 12.3. Let v = u - 1.4. Sort 4, v, i in descending order. 4, v, i Let w be (27/2 - 1/2) + -4. Suppose 3z + wv - 5v = -57, 2z + 5v + 38 = 0. Put 4, 2, z in ascending order. z, 2, 4 Let t = 0.00284 + -27.31084. Let v = 0.592 - t. Let z = 28 - v. Put 8, z, 1/4 in decreasing order. 8, 1/4, z Let d(c) = -c3 - c2 - 4c + 2. Let u be d(0). Put 7, u, 4, -9 in ascending order. -9, u, 4, 7 Suppose -3n - 4h = 44, -26n + 4h = -23n + 4. Sort -5, 3, -6, n in increasing order. n, -6, -5, 3 Let y = -121/6 - -20. Suppose -4r + 2q = r + 5, -r + 11 = 2q. Let g = 0.47 + -0.48. Sort r, g, y. y, g, r Suppose n - 25 = -4n. Let p = n - 2. Let y = p + -3. Sort 2/15, 1/2, y in ascending order. y, 2/15, 1/2 Suppose h + 2h = 6. Suppose 0 = -102o + 68o - 68. Let x = 8 + -12. Sort h, x, o. x, o, h Let y(b) = 4b + 115. Let z be y(-30). Let k = -5 + 10. Sort 0.4, k, z. z, 0.4, k Let h = -72 + 72. Let s = h - -4. Let m = 2.3 - 2. Put 0, m, s in increasing order. 0, m, s Let r(m) = m*2 + 4m - 27. Let k be r(-8). Let u(o) = o*3 + 1. Let t be u(0). Suppose 3s = s. Sort s, k, t in descending order. k, t, s Let o be (15/6 - 2)8. Suppose 10 = -6z - 8. Let p be (-4)/4 + (-6 - z). Put o, 5, p in ascending order. p, o, 5 Let d be 6 - ((-1650)/(-24))/11. Let y = -7 - -2. Sort -0.03, y, d in descending order. -0.03, d, y Let r = -0.6 + 0.3. Let a = 23 + -15.7. Let i = a + -7.7. Sort r, -2/25, i in decreasing order. -2/25, r, i Suppose -2k - 3v - 8 = -2v, -3k - 5v = 5. Let c be 3616/304 - (-2)/19. Put c, k, -3, -2 in descending order. c, -2, -3, k Let b = -6 + -2. Let k = 264.4 + -256. Let v = k + b. Sort -1/2, v, -0.1 in decreasing order. v, -0.1, -1/2 Let z be 14 + -13 + 4/(-3). Sort z, 0, 2/11, 2. z, 0, 2/11, 2 Let w = 0.12 - -0.28. Let m = -140 - -139. Sort w, -2, -29/4, m. -29/4, -2, m, w Let n be (-2 - 2)3/3. Let d = 67 + -113. Let z be (-8)/44 - d/11. Sort -2, z, n in decreasing order. z, -2, n Suppose -i + 114 - 104 = 0. Suppose 0 = 4f + i + 2. Suppose 3t = w - 4, -2t + 4w = 9w - 3. Sort 0, f, t in descending order. 0, t, f Let i = 267.1 + -267. Sort 2/5, i, 31 in decreasing order. 31, 2/5, i Let i be (12/9)/((-11)/(-132)). Put 3, 4, 2, i in descending order. i, 4, 3, 2 Let b = 4174 - 4106.96. Let k = b - 71. Let u = 0.04 - k. Sort u, -3, -0.05 in descending order. u, -0.05, -3 Let i = 2 - 3. Let o = 263/77 + -36/11. Let r be (-2)/11(-3 - -2). Sort i, r, o in decreasing order. r, o, i Suppose 4a - 5t + 25 + 7 = 0, 6 = 2a + 3t. Sort 0, a, 21, 1. a, 0, 1, 21 Let b = 230.6 + -231. Put b, 0.3, -5, 2/11 in ascending order. -5, b, 2/11, 0.3 Let y = 46 - 39. Let v be (-6)/(-24) + y/(-20). Sort 2, v, 0.1. v, 0.1, 2 Let x = -341 - -319. Sort x, 0.3, -2 in descending order. 0.3, -2, x Let f = -30 + 31. Let o = f - -4. Suppose -2u = -4l - 8, 2u + 3u + 16 = l. Put -0.5, o, l in descending order. o, -0.5, l Let n = -157 + 1103/7. Suppose 2l - 6 = g, -3g = -l - 2l + 18. Put n, -0.5, g in increasing order. g, -0.5, n Let w = 13 + -13. Let r be 1/(-5) - (-8)/(-110). Let c = -20/33 - r. Put w, 2/5, c in ascending order. c, w, 2/5 Let l = 134 - 139. Let w = 15 + -11. Suppose 2s + 2a + 0a - 8 = 0, -ws + 3a + 9 = 0. Put s, -1, l in increasing order. l, -1, s Let m = -74.74 + 74. Let n = m + 0.24. Put 0.5, -3, n in decreasing order. 0.5, n, -3 Let g(z) = 18z + 35. Let a be g(-2). Suppose 4c - 21 = w, -3w = -c - 2w + 3. Suppose f = 6f. Sort f, a, c in descending order. c, f, a Suppose x + 2 = o - 3, 0 = -4o + 5x + 21. Suppose 2a = -2a - 3z + 21, oa = 3z + 27. Sort 4, a, 3. 3, 4, a Let j = -2 - -6. Let z(y) = -20 - 4y + y + 6. Let t be z(-5). Sort j, t, -12. -12, t, j Let p = 378 + -383. Sort p, -2/15, -1. p, -1, -2/15 Let n = -2 + 7. Let f = -6 + n. Sort -3, f, -2 in decreasing order. f, -2, -3 Let h be (-4 + 11)/((-2)/4). Let x be -2 - (1 - (-46)/h). Sort 0.5, x, 3/8 in increasing order. x, 3/8, 0.5 Let k = 37 + -38. Suppose -3o - 3r = -3, 0 = o - 3o + 2r + 10. Sort o, k, -4 in decreasing order. o, k, -4 Let g = -1.111 + 1.311. Put 0.3, -20, g in decreasing order. 0.3, g, -20 Let o be (-2 - 12/(-8))(-2 + 4). Sort -0.2, o, 1. o, -0.2, 1 Let b be (-2 - -4)/((-4)/(-14)). Suppose -bt = -3t. Sort t, 6, 1, 3. t, 1, 3, 6 Suppose 0 = 14017g - 14004g - 416. Sort g, 3/2, -0.2 in ascending order. -0.2, 3/2, g Suppose 4f + 34 = 3s, 18 - 60 = -5s + 3f. Let x be (-16)/(-12) + 2/(-6). Sort x, -5, s, -3. -5, -3, x, s Let p(i) = 99i + 687. Let n be p(-7). Put 2/13, 11, n, -2 in descending order. 11, 2/13, -2, n Suppose -61u + 24 = -55u. Sort -1, 0, u, -2 in ascending order. -2, -1, 0, u Let g(p) = -2p3 + p2 + 15p - 19. Let a be g(-3). Let m(s) = 7s. Let t be m(-1). Put 5, a, 0, t in ascending order. t, a, 0, 5 Suppose -5s + 4s + 5 = -2q, 2s - 10 = 0. Suppose q = -2x - x - 12. Let i = 88 - 89. Sort x, 0, i in increasing order. x, i, 0 Let s = -1814 + 5440/3. Let u = -3 - 1. Let p = u - -6. Sort s, -4, p in descending order. p, s, -4 Let s(r) = r3 - 2r - 46. Let p be s(0). Sort -5, 1, p in descending order. 1, -5, p Let u = -0.49 + -0.05. Let z = u - -0.65. Sort 0.3, z, -4/3 in increasing order. -4/3, z, 0.3 Let t = 53 + 61. Let q be 8/(-44) - t/(-22). Put q, -3, 2, 3 in descending order. q, 3, 2, -3 Let z = 233 - 158. Let o be ((-6)/z)/((-36)/(-20865)). Let k = 93/2 + o. Sort 0.5, k, -3/5 in descending order. 0.5, k, -3/5 Let n(l) be the third derivative of 1/120l6 + 3/2l*3 + 0 + 5l*2 + 0l + 3/8l4 + 2/15l*5. Let x be n(-7). Sort x, 5, 0 in ascending order. x, 0, 5 Let m = 30 + -152/5. Suppose -50r + 6 = -52*r. Sort 4, r, -0.02, m in decreasing order. 4,	{ "pile_set_name": "DM Mathematics" }
prime factors of 346493726? 2, 419, 413477 What are the prime factors of 440453639? 1033, 426383 What are the prime factors of 2188528378? 2, 109, 10039121 What are the prime factors of 4153853788? 2, 7, 1721, 86201 List the prime factors of 50244259. 13, 23, 197, 853 List the prime factors of 949694958. 2, 3, 29, 1819339 List the prime factors of 1008807225. 3, 5, 1361, 9883 List the prime factors of 541071349. 7, 13, 5945839 What are the prime factors of 2215725836? 2, 83, 307, 21739 What are the prime factors of 89051468? 2, 11, 31, 65287 List the prime factors of 32374611. 3, 3597179 List the prime factors of 5771640444. 2, 3, 131, 3671527 List the prime factors of 139387995. 3, 5, 79, 39209 What are the prime factors of 287187895? 5, 37, 1552367 What are the prime factors of 225750116? 2, 56437529 List the prime factors of 98546594. 2, 49273297 What are the prime factors of 1339913823? 3, 446637941 List the prime factors of 251019505. 5, 11, 29, 337, 467 What are the prime factors of 66541910? 2, 5, 17, 37, 71, 149 List the prime factors of 1448689840. 2, 5, 13, 383, 3637 List the prime factors of 166995225. 3, 5, 742201 List the prime factors of 3015643186. 2, 383, 577, 6823 List the prime factors of 9168342. 2, 3, 433, 3529 What are the prime factors of 2203638003? 3, 7, 34978381 What are the prime factors of 579672076? 2, 1523, 95153 List the prime factors of 84359833. 97, 869689 What are the prime factors of 84748948? 2, 379, 55903 What are the prime factors of 526556900? 2, 5, 853, 6173 List the prime factors of 692832713. 692832713 What are the prime factors of 61616275? 5, 7, 179, 281 List the prime factors of 51666217. 51666217 List the prime factors of 7977609. 3, 149, 661 List the prime factors of 2067466796. 2, 89, 883, 6577 What are the prime factors of 4199237041? 37, 113492893 What are the prime factors of 1056177371? 3373, 313127 What are the prime factors of 92768423? 11, 8433493 What are the prime factors of 637854462? 2, 3, 7, 14759 What are the prime factors of 485434299? 3, 7, 23115919 What are the prime factors of 539007050? 2, 5, 29, 127, 2927 What are the prime factors of 4571102042? 2, 13, 19, 9253243 List the prime factors of 264063836. 2, 83, 109, 7297 What are the prime factors of 812830822? 2, 41, 241, 41131 List the prime factors of 764673993. 3, 31, 913589 What are the prime factors of 98936924? 2, 113, 218887 What are the prime factors of 58633376? 2, 1832293 List the prime factors of 459453296. 2, 59, 181, 2689 What are the prime factors of 8317451163? 3, 7, 199, 1087, 1831 List the prime factors of 3020271737. 7, 4621, 93371 What are the prime factors of 227980727? 13, 17, 31, 107, 311 What are the prime factors of 94123075? 5, 3764923 What are the prime factors of 57816090? 2, 3, 5, 569, 1129 What are the prime factors of 8710669782? 2, 3, 483926099 List the prime factors of 6157728198. 2, 3, 97, 1867, 1889 What are the prime factors of 49092631? 7, 1361, 5153 List the prime factors of 40308084. 2, 3, 41, 9103 What are the prime factors of 153980512? 2, 7, 687413 List the prime factors of 2149777482. 2, 3, 29, 12355043 List the prime factors of 2335790013. 3, 778596671 What are the prime factors of 2233651052? 2, 167, 3343789 What are the prime factors of 965258420? 2, 5, 7, 127, 233 What are the prime factors of 596337018? 2, 3, 31, 103423 List the prime factors of 105532033. 4973, 21221 List the prime factors of 4629324. 2, 3, 7, 7873 What are the prime factors of 2643010197? 3, 59, 14932261 List the prime factors of 22839846. 2, 3, 3806641 List the prime factors of 283305376. 2, 79, 112067 What are the prime factors of 1208421932? 2, 23, 2441, 5381 List the prime factors of 96176589. 3, 491, 65293 List the prime factors of 418853315. 5, 1279, 65497 List the prime factors of 2828844964. 2, 11, 5844721 What are the prime factors of 37365135? 3, 5, 2491009 What are the prime factors of 449438647? 7, 64205521 What are the prime factors of 838687607? 19, 1847, 23899 What are the prime factors of 25186394? 2, 12593197 List the prime factors of 24878438. 2, 13, 173, 5531 What are the prime factors of 7735501079? 7735501079 What are the prime factors of 54512804? 2, 13628201 List the prime factors of 113956077. 3, 2309, 16451 What are the prime factors of 31922480? 2, 5, 399031 What are the prime factors of 3937545939? 3, 281, 4670873 List the prime factors of 3983374. 2, 53, 37579 List the prime factors of 995547375. 3, 5, 97, 3041 What are the prime factors of 112128011? 112128011 List the prime factors of 10631626. 2, 641, 8293 What are the prime factors of 10183180? 2, 5, 7, 10391 List the prime factors of 48813036. 2, 3, 4067753 What are the prime factors of 81505687? 19, 101, 42473 List the prime factors of 759472581. 3, 7, 23, 1572407 What are the prime factors of 7191738? 2, 3, 399541 What are the prime factors of 265606635? 3, 5, 7, 47, 107, 503 What are the prime factors of 1489492861? 30839, 48299 What are the prime factors of 2633759940? 2, 3, 5, 7, 6270857 List the prime factors of 720454119. 3, 7, 11, 3118849 List the prime factors of 70213651. 70213651 List the prime factors of 234429602. 2, 11, 2161, 4931 List the prime factors of 310280505. 3, 5, 20685367 List the prime factors of 468656892. 2, 3, 11, 1183477 What are the prime factors of 1349683935? 3, 5, 1279, 70351 What are the prime factors of 675485072? 2, 17, 113, 21977 List the prime factors of 1704777997. 13, 37, 3544237 What are the prime factors of 4253808547? 14983, 283909 List the prime factors of 699626847. 3, 2851, 81799 What are the prime factors of 148410002? 2, 13, 5708077 List the prime factors of 8790108. 2, 3, 732509 What are the prime factors of 1677446804? 2, 11, 191, 199601 List the prime factors of 268481003. 7, 1117, 34337 List the prime factors of 67146258. 2, 3, 11191043 What are the prime factors of 3412050300? 2, 3, 5, 3791167 List the prime factors of 28911966. 2, 3, 23, 9109 List the prime factors of 650670460. 2, 5, 11, 23, 128591 List the prime factors of 328817933. 19, 910853 List the prime factors of 142525625. 5, 11, 20731 What are the prime factors of 2293910338? 2, 1146955169 List the prime factors of 3788814376. 2, 6263, 75619 What are the prime factors of 937112192? 2, 7321189 What are the prime factors of 26622895? 5, 13, 19, 21557 What are the prime factors of 486849797? 7, 2281, 30491 List the prime factors of 3030353021. 37, 79, 223, 4649 List the prime factors of 1249359275. 5, 49974371 List the prime factors of 32702720. 2, 5, 29, 881 What are the prime factors of 260465849? 7, 29, 1283083 What are the prime factors of 1847007575? 5, 7, 19, 555491 List the prime factors of 55774257. 3, 7, 11, 83, 2909 What are the prime factors of 56960081? 17, 19, 176347 What are the prime factors of 2784255947? 11, 253114177 List the prime factors of 288565906. 2, 1979, 72907 List the prime factors of 16420254. 2, 3, 41, 66749 What are the prime factors of 820515163? 13, 63116551 List the prime factors of 310853317. 37, 1049, 8009 List the prime factors of 78597951. 3, 61, 429497 List the prime factors of 75568172. 2, 18892043 List the prime factors of 236744024. 2, 11, 31, 86783 What are the prime factors of 182055549? 3, 13, 19, 67, 193 What are the prime factors of 6531715? 5, 1306343 What are the prime factors of 106802245? 5, 11, 17, 103, 1109 List the prime factors of 46395364. 2, 313, 37057 List the prime factors of 91477360. 2, 5, 13, 87959 List the prime factors of 109397576. 2, 47, 131, 2221 List the prime factors of 110101515. 3, 5, 7340101 List the prime factors of 3268312000. 2, 5, 408539 List the prime factors of 267962423. 267962423 List the prime factors of 226364711. 226364711 What are the prime factors of 41275373? 41275373 List the prime factors of 655675595. 5, 131135119 List the prime factors of 100588892. 2, 25147223 List the prime factors of 220555645. 5, 44111129 What are the prime factors of 149289236? 2, 37322309 What are the prime factors of 273414627? 3, 61, 349, 1427 What are the prime factors of 557455984? 2, 1213, 28723 What are the prime factors of 714728294? 2, 7, 51052021 What are the prime factors of 245879930? 2, 5, 24587993 List the prime factors of 401804159. 67, 101, 59	{ "pile_set_name": "DM Mathematics" }
14j + 7 = -13j, 5j - 1 = 2h. Suppose -3n + n = 0. Solve n = -hv + 2m, 4m + 3 = 2v + m for v. -3 Let n = -20 - -20. Suppose 5u - 2q - 3q - 30 = n, u + 3q + 10 = 0. Solve v = 2s + 9, -4v = s + 11 - u for s. -5 Let x(p) = p2 + 2p. Let l be x(0). Suppose a + 15 = 4h, 6 = -lh - h - 3a. Solve -3q + 2 = -b + h, b - 8 = -4q for q. 1 Suppose 86n - 10 = 84n. Solve -7h + 3h - 2a - 24 = 0, 0 = -nh + a - 16 for h. -4 Let m be (-9 - 11) + -1 + 1. Let k = -1 + m. Let y be 16/7 + 6/k. Solve -5a + yq = q + 3, 2a + 2q = -6 for a. -1 Let d(n) = n + 4. Let t(z) = z2 + 4z + 3. Let r be t(-6). Let l = r - 19. Let p be d(l). Solve -s + 4v + 1 = p, 3 = -2s + 4v + 5 for s. 1 Let u be ((-48)/3)/(0 + (-2)/(-11)). Let v = u + 88. Solve 5 = -r - 3p, 2r + 4p + v + 4 = 0 for r. 4 Let z(w) be the first derivative of w*4/4 + 8w*3/3 + 2w*2 - 10w + 19. Let u be z(-7). Solve 4o = -2h + 10, 8o = 3o - 2h + u for o. 1 Suppose h = -h + 4. Let x(g) = -g2 - 7 - 1 - 1 - 15g + 0gh. Let b be x(-14). Solve 4u - 3q - 3 = 0, 2q = bu - 0q - 2 for u. 0 Let r be 0 + 4 - 8 - -82. Let i be (r/(-65))/((-4)/10). Suppose -4 = -h - 5s + 3, -5s + 5 = 0. Solve hl + 3l = io + 12, 5l = -2o + 17 for l. 3 Suppose 75l - 97l + 66 = 0. Solve -4k = -5m - 9 - 13, -9 = -k + lm for k. 3 Let j(o) = o*2 - 24o - 243. Let i be j(32). Solve -5d + 3g = 2, -i = 4d + 3g - 33 for d. 2 Suppose -a + 4b = -18, -11a + b = -14a + 2. Solve 2 = ar, r + 0 = 2l - 1 for l. 1 Suppose -4g - 9 = -7g, 2b - g = 27. Suppose 0 = -3j + b, 5o - 4j + j = -15. Let q be (o - 0/5) + 2. Solve a + 3z + 0z = -2, -4z + 14 = -qa for a. -5 Suppose k + 0k - 2 = 0. Let f = 383 + -381. Let a = f + k. Solve 2u - au - 8 = 0, -u = -v + 5 for v. 1 Suppose 0 = 2a + 4 - 12. Let x be (-4)/18 - (-40)/18. Suppose -2 - 2 = -xf. Solve an = 4y - 16, 5n + y - fy = 0 for n. 1 Suppose 3s + 1 - 13 = 0, 5s - 14 = 3y. Suppose -9 = -yn - 17. Let h be 0 - (-3)/((-6)/n). Solve 23 = ho - 3v, -o = -2o + v + 9 for o. 4 Let s = -1525 - -1533. Solve -4 = 3q - 4n, -5q + 1 = -sq + n for q. 0 Let s(m) be the second derivative of m3/6 + 17m*2/2 - 4m. Let t be s(-13). Suppose -h + th - 6 = 0. Solve 2j - 6p = -hp + 4, -3p = 5j - 10 for j. 2 Suppose 26r - 17 = 61. Solve -3i - 4c - 3 = 0, -5i + c - rc + 9 = 0 for i. 3 Let c(i) = i3 + i2 - 3i + 2. Let h be c(2). Solve -5r + 23 = 3t, r + 4t = ht for r. 4 Let i be 0 - (((-15)/3 - -1) + 1). Solve f - i = 5v, 5f - 4v = 1 - 7 for f. -2 Let p = 181 - 181. Solve p = 4x - 4v + 36, 3x + 0v + 7 = -2v for x. -5 Let o(k) be the third derivative of -k*5/60 + 5k*4/8 - 4k*3 + 16k*2. Let d be o(11). Solve -2p + 0 + 10 = 2s, 0 = p - 4s + d for p. 0 Let c = -4 + 6. Suppose 2z = j + cj + 7, 0 = 2j + 4z - 22. Suppose 0 = -7r + 8r - 2d - 5, 2d = -2. Solve 4u + 6 = 5p, -r - j = 2u - 3p for u. 1 Let h = -34 + 37. Suppose -4v + 4 + 3 = -hf, 3 = 5v + 2f. Suppose 3i - 22 = -v. Solve -i = 3y + 2r, 3y + 40 = -y + 5r for y. -5 Let b be ((-36)/(-14))/(3/14). Let m be 44/b + 2/(-3). Solve -5x + 4t = 1 - 15, -x = -t - m for x. 2 Let p be 12/(-14) - 425/(-35). Solve -5s - 3l - 13 = 0, pl - 1 = 3l for s. -2 Let x be (25/(-20))/((-3)/12). Suppose 2s - 4y = 17 + 3, -s - xy - 25 = 0. Solve 2o - 3i - 9 = 0, 0 = i + 1 - s for o. 3 Let r = 15 - 9. Let s be ((-1)/(-1))/(r/(-12)). Let k be (s - (-21)/6)2. Solve -f = kc - 8, 4f - 3c + 13 = -0c for f. -1 Let o = -184 - -188. Solve 3l + 2v = 3v + 4, 6 = -l + ov for l. 2 Let t(m) = 27m2 + 1. Let o be t(-1). Suppose -x = 12 - o. Let c = x + -14. Solve -3y - y = 4u, 5u + cy - 3 = 0 for u. 1 Let g be 37 + 1(-2 + 5 - 0). Let p = -36 + g. Solve 3c + p = -z, -2z + 4c + 2 = 10 for z. -4 Suppose 6b = 13b - 63. Solve -b = 3n + 8c - 11c, 2n - 3c + 6 = 0 for n. -3 Let j = 659 + -655. Solve 2s + 6l = 2l - j, s - l + 2 = 0 for s. -2 Suppose 0 = 27p - 189. Solve 0 = -3z + w + 4, p = -4z + 3w + 9 for z. 2 Let x = -317 - -322. Solve 12 = -3v + b, 0v - 5v - 20 = xb for v. -4 Let z(v) = 5v + 32. Let h be z(-5). Suppose -11 + h = -b, 2y + 5b = 28. Solve -2u = yr + u, r = 5u for r. 0 Suppose 86 - 23 = -b. Let k = -42 + 33. Let d be 2/k + (-203)/b. Solve -5g - dq + 10 = -0q, 2q = -4g + 6 for g. -1 Suppose 3x + k = 42, x - 4 = -3k + 2. Suppose 3q + 3i = 39, x = 4q + q - 5i. Let w be ((-1)/(-2) - 0)0. Solve 2 = -m + s, q = -m - wm - s for m. -5 Let m = 1 + 1. Let x(f) = f - 2. Let p be x(m). Let b(t) = 6t - 106. Let k be b(18). Solve 0 = -kz + i - 3, pz + i - 7 = 3z for z. -4 Let h = 43 - 39. Suppose 3 = 2p + 2m - 9, -hp = 3m - 29. Solve 5u - 2b + 18 + p = 0, 0 = -5u + 3b - 31 for u. -5 Let i(f) = 4f2 - 2f - 7. Let u be i(-5). Suppose 5o - u = o + 3s, 2s + 102 = 4o. Solve -5t + o = 0, 5n - 4t + 2t = -25 for n. -3 Let b(g) = -3g - 53. Let s be b(-19). Suppose 2r - 3l = -0 + 10, -r + l = -s. Solve 2t = -4k - 22, -23 - r = 5t + 4k for t. -1 Let o(a) = -a - 9 + 14 + 20a2 - a3 - 18a. Let u be o(19). Solve 9 = -x - uw, 2 - 9 = -3x + 2w for x. 1 Let z be 8/(-30)3-10. Solve -5i + q = 22, -z = i + 2i + 2q for i. -4 Suppose 0 = 4r - 9r + 40. Solve -3y - r = -2y - n, -24 = 5y - n for y. -4 Let b = -17 - -61. Let z = b + -42. Solve y - 3v = -3, -4 = zy - v + 2 for y. -3 Suppose -43 = -5b + 2. Let h = b + -6. Suppose 4v = hv + 6. Solve 5 = -5m + 4n - v, -n = -4m for m. 1 Let y(o) = -o*2 + 8o + 6. Let h be y(8). Suppose 0 = 2g - 4g + h. Solve 4 = -3v + 4m, 0v + 3v - g = -3m for v. 0 Let s(i) = i3 + 25i*2 - 56i - 49. Let q be s(-27). Solve 3j - 3b + 17 = -b, qj - b + 19 = 0 for j. -3 Suppose -c = -4p + 2, -2c = 2c - 2p - 20. Let u = -62 + 64. Suppose r + 4d - 4 = 0, ur + 3r + 2d - 2 = 0. Solve -g - a + 1 = r, 1 = 4g - 5a + c for g. 0 Suppose 0 = -4h - 4i + 32, -2h + 13i + 16 = 12i. Solve 3z = -4b + h, -5b + 4z - z = -10 for b. 2 Suppose -z - 5f + 17 = 0, 2z + 1 = 2f - 1. Solve 9c - 4c + 4m - 8 = 0, -c + m - z = 0 for c. 0 Let r = -16 - -22. Suppose rv - v - 125 = 0. Suppose -7 - 23 = -3p - 5h, -5h = 2p - v. Solve 0 = -j - 5m, -pj - 5m + 20 = -0m for j. 5 Suppose -5y = o - 17, -2y + 2o = -0 - 2. Suppose -5q + 5x = 0, 4 = -yq + 5x - 0x. Solve 5 = -h + i, -3h - 9 = -qh - 2i for h. -1 Suppose 0 = 5w - 43 + 158. Let p = 46 + w. Suppose 0 = -0c + 3c - 5y - p, y = c - 7. Solve 4 = -2q, 0 = -h - 3h - 3q - c for h. 0 Suppose j = -3j + 4, p - 4j = 0. Suppose pm + 7x - 2x = -20, 0 = -x + 4. Let v = m + 14. Solve 2f - 5d - 4 = -f, vd - 13 = -3f for f. 3 Let g = -848 - -834. Let x(l) = -2l - 5 - 3l + 4l. Let r be x(g). Solve 3h - 7 = 2a, 3h - 3a = -h + r for h. 3 Let c(k) = -k3 + 35k*2 + 38k - 69. Let i be c(36). Solve 2b + 10 = -2o + ib, 3b = 12 for o. -3 Let k(v) = v*2 + 2v - 7. Let y be k(-5). Let i = 10 - y. Suppose -2u = -10, -100 = iq - 5q - 5u. Solve 0 = 5d - q, 2d - 5d = -5l + 10 for l. 5 Let m(p) = -80p2 - 13p - 82p2 + 165p*2 + 8. Let c be m(4). Solve 2j = 6j + 5h - c, 0 = -4j + 4h + 4 for j. 1 Suppose -3b + 8 = 2z, -2z = -b - 5 - 3. Let o be 21/14(5 - 3). Solve 20 = s + os - 4q, -5s = zq - 7 for s. 3 Suppose 10r - 12r - 32 = -2h, r = 2h - 28. Solve -4q + 2f = 0, 2q + 7f + 8 = hf for q. 1 Let s = 15 - -85. Let y be (s/5)/4 + -3. Solve 0g - 5z = yg, -g - 4z - 3 = 0 for g. 5 Suppose -12m + 5m - 21 = 0. Let b(q) = q + 6. Let l be b(m). Solve -f - l = 2j, f - 1 + 5 = -j for j. 1 Suppose -4j + 2s = -312, -5j + 5s = -0s - 380. Let w = j - 80. Solve 0 = -t + 5c - 5, wc = c - 2 for t. 5 Suppose -35 = -26w + 19w. Solve -3n = 3y - 0y, wn + 9 = 4y for n. -1 Let r(u) = 2u2 - 2u*2 + 6u*2. Let z be r(-1). Solve -zh + 2h + 15 = i, -4h = -2i - 18 for h. 4 Let y = 56 + -56. Suppose -3 = 3p, -2b - 4p + 23 = p. Let r = -11 + b. Solve y = 3o - 3w - 6, -2w - 3 = -ro - 0o for o. -1 Let b = -360 + 353. Let q = 12 - 5. Let m = b + q. Solve m = 3p - 6, -r - 16 = -3p - 5 for r. -5 Let t be -3(-8)/(-6) + -6 + 12. Suppose -i + 2n = -ti + 12, -9 = -i - n. Solve 2k + a = -3a + i, 3a = -3k + 3 for k. -1 Let y be 4/1	{ "pile_set_name": "DM Mathematics" }
+ 3. Suppose 2v = -10, 10s + 1 = 13s + v. Give i(s). -1 Let h(m) = -4m*2 + 11m - 2. Let b(g) = -5g2 + 11g - 3. Let k(n) = 5b(n) - 6h(n). Give k(-9). 15 Let k(z) = -z + 16. Let s be k(11). Let y(g) = -3 - g - 1 - 4 - s. Calculate y(-8). -5 Let t(w) = -2w3 - 6w*2 + 7w - 2. Let r be -6 + (14/42)/((-2)/(-6)). Determine t(r). 63 Let a(l) = -9l - 5. Let v(u) = u2 - 10u - 29. Let x be v(12). What is a(x)? 40 Let x(u) be the first derivative of u5/20 - u4/4 + u*3/6 + 3u*2/2 - 18u - 2. Let s(w) be the first derivative of x(w). What is s(3)? 6 Let f = -41 + 50. Let j(x) = -x + 3. Let q be j(f). Let w(m) = m - 2. What is w(q)? -8 Let t = -136 - -138. Let u(v) = 0vt - 8v*2 - 40v + v*3 - 5 + 48v. Determine u(7). 2 Let s(q) be the second derivative of q6/720 + q5/40 - 5q4/12 + 7q. Let j(u) be the third derivative of s(u). Determine j(-4). -1 Let g(p) = -p*3 - 1. Let i(x) = 2x*3 - 6x*2 - 7x - 2. Let o(c) = -3g(c) - i(c). Let k(b) = 2b*2 - 68b - 5. Let z be k(34). Determine o(z). -5 Let t(v) = v*2 + 5v - 3. Suppose o - 24 + 17 = 0. Suppose 0 = u - 1 + o. What is t(u)? 3 Let v(z) = 3z2 + 16z - 15. Let o(t) = 2t2 + 11t - 10. Let b(h) = -7o(h) + 5v(h). Give b(-5). 5 Let i(c) be the first derivative of 2c2 + c - 4. Suppose -3r = 3n, -7n + 4r + 27 = -2n. Suppose 4o = 1 + n. What is i(o)? 5 Let h = 1103 - 1108. Let z(m) = -m3 - 6m*2 + 2m - 2. Give z(h). -37 Let n(h) = -2h2 + 8h - 2. Let u(o) = -o2 + 1. Let w(f) = -n(f) + u(f). Determine w(8). 3 Let q(y) = -y3 + 4y2 - 4y + 2. Let z(n) = 5n2 + 78n - 30. Let w be z(-16). Determine q(w). 2 Let i(n) = 3n - 21. Let c(s) = -6s + 38. Let j(r) = -4c(r) - 7i(r). Give j(-10). -35 Let m(c) be the first derivative of c*2/2 + 7c - 1. Suppose 139 = -16s + 27. Determine m(s). 0 Let x(r) = -r. Let h(f) = 7f - 6. Let d(w) = -h(w) - 6x(w). Let y = -62 + 68. Calculate d(y). 0 Let h(i) be the third derivative of -i6/120 - 3i5/20 + i4/24 + 3i3/2 + 11i*2. Suppose 2r + 24 = -2b, 3b = r + 4r + 36. What is h(r)? 0 Let l(a) = -5a - 1329 + 2658 - 1330. Give l(3). -16 Let h(s) = -5s3 + 4s*2 - s + 4. Suppose 14m = 17m + 9. Let l(d) = -6d*3 + 3d*2 + 3. Let n(o) = ml(o) + 2h(o). Determine n(-1). -8 Let r(c) be the first derivative of c4/4 + 9c + 306. Suppose 3w = 5w. What is r(w)? 9 Let x(b) = 3b3 - 6b*2 + 14b - 9. Let f(d) = -5d3 + 6d*2 - 13d + 10. Let s(v) = 2f(v) + 3x(v). Calculate s(-8). -7 Let z(a) = a*3 + 21a*2 - 20a + 49. Let k be z(-22). Let j(b) = 3b - 5. Give j(k). 10 Let r(t) = 84t*3 - 4t*2 + 92t*3 - 173t3 + 1 - t. Give r(-2). -37 Let j(k) = -k + 1. Let m(u) = u3 - 3u2 - 2u - 5. Let w be 6/10 + (-1449)/(-35). Let c be (w/(-9) + 4)-6. Let h be m(c). Calculate j(h). -2 Let n(f) = 2f - 3f + 4 - 11 + 0f. Suppose 5z + 30 = -0. Give n(z). -1 Let s be 2/(-9)-21 - (-1)/3. Let z(o) = -o*2 + 5o - 1. Calculate z(s). -1 Let t(j) be the third derivative of -43j2 + 0j*5 + 0j + 1/120j6 + 0 + 0j*3 + 1/24j*4. Calculate t(-2). -10 Let s(b) = -2b. Let h be s(-3). Let a(n) = -30n3 + 5n*2 + 2 + 4n + 61n3 - 32n*3 - 9. Calculate a(h). -19 Let x(f) = 11f - 5f - 17f. What is x(3)? -33 Let d(n) = n*3 - 2n + 2. Suppose 11r = -20r + 62. Determine d(r). 6 Let r(z) = -6z - 1. Let h be r(-1). Let c be (-18)/12-12. Suppose -5k + q + h = -3q, -k - cq = 18. Let m(l) = l*3 + 3l*2 + 2l + 1. Give m(k). -5 Let o(g) be the third derivative of -7g5/60 + g4/24 - g3/6 + 31g*2. What is o(1)? -7 Let g(p) = -51 + 61 - 15 + 14p. Determine g(5). 65 Let q be 6(-2 - (-32)/12). Let f(c) = -q + 4 + c2 + 12c - 6c. What is f(-6)? 0 Let x(t) = 139 + 6t2 + t2 + 6t - 2t2 + t3 - 136. Give x(-5). -27 Let d(l) = -7l + 1. Let m(g) = g. Let t(k) = k2 - k. Let n be t(-2). Let h(u) = nm(u) + d(u). Calculate h(2). -1 Let g(w) = -3w - 7. Let v = -1206 - -1204. Determine g(v). -1 Let h(d) = d - 1. Let r(o) = o. Let g = -5 - -1. Let a(x) = gh(x) - r(x). Let m = -6252 - -6256. Determine a(m). -16 Suppose -3u + 7q - 4q = 42, 5 = -q. Let i = u + 20. Let z(k) = 2k + 4 + i - 2. Calculate z(3). 9 Let f(j) = -5j2 + 2 - 6498j - 4j3 + 5j*3 + 0j*3 + 6500j. Let v(u) = -u3 - u2 - u - 1. Let m be v(-1). Suppose -z + 4 = -mz. What is f(z)? -6 Let c be -2 + (-1 - -31)/3. Let v be 4c - 9/(-3). Suppose -l - 10 = 4l + 4j, -5j - v = -5l. Let p(s) = s*3 - 3s2 + s + 2. What is p(l)? 0 Let o(g) = -g3 - 36g2 + 39g + 61. Let d be o(-37). Let m(i) = -i*3 - 12i*2 + 13i + 9. Determine m(d). 9 Suppose j - 2f + 0 = -7, 0 = -j + f - 4. Let s(v) = 61v - 7. Let i(n) = -9n + 1. Let b(q) = -14i(q) - 2s(q). Determine b(j). -4 Let p(v) = v2 + 44v + 286. Let g be p(-8). Let q(r) = -6r2 - 2r. Calculate q(g). -20 Let k(h) be the third derivative of h5/60 - h4/4 + 2h3/3 + 19h2. Let n(r) = -r - 1. Let l(t) = k(t) + n(t). What is l(7)? 3 Let o = -356 - -361. Let k(p) = -p3 + 5p2 + 2p. Give k(o). 10 Let x(w) = w*3 - 4w*2 - 6w - 1. Let r = -58 + 80. Suppose 25j = rj + 15. Calculate x(j). -6 Let j(d) be the second derivative of -4d3/3 - d2/2 + 10d. Suppose -4t - 12 = -0t. What is j(t)? 23 Let t(f) = -f*2 - 12f - 37. Let p be t(-4). Suppose -3k = 1 - 16. Let g(u) = -ku - 4 + 0u + 2u. Calculate g(p). 11 Let v(s) = -17s + 8. Let m(x) = -6x + 3. Let o be (-4)/3(-1 - -4). Let y(k) = ov(k) + 11m(k). Let d(z) = z2 + 10z + 2. Let n be d(-10). Calculate y(n). 5 Let a(g) = 7g - 11. Let m(s) = 6s - 10. Let r(x) = -4a(x) + 5m(x). Let o = -15 + 18. Suppose 4q = -i + 23, -oi = -4 - 5. Calculate r(q). 4 Let x(q) be the second derivative of q5/20 - q4/2 - q*3/2 - 5q*2/2 + 46q + 2. Calculate x(6). -23 Let h(y) = -7y - 3. Suppose 2r - 5 = 3. Suppose 4c = -r - 12. Determine h(c). 25 Let c = -3 + 0. Suppose u = 7 - 4. Let q(g) = 4g*3 + 5 - 1463g - 4 - ug3 + 1467g + 5g2. Give q(c). 7 Suppose 2h + 2h - 4 = 0. Let g(x) = 3x*3 + 2x*2 - 3x - 2. Let d(k) = k3 - k2 + k - 1. Let r(f) = hg(f) - d(f). What is r(-3)? -16 Let b = -20 - -25. Let p(x) = -2x*2 - 4 + 5x*2 - 8x*2 + bx + 4x2. Determine p(3). 2 Suppose -25j + 47j - 23j = 0. Let n(i) be the third derivative of 0 + 6i2 + ji - 1/12i5 - 2/3i*3 - 1/120i*6 + 1/12i*4. Determine n(-5). -14 Let q = 577 - 574. Let g(x) = 4x. Calculate g(q). 12 Let s(z) = 7z2 + 3z + 2. Let n be s(-1). Let q be 4/((-5)/(15/n)). Let t(g) = -g3 + g2 + g - 2. What is t(q)? 8 Suppose 0 = -y - 45 + 13. Let f = y - -28. Let h(x) = -x. Let r(s) = -s*2 + 5. Let n(t) = fh(t) - r(t). Give n(-5). 0 Let o = -360 - -354. Let p(a) = -a*3 - 5a*2 + 4a - 14. Give p(o). -2 Let a(f) = -8f - 6. Suppose -102t + 96t - 24 = 0. Determine a(t). 26 Let h(g) = -g - 8. Let m(i) = i2 - 16i + 30. Let z be m(13). Give h(z). 1 Let b = -63 + 68. Suppose 0 = -bn + n - 8. Let j(s) = s2 + 2s + 3. What is j(n)? 3 Suppose -14j + 7j = -14. Suppose -j - 8 = 10f. Let g(n) = 17n + 1. Determine g(f). -16 Suppose 2a = 4u + 8, -5u + 7 = -2u + 5a. Suppose 10 + 20 = 3y. Let l(p) = -2p2 - 1 - 6 - 2 + y. Calculate l(u). -1 Let w(n) be the third derivative of 5n4/24 - n3 + 61n2. What is w(-5)? -31 Suppose 2l - 96f = -91f - 26, 32 = -3l + 4f. Let c(t) = t + 27. What is c(l)? 19 Let p be (-45 + 3)(-7)/14. Let l = p + -19. Let a(k) = k2 + k - 2. What is a(l)? 4 Let v(f) = -2f*3 - 4f*2 - 7f - 14. Let p(g) = g*3 + 2g*2 + 4g + 7. Let k(r) = -11p(r) - 6v(r). What is k(-3)? 4 Let n(x) = -8x + 9. Let j(a) = -4a + 4. Suppose 3 = 2c + 3z, -c + 4c - 47 = 4z. Let b(t) = cj(t) - 4n(t). Determine b(1). -4 Let w(s) = -s*3 - 6s*2 + 3s + 5. Let z(n) = -3n3 - 11n*2 + 6n + 9. Suppose 10 = -5h + 3h. Let j(p) = hw(p) + 2z(p). Calculate j(7). 21 Let t(m) = -5m3 - 12m*2 + 5m - 27. Let u(n) = n3 + n2 - n + 5. Let o(i) = -t(i) - 6u(i). Give o(6). 3 Let q(g) = g - 1. Suppose 19 = 3p - 4v, 4p + 3v - 5 = -13. Let i(f) = 2f*2 + 9f - 4. Let j(d) = pi(d) - 5q(d). Give j(-4). 17 Let v(m) = m*2 + 4m + 3. Let f be v(-5). Suppose q = -f + 10. Let w(g) = 5 - 6gq + 4g*3 - 5g*3 - 3g - 3. Calculate w(-5	{ "pile_set_name": "DM Mathematics" }
2k2 - 3k*2)(2 + 1 - 1). -4k2 Expand (-4 - q + 4)(1 + 8q - 11q + 6q). -3q*2 - q Expand (-7 + 26 - 11)(-5 + 4 + 2)(-d + 2d - 3d). -16d Expand (v - 3v + 4v)(-4 - v + 4). -2v*2 Expand (5s*2 - 4s*2 + 15 - 14)(2s + 0s - s). s*3 + s Expand 0t*5 + 0t*5 - 4t*5 + (3t + t*4 - 3t)(4 + 2 - 4)(-4t + 2t + t). -6t5 Expand (-1 + 1 + 3 + 3 + 0 - 1 + (-1 + 1 - 2)(0 + 6 - 5))(0y*2 + 0y2 - y2). -3y2 Expand -6a*3 + 2a*3 + 0a + 2a + (-3a + 3a + a)(3a2 + a2 - 7a2) - a3 + a - a. -8a3 + 2a Expand 21c + 14c - 55c + (2c + 0c - 4c)(-2 + 2 - 1). -18c Expand (-2t2 + 0t2 + t2)(3 + 1 + 7). -11t*2 Expand (0w - 3w + w)((2 + 1 - 5)(-1 - 2w + 1) - w + 2w + 2w). -14w2 Expand (-1 - 2d + 1)(0d + d - 3d)(3d - 13d + 2d). -32d*3 Expand 34w*3 - 2w*4 - 28w*3 + 0w*4 - 2w*4 + 5w*4 - 4w*4 + 5w*4 - 2w*4 - 5w*4 + (-w - 3w + 6w)(2w3 + 0w*3 - 3w*3). -7w*4 + 6w3 Expand -p4 - 4p2 + 4p2 + (p3 + 2p3 - 2p*3)(-3p + 6p - p) - 2p4 + 0p4 + p4 + (4p3 + p3 - 4p*3)(-3p - p + 3p). -p4 Expand n3 + 4 + 2n + 1 - 2 + (4 - 4 - 2n*3)(-4 + 3 + 2) - 3n3 + n3 + n3. -2n*3 + 2n + 3 Expand (4 - 4 - 1)(0 + 0 + p) + 47p - 74 + 74. 46p Expand (0 + 2 - 3 + 3q)(-3 - q3 + 3). -3q4 + q3 Expand (-3t4 - 2t*4 + t + 3t*4)(0t + 5t + 2t). -14t*5 + 7t*2 Expand -5 - 5t2 + 5 + (-t + t + t2)(-2 - 2 + 2). -7t*2 Expand -2o*3 + 2o*3 + 2o3 - o3 + 4o3 - 9o3 + (o - o + o2)(0o - 3o + o). -6o*3 Expand ((3u + 0u - u)(5 + 1 - 4) - u + 3u - 3u)(u - 2u - u). -6u2 Expand 3 + 7u - 3 - 5 - u + 5 + (-6 + 3 + 1)(-2u - 2 + 2). 10u Expand (-2r*2 + 81r + 82r - 123r)(-1 - 2 + 1). 4r*2 - 80r Expand (5 - 6m - 5)(0m4 - 2m*4 + 0m*4) + 0m*5 + 0m*5 - 5m*5 + (2 - 2m*2 - 2)(0m3 + 0m*3 + 2m*3). 3m*5 Expand (-1 + 2 + 1)(-5i + 3 - 3) + 0i - 2i + 0i. -12i Expand (u2 + u2 - 3u*2)(-u + u + 2u2)(-6 + 5 - 4 - 5u). 10u*5 + 10u*4 Expand 9y*2 - 2y*2 + 15y*2 + (5 - 2 - 1)(-4y2 + 0y*2 + 2y*2). 18y*2 Expand (-3g*2 + 2g3 - g2 - 4g + 3g*2)(5 + 5 - 5). 10g3 - 5g*2 - 20g Expand 0r4 - r4 + 3r*4 + 2r*4 - 5 + 5 + (3r*2 - 3r2 + r2)(2r*2 - 5r*2 + 2r*2) + (6r*2 + 2r*2 - 7r*2)(2r2 + r - 2r + 2r). 5r4 + r3 Expand (-j + 5j - 2j)(-2j + 2j - j3 + (-j - j + 0j)(-j2 - j + j)). 2j*4 Expand ((0n + 2n - 4n)(3 - 1 + 0) + 2n + n - 2n)(2n - 3n - 2n). 9n*2 Expand 0k*3 + 0k*3 + 2k*4 + (1 - 1 + k)(-3 + 2k3 + 3) + k2 - 2k4 - k2 + (-5k + 0k + 4k)(5k3 - 3k3 + k3). -k*4 Expand (g + 1 - 1)(-18g + 24 - 24) + g2 - 2 + 2. -17g*2 Expand (2k + 4k - 4k)(2 + 0 - 3)(2k2 - 8k*2 - 4k*2). 20k*3 Expand (2 - 7 - 2)(6l4 + 5l*4 - 5l*4). -42l4 Expand (m2 + 6m2 + m2)(0m - 3m + 2m). -8m*3 Expand 5o*2 - 3o*2 + 0o*2 + (1 + 0 + 0)(-6o2 - 6o*2 + 6o*2). -4o*2 Expand (2h*2 - 2h*2 - 6h*2)(-5h - h + 5h) - 2h - 2h*3 + 2h + (-2 + 2 - 2h)(-2h2 + 2h - 2h). 8h*3 Expand -2 + 3b*2 + 2 + (0b - b + 2b)(-2b + 2b + 2b) - 6b*2 - 5b*2 + 3b*2. -3b*2 Expand (-s - 64s - 2s - 16s)(2 - s - 2). 83s*2 Expand 3x*3 - 4x*3 + 2x3 + (-x + x + x2)(-5x + x + 5x) + 5x*3 - 3x*3 + 0x*3 + 2 + 0x3 - x3 + 2x3 - x3 + 4x3 - x3. 7x3 + 2 Expand (-3z*2 + 2z2 - z2)(-3 + 0 + 0) + z2 + 0z*2 + 0z*2 + (1 - 1 - 2z)(0z + 2z - z) - 6z2 + z2 + 3z2 - 2z2 + z2 + 3z2. 5z*2 Expand (31 + 9 - 21)(0t2 - 2t - t*2 + 0t*2). -19t*2 - 38t Expand (4a + 5a + 3a)(-a + 0 + 0) - 2a2 - a2 + 5a2 + (a2 + 3a2 - 2a*2)(6 - 2 - 3). -8a2 Expand (3n + 2n + 2n)(-3 - 1 + 3)(0 + 2 - 1). -7n Expand (-2w + 4w - w)(-2w2 + 2w - 2w) + 1 - 8w*3 - 1 - 9w*2 - 8w*3 + 9w*2 + (0w - w + 2w)(0 - 2w2 + 0). -20w*3 Expand (-4f*2 + 4f2 + f2)(3 + 2 - 3)(3 + 3f3 - 3). 6f*5 Expand 5v4 + v4 - 5v4 + (2 - 4 + 0)(5v4 - 35 + 35) - v2 + 2v4 + v2. -7v4 Expand (-2 + 2r*2 - 3 + 0)(-r*2 + 3r*2 - 3r*2) - 4r*4 + 3r*4 + 0r*4. -3r*4 + 5r*2 Expand -2j*2 - 2 + 2 + (-j - 3j + 6j)(2j + 4j - 4j) + 0 + 2j*2 + 0 - 1 - 84j*2 - 80j*2 + 176j*2. 16j2 - 1 Expand (y2 + 3y2 - 2y*2)(3 - 3 + y)(4y + 2 - 2 - y + y + y + (2 + 5 - 5)(-y + y + y) + 2y - 3 + 3 - 2 + 2 - 2y + 5 + 2y - 5). 18y4 Expand ((u - u - u)(-u - 3u + 2u) - u*2 + 0u*2 + 3u*2)(10u3 + 27u - 27u). 40u*5 Expand ((2w + 2 - 2)(3 + 1 - 5) - w - 3w + 3w - 4w + 4w + w + 0 - w + 0)(-8 - 4 - 3w2 + w2). 6w*3 + 36w Expand (2 - 2 - 2m2 + 1)(0m + 0m - 5m3). 10m*5 - 5m*3 Expand (3g - g*2 - 3g)(-3g*2 - 2g + 2g) + 14g*3 - 7g*4 - 14g*3. -4g*4 Expand -4x*2 + 4x*2 - 3x*3 - 4x*3 + 2x*3 + 0x*3 + (2x*2 + 2x*2 - 7x*2)(4x - 4x - x). -2x3 Expand (-3w + 4w - 2w)(-131 + 131 + 55w). -55w2 Expand (5m - 2m - 2m)(0m - 2m + 8m). 6m2 Expand (0 + 1 + 0)(-4u + u + 5u) - 139 + 4u + 139 + u + 0u + 0u - 2 + u + 2 + (-1 + 0 - 1)(0u + 0u + 2u). 4u Expand (2k3 + 4 - 4)(k - 4k + 2k) - 162k4 + 45k*2 + 161k*4 + 0k*2. -3k*4 + 45k*2 Expand (-2i - 2i2 - 16 + 16)(-3i2 + 3i*2 - 3i*2). 6i*4 + 6i*3 Expand (d + 2d - 2d)(-4d4 - d4 + 3d4) + d5 + 0d5 - 3d*5 - 20d*5 - 6 + 8d*5 + 5d*5. -11d*5 - 6 Expand (f - 13f + 28f)(-4f2 + f2 + 0f*2). -48f*3 Expand 3l4 - l4 + l*4 + (-2l*3 + 0l*2 + 0l*2)(4 - 2l - 4). 7l*4 Expand (-2 + 1 - 1)(3y - y + y)(3 - 4 - 3)(3 - 2 + 1). 48y Expand (-3s2 + 22s*2 - 51s*2)(s3 - s3 + 4s3). -128s*5 Expand ((-3s + s + 3s)(-2 + s + 2) + 3s2 - 3s2 + s2)(-148 + 33s + 148). 66s3 Expand (2o - 3o + 0o)(9o + 4o2 - 36o + 25o). -4o*3 + 2o*2 Expand (4 - 24 + 2)(-1 - 2j2 - 1 + 0j*2). 36j*2 + 36 Expand (2 - 2 - 2c*2 - 5c*2 + 3c*2 + 0c*2 + (-6c + c + 3c)(-c + c + 2c))(-12 + 13 - 8). 56c2 Expand 1 + g - 1 + (0 - 5 + 3)(-2g + 4g - g) + 2 + 3g - 2. 2g Expand -2r - 2r + r - 3r + 0r + r + (3r + r - 2r)(4 + 0 - 3) + r + 3r - 2r - 4 + 4 - 3r. -4r Expand (-6z + 3z - 5z)(1 - 2 + 3) + 12z - 2 + 0z - 5z. -9z - 2 Expand (12 - 9 - 12)(-r*2 + 0r2 - r2). 18r2 Expand (-17w + 17w + 3 + 2w*2)(3w2 + 0 + 0). 6w*4 + 9w*2 Expand (-4d*3 + 5d*3 - 2d*3)(-1 + 0 + 3) - 22d3 + 58 - 58. -24d*3 Expand 3j*5 - 4j*5 + 2j*5 + (-j + 3j - 3j)(0j2 + 0j*2 - 2j*4) - 3j*5 + 0j5 + j5. j*5 Expand -4p + 3p + 5p + (-4 + 2 + 1)(3p - 2p + 0p) + 2p - 2p + 3p. 6p Expand ((-2j - 2j + 2j)(0 - 2 + 0) - j + 2 - 2 - 3 + 3 + j - j + 0j + 2j)(1 - 6 - 1). -30j Expand ((2b4 - 2b*4 - 2b*4)(1 + 5 - 4) + 0b4 + 0b4 - b4)(2 - 5 + 2). 5b*4 Expand (-37a + 7a - 4a + (-3 + 2 + 3)(-a - a + 4a))(-4 + 3 - 1). 60a Expand ((-2w - 2w + 2w)(0w - w + 3w) + 0w2 - 4w*2 + 2w*2 - 2w2 - w2 + 2w2 + (3w - 2w + w)(0w + 2w + 0w))(-3w + 0w + 8 - 9). 9w3 + 3w*2 Expand (9 - 18 + 15)(-2a + 3a + 0a). 6a Expand (-2z5 - 3z*5 + 0z*5)(1 + 3 + 6). -50z5 Expand ((-5g*2 + 4g*2 + 2g*2)(-g - 2 + 2) + 2g3 - 4g*3 + 0g*3)(3g + 3g - 4g). -6g*4 Expand 0 + 3y*2 + 0 + (-y - 3y + 3y)(3y - 4y + 2y). 2y*2 Expand (-2v + v - v)(3v + 3 - v - 2)(1 + 0 + 0). -4v*2 - 2v Expand 3w3 + w2 - w2 + (3 + 2 - 6)(10w2 - 10w*2 - 5w*3). 8w*3 Expand (-3i + i + i + (-2 + 2 + i)(-4 + 3 - 1))(-30 + 30 - 2i3). 6i*4 Expand (4 - 4 - 2w*2)(-36 + 36 - 15w). 30w*3 Expand (-2r + 1 - 1 + (3r + 3r - 4r)(-6 + 4 + 3) + 4r - 2r - 3r - 3r + 0r + r)(-2 + 3 - 2)(1 + 0 + 1). 6r Expand (-2 + 1 + 0)(-3a*3 + 5a3 - a3)(29 - 14a - 29). 14a4 Expand 2z*5 + 0z5 + z5 + z*5 + 3z*4 - 3z4 + (-1 + 1 - z4)(-5z + 5z - z). 5z*5 Expand 0r*2 + 0r*2 - 2r*3 + (4r*3 - 2r*3 - 3r*3)(-4 + 3 + 2) - 2r2 + 2r*2 + 2r3. -r3 Expand (s2 - s	{ "pile_set_name": "DM Mathematics" }
p. -6.8 Round -0.27516854 to three decimal places. -0.275 What is -277296.1966 rounded to the nearest one thousand? -277000 Round -46658362 to the nearest one hundred thousand. -46700000 Round 0.0000718014415 to 5 dps. 0.00007 What is -0.000405733176 rounded to seven decimal places? -0.0004057 What is 308089.855 rounded to the nearest one thousand? 308000 Round 68580.6224 to the nearest ten. 68580 What is -0.00139012138 rounded to 6 dps? -0.00139 Round 0.000023344055 to 7 dps. 0.0000233 What is -0.0000472603525 rounded to 6 dps? -0.000047 Round -9.6451256 to 2 decimal places. -9.65 Round 22779470200 to the nearest 1000000. 22779000000 Round 0.248882275 to 2 dps. 0.25 Round -291975.9142 to the nearest 10. -291980 Round -0.00996427635 to five dps. -0.00996 What is -0.01067757082 rounded to five dps? -0.01068 What is 118011200 rounded to the nearest one million? 118000000 What is 331879.603 rounded to the nearest ten? 331880 What is 785.513127 rounded to 1 dp? 785.5 What is -37164969 rounded to the nearest one hundred thousand? -37200000 What is 197.1930483 rounded to two decimal places? 197.19 What is 570.52 rounded to the nearest one thousand? 1000 What is -16407264820 rounded to the nearest one million? -16407000000 What is -2778444.51 rounded to the nearest one hundred? -2778400 What is -0.00006499998392 rounded to 7 decimal places? -0.000065 What is 0.000247813512 rounded to 6 dps? 0.000248 Round 994469.2 to the nearest 1000000. 1000000 What is 0.03174486244 rounded to 3 dps? 0.032 What is -1021989382 rounded to the nearest ten thousand? -1021990000 What is -3.803738427 rounded to 2 decimal places? -3.8 What is -0.00245252208 rounded to 4 decimal places? -0.0025 Round -0.00000042297538 to 7 decimal places. -0.0000004 Round 40.72630334 to 3 dps. 40.726 What is 6416970640 rounded to the nearest 1000000? 6417000000 What is 124.3145886 rounded to the nearest ten? 120 What is 276303164700 rounded to the nearest 1000000? 276303000000 What is -454.940721 rounded to zero dps? -455 What is -1086790.43 rounded to the nearest ten thousand? -1090000 Round -2576.09192 to the nearest integer. -2576 Round -0.001750869595 to four decimal places. -0.0018 What is 0.1931207269 rounded to three decimal places? 0.193 What is -64267646 rounded to the nearest one hundred thousand? -64300000 What is 3155744.48 rounded to the nearest one hundred? 3155700 What is 14.5073061 rounded to 1 decimal place? 14.5 What is 0.00569326537 rounded to 3 dps? 0.006 Round 10564759.913 to the nearest 10000. 10560000 Round 0.28633581 to 4 decimal places. 0.2863 What is 5.43637051 rounded to 3 decimal places? 5.436 Round 23.696409 to 0 decimal places. 24 What is -48.6793868 rounded to 1 dp? -48.7 Round 946.66762 to the nearest ten. 950 Round -0.94831741 to 4 decimal places. -0.9483 Round 16781724.1 to the nearest one thousand. 16782000 What is 0.000013841249968 rounded to 7 decimal places? 0.0000138 What is 0.000290537 rounded to 7 dps? 0.0002905 Round -1656.63359 to the nearest 100. -1700 What is -5959348.602 rounded to the nearest 100? -5959300 Round -8.84622848 to 2 decimal places. -8.85 What is 0.000194321285 rounded to 6 dps? 0.000194 Round -4306488.84 to the nearest one hundred. -4306500 What is -1876205.59 rounded to the nearest ten thousand? -1880000 What is -37.855348 rounded to the nearest 100? 0 Round 7.033988928 to 4 decimal places. 7.034 What is 0.101726126 rounded to five dps? 0.10173 Round -361406605 to the nearest 10000. -361410000 What is -630229.29 rounded to the nearest 10000? -630000 Round 2833.27281 to the nearest one hundred. 2800 What is -4518466480 rounded to the nearest one hundred thousand? -4518500000 Round -0.295236449 to 4 dps. -0.2952 What is -0.0000174591987 rounded to 7 decimal places? -0.0000175 Round -761.545275 to one dp. -761.5 Round 176756.501 to the nearest ten. 176760 Round 59307.2111 to the nearest 1000. 59000 Round -22940.4218 to the nearest ten. -22940 Round -13999039.2 to the nearest one hundred thousand. -14000000 What is -0.0003379467 rounded to six dps? -0.000338 Round -0.4973558512 to 2 decimal places. -0.5 What is 0.0021750226 rounded to 3 decimal places? 0.002 Round -4522337.7 to the nearest 1000000. -5000000 What is 0.006775536 rounded to one decimal place? 0 What is -3112.8824 rounded to the nearest 1000? -3000 Round -2803.14159 to the nearest one thousand. -3000 What is 1602.65514 rounded to the nearest ten? 1600 Round -3239649710 to the nearest 100000. -3239600000 Round 208.67402433 to 3 decimal places. 208.674 What is -8282.918 rounded to the nearest ten? -8280 Round -44604.5503 to the nearest 10. -44600 What is 7494.48848 rounded to the nearest ten? 7490 What is 491.63651 rounded to zero decimal places? 492 Round 0.005501884786 to three dps. 0.006 What is 0.001917351785 rounded to 5 dps? 0.00192 Round 17664925744 to the nearest one hundred thousand. 17664900000 Round -1592958.3 to the nearest 1000000. -2000000 What is -0.00640534167 rounded to seven dps? -0.0064053 What is 0.0146748701 rounded to four decimal places? 0.0147 Round 33172640 to the nearest 100000. 33200000 What is 0.001133342309 rounded to six decimal places? 0.001133 Round 28580955.09 to the nearest one million. 29000000 What is 17515931.96 rounded to the nearest 100000? 17500000 What is -37.714678 rounded to the nearest ten? -40 Round 0.18542317954 to two decimal places. 0.19 Round 820.63409 to the nearest 100. 800 Round 7179.829 to the nearest ten. 7180 Round 877275.5734 to the nearest 1000. 877000 Round -1100604346 to the nearest one hundred thousand. -1100600000 Round -0.3123469663 to 3 decimal places. -0.312 Round -165.838141 to 0 dps. -166 What is -0.019630295 rounded to 1 dp? 0 Round 0.0061348915 to six dps. 0.006135 Round 760174.07 to the nearest one hundred. 760200 What is -46209921900 rounded to the nearest one million? -46210000000 Round 72079.4188 to the nearest 1000. 72000 Round -480.74741 to the nearest 10. -480 What is -0.0112039924 rounded to four decimal places? -0.0112 What is -67.5414734 rounded to the nearest ten? -70 Round -2830.4154 to the nearest 10. -2830 What is 3.88401067 rounded to 3 decimal places? 3.884 What is 273.91454 rounded to the nearest integer? 274 What is 18746.388 rounded to the nearest 10? 18750 Round 6.1778498 to two dps. 6.18 Round -37287.0973 to the nearest 1000. -37000 What is -77.646281 rounded to the nearest integer? -78 What is 9.4269259 rounded to 0 decimal places? 9 Round -86509.644 to the nearest ten thousand. -90000 What is -18.97211924 rounded to 1 decimal place? -19 Round -5544395810 to the nearest 100000. -5544400000 Round 3367218683 to the nearest 100000. 3367200000 What is -63775951.55 rounded to the nearest 100000? -63800000 Round -0.2896801395 to three dps. -0.29 Round 313.1504766 to 1 decimal place. 313.2 What is 14.3209667 rounded to two dps? 14.32 Round 46902669.9 to the nearest one thousand. 46903000 What is -0.000031882355 rounded to 5 decimal places? -0.00003 What is -114307103 rounded to the nearest ten thousand? -114310000 What is -91.21933486 rounded to two decimal places? -91.22 What is -0.000393630818 rounded to 7 dps? -0.0003936 What is -0.151970576 rounded to 2 dps? -0.15 What is -0.0256153923 rounded to five decimal places? -0.02562 Round 92.98066 to zero decimal places. 93 What is 31066.6377 rounded to the nearest ten? 31070 Round -37692343.6 to the nearest one hundred thousand. -37700000 Round 6190798.28 to the nearest 10000. 6190000 What is -27.8694532 rounded to the nearest 10? -30 What is -0.04819463441 rounded to six decimal places? -0.048195 What is 0.006006746063 rounded to 3 dps? 0.006 Round -270780605 to the nearest 100000. -270800000 What is 0.00367071159 rounded to four decimal places? 0.0037 Round -9230.4686 to the nearest ten. -9230 What is 0.025294651 rounded to four decimal places? 0.0253 What is -0.5172258296 rounded to 5 dps? -0.51723 Round -1.83482138 to two dps. -1.83 What is 1223304810 rounded to the nearest one hundred thousand? 1223300000 What is 0.098656253 rounded to three decimal places? 0.099 What is 953.60617 rounded to 2 decimal places? 953.61 What is -2.64492701 rounded to 4 dps? -2.6449 Round 5525881.8 to the nearest 1000. 5526000 What is 123.5100313 rounded t	{ "pile_set_name": "DM Mathematics" }
3, e: 1, z: 1, l: 3, i: 2}? 2/15 What is prob of picking 2 a when two letters picked without replacement from {k: 5, a: 2}? 1/21 Two letters picked without replacement from irjddjdjjri. Give prob of picking 1 d and 1 j. 12/55 Four letters picked without replacement from everooavavoqoeeoaaee. What is prob of picking 2 a, 1 r, and 1 q? 2/1615 Four letters picked without replacement from {x: 4, v: 3}. Give prob of picking 1 v and 3 x. 12/35 Three letters picked without replacement from {g: 4, d: 2, j: 2}. What is prob of picking 2 d and 1 g? 1/14 What is prob of picking 1 k and 1 w when two letters picked without replacement from kwkwwwwww? 7/18 Four letters picked without replacement from {h: 3, y: 13}. What is prob of picking 2 h and 2 y? 9/70 Four letters picked without replacement from dtndztttonfnfnnnn. Give prob of picking 4 n. 1/68 Four letters picked without replacement from {p: 16, h: 2}. What is prob of picking 3 p and 1 h? 56/153 Three letters picked without replacement from {o: 4, z: 4, h: 10, n: 1, f: 1}. What is prob of picking 1 z and 2 h? 3/19 What is prob of picking 1 v and 1 s when two letters picked without replacement from vvvvvvpvpsvqpqvv? 1/12 Calculate prob of picking 1 k and 2 j when three letters picked without replacement from bbkbjabbjjbk. 3/110 Calculate prob of picking 1 h and 1 e when two letters picked without replacement from {x: 1, e: 5, h: 4}. 4/9 Three letters picked without replacement from {u: 4, x: 1, i: 2, q: 3, n: 1, e: 1}. Give prob of picking 1 n, 1 q, and 1 x. 3/220 What is prob of picking 1 f and 1 u when two letters picked without replacement from uddufdfdudufduu? 6/35 Calculate prob of picking 1 o and 3 m when four letters picked without replacement from omommm. 8/15 Three letters picked without replacement from ggfgfgfgfggfffgfgff. What is prob of picking 2 g and 1 f? 120/323 What is prob of picking 1 m, 1 h, and 1 e when three letters picked without replacement from {d: 3, x: 4, e: 1, w: 3, m: 3, h: 1}? 3/455 What is prob of picking 3 m when three letters picked without replacement from ssssssmmsssmssssss? 1/816 Calculate prob of picking 3 c and 1 i when four letters picked without replacement from {c: 12, i: 6}. 22/51 Three letters picked without replacement from zzhebzbzbibeeb. Give prob of picking 1 b, 1 h, and 1 i. 5/364 Two letters picked without replacement from {e: 2, w: 5}. What is prob of picking 2 w? 10/21 Four letters picked without replacement from hffffffffffhfffh. What is prob of picking 2 h and 2 f? 9/70 Three letters picked without replacement from lll. Give prob of picking 3 l. 1 What is prob of picking 1 p and 1 m when two letters picked without replacement from {p: 2, f: 1, t: 2, m: 1}? 2/15 Calculate prob of picking 1 e and 1 u when two letters picked without replacement from {u: 13, e: 5}. 65/153 Two letters picked without replacement from vtmkdvtvdmdovmd. What is prob of picking 1 o and 1 d? 4/105 Three letters picked without replacement from rrrxfex. Give prob of picking 1 e, 1 f, and 1 x. 2/35 What is prob of picking 2 f, 1 u, and 1 l when four letters picked without replacement from ufffffufuufffluufuuf? 88/969 Calculate prob of picking 2 b and 2 a when four letters picked without replacement from {a: 2, b: 10}. 1/11 Two letters picked without replacement from {k: 4, s: 3, f: 1, x: 5, i: 1}. Give prob of picking 2 x. 10/91 What is prob of picking 1 q and 1 e when two letters picked without replacement from beesejbjqebjbbbtbj? 4/153 What is prob of picking 4 z when four letters picked without replacement from {a: 1, z: 9, p: 1}? 21/55 What is prob of picking 1 g and 1 p when two letters picked without replacement from {h: 2, p: 1, q: 1, a: 5, y: 1, g: 10}? 1/19 Two letters picked without replacement from {w: 1, q: 2, b: 1}. Give prob of picking 2 b. 0 Calculate prob of picking 2 x when two letters picked without replacement from xtxt. 1/6 Four letters picked without replacement from {p: 2, s: 1, o: 3, r: 6, u: 6}. Give prob of picking 1 u, 1 r, and 2 o. 3/85 What is prob of picking 2 w and 1 z when three letters picked without replacement from wawz? 1/4 Two letters picked without replacement from {s: 2, d: 1, n: 1, l: 1, e: 2}. Give prob of picking 1 d and 1 n. 1/21 What is prob of picking 2 s and 1 w when three letters picked without replacement from wwwssswswwsw? 7/22 Three letters picked without replacement from xjjjgxjgjjxnn. Give prob of picking 1 j and 2 x. 9/143 Four letters picked without replacement from {v: 2, g: 8}. Give prob of picking 2 v and 2 g. 2/15 Four letters picked without replacement from wwpwwwppwrrrpwpwwpp. Give prob of picking 4 w. 21/646 What is prob of picking 1 a and 1 r when two letters picked without replacement from {i: 1, a: 1, r: 1}? 1/3 Two letters picked without replacement from mscccccgstcmcctccmt. Give prob of picking 2 t. 1/57 Two letters picked without replacement from wwwwwwsaywwsww. What is prob of picking 1 y and 1 a? 1/91 Calculate prob of picking 1 r, 1 z, and 1 y when three letters picked without replacement from {z: 1, y: 2, r: 11}. 11/182 What is prob of picking 2 u and 2 z when four letters picked without replacement from {v: 5, u: 4, z: 7}? 9/130 Three letters picked without replacement from {o: 2, k: 3, f: 1, u: 1, b: 3, v: 2}. Give prob of picking 1 o, 1 k, and 1 b. 9/110 Calculate prob of picking 1 p, 1 r, 1 d, and 1 t when four letters picked without replacement from {f: 5, v: 5, t: 1, d: 2, r: 2, p: 2}. 2/595 What is prob of picking 2 l when two letters picked without replacement from {l: 2, z: 8}? 1/45 Two letters picked without replacement from {c: 9, p: 1, m: 1, l: 2}. What is prob of picking 1 l and 1 c? 3/13 What is prob of picking 1 c and 2 e when three letters picked without replacement from rieevicccmem? 9/220 Three letters picked without replacement from {f: 4, r: 2, t: 4, b: 2, a: 2, o: 1}. What is prob of picking 1 b, 1 o, and 1 r? 4/455 Three letters picked without replacement from upgppglguggqr. What is prob of picking 1 u, 1 r, and 1 p? 3/143 Three letters picked without replacement from cxcccccccccccccccccc. What is prob of picking 2 c and 1 x? 3/20 Calculate prob of picking 2 a and 1 b when three letters picked without replacement from ppppbpoabopoppaa. 3/280 What is prob of picking 1 h, 1 f, and 1 n when three letters picked without replacement from kknafafjh? 1/42 Three letters picked without replacement from {i: 4}. Give prob of picking 3 i. 1 What is prob of picking 1 r and 1 p when two letters picked without replacement from {h: 1, p: 2, r: 1, o: 1}? 1/5 Two letters picked without replacement from {l: 4}. What is prob of picking 2 l? 1 What is prob of picking 2 i when two letters picked without replacement from iaaiaiaiaaaaiiai? 7/40 Two letters picked without replacement from kkkxxjrkkxki. Give prob of picking 1 i and 1 r. 1/66 Three letters picked without replacement from {y: 3, e: 1, p: 2, w: 1}. Give prob of picking 1 p, 1 e, and 1 w. 2/35 Calculate prob of picking 1 w, 1 y, 1 o, and 1 a when four letters picked without replacement from {q: 2, o: 1, j: 2, w: 1, a: 1, y: 2}. 1/63 Two letters picked without replacement from {x: 5, i: 1, g: 1, s: 1, p: 1}. What is prob of picking 1 g and 1 p? 1/36 Calculate prob of picking 2 v and 1 r when three letters picked without replacement from {r: 2, v: 8, o: 2}. 14/55 Two letters picked without replacement from {m: 1, o: 1, n: 1, b: 1, r: 1}. What is prob of picking 1 o and 1 m? 1/10 Calculate prob of picking 1 x and 1 a when two letters picked without replacement from aaaaaaaaaazazaaax. 7/68 Three letters picked without replacement from {j: 3, s: 3, i: 5, b: 2, x: 3, h: 3}. Give prob of picking 2 x and 1 i. 5/323 What is prob of picking 2 w when two letters picked without replacement from dwdyyywydyywdywwy? 5/68 What is prob of picking 1 x and 1 i when two letters picked without replacement from mxxixxxxxm? 7/45 Calculate prob of picking 1 w and 2 k when three letters picked without replacement from {b: 1, e: 2, w: 1, k: 2, m: 4, a: 5}. 1/455 Calculate prob of picking 2 q and 2 a when four letters picked without replacement from aqaaqaaqqa. 3/7 Calculate prob of picking 1 k and 1 d when two letters picked without replacement from {k: 1, l: 1, g: 1, d: 1,	{ "pile_set_name": "DM Mathematics" }
(c) 2/13 a What is the nearest to -42 in -1/10, -579, 1? -1/10 Which is the closest to 2180? (a) 0.6 (b) -17 (c) 3/4 (d) 0.1 c What is the nearest to 0.1 in 366, -7, -0.07? -0.07 What is the nearest to -0.05 in -1/3, -1, -1092? -1/3 Which is the closest to -1? (a) -6/13 (b) -4 (c) -1 (d) -80 (e) -0.3 c What is the closest to -2/85 in 0.052, -1/4, 0.043? 0.043 What is the nearest to -19 in -2, -161, 0.2, -0.3? -2 What is the nearest to -2 in -2, 84.5, 0.4, 2/7? -2 What is the closest to -1 in 0.5, -99, 1414? 0.5 What is the closest to 2 in 0, -4, 0.07, -68, -71? 0.07 Which is the closest to -3/2? (a) 0.1 (b) -22 (c) -122 a Which is the nearest to 4? (a) -38968 (b) 1 (c) -3 b Which is the nearest to 0.27? (a) 5 (b) 4/7 (c) 4 (d) 52 (e) -2 b Which is the closest to -2/7? (a) -1/4 (b) -3 (c) 10 (d) -285/8 a What is the closest to 1 in -8, 2/17, -68.45, -0.2? 2/17 What is the nearest to 0.6 in -0.4, -0.3, -4/7, 1588/5, 2/5? 2/5 Which is the closest to -3? (a) -1 (b) 2/5 (c) 3 (d) -0.1 (e) -1395 a Which is the nearest to 64? (a) 0.4 (b) 1/4 (c) -0.4 a Which is the closest to -2/7? (a) -0.3 (b) 0.2 (c) -34 (d) -1/3 a Which is the nearest to 0.08? (a) 2/19 (b) 1/4 (c) -5588 a Which is the closest to -81/4? (a) 465 (b) 5 (c) 1 c What is the nearest to 0.0503 in -4, -0.3, 0.4, -5? 0.4 What is the closest to -1/1370 in 2/5, 0, 0.1? 0 Which is the nearest to 2/109? (a) 3 (b) -0.2 (c) -4/413 (d) -2/15 c What is the nearest to -351 in -1, -1/5, 1, -0.5? -1 What is the closest to -2 in 4, 0.084, -3/38, 2? -3/38 What is the closest to -0.1 in -12, 1, 190, 1/4? 1/4 Which is the closest to 25? (a) -5 (b) 2.24 (c) -2/29 b Which is the closest to -1/2? (a) -25 (b) 11 (c) 3 (d) 0 d Which is the closest to -4/41? (a) -3/8 (b) -8/3 (c) 0.3 a Which is the nearest to -5? (a) -11 (b) -4 (c) 1/9 (d) -0.5 b What is the closest to -51/8 in 9, -4, 12? -4 What is the closest to 6 in -11, 0, -7, 2, -58? 2 Which is the nearest to 5? (a) 90 (b) 0.5 (c) -4 (d) -3 (e) -5 b What is the nearest to 1/4 in -2/7, 0, 119, -4, 2/7? 2/7 Which is the nearest to -0.1? (a) -9.7 (b) 2 (c) 98 (d) -4 (e) 0.3 e What is the closest to 0 in -1/5, -4, -14/433? -14/433 Which is the closest to -5? (a) -0.11 (b) -1/4 (c) 37 (d) -1 (e) -0.1 d What is the nearest to 1.32 in 7.3, 32, 0.3? 0.3 What is the nearest to 2 in -12.6, 2/33, -5? 2/33 Which is the nearest to 1? (a) -2/3 (b) 3 (c) 23/21 (d) -0.4 (e) 0.04 c What is the closest to -1 in -8, 29844, 2/7? 2/7 Which is the closest to -1? (a) -18/19 (b) -449 (c) 2/9 a Which is the closest to 0? (a) -37 (b) -623 (c) 0.7 (d) -3/5 d Which is the nearest to 0.2? (a) 0.5 (b) -4/5 (c) -158 (d) 0.4 d Which is the closest to -31? (a) -2 (b) 0.4 (c) -126 (d) -0.4 a Which is the closest to 22? (a) -12 (b) -1 (c) -3 (d) 1 (e) 0 d Which is the nearest to -2008? (a) -0.3 (b) -2/23 (c) -1 c What is the closest to 5 in 6, 5, 145? 5 What is the closest to 12/11 in -11.4, -5/3, 1/4, 1, -0.09? 1 Which is the nearest to 0.1? (a) -0.5 (b) -2/2271 (c) 0.2 (d) -0.07 (e) -2/9 c Which is the nearest to 3? (a) 8 (b) 69 (c) -573 a Which is the nearest to -101.3? (a) -5 (b) -8 (c) 1 b Which is the closest to -86? (a) 3/5 (b) -1/5 (c) 3 (d) -5 (e) -5/3 d Which is the nearest to 20? (a) 2 (b) 3853 (c) -3 a What is the closest to 2/9 in 0.04, -0.4, 2/13, -36, 0.4? 2/13 Which is the nearest to 1? (a) 3 (b) 1/4 (c) 1/2 (d) 0.1 (e) 1/6 c Which is the closest to 0.3? (a) 0 (b) 72 (c) -57 a Which is the nearest to -36? (a) 10 (b) -2 (c) 0 (d) -1/32 b What is the nearest to -36/7 in 5, -5, 1? -5 What is the closest to -5764 in 3/7, -2/7, -1.1? -1.1 Which is the closest to 0.06? (a) -910 (b) 14.3 (c) 4 c Which is the nearest to -2.359? (a) 1 (b) -6/13 (c) -2/5 b Which is the closest to -0.1? (a) -3/7 (b) 1 (c) -1 (d) 0.005 (e) -1/183 e Which is the nearest to 0.01? (a) 4 (b) -856 (c) 1 c What is the nearest to -3567 in 61, 5, -3, 0.3? -3 Which is the closest to 46? (a) -3/5 (b) 5 (c) -5 (d) -1.1 b Which is the nearest to 1.1? (a) -0.02 (b) -1/5 (c) -3/5 a What is the closest to -1/3 in -0.07, 1/3, -7, -117, 1/7? -0.07 Which is the nearest to 8? (a) -1 (b) -0.5 (c) 1/23 (d) 4 d What is the nearest to 1 in -0.13, 23, 6, -1? -0.13 What is the nearest to -1 in -1/23, 35/38, -4? -1/23 What is the closest to 1/4 in 0.4, 5, 0.2, -0.6, -0.028313? 0.2 What is the nearest to -2/5 in 0.4, -721, -5, -0.1? -0.1 Which is the closest to -2? (a) -374.3 (b) 3/4 (c) -5 b What is the closest to 1.43 in 0, -2520, 0.5? 0.5 What is the closest to -1/4 in 4, -0.0219, -0.1, -0.2? -0.2 What is the closest to 0 in -4/3, -0.19, -0.1, -135? -0.1 What is the closest to 0 in 1705, 2/13, 2/9? 2/13 What is the closest to -140 in -3/19, -6/7, -3? -3 Which is the nearest to 0? (a) 2.1 (b) 97/2 (c) -0.4 (d) 3/5 c Which is the closest to 0? (a) -30 (b) -0.2 (c) 1293 b Which is the closest to 5? (a) -30 (b) -3 (c) -4/65 c What is the nearest to 0 in -0.17, 2.59, 25, -1? -0.17 What is the closest to 0 in -5, -0.02, 0.45, -0.4? -0.02 Which is the closest to 15/2? (a) 4 (b) -2/3 (c) 346 a Which is the closest to 0.3? (a) -0.144 (b) 0.03 (c) 2 b Which is the closest to -18? (a) -1 (b) -2 (c) 1/36 b Which is the nearest to 1769? (a) -2 (b) -0.4 (c) 2/13 (d) -0.1 c Which is the closest to 0.5? (a) 0.3 (b) -0.065 (c) -16/9 a What is the nearest to -1 in 0.75, -1/3, 17? -1/3 What is the closest to 5 in 0.3, 0.1, -5/141, 0.5? 0.5 What is the closest to -0.2 in -0.097, 0.1, -2, -20.1? -0.097 What is the nearest to 1/4 in 3/2, 208, 1/12, 2/11? 2/11 Which is the nearest to 5? (a) 0.9766 (b) 3/4 (c) -0.5 (d) -2 a What is the nearest to -1/33 in -1, 71, -0.4? -0.4 What is the nearest to 0.1 in 2/9, -670, 1, -1? 2/9 What is the nearest to -2/3 in -2/2407, -5, -2.9? -2/2407 What is the nearest to 2 in -124, 0.7, 4, 0.5, -1/2? 0.7 What is the nearest to -497.4 in 0.3, 2/11, -0.2, 1? -0.2 What is the closest to 7 in 0.5, -169/8, -17, 1/9? 0.5 What is the nearest to -2 in 2/7, 1/457, -4/11, 0.4? -4/11 Which is the nearest to 2? (a) -0.3 (b) 1.3 (c) -0.4 (d) -64 b What is the closest to -108 in 0.01, -1, -0.01? -1 What is the closest to 0 in -1/6, 24.1, -24? -1/6 Which is the nearest to 1? (a) 1/110 (b) 2/5 (c) -0.78 b What is the closest to -0.1 in -0.06, 4, -0.3, -0.001, -5? -0.06 What is the closest to -257 in 0.2, 0.21, 0.1? 0.1 Which is the closest to -1/17? (a) 3/2 (b) 3/13 (c) 1/15 c Which is the closest to 2/7? (a) 0 (b) -46 (c) -4 a What is the closest to -1.1 in 172, 5, -0.5, -2/13? -0.5 What is the closest to 1 in -79, -708, 1, -8? 1 What is the nearest to -2 in -0.31, -1/24, -3? -3 Which is the closest to -0.1? (a) 1/34 (b) 1/5 (c) 0 (d) 7 c Which is the closest to 0.82? (a) -4 (b) 1 (c) -2/375 (d) -3/2 b Which is the nearest to -1/2? (a) -4 (b) -3 (c) -0.4 (d) 3/28 (e) -0.28 c What is the closest to 2 in -1, -24, -7? -1 Which is the nearest to 0.02? (a) 6/7 (b) 0.1 (c) -3.4 (d) 2 b What is the nearest to -1 in -2/19, 0.8, -4/7, 1/2? -4/7 What is the closest to 3 in -1/8, -2207, -5, 3? 3 What is the closest to -0.1 in -5, 2, 1/1201? 1/1201 What is the nearest to -3/13 in 4, -571.73, 5? 4 Which is the nearest to 2? (a) -1316 (b) 0 (c) 0.1 (d) 0.08 c What is the closest to 0 in -1/5, 75, -2/9, 43, -5? -1/5 Which is the closest to -3? (a) -14 (b) -28 (c) -7 (d) 4 c Which is the closest to -5? (a) 4 (b) 46 (c) 2/61 c Which is the closest to -2/9? (a) 2/3 (b) 0 (c) 4 (d) -5 (e) 57/10 b Which is the nearest to 58? (a) 0 (b) -9 (c) 5 (d) 2 c What is the nearest to 0.22 in 8, 0, -3, 2/33, -5? 2/33 What is the nearest to 0 in -0.1, 28941, 2/7, 1? -0.1 Which is the closest to 9753? (a) 2/11 (b) 3 (c) 1 (d) 0 b What is the nearest to -2/7 in 4, 1/119, 14, -2, 2/5? 1/119 Which is the nearest to 2/3? (a) 0 (b) -154 (c) 0.7 c Which is the closest to -1/4895? (a) -1 (b) 0.1 (c) 0.4 (d) -0.06 d Which is the nearest to -2/7? (a) 0.5 (b) 142 (c) 4 (d) -0.9 (e) 2/35 e What is the closest to 4 in 0.4, -0.1, 2/25, -11, -0.3? 0.4 Which is the closest to -1? (a) 3 (b) -0.1 (c) 0 (d) -2/3 (e)	{ "pile_set_name": "DM Mathematics" }
838, -3899? -3z3 - 37z*2 + z - 3 What is the b'th term of 16, 39, 70, 109, 156? 4b*2 + 11b + 1 What is the f'th term of -110, -109, -108, -107, -106? f - 111 What is the v'th term of -66, -85, -104? -19v - 47 What is the m'th term of -80, -62, -22, 46, 148, 290, 478? m3 + 5m*2 - 4m - 82 What is the w'th term of 107, 217, 323, 425, 523, 617, 707? -2w2 + 116w - 7 What is the o'th term of -196, -406, -616, -826, -1036, -1246? -210o + 14 What is the s'th term of -12, 6, 50, 126, 240, 398, 606? s3 + 7s*2 - 10s - 10 What is the i'th term of -103, -133, -163, -193? -30i - 73 What is the o'th term of 39, 53, 77, 117, 179? o3 - o2 + 10o + 29 What is the c'th term of 4390, 4394, 4398? 4c + 4386 What is the a'th term of 122, 133, 166, 233, 346, 517? 2a3 - a2 + 121 What is the m'th term of 249, 253, 257, 261, 265? 4m + 245 What is the z'th term of 1165, 2330, 3495? 1165z What is the h'th term of 1674, 1676, 1678, 1680, 1682? 2h + 1672 What is the h'th term of -81, -146, -193, -222? 9h*2 - 92h + 2 What is the y'th term of -1659, -1650, -1639, -1626, -1611, -1594, -1575? y*2 + 6y - 1666 What is the j'th term of -1054, -1071, -1088? -17j - 1037 What is the m'th term of 9, -57, -175, -351, -591, -901, -1287? -m3 - 20m2 + m + 29 What is the y'th term of -784, -779, -772, -763, -752, -739, -724? y2 + 2y - 787 What is the l'th term of 215, 302, 389, 476, 563? 87l + 128 What is the n'th term of -2112, -2123, -2148, -2193, -2264, -2367, -2508? -n3 - n2 - n - 2109 What is the w'th term of -20, -60, -126, -218? -13w2 - w - 6 What is the k'th term of -74, -73, -72, -71? k - 75 What is the z'th term of -1, 20, 61, 128, 227, 364? z3 + 4z*2 + 2z - 8 What is the p'th term of 49, 89, 131, 175? p*2 + 37p + 11 What is the y'th term of 10, 19, 42, 85, 154, 255, 394, 577? y3 + y2 - y + 9 What is the g'th term of -235, -236, -237, -238? -g - 234 What is the m'th term of 443, 886, 1329, 1772? 443m What is the o'th term of 93, 301, 521, 759, 1021, 1313, 1641, 2011? o3 + 201o - 109 What is the w'th term of 8, 11, 30, 71, 140, 243? w*3 + 2w*2 - 10w + 15 What is the w'th term of -23, -81, -139? -58w + 35 What is the h'th term of 70, 71, 64, 43, 2, -65, -164? -h3 + 2h*2 + 2h + 67 What is the q'th term of 542, 544, 546, 548, 550? 2q + 540 What is the z'th term of -117, -230, -343, -456, -569, -682? -113z - 4 What is the f'th term of 3, -3, 9, 57, 159, 333, 597? 3f3 - 9f2 + 9 What is the n'th term of 98, 229, 412, 653, 958, 1333, 1784, 2317? n3 + 20n2 + 64n + 13 What is the w'th term of 185, 181, 177, 173, 169, 165? -4w + 189 What is the p'th term of 207, 206, 205? -p + 208 What is the q'th term of -9090, -9093, -9096? -3q - 9087 What is the b'th term of 87, 77, 65, 51, 35? -b*2 - 7b + 95 What is the w'th term of -6, -24, -54, -96, -150, -216? -6w2 What is the n'th term of 102, 145, 188, 231, 274, 317? 43n + 59 What is the r'th term of -141, -154, -167, -180, -193? -13r - 128 What is the d'th term of -35, -18, -1, 16? 17d - 52 What is the r'th term of 61, 94, 101, 82, 37? -13r2 + 72r + 2 What is the h'th term of 226, 236, 246, 256? 10h + 216 What is the c'th term of -969, -1907, -2835, -3747, -4637, -5499? c3 - c2 - 942c - 27 What is the g'th term of 5, 110, 287, 530, 833, 1190? -g*3 + 42g*2 - 14g - 22 What is the n'th term of 69, 102, 135? 33n + 36 What is the x'th term of 42, 85, 128? 43x - 1 What is the t'th term of 62, 64, 66, 68, 70, 72? 2t + 60 What is the t'th term of -89, -103, -117, -131, -145? -14t - 75 What is the l'th term of -103, -184, -237, -250, -211? 2l3 + 2l*2 - 101l - 6 What is the p'th term of -73, -12, 157, 488, 1035? 9p3 - 2p - 80 What is the h'th term of -2596, -5191, -7788, -10387? -h*2 - 2592h - 3 What is the d'th term of -289, -339, -407, -499, -621, -779? -d*3 - 3d*2 - 34d - 251 What is the c'th term of -383, -382, -369, -338, -283, -198, -77? c*3 - 6c - 378 What is the h'th term of -1087, -1086, -1085, -1084? h - 1088 What is the q'th term of -81, -149, -201, -231, -233, -201? q*3 + 2q*2 - 81q - 3 What is the c'th term of -167, -153, -125, -77, -3, 103, 247, 435? c3 + c2 + 4c - 173 What is the r'th term of -19, -46, -81, -124, -175, -234, -301? -4r*2 - 15r What is the g'th term of -9, -47, -117, -225, -377, -579, -837, -1157? -g*3 - 10g*2 - g + 3 What is the h'th term of 397, 418, 439, 460, 481? 21h + 376 What is the b'th term of -98, -133, -172, -215, -262, -313? -2b2 - 29b - 67 What is the w'th term of 10, 29, 50, 73, 98, 125, 154? w*2 + 16w - 7 What is the k'th term of -34, -333, -826, -1507, -2370, -3409? k*3 - 103k*2 + 3k + 65 What is the d'th term of -27, 62, 163, 282, 425? d*3 + 82d - 110 What is the f'th term of 37, 24, 9, -8, -27? -f*2 - 10f + 48 What is the b'th term of 1775, 3552, 5331, 7112? b*2 + 1774b What is the d'th term of 34, 27, 20, 13? -7d + 41 What is the j'th term of 43, 173, 391, 697, 1091? 44j*2 - 2j + 1 What is the m'th term of -80, -87, -106, -143, -204? -m3 - 79 What is the u'th term of 16, 6, -16, -56, -120, -214? -u3 - 3u + 20 What is the w'th term of -27, -55, -85, -117, -151, -187? -w2 - 25w - 1 What is the k'th term of 256, 1014, 2276, 4042, 6312? 252k2 + 2k + 2 What is the z'th term of -27, -35, -53, -87, -143? -z3 + z2 - 4z - 23 What is the r'th term of -10717, -21432, -32147, -42862, -53577, -64292? -10715r - 2 What is the u'th term of -28, -54, -80, -106? -26u - 2 What is the l'th term of -58, -114, -170, -226, -282, -338? -56l - 2 What is the k'th term of -538, -542, -550, -562, -578, -598, -622? -2k2 + 2k - 538 What is the p'th term of 3636, 3635, 3634, 3633, 3632, 3631? -p + 3637 What is the u'th term of -68, -524, -1770, -4202, -8216, -14208, -22574, -33710? -66u3 + u2 + 3u - 6 What is the t'th term of 27, 31, 33, 33? -t*2 + 7t + 21 What is the u'th term of 148, 296, 434, 556, 656? -u3 + u2 + 152u - 4 What is the d'th term of 977, 1948, 2919, 3890? 971d + 6 What is the p'th term of -186, -371, -556, -741, -926, -1111? -185p - 1 What is the j'th term of 209, 406, 589, 752, 889, 994, 1061, 1084? -j3 - j2 + 207j + 4 What is the d'th term of -69, -47, -15, 33, 103, 201, 333, 505? d3 - d2 + 18d - 87 What is the w'th term of 56, 58, 60, 62, 64, 66? 2w + 54 What is the u'th term of 2174, 2174, 2176, 2180, 2186? u*2 - 3u + 2176 What is the y'th term of 3, 23, 53, 93, 143? 5y2 + 5y - 7 What is the l'th term of -3, -1, 5, 15, 29, 47? 2l2 - 4l - 1 What is the q'th term of -16, -35, -54, -73? -19q + 3 What is the l'th term of 25, 118, 267, 466, 709, 990, 1303, 1642? -l3 + 34l*2 - 2l - 6 What is the g'th term of -106, -211, -326, -457, -610, -791? -g3 + g2 - 101g - 5 What is the d'th term of -385, -388, -393, -400, -409, -420, -433? -d2 - 384 What is the h'th term of -25, -37, -53, -73, -97, -125, -157? -2h*2 - 6h - 17 What is the z'th term of -9, 12, 43, 78, 111, 136, 147? -z*3 + 11z*2 - 5z - 14 What is the i'th term of 75, 84, 105, 144, 207, 300? i*3 + 2i + 72 What is the p'th term of -4585, -9170, -13755, -18340, -22925, -27510? -4585p What is the m'th term of -9410, -9408, -9406? 2m - 9412 What is the b'th term of -36, -232, -762, -1794, -3496? -28b3 + b2 - 3b - 6 What is the u'th term of 56, 79, 116, 167, 232? 7u2 + 2u + 47 What is the u'th term of -20, -145, -356, -653, -1036, -1505, -2060? -43u2 + 4u + 19 What is the f'th term of -26, -59, -118, -215, -362, -571? -2f3 - f2 - 16f - 7 What is the x'th term of 73, 144, 215, 286? 71x + 2 What is the i'th term of -40, -71, -98, -121, -140, -155? 2i*2 - 37i - 5 What is the i'th term of -1826, -1824, -1822, -1820, -1818? 2i - 1828 What is the d'th term of 6, 11, 40, 105, 218? 2d*3 - 9d + 13 What is the g'th term of -73, 3, 79? 76g - 149 What is the y'th term of 166, 337, 508, 679? 171y - 5 What is the i'th term of -180, -371, -550, -711, -848, -955, -1026, -1055? i*3 - 198i + 17 What is the k'th term of -3849, -3854, -3863, -3876, -3893, -3914? -2k2 + k - 3848 What is the c'th term of -30, -26, -12, 18, 70, 150, 264, 418? c3 - c*2 - 30 What is the w'th term of -40, -152, -332,	{ "pile_set_name": "DM Mathematics" }
be 225/33 + (-8)/(-44). Let h = -11 - -14. What is the derivative of gf2 + 1 - 4f*2 - 4f*4 - hf*2 wrt f? -16f*3 Let q(z) = 34z - 4. Let p(j) = -4j + 1 - 2j + 3j + 4j. Let i(h) = -3p(h) - q(h). Differentiate i(k) with respect to k. -37 Let c(z) be the first derivative of 0z + 4 + z*2 - 5/3z*3. Find the second derivative of c(n) wrt n. -10 Suppose -2s - 2s + 17 = o, -5s - 5 = -4o. Suppose -31 = -ow + 19. Find the second derivative of -wc4 + 0c + 0c + c + 3c*4 wrt c. -84c*2 Let o(j) be the first derivative of 19j*3/3 + 14j*2 - 90. Find the second derivative of o(w) wrt w. 38 Let w(i) be the third derivative of 0i*4 + 11/168i*8 + 5i*2 + 0i*7 + 0 + 19/60i*5 + 0i*3 + 0i*6 + 0i. What is the third derivative of w(x) wrt x? 1320x2 Let p(u) be the second derivative of 0u*2 + 0u*5 + 0u*3 - 7/6u*4 - 11u + 1/10u6 + 0. Find the third derivative of p(l) wrt l. 72l Let a be (1 - -69)2/(-4). Let q be 2/(-4) + a/(-14). What is the third derivative of 3f + 2fq + 2f*6 - 7f + 4f wrt f? 240f*3 Let g(w) be the first derivative of 8w*5/5 + 17w*2 + 36. What is the second derivative of g(j) wrt j? 96j*2 Suppose -3l = l - 20. Find the second derivative of 99y - 95y + ly4 + 10y*4 wrt y. 180y*2 Let s(r) = -25r + 4. Let h be s(-1). What is the second derivative of ho5 - 6o + 9o + 11o wrt o? 580o3 Let o(q) = -5q + 39. Let s be o(7). Differentiate -2 - 5 - 2d2 - s + 21d*2 wrt d. 38d Let d = 98 + -58. Find the third derivative of -do2 + 11o*6 + 70o*2 + 3o*6 wrt o. 1680o*3 Let n(y) be the second derivative of 11y7/42 - y5/10 + 21y4/2 + 90y. Find the third derivative of n(g) wrt g. 660g2 - 12 Let q(r) be the third derivative of 61r*4/6 + 8r*3 + 443r*2. Find the first derivative of q(p) wrt p. 244 Let m(r) = -2r + 3. Let b = 3 - 0. Let i be m(b). Let v(u) = -9u4 + 9. Let x(k) = -10k*4 + 10. Let a(f) = iv(f) + 2x(f). Differentiate a(l) wrt l. 28l*3 What is the first derivative of 40 - 48j + 41 - 23 wrt j? -48 Let k(l) = 2l4 + 11l*3 + 80l - 5. Let i(p) = -p*4 + 2p + 1. Let r(z) = -4i(z) - k(z). What is the second derivative of r(b) wrt b? 24b*2 - 66b Let s(b) be the second derivative of 4b + 0b*5 - 9/4b*4 + 0 + 0b*2 + 0b*6 + 0b*7 + 0b*3 - 3/14b*8. Find the third derivative of s(z) wrt z. -1440z3 Let g(x) be the third derivative of x5/15 - x*4/12 - 19x*2. Let j(s) = 2s*2 - s. Let t(q) = -2g(q) + 5j(q). Find the second derivative of t(a) wrt a. 4 Let g(w) be the second derivative of -21w + 0 + 0w2 + 0w*6 + 1/6w*3 + 0w*5 - 17/21w*7 + 0w*4. What is the second derivative of g(p) wrt p? -680p*3 Let a = 179 - 177. Let w(g) be the third derivative of 0g - 4ga + 0g*3 + 1/8g*4 + 1/15g*5 + 0. What is the second derivative of w(r) wrt r? 8 Let f(w) = 0w + w - 2w + 0 + 11. Let r be f(8). What is the derivative of 0g*3 + 2g3 + g3 - 12 - 4gr wrt g? -3g*2 Let p(z) = -2z*2 - 12z - 60. Let b(a) = -6a - 30. Let o(u) = 7b(u) - 3p(u). Find the first derivative of o(d) wrt d. 12d - 6 What is the second derivative of 266i4 - 81i*4 + 252i + 188i4 + 326i*4 + 102i wrt i? 8388i2 Differentiate 9x + 47 - 2x3 + 60 + 109 + 46 wrt x. -6x*2 + 9 Let w(g) = -106g*4 - 2g*2 - 3g - 1. Let r(b) = -212b4 - 5b*2 - 8b - 3. Let z(n) = -2r(n) + 5w(n). What is the second derivative of z(l) wrt l? -1272l2 Let j(w) = -232w*4 + 2w*3 - 3w*2 - 2w - 2. Let f(o) = o4 - o3 + o*2 + o - 1. Let s(y) = -2f(y) - j(y). Find the third derivative of s(i) wrt i. 5520i Let x(l) be the first derivative of -148l*6/3 - 5l*2/2 + l - 216. What is the second derivative of x(c) wrt c? -5920c*3 Suppose 3f + 6 = 15. Let m be (0 - 2)/2 - -3. What is the third derivative of ma2 + fa*2 - 3a*2 + 2a*2 + 2a*3 wrt a? 12 Find the third derivative of -67v*5 + 188v*2 + 7v*5 - 1 - 21v*5 - 34v*5 - 29v*5 wrt v. -8640v*2 Let n(y) be the first derivative of 52y6/3 - y5 + 599y2/2 + 914. Find the second derivative of n(v) wrt v. 2080v*3 - 60v*2 Let n(d) be the first derivative of 0d*2 - 25 - d - 2/3d*3. Differentiate n(p) with respect to p. -4p Let p = -8784 + 14089. What is the third derivative of 5305h + 37h*2 - ph - 31h5 wrt h? -1860h*2 Suppose 3c - 13 = 2. Find the third derivative of 1 + cj2 + 79j*3 - 2 - 72j*3 wrt j. 42 Find the first derivative of 45t - 37432 - 123t + 37337 wrt t. -78 Let x(l) be the third derivative of -23l6/40 + l5/60 - 17l4/24 - 40l*2. Find the third derivative of x(q) wrt q. -414 Let g be ((-9)/(-12) - -3) + 4/16. What is the third derivative of 8d*4 - 5d*2 - 4d*4 - 4d*g + 12d*6 wrt d? 1440d*3 What is the second derivative of 78d*2 - 29d*2 - 6 - 651d*4 + 28d - 29d2 - 20d*2 wrt d? -7812d*2 Suppose v = -3g + 153 + 624, 6 = 2v. Find the second derivative of -gy*5 - 9y - 3y + 268y*5 wrt y. 200y*3 Let b be 4/8 + (-2)/4. Suppose bn = -4n + 48. What is the second derivative of -nt*4 + 3t*2 - 9t*2 - 10t + 6t2 wrt t? -144t*2 Let x(q) be the third derivative of -7q*6/120 + 31q*4/24 + 69q*3 - 3q*2 - 41q. Find the first derivative of x(i) wrt i. -21i2 + 31 Let f(w) = 6w*3 + 245w*2 + 19w + 528. Let x(k) = k*3 + 40k*2 + 3k + 88. Let b(s) = -6f(s) + 38x(s). Differentiate b(o) with respect to o. 6o2 + 100o Suppose 0 = 3s + t - 7, -5s + 5t + 45 = -0s. What is the derivative of -19xs + 14x*4 - 11 + 1 + 6x*4 wrt x? 4x*3 What is the third derivative of -43u*2 + 32u*5 + 49u*5 - 15u*2 wrt u? 4860u2 Let q(h) be the second derivative of -h8/3360 + h*7/840 - 7h*4/12 - 5h. Let t(p) be the third derivative of q(p). Find the third derivative of t(o) wrt o. -12 Let i be (-9 - -9) + 4-1. Let b(c) = 2c + 13. Let d be b(i). What is the third derivative of -g*5 - 2g + 2g + 6g*2 + 13g*d wrt g? 720g*2 Let n(d) be the second derivative of -809d*5/20 + 51d4/4 - d2 - 77d + 5. What is the third derivative of n(f) wrt f? -4854 Differentiate -60p*3 - 107p*4 + 121 + 29p*3 + 31p*3 with respect to p. -428p3 Let t(k) = k3 - 2k2 - 7k + 7. Let i be t(4). Find the third derivative of -30c2 - 72 + 72 - ic*4 wrt c. -264c Let g(y) = -2y2 + 7y - 1. Let r(v) = -609v3 - 8v*2 + 28v - 483. Let p(j) = 4g(j) - r(j). Find the first derivative of p(w) wrt w. 1827w*2 Let p = 119 - 93. What is the third derivative of 37w*2 + 6w*3 + pw*4 - 1 - 13w*4 - 14w*4 wrt w? -24w + 36 Let z(i) = i*3 + 15i*2 + 12i - 13. Let p be z(-14). Find the third derivative of -29b2 + b - b - pb*4 - 12b*2 wrt b. -360b Let q(j) = -13j2 + 9j - 349. Let f(s) = 5s2 - 4s + 175. Let g(i) = 5f(i) + 2q(i). Differentiate g(r) wrt r. -2r - 2 Let v = 119 + 14. Let u be v/2 - (-2)/4. What is the first derivative of 3s*3 - 5 - 67s + us wrt s? 9s*2 Suppose -2 + 0 = -u. Let q = u - -3. Find the second derivative of -o - o - 4o*5 + 5o*q - 2o wrt o. 20o3 Find the second derivative of -1947u*2 + 220u + 144u4 + 1947u*2 - 551u*4 wrt u. -4884u*2 What is the derivative of 4q - 43q2 - 211 - 7q - 2q3 + 3q + 86 wrt q? -6q2 - 86q Let g(f) = f - 1. Suppose 0d + 5m = 5d - 10, 3m = 6. Let x(l) = -dl + 0 - 3 + 2. Let k(c) = 4g(c) - x(c). What is the derivative of k(q) wrt q? 8 Let p be 22/88 + 11/4. Let a(n) be the third derivative of 0 + 0n + 0n*4 - 4n*2 - 1/12n*5 + 1/3n*p. Differentiate a(r) wrt r. -10r Let l(j) be the second derivative of -5/4j5 + 0 + 0j*3 + 20j + 1/2j2 + 0j*4. What is the first derivative of l(h) wrt h? -75h*2 Suppose -a = 3a + 12, -4q + 4a = 0. Let y be 10q/9. What is the second derivative of -r + 4r3 + r3 - 2r*3 + yr wrt r? 18r Let c(g) be the second derivative of -39g*5/10 - 43g4/12 - g3/3 + 17g + 3. Find the third derivative of c(z) wrt z. -468 Let j(b) = -b + 6. Let t be j(0). Let h be 12 - ((-15)/10 + 1)-6. Find the third derivative of -2at + 2a*6 + 4a*2 + ha*6 wrt a. 1080a*3 Find the second derivative of -82y + 5y2 - 4y*2 + 13y*4 + 3y*4 - 1 - 6y**4 wrt y. 12	{ "pile_set_name": "DM Mathematics" }
decades are there in 7/2 of a century? 35 Convert 902.197 weeks to minutes. 9094145.76 How many millilitres are there in seven halves of a litre? 3500 How many decades are there in 185.5886 centuries? 1855.886 What is 210362.5 micrometers in centimeters? 21.03625 What is 385.6198g in tonnes? 0.0003856198 How many decades are there in 2368368.3 months? 19736.4025 How many grams are there in 123.8033ng? 0.0000001238033 How many millimeters are there in one tenth of a meter? 100 What is 59.59186 millennia in centuries? 595.9186 What is 50.00637 months in millennia? 0.0041671975 How many months are there in ten thirds of a decade? 400 What is 7.958927 centuries in millennia? 0.7958927 What is 9940.668 millilitres in litres? 9.940668 Convert 92671.77 nanometers to meters. 0.00009267177 What is 3/5 of a century in years? 60 What is 7/18 of a week in minutes? 3920 What is 3/10 of a litre in millilitres? 300 How many months are there in seven quarters of a millennium? 21000 What is 3/50 of a microgram in nanograms? 60 How many millilitres are there in 6/25 of a litre? 240 How many litres are there in 0.3129168ml? 0.0003129168 What is 55/4 of a millennium in decades? 1375 What is nineteen quarters of a day in hours? 114 What is 23467.84 centimeters in micrometers? 234678400 What is 1/27 of a day in seconds? 3200 How many millimeters are there in 3/50 of a kilometer? 60000 Convert 26339.48 meters to nanometers. 26339480000000 What is 66781.09 nanograms in grams? 0.00006678109 How many centimeters are there in one fifth of a kilometer? 20000 What is three tenths of a litre in millilitres? 300 What is 6/25 of a milligram in micrograms? 240 How many millimeters are there in seven halves of a meter? 3500 How many micrometers are there in 23.31058 meters? 23310580 How many grams are there in 7/8 of a kilogram? 875 What is 1/5 of a litre in millilitres? 200 What is 53934180.3 minutes in weeks? 5350.613125 What is seven sixteenths of a century in months? 525 How many millennia are there in 0.8043577 centuries? 0.08043577 What is 49/5 of a kilogram in grams? 9800 What is 468.1275 days in milliseconds? 40446216000 How many years are there in fifty-five halves of a millennium? 27500 How many micrometers are there in 67.05064 meters? 67050640 How many kilograms are there in 0.528659ng? 0.000000000000528659 What is 0.628653ng in milligrams? 0.000000628653 Convert 178478.9nm to centimeters. 0.01784789 Convert 319722.5 kilograms to tonnes. 319.7225 What is 45057.24mm in centimeters? 4505.724 What is 10.354842 seconds in minutes? 0.1725807 How many centuries are there in 7/2 of a millennium? 35 How many tonnes are there in 328.1128 kilograms? 0.3281128 Convert 8969.344 litres to millilitres. 8969344 How many years are there in 3/5 of a millennium? 600 How many micrometers are there in 0.8660554nm? 0.0008660554 Convert 75501.72 millilitres to litres. 75.50172 How many grams are there in 36.3188 nanograms? 0.0000000363188 How many centuries are there in 2.3045 millennia? 23.045 How many milligrams are there in 3/8 of a gram? 375 What is three tenths of a litre in millilitres? 300 What is 3/25 of a microgram in nanograms? 120 What is 968.182g in milligrams? 968182 What is 1/5 of a week in minutes? 2016 How many years are there in nine tenths of a millennium? 900 How many hours are there in 0.40618 days? 9.74832 What is 178552.9 millilitres in litres? 178.5529 What is 4.331403 kilometers in micrometers? 4331403000 What is seventy-one quarters of a century in months? 21300 What is 0.1255989 weeks in nanoseconds? 75962214720000 What is 7069.457 hours in seconds? 25450045.2 Convert 487.883 millennia to months. 5854596 What is one fifth of a kilometer in centimeters? 20000 How many kilograms are there in 3023.15 milligrams? 0.00302315 What is eighteen fifths of a millennium in months? 43200 Convert 292.971 meters to millimeters. 292971 How many years are there in three tenths of a millennium? 300 How many millilitres are there in 8.494776 litres? 8494.776 Convert 9.84027 millennia to years. 9840.27 How many microseconds are there in 558377.1 milliseconds? 558377100 What is 5.221312 nanoseconds in microseconds? 0.005221312 How many nanometers are there in eighteen fifths of a micrometer? 3600 How many nanometers are there in 3/50 of a millimeter? 60000 What is sixty-nine halves of a decade in years? 345 How many months are there in 56.89668 millennia? 682760.16 How many hours are there in 43749.855 seconds? 12.1527375 How many micrometers are there in three tenths of a millimeter? 300 How many grams are there in 47/4 of a kilogram? 11750 How many millimeters are there in 112.6945 nanometers? 0.0001126945 How many micrometers are there in 6/5 of a millimeter? 1200 How many millimeters are there in eleven halves of a centimeter? 55 What is 6.777241kg in milligrams? 6777241 How many micrometers are there in 1/5 of a centimeter? 2000 How many grams are there in 92.91049ng? 0.00000009291049 What is 8/21 of a week in minutes? 3840 How many milligrams are there in 0.491056g? 491.056 How many months are there in 4/15 of a decade? 32 What is one fifth of a millennium in months? 2400 Convert 0.6382085 milligrams to kilograms. 0.0000006382085 How many months are there in 5.997611 decades? 719.71332 How many centuries are there in 42/5 of a millennium? 84 How many millilitres are there in 49/5 of a litre? 9800 How many millilitres are there in eleven halves of a litre? 5500 What is twenty-one eighths of a millimeter in micrometers? 2625 What is 5236.556um in kilometers? 0.000005236556 How many hours are there in 546.53346us? 0.00000015181485 What is sixty-seven quarters of a minute in seconds? 1005 Convert 2.7404262 months to decades. 0.022836885 What is eleven quarters of a litre in millilitres? 2750 What is sixty-three eighths of a litre in millilitres? 7875 How many micrometers are there in 846.2643 millimeters? 846264.3 How many weeks are there in 43.4032578 minutes? 0.00430587875 Convert 8092.588mg to nanograms. 8092588000 Convert 2230278.6s to minutes. 37171.31 What is 0.3873827 centimeters in meters? 0.003873827 Convert 2146.1 days to seconds. 185423040 How many millilitres are there in 7/4 of a litre? 1750 What is one quarter of a tonne in kilograms? 250 What is 90274.6 meters in millimeters? 90274600 How many nanometers are there in 0.1291495 millimeters? 129149.5 Convert 34.45602 millilitres to litres. 0.03445602 Convert 7.977175 millimeters to nanometers. 7977175 Convert 6.849198kg to micrograms. 6849198000 What is 0.0554117mg in tonnes? 0.0000000000554117 How many hours are there in 45/4 of a week? 1890 What is 8.395384 grams in kilograms? 0.008395384 How many kilograms are there in thirty-three fifths of a tonne? 6600 How many microseconds are there in 837.908 minutes? 50274480000 What is 0.3897229km in micrometers? 389722900 What is 6.75729t in kilograms? 6757.29 Convert 951390.1 minutes to nanoseconds. 57083406000000000 What is eleven eighths of a gram in milligrams? 1375 Convert 694.6851t to kilograms. 694685.1 What is one tenth of a litre in millilitres? 100 How many kilograms are there in 0.3891076 grams? 0.0003891076 What is 583.82 litres in millilitres? 583820 How many millilitres are there in twenty-one halves of a litre? 10500 How many tonnes are there in 1423.449kg? 1.423449 How many minutes are there in twenty-one eighths of a day? 3780 What is 0.2073618 months in years? 0.01728015 Convert 0.7242206ml to litres. 0.0007242206 What is seventeen halves of a kilogram in grams? 8500 What is 59143.42 millilitres in litres? 59.14342 What is 99008.05 weeks in milliseconds? 59880068640000 What is 102.4194 kilograms in tonnes? 0.1024194 Convert 504.0642l to millilitres. 504064.2 How many nanograms are there in 1/5 of a microgram? 200 What is six fifths of a millennium in years? 1200 How many kilograms are there in 39.13416t? 39134.16 How many millennia are there in 7257.576 years? 7.257576 Convert 689.282 millennia to months. 8271384 How many grams are there in twenty-one quarters of a kilogram? 5250 What is one twentieth of a millisecond in nanoseconds? 50000 What is 52731.8 seconds in milliseconds? 52731800 Convert 6.300739 minutes to seconds. 378.04434 How many mill	{ "pile_set_name": "DM Mathematics" }
units digit of t? 7 Let z be (777/(-6))/((-6)/(48/4)). Suppose 0 = -zm + 264m - 380. What is the units digit of m? 6 Let n(p) = -p*3 + 13p*2 - 18p - 15. Let r be n(11). Suppose -r = x - 322. What is the hundreds digit of x? 2 Let k(l) be the first derivative of -l*4/24 + 5l*3/3 - 39l*2/2 - 5. Let q(u) be the second derivative of k(u). What is the units digit of q(6)? 4 Let v(s) = 2s*3 + 17s*2 - 8s + 7. Let z be v(-11). Let d = 989 + z. What is the units digit of d? 9 What is the hundreds digit of (3016696/174)/(20/15)? 0 Suppose -1106 = 2d + 4c - 14330, 3d - 3c - 19845 = 0. What is the tens digit of d? 1 Suppose 0 = 3h + 3s - 1263, 2h + 3s + 441 = 3h. Let d = 672 - h. Suppose d = 6z - 684. What is the units digit of z? 5 Suppose -32g = -1181233 + 44497. What is the units digit of g? 3 Let k(s) = -173s + 46. Suppose 29l + 32 = 25l. Let j be k(l). Suppose 0b + j = 11b. What is the tens digit of b? 3 Let s be (-14 - -15)/((-1)/32). Let x = -29 - s. What is the hundreds digit of (10/x)/(3 + (-935)/315)? 1 Let y = 258 + -254. What is the hundreds digit of (-7 - 446/y)16/(-3)? 6 Suppose -6i - 6 = -9i, -4t = i - 4474. What is the hundreds digit of t? 1 Let w(n) be the first derivative of -11n4 - n3 - 3n*2/2 - 5n - 73. What is the tens digit of w(-2)? 4 Let o be (-147)/4 - ((-42)/24)/(-7). Let w = -35 - o. Let t(b) = 51b + 7. What is the units digit of t(w)? 9 Suppose 0 = 79r - 87624 - 3173970. What is the tens digit of r? 8 Suppose -5u = -2y - 53158, -35u + 33u + 21269 = 5y. What is the ten thousands digit of u? 1 Suppose -78j - 62j + 293179 = -49961. What is the tens digit of j? 5 Let b be ((-5440)/(-256))/((-1)/(-417)). Suppose 0 = -br + 1447r - 144. What is the units digit of r? 2 Let x = -1486 + 2740. What is the units digit of x? 4 Suppose 124p = 12p + 13p + 552024. What is the hundreds digit of p? 5 Let g = -58 + 69. Suppose -56 + g = -9h. Suppose -hb - 171 + 726 = 0. What is the hundreds digit of b? 1 Let s(q) be the second derivative of 67q*4/4 + 7q3/3 - q2/2 + 154q + 1. What is the hundreds digit of s(3)? 8 Let q(w) = -w2 - 42w - 17. What is the tens digit of q(-33)? 8 Let a(l) = -289l3 + 4l + 3. Suppose 2k = -2r + 6, 2r = -2r + 16. What is the tens digit of a(k)? 8 Let z = -18 - -658. Let m = z + -46. What is the hundreds digit of m? 5 What is the thousands digit of (-34)/119 + 180440/28? 6 Suppose 3d = 15d - 72. What is the units digit of (-15)/d43(4 - 10)? 5 Suppose -59z + 39z = 36z - 852992. What is the tens digit of z? 3 Let r be 2/(36/15 - 2). Suppose r = -5n, 5v + 4n + 344 = -0v. Let x = v + 193. What is the tens digit of x? 2 Let x = -67892 + 99810. What is the tens digit of x? 1 Let t(y) be the third derivative of -y6/120 + y5/3 + 3y*4/4 - 49y*3/6 - 34y*2. What is the tens digit of t(20)? 1 Let j = -41 + 151. Let f = 29 + -37. Let c = f + j. What is the tens digit of c? 0 Suppose -3i + 229 = -5r - 306, 0 = 3i + r - 559. What is the units digit of i - (-1 - -1) - 4? 1 Let u(g) = g*3 + 2g*2 + 5g + 4. Let l be u(-1). Suppose 50q - 47q - 999 = l. What is the hundreds digit of q? 3 Suppose -157949 = 76077z - 76088z. What is the units digit of z? 9 Suppose 16871 = 8w + 5863. What is the tens digit of w? 7 Suppose x = 5t - 16, t + 4 = -3x + 20. Suppose 4h - 4 = xc, -20 = -h - 4h. What is the units digit of -2 - (-143 + c)/5? 6 Let n(h) = -5h - 11. Let j be n(-3). Suppose -a = -6 + j, 3l + a = 2108. Suppose -5o + l - 192 = 0. What is the tens digit of o? 0 What is the hundreds digit of 183231/24 + 225/600? 6 Suppose -2p + 80a - 75a = -150, -4 = a. Let l = 40 - -126. Let w = l - p. What is the hundreds digit of w? 1 Let r(p) = 4p + 29. Let a be r(-7). Let z(o) = -26o - 1. Let y be z(a). Let t = 37 + y. What is the units digit of t? 0 Let i be -5 + 46164/(-24)(0 + -2). Suppose 7l = i + 274. What is the units digit of l? 8 Let p(t) = -72t2 + 39t2 + t3 - 26t + 3t - 26. What is the units digit of p(34)? 8 Suppose -23l + 24l - 17196 = -5o, 3o + 5l = 10344. What is the tens digit of o? 3 Let y(v) = 5v*3 - 281v*2 - 71v - 147. What is the tens digit of y(58)? 1 Suppose r + 1 = -3v, 2v + 3r = -0r - 3. Suppose v = 3c + 206 - 1091. What is the hundreds digit of c? 2 Suppose 66d = 43d - 92. What is the units digit of d/(-2)(673 + -4 + -10)? 8 Suppose 4z + 3444 = 4g - 0g, -3z = 4g - 3458. Let h = -568 + g. What is the hundreds digit of h? 2 Let b be ((-6)/(-12))/((-4)/(-40)). Suppose -2q + 59 = 5v - 347, v + 1069 = bq. What is the units digit of (((-110)/15)/11)/((-1)/q)? 2 Let i be 2/16 - 27761/136. Let b = i - -330. What is the units digit of b? 6 Let m = -292 + 306. What is the tens digit of m/(-3)(2 - 113)? 1 Let m = -1241 - -2173. What is the units digit of m? 2 Let u be -2 - -2 - 6/93. Let g be (-1)/4u + 39/2. Let n = -10 + g. What is the tens digit of n? 1 Let u = 25627 - 17732. What is the hundreds digit of u? 8 Let w = 62 - 37. Suppose 123l - w = 118l. Suppose 5a = -3r + 166, r - 42 = -0r - la. What is the units digit of r? 2 Let m(b) be the third derivative of -b5/60 + 13b*4/6 - 64b*3/3 + 13b*2 + b. What is the hundreds digit of m(38)? 4 Let p(x) = 0x*3 - 7x - 5 - 4x - 181x2 - x3 + 170x2. Let c be p(-7). Let t = c - -263. What is the tens digit of t? 3 Let g be 4/(-34) + (-6200)/1054. Let n(l) = -169l + 123. What is the thousands digit of n(g)? 1 Suppose -k = -2x + 1917 - 539, 4k = 3x - 2057. Let v = x - -986. What is the thousands digit of v? 1 What is the thousands digit of ((-8)/(-2))/((2/2135)/((-77)/(-35)))? 9 Let a(y) = -6y + 3y + 7y - 15 + y. Let p be a(5). Let h(f) = f*2 + 2f + 9. What is the tens digit of h(p)? 2 Suppose -252t + 262t - 1529 = 2201. What is the units digit of t? 3 Suppose 4388 = 2p + 3h - 5660, -5h = 5p - 25140. What is the thousands digit of p? 5 Suppose -17y + 105 + 82 = 0. Suppose yx - 12x + 120 = 0. What is the tens digit of x? 2 Let q = 751 + 2925. Suppose -63s + 68s = 5y - 3700, -s + q = 5y. What is the units digit of y? 6 Let u = 35045 - 23825. What is the hundreds digit of u? 2 Suppose -8a + 16 = -0. Suppose -af = w + 5, 3f - w - 2w = 15. Suppose -5j + 179 + 56 = f. What is the tens digit of j? 4 Let g(k) be the first derivative of k*4/4 - 14k*3/3 - 13k*2/2 - 13k - 169. What is the tens digit of g(15)? 1 Suppose 3c - 38286 - 92979 = 4g, -g = 2c - 87521. What is the ten thousands digit of c? 4 Suppose 0 = -11v + 8v + 9, -2v = -4b - 10. What is the units digit of (416/(-24))/(b/39)? 6 Let j(v) = -861v - 14. Let k be j(-3). Suppose 13h + k = 7223. What is the tens digit of h? 5 Let c = -60647 + 86314. What is the ten thousands digit of c? 2 What is the thousands digit of 449/1347 - 188512/(-6)? 1 Suppose 77k - 338306 = 394118. What is the units digit of k? 2 Let n be (-5 - -6)(-3 + 3)/3. Let v(f) be the first derivative of f4/4 - f2 + 20f + 1. What is the tens digit of v(n)? 2 Let g = -1615 + 2376. What is the units digit of (g(3 - 2))/((-14)/(-14))? 1 Suppose 24n = 14n + 74140. What is the units digit of n? 4 Suppose -3p + 3h + 2922 = -4977, -3p - 9h + 7851 = 0. What is the hundreds digit of p? 6 Let d = -128 + 133. Suppose 3a - 15 = -3h, h - 2a - 11 = -da. Suppose 4i = -z + 381 + 513, 0 = z - h. What is the units digit of i? 3 Let j be 5/((-10)/(-12)) - -3. Suppose 0 = jw - 100 - 17. Suppose wt = 17t - 444. What is the units digit of t? 1 Let n = 344 + -336. Suppose -457 = -ng + 239. What is the units digit of g? 7 Suppose -416 = w - 1042. Suppose 947 - 7 = 2j. Suppose -8g + w = -j. What is the tens digit of g? 3 Let u = 11660 - -18598. What is the units digit of u? 8 Let l = 1273 + -798. Suppose -4h = -481 - l. Suppose 17u - h = 2498. What is the units digit of u? 1 What is the tens digit of -194(9 - (-7405)/(-30)) + (-2)/3? 3 What is the hundreds digit of ((30/20 + -4)/5)/((-2)/1284)? 3 Let y = 64 - 35. Suppose -16 = 4z, -3k + 2z + y = -3z. Suppose -5c + 46 = 2i, -28 = -i + kc + 17. What is the tens digit of i? 3 Suppose 163 - 159 = -2q, 5s - 4q = 42748. What is the thousands digit of s? 8 Suppose -1028015 - 1007599 = -42l. What is the	{ "pile_set_name": "DM Mathematics" }
0 What is 2215775 rounded to the nearest 10000? 2220000 What is -1.8784661 rounded to 3 dps? -1.878 Round 25192300 to the nearest 1000000. 25000000 What is 110401.74 rounded to the nearest 100? 110400 Round 0.000154142 to 7 dps. 0.0001541 Round -0.137007 to one decimal place. -0.1 What is 467503 rounded to the nearest one million? 0 What is -0.00000133384 rounded to 6 decimal places? -0.000001 What is 0.02012546 rounded to three decimal places? 0.02 What is -8878995 rounded to the nearest 100000? -8900000 What is 0.00002524109 rounded to five dps? 0.00003 What is -5281700 rounded to the nearest 1000000? -5000000 What is 6332080 rounded to the nearest one hundred thousand? 6300000 Round -42.389 to the nearest ten. -40 What is -0.0013362 rounded to 4 decimal places? -0.0013 Round -2384.39 to the nearest 10. -2380 What is 115.326 rounded to the nearest 10? 120 Round 0.1068376 to three decimal places. 0.107 What is 4478.425 rounded to the nearest integer? 4478 Round -0.00036259565 to 5 dps. -0.00036 Round 371687 to the nearest 1000. 372000 Round 0.00000257553 to 7 dps. 0.0000026 Round 2236000 to the nearest 100000. 2200000 Round 0.000373829 to five dps. 0.00037 Round -0.883923 to three decimal places. -0.884 What is 7401.064 rounded to the nearest one hundred? 7400 What is -0.00001092909 rounded to 7 decimal places? -0.0000109 Round -0.43745652 to two decimal places. -0.44 Round 123527670 to the nearest 1000000. 124000000 What is -42326.31 rounded to the nearest 100? -42300 Round -0.0001466262 to six decimal places. -0.000147 Round -0.0000010170001 to seven dps. -0.000001 Round -0.0000275131 to 7 dps. -0.0000275 What is -0.0000306736 rounded to 7 dps? -0.0000307 What is -21099.95 rounded to the nearest 10? -21100 What is 0.00002895532 rounded to 6 dps? 0.000029 Round 1270.5 to the nearest ten thousand. 0 Round 838620 to the nearest 100000. 800000 What is 0.00000262484 rounded to seven decimal places? 0.0000026 Round 0.000131397 to four decimal places. 0.0001 What is 0.395065 rounded to 2 decimal places? 0.4 Round -1700.4242 to the nearest 100. -1700 What is -0.642484 rounded to 3 dps? -0.642 Round -6494.195 to the nearest one thousand. -6000 Round 4849.51 to the nearest 10. 4850 What is 11228266 rounded to the nearest one thousand? 11228000 Round 0.020739579 to 3 decimal places. 0.021 What is 18.78363 rounded to the nearest integer? 19 Round -0.03404859 to 3 decimal places. -0.034 Round 0.000001292305 to 7 decimal places. 0.0000013 Round 1620638 to the nearest 100000. 1600000 Round 107461.2 to the nearest 1000. 107000 What is 16.4585 rounded to one dp? 16.5 What is -0.06814042 rounded to three decimal places? -0.068 What is 2239.463 rounded to the nearest 100? 2200 What is 369.302 rounded to the nearest 10? 370 Round -0.000000629775 to seven decimal places. -0.0000006 What is 4.613713 rounded to 3 dps? 4.614 Round 0.13726 to two decimal places. 0.14 What is 2075330 rounded to the nearest 1000000? 2000000 Round 0.0000014312606 to seven decimal places. 0.0000014 Round 0.00012270641 to seven decimal places. 0.0001227 What is 1156975 rounded to the nearest 100000? 1200000 Round 460224 to the nearest one hundred thousand. 500000 Round 0.000710351 to 6 dps. 0.00071 Round -4426320 to the nearest one million. -4000000 What is 0.0004194744 rounded to 5 decimal places? 0.00042 Round -8893.62 to the nearest 10. -8890 What is -0.0090094 rounded to 5 dps? -0.00901 Round 95994.2 to the nearest one hundred. 96000 Round 0.12464645 to 5 dps. 0.12465 What is -1.4679279 rounded to one decimal place? -1.5 Round -132064 to the nearest 10000. -130000 Round -19600436 to the nearest 1000. -19600000 Round -0.000002611725 to 7 decimal places. -0.0000026 What is -315.61882 rounded to one decimal place? -315.6 What is -0.00571534 rounded to 5 dps? -0.00572 Round -121.73349 to zero decimal places. -122 Round -3516891 to the nearest 1000. -3517000 Round 0.00002492068 to 7 dps. 0.0000249 Round -901741 to the nearest one thousand. -902000 Round 0.1411119 to four dps. 0.1411 What is -3305.7113 rounded to the nearest integer? -3306 Round -9353.0924 to the nearest 10. -9350 Round -0.1330358 to 5 decimal places. -0.13304 What is 67251800 rounded to the nearest 1000000? 67000000 Round 0.0954605 to 3 decimal places. 0.095 What is -0.00555301 rounded to 4 decimal places? -0.0056 What is 0.00000047451 rounded to 6 dps? 0 What is 11188.6 rounded to the nearest 1000? 11000 Round -784.886 to the nearest 100. -800 Round 0.0002251191 to 5 decimal places. 0.00023 Round 8.0114068 to 1 decimal place. 8 Round 64962.3 to the nearest 1000. 65000 Round 95.41445 to the nearest 10. 100 What is 197347100 rounded to the nearest one hundred thousand? 197300000 What is -3.55443 rounded to two decimal places? -3.55 What is -30953300 rounded to the nearest 1000000? -31000000 Round -91.34282 to 0 dps. -91 Round 17.29198 to 1 dp. 17.3 What is 172510 rounded to the nearest 10000? 170000 What is -15.8393 rounded to 1 dp? -15.8 Round 0.000039976 to seven decimal places. 0.00004 What is 0.0035595 rounded to six dps? 0.00356 What is 39105600 rounded to the nearest 100000? 39100000 What is -0.40784237 rounded to 3 decimal places? -0.408 Round -1188.6485 to 1 decimal place. -1188.6 What is 19.491427 rounded to 1 decimal place? 19.5 Round -0.000229105 to six dps. -0.000229 What is -39238.095 rounded to the nearest one thousand? -39000 What is 67743.56 rounded to the nearest one hundred? 67700 What is -0.00010647 rounded to five dps? -0.00011 What is 0.00005927554 rounded to six decimal places? 0.000059 What is -0.000007718765 rounded to 7 decimal places? -0.0000077 Round -0.011946006 to 5 decimal places. -0.01195 Round 0.0000001965618 to seven dps. 0.0000002 What is -675.395 rounded to the nearest 100? -700 What is -145523.65 rounded to the nearest 100? -145500 Round -0.0002649903 to 6 decimal places. -0.000265 What is -76812800 rounded to the nearest one hundred thousand? -76800000 What is -13340.781 rounded to the nearest one hundred? -13300 Round 1513520 to the nearest ten thousand. 1510000 Round 2843370 to the nearest 10000. 2840000 What is -26190270 rounded to the nearest 100000? -26200000 What is -119647.64 rounded to the nearest one thousand? -120000 What is -494656 rounded to the nearest 1000? -495000 What is 506.971 rounded to 0 dps? 507 What is 69.53363 rounded to one dp? 69.5 Round -297.76989 to the nearest 100. -300 Round 0.0008357 to 4 decimal places. 0.0008 What is -0.00354069 rounded to two dps? 0 What is -17428.165 rounded to the nearest one thousand? -17000 What is -0.5361768 rounded to one dp? -0.5 Round 0.0000525427 to seven dps. 0.0000525 Round -0.000036417596 to seven dps. -0.0000364 What is 178901.7 rounded to the nearest 1000? 179000 Round 0.005001438 to five dps. 0.005 What is -0.00091742 rounded to four dps? -0.0009 What is -0.05446112 rounded to four dps? -0.0545 Round 0.126147 to 3 dps. 0.126 Round 0.0000230575 to seven dps. 0.0000231 Round 1.1109993 to 1 decimal place. 1.1 Round 0.010910947 to 3 dps. 0.011 Round 0.0741505 to 2 decimal places. 0.07 What is 2924750000 rounded to the nearest one million? 2925000000 Round 96.347 to the nearest integer. 96 Round -0.0092192 to three decimal places. -0.009 What is 190602.6 rounded to the nearest ten thousand? 190000 What is -0.005606005 rounded to four dps? -0.0056 What is 6842620 rounded to the nearest one hundred thousand? 6800000 What is -166498890 rounded to the nearest 1000000? -166000000 Round -52545500 to the nearest one hundred thousand. -52500000 Round 0.000598773 to six dps. 0.000599 What is -0.0000290509 rounded to 7 decimal places? -0.0000291 Round 620.4421 to the nearest ten. 620 Round -0.00295513 to five dps. -0.00296 Round 2314.685 to 0 decimal places. 2315 Round 7724.84 to the nearest one hundred. 7700 What is 0.005802205 rounded to 4 decimal places? 0.0058 Round -120217.5 to the nearest one hundred. -120200 Round 4234.43 to the nearest ten. 4230 Round 723870 to the nearest one million. 1000000 What is -0.0059229115 rounded to six decimal places? -0.005923 What is 0.00003878018 rounded to 7 decimal places? 0.0000388 Round 0.00374748 to 4 dps. 0.0037 Round -1.5965181 to 1 decimal place. -1.6 What is -0.00213225 rounded to 3 d	{ "pile_set_name": "DM Mathematics" }
mine y(i). -2 Let k(o) = 4. Let y = -3 - -2. Let v(n) = n + 1. Let q(j) = yk(j) + 5v(j). Let b(d) = -d*3 - 3d*2 - 2d - 1. Let c be b(-2). Determine q(c). -4 Let u(f) = -3f2 + f3 + 0f*3 + 209 - 203 - 2f + 7f2. Let c(m) = -m3 - 6m*2 - 3m + 5. Let n be c(-5). Calculate u(n). -9 Let y(q) = -q*2 - 7q - 9. Let g(k) = -k*3 - 4k*2 + 11k - 13. Let i be g(-6). Determine y(i). -9 Let l(y) = 3y3 + 2y - 1. Suppose -7b + 4b + 6 = 0. Suppose bp - 14 = w - 5w, 0 = -5w + p. Suppose -h = -2h + w. Calculate l(h). 4 Let b(l) = -l + 3. Suppose -y = -8t + 3t + 14, -3y + 15 = 4t. Determine b(t). 0 Suppose 4d + 2a = 7a - 5, -3d = 5a - 5. Let w(s) be the second derivative of s4/12 + 9s*2/2 - 2s. What is w(d)? 9 Let z(p) = 4p + 1. Let h(o) be the second derivative of 11o3/6 + o2 - 5o. Let n(q) = -3h(q) + 8z(q). What is n(2)? 0 Let r(d) be the third derivative of d4/12 + d3/3 + 2d2. Let c be r(-2). Let t(p) = -p3 - 2p2 - p + 2. Calculate t(c). 4 Let i(b) = -6b - 3. Let q be i(-1). Let o(t) be the third derivative of 0 + 1/24t4 + 1/120t*6 - 4t*2 + 0t - 1/60t5 - 4/3t*q. Calculate o(0). -8 Let g(q) = -4q - 1. Let u(s) = -s - 5. Let y(j) = j + 4. Let d(z) = 4u(z) + 5y(z). Let i(f) = -6d(f) - g(f). Let w be 4/6(3 + -6). Determine i(w). 5 Let t(g) = 0g + 3g - 4g - 2. Let q = 3 - -1. Calculate t(q). -6 Suppose -13j + 15j - 2 = 0. Let x(s) = -26s + 1. Determine x(j). -25 Let i(p) = -p + 2. Suppose 0 = -2h - 2h + 16. Suppose -5f - 2 = -hf. What is i(f)? 4 Let v = -7 - -4. Let j(u) = -u + 3 - 4 + 5 + 0u. Calculate j(v). 7 Suppose 0 = -3y - 2y + 5u + 5, 2u - 12 = -5y. Suppose 4i + b - 8 = 0, -4b = -yb. Let x(h) = -1 + 4 + i - h. What is x(4)? 1 Let m(l) be the first derivative of -l5/20 + l4/12 - l3/6 - l2 + 2. Let q(g) be the second derivative of m(g). Let p = 4 - 3. Determine q(p). -2 Let a(y) be the second derivative of -y4/3 + y2/2 + 38y - 2. Determine a(-1). -3 Let h(w) = -w - 10. Let n(r) = -3. Let m(o) = 4h(o) - 14n(o). Let l be m(-2). Suppose -u = u + l. Let t(i) = i. Determine t(u). -5 Let t(r) be the second derivative of 7r + 0 - 3/2r*2 + 1/6r*3. Determine t(3). 0 Suppose -2z - 4o = o - 21, 12 = z + 3o. Suppose 0 = -zx + 6 - 0. Let f(p) = 0p2 - 3 + p + px + 2 + 2p3. Determine f(1). 3 Suppose 0 = 2w + 2w. Let k(o) = -3 - o + 7 + 4 + w. Calculate k(0). 8 Let p = 2 + 3. Let j = p - 0. Let h(r) = 0r + 4r - j - r. Calculate h(5). 10 Suppose -5l - 4 = -14. Let v(c) = -17c2 + cl - 13 + 31c + 49. Let o(f) = -3f2 + 6f + 7. Let y(r) = 11o(r) - 2v(r). Determine y(4). 5 Let z = -1 - -1. Let p(j) = 2j2 - 2 + 0j - j*3 - 2j + zj. Let s be (-3)/(-2) - (-15)/30. Calculate p(s). -6 Suppose -6t + 8t = 6. Suppose -2 = v - t. Let y(w) = 1 - 3w + 1 - 1. Give y(v). -2 Let c(j) = j - 5. Let p be c(7). Let y = 5 - p. Let d(t) = -t*2 + 3t + 1. Calculate d(y). 1 Let f(w) be the third derivative of -w6/180 + w5/40 + w*4/4 - 5w2. Let b(j) be the second derivative of f(j). Determine b(3). -9 Let f(w) be the first derivative of -w5/60 - 4w3/3 - w2 + 2. Let g(i) be the second derivative of f(i). Calculate g(0). -8 Let d(c) = -3c + 7. Suppose -6 + 4 = w, -z + 15 = -5w. Give d(z). -8 Let f(x) be the third derivative of -x5/60 + 11x*4/24 - 2x*3/3 + 36x*2. What is f(10)? 6 Let s = 3 - -2. Let n = 8 - s. Let d(k) = 1 + k + 3k*2 + 2k - 4 - k*n - 2k*2. Give d(2). -1 Suppose 3p = 2p + 4. Let w = -3 - -4. Let i = p - w. Let t(h) = h3 - 3h*2 - 2h + 4. Determine t(i). -2 Suppose -s = 3z + 4, -2s + 17 = 2s + z. Let h(a) = 2a + a + 3a - sa. Suppose 10m - 5m = -4i - 22, 2m + 1 = i. Give h(m). -2 Let p(s) be the first derivative of -s*2/2 - 10s - 1. Let b(y) = -y - 10. Let o be 88/33 - ((-2)/3)/2. Let n(h) = ob(h) - 2p(h). Calculate n(0). -10 Let w = 134 - 139. Let u(r) = r*2 + 5r - 2. Calculate u(w). -2 Let g(t) = -t - 3. Let c = -2 + 6. Suppose 5z + 5 = 5s, -s - cz = -4s + 4. Let u = 4 - s. Give g(u). -7 Let a(t) be the third derivative of t5/60 + t4/8 - t*3/2 + 4t*2. Calculate a(-5). 7 Let y = 14 + -18. Let v(i) = 5i - 12. Let n(d) = -d + 3. Let t(m) = -9n(m) - 2v(m). Give t(y). 1 Let p(l) be the first derivative of l*3/3 + 3l*2 - 2l - 7. Let d = -2 - 6. Let a = d + 3. Calculate p(a). -7 Let v(b) = -2b - 1. Let x be v(-2). Let c(r) = 0r + 2 + 2r - r - xr. What is c(3)? -4 Let y(c) = c*3 + 9c*2 + 8c. Let f(l) = -l - 2. Let u(w) = -w*2 + w + 6. Let h be u(0). Let n be f(h). Give y(n). 0 Suppose 2u + 21 = -u + 3d, 0 = -4d + 12. Let v be -12(-6)/u. Let m(l) = 4l + 3. Give m(v). -9 Let m(z) = z3 - 5z*2 + 4z + 3. Let h be m(4). Let n be 1/6h0. Let x(f) = 0f + n + 2 - f. Give x(4). -2 Let o(z) be the second derivative of -z + 0z*2 + 1/6z3 + 0. Determine o(-6). -6 Let a(s) be the first derivative of -s3/3 - s*2/2 + 2s + 2. Determine a(-4). -10 Suppose -5 = 3f - 11. Let r(k) be the second derivative of -1/3k*3 + 3k + 1/2kf - 1/12k*4 + 0. What is r(-3)? -2 Let m be (-2)/4 - (-38)/4. Let b be (m/(-2))/((-3)/8). Let z(y) = b - 3y - 12. Calculate z(-2). 6 Let i(o) = -3o + 1 + 5o + o + 0. Suppose -2 = -g + 1. Suppose -gm + m - 5p = -3, -2p = -2m - 4. Give i(m). -2 Let h(r) = r*2 + 2r - 1. Let y be (-12)/24-26/3. Determine h(y). 7 Let p be (30 + -29)/((-2)/10). Let i(n) = n*3 + 6n*2 + 6n - 1. Calculate i(p). -6 Let f = 2 - 2. Let w(l) = 12l2 - 4l2 + f + l - 1. Give w(1). 8 Let k = -2 - -4. Let a(m) = -m + 5 - mk - 2 + 5m. Determine a(4). 3 Let j(n) = n2 + 9n + 5. Suppose -3k + 4y - 23 = 0, 3k - 5y + 35 = -2k. Determine j(k). -15 Let p be (-1)/((1 + -5)/8). Let n(k) = -k - 2. What is n(p)? -4 Let a(w) be the third derivative of w5/60 - w4/24 - w3 + w2. Suppose 5d = -0d + 25. Suppose -3n + 5n + x = -5, -25 = n + dx. What is a(n)? -6 Let i(u) = -u*3 - 6u*2 - 7u - 7. Let n be i(-5). Suppose nl = -l + 12. Let o(y) = y - 4. Give o(l). -1 Let q(z) be the second derivative of -z3/3 + 5z. Give q(3). -6 Let v(t) = t*2 + 6t - 2. Let a = 28 - 34. What is v(a)? -2 Let n(y) = 9y - 12. Let b(g) = 11g - 13. Let v(k) = 5b(k) - 6n(k). Determine v(-7). 0 Let r(t) = -t*3 + 9t*2 - 7t + 1. Let c(z) = -2z2 - 13z - 7. Let f be c(-5). Calculate r(f). 9 Let k be -154/(-12) + -15. Let p(d) = -d2 - 11d - 12. Calculate p(k). -2 Let r(c) be the third derivative of c6/120 - c5/15 - 2c3/3 - 32c*2 + 2c. Suppose 2i - 7 = 1. Give r(i). -4 Let v(i) = i2 + 5i. Suppose -30 = 5p - 6u + u, -2p + 3u - 14 = 0. Give v(p). -4 Let r(s) = s*2 - s + 1. Suppose 2x = -4h + 14, 2h + 2x + 7 = 5h. Suppose -n + 11 = 2g + 5, hn + 2 = -g. Give r(n). 7 Suppose p = 4p - 12. Suppose 3s - s = 3j + p, -2j + 4 = 0. Let l(c) = -c*2 + 7c - 2. Determine l(s). 8 Let k(o) = -o*2 - 9o - 1. Let r(s) = -s*3 + 5s*2 + 4s + 5. Let j be r(6). Calculate k(j). 13 Let h(t) = t*2 - t - 4. Let u(d) = -2d + 9. Let f be u(3). Determine h(f). 2 Let g(a) = a*2 - 2a + 3a - 22 + 26. Determine g(0). 4 Suppose -2f = -0f + 6. Let y(w) = -4w. Let m(d) = -d - 1. Let q(b) = -8b - 5. Let a(o) = -5m(o) + q(o). Let c(n) = 8a(n) - 5y(n). Calculate c(f). 12 Let v(b) be the first derivative of b*3/3 - 5b*2/2 - 3b + 4. Give v(4). -7 Let f(k) = -1 - 135k2 + 2k + 125k2 + 0k. What is f(1)? -9 Let a(b) = b*3 + 8b*2 + 6b - 9. Let f = -18 - -39. Suppose 4x = x - f. Let t be a(x). Let i(y) = y2 - y - 2. What is i(t)? 4 Let a(b) = b2 - 5b - 5. Let s = -62 + 68. What is a(s)? 1 Suppose -u + 3 = -0u. Suppose 0 = uc - 19 + 1. Let i be (-4)/6 - 20/c. Let x(n) = n*3 + 5n*2 + 6n + 1. Give x(i). -7 Suppose t - 4 = 4i, -i - 20 = -2t - 3t. Let q = t + -2. Let a(h) = -2h*2 + 2h - 1 - 9h2 + hq. Determine a(1). -9 Let f(v) = 12v3 - v3 - 12v3 + 4v. Determine f(-3). 15 Suppose 2r + 2x = -0r + 44, -2r = -x - 35. Let q = r + -14. Let h(y) be the first derivative of -y2/2 - y + 1. What is h(q)? -6 Let j(o) = o2 - 5o + 4. Let f be 7 - ((-15)/(-45) + (-2)/(-3)). What is j(f)? 10 Suppose 2g + 0 = -8. Let h(o) be the second derivative of -o4/12 - o3/2 - 3o2/2 + 12o. What is h(g)? -7 L	{ "pile_set_name": "DM Mathematics" }
7649? 647648 What comes next: -1013192, -1013193, -1013194, -1013195, -1013196, -1013197? -1013198 What comes next: 8468, 8469, 8470, 8471, 8472, 8473? 8474 What comes next: 212, 85, -42? -169 What is the next term in -29782, -59551, -89320, -119089? -148858 What comes next: 574, 579, 582, 583? 582 What is the next term in -19, -181, -465, -883, -1447? -2169 What comes next: 19795, 39684, 59573, 79462? 99351 What is the next term in 444, 1012, 1584, 2160? 2740 What is next in 504292, 504292, 504296, 504304, 504316, 504332, 504352? 504376 What is the next term in -580, -1382, -2182, -2980, -3776? -4570 What is the next term in 908, 866, 750, 524, 152, -402, -1174? -2200 What is next in -72495, -144996, -217497, -289998, -362499, -435000? -507501 What comes next: -854, -1644, -2308, -2780, -2994, -2884, -2384, -1428? 50 What comes next: -272, -1486, -3506, -6332? -9964 What is next in -121340, -242683, -364026, -485369? -606712 What comes next: 25182, 25189, 25196, 25203? 25210 What is next in 912, 860, 800, 732, 656, 572? 480 What comes next: -381, -376, -337, -246, -85, 164, 519? 998 What comes next: 1448881, 1448880, 1448879, 1448878? 1448877 What comes next: 16352, 32705, 49058, 65411? 81764 What is the next term in 786068, 1572136, 2358204? 3144272 What is the next term in -799, -1631, -2525, -3511, -4619, -5879? -7321 What is the next term in 14612, 28848, 43084, 57320, 71556? 85792 What comes next: 170, 337, 504, 671? 838 What is next in -9574, -19148, -28722? -38296 What is the next term in -2359, -9419, -21187, -37663, -58847, -84739, -115339? -150647 What is the next term in 5, -4, -15, -28, -43, -60? -79 What comes next: -8455, -16360, -24265? -32170 What comes next: 291, 866, 1441, 2016, 2591, 3166? 3741 What comes next: 106, 170, 236, 304, 374? 446 What is the next term in -5429, -21647, -48671, -86495, -135113, -194519, -264707, -345671? -437405 What is the next term in -70014, -70010, -70002, -69990, -69974, -69954, -69930? -69902 What is the next term in -5596, -5590, -5580, -5566? -5548 What is the next term in -978, -999, -1020, -1041, -1062? -1083 What comes next: -165, -1358, -4601, -10920, -21341? -36890 What is next in -1149638, -1149637, -1149636, -1149635, -1149634? -1149633 What is the next term in 5688, 11433, 17178, 22923? 28668 What is the next term in -479, -985, -1565, -2255, -3091, -4109, -5345, -6835? -8615 What comes next: 79, 243, 589, 1177, 2067? 3319 What is the next term in -143845, -287701, -431557? -575413 What comes next: -3739, -7481, -11221, -14959, -18695, -22429? -26161 What comes next: 3453, 6844, 10233, 13620, 17005, 20388? 23769 What is next in 492, 479, 442, 369, 248, 67, -186? -523 What comes next: -600, -597, -620, -681, -792, -965, -1212? -1545 What is the next term in -793, -1295, -1797? -2299 What is next in 3650, 7292, 10934, 14576, 18218? 21860 What is the next term in -161365, -322735, -484105, -645475, -806845, -968215? -1129585 What is next in -2, 56, 152, 286? 458 What comes next: 18357, 18356, 18363, 18384, 18425, 18492, 18591? 18728 What is the next term in 153982, 153987, 154006, 154045, 154110? 154207 What comes next: 110, 137, 194, 293, 446, 665, 962? 1349 What is the next term in -65657, -131312, -196967, -262622? -328277 What is the next term in -408, -767, -1098, -1401, -1676, -1923, -2142? -2333 What is the next term in 5581, 11178, 16775? 22372 What comes next: -11611, -11768, -11925, -12082, -12239? -12396 What comes next: 984, 1286, 2102, 3690, 6308, 10214? 15666 What is the next term in -16935, -33865, -50785, -67689, -84571, -101425? -118245 What is next in -35980, -71955, -107930, -143905? -179880 What is next in 1908951, 1908950, 1908949, 1908948, 1908947, 1908946? 1908945 What is next in 86, 331, 728, 1277, 1978, 2831? 3836 What is the next term in -387, -799, -1239, -1719, -2251, -2847, -3519, -4279? -5139 What is next in 139, 319, 499, 679? 859 What comes next: -234708, -469412, -704116, -938820? -1173524 What is the next term in 1489, 2982, 4463, 5926, 7365, 8774, 10147? 11478 What is the next term in -50955, -50961, -50971, -50985, -51003, -51025, -51051? -51081 What comes next: 760, 6208, 20992, 49780, 97240? 168040 What is the next term in -12244762, -24489524, -36734298, -48979090, -61223906, -73468752? -85713634 What is next in 3708, 7421, 11148, 14895, 18668, 22473, 26316? 30203 What comes next: -3514, -6733, -9956, -13183, -16414? -19649 What comes next: 253, 502, 749, 994, 1237, 1478? 1717 What is the next term in -158, -314, -554, -920, -1454, -2198? -3194 What comes next: 94, 187, 280, 373, 466? 559 What is the next term in 655, 606, 553, 496, 435? 370 What comes next: -1460, -1480, -1504, -1526, -1540, -1540, -1520? -1474 What is the next term in 45524, 182098, 409722, 728396, 1138120? 1638894 What comes next: 525, 820, 1115? 1410 What is the next term in 119, 9, -103, -217, -333, -451? -571 What comes next: 2762, 5542, 8350, 11192, 14074, 17002? 19982 What is next in 181918, 363847, 545786, 727741, 909718? 1091723 What is the next term in -10, -66, -254, -646, -1314? -2330 What is the next term in -4425093, -4425092, -4425091, -4425090, -4425089, -4425088? -4425087 What is next in -49, -160, -275, -394, -517? -644 What is the next term in -704, -2834, -6414, -11450, -17948, -25914, -35354, -46274? -58680 What comes next: 900872, 1801745, 2702618? 3603491 What comes next: 477336, 954674, 1432012, 1909350? 2386688 What is next in 347, 1359, 3039, 5393, 8427, 12147, 16559, 21669? 27483 What is the next term in 883, 904, 935, 976, 1027? 1088 What comes next: -1849053, -3698108, -5547163, -7396218, -9245273? -11094328 What comes next: -1115811, -1115806, -1115797, -1115784, -1115767? -1115746 What is the next term in -7684, -7681, -7678, -7675? -7672 What is next in -106073, -212147, -318221? -424295 What is next in -332, -615, -902, -1193, -1488? -1787 What comes next: 94532, 756322, 2552604, 6050624, 11817628, 20420862? 32427572 What is next in 4235, 8476, 12721, 16970? 21223 What is next in 35, 92, 145, 194, 239? 280 What is next in 71891, 71888, 71885? 71882 What is next in 811014, 1622030, 2433046, 3244062, 4055078, 4866094? 5677110 What is next in -189, -179, -177, -195, -245, -339, -489? -707 What is the next term in 2686, 2677, 2668? 2659 What is next in -447, -425, -403, -381? -359 What is next in 13596, 13566, 13526, 13476? 13416 What comes next: 292, 346, 434, 574, 784? 1082 What is next in -36996, -36998, -37000, -37002? -37004 What comes next: -1347249, -1347251, -1347253? -1347255 What is next in 34786, 34786, 34784, 34780, 34774, 34766? 34756 What is the next term in 649, 1537, 2659, 4015, 5605? 7429 What is next in 325, 355, 407, 481, 577, 695? 835 What is next in 89, 52, 17, -22, -71, -136, -223? -338 What is the next term in 3708, 7415, 11122, 14829, 18536, 22243? 25950 What is the next term in -2986, -6080, -9166, -12238, -15290, -18316, -21310? -24266 What is next in -647, -2806, -6411, -11462, -17959? -25902 What is the next term in 574, 1016, 1458, 1900? 2342 What comes next: 130, 289, 464, 661, 886? 1145 What comes next: -30747, -61505, -92265, -123027? -153791 What is the next term in -2885, -5786, -8685, -11582, -14477, -17370, -20261? -23150 What is the next term in -246, 829, 2620, 5127, 8350, 12289, 16944? 22315 What is next in 4060, 4063, 4070, 4081, 4096? 4115 What is next in -4656, -9321, -13990, -18663, -23340? -28021 What is next in 1299, 2279, 3259, 4239, 5219? 6199 What comes next: -1799, -1753, -1657, -1487, -1219? -829 What comes next: 601, 1683, 2765, 3847, 4929? 6011 What comes next: 423899, 423903, 423909, 423917, 423927, 423939? 423953 What comes next: 49, 13, -75, -239, -503, -891, -1427? -2135 What is the next term in 33231, 66461, 99689, 132915? 166139 What is next in 35, 114, 225, 368, 543, 750, 989? 1260 What is the next term in 2580, 2598, 2628, 2670? 2724 What comes next: 19747, 19715, 19683? 19651 What is next in 2702, 5396, 8090? 10784 What comes next: -26380, -26358, -26312, -26236, -26124, -25970, -25768, -25512? -25196 What is next in -6005, -24005, -54005, -96005, -150005, -216005, -294005? -384005 What is next in 283, 511, 683, 799, 859? 863 What comes next: 43, 189, 313, 415, 495? 553 What comes next:	{ "pile_set_name": "DM Mathematics" }
(sqrt(143)2 + sqrt(143)))/sqrt(11))2 + (sqrt(832) + sqrt(832)-3 + sqrt(832) - sqrt(832) - sqrt(39)/(sqrt(24)/sqrt(8)))*2-5. -18312 Simplify (-3 + ((-1 + sqrt(425))6 - (sqrt(425) - (-6(sqrt(425) - 4sqrt(425)) - sqrt(425)))) + 3)2 + -3. -1320sqrt(17) + 205733 Simplify (((0 + 3sqrt(128))6)*2 - (-6(-4 + sqrt(128))-1)2) + 1. 2304sqrt(2) + 36289 Simplify 5((sqrt(77)/(1sqrt(22)/sqrt(2))2 - 1(-5 + sqrt(7)-2)3) + -5). 50 + 40sqrt(7) Simplify (sqrt(3888)4 + (-2sqrt(108))/sqrt(4))/(sqrt(576)6-2). -23sqrt(3)/48 Simplify -5(4 + 2sqrt(3) - sqrt(30)/(sqrt(10)-3))2 - ((sqrt(210) + (sqrt(210) - 1sqrt(210)) - sqrt(210))/sqrt(10))/(-2-2sqrt(7) + sqrt(7)). -485/3 - 280sqrt(3)/3 Simplify 2((5 + (sqrt(1300) - (sqrt(1300) + 2) - sqrt(1300)))2 - (sqrt(1300) + -3 + 0 + sqrt(1300) - sqrt(1300))2 - (6sqrt(1300)-1 + 4)). -8 + 120sqrt(13) Simplify -2 + (sqrt(15)/sqrt(3) + -5 + -1 - (2sqrt(60)3)/sqrt(12))2 + -2. 60sqrt(5) + 157 Simplify -1(-3 + sqrt(18) + 1)2 - ((sqrt(4) - sqrt(40)/(sqrt(50)/sqrt(5))) + sqrt(4) + sqrt(4))/(-3sqrt(18) - sqrt(2)). -22 + 61sqrt(2)/5 Simplify -3((3(sqrt(112) + sqrt(7)) + (sqrt(7) - sqrt(112)6))2 + 4 + (0 + sqrt(42)/sqrt(6))2 + 2). -1383 Simplify 2 + (1(sqrt(30)/sqrt(6) + sqrt(5)) - (sqrt(5) + (sqrt(60)1)/sqrt(12)))2 + ((sqrt(3000) - sqrt(30))/sqrt(6) + -5)2. -90sqrt(5) + 432 Simplify (((sqrt(72) - sqrt(72)1)/sqrt(12) - sqrt(600)-1)-4)/(6sqrt(144)/(-2sqrt(8) + sqrt(8))). 20sqrt(3)/9 Simplify -62(-3((-3 + (sqrt(700) - (sqrt(700) + -5sqrt(700)-1)))5 + 4))2. -47263068 - 594000sqrt(7) Simplify (1(sqrt(121) + sqrt(121) + -51sqrt(121)) + (-6sqrt(121)2 - -2sqrt(121)-5))/(((sqrt(66) - sqrt(66)1)6 - sqrt(66))/(-5-1sqrt(6))). 125sqrt(11) Simplify 3(sqrt(117) + -1 - (sqrt(13)1-4)2) - (1sqrt(117)-4)/sqrt(9)5. -627 + 29sqrt(13) Simplify (1 + sqrt(2736) + -3 + sqrt(2736) + (sqrt(2736) + -1)3 + sqrt(2736) - (5 + (sqrt(2736) - 2sqrt(2736)) + 2sqrt(2736)3))2. -240sqrt(19) + 2836 Simplify ((-4(sqrt(13) + 1))2 + (0 + sqrt(13))-2 - (1sqrt(13)4-4)2) + ((2sqrt(13)5 - (sqrt(1872) + -2 + sqrt(1872))) + 2)2. -540 - 82sqrt(13) Simplify 66((sqrt(162) + (0 + sqrt(162) + 4)*2 - (2 + sqrt(162) + 3)) + (4(3 + -5 + sqrt(162)))*2). -18144sqrt(2) + 101844 Simplify (((sqrt(102)2 + sqrt(102))-6)/(sqrt(6) + sqrt(6) + 2sqrt(96)))2 - ((sqrt(204)-2 - sqrt(204))/sqrt(12) - (sqrt(272) + -2 + sqrt(272))*2). -29sqrt(17) + 28677/25 Simplify ((2sqrt(95) + sqrt(95) + sqrt(95) - sqrt(95))-6)/(sqrt(5) - (sqrt(120)/sqrt(3))/sqrt(8) - sqrt(5)) + -3 + 2(sqrt(76) + 0). -3 + 22sqrt(19) Simplify -5 + (sqrt(95) + sqrt(95) + (sqrt(95) - -3-2sqrt(95)) + -4sqrt(95)-1)/((sqrt(3240)-1 - sqrt(3240))/sqrt(8)). -5 - sqrt(19)/18 Simplify 1(((sqrt(68) + sqrt(68) + sqrt(68)1 - sqrt(68))4)/(sqrt(324)2 + sqrt(324) + sqrt(324) + sqrt(324)) - (3 + (-4 + sqrt(153))1)). -127sqrt(17)/45 + 1 Simplify (-5 + (2 + -1sqrt(3) - sqrt(3)) + sqrt(27)1-4 - (0 + (sqrt(30) + sqrt(750) + 1sqrt(750) + sqrt(30))/(sqrt(640)1)))*2. 93sqrt(3) + 2919/4 Simplify 3-2(((sqrt(363) + 3 + sqrt(363)-4)-6)*2 + 3). -707634 + 42768sqrt(3) Simplify (4 + (-5sqrt(121)1)/(sqrt(77)/(sqrt(7) + sqrt(28))) + 6(sqrt(11) + sqrt(66)/sqrt(6) + 1) + 5 + 1)2. -96sqrt(11) + 355 Simplify (-3 + 3 + sqrt(405) + 43sqrt(5))*2 - (sqrt(180)2)/(sqrt(72)/(sqrt(56)/sqrt(7))). -4sqrt(5) + 2205 Simplify 46(3 + (3(sqrt(612)-1 + -4 + sqrt(612)-2 + 1 + 0))*2). 23328sqrt(17) + 1191744 Simplify (1(-3sqrt(425))*2 + 3 + 2sqrt(425))-2 - (4(3 + sqrt(425)-4)-3)*2. -988152 + 17260sqrt(17) Simplify (sqrt(3888)-1 + 5 + -1-2sqrt(3888) - ((sqrt(144) + sqrt(144) + -3sqrt(144))/sqrt(3) + sqrt(48) + sqrt(96)/(sqrt(2) + sqrt(18))))*2. 350sqrt(3) + 3700 Simplify (sqrt(19) + sqrt(19) + 0 + sqrt(76) - (sqrt(228)/(2sqrt(12)))2)-2 + (0 + sqrt(1539) + 1)*2-13. -9221/2 - 62sqrt(19) Simplify (1 + 2 + ((sqrt(171) - -2sqrt(171))3 + (sqrt(171)22 - sqrt(171) - sqrt(171)))/(((sqrt(9) - (sqrt(9) - sqrt(45)/sqrt(405))) + sqrt(9))-5))2. -297sqrt(19)/25 + 208719/2500 Simplify ((2sqrt(48)5 - sqrt(48)) + (1sqrt(240)/sqrt(5) - sqrt(48)))/(sqrt(32)/(-4sqrt(40)/sqrt(5))). -72sqrt(3) Simplify (3 + 3 + -252sqrt(2299)5)2. -13200sqrt(19) + 22990036 Simplify ((sqrt(144) - (sqrt(144) + sqrt(144)2))/sqrt(3))2 - (5 + (sqrt(147) - (1(sqrt(147) + (sqrt(147) - (sqrt(147) + 1sqrt(147)))) - sqrt(147))))2. -421 - 140sqrt(3) Simplify (6sqrt(44)/sqrt(4) + 4 + (sqrt(99) - (5(sqrt(99) - -2sqrt(99)))2) - (-1((sqrt(11) - (sqrt(11) + 1 + sqrt(11)))-3 + -1))2-4)-5. -285sqrt(11) + 109295 Simplify 1 + ((sqrt(3) + sqrt(21)/sqrt(7))-2 - -11sqrt(3)) + (-4sqrt(225))/(sqrt(30)/(sqrt(10) + sqrt(10)-1 + sqrt(10))). -23sqrt(3) + 1 Simplify (sqrt(35)-25 + sqrt(315) + sqrt(315)-3)/((sqrt(672)/(sqrt(192) - sqrt(12)))/(sqrt(8) + sqrt(64)/(sqrt(16)/sqrt(2)))). -96sqrt(5) Simplify ((sqrt(360) + (sqrt(360) - (sqrt(360) + -1sqrt(360))3) - sqrt(360) - sqrt(360))/sqrt(12)1)/(sqrt(216)6 + (sqrt(96)3 - sqrt(96))). 0 Simplify 5 + 5(sqrt(24)/((3sqrt(432) - sqrt(12)) + sqrt(12) + sqrt(12)) + -4)6. -115 + 30sqrt(2)/19 Simplify ((((sqrt(2299) - -1sqrt(2299)-1 - -4(1 + sqrt(2299))) + (sqrt(2299) - -22sqrt(2299))-4)6 + 5)-3)2. -551232sqrt(19) + 190695825 Simplify (sqrt(468)-26-3)2 + ((sqrt(78) - sqrt(78)2)-1)/((sqrt(864)-1 - sqrt(864)) + sqrt(864) - sqrt(864)). -sqrt(13)/24 + 606528 Simplify (-1 + 2 + 6(-4 + sqrt(468)) + 1 + (3 + (sqrt(468) - (sqrt(468) + 3)) - sqrt(468)))2-1. -12184 + 1320sqrt(13) Simplify 3((sqrt(110) + sqrt(110) + 5-1sqrt(110) + (sqrt(110) - sqrt(110)-25))/(sqrt(110)/(sqrt(33)/sqrt(3)-4 - sqrt(11))))2. 52800 Simplify (4 + 5((sqrt(200)1 + 0)5 + 0) + 2)*2. 3000sqrt(2) + 125036 Simplify (1((-1 + sqrt(605))-3 - sqrt(605))6)2 + (sqrt(720)/sqrt(9) - sqrt(55)/(sqrt(11)1))*24. -9504sqrt(5) + 348984 Simplify (-42((sqrt(5) - sqrt(5)-1) + sqrt(5))-1-4)*2 + ((sqrt(720) + 0)1 + -4)-1. -12sqrt(5) + 46084 Simplify (-4 + (sqrt(704)-21 - (sqrt(704) + sqrt(704)2 + 5)) + sqrt(704) + -2 + sqrt(704) + -2 + -3 + 1)26. 4320sqrt(11) + 39366 Simplify (-5 + 4 + 3 + 2(2sqrt(1216) + 0 + 4))-6. -192sqrt(19) - 60 Simplify (((-2sqrt(126) - sqrt(126))/sqrt(6) - sqrt(21))/(sqrt(7) + sqrt(28)2) + (sqrt(99)/(sqrt(22)/sqrt(2)))/(sqrt(27)1 + sqrt(27)))-6. 19sqrt(3)/5 Simplify (-5 + ((5 + (sqrt(112) + -2 - sqrt(112)) + 4)5 + -2)3)*2. 8836 Simplify 5(((sqrt(208) + (sqrt(208) + sqrt(208)-3 - sqrt(208)))1)*2 + 2 + (4(sqrt(13) + -1) + -6sqrt(637))2). 1520sqrt(13) + 98110 Simplify -1 + (-1(4 + (sqrt(1300)1 + -2 - sqrt(1300) - (sqrt(1300) + (sqrt(1300) - (sqrt(1300) + 2 + 0)))))1)2. -80sqrt(13) + 1315 Simplify 3 + 2sqrt(637) + -3 - -5(sqrt(1573) + -1 + 0)*2. -96sqrt(13) + 7870 Simplify (3(sqrt(490) - ((sqrt(490) - -2sqrt(490)-3) + sqrt(490) - sqrt(490))))/((sqrt(20) - -1sqrt(2000))/(sqrt(40)/(sqrt(10)-2))). -63sqrt(2)/11 Simplify (6-4sqrt(228)-24)/(sqrt(108)/(3sqrt(9)) + sqrt(12) - (sqrt(12) - (sqrt(12) - (sqrt(768)2 - sqrt(12))))). -576sqrt(19)/41 Simplify (((sqrt(64)/sqrt(2))/sqrt(2))/(sqrt(16)/(sqrt(4)2)))/((sqrt(2) - (-2(sqrt(4)/sqrt(2) - sqrt(2)) - sqrt(2))) + sqrt(8)-3). -sqrt(2)/2 Simplify -2 + -5(2((sqrt(1728)3-5 - sqrt(1728)) + sqrt(1728) + sqrt(1728) + 5))*2. -6774262 + 67200sqrt(3) Simplify 5(-6(sqrt(133)2 - sqrt(133)) + (sqrt(133) - -2sqrt(133)1))/((sqrt(1008)-2 + sqrt(1008))/(sqrt(44)/(sqrt(22)/sqrt(2)))). 5sqrt(19)/2 Simplify ((2-2sqrt(104) - 1(sqrt(104) - 1sqrt(104)))-6)/((sqrt(128)25 - sqrt(128) - sqrt(128))4) + -2. -2 + 3sqrt(13)/16 Simplify (-1sqrt(560) - (sqrt(315) + sqrt(315)-3 - sqrt(315))/sqrt(9))/((sqrt(70)2)/sqrt(10)3). -sqrt(5)/6 Simplify (-2 + (5(1sqrt(567) + 5)2 + -1)2)5. 44100sqrt(7) + 295495 Simplify (sqrt(2916)-1 + sqrt(396)/sqrt(176))/((sqrt(98) + sqrt(98)2)3 - (sqrt(98)-1 - sqrt(98))3)-6. 3sqrt(2)/2 Simplify 1 + -14(5 + sqrt(180)-2 + 0). -19 + 48sqrt(5) Simplify (-3 + (6sqrt(209)-1 + -2sqrt(209)2)/(sqrt(99)/(sqrt(729)1 + sqrt(729))) + -1)2. 1440sqrt(19) + 615616 Simplify (sqrt(2448)-11 + ((sqrt(2448) + -1 + sqrt(2448))*-4	{ "pile_set_name": "DM Mathematics" }
t g(m) = m*2 + m. Let b(c) = -2c*2 + 2c. Let w(t) = -b(t) - 4g(t). Factor w(a). -2a(a + 3) Let y(m) be the second derivative of -m7/126 + m6/90 + m5/60 - m4/36 + 5m. Suppose y(p) = 0. What is p? -1, 0, 1 Let f(q) be the second derivative of -1/4q4 - 9/2q*2 + 0 - 2q*3 + q. Factor f(g). -3(g + 1)(g + 3) Let v be ((-9)/27)/((-2)/18). Let t(i) be the first derivative of -3/5i*5 + 0i*2 - v + 1/3i*6 + 0i*3 + 1/4i*4 + 0i. Determine o so that t(o) = 0. 0, 1/2, 1 Suppose 0 = -5v - g + 15, 4v - 2v - 2g - 6 = 0. Factor 2p5 + 0 - vp*3 - 2p*4 + 4p*2 - 2 + 2p - p*3. 2(p - 1)*3(p + 1)*2 Let h be (-2)/22(-291)/970. Find i, given that 3/5i*2 - 3/5 - 3/5i*3 + hi = 0. -1, 1 Let z(s) be the third derivative of -s5/180 - s4/72 - 2s2. Determine h so that z(h) = 0. -1, 0 Let b(t) = -11t3 + t2 - 5t - 5. Let d(f) = -5f3 + f2 - 2f - 2. Let r(i) = 2b(i) - 5d(i). Factor r(v). 3v*2(v - 1) Suppose 0r + 4r = 2r. Factor 4/7w*3 - 6/7w*2 + rw + 2/7. 2(w - 1)2(2w + 1)/7 Let f(m) = -m. Let s be f(-4). Let k = -4 + s. Factor 2 + ki - 5i2 + 3i + 0. -(i - 1)(5i + 2) Let o = 943 - 3759/4. Let -3f + of*2 + 1/4f*4 - 3/2f*3 + 1 = 0. Calculate f. 1, 2 Let g(p) be the third derivative of -3/10p*5 - 11/105p*7 + 0p + 0p3 + 0 + 1/6p4 - p2 + 1/56p8 + 1/4p*6. Factor g(l). 2l(l - 1)3(3l - 2) Factor -3/7a + 4/7a2 - 18/7 + 1/7a*3. (a - 2)(a + 3)*2/7 Suppose 12 = 5v - 2v. Let q(h) = 2h - 5. Let a be q(v). Factor 2t4 + 10t*5 - 4t*3 + 2t*a - 8t*5 - 2t*2. 2t*2(t - 1)(t + 1)2 Let q(d) be the second derivative of -d4/60 + d3/6 - 3d*2/5 - 10d. Factor q(x). -(x - 3)(x - 2)/5 Let u = -38 + 41. Let -2/7g - 2/7g5 + 0g*4 + 0g*2 + 4/7gu + 0 = 0. What is g? -1, 0, 1 Let w(q) be the third derivative of q9/20160 - q8/3360 - q7/1680 + q6/120 + q5/20 + 3q2. Let b(t) be the third derivative of w(t). Factor b(z). 3(z - 2)(z - 1)(z + 1) Factor 9x - 9x + 7x3 - 4x*3 - 18x*2. 3x*2(x - 6) Determine a so that 0 - 2/3a - 2/9a*2 = 0. -3, 0 Factor -2/5u*2 + 4/5u*3 + 0u - 2/5u4 + 0. -2u*2(u - 1)*2/5 Let c = 8 + -38/5. Let a be (-2 + 2)/(-2 - 0). Solve -cb*3 + 0b + a - 1/5b2 - 1/5b*4 = 0. -1, 0 Let y be (-1)/(-14) - (-18)/42. Let k(g) be the first derivative of 2 - 2g + g*2 + 2/3g*3 - yg*4. Factor k(h). -2(h - 1)*2(h + 1) Let h(l) = l*3 - 3l*2 + 2l + 3. Let r be h(3). Let i be 03/r + 2. Factor 0f2 + f2 + f*4 + 2f*3 - if - 2f2. f(f - 1)(f + 1)(f + 2) Let f be (-180)/(-351) - (-5)/((-65)/(-2)). Let v(p) be the first derivative of -4p - p2 - 2 + fp*3. Factor v(j). 2(j - 2)(j + 1) Suppose -2/7b*2 + 6/7b - 4/7 = 0. What is b? 1, 2 Let p(k) be the second derivative of -k10/30240 - k9/7560 - k8/6720 + k4/4 + 3k. Let n(o) be the third derivative of p(o). Factor n(b). -b3(b + 1)*2 Let h(u) be the second derivative of 0u*2 - 1/42u*7 - 1/6u*3 + 1/10u*5 + 0u*6 + 0 - 3u + 0u4. Factor h(j). -j(j - 1)*2(j + 1)2 Let d(t) be the first derivative of -t7/1960 - t*3/3 + 4. Let k(y) be the third derivative of d(y). Suppose k(i) = 0. What is i? 0 Let b(d) = -3d*2 + 7d - 6. Let s(z) = 3z2 - 6z + 6. Let c(k) = -3b(k) - 2s(k). Find v, given that c(v) = 0. 1, 2 Let z(f) = 18f2 + 5f - 6. Let o be 5-112/(-10). Let v(l) = -2 + l + 0 + ol2 + l. Let y(h) = 7v(h) - 2z(h). Let y(k) = 0. What is k? -1, 1/3 Let f(h) = -h. Let t(g) = -5g*2 - 7g. Let p(s) = 2f(s) - t(s). Solve p(w) = 0. -1, 0 Let r be (22 + 2)/(3/4). Suppose -4t - r = -f, 3t - t - 38 = -4f. Factor -2 - 2c - 2c*2 - 8c - fc2 + 6. -2(c + 1)(7c - 2) Factor 4/3i2 + 4/3i - 4/3 - 4/3i3. -4(i - 1)*2(i + 1)/3 Let u = -28 + 169/6. Let l(a) be the second derivative of 0 + 1/15a6 - 3a + 0a2 + ua*3 + 0a*5 - 1/6a*4 - 1/42a*7. Suppose l(j) = 0. What is j? -1, 0, 1 Let q be (-6 - (-6 - 5)) + -3. Factor 0y*q - 1/3y*3 + 0 + 1/3y. -y(y - 1)(y + 1)/3 Let f be (-1)/((-12)/9) - (-46)/24. Find z such that 2/3z + 0 + fz2 = 0. -1/4, 0 Let k(v) be the third derivative of -v8/504 - v*7/630 - 2v*2. Find m, given that k(m) = 0. -1/2, 0 Factor 4 + 4c*2 + 22/3c + 2/3c3. 2(c + 1)(c + 2)(c + 3)/3 Let z = 386 + -382. Solve 2/5dz - 2/5d*2 + 2/5d + 0 - 2/5d3 = 0 for d. -1, 0, 1 Let h(t) = 2t + 5. Let q be h(0). Let i(y) be the third derivative of 1/6y3 + 0y + 0 + 2y2 + 27/80y*q - 3/8y*4. Factor i(b). (9b - 2)2/4 Let n(g) be the second derivative of -g6/60 + 3g5/10 - 23g*4/12 + 5g*3 - 25g*2/4 - 43g + 2. Determine h so that n(h) = 0. 1, 5 Solve -9j5 - 2j*3 + 11j*5 + 4j*3 + 4j4 = 0. -1, 0 Let d(k) = -k5 - 4k3 + 6k*2 + 5k. Let z be (0 - 11)/(-1 - -2). Let p(n) = -2n5 - 7n*3 + 11n*2 + 9n. Let j(f) = zd(f) + 6p(f). Factor j(o). -o(o - 1)2(o + 1)*2 Let t be (6/24)/((-2)/(-4)). Factor -tw*3 - 1/2w + 0 - w*2. -w(w + 1)2/2 Let n(f) be the third derivative of -f6/780 + f5/195 - f4/156 - 8f2. Factor n(y). -2y(y - 1)2/13 Factor 4f + 12 - 20/3f2 + 4/3f*3. 4(f - 3)*2(f + 1)/3 Suppose 3o - 3 = -o + 5f, 14 = 5o + 4f. Let a(p) be the first derivative of 2/7po - 2 + 2/7p*3 - 2/7p. Solve a(r) = 0 for r. -1, 1/3 Let x(h) = 5h4 + 3h*3 - 12h*2 + 8h + 4. Let l(i) = 10i4 + 6i*3 - 24i*2 + 17i + 9. Let m(j) = -4l(j) + 9x(j). Let m(s) = 0. Calculate s. -2, 0, 2/5, 1 Let n(g) be the third derivative of -3g2 + 1/12g*3 - 1/840g*7 - 5/96g*4 + 0 + 0g + 1/80g5 + 1/480g*6. Suppose n(h) = 0. Calculate h. -2, 1 Let p be ((-6)/(-8))/((-1)/(-4)). Suppose -2t - 8 = -5z, pz - 3t + 1 = 2z. Suppose zg2 + 2 + 2 - 6g + 0g = 0. Calculate g. 1, 2 Let l = 7 - 10. Let z(n) = 9n*2 + n. Let f(o) = -3o*2. Let i(u) = lz(u) - 8f(u). Factor i(w). -3w(w + 1) Let n = 233/20 + -58/5. Let t(i) be the third derivative of -3/8i*4 - ni*5 + 0i*3 + 0 + 3i*2 + 0i. Find v, given that t(v) = 0. -3, 0 Let j be -15/(10/(-8)). Suppose 74o*2 + 4o*3 - 4o - 2 - 74o2 + 2o*j = 0. Calculate o. -1, 1 Find j, given that 4j*2 - 2/7j*5 - 2/7j*3 - 8/7j*4 + 40/7j + 16/7 = 0. -2, -1, 2 Determine j, given that 2j4 + 5j*5 + 23j*3 - 33j*3 - 2j*4 + 5j = 0. -1, 0, 1 Let j(p) be the second derivative of p*7/63 + 2p6/45 - p4/9 - p*3/9 - 7p. Factor j(s). 2s(s - 1)(s + 1)3/3 Let o(l) = -4l*4 - 5l*3 - 2l*2 + 42l - 17. Let b(x) = 3x4 + 3x3 + x2 - 28x + 11. Let n(d) = -7b(d) - 5o(d). Let n(z) = 0. What is z? -2, 1, 4 Let f(a) = -a4 + a3 + a2 + 1. Let z = -1 - 5. Let q(s) = 4s*4 - 2s*3 - 6s*2 - 4s - 4. Let l(j) = zf(j) - q(j). Solve l(v) = 0. -1, 1 Let l(n) be the first derivative of -n5/110 + n4/66 - 2n - 1. Let x(c) be the first derivative of l(c). Find m such that x(m) = 0. 0, 1 Let m(r) = r*2 - 4r - 42. Let p be m(-5). Find q, given that -1/5qp - 2/5q*2 + 0 + 0q = 0. -2, 0 Suppose 3o - 4s + 6s + 3 = 0, 6 = o + 3s. Let q be 3 - 1 - (3 + o). Solve gq + 1 - 3 + 2 + g3 = 0 for g. -1, 0 Let d be 2/3 + 332/60 + -6. Let p(z) be the first derivative of 1/10z4 + 0z*3 - dz*2 - 2 + 0z. Find w such that p(w) = 0. -1, 0, 1 Determine r, given that -2 - 1/4r2 - 3/2r = 0. -4, -2 Let q(p) be the third derivative of 0p3 + 0 - 1/180p5 + p2 + 0p - 1/36p*4. Factor q(y). -y(y + 2)/3 Let m = -701/4 + 176. Solve -7/4s4 - ms*2 + 3s*3 + 0 - 1/2s = 0 for s. -2/7, 0, 1 Let d be (-5)/(-150)(-6)/(-4). Let n = 23/60 - d. Factor 0j*2 - 1/3j*3 + nj + 0. -j(j - 1)(j + 1)/3 Let s(j) be the first derivative of j6/360 - j5/30 + j*4/6 + 2j3/3 + 1. Let z(k) be the third derivative of s(k). Factor z(y). (y - 2)2 Let n(z) be the first derivative of -4z3/21 - 3z*2/7 - 2z/7 + 4. Factor n(w). -2(w + 1)(2w + 1)/7 Factor -4f*4 - 202f - 172f2 + 1082f - 71f3 - 9f*3 - 140f*2 - 484. -4(f - 1)*2(f + 11)*2 Let s be (-26)/13 + (-57)/(-26). Let f = s - -27/130. Factor 4/5 + fy*2 + 6/5y. 2(y + 1)(y + 2)/5 Let q(z) be the first derivative of -z4/16 + z3/12 + z*2/8 + 9z + 4. Let y(v) be the first derivative of q(v). Factor y(m). -(m	{ "pile_set_name": "DM Mathematics" }
4? 2 Let r(p) = p*2 - 11p + 13. Let s be r(-6). Let f = -76 + s. What is the tens digit of f? 3 Let y be 2/(-6) - (-1348)/12. Let b = y + -57. Let o = b + -27. What is the units digit of o? 8 Let f(p) = -p*2 + 36p + 68. What is the tens digit of f(18)? 9 Let f = 6 + -114. Let u = f - -193. What is the tens digit of u? 8 Let n = -3 - 11. Let k = n + 30. Let c = k - 11. What is the units digit of c? 5 Let k(v) = 19v + 55. What is the tens digit of k(5)? 5 Suppose 5f = -5m - 0f - 30, 0 = 5m + f + 30. Let b = 16 + m. What is the tens digit of b? 1 Let i be ((-5)/15)/(1/(-9)). Suppose 0 = 2y - 17 + i. Suppose -5d + 4f = -13, -d + 4f = y - 0. What is the units digit of d? 5 Let q = -2241 - -4467. What is the tens digit of q? 2 Suppose 2l = 7l - 5u - 15, 1 = 3l + 5u. Suppose 146 = 3x - t, lt - 94 = -2x + t. What is the tens digit of x? 4 Let l(p) = p + 8. Let d be l(-6). Suppose -5 + d = -g. Suppose -gk = -9, 8 = 2c - c - 4k. What is the units digit of c? 0 What is the hundreds digit of 2302 + 6 + -9 + -6? 2 Let x(r) = 7r2 + 0r + r - 5 + 0r2 + 2r. What is the units digit of x(3)? 7 Suppose -241 = -a - 5m, -m + 4m = -2a + 461. Let g = 326 - a. What is the units digit of g? 0 Suppose -9y + 36 = -0y. Suppose 0b - 3i - 40 = -b, 245 = yb + 5i. What is the tens digit of b? 5 Suppose 4t + 2b = 338, -t - 3b - 9 + 86 = 0. What is the tens digit of t? 8 Let a(o) = 26o + 27. What is the units digit of a(16)? 3 Suppose 188 = -u + 2u + 2g, -4u - g = -780. What is the hundreds digit of u? 1 What is the units digit of 661 + (-14)/(-2)? 3 Let q(k) = k2 - 4k + 6. Let c be q(3). Suppose 2w + cw = 55. Suppose h + w - 41 = 0. What is the units digit of h? 0 Let v(h) = 25h2 + 217h - 224h - 2 + 2h*2. What is the units digit of v(-3)? 2 Suppose 6 = 2t - 0t. Suppose -33 = -3n - ty, n + 0 = y + 1. Let p(g) = g3 - 6g*2 + 4g + 7. What is the units digit of p(n)? 1 Suppose -5b + 2y = -3y + 10, 5y = 4b + 11. Suppose -2u - b = -h - 2, 0 = 2u + 5h - 31. What is the units digit of u? 3 Let o(i) = 87i + 40. What is the hundreds digit of o(8)? 7 Let m(w) = -2w*3 + 3w*2 - 10w - 7. What is the units digit of m(-5)? 8 Suppose 4k + 8 + 24 = 0. Let w(p) be the second derivative of p5/20 + 3p*4/4 + 7p*3/6 - 3p*2/2 - 9p. What is the units digit of w(k)? 5 Let r = 25 - 16. Suppose -u = r - 15. Suppose -ub + 66 = -0b. What is the units digit of b? 1 Let a = -28 + 37. Suppose 282 = -aj + 1272. What is the tens digit of j? 1 Let l(v) = -v2 + 7v - 14. Let q be l(6). Let n = q - -24. What is the units digit of n? 6 Let s(o) = -2o3 + 34o*2 - 16o - 5. What is the units digit of s(5)? 5 Suppose 5d = -5d + 50. Suppose 2v - du = -3v + 95, 10 = -2u. What is the units digit of v? 4 Suppose 0 = 3579z - 3572z - 16044. What is the tens digit of z? 9 Let q(f) = 3f + 27. Let y be q(-10). Let z(x) = 18x*2 + x - 7. What is the tens digit of z(y)? 5 Suppose 0 = -0m + 2m - 6. Suppose -mi - 45 = 15. What is the units digit of (16/i)/1-15? 2 Let r be 2/3 + (-16240)/(-30). Suppose 0 = -5k + r + 178. What is the units digit of k? 4 Let q(c) = -c*3 - 8c*2 + 9c - 5. Let x be q(-7). Let p = 195 + x. What is the units digit of p? 8 Suppose 5x - 480 = 5. Suppose 6s - x = 5s. What is the tens digit of s? 9 Suppose 15 = p + 3n, n + n = 4p - 18. Let z(u) = u2 + 4u + 3. What is the units digit of z(p)? 3 Suppose -4d + 3 = -9. Let m be -4 + d2/3. What is the units digit of -2 + (-2)/m - -26? 5 Suppose 8x = -0 + 16. Suppose 2c - 2f - 28 = 16, xc + 5f = 37. What is the units digit of c? 1 Suppose -6y + 8y = 5v - 8312, v = 4y + 1648. What is the units digit of v? 4 Let w be ((-2)/3)/((-8)/48). Let v be -51(-14)/244 + -4. Suppose -v = -wc - 43. What is the tens digit of c? 1 Suppose 4c = 27 + 17. Let x = 8 + c. Let s = -6 + x. What is the tens digit of s? 1 Let v = 128 + -123. Suppose 0j + 1120 = vq + 5j, 5j - 240 = -q. What is the tens digit of q? 2 Let u = 21 + -56. Let h = u + 74. What is the units digit of h? 9 Let h = 96 + -92. Suppose 0 = 5j - 3c - 288 - 462, 0 = -hj - 3c + 600. What is the units digit of j? 0 What is the units digit of (104/(-14))/(50/(-36925))? 6 Suppose 4f - 12 = 0, 6t - 9t + 3f = -12315. What is the hundreds digit of t? 1 Suppose 0 = -2d - 3l + 16, 3d - 3l = -8 + 2. Suppose 63 = 3i - 3m, i = di - 2m - 17. What is the units digit of i? 5 Let f = 4 - -8. Let p be f/(-42) - 116/(-14). Let y = 26 - p. What is the tens digit of y? 1 Let c(g) = -g3 + 9g*2 + 21g - 26. Suppose 0b + 4b + 4o = 20, 60 = 4b - 4o. What is the units digit of c(b)? 4 Suppose -4h + p + 1961 = 0, -2p + 163 + 334 = h. What is the hundreds digit of h? 4 What is the hundreds digit of 5 + 387/(-81) + 8564/18? 4 Let x(a) = -a3 + 5a*2 + 3a - 7. Let i(s) = -s*3 + s + 2. Let y be i(-2). Let j be 5-1(y - 9). What is the units digit of x(j)? 8 What is the tens digit of 124/(-8) - -243? 3 Let i(j) = -j*3 - 7j*2 + 6j - 4. Let s be i(-7). Let r = -2 - s. What is the units digit of r? 4 What is the units digit of 14/21 - 3712/(-12)? 0 Let m(l) = 3l2 - 2 + 1039l - 4l2 - 1037l + 4 - 4l3. Let w = 0 + -1. What is the units digit of m(w)? 3 Let o(f) = -26f + 1. Let j be o(-1). Let t(m) = m*3 + 15m*2 - 35m + 24. Let k be t(-17). Let r = k - j. What is the units digit of r? 4 Suppose -h = 0, 3 = -0g - 3g - 4h. What is the hundreds digit of g/2 - (-2490)/20? 1 Let y(b) = -b3 - 8b*2 - b + 14. Let v be (9/4)/((-4)/16). What is the tens digit of y(v)? 0 What is the tens digit of 1/1 + 390 - -6? 9 Let x be 7 + 0 + -1 + 0/2. Suppose xk - 1380 = -6k. What is the hundreds digit of k? 1 Let n(f) = 6f*3 + 9f*2 - 6f - 8. What is the tens digit of n(6)? 7 Suppose -5h + 2r = -5109, -4h + 6r + 4082 = 7r. What is the units digit of h? 1 Let v(o) = -2o - 8. Let s be v(4). What is the units digit of 12/(-10)(s + -129)? 4 Let f be 422/6 - (-4)/6. Suppose -3s - 174 = 4w, 0s = 5w + s + 212. Let i = w + f. What is the units digit of i? 9 Let f(g) = -g + 10. Let v be f(6). Suppose -b = 3q - 3 + v, -q + 1 = b. Suppose bn = 4w - 62, -w - n + 8 = -4n. What is the tens digit of w? 1 Let n = -619 - -1843. What is the units digit of n? 4 Let l be 8/12 - 176/12. Let x be 128/(l/3 - -4). What is the units digit of ((-2)/(-3))/((-16)/x)? 8 Let z(x) = -x2 + 7x + 7. Let q be z(8). Let v be (((-4)/q)/4)/1. Let i(o) = 46o3 - o2 + 1. What is the units digit of i(v)? 6 Suppose -4f + 5y + 170 = f, 2y - 34 = -f. Let w = 15 + f. What is the tens digit of w? 4 Let x(b) = 7b + 11b - 8b + 8b + 5. Let a be x(11). Suppose 5d = -4i + a, -3i = -d - 6 - 151. What is the tens digit of i? 5 Suppose 5x = -4t + 1063, 2x = -5t + 1459 - 143. What is the tens digit of t? 6 Suppose 3g + 3i - 207 = 0, 0 = 5g + 3i - 5i - 310. Let v = g + -56. What is the units digit of v? 8 Let p = -2198 + 4508. What is the tens digit of p? 1 Suppose -1029 = -6x + 1161. What is the units digit of x? 5 Let b be 2/416. Suppose -4g - 5f - 5 = -1, bg + 5f = -8. Suppose 72 - g = 4h. What is the units digit of h? 7 Suppose 5c + 5n = 0, 2c = 4c - 2n + 12. Let o be -41 - (-3 - c)1. Let b = o + 63. What is the units digit of b? 2 Let k(n) = 876n2 - 109n - 212. What is the units digit of k(-2)? 0 Suppose 9u + 44 = 13u. Let j = 59 + u. Let m = -21 + j. What is the tens digit of m? 4 Let k = 131 + -142. Let x(w) = 2w2 - 7w - 36. What is the tens digit of x(k)? 8 Let n = 33 + 189. What is the tens digit of n? 2 Suppose z - 8 = -4l, -z + 0l - 10 = -5l. Suppose 3u + 159 - 783 = z. What is the hundreds digit of u? 2 Suppose -4n + 2w = -378, -4n + 2w - w = -377. Let g = n + -15. What is the tens digit of g? 7 Let q(b) = b*2 + 44b + 19. Let l(s) = -2s2 - 44s - 18. Let k(p) = -4l(p) - 3q(p). What is the units digit of k(-11)? 6 Suppose -2j = -j - 3g + 4, -17 = -4j + g. Suppose -jh - x = -6x - 580, 0 = -h - x + 108. What is the units digit of h? 2 Suppose 24 = 4j + 4f, j + 3f - 5 = 5. Suppose jo + x + 25 = -0x, -5 = -2o + 3x. Let b = 9 + o. What is the units digit of b? 4 Let m(a) = 157*a + 17. What is the hundreds digit of m(4)? 6 L	{ "pile_set_name": "DM Mathematics" }
z - 2z*2 - 22. -2(z + 5)*2 Factor 5q3 - q3 - 7q3 + q3. -2q3 Let d(u) be the second derivative of -u6/120 - 3u5/40 - 5u*4/48 + 34u. Factor d(x). -x*2(x + 1)(x + 5)/4 Let i be 117/(-15) - (0 + -8). Let il*2 - 2/5l - 3/5 = 0. What is l? -1, 3 Let w be (-12)/18 + 6/9. Let l(c) be the third derivative of w - 1/60c6 + 0c*3 + 1/60c5 - c2 + 0c + 1/210c*7 + 0c4. Find f such that l(f) = 0. 0, 1 Let h(r) be the third derivative of r8/2520 + r7/1260 - r6/270 + 2r3/3 - 4r*2. Let d(g) be the first derivative of h(g). Factor d(w). 2w*2(w - 1)(w + 2)/3 Let g be 0 + (2 + -1)3. Let j = -104 + 107. Factor gh3 - j - 1 - 4h - 2h - h3. 2(h - 2)(h + 1)2 Suppose -1 = j - 0, -5j = 5d - 5. Let q(t) be the second derivative of -dt + 0 - 1/18t4 + 1/6t*2 - 1/18t*3. Determine k so that q(k) = 0. -1, 1/2 Let k(u) = -5u*2 + 6u. Let r(q) = 11q2 - 12q. Let s = -9 - -11. Let p(o) = sr(o) + 5k(o). Solve p(y) = 0. 0, 2 Factor -9/5a + 6/5a*3 + 6/5a*2 + 3/5a*5 - 9/5a*4 + 3/5. 3(a - 1)*4(a + 1)/5 Let q be (-24 - -1)/((-5)/(-25)). Let n be 2/(-7) - q/35. Factor 2/7g5 + 0g + 16/7gn - 10/7g*4 + 0 - 8/7g*2. 2g*2(g - 2)*2(g - 1)/7 Let m be 1 + 0 + 1 - 0. Factor 0a2 + 4a*m - 2a*2. 2a*2 Let t = 12 + -10. Let s(m) be the second derivative of 0m*2 + 0 - 1/20m*5 + 1/90m*6 + 1/12m*4 - 1/18m*3 - tm. Determine i so that s(i) = 0. 0, 1 Suppose 3m + 0m - 36 = 0. Factor -1 + 6l - 2l*3 + ml*3 - 6l*2 - 6l*2 - 3l4. -(l - 1)3(3l - 1) Let r(n) be the second derivative of 3n5/20 + n4/4 - n3 - 14n. Factor r(t). 3t(t - 1)(t + 2) Suppose 3 = -c + 5h - 4h, 0 = 5c + h - 15. Let n(b) be the third derivative of 0b5 - 1/108b*4 - 3b*c + 0 + 0b + 0b3 + 1/540b*6. Factor n(l). 2l(l - 1)(l + 1)/9 Let o(z) be the third derivative of -z5/60 + z3/6 + z2. Suppose o(a) = 0. Calculate a. -1, 1 Let n(m) = -m2 + 3m + 1. Let b be 33/6 - 2/4. Suppose bz + 16 = -19. Let k(o) = -2o2 + 6o + 3. Let f(j) = zn(j) + 3k(j). Let f(g) = 0. What is g? 1, 2 Solve 6/5 - 17/5c + 11/5c2 = 0. 6/11, 1 Let p(x) = x2 - 1. Let t be p(1). Suppose t = 4d + 20, -3m + m - 21 = 5d. Find k such that k3 + 4 + 9k*3 + mk - 6k2 - 10k2 = 0. -2/5, 1 Let t(y) be the first derivative of -y6/90 + y4/18 - y2/6 + 3y - 2. Let u(r) be the first derivative of t(r). Factor u(j). -(j - 1)2(j + 1)*2/3 Suppose 4u + 25 = -u. Let p(o) = 9o3 + 2o*2. Let d(c) = -6c3 - c2. Let y(z) = up(z) - 7d(z). What is h in y(h) = 0? -1, 0 Let f(c) be the first derivative of 0c2 + 1/12c*4 + 0c*3 + 1/15c*5 - 1 + 0c. Solve f(j) = 0. -1, 0 Factor 4/7z4 + 0z + 0 - 2/7z5 - 2/7z*3 + 0z*2. -2z*3(z - 1)2/7 Let n(r) be the second derivative of r5/35 + r*4/7 - 4r*3/7 - 16r*2/7 + 21r. Factor n(j). 4(j - 2)(j + 1)(j + 4)/7 Let q be 3/(0 - 3/4). Let k = -1 - q. Factor -t5 + 2t2 - t5 - 4t3 + 6t*k - 2t*4. -2t*2(t - 1)(t + 1)2 Factor 8d - 2d3 + 8 + 0 + 174d*2 - 176d*2. -2(d - 2)(d + 1)(d + 2) Let y(l) = -3l2 + 21l + 3. Let v be y(7). Factor vt + 6t*3 - 3/2t*4 - 15/2t*2 + 0. -3t(t - 2)(t - 1)2/2 Let p(g) = g3 - 10g2 - g + 14. Let y be p(10). Let u be y/(-10) + 72/105. Factor -4/7d*3 + 2/7d + 0 + ud2. -2d(d - 1)(2d + 1)/7 Suppose 2 + 4 = -3c. Let h(k) = -3k - 1. Let r be h(c). Solve -rl*2 + 3l*2 - 4l + 0l2 = 0 for l. -2, 0 Suppose v = -4s - 19 + 1, 2v + 3s = -11. Determine w, given that 9 - 12 + 2w4 - vw*3 + 3 - 4w*2 = 0. -1, 0, 2 Let w(k) be the first derivative of 8k*5/5 + 43k*4/10 + 16k3/5 - k2/5 - 4k/5 + 7. Determine d so that w(d) = 0. -1, -2/5, 1/4 Let j(s) be the first derivative of -s7/840 + s6/180 - s5/120 - s3 + 2. Let y(g) be the third derivative of j(g). Factor y(r). -r(r - 1)*2 Suppose -17b - 3b = 0. Factor -3/4s*3 + bs + 3/2s2 + 0. -3s*2(s - 2)/4 Let o(v) be the third derivative of 0 + 0v6 + 0v + 0v3 - 1/735v*7 + 0v*5 + 4v*2 + 0v*4. Suppose o(j) = 0. Calculate j. 0 Suppose 9/7m + 30/7 - 3/7m2 = 0. Calculate m. -2, 5 Let q = 5 + -4. Let l be 0 - q - (-12)/3. Determine r, given that 2r*4 + 0r*2 - 8/5r*5 + 0r + 0 - 2/5rl = 0. 0, 1/4, 1 Let z(k) be the first derivative of -k5/30 + k4/6 - 7k*2/2 - 7. Let m(p) be the second derivative of z(p). What is t in m(t) = 0? 0, 2 Factor 0z*2 + 3z*2 + 16z - 7z2. -4z(z - 4) Let u = -7/30 + 26/15. Solve 1/2 + ux*2 - 1/2x*3 - 3/2x = 0 for x. 1 Let w be ((-2)/4)/(3/(-12)). Let u = w + 0. What is a in 1/3au + 1/3a - 1/3a4 + 0 - 1/3a3 = 0? -1, 0, 1 Let d(x) be the first derivative of -x7/2520 + x6/360 - x4/18 - 2x3/3 + 4. Let q(o) be the third derivative of d(o). Suppose q(v) = 0. Calculate v. -1, 2 Let 2j - 6j - 7j*3 + 6j*2 + 5j*3 = 0. What is j? 0, 1, 2 Let v be (-21)/2816/(-18). Solve 0 + 1/3d + 1/3d*3 + vd2 = 0 for d. -1, 0 Let j(u) be the first derivative of -u6/120 - u5/30 + u4/8 - u*2/2 - 6. Let m(p) be the second derivative of j(p). Factor m(n). -n(n - 1)(n + 3) Find m such that 12 + 20m*3 - 30m*2 - 22 - 35m + 15m5 + 0 + 40m4 = 0. -1, -2/3, 1 Let r(n) = -n2 - 11n - 10. Suppose -v + 4w = 6, 48 = v - 6v + 2w. Let d be r(v). Factor 0t2 + dt + 0 + 0t3 - 1/4t4. -t4/4 Let c(z) be the third derivative of z6/300 + z5/75 + z*4/60 + 2z*2. Find g such that c(g) = 0. -1, 0 Suppose 2q - 16 = -6. Determine c, given that -5c4 - 12c*2 + 8c*3 + 2c + c + qc - 2 + 3c*4 = 0. 1 Let w = 68 + -407/6. Let d(h) be the second derivative of 0h*2 + h - wh*3 + 1/30h*6 + 0 - 1/12h*4 + 1/20h5. Determine u, given that d(u) = 0. -1, 0, 1 Let d(u) = u3 - 25u2 - 3u + 77. Let t be d(25). What is k in -3/2kt + 0k*3 + 0 + 9/2k*4 + 0k + 3k5 = 0? -1, 0, 1/2 Let f(l) = 17l*2 - 7l + 8. Let c(x) be the third derivative of x5/15 - x4/12 + x*3/3 + 2x*2. Let k(v) = -9c(v) + 2f(v). Factor k(o). -2(o - 1)2 Let v(u) be the second derivative of u4/36 + u3/9 + u2/6 - 5u. Let v(q) = 0. Calculate q. -1 Factor 4w*4 + 52w*2 + 16 - 21w - 27w - 12w*3 + 7w*3 - 19w*3. 4(w - 2)*2(w - 1)*2 Let b be 2(-3 + 1) + 2. Let y be 2 + -3 + (b - -6). Let -1/2i4 + 1/2i + 1/2i2 + 0 - 1/2i*y = 0. Calculate i. -1, 0, 1 Let j(r) be the first derivative of -2/5r*2 + 2/15r*3 + 2 + 0r. Factor j(z). 2z(z - 2)/5 Solve 0b + 34b*2 - 4b - 30b2 = 0. 0, 1 Let o(l) be the first derivative of -l7/105 - l6/30 + l5/30 + l4/6 - l2/2 + 3. Let p(m) be the second derivative of o(m). Solve p(w) = 0. -2, -1, 0, 1 Let h(a) be the second derivative of 0 + 0a*2 - 1/36a*4 - 1/9a*3 + 2a. What is f in h(f) = 0? -2, 0 Let f = -537/187 - -55/17. Solve 0 + 2/11y2 + fy = 0. -2, 0 Suppose -i - 4 + 3 = 0. Let t be (i/10)/((-3)/12). Factor t - 4/5u - 6/5u*2. -2(u + 1)(3u - 1)/5 Let i(m) = 23m5 + 87m*4 + 14m*3 - 104m*2 - 20m + 4. Let w(k) = k5 + k3 - k*2 - k - 1. Let f(s) = i(s) + 4w(s). Suppose f(x) = 0. Calculate x. -2, -2/9, 0, 1 Let k(u) be the first derivative of 0u4 + 0u + 1/12u3 - 1/2u*2 - 1/120u*5 - 4. Let g(n) be the second derivative of k(n). Factor g(l). -(l - 1)(l + 1)/2 Let j = 3 - 1. Let w be (18/15)/(6/20). Solve 0y - 49/2y*5 - jy*3 + 14y*w + 0y2 + 0 = 0. 0, 2/7 Let m(u) be the second derivative of u7/5040 + u6/720 + u5/240 - u*4/2 - 5u. Let o(t) be the third derivative of m(t). Find v, given that o(v) = 0. -1 Let m be 0/2 - ((-220)/35 + 6). Solve m + 0q - 2/7q*2 = 0. -1, 1 Suppose -3m = 49 - 58. Find b, given that -1/3bm - 1/3 + 1/3b*2 + 1/3b = 0. -1, 1 What is s in 10 - 33s2 + 5s*5 - 2s + 10s - 20s*3 + 7s + 23s2 = 0? -1, 1, 2 Suppose -3v + 12 = v. Solve -12g - 2g*2 - 5g*2 + vg*2 = 0. -3, 0 Factor -36/7r - 2/7r2 - 162/7. -2(r + 9)*2/7 Let l(x) = -7x*2 + 5x. Let s(z) = z*2 - z + 1. Let p(w) = -l(w) - 6s(w). Find k, given that p(k) = 0. -3, 2 Let d be (-171)/10 + 2/4. Let p = d + 17. Factor -2/5t4 - 2/5t*5 + 0 + pt*3 + 2/5t*2 + 0t. -2t2(t - 1)(t + 1)2/5 Let r be (-5 + 3/1)2. Let k be (2/(-6)*r)/	{ "pile_set_name": "DM Mathematics" }
-312 or -2? -2 Is 573 greater than 573? False Which is greater: -1 or -1/1063? -1/1063 Which is smaller: 201/2 or 100? 100 Is -6/4045 greater than 2/3? False Which is greater: 155 or 309/2? 155 Is 27/19 smaller than 0.3? False Is 0.08 at least 16? False Are -472 and 1 equal? False Is -15/2056 smaller than 1? True Are -24 and -16 equal? False Is 1/1557 smaller than 0? False Which is greater: 1 or -16/147? 1 Are -1 and 2/959 equal? False Do -3266 and -3266 have the same value? True Are 72 and -5 non-equal? True Which is smaller: 849 or 0.05? 0.05 Do 1870 and 1875 have different values? True Which is bigger: -3894 or -3901? -3894 Is 41/2 at most -0.56? False Is -7 greater than -15? True Which is bigger: 2/115 or -5? 2/115 Is -140 equal to -142? False Is -15 greater than -14? False Is 873 >= 3497/4? False Which is smaller: 217 or 1? 1 Is 5/2 greater than 171? False Which is smaller: 772/21 or 37? 772/21 Is -114 > -340/3? False Which is smaller: 9 or 5? 5 Which is bigger: -676 or -678? -676 Are 10363/3 and 3455 equal? False Is 110 at most as big as 112? True Is 26752 < 26753? True Which is bigger: 0 or -29/95? 0 Are 24 and 28 non-equal? True Which is greater: 0.02 or -41? 0.02 Is 374 equal to 372? False Are -7 and -14/5 nonequal? True Which is smaller: -2 or -4772? -4772 Which is bigger: 12702 or 12704? 12704 Is -7 > -0.25? False Is 23/83 > -1? True Which is greater: -125/304 or 1? 1 Is 347/5 smaller than -0.2? False Which is smaller: 1 or 17/786? 17/786 Is 1096 <= 4379/4? False Which is smaller: -13351 or -13350? -13351 Which is smaller: 0 or 54? 0 Is -5 greater than or equal to -1096? True Is -1034 smaller than -2? True Which is smaller: 2 or 7.889? 2 Is 13 at most 15? True Is 0 bigger than -46/145? True Is 3 greater than -1/271? True Which is greater: 0.5 or -103? 0.5 Are 4363 and 4365 nonequal? True Which is smaller: 0 or 2/1837? 0 Is -2/3573 equal to 1? False Are 9270 and 9269 unequal? True Which is greater: -33 or -35? -33 Is 74 at most 71? False Which is smaller: -20696 or 0.1? -20696 Are 0 and -11/263 non-equal? True Is -4169 bigger than -4169? False Which is smaller: -523/2 or -261? -523/2 Which is bigger: 30.8 or 2? 30.8 Which is greater: -0.3 or 1/199? 1/199 Which is smaller: -77 or -1/6? -77 Which is bigger: 4 or -25? 4 Which is smaller: 1954 or 13674/7? 13674/7 Which is smaller: 69 or 19? 19 Which is bigger: 80 or 88? 88 Which is bigger: 1 or 3/25774? 1 Is -12 > 6? False Which is smaller: 1 or 97/7? 1 Is 3.2 less than or equal to 23/4? True Is -18517 < -18517? False Do 0.2 and -4387 have different values? True Which is smaller: -1 or 18889? -1 Which is bigger: 3 or 1.2? 3 Which is smaller: 15603 or 15601? 15601 Is -24166/7 less than -3452? True Is 12/17 != 0? True Which is smaller: -43 or -31? -43 Which is bigger: 45/8 or 1? 45/8 Is 263 smaller than 254? False Do 9675 and 9675 have different values? False Which is greater: -2/15 or 65? 65 Is 70 greater than or equal to 72? False Is 1 smaller than -6/18145? False Do -31 and -31 have different values? False Which is smaller: 12 or 92? 12 Which is smaller: -44/7 or 0.38? -44/7 Which is smaller: 2353/6 or 393? 2353/6 Which is smaller: 1725/26 or 65? 65 Is 16896 at least as big as 16896? True Are -19 and -7/5 nonequal? True Are 1 and 1/22181 non-equal? True Which is smaller: -3 or -1582? -1582 Are 6/59 and -0.1 equal? False Which is greater: -8/35 or 39? 39 Which is smaller: 0 or 3/92? 0 Which is bigger: -1 or -2/2687? -2/2687 Which is smaller: -30 or 0? -30 Which is smaller: 127/27 or 5? 127/27 Which is bigger: -45 or -177/4? -177/4 Is -2/4599 greater than or equal to 0? False Do -1/398 and 0.1 have different values? True Which is smaller: 1/2311 or -1? -1 Which is greater: 130 or 23? 130 Is -3603 >= -3602? False Which is smaller: -1 or -1/1013? -1 Which is bigger: 248 or 249? 249 Which is smaller: -3/1670 or 1? -3/1670 Which is smaller: 0 or 2/825? 0 Is 1 bigger than -85? True Is -191 at least as big as 4/7? False Does -1649 = -1649? True Which is smaller: -0.1 or -3.98? -3.98 Which is bigger: 0 or 3/79? 3/79 Which is smaller: 8422/13 or 648? 8422/13 Is -116 at least as big as 5? False Is 23.4 > -1? True Which is greater: 60 or -15? 60 Is -2.1 at most as big as -444? False Is 3 < -189? False Which is smaller: 0 or -27/91? -27/91 Is -783 != -3922/5? True Is 0.06 < 35/2? True Is 10691 bigger than 10690? True Is 2857 > 2856? True Which is smaller: -10079/4 or -2519? -10079/4 Which is bigger: 5/4 or 10? 10 Which is greater: -14/117 or 1? 1 Is 36 > 41? False Which is greater: -9 or -53/6? -53/6 Are -1 and -203 nonequal? True Is 190 bigger than 189? True Which is smaller: -239 or -258? -258 Is 2/19 at most -200? False Which is greater: 89 or 88? 89 Which is greater: -1.3 or 0.02? 0.02 Is -13307 bigger than -13308? True Which is bigger: 1 or -1/383? 1 Is 1/9374 greater than 0? True Which is greater: 1 or 1/1495? 1 Do 35 and 21 have the same value? False Which is smaller: -35 or -2/123? -35 Is 8/3 greater than 2? True Which is smaller: -137 or 90? -137 Which is bigger: -0.08 or -32/19? -0.08 Which is greater: -31/6 or -6? -31/6 Which is bigger: -2/657 or -3? -2/657 Which is bigger: -149 or -150? -149 Is -1615 > 3? False Which is bigger: -2/7 or -1/959? -1/959 Which is bigger: -1/28 or 5/3? 5/3 Which is smaller: -13 or -29? -29 Is -10 at least as big as -140/13? True Is 32 smaller than 41? True Is 167 at most 5? False Are -73 and -2.9 equal? False Which is bigger: -7 or -10? -7 Is 5708 at most 5710? True Is -17 > -17? False Is -8/465 > 1? False Which is smaller: 846 or 847? 846 Which is smaller: 1/4 or 2/99? 2/99 Which is bigger: 2018 or 2019? 2019 Which is bigger: 4142 or 4146? 4146 Which is smaller: -1 or 4/299? -1 Which is greater: -1 or -5498? -1 Is -14606 at least as big as -14607? True Is 139 less than or equal to 134? False Which is smaller: 76 or 65? 65 Is 12/179 at most as big as 1? True Which is bigger: 1471 or -2? 1471 Is 300 at least 295? True Does -1729 = -1729? True Which is smaller: -4950 or -4951? -4951 Which is bigger: 523/7 or 75? 75 Which is bigger: -27 or -346/13? -346/13 Do -622 and -622 have the same value? True Which is greater: -439 or -441? -439 Are 30 and 9 equal? False Is -234 smaller than -6? True Which is smaller: 4/2615 or 1? 4/2615 Is -63 > -63? False Are 6308 and 6309 unequal? True Which is smaller: -1114 or -1112? -1114 Is -1345 at most -1343? True Are 334 and 333 unequal? True Which is smaller: -30803 or -30801? -30803 Is 113 greater than or equal to 113? True Which is bigger: 123 or 124? 124 Is 0 < 10/157? True Which is greater: 324 or -1.1? 324 Is 1 smaller than 0.29? False Is -3673 at most -1? True Is -1030 > -1032? True Is 0.1 at most as big as -0.0746? False Are 1157 and 1156 unequal? True Is 2/265 not equal to 1/3? True Is -2 less than -60/73? True Is -3 <= 65? True Which is smaller: -102 or -108? -108 Which is smaller: -9/35 or 0? -9/35 Which is smaller: 18 or 9? 9 Is 8 less than 4/629? False Is -1 <= 2/5353? True Which is bigger: -162 or -164? -162 Do 936 and 932 have different values? True Which is smaller: 8754/25 or 351? 8754/25 Which is greater: -4 or -3871? -4 Is 54/139 <= 0? False Which is smaller: 0.1 or -448? -448 Which is smaller: -130 or 5? -130 Which is smaller: -0.013 or -0.095? -0.095 Which is greater: -38 or -1.2? -1.2 Which is greater: 13.3 or -1/5? 13.3 Which is smaller: -65 or -50? -65 Is 1 != 15/97? True Which is greater: -6026/7 or -862? -6026/7 Are 11 and -10 non-equal? True Which is smaller: 39 or 40? 39 Which is smaller: -3/3074 or 1? -3/3074 Which is greater: 0 or 24/109? 24/109 Which is smaller: 3146 or 3148? 3146 Which is bigger: -0.1 or -149? -0.1 Is 1 < 327/185? True Is -2 greater than or equal to 30/7? False Which is smaller: -5/1209 or 0? -5/1209 Do -38/11 and 0 have the same value? False Which is bigger: -20/19 or -4? -20/19 Which is greater: 0 or -13.9? 0 Which is bigger: 4 or -25? 4 Is 65 > 0? True Are 592 and 591 unequal? True Which is greater: 5/5552 or 1? 1 Which is bigger: -2 or -139/187? -139/187 Is -6 at most 15? True Is -48 not equal to 12? True Are 49305 and 49304 non-equal? True Is -4455 at least -4453? False Is -0.451 > -1? True Is 0.17 greater than -11? True Is -205 equal to 7? False Which is greater: -11958	{ "pile_set_name": "DM Mathematics" }
t and 13. 13 Suppose 31o + 3o = -408. Let q be ((-299)/52)/(3/o). What is the highest common factor of 989 and q? 23 Let h = 3481 + -3178. Calculate the greatest common divisor of 1919 and h. 101 Let n be 8/(-6)(42/(-12) - 1). Let h = -309 + 411. What is the highest common divisor of h and n? 6 Let j(g) = -1700g - 2200. Let a be j(-8). Calculate the greatest common factor of a and 20. 20 Let g(l) = 6049 - 6290 + 8l + l + 7l. Let c be g(17). Calculate the highest common factor of c and 186. 31 Suppose -4x - 2d = -72, -5x - 9d + 90 = -4d. Calculate the greatest common divisor of 146 and x. 2 Let s(w) = -84w + 3532. Let h be s(42). Let r(u) = 2u3 - 10u*2 + 8u + 4. Let y be r(6). What is the greatest common factor of y and h? 4 Suppose -7x + 18 = -x. Suppose 0 = -xo + b + 11, -4o - 6 + 4 = 2b. What is the highest common divisor of o and 50? 2 Let j = 5346 - -6643. What is the greatest common divisor of 76 and j? 19 Let h be (-8 + -1)(-3)/9. Let t(v) = 4v + 7. Let g be t(-4). Let w = 15 + g. What is the greatest common divisor of w and h? 3 Suppose 92q - 12847 - 11420 + 9363 = 0. Calculate the greatest common divisor of q and 14013. 81 Suppose -q - i = -17, 2 = -2i - 6. Let f = q + 53. Suppose 5x - t - 41 = f, 4x = -2t + 106. What is the greatest common factor of x and 72? 24 Suppose -21p - 825 = -16p. Let y = -127 - p. What is the highest common factor of y and 133? 19 Suppose 4y - 3h - 171 = 63, 2y + h - 112 = 0. Let d be 1(0 - 2 - -2). Let k be -3 - (-21 + (d - 1)). Calculate the greatest common divisor of k and y. 19 Suppose 0 = 3m + 9 - 96. Let g = -12 - -14. Suppose 4q = -5k + gq + 135, k - 2q = 39. Calculate the greatest common divisor of m and k. 29 Suppose -5y + 2028 = -2u - 3926, y = u + 1195. Calculate the highest common divisor of 1080 and y. 108 Suppose 31 = -l - k, 2l = -4k + 6k - 58. Let p = -24 - l. Suppose 8i - pi - 24 = 0. What is the greatest common factor of 48 and i? 12 Let v be (53/53)/(2/294). What is the highest common factor of 196 and v? 49 Let w(x) = -x3 + 11x*2 - 14x - 22. Let z be w(7). Let k = -83 + 121. What is the highest common divisor of z and k? 38 Suppose -74x = -38x - 46x + 6150. Calculate the greatest common divisor of 10 and x. 5 Suppose 0 = -781o + 786o - 30. Suppose -357 = -ob + 147. What is the greatest common divisor of b and 108? 12 Let f = 9670 - 9087. Calculate the highest common factor of f and 473. 11 Let u = 846 - 831. Let h be (105/u)/((-1)/(-3)). What is the highest common divisor of h and 3? 3 Let l be (84/(-8) - 13)/((-6)/1488). What is the greatest common divisor of 248 and l? 124 Let p(i) = -4i - 19. Let q be p(-6). Suppose 4g + 88 = -qn, 5g - 20 = 2n + 2. Let h = 43 + n. What is the greatest common factor of h and 27? 27 Let u be -5 + (43/2 - (-5)/(-10)). Calculate the highest common factor of 2504 and u. 8 Suppose 15q - 21q = -m - 510, -2q + 170 = 3m. What is the greatest common divisor of 459 and q? 17 Let n be (-41760)/(-84)3/67. Calculate the greatest common divisor of n and 60. 60 Suppose 257q - 5079145 = -1283255. Calculate the greatest common factor of 70 and q. 70 Let b = -99 - -136. Suppose bs - 35s - 2136 = 0. What is the highest common divisor of s and 12? 12 Let c = 3768 - 3647. Let x(i) = -i*3 - 3i*2 + 3i - 2. Let w be x(-6). What is the highest common divisor of w and c? 11 Suppose -150 = -c - 4s, -4c + 763 = 3s + 111. Suppose 0 = 3x - a - c, -x + 0a + a = -52. Calculate the highest common factor of 19 and x. 19 Let k(f) = f2 + f + 3. Let d be k(-2). Suppose -g = -dg + 16. Suppose -14s + gs + 1430 = 0. What is the highest common divisor of s and 13? 13 Suppose -5 = 3x + 1, 0 = -2p + 2x + 1342. What is the greatest common divisor of p and 5575? 223 Let p = -251 - -260. Suppose pc - 224 = 1801. Calculate the greatest common factor of c and 25. 25 Let b = -142 - -182. Suppose -4p + 5v = -394 - 151, -3p - 3v + 429 = 0. Calculate the greatest common divisor of b and p. 20 Suppose -4a - 3q + 5 = a, 5q = -2a - 17. Suppose -ak - 20 = -260. Let y be 30(2 - 10/15). What is the highest common factor of k and y? 20 Let n be (2 - 0) + -21324/(-12). What is the highest common factor of n and 372? 12 Let p = 76 + -52. Let d = p + -13. Suppose 3v - 4k = 132, 0k - k + 176 = 4v. Calculate the greatest common divisor of v and d. 11 Let m(f) = 558f + 522. Let p(a) = 159a + 149. Let k(n) = -5m(n) + 18p(n). Let t be k(5). Calculate the greatest common factor of 27 and t. 27 Let h be (73 - 16)/19 + 159. Calculate the greatest common factor of h and 9. 3 Suppose -3a + j = -119, 13a - 5j = 17a - 203. Calculate the greatest common divisor of a and 3794. 14 Let v be (-10)/4 - 90/(-36). Suppose -4u + 30 = -3p, v = 3u + 3p - 7p - 19. What is the greatest common divisor of 12 and u? 3 Let s = 41155 - 36487. Calculate the highest common divisor of 108 and s. 12 Let s be (170 - 0/1)192/480. Suppose 92u = 93u - s. What is the greatest common factor of u and 238? 34 Suppose -4h = 7h - 308. Let r = 82 - 81. Let c be ((5 + -11)-7)/r. What is the greatest common divisor of c and h? 14 Let t(b) = 2b3 + 6b*2 - 11b - 7. Let z be t(-4). Suppose 2h = 4c + 298, -271 = 3h - zh - 5c. Calculate the greatest common divisor of 11 and h. 11 Let v(o) = -o2 - 16o - 27. Let z be v(-14). Let g be z/((-4659)/777 + 6). What is the highest common factor of 37 and g? 37 Let b be 1986 - 110/(-20)(-12)/11. Calculate the greatest common divisor of 891 and b. 99 Suppose 5c + 11 = 1, 4d - 48 = 2c. Suppose 326m - 5 = 321m. Suppose -2z + d = -m. What is the highest common factor of 66 and z? 6 Let k(r) = r3 + 6r + 45. Let l be k(0). Calculate the highest common factor of l and 1404. 9 Let p(k) = 12k2 + 4k - 10. Let u be p(-9). Suppose -5h + u = -244. What is the highest common divisor of 26 and h? 26 Suppose -5h = -10, -10d + 9d + 438 = -h. What is the highest common factor of 825 and d? 55 Let k = -9926 + 10106. Calculate the highest common factor of k and 195. 15 Let a = -51943 + 53028. Let p = -8 - -43. What is the greatest common factor of p and a? 35 Suppose -3n + 21 - 222 = 0. Let d(h) = -2h - 36. Let a be d(-17). Let l = a - n. Calculate the greatest common divisor of 26 and l. 13 Let g(m) = -236 + 10m + 256 - 5m. Let u be g(17). What is the greatest common divisor of u and 14? 7 Let i be ((25/20)/(-5))/((-2)/328). Suppose -4u + 2o + 172 = 0, 0 = -u + o - 0o + i. Let b = 34 - 16. What is the greatest common divisor of u and b? 9 Suppose 82295 + 21640 = 15v. What is the greatest common divisor of 338 and v? 169 Suppose 4c = -2c + 12. Suppose 0 = -2f - c, -3b - 2f = -6f - 79. Calculate the highest common factor of 15 and b. 5 Suppose -2x - 5t + 1417 = 404, -4x = -2t - 1966. Let f(k) = k*3 + 10k*2 + 109k + 938. Let d be f(-9). What is the highest common factor of d and x? 38 Suppose -5r + 36 = r. Suppose 218 + 16 = rv. What is the highest common factor of 13 and v? 13 Let k(f) = 64f + 1360. Let y be k(-19). What is the highest common divisor of y and 3664? 16 Let n = -2825 + 2863. Calculate the highest common divisor of n and 209. 19 Let z be ((-9)/3)/(15/790). Let h = z + 170. Calculate the greatest common divisor of 30 and h. 6 Suppose -3h + 19 = -17. Let p be ((-432)/(-16))/((-3)/(-2)). Let a(t) = t*2 - 23t + 150. Let q be a(p). Calculate the highest common divisor of q and h. 12 Suppose -3j + 68 = -j. Let b = j + -20. Let h(g) = 14g3 + g2 - 3g + 2. Let w be h(2). Calculate the greatest common divisor of w and b. 14 Suppose 0 = 4g - 8, -4m + g + 10 = -0m. Suppose 15 = 3l + a, 0l = -4l - ma + 15. Suppose -lw + 746 = 146. What is the highest common factor of w and 25? 25 Let x = 47315 + -47198. What is the greatest common factor of 975 and x? 39 Suppose 0 = 3w - 21 - 6. Suppose 456x - 460x - 5f = -66, x - 2f = -16. What is the highest common divisor of w and x? 1 Suppose 5c = -5r + 700, -r + 295 = r + 5c. Suppose -21i + 618 = r. What is the greatest common factor of 207 and i? 23 Let q = -367 - -374. Suppose 45 = -qk + 136. Calculate the greatest common divisor of k and 1339. 13 Let f = -234 - -238. Suppose 94 = 2i + 12*u -	{ "pile_set_name": "DM Mathematics" }
88. Find the common denominator of -61/18 and o. 18 Let l(s) = 3s - 10. Let n be l(4). Let c(m) = 3m + 7mn - m2 - m3 - 5 + 3 - 4. What is the lowest common multiple of c(6) and 14? 84 Suppose n - 74 = -q, q - 2n = -0n + 80. Calculate the smallest common multiple of q and 12. 228 Let l(i) = -i + 10. Let k be l(3). Suppose -k + 29 = 2c. What is the least common multiple of 7 and c? 77 Let z = 2/39479 - -95499693/157916. Let w = z + -625. Find the common denominator of 3/16 and w. 16 Let z(m) = 2m3 + 18m + 0m2 - 20m - 1 - 5m2. Calculate the least common multiple of z(3) and 110. 110 Suppose -11 = q - 25. What is the common denominator of 9/(-40)-86 - q/(-35) and 46/36 + 2/(-2)? 36 Suppose 0 = 5z - 17 - 3. Suppose -3s + 19 = 2s - 3m, -10 = s + zm. Let x = 23 - 9. Calculate the lowest common multiple of x and s. 14 Let p = 4 - 0. Let d = -10 - -6. What is the lowest common multiple of p and (3/d)/((-3)/12)? 12 Let d = -8 + 14. Let p(h) = 5h*2 - 5h. What is the least common multiple of p(2) and d? 30 Suppose -44 = -6r - 14. Find the common denominator of 11/(-6) + -2 + 1 and (-1)/r + 2 + 434/(-80). 24 Let s be (-23702)/(-5915) - 4 - (-1 + 1). Let h = 39757/5915 - s. Find the common denominator of h and 41/(-2)(-2 + 1). 14 Let g be (-3 + 105/25)5. Suppose 3z - g + 0 = 0. Suppose -5k = x + zx - 10, -3x - k + 26 = 0. What is the smallest common multiple of 3 and x? 30 Suppose 5m = 3k - 4, 3k = 4k - 2m - 1. What is the lowest common multiple of 30 and k? 30 Suppose 4s + 70 = 218. Suppose -5n + 4o - s = -87, 3o + 20 = 2n. What is the lowest common multiple of n and 21? 210 Suppose 3i - 6 = 6i. Let g be -18(-2 - i/4). Calculate the common denominator of (-54)/(-8) + g/(-18) and 89/8. 8 Let c = -29873/1476 + -4/369. Find the common denominator of c and 29/718. 1436 Calculate the lowest common multiple of (4/(-18))/(9/(-81)) and 10. 10 What is the least common multiple of 7 + 3/(3/2) and ((-1)/(-2))/(1/16)? 72 Let m = -813727/30 + 27110. Let j = m - -143/6. Calculate the common denominator of j and -3 - -2 - 495/10. 10 Calculate the smallest common multiple of 13 and 78 - ((-1016)/200 + (-6)/(-75)). 1079 Suppose -4 = -5q - 24, j - 10 = 3q. Calculate the common denominator of (-47 + 3)/((-85)/(-17)) and j + 4(-11)/(-7). 35 Let p = -56335 + 1689887/30. What is the common denominator of (-16)/(-9) - (7 + -5) and p? 90 Let a = -12/727 - -99743/8724. Find the common denominator of a and ((-16)/324)/((-4)/78). 108 Suppose 6764 = 2n - 3y, 5n + y - 10157 = 2n. Let o = -54249/16 + n. What is the common denominator of (2 + 7)/((-40)/(-18)) and o? 80 Suppose -6m + 15m = 216. Let n = m - 18. Suppose -11 + 51 = 4v. What is the smallest common multiple of n and v? 30 Let h(y) = 49y2 - 41y + 11. Let z be h(9). Let o = z - 14517/4. Calculate the common denominator of 29/5 and o. 20 Find the common denominator of (-2)/6 - 20/(-18) and (-4602)/1298 - -11. 99 Suppose 2u = -4j - 22, -5u + u - 40 = 4j. Calculate the least common multiple of (-1 - u)(-4)/(-8) and 49. 196 What is the lowest common multiple of 61 + 4 - (-30)/6 and 7? 70 Let x(k) = k*2 - 3k - 25. Let m be x(7). Suppose 0 = 4d + 8, v + md = 2d + 3. What is the smallest common multiple of 24 and v? 120 Suppose 0 = z - 0z - r + 15, 4z + 5r = -78. Let d = z - -29. What is the common denominator of -41 and 85/(-66) - 2/d? 11 Let x(u) = -3u2 + 4u + 1. Let o be x(-1). Calculate the smallest common multiple of 8 and -3(5/o)/((-8)/(-16)). 40 Suppose 25u + 4 = 24u, -4u = c - 74. What is the smallest common multiple of 150 and c? 450 Suppose 74 = 5a - 4n, -4 = n - 3. Suppose 5r + 21 = 4z, -3z - 4r + a = 6. Calculate the smallest common multiple of z and 9. 36 Calculate the common denominator of 27/112 and 4/(-48)(-150)/4. 112 Let v = 355 - 9939/28. Calculate the common denominator of 20/77 and v. 308 Let j = -41 + 44. Calculate the smallest common multiple of 15 and (0 - j) + (-2 + 3)18. 15 Let m = 2120/63 - 548/21. Calculate the common denominator of m and (1/(-3))/(1/(-25)). 9 Suppose -465 = -97k + 94k. Let v = k + -152. What is the lowest common multiple of v and 10? 30 Let f(i) = 4i2 + 26i - 6. What is the least common multiple of 42/8 + (-2)/8 and f(-7)? 40 Let y(v) = -3v2 - v - 3v*3 + 0v + v*3. Let o be y(-3). What is the common denominator of 132/o70/(-104) and 41? 26 Let x(n) = 2n2 + 8n + 13. Let g(z) = z*2 + 9z - 6. Let a be g(-9). What is the common denominator of x(a) and -67/3? 3 Let s be (-4)/(-2) - (10 + 1). Let j(q) = q*2 + 7q - 10. Calculate the lowest common multiple of j(s) and (-474)/(-24) - -1 - (-6)/(-8). 40 Suppose -2o - 31m = -33m - 24, -2o + 4m + 20 = 0. Calculate the smallest common multiple of o and 10. 70 Find the common denominator of -32/669 and (60 + (-3 - -2))(-73)/876. 2676 Let t = 959/44 - 83/11. Let v = t + -271/12. What is the common denominator of v and -41/3? 3 Suppose -3x + 5j + 92 = -162, 0 = 2x - 3j - 170. Calculate the smallest common multiple of x and 72. 792 Let h be 14/(-77) - (-326)/(-22). What is the smallest common multiple of 33 and 90(25/h + 2)? 330 Let w = -3045329273787/89936 - -237027491/7. Let j = w - 1/1168. What is the common denominator of j and -37/70? 770 Suppose -i - 2i - 20 = 5d, -2i - 8 = 2d. Let y be 105/9 - d/(-6). Let v = 21 - y. Calculate the lowest common multiple of 18 and v. 90 Suppose k = 4o, -2k - 3o = -5o - 30. What is the smallest common multiple of 45 and k? 180 Let j = 151513/2070 + 83/230. Let p = 5755/72 - j. Find the common denominator of ((-182)/24)/(12/(-8)) and p. 72 Let q = 5 + 13. Suppose 751l - 749l = 48. Calculate the lowest common multiple of q and l. 72 Suppose 10 = 5z, -12 = -v - 2z - 0. Find the common denominator of (0 + 10/v)(-29)/5 and -109/6. 12 Let o = 1414 - 1408. What is the least common multiple of 24 and o? 24 Let d(x) = -x*2 - 7x + 2. Let v be d(-7). Suppose -4k = -117 + 29. Suppose v = 3c - k. What is the smallest common multiple of 18 and c? 72 Let p(d) = -7536d - 266. Let u be p(5). Let w be ((-158)/(-36))/(8/69172). Let i = w + u. Calculate the common denominator of -67/16 and i. 144 Let i = 40 + -41. Find the common denominator of -31/15 and 2 - (1 - i)/((-36)/(-34)). 45 Let y = -8865 - -5716. Let m = -25287/8 - y. What is the common denominator of (218/(-44) + 0)/(-1) and m? 88 Let n be (7/(105/(-10)))/((-3)/36). Let r = -2 + 9. Calculate the least common multiple of r and 44/n32/3. 77 Let y be (-11)/((-11)/(-22)). Find the common denominator of 4/33 and ((-20)/3)/(3/y). 99 Let k = 52 + -39. Let w = 33 - k. Calculate the lowest common multiple of 14 and w. 140 What is the common denominator of 77/10 and -5 - 3864/(-284)? 710 Let t = 379 - 356. What is the lowest common multiple of 2 and t? 46 Let m(w) = -6 - 3w - 5 + 0w. Suppose 295y = 302y + 49. What is the lowest common multiple of 11 and m(y)? 110 Let g = -18381/2110 + 12/1055. Let i be (1/2)/((-310)/14111). Let d = i - -3/310. Find the common denominator of d and g. 20 Let y be (-1)/(-2) + (-104718)/(-48). Let t = y + -2187. What is the common denominator of t and -29/4? 8 Let b = -126827/18 - -7051. What is the common denominator of -1 + (2 - 4) + (-234)/360 and b? 180 Let m be -2 + (68576/(-26))/2. Let v = m - -17632/13. Let r = -10203/286 + v. Find the common denominator of 89/10 and r. 110 Let a(g) = -2g*3 - g - 2g*3 - 7g*2 + 9 + 4g3 - g3. What is the lowest common multiple of 14 and a(-7)? 112 What is the smallest common multiple of ((3/4)/(19/152))/2 and 24? 24 Calculate the lowest common multiple of (-68)/102 - 1072/(-6) and 4. 356 Calculate the common denominator of 6/(-4) + (-21045)/3294 and (14/4)/((-8)/(-2)). 72 Let k = 15206 + -21395. Let y = k - -61949/10. What is the common denominator of 115/98 and y? 490 Let f = 24 + -45. Let i = -11 - f. What is the lowest common multiple of 76/i - (-18)/45 and 7? 56 Let w = -119368/173 + 690. Let v = w + 3263/2076. Let n = -571/171 - 99/38. What is the common denominator of v and n? 36 Suppose 0 = -g + 3g + 4. Let r = 14 - g. Let p(q) = -q2 - 8q - 2. What is the lowest common multiple of p(-6) and r? 80 Suppose 32t = 47t - 135. Calculate the sma	{ "pile_set_name": "DM Mathematics" }
0.11 + v. Which is the closest to k? (a) -3 (b) -0.4 (c) 1 b Let o = -29/11 + 745/99. Let g = 590/117 - o. Which is the closest to 3? (a) g (b) -3 (c) -2 a Let y be (18/(-15))/((-4)/10). Suppose -k - 140 = yk. Let s be (-22)/k + 12/(-28). Which is the nearest to -3? (a) s (b) 5 (c) 1/3 a Let q(l) = l3 - 10l*2 - 11l - 5. Let r be q(11). Let f = 16.7 - 15. Let w = 2 - f. Which is the nearest to w? (a) 1/5 (b) r (c) 2/17 a Let w be (68/11 - 10) + 4. What is the nearest to -3 in 1, 5, w, -3/8? -3/8 Let w = 25 - 24.79. Let p = w - 0.31. Which is the closest to p? (a) 5 (b) -0.2 (c) -2/9 b Let h be -3 + -222/(-16). What is the closest to h in 3, -4, 2/69? 2/69 Let s be (15 + -4 - -11)/(-2). What is the nearest to -0.3 in s, -3/5, 1, -0.3? -0.3 Let b = -0.102 + 0.14. Let h = b + -0.138. What is the nearest to 1 in -2, 4/7, h? 4/7 Let h = 6.5 + -6.6. Let w = -437/6 - -73. Let v = 9 + -14. Which is the nearest to -1? (a) w (b) h (c) v b Let a = -67.5 + 63.5. What is the nearest to -1 in -7, a, -0.3? -0.3 Suppose -20d = -30 - 30. Suppose -32 = -3g - 38. What is the closest to 0.05 in g, d, -5? g Let j = -35 + -3. Let u = -37.5 - j. Which is the nearest to 0.4? (a) 2/3 (b) u (c) 5 b Let l = -5.26 + 0.26. Let d = 0.04 - 9.04. Let p = d - -8. Which is the closest to p? (a) 4 (b) -4 (c) l b Let i = 293 - 2639/9. Which is the closest to -1/2? (a) -12 (b) i (c) 21 b Let d = -65 + 61.1. Let z = -0.1 + d. Let v = -56 - -51. Which is the nearest to 2/7? (a) z (b) v (c) 4 c Let s = -0.1 + 2.1. Let j = -17054 - -17060. What is the closest to 1 in s, j, -0.2? s Let w = 6.3 + -6. Let t = 0.02 - 0.52. Let l = -4.478 - -1.478. Which is the closest to l? (a) t (b) w (c) 4/7 a Let i = -25.2 - -23. Let t = i - -2.1. Let x = -5 + 2. What is the closest to t in x, -0.3, 4? -0.3 Let s = 305 - 308. Which is the nearest to 6/13? (a) 0.1 (b) 2/21 (c) 0 (d) s a Let p = -27.58 - -27.08. Let b = 0.2 + -0.3. What is the closest to b in p, 0.06, 1/6? 0.06 Let r = -0.178 + -0.022. What is the nearest to 1/2 in r, -5, 0.12, 0? 0.12 Let a = -23 - 6. Let f = -80 - -52. Let m = a - f. What is the closest to -1 in -3, 0.2, m? m Let t be (-2 - 128/(-60))/(4/(-18)). Which is the nearest to -1? (a) 0.4 (b) t (c) 0.05 b Let l be 59/8 + 13/39-21. What is the nearest to -1 in l, -1/140, 0? -1/140 Let w be (13 + -1)139/695. What is the nearest to -3 in 0, 1/3, w, 5? 0 Suppose x = 0, -50p - 4x = -55p + 10. Let t = 7 + -11. Which is the closest to p? (a) -3 (b) t (c) -3/8 c Let x be ((-182)/6)/710. Let b = x - -43. What is the nearest to b in 0, -3, -10? 0 Let n = -4.65 + 6.65. Let v = -5 - -5.4. What is the closest to v in -0.1, 1, n? -0.1 Suppose -5g + 42 = 37g. Which is the nearest to 0.2? (a) 2/3 (b) g (c) 3 (d) 6 a Let y = 572/3 - 191. Let l be (1/(-9))/(6/12). Which is the closest to y? (a) l (b) 0.5 (c) 2 a Suppose 5u + 3 = 8. Which is the nearest to u? (a) -1 (b) -3 (c) -2/29 c Let b = -28 + 28.62. Let g = -0.62 + b. What is the nearest to g in 4, 3, 2/15? 2/15 Let g = -2.1 - -2. Let x = 0 - g. Let q be ((-70)/70)/(7/(-3)). Which is the nearest to x? (a) 3/5 (b) -5 (c) q c Let y = 0.204 - -3.796. Which is the closest to -0.1? (a) -0.11 (b) y (c) -0.04 a Let h = -74 - -69. What is the closest to 0.08 in 3, h, 0.5? 0.5 Let w = -5.7 + 0.7. Let c be 1(2 - -3) - 1. Let x be 1/(8/(-16) + (0 - 0)). What is the closest to -2/3 in c, w, x? x Let f = 363 + -361. Let v = -0.03 - 1.97. Which is the closest to v? (a) -1/7 (b) -5 (c) f a Suppose 2p = -2p + 80. Let u be (65/p)/(2/8). Let l = -13 + u. Which is the nearest to 1/3? (a) l (b) 4 (c) 1 a Let r = -380.4 + 382. What is the closest to r in -5/2, -5, 3? 3 Let p = 15 - 14.3. Let i = p - 0.7. Which is the nearest to -2? (a) -2/7 (b) -3/4 (c) i b Let h = 76 + -76. What is the nearest to -2/7 in -0.3, 0.02, h, -3? -0.3 Let f = -2.577 + 2.967. What is the nearest to -1 in 0.5, 0, f? 0 Let v = 7 - 8. Let w = -4 + 5. Let h be 5/3w/(-5). What is the closest to v in 2, 0, h? h Let f = 958 + -953. What is the closest to 1 in 3, f, 1? 1 Let m = 9.02 + -0.02. Let f = m + -9.1. Let g(l) = l2 - 11l + 7. Let c be g(10). What is the closest to c in 3, -2, f? -2 Suppose 0 = -12f + 7f - 15. Suppose -6l = -3l + 18. Let c be (123/42 - 3)l. What is the closest to -1 in -0.5, f, c? -0.5 Let n be (-6)/(-21) + (-509)/(-7). Let k = -221/3 + n. Suppose 4p + 3 = f, 2p + 0p = -3f - 19. Which is the nearest to k? (a) 4 (b) 0.2 (c) p b Let l = -3.7 - -36.3. Let y = 14 - 47. Let n = y + l. Which is the nearest to -4? (a) 0.4 (b) n (c) 0.5 b Let f = 385 + -392. What is the nearest to 1/2 in -3, -9, f? -3 Let c = 7/45 - -17/180. Let h be (6/(-4))/(21/6). What is the closest to 1/5 in h, 3, c? c Let n = -263 + 258. What is the nearest to -3 in 3, n, -2/13? n Let p = -35 + 39. What is the nearest to 0.01 in -3/10, p, -2? -3/10 Let h be (1/10)/(3/24). Let m = h - 22/15. Which is the closest to m? (a) -3 (b) 5 (c) 0.3 c Let q = -3 - -2.6. Let v be (4/(8/(-1)))/(13/(-2)). What is the nearest to v in -4, q, 0? 0 Let x = -6.7 - -7. Let p be -7(-6)/273 - (-29)/(-104). What is the nearest to -1 in x, 0.5, p? p Let t = 59.28 - -2.62. Let y = t - 62. Which is the nearest to y? (a) 3 (b) -1/8 (c) 0.2 b Let i = -2/39 + -31/156. Suppose -12o = o + 13. Which is the closest to o? (a) -0.5 (b) i (c) 1 a Let l = -1.61 + -2.39. What is the closest to 1 in -0.2, l, -12? -0.2 Let o = -4 + -1. Let k = -28/3 - -146/15. Let d be ((-2)/(-6))/((-3)/18). Which is the closest to d? (a) k (b) o (c) 1/2 a Let x = -32/3 + 10. What is the closest to x in -0.1, -0.5, 1, 0.5? -0.5 Let p = 1.8 + 6.7. Let g = 8 - p. Which is the closest to -0.1? (a) -5 (b) g (c) 1/6 c Let x = -0.07 + 2.07. Let k = 8.7 - 9. Which is the nearest to -1? (a) x (b) k (c) -3 b Suppose 4d + 5b - 58 = 0, -7d = -2d + 5b - 70. Let c = -4/25 - 17/50. What is the closest to c in 0, d, 1/3? 0 Let a = -12/95 + 511/285. What is the closest to -0.1 in -0.2, 1/2, a? -0.2 Let q = -49.62 - -49.52. Let j = -1 + 0.8. Which is the closest to q? (a) -2/13 (b) 3 (c) j a Let d = -193/4 + 48. Suppose -2o + 9 = 15, -5x - 3o = 4. What is the closest to x in -2, 2/7, d? 2/7 Let p = 66 - 105. Let i = 39 + p. What is the nearest to 1/2 in 4, -0.07, i? i Let h = -133 - -134. Which is the closest to h? (a) -2.9 (b) -0.3 (c) 5 b Let z = -0.1 + 0.3. Let m = 395 + -391. What is the nearest to z in 2, m, -0.3? -0.3 Let z = 255 + -2037/8. Which is the nearest to -12? (a) -0.4 (b) z (c) -2 c Suppose 238w = 243w - 5. Let r = 2.97 - 3. Let z = r + -0.37. What is the closest to 1 in -5/2, w, z? w Let m = -165 - -165.2. Which is the nearest to m? (a) 2 (b) -0.4 (c) 0 c Let j = 98 - 102. What is the closest to -0.6 in 2, -1/21, j? -1/21 Let h = 0.25 + -0.01. Let d = h - 14.24. Let m = d - -10. What is the closest to -1/5 in m, 2/11, 5/4? 2/11 Let f = 1078 - 14016/13. What is the nearest to -7 in f, 2/5, -1/6, -2/3? -2/3 Let a be (336/35)/(-12) - 376/(-70). What is the nearest to a in -0.2, 1, -5? 1 Let n = 8 - 15. Let q = 1914.5 + -1915. Which is the nearest to -3? (a) n (b) 4 (c) q c Let w be 28/4 - (8 - (12 + -15)). Let f = 2/5 - -1/5. What is the closest to -0.2 in w, 0.5, f? 0.5 Let q = -19 - -11. Let m(s) = -s3 - 9s*2 - 7s + 10. Let t be m(q). Suppose -3d - 4 = tr, r + d + 2 = -0r. What is the nearest to r in 1, 1/4, -0.1? -0.1 Let g = 1.5 - 1. Let j = 117 + -117. Let y be (-1)/(-6) + -3 + 3. Which is the closest to -2? (a) y (b) j (c) g b Let y = 0.0884 - -3.9416. Let o = y - 4. Let u = -0.07 - o. Which is the closest to u? (a) -4 (b) -5 (c) 0.4 c Let f be 312/273. Suppose -5w - p - p = -38, 0 = w + p - 7. Let j be w/399/12. Which is the nearest to -1? (a) 0.4 (b) f (c) j c Let i = -653/1545 + 7/309. Which is the closest to -1? (a) i (b) -14/11 (c) -1 c Let o = 0.039 + 19.961. Let r = o - 20.5. What is the closest to -3 in -1, -3, r? -3 Let d = 28 - 18. Suppose -q = q - d. Let o = -2.959 - 0.041. Which is the closest to o? (a) -5 (b) 2/21 (c) q a Let w = -44 + 44. Let t = 3/16 - 23/80. Let s = -121/3 - -40. Which is the nearest to s? (a) 1 (b) w (c) t c Let l be (4/(-10))/(-7104/(-	{ "pile_set_name": "DM Mathematics" }
hat is -0.000182572202 rounded to 7 dps? -0.0001826 Round -1002274840 to the nearest one hundred thousand. -1002300000 What is 1025497.134 rounded to the nearest one hundred? 1025500 Round 18869.30825 to the nearest ten. 18870 What is -73109017.3 rounded to the nearest 10000? -73110000 What is 21773050 rounded to the nearest 1000000? 22000000 Round 0.003488604299 to seven decimal places. 0.0034886 Round 5902450.282 to the nearest 1000000. 6000000 What is -3613053.1 rounded to the nearest 1000? -3613000 Round -0.0000731850056 to 6 decimal places. -0.000073 What is 14.067779 rounded to 1 decimal place? 14.1 Round -22856.35 to the nearest one thousand. -23000 Round -3993363450 to the nearest one hundred thousand. -3993400000 What is 752.3298264 rounded to 1 decimal place? 752.3 Round 96852.66723 to the nearest 100. 96900 What is -2641.78728 rounded to one dp? -2641.8 What is 378517.608 rounded to the nearest one thousand? 379000 What is -2534.79931 rounded to one dp? -2534.8 Round 1221281.23 to the nearest 100000. 1200000 What is 0.004842875897 rounded to six dps? 0.004843 Round 0.00000458477683 to six dps. 0.000005 What is 1258.03859 rounded to the nearest 100? 1300 What is 8.2938618 rounded to the nearest ten? 10 What is -0.305559956 rounded to five decimal places? -0.30556 Round 73409126.89 to the nearest one hundred thousand. 73400000 Round -0.000001235114729 to 7 dps. -0.0000012 What is 17852194.9 rounded to the nearest 1000? 17852000 Round -365.5302889 to the nearest one hundred. -400 Round -65658191.5 to the nearest 1000000. -66000000 Round -12543965220 to the nearest 1000000. -12544000000 Round -0.0937105841 to 4 decimal places. -0.0937 Round -111.9076459 to 2 decimal places. -111.91 What is 4.910285 rounded to three decimal places? 4.91 What is 45.888996 rounded to two decimal places? 45.89 What is -78875.429 rounded to the nearest ten? -78880 What is -0.06438829 rounded to 1 decimal place? -0.1 What is -0.0134992571 rounded to 6 decimal places? -0.013499 Round -294.273308 to the nearest integer. -294 Round 2.578503 to the nearest 10. 0 What is 0.263342364 rounded to two decimal places? 0.26 What is 114789.1468 rounded to the nearest 10000? 110000 Round -7704348.98 to the nearest one million. -8000000 Round -5129615.684 to the nearest one thousand. -5130000 What is 0.000161233427 rounded to six dps? 0.000161 Round -1266.299263 to one dp. -1266.3 What is -550.269203 rounded to the nearest 100? -600 What is -199342.5335 rounded to the nearest 10? -199340 What is -0.0000055112722 rounded to 7 decimal places? -0.0000055 Round 248570.8101 to the nearest 100000. 200000 What is 0.00015496545 rounded to 6 dps? 0.000155 Round 0.0064798208 to two decimal places. 0.01 What is -8.360082 rounded to 2 dps? -8.36 What is 237830225.7 rounded to the nearest ten thousand? 237830000 What is -321.0463636 rounded to the nearest integer? -321 Round -9.94394396 to two decimal places. -9.94 What is -23450.2303 rounded to the nearest 1000? -23000 What is -0.0002782431 rounded to 3 dps? 0 What is 1587869.756 rounded to the nearest one thousand? 1588000 What is 4743.0685 rounded to the nearest ten? 4740 What is 4900673.1 rounded to the nearest 1000000? 5000000 What is 168796152 rounded to the nearest 1000000? 169000000 Round -14481142.4 to the nearest 1000. -14481000 What is 0.03285001 rounded to two dps? 0.03 What is -1971.74078 rounded to the nearest ten? -1970 Round 0.033810136 to 4 decimal places. 0.0338 What is -68.3127025 rounded to 1 decimal place? -68.3 Round 0.0929462252 to 2 dps. 0.09 Round -4.132371083 to 1 dp. -4.1 Round -90657317 to the nearest 1000000. -91000000 What is -0.0051493783 rounded to four dps? -0.0051 What is 0.000212575118 rounded to seven dps? 0.0002126 What is -9.974557672 rounded to 1 decimal place? -10 What is 0.00000213189197 rounded to seven dps? 0.0000021 Round -264.46838 to one decimal place. -264.5 Round -0.000799771937 to 6 decimal places. -0.0008 Round -4829638.81 to the nearest 10000. -4830000 Round -8.9533799 to 1 dp. -9 What is 1569.59411 rounded to the nearest integer? 1570 What is 6.623834049 rounded to the nearest integer? 7 Round -4263804.52 to the nearest 100000. -4300000 What is -2795.70083 rounded to the nearest one hundred? -2800 What is 0.20260667133 rounded to 4 dps? 0.2026 What is -0.11521873 rounded to 3 dps? -0.115 Round -0.29388746 to 5 dps. -0.29389 What is -18096454.4 rounded to the nearest 10000? -18100000 What is 0.0000508831124 rounded to six decimal places? 0.000051 Round -2.6355500439 to 4 decimal places. -2.6356 What is -0.564636772 rounded to five dps? -0.56464 What is -0.00006686649644 rounded to six dps? -0.000067 What is -0.00025038954333 rounded to six decimal places? -0.00025 What is 5947457.822 rounded to the nearest one million? 6000000 Round 0.244342059 to four decimal places. 0.2443 What is 58.887047 rounded to one dp? 58.9 What is -0.00166757138 rounded to 7 dps? -0.0016676 What is -0.07489173544 rounded to two decimal places? -0.07 Round -0.000193465351 to 4 dps. -0.0002 Round 0.0535734828 to 3 dps. 0.054 What is 752.239223 rounded to zero decimal places? 752 Round 0.0000010967415 to seven decimal places. 0.0000011 Round -0.01023129443 to 5 dps. -0.01023 Round 150267.3807 to the nearest 100. 150300 Round 2.49960478 to 3 dps. 2.5 What is -1174179.35 rounded to the nearest one hundred? -1174200 What is 285138.917 rounded to the nearest ten thousand? 290000 What is -0.0000507621936 rounded to seven dps? -0.0000508 What is -199866.956 rounded to the nearest ten? -199870 What is -87014.442 rounded to the nearest 10? -87010 What is -5982249 rounded to the nearest ten thousand? -5980000 Round -107.91483015 to one dp. -107.9 What is 21397.519 rounded to the nearest 1000? 21000 Round 9078627.56 to the nearest one million. 9000000 What is -0.219323542 rounded to 4 dps? -0.2193 What is 3383582.611 rounded to the nearest 10? 3383580 Round 0.0322767357 to 3 decimal places. 0.032 What is 0.633886076 rounded to four decimal places? 0.6339 What is 477223.16 rounded to the nearest 10000? 480000 What is -0.000020898336307 rounded to seven decimal places? -0.0000209 Round 0.009046013 to 3 dps. 0.009 What is -2035775820 rounded to the nearest one hundred thousand? -2035800000 What is 36775.198 rounded to the nearest ten? 36780 What is -47.6802361 rounded to one dp? -47.7 Round 0.0012778210294 to five decimal places. 0.00128 What is 33.1470598 rounded to 2 decimal places? 33.15 What is -1.499667 rounded to one decimal place? -1.5 What is 12.2906219 rounded to one decimal place? 12.3 Round 257309908.5 to the nearest ten thousand. 257310000 What is 0.000003043750554 rounded to seven dps? 0.000003 What is -20.886167 rounded to the nearest 100? 0 What is 0.0000025410852 rounded to 7 dps? 0.0000025 Round 44111.076 to the nearest ten. 44110 Round -0.000165383323 to six dps. -0.000165 What is 0.03435667487 rounded to four dps? 0.0344 What is -0.053018401 rounded to 5 decimal places? -0.05302 What is -342.7663559 rounded to 2 decimal places? -342.77 What is -0.002143757984 rounded to five decimal places? -0.00214 Round -14680988210 to the nearest 1000000. -14681000000 What is -218629764.1 rounded to the nearest 1000? -218630000 Round 0.000011984983094 to seven dps. 0.000012 What is -29229.95675 rounded to 0 decimal places? -29230 Round 0.00000115106175 to 6 decimal places. 0.000001 Round -307702.7044 to the nearest one hundred thousand. -300000 Round -0.000028592175099 to 6 dps. -0.000029 Round 0.055571202 to five decimal places. 0.05557 What is 0.71842056 rounded to three decimal places? 0.718 What is 543203.406 rounded to the nearest one thousand? 543000 Round -0.0000677698484 to six decimal places. -0.000068 Round -18903661.5 to the nearest 10000. -18900000 What is -158802.518 rounded to the nearest ten? -158800 What is -0.000000450180387 rounded to seven decimal places? -0.0000005 What is -0.00050759982 rounded to 7 dps? -0.0005076 What is 180345.98 rounded to the nearest one thousand? 180000 What is -18.9250389 rounded to zero dps? -19 What is -0.00251416515 rounded to 6 dps? -0.002514 Round -77291840 to the nearest one million. -77000000 What is 165700.807 rounded to the nearest 100? 165700 What is 9230838.89	{ "pile_set_name": "DM Mathematics" }
(-211225/88) Simplify ((s(-4/3)/s*(-5))/((ss*(1/11))/(sss/(s3/s)s)))/((s*(-2/7)/sss)(-2/15))(-2/41) assuming s is positive. s(14431/3157) Simplify ((h(4/3))(-1)(h*1h)10)(-6/5) assuming h is positive. h(-112/5) Simplify (((r(-1/3))(2/23)/(r(-1)r/(r(-8)rr)))(18/7))(2/87) assuming r is positive. r(-1664/4669) Simplify (rr*(-5)/rrrr(2/33))17((rr/(r/(r/(rrrr(10/7)rr))r))/rrrr(3/5))(3/25) assuming r is positive. r(-1456141/28875) Simplify (((f(-5/9)/f)/f)/f)/f12(((f/((f*(-29)f)/f))/f)/f)(-40) assuming f is positive. f(-10220/9) Simplify (uu(-18/7)u*(-2/101)/u(u(-3))(-1/4))(-1/6) assuming u is positive. u(5207/16968) Simplify (((h/(h(-4/11)/h))/h(-1/4)hh/(h*(2/11)/h)h(hh*6h)/h)(-5))(-1/6) assuming h is positive. h(985/88) Simplify (i(2/13)/(i(i/(i(-2/11)i))/ii))/(i/i(1/4))(-2/21)((ii(-2))(-35))(-17) assuming i is positive. i(-1193105/2002) Simplify (k5/k)/(k(((kk/(k/k(2/3))k)/k)/kk)/k)(k(k(-5)k)/k)/(k*(-4/9)k)(kk1)(-41)/((k/k(2/7))/k)36 assuming k is positive. k*(-4658/63) Simplify (pp*(-2/3)(p*(1/18)p)/p(p/(pppp/(p/(p/p*21pp)p)p))(-5/14))(4/5) assuming p is positive. p(-1342/315) Simplify ((ss/(sss/s*(2/3)))/ss)/s*2s(3/5)/(s(-1)/s)((ss(5/4))/s(1/2))(4/23) assuming s is positive. s(197/345) Simplify ((r/((r*(3/4)/rr)/r))/rr35)/(r(-29)r/r*(-1/27)rr) assuming r is positive. r(6611/108) Simplify (((s(1/5)/s)/s)/s)12(ss20ss)/(s36/s) assuming s is positive. s(-228/5) Simplify (((w5(w/(ww(-3/4)))/w)/(w4w(-2)))(8/3))31 assuming w is positive. w(682/3) Simplify ((m*25/(mm/(m*(2/35)m)))(5/7))24 assuming m is positive. m(20208/49) Simplify (((u(-6)u/((u(-1/7)/u)/uu))(16/5))39)(13/5) assuming u is positive. u(-219024/175) Simplify (((o/o*(-10))/(oo17/o))/(o(-1/4))42)(2/29) assuming o is positive. o*(9/29) Simplify (uuuu*(-1/8)u/(uu(4/3)))(-1/10)/((u/((uu/(uuu*(-1/2)u)u)/u))(11/4))(8/3) assuming u is positive. u(-2677/240) Simplify (m/(m(4/7)m)m)/m(-2)(m/m(-1/5))/m(-3/2)(m1)47m*(-5)m6 assuming m is positive. m(3719/70) Simplify ((jjj*(-1)jj)(-8/13))(5/14)/((j0)42(j/j(3/2))/j(-1/3)) assuming j is positive. j*(-269/546) Simplify ((hh*(-6)hhh*(-2/7))/(hh*(-6)hh(-3)/hh))/((((hhh/(h1/h))/h)/h)(-1/18)((h/((h1/h)/h))/h)29) assuming h is positive. h(-3179/126) Simplify (y/(y3yy)y/y*(-2)yy(y/(y*(2/3)y)y)/(y(-6)y))/((y1)(2/3)(y(3/5)yy)/yy6) assuming y is positive. y(-29/15) Simplify ((b(2/5)/b(-5/2))/(bb1bb(-1)))/(b/((b(1/5)/b)/bb)bb4/b)(-8) assuming b is positive. b(473/10) Simplify (((d/d(3/8)ddd)/d15)/(d(-3/8)/dd/(dd(-1/17))))(-29) assuming d is positive. d(4959/17) Simplify ((((y(2/39)/y)/(y/(yy*15yy)))37)(-27))(1/10) assuming y is positive. y(-104229/65) Simplify (h(-1)h)*(-4)/(h/(hhhh*1h))*(2/11)(h*(-1)/((hh/(hh(h/h*3)/hhh)h)/h))/(((h*(-6)/h)/h)/(hhh(1/5))) assuming h is positive. h(491/55) Simplify ((l/l9)/(ll*(1/12))l/((ll(1/6)l)/l)ll(3/4))/(((l/l1)/(l/(l*(2/9)l)))/(l*(1/6)(l/l2)/l)) assuming l is positive. l(-86/9) Simplify ((t/((t/t27)/t))43tt/((t/(t/((ttt*13tt)/t)))/t)tt(-2/63)t)(-3/2) assuming t is positive. t(-75157/42) Simplify (((iii*(1/9)ii)/i(-3))/(i/i12ii/i9i))(-1/8) assuming i is positive. i(-217/72) Simplify ((h4/h)(4/23)(h(-1/6)/h)(1/16))(16/5) assuming h is positive. h(991/690) Simplify ((m(1/3))(-34)(m/m(3/8))/m(-6/11))19 assuming m is positive. m(-50977/264) Simplify (j(-1/18)/j10(j/j(1/9))(-47))(-1/38) assuming j is positive. j(311/228) Simplify (m(2/7))(-25)m6/m(3/5)(m/(m/(mm(-1/2))))(-4/11)/(m(m(-2/3)/m)/mm(-1)) assuming m is positive. m(857/1155) Simplify (((b*(2/3)bb(b/(b*(1/9)b))/b)(-1/7))(-2/5))(-2/7) assuming b is positive. b(-8/315) Simplify ((v/v(-2/5))(-29/2)v(-4)/(v(-9)/v))(-3/2) assuming v is positive. v(429/20) Simplify (g(-2)g)*(-1/24)(g(-2))(-14/11)(g/g(1/4))(34/5)g*(-1/7)g(2/13) assuming g is positive. g(924697/120120) Simplify ((((a*3a)/aa)/a)/((aa*(-6)a)/a))/(a*(-3/8)a*(-4/5))a(-2/11)/((a/((a/(a(-4)/aa))/a))/a)a*(-6)aa(-3)/aa assuming a is positive. a(2197/440) Simplify ((u(-14))*(-24)u*(-16)/(u/(uu(-15))))26 assuming u is positive. u*7930 Simplify (((vv/(vv(-2))vvvvv*(-3/4)/vv)(-2/19))(10/13))(-33) assuming v is positive. v(4125/247) Simplify (((i*(-1/5)i)/i(-1/4))/(i/i(-1)i(-4/3)i))/((i2/i)/i6i(1/8)i(3/7)) assuming i is positive. i(3217/840) Simplify (j*(-2/3)j(-3))(4/11)(j(-2/5))(-1/38)(jj(-2/21)jj)/(j/(j/((j/(j(-1)/j))/j))) assuming j is positive. j(-278/665) Simplify ((q(-1)/q)/q)(13/4)(q*(-1/3)/qqq)(18/13)(q(2/5))(3/2)q(-1/5)q7 assuming q is positive. q(-371/260) Simplify ((ff1)(-3/4))(-2/51)/((f1)34/(f(2/3))(-8)) assuming f is positive. f(-2003/51) Simplify ((l(-2/7)/l)/l(-2)l*(-6/7)/(ll(5/3)))/((l/l11)/l(-4/5))40 assuming l is positive. l(7669/21) Simplify ((g(1/2))*(-9/11)g*(-6/5)g(-6)/g)/((g/g(2/11)g)/gg4)(2/23) assuming g is positive. g(-22841/2530) Simplify ((r(-1/7)rr)*(11/6)r*(-18)/(r/(rr(r(1/10)/r)/r)))30 assuming r is positive. r(-3254/7) Simplify (o(-12)o(-1/10))(-10)o(-1)/(oo*(2/9))o/(o/(o*8/o))((o/(oo5/o))/oo)/o assuming o is positive. o(1087/9) Simplify ((w/w(2/7))/w)(-15)/(w(-5)/(w*(-8)/w))(ww/(w1w))/(w/(w/w*(2/7)))w*(1/4)ww6 assuming w is positive. w(29/4) Simplify ((cc/c(4/3))/(c/c(-7)cccc))/(c/(c/c*(1/4))c*(-1/5)/c)(((c/c(-4))/c)/c2)/((cc(2/3)c)/c)(-1/43) assuming c is positive. c(-21529/2580) Simplify (((s/(s/(ss(3/2))s))*(-13)s/((s/s*(-2/11))/ss)ss(-12/7))25)(9/10) assuming s is positive. s(-141345/308) Simplify (vv(-6/5)v)/(((vv6)/vv)/v)v8v*(-4/5)/vvvv*(-2/7)vv7v(-3)/v(-3/8) assuming v is positive. v*(453/56) Simplify (((gg0)(-35/2)g(-2/9)/gg*4g)(-5/4))(-2/111) assuming g is positive. g(-1235/3996) Simplify ((z(-3/5)z)42/(z/(z(-4/3)/z))(-5/7))(-2/17) assuming z is positive. z(-4028/1785) Simplify ((p(-5/13)/pp/p(-4/7))/(p22)(-2/15))(-2/69) assuming p is positive. p(-8518/94185) Simplify k(4/9)/(k*(3/10)k)(k(-39))(13/8) assuming k is positive. k(-23123/360) Simplify (b/b(-9)b/b(-9))13(b0b/(b/b(5/3)))/(b/(((b/(b/b(-1/3)bb))/b)/b)b)(2/151) assuming b is positive. b(39499/151) Simplify (jj*(-2/29)jjjj(jj/(j(3/7)/j))/jj)*(-7/6)(jj1jjj(10/9))13 assuming j is positive. j*(30115/522) Simplify (((((pp/(ppp*(4/15)))/p)/pp)/ppp(2/3)/p)/(p5)47)(-20/9) assuming p is positive. p(4732/9) Simplify ((t/t(-1/2))/(t/t*(3/11))(t(1/5))(8/7))(-12) assuming t is positive. t(-4626/385) Simplify ((p1)(3/34)(p(-4/7)p)/(p/((pp/p(4/9))/p)))/((p4/(((((pp*5/p)/p)/p)/pp)/pp))/(ppp(-2))(-10)) assuming p is positive. p(-1987/2142) Simplify ((c(-2/5))(-16))44(c*(-3/5)c/c3)(1/2) assuming c is positive. c(2803/10) Simplify ((n(2/7))*(-15)(n*(-6)n)/nnn/(n*5/nnn))/((nn*(2/13)nn(-1)n)/(((n/n(-1))/n)/n(-1))) assuming n is positive. n*(-1314/91) Simplify ((ww(2/3)/w)9/((w*(1/5)w)/(w/((ww(1/5))/w))))/(((w/w(4/3))/(w/w2w))/(ww(-3)w/(www/w(-5)))) assuming w is positive. w(-46/15) Simplify ((o/o*3ooo(-1/6))/(((o(-1/4)/o)/o)/oo)9)/(o(o*(1/2)o)/oooooo/(o3o)oo)(-21/5) assuming o is positive. o(2339/60) Simplify (h*3/hh*(-3)h)/(((h*(-1/8)/h)/hh)/(h*(-3/5)h))(h(-3)/((h/(hh/((h/(h/(h/h(-3/4))))/h)))/h))/(h(-1/2))(12/11) assuming h is positive. h(141/440) Simplify ((y*11/(y/(y/((yy*(2/7)yy)/y))y))/((y(-3/17)/y)/(y/(y9y))))*(-38) assuming y	{ "pile_set_name": "DM Mathematics" }
s -61300000 rounded to the nearest 1000000? -61000000 What is -0.00002129 rounded to six dps? -0.000021 What is -80400000 rounded to the nearest 1000000? -80000000 What is 0.07365 rounded to 2 decimal places? 0.07 What is 0.0209542 rounded to 3 decimal places? 0.021 What is -11402.3 rounded to the nearest one thousand? -11000 What is -0.02862 rounded to 3 decimal places? -0.029 What is -0.0003391 rounded to 4 dps? -0.0003 Round 0.0000452 to five decimal places. 0.00005 What is -22916 rounded to the nearest 100? -22900 Round -10.69 to 1 decimal place. -10.7 What is 101100 rounded to the nearest one thousand? 101000 Round 354740 to the nearest 1000. 355000 Round -132.994 to the nearest integer. -133 Round 0.000528 to four decimal places. 0.0005 Round 0.316 to 1 decimal place. 0.3 What is -901 rounded to the nearest one hundred? -900 What is 0.04053 rounded to three decimal places? 0.041 What is -9740000 rounded to the nearest 1000000? -10000000 What is 0.00000052 rounded to six decimal places? 0.000001 What is -8.579 rounded to one dp? -8.6 What is 4446 rounded to the nearest 100? 4400 What is 5.87 rounded to 1 decimal place? 5.9 Round 53.57 to the nearest ten. 50 What is 4717.9 rounded to the nearest 1000? 5000 What is -3261000 rounded to the nearest 100000? -3300000 What is 66483000 rounded to the nearest 1000000? 66000000 Round 0.00000541 to 6 decimal places. 0.000005 What is -0.000001206 rounded to seven decimal places? -0.0000012 Round 0.62426 to 2 decimal places. 0.62 Round -1.668 to the nearest integer. -2 What is 4310 rounded to the nearest ten thousand? 0 What is 4324.3 rounded to the nearest 100? 4300 Round 340.24 to the nearest ten. 340 Round 50815 to the nearest one hundred. 50800 Round 121920 to the nearest 10000. 120000 Round 48321300 to the nearest 1000000. 48000000 Round 0.02093 to two dps. 0.02 What is 57.01 rounded to the nearest 10? 60 Round 5.7777 to 1 dp. 5.8 What is 114.36 rounded to the nearest integer? 114 What is -4790000 rounded to the nearest one million? -5000000 What is 206550 rounded to the nearest 10000? 210000 What is 21.561 rounded to one decimal place? 21.6 What is 3051000 rounded to the nearest one million? 3000000 Round 3.0583 to 1 dp. 3.1 What is -0.000003897 rounded to seven dps? -0.0000039 Round 0.007046 to four decimal places. 0.007 What is 296690000 rounded to the nearest 1000000? 297000000 What is -30.5833 rounded to the nearest 10? -30 Round -79610 to the nearest ten thousand. -80000 What is -0.1794 rounded to 2 dps? -0.18 What is 614.4 rounded to the nearest ten? 610 Round -0.04195 to 3 dps. -0.042 Round -4.2336 to the nearest integer. -4 Round 0.0004239 to 5 dps. 0.00042 What is 0.003025 rounded to 3 dps? 0.003 What is -0.09228 rounded to 3 decimal places? -0.092 What is -1.0178 rounded to two decimal places? -1.02 What is 0.00000000521 rounded to 7 decimal places? 0 What is -0.14264 rounded to one dp? -0.1 Round 699400 to the nearest 100000. 700000 Round -0.0000008689 to 7 decimal places. -0.0000009 Round 0.000017685 to six decimal places. 0.000018 Round -1.816 to 2 dps. -1.82 Round 0.00011793 to 5 decimal places. 0.00012 What is 0.000010886 rounded to 6 decimal places? 0.000011 Round -8889.8 to the nearest 100. -8900 Round -41.4 to the nearest ten. -40 What is -0.000012908 rounded to 6 dps? -0.000013 What is -3355.4 rounded to the nearest one hundred? -3400 Round -38300 to the nearest 1000. -38000 What is 39795000 rounded to the nearest 1000000? 40000000 What is -442050 rounded to the nearest 100000? -400000 What is 0.2168 rounded to two dps? 0.22 What is -20.9272 rounded to 1 decimal place? -20.9 Round 0.000047 to 5 decimal places. 0.00005 Round -648000 to the nearest one hundred thousand. -600000 Round -0.18326 to two decimal places. -0.18 What is 4.6666 rounded to two dps? 4.67 What is -0.14934 rounded to three decimal places? -0.149 Round 0.0207423 to 4 decimal places. 0.0207 Round 0.0336 to three dps. 0.034 What is 0.78031 rounded to 2 decimal places? 0.78 What is -0.04216 rounded to three dps? -0.042 Round -86.03 to the nearest integer. -86 What is 0.0000011997 rounded to 7 decimal places? 0.0000012 What is -18.1786 rounded to the nearest integer? -18 What is -0.002773 rounded to 4 dps? -0.0028 Round -81700 to the nearest 10000. -80000 What is -685000 rounded to the nearest ten thousand? -690000 What is 99213000 rounded to the nearest 1000000? 99000000 What is -0.00002494 rounded to 6 dps? -0.000025 Round -68726000 to the nearest one million. -69000000 Round 14.4 to the nearest 10. 10 Round 30880 to the nearest 10000. 30000 What is -0.000001129 rounded to 7 dps? -0.0000011 Round -0.282 to one decimal place. -0.3 What is -0.0864 rounded to three decimal places? -0.086 Round -0.0000003326 to seven dps. -0.0000003 What is -1.36 rounded to 1 dp? -1.4 What is -0.0002189 rounded to 5 dps? -0.00022 What is 0.00001396 rounded to 6 decimal places? 0.000014 What is 11.048 rounded to 0 dps? 11 Round 16090 to the nearest one thousand. 16000 What is 0.00042114 rounded to 5 decimal places? 0.00042 Round -287500 to the nearest ten thousand. -290000 What is 0.0218 rounded to 2 decimal places? 0.02 Round -0.000013641 to 6 dps. -0.000014 What is 0.00001471 rounded to 6 dps? 0.000015 What is 0.00012153 rounded to four dps? 0.0001 What is 553.68 rounded to the nearest one hundred? 600 Round 78.4 to the nearest ten. 80 What is 0.00004883 rounded to six decimal places? 0.000049 Round -1146.35 to the nearest one hundred. -1100 Round -45240 to the nearest 10000. -50000 What is -0.003319 rounded to four dps? -0.0033 Round -10709000 to the nearest 1000000. -11000000 What is 24.62 rounded to the nearest ten? 20 What is -0.04599 rounded to four decimal places? -0.046 What is 3492.7 rounded to the nearest one thousand? 3000 Round 45700 to the nearest ten thousand. 50000 Round -408400 to the nearest 100000. -400000 What is 0.00102571 rounded to 4 decimal places? 0.001 Round -80360000 to the nearest 1000000. -80000000 What is 0.0000001748 rounded to 6 dps? 0 What is 32405 rounded to the nearest one thousand? 32000 What is -32178 rounded to the nearest one hundred? -32200 Round -716 to the nearest 100. -700 Round 5240 to the nearest one thousand. 5000 Round -0.00060215 to 6 decimal places. -0.000602 What is -20.96 rounded to 1 decimal place? -21 Round 0.0001517 to six dps. 0.000152 Round -0.2278 to 2 dps. -0.23 What is 5884.9 rounded to the nearest 1000? 6000 Round -295590 to the nearest 10000. -300000 What is -3.99743 rounded to one dp? -4 Round 0.000002975 to seven dps. 0.000003 Round 0.002086 to three decimal places. 0.002 What is 0.00004328 rounded to six decimal places? 0.000043 What is -2.5529 rounded to two decimal places? -2.55 What is 0.0019626 rounded to four decimal places? 0.002 What is -509980 rounded to the nearest one thousand? -510000 What is 0.02866 rounded to 3 decimal places? 0.029 What is -0.000002188 rounded to 6 dps? -0.000002 What is 0.00136487 rounded to four dps? 0.0014 What is -348.3 rounded to the nearest 10? -350 What is 812 rounded to the nearest 10? 810 Round 299600 to the nearest 10000. 300000 What is -1290300 rounded to the nearest 100000? -1300000 Round 0.058074 to three dps. 0.058 What is 0.00038637 rounded to 5 dps? 0.00039 Round 0.00000256633 to 6 decimal places. 0.000003 What is -0.0000558 rounded to 5 dps? -0.00006 Round 964500 to the nearest ten thousand. 960000 Round -1981000 to the nearest 100000. -2000000 What is -1307300 rounded to the nearest 10000? -1310000 Round -0.070263 to 3 decimal places. -0.07 Round -77.507 to the nearest ten. -80 Round -0.0001121 to five decimal places. -0.00011 What is 7282000 rounded to the nearest one million? 7000000 What is -293800 rounded to the nearest one hundred thousand? -300000 What is 0.12347 rounded to three dps? 0.123 Round 1380.1 to the nearest ten. 1380 Round 0.004625 to three decimal places. 0.005 Round -5.19 to 1 decimal place. -5.2 What is 0.00001582 rounded to seven decimal places? 0.0000158 Round -7185700 to the nearest 100000. -7200000 What is 0.005613 rounded to three dps? 0.006 Round -0.000445674 to 6 decimal places. -0.000446 What is -0.0000762 rounded to 5 decimal places? -0.00008 Round -0.00000361 to six decimal places. -0.00	{ "pile_set_name": "DM Mathematics" }
2 PM How many minutes are there between 10:35 PM and 5:13 AM? 398 How many minutes are there between 11:09 AM and 5:51 PM? 402 What is 592 minutes after 2:21 PM? 12:13 AM How many minutes are there between 11:29 AM and 11:31 AM? 2 How many minutes are there between 4:46 PM and 4:35 AM? 709 How many minutes are there between 11:32 PM and 9:10 AM? 578 How many minutes are there between 12:35 AM and 11:18 AM? 643 What is 641 minutes after 4:32 AM? 3:13 PM What is 51 minutes after 12:39 PM? 1:30 PM What is 708 minutes before 2:46 AM? 2:58 PM What is 128 minutes after 4:40 AM? 6:48 AM How many minutes are there between 4:21 AM and 2:41 PM? 620 What is 404 minutes after 4:41 AM? 11:25 AM How many minutes are there between 8:32 AM and 10:27 AM? 115 How many minutes are there between 3:40 PM and 2:42 AM? 662 How many minutes are there between 11:01 AM and 11:34 AM? 33 How many minutes are there between 8:22 AM and 7:54 PM? 692 How many minutes are there between 2:34 AM and 3:34 AM? 60 How many minutes are there between 1:56 PM and 12:30 AM? 634 How many minutes are there between 6:41 PM and 4:32 AM? 591 How many minutes are there between 6:32 PM and 1:14 AM? 402 What is 115 minutes before 4:07 PM? 2:12 PM How many minutes are there between 12:35 AM and 5:26 AM? 291 What is 624 minutes after 2:02 AM? 12:26 PM How many minutes are there between 7:31 AM and 12:51 PM? 320 What is 371 minutes before 3:52 AM? 9:41 PM How many minutes are there between 6:11 PM and 6:46 PM? 35 How many minutes are there between 2:32 PM and 6:29 PM? 237 What is 616 minutes before 3:14 PM? 4:58 AM What is 485 minutes before 5:38 PM? 9:33 AM What is 149 minutes after 4:27 PM? 6:56 PM How many minutes are there between 4:17 AM and 9:40 AM? 323 How many minutes are there between 7:30 AM and 1:42 PM? 372 How many minutes are there between 12:56 AM and 12:16 PM? 680 What is 67 minutes before 4:02 AM? 2:55 AM What is 639 minutes before 4:59 PM? 6:20 AM What is 669 minutes after 10:44 PM? 9:53 AM What is 90 minutes after 12:58 PM? 2:28 PM How many minutes are there between 6:11 PM and 1:07 AM? 416 How many minutes are there between 1:09 PM and 12:53 AM? 704 What is 104 minutes before 1:17 PM? 11:33 AM How many minutes are there between 2:51 AM and 6:18 AM? 207 What is 468 minutes before 12:54 PM? 5:06 AM How many minutes are there between 8:28 AM and 11:45 AM? 197 How many minutes are there between 8:57 PM and 2:29 AM? 332 What is 145 minutes after 12:43 AM? 3:08 AM How many minutes are there between 11:21 PM and 1:28 AM? 127 How many minutes are there between 9:53 AM and 7:49 PM? 596 How many minutes are there between 11:57 AM and 8:13 PM? 496 How many minutes are there between 5:16 AM and 3:40 PM? 624 How many minutes are there between 11:19 PM and 12:21 AM? 62 How many minutes are there between 8:55 PM and 9:07 PM? 12 How many minutes are there between 12:10 AM and 6:44 AM? 394 How many minutes are there between 6:09 AM and 8:38 AM? 149 What is 428 minutes before 2:39 AM? 7:31 PM What is 240 minutes after 12:10 PM? 4:10 PM How many minutes are there between 8:10 AM and 8:14 AM? 4 How many minutes are there between 10:21 AM and 6:14 PM? 473 How many minutes are there between 2:04 AM and 4:16 AM? 132 How many minutes are there between 8:04 PM and 8:08 PM? 4 What is 691 minutes before 9:02 PM? 9:31 AM How many minutes are there between 3:12 AM and 7:24 AM? 252 What is 249 minutes before 10:20 PM? 6:11 PM What is 277 minutes before 10:33 PM? 5:56 PM What is 599 minutes after 7:59 PM? 5:58 AM How many minutes are there between 11:59 PM and 5:01 AM? 302 What is 665 minutes after 3:07 PM? 2:12 AM How many minutes are there between 11:46 PM and 7:29 AM? 463 How many minutes are there between 5:46 AM and 11:39 AM? 353 What is 167 minutes before 10:30 AM? 7:43 AM What is 573 minutes before 7:34 PM? 10:01 AM How many minutes are there between 2:30 AM and 1:51 PM? 681 What is 572 minutes after 2:06 AM? 11:38 AM How many minutes are there between 8:28 PM and 1:31 AM? 303 What is 428 minutes after 8:18 AM? 3:26 PM What is 665 minutes before 9:18 AM? 10:13 PM How many minutes are there between 8:59 AM and 6:35 PM? 576 What is 209 minutes after 4:22 PM? 7:51 PM How many minutes are there between 4:09 AM and 7:14 AM? 185 How many minutes are there between 10:19 AM and 11:28 AM? 69 What is 719 minutes before 5:07 PM? 5:08 AM How many minutes are there between 3:37 AM and 3:08 PM? 691 What is 592 minutes after 11:08 AM? 9:00 PM How many minutes are there between 6:23 PM and 6:09 AM? 706 How many minutes are there between 8:12 AM and 9:44 AM? 92 What is 321 minutes after 10:27 AM? 3:48 PM How many minutes are there between 7:16 AM and 12:40 PM? 324 What is 181 minutes after 6:40 PM? 9:41 PM What is 120 minutes after 8:59 PM? 10:59 PM How many minutes are there between 11:24 AM and 10:36 PM? 672 What is 421 minutes after 2:51 AM? 9:52 AM What is 305 minutes after 4:27 PM? 9:32 PM What is 159 minutes before 11:43 PM? 9:04 PM How many minutes are there between 8:56 AM and 4:33 PM? 457 What is 76 minutes after 2:13 PM? 3:29 PM What is 320 minutes after 2:00 AM? 7:20 AM How many minutes are there between 10:47 AM and 8:34 PM? 587 What is 170 minutes after 1:31 AM? 4:21 AM What is 501 minutes before 5:12 AM? 8:51 PM How many minutes are there between 1:41 PM and 3:18 PM? 97 What is 391 minutes before 9:17 PM? 2:46 PM How many minutes are there between 5:31 AM and 9:00 AM? 209 What is 313 minutes before 9:00 PM? 3:47 PM What is 171 minutes after 9:17 PM? 12:08 AM How many minutes are there between 6:10 AM and 8:35 AM? 145 What is 492 minutes before 1:53 AM? 5:41 PM How many minutes are there between 11:10 AM and 9:35 PM? 625 What is 238 minutes before 7:37 PM? 3:39 PM How many minutes are there between 11:28 AM and 7:07 PM? 459 How many minutes are there between 10:55 AM and 7:47 PM? 532 How many minutes are there between 10:01 PM and 10:49 PM? 48 How many minutes are there between 12:21 PM and 9:13 PM? 532 How many minutes are there between 7:05 PM and 9:30 PM? 145 How many minutes are there between 4:19 PM and 10:58 PM? 399 How many minutes are there between 12:53 PM and 11:36 PM? 643 How many minutes are there between 4:55 AM and 10:19 AM? 324 How many minutes are there between 8:05 PM and 7:37 AM? 692 What is 473 minutes before 9:00 PM? 1:07 PM How many minutes are there between 5:40 AM and 10:32 AM? 292 What is 697 minutes after 4:42 AM? 4:19 PM How many minutes are there between 9:04 PM and 6:22 AM? 558 What is 76 minutes before 1:24 AM? 12:08 AM What is 166 minutes after 6:55 PM? 9:41 PM How many minutes are there between 6:46 AM and 9:24 AM? 158 What is 77 minutes before 1:32 AM? 12:15 AM What is 657 minutes before 10:03 AM? 11:06 PM How many minutes are there between 5:14 PM and 9:09 PM? 235 What is 663 minutes after 5:54 AM? 4:57 PM What is 14 minutes before 9:44 AM? 9:30 AM What is 505 minutes before 5:16 AM? 8:51 PM How many minutes are there between 12:01 AM and 2:52 AM? 171 What is 166 minutes before 3:16 PM? 12:30 PM How many minutes are there between 12:34 PM and 6:50 PM? 376 What is 391 minutes after 1:37 PM? 8:08 PM How many minutes are there between 11:50 PM and 9:55 AM? 605 What is 4 minutes after 8:10 AM? 8:14 AM What is 636 minutes after 2:32 PM? 1:08 AM How many minutes are there between 7:33 AM and 3:07 PM? 454 What is 38 minutes after 8:54 AM? 9:32 AM What is 667 minutes before 4:13 AM? 5:06 PM What is 217 minutes before 5:01 PM? 1:24 PM What is 367 minutes before 12:54 PM? 6:47 AM What is 171 minutes after 1:43 AM? 4:34 AM What is 458 minutes before 1:42 PM? 6:04 AM How many minutes are there between 6:10 PM and 8:49 PM? 159 How many minutes are there between 11:40 AM and 11:39 PM? 719 How many minutes are there between 11:29 PM and 6:10 AM? 401 How many minutes are there between 2:36 AM and 7:53 AM? 317 How many minutes are there between 11:00 AM and 7:27 PM? 507 What is 264 minutes before 1:47 AM? 9:23 PM What is 687 minutes after 9:24 PM? 8:51 AM What is 456 minutes before 3:09 PM? 7:33 AM What is 318 minutes after 11:38 PM? 4:56 AM How many minutes are there between 6:56 AM and 6:00 PM? 664 What is 416 minutes before 8:22 PM? 1:26 PM How many minutes are there between 5:21	{ "pile_set_name": "DM Mathematics" }
hen 584 is divided by 84? 80 What is the remainder when 3038 is divided by 8? 6 Calculate the remainder when 177 is divided by 171. 6 Calculate the remainder when 33 is divided by 12. 9 Calculate the remainder when 676 is divided by 62. 56 What is the remainder when 100 is divided by 44? 12 Calculate the remainder when 14319 is divided by 66. 63 What is the remainder when 152 is divided by 40? 32 What is the remainder when 2435 is divided by 66? 59 Calculate the remainder when 23 is divided by 8. 7 What is the remainder when 985 is divided by 55? 50 What is the remainder when 27 is divided by 11? 5 What is the remainder when 1661 is divided by 13? 10 What is the remainder when 1245 is divided by 83? 0 Calculate the remainder when 2304 is divided by 78. 42 Calculate the remainder when 41 is divided by 9. 5 Calculate the remainder when 1580 is divided by 99. 95 Calculate the remainder when 3213 is divided by 134. 131 Calculate the remainder when 154 is divided by 82. 72 Calculate the remainder when 2809 is divided by 2768. 41 What is the remainder when 6046 is divided by 42? 40 Calculate the remainder when 5625 is divided by 29. 28 What is the remainder when 742 is divided by 671? 71 What is the remainder when 1482 is divided by 8? 2 Calculate the remainder when 157 is divided by 32. 29 Calculate the remainder when 158 is divided by 97. 61 Calculate the remainder when 1492 is divided by 256. 212 Calculate the remainder when 1703 is divided by 27. 2 Calculate the remainder when 979 is divided by 35. 34 What is the remainder when 137 is divided by 47? 43 What is the remainder when 129 is divided by 22? 19 What is the remainder when 4535 is divided by 63? 62 What is the remainder when 508 is divided by 366? 142 Calculate the remainder when 229 is divided by 69. 22 What is the remainder when 124 is divided by 7? 5 Calculate the remainder when 7827 is divided by 182. 1 Calculate the remainder when 1382 is divided by 9. 5 What is the remainder when 335 is divided by 21? 20 Calculate the remainder when 461 is divided by 16. 13 What is the remainder when 207 is divided by 115? 92 Calculate the remainder when 188 is divided by 162. 26 Calculate the remainder when 443 is divided by 34. 1 What is the remainder when 342 is divided by 8? 6 What is the remainder when 10598 is divided by 62? 58 Calculate the remainder when 3894 is divided by 41. 40 What is the remainder when 2880 is divided by 474? 36 What is the remainder when 3564 is divided by 28? 8 What is the remainder when 122 is divided by 17? 3 What is the remainder when 135 is divided by 50? 35 Calculate the remainder when 433 is divided by 44. 37 What is the remainder when 93 is divided by 40? 13 What is the remainder when 319 is divided by 102? 13 What is the remainder when 1055 is divided by 30? 5 What is the remainder when 1515 is divided by 33? 30 What is the remainder when 888 is divided by 150? 138 Calculate the remainder when 328 is divided by 21. 13 What is the remainder when 1477 is divided by 17? 15 Calculate the remainder when 118 is divided by 2. 0 Calculate the remainder when 754 is divided by 131. 99 Calculate the remainder when 336 is divided by 183. 153 Calculate the remainder when 1922 is divided by 958. 6 What is the remainder when 1003 is divided by 48? 43 What is the remainder when 88 is divided by 47? 41 What is the remainder when 1070 is divided by 26? 4 Calculate the remainder when 141 is divided by 18. 15 Calculate the remainder when 324 is divided by 41. 37 Calculate the remainder when 18 is divided by 13. 5 What is the remainder when 381 is divided by 48? 45 Calculate the remainder when 229 is divided by 21. 19 What is the remainder when 11465 is divided by 31? 26 Calculate the remainder when 74 is divided by 19. 17 What is the remainder when 600 is divided by 208? 184 Calculate the remainder when 1074 is divided by 43. 42 Calculate the remainder when 391 is divided by 11. 6 Calculate the remainder when 309 is divided by 127. 55 What is the remainder when 445 is divided by 14? 11 Calculate the remainder when 227 is divided by 74. 5 What is the remainder when 127 is divided by 43? 41 What is the remainder when 357 is divided by 339? 18 Calculate the remainder when 232 is divided by 123. 109 Calculate the remainder when 8383 is divided by 195. 193 What is the remainder when 350 is divided by 59? 55 What is the remainder when 416 is divided by 15? 11 Calculate the remainder when 186 is divided by 19. 15 What is the remainder when 61 is divided by 7? 5 What is the remainder when 585 is divided by 59? 54 Calculate the remainder when 504 is divided by 501. 3 What is the remainder when 260 is divided by 24? 20 What is the remainder when 162 is divided by 11? 8 What is the remainder when 233 is divided by 57? 5 What is the remainder when 127 is divided by 37? 16 What is the remainder when 743 is divided by 37? 3 What is the remainder when 3307 is divided by 11? 7 Calculate the remainder when 609 is divided by 203. 0 What is the remainder when 502 is divided by 3? 1 What is the remainder when 853 is divided by 43? 36 Calculate the remainder when 567 is divided by 15. 12 Calculate the remainder when 1561 is divided by 34. 31 What is the remainder when 447 is divided by 50? 47 What is the remainder when 220 is divided by 25? 20 What is the remainder when 190 is divided by 66? 58 What is the remainder when 3733 is divided by 1243? 4 Calculate the remainder when 120 is divided by 91. 29 Calculate the remainder when 263 is divided by 97. 69 What is the remainder when 310 is divided by 21? 16 Calculate the remainder when 666 is divided by 209. 39 Calculate the remainder when 699 is divided by 56. 27 Calculate the remainder when 772 is divided by 222. 106 What is the remainder when 1078 is divided by 47? 44 What is the remainder when 429 is divided by 108? 105 What is the remainder when 954 is divided by 51? 36 Calculate the remainder when 4168 is divided by 139. 137 What is the remainder when 23758 is divided by 240? 238 What is the remainder when 346 is divided by 96? 58 Calculate the remainder when 200 is divided by 22. 2 What is the remainder when 6567 is divided by 18? 15 Calculate the remainder when 210 is divided by 55. 45 What is the remainder when 344 is divided by 23? 22 Calculate the remainder when 3602 is divided by 75. 2 Calculate the remainder when 407 is divided by 82. 79 What is the remainder when 81 is divided by 17? 13 What is the remainder when 2666 is divided by 127? 126 What is the remainder when 285 is divided by 13? 12 Calculate the remainder when 733 is divided by 148. 141 What is the remainder when 34 is divided by 3? 1 Calculate the remainder when 310 is divided by 26. 24 What is the remainder when 2218 is divided by 139? 133 Calculate the remainder when 895 is divided by 16. 15 Calculate the remainder when 113 is divided by 2. 1 Calculate the remainder when 267 is divided by 10. 7 Calculate the remainder when 1822 is divided by 83. 79 What is the remainder when 778 is divided by 52? 50 Calculate the remainder when 94 is divided by 62. 32 Calculate the remainder when 72943 is divided by 94. 93 Calculate the remainder when 32 is divided by 13. 6 Calculate the remainder when 107 is divided by 27. 26 Calculate the remainder when 331 is divided by 37. 35 What is the remainder when 254 is divided by 52? 46 Calculate the remainder when 1016 is divided by 91. 15 Calculate the remainder when 543 is divided by 63. 39 What is the remainder when 3695 is divided by 56? 55 Calculate the remainder when 5448 is divided by 218. 216 What is the remainder when 117 is divided by 35? 12 Calculate the remainder when 40 is divided by 10. 0 Calculate the remainder when 695 is divided by 6. 5 Calculate the remainder when 34846 is divided by 88. 86 Calculate the remainder when 1074 is divided by 20. 14 Calculate the remainder when 128 is divided by 70. 58 What is the remainder when 810 is divided by 30? 0 Calculate the remainder when 3627 is divided by 903. 15 What is the remainder when 1590 is divided by 200? 190 What is the remainder when 18 is divided by 10? 8 What is the remainder when 42 is divided by 5? 2 What is the remainder when 2025 is divided by 176? 89 What is the remainde	{ "pile_set_name": "DM Mathematics" }
.8 0.011.42509 0.0142509 What is -0.02 times 18414? -368.28 What is -3968775 times 0.5? -1984387.5 -5.672 -5 28.36 Product of 183 and 0.559. 102.297 -0.14 times -30738 4303.32 -11.6 times 155 -1798 Multiply 0.09 and -707. -63.63 Work out -128877 * 20. -2577540 227 * 0.3538 80.3126 Multiply 0.5 and -18965. -9482.5 Product of -5 and 2.80981. -14.04905 185.9071 times 2 371.8142 -5 * -230777 1153885 What is -81.2 times -0.045? 3.654 Product of 32353 and 5. 161765 Work out -0.4 * -0.5333. 0.21332 -7.14-8284 59147.76 Calculate -9.541-3. 28.623 What is the product of -2 and 2.0761? -4.1522 Multiply -0.4 and 573121. -229248.4 2-5692 -11384 Multiply 0.4 and -36279. -14511.6 What is 125 times -0.6183? -77.2875 Multiply -55 and 78. -4290 Calculate -6.4107.6. -688.64 -11.4-2.7 30.78 Multiply 0.025 and 381. 9.525 0.11 times -27975 -3077.25 What is the product of -12 and -1507? 18084 What is -7.4 times 188.23? -1392.902 What is the product of 80284 and 0.11? 8831.24 Calculate 135.091-2. -270.182 20802-3 -62406 Calculate -0.04-34. 1.36 -0.03 times 2053 -61.59 What is 1538 times 0.4? 615.2 Calculate -2482.678. -664.144 What is 7.11 times -107? -760.77 What is the product of 21896 and 0? 0 Product of 200 and 864. 172800 Product of 0.2 and 3264. 652.8 What is -0.0142165 times -3? 0.0426495 6.666 times 5 33.33 Multiply -0.047565 and 0.5. -0.0237825 Work out -17876 1. -17876 Product of -4 and -0.187422. 0.749688 Work out 66 * -868. -57288 Work out -16 * 4848. -77568 What is -6 times 755860? -4535160 -234600 * -0.2 46920 What is the product of -0.4 and -10.262? 4.1048 What is the product of -8765 and 10? -87650 42.5 * 936 39780 What is -0.55 times 6100? -3355 388573 times -0.1 -38857.3 Product of -0.18 and 89. -16.02 Calculate -0.4450791. -180316.4 What is -0.197383 times 1? -0.197383 What is the product of 13 and 0.0456? 0.5928 Calculate -8312964. -1076012 1024 * 0.0775 79.36 Work out -8119 * -0.078. 633.282 What is 45065 times 1? 45065 What is the product of 3 and -102254? -306762 Multiply 12351 and 1.6. 19761.6 -0.06 * -807.89 48.4734 What is the product of -2 and -54964? 109928 0.14-99290 -13900.6 0.3 -212134 -63640.2 Calculate 10765.8-0.9. -9689.22 Product of -2208 and 2.82. -6226.56 Work out -0.1 -3921.6. 392.16 Calculate 0.4-46473. -18589.2 What is the product of 0.153288 and -2? -0.306576 Product of -583.76 and -1. 583.76 What is the product of -0.01 and -1253.2? 12.532 What is 0.3 times -91069? -27320.7 1495 17 25415 -0.02 times -3268 65.36 1.5 times 1.4277 2.14155 What is the product of 54.23 and -57? -3091.11 Multiply 320 and 3160. 1011200 What is the product of 1099 and 23.7? 26046.3 Work out 0.2 * -19940. -3988 Calculate 465141-5. -2325705 Work out 0.5 -0.04104. -0.02052 Calculate 39-3302.6. -128801.4 What is -13 times 56886? -739518 What is the product of 2.1 and -0.2508? -0.52668 What is -0.183 times -13685? 2504.355 What is 36.8 times -117? -4305.6 0.276869 15373.8 What is 958411 times -0.4? -383364.4 -1 * 1946.2 -1946.2 What is -12.1 times 10.447? -126.4087 3242 * 1.1 3566.2 What is the product of -11799 and -3.81? 44954.19 Product of -0.5 and -1042.6. 521.3 -170 times 944 -160480 Calculate -9.290.85. -7.8965 Multiply -784 and -8.7. 6820.8 0.5390995 195497.5 Work out 165.16 * 19. 3138.04 -7539706-1 7539706 What is 43.54 times -0.0282? -1.227828 What is -661630 times 0.1? -66163 What is -13 times 2022? -26286 8 166 1328 Calculate -16530-2.8. 46284 Multiply -0.064975 and 0.4. -0.02599 5541-1 -5541 What is 5 times -2.5512? -12.756 What is the product of 0.3 and 0.0254509? 0.00763527 Product of 65601.6 and 5. 328008 Work out 0.5 * -90361. -45180.5 -6.575 * -2 13.15 What is -66 times 0.0438? -2.8908 -1.18 times 236.77 -279.3886 Calculate 0.12513.99. 251.399 1.805 -495 -893.475 234 times -62 -14508 Work out 0.04171 * 26.7. 1.113657 Work out -3.6 * 87.379. -314.5644 0.5 times 1949.7 974.85 What is the product of -3 and -4818? 14454 -23.2 * 104.9 -2433.68 -1.763 times -46 81.098 Product of -0.62 and 4288. -2658.56 Calculate -0.313564. -176.532 What is 0.6 times 0.01436? 0.008616 Work out 5.836 -1. -5.836 What is -8 times 240.48? -1923.84 Multiply 15440 and -62. -957280 -0.02 times -21139 422.78 Work out -0.92 * 0.049. -0.04508 What is -0.3056 times 1.2? -0.36672 Calculate 0.1384-0.7. -0.09688 2 -164727 -329454 Work out -0.6 * -2632. 1579.2 What is -377590 times -0.1? 37759 Calculate 3899000.3. 116970 -0.002 26795 -53.59 Multiply -0.746 and 3. -2.238 Work out -0.08 * 10.9. -0.872 -5776 * -1 5776 What is the product of 0.026 and 0.52? 0.01352 -2140.2 times -8 17121.6 Multiply -2688 and 0.4. -1075.2 Product of -102978 and 0.5. -51489 What is -73 times 0.2317? -16.9141 Product of 0.098 and -963. -94.374 0.15 times -3838 -575.7 -0.04 times 98.022 -3.92088 What is the product of -0.5 and -0.3129? 0.15645 Calculate 6561.3. 852.8 -1.9299 33 -63.6867 230250.062 1427.55 Product of -7 and -3491. 24437 Product of 1161 and -6. -6966 Multiply -19 and 5927. -112613 Calculate -32-3.6962. 118.2784 0.527664 13832 Calculate 18-4772. -85896 -2249 times 3 -6747 -16-13105 209680 -0.5 -13196.5 6598.25 -0.025-0.499 0.012475 0.262 0.0066 0.0017292 Work out 20.3 * -29.4. -596.82 Product of -8 and 7.05. -56.4 Multiply 2666.6 and -132. -351991.2 45.610 456 What is 0.4 times -4141.48? -1656.592 Multiply 2 and -2.9107. -5.8214 0.2 -37.4799 -7.49598 Multiply 5 and 19.366. 96.83 Multiply 13.1867 and 0.6. 7.91202 Work out 19 * 35.57. 675.83 5 * 1.02927 5.14635 0.41381-0.3 -0.124143 Calculate -6.04-92. 555.68 -0.2892336 times -4 1.1569344 Calculate -756-37. 27972 -2226 -0.1053 234.3978 1.127 * -217 -244.559 Multiply -8 and 19222. -153776 What is the product of 1357 and -1193? -1618901 What is the product of 343 and -1770? -607110 -56.795 * 0 0 Multiply 0.708748 and -1. -0.708748 -0.1091 times -15.8 1.72378 -2.889 times 0.03 -0.08667 Product of 0.05 and 0.131. 0.00655 0.039931 * -2 -0.079862 What is 672.6 times 11? 7398.6 What is the product of -3.5 and -2365? 8277.5 -0.18 * -1244 223.92 Product of -6.1 and -24305. 148260.5 What is the product of 0.8 and -294? -235.2 -11.0363 times 0.5 -5.51815 What is the product of -4 and -156007? 624028 Calculate 162-157.89. -25578.18 What is the product of 1 and 13545? 13545 What is the product of -11.2 and -0.008? 0.0896 Work out -46 5346. -245916 Multiply 45972 and -0.3. -13791.6 Multiply -8267 and 0.03. -248.01 13 times -38168 -496184 Work out 56294 * 1. 56294 Work out 52 * -3195. -166140 0.16 * 453550 72568 Work out 10.4 * 114. 1185.6 Product of -20 and -0.35997. 7.1994 What is -129.4 times 0.02? -2.588 Work out 190 * 15.96. 3032.4 Work out 26 * 0.081073. 2.107898 0 times 17.096 0 0.04802 times -0.9 -0.043218 What is the product of -0.09 and 156997? -14129.73 Product of -3414 and -315. 1075410 What is -1763 times -0.0627? 110.5401 Product of -0.124 and -5.2. 0.6448 0.0269 * 722 19.4218 Work out 1796441 * -0.1. -179644.1 Calculate -0.069-13820. 953.58 What is 523 times 32? 16736 Calculate -1.611.97. -3.1717 Product of 0.783 and -774. -606.042 -26.25 * 0.053 -1.39125 Work out 49391 * -3. -148173 Calculate 1681.541-0.5. -840.7705 Work out 661 22. 14542 -14 * -34865 488110 -0.17-0.0226 0.003842 Multiply 102.8 and 0.06. 6.168 -0.1 times -103173 10317.3 Product of -0.5 and 121279. -60639.5 Product of 373 and -0.019. -7.087 What is -0.4 times -6978? 2791.2 0.20.03185 0.00637 Multiply 8.3179 and 0.5. 4.15895 Multiply -255 and -0.252. 64.26 What is the product of -80.858 and 5? -404.29 Product of -0.1 and 243067. -24306.7 538 * -23.4 -12589.2 Work out 0.04017 * 56. 2.24952 What is 1.1 times -1254.3? -1379.73 0.02145 0.107 -11182-0.08 894.56 -0.37842.4 -311.688 Product of 1.0442 and 0.2. 0.20884 Product of -476 and 2408. -1146208 What is the product of 2.1 and 160492? 337033.2 Calculate 8792.04. 1793.16 Calculate -0.21-163.45. 34.3245 Work out 10 -15523. -155230 -0.34 * 28852 -9809.68 -217461-3 652383 Multiply -238 and 206. -49028 Calculate -371329. -334188 Product of -233.4 and -789. 184152.6 Work out -645 * -67. 43215 What is the product of -4.5 and 0.88? -3.96 What is 464.562 times -5? -2322.81 Multiply 0.02967 and 141. 4.18347 Product of 3 and -206443. -619329 M	{ "pile_set_name": "DM Mathematics" }
201? -20001110 In base 11, what is -1a566 + 9360? -11206 In base 16, what is 3 + -1d3c39? -1d3c36 In base 15, what is ed3c5 - -115? ed4da In base 15, what is -a + -18798c? -187997 In base 12, what is -24b52 - -5? -24b49 In base 8, what is 50 + 4347717? 4347767 In base 10, what is 10774230 - 0? 10774230 In base 13, what is -5 + 1cc460? 1cc458 In base 15, what is b86 + 23? ba9 In base 2, what is 1100110110 - -1000010101111? 1001111100101 In base 16, what is 0 + -5bb7f? -5bb7f In base 9, what is -482 - -166232? 165640 In base 12, what is 2a16a9206 + 1? 2a16a9207 In base 12, what is -13a8711 - -4? -13a8709 In base 11, what is 5011 + -1321? 37a0 In base 4, what is -13302223032 - 1013? -13302230111 In base 9, what is 1272 - 130548? -128266 In base 12, what is -3258631 + -4? -3258635 In base 14, what is 114 - 17bc3? -17aad In base 9, what is 1030851 + -24? 1030826 In base 15, what is -633e2 - 1? -633e3 In base 11, what is -187 - -132152? 131a76 In base 12, what is -290b2 + a1? -29011 In base 16, what is -18e + -5153d? -516cb In base 16, what is 22f - db98? -d969 In base 14, what is 6d2 + -2c7d? -258b In base 13, what is 572ab - -4a? 57328 In base 2, what is 1011101100110011 + -110000? 1011101100000011 In base 7, what is 2536 - 3142246? -3136410 In base 9, what is 621 - -122786? 123517 In base 10, what is 5 - -20380052? 20380057 In base 7, what is 5 + 166254110? 166254115 In base 8, what is 361506117 + 2? 361506121 In base 5, what is 13111330221 + -2? 13111330214 In base 9, what is -17462 - 6421? -24883 In base 4, what is 11313031 - -11303? 11331000 In base 10, what is 12003832 + 32? 12003864 In base 11, what is -a53841a8 + a? -a5384199 In base 2, what is -11010 + 1001100110000100101? 1001100110000001011 In base 2, what is -100111011001001000101011011 - -10? -100111011001001000101011001 In base 11, what is -7 - 162440a? -1624416 In base 13, what is 3 - -1617625? 1617628 In base 16, what is -3d84f + 18? -3d837 In base 7, what is 2130465 + -215? 2130250 In base 3, what is 2 + -1200011010120010? -1200011010120001 In base 2, what is -1 - -1001100010000101110? 1001100010000101101 In base 8, what is 451371 + -4274? 445075 In base 11, what is 1 - 3071143? -3071142 In base 9, what is -238781 + -24? -238815 In base 5, what is 1 + -322124200? -322124144 In base 5, what is -10140004223 + -2? -10140004230 In base 4, what is -2001 - -12332320203? 12332312202 In base 5, what is -32314300 - -1130? -32313120 In base 15, what is -1e - -37c85? 37c66 In base 2, what is 11011111011000010000 - -111000? 11011111011001001000 In base 6, what is -11055543 - -41? -11055502 In base 8, what is 72773 + 30? 73023 In base 7, what is -115143655 + 24? -115143631 In base 2, what is 1001011110 + 100101111001100? 100111000101010 In base 14, what is -bd588 - -251? -bd337 In base 14, what is 235941 - 1? 235940 In base 15, what is 62b36a5 - 4? 62b36a1 In base 5, what is 23 - 333341100? -333341022 In base 4, what is -10 + 321332120230? 321332120220 In base 16, what is 2 - 9157c? -9157a In base 15, what is -25026a3 - -7? -250269b In base 3, what is -111 - 1001002221110? -1001002221221 In base 13, what is 609 - -343a? 3a46 In base 3, what is 2 - 101000211102111? -101000211102102 In base 2, what is 1001101101000110 - 10101111? 1001101010010111 In base 5, what is 3030 - -13242? 21322 In base 2, what is -100010001000 - -110010000101101101? 110001100011100101 In base 5, what is 111412 - -4230024? 4341441 In base 16, what is -210aa423 + 2? -210aa421 In base 2, what is 1111001011011011001 - 10110110000? 1111001000100101001 In base 15, what is -10c6 - 596dd? -5a7b4 In base 16, what is 521 + 1595? 1ab6 In base 2, what is 101100 + 10000111111011100110? 10000111111100010010 In base 14, what is -56bd25 - -6? -56bd1d In base 3, what is 120112120022201 - 1? 120112120022200 In base 4, what is -10110312 + 1221230? -2223022 In base 5, what is -1232 - -210400230? 210343443 In base 7, what is -14 - 1440030510? -1440030524 In base 5, what is 200224110140 - -1? 200224110141 In base 6, what is 302045331 - 1? 302045330 In base 13, what is -10a2 - 17627a? -17734c In base 15, what is -a + -1be9abc? -1be9ac7 In base 6, what is -11133 + 523? -10210 In base 14, what is 6 - b5c259? -b5c253 In base 16, what is e + 7b11f3? 7b1201 In base 16, what is -278f - 258c? -4d1b In base 4, what is 121102 + -222310? -101202 In base 8, what is -1666 - 3170? -5056 In base 5, what is -2241 + 1213300? 1211004 In base 16, what is 8a0f05 - -4e? 8a0f53 In base 12, what is 73b23 + 368? 7428b In base 11, what is -1476910 + -28? -1476938 In base 10, what is -1300 - 86349? -87649 In base 11, what is -a450999 + 1? -a450998 In base 13, what is 5 + -a859308? -a859303 In base 9, what is -31 + -120013? -120044 In base 16, what is -2c67985 + 1? -2c67984 In base 5, what is 11031313 + 13230? 11100043 In base 13, what is -4 - -1183203? 11831cc In base 8, what is -240536 - -12777? -225537 In base 15, what is -2ab5e1d6 - 3? -2ab5e1d9 In base 12, what is -404a0308 + -3? -404a030b In base 10, what is -10498139 - 25? -10498164 In base 3, what is 110222121121 - 201202? 110221212212 In base 5, what is -12 - 1233410000? -1233410012 In base 9, what is 2817 - 183257? -180340 In base 8, what is -122501645 + 4? -122501641 In base 7, what is -3255313611 - 16? -3255313630 In base 10, what is 624 + 447? 1071 In base 6, what is -422 - -330551? 330125 In base 12, what is 1 - -b961b37? b961b38 In base 4, what is 11 + 3020321030101? 3020321030112 In base 16, what is 3f50c6 - -52? 3f5118 In base 8, what is -6 + 1117175525? 1117175517 In base 10, what is 3642 + -3334? 308 In base 15, what is e - -13384a? 133859 In base 13, what is -863a + 31b? -831c In base 3, what is 11 + -122112200010011? -122112200010000 In base 15, what is -82c3eb - -5? -82c3e6 In base 4, what is -1313212223 - -103? -1313212120 In base 7, what is -14 - 5552546? -5552563 In base 2, what is -1011010101000 - -1011111010101? 100101101 In base 15, what is 44274 - -89e? 44b23 In base 4, what is 23300102202311 - -3? 23300102202320 In base 5, what is -1002040140 - 2? -1002040142 In base 14, what is -3 - 29355cb? -29355d0 In base 15, what is -2 - -110c2c? 110c2a In base 3, what is -122011 - 210201220121? -210202112202 In base 11, what is -306181a - 2? -3061821 In base 3, what is -12 - 11120220101012212? -11120220101020001 In base 2, what is -1001111101100100101111 - 1011? -1001111101100100111010 In base 13, what is 595aa + -3? 595a7 In base 2, what is -1011111001100 - -10010101100111111? 10001001101110011 In base 12, what is 291a + aa3? 3801 In base 3, what is 11 - -1211211220102020? 1211211220102101 In base 12, what is -5 - 805926? -80592b In base 16, what is -1 + 8f402f? 8f402e In base 5, what is -3032444433 - 10? -3032444443 In base 12, what is 468950 + 4b1? 469241 In base 14, what is 39729 - -7? 39732 In base 10, what is 536908 - -2? 536910 In base 6, what is -3 + 100332430324? 100332430321 In base 7, what is -1042555226 - 5? -1042555234 In base 12, what is -290434 + -14? -290448 In base 15, what is -3 - 9d6612? -9d6615 In base 3, what is -11001010 + 2122210112? 2111202102 In base 2, what is -1 + -110000000001111000110111111? -110000000001111000111000000 In base 14, what is 440c3 + -109b? 43026 In base 12, what is 3 + -215a072? -215a06b In base 14, what is -35b0ac - 7? -35b0b5 In base 13, what is -22049ac - a7? -2204a86 In base 13, what is -13c - 239bb? -23b2a In base 3, what is -1212021012120 - -1002? -1212021011111 In base 6, what is 113130445 - 1? 113130444 In base 7, what is -36123 + -4024? -43150 In base 12, what is 1 - 200640? -20063b In base 5, what is -4 + 11140033221? 11140033212 In base 7, what is 3 - 134223320? -134223314 In base 16, what is 195213a + b? 1952145 In base 2, what is 100 - 10100010110110011010? -10100010110110010110 In base 15, what is 251c + 19a3? 3ec0 In base 11, what is -21540981 - -12? -2154096a In base 14, what is 7189a2b + -5? 7189a26 In base 2, what is 100110 - -10000001111011011001? 10000001111011111111 In base 16, what is 2360576 - 2? 2360574 In base 3, what is -102220011022120 - -20? -102220011022100 In base 5, what is -10 + -24240130321? -24240130331 In base 11, what is a88 + -1167? -18a In base 11, what is -21 + 396163? 396142 In base 6, what is -133 + -14340? -1451	{ "pile_set_name": "DM Mathematics" }
*3 and give v. 58 Express 72k - 2 - 72k - 2k*3 - 2k*2 in the form yk*3 + w + zk*2 + uk and give y. -2 Rearrange 15f2 - 516f*3 - 13f*2 - 164f*3 + 2 to l + cf*2 + hf + mf3 and give l. 2 Express -807s*2 + 0s*2 + 197s*2 - 152s*2 in the form qs*2 + h + vs and give q. -762 Express 1 - y*4 + 5y - 5y2 + y3 - 2y*3 + 5y*3 + 3y*2 + 2y*4 as qy*3 + jy*2 + vy*4 + n + xy and give v. 1 Rearrange -109 - 108 + 328 - 14f3 + 6f*4 - 114 to xf + jf2 + vf*4 + h + bf*3 and give h. -3 Express (-22c + 38c + 25c)(-5 + 5 + 1)(0 + 6 - 2) as j + vc and give v. 164 Express -10 + 242z + 16 - 5 - 3 + 2z2 as cz*2 + d + az and give a. 242 Rearrange 231f - 60f + 6f + 96f to uf + x and give u. 273 Express -4 - 2715h + 4 - 2210h2 + 2715h in the form m + th + wh*2 and give m. 0 Rearrange 3q + 63q3 + 48q*2 - 6 - 50q*2 + 8 + 0q + 0 to oq2 + t + lq*3 + zq and give z. 3 Express 11 + 237b2 - 83b*2 - 79b*2 + 2b - 78b2 in the form cb + y + mb2 and give m. -3 Rearrange (-2 + 0 + 1 + 2 + 1 - 1 + 2 + 4 - 5 + (-2 + 1 + 2)(0 + 5 - 3))(5c - c + 0c)(4 - 1 - 1)(30 - 30 - 150) to ac + v and give v. 0 Express (13n + 6n - 49n)((n - n - 2n)(-3 + 2 + 3) - 3n + 2n + 0n + 4n - 2n - 5n) in the form tn + mn2 + h and give m. 240 Rearrange -q2 - 2q4 + 17q + 13q3 + 11q - 15q3 to bq + mq4 + sq*2 + cq*3 + i and give s. -1 Express 0 + 13j - 3 - 13j + 37j*2 as vj*2 + dj + a and give v. 37 Rearrange (0 - 4 + 2)(0z + 4z3 + 0z) + (-4 + 4 - z)(-6z*2 - 17 + 17) to the form d + oz*3 + yz + fz2 and give d. 0 Express -381b + 54b + 61b + 67b - 555b in the form w + mb and give m. -754 Express -2m*4 + 1809m - 3623m + 3 - 7m*2 + 1812m in the form am2 + cm + pm3 + rm*4 + b and give r. -2 Express -2b*3 + 8b - 23b + 2 + 27b as hb + k + sb*2 + db*3 and give k. 2 Rearrange 2n*4 + 3n*2 + 34n - 46n + 0n*3 - 2n*3 to the form o + bn*2 + kn + sn4 + in3 and give i. -2 Rearrange 2313 + k3 - 2327 - 2k3 - k to sk + h + xk2 + tk*3 and give t. -1 Rearrange 0r - r - 21 + 56 + 37 + 39 to fr + p and give f. -1 Express -s3 - 5 + 2s + 5s4 - 7 - 3s*4 - 2s*2 + 9 in the form fs*3 + ls*4 + ms*2 + j + ns and give j. -3 Rearrange (-t*2 - 11t2 - t2 - 6t2)(-53 + 33 - 53)(-t + 2t*2 + t) to ut*2 + pt*3 + bt*4 + h + ft and give b. 2774 Express (-4 - 2i + 3 - 1)(-2 - 3 + 1)(13 - 2 + 11) in the form bi + u and give b. 176 Express (-5 + 2 + 2)(-55 + 1 - 41)(4h - 4h - 4h) as mh + x and give m. -380 Express -3o2 - 2o - o*2 + 35 + 0o2 + o2 + o*2 in the form qo*2 + z + jo and give j. -2 Express 84752f3 - 84783f*3 - 8f - 3f as zf*3 + uf + qf2 + n and give u. -11 Express (1 + 0 + 9)(-q + 3q + 0q)(18q*3 - 4q*3 - 5q*3)(5 - 1 - 3) in the form iq + b + jq*3 + oq*4 + uq*2 and give o. 180 Rearrange -4l - 86 - 58 + 4l + 2l*2 - 1 to the form w + fl*2 + kl and give f. 2 Rearrange (-79u2 + 2u*3 - 7556 + 7556)(2u + 0u + 4u) to hu + vu4 + cu*3 + k + tu*2 and give c. -474 Rearrange (-3f - 4f - 69 + 66)(-2 + 2 - 3) to the form if + o and give i. 21 Rearrange -j - 9 + 3 - 10 to g + fj and give g. -16 Express (-2a + 0a + 0a)(3a - 43a - 372a) as g + ia*2 + za and give i. 824 Rearrange 3 - 1 - 46r + 6 + 0 + 17r to h + dr and give d. -29 Rearrange (-5 + 5 + 3o)(-o3 - 2o + 2o) + 317o*2 + 498o*2 - 545o2 - o4 to co3 + do + n + ho4 + vo*2 and give h. -4 Rearrange m - 2m + 0m + (1 - 4 + 1)(3m - m - m) - 2m - 13 + 13 + m + 6m - 8m to o + qm and give q. -6 Rearrange -63 + s + 5s3 + 125 + s2 - 62 to the form ns + xs*3 + ms2 + k and give n. 1 Rearrange -f3 + 0f3 - 5f*3 + 6 - 3 + 2f to v + yf2 + cf*3 + uf and give u. 2 Express (-1 - 33b3 + 52b*2 - 100b*3 + 137b*3)(4 - 4 + b) in the form k + cb4 + fb + ab3 + qb2 and give f. -1 Rearrange q3 - 6 - 17q - 7q + 28q to the form sq + yq3 + lq*2 + d and give y. 1 Express -2f + 2f - 189f*2 + 184f*2 - 9f*3 - 4 as vf*2 + cf + w + qf3 and give v. -5 Express -60b - 2b3 - 3b*4 - 3 + 56b - 2b2 + 5b*4 as ub + gb2 + tb*3 + wb*4 + j and give w. 2 Express (0z + z - 3z)(209 + z*2 - 415 + 208 + 104z*3) as bz*3 + f + pz + az2 + yz*4 and give p. -4 Express (-291 + 291 - 662t + (-3 - 3 + 4)(t - 2t - t))(2t*2 - 4t*2 + 0t*2) in the form it + dt3 + ut*2 + z and give d. 1316 Express (0q + 2q - q - 3q - 2q + 4q + (4 - 1 - 1)(-2 + 2 + q) + 2q + 4q - 5q)((0 - 3 + 2)(5 + 18 + 1) - 3 + 1 - 1) in the form t + oq and give o. -81 Express -5 - 29o*2 + 36o*2 - 4o + 2o + 33o*2 as ko*2 + y + wo and give w. -2 Express (-5 - 3 + 6)(7 + 3 - 12)((1 + 2 - 1)(-2u - u + 2u) + u + u - 3u - 2u + 1 - 1 + 3u - 1 + 1) as tu + x and give t. -8 Express 0 - 178c - 4 + 179c + 3 in the form yc + i and give i. -1 Rearrange 799p2 + 801p*2 - 552p - 2395p2 + 797p*2 to wp*2 + bp + q and give b. -552 Express 62432 - 62432 + 557n2 as gn + j + zn2 and give z. 557 Express -43 - 50 + 94 - 4c - 40c as n + pc and give p. -44 Rearrange (-5h + 3 - 3)(951h - 781h + 1002h) to g + ph + dh2 and give d. -5860 Rearrange d3 - 24d*3 - 8580 - 16d*2 + 8580 to the form ld*3 + u + id*2 + rd and give i. -16 Express 9h - 24h + 5h + 10h - 1233h2 as n + ch*2 + vh and give v. 0 Express (-30 + 18 - 12)(0a2 + a2 + 0a2) as ja*2 + ta + d and give j. -24 Rearrange (-4 + 5 + 2)(122 + 24v - 122 + (2v + 0v - v)(-1 + 2 + 1) - 5v + 3v + 4v + v + v - 3v)(-121 - 40 + 49) to i + uv and give u. -9072 Rearrange (-2 + 2 + 2t)(-2 + 6 - 2)(-1161t - 48t*2 + 1161t) to ut2 + h + yt + kt3 and give u. 0 Rearrange (-3 + 3 + 3t*2)(0t - 20t + 0t) to kt*2 + g + xt + ct3 and give c. -60 Rearrange (-k2 + 13k - 13k)(-3 - 3 + 7)(-22 - 22 - 30) + (5k - 2k - k)(3k - k + 0k) to vk + hk*2 + o and give h. 78 Express 0 + 0 - r + (r + r + 0r)(-3 + 0 + 1) - 2r + 4r - 3r + r + 3r - 2r - 421r + 82r - 105r in the form p + wr and give w. -448 Rearrange -4d + 13 + 2d + 7d - 2d to the form ad + w and give a. 3 Express 0 + 0 + 2b + (-4 + 5 + 0)(-3b - 5b + 28b) - 3 + 3 - b in the form zb + j and give z. 21 Express 3774g4 - 11 + g2 - 2g3 - 3771g*4 + g + 8 in the form ng*3 + mg*4 + kg*2 + u + cg and give k. 1 Rearrange (2o - 1 + 1)(-515o3 + 937o*3 - 197o*3) to the form po*3 + lo*2 + m + go + fo4 and give f. 450 Express 24u - 88 - 3u - 19u as z + ku and give k. 2 Rearrange 13 - 7 - 6 - 129m*2 - 142m*2 to the form g + jm*2 + zm and give g. 0 Express (-3l3 - 2l*3 + 12l*3)(-7l - 5l + 5l + 2l - 5l + l + (3l - l - 4l)(1 + 5 - 4)) as al2 + zl*4 + jl*3 + o + dl and give z. -91 Rearrange (-4 + 2 + 0 + 2n)(-1190n + 655n - 784n) to the form s + bn*2 + dn and give d. 2638 Rearrange (-d + d - d)(-6 - 5 + 4)(2 - 4 - 2)(8d - 20d + 0d) to the form vd + rd*2 + b and give r. 336 Express 3k*2 + 3 - 2k*3 - 3 + (k - 4 + 4)(-8343k + 8343k - 182k2) in the form lk*2 + q + yk + tk3 and give t. -184 Rearrange (-6 + 5 + 5)(-3l + 2l + 2l)(2l3 - 3l + 3l)(11 - 28 + 100) to the form ul2 + jl*4 + zl*3 + v + al and give j. 664 Express -60 - 4f2 - 127 - 119 + 58 as t + af*2 + uf and give t. -248 Rearrange -8u4 - 8 + 0u*2 + 2u*2 + 0u*2 + 8 + 3 to w + hu*2 + ju*3 + ou + lu4 and give l. -8 Express -5h + 1 + 4h2 + 16h*2 - 11h*2 as ch*2 + n + rh and give r. -5 Express 3601m - 3602m + 17m4 + 4 - 6 + m2 + 17m*3 as zm*3 + gm*2 + tm*4 + um + v and give t. 17 Rearrange (-26 + 26 - 9y)(5y2 + 3y*3 - 5y*2)(-8 - 7 + 14) to the form by3 + ry + vy2 + wy*4 + a and give w. 27 Rearrange -c - 26c3 - c + c3 - 3 + 11c3 - c2 to kc*3 + y + bc + fc2 and give f. -1 Rearrange 4 - 2 - 1 - s3 + (-10 + 72s - 152s + 54s)(5s2 - s2 - 3s2) to the form ks*2 + gs*3 + r + cs and give k. -10 Rearrange (-7u3 + 441u	{ "pile_set_name": "DM Mathematics" }
Is (0 + (-6)/k)/((-11)/44) even? True Let b = 5735 - 4672. Does 18 divide b? False Suppose 0 = 2u - 5x - 3770, 5u + 2x - 7134 = 2320. Suppose 11h = -3h + u. Is 10 a factor of h? False Suppose -24 = -4i, 0 = 3a + 8i - 13i - 4083. Is a a multiple of 59? False Suppose 0 = 4p + 82 - 94. Suppose 12k - 411 = -j + 14k, k = -p. Does 15 divide j? True Let i be (16 - 1)(-9)/(-15). Suppose -il = -14 + 77. Let h = l + 20. Does 12 divide h? False Let t = 618 - 414. Suppose -5k + t = -171. Is k a multiple of 5? True Suppose x + t + 4 = 43, 0 = -5x + 5t + 205. Is 1/5 + 26872/x a multiple of 14? True Suppose -7g = -9g - 54. Let s = g - -32. Suppose sr - 150 = -r. Is r a multiple of 5? True Suppose -4j = -4f + 8, 4f - 3j - 2j - 6 = 0. Suppose -2x + 816 + 511 = -r, fr - 1996 = -3x. Is x a multiple of 8? True Let f be (32/(-3))/(-8) - (-848)/3. Suppose h = 2w - f, -3w + 8w - 3h - 708 = 0. Is w a multiple of 24? True Suppose 2q + 4z = 44698, -44z + 89426 = 4q - 46z. Is q a multiple of 17? True Is (-4280848)/(-407) - (-112)/(-2072) even? True Suppose -64i - 79590 = -78i. Does 21 divide i? False Let r(k) = 15k - 9. Let w = 5 - 3. Let f be 10 + 0w/6. Is r(f) a multiple of 47? True Let t(z) = 3z + 13. Let a be t(-21). Let m = a - -52. Suppose -5w - 3k = 2k - 90, mw + 3k - 34 = 0. Is w a multiple of 5? True Let o(n) = -2n2 + 9n + 17. Let d(g) be the third derivative of -g5/60 + g4/24 + g*3/6 + 3g*2. Let w(q) = -6d(q) + o(q). Is w(5) a multiple of 42? True Let r = 21893 + -2911. Does 7 divide r? False Let w(z) = -z*3 - 52z*2 - 921z. Is 10 a factor of w(-27)? False Let d = -355 - -352. Suppose 4 = k + 10. Is (-4 - (-4 - 76))d/k a multiple of 20? False Suppose -18u + 36789 - 5301 = 30u. Does 118 divide u? False Suppose -135930 = -10o - 335o. Is o a multiple of 5? False Suppose -3q = -2a + 15694 + 29708, -q - 22698 = -a. Is 12 a factor of a? True Let v be 18/10 + (-5)/(-25). Suppose 0 = -5b + vt + 12, t = 4b - 4t + 4. Suppose 155 = bi - 5p, 0 = -2i - 3p - 17 + 78. Is 7 a factor of i? True Let g be 434/35 - 8/20. Suppose -g = 4a, -3a - a = -4d + 112. Does 5 divide d? True Let c be (6/9)/((-1)/(-597)). Let d = -132 + c. Let p = -134 + d. Is p a multiple of 33? True Let r(v) = -13v + 6. Let p = 56 - 62. Does 21 divide r(p)? True Let j = 65 - 62. Suppose -jz = -4s - 0z + 16, 0 = 3s + 5z + 17. Does 9 divide ((-60)/16)/(s/(-12))? True Suppose -34203 = -5c + 1839t - 1836t, 0 = -5c + 2t + 34202. Is c a multiple of 9? True Suppose 10r - 9472 - 36938 = 0. Suppose -61l + 64l = r. Is 13 a factor of l? True Let r(j) = 10j2 - j - 301. Is 70 a factor of r(-20)? False Let c(s) = 131s*2 - 12s + 7. Let b be c(3). Let i = b - 748. Is i a multiple of 19? False Suppose b - 5f - 6411 = 0, 0 = -5b - 5f + 27740 + 4105. Is b a multiple of 73? False Let a = 225 + -157. Let t = a + -65. Does 13 divide 0 + 173 - (-20)/(-15)t? True Let j = 167 - 162. Suppose 8l - jl = 567. Does 7 divide l? True Let n(b) = -2b3 + 14b*2 + 12b + 7. Let z be n(9). Let t = -41 + z. Let u = 481 + t. Does 31 divide u? False Let r(a) be the first derivative of 2a3/3 - 5a*2/2 - 16a + 133. Does 24 divide r(8)? True Let o(f) = -2f3 + 8f*2 - 3f - 19. Let u be o(-7). Suppose -18p = -19p + u. Is p a multiple of 70? False Let s(p) = 34p - 24. Let g(b) = -8b + 6. Let m(d) = -18g(d) - 4s(d). Does 3 divide m(6)? True Suppose -4y + 750 = 2u, -3u + 4u = 2y - 385. Let k be ((-7)/(-14))/(2/(-500)). Let d = y + k. Does 13 divide d? True Let k be 1(99 + 4 - 2). Let f = k + -66. Suppose -17d = -12d - f. Is 5 a factor of d? False Let k(t) = 2t + 17. Let y be k(4). Suppose -3j - y + 6 = -4v, 3v - 3j = 15. Suppose -vp + 88 = h + h, 3h - 132 = 2p. Does 9 divide h? False Suppose -93y = -90y - 9. Suppose 4f + 43 = yd + 1120, -3f + d + 809 = 0. Is 15 a factor of f? True Suppose 0 = 36z - 219414 - 176151 - 896979. Is z a multiple of 22? True Let p(l) = -2l + 36. Let q be p(22). Let b be (-1 - (-16 - -1)) + 10 + q. Suppose 18k = bk + 58. Is k a multiple of 6? False Suppose -41835 = -4o + d, -16d = -3o - 12d + 31360. Does 20 divide o? True Let k = -90905 + 127532. Does 45 divide k? False Let g be 1212/(-78) - (-2)/(-13). Is g - (1840/(-5) - -6) a multiple of 24? True Suppose -4s + 181 = -111. Let u = 83 - s. Suppose 0 = 15c - uc - 840. Does 42 divide c? True Let i(b) = -42b*2 + 1387b - 33. Let v be i(33). Let a(f) be the first derivative of -f*2/2 + 73f - 1. Is a(v) a multiple of 14? False Let z(o) = -9 - 9 + 60o2 - 3 - 3 + 6o - 6. Does 17 divide z(-5)? False Suppose -5m + 2r = -214, -r - 188 = -4m - 5r. Suppose 404 = 4v - 4h - m, -3h = 0. Suppose 3f = 4c + 196, 4c = 4f - v - 156. Does 12 divide f? True Suppose n - 334 = -2s, n = -5s + 401 - 49. Does 6 divide n? False Suppose 0 = -5r - 3o + 30585, 63r + 4o + 30620 = 68r. Is r a multiple of 24? True Let a(k) be the first derivative of -3k4/2 - 3k*3 + 7k*2 + 22k + 213. Is a(-4) a multiple of 103? True Suppose -d - 1337 = 5l + 2d, -3l = -d + 791. Suppose 0 = 4k - 1135 - 417. Let a = l + k. Is a a multiple of 25? False Is (7 + 11 - 69)/(3/(-142)) a multiple of 71? True Is 5 a factor of (-3 - 88/(-11))(-3)/(3/(-319))? True Let o be 2/4 - (-3)/1833. Suppose 5v = -10, -of + 3v + 86 = -5f. Is 4 a factor of f? True Let j(g) = g*3 + 23g*2 + 8g + 31. Let l be j(-24). Let d = l - -1871. Does 42 divide d? True Let c(s) = -s*3 - 3s*2 + 2s + 3. Let o be c(-6). Suppose 4y + 4a - 456 = -0y, -2y + 5a + 228 = 0. Let g = y - o. Is 5 a factor of g? True Let u(d) = -d3 - 10d*2 + 13d + 23. Let g be (-11)/(-2)(-5)/(20/8). Let a be u(g). Is (a - (-8)/40)10/4 a multiple of 2? False Suppose -9227 = -2o - 4u + 4289, 2o + 5u - 13513 = 0. Does 43 divide o? False Suppose 2h = -3x - 0 - 2, -x = 4h + 14. Suppose 0 = -4b - 3q + 554, -2q - 2 - x = 0. Is 28 a factor of b? True Suppose 0 = 101i - 76i - 906725. Is i a multiple of 14? False Suppose -y + 549 = -2f, 2f - 2y - 57 = -607. Let r = 717 + f. Is 91 a factor of r? False Let i = 553 + -398. Let g = 820 - i. Is 48 a factor of g? False Suppose -4h + 3j = -h - 951, -3j - 1273 = -4h. Suppose -5s + h = -5r + 8r, r - 3s - 112 = 0. Does 5 divide r? False Suppose 2j - 8j - 156 = 0. Let t = -20 - j. Suppose -q + 7 = -t. Is q even? False Let c(y) = 7y*3 - 4y*2 + 9y - 6. Let m(h) = 23h3 - 13h*2 + 29h - 18. Let f(t) = 7c(t) - 2m(t). Does 10 divide f(2)? True Let h(n) = 3n2 + 3n - 7. Let c be h(-4). Let d = 27 - c. Does 13 divide (0 + 65/d)(2 + -4)? True Let i be (9 - 0 - (3 - 0)) + 3. Suppose -1031 + 383 = -ih. Is 4 a factor of h? True Suppose 0 = -v - 2, 5v + 10 = 5g. Suppose 0h - s - 86 = 5h, -5h + 5s - 110 = g. Let w(d) = d*2 + 4d + 14. Is w(h) a multiple of 45? False Let o(n) = n*2 + 4n + 3. Let t(x) = x*2 + 4x - 5. Let m be t(-4). Let q be o(m). Let a(v) = v*2 - 6v + 11. Is 9 a factor of a(q)? True Let k(j) = -j*2 - 3. Let w be k(0). Is w - 607/(-11) - 2/11 a multiple of 11? False Let j be 116/16 + 3/(-12). Let n(t) = -70t + 12. Let d be n(j). Is 7/56 - d/16 a multiple of 10? True Let d = 4 - -1. Suppose -df - 3r = 12 - 5, 3r + 3 = -3f. Does 24 divide 0 - 916/f? True Suppose -44 - 58 = -17w. Is 25 a factor of -124(w - 31/2)? False Suppose -311 = 2w + 5v + 177, 1254 = -5w - 4v. Let t = -164 - w. Let j = -40 + t. Does 10 divide j? True Suppose 343p - 352p + 298710 = 0. Does 101 divide p? False Suppose 9b - 4b - 9425 = -5w, 0 = b + 4w - 1888. Does 4 divide b? True Let n(l) = 16l*2 + 36l - 170. Is 19 a factor of n(18)? True Suppose 2x - 2802 = 5u, 4x = -x - 5u + 6970. Does 8 divide x(-8)/(-32) - -2? False Let m(y) = y2 - 3y - 39. Suppose 5i = 5f - 35, f - 4i + 0i = 22. Let z(t) = 3t3 - t2 - 4t + 5. Let b be z(f). Is 14 a factor of m(b)? False Let x(a) = a*3 - 13a*2 - 2a + 130. Let v(m) = 17m - 427. Let t be v(26). Does 22 divide x(t)? True Let a = 46 - 46. Suppose 2m - 2q - 60 = a, 150 = 3m + 2m + 2q. Suppose 0 = -2*z + 2 + m. Is z a multiple of 4? True Let x be 63 + -3 + (-8)/4. Suppose u + 50 - x = 0. Is (u/(-20))/(1/(-45)) even? True Is 81 a factor of (	{ "pile_set_name": "DM Mathematics" }
-s*3 + 67s*2 + 1444s - 96436. What is v(67)? 312 Let s(m) = m*3 + 3m*2 - 3m + 175. What is s(-14)? -1939 Let d(j) = -j*2 - 10241j - 14642500. Calculate d(-1718). 14 Let v(d) = -d*2 + 244d + 3515. Determine v(-17). -922 Let c(i) = -342i2 + 3760i + 35. Give c(11). 13 Let z(u) = 29u2 - 2400u - 2407. Determine z(-1). 22 Let t(a) = -108a2 + 421a + 53. Determine t(4). 9 Let u(y) = y*3 - 22y*2 - 2389y - 226. Give u(-39). 164 Let u(a) = -a*3 + 134a*2 - 4390a + 238. What is u(77)? 161 Let b(n) = -n*2 - 1410n - 89987. Give b(-67). -6 Let h(r) = -4397r + 153946. Determine h(35). 51 Let o(u) = 1098u + 69087. What is o(-63)? -87 Let t(y) = -y*3 + 30y*2 + 843y - 91. Give t(-18). 287 Let i(c) = -2c3 + 295c*2 - 731c + 339. What is i(145)? -531 Let u(h) = 5h2 + 5628h + 16841. Give u(-3). 2 Let y(v) = 3v2 + 5498v + 43796. Give y(-8). 4 Let c(m) = 1640m + 11695. Determine c(-7). 215 Let x(s) = -5s*2 + 22s + 334. Determine x(-10). -386 Let d(x) = 22x - 1267. Give d(43). -321 Let k(v) = -220v - 2121. What is k(-4)? -1241 Let v(g) = -15572g + 125033. Calculate v(8). 457 Let s(p) = 3p*2 + 175p + 1302. Determine s(-9). -30 Let o(d) = -146d2 + 555d + 12. Determine o(4). -104 Let v(m) = -m*3 + 2593m*2 + 325555m - 599. Determine v(-120). 1 Let l(d) = 29755d - 386869. Determine l(13). -54 Let z(g) = -4146g + 427044. Determine z(103). 6 Let n(f) = -5f3 - 653f*2 - 4911f - 30. Give n(-8). 26 Let x(m) = -741m2 + 9. What is x(1)? -732 Let u(r) = -166r - 4302. Determine u(-26). 14 Let u(b) = b*3 + 240b*2 - 10577b - 3866. Give u(-278). -252 Let j(i) = i*3 - 113i*2 + 1277i + 297. Calculate j(13). -2 Let h(x) = -x*3 - 89x*2 + 943x - 2232. Determine h(6). 6 Let z(x) = -3x3 - 33x*2 + 268x - 2. Determine z(8). -1506 Let u(i) = -51083i + 4648547. Determine u(91). -6 Let l(i) = -52602i + 6364841. Determine l(121). -1 Let l(n) = -12n2 - 103n + 33. What is l(-9)? -12 Let b(d) = d*3 - 60d*2 + 106d + 2593. What is b(57)? -1112 Let k(g) = -g*2 + 197g - 6815. Determine k(45). 25 Let q(a) = 239a + 1426. Calculate q(-6). -8 Let m(s) = 1846s + 267667. Determine m(-145). -3 Let m(j) = -j*2 + 4091j + 12279. Determine m(-3). -3 Let j(g) = 136g + 2028. Calculate j(-13). 260 Let k(x) = 2x*2 - 1439x + 167467. Determine k(146). 5 Let k(s) = 3157s - 113785. Calculate k(36). -133 Let d(c) = -14c*2 + 997c - 7919. Calculate d(9). -80 Let f(b) = 15525b - 16223627. Give f(1045). -2 Let q(k) = 2k*3 - 1523k*2 + 3774k + 15966. Calculate q(759). 27 Let n(w) = -5697w3 - 8w*2 - 6w + 10. Determine n(1). -5701 Let x(g) = 87g2 + 345g + 64. What is x(-4)? 76 Let p(d) = -160212d - 2563390. Give p(-16). 2 Let s(r) = r3 + 10r*2 + 273r + 2869. Calculate s(-10). 139 Let o(m) = -m*2 - 41652m + 1125327. Give o(27). -6 Let i(q) = -13394q2 - 40262q - 4. Determine i(-3). 236 Let n(z) = 2z + 161. Determine n(-77). 7 Let a(m) = -55m + 3287. Give a(69). -508 Let o(i) = 4279i + 746. Calculate o(0). 746 Let i(k) = -1637k - 157092. Give i(-96). 60 Let i(m) = -168m2 - 93649m - 40665. Calculate i(-557). -4 Let q(u) = -2272u - 10602. Calculate q(-3). -3786 Let y(j) = -11j*3 - 3j*2 - 400j - 2650. Determine y(-7). 3776 Let v(y) = 2y2 + 218y + 437. What is v(-2)? 9 Let r(l) = l*2 - 6902l - 3331815. Calculate r(-453). 0 Let t(f) = -14f3 + 36f*2 + 211f - 1241. Determine t(6). -1703 Let n(q) = -q*3 + 22q*2 - 66q - 184. Give n(8). 184 Let v(y) = y*3 - 29y*2 + 13y - 210. Give v(30). 1080 Let h(m) = 8m2 + m - 1650. Determine h(0). -1650 Let v(j) = 150j*2 + 1504j + 59. Give v(-10). 19 Let h(s) = 2s3 - 1240s*2 - 382s + 236875. What is h(620)? 35 Let k(w) = -6692w + 287799. Calculate k(43). 43 Let p(h) = -28h*2 + 7726h + 246. Determine p(276). -306 Let b(f) = -22f - 1979. Give b(-99). 199 Let x(l) = -5l*2 + 25l - 131. Calculate x(5). -131 Let n(k) = 139k2 - 47960k - 46361. Calculate n(346). 3 Let m(t) = -81652t + 81656. Calculate m(1). 4 Let y(m) = 1215m + 112873. What is y(-93)? -122 Let z(y) = 3136y - 486225. What is z(155)? -145 Let z(m) = 2m*3 - 1481m*2 + 37171m - 447. Calculate z(26). -5 Let i(t) = -4t3 - 187t*2 - 688t - 7. What is i(-4)? 9 Let f(o) = -1773o + 410999. Determine f(232). -337 Let u(d) = -d2 - 80d - 1260. Calculate u(-50). 240 Let f(y) = -6358y + 495932. What is f(78)? 8 Let o(u) = 4u*2 + 21u - 1915. Determine o(-26). 243 Let r(h) = -2h3 - 623h*2 + 1572h + 735. Determine r(-314). 107 Let k(t) = -t*3 + 108t*2 + 49t + 6605. Determine k(109). 65 Let z(u) = -7u2 - 810u + 78. Give z(-116). -154 Let v(u) = -47u2 + 285u - 37. Calculate v(4). 351 Let l(g) = -9075g - 1597210. Determine l(-176). -10 Let h(n) = 512n - 14647. Give h(29). 201 Let u(w) = -30w3 - 336w*2 + 152w + 2401. Give u(-11). 3 Let s(u) = -u*2 - 30661u - 245216. Determine s(-8). 8 Let x(h) = 635h + 205913. What is x(-324)? 173 Let f(o) = -7o*2 + 405o + 7650. Give f(-15). 0 Let l(t) = 3480t + 139452. Calculate l(-40). 252 Let x(v) = v3 + 939v*2 - 11534v - 116012. What is x(-951)? 10 Let c(u) = -4u2 - 1138u - 4589. Calculate c(-4). -101 Let d(v) = -2v2 + 2354v + 195600. Calculate d(-78). -180 Let u(h) = 4h2 + 518h + 7645. Calculate u(-17). -5 Let b(k) = -8534k + 76974. What is b(9)? 168 Let o(g) = g3 - 60g*2 - 61g + 146. What is o(61)? 146 Let j(y) = 170037y + 680145. Calculate j(-4). -3 Let o(q) = -12q*3 - 797q*2 - 11098q + 836. Calculate o(-20). -4 Let t(p) = -41p3 - p2 + 34p - 66. Give t(2). -330 Let m(h) = -h*2 - 153h - 5800. Give m(-85). -20 Let z(j) = 13291j + 159535. Give z(-12). 43 Let l(z) = -738z - 34706. Calculate l(-48). 718 Let z(c) = -4276c - 3355. Determine z(-1). 921 Let i(z) = -2z*2 + 1545z - 275376. Determine i(279). -3 Let h(c) = -67c3 - 6c*2 + 76c + 81. Give h(-1). 66 Let b(r) = 5646r + 67765. Determine b(-12). 13 Let b(n) = -929n - 21265. Determine b(-23). 102 Let h(k) = 40523k - 121492. What is h(3)? 77 Let b(r) = -r3 + 12r*2 - 31r + 1234. What is b(16)? -286 Let s(q) = -q*3 + 66q*2 - 274q + 5360. What is s(63)? 5 Let z(w) = 3445189w + 58568222. Give z(-17). 9 Let p(m) = 3596m + 21668. What is p(-6)? 92 Let n(b) = 120b - 34894. Calculate n(291). 26 Let p(l) = l3 + 23l*2 - 6698l + 1712. What is p(71)? 8 Let y(u) = 9u3 + 57u*2 + 27u - 19. Give y(-6). -73 Let y(h) = -11140h + 45785. Give y(4). 1225 Let j(k) = -117k*2 - 2221k + 29529. Calculate j(-28). -11 Let n(i) = 2370i - 16639. What is n(7)? -49 Let k(t) = -122t*2 - 816t + 265. Calculate k(-7). -1 Let j(w) = -3w2 - 538w + 2837. What is j(5)? 72 Let z(y) = -74116y + 33055741. Calculate z(446). 5 Let j(m) = -52m*2 + 4191m + 44007. What is j(90)? -3 Let c(t) = -145t + 3486. What is c(18)? 876 Let q(d) = -28d*2 - 135d - 133. What is q(-1)? -26 Let h(c) = c*3 - 52c*2 - 442c - 2239. Give h(60). 41 Let n(a) = 6a2 + 1614a + 14040. Calculate n(-9). 0 Let t(c) = c*3 + 48c*2 - 1026c - 51397. What is t(-46)? 31 Let o(c) = 33c2 + 666c - 1330. What is o(2)? 134 Let b(x) = 100x - 3611. Give b(37). 89 Let n(t) = 100717t + 2719356. Give n(-27). -3 Let d(k) = k*2 - 92k - 442. Determine d(109). 1411 Let c(o) = o*3 - 426o*2 - 39897o + 965. Calculate c(505). -45 Let z(u) = -u*2 + 209u - 4828. Determine z(27). 86 Let a(t) = -6t - 377. Calculate a(-35). -167 Let g(n) = n3 + 81n*2 - 269n - 1627. What is g(-84)? -199 Let v(y) = -227806y - 911229. Determine v(-4). -5 Let n(b) = -25b*2 - 736b + 1199. Calculate n(-31). -10 Let o(a) = -a*2 + 244a + 13000. Determine o(289). -5 Let n(q) = 4q3 + 334q*2 - 330q + 15334. Calculate n(-85). 34 Let m(d) = 10d2 - 2211d - 1986. What is m(222)? 12 Let o(a) = -180a + 11628. Calculate o(64). 108 Let t(p) = -18p*2 - 4506p - 43181. What is t(-10)? 79 Let v(h) = -18h2 - 387h - 1115. Determine v(-18). 19 Let h(l) = -43l2 - 48l - 230. Give h(-5). -1065 Let g(w) = 33297w + 332950. Determine g(-10). -20 Let j(b) = 1911b + 69109. What is j(-36)? 313 Let u(a) = a*3 + 77a*2 - 485a + 406. What is u(-83)? -673 Let l(b) = b*2 + 182b - 1398. Determine l(10). 522 Let z(r) = -8131*	{ "pile_set_name": "DM Mathematics" }
+ y*2 - y + 0y*3 in the form fy + iy3 + m + cy*2 and give m. 1 Rearrange 19 + 10h - h - 19 to u + gh and give g. 9 Express 11o*2 - 3o*2 - 2 + 11o*4 - 9o*2 + 11o*4 in the form mo*4 + jo*2 + yo + go3 + f and give m. 22 Rearrange 2t*3 + 2t - t*2 - 1 + 4t2 - t2 - t to the form y + vt + ot*3 + dt*2 and give v. 1 Express 40m*2 - m + 47m*2 - 80m*2 as vm + tm2 + o and give t. 7 Rearrange 17t - 2 - 10t + 0 - t2 + 2t*4 - 5t - 2t3 to vt*3 + dt*4 + ht*2 + rt + j and give v. -2 Express -3o + 4o + 3o + 0o in the form jo + z and give j. 4 Express (6k*2 - 2k2 - k2)(-51 - 11 + 4)(3 - 1 + 0) as bk + ck*2 + q and give c. -348 Express -2m*2 + 12m + 15m - 27m - 4 as q + gm + xm*2 and give q. -4 Express 0y*2 - 2y*2 - 2y - 1 - 32y3 + 33y*3 + 4y*2 as cy + oy3 + x + iy*2 and give i. 2 Express (2 - 1 + 0)(3k + 4k - 6k + (1 + 2 - 2)(k + 0k + 0k) + 5k + 2k - 5k)(k*2 - 3k2 - k2) in the form qk + tk*2 + sk*3 + o and give s. -12 Rearrange 3 + 1 - 30z - 4 to iz + j and give i. -30 Express (11u + 13u - 7u)(-u + u - 2u) + 8 - 8 - 5u2 as j + ou + ru2 and give r. -39 Rearrange 32j*3 - 14j*3 - 17j3 - j4 + 3j2 + 3j*2 to oj*3 + b + sj*4 + nj + vj2 and give o. 1 Express 2k*2 - 5k*2 - 3k*2 in the form sk + zk2 + q and give z. -6 Express -1 - 8x*3 + 4x + 0x - 3x + 3x3 in the form bx*3 + rx + s + cx2 and give s. -1 Rearrange -3a + a + 4a + 2a + 2 - 2 + (-2 - a + 2)(-3 + 0 + 2) + 4a - 1 + 1 + 1 - 2a - 1 to the form ya + w and give w. 0 Rearrange 4k + 0k - 2k + 6k - 2k - 2k + (1 - 5 + 3)(5k + k - 4k) + 0k + 0k + k + 3k + 3k + k + (2 - 3 - 1)(3k + k - 2k) to lk + b and give l. 6 Express (2l + 0 + 0)(-l + 1 - 1 + 3 - 3 - 2l + (-l + l + l)(-1 + 2 + 0)) in the form p + nl*2 + al and give n. -4 Express -z2 + z2 + z*3 + (-z - 2z*2 + z)(z + 3z - 3z) - z*3 - 3z*3 + 3z*3 as p + yz*3 + dz*2 + mz and give y. -2 Express -2g4 + 42g*2 - 84g*2 + 41g*2 - 13g in the form kg2 + pg*4 + ug*3 + xg + f and give x. -13 Rearrange -1 - 5i2 + i + 3 + 3i*2 - 3i*2 to hi*2 + z + ki and give z. 2 Express 2j2 + 48j*4 - 8j*3 - 49j*4 - 1 + j + 1 as yj*4 + cj*3 + ij*2 + r + bj and give i. 2 Rearrange 5v2 - 158 + 158 to the form pv*2 + tv + h and give p. 5 Express 3u - 2u + 3u as a + bu and give b. 4 Express (21 + 2 + 9)((2d - d - 3d)(6 - 3 + 1) + 0d + 4d - 3d) in the form vd + t and give v. -224 Express (-2 + 4 - 3)(2t - 4t + t) + (3 - 2 - 3)(-t + 0t + 0t) - 2t + 3t - 2t - 5t - 4t + 3t as c + nt and give n. -4 Rearrange (12t - 5 - 3 + 7)(4t*3 - 14t*3 + 0t*3) to gt + nt4 + q + bt*2 + ot*3 and give o. 10 Rearrange (-3 + t + 3)(0 + 0 - t3) + (t3 + 4t - 4t)(-19t - 98 + 98) to the form jt3 + ut*2 + zt + yt4 + q and give y. -20 Rearrange 34 - 13 - 21 - 8r - 5r2 to gr + jr2 + p and give j. -5 Rearrange -31r - 92 - 30r + 96r - 33r to j + yr and give y. 2 Rearrange (-2 - 3 + 0)(0u - 5u + 3u) + 2u + 8 - 2 - 1 to the form xu + w and give x. 12 Rearrange -2 + 36f + 3 - 1 to xf + j and give x. 36 Rearrange (3 - 2 - 2)(4z - 3z - 3z) + (0z + z + 0z)(2 - 3 + 0) + (4z - z - 2z)(4 + 21 - 7) to d + wz and give d. 0 Express (141c*2 + 463c*2 + 191c*2 - 165c*2)(3 - 3 + 2c) as kc*3 + b + dc*2 + mc and give k. 1260 Rearrange 22j2 - 7j*2 - 9j*2 to the form g + uj*2 + oj and give u. 6 Express 7s - 1 + 9s - 4s4 - 17s - 1 as bs3 + fs*4 + ms + zs2 + a and give a. -2 Rearrange 9j + 25j - 16j + 32j to the form b + cj and give c. 50 Rearrange (0y + 0y + y)(y + 24y - y + 5) to the form p + uy2 + ly and give l. 5 Express (y - 4y + 4y)(-1767 + 115y + 1767) in the form sy2 + t + hy and give s. 115 Express (q*4 - 4 + 4)(3 - 1 + 0) + 3q - 3q + 2q4 + (-2 + 1 - 2)(-4q2 + 3q*4 + 4q*2) in the form rq*3 + l + uq*4 + wq + iq2 and give u. -5 Express 4375v - v*2 - 2 - 4375v as iv + sv*2 + u and give u. -2 Rearrange (-3t + 0t + t)((0 + 2 + 0)(0 - 5 + 4) + 3 + 0 - 2 - 16 + 24 + 27) to dt + w and give w. 0 Rearrange 17 - 5 - 7 + 7h2 - h3 - 3 to the form sh*3 + ah*2 + j + oh and give j. 2 Rearrange 11m + 10 - 2m - 4m to pm + f and give f. 10 Rearrange (-7k - 6k + 4k)((5k + k - 4k)(-3k*2 + 5k2 - k2) + 2k3 + 1 - 1) to the form d + fk*2 + nk + pk4 + hk*3 and give p. -36 Express -93o*2 - 81o*2 + 202o*2 - 2 + 3o in the form zo2 + j + uo and give j. -2 Rearrange (67w + 50w - 38w)(-5 + 5 - w) to the form yw + g + qw*2 and give q. -79 Express 26 + x - 3x + 4x - 3x as q + ux and give q. 26 Express 2u*4 - u + 6u + 2u2 - u + u3 in the form iu*4 + du + vu2 + m + zu*3 and give v. 2 Rearrange (-4h*3 + 4h3 + h3)(3h - h - h)(-1 - 3 + 3 + (-15 + 11 + 10)(0 + 0 + 4)) to r + vh2 + sh + kh4 + oh*3 and give k. 23 Rearrange (-4t3 - t3 + 2t3)(-4t - t + 3t) + 3t2 + 3 - t4 + 3t*4 - 5 to the form nt + yt3 + ft*2 + qt*4 + w and give q. 8 Rearrange 0 - 1 - 3i - 3i4 + i to the form s + wi*4 + ji*2 + ni*3 + qi and give w. -3 Rearrange (-d - 3d + 3d)(3d - 2d3 - 3d) + 2d4 - 4 - 2d3 + 4 + d2 to the form od + ad*3 + xd*2 + f + jd*4 and give x. 1 Rearrange (-6m - m + 2m - 2m + 0m + 0m + (-3m - m + 5m)(-1 + 0 + 4) + 2m + 0 + 0)(3 - 4 - 1) to gm + v and give g. 4 Express 3b2 - 2b*3 + 2b - 2b2 + 5 + b2 in the form fb*3 + ib + m + db2 and give m. 5 Express 0 + 2 + 2s*4 + 3s3 - s3 + 0 as gs2 + vs*3 + ns + rs4 + t and give v. 2 Rearrange 0 + 0 + 2z*4 + (3z*2 - 4z2 - z2)(22z*2 + 62z*2 - 138z*2) to jz*4 + dz*2 + l + bz + xz3 and give d. 0 Rearrange (-2x - 6x + 4x)(2x + x - 2x) + (-3x + 4x + 0x)(-3x + 3x - 3x) to fx2 + ux + w and give f. -7 Rearrange 11v - 11v + 39v2 + (2v - 1 + 1)(v - v + v) - 4 + 4 - v2 to fv*2 + mv + u and give f. 40 Express 2d - 1 + 1 + (-d + d - d)(-1 + 2 - 2) - 1 - 2d + 1 + (d + 0d + d)(-1 + 5 - 1) + d + 2d - 6d as m + nd and give n. 4 Express d*2 - d + 0d*3 + 3d3 - d3 - 3 - d*3 in the form t + pd + od2 + jd*3 and give p. -1 Rearrange (1 + 2 + 0)(2 - 2 - s*3) + (-2 + 6 - 2)(6 - 14s3 - 6) to the form x + bs*3 + vs + ws2 and give b. -31 Rearrange (-h + 62h + 36h)(0h3 + 6h*3 - 4h*3) - 2h*4 - 4h*4 + 5h*4 to ah*2 + lh*4 + oh*3 + rh + j and give l. 193 Rearrange (3 + 3 - 5 + (-3 - 3 + 2)(0 + 3 + 0))(0a - a - 2a) to the form da + z and give d. 33 Rearrange 0x - 3x + 12x + (-x + 4x - 2x)(-1 - 1 + 4) to o + fx and give f. 11 Express -3j2 - 11j*2 + 4j*2 - 5j*2 as cj + b + vj2 and give v. -15 Express -w4 + 12w*4 + 4w*4 + (2w + 5w - 3w)(2w2 + w3 - 2w2) as dw*3 + yw*4 + r + aw + xw2 and give y. 19 Express -x4 - 43x2 + 2 + x3 - 3 + 45x2 as cx + vx2 + ox*4 + l + dx*3 and give d. 1 Rearrange -4a*2 + 7a + 3a2 - 4a + a*3 + 2a*3 to the form pa*2 + qa*3 + z + ua and give p. -1 Rearrange -2b3 - 19b2 + b2 + 3b2 - 19b*2 to the form x + mb*2 + fb + zb3 and give m. -34 Express (2l + 3 - 3 - 5l + 2l + 5l - 2l + l + 0l + (1 - 2 + 3)(l - 4l + l) - 6l - 25 + 25)(-2 - 3l + 2) in the form tl2 + fl + k and give t. 21 Rearrange c - 14 - 4c4 + 19 - c3 + 4c*2 - 6 to the form lc + sc2 + k + dc*3 + fc*4 and give s. 4 Rearrange -4y*2 - 35y*2 + 14y*2 - 23y*2 to uy + vy2 + p and give v. -48 Express 11t + 1 - 1 as y + ht and give h. 11 Rearrange 11j4 - j4 + 5 - 8j4 - j2 - 3j*4 to qj + bj4 + xj*3 + g + wj*2 and give b. -1 Rearrange -2v4 + v4 + v*4 - 14v*3 + 2v*2 - 2v - v*4 to pv*4 + gv*3 + nv*2 + y + hv and give g. -14 Rearrange 5l - 2l + 5l + 4l to x + yl and give y. 12 Rearrange 18g - 10 + 25g + 10 to yg + i and give y. 43 Rearrange -4 + 2s + 3s*2 - 2s*2 - 2 - 3 to the form cs*2 + ws + p and give c. 1 Rearrange c3 + 81 - 81 + c2 + 2c*4 to th	{ "pile_set_name": "DM Mathematics" }
6975912 In base 12, what is 4 - 10129910? -10129908 In base 15, what is 1 - 214079a? -2140799 In base 7, what is 1352433435 - -5? 1352433443 In base 15, what is -c + -e059e? -e05ab In base 16, what is 1 - -22065? 22066 In base 2, what is 10111100011 + -100111100111001? -100100101010110 In base 11, what is -6a61327 + 3? -6a61324 In base 13, what is -a4 - -b716? b642 In base 12, what is 639 - -1b7ab? 20228 In base 16, what is -1eb2a + -3b? -1eb65 In base 2, what is -11110111000110 + 110100101100? -11000010011010 In base 13, what is 87aa - -53a? 9017 In base 11, what is 1997 - 507a9? -49912 In base 10, what is -180620 - 371? -180991 In base 8, what is 1724461 - 1016? 1723443 In base 5, what is 4434142 - 20431? 4413211 In base 16, what is -4d6 - 76ea? -7bc0 In base 2, what is 1101111 + 1110110000011010? 1110110010001001 In base 5, what is 103142424104 + 3? 103142424112 In base 3, what is 1112020020101 + 0? 1112020020101 In base 10, what is 2528839 + -97? 2528742 In base 5, what is -2304104333 + -3? -2304104341 In base 7, what is -12026 - 25653? -41012 In base 7, what is -44555 + -10103? -54661 In base 13, what is a1b42 + -84? a1a8b In base 4, what is -113 - 12110222031? -12110222210 In base 12, what is -805 - -6518b? 64586 In base 3, what is -21110222021022 - 0? -21110222021022 In base 9, what is 368850567 + -2? 368850565 In base 2, what is -110010110011110110000001000 + -1000? -110010110011110110000010000 In base 10, what is -5587610 - -20? -5587590 In base 3, what is 2 + 20002220002122100? 20002220002122102 In base 6, what is -124310315 - -14? -124310301 In base 6, what is -2 - 3253312225? -3253312231 In base 6, what is 54221213 - 11? 54221202 In base 13, what is 82 - -3391a? 3399c In base 6, what is 545 + 30101251? 30102240 In base 12, what is -24a716 - -76? -24a660 In base 7, what is 16242355 + -3? 16242352 In base 15, what is -3488 - -2bae? -7c9 In base 9, what is 1743270 + 48? 1743328 In base 5, what is -4440320133 - -24? -4440320104 In base 5, what is -10301113 - -403? -10300210 In base 16, what is -148cf3f + 3? -148cf3c In base 8, what is -15563 + 41137? 23354 In base 11, what is -138306 + -65? -138370 In base 4, what is -13 + -10031122030110? -10031122030123 In base 7, what is -5 + -43563231? -43563236 In base 7, what is -44121 + -150? -44301 In base 10, what is -1574990 - -2? -1574988 In base 11, what is 145 - 41290? -41146 In base 14, what is -109b3 - -7? -109aa In base 9, what is -4 + 50022131? 50022126 In base 13, what is 1513154 + 10? 1513164 In base 5, what is 133320 + 13244? 202114 In base 15, what is -3 - 10485b? -10485e In base 7, what is -1123516 + 2041? -1121445 In base 9, what is 5 - 11652654? -11652648 In base 16, what is 6268a - -3? 6268d In base 14, what is 82 - -c9b58a? c9b62c In base 11, what is -8a695674 + -5? -8a695679 In base 13, what is 3337c5 - -3a? 333832 In base 8, what is -66 - 4461505? -4461573 In base 13, what is -1 - 1a78cab? -1a78cac In base 10, what is 3618395 + -4? 3618391 In base 10, what is -538807 + -8? -538815 In base 7, what is 2635 - 153545? -150610 In base 4, what is 10320110 + 101313022? 112233132 In base 13, what is -151 - -3878? 3727 In base 12, what is 2133b3 - 31? 213382 In base 16, what is 52 + 2f598? 2f5ea In base 14, what is -2c2 + -128d7? -12bb9 In base 16, what is ca0 - -102b5? 10f55 In base 3, what is 2020020212212110 - 101? 2020020212212002 In base 6, what is 102450 - 4345? 54101 In base 16, what is -44 + f61ad? f6169 In base 2, what is -1011 + 1110100101111011000010? 1110100101111010110111 In base 15, what is a - -7db54c? 7db557 In base 14, what is -867754 - -1? -867753 In base 4, what is 13232 - -12120012? 12133310 In base 14, what is 3407b + -4cc? 3398d In base 3, what is 122 - -102020112002? 102020112201 In base 12, what is 1a3 - 1211? -102a In base 12, what is 16ab321 - -9? 16ab32a In base 3, what is -1111221121212112 + 1200? -1111221121210212 In base 15, what is 1a61bcb0 - -4? 1a61bcb4 In base 8, what is 257522 - -477? 260221 In base 15, what is -4 + -1db2d5c8? -1db2d5cc In base 4, what is -101 - 112203221203? -112203221310 In base 7, what is -20 - 1001465? -1001515 In base 16, what is 2 + 4b10f8? 4b10fa In base 8, what is 10 + -16543? -16533 In base 6, what is 4241445010 - 4? 4241445002 In base 16, what is -145 + -259? -39e In base 4, what is 21123100102 + 11302? 21123112010 In base 10, what is -14 + 217467? 217453 In base 4, what is 13011330 + -31332? 12313332 In base 11, what is -132 + -3a514? -3a646 In base 10, what is 1513 - -575? 2088 In base 15, what is -c + 2339b7? 2339aa In base 9, what is -76618 - 10830? -87548 In base 16, what is -6e328 - 1? -6e329 In base 16, what is -153 - 7e76c? -7e8bf In base 8, what is -762 - 1776512? -1777474 In base 8, what is -1263100 + 4? -1263074 In base 11, what is 787 + 2173? 294a In base 6, what is 11 + 111123552? 111124003 In base 3, what is 1021 - -10211001222222? 10211002001020 In base 7, what is 12051123 + -3? 12051120 In base 8, what is -4 - 37763224? -37763230 In base 15, what is -9d2228 - -b? -9d221c In base 2, what is 11011 + -10010110011111101101000? -10010110011111101001101 In base 3, what is 20 - 1221222201110120? -1221222201110100 In base 3, what is 1020211010100200 - 0? 1020211010100200 In base 7, what is 1 - 13354666? -13354665 In base 6, what is -550500341 + 110? -550500231 In base 12, what is 666 + -112a? -684 In base 15, what is 12 + -3d7e? -3d6c In base 4, what is 1 - 10120321210010? -10120321210003 In base 9, what is -23 + -46015564? -46015587 In base 15, what is -10e57 - -2cd8? -d16e In base 16, what is 78e + 1e72? 2600 In base 6, what is 4351 - -22450401? 22455152 In base 3, what is -1 - -11120012121111? 11120012121110 In base 2, what is -1010100101001 - 1001110110? -1011110011111 In base 13, what is -57c3 + -242? -5a35 In base 3, what is -11 + 10001201111011? 10001201111000 In base 8, what is 235612 - -11172? 247004 In base 14, what is 16 + -2bb6c6? -2bb6b0 In base 4, what is -1221332201 + -1232? -1222000033 In base 4, what is 10 - -1100112220? 1100112230 In base 10, what is -70200 - -393? -69807 In base 7, what is 360321 + -640? 356351 In base 7, what is 5 - -3512520206? 3512520214 In base 6, what is -13250 - -21041? 3351 In base 15, what is 83369ca + -5? 83369c5 In base 13, what is 7957773 - 0? 7957773 In base 10, what is -82476081 + -2? -82476083 In base 13, what is -486b - -a71? -3aca In base 7, what is 1 + 1134146151? 1134146152 In base 8, what is -5 - -330601572? 330601565 In base 13, what is 1caa - bca1? -9cc4 In base 2, what is 110000100110100010001110 - 1? 110000100110100010001101 In base 8, what is 3765015 - 271? 3764524 In base 15, what is 191 - -433b4? 43555 In base 10, what is -2742 - 1672? -4414 In base 4, what is 3 + 1020313313? 1020313322 In base 5, what is 1014422224232 - 0? 1014422224232 In base 12, what is -724b354 + 0? -724b354 In base 8, what is 362670 + -51? 362617 In base 13, what is -a1157 + -19a? -a1324 In base 16, what is 22f533ce + -1? 22f533cd In base 12, what is 124 - 4518? -43b4 In base 6, what is -513 + 31424401? 31423444 In base 12, what is -32915 + 1909? -31008 In base 10, what is 141282 - 3? 141279 In base 16, what is -88b4 + 4c? -8868 In base 9, what is 15832612 - -16? 15832628 In base 6, what is 21 + -555202043? -555202022 In base 16, what is 6a50 + -2ee? 6762 In base 14, what is -2c + -598a? -59b8 In base 8, what is 362033655 + -6? 362033647 In base 13, what is 1813 - 7a76? -6263 In base 7, what is 515026 + 2320? 520346 In base 13, what is -1 + -9b14b59? -9b14b5a In base 3, what is -12112001 + 2101211? -10010020 In base 4, what is -10123020 - 111222? -10300302 In base 13, what is -7752c - -b07? -76725 In base 9, what is -1 - 38251? -38252 In base 10, what is 4 - -191878? 191882 In base 7, what is 412621521 - 4? 412621514 In base 7, what is -1034226562 - -5? -1034226554 In base 7, what is 1 + 31104633? 31104634 In base 2, what is -101011001010000001111 - 111101? -101011001010001001100 In base 14, what is a8823 + -c? a8815 In base 6, what is 222 + -24201125? -24200503 In base 3, what is -12122022 - 21201102? -111100201 In base 13, what is 105625a + a? 1056267 In base 6, what is -2141455 + 15423? -2122032 In base 6, what is -3 + -51515013155? -51515013202 In base 3, what is 101010022	{ "pile_set_name": "DM Mathematics" }
= b*2 - 1650b + 651075. Calculate i(653). 34 Let h(i) = -43i3 + 3i*2 - 6i - 2. Give h(3). -1154 Let p(h) = -41h3 + 736h*2 + 37h - 15. What is p(18)? 3 Let v(g) = 635g2 + 49g. Calculate v(1). 684 Let x(t) = 47t + 3967. Determine x(-74). 489 Let i(b) = 3981b - 8261. Give i(2). -299 Let w(l) = l*3 - 55l*2 + 184l + 1053. Give w(51). 33 Let f(l) = l*3 + 90l*2 + 1850l + 1236. Give f(-59). -3 Let y(r) = -16r2 - 630r - 4278. What is y(-16)? 1706 Let b(z) = 6630z + 86362. Determine b(-13). 172 Let m(g) = 256g*3 + 7g*2 - 71g + 73. Determine m(1). 265 Let u(c) = c*3 + 792c*2 + 152725c + 2264. Calculate u(-460). -36 Let h(x) = -216x - 1450. Determine h(-9). 494 Let u(n) = 172n*2 + 7790n - 13814. Determine u(-47). 4 Let q(x) = -1903x - 62717. What is q(-33)? 82 Let q(b) = 2203b - 79285. Determine q(36). 23 Let f(r) = r*2 + 29726r - 237939. Calculate f(8). -67 Let h(f) = -6897f - 6393543. Determine h(-927). -24 Let d(p) = p3 - 9p*2 + 52505p - 948037. Calculate d(18). -31 Let s(w) = 876w - 14019. Calculate s(16). -3 Let m(v) = -2v*3 + 38v*2 + 146v - 2985. Calculate m(16). 887 Let s(d) = -1901d + 112217. Give s(59). 58 Let p(o) = o2 + 685o - 6244. Determine p(9). 2 Let m(c) = c*2 - 4c - 83508. Calculate m(291). 9 Let a(k) = 31k2 + 1876k - 4986. What is a(-63)? -135 Let m(l) = 281764l - 845470. What is m(3)? -178 Let k(b) = 62b - 675. Calculate k(6). -303 Let f(i) = 510i + 4749. Determine f(-6). 1689 Let p(j) = -3j*3 + 113j*2 - 639j + 12551. Determine p(35). -14 Let h(c) = 75c3 + 65c*2 - 18c - 13. Determine h(-1). -5 Let v(q) = 6q2 - 149q + 844. Calculate v(5). 249 Let m(s) = -2s3 - 4s*2 + 58s - 16. Calculate m(7). -492 Let x(y) = -45y3 + 3y*2 - 2y + 19. Calculate x(3). -1175 Let l(k) = -2458k - 10070. What is l(-4)? -238 Let r(w) = 430w*2 - 5209w + 637. Give r(12). 49 Let h(j) = -1282j - 8937. Calculate h(-7). 37 Let v(p) = -26834p + 268336. Calculate v(10). -4 Let j(i) = i*3 + 6i*2 - 134i - 796. Give j(-6). 8 Let x(q) = 1212q2 - 41198q - 346. What is x(34)? -6 Let p(l) = -761l - 86657. Calculate p(-113). -664 Let a(i) = i2 + 918i + 7091. Determine a(-8). -189 Let j(w) = -w*3 + 8w*2 - 2w + 120. What is j(0)? 120 Let r(c) = -c*3 - 30c*2 - 237c - 288. What is r(-11)? 20 Let g(i) = 52469i + 891973. Calculate g(-17). 0 Let a(p) = 1851p*2 - 127718p - 112. Determine a(69). -43 Let b(y) = 284y - 9065. Determine b(31). -261 Let f(h) = -8h*2 - 182h + 447. Calculate f(-25). -3 Let f(g) = -g*3 + 228g*2 + 60998g - 3875. Determine f(386). -15 Let c(g) = -41957g + 545466. Calculate c(13). 25 Let o(v) = -v2 - 19v - 59. What is o(-12)? 25 Let r(j) = 6j2 - 10184j - 81867. Determine r(-8). -11 Let d(i) = -3i3 - 1212i*2 - 1215i - 57. Determine d(-403). 2361 Let o(z) = 2z2 - 45z - 452. What is o(-6)? -110 Let f(q) = -q*3 - 32q*2 + 184q + 4827. Give f(-31). -1838 Let d(r) = r*3 + 36r*2 - 1119r - 38333. Determine d(-40). 27 Let g(t) = t*3 - 214t*2 - 83522t + 17873703. Determine g(214). -5 Let c(z) = -543533z - 1087070. Calculate c(-2). -4 Let q(b) = 9b*3 + 16b*2 - 75b - 36. Give q(5). 1114 Let i(d) = -d*3 - 13d*2 + 484d - 643. Determine i(-30). 137 Let p(i) = 558i2 + 69i + 69. What is p(-1)? 558 Let u(j) = -j*3 - 60j*2 - 735j - 168. Give u(-43). 4 Let r(z) = -z*3 - 118z*2 + 51z + 6026. Give r(-118). 8 Let h(k) = -10199k + 40813. Determine h(4). 17 Let g(c) = -c3 - 10c*2 - 1266c - 7645. What is g(-6)? -193 Let z(d) = d*3 - 196d*2 - 2487d - 1713. Calculate z(208). 159 Let g(c) = -143c + 5375. Give g(38). -59 Let n(q) = -6q*2 + 91094q + 546785. What is n(-6)? 5 Let m(l) = 46l2 - 900l + 4436. What is m(10)? 36 Let y(n) = 2n3 + 10n*2 - 888n - 8085. Give y(-9). -741 Let b(n) = -799540n - 3198171. What is b(-4)? -11 Let m(o) = o3 + 2264o*2 - 15740o + 356538. Calculate m(-2271). -9 Let m(v) = -5v2 + 1486v - 77285. Determine m(230). -5 Let q(b) = 2189b - 26315. Give q(12). -47 Let f(y) = -y3 - 28y*2 + 2014y + 55063. Calculate f(-27). -44 Let y(b) = 202b2 + 1981b - 7905. Calculate y(4). 3251 Let u(n) = 2840n - 17043. Determine u(6). -3 Let h(r) = r3 + 93r*2 + 381r - 244. Determine h(-5). 51 Let v(q) = -268q - 40361. Calculate v(-151). 107 Let z(j) = -5j*2 + 2043j + 8032. Give z(-4). -220 Let w(h) = 27h + 4342. Determine w(-190). -788 Let u(v) = 29v*2 + 4249v + 108624. Calculate u(-33). -12 Let o(l) = 144l2 + 56036l + 7780. Give o(-389). 0 Let l(c) = -8c3 + 16c*2 - 26c - 97. Calculate l(-5). 1433 Let b(g) = 7g3 + 53g*2 + 284g + 1337. Calculate b(-6). 29 Let m(d) = d*2 + 8314d + 24937. Determine m(-3). 4 Let r(u) = -3u2 + 1927u - 11574. Calculate r(6). -120 Let n(z) = -54z - 499. What is n(-30)? 1121 Let n(q) = 14q*2 + 193q + 125. Determine n(-18). 1187 Let l(a) = -7792a + 841497. Calculate l(108). -39 Let a(f) = -13f*3 + 12f*2 - 29f + 12. Give a(4). -744 Let g(y) = 3y2 + 24y - 490. Determine g(10). 50 Let p(f) = 1516f - 210730. Calculate p(139). -6 Let a(q) = 2614q - 5213. Determine a(2). 15 Let r(x) = -x*2 + 34x + 1825. What is r(-30)? -95 Let p(d) = d*3 - 107d*2 - 816d + 2052. What is p(114)? 0 Let w(n) = -26n3 + 2704n*2 - 11n + 1142. What is w(104)? -2 Let x(q) = -2q3 - 134q*2 + 9q + 541. Calculate x(-67). -62 Let i(n) = -1242n + 619719. Determine i(499). -39 Let m(h) = -44h + 6237. Determine m(141). 33 Let f(o) = 4809o - 57404. What is f(12)? 304 Let b(g) = 2g*2 - 151g - 73374. Determine b(233). 21 Let l(s) = s*3 - 209s*2 - 671s + 7744. What is l(212)? 324 Let x(c) = -c*3 + 18c*2 + 137c - 201. Give x(-7). 65 Let y(f) = -144f + 46215. Determine y(320). 135 Let g(r) = 19r*3 + 611r*2 + 3062r + 31. What is g(-5)? -2379 Let f(m) = -m*2 + 539m - 8386. What is f(16)? -18 Let h(v) = 5v2 - 85v + 261. Determine h(17). 261 Let n(r) = 25r2 + 324r + 1604. Determine n(-5). 609 Let g(p) = p*2 - 324p + 26320. What is g(162)? 76 Let h(m) = -6886m + 702392. What is h(102)? 20 Let t(o) = -3975o + 7839. Determine t(2). -111 Let f(i) = -5299i2 - 137856i - 2137. Calculate f(-26). -5 Let h(n) = -517n + 5499. Calculate h(12). -705 Let g(w) = 54124w + 920118. Give g(-17). 10 Let s(o) = 127o2 + 6035o + 8879. Give s(-46). 1 Let d(c) = 5c3 - 11c*2 - 228c + 781. Give d(5). -9 Let n(c) = c*2 - 69240c - 623254. Calculate n(-9). -13 Let t(l) = l*3 - 97l*2 - 2486l + 192389. Give t(103). -15 Let x(u) = -431u2 + 9492u - 163. Calculate x(22). 57 Let t(q) = -3q2 - 128q + 54790. Give t(-158). 122 Let f(x) = 44x3 - 45x*2 - 8x - 4. What is f(4)? 2060 Let q(s) = -3325s - 246053. Give q(-74). -3 Let c(s) = -2s*3 - 19s*2 - 227s - 4139. Give c(-13). -5 Let y(h) = h*3 + 39h*2 + 141h + 87. Determine y(-35). 52 Let m(g) = g*2 - 252g + 6391. What is m(29)? -76 Let b(t) = 110t3 - 183t*2 + 181t + 2. What is b(1)? 110 Let z(m) = 2510m + 868466. Give z(-346). 6 Let v(n) = -236n + 2151. What is v(4)? 1207 Let k(p) = p*3 - 45p*2 - 432p - 221. Calculate k(53). -645 Let k(b) = 563b3 - 60b2 + b + 1. Give k(2). 4267 Let i(f) = f3 + 102f2 + 2313f - 9. Determine i(-34). -43 Let l(f) = 213f + 2299. Determine l(-12). -257 Let n(r) = -98r*3 + 249r*2 - 6r - 3. Calculate n(-1). 350 Let m(c) = c*2 - 210c + 5210. Calculate m(43). -1971 Let t(b) = 39b2 - 928b - 34. What is t(24)? 158 Let l(c) = 602c - 5740. Calculate l(10). 280 Let t(q) = q3 - 82q*2 + 556q + 153. Give t(8). -135 Let o(d) = 2d3 + 37d*2 - 696d + 93. What is o(-30)? 273 Let z(q) = -q*3 - 150q*2 + 317q + 1975. What is z(-152)? -1 Let l(r) = 3r3 - 62r*2 + 191r - 23. Give l(17). 45 Let o(j) = 13j2 + 794j + 701. Give o(-61). 640 Let j(q) = -60q3 - 30q*2 + 46q + 50. Determine j(2). -458 Let a(j) = -4j3 + 5j*2 + 2026j + 4044. Calculate a(-2). 44 Let j(b) = -b*2 + 3905b - 39050. Determine j(10). -100 Let d(g) = 28g2 + 166g + 577. What is d(-5)? 447 Let i(r) = -2r2 + 1587r - 204. Determine i(0). -204 Let k(x) = -316x - 10026. What is k(-31)? -230 Let j(n) = -n2 + 12n + 66. Determine j(-18). -474 Let s(g) = 15g3 + 530g**2	{ "pile_set_name": "DM Mathematics" }
is the r'th term of 9, 18, 19, 12? -4r2 + 21r - 8 What is the p'th term of 1, -21, -63, -131, -231, -369, -551, -783? -p*3 - 4p*2 - 3p + 9 What is the v'th term of -108, -183, -270, -375, -504? -v*3 - 68v - 39 What is the b'th term of 1281, 2563, 3847, 5133, 6421, 7711, 9003? b*2 + 1279b + 1 What is the h'th term of 553, 554, 555, 556? h + 552 What is the p'th term of -36, -79, -164, -303, -508, -791, -1164? -2p3 - 9p*2 - 2p - 23 What is the n'th term of -325, -276, -225, -172, -117, -60, -1? n*2 + 46n - 372 What is the n'th term of -173, -397, -771, -1295, -1969, -2793, -3767? -75n2 + n - 99 What is the a'th term of -2975, -5954, -8933, -11912, -14891, -17870? -2979a + 4 What is the g'th term of 598, 1197, 1796? 599g - 1 What is the z'th term of 1239, 4950, 11135, 19794, 30927, 44534? 1237z2 + 2 What is the f'th term of 2194, 2195, 2196, 2197? f + 2193 What is the k'th term of 661, 655, 639, 607, 553, 471? -k3 + k*2 - 2k + 663 What is the d'th term of 202, 206, 212, 220, 230, 242? d*2 + d + 200 What is the z'th term of 6, -18, -42, -66? -24z + 30 What is the p'th term of -24, -20, -12, 0, 16, 36? 2p2 - 2p - 24 What is the h'th term of 68, 119, 154, 173? -8h2 + 75h + 1 What is the k'th term of -19, -17, -15, -13? 2k - 21 What is the w'th term of 76, 152, 228, 304, 380, 456? 76w What is the w'th term of 417, 422, 427? 5w + 412 What is the o'th term of 12, -34, -110, -216, -352? -15o*2 - o + 28 What is the t'th term of 61, 80, 99, 118? 19t + 42 What is the l'th term of -9, -30, -61, -108, -177, -274, -405, -576? -l3 + l2 - 17l + 8 What is the c'th term of -184, -185, -186, -187, -188? -c - 183 What is the z'th term of -439, -877, -1315, -1753? -438z - 1 What is the v'th term of -41, -52, -71, -104, -157, -236, -347, -496? -v*3 + 2v*2 - 10v - 32 What is the t'th term of 26, 62, 116, 194, 302? t*3 + 3t*2 + 20t + 2 What is the f'th term of 156, 301, 446? 145f + 11 What is the v'th term of 2525, 5051, 7577? 2526v - 1 What is the l'th term of -16, -61, -108, -157, -208, -261, -316? -l*2 - 42l + 27 What is the s'th term of -160, -655, -1488, -2665, -4192, -6075? -s*3 - 163s*2 + s + 3 What is the h'th term of 1372, 1370, 1368, 1366, 1364? -2h + 1374 What is the y'th term of 2996, 2995, 2994? -y + 2997 What is the w'th term of -428, -448, -482, -530, -592, -668? -7w2 + w - 422 What is the a'th term of 8993, 17985, 26977, 35969? 8992a + 1 What is the y'th term of -32, -40, -48, -56, -64? -8y - 24 What is the g'th term of 89, 90, 91, 92, 93? g + 88 What is the x'th term of 217, 203, 171, 115, 29, -93? -x3 - 3x*2 + 2x + 219 What is the y'th term of -1572, -3144, -4716? -1572y What is the n'th term of -979, -995, -1037, -1117, -1247, -1439, -1705? -2n3 - n2 + n - 977 What is the j'th term of -88, -56, -2, 74, 172, 292, 434? 11j2 - j - 98 What is the w'th term of 261, 1022, 2297, 4092, 6413, 9266? w3 + 251w*2 + w + 8 What is the x'th term of 67, 93, 153, 259, 423, 657, 973? 2x*3 + 5x*2 - 3x + 63 What is the i'th term of 928, 916, 900, 880, 856, 828? -2i2 - 6i + 936 What is the i'th term of 57, 115, 173, 231, 289, 347? 58i - 1 What is the u'th term of 583, 1218, 1853, 2488, 3123, 3758? 635u - 52 What is the l'th term of 82, 334, 754, 1342? 84l2 - 2 What is the j'th term of 61, 87, 115, 145, 177, 211? j2 + 23j + 37 What is the x'th term of 29, 34, 39? 5x + 24 What is the t'th term of -70, -270, -604, -1072, -1674, -2410, -3280? -67t2 + t - 4 What is the u'th term of -92, -103, -128, -173, -244, -347, -488, -673? -u3 - u*2 - u - 89 What is the i'th term of 27, 111, 251, 447? 28i2 - 1 What is the s'th term of -25, -15, 9, 53, 123? s3 + s*2 - 27 What is the h'th term of 18, 35, 76, 153, 278, 463? 2h*3 + 3h + 13 What is the x'th term of 111, 506, 1163, 2082, 3263, 4706, 6411? 131x2 + 2x - 22 What is the q'th term of -298, -299, -300, -301, -302? -q - 297 What is the r'th term of -122, -129, -142, -161, -186, -217? -3r2 + 2r - 121 What is the u'th term of -546, -539, -530, -519, -506, -491, -474? u*2 + 4u - 551 What is the g'th term of 531, 530, 529, 528, 527? -g + 532 What is the x'th term of 19, -1, -55, -161, -337, -601, -971, -1465? -3x3 + x2 - 2x + 23 What is the f'th term of -283, -276, -267, -256, -243, -228? f*2 + 4f - 288 What is the o'th term of -5, -22, -57, -116, -205, -330, -497, -712? -o*3 - 3o*2 - o What is the u'th term of 35, 64, 93, 122? 29u + 6 What is the o'th term of -124, -238, -350, -460, -568? o*2 - 117o - 8 What is the q'th term of -5000, -4992, -4982, -4970, -4956? q*2 + 5q - 5006 What is the z'th term of -18, -17, -14, -9? z*2 - 2z - 17 What is the c'th term of -19, -52, -85, -118? -33c + 14 What is the w'th term of 8453, 8450, 8437, 8408, 8357? -w3 + w2 + w + 8452 What is the j'th term of 146, 138, 128, 116, 102? -j2 - 5j + 152 What is the s'th term of 3916, 3918, 3922, 3928, 3936, 3946, 3958? s2 - s + 3916 What is the u'th term of -6436, -6440, -6446, -6454, -6464, -6476? -u2 - u - 6434 What is the c'th term of -417, -415, -413? 2c - 419 What is the m'th term of 53, 51, 49, 47? -2m + 55 What is the y'th term of 109, 207, 305, 403, 501? 98y + 11 What is the w'th term of -8249, -16502, -24757, -33014, -41273? -w2 - 8250w + 2 What is the y'th term of 296, 1173, 2634, 4679, 7308, 10521? 292y2 + y + 3 What is the i'th term of 23, 43, 63, 83, 103, 123? 20i + 3 What is the w'th term of -18, -16, 12, 78, 194, 372? 2w3 + w2 - 15w - 6 What is the k'th term of 277, 280, 293, 322, 373? k3 - k2 - k + 278 What is the f'th term of 797, 793, 787, 779, 769? -f*2 - f + 799 What is the d'th term of 124, 137, 174, 247, 368, 549, 802? 2d*3 - d + 123 What is the o'th term of 404, 406, 408, 410? 2o + 402 What is the m'th term of -55, -122, -175, -208, -215, -190, -127, -20? m3 + m2 - 77m + 20 What is the l'th term of 2617, 2616, 2613, 2608, 2601? -l2 + 2l + 2616 What is the d'th term of 269, 548, 841, 1154, 1493, 1864? d3 + d2 + 269d - 2 What is the m'th term of -1666, -3325, -4982, -6637, -8290, -9941, -11590? m2 - 1662m - 5 What is the d'th term of -133, -145, -179, -247, -361, -533, -775, -1099? -2d3 + d2 - d - 131 What is the w'th term of 2, 15, 58, 149, 306, 547? 3w*3 - 3w2 + w + 1 What is the j'th term of 71, 62, 51, 38, 23, 6? -j2 - 6j + 78 What is the h'th term of 1, -6, -15, -26, -39, -54, -71? -h2 - 4h + 6 What is the q'th term of 8054, 16110, 24166, 32222, 40278, 48334? 8056q - 2 What is the w'th term of -27, -26, -35, -60, -107, -182, -291, -440? -w3 + w2 + 5w - 32 What is the k'th term of 59, 58, 57, 56, 55? -k + 60 What is the o'th term of 150, 143, 148, 177, 242, 355, 528, 773? 2o3 - 6o*2 - 3o + 157 What is the k'th term of -213, -427, -639, -849? k*2 - 217k + 3 What is the r'th term of -457, -459, -461? -2r - 455 What is the s'th term of -42170, -42168, -42164, -42158, -42150, -42140? s2 - s - 42170 What is the l'th term of 93, 369, 829, 1473? 92l2 + 1 What is the y'th term of -174, -175, -178, -183? -y2 + 2y - 175 What is the z'th term of 902, 1801, 2700, 3599, 4498, 5397? 899z + 3 What is the v'th term of -2246, -4492, -6724, -8936, -11122? v3 + v2 - 2256v + 8 What is the p'th term of 157, 327, 509, 703, 909? 6p*2 + 152p - 1 What is the s'th term of 313, 328, 357, 406, 481, 588, 733? s3 + s2 + 5s + 306 What is the l'th term of -8, -29, -64, -113, -176? -7l*2 - 1 What is the j'th term of 1, -10, -35, -74, -127, -194? -7j*2 + 10j - 2 What is the j'th term of 74, -9, -94, -181? -j*2 - 80j + 155 What is the q'th term of -9, 3, 15, 21, 15, -9, -57? -q*3 + 6q*2 + q - 15 What is the v'th term of -37, -86, -135, -184, -233? -49v + 12 What is the b'th term of -13, -50, -109, -190, -293, -418, -565? -11b2 - 4b + 2 What is the f'th term of -1, -11, -39, -91, -173? -f*3 - 3f*2 + 6f - 3 What is the i'th term of -2477, -2475, -2473, -2471, -2469? 2i - 2479 What is the y'th term of -17, -29, -41, -53, -65? -12y - 5 What is the i'th term of -251, -529, -807, -1085? -278i + 27 What is the f'th term of -76, -138, -190, -232, -264, -286, -298? 5f*2 - 77f - 4 What is the c'th	{ "pile_set_name": "DM Mathematics" }
8143 What is the s'th term of 185029, 185094, 185145, 185176, 185181, 185154, 185089, 184980? -s3 - s2 + 75s + 184956 What is the p'th term of -3644773, -3644769, -3644771, -3644779? -3p*2 + 13p - 3644783 What is the r'th term of -10812, -14106, -17402, -20700, -24000, -27302, -30606? -r*2 - 3291r - 7520 What is the m'th term of 144068, 144030, 144004, 143996, 144012, 144058, 144140, 144264? m*3 - 45m + 144112 What is the r'th term of 8319, 16337, 24369, 32415, 40475, 48549? 7r2 + 7997r + 315 What is the d'th term of 29410899, 117643576, 264698031, 470574258, 735272251, 1058792004, 1441133511? -d*3 + 29410895d*2 - d + 6 What is the m'th term of 5148, 10262, 15290, 20190, 24920, 29438, 33702, 37670? -7m3 - m2 + 5166m - 10 What is the d'th term of 9200, 32, -15248, -36640? -3056d2 + 12256 What is the u'th term of 4767, 9599, 14441, 19299, 24179, 29087? u3 - u*2 + 4828u - 61 What is the s'th term of -190418, -380836, -571254, -761672? -190418s What is the i'th term of 183930, 183928, 183924, 183918? -i2 + i + 183930 What is the k'th term of -3283, -5951, -13097, -26959, -49775, -83783? -373k3 - k2 - 54k - 2855 What is the h'th term of 2576988, 2576984, 2576980, 2576976, 2576972, 2576968? -4h + 2576992 What is the y'th term of 10749841, 10749842, 10749843, 10749844, 10749845? y + 10749840 What is the a'th term of 279335, 559343, 839351, 1119359? 280008a - 673 What is the i'th term of 401695917, 401695914, 401695911? -3i + 401695920 What is the d'th term of -48651468, -48651477, -48651494, -48651519, -48651552? -4d2 + 3d - 48651467 What is the b'th term of -485, -399, -263, -83, 135, 385, 661, 957? -b*3 + 31b2 - 515 What is the s'th term of -807710, -805082, -802452, -799820, -797186, -794550, -791912? s2 + 2625s - 810336 What is the s'th term of -1219802, -2439678, -3659554, -4879430, -6099306? -1219876s + 74 What is the y'th term of -14433, -57445, -129141, -229527, -358609? -y*3 - 14336y*2 + 3y - 99 What is the w'th term of -11351439, -22702880, -34054321, -45405762, -56757203? -11351441w + 2 What is the d'th term of -15189188, -30378372, -45567556? -15189184d - 4 What is the u'th term of -125512133, -125512129, -125512123, -125512115, -125512105? u*2 + u - 125512135 What is the n'th term of 6603184, 13206370, 19809556, 26412742? 6603186n - 2 What is the m'th term of 1150993, 4603897, 10358711, 18415441, 28774093, 41434673, 56397187? m*3 + 1150949m*2 + 50m - 7 What is the f'th term of -34638, -34245, -33852? 393f - 35031 What is the h'th term of 41707, 83227, 124747, 166267, 207787? 41520h + 187 What is the z'th term of -11248941, -22497882, -33746823, -44995764, -56244705, -67493646? -11248941z What is the o'th term of 65066, 64970, 64824, 64634, 64406, 64146, 63860, 63554? o3 - 31o*2 - 10o + 65106 What is the a'th term of -30716, -61337, -91950, -122555, -153152, -183741? 4a2 - 30633a - 87 What is the x'th term of 1628657, 3257318, 4885979, 6514640, 8143301, 9771962? 1628661x - 4 What is the l'th term of 843762, 843633, 843420, 843123, 842742, 842277? -42l*2 - 3l + 843807 What is the v'th term of -644, -1053, -1208, -983, -252? 21v3 + v2 - 559v - 107 What is the n'th term of -1942, -10474, -25602, -47326? -3298n2 + 1362n - 6 What is the h'th term of -833055, -833633, -834211, -834789, -835367? -578h - 832477 What is the o'th term of -8706, -17405, -26080, -34719, -43310, -51841, -60300? 2o*3 - 8713o + 5 What is the q'th term of 90203, 180491, 270777, 361061, 451343, 541623? -q*2 + 90291q - 87 What is the c'th term of 4930511, 4930476, 4930441, 4930406, 4930371, 4930336? -35c + 4930546 What is the f'th term of 47745, 47209, 46315, 45063? -179f*2 + f + 47923 What is the w'th term of 2916, 2505, 1840, 939, -180? 3w*3 - 145w*2 + 3w + 3055 What is the g'th term of 83763, 168184, 253261, 338994, 425383? 328g2 + 83437g - 2 What is the j'th term of -68556547, -137113094, -205669641, -274226188? -68556547j What is the z'th term of -6189426, -6189416, -6189392, -6189348, -6189278, -6189176, -6189036, -6188852? z3 + z2 - 6189428 What is the u'th term of -28053, -27851, -27649, -27447, -27245, -27043? 202u - 28255 What is the m'th term of -100393, -100309, -100225? 84m - 100477 What is the w'th term of 58647, 117465, 176441, 235575? 79w*2 + 58581w - 13 What is the s'th term of -14023399, -14023401, -14023405, -14023411, -14023419, -14023429? -s*2 + s - 14023399 What is the k'th term of -119415396, -119415397, -119415398, -119415399? -k - 119415395 What is the w'th term of -77064200, -154128399, -231192598, -308256797, -385320996? -77064199w - 1 What is the n'th term of -101420, -405679, -912776, -1622711, -2535484? -101419n2 - 2n + 1 What is the d'th term of 52304, 52230, 52134, 52010, 51852? -d*3 - 5d*2 - 52d + 52362 What is the q'th term of -22971212, -45942426, -68913638, -91884848? q*2 - 22971217q + 4 What is the z'th term of -8216, -65810, -222206, -526826, -1029092, -1778426? -8237z3 + 21z*2 + 2z - 2 What is the r'th term of -11989, -17200, -22409, -27616? r*2 - 5214r - 6776 What is the o'th term of -69498, -69469, -69442, -69417, -69394, -69373? -o*2 + 32o - 69529 What is the o'th term of 3500122, 3500223, 3500324? 101o + 3500021 What is the p'th term of 3545, 7983, 12429, 16883? 4p*2 + 4426p - 885 What is the c'th term of -357412, -357433, -357454, -357469, -357472, -357457, -357418, -357349? c*3 - 6c*2 - 10c - 357397 What is the v'th term of 20733, 155987, 523115, 1238055, 2416745, 4175123? 19323v3 - v2 - 4v + 1415 What is the a'th term of -271920, -271618, -271314, -271008? a*2 + 299a - 272220 What is the x'th term of 33205, 67265, 101325? 34060x - 855 What is the u'th term of 11, 115, 415, 983, 1891? 12u*3 + 26u*2 - 58u + 31 What is the y'th term of 409, 2381, 5881, 10909, 17465, 25549, 35161? 764y2 - 320y - 35 What is the v'th term of 1119077, 1118852, 1118625, 1118396, 1118165, 1117932? -v*2 - 222v + 1119300 What is the t'th term of -160288, -320723, -481158, -641593? -160435t + 147 What is the t'th term of 351656419, 703312838, 1054969257, 1406625676? 351656419t What is the t'th term of 6898, 6284, 5670, 5056, 4442, 3828? -614t + 7512 What is the a'th term of 136590417, 136590416, 136590415, 136590414? -a + 136590418 What is the k'th term of -2163, -4296, -6423, -8544, -10659, -12768, -14871? 3k*2 - 2142k - 24 What is the j'th term of -189307166, -378614328, -567921490, -757228652, -946535814? -189307162j - 4 What is the m'th term of -688759, -688674, -688533, -688336, -688083, -687774? 28m2 + m - 688788 What is the b'th term of 807430, 807395, 807332, 807235, 807098? -b3 - 8b2 - 4b + 807443 What is the d'th term of 2537954, 10151994, 22842060, 40608152, 63450270, 91368414, 124362584? 2538013d2 + d - 60 What is the n'th term of -487449, -487515, -487581? -66n - 487383 What is the s'th term of 11635, 6734, -6577, -32504, -75253? -701s3 + s2 + 3s + 12332 What is the z'th term of -27051979, -27051981, -27051985, -27051991, -27051999? -z*2 + z - 27051979 What is the d'th term of 108279920, 108279918, 108279916, 108279914, 108279912? -2d + 108279922 What is the k'th term of -3554, -28306, -95454, -226184, -441682? -3531k3 - 12k*2 + k - 12 What is the q'th term of 15149346, 30298691, 45448036, 60597381? 15149345q + 1 What is the j'th term of 46393233, 46393234, 46393235, 46393236? j + 46393232 What is the y'th term of 29492, 117911, 265292, 471647, 736988, 1061327? 2y3 + 29469y*2 - 2y + 23 What is the l'th term of -695, -2563, -5679, -10055, -15703, -22635, -30863? -2l3 - 612l*2 - 18l - 63 What is the p'th term of -412300, -412314, -412332, -412354? -2p2 - 8p - 412290 What is the i'th term of -2009, -2235, -2627, -3185, -3909, -4799? -83i2 + 23i - 1949 What is the u'th term of -6965139, -6965142, -6965145, -6965148, -6965151, -6965154? -3u - 6965136 What is the x'th term of 1251, 4910, 10971, 19434, 30299? 1201x*2 + 56x - 6 What is the c'th term of 61327107, 122654220, 183981337, 245308458, 306635583? 2c2 + 61327107c - 2 What is the r'th term of 621, -4544, -13147, -25182, -40643, -59524, -81819? r*3 - 1725r**2	{ "pile_set_name": "DM Mathematics" }
-4y - 629. What are the prime factors of ((-9)/6)/(24/y)? 2, 11 Let b = 95 + -93. Suppose -117 = -x + bz + 53, -530 = -3x - 4z. What are the prime factors of x? 2, 3, 29 Let x(w) = w*3 - 5w*2 + 2w - 7. Let g be x(5). Let h(f) = 13f2 + 3f - 2. Let c be h(2). List the prime factors of 2 + 3 + g + c. 2 Let s = 381 - -909. What are the prime factors of s? 2, 3, 5, 43 What are the prime factors of (-15045)/(-8) - (15 + 1476/(-96))? 3, 11, 19 Let j(d) = -6d3 - 5d*2 + 69d - 27. List the prime factors of j(-10). 4783 Let u = 118 + -116. Let z = 0 - 0. Suppose w + 19 = uk, z = 5k + 3w + 2w - 70. What are the prime factors of k? 11 Let n = 187 - -277. What are the prime factors of n? 2, 29 Suppose j = 6j + 5q - 130, j - 14 = -4q. Suppose 659 = 12v - 13. Suppose -2a + j = -v. List the prime factors of a. 43 Suppose 426 = 7l - l. Suppose -l = -7d + 405. List the prime factors of d. 2, 17 Let d be 5 - 31/1. Suppose dm - 30 = -4y, 5y + 3m - 25 = 3y. Suppose 4w - t + 7 = 5w, yt + 13 = 3w. List the prime factors of w. 2, 3 Suppose 2j - 19 = 5. Let p(t) = t*2 - 2t + 4. Let g be p(-6). Let k = j + g. What are the prime factors of k? 2 List the prime factors of 333204/180 + 10 - 6/45. 1861 Let d = 7 + -9. What are the prime factors of (-3)/d + 6 + (-765)/(-6)? 3, 5 Let a = 10 + -10. Suppose -106 = -ac + 2c - w, -4w = 4c + 212. Let j = -35 - c. What are the prime factors of j? 2, 3 Let j = -981 + 1937. List the prime factors of j/10 + (-2)/(-5). 2, 3 Let y(g) be the second derivative of -8g3/3 + 5g*2/2 + 13g. List the prime factors of y(-1). 3, 7 Suppose -n = -5z - 5 + 31, -5n - 10 = -z. Suppose za = -2l + l + 33, -2l + 50 = 2a. What are the prime factors of l? 23 Suppose -54340 = -3f - 17f. What are the prime factors of f? 11, 13, 19 What are the prime factors of (-637)/(-5) - (-6)/(-15)? 127 Let f = 153 - 149. What are the prime factors of f? 2 Suppose -399l + 409l - 11450 = 0. List the prime factors of l. 5, 229 Let f be (3/(-1))/(-2 - (-70)/32). Let a = -12 - f. What are the prime factors of a? 2 Let a = 11 + -11. Suppose -10h + 5h + 15 = a. Suppose 0 = -5d + 5, -105 = -4q - hd + 2d. What are the prime factors of q? 2, 13 Suppose -11t + 9t + 10 = 0. Suppose -tm = -11 + 1. Suppose mw - i = 11 + 14, 0 = 5w + 3i - 35. List the prime factors of w. 2, 5 Let v(w) be the third derivative of w6/6 - w4/6 + w*3/2 + 31w*2. What are the prime factors of v(2)? 5, 31 Suppose -700 = -3y - 2i + 1016, 3y - 3i = 1701. What are the prime factors of y? 2, 3, 5, 19 Let f = 60 - 22. Suppose fd - 146 = 36d. What are the prime factors of d? 73 Let y = -169 + 184. Suppose 4s + 73 - 29 = 0. Let p = y + s. List the prime factors of p. 2 Let z = -751 + 1169. What are the prime factors of z? 2, 11, 19 Let k = 1313 - -378. What are the prime factors of k? 19, 89 Suppose l = 4l + n - 4425, l - 1488 = 4n. What are the prime factors of l? 2, 3, 41 Let z = 53 - 53. What are the prime factors of 0 - (-4)/(5 - (3 + z))? 2 Suppose -26u + 14u = -6312. List the prime factors of u. 2, 263 Suppose u - 3p = 2079, -34u + 2p = -37u + 6270. List the prime factors of u. 2, 3, 29 Suppose -3r + 3s = -27, -2r + 2s + s + 18 = 0. Suppose -48 = 6n - rn. List the prime factors of n. 2 Suppose -2j - 3j = -15. Suppose y - 3y - 5x = -45, jy - 35 = -x. What are the prime factors of y? 2, 5 Suppose -y - 2y - 3j = -24, 0 = -5y + 4j + 22. Suppose -y + 24 = s. List the prime factors of s. 2, 3 Suppose -28c + 19268 = -6128. List the prime factors of c. 907 Let h be -10(3 + (-14)/4). Suppose -hb + 4z = -18, -3z + 5z = 4b - 12. Suppose -2m + m = 3l - 11, 11 = 3m - bl. List the prime factors of m. 5 Suppose 0 = -15k + 80973 - 18063. List the prime factors of k. 2, 3, 233 Let c(y) = y2 - 2y + 3. Let j be c(3). Suppose -jb + r = -2b - 162, -3r + 88 = 2b. Let h = b + 9. List the prime factors of h. 2, 5 Let u(d) = 2d2 - 2d + 2. Suppose -6 = q + 2s, 3q + s - 3s = -26. What are the prime factors of u(q)? 2, 73 Suppose 11o - 34 = 21. Suppose -2k + 3v - 810 = -ok, -4v + 814 = 3k. What are the prime factors of k? 2, 7, 19 Suppose -3p - 5c + 506 = 0, 3p + 0p = 4c + 551. List the prime factors of p. 3, 59 Let a = -314 + 960. What are the prime factors of a? 2, 17, 19 Let a = 30 + 88. What are the prime factors of a? 2, 59 Suppose 4p = 2p + f + 14, -2p = -4f - 8. Suppose -p + 4 = -2j. Suppose g - 24 = jt - 3, 2t + 34 = 2g. What are the prime factors of g? 13 Let j = 58 + 228. What are the prime factors of j? 2, 11, 13 Let f = 1902 - 1134. What are the prime factors of f? 2, 3 Let i = -285 + 981. List the prime factors of i. 2, 3, 29 Let b = -4 + -14. List the prime factors of (-6)/4(-21)/b-68. 7, 17 What are the prime factors of 580/2 - (-1 + 1)? 2, 5, 29 Let q(h) = 2h2 - 3h - 11. Let f be q(-5). Suppose 26i - 20i - f = 0. What are the prime factors of i? 3 Suppose -5c + 1 = 3y, 3y + 0y - 5 = -c. Suppose -3x = yx - l - 175, -2l - 134 = -4x. List the prime factors of x. 2, 3 Let m be 18/30 - 2/(-5). Let a = 10 - m. Suppose 0 = aq - 12q + 159. List the prime factors of q. 53 Suppose 3g = -111 + 186. What are the prime factors of (1 + -41)g/(-50)? 2, 5 Suppose -4x + 5x + 18 = 0. Let y be (-546)/x - (-2)/(-6). Suppose u - 2u + y = 0. What are the prime factors of u? 2, 3, 5 Let p(m) = -112m*3 + m. Let h be p(-1). Suppose 26 - h = -5u. Let a = u + 10. List the prime factors of a. 3 Let j(p) = 50p - 582. List the prime factors of j(43). 2, 7 Let c(m) = -m2 + 2m + 11. Let y be c(5). Let u be (y/6)/((-3)/9). List the prime factors of -3 - (-43)/u2. 2, 5 Let i(t) = 8t + t - 47 + 41. Let z be (-6)/4(-8)/3. List the prime factors of i(z). 2, 3, 5 Let v = 15 + -6. Let m(h) = -9h*2 + 3h + 0h - 7 + 2h + h*3 - 2h. What are the prime factors of m(v)? 2, 5 Let l(g) = g + 31. Let o be l(-29). Suppose -3k + 5y = 3y - 453, -2k - oy = -292. What are the prime factors of k? 149 What are the prime factors of ((-964)/3 + 3)/((-1)/3)? 5, 191 Let n = 909 - 692. List the prime factors of n. 7, 31 Let t(i) = -11i - 10. Let a be t(18). What are the prime factors of 3 - 5 - (6 + a)? 2, 5 What are the prime factors of 24769/10 + 1/10? 2477 Suppose 0 = 5w - 3130 + 395. What are the prime factors of w? 547 Let s(u) = u3 + 2u*2 + 4u - 10. Let y be (-20)/(-6) - 18/(-27). Let z be s(y). Suppose -f = 2f - z. What are the prime factors of f? 2, 17 Let h(m) = m2 + 3m - 8. Let z(o) = o*3 + 5o*2 - 5o + 13. Let b be z(-6). Suppose -12 = 4c, c = -2u - b - 10. What are the prime factors of h(u)? 2, 5 Suppose 4p - 117 = -5c, 0c - 3c + 69 = 2p. List the prime factors of c. 3, 7 Let r(k) = -k2 + 7k - 5. Let a be ((-5)/4)/((-1)/4). Let o be r(a). Suppose -oz = 5b - 70, 5b - 2z - z = 70. List the prime factors of b. 2, 7 Let y be (-2)/(-4)(323 - 25). Suppose -10z = -y - 161. List the prime factors of z. 31 Let g(h) = 3h2 - 3 + 6h*2 + 3h*3 - 10h + 11 - 2h3. List the prime factors of g(-10). 2 Let k(n) = -n3 + 14n*2 + n - 14. Let i be (-55)/(-4) + 3/12. Let l be k(i). Suppose 0 = -u + 5x + 52, 2u + lx - 82 = -x. What are the prime factors of u? 2, 3, 7 Let d(q) = -10q - 8. Let b = 11 - 16. What are the prime factors of d(b)? 2, 3, 7 Suppose 0 = -3z + 5k - 85, -3z = -0z + 4k + 40. Let c be ((-68)/z - 1)5. What are the prime factors of (-265)/(-15) + c/9? 19 What are the prime factors of 306/357 + (-30662)/(-14)? 7, 313 Let v(u) = -u3 + 13u*2 + 14u + 57. List the prime factors of v(14). 3, 19 Let b(i) = 19i2 + 2i - 1. What are the prime factors of b(-3)? 2, 41 Let h(k) = k*3 + 4k*2 - 3k + 5. Let p be h(-5). Let i = -18 + p. Let y = i - -47. What are the prime factors of y? 2, 3 Let v = -7 + 3. Let c(r) = 8r2 - 6r + 15. Let l(h) = 14h2 - 11h + 28. Let a(s) = -5c(s) + 3l(s). What are the prime factors of a(v)? 53 Suppose -40 = -5g - j - 3j, 3g + 5j = 11. Suppose -2y = -0y - 2a + g, -3y + 2a - 14 = 0. What are the prime factors of (y + 4)(-49)/(-2)? 7 Suppose 3w + 3 = 0, 2i + 5w - 264 = 123. List the prime factors of i. 2, 7 Let b(o) be the third derivative of o6/120 - o5/60 - o4/6 + o*3/6	{ "pile_set_name": "DM Mathematics" }
= 182 + -184.09. Let w = t - -0.09. Which is the smallest value? (a) 0.4 (b) -4 (c) w b Suppose -2f + h + 26 = 2f, -2f = h - 16. Let j(g) = 4g - 30. Let m be j(f). Which is the second biggest value? (a) -0.6 (b) -2/17 (c) m a Let t = -154 + 219. Let q be (-8)/52 - 3/t. Which is the third smallest value? (a) -0.4 (b) -2 (c) q c Let u = 1.92 - -0.08. Let s = 0.73 + -0.83. What is the smallest value in s, 0.3, u? s Let d = -51.7 - -55.09. Let k = 0.49 - d. Let v = k + 2.5. Which is the third biggest value? (a) v (b) 0.2 (c) -1/32 a Let m = -408 - -3671/9. Which is the second biggest value? (a) -12/5 (b) 3 (c) m c Let f = -1522 + 1526. What is the third smallest value in 2, 1/4, f, 5? f Let w = -13.8 - -10.8. Which is the third smallest value? (a) w (b) -19 (c) 3 c Let k = 0.8 + -0.7. Let x = -1.52 - -2.92. Let i be 2/3 - (-22)/(-6). Which is the second biggest value? (a) x (b) i (c) k c Let m = 0.01 + 1.99. Let s be 3/(7/(210/(-45))). Which is the fourth biggest value? (a) 0 (b) s (c) m (d) -1 b Let h = 794.5 + -794. Let d = 1.2 - 0.2. Let l = 1.4 - d. Which is the third biggest value? (a) l (b) 1 (c) h a Let j = 6/17 - 41/68. Let f = -1641 - -1641.3. What is the fourth smallest value in -0.3, 1, f, j? 1 Suppose 3r - 13 = 4l, 4r + r = -2l + 13. Suppose ro + 6 = 0, o - 9 + 1 = 5x. Which is the third biggest value? (a) -1 (b) x (c) -4 c Let j = 4 + -4.35. Let q = j + 0.5. Let k = 0.05 + q. What is the smallest value in 0, -5, k? -5 Let i = 4.96 + 0.04. Let d be (3/(-33))/((-2)/(-12)). Let x be -6 - (75/(-12) - 0). Which is the smallest value? (a) i (b) x (c) d c Let g = 396.4 - 396. What is the biggest value in g, 4, 2? 4 Let s = 0.3 + 0.4. Let z = 0.7 + s. Let p = z - 1.5. What is the third biggest value in -5, p, 0.5? -5 Let x = 5 + -5.4. Suppose 5f = 14 + 11. Suppose -1 = -2w - w + 5i, 5w - fi - 5 = 0. Which is the third biggest value? (a) -2 (b) x (c) w a Let y = 955 - 955.5. Suppose 0 = 3n - 6g + 3g + 3, -3n = -4g + 6. Let v = 0.2 - 0.4. What is the second smallest value in v, y, n? v Let w = 0.039 - 0.539. Let q be ((-10)/200)/(2/12). Which is the smallest value? (a) q (b) w (c) -0.2 b Let w = 906/143 + -80/13. Suppose 2p + 8 = -4h, -2p + 3h = -h. What is the third biggest value in w, p, 0? p Let p = 0.04 - 0.34. Let d be 58/26 - 3/13. Which is the biggest value? (a) d (b) p (c) -0.5 a Let n = -51 - -50. Which is the smallest value? (a) 2/5 (b) -5 (c) n (d) 3/2 b Let n = -7.06 - -0.06. Let r = -20097 + 301457/15. What is the second biggest value in n, -3/8, r? -3/8 Let d be (5/40)/(30/(-40)). What is the third smallest value in 4, d, 653? 653 Let r = -4005 + 4003. Let x(i) = -i + 1. Let p be x(0). What is the second biggest value in r, 0.5, p, 0.1? 0.5 Let h = 43 - 40. Let j be h/((108/20)/3). Which is the second smallest value? (a) -0.07 (b) -1/5 (c) j a Let m be (3/18)/(54/216). Which is the smallest value? (a) 2/99 (b) -0.07 (c) m b Let w(c) = -2c - 9. Let x be w(-5). What is the fourth biggest value in 0, -8, -5/2, x? -8 Let x(h) = -h + 5. Let s(g) = g - 4. Let k(m) = -4s(m) - 5x(m). Let w be k(9). What is the third biggest value in -3, w, -4, 3? -3 Let d(m) = -m2 - 21m + 27. Let o be d(-20). Let k = o + -46. Let s = -2 + 1.99. Which is the second smallest value? (a) k (b) s (c) 5 a Let j = 17.01 + -17. Suppose 10b - 3 = 11b. What is the smallest value in b, j, -3/2? b Let n = -0.14 + 0.43. Let r = 0.01 + n. Suppose 46 = -31k + 84 + 117. Which is the biggest value? (a) r (b) k (c) -1/5 b Suppose -2n - 29 = -5v - 6n, v - 2n - 3 = 0. Suppose -23 = h + vt, 3t + 8 + 7 = 0. What is the third biggest value in -0.1, h, -3? -3 Let n(d) be the second derivative of 4d3/3 - d2/2 - 4d. Let m be n(-9). Let y = -287/4 - m. Which is the third smallest value? (a) 0.5 (b) -5 (c) y c Let l be (4 + -9)-11. Let j = -0.14 + 0.24. Which is the third smallest value? (a) j (b) -2/5 (c) 0 (d) l a Let u be 10/(-1 + 3 + 0). Let w = 1065/2138 + 2/1069. Which is the third smallest value? (a) w (b) -3/8 (c) u c Let g be (-6)/(-3) - 0/2. Let c be (3 - 2)-1g/10. What is the second smallest value in c, -3/11, 2/7, -2? -3/11 Let z = -16.6 - -16.7. What is the biggest value in z, 0.3, 2? 2 Let o = 1.9 - -10.1. Let x = 13 - o. Let f = -6.5 - -6. What is the smallest value in x, f, 0.5? f Let d = 5 - 5.04. Let i = -1.04 - d. Let m be (-164)/(-24) + -1 - (2 + 3). Which is the biggest value? (a) m (b) i (c) 4 c Let d = -0.14 + 0.04. Suppose 8 + 23 = 5f - l, f - 8 = 2l. What is the smallest value in f, -2, d? -2 Suppose 137d = 88d + 686. Which is the biggest value? (a) d (b) -3 (c) 0 a Let o = 65.7 + 8.3. Let w = -74.2 + o. What is the third smallest value in -3, w, 7, 2? 2 Let p = 60.8 + -70.8. Let g = -0.35 - 0.05. Which is the second smallest value? (a) 5 (b) g (c) p b Let n = 8.17 - 0.37. Let g = n - 7. Let y = g - 1.2. What is the third biggest value in y, -2/23, -0.2? y Suppose -p = 5q + 47, -1 - 9 = 2q. Let n = p - -18. Let r be (0 - n) + (-78)/21. What is the second smallest value in 1/4, -1, r? 1/4 Let r = 2/109 - -192/1417. Let w = 60.8 + -61. Which is the third smallest value? (a) w (b) -20 (c) r c Let q = 10.49 - 10.4. What is the biggest value in q, -7, 2/3? 2/3 Let v = -154 - -151. Suppose 30 = -3f + 18. Which is the third smallest value? (a) -0.4 (b) f (c) -4/7 (d) v c Let v = -64.6 + 0.6. Let s = 62.3 + v. Which is the second biggest value? (a) -3/7 (b) -0.2 (c) s a Let i be (-22)/(-5) + (-14)/35. Let a be ((-1)/(-3))/(i/20). Suppose -3l = 3y - 0 + 6, -4l - 10 = 2y. What is the third smallest value in -1/3, y, a? a Let i = 121 - 124. Let m(r) = r*3 - 5r*2 + 4r + 1. Let d be m(3). What is the second smallest value in -2, d, i? i Let y = 48 + -140. Which is the biggest value? (a) 1/5 (b) y (c) 1 c Let n = -281 + 1970/7. Let q = 2841 + -2841.3. Which is the second biggest value? (a) q (b) n (c) 0.08 c Suppose -3m - 16 = -5b + 7, 0 = -4m - b. Let j be (((-8)/10)/(-2))/(22/(-10)). What is the second biggest value in j, 2, m? j Let y(m) = -m3 + 7m*2 - 4m - 8. Let c be y(6). Let b = -0.0037 + 0.0037. What is the biggest value in b, c, -5? c Let g = -586 - -583. Which is the biggest value? (a) -5 (b) 0 (c) -4 (d) g b Let h(i) = -i*3 + 33i*2 + 3i - 95. Let p be h(33). Which is the second smallest value? (a) -44 (b) 5 (c) p c Let g be (-28)/(-30) - (-6)/15. Let w = 269/3 - 89. Let y(z) = z + 1. Let a be y(2). What is the second smallest value in a, w, g? g Let v be ((-3)/(-2) - 1)/((-47)/(-4042)). Let w = v + -47. Let o be 2/(-4) + (-6)/4. Which is the biggest value? (a) 5 (b) o (c) w a Let l = -6 + 10. Let b = -5.6 - -1.6. What is the biggest value in l, -2, b? l Let n = 1 - 0. Let o be n - (18/(-20) - -2). Let k = 3763/3 - 1254. What is the second biggest value in o, -0.5, k? o Let j = -2.929 + -0.071. What is the fourth biggest value in -0.2, j, 5, 1? j Suppose -3l + 4l = -14l. Which is the second biggest value? (a) l (b) 7/5 (c) -5 a Let y = 1.7 + 10.3. Let o = -22.16 - -5.16. Let n = o + y. What is the third biggest value in 0.3, n, -1? n Let b be (6/99)/((-2)/(-3)). Let v = 1091 - 4363/4. What is the fourth biggest value in 0.1, 1, v, b? b Let n = 6 + 1. Let g = -6.6 + n. What is the biggest value in g, 0.1, 9/5? 9/5 Let d = -30.9 + 31.4. Which is the smallest value? (a) d (b) -0.5 (c) 25 b Let m(f) = f3 + 8f*2 + 8f + 5. Let i be m(-7). Let z = 584 - 584. What is the fourth biggest value in 1.2, 0.1, i, z? i Let p = 24 + -17.8. Let z = p + -4.2. Which is the smallest value? (a) z (b) 0.4 (c) 0 c Let m = -161.7 + 153. Let z = m - -9. Let w = 0.2 - 0.4. What is the second smallest value in z, -5, w? w Suppose z + 528 = -3z. Let j be (-8)/2(-6)/z. Let i = 11 + -8. What is the biggest value in j, i, -0.4? i Let x = 19 - 7. Let d = x - 12.1. Which is the second biggest value? (a) 0.4 (b) -0.09 (c) d b Suppose -d + 5o - 2 = -13, 2d - 1 = 3*o. Let i = 5 - 0. Which is the third smallest value? (a) d (b) -0.03 (c) i c Let b be -2 + 3 - 638/126. Let c = b - -30/7. Let m = 0.3 - 5.3. What is the biggest value in -2/7, m, c? c Let d = 3 + -3. Let v = -41.06 - 0.94. Let	{ "pile_set_name": "DM Mathematics" }
n 639 is divided by 130? 119 What is the remainder when 9985 is divided by 22? 19 Calculate the remainder when 51478 is divided by 28. 14 What is the remainder when 5450 is divided by 1361? 6 What is the remainder when 4903614 is divided by 5? 4 What is the remainder when 10925 is divided by 683? 680 What is the remainder when 14303 is divided by 457? 136 Calculate the remainder when 9216 is divided by 229. 56 Calculate the remainder when 46638 is divided by 464. 238 What is the remainder when 365010 is divided by 26? 22 Calculate the remainder when 2460 is divided by 112. 108 What is the remainder when 1806 is divided by 94? 20 What is the remainder when 4541 is divided by 243? 167 Calculate the remainder when 63440 is divided by 311. 307 What is the remainder when 3263 is divided by 1552? 159 What is the remainder when 1691 is divided by 452? 335 Calculate the remainder when 155987 is divided by 124. 119 What is the remainder when 2370 is divided by 396? 390 Calculate the remainder when 382736 is divided by 342. 38 What is the remainder when 180541 is divided by 118? 1 Calculate the remainder when 13897 is divided by 31. 9 What is the remainder when 29062 is divided by 1932? 82 What is the remainder when 3164427 is divided by 30? 27 What is the remainder when 574558 is divided by 72? 70 What is the remainder when 16263 is divided by 152? 151 What is the remainder when 4795 is divided by 1271? 982 What is the remainder when 58547 is divided by 29268? 11 What is the remainder when 44460 is divided by 160? 140 What is the remainder when 286851 is divided by 806? 721 Calculate the remainder when 1761118 is divided by 480. 478 What is the remainder when 49842 is divided by 364? 338 What is the remainder when 14149 is divided by 2? 1 Calculate the remainder when 4951 is divided by 18. 1 Calculate the remainder when 8788 is divided by 1461. 22 What is the remainder when 7942 is divided by 1985? 2 Calculate the remainder when 91292 is divided by 2467. 13 What is the remainder when 62110 is divided by 92? 10 Calculate the remainder when 330 is divided by 196. 134 Calculate the remainder when 72815 is divided by 103. 97 What is the remainder when 35838 is divided by 320? 318 What is the remainder when 11648 is divided by 24? 8 What is the remainder when 8114 is divided by 145? 139 Calculate the remainder when 27972 is divided by 16. 4 Calculate the remainder when 19409 is divided by 36. 5 What is the remainder when 134720 is divided by 286? 14 Calculate the remainder when 3085 is divided by 80. 45 What is the remainder when 3081821 is divided by 1544? 1541 Calculate the remainder when 11056 is divided by 552. 16 Calculate the remainder when 4201 is divided by 608. 553 Calculate the remainder when 56582 is divided by 2175. 32 What is the remainder when 15692 is divided by 413? 411 What is the remainder when 40656 is divided by 726? 0 What is the remainder when 41325 is divided by 83? 74 Calculate the remainder when 1922 is divided by 498. 428 What is the remainder when 842720 is divided by 331? 325 Calculate the remainder when 88261 is divided by 323. 82 Calculate the remainder when 61386 is divided by 100. 86 Calculate the remainder when 1316 is divided by 58. 40 What is the remainder when 1397 is divided by 605? 187 Calculate the remainder when 4980 is divided by 568. 436 What is the remainder when 3237 is divided by 141? 135 Calculate the remainder when 2015915 is divided by 84. 83 Calculate the remainder when 1102 is divided by 14. 10 Calculate the remainder when 3169 is divided by 7. 5 Calculate the remainder when 6822 is divided by 54. 18 What is the remainder when 5107 is divided by 718? 81 Calculate the remainder when 802143 is divided by 112. 111 Calculate the remainder when 1346 is divided by 381. 203 Calculate the remainder when 237 is divided by 75. 12 What is the remainder when 3066 is divided by 74? 32 Calculate the remainder when 1323 is divided by 320. 43 Calculate the remainder when 156537 is divided by 128. 121 Calculate the remainder when 2209666 is divided by 11. 8 What is the remainder when 156398 is divided by 23? 21 What is the remainder when 81390 is divided by 684? 678 Calculate the remainder when 75465 is divided by 546. 117 What is the remainder when 687 is divided by 611? 76 Calculate the remainder when 1139 is divided by 185. 29 Calculate the remainder when 126 is divided by 56. 14 What is the remainder when 209370 is divided by 80? 10 Calculate the remainder when 1472 is divided by 29. 22 What is the remainder when 2797 is divided by 2569? 228 Calculate the remainder when 510942 is divided by 170313. 3 Calculate the remainder when 960398 is divided by 140. 138 What is the remainder when 950 is divided by 360? 230 Calculate the remainder when 74534 is divided by 847. 845 What is the remainder when 31170 is divided by 1184? 386 Calculate the remainder when 34227 is divided by 203. 123 Calculate the remainder when 201687 is divided by 201685. 2 What is the remainder when 140 is divided by 63? 14 What is the remainder when 17618 is divided by 3519? 23 What is the remainder when 341486 is divided by 136? 126 Calculate the remainder when 42171 is divided by 16. 11 What is the remainder when 202971 is divided by 488? 451 Calculate the remainder when 5702 is divided by 2828. 46 Calculate the remainder when 62619 is divided by 20. 19 What is the remainder when 17896 is divided by 267? 7 Calculate the remainder when 341 is divided by 86. 83 Calculate the remainder when 39499 is divided by 3290. 19 What is the remainder when 251682 is divided by 51? 48 Calculate the remainder when 30269 is divided by 356. 9 Calculate the remainder when 18491 is divided by 138. 137 What is the remainder when 13520 is divided by 160? 80 Calculate the remainder when 126055 is divided by 41953. 196 What is the remainder when 124564 is divided by 8? 4 Calculate the remainder when 319589 is divided by 149. 133 What is the remainder when 28972 is divided by 2414? 4 Calculate the remainder when 49193 is divided by 455. 53 What is the remainder when 16769 is divided by 185? 119 Calculate the remainder when 1557 is divided by 723. 111 Calculate the remainder when 24680 is divided by 68. 64 What is the remainder when 20221 is divided by 9? 7 What is the remainder when 29299 is divided by 127? 89 What is the remainder when 35001 is divided by 25? 1 Calculate the remainder when 699 is divided by 569. 130 Calculate the remainder when 120778 is divided by 607. 592 What is the remainder when 76967 is divided by 38453? 61 What is the remainder when 2933 is divided by 1145? 643 Calculate the remainder when 139507 is divided by 6. 1 What is the remainder when 780 is divided by 30? 0 Calculate the remainder when 4347 is divided by 1607. 1133 What is the remainder when 171265 is divided by 33? 28 What is the remainder when 9756 is divided by 202? 60 Calculate the remainder when 1053 is divided by 441. 171 Calculate the remainder when 875742 is divided by 39. 36 Calculate the remainder when 1395 is divided by 656. 83 Calculate the remainder when 268584 is divided by 72. 24 What is the remainder when 21948 is divided by 257? 103 Calculate the remainder when 115721 is divided by 99. 89 What is the remainder when 98736 is divided by 218? 200 What is the remainder when 5969 is divided by 1858? 395 Calculate the remainder when 161248 is divided by 231. 10 What is the remainder when 160868 is divided by 195? 188 Calculate the remainder when 4190 is divided by 801. 185 Calculate the remainder when 2043 is divided by 676. 15 What is the remainder when 126767 is divided by 14? 11 What is the remainder when 2423 is divided by 35? 8 What is the remainder when 37071 is divided by 1692? 1539 Calculate the remainder when 9394 is divided by 209. 198 What is the remainder when 2226 is divided by 511? 182 What is the remainder when 88161 is divided by 36? 33 Calculate the remainder when 4289 is divided by 27. 23 Calculate the remainder when 10167 is divided by 106. 97 What is the remainder when 1982084 is divided by 487? 481 Calculate the remainder when 1521 is divided by 451. 168 Calculate the remainder when 87130 is divided by 38. 34 Calculate the remainder when 8721 is divided by	{ "pile_set_name": "DM Mathematics" }
*2 and give t. 1428 Express ((1 - 5 + 2)(-3o + 5o + 0o) + 9o - o + 0o - 2o + 1 - 1 + (2o + 0o + 0o)(3 + 2 - 3) + 6o - 4o + 3o)(-18 - 11 + 7) as ko + m and give k. -242 Express -39 - j3 - 161j*2 + 12j + 20 + 21 - 15j - 35j*2 as nj + vj3 + z + mj*2 and give v. -1 Express (-3 - 1 + 2)(-31z + 17z + 66z)(0 + 7 - 2) in the form o + mz and give m. -520 Express (0 + 1 - 3 + (2 - 2 + 5)(-4 - 3 + 6))(2 - 1 + 0)(0 + l + 0) + (-9l - 8l + 3l)(-2 + 5 - 5) as jl + a and give j. 21 Rearrange 2 - 1820n - 37n - 1318n - 146n to the form c + yn and give y. -3321 Rearrange 7 - 4 - 3 - 5280n + 446n to tn + w and give t. -4834 Rearrange -210 - 31x + 28x - x + 630 to the form b + mx and give m. -4 Rearrange -1 - 303c - 1382c + 1 - 1087c to dc + k and give d. -2772 Rearrange r + 5428r4 + r3 - 10r*2 + 1 + 12r*2 + 62r*2 - 5429r*4 to hr + kr2 + fr*4 + pr*3 + x and give h. 1 Rearrange 5s - 3s + 0s - 8s + 196 + 5s to i + zs and give z. -1 Rearrange (3q + 0q + q)(56 + 75 - 204)(1 - 2 + 3 + (2 - 1 + 0)(0 + 0 - 2) + 2 - 4 - 2) to the form kq + m and give k. 1168 Rearrange -u2 + 44 - 5u*2 + 0u*2 + 20973u - 20983u to the form k + cu + xu2 and give k. 44 Express (-24n + 252n + 12n + (-5n + 0n - 5n)(2 - 2 - 1) - n + 3 - 3 - 4n + 4n + n)(1 - 1 - 1) in the form wn + c and give w. -250 Rearrange -i*4 + 102552i*3 - 2i*4 + 2i*4 - 102554i*3 - 4i*2 to the form xi + ti3 + v + ji*4 + ni*2 and give j. -1 Express (18b - 10b + 4b)(124b + 148b - 140b + 159b - 55b + 143b) as t + ib*2 + pb and give i. 4548 Express (3n - 71 + 71)(-5 + 2 + 1)(3n + n - n) as zn + m + rn*2 and give r. -18 Rearrange -16o*4 - 2 + 7 - 6o*3 + 3o*2 + 3o - 3 + 17o4 to qo + a + bo3 + yo*4 + zo*2 and give z. 3 Express -132x + 24491 - 48970 + 24492 as dx + g and give d. -132 Rearrange 567p - 3 - 1008p + 512p - 11 to u + tp and give u. -14 Rearrange -758m*2 - 1 + 4047m*2 - 647m*2 + 1 to cm + j + um2 and give u. 2642 Rearrange (421 + 2y*2 - 128y + 334 - 739)(1 + 2y*2 - 1) to the form xy*3 + iy + g + zy2 + dy*4 and give d. 4 Rearrange (44y - 52y + 432y)(1 + 3 - 2)(2 - 2 - 2)(14 - y - 12 - 2y) to hy + xy*2 + z and give x. 5088 Express -2a*4 + 0a + 12a3 - 34a*3 + 5a*2 - 2a + 32a3 in the form ha + ua4 + w + sa*2 + ma*3 and give u. -2 Express -17587f*3 - 10418f*3 - 5211f*3 - 2f2 + f3 + 2f2 + (-2f + 2f - f)(2 - 2 - f*2) as s + hf*2 + cf + of3 and give o. -33214 Express 763t - 315 - 12704t + 161 + 154 in the form m + yt and give y. -11941 Rearrange 867j + 360j + 1151j - 323j + 336j to k + wj and give k. 0 Express (-1 + 6 - 1 + (-3 + 4 - 4)(1 + 0 + 0))(-20p - 14p + 3p) as fp + s and give s. 0 Express -234p + 17p + 7315p2 - 7317p*2 - 2p*3 - 114p + 21p in the form op + s + qp2 + gp*3 and give o. -310 Express -169l*3 + 2l + 2 + 94l3 + 74l*3 + 166l*2 in the form ml + j + hl2 + bl*3 and give j. 2 Rearrange (3r - 2r + 0r)(-13 + 7r + 13)(-1252 - 420r + 1252) to the form qr3 + br + sr2 + u and give q. -2940 Rearrange (-p3 + 0p3 - p3)(89p + 115p - 44p + (-46 - 38 + 47)(-p + 0 + 0)) to sp + yp2 + xp*3 + z + tp*4 and give t. -394 Express -8z*2 + 1107197z - 138 - 1107197z as lz + sz2 + u and give s. -8 Rearrange (-h2 + 5h*2 - 3h*2)(4748h - 4 + 5 - 2982h) to the form ph3 + m + dh + ah2 and give p. 1766 Express -67s + 906s2 + 15 - 901s*2 - 10 - 4 in the form f + vs*2 + ts and give f. 1 Express 389 - 131 - 132 - 125 - m*2 - 128m in the form ym + g + pm*2 and give g. 1 Rearrange 45 - 43 - 3261q + 3947q to yq + j and give j. 2 Express 14546d2 - 5606d*2 + 4080d - 2043d - 2039d as nd + s + gd*2 and give g. 8940 Express -107d - d*3 + 47d + 24d + 43d + 8d2 - 3d*2 in the form jd*3 + gd*2 + pd + t and give j. -1 Express 18852d2 - 18853d*2 + 4d*3 + 212d*3 as o + wd*2 + ld + nd3 and give w. -1 Rearrange (-5426 - 10100 - 11624 - 5651 - 5401 + 7226)(5l3 + 4l*3 - 4l*3) to the form ul*3 + f + il*2 + cl and give f. 0 Rearrange 70660 - 144181 + 2a + 72366 to y + sa and give s. 2 Rearrange (21 + 82 + 46)(3z*2 + 0z + 3z - z) to qz + cz2 + f and give c. 447 Rearrange (6s*2 - 9 + 9)(6s - 3s - 4s + (-42s - 19s + 10s)(-3 - 22 + 6) + s - s + 2s) to the form o + cs + ls*2 + ds*3 and give d. 5820 Rearrange -9 - 53q*2 + 1 + 31 - 13q*2 to yq + n + uq2 and give u. -66 Rearrange 0 + 115455d - 111389d + 1 to the form rd + s and give s. 1 Express (-4 + 4 + t)(-5 + 3 + 4)(1872 - 206 - 4025) as a + it and give i. -4718 Rearrange 708557x + 708498x - 23 - 1417102x to lx + j and give j. -23 Express (649 - 649 - 8x)(-2x*3 + 5x3 - x3) + (-2x2 + 2x*2 - 3x*4)(-8 - 9 + 5) in the form wx + dx*4 + ix*2 + y + ax*3 and give d. 20 Rearrange (-8m - 1 + 1 + (1 - 2 + 2)(-m + m - 11m))((-3 - 4 + 5)(3 + 3 - 7) + 5 + 0 - 3) to the form sm + i and give s. -76 Rearrange (2k*3 + 2k*3 - 2k*3)(-7958k + 4042k - 29 + 3996k) - 4k*4 - 46k*3 + 46k*3 to the form sk + bk4 + qk*3 + c + tk*2 and give q. -58 Rearrange -7 + 66l*2 - 5l*3 + 4 + 2l*4 - 63l*2 + 9l*4 to the form vl + r + jl3 + bl*2 + dl*4 and give r. -3 Express (-123a*3 + 424a*3 - 159a*3)(-14a - 7a - a) in the form ca3 + ka*2 + ma*4 + f + ua and give c. 0 Rearrange (4n2 + 3n*2 + 0n*2)(339 - 1509n2 - 339) to yn + gn2 + ln*3 + in*4 + z and give z. 0 Rearrange -368 - 131k + 375 - 9k3 - 4k*3 + 129k to zk + uk*2 + c + tk*3 and give t. -13 Express -2811z - 7860z + 5446z as s + fz and give f. -5225 Express 2561j - 43338 + 4124j + 43338 in the form f + rj and give r. 6685 Express 5 - 1101q + 569q*3 - 285q*3 + 5 - 286q*3 - 8 as aq + hq3 + xq*2 + r and give x. 0 Express 2144307x + 0 - 2143620x - 2 in the form i + ux and give u. 687 Express 2 - 1 + 25j3 - 2j*2 + 17j*3 + 3j + 3j4 - 2j - 2j3 as nj + pj2 + sj*4 + qj*3 + r and give r. 1 Rearrange -108 + 41 + 41 - 8273g*2 + 25 - g to the form x + ig*2 + ug and give u. -1 Rearrange -5u3 + 41747u - 2 - 41753u + 4u*3 - 155u*2 to zu + mu2 + iu*3 + f and give m. -155 Rearrange -12m*2 - 8m2 - m + m3 + 3 + 42m2 - 26m*2 - 3m*4 to vm*4 + w + lm*3 + im*2 + nm and give n. -1 Rearrange ((-z2 + z2 - 2z3)(-2 + 5 - 1) + z2 - z2 + z*3)(-79 + 79 + 38z) to b + mz*2 + hz*3 + oz*4 + dz and give o. -114 Express (2l + l - 5l - 7l)(9l - 21l - 12l + 16) in the form gl*2 + ql + w and give g. 216 Express (-10m + 2m + 2 + 7m)(25m - 3m + 11m) + 4m*2 + 2m - 2m in the form gm*2 + qm + r and give q. 66 Express (-7y2 - 22y*2 + 9y*2)(-12 - 16y2 + 919y - 465y - 455y) as py + l + xy*4 + uy*2 + ky*3 and give k. 20 Express (4 - 18 + 2)(-7b2 - 10b*2 - 3b - 2 + 23b2) as mb*2 + sb + o and give o. 24 Express (1 - w - 1)(3 + 1 - 2) + (-81 - 2 - 73)(-5 + 0 + 4)(-28w + w + 12w) in the form rw + k and give k. 0 Express (0 - 6 + 0)(5j*2 - 31742 + 31745 + 3j + j*2) in the form ij + tj2 + p and give p. -18 Express 25h*4 + 110 - 2h*2 - 111 - 37h*4 + (0h*4 - 2h4 + h4)(-4 - 1 - 2)(0 + 0 + 2) in the form bh2 + gh + fh4 + t + zh3 and give t. -1 Express s4 - 1 + 119s2 - 114s - 55s2 - s4 - 62s*2 + 2s3 + s4 as ys4 + as*3 + gs + m + vs2 and give m. -1 Rearrange -1526h*4 + 8h*2 - 120h*3 + 1532h*4 + 123h*3 to the form v + kh*3 + ch + uh2 + gh*4 and give u. 8 Rearrange -5 + 6 - 111q - 9 - 1 + 10 to the form iq + f and give i. -111 Express 556 + 2u*3 + 540 + 36u - 1096 - u*2 as iu*3 + lu*2 + z + ju and give j. 36 Rearrange (218807 + 23t3 - 218807 - 5t)(-2t + 0t + 4t) + 4t - 4t - 2t4 + t2 to it*4 + nt*3 + l + dt + bt2 and give l. 0 Express -3s + 8s2 + 18s*3 + 895 - 897 - 11s*2 as rs + ts3 + c + qs2 and give t. 18 Rearrange (-u2 + 3u2 - u2)(6u + 0u - 3u) - 220u + 99u + 114u**3	{ "pile_set_name": "DM Mathematics" }
o) = -o*2 + 2o + 4. Let k be q(4). What is the third smallest value in -2, k, -0.2? -0.2 Let j = -5 - -8. Let u be (-2 - (-7)/j)-1. Let d = -0.962 - 0.038. Which is the second smallest value? (a) d (b) u (c) -1/6 b Let k = -47 - -48.9. Let z = k - 2. Let y = -0.56 + 0.06. Which is the biggest value? (a) z (b) 4 (c) y b Let u be (-75)/(-36) + -1 + -1. Which is the second biggest value? (a) -2/9 (b) u (c) 15 (d) -0.4 b Let m = 0.4 - 1.5. Let k = m + 7.1. Which is the second smallest value? (a) -1/5 (b) k (c) -5 a Suppose 4g + 0g = -28. Let k = g - -12. What is the third biggest value in k, 2/3, -3? -3 Let w = -0.01 + -0.05. Let k = w - -0.66. Let x = 0.8 - k. What is the second biggest value in x, 1, 5? 1 Let w = -4.2 + 4. Let y = 0.75 - 0.35. Which is the third smallest value? (a) w (b) 5 (c) y b Suppose -1 = -2h + 3h - 2i, 5i - 6 = -h. What is the biggest value in -3, 9, h? 9 Let p = -5.3 - -5. Which is the second smallest value? (a) p (b) 5 (c) -1/4 c Let q be -3 - -5 - 11/6. Let v = 0.08 - 8.08. Let d = -4 - v. What is the third biggest value in d, 5, q? q Let r(k) = k3 - 13k*2 + 15k - 6. Let g be r(12). Let b be (g/20)/(1/2). What is the second biggest value in b, -2/9, -1/5? -1/5 Let g = 174.95 - 171. Let s = -0.05 - g. Suppose 1 + 13 = -3f - 5j, -j = 2f + 7. Which is the biggest value? (a) s (b) f (c) -1/6 c Let i = 5 + -5. Suppose -2x + ix = 0. Which is the third biggest value? (a) x (b) -0.4 (c) 2/11 b Let b = -14 - -27/2. Let k be (-7)/(-21)(-2 - 13). What is the third biggest value in 0.1, k, b? k Let j = 5.7 + -6. Let k be 662/1824/16. Let m = k + -55. Which is the biggest value? (a) m (b) j (c) 5 c Let l = 7/96 - -3/32. Let h = 1/2 - l. Which is the smallest value? (a) h (b) 4 (c) 2 a Let l be (-75)/15 + 18/4. Let b be 6/(-10)4/6. What is the third biggest value in l, b, 5? l Let x = -273 + 271. Let q = 3 - 3.03. Let w = -5.03 - q. Which is the third biggest value? (a) 3 (b) w (c) x b Let u = -3.96 + -0.04. Let g = u + 7. What is the third smallest value in -2/7, -2/3, g? g Let w = 0.1 - 0.1. Let u = 4 + -3.85. Let k = -0.05 + u. Which is the second smallest value? (a) 0.3 (b) k (c) w b Let s = 1 - -3. Suppose -2r = -sj + r + 22, 10 = -5r. Let m = 67 + -70. Which is the third biggest value? (a) 3 (b) j (c) m c Let f = -79/345 - -2/69. Let x = -337/3445 + 6/53. Let u = -123/455 - x. Which is the second smallest value? (a) -4 (b) f (c) u c Let x = 22 + -22.3. What is the biggest value in x, -0.06, -1? -0.06 Let p = -0.9 - -1. What is the second smallest value in p, 5, 0? p Let i be (-232)/(-4785) + (-18)/(-22) + -1. Which is the second biggest value? (a) i (b) -56 (c) 1/2 a Let t be 710/8 + 1/4. Let y = t + -622/7. What is the third biggest value in y, 0.1, -2? -2 Let f be (2 + 7/(-4))/1. Let a = -0.2 + 0.1. What is the smallest value in a, f, 1? a Let s(n) = -n3 + 8n*2 + 2n - 12. Let k be s(8). Let m = -83468 - -21618129/259. Let v = m + -4/37. Which is the smallest value? (a) -4 (b) k (c) v a Let j = -0.1 + 1.1. Let t be 0 - (21 + 6/(-2)). Let d = t + 13. Which is the second biggest value? (a) -4 (b) j (c) d a Let a = 20.5 + -21. What is the third smallest value in -0.1, a, 0.3? 0.3 Let k = 11 + -10. What is the smallest value in 3, -3, k? -3 Let x = -68 - -66. Which is the second biggest value? (a) 1/7 (b) 3 (c) x a Let s = -1.3 - 2.7. Which is the second biggest value? (a) -1.3 (b) s (c) 4 a Let y = 2/35 + -41/105. What is the third smallest value in 0.1, 0.8, -4, y? 0.1 Let u = 85 - 90. Let q = 0.9 + -1. Which is the smallest value? (a) q (b) u (c) -0.5 b Suppose 4z = 14 + 6. What is the second biggest value in 4, -0.3, z? 4 Suppose -u = -5u. Suppose 3i = -ui. Let q be (-2)/9 + (-29)/(-9). Which is the second smallest value? (a) i (b) -3 (c) q a Let d = 10.7 + -11. Let c = -67/273 + 4/39. What is the third biggest value in 0.4, c, d? d Let j = -37 - -35. Which is the biggest value? (a) j (b) 4 (c) -2/9 b Let s = 0.1 + -4.1. Let j = -0.1 + 7.1. Let p = -4 + j. What is the third smallest value in -1, p, s? p Let s(m) = -9m - 2. Let u be s(-1). Suppose r - 4 = -2t, 6r - r = -5t + 20. Which is the third smallest value? (a) 3 (b) u (c) t b Let f = -9 + 8.9. What is the second smallest value in 1/3, f, 1? 1/3 Suppose 3u - 3j - 6 = 0, 0j - 4j = 3u + 29. Let g = -2 + -3. What is the third smallest value in u, g, -0.5? -0.5 Let v be 2(-3)/(-12)10. Let s = v - 5. Let k be (s + 0)/(2 - 1). Which is the second biggest value? (a) 4 (b) -2 (c) k c Let x = -14.99 + 15. Let i = 0.01 - x. What is the smallest value in -2, 0.1, i? -2 Let p = 27 - 24. What is the biggest value in -4, 2, 1, p? p Suppose 5k - 37 = k - 5u, -k = 2u - 13. What is the third smallest value in 2, k, 2/13, 0? 2 Let b(r) = -r + 4. Let l be b(-3). What is the third biggest value in -2/9, -2/11, l? -2/9 Let u = -0.26 + 0.16. Which is the third biggest value? (a) -3 (b) 2 (c) 6 (d) u d Suppose -h + x + 11 = 4x, -x = -3h + 3. Let u = 0.32 + -0.12. What is the third smallest value in u, 2/7, h? h Suppose 0 = 4z - 2z + 8. Which is the third biggest value? (a) 3/2 (b) z (c) 1 b Let h = 5.1 + -5.5. What is the second biggest value in -0.1, 2, h, 3? 2 Let p(g) be the first derivative of g3 - g2 + g + 7. Let z be p(1). Which is the smallest value? (a) z (b) 0.05 (c) -5 c Let t = -7 + 10. Let m = 0.03 + 0.27. Which is the third biggest value? (a) m (b) -0.01 (c) t b Let s = -1.048 + 0.048. Which is the fourth smallest value? (a) s (b) -0.4 (c) 3/7 (d) -17 c Let l = 6 + -2. Let s be 33/6 + (0 - l). What is the biggest value in s, -0.5, 0? s Suppose 5q + 5k - 20 = 0, 2q + k - 3 + 0 = 0. Let f(z) = 14z - 6. Let r be f(5). Let w = 255/4 - r. Which is the biggest value? (a) w (b) q (c) -0.3 a Let l = 0.14 - -3.86. Let h = -2108/9 - -234. Let x = 5.4 - 0.4. What is the smallest value in l, h, x? h Let r = 7 - 6. Which is the biggest value? (a) r (b) 0.1 (c) -1 a Let p = -1 + 0.5. Let f = 37.4 - 37. Which is the second biggest value? (a) f (b) p (c) 5 a Let f = 0.1 + -0.3. Let w = 6.4 - 4. Let h = w + -2. Which is the biggest value? (a) h (b) f (c) 2 c Let b = -0.04 - 0.56. Let c = -22.6 - -25. Let q = b - c. What is the second biggest value in 5, -4/5, q? -4/5 Let o = 0.25 + -14.25. Let x = o + 14.1. Let n = 0.8 + -4.8. Which is the third biggest value? (a) n (b) x (c) 0 a Let p = -2 - -2.1. Let w = -300 + 6603/22. Let j = w - 10/33. Which is the second biggest value? (a) p (b) -5 (c) j c Let t = -7 - -10. Suppose 140 = 5r - 5a, -tr - 3a = -5a - 79. Suppose -5b = -8 + r. What is the biggest value in -0.3, b, 0? 0 Let k = -1.08 + 0.08. What is the biggest value in 0.4, -5, k? 0.4 Let t = -0.123 + -6.877. What is the second smallest value in t, -4, -0.5? -4 Let k be ((-112)/(-98))/(6/21). Which is the second smallest value? (a) 2 (b) k (c) -1 (d) -11/3 c Let y = 761/1743 - 2/249. What is the smallest value in -2/15, y, -1? -1 Let u = 0.7 + -1. Let z = u + 0. What is the third smallest value in z, 0.4, 1/2? 1/2 Let m = 1.6 + -2.1. What is the biggest value in 0, m, -1/6? 0 Let y be 192/112(-1)/4. What is the third smallest value in 0.2, y, 3? 3 Let c = 212 - 1487/7. Let q = 0.3 - 0.4. What is the second biggest value in c, 0.3, q? q Let c = -9 + 6. What is the biggest value in c, -1/3, 5? 5 Let d = 4.7 - -0.3. Let n = -632 + 634. What is the third smallest value in -2/9, d, n? d Let j = -44.1 + 51. Let s = -0.1 - j. Let u = 3 + s. Which is the third biggest value? (a) -2 (b) u (c) -3/4 b Let c be (-47)/44 + (-75)/(-60). Let j = 2 + 0. Let i = 0 - j. What is the third smallest value in c, i, 0? c Let u be (-4)/(-6) + 0/(-14). Which is the second smallest value? (a) u (b) -0.8 (c) -4/7 c Let k(x) = 3x*3 - 2x*2 + x. Let l be k(1). Suppose -n + 6 = l. Which is the biggest value? (a) n (b) -0.4 (c) -4 a Let i = 0.9 + -5.9. What is the third smallest value in 0.2, 5, i? 5 Let q = 2 + -1.9. Let s(j) = j - 8. Let f be s(11). Suppose 5w = fw. Which is the biggest value? (a) w (b) 1/7 (c) q b Let v = -25.87 - -26. Let q = -0.43 + v. What is the biggest value in q, -1/5, -2/3? -1/5 Suppose 76 = -2b + 70. W	{ "pile_set_name": "DM Mathematics" }
75640 or 0? -3/175640 Which is bigger: 10142 or 10188? 10188 Which is smaller: -1605 or -12847/8? -12847/8 Is 0 >= -74/30481? True Which is greater: -1008 or -952? -952 Which is greater: 167970 or 167971? 167971 Which is smaller: -6/45281 or 1? -6/45281 Which is smaller: 0.21 or 9/305? 9/305 Is 691113 bigger than 691113? False Is -8246 at most -8244? True Which is bigger: -406/1515 or 0? 0 Is -87853 at most as big as -87863? False Which is smaller: 6/31 or -3/22411? -3/22411 Is -927/413 >= -2? False Does -6894 = -46? False Which is smaller: -2720 or 77? -2720 Is 26/9111 at most 1? True Which is greater: -1411 or -1380? -1380 Which is smaller: -32 or 1296? -32 Is 0 greater than or equal to 99/1387? False Is 136860 smaller than 136856? False Is 9/323 greater than or equal to 15? False Which is smaller: -5/3210621 or 1? -5/3210621 Which is bigger: -2 or -452/277? -452/277 Is -25.9 greater than 13.92? False Which is smaller: 91 or 102? 91 Is 35 less than or equal to -5376/5? False Is -1510795 equal to -1510794? False Is 80033 at most as big as 80037? True Which is bigger: 1 or -55818? 1 Is 23.8 <= 121.8? True Which is greater: -411248 or -1233743/3? -1233743/3 Is 103/49 equal to 2? False Is -2/14259 != 2/7? True Are -132.963 and 0.2 non-equal? True Which is smaller: -2/108607 or 0? -2/108607 Is -1 less than -49/98899? True Is 96052 equal to 96052? True Are 21660 and 21658 equal? False Which is bigger: -1 or -2/3698727? -2/3698727 Does 4/1133509 = -1? False Which is smaller: 666 or 667? 666 Is -0.1 less than 94.811? True Is -4235/12 equal to -354? False Is -33841 not equal to -33838? True Which is bigger: 0.05 or -37916? 0.05 Does -926 = 760? False Which is greater: 375 or 63? 375 Is 0.02 != -63246? True Is 9 at most 619/68? True Is 0 < -6/3569153? False Which is smaller: 1 or -2/3646459? -2/3646459 Which is smaller: 18652 or -2/17? -2/17 Which is smaller: 230530 or 230532? 230530 Is -794 less than -27816/35? False Which is bigger: 114 or -290? 114 Which is greater: -1 or -2/895395? -2/895395 Which is greater: -2530 or -53120/21? -53120/21 Which is smaller: -137 or -1031? -1031 Which is bigger: 124 or 5330/43? 124 Which is smaller: -119/1067 or 1.7? -119/1067 Is -41784 not equal to -41783? True Which is smaller: -920 or -37756/41? -37756/41 Which is smaller: 1.84 or 0.0446? 0.0446 Which is greater: -19/7890 or -1? -19/7890 Is -1/12241969 >= 1? False Which is smaller: -13209/41 or -1? -13209/41 Are -10747 and -10747 equal? True Which is bigger: -821576/5 or -164315? -164315 Which is bigger: -22/2815 or 0? 0 Which is smaller: 68507 or 274029/4? 68507 Which is greater: -145 or -185? -145 Which is smaller: 0.337 or -150/7? -150/7 Is 1292014/23 equal to 56174? False Is -58872/53 less than -1111? False Which is greater: -1/61151 or 0.5? 0.5 Which is bigger: 15/243506 or 0? 15/243506 Which is smaller: -70/37647 or -0.1? -0.1 Is -2/207557 greater than 1? False Which is greater: 10 or 349/34? 349/34 Do 0 and 10749200 have different values? True Which is bigger: -4 or -4170/947? -4 Which is smaller: -31.875 or 1/3? -31.875 Which is smaller: -934 or -969? -969 Which is bigger: 180/125797 or 1? 1 Which is smaller: 2/7 or 54.235? 2/7 Is 24 <= 0.0426? False Which is bigger: 0 or 1/717109? 1/717109 Are 5187722 and -2 unequal? True Is -575353 equal to -575352? False Is -2.7 smaller than 3516? True Is 173205/2 less than -1? False Which is bigger: -1628 or -491? -491 Which is smaller: -4 or -2952/1163? -4 Which is greater: -8912/17 or -525? -8912/17 Is -544 less than or equal to -16910/31? False Which is smaller: -1 or -1304/715? -1304/715 Which is bigger: 625/87 or 7? 625/87 Is -2/23 at most -61011? False Which is smaller: -16366 or -130923/8? -16366 Which is bigger: 112227 or 112225? 112227 Which is bigger: 3 or 2133/736? 3 Is 7/372871 bigger than 0? True Which is smaller: 196754 or 196758? 196754 Is -69892 > -69891? False Is 42 greater than -3045? True Which is smaller: -5 or -668516? -668516 Is -36505 <= -36518? False Which is smaller: 253024 or 253027? 253024 Is 2148 bigger than 2136? True Which is bigger: -35145/7 or -5020? -5020 Is 122338 bigger than 122334? True Are 594 and 82411/139 unequal? True Do 0 and 292/12969 have the same value? False Which is greater: -236436 or -945749/4? -236436 Which is bigger: -3930 or -27512/7? -3930 Which is smaller: -297 or 0.064? -297 Are 819523 and 819524 equal? False Which is greater: -3/89 or -592? -3/89 Is 91 not equal to -289? True Which is greater: 0.1253 or -136? 0.1253 Are -5596978 and -5596977 unequal? True Is 1 at least as big as 631/3359? True Which is bigger: -12522 or -12520? -12520 Which is smaller: -5/25828 or -1? -1 Which is bigger: -415 or -14133/34? -415 Is 5405 not equal to 5420? True Which is smaller: -1853 or -1924? -1924 Is -11711 at most as big as -11711? True Is -14549 <= -101839/7? True Which is smaller: 1/729354 or -1? -1 Which is smaller: 685 or 323? 323 Which is smaller: -2969 or -50? -2969 Is 1566670 smaller than -0.5? False Is 3 at most as big as 1853/1192? False Which is bigger: 1 or -17/6198? 1 Does 10287/31 = 333? False Which is smaller: -14 or 22? -14 Are 473 and 10.9 equal? False Is 255412/5 less than 51083? True Is 3203320 at least as big as 3203322? False Which is smaller: -1246 or -1256? -1256 Which is smaller: -425675 or -425676? -425676 Which is smaller: -30847 or -30852? -30852 Is 780 < 10905/14? False Which is greater: -20 or -4498? -20 Are -1/2 and -445330 non-equal? True Which is smaller: -780212 or -780213? -780213 Do 7985661 and 7985659 have the same value? False Are 38 and 276/7 unequal? True Is -11545 greater than or equal to -11306? False Which is smaller: -5 or -1811? -1811 Which is bigger: -3283696 or -1/3? -1/3 Which is bigger: -227786 or -227763? -227763 Is 1446177 at most 1446178? True Which is smaller: -37/23 or -5/11? -37/23 Is 1 <= 2/1252753? False Is 56 >= -10309? True Is 149600 != 149621? True Is -1662/17 at least as big as 8? False Which is smaller: -605 or -641? -641 Which is smaller: 0.06 or -30007? -30007 Is 7611/106 less than or equal to 71? False Which is greater: -12 or -471/40? -471/40 Is -19632 not equal to -19631? True Is -301/925 less than 0? True Are 276101/11 and 25101 nonequal? True Is 8286 greater than or equal to 8345? False Is -44 at least as big as 23.89? False Is -2/7 at least 354989? False Is -5425 equal to -5418? False Is 445 less than or equal to -1968? False Which is smaller: -6.17 or 43? -6.17 Is -1 less than or equal to -143/6438? True Is 476/5 <= -6/31? False Is -874724 smaller than -874724? False Which is bigger: -2077 or -2107? -2077 Which is greater: -1 or -2/46283? -2/46283 Which is greater: 870783/5 or 174156? 870783/5 Which is smaller: -70153 or -70155? -70155 Which is smaller: -1521981 or -1521980? -1521981 Which is greater: -5031985 or 0.1? 0.1 Is 1 <= 40/154469? False Are 0 and 120/821 unequal? True Is 1/32261 greater than 1? False Which is bigger: 326835 or 326834? 326835 Which is smaller: 18 or -572? -572 Is 10204 at most 10204? True Is 1165/1689 greater than -0.1? True Which is bigger: -500522/9 or -55613? -55613 Which is smaller: 174 or 209? 174 Which is smaller: 419696 or 419692? 419692 Is 1076933 equal to 1076934? False Which is smaller: -1 or -2387? -2387 Are -316 and -123 equal? False Is 14760/17 at least as big as 869? False Which is bigger: -2010400 or -2/3? -2/3 Which is greater: -1/2 or 0.384146? 0.384146 Is -13338 < -13336? True Is 10879 at most 10877? False Are -200583 and -200596 equal? False Which is smaller: 18 or 2177/123? 2177/123 Which is smaller: 4370 or 4391? 4370 Which is smaller: 0.5 or 635677? 0.5 Is -28269 smaller than -28316? False Which is smaller: -86/617 or 1? -86/617 Is -1.1477 smaller than -6? False Which is bigger: -1 or 894/2339? 894/2339 Which is greater: -0.5797 or 60? 60 Is -1960/37 smaller than -53? False Which is bigger: -101020 or -101009? -101009 Are -2/195723 and 0 unequal? True Which is smaller: -1 or -3/18467? -1 Which is greater: -24286 or -24276? -24276 Which is smaller: 1/115593 or 0? 0 Is -9758 at most as big as -10? True Which is bigger: 1/303740 or -1? 1/303740 Which is bigger: 60410 or -25? 60410 Which is smaller: 3649 or 3647? 3647 Which is bigger: 560/43 or 14? 14 Which is sm	{ "pile_set_name": "DM Mathematics" }
llions digit of 9046956? 9 What is the thousands digit of 424334? 4 What is the ten thousands digit of 311913? 1 What is the thousands digit of 2537636? 7 What is the units digit of 34115? 5 What is the tens digit of 691675? 7 What is the hundred thousands digit of 208820? 2 What is the tens digit of 8053565? 6 What is the millions digit of 16060953? 6 What is the hundred thousands digit of 4514563? 5 What is the hundreds digit of 1835728? 7 What is the hundreds digit of 57452? 4 What is the thousands digit of 226744? 6 What is the hundreds digit of 51653? 6 What is the thousands digit of 556412? 6 What is the hundreds digit of 387463? 4 What is the hundreds digit of 3082? 0 What is the hundreds digit of 121188? 1 What is the thousands digit of 3469317? 9 What is the ten thousands digit of 3409441? 0 What is the tens digit of 743657? 5 What is the tens digit of 2619476? 7 What is the thousands digit of 7942097? 2 What is the units digit of 456448? 8 What is the tens digit of 2596033? 3 What is the units digit of 3895031? 1 What is the ten thousands digit of 231598? 3 What is the ten thousands digit of 274294? 7 What is the units digit of 6163769? 9 What is the ten thousands digit of 3392545? 9 What is the hundreds digit of 1939713? 7 What is the hundreds digit of 730018? 0 What is the ten thousands digit of 3182329? 8 What is the ten thousands digit of 275262? 7 What is the ten thousands digit of 253387? 5 What is the units digit of 1855678? 8 What is the hundred thousands digit of 468756? 4 What is the hundred thousands digit of 19708486? 7 What is the units digit of 955123? 3 What is the hundred thousands digit of 4414708? 4 What is the tens digit of 2376682? 8 What is the thousands digit of 874363? 4 What is the tens digit of 1346079? 7 What is the millions digit of 4630289? 4 What is the millions digit of 7995529? 7 What is the ten thousands digit of 50745? 5 What is the hundreds digit of 442144? 1 What is the thousands digit of 2922795? 2 What is the ten thousands digit of 34514040? 1 What is the ten thousands digit of 298701? 9 What is the tens digit of 1565787? 8 What is the hundred thousands digit of 920348? 9 What is the hundred thousands digit of 27724542? 7 What is the hundreds digit of 1186480? 4 What is the ten thousands digit of 253663? 5 What is the tens digit of 992947? 4 What is the hundreds digit of 8070218? 2 What is the thousands digit of 2562049? 2 What is the hundred thousands digit of 16558722? 5 What is the millions digit of 1386970? 1 What is the ten millions digit of 22381853? 2 What is the hundreds digit of 6457047? 0 What is the hundreds digit of 1844877? 8 What is the ten millions digit of 21927613? 2 What is the thousands digit of 604224? 4 What is the tens digit of 2532458? 5 What is the thousands digit of 68251? 8 What is the tens digit of 2977550? 5 What is the hundreds digit of 336520? 5 What is the units digit of 5808320? 0 What is the hundred thousands digit of 216910? 2 What is the hundreds digit of 19830288? 2 What is the tens digit of 209213? 1 What is the units digit of 257227? 7 What is the tens digit of 15125793? 9 What is the hundreds digit of 407693? 6 What is the millions digit of 1068398? 1 What is the ten thousands digit of 100247? 0 What is the millions digit of 17519363? 7 What is the units digit of 10704294? 4 What is the units digit of 14604? 4 What is the units digit of 171166? 6 What is the hundreds digit of 7354202? 2 What is the thousands digit of 245933? 5 What is the tens digit of 310827? 2 What is the millions digit of 4336316? 4 What is the ten thousands digit of 14943656? 4 What is the tens digit of 269168? 6 What is the tens digit of 2189673? 7 What is the units digit of 8268942? 2 What is the units digit of 1116063? 3 What is the ten thousands digit of 121244? 2 What is the hundred thousands digit of 2830567? 8 What is the thousands digit of 486284? 6 What is the hundred thousands digit of 413490? 4 What is the hundred thousands digit of 1442578? 4 What is the millions digit of 6029846? 6 What is the thousands digit of 4234800? 4 What is the thousands digit of 320381? 0 What is the tens digit of 126010? 1 What is the millions digit of 2725821? 2 What is the thousands digit of 265481? 5 What is the hundred thousands digit of 363102? 3 What is the thousands digit of 12205432? 5 What is the tens digit of 136506? 0 What is the thousands digit of 426311? 6 What is the hundred thousands digit of 256110? 2 What is the hundred thousands digit of 435746? 4 What is the ten thousands digit of 2730788? 3 What is the ten thousands digit of 986601? 8 What is the units digit of 81257? 7 What is the hundreds digit of 13527617? 6 What is the hundred thousands digit of 3501786? 5 What is the hundred thousands digit of 20010827? 0 What is the thousands digit of 32530387? 0 What is the tens digit of 141943? 4 What is the thousands digit of 2303193? 3 What is the tens digit of 1628680? 8 What is the ten thousands digit of 6171812? 7 What is the ten thousands digit of 153979? 5 What is the millions digit of 5103290? 5 What is the hundreds digit of 45486? 4 What is the hundred thousands digit of 617346? 6 What is the ten thousands digit of 248676? 4 What is the hundred thousands digit of 10317980? 3 What is the tens digit of 85597? 9 What is the units digit of 7190780? 0 What is the hundreds digit of 157526? 5 What is the tens digit of 1962328? 2 What is the thousands digit of 451884? 1 What is the millions digit of 1126972? 1 What is the thousands digit of 4067695? 7 What is the tens digit of 32784? 8 What is the tens digit of 205405? 0 What is the hundred thousands digit of 291591? 2 What is the hundreds digit of 10111184? 1 What is the millions digit of 36546223? 6 What is the hundreds digit of 297903? 9 What is the units digit of 536985? 5 What is the thousands digit of 180552? 0 What is the units digit of 923446? 6 What is the tens digit of 23780222? 2 What is the units digit of 26403607? 7 What is the thousands digit of 364839? 4 What is the thousands digit of 12208225? 8 What is the tens digit of 473533? 3 What is the thousands digit of 5289? 5 What is the hundreds digit of 165272? 2 What is the ten thousands digit of 3517752? 1 What is the ten thousands digit of 153693? 5 What is the thousands digit of 969358? 9 What is the hundreds digit of 1081748? 7 What is the hundred thousands digit of 116453? 1 What is the units digit of 2636615? 5 What is the ten thousands digit of 563023? 6 What is the tens digit of 3308761? 6 What is the units digit of 257164? 4 What is the tens digit of 282317? 1 What is the hundreds digit of 457837? 8 What is the hundred thousands digit of 205440? 2 What is the units digit of 1060524? 4 What is the thousands digit of 19508? 9 What is the thousands digit of 3729806? 9 What is the tens digit of 644449? 4 What is the tens digit of 5704370? 7 What is the millions digit of 17967959? 7 What is the tens digit of 2723295? 9 What is the hundred thousands digit of 624335? 6 What is the hundreds digit of 22366303? 3 What is the ten thousands digit of 5747750? 4 What is the millions digit of 23777433? 3 What is the tens digit of 3644731? 3 What is the ten thousands digit of 1730087? 3 What is the hundreds digit of 234162? 1 What is the thousands digit of 2188995? 8 What is the units digit of 1332097? 7 What is the units digit of 25774441? 1 What is the hundreds digit of 1366157? 1 What is the hundreds digit of 3131? 1 What is the hundreds digit of 343989? 9 What is the hundred thousands digit of 472360? 4 What is the hundreds digit of 341520? 5 What is the hundreds digit of 18537297? 2 What is the ten millions digit of 14367948? 1 What is the ten thousands digit of 4049371? 4 What is the hundred thousands digit of 3472226? 4 What is the tens digit of 335551? 5 What is the hundreds digit of 41632221? 2 What is the hundreds digit of 1368871? 8 What is the ten thousands digit of 100664? 0 What is the thousands digit of 2034834? 4 What is the units digit of 336039? 9 What is the units digit of 3695980? 0 What is the ten thousands digit of 7928119? 2 What is the ten thousands digit of 18812130? 1 What is the thousands digit of 402863? 2 What is the units digit of 241055? 5 What is	{ "pile_set_name": "DM Mathematics" }
-i + 209767221 What is the b'th term of -816649, -3265951, -7348121, -13063159, -20411065? -816434b2 - 215 What is the g'th term of -1204, -2741, -4612, -6817, -9356? -167g*2 - 1036g - 1 What is the j'th term of 1433, 3138, 4843? 1705j - 272 What is the r'th term of 25, -321, -1463, -3797, -7719? -66r*3 - 2r*2 + 122r - 29 What is the g'th term of -50237, -50252, -50273, -50300, -50333, -50372, -50417? -3g2 - 6g - 50228 What is the s'th term of -50058, -100386, -150714, -201042? -50328s + 270 What is the a'th term of 5985175, 5985174, 5985173, 5985172, 5985171? -a + 5985176 What is the f'th term of 68963, 276189, 621595, 1105205, 1727043? 4f*3 + 69066f*2 - 107 What is the k'th term of -34721, -71619, -108613, -145751, -183081, -220651, -258509? -8k*3 - 36842k + 2129 What is the z'th term of 37684, 75366, 113048? 37682z + 2 What is the q'th term of 112, 1797, 3482, 5167, 6852? 1685q - 1573 What is the z'th term of 17813503, 35627004, 53440505, 71254006, 89067507, 106881008? 17813501z + 2 What is the c'th term of -16629, -62155, -136577, -239895, -372109, -533219, -723225? -14448c*2 - 2182c + 1 What is the s'th term of -104, -1570, -5518, -13190, -25828, -44674? -207s3 + s2 - 20s + 122 What is the o'th term of -390, -216, 16, 324, 726? 3o3 + 11o*2 + 120o - 524 What is the y'th term of 2133, 8345, 25227, 58113, 112337? 889y3 + y2 - 14y + 1257 What is the t'th term of -739529, -1479053, -2218577, -2958101, -3697625, -4437149? -739524t - 5 What is the k'th term of -372997, -748103, -1123209, -1498315, -1873421? -375106k + 2109 What is the b'th term of 9427, 39092, 88615, 158062, 247499, 356992, 486607? 11b3 + 9863b*2 - b - 446 What is the b'th term of -7413, -7731, -8021, -8283, -8517? 14b*2 - 360b - 7067 What is the j'th term of -369421, -738957, -1108493? -369536j + 115 What is the a'th term of -14382, -28844, -43314, -57792, -72278, -86772, -101274? -4a*2 - 14450a + 72 What is the m'th term of 392, 623, 752, 785, 728, 587, 368? m*3 - 57m*2 + 395m + 53 What is the s'th term of 30330, 30319, 30292, 30237, 30142? -2s3 + 4s*2 - 9s + 30337 What is the i'th term of -22551, -22428, -22307, -22188, -22071? -i*2 + 126i - 22676 What is the r'th term of -291, -629, -1629, -3621, -6935, -11901, -18849, -28109? -55r3 - r2 + 50r - 285 What is the m'th term of 17852, 71067, 159750, 283901, 443520, 638607? 17734m2 + 13m + 105 What is the f'th term of -25476, -203743, -687608, -1629873, -3183340, -5500811, -8735088? -25467f3 + 3f*2 - 7f - 5 What is the p'th term of 51228, 51495, 51914, 52491, 53232, 54143, 55230? p*3 + 70p*2 + 50p + 51107 What is the p'th term of 583204, 1166345, 1749486, 2332627, 2915768, 3498909? 583141p + 63 What is the h'th term of -1406, -6474, -14916, -26732? -1687h*2 - 7h + 288 What is the o'th term of 20959, 23844, 28651, 35380, 44031, 54604? 961o2 + 2o + 19996 What is the f'th term of -2038, -626, 786, 2198, 3610, 5022? 1412f - 3450 What is the y'th term of -2042428, -4084923, -6127420, -8169919, -10212420, -12254923? -y2 - 2042492y + 65 What is the o'th term of -7155466, -7155507, -7155566, -7155643, -7155738, -7155851? -9o2 - 14o - 7155443 What is the q'th term of 58, 202, 394, 622, 874, 1138, 1402? -2q3 + 36q*2 + 50q - 26 What is the f'th term of -8153498, -16306996, -24460492, -32613986, -40767478? f*2 - 8153501f + 2 What is the h'th term of -26643, -106549, -239701, -426099, -665743, -958633? -26623h2 - 37h + 17 What is the z'th term of 595207, 2380671, 5356445, 9522529, 14878923, 21425627? 595155z2 - z + 53 What is the t'th term of 16826, 68114, 153600, 273290, 427190, 615306, 837644, 1094210? t3 + 17093t*2 + 2t - 270 What is the n'th term of -155150, -155142, -155134, -155126? 8n - 155158 What is the s'th term of 295798, 295415, 295032, 294649, 294266? -383s + 296181 What is the t'th term of 554, 893, 1586, 2813, 4754, 7589, 11498? 30t3 - 3t*2 + 138t + 389 What is the q'th term of 12392, 48327, 84260, 120191, 156120? -q*2 + 35938q - 23545 What is the q'th term of -81528, -164503, -247478? -82975q + 1447 What is the q'th term of -19496, -38590, -57684, -76778? -19094q - 402 What is the i'th term of -70905, -139720, -208535? -68815i - 2090 What is the u'th term of 90378, 361563, 813538, 1446303? 90395u2 - 17 What is the a'th term of -108447373, -216894746, -325342107, -433789450, -542236769? a3 - 108447380a + 6 What is the l'th term of 24951, 49861, 74767, 99669? -2l*2 + 24916l + 37 What is the q'th term of 615, 3753, 11353, 25353, 47691, 80305, 125133? 323q3 + 293q*2 - 2q + 1 What is the c'th term of -92970, -185913, -278832, -371727, -464598, -557445? 12c2 - 92979c - 3 What is the j'th term of -186450, -372019, -557588, -743157, -928726? -185569j - 881 What is the k'th term of -82385, -159410, -236437, -313466, -390497, -467530? -k2 - 77022k - 5362 What is the j'th term of 34649, 69050, 103457, 137870, 172289, 206714, 241145? 3j2 + 34392j + 254 What is the c'th term of -101385483, -101385486, -101385489? -3c - 101385480 What is the a'th term of -366, -839, -1920, -3849, -6866, -11211, -17124, -24845? -40a*3 - 64a*2 - a - 261 What is the g'th term of 996, 3687, 8168, 14439, 22500, 32351? 895g*2 + 6g + 95 What is the a'th term of 3899, 7773, 11609, 15389, 19095, 22709, 26213? -3a3 - a2 + 3898a + 5 What is the j'th term of -2249, -4318, -6383, -8444, -10501? 2j2 - 2075j - 176 What is the o'th term of -180491, -360972, -541447, -721916, -902379, -1082836? 3o2 - 180490o - 4 What is the m'th term of 14300, 32591, 54866, 81125, 111368, 145595, 183806? 1992m2 + 12315m - 7 What is the q'th term of -10176, -20439, -30700, -40959, -51216, -61471? q*2 - 10266q + 89 What is the a'th term of -1357275, -1357264, -1357253, -1357242? 11a - 1357286 What is the t'th term of 8538, 5305, -80, -7617, -17306, -29147? -1076t*2 - 5t + 9619 What is the d'th term of -5825984, -5825994, -5826004, -5826014, -5826024, -5826034? -10d - 5825974 What is the r'th term of -218, -324, -212, 220, 1074, 2452, 4456? 17r*3 + 7r*2 - 246r + 4 What is the s'th term of 51701, 103417, 155131, 206843, 258553, 310261? -s*2 + 51719s - 17 What is the j'th term of 2443, 11168, 25709, 46066? 2908j2 + j - 466 What is the y'th term of -36744, -73476, -110194, -146892, -183564, -220204, -256806, -293364? y3 + y2 - 36742y - 4 What is the o'th term of -20141, -40042, -59943, -79844, -99745, -119646? -19901o - 240 What is the i'th term of -11205, -44721, -100547, -178683, -279129? -11155i*2 - 51i + 1 What is the p'th term of -34864, -139457, -313790, -557875, -871724, -1255349, -1708762, -2231975? -2p3 - 34858p*2 - 5p + 1 What is the p'th term of -17697, -13568, -6687, 2946, 15331, 30468? 1376p2 + p - 19074 What is the r'th term of 993397, 993495, 993665, 993913, 994245, 994667, 995185? r3 + 30r2 + r + 993365 What is the g'th term of 11107863, 22215733, 33323605, 44431479, 55539355, 66647233? g2 + 11107867g - 5 What is the k'th term of -1705299, -1705378, -1705589, -1705998, -1706671? -11k*3 - 2k - 1705286 What is the n'th term of 1520, 5862, 13098, 23228, 36252, 52170, 70982? 1447n2 + n + 72 What is the h'th term of -9108, -9189, -9266, -9339, -9408, -9473? 2h*2 - 87h - 9023 What is the p'th term of 4325, 4333, 4317, 4253, 4117, 3885, 3533? -4p3 + 12p*2 + 4317 What is the k'th term of 61019, 67195, 83957, 116597, 170407, 250679, 362705? 882k3 + k2 - k + 60137 What is the s'th term of -33879, -33888, -33909, -33942, -33987? -6s2 + 9s - 33882 What is the a'th term of 10740, 21736, 32732, 43728, 54724, 65720? 10996a - 256 What is the m'th term of -21463, -85832, -193101, -343258, -536291, -772188, -1050937? 2m*3 - 21462m*2 + 3m - 6 What is the t'th term of -13148784, -26297567, -39446352, -52595139, -65743928? -t*2 - 13148780t - 3 What is the v'th term of -40949501, -81899003, -122848505? -40949502v + 1 What is the u'th term of 15649, 30890, 46131, 61372? 15241u + 408 What is the u'th term of 35898, 36040, 36154, 36234, 36274, 36268, 36210? -u*3 - 8u*2 + 173u + 35734 What is the a'th term of -95248, -190494, -285	{ "pile_set_name": "DM Mathematics" }
in 6n2 - 12n*2 + 2341n*3 + 7n*2 + 15n. 2341n3 + n2 + 15n Collect the terms in -196b - 146b + 370b - 113b. -85b Collect the terms in -37089n*3 - 36907n*3 - 37063n*3 + 111035n*3. -24n*3 Collect the terms in 84 + 175 + 31o*2 + 37. 31o*2 + 296 Collect the terms in -380110w + 1008w2 - 380103w + 760213w. 1008w*2 Collect the terms in 575875o*3 - 287096o*3 - 288827o*3. -48o*3 Collect the terms in 69j*2 + 8j*3 - 12j*3 - 15j*3 + 224j*2 + 327j*2. -19j*3 + 620j*2 Collect the terms in -413t*2 - 10t*2 + 41t*2 + 8t + 3t. -382t*2 + 11t Collect the terms in 408 + 411 - 1222 + 403 + 216s - 397s + 180s. -s Collect the terms in -174x*3 - 45x*2 + 178x*3 - 1501x*2. 4x*3 - 1546x*2 Collect the terms in -104 - 103 + 300 - 16u - 95. -16u - 2 Collect the terms in -204 - 291l + 138l + 394 + 144l + 95. -9l + 285 Collect the terms in 298206 + 298078 - 596284 + 615l*3. 615l*3 Collect the terms in -8942d*2 - 8852d*2 - 8958d*2 + 26384d*2. -368d*2 Collect the terms in 6890p*2 - 106627p*2 + 4580p*2. -95157p*2 Collect the terms in 147214o - 46668o - 36799o + 130182o + 116665o. 310594o Collect the terms in -1395 - 1606 - 1159 - 2s - s2. -s2 - 2s - 4160 Collect the terms in -61665j*3 - 61792j*3 + j + 123557j*3. 100j*3 + j Collect the terms in -3 - 50d*2 + 167d*2 - 124d*2 + 71d*3 + 3. 71d*3 - 7d*2 Collect the terms in 318447d + 83486d + 315445d. 717378d Collect the terms in -4819g*3 + 5348 - 5348 + 28176g*3. 23357g*3 Collect the terms in -3789 - 13n*2 + 799 + 8n*2 - 9n*2. -14n*2 - 2990 Collect the terms in -216630z*3 - 216660z*3 + 649869z*3 - 216667z*3. -88z*3 Collect the terms in -15908370340 + 15908370340 - 23i. -23i Collect the terms in 130u*3 + 0u - 70u2 - 4u*2 + 74u*2 + 0u. 130u3 Collect the terms in -1615 - 26t - 1621 + 3244 - 37t + 80t - 28t. -11t + 8 Collect the terms in -298q3 - 65q*3 - 101q*3 + 5q*3 - 143q*3 - 143q*3. -745q*3 Collect the terms in -4d - d*2 + 48 - 5314d*3 + 0d - 48. -5314d3 - d2 - 4d Collect the terms in 14522z2 + 12849z*2 - 27382z*2. -11z*2 Collect the terms in -5q - 75q - 5q + 54q - 17q + 25q. -23q Collect the terms in -19610k - 17581k + 37176k. -15k Collect the terms in 6796 + 6801 + 6839 - 20436 + 26c2. 26c*2 Collect the terms in 42214359u*3 - 84428681u*3 + 42214377u*3. 55u*3 Collect the terms in -22994f*2 - 28966f*2 - 104 - 29086f*2. -81046f*2 - 104 Collect the terms in 475 - 6304h*2 - 6191h*2 + 12497h*2. 2h*2 + 475 Collect the terms in 3186d*2 - 3878 + 3878 - 3186d*2 - 139d*3. -139d*3 Collect the terms in 27m*2 - 18291m + 36965m - 18674m + 33m2. 60m*2 Collect the terms in 328l*2 - 328l*2 + 814l*3. 814l*3 Collect the terms in 52081m + 60298m - 21887m - 13894m. 76598m Collect the terms in 0d2 - 1299272d - 33d3 - 2d*2 + 1299272d. -33d3 - 2d*2 Collect the terms in 612r + 107 - 131r2 + 101 - 308 + 100. -131r*2 + 612r Collect the terms in 16206c - 5255c - 5370c - 5479c. 102c Collect the terms in -12317593 + 19960k - 153397k + 12317593. -133437k Collect the terms in -12282b - 12125b + 23848b. -559b Collect the terms in 22f - f2 - 106 + 232 + 46f - 6f - 103. -f2 + 62f + 23 Collect the terms in 4644940b2 + 4b*3 - 13934820b*2 + 4644943b*2 + 4644937b*2. 4b*3 Collect the terms in -226m - 156m - 26m. -408m Collect the terms in 30k - 18k2 - 16 - 22k*2 - 9k*2 + 48k2. -k2 + 30k - 16 Collect the terms in 24 - 13a - 31 - 15a + 39a - 13a + 3. -2a - 4 Collect the terms in -340183 - 3s + s + 329708. -2s - 10475 Collect the terms in -126 - 37 - 2o - 1. -2o - 164 Collect the terms in 390m2 - 6m*2 - 60m*2 - 45m*2 - 2m - 131m2 + 6. 148m*2 - 2m + 6 Collect the terms in 1134g + 1135g - 3417g + 1148g + 16g3. 16g*3 Collect the terms in 1893r*2 - 1893r*2 + 114078r*3. 114078r*3 Collect the terms in -50h3 - 43643 + h2 - h*2 + 43643. -50h*3 Collect the terms in -1743985 - 1744008 + 3487993 - 53z. -53z Collect the terms in -54 + 25 + 945606x + 29. 945606x Collect the terms in -600g*2 - 1 + 256g*2 + 612g*3 - 519g*3 + 344g*2. 93g*3 - 1 Collect the terms in -171o + 171o + 40421o*2. 40421o*2 Collect the terms in 1678i*2 + 350i*2 - 2030i*2. -2i*2 Collect the terms in -11838954a - 11838955a + 23677860a. -49a Collect the terms in -9 + 3066s*2 + 2 + 7 + 7753s*2. 10819s*2 Collect the terms in 1549896n + 1549895n + 1549893n - 4649691n. -7n Collect the terms in -12 - 43x2 + 42x2 - 3 - 46 + 68 - 7. -x2 Collect the terms in -45 + m*3 - 26m*2 + 132m*2 + 0m3 + 47. m3 + 106m2 + 2 Collect the terms in 193m + 84m + 94m + 291m. 662m Collect the terms in 21g - 20g + 2 - 2 + 1 + 3746g2. 3746g2 + g + 1 Collect the terms in -6381 + 7891 - 125339 + p + p2. p*2 + p - 123829 Collect the terms in 1687406 - 3374825 + 9u*2 + 1687419. 9u*2 Collect the terms in 285u + 213u - 660u + 235u. 73u Collect the terms in -875a3 - 832a*3 + 2312a*3 - 701a*3. -96a*3 Collect the terms in -39 + 13 + 14 - 24029n + 12. -24029n Collect the terms in 105832 - 317486 + 105827 + 9t*3 + 105827. 9t*3 Collect the terms in -22o*2 + 22o*2 - 12o - 4o + 3o*2 - 5o - 5o2. -2o*2 - 21o Collect the terms in -2079 - 2084 + 4163 - 45371m. -45371m Collect the terms in 195717g - 4g*2 + 9g*2 - 4g2. g2 + 195717g Collect the terms in -13q*3 - 14q*2 - 51q*3 - 66q*3 - 68q*3 + 27q*3. -171q*3 - 14q*2 Collect the terms in 48u*3 + 49u*3 - 188u*3 + 37u*3 + 50u*3. -4u*3 Collect the terms in l - 329l*2 + 2392731191 + 0l - 2392731191. -329l2 + l Collect the terms in 1357k + 1831k + 764k + 2358k - 810k. 5500k Collect the terms in 24922q - 21565q + 114110q. 117467q Collect the terms in 15w + 30 + 17w - 29w - 38 + 9. 3w + 1 Collect the terms in 2 + 323758852t*2 - 2 - 323758856t*2. -4t*2 Collect the terms in -526626k*2 + 167k - 897759k2 - 167k. -1424385k2 Collect the terms in -i2 + 11 + 14i*2 - 99i - 18i. 13i*2 - 117i + 11 Collect the terms in 74359x3 - 6x - 148718x3 + 74357x*3 + 3x + 3x. -2x*3 Collect the terms in 2332j - 5j3 - 6918j + 2256j + 2331j. -5j3 + j Collect the terms in 407p - 1015p - 4p*3 + 501p + 107p. -4p*3 Collect the terms in 2 - 1475559p*2 - 94p*3 + 1475559p*2. -94p*3 + 2 Collect the terms in -11427445255m*3 + 11427445253m*3 + 0m*2 + 0m*2. -2m*3 Collect the terms in 7304d*3 - 2853d*3 - 102d - 4466d3 + 102d. -15d3 Collect the terms in -1680 - 13g*2 - 17g + 4g - 568. -13g*2 - 13g - 2248 Collect the terms in 764m + 635m + 256m - 634 + 32m. 1687m - 634 Collect the terms in -1178w + 3559w - 1190w - 1187w - 18. 4w - 18 Collect the terms in -17568y2 + 7008y*2 + 28581y*2 + 67241y*2. 85262y*2 Collect the terms in 32r + 44r + 398r*2 + 1248r*2. 1646r*2 + 76r Collect the terms in 820f3 - 2437f*3 + 1681 + 814f*3 + 804f3. f3 + 1681 Collect the terms in -1914y + 1166y + 2626y - 1881y. -3y Collect the terms in 65578 - 139d*2 - 1304d + 1304d + 142d*2. 3d*2 + 65578 Collect the terms in 1894h*2 - 3195h*2 - 7140h*2 + 1440h*2 - 5273h*2. -12274h*2 Collect the terms in 1005497t + 917155t + 476658t - 247948t. 2151362t Collect the terms in -5675677f2 + 2837843f*2 + 2837844f*2. 10f*2 Collect the terms in 22356150l*2 + 743l*3 - 22356150l*2. 743l*3 Collect the terms in 70 - 227 + 78 + 13602l*3 + 79. 13602l*3 Collect the terms in -785 + 378j - 4j2 - 188j - 184j. -4j*2 + 6j - 785 Collect the terms in 93806 + 93811 + 2x - 187617 - 984x*2. -984x*2 + 2x Collect the terms in 30037 + 2a3 + 30160 - 60197. 2a*3 Collect the terms in -36016b + 72385b - 36294b. 75b Collect the terms in -206j - 203j + 10j*3 + 20j*3 + 416j. 30j3 + 7j Collect the terms in -44 + 161x - 2x*3 - 49x - 51x - 56x. -2x3 + 5x - 44 Collect the terms in -144a3 + 29a*3 - 753a**3	{ "pile_set_name": "DM Mathematics" }
/(sqrt(45)/(sqrt(18)/sqrt(2)))). 4sqrt(3) Simplify ((1sqrt(495)-4 - sqrt(495))/(sqrt(81)-4))/((sqrt(3520) + (sqrt(3520) - 2sqrt(3520)) + sqrt(3520))/(sqrt(140)/sqrt(7))). 5sqrt(5)/48 Simplify (2 + (sqrt(11)-2 + -1)2 + 1 - (2sqrt(704) + 0 + (sqrt(198)/(sqrt(9) + sqrt(27)/sqrt(3)))/sqrt(2)))2. -41sqrt(11) + 18495/4 Simplify -1 + -4(-4(0 + sqrt(405) + 4) + -5). 83 + 144sqrt(5) Simplify (3(sqrt(80) + (sqrt(80) - (22sqrt(80))*2) + sqrt(80)) - (sqrt(20)/(((sqrt(44) - sqrt(44)4) + sqrt(44))/sqrt(11)))*2-2)3. -23025/2 + 108sqrt(5) Simplify -5(((4sqrt(704)-2 - sqrt(704) - sqrt(704)) + 4(2 + sqrt(704)))-3 + -3 + -5)2. -1145600 + 46080sqrt(11) Simplify -4(sqrt(22)-3-35)/(sqrt(176)/sqrt(4) - sqrt(704)). 30sqrt(2) Simplify ((14(-5 + 0 + sqrt(252) + sqrt(252) - 4(sqrt(252) + (sqrt(252) - -1sqrt(252)))) + -1)-3 + -5)*2. 83520sqrt(7) + 3632164 Simplify -2(0 + sqrt(833))5 - (4-1(sqrt(833) + -5))*2. -13728 + 1050sqrt(17) Simplify ((sqrt(21) + sqrt(105)/sqrt(5)5)/(sqrt(77)/(1sqrt(11))))*2 + (sqrt(18) + -1sqrt(1458))/(sqrt(30)/sqrt(5)-4). 2sqrt(3) + 108 Simplify -6sqrt(304)4 - (sqrt(304) + (sqrt(304) - (-2 + -2sqrt(304)) - sqrt(304))) - (4sqrt(304)-16 + 3). -12sqrt(19) - 5 Simplify ((6(2sqrt(144) - sqrt(144)))/(sqrt(27)/sqrt(3)2))/(4sqrt(968) - sqrt(968) - (4sqrt(88))/sqrt(11)). 3sqrt(2)/29 Simplify ((sqrt(300) - (sqrt(300) - (sqrt(300) + 2sqrt(300))))-3)/(sqrt(6) + 2sqrt(96) - 1sqrt(6)1). -45sqrt(2)/8 Simplify -2(-1 + -2sqrt(176)-1 - (1 + -1sqrt(176)-1))*2 + -3. -363 + 32sqrt(11) Simplify (-3(6(sqrt(560) + sqrt(35)) - (sqrt(280)1 + sqrt(280))/sqrt(8)))/(3(sqrt(1008)2 + sqrt(7) + sqrt(7) + -6sqrt(35)/sqrt(5))). -7sqrt(5)/5 Simplify ((sqrt(64) + sqrt(4))3)/(sqrt(4)/sqrt(2)-6) + (sqrt(350) - (1sqrt(350) - sqrt(350))2)/sqrt(7). 5sqrt(2)/2 Simplify -2(6(4 + 0 + sqrt(1053)) + 4 + (2(sqrt(1053) + -2))2). -8512 + 180sqrt(13) Simplify (-5 + ((1sqrt(252))2 + 2 - ((1 + sqrt(252))2 + sqrt(252) + -5) - (sqrt(252) - ((sqrt(252) + 1)4)*2 - 41sqrt(252)))4)1. 768sqrt(7) + 16211 Simplify ((-5-41sqrt(320) - (-2 + -1 + sqrt(320) + 2)) + 2)2. 912sqrt(5) + 115529 Simplify (-3 + -5(sqrt(637) + 1) + -2(sqrt(637) - (sqrt(637) + 0)) + (sqrt(637) - -1sqrt(637)1 - sqrt(637)) + 3 + 3)*2. 112sqrt(13) + 10196 Simplify (-25((sqrt(1900) - (-4 + sqrt(1900) + 0 + sqrt(1900) - sqrt(1900)))-6 + 1 + (sqrt(1900) - ((-1 + sqrt(1900))6 + sqrt(1900))))-1)2. 204000sqrt(19) + 6868900 Simplify ((sqrt(77)/sqrt(396) - sqrt(49)/(-4sqrt(7)))2 + -2(sqrt(63) + sqrt(63) + 3sqrt(7623))/sqrt(9))-3. -175/48 + 210sqrt(7) Simplify 1(-4 + -5 + (sqrt(70)/(sqrt(110)/(-2sqrt(11))) + (sqrt(77)/(sqrt(11) - -3sqrt(44)/sqrt(4)))*2)-3). -165/16 + 6sqrt(7) Simplify sqrt(19)1 + 0 + (sqrt(931) + sqrt(931)-2 + sqrt(931))2 + 2 + 1(-2sqrt(1900)2 + 5)*2. -399sqrt(19) + 30427 Simplify -4-4(sqrt(180) - 2(sqrt(180) + 4)2 - (4sqrt(45)1)/sqrt(9)). -6272 - 1504sqrt(5) Simplify (-12(sqrt(1331)-1 + 3)-43-3)*2. -342144sqrt(11) + 6946560 Simplify ((-4sqrt(117)-5 - sqrt(117))-2)/((-3sqrt(1089) + sqrt(1089) + sqrt(1089))-3). -38sqrt(13)/33 Simplify (((3sqrt(128) + -5 + ((sqrt(128) + -3 + sqrt(128))2 - sqrt(128)))-5)2 + -2 + -1)-1. -118222 + 26400sqrt(2) Simplify (-6(-4 + 1(sqrt(1053) + sqrt(1053)1) - (3 + sqrt(1053)1 - sqrt(1053) - (sqrt(1053) + -1 + 0)))-6)*2. -559872sqrt(13) + 12365136 Simplify (sqrt(78) + sqrt(78)-36)/(sqrt(30)/sqrt(5)-6) + (5sqrt(208)-1 + sqrt(208) - (sqrt(208) + -1 + sqrt(208) + -5 + sqrt(208) + sqrt(208)))2 + 4. -2287sqrt(13)/6 + 13352 Simplify -5 + (23sqrt(204) - (sqrt(204) + (sqrt(204) - sqrt(204)-2))-1)/((sqrt(432) + (sqrt(192) + sqrt(192)-2 - sqrt(12)))-6). -5sqrt(17)/3 - 5 Simplify -3 + -5((4 + sqrt(612) + 1)*2 + sqrt(612) + 1 + 2 + 0). -3203 - 330sqrt(17) Simplify -4 + 4 + (sqrt(44)-5 - (-1sqrt(11) + -5)*2) + (1 + 1(-1 + sqrt(11)))6. -14sqrt(11) - 36 Simplify (-6-5-4-2sqrt(1573)-13-4 + 0)2. 13047091200 Simplify (-5 + (sqrt(432)2 + 2 - sqrt(432)) + -1 + (sqrt(432) - (sqrt(432) + 0)) + 1 + (sqrt(432) + 0 - sqrt(432))-5 + 2)2. -24sqrt(3) + 433 Simplify (-1 + (sqrt(9072)-1 + 4)2 + (6sqrt(9072)2 + sqrt(9072) + sqrt(9072) + sqrt(9072) + -4(-1 + sqrt(9072) - sqrt(9072)))*2)-5. -10251515 - 20160sqrt(7) Simplify (-3 + sqrt(637))2 + sqrt(39)/(sqrt(9)/sqrt(3)) - ((sqrt(13) + sqrt(13)-14)2 - ((2sqrt(117))/sqrt(9))*2). -41sqrt(13) + 581 Simplify 1(-4 + 3 + (1(sqrt(2299) + -1sqrt(2299)) + (-3 + (1 + sqrt(2299) - sqrt(2299)) - sqrt(2299)))2 + -3). 44sqrt(19) + 2299 Simplify 3 + (1 + -5 + sqrt(500) + -1 + (sqrt(45) + 1 - 4sqrt(500)))2. 216sqrt(5) + 3664 Simplify 5(-4-1sqrt(78) - sqrt(78) - (sqrt(78) - ((sqrt(78) - (sqrt(78) + 2sqrt(78)))-4 + sqrt(78) - sqrt(78))))/((1sqrt(24)-2)/(sqrt(40)/sqrt(90))). -25sqrt(13)/3 Simplify (sqrt(209)-2-444)/(sqrt(1100)-2 + sqrt(11) - (sqrt(11) - (sqrt(44)/sqrt(4)-3 - sqrt(11)))). -16sqrt(19)/3 Simplify (sqrt(1694)-5)/(sqrt(14)/sqrt(7)1) + 0 + 2. -55sqrt(7) + 2 Simplify -1 + (sqrt(180) - (sqrt(180) - 2-3sqrt(180)))/(sqrt(4) - (sqrt(324) - sqrt(324)-1))3. -1 + 54sqrt(5)/17 Simplify (((sqrt(3240) - sqrt(3240)-1) + (sqrt(200)/sqrt(5) + sqrt(40))-5)/(sqrt(128) + sqrt(128)-2 + -4(sqrt(8) - sqrt(200))))2. 20/9 Simplify (2((-6sqrt(132)-1)/sqrt(11))/(sqrt(384)-1-1) + 5)*2. 15sqrt(2) + 59/2 Simplify (sqrt(441)1 + sqrt(9))/(sqrt(243)-2) + 1(sqrt(120)/(1sqrt(10)))/(sqrt(32)/(sqrt(128) - sqrt(8)) + sqrt(4)). 11sqrt(3)/36 Simplify -5(sqrt(104) - (sqrt(104) + 52sqrt(104)))/(sqrt(512) - sqrt(8)) - (sqrt(130) - (-34sqrt(130) - sqrt(130)))/((sqrt(400)/sqrt(8))/sqrt(5)). -48sqrt(13)/7 Simplify 6-6(-1 + sqrt(76))-3 - (-3-2sqrt(171))/(-5sqrt(36)/sqrt(4) - sqrt(9))-1. -108 + 215sqrt(19) Simplify (((sqrt(119) + (sqrt(119) - -6sqrt(119)-4))/(sqrt(1008)/sqrt(9)) + 5)-2)*2. -220sqrt(17) + 2157 Simplify (1 + (4(sqrt(300) + sqrt(300) + sqrt(300)-2 + sqrt(300)) + sqrt(300) - -4-2sqrt(300)) + 1 + (sqrt(300) - (sqrt(300)-2 - sqrt(300))5) + -1)*2. 260sqrt(3) + 50701 Simplify 3-6-2sqrt(980) + -5 + (-1sqrt(135) + sqrt(135))/sqrt(3) + -5. -10 + 504sqrt(5) Simplify (-1 + -3sqrt(2448)2)2-2 + (-3(sqrt(2448)-1 + sqrt(2448) - sqrt(2448) - sqrt(2448)))*2 + 4(0 + sqrt(2448)) + 2. -88128 - 240sqrt(17) Simplify -6(4 + -3-2sqrt(448) + (1(1 + sqrt(448)) + (sqrt(448) - (sqrt(448) + 0 + 2) - sqrt(448)) + sqrt(448))2 + 3). -2736 - 192sqrt(7) Simplify (-1(3 + (2sqrt(833) - sqrt(833))) + 0 - 1(sqrt(833) + 0 + 4)2)*2. 462sqrt(17) + 7618 Simplify (-5-2((sqrt(700) - (sqrt(700) + 0))-1 - sqrt(700) - sqrt(700)))2 - ((1 + -3sqrt(7) - (sqrt(112) + 2sqrt(112))) + 0)2. 30sqrt(7) + 278424 Simplify 1 + -2 + ((sqrt(1008)-2 - sqrt(1008))6)/((6sqrt(128) + sqrt(32))/sqrt(8)). -108sqrt(7)/13 - 1 Simplify -3 + ((sqrt(171) - -6sqrt(171)3)4)/((sqrt(9) - sqrt(9)2-3)3). -3 + 76sqrt(19)/21 Simplify -5(((3sqrt(16))/sqrt(8)-3)*2-2 - 3(-5 + (sqrt(2) - -4sqrt(98)))). 435sqrt(2) + 1545 Simplify (-2((sqrt(1331) - (-2 + sqrt(1331)2 - sqrt(1331)))-2 + -1 + sqrt(110)/(sqrt(10)2) + -4))2. -36sqrt(11) + 335 Simplify -5 + (sqrt(52) - (sqrt(520) + 1sqrt(520) + sqrt(520) + sqrt(520) - sqrt(520))/sqrt(10))/sqrt(4) - (((-3 + sqrt(13)-1)*2 - sqrt(104)/sqrt(2)) + -2). -25 - 6sqrt(13) Simplify -2 + (3(sqrt(704) + (sqrt(704) - -3sqrt(704)1 - sqrt(704))))2 + -2 + 3(-3 + sqrt(704)) + sqrt(704) + sqrt(704) + 2 + 1. 40sqrt(11) + 101366 Simplify (-2 + -3 + -4(0 + (sqrt(605) - sqrt(605)3)) + ((sqrt(605) + -1)6 - (-1 + sqrt(605)2)))2. -2640sqrt(5) + 87220 Simplify 3 + 2 + (3sqrt(875))/(sqrt(56)/(sqrt(56)/sqrt(7))). 5 + 15sqrt(5) Simplify (-2sqrt(108))/(1sqrt(96)) + (2 + sqrt(242) + 2 + sqrt(242) - (4 + (sqrt(242) + 0 - sqrt(242)))). 41sqrt(2)/2 Simplify -3((-5-5sqrt(960) - sqrt(960))/((sqrt(15) - (sqrt(105)/sqrt(7) - sqrt(15))3)/sqrt(5)))2. -552960 Simplify 3 + -2 + (sqrt(396) + 0 + sqrt(396))2 + -1 + (-4-1sqrt(176))2-6 + 4. -15308 Simplify -1(((6sqrt(133)-3 - sqrt(133) - sqrt(133))/(sqrt(112)4))*25 + 0). -2375/16 Simplify -4((2 + sqrt(176) + -4 + -5 - ((sqrt(176)-2 -	{ "pile_set_name": "DM Mathematics" }
-24 = -3s + y. Let i be v(s). What is i rounded to the nearest ten? 50 Let m = 8.8 - 9.496. What is m rounded to one dp? -0.7 Let v(x) = -10743x*2 + 8x - 9. Let l = -45 + 34. Let g be v(l). Round g to the nearest one million. -1000000 Let u = -3.11 + -0.69. Let m = u - -3.8000587. Round m to five decimal places. 0.00006 Let f = 2410.00001689 + -2410. Round f to six decimal places. 0.000017 Suppose 7a - 11a = -32. Suppose ai = -512133 + 8352133. What is i rounded to the nearest 100000? 1000000 Let h be -71 + 66 + (-1 + -1620000)-5. What is h rounded to the nearest 100000? 8100000 Let f be (0/3)/(4 + -2). Suppose -3r + o + 3o + 17460016 = 0, f = 3r - 5o - 17460020. Suppose 4g - r = 6g. Round g to the nearest one hundred thousand. -2900000 Let w = 0.031 - 0.0310393. Round w to six decimal places. -0.000039 Let g(f) = -662f2 - 3f + 4. Let b be g(2). Round b to the nearest 100. -2700 Let s = 0.54 + -0.658. Let d = s + 4.292. Let w = 4.1 - d. Round w to two dps. -0.07 Let n = 0.59899487 + -0.599. Round n to seven decimal places. -0.0000051 Let h = 28241237.99911 + -28241105. Let w = h + -133. What is w rounded to 4 decimal places? -0.0009 Let m = -3.52 - -2.1. Let c = 1.41999952 + m. What is c rounded to 7 dps? -0.0000005 Let m = 308.68 + -326. Round m to one decimal place. -17.3 Let o = 33997370.0200238 + -33997373. Let c = 2.02 + 0.96. Let x = o + c. Round x to six dps. 0.000024 Let b = 1.5024 + -1.5. Let g = b - 0.7414. Let p = g - -0.069. What is p rounded to 1 decimal place? -0.7 Let z = -7432.006141 + 7432. What is z rounded to three dps? -0.006 Let t be (-8377002)/1806 - 3/(-7). Round t to the nearest one hundred. -4600 Let q = -233.89998288 + 233.9. What is q rounded to 6 decimal places? 0.000017 Let t = -371 + 370.99999821. Round t to seven decimal places. -0.0000018 Suppose 5q + 6 = -l - 12, 4l - 12 = q. Let b be 4(-5)/l + 4. Let r be -75((-218)/b - 3). What is r rounded to the nearest 1000? -3000 Let b = -773.035 + 772. Round b to 1 decimal place. -1 Let l be ((-2)/(-4))/1 - (-53699)/2. Suppose -f + 6f + l = 0. Round f to the nearest 1000. -5000 Let i = 28.4 + -5.4. Let m = i - 25.2. What is m rounded to the nearest integer? -2 Let v = -1.44 - -79.44. Let h = v + -78.0066. Round h to 3 decimal places. -0.007 Suppose -8u - u - 180000 = 0. Round u to the nearest one hundred thousand. 0 Suppose 3y - 4111992 = -0y. Let r = y - -259336. Round r to the nearest one hundred thousand. 1600000 Let l(k) be the third derivative of 1/24k4 + 0k - 1/3k3 + 0 + 5875/3k*5 + 2k*2. Let v be l(2). What is v rounded to the nearest 100000? 500000 Let r = -2270 + 2270.01007. Round r to three decimal places. 0.01 Let j = 516 + -516.0273. Let i = j - -0.026. Round i to three dps. -0.001 Let u = -226 + 30. Let j = u - -199.84. Let g = j + 0.06. Round g to the nearest integer. 4 Let t = -113 + 72. Let w = 41.000076 + t. Round w to 5 decimal places. 0.00008 Let b = -1778.8721649 + 1679.87216. Let j = -99 - b. Round j to 6 dps. 0.000005 Let j(y) = 3551y*2 - 15y - 4. Let s be j(-7). Round s to the nearest ten thousand. 170000 Let h = 19.5899 + 0.4341. Let w = 3.6 + 16.4. Let l = h - w. What is l rounded to three decimal places? 0.024 Suppose 794528 = -2c + 4c. Let h = -282736 - c. What is h rounded to the nearest 100000? -700000 Let f = -9007.75 + -484.85. Let l = f - -9492.4599904. Let w = -0.14 - l. What is w rounded to six dps? 0.00001 Let l = -376 + 582. Let o = 205.999638 - l. What is o rounded to 5 decimal places? -0.00036 Let p = -234329.0253354 - -234329. Let a = 0.2253346 + p. Let h = a + -0.2. What is h rounded to six decimal places? -0.000001 Let h = -8198 + 72597. Let v = 2934835 - h. Suppose -v = -5z + 179564. Round z to the nearest 100000. 600000 Let i = -1963833.22 + 1963843.21999868. Let d = i + -10. What is d rounded to seven dps? -0.0000013 Suppose 5h = 231 + 84. Let w be 8/(-14)h/(-18). Let y be 11000002/2 - w/2. Round y to the nearest 1000000. 6000000 Let u be 9600018/4 - (-4)/(-8). Suppose -q + 2 = -1. Suppose -u = -5i - a - a, -qi - 2a + 1440004 = 0. Round i to the nearest one hundred thousand. 500000 Let t = 1.781 + -3.178. What is t rounded to 1 decimal place? -1.4 Let t = 68 + -68.00000524. Round t to 7 dps. -0.0000052 Let m be 4550/(-21)-375(-312)/5. What is m rounded to the nearest 100000? -5100000 Let i = -505.0871 + 505. Let c = 8.6771 + i. What is c rounded to 0 dps? 9 Suppose 4 = -4t, -2h - t + 39 = -6t. Let c = 23 - h. Suppose 0f - 90000 = cf. Round f to the nearest 10000. -20000 Suppose 0f - 41 = 4a + 5f, -2a + 4f - 14 = 0. Let w be 13((-177)/a + (-3)/(-9)). What is w rounded to the nearest ten? 260 Let j = -919181 + 919188.000002. Let v = -0.09 - 6.91. Let x = v + j. What is x rounded to six decimal places? 0.000002 Let i = -94.65 - 1.35. Let w = -96.0063 - i. Round w to 3 dps. -0.006 Let f be (-4 + 29)/(3/7560). Suppose 0 = -4s + 3s - f. Round s to the nearest 10000. -60000 Let x = -302 - -300.7. Let l = 0.13574 + 1.1642576. Let v = l + x. Round v to six decimal places. -0.000002 Let w = 24.553 + -0.053. What is w rounded to the nearest ten? 20 Let j(b) be the first derivative of 2b*3/3 + 2b*2 + 9b - 11. Let l be j(-3). Let m be (l + 7985)(-2825)/2. Round m to the nearest one million. -11000000 Let d = -0.50402544 - -0.504. What is d rounded to five decimal places? -0.00003 Let s = 61.59 + -61.56343. Round s to 3 decimal places. 0.027 Let n be 1498560/(-720)(0 - 75). What is n rounded to the nearest 100000? 200000 Let n = -9.066 - -0.056. Let b = 0.01 + n. Let s = b - -8.93. What is s rounded to one dp? -0.1 Let z = -12907538318 - -12907552592.7616124. Let f = z + -14225.7616. Let l = 49 - f. What is l rounded to six decimal places? -0.000012 Let m = 2.8385 - 2.8. Let f = m - 0.036. Round f to 3 decimal places. 0.003 Let p = -35.5 + 35.49999756. What is p rounded to seven decimal places? -0.0000024 Suppose 0 = 12o - 7o - 20. Suppose 8r = 3r + k - 3300000, 0 = -3r + ok - 1980000. What is r rounded to the nearest 100000? -700000 Let s = -41.91 + 40.3. Let t = s - -4.3. Let i = -2.690361 + t. Round i to five dps. -0.00036 Let p(u) = 1249802u - 12. Let t be p(3). Suppose 1621522 = -2j - 2997266. Let v = t + j. Round v to the nearest 100000. 1400000 Suppose -76864 = -2p + 37610. Let h = p + -89237. What is h rounded to the nearest ten thousand? -30000 Suppose 0o + 4o - 20 = 0. Suppose -g + t = 2, g + 7 = og - t. Let c be (-3)/(-1) - -2460000 - g. Round c to the nearest 100000. 2500000 Suppose -14z - 32540697 = 8759303. What is z rounded to the nearest 1000000? -3000000 Let y = 9 + -7.6. Let m = y - -0.2. Let a = m - 1.552. What is a rounded to 2 decimal places? 0.05 Let g(f) = 3f*2 - 62f - 37. Let w be g(16). Round w to the nearest one hundred. -300 Let v = -4612 + 4631.935. Round v to 0 dps. 20 Let d(y) = y*3 + 14y*2 + 25. Let g be d(-14). Let h be ((-30)/g)/((-4)/(-6000000)). What is h rounded to the nearest 100000? -1800000 Let r = -350554084533946.74999955 - -350554076880585. Let q = r + 7653362. Let l = q - 0.25. Round l to seven dps. 0.0000005 Suppose 455915 = -60a + 67295. Round a to the nearest 100. -6500 Suppose 5r - 66228 = 9533772. What is r rounded to the nearest one hundred thousand? 1900000 Let p = -130 - -69. Let g = p + 61.0063. Round g to three dps. 0.006 Let z be (3 - -52 - 0) + 1 + -3. Suppose z = n + s - 587, -n + 648 = 3s. What is n rounded to the nearest ten? 640 Let x = 13949245757 + -20873127878. Let l = 6923882164.00000049 + x. Let g = -43 + l. Round g to 7 decimal places. 0.0000005 Let v(d) be the third derivative of 15d6/8 + d5/15 - d4/4 + 5d*3/6 - 3d*2. Let b be v(5). What is b rounded to the nearest 1000? 28000 Let d = 89 + -141. Let h = 24 + d. Let t = -28.063 - h. What is t rounded to two decimal places? -0.06 Let y = 249 + -250.028. What is y rounded to one dp? -1 Suppose -39b + 3b = -39744000. What is b rounded to the nearest ten thousand? 1100000 Let i = -255354 - -255331.0158. Let w = 23 + i. Round w to three decimal places. 0.016 Let s = -2014.01307 - -2014. Round s to three dps. -0.013 Let o = -0.28599514 + 0.286. Round o to six decimal places. 0.000005 Let y(g) = -14g - 60. Let x be y(-4). Le	{ "pile_set_name": "DM Mathematics" }
3 - 2 Let h(k) = -k*2 - 4k - 4. Let l = 1199 + -1201. Let p(y) = 4y2 + 13y + 12. Give lp(n) - 7h(n). -n*2 + 2n + 4 Let a(k) = -2k2 - 86k - 50. Let p(y) = y*2 + y + 12. Determine -a(l) - 4p(l). -2l2 + 82l + 2 Let i(k) = -14k2 + 26k - 20. Suppose -19h - 6512 = 138. Let r = -344 - h. Let d(o) = -5o*2 + 9o - 7. What is ri(y) - 17d(y)? y*2 + 3y - 1 Let l(u) = 1. Suppose 90 = -25j - 35. Let t(b) = -b3 + 9b*2 + 5b - 5. Let h(x) = jl(x) - t(x). Let m(p) = p3 - 4p*2 - 2p. What is -2h(k) + 5m(k)? 3k3 - 2k*2 Let j(z) = 43z*2 + 4z - 129. Let i(r) = -21r2 - 2r + 71. Calculate 9i(d) + 5j(d). 26d2 + 2d - 6 Suppose -2j = 5l + 9 - 33, l - 2j = 0. Suppose 3m + lf = 14 - 8, -3m + 4f = -30. Let a(v) = 15v + 1. Let d(c) = 8c. Determine ma(y) - 11d(y). 2y + 6 Let a(h) = 2h2 + 2h + 2. Let r(x) = -165x2 + 14x + 25. Determine 7a(b) - r(b). 179b*2 - 11 Suppose 6 = g, 4g - 32 = -4r - 36. Let k(u) = u2 - 4u - 7. Let y(t) = -t*2 + 5t + 8. What is rk(m) - 6y(m)? -m*2 - 2m + 1 Let s(b) = 169b2 - 32b + 26. Let z(q) = -101q2 + 19q - 15. Give 7s(v) + 12z(v). -29v2 + 4v + 2 Let u(g) = 2g2 - 106g - 23. Let c(s) = 2s2 - 119s - 22. Give -5c(f) + 6u(f). 2f2 - 41f - 28 Let d(t) = -t*3 - t + 2. Let i(u) = -1633u*3 - 213u + 426. Calculate -213d(n) + i(n). -1420n*3 Let a(t) = -9t*3 + 7t*2 + 15t + 4. Let c(v) = -7v3 + 9v*2 + 14v + 3. Calculate 3a(o) - 4c(o). o*3 - 15o*2 - 11o Let v(g) = 2g2 + g - 2. Let b(a) = -74a*2 - 9a + 51. Give -b(f) - 8v(f). 58f*2 + f - 35 Let j(r) = -7785r*3 + 2422r*2 - 1211r. Let y(q) = -2q2 + q. Determine -2j(s) - 2422y(s). 15570s3 Let k(r) = -r3 - r*2 + 5r - 1. Let z(c) = 24c2 - 9c + 4. Let m(w) = 19w2 - 7w + 3. Let d(q) = -5m(q) + 4z(q). Give d(p) + k(p). -p*3 + 4p Let t(b) = -7b - 6. Let x(p) = p + 1. Let o = -77 - -81. Let n(a) = -2a*3 + 6a*2 + 8a + 5. Let r be n(o). What is rx(g) + t(g)? -2g - 1 Let y = -2228 + 2226. Let h(v) = -6v2 + 2. Let d(k) be the second derivative of -7k4/12 + k2/2 - 4k. Determine yh(i) + 3d(i). -9i*2 - 1 Let c(h) = 5 - 4h - 47h2 + h3 + 22h*2 + 25h*2. Suppose 4s + 78 = 6s. Let k = -32 + s. Let y(p) = 2p*3 - 7p + 9. What is kc(d) - 4y(d)? -d*3 - 1 Let v(l) = 160l*3 - 28l*2 + 28. Let k(w) = 99w*2 - 14w*3 - 94w*2 - 15w*3 - 5. What is -28k(p) - 5v(p)? 12p*3 Let o(x) = -4x*3 - 2x*2. Let b be (6/(-12))/((-3)/(-78)) + 15. Let h(c) = -3c3 - c3 + 0c3 - 3c*2. Determine bh(q) - 3o(q). 4q*3 Let r(k) = 854k + 6836. Let u be r(-8). Let a(l) = 3l3 - 7l*2 + 31l - 7. Let z(y) = 2y3 - 4y*2 + 16y - 4. Calculate ua(n) - 7z(n). -2n3 + 12n Let g(l) = 452l - 152l + 40l2 - 152l - 152l. Let r(y) = 40y*2 - 5y. Calculate 5g(a) - 4r(a). 40a2 Suppose 29q - 1824 = 10q. Suppose -98 = j - q. Let l(h) = -6h. Let b(m) = -m*2 - 13m - 1. What is jb(n) + 5l(n)? 2n2 - 4n + 2 Let o(d) = -1. Let m = -2202 + 2200. Let q(y) = 9y - 2. Give mo(z) + q(z). 9z Let y be 2/25 - (31556/(-350))/23. Let o(k) = 2k*3 - 4k*2 - 4k - 11. Let n(g) = -4g3 + 7g*2 + 7g + 21. Calculate yn(l) + 7o(l). -2l3 + 7 Let u(w) = -8w*2 - 1016w + 15. Let l(b) = -2b2 - 338b + 4. What is 7l(r) - 2u(r)? 2r2 - 334r - 2 Let j(h) = -h + 3. Let x(p) = 6p - 2411. What is -4j(c) - x(c)? -2c + 2399 Let j(a) = -a2 - 9a + 28. Let k = 10855 + -10857. Let m(i) = 2i - 7. What is kj(g) - 9m(g)? 2g*2 + 7 Let t(b) = -870b - 22. Let s(c) = 1743c + 40. Calculate -6s(i) - 11t(i). -888i + 2 Let b(m) = 24m3 + 11m*2 + 10m + 1. Let l = 268 - 270. Let h(v) be the first derivative of -5v4/4 - 2v3/3 - v2 - 48. Determine lb(f) - 11h(f). 7f3 + 2f - 2 Let g = -115 + 90. Let r be (-5)/(-2)70/g. Let i(k) = -19k. Let z(j) = -28j. Calculate ri(s) + 5z(s). -7s Let x(v) = 3v + 10. Let g(u) = 2u*2 - 11u - 43. Let b(w) = 2g(w) + 9x(w). Let t(j) = -8j2 - 10j - 7. Determine -11b(y) - 6t(y). 4y2 + 5y - 2 Let x(n) = -4342n2 + 338n + 169. Let u(j) = 155j2 - 12j - 6. What is -169u(t) - 6x(t)? -143t2 Let x(c) = 3c*2 + 4c - 8. Let a(q) = 5q2 + 9q - 4. What is 2a(d) - 5x(d)? -5d2 - 2d + 32 Suppose 67h = 71h + 16. Let f(s) = s*2 - 2s - 2. Let v(k) be the second derivative of -1/2k3 + 0 + 1/12k*4 + 8k - 3/2k2. Determine hv(j) + 6f(j). 2j2 Let y(r) = r3 - 2r + 13. Let j(p) = 2p*3 - 6p*2 - 21p - 7. Let s be j(-2). Let x(o) = 2o3 + o2 - 5o + 27. Give sy(d) + 2x(d). -d*3 + 2d*2 - 11 Let f(n) = 0n - 2 - 17n - 1 + 16n - 13n - 6n*2. Let y = -275 - -269. Let x(i) = -2i*2 - 5i - 1. Calculate yf(l) + 17x(l). 2l2 - l + 1 Let j(f) = 9f3 + f2 + f + 10. Let l(o) = -10o3 - o2 - o - 12. What is 6j(r) + 5l(r)? 4r3 + r2 + r Suppose -34 - 14 = -6g. Let f(y) = 5y - 14. Let h(w) = 6w + 5. Let o(d) = 8d + 8. Let x(s) = 7h(s) - 5o(s). Give gx(u) - 3f(u). u + 2 Let f(p) = -3p2 + 2p. Suppose 3y - 4d + 198 = 148, 0 = 4y + 3d + 150. Let g(u) = -u - 21u2 + 6u + 10u. Calculate yf(j) + 4g(j). 6j*2 Let t(n) = -125n*2 - 21n + 3. Let m(b) = 53b2 + 11b - 2. Calculate 7m(q) + 3t(q). -4q2 + 14q - 5 Let i(q) = -8q + 28. Let s = -4 + 2. Let p be (56/1)/s1. Let d(u) be the third derivative of -u4/24 + u3/2 - 6u2 + 5u + 11. Determine pd(o) + 3i(o). 4o Let c(t) = -2t*3 + 4t*2 - 4t - 6. Let u(w) = -83 - 3w2 + 0w*3 + 2w*3 + 3w - 92 + 180. Determine -3c(r) - 4u(r). -2r3 - 2 Let j(i) = -2i2. Let f(z) = -z2. Let a = 941 + -933. Determine af(c) - 3j(c). -2c2 Let i(v) = 5v*3 - 1077v*2 + 3. Let p(b) = -28b*3 + 6461b*2 - 17. Determine 17i(r) + 3p(r). r3 + 1074r*2 Let q(m) = -2m*2 + m - 7. Let s(h) = -11h*2 + 13h - 52. Let b(l) = 5l2 - 6l + 24. Let w(z) = 13b(z) + 6s(z). What is q(a) - 3w(a)? a2 + a - 7 Let x(i) = 35i*3 - 14i*2 + 7i + 201. Let w(t) = -12t3 + 4t*2 - 2t - 67. Give 7w(s) + 2x(s). -14s3 - 67 Let y(g) = -4g - 961. Let j(h) = -2h + 18. Calculate 3j(t) - y(t). -2t + 1015 Let m be ((-36)/60)/(126/(-210)). Let i(n) = 55n*3 + 4n + 4. Let w(g) = g*3 - g - 1. Calculate mi(k) + 4w(k). 59k*3 Let y(g) = -7g*3 + 11g*2 + 2g + 83. Let p(k) = 9k3 - 14k*2 - 3k - 84. What is 5p(s) + 6y(s)? 3s3 - 4s*2 - 3s + 78 Let o(a) = -7a3 + 8a*2 - 2a + 18. Let f be o(5). Let s = 669 + f. Let q(y) = 3y3 + y2 - 2y - 5. Let r(n) = n*3 - n - 2. Give sq(v) - 5r(v). v3 + 2v2 + v Let z(n) = -n2 + 6n. Let x(c) = 66c*2 + 90c - 3. Determine x(m) - 15z(m). 81m*2 - 3 Let h(k) = -1237 - 2k + 656 - 4k2 + 3k*3 + 583. Let o be (-2)/(-2 + 15/6). Let j(q) = -3q - 3q2 - 4q*2 + 3 - 2q*3 + 7q*3. Give oj(l) + 7h(l). l3 - 2l + 2 Let h(k) = 0 + 0 - k. Let t(g) = g*2 - 1. Let m = 4659 + -4657. What is mt(u) + h(u)? 2u2 - u - 2 Let f(v) = -18v*3 + 20v*2 + 6v - 10. Let t(d) = 18d3 - 16d*2 - 6d + 8. Calculate -4f(h) - 5t(h). -18h3 + 6h Let l(d) = -5d3 + 131d*2 + 21d. Let f(y) = 9y3 - 261y*2 - 33y. What is -3f(v) - 5l(v)? -2v3 + 128v*2 - 6v Let t(b) = -960b3 + 22b*2 - 24b + 88. Let x(n) = 481n3 - 12n*2 + 13n - 48. Give 6t(v) + 11x(v). -469v3 - v Let z(o) be the second derivative of 5o*3/2 - 12o*2 + 2o - 2. Let f(d) = -3d + 5. Let b be ((-6)/5)/(4/(-10)). Let i = -2 - b. Give iz(l) - 24f(l). -3l Let k(y) = -373y + 1. Let w(p) = 394p + 1. Calculate 4k(a) + 5w(a). 478a + 9 Let o(c) = -c - 1. Suppose -3t = -t - 14. Suppose -29 + 8 = tq. Let b be q(8/4 + 5/(-3)). Let y(w) = -1. Determine bo(l) + 3y(l). l - 2 Let b = -157 - -823. Let s = b + -672. Let a(l) = -l3 - l2 - l. Let w(y) = y*3 + 4y*2 + 6y. Calculate sa(v) - w(v). 5v*3 + 2v*2 Let v(k) be the first derivative of 11/3k*3 - 6k*4 - 11/2k*2 + 0k + 37. Let i(m) = -5m3 + 2m*2 - 2m. What is 11i(d) - 2v(d)? -7d3 Let n(k) = -k - 1. Let a(o) = 9o*2 + 4o + 2. Let d = -2585 - -2584. Give da(j) - 4n(j). -9j2 + 2 Let l(r) = 3r*2 + 6r + 7. Let d(i) = 2i2 + 3i + 4. Let f = -487 - -511. Suppose f*u = 186 -	{ "pile_set_name": "DM Mathematics" }
= -a*2 + 36a - 350. Give f(19). -27 Let j(w) = 11w2 - 451w + 440. What is j(40)? 0 Let r(p) = -p*2 - 12p - 36. Give r(-18). -144 Let n(i) = i*2 + 211i - 2441. Determine n(11). 1 Let h(a) = -60a - 261. What is h(-5)? 39 Let z(m) = 3m*2 - 41m - 4. Give z(14). 10 Let f(w) = -7w + 53. Calculate f(-6). 95 Let d(u) = -9u*2 + 5u - 160. What is d(8)? -696 Let c(p) = -27p2 + 1047p + 237. Determine c(39). 3 Let o(z) = z*2 + 111z + 2377. Calculate o(-82). -1 Let o(c) = -11c2 + 79c + 194. Give o(-2). -8 Let d(m) = 30m - 421. What is d(8)? -181 Let x(n) = 255n - 16958. Calculate x(66). -128 Let w(v) = v*3 - 6v2 - 10. Determine w(4). -42 Let m(j) = -j2 - 38j + 321. Give m(-48). -159 Let x(w) = 3w*2 - 84w + 160. What is x(26)? 4 Let b(x) = 39x2 + 121x + 15. Determine b(-3). 3 Let l(g) = -27g - 140. Give l(-6). 22 Let n(o) = -o3 + 24o*2 - 83o + 46. What is n(20)? -14 Let c(z) = -z*3 - 113z*2 + 118z + 363. What is c(-114)? -93 Let z(x) = -39x2 - 701x + 7. What is z(-18)? -11 Let n(b) = 61b - 1127. What is n(18)? -29 Let u(t) = 250t + 4571. What is u(-18)? 71 Let r(m) = m*2 + 56m - 126. What is r(-56)? -126 Let w(a) = a*2 + 10a - 330. Give w(-21). -99 Let c(p) = 16p - 77. Give c(2). -45 Let h(p) = -3p*3 - 284p*2 + 100p + 480. Calculate h(-95). 5 Let a(x) = -x*2 + 405x + 2891. Calculate a(-7). 7 Let t(c) = -202c - 1433. What is t(-7)? -19 Let r(q) = -q2 - 49q - 465. Give r(-41). -137 Let f(a) = 32a2 - 6a - 1. Give f(-1). 37 Let b(q) = -q*2 + 40q + 83. Give b(14). 447 Let t(p) = -35p2 + 627p + 58. Determine t(18). 4 Let q(z) = 2z3 - 80z*2 - z + 42. Give q(40). 2 Let s(b) = -176b - 10603. Give s(-60). -43 Let l(i) = -2i + 63. Determine l(17). 29 Let i(a) = -2a*3 - 101a*2 - 239a + 107. Give i(-48). 59 Let g(d) = d*3 - 3d*2 - 8d - 11. Determine g(-4). -91 Let o(p) = -p*3 + 24p*2 + 58p - 83. Calculate o(26). 73 Let a(o) = 2731o + 24546. Determine a(-9). -33 Let n(t) = -60t - 280. Determine n(-5). 20 Let d(h) = -3h2 + 29h + 31. Give d(10). 21 Let u(v) = -v*3 + 67v*2 + 362v + 8. Give u(-5). -2 Let p(g) = -277g - 89472. Calculate p(-323). -1 Let a(v) = 2v*3 - 271v*2 + 672v - 934. Give a(133). -3 Let b(u) = -u*2 + 31u + 816. What is b(-17)? 0 Let z(w) = -w*3 - 215w*2 - 1855w - 3. What is z(-9)? 6 Let r(x) = -x*3 + 15x*2 - 30x + 11. What is r(14)? -213 Let u(b) = -b*2 + 2336b + 7010. What is u(-3)? -7 Let k(m) = m*3 + 7m*2 + 2m - 146. Calculate k(-10). -466 Let m(o) = o*3 + 60o*2 + 8o + 512. Determine m(-60). 32 Let a(l) = -2l2 + 35l - 206. Calculate a(14). -108 Let a(o) = -13o3 - 276o*2 + 235o + 342. Give a(-22). 12 Let r(m) = 1670m + 758175. What is r(-454)? -5 Let v(t) = -2t*2 + 279t - 685. Calculate v(137). 0 Let w(h) = 5h2 + 46h + 4. Calculate w(-12). 172 Let y(n) = n*3 - 7n*2 - 101n + 271. Determine y(13). -28 Let r(i) = 735i + 5138. Determine r(-7). -7 Let l(g) = 19g*2 + 6g + 15. Give l(-2). 79 Let a(l) = -733l + 4416. Give a(6). 18 Let v(a) = 11a*2 + 66a - 4. Calculate v(-7). 73 Let z(b) = -2b2 + 29b - 109. Calculate z(9). -10 Let r(z) = -2z2 - 131z + 897. What is r(-72)? -39 Let w(k) = -4k3 + 25k*2 + 10k - 16. Calculate w(-1). 3 Let x(c) = -c*3 + 11c*2 - 2c - 46. What is x(10)? 34 Let d(h) = -2461h - 17238. Determine d(-7). -11 Let j(v) = -2v*2 - 34v - 98. Calculate j(-3). -14 Let y(a) = 5a2 + 226a - 21. Give y(-45). -66 Let l(t) = -t*3 - 24t*2 + 2t + 111. Calculate l(-24). 63 Let o(d) = -4d2 - 7d + 136. Determine o(5). 1 Let y(b) = -6b2 + 655b - 5942. Give y(10). 8 Let m(b) = 3b2 + 2b - 158. Calculate m(7). 3 Let c(m) = 157m3 + m2 + 3m + 3. Calculate c(-1). -156 Let n(z) = -18z + 198. Calculate n(16). -90 Let y(j) = 100j - 420. Give y(4). -20 Let h(x) = 2x2 - 39x + 7. Determine h(21). 70 Let n(b) = b*3 - 15b*2 - 196b + 3021. What is n(17)? 267 Let y(p) = 37p + 2756. Calculate y(-74). 18 Let l(z) = z2 + 57z - 252. Calculate l(-66). 342 Let x(o) = o*3 - 10o*2 - 146o + 20. What is x(18)? -16 Let r(g) = -2g3 - 126g*2 - 783g + 57. Calculate r(-56). 1 Let z(f) = f*2 + 3f - 94. Calculate z(12). 86 Let d(l) = 2l3 + 25l*2 + 19l + 31. What is d(-12)? -53 Let w(b) = 22b + 655. What is w(-30)? -5 Let q(k) = k2 + 9k - 64. Give q(9). 98 Let d(a) = a*3 + 212a*2 - 1555a + 91. What is d(7)? -63 Let g(l) = -367l - 12110. Give g(-33). 1 Let x(j) = 6038j - 54353. Calculate x(9). -11 Let w(b) = -3b3 + 5b*2 + 20b - 66. Give w(5). -216 Let l(n) = 2n3 + 12n*2 - 8n - 4. What is l(-6)? 44 Let g(h) = h*3 - 31h*2 - 7h + 33. Determine g(31). -184 Let w(m) = m*3 - 12m*2 + 87m - 307. Determine w(6). -1 Let a(u) = -5u2 - 9u - 21. Calculate a(-4). -65 Let r(l) = -l*3 - 12l*2 - 34l - 140. Determine r(-10). 0 Let q(p) = 20p - 21. Give q(6). 99 Let b(v) = -v2 + 59v - 91. Give b(0). -91 Let m(j) = 57j + 1151. Calculate m(-20). 11 Let g(y) = -y2 + 275y - 18603. Give g(155). -3 Let z(l) = -5840l - 157677. What is z(-27)? 3 Let f(u) = -u3 + 2u*2 + 13u - 29. What is f(4)? -9 Let v(j) = 12j3 + 1572j*2 - 3j - 441. Calculate v(-131). -48 Let w(z) = 65z + 644. Determine w(-10). -6 Let u(g) = -127g + 3423. Calculate u(27). -6 Let s(u) = u*3 - 21u*2 - 22u - 46. What is s(22)? -46 Let i(a) = a*3 - 3a*2 + 28a - 102. Give i(4). 26 Let k(v) = 3v3 - 7v*2 + 4v + 4. What is k(3)? 34 Let z(t) = 53t - 351. What is z(8)? 73 Let c(d) = -d2 - 13d - 60. Calculate c(-10). -30 Let b(x) = 302x + 8156. Determine b(-27). 2 Let w(k) = k3 - 7k*2 + 83k - 714. Determine w(8). 14 Let s(y) = -y*2 + 76y - 1021. What is s(60)? -61 Let a(h) = 2h3 + 109h*2 + 50h - 260. Calculate a(-54). -44 Let m(a) = -a*2 - 80a - 343. Give m(-76). -39 Let m(u) = -18u2 - 740u - 88. Determine m(-41). -6 Let i(o) = -183o - 10065. Calculate i(-55). 0 Let o(q) = -q2 - 120q - 586. What is o(-5)? -11 Let p(v) = v*2 - 19v + 24. Calculate p(16). -24 Let n(p) = -2p3 - 61p*2 + 32p - 6. Give n(-31). -37 Let u(i) = 14i + 764. Give u(-32). 316 Let x(z) = -2z*3 + 247z*2 + 1008z - 56. What is x(-4)? -8 Let b(t) = -t*2 + 6t - 3. Determine b(12). -75 Let r(m) = -m*3 + 26m*2 - 30m + 96. Determine r(25). -29 Let g(f) = 72f2 - 7f - 6. Give g(-1). 73 Let l(a) = -57a - 582. What is l(-11)? 45 Let t(n) = n3 - 225n*2 - 2100n - 1399. Give t(234). 5 Let i(d) = 4d2 + 35d + 47. Give i(-6). -19 Let c(k) = k*3 - 45k*2 + 165k - 43. What is c(41)? -2 Let h(u) = 35u - 128. Determine h(12). 292 Let q(v) = -2v*2 + 54v + 831. What is q(38)? -5 Let q(y) = -6y3 + 38y*2 - 31y + 53. Calculate q(6). -61 Let l(v) = -3v3 + 8v*2 + 25v + 10. Give l(5). -40 Let c(h) = -30h - 1121. What is c(-38)? 19 Let v(l) = l3 + 36l*2 + 33l - 12. Calculate v(-35). 58 Let h(v) = -2v3 + 11v*2 - 13v + 7. What is h(4)? 3 Let m(g) = 2g2 + 51g + 64. Calculate m(-24). -8 Let w(a) = 7a2 + 124a + 6. What is w(-17)? -79 Let r(w) = -16w2 - 74w - 75. Calculate r(-2). 9 Let u(r) = r*2 + 239r + 8066. Determine u(-41). -52 Let j(r) = r*3 + 103r*2 + 16r + 1741. Determine j(-103). 93 Let j(f) = -157f + 2827. Give j(18). 1 Let d(h) = 2h*3 - 19h*2 + 19h - 18. What is d(9)? 72 Let m(o) = -13o2 + 31o + 40. Calculate m(5). -130 Let c(i) = -241i + 1932. Calculate c(8). 4 Let y(w) = -160w + 5284. Determine y(33). 4 Let j(d) = -3d - 31. What is j(26)? -109 Let o(k) = k3 + 19k*2 + 5k. Determine o(-19). -95 Let a(w) = w*2 - 25w - 6. Determine a(20). -106 Let u(o) = -33o - 407. What is u(-9)? -110 Let z(v) = -v2 + 8v + 34. Determine z(17). -119 Let q(o) = 4o3 + 62o*2 - 125o + 3. Determine q(2). 33 Let l(i) = 14571i + 43709. Give l(-3). -4 Let q(w) = w3 - 7w*2 - 6w - 107. Determine q(9). 1 Let g(i) = -60i + 304. Determine g(7). -116 Let x(z) = -z2 - 62z - 378. What is x(-56)? -42 Let p(f) = -f*2 + 48f - 511. Determine p(35). -56 Let c(s) = 2s - 17. What is c(-72)? -161 Let v(b) = 317b*2 + 2849b - 9. Give v(-9). 27 Let j(v) = -50v - 4969. Determine j(-101). 81 Let o(d) = d3 - 35d*2 + 25d + 318. Calculate o(34). 12 Let p(q) = -5q2 - 15q - 19. Determin	{ "pile_set_name": "DM Mathematics" }
s) = s. Let n(c) = b(c) - 8m(c). What is the first derivative of n(f) wrt f? -12 Let y = -49 - -51. Find the third derivative of -4x*y + 12x*3 + 20x*3 - 17x*3 + 15x*3 wrt x. 180 Let q(w) be the second derivative of -97w*6/15 - 359w*2/2 - 244w. What is the first derivative of q(p) wrt p? -776p3 Let t(b) = b - 9. Let h be t(12). Let i be 6(h - 1)/4. Differentiate -iw4 - 12w*2 + 12w*2 - 2 with respect to w. -12w*3 Suppose n - 6n = -60. Let q(o) = -57o3 - 5o + 27. Let t(x) = 142x3 + 12x - 68. Let f(c) = nq(c) + 5t(c). Find the first derivative of f(r) wrt r. 78r2 What is the second derivative of -491f - 94f3 + 67f*3 - 424f + 160f - 540f*3 wrt f? -3402f Let m(o) be the first derivative of -109o5/5 - 2o*3/3 + 15o*2 + 116. Find the third derivative of m(i) wrt i. -2616i Suppose 0 = s - 4s. What is the second derivative of 2v*2 + 5v*2 + 6v + sv wrt v? 14 Let o(h) = 7h - 2. Let m be o(1). Let g be (-2)/m - 153/(-45). Find the third derivative of -18u2 + 26u*g + 4u*2 - 17u*3 wrt u. 54 Find the third derivative of -163p*2 - 486p*5 + 34p*6 + 486p*5 + 219p*6 wrt p. 30360p*3 Let q(w) be the second derivative of -125w7/14 + w4/4 - 11w3/3 - 62w. What is the third derivative of q(s) wrt s? -22500s2 Let s(v) be the third derivative of -7v*6/12 + 43v*4/24 + 112v*2 - 2. What is the second derivative of s(d) wrt d? -420d Let c(n) be the third derivative of -13n6/40 - 26n*3 + 63n*2. What is the derivative of c(w) wrt w? -117w*2 Let m(j) = -2j + 4. Let f be m(0). Let w be 20/(-70) + f/14. What is the derivative of w - 2 - 5u4 - 3 + 8 wrt u? -20u*3 What is the third derivative of 5 - 5 - 6d*2 - 8d + 5d2 + 23d*5 wrt d? 1380d*2 Suppose 23q = 3q + 100. Let z(h) be the second derivative of 1/2h*3 - 1/5h*q - 2h + 0h2 + 0 + 0h*4. What is the second derivative of z(n) wrt n? -24n Differentiate -2k2 - 2k - 22 - 21 + 0k2 with respect to k. -4k - 2 Let j(s) be the first derivative of 0s2 + 19 - 1/5s*5 - 11s + 0s3 + 0s*4. Differentiate j(c) with respect to c. -4c*3 Differentiate -9 - 6 + 20k*2 + 2k*3 - 16 - 6k*2 wrt k. 6k*2 + 28k Let v(z) = -79z2 - 2z - 1. Let m(f) = -f*2. Let i(j) = -2m(j) - v(j). What is the second derivative of i(a) wrt a? 162 What is the second derivative of -2s4 - 74s + 2824s2 - 16s*3 - 2824s*2 wrt s? -24s*2 - 96s Let w be 6/10 - (-2)/5. Let v(f) = 13f + 27f - 1 - 34f. Let y(u) = -1. Let r(n) = wv(n) - 2y(n). Find the first derivative of r(a) wrt a. 6 Let j be 5 + -3 - (3 + -3). Find the first derivative of -24f - 12fj + 2 + 7f*2 + 24f wrt f. -10f Let u(o) be the second derivative of 155o*3/6 - 137o*2/2 + 42o. What is the derivative of u(d) wrt d? 155 What is the third derivative of -18l2 + 4l*2 + 5l*2 + 3l*2 + 79l*3 wrt l? 474 Let v = -434 - -436. Let m be ((-4)/(-6))/(4/18). Find the second derivative of -vr*3 + 10r + 7rm + 0r*3 wrt r. 30r Let h(k) be the first derivative of 19 - 6k2 + 3k3 - 30 + 26. What is the second derivative of h(g) wrt g? 18 Let k(p) be the first derivative of p6/3 - 2p2 - 2p + 26. Find the second derivative of k(t) wrt t. 40t3 Suppose -4q - 174 = -190. Let o(c) be the second derivative of 0c3 + 0c*4 + qc + 4c2 - 1/20c*5 + 0. Differentiate o(d) wrt d. -3d*2 Find the first derivative of 3l + 28l + 128 + 105l + 61l wrt l. 197 Find the second derivative of -5g - g*4 - 1 - 12g*3 - 2g*3 + 1 - 10g*3 wrt g. -12g*2 - 144g What is the derivative of -523 + 251h4 + 286h*4 - 161h*4 wrt h? 1504h*3 Let f(o) = 25o*3 - 39o. Let j(h) = -464h + 350h3 - h2 + h*2 - 81h. Let p(q) = 55f(q) - 4j(q). Find the second derivative of p(b) wrt b. -150b Let u(d) be the second derivative of -2d*2 + 0d*3 + 0 - 20d - 23/12d4. Differentiate u(n) wrt n. -46n Let a(f) be the second derivative of -f*6/15 - 49f*4/12 + 37f*3/2 - 396f. What is the second derivative of a(l) wrt l? -24l2 - 98 Let o = -14 - -17. Suppose -ok = -4 - 2. Find the third derivative of r2 + r3 + 2r3 + 8r*2 - kr*2 wrt r. 18 Let h(a) be the second derivative of 139a*3/3 + 175a*2 + a - 46. Find the first derivative of h(p) wrt p. 278 Suppose -6 = -2c - 0c. Let v(h) = -5h + 3. Let y be v(0). What is the second derivative of -yf3 - 4f + 0fc + f3 wrt f? -12f Let c(t) be the second derivative of -77t4/12 + 12t*3 + 89t - 2. Find the second derivative of c(j) wrt j. -154 Let q be -7 + 8 + (-2)/((-3)/3). Let z(n) be the second derivative of -8n + 0 - 2n*2 - 1/6n*4 + 0n*q. Find the first derivative of z(h) wrt h. -4h Let y(r) be the first derivative of r*6/6 + 5r*4/2 + 45r*2 - 121. Find the second derivative of y(b) wrt b. 20b*3 + 60b Let l(q) = 948q4 - 1322q + 16. Let v(k) = -316k4 + 440k - 6. Let f(a) = 3l(a) + 8v(a). What is the second derivative of f(x) wrt x? 3792x2 Suppose 9g = 5g + 32. Suppose -2w = -6w + g. What is the third derivative of -a2 - 10a5 + aw - 9a2 wrt a? -600a*2 Suppose 0 = -m - 3m - 5t + 95, -t = 5m - 124. Let x = -21 + m. Differentiate 2 + 3 - 5 + xo + 3 wrt o. 4 Let d(u) = -u2 - u + 3. Let t(o) = -185o*3 - 5o*2 - 30o + 21. Let b(h) = -5d(h) + t(h). Find the second derivative of b(i) wrt i. -1110i Let r(t) = -220t3 + 206t*2 - 6t. Let s(b) = -441b3 + 411b*2 - 10b. Let z(y) = -5r(y) + 3s(y). What is the third derivative of z(h) wrt h? -1338 Let u(v) = 2v2 + 1. Let o be u(-1). Let l be -1((-20)/(-4) - 3) + 4. Find the third derivative of -7pl - 2p*2 + 5p*6 + op*2 + 0p*2 wrt p. 600p*3 Let t(a) be the first derivative of -26a*2 - 220a - 293. What is the derivative of t(y) wrt y? -52 Let d be 4 - (-9 + 21832/1680). Let v(t) be the third derivative of 0t6 + 0 + 5/6t*3 + 0t*4 + 0t - 3t2 - dt*7 + 0t*5. Differentiate v(h) wrt h. -4h*3 Suppose -5x + 7 = -3. Find the second derivative of 3nx - 15n*2 + 5n + 0n wrt n. -24 Let b(v) = 629v*3 - 2v*2 - 5v - 2. Let j(y) = -315y3 + 2y + 1. Let p(a) = 2b(a) + 5j(a). Find the third derivative of p(i) wrt i. -1902 Let j(h) = 2h3 - h2 + 1. Let l(f) = -158f*3 + 3f*2 - 10f - 10. Let x(p) = 3j(p) + l(p). Find the second derivative of x(w) wrt w. -912w Let n(j) be the first derivative of -24j5 + 281j - 257. What is the derivative of n(x) wrt x? -480x3 Let r = 35 + -31. What is the second derivative of -2ir + i4 + 14 - 2i + 9i*4 + 22i*4 wrt i? 360i*2 What is the second derivative of -40 - 12m - 21m + 34m - 59 - 518m2 wrt m? -1036 Let x(j) be the third derivative of 11j*2 + 0j + 0j3 + 0 - 7/24j*4 + 0j*6 - 11/210j*7 + 0j*5. What is the second derivative of x(l) wrt l? -132l*2 Let u be (-4)/(-12) + (-4)/3. Let q be (4 + u - 4) + 3. What is the second derivative of 4m + 3mq - m2 + m2 wrt m? 6 Differentiate 67 + 19 + 126 - 253p - 226p wrt p. -479 Let z(f) = -13f*3 - 12f*2 - 2f. Let w(o) = 4o + 0o - 3o. Let u be (-1)/20/7 - -1. Let v(y) = uz(y) + 2w(y). Find the third derivative of v(p) wrt p. -78 Suppose 0 = 4w - 2p - 89 - 47, 0 = 5w - p - 164. Let l = -28 + w. What is the second derivative of 2b + b + 6b + 9b*l wrt b? 108b2 Let b = 4 - -1. Let v be (10 - (b + -2)) + -3. What is the first derivative of x2 - v + 4 + 5 + x*2 wrt x? 4x Suppose 16 = -2u - 5h, 4u - 9u + 3h = -22. Let w be -1 - 3(-3 + u). Find the third derivative of -30q2 + 25q*w + 0 + 4q*3 + 0 wrt q. 24 Let j = 13 - 0. Differentiate 4a*3 + 5 - 10 + ja*4 - 4a*3 with respect to a. 52a3 Let f(m) = -m4 + 13m + 3. Let o(u) = -4u*4 + 64u + 14. Suppose 5h = 3h - 6. Let g(n) = ho(n) + 14f(n). Find the second derivative of g(q) wrt q. -24q2 Let w(f) = 9f - 39. Let k be w(9). Differentiate -42o + 30o*3 - 12 + 84o - ko wrt o. 90o2 Let w(d) = -d3 + 4. Let u be w(0). Differentiate 21 - 5g - g + 12g*u + 6g wrt g. 48g3 Let q(c) = -10c - 26. Let p be q(-3). Find the third derivative of -pj6 - 3j*6 - 40j*2 - 20j*6 wrt j. -3240j*3 Let t(m) be the first derivative of -3m7/280 + m6/72 + 4m	{ "pile_set_name": "DM Mathematics" }
. Which is the closest to q? (a) p (b) 2/3 (c) 0.02 c Let t = -2.55 - -2.55. What is the nearest to 1 in -21.1, t, -3, -1/7? t Let n = 3.6707 - 2.6707. What is the nearest to 51 in 3, -3/4, -0.2, n? 3 Let c = -1.1 + 0.8. Let f = -79215/4 + 19803. What is the closest to 1/11 in c, f, 3? c Let z = 355 - 358.24. Let s = -3.54 - z. Which is the closest to 3? (a) -3/2 (b) s (c) 0 c Let j = 12359/8242 - -2/4121. What is the closest to -3/5 in 76/5, j, -4? j Let s = -243/28 + 173/28. Suppose -z = 3j - 3z, 4j + 4 = 4z. Which is the nearest to 1? (a) j (b) 5 (c) 0.4 (d) s c Let f(k) = k*2 + 16k - 18. Suppose 16g = 22g + 102. Let j be f(g). Let p = 9.8 + -5.8. What is the nearest to p in -5, j, 0.4? 0.4 Suppose -8n = 184 + 440. Let j = n - -80. Suppose jo + 0o + 33 = 5u, 4o = -4u + 4. Which is the nearest to 0.02? (a) -0.1 (b) u (c) 0.4 a Let y = 1199.8 + -1200. Which is the closest to 0? (a) y (b) -0.3 (c) 1/11 (d) 0.5 c Let j = 7.066 - 7.156. Which is the closest to 0.05? (a) 4 (b) j (c) 0.07 c Let m(l) = -41l3 + 2l*2 + 5l + 3. Let h be m(-1). Suppose -4n = -4, hu - 39u - 4n = -8. Which is the nearest to u? (a) 7 (b) 0.1 (c) -1 c Let k = 14989 + -14983. Which is the nearest to 0? (a) -0.2 (b) -3/16 (c) -2 (d) k b Let i = -2164 + 2169. Which is the nearest to 13/4? (a) 1 (b) -5 (c) -4 (d) i d Let x be (-10)/(-155) - 1224/1674. Let u(g) = -g*2 + 5g + 2. Let n be u(6). Let w = -4 + 4.2. What is the nearest to x in w, n, 0.5? w Let g = 4774 - 33422/7. Which is the closest to 0.09? (a) 0.05 (b) g (c) -5 (d) 0.3 a Let z = -159 + 158.765. Let k = z - 1.765. What is the closest to -2/11 in -5, 4/3, k? 4/3 Suppose -596h - 30 = -591h + 5x, -17 = 3h + 2x. Which is the nearest to -1? (a) 4/15 (b) 2 (c) h a Let h = 141 - -122. Let o = h - 258. What is the closest to 0.3 in 3, 0.5, o? 0.5 Let r = 87426 - 87428. Let y = 371/18 + -178/9. What is the nearest to y in 2/13, 5, r? 2/13 Let j = -3 - -5. Let z = -0.969614 + -0.030386. Which is the closest to z? (a) j (b) 5 (c) 6 (d) -0.4 d Let m = 7127 - 7124. What is the closest to -1/3 in -24, 4, m? m Let w be (6/2)/((546/(-28))/(-13)). Which is the closest to w? (a) 5 (b) -3/8 (c) 4 (d) -0.4 c Let p = -1652/11 + 150. Let j = 4.22 - -14.78. Let o = 0.12 - 0.12. Which is the closest to o? (a) j (b) p (c) 1 b Suppose -59 - 11 = 30o + 20. Which is the closest to 2? (a) -5 (b) o (c) -20 (d) -0.4 d Let w(q) = q*3 - 8q*2 - q + 10. Let r be w(8). Let g = -2.36 + 2.26. What is the closest to 0 in r, 5, g? g Let d = -128.39 + -0.61. Let v = 135 + d. What is the closest to -6 in 2, v, 3? 2 Let y = 6 + -20/3. Let i be (-1)/3 - (-5)/6. Let k = -1/4041 - -16169/20205. What is the closest to i in k, -0.3, y? k Let q = -15582 - -15585. What is the nearest to q in 0.7, -2, -7/5, -5? 0.7 Let g = 1.53 + 682.37. Let p = 684 - g. What is the nearest to 0.2 in p, -1/9, 5/2, -3? p Let s = 13/5 - 81/35. Let g be 22/12(-480)/1320. Which is the closest to s? (a) g (b) -1 (c) 0.02 (d) 3 c Let v = -933 - -933.9. What is the nearest to v in 56, 2/9, 5, -4? 2/9 Let j = -0.17504 + 81.35104. Let z = j - 0.176. Let u = 80 - z. What is the closest to 1 in u, 4, 0.5? 0.5 Suppose 4w - 13 = -5. Suppose -5z - wx = -0x + 10, 0 = -z - 4x - 2. Which is the closest to -0.1? (a) 0.05 (b) z (c) 5 a Let g be (1/4 + (-99)/(-36))/(-1). Let y(f) = 7f - 54. Let n be y(7). Which is the closest to -0.1? (a) n (b) -2 (c) g (d) -2/3 d Let d = 245.03 - 245. Let w = -7.04 - 0.96. Which is the nearest to 1? (a) 3/2 (b) w (c) d a Let k be 2/(-4)(-8 - -7). Which is the closest to k? (a) 0.001 (b) -1/3 (c) -2/11 a Let n(u) = -2u*3 + 3u*2 - 2u. Let q be n(2). Let k = 216812 - 2384934/11. What is the closest to -0.1 in k, -2/7, -4, q? k Let i = -6228 - -6193. Which is the nearest to i? (a) 0.2 (b) 0.3 (c) -3 (d) -4 d Let v = 1302.3 - 1298.3. Which is the closest to -1/4? (a) v (b) 2 (c) 0 (d) 21 c Let p = -201 - -571. Let z = p - 4068/11. Which is the closest to -3? (a) z (b) 1 (c) -0.2 (d) -4 d Let g = -12.1 - -12. Let o = 134 + -182. Let y = o - -48.08. What is the nearest to g in y, -0.5, 2/3? y Let s = 5527 - 5526.96. Which is the nearest to s? (a) -2/7 (b) 65 (c) -0.2 (d) 3 c Suppose 2s = 5g + 1237, 10g + 5s = 5g - 1265. Let f = 1989/8 + g. Which is the nearest to 3/5? (a) 3 (b) -2/5 (c) f c Let n = 2/511 + 499/3066. What is the nearest to 0.1 in n, -4, -30? n Suppose 0 = l - 3 - 2. Let y = -181.3 - -181. Which is the closest to 0? (a) y (b) l (c) -4 a Let s = -3.497 + 1.497. What is the closest to -4 in -3/4, s, 3? s Let k = 0.15 - 0.2. Let v = 14.96 - 14.46. Let s = -30.6 + 31. Which is the nearest to -2/5? (a) k (b) s (c) v a Let y be 1050/(-20)(-4)/5. Let h be (-6)/((-7)/(y/(-9))). Let f be (5/(70/h))/1. Which is the nearest to 6? (a) 4 (b) f (c) 1/3 a Let j = -27.8 - -18.9. Let d = -3.9 - j. Suppose 2 = -5l + 3a, l + 4l - a - 6 = 0. What is the nearest to l in -0.3, -3/7, d? -0.3 Let l = -4 - 0. Let w = 74563/7 + -10652. Which is the nearest to -1/5? (a) l (b) w (c) 3 b Let s = 0.576 + 29.124. Let m = 29 - s. Let n be -10 + (-198)/(-27) - -2. What is the nearest to 2 in n, -0.2, m? -0.2 Let q = -68 + 121. Let g = q + -52.9. Let v = 0 + g. Which is the closest to -6? (a) -0.4 (b) v (c) 4 a Let i = -427 + 334. Let w = i + 99. Let j = -6 + 8. What is the nearest to 1 in j, 0.02, w? 0.02 Suppose 0 = m - 2 + 6. Let o = 707 - 706.369. Let l = o - 0.131. Which is the closest to 0.08? (a) l (b) 0 (c) m b Let y = 144 + -579/4. Let b be (-11)/10 - 168/(-112). What is the nearest to 1 in 3/2, b, y? 3/2 Let s = -3 + 1. Let u be (((-1)/(-2))/(639/208))/1. Let i = -6 - -3. Which is the closest to s? (a) 4 (b) i (c) u b Let w = 0.6 - -0.4. Let m = -0.25968 + 0.05968. What is the nearest to w in -2, m, 0.1? 0.1 Let m = -1322 - -1330. Let j(d) = -d*3 + 6d*2 + 7d + 3. Let g be j(7). Let i be ((-8)/(-16) - 1)/(1/(-6)). Which is the closest to g? (a) 2 (b) m (c) i c Let f = 9268 - 9266. What is the nearest to 1 in 0.47, 1/4, f? 0.47 Let n = 0.232 - -1.768. Let m = 0.44 + -2.34. Let u = m + 4.9. What is the nearest to u in 0.5, n, -0.2? n Let g = -184.46 + 180.46. What is the nearest to 0.6 in -8/35, g, 4? -8/35 Let v = -320.57 - -320. Let k = v - 1.43. What is the nearest to k in 0.1, 0.2, -1? -1 Let p = 0.3 + -0.4. Let k = p - -0.1. Suppose 0 = 5c - 4w + 28, -5c - 592 = -5w - 557. What is the closest to c in 12, k, -1/7? k Let h = -0.1 - -0.1. Let q = 9701 + -9694. Which is the nearest to q? (a) h (b) -2/3 (c) 3/4 (d) -2 c Let x(i) = -i - 4. Let g be x(-7). Suppose m + 7p - 33 = 3p, -43 = -gm + 2p. Let o be (m - 16)1/(-5). What is the nearest to o in 0.4, 2/7, 2? 2/7 Suppose 2p = -3i + 14, -i + 7 = 5p - 2p. Let s be 2/6 + i/24. Let q = -2.1 + 7.1. Which is the nearest to 1? (a) s (b) q (c) 4 a Let d be (6/15)/(4/5(-30)/(-60)). Let j = -0.8 - -0.5. What is the nearest to 0.2 in j, d, 5? j Let g = 31 + 0. Suppose 4y - 4w = w + 33, 0 = 4y - 3w - g. Let j = 10 - y. What is the nearest to j in -4, 2, 1/4? 2 Let k = 0.038464 - -0.061536. Let p = 3 - 3. What is the nearest to 0.08 in k, p, -0.2? k Let v be ((-6)/(-12798))/(29/(-6) + 5). What is the closest to 0.1 in v, -1/3, -0.4? v Let s(z) = 26z3 - 7z*2 + 6z - 2. Let f be s(2). Let l = -761/4 + f. What is the closest to -2/5 in -2/5, 10, 2/11, l? -2/5 Let n = -2/887 - 2653/3548. Let q = -8.1 - -12.1. Which is the closest to -5/4? (a) n (b) q (c) -2 a Let d = 3885/13 - 299. Let h = 15/11 - 49/44. What is the closest to d in h, -0.4, -1/3? -1/3 Let w = -8.26 - -0.16. Let s = w - -8. Let h = 15.66 - 20.66. Which is the closest to s? (a) -4/5 (b) -3 (c) h a Let t be ((-1)/(-9))/(12/24). Let h be 2/198308/28. Let v = 4 + -2. Which is the nearest to h? (a) -3/7 (b) v (c) t c Let m = 0 + -5. Let g = -619 + 616. Which is the closest to g? (a) m (b) -1/3 (c) -2/17 a Let s be ((-3)/(-15) - -1)/((-5)/(-100)-6). What is the nearest to 0 in 85, s, 0.3, 0.1? 0.1 Suppose 4y + 5o - 15 - 6 = 0, 0 = 2y - 3o + 17. Let z = -20681/7347 - -87/31. Let w = z + 251/1659. What is the closest to 6 in y, -0.4, w? w Let u = 22.33 - 6.39. Let l = u	{ "pile_set_name": "DM Mathematics" }
y ((pp(1/2)p)/p)*(-1)/(pp*(3/8)/ppp1) assuming p is positive. p(-31/8) Simplify (d0d)/(d*4/d)(d/(d/((dd1d)/d)))(-27) assuming d is positive. d(-56) Simplify (g*(-1/2)g)/gg(-6)g((gg/((g/(g/(gg/(((g(gg2)/gg)/g)/gg)g)g))/g))/g)/g(2/29) assuming g is positive. g(-149/58) Simplify (b(-1/3)b*9/bb)/(b*6/((bb/(bb(7/2)))/b)) assuming b is positive. b(-5/6) Simplify ((gg(1/8))/g)(2/51) assuming g is positive. g*(1/204) Simplify ((s(s/s*(-2))/ss)/s)*(1/6)s*(-1)s/s*(-4/7)s assuming s is positive. s*(29/14) Simplify ((((bb*(-2/23))/bb)/b)/bb)/(b/(bb((b/(bb/(bb(-35))))/b)/b)) assuming b is positive. b(-830/23) Simplify mm(mm*(-5))/mmmm*3(mm/(mm/(m*0m)m)mm)(-3/34) assuming m is positive. m(31/17) Simplify (((m2/mm)/m)(3/2))24 assuming m is positive. m36 Simplify (j(-1/3))(-16)/(j/j1jjj/(j/(j(jjj*(3/8)jjj)/jj))) assuming j is positive. j(-73/24) Simplify (d/(dd*(-10/9)d))/ddd(-9) assuming d is positive. d(-80/9) Simplify (d/d*15d/d(-12))(-39) assuming d is positive. d39 Simplify (r2r/((r(-1/7)/rr)/r))/(r*1r)(-11) assuming r is positive. r(183/7) Simplify (g17)47 assuming g is positive. g799 Simplify (x4x6/x)(2/105) assuming x is positive. x(6/35) Simplify (qq*(-4/15))/qq(-21) assuming q is positive. q(-319/15) Simplify (q(q0q)/qq)(-2/35) assuming q is positive. q(-4/35) Simplify (u/(u/(u/u(-17))u)u)/(u19u) assuming u is positive. u(-2) Simplify ((g7g)/gg*2/g)/((g((g/g0)/g)/g)/g)45 assuming g is positive. g53 Simplify n(2/27)/(n/(n*(-23)/n)n) assuming n is positive. n*(-700/27) Simplify (aa*4a)/((a*(-2)/a)/aa)a(-6)/aa(7/3) assuming a is positive. a(13/3) Simplify (y/y(-2/7))(-14)/(y/(y*(-1)y)y)(-1/9) assuming y is positive. y(-160/9) Simplify ((i/(ii/i(-1/5)))(24/5))38 assuming i is positive. i(-5472/25) Simplify r*(-2/7)r*(-5)r*(-1/8)r(-3/2) assuming r is positive. r(-387/56) Simplify (yyy/(yy(6/13)/y))/y(-4) assuming y is positive. y(85/13) Simplify (w(-2/7)/((w(w*(-4)w)/w)/w))/(w(-1)/w(-2/7)) assuming w is positive. w*(31/7) Simplify (aaaa*(-5/6)aaa(-1/7))/(((a7/a)/aa)/(a(-5/2)/a)) assuming a is positive. a(-115/21) Simplify (p(-1/2)p)/(p(1/7)/p) assuming p is positive. p(19/14) Simplify (q(1/13)/q16)(-9/7) assuming q is positive. q(1863/91) Simplify ((j(-2/5))(1/8))(-20) assuming j is positive. j Simplify (q(4/7)q)/((qq/(q*(5/8)q))/q) assuming q is positive. q*(123/56) Simplify t(t/t*(13/6))/ttt/(t/(t/t18t))tt assuming t is positive. t(-85/6) Simplify (h(-1/5)/h(1/2))36 assuming h is positive. h(-126/5) Simplify (v(-2/19)/vvv)(-4/7) assuming v is positive. v(-68/133) Simplify (q/q(-1))(-31)/(q/(q/q*(-1/5))q/(qq/((q/(qq/q*(2/7)))/q))q) assuming q is positive. q(-2103/35) Simplify ((b(-15/2)b)/b)/(bb0) assuming b is positive. b(-17/2) Simplify ((z/(zz1)z)/z)(-39)/(z/z(1/4)(z3z)/z) assuming z is positive. z*(141/4) Simplify ((ll2)(-11/3))29 assuming l is positive. l(-319) Simplify (k/(k*(-1/3)k))*30k*(-1/2)kk/(k/((kk(1/3))/k)) assuming k is positive. k(65/6) Simplify (o/(o/o*(-10))o)/(((oo/o(-4/3)oo)/oo)/o) assuming o is positive. o*(-40/3) Simplify (ff/(f*(-2/15)/f))/ff(-2/39)/f assuming f is positive. f(211/195) Simplify (yy/((y/y1)/y))(-10/13)/((yyy(-4))/(y(-3)y)) assuming y is positive. y(-30/13) Simplify y36/(yy/y(-1/25)y) assuming y is positive. y*(824/25) Simplify (dd(-14))0 assuming d is positive. 1 Simplify h*(-6)/hh*29h assuming h is positive. h23 Simplify (l5l)/((l/l0l)/l) assuming l is positive. l*5 Simplify ddd(5/2)dddddd4ddd(-2)/(d(-5)/d) assuming d is positive. d*(39/2) Simplify (tt/(t/((tt/(t(((t/t*(3/2))/tt)/t)/t))/t))t(1/4))(-26) assuming t is positive. t(-195/2) Simplify v5/v(-3/4)(v/v(-3/5))/v(3/4) assuming v is positive. v(33/5) Simplify ((g/g(1/9))/g*(-6))/((g/(g(g/(g/(g*(-2/5)/g)))/gg))/ggg)(2/49) assuming g is positive. g(14974/2205) Simplify (f*(-6)f)/((ff/(f(ff5/fff)/ff))/f)f3f3 assuming f is positive. f8 Simplify (r/(r*3r))/r(3/2) assuming r is positive. r(-9/2) Simplify g*(2/9)ggg*(-2/15)g*4g6 assuming g is positive. g(544/45) Simplify (ff(-7)/ff*(-3))/((ff*(-2))/ff6) assuming f is positive. f(-14) Simplify r*(-3/5)r(-4/5) assuming r is positive. r(-7/5) Simplify m*27m/(m/(m/(m(m/(mm*27))/mm)))m assuming m is positive. m55 Simplify (g(2/17))(-39) assuming g is positive. g(-78/17) Simplify (k/(kk*(-6/19))k)(6/7) assuming k is positive. k(150/133) Simplify (a(2/13)/(a/a(4/3)))(-45) assuming a is positive. a(-285/13) Simplify ((g(g(-7)/g)/g)/(g/(g/g(1/4))))(-11) assuming g is positive. g(363/4) Simplify ((l(-4)l)/l*(-11))/(l((l/((l/l*(2/5))/l)l)/l)/lll/(ll(-1/2))) assuming l is positive. l(51/10) Simplify (g/((g/g(3/41))/g))(-22) assuming g is positive. g(-968/41) Simplify ((y(-17)y)/y)40 assuming y is positive. y(-680) Simplify (w18/w1)(-6/25) assuming w is positive. w(-102/25) Simplify (b(-1/7))(-24) assuming b is positive. b(24/7) Simplify o(2/15)/oo(2/15)o*(-2/13)(oo(2/7)o)/o assuming o is positive. o*(544/1365) Simplify uu*(2/3)u/(u/(u/(u(-1/21)/u))) assuming u is positive. u(26/7) Simplify (o((o/(o(((oo5/oo)/oo)/o)/o))/o)/o)/((ooo/(ooo(-1)/o))/o)oo/o4oo(-2) assuming o is positive. o(-10) Simplify f(2/21)fff*(1/13)f assuming f is positive. f*(866/273) Simplify (j/((j/(j/((jj*(2/25))/j)))/j)jj8)(-1/20) assuming j is positive. j(-273/500) Simplify (ll3)/l(-2/5)(ll/(ll(l/((l*4/l)/ll))/l))/l6 assuming l is positive. l(7/5) Simplify ((jj/(((j(1/3)j)/j)/jj)j)/j)(2/35)/(j(2/25)/(j1/j)) assuming j is positive. j(8/525) Simplify c(-5/6)/(c(1/3)c) assuming c is positive. c(-13/6) Simplify ((w0w)(-1/38))(1/4) assuming w is positive. w*(-1/152) Simplify (((yy*(3/4)/yy)/y)/y*9)/((yyy/y(-2/3))/y)(-35) assuming y is positive. y(1021/12) Simplify (g/g(-4))/g(-1/8)(g(ggg6/g)/gg)/ggg*(-3/2)gg assuming g is positive. g(109/8) Simplify ((cc*(-8)c)/c)(-25) assuming c is positive. c175 Simplify (v(1/2)/(v/v(-3/5)))/(v*(3/7)vv(-1/8)) assuming v is positive. v(-673/280) Simplify (d/d(-2)d)*(-26)(dd(-1/2))/d0 assuming d is positive. d(-207/2) Simplify (u(-1/4)(uu(-4/11)/u)/u)(2/21) assuming u is positive. u(-71/462) Simplify (mm(2/17))(-2) assuming m is positive. m(-38/17) Simplify (v(-1/2))*(1/50)v/v*(2/9)v(-3) assuming v is positive. v(-2009/900) Simplify (m/m*13mm/m(1/5))(2/47) assuming m is positive. m(-102/235) Simplify (k/(kk/(kk44k)))/k34 assuming k is positive. k11 Simplify ((h/h(2/11))/h(-2/3))/(h/h2)(-4/43) assuming h is positive. h(1975/1419) Simplify (i(-6)ii/((i(1/15)/i)/i))/(i/i(-2/7))(-2/11) assuming i is positive. i(-2117/1155) Simplify ((ooo/(o/(o*(-1/2)/o))o)/ooo(-2/15)/o)37 assuming o is positive. o*(407/30) Simplify ((((tt*(2/5)t)/t)/t)(-44))7 assuming t is positive. t(-616/5) Simplify ((z1z)/z)(-1/10)z*(-2/3)z(-3/4) assuming z is positive. z(-91/60) Simplify (z*(1/19)z/(z(z/z(1/25)z)/z))(1/8) assuming z is positive. z(-431/3800) Simplify ((h/(hh(1/5))h)/((h*(-9)/hh)/h))(4/7) assuming h is positive. h(216/35) Simplify (a*6(a/((aa/((((a/a(-2))/a)/a)/a))/aa))/a)(2/15) assuming a is positive. a(8/15) Simplify z((z(-17)z)/z)/zz(1/20) assuming z is positive. z(-339/20) Simplify g(2/109)gg(-18/11)gg assuming g is positive. g(1657/1199) Simplify (oooo1)(3/7)/(o(1/2)/o)27 assuming o is positive. o(213/14) Simplify (t0)*(17/7)((ttt/((tt(-1/2)tt)/t)tttt)/t)43 assuming t is positive. t(387/2) Simplify l/l(5/2)l9 assuming l is positive. l(15/2) Simplify i**	{ "pile_set_name": "DM Mathematics" }
5p3 - 1080p + 531p2 = 0. 0, 1, 216 Let r(f) be the third derivative of -f8/1008 - 4f*7/315 + 161f*6/360 + 133f*5/45 + 5f*4/18 - 352f*3/9 - 537f*2 - f. Suppose r(b) = 0. What is b? -16, -2, 1, 11 Let r(x) be the third derivative of 0x + 0x3 - 34x*2 - 19/12x*6 + 105/8x*4 + 2 - 2/7x*7 - 5/336x8 - x5. Solve r(p) = 0 for p. -7, -3, 0, 1 Let n = 2831 - 1246. Factor 484 + nf2 - 5f*5 + 47f*4 - 1016f*3 + 4f*5 - 1496f + 397f3. -(f - 22)2(f - 1)*3 Let n be 180/(-15)(-147)/(-6). Let h be 18/23173 - n/(-539). Solve -162/7q + 0 + hq2 - 2/7q*3 = 0. 0, 9 Let f = 12171/2 - 6085. Let h(g) be the first derivative of -5 + 2/3g*3 - 2/5g5 + g2 + 0g - fg*4. Factor h(a). -2a(a - 1)(a + 1)2 Let f(c) = -c2 + 14. Let q(b) = 280b2 + 270b - 88. Let d(s) = -6f(s) - q(s). Factor d(j). -2(j + 1)(137j - 2) Let d(k) be the second derivative of k6/60 - k5/6 + 2k4/3 - 4k*3/3 + 55k*2/2 + 74k. Let q(s) be the first derivative of d(s). Factor q(r). 2(r - 2)2(r - 1) Let x(s) be the second derivative of s*4/6 - 17s*3/6 - 9s*2/2 + 2891s. Determine u so that x(u) = 0. -1/2, 9 Let x(t) be the first derivative of -2t3/63 + 34t*2/7 - 202t/21 - 1297. Suppose x(z) = 0. What is z? 1, 101 Let j be (-56)/(-36) - (-89)/((-25632)/448). Factor -2/7h - 2/7h*4 - 6/7h*3 + j - 6/7h*2. -2h(h + 1)3/7 Let r(q) = -49q*2 + 1. Let k be r(3). Let s be (24/14)/((-60)/k). Factor -sa*2 - 36/7 + 2a*3 + 150/7a. 2(a - 3)2(7a - 2)/7 Let j(a) = 47a*3 + 1221a*2 - 65a - 1010. Let u be j(-26). What is o in 86/3o3 + 92/3 + 274/3o - 2/3ou + 90o2 = 0? -1, 46 Let a(k) be the second derivative of k7/735 - k*5/210 + 33k*2 + 2k + 8. Let r(v) be the first derivative of a(v). Solve r(c) = 0. -1, 0, 1 Let o(m) be the third derivative of 2m7/315 + 47m*6/180 + 263m*5/90 - 14m*4/3 - 16m*3 - 12182m*2. Determine c, given that o(c) = 0. -12, -1/2, 1 Let i = 11338/755 - 818/151. Factor 7/2x + ix2 - 18/5x*3 + 3/10. -(x - 3)(6x + 1)2/10 Let g(q) be the first derivative of 0q*2 + 0q*3 + 0q + 2/85q5 + 4 + 3/17q*4. What is j in g(j) = 0? -6, 0 Let w(c) be the first derivative of -148c*3/3 + 400c*2/3 + 176c/3 - 6642. Solve w(s) = 0. -22/111, 2 Suppose -7j = -369 + 169 + 179. Let l(y) be the second derivative of -31y + 0 - 1/42y4 - 2/7y*2 + 1/7y*j. Factor l(p). -2(p - 2)(p - 1)/7 Let c(y) = -13y*2 + 11y - 21. Let r be c(6). Let w = r - -423. Find m, given that -3/5m5 + w + 0m*2 + 9/5m*4 + 0m - 6/5m3 = 0. 0, 1, 2 Factor 1173a*3 - 536a + 62a2 + 832 + 1026a*3 - 2200a*3. -(a - 52)(a - 8)(a - 2) Let -645t*2 + 354t*2 + 279t*2 + 15t*3 - 3t = 0. What is t? -1/5, 0, 1 Suppose 3u = -0u + 4c + 6, c = u - 2. Factor -v2 + 0v + 2v + 4v2 - vu + v - v*3. -v(v - 3)(v + 1) Let j(h) be the first derivative of -h3/5 - 423h*2/5 - 843h/5 - 5690. Factor j(t). -3(t + 1)(t + 281)/5 Let n(z) be the third derivative of 1/120z6 + 0z*4 + 1/210z*7 + 0z*3 - 97z*2 + 0z*5 + 0 + 1/1344z*8 + 0z. Find q such that n(q) = 0. -2, 0 Let s = 47 - 40. Factor -23u3 + 44u*3 - 11u*3 + 12 - 21u - su3 + 6u*2. 3(u - 1)*2(u + 4) Let i be (-4)/6 + (0 - 64/(-24)). Factor 1662t - 10t*3 - 1638t - 4ti - 4t*4 - 6t*3. -4t(t - 1)(t + 2)(t + 3) Let y(f) = f2 - 5366f - 5372. Let u(p) = -2682p - 2685. Let t(r) = 5u(r) - 3y(r). Factor t(q). -3(q - 897)(q + 1) Let p(z) be the third derivative of z5/90 + 35z*4 + 44100z*3 + 1145z2. Find u such that p(u) = 0. -630 Let v(d) be the second derivative of d7/168 + 19d6/60 + 97d*5/16 + 553d*4/12 + 147d*3/2 - 2d + 29. Let v(f) = 0. Calculate f. -14, -9, -1, 0 Suppose 3l - 2b = -4, -2l - b + 7 + 2 = 0. Let w be 612/(-119) + l/14 + 8. Solve 7q*4 + 6q*2 - 1 + 3/2q*5 + 11q*w - 1/2q = 0 for q. -2, -1, 1/3 Let k(t) be the first derivative of -2t5/45 + 5t*4/2 + 188t*3/27 + 624. Solve k(a) = 0 for a. -2, 0, 47 Let m be 20(21/6)/7. Suppose -5k - m = -f, f - 3f - 8 = 4k. Find d, given that 2d2 - d2 + 2d2 - 9d + fd2 = 0. 0, 3 Let c = 8665/6 - 25991/18. Factor 0y - cy2 + 2. -2(y - 3)(y + 3)/9 Let -21/2k*3 + 3/2k*4 - 303/2k*2 - 270 - 819/2k = 0. Calculate k. -4, -3, -1, 15 Let j(t) be the second derivative of 1/24t4 + 0 - 46t + 0t2 - 3/4t*3 + 9/40t*5 - 1/60t*6. Factor j(r). -r(r - 9)(r - 1)(r + 1)/2 Let a(v) be the second derivative of 2/27v3 - 3 + 9v + 1/54v4 + 1/9v*2. Determine n so that a(n) = 0. -1 What is g in -780/7g + 32/7g3 + 46/7 + 702/7g*2 = 0? -23, 1/16, 1 Suppose 5s - 3w = s + 13, -4 = -4w. Solve -9u5 - 22u*3 - 6u*4 - 6u*s - 12u*3 + 37u*3 + 6u*2 = 0. -1, 0, 2/3 Let c(l) be the first derivative of -25l*6/21 + 58l*5/7 + 48l*4/7 - 880l*3/21 + 272l*2/7 - 96l/7 + 494. Find j such that c(j) = 0. -2, 2/5, 1, 6 Determine b, given that -2b3 + 12/7b + 2/7b5 + 10/7b*4 + 0 - 10/7b*2 = 0. -6, -1, 0, 1 Suppose -8 = 9g - 10g. Suppose -10z = -gz - 6. Determine c, given that -5c*z + 26 - 17c*2 - 6 + 2c*2 = 0. -2, 1 Factor -100/9n + 0 + 10n2 - 8/3n*3 + 2/9n*4. 2n(n - 5)2(n - 2)/9 Let d(t) be the first derivative of 31 - 3/14t4 + 9/14t*2 - 2/7t*3 - 1/14t*6 - 3/7t + 9/35t5. Factor d(f). -3(f - 1)*4(f + 1)/7 Let y(w) be the first derivative of -w*3/3 + 1010w*2 - 1020100w - 3334. Determine i, given that y(i) = 0. 1010 Let x(b) = 5b3 + 11b*2 + 4b - 40. Let r(m) = 15m3 + 33m*2 + 18m - 119. Let v(o) = 4r(o) - 13x(o). Find g such that v(g) = 0. -11/5, -2, 2 Let v(r) = -8r2 + 17r + 3. Let p = -157 - -86. Let s = -74 - p. Let g(m) = -65m2 + 135m + 25. Let o(h) = sg(h) + 25v(h). Factor o(n). -5n(n - 4) Let o(f) = -62f + 11537. Let d be o(186). Find z, given that -2/3z*d - 2/3z*4 - 4/3z + 0 + 2/3z2 + 2z*3 = 0. -2, -1, 0, 1 Let d(m) be the first derivative of -8m*6/3 - 412m*5/5 - 466m*4 - 308m*3/3 + 1700m*2 - 800m + 4630. Determine q so that d(q) = 0. -20, -5, -2, 1/4, 1 Let i(p) be the second derivative of p*5/190 - 423p*4/19 + 715716p*3/19 - 605495736p*2/19 + 2161p. Determine u so that i(u) = 0. 846 Let q(s) = -3s4 - 1. Let b(z) = -20z*4 + 1164z*3 + 2325z*2 + 1162z - 7. Let y(o) = -b(o) + 7q(o). Factor y(a). -a(a + 1)*2(a + 1162) Let z(g) = 2g + 16. Let y be z(-8). Suppose y = 5d - x - 13, -5x + 3 = 3d - 4x. Factor -12 + 3l*4 + 9l*d - 9l*3 - 9l*3 + 2l*3 + 4l*3 + 12l. 3(l - 2)2(l - 1)(l + 1) Let h(o) = -1789o - 59033. Let y be h(-33). Factor yd3 + 2/3d*4 - 2/3d*5 + 0d + 0 + 0d2. -2d*3(d - 3)(d + 2)/3 Factor -9s*2 - 365s + 166s + 24 + 149s. -(s + 6)(9s - 4) Let f(g) be the third derivative of -8/3g4 - 4/15g*5 - 1/90g*6 + 0 + 0g - 3g2 - 5/6g*3. Let v(h) be the first derivative of f(h). Factor v(n). -4(n + 4)2 Let m(b) be the second derivative of -b5/130 - b*4/6 - 2b*3/3 + 40b*2/13 + 2417b - 1. Suppose m(y) = 0. Calculate y. -10, -4, 1 Let y(u) = 3u - 72. Suppose -175q + 185q - 240 = 0. Let a be y(q). Factor a - 3/5c*4 - 24/5c*2 + 3c*3 + 12/5c. -3c(c - 2)*2(c - 1)/5 Let g(w) be the first derivative of -77/26w4 + 2/65w*5 - 2704w + 100w3 + 158 - 1196w*2. Find i, given that g(i) = 0. -1, 26 Let f(h) = 2h4 - h3 + h*2 + 2h + 1. Let g(b) = 5b5 + 33b*4 - 99b*3 - 141b*2 + 218b + 4. Let w(v) = -4f(v) + g(v). Find k such that w(k) = 0. -7, -2, 0, 1, 3 Let t = -5774 + 5777. Let a = -71/6 + 12. Factor -1/3w - aw4 + 1/6 + 1/3w*t + 0w2. -(w - 1)3(w + 1)/6 Let x be (-171)/194/(-18). Solve 100m4 + m3 + 96m4 - m + mx - 197m4 = 0 for m. -1, 0, 1 Find c such that 2/7c*5 + 0c*2 + 0c + 0 - 292/7c4 + 0c*3 = 0. 0, 146 Factor 7921/4 + 89/2x + 1/4x2. (x + 89)2/4 Let d(k) be the third derivative of -k9/7560 + k8/3360 + k7/1260 - k6/360 - 57k*4/8 - 30k*2. Let w(a) be the second derivative of d(a). Factor w(m). -2m(m - 1)2(m + 1) Let s = 59839 - 59821. Solve 0 - 4g4 + sg*3 + 1/3g*5 + 27g - 36g2 = 0 for g. 0, 3 Factor -1/4b*2 - 35/4 - 3b. -(b + 5)(b + 7)/4 Let g(z) = 2	{ "pile_set_name": "DM Mathematics" }
e -4m = -tl + l - 3, 4m = -4l for l. -1 Suppose -10v + 3g = -8v + 4, 2v + 5g = 28. Solve -6 = -4p - p + 4d, 0 = -3p + vd + 2 for p. 2 Let v = 136 + -127. Suppose n - 2 = v. Solve 4y = -p + 15, -4y - 5p + n = -0y for y. 4 Let p(n) = -60n*3 + n. Let x be p(-1). Suppose -35u - 2u = -2u - 1925. Let a = x - u. Solve 0 = -j - aw + 4 + 13, -j + 2 = -w for j. 5 Let o(d) = -4d - 23. Let m be o(-8). Let b(y) = 2y2 + 4y + 3. Let v be b(-1). Let i be 7 + m/(-2 - v). Solve 0 = -ia - 0a + 3z - 12, 0 = z for a. -3 Suppose -f + 29 = 3d, -5d - 4f + 8f = -71. Let v(l) = l - 11. Let r be v(d). Suppose r = -21y + 26y - 95. Solve -2h + 3m = 2h - y, -2h = -m - 9 for h. 4 Let k = 94 + -28. Let o = k - 72. Let u(h) = -3h - 1. Let i be u(o). Solve 3y + 4q = i, -4y + 18 = 3q - 0q for y. 3 Let i = 47 - 51. Let v be (6/i)/((-12)/(-80)). Let a be (v/(-25))/(4/40). Solve ac + 5h = -12, 0c + h = -c - 3 for c. -3 Suppose 534j = -98j - 4295 + 13775. Solve m + 15 = 3b, -3b + 8m - 12m + j = 0 for b. 5 Suppose -12 = 4b, 2b = 3r + 12 - 18. Suppose r = 32u + 8u - 80. Solve -5c - 35 = 4v - uv, -40 = 5c + 3v for c. -5 Suppose -6d = d. Suppose 4q = -dq + 12. Solve -3f = qi + 6, 3f - 19 = i - 5 for f. 3 Suppose -j - 1 = -y + 16, -j + 73 = 5y. Let l = -323714 + 323724. Solve -5q = -2w + y, 3 = 2q + 3w - l for q. -1 Let v(c) = -c2 - 9c - 10. Let a be v(-7). Let p be (-3)/(-1) + (5 - 4). Let j be (4/4)/(2/p). Solve -16 = -4x + 2l - l, -x + a = jl for x. 4 Suppose -6l = -4l. Let d = 13205 - 13203. Solve -dj + lf + 3f = -3, -5f - 12 = -j for j. -3 Let c = -57521 - -57528. Suppose -4q - 5a = -31, 4a + 7 = -2q + 27. Solve -qy + 5g = c, 4y + g - 1 = 5y for y. 2 Suppose 0 = 192u - 189u + 849. Let c = u + 285. Solve y - c = -3q, 1 = -4y + q - 4q for y. -1 Let o = -68 + 73. Suppose -4u + 12 = -2x, -5 = ox - 3u + 4. Suppose x = -0g - 3g. Solve 0 = b + p + 6, 3p + gp = b - 2 for b. -4 Let z be (0 + -1)/(1223/(-1104)). Solve -2l = -zx - 14, 34l - 9 = 2x + 31l for x. -3 Let b(m) = -7m + 42. Let x be b(10). Let i = -23 - x. Solve 17 = 3y + 4z, -y + 0y + 13 = iz for y. 3 Suppose 3d + 118 - 106 = -2q, -5q + 33 = -3d. Solve qx - 20u + 24u = -11, -u = 4x + 6 for x. -1 Let o(f) = -f - 9. Let d be o(-12). Suppose 5c - 4 - 32 = 4v, c - dv - 16 = 0. Let p be -1 + (2 + 4)/2. Solve 4z = l - 1, -pl - c = -5z + l for z. -1 Let q = -132 - -104. Let o = 28 + q. Let c = -1 + 4. Solve 3 = 3s - 0b + cb, o = 2s + 5b + 10 for s. 5 Suppose 3x - 4c = 38, 7x - 2c - 14 = 8x. Solve 5d = 15, d - 10 = -xn + 3 for n. 5 Suppose -8l + 171 = -1421. Let x = l + -194. Solve 0 = -3q + 4r + 6, 0q - 2 = -q + xr for q. 2 Let r be (4/846)/(8/140). Solve 2w + 6 = ry + 4w, 4y = 3w - 9 for y. 0 Suppose -55b + 60b + 10 = 4o + 35, 3o = 0. Solve 0 = -f + 4g - 6, -bf - 2g + 3 + 11 = 0 for f. 2 Suppose 5q - 4v - 50 = 0, -q + 296v + 10 = 298v. Suppose 8 = -4s - 4u, -3 + 2 = 3s - 2u. Let t = s + 4. Solve i + 3p = q, -t = -3p + 3 for i. 4 Suppose 29x - 22x = 0. Suppose x = -c + 6k - 2k, -5c + 15 = -5k. Solve d - 7 = 4i, -i - 3i = c for d. 3 Suppose 3o + 155 = -b, b - 3b = 10. Let d = 70 + o. Suppose -2 = -5q + 3. Solve -d = -5r + z, -r + 2z = -q - 3 for r. 4 Let p be (-196 - -196) + (-1)/((-1)/7). Solve -3s = n - p, -5n + 0 = s - 7 for n. 1 Let z be (-1788)/2235 - 34/(-5). Solve -m = h, 0 = -10m + zm - h + 3 for m. 1 Suppose 0 = 2w - 2 - 2. Suppose 0 = -20y - 88 + 128. Solve 0 = -wn - 5i + 14, -3n + 2i = -y - 0 for n. 2 Let c(z) be the third derivative of z6/120 - z5/30 + z4/12 + z3/2 + 6z2 + 5z. Let v be c(3). Solve 3u = 4t - t + v, 10 = 3u + t for u. 4 Let t be ((-3185)/52)/(-35) - 2/(-8). Solve 12 = -4g, 2g + t = -5v + 4v for v. 4 Let p = 87 - 108. Let y be ((-77)/p - 4)/((-1)/12). Suppose 13 + 3 = yt. Solve 5x - tf = -6, -10 = -2f - 2 for x. 2 Let t be 2/(-4) - 92/8. Let o = t + 20. Let d be o + 0(-1)/5. Solve 0 = 5f + 2k - 10, -4f - k + d = 3k for f. 2 Let l be ((-1200)/(-32))/25(-8)/(-6). Solve -3y = 3m + 3, -3y + 206m = 204m - l for y. 0 Let q(x) be the first derivative of x*2 - 8x + 159. Let j be q(6). Solve -3t + jk - 10 = 0, -5t + 10 = 5k - 20 for t. 2 Let r(y) = y - 7. Let i be r(3). Let o be (2 - 29/i)(-12)/3. Let d = 54 + o. Solve -4g - s = -2s - d, -2g = 2s - 16 for g. 5 Let p(z) = -2z - 7. Let o be p(-6). Suppose -3y = -4b + 796, 2y + 5b + 441 = -128. Let j = -269 - y. Solve ot + 8 = 3i, -5t + 0 = ji + 2 for i. 1 Suppose 0 = 3i - 5t - 235, 5i + 2t - 290 - 81 = 0. Suppose -7p = 18p - i. Solve pr - 4x + 1 = -0, -6 = 2r - 4x for r. 5 Suppose -5o + 88 = 3h, 197o + h = 190o + 104. Solve -3c - 5x = 9, -4c + 2x = -0c - o for c. 2 Let b(v) = v3 - 23v*2 + 10v - 226. Let g be b(23). Let d = 32 - 10. Let x be (-7 - -1)4/(-6). Solve -3m = gt - d, -xm + 9 + 19 = 5t for m. 2 Let j be -3 + (-26)/(-117) + (-7826)/(-18). Suppose c + 429 - j = 0. Solve -v + 3v - c = -d, 3d + 3v - 6 = 0 for d. 1 Let o be 42/28 + (-1)/(-2). Solve n = -k, -3k = -on + 2k - 28 for n. -4 Let l(q) = -6q + 2. Let t be l(-1). Suppose o = -o + t. Let g be 22/8 - 1o/(-16). Solve -3c = gb + 3, 3b + 2b - 1 = c for b. 0 Let d be (4/(-70))/((-2)/(-10))(-848 + 834). Solve 0g + g = n + d, 5 = n + 2g for n. -1 Let u = 19308 + -19304. Suppose -7a = -6a. Solve -4i + 17 = -i + k, i + uk - 13 = a for i. 5 Let f(o) = -8o3 - 119 + 118 + o2 + 2o*2. Let q be f(1). Let h be (q/(-15))/((3 + -2)/15). Solve m = -2b - h, 3m - 19 + 2 = b for b. -5 Let w = 123 - 121. Let a(x) = -3x - 15. Let z be a(-6). Suppose zf - 9 = 3. Solve 0g + g + 3d - 4 = 0, -2g - wd = f for g. -5 Suppose y - 5y = -8. Let z(k) = 3k + 1. Let f be z(1). Solve -2q + 2r + y = -fq, -21 = q - 4r for q. -5 Suppose 5s = -5m + 5, 6m - 4m - 12 = -4s. Let d = s - 2. Suppose -3y + 6 = -d. Solve 2v - 24 = -4i, -3i + 27 - 6 = yv for v. 2 Let s = -134 - -114. Let p be (6/(-4))/(15/s + 0). Solve 3 = 5h - p, 3h = -3y + 6 for y. 1 Let r(v) = -v*2 + 10v + 818. Let i be r(34). Solve ib = -5k - 9 - 12, 16 = -4k - 2b for k. -5 Let w = 1071 + -1067. Solve 5i - 3i - 4 = 4o, -wi - 4o = -20 for i. 4 Let q be ((-5)/(-2))/((-20)/(-48)). Suppose 5o = -q + 16. Suppose 0 = -r + o + 2. Solve -2k - 3k = -b, 0 = -rb - k for b. 0 Let y = 49 + -44. Let n = -18 - 123. Let z = 141 + n. Solve -yb + 3g - 4g - 15 = z, 0 = 2b - 5g - 21 for b. -2 Suppose 0 = -6h - 46 - 38. Let f be 1/((-7)/h) + 2. Solve -fi = i - 4j + 20, -3i + 3j = 15 for i. 0 Let l = 5 - 1. Suppose 0 = 5q - 2p - 53, -332 + 314 = -3p. Solve lh + 16 = n, 4h - h + q = n for h. -3 Let l(h) = -3h2 + 14h + 10. Let p be l(5). Let c be p + (-2 - -1) - (5 - 6). Solve -3x + cx = 4s - 6, 2x - 9 = -s for s. 3 Let z = -10 - -22. Let u = 9101 - 9097. Solve -12 = -ux, -3k + 2x + z = x for k. 5 Suppose 0 = -7q + 6q + 3. Let h = 44 + q. Suppose -9v = -h - 7. Solve -3f = -3w - v, 4f - 14 + 0 = -2w for f. 3 Let v be 65/30 + -4 + 1. Let q(w) = -w3 - 2w*2 - w + 3. Let u be q(v). Solve -j - 2j = 6, uj = -a - 13 for a. -3 Let u be (-1176)/(-198) - 11/((-1815)/10). Solve 8g - 2h = 3g + 24, -3g = 3h - u for g. 4 Let h(o) = o*2 + 37o - 74. Let n be h(-39). Solve 10j + 5f = 6j + 18, -10 = -nj - f for j. 2 Suppose -16y + 7 - 7 = -0. Solve y = -v + 5l - 23, -4v - 1 = 4l - 5 for v. -3 Suppose 0 = 65p - 1323 - 1342. Solve 0 = 2n - 10, -5d - pn = -39n - 20 for d. 2 Suppose 50 - 10 = 20t. Solve -5y - 7 = tn, 3y + 5 = -4n + 2n for n. -1 Suppose 354r - 349r - 13 = 2n, 2n = -5r + 37. Solve -2q - 2x = -4, 19 = -3q + rq + 5x for q. -3 Let c(n) = -5n - 30. Let w be c(-7). Suppose 0 = j - 2a, -3a = -419j + 419j. Solve g - 9 + j = -wb, -g + 3 = 2b for b. 2 Suppose -817 - 1199 = -322w + 238. Let u = 11 - 8. Solve 4n - ul - w = -42, -3n - 10 = l for n. -5 Let l(q) = 1263q - 17 - 636q - q*2 - 647q. Suppose -76 = 6z - 2z. Let o be l(z). Solve -5t + or = 14, -t = 6r - r - 8 for t. -2 Suppose 81a - 116 = 46. Solve -9o - 5c = -o + 7, ao - 3c = 11 for o. 1 Suppose -231m + 223m + 40 = 0. Suppose 2*c	{ "pile_set_name": "DM Mathematics" }
1 - i = 0 for y. 4 Let b be 129/9 - (-8)/12. Solve b = -5v - 5 for v. -4 Let v be 7 - 9/((-18)/(-4)). Solve 20 = 5t - v for t. 5 Let l(k) = -2k - 3. Let a be l(-4). Solve -4g + 3g = -a for g. 5 Let a(i) = i + 6. Suppose -2t + 4 + 4 = -4x, -5t + x = 7. Let r be t(1 + 0) + 2. Let z be a(r). Solve -2 - z = 4p for p. -2 Suppose 4a = q - a - 20, q + 4a = -16. Solve qr = -r - 5 for r. -5 Suppose -7u = -3u - 60. Suppose 4b = 2m + 20, 2m - u = -3b + m. Suppose -bt = -t. Solve 3v = -tv - 3 for v. -1 Let w be 498/4 + (-4)/(-8). Let k = -74 + w. Suppose 2u = -u + k. Solve 5h = -2 + u for h. 3 Let u = 5 + -7. Let h be (1 + -1)u/4. Let l be (4/(-3))/((-2)/6). Solve lc + hc = 0 for c. 0 Let w = -9 - -11. Let b be (-10 + 10)w/(-4). Solve 2 = -2r - b for r. -1 Let c = 2 - 3. Let u be (1 - 0) + (-5)/c. Suppose -4d - 4k = -4, -4k = -3d + u + 4. Solve dy = -8 - 2 for y. -5 Suppose -5b + i - 2i = -15, 0 = -2b + 2i + 6. Suppose 7d - 1 = -2q + 2d, 0 = -q + 5d - 7. Let j be 1/((4 + q)/4). Solve b = -m + j for m. -1 Let a = 2 + 4. Solve 0 = 2f - af for f. 0 Suppose -2o + o + 4 = 0. Let h(j) = j. Let k be h(o). Solve 8 + k = 4l for l. 3 Let p be 120/(-18)(-3)/2. Solve -2 = -4w + p for w. 3 Let m = -12 + -30. Let n be (-6)/4m/9. Solve -3c + 1 = n for c. -2 Suppose -14x = -17x + 66. Let h = x + -19. Solve 0 = -3f - 6 - h for f. -3 Let f be (-74)/(-26) - (-4)/26. Let w be (-2 + f)/((-3)/(-6)). Suppose -wb = 2b - 24. Solve 0 = 2j + j - b for j. 2 Let z be 6/4 + (-3)/(-6). Solve -zo + 6 = -4o for o. -3 Let p(m) = m*3 - 5m*2 - 5m - 3. Let q be (9 + -6)(-2)/6. Let d(g) = -6g. Let h be d(q). Let k be p(h). Solve kl = -2l for l. 0 Let k(b) = -3b2 + b + 1. Let h be k(-1). Let n = h - -3. Suppose -2c - 6 = -3j, n = 2c + 2c + 4j - 28. Solve m + 2 + c = 0 for m. -5 Let v be 3 + 2 + (2 - 2) + 0. Solve 2x = 1 + v for x. 3 Let q(a) = -a2 + 7a + 10. Let t be (2 - 1) + 2 + 1. Suppose -4v = 3j - 26, 2v = tj - 5j + 14. Let k be q(v). Solve 2p + k = -0 for p. -1 Let i(g) = g*2 + 10g - 4. Let u be i(-10). Let r be 207/45 + u/(-10). Solve 0 = rm - m + 4 for m. -1 Suppose -10 = -5a, 2 = -l - 2a + 7. Let f(h) be the third derivative of -h5/60 + h3/6 + h2. Let g be f(l). Solve gp + 10 = 5p for p. 2 Let x(l) be the third derivative of -l4/24 + 11l*3/6 + 5l*2. Let j be x(10). Solve -a = 3 + j for a. -4 Suppose -g = g. Solve gi = -i + 3 for i. 3 Suppose 8c + 15 = 11c. Solve -3w = -cw for w. 0 Let m = -68 + 68. Solve mn - 2n - 2 = 0 for n. -1 Let t(p) = 5p2 + 5p - 12. Let m be t(-4). Let d be (-2)/(-4)-11-6. Let r = m - d. Solve 0w = -3w - r for w. -5 Let l = -73 + 76. Solve -lx + 8x = -25 for x. -5 Let k = 0 + 21. Let s = k + -7. Solve -6 - s = 5o for o. -4 Let k(j) = j2 + 11j + 20. Let g be k(-9). Solve 4o - 5o + g = 0 for o. 2 Suppose -4x - 2 = -26. Let i(c) = c3 - 7c*2 + 6c + 5. Let k be i(x). Solve -kq = -q - 4 for q. 1 Suppose 5n = -3t, -2n = 3n + t. Solve nx - 3 = 3x for x. -1 Suppose 5g = 25, -5w - 18 - 42 = g. Let f(v) = v2 + 14v + 18. Let b be f(w). Solve 19 = -bq + 4 for q. -3 Let k(p) = 3p - 3. Let v be k(3). Let i = 0 - -3. Suppose ix - 2 - 4 = 0. Solve -xl = -vl - 12 for l. -3 Let s(j) = -j2 - 7j + 7j + 2. Let r be s(0). Let m = -2 + r. Solve ma + 12 = 4a for a. 3 Let l = 31 + 4. Solve -5v = 10 - l for v. 5 Suppose -5c = -0c. Suppose ca - a = -2. Solve -a = -4k + 2 for k. 1 Suppose -3h + 0h = 0. Let z(f) = f*2 - 8f + 1. Let j be z(8). Let v be 0/(-2(0 + j)). Solve h = -5q - vq for q. 0 Suppose 0 = 10i - 4i - 6. Solve -5 = 2x - i for x. -2 Let w be (4/(-8))/((-2)/(-4)). Let j(g) = g*2 - g - 1. Let x be j(w). Solve -2 + x = -r for r. 1 Let u be 3((-4)/(-2) - 1). Let r = -1 + u. Let l be ((-15)/6 + 2)-2. Solve -g - r = -l for g. -1 Let a = -6 + 12. Let d be (40/a)/((-2)/(-6)). Let r = 75 + -71. Solve 9b = rb + d for b. 4 Suppose u = -0 + 1, 0 = 4l + u + 7. Let f = l - -4. Solve z - 4 + f = 0 for z. 2 Suppose 6 = 2s - 0. Let p be 2/(-6) + 1/s. Suppose g = -pg + 5. Solve 0 = -ga - 15 - 0 for a. -3 Let o be -1 + 3/(3 - 0). Suppose 21 = 2g - oy + y, 2g + 4y = 30. Solve 4r - 7 = g for r. 4 Suppose 6 = x + x - h, -5x + 17 = -2h. Suppose -b + 2s = s + 4, s = xb. Solve -9 - b = -2f for f. 5 Let c(z) = 3z - 18. Let v be c(6). Solve q + 3 + 2 = v for q. -5 Suppose 10 + 5 = a. Let h = -21 + a. Let z = -3 - h. Solve zk = 7k + 16 for k. -4 Let u be 3/(((-9)/6 + 1)-2). Solve -8x = -ux for x. 0 Let n = 0 - -2. Let r = 70 + -68. Solve o + n = -r for o. -4 Suppose 5j - 2v = 5, v - 6v = 0. Let q be (20/8)/(j/2). Solve 0 = qn - 0 + 5 for n. -1 Let z(o) = o2 - 2. Let b(p) = p3 + 13p*2 + 13p + 10. Let f be b(-12). Let y be z(f). Solve yj + 0j = 0 for j. 0 Suppose 0 = j - 3g - 21, -5j + 6j + 3g + 9 = 0. Solve -o + j = 10 for o. -4 Let y be 1((15 - 2) + 2). Let a = -12 + y. Solve ar - 4 = -r for r. 1 Let m(o) = o*2 + 6o - 3. Let x be m(-6). Let z(d) = -d*2 - 4d - 3. Let c be z(x). Suppose 5b + 0b = 80. Solve 0 = -ca - 4a + b for a. 4 Let d(z) = z*3 + 6z*2 - 4z + 3. Let n be -8 - ((-3)/1 - -1). Let j be d(n). Let t = j + -17. Solve -5b = -3b - t for b. 5 Let h(q) = q*2 - 7q + 6. Let k be h(6). Suppose -4 = -kt - t. Suppose 3z - 2v + 6 = 0, -5v + 16 = -tz + 1. Solve z = -2d - 0d + 10 for d. 5 Suppose -3m + 4h + 26 = 0, 3m + 2h - 5h = 24. Suppose -p - 5w - m = -0w, -4p = 3w - 10. Suppose -r - 9 = -pr. Solve 4d - 5d - r = 0 for d. -3 Suppose -12 = -s + 3h, -3h - 16 = h. Solve 4x + 0x + 16 = s for x. -4 Suppose s = -s. Suppose -7u + 0 = -35. Solve -5v + 5 + u = s for v. 2 Suppose m = s, 0s - 5s + m = 12. Let f = 7 + s. Suppose 0 = 5w + f - 14. Solve 15 = wu + 5 for u. 5 Let t = 2 - -2. Let z = t + -2. Suppose 2n = zj + 6, 3j = -0j - 3. Solve nm + 0 = 6 for m. 3 Let n be (0 - -28)(-25)/(-100). Solve -n = w - 2 for w. -5 Suppose -2k - 15 = -m, 0 = -2k + k - 3. Suppose 3y = 4y - 2. Solve 0 = yc - m - 1 for c. 5 Let p be (2/3)/(2/69). Solve -3 = -4j - p for j. -5 Suppose 0 = -3r - 3j + 45, r + j = -2j + 5. Let y be (2/(-5))/((-4)/r). Let u = 3 + -3. Solve ud = yd for d. 0 Let i be (-24)/(-84) - 12/(-7). Solve -4a = -ia + 2 for a. -1 Let y(c) = -5c3 + c2 + c. Let h be y(-1). Suppose 5 + 7 = -n - 3b, 2n - hb = 20. Solve nk = -4k + 20 for k. 5 Let q(x) = x - 1. Let m be q(-6). Let d = 11 - 21. Let g = m - d. Solve p = 2 - g for p. -1 Let w = 13 + -13. Solve wy + 6 = 3y for y. 2 Suppose -6y + 2y = 0. Let l be y/(-3)(-2)/(-4). Suppose -21 = 3f + 5z - 8, -18 = -2f + 2z. Solve t + f - 3 = l for t. -1 Let l(s) = -11 + 13 + s2 - s - 2s. Let q be l(2). Solve 3 = -qx - 3x for x. -1 Suppose 0 = -4q + 20, -4j = -3j - 3q + 13. Let k = 1 - -6. Let s = k + -4. Solve 10 = -sh - jh for h. -2 Let g = 96 + -78. Solve -20 = -14l + gl for l. -5 Let u = -90 - -121. Solve -u = -5i - 6 for i. 5 Suppose -4x + 6 = -x. Let z(v) = -v*2 + 4 - xv - 5 + 2v2. Let p be z(-1). Solve pu - 4 = -2u for u. 1 Let s = 6 + -2. Suppose so + 6 = 14. Suppose ol + 5 = 7l. Solve d + 0 = l for d. 1 Suppose -y + 16 = 3y. Solve 0 = 3l + l + y for l. -1 Let b be (-2)/40/(-1). Let z = b - -2. Solve 9 = zw + 3 for w. 3 Let t be (4/(-2) - 3)/(-1). Suppose -6u + 4 = -tu. Solve -b + 0b = u for b. -4 Suppose 5o - 7 = 2g - 23, 0 = -5g + 3o + 21. Suppose 0n - 12 = -gn. Suppose -r + 16 = -9k + 4k, 3r - 62 = k. Solve r = 5j - n for j. 5 Let h be -2(-1 + 9/(-6)). Suppose 7 = 4s + 2c - hc, 3s - 6 = 2c. Solve -so = -2o for o. 0 Let k(y) be the first derivative of 0y + 1/4y4 + 0y*2 - 1/3y*3 + 4. Let o be k(1). Solve -i - 4 = -o for i. -4 Suppose -13 = -3b + 2f, 6b + 4f - 1 = 3b. Let h be (1/1)/((-1)/(-2)). Let q(x) = -x*3 + 3x*2 - 2. Let c be q(h). Solve cn + bn = -25 for n. -5 Let h = -4 + 7. Let f(x) = hx*2 - 4x*2 + 10 + 4x + 2x. Let w be f(7). Solve wa - 8 = a for a. 4 Let o = -14 - -9. Let u = 8 + o. Let s(r) = -r*3 - 11r*2 - r - 4. Let q be s(-11). Solve -ub + 12 = -qb for b. -3 Let i(q) = -q - 3. Let d be i(0). Let g = d - 3. Let v be 3(-1)/g10. Solve l + 0l - v = 0 for l. 5 Suppose -6 = -3*t + 9.	{ "pile_set_name": "DM Mathematics" }
cending order. 5, n, j Let h(b) = b3 - b2 - b + 3. Let s be h(0). Suppose -c - 10 = -sc. Let q be (-1)/4(-5 + 1). Put -5, c, q in ascending order. -5, q, c Let w = -643/5 - -129. Put -2, w, 2/9, -4 in descending order. w, 2/9, -2, -4 Let k be ((-3 + 5)/10)/1. Let g = -0.37 - -0.07. Sort g, 4, k. g, k, 4 Suppose -2a = -0a - 10. Let t = 2 - 2. Suppose m = -tm. Put a, m, 4 in decreasing order. a, 4, m Suppose -i = -4i. Let o(h) = -1 - 3h + 3 + 3. Let q be o(3). Put -5, i, q in ascending order. -5, q, i Let u be (-2)/12 - 8551/(-42). Let b = -203 + u. Sort -0.1, b, -0.3 in descending order. b, -0.1, -0.3 Suppose 3s - 8s = -15. Let y be (-10)/(-3) - (-7)/(-21). Suppose yv = -3l + 12, -2v - 4l = -0v - 8. Put s, -1, v in descending order. v, s, -1 Let v = -0.3 + -2.7. Suppose 2q - 5 = -3q. Let g be (1 - 2)/(q/(-5)). Put v, 1, g in decreasing order. g, 1, v Suppose 2m + 14 = 4d, -18 + 0 = -3d + 3m. Let n = 48 + -46. Put n, 0, d in increasing order. 0, d, n Let i(h) = 0h2 - 5h*2 + 3h + 3h - h3 + 5. Let q = 5 - 11. Let x be i(q). Sort -4, 1, x in increasing order. -4, 1, x Suppose 5c = -10 + 5. Let p = 0 - -1. Sort p, c, 5. c, p, 5 Suppose 3c = 4c. Put -5, 1, c in increasing order. -5, c, 1 Suppose -2i + 0i = 8. Let g be (-1 + 3)(0 - -1). Put i, g, 5 in decreasing order. 5, g, i Let u = 1 - 1. Let o(k) = k3 - k2 + k + 5. Let v(d) = -d3 - d - 1. Let z(i) = -o(i) - 2v(i). Let f be z(u). Put -5, f, 1 in decreasing order. 1, f, -5 Let m(b) = b + 7. Let p be m(-5). Suppose 14 = 2a + pw, 5a + 3w + 0w - 29 = 0. Suppose 3z - 1 = 14, 5i = -az + 10. Sort -5, 4, i in decreasing order. 4, i, -5 Let j(l) = l*2 + l + 2. Let v be j(-3). Suppose 0 = q + 7 - 4, -g - v = 3q. Sort 0, 2, g in ascending order. 0, g, 2 Suppose p - 4b = -13 + 1, -2b = 2p + 4. Sort -5, p, 5 in decreasing order. 5, p, -5 Let o = -6.1 - -6. Let j = 0.5 - 0. Sort j, 5, o in increasing order. o, j, 5 Let q(d) = d3 - 12d*2 - 6. Let u be q(12). Let o = u - -7. Sort -2, o, 2 in increasing order. -2, o, 2 Let b = 39 + -36. Sort b, -5, -1, 1. -5, -1, 1, b Let n(h) = h + 2. Let m be n(3). Let d = 3 + -2. Put m, -5, d in ascending order. -5, d, m Let y be ((-10)/(-8))/(1/(-4)). Let u be ((-6)/5)/(-4 - (-74)/20). Sort y, u, -4. y, -4, u Suppose -2 = 2x - 10. Put -5, 1, x in increasing order. -5, 1, x Let s = -149/35 + 34/7. Sort s, 0.3, 1/6 in descending order. s, 0.3, 1/6 Suppose -2h + 21 = 15. Put h, -2/3, 4/11 in descending order. h, 4/11, -2/3 Let t = -0.3 + 0. Let g = 0 + t. Let v = -0.4 + -2.6. Put g, 1, v in increasing order. v, g, 1 Let y(g) = -g2 - 5g + 2. Let d be y(-5). Sort d, -2, 6 in decreasing order. 6, d, -2 Suppose -5d = -d - 4. Let o be 3/(6/(-8)-2). Sort -1, d, o in decreasing order. o, d, -1 Let a(r) = -r*3 - 7r*2 + 7r - 4. Let k be a(-8). Put 1, k, -4 in decreasing order. k, 1, -4 Let g = -16 - -13. Put -2, g, -5 in ascending order. -5, g, -2 Let g be 2/(-2) - (2 + -6). Suppose 11a = 12a + 3. Sort g, 0, a. a, 0, g Suppose -2i - 9 = -3. Suppose -4g + 28 = 2c, -5c - 4g + 15 = -5g. Put i, 0, c in descending order. c, 0, i Suppose 4 = o + 9. Let b = o - -5. Sort 2, b, 4 in decreasing order. 4, 2, b Let k = -11/9249 - 21383545/120237. Suppose 2l + 371 = -3m, -3l - 3m = 504 + 45. Let c = l - k. Sort 0.4, c, 1. c, 0.4, 1 Let b(r) = -r*3 - 7r*2 + 2r + 11. Let a be b(-7). Let j be 2/(-4) + 2/(-4). Put a, j, 0 in descending order. 0, j, a Suppose 2c = -1 - 5. Let l be ((-4)/5)/((-9)/(-45)). Put l, c, -5 in increasing order. -5, l, c Let x = 0.01 - -0.29. Suppose 5v + 15 = -0v. Put v, x, 0.4 in descending order. 0.4, x, v Let i = 46 - 21. Suppose 0 = 6o - o - i. Put -3, 3, o in descending order. o, 3, -3 Let u be (1 - 0)/(-1 + -5). Put -2, -6, u in decreasing order. u, -2, -6 Let b(s) = s + 3. Let d be b(-5). Suppose 13 = 7v - 1. Sort v, d, -3 in descending order. v, d, -3 Let g = 77 - 769/10. Let k = 2 - 5/3. Sort 1/7, k, g in descending order. k, 1/7, g Suppose 28 = -3x - 5w, -4x + 2x - 4 = -4w. Let v = x + 9. Let t be v/(-6)(1 - -9). Sort t, -3, 0 in increasing order. t, -3, 0 Let a = -6 - -5.6. Let p = 0.4 - 0.9. Let y = -0.4 - p. Sort y, a, 5 in ascending order. a, y, 5 Let p = 0.6 - 1.6. Sort -2, 0.5, p. -2, p, 0.5 Let y be (0 + -1)(3 - 4). Let r be 4/(-6)(-60)/(-8). Sort r, y, 10. r, y, 10 Let a be (2/(-4))/(1 + 25/(-30)). Sort -7, 6, a in ascending order. -7, a, 6 Suppose 3u + 2v - 93 = 0, -4u + 94 = 2v - 30. Suppose -5n + u = -29. Let t be (-6)/(-9) - n/45. Sort -1, -0.4, t in increasing order. -1, -0.4, t Let o = -4 - 1. Let v be o + (-2 - (3 - 3)). Let l(n) = -n - 7. Let x be l(v). Put 5, -4, x in descending order. 5, x, -4 Let k(l) = -3l3 - 2l*2 + 4l - 3. Let h be k(1). Put h, 4, -2 in increasing order. h, -2, 4 Let y = 4.4 + -4. Let c = -0.0379 - -0.0379. Sort -1, c, y in increasing order. -1, c, y Suppose -3f = 3q + 36, -2q + 5q + 40 = f. Sort 2, -1, q in decreasing order. 2, -1, q Suppose -j - 3j = -12. Suppose -1 = -5b + 4. Put b, j, -3/5 in descending order. j, b, -3/5 Let n = 0.05 - 3.05. Let v = -7 - n. Let x = 4.95 - 5.95. Put x, 0, v in ascending order. v, x, 0 Suppose -8 + 22 = 2y. Let x = y - 11. Sort 1, x, 3. x, 1, 3 Let v(p) = -4p + 33. Let o be v(8). Sort 3, 8/5, o in ascending order. o, 8/5, 3 Suppose -4m = 3m - 21. Put m, 0, 4, 1 in ascending order. 0, 1, m, 4 Let k be ((-3)/(-5))/(13/65). Put 0, -4, k in increasing order. -4, 0, k Suppose 3 - 2 = -d. Let z be (-2)/8 + 4/16. Sort z, 1, d in decreasing order. 1, z, d Suppose 0 = 2v - 5z - 3, z - 60 = -5v - 4z. Let t = v - 4. Suppose 3o = 5a - a + 8, 2o - 4 = 4a. Sort o, -1, t in ascending order. -1, o, t Let v be 3/((-6)/(-8)-2). Put -33, -4, v in ascending order. -33, -4, v Suppose 6 = -b + 2. Let r = b - -4. Put -1, 5, r in ascending order. -1, r, 5 Let g(y) = 5y*3 - 2y*2 + 1. Let m be g(1). Suppose -2w - 3w = 5. Suppose -5h = -h - 4. Put w, m, h in decreasing order. m, h, w Suppose -4w - 12 = -4b, -5w - 1 = -b + 6. Suppose 0 = -5v - bz - 2z + 5, -5z = 0. Put -2/13, v, -5 in increasing order. -5, -2/13, v Suppose 5d = 2l - 49, 6 = d - 5l + 2. Let s = d + 9. Let a = -0.1 + 0.1. Sort a, s, -4. -4, s, a Let j be (-45)/251/3. Let b = -5 - -1. Suppose -5i - 4m = -10, -8 - 12 = -4m. Put b, j, i in increasing order. b, i, j Let p = 22 - 22.4. Sort p, -4, -0.3 in ascending order. -4, p, -0.3 Let y(m) be the third derivative of m*5/60 - 5m*4/12 - 5m*3/6 - 4m*2. Let c be y(10). Sort -3, c, -1 in increasing order. c, -3, -1 Suppose 5s = 5, -2s + 62 = 5v - 2v. Sort 0, -3, v in decreasing order. v, 0, -3 Let v(s) = s + 10. Let q be v(-7). Suppose 2h = 5 - q. Put 0.04, -3, h in decreasing order. h, 0.04, -3 Let n = -3 + 8. Let i = n + -6. Sort 3, i, 0.1 in decreasing order. 3, 0.1, i Let k = -36 - -33.1. Let m = 0.1 - k. Sort -1/3, m, 7 in descending order. 7, m, -1/3 Suppose 15 + 9 = -4z. Let r(v) = -v + 2. Let w be r(z). Suppose 0 = 3q + 2 - w. Put 3/4, q, -2 in descending order. q, 3/4, -2 Let v(f) = 2f2 - 3f + 3. Let x be v(2). Let c be ((-2)/4)/((-3)/(-24)). Sort x, 2, c in ascending order. c, 2, x Let y(z) = z*3 - 6z*2 + 2z - 2. Let h be y(5). Let o be (2 + (h - -2))-1. Suppose 0 = 4f - 20, 2g + g = 5f - o. Sort 2, g, -2. -2, 2, g Suppose 0 = -0q - 4q + 16. Sort 0.5, q, -4 in decreasing order. q, 0.5, -4 Let l be -4 + 12 + (-1 - 1). Let v = l - 1. Sort -2, 0, v in decreasing order. v, 0, -2 Suppose 5f = -3s - 2, -6s + 8s - 4f - 28 = 0. Sort 1, s, -4. -4, 1, s Let o = -6.89 - 0.11. Let k = -6 - o. Sort k, 0.5, -1 in descending order. k, 0.5, -1 Let o = 1.16 + 0.14. Let x = -6.3 + o. Sort x, -2/7, -4 in ascending order. x, -4, -2/7 Suppose 3q - 5f + 9 = -7, 0 = -4q - 4f. Let c(l) = 4l - 5. Let h be c(2). Sort h, -3, q. -3, q, h Let s = 38 - 344/9. Let n be ((-3)/5)/3 - 0. Let v = 163 - 168. Put n, v, s in ascending order. v, s, n Let h = -105.5 - -105. Sort h, -2/9, 0.17, 1 in increasing order. h, -2/9, 0.17, 1 Let b(z) = z*2 - 7z + 5. Suppose h + 3u = -8, -7h + 2h + u = -40. Let g be b(h). Sort g, -5, -1 in descending order. g, -1, -5 Suppose 0 = 5t + 1 - 31. Suppose -2l + 4l - 4j - 28 = 0, l + 2j + t = 0. Suppose l*m - 11	{ "pile_set_name": "DM Mathematics" }
-6752/320845 or -1? -6752/320845 Do 28437770 and 28437759 have the same value? False Are 1 and -2/462879905 unequal? True Is 86044 equal to 86059? False Do -8/11 and 426783 have the same value? False Is 2 less than 13114/15025? False Is -0.1050978 equal to -3? False Which is greater: -1980682/15 or -132045? -132045 Is -3172004 at most -3172015? False Which is greater: -29810 or -32040? -29810 Are 17768488/3 and 5922828 non-equal? True Which is bigger: -477900 or -477902? -477900 Is 22.628 at most as big as -62? False Which is greater: 374832 or 374598? 374832 Does -25249 = -13895? False Is -798/278449 >= 0? False Is -1.219 at most as big as -191862? False Which is smaller: 888798 or 888741? 888741 Which is smaller: -4 or -3018/775? -4 Is -58309605 less than -58309604? True Is 56407750 at most as big as 56407754? True Is -3192488 <= -3192441? True Which is smaller: -20638 or 273? -20638 Which is smaller: 0 or 118/249027? 0 Is 845/33427 less than 1? True Is -132.8 at least 41.3115? False Which is greater: 17259 or 1782? 17259 Which is bigger: 0 or 64/22517? 64/22517 Which is smaller: 0 or 9123073? 0 Is 5 at least 2045/528? True Do 24015357 and -0.1 have different values? True Which is bigger: -1530 or -86997? -1530 Is -55919 smaller than -42401? True Which is greater: -48772988/17 or -2868999? -2868999 Are -195761 and -195726 equal? False Which is greater: -18356050 or -49? -49 Which is greater: 26033/657 or 41? 41 Are -33 and 5.9373 unequal? True Which is bigger: -537336 or -537346? -537336 Is -7998278 equal to -7998308? False Which is greater: 8 or 4107661? 4107661 Which is smaller: -1219/22741 or 0? -1219/22741 Which is smaller: -5353 or -50? -5353 Is 0 less than or equal to -2/3916484829? False Which is bigger: 850274/99 or 8590? 8590 Which is smaller: -9 or -111864/12103? -111864/12103 Which is smaller: 550622372/3 or 183540792? 550622372/3 Is -488692739 less than -488692739? False Is 1 at most as big as -407/34950? False Is 26424862 greater than or equal to 0? True Which is greater: 3568/15925 or -2/9? 3568/15925 Is -1/5 >= -13400366? True Which is greater: 0 or -104/3161555? 0 Which is smaller: 14800 or 14792? 14792 Is 0 >= -2/281414687? True Which is greater: -164194 or -164185? -164185 Which is smaller: 6194 or 729? 729 Which is smaller: 17219303 or 17219304? 17219303 Do -1549881 and -1549856 have the same value? False Is 151856342 smaller than 151856342? False Which is greater: 466 or 1/52247? 466 Is 6 equal to -2322505? False Is 2682 at least as big as 3230? False Is 7841939 at most as big as 7841960? True Is 485 greater than or equal to 482884? False Which is smaller: 26414545 or 26414546? 26414545 Is -1 greater than -1/529550345? False Is 95/162968 greater than 1? False Is 2/13 smaller than -137869? False Which is smaller: -1 or 147/4665001? -1 Is 4 less than 30/97739? False Which is smaller: -85303/660 or -128? -85303/660 Is 3/19 bigger than 79.40772? False Which is greater: -42 or 12/385057? 12/385057 Which is smaller: 0 or 4/22778165? 0 Which is bigger: 1/17 or 69270.2? 69270.2 Is 663220 greater than or equal to 663119? True Is -59 > -5298? True Which is bigger: 11308976 or 11308977? 11308977 Which is greater: -1385098/51 or -27158? -27158 Is 1 less than or equal to 4/33103441? False Which is greater: -170 or -19099/113? -19099/113 Is -15038973 at least -15039081? True Is 3892751/15 > 259516? True Is -1984987 bigger than -63519589/32? True Is 9831645 < 9831663? True Is 0 > -9/122638? True Is 6972989/2 smaller than 3486494? False Is 424500 greater than -19? True Which is smaller: -1 or 399/7992659? -1 Which is smaller: -983177406 or -983177407? -983177407 Which is smaller: 10/129 or -21314? -21314 Is -4473/1068772 at most as big as 1? True Is -2/5 smaller than 11083313/2? True Is -122228 > -122241? True Which is smaller: 410476 or 410151? 410151 Are -866 and 57932 equal? False Are -1507236 and -205 non-equal? True Which is bigger: -3571563/386 or -9254? -3571563/386 Is -133006 less than or equal to -132970? True Is 307 greater than -845/88? True Is -2/11 smaller than 403/135384? True Is -1860 > -3322? True Is 1/65463709 < 0? False Which is bigger: 0 or -4/24420547? 0 Is -2723797 at most -2723845? False Is -40.75528 at least as big as -3/5? False Which is smaller: 1772013 or 40? 40 Is 0.811 != -258422? True Which is bigger: -47989/3 or -9/23? -9/23 Are -187215352 and -187215352 equal? True Is -133/162123 != 1? True Is -3381 >= -6566? True Is -0.06 greater than or equal to -2098.0098? True Is -3974 greater than 3846? False Are -13217 and -14078 non-equal? True Which is greater: 24414 or -47? 24414 Does -537/160024 = 1? False Is -12/1204189 greater than 1? False Is 10 < 1331420? True Is 2753448 at least as big as 2753448? True Is 43584 less than or equal to 44135? True Which is bigger: 1 or 9687/11303? 1 Is 1605/1490942 less than -1? False Are 81960 and 85681 nonequal? True Which is smaller: -0.00995 or 14456? -0.00995 Is -416.9 less than or equal to 17/61? True Which is bigger: -80300/27051 or -4? -80300/27051 Is 33596884/19 at most 1768257? False Is 1/2 <= 16.22565193? True Is 795 less than or equal to 4649? True Is 2290 bigger than -0.24068? True Which is greater: -7935/62 or -129? -7935/62 Is 89832199 greater than or equal to 628825385/7? True Is 121985 != 121533? True Are 5174/149 and -0.23 equal? False Which is bigger: 2/6307649 or 1? 1 Is -20244 smaller than -8143? True Is 0.9378127 bigger than -1? True Is -197730/15763 less than -13? False Is -38 greater than or equal to -175946? True Which is bigger: -907509/7 or -3/2? -3/2 Which is greater: 0 or 2/37649155? 2/37649155 Is 4389808 greater than 4389810? False Does 1183950418 = 1183950419? False Which is smaller: -2187 or 1/2070? -2187 Is 250205/2 less than or equal to 2/5? False Which is greater: -2 or 1183499? 1183499 Which is bigger: -4128 or 38073? 38073 Which is greater: -49 or -405/329? -405/329 Which is bigger: 38/987 or 63/22? 63/22 Is 32/20962697 <= -1? False Are -1805849 and -1805849 non-equal? False Is -178194 not equal to 2/75? True Is -1/3 greater than -1208.37623? True Is 2/63335627 at most 0? False Is -247/107313 at least -1? True Which is smaller: -16935/11521 or -1? -16935/11521 Is -4.74 less than or equal to -12088? False Which is greater: 2 or 1136/1753? 2 Which is greater: 1/16864268 or 0? 1/16864268 Which is smaller: 0 or -5475/58903? -5475/58903 Which is greater: 0.03806 or -1.2442? 0.03806 Which is bigger: 821/103794 or 0? 821/103794 Which is greater: -1.8 or -12019623? -1.8 Is 3432/24491 greater than 0? True Which is smaller: 20789 or 20616? 20616 Which is smaller: 28 or -0.136697? -0.136697 Are 5975757 and 5975755 unequal? True Which is smaller: -10/339263127 or 0? -10/339263127 Is 465699098/7 equal to 66528443? False Is 364874 != 364802? True Which is greater: -111516626 or -111516624? -111516624 Is 2909372 less than or equal to 2909375? True Is -86073 greater than or equal to -86074? True Which is bigger: -3/14347099 or 1? 1 Which is smaller: 1 or 6/4294493? 6/4294493 Which is greater: 31454/735 or 42? 31454/735 Does 1 = -4/30629901? False Are -167728543 and -167728548 unequal? True Are -0.2 and -1052866 unequal? True Is 1 at most as big as 54/30863447? False Are 20480/4541 and 4 nonequal? True Are -13926075 and -13926074 non-equal? True Is 425490 < -41? False Is -598.23 greater than -0.086? False Does -8/50917 = -8.9? False Which is bigger: -44708547 or -44708543? -44708543 Is -5439789 greater than or equal to -5439792? True Which is bigger: 17.55028 or -0.4? 17.55028 Which is bigger: -1274881/30 or -42495? -42495 Are -139.064 and 0.071 equal? False Is -39 less than -22244/559? False Which is greater: -98355062/25 or -3934203? -98355062/25 Are 79 and 94373/1174 equal? False Is -67897 less than -67392? True Is 8922160 greater than or equal to -0.061? True Is 1339 >= 2674? False Is 596440 < 596533? True Is -2958 >= -1444? False Is -76/11 < 28494? True Which is smaller: 1380352 or 1380345? 1380345 Is 237355 less than or equal to -37? False Does 2592/1901 = 1? False Which is smaller: 4/6309105 or 0? 0 Do 52870729 and 52870733 have the same value? False Is -566958335 smaller than -566958336? False Is -82590254 not equal to -3/2? True Is -2003058263	{ "pile_set_name": "DM Mathematics" }
t derivative of -i*4/12 + 157i*3/9 + 320i*2/3 + 644i/3 - 4651. Factor z(g). -(g - 161)(g + 2)2/3 Find n, given that 3599/9n + 1/9n3 + 3481/9 + 119/9n*2 = 0. -59, -1 Find t such that -50/21t*4 - 80/21 + 130/21t*2 - 130/21t*3 + 134/21t - 4/21t5 = 0. -8, -5, -1, 1/2, 1 Suppose -j + 3r = -8, 4j + 5r + 17 = 2j. Let k be j/(-12) - (-20)/(-10) - -2. Factor -1/12z*2 - 1/6z + 1/6z3 + kz*4 + 0. z(z - 1)(z + 1)(z + 2)/12 Let p(r) be the first derivative of -3r2 - 3/2r*4 + 48 + 3/10r*5 + 3/2r + 3r3. Determine y, given that p(y) = 0. 1 Let y(r) be the second derivative of -7r + 1/48r4 + 19/24r*3 + 9/4r*2 - 26. Find g, given that y(g) = 0. -18, -1 Let o(z) be the third derivative of 73z*2 + 0 + 10/3z*3 - 1/10z*5 - 13/12z*4 + 1/12z*6 + 0z + 1/105z7. Factor o(w). 2(w - 1)*2(w + 2)(w + 5) Factor -15/4 + 1/8x*2 - 1/8x. (x - 6)(x + 5)/8 Factor 5135x + 328x2 + 2x*3 - 627 - 27x*3 - 3968x*2 - 843. -5(x - 1)(x + 147)(5x - 2) Suppose 3p = 6, 0 = h + 7p - 2p + 2. Let c be (-5h/(-210))/((-2)/14). Find f, given that -3f*3 + 2f2 + 6 - f4 + 2fc - 13f + 3f2 + 4f3 = 0. -3, 1, 2 Let k(j) be the second derivative of j7/7560 + j*6/1080 + 65j*4/6 + 13j - 8. Let h(g) be the third derivative of k(g). Factor h(l). l(l + 2)/3 Let t(f) = -14f + 27. Let k be t(0). Determine c so that kc3 - 3c*2 + 103c*4 - 106c*4 + 102c*2 + 105c + 36 = 0. -1, 12 Let u(k) = -4k3 - 2k - 2. Let n be u(-1). Let x(f) = f*3 - 5f*2 + 6f - 2. Let r be x(n). Factor -2w2 + rw*2 - 3w3 - w2. -3w2(w - 1) Let y(w) be the third derivative of 1 + 0w4 - 1/4w*5 + 0w*3 + 11/120w*6 + 3w*2 - 13/1050w*7 + 1/1680w*8 + 0w. Factor y(h). h*2(h - 5)*2(h - 3)/5 Factor -963v2 + 1580v*2 + 45 + 19 - 780v*2 + 94v + 5v3. (v - 32)(v - 1)(5v + 2) Let m = 1186283/3 + -395425. Factor 2/3z + mz*4 - 2z*2 + 0 + 0z*3. 2z(z + 1)(2z - 1)2/3 Suppose -r - 21 = -57. Suppose -37z + 28z = -r. Let 22/17a*z + 104/17a*2 + 92/17a*3 + 0 + 16/17a = 0. What is a? -2, -2/11, 0 Let g(w) be the third derivative of w*6/300 - 4w5/75 + w4/4 + 218w2. Determine a so that g(a) = 0. 0, 3, 5 Let k = 4116684/5 + -823336. Let i = -30/13 - -163/65. Find r such that 0 + kr*2 + 0r - ir3 = 0. 0, 4 Let q(d) = 10d*2 + 755d - 705. Let j(r) = r*2 - 2r + 5. Let t(w) = 15j(w) - q(w). Let t(s) = 0. Calculate s. 1, 156 Let c = 506/43 - 60677/5160. Let u(k) be the third derivative of 0k + ck5 + 28k*2 - 7/6k*3 + 5/48k*4 + 0. Factor u(y). (y - 2)(y + 7)/2 Let y = 127/2 + -349/14. Let c = 272/7 - y. Determine z so that -10/7z - 12/7 - cz*2 = 0. -3, -2 Let r(v) = -163v - 98. Let b be r(-8). Let p = -13265/11 + b. Suppose -2/11f5 - pf*2 + 2/11f*3 + 0f + 0 + 1/11f4 = 0. What is f? -1, 0, 1/2, 1 Let -1728d*2 - 396d*4 + 649d*3 + 615d*3 + 2d*5 - 6d*5 + 204d*4 = 0. Calculate d. -54, 0, 2, 4 Let u(q) be the third derivative of 7q*6/120 + 8q*5/5 + 105q*4/8 - 49q*3/3 - 521q2 + q. Factor u(x). (x + 7)2(7x - 2) Let k(r) be the second derivative of r8/40320 + r7/15120 - r*6/720 + 39r*4/4 + 2r - 13. Let f(u) be the third derivative of k(u). Factor f(t). t(t - 2)(t + 3)/6 Let q(n) be the third derivative of -n*8/1176 - 2n7/245 - n6/84 + 8n5/105 + n4/7 - 16n*3/21 + 2n*2 - 803n. Let q(w) = 0. Calculate w. -4, -2, 1 Let j(n) be the first derivative of -2n3/15 - 10n*2 + 208n/5 - 4190. Let j(o) = 0. Calculate o. -52, 2 Suppose 0 = 18z + 6z - 72. Factor -25407b3 - 3b4 - b4 - 32b2 + 25443b*z. -4b*2(b - 8)(b - 1) Let d = -23/297 + 2447/4752. Let z(b) be the first derivative of db*4 - 2b + 15 - 5/2b3 + 9/2b*2. Let z(r) = 0. What is r? 2/7, 2 Suppose -s - 20 = 5v, 0 = -s - 76v + 77v + 4. What is n in -2n2 - 3/4n*4 - 11/4n*3 + s + n = 0? -2, 0, 1/3 Let d(z) be the first derivative of 2z*5/5 + 15z*4/2 + 24z*3 - 256z*2 - 1536z + 5783. Factor d(u). 2(u - 4)(u + 3)(u + 8)2 Suppose -22z - 25728 = 73z - 162z. What is l in z + 3/2l4 - 48l*2 + 48l*3 - 384l - 3/2l5 = 0? -4, 1, 4 Let j(n) = 33n*3 + 121n*2 - 315n + 62. Let d(v) = 5v3 - v2 + v - 2. Let w(q) = -10d(q) + 2j(q). Factor w(l). 4(l - 2)(l + 18)(4l - 1) Factor 1020o - 13200 - 3/4o3 - 3o*2. -3(o - 20)*2(o + 44)/4 Let r(b) = -11b2 - 15b + 3. Suppose 7v + 56 = 3v. Let t(g) = 25g2 - 8g + 1 + g - 51g2 + 21g*2. Let o(n) = vt(n) + 6r(n). Factor o(m). 4(m + 1)2 Let k(d) be the first derivative of d5/45 + 23d4/12 + 43d*3/3 + 63d*2/2 + 5897. Factor k(g). g(g + 3)*2(g + 63)/9 Let s(m) be the first derivative of 0m + 0m*2 - 1/36m*6 + 7/24m*4 + 0m*5 + 3 + 1/3m*3. Find y such that s(y) = 0. -2, -1, 0, 3 Find l, given that 13l*3 - 4l*3 - 189l*2 - 1350 + 432927l*4 - 1065l - 432924l4 = 0. -5, -2, 9 Let h(k) be the first derivative of 5k*6/2 - 146k*5 + 2505k*4/2 - 12380k*3/3 + 11775k*2/2 - 3690k - 201. Solve h(o) = 0 for o. 2/3, 1, 3, 41 Let g = -18 + 22. Suppose -i + 5 = g. Suppose 2u + 12u*2 - i - 19 + 45u + 9u = 0. Calculate u. -5, 1/3 Suppose -2759g = -2761g. Let s(q) be the second derivative of -7q*3 - 1/10q*5 + 8/5q*4 + g - 10q*2 - 35q. Factor s(a). -2(a - 5)2(5a + 2)/5 Suppose 0 = -87m + 82m - 45. Let c be (m/6)/(1/((-2)/12)). Factor 0 - 5/2t + ct2. t(t - 10)/4 Suppose -774/17r + 232/17r*2 - 1620/17 - 14/17r*3 = 0. What is r? -10/7, 9 Let j = -80562/13 + 161189/26. Determine u, given that -1/2u*2 + 0 + ju = 0. 0, 5 Let t(x) be the third derivative of x*5/24 + 515x*4/48 + 1417x*2. Let t(z) = 0. Calculate z. -103, 0 Let v(d) = -11d - 64. Let j be v(-7). Let -3b3 + 43b*2 - jb*2 - 591 + 591 = 0. Calculate b. 0, 10 Find y such that -5y*3 - 137y - 413 + 792 - 3y3 - 379 - 1097y*2 = 0. -137, -1/8, 0 Factor 73s*5 + 3s + 3s4 - 3s*2 - 38s5 - s - s3 - 36s5. -s(s - 2)(s - 1)2(s + 1) Let z(c) be the first derivative of 5c3/3 - 195c*2 - 1654. Factor z(o). 5o(o - 78) Suppose 16/5 + 2/5b*4 - 16/5b*3 + 42/5b*2 - 44/5b = 0. Calculate b. 1, 2, 4 Let f(n) be the third derivative of 0n3 + 0n + 1/600n6 + 0n*4 + 7/100n*5 + 0 - 27n2. Factor f(d). d2(d + 21)/5 Let x be ((-3312)/288)/(2 + 1 - (-2 + 7)). Factor 7/4r*2 - xr + 3/2. (r - 3)(7r - 2)/4 Factor -11 + 3/2x2 - 263/4x. (x - 44)(6x + 1)/4 Suppose 606c2 - 7c*3 + 293c*2 + 4c*3 + 70c*2 - 18638 + 96401 - 78729c = 0. Calculate c. 1, 161 Let u = 179297/5 + -35859. Factor uy2 + 32/5 - 34/5y. 2(y - 16)(y - 1)/5 Let p(n) be the first derivative of -3n4 + 56n*3 + 50n*3 - 69n - 168 - 39 - 11n3 - 102n*2. Factor p(b). -3(b - 23)(b - 1)(4b + 1) Suppose 5w = -5y + 20, -4w + 16 = -487y + 489y. Let c(r) be the third derivative of yr3 + 0 - 11r*2 - 1/12r*4 + 1/30r*5 + 0r. Factor c(a). 2a(a - 1) Let k(m) = -2m2 + 2m + 1. Let x be k(3). Let t be (-99)/x - (-4 + 8 + 1). What is n in n*3 + 1/3n*t - 1/3n*5 + 0 - 2/3n - 1/3n2 = 0? -1, 0, 1, 2 Let b(x) be the second derivative of -x5/20 + 487x*4/15 - 12623x*3/2 - 7605x*2 - 72x - 1. Factor b(f). -(f - 195)*2(5f + 2)/5 Let n(x) be the first derivative of -4x*3/3 - 66x*2 - 728x - 2036. Factor n(k). -4(k + 7)(k + 26) Determine w, given that -2/9w2 - 436/9 - 146/3w = 0. -218, -1 Let h(f) be the first derivative of -3/2f4 + 8/3f*3 - 76 + 12f + 13f2. Let h(b) = 0. Calculate b. -1, -2/3, 3 Find f, given that -450f*2 + 2f*4 + 21f*3 + 127900f - 270 - 127225f + 4f*3 + 18f4 = 0. -6, 3/4, 1, 3 Let k(r) be the third derivative of r7/1155 - 3r6/220 + r5/30 + 7r*4/44 - 2r*2 + 2r - 582. Solve k(p) = 0. -1, 0, 3, 7 Let u be (6/(-4))/(27/(-360)). Solve -4z2 + 5z*5 - 40z + 35z3 - 20 + uz*4 + 5z4 - z2 = 0 for z. -2, -1, 1 Let t(p) = 11p + 145. Let c be t(-13). Suppose 2n*3 + 7n*4 + 8n*2 - 12n - 6n4 - 3n*4 - 4n + cn3 = 0. What is n? -2, 0, 2 Factor -72/5 - 3h*3 - 222/5h - 111/5h2. -3(h + 3)(h + 4)(5h + 2)/5 Solve 20u*5 - 128u - 52u4 - 5u*3 - 32u*3 - 3823819u*2 - 11u**3 + 38	{ "pile_set_name": "DM Mathematics" }
to ml + s + xl*3 + nl*2 and give n. 1 Express (-2 + 3 - 2)(1001 - 1001 + 50t)(25t + 0 + 1 - 29t) as u + jt + gt*2 and give g. 200 Express 408h*3 - 816h*3 + 406h*3 - 161h*2 - 7h*2 in the form jh*3 + ah*2 + kh + w and give a. -168 Rearrange (-228 - 33 - 49)(-3 + 1 + 0)(b + 2b - 2b) to fb + d and give f. 620 Express 15b - 49b + 21b + 100 + 21b as f + jb and give j. 8 Express 6m2 - m2 + m2 + (-8m + 4m - 13 + m)(-2m - 3m + 2m) in the form im + dm2 + o and give d. 15 Express -y + 3y*4 - 2 + y + 2y*2 - 10y*3 + 2y + 4y3 + 5y*3 in the form my + iy2 + zy*3 + ty*4 + h and give m. 2 Rearrange 5g + 11 - 4g + 0 - 3g to o + fg and give o. 11 Rearrange (-15s - 2s + 2s)(4 - 4 + 2) + (2 + 1 - 5)(-2s + 4s - s) to the form ps + f and give p. -32 Express 27w - 22 + 18 + 8 in the form gw + j and give g. 27 Rearrange -30n*2 - 51n*2 - 5n*2 + 2n to u + dn + jn2 and give j. -86 Express d4 + 1 + 28d2 - 24d2 - d3 - 23d2 + 0d*3 as bd*2 + rd + od3 + t + cd*4 and give b. -19 Express (x - 2x + 5x)(3x - 6x + 4x)(-9 - 269 + 75) as bx2 + n + dx and give b. -812 Express (-2 - 1 + 0)(3 + 3 + 2)(1 - 1 - 2g) in the form a + tg and give t. 48 Rearrange 3l3 + 0l*3 + 0l*3 + 65l*2 - 121l*2 to the form tl + zl3 + cl*2 + f and give z. 3 Rearrange (-3h*2 + 2h2 - h2)(-2 - 5h*2 + 2) + (-2 + 2 - 2h*3)(195h - 172h - 94h) to g + yh*3 + ih*2 + lh + zh4 and give z. 152 Express r + 3r*2 - 2 - 4r - 7r - 2r*3 - r as jr*2 + tr*3 + ir + n and give j. 3 Rearrange (-5 + 5 + z)(-5 + 5 + 2) - z + 0z + 0z + (-2z + 3z + z)(44 + 255 - 34)(0 - 1 + 0) to dz + f and give d. -529 Express 391s - 113s - 142s - 98s - 90s as ns + i and give n. -52 Rearrange -208a + 232 - 309a - 193a - 232 to the form b + wa and give w. -710 Rearrange -37 - 5r3 + 37 + (2 - r - 2)(-r*2 - 6r*2 + 3r*2) - 9r*3 + 33r*3 + 4r*3 to the form kr*2 + ir + j + yr3 and give y. 27 Rearrange 2a3 + 8240 - a4 - 8222 + 4a + 5a to xa4 + la*2 + ua*3 + j + sa and give s. 9 Express (-8918m + 1 - 11513m - 3802m - 1)(0 + 2m + 0) as cm + gm2 + i and give g. -48466 Rearrange 3h*2 + 9h4 - h3 - 54498 - 4h2 + 54488 to nh*4 + ih*2 + ph + xh3 + u and give u. -10 Rearrange -490g + 247g + 244g + 597 to j + bg and give b. 1 Rearrange -2s + 234 - s*3 + 0s - 22 to is3 + ms + c + gs2 and give g. 0 Rearrange 5g - 18159g3 + 6 + 18160g*3 + 19g*2 - 4 to the form dg*2 + cg + x + wg3 and give c. 5 Rearrange 7s*2 - 5970s - 8s2 - 1 + 5972s - 227s3 to hs*3 + ds*2 + t + ps and give t. -1 Rearrange 0k3 - 2k - 1 + 3k4 - k2 + k3 - 1 - k2 to p + wk*4 + bk + nk2 + ck*3 and give w. 3 Rearrange (2g*2 + 2g*2 - 3g*2)(0g + 4g - 2g)(-113 + 514 - 126) to the form h + yg + qg*3 + ig*2 and give q. 550 Rearrange -4l - 4l + 2l - 7 + 1 - 5l to the form r + vl and give r. -6 Express 58l + 7 + 3 - 7 - 5 as hl + j and give h. 58 Express 38j - 57 + 42j - 124j + 40j + 3 in the form yj + u and give y. -4 Rearrange (9 + 1 - 4)(2v - 3v - 2v) + 33 - 33 + 10v to xv + t and give x. -8 Express -12p - 17p + 27p + 3p - 4p + 0p + (0 - 2p + 0)(-1 + 0 + 3) as cp + v and give c. -7 Express (-7k - 11k + 0k)(-k - 15 + 8 + 5) as nk2 + l + gk and give g. 36 Rearrange -40o2 + 4o*2 + 20o*2 - 17 to z + go*2 + xo and give z. -17 Express 73c - 144c + 89c - 665c as vc + b and give v. -647 Rearrange (1 + 1 - 4)(-b + 5b + 7b) + 1 - b - 1 + (0 - 4 + 3)(b - 4b + b) to the form cb + v and give c. -21 Rearrange 7 + 24 + 2423p - 44 + 13 to h + mp and give m. 2423 Express -208r - 1608r - 95r in the form b + ur and give u. -1911 Rearrange -2 + 54m + 6m2 + 2m*3 + 19m*2 - 15m*2 to the form zm*2 + v + dm*3 + qm and give d. 2 Rearrange (-3i + 4 - 4 - 2i + 2 - 2 + (0i + i - 4i)(1 - 2 - 1) + i + i - 3i + (i + 2i - 2i)(-1 + 4 - 4))(-2 + 0 + 6) to bi + u and give b. -4 Express 3 - 1 - 1 + 2l + (216l - 288l - 270l)(-2 + 5 - 1) in the form h + xl and give x. -682 Express -36k + 1945k2 - 4k + 40k as wk*2 + v + qk and give w. 1945 Rearrange 292h - 832h*2 + 293h - 585h to the form nh*2 + lh + a and give a. 0 Express -w*4 + 15w*4 + 7w - 2 - 4w3 - 7w + 2w3 in the form yw + aw3 + mw*2 + bw*4 + g and give a. -2 Express (4p*2 - 4p2 + p3)(1 - 3 + 1) + 100p - 11 - 4p3 + 19 - 102p + 6p2 as fp*2 + qp + i + cp3 and give c. -5 Express (5d + 8d - 16d)(-116 + 116 + 26d) + 6 - 5d2 - 6 as vd + qd2 + s and give q. -83 Express n2 - 57 + 28 + 30 + 37 as jn*2 + gn + c and give c. 38 Express (-436 - 76g + 436 + (0 - 1 - 3)(-5g + g + 0g))(-2g + 2g - g3) in the form yg + ng3 + fg*2 + og*4 + x and give o. 60 Rearrange 16k*2 + k - 11k*2 + 1 - 6k*2 - 15k*2 - 11k*2 to the form vk*2 + rk + i and give i. 1 Express (-x2 + x2 - x*2)(-3 - 4 + 4) + (2x + 2x - x)(3 + 4x - 3) + 2x2 - 4x*2 + 3x*2 - 3x as tx + i + ax*2 and give t. -3 Rearrange 60 + 48q - 58 + 3q to a + rq and give a. 2 Rearrange 222q + 225q + 222q + 11 - 665q to zq + j and give j. 11 Express 423g + 4 - 11 + 6 + 0 + 0 in the form r + hg and give h. 423 Rearrange -558o*2 + 117o*2 - 99o*2 to the form wo + l + ko2 and give k. -540 Express (-1 + 0 - 1)(2 + 3 - 3)((3 + 5 - 2)(0z + z + 0z) - 4 - 3z + 4) + 5 + 4z - 5 + (3z - 2z + 0z)(4 - 3 - 2) as n + hz and give h. -9 Rearrange -2r*2 - 32r + 361 + 374 - 737 to h + lr + jr*2 and give j. -2 Express -210 - 7 + 84 - 2i - 182 in the form ri + s and give s. -315 Rearrange (-4c - 11 + 11)(-11 + 0 - 6 + (-2 + 1 - 1)(-2 + 2 - 1) + 8 - 4 - 7)(-1 + 1 + 1) to qc + z and give z. 0 Express -457u + 142u + 110u in the form zu + l and give z. -205 Express (y - 2y - y)(15 - 15 + 14y) - 5y2 - y2 + 4y2 + (2 - 4 + 1)(y - y + y*2) + 2 - 2 + 2y*2 in the form fy*2 + i + ky and give f. -29 Rearrange 2n - 9n*3 + 24n*2 - 10n*3 - 36n*2 + 25n*2 to cn*2 + ln*3 + a + gn and give l. -19 Express -74q - 13q + 14q + 5q - 53q as a + pq and give p. -121 Rearrange (4c - 4c - 2c)(-c + 0c + 2c)(103c*2 - 346c*2 - 234c*2) to the form vc*4 + hc + sc3 + rc*2 + p and give p. 0 Express (-1084 + 1084 + 303v)((6 - 2 - 3)(-2 + 2 - 2) - 1 - 5 + 1)(3 + 2 - 3)(-3 + 1 + 0) in the form av + b and give a. 8484 Express -75u*2 - 7 - 11 + 4 - 2u + 73u2 in the form s + iu*2 + tu and give i. -2 Rearrange -287w - 210w + 320w + 0w - 2w + 3w - 3w - 2w + 3w + (4w + w - 3w)(1 - 5 + 3) - 2w + 1 - 1 - 6w + 5w + 2w to z + fw and give f. -181 Rearrange 4 - 4 + 2z*2 - 41z*3 - 274z + 274z to wz + g + jz2 + iz*3 and give g. 0 Express -5 - 8 - 3a*3 + 33a*4 + 6 - 27a*4 + 4a*2 + 2a*3 as ra*2 + qa + ia3 + c + ta*4 and give c. -7 Rearrange 122g + 42g + 1 - 3 to the form rg + k and give k. -2 Rearrange (-5i2 - 2i*2 + 6i*2)(0 + 0 - 4) + (-9i + 9i - 12i2)((-2 + 0 + 4)(-2 + 5 - 2) + 2 - 2 + 2) to mi + vi2 + r and give m. 0 Express 34016 + 3b + 0b3 - b3 - 34038 as ib*3 + gb + nb2 + u and give u. -22 Express (4h*2 + 2h + h3 + h2 - 2h2)(4 - 4 - 7h + (3 - 5 + 1)(4h - 2h + 0h)) in the form sh*4 + fh*2 + o + xh*3 + jh and give f. -18 Express 3g2 + g2 - 2g*2 + (-11 - 25 - 19)(-g*2 - 2g + 2g) as p + ng + ag2 and give p. 0 Rearrange (6 - 6 - w2)(-2 - 1 + 2) + (-14w2 + 8w*2 - 12w*2)(-1 + 1 - 2) to y + cw2 + rw and give c. 37 Express -84l2 - 7l + 26l + 3l*3 - 9l - 11l as ul*3 + tl + ql2 + h and give t. -1 Rearrange -108x*4 - x - x + 203x*4 + 4 - 109x*4 - 6x*3 to vx*3 + ix*4 + mx + g + tx2 and give g. 4 Rearrange (-18 + 6z + 18 + (z - 3z - 2z)(2 + 2 + 0) - 2z + z - 2z + (5 - 4 - 3)(4z + 0z - 3z))(-2z + 3z + z) to s + bz2 + az and give b. -30 Express (2 + 2 - 3 + (1 + 0 - 3)(3 - 1 + 0))(r + r - 4r)(-7 + 2 - 26) in the form wr + q and give w. -186 Rearrange (2r + 3r + r)(-71 - 22*r + 71 +	{ "pile_set_name": "DM Mathematics" }
at comes next: 109159, 109157, 109155, 109153, 109151, 109149? 109147 What is the next term in 2761, 5558, 8393, 11266, 14177, 17126? 20113 What comes next: -1634, -3247, -4834, -6383, -7882, -9319? -10682 What is the next term in 12466, 24940, 37416, 49894, 62374, 74856? 87340 What comes next: -7217, -7283, -7349, -7415, -7481, -7547? -7613 What is next in 2909, 11656, 26221, 46592, 72757, 104704, 142421, 185896? 235117 What comes next: 11244, 11300, 11356, 11412? 11468 What is the next term in -1080, -1025, -972, -921, -872? -825 What comes next: 274, 344, 414, 484, 554? 624 What is the next term in 1626, 6636, 14976, 26640, 41622, 59916? 81516 What is next in -1978, -7988, -18032, -32134, -50318? -72608 What comes next: -42001, -42043, -42105, -42181, -42265, -42351, -42433, -42505? -42561 What comes next: 12737, 25409, 38079, 50747, 63413, 76077? 88739 What is the next term in -237, -846, -1827, -3180, -4905, -7002? -9471 What is next in 3381, 13752, 31045, 55266, 86421, 124516, 169557, 221550? 280501 What is the next term in -226679, -906802, -2040341, -3627296, -5667667, -8161454, -11108657? -14509276 What is next in 11201, 22383, 33565, 44747, 55929, 67111? 78293 What is next in -11035, -22044, -33067, -44110, -55179? -66280 What comes next: -14341, -14351, -14365, -14383, -14405, -14431? -14461 What comes next: -376444, -376424, -376382, -376306, -376184? -376004 What is next in 2668964, 5337927, 8006892, 10675859? 13344828 What is next in -2190803, -4381607, -6572411, -8763215, -10954019, -13144823? -15335627 What comes next: -545255, -545251, -545245, -545237? -545227 What is the next term in -2978, -23775, -80224, -190151, -371382, -641743? -1019060 What is the next term in -13655, -13661, -13673, -13691, -13715, -13745? -13781 What is next in 945, 994, 1077, 1194, 1345, 1530? 1749 What is next in 10423, 83389, 281433, 667093, 1302907, 2251413, 3575149, 5336653? 7598463 What is next in 2054, 5467, 8856, 12209, 15514, 18759? 21932 What is next in -203, -369, -491, -569, -603, -593, -539? -441 What comes next: -27257, -27268, -27301, -27368, -27481, -27652, -27893, -28216? -28633 What is the next term in 4729, 9398, 14043, 18652, 23213, 27714, 32143, 36488? 40737 What comes next: 233, 366, 691, 1292, 2253, 3658, 5591? 8136 What is next in -56918, -56907, -56890, -56867, -56838, -56803, -56762? -56715 What is next in 30018, 60033, 90048, 120063? 150078 What is the next term in -81, -235, -653, -1467, -2809? -4811 What comes next: -10655, -10528, -10401, -10274, -10147? -10020 What comes next: 2160, 2519, 2892, 3285, 3704, 4155? 4644 What is next in 1765, 7037, 15821, 28117, 43925, 63245, 86077? 112421 What is next in 728, 1456, 2164, 2852, 3520, 4168, 4796? 5404 What is the next term in 267, 1261, 2943, 5313? 8371 What is the next term in 38394, 76797, 115200, 153603, 192006? 230409 What is the next term in -5541, -11056, -16555, -22032, -27481, -32896, -38271? -43600 What is the next term in 47476, 94950, 142424, 189898, 237372, 284846? 332320 What is the next term in -114667, -458651, -1031949, -1834555, -2866463, -4127667, -5618161, -7337939? -9286995 What is the next term in 102590, 102595, 102612, 102647, 102706, 102795, 102920? 103087 What is next in 246, 345, 444, 543, 642? 741 What is next in -4610, -4669, -4778, -4949, -5194, -5525? -5954 What is next in -16, -2, 68, 230, 520, 974, 1628? 2518 What is the next term in -220, -179, -136, -91? -44 What is next in -147, -284, -453, -666, -935, -1272, -1689? -2198 What is next in -2480, -4980, -7502, -10058, -12660? -15320 What is next in 774, 782, 814, 882, 998, 1174, 1422, 1754? 2182 What comes next: -1046, -1660, -2682, -4112, -5950, -8196? -10850 What is next in 20351, 20350, 20349, 20348? 20347 What is next in -1503, -1496, -1491, -1488, -1487, -1488, -1491? -1496 What comes next: -1317357, -1317358, -1317359? -1317360 What is next in -186, -374, -884, -1878, -3518, -5966, -9384? -13934 What is next in -3210, -4127, -5046, -5967? -6890 What is next in -16, 109, 234, 359? 484 What is the next term in 4540, 4561, 4580, 4597? 4612 What comes next: -103, -213, -331, -469, -639, -853, -1123, -1461? -1879 What comes next: 128, 512, 1128, 1982, 3080, 4428, 6032? 7898 What comes next: -1747, -1755, -1771, -1801, -1851, -1927, -2035? -2181 What is next in -144, -242, -556, -1194, -2264, -3874, -6132? -9146 What is the next term in 3250, 12980, 29192, 51892, 81086, 116780? 158980 What comes next: -422, -865, -1322, -1787, -2254, -2717? -3170 What is next in 897, 3601, 8109, 14421, 22537, 32457? 44181 What is the next term in -4387, -8784, -13187, -17590, -21987, -26372, -30739, -35082? -39395 What is next in -69, -307, -711, -1281? -2017 What comes next: -3353, -6714, -10073, -13430, -16785, -20138? -23489 What is next in -76713, -153430, -230147, -306864, -383581? -460298 What is next in 257, 297, 399, 593, 909, 1377, 2027? 2889 What comes next: -6, -85, -224, -423, -682, -1001, -1380? -1819 What is next in 27, 133, 295, 501, 739, 997? 1263 What comes next: -29163, -58484, -87805, -117126, -146447? -175768 What is the next term in 109, 396, 1173, 2686, 5181, 8904, 14101, 21018? 29901 What comes next: 434, 170, -268, -880, -1666? -2626 What is next in -185, -738, -1661, -2954, -4617, -6650, -9053? -11826 What is next in -16678, -33360, -50042? -66724 What is the next term in 18, -38, -146, -312, -542? -842 What is next in 3688, 15042, 33936, 60364, 94320, 135798? 184792 What comes next: -71, -171, -361, -647, -1035, -1531? -2141 What is next in 7199, 14432, 21665, 28898? 36131 What is the next term in -2809, -2864, -2955, -3088, -3269, -3504? -3799 What is next in -1104, -2208, -3312? -4416 What is the next term in 759, 1495, 2203, 2871, 3487, 4039, 4515, 4903? 5191 What is the next term in 278, 303, 306, 275, 198? 63 What is the next term in -958, -1917, -2880, -3847, -4818? -5793 What is the next term in 86, 370, 850, 1532, 2422, 3526, 4850? 6400 What is next in 2801, 2657, 2517, 2381? 2249 What is next in -115, -451, -1005, -1777, -2767, -3975, -5401? -7045 What comes next: 115825, 115822, 115817, 115810? 115801 What is next in -26, -300, -1046, -2498, -4890, -8456? -13430 What is the next term in -595, -4776, -16089, -38086, -74319, -128340, -203701? -303954 What comes next: -7577, -15215, -22851, -30485, -38117, -45747? -53375 What comes next: 32, 137, 306, 533, 812, 1137? 1502 What is the next term in 3657, 3623, 3587, 3549, 3509, 3467, 3423? 3377 What is next in 217546, 435094, 652644, 870196, 1087750, 1305306, 1522864? 1740424 What is the next term in -394, -312, -230, -148, -66, 16? 98 What comes next: -4782, -9859, -14936, -20013, -25090, -30167? -35244 What is next in 3, 64, 155, 282, 451, 668, 939, 1270? 1667 What comes next: 22300, 44594, 66886, 89176, 111464, 133750, 156034? 178316 What comes next: -1518, -3035, -4552, -6069, -7586? -9103 What comes next: 3103, 3121, 3143, 3163, 3175, 3173, 3151, 3103? 3023 What comes next: -90, 115, 328, 549, 778, 1015, 1260? 1513 What comes next: 19395, 38777, 58159, 77541, 96923, 116305? 135687 What is the next term in 539, 704, 869, 1034? 1199 What is the next term in -72, -517, -1706, -4011, -7804? -13457 What is the next term in -425, -807, -1157, -1469, -1737? -1955 What is next in -267581, -535161, -802741? -1070321 What is the next term in -1161, -2326, -3491, -4656, -5821? -6986 What is next in -33017, -132083, -297189, -528329, -825497, -1188687, -1617893? -2113109 What is the next term in 736, 1281, 1838, 2413, 3012, 3641, 4306? 5013 What comes next: -576657, -576665, -576677, -576693? -576713 What is next in 433, 473, 541, 637, 761? 913 What is next in -72, -653, -2232, -5307, -10376, -17937, -28488, -42527? -60552 What is the next term in -3739, -3723, -3673, -3571, -3399, -3139, -2773, -2283? -1651 What is the next term in 11340, 11309, 11278, 11247? 11216 What is the next term in 68334, 68350, 68380, 68430, 68506, 68614? 68760 What comes next: 12, 94, 356, 900, 1828, 3242? 5244 What comes next: 412, 828, 1252, 1684, 2124, 2572, 3028? 3492 What comes next: -1428, -1486, -1532, -1560, -1564? -1538 What comes next: 30027, 30015, 30003, 29991, 29979? 29967 What is next in -64049, -64050, -64051, -64052? -64053 What is the n	{ "pile_set_name": "DM Mathematics" }
et l = -1 - m. Solve k = 2j - 0 + 4, 5k + l = j for j. -4 Suppose 5l - 16l + 233 = 24. Let q(a) = a + 11. Let o be q(-6). Solve 2y = 5x + l, -2x = -3x - o for y. -3 Let k = 75 - 72. Suppose -x + ku + 25 = 0, 0 = 4x + 5u - 2 - 183. Let w = x + -37. Solve -4i - 9 = -2h - w, 2h - 7 = 5i for i. -1 Suppose 6c - 252 = -c. Suppose 7o + c = 9o. Solve -4i + 36 = 4a, 6 = -3i + o for a. 5 Suppose 4f = -5 - 3. Let n be (-24)/(-16)(-1 + f/(-6)). Let a be n(-25)/104. Solve -2i + 4 = 0, 2i + 3i - a = 3h for h. 0 Let n(a) = 753a + 5. Let k be n(0). Solve -s + 63w - k = 61w, 0 = -4s - 5w - 7 for s. -3 Suppose 5k + 5k - 50 = 0. Let x = k + -5. Solve 2m - 5t + 5 = x, 5m - 3m = 2t - 8 for m. -5 Let n be (-4 - 1) + (-112)/(-3 + -11). Solve 0 = -4o - 2s + 10, -4 = -o - 2s + n for o. 1 Suppose 0 = h - t - 21, -4h - 2t + 80 + 28 = 0. Let j = 109931 + -109926. Solve -3y + 8y - h = 2p, -25 = -jy - 2p for y. 5 Let l be (-4)/6 + 186/9. Let s be 205/l + (-3)/(-4). Solve v = -f - 3, -4f - 5v = -0f + s for f. -4 Let z = 2004 - 2004. Solve z = 2v - 3j + 2, 2v + 0v - 4j = -4 for v. 2 Let x(j) = 2j*3 + 15j*2 + 4j + 16. Let v be x(-5). Suppose 119m - vm = 0. Let q be 1-2(-3)/2. Solve 2a + 4 = 3p + a, m = qa + 12 for p. 0 Suppose -4r - 12 = -4q, -r = 3r + 5q - 33. Let j be (-21 + -2)/(1/(-2)). Let w = j + -34. Solve 2f - 2g - w = 0, -5f + 23 = -rf - 4g for f. 1 Suppose k = 5k. Suppose -5s + 2 = y - 22, -3y = 5s - 72. Suppose -5b + 34 - y = 0. Solve k = -2l - 5j - 15, -6l + bl + 2j = -6 for l. 0 Suppose -4n + 134 = 4s + 146, -4n - 36 = -2s. Let c(y) = y*2 + 6y - 8. Let p be c(-8). Solve 0 = -4z + 3w + p, -40 = -4z - w - sw for z. 5 Let a = -345 - -408. Suppose 3f + 33 = -3v + a, -4f = 2v - 30. Suppose -2w + 6 - 2 = -h, -2h = 5w - 19. Solve -wz - d = -4d + 21, 5z = -d - v for z. -2 Suppose 3u = -x + 15, -2u = -69x + 70x - 13. Solve uw + 24z + 10 = 26z, -z - 19 = 5w for w. -4 Suppose 4c = -3c + 28. Suppose -4m + 2i + 12 = -2m, cm = -3i - 4. Let g(o) = -o - 2. Let n be g(-7). Solve -3d = mr + 16, -d = -3r + 3 - n for d. -4 Let r(i) = -28i - 2408. Let l be r(-86). Solve 5x - 8x + 3f + 15 = l, -4x = 2f + 10 for x. 0 Suppose -5z + 5m = -25, 2z = 6z + 3m - 55. Let x = -16 + 6. Let n = z - x. Solve 2l = 3t + 5, -3t - n = -l + 2l for l. -5 Let u be (-2)/(-13) + ((-7140)/(-6825) - (-18)/10). Solve 2f + 3f - 3v = 15, -uv + 9 = 3f for f. 3 Suppose -2360k - 585 = -2425k. Solve -29 + k = 4l + 4j, -20 = 4l + 2j for l. -5 Let q be 18((-4)/(-2) + 128/(-72)). Solve -4x + qp - 4 = 0, -3 = -2x - 2p + 7 for x. 2 Suppose -5v = -5q + 5, -2v + 15q = 17q - 18. Solve -3c = 3t + 6, -3c = -4t + v + 23 for c. -5 Let h = -6140 - -6144. Solve -3v = -f - 32 + 12, 0 = -hf - v - 15 for f. -5 Let j(p) = p*2 + 46p - 616. Let h be j(-57). Solve 4k + 7 = hf - 6f, -2k = -f + 5 for f. -1 Let t(j) = -2j2 - 23j + 37. Let o be t(-11). Let f be (1 - -1)/(32/o). Solve 2c = c, -3x = -5c + f for x. -1 Let p(u) be the first derivative of u2/2 + 6u + 1. Let l be p(-3). Let c = -716 - -720. Solve -cg = w - 3 - 20, lw = 3g - 6 for g. 5 Suppose 2k + 7 = -h, -5k - 4h = -2k + 23. Let q(o) = -5o*3 + 2o*2 + 6o + 4. Let c be q(k). Solve -5u - c = 5m, -u + 19 = -4m + m for u. 4 Suppose 0 = 5m - 10, 4y + 134 = -342m + 341m. Let w be ((-2)/(-4))/(1/74). Let f = w + y. Solve 0 = 2k + c + 1, -fk = -2c + c - 6 for k. 1 Let k(v) = 8v2 + 98v - 40. Let x be k(-13). Suppose -5y + 40 + 30 = 0. Suppose -94 + x = -yf. Solve 16 = -5z + 6, -fz + 7 = 3t for t. 5 Let q(k) = -9k + k*2 - 8k + 4k. Let y be q(13). Suppose 0 = -4i + 2i + 2x + 18, -i + 3x + 19 = y. Solve -2v = -5f - 1 - i, 4f - 3v = 3 for f. -3 Suppose -1 = 5t - 76. Let m be 4 - ((-224)/120 - 2/t). Suppose -mh + 10 = -26. Solve -4j + 4f - 9f = 32, 2j - 3f - h = 0 for j. -3 Let h be (-25)/(-25) + 15. Suppose -hc + 16c = -740. Let p = c + 74. Solve p = -0t - t - 2, t = -4r - 14 for r. -3 Suppose 2y + h = -8, -10h - 10 = -5y - 5h. Let l be (-1)/y-3(-2180)/654. Solve -2r + 2n + 28 = 2r, lr = 2n + 33 for r. 5 Suppose 99 = -5089b + 5098b. Solve 22 = -3c - 2z, -4c = z - 2z + b for c. -4 Let l be (-4 - -12)(-2)/(-4). Suppose -s = -l - 1. Suppose 5o + 15 = sb, 32 = 4b - 3o + 4o. Solve -2q - f = -5q - b, 5q = -2f + 3 for q. -1 Let v(y) be the first derivative of -2y2 + 19y + 23. Suppose 5r - 4r = 4. Let b be v(r). Solve -2d - 25 = -3d + 5p, bp + 12 = 0 for d. 5 Let t = 105 + -105. Suppose t = s + 15 - 17. Suppose -42 = sl - 50. Solve -2p + 3p = -2a - l, -5a = -5p + 40 for a. -4 Suppose -434 = -127h - 53. Solve -2a = 5z - 7, 2z - ha + 2 - 1 = 0 for z. 1 Let k be (-5)/(-6) - (-22457)/102. Let h = k + -221. Solve 0 = 5w - 0z + z - 24, -3z + 12 = h for w. 4 Suppose -30 + 4 = -3q + 4f, 5q - 5f - 35 = 0. Suppose -qo + 0 = -8. Let y be 60/200(5 + 0)2. Solve -3h - 8 = -ym - m, -18 = oh + 2m for h. -4 Suppose 2x - 5v - 43 = 0, -121 = -188x + 183x - v. Solve c = -3d + 1, -4d = -4c - c + x for c. 4 Suppose -3w + w = -5i - 16, -2w + 12 = -3i. Solve 14 = 2o + 4n, o + 6 + w = 2n for o. -1 Suppose 6p - 80 = 2p. Let b be 10/(-6) - (-816)/144. Solve -s - 5 = v - 2v, bs - 2v + p = 0 for s. -5 Let j be ((-99)/15)/((-2)/(-10)). Let l = 12 - j. Let z be (-4)/6l/(-10). Solve -zd + 3y = 5y - 2, 0 = -4d + 5y + 18 for d. 2 Let a(i) = i*2 - 10i - 10. Let k be a(11). Let g = k - -1. Let w(m) = -m + 5. Let d be w(5). Solve d = -2b - gz - 20, -2b = 4z - 7z - 5 for b. -5 Let v(u) = 9u*3 - 81u*2 - 4u + 40. Let h be v(9). Solve -2p - 25 = hr - 35, 5r - 5p + 25 = 0 for r. 0 Suppose -2p = 3j - 19, -3j - 10 = -5j. Let f(c) = -2c2 + 19c - 6. Let w be f(9). Solve -wl + 3g + 1 = -p, -l + 10 = -4g for l. -2 Suppose 0 = -19n + 40n - 35 - 49. Solve -4r = 2d - 10, 3d + nr = -0d + 15 for d. 5 Let x(i) = 1613i - 4828. Let s be x(3). Solve -3g - s = -2m, 0g = 5m - 2g - 11 for m. 1 Let l = -11608 + 11610. Solve -lh + 26 = 5p, h + 14 = -2p + 25 for p. 4 Let m = -382 + 385. Let t(n) = 2 - n3 + 8n3 - n2 - 3n3 - 3n*3 - n. Let x be t(0). Solve -19 = 4j - 6j - mk, 0 = -xj - 2k + 16 for j. 5 Let n = 2565 + -2560. Solve -12 = -i + 2p - 20, 0 = -np + 15 for i. -2 Let t(r) = -r*3 + 8r*2 - 3. Let g be t(8). Suppose 104o - 103o - 7 = 0. Let w be o/g + 1 - (-32)/6. Solve 0 = 3i - 4n + 10, 4n + 6 = wi + 18 for i. -2 Suppose -5d + 41 + 235 = 87d. Solve 4t = -5r + 40, r + dt + 2 - 10 = 0 for r. 8 Suppose -3b = -2x - 6, 5x - 3 = -2b - 18. Suppose 9c - 6c - 81 = b. Let w = c + -25. Solve 4q + 20 = -4t, -4q = wt - t + 20 for q. -5 Suppose -3x + 24 = 9. Suppose xs = 20, 2s = -13j + 16j + 8. Solve 0l - 2l + d = j, -5d - 14 = 4l for l. -1 Let q(r) = -3r*2 - 14r - 3. Suppose -4 = -15u + 16u. Let k be q(u). Solve -4j = -20, 4j = -kd - j + 40 for d. 3 Let d be 0 - 282 - 5/(-15)9. Let r = d + 283. Solve -5u - r = -2h, -5u = -0u - 3h + 6 for u. 0 Suppose -6o = -3o - 2o. Suppose o = -8h + 16h + 8. Let y be (-61 - -61) + 7h/(-1). Solve 5s = -2m + ym - 15, 3m + 31 = -5s for m. -2 Suppose 0 = -p + 2u + 6, p - 89u + 94u = -1. Solve -2i = 3h - 12 + 28, ph = i - 14 for i. -2 Let x be (26/7 + -4)/(1/(-7)). Suppose -3r = -xr - 23. Suppose -8 + r = -3u, 6 = 2d + 2u. Solve -5v + b = -0v + 22, -3v - 2b = d for v. -4 Let b be (-456)/(-133) + (-3)/7. Let r(d) = -d2 - 7d + 30. Let s be r(b). Solve -4a - 14 = -a + 4i, 5a - 5i = s for a. -2 Suppose -6q = 2q. Let g be 19/(-38)(q - -2). Let c(o) = -o3 + 2o*2 - 1. Let b be c(g). Solve -5m + 5x = 40, 4m - bm - 3x + 19 = 0 for m. -5 Suppose 17m - 14m = 6. Suppose -36 + 34 = -mk. Let p be (3 + k)4/8. Solve 4l + 5 = l + 4f, 0 = -l + pf - 3 for l. 1 Suppose -16i = 3i - 2i - 238. Solve -7c + 6c = -4o + i, -3o + 8 = -2c for c. 2 Let s(d) be the second derivative of -d4/6 - 7d*3/3 - 3d*2 + 30d. Let y be s(-7). Let o be (-3)/9 + (-8)/y. Solve -3c = 2u + 4, 2u - 5 = c - o for u. 1 Let d = -64 - -74. Suppose -du + 10u = 9u. Solve -2q + 3 = -uj -	{ "pile_set_name": "DM Mathematics" }
3s2 - s2)(2s - 2 + 2) - 1 - 2s*2 - 5s - 1499s3 + 3s + 1508s3. 26s*3 - 2s*2 - 2s - 1 Expand (1 + 2 - 4)(2 - r3 - 2) - 2r*3 + 2r - 2r - 657r*3 + 38r + 40r - 2r*2 - 78r. -658r3 - 2r*2 Expand (2 - 3c*2 - 2)(-1 - 2 + 1)(-43 - 8c + 3 + 45). -48c3 + 30c*2 Expand (4 + 1 - 7)(p3 - p3 + 2p3) - 33937p*2 + 16973p*2 - 3820p*3 + 16964p*2. -3824p*3 Expand (-73q + 1256 - 1256)(-1631q + 1618q + 3 + 0). 949q*2 - 219q Expand 2o + 4o - 4o + (1 - 4 - 2)(-1 - 2 + 1)(11o - 2o - o) - 4o + 4o - 2o + (-2o + 5o - 4o)(1 - 1 - 1) - 3o + 4o + 2o. 84o Expand (2 - 2 + 1)(72t*5 - 3t*5 + 6t*5 + (3t3 + t3 - 5t3)(-3t2 + 4t*2 - 3t2) - t5 - 4t + 4t - 18t5 + 11 - 11). 58t5 Expand q3 - 6q3 + 4q*3 + 4q - 4q - 3q*3 + (3q*2 + 3q*2 - 5q*2)(1 - 3q - 1) + 2 - 2 + 2q*3 + (8q + 0q - 2q)(2q*2 + 3 - 3). 7q*3 Expand (16 + 8 - 6 + (1 + 1 - 3)(-6 - 1 - 4))(257b - b*2 - 257b). -29b2 Expand (-9757 - 630 + 4881 - 9455 - 4509 - 11982)(0r + 0r - 4r4). 125808r*4 Expand -19 + 27h*2 + 19 + (2 - 1 + 1)(-55h2 - 41h*2 + 31h*2) - 2 + 2h*2 + 2 - 3h*2 + 3h*2 - 2h*2. -103h*2 Expand (-4m*4 + 3m*2 - 3m*2)(-1 - 2 + 2) + 2m2 - 2m2 + m4 + 2m4 - 16m + 17m3 + 18m*3 - 35m*3. 7m*4 - 16m Expand -26w2 + 30w*2 - 23w*2 + (w - 5 + 5)(-70w + 0 + 0 - 11w). -100w2 Expand -2 + 2 - i + (4i - 2i + 0i)(2 + 0 - 1) - 205206 + 205206 - 1072i + 3 - 5 + 6i - 4i. -1069i - 2 Expand (3 + 4 + 3)(4y - 3y + 0y)(123 - 123 + 6y + (y - 2 + 2)(4 - 1 - 1)). 80y2 Expand -2r*3 + 40r*4 + 3r*3 - 39r4 + (-r2 - 1 + 1)(-r2 + 3r*2 - 3r*2). 2r4 + r3 Expand (112i - 1983i*2 - 15i + 1980i2)(-4i + 1 - 3 + 0). 12i*3 - 382i*2 - 194i Expand (-925 - 768 + 650 - 464)(-4n*2 + 3n*3 + 4n*2). -4521n*3 Expand (-3j*2 + 35786j*4 + 2j - 2 - 35789j4 + 0j)(2 + 0 + 0). -6j*4 - 6j*2 + 4j - 4 Expand (-c*2 - 2c*2 + 5c*2 + (3c - 6c + 0c)(-c + c - c) + 6c*2 - 3c2 + c2)(138c*2 - 228c*2 + 111c*2). 189c*4 Expand 3u - 4 + 4 + (7 - 1 + 2)(0u + 5u - 2u + (-4u - 2u + 5u)(3 - 2 + 0)) - 8 - u + 8. 18u Expand (4 + 2 - 4)(-1 + 1 - 8c + (2c + c - 6c)(-2 - 2 + 3) - 219 - 5c - 194 + 442). -20c + 58 Expand (-12q + 5q - 6q)(10q4 + 10q*2 - 10q*2) + 3q*4 - 29q*2 + 9q*4 + 3q*5 + 30q*2. -127q*5 + 12q4 + q2 Expand -4d - 11d*3 + 4d + (0d2 - 4d*2 + 3d*2)(-4d - 15d + 3d) + 2d*2 - 7d*3 - 2d*2. -2d*3 Expand (5 - 4 + 1)((5u2 - 5u2 + u2)(1 - 1 - 2u) - 81826u2 + 81826u*2 + 438u*3). 872u3 Expand (-a2 + 0a + 0a + (-6a + 2a + 2a)(-a + a - 4a) + 8 - 8 - 17a*2)(-12a2 + 0a + 6a2 + a). 60a*4 - 10a*3 Expand 79288l*3 + 361l*4 - 79288l3 - l4 + 4 - 4 + (0 - 2 + 1)(3l*2 - 2l*4 - 3l2) - l4 + 2l4 + 0l*4. 363l*4 Expand (29 + 0 + 7)(-3 + 2 - 2)(0 + 73v*2 - 1 - 2v - 74v2) + (3 + 0 - 4)(-4 + 4 + 2v2). 106v*2 + 216v + 108 Expand -x - 5x + 9 + 3x + 2x - 3x + 2x + (-2 + 2 + 2x)(-2 + 4 - 3) + 4 - x - 4. -5x + 9 Expand -w*2 - 3w*2 + 2w*2 - 6 + 6 - 19w*2 - 17w*2 + 8w*2 - 5w*2 + (w + 1 - 1)(-w + w - 2w) - 5w2 + w2 + 2w2. -39w*2 Expand (-2 + 4 + 0)(-62d + 71d + 45d) + (-6 + 3 - 22)(-2d + 3 - 3)(0 + 1 + 1). 208d Expand (3 - 5 + 3)(3f - 3f + f)(-1808 + 501 - 771). -2078f Expand (-4q3 + q - q)(2q - 2q + 2q2) + 3845q - 991q5 - 3845q. -999q5 Expand (-134c*4 - 3c*4 - 71c*4)(-1 + 1 - 3c). 624c*5 Expand (9 - 1 - 20 - 14)(-432 + 432 + 15x + (3x - 5x + x)(1 - 1 - 2)). -442x Expand (-1 + 1 + 2c*2)(-28c + 14c - c)(9c*2 + 28 - 28). -270c*5 Expand (4 - 4 - 2o*2)(2o2 - 4o*2 + 0o*2) + (51240 - 51240 - 33o)(11o*3 + 12o*3 - 13o*3). -326o*4 Expand (-3 + 6 - 2 - 1 + 1 - 2 - 1 - 2 + 1 + 4 - 4 + 1 + (0 - 2 + 3)(2 + 3 - 3) - 4 - 2 + 4 + 5 - 3 - 1 - 3 + 2 + 3)(-267h*2 + 132h*2 - 152h*2). -287h*2 Expand (5h*3 - 4h*3 + 0h*3)(104 - 140 + 57 + h*2 - 12h). h*5 - 12h*4 + 21h3 Expand i2 + 2 - 2 + (i - 2i - i)(-3i + 3i + i) - i*2 + 2 - 2 + (54i + 63i - 92 - 130i)(2i - 6i + 2i). 24i2 + 184i Expand (-7 + 1 + 4)((2m - 2m - 2m)(0 - m + 0) + 1153m*2 - 194m + 194m). -2310m*2 Expand (-94n*5 - 342 + 342)(3 - 1 - 8)(-6 + 4 - 1)(-12 + 38 + 3). -49068n5 Expand (-2z + 3z - 3z)(-5z*3 + 5z*3 + 8z*3) + 4z4 - z4 - z4 - z4 + z*4 + 22z*4 + (0z2 - z2 + 3z2)(3z2 + 4z*2 - 6z*2). 10z*4 Expand (3 - 3 + 2)(16d - 10d + 4d) + 16d - 494 + 490 - 38d. -2d - 4 Expand (12 + g*2 - 12 - 3g*3)((12 + 9 - 27)(6 - 1 - 3) - 1 + 3 - 3)(-7g + g + 5g). -39g4 + 13g*3 Expand (-10a - 2a + 3a)(3 - 3 + 1) + (141 - 14 + 51)(5a - 2a - a) + (-2a - a + 2a)(3 + 0 - 5). 349a Expand (3m - 47 + 7m + 50)(-1 - 2m + 1 + (-46 - 194 + 144)(1 - 1 + m)). -980m*2 - 294m Expand (2 - 4 - 2)(3o2 - o2 - o*2) + 5737o*2 + 5736o*2 + 2 - 11475o*2 + 75o. -6o2 + 75o + 2 Expand (-11g + 40 - 29 + 17g)(-4 - 2 + 2 + (-4 + 2 + 0)(2 - 3 + 3) + 3 + 0 - 4 + 3 + 0 - 6). -72g - 132 Expand (2k*2 - 2k*2 + 2k*2)(-2953k3 + 18035k - 18035k). -5906k*5 Expand (-7r*3 - 8r*3 - 14r*3)(2 + 3 - 3)(-2 - 4 + 2). 232r*3 Expand (28d - 192d + 43d)(-d - d + 4d) + (2 + 0 + 2)(-d2 + 0d2 - d2). -250d2 Expand (143m + 10m - 18m)(-94 + 257 - 102). 8235m Expand (3p5 - 4p*5 + 0p*5)(4 + 0 - 5) + (4p2 + p2 - 2p*2)(-13715p + 13715p - 964p3). -2891p*5 Expand -425q*2 + 425q*2 - 49q3 + q3 + 0q3 - 11q*3 + (0q2 + q2 + q*2)(2q - 7q + 2q). -65q*3 Expand (-256a*2 - 163a*2 + 29a - 29a)(0a - 4a + 4 + a). 1257a3 - 1676a2 Expand -x2 - 5 - 32x + 4x*2 + 33x + (1 - 3 + 13)(-6x*2 - 51 + 51). -63x*2 + x - 5 Expand (74j - 1 + 32j - 197j)(7j + 2 - 2j - 6j). 91j2 - 181j - 2 Expand (3n + 0n - 4n)(-19 + 19 - 13n4 + 13) + 2n2 + n5 - n*4 + 2n5 - n5. 15n5 - n4 + 2n*2 - 13n Expand (9y3 - 12 + 12)(3y2 - 2 + 2) - 2y*5 + 0 + 0 + (2y - 2 + 2)(-9y*4 - 2y*4 + 3y*4). 9y*5 Expand (-2t - 3t + t + (-11t + 59t + 29t)(2 + 4 - 3))(3t3 + 3t*3 - 7t*3)(-t + 0 + 0). 227t5 Expand (-3v2 + v2 + 4v2)(-8v3 + 3 - 3)(-2 + 5 - 2 + 2 + 4 + 1 + (1 - 3 + 0)(3 + 2 - 4)). -96v*5 Expand (2o*2 - 4o*2 + 0o*2)(-4 + 2 + 0) + 0o2 + 9o*2 - 4o*2 - 60 - 2o - 72 + 131 + 19o2. 28o*2 - 2o - 1 Expand (19 - 46 + 19)(-4 + 4 - 1)(-240t2 + 240t*2 - 56t*5). -448t5 Expand r5 + r*5 - 5r*5 + (11 + 6r*3 - 11)(3r - 9r + 0r)(-13r + 2 - 2). 465r*5 Expand 0 + 0 + k - 3k + k + 4k + 1 - k - 1 + (-2 - 3 + 3)(0k + 0k - k) + 0k + 3k - 5k - k + 6k - 2k - k - 28 + 14 + 10. 4k - 4 Expand (476 + 84 + 1622)(3j*3 - 6j*3 + 4j*3). 2182j*3 Expand (3 - 3 - 1)(636r - 37629 + 37629)(4 - 4 + r). -636r2 Expand (2 - k - 2)(-393 - 1142 + 178). 1357k Expand (8v*2 - 4v + 3v - 21v*2)(2v - v - 2v) - v*3 - 12v + 5v2 + 12v. 12v3 + 6v*2 Expand (174 + 2v*3 + 5v*2 - 174)(-18 + 196 + 51 + 425). 1308v3 + 3270v*2 Expand ((-2 - 1 + 2)(3 - 5 - 3) + 0 + 9 - 13)(2m2 - m2 + 2m2 + 2m). 3m2 + 2m Expand z - 4z + z + (1 - 1 + 2z)(2 + 0 + 0) - 4z - 2z + 3z + 98 + 8z - 98 + (3 + 1 + 3)(0z - 2z - z). -14z Expand (0m + 3m - m)(3m - 3m + 2m) + 107726 - 107713 - 6m*2 - 30m*2. -32m*2 + 13 Expand (-7 + 2 + 3)(-4p + p + p)((-4 + 4 + 7p)(23 - 23 - 7p) + (1 + 2p - 1)(-1 + p + 1)). -188p*3 Expand (-3i + 4i - 5i)(-7 - 28 - 7 - 23) + (0 + 1 - 2)(-5i + 6i + 3i). 256i Expand (-11i + 22i + 29i)(4 - 2 - 19 + (-6 + 5 - 1)(-3 + 2 - 1)). -520i Expand (-3f5 + 2f - 2f)(2 - 4 + 1)(2 + 6 + 1)(-3 + 0 + 1)(12 + 23 - 12). -1242f*5 Expand (62 - 732 + 218)(l*2 - 5l*4 + 11l*4 - 7l*4). 452l*4 - 452l*2 Expand (2 - 5 + 2)(5667n - 5605n + 13 + 1)(3n + 0 + 0). -186n2 - 42n Expand (-281 + 281 - 2m)(-3m + 6m + 12m) - 3m*2 - 5m*2 + 5m*2. -33m**2 Expand (-224 - 19	{ "pile_set_name": "DM Mathematics" }
1sqrt(1584))). 28sqrt(7)/25 Simplify 1((sqrt(192) + 2)2-5 + sqrt(192)) + -2. -982 - 152sqrt(3) Simplify -2 + (0 + sqrt(891) + sqrt(891) - (sqrt(11) - (4 + sqrt(11)2)))*2-3. -11963 - 456sqrt(11) Simplify 1sqrt(325) + -4 - ((-1sqrt(325))2 + sqrt(325) + -3). -326 Simplify -3sqrt(176) + -5 + sqrt(99) + 1((1sqrt(77))/sqrt(7))*23. -9sqrt(11) + 28 Simplify (1(4-4sqrt(99)1 + -4) + 0)2. 384sqrt(11) + 25360 Simplify (-2sqrt(133)-2 + 62sqrt(133))/(sqrt(70)/sqrt(90)-5). -48sqrt(19)/5 Simplify 4-4(sqrt(297)/(sqrt(9) + 1sqrt(9) + sqrt(9)))/(sqrt(11) - (6sqrt(539) - sqrt(11)) - sqrt(11)). 16sqrt(3)/123 Simplify (-4(sqrt(55) - -6(sqrt(55)-2 - sqrt(55))))/(sqrt(198)/sqrt(2) + (sqrt(55)-1)/sqrt(5)). 34sqrt(5) Simplify ((sqrt(26) + 1sqrt(26)3 - sqrt(26)) + (2sqrt(156) - sqrt(156))/sqrt(6))/((sqrt(18) - (sqrt(162) + sqrt(162)1)/sqrt(9))/sqrt(9))4. -16sqrt(13) Simplify (-1 + ((sqrt(2448) - (-1 + sqrt(2448) - sqrt(2448)))1 + -2)4)*2. -480sqrt(17) + 39193 Simplify -2((sqrt(156)/(sqrt(8)/sqrt(2)) + sqrt(39))-4)/((-6sqrt(72))/sqrt(6)). -4sqrt(13)/3 Simplify (-2 + sqrt(1539))3 + (5(-3 + sqrt(1539)))*2 + sqrt(1539). -1314sqrt(19) + 38694 Simplify (3 + (-3sqrt(42)/sqrt(2))/((sqrt(144)/sqrt(3) - sqrt(3)) + sqrt(3) - sqrt(3)))-4. -12 + 4sqrt(7) Simplify sqrt(52)/sqrt(4)-3-6 - (-2sqrt(208))/sqrt(4). 22sqrt(13) Simplify (sqrt(190)/(sqrt(10) + sqrt(90)-1))*2 + (6sqrt(38)/sqrt(2))*2 + sqrt(475) + 1. 5sqrt(19) + 2759/4 Simplify (2(1 + sqrt(112) + 3)-5-2)2. 12800sqrt(7) + 51200 Simplify (1(sqrt(104)/(sqrt(6)/sqrt(3)) - sqrt(52)))/(sqrt(32)/(sqrt(32) - sqrt(8))-1). 0 Simplify -5((sqrt(560)-2)/(sqrt(605) + 1sqrt(605)) + 5)2. -15685/121 + 200sqrt(7)/11 Simplify ((sqrt(684) + 52sqrt(684) + sqrt(684))3-5)*2. 22161600 Simplify sqrt(1573) + 5 + 5 + (-5sqrt(13)3)2 + 3. 11sqrt(13) + 2938 Simplify (2(-3 + -1 + -2 + 2sqrt(13) + sqrt(117)2 + sqrt(117))-2)*2. -2112sqrt(13) + 25744 Simplify (6-1(sqrt(960)/sqrt(12) + 5sqrt(20)))2. 35280 Simplify (-4(sqrt(480) + (sqrt(480) - ((sqrt(480) - 1sqrt(480) - sqrt(480)) + sqrt(480)))) - sqrt(480))/(sqrt(50)/sqrt(5)3) + -5. -12sqrt(3) - 5 Simplify (-3sqrt(2560))/sqrt(8) + ((sqrt(240)-4)/sqrt(3))2. -24sqrt(5) + 1280 Simplify ((-4 + sqrt(76)/sqrt(4) + -3 - sqrt(209)/(sqrt(121)/(sqrt(33)/sqrt(3)))) + -5 + 1)2. 121 Simplify (3 + (sqrt(1900) + ((-1 + sqrt(1900))2 + 0 - sqrt(1900)))4 + 3)3. -240sqrt(19) + 22830 Simplify (((6sqrt(350)-2)/sqrt(7))/(3sqrt(10)-2-4))*2. 5/4 Simplify (3-5(sqrt(70) + (sqrt(70) - sqrt(70)-1)))/(3(sqrt(10) + sqrt(90)-2 + sqrt(90) - sqrt(10))). 5sqrt(7) Simplify sqrt(10)/(sqrt(405)/sqrt(9)) - sqrt(14)/(-2sqrt(28)). 7sqrt(2)/12 Simplify ((0 + (2 + -1sqrt(704))1)2 + 4)-2. -1424 + 64sqrt(11) Simplify (sqrt(17) - (sqrt(425) + -2) - (sqrt(1377) + 2)) + sqrt(85)/(sqrt(320)3). -311sqrt(17)/24 Simplify (-4 + -3(sqrt(75) + -1) + sqrt(75) + -1sqrt(75) + -1)2. 60sqrt(3) + 679 Simplify ((sqrt(1331) - 2sqrt(1331)4 - sqrt(1331)-4-5)-1)2. 970299 Simplify -6(4 + sqrt(325)2) - (-3(sqrt(325) + 1) + 4 + 0 + sqrt(325))*2. -1325 - 40sqrt(13) Simplify -5 + sqrt(35)/(sqrt(40)/(sqrt(16)/sqrt(2))) + (sqrt(7) - (sqrt(63) + 2)*2) + sqrt(378)/sqrt(6). -72 - 7sqrt(7) Simplify -4(sqrt(425) + 3 + (-3sqrt(425))*2 + sqrt(425)) + (sqrt(425)1 + -1 - -4(sqrt(425) - 1sqrt(425)))*2. -14886 - 50sqrt(17) Simplify (sqrt(600) + sqrt(600) + (sqrt(600) - (3-1sqrt(600) + sqrt(600))))/(sqrt(972) + 5sqrt(972)). 25sqrt(2)/54 Simplify (-5(sqrt(130)1 - sqrt(130)) + -2sqrt(130)-3 + sqrt(130))/(5sqrt(1440)-1). -7sqrt(13)/60 Simplify (6(sqrt(35)1-6)/(-1sqrt(5)4))*2. 567 Simplify (sqrt(3645)3 + sqrt(45))/(sqrt(9) + 43sqrt(9)). 28sqrt(5)/13 Simplify -4 + (-2sqrt(104)24)/((-2sqrt(88))/sqrt(11) + sqrt(8) - (sqrt(8) + sqrt(968)1)). -4 + 16sqrt(13)/13 Simplify (-6-2sqrt(540))/(-2sqrt(60)/sqrt(192))-5. 720sqrt(3) Simplify 1 + -2 + (2 + sqrt(1872)-1 - sqrt(1872)) + 5(-1sqrt(1872) - sqrt(1872)) + 4. -144sqrt(13) + 5 Simplify 5(5(sqrt(7) - (sqrt(28)/sqrt(4) + 1)) + 5)*2. 0 Simplify (-3 + (2sqrt(1539) - sqrt(1539)) + 4 + sqrt(1539) + (sqrt(1539) + sqrt(1539)1 + 2)-4)*2. 756sqrt(19) + 55453 Simplify (4sqrt(720))/sqrt(9) - (1sqrt(245) + -5). 5 + 9sqrt(5) Simplify 3 + sqrt(1100) + sqrt(11) + ((sqrt(11) + -3)-6)*2 + -4. -205sqrt(11) + 719 Simplify ((sqrt(152)2)/sqrt(8) - (sqrt(684) + -2))2 + sqrt(114)/sqrt(6)-6 + (sqrt(19) - 1(sqrt(19)-3 + sqrt(19)) - sqrt(19))*2. -22sqrt(19) + 384 Simplify (sqrt(198)/(sqrt(6) + sqrt(96)-3))/(-2(sqrt(539) + sqrt(539) + 2sqrt(539)))-6. -3sqrt(3)/308 Simplify (sqrt(2) + -2 + 4 + -1)2 + 4(sqrt(72)1)2 + sqrt(72). 8sqrt(2) + 291 Simplify 2 + sqrt(176) + (2sqrt(176))2 + -4 + sqrt(44)/sqrt(4) + 6sqrt(44)/sqrt(4). 11sqrt(11) + 702 Simplify (sqrt(616)/sqrt(11))/sqrt(8) + 3 - ((sqrt(21)/sqrt(3) - sqrt(7)) + 1 - (2 + sqrt(700))). 4 + 11sqrt(7) Simplify ((-1(0 + sqrt(75)))2 + -5)-5. -350 Simplify (-6sqrt(110)2 + (sqrt(110) - 2sqrt(110))4)/((((sqrt(100) - -1sqrt(100)) + sqrt(100) + sqrt(100))5)/sqrt(10))-5. 4sqrt(11) Simplify ((-6(sqrt(600) + sqrt(600)1))/(sqrt(4608)2 - sqrt(32)))2. 2700/529 Simplify ((sqrt(1539) - (3 + 1sqrt(1539))) + -5 + -4)-6 + -4. 68 Simplify (sqrt(196)/(sqrt(4)2))/(sqrt(49)/sqrt(847)). 11sqrt(7)/2 Simplify (((-3sqrt(252)4 - (-2 + sqrt(252) + -1)) + 2)3)*2. -7020sqrt(7) + 383517 Simplify (0 + sqrt(2))-2 + ((2 + sqrt(2)-1 + sqrt(2) + sqrt(2))*2 - sqrt(2)) + -2 + -2sqrt(72). -11sqrt(2) + 4 Simplify (-2 + 1 + -1sqrt(405) + sqrt(405))*2-1. -1 Simplify (-2sqrt(1024)-5)/(sqrt(648) - (2sqrt(648)-4 + sqrt(648)) - sqrt(648)). 80sqrt(2)/63 Simplify (-1((sqrt(99) + -5(sqrt(99) + 1sqrt(99)) - (0 + -1sqrt(99))) + 3))2. -144sqrt(11) + 6345 Simplify 6(-4 + sqrt(171)-2 + sqrt(171) + sqrt(171) + 2 + 3)-5. -30 Simplify -6(((-1 + sqrt(704))-3)2 + sqrt(704) + -2)3. -114174 + 2448sqrt(11) Simplify (-5sqrt(352)-6)/((sqrt(162)/sqrt(36))/sqrt(9)). 240sqrt(11) Simplify (sqrt(396)3-4 + sqrt(396) + (-2 + sqrt(396) + sqrt(396))-5 + sqrt(396) + 2)2. -2880sqrt(11) + 158544 Simplify (2sqrt(500) + 3 - (sqrt(500) + 1 + -3)2)6. -3006 + 360sqrt(5) Simplify (0 + sqrt(117) + 2 - (sqrt(117) + 1 + 0 - sqrt(117)) - ((sqrt(117) - (sqrt(117) + 3 + -2sqrt(117))) + 3))*2. -6sqrt(13) + 118 Simplify ((sqrt(76) + sqrt(76)-2)1)/(sqrt(484) + sqrt(484)2). -sqrt(19)/33 Simplify ((sqrt(396) + -5)2 + -2 + sqrt(176))-3. -1257 + 168sqrt(11) Simplify (-4 + (sqrt(112) - (sqrt(112)3 + -4 + sqrt(112))) + -1)*2. 24sqrt(7) + 1009 Simplify (sqrt(2880) + 2sqrt(2880) + (sqrt(1125)-4 + sqrt(1125))*2)-6. -60750 - 432sqrt(5) Simplify -4 + -3((sqrt(363) + -1sqrt(363))2 + -3 + -6(1 + sqrt(363) - sqrt(363))). 23 Simplify (-5 + (5(sqrt(75) + 1) + 1((sqrt(75) + 3 - sqrt(75)) + sqrt(75)))6)2. 15480sqrt(3) + 99049 Simplify (-6-61(5 + (sqrt(128) - (sqrt(128) + 1)))-2)*2. 82944 Simplify -2(sqrt(72)/(((sqrt(8)/sqrt(2) - sqrt(4)) + sqrt(4))5) - ((2sqrt(216))/sqrt(12) - (sqrt(18)1 + -2))). 4 + 24sqrt(2)/5 Simplify -2 + (sqrt(1617)-2)/(2sqrt(1584)). -2 - 7sqrt(3)/12 Simplify (-3 + sqrt(48))2 + -3 - (0 + sqrt(243)). -33sqrt(3) + 54 Simplify (sqrt(84)-1 + (sqrt(126) + (sqrt(126) + (-2sqrt(126) - sqrt(126)) - sqrt(126)))/sqrt(6))/((sqrt(216) - 5sqrt(216) - sqrt(216))/sqrt(8)). 4sqrt(7)/15 Simplify ((2sqrt(216))/sqrt(9))/(sqrt(432)-1 + sqrt(12)). -2sqrt(2)/5 Simplify (sqrt(66)131)/(1sqrt(6)-4-3). sqrt(11)/4 Simplify -2 + (-1(-5 + sqrt(891) + 0) + -3)*2. -36sqrt(11) + 893 Simplify 2 + ((sqrt(165)/sqrt(5)5 + sqrt(33))/(1sqrt(3)-4))2. 107/4 Simplify ((sqrt(204)1-3 + 4(-1sqrt(204) + sqrt(204)))/(-6(sqrt(432)1 + sqrt(432) + sqrt(12))))2. 17/676 Simplify (2(sqrt(156) - 2sqrt(156))-6)/(-3sqrt(588)-2). 2sqrt(13)/7 Simplify 4(3 + sqrt(68))-12. -16sqrt(17) - 24 Simplify ((sqrt(99) + (sqrt(99) - sqrt(99)2)5 + sqrt(99) - sqrt(99)) + -5-2sqrt(99))/((sqrt(900) - (2sqrt(900)4 + sqrt(900))) + sqrt(900)). -3sqrt(11)/35 Simplify 3(((sqrt(96)/sqrt(4) - sqrt(24))/sqrt(2))/sqrt(6) + -4 + sqrt(24)/(sqrt(12)1)). -12 + 3sqrt(2) Simplify (((sqrt(78) + (1sq	{ "pile_set_name": "DM Mathematics" }
actor of t and 60. 30 Suppose 4w - 4f - 456 = 0, -117w - 3f + 134 = -116w. Calculate the highest common divisor of 68 and w. 17 Let j(h) = h + 3. Let i be j(-3). Suppose -2n + i = -12. Suppose 3w - w = 108. What is the greatest common factor of n and w? 6 Let i be (10/6513)/((-6)/(-111)). What is the highest common divisor of 296 and i? 37 Let h(z) = z*3 - 10z*2 + 6z - 13. Let i be h(11). Let d = i - 166. Calculate the highest common factor of 4 and d. 4 Let y be 1 - -1 - (-375)/(-5). Let o = y + 115. What is the greatest common divisor of 14 and o? 14 Let h(c) = 21c2 + 2c - 3. Suppose -2v + 2 = -0. Let s be h(v). What is the greatest common divisor of s and 220? 20 Let b be (2/(-2))/(507/(-63) - -8). What is the greatest common factor of b and 1? 1 Suppose 4318 = -5k - 2w, 1731 = -2k + w + 2w. Let r be k/(-63) - 3(-2)/21. What is the greatest common factor of r and 14? 14 Suppose -3d + 70 = 373. Suppose 0 = -5t + 2609 - 454. Let l = t + d. What is the greatest common factor of l and 33? 33 Let c be 1128/(-6)36/(-16). Calculate the greatest common factor of c and 9. 9 Suppose 1608 = 130u - 63u. Suppose -s + 3c = -9, 2s - s - c - 5 = 0. Calculate the greatest common factor of u and s. 3 Suppose 0 = 30u - 23u - 84. What is the greatest common factor of u and 48? 12 Let a be (-1)/((-1)/(-1)) - (-61 - -42). What is the highest common divisor of a and 2? 2 Let q = -207 + 539. Let w = -228 + q. Let z = 73564 - 73551. What is the greatest common divisor of w and z? 13 Let u be 6 + 9(-10)/(-15). Suppose b = -2b - 21. Let s = u + b. Calculate the greatest common factor of s and 10. 5 Let a be -4158/(-52) + (-4)/(-26). What is the highest common divisor of 16 and a? 16 Let n = 208 + -199. Suppose 29 = 4q - 195. Suppose nb - q = 7b. What is the greatest common divisor of 70 and b? 14 Let j be (-5)/(75/276)3610/(-76). What is the greatest common divisor of j and 38? 38 Let i(u) = -u*3 + 3u*2 + 6u - 2. Let q be i(4). Let t(l) = 1 - 3 - q + 1 - 5l. Let a be t(-6). What is the greatest common divisor of 23 and a? 23 Suppose 0 = 16l - 18l - 20. Let j(v) = v2 + 8v + 10. Let w be j(l). Let t = -15 + w. Calculate the highest common factor of t and 165. 15 Suppose 18n - 23n + h = -20, 0 = -2h - 10. What is the greatest common divisor of n and 51? 3 Suppose 2k + 2k = 4b + 16, -3k = -b - 14. Let t(j) = 8j + 4. Let d be t(k). Calculate the highest common divisor of d and 33. 11 Let f be 3 + (0 - 1) + -2. Suppose -3d + fd = -24. Let r be (10/(-8))/(d/(-384)). What is the greatest common divisor of 40 and r? 20 Let l be -4(0 - (0 - 3)). Let a = -9 - l. Suppose 7z = az + 56. Calculate the greatest common divisor of 42 and z. 14 Let m(z) = -2z*3 - 18z*2 + 7. Let f be m(-9). What is the greatest common divisor of 462 and f? 7 Let b be (-7)/((-28)/(-36)) + 1. Let h be (b - -15) + 1/(-1). Calculate the greatest common factor of h and 9. 3 Suppose 0 = 18i - 520 - 128. Let v be ((-108)/5)/(4/(-30)). What is the highest common factor of v and i? 18 Let k be 141(-4)/(-8). Let j(v) = v + 1 - 5 + 5 - 3. Let f be j(3). What is the highest common divisor of k and f? 1 Let d(x) = x*3 - 53x*2 - 110x + 65. Let f be d(55). What is the highest common divisor of f and 13? 13 Let h be 4/(-7) + ((-7660)/(-7))/4. Calculate the greatest common divisor of h and 7. 7 Suppose 5m = 4l + 436, 8 = l - 3l. Let w(s) = 148s - 136. Let d be w(1). Calculate the greatest common divisor of d and m. 12 Let k = -95 - -157. What is the greatest common divisor of 2 and k? 2 Let y = 1 - 1. Let z(u) = -15u - 16. Let c(q) = 8q + 9. Let m(v) = 11c(v) + 6z(v). Let x be m(y). Calculate the greatest common divisor of 1 and x. 1 Suppose 198 = 3u - 3j, 2u - 7u = j - 306. Calculate the greatest common factor of 186 and u. 62 Let r = 11 + -8. Suppose -2y + 26 = 2y - 5t, 3t = ry - 18. Suppose o - yo = -360. Calculate the highest common divisor of 15 and o. 15 Suppose 3z - z - 86 = 0. Suppose 0 = 4l - 3x - 857, -3l + 510x - 515x = -650. What is the highest common factor of l and z? 43 Let v(y) = y*2 + 5y - 4. Let d be v(-8). Let n = d + -9. What is the greatest common divisor of n and 1? 1 Let d(i) = 9i - 129. Let m be d(16). Calculate the greatest common factor of 12 and m. 3 Let s = -101 - -103. What is the highest common divisor of 14 and s? 2 Let f be ((-2)/6)/(3/(-63)). Let s = f - 0. Suppose 0 = -61h + 80h - 266. What is the greatest common factor of s and h? 7 Suppose -117 = 3l - 357. Suppose -2y - 3x + 120 = 0, -y = -2x + x - 65. Let p = 73 - y. What is the greatest common divisor of l and p? 10 Suppose 9h - 259 = -43. What is the greatest common divisor of 32 and h? 8 Suppose 3t = 266 + 130. Calculate the greatest common divisor of 99 and t. 33 Let o(h) = 2h*2 + 8h + 11. Let a be o(-5). Suppose 5v + 6 = a. Suppose -r + 4f + 7 = -3, -vf - 14 = -4r. What is the greatest common factor of r and 6? 2 Suppose 3a - 20 = -a. Suppose -3b = 2b - a. Let k = -38 - -49. Calculate the highest common factor of k and b. 1 Let a = 186 - 172. Calculate the highest common factor of 518 and a. 14 Suppose 0 = 2z - 0z - 5o + 10, -z + 4o - 11 = 0. Let i(c) = -46c + 6. Let v be i(z). Let w be -1 - 3v/12. What is the greatest common factor of w and 22? 11 Suppose 20h - 61 = 199. Calculate the greatest common factor of 117 and h. 13 Let l = 281 + -269. Let a be (0 + 70)(-16)/(-10). Suppose -a = 4s - 352. Calculate the highest common divisor of l and s. 12 Let o = 112 - 8. Let d = 0 - -5. Let g(i) = -i*3 + 5i*2 + 2i + 3. Let b be g(d). What is the highest common divisor of o and b? 13 Let y(l) = 2l3 + 29l*2 + 4l + 19. Let n be y(-13). Calculate the greatest common divisor of 6 and n. 6 Let k be ((86/(-8) - -2) + -1)-4. Suppose 0 = kj - 36j - 39. What is the highest common factor of 143 and j? 13 Let l = 36 - -120. What is the highest common divisor of l and 12? 12 Suppose -55 = -2p - 0p - w, p = -w + 29. Let c be p/10 + 4/10. Suppose c = t - 3. Calculate the highest common factor of 12 and t. 6 Suppose 333 = 3y - 228. What is the greatest common divisor of y and 85? 17 Let g = -105 - -182. Let z be ((-20)/(-72) + 44/198)22. What is the greatest common factor of z and g? 11 Let m be 20/3 - (-16)/12. Suppose -4j + mj - 660 = 0. Suppose -2h + 16 = -14. Calculate the greatest common factor of h and j. 15 Let n be 22936/671 + 2/(-11). What is the greatest common divisor of 68 and n? 34 Suppose 14b - 66 = 12b. Suppose -f + 11 = -b. Let p be (2/(-4))/((-1)/8). Calculate the highest common divisor of f and p. 4 Suppose -b + 4 = -0b. Suppose -bs + s = -3. Let h = -418 - -427. What is the greatest common divisor of s and h? 1 Suppose 0n + 117 = 13n. What is the highest common factor of 153 and n? 9 Let d(t) = -t*2 + 6t + 2. Let n be d(6). Suppose 54 = 5g - ng. Calculate the highest common factor of g and 54. 18 Let k(a) = 68a + 1. Suppose 4 = 2y - 4f + 6f, y - 4f = 17. Let d be k(y). What is the highest common divisor of d and 31? 31 Suppose -4h + 27 = -3o, -h + 2 = 3o - 1. Suppose 2g = -hg. Suppose 2y = -gj + 2j + 98, 4j + 241 = 5y. What is the greatest common factor of y and 15? 15 Suppose 69 = 5j - 2j - 2x, 0 = -5j + 2x + 119. What is the greatest common divisor of 250 and j? 25 Suppose -2 = -3x + 10. Suppose -z + xz = 0. Suppose 5p - 2r = -zr + 75, 5r - 93 = -4p. What is the highest common factor of p and 34? 17 Let y(g) = g2 - 7g - 6. Let r be y(9). Suppose -10u = -ru + 80. Let l be -1 - (1/(-1) + -8). What is the highest common divisor of l and u? 8 Suppose 34j - 61j + 20574 = 0. What is the highest common factor of 6 and j? 6 Let w be (4 - 25/5) + 39. What is the highest common divisor of 133 and w? 19 Let w be 21 - -3(-2)/(-2). What is the highest common divisor of 12 and w? 12 Let x be 9/((-135)/20)16182/(-248). Suppose -4r + 2j + 242 = 0, 5r + 5j = 374 - 109. What is the greatest common divisor of x and r? 29 Suppose 2j - 179 = -3k, -5j + 99 = 5k - 351. Calculate the greatest common factor of j and 28. 7 Let r = 133 - 94. Let f = -15 + r. Suppose -fa = -23a - 20. What is the highest common factor of a and 20? 20 Suppose 4*w - 42 + 10	{ "pile_set_name": "DM Mathematics" }
)/(-342). -3/2 Calculate -11 - ((-28)/(-21) + 336/72). -17 10/(-1) + 6996/693 2/21 What is the value of (-20)/(-110) + 159/33 - -7? 12 Evaluate 177/1197 + 15/(-6) + 303/126. 1/19 Calculate (3 - 20/8)/(-7 + (-387)/(-54)). 3 Calculate 20/2 + (-16490)/1455. -4/3 What is (6/22)/((-5895)/(-95106))? 22/5 What is the value of (-12)/(30/26 + -1 - 4508/2093)? 6 (-504)/(-35) - (-9 + (-1008)/(-120)) 15 What is the value of -2 - 238/682/1? -9 What is the value of 33/357 + (19 - (-1072)/(-56))? -2/17 (-13244)/(-60060) + 4/(-26) 1/15 Calculate 2(135/1215 - (382/36 - 1)). -19 Calculate 1/(-2)(-9 + -14 + 17) - -5. 8 ((-1)/46 - 3)/(1/2) -9 Evaluate (130/(-30))/(460/30 + -15). -13 What is (-10)/(-2) + ((-528)/38 - (9 - 18))? 2/19 What is the value of (34/(-153))/(-4 + -1 + (-38)/(-9))? 2/7 Calculate (-9434)/(-1424) - (7 + 0). -3/8 What is (-2142)/85 - (-64)/20? -22 Calculate (-22)/99 + (-9)/81. -1/3 What is the value of (-13)/(-1612)-4(-620)/20? 1 Evaluate (-12)/(-10)-5 - 46/(-10). -7/5 (20 - 8) + -7 - 19 - (-4 - -8) -18 What is -2 - ((-9)/(-6))/((-9)/30) - 20? -17 What is the value of ((-123)/12)/((-207)/180) - 2/(-23)? 9 What is (-3573)/(-189) - (-418)/(-22)? -2/21 What is the value of (-12)/26260/4686/5? -4/13 What is the value of -416/320(-15 - 0) + 2? 5 What is the value of (390 + -39)/39 + (-69)/3? -14 What is the value of 142/8 + 57/228? 18 Calculate (16/(-18))/8 + 13694/3690. 18/5 Evaluate 17 + (-10)/(-30(-19)/(-114)). 9 What is the value of ((-68)/17)/((-140)/(-7))? -1/5 What is 30/28(-84)/210? -3/7 What is 250/1200 + (4 - 1)/24? 1/3 What is the value of 177/236 + 235/(-20)? -11 Calculate 37/(-148) - (-1)/(60/175). 8/3 34(-8)/1344 + 21/(-252) -2/7 What is the value of 3 - ((-35)/(-21))/((-3)/(-27))? -12 Evaluate ((-2 + 4)/(532/(-114)))/(1/(-1)). 3/7 What is ((-3)/12-1)/((837/180)/31)? 5/3 What is the value of ((2 - 1) + -5)/4? -1 Evaluate 1/(22/(-8)) + 312/132. 2 Calculate (7 - (13 + -7))(-3 - 1). -4 What is the value of (-39)/(-6) + (-56)/112? 6 3/30 - 0 - (14 + (-219)/10) 8 What is the value of 188/(-517) - 6/(-11)? 2/11 (-66)/(-12)22/(8 - -3) 11 ((-4)/(-6))/(((-4185)/90)/31) -4/9 414/322(-14)/(-3)6/378 2/21 What is (-7 - (-189)/28)/((-13)/12 - -1)? 3 What is 190/4(152/80)/(-19) - -1? -15/4 Evaluate (12/10)/(33/55). 2 Calculate 1/(-6) + 4/42707/404. 0 What is the value of (462/(-63))/22((-14)/(-12) - 1)? -1/18 -5 - ((-42 - -53) + (-306)/19) 2/19 Calculate (0 - 1) + (-5 + -6)(-21)/63. 8/3 -3 + (-432)/(-120)(-35)/(-21) 3 (-5)/(-21)-80(-288)/1600 24/7 Calculate (576/480)/((-54)/(-15)). 1/3 What is the value of 114/6177/(-59)? -7 What is 22 + (-832)/56 - (-24)/28? 8 Evaluate 47 + -9 + -3817/34. 19 Evaluate (-231)/44 - (-6)/241. -5 What is -3((3 - 4125/243) + 14)? -2/27 What is (-32)/(-66)(-7110)/3160? -12/11 ((-632)/(-36972))/((-7)/(-9)) 2/91 What is the value of (-40)/(-24) + (1 - 25/(-3))? 11 What is (-18)/20(2550/(-180) - -14)? 3/20 8/9 + 1751(-44)/3366 -22 Calculate (12 - 14)/(10 - 8). -1 What is the value of ((-25)/(-10))/(225/(-210)(-28)/72)? 6 Calculate 6/(-2) - (-5546)/1062. 20/9 What is the value of ((-60)/(-80))/((0 - (-252)/(-8))/(-6))? 1/7 What is (-6)/(-72)42(-104)/(-56)? 13/2 What is the value of ((-15)/4)/((-4737)/(-12632))? -10 What is ((-84)/(-32))/(-7) - ((-116260)/4960 + 23)? 2/31 2/(-53) - 9430/8533 -8/7 What is (8/16)/(37/1850)? 25 What is 106/(-1218) + (-840)/8120? -4/21 Calculate (64/24)/(7/(-42)). -16 What is the value of ((-42)/(-126))/(3/36) + -9? -5 What is (23/(-966)15)/(50/(-8))? 2/35 What is 12/2 + 33(-45)/115 + 7? 2/23 What is (-12 - 0) + (30 - 24) - (-54)/8? 3/4 What is 30/(-240)16 - 48/(-4)? 10 What is (-58)/96 - ((-152)/12 - -3 - -9)? 1/16 3 - ((-254)/(-132) - 38/(-228)) 10/11 Evaluate (8/90)/((148/(-259))/((-12)/70)). 2/75 Calculate (-28)/(-5)(16 - (-533)/(-26) - -7). 14 Calculate 34(-4)/(-10) + 302 + -316. -2/5 Calculate (-118)/320 - (-30)/(-9)663/(-5525). 1/32 Evaluate (-1092)/936(-3)/(-42). -1/12 What is (-1080)/(-88) + -6 - (-34 + 4)/(-5)? 3/11 Calculate (0 + (-3)/(-4))/((-11400)/3040). -1/5 Evaluate (-34)/289 + 3 + (-265)/85. -4/17 Evaluate (((-4)/20)/((-18)/150))/(-1). -5/3 What is the value of (1 - (-11)/(-33))/(-3 + (-305)/(-105))? -7 Calculate 1(5/(20/16) + 9). 13 Calculate -13 + (-693)/(-11) + (-7 - (7 - 4)). 40 What is (1854/(-96) - -19)4/20? -1/16 What is the value of 2/(-8) + (-1497)/(-3108) + 76/(-266)? -2/37 Calculate (-28 - (-1032)/36)-15. -10 Evaluate 1100 + -1103 + (-2)/2-11. 8 Calculate (6640/(-62997) - (-2)/22)-3. 1/23 (1 + (-87)/81)/((-45)/90010) 4/27 What is the value of 111 + (-79764)/8211? 9/7 What is 2/(2/3)(-312)/117? -8 Calculate (22/14)/(3 - 20/7). 11 What is the value of ((-731)/344 - (-3 + 1)) + 350/1520? 2/19 What is ((-23)/1)/((-576)/320) - (-4)/18? 13 Calculate 2/25 + 10168/(-24600). -1/3 What is the value of (6/15)/((-11)/385)2/4? -7 Calculate (-5)/(12/((-1224)/595)). 6/7 Calculate ((-12)/(-22))/((-3)/11 - (-40)/110). 6 ((-5100)/(-90) - 57)/((-11)/(-3)) -1/11 Evaluate (-16)/(128/(-24)) - (30 - 9). -18 What is ((-16)/(-3))/(-12 + 722/57)? 8 Calculate -3 + (-290)/1164/5. -5 Calculate (-4)/(-1) + (-883 - -872). -7 Evaluate (3/305)/((-36)/72). -1 What is (-4)/(-6) + 40/(-45)? -2/9 Evaluate (9/(-135)12)/((-5)/(-675)-6). 18 What is (78/897 - (-260)/184)/((-2)/28)? -21 What is ((-376)/470)/((-2)/(-5))(-7)/2? 7 Evaluate (-176)/110(-120)/64. 3 Evaluate (-1836)/(-714)(-14)/(-4). 9 What is the value of (-23 + 676/39)(-6)/(-10)? -17/5 Calculate (-86 - -84)1/((-1)/(-5)). -10 30/42-7 - -21 16 Evaluate 2432/(-240) - (-50)/5. -2/15 Calculate 1(-9 - ((-324)/(-40))/((-12)/16)). 9/5 Calculate (-96)/126 - 70/(-49). 2/3 7/(28/(-114)) + 4 + 93/(-62) -26 Calculate 24 - 1022/12. 7 Calculate -5 - (333/(-27) + 0 + 8). -2/3 What is the value of 5/(-3)(-60)/(-57 - -37)? -5 What is the value of (-21)/(-28)(-64)/(-6384)-14? -2/19 -14(21/(-70) - 68/(-85)) -7 3/(-15)(-4 - ((-204)/(-72) - 6)) 1/6 What is (((-11)/((-22)/4) - 10) + -5)1? -13 Calculate 7 + (-12)/(-24)-4. 5 What is 2709/594 - 4? 1/11 What is the value of 2/(-64)(-72 - -74)? -1/16 Evaluate (-6)/526/130-25. 6 Evaluate 1143744/(-51888) - (-23 - -1). -2/47 What is the value of 17 + -50 + 700/1128/5? -23 What is 105/(-6) + 3 + (520/16)/13? -12 Evaluate 0/(-3) - ((-52)/13 + 11/2). -3/2 What is the value of 4 + 129/(-33) + (-357)/539? -4/7 Calculate 11/((-330)/(-160))(-18)/360. -4/15 Calculate (-7)/((-84)/27)(-7 - 384/(-54)). 1/4 Calculate (-304)/40 - ((-2 - -6) + -12). 2/5 Evaluate 5(5 - 3) + (16 - (-9 + 23)). 12 (-39)/(-832)8 - (-13)/(-112)2 1/7 Calculate 194/30 - (-3230)/(-510). 2/15 What is the value of 6/(-39) - ((-2896)/(-104) + -21)? -7 What is (-4)/(-60) + 22644/4590? 5 Calculate (1/(-3)-1)/(50/(62100/(-23))). -18 What is the value of (18 - 7596/144) + 35? 1/4 Evaluate ((-304)/13309/(-24))/((-2)/(-14)). 3/5 Evaluate 1113/84 + (-16)/(-192)-15. 12 Evaluate (38/(-50) + (-1)/(-1))310/93. 4/5 (-28 + 1098/39)/((-244)/(-52)) 2/61 What is the value of ((11/6)/(43/(-86)))/((-2)/6)? 11 (-2(-7 + (-639)/(-90)))/(259/(-70)) 2/37 24/(-18) - 578/102(2 + -4) 10 What is (12936/(-1232))/((-2)/4)? 21 What is the value of 1/(-15)(-42 + 54) - 183/15? -13 Evaluate (-14)/(-8) - 14(-717)/(-5544). -2/33 (3 + 1)/((-3176)/(-3970)) 5 What is ((-58)/(5104/(-165)))/(3/63)? 5/4 (162/(-5103))/(1 + (-4)/6) -2/21 Calculate ((-140)/(-60))/(-3 - 26/(-6)). 7/4 (-62 - (27 - 86))/((0 - 2)/20) 30 What is (-1 - (-10)/6)/((-370)/(-18870))? 34 What is ((-7)/4)/((-3)/12 + 0/(-8))? 7 ((-168)/(-60))/(10 + 312/(-30)) -7 What is ((-27435)/236 + 121)/(0 + 2/16)? 38 What is (-225)/20 + (-80)/(-64)? -10 What is the value of -3 + 14 + 1356/(-120)? -3/10 Evaluate (-27)/(-3) - (-4228)/(-476). 2/17 ((-2)/(-74))/(234/468) 2/37 Calculate (-7 - (-5)/(195/267)) + (-153)/273. -5/7 What is the value of (-6)/(-4) - (-10 + (-261)/(-18))? -3 2/21 + ((-1144)/546 - 1) -3 What is the value of ((-450)/10 + 54)2/6-5? -15 What is the value of ((-78)/91)/(((-105)/70)/((-7)/9))? -4/9 What is (318/212)/((-2)/32) - -9? -15 8/5 - -27(-12)/(-60) 7 Calculate (-472)/34 - (3030/(-255) - -12). -14 What is the value of (-100)/560778/(-5) + -7? 15 408/(-180) + 4/15 -2 What is the value of 2784/(-3744) - (-1)/13? -2/3 What is the value	{ "pile_set_name": "DM Mathematics" }
2, -1, 413, -3 in decreasing order. 413, 2, -1, -3 Put -0.4, 0, 21 in decreasing order. 21, 0, -0.4 Put -1/4, -0.025, -2 in ascending order. -2, -1/4, -0.025 Sort 3, -5/3, 15, 2/5 in descending order. 15, 3, 2/5, -5/3 Put -60, 3, -9 in ascending order. -60, -9, 3 Sort 5, 443, -3, 20, 1/10 in increasing order. -3, 1/10, 5, 20, 443 Sort -139, 4/9, 1. -139, 4/9, 1 Sort 3, -1, 51, 1 in increasing order. -1, 1, 3, 51 Sort -0.3, 5/3, 2, -1 in ascending order. -1, -0.3, 5/3, 2 Sort 1, -5, 87 in decreasing order. 87, 1, -5 Put -0.5, 0.5, -1, 8, -36 in decreasing order. 8, 0.5, -0.5, -1, -36 Put 1/14, -0.4, 1, 0.028 in descending order. 1, 1/14, 0.028, -0.4 Sort -3, -2, 11, 3 in descending order. 11, 3, -2, -3 Sort 4, -4, -2, -12. -12, -4, -2, 4 Sort 2/11, -3, 1/25, 2/7 in descending order. 2/7, 2/11, 1/25, -3 Put 2, 6, 5, -5, -56 in decreasing order. 6, 5, 2, -5, -56 Put 2, -5.23, 2/7 in increasing order. -5.23, 2/7, 2 Sort 1, 3, 0 in ascending order. 0, 1, 3 Sort 64, -1, 29. -1, 29, 64 Put -0.2, 3/22, -2/11 in decreasing order. 3/22, -2/11, -0.2 Sort -3, 80, 249. -3, 80, 249 Sort 8, 4, 21 in decreasing order. 21, 8, 4 Sort 6, -1/4, -3/64 in ascending order. -1/4, -3/64, 6 Sort 0.1, -1/3, -6, 1, 4/5. -6, -1/3, 0.1, 4/5, 1 Put -2, 0, 11/12 in descending order. 11/12, 0, -2 Sort 2, 0.4, -73 in decreasing order. 2, 0.4, -73 Put 5, -4, -102, -5 in decreasing order. 5, -4, -5, -102 Put -89, 4, -0.1, 0.5 in decreasing order. 4, 0.5, -0.1, -89 Put 34, 0.5, -2, -5/7 in ascending order. -2, -5/7, 0.5, 34 Sort -5, 2, 20. -5, 2, 20 Put 0.4, -0.1, 4, 6 in decreasing order. 6, 4, 0.4, -0.1 Put -0.33, -0.4, 14 in descending order. 14, -0.33, -0.4 Sort 10/9, 5, -0.2, 1, 0.5. -0.2, 0.5, 1, 10/9, 5 Sort 105, -0.5, -0.2, 0.3. -0.5, -0.2, 0.3, 105 Put -2, -791, 2, -3 in decreasing order. 2, -2, -3, -791 Put 0, 6/5, -2 in decreasing order. 6/5, 0, -2 Sort 4, -0.4, -68 in ascending order. -68, -0.4, 4 Sort 2, 11, -4, -2. -4, -2, 2, 11 Sort -3, -17, 4, 3 in ascending order. -17, -3, 3, 4 Sort 0.143, -2/3, 5 in decreasing order. 5, 0.143, -2/3 Put 53, 5, -40 in decreasing order. 53, 5, -40 Sort 3, 8, 2, -5, -37 in ascending order. -37, -5, 2, 3, 8 Sort 15.84, -4, 3, 0.04 in increasing order. -4, 0.04, 3, 15.84 Put -2, -1, 160 in descending order. 160, -1, -2 Sort -1/3, 2, -2/9, -0.5 in increasing order. -0.5, -1/3, -2/9, 2 Sort -0.3, -6, 2/191, 0 in increasing order. -6, -0.3, 0, 2/191 Sort -138, 0, -1. -138, -1, 0 Sort 2, -0.5, 1/53, 6, 2/7. -0.5, 1/53, 2/7, 2, 6 Sort 7, -5, -52, 5 in ascending order. -52, -5, 5, 7 Sort 5, -53, 2, -15, -4 in ascending order. -53, -15, -4, 2, 5 Put 3, 5, -4/3 in descending order. 5, 3, -4/3 Put -2, 4, 1, -1 in decreasing order. 4, 1, -1, -2 Sort -55/6, 4, -13 in increasing order. -13, -55/6, 4 Sort 3/4, 14/9, -43, -2/7 in descending order. 14/9, 3/4, -2/7, -43 Sort -0.038, 2/7, 0.5, -4, 6. -4, -0.038, 2/7, 0.5, 6 Put 4, -0.3, -7507 in descending order. 4, -0.3, -7507 Sort 17, -1/3, -0.2. -1/3, -0.2, 17 Put 0, -1/2, -0.115 in increasing order. -1/2, -0.115, 0 Sort -30, -4, 1 in decreasing order. 1, -4, -30 Put -48, 3, -3, 0 in ascending order. -48, -3, 0, 3 Put 0, 17, -5, 6 in increasing order. -5, 0, 6, 17 Sort 3/8, -2/3, 3.2 in decreasing order. 3.2, 3/8, -2/3 Sort 0, -5, -20, -1 in ascending order. -20, -5, -1, 0 Put 1, -93, -3 in decreasing order. 1, -3, -93 Put -1, -36, 2 in decreasing order. 2, -1, -36 Sort -49, -8, 4 in descending order. 4, -8, -49 Sort 0, 2/13, -0.5, -1 in decreasing order. 2/13, 0, -0.5, -1 Sort 4, -15, 0, 3, -4 in descending order. 4, 3, 0, -4, -15 Sort -147, -4, 4, 3 in increasing order. -147, -4, 3, 4 Sort -10, -1, -3, 5/2 in increasing order. -10, -3, -1, 5/2 Sort 0, -44, 2 in increasing order. -44, 0, 2 Put -20, 23, 0 in decreasing order. 23, 0, -20 Sort 0, -2, 98 in decreasing order. 98, 0, -2 Sort 4, -2, 3 in descending order. 4, 3, -2 Put 2, 1115, -5 in ascending order. -5, 2, 1115 Put -1, -11, 1/2, 1/4, -169 in descending order. 1/2, 1/4, -1, -11, -169 Sort 5, 4.132, 1/6 in increasing order. 1/6, 4.132, 5 Sort -1, 19, 4, -5 in descending order. 19, 4, -1, -5 Sort 281, 0, -3 in descending order. 281, 0, -3 Put -0.4, 5/2, 93 in decreasing order. 93, 5/2, -0.4 Put -0.4, 3, 6, -1/5 in increasing order. -0.4, -1/5, 3, 6 Sort -5, 27, 5, 1 in decreasing order. 27, 5, 1, -5 Put 0, 3, 2, 4 in decreasing order. 4, 3, 2, 0 Sort -4/5, -5, -1, -3/8. -5, -1, -4/5, -3/8 Sort 0.2, 4/37, 11, 0.3 in descending order. 11, 0.3, 0.2, 4/37 Put -3, -2, -174 in ascending order. -174, -3, -2 Sort -5, 13, -2, 0.3, -63 in ascending order. -63, -5, -2, 0.3, 13 Put -2/11, -0.2, -2/31 in descending order. -2/31, -2/11, -0.2 Put 5, -24, 533 in decreasing order. 533, 5, -24 Sort -2, -3, 65 in descending order. 65, -2, -3 Sort 0.4, 3, -4/3, 5, -13/4 in decreasing order. 5, 3, 0.4, -4/3, -13/4 Put -0.1, -3, 14 in decreasing order. 14, -0.1, -3 Put -4, 18, 1, 2/7, 4 in increasing order. -4, 2/7, 1, 4, 18 Sort 1/5, -0.5, -458/5 in decreasing order. 1/5, -0.5, -458/5 Put -2/3, 0, -116/9 in descending order. 0, -2/3, -116/9 Sort 4, -1, -7, -24, 3 in descending order. 4, 3, -1, -7, -24 Sort -4, -5, 0, -3. -5, -4, -3, 0 Put -1, 4, 3, 2 in descending order. 4, 3, 2, -1 Sort -25, 5, -7, 3 in increasing order. -25, -7, 3, 5 Sort -29, 21, -3 in ascending order. -29, -3, 21 Put 4, -5, -66 in increasing order. -66, -5, 4 Put 8, -5, 4, 1555, 3 in decreasing order. 1555, 8, 4, 3, -5 Sort 5, -58, 2/7. -58, 2/7, 5 Put 6, 1, 2 in increasing order. 1, 2, 6 Sort -4, 1, -97 in increasing order. -97, -4, 1 Sort 6, 7, -3. -3, 6, 7 Sort 0, -2/15, 0.513, -2 in decreasing order. 0.513, 0, -2/15, -2 Sort -65/12, 6, 0.4 in ascending order. -65/12, 0.4, 6 Sort -3, 6, 5, -5 in ascending order. -5, -3, 5, 6 Sort 8, -4, 1. -4, 1, 8 Sort -2, -1, 0, 2 in descending order. 2, 0, -1, -2 Sort 0.4, -2, 0.06, 1 in descending order. 1, 0.4, 0.06, -2 Sort 4, 5, -14 in decreasing order. 5, 4, -14 Sort -0.5, 0.35, 2/3, -1/7 in decreasing order. 2/3, 0.35, -1/7, -0.5 Sort -0.03, 1, -0.4 in descending order. 1, -0.03, -0.4 Sort 2/5, -7, 2, -5 in decreasing order. 2, 2/5, -5, -7 Sort 1/12, -4, 1. -4, 1/12, 1 Sort 18382, 0, -2 in descending order. 18382, 0, -2 Sort 2.1, 2/5, -0.5, -6/163, -5 in descending order. 2.1, 2/5, -6/163, -0.5, -5 Put -30, -1/5, 5/3 in decreasing order. 5/3, -1/5, -30 Put -0.11, -11, 2 in descending order. 2, -0.11, -11 Put 5, -1, -295, -3, 2 in decreasing order. 5, 2, -1, -3, -295 Sort 4, 3, -8, 17 in decreasing order. 17, 4, 3, -8 Sort 2/3, 33/7, -4 in decreasing order. 33/7, 2/3, -4 Put -2/11, -7084, 3 in decreasing order. 3, -2/11, -7084 Sort 2, -87, -4, 5 in descending order. 5, 2, -4, -87 Sort -5/13, -1, 0.3. -1, -5/13, 0.3 Put -0.5, -1/4, -3, 2/11 in descending order. 2/11, -1/4, -0.5, -3 Sort 5, 1/38, 6/5, -2. -2, 1/38, 6/5, 5 Sort -49, -2, -20, 4 in increasing order. -49, -20, -2, 4 Sort -3, 1, -54, 3 in increasing order. -54, -3, 1, 3 Put 0, 1994, 5 in ascending order. 0, 5, 1994 Put -144, -3, -2 in decreasing order. -2, -3, -144 Sort -3/8, -4, -1/9. -4, -3/8, -1/9 Sort 447, -1, 0. -1, 0, 447 Sort -1, -2, -4.48 in decreasing order. -1, -2, -4.48 Put -13, 2, 0.4 in ascending order. -13, 0.4, 2 Put -1, -3/7, -16, 3 in decreasing order. 3, -3/7, -1, -16 Put 5, -4, 44, 0.5 in ascending order. -4, 0.5, 5, 44 Put -5, 7, -8, 5 in ascending order. -8, -5, 5, 7 Sort -2/9, -2, 2, -4 in decreasing order. 2, -2/9, -2, -4 Sort 2, -6, 5/4, 1. -6, 1, 5/4, 2 Sort 0.5, -560, 3/4 in descending order. 3/4, 0.5, -560 Put -2/9, -1/4, -2/13, 0.3, -4 in descending order. 0.3, -2/13, -2/9, -1/4, -4 Sort 8/7, -4.4, 2/9, -0.5 in increasing order. -4.4, -0.5, 2/9, 8/7 Put 1/4, -2, -4 in decreasing order. 1/4, -2, -4 Sort 2, -2, -31 in decreasing order. 2, -2, -31 Sort -1/6, 1, 78, 2/3 in ascending order. -1/6, 2/3, 1, 78 Put 0.13, 0, 3/4, -0.3 in descending order. 3/4, 0.13, 0, -0.3 Sort -0.1, -51, 6. -51, -0.1, 6 Sort -8, -0.3, 3, -2 in ascending order. -8, -2, -0.3, 3 Sort -2, 2, 4. -2, 2, 4 Sort -63, -1, -0.4, 3/2 in increasing order. -63, -1, -0.4, 3/2 Put -16/13, 5, -24/17 in decreasing order. 5, -16/13, -24/17 Sort -0.1, -53, 0.08, 1/4, -0.5. -53, -0.5, -0.1, 0.08, 1/4 Sort -3, -4, -108, 4, -5 in increasing order. -108, -5, -4, -3, 4 Put -0.4, 2/7, -3, 8/5 in descen	{ "pile_set_name": "DM Mathematics" }
)/q)(1/59)/(q22)2 assuming q is positive. q(-2614/59) Simplify (((d*(-12)d)(-14))(-1/50))(-2/9) assuming d is positive. d(154/225) Simplify ((i/(i/((ii/((i/i(1/2))/i))/i)i)i)(4/9)ii(-2/13)i(-1/2))(-33) assuming i is positive. i(-869/26) Simplify (z(-3/2)z)/(z/(z(17/2)zz))(z12/z)/(z8zz) assuming z is positive. z10 Simplify (y18/y(2/13))/(y(-10/13)y(12/11)y) assuming y is positive. y*(2363/143) Simplify (zz*(-22)/zz*(-20)z)/((zz/(z/(zz*(1/8))))/((z/(z/(zz*(3/13)z)))/z)) assuming z is positive. z(-4357/104) Simplify (c(-3/5)(c(-2)c)/c((c/((cc(3/4))/c))/c)/c6)(-39) assuming c is positive. c(7293/20) Simplify (zz(-5/4)zz19z)/(zz(3/11)z/(((zz(3/4)z)/z)/zz)) assuming z is positive. z(445/22) Simplify ((rr/(r(1/5)/r))(2/83)r/(rrr/(rr*(-5)))r6)(1/5) assuming r is positive. r(28/2075) Simplify (d4/d*(-6/11)dd(-1/2)/dd(1/6)/d)10 assuming d is positive. d(1060/33) Simplify ((h/h(-1/8))(-1/7))(-2/3) assuming h is positive. h(3/28) Simplify (j(1/8)/j)/(j*(-5)j)j(4/13)j/(((j/j18)/j)/j) assuming j is positive. j(2437/104) Simplify (n*(-1/5)n/(nn(-10)))/(n/n16n(-15)/n) assuming n is positive. n(204/5) Simplify (w*(2/21)w)/w*(-6/11)w(2/17)/w(-1/28) assuming w is positive. w(28181/15708) Simplify u(2/49)uu/u*(-8)uuu/u*3u(2/7) assuming u is positive. u(506/49) Simplify ((x*1/xx)/x)/x*(1/6)x*(-1)x(-11)/x assuming x is positive. x(-79/6) Simplify (g/(g/(gg/(g/g(-1/11)gg))))(-3)(gggg(2/7)g)48 assuming g is positive. g(16092/77) Simplify (t(2/3))(-11/3)(t(1/15)/tt)(-44) assuming t is positive. t(-242/45) Simplify ((f/f(2/45))/(f/f(-1/26)))(-44) assuming f is positive. f(2134/585) Simplify (n*2nnn*(2/7)n*(4/7)/(nn(-3/5)))(-33) assuming n is positive. n*(-5148/35) Simplify (k/((kk*(2/7))/kkk)k)(-25)/((k/(k(-4/5)kk))/(k/(kk(-3/16)))) assuming k is positive. k(4217/560) Simplify (o/(o(o/(oo26))/o)o*(-2/95)o)12 assuming o is positive. o(31896/95) Simplify (z*(-18)z)/zz(-8/7)z/z*(2/21)zz(18/11)z assuming z is positive. z*(-3373/231) Simplify (mmm3/m)/m(-3/8)mm2m*(-1/5)m assuming m is positive. m(327/40) Simplify (r(-9/4)rr*(-1)rr)(-17/3) assuming r is positive. r(17/12) Simplify (((d/d(2/5))33)(-10))(-3/8) assuming d is positive. d(297/4) Simplify (dd/d*(1/58)d(-17/5))(-26/3) assuming d is positive. d(1781/145) Simplify (p/(p(-6)/p))*12(p(1/5))(-12) assuming p is positive. p(468/5) Simplify (t21t(-1/43))/((t(-2/9)/tt)/tt(t/(tt5))/tt) assuming t is positive. t(10139/387) Simplify ((l(-7)l1)(-9))(1/90) assuming l is positive. l(3/5) Simplify (a/(a(-12)/a)a/((a/(a*(20/7)a))/a))/(((a/(a/a(-2/5)))/a)/(a/(a/a10))) assuming a is positive. a(1059/35) Simplify a(-12)(((aa*13a)/a)/a)/a(a(2/3))(14/9) assuming a is positive. a(28/27) Simplify ((ww/w(19/4))/(w(-1/13)w))(-43) assuming w is positive. w(8213/52) Simplify yy/(yy28)yyy*23y(y17y)(-3/38) assuming y is positive. y(-46/19) Simplify ((yy5(y/y(-31))/y)(-6))(2/35) assuming y is positive. y(-444/35) Simplify (((y/y*13y)/y)/y(y/y(-7/4))/yy)/(y/((yy19)/y)yy/y(4/13)) assuming y is positive. y(315/52) Simplify (a(5/2)a*(-7)a/(a/(a*(-3/2)/aa))a(3/4)aa)4 assuming a is positive. a(-13) Simplify (k(-2/7)k*(2/9)(k*(-9)k)/k(-7))(-1/17) assuming k is positive. k*(67/1071) Simplify (((t(tt(-7))/t)/ttt(-1/10))/(t12tt(3/13)))(-40) assuming t is positive. t(10052/13) Simplify ((o/(oo/(oo/o(-1/6))))/o(-1/11))/(o/(oooo(-3)))(-37) assuming o is positive. o(2525/66) Simplify (x(-2/11))*29(xx/(((xx/(xx/(((x/(x/(x(2/17)/x)))/x)/x)))/x)/x)x)(23/3) assuming x is positive. x(30944/561) Simplify (k0)(-2/17)/((kk/k(-8))/kkkk*1k) assuming k is positive. k(-13) Simplify (i/((i5/ii)/i)i5)/(i(-1))(-46) assuming i is positive. i(-44) Simplify ((p/(pp(-8))pp/(p/(p(-1)/p))p)/(p(3/5)/(p/(p/p(4/3)))))38 assuming p is positive. p(4978/15) Simplify t/t*(2/27)t*(-3/2)(t/t17)/(t/t(-5)) assuming t is positive. t(-1219/54) Simplify ((n4n(3/11)n)(1/4))(-2/7) assuming n is positive. n*(-29/77) Simplify (zz/(zz(-2/3)/zz))*(3/23)/((zz*(4/9)/zz)/(zzz/z(2/17))) assuming z is positive. z(5825/3519) Simplify i*(-9)i/(i/((ii/((i/(ii*(3/11)))/ii))/i))i(-9)i(-10/7) assuming i is positive. i(-1398/77) Simplify ((l(-1/4))10l(-5)/(((l3/l)/ll)/l))(-2/149) assuming l is positive. l(17/149) Simplify (((k*(-3/4)/k)/k)/kkkk/(((k*(-1/28)kkkkk)/k)/k))42 assuming k is positive. k(-156) Simplify (i/((ii/i(2/3)iii)/iii))/((i*(1/2)i)/ii)(i/i(1/3))(-18) assuming i is positive. i*(-107/6) Simplify (cc*(4/13)c*(-8)cc)/(c(2/37)cc(-3/11)) assuming c is positive. c(-28961/5291) Simplify (p/((p(1/4)p)/p)p(1/6)(p*2/p)/pp(p((p/(p*(6/7)p))/p)/p)/pp)(-22) assuming p is positive. p(-55/42) Simplify ((s/((ss/((s/s*(6/11))/s)s)/s)s/s(-2/9))/(s(-1))(-17))48 assuming s is positive. s(-27440/33) Simplify (ppp(-17)p)/p*(1/2)p(17/5)/(p(-7/4)/ppp) assuming p is positive. p(-207/20) Simplify (f(-3)f/(f/(f(-1/8)/f))(f(1/4))(-2/137))13 assuming f is positive. f(-58825/1096) Simplify (z(1/20)/z)(-11/3)(zz(-2/39))/(z(-4/3)/zzz) assuming z is positive. z*(1239/260) Simplify (gg*21g/(gg1))/(g/(((gg(-2/7)/g)/g)/g))(-4/9) assuming g is positive. g(1415/63) Simplify ((s(1/2))(-44)/(s(2/7))(3/4))9 assuming s is positive. s(-2799/14) Simplify g(9/2)g18g*21/gg(g/(g/(gg/(gggg(-1/28)gg)g))g)/g assuming g is positive. g(1163/28) Simplify (x24/x15)/(x/(x/x(-20))x(2/67)) assuming x is positive. x(1941/67) Simplify (o(-6))(-46)(((oo*(2/29)o)/o)/o)/o(4/7) assuming o is positive. o(55926/203) Simplify (z(-21))(-9/4)(z/(z/(z(-3/4)z)))(-15) assuming z is positive. z(87/2) Simplify (fff*(1/3)fff)*(-1/51)((f/(f/(((ff3f)/f)/f)ff))/f)6 assuming f is positive. f(-16/153) Simplify n(-1/6)/((n/n(3/5))/n)(n0)(-11/2) assuming n is positive. n(13/30) Simplify (b/b(2/19))(-6/11)(b*(1/3)b)(3/46) assuming b is positive. b(-1928/4807) Simplify (r(-1/4))25/(r5/r(6/17)) assuming r is positive. r(-741/68) Simplify (n8/n*1n10/(n5/n))(-1/44) assuming n is positive. n(-13/44) Simplify ((c/(c*31/c))/cc(3/23))/(c(-1/14))(-5) assuming c is positive. c(-9733/322) Simplify (((x*(3/11)x)0)(-12))(-1/14) assuming x is positive. 1 Simplify ((r(-8)rr)(2/59))44 assuming r is positive. r(-528/59) Simplify ((b/(b/(b/b(-3)bb)b))/b)(1/9)b*(-2/17)/((bb/b*(2/13))/bbb) assuming b is positive. b(-5011/1989) Simplify ((dd/d*(-2/3)d)(-2/13)/((d(-4/5)d)/(dd/(d*5d))))(16/9) assuming d is positive. d(-14864/1755) Simplify ((j/(jj(-19)))/j(5/7))/((j(-1/9)/j)/jj(-11)) assuming j is positive. j(1978/63) Simplify ((c/c*(-1/5))/(c/(cc(5/6))))/((c/c0)/c7) assuming c is positive. c(241/30) Simplify (ll(1/8))(5/3)/((ll(-4/3))/(l(-7/2)/l)) assuming l is positive. l(-55/24) Simplify (c(1/9))(-34)/((c/c(-2/45))/c(-2/7)) assuming c is positive. c(-1609/315) Simplify ((c/(c/c(-6)))/(c/(c16c)))/(c/c(8/9)cc(-1/10)) assuming c is positive. c(809/90) Simplify o/(o/(o/o(2/19)o)o)o*15ooo*(13/2)o(1/8)/o assuming o is positive. o(3575/152) Simplify (((t/(t/(t/t(1/2))))(-21))(-10/13))(-7) assuming t is positive. t*(-735/13) Simplify (((d/(dd*3)dd)/(dd*2))/(dddd/(d/(d/(d*(-5)/d)))dd(2/5)))(-1/4) assuming d is positive. d(77/20) Simplify (((b/b(-1))/bbb(-1/4))28)(3/38) assuming b is positive. b(147/38) Simplify n(2/21)nn(-28)((nnn(5/8))/n)/(n/(n(4/3)n)) assuming n is positive. n(-1341/56) Simplify (j(1/2))(-6/17)/(j0jj*(8/9)/	{ "pile_set_name": "DM Mathematics" }
*2 + 5d - 15. Let j(i) = -5o(i) + 8s(i). Determine j(r). 4 Suppose -16 = -3s - 5m, -2m + 20 = 2m. Let c(k) be the second derivative of 0 - 6k + 1/6k*3 + 0k2. Give c(s). -3 Let x(g) = g2 - 13g + 19. Suppose -135w + 143w - 24 = 0. Suppose -2v - 16o = -15o - 23, 14 = v + wo. Give x(v). -3 Let t(a) = 22a + 338. Let j = 18513 + -18528. What is t(j)? 8 Suppose -80x - 597 = 123. Let c(g) = g2 + 9g - 14. Calculate c(x). -14 Let p(b) be the second derivative of 2b3 + b2/2 + b - 7. Let l = 158 - 159. What is p(l)? -11 Let w(h) = -231h + 16624. Let r be w(72). Let l(j) = 57j + 465. Calculate l(r). 9 Let h(l) = -l3 - 10l*2 - 6l + 15. Suppose 79 = 78d - 97d - 54. What is h(d)? -90 Suppose 2m = -4w - 6, -2w = -35m + 40m - 41. Let o(s) = -15s*2 + 163s + 22. Determine o(m). 0 Let b(x) be the third derivative of -x*3 + 30x + 0 + 1/12x4 - x2 + 1/60x5. Determine b(-5). 9 Let p(x) be the second derivative of -x4/12 + x*3/6 + 5x2/2 - x. Let d = 21900 - 21895. Calculate p(d). -15 Let t(k) = -k2 + 7k - 7. Let g(w) be the second derivative of -w5/20 + 5w*4/6 + 13w*3/6 + 3w*2/2 - 20w. Let y be g(11). Let a = y - 19. Give t(a). -1 Let r(m) = m*2 - 4m. Suppose -4z = -30 - 6. Suppose -z = -3i - 0. Suppose ig = 20 - 8. What is r(g)? 0 Let d be 30/75 - 233/(-5). Suppose dv = 58v + 44. Let f(k) = k2 + 2k - 5. Give f(v). 3 Suppose c - 2 = -2g - 0g, 9 = -3g. Let r(y) = -9y*2 + 9y - 3 - 8y2 + 17y2 - 3 - y2. Calculate r(c). 2 Let t(a) = -2a - 9. Let i be t(-5). Let l(v) = -i + 6 - 5 - 2 + v + v2. Give l(3). 10 Let y(l) = 39 + 22l - 20l - 5 - 20. Determine y(-12). -10 Let j(c) = -16c + 247. Suppose 1785 - 4815 = -202l. What is j(l)? 7 Let o(g) = 5g + 6g + 329g*2 - 665g*2 + 329g*2 - 5g + 13 - g*3. Give o(-7). -29 Let t(a) = -2 - 282a + 143a + 8a*2 - 2a*2 + 143a + 3. Give t(-2). 17 Let f(g) = -804g + 102921. Let l be f(128). Let b(y) be the second derivative of -y4/12 + 7y3/6 - y2/2 + y. Calculate b(l). -19 Let z(x) = -x3 - x2 + x - 13. Let m(h) be the third derivative of h*6/120 + 3h5/10 + h4/8 + 9h3 - 66h*2. Let j be m(-18). Give z(j). -13 Let m = 5 - 4. Let q = 115 - 94. Let p(j) = -23 + 43 - q - 5j. Calculate p(m). -6 Let p(m) = -128m3 - m2 + 1. Suppose 5r + 20176 = 20171. Give p(r). 128 Let b(w) be the second derivative of -w*5/20 + 7w4/4 + w3/3 - 37w2/2 - 191w. Give b(21). 5 Let f(t) = 378t2 - 953t*2 - 4t + 287t2 + 284t*2 - 2t*3 - 6 + 0. Determine f(-4). 74 Let g be (-1 - 9)((-22)/55)/2 + 11. Let m(z) = -z*3 + 14z*2 - 15z - 16. Give m(g). -42 Let n(k) = -189k + 1185. Let y(v) = 44v - 296. Let l(p) = 2n(p) + 9y(p). What is l(16)? -6 Let j(o) = o*3 - 15o*2 + 14o. Let i be j(14). Let h(s) = 4s - s2 + 3s*2 + is + 4 - s*2. Let t(m) = -10m + 56. Let w be t(6). Calculate h(w). 4 Let c be 6/((-150)/(-95)) - (-77)/385. Let k(m) = 11m3 - 10m*2 - 7m - 2. Let y(g) = 5g3 - 5g*2 - 3g - 1. Let b(i) = 4k(i) - 9y(i). What is b(c)? 13 Let h(y) = 10y + 52. Let j be -2(8 - 9 - -4). Calculate h(j). -8 Let d(p) be the second derivative of p*4/6 + 5p*3/6 + 2p*2 + 2p. Suppose -2u - 8 = 2i, 0i = i + 5u + 8. Let r be (i + 6/(-6))(1 - 0). Give d(r). 16 Let j(s) = 8s*2 + 2s + 1. Let f = 85 + -83. Let d be (-7 - 3) + 5 + f2. Determine j(d). 7 Let n(y) = -2y - 1. Let k(u) = -4u - 4. Let h(c) = k(c) - 3n(c). Let w = -2 - -1. Let j be (-3 - -2)3w. Give h(j). 5 Suppose -5c + 2c = -3, 2u = 5c - 5. Let l(g) be the first derivative of g*2/2 - 9g - 19. Determine l(u). -9 Let p(v) = 222v - 1 - 120v - 96v. Calculate p(13). 77 Let j(z) = z2 + 4z + 1. Let g = -27 - -29. Suppose -gt = -4d - 22, -2d + 6d - 5t = -31. Give j(d). 1 Let y(n) = n2 - n. Let r be y(0). Suppose 3j = -3, 4s + 3j - 20 = -3. Let l(h) = 11h + 7. Let g(p) = 9p + 8. Let b(k) = sg(k) - 4l(k). What is b(r)? 12 Let o(j) be the second derivative of j5/20 - j4/2 - j*3 - 11j*2/2 - 89j - 60. Suppose 11 = a - 0a + 2w, -3a - 2w = -25. What is o(a)? -4 Let m(o) = o*2 + 8o + 4. Let z(y) = 3y2 + 23y + 13. Let c = 103 - 111. Let x(d) = cm(d) + 3z(d). Give x(-6). 13 Let h(t) = -t*3 + 3t*2 - 2t + 4. Let z(s) be the first derivative of -s*3/3 + 9s*2 + 22s - 58. Let b be z(19). Determine h(b). -2 Let z be ((8/(-20))/((-2)/(-10)))/(-2). Let l(s) = s - z - 4 + 2 + 6. Calculate l(7). 10 Let r(f) = -2f - 56. Let q be 136369/19716 - (13/(-12) - -1). Calculate r(q). -70 Let m(s) = -s3 + 58s*2 + 255s - 457. Let p be m(62). Let y(h) = -31h - 708. Determine y(p). 5 Let t be (-10)/4(-20 + 18) + 5083/(-1020). Let i(b) be the third derivative of -tb5 + 0 + 1/12b*4 + 16b*2 + 0b + 1/3b3. Calculate i(4). -6 Suppose -6 = -4i + v, -2i + 235 = -2v + 229. Let p(x) = 5x - 1. Determine p(i). 4 Suppose -g - 38 = 3r, 11r + 44 = 8r - 4g. Let m(k) = k3 + 12k*2 - k - 7. Give m(r). 5 Let g(r) = 6r + 39. Let n(l) = l3 + l2 - 24l + 30. Let q be n(3). Determine g(q). 3 Let k(y) = -y2 + 14y + 6. Let v be k(14). Let t be (-2)/v - 70/(-21) - 2. Let n(o) = -7o. Calculate n(t). -7 Let t(z) = -77z*2 + 2z + 1. Suppose -4y + 14 = 12n - 10n, -20 = 4n - 4y. Give t(n). -78 Let h(p) be the first derivative of -2p*3/3 + 7p*2 + 17p + 2069. Determine h(8). 1 Let d(q) be the second derivative of -q*4/3 - 2q*3 + 11q*2/2 + 1566q. Give d(1). -5 Let z(l) be the first derivative of -l*4/4 - 5l*3/3 + 3l*2 - 9l + 2085. Give z(-8). 135 Let g(i) = -i - 9. Let q be 315/(-189) + 434/(-6). Let w = 71 + q. Determine g(w). -6 Let z(o) be the second derivative of o*2 + 2 + 13o + 1/6o3. Determine z(0). 2 Let f(c) = 5c + 42. Let g be f(-8). Let u(r) = -172r2 + 341r*2 - 5r - 170rg. What is u(-6)? -6 Suppose -29u + 64u = 22u - 39. Let a(o) = -o*2 + 35o + 111. Calculate a(u). -3 Let a(x) = -240 - 283 + 10x + 806 - 243. Determine a(-6). -20 Let g(x) = 9x + 108. Let n(a) = -25a - 283. Let v(w) = -8g(w) - 3n(w). Determine v(-11). -48 Let p(x) be the third derivative of -38x*2 + 1/6x*4 + 0x - 7/6x3 + 0. Give p(2). 1 Let s be (1 + (-54)/45 - (-52)/10) + -6. Let z = 9 + -3. Let u(x) = zx3 - x2 + 6 - 5 + 0x2. Calculate u(s). -6 Suppose 79f = 80f - 3. Let z(c) = -4c*3 + 0c*2 - c - fc2 - c3. Calculate z(-2). 30 Let c(k) = 2k3 - 4k*2 + 2k - 7. Let i be -6(-31 + 34 + (-20)/6). What is c(i)? -3 Let z(j) = 1 - 6 + 6j - 5j + 3. Let m(l) = -l2 - 8l - 1. Let r be m(-7). Suppose 8 - r = -n. What is z(n)? -4 Let u(g) = 74 + 3g - 14 - 15 - 22 + 7g. Determine u(-7). -47 Let h = 3356 - 3351. Let n(a) = 9a + 6. Give n(h). 51 Let w be -4 - (-4)/(-8)1-38. Let s be (-3 - w/(-4)) + 25/20. Suppose -5 = sg - 17. Let l(z) = -2z + 4. Give l(g). -8 Suppose 10 = 2z, -b + z = 15 - 5. Let o(i) = -1789 + 929 + 860 - 5i. Determine o(b). 25 Let g(m) = -m - 1. Suppose 2z - 50 = -5t, 5z + 3t + t = 108. Suppose -u + p = -59 + 42, 5p = -u + 29. Let o = z - u. Calculate g(o). -2 Let h(m) be the first derivative of m*3/3 - 13m*2/2 - m + 44. Let s(v) = -2v + 1. Let k(l) = -h(l) + 2s(l). Determine k(10). -7 Let q(r) be the third derivative of 0 + 0r - 1/24r4 + 67r2 + r3. Give q(3). 3 Let c be (24 + (-49 - -21))/(0 - 4/3). Let y(x) be the third derivative of -x5/30 + x4/8 + x*3/2 + 3x*2. What is y(c)? -6 Let l be (-1)/(-3) - ((-91)/(-21) - 4). Let o be 1 - l - (4 - 10). Let y(v) = v - 1. Let b(a) = 6a - 12. Let c(z) = -b(z) + 5y(z). Determine c(o). 0 Let i(o) = 3o + 252o2 - 3 + 3o*3 - 246o*2 - 2o*3. Let k = 318 - 324. What is i(k)? -21 Let u(g) = g + 25. Let w be u(-12). Suppose 2x - w = -21. Let y be (2/x)/(9/(-108)). Let f(n) = n*2 - 6n. Calculate f(y). 0 Let j be (-24)/(-15) + (-6)/10. Let o(l) = -27l3 - 71l*2 + l - 7. Let x(y) = 24y*3 + 59y*2 - y + 6. Let i(d) = -5o(d) - 6x(d). Give i(j). -8 Suppose -3g - p + 20 = 0, -5g + 31p - 35p = -45. Let d(a) = -a3 + 5a*2 - 4a + 16. Determine d(g). -4 Let a(w) be the second derivative of -w5/60 - w4/8 + w*3/6 + 19w*2/2 + 16w + 2. Let u(h) be the first derivative of a(h). Give u(-4). -3 Suppose 2w = d - 45 - 53, 2w = -3*d + 262. Suppose	{ "pile_set_name": "DM Mathematics" }
3/3 - 54a*2 - 116a/3 - 16/3 = 0. What is a? -1/4, 2, 4 Factor -i*2/9 - 2i/9 + 8/9. -(i - 2)(i + 4)/9 Factor 2t*4 + 8t*3 - 6t*2 - 36t. 2t(t - 2)(t + 3)2 Factor -2w*3/15 - 38w*2/15 - 12w/5. -2w(w + 1)(w + 18)/15 Solve q4 + 37q*3 + 248q*2 + 464q = 0. -29, -4, 0 Let 3i2/4 - 189i/2 - 390 = 0. What is i? -4, 130 Factor -18o2 - 394o + 44. -2(o + 22)(9o - 1) Factor -3u*2/5 - 1638u/5 - 223587/5. -3(u + 273)2/5 Find m, given that -4m*5/3 + 110m*4 - 478m*3 + 2362m*2/3 - 574m + 156 = 0. 1, 3/2, 78 Factor -4r2/3 - 32r - 476/3. -4(r + 7)(r + 17)/3 Determine k so that k*3/7 - 285k*2/7 - 6000k/7 - 30500/7 = 0. -10, 305 Suppose 2v3/7 - 16v*2 - 1560v/7 - 4896/7 = 0. What is v? -6, 68 Determine w so that -2w5 - 120w*4 + 248w*3 - 4w*2 - 246w + 124 = 0. -62, -1, 1 Factor -z*4 + 60z*3 - 958z*2 + 1740z - 841. -(z - 29)*2(z - 1)*2 Suppose 4b*4 + 16b*3 + 12b*2 = 0. What is b? -3, -1, 0 Factor -3s*2 - 156s - 2028. -3(s + 26)2 Let 4o*5 + 76o*4 + 388o*3 + 180o*2 - 648o = 0. What is o? -9, -2, 0, 1 Find p, given that -2p2/5 + 228p - 4528/5 = 0. 4, 566 Suppose -2f4 + 52f*3 + 114f*2 - 52f - 112 = 0. Calculate f. -2, -1, 1, 28 Solve b*5/12 + 5b*4/4 + 35b*3/12 - 5b*2/4 - 3b = 0 for b. -12, -3, -1, 0, 1 Determine v so that -4v3/5 + 36v*2 + 784v/5 = 0. -4, 0, 49 Determine n so that -15n3 + 230n*2 - 75n = 0. 0, 1/3, 15 Solve -11t4/5 - 37t*3 - 307t*2/5 - 103t/5 + 6 = 0 for t. -15, -1, 2/11 Factor -p*2/7 - 183p/7 + 558/7. -(p - 3)(p + 186)/7 Factor 2w*2/9 - 2/9. 2(w - 1)(w + 1)/9 What is d in -d3/4 - d2/4 + d + 1 = 0? -2, -1, 2 Determine s so that 4s*3 - 1184s*2 + 87616s = 0. 0, 148 Let -3z2 + 27z - 54 = 0. What is z? 3, 6 Factor -2u3/5 + 1770u*2 - 2610750u + 1283618750. -2(u - 1475)3/5 Factor 3x*3/4 - 15x*2/8 - 3x/2 + 9/2. 3(x - 2)2(2x + 3)/8 Determine j, given that 12j*5 - 16j*4 - 12j*3 + 16j*2 = 0. -1, 0, 1, 4/3 Determine k so that 2k*4/5 - 13k*3/5 + 28k*2/5 - 23k/5 + 6/5 = 0. 1/2, 1, 2, 3 Factor m*3/9 + 29m*2/9 + 224m/9 + 196/9. (m + 1)(m + 14)2/9 What is d in -d3/7 + 67d*2/7 - 591d/7 + 171 = 0? 3, 7, 57 Factor -k*3/9 + 16k*2/9 + 529k/9 - 544/9. -(k - 32)(k - 1)(k + 17)/9 Factor 18b3/7 - 10b*2 + 64b/7 + 8/7. 2(b - 2)2(9b + 1)/7 Factor -2a*3/21 - 40a*2/21 - 34a/3 - 440/21. -2(a + 4)(a + 5)(a + 11)/21 Solve c2/2 + 6c + 16 = 0. -8, -4 Find v, given that -2v5/13 + 236v*4/13 + 12v*3/13 - 1400v*2/13 - 1882v/13 - 708/13 = 0. -1, 3, 118 Solve 5j3 + 5j*2 - 25j + 15 = 0 for j. -3, 1 Suppose -3t5 + 6t*3 - 3t = 0. What is t? -1, 0, 1 Suppose -2i2/3 + 668i = 0. What is i? 0, 1002 Solve c*3/2 - 2535c*2/2 + 2142075c/2 - 603351125/2 = 0. 845 Let 2z2/7 + 6z/7 - 8 = 0. What is z? -7, 4 Factor m*2/3 - 2765m/3. m(m - 2765)/3 Find c, given that -c2 - 34c + 152 = 0. -38, 4 Find c, given that 5c4 + 115c*3 - 35c*2 - 775c + 690 = 0. -23, -3, 1, 2 Let -5z3 - 4525z*2 - 1030535z - 3051015 = 0. Calculate z. -451, -3 Factor x*4/6 + 7x*3/6 - 5x*2/3 - 8x/3. x(x - 2)(x + 1)(x + 8)/6 Factor 2f*4 + 3198f*3 + 1704534f*2 + 302838874f. 2f(f + 533)*3 Suppose -4k*4 + 48k*3 + 56k*2 - 48k - 52 = 0. Calculate k. -1, 1, 13 Factor -u*2/3 - 112u. -u(u + 336)/3 Factor f4/2 + 174f*3 - 699f*2/2 + 175f. f(f - 1)2(f + 350)/2 Factor -2a2 - 40a - 192. -2(a + 8)(a + 12) Determine j so that j*2/5 + 5838j/5 + 8520561/5 = 0. -2919 Let 5i3 + 170i*2 + 620i + 600 = 0. What is i? -30, -2 Let -4h5/3 + 98h*4/3 + 56h*3/3 - 148h*2/3 - 52h/3 + 50/3 = 0. What is h? -1, 1/2, 1, 25 Factor -2d4/9 - 16d*3/9 + 22d*2/3. -2d*2(d - 3)(d + 11)/9 Let 3m*2/2 + 324m + 17496 = 0. What is m? -108 Suppose 3b2/2 + 351b - 705/2 = 0. Calculate b. -235, 1 Let -3b2/2 - 141b/2 - 69 = 0. What is b? -46, -1 Factor -2v2/17 + 160v/17. -2v(v - 80)/17 Factor 5j2 - 200j - 645. 5(j - 43)(j + 3) Factor -z*2 - 11667z/5 - 4666/5. -(z + 2333)(5z + 2)/5 Find y such that y*5/3 + 26y*4/3 - 39y*3 + 94y*2/3 + 116y/3 - 40 = 0. -30, -1, 1, 2 Factor -p*3/5 - 57p2/5. -p2(p + 57)/5 Factor -h4 + 6h*2 - 8h + 3. -(h - 1)*3(h + 3) Let -c*4/2 + 35c*3/2 - 149c*2 + 132c = 0. Calculate c. 0, 1, 12, 22 Determine s, given that -2s4 - 12s*3 + 44s - 30 = 0. -5, -3, 1 Determine k so that 3k4 - 381k3 = 0. 0, 127 Solve -i3 + 16i2 - 29i - 130 = 0. -2, 5, 13 Solve -l*4/2 + 38l*3 - 714l*2 = 0. 0, 34, 42 Solve -2b*5/7 + 764b*4/7 + 3852b*3/7 + 6952b*2/7 + 5414b/7 + 1548/7 = 0 for b. -2, -1, 387 Let -2s2/5 + 14s/5 + 88/5 = 0. What is s? -4, 11 Factor -y*3 + 596y*2 - 88205y - 178802. -(y - 299)*2(y + 2) Solve -5g5 - 360g*4 + 15g*3 + 1090g*2 + 720g = 0. -72, -1, 0, 2 Find t such that 4t5/3 + 9t*4 + 29t*3/3 - 37t*2/3 - 11t + 10/3 = 0. -5, -2, -1, 1/4, 1 Let 45o2/8 - 291o/2 - 39/2 = 0. Calculate o. -2/15, 26 Factor 26p3/3 + 224p*2 - 104p/3. 2p(p + 26)(13p - 2)/3 Find a such that -2a3 + 68a*2/9 - 56a/9 - 16/9 = 0. -2/9, 2 Find x, given that -2x2/3 + 292x - 31974 = 0. 219 Determine m so that -28m2 + 340m - 312 = 0. 1, 78/7 Factor c*2/4 + 11c/4 + 9/2. (c + 2)(c + 9)/4 Factor -2f*4/3 - 2f*3 + 8f/3. -2f(f - 1)(f + 2)2/3 Suppose -2g*4 + 2g*3 + 4g*2 = 0. Calculate g. -1, 0, 2 Factor 2h*5 - 4h*3 + 2h. 2h(h - 1)*2(h + 1)*2 What is y in -4y*5 + 80y*4 - 48y*3 - 584y*2 + 1012y - 456 = 0? -3, 1, 2, 19 Factor 2t2/11 + 18t/11 - 4. 2(t - 2)(t + 11)/11 Factor -p*2 + 982p + 1968. -(p - 984)(p + 2) Find n, given that -n2/2 - 24n - 288 = 0. -24 Factor 729b4 - 4617b*3 + 1485b*2 - 163b + 6. (b - 6)(9b - 1)*3 Find b such that 3b*5/8 - 41b*4/4 + 133b*3/2 + 49b*2 = 0. -2/3, 0, 14 Factor 2x*2/3 + 2x - 36. 2(x - 6)(x + 9)/3 Solve 2x4 - 18x*3 - 68x*2 - 48x = 0 for x. -2, -1, 0, 12 Factor -4h2/9 - 5528h/9 - 1909924/9. -4(h + 691)2/9 Factor 2b*2/17 + 18b/17 + 36/17. 2(b + 3)(b + 6)/17 What is j in 2j5/15 + 8j*4/5 + 92j*3/15 + 8j*2 + 10j/3 = 0? -5, -1, 0 Determine s so that 4s4/5 - 842s*3/5 - 422s2/5 = 0. -1/2, 0, 211 Determine h so that -h3/5 + 1647h2/5 - 677328h/5 - 678976/5 = 0. -1, 824 Find a such that 7a3 - 1139a*2 - 2636a - 660 = 0. -2, -2/7, 165 Solve -8b5/7 + 272b*4/7 - 2306b*3/7 - 202b*2/7 + 238b + 578/7 = 0. -1/2, 1, 17 Factor -2b2 - 24b - 72. -2(b + 6)2 Factor -8t*2/5 - 38t + 48/5. -2(t + 24)(4t - 1)/5 Factor t5/2 - 4t*4/5 - 2t3/5. t3(t - 2)(5t + 2)/10 Find x such that -5x*4 - 2925x*3 - 429240x*2 - 426320x = 0. -292, -1, 0 Factor 5p3 - 15p*2 - 5p + 15. 5(p - 3)(p - 1)(p + 1) Factor -3z*5 - 9z*4 + 18z*3 + 30z*2 - 63z + 27. -3(z - 1)3(z + 3)2 Factor -n4/8 + 7n3/8 - n2 - 2n. -n(n - 4)2(n + 1)/8 Solve 4h5 + 16h*4 + 8h*3 - 16h*2 - 12h = 0. -3, -1, 0, 1 Suppose -d*4 - 15d*3 - 27d*2 - 13d = 0. What is d? -13, -1, 0 Suppose -4c4 - 140c*3 - 452c*2 + 1340c - 744 = 0. Calculate c. -31, -6, 1 Factor -4o2 + 5364o - 5360. -4(o - 1340)(o - 1) Factor 2y2 - 38y + 140. 2(y - 14)(y - 5) Suppose w*3/9 - 1519w*2/9 - 3041w/9 - 169 = 0. What is w? -1, 1521 Solve 4r5 + 48r*4 - 116r*3 - 48r*2 + 112r = 0. -14, -1, 0, 1, 2 Factor -10f5 - 534f*4 - 212f*3. -2f*3(f + 53)(5f + 2) Factor 2v4/9 + 2v*3 - 2v*2/3 - 50v/9 + 4. 2(v - 1)2(v + 2)(v + 9)/9 Let -g5/2 + 14g*4 - 91g*3/2 - 60g2 = 0. What is g? -1, 0, 5, 24 Suppose -o2/2 + 210o + 1278 = 0. Calculate o. -6, 426 Let -l3/2 + 11l*2 + 197l/2 + 87 = 0. Calculate l. -6, -1, 29 Solve 28p4/5 - 316p*3/5 + 1068p*2/5 - 196p + 40 = 0 for p. 2/7, 1, 5 Determine p, given that -16p5 - 36p*4 + 248p*3 + 96p*2 - 232p - 60 = 0. -5, -1, -1/4, 1, 3 Factor 3z3 - 72z*2 - 75z. 3z(z - 25)(z + 1) Factor -3t*3 - 33t*2 - 84t. -3t(t + 4)(t + 7) What is k in k2/6 - 8k/3 - 161/6 = 0? -7, 23 Find y such that 16y4/9 + 4y*3 - 122y*2/9 - 4y + 16/9 = 0. -4, -1/2, 1/4, 2 Factor 29w2 + 176	{ "pile_set_name": "DM Mathematics" }
5i = -2i + 25, mz - 14 = 2i for z. 2 Let h = -7328 - -7333. Solve -hq = -b - 34, -6q - 23 = -10q + 5b for q. 7 Let z = -162 + 165. Let u = 13 + -9. Let y = u + -1. Solve -2g - 3q - z - 1 = 0, -yg + 2q + 20 = 0 for g. 4 Suppose 124 = 4s + 4a, 0a + 145 = 5s + 3a. Suppose 512 - s = -6t. Let f = t - -86. Solve p = 2r - 5, -1 = -r + fp - 3 for r. 3 Let r(p) = -p*3 - 20p*2 + 46p + 48. Let w be r(-22). Let j be 1 - w - (-102)/17. Solve 3u + 15 = 0, -3u + 2 = jn - u for n. 4 Suppose 0 = 103s - 108s + 25. Suppose so = -139 + 164. Solve 4 = y - q + 7, oq + 5 = 0 for y. -4 Suppose 3b - 111 = -72. Suppose -4f - 5s = -b, s + 3 = 3f - 2s. Solve 0 = -2u + 4i + 24, u = -0u - fi - 8 for u. 2 Let l(m) = -29m2 + 354m - 63. Let d be l(12). Solve 3x - 3 = -127c + 124c, c - d = x for x. -4 Let m be -20(0 + (-8)/10). Let j(h) = h*2 + 38h - 213. Let u be j(-36). Let i be u/114(-3)/(30/16). Solve it + m = 0, -5c + 2t - 36 = 6t for c. -4 Suppose 5k = -1 - 64. Let q be (-4)/(-18) - 6/27 - k. Suppose qx - 7x = 12. Solve -xh = 2a, 0a - 4h = 5a for a. 0 Let j = 11 + -6. Let b(n) = -5n*2 - 2n + 1. Let r be b(1). Let k be 0 - (0 + 4) - r. Solve -u - ka + 1 = 0, 3u - 9 = ja + 16 for u. 5 Suppose -700f = -693f - 28. Solve 3u - x = -21 + 35, -3u - fx + 19 = 0 for u. 5 Suppose 4x + 40 = 4l, 3l + 34 = 6l - 4x. Solve 2p = l, 35m = 33m + 3p - 23 for m. -7 Let r be (55/(-10))/(-11)(-2 + 2). Suppose -2w + 12 = b - rw, -3w + 81 = 5b. Suppose -3i - 6i + b = 0. Solve y - 6 - 9 = -ih, -2h = -4y + 10 for y. 5 Suppose 4u + 3i - 5 = 3u, 0 = 5u + 5i - 15. Solve -4c = 5f + 26, 10f = -uc + 14f for c. -4 Suppose -76 = -29h + 287 - 102. Solve 0 = -3o - 3v + 27, -6o = -ho - 2v + 22 for o. 4 Let z(p) = 191p - 188. Let n be z(1). Solve 7l + 1 = 6l, -6a + nl = 21 for a. -4 Suppose 5l - 25k - 12 = -22k, -2l + 6 = -k. Solve 2u - lu = 4x - 24, 7 = 2u + x for u. 1 Let v be -3 - (2/6)/(3/(-36)). Let r be (12/8)/v2 - -2. Solve -2h + rh - 2j - 12 = 0, 12 = 3h - 5j for h. 4 Suppose -26q - 34q + 232 = -2q. Solve -3p + 9 = 3j, p + 21 = qj + 14 for j. 2 Let k be (-660)/(-33) - (2/(-1) + 1). Let a be 3/k + 13/7. Solve 0 = -3b, -4c + 5b = ab + 16 for c. -4 Suppose -3 = -w, 14v - 11v - 5w + 3 = 0. Solve -3l = -vm + 13, -3l - 8m - 5 = -4m for l. -3 Let j(v) = -3v2 - 25v - 5. Let l be 4 + -9 + (3 - 6). Let p be j(l). Suppose 3f - 9 = pz, 3z = -z. Solve 3k + 0k - b - 16 = 0, 12 = -fb for k. 4 Let d be (58/9 + -6)/(2/9). Suppose -2z - di - 80 = -5z, 2z - 50 = -2i. Solve -c - 2 = -2b, -5b + 5 = 4c - z for b. 3 Let p(k) be the first derivative of k*2/2 + 41k - 33. Let f be p(-37). Solve 0 = y + fz - 18, 5z - 27 = -2 for y. -2 Let h be 1947/9 - 18/(-27). Let y = h - 212. Solve 1 = x - b, -2x + yb + 15 + 2 = 0 for x. -4 Let l(z) = z*2 - 44z + 200. Let p be l(5). Suppose 14j = -3d + 16j + 5, d = 4j - p. Solve -ds - 2o + 11 = 2, 12 = -4o for s. 5 Let s be (-5358)/9 - 80/(-60). Let b = s - -595. Solve 5l + b = -0x - 4x, l + 6 = 5x for l. -1 Suppose -s - 257 = 5p - 3p, -5s - 4p = 1291. Let w = s - -262. Solve 0o = o + 3i + 5, -wo - 3 = 5i for o. 4 Let d = 9 + -9. Let x(o) = -26o + 110. Let s be x(4). Suppose p - sp - 25 = -5n, -4n - 4p + 20 = 0. Solve 3q - 5l + 14 = d, -nl + 3 - 4 = 2q for q. -3 Suppose 190v - 604 = 346. Solve 8m + 3 = 9m + 2l, -vl + 3 = m for m. 3 Let q be 56-1 + (-52)/13. Let j be (40/q)/(1/42). Let b be (j/(-21))/(2/6). Solve ba - 10 = -4d - d, a - 5d - 15 = 0 for a. 5 Let c = 112 - 46. Let i be 311/(c/36). Solve 4d - 4o - i = 2d, 3 = 5d + 4o for d. 3 Let q = -93 + 104. Suppose 5x + ql = 8l + 10, -4x - 3l = -5. Solve -1 + 4 = 5m + 4v, xm + v = -3 for m. -1 Suppose -7a - 2k - 20 = -8a, 0 = -a + 3k + 26. Solve 0 = -5b - 5f + 10, af - 13f = 4b - 10 for b. 0 Let m(n) = 2n2 + 106n - 102. Let g be m(-54). Solve 5x - 554y = -550y - g, 0 = -3x - 3y - 9 for x. -2 Let u be 10/30 - 15/(-9). Let w be (-1943)/(-377) + u/(-13) + 0. Solve -wa + 3l = -40 + 14, 0 = -3a + 4l + 20 for a. 4 Let f be ((-9)/(-12))/(3/88). Suppose f = 3b - 83. Solve 3k - 8 = 2p + 14, -3p - b = -5k for p. -5 Let t = 2537 - 2527. Solve -5p - 13 = -0p - k, -p = 4k - t for p. -2 Let m be (0/(-3 - 0))/(-1). Solve 10r - 6r = -8, -2b + 2r - 2 = m for b. -3 Let z be 2 + (2 - 13) - -23. Let n be (-20)/90 - z/(-63). Solve 2q + 23 = -0q + 5i, n = -5q - 2i - 14 for q. -4 Let d = 191 - 183. Suppose -12t + 8t = 4b + 12, t + 2b = -d. Solve 4y = -3l + tl + 7, 2l = 4y - 10 for y. 2 Suppose -298 = -12o - 250. Solve 5j = 4j + 3f - 8, -19 = -oj - 5f for j. 1 Suppose 13h = 24h - 55. Solve -k + r = -4, hr - 94 = -4k - 114 for k. 0 Suppose 53u - 735 = 2710. Suppose -25h = -540 + u. Solve g = 5a - 6, -4a + 9 = 5g - h for a. 2 Let a(u) = 5u + 16 - 16 + 19. Let o be a(-5). Let s be 150/18 + 2/o. Solve 0l - 5f = 4l + 13, f + s = l for l. 3 Suppose -12g - 5t = -10g - 247, -t = 3g - 338. Let f be (-2)/12 + g/18. Solve -f = -2z - y - 0y, 0 = -5y for z. 3 Let c = -787 + 789. Solve 17n - 7 = -ch + 20n, 0 = 4h + 4n - 4 for h. 2 Let n be (1/(-3))/((-14)/480522-17). Let l = -663 - n. Suppose 0 = 2f - 10, -3d + 11 = -f - 2. Solve -5w = b + d + l, -3b = 2w + 9 for w. -3 Suppose -33m + 36m - 450 = 0. Suppose 2q - 156 = -m. Solve 0 = 3x - qv + 3, -x - 3v + 1 = 2 for x. -1 Let g(x) = -3x3 + 4x*2 - 3x - 6. Let b be g(2). Let i be 4(-4 + (-125)/b). Solve -4l - 3c = i, c = -5l + 2c + 3 for l. 0 Let t = -7610 - -7680. Solve 73k + 2o = tk - 1, 3k + o = 4 for k. 3 Let c(j) = -j3 - 23j*2 + 175j + 46. Let i be c(-29). Solve -5s - 42 + i = 0, -3p + 2s = 5 for p. -5 Suppose d + 3d = 2b + 32, 0 = 3d + 6. Let q(g) = g + 7. Let v be q(b). Let i = v + 20. Solve 5n - i = -2, -2k + 4n = 4 for k. 0 Let v be (-2)/(-4)((-8)/(-4) - -204). Let s = v + -103. Solve s + 8 = -4c + 4b, 0 = -3c - 4b - 27 for c. -5 Let x(b) = 26b - 163. Let m be x(6). Let q(f) = 2f*2 + 26f + 111. Let z be q(m). Solve -a - 3j - 8 + 4 = 0, 0 = 3a - 4j - z for a. 5 Let i be ((-3 - -4) + 5 - 8)6/(-4). Solve 3k - 12 = -iw, 3w - 3k + 7 = -11 for w. -1 Let i(j) = -j3 - j2 + 40j - 14. Let s be i(-7). Solve 0 = 3v + 3p - 3, -17v + 13v + 5p - 23 = s for v. -2 Suppose 5l - 91 = -6. Suppose 2f + 30 = lf. Solve 2n = -ft + 4, -4t + 7t + 2n - 8 = 0 for t. 4 Let c be 344/(-6) + (-8)/12. Let k be (-56)/(-420) - c/15. Suppose 14 = kg - 14. Solve -y + g = 2r, -3y - r = -0y - 16 for y. 5 Suppose -8m = -16m + 32. Suppose -3j - 5 = mv, j + 4 = -2v - 1. Solve -4g = -2g - 8, 0 = -2r + jg - 30 for r. -5 Let n be 16/1019/(-152)-20. Solve nk = 3w + 29, -5k = -5w - 50 + 10 for k. 5 Let h be (14/(-6))/(4/(-108)21). Solve -2b + 13 = -0w - 5w, -3b + h = -2w for b. -1 Let s = -4022 + 4053. Solve 0 = 4f - 16, -36x + sx + 29 = f for x. 5 Suppose 46s + 149s - 585 = 0. Solve sx + 5 = -3b + 5x, 0 = -b + 3x + 3 for b. -3 Suppose -4z = 2q - 6q + 12, 5 = 5q. Suppose 4g + 38 = -58. Let m be ((-16)/g)/(z/(-12)). Solve -mt - 35 = 3s, -s + 8 = 3t + 28 for t. -5 Let t(g) = g - 1. Let h be t(4). Let a be -21((-10)/7)/(6/(-14)). Let m = -70 - a. Solve m = -b - 3f - 12, hf = -b - 3b - 12 for b. 0 Let n = -150 + 346. Let m be 15/(105/n) + 10/2. Solve -4u + 12 - m = -q, 5q = -2u + 17 for u. -4 Let l(a) = a3 + 8a*2 - 2a - 85. Let j be l(-5). Solve 5u = -4w - 23, j = 4w - 88 + 96 for u. -3 Suppose -338113j + 338221j - 324 = 0. Let t(g) = g - 3. Let s be t(5). Suppose 0 = 3w + sw - 15. Solve -4n + 27 = wx, -n - 4n = jx - 30 for n. 3 Suppose 0 = -3t - 494n + 496n + 11, -4t + 3n = -14. Solve -2l = 21 - 17, 0 = -tm + 3l + 26 for m. 4 Let f(w) = -212w - 2754. Let s be f(-13). Solve 3y - 12 = -5d + s, -4d = -y - 1 for d. 1 Let r be ((-8)/(-6) - 1)-3. Let q be r/(((-3)/(-18))/(-1)). Let w = 4415 + -4412. Solve 2y = -5m - 1, -m = qy - wy + 8 for y. -3 Let z(q) = 701q - 9108. Let r be z(13). Solve -rc = -2y + 10, -2y - 60c = -58c + 18 for y. -5 Suppose -v + n = -5v + 17, v + 3n = 18. Let y = -550 - -565. Solve 3*z - 6 = -y,	{ "pile_set_name": "DM Mathematics" }
= -0t, j = -2t + 3 for j. 1 Suppose 5w - 4j = 3w - 4, -5w + j = -8. Solve 2v + 13 = 3c, wv - 7c + 2c = -23 for v. 1 Let g = -5 - -9. Suppose 0 = 3t + o + go, 2o = 0. Let u be t + -1(-2 - -1). Solve -5b + k + 1 = -0b, 3b = k - u for b. 1 Let b = -3 - 11. Let w = b - -19. Solve wv - 3y - 5 = 12, 5v - 16 = 4y for v. 4 Let d = 122 + -209. Let i = 87 + d. Solve 4b - 4j - 20 = i, 0 = b + 3j + j for b. 4 Suppose -17 = -5c + 2k, 0 = -2c + c - 3k. Let z be -1 + 2 - (-31 + 0). Let r = 45 - z. Solve -4q = -u - r, 0u - 13 = q + cu for q. 2 Let w be -13 + 22 + (1 + 0)1. Solve -2g - 4h + w = 0, -5g + 5h + 28 - 3 = 0 for g. 5 Let p be -3 + 3 + 5 + -2. Suppose -pr - 5 = -8r. Suppose 0 = 4u - 17 + r. Solve -5q - 11 = -us, -3s + 6 = -2q - q for s. -1 Suppose 0f - d = 2f + 50, -4f = -5d + 128. Let y = f - -31. Solve 35 = ys - 3m, -6m - 20 = -2m for s. 5 Suppose 3z = -4w + 443, 5w - 2z + z = 549. Let o be w/4 - 2 - 10/(-20). Solve 5l = -10, 2l = -4v - 3l - o for v. -4 Suppose -3 + 11 = 2x. Suppose xg = -g - 2d + 5, 0 = 4d. Solve -z = -f + g, z + 2 = 5f + 9 for f. -2 Suppose 3t = 2t + 4. Let x = -3 - -8. Suppose 3 + 5 = -2l + tm, 3m = xl + 6. Solve 6 = 2b - lg - 2g, -g = 3b - 5 for b. 2 Suppose 5i + 20 = 15i. Solve -3w = 6, 4a + 0w + 16 = iw for a. -5 Suppose 2i + 3 = 3m, -3m = -5i - m + 9. Solve 20 = -4r, -c + 3r = -i - 8 for c. -4 Suppose -6r = -74 - 22. Suppose 13u = ru - 36. Suppose 3g - 3 = u. Solve -gx + 15 = -3d, -x - d + 25 = -6d for x. 0 Let q(m) = m*3 - 13m*2 + 11m + 24. Let y be q(12). Solve -4o = y, 24 - 12 = -3f - 3o for f. -1 Let n be ((-18)/12)/((-2)/(-12)). Let p = n + 0. Let x be (30/2)/(p + 10). Solve -3g + x = -4k, 0 = k + 3 for g. 1 Let i(b) = b3 + 4b*2 + 4b. Let g be i(-3). Let w(k) = k*3 + 4k*2 + 4k + 7. Let h be w(g). Solve -hp = -5c + 14 - 2, 16 = 4c for p. 2 Suppose 2x = -5k + 47, 4x + x = -2k + 23. Solve k = p - 4a, 2a = -5p - 0a - 21 for p. -3 Let h(g) = g3 - 2g2 - g + 5. Let c(i) = -i3 + i*2 + 3. Let l be c(0). Let w be h(l). Let z = -8 + w. Solve -u + 0u - zj + 2 = 0, 0 = -4u - 4j for u. -1 Let z = 10 - 5. Let p(g) be the first derivative of -g2/2 + 8g - 7. Let s be p(-13). Solve 2v + zq + 1 = s, 0 = q - 4 for v. 0 Suppose 5z - 15 = p, -14 = -5z + 3p + 11. Suppose 3s = -2b + z + 10, 0 = 5s - 10. Solve bv + 4j = -25, -v - 2j - 7 = -j for v. -3 Suppose -o - 8 = -5o. Let q = 9 - 4. Suppose 5r = 23 + 167. Solve oj + qx + 9 = r, -3x = -2j - 11 for j. 2 Suppose 2b + 5l - 7 = -15, -5b + 42 = -3l. Solve b = 3p, x - p + 11 = 3p for x. -3 Let f = 8 + -6. Suppose -3c - fc = -10. Suppose 5w + s - 75 = 0, -cs - 6 - 4 = 0. Solve 4i = -5u + 2i - 6, 4u - 4i = -w for u. -2 Suppose -d + 2 = -3. Let b be (28 - 1) + 2 + -5. Let t = 32 - b. Solve dw - 3 = w - 5m, -t = -3w + 2m for w. 2 Let d be 4/(-1 - -3) - -3. Suppose -d + 1 = -w. Suppose 9 = -k - 4i - 5, k - wi - 18 = 0. Solve -3u + 8u - ks = -21, -13 = 3u - s for u. -5 Suppose -3k = 0, -5f + 3k - 55 + 175 = 0. Suppose 27d - 9 = fd. Solve -4u + 4 = 0, -dj + 0u + 14 = -u for j. 5 Let f be 8/(7/((-28)/(-8))). Suppose 5k + 5u = -0u + 10, k - u - f = 0. Solve 3q + 3x + 6 = 0, -kx - 4 = q - 0x for q. -1 Let y = -16903 + 16908. Let l = 304 + -202. Let g be (0 - -1)/(2/l). Solve 3d - 20 = -4h - g, -2d + 10 = -yh for h. -4 Suppose 0 = 2j - 10, 4d + j + 0 = 5. Let s(o) = -2o - 7. Let w be s(-6). Suppose 3m + 5n - 35 = -m, 0 = wn + 5. Solve 2y + m + d = 0, 9 = -q - y for q. -4 Let c(x) = -6x + 5. Let u be c(-2). Let k(f) = f2 - 16f - 17. Let d be k(17). Solve d = b, -3h - b - u = -2 for h. -5 Let o = 1 - -4. Solve 5i - of + 4f - 18 = 0, 4f = 3i - 21 for i. 3 Suppose 0 = -3b, -k + 4b = 4 - 12. Solve -k = -u + 3n, -4n + 6n = -2u - 8 for u. -1 Let l(d) = 2d2 - 37d + 18. Let t be l(18). Solve 5x + 1 - 6 = 4s, t = x + 3s + 18 for x. -3 Let n = 132 - 128. Solve -3 = 3f, 2x + 5f + 5 = nf for x. -2 Let u be 1 + 19 - (-3 - -8). Solve u = -5n, 0 = -l - 5n - 20 + 2 for l. -3 Let k = 768 + -766. Solve -23 = 5b + 2h, -b - 2b - 13 = kh for b. -5 Let j = 124 + -120. Suppose 0 = -ja + 3a - 5a. Solve -5t = -4w - 33, a = 4t - 3t - 5 for w. -2 Suppose 10c = -9c + 475. Solve i - c = 5n, 0 = 4n + 18 - 2 for i. 5 Suppose 4r + 12 = 9r + 4x, 0 = -r - 5x - 6. Solve ri + n + 14 = 0, 6 = i + 3n + 4 for i. -4 Let m = -8 - 4. Let d(i) = -i - 12. Let o be d(m). Suppose 3b - 6 = -o. Solve 5h = -bt - 20, 5h - 5 + 35 = -4t for h. -2 Let p(r) = r2 + 91r - 379. Let b be p(-95). Suppose 4i = 2c + 2i - 12, -5i = c + 12. Solve -3o = -cl + 5l - b, -1 = l for o. 1 Suppose -2z = -f - 29, 5z - 4f - 71 = -2f. Suppose z = q - 2d, -11 = q - 4q - d. Solve 6 = -qt - k, 4k - 19 - 5 = 4t for t. -2 Let b = -34 - -42. Solve 3u + b = 4u + z, 5u - 3z = 8 for u. 4 Suppose 3d - 15 = 0, -h - 3h + 27 = -d. Suppose 4j = 5j - 4. Suppose -5w = -10, jy + 3 = -4w + 19. Solve -4v + 0 + h = 4g, -yv = 3g - 3 for g. -1 Let v = 560 - 555. Solve 25 = -w - vz, 18 + 8 = -2w - 4z for w. -5 Let d(r) = r - 22. Let n be d(10). Let f = 17 + n. Let z be f + (-9)/((-36)/(-8)). Solve zu = -9, p - 4u = -0p + 8 for p. -4 Suppose -308 = -5q + q + 4c, 5c = 3q - 239. Let o = q - 73. Let d = 1 - -3. Solve df + 3a - 1 = 0, oa - 2 = f + 3a for f. 1 Let y be (-1 - (-6)/(-3))-1. Suppose t + t - yt = 0. Solve 3d - 14 = -l, td - 5l + 26 = 4d for d. 4 Let a(u) = 121u*3 + 4u*2 + u - 1. Let x be a(-1). Let g = x + 122. Solve -q + 0q + 5c + 4 = 0, 4q - gc = -1 for q. -1 Let l be (-6 - -1)10/(-25). Let x(h) = h*2 - h. Let b be x(0). Solve -2n = -bj - 4j + 18, 2j = ln + 14 for n. -5 Let k(s) = -s*3 + 10s*2 - 17s + 8. Let z be k(8). Solve -3m + 7r + 35 = 2r, m - 5r - 25 = z for m. 5 Let g be 1 - 3 - -4 - -3. Let f be (-204)/(-60) - (-3)/g. Solve 3h = -5u + 4, -2h = -4h - 2u + f for h. 3 Let z(y) = -4y*2 - 92y + 1. Let i be z(-23). Solve 0 = -3c, -2l - 3c + i = -5 for l. 3 Let y = -21 + 34. Solve -x - x = 2q - 16, -4x - y = -5q for q. 5 Suppose -44x = -67 - 65. Solve -5 = -4b + 5b - 4k, 5 = -2b + xk for b. -1 Let t = 185 - 180. Solve 12 = 4z - 4y + ty, 12 = -2z - 5y for z. 4 Let s = -1274 + 1279. Solve -4o + 0o + 13 = -5v, 0 = -v - s for o. -3 Let h be 1 + 3(-1 - (-48)/18). Solve -4l + hl + 4v = -16, 5l - 3v + 1 = 0 for l. -2 Suppose -3o + 0 = -12. Let i be (-24)/((-8)/(-4)) - o. Let q be 12/i - 3/(-4). Solve -j = -2, 2j - 24 = 5y - qj for y. -4 Let i be 22/33 + 13/3. Let c(a) = a*2 - 4a + 5. Let z be c(i). Suppose 8t - zt = -38. Solve 3h + 21 = -3p, -p - 5h + 4 = t for p. -5 Let g(x) = x2 + 4x - 2. Let y be g(3). Let z be y/3 + 8/(-36)6. Solve b = -4a - 8, -8 - 2 = 5a - zb for a. -2 Let j be (2/7)/((-3)/(-21)). Suppose 3c - 7c + 4z = -4, -jz - 11 = -5c. Let x be (9/(c + -6))/(-1). Solve 5y - 5 = -i - i, -4i = -xy + 3 for i. 0 Let g(l) be the first derivative of 2l3/3 + 5l*2 + 8l - 16. Let t be g(-6). Let o be 3(1 + -1 - -1). Solve -16 = 3c + 7i - 3i, -5i - t = -oc for c. 0 Suppose 3v - 28 = 5c, 19 = v + 5c + 3. Let s(l) = 6l + 163. Let y be s(-26). Solve 4o - h - 21 = 0, -4o = 2h - y - v for o. 5 Suppose -3t + t = -5f - 31, -3t = 3f + 6. Solve -3l + 22 = tv + 4, l + 4v - 12 = 0 for l. 4 Let k(g) = -9g - 9g - 17 + 20g. Let z be k(10). Solve 0 = 4s + zq - 28, -2s - 4 = 2s - 5q for s. 4 Let z(h) = h*2 + 7h + 2. Let q be z(-3). Let r(m) = m*2 + 10m + 2. Let c be r(q). Solve 5p - 5 = 5a - 0, -2p + 4a = -c for p. 1 Let a(f) = 13f + 106. Let t be a(-8). Solve 4w - ti + 6 = -0w, -w - 4i - 15 = 0 for w. -3 Let r be 451/205 - (-2)/(-10). Solve -z - rn = -0z - 8, -4z + 20 = 5n for z. 0 Suppose -22h + 15h = 476. Let m = -66 - h. Solve -3x - 3 = b + m, 3b + 15 = -x for b. -5 Let j(h) be the second derivative of -h4/12 - h3/6 + 15h*2/2 - 15h - 1. Let d be j(-4). Solve -dx + 5g = 35 + 2, g + 7 = -3x for x. -4 Let k = 4 - -33. Suppose -107 - k = -8m. Solve -4l - m = -4x + 2, -4x - 3l = -20 for x. 5 Let u(o) = o*3 - 5o*2 - 3o - 14. Let m be u(6). Suppose 0	{ "pile_set_name": "DM Mathematics" }
424/63 - -721. Let v = m - 59/252. Which is bigger: q or v? q Let j = -0.09 + -29.91. Is 2/47 bigger than j? True Let b(v) = 7v3 - 1. Let d be b(1). Let s be d4/8 - -2. Suppose 0 = 5y - 3c + 9, -sy + y - 6 = -2c. Is y greater than -2/11? True Let q be (-6)/(-10) + 19962/105. Let v = q + -191. Let y be (-1 - (-1 + 1))0. Which is bigger: y or v? y Suppose -d = -4n + d + 24, 3n + 2d = 18. Suppose j - 4u = 0, 3u = 3j - nj. Do j and -5/4 have the same value? False Suppose 2t - 16 = 3x + 15, 4t - x = 67. Suppose g + t = 22. Let z be (-12)/g(-5)/20. Is 1 smaller than z? False Let s = -120 + 634. Is s greater than 514? False Let n be (30/(-9) - -5)8/(-4). Is n at most -1? True Let q(l) = -l3 - 8l*2 - 9l + 6. Let w be q(-7). Which is greater: 24 or w? 24 Let g(t) = -24t + 101. Let c be g(4). Do 11/3 and c have the same value? False Let u = 5 - 3. Let t = u - 9. Let z(s) = s3 + 8s*2 + 8s + 2. Let d be z(t). Is d < -1? True Let z = 98 - 44. Let a be 1 - (-1 + z/28). Suppose 23 = 33o - 10. Which is smaller: o or a? a Let q = -55/28 + 9/4. Let r = 232 + -362. Let d = r + 129.9. Which is smaller: d or q? d Let j = -464 - -463. Let l = 2.6 - 0.6. Let q = l - 1.8. Which is greater: q or j? q Let z(u) = 2u + 4. Let n(t) = -2t2 - 6t + 7. Let f be n(-4). Let d be z(f). Do d and 1 have different values? True Let n = -486 - -502.91. Let q = n - 17. Is q >= -1/4? True Let d be (-6)/(-27) + (-1 - 7/(-9)). Which is greater: d or 1/186? 1/186 Let q be 346 - (-8 - (6 - 14)). Is 345 equal to q? False Let k be -12((-64)/(-24) + -4). Suppose 2o - 70 = -3o. Which is smaller: k or o? o Let a(r) = 27r - 291. Let h be a(9). Are -1 and h unequal? True Let k be (-2)/((4 - 2)/(-36)). Let y = k + -24. Is y smaller than 13? True Let s = -302 + 301. Suppose -10 = 8v - 3v. Let l be (-10)/(-18) - v/(-9). Is s < l? True Let n be 43 - 1/(1/5). Which is smaller: 37 or n? 37 Let x = 15 + -10. Suppose -o = xo - 54. Do o and 10 have the same value? False Let w = 374097 + -8592802/23. Let a = w - 497. Does -2 = a? False Let v be (-20)/(-15) + 4/6. Suppose -m + 66 = vm. Let b = 156 - 135. Which is greater: m or b? m Let x be -34/1220. Let n be (-12)/x + (-76)/10. Is n bigger than -5? False Let r = -1683.981 - -1683. Let y = r + -0.019. Is 47 greater than or equal to y? True Let x = 0.51 - 0.11. Let q = 0.4 - x. Let l = 0.016 + 13.984. Which is bigger: l or q? l Let v be (46/(-144))/(81/(-108)). Let m = -2/27 - v. Let s = -5.8 - -6. Are s and m equal? False Let l be (-1)/2 + (-9)/6. Let y = 151 + 369. Let s be (-3)/4y/273. Which is smaller: l or s? l Let t be 1085/(-1075) + 4 - (3 + 0). Let k = t - -436/645. Is k < 1.4? True Let x = -0.04 - -4.44. Let k = x - 16.4. Is k >= -1/2? False Let o = 90 - 89. Suppose -4z + 29 = -5i, z + o = 3i + 17. Which is smaller: z or -3/10? -3/10 Let q = -3/40 - 13/40. Which is smaller: q or 1/53? q Suppose 0 = 3r + 3r - 12. Let k(y) = ry - 11 + 2y - y - 4y. Let j be k(-9). Which is smaller: -5 or j? -5 Let a be 6/(-180)5 + (-13)/(-86). Which is bigger: 1/2 or a? 1/2 Let s = -1.129 - -166.129. Which is bigger: s or 4? s Suppose -1112 + 972 = 5n. Which is bigger: -27 or n? -27 Let w = -3/623 - -252339/4984. Is w greater than or equal to 52? False Let l = 1331 + -1332. Is l bigger than 3/361? False Let l = 27.4 + -43.5. Let r = l + 14. Let c = -0.1 - r. Which is smaller: c or 0? 0 Suppose -243 = 3w + 69. Let a be w/(-51) + (4 - 6)1. Which is bigger: a or 1? 1 Let w = 674 + -661. Is 3 at most as big as w? True Let j = 16.87 - 17. Suppose 28 = 5m - f, -2m + 6f - 9f = -18. Which is smaller: m or j? j Suppose 235j - 9373 = 248j. Is j greater than or equal to -721? True Let u be (-47)/(-188) + 6818/24. Is u greater than or equal to 285? False Let q = -2897 + 2897. Are 4.9 and q unequal? True Let m be ((-367)/(-15) - 0)3. Let l be (-3620)/50 - 3/5. Let i = l + m. Which is smaller: 14/9 or i? i Let t = 3 - 10. Let h(f) = 4f + 29. Let r be h(t). Is r equal to -2/133? False Let h = -1 - -0.68. Let v = -0.3 - h. Let j = v - -0.08. Is 3 at most as big as j? False Suppose -2m + 9 = -11m. Which is smaller: m or 69/7? m Let u be (-6)/69 + (-5)/207. Is u > -4/3? True Let l(k) = -k3 + 35k*2 - 65k + 4. Let o be l(33). Which is bigger: o or 32? o Let l be 66/(-16) - (4 + 33/(-8)). Suppose f + 4f - 10 = 0. Suppose 4q = 2u - 2, 3u = -5q + fq + 12. Is q less than l? False Let z = -331 - -206. Is z less than or equal to -124? True Suppose -2x = -8 + 6. Let h be 22x/10 + -2. Which is bigger: h or 2/3? 2/3 Let t be 6/(-28)(-3 + (-2)/(-6)). Which is smaller: t or -0.04? -0.04 Let j = -1233/85 + 250/17. Is j greater than -0.399? True Let a(w) = -w3 + 24w*2 + 20w - 6. Let n be a(25). Is n greater than -134? True Let d(w) = -w*3 + 25w*2 - 25w + 5. Let j(u) = 16u + 8. Let h be j(1). Let r be d(h). Which is smaller: -37/2 or r? r Let c = -356 + 421. Which is smaller: 2/3 or c? 2/3 Let n(o) = o3 + 4o*2 + o + 4. Suppose 2 = -2v + 3y, -15 = 3v + y - 1. Let k be n(v). Which is smaller: 2/17 or k? k Let p = -2 + 1.7. Let z = -76 + 156. Let b = -75 + z. Which is smaller: p or b? p Let p(j) be the third derivative of j*6/120 - 13j*5/60 + 13j*4/24 - 11j*3/6 - 10j*2. Let i be p(12). Which is smaller: i or -1? -1 Let d = -11 - -13. Suppose -14 = -dy + 12. Let c be 4/(-12) - (-129)/9. Is c greater than y? True Suppose 12v + 68 = 56. Which is greater: v or 3/283? 3/283 Let n = 6.977 + 0.023. Let t = -26 - n. Is t greater than or equal to 2/11? False Let d = 724 - 724. Let a = -536750/3071 + 2474/83. Let n = -145 - a. Which is smaller: n or d? n Let s = 14233/29 + -491. Which is smaller: -1 or s? -1 Let o(b) = -b2 + 3b + 15. Let m be o(7). Let c = m - 7. Let h be c/695(-3)/(-6). Is h smaller than -1? False Suppose -69y + 64y - 345 = 0. Which is smaller: 2 or y? y Let z = 242 - 334. Is -735/8 != z? True Let d be 7/((-55)/20 + 3). Let y be (4 - d/8)-2. Which is smaller: 1/3 or y? y Let q(k) = k*3 + 10k*2 + 2k + 22. Let t be q(-10). Suppose -tw = 3f + w, f - 4w + 5 = 0. Are -3/28 and f equal? False Let m(j) = -5j + 7. Let a(p) = 11p - 15. Let b(y) = -4a(y) - 9m(y). Let c be b(8). Suppose cs - 5 + 0 = 0. Are s and 8/7 non-equal? True Suppose -b - 9 = 3y + 9, -5b + 4y - 109 = 0. Let j = b + 15. Let i(w) = -w - 13. Let v be i(-6). Which is greater: v or j? j Suppose 0 = -793j + 813j + 140. Suppose -2f + 9 = -5f. Which is smaller: j or f? j Suppose -200 = 4g - h, 5g + 2h + 250 = 3h. Which is smaller: -53 or g? -53 Let x = -0.1 - 0.4. Let k = -0.4 - x. Let h = -28 - -28. Is h less than or equal to k? True Let k be 3 - (1 - 2)10. Let o = 20 + k. Suppose -6w - o = -9w. Is w at most 10? False Suppose 0 = 2j - j - 4f + 75, -2j - 5f - 137 = 0. Are -73 and j equal? False Suppose -3q + 2w - 7w = 33, 0 = -w - 3. Let n be (q/(-4) - 0)4/(-15). Is n at least 10? False Let k = -2018 - -2025. Is -47 <= k? True Let p be 10 - (-2 - (2 - (3 + 0))). Suppose z - 8 = -p. Is -17/11 greater than or equal to z? True Let l be (2/(-5))/((-7)/1085). Let i be 4l/(-273) - -1. Let t = i + 2/39. Is t greater than 1/5? False Suppose -2 = 5j + 3. Let t(g) = -g*3 + 4g*2 + 2. Let z be t(4). Suppose -zs = -6s - 12. Which is greater: j or s? j Let o = -45 + 38. Suppose 30 = -7v + 2v. Is o equal to v? False Let a = -1665 - -1614. Which is bigger: -566/11 or a? a Let q = 18.2 - 2.2. Let j = 0.2 + -0.2. Are j and q equal? False Let l(y) = y3 + 4y*2 - 9y - 8. Let k be l(-6). Suppose -9g - 108 = -5g. Which is smaller: k or g? g Let c = -18 - -52/3. Let r = 0.8427 + -0.7897. Is c greater than or equal to r? False Suppose -10 = -x + 6x. Let a be (-4)/12 - 2/x. Which is smaller: a or 1? a Suppose 3w + 10 = 5z + 29, -z - 9 = -w. Suppose -5 = 2u - w. Suppose 0 = up - 80 + 24. Is p < 13? False Let n be 17 - ((-12)/(-4) - 3). Let p = n - 28. Let u be ((-2)/4)/((-2)/(-44)). Is p greater than or equal to u? True Suppose -4a = 35 - 31, 2u - 162 = 4a. Is u less than 90? True Let v be 3 - (1040/(-36))/(-10). Suppose 3x = 2c - 4 - 11, 2c - 2x - 12 = 0. Which is smaller: c or v? v Suppose 2h - 5v + 22 = 6, 2h + 52 = -4v. Let r be ((-3)/(-549))/((-2)/h). Is -1 > r? False Suppose 0	{ "pile_set_name": "DM Mathematics" }
Let t = -5 + 7. Suppose -ts + 4 = -6. Solve a + 2 = su - z, 2a = -u - 4 for a. -3 Suppose 15 = 2t + 4k - 53, -5k - 97 = -4t. Solve 4w - 16 = d, -3w - w + t = -4d for w. 3 Suppose 0 = -7a + 3a. Solve -3h = b - 7, a = 2h + b + b + 2 for h. 4 Let z = -8 + 10. Solve 4k - q + zq + 5 = 0, 3q = -3k + 3 for k. -2 Suppose 4p - x + 8 = 5p, -4x = 3p - 26. Let l = 16 - p. Suppose -3v = -8v + l. Solve y + 1 = vi, 6i - 3i + 1 = 2y for y. 5 Suppose 3k = -2y + 16, -24 = -4y + 3k - 5k. Solve -5z = 3b + 12, 17 = -yb + 3z - 3 for b. -4 Suppose -7z = 12z - 95. Solve 0 = f + 2o - 1, o - z = f - 3o for f. -1 Let f(u) = -3u + 3. Let b be f(0). Solve -g + 3d = -d, 0 = -5g + bd + 17 for g. 4 Suppose -5t + 20 = -0t. Suppose -tr = r - 10. Solve -2a + 8 = -ro - a, 4o + 3a - 4 = 0 for o. -2 Suppose 41 = 4d - 15. Suppose -2r = 4p + 44, -3p = -6r + 2r + 22. Let g = p + d. Solve u = ga - u, 3a = u for a. 0 Let m be -8(-3)/(-18)3. Let g be 22/5 + m/10. Suppose 2z - z = k - 4, -gz = 3k - 12. Solve 5v = -2f + 9, kv + 0f - 18 = 2f for v. 3 Let x be (-18)/(-12) - (-1)/2. Let u be x + -2 - (-10)/2. Let c = u - 3. Solve 5s + 3j = 21, -3j = s - cs - 3 for s. 3 Suppose -3c = -7c + 40. Let b = -5 + c. Solve -3o - 12 = -2x, 2o - 4x + 6 = bo for o. -2 Suppose 4x - 2n = 3 - 17, -3n = -x - 11. Let l be (-2)/x + 17 + -6. Solve -g + 5i + 4 = -3, 2g + l = -3i for g. -3 Suppose 2c - 2 = y, 4c - 6 = y - 0c. Suppose 2w + 0w = -yh, -w + 2h = 3. Let d be (w + -1)-6 + 1. Solve -g = 3g - 16, q = -3g + d for q. 1 Let f = -8 + 12. Suppose fb - 10 = 10. Solve 0m - 2m = 4r + 22, -r = -3m - b for r. -4 Let t be (0 - 0) + -1 + 0. Let i be 19/4 - t/4. Solve d + 5b - 19 = -0, -id + 4b = 21 for d. -1 Suppose 0 = -10s + 13s - 27. Solve 0 = 3k + 3a - 24, 2a - 29 = -3k - s for k. 4 Let c(r) = -r2 - 6r - 4. Let w be c(-4). Let s = w - -2. Solve x + 3a - sa - 19 = 0, -2x - 17 = 5a for x. 4 Let d be (-2)/(18/21)3. Let h = 7 + d. Solve 3b - 24 = 4w, -3w - w - 2b - 4 = h for w. -3 Suppose 0 = -s - 20 + 25. Solve -2v + 10 = sh, -5h + 4h + 20 = 4v for h. 0 Suppose 2l + w + 4 = 4l, 2w = 0. Suppose 16 = lb + 2b. Solve -2r + 5v + 35 = 0, 2r - bv = 6 + 24 for r. 5 Suppose 3k - h = 4h + 27, 0 = 5k - 2h - 26. Solve -3v - 5q = -6v + 3, 3v - 3 = -kq for v. 1 Let l(q) = -3q - 9. Let m be l(-8). Let g = m - 14. Solve 0 = 4a - o + 8, a + g + 1 = o for a. -2 Let v = -14 - -30. Suppose 5x = 4x + v. Let m be 10/45 - x/(-9). Solve 4i = 4t, 4i = 3t - m - 0 for i. -2 Suppose -56h = -53h - 15. Solve 0 = 3r - 0r + 3p + 3, 2r - 5 = hp for r. 0 Suppose 2l + b = 5b - 44, l = b - 21. Let y be 0 - l/((-1)/(-1)). Solve -3o - 5 = -4r, r + o = -2r + y for r. 5 Let x be 2/((-6)/(-21)) + -4. Solve s + 2o = 5o + 12, 0 = xs + 3o for s. 3 Let j = -30 + 36. Solve -2q = 3l - 6, -l = -2q - jl + 6 for q. 3 Suppose -4w - 10 = -2. Let a be (108/15)/(w/(-10)). Suppose -3j + 24 = -f, -3j - 4f = -3 - a. Solve -2q - 4 = -3t - 0, 5t = q + j for t. 2 Let a(w) = -w3 - 7w*2 + 10w + 18. Let y be a(-8). Solve -5j + v = -2v - 22, -yv = -j + 3 for j. 5 Let h be -2 - (-1)/((-3)/(-12)). Let q(n) = n2 + 0n*2 - 10 - 6n + 0n2. Let j be q(8). Solve 4u = 3t + j - h, 4t - 2u = -12 for t. -4 Let j(p) = p2 - p - 3. Let x be j(3). Solve xl + 2v = 1, 8 = 5l - 2v - v for l. 1 Suppose 5b + 4m + 1540 = 0, 3b - 3m + 924 = 2m. Let r be b/(-20) + 6/(-15). Solve -5j + 5o - r = 0, 0 = j + 5o + 1 + 2 for j. -3 Let z(a) = a + 3. Let w be z(-3). Let l(v) = v2 + 11v - 8. Let d be l(-11). Let g = w - d. Solve 5k - 1 = -0k + f, -g = -4k - f for k. 1 Let k = 1 + 1. Suppose -3f + 5 = -kf. Solve -u = 4i + 23, -4i + 5 = -fi for u. -3 Suppose -3l + 13 = 5a - 16, 2l - 22 = -4a. Suppose -4 = -2u + a. Solve ui = -3v - 5, -i + 3 = 2i for v. -3 Suppose 58 = 5m - 2. Solve -s = 4z - 4s - m, 3s - 3 = -z for z. 3 Let m(s) = -s*3 + 3s*2 - s - 2. Let r be m(2). Suppose 32 = 2u - 2b, r = -4u + 2u - b + 20. Solve -4c + 4i = -6c + 16, -5c + u = -4i for c. 4 Let n = 9 - 7. Suppose x - 5b + n = 10, -5x - 4b + 69 = 0. Let m = x + 1. Solve -2u - 2k = -m, 2u + 2u - 4k = -4 for u. 3 Let y(s) = -s*2 - 12s - 11. Let n be y(-9). Solve -g + 4g + f = -12, -4f - n = 4g for g. -4 Suppose -5c + 3w + 6 + 5 = 0, -4w = -2c - 4. Solve -5m + m - cz = -28, -3m - z = -11 for m. 2 Let c(d) = d*3 - 6d*2 + 5d + 15. Let m be c(4). Solve 4g = mi + 3 - 5, -5i + 5 = -5g for i. 2 Let a(t) = -t*3 + 6t*2 + 5t - 4. Let p be 237/33 + 2/(-11). Let z be a(p). Let q be z/(-8) - 12/(-16). Solve l + l - 4u = 18, -qu = -l + 13 for l. 1 Let a(o) = o*3 - 20o*2 - 21o + 1. Let y be a(21). Suppose 0q - 5q = -80. Suppose 4j - q = -0j. Solve 5k + jg = 1, k + 2g - g = y for k. -3 Suppose 3 = 2b - 15. Let w = 15 - b. Solve 5q = 3j + w, -3q + 0q + 18 = 3j for q. 3 Suppose -3j = -3g - 9, -7j + 4g = -4j - 9. Solve -6v = -ja - v + 1, -3a - v = 11 for a. -3 Let d(n) = -n + 5. Let o be d(6). Let w be ((-2)/(-3))/(3/9). Let y be (o + w)-2-1. Solve -4f = -6f - j + 1, 0 = 2j + y for f. 1 Let i(y) = y*2 - 4y + 3. Let l be i(6). Let q be 6/l + (-54)/(-15). Solve 2z - qa - 18 = 0, 5a = -3z + z for z. 5 Suppose -4y - 3b = -3y + 8, -4b = -5y + 36. Solve 2c - 3j + 18 = -3c, -5j - y = 3c for c. -3 Suppose 0 = -4y + y. Let s = -4 + 5. Let j be s/((3 + -6)/(-21)). Solve -m = -2k + 7 - y, -4k - 5m = -j for k. 3 Let k(x) = x + 5. Let b be k(-5). Suppose -5o - 5n = -10, -6o + n + 13 = -2o. Solve oh - 2q + bq = 15, -5h - 5q = -25 for h. 5 Let x = 8 - 5. Let f(m) = 0 + xm + 5m2 - 2m + 1 + 2m. Let g be f(-2). Solve 3t + 2i = -3i - g, 0 = -4i for t. -5 Let v(h) = h3 + 7h*2 + h + 10. Let x be v(-7). Suppose -3m + 9 - x = 0. Solve -4z - 2 + 3 = -3t, -2t = -3z + m for t. 5 Let l be 2/(-5)15/(-3). Let s(h) = -h2 + 5h - 4. Suppose 2p = -2x - 2, -p = 4p + 20. Let m be s(x). Solve 0k = -k, ld - k - m = 0 for d. 1 Let f(k) = -k3 - 3k*2 + k + 3. Let c be f(-3). Solve t - 3u - 14 = -t, c = t - 2u - 8 for t. 4 Let r(s) = -s3 + 8s*2 - 3s - 28. Let o be r(7). Solve o = -5y + 4m - 19, 0y - 4y - 17 = -5m for y. -3 Suppose -5b = -2f, 0 = 5b - b + 4f. Solve k - 3y + 7 = b, 4k - 2y = 1 - 9 for k. -1 Suppose -2b + 3x = -x - 4, 5b = 4x + 10. Solve 2w + 2n + 4 = 0, bn = 3n - 3 for w. -5 Let n be (-2)/(-2(-3)/(-12)). Solve -12 = l + 2t, -3l + nt + 8 = -t for l. -4 Suppose 35r = 41r - 18. Solve 4w = -4f + 28, rf = -f + 12 for w. 4 Let f be 6/(-10) - 99/(-15). Suppose f = 4u - 6. Solve -j - b = -2, 2j = 6j + ub - 11 for j. 5 Suppose 5u = u - 24. Suppose -5z = -2b - 0b + 1, -4z = 4b - 16. Let l be (11/(-2))/(b/u). Solve m + 3r - 7r + l = 0, -2r = -6 for m. 1 Let m be 0 - -16 - 0/3. Solve 2t - 4i = -m, 2i = -4t + 6t + 8 for t. 0 Let y(t) = -6t + 3. Let o be y(-3). Solve 3d + 4j - 4 + o = 0, -5j - 4 = -2d for d. -3 Suppose 2i + 4c = -4, -5i + c + 17 = -6. Let j be (-6)/(1/(-2)3). Solve u + 14 = -jy + 3u, 0 = -5y - 2u - i for y. -2 Let l(m) = 4m2 + 1 - 5m*2 + 10m + 3m2. Let c be l(-7). Solve -4u - c + 1 = -4s, -3u = s + 13 for u. -5 Suppose -242 = -6j - 80. Solve -3h = -5i + j, 4h = 2h + i - 11 for h. -4 Let t = 83 - 78. Solve -2w - 10 = 5o, o + 25 = -4o - tw for o. 0 Let w be 5/10(3 + -1). Let j(f) = f + 1. Let y be j(w). Solve 2r - 12 = 6r + 2a, -11 = 3r + ya for r. -1 Let k = -43 + 43. Solve k = -5j + j + 4, -4j = -c for c. 4 Let q be (-9)/(-4)(2 + (-14)/21). Solve i = -2o + 5o + 12, 5o = -qi - 6 for o. -3 Suppose -4q - 2 = -18. Let f(y) = -y3 + 7y*2 - 6y - 3. Let m be f(5). Let z = 45 - m. Solve -qj - 21 = -2j - 3b, -j - z = -5b for j. -3 Suppose 78 = -2r - r. Let d = -16 - r. Let v be 36/d5/2. Solve a - 4a - 3p = -15, 0 = -5a - p + v for a. 1 Let q = 1 - -2. Let l(d) = d3 - 7d*2 + 8. Let t be l(7). Solve -2a + t = 4z, 12 = 3a + qz - 0 for a. 4 Suppose -3d + d + 32 = 0. Suppose -4a + 0a + d = 0, 2b - 22 = -3a. Solve -5g - b = -3u, -4g + 3 = -3u - g for u. -5 Let v(i) = 2*i - 15. Let x be v(8). Suppose	{ "pile_set_name": "DM Mathematics" }
5 a Let r be (-3)/(-7)2/3. Let s = -118.1 + 95. Let o = s - -23. What is the closest to o in r, 2, 4? r Let v = 0.2 - 0.1. Which is the nearest to v? (a) -3/7 (b) -1/2 (c) 0.2 c Let v = 144/91 - 28/13. Which is the nearest to 0.1? (a) v (b) 8 (c) 2/9 c Let i be (-1 - 3)/4 + 14/18. Which is the closest to -0.1? (a) -2/23 (b) -5 (c) i a Suppose 4u + 4 = 4d, -2d = 2d - 12. Let c be (u/18 + 0)6. Let q = 1.2 + -1. What is the nearest to c in -1, 0.1, q? q Let v = 9 + -13. Let g be (-2)/(-18)(-6 - v). What is the nearest to 0 in 0, 4/5, g? 0 Let y = -947/8 + 118. Which is the closest to -1/2? (a) y (b) -2/9 (c) 1 a Let i = -1.2 + -0.8. Which is the nearest to i? (a) -1/9 (b) -2 (c) 0 b Let x = -56.2 + 56. Which is the nearest to -1? (a) x (b) 3 (c) -0.4 c Let l(q) = q2 - 7q + 1. Let o be (8/(-10))/((-2)/15). Let g be l(o). Let h = -0.01 + 4.01. What is the closest to -1 in -0.5, h, g? -0.5 Let i be (10/4)/((-5)/10). Let p = -238/3 + 80. Which is the closest to p? (a) 4/3 (b) 2/3 (c) i b Let h be (2/(-12))/((-9)/(-6)). What is the nearest to -0.2 in -1/7, h, -4? -1/7 Let j = -114 + 1940/17. Which is the closest to -3? (a) j (b) -3 (c) -2/9 b Let z = 254/5 + -51. What is the nearest to z in 3, 5, -4? 3 Let j be -1 + (-2932 - (2 - 2)). Let d = j + 143711/49. Let g = d - 8/49. What is the closest to -0.1 in -0.4, g, -3? g Let h be 1(-1)/(3/(-6)). Let m be -1 + 356/(-518) + h. Let f = 1/37 - m. Which is the nearest to f? (a) 3 (b) -2 (c) 0 c Let r(z) = z3 + 9z2 - z - 12. Let l be r(-9). Let x = -0.04 + -0.26. Let w = 49/90 + -2/45. What is the closest to 1 in x, l, w? w Let n = -2.04 + 0.04. Let k = 0.15 - 5.15. Let p be (-1)/(1 - 6/(-4)). What is the closest to p in k, -3/4, n? -3/4 Let y = 13.8 - 2.8. Let x = -10.9 + y. Let d = 7 + -11. Which is the closest to x? (a) 0.2 (b) 3 (c) d a Let f = -3.4 + -1.65. Let m = 0.05 + f. What is the closest to 0.1 in m, -4, 3/5? 3/5 Let u = -0.07 + -0.13. Let o = -0.2 - u. What is the closest to o in 1, 1/2, 0? 0 Let x = -6 - 2. Let m(j) = j3 + 7j2 - 8j + 3. Let n be m(x). Which is the closest to 1? (a) -0.3 (b) n (c) 0.3 c Let g = 0.18 + -0.18. What is the nearest to 1/2 in 0.1, 5, g? 0.1 Let z = -31 + 31.1. Which is the closest to z? (a) -0.1 (b) -2/7 (c) -4 a Let j be 54/10 - 4/10. Let s = 1 + -8. Let i = s + j. Which is the nearest to -2/3? (a) i (b) 2 (c) 0.2 c Let x = 1.33 - 4.33. Let j = -1 + 0.9. Let p = 0 - 0. What is the closest to j in p, x, -1/7? -1/7 Let n(c) = c*2 - 8c + 8. Let d be n(7). What is the closest to 0 in -4/3, d, 4? d Let o = -0.04 - 0.36. Let l = -3.99 - 0.01. Let v = 16.9 - 17. Which is the closest to -2? (a) v (b) o (c) l b Suppose -4k + 3 = -5f, 2 = -3k + 5f + 8. Let i = 0.38 - 1.38. Let z = 3.1 + -3. Which is the nearest to z? (a) 3 (b) i (c) k b Let c be ((-12)/21)/(40/28). What is the nearest to c in -3, -0.5, 1? -0.5 Let p = -0.025 - -4.025. What is the nearest to 1 in p, 4/9, -4? 4/9 Let t be (-9 - -8)(1 - 3/4). Let y = -0.2 + 0.3. Which is the nearest to t? (a) -5 (b) 5 (c) y c Suppose 4c = -c - 4q - 16, 5c = 5q + 20. Let m be ((-90)/21)/(2/28). Let s be ((-6)/m)/(9/(-12)). What is the closest to c in -2/17, s, 0.1? 0.1 Let s = -80 + 81. What is the closest to s in 1, 3/13, 3? 1 Let w = -7 - -11. Let a be ((-6)/(-4) + 1)8. Let v be (a/(-16))/((-3)/w). What is the nearest to 2/5 in 4, v, 4/5? 4/5 Let h = 0.67 - 0.7. What is the nearest to 0 in h, -0.1, 3? h Let p = 0.13 - 0.08. Let w = p + 0.05. What is the nearest to w in 5, 1/8, -2? 1/8 Suppose d + 14 = -2v, 3v + 5d - 18 = 4v. Let t be 44/v + 2 - -3. Which is the nearest to t? (a) -2/3 (b) 2 (c) -3/4 a Suppose 0 = 2f - 7f. Let o = 1 - 1. Suppose 0u + u = 3. Which is the nearest to f? (a) 2/3 (b) u (c) o c Let h = 0.41 + -0.01. Let n = 21 - 21.23. Let y = 0.03 + n. Which is the nearest to 0? (a) h (b) y (c) -5 b Let z = -1 + 1.5. What is the nearest to 0.2 in z, 0.2, 3/2? 0.2 Suppose 2 = x, 0s + 5x - 5 = -s. What is the closest to 0.2 in 0.5, s, 1/3? 1/3 Let t be (-92)/(-5) - (-18)/(-45). Let r be 4/14(-42)/t. Which is the nearest to -1? (a) r (b) -0.4 (c) 4/5 a Let f = 6 - 24. Let k = -17.5 - f. Which is the closest to 1? (a) -5 (b) k (c) -2 b Let u = -13 - -11. Which is the closest to -2? (a) -2/3 (b) u (c) 3 b Let p be -2 - 10/(450/(-81)). Let f be 1 + (-2)/(4/3). Which is the closest to p? (a) -4 (b) 4 (c) f c Let u = -0.09 + -10.91. Let w = u - -15. Let k = -0.2 + 1.2. Which is the closest to 1/4? (a) k (b) w (c) 2 a Let l = -27.75 + 28. Which is the closest to 1? (a) -0.3 (b) l (c) -1 b Let x(k) = k*3 + 8k*2 - 8k + 10. Let v be x(-9). Let f = 224/3 + -73. Which is the closest to v? (a) 2 (b) f (c) 1/2 c Let o = 14.88 - 15. What is the closest to 0.1 in o, -2/15, 0.1? 0.1 Let k = -1.1 - -1.3. Let d = 4.5 - 4.8. Let u = 0.4 - 0.3. Which is the nearest to u? (a) d (b) -0.1 (c) k c Suppose -2t = -7t + 25. Let o be 2/(-12)4(-18)/20. Which is the nearest to -0.3? (a) 0.5 (b) o (c) t a Let s = 0.85 + 6.15. Which is the closest to s? (a) -4 (b) -2 (c) -2/5 c Let u be (-2 + 3 + -1)/1. Let j = 12 - 7. Which is the nearest to u? (a) -0.4 (b) j (c) -2 a Let i = -0.43 - -0.13. Let l = -266 - -1859/7. What is the nearest to 0 in i, l, 3? i Let x = -631/21 - -91/3. Which is the nearest to -1? (a) -1/8 (b) x (c) 0.2 a Let m be ((-2)/1)/4 - 6/(-60). Which is the nearest to m? (a) -0.1 (b) 2/15 (c) 4/9 a Let i = -0.1 - -0.6. Let s = 10/9 - 148/117. What is the nearest to -2/5 in s, -5, i? s Suppose 0 = 4d - 4 - 0. Let y be 18/(-56) - 6/24. What is the nearest to d in 0.1, y, -1/3? 0.1 Let i be (1/(-3))/((-2)/1). Which is the closest to 0.1? (a) i (b) -1/3 (c) -0.5 a Let g = -1 - -2. Let z be (1 + -2)5g. Let p = 3.2 - 3. What is the closest to -1 in 2/5, p, z? p Let f = -97 - -96.7. What is the nearest to -0.06 in f, 1, 3? f Let s = -4 + 3. Suppose 4p = 9 - 1. Suppose -4g - 6w + pw + 16 = 0, 0 = -5g + w + 14. Which is the nearest to s? (a) -1/2 (b) g (c) -2/7 a Let i = 105/4 + -743/28. Let h = 0.04 + -0.14. What is the closest to 2/7 in h, 4, i? h Let z = -14 - -18. Suppose -q + 5p = 3q - 75, 0 = -5p + 5. Suppose -4s + a = 5, s + 4a - q = 4s. What is the closest to 0.1 in s, 4/7, z? s Let n be (-2)/1022 - -4. Which is the nearest to -0.2? (a) 5 (b) 2 (c) n c Let m = 5/78 + -123/26. Let f = 5 + m. Let a be ((-12)/(-10))/((-18)/(-45)) - 0. What is the nearest to a in -0.1, f, 5? 5 Let m = -7 - -6.6. Let l be 12/54 - 34/72. Which is the nearest to l? (a) m (b) 0.1 (c) -0.2 c Let r = -4.17 + 0.17. Let n = -3 - -6. Let j = 2 + -2.2. What is the nearest to -2 in r, j, n? j Let b = -0.2 - -0.4. Let m = -11 - -8. Let c = 2/63 - -19/63. What is the nearest to c in b, m, 4? b Let w = 25 - 25.3. What is the closest to w in -0.4, 4, 3? -0.4 Let r be (-8)/(-3)(-45)/(-20). Suppose v + r = 3. Which is the nearest to 0.1? (a) 3 (b) 1 (c) v b Let d be -3 - -1 - 42/(-20). Let r = 0.32 + -0.12. Let p = 0.7 + 0.3. What is the closest to p in r, d, 0? r Let k = 61 - 425/7. Let s = 0.03 - 0.13. Which is the nearest to k? (a) s (b) 0 (c) 1 b Let h = 5 - -5. Let r = -6 + h. Which is the closest to -2/5? (a) 0.4 (b) r (c) 0.3 c Let i(f) = f - 3. Let t be i(4). What is the closest to t in -0.2, 2, 4? 2 Let q = 175/4 + -44. Which is the closest to q? (a) -0.1 (b) 5 (c) 13 a Let g = 5 - 2. Which is the nearest to 1/4? (a) -0.3 (b) -4 (c) g a Let z = 1 + 11. Let w = 7 - z. Which is the closest to -1/4? (a) w (b) 4 (c) 1 c Let g(k) = k + 9. Let q be g(-9). Suppose -15 = -qw - 3w. Which is the nearest to -0.1? (a) -2 (b) w (c) -0.2 c Let t = -142 + 141.99. Which is the nearest to 0? (a) 1 (b) t (c) 2 b Let g = -6 - -11. Which is the closest to -1/4? (a) -1 (b) 2 (c) g a Let o = 8 + -19. Let h = o - -7. Let j = h - -4.5. Which is the closest to 0.1? (a) 2 (b) j (c) -3 b Let v be 62/30 - 20/50 - 1. Which is the nearest to 0? (a) 5/3 (b) 7/2 (c) v c Let s = 109/10 + -21/2. Which is the closest to -1/2? (a) 5 (b) s (c) -2 b Let i = 12 + -12.09. Let z = i + -0.01. What is the nearest to z in 2, 1/6, 1/2? 1/6 Let w be 20/(-45)*(-6)/4. Let i = -33731/11 + 3069. Let	{ "pile_set_name": "DM Mathematics" }
- 257696 for t. 63 Solve -2048g - 48125 - 35526 = 13130 + 1523 for g. -48 Solve -122633 - 8772 = -3205c for c. 41 Solve 580u - 37083 = 11729 - 12272 for u. 63 Solve -111r + 152r + 14877 = -510r for r. -27 Solve 136s - 202s = 1584 for s. -24 Solve 343r = 244r - 143r - 13794 for r. -57 Solve -133o + 462 = -53o - 21o - 38o for o. 22 Solve 376t + 331t + 1159 = -1841 - 4070 for t. -10 Solve -20z - 339596 = -339056 for z. -27 Solve 179 - 234 = -73i + 142 + 168 for i. 5 Solve 530o - 18233 = -3332 + 11069 for o. 49 Solve 512a - 794a + 27367 = 400a - 7415 for a. 51 Solve -1218t - 383t = -294t - 49666 for t. 38 Solve -1447y + 7801 = -52973 for y. 42 Solve -7912 = -11911t + 11819t for t. 86 Solve 2x + 26 - 44 - 11 = 7 for x. 18 Solve 115h - 72h = 34h - 117 for h. -13 Solve 49200 = 424l + 136l + 424l for l. 50 Solve 759q + 468q = 86095 - 18610 for q. 55 Solve 168 = 381k - 723k + 350k for k. 21 Solve -3174n = -3109n - 1625 for n. 25 Solve 2642c = -4060c - 3139c - 580619 for c. -59 Solve -169y - 659y - 44289 = -125y for y. -63 Solve 68277h - 68316h = -1560 for h. 40 Solve -8087z = -244167 - 370445 for z. 76 Solve -23165d = -22798d + 11744 for d. -32 Solve 31b - 881 = -299 - 117 for b. 15 Solve -130 = -460b - 37 - 1473 for b. -3 Solve 1396 + 798 = -456y - 542 for y. -6 Solve -117r - 4420r - 45900 - 51573 - 70396 = 0 for r. -37 Solve -21h - 948h - 3955 = -28180 for h. 25 Solve -12197 = -530s - 782s - 7526 + 34689 for s. 30 Solve -733322 - 474838 = -12585h for h. 96 Solve 9p + 12400 = -10p - 194p + 13p for p. -62 Solve 152845 = -86p + 156887 for p. 47 Solve 112y = 334y + 19y + 9640 for y. -40 Solve 0 = -164g - 6g + 617g - 26373 for g. 59 Solve -14498 - 63029 = 2538r - 9001 for r. -27 Solve -54 = -88f + 223 + 163 for f. 5 Solve -21r - 562 - 129 = 65 for r. -36 Solve 238y + 1411 + 3634 = -46y - 3759 for y. -31 Solve -31858 + 14771 = -1045z + 49656 + 14767 for z. 78 Solve 1434h - 270915 + 64455 = -4301h for h. 36 Solve -192p + 4080 = -1704 - 3048 for p. 46 Solve 127j - 82j = -156j - 181j for j. 0 Solve 0 = -63o - 57o - 18o - 12006 for o. -87 Solve 164d - 3530 - 9804 = 8d - 74 for d. 85 Solve 169y + 261 = 106y + 92y for y. 9 Solve -2482q + 2712q + 3910 = 0 for q. -17 Solve 76744x = 79671x - 35124 for x. 12 Solve -686x + 121x - 739x - 13013 = -121x for x. -11 Solve -60s + 162s + 14080 = -31s - 43s for s. -80 Solve 153x + 33498 - 117688 = -62158 for x. 144 Solve -1103m + 6100 = 422m for m. 4 Solve 272500c = 272573c - 1241 for c. 17 Solve 0 = 94736c - 94642c - 940 for c. 10 Solve 0 = -172241l + 172062l - 179 for l. -1 Solve 0 = 45028b - 45073b + 1575 for b. 35 Solve -2852m - 14693m - 5512m - 2297160 = -1787m for m. -108 Solve -1513t + 1544t = -154 - 373 for t. -17 Solve -23346 + 1577 = 907p - 2886p for p. 11 Solve 0 = 1446h - 30657 - 8385 for h. 27 Solve -1939l + 427644 = 1455l for l. 126 Solve 516f + 6352 = 2947 + 2373 for f. -2 Solve -2707h = 2633h - 5376h - 3600 for h. -100 Solve 84 + 221 = -254h + 481h - 149 for h. 2 Solve -25270n = -25178n - 4692 for n. 51 Solve 6789u + 279372 = 462269 + 299122 for u. 71 Solve -50283 = -3827p + 2468p for p. 37 Solve -37811 + 37783 = 2a for a. -14 Solve 140l + 322l - 7148 = -5l - 33300 for l. -56 Solve 1484j + 311273 + 386101 = 6890j for j. 129 Solve 375107t = 375551t + 1160 + 172 for t. -3 Solve 320c + 4069 + 8411 = 0 for c. -39 Solve 0 = -4175o - 111076 - 160299 for o. -65 Solve 13868z - 15880z = -42252 for z. 21 Solve 6827 + 457 = -402v - 205v for v. -12 Solve 73988 = -2146q + 155536 for q. 38 Solve -13k - 17k - 9k - 905 - 2176 = 0 for k. -79 Solve 602g = -1782719 + 1730947 for g. -86 Solve -402s - 1277s = -2729s - 24150 for s. -23 Solve 4m + 291042 = -49m + 287279 for m. -71 Solve -916g + 26228 + 3084 = 0 for g. 32 Solve 167q - 144q - 7259 = -293q + 2537 for q. 31 Solve -1679q - 1604q = -791q + 1409q + 54614 for q. -14 Solve -21141230 = 20d - 21140130 for d. -55 Solve 902x = -405x + 334x - 65191 for x. -67 Solve -158 - 84 = 2243c - 2265c for c. 11 Solve 5221 - 20805 = 487k for k. -32 Solve -1176f = 1197f - 2345f + 868 for f. -31 Solve -256695q + 256721q + 988 = 0 for q. -38 Solve -107q - 244287 + 249047 = 63q for q. 28 Solve 0 = 14t + 140402 - 140164 for t. -17 Solve 763 = -1855i - 2942 - 1497 - 2218 for i. -4 Solve -22k - 645 + 190 + 1095 + 636 = 0 for k. 58 Solve 0 = 244x - 163x + 338 - 3497 for x. 39 Solve 10040 = 8042j - 8256j - 5154 for j. -71 Solve -298g - 7176 = 81g - 725g - 850g for g. 6 Solve -603 - 4059 + 1441 - 1103 = -47n for n. 92 Solve 1428 = 11577j - 11645j for j. -21 Solve 5x + 26x - 2012 = -37x - 5616 for x. -53 Solve -19g + 22g - 4361 = -86g for g. 49 Solve 0 = 248t + 702t - 276t + 41114 for t. -61 Solve 2328p - 87 + 1307 + 1244 = 136 for p. -1 Solve 0 = -13s - 171s - 221s + 405 for s. 1 Solve 89g = -149g + 52g - 103g + 2023 for g. 7 Solve -2024 = -145q - 2553 - 12376 for q. -89 Solve 544q + 4749 + 7683 = -1010q for q. -8 Solve 3559j - 3496j + 945 = 0 for j. -15 Solve -416b - 4752 - 635 = -10010 - 8689 for b. 32 Solve 98u + 19822 = 25702 for u. 60 Solve -363v - 6929 + 14113 + 22582 = 0 for v. 82 Solve 273l - 126535 = -6418l + 20667 for l. 22 Solve 0 = 3912b - 2116b + 4579b + 33984 - 467484 for b. 68 Solve -672t + 21375 = -197t for t. 45 Solve -185l + 1280 = 6658 + 1097 for l. -35 Solve 8205o + 8245o - 2450 = 16415o for o. 70 Solve -5695 = -818t + 82t - 19056 - 43311 for t. -77 Solve -418u = 322u + 102u + 65u + 12698 for u. -14 Solve 1598 + 1394 = 1932z - 436z for z. 2 Solve 414l = 82l + 58l + 20044 + 4068 for l. 88 Solve 483r - 950r + 270r = 10441 for r. -53 Solve 227l + 7309 = 119l - 181l - 783 for l. -28 Solve -483r = -925r + 345r + 291 for r. 3 Solve 232y - 196y + 343y + 3315 + 2749 = 0 for y. -16 Solve 1831y = -1849y + 5498y - 1838y - 540 for y. -27 Solve 38w = -57w + 17w + 2382 + 894 for w. 42 Solve -1064t - 1193t + 2240 = 1062t - 3479t for t. -14 Solve 104u - 151u = 147u + 28u - 20646 for u. 93 Solve -2550 = 485x - 36891 + 2816 for x. 65 Solve 377p + 430p + 10392 = -44p - 448p for p. -8 Solve 11098 - 22764 = 141p - 10820 for p. -6 Solve 30807y - 29818y - 43516 = 0 for y. 44 Solve 2725r = 1343r - 71864 for r. -52 Solve -s - 1142s - 18400 - 55895 = 0 for s. -65 Solve 14194m + 5128m = -300552 - 1593004 for m. -98 Solve -194q - 1552q = 2138q - 388400 for q. 100 Solve 9957p - 9811p = -5110 for p. -35 Solve 503l - 1019l - 446 - 152 = -503l for l. -46 Solve -330t - 220t - 978 - 106 = 16 for t. -2 Solve -74210 = -4i - 74070 for i. 35 Solve 0 = -1477l - 10833 + 84683 for l. 50 Solve 433q + 926q - 202q - 94178 = 196q for q. 98 Solve 33217 - 20912 = -427s - 108s for s. -23 Solve 8820j = -7743 - 18717 for j. -3 Solve -471d - 6774 = -13839 for d. 15 Solve 25100 = -388t - 616t for t. -25 Solve 250b - 581 = 831b for b. -1 Solve -123o + 1479 = 495 for o. 8 Solve -247672 - 240134 = -4279s for s. 114 Solve -1039q - 751q = 466q - 440q + 108960 for q. -60 Solve -1003x + 11480 = -863x for x. 82 Solve -3791s = -128944 + 29044 - 116579 + 19347 for s. 52 Solve -2297m + 3355 = -2236m for m. 55 Solve 3978s = -270285 + 286197 for s. 4 Solve 707r - 7398 + 1443 = 8666 - 1188 for r. 19 Solve 422365 = -4088o - 286o - 595o for o. -85 Solve -84l + 436l + 43365 - 15667 = -907l for l. -22 Solve 12f - 1329 = -163f - 10079 for f. -50 Solve 5177 + 19888 = 557t for t. 45 Solve -999d - 1351d - 6927 - 66524 = 208549 for d. -120 Solve -956n + 1870n = 1125n - 2110 for n. 10 Solve 0 = -742u - 13212 - 89926 for u. -139 Solve -1215 = -456w + 892w - 463w for w. 45 Solve 732717x - 733822x + 114920 = 0 for x. 104 Solve 5i - 53i = -439i + 32493 - 1213 for i. 80 Solve 593g - 12129 = -3713 + 6409 for g. 25 Solve -3293w - 327161 = 1590w for w. -67 Solve -11719g = -9343g - 33264 for g. 14 Solve 1669m = -3072 - 3604 for m. -4 Solve -2168a + 29735 - 103447 = 0 for a. -34 Solve 4h - 43h + 249 = 741 + 600 for h. -28 Solve 306o = 463o - 230o - 1606 for o. -22 Solve 5*k = k - 325 + 161 for k. -41 Solve	{ "pile_set_name": "DM Mathematics" }
e l. 2 Express -5m + 289m4 - m2 - 14m2 - 290m*4 as pm*3 + k + gm*4 + jm + hm2 and give g. -1 Express (-4 - 5 - 1)(-3h + 680 + h - 658) - 2h + 4h - 3h as g + ah and give g. -220 Express -288z - 113z + 126z - 137z - 752z in the form l + sz and give s. -1164 Rearrange 53s - 173 + 2s4 - 28s - 27s - s4 - 3s*2 + 2s*2 to the form us*3 + os*4 + gs + ls2 + v and give l. -1 Rearrange -10k*2 + 988 + 5k*2 - 981 - 12k*2 to pk + w + yk2 and give w. 7 Rearrange ((-p3 - p + p)(-p - 4p + 4p) - 2p4 + 33 - 33)(10 + 17 - 5) to the form wp4 + hp*3 + zp + kp2 + b and give w. -22 Express 4z*3 - 32z*4 - z + 33z*4 - 10 - 5z*3 as o + sz + bz4 + az*2 + nz*3 and give a. 0 Express (11p + 11p - 6p)(-10p*3 - 7p*2 + 7p*2) in the form l + np + gp4 + kp*3 + xp*2 and give g. -160 Express (1 + 1 - 4 + (114 - 387 - 349)(2 - 1 + 1))(-2m*2 + 0m + 0m) in the form t + am + ym2 and give a. 0 Express 3b*2 + 26b2 - 26046 + 26049 + b3 in the form t + ab3 + mb + cb2 and give t. 3 Rearrange -x2 + 6x + 92 + x - 95 to zx + c + ix2 and give c. -3 Rearrange (-o2 + 0o + 0o)(-98 + 353o + 100 - 61o) to ro*2 + h + to*3 + zo and give r. -2 Rearrange -25d - 34d + 88d - 92 - 31d to the form b + nd and give n. -2 Rearrange (-1 + 0 - 3)(2 - 4 + 1)(0a + 3a + 0a + (4a - 3a + 0a)(2 + 2 - 2) + (-a - 4a + 2a)(-3 + 3 + 2) - 1 + 1 + 2a) to ia + j and give i. 4 Express (9z - 14z - 9z)((7z - 4z + z + (z + 3 - 3)(1 + 0 - 2))(5 - 3 - 3) + (2z - 5z + z)(3 + 0 - 2)) as yz2 + h + xz and give y. 70 Rearrange (-23k3 + 20k*3 + 24k*3)(1 + 2k - 1) + 3k*4 - 5k*4 + 0k*4 to the form ik*4 + vk*3 + m + rk*2 + ck and give i. 40 Express (-v*2 + 4v*2 - 2v*2)(-v + 0v + 7v) + (12v + 5v - v)(-v2 + 5 - 5 - v) as av*3 + iv*2 + g + tv and give a. -10 Rearrange 3m2 + 0m*2 - 2m*2 + 82 - 82 + 28m*2 + (0m + m + m)(0m - 2m - 6m) to the form hm2 + b + xm and give h. 13 Rearrange -458z2 + z - z3 - 451z*2 + 902z*2 to k + rz + xz3 + vz*2 and give r. 1 Express 79w + w*3 - 147w + 29w as p + lw*3 + xw*2 + tw and give x. 0 Rearrange 157 - 2s + 22s*2 - 48 - 56 - 52 to the form ds*2 + u + gs and give d. 22 Express -128 - 171 + 390 - 3x3 + 2x + 2x4 + 4x*3 - 154 - 3x*2 in the form z + wx*3 + px + lx2 + dx*4 and give d. 2 Express -4n*3 - 7592n*2 + 1 + 7593n*2 - 37n*3 - 2n in the form l + mn3 + qn + fn2 and give l. 1 Express i2 + 22i*2 + 100i*2 + 110i*2 as ai*2 + ci + y and give a. 233 Rearrange 2x + 41x*3 - 35x*3 + 2 - 6 - 3 to px*2 + kx*3 + i + bx and give b. 2 Express (-29w + 10w + 11w)(0 - 2 + 3)(0 + 11 + 7) in the form hw + m and give h. -144 Rearrange 3q - 4q + 0q3 + 3q + 144q3 to the form f + iq*3 + tq + mq2 and give f. 0 Express -2g2 + g2 + 753g + 8 - 752g as y + og + sg*2 and give o. 1 Rearrange 5k*3 - 48 + 4k - 50 - 4k3 + 115 to the form fk*3 + xk + vk2 + o and give x. 4 Rearrange (0 - 5 - 4 + (2 + 1 - 2)(-5 + 0 + 3))(-9m - m - 7m) to t + im and give i. 187 Rearrange 2a2 + 47a + 115a - 78a + 1 to ma2 + ka + p and give m. 2 Rearrange (h + 0 + 0)(37h - 319h + 1126h + 793h) to the form uh*2 + zh + t and give u. 1637 Rearrange -2 - 12k - 7 - 8 + 16 - 123k to bk + r and give r. -1 Express 7d + 28d - 463d - 430d + 191d as b + id and give i. -667 Rearrange (k2 - k2 + k2)(3k - 3k + k) + (4 - k - 4)(-133k + 64k + 59k)(-2k + 2k - 2k) to ak + xk*3 + mk2 + z and give x. -19 Express (-x3 + 0 + 0)(131 - 328 + 127)(-1 - 1 + 1) as ox2 + ax*3 + rx + s and give a. -70 Rearrange -8 + 3z + 0 - 3 + z - 6 to the form dz + o and give d. 4 Express (-56301 + 56301 + 605d)(-2d + 2 - 2) in the form q + jd*2 + md and give j. -1210 Express -15n3 + 6n - 9n + 25n + n*3 + 9n as cn3 + wn*2 + b + pn and give c. -14 Express -401k2 + 358 - 722 + 364 - 1786k*2 in the form xk*2 + v + mk and give v. 0 Express (0 - 3 + 1 - 2b)(30b - 23b - 30b) in the form hb + tb2 + r and give t. 46 Rearrange -2 - 31 + 7o + 13 to i + no and give n. 7 Rearrange (-2j + 0j + 0j)(12j - 5j - 96j) - j*2 + 4j - 4j to the form bj + xj2 + m and give x. 177 Express (1 - 1 - g)(-26 + 57 - 6)(0 + 1 + 1) as l + sg and give s. -50 Rearrange (4r + r - 3r)(1 + 0 - 2)(730r3 - 15r*2 - 2r*2 - 727r*3) to the form d + yr + sr4 + lr*2 + qr*3 and give q. 34 Rearrange (-q - 2q - 2q - 2)(2 + 1 - 6)(0 - 1 + 3)(0 + 3 - 8)(-9 + 9 + 4q*3) to the form hq*2 + y + kq*4 + sq*3 + cq and give s. -240 Rearrange -40o + 231o + 107o - 574o to ho + x and give h. -276 Rearrange -o3 - 9 - 2o*2 - 3o + 7 - 3o - o4 to the form yo*3 + fo + i + po4 + jo*2 and give p. -1 Rearrange (-65i*2 + 31i*2 + 35i*2 - 1 - 2i*3)(6i - 6i - 16i) to the form li + yi2 + xi*3 + w + pi*4 and give x. -16 Express 2d - d + d + (4 + 0 - 3)(-145 + 141 + d - 7d) in the form p + ad and give p. -4 Rearrange -7 + 64q - 6q2 + 48q - 3q3 + 6q*2 + 10 to the form k + dq*2 + pq*3 + sq and give k. 3 Rearrange -8x2 - 5x*2 + 2x*2 + (3x + 2x - 4x)(10x + 14x - 7x) to the form nx + mx*2 + o and give m. 6 Express -3d - 3d + 12d - 4 in the form v + qd and give v. -4 Rearrange -12d - 78d + 91d + 21 to wd + m and give m. 21 Express (-2 + 2 - 2x)(-152 - 120 - 1029) + 6x - 4x - 3x as wx + v and give w. 2601 Rearrange b3 - 12b*3 - 10b*4 + 30 - 32 to the form jb*2 + vb + hb3 + zb*4 + l and give l. -2 Express -34m + 4m + 2m*2 - 137 - m + 136 in the form am + d + im2 and give d. -1 Express (-4b + 0b + 3b)(-788 - 754 + 1623)(-5 + 3 + 1) in the form f + kb and give k. 81 Express (5h - 6h - 2h)(0 + h + 0)(-2h + 4 - 5 - 1) in the form ch*3 + qh + m + jh2 and give c. 6 Rearrange (j + 0 - 2 + 1)(9 - 236 - 162) to the form m + wj and give w. -389 Express -5k + 3645k2 + 6k - 3643k2 + 224k*4 in the form o + mk*4 + vk + pk2 + dk*3 and give v. 1 Rearrange -44p*2 + 331p*2 - 10p*2 + (2p - p + p)(-3p + 4p - 3p) to the form zp + v + cp*2 and give c. 273 Express 84z + 419z + 155z as vz + j and give v. 658 Express -760821 + 70k + 760821 as w + fk and give f. 70 Rearrange 0m*3 + 2m2 - 18 - m3 - 70 + 2m3 - 93 to the form sm*3 + am + nm2 + r and give n. 2 Rearrange -2716d*4 + 3d + 0d + 4 + 2714d*4 to the form qd*3 + rd + xd2 + o + hd*4 and give r. 3 Rearrange -3 - 5y - 182y2 - 6y + 180y2 - 12 + 3y to the form x + vy + ay*2 and give a. -2 Rearrange -31x*2 - 14x*2 + 12x*2 - 9 to p + gx*2 + sx and give s. 0 Express -263v + 381v + 142v + 559v as g + rv and give r. 819 Express -2867 + 1432 - 5a*2 + 1448 in the form fa*2 + h + pa and give f. -5 Rearrange (-37 - 34 - 30)(2f + 1 - f + 0f)(-f*3 - 3f + 3f) to uf*4 + if*2 + wf + g + df3 and give u. 101 Rearrange (3j + 2j2 + 8j - 5 - 9j)(-1 - 1 + 4 + 1 + 1 - 3 + (-1 + 1 + 1)(0 + 3 - 1)) to oj + uj2 + b and give u. 6 Rearrange -14y*2 - 14y + 2y3 + 0y*2 + 7y*2 - 3y*2 to the form o + wy + ky3 + ay*2 and give a. -10 Rearrange 174w*2 + 96 + 101 - 197 to yw*2 + b + pw and give y. 174 Express 276f2 - 127f*2 + 79f*2 + 346f*2 as kf*2 + p + tf and give k. 574 Express -2l3 + 3 + 21l*3 - 18l*3 - l - 37l*3 as cl*3 + g + wl + yl2 and give c. -36 Express (4 - 4 + 10)((-2z + 0 + 0)(3 + 1 - 6) + 2 - 2 + z) as qz + v and give q. 50 Express (-26f + 5f - 15f)(3 - 5 + 7)(-2 + 5 - 4) as wf + j and give j. 0 Express -3o*2 - 3o*3 - 689 + 687 - 2o*3 in the form yo*2 + fo*3 + k + to and give k. -2 Rearrange (4i + 2i*3 - 4i)(55 + 38 + 46) + (4 + i - 4)(-7i2 + 2i*2 + 3i*2) to di*2 + ui*3 + wi + z and give u. 276 Rearrange 18 - 3c - 18 + (c + 0 + 0)(-5 + 3 + 0) - 2 - 2c + 2 - 29 + 21c + 3c - 28c to q + uc and give q. -29 Rearrange -39s - 40s + 1 - 2s*4 + 96s to the form ps + gs*2 + is*4 + r + us**3 and give r. 1 Exp	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.