Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
) = -k + 2. Let v(t) = t - 3. Let y(g) = -6u(g) - 4v(g). What is y(d(i))? 2i Let t(z) = 2z*2 + 1 - 1. Suppose -9w + 3w = -30. Let r(a) = 5 - w + 6a + 0. What is r(t(b))? 12b2 Let s(y) = -3. Let h(t) = 5 + 0 + t2 + 3 - 4. Let n(u) = -3h(u) - 4s(u). Let j(x) be the third derivative of x5/60 - x2. What is n(j(p))? -3p*4 Let b(q) = 2q*2 + 5. Let f(j) = 1. Let y(s) = b(s) - 5f(s). Let x(i) be the third derivative of i4/24 + i2. Give x(y(d)). 2d2 Let a(y) = 4y*2. Let g(d) = -10d - 2. Determine a(g(n)). 400n2 + 160n + 16 Let v(u) = -2. Let h(t) = -t - 6. Let s(b) = h(b) - 3v(b). Let g(c) be the third derivative of c5/30 - c2. Calculate g(s(i)). 2i*2 Let t(y) = 0y + 0y - 2y. Let d(r) be the first derivative of r*4/4 - 4r - 1. Let j(u) be the first derivative of d(u). What is j(t(a))? 12a2 Let c(x) be the third derivative of -x5/60 - 8x*2 + 2. Let v(l) = -5l*2. Determine c(v(n)). -25n*4 Let c(m) = 8m. Let r(h) = 35h2. Give r(c(k)). 2240k*2 Let w(n) = 4n*2 + 3n*2 - 6n*2 + 0n*2. Let r(v) = -6v*2. What is r(w(p))? -6p*4 Let z(u) = -8u - 5u - u + 12u. Let l(q) be the second derivative of q*4/6 + 2q. Give l(z(d)). 8d2 Let v(f) = -8f. Let s(t) = 23t2. Give v(s(y)). -184y*2 Let f(m) = -28m2. Let u(v) be the second derivative of -v3/3 - 8v + 2. What is u(f(x))? 56x*2 Let d(x) = 9x*2 + x. Let n(o) = -6o. Calculate n(d(f)). -54f2 - 6f Let m(s) = -2s - 23. Let u(a) = -3a*2. What is u(m(q))? -12q*2 - 276q - 1587 Let q(c) = 160 - 160 - c*2. Let i(z) = -50z*2. Determine q(i(t)). -2500t4 Let c(l) be the first derivative of -l2/2 + 2. Let s(d) = -d. Let t(n) = n. Let h(k) = 3s(k) + t(k). What is h(c(j))? 2j Let i(q) be the third derivative of 0q + 0q*4 + 0q*3 - 1/30q*5 + 0 + 5q*2. Let m(o) = -7o*2. Give m(i(v)). -28v*4 Let a(m) = -374m*2. Let w(f) = -8f*2. Calculate w(a(b)). -1119008b*4 Let y(q) be the first derivative of 2q*3/3 + 12. Let m(x) = -2x*2 - 15x. What is y(m(u))? 8u4 + 120u*3 + 450u*2 Let j(y) = -46y. Let q(b) be the third derivative of -b*4/12 - 19b*2. What is q(j(w))? 92w Let x(m) = 70m. Let s(j) = -9j*2. Determine x(s(l)). -630l*2 Let l(f) = 2f. Let d(h) = 2h2 - h + 1. Let p(b) = -385b*2 + 210b - 210. Let x(o) = -210d(o) - p(o). Calculate l(x(n)). -70n*2 Let q(x) = -3x. Let m(c) be the first derivative of 5c2 + 10. What is q(m(j))? -30j Let y(g) = -10g2. Let c(d) = -9d - 4. Determine y(c(l)). -810l2 - 720l - 160 Let i(u) = -5u2 - 2u - 36. Let b(n) = -2n. What is i(b(q))? -20q*2 + 4q - 36 Let c(t) = -14t. Let q(g) be the third derivative of g4/12 + 27g*2. Calculate c(q(n)). -28n Let x(a) = a. Suppose 0 = 2t - 6 + 2. Let n(i) be the third derivative of 0i - 1/60i5 + 0i*3 + 0 + 0i*4 + 2it. Determine n(x(v)). -v2 Let k(z) = 10z2 + 5z + 5. Let n(r) = 5r2 + 3r + 3. Let x(g) = -3k(g) + 5n(g). Let p(m) = -2m2. Calculate x(p(s)). -20s*4 Let h(j) = j - 2j - 1 + 1. Let p(t) be the third derivative of -t*4/12 - 4t*2. What is p(h(d))? 2d Let n(o) = -14o2. Let j(y) = -5y*2 + 3y*2 + 4y*2. Give n(j(x)). -56x*4 Let z(m) = -m. Let o(a) = 2a*2 + a. Let n(p) = o(p) + z(p). Let t(j) = -j. Determine n(t(d)). 2d*2 Let q(j) = -5j. Let y be (-24)/(-36) + (-92)/(-6). Let i(r) = 4r2 + 16r. Let z(f) = f*2 + 3f. Let v(d) = yz(d) - 3i(d). Determine q(v(g)). -20g2 Let t(x) = x. Let a(b) = -b2 - 5b - 1. Let k(s) = a(s) + 5t(s). Let q(r) be the first derivative of k(r). Let i(o) = -11o. Calculate i(q(h)). 22h Let c(w) = -2w. Let m(a) = -76a2 + 22a. What is c(m(u))? 152u2 - 44u Let w(v) = -57v. Let x(s) = -119s. Give x(w(p)). 6783p Let o(l) = 2l*2. Let x = 13/294 - -6/49. Let p(q) be the second derivative of 0q*2 - xq*4 + 0 + q + 0q*3. What is o(p(j))? 8j*4 Let v(f) = 49f2 + f. Let i(o) = o2. Determine v(i(l)). 49l4 + l2 Let x be 2 - (3/(-3) + 1). Let u(b) = 2b2 - b2 - xb2. Let c(v) = v2. Calculate c(u(w)). w4 Let t(z) = z. Let n(o) = 5o*2 - 6o - 6. Let i(u) = 154u2 - 187u - 187. Let f(a) = 6i(a) - 187n(a). Give t(f(h)). -11h2 Let o(h) = -3h. Let q(x) = -x*2 + 2x. Let g = -22 + 31. Let y(n) = -4n2 + 9n. Let d(m) = gq(m) - 2y(m). Give o(d(c)). 3c2 Suppose -3k + 13 = 3r + 4, -k + 1 = 0. Let a(l) = l2 - rl2 + l2 + 2l2. Let i(h) = 5h. Let q(b) = -4b. Let s(d) = -3i(d) - 4q(d). Give s(a(m)). 2m2 Let x(w) = -w2. Let v be 1/(-2) - 5/(-2). Let r(j) be the first derivative of j*v - 1 + 0j + 0j + 0. Calculate x(r(s)). -4s*2 Let q(l) = -23l. Let j(s) = -8s. Determine j(q(v)). 184v Let i(p) = 7 - 6 - 1 + 4p. Let r(w) = 9w - 7. Let d(b) = -5b + 4. Let f(u) = -7d(u) - 4r(u). Determine f(i(c)). -4c Let b(i) = 2i. Let l(g) be the first derivative of 0g*2 + 1 - 2/3g*3 + 0g. Calculate l(b(r)). -8r2 Let p(r) = -12r. Let l(t) = -34t2. What is p(l(i))? 408i*2 Let c(t) = -2t. Let i(l) = 202l2 + 2l. What is c(i(n))? -404n2 - 4n Let z(b) = -15b2 + 5b. Let s(l) = 8l2 - 3l. Let w(k) = -10s(k) - 6z(k). Let i(p) = -3p. Give i(w(r)). -30r2 Let u(q) be the first derivative of -q5/60 - 3q2/2 - 8. Let c(l) be the second derivative of u(l). Let t(g) = -15g*2. What is c(t(r))? -225r*4 Let d(s) = 31s*2. Let b(f) = 110f. Determine b(d(r)). 3410r2 Let l(h) = h2 - h2 + h2 + 0h*2. Let y(n) = -4n. Let f(x) = -x. Let m(r) = 10f(r) - 2y(r). Give l(m(v)). 4v2 Suppose 0 = 4m + m - 40. Suppose -1 = -2n + i, mn - 3n + 2i - 7 = 0. Let j(o) = 2 - 3 - 4o + n. Let x(v) = -v. What is j(x(l))? 4l Suppose -32 = -3c - 5. Let j(z) = 9z + 3z2 - cz. Let f(l) = -2l. What is j(f(t))? 12t*2 Let w(y) = -35y*2. Let h(x) = -11x. Give h(w(p)). 385p2 Let d(y) = 16y*2. Let i(m) = -4m*2. Give d(i(b)). 256b*4 Let p(m) = -2m. Let a be 7 + -4 - 3 - -1. Let n(x) = 3x - 4. Let f be n(3). Let b(w) = w + 1. Let u(k) = -5. Let v(r) = au(r) + fb(r). Determine v(p(c)). -10c Let o(g) = -2g. Let m(t) be the third derivative of t5/3 + 31t*2. What is o(m(v))? -40v*2 Let p(y) = -39y. Let w(m) be the first derivative of -2m3/3 - 14. Calculate p(w(k)). 78k*2 Let u(i) = -3i*2. Let q(b) = -152 + 152 + 31b. What is u(q(o))? -2883o2 Let f(a) be the third derivative of a4/8 - a3/2 + 5a2. Let c(l) = l2 - l + 1. Let q(n) = 3c(n) + f(n). Let v(k) = 3k. Give v(q(z)). 9z2 Let l(h) = 23h - 7. Let j(d) = 4d2. Calculate l(j(z)). 92z*2 - 7 Let t be (-1)/(1/(-5) + 0). Let p be 22/t + (-4)/10. Let j(x) = -3x - px + 6x. Let h(l) = -2l2. Give h(j(c)). -2c*2 Let q(c) = 6c + 3. Let g(a) = -10a. Calculate g(q(s)). -60s - 30 Let t be 6/272/54. Let v(d) be the third derivative of 0 + 1/20d*5 + 0d + 0d3 + 0d*t + 2d*2. Let n(c) = c. Determine v(n(m)). 3m*2 Let y(i) = 11i2. Let j(p) be the second derivative of p4/6 + p. Calculate j(y(m)). 242m4 Let i(g) = 170g. Let o(c) = -10c. Let r(x) = -3i(x) - 50o(x). Let a(y) = y. Give r(a(k)). -10k Let k(c) = -5c. Let b(i) be the second derivative of 0 + 3i + 0i2 + 1/3i*3. Calculate b(k(d)). -10d Let o(h) = 1. Let j(v) = 2v - 5. Let w(x) = j(x) + 5o(x). Let p(g) = -3g2. Determine p(w(r)). -12r*2 Suppose -4y = -q - 5, 6y - y + 2q + 10 = 0. Let p(x) be the first derivative of 1 + yx + 3/2x*2. Let u(a) = -a. Determine p(u(w)). -3w Let c(h) be the third derivative of -h4/12 - h2. Suppose -3j = 2j - 45. Let g(z) = -6z + jz - 4z. Calculate c(g(u)). 2u Let d(y) = -y. Let l(i) = -29579i2. What is l(d(a))? -29579a*2 Let h(a) = -43a*2. Let s(y) = -23y*2 + 9y*2 + 12y*2. Calculate h(s(t)). -172t*4 Let y(l) = -5l*2 - 5. Let q(u) = 7u*2. Calculate q(y(b)). 175b*4 + 350b*2 + 175 Let v(q) = -30q*2. Let j(f) = 7f*2. Calculate v(j(k)). -1470k*4 Let o(x) = 3x*2. Let q(m) be the third derivative of 0m + 1/12m4 - 5m*2 + 0 + 0m*3. Give q(o(j)). 6j*2 Let i(m) = -4m*2. Let x = -1 + 3. Let u(j) = 3j*2 + 0j*x - 2j2 + j2. Determine u(i(l)). 32l4 Let k(r) = -8r. Let y(p) = 1220p + 6p*2 - 1220p. Give k(y(x)). -48x2 Let m(y) = 4y - y*2 - 5y + y.	{ "pile_set_name": "DM Mathematics" }
orm s + ga + ba*3 + fa*2 + ya4 and give y. 23 Express o2 + 41 - 2o3 - 120 + 40 + 43 - 6o - 3o2 as wo*2 + vo + yo3 + d and give v. -6 Express 146 - 144 + 100z*2 + 259z*2 + (-1 + 2 + 0)(2z2 + 3z*2 - 7z*2) + 2z - 2z - 2z*2 in the form v + az + hz2 and give h. 355 Express -2q + 2 - 2 + (-3 - 1 + 2)(2q + q - 4q) + 200q + 98q - 416q in the form k + fq and give f. -118 Rearrange (-1 + 2 + 0)(b - 34 + 33 + 2b)(3b2 + 3b2 - b2) to the form ob3 + xb + ab2 + h and give o. 15 Rearrange 5d*2 - 5d*2 - 2d3 + (-3 + 3 + d2)(0d + 0d + d) - 2d + 70d2 + 1647d*3 - 1648d*3 - 20d*2 to u + xd*2 + fd + jd3 and give f. -2 Rearrange 368y + 46y + 294y - 71y to ny + m and give n. 637 Rearrange (-3t + 6t - 6t)(-5 + 1 + 2) to v + at and give a. 6 Express -35p*3 - 20p2 - 3 - p4 + 2p + 1 + 37p*3 + 0 as yp*4 + l + zp*3 + tp*2 + hp and give l. -2 Express 3g2 - g2 + 3g*2 + 17 - 10 + 3g*2 as wg*2 + y + hg and give w. 8 Rearrange -5j3 - 43 + 39 + 9 + (-24 + 8 - 7)(3j2 - 3j2 - j3) to gj3 + w + vj*2 + xj and give g. 18 Express 16t + 2 + 284t*4 + 34t + 2t3 - 2t*2 - 48t as yt2 + qt*4 + jt + dt3 + x and give q. 284 Express -316u*3 + 154u*3 - 7u*2 + 171u*3 + 4u*4 in the form qu*2 + m + lu*4 + tu*3 + iu and give l. 4 Rearrange 1 + 8v + 0v*3 - 9527v*4 + 3v*2 + 9524v*4 + 0v*3 to gv*4 + cv + sv3 + j + nv*2 and give c. 8 Rearrange 3r - 33 + r*3 + 2r*4 + 15r*2 + 48 - 15 to k + cr*2 + sr*4 + vr + br3 and give v. 3 Express 70t - 3 - 62t - 1840t*3 + 1836t*3 as qt*3 + j + ct + ft2 and give q. -4 Express 4x - 5x + 224 - 99 - x2 as vx*2 + l + px and give l. 125 Express (-v - 8v - 2v + 1 - 1 + 2v + (0 + 1 - 3)(-2v + 4 - 4))(-3v2 + 14v*2 + 2v*2) as u + qv*2 + yv + bv3 and give b. -65 Express -14o*4 + 1 - 15o*4 + 45o*4 - 7o + 0o - 12o4 - o3 as xo + ho*3 + q + uo*2 + yo*4 and give x. -7 Rearrange 2c - 2 - 2652c4 + 5169c*4 - 2615c*4 to oc + mc2 + qc*3 + s + lc*4 and give l. -98 Rearrange (-29c + 29c - 20c*2)(-6c2 + 2c - 1 + 4c2 - 2c*2) to the form dc*2 + uc + yc3 + xc*4 + i and give i. 0 Express -43 + 50l + 26 + 17 in the form il + c and give i. 50 Express j4 + 1 + 23j*2 + 0 - 2j*4 + 2j*4 in the form xj*2 + wj + o + sj4 + yj*3 and give o. 1 Express (-2 + 2 - 2)(1223 + 359v - 1223) + 0v - 2v - v as s + lv and give l. -721 Rearrange 6q - 14q + 2 + 10q4 - 2q - 2q + 6q to the form rq2 + zq*4 + s + bq*3 + vq and give v. -6 Rearrange -116z - 161z - 127z - 2z to f + iz and give i. -406 Express -5 + d + 5 + (2 - 2 - 4d)(-4 + 0 + 34) as u + xd and give x. -119 Rearrange 14c3 - 378c - c*3 - 7c*3 + 360c + 8c3 to wc + nc3 + g + bc*2 and give w. -18 Rearrange (10 + 43 + 28 + (-1 - 2 + 2)(4 - 5 + 2))(0 + 0 - t) to the form kt + v and give k. -80 Rearrange (x2 + x2 + 0x2)(-3x2 + x2 + 5x*2) + 32x*4 - 41x*4 - 135x*4 to dx*2 + yx*4 + r + vx + ux3 and give y. -138 Rearrange -16r - 1609r2 - 30r*3 + 3 + 16r + 1608r2 - 2r*4 to the form qr*4 + n + sr*2 + hr + br3 and give s. -1 Rearrange 0r + 2r - r + (-4r + 3r + 4r)(44 + 0 + 115) to j + qr and give q. 478 Rearrange w + 35w3 + 120w*3 - 3w - 20w3 + 4w to the form y + vw + qw*2 + rw*3 and give q. 0 Express (-18 + 12 + 12)(-3 - 1 + 6)(2 + 3o - 2)(29 - 19 - 18)(4 - 3 + 0) in the form p + mo and give m. -288 Rearrange 4l*2 - l - 13l2 - 2 - l3 + 7l2 - 2l*4 to the form wl*3 + n + fl*4 + bl*2 + ul and give w. -1 Express -28f4 - 25f*3 - 6 + 26f*3 + 5 - 1 in the form sf*2 + df + if4 + hf*3 + a and give i. -28 Rearrange -45s*2 + 49s*2 + 14s - 4 - 14s to ns*2 + g + os and give n. 4 Rearrange 3m2 - m + 15m*3 - 3m*2 - 5 - 155790m*4 + 155788m*4 to the form om*4 + am + zm2 + im3 + b and give i. 15 Rearrange (b2 + 0b2 + 6b2 + b3)(-297 - 115 + 110) + 0b*3 - 3b*3 + 4b*3 to xb*2 + p + mb + rb3 and give x. -2114 Rearrange -29u - 4u3 + 17u - u*2 + 4 + 9u*3 + 5u*3 + 14u to du3 + hu + wu2 + b and give h. 2 Express -6n + 94 - 96 + 24n + 2n - 4n - 3n + (3n - 4n + 0n + (2 + 4 - 4)(-2n + 0n + 0n))(-1 - 2 + 5) in the form z + hn and give z. -2 Express (3375 - 6d + 10d - 3404)(-2d3 + d3 - d3) as id*3 + v + gd*4 + od + wd2 and give g. -8 Rearrange (-d + 0d - d*2 + 0d2 + (-d2 - 4d2 + d2)(2 - 1 - 2))(2d + d + d)(-3 + 0 + 2) to the form v + yd*2 + nd*3 + kd and give y. 4 Express -35h + 70h + 23h + 95h in the form jh + x and give j. 153 Express 7 + 175i + 0 - 6 as k + mi and give k. 1 Express 3 + 2 + 3222v + 1 - 3220v in the form zv + n and give z. 2 Express -147a3 + 2a*2 + 72a*3 + 11a + 71a3 - 2 as fa + d + oa3 + ba2 and give d. -2 Express -o4 + o*3 - 22o - o*2 - 21o + 38o in the form go*3 + jo + bo4 + q + ko*2 and give k. -1 Rearrange (639 - 639 + 29u*3)(0u - 3u + 4u) - u4 - u4 + 4u*4 to the form ru + y + fu2 + vu*4 + xu*3 and give v. 31 Express -1555 - 1546 - 61u + 277u + 3101 in the form q + lu and give l. 216 Rearrange 39u2 + 16u + 7u - 43u - 1 + 14u + 7u to gu + nu*2 + d and give d. -1 Rearrange (65s*2 + 21s*2 + 16s*2 + (0 + 0 - 2s)(-s + 2s - 3s) + s2 + 2s*2 - 5s*2)(-5s - 5s + 5s) to ms*3 + ks*2 + os + n and give m. -520 Express 105m + 188m + 25m as w + om and give o. 318 Express (-21 - 6x + 21)(0x + 0x + 4x3)(-2 + 2 - 4) in the form vx + hx*3 + wx*2 + d + sx*4 and give s. 96 Rearrange (-3w + w*2 + 3w)(-4 + 2w + 4 + (6 - 14 - 38)(-3w + 4w - 2w)) to i + jw2 + qw + mw3 and give m. 48 Rearrange 379v + 951v2 - 379v - 83v2 to r + pv + xv2 and give x. 868 Express -7 + 697t*4 + 3 - 298t*4 + (-2t*2 + 2t2 - t2)(3t*2 - 3t2 + t2) as k + xt4 + rt + gt3 + at2 and give x. 398 Rearrange (-a3 - 58a3 + 8a*3)(-2 + 0 - 2) + 0a3 - 3a*3 + 4a*3 to g + na*3 + ma*2 + wa and give m. 0 Rearrange -3i3 - 113 + 5i*2 - 4i*4 - 2i + 45 + 67 + 0i3 to a + ni*4 + ci*3 + zi*2 + li and give a. -1 Rearrange (-4v2 - 2v*2 + 4v*2)(-4 + 5 - 2) + v*2 - 3v*2 + 4v*2 + 33v*2 - 35v*2 - 116v + 120v to xv*2 + fv + m and give f. 4 Rearrange -11 + 6z4 + 20z*2 + 20 + 2z*3 - 20z*2 to dz + h + nz2 + gz*3 + cz*4 and give g. 2 Express 75l + 5 + 29 - 34 as hl + d and give h. 75 Rearrange 62v + 122v + 9 - 7 - 2 to the form kv + r and give k. 184 Express (-6p2 - 2p*2 - 2p*2)(-5p2 + 3p2 - p2) + (2p2 + p - p)(4p2 + 0p*2 - 6p*2) as x + up*4 + zp + fp3 + gp*2 and give f. 0 Express (1 + 2 - 1)(2g + 1 - 1)(5 + 0 - 1)(-182 + 23 - 33) in the form h + fg and give f. -3072 Rearrange -20 - 11t - 5t + 16t - 2t*2 to the form rt + w + kt2 and give w. -20 Rearrange 38o - 2o2 - o - 12o + o - 13o to the form ao + w + go2 and give a. 13 Rearrange (4y2 - y2 - 5y2)(4y2 + 444y*2 + 518y*2) - 2y*4 + 0y*4 + 3y*4 to by*3 + my*2 + p + vy + zy4 and give z. -1931 Rearrange 20 + 192g - 8 - 12 + 353g to ug + p and give u. 545 Rearrange -2s3 + 43s + s*4 + 0s*4 - 4s*4 + 39s - 2 - 80s to us*3 + xs*4 + vs*2 + t + ns and give u. -2 Express -2 + 2316h2 + 34h + 31h - 2317h*2 as zh*2 + xh + y and give y. -2 Express 4u + 226u*2 - u - u - 43u*2 in the form tu + a + fu2 and give f. 183 Express -q3 - 14q - 158q2 + 16q + 82q2 + 35 + 77q*2 in the form b + mq*3 + rq*2 + oq and give b. 35 Express 500f2 - 668f + 668f in the form zf*2 + r + cf and give z. 500 Express 4x2 + x3 - 10x*2 - 10x*4 + 114 - 58 - 55 as p + qx*4 + lx*2 + gx + fx3 and give l. -6 Express (5 - 5 - 2m)(-3994m*2 + 9188m - 18373m + 9185m) in the form dm3 + om + g + lm2 and give d. 7988 Rearrange 6x4 - x4 + 2x3 + x3 + (4x - 2x2 - 4x)(255 - 33x*2 - 255) to t + ax*3 + mx + w*	{ "pile_set_name": "DM Mathematics" }
ich is greater: i or z? i Suppose -4i - 2 = -3r + r, 0 = r + 3. Is i at least 0? False Let p = -0.995 + -0.005. Is p < -0.2? True Suppose 2q - 4q = -5b, -b + 5q = 23. Suppose -10k + 7k + 6 = 0. Do b and k have different values? False Let c = -19.42 + 19. Let g = 13.98 - 14. Let u = c - g. Which is greater: -2/7 or u? -2/7 Let z(l) = l*3 - 14l*2 - 17l + 29. Let f be z(15). Is f less than or equal to 1/24? True Let u be 1 - (-1 + 3)2. Let r be (4/(-3))/(1/u). Is r not equal to 1? True Let h be -5((-4)/2)/(-2). Let r = h - -4. Which is smaller: r or 1? r Let y be 12 + 4/3. Which is smaller: 4 or y? y Suppose 4k + 52 = 196. Suppose 0 = 3o - 3z + k, 28 = -4o + 5z - 24. Let l be 2/o - (-18)/(-24). Which is bigger: l or -3/5? -3/5 Suppose 5y - 3d = 15, d + 2 = 4y - 3. Which is greater: y or -2/3? y Let y = 26.8 - 29. Let h = y + 1.9. Which is smaller: -0.2 or h? h Suppose -3c + 43 = 1. Suppose -c = -p + 4p + 4m, -4p - 5m - 18 = 0. Which is bigger: -3 or p? p Let x = -11 + 8. Let s = 24 - 26. Which is smaller: x or s? x Suppose -6 = -3f - 12. Which is greater: 0 or f? 0 Suppose 0d + 3d + 306 = -3o, 2d = -4o - 204. Let g be (-56)/d(-66)/(-48). Let j = g - 10/17. Which is smaller: j or 1? j Let q(m) = 2m*3 - 2m + 1. Suppose -17 = -2n + 3v, -3v + 18 = -2n - 7v. Let x be q(n). Which is greater: 7/5 or x? 7/5 Let f = 64 - 323/5. Is 0.4 less than f? False Let r(k) = k - 1. Let j be (1/1 + -3)/(-2). Let i be r(j). Is 3/5 at least i? True Suppose 0y + 3o + 837 = 4y, -3y + 5o = -636. Let g be (-120)/y + (-4)/(-6). Which is smaller: -1 or g? -1 Let f = -42 - -32. Which is greater: -1/3 or f? -1/3 Let c = -7.5 + 2.4. Let y = c - -5. Are 6 and y non-equal? True Let q = 13051/17 - 768. Which is smaller: 0 or q? q Let r be (-131)/7 + 10/(-35). Is -37/2 at least as big as r? True Let a = 15 + -16. Let x = 1.1 + 8.9. Is x less than or equal to a? False Let j = -81/91 + 6/13. Is j bigger than 4/9? False Suppose -2b = -6b + 3c - 30, b + 15 = -3c. Let s be (-47)/6 - (-18)/(-108). Is s at most b? False Let s = 1/328 + 317/3608. Which is smaller: -1 or s? -1 Let o = 4 + -3. Let f be o/(-6)(-18 - -3). Is 2 greater than or equal to f? False Suppose 0d - 3d + 3c = 0, d + 3c + 4 = 0. Suppose 7b + 18 = -2b. Let x = d - b. Which is greater: x or 2/9? x Suppose u + 3 = -2u. Let t = -6 - -8. Suppose 6 - t = -5d + 2a, 2d + 7 = -a. Which is smaller: u or d? d Let z be 2/(-3) + (-19 - -20). Let q = -3 - -3. Does q = z? False Suppose 2b = -0b + 4. Suppose -20 = bk + 28. Let q be (-2)/8 - (-2)/k. Which is bigger: 1 or q? 1 Let g be (2 - (0 + 1))4. Suppose 2k + g = -2k. Suppose -3c - 3b - 8 = -2c, -4c + 5b = -2. Is c > k? False Let a = -0.14 - -0.14. Which is greater: 1 or a? 1 Suppose 3f + 2q - 9 + 0 = 0, 5f = -5q + 15. Suppose 0 = -ft + t + 10. Suppose 0 = -7c + 2c + t. Which is bigger: c or 0? c Suppose -51 = -4q - 0q - 3r, 2q - 2r = 22. Let o = 17 - q. Suppose ou = -5, 2u + 3 = -f - 0u. Which is smaller: f or -3? -3 Suppose 2z = -0j + 2j - 40, 0 = -4j - 4z + 64. Suppose -2a + 12 = -0a - g, 0 = -3a - 4g + j. Suppose -49t - 28t = -308. Is a smaller than t? False Suppose -9 = 2k + 3. Let b(d) = -3d - 6. Let o be b(-4). Suppose -o - 9 = 3a. Which is greater: a or k? a Let s(r) = -r + 2. Let f be s(2). Let p = -4 - -4. Suppose f = c - 4 - p. Which is bigger: 5 or c? 5 Let h = -3 + 6. Suppose -25k = -24k - 2. Is k smaller than h? True Suppose 7y - 3y = 4t + 12, 2t = -2y + 10. Which is greater: t or 3? 3 Suppose 2g + 0g = -6, 2g = 5x - 21. Let i(b) = b - 2. Let c be i(x). Let p be 0/(-1 + -2 + c). Is p greater than 1? False Suppose -4a + 7 + 65 = 4l, -2l + 78 = 5a. Let b = a - 22. Does -9 = b? False Let n(t) = -3t - 5. Let q be n(-2). Let p be 2/3 + 84/(-99). Which is greater: q or p? q Suppose 5y = -0y. Let b = y + 1. Let o be 1/(-13)6/3. Does b = o? False Let u(q) = -2q + 11. Let x be u(7). Let f be 4/(-3) + (-4)/6. Is f > x? True Let w = -206/3 + 616/9. Let z = -14 + 12.96. Let g = z + 0.04. Does w = g? False Let m be 2/5(13 + -3). Suppose -m - 2 = -3z. Are 6 and z non-equal? True Let z = -13/5 - -57/20. Let g = 0.58 - -0.02. Let p = g + -0.5. Are p and z unequal? True Suppose -4u + 1 = 5. Let p be (-1u/3)/1. Which is bigger: 1 or p? 1 Let a = 0.001 + 0.069. Which is smaller: -1 or a? -1 Suppose m + 8 = -z, -z + m + 4 = 2. Let d = 31/12 + z. Let f = -3/4 - d. Is -1 at most f? True Let p(k) = k3 - 4k*2 - 4k - 3. Let f be p(5). Let q = -71 - -120. Let i be f/(-8) - q/28. Is i > -2? False Let k(a) = a - 3. Suppose 0 = -3g - 13 - 2. Let o(u) = 1. Let x(q) = go(q) + k(q). Let l be x(11). Which is smaller: 4 or l? l Let f(r) = r - 6. Let j be f(8). Suppose 0 = -2k + 2w - j, -3w - 4 = -1. Is -2 bigger than k? False Let i be -3 + -2 + (-1 - -5). Let z = i + 3. Let v be (-3)/(-2)z/(-6). Is 0 at least v? True Suppose -c - 2 = -3c. Let f be c - 2 - (-16)/6. Which is smaller: 1 or f? 1 Let v be (9/102)/(6/8). Is v less than 1? True Let y = -4005 - -805007/201. Let b = -380/2211 - y. Which is smaller: 1 or b? b Let t = 102.789 + 0.211. Is t <= 2/3? False Let q = 0.07 - -6.93. Let d = q + -7.4. Suppose 3x = -2x. Is d smaller than x? True Suppose 2y + 8 = -2y + 3p, -3p = 4y + 32. Is y <= -6? False Let r = 5 - 3. Suppose -1 - r = -3i. Which is smaller: 2/15 or i? 2/15 Let o(a) = -a3 + 2a*2 + a. Suppose -z = -0z - 2. Let f be o(z). Let g(x) = -x3 + x + 3. Let v be g(0). Is f less than or equal to v? True Let q(v) = v2 + 2v + 5. Let p be q(-3). Which is smaller: p or -1? -1 Suppose -5a = -s + 82, 5s + 3a + 33 = 499. Let h be (3 - 1) + s/(-36). Which is smaller: -2 or h? -2 Suppose -7k = -2k. Are k and 6/13 equal? False Let m = -2 - 1. Let f(s) = 4s - 3s*2 + 4s*2 + 0 + 2. Let o be f(m). Which is smaller: o or 2/9? o Let f be (-4)/(-10)15/3. Suppose 8 = -2g - 2t, 0g - t - f = -g. Let q be (6/(-9))/((-16)/(-24)). Is q less than g? False Let j = 1252/11 - 114. Which is greater: j or 0? 0 Let n = -34/15 + 13/5. Let o = -2.156 + 0.216. Let v = o - -2. Are v and n non-equal? True Let x be ((-6)/(-228))/((-4)/(-24)). Which is smaller: x or 0? 0 Let i = 53.9 + -65. Let f = i - -11. Is f < 1? True Let b be 1/((0 - 0) + -3). Which is smaller: b or 0? b Let q = 135/8 - 17. Let b = -4604/3 - -1521. Let m = 13 + b. Which is smaller: m or q? m Suppose 0 = -2w - 2w. Let q = 1 - w. Is q > 0? True Let t = -31.6 + 38. Let o = 9 + -16. Let g = o + t. Which is bigger: g or -1/4? -1/4 Suppose 3a = -6 - 0. Let m be 3 + -6 + 0/a. Is 0.1 at most as big as m? False Let h(i) = 4i. Let v be h(1). Let m = v + -3. Let z = m - 2. Is z greater than 0? False Suppose 4g + 17 = -3q, 3q = 3g + 10 + 8. Let s be ((-3)/4)/(-2 + -1). Which is smaller: s or q? s Let m = 0.1 - 0.1. Suppose 4u + 20 - 76 = 0. Let g be (-4)/u + (-72)/(-105). Which is greater: g or m? g Let s be -3 + (4 + 1 - 0). Suppose h - 4h - c = 2, s = -5h - 3c. Which is greater: -0.1 or h? -0.1 Let u(h) = -h3 - 6h2 + h + 5. Let v(j) = j2 - 5j. Let w be v(3). Let g be u(w). Which is smaller: 0 or g? g Let l = -27452/2781 - -266/27. Which is bigger: l or 0? 0 Suppose 0 = -3s + 2 + 22. Let j = s - 3. Which is greater: j or 1/3? j Let x = 7 - 7. Let w = x + 2. Which is bigger: w or 2/3? w Suppose -3w - 90 = 18. Is -36 at least w? True Let a = -60/161 - -2/23. Is -3 bigger than a? False Suppose 3a - 28 = -4f - a, 0 = -f - 3a + 17. Which is bigger: 7 or f? 7 Let d(i) = -i*2 - i - 1. Let r be d(-1). Let q be (-1 + 4)/((-3)/(-2)). Let c be 0 + (2 - q/2). Is r < c? True Suppose -g - h + 1 + 1 = 0, 5h - 2 = -g. Are -2 and g nonequal? True Suppose -16 = 4w + 2u, 4w - 5u + 32 = 2w. Suppose -4d + d = -18. Let g be (18/(-8))/(d/16). Is g > w? False Suppose -u = -2u + 66. Suppose 0 = 4c - 3y - 0y + 74, -3c - 3y - u = 0. Which is greater: c or -21? c Suppose 5c - 15 + 0 = 0. Let j = c + -5. Let l be -2(1 - 2) + -3. Is j < l? True Let c be (-1)/4 + (-39)/(-12). Let j be (-11)/15 + c/9. Let v = -2.9 + 3. Is j <= v? True Let m = 30 - 29.53. Let a = m - 0.17. Is a != -2/5? True Let k = 39 - 68. Is -30 smaller than k? True Let p = -0.8 + 0.71. Is p >= -0.1? True Let x(m) = -m + 5. Le	{ "pile_set_name": "DM Mathematics" }
2 - 3p + 18. Calculate -3c(q) - 5n(q). q2 + q Let z(n) = 11n*3 - 15n*2 - 11. Let s(k) = -5k*3 + 8k*2 + 5. Give -7s(v) - 3z(v). 2v*3 - 11v2 - 2 Let a(v) be the second derivative of -v4/12 + v3/6 + v2/2 + v. Let g = 3 - 1. Let k(h) = 5h2 + 0h*2 - 6h - h*2 + gh*2 - 4. What is 4a(x) + k(x)? 2x2 - 2x Let j(k) = 32k + 34k - 65k. Let p(i) = -i + 1. What is 4j(q) + 3p(q)? q + 3 Let f(d) = -8d*3 + 9d*2 - 9d + 9. Let a(r) = -2r3 + 2r*2 - 2r + 2. Suppose 1 + 9 = 5h. Give hf(i) - 9a(i). 2i*3 Let p(h) = -136h. Let j(r) = -r. Give 85j(z) - p(z). 51z Let a(y) = 3y + 3. Let p(f) = -f - 1. Let o(x) = 8x + 7. Let m(s) = -o(s) + p(s). What is -11a(b) - 4m(b)? 3b - 1 Let k(d) = 8d - 10. Let z(j) = 9 + 20 - 23j + 18 - 18. Determine -17k(q) - 6z(q). 2q - 4 Let n(c) = 15c. Let m be (3 - -2) + -10 + 6. Let g(k) = -k. Give mn(a) + 20g(a). -5a Let a(p) = 4p - 1. Let c(t) = t - 9. Let j be c(7). Suppose 3h - 15 = -2h. Let g(x) = hx - x - x. Give jg(m) + a(m). 2m - 1 Let k(b) be the first derivative of b*2 - 1 + 0 + 0 - 3b. Let l(o) = -o + 2. Let c = -1 + 4. Give ck(f) + 4l(f). 2f - 1 Let m(i) = 2i3 - i2 + 5i. Let d(y) = -2y3 + y2 - 4y. Suppose 2 = 2a - 6, 2u = -3a + 16. What is um(j) + 3d(j)? -2j3 + j2 - 2j Let j(z) = -10z2 - 5z + 5. Let g(k) = 10k2 + 4k - 4. Determine -5g(b) - 4j(b). -10b2 Let n(p) = 3p*3 + 4p*2 + 5p - 1. Let z(x) = 3x3 + 3x*2 + 4x - 1. Determine 3n(s) - 4z(s). -3s3 - s + 1 Let u(q) = 5q - 8. Let y be u(6). Let l(s) = 2s. Let w(v) = -29v + 8. Let f(c) = -10c + 3. Let z(x) = 8f(x) - 3w(x). Determine yl(t) - 6z(t). 2t Let f(g) be the first derivative of -g*3/3 + 5g*2/2 - 3g + 1. Let a(u) be the first derivative of f(u). Let l(n) = -1 - 1 + 4n - 9. Give 13a(k) + 6l(k). -2k - 1 Let m(f) = -2f3 - 19f - 5. Let u(p) = p*3 + 18p + 4. What is 3m(n) + 4u(n)? -2n3 + 15n + 1 Let l(c) = -21c2 - 5c + 5. Let m(k) = 84k2 + 21k - 21. Determine 21l(r) + 5m(r). -21r2 Let p(j) = 4j. Let l = 64 - 63. Let b(z) = -z. Determine lb(r) + p(r). 3r Let h(v) = v*2 + 4v + 4. Suppose -z - 4 + 3 = 0. Let o(s) = s*2 + 5s. Let r be o(-5). Let k(a) = 1 + 0a + r + a. Determine zh(x) + 5k(x). -x2 + x + 1 Let x(i) = 3i + 3. Let u(g) = -2g - 2. Let s(v) = 2v*2 - 8v - 6. Let f be s(5). What is fu(l) + 3x(l)? l + 1 Let w(y) = -4y3 - 5y*2 + 3. Let t(q) = -10q*3 - 6q2 - 1. Let k(b) = -b3 - 1. Let d(u) = 5k(u) - t(u). Let g = -2 + -4. Calculate gw(n) - 5d(n). -n3 + 2 Suppose 5y - 45 = 5. Let m be (0 + -1)/(2/y). Let i(t) = t + 1. Let q(l) be the third derivative of l4/12 + l3/6 + l*2. What is mi(d) + 3q(d)? d - 2 Let i(s) = -2s*2 + 4s + 2. Let l(k) = -2k2 + 5k + 2. Give 4i(j) - 3l(j). -2j2 + j + 2 Let j(y) = 68y. Let v(i) = 476i. Calculate 34j(u) - 5v(u). -68u Let h(c) = 114c3 + 104c*3 - 7 - 3c*2 - 224c*3. Let j(l) = 5l*3 + 2l*2 + 6. Determine -6h(r) - 7j(r). r3 + 4r*2 Let s(q) = -2q*2 + 6q + 3. Let p(g) = -6g2 + 17g + 8. Let l = 29 - 33. Give lp(r) + 11s(r). 2r2 - 2r + 1 Let f(b) = 2b3 + b2 + b + 3. Let i(z) = z3 + z + 1. Give -2f(m) + 6i(m). 2m*3 - 2m*2 + 4m Let y(o) = -2o2 - 15. Let p(h) = -2h*2 - 16. Give -4p(q) + 5y(q). -2q*2 - 11 Let p(l) = -5l*2 + 6l - 4. Let c = -1 - 0. Let s(u) = -u + 2 + 3 - 4 + u*2. What is cp(k) - 6s(k)? -k2 - 2 Let w(p) = 7p*2 + 6p. Suppose -3z = -z - 4. Let j(h) = -h - 6h*z - 3h*2 + 3h*2 - 4h. Give 5j(g) + 4w(g). -2g2 - g Let t(v) = -7v - 4. Let c(s) = -2 - 6s + s + s. Let a(g) = g3 + 4g*2 - 7g - 5. Let q be a(-5). Determine qc(r) - 3t(r). r + 2 Let d(k) = -k - 118 + 118. Let g(f) = -6f. What is 5d(j) - g(j)? j Let a be (-9)/(-6) + (-5)/(-10). Let o be 4/(-1) - (1 - 2). Let v(r) = -2r2 + 2r + 1. Let n(l) = -2l2 + 3l + 2. Determine an(f) + ov(f). 2f2 + 1 Let x(q) be the first derivative of 8q3/3 - q2/2 + 5q - 208. Let b(s) = -s + 1. Let c(i) = 7i*2 + 3. Let z(t) = b(t) + c(t). Determine -5x(u) + 6z(u). 2u*2 - u - 1 Let z(p) be the first derivative of 19p*2/2 - 13p - 3. Let c(r) = -3r + 2. Determine -39c(a) - 6z(a). 3a Let s(b) = b + 1. Let a(o) = 2o2 + 4o + 3. Calculate a(p) - 4s(p). 2p*2 - 1 Let h(s) = 2s + 4. Let r = 21 - 24. Let b(o) = -1. Determine rb(t) - h(t). -2t - 1 Let c(n) = -4n3 + n2 - 5n + 1. Let p(u) = u - 1. Let k(g) = -c(g) - 5p(g). Let r(t) = 13t*3 - 3t*2 + 13. What is 7k(j) - 2r(j)? 2j3 - j2 + 2 Let l(u) = -3u2 - 15u - 7. Let k(n) = 2n2 + 10n + 5. Determine -7k(p) - 5l(p). p*2 + 5p Let v(j) = 2j3 + 7j + 6. Let b(y) = -2y3 - 6y - 5. Let d = 53 + -57. What is dv(q) - 5b(q)? 2q3 + 2q + 1 Let j(n) = 16n. Let t(k) = 4k - 1. Let c be t(7). Suppose cw - 24w = 30. Let a(i) = 5i. Give wa(x) - 3j(x). 2x Let u(a) = 3a2 - 2a. Let p(x) = 7x2 - 3x - 1. Calculate 2p(k) - 5u(k). -k*2 + 4k - 2 Let x(k) = 2k3 + 2k*2 + 2k. Let o(f) be the third derivative of 1/6f4 + 0f*3 + 1/24f*6 - 3f*2 + 0 + 1/12f*5 + 0f. Determine 3o(u) - 7x(u). u3 + u2 - 2u Suppose 4i = -3s - 7, 2i - 6i = 4s + 4. Let t(y) = -6y2 - y + 1. Let l(c) = 5c*2 + c - 1. Calculate st(g) + 4l(g). 2g2 + g - 1 Let z(k) = -k2 - k + 4. Let g(r) = 0r + 3r - r*2 + 7 - 5r. Give 4g(s) - 7z(s). 3s2 - s Let d(b) be the second derivative of -1/6b*3 - 1/12b*4 + 0 + 1/2b*2 + 2b. Let q(w) = 3w2 + 4w - 4. Suppose -7 - 1 = -2h. Calculate hd(f) + q(f). -f*2 Let t(f) = 1. Let b(i) = -28i*2 - 84. Determine -b(m) - 84t(m). 28m2 Let a(u) = 4u*2 - 5u + 1. Let w be -8 - -7 - 26/(-1). Suppose 2f = -p - 13, -f + 5p = -3f - w. Let z(g) = 5g*2 - 6g + 1. Give fz(j) + 6a(j). -j*2 + 1 Let m(t) = 3 + 3t + 5t3 + 0t - 3t. Let f(n) = n3 + 1. Let o(b) = 4f(b) - m(b). Let d(v) = -v*2 - 2v - 2. Calculate d(w) + 2o(w). -2w3 - w2 - 2w Let x(i) = -6i*2 + 4i + 1. Let u(m) = -17m2 + 11m + 3. Give -4u(g) + 11x(g). 2g2 - 1 Let q(h) = 6h*3 - 4h*2 + 3h. Suppose 4i - i = 21. Let v(u) be the third derivative of -u6/30 + u5/20 - u4/12 - u2. Calculate iv(a) + 5q(a). 2a3 + a2 + a Let z = 20 - 7. Let u(p) = -8p + 7. Let o(k) be the second derivative of 17k*3/6 - 15k*2/2 - k. Calculate zu(a) + 6o(a). -2a + 1 Let q be (-2)/5 + (-8)/5. Let u(j) be the second derivative of j*3/6 + j. Let s(d) = d + 2. Let m(l) = l + 5. Let h be m(-4). Determine hs(y) + qu(y). -y + 2 Let r(g) be the second derivative of g3 + 2g*2 - 9g. Let o(a) = -7a - 1. Let t(h) = 21h + 4. Let i(m) = 11o(m) + 4t(m). Give -4i(d) + 5r(d). 2d Let g(t) = -t3 - t2 + t + 1. Let f(y) be the third derivative of -y6/120 + y5/10 - y4/4 - y3 + 47y*2. Calculate -f(i) - 6g(i). 7i3 Let c = 25 + -18. Let j(p) = -5p + 1. Let d(w) = 3w - 1. Give cd(u) + 4j(u). u - 3 Let w(v) be the first derivative of -v2/2 + 6v + 2. Let p(z) = 1. Let l = 2 - 4. Let c = l - -7. Give cp(g) - w(g). g - 1 Let o(w) = -3w + 4. Let f(y) = 49y - 63. Calculate 4f(z) + 63o(z). 7z Suppose -l = -0l + 4. Let m = -2 - -7. Let b(u) = -4u*2 + 5u - 5. Let v(z) = -3z2 + 4z - 4. Calculate lb(y) + mv(y). y*2 Let v(s) be the first derivative of -3s*2/2 - 3s + 4. Let x(l) = -7l - 7. Give 9v(b) - 4x(b). b + 1 Let c(y) = 9y + 7. Let a(i) = -4i - 3. Give -7a(b) - 3c(b). b Let h(g) = -5g - 1. Suppose t = -4t - 10. Let q(a) = -2a + 1. Let v(o) = -3o + 3. Let s(d) = tv(d) + 5q(d). Give 2h(l) - 3s(l). 2l + 1 Let p(h) = -4h + 4. Let g(l) be the second derivative of l3/6 - l2/2 - 31l. What is 9g(i) + 2p(i)? i - 1 Let y(b) = 5b2 + 3b + 3. Let k(z) = -6z2 - 4z - 4. Let m = 4 - 6. Let v be 10/3 - m/(-6). Give vk(p) + 4y(p). 2p2 Let u(w) = w3 - 9w*2 + 7w + 10. Let a be u(8). Let j be -12a(-2)/8. Let r(l) = -3l. Let b(n) = -16n. Calculate jb(v) - 33r(v). 3v Let q(b) = -2b*3 - 6b*2 - 4b + 1. Let x(v) = 1 + 6v - 9v - 5v2 - 5v*3 + 3v*3. Calculate 5q(k) - 6x(k). 2k*3 - 2k - 1 Suppose -4q = -p - 28, 2p + p + 12 = 0. Let m be ((-8)/5)/(2/(-5)). Let j(h) = -2h - m	{ "pile_set_name": "DM Mathematics" }
nearest integer? 28 What is 78275 to the power of 1/6, to the nearest integer? 7 What is the fifth root of 49536 to the nearest integer? 9 What is the third root of 438 to the nearest integer? 8 What is 140100 to the power of 1/7, to the nearest integer? 5 What is the square root of 1321 to the nearest integer? 36 What is the ninth root of 69270 to the nearest integer? 3 What is 89179 to the power of 1/2, to the nearest integer? 299 What is the fifth root of 3778 to the nearest integer? 5 What is 27946 to the power of 1/3, to the nearest integer? 30 What is the fourth root of 6557 to the nearest integer? 9 What is the square root of 851 to the nearest integer? 29 What is 74666 to the power of 1/2, to the nearest integer? 273 What is 6280 to the power of 1/3, to the nearest integer? 18 What is the cube root of 27444 to the nearest integer? 30 What is 8638 to the power of 1/2, to the nearest integer? 93 What is the square root of 125197 to the nearest integer? 354 What is 3047 to the power of 1/4, to the nearest integer? 7 What is the square root of 9744 to the nearest integer? 99 What is 13594 to the power of 1/4, to the nearest integer? 11 What is 72105 to the power of 1/2, to the nearest integer? 269 What is the cube root of 2413 to the nearest integer? 13 What is the square root of 1531 to the nearest integer? 39 What is the ninth root of 64462 to the nearest integer? 3 What is 129633 to the power of 1/3, to the nearest integer? 51 What is 165983 to the power of 1/2, to the nearest integer? 407 What is 24689 to the power of 1/2, to the nearest integer? 157 What is 26045 to the power of 1/4, to the nearest integer? 13 What is 2977 to the power of 1/3, to the nearest integer? 14 What is 7902 to the power of 1/3, to the nearest integer? 20 What is the square root of 542 to the nearest integer? 23 What is 25563 to the power of 1/4, to the nearest integer? 13 What is the cube root of 26839 to the nearest integer? 30 What is 1510 to the power of 1/2, to the nearest integer? 39 What is 147202 to the power of 1/8, to the nearest integer? 4 What is 293 to the power of 1/10, to the nearest integer? 2 What is 52780 to the power of 1/10, to the nearest integer? 3 What is 56621 to the power of 1/5, to the nearest integer? 9 What is 1693 to the power of 1/6, to the nearest integer? 3 What is the ninth root of 6023 to the nearest integer? 3 What is the cube root of 1492 to the nearest integer? 11 What is the square root of 7486 to the nearest integer? 87 What is 53432 to the power of 1/7, to the nearest integer? 5 What is 15519 to the power of 1/2, to the nearest integer? 125 What is the cube root of 33102 to the nearest integer? 32 What is the tenth root of 3011 to the nearest integer? 2 What is 5755 to the power of 1/8, to the nearest integer? 3 What is the square root of 105499 to the nearest integer? 325 What is the square root of 8004 to the nearest integer? 89 What is the third root of 21324 to the nearest integer? 28 What is the cube root of 5903 to the nearest integer? 18 What is the ninth root of 5400 to the nearest integer? 3 What is the third root of 801 to the nearest integer? 9 What is the fifth root of 31093 to the nearest integer? 8 What is the seventh root of 827 to the nearest integer? 3 What is the seventh root of 1933 to the nearest integer? 3 What is the square root of 91497 to the nearest integer? 302 What is the third root of 5483 to the nearest integer? 18 What is 670 to the power of 1/4, to the nearest integer? 5 What is the seventh root of 30 to the nearest integer? 2 What is the fifth root of 170241 to the nearest integer? 11 What is 3529 to the power of 1/2, to the nearest integer? 59 What is the square root of 1796 to the nearest integer? 42 What is the square root of 817 to the nearest integer? 29 What is 15745 to the power of 1/2, to the nearest integer? 125 What is 37526 to the power of 1/6, to the nearest integer? 6 What is 18739 to the power of 1/10, to the nearest integer? 3 What is the seventh root of 24540 to the nearest integer? 4 What is 624 to the power of 1/6, to the nearest integer? 3 What is 4494 to the power of 1/2, to the nearest integer? 67 What is the ninth root of 1487 to the nearest integer? 2 What is the square root of 2439 to the nearest integer? 49 What is the tenth root of 7809 to the nearest integer? 2 What is the square root of 65694 to the nearest integer? 256 What is the square root of 210 to the nearest integer? 14 What is 7766 to the power of 1/2, to the nearest integer? 88 What is the cube root of 4534 to the nearest integer? 17 What is 103697 to the power of 1/2, to the nearest integer? 322 What is 663 to the power of 1/10, to the nearest integer? 2 What is the square root of 417 to the nearest integer? 20 What is the square root of 5851 to the nearest integer? 76 What is 32981 to the power of 1/10, to the nearest integer? 3 What is the square root of 1449 to the nearest integer? 38 What is the square root of 9565 to the nearest integer? 98 What is 39899 to the power of 1/10, to the nearest integer? 3 What is the eighth root of 53574 to the nearest integer? 4 What is the square root of 19289 to the nearest integer? 139 What is the square root of 3340 to the nearest integer? 58 What is 30464 to the power of 1/7, to the nearest integer? 4 What is the third root of 1271 to the nearest integer? 11 What is the square root of 708 to the nearest integer? 27 What is the sixth root of 1265 to the nearest integer? 3 What is 12631 to the power of 1/3, to the nearest integer? 23 What is the square root of 5287 to the nearest integer? 73 What is the cube root of 867 to the nearest integer? 10 What is 7516 to the power of 1/8, to the nearest integer? 3 What is the cube root of 9180 to the nearest integer? 21 What is the third root of 13809 to the nearest integer? 24 What is the cube root of 658 to the nearest integer? 9 What is the seventh root of 4733 to the nearest integer? 3 What is 4325 to the power of 1/8, to the nearest integer? 3 What is 13166 to the power of 1/2, to the nearest integer? 115 What is 1766 to the power of 1/10, to the nearest integer? 2 What is 1176 to the power of 1/5, to the nearest integer? 4 What is the seventh root of 42545 to the nearest integer? 5 What is the cube root of 23485 to the nearest integer? 29 What is the third root of 474 to the nearest integer? 8 What is the third root of 1031 to the nearest integer? 10 What is 61727 to the power of 1/6, to the nearest integer? 6 What is the seventh root of 17026 to the nearest integer? 4 What is the third root of 3630 to the nearest integer? 15 What is the square root of 2803 to the nearest integer? 53 What is the ninth root of 2466 to the nearest integer? 2 What is the tenth root of 45147 to the nearest integer? 3 What is 8327 to the power of 1/3, to the nearest integer? 20 What is the tenth root of 8026 to the nearest integer? 2 What is 497 to the power of 1/2, to the nearest integer? 22 What is the fourth root of 148033 to the nearest integer? 20 What is the fifth root of 4181 to the nearest integer? 5 What is the cube root of 32919 to the nearest integer? 32 What is the third root of 127734 to the nearest integer? 50 What is 7710 to the power of 1/6, to the nearest integer? 4 What is the square root of 7279 to the nearest integer? 85 What is the square root of 2224 to the nearest integer? 47 What is the square root of 1319 to the nearest integer? 36 What is the eighth root of 61750 to the nearest integer? 4 What is the cube root of 2976 to the nearest integer? 14 What is 74281 to the power of 1/9, to the nearest integer? 3 What is the tenth root of 6955 to the nearest integer? 2 What is the fifth root of 6568 to the nearest integer? 6 What is 807 to the power of 1/2, to the nearest integer? 28 What is the fourth root of 5388 to the nearest integer? 9 What is the square root of 264 to the nearest integer? 16 What is the square root of 40757 to the nearest integer? 202 What is 417 to the power of 1/3, to the nearest integer? 7 What is 250 to the power of 1/6, to the nearest integer? 3 What is 778 to the power of 1/4, to the nearest integer? 5 What is the cube root of 48302 to the nearest integer? 36 What is 92296 to the power of	{ "pile_set_name": "DM Mathematics" }
-l*2. Calculate t(f(c)). -1168c*2 Let j(c) = -2c*2. Suppose 0 = p - 5x - 14, -4x = 4p + x - 6. Let i(y) = py2 - 29y*2 + 8y*2. What is i(j(b))? -68b*4 Let b(y) = -82y*2. Let c(g) = 619g - 308g - 311g + g*2. Determine c(b(m)). 6724m*4 Let p(k) = 8995k*2. Let n(u) = -6u*2 - 4. Determine n(p(l)). -485460150l4 - 4 Let h(m) = m3 + 29m2 + 53m - 4. Let l be h(-27). Let t(n) = -20n - ln + 45n. Let p(k) = -41k*2. Determine p(t(c)). -164c*2 Let h = 0 + 2. Let c(j) = 10j + 2 - h. Let i(o) = -5o2 + 6. Let t(v) = -9v*2 + 11. Let w(u) = 11i(u) - 6t(u). What is c(w(q))? -10q*2 Let j be (9 - 0) + 3 + 2 + -8. Let y(x) = -7 + 7 - jx*2. Let t(l) = -4l. Calculate t(y(u)). 24u2 Let s(a) = -a2 - a + 2. Let g(d) = 8d*2 + 6d - 12. Let u(v) = -g(v) - 6s(v). Let z(j) = -24j + 1. What is u(z(n))? -1152n2 + 96n - 2 Let v(t) be the second derivative of t*3/6 - t. Let w(u) = 241u*2 - 645u*2 + 227u*2 + 224u*2. Determine v(w(r)). 47r*2 Let o(m) = 20m*2. Let v(p) = -230p*2 - 231p*2 - 248p*2 + 726p*2. Determine v(o(b)). 6800b*4 Let f(h) = 526h2. Let i(m) be the third derivative of m4/12 - m*2 + 46m. What is i(f(k))? 1052k2 Let a(i) = 4i. Let k(m) = m + 1. Let n be (9/(-6))/(1/(-2)). Suppose 5v - n = 2. Let j(f) = 5f + 6. Let d(g) = vj(g) - 6k(g). Determine d(a(x)). -4x Let o(h) = -11h*2. Let v(u) = -2u - 3. Let q(z) = z + 4. Let d(m) = -3q(m) - 4v(m). What is o(d(y))? -275y2 Let r(h) = 6464h*2 - 15h. Let t(v) = 19v. Calculate t(r(x)). 122816x*2 - 285x Let i(u) = -13u2. Let g(z) = -2. Let w(y) = y2 + 11. Let t(s) = 12s*2 + 3s + 2. Let o be t(-1). Let f(j) = og(j) + 2w(j). What is f(i(x))? 338x4 Let t be (9 + 1)(3/(-5) - -1). Let v(i) = -239 - ti - 3i + 239. Let b(k) be the third derivative of -k5/30 - k2. Calculate b(v(m)). -98m2 Suppose -4b + 2733 = -3179. Let o(k) = 3k - 1478 + b. Let v(y) = 22y. Give o(v(a)). 66a Let y(l) = 4l. Let u = -201/4 - -101/2. Let o(k) be the second derivative of 0k2 + 0 + 6k + 0k3 + uk*4. Calculate y(o(f)). 12f*2 Let q(a) = -2a. Let i(w) be the first derivative of -w*5/15 - 53w*2/2 - 54. Let t(f) be the second derivative of i(f). Determine q(t(r)). 8r2 Let t(d) = 353 - 353 + d. Let y be (-1)/(-4) - (-25)/(-4). Let z(p) = p2 + 6p. Let w(k) = yt(k) + z(k). Let g(j) = 6j. Calculate w(g(b)). 36b*2 Let f(t) = 94t*2. Let z(i) = 121i + 119i - 239i. Determine z(f(w)). 94w2 Let t(c) be the second derivative of c4/4 + 33c. Let f(m) = 19m2. What is f(t(i))? 171i*4 Let t(s) = s. Let a(r) = 171r*2 - 22r. Calculate a(t(n)). 171n2 - 22n Let g(i) = 14i2. Let k(t) be the third derivative of -3t*4/8 + 150t*2. Give g(k(y)). 1134y*2 Let t be (-31/(-2))/((-3)/(-2)). Let r(o) = -o2. Let j(n) = n2. Let q(g) = tr(g) - 6j(g). Let c(h) = 3h2. Calculate q(c(m)). -63m*4 Suppose 0 = -3k - 0k + 6. Let d(v) = -2v*2 + 0v*2 + 2vk + v2. Let l(f) be the second derivative of f*4/12 + 29f. What is d(l(p))? p*4 Let n(u) be the third derivative of 0 + 5/24u*4 + 0u*3 - 7u + 3u2. Let r(m) = 5m*2 + 0m*2 + 0m*2. Determine r(n(o)). 125o*2 Let m(v) = -6v*2. Let h(x) be the third derivative of 13x*5/12 - 3x*2 - 90. Calculate h(m(c)). 2340c*4 Let k(d) = 56d. Let p(h) = -38h. Calculate p(k(a)). -2128a Suppose 0 = 3h - 2h - 1. Let v(d) = 3d3 - d2 + d - 1. Let b be v(h). Let k(y) = y2 + 0y*b - 2y*2. Let x(o) = 9o. Give k(x(z)). -81z2 Let l(c) = -2c. Let o(f) = f + 2f + 28f*2 - 25f*2. Calculate l(o(v)). -6v*2 - 6v Let j(m) = 2m2. Let t(a) = -1934783a. Calculate j(t(d)). 7486770514178d2 Let h(y) be the third derivative of -y5/60 - y2. Let d = -29 - -211. Let u(z) = z2 + 182z + 0z2 - dz. Determine u(h(k)). k*4 Let b(v) = -2v + 1. Let n(j) = -85j + 30. Let m(u) = 30b(u) - n(u). Let w(k) = 15k. What is w(m(f))? 375f Let l(k) = 2k2. Let m(p) = p2 + 6p + 23. Let z be m(-17). Let y(h) = 210h - h2 - zh. Calculate l(y(x)). 2x4 Let p(t) = 7t. Let b be -11 + 3 + (4 - -4). Let f(s) be the first derivative of -6 + bs2 - 1/3s*3 + 0s. Calculate f(p(o)). -49o2 Let i(u) = -6u*2 + 28u + 7. Let z(n) = -5n2 + 24n + 6. Let o(f) = -6i(f) + 7z(f). Let p(g) = g*2 - 31g. Calculate p(o(j)). j*4 - 31j*2 Let r(z) = -z - 62 + 62. Let b(y) be the first derivative of -3y*2 + 285. What is b(r(w))? 6w Let j(p) be the second derivative of 5p4/12 - p - 27. Let a(v) = 38v. Calculate j(a(l)). 7220l2 Let z be 6/((-42)/91)(-2 - -1). Let o(d) = -8d2 - 5d*2 - zd*2. Let i(g) = -2g + 0 + 0. Calculate o(i(w)). -104w2 Let z(s) = -8s + 519s - 310 + 310. Let f(j) = j. Determine z(f(r)). 511r Let c(b) = -6569b2 - 2. Let x(s) = 3s*2. What is c(x(y))? -59121y*4 - 2 Let m(z) = -9z. Let j(l) = -12308l. Determine j(m(w)). 110772w Suppose 5l = -5y + 20, -10l = -5l + 4y - 16. Let b(u) be the second derivative of lu*2 + 0u*3 - 1/2u*4 - u + 0. Let f(a) = -2a. Give f(b(t)). 12t2 Let z be 20/(-8)-1 + 1/2. Let u(w) = -5w2 - 7w*2 + 4w*2 + zw2. Let j(h) be the second derivative of h4/6 - 2h. Determine u(j(l)). -20l*4 Let n(j) = -46j. Let a(f) be the second derivative of -f*4/12 - 125f. Give n(a(h)). 46h2 Let j(i) be the third derivative of -37i*5/60 + 2i*2 + 4i. Let g(m) = -6m. What is j(g(o))? -1332o*2 Suppose 0 = -4z + 48. Let w(i) = -6i - 8i + zi. Let d(n) = -4n. Give w(d(r)). 8r Let x(v) = 45v - 10v - 14v - 5v - 17v. Let n(u) = 497u. What is x(n(j))? -497j Let k(r) = 1096r2 - 2201r*2 + 1101r*2. Let h(a) be the first derivative of 4a*3/3 + 1. Give k(h(w)). -64w*4 Let y(x) = 7x - 1. Let h(g) be the third derivative of -g*5/60 - 2g*2. Determine y(h(d)). -7d*2 - 1 Let t(v) = -54v*2 + 57v*2 + 55v - 172v. Let x(a) = a2. What is x(t(q))? 9q*4 - 702q*3 + 13689q2 Let h(n) be the second derivative of n3/6 + 283n. Let d(x) = -5x + 11. Calculate d(h(s)). -5s + 11 Suppose -7g + 17 - 3 = 0. Let i(l) = 15l - 11. Let u(n) = 3n - 2. Let c be 2/(-8) + (-43)/4. Let d(a) = cu(a) + gi(a). Let v(s) = s. Determine d(v(q)). -3q Let g(l) = 13l + 6. Let s(d) = -2d - 1. Let o(c) = -g(c) - 6s(c). Let n(b) = -8b + 8b - b2. Calculate n(o(r)). -r2 Let z(j) = 3j. Let n(h) = -h. Let k be n(-3). Let w(p) = -p3 + 5p*2 - 14. Let o be w(4). Let l(y) = -y + oy + y - ky. What is z(l(c))? -3c Let f(v) = 2v. Let g(r) be the first derivative of 12r*2 + 4r - 93. Give f(g(t)). 48t + 8 Let s(r) be the first derivative of r2/2 - 11r + 2. Let t be s(13). Let p(c) = 2c2 - 4c*2 - t + 2. Let y(l) = 5l*2. Give p(y(f)). -50f*4 Let l(f) = -12f*2. Suppose -4j = -9j + 15. Let z(w) = -jw*2 + 1063w - 1063w. What is z(l(t))? -432t*4 Let f(q) = -4q*2. Let v(o) be the second derivative of 6o + 0 + 0o2 - 5/6o*3. Determine v(f(g)). 20g*2 Let u(q) = 2q*2 - q - 1647. Let y(p) = 4p. What is y(u(t))? 8t2 - 4t - 6588 Let a(k) = -9k. Let o(p) = 0p + 64p2 + 0p + 21 + 58p2 - 125p*2. Give o(a(w)). -243w*2 + 21 Let c(d) = 4d*2. Let i(t) = 7t*2 - 2. Let k(z) be the second derivative of -11z*4/6 + 7z*2/2 - 3z. Let a(x) = -7i(x) - 2k(x). What is c(a(l))? 100l4 Let z(m) be the first derivative of -1/12m*4 + 0m*3 + 3 + 5/2m*2 + 0m. Let b(j) be the second derivative of z(j). Let o(d) = -2d. Give o(b(t)). 4t Let j(v) = 9v. Let r(k) = -52872k. Give j(r(y)). -475848y Let n(h) = -3h*2. Let m = -11 + 13. Let y(p) = -18p*m + 3p + 0p - 3p. Determine y(n(v)). -162v4 Let x(h) be the third derivative of -h5/3 + h2. Let u(n) be the second derivative of n4/6 + 2n - 6. Give x(u(k)). -80k4 Let l(d) = 30d2 - 5. Let h(p) = -p2 - 1. Let s(c) = -5h(c) + l(c). Let f(w) = 6w. Give f(s(v)). 210v2 Let a(p) = -3p*2. Let b(r) = r - 6709. Give a(b(j)). -3j*2 + 40254j - 135032043 Let d(j) = j*2 + 176j. Let u(y) = y*2 + 1414y - 1414y. Calculate u(d(t)). t4 + 352t*3 + 30976t*2 Let y(b) = -4 + 4 + 2b. Let m(j) be the second derivative of 0 + 5/6j3 + 0j*2 + 9j. What is m(y(d))? 10d Let k(c) = 4c*2. Let n(a) = -6a**2. Let x(q	{ "pile_set_name": "DM Mathematics" }
multiple of 4? True Is 71 a multiple of 18? False Is 31374 a multiple of 27? True Is 46332 a multiple of 52? True Is 19 a factor of 389? False Is 12 a factor of 14688? True Does 61 divide 35136? True Is 59826 a multiple of 46? False Is 75 a factor of 85350? True Is 3 a factor of 600? True Is 5852 a multiple of 13? False Is 353 a factor of 17297? True Does 17 divide 9988? False Is 17 a factor of 358? False Is 57400 a multiple of 41? True Is 46 a factor of 690? True Is 86 a factor of 7220? False Does 6 divide 504? True Is 72 a factor of 1146? False Is 10 a factor of 10? True Is 5 a factor of 382? False Is 740 a multiple of 17? False Is 8798 a multiple of 14? False Is 13 a factor of 895? False Does 19 divide 12094? False Is 798 a multiple of 19? True Does 13 divide 44460? True Is 20 a factor of 1680? True Is 40 a factor of 6906? False Is 2687 a multiple of 109? False Is 3124 a multiple of 77? False Is 111 a factor of 72906? False Does 15 divide 600? True Is 11268 a multiple of 4? True Does 54 divide 13824? True Is 42 a factor of 2856? True Is 5 a factor of 760? True Is 12 a factor of 3288? True Is 71 a factor of 1207? True Is 19 a factor of 703? True Does 30 divide 2790? True Does 27 divide 54? True Is 858 a multiple of 26? True Does 10 divide 230? True Is 19 a factor of 156? False Does 11 divide 2772? True Is 26 a factor of 48941? False Is 28 a factor of 2072? True Is 10 a factor of 38980? True Does 7 divide 406? True Is 57 a factor of 969? True Is 12 a factor of 1838? False Is 681 a multiple of 16? False Is 5672 a multiple of 8? True Is 135 a multiple of 5? True Does 8 divide 1440? True Is 2208 a multiple of 23? True Is 1274 a multiple of 10? False Is 2412 a multiple of 69? False Is 7 a factor of 2807? True Is 1893 a multiple of 70? False Is 6 a factor of 3610? False Does 4 divide 452? True Is 5 a factor of 6380? True Is 15 a factor of 15590? False Does 14 divide 11634? True Is 373 a multiple of 24? False Does 35 divide 46810? False Is 79 a factor of 6940? False Is 212 a factor of 20988? True Is 63 a factor of 74284? False Is 1077 a multiple of 51? False Does 29 divide 511? False Is 57 a factor of 4275? True Is 26 a factor of 3247? False Is 1293 a multiple of 30? False Does 37 divide 900? False Is 16 a factor of 1536? True Does 15 divide 450? True Is 36 a factor of 252? True Does 125 divide 5125? True Does 19 divide 263? False Does 4 divide 461? False Is 2520 a multiple of 6? True Is 4 a factor of 240? True Is 9605 a multiple of 14? False Is 44 a factor of 2643? False Is 21 a factor of 54956? False Does 6 divide 1991? False Is 81 a multiple of 9? True Is 200 a multiple of 4? True Is 3790 a multiple of 102? False Does 27 divide 11880? True Does 37 divide 7257? False Is 2659 a multiple of 2? False Is 26 a factor of 431? False Is 13 a factor of 36478? True Is 13305 a multiple of 26? False Is 19 a factor of 1159? True Does 23 divide 897? True Does 35 divide 26813? False Is 5 a factor of 725? True Is 51 a factor of 6894? False Does 2 divide 833? False Is 6402 a multiple of 35? False Is 44 a factor of 848? False Does 12 divide 1702? False Is 12 a factor of 183? False Is 115 a multiple of 23? True Is 48 a factor of 864? True Is 20 a factor of 981? False Does 171 divide 60338? False Is 3240 a multiple of 40? True Is 25 a factor of 50911? False Is 10 a factor of 1360? True Is 59 a factor of 1947? True Does 8 divide 296? True Is 1653 a multiple of 29? True Is 500 a multiple of 50? True Is 26864 a multiple of 184? True Is 7471 a multiple of 8? False Is 4865 a multiple of 7? True Is 10000 a multiple of 32? False Is 19 a factor of 17290? True Is 7 a factor of 2107? True Does 10 divide 1971? False Does 261 divide 12006? True Is 89 a factor of 21805? True Does 8 divide 417? False Does 15 divide 13717? False Does 48 divide 816? True Is 77 a factor of 28796? False Does 255 divide 20910? True Does 11 divide 641? False Is 17319 a multiple of 9? False Is 441 a multiple of 49? True Is 23 a factor of 3933? True Does 37 divide 638? False Does 52 divide 34667? False Is 39 a factor of 1092? True Is 126022 a multiple of 21? False Is 58 a factor of 4176? True Is 18 a factor of 5002? False Does 2 divide 1776? True Does 12 divide 4368? True Does 15 divide 1566? False Is 29 a factor of 4640? True Is 1820 a multiple of 5? True Does 2 divide 240? True Is 463 a multiple of 31? False Is 12888 a multiple of 8? True Is 1105 a multiple of 10? False Is 20 a factor of 39300? True Is 78 a multiple of 13? True Is 9 a factor of 417? False Is 5 a factor of 850? True Is 3582 a multiple of 22? False Is 94 a factor of 6764? False Is 23696 a multiple of 80? False Is 1359 a multiple of 2? False Is 101 a factor of 138106? False Does 4 divide 91? False Is 15 a factor of 597? False Is 176 even? True Is 27759 a multiple of 8? False Does 4 divide 140? True Is 17 a factor of 389? False Is 906 a multiple of 8? False Does 14 divide 3963? False Is 23 a factor of 460? True Is 180 a multiple of 45? True Is 200 a factor of 5000? True Is 4641 a multiple of 11? False Is 504 a multiple of 24? True Is 96 a multiple of 16? True Does 4 divide 13887? False Is 28 a factor of 7000? True Is 456 a multiple of 45? False Is 7 a factor of 93? False Is 7 a factor of 1057? True Does 18 divide 39924? True Does 7 divide 15950? False Is 24 a factor of 12704? False Is 41 a factor of 10209? True Is 8778 a multiple of 266? True Is 12 a factor of 4137? False Is 6 a factor of 1181? False Does 122 divide 3416? True Is 15 a factor of 849? False Does 26 divide 572? True Is 51 a factor of 1953? False Does 24 divide 41184? True Is 31 a factor of 9322? False Does 13 divide 4270? False Is 451 a multiple of 17? False Is 41052 a multiple of 22? True Is 83074 a multiple of 102? False Does 218 divide 13516? True Does 22 divide 4946? False Is 4806 a multiple of 54? True Is 12 a factor of 326? False Is 30850 a multiple of 7? False Is 8712 a multiple of 9? True Does 12 divide 9063? False Does 11 divide 2452? False Is 12 a multiple of 12? True Does 154 divide 3080? True Does 19 divide 570? True Does 22 divide 15972? True Does 5 divide 666? False Is 28268 a multiple of 37? True Does 11 divide 22946? True Is 5114 a multiple of 8? False Is 5 a factor of 153? False Is 10938 a multiple of 12? False Is 84 a factor of 2856? True Does 89 divide 18475? False Is 7 a factor of 41219? False Is 2700 a multiple of 15? True Does 14 divide 12040? True Does 10 divide 10230? True Does 47 divide 7943? True Does 89 divide 22827? False Does 4 divide 179? False Is 19872 a multiple of 27? True Is 42 a factor of 354? False Is 1576 a multiple of 8? True Is 4 a factor of 248? True Does 85 divide 2465? True Is 14 a factor of 1708? True Is 7 a factor of 10229? False Is 2 a factor of 612? True Is 27 a factor of 1944? True Does 7 divide 48? False Is 5632 even? True Is 16280 a multiple of 110? True Is 528 a multiple of 11? True Is 7144 a multiple of 15? False Is 18 a factor of 6282? True Is 234 a factor of 19656? True Is 13 a factor of 117? True Is 4784 a multiple of 23? True Does 9 divide 666? True Is 12 a factor of 22? False Does 339 divide 7062? False Does 78 divide 1866? False Is 3366 a multiple of 51? True Is 46726 a multiple of 71? False Does 64 divide 5760? True Is 57 a factor of 36993? True Is 12 a factor of 2256? True Is 400 a multiple of 50? True Is 73 a factor of 1314? True Is 30 a factor of 7710? True Is 6322 a multiple of 113? False Does 30 divide 1789? False Does 13 divide 642? False Does 25 divide 456? False Is 521 a multiple of 3? False Is 11 a factor of 781? True Does 40 divide 303? False Is 840 a multiple of 14? True Is 60276 a multiple of 12? True Is 5215 even? False Is 69974 a multiple of 59? True Does 4 divide 1847? False Does 29 divide 667? True Is 107 a multiple of 3? False Does 8 divide 560? True Does 14 divide 55790? True Does 71 divide 6003? False Is 26 a factor of 598? True Is 11 a factor of 11815? False Is 1575 a multiple of 26? False Is 58 a factor of 3243? False Does 12 divide 4675? False Is 10 a factor of 1210? True Is 40 a factor of 69720? True Does 22 divide 374? True Is 9 a factor of 684? True Is 3702 a multiple of 4? False Does 60 divide 23160? True Is 7350 a multiple of 98? True Is 48 a factor of 1418? False Does 38 divide 1915? Fa	{ "pile_set_name": "DM Mathematics" }
i2. Let u be n(5). Find the common denominator of (-564)/u(-2)/(-12) and 73/4. 12 Suppose -368 = -4w - 4l, 2w = w - 3l + 88. What is the smallest common multiple of 18 and w? 846 Suppose 7a + 5 = 2a. Let x = a + 4. Suppose -xl - 4 = -5l. What is the smallest common multiple of 10 and l? 10 Suppose 2h + 2 - 6 = 0. Suppose 1 = -d, -4v - 4d + 6 = -6. Calculate the smallest common multiple of (-5)/(-2)(v + 14/(-5)) and h. 6 Let k = -367/2856 + 45/136. What is the common denominator of k and 11/14? 84 Let i = -66935/16 + 4186. Calculate the common denominator of i and ((-30)/600)/((-3)/246). 80 Find the common denominator of -4((-23)/4 - -4) and (-168)/(-15) + (6 - 5). 5 Calculate the lowest common multiple of 88 and (1 + 0)/((-21)/(-672)). 352 Let a = -178 - -186. What is the least common multiple of 32 and a? 32 Let k = 14703/8 + -1833. Let n = 1144685/34 + -33670. What is the common denominator of k and n? 136 Let x = -14 + 23. Let r(m) = -4m + 44. What is the lowest common multiple of 20 and r(x)? 40 Suppose -3v + 0z = -z - 1, z + 5 = -v. Let y = 8 + v. What is the least common multiple of 32 and 3 + -1 + -3 + y? 96 Let t = -3065/168 - -611/24. Calculate the common denominator of t and 8/76 + 431/1140. 420 Let j = -3739 + 33580/9. Calculate the common denominator of 55/183 and j. 549 Let m = 545 + -500. Calculate the least common multiple of 35 and m. 315 Let y(o) = -2o2 - 5o - 3. Let c be y(-4). Find the common denominator of (0 - 262/(-4))c/(-45) and 29/20. 60 Let h = 14 + -12. Suppose 4z - hn = -28, 2z + 3z - 2n + 37 = 0. Calculate the common denominator of 1/5 and z. 5 Let z be 1/(-4)-66/9. What is the common denominator of z/(-2) + (-154)/(-66) and -39/20? 60 Let k = 47501/2444 + -3951/94. Let g = 622/13 + k. What is the common denominator of -73/3 and g? 12 Let y(f) be the first derivative of -f*4/4 - 3f*3 - 5f*2 - 8f + 3. Suppose 7x + 10 + 46 = 0. Calculate the least common multiple of y(x) and 14. 56 Let o = 2827 + -50927/18. Find the common denominator of o and -93/14. 126 Find the common denominator of -2 + (-642)/(-112) - 27/72 and 95/14. 14 Let u = -720 - -38995/54. Calculate the common denominator of -31/63 and u. 378 What is the least common multiple of 118 and (-1)/(-1) - (-16 + -3)? 1180 Let j(b) = 4b*2 + 2b - 2. Let d be j(-2). Calculate the common denominator of 91/10 and d/25 - 398/70. 70 Suppose 0 = 4l + s - 76, -5l + s + 104 = -0l. Suppose l = -4o + 8o. What is the least common multiple of o and 7? 35 Let i = -21998/7 + 3137. What is the common denominator of i and -91/148? 1036 Let w = -21 + 61. Suppose -f = f - w. Calculate the lowest common multiple of f and 22. 220 Suppose g - 5g = 24. Let s(y) = 76y2 - 3. Let q be s(5). Find the common denominator of 53/34 and q/462 - (-2)/g. 374 Let o(y) = -y2 - 5y + 16. Let w be o(-7). Let f be (-6 - -3)/(-3) + w. Suppose 24 - 135 = -fx. Calculate the common denominator of -11/9 and x. 9 Let y be -574 + 2(-5 + 6). Calculate the common denominator of 0 + -1y/(-24) and (-15)/(-24)(-9 - 0). 24 Let q(r) = r + 12. Let h be q(6). Suppose -3l - s = -16 + 4, -3s = 3l - h. Calculate the least common multiple of l - (-4 - (-4 - -7)) and 6. 30 Let u = 29 + -11. Let j = -27 + u. Find the common denominator of j/45 + 866/(-320) and 37/20. 160 Let n(f) = -f3 + 27f*2 - 47f - 61. What is the lowest common multiple of n(25) and 42? 42 Suppose -14 + 134 = -5m. What is the common denominator of 29/22 and (462/m)/(38/(-4))? 418 Let p = 46 + 94. Find the common denominator of -77/12 and (-485)/p - 2/7. 12 Suppose -z + 2z = -4k - 2, -3z - 70 = -4k. Calculate the common denominator of (2/20)/(z/(-1305)) and 117/10. 20 Suppose 2g - 907 = 6g + r, 5g + 1142 = -4r. Calculate the common denominator of (9/(-18))/((-6)/g) and 4/3. 6 Let v(u) = u3 - 5u*2 + 2u - 3. Let b(r) = 2r2 + 4r - 1. Let x be b(-3). Let t(w) = -w*2 + 7w + 5. What is the least common multiple of v(x) and t(4)? 119 Let r(j) = j*3 - 14j*2 + 13j + 5. Let s be -2(4 + 84/(-8)). Calculate the least common multiple of r(s) and 2. 10 What is the common denominator of 151/18 and (3 - 159/51) + (-516)/1683? 198 Let h be 88/5 - 2/(-5). Suppose 54 = -5r - 3f, -4f = -4r + 19 - 75. Find the common denominator of r/h - (-403)/60 and 11/18. 180 Calculate the common denominator of -31/30 and ((-256)/(-56) - 6)/(5 - 3). 210 Calculate the common denominator of (-18 - 4)2/(-40) and 17/32. 160 Suppose 26 = 3s + 5i, 5i - 7 - 7 = 3s. Suppose 7g - 4g - sp = 72, 2g - 2p = 50. What is the smallest common multiple of 22 and g? 22 Let b(n) = -13n + 5. Let w be b(-3). Suppose 0 = -m - w + 71. Calculate the smallest common multiple of m and 18. 54 Let r(b) = 8b + 140. Calculate the common denominator of 1 + 0 - 61/(-4) and r(-16). 4 Suppose -4p = -9p - 2s - 13, -4p + 4s - 16 = 0. Find the common denominator of (-266)/(-20) - (p + 6) and -5/16. 80 Let i = -2/1387 + 31905/2774. Find the common denominator of i and (2085/330 + 2/11)/(-6). 12 Let v be (-18 - -2)/(3/(-6)). Let w = v + -22. Let n(b) = -b*2 - 31b + 18. What is the least common multiple of w and n(-31)? 90 What is the lowest common multiple of 3 - (2 - -18)230/(-8) and 16? 4624 Suppose -38 = -2h - 4j, -5h + 93 = -4j + 26. Calculate the least common multiple of (-10)/(-4)(h - 5) + 3 and 16. 112 Let l be 56/(-140) + (-33)/(-5). Let d = 142/15 + l. Calculate the common denominator of (-2)/(-5) - 373/20 and d. 12 Let w = 2 + 0. Suppose -ws = -4s + 10. Let i = 32 + -22. Calculate the least common multiple of s and i. 10 Let x(s) = 21s - 9. Let r be x(8). Calculate the common denominator of r3/54 - 3 and -101/16. 48 Suppose 7924 = 67y - 53y. What is the smallest common multiple of 6 and y? 1698 Suppose 0 = -3t - 2o + 110, 29t + 60 = 30t - 4o. Calculate the lowest common multiple of t and 45. 360 Let d = 1426 + -20033/14. What is the common denominator of 81/62 and d? 434 Let j be (-1)/1663(1 - 13). Let d = -181051/29934 - j. Calculate the common denominator of d and ((-285)/12)/((-6)/(-4)). 18 Let l = 2398/21 - 951/7. Find the common denominator of 1/35 and l. 105 Let s = -7/1300 + -17609/49400. What is the common denominator of s and -37/12? 456 Suppose 3k - 2o + 3o - 11 = 0, 5k + o - 15 = 0. Suppose -4a - 12 = -ka. Calculate the common denominator of 2(3 - 55/a) and 75/2. 6 Suppose 3000 = -5d - 5a + 14670, 2d - 5a - 4661 = 0. Let j = -32635/14 + d. What is the common denominator of j and ((-2)/4)/((-1890)/34398)? 70 Let h be 5/((-5)/4) - 716326. Let o be h/176 - 12/(-66). Let g = -4080 - o. What is the common denominator of g and -83/8? 8 Suppose -4v + u + 694 = 55, -156 = -v + u. Calculate the lowest common multiple of 10 and v. 1610 Suppose z = 3h - 2z - 489, 3h + 3z - 471 = 0. What is the least common multiple of h and 40? 160 Suppose 0o = -4d + 5o - 320, -80 = d + 5o. Let j = 22241/8 - 2784. What is the common denominator of j and 8/40 + (-114)/d? 8 Let x = 41 - 38. Calculate the lowest common multiple of 33 and x. 33 Let b = -1/421 - -36635/3368. Calculate the common denominator of b and 55/16. 16 Let i(n) = -2n + 1. Let d be i(5). Let y = d + 34. What is the smallest common multiple of 2 and (70/y)/(4/10)? 14 Suppose 0 = -0m + 2m. Suppose mk + 5g = -2k + 28, 0 = -3g. What is the smallest common multiple of k and ((-10)/(-3))/(6/36)? 140 Let m = -3881/10 + 390. Calculate the common denominator of m and 141/(-20) + 2/8. 10 Suppose 0 = -52i + 8769 - 2581. What is the lowest common multiple of i and 49? 833 Suppose -22 = -3m + 4q, 0 = 5m + 2q + q + 2. Suppose 22c + 617 = -353c + 3242. What is the smallest common multiple of m and c? 14 Let i(w) = -2w2 + 30w - 27. Let t be i(14). Find the common denominator of -47/33 and ((-91)/42)/(-13)(-88 - t). 66 Suppose 9o - 21o = -900. What is the common denominator of (o/(-354))/1(1 + -3) and -30? 59 Let r = 772 + -767. What is the least common multiple of r and 20? 20 Let o(a) = 112*a - 12. Calculate the smallest common multiple of o(8) and 10. 4420 Let n = 5/244 + 3833/488. Find the common denominator of n and 15/52. 104 Calculate the lowest common multiple of (-3)/21 - ((-680)/(-14))/(-4) and 30. 6	{ "pile_set_name": "DM Mathematics" }
(z)). 3z4 Let f(b) = b. Let j(z) = z2 - z + 1. Let r(p) = -7p*2 - p + 1. Let y(l) = 2j(l) - 2r(l). Determine y(f(a)). 16a*2 Let b(r) = -3r + 9. Let w(l) = -2l. Give w(b(o)). 6o - 18 Let w(b) = 2b - b + 2b - 2b. Let x(q) = -2q*2. Calculate x(w(i)). -2i*2 Let f(v) be the first derivative of -2v*3/3 - 2. Let m(g) = 3g*2. What is m(f(b))? 12b*4 Let j(d) = 434d. Let z(b) = 6b2. Determine z(j(s)). 1130136s*2 Let b(f) = -2f. Suppose 4s - 8s = -8. Let p(n) = 27n + 5n*s - 27n. Give b(p(o)). -10o2 Let o(c) = 2c*2. Suppose -z + 1 = 0, 2 = 2j - 0j - 2z. Let n(k) = -2k + j - 2. Determine o(n(p)). 8p*2 Let k(u) = -2u*2 + 2u. Let j(v) = -5v. What is j(k(g))? 10g*2 - 10g Let f(d) = 2d2. Suppose -4w = 16, 3w + 0 = z - 14. Let i(b) = -b3 - 9b*2 - 7b + 10. Let v be i(-8). Let p(r) = -r*z + 2r*2 + 2r*v. Give p(f(x)). 12x*4 Let g(l) = 11l*2 + 9l*2 - 12l2. Let a(i) = -i2. What is g(a(y))? 8y4 Let q(h) = 462 - 5h - 462. Let m(s) = -5s. Calculate m(q(l)). 25l Let o(x) be the third derivative of -x7/5040 - x5/60 - x*2. Let q(f) be the third derivative of o(f). Let b(c) = 2 + 3c - 5c - 2. Calculate b(q(j)). 2j Let h(l) = l. Suppose 2k + 4q - 26 = 0, k - 2q = q - 7. Let a = k - 3. Let u(j) = -2ja - j2 + j*2. Give u(h(d)). -2d*2 Let p(y) = 51y. Let b(u) = -7u. Let s(x) = 2x. Let a(h) = -b(h) - 4s(h). What is p(a(d))? -51d Let b(g) = 5g. Let r(d) = 3011d. What is b(r(i))? 15055i Let n(h) = -4h*2. Let z be (1 - 14/(-6))-3. Let c be (-8)/(-12) + z/(-3). Let g(l) = -5l + 2 - 2 + cl. What is g(n(q))? 4q2 Let l(t) be the third derivative of -t5/20 - 4t2. Let k(i) = -i2 - i + 1. Let x(a) = -14a2 - 12a + 12. Let w(n) = -12k(n) + x(n). What is w(l(m))? -18m*4 Let u(l) be the third derivative of -7l*4/12 - 4l*2. Let a(f) = 70f. Let m(r) = 4a(r) + 21u(r). Let g(o) = -o*2. Give g(m(q)). -196q2 Let y(r) be the third derivative of -r5/30 + 4r2. Let i be ((-1)/2)/((-2)/20). Let q(f) = -f - if + 4f. What is y(q(a))? -8a*2 Let b(n) be the third derivative of 1/24n*4 + 0n*3 + 0 + 0n - 2n2. Let i(k) = 8k + 10. Let g(d) = -d - 1. Let u(a) = 10g(a) + i(a). Determine b(u(m)). -2m Let x(a) be the second derivative of 2a + 0a*2 + 1/3a*3 + 0. Let q(g) = -6g + 8. Let z(n) = -4n + 5. Let b(p) = 5q(p) - 8z(p). Calculate x(b(o)). 4o Let b(s) = s2. Let x(z) = z3 + 9z2 + 7z - 7. Let g be x(-8). Let c be g + 3 + -12. Let u(r) = -cr*2 + 5r - 5r. What is b(u(n))? 4n*4 Let r(x) = x - 5x - 3x. Let d(a) = -2a + 5. Let i(s) = -s + 2. Let v(y) = 2d(y) - 5i(y). What is r(v(p))? -7p Let m(k) = -1 + 9k + 4 - 2 - 3. Let g(s) = -3s2. Determine m(g(b)). -27b*2 - 2 Let x(i) = -8i*2 + 10. Let r(t) = 0t*2 - 2t*2 + 3t*2 - 1. Let a(y) = 10r(y) + x(y). Let b(w) = 4 + 2w - 4. Give b(a(f)). 4f*2 Let o(m) = 5 + 7 - 103m*2 - 12. Let j(x) = x. Give j(o(h)). -103h*2 Let f(q) = -7q. Let x(n) be the third derivative of -n*4/6 + 22n*2. Determine x(f(p)). 28p Let l(m) = 9m. Let w(h) = -157h*2. Calculate l(w(k)). -1413k*2 Let o(c) = 3c. Let r(p) = 547p2. What is r(o(q))? 4923q*2 Let s(z) = -10z. Let t(y) be the second derivative of 2y - 1/3y*3 + 0y*2 + 0. Calculate t(s(f)). 20f Suppose 0 = 4u - 3u - 3. Let r(t) = 5t - 3t - ut. Let a(f) = -f2 + 5f*2 + 3f*2. Calculate r(a(n)). -7n*2 Let s(d) = -4d*2 - 2. Let u(v) = 9v*2 + 5. Let c(x) = -5s(x) - 2u(x). Let g(q) = -4q. Determine g(c(i)). -8i2 Let w(f) = f. Let z be -8 - -9 - (1 + -2). Let o(r) be the second derivative of 0r*z + 1/2r*3 + 0 - r. Calculate o(w(p)). 3p Let x be (12/30)/((-6)/(-5)). Let n(j) be the first derivative of 0j + xj*3 - 2 + 0j*2. Let r(d) = -2d. Give n(r(a)). 4a2 Let g(z) = -z2. Let h = 1 - 0. Let w(l) = 4 + 5 + h - l - 1. Let y(k) = 2. Let t(u) = 2w(u) - 9y(u). What is g(t(m))? -4m2 Let h(i) be the second derivative of i4/2 - 8i. Let v(s) = 3s. What is v(h(w))? 18w2 Let u(g) = -7g + 2. Let r(c) = -315c + 91. Let z(p) = -6r(p) + 273u(p). Let h(d) = 2d*2. Give h(z(b)). 882b*2 Let d(z) = -6z*2 - 7z*2 + 14z*2. Let w(o) = 2o*2. Give d(w(n)). 4n*4 Let p(d) = d. Let c(g) = 2g*2 - 120g. Determine c(p(a)). 2a2 - 120a Suppose -o - o = -4. Let n(q) = oq2 - 8q*2 + 4q*2. Let k(r) = 4r*2. Give k(n(g)). 16g*4 Let y(g) = -5g. Suppose 3f + 4 = -5. Let l(w) = 2w*2 + 4w + 4. Let z(o) = 2o2 + 3o + 3. Let u(m) = fl(m) + 4z(m). Calculate u(y(j)). 50j2 Let b(d) = -5d + 3. Let n(g) = 6g - 4. Let p(h) = -4b(h) - 3n(h). Let u(c) = c - 12. Give p(u(y)). 2y - 24 Let d(p) be the first derivative of -p*3/3 - 22. Let l(u) = 2u*2 - 6u - 6. Let g(t) = -t - 1. Let b(x) = -24g(x) + 4l(x). Calculate b(d(y)). 8y4 Let v(z) = 0 - 2 - z2 + 4z - 6z. Let b(n) = -2n*2 - 5n - 5. Let d(w) = 2b(w) - 5v(w). Let i(h) = 9h2. Determine d(i(p)). 81p*4 Let n(h) be the first derivative of 2h*3/3 + 1. Let x be 45/18 + (-1)/2. Let y(b) = 4b2 - bx - 2b2 - 2b*2. Give y(n(a)). -4a4 Let o(g) be the third derivative of g5/30 - 23g2. Let z(l) = 6l*2 - 17l - 17. Let r(p) = -p*2 + 3p + 3. Let u(c) = 34r(c) + 6z(c). What is u(o(t))? 8t4 Let o(z) = z. Let k(m) = 4m*2 + 3m. Give k(o(b)). 4b2 + 3b Let u(s) = 2s2 - 3s*2 + 3s*2. Let i(a) = 8a + 5. Let j(k) = -33k - 21. Let t(g) = 21i(g) + 5j(g). Give t(u(h)). 6h*2 Let j(r) = -4r. Let z(q) = 621q2. What is j(z(b))? -2484b*2 Let y(c) = 4c*2 - 3c*2 + 5c*2 + 11c*2. Let q(z) = -2z*2 - 3z*2 + 3z*2. Give q(y(v)). -578v4 Let q(o) = o3 - 3o2 + 3o - 1. Let t be q(2). Let u(v) = 3 - t + 2v - 2. Let c(i) = -4i*2. Determine c(u(y)). -16y*2 Let q(j) = 26j. Let c(d) = -28d - 1. Give c(q(x)). -728x - 1 Let n(p) = p*2. Let h(z) be the third derivative of -5z4/3 - z2 + 17z. Calculate n(h(f)). 1600f2 Let a(m) be the second derivative of m4/12 - 2m. Let c(d) = -2d + 5 - 5. Give a(c(b)). 4b2 Let g(j) = -260j. Let p(b) = 24b. Calculate g(p(y)). -6240y Let v(p) = 3p2. Let r(j) be the first derivative of -1/6j*4 + 2j + 0j3 + 0j*2 - 2. Let h(m) be the first derivative of r(m). Give v(h(c)). 12c4 Let h(k) = -k. Let j(i) = -i2 + i + 63. Determine j(h(a)). -a2 - a + 63 Let o(f) = f. Let a = -6 - -4. Let x(w) = w2 + 2w + 2. Let g(s) = 3s*2 + 9s + 9. Let k(n) = ag(n) + 9x(n). What is o(k(y))? 3y2 Let q(l) = l. Let x(y) be the third derivative of -y5/30 + 17y*2. Determine x(q(b)). -2b*2 Let j(l) = -5l. Let z = 12 + -9. Let w(t) = -3t - 2t + zt + 0t. Give w(j(y)). 10y Let g(m) = -2m - 3. Let x(y) = -1. Let d(h) = -g(h) + 3x(h). Let b(p) = -p2 + 3p*2 + 0p*2. What is b(d(k))? 8k*2 Let d(f) = -5f - 2. Let z(u) = -u - 1. Let j(c) = 3d(c) - 6z(c). Let b(n) = -2n. Give b(j(k)). 18k Let l(a) = 5a. Let v(i) = i + 6. Let q be v(-3). Let d(f) = -qf*2 - 3f*2 + 4f*2. Give l(d(k)). -10k*2 Let m(a) = 42a*2. Let v(s) = -16s. Determine m(v(d)). 10752d2 Suppose 5 = 5l - 5. Let q(g) = -gl - g2 + 3g2. Let v(h) = -39 + 22 + 17 - h. Calculate q(v(a)). a2 Let w(h) = -8h*2 + 24h - 24. Let u(z) = -z + 1. Let i(q) = 48u(q) + 2w(q). Let k(f) = f. Determine i(k(p)). -16p2 Let r(b) = 3b. Let t(s) be the third derivative of s*4/8 + 6s*2. Calculate r(t(w)). 9w Let o(m) = -8m2 - 3m. Let i(g) = 360g2 + 136g. Let b(z) = -6i(z) - 272o(z). Let a(s) = 2s. What is b(a(u))? 64u*2 Let f(q) = -6q. Suppose -15 + 3 = -3b. Let g(d) = 2 + d + 2 - b. Determine g(f(a)). -6a Let d(p) be the first derivative of p*5/30 + 3p*2/2 - 4. Let z(m) be the second derivative of d(m). Let i(w) = 9w. Give z(i(u)). 162u2 Let r(g) be the second derivative of -g5/60 - g3/6 + 4g. Let x(z) be the second derivative of r(z). Let u(s) = s. Give u(x(f)). -2f Let x(f) = -4 + 4 - 3f*2. Let h(q) = q + 24. Let w be h(0). Let z(g) = -wg - g*2 + 24g. What is z(x(s))? -9s4 Let k(x) = -5x. Let m(f) = 3f. Let a(p) = -2p. Let j(y) = 3a(y) + 4m(y). Give k(j(i)). -30i Let t(f) = -2f. Let z(k) = k*2 + 102. Determine z(t(c)). 4c*2 + 102 Let m(c) = 2c*2. Let b(l) = 5l. Give b	{ "pile_set_name": "DM Mathematics" }
uppose -3c = -n, 2v + 43 = c + 150. Is v composite? True Let t be (6/9)/(2/9). Suppose 3u = -t, 0 = -a - 3u - u + 58. Suppose -173 = -3q - a. Is q prime? True Let z(j) = j3 + 14j*2 - 11j - 13. Is z(-10) composite? True Let c = 379 + 276. Is c a composite number? True Let y(n) = n*3 + 8n*2 - 2n - 2. Suppose -4i - 2 - 30 = 0. Let m be y(i). Is ((-26)/(-3))/(m/105) a prime number? False Let l(g) = 5g*3 - 11g*2 + 6g + 2. Let w(b) = -9b3 + 21b*2 - 11b - 4. Let a(u) = -5l(u) - 3w(u). Is a(5) a composite number? False Let w(k) = -10k - 9. Is w(-22) composite? False Suppose -2y - m + 5163 = -0y, m = -3y + 7742. Is y a composite number? False Suppose 158 = 8d - 4314. Is d a composite number? True Let y = 0 + 4. Let g(v) = 133v + 6. Let b be g(3). Suppose -yn = -0n + 3x - 512, 0 = -3n + 3x + b. Is n composite? False Suppose 2y = 2u - 2040, y - 3048 = 4y + 3u. Let w = 1511 + y. Is w composite? True Suppose -2p + 1135 = -351. Is p prime? True Suppose -3n - 2n - 2g = -285, 3n - 4g = 145. Is n a composite number? True Let d(r) = r - 13. Let v be d(7). Let a = v + 6. Let y(w) = w + 10. Is y(a) a composite number? True Let f be ((-3)/(-3))/(3/441). Suppose -377 = -2t + f. Suppose 2i + 45 + 80 = j, -2j + i = -t. Is j composite? True Let p(k) = k - 1. Let n be p(3). Suppose 0o + o + 238 = nr, 0 = 5o + 10. Suppose 5s + 4v - r = 0, -4s - 8v = -5v - 94. Is s a prime number? False Let f(d) = -153d + 1. Suppose 3b - 3m = -7m - 19, 3m = -2b - 14. Let s be f(b). Let o = -77 + s. Is o composite? True Suppose -2a + 11 = -19. Suppose -a = -5k - 0. Is -2 + k + -2 - -8 a prime number? True Let r(s) = 81s - 2. Let v(j) = j + 1. Let y(g) = -r(g) - 3v(g). Is y(-1) a composite number? False Let w(a) = 2a - 9. Let r be w(7). Suppose 0 = -3f + 5m + 226, -2m = -rf + 202 + 162. Suppose 5v = 23 + f. Is v prime? True Let h(g) = 11g + 24. Let r = -28 + 45. Is h(r) a prime number? True Suppose -4f = -2a + 1786, 2f = 4a + f - 3600. Is a prime? False Let c(j) = -1. Let u(n) = -10n - 3. Let x(v) = -4c(v) - u(v). Is x(6) composite? False Suppose -5p - 3d + 9 = 0, 2p = -2p - d + 10. Suppose -5r - 618 = -px, -3x + 2r + 1049 = 2x. Is x a composite number? False Let p(t) be the third derivative of t*4/2 - 5t*3/3 + 2t*2. Let i be p(7). Suppose 2j - i = 3v, 3v - 5 = j - 42. Is j prime? True Suppose 0 = 4y - q - 6, -y = -0q - 5q - 11. Is 467 - ((-1)/1 - y) a composite number? True Is (574/4)/(1/2) a prime number? False Suppose 4b - 9b = 20. Let o = 0 - b. Suppose 3r - 439 = -4f, of = 3r - 263 - 192. Is r composite? False Suppose 0 = -4g + 15 - 3. Suppose -21 = gj - 0j. Is (-1419)/(-7) - 2/j a prime number? False Suppose 7w - 3i - 251 = 2w, -4w = -2i - 202. Suppose -12 + 2 = s - 5l, 5s + 3l = -78. Let c = w + s. Is c a prime number? True Is (-1)/(-4 - 55884/(-13972)) prime? False Let z = -334 + 627. Is z prime? True Let w(o) = -o*3 - 2o - 5. Is w(-6) a prime number? True Let s(l) be the first derivative of -203l2/2 - 6l + 2. Let j be s(-4). Suppose 2z = 4n - j, -2z = -n - 6z + 215. Is n a prime number? False Let f = 170 + 33. Is f a prime number? False Is (-1)/(-2)(-5 - -289) composite? True Let p = 0 + 4. Suppose -10 = h + ph. Is h + 22 - 6/(-3) prime? False Suppose 5h + 548 = -3i + 2968, -i - 5 = 0. Is h a composite number? False Let x(q) = -65q + 47. Is x(-18) a prime number? True Let d(x) = -x2 - 5x - 4. Let t be d(-3). Suppose ta - 3s = 9, -8 = -a + 4s - 1. Suppose -8 + a = -g, k - 3g + 8 = 0. Is k a composite number? False Let b(u) = u + 6. Let j be b(-4). Suppose jp = -2p + 844. Is p prime? True Let v be 9/6 + 631/2. Suppose 2i + 2r = 592, 4i + 5r - v = 870. Is i a composite number? False Suppose 0 = a - 36 - 164. Let o = 334 - a. Is o a prime number? False Let j be (-2 + 4)-1 + 4. Suppose -2q - jo + 16 = q, -2 = -o. Suppose -w = qw - 185. Is w a composite number? False Suppose 460 = 4c - 2f, 6c - 4c + 5f - 230 = 0. Suppose 3b = 4b - c. Is b composite? True Let d = -102 - -181. Is d prime? True Suppose 2 = 2v + 4w - 6, -3w + 6 = 3v. Suppose v = -3y + 180 + 471. Is y prime? False Let k(b) = b*2 - 5b - 4. Let a be k(5). Let d be 1 + -1 + a/(-2). Is d(0 - (2 + -3)) a composite number? False Let l(h) = -h - 9. Let s be l(-11). Suppose -3x + 396 = -3o, -4x + so = -488 - 30. Is x prime? True Suppose 2v + 94 - 30 = 0. Suppose 0 = -c - c + 138. Let y = v + c. Is y prime? True Let f be ((-3)/6)/(3/12). Is (0 + f - -63) + -3 prime? False Suppose 4h - 2v = -79 - 39, v = 3. Let s = 71 + h. Is s composite? False Let g = 2 - -5. Is g a composite number? False Suppose d = -3d + 936. Suppose 6b + d = 3b. Is (-2 + 1)/(2/b) prime? False Let b be 2 - (-36 - -3)1. Let h be b/(-28) + (-1)/(-4). Is h5(-74)/10 a composite number? False Let k(z) = z*3 - 14z*2 + 12z + 15. Let l be k(13). Let r = 9 - l. Is r a prime number? True Let l = -172 + 255. Is l a prime number? True Suppose 131 = 3h - 5p, 2p - 163 = -4h - 3p. Suppose 3w + 23 = 4r, -h = w - 5r - 16. Let y(x) = -192x - 1. Is y(w) a composite number? False Let s(o) = -79o*2. Let t be s(-1). Let z = -143 - t. Let r = 97 + z. Is r composite? True Suppose -3v + 16 = -20. Let c = -10 + v. Suppose cq - 112 = -38. Is q a composite number? False Let f = -297 - -785. Let q = 21 + f. Is q a composite number? False Suppose -3n = -2n - m - 2335, 3m = 0. Is n a prime number? False Suppose 2m - 1648 = 2p + 3580, 5193 = 2m + 5p. Is m prime? True Let z(s) = -s - 5. Let r be z(-6). Let a(n) = 6n - n2 - 2 + r + 6n. Is a(8) a prime number? True Is ((-852)/(-16))/(3/12) a composite number? True Let n(g) = -g*3 + 7g*2 + g - 7. Let h be n(7). Suppose h = -a + 2 - 4. Is (a/(-4))/((-4)/(-1016)) a prime number? True Let h be -5(0 + (-6)/(-5)). Is (-340)/(-16) + h/(-8) a prime number? False Let y(a) = 4a2 - a + 9. Let i(n) be the first derivative of n3 - n2/2 + 10n + 2. Let j(s) = 5i(s) - 4y(s). Is j(0) a prime number? False Let t = -38 - -83. Let x = t - -44. Is x prime? True Let n = -1209 - -1892. Is n prime? True Let m(u) = 23u2 + 20u + 8. Let g(z) = -8z2 - 7z - 3. Let p(t) = 11g(t) + 4m(t). Is p(6) prime? False Let j(u) = u*2 + 15u + 5. Is j(7) a composite number? True Suppose 0 = -3y + 5 + 4. Suppose -3c - 2 = -2c. Is 43/y - c/(-6) prime? False Suppose 2k + u - 166 = 342, -5k + 1275 = 5u. Let b = k - 134. Is b a composite number? True Suppose r - 23 = 308. Is r composite? False Let r = 1838 + -841. Is r a composite number? False Suppose -2v - 1713 + 435 = -2s, -5s - v + 3171 = 0. Is s prime? False Suppose -o = -2n + 4o + 3, -5n = o - 48. Let f be 0(n/6 - 1). Suppose 6l - 5l - 21 = f. Is l composite? True Suppose 3x - 3 = 0, 5x = l - 1413 - 603. Is l composite? True Let q = 15 + -10. Suppose -115 = -2v - qm, -2m = -5v + 2m + 205. Suppose 4o - 143 = v. Is o prime? True Suppose 10j = 6j + 1924. Is j prime? False Let t(x) = x2 + 2x - 5. Let l = -1 - -10. Suppose 3m - l = 3. Is t(m) composite? False Let h(f) = f3 - 2f + 7. Is h(6) prime? True Let j(r) = 265r2 - 4r + 3. Is j(2) composite? True Suppose -1784 = -4u - p, 1085 - 199 = 2u + 2p. Is u a prime number? False Suppose 4q - 2y = 0, 4q + y - 4 = 2y. Suppose -258 = -qx + 316. Is x composite? True Let s = 96 + 146. Suppose -2x + 484 + s = 0. Suppose 0 = -0n + 3n - x. Is n a prime number? False Let l(w) = -w. Let p(z) = 16z + 5. Let o(n) = -2l(n) + p(n). Is o(6) composite? False Let l(m) be the third derivative of m6/45 + m5/20 - m4/24 - m3/6 + m2. Let v(j) be the first derivative of l(j). Is v(-6) prime? True Let d(x) = -x3 - 5x*2 - x + 1. Let r be d(-7). Let j = 270 - r. Suppose -21 - j = -5y. Is y prime? True Suppose -2x - m + 178 = 0, -m - 352 = -4x - 4m. Is x composite? True Suppose 5w + m - 1937 = 0, -11 + 3 = -4m. Suppose -5f + w = h - 0h, 302 = 4f - 3h. Is f composite? True Suppose -67 = 5b - 4r - 1142, -1080 = -5b + 5r. Is b a composite number? False Let h = 0 + 0. Let x(n) = -n3 - n2 - n - 8. Let d be x(h). Let o(y) = -y3 - 6y*2 - 8y - 7. Is o(d) composite? True Let h(n) be the first derivative of 11n*2/	{ "pile_set_name": "DM Mathematics" }
-su + 6 for o. 0 Let z(l) = -65l - 258. Let j be z(-4). Solve -a - ju - 3 = -0, 0 = -2u for a. -3 Let u(a) = -12a - 6. Let r be u(8). Let l = 107 + r. Solve -13 = -5n + 2o, -o - 2 = ln - 3 for n. 1 Let t = -94 - -99. Solve -3s - 2l = 5 + t, -12 = 4s + 4l for s. -4 Suppose 2g + 3g - 4p - 46 = 0, 0 = -2p - 8. Suppose 9 = 5t - g. Solve 14 = a - 2j + t, -5a = -4j - 37 for a. 5 Suppose -2j + 52 = 11j. Solve -ju + 5b = 12, 4u + 7b - 9b = 0 for u. 2 Let g be (-1 + -2)2/(-2). Suppose -k = z - 4, g = -3z + k + 7. Solve i = p - 5p + 23, -21 = -zi - 3p for i. 3 Suppose -58 = -5j - 4p - 0p, -22 = -3j + 4p. Suppose 11 = y + j. Solve 2i = 2t - i - y, -t = -i - 1 for t. 2 Let o be 22556/(-40)4/(-14). Let n = o + -87. Solve 2q = 3r - 7, -4r - 18 = -r + nq for r. -1 Let i be 279/15 - (-4)/10. Let z = i + -14. Solve -4 = 2t, -3x + 0 = 5t - z for x. 5 Let a = -11 + 14. Let d be (2 + a/(-6))2. Suppose -5m = dj, -2m = j + 3m. Solve -f + 4h + 3 = j, 9h - 4h + 5 = 0 for f. -1 Let d(p) = p*2 + 6p - 22. Let l be d(-9). Solve 3t + 2h + 6 = 0, -lt = -0t + 3h + 11 for t. -4 Let j(t) = t3 - 7t*2 + 7t - 3. Let r be j(6). Suppose -9p = -rp - 30. Solve -5w - 2 = pb - 3w, -4b + 2w - 16 = 0 for b. -2 Suppose 2b = 1 + 3. Suppose -2k - b = -4. Let t(r) = 9r*2 + r. Let d be t(k). Solve x = -5y - d - 3, -10 = -y + 4x for y. -2 Let z be (-3)/(-9)-1-15. Let x = 4 - 4. Suppose x = a + 2, -b + 0a = 2a. Solve -4t = -zj + 2, -bj - t - 17 = 2t for j. -2 Let s(x) = -x + x3 + 3x - x - 6 + 0x - 6x*2. Let v be s(6). Suppose v = -2h + 1 + 9. Solve hr + 8 = -a - 1, 2r = 3a + 10 for a. -4 Suppose -58 = 4f - 3c, c + 61 = -5f - c. Let o = f + 17. Suppose 86y - 28 = 82y. Solve 0s + 4l = s + y, ol = 2s + 2 for s. 5 Let d = 11 + -14. Let n = d - 2. Let k(b) = -b*2 - 5b + 2. Let t be k(n). Solve -5g = -5s + s + 36, -s + 12 = -tg for s. 4 Suppose -678w = -661w - 34. Solve -wn + 23 = 3d - 0n, -9 = -d - n for d. 5 Let o be ((-8)/(-20))/((-1)/(-35)). Solve 0 = 4s - g + o, -5s + 0g - g - 13 = 0 for s. -3 Suppose 11 = 5z - 69. Suppose -14 - z = -6o. Solve -3b + 3y = 2b + 3, -4b - o = -5y for b. 0 Suppose 9n = -5g + 4n + 85, 5g - 86 = -4n. Suppose u = -2u + g. Solve 2p + 4j - u = 0, -j + 12 = 4p - 4j for p. 3 Suppose -4o - 12 = -4a + 8, 0 = o + 5a - 25. Let w be 1/(-2)-216. Solve 4n + 3m - w = o, n - 3n + 8 = -5m for n. 4 Suppose 138 = -19h + 13h. Let f = -18 - h. Solve 4n = -5w + 5n - 15, fw + 15 = -2n for w. -3 Suppose -90 = 22z - 67z. Solve -4l + 4a = 20, -3l - 7 = za - a for l. -3 Let d be 6/6 - (-15)/(-3). Let o be (-2 + 7)/(5 + d). Let v = -2 + 4. Solve oj + 10 = -3x, x + 0 = -3j - v for j. 1 Let u be ((-24)/9)/(1/(-3)). Solve -2z = -2p, -p + 3z + 4 = u for p. 2 Let d be (-12)/(-10)(-80)/(-12). Let a(b) = -b3 + 8b*2 + 3b - 20. Let w be a(d). Solve -3z - 2s = -0s + 13, wz + s = -14 for z. -3 Suppose 0 = -2z - k + 1 + 9, -4 = k. Solve -8u = -zu + 5, 5 = -2a + u for a. -5 Suppose 9u = 10 + 17. Suppose 4s + 4k = 0, k = -us + 7 + 3. Solve -w = -sz - 5 + 10, -3w - 4 = -4z for z. 1 Let v(q) = -q3 + 9q*2 - 17q + 31. Let z be v(7). Solve 2b + r = 8, 3b - z = r + 7 for b. 5 Suppose 32 = 4t - 16. Suppose 0 = 3l - l - t. Suppose -2s + 5s - l = 0. Solve -m = sm - 15, -5z - m + 5 = 0 for z. 0 Suppose 43 = 24b - 77. Solve 2t + 3 = -bk - 1, -k = 2 for t. 3 Let w = 1091 + -1079. Solve n + 5 = -2b, 0b - w = 4n + 4b for n. -1 Let b be (-19)/(-5) + 16/(-20). Solve -4c + 4 = -3c, 3w - b = 3c for w. 5 Let r = -35 + 108. Suppose 0m + 65 = 3q - 2m, 4m = 3q - r. Solve 3u + 0u - q = -z, -4 = -z for u. 5 Suppose -3f + 2k + 9 = k, k + 13 = 4f. Solve z + fh = -7, 0 + 30 = 3z - 5h for z. 5 Let m be -15/((-5)/(-2)). Let q = 1 - m. Suppose qk = -k + 12. Solve a - 4a = 6, kp - 7 = -a for p. 3 Let j(m) = 2m2 - 15m + 13. Let l be j(7). Solve 4h - 1 = -2o + 1, -5h = -o - l for h. 1 Let n = 205 + -202. Solve -y = -5b + 3, 0b + ny = 3b - 9 for b. 0 Let c(u) = 3u - 12. Let r be c(-4). Let h be (15/(-6) + 2)/(4/r). Solve 5w - j = -15, -j = 4w - hj + 12 for w. -3 Suppose 5d - 25 = -5c, 3d - 3 = -5c + 2. Suppose 5x + 2n - 64 - 15 = 0, -5n = -d. Solve 2m - 11 = -6l + l, -x = 3m - 3l for m. -2 Suppose -2c = -8c + 96. Let t = 30 - c. Solve 2q = -4i + t, -4q + 23 = 3 for i. 1 Suppose -4 = -f + 4j, 0 = 5f - 2j - 3j - 50. Suppose 5x = 3x + 22. Let v = 24 - 19. Solve 0 = -2p + vq + x, 3p - 3q - f = -0p for p. 3 Let a = 9 + -6. Suppose az = -0z. Suppose z = -3v + 8 + 7. Solve 0i + 13 = 4i + 5f, 5i - vf + 40 = 0 for i. -3 Let b = -16 + 14. Let p be 4 - 23/b. Let h be ((-4)/p)/((-12)/42). Solve 0 = -4v - 20, -5g = -hv + 3v + 10 for g. -1 Let w be ((-1)/(-3)-23)/((-2)/6). Suppose -10t + 17 = -w. Solve -3q - 1 = 3j + 8, -tj = 8 for q. -1 Let r(j) = j3 - j2 - j - 11. Let u be r(3). Solve -ua - 1 = -3a + 4b, 4b + 13 = 3a for a. 3 Let k = 151 + -148. Solve -24 = -2n - 4l, -kn = 4l - 3l - 11 for n. 2 Let f be 2 - (3 + -2)-3. Suppose 0x + 4x = -fz + 10, x = 2z - 4. Suppose 9 = -zn + 13. Solve -p - 8 = no, -o - p + 1 = 5 for o. -4 Let j = 75 - 103. Let z = 33 + j. Solve -4k + 0k = zi - 5, 5i - 20 = -k for i. 5 Suppose 54 - 12 = 21z. Solve h = -y - 1, zh - 15y + 13y = -2 for h. -1 Suppose 0 = t - 124 + 119. Suppose m + p = -2m + 28, 24 = 5m - 4p. Let q = m - 5. Solve -2s - 2 = tk + 6, k = qs + 12 for s. -4 Let z(a) = a2 + a - 48. Let n be z(0). Let i = n - -50. Solve 3x = 2r + 15, -3x + 5r + 5 = -ix for x. 5 Let r = -12 - -18. Let p = 35 + -33. Suppose 0 = -5q + q + 8. Solve pb - 2i + 18 = 6b, -2i = -qb - r for b. 2 Suppose 3p + 12 + 94 = 4d, 2d - 4p = 58. Suppose -dt + 75 = -10t. Let b = 5 + -2. Solve 40 = -5o + tc, -o + 6 = -bc + 24 for o. -3 Let r = -117 + 80. Let w = 41 + r. Solve -5c + 11 = -wv, 5v = -4c + c - 23 for v. -4 Suppose -18 = -4c - 2y, 8y - 3y = 2c - 15. Let g = 10 - c. Let b be (3 - 3) + (3 - 1). Solve 2o = 2h - h - g, -b = 2o for h. 3 Suppose -5s + 0s - 4d = 730, 0 = -3s + d - 455. Let w be 3/((-1)/5s/20). Solve -27 = 5c - wn, -5c + n - 30 = -4n for c. -5 Suppose w = -4d + 14, -4d - 6 = 3w - 16. Let y be (-32)/d - -3 - -6. Solve i - y = -o + 1, 0 = -3o - i + 2 for o. 0 Suppose -30 = -4v - 4a + 2a, 2a + 15 = 5v. Suppose 14 = 3u - u + 3w, 4 = w. Solve 2r + h = 2, r - vh = -2h + u for r. 1 Suppose w = -3x + 194, 3w - 2x - 604 = -0w. Let n be (1/4)/(10/w). Solve 4b = -5u - 21, -nu - 3b = -3u + 14 for u. -1 Let m(h) = h - 24. Let r be m(28). Solve -rs - 2c = 0, 2s + 1 = -3c + 5 for s. -1 Suppose i - b - 1 = 0, 0i + b - 3 = -i. Suppose z + 21 = -4n, -iz - 4n + 2n = 18. Let x = 15 + z. Solve 5q + 2l = x, 0 = -2q - 0l + 3l + 4 for q. 2 Suppose 2 = -11v + 10v. Let o be v1/9 - 140/(-63). Solve -oz = 2p + 18, p + 3z + 14 = -3 for p. -5 Let s = 126 + -124. Solve -2z - 8 = sy, -7z + 8 = -3z - 2y for z. 0 Suppose -12z + 105 = 9z. Solve zj - 5l = 45, 21 = 4j + l + 5 for j. 5 Suppose -19u + 14 = 5c - 17u, 3u - 6 = 0. Solve 5p - l = -c, 5 = -0p - 2p - l for p. -1 Let z(u) = -56u - 256. Let y be z(-5). Solve -s + 3o = 8 - y, -5o = 4s + 4 for s. 4 Let b be (((-336)/35)/(-6))/(6/75). Solve 5j = 5s - b, j + 0s - 2 = -5s for j. -3 Let l(u) = u*3 + 4u*2 - 7. Let d = 14 - 17. Let w(k) = 4k + 9. Let z be w(d). Let b be l(z). Solve -2a + 19 = -5q, -ba = -3a + 2q + 8 for a. 2 Let y = -338 + 340. Solve -a + 2l = a + y, -2a = l + 5 for a. -2 Let h(d) = d2 - 5. Let p = -36 - -39. Let z be h(p). Solve 5k - 2w = 2, -k + 3k = 4w + z for k. 0 Let n = 1068 - 1068. Solve r - 5r + 3f + 18 = n, -r + 3f = -9 for r. 3 Suppose 0 = 1056v - 1068v + 120. Solve -6o + 11 = -3y - 5o, o + v = -4y for y. -3 Let c = 267 - 265. Solve 5 = 5m - 3s, -cm + 10 = 3m - 2s for m. 4 Let h(k) = -k3 - 7k*2 - 18k - 21. Let v be h(-4). Solve 0 = 4a - 2w + 2, -2a + 4 = -vw - 1 for a. -2 Let x = 31 - 26. Suppose -90 = -i - xi. Solve -5k = -0k - 2q + i, 5q = -k - 3 for k. -3 Let q = -26 - -38. Let b(s) = s2 - 13s + 12. Let z be b(q	{ "pile_set_name": "DM Mathematics" }
e units digit of x(0)? 1 Let t(y) be the first derivative of -y*3/3 - 13y*2/2 - 4y - 10. Let z be t(-10). Suppose 0 = -0h - h + z. What is the units digit of h? 6 Let c(j) = j3 + j2 - j + 48. Suppose 8n = 9n. Let r be c(n). Suppose 0 = -4w - x + 108, 0 = -0w + w - 5x - r. What is the tens digit of w? 2 Let o be (-20)/(-90) - (-34)/9. Let y be 3 + 0 + 0 + 1. What is the units digit of -1(-21 - y/o)? 2 Let n = -693 - -934. What is the units digit of n? 1 Let y(a) = 2a*2 - 12a + 2. Let h = 17 - 10. Let w be y(h). Suppose -2s + w = 2u, u = 2s + 6u - 4. What is the units digit of s? 2 Suppose 7o + 712 = 11o. What is the units digit of o? 8 Let m = -375 - -679. What is the tens digit of m? 0 Let x(v) = 2v + 21. Let p be x(-10). Suppose -z = -2y - 35, -z + 5y = -p - 37. What is the tens digit of z? 3 Let p(b) = b3 + 17b*2 - 20b - 92. What is the units digit of p(-13)? 4 Let g(x) = 8x - 167. What is the tens digit of g(23)? 1 Suppose 15k + 18k - 11946 = 0. What is the hundreds digit of k? 3 Let j be 28/6 + (-2)/(-6). Let r be ((-58)/(-8))/((-58)/(-1160)). Suppose -2p = jc - r, 0p = -c - p + 26. What is the tens digit of c? 3 Suppose 0a + a - 29 = -5d, -a = -3d + 19. Suppose 15 = dy - y. What is the tens digit of (8/y)/((-3)/(-27))? 2 Let k(c) = c*3 + 10c*2 + c + 12. Let u be k(-10). Suppose -us - s + q + 14 = 0, 3 = 3q. What is the units digit of (s + -4)/(2/6)? 3 Let i(r) = 204r*2 - r. Let l be i(-1). Suppose -l = -7n + 467. What is the units digit of n? 6 Suppose l = 2l. Suppose l = 5q + 5y, -7 + 1 = 5q + 3y. What is the tens digit of 16 + (-2)/((-2)/q)? 1 Let f = 96 - 54. What is the units digit of f/(-4)14/(-3)? 9 Let z(f) = -f*2 - 11f - 9. Let l be z(-10). Suppose 5r - 3r = v - 33, 5r - 5v = -90. What is the tens digit of 43l + r/5? 4 Suppose -k - 5q = -1547 - 57, -6352 = -4k - 4q. What is the thousands digit of k? 1 Suppose -23n = n - 49224. What is the hundreds digit of n? 0 Let h = -292 + 642. Let z = h - 193. What is the units digit of z? 7 Let t = 2973 + 127. What is the units digit of t? 0 Let s(h) = -h3 + 19h*2 + 13h + 41. What is the thousands digit of s(12)? 1 Suppose f - 772 - 2119 = -4c, 0 = -2c + 2f + 1448. What is the units digit of c? 3 Let y(g) = g2 - 5g - 8. Let a = 85 + -57. Suppose 3l + 4u = 20 + a, 4u + 24 = 3l. What is the tens digit of y(l)? 7 Let h(s) = 2s2 - 4s - 3. Let r(t) be the first derivative of -t*4/4 - 2t*3/3 + 3t*2/2 + 6t - 3. Let g be r(-3). What is the units digit of h(g)? 5 Let p = -1 - -9. Suppose 16w - 13w - 5h = 55, w - 30 = 4h. Suppose -pl - 56 = -wl. What is the units digit of l? 8 Suppose -3f - g - 3 = 1, 5f + 2g = -8. Let c(t) = -t2 + 12. What is the units digit of c(f)? 2 Suppose 0 = q + u - 63, 78 = 2q + 4u - 40. What is the units digit of q? 7 Let r = -13 - -27. Suppose 0 = 7w - r - 7. Suppose 0p + 183 = wp. What is the units digit of p? 1 Let v(u) = -u*3 + 27u*2 - 26u + 3. Let q be v(26). Suppose -299 - 91 = -qy. What is the hundreds digit of y? 1 Let q(j) = 14j*2 + 7j - 1. What is the tens digit of q(6)? 4 Suppose -2f - f + 5l + 2448 = 0, -l = 2f - 1632. What is the hundreds digit of f? 8 Let z = 758 - 390. What is the tens digit of z? 6 Let l = -20 + 30. What is the units digit of (-1)/(-2)(l + 108)? 9 Let b = -671 - -2305. What is the thousands digit of b? 1 Suppose 0 = -3u + 3, -u = -i + 14 - 13. Suppose 5q - 837 = -4g, -iq + 1305 = 5g + 263. What is the tens digit of g? 0 Suppose -5i + 14b + 20 = 12b, 2b = -5i + 20. Suppose -k - 172 = -y - 48, iy - 492 = 2k. What is the units digit of y? 2 Suppose -9d = -4d - 20. Suppose 5h - dh = -28. Let j = -12 - h. What is the units digit of j? 6 Let o(k) = -k*3 - 24k*2 - 25k - 49. Let y be o(-23). What is the tens digit of (2/(-9))/((-1)/(-48))y? 3 Let m(r) = -28r - 6. Let d(x) = 2x + 1. Let s(h) = 8d(h) + m(h). What is the units digit of s(-6)? 4 Let u(k) = -227k2 + 248k2 + 0 - 17 + k3 + 17k. What is the units digit of u(-20)? 3 Let d be 5/(-35) - 64/(-7). Suppose 0q - d = -3q. Suppose -2f - 19 = -qf. What is the units digit of f? 9 Suppose 3d + 3s - 5s + 4 = 0, 0 = -d - s + 2. Suppose d = 3z - z - 6. Suppose zk - 35 = 19. What is the tens digit of k? 1 Let w(d) = 4d + 2. Let r(b) = -b + 1. Let m(y) = -2r(y) - w(y). Let h be m(-5). What is the units digit of 105/h - (-6)/(-4)? 6 Let l = 45 + -43. Suppose 3a - lz = 5a - 122, -3a + 3z + 207 = 0. What is the units digit of a? 5 Let j = 5 - 8. What is the units digit of 36 + (-3)/(-3) + j? 4 Suppose c - 3v - 3 = 24, 5c - 3v - 99 = 0. Let o be ((-5)/3)/(-10(-8)/(-240)). Suppose -2q = -s - 5 + c, -os = -5q - 85. What is the tens digit of s? 2 Suppose -255 = 39z - 40z. Suppose -1235 = -5v - 5l, 0 = -2v + 3v - l - z. What is the hundreds digit of v? 2 Suppose -13r + 10r - 6 = -4c, 0 = 4r + 3c - 17. Let p(t) = t + 58. Let x be p(0). Suppose 2k = 5l + 121, x = k - 4l + r. What is the units digit of k? 8 What is the units digit of (-1)/((-3)/24)74? 2 Let h(z) be the third derivative of 3z*4/8 - 5z*3/2 - 5z*2. What is the units digit of h(9)? 6 Let b = -6 + 9. Suppose w + 5p + 60 = 2w, bp + 12 = 0. What is the units digit of w? 0 Let d(h) = -h*2 - 6h - 5. Suppose -2w - 4x = 24, 0 = 3w - w + 2x + 16. What is the units digit of d(w)? 3 Let s = -2 + 6. Let b be ((-10)/(-6))/(s/12). Suppose -bg - 4a + 2a + 144 = 0, 0 = 5a + 15. What is the units digit of g? 0 Let j(h) = h*2 - 13h + 15. Let i be j(12). Suppose 0 = -5u + im + 423, 2m - 425 = -5u + 18. What is the units digit of u? 7 Suppose -1148 = -4g + 4c, 3g - 594 = -4c + 232. What is the units digit of g? 2 Let k = -26 - -11. Let c be k/14/5. Let i = -3 - c. What is the units digit of i? 9 Suppose 2z - 16 = -3c, 0c = -5c + 4z + 56. Suppose -2s = 2 - c. Let p(l) = 12l - 4. What is the units digit of p(s)? 2 Suppose -2n + 2z + 1322 = 0, -13n + 17n - z - 2656 = 0. What is the tens digit of n? 6 Let x(b) = b3 - b2 - 8b - 28. What is the hundreds digit of x(8)? 3 Let o(q) = 2q + 156. What is the tens digit of o(-13)? 3 Suppose 2w - 5a - 4220 = 0, 152a - 2121 = -w + 149a. What is the units digit of w? 5 Let m = 1211 + -656. What is the units digit of m? 5 Let z be (-1510)/(-50) + 2/(-10). Let i be 25/(z/9). What is the tens digit of (i/2)/(6/88)? 2 Let z(c) = 2c*2 + 7c + 5. Let d be z(-5). Let y be ((-135)/d)/(2/16). What is the tens digit of y/(-90) - (-397)/5? 8 Let k be 115/20 - 3/(-12). Suppose -ky = -y - 125. Let s = y - -5. What is the units digit of s? 0 Suppose -338 + 113 = -5w. Suppose -s + 5v = -46, s + v = -5 + w. What is the tens digit of s? 4 Let r(q) = -q2 + 24q + 2. Let k(f) = f*3 + 4f*2 - 8f - 8. Let u be k(-5). What is the hundreds digit of r(u)? 1 Let r be (-126)/(-10) + 8/20. Suppose -n - 5s - 19 = 0, -4s - 24 - 2 = -n. Suppose -n = -5b - 4z + r, -3z = -b. What is the units digit of b? 3 Let d = 1300 + -1285. What is the units digit of d? 5 What is the tens digit of (2 - 5)/((-30)/210)? 2 Suppose -109x - 1768 = -113x. What is the units digit of x? 2 Suppose j - 2 + 6 = 0, 4v = j - 44. Let f = v + 24. What is the tens digit of f? 1 Let g = 103 + -100. What is the units digit of ((-216)/g)/(32/(-6))? 2 Let g be ((-4)/(-6))/(6/(-36)). Let w be 10/g60/(-75). Suppose -4t + 2t - 26 = -r, 5r = wt + 138. What is the units digit of r? 8 Let n(a) = -18a3 + 2a*2 + 2a. Let x(m) = m*3 - 2m*2 - 1. Let i be x(2). What is the tens digit of n(i)? 1 Let w(s) = -2s*2 - 8s - 3. Let g be w(-3). Suppose 0 = -gy + 5m + 525, -2y + 0y = 3m - 369. What is the hundreds digit of y? 1 Let d(u) = -10u*3 + 5u*2 + 6u + 5. What is the tens digit of d(-4)? 0 Let c be (-92)/(-6)(-7 + 4). Let t = c + 76. What is the units digit of t? 0 Suppose -h + 2h = 0. Let b(f) = -f + 25. Let t be b(h). Suppose -t = -2j + 7. What is the tens digit of j? 1 Let x = -1355 + 3841. What is the units digit of x? 6 Let t(g) = -g2 + 16g - 13. Let h be t(15). Suppose -r - 9 = -2c, 0 = c - hc + 5r + 9. What is the tens digit of 35 - ((-5)/(-1) - c)? 3 Let s = 8 + -6. Suppose -sk - 4f + 6 = 0, 6k - k - 2*f = -9. W	{ "pile_set_name": "DM Mathematics" }
. Let j(k) = 0 + 2k - 2 - k2 - 6k + 3k. Let f(n) = -3j(n) - y(n). Find the second derivative of f(d) wrt d. -300d Let k(t) = 412t*2 - 21t - 8846. Let w(z) = -1649z2 + 86z + 35387. Let p(g) = -25k(g) - 6w(g). What is the first derivative of p(u) wrt u? -812u + 9 Let m = -59 - -59. Suppose 2d = 1 + 1, 4p - 2d - 6 = m. What is the third derivative of -18c4 - 20c*p - 10c*4 + 7c*4 - 2c*2 wrt c? -504c Let f(d) = 112 - 13d2 + 51d*2 + 31d + 99. Let w(i) = -13i2 - 11i - 70. Let q(p) = -6f(p) - 17w(p). Find the first derivative of q(c) wrt c. -14c + 1 Let h(f) be the third derivative of 1543f9/504 + f7/105 + 158f5/15 + f4/24 + 5f*2 + 201f. What is the third derivative of h(m) wrt m? 185160m3 + 48m Let o(l) = l + 72. Let t(m) = -2149m - 27. Let f(i) = -2o(i) - 2t(i). Differentiate f(g) wrt g. 4296 Find the first derivative of -1824x + 173x - 760x + 49 - 11 + 85 wrt x. -2411 Let k = -112 + 151. Find the third derivative of 10 + kr2 - 33 + 23 + 21r*3 - 3r*4 wrt r. -72r + 126 Let p(o) = o*2 - 19o + 60. Let u be p(4). Let m(l) be the second derivative of 0l3 + u - 4l - 2/3l4 + 15/2l*2. What is the derivative of m(d) wrt d? -16d Let y(d) be the second derivative of 142d + 0d*3 + 0 + 2/15d*6 + 78d*2 + 0d*5 + 1/4d*4. What is the first derivative of y(l) wrt l? 16l*3 + 6l Let o be 71(-1 + (-1 - -3)). What is the second derivative of 118z + 17z2 - 75z + 2z3 - oz wrt z? 12z + 34 Let h(u) = 18u - 35. Let r be h(10). Find the second derivative of -31s3 + 18s - 145 + r wrt s. -186s Let m(t) = t2 + 13. Let p = -3 + 7. Let s be m(p). Find the second derivative of 30q + 25q5 + sq - 25q + 7q*5 wrt q. 640q*3 Let y(x) be the third derivative of -1 - 2x*2 - 3/4x*5 + 1/70x*7 + 0x - 23/120x6 + 1/12x*4 + 0x*3. What is the third derivative of y(o) wrt o? 72o - 138 Find the second derivative of -2594q + 6166q + 6985q - 343q*2 - 2028q - 167q2 wrt q. -1020 Let h(t) = -t3 + 19t*2 + 21t - 15. Let i(x) = x*2 + 7x + 2. Let j be i(-9). Let m be h(j). Differentiate -mf + 5f - 4 - 17f with respect to f. -17 What is the third derivative of -3k*2 - 1040k*6 + k - 553521 + 553521 + k wrt k? -124800k*3 Let n(d) = -265d*3 - 3d*2 - 183d + 22. Let a(b) = 798b3 + 8b*2 + 551b - 64. Let g(k) = 6a(k) + 17n(k). Find the second derivative of g(l) wrt l. 1698l - 6 Let v(u) = u4 - u3 - u2 + 1. Let n(a) = -278a4 + a2 - 1312. Let p(l) = -n(l) - v(l). Find the first derivative of p(m) wrt m. 1108m3 + 3m*2 Let j = 4028 + -12082/3. Let t(u) be the second derivative of 7/2u*2 + ju*4 + 0u*3 - 18u + 0. Differentiate t(s) with respect to s. 16s Let y = 231 + -193. What is the second derivative of 53o*2 - 7o*4 - 130o - 57o2 + 132o + 0 - y wrt o? -84o2 - 8 What is the second derivative of -4t + 47092t5 - 46044t*5 - 2t + 0t - 250 wrt t? 20960t*3 Suppose -y + 9 = -4. Suppose a + 9 - y = 0. What is the third derivative of -az*2 - 29z*6 - 2z*3 + 41z*6 + 2z*3 wrt z? 1440z*3 Let b(k) be the first derivative of 511k*4/4 + 2k*3/3 + 103k + 1104. What is the third derivative of b(l) wrt l? 3066 Let y(r) be the third derivative of -r6/30 - r5/15 - 61r4/24 - 2438r*3/3 - 709r*2 - 4r. What is the first derivative of y(x) wrt x? -12x2 - 8x - 61 Suppose 0 = -f + 137 - 87. Differentiate 48n4 + 0n3 - n3 + 0n3 + 50n*4 + f wrt n. 392n*3 - 3n*2 Let o(w) = -85757w*2 - 53766w - 34. Let y(z) = 61255z2 + 38404z + 24. Let c(t) = 12o(t) + 17y(t). Find the second derivative of c(f) wrt f. 24502 Let s(f) be the third derivative of 7571f6/120 - 423f5/20 + f4/8 + 82f2 + f - 50. Find the third derivative of s(y) wrt y. 45426 Let c(k) be the third derivative of -29/6k*3 + 0 - 41/60k*5 + 0k + 0k4 + 30k*2. Find the first derivative of c(n) wrt n. -82n Let p(g) be the second derivative of 1989g5/20 - 3683g*3/3 + 29g + 55. What is the second derivative of p(m) wrt m? 11934m Let h(r) = -r2 + 18r*2 + 2 + 7r*2 + 5r. Let u be h(-3). Differentiate 26l2 + ul - 104l - 99l + 5 with respect to l. 52l Suppose -9 = -a + 2. Suppose 4 + a = 3n. What is the first derivative of -22h3 + 7 - n + 15 wrt h? -66h*2 Suppose -15 + 10 = -b. What is the third derivative of 7w*5 + 7 + 36w*5 - 9w*2 + b - 16 wrt w? 2580w*2 Suppose -4o + 36 = -124. Let l = 45 - o. Find the third derivative of lz2 + 15z*4 - 11z*4 + 14z*4 wrt z. 432z Let y(h) = 3987h2 - 4311h + 112. Let g(b) = -1995b2 + 2155b - 64. Let z(x) = 7g(x) + 4y(x). What is the second derivative of z(o) wrt o? 3966 Let y(k) = -6663k3 - 5k*2 - 301k. Let h(z) = -13305z3 - 11z*2 - 601z + 1. Let x(d) = -2h(d) + 5y(d). Find the third derivative of x(u) wrt u. -40230 What is the third derivative of 403f5 - 7f + 19f2 - 203 - 36f*6 + 44f*6 - 9f*2 - 11f*2 wrt f? 960f*3 + 24180f*2 Find the second derivative of -2334 - 1997t + 1163 - 5843t + 1171 + 9574t*2 wrt t. 19148 Suppose -9q - 259 = -2q. Let v = q + 67. Find the third derivative of 58y*2 - 22y*5 + 4y*5 - vy*2 - 31y*2 wrt y. -1080y*2 Let o = 127 + -101. Find the first derivative of o - 77 + 56v + 7 - 43 wrt v. 56 Let a(n) be the second derivative of 161n4 - 1092n*2 - 801n. Differentiate a(y) with respect to y. 3864y Let u(q) = 2q*2 + 21q + 14. Let j be u(-10). Differentiate 520x4 - x + 20 - 1 - 596x*j with respect to x. -304x*3 - 1 Suppose -k = b - 2b + 356, 5k + 3b = -1748. Let g be ((-3)/(-2))/((-66)/k). Differentiate 5p - gp + 11 + 3p4 + 3p wrt p. 12p3 Suppose 14o - 48 = 6o. Find the third derivative of 3p*2 + 298p*6 - 120p*6 + 2p - 88po wrt p. 10800p*3 Let h(f) = 10587f*2 - 8208f - 21. Let n(u) = -2647u2 + 2052u + 5. Let d(z) = -5h(z) - 21n(z). Find the second derivative of d(q) wrt q. 5304 Let o(c) = -3c + 2. Let t be o(2). Let i be -3 - (t - -2) - -8. Find the first derivative of 18 + 13 + i - 2 - 22u wrt u. -22 Find the third derivative of -1104l - 1088l + 6l6 - 58l*5 + 2179l + 42l2 - 79l*5 wrt l. 720l*3 - 8220l*2 Let f(h) = 40h + 83 + 45h - 2h*2 - 93h. Let d(z) = -z*2. Let o(n) = -4d(n) + f(n). What is the first derivative of o(y) wrt y? 4y - 8 Find the third derivative of 3295b*2 + 3176b*5 - 6340b*5 - 343b*3 + 3170b*5 wrt b. 360b*2 - 2058 What is the third derivative of 3503z*2 + 4z - 220758 + 908z3 + 220758 - 4z wrt z? 5448 Let c(r) = 2r3 + r2 + r - 1. Let g(z) = 4436z*3 - 12z*2 + 381z + 3. Let v(s) = -3c(s) - g(s). Find the third derivative of v(f) wrt f. -26652 Let c(o) be the third derivative of 1/8o*4 - 5/24o*6 + 0 - 137o*2 + 0o - 11/6o3 + 0o*5. What is the second derivative of c(s) wrt s? -150s Let x(d) = d*3 - 5d*2 + 4d + 5. Let b be x(4). Find the second derivative of 127z + 15z*b + 9z*4 + 105z - 8z4 wrt z. 300z*3 + 12z*2 Let o(z) be the third derivative of -19z*6/30 - 9z*4/8 + 252z*3 - 6z*2 + 115. Differentiate o(m) wrt m. -228m*2 - 27 Let y(v) = 6v + 203. Let a be y(-24). Find the second derivative of -10w3 - 30w + aw - 2 + 4w*4 + 1 - 9w wrt w. 48w2 - 60w Let d(f) be the third derivative of -41/3f3 + 23f*2 - 5/24f*4 + 2 + 0f. What is the derivative of d(j) wrt j? -5 Let y = 153 + -128. What is the second derivative of 578d3 - 11d - yd - 580d*3 - 23d*4 wrt d? -276d*2 - 12d Let z(c) be the second derivative of -c*8/28 + 4383c*5/20 + 13c*4/12 - 77c3/3 + c2 - 11533c. What is the third derivative of z(i) wrt i? -240i*3 + 26298 Let k(r) = 71r*2 - 12r - 8. Let t(b) = -26b2 + 60b*2 - 16b - 23 - 18b + 180b*2. Let h(m) = 17k(m) - 6t(m). What is the derivative of h(u) wrt u? -154u Let f(h) = -4h + 18. Suppose 0 = -5y + 2q + 18, 4 = -2y - q + 13. Let j be f(y). Find the third derivative of 2 + 12u6 + 1334u*2 - j - 1294u*2 wrt u. 1440u*3 Let i(s) be the first derivative of 0s*2 + 3/4s*4 - 20s - 44/3s3 + 133. What is the derivative of i(n) wrt n? 9n*2 - 88n What is the first derivative of 1164 - 120f4 + 19f*4 + 455f**4 -	{ "pile_set_name": "DM Mathematics" }
t is the smallest common multiple of 4 and 2 + -284(-6)/24? 292 Let t = 71 + 4. Find the common denominator of (-100)/t43/(-10) and -43/18. 90 Let v = -212 + 8051/38. Calculate the common denominator of v and 19/2. 38 Let f(g) = -g + 3. Let k be f(0). Calculate the common denominator of 8/14 + 0 + 282/(-28) and (2/k)/(24/582). 6 Calculate the common denominator of 931/741 + 4/(-24) and 103/52. 156 Let p(i) be the second derivative of -i*4/12 + 11i*3/6 + 6i*2 - 11i. Calculate the lowest common multiple of p(10) and 10. 110 Suppose 2 = 6h - 10. Calculate the smallest common multiple of h and 10. 10 Let p(q) = 2q*3 - 4q*2 + 16q - 27. Calculate the least common multiple of 7 and p(2). 35 Suppose -q + 104 = 5t, -8t + 2q = -3t - 92. Calculate the smallest common multiple of 70 and t. 140 Let g be (6 - 3) + (-223)/86. Let t = -703/301 + g. What is the common denominator of t and 97/10? 70 Let u = -430 - -5991/14. Let f = -150027/460 + 1636/5. Calculate the common denominator of u and f. 644 Let h = -408 + 8590/21. Calculate the common denominator of 46/(-30) - 1/2 and h. 210 What is the common denominator of (2 + (-51)/(-9))18/20 and 4/(-40)(-87)/(-24)? 80 Suppose -r - z = 8 + 4, 4z = r + 2. Let l(s) = s3 + 11s*2 + 7s - 16. What is the least common multiple of l(r) and 272? 1904 Let z(v) = -2v2 + 9v + 3. What is the smallest common multiple of 12 and z(3)? 12 Let z = 147187/37 + -7955/2. Find the common denominator of z and -29/78. 2886 Let h = 783109273690243175482737397/126433560 - 6193840256418020427. Let r = -2458/95783 + h. Let o = r - -1/1320. Find the common denominator of o and 97/2. 2 Suppose d - 3m = -m, -4d - 15 = -3m. What is the common denominator of 54/11 and (-8)/d - 155/30? 66 Let f = 199 + -189. Calculate the lowest common multiple of 5 and f. 10 Let w(c) = -c2 + 8c - 5. Let z be w(7). Let p = z - -10. Calculate the smallest common multiple of 8 and p. 24 Suppose 0 = -5x - 25, -h + 4 = -2h - x. Let c be (3/(-2))/(h/1278). Let z = c - -15295/8. Find the common denominator of 11 and z. 8 Suppose -207 = -14k - 39. Let r(w) = w3 + 8w*2 + 7w - 2. Calculate the smallest common multiple of k and r(-5). 228 Let z = 4 + -2. Calculate the least common multiple of (-5)/(-20)3 - (-6)/(-72)-831 and z. 70 What is the smallest common multiple of 357 and (-514/(-7))/((-84)/(-882))? 2142 Let l = 10244 - 19983/2. Let s = -267 + l. Calculate the common denominator of -103/38 and s. 38 Let l = -526453/210 + 7522/3. Calculate the common denominator of l and 61/56. 280 Let t(p) = -p2 - p + 5. Let k be t(0). Suppose -kn - 1879 - 1886 = 0. Let b = 15067/20 + n. What is the common denominator of b and -49/2? 20 Let h(k) = k*2 - 11k + 14. What is the least common multiple of 14 and h(-21)? 686 Let v = -93 + 120. Calculate the least common multiple of v and 21. 189 Let i = 42 + -29. Let w(a) = a*3 - 14a*2 + 12a + 31. Suppose -1 = 2j - 3, -3c + j = -89. Calculate the smallest common multiple of w(i) and c. 90 What is the common denominator of (1092/18)/((-16)/(-12)) and 101/102? 102 Let q(n) = n*2 + 11. Suppose -16z - 52 = -4. Calculate the least common multiple of 62 and q(z). 620 Calculate the common denominator of -31/416 and (-134)/469 - 1203/(-1638). 1248 Suppose -d - 17 - 68 = -5a, -4a + 4d + 68 = 0. What is the common denominator of (-2)/a + 3561/(-1377) and -46/3? 27 Suppose -3z + 6r + 4 = 4r, -4 = -4r. Suppose -2i + 22 = 5o, 0o + 4 = 4o + 5i. What is the least common multiple of o and z? 6 Suppose -3w - 2n = -18, 5w + 6 = 6w - 4n. Calculate the smallest common multiple of w and 33. 66 Suppose 4b - 26 = -2r, -19r = 3b - 22r - 42. What is the lowest common multiple of b and 197? 1773 Suppose h = -k + 23, 4k + 7 + 13 = 0. Suppose 50 = 4a + a. What is the smallest common multiple of h and a? 140 Suppose 4 + 4 = 4k. Let b = 54 - 52. Suppose m + 28 = 3p + bm, -m - k = 0. What is the least common multiple of 4 and p? 20 Suppose 0 = -3k + 39 + 39. Suppose -t + p = -4p - k, -t - 10 = 4p. Calculate the smallest common multiple of -7(-12)/1 and t. 42 Let v = -85 - -100. Calculate the smallest common multiple of v and 87. 435 Let z = 8 + -6. Suppose -f - 5t = f - 12, zf = 4t - 6. Calculate the least common multiple of 3 and (18/(-21))/(f/(-7)). 6 Suppose -2h - 13 = -69. Calculate the least common multiple of 7(-20)/(-15)18/h and 16. 48 Let b = -393/38 + -167/95. Find the common denominator of ((-249)/(-10))/(-11 - 1) and b. 40 Suppose -s - 2n + 11 = n, -4n - 12 = 0. What is the common denominator of -8/9 and (-1)/2 + (-174)/s? 45 Let t = 293 - 261. Calculate the smallest common multiple of 10 and t. 160 What is the common denominator of (-120)/(-2240) + (2 - 0/(-1)) and (-2)/(-5)1515/(-72)? 168 What is the least common multiple of (-4)/(-16) - 188/(-16) and 3? 12 Let x(f) = 4f. Let m be x(0). Suppose -3o + 6 + 0 = 0. Suppose m = ot - t - 9. Calculate the smallest common multiple of 5 and t. 45 Let g = 841 - 839. What is the smallest common multiple of 25 and g? 50 Find the common denominator of (274/(-960))/1 + (-154)/(-385) and -107/28. 672 Suppose 2u - 2r + 18 - 450 = 0, 4r = 0. What is the smallest common multiple of 132 and u? 2376 Let d = 114 + -745/7. Calculate the common denominator of -63/430 and d. 3010 Let t(y) = y2 - 8y + 2. Let i be t(7). Let j(b) = b*3 + 4b*2 - 4b + 6. Calculate the least common multiple of ((-2)/1)/((-2)/10) and j(i). 10 Let z = -1758 + 15790/9. Let f be (-52)/(2/1 - (-48)/(-18)). What is the common denominator of z and ((-66)/(-8))/(2 - f/36)? 18 Let p(t) = -4t - 7. Let y be p(7). Calculate the least common multiple of 20 and 448/y10/(-4). 160 Let v be ((-4)/(-8))/(1/(-2)). Suppose -2 - 2 = 5t + d, -t - 16 = 4d. What is the common denominator of 156/(-15)(t + v) and 4/3? 15 Suppose 21 = w + y, -3w + 2y + 65 + 13 = 0. What is the lowest common multiple of 8 and w? 24 Suppose -8d + 3d - 10 = 0. Let i be 70/d(-24)/20. Suppose i = -m + 4m. What is the lowest common multiple of m and 10? 70 Let y = -121375/14 + 8664. Calculate the common denominator of y and 4/(-48)(-276)/9. 126 Suppose -6f + p + 15 = -2f, 5f + 5p - 25 = 0. Suppose 30r = 32r - f. Calculate the smallest common multiple of r and 6. 6 Let r(q) = 7q2 - q - 2. Suppose 3t + d = 11, 0 = -7d + 6d + 5. Calculate the lowest common multiple of r(-1) and t. 6 Suppose 2l - 57 = -1. Suppose 29m = 32m - 36. What is the smallest common multiple of l and m? 84 Let k be (-234)/(-15) - (-2)/5. Suppose km = 13m + 48. Calculate the lowest common multiple of 4032/12 and m. 80 Let v be ((-237)/(-21) - 3) + (-6)/21. Find the common denominator of 3/1047/3 and (378/15 + 4)/v. 20 Let s(o) = 2o + 8. Let c be s(-8). Let g(l) = -l + 2. What is the lowest common multiple of 21 and g(c)? 210 Let r(z) = -z3 - 3z*2 - 14z - 18. What is the lowest common multiple of 6 and r(-4)? 54 Let p = -2057996118 + 160514578079/78. Let w = -1383144/13 - p. Let v = 10491 - w. Find the common denominator of 59/30 and v. 30 Let v(u) = -37u - 21. Let c be v(-5). Suppose 0 = 3n + 5k - c, 5n - 2k = 50 + 182. What is the lowest common multiple of n and 6? 48 What is the common denominator of (-18)/(-6) - (-33)/16 and (-3)/1 + -4 + (-152)/(-18)? 144 Let y = 5/5653 - -785677/101754. Let w = -43281/32 + 1355. Calculate the common denominator of y and w. 288 Let w be (-7 + 137413/19630)(-4)/3. Let t = -1050193/58890 + w. What is the common denominator of 75/8 and t? 24 Suppose 66 = 70r - 64r. What is the smallest common multiple of r and (2/3)/(4/42)? 77 Let i = 29271/75808 + -5/7107. Calculate the common denominator of -13/132 and i. 1056 Calculate the common denominator of -35/4 and ((-13)/(-4))/(5/((-75)/33)). 44 Let m(h) = 6 - 2 - 5h + h2 - 1. Calculate the lowest common multiple of (48/60)/(2/15) - 2 and m(6). 36 Suppose -3i + 15 = 0, -i = r + 4i - 23. Calculate the lowest common multiple of (14 - (3 - 1)) + r and 4/(-3)(-15)/2. 10 Let b = -1730 - -1730. Let l be (55 + 0/1)1. Suppose b = -3v - 4 + l. Calculate the least common multiple of v and 6. 102 Let p = 3617/150 + 4/75. Calculate the common denominator of p and 4/2273/(-16). 264 Let p(i) = 23i +	{ "pile_set_name": "DM Mathematics" }
3 13437 What is the product of -0.319 and -87? 27.753 Multiply -1555 and -58. 90190 Calculate -23511.9. -4466.9 Product of -0.594 and 2731. -1622.214 Product of 1.1174 and -0.3. -0.33522 What is the product of 0.0766 and -3? -0.2298 -0.14 times 9.5 -1.33 135.82 times -78 -10593.96 Multiply -0.3 and -0.80196. 0.240588 63.38 9.4 595.772 16199 * -196 -3175004 Calculate -45.74555. -228.7275 0.1045 3.2 0.3344 What is the product of 8.2813 and -0.1? -0.82813 Work out -188 * -20.08. 3775.04 Multiply -4 and 1597.93. -6391.72 Multiply 0.0354 and 0.6. 0.02124 Calculate 9064-63. -571032 Multiply 0.0739112 and 4. 0.2956448 116.404-0.4 -46.5616 Calculate -0.4-10897. 4358.8 -0.70462-0.2 0.140924 Calculate 0.23978. 224.94 Multiply 1530 and -0.06. -91.8 What is -0.46 times 8.3? -3.818 What is -0.004 times 40977? -163.908 -25945 times -0.24 6226.8 Multiply -0.651 and -0.41. 0.26691 What is the product of 10621 and -8? -84968 110 0.31 34.1 Calculate -781-0.264. 206.184 Work out -31120 0.9. -28008 Calculate -3-0.07302. 0.21906 207 times 12.18 2521.26 Work out -98.6 -135. 13311 What is -0.3081 times -10.9? 3.35829 00.7853 0 Work out 6 573. 3438 -0.14 times 830 -116.2 60-4161 -249660 What is 0 times -1730.54? 0 -0.023705 55 -1.303775 -0.2342 times -35 8.197 0.0394 times -107 -4.2158 Product of 3 and 260104. 780312 4.43206 * 0.15 0.664809 13110.085 111.435 What is -0.262301 times 1? -0.262301 -203017 -142107 -14 * -32151 450114 Multiply 0.4 and 30.819. 12.3276 Product of -0.6 and -209.65. 125.79 Multiply -134 and 0.0773. -10.3582 -0.034931 times 0.1 -0.0034931 -703770 times -2 1407540 Calculate 0.4934-0.0794. -0.03917596 What is 78627.3 times 0.01? 786.273 What is -2 times -11.008? 22.016 What is -3.93 times 116? -455.88 What is -18.99 times 0.7? -13.293 10066.9 times -0.3 -3020.07 -30 times 1245 -37350 Multiply -888121 and -0.8. 710496.8 2 19731 39462 Calculate 3.1-639. -1980.9 What is 0.2 times -14054? -2810.8 1887 times 21 39627 -491 2.6 -1276.6 0.08 * -5630 -450.4 What is the product of 457640.7 and -0.3? -137292.21 Multiply 0.17 and 706. 120.02 What is -0.5 times -1343019? 671509.5 What is -2 times 0.010016? -0.020032 What is 500446 times 1? 500446 Work out 3 * 21595. 64785 Multiply 11 and 395. 4345 -7-7231 50617 -28 20342.9 -569601.2 Calculate 6.55-0.067. -0.43885 -1.133-1797 2036.001 Work out 1 * 1342222. 1342222 2 times 20157 40314 199585 times -0.5 -99792.5 0.4 times 4255 1702 Work out -1036 * 1.08. -1118.88 Work out 3565 * 25. 89125 Multiply -0.074 and -0.0314. 0.0023236 Multiply -15910 and -9. 143190 What is the product of -10141 and 0.006? -60.846 3 times 16591 49773 What is -0.71 times -4259? 3023.89 Calculate -2504.830.8. -2003.864 -0.2 292458 -58491.6 Work out -2413.84 * -6. 14483.04 1 times -9458 -9458 Multiply 78106 and -0.3. -23431.8 -685 * -35.5 24317.5 Product of -0.83 and 1854. -1538.82 Calculate -0.5-90998. 45499 0.2482 times 14.11 3.502102 Multiply -1.5 and -3176. 4764 Work out 5.79 1558. 9020.82 -364998 times -0.2 72999.6 0.2680.398 0.106664 5857811 644358 What is the product of -0.251 and -13273? 3331.523 -0.02119857 -2397.14 Multiply 5.294 and -51. -269.994 -95840 times -4 383360 -0.4 times 1.6677 -0.66708 What is the product of 480 and -1.26? -604.8 -4 -79.92 319.68 Product of -0.3 and 7507. -2252.1 -10.2 * -2809 28651.8 Multiply -5 and -0.05139. 0.25695 -4 * -1.572 6.288 Work out -0.3 * -0.0787. 0.02361 Product of 13564 and 3.9. 52899.6 Multiply -1.4 and 8070. -11298 Multiply 43.36693 and 0. 0 Multiply -247 and -0.079. 19.513 Product of -2 and -0.6855. 1.371 Multiply 11884 and 0.42. 4991.28 Product of 8 and 58.1. 464.8 -0.02725 times -0.63 0.0171675 0.5-0.036531 -0.0182655 What is 22.61 times -1.2? -27.132 Work out 8.469 -2. -16.938 0.28038 times -0.2 -0.056076 Work out 538 * -2.64. -1420.32 What is -5 times -145127? 725635 Multiply -26800 and 5. -134000 3 * -36810 -110430 93.2-132 -12302.4 Product of 0.2 and 1888. 377.6 Multiply 41 and -0.069. -2.829 Calculate 08276. 0 0.120065 * -9 -1.080585 Product of 5 and 469.41. 2347.05 Product of 4362.6 and 0.2. 872.52 Multiply -170587 and -5. 852935 Multiply 26079 and -0.1. -2607.9 What is -5709 times -0.3? 1712.7 Multiply 144.211 and -5. -721.055 Calculate 11.68690. 0 Product of 0.85902 and -0.03. -0.0257706 Product of 170203.4 and -0.1. -17020.34 Multiply 3 and -32362. -97086 Product of -1247 and -2. 2494 Work out -0.3 -0.01137. 0.003411 Work out -0.4 * -13703. 5481.2 Work out -9 * 331.7. -2985.3 0.0434892 times -0.4 -0.01739568 Work out 19430 * -0.4. -7772 What is the product of -31530 and 0.01? -315.3 -58 times 0.783 -45.414 0.11-174593 -19205.23 -2.684 0.061 -0.163724 2.4409954 9.76398 What is the product of 73 and -0.0499? -3.6427 What is the product of -0.4015 and 0.5? -0.20075 What is the product of 4.5738 and 0.12? 0.548856 What is the product of -31754 and -183? 5810982 Product of -6717 and -5. 33585 1086 times 1542 1674612 -81 times -5.429 439.749 -381 times -0.312 118.872 Product of -351855 and -0.07. 24629.85 Work out 1.63 0.4338. 0.707094 Multiply 1814 and -0.009. -16.326 -9097 times -0.75 6822.75 -1201.55 * -0.1 120.155 1.650722 * -0.2 -0.3301444 -0.50.098994 -0.049497 Work out -0.28 -91. 25.48 Multiply 0.4 and 0.20273. 0.081092 Multiply -0.1558 and -3.6. 0.56088 Multiply -390916 and -3. 1172748 What is -958184.5 times 0? 0 0.011 * -49 -0.539 What is the product of -1.006 and 15.25? -15.3415 -1-4631 4631 293 -265.5 -77791.5 Work out -4789 * 79. -378331 Work out -35428 * -20. 708560 Product of 10 and 24511. 245110 Calculate 0.011-6719. -73.909 Multiply 0.5 and 0.06202. 0.03101 What is 125968.9 times 0.5? 62984.45 Calculate -90.07303. -0.65727 89 times -67 -5963 What is the product of -0.58 and -1.08888? 0.6315504 Calculate 0.034570.021. 0.00072597 -16 -1.4223 22.7568 Calculate 93.6-12.3. -1151.28 Multiply -112 and -0.0651. 7.2912 Multiply -197 and -954. 187938 Product of -126.9 and -0.016. 2.0304 -14 times -0.006683 0.093562 -0.6 202357 -121414.2 Work out 0.09 * 164733. 14825.97 What is 22.3 times 1.5? 33.45 Product of -3.935 and 0.08. -0.3148 -208 * 626 -130208 Product of -0.132 and -0.4607. 0.0608124 Work out 1 * -1093.1. -1093.1 Calculate 2432.51.7. 4135.25 Calculate -613-0.07235. 44.35055 4 * 1.3388 5.3552 Product of -0.392 and 31. -12.152 Product of 4282.3 and 0.7. 2997.61 What is -4 times -1409.1? 5636.4 Calculate 0.042-111.18. -4.66956 274 5855 1604270 -33569 * 3 -100707 Product of -0.25 and 259. -64.75 -2.3 times -5758 13243.4 What is the product of 0.04 and -232620? -9304.8 Multiply -1 and 18389. -18389 6.1-0.08 -0.488 Multiply 3748.8 and 11. 41236.8 What is the product of 0.637 and -2104? -1340.248 0.2 43.08 8.616 What is 0.1 times 6.41097? 0.641097 What is 449079 times -3? -1347237 What is -5258 times 1.99? -10463.42 Calculate -34000-5. 170000 What is the product of -0.04 and 4.3654? -0.174616 0.1 17050 1705 -10 times 133 -1330 Calculate 1.9020.8. 1.5216 Multiply -0.1041 and -1.2. 0.12492 Calculate 8973-15. -134595 Calculate -187570.4. -7502.8 Calculate -4304560. -1218240 Product of -477579 and 0.3. -143273.7 Work out -0.404675 * -0.3. 0.1214025 -1.4 * 1402 -1962.8 -6.1 * -2.164 13.2004 Multiply 1.3 and -19362. -25170.6 829359 * 0.5 414679.5 What is 2.55 times -8.1? -20.655 Product of 20 and -284.13. -5682.6 Multiply 851 and 444. 377844 What is -43 times -1076? 46268 -933545 times 0.2 -186709 Calculate -490.3-0.02. 9.806 24665.53-0.5 -12332.765 What is the product of -0.36 and 0.0962? -0.034632 1784117 208728 What is the product of -1.604 and -0.029? 0.046516 What is the product of -1206 and 0.118? -142.308 Calculate 0.06254500. 3379 Product of -70 and -857. 59990 Work out -0.017 * -1.5. 0.0255 Work out 0.8 * 8184. 6547.2 86677 times 5 433385 1244 * 2.9 3607.6 Work out 3181 * -186. -591666 Multiply 77.24 and 3. 231.72 What is the product of -3 and -9343? 28029 23.9-2705 -64649.5 1479642 0 0 Work out -50 * 38. -1900 1183 354 Work out -0.00202 15. -0.0303 0 * 1.5654 0 -60-1.789 107.34 Product of -9 and 328. -2952 What is the product of 980 and -4986? -4886280 -55-0.157 8.635 Product of 4.04 and 76. 307.04 Product of -0.9 and -2552. 2296.8 0.1 * 0.1 0.01 -0.191 times	{ "pile_set_name": "DM Mathematics" }
287088x/11 - 287096/11 = 0. -2, -2/5, 1, 35887 Solve 2c*2/7 + 28286c/7 - 11753976/7 = 0 for c. -14547, 404 Factor 3u2 + 27597u + 5478564. 3(u + 203)(u + 8996) Find m such that -2m2/5 + 128154464m/5 - 2052945830390912/5 = 0. 32038616 Determine y so that -4y3 + 1520688y*2 - 27371088y = 0. 0, 18, 380154 What is q in 5q5 + 11955q*4 - 5631935q*3 - 5655835q*2 + 5631930q + 5643880 = 0? -2794, -1, 1, 404 Factor -5y2 + 62893480y + 125786980. -5(y - 12578698)(y + 2) What is d in -40d3/3 + 25852d2 = 0? 0, 19389/10 Suppose -r2/9 + 993299r/9 - 662198/3 = 0. Calculate r. 2, 993297 Suppose u5 - 8992u*4 - 316647u*3 + 6339310u*2 - 21269812u + 19859400 = 0. Calculate u. -50, 2, 11, 9027 Let -2p2/9 + 243362p/3 - 3650380/9 = 0. What is p? 5, 365038 Factor -2t3 - 177660t*2 - 532962t. -2t(t + 3)(t + 88827) Find m, given that -484m*3/3 + 1176956m*2 + 2140320m + 2918800/3 = 0. -10/11, 7297 Solve -2r3/3 + 9484r*2/3 - 3129414r - 1522331712 = 0 for r. -352, 2547 Suppose -1458l5 + 118948986l*4 + 753408648l*3 - 537516416l*2 + 122058752l - 9138080 = 0. What is l? -7, 2/9, 81590 Suppose 4v4 + 41600v*3 + 3884704v*2 + 99507456v + 774681408 = 0. Calculate v. -10306, -58, -18 Suppose 5u4/6 + 55661u*3/6 + 5566u*2/3 = 0. What is u? -11132, -1/5, 0 Factor -2n*2/13 + 20549720n/13 - 52786374009800/13. -2(n - 5137430)2/13 What is k in 3k*3 + 6777k*2 - 3434436k + 17002380 = 0? -2686, 5, 422 Let -70i3 + 132295i*2 - 8540420i - 610705 = 0. Calculate i. -1/14, 67, 1823 Factor -4z2 - 60384z - 2408960. -4(z + 40)(z + 15056) Determine t, given that -5t3 - 2995t*2 - 216220t + 3328000 = 0. -512, -100, 13 Suppose 18v5 - 9141v*4/2 + 155067v*3 - 279798v*2 - 24396v = 0. Calculate v. -1/12, 0, 2, 38, 214 Factor 2v5/9 + 2056v*4/3 + 717046v*3/9. 2v*3(v + 121)(v + 2963)/9 Factor -2g*3/13 - 27646852g*2/13. -2g*2(g + 13823426)/13 Factor 4q2 + 3428q - 1411776. 4(q - 304)(q + 1161) Find s, given that -2s4/9 + 10754s*3/9 - 96604s*2/9 - 107360s/9 = 0. -1, 0, 10, 5368 Let 5z4 + 1570z*3 - 14680z*2 - 37328130z - 2308134285 = 0. What is z? -193, -81, 153 Find k, given that -k*4/3 - 1465k*3 - 26333k*2/3 + 1465k + 8778 = 0. -4389, -6, -1, 1 Suppose 5j4 - 11855j*3 - 27885165j*2 - 16596012125j - 3122420930860 = 0. What is j? -539, 3988 Factor -2l3/11 + 165746l*2/11 + 14958768l + 40597521696/11. -2(l - 83857)(l + 492)*2/11 Determine y so that 4y*5 - 6528y*4 - 17108236y*3 - 10244724040y*2 - 1907869429200y + 1918131268000 = 0. -530, 1, 3221 Determine q so that 2q4/7 - 5952q*3/7 - 349782q*2/7 - 6546812q/7 - 38519664/7 = 0. -23, -12, 3034 Suppose 2m2/9 - 19294m/9 - 6434700 = 0. What is m? -2403, 12050 Factor 2o3/9 + 114626o*2/9 + 30349004o/9. 2o(o + 266)(o + 57047)/9 Let -125841m*3/5 - 880892m*2/5 - 755081m/5 - 6 = 0. What is m? -6, -1, -5/125841 Factor 2t2/3 + 45094132t/3 + 254185092604178/3. 2(t + 11273533)2/3 Find u such that 3u*5/2 + 24186u*4 - 387393u*3 - 532488u*2 + 4260807u/2 - 1234710 = 0. -16140, -3, 1, 17 Find v, given that 507v2/4 - 3046719v/2 + 18308671923/4 = 0. 78121/13 Find h such that 2h5/15 - 58h*4 + 120748h*3/15 - 1714712h*2/5 - 3592752h/5 = 0. -2, 0, 89, 174 Suppose -3w5/2 + 189w*4/2 - 939w*3 - 19872w*2 + 42768w = 0. What is w? -11, 0, 2, 36 Factor -3m2/5 - 5309m/5 - 71996/5. -(m + 1756)(3m + 41)/5 What is c in 2c3 - 213260c*2 + 5330142c + 11513340 = 0? -2, 27, 106605 Let -2c3/9 + 1564c*2/9 - 404600c/9 + 3851792 = 0. What is c? 238, 306 Find q, given that -q*4 + 83q*3 + 4489q*2 - 22595q - 214200 = 0. -40, -5, 9, 119 Determine d, given that 2d5/3 + 1390d*4/3 - 5158d*3 + 40970d*2/3 + 15472d/3 - 14120 = 0. -706, -1, 1, 5, 6 Let j*5 - 14107j*4 + 126877j*3 + 70643j*2 - 2157134j + 1973720 = 0. Calculate j. -4, 1, 5, 7, 14098 Factor -3h3/2 - 682503h*2/2 - 1706220h. -3h(h + 5)(h + 227496)/2 Factor 16v*3/7 + 208504v*2 + 33398269633v/7 + 5174671731996/7. (v + 156)(4v + 182129)2/7 Solve i2/8 + 111867i/8 + 24747425/2 = 0 for i. -110975, -892 Suppose -u5/4 - 975u*4/4 + 95077u*3/4 - 2062753u*2/4 - 1717098u - 1177397 = 0. What is u? -1066, -2, -1, 47 Factor -2t4 + 32164t*3 - 179201160t*2 + 379279162800t - 186847884648000. -2(t - 5130)3(t - 692) Factor -m*2/4 - 1227373m - 1506444481129. -(m + 2454746)*2/4 Let -2f*4/13 - 332116f*3/13 - 13788958050f*2/13 - 110290410000f/13 = 0. What is f? -83025, -8, 0 Find i, given that 2i4 - 334i*3 - 33666i*2 - 335250i + 1317600 = 0. -61, -15, 3, 240 Let i*3/4 - 3859723i*2/2 - i/4 + 3859723/2 = 0. What is i? -1, 1, 7719446 Find g such that 4g*3 - 74436g*2 - 58620192g - 11307942608 = 0. -382, 19373 Determine p, given that 3p4 + 3552570p*3 + 7105131p*2 + 3552564p = 0. -1184188, -1, 0 Find o such that o*2 - 150054o - 3451771 = 0. -23, 150077 Let x*2/3 - 1702181x/3 + 1702180/3 = 0. Calculate x. 1, 1702180 Solve 2f4/19 + 232442f*3/19 - 2789502f*2/19 + 10460862f/19 - 12553164/19 = 0. -116233, 3, 6 Solve 3s2/4 - 930009s/4 + 2324985/2 = 0. 5, 309998 Suppose -9g3/2 + 352929g*2/4 + 2412543g/4 - 205947/2 = 0. What is g? -7, 1/6, 19614 What is o in 2o4/3 - 200o*3/3 + 3434o*2/3 - 6348o + 8640 = 0? 2, 9, 80 Find n such that 2n4/13 - 13938n*3/13 - 589098n*2/13 + 1220002n/13 - 616968/13 = 0. -44, 1, 7011 Find g, given that 2g3 - 447924g*2 - 447930g + 895852 = 0. -2, 1, 223963 Determine p, given that -2p4/3 - 3739702p*3/3 - 582724416982p*2 - 1748162031850p/3 + 3496339022500/3 = 0. -934925, -2, 1 Solve y*3/5 + 60194y*2/5 - 300991y/5 + 240796/5 = 0. -60199, 1, 4 Factor 9h3 + 21325380h*2 + 21325371h. 3h(h + 1)(3h + 7108457) What is n in -3n3 + 72417n*2 - 440079957n + 36885425895 = 0? 85, 12027 Solve 4z2/7 - 28180z/7 - 1447584/7 = 0 for z. -51, 7096 Suppose -2u3/7 - 7978u*2/7 - 363394u + 12253949338/7 = 0. Calculate u. -2489, 989 Solve -2d3/15 + 3844d*2/15 - 443638d/5 = 0 for d. 0, 453, 1469 Solve -7188r2 - 1344424r - 50116 = 0. -187, -67/1797 Factor -2d2/9 - 89932d + 7285950. -2(d - 81)(d + 404775)/9 Suppose -3l3 + 105882l*2 - 2539797l + 12591390 = 0. Calculate l. 7, 17, 35270 Factor 2f2/5 - 126016f/5 - 3277768/5. 2(f - 63034)(f + 26)/5 What is p in p*4/9 + 479p*3 - 143365p*2 + 90071825p/9 + 161051500/3 = 0? -4596, -5, 145 Factor -14f2/5 + 39862f + 113896/5. -2(f - 14237)(7f + 4)/5 Solve -2u*5 + 226436u*4 + 1358664u*3 + 2717356u*2 + 2264474u + 679344 = 0. -3, -1, 113224 Factor -284o3 - 1999356o*2 - 3518845440o + 49561600. -4(o + 3520)2(71o - 1) Find z, given that -836z*4 + 172224z*3 + 346128z*2 - 3328z = 0. -2, 0, 2/209, 208 What is f in 4f4/3 - 59536f*3 - 6792320f*2/3 - 8341952f - 24311360/3 = 0? -34, -2, 44690 What is j in 2j4 + 15076j*3 + 28455864j*2 + 169952048j - 453848192 = 0? -3766, -8, 2 Factor -2l3 - 32748l*2 - 132334818l + 14119273168. -2(l - 104)(l + 8239)2 What is v in -v3/5 - 22224v2/5 - 129113949v/5 - 61910621326/5 = 0? -10849, -526 What is r in -15r4 + 60598r*3 + 919705r*2 + 3162800r + 405500 = 0? -10, -5, -2/15, 4055 Determine m so that -m*5/4 + 12448m*4 - 124463m*3 + 796531m*2/2 - 1891731m/4 + 373365/2 = 0. 1, 3, 5, 49782 Factor -i*2/2 - 16464019i/2 - 16464017. -(i + 2)(i + 16464017)/2 Find z such that z2/2 - 21821z/2 - 766185 = 0. -70, 21891 Factor -2u3 - 1022u*2 + 489428u + 490448. -2(u - 302)(u + 1)(u + 812) What is n in -9n*5/7 - 2915669n*4/7 - 314820755926n*3/7 - 11325825624024000n*2/7 + 416967261408000000n/7 + 93218688000000000/7 = 0? -108000, -2/9, 37 Solve g*2/7 - 1811162g/7 + 820076947561/7 = 0. 905581 Find x such that -4x5 + 73616x*4 - 1029996x*3 + 2868784x*2 + 1030000x - 2942400 = 0. -1, 1, 4, 10, 18390 Determine a so that -3a5 + 582a*4 + 1347a*3 - 33678a*2 + 31752a = 0. -9, 0, 1, 6, 196 What is b in -2b3 + 3094b*2 + 330232b - 1370304 = 0? -104, 4, 1647 Let 5h2 + 927340h + 17617655 = 0. What is h? -185449, -19 Solve 2x*4/13 - 364	{ "pile_set_name": "DM Mathematics" }
- 0w + 2. Let c = w - x. Solve 5a + 2p + 15 = c, -2p + 5p = 0 for a. -3 Suppose o = -4a - a + 175, -4a - 2o + 146 = 0. Suppose 0 = 2b - 6, 5t + 3b - a = -0t. Solve 0k = -3w - 2k + t, 4w - 2k + 12 = 0 for w. -1 Let i(z) = z3 - 11z*2 - z + 14. Let y be i(11). Solve 2j - 4 = -3k - 6, 2k = 3j + y for j. -1 Let l(c) = -c3 + 14c*2 + 16c - 7. Let x be l(15). Solve -s - 2 = 0, -n - s = -6n - x for n. -2 Suppose 3t + x + 17 = 0, -2t - 4 + 10 = 5x. Let q = t + 11. Suppose 37 = 4w - 5k, 6w + 4k + 5 = w. Solve -3i + qd = 14, -2i + 25 = wi + 3d for i. 2 Suppose 3t - 14 = -2. Suppose p = -2p - ti - 17, -p + 4i = -5. Let a = p + 8. Solve -b + m + 6 = -0b, -4m = ab + 6 for b. 2 Suppose -u = -5u + 12. Suppose 5q = 3c + 51, -uq + 2q + 4c = -17. Solve -5k - 10 = 4s - qs, -2s + 5k = -10 for s. 0 Let n = 4 + -4. Let t be n/((4 - 0) + -3). Solve 0 = -3i - j, 2i + tj = -5j for i. 0 Let q be (-6 - -11) + 21. Suppose 59 = 4f + q. Solve o + 4w = w + f, 0 = -o + 4w - 22 for o. -2 Suppose 5s - 2x + 8 = 0, 4x - 5 - 11 = s. Solve 0l = -2l + 2, s = -2q - 2l - 2 for q. -2 Suppose -6 + 1 = -g. Suppose -10 = -3t + g. Suppose 0u - 7 = 2u + 3x, 4x + 17 = tu. Solve -y - 5c + 23 = 0, 0 = -y + 4y + c + u for y. -2 Let s(h) = -h - 2. Let w be s(-4). Suppose -wp - 2p + 12 = 0. Solve -3u + 3l = -p, -u - 16 = -2u + 4l for u. -4 Let i = -10 + 13. Solve 0q + 1 = 5s + q, -3q = -5s - i for s. 0 Let b be -4 + (-1 + 9)/1. Solve 0 - b = 3o + 5t, 0 = 4o + 4t for o. 2 Let i(l) = 6l - 44. Let q be i(10). Solve -4y = -4m + 16, -q = -3m + y + 4y for m. 2 Let m(f) = 4f*2 + 36f - 18. Let x(r) = r*2 + 12r - 6. Let u(y) = -2m(y) + 7x(y). Let h be u(9). Solve 4t = -5 - 3, -3t = 3l + h for l. -5 Let u(g) = -g2 - 8g - 7. Let p be u(-6). Suppose -c - 4d - 9 = 0, 2d - p = 7d. Let j be 7/2 + c/(-10). Solve -jf = -3s - 23, f + 5s + 25 - 2 = 0 for f. 2 Let d = -2 + 2. Solve -4n - 5j + j + 24 = d, 5n - 4j - 21 = 0 for n. 5 Suppose -2j - j = -12. Suppose -2q = 4s - 22, -5s + 12 = 3q - 19. Solve q = jy + 5b, 3y + 3b - 4 = 2 for y. 3 Let x be (16/(-12))/(2/(-3)). Let g = 7 - x. Solve 0 = 2y - y - 3f - g, 0 = -y + 4f + 5 for y. 5 Let a(f) = f + 8. Let u be a(-6). Let d(n) = -n - 2. Let x be d(0). Let c be (-4 - -1 - x)-5. Solve -2p = -1 - c, 5p = ul + 11 for l. 2 Let a be 56/10 + 6/15. Suppose -2k - 15 = 3y, -k - a = y - 1. Solve -s - c + k = -4, -4s - 20 = -5c for s. 0 Suppose -t + u + 6 = 0, -5t + u - 5u + 21 = 0. Solve -5i = -3d + t, -1 - 16 = 3i + d for i. -4 Suppose -5j - 2m = -47, -2j + 5m = j - 22. Let t be 2/(-4)(-4)/(-2). Let a be 6t4/(-6). Solve 3p = 4l - 7, -4p - al - 9 = -jl for p. -1 Let m(h) = -h + 12. Let q be m(12). Suppose -4w = -3u + 20, qu + 5u = w + 22. Solve -2l - 2n = -ul - 10, -1 = -l - n for l. -2 Let w = 0 + -1. Let z be -5(6/10 + w). Solve a + 2f - 3f - 5 = 0, zf = -8 for a. 1 Let n = -6 - -8. Solve s - 2a = 5s + n, 4a = -12 for s. 1 Suppose -20 = -5m - 5. Suppose -ml + 0r - 27 = 3r, 0 = -2l - r - 17. Let h be (-20)/l(3 + -1). Solve -3p + p + n = -2, hn = -p - 10 for p. 0 Suppose -24 = a + a. Let h = a + 7. Let b = 0 - h. Solve 5j = -l - 4, 0l - bl = -3j - 8 for j. -1 Suppose -y - 3x = -16, -4y = -x + 4x - 28. Let b = 1 + y. Let n be 0/((-41)/2). Solve 5c - c - 8 = n, 2f + 18 = bc for f. -4 Let s = -9 + 5. Let b(y) = -y*3 - 3y*2 + 2y - 5. Let w be b(s). Solve a - 8q + 3q + 23 = 0, 9 = -3a + wq for a. 2 Let n be -4 - -1 - (4 - 5). Let f be n/6 + 26/6. Solve -3x + 9 = -5v, -2v + 3v - 12 = -fx for x. 3 Let c(t) = t3 - 7t*2 - 8t - 8. Let s be c(8). Let y be (-1)/(-2(-1)/s). Solve -yw - 5 - 9 = 3g, -26 = 4w - 3g for w. -5 Let p(c) = -c3 - 7c*2 + 2c + 16. Let b be p(-7). Solve 0y - 5i - 30 = 5y, -by + 3i - 7 = 0 for y. -5 Let l = -1 - -3. Suppose -56a - 22 = -67a. Solve -au - 3z + lz = 6, -u - 4z = -4 for u. -4 Let q be (-1)/(-2)0/3. Solve 0j - 24 = 5j - 4f, -3j + 2f - 14 = q for j. -4 Let j = -12 + 15. Suppose 4d = jd. Solve 4t - 24 + 6 = 2x, x - 3t + 13 = d for x. -1 Suppose 4y = 2y. Suppose -5m + 0m + 10 = y. Solve f = -4s - 12, 0f - mf = 3s + 4 for f. 4 Let o = -26 - -29. Solve -5j + 0j + 5 = 4t, 4t + 3 = oj for t. 0 Suppose -63 + 15 = -4x. Solve -4d = d + 2l - 6, 0 = -5d + 4l - x for d. 0 Let l(h) = 3h - 16. Let t be l(7). Solve tg - 6r - 35 = -2r, 4g = r + 17 for g. 3 Let j = -22 - -40. Solve l + 3 = 2u - 0, 3l - j = -3u for l. 3 Let j(t) = -4t - 8. Let h be j(-8). Suppose q + b - 2 = 0, -h = -5q + b + 4. Solve 0 = 5y + 25, -3y - 40 = qa - 0y for a. -5 Let z = 37 + -26. Solve 0 = -b - 0b - 2u + z, -b = 4u - 19 for b. 3 Suppose 2f - 36 = 4f. Let g = f + 43. Solve -q - 4i + 10 = q, 5i - g = 0 for q. -5 Let m be (-1 + 7)(-42)/(-36). Let i = -2 + m. Solve -6 = 3z + 4f, -4f - 2 = z - if for z. -2 Let i = -6 + 1. Let l(k) = k*3 + 6k*2 + 2k - 4. Let d be l(i). Solve -t = -4a - d, -5a + 2t = -t + 12 for a. -3 Let n be (-1 - -9)2/8. Suppose 0 = -nx - 1 + 31. Solve -x = -3m - 3k - 2k, 4k - 12 = m for m. 0 Let q = -431 - -431. Suppose 2h - 30 = -h. Suppose -4i - i = -h. Solve ql - 22 = -2k + 4l, 4l = -2k - i for k. 5 Let k be ((-1)/2)/(1/(-292)). Suppose 34 = 5t - k. Suppose -m = -0m - t. Solve -4n + 4 = -3c, -3c - 4n - 8 = -m for c. 4 Let i be 0 + (-4 + 8)/2. Solve ia + 13 = u, 0a + 5 = -5u - 4a for u. 3 Suppose -38 = -2m - 0m. Suppose 47 = 3d - m. Solve -2s + z = 6, -2z + z = 5s + d for s. -4 Let o(w) = -w - 7. Let x(y) = -y*2 - 10y - 7. Let c be x(-10). Let q be o(c). Solve h - 2 = 3b - q, -3b - 26 = 5h for b. -2 Suppose 0 = -4a + 4t, 2a - 12 = -0a - 4t. Solve 0z - 30 = 3z + 3s, -as = 3z + 25 for z. -5 Suppose -5p + 5y + 15 = -0p, -4y + 3 = p. Let u = 11 - p. Solve x - u = -x - f, -6 = -x - f for x. 2 Let s(x) = 5x - 2. Let d be s(3). Suppose 45 = 4r - n, -d = -5r + 3n + 45. Suppose -r = -5u + 9. Solve -uo + 6 - 18 = 0, 5o = 5i + 5 for i. -4 Suppose -4m + 9m = 75. Let y be 85/25 - (-2)/(-5). Suppose m = f - 4q, 5f + yq = 2 + 4. Solve 3t - 2u + 5 = 0, -7 = 5u + f for t. -3 Let l be (-2 - -1)-4 + 1. Suppose -r + j + 1 = -4, -10 = lj. Let v be (18/r)/2 + 0. Solve 5q - 4 = -c, -v = c - 7 for q. 0 Suppose -36 + 6 = -10v. Solve -v = -d + 2h, 2d + 5h + 9 = 24 for d. 5 Let r = 11 - 4. Solve -k - 2h = r, 1 + 17 = -2k - 5h for k. 1 Let l = -17 - -20. Suppose -2 = -lp - 5z, 0 = -6p + 2p + 5z + 26. Solve 5j + 27 = y, y = pj - 0y + 22 for j. -5 Suppose 72 = 30s - 22s. Suppose 0 = -4j + 2j + 5z - 8, 4j - 16 = 2z. Solve -r + s = 2b, 0r + 2r + j = 2b for r. 1 Let j(y) = 1 + 2 - 2 - 4 - y. Let t be j(-6). Solve tk + 16 = -z, 2k + z + 4 = 2z for k. -4 Let b be (3 + -3 - -2) + 3. Suppose 1 = 3j - b. Solve -2t - 2r = -6, jt + 13 = 5r - 2 for t. 0 Suppose -5h - 5k + k = 4, k = -5h - 1. Solve b - 18 = 4u, 0 = -2b - 4 - h for u. -5 Suppose -6 = d - 3d. Suppose -2f + 9 = o, 2o = df - 0o - 24. Solve -2n = -3r - 3, -n = -fn - 15 for r. -3 Let x(f) = -f + 4. Let m be x(0). Solve 5w = mc - 10, 0 = 4w - 3c + 14 - 6 for w. -2 Let i be (15/2)/((-3)/(-30)). Suppose 4v = c + i, 2c = -v + 7c + 14. Solve w + z - 7 = 0, 4z - v = -0w - w for w. 3 Let d(w) = -w*2 + w + 1. Let j be -2(-2)/(-1 - 0). Let c be d(j). Let a = 28 + c. Solve -2t + 2p + a = -5, p = -3 for t. 4 Suppose 23 + 5 = 4n. Suppose -3g = -ng + 28. Solve -2a = 2l - 8, -3l + 2a - ga = -18 for l. 1 Suppose 3q - 7 = -2p + 6, 2p + 5q - 19 = 0. Suppose -g - pg = -12. Solve -2w - 4 = 2w, 4o - gw - 24 = 0 for o. 5 Let i(a) = -193a*2 - 2a - 1. Let y be i(-1). Let d be 2/(-7) + y/(-84). Solve -dn - 2n = 2z - 4, -z = -n + 4 for z. -2 Suppose -5y - 2u = -34, 3y + 2u - 33 = 5u. Suppose 2a + 0 = y. Solve 3s = -0d + 3d + 12, -22 = 2s + ad for s. -1 Let u be (-110)/(-8) - (3/(-4))/3. Solve -3f - 24 = -3q, 0q - 3q + u = -f for q. 3 Let k be ((-3)/9)/((-9)/756). Solve 4q + 0 = -4p - 12, -4p = -4q - k for q. -5 Let o(y) = y*2 + y + 2. Let m be o(-2). Suppose v - m = 2g, g - 6v + 20 = -v. Solve g = -i + 5s - 1, -3i + 5s	{ "pile_set_name": "DM Mathematics" }
*2 - 2z - 352. Let r(g) = 6397g2 - 9g - 1407. Let s(k) = 18i(k) - 4r(k). Find the first derivative of s(a) wrt a. 6244a Suppose -5k - 3 + 102 = 2g, -k + 3 = 0. Suppose g = 2b - 32. Find the second derivative of bi4 - i - 21i*4 + 0i wrt i. 192i2 Let x(i) be the third derivative of 23/12i*4 + 1/30i*5 - 137/120i*6 + 52i*2 + 1/6i*3 + 0 + 0i. Find the second derivative of x(f) wrt f. -822f + 4 Let h(b) be the third derivative of -1063b*7/70 - 1618b*3/3 + 4b*2 - 37b. What is the derivative of h(z) wrt z? -12756z3 Let w(c) be the third derivative of c9/252 + 53c8/336 + c7/42 - 7c5/4 - 523c*2. What is the third derivative of w(n) wrt n? 240n*3 + 3180n*2 + 120n Let b be ((-16)/12 - -1) + 38/6. Suppose -5i = -0i - 4t - b, -4t = -2i. Find the third derivative of 0ri - r6 + 2r2 + 10r*6 + 0r*6 wrt r. 1080r*3 Let i be 48/(-9)((-33)/12 - -2). Find the third derivative of 0d5 + 37di + d5 - 32d2 - 9d*2 + 4d - 8d + 2d wrt d. 60d2 + 888d Let x(b) be the second derivative of -9b5/4 - 3b*4/4 + 2866b*3/3 - 622b + 2. What is the second derivative of x(a) wrt a? -270a - 18 Suppose -4p - 7p = -22. What is the third derivative of 1629c*p - 130c*5 - 1693c*2 + 52c*5 wrt c? -4680c*2 Suppose -27g + 19 + 35 = 0. What is the third derivative of -22zg - 4z*4 + 27z*2 - 5 + 14z4 - z3 wrt z? 240z - 6 Let f(q) be the second derivative of -53q*4/6 + 1697q*2/2 + 1847q. What is the derivative of f(c) wrt c? -212c Suppose 0 = 2q - 7q + 10. Let a(o) = -o3 - 2o*2 + o. Let r be a(-3). Find the third derivative of 3g*6 + 6g*6 - 6g*q + 6g*r wrt g. 1800g3 Let s(m) be the first derivative of -m5/5 - 3977m4/4 + 2511m*2 + 6621. What is the second derivative of s(d) wrt d? -12d*2 - 23862d Let w(h) be the first derivative of -142h6/3 + 5h*4/4 - 698h*3 - 4266. What is the third derivative of w(j) wrt j? -17040j2 + 30 Let j(v) = -v2 - 3v - 2. Let z(p) = -7801p*2 + 13p - 2778. Let t(m) = -4j(m) - z(m). What is the derivative of t(b) wrt b? 15610b - 1 What is the second derivative of -2092p - 7524p*3 + 3779p + 6504p wrt p? -45144p Let a = 40 + -34. Let u(b) = 13b - 17. Let f(d) = d - 4 - 11 + 16. Let t(j) = af(j) + u(j). Find the first derivative of t(m) wrt m. 19 Let a(i) be the second derivative of 43i4/12 + 36i*2 - 76i. Let k(g) = -1. Let h(z) = a(z) - 2k(z). Differentiate h(y) wrt y. 86y Let h(i) be the first derivative of 19i4/3 + 5i3/3 + i2 + 51i - 31. Let a(x) be the first derivative of h(x). Find the second derivative of a(g) wrt g. 152 What is the third derivative of -17w*2 - 2w*2 + 1196w*4 + 794 + 0w*2 - 7w*2 + 25w*2 wrt w? 28704w Let b = -6 + 35. Let w = -26 + b. Differentiate -21q - wq - 23 - 11q - 2q wrt q. -37 Let u = 165 - 163. Differentiate -799h4 - 2h*u - 3h*2 + 817h*4 - 19 + 4h*2 wrt h. 72h*3 - 2h Let x be (0 - -2)/(-5 - (-189)/35). What is the second derivative of -t - xt3 + 3t*3 - 37t + 20t5 wrt t? 400t*3 - 12t Let w(a) = -a*3 - 14a*2 - 39a + 14. Let y be w(-10). What is the second derivative of -4 + 105f3 + 27 + yf + 2f - 8f - 12 wrt f? 630f Let p(u) be the first derivative of -691u*4/4 - 218u3/3 + u2 + 1369. What is the third derivative of p(j) wrt j? -4146 Let m(q) be the second derivative of 2q6/5 + 3q*5/5 - 7q*4/12 - 9557q*3/6 - 3267q. What is the second derivative of m(k) wrt k? 144k2 + 72k - 14 Let u(p) = p3 - p2 + 4p + 3. Let g be u(0). What is the third derivative of 19i*3 - 16i*2 - 94i*g - 2i + 2i2 wrt i? -450 Suppose -4z + 584 + 172 = 0. What is the third derivative of 381y3 + 7y*4 - 187y*3 - zy*3 + 73y*2 wrt y? 168y + 30 Suppose -34w = -40w. Suppose w = 3q - 15, 3p = q + 85 - 3. What is the second derivative of b + 21b - pb*2 + b wrt b? -58 Suppose 0 = -5y + y + 12. Let n(h) = 564h - 2253. Let z be n(4). Find the third derivative of 159s*y - 80sz - s4 - 79s3 + 25s*2 wrt s. -24s Let t = -4434 + 4440. Let j(f) be the second derivative of 11/3f3 + 0 - 30f - tf2. Differentiate j(z) wrt z. 22 Suppose -6 = -5v - 2a, 2a + 1 = -v - 1. Suppose n = -2q + v, -q + 2q + 5n + 8 = 0. What is the first derivative of -42 + 9 - 7i + qi - 4i wrt i? -9 Suppose 44 + 31 = -25j. Let w(r) = -2r*2 + r + 1. Let k(c) = -2c*2 - 2c - 73. Let q(p) = jw(p) - k(p). What is the first derivative of q(u) wrt u? 16u - 1 Suppose -23l + 86 = -21l. Find the second derivative of -lo2 + 16o + 30 - 30 - o wrt o. -86 Find the first derivative of 1848z2 - 69z - 145 - 465 - 1852z2 - 181z wrt z. -8z - 250 Let y(c) = -60c*2 + c. Let h(t) = 7434t*3 + 118t*2 + 7716t. Let i(k) = -h(k) - 2y(k). Find the third derivative of i(f) wrt f. -44604 Suppose -34 + 37 = h. What is the third derivative of -218a*h - 94a*2 + 112a*2 - 121a*2 wrt a? -1308 Let n be ((54/12 + -3)-15)/(-3). Let o(b) be the second derivative of -10b + 1/20b*5 + 0b*4 + 0b*3 + nb*2 + 0. Differentiate o(d) wrt d. 3d*2 Suppose t = 2b + 18, 5 = -3t + b + 64. Find the first derivative of -3v*2 + tv*2 - 10v*2 + 2v + 5v4 - 97 - 7v*2 wrt v. 20v*3 + 2 Let n be 1 + (-10)/6 - (-253)/33. Find the first derivative of n - 21o - o + 9 + 24 wrt o. -22 Let t(l) = l*3 + 22l*2 + 15l - 46. Let r be t(-21). Find the first derivative of -rz3 + 127z3 + z3 - 117 wrt z. 144z2 Let t(u) be the first derivative of 1721u*2 + 6057u - 4935. Differentiate t(d) with respect to d. 3442 Let o(u) = -u + 1. Let k(m) = 19m - 89. Let x be k(5). Let s(f) = 72f - 29. Let r(j) = xo(j) - s(j). Differentiate r(t) with respect to t. -78 Let y(b) be the third derivative of b7/105 + b6/120 + b4/24 - 145b3/3 + b2 + 15b + 5. Differentiate y(u) wrt u. 8u*3 + 3u*2 + 1 Let f(u) = -2387u*3 + 9u*2 + 18u - 17. Let r(i) = 1193i3 - 4i*2 - 9i + 9. Let m(j) = 4f(j) + 9r(j). What is the second derivative of m(y) wrt y? 7134y Let o(x) be the first derivative of 2x*5/5 - 2561x*4/4 - 927x*2 - 2721. Find the second derivative of o(l) wrt l. 24l*2 - 15366l Let p(r) = 5r - 15. Suppose l = -5n + 61 - 17, 2n + 64 = 3l. Let o(w) = 1. Let m(v) = lo(v) + 3p(v). What is the derivative of m(t) wrt t? 15 What is the second derivative of 1068w2 + 85 - 383 - 522 - 13w + 52 + 11w wrt w? 2136 Let m(a) = 2898a*3 + 6a*2 - 1251. Let v(x) = -5797x*3 - 13x*2 + 2507. Let y(h) = -13m(h) - 6v(h). What is the derivative of y(n) wrt n? -8676n*2 What is the second derivative of 662s + 3446s3 - 3696s + s*2 - 2077s wrt s? 20676s + 2 Let u(f) be the second derivative of -1/3f*4 + 41/2f*2 + 1/6f*3 - 3 - 4f. Differentiate u(j) with respect to j. -8j + 1 Let p(z) be the second derivative of 601z*5/10 - 1205z*4/12 - 186z. Find the third derivative of p(l) wrt l. 7212 Let c(v) be the third derivative of 0v + 0v*4 - 1/3v*3 + 3/10v*5 + 48 - 2v*2 - 19/60v6. Find the third derivative of c(i) wrt i. -228 Let n(q) = q2 + 8q + 18. Let f be n(-4). What is the second derivative of -4a - 23af + 5 + 8a*5 + 5 + 19a*2 - 3 wrt a? 160a*3 - 8 Suppose 15 = 33x - 32x. Find the third derivative of 110z*3 - xz*2 - 51z*3 - 62z*2 wrt z. 354 Let f(x) = 25x - 16. Let c be f(1). Find the third derivative of 10u3 + 28u*3 + 19u*3 + 42u*4 - cu*3 - 109u*2 - 44u*4 wrt u. -48u + 288 Let q(a) be the second derivative of 0 + 0a6 + 9/20a*5 + 5/3a*3 - 78a + 1/2a2 + 0a*4 + 1/21a*7. What is the second derivative of q(l) wrt l? 40l*3 + 54l Suppose -3h + 2h = -4i + 17, -h = 5. Let j be 2 - (-2)/(-8)(-3 + i). Find the first derivative of -27rj - 7847r + 7847r + 40 wrt r. -54r Let a(z) be the second derivative of 2467z6/30 + 2383z*2/2 - 3367z. Differentiate a(j) with respect to j. 9868j3 Let y(i) be the third derivative of 1/2i*7 - i + 32/3i*3 + 0i*4 - 11i*2 + 0i*6 + 0 + 0i*5. What is the derivative of y(n) wrt n? 420n*3 Let c be (4/(96/54))/(9/2640). Find the second derivative of -q - 663q*2 + 5 + 14q + 2q4 + cq*2 wrt q. 24q**2 - 6 Let s = 1179 + -1179. Let v	{ "pile_set_name": "DM Mathematics" }
suming q is positive. q*(-685/84) Simplify l/((ll(ll/(ll/(l((lll*(-2)ll)/l)/l)))/ll)/l)l/l(-17) assuming l is positive. l17 Simplify o(-2/65)ooo(2/31) assuming o is positive. o(4098/2015) Simplify o(o0o)/oo(-2/7)o(o6/o)/ooo/(o/o(3/5)) assuming o is positive. o(256/35) Simplify tttt*(5/8)(t/((t/(t/(t*(-1/4)/tt)))/t)t)/t assuming t is positive. t(47/8) Simplify (d/(d(-26)/d))/(d(2/45)d) assuming d is positive. d(1213/45) Simplify (y1/y(-1))15 assuming y is positive. y*30 Simplify (h/(hhh(-1/2)/hhh)h)(-45)/((h5/h)/((hh(-10)h)/hh)) assuming h is positive. h(21/2) Simplify ((dd*0d)30)(-15/4) assuming d is positive. d(-225) Simplify l(-11)/(l/((l*(-26)l)/l)) assuming l is positive. l(-38) Simplify n(-9)nn*(2/7)n*(-1/2)/(n(nnn/(n/n(-4/3)))/n) assuming n is positive. n(-373/42) Simplify ((t2)(-16/7))(-2/29) assuming t is positive. t(64/203) Simplify ((j/((j*(-1)j)/j))/jjj(5/7)/j)(2/13) assuming j is positive. j(24/91) Simplify x(-2)x6(x(-1))(-7/4) assuming x is positive. x(23/4) Simplify u(2/35)/u44 assuming u is positive. u(-1538/35) Simplify (zz(1/3)zz/z(-1/11)z)/(z*1z)(-49) assuming z is positive. z(3380/33) Simplify x*(-3)x/x*(2/3)(x/((x(-2/7)/x)/x))(10/9) assuming x is positive. x*(62/63) Simplify (dd/(d/d*(3/4))dd)/((dd*26d)/d) assuming d is positive. d(-93/4) Simplify ((l(-9/7)l)/ll)/(l(-15)/l) assuming l is positive. l(110/7) Simplify (b*(4/17)b(b/(b/(b/b(-10/3)b)))/b)20 assuming b is positive. b(5680/51) Simplify (b/((b(bb*5b)/b)/b)b)(2/39) assuming b is positive. b(-8/39) Simplify ((o/o(-2/7))(-9/11))1 assuming o is positive. o(-81/77) Simplify (z(-17)/((zzz(-4)z)/z))(15/8) assuming z is positive. z(-225/8) Simplify (r*10r)/rrr(3/4) assuming r is positive. r(47/4) Simplify (f(-6))(-1/6) assuming f is positive. f Simplify (n*(1/12)/nn(2/23)/n)(3/7) assuming n is positive. n(-505/644) Simplify a9a/((a/(a23a))/a) assuming a is positive. a34 Simplify t(-6)tt0 assuming t is positive. t(-5) Simplify ((j*(-11)/j)/(j/(j/(jjj(-2/5)))))(2/39) assuming j is positive. j(-136/195) Simplify (p3/p0)/((p/(p/(p(p*(2/21)p)/p)p))/(pp*4p)) assuming p is positive. p*(187/21) Simplify (v(v/v*(-9))/vv/(vv(-7)))/(v(2/7)vv/((v/((vv(-6))/v))/v)) assuming v is positive. v(145/7) Simplify (x(-1/9))(10/11) assuming x is positive. x(-10/99) Simplify (o(6/7))(-21) assuming o is positive. o(-18) Simplify (r(-1))(2/11)(r(-1/4)/r)44 assuming r is positive. r(-607/11) Simplify (i(-10))(-7) assuming i is positive. i70 Simplify ((q(-3))(-48))5 assuming q is positive. q720 Simplify jj/j*(7/2)jj(-6) assuming j is positive. j(-13/2) Simplify (r6/r6)(-26) assuming r is positive. 1 Simplify (((j/(jj(1/5)))/j)/j2)/(j(-2/13)/j2) assuming j is positive. j(-68/65) Simplify (u2u)(-4/19) assuming u is positive. u(-12/19) Simplify mm*35m*46m assuming m is positive. m83 Simplify (z/((z/z5)/z)zz/(z*(1/3)z)z)43 assuming z is positive. z(989/3) Simplify (h(-18)h(-6/11))(-3/14) assuming h is positive. h*(306/77) Simplify ((tt/t(-1))31)(8/19) assuming t is positive. t(744/19) Simplify (c*18c)/cccc9/c assuming c is positive. c28 Simplify z/(z/z(-3))z*(2/33)z assuming z is positive. z*(-64/33) Simplify (o/(oo/(o*(6/11)o))oo)/o(o/o(7/6))/o assuming o is positive. o(25/66) Simplify (s/s(1/8)s*(-8)s)/(s7/((s3/ss)/s)) assuming s is positive. s(-89/8) Simplify (q1)19/((q/(q/((q(-1/3)q)/q)))/(q*2/qq)) assuming q is positive. q(64/3) Simplify ((v(-2/27)v)/(vv(1/10)))(-1/16) assuming v is positive. v(47/4320) Simplify ((g1/g)/(gg/g(-5/2)))/((((gg/(g/g*(-3/7)))/g)/g)/(gg/(ggg(-1/3)))) assuming g is positive. g(-115/42) Simplify ff(-2/5)f(f(f/f*(2/7))/ff)/f assuming f is positive. f(81/35) Simplify w(-7)w3w*3/ww4/w assuming w is positive. w Simplify (u/(u(-2/3)/u)u)(-10)(uu(-1)u)(-38) assuming u is positive. u(-224/3) Simplify z/z*2z*(1/10)/zz*(2/7)z(-1/7) assuming z is positive. z(-123/70) Simplify aa/a36a/a(-3/2) assuming a is positive. a(-63/2) Simplify (x(-2/3))(9/2)/(x/x*(2/7)xx/x(-2)) assuming x is positive. x(-54/7) Simplify p/(p(2/15)p)p/p4 assuming p is positive. p(-47/15) Simplify (s(2/27))(-19) assuming s is positive. s(-38/27) Simplify ((jjj/(j/((j/j(1/6))/j)))(-50))(2/91) assuming j is positive. j(-550/273) Simplify (i/((i/i2)/i))(1/6) assuming i is positive. sqrt(i) Simplify ((oo*2oo)/o)(-2/35)/(o(2/19)/(o/o8)) assuming o is positive. o(-4877/665) Simplify (z/(z(-4/17)z))/(z4/z) assuming z is positive. z(-47/17) Simplify (i/(iii*(-5)/ii))/(i*2i)(i(-1/3)i)/(i(i3i)/i) assuming i is positive. i*(-7/3) Simplify f(ff/((((f(f/f*(-1))/f)/f)/f)/f))/ffff/(f/(f/(f/((((f/(ff(-23)ff))/ffff)/f)/f)f))) assuming f is positive. f25 Simplify (k(-2/7))(-3/2)/(k/(k/k1)kk/k0k) assuming k is positive. k*(-25/7) Simplify (g/((g/((g/((gg*(-6))/g))/g))/g)g4)/(g9g/(gg/(gg(-5)))) assuming g is positive. g7 Simplify f(3/2)/f(-8)f*8f/(f((f/((f1f)/f)f)/f)/ff) assuming f is positive. f(35/2) Simplify (b7/b)(-1/76) assuming b is positive. b(-3/38) Simplify g(g/(ggggg2)g)/gggg(2/9) assuming g is positive. g(-16/9) Simplify (a/(a/((aa*(-2/77)a)/a)))/(aa13) assuming a is positive. a(-1003/77) Simplify (v/v(-6))(13/7) assuming v is positive. v13 Simplify h14/(h/h16) assuming h is positive. h29 Simplify (f(3/10)/(ff*(8/7)f))(-37) assuming f is positive. f(7363/70) Simplify (u*5(u/(uu/u(-3/7)))/uu)49 assuming u is positive. u175 Simplify o(((o/(o/(o/o(-38))))/oo)/o)/oo/(o(-2)o) assuming o is positive. o40 Simplify ((o(1/5)/o)/(oo/(o/(oo/(oo(-5))))))(-5) assuming o is positive. o39 Simplify ((o/(((oo(-1/23))/o)/o))/o)50 assuming o is positive. o(1200/23) Simplify (h0)*(18/5)((h/(h/(hhh*(-9)hh)))/hh)/hh0/h assuming h is positive. h(-7) Simplify (ddd(2/3)/dd)*(-3/11)(d/d*(-1/2)d)(-29) assuming d is positive. d(-1611/22) Simplify v/v*(2/9)vv5vvv*1vv/(vvv7v) assuming v is positive. v(16/9) Simplify (l(-3)/l(-1/3))/(l(2/9)/(l*(-1)l)) assuming l is positive. l(-26/9) Simplify (a(2/9))(-9/8) assuming a is positive. a(-1/4) Simplify c6/c(-2/13) assuming c is positive. c*(80/13) Simplify ((qq(-10))/(q(2/13)q))/(qq/(((q(1/5)/q)/q)/q))8 assuming q is positive. q(-3156/65) Simplify ((t/t(-5/2)tt)/t(-2/9))(-13) assuming t is positive. t(-1339/18) Simplify ((c(-4/3)/c)/c)/(c/(c*5c)) assuming c is positive. c*(5/3) Simplify (z/(z/(zzzz/z*(4/13)))z)/z(-1/8) assuming z is positive. z(501/104) Simplify (r*3/r)/(rr*2)r/(r*(-7)/rr)r/r6 assuming r is positive. r2 Simplify f6f*16f assuming f is positive. f*23 Simplify (bb(2/5)/b)26((bbb/b2bbbb)/bb)/(bbbb(-7)) assuming b is positive. b(97/5) Simplify (t/t(-4/3))/(tt/((((t*9t)/t)/t)/t))(t2/t)(-7) assuming t is positive. t(1/3) Simplify (s(ss(-2)/s)/sss)(-48)/(s/s(1/13)s(-2/11)) assuming s is positive. s(-106/143) Simplify kk15/kk(((k/(k/(kk*(-3/2)k)))/k)/kk)/kk assuming k is positive. k*(31/2) Simplify (d/(dd/(d/(dd(-6)d))))(-40) assuming d is positive. d(-160) Simplify (qq/q(3/14))/q(2/19) assuming q is positive. q(447/266) Simplify k(-5/4)/(k(-3/26)k) assuming k is positive. k(-111/52) Simplify (p(2/7)pp(-1/7))/(p0p)(4/3) assuming p is positive. p(-4/21) Simplify (f/f(-5/3))1 assuming f is positive. f(8/3) Simplify x(4/7)x/(x*0x)(x(-2/7))(-35) assuming x is positive. x(74/7) Simplify c/c(-4)c(-3/2) assuming c is positive. c(7/2) Simplify p*(-8)p/(p((p/(p/(p(-4)p))pp)/p)/p)p/p(-8)p6 assuming p is positive. p10 S	{ "pile_set_name": "DM Mathematics" }
of -x4/8 - x3/3 - 7x2. Give a(-2). 4 Let p = 7 - 7. Let d(g) = -2 + pg - 5g3 + 3 - g. Suppose 0 = -m - a, a = 4m - 4a - 9. Give d(m). -5 Let j(q) = 2q*3 + 5q*2 + 13q - 10. Let c(n) = n*3 + 3n*2 + 6n - 5. Let l = 18 + -13. Let u(x) = lc(x) - 2j(x). Calculate u(-4). -5 Suppose n + 6 = 3. Let i = n + 3. Let g(j) = -j*2 - j + 3. What is g(i)? 3 Let w(r) = 7 - 2r + 0r + 0r - r. Let f(k) = 70k - 91. Let c(z) = 7z - 9. Let y(b) = -49c(b) + 5f(b). Let n(a) = -13w(a) - 6y(a). Calculate n(-5). 8 Let n be 20/(-4)(-4)/10. Suppose -2h - 2b = 0, 0 = 3h - 2b + 7 - 22. Let q(f) = hf - 3f3 - 2f*2 - 2f + 4f3. What is q(n)? 2 Let m(l) = l3 + 9l*2 - 5. Let w be m(-9). Suppose -4h - 12 = -5g, g - 6 = -h + 3h. Let k(n) = -5n2 + 1 + gn2 - 3 - n3. What is k(w)? -2 Let b(r) be the first derivative of -r5/60 - r4/24 + r*3/3 - 2r*2 + 4. Let y(u) be the second derivative of b(u). Calculate y(-2). 0 Let v(l) = -l - 5l + 2l - 4l. Let d(s) = -4 + 1 - s + 3. Let t(q) = -4d(q) + v(q). What is t(-2)? 8 Let h(i) = 8 - 8 - 5i + i. Determine h(-3). 12 Let u(c) = -2 + c*2 - 2c*2 + 11c - 3c - 2. Give u(8). -4 Let j(k) = 95k*2 + 3k - 47k2 - 47k*2. Suppose -39 = -4n + 3r, -2r = -4n - 5r + 9. Suppose -p - n = p. What is j(p)? 0 Let a(h) = 20h3 + 10h*3 - 39h3 + 1 - h2. Determine a(1). -9 Let g be 30/(-3) - -3 - -2. Let v(t) = -t*3 - 4t*2 + 6t + 1. Determine v(g). -4 Let k(h) = -3h - 2. Let q(o) = o2 + 6o - 3. Suppose 0 = 4y + 5w + 44, -y + w = -2y - 10. Let c be q(y). Calculate k(c). 7 Let z(u) be the second derivative of u6/144 - 5u*4/12 - 5u. Let y(i) be the third derivative of z(i). Determine y(2). 10 Let h(i) = -i - 7. Let r(l) = -l - 15. Let w be r(-10). Give h(w). -2 Let m be 1 + -2 + 2 + -1. Let j(o) = m - o - 4 + 0. Calculate j(3). -7 Let d(m) = -m*3 + 2m*2 + 2m - 3. Let f = 62 - 60. Calculate d(f). 1 Let s(g) be the first derivative of g*2 + 6g + 15. What is s(-5)? -4 Let o(a) = a*2 - 5a + 7. Suppose 15 = -5q + 45. What is o(q)? 13 Let i = -3 + 5. Suppose -v = iv + y - 9, 0 = -v - y + 5. Let w(x) = x*2 - 2x - 1. Determine w(v). -1 Let r(x) = -x*2 + 0x*2 + 3 - 753x + 755x. Determine r(4). -5 Let o(k) = 5k*3 + 16k*2 - 21k - 16. Let b(d) = -d*3 - 4d*2 + 5d + 4. Let s(q) = 9b(q) + 2o(q). Suppose 4p + 11 - 23 = 3t, 0 = -4t. Determine s(p). 4 Let y = 23 + -13. Suppose -3c - 2c = -5r + y, 2r - 7 = -c. Let g(t) = -3t*2 + 2t*2 - 6 + 4t + 4. Determine g(r). 1 Let l be 81 - (-5)/(25/(-20)). Let x(t) = t3 - 2t*2 - 5t - 3. Give x(l). 9 Suppose 8 = -2o + 4o. Let g(x) = -2x2 + 11x + 3. Let u(n) = n + 3. Let b be u(-6). Let p(s) = s*2 - 6s - 2. Let c(r) = bg(r) - 5p(r). Calculate c(o). 5 Let d(f) = -f*2. Let v(t) = 6t - 2. Let q be v(3). Let w = -13 + q. Determine d(w). -9 Let y(k) = -k*2 - 11k - 14. Let s be y(-10). Let p = s - -8. Let o(t) = -2 - 3 + 2t + 0t*2 - 4t + t*2. Determine o(p). 3 Let y(s) = 21s*3 - 38s*3 + 8s - 9s2 + 18s3 + 3. Calculate y(8). 3 Let j(c) = c3 - c - 1. Let r(q) = 7q3 - 4q*2 - 13q - 3. Let a(z) = 6j(z) - r(z). Determine a(5). 7 Let f be (2 - (-24)/(-10))10. Let u be (-4)/530/f. Let h(p) = p2 + 7p - 7. Let k(g) = g*2 + 8g - 8. Let v(j) = uk(j) - 7h(j). Determine v(-2). -1 Let f(i) be the first derivative of -i4/2 - i2 - 2i - 15. Determine f(-2). 18 Let h(g) = g2 - 12g + 22. Let c be h(10). Let n(r) = 5r2 - 3r - 2. Let z(v) = 6v2 - 3v - 2. Let t(y) = -5n(y) + 4z(y). Determine t(c). 4 Let l(b) = -3b - 3. Let g be l(-2). Let a = g + -3. Let n(d) be the second derivative of d4/12 + d3/6 - 4d*2 + d. Calculate n(a). -8 Let f(k) = -k - 3. Let y be f(-8). Suppose 4g + 3 + y = 0. Let v(r) = -1. Let i(u) = 5u - 3. Let t(d) = i(d) - 5v(d). Calculate t(g). -8 Suppose 0 = -5a - r + 32 + 6, 4r = -3a + 33. Let q(y) = ay - 3 - y - 4y. Calculate q(5). 7 Let d(v) = -v2 - 5v - 1. Let j be 5124/(-20). Calculate d(j). -7 Let f = 3 + -8. Let d(b) = b + 4. Let o be d(-4). Let r(c) = -5 - c - 2c + oc. What is r(f)? 10 Let i(f) = -f*2 - 6f + 8. Let d be i(-8). Let z(m) = m + 12. Calculate z(d). 4 Let m(g) = g*3 + 4g*2 - 7g - 6. Let v(y) = y*2 + y + 5. Let t be v(0). Suppose -9 = -tw - 34. Calculate m(w). 4 Let s be -13(-15 + 16). Let p(m) = -m*3 - 4m*2 - 5m - 3. Calculate p(s). 3 Let d(v) = 1 + 5v2 - 4v*2 - 6v + 2 + 0. What is d(6)? 3 Let h(j) = -8j2 + 1. Let u = 64 - 65. What is h(u)? -7 Let c(i) = -i + 5i*3 - 5i*3 + 7i*3 - 1 - 8i*3. Calculate c(-2). 9 Let m(r) = 24r + 9. Let v(w) = -13w - 5. Let p(z) = 6m(z) + 11v(z). Calculate p(4). 3 Suppose 0 = -z + 3 - 1. Let g(v) = -v - 2v + 2v2 - z + 6v. Determine g(-3). 7 Let a(b) = -b*2 - 2b - 1. Let y be a(-1). Let h(x) = -x*2 - x - 14. What is h(y)? -14 Let h be 5 + 1/(1/1). Suppose -c + hc = -35. Let o(x) = x*3 + 7x*2 + x + 7. Let y be o(c). Let r(q) = -q + 6. Give r(y). 6 Suppose -h = 2o + 11, h + 35 = -5o - 4h. Let a(v) be the second derivative of -v*4/12 - 2v*3/3 - 3v*2 - 3v. Determine a(o). -6 Let z(g) = 2g2 - 5g - 3. Let v be 0 - (-5 - (-1)/1). Determine z(v). 9 Let n be (2/5)/((-2)/20). Let y(z) = -z*3 - 5z*2 - 4z - 2. Determine y(n). -2 Suppose -14 = -3s + 1. Let b(x) = -x + 4. Let m(i) = i - 4. Let f(q) = 7b(q) + 6m(q). Calculate f(s). -1 Let p(n) = n2 - 2n - 1. Suppose -2t - 4 = 0, -t = -4s + s + 11. Determine p(s). 2 Let h(v) = -4v3 + v2 + v - 1. Let b(k) = k3 + 10k*2 + 8k - 8. Let r be b(-9). Give h(r). -3 Let o = -15 + 18. Let y(v) = -v - 2. Suppose 7t + 27 = 3t - d, 3t - 2d + 12 = 0. Let m(w) = -1. Let b(k) = tm(k) + y(k). Determine b(o). 1 Suppose 3s = 4z - 11, -8 = -s - 5z + 1. Let q(l) = 5l + 1. Calculate q(s). -4 Suppose 2u - 2n - 16 = 0, -2u + 0n + 4n + 26 = 0. Suppose u = d - 1. Let a(i) = -i + 7. Calculate a(d). 3 Let n(r) = -5r2 + 0r*2 - 312r*3 + 311r*3 + 2 + 0r2 - r. What is n(-5)? 7 Let k(j) be the third derivative of -j7/2520 + j6/240 + j5/60 + j4/6 - j2. Let l(y) be the second derivative of k(y). Determine l(4). -2 Let b(k) = -k*3 - 5k*2 + 1. Let s = -8 + 10. Let j(i) = -8i - 1. Let w be j(-2). Suppose sn + w = -n. What is b(n)? 1 Let d(q) = -16q3 + q2 + 2q + 1. Suppose 1 = 7x + 8. Calculate d(x). 16 Let s(p) = 6p + 1. Let n(t) = -3 - 4t - 7 + 14t - t2. Let o be n(9). Let g be 0 + 0 + (o - 1). Determine s(g). -11 Let h(l) be the second derivative of l5/20 - l4/3 - 50l + 1. What is h(3)? -9 Suppose -a = 0, -3n + 5 = -2n - 3a. Suppose -5r - i + 15 = 0, -n + 0 = i. Let p(z) = 0z2 - z + z2 - 1 + 0z + rz. Give p(-4). 3 Let t = 7 - 2. Let n(j) be the first derivative of j4/4 - 4j*3/3 - 3j*2 + j + 2. Give n(t). -4 Suppose -2g - 1 = 5m - 2, 2 = -2m - 2g. Let h(p) = 7p + 1. Calculate h(m). 8 Let i(m) = m*3 - 4m*2 - 2m + 1. Suppose 9n - 10n = -3. Determine i(n). -14 Let f be (-7)/4(-6 + 2). Let t(c) = c3 + fc*2 + 7c + 9 - 10 + 4. Determine t(-6). -3 Let c(l) = -7 + 17l - 41l + 9l + 14l. Calculate c(-3). -4 Let t(o) be the third derivative of o6/120 + o5/15 + o3/3 + o2. Let a be t(-4). Let x(n) = -2n + 5 - 2 + 0n2 + n3 + 2n2 - n2. Give x(a). 11 Let t(p) be the third derivative of p5/20 + p4/24 + 40p*2. Determine t(-2). 10 Let c be 20(6/(-15))/(-1). Let w(g) = -2g + 8. Give w(c). -8 Let a(s) = -s - s - 3 - 3s - s - s*2. Let t = -3 + 3. Let d be (-5)/2(2 + t). What is a(d)? 2 Suppose 0z = z. Let v(a) = -a3 + a2 + a + 15. Determine v(z). 15 Let y(j) = -11j + 7. Let p(w) = -21w + 13. Let v(u) = -4p(u) + 7y(u). Determine v(2). 11 Let a = -235 - -230. Let y(v) be the first derivative of -2v*3 - 1/4v*4 - 2v2 - 1 - v. Determine y(a). -6 Let d(a) = -a2 - 10a - 8. Suppose -5h + 0h - 45 = 0. Let t be d(h). Let s(f) = -6f*2 + 2f - 1. Calculate s(t). -5 Let j(f) = -f*2 - 5f. Let x be j(-5). Let w(k) = xk - k + 5k - 4. Calculate w(3). 8 Let z(x) = 3x2 - 3x - 6. Let a(q) = -q - q*2 + 0q - 34 + 33. Let d(m) = 2a(m) + z(m). Give d(6). -2 Let p(f) be the third derivative of -f4/24 - f3/2 + 22f2. Calculate p(7). -10 Let g(f) = -f3 - 7f2 - 6f - 3	{ "pile_set_name": "DM Mathematics" }
is the nearest to 1? (a) 0.01 (b) -4 (c) i a Let x = 414 - 409. Which is the closest to 0? (a) x (b) 3 (c) -9 (d) -3/4 d Let d = -19112 + 133788/7. What is the closest to 0 in 0.09, d, 2/215? 2/215 Let w = -21190 - -21194. Let r be (2 - 4/2)/3. Which is the closest to 2/3? (a) 1 (b) w (c) -17 (d) r a Suppose 2z - 3y - 22 = -8, 0 = 5z - 2y - 2. Let f = -4 - -3. Let s be (-6)/21 + (-19)/7. What is the nearest to -1/2 in z, s, f? f Let w = 44541 - 44541.1. Let k = 0.05 + 0.05. What is the closest to k in w, 3, 0, -5? 0 Suppose 16 = -5r + 7r. Let k = r + -4. Let o be 496/(-60) + 7. What is the closest to k in 3, o, 0.2? 3 Let k = 0.04493 - -25.95507. Which is the nearest to k? (a) 2/3 (b) 2 (c) 3 (d) 2/11 c Let w = 8236 + -8257.6. Which is the nearest to -2? (a) w (b) 1/2 (c) 3 (d) 0.1 d Let u = -4.3 + 0.3. Let d = -425/11 + 1253/33. Which is the nearest to -2? (a) d (b) 4 (c) u a Let v be (6/7)/((-950)/133 - -7). Which is the nearest to 0? (a) -3 (b) -2 (c) v (d) 0.04 d Let q = 6/131 - -220/917. Let w = 34 + -30.2. Let i = w - 0.8. Which is the nearest to q? (a) 1 (b) i (c) 4 a Let w be (1/(-3))/(4/(-12)). Let d = -1534 + 1878.2. Let b = d + -344. What is the nearest to b in -0.4, w, -2/19? -2/19 Let m = -32489/31 - -1048. Which is the nearest to -1/3? (a) m (b) 5 (c) -3 (d) -5 a Let n = -34.368 + 0.368. Let b = -38 - n. Let i be 2/(14(-2)/(-4)). What is the nearest to -0.2 in i, 2/5, b? i Let r be ((-1)/2)/(2/(-8)). Let l(z) = z*2 - 214z + 646. Let s be l(3). What is the nearest to s in -3, 3/7, r? r Let v be -8(-3)/42 - (-54)/(-2016)-100. Which is the closest to 0.2? (a) -0.1 (b) 2 (c) v a Let x be 1/4 + (-5)/36. Let t = 400 - 314. Let f = 85.8 - t. Which is the nearest to -1/2? (a) f (b) x (c) 3 a Let x = -44 - -48. Suppose xz = -4y + 2z + 76, 0 = -3y + 5z + 31. Let w = y - 18. Which is the nearest to -1? (a) 5/3 (b) -2/5 (c) w c Suppose 0a + 2l = 4a - 508, 0 = a - 2l - 121. Let j = -391/3 + a. Let n = -3.10384 - -0.10384. What is the nearest to -1 in j, n, 8? j Let z = 129 - 129. Let l = 33 - 38. Which is the nearest to z? (a) -0.1 (b) 3 (c) l a Let g be 874/456 + (-18)/8. Which is the nearest to -20/3? (a) -0.05 (b) g (c) 2/3 b Let h = 245.33 + -245.53. What is the closest to -1 in -0.6, 0.3, 3.6, h? -0.6 Let z = 2814 - 2809. Which is the nearest to 1? (a) 2 (b) 0.4 (c) z (d) 0.9 d Let j = -0.235 + 12.035. Let v = -20.2 - j. What is the nearest to v in 0.5, 1/4, -3? -3 Suppose -i - 4i + 3k = -16, -i - 7 = -4k. Let a = 311 + -316. What is the closest to 3/2 in a, i, 1? 1 Let j = -257 + 246.7. Let a = 7.7 + j. What is the closest to 0 in a, -0.3, -1/7? -1/7 Let f = -313.6 + -90.4. Let r = f - -408. What is the closest to r in 0.3, -2, -1/4? 0.3 Let p be 3/((-27)/687) + 0. Let i = 77 + p. Let n = -554 + 553. What is the nearest to i in n, 4, -5? n Let i = -280 - -323. Suppose -im = 11 + 32. What is the nearest to 3/10 in 2/21, 2/9, m? 2/9 Let g(n) = n3 - 7n*2 + 7n - 1. Let t be g(6). Let w be (18/(-10))/(21/(-70)). Let v be 63/91/w. What is the nearest to 0 in -6, v, t? v Let h = -14558 + 14554. Let t = 0.03 + -0.83. Which is the closest to t? (a) 1/2 (b) h (c) 0.3 c Let n be (-1 - 17)(-17)/3. Let o be (-2)/17 + 24/n. What is the closest to -0.1 in -4/7, o, -1, -1/2? o Let o(f) = -327f - 1. Let r be o(0). Which is the nearest to -15? (a) r (b) 0 (c) -2.2 (d) 4 c Suppose -50t + 196t = 292. What is the nearest to 1.9 in t, 3/2, 0.1, -3/7? t Let x = -0.4476 + 0.4476. Which is the nearest to x? (a) 1 (b) -0.1 (c) 2 (d) 2/17 b Let t = 18310 - 91546/5. Which is the nearest to -1? (a) t (b) 2/19 (c) -0.02 (d) 5 c Suppose -s - 819y - 63 = -820y, 294 = -5s + 2y. What is the nearest to -0.1 in 1/8, s, -2/3? 1/8 Let s = 9.989285 + 0.010715. Let n(f) = -f. Let g be n(1). Which is the nearest to -0.1? (a) s (b) 2/9 (c) 0.1 (d) g c Let p be 12/14(-3 + 24). Let q be 6/15 - p/15. Suppose 2 = 65n - 66n. What is the nearest to n in q, 2/7, -1/7? q Let p be 27 + (-4)/8-2. Let g = 0.002 - -1.998. What is the nearest to g in 0.5, 3/2, p? 3/2 Let o = 186.5 + -186. Let t = -1.5 + o. Which is the closest to t? (a) 71/3 (b) 3 (c) 4 b Let t(v) = -38v + 7. Let d be t(-7). Let w = 1361/5 - d. Let s = -5790 + 5785. Which is the closest to -2/11? (a) s (b) -1 (c) w c Let i = -10819.8302 + 10847.7. Let n = i - -0.0302. Let o = 28 - n. Which is the nearest to 3/5? (a) -5 (b) o (c) 2 b Let i = -891 + 890.5. Let j = 0.3 - 0.2. Let p = 1 + 1. What is the nearest to p in j, 4/7, i? 4/7 Let p(r) = r2 + 4r + 2. Let h be p(-3). Let k be h/(-4)-3 + 1. Let v = -198 + 198.5. What is the closest to 4 in v, -2, k? v Let k be ((-5)/30 + (-3)/54)-1. Let r(l) = -l*2 + 60. Let u be r(8). Let n = 5 - 1. Which is the nearest to u? (a) k (b) 0.2 (c) n b Let w = -226 - -154. Let m = w - -73. What is the nearest to 2/5 in m, 2/35, -3? 2/35 Let q = 5.1 - 0.1. Let z = 226.61 - 226.51. What is the nearest to z in 2/13, -10/9, q? 2/13 Let t = 0.01 + -9.01. Let s = t - -6. Let m = 0.0871 - 1.0871. Which is the closest to -6? (a) -4/3 (b) m (c) s c Let o = 2154 + -2157. Which is the closest to 1/3? (a) 6/13 (b) o (c) -0.83 a Let z = -328.2 + 328.2. What is the closest to 1 in 13, 0.4, z? 0.4 Suppose -5y - 2 = -4n, 3n = 9y - 7y - 2. Let b be (y/5)/(27/180-3). What is the closest to b in 4, 2/19, 0.4? 0.4 Let p = 20638 + -62971/3. Let t = p + 351. Let h be (-1)/(22/(-20)). What is the closest to t in h, -5, 0? 0 Let y be ((-2646)/105 + 26)-5. Let q = 4 + -4.4. Let p = 0.2 + q. Which is the closest to p? (a) 1 (b) y (c) -0.3 c Let p = -3138261778 + 12097999075787/3855. Let m = p + 6/1285. Let g = m - -21. Which is the nearest to g? (a) 4 (b) -0.4 (c) 0.2 c Suppose 35z + 15 = 30z + 4i, 2z + 4i = -6. Which is the nearest to 0? (a) 2 (b) z (c) 0.5 c Let h = -11514 + 11513.5. What is the nearest to 1 in 3/2, h, 0.9, -0.1? 0.9 Let o = -31.73 + 35.73. What is the closest to 2 in -0.122, o, -2? o Let z(v) = 26v - 676. Let r be z(26). Let m(t) = t - 12. Let c be m(9). What is the nearest to -0.2 in -1/5, c, -2/15, r? -1/5 Let n = -7.3 + -38.7. Let o = -91 - n. Let g = -44.5 - o. Which is the nearest to -1? (a) 2 (b) 2/3 (c) g c Let o = 66.8 - 67. Let z = 8.95 - 9. Let a = -1.05 - z. What is the closest to a in -2, 4, o? o Let w = -2.6 + 0.6. Let y = 9763.2 + -9763. Let k = -0.1 - 0.1. What is the nearest to y in w, k, 1? k Let f = -0.024 - -0.047. Let i = 0.077 + f. Suppose 4t - 28 = 4k, 4k + 12 = 4t + 8k. Which is the nearest to i? (a) t (b) -3/5 (c) 1/4 c Let q = -8 + 5. Let w be 8/(-30)(-6)/(-4). Let f = -1927/5 + 385. What is the closest to f in 3, w, q? w Suppose 2y = -91u + 87u - 124, 32 = -u - y. What is the closest to 4 in u, -2/11, -2/9, -4/3? -2/11 Let o = -113 - -104.63. Let t = o - -8.27. What is the nearest to 7/3 in -1/7, -3, t? t Suppose -5a - 2m + 7 + 0 = 0, -3a = -5m + 2. Let v = 564.1 - 562.1. What is the closest to a in v, -9, -0.3? v Let s be 2/4(-2)/4. Let j be 54/(-81)(-6)/8. Let v be (16/28)/((-24)/84). What is the closest to v in 1/3, j, s? s Let u = 1169.055 + -1172. Let z = -0.055 + u. Which is the nearest to -2/13? (a) -0.2 (b) -1 (c) z (d) -2 a Let p = -0.671 + 0.511. Let s = p + 0.26. Which is the nearest to 1? (a) s (b) 2/11 (c) -0.1 b Let b = 77/5 + -15. Let p be (-1498)/214 - (-20)/(-12)(-115)/25. What is the nearest to -2/11 in -8, 5, p, b? b Let u = -1.023652 + 0.023652. Let s = 29/2 - 15. What is the closest to u in -3, -8, s? s Let x be 13494/(-4152) - 5/(-4). Let a = -5 + 10. Suppose 10 + 4 = o - 5q, -3q = -o + 8. What is the nearest to o in a, 0.5, x? x Let v = 18152 + -18152.1. Let q be 2/(-7) + (-22)/21. Which is the closest to 2/5? (a) 1/7 (b) q (c) v a Let y be 15 + (-15 - (15 + -67)). Which is the closest to y? (a) 0.4 (b) 0.24 (c) 2 c Let j be (-9)/27 + (-4)/6 - -1. Let f = 25 + 13. Let i = f + -37. Which is the nearest to 1? (a) i (b) j (c) 5 a Let d = -13 + 11. Suppose 2y - 18 = 2m, -91y = -94y + m + 19. What is the closest to y in 4, d, 3? 4 Let a(k) = k3 + 7k*2 - 5k + 19. Let f be a(-8). Let i be (0/3)/(f*(-6)/(-30)). What is the closest to 0 in -0.4, -	{ "pile_set_name": "DM Mathematics" }
3 + g - g + 2g*3 + 3g*3 + 0g3 + (g2 + 0g2 - 3g*2)(0g + 5g - 2g). 2g*3 Expand (u - u + 2u + u + 0u - 3u + (0 - 2 + 0)(-2u - 2 + 2) + 3u + 3 - 3 - u + 2u + u)(65 - 41 + 90)(-3 + 2 - 2). -3078u Expand ((-3 + 2 - 1)(3z - 3z + 2z) - 2z + 4 - 4 + 2z - 3z + 2z - 2z - 1 + 1 + 1192 + 24z - 1192)(0z4 + 4z*4 - 2z - z*4). 51z*5 - 34z2 Expand -p2 - 3p - 4 - 21 + 41 - 2p*2 + 3p*2 - 3p*2 + (0 + 2p*2 + 0)(-1 + 2 + 1). p*2 - 3p + 16 Expand (2y + 9y - 12y)(61y + 30y - 26y). -65y*2 Expand (5 + 47 + 19)(-4q + q + q). -142q Expand 14r + 4r - 1 - 5r + (-7 + 5 - 7)(-4r + 4r - r). 22r - 1 Expand (-2j*2 - 5j + 5j)(1 + 23j - 21j + 1)(-5j - 2j - 2j). 36j4 + 36j*3 Expand (0y + 0y - 5y*4)(5 + 8 - 13 + 11y). -55y5 Expand -s5 - s2 + s2 + (4s3 + 3s*3 - 6s*3)(2s2 - s2 + s2) + 14s*5 + s - s. 15s*5 Expand -36s*3 + 30s*3 + 63s*3 + 0s*3 - 3s3 + s3 + (-s2 - s2 + 3s2)(0 + 2s + 0) + 2s*2 + 2s*3 - 2s*2. 59s*3 Expand -8t*4 - 40t*4 + 13t*4 + (-2t*2 + 2t - 2t)(-2t + 2t + t*2) + (t - t + 2t)(-2 + 2 + 2t*3). -33t*4 Expand (138 + 126 - 413)(4z - 4z - z). 149z Expand -w2 + w - w + (0w - 2w + 4w)(1 - 1 + 2w) - 2w2 - 4w*2 + 4w2 + w2 - 2 + 2 + w*2 + 1572 - 782 + 7w - 786. 3w2 + 7w + 4 Expand (2 - 4 + 1)(3y - y - y)(-8 - 9 + 9 - 8y). 8y2 + 8y Expand (-4q5 - q5 + 7q*5)(-150 - 63 - 129). -684q5 Expand (0a2 - a2 + 0a2)(0a2 + 4a*2 - 3a*2)(58 - 8 + 39). -89a4 Expand (1 + 0 + 1)(-2t + 0 + 0t - 1)(9 - 9 - 8t*3) + 4t*4 - 2t*4 + 0t*4. 34t*4 + 16t*3 Expand (0j - 3j - 2j)(-102j + 67j + 84j). -245j2 Expand (g - 6g + 2g + 2g - g + 0g + (0 + 0 - 1)(2 - g - 2))(-g - 6g - 3g). 10g*2 Expand (-6d*3 + 9d*3 - 4 - 6d*3)(25 - 4 - 1). -60d3 - 80 Expand -13w*2 + 21w*4 + 28w*2 - 17w*2 + 2w3 + w4 - 5w4 - 3w4 + (w2 + 2 - 2)(2w - w*2 - 2w). 13w4 + 2w*3 - 2w*2 Expand (-2a*2 + 6 - 8a + 8a)(-3a2 - 2a*2 + 7a*2)(137 + 26 - 65). -392a4 + 1176a*2 Expand (-26 + 26 - 4i)(-3i*4 + 0i*4 + 5i*4) - 4i*2 + 4i*2 + 2i*5 + 4i5 + i5 - 3i5. -4i*5 Expand 9o + 6o - 17o + 2o + 3o - 3o + 0o - 3o + 2o + (3 - 1 - 1)(3o - 5o + 6o) - 3o + 2o + 0o. 2o Expand (-3v - 3v + 4v)(3865 - 3863 + 0v2 + 6v*2). -12v*3 - 4v Expand (-2 + f*2 + 5 + 0 + 3f*2 - 2f*2 - 4f*2 - 4f*2 - 3f*2 + 5f*2 - f + 2f*2 + f + (2 + 1 - 5)(-f2 - f2 + 0f2))(3 - f - 3). -2f3 - 3f Expand (-3d + 0d + 2d)(74d + 12d - d). -85d2 Expand (2245 - 2245 + 16a*3)(2a2 + 4 - 6 + 0a*2). 32a*5 - 32a3 Expand (m2 - 3m2 + 3m*2)(-3 + 2m3 + 3) + 0m*5 + 0m5 + m5 + 2m5 + m5 - m5 + (-2 + 2m*3 + 2)(7m2 - 7m*2 + 3m*2). 11m*5 Expand (65h*2 - 11 + 2h*3 - 65h*2)(-h2 - 2 + 2 + h2 - 4h + 4h + (2h - h - 2h)(-2h - 3 + 3) - 2h2 + 2h*2 + 2h*2). 8h*5 - 44h*2 Expand -19q*5 + 18q*5 - 26q*5 + (-9 - 3q + 9)(q4 + 2q*4 - 4q*4). -24q*5 Expand (2o + 3o - 2o)(-3o + 3o - 2 - o + (-3 + 4 + 1)(4o - 3o - 2o)). -9o*2 - 6o Expand (1 - 4 + 1)(4 - 2 + 1)(-3 + 7 - 2)(m - 5m - 2m). 72m Expand (-2w - w - 4w)(-4w + 5w + w)(10 + 7 - 7). -140w2 Expand (3 - 3 - 2m*2)(m*2 + 119m - 3m2 + 3m*2). -2m*4 - 238m*3 Expand (5q - 12q + 5q)(-2 + 1 + 0) + (2 + 1 - 1)(-2q + 7q + 0q) + 0q + q + 0q + (0q + 0q + q)(-2 + 3 + 2). 16q Expand (-3t*3 + 5t*3 + 0t*3)(-2 + 0 + 4)(-98t + 105t2 + 98t). 420t5 Expand (0 + 2h*3 + 0)(-2h2 - 3h*2 + 3h*2) + 95h*3 + 7h*5 - 95h*3 + (7h*2 - 3h*2 - 2h*2)(h*3 + 0h*2 + 0h*2). 5h*5 Expand (6 - 3 - 1 + (3 - 1 + 0)(2 - 4 + 0))(-229p + 229p - 344p*2). 688p*2 Expand (0m - m - m)(1479 - 739 - 679 - 3m). 6m2 - 122m Expand -m2 + m5 - 4m5 + 5m5 + (m - m + m5)((1 + 0 + 3)(5 + 7 + 2) + 0 + 3 - 4). 57m5 - m2 Expand (0u + 2u + 6u)(6 - 4 + 8). 80u Expand -3o5 - 2o*5 + 8o*5 + (0o*2 - 4o*2 + 2o*2)(216o2 - 216o*2 - 178o*3). 359o*5 Expand -2k*2 + 2k2 - k2 + (5k2 - 5k*2 + 2k*2)(1 + 0 + 0) - 14 - 114k2 + 120k*2 + 4. 7k*2 - 10 Expand -1 + 1 + q + (-5q + q + 3q)(2 - 1 - 2) + 2q + 0 + 0 + 1 - 1 + q + 98q + 121q + 261q. 485q Expand (-36 + 36 - t4)(-23t - 27t + 63t) + 2t*5 - 2t5 - t5 + (3t4 - 7t*4 + 2t*4)(2t - 4t + t). -12t5 Expand (-2f + 2 - 2)(0f - f + 0f)(3f2 - 2f2 + f2 + 36f2 + 18f*2 + 33f*2 + (-5f + 5f - 2f*2)(2 + 2 - 2) - 2f2 + 0f*2 + 0f*2). 166f4 Expand -m3 + 0 + 0 + (5 - 3 + 0)(-28m*3 + 232m - 232m). -57m*3 Expand (6z - 6z - z2)(-2 - 3 + 4) + (z - 4z + z)(27z - 34z + 23z) - 2z*2 + 0z2 + z2. -32z2 Expand (1 - 4 + 0)(10 + 18i + 2 - 11). -54i - 3 Expand ((-3b - b + 2b)(0b*2 - 4b*2 - 2b*2) - 5b*2 + 7b*3 + 5b*2)(b*2 + 2b*2 - 2b*2) + 1 - 1 - 3b*5. 16b*5 Expand (-p - 5 + 5)(2p + 3p - 3p)(3p2 + 11p - 11p). -6p*4 Expand ((-k + 3k - 4k)(4 - 2 + 0) + 2k + 0k - 4k - 20k + 27 - 27)(-6 - 6 + 5) + (2k + 3k - 6k)(-2 + 2 + 1). 181k Expand (0 + w*3 + 1 - 4)(-3w + 3w + 2w2) + (-3w - 7w + w)(w*4 + 0 + 0). -7w*5 - 6w*2 Expand (-3 + 8 + 2)(-w*2 - 363w + 363w + 29). -7w*2 + 203 Expand (-5v - 6v2 + v2 - 816 + 817)(3 - 3 + 4v). -20v*3 - 20v*2 + 4v Expand (17c3 - 4708c*2 + 4708c*2)(5 - 2c - 5 + (-3 + 0 + 4)(2c + 2 - 2) + 1 - 1 + c). 17c*4 Expand (17k*2 + 87 - 87 + 3k*2 + 0k*2 - 2k*2 + (1 - 2k - 1)(-2k + 4 - 4) + 2k2 + 2k*2 - 3k*2 - 2k*2 + 0 + 0)(-3k3 + 4k*3 - 3k*3). -42k*5 Expand (-75i + 146i - 714i - 220i - 342i)(-i4 + 3i*4 - 4i*4). 2410i5 Expand (-1 + y2 + 1)(-2y*3 + 1311y*2 + 7y*3 - 1288y*2). 5y*5 + 23y*4 Expand -5u + 5u + 2u5 + u5 - u5 + u5 + (-5u2 + 0u*2 + 4u*2)(0u3 + 4u*3 - 2u*3) + 2 - 2 - 2u*5 - 560u*5 + 287u*5 + 564u*5. 290u*5 Expand -21r*5 + 4r*5 - 68r*5 + (2r2 + r2 - 4r2)(-2r3 + 0r*2 + 0r*2) - 2r*5 + 3r*5 - 2r*5. -84r*5 Expand (-18 + 57 + 46)(2 + 3 - 4)(1 + 1 - 3)(-3 + 5 - 1)(-l5 - 6l*5 + 2l*5). 425l*5 Expand (3 - 19 - 2298r*2 + 2296r*2)(1 + 3 - 3). -2r2 - 16 Expand (-2v + 0v + 3v)(-34 - 86 + 31). -89v Expand -4s + s2 + 4s + (0 + 0 + 1)(0s*2 - 5s*2 + 3s*2) - 3s2 - s2 + 3s2 + 1 + 123s - 123s + 34s*2. 32s*2 + 1 Expand -1 + 1 - 3o*2 + (-7 + 3 + 1)(3o - 2o + 0o)(-4 + 2 + 8)(0o + 2o - 3o). 15o2 Expand g2 - g2 + g4 - 2462g + 2462g + 517g*4 + (-3 - 2g + 3)(g3 + 3 - 3). 516g*4 Expand (11c + 2c - 2c)(17 - c - 17). -11c*2 Expand (-q - 5q + 4q)(2 + 2 - 2) - 4q + 0q - 3q + 182q - 7848 + 7848 + (4 - 3 + 1)(-q - 4q + 7q) + 2q + 1 - 1 + 3 - 3 + 2q. 179q Expand (-4s + 4s + 4s)(s - 2s - 2s + (0 - 2 + 5)(0s + 3s - s) - 2s + 0s + s). 8s*2 Expand (y - 3y - 8y)(y + 4 - 4) + ((5 + 3 - 1)(-7y + y + 4y) - y - y + 3y)(y + 0y + 0y). -23y*2 Expand 5j - 2j - 6j - 16 + 16 - 8j + (1 - 1 - 2)(-3j - j + 5j) + 0j + 2j - j. -12j Expand (5 - 2a - 5)(-1 - 4 + 4)(2a - 2 + 2 + (3a - a - 3a)(-3 - 7 + 13)). -2a2 Expand p4 + 1 - 1 + (49p*3 - 16p*3 + 29p*3)(3p - p - p). 63p*4 Expand ((a - 2a + 2a)(2 + 0 - 4) + 2a - 7a + 3a + 0a - a - 11a)(-8a4 + 7a*2 - 7a*2). 128a*5 Expand -4s + 7s - s + (-4 + 3 - 6)(-4s + s + 2s). 9s Expand (-6g - 4g + 0g)(-g + g - 4g) + 0g2 - 2g*2 + 3g*2. 41g*2 Expand (0 + 4g + 0)((-4 + 3 + 3)(3 - 3 + g) + (-g + 2g - 2g)(0 + 3 + 5) - g + 2g + 0g). -20g2 Expand (6 - w2 - 6)(w2 - w2 + w2) + (2w*2 - w + w)(60w2 + 72w*2 - 89w*2) + 0w*3 + 0w3 + w4. 86w4 Expand d + d5 + 12d - 6d + (-2d*4 + 0d + 0d)(3d - 3d - 2d) - d2 + d2 + d5 + 4d*5 - 4d5 - d5 - 2d5 - 2d*5 + 3d*5. 4d*5 + 7d Expand (-10i4 - 2i4 + i4)(-70 - 12i + 70)(0 + 1 + 0)(2 - 2 + 1)(-2 + 3 - 3). -264i5 Expand -1 - k4 + 1 + (8 +	{ "pile_set_name": "DM Mathematics" }
1 by -90. -1/90 11684 divided by 23 508 Divide -3 by 12. -1/4 Calculate 3 divided by 128. 3/128 Divide 141 by -18. -47/6 Divide -36 by -21. 12/7 -265 divided by 5 -53 Divide -774 by -2. 387 What is -305 divided by -7? 305/7 What is -3450 divided by -23? 150 Divide 1 by -5266. -1/5266 What is 0 divided by -15? 0 What is -18 divided by -8? 9/4 Calculate -18865 divided by 3773. -5 -7 divided by -889 1/127 What is -1172 divided by 1? -1172 What is -17289 divided by 9? -1921 What is 475 divided by -57? -25/3 What is 3660 divided by -610? -6 Calculate -92 divided by 6. -46/3 -39 divided by 3 -13 Calculate -10 divided by 420. -1/42 Divide -2 by -723. 2/723 Calculate -1210 divided by 55. -22 Calculate 1105 divided by -65. -17 -1413 divided by -471 3 -1743 divided by -4 1743/4 Calculate -1355 divided by 5. -271 What is -4536 divided by -7? 648 What is -1619 divided by 1? -1619 2364 divided by -394 -6 Calculate -4056 divided by 6. -676 Divide -392 by 28. -14 What is -462 divided by 14? -33 Divide -22594 by 1. -22594 What is -6902 divided by -4? 3451/2 What is -4 divided by -1227? 4/1227 What is 332 divided by 332? 1 -50 divided by 6 -25/3 -5 divided by 165 -1/33 Divide 1116 by 12. 93 What is 5 divided by -1845? -1/369 462 divided by -1 -462 Calculate 1 divided by 4. 1/4 Divide -2352 by -1176. 2 What is -3 divided by -5759? 3/5759 -1615 divided by -4 1615/4 Calculate -16 divided by 42. -8/21 What is -5 divided by 211? -5/211 Calculate 0 divided by 247. 0 Calculate -4085 divided by 5. -817 What is 274 divided by -4? -137/2 -596 divided by -149 4 -42035 divided by 5 -8407 Calculate -4 divided by 813. -4/813 What is -1 divided by 420? -1/420 Divide -3 by 6874. -3/6874 What is 170 divided by -85? -2 Divide -4 by 255. -4/255 What is -8502 divided by -6? 1417 -1054 divided by -2 527 What is -2059 divided by -19? 2059/19 What is -1 divided by -29? 1/29 Divide -27 by -5. 27/5 Divide 3428 by -2. -1714 What is -1290 divided by -1? 1290 What is -5 divided by 61? -5/61 13205 divided by -5 -2641 Calculate -1968 divided by -12. 164 282 divided by -5 -282/5 What is 5 divided by -73? -5/73 What is -19 divided by 118? -19/118 1 divided by -12 -1/12 Divide 4 by -1315. -4/1315 Divide 2762 by -2762. -1 Divide -1610 by 5. -322 Divide 54 by 11. 54/11 Calculate 21936 divided by -6. -3656 -72 divided by 12 -6 Divide 34 by 142. 17/71 What is -15353 divided by -3? 15353/3 What is -553 divided by -79? 7 Calculate 21 divided by -10. -21/10 0 divided by 21 0 Divide -13858 by -13. 1066 -5 divided by -856 5/856 -152 divided by -8 19 Calculate 9212 divided by -2. -4606 Divide -252 by -3. 84 Divide 2080 by -5. -416 Divide -1161 by 9. -129 What is 3920 divided by -80? -49 30 divided by -11 -30/11 311 divided by 5 311/5 Calculate 5 divided by -101. -5/101 162 divided by 3 54 What is 42 divided by -3? -14 Divide -3300 by 6. -550 -1 divided by 27 -1/27 Divide 623 by -1. -623 218 divided by -109 -2 -315 divided by -21 15 Divide -10192 by -8. 1274 3076 divided by -4 -769 Divide -2 by 113. -2/113 Calculate -916 divided by -4. 229 -5 divided by -84 5/84 Divide -38985 by 5. -7797 Divide 247 by 5. 247/5 Divide 4 by 31. 4/31 Calculate 496 divided by 1. 496 Divide -1 by 33. -1/33 Calculate 761 divided by 761. 1 Calculate 9 divided by -511. -9/511 Calculate 692 divided by 173. 4 Calculate 37 divided by 17. 37/17 Calculate 295 divided by 1. 295 What is 1440 divided by 8? 180 Divide -253 by 11. -23 What is 1 divided by -17? -1/17 What is 4396 divided by 157? 28 What is 0 divided by 297? 0 Divide -2638 by -6. 1319/3 0 divided by 405 0 -597 divided by -199 3 Divide 737 by 11. 67 Divide -346 by 2. -173 Calculate -174 divided by -6. 29 4 divided by -237 -4/237 -10 divided by 2 -5 -32 divided by -3 32/3 What is -17 divided by -61? 17/61 What is -675 divided by -75? 9 15419 divided by 17 907 306 divided by -5 -306/5 What is -64 divided by 5? -64/5 What is 48 divided by 61? 48/61 108 divided by -36 -3 Divide -380 by -4. 95 Calculate 2 divided by -431. -2/431 4 divided by 260 1/65 Divide 814 by -1. -814 Calculate 547 divided by -2. -547/2 Divide 3 by -86. -3/86 -304 divided by -4 76 What is 0 divided by -50? 0 Divide -3895 by 779. -5 What is 18 divided by 18? 1 What is -75 divided by -25? 3 Calculate -336 divided by -1. 336 Calculate 567 divided by 63. 9 Divide 1 by -29. -1/29 Divide -4 by 488. -1/122 What is 8292 divided by 2073? 4 What is 4 divided by -270? -2/135 Divide 540 by -3. -180 What is -37 divided by -64? 37/64 What is -1903 divided by -173? 11 Calculate -8370 divided by -27. 310 Calculate -1 divided by 1. -1 Divide -3 by -25. 3/25 -372 divided by -2 186 Calculate -153 divided by 9. -17 What is -375 divided by -15? 25 0 divided by -2 0 What is 4450 divided by -890? -5 0 divided by 89 0 11307 divided by 3 3769 Calculate 162 divided by -137. -162/137 What is -42 divided by 6? -7 Divide 513 by 5. 513/5 13 divided by 1 13 48 divided by -8 -6 Divide 183 by -61. -3 Divide 21 by 16. 21/16 Divide 6 by 17. 6/17 Divide -65 by -2. 65/2 Calculate -209 divided by 19. -11 Divide -132 by -44. 3 Divide 4004 by 3. 4004/3 Calculate -52 divided by 1. -52 Divide -161 by 161. -1 3 divided by 29 3/29 What is -5181 divided by -157? 33 -5242 divided by -5 5242/5 -1290 divided by 258 -5 Calculate 5 divided by -5. -1 Calculate 0 divided by -121. 0 -6592 divided by 32 -206 Calculate 1452 divided by 6. 242 What is 1464 divided by 244? 6 What is -2 divided by 907? -2/907 Calculate -194 divided by -1. 194 What is -77 divided by -128? 77/128 Divide -18378 by 9. -2042 -18 divided by 271 -18/271 Calculate -27 divided by -7. 27/7 Divide 10 by 5. 2 Divide 5769 by -5769. -1 What is 92 divided by -23? -4 Calculate -261 divided by -87. 3 Divide -7 by -368. 7/368 What is -802 divided by -2? 401 Divide -15966 by -9. 1774 Divide 990 by 198. 5 Divide -2 by 1070. -1/535 Divide 4 by -173. -4/173 167 divided by -12 -167/12 What is 2 divided by -48? -1/24 Divide 2 by -348. -1/174 Calculate -285 divided by -1. 285 504 divided by 1 504 Divide 3910 by 5. 782 Calculate -6 divided by -560. 3/280 Calculate 112 divided by -28. -4 -448 divided by 224 -2 Calculate 350 divided by 70. 5 Calculate -162 divided by -6. 27 Calculate -905 divided by -5. 181 What is -6340 divided by -10? 634 What is 7924 divided by -283? -28 Divide -8 by -141. 8/141 Divide 8 by 5. 8/5 508 divided by -127 -4 Calculate 55 divided by 4. 55/4 Divide -172 by 5. -172/5 Divide 224 by -109. -224/109 Calculate 160 divided by 80. 2 What is 804 divided by -1? -804 Divide 0 by 272. 0 710 divided by 710 1 Divide -18634 by 154. -121 2119 divided by 13 163 Divide -190 by 38. -5 -27760 divided by 2776 -10 Calculate 135 divided by 15. 9 Calculate 1443 divided by -3. -481 Divide -57 by -134. 57/134 Divide 2 by -131. -2/131 Calculate 426 divided by -142. -3 Divide -32 by -32. 1 -84 divided by -21 4 Divide -340 by -4. 85 Calculate -105 divided by 1. -105 Calculate 609 divided by 5. 609/5 What is -10 divided by -18? 5/9 Divide 670 by -5. -134 What is -2 divided by -1435? 2/1435 Calculate 470 divided by -47. -10 17100 divided by -5700 -3 What is 993 divided by -5? -993/5 Calculate 880 divided by 88. 10 Divide -7659 by 3. -2553 What is 68 divided by 2? 34 Calculate -115 divided by 5. -23 Divide -1 by -651. 1/651 What is 1528 divided by 382? 4 -4 divided by 308 -1/77 Calculate 633 divided by 1. 633 What is -1130 divided by -565? 2 Calculate -3718 divided by 22. -169 Calculate 989 divided by 43. 23 What is -4661 divided by -1? 4661 4 divided by 416 1/104 What is 135 divided by -15? -9 Calculate 1210 divided by -5. -242 Divide 0 by 6. 0 Divide 1 by -8920. -1/8920 394 divided by 36 197/18 Calculate 1 divided by -82. -1/82 -15 divided by 2 -15/2 What is -89 divided by -14? 89/14 Divide -670 by 2. -335 What is 1 divided by -303? -1/303 Divide -378 by 6. -63 What is 825 divided by 15? 55 Divide -486 by 18. -27 Divide -16 by 10. -8/5 Divide 2120 by -106. -20 What is -116 divided by 58? -2 Divide -214 by -1. 214 -1 divided by 618 -1/618 Divide 2 by 89. 2/89 Divide 15 by -187. -15/187 -3108 divided by 1036 -3 What is 2905 divided by -5? -581 Calculate 28548 divided by -52. -549 -350 divided by -70 5 3 divided by 5 3/5 Calculate 15 divided by -56. -15/56 -4 divided by -657 4/657 Calculate 22 divided by -	{ "pile_set_name": "DM Mathematics" }
v + 2987h*2v*2 + 5018h*2v wrt h? -95208v2 - 2556v What is the derivative of 3173821d2 - 2d - 8678372? 6347642d - 2 What is the second derivative of 12252i*3p*3 + 375i*2p*3 - 23ip3 - 2ip - 1738065i wrt i? 73512ip*3 + 750p*3 Find the second derivative of -57252o*4 + 1279o*2 + 58930385o wrt o. -687024o2 + 2558 What is the second derivative of 63f*2wxy - 376949f2wx + fwxy - 12fwx - 6fxy - 8fy - 2xy - 112y wrt f? 126wxy - 753898wx What is the third derivative of 709783745h6 + 1020509798h*2 wrt h? 85174049400h*3 What is the derivative of -33756066bj - 9bp2 - 113jp + 6j - 559p2 - 2p - 2 wrt b? -33756066j - 9p*2 What is the third derivative of -7167206w*4 - 2w*3 - 537w*2 + 7w + 20 wrt w? -172012944w - 12 Differentiate -c2z*3 + 2504c*2z*2 + 42cz - 232z*3 - 677z*2 - 2z wrt c. -2cz*3 + 5008cz2 + 42z Differentiate 6905069a2py + 17a*2p - 18a2 + 135ap wrt y. 6905069a*2p What is the second derivative of -71421463z4 - 4z - 9720977? -857057556z2 What is the second derivative of -2679725j*3 - 2j + 313664 wrt j? -16078350j What is the second derivative of 331374x*5 - 10x3 - x2 + 2087440x wrt x? 6627480x*3 - 60x - 2 What is the derivative of 14784p3u*2 - 8916930p*3 - 217p*2u*2 wrt u? 29568p*3u - 434p2u What is the second derivative of 48371t4 - 2t*3 + 1303t*2 - 496833t - 428 wrt t? 580452t2 - 12t + 2606 Find the third derivative of -546803035k5 - 1813k*2 + 7004k - 5. -32808182100k2 What is the second derivative of -631b*5 + 64b*3 - 15b*2 + 72956b - 46 wrt b? -12620b3 + 384b - 30 Find the second derivative of -304225750l2 - 46232372l + 2. -608451500 What is the second derivative of -57x4 - 9x*3 + 2473x*2 - 11191429x - 1? -684x2 - 54x + 4946 Find the third derivative of -77403382r3 - 1622r*2 + 663 wrt r. -464420292 What is the second derivative of 13l*3u*3 + 9l*3u*2 + 49261l*3 - 3lu - 71u*3 - 4u wrt u? 78l3u + 18l3 - 426u Find the third derivative of 41488759n5 + 364n*2 - 26n - 50. 2489325540n2 What is the second derivative of -11375424j*2 - 17j - 1368119 wrt j? -22750848 What is the third derivative of 5018l6 - 34l*5w + 49467l2w + 3l2 - 39w wrt l? 602160l3 - 2040l*2w What is the first derivative of -2v2 - 4176485v + 4918911? -4v - 4176485 What is the third derivative of -48344725x*3 + 53182607x*2 - x + 2 wrt x? -290068350 Find the second derivative of -60526118g*2 - 4g - 526642. -121052236 Find the second derivative of 12446029p3 - 3p*2 + 105139p - 119. 74676174p - 6 Find the second derivative of -985956325f*3 + 1300478711f wrt f. -5915737950f Find the first derivative of -961jl2 + 5566jlo*3 - 852l*2o*3 + 3l*2o*2 - 305l*2o + 2lo*3 wrt j. -961l*2 + 5566lo3 Find the third derivative of -72962772v*5 - 374v*2 + 5v - 4073 wrt v. -4377766320v2 Differentiate -2k*2 + 508318041k - 1158107021 with respect to k. -4k + 508318041 Differentiate -1877115j3 - j2 - j + 7342681 wrt j. -5631345j2 - 2j - 1 What is the derivative of 7fip - 5899fi - fp - 3f - 130313ip - 5i wrt p? 7fi - f - 130313i Differentiate -2o*3 + 468574o*2s*3 - 13s*3 + 5s*2 - 2208s - 3 with respect to o. -6o2 + 937148os3 What is the third derivative of -8l*6 + 5951155l*5 - 923l*2 - l + 12587? -960l*3 + 357069300l*2 Find the third derivative of -29419857l4 + l3 + 429614239l2. -706076568l + 6 Find the second derivative of -60136720z3 - 3072156z + 1. -360820320z Find the second derivative of -3299887r*2y*2 - 2r*2y + 7ry*2 - 38ry - 22r + y*2 wrt r. -6599774y*2 - 4y What is the derivative of -h*2 + 196234705h - 112267119 wrt h? -2h + 196234705 Find the third derivative of -19833644x*6 - 2x*2 - 4x - 608876 wrt x. -2380037280x3 What is the derivative of 361q*2 + 97950q - 425306745 wrt q? 722q + 97950 Find the second derivative of 3km3 - 5km2 + 7km - 132k - 6708m3 + 19m*2 - 173m wrt m. 18km - 10k - 40248m + 38 Find the third derivative of 80o4 + 306557o*3 - 2o*2 + 75074165o. 1920o + 1839342 Find the third derivative of -126260230v*5 - 102111027v*2. -7575613800v*2 Differentiate -1325254h - 6507021 wrt h. -1325254 Find the second derivative of 4y4 + 605110y*3 + 3963295y - 2. 48y2 + 3630660y Find the third derivative of 10a5 - a4 - 1898486a*3 + 103071a*2 + 1232 wrt a. 600a*2 - 24a - 11390916 What is the third derivative of 63352532l5u*2 - 4l*2u*2 - 8l*2u + lu + 464u*2 + 3u - 2 wrt l? 3801151920l2u2 Find the second derivative of j4 - 51185j3o - 253j2 - 2jo + 3j + 3o + 31863 wrt j. 12j*2 - 307110jo - 506 What is the third derivative of -6s*5 - 2354544s*4 + 67170s*2 + 2? -360s*2 - 56509056s What is the second derivative of 399g2i*4 - 2g*2i + g*2 + 7558i*4 + 2i - 1614523 wrt i? 4788g2i*2 + 90696i*2 Find the third derivative of 11383097ry3 - ry*2 - 4655497ry - 2y*3 - 2y*2 wrt y. 68298582r - 12 Differentiate 248k3 + 93k*2 - k - 14846463 wrt k. 744k*2 + 186k - 1 Find the second derivative of 2a5 + 46a*3 - 33385a*2 - 4137759a. 40a3 + 276a - 66770 Find the second derivative of -18284000r5 - 22620491r wrt r. -365680000r3 What is the derivative of -173a*4 - 8575a*2 + 4578588? -692a*3 - 17150a What is the third derivative of 15358960o3 - 2o*2 + 3o + 754849? 92153760 Find the second derivative of -398788679m3 - 309253890m wrt m. -2392732074m Find the second derivative of 22h*3 + 154352h*2 - 15h - 61193. 132h + 308704 Find the third derivative of 152878179o*5 + 109o*2 - 103o + 2157 wrt o. 9172690740o2 What is the second derivative of -24019q*5 + 3409q*4 - 34018993q - 1 wrt q? -480380q3 + 40908q*2 What is the second derivative of 108899431x*2 - 217713433x wrt x? 217798862 Find the first derivative of 567991739a2 - 218019916 wrt a. 1135983478a Differentiate 3ps*2 - 1862199p - 1374223s2 wrt p. 3s*2 - 1862199 What is the second derivative of -102714748g*4 - 56823233g? -1232576976g2 Differentiate -1502b*3 + 48040b - 78151905 wrt b. -4506b2 + 48040 Differentiate -159966170w + 127345947 wrt w. -159966170 Find the second derivative of b*4 - 12574196b*3h + 266bh - 254b - h + 68 wrt b. 12b*2 - 75445176bh What is the third derivative of -121173714g4 + g3 + 933030917g2 wrt g? -2908169136g + 6 What is the second derivative of -46865418b2nr2 + 2b*2n - 1078bnr2 - 2br2 - 9b - 782r wrt b? -93730836nr2 + 4n What is the third derivative of -25k4 + 8477703k3 + k2 + 71k + 18356? -600k + 50866218 What is the derivative of 1374f4 + 271665f + 466103066? 5496f3 + 271665 Differentiate 768y*4 + 2y*3 + 2228y*2 - 56100863 wrt y. 3072y*3 + 6y*2 + 4456y What is the first derivative of -2b2x + 3b2 + 48bx2 - 2bx + 97x*2 + 26007 wrt b? -4bx + 6b + 48x2 - 2x Differentiate 442800401q2 + 452796249 wrt q. 885600802q Differentiate -11n4 - 313464n*3 - 25174652. -44n*3 - 940392n*2 What is the third derivative of -71d*6 + 2334554d*3m*3 + 12787d*2m + 1324dm*3 wrt d? -8520d*3 + 14007324m*3 What is the third derivative of -325bv6 + 2bv2 - 2bv + 106119v*4 - 2v*2 - 2184941 wrt v? -39000bv3 + 2546856v Differentiate -28494327p2r*3 + 89962108p*2 wrt r. -85482981p*2r*2 Find the third derivative of 2053z*4 + 1628z*3 - 4336678z*2 wrt z. 49272z + 9768 Find the second derivative of -1064s4 + 28s*3 - 7s*2 - 20948s - 5184 wrt s. -12768s2 + 168s - 14 What is the third derivative of 7663712a4 + 2a*2 + 1722637a? 183929088a What is the second derivative of -396j*5 + 9500j*4 + 17323874j? -7920j3 + 114000j*2 What is the first derivative of -18200594b*4 + 36227419 wrt b? -72802376b3 Differentiate d2vz*2 - 69430947dz3 + 2vz3 - 241vz2 - 2v - 2z3 + 5z - 322 with respect to d. 2dvz2 - 69430947z**3 What is	{ "pile_set_name": "DM Mathematics" }
3d + 0d). -255d5 Expand (4c - 4c + 2c)(-1 - c2 + 4 - 4) + 46c - 46c + 18c*3. 16c*3 - 2c Expand 58k2 + 84k*2 - 91k2 - k2 - 2k + 2k - 3 + 3 + k*2 + (4 - 1 - 4)(2k - 2k - k2) + 1 + k2 - 1. 53k2 Expand (-4z + 4z + z2)(4 - 9 - 2) + 3z2 + 4z*2 + 11z*2. 11z*2 Expand (3 + 23w - 3)(-5 + 5w - 5w - 3w). -69w2 - 115w Expand (5 + 2 - 3x - 6)(-27 - 22x + 27). 66x*2 - 22x Expand (3 - 6 + 5)(-62 - 716 - 252 + 2t - 46). 4t - 2152 Expand -5v + 10v + v + (-1 - 9 - 6)(5v - 3v - v). -10v Expand (-2y*2 + 4y2 - y2 + (2 + y - 2)(-2y + 0y + 0y) - 3y2 - y2 + 3y*2)(2884 - 2884 - 137y2). 274y*4 Expand (-2l + 2l2 + 0l - 4l2)(0 - 2 + 4)(-56l*2 + 63l - 63l + (-l - l + 3l)(l - 4l + l)). 232l4 + 232l3 Expand m4 - m4 + m4 + (4 - 4 - 2)(-43m*4 + 46m*4 + 53m*4). -111m*4 Expand (5 - 17 - 6)((3 + 4 - 5)(-2z + 3 - 3) + 3z - 2z + 0z)(-z - 6z + 2z). -270z2 Expand (-4k + k + k)(3k - 2k + 0k) - 87 + 87 - 16k2. -18k*2 Expand (3l*3 - 4l*3 - 2l*3)(14l + 443 - 443 + 5l). -57l4 Expand (0c + 13c3 + 0c)(9 - 6 + 15)(5 - 5 + c*2). 234c*5 Expand ((b - b - b)(1 - 3 + 9) + 2b + 3b - 3b)(5b2 - 3b2 - b2). -5b3 Expand (-2f - f*2 + 2f)((1 - 2 + 0)(5 - 4 - 3) + 0 + 2 + 3 + 1 + 2 + 3). -13f2 Expand (-1705c + 1054c + 907c)(-2c + 7c - c). 1024c*2 Expand 0f*5 - 5f5 + f5 + (-f*2 + 2f*2 - 3f*2)(0f3 - f3 + 3f*3) + 4 + 2 - 204f*5 + 198f*5. -14f*5 + 6 Expand (2q2 - q2 - 3q2)((4 - 1 - 1)(0q*2 - 3q2 + q2) - 2 + 2 - q*2)(-4 + 2q + 4). 20q*5 Expand 1672a - 1672a + 35a*2 + 0a*2 + 3a2 - a2 + (-3 + 3 + 2a)(5a - a - a) - a + a - 4a*2. 39a*2 Expand (3 - 2 - 2)(-123 + 87 - 3p + 7p) + 2p - 4 + 4. -2p + 36 Expand (-3 + 3 - 2)(2o - 3 + 3 + (-o + 0o + 0o)(-1 - 1 + 0) + 4o - o - o - 7o - 6 + 6 - o + 2o - 3o). 6o Expand (-n - n + n)(-4n*3 + 262n*4 - 529n*4 + 263n*4)(-3 + 5 - 3). -4n5 - 4n*4 Expand (-488h - 2 + 425h - 391h)(3h - h - 3h). 454h*2 + 2h Expand (-458j + 980j - 3239j + 295j - 4633j)(4j - 2j - 4j). 14110j*2 Expand (0 + 3 - 2)(-4p - 8 - 1 + 2p)(-62 - 35 + 64). 66p + 297 Expand -f*3 + 2f3 + f3 + ((0f - 3f + 5f)(-5 + 2 + 2) + 0f + 0f + f)(-9f + 9f - f2). 3f3 Expand (-3 + d2 + 3)(-1 + 2 + 0) + d + d2 - d - 5d*2 + 0d*2 + 9d*2. 6d*2 Expand -2n*4 + 6n*4 - 5n*4 + (0 + 2 - 3)(-15n4 + 20n*4 + 19n*4). -25n*4 Expand (3 - 2 + 1)(-7u2 - 5u*2 + 6u*2)(3u - 5u + 19u). -204u*3 Expand (2 - 4u*3 - 5 + 10)(-u*2 - 2 + 2). 4u*5 - 7u*2 Expand (-1 + 51f + 1)(4 - 2 - 1)(-16 - 24 + 27)(0 + 5 - 3)(-2 - 3 + 4). 1326f Expand (-2l + 3l - 3l)(1 - 1 + 1 + (0 - 4 + 2)(2 - 6 + 2) + 4 + 3 - 5 + 3 + 2 + 0)(l - 3l - 5l). 168l*2 Expand 3k - 2k + 0k + (-2k - 4k + 7k)(1 - 1 - 2) + (-k + k + 2k)(4 + 5 - 4). 9k Expand (4 - 4 + 1)(-10h - 12h - 2h)((-2h + h + 3h)(3 + 4 - 5) + 4h - 3h + h) - h2 - 2h*2 + 2h*2. -145h*2 Expand (-q + q + q)((0q2 - 4q*2 - 3q*2)(-q + 2q2 + q) + (61q*2 - 11q2 - q2)(-7q*2 + 2q*2 + 4q*2))(2 - 1 - 2). 63q5 Expand (3 + 15 - 5)(-3d + d + 4d) + (-1 + 3 + 0)(-2d + 0d + 4d). 30d Expand -11a + 17a - 10a - 4a + 6a - 4a - 4 + 4 + 2a + (5a - 4a + a)(0 - 1 + 2) + 3a - 3a + a + 0a + 2a - 3a - 326 - 48a - 13a - 64a + 326. -127a Expand 9 - 9 - 7n2 + (2 + 0 - 1)(3n2 + 2n*2 - 4n*2) + 4n*2 + 0n*2 - 3n*2 - 129 + 65 - 10n*2 + 65. -15n*2 + 1 Expand 3l - 2l + 0l + (-26 + 12 + 28)(0 + 0 + 2)(4l + l - 3l)(5 - 5 - 1). -55l Expand (3p + 0p + p)(-p3 - 3p*3 - 15p*3) - 3p*4 + 0p + 0p. -79p*4 Expand -5m + 5m + m3 + (m - 2m + 3m)(3m2 - 2m*2 - 3m2) + 2 - 2 + m3 - 3m3 + 0m3 + m3 + (3 - 3 - m)(-47m*2 + 136 - 136). 43m*3 Expand (-18g*5 + 6g*5 - 15g*5 + g)(-3 + 2 - 2)(-2 + 2 + 2)(-2 + 2 + 2). 324g5 - 12g Expand (4q - q - q)(-319q + 299 - 299). -638q*2 Expand (-9 - 2d + 8 - 2 + (0 + 2d + 0)(-2 - 2 + 3))((2 - 4 + 0)(-3 + 1 + 0) + 6 - 4 - 1). -20d - 15 Expand w + w2 + 2w*2 - 2w*2 + 0w*2 + 2w*2 + 0w*2 + (-2 - 1 + 1)(2w2 - 3w*2 + 4w*2) - 2w*2 + 0w2 + w2. -4w2 + w Expand 231t*4 - 75t*4 + 99t4 + (-t3 + 3t - 3t)(-t + 4t - 2t). 254t*4 Expand (-79v*2 - 73v*2 + 205v*2)(2v2 - 4v2 - v2) + (5 - 5 + v)(-v + v - 2v*3). -161v*4 Expand (4y + 7y2 - 4y)(89y*2 - 60y*2 + 146y*2 + 54y*2). 1603y*4 Expand (0r - r + 0r)(-4 + 2 + 0) - 4r + r + 2r - r - 2r + 5r + 2 + 2r - 2 - r - 3 + 3 - 61r - 102 + 60r + 26. 3r - 76 Expand (s*2 + 3s*2 - 3s*2)(50 - 72 - 100)(3s - 3s - s). 122s*3 Expand (6 - 2 - 3)(2h3 + 3 - 3 + (h2 + h2 + 0h*2)(-6h - 2h + 5h)). -4h*3 Expand (69z + 231z - 74z)(4z - 5z + 4z). 678z2 Expand (-v4 + 7v*4 - 4v*4)(-v + 3v - 4v) + 185v5 - 64v*5 + 80v*5. 197v*5 Expand (0 + 5 - 4)(-1 - k + 1) - k - 1 + 1 + k + 2k - 2k + 14 - 43k - 10 + 42k. -2k + 4 Expand 7w + 4w - 7w + (-6 + 2 + 2)(-3w + 3w + 3w) + w + 84 - 84. -w Expand (-51f + 99f - 52f)(89f4 - 32f*4 - 36f*4). -84f*5 Expand (0 + 1 + 0)(-2 - 13 + 1)(-194j + 194j - 3j*5). 42j*5 Expand (9k*2 + 389 + 397 - 781)(0 + 6 - 3). 27k2 + 15 Expand (-29 + 18 - 25)(-7w2 + 5 + 0 - 7). 252w*2 + 72 Expand -4f*3 - 3f*2 + 3f*2 + (-2f*2 - 3f + 3f)(-146 - 58f + 146). 112f*3 Expand (166 + 137 - 109)(-2p2 + 4p2 + p2). 582p2 Expand (4i*2 - 3i2 + i2 - 1 - 2i3)((-1 + 2 - 2)(0i2 + i2 + 0i2) + 11i*2 - 9i*2 + 13i*2). -28i*5 + 28i*4 - 14i*2 Expand (-6 + 6 - 2u)(1 - 3 + 8)(2u - 3u - u). 24u2 Expand (5a - 5a - 7a*2 - 3 + 2a*2 + 3 + (-1 + 1 + a)(3a - a - a) + 0a*2 + 0a*2 - 2a*2)(a + a + 0a)(-2 + 0 - 3)(0 + 4a + 0). 240a4 Expand (3z2 + z2 - z*2)(-1 + 1 + 3z) - 8z - 11z3 + 8z + (1 - 3 + 0)(-1 + 1 - z3) - 3z - z*3 + 3z - 2z3 + 4z*3 - 4z*3. -3z*3 Expand (3 - 3 - 1)(-3m + 4m - 4m) + 345m - 713m + 321m. -44m Expand 10l - 3l2 - 10l + (-2l + 0l + 3l)(6l - 3l + l). l*2 Expand (6 - 1 + 1)(-2 - 2 + 6)(-3 - 3 + 7)(2t + 1 - 1). 24t Expand (-4 + 1 + 1)(-3 + 2a + 3) + 9 - 196a - 191a + 386a. -5a + 9 Expand (16h - 3h - 7h)(-2h + 3h + h) + (-9 + 3 + 2)(h2 + 0 + 0). 8h*2 Expand (6q + q + 0q)(6 + 54q2 + 7 - 13). 378q*3 Expand -4t + 5t - 3t + (-1 + 2 + 1)(4t - t - t) + 4t - 4t - t - 43 - 24t + 43. -23t Expand (f*2 - 2f3 - f2)(2f + 3f - 4f) + (-2f3 + 0f + 0f)(2f - 2f + f) + 5f3 - 5f*3 + 10f*4. 6f*4 Expand (-2 + 2k*3 + 2)(3k + k - 3k)(9k + 1 - 1) + 7k5 + 5k - 5k. 25k5 Expand (-s2 - 2s + 2s)(3 - s3 - 3)(-746 - 514 - 65). -1325s5 Expand (35 - 15 + 9 + 3p + 37)(-5 + 2 + 5). 6p + 132 Expand y3 - y3 + y*3 - 181y*3 - 1699 + 1699 + (0 - 2 + 1)(0y - 2y*3 + 0y). -178y3 Expand (-3w*3 + 2w*5 + 3w*3)(1 + 0 + 0) - 114w3 + 1077w*5 + 178w*5 + 114w*3 + 23w*5. 1280w*5 Expand (1 + 12d*3 - 18 - 14d*3)(-1 + 1 + 11). -22d3 - 187 Expand (-3 - 5w*2 + 3)(-w*3 + 0w*3 - 9w*3) - 2w*2 + 2w*2 + 2w*5. 52w*5 Expand -8o*2 - 16o*2 + 5o*2 + (10 - 10 + 11o*2)(5 - 5 + 1). -8o2 Expand (-2b3 + b3 + 0b3)(-3b - 3b + 4b) - 2b*4 + 3b*4 - 2b*4 + 2392 - 2392 + 238b*4. 239b*4 Expand 4t + 0t + t + (2 + t - 2)(-27 + 156 + 242). 376t Expand (-6 + 0 + 9)(-4 + 4 + 2)(-6 + 3 + 0)(-f*4 - 3f4 + f4). 54f4 Expand (2 - 146v + 85v + 87v)(3v*3 - 3v3 - v3). -26v4 - 2v*3 Expand -2l*4 + 7l*4 - 10l*4 + (-3 - l + 3)(141l3 - 80 + 80). -146l*4 Expand (-10u - 17u - 11u + (-2 + 1 + 2)(-4u + 0u + 5u))(2 - 3 + 0 + 6 + 0 - 4 + (-2 + 2 - 2)(0 - 1 + 3) - 3 - 1 + 3). 148u Expand -z2 - 4z + 4z + 0z2 - z2 + 0z2 + (-3z - 24 + 24)(-2z - 2z + 5z) - 5z - 4z*2 + 5z. -9z2 Expand (-2i*2 - 4i*4 + 2i*2)(-15i + 230i + 11i). -904i*5 Expand (-9382 + 23h + 9382)(-2 + 2 + h2) - h	{ "pile_set_name": "DM Mathematics" }
the second biggest value in t, 0.2, -3, 0.5? 0.2 Let h = -1.462 - -1.442. What is the second biggest value in 0, -5, h, 2/11? 0 Let p = 0.0858 + 4.9142. Let y be (-1)/(-4)(2 + 2). What is the second smallest value in -3, y, p? y Let v = -1.1 + 0.2. Let x = v - -4.9. Let g = 474/91 - 64/13. Which is the second smallest value? (a) x (b) g (c) 0.5 c Let m = -8581/10 - -855. Let p = -5/2 - m. What is the third biggest value in -0.5, p, 26? -0.5 Let p(h) = 6h - 17. Suppose -3r + 2r - 8 = 0. Let b be p(r). Let c be 1 - b/(-75) - 0. What is the biggest value in c, 0, 2? 2 Let z(k) = k. Let q be z(4). Let j = 483 - 483.199. Let x = 5.199 + j. Which is the biggest value? (a) q (b) x (c) -0.6 b Let q = -0.31 + -121.29. Let u = 121 + q. What is the second smallest value in 2, -1, u? u Let v = 4.7 + -5. Let s = -250 + 247. What is the third biggest value in s, 0.11, v? s Suppose -703v - 21 = -696v. Which is the biggest value? (a) 0.011 (b) 2/7 (c) v b Let u = -35.5 - -33.5. Which is the second biggest value? (a) u (b) -5 (c) 2/9 (d) -0.4 d Let x = -4.26 - -0.26. Let l = 66 + -66. Which is the third smallest value? (a) x (b) -13 (c) -0.3 (d) l c Suppose 18 = 3m - 3. Let y = m + -3. Suppose 3s - ys = 0. Which is the biggest value? (a) -5/4 (b) s (c) 5 c Let f be 1/(-9)(-25 - -27). What is the biggest value in -0.069, f, 2/3? 2/3 Let g(n) = -n*2 + 3n + 42. Let i be g(8). Let k = -0.4 - -3.4. What is the second smallest value in i, 5, k? k Let q(z) = -9z. Let j be q(-1). Suppose 0 = 4x - 19 - j. Suppose 0 = 5y + 13 + x. Which is the third smallest value? (a) 2 (b) 3 (c) y b Let h = -8 + 20. Suppose -7b + 9b = h. What is the third biggest value in -4/5, b, 0.4? -4/5 Let y = -0.008 + 4.008. Let i = -2/5 - -29/35. Which is the third biggest value? (a) -1 (b) -2/11 (c) y (d) i b Let t = -108 - -62. Let x = -49 - t. What is the third biggest value in x, -0.3, -1/4? x Let y = -40 + 43. Let b = -0.1 - 0.1. Let o = 0.2 + b. What is the second biggest value in 5, y, o? y Let h be (3 + -6)/((-7)/((-28)/(-18))). What is the third biggest value in -4, 2, h, -0.4? -0.4 Let y be (24/10)/((-336)/(-120)). Which is the fourth smallest value? (a) -5 (b) 0.2 (c) -2 (d) y d Let k be ((-8)/30)/(5/(-500)). Let n = k + -26. What is the smallest value in n, 1/3, 3? 1/3 Let o = 0.06 + -2.06. Let p be -9 + ((-16)/(-24) - -8). Which is the second biggest value? (a) o (b) p (c) 2 (d) -2/19 d Let o = -0.5 - 2.5. Let m = 18 + -17.9. Let k = m - 5.1. Which is the second smallest value? (a) k (b) o (c) 5 b Let k be 12 + (-8078)/490 - (-2)/7. Which is the second smallest value? (a) k (b) 0.15 (c) -2/5 c Let p be ((-2)/(-7))/(((-8)/(-7))/8). What is the biggest value in -4, p, -0.3, -2/9? p Let v = -8.9 + 8.7. What is the biggest value in 2/19, 2/51, -0.1, v? 2/19 Let r = -110 - -113. Let v = -1.22 - -1.1. Which is the second smallest value? (a) 2 (b) r (c) v a Let p = 3.2 - 2.88. Let r = p + -4.32. What is the second smallest value in -1, -0.2, r? -1 Let s be (-12)/(-10)22 - 9/(-15). Which is the biggest value? (a) s (b) 2/7 (c) 0.2 a Let h = 139.2 - 139. Which is the biggest value? (a) h (b) -33 (c) 2/11 a Let f = 235.8 - 236. What is the smallest value in -0.9, -1/2, -4/5, f? -0.9 Let s = 913/4 - 224. Let u = s - 247/60. Which is the second smallest value? (a) -6 (b) 0 (c) u b Let u = -8 - 11. Let n be (0 + 0 + -2)/(16/12). Let z be 3/12 + (-5)/(-12). What is the third biggest value in z, n, u? u Let h = 0.003 + -0.403. Which is the smallest value? (a) -1/7 (b) 0.151 (c) 1 (d) h d Let q = -191/301 + 15/43. What is the smallest value in -3, 19, q? -3 Let f be 18/42((-28)/6 - -5). Which is the fourth smallest value? (a) -7 (b) 0.1 (c) -0.5 (d) f d Let r = 9.83 - 116.63. Let v = r + 107. Which is the second smallest value? (a) 5 (b) v (c) 1/9 b Let x be (-9)/3 + (-2 - -2). Let d = -449/5 - -89. Which is the biggest value? (a) x (b) d (c) 1 c Let b = -1.49 + 1.09. Let x be 9/(-6)3(-4)/18. What is the third smallest value in 1/3, -0.2, x, b? 1/3 Suppose -136 + 11 = 25q. What is the second smallest value in q, -3/4, 31.8? -3/4 Let z = -69739/177 - -394. Let j = z - -62/531. Which is the third smallest value? (a) -2 (b) j (c) -3/4 (d) -4 c Suppose 20r - 6r - 70 = 0. Suppose r = 2s + 7. Let t be -1((-16)/3)/2. Which is the second smallest value? (a) 0 (b) s (c) t a Suppose z = 6z + 20. Let c = 19 + -1. Let t = -19 + c. What is the second smallest value in z, t, 0.4? t Let q = 45.34 - -0.66. Let g = 44 - q. Which is the smallest value? (a) 2 (b) g (c) -2/19 b Let h = -2.02 - -4.02. What is the second smallest value in h, 1, 5, -6? 1 Let x = 28 + -26.3. Let s = 4.7 - x. Let g = 5 - s. Which is the third biggest value? (a) -5 (b) g (c) -2/5 a Let v(h) = 5h - 26. Let i be v(6). Let s be (-23)/38 - (-2)/i1. Which is the third smallest value? (a) -3 (b) 1 (c) s (d) -0.4 c Suppose -3d + d + 3u - 5 = 0, 30 = 4d + 2u. Let g = -17 - -14. Which is the smallest value? (a) g (b) d (c) -2/3 a Let k = -584 + 2335/4. What is the smallest value in 70, k, -0.3? -0.3 Let y = -107.8 + 108. What is the biggest value in -3, -353, y, 0? y Let n = -381 - -383. Which is the second biggest value? (a) 0 (b) n (c) -7 a Let f = -6.5 - 0.1. Let b = f + -1.4. What is the third smallest value in -2, b, 2/15? 2/15 Let z = -4.5 - -8.5. Which is the second smallest value? (a) -1/6 (b) -4 (c) 45 (d) z a Suppose -z - 3c - 544 = 3z, -5z - 675 = 5c. Let n = 413/3 + z. Let b = -328.1 - -328. What is the biggest value in n, -0.3, b? b Let u = -410 - -420. Which is the biggest value? (a) -2 (b) -5 (c) u c Suppose 0n - 5n = -2t, 10 = 5n - 4t. Let r be 0 + ((-4)/2 - n). Which is the second smallest value? (a) r (b) 2/11 (c) 1/4 (d) -3/2 a Suppose 0 = u - 4u + 36. Let d = -24 + u. Let w be 16/d + (-258)/(-207). What is the third biggest value in w, -0.1, 1/4? -0.1 Let q = 16.2 - 0.2. Let n = q - 13. What is the biggest value in 10, -3, n? 10 Let c be 6/(4/(-6)-3). Let t = 1469 + -1474.036. Let x = t + 0.036. What is the smallest value in x, c, -3/5? x Let q = -1615.7 - -1616. What is the biggest value in 1, 0, q, 68/7? 68/7 Suppose 99m - 89m + 190 = 0. Which is the third biggest value? (a) 0.5 (b) m (c) 2/13 b Let z be (-18)/(-4)(-28)/42. Which is the third smallest value? (a) z (b) 3 (c) 190 c Let u = -0.237 - -0.037. Suppose -5s + 2j = -28, -2s - 4 = -2j - 20. What is the third smallest value in u, s, 5? 5 Let h = 28.9 + -29. Let n = 116 - 124. Which is the smallest value? (a) h (b) 5 (c) n c Let u be ((-28)/(-490))/(-13/(-30)). Suppose -2f - 6 - 4 = 0. Suppose g + 5 + 17 = 5q, g + 6 = q. Which is the second biggest value? (a) f (b) u (c) q b Let z = -1/39 + -49/117. Which is the smallest value? (a) z (b) 9 (c) -4 c Let m = 2.94 + -6.94. Which is the biggest value? (a) -2.3 (b) m (c) 0.06 c Let k be (-14)/8 + 6/3. Let o = 0.8044 + -0.7744. Which is the second smallest value? (a) 1 (b) o (c) 3 (d) k d Suppose -z = z + 4. Let p = 0.27 + -0.67. What is the second smallest value in z, p, 4/3? p Let o = 46 + -50.96. Let x = -0.04 + o. Let q be 96/45 + 0 - 2. What is the smallest value in q, 2/7, x? x Let f = -0.44 + -10.56. Let l = f - -13. Suppose 4g + 6 + 6 = 0. What is the third biggest value in g, l, -0.4? g Let x = 1.6 - 1.9. Suppose 2d + d + 3 = 0. Which is the third biggest value? (a) x (b) 0.2 (c) d c Let d = 0.218 - 0.218. What is the third smallest value in 0.5, 4, -1/8, d? 0.5 Let r = 39 - 44.8. Let v = r - -6. Let w = v - -5.8. Which is the third smallest value? (a) w (b) 0.3 (c) -5 a Suppose a - 2 = -1. Let r = 43.7 + -50. Let j = -6.1 - r. What is the third biggest value in a, j, 0? 0 Suppose 4r = 3q + 25, -4q - 18 - 6 = -3r. What is the smallest value in -0.1, q, -12? -12 Let t = 25 + -24. Which is the smallest value? (a) t (b) 31/3 (c) 2/7 (d) 5 c Let x = 0.691 - 0.591. What is the third biggest value in -2.3, -0.03, x? -2.3 Let w = 0.768 - 0.268. What is the second biggest value in -0.3, w, -0.1, 1? w Let q = 187.969 - 188. Which is the fourth biggest value? (a) q (b) -3/4 (c) 0.5 (d) -0.2 b Let n = 2565 - 2550. What is the smal	{ "pile_set_name": "DM Mathematics" }
third derivative of -m*4r*2 + 12m*4 + 674m*3r*2 + 2144m*2r*2 - 6r*2 wrt m. -24mr2 + 288m + 4044r2 Find the second derivative of 3071f*3 + 338f*2 + 4741504f. 18426f + 676 What is the third derivative of -1216j*6 - 2j*3 - 151189j*2 wrt j? -145920j*3 - 12 Find the second derivative of 92t*4 + 385t*3 + 2t*2 - 7t - 7091. 1104t2 + 2310t + 4 What is the derivative of -877867p2 - 2p + 2601305? -1755734p - 2 What is the second derivative of 56249m*4 + 62494m wrt m? 674988m2 Find the third derivative of -306418x*3 - 1680x*2 - 36x wrt x. -1838508 Find the second derivative of 2o5 + 114o*4 - 10o*3 + o + 134924 wrt o. 40o*3 + 1368o*2 - 60o What is the third derivative of -241759s6 - 171937s*2 wrt s? -29011080s*3 Differentiate 44426a*2b*2p - 7a2b*2 - 2a*2b - 84ab*2 + 10abp - 109b2 with respect to p. 44426a*2b*2 + 10ab Differentiate 5914u*4z*3 + 2u*4 + 15z*3 + 48z - 5 with respect to u. 23656u3z*3 + 8u*3 What is the third derivative of 58012h*3 + 4622h*2 wrt h? 348072 What is the third derivative of -82777n*2z*4 + 5n*2z*2 - 2n*2z + 5n2 - 4nz4 - 30nz - z2 wrt z? -1986648n*2z - 96nz Differentiate n*2o*2 - 650n*2o - 1258n2r + no3 - 2o*3r + 3 with respect to r. -1258n2 - 2o*3 Differentiate -3381m*3 - 4m*2 - 325853. -10143m*2 - 8m What is the derivative of -2023w4 - 22w + 222649 wrt w? -8092w3 - 22 What is the third derivative of 3z*5 + 38234z*3 + 2z*2 + 17z - 6269? 180z2 + 229404 What is the first derivative of 784885k + 3362382 wrt k? 784885 What is the first derivative of 257448d3 + 2336054 wrt d? 772344d*2 What is the second derivative of 2f*3o - 17f3 - 27f*2o + 103fo + 2f - 22 wrt f? 12fo - 102f - 54o Find the first derivative of -y2 - 7440y + 118170 wrt y. -2y - 7440 Find the second derivative of -6c*4 - 45c*3d - 494c2d*2 - cd*2 - cd + 66c - 3d*2 + 22d wrt c. -72c2 - 270cd - 988d*2 What is the second derivative of -3hiw*4 + 2hiw*2 + 3hiw - 107hi + 9h - 645w*2 wrt w? -36hiw*2 + 4hi - 1290 What is the third derivative of -154169j*3 + 954j*2 + 58j wrt j? -925014 Differentiate 5030a3t + 3811a3 + 3a*2t + 4a with respect to t. 5030a*3 + 3a*2 What is the second derivative of -4342898h*2o*2 - 48h - 6796o2 + 2 wrt h? -8685796o*2 Differentiate 290923w*2 - 126742. 581846w Find the third derivative of -239708v5 + 13613v*2 + v. -14382480v*2 What is the third derivative of 34r*4 - 2450r*3 - 2r*2 - r - 13753 wrt r? 816r - 14700 Differentiate -492193q - 437955 wrt q. -492193 What is the derivative of -3js3 - 22838js2 + 4j - 1565 wrt s? -9js*2 - 45676js Find the third derivative of -34062n*3v*2 + 54n*2v*2 + 3nv2 - 2n + 26 wrt n. -204372v2 What is the second derivative of -2l*5 + 4l*4 - 1311l*3 - 218150l wrt l? -40l3 + 48l*2 - 7866l Find the first derivative of 5hq - 4934h - 195q + 128 wrt h. 5q - 4934 What is the first derivative of -282588v*2 + 564081 wrt v? -565176v Find the first derivative of -a*3q - 340a2q + 23aq*2 + 63q*2 - 851q + 6 wrt a. -3a2q - 680aq + 23q2 What is the third derivative of -8kn3v - 46kn*3 - 2kn - 156n*3v - n*3 + 17543n*2v - v wrt n? -48kv - 276k - 936v - 6 Find the third derivative of -2940590f4 - 8f*2 + 122048. -70574160f Find the first derivative of 88008iv + 908301i wrt v. 88008i Differentiate 15r2x - 27776r2 + 83x*2 with respect to x. 15r*2 + 166x What is the first derivative of 52cho2 + 3ch - 3c + 17ho*2 + h + 3o - 21 wrt o? 104cho + 34ho + 3 What is the third derivative of 294498h*5 - 3h*2 + 9h + 3380 wrt h? 17669880h2 What is the third derivative of -1464d*3i*3 - 18d*3 + 6d*2 - 26di2 - di - 8i3 - 2i*2 wrt d? -8784i*3 - 108 What is the second derivative of 1446273f*4 + 68777f - 1 wrt f? 17355276f2 Find the first derivative of -bhw3 - 822bhw - 39bw*2 - 7bw + hw2 + w3 wrt h. -bw3 - 822bw + w2 What is the third derivative of 388a*5 - 366a*4 - 188a*2 - 10273 wrt a? 23280a*2 - 8784a What is the second derivative of -1766t4 + 9t*3 - 42t - 252 wrt t? -21192t2 + 54t What is the derivative of 257647s2z*2 + 45z*2 - z + 595 wrt s? 515294sz2 Find the second derivative of 69a*3 - 1109a*2 - 56353a wrt a. 414a - 2218 Find the third derivative of am*3n + 2am*3 + 3am2n + am2 - 2amn - 495m3n - 19m3 - m2n + m*2 + 278m wrt m. 6an + 12a - 2970n - 114 Differentiate -337811h4 + 520603. -1351244h*3 What is the third derivative of -14972l*5 + 12l*2 - 2l - 162? -898320l2 What is the first derivative of -7n*4 + 2481n + 9286? -28n3 + 2481 What is the third derivative of -5255304r*5 + 55r*2 + 7r + 492 wrt r? -315318240r2 What is the first derivative of -1290154jy3 + 3y*3 + 7y*2 - 1139y + 2 wrt j? -1290154y3 Find the third derivative of -31346p4 - p3r - 8p*2 - 29pr - 1 wrt p. -752304p - 6r Find the first derivative of 9o4 + o3 + 53o + 611511. 36o*3 + 3o*2 + 53 What is the third derivative of 6w*5 + 1028w*3 + 49w*2 + w - 2? 360w*2 + 6168 Differentiate 2766nr + 25703n - 9r wrt r. 2766n - 9 What is the third derivative of -1233798w5 + 59w*2 - 1217w wrt w? -74027880w2 What is the second derivative of -3k*2pr - 3251k*2p - k*2r*2 - 2kp - 2kr2 - 4pr - r2 + 24r wrt k? -6pr - 6502p - 2r*2 What is the third derivative of -4533b*6 - 233b*4 - 2214005b*2? -543960b*3 - 5592b What is the third derivative of -o*4x*2 - 689o*4x - 3o4 - 23o*2x - 14o2 + ox - 14x2 wrt o? -24ox2 - 16536ox - 72o What is the derivative of -16g2i + 338105g2 + gi + 2i2 - 903i wrt i? -16g2 + g + 4i - 903 What is the derivative of -a*2 - 32562a - 73567? -2a - 32562 Find the second derivative of 848723z*2 + 3325z - 4. 1697446 Differentiate -28387z - 2095. -28387 What is the first derivative of -402053pu4 - 296p - 116 wrt u? -1608212pu*3 Differentiate -13m*2u - 11974m2 + 1925u with respect to u. -13m2 + 1925 What is the derivative of -5f*2k + 46250f2 + 1648k wrt k? -5f2 + 1648 Find the first derivative of 31b*2p + 6b2 + 5b + 13525p - 3 wrt b. 62bp + 12b + 5 What is the second derivative of 552539j3 - 339j + 368? 3315234j What is the first derivative of -92536c - 92378? -92536 What is the derivative of -2709f2 - 37f - 146741? -5418f - 37 What is the third derivative of -f3r*4 - 8f*3r*3 - 10f*3r - 304f2r*2 + 107r*4 wrt r? -24f*3r - 48f3 + 2568r Find the first derivative of 439202f + 133821 wrt f. 439202 What is the third derivative of 532295lu3z*3 - 4lu3z*2 - 65lu3z - 2lu*2z*3 - lu*2z*2 + 28 wrt z? 3193770lu3 - 12lu2 What is the third derivative of -25795v*4 - 2733v*2 + 2v wrt v? -619080v Find the third derivative of -386712u*3 + 233058u*2. -2320272 What is the derivative of -665d*2 - 12dn + 45503n wrt d? -1330d - 12n Find the first derivative of -g*4i + 1945g2i + gi + 12094i + 3 wrt g. -4g3i + 3890gi + i Find the second derivative of -57d5 + 70d*4 - 29010d - 2. -1140d3 + 840d*2 Find the second derivative of 10470g*2 - 192g - 8. 20940 Differentiate -145993m2r*2 + 2m*2r - 28m2 + 879 wrt r. -291986m*2r + 2m2 What is the second derivative of -9272g*2o*2w - 6g2w*3 - 3gw3 - 3gw2 + 2o*2w3 - o2w - 2o - 3184w2 wrt g? -18544o*2w - 12w3 What is the second derivative of n3 + 13074n*2 + 3816n? 6n + 26148 Differentiate -357635g*4 - 207877 with respect to g. -1430540g*3 Differentiate -453940a*2 + 846850 wrt a. -907880a Find the third derivative of -99996c4 - 4c*3 - 160524c*2. -2399904c - 24 What is the third derivative of -c*4 + 6748c*3 + 446068c*2 wrt c? -24c + 40488 Differentiate 534323n2 + 1152144 wrt n. 1068646n What is the second derivative of -30j2z**	{ "pile_set_name": "DM Mathematics" }
= 10u - 13. Let w be c(4). Suppose -wf + 24f = -9. Solve 5q - 4l = 0, -2q + 33 = 2l + fl for q. 4 Let f = -744 - -747. Suppose -16 = -2b - 5p, p - 16 = 2b - 2p. Let y be (-82)/(-5) + b/5. Solve -3s + 4v - y = s, -4v = fs + 19 for s. -5 Let k = -33 + 37. Suppose 0 = -kx - x + 20. Solve 13 = 5o + 3y, xo - 5y = -o + 5 for o. 2 Let j be (0 + -2 + 3)(6 - 7). Let d be (3 + j)77/14. Solve 23 = -2u - 2u - 3o, -o - d = 2u for u. -5 Suppose 0 = 19r - 12r - 49. Solve -4w - r - 3 = 3k, 0 = w + 1 for k. -2 Let q(r) = 5r - 1 + 2r + 120r*2 - 121r*2. Let s be q(6). Solve sc - 37 = 5b - b, b = 3c - 18 for b. -3 Let i be -2 + (-2)/(4/(-86)). Suppose io + 45 = 46o. Solve -o = -m - 3x, 2x + x + 3 = 3m for m. 3 Let v(l) = -2l - 6. Let u be v(-4). Suppose -111n + 4 = -107n. Suppose -up + n = -3. Solve -i - 5 = -3m, -i + pm - 2 - 1 = 0 for i. 1 Let q = 149 - 144. Solve 0 = -4m + 12, -7m + 32 = qc - 3m for c. 4 Suppose -k - 1 = -5m - 5, -5k + 112 = -2m. Let p = k - 24. Let t be ((-15)/6 - -2)p. Solve t - 16 = 4g - j, -4 = j for g. -5 Suppose 12m = 33 + 15. Solve -5 = n + 4u - 23, 2n - 2u + m = 0 for n. 2 Suppose -11y - 16 + 71 = 0. Suppose -2 + y = w + x, 4w - 6 = -2x. Solve -4k - b = w, -3k = -k - 4b for k. 0 Suppose -24q + 66 = -54. Solve 0 = -5j - 5r + 40, -qr + 10r = 20 for j. 4 Let z = -35 - -35. Suppose zq - 3q = -78. Suppose u + 16 = q. Solve -4d - 4w - 20 = -0d, -2d + 4w = u for d. -5 Let w = 4 - 1. Let p be -11 + 31 + 22. Let y = 24 - p. Solve 2t + 5c - 4 = -y, 2t = wc + 4 for t. 2 Let r(n) = -n + 4. Let k be r(-3). Let v be (-2)/((-2)/k1). Solve -w + vo = 3o - 17, 5w = -o + 22 for w. 5 Let k = -103 - -108. Solve -km + 3b - 12 = 15, -4m - 4b + 4 = 0 for m. -3 Suppose -4r = -7r, 4o - 4r - 144 = 0. Suppose -u + 5u = 0, 2u = -3a + 306. Let d be a/27 - (-8)/o. Solve 2l + 16 = -3k + dl, -k + 4 = 4l for k. -4 Let z be 9 - (-64)/8(-2)/(-4). Solve 0 = -2m + 2t + 2, -4t + t = m - z for m. 4 Suppose -3k = -3b - 18, -b + 12 = 3k + 2k. Let u be (b/(-4))/((-1)/(-24)). Suppose 13 = 5v - 12. Solve -3r - 3h = -u, v = 5r - 2h + 3 for r. 2 Suppose 0 = -4p + 3t + 74 - 73, 3p = -2t + 22. Solve 2w - 7w - 3c = 15, -9 = 3w + pc for w. -3 Suppose 5b + w - 1 = 0, -4w + 2w = 3b - 2. Suppose -4u + 5k - 5 = b, 3 = -u - u + 3k. Solve a + 3 + u = 3y, 4y + 7 = 5a for a. 3 Let n = -3 - -5. Suppose -24 = -4j + 4. Suppose -no = -4y - 3o + j, 5y = -3o + 7. Solve 2x - y = 4w, 4w - 8w = -x + 3 for w. -1 Suppose 2q = -5 + 13. Suppose qm = 2b + 42, -4m + b = m - 54. Solve -4k + m + 15 = 2u, -k = 2u - 14 for k. 4 Let a be ((-16)/10)/(-2) - 176/(-80). Solve 0 = -4u - 2n + 9 + 9, -u = -an - 1 for u. 4 Suppose 0 = 298m - 292m. Suppose u = 3u - 8. Let k = -2 + u. Solve m = ki - 3r + 7r + 10, -i = -4r - 7 for i. -1 Suppose 7 = 3r - 56. Suppose 0a + 3f - r = -a, -5f = 3a - 43. Solve -3 = -2i + ak - 3k, 8 = 3i - k for i. 3 Let h be 1036/481 + 4/(-26). Solve -4f + 3c - 5 = 0, 0c = f - hc for f. -2 Let f(t) = -t*2 - 33t - 155. Let g be f(-27). Solve 4w = 4q - 32, -2q + 17 = -4w - g for q. 4 Suppose -o = y - 0y + 2, 0 = -5o + 2y + 18. Solve 4d = 2r + r - 8, -4d + 12 = or for d. 1 Suppose -4y - 2i = 26, -5y - 19 = -i + 10. Let u = y - -10. Solve -16 = -ua, r + 4a - 16 = -0a for r. 0 Let r be (2 - 4)(-30)/60. Solve -5b - 2l + 5l + 7 = 0, r = 3b - 5l for b. 2 Let z(p) = -13p*3 + 3p*2 - 15p - 17. Let v be z(-1). Solve o - v = -4j, 4o + 3j - 23 = -2j for o. 2 Let q = 21 + -17. Let d(m) = 14m + 41. Let l(c) = 5c + 14. Let s(n) = -6d(n) + 17l(n). Let v be s(11). Solve -2 = -3j - w, vj + 5w - 2 = -q for j. 1 Suppose -2q = -28 + 18. Solve x = 2c - q, 2x - 16 = -4c + 6 for x. 3 Let n = -58 - -44. Let f be (2/4)/((-1)/n). Solve 3i + f + 12 = -2u, -4u + 17 = -5i for u. -2 Let c(o) = o3 + 8o*2 - 2o - 13. Let b be ((-7)/3 - -1)/(31/186). Let d be c(b). Solve -2y - l = -3, l - 2 = -dy - 0 for y. -1 Suppose 0 = -3t + 5u + 9, -3t - 3u = -6t + 9. Suppose -p = -3a + 71, -5 = tp + 1. Solve -5n = 4q - 6 + a, -5 = n for q. 2 Suppose 2y + 5 + 5 = -4n, -4y - 20 = 0. Let c(g) = g*3 - g - 6. Let r be c(n). Let x be 7 - (-4)/(8/r). Solve 0 = 4t - 2t - x, -12 = 3u - 3t for u. -2 Let u be ((-1)/(-1))/(-1)36/(-12). Suppose 0 = 6t - ut. Solve -1 = 2n + 2q + 3, t = -n - 3q - 8 for n. 1 Suppose 2b + 81 = 87. Let m = 5 - 7. Let f be (-15)/(-25) + m/(-5). Solve 5n - bw - f = w, 26 = -2n - 5w for n. -3 Let t = -28 - -20. Let f be (-4)/(-12)(-2 - t). Solve -s - fg = 10, -4s - 3g - g = 28 for s. -4 Let x = 30 - 27. Solve 4n - 8 = v + 9, 0 = -2n + xv + 1 for n. 5 Suppose 3r - z - 41 = 0, 5r = 2z + 3 + 67. Let v be ((-2)/4)/((-2)/r). Solve 2g - 9 = i, vg = -0g - 5i - 6 for g. 3 Let a(n) = n + 6. Let b be a(-6). Let v = 0 + b. Suppose -5s + 4 + 6 = v. Solve u = -4r + 11, -sr + u + 7 = -0r for r. 3 Let z be 4/10 - (-4)/(-10). Let m = -6512 - -6514. Solve mx = -2x + 3y - 17, 5x + 4y + 29 = z for x. -5 Suppose 6 = 5c - 4. Let o be (-16)/(-2) - 2c. Solve 0v - 21 = -ow + 5v, -5v - 22 = -3w for w. -1 Let t be 13/(52/(-32)) + 10. Solve 2g = -3f + 6g + t, 4f - 4g = 0 for f. -2 Let u be -2(-425)/204 - 1/6. Solve 4k = -4c + c + u, 4c - k = -20 for c. -4 Let w be 7/((-56)/(-16)) - -3. Solve o + 5 = 2o + 3l, -wo - 13 = -4l for o. -1 Let k be ((-40)/50)/(1/(-5)). Suppose -ka = 5w - 14, w = 4a - 42 + 16. Solve -p = p - t - a, 5t = -5p for p. 2 Suppose -4f = 2l + 12 - 8, 4 = -l - 3f. Solve 3 = -b, 2k + lb + 3 = -1 for k. 1 Let f be (-216)/(-264) + 4/22. Solve 0 = 5k + 4y + f, k - 4 = 4k - y for k. -1 Suppose -4d - 13 + 4 = -l, 19 = 4l + d. Suppose 150 = i + li. Solve k - 20 = -4g, -5g + 3k + 0 + i = 0 for g. 5 Let f be 4/(-32)-4(4 - 2). Solve -2q + 2r = -0q - 8, f = -5q - 2r for q. 1 Let z be 2 - (3 - 2) - -5. Suppose c + 3 = z. Let n be 4/(-10) - 27/(-5). Solve -np = 2i + 22, 5i + 4p + 18 + c = 0 for i. -1 Suppose 5o - 2z - 5 = 0, 5o - 2z + 7z - 40 = 0. Suppose 0 = v - 32 + 3. Let c be 4/20 - v/(-5). Solve -4g = 3r - 4 + 11, -3g - or = c for g. -1 Suppose 3b - 22 + 6 = 2c, 5b - 2c - 20 = 0. Solve -i - p = -b, -4i + 3p = -5i + 4 for i. 1 Let a(o) = -o3 + 4o*2 - 10o + 26. Let i be a(3). Solve -2l + iw = 0, 0w = 4l - w for l. 0 Let u(o) = -o*2 - 13o + 2. Let l be u(-13). Solve 8q - 3q - 5 = 0, 4q - 6 = lz for z. -1 Let z = 11 - 21. Let g be (-46)/z + (-4)/(-10). Solve m + gc = c - 11, -3c = m + 8 for m. 1 Let p be 9 + 2/(0 + -2). Suppose -18 - 22 = pl. Let g = -1 - l. Solve gh + 2u = -10, 5u - 2 + 1 = 3h for h. -2 Let l = 0 + 3. Let z(v) = v3 - 60v*2 + 8v - 480. Let p be z(60). Solve -5i + n + 15 = p, -ln + 0 = i + 13 for i. 2 Let k be (-2 - -4)1 + (-22 - -22). Solve -3i + n - 9 + 1 = 0, -5n = -ki + 12 for i. -4 Suppose 0 = 2a + 2o + 4, 3a = 6a - 5o - 10. Suppose -5y - 1 = -21. Solve -ym - m - 8 = 2h, -3h + 4m - 12 = a for h. -4 Let n be (-2)/(-5)(-10 + 45). Solve n = -3k + 5a, 3k - 3a = 1 - 13 for k. -3 Let z be ((-2)/4)/((-1)/4). Suppose -3n = 2n - 20. Let y(t) = -t3 + 5t*2 + 4t - 5. Let d be y(5). Solve -3h + 3r = d, 6r - r + z = -nh for h. -3 Suppose -h + 6h - 15 = -3v, -9 = -3h - 2v. Solve -hj = 5r - 17, 0 = -j - r - 4 + 7 for j. -1 Let u be 52/(-65)10 - -22. Solve 0 = 5k + 3c - 22, -k - c + u = 2k for k. 5 Let p(n) = -n*3 - 5n*2 - 6n - 6. Let t be p(-4). Solve -th = h - z - 13, -2z - 2 = 0 for h. 4 Let d be (-9)/36 + 25/4. Suppose -u + 3u = d. Suppose 40 = us + b, 4b = s - 5s + 48. Solve -2o = -m - s - 1, -5m + 2o = 35 for m. -5 Suppose 20 = 5v, k = -v - 0v + 22. Solve -n = -4n - 2m + k, -12 = -4m for n. 4 Suppose -2v = 5c - 8c - 75, -3v = 5c - 103. Let r = 40 - v. Solve -3o = rl + 26, 2l + 0l + 3o + 16 = 0 for l. -5 Suppose -3q + 5t - 10t + 25 = 0, -4t = -4q + 12. Solve 5n + 30 = 5i - 0, -n + 24 = qi for i. 5 Let o be 6/4 + -1 + 86/(-172). Solve 3v = 9, o = 5s + 2v - 0v - 26 for s. 4 Let d(i) = -10i3 - 2i*2 - i. Let z be d(-1). Let b = 9 - z. Solve 4k - 2j - 10 = b, 2k - 3j = 2j + 9 for k.	{ "pile_set_name": "DM Mathematics" }
(sqrt(1452) - (sqrt(1452) + (sqrt(1452) - (-1sqrt(1452) + sqrt(1452) + sqrt(1452)) - sqrt(1452)))))/(sqrt(66)/sqrt(44) + sqrt(6))-6. -88sqrt(2) Simplify 4 + ((sqrt(324) - ((sqrt(324) + sqrt(324)3 - sqrt(324)) + sqrt(324)))/sqrt(9))/(sqrt(12) - 3sqrt(108)). 3sqrt(3)/8 + 4 Simplify 3(2(sqrt(80)2 + 3 + (sqrt(80) - (sqrt(80)-2 + -2) - sqrt(80))))*2. 1920sqrt(5) + 15660 Simplify sqrt(78)/(sqrt(30)/sqrt(5))-3 + (0 + sqrt(325))2. 7sqrt(13) Simplify (-2 + -5(0 + 2(sqrt(1700) + 0)))2 + 1. 400sqrt(17) + 170005 Simplify (-6(sqrt(171) + 0) + 4)2 + ((5 + 1 + sqrt(171))2)*2 + -1. 6999 Simplify ((sqrt(119) + sqrt(119)1 + sqrt(119) + sqrt(119))-5)/(sqrt(7) + sqrt(63)-2) + 4. 4 + 4sqrt(17) Simplify -1(sqrt(45)/(sqrt(99)/(sqrt(275) + sqrt(11))) - (2sqrt(320) + 2)). 2 + 10sqrt(5) Simplify 5 + (sqrt(100)/sqrt(5) + (sqrt(5) + (sqrt(5) - sqrt(10)/sqrt(2)) + sqrt(5))-1 + -1)2. 6 Simplify sqrt(36)/(sqrt(132)/sqrt(176)) - (3-4(sqrt(3)1 + sqrt(3)))*2. -1728 + 4sqrt(3) Simplify (1 + sqrt(320) + 2 + -4 + -2)*2. -48sqrt(5) + 329 Simplify 1 + sqrt(5) + sqrt(45) + 1(sqrt(180) - sqrt(5)) + -1 + 3. 3 + 9sqrt(5) Simplify (5 + 4(sqrt(7) + (sqrt(28) - sqrt(7))) - (sqrt(140)/(sqrt(20)/sqrt(4)))/sqrt(4))2. 70sqrt(7) + 368 Simplify -4 + (2(sqrt(2000) + 1) + sqrt(2000))2. 240sqrt(5) + 18000 Simplify (sqrt(336)/sqrt(72) + ((sqrt(42) - sqrt(168))6 - sqrt(42)))/(4sqrt(24)/sqrt(4) - (sqrt(6) + sqrt(36)/(sqrt(18)/sqrt(3)) + sqrt(6))). -20sqrt(7)/3 Simplify -1 + (sqrt(34) + sqrt(34) + (sqrt(408)-1 + sqrt(408))/sqrt(12))/(sqrt(242)-3). -1 - 2sqrt(17)/33 Simplify -4((1sqrt(117)1)2 - (2sqrt(130)-1)/sqrt(10)). -468 - 8sqrt(13) Simplify (((sqrt(240)-3)/sqrt(10))/(sqrt(768) + sqrt(768)3))*2. 9/512 Simplify -2 + -6((sqrt(245) - (sqrt(245) + sqrt(245) + sqrt(245) + 1sqrt(245))25) + 2)2. -84sqrt(5) + 235174 Simplify ((sqrt(121)4 + sqrt(121))3)/(1sqrt(539)). 15sqrt(11)/7 Simplify -5(sqrt(425) - -5sqrt(425)-3)-6. -2100sqrt(17) Simplify (((sqrt(70) + -2sqrt(70) + sqrt(70))3-2)/(-1sqrt(1000))5)*2. 0 Simplify ((3sqrt(36))/(sqrt(2) + sqrt(14)/sqrt(7)4))2. 162/25 Simplify -5(-1 + -1 + sqrt(637) + sqrt(637) + 1(-1sqrt(117))/sqrt(9)). -65sqrt(13) + 10 Simplify 4((sqrt(80) + -2 + sqrt(80))-6 - sqrt(80))24. -19968sqrt(5) + 218624 Simplify (((sqrt(2) - (3 + sqrt(2) + sqrt(2))) + 1 + -4 + -2sqrt(2))-6)2. 1296sqrt(2) + 1944 Simplify (3(5 + (2sqrt(176) - sqrt(176))5 + -5)3)*2. 356400 Simplify (-2 + sqrt(204)/(-3sqrt(12)))*2 + (sqrt(187)/((sqrt(66) - -4sqrt(66))/sqrt(6) - sqrt(11)))*2. 4sqrt(17)/3 + 1001/144 Simplify ((6sqrt(68)-1)/(1sqrt(16) - sqrt(4)))2 + 2 + 3 + sqrt(153) + -1. 3sqrt(17) + 616 Simplify -3 + (-3(-3sqrt(1377) + 0 + 1))*2 + -1. -486sqrt(17) + 111542 Simplify 1 + ((sqrt(684) - ((sqrt(684) + 0)*2 + 5)) + 3sqrt(684) + -4)6. -4157 + 144sqrt(19) Simplify (5(1sqrt(24) + sqrt(24)))/sqrt(12) - (-6(sqrt(10)/sqrt(5)-3 - sqrt(2)))*2. -1152 + 10sqrt(2) Simplify (sqrt(117) + (sqrt(117) - (sqrt(117)-2)2-2) - (-1 + sqrt(117))6) + sqrt(52)/sqrt(4)-2 + ((sqrt(52)2)/sqrt(4))2. -14sqrt(13) + 994 Simplify (2-2sqrt(7260))/(sqrt(96)/((2sqrt(64))/sqrt(8))). -88sqrt(5) Simplify -3 + (2sqrt(1512))/(2sqrt(96) + sqrt(96)). -3 + sqrt(7) Simplify 1 + (sqrt(1617) - 5(sqrt(1617) + sqrt(1617) + sqrt(1617)1) - sqrt(1617))/((-1-2sqrt(121))/sqrt(11)). -105sqrt(3)/2 + 1 Simplify ((((sqrt(72)-2)/sqrt(6))/sqrt(6) + (sqrt(16) - sqrt(16)1)/sqrt(8) + (sqrt(8)/sqrt(4)3 - sqrt(2)))63)*2. 0 Simplify (-1sqrt(81))/(sqrt(147) - (sqrt(147) - (sqrt(147) - sqrt(147)3 - sqrt(147))))-1. -sqrt(3)/7 Simplify (5sqrt(30)4)/(sqrt(490) - sqrt(490)-3). 5sqrt(3)/7 Simplify -6((sqrt(48) - (((sqrt(288)/sqrt(6))2 - sqrt(48)) + -5))1 + 5) + 4. -48sqrt(3) + 232 Simplify ((2sqrt(495))/sqrt(11) - (-1sqrt(405) + sqrt(45)))/((sqrt(45) + 4sqrt(1620) + sqrt(45))/sqrt(5)). 2sqrt(5)/13 Simplify (1 + -2 + 3(2 + sqrt(1331) + sqrt(1331)))*2. 660sqrt(11) + 47941 Simplify (-3 + 0 + 2-2(1 + sqrt(300))-5)2. 6800sqrt(3) + 120289 Simplify (-2-5sqrt(20))/(sqrt(90)/(-2sqrt(9))). -20sqrt(2) Simplify 4 + ((3(sqrt(1300) + 1) - (2 + 2 + sqrt(1300) + sqrt(1300)))3)*2. -180sqrt(13) + 11713 Simplify (2 + sqrt(34)/(sqrt(8)/sqrt(100)))*2 + -3. 20sqrt(17) + 426 Simplify (4 + 5(sqrt(176)15 + 3 + -2))2. 1800sqrt(11) + 110081 Simplify 3 + ((sqrt(3888) - (sqrt(3888) + (sqrt(3888) - sqrt(3888)-2) - sqrt(3888))) + sqrt(3888) + 5 + (2 + sqrt(48)-2)-4)2. 24sqrt(3) + 60 Simplify -4 + ((sqrt(252) - 5sqrt(252) - sqrt(252))/sqrt(9) + sqrt(28))/(sqrt(4) + sqrt(40)/(-5sqrt(10) - sqrt(10))). -24sqrt(7)/5 - 4 Simplify ((-1(sqrt(833)1 + -3) - (4 + 2(sqrt(833) - (sqrt(833) + sqrt(833)2) - sqrt(833))))-6)*2. -2520sqrt(17) + 749736 Simplify (sqrt(114)24-1)/(-63sqrt(54)). 4sqrt(19)/27 Simplify (3 + sqrt(153) + sqrt(153))*2-3 - ((2sqrt(136)/sqrt(8))2 + -3). -1928 - 108sqrt(17) Simplify (-2(sqrt(198)/sqrt(150) + sqrt(33) - sqrt(33)))/(sqrt(110)/(sqrt(1000)-1)). 4sqrt(3) Simplify (sqrt(27)/((sqrt(9) + sqrt(36)/sqrt(4))1 - sqrt(9)) - (-3 + sqrt(3) + -1 + sqrt(27)/(sqrt(9) + sqrt(9)2)))2. -8sqrt(3)/3 + 49/3 Simplify (-2 + (-1sqrt(2016) + sqrt(2016) - sqrt(2016))/(sqrt(8)-2-4 + sqrt(8)))2. 8sqrt(7)/3 + 64/9 Simplify 5(((-4 + 1 + sqrt(192))1)*2 + 5). -240sqrt(3) + 1030 Simplify (sqrt(1377) + -1 - sqrt(1377))*2 + 4 + (sqrt(272)-3 - (sqrt(68) + sqrt(17) + 1)*2) + 1. -148 - 18sqrt(17) Simplify (((sqrt(7) - sqrt(7)1)2 + sqrt(7) + -5 - (-3sqrt(7) + -4)) + 0)-1. -4sqrt(7) + 1 Simplify (((3sqrt(192))2 + sqrt(192))-5 + sqrt(192)32)-3. -24sqrt(3) + 25920 Simplify (((sqrt(190) - -21sqrt(190)) + sqrt(190))/sqrt(5))/(sqrt(6)/(sqrt(48)-4)). -64sqrt(19) Simplify ((-33sqrt(1872))*2 + 31sqrt(1872))-5 + 5. -758155 - 180sqrt(13) Simplify (6(-1 + sqrt(153)) + 4sqrt(153)3)6. -36 + 324sqrt(17) Simplify (21sqrt(144))/(-6(sqrt(108) + sqrt(108)2 - sqrt(108))). -sqrt(3)/9 Simplify (sqrt(76) + 3-3sqrt(76))/sqrt(144). -4sqrt(19)/3 Simplify (5(0 + sqrt(605) + 5))*2 - 2((sqrt(180)/(-1sqrt(9)))/sqrt(4))2. 2750sqrt(5) + 15740 Simplify ((sqrt(768)-4 - sqrt(12))/sqrt(6) - (5 + -3sqrt(162)))*2. 60sqrt(2) + 97 Simplify 3((sqrt(102)/sqrt(384))2 - sqrt(170)/sqrt(810)) + -4. -205/64 - sqrt(17)/3 Simplify (sqrt(20)2-4 + sqrt(20))/((sqrt(24) + sqrt(1944))/sqrt(6)). -7sqrt(5)/10 Simplify ((-4(1 + sqrt(19)) - sqrt(19) - sqrt(475)5) + 1)*2. 180sqrt(19) + 17109 Simplify 4 + ((sqrt(17) + -4sqrt(153)/sqrt(9) + sqrt(1088) + 0)6)*2 + -3. 15301 Simplify (6((sqrt(63) - (sqrt(63) - sqrt(63)2))-5)/(sqrt(81) + sqrt(81)2)4)*2. 44800/9 Simplify -4-2(-2sqrt(1053) + -4 + 4)4. -576sqrt(13) Simplify (6sqrt(1053)-321)*2. 1364688 Simplify ((-3 + (5 + sqrt(405) - sqrt(45)))-1)*2. 24sqrt(5) + 184 Simplify (4(sqrt(30) - (sqrt(30) - (sqrt(30) - (sqrt(30) - sqrt(210)/(1sqrt(7))))) - sqrt(30)))/((2sqrt(80))/sqrt(8) - -3(sqrt(10) - sqrt(40))). 0 Simplify -2(-6(-3sqrt(66) + sqrt(66)))/(sqrt(384)-3). sqrt(11) Simplify (sqrt(135)/(sqrt(50)/(-3sqrt(10))))/((sqrt(99) - (sqrt(99) - ((sqrt(99) - (sqrt(99)3 + sqrt(99)))-5 + sqrt(99))))/sqrt(11)). -3sqrt(3)/16 Simplify -4 + ((sqrt(52)-5)2 + sqrt(52)5 - (2sqrt(117) + -3)2). 46sqrt(13) + 819 Simplify (1(-6sqrt(108)/sqrt(12))/(4(sqrt(96) + (sqrt(96)-1 - sqrt(96)))/sqrt(8)))2. 27/16 Simplify (-3 + sqrt(17) + 0 - sqrt(17))2 + (sqrt(2448) + 3sqrt(2448) + sqrt(2448))2 + 3 + sqrt(612)2 + 0. 12sqrt(17) + 61212 Simplify ((sqrt(216) + sqrt(216)-2)/sqrt(9)4)/(6(sqrt(128) - sqrt(128)-1))1. -sqrt(3)/12 Simplify (5(3sqrt(242) + -4 + 5 + -4))*2 + -2. -4950sqrt(2) + 54673 Simplify (1sqrt(931)-1 + (sqrt(931) - (3(sqrt(931) + -6sqrt(931)) - sqrt(931))))*2. 238336 Simplify (sqrt(77) - (6(sqrt(77) + sqrt(77) + sqrt(77)-4 + sqrt(77) + sqrt(77)) + sqrt(77) - sqrt(77) - sqrt(77)))/(-2sqrt(891)). -sqrt(7)/9 Simplify (-4sqrt(1260)-4)/((sqrt(343) - (sqrt(343)4 - sqrt(343)))-4). 12sqrt(5)/7 Simplify (1 + sqrt(704))2 + (1sqrt(1331))*2 + (3 + (-1 + sqrt(11) - sqrt(11)) + sqrt(11) - (sqrt(44) + -1)). 15sqrt(11) + 2039 Simplify 1((sqrt(1053) - -5(-2 + sqrt(1053))) + sqrt(105	{ "pile_set_name": "DM Mathematics" }
the prime factors of x. 2, 19 What are the prime factors of (461/2 - (-39)/(-26)) + 1? 2, 5, 23 Suppose -11z + 9z + 442 = 0. List the prime factors of z. 13, 17 Suppose 798 = 5k - 57. Suppose 0 = 4u - w - 705, -3u - 3w = -696 + k. Suppose -7n = -3n - u. List the prime factors of n. 2, 11 Let d = -5 - -11. Let i = 15 - d. Suppose -4v = -iv + 15. List the prime factors of v. 3 Suppose 0 = 8m - 2430 - 578. List the prime factors of m. 2, 47 Suppose 0 = w - 2w + 3. Suppose -5s + 275 = wy, -3y - 3s + 195 + 78 = 0. Let d = y + -46. List the prime factors of d. 2, 11 List the prime factors of 76/(1 + 3 + -2). 2, 19 List the prime factors of 3/((-15)/4) + 3063936/2370. 2, 17, 19 Let c(h) = -102h3 - 7h*2 - 6h. List the prime factors of c(-2). 2, 5 Suppose 2z - 3z - 16 = -5q, 4q = 4z. Suppose zf - 151 = 25. Suppose -5t = -f - 11. What are the prime factors of t? 11 Let u(t) = 2t + 6. Let h(p) = -p*3 - 18p*2 - 18p - 20. Let g be h(-17). Let b be u(g). Suppose -3q + 48 + 42 = b. What are the prime factors of q? 2, 3, 5 Suppose 280c - 5568 = 268c. List the prime factors of c. 2, 29 Let y = 731 - 453. List the prime factors of y. 2, 139 Suppose -l - 2l + 28 = 5f, -4f + 15 = -5l. Suppose -fu - n = -160, 0 = -u + 4u - 2n - 83. What are the prime factors of u? 31 Suppose 7a = 9a - 78. List the prime factors of (78/(-3))/((-2)/a3). 13 Let k(w) = -3w - 15. Let m be k(-16). Suppose m = a + v, a + 4v - 26 = 19. Let p = a + 2. What are the prime factors of p? 31 Suppose 63h - 601 = 62h. What are the prime factors of h? 601 Let a(o) = 180o - 29. List the prime factors of a(18). 13, 19 Let s be (-8)/4815/(-2)4. Suppose 280 = sy - 60. List the prime factors of y. 2, 17 Let r = -1 + -5. Let n(t) = t3 + 5t*2 - 7t - 1. Let z be n(r). Suppose 4s + 23 = -3a + 88, -a - z = -4s. List the prime factors of a. 3, 5 Suppose -26l + 21800 = -l. List the prime factors of l. 2, 109 Let n(t) = t*3 + 8t*2 - 8t - 2. Suppose -3k + 8k + 20 = 0. List the prime factors of n(k). 2, 47 Let a(m) = -2m - 28. Let w be a(-16). Let g be 1-22/(-1). Suppose 0b + 4b + 2s = 38, gs = -w. What are the prime factors of b? 2, 5 Suppose s + 4s = 0. Suppose -2h - 3h = s. Suppose hf - f = -2. What are the prime factors of f? 2 Let l = -12 + 46. Suppose 0 = 3p + 4t - 9t - l, -2t = p + 7. Suppose 5j - 88 = 2w, -5j + 0j + 68 = pw. What are the prime factors of j? 2 Let q(p) = -99p3 - p2 + p - 4. Let k(h) = -199h*3 - 2h*2 + h - 7. Let a(j) = 3k(j) - 5q(j). What are the prime factors of a(-1)? 2, 3, 17 Let f = 1373 + -525. List the prime factors of f. 2, 53 Let j(n) = -n3 + n2 + n + 12. Let k be j(0). Suppose 4f - k = -2f. Suppose fd + 100 = 7d. List the prime factors of d. 2, 5 Let r(t) = -t - 1. Let u be r(3). List the prime factors of (12/5)/(u + 22/5). 2, 3 Let k be 8(1 - 3/(-4)). Let b = -6 + k. What are the prime factors of b? 2 Let c(g) = 4g - 18g - 61g + 1 + 29g. List the prime factors of c(-1). 47 Suppose 17 = -2s + z, -s - z = -4z + 11. Let o = 12 + s. Suppose -b + 0b = -op + 76, b = -p + 19. List the prime factors of p. 19 Suppose -a - 3a = -8. Suppose 0l = -3t - 5l + 253, -99 = -t + al. List the prime factors of t. 7, 13 Let g be 10/(-30) - (-1)/3. Suppose g = -c + 5t + 77, 2c - t = -2t + 176. List the prime factors of c. 3, 29 Let h be (-6)/12 - (-2 - (-519)/6). Let i = h - -143. What are the prime factors of i? 2, 29 Suppose -2u + 5 = -3. Suppose 3j + 5x = 5j - 146, -uj - 2x + 340 = 0. What are the prime factors of j? 83 Let q(i) = 21i3 + 13i*2 - 23. What are the prime factors of q(5)? 2927 Let m(n) = -9n*3 + 1. Let b = 10 + -9. Let g be m(b). What are the prime factors of (-18)/g(-32)/(-3)? 2, 3 Let s(p) = -p*3 - 10p*2 - 8p + 14. Let z be s(-9). Suppose 2i - 1070 = -zh, 2h - i - 63 - 365 = 0. What are the prime factors of h? 2, 107 Let n(o) = o2 - 11o. Let k(b) = 4b2 - 3b + 2. Let s be k(2). List the prime factors of n(s). 2, 3 Let c(x) = x3 + x2 - x - 1. Let n(q) = 7q3 + 12q*2 - 9. Let m(b) = 5c(b) - n(b). What are the prime factors of m(-4)? 2, 5 Let i = 120 + -116. Suppose 0 = -h + 7 + 20. Suppose -if = -h - 61. List the prime factors of f. 2, 11 Let k(w) = 4w + 1. Let j be k(4). Let i = j - 12. Suppose m = i - 3, -h - 5m + 32 = 0. List the prime factors of h. 2, 11 Let y(p) = -p2 + 8p + 13. Let q be y(10). Let g be 6/2 + q + -4. List the prime factors of 21 + g/(2 + 0). 17 Let l be 33/(-99)(-111)/(-2)-2. Let a(c) = -c*2 - 3c - 2. Let q be a(-6). Let p = q + l. List the prime factors of p. 17 Let d(u) = 64u2. Suppose 0 = j - q - 3, 0j + 2q + 7 = j. List the prime factors of d(j). 2 Let z be -4 - -8 - (4 + -3). Suppose -zc + 60 = 15. What are the prime factors of c/(-5)16/(-3)? 2 Suppose -3d - 5r = -23, -5 = r - 3. List the prime factors of d. 11 Suppose v = -4v - 3c, -v - 2c - 7 = 0. List the prime factors of 514/6 - (2 + (-4)/v). 5, 17 List the prime factors of (5 + 85/(-10))-66. 3, 7, 11 Let h = 18 - 13. Let i(m) = m3 + 14m*2 + 15m - 36. Let u be i(-12). Suppose j = hf + u, -5j + 261 + 27 = -f. What are the prime factors of j? 3, 19 Let k(u) be the third derivative of 3u4/4 - 43u*3/6 - 40u*2. What are the prime factors of k(16)? 5, 7 Suppose 0d = 3x - 5d - 32, 0 = d + 4. Suppose -xp - 16 = -0p. Let n(j) = j + 6. List the prime factors of n(p). 2 What are the prime factors of 8/1260/(-8) - -1644? 11, 149 Suppose 0 = -91q + 70q + 44709. What are the prime factors of q? 2129 Let x be 5/(-15) + 5/(-3). Let f be -2 - (x - (-4 + 3)). What are the prime factors of (8/16)/(f/(-34))? 17 Let j = 16 - 14. Let r(z) = -j + 4z - 15z + 1 - 3. List the prime factors of r(-3). 29 Let c(p) = p3 - 9p*2 + 15p - 1. Let v be c(7). Let f be (3/v)/(1/564). Suppose -5u + d - 4d + 302 = 0, 0 = -5u + 2d + f. List the prime factors of u. 2, 29 Suppose 3b = -2l - 3l + 308, -5l - 25 = 0. Suppose -f = 5u - b, 44 = 3u - 5f - 45. Suppose 0 = -4g + 95 - u. List the prime factors of g. 2, 3 Let b(i) = i*3 - 26i*2 + 25i + 5. Let d be b(25). Suppose -3n = 5x - 231, -dn + 2x = 4x - 385. List the prime factors of n. 7, 11 What are the prime factors of (3/2 - 0)/(1194/1522748)? 1913 Suppose 5o - 160 = -0o. Let x = 23 - o. Let r = -3 - x. What are the prime factors of r? 2, 3 Let x = 13136 - 8773. What are the prime factors of x? 4363 Suppose 551 = c + 547. Suppose -3f + 585 + 41 = -5s, -415 = -2f + s. Suppose b + f = cb. What are the prime factors of b? 3, 23 Suppose 89 = -13t - 899. Let v = t - -107. List the prime factors of v. 31 Let y(v) = 156v2 - 2v + 1. What are the prime factors of y(2)? 3, 23 Let p(y) = 21y + 1. Suppose 6 = 4f - 6f. Let k(d) = d + 4. Let l be k(f). What are the prime factors of p(l)? 2, 11 Let u be 1 - 1 - (6 + -6). Suppose -5c + 55 = -uc. List the prime factors of (8/(-4) - -1) + c. 2, 5 Let w(m) = 2m3 + m2 - 2m + 2. Let x be w(1). List the prime factors of 321/x(-2)/(-2). 107 Suppose -6019 = -29q + 8104. List the prime factors of q. 487 What are the prime factors of 4847 - (-12)/(-3)1? 29, 167 Let a = 61 - 28. Suppose 30s + 231 = as. List the prime factors of s. 7, 11 Let t(v) = -2v3 - 17v*2 - 56v - 54. List the prime factors of t(-10). 2, 13, 31 Suppose 3j + 1787 = 3z + 5j, 0 = 5z + 2j - 2981. What are the prime factors of z? 3, 199 Suppose 3l = -2l. Suppose l = -m + 33 + 41. Suppose 3j - 26 = -s, 3s + 5j = 5s - m. What are the prime factors of s? 2 Suppose -5z - 3y + 1636 + 2457 = 0, 0 = 4z + 5y - 3264. List the prime factors of z. 821 Let d be (1164/8)/(7/(-14)). Let m = d - -587. What are the prime factors of m? 2, 37 Let b = -11 + 262. Suppose -3o + b = 68. List the prime factors of o. 61 Suppose 3c + 75 = -2c. Let s = 28 - 25. What are the prime factors of (c1)/s-1? 5 Let h = 276 + -42. Suppose -4o = -0o + 628. Let k = h + o. What are the prime factors of k? 7, 11 Let r(f) = f - 3. Let j be r(19). Let q = 23 - j. List the prime factors of q. 7 What are the prime factors of -138((-35)/(-14) + -7)? 3, 23 Let i(t) = t2 - 7t + 5. Let y be i(6). Let c(f) = -f + 0 - 3 + 2 + 32f*2. List the prime factors of c	{ "pile_set_name": "DM Mathematics" }
me factors of 11286? 2, 3, 11, 19 What are the prime factors of 44739? 3, 1657 What are the prime factors of 16886? 2, 8443 What are the prime factors of 555? 3, 5, 37 What are the prime factors of 23268? 2, 3, 7, 277 List the prime factors of 43926. 2, 3, 7321 What are the prime factors of 1976? 2, 13, 19 List the prime factors of 2010. 2, 3, 5, 67 What are the prime factors of 3743? 19, 197 What are the prime factors of 13625? 5, 109 List the prime factors of 2917. 2917 List the prime factors of 6082. 2, 3041 What are the prime factors of 3040? 2, 5, 19 What are the prime factors of 25555? 5, 19, 269 List the prime factors of 55556. 2, 17, 19, 43 What are the prime factors of 1884? 2, 3, 157 What are the prime factors of 48346? 2, 23, 1051 What are the prime factors of 45? 3, 5 What are the prime factors of 90906? 2, 3, 109, 139 What are the prime factors of 22614? 2, 3, 3769 What are the prime factors of 3792? 2, 3, 79 What are the prime factors of 5470? 2, 5, 547 List the prime factors of 91058. 2, 11, 4139 What are the prime factors of 541? 541 List the prime factors of 2520. 2, 3, 5, 7 What are the prime factors of 1452? 2, 3, 11 What are the prime factors of 12625? 5, 101 What are the prime factors of 3446? 2, 1723 What are the prime factors of 17191? 17191 List the prime factors of 13785. 3, 5, 919 What are the prime factors of 1408? 2, 11 What are the prime factors of 11333? 7, 1619 What are the prime factors of 42233? 157, 269 List the prime factors of 18773. 18773 What are the prime factors of 4997? 19, 263 What are the prime factors of 6671? 7, 953 List the prime factors of 1832. 2, 229 What are the prime factors of 4695? 3, 5, 313 List the prime factors of 5668. 2, 13, 109 List the prime factors of 39799. 39799 What are the prime factors of 12126? 2, 3, 43, 47 What are the prime factors of 3095? 5, 619 List the prime factors of 870. 2, 3, 5, 29 List the prime factors of 110887. 7, 31, 73 List the prime factors of 336. 2, 3, 7 What are the prime factors of 493? 17, 29 What are the prime factors of 51642? 2, 3, 19, 151 List the prime factors of 727. 727 What are the prime factors of 55? 5, 11 What are the prime factors of 17875? 5, 11, 13 What are the prime factors of 2096? 2, 131 What are the prime factors of 1700? 2, 5, 17 List the prime factors of 100. 2, 5 What are the prime factors of 19503? 3, 11, 197 List the prime factors of 6753. 3, 2251 List the prime factors of 2452. 2, 613 What are the prime factors of 8163? 3, 907 What are the prime factors of 269? 269 What are the prime factors of 32891? 31, 1061 List the prime factors of 65947. 7, 9421 What are the prime factors of 2860? 2, 5, 11, 13 What are the prime factors of 13412? 2, 7, 479 List the prime factors of 800. 2, 5 List the prime factors of 11689. 11689 What are the prime factors of 11029? 41, 269 What are the prime factors of 125? 5 List the prime factors of 3925. 5, 157 List the prime factors of 126. 2, 3, 7 What are the prime factors of 3086? 2, 1543 What are the prime factors of 774? 2, 3, 43 List the prime factors of 1935. 3, 5, 43 What are the prime factors of 2053? 2053 What are the prime factors of 46692? 2, 3, 1297 List the prime factors of 8430. 2, 3, 5, 281 What are the prime factors of 2236? 2, 13, 43 What are the prime factors of 1338? 2, 3, 223 List the prime factors of 39484. 2, 9871 What are the prime factors of 20804? 2, 7, 743 List the prime factors of 35211. 3, 11, 97 What are the prime factors of 19464? 2, 3, 811 List the prime factors of 1159. 19, 61 List the prime factors of 1945. 5, 389 List the prime factors of 5886. 2, 3, 109 List the prime factors of 314. 2, 157 What are the prime factors of 63394? 2, 29, 1093 List the prime factors of 1893. 3, 631 List the prime factors of 275. 5, 11 List the prime factors of 17549. 7, 23, 109 What are the prime factors of 11272? 2, 1409 List the prime factors of 112275. 3, 5, 499 List the prime factors of 3735. 3, 5, 83 What are the prime factors of 4178? 2, 2089 What are the prime factors of 18119? 18119 List the prime factors of 77501. 19, 4079 List the prime factors of 3219. 3, 29, 37 What are the prime factors of 4336? 2, 271 List the prime factors of 64753. 13, 17, 293 What are the prime factors of 3286? 2, 31, 53 List the prime factors of 128814. 2, 3, 7, 3067 What are the prime factors of 7515? 3, 5, 167 What are the prime factors of 828? 2, 3, 23 List the prime factors of 11539. 11, 1049 List the prime factors of 15880. 2, 5, 397 List the prime factors of 987. 3, 7, 47 What are the prime factors of 9924? 2, 3, 827 What are the prime factors of 102536? 2, 7, 1831 List the prime factors of 1146. 2, 3, 191 What are the prime factors of 102620? 2, 5, 7, 733 List the prime factors of 4948. 2, 1237 What are the prime factors of 286? 2, 11, 13 What are the prime factors of 1357? 23, 59 What are the prime factors of 7042? 2, 7, 503 List the prime factors of 10254. 2, 3, 1709 List the prime factors of 1041. 3, 347 What are the prime factors of 46291? 7, 17, 389 What are the prime factors of 2009? 7, 41 What are the prime factors of 96443? 96443 What are the prime factors of 5134? 2, 17, 151 What are the prime factors of 6723? 3, 83 List the prime factors of 65376. 2, 3, 227 What are the prime factors of 10237? 29, 353 What are the prime factors of 403? 13, 31 What are the prime factors of 752? 2, 47 List the prime factors of 3116. 2, 19, 41 What are the prime factors of 6943? 53, 131 What are the prime factors of 30184? 2, 7, 11 List the prime factors of 3719. 3719 What are the prime factors of 48586? 2, 17, 1429 List the prime factors of 167593. 167593 List the prime factors of 4732. 2, 7, 13 List the prime factors of 5407. 5407 What are the prime factors of 6094? 2, 11, 277 What are the prime factors of 5894? 2, 7, 421 List the prime factors of 3281. 17, 193 What are the prime factors of 29464? 2, 29, 127 What are the prime factors of 7949? 7949 What are the prime factors of 9518? 2, 4759 List the prime factors of 36745. 5, 7349 List the prime factors of 56291. 181, 311 What are the prime factors of 44743? 101, 443 List the prime factors of 5869. 5869 List the prime factors of 20442. 2, 3, 3407 What are the prime factors of 98613? 3, 10957 What are the prime factors of 18803? 18803 List the prime factors of 918. 2, 3, 17 What are the prime factors of 713? 23, 31 What are the prime factors of 31299? 3, 10433 What are the prime factors of 104190? 2, 3, 5, 23, 151 List the prime factors of 38136. 2, 3, 7, 227 List the prime factors of 51155. 5, 13, 787 What are the prime factors of 44? 2, 11 What are the prime factors of 769? 769 What are the prime factors of 15944? 2, 1993 List the prime factors of 465. 3, 5, 31 What are the prime factors of 11117? 11117 List the prime factors of 2674. 2, 7, 191 What are the prime factors of 13256? 2, 1657 What are the prime factors of 11452? 2, 7, 409 What are the prime factors of 29605? 5, 31, 191 What are the prime factors of 3693? 3, 1231 List the prime factors of 7942. 2, 11, 19 List the prime factors of 432. 2, 3 List the prime factors of 61275. 3, 5, 19, 43 What are the prime factors of 1188? 2, 3, 11 List the prime factors of 2376. 2, 3, 11 What are the prime factors of 11019? 3, 3673 What are the prime factors of 92? 2, 23 What are the prime factors of 4306? 2, 2153 List the prime factors of 10444. 2, 7, 373 What are the prime factors of 17683? 17683 List the prime factors of 651. 3, 7, 31 What are the prime factors of 10283? 7, 13, 113 List the prime factors of 87125. 5, 17, 41 List the prime factors of 12958. 2, 11, 19, 31 What are the prime factors of 1016? 2, 127 List the prime factors of 3206. 2, 7, 229 What are the prime factors of 17070? 2, 3, 5, 569 What are the prime factors of 655? 5, 131 List the prime factors of 2213. 2213 What are the prime factors of 15907? 15907 List the prime factors of 673. 673 What are the prime factors of 7115? 5, 1423 What are the prime factors of 4281? 3, 1427 What are the prime factors of 4076? 2, 1019 What are the prime factors of 101267? 101267 List the prime factors of 1183. 7, 13 What are the prime factors of 129? 3, 43 List the prime factors of 3098. 2, 1549 What are the prime factors of 4895? 5, 11, 89 List the prime	{ "pile_set_name": "DM Mathematics" }
)) + 2. Let i(d) = p + 7d + 7d - 4d + 4d. Determine kt(c) - 5i(c). 2c - 2 Let j(v) = -7v*2 + 18v + 133. Let u(o) = -6o2 + 15o + 133. Give -4j(b) + 5u(b). -2b2 + 3b + 133 Let g(t) = t - 5. Let m(p) = -128 - 5p + p + 148. Calculate -9g(s) - 2m(s). -s + 5 Let y(n) = -3n*3 - 46n*2 - 5. Let k(o) = -2o*3 - 45o*2 - 4. Calculate 5k(l) - 4y(l). 2l*3 - 41l*2 Let p(n) = -14n - 5. Let i(j) = 2j + 1. Let d(l) = 2i(l) - p(l). Let x(a) = 6a + 2. Calculate 2d(c) - 7x(c). -6c Let c(f) = 25f3 - 2f*2 - 5f - 3. Let v(d) = 23d3 - 3d*2 - 5d - 4. Calculate 3c(u) - 2v(u). 29u3 - 5u - 1 Let v(w) = -w. Suppose -2c + 5c = 3n + 24, 25 = -5n. Let o(l) be the third derivative of 0l + 0l*3 - 13l*2 + 1/4l*4 + 0. Determine cv(r) + o(r). 3r Let r(z) = 2z*2 - 4z. Let p = 2 - 6. Let w be 1/((-4)/(0 + -4)). Let m = w - p. Let j(a) = 3a2 - 5a. Determine mr(t) - 4j(t). -2t2 Let v(w) = -w2 + 1. Let g(z) = 2z*3 - 6z*2 + 7. Let j be 1 + -1 + (3 - 4/2). Calculate jg(o) - 5v(o). 2o3 - o2 + 2 Let y(z) = -12z3 - 21z - 21. Let q(x) = -71x3 - 69x*3 - 5x + 0 - 5 - 67x3 + 204x*3. Calculate -21q(v) + 5y(v). 3v*3 Let t(a) = -22a*2 - 12a - 12. Let i(n) = -9n2 - 5n - 5. Let v be (8/(-3))/(2/(-9)). Suppose -25s + 37 = 162. What is st(b) + vi(b)? 2b*2 Let m(c) = -c. Let d(h) = -15h. Suppose -15 = -82u + 79u. Suppose 0 = -2k - 10, -uf + 111 = -k + 6. Calculate fm(q) - d(q). -5q Let i(m) = 5m2 - 10m + 27. Let z(k) = 3k2 - 6k + 13. Give 4i(j) - 7z(j). -j*2 + 2j + 17 Let g(d) = 1 + d + 2 - 2. Let y(t) = -12t - 2. Let s(z) = -1 - 29z - 1 + 33z + 3. Let i(a) = -14s(a) - 4y(a). What is -6g(v) - i(v)? 2v Let o(q) = 6 - 6q - 13 + 5q2 + 11. Let w(z) = z2 - z + 1. What is o(n) - 4w(n)? n*2 - 2n Let o(f) = f. Let m(x) = 7x - 4. Let s(p) = -m(p) + 6o(p). Let u(h) = -3h + 0h - 7h + 3h + h + 27. Determine -27s(v) + 4u(v). 3v Suppose -4g - g + 25 = -5d, 4g - 11 = -5d. Let h(b) be the first derivative of -57b*2/2 + 138. Let n(f) = 7f. Calculate gh(p) + 33n(p). 3p Let v(g) = 5g - 8. Let s(m) = 4m - 7. Determine -6s(n) + 5v(n). n + 2 Let z(q) = q - 1. Let g(w) = -w2 - w + 7. Calculate g(h) + z(h). -h2 + 6 Let u(f) = f2 - f - 1. Let d(i) = i2 + 3i - 19. Suppose 0 = 5p - 7p - 12. Let m be d(p). Let a(y) = 3y3 + 6y*2 - 4y - 5. What is ma(g) + 4u(g)? -3g3 - 2g*2 + 1 Let x(w) = 2w + 52 + 42 + w2 - 92. Let n(s) = -s2. What is -3n(g) + x(g)? 4g*2 + 2g + 2 Let t(u) = -2u3 + 100u*2 - 10. Let q(m) = 2. Calculate 5q(i) + t(i). -2i3 + 100i*2 Let r = -2606 + 2604. Let s(k) = 5k*2 - 4k + 2. Let g be -1(-2 + 2/2). Let v(i) = g - 3i + 3i2 + 0 + i2. What is rs(x) + 3v(x)? 2x2 - x - 1 Let v(k) be the first derivative of -k4/4 - 7k2/2 - 7k + 139. Let y(p) = -p*3 - 4p - 4. Determine 4v(w) - 7y(w). 3w3 Let z(l) = l2 + 1 + l2 + 5l3 + l2. Let n = 4337 + -4336. Let h(c) = c3 + c2 + 1. What is nz(t) - 3h(t)? 2t3 - 2 Let b(h) = 56h*2 + 42h. Suppose 4y + 3p - 156 = 8y, 0 = 4y + 2p + 176. Let u(s) = s2 + s. Determine yu(x) + b(x). 14x2 Let a(m) = -2m - 3. Let g(h) = h - 4. Let o(c) = c - 2. Let v(s) = 3g(s) - 4o(s). Determine 2a(k) - 3v(k). -k + 6 Let k = -3 - -8. Let d(c) = -c*3 + 2c - 7. Let q(w) = -w*3 + 2w - 8. What is kq(y) - 6d(y)? y*3 - 2y + 2 Let k(p) = 6p. Let q = -322 - -319. Let x(i) = -6i. Determine qk(o) - 4x(o). 6o Let q(c) = c2 + 10c + 6. Let s(p) = -p*2 - 11p - 7. Suppose -20i + 54 = -86. Determine iq(k) + 6s(k). k2 + 4k Let l(s) = -s + 1. Let n(c) = -5c + 6. Let m(k) = 3 - 22 - 10 + 5k. Let q be m(6). Determine qn(b) - 4l(b). -b + 2 Let w(h) = 3h3 + 4h*2 + 8h + 99. Let q(u) = -2u3 - 3u*2 - 5u - 65. Give -8q(v) - 5w(v). v*3 + 4v*2 + 25 Let v(f) = -5f*2 - 6f + 4. Suppose 4c = 4, -c + 5c + 20 = 4o. Let m(a) = -a2 - a + 1. Determine om(w) - v(w). -w*2 + 2 Let p(z) = 5z*3 + 5z*2 + 8z - 6. Let a(s) = 1 + 2s3 - 13s2 - s2 + 16 - 16s3 - 23s. Calculate 6a(b) + 17p(b). b3 + b2 - 2b Let h(n) = -7n + 6n + 7 - 2n + 0. Let o(w) = -5w + 12. Let x(u) = 11h(u) - 6o(u). Let l(j) = 4j - 7. Calculate 5l(z) + 7x(z). -z Let f(n) = -4n2 + n + 16. Let w(j) = -14j - 105. Let m be w(-7). Let s(u) = -3u2 + u + 11. What is ms(z) + 5f(z)? z2 - 2z + 3 Let c(v) = 2v + 2. Let d(f) = f + 3. Let k(w) = -3c(w) + 4d(w). Let y(m) = m2 - 4m - 8. Let l be y(6). Let p(u) = -3u + 7. Calculate lp(s) - 5k(s). -2s - 2 Let z(m) = -2m - 2. Let n(t) = 2t + 3. Calculate 4n(a) + 6z(a). -4a Let l(j) = -j3 - 2j*2 - 3j. Let r(u) = -3u3 - 7u*2 - 10u. Let v = -312 + 310. Give vr(s) + 7l(s). -s3 - s Let t(q) = q2. Let h = 3 - 5. Let d = h - -7. Suppose -dc + 3 = 2u - 17, 4c - 33 = -5u. Let w(k) = k*3 + 4k*2 - 1. Give ut(f) - w(f). -f3 + f2 + 1 Let q(y) = -3y2 - 4 - 3y + 10y3 + 4y*2 - 4y*3 - 3y*3 - 9y3. Let a(x) = 1 - 2 + 2 + x + x3. Suppose -w - 5 = -1. Calculate wa(o) - q(o). 2o3 - o2 - o Let l(o) = -4o3 + 6o*2 - 6o. Let a = 0 - 1. Suppose 8w + 10 - 42 = 0. Let g(n) = -5n3 + n2 + 5n3 - n3 + 3n - wn. What is al(z) + 6g(z)? -2z*3 Let q(d) = -3d*3 - 6d*2 + 2d + 14. Let f(r) = -9r3 - 17r*2 + 6r + 40. What is -6f(v) + 17q(v)? 3v3 - 2v - 2 Let x(c) = -6c2 - 7c + 11. Let p(j) = -3j2 - 3j + 5. Suppose -12g = -77g - 195. Suppose 0 = -o - o + 14. Determine gx(k) + op(k). -3k2 + 2 Let x(p) = -p3 - p2 - p + 7. Let v be x(2). Let j(z) = 10 - 4 + 9z + 8 - 3. Let m(u) = -5u - 6. Give vm(c) - 4j(c). -c - 2 Let s(d) = -7d*3 + 6d*2 + 2d + 6. Let r(v) = -932 - 932 + 1851 - 4v - 13v*2 + 15v*3. Determine -6r(c) - 13s(c). c3 - 2c Let k(l) = 6l3 - 6l*2 - 3l. Suppose 0 = 2a - 0a - 4i - 6, -3i = -4a - 13. Let t(c) = -11c*3 + 11c*2 + 5c. What is ak(z) - 4t(z)? 2z3 - 2z*2 + z Let r(z) = z. Let t(p) = 2p + 1. Let o be 3/453 + (-439)/(-5). Let f = o + -85. Give ft(v) - 7r(v). -v + 3 Let s(c) = -c3 + c2 + 1. Let h(r) = 7r*2 - 5. Let z(v) = 2v3 + v2 - 1. Let d(n) = -h(n) + 6z(n). Calculate d(q) + s(q). 11q*3 Let h(p) = p. Let g(y) = 4y + 18. Calculate 2g(o) - 6h(o). 2o + 36 Let t(m) = -2m + 3. Let b(d) = 5d - 7. Let s = 784 - 788. What is sb(q) - 9t(q)? -2q + 1 Let z(u) = -8u + 4. Let c(h) = 3h - 1. Suppose 48v + 2a + 12 = 44v, 2a = 3v + 2. What is vz(r) - 7c(r)? -5r - 1 Let w = 925 + -922. Let j(a) = 10a2 - 2. Let v(k) = 11k*2 - 3. Calculate wj(x) - 2v(x). 8x*2 Let h(d) = 7d*3 - 4d*2 - 6d + 4. Let t(l) = -13l3 + 7l*2 + 12l - 7. What is -7h(s) - 4t(s)? 3s3 - 6s Let a(q) = 3q3 + 4q*2 + 3q - 4. Let r(g) = 2g3 + 3g*2 + 3g - 3. Calculate -4a(j) + 5r(j). -2j3 - j2 + 3j + 1 Let f(i) = -2i - 3. Let g(d) = d + 1. Suppose -3a - 17 = p, -2a = -0p + 4p + 38. Determine pg(z) - 3f(z). -2z + 1 Let d = -723 + 728. Let g(u) = 2u2 + 12u - 11. Let x(r) = -r*2 - 8r + 7. Determine dg(f) + 8x(f). 2f2 - 4f + 1 Let a(m) = -378m - 1. Let c(i) = 758i + 2. Determine 7a(d) + 3c(d). -372d - 1 Let w(a) = 16a*2 - 23a - 50. Let z(r) = -5r2 + 8r + 17. Determine -2w(t) - 7z(t). 3t2 - 10t - 19 Let p(i) = -62i - 22. Let l(v) = -31v - 11. Let b(t) = 5l(t) - 2p(t). Let k(d) = -6d - 2. Determine -2b(z) + 11k(z). -4z Suppose -2g + 33 = 5o, 36 = 2o + 3o - g. Let h(u) = 3u3 - 3u*2 - 7u + 13. Let x(b) = 2b3 - 2b*2 - 5b + 9. What is ox(i) - 5h(i)? -i3 + i2 - 2 Let s(n) = -n + 1. Let g(a) = -a + 1. Let y be (18/(-36))/(1/(-8)). Suppose yx = -20, 2 = 2v + 2x + 4. Calculate vg(h) - 3s(h). -h + 1 Let t = 16048 - 16046. Let u(k) = 30k - 21. Let c(x) = -3x + 2. Suppose d = 3d - 42. What is dc(n) + tu(n)? -3n Let f(h) = 3h + 4. Let x(n) = 4n - 2. Give -f(b) + x(b). b - 6 Let g(t) = -125t - 8. Let m(r) = r + 2. Determine -g(u) - 5m(u). 120u - 2 Let o(v) = 61v + 17. Let u(l) = 129l + 34. What is 13o(z) - 6u(z)? 19z + 17 Let t(i) = 1. Let f(g) = 8 + 29g - 10g - 14g. Calculate -f(x) + 6t(x). -5x - 2 Let l(n) = -n*2 - 2n - 1. Let	{ "pile_set_name": "DM Mathematics" }
4:16 PM? 6:13 PM What is 710 minutes before 6:18 PM? 6:28 AM How many minutes are there between 3:25 PM and 6:31 PM? 186 How many minutes are there between 4:06 AM and 11:32 AM? 446 How many minutes are there between 8:42 AM and 10:59 AM? 137 How many minutes are there between 8:58 PM and 6:44 AM? 586 How many minutes are there between 6:19 AM and 2:11 PM? 472 What is 670 minutes after 7:03 AM? 6:13 PM How many minutes are there between 2:30 PM and 1:52 AM? 682 How many minutes are there between 6:03 PM and 5:24 AM? 681 What is 394 minutes after 5:38 AM? 12:12 PM What is 636 minutes after 8:53 AM? 7:29 PM How many minutes are there between 11:46 PM and 4:25 AM? 279 How many minutes are there between 12:35 AM and 10:30 AM? 595 How many minutes are there between 9:07 PM and 8:08 AM? 661 What is 496 minutes after 11:40 AM? 7:56 PM How many minutes are there between 1:21 AM and 4:14 AM? 173 How many minutes are there between 1:54 PM and 11:46 PM? 592 How many minutes are there between 12:54 AM and 10:59 AM? 605 What is 355 minutes before 3:45 PM? 9:50 AM What is 374 minutes after 3:03 PM? 9:17 PM How many minutes are there between 7:56 AM and 9:46 AM? 110 What is 459 minutes before 9:34 AM? 1:55 AM How many minutes are there between 10:34 PM and 1:27 AM? 173 What is 664 minutes after 12:06 AM? 11:10 AM How many minutes are there between 7:14 AM and 10:57 AM? 223 What is 110 minutes after 9:25 AM? 11:15 AM What is 517 minutes after 10:18 PM? 6:55 AM What is 327 minutes after 4:00 PM? 9:27 PM How many minutes are there between 12:57 AM and 2:33 AM? 96 How many minutes are there between 10:50 AM and 2:56 PM? 246 What is 387 minutes before 2:14 AM? 7:47 PM What is 321 minutes before 9:28 AM? 4:07 AM How many minutes are there between 12:24 AM and 7:33 AM? 429 What is 327 minutes before 12:58 AM? 7:31 PM How many minutes are there between 3:45 PM and 8:28 PM? 283 How many minutes are there between 8:56 PM and 2:56 AM? 360 How many minutes are there between 2:46 PM and 4:27 PM? 101 How many minutes are there between 8:46 AM and 2:53 PM? 367 How many minutes are there between 4:59 PM and 11:43 PM? 404 What is 238 minutes after 7:41 PM? 11:39 PM What is 341 minutes after 9:59 AM? 3:40 PM What is 39 minutes before 9:30 AM? 8:51 AM How many minutes are there between 9:08 PM and 6:27 AM? 559 How many minutes are there between 5:32 PM and 5:21 AM? 709 What is 67 minutes before 4:23 PM? 3:16 PM What is 410 minutes after 8:18 AM? 3:08 PM What is 270 minutes before 5:22 AM? 12:52 AM What is 255 minutes before 5:37 PM? 1:22 PM How many minutes are there between 11:53 PM and 5:53 AM? 360 How many minutes are there between 10:17 PM and 7:03 AM? 526 How many minutes are there between 10:08 AM and 12:55 PM? 167 How many minutes are there between 5:53 PM and 4:29 AM? 636 What is 110 minutes after 8:50 PM? 10:40 PM What is 207 minutes after 12:04 PM? 3:31 PM What is 223 minutes before 1:46 PM? 10:03 AM How many minutes are there between 8:18 AM and 12:21 PM? 243 What is 111 minutes after 5:11 AM? 7:02 AM How many minutes are there between 12:51 AM and 12:13 PM? 682 What is 568 minutes before 3:18 AM? 5:50 PM What is 665 minutes before 2:40 AM? 3:35 PM How many minutes are there between 6:36 PM and 5:54 AM? 678 What is 115 minutes after 1:40 AM? 3:35 AM How many minutes are there between 1:18 AM and 10:16 AM? 538 How many minutes are there between 11:46 PM and 1:33 AM? 107 What is 610 minutes after 4:02 PM? 2:12 AM What is 643 minutes after 4:02 AM? 2:45 PM What is 631 minutes before 7:05 PM? 8:34 AM What is 310 minutes after 2:02 AM? 7:12 AM How many minutes are there between 4:01 AM and 6:33 AM? 152 What is 616 minutes after 10:47 AM? 9:03 PM What is 289 minutes after 1:51 PM? 6:40 PM How many minutes are there between 4:38 AM and 5:18 AM? 40 What is 144 minutes before 10:25 PM? 8:01 PM How many minutes are there between 12:56 PM and 9:41 PM? 525 How many minutes are there between 2:47 PM and 2:07 AM? 680 What is 448 minutes before 12:28 PM? 5:00 AM What is 137 minutes after 8:18 PM? 10:35 PM What is 662 minutes after 5:44 AM? 4:46 PM What is 493 minutes after 1:51 PM? 10:04 PM How many minutes are there between 4:12 PM and 5:03 PM? 51 How many minutes are there between 9:08 AM and 2:21 PM? 313 What is 685 minutes after 8:23 PM? 7:48 AM What is 421 minutes before 11:45 AM? 4:44 AM How many minutes are there between 10:02 AM and 6:07 PM? 485 What is 480 minutes before 4:39 PM? 8:39 AM What is 553 minutes after 12:21 PM? 9:34 PM What is 130 minutes before 1:04 AM? 10:54 PM What is 661 minutes before 8:03 PM? 9:02 AM What is 11 minutes before 8:12 AM? 8:01 AM What is 320 minutes before 11:03 PM? 5:43 PM How many minutes are there between 7:09 PM and 1:55 AM? 406 What is 419 minutes after 5:52 AM? 12:51 PM How many minutes are there between 10:21 PM and 12:43 AM? 142 What is 589 minutes before 11:36 AM? 1:47 AM What is 91 minutes after 9:09 PM? 10:40 PM How many minutes are there between 12:49 AM and 11:09 AM? 620 How many minutes are there between 4:23 PM and 2:19 AM? 596 How many minutes are there between 3:55 PM and 1:13 AM? 558 What is 309 minutes before 10:18 PM? 5:09 PM What is 394 minutes before 12:38 AM? 6:04 PM How many minutes are there between 12:58 AM and 12:17 PM? 679 What is 237 minutes after 8:30 AM? 12:27 PM What is 266 minutes before 11:30 AM? 7:04 AM How many minutes are there between 9:25 PM and 11:07 PM? 102 What is 406 minutes before 1:46 AM? 7:00 PM What is 564 minutes after 7:36 AM? 5:00 PM What is 249 minutes before 9:28 PM? 5:19 PM How many minutes are there between 11:04 PM and 5:46 AM? 402 What is 664 minutes before 11:34 PM? 12:30 PM How many minutes are there between 9:21 AM and 7:05 PM? 584 What is 156 minutes after 10:43 AM? 1:19 PM How many minutes are there between 10:57 PM and 10:12 AM? 675 What is 11 minutes before 11:35 PM? 11:24 PM What is 599 minutes after 3:28 AM? 1:27 PM What is 446 minutes after 11:18 PM? 6:44 AM What is 432 minutes before 7:01 AM? 11:49 PM How many minutes are there between 10:31 PM and 10:14 AM? 703 What is 244 minutes after 11:57 AM? 4:01 PM What is 10 minutes after 1:25 AM? 1:35 AM What is 104 minutes after 8:47 PM? 10:31 PM How many minutes are there between 7:04 PM and 11:14 PM? 250 What is 583 minutes after 3:52 PM? 1:35 AM How many minutes are there between 11:25 AM and 9:43 PM? 618 How many minutes are there between 2:19 AM and 12:35 PM? 616 What is 127 minutes after 12:50 AM? 2:57 AM What is 167 minutes after 9:47 AM? 12:34 PM What is 304 minutes before 7:39 PM? 2:35 PM What is 277 minutes before 4:52 AM? 12:15 AM How many minutes are there between 8:52 PM and 11:28 PM? 156 How many minutes are there between 4:57 AM and 4:36 PM? 699 What is 321 minutes after 4:33 PM? 9:54 PM What is 402 minutes after 6:58 PM? 1:40 AM What is 295 minutes after 1:41 PM? 6:36 PM How many minutes are there between 12:49 AM and 11:46 AM? 657 What is 209 minutes before 4:14 AM? 12:45 AM How many minutes are there between 11:24 AM and 5:19 PM? 355 What is 564 minutes before 4:35 PM? 7:11 AM What is 665 minutes before 8:36 AM? 9:31 PM What is 310 minutes after 11:39 PM? 4:49 AM How many minutes are there between 8:49 AM and 1:28 PM? 279 What is 386 minutes before 4:18 PM? 9:52 AM How many minutes are there between 6:28 PM and 6:40 PM? 12 How many minutes are there between 1:10 AM and 10:09 AM? 539 What is 485 minutes after 9:02 AM? 5:07 PM How many minutes are there between 5:08 PM and 11:02 PM? 354 How many minutes are there between 7:09 AM and 12:05 PM? 296 How many minutes are there between 4:09 AM and 8:05 AM? 236 How many minutes are there between 8:01 AM and 2:27 PM? 386 How many minutes are there between 5:52 PM and 4:15 AM? 623 How many minutes are there between 10:17 PM and 9:37 AM? 680 How many minutes are there between 8:15 AM and 11:21 AM? 186 What is 250 minutes after 4:43 AM? 8:53 AM What is 700 minutes after 3:49 AM? 3:29 PM What is 463 minutes before 9:22 AM? 1:39 AM How many minutes are there between 2:03 PM and 9:50 PM? 467 What is 496 minutes after 1:23 PM? 9:39 PM How many minutes are there between 7:46 PM and 3:24 AM? 458 What is 501 minutes before 8:24 AM? 12:03 AM What is 49 minutes after 12:29 AM? 1:1	{ "pile_set_name": "DM Mathematics" }
? 900 How many seconds are there in 166728.4 hours? 600222240 Convert 82.09266nm to millimeters. 0.00008209266 What is fourty-three halves of a litre in millilitres? 21500 How many centimeters are there in 84.45064 kilometers? 8445064 What is 29/5 of a litre in millilitres? 5800 Convert 99.37284ng to micrograms. 0.09937284 What is 9.48231 litres in millilitres? 9482.31 Convert 56.3015t to milligrams. 56301500000 How many millilitres are there in twenty-six fifths of a litre? 5200 What is 7/3 of a minute in seconds? 140 Convert 1.9273302 microseconds to days. 0.0000000000223070625 How many minutes are there in 3/40 of a day? 108 What is 0.4291476mm in kilometers? 0.0000004291476 How many months are there in 0.6009374 decades? 72.112488 What is 27.521421 nanoseconds in minutes? 0.00000000045869035 Convert 0.4919304us to milliseconds. 0.0004919304 What is 9.109049 nanometers in kilometers? 0.000000000009109049 How many millimeters are there in 3/40 of a kilometer? 75000 How many grams are there in three eighths of a kilogram? 375 What is thirteen eighths of a century in months? 1950 What is 27/2 of a litre in millilitres? 13500 Convert 0.5985399 nanometers to meters. 0.0000000005985399 What is thirty-two fifths of a litre in millilitres? 6400 What is 488547.9ml in litres? 488.5479 How many hours are there in 32091.345 seconds? 8.9142625 How many millilitres are there in 41.06689 litres? 41066.89 What is 3/32 of a day in minutes? 135 What is 3/25 of a litre in millilitres? 120 How many milliseconds are there in 11/2 of a second? 5500 How many centuries are there in 0.6829526 decades? 0.06829526 What is 2/15 of a millennium in months? 1600 How many litres are there in 0.8767747ml? 0.0008767747 What is 3/25 of a century in months? 144 How many millilitres are there in 18/5 of a litre? 3600 What is 0.2543324mm in kilometers? 0.0000002543324 What is thirteen quarters of a millennium in months? 39000 How many milligrams are there in 108911.1 nanograms? 0.1089111 What is 11/4 of a minute in seconds? 165 Convert 9.954846 nanometers to millimeters. 0.000009954846 What is 20/9 of a hour in seconds? 8000 How many milliseconds are there in 5.620357us? 0.005620357 How many hours are there in eleven halves of a day? 132 What is 28.23181 kilograms in nanograms? 28231810000000 How many millilitres are there in 6/5 of a litre? 1200 How many months are there in eleven eighths of a decade? 165 What is 4067.746l in millilitres? 4067746 How many millennia are there in 18812.6 centuries? 1881.26 How many centuries are there in 57970.46 decades? 5797.046 Convert 121.0492 days to milliseconds. 10458650880 What is one fifth of a minute in seconds? 12 How many millimeters are there in ninety-five halves of a centimeter? 475 How many minutes are there in fourty-five eighths of a week? 56700 Convert 525775.3 centuries to decades. 5257753 How many millilitres are there in 1/10 of a litre? 100 What is 86873.88l in millilitres? 86873880 What is 35.96312l in millilitres? 35963.12 What is 20.1310029ms in days? 0.00000023299771875 What is 68743.107ns in hours? 0.0000000190953075 How many grams are there in 2.366548ng? 0.000000002366548 What is 41/2 of a gram in milligrams? 20500 How many millimeters are there in 6/5 of a centimeter? 12 Convert 4.148324 centuries to months. 4977.9888 How many millilitres are there in seven quarters of a litre? 1750 Convert 3366.777 grams to kilograms. 3.366777 How many micrometers are there in 3/25 of a millimeter? 120 Convert 3894.492l to millilitres. 3894492 Convert 0.0592253t to kilograms. 59.2253 What is one quarter of a minute in milliseconds? 15000 What is 3/5 of a micrometer in nanometers? 600 Convert 682748.9mg to micrograms. 682748900 What is 75/4 of a litre in millilitres? 18750 How many milliseconds are there in thirty-two fifths of a second? 6400 Convert 0.1781495 meters to micrometers. 178149.5 What is twenty-one quarters of a gram in milligrams? 5250 What is 3/25 of a gram in milligrams? 120 What is 18/5 of a microgram in nanograms? 3600 How many millimeters are there in 3/5 of a meter? 600 What is 3/40 of a millennium in years? 75 What is 6/25 of a millisecond in microseconds? 240 Convert 2.887245 millilitres to litres. 0.002887245 What is 3/50 of a litre in millilitres? 60 How many millilitres are there in 31/2 of a litre? 15500 How many nanograms are there in 18/5 of a microgram? 3600 What is 148.9186mm in centimeters? 14.89186 Convert 2429715.42 milliseconds to days. 0.02812170625 What is 12/25 of a meter in centimeters? 48 Convert 31984.38 millennia to months. 383812560 How many micrometers are there in 1/10 of a meter? 100000 What is 5.918056 hours in minutes? 355.08336 What is thirty-four fifths of a meter in millimeters? 6800 What is 62068.2993 milliseconds in weeks? 0.00010262615625 What is thirty-two fifths of a centimeter in micrometers? 64000 What is 14.75202 litres in millilitres? 14752.02 What is 7/2 of a week in hours? 588 What is 69351.69 centuries in months? 83222028 What is 82580.98 centuries in years? 8258098 How many millilitres are there in 7.496434 litres? 7496.434 How many minutes are there in 25.443057 microseconds? 0.00000042405095 Convert 0.8359665ml to litres. 0.0008359665 What is seven halves of a millennium in months? 42000 How many millimeters are there in 114617.1nm? 0.1146171 What is 8350.369km in micrometers? 8350369000000 What is 39.38926m in millimeters? 39389.26 What is one twentieth of a kilometer in millimeters? 50000 Convert 0.0500554 meters to millimeters. 50.0554 Convert 186203.9um to nanometers. 186203900 How many micrometers are there in 29295.55 millimeters? 29295550 What is 5988.984 tonnes in kilograms? 5988984 What is three eighths of a century in months? 450 Convert 71.70281 centuries to months. 86043.372 How many weeks are there in 110.292147 hours? 0.656500875 How many milliseconds are there in six fifths of a minute? 72000 How many centimeters are there in 0.4207763 meters? 42.07763 Convert 15.9035ug to tonnes. 0.0000000000159035 What is 3/32 of a meter in micrometers? 93750 What is 0.4793959 kilograms in micrograms? 479395900 What is fifty-seven halves of a litre in millilitres? 28500 How many centuries are there in 1.317907 decades? 0.1317907 What is 1095.1824 months in millennia? 0.0912652 How many centuries are there in 1.7730732 months? 0.001477561 What is 45/2 of a milligram in micrograms? 22500 How many millilitres are there in 27/2 of a litre? 13500 What is 31.28921 years in millennia? 0.03128921 How many centimeters are there in twenty-five halves of a meter? 1250 How many millimeters are there in 27/5 of a meter? 5400 How many grams are there in 0.5365544t? 536554.4 How many minutes are there in 17/9 of a week? 19040 Convert 967.5421 years to centuries. 9.675421 How many tonnes are there in 273662.7 nanograms? 0.0000000002736627 What is seven thirds of a year in months? 28 What is 556377.2 days in hours? 13353052.8 What is 0.7441762 millilitres in litres? 0.0007441762 How many microseconds are there in thirty-four fifths of a millisecond? 6800 Convert 0.270898 kilograms to milligrams. 270898 What is 3/10 of a meter in millimeters? 300 How many milligrams are there in 5198.93g? 5198930 How many millennia are there in 1955.8008 months? 0.1629834 What is 37/5 of a litre in millilitres? 7400 How many minutes are there in one quarter of a hour? 15 Convert 5538.117ug to milligrams. 5.538117 Convert 88728.37l to millilitres. 88728370 How many microseconds are there in 51/2 of a millisecond? 25500 How many months are there in 3/5 of a millennium? 7200 How many years are there in 45141.64 centuries? 4514164 Convert 0.5044437 millilitres to litres. 0.0005044437 What is 1/10 of a millimeter in micrometers? 100 What is thirty-two fifths of a century in years? 640 What is three sevenths of a week in minutes? 4320 How many years are there in 13/8 of a millennium? 1625 What is 53/5 of a litre in millilitres? 10600 How many kilograms are there in 335733.4ng? 0.0000003357334 What is six fifths of a century in decades? 12 How many weeks are there in 233497.593 milliseconds? 0.0003860740625 What is 46/5 of a decade in years? 92 Convert 962.8184 hours to minutes. 57769.104 How many centuri	{ "pile_set_name": "DM Mathematics" }
ppose -h - 24 = -2n + s, 5n - 102 = -3h. What is the units digit of n? 8 Let q = 3 - 5. Let r = q + 9. Suppose -3 = 2d - 5c, -3d + rc + 3 = 2c. What is the units digit of d? 6 Let p be 1/(-1 + (-40)/(-44)). Let f = 8 - p. What is the tens digit of f? 1 Let l(y) = 40y + 7. What is the tens digit of l(2)? 8 Suppose 0d = d - 4. Let t(i) = -i - 1. Let n be t(-4). Let b = d - n. What is the units digit of b? 1 Let a = 4 - -2. Let m(x) = x*2 - 5x - 2. Let h be m(a). Suppose t = h + 2. What is the units digit of t? 6 Let a = -2 + 0. Let o(i) = -i - 1. Let z be o(a). Let r = 5 - z. What is the units digit of r? 4 Let f = 9 + 1. What is the units digit of f? 0 Suppose 270 + 290 = 7n. What is the units digit of n? 0 What is the units digit of 18/81 - 104/(-18)? 6 Let q be 37/((1 + 1)/(-2)). Let p = -25 - q. Suppose -h + 0h = f - p, 3f - 45 = -4h. What is the units digit of h? 9 What is the units digit of 339(-3)/(-9)? 9 Let b(s) be the second derivative of -1/6s4 - 1/3s*3 + 1/20s*5 + 0s*2 + 0 - s. What is the units digit of b(3)? 3 What is the tens digit of (-1)/(3/(-245)) - (-13)/39? 8 Let a = 0 - -8. Suppose -a = 2f - 26. Suppose -d + 2s - 5s - 11 = 0, 4d + f = -5s. What is the units digit of d? 4 Suppose -2q + 19 = x, 5x - 3q + 0q = 147. Let z = -16 + x. What is the tens digit of z? 1 Let z be (3 + -2)/((-1)/5). What is the units digit of (-9)/z(-20)/(-6)? 6 What is the units digit of (9/(-2) - 2)-2? 3 Let p be (-3)/(9/(-309))1. Suppose -27 = -5d + p. What is the units digit of d? 6 Let r(f) = f + 2. Let h be r(1). Suppose hz = 84 + 6. What is the units digit of z? 0 Suppose 2a - 14 - 34 = 0. What is the units digit of a? 4 Suppose -3q = -3b + 84, -b + 42 = -2q + 12. What is the units digit of b? 6 Suppose 4c + 2t = t + 23, 0 = -5c - t + 28. Suppose -4k + 2k + 2 = j, -ck = 2j - 3. What is the units digit of j? 4 Let l = 60 - 21. Let v(x) = -x*2 + 3x - 5. Let k be v(6). Let n = k + l. What is the units digit of n? 6 Suppose 0 = 2a - 4a - 2d + 830, 0 = -4a - 2d + 1650. What is the hundreds digit of a? 4 Let l be 5(117/15 - 1). Let v(k) = -k - 3. Let d be v(-7). Suppose dc - 6 = l. What is the tens digit of c? 1 Suppose -4a - 2b = -b + 2, 0 = 4b + 8. Let q = 2 + a. What is the units digit of q? 2 Suppose -2w = 3j - 5w - 24, -5j + 4w + 35 = 0. Let k be 39 + 0/(-3) + 1. Suppose -3c = -6c + 4x + 13, -k = -5c + jx. What is the tens digit of c? 1 Let j be (-36)/(-21) + 4/14. Let d = j - -1. What is the units digit of d? 3 Let k(c) be the first derivative of c4/4 + c3 - c*2/2 - 2c - 1. Let f(x) = 2x + 3. Let j be f(-3). What is the units digit of k(j)? 1 Let f be ((-9)/15)/((-2)/10). What is the units digit of ((-32)/(-6))/(2/f)? 8 Let u(w) = -3w3 + w2 - 2w - 2. What is the units digit of u(-1)? 4 Let z(v) = -v2 - 19v - 25. What is the units digit of z(-16)? 3 Suppose 0 = -2n + 3n - 21. Let j = n + 1. What is the tens digit of j? 2 Let d be (5 - 1 - 3)2. What is the units digit of d/1 - (-1 + 1)? 2 Suppose 0 = 3v - 2a - 5, 3a = -4v + 8a + 2. Suppose -2k + 60 = vk. What is the units digit of k? 2 Let v(a) = -a*3 - 6a*2 - 12a - 18. What is the units digit of v(-9)? 3 Let g(d) = -7d - 1. Let k = 1 + -4. What is the tens digit of g(k)? 2 Suppose -2l - 24 = -3l. Suppose x - 3x = l. What is the units digit of (-123)/(-18) + (-2)/x? 7 What is the units digit of 2/1 + 12 - -2? 6 Let b be (-5)/(8/3 - 3). Suppose -3x + 2x = -b. What is the tens digit of x? 1 Let x(p) = 4p3 + 2p*2 - p. Let b be x(1). Suppose -bz + 5m = -0z - 15, 4z = -5m + 39. What is the units digit of z? 6 Suppose -7h = -3h - 108. Let o = -1 + 7. What is the units digit of 8/6h/o? 6 Suppose 5p - 3c - 658 = 0, -3p + 0p + c + 398 = 0. What is the units digit of p? 4 Let t be (-16)/56 - 30/(-7). What is the units digit of 2/456/t? 7 Let y = 15 - 20. Let u(k) = -k*2 - 7k + 4. What is the tens digit of u(y)? 1 Let g = -6 - -10. Let n(q) = 2q2 - 4q - 1. Let u be n(4). Suppose z = -gz + u. What is the units digit of z? 3 Let s = -7 - -12. Suppose h + 3l = 7, -sh - 22 = -3l - l. What is the units digit of (-32)/(-18) + h/(-9)? 2 What is the units digit of (21/(-12))/1-104? 2 What is the hundreds digit of 4 - 17/((-51)/396)? 1 Let t(j) = 16j*2 - 7j*2 + 19j - 11 - 4 + 7j2. Let h(q) = -3q*2 - 4q + 3. Let x(u) = 11h(u) + 2t(u). What is the tens digit of x(-3)? 1 Suppose 85 - 5 = -5k. Let p = 17 + k. What is the units digit of p? 1 What is the hundreds digit of (-4)/(-7) + 8694/49? 1 Suppose -3l + 99 = -210. What is the tens digit of l? 0 Let m = 182 - -4. What is the hundreds digit of m? 1 Suppose 20 = 2r - 0r. What is the units digit of (-5)/r2/(-1)? 1 Suppose -2w = -j - 4, 2j = -4w + j + 14. Let d = w - 2. What is the units digit of d? 1 Suppose 0 = 5k + 3 + 2. Let l(j) = 15j*2 + 1. What is the tens digit of l(k)? 1 Let y be ((-6)/8)/((-1)/(-12)). What is the tens digit of (y/(-3))/((-2)/(-12))? 1 Let d(h) = h - 2. Let p be d(6). Suppose pk + 2c - 37 = -k, -15 = -2k - c. What is the units digit of k? 7 Suppose -2 = -i - 0i. Suppose 4p + o = 69, 48 = ip - 2o + 6. What is the units digit of p? 8 Suppose -t + 69 = h + 3h, -h - t = -21. Suppose 30 = 2a - h. Suppose -c - 7o + 16 = -3o, -5o = 2c - a. What is the units digit of c? 4 Let s be (-4)/10 - (-166)/(-10). Let x be 1/(1/(1 + -2)). What is the units digit of x/2 + s/(-2)? 8 Let b(n) = 9n - 3. What is the units digit of b(9)? 8 Suppose 3u - u + 22 = 0. Let g(z) = -4z - 9. What is the tens digit of g(u)? 3 Let i(r) = -r3 - 15r*2 + 16r + 9. What is the units digit of i(-16)? 9 Suppose 0 = -5h + 2a - 20, -5h - a - 2a - 45 = 0. Let o(x) = -x*2 - 4x + 6. Let b be o(h). Let k = b - -9. What is the units digit of k? 3 What is the hundreds digit of 20/(-50) - 1564/(-10)? 1 Let l(q) = 2q2 - 4. What is the units digit of l(4)? 8 Let y(f) = -f - 6. Let o = 13 + -21. What is the units digit of y(o)? 2 Let d = 2 - -3. Suppose 0 = dv - 2x - 129 + 21, 0 = 2v + 4x - 48. What is the units digit of v? 2 Suppose 75 = -6s + 11s. Let y = 5 - 1. Suppose 3v - n = s, -v = -3v + yn. What is the units digit of v? 6 Suppose -j = 4j - 35. Suppose -2t + 3t = j. What is the units digit of t? 7 Let t = 0 + -4. Let m(u) = -2u - 2. What is the units digit of m(t)? 6 Suppose -3a + 5 = -2a. Suppose -i = -4o - 3, 0i - 15 = -ai - o. What is the units digit of i? 3 Let p(f) = f2 - 6f. Let h be p(3). Let w = -8 - h. What is the units digit of w? 1 Let k = -55 + 57. What is the units digit of k? 2 What is the units digit of (-45 + (-2 - 0))(1 - 2)? 7 Suppose 0 = 2t - 3 - 5. What is the units digit of t? 4 Let n be 3/2 + (-388)/(-8). Let z = -30 + n. What is the tens digit of z? 2 Suppose -20 = 2t - 6t. What is the units digit of 791/35 + (-3)/t? 2 Let b = 15 + -10. Suppose bj = 2l + 53, 4j - 28 = -0l - 2l. What is the units digit of j? 9 Let u = -3 + 3. Suppose j + u = 1. What is the units digit of j? 1 Suppose -5f + 16 = -9. Suppose 3b - 25 = u, -32 - 11 = -fb + 3u. What is the units digit of b? 8 Suppose x = 3f + 1, -4f = -2f - 4. Let i(w) = -w + 5. Let b be i(x). What is the units digit of -3(-1)/b-4? 6 Let f = 23 - 18. Let b(m) be the third derivative of -m6/120 + m5/12 + m4/12 + m3/3 - m*2. What is the units digit of b(f)? 2 Suppose -15l - 80 = -17l. What is the units digit of l? 0 Let z(h) = -h. Let a be z(-5). Suppose -p + 10 = -ap - 5o, 12 = -2p + o. Let m = 10 + p. What is the units digit of m? 5 Let c = -66 + 87. What is the units digit of c? 1 Let k be 3/(1 + (-2)/(-4)). Suppose 10 = -7c + kc. Let u(l) = -2l + 2. What is the units digit of u(c)? 6 Suppose 3w + 3 = 123. What is the units digit of 968/w + 8/10? 5 Suppose 11c = 517 + 649. What is the tens digit of c? 0 Let p be (-2)/(-5) - 56/(-35). Let g(n) = -n + 6. Let u be g(-6). Suppose -p = 2k - u. What is the units digit of k? 5 Suppose 5j = 3 + 2. Suppose 0 = -3d + j - 4. What is the units digit of 195/25 - d/5? 8 Let h be 0/(2/1 - 1). Let f = h + 2. Suppose -c + 4 - f = 0. What is the units digit of c? 2 Let y(i) = 4*i - 33. What is the units digit of y(10)? 7 Let q = 12 + -8. Su	{ "pile_set_name": "DM Mathematics" }
0.000011874 to 6 decimal places. 0.000012 Round -0.0000105254 to 6 decimal places. -0.000011 What is 39.066 rounded to 1 dp? 39.1 What is 3159 rounded to the nearest one thousand? 3000 Round 0.000001187 to 7 decimal places. 0.0000012 Round 10.83 to the nearest integer. 11 Round -0.0000005475 to seven dps. -0.0000005 Round -0.00008155 to six decimal places. -0.000082 Round 51.32 to zero decimal places. 51 Round 0.00029735 to 5 dps. 0.0003 What is 275.01 rounded to the nearest one hundred? 300 Round 78.6 to the nearest one hundred. 100 What is -36.2 rounded to 0 dps? -36 Round -3052 to the nearest one hundred. -3100 Round -10774 to the nearest one thousand. -11000 Round -0.000069227 to 6 dps. -0.000069 Round -0.0000040124 to 6 dps. -0.000004 Round -70039.2 to the nearest one thousand. -70000 What is 131.3 rounded to the nearest one hundred? 100 What is -0.10794 rounded to 3 decimal places? -0.108 What is -13.0004 rounded to 1 dp? -13 Round 0.0000014175 to 7 decimal places. 0.0000014 Round 122.4 to 0 dps. 122 Round 21.198 to 0 decimal places. 21 What is 0.000047471 rounded to 5 dps? 0.00005 Round 5085400 to the nearest 1000000. 5000000 Round 67970 to the nearest one thousand. 68000 Round -10.407 to one dp. -10.4 Round -465 to the nearest 100. -500 Round -27118000 to the nearest one hundred thousand. -27100000 Round 0.00012192 to five decimal places. 0.00012 Round 0.00148652 to 5 dps. 0.00149 What is -0.0000446159 rounded to 7 decimal places? -0.0000446 What is 2.5931 rounded to one dp? 2.6 Round -901400 to the nearest ten thousand. -900000 Round 0.000001099 to 7 decimal places. 0.0000011 Round -0.017742 to three dps. -0.018 Round 226700 to the nearest ten thousand. 230000 Round -1140000 to the nearest 100000. -1100000 What is -1899000 rounded to the nearest 1000000? -2000000 What is -3.28 rounded to zero dps? -3 What is -0.00096878 rounded to 4 dps? -0.001 What is 55.14 rounded to the nearest integer? 55 What is 0.0000030044 rounded to seven dps? 0.000003 Round -0.00005153 to six decimal places. -0.000052 Round 239200 to the nearest ten thousand. 240000 What is 94.7 rounded to the nearest 10? 90 What is 0.00007448 rounded to six decimal places? 0.000074 What is 15124000 rounded to the nearest one hundred thousand? 15100000 Round -0.0305 to 2 decimal places. -0.03 What is 7620000 rounded to the nearest 1000000? 8000000 Round 1024340 to the nearest ten thousand. 1020000 What is 476.7 rounded to the nearest ten? 480 What is 0.0003267 rounded to five decimal places? 0.00033 Round -81150 to the nearest 1000. -81000 What is -0.0000423 rounded to 5 decimal places? -0.00004 What is 4023 rounded to the nearest one hundred? 4000 Round -561130 to the nearest one thousand. -561000 What is -6111 rounded to the nearest 1000? -6000 What is 211940 rounded to the nearest 10000? 210000 Round 0.000775 to 5 dps. 0.00078 Round 18.628 to the nearest integer. 19 Round 374.22 to zero decimal places. 374 Round -5.51 to 1 decimal place. -5.5 Round -0.000000868 to 7 dps. -0.0000009 What is -22890 rounded to the nearest 1000? -23000 Round 23932 to the nearest one thousand. 24000 Round 0.04775 to three dps. 0.048 What is 0.0002517 rounded to 4 decimal places? 0.0003 Round 0.000000727 to 7 decimal places. 0.0000007 Round 0.033107 to 4 decimal places. 0.0331 What is -44.41 rounded to the nearest ten? -40 Round 676 to the nearest one hundred. 700 Round -57.13 to the nearest 10. -60 What is -0.0000037999 rounded to 7 dps? -0.0000038 Round -0.00005547 to 5 dps. -0.00006 What is 0.000000176 rounded to 6 decimal places? 0 Round -0.0373837 to two dps. -0.04 Round 0.000803 to 4 decimal places. 0.0008 What is -114.78 rounded to 0 decimal places? -115 What is 0.000092604 rounded to six dps? 0.000093 What is 439920000 rounded to the nearest one million? 440000000 What is 0.021691 rounded to four decimal places? 0.0217 Round -39827 to the nearest 10000. -40000 Round -19650000 to the nearest 1000000. -20000000 What is -6841.3 rounded to the nearest ten? -6840 Round 0.0001765 to 5 decimal places. 0.00018 What is -802.96 rounded to the nearest one hundred? -800 What is -113.382 rounded to the nearest 10? -110 What is -4006.8 rounded to the nearest ten? -4010 Round 0.051977 to 4 dps. 0.052 What is 0.004409 rounded to 3 dps? 0.004 Round -0.453 to one dp. -0.5 Round 0.0000079 to five dps. 0.00001 What is 0.032468 rounded to four decimal places? 0.0325 Round 232400 to the nearest 10000. 230000 Round 831200 to the nearest ten thousand. 830000 Round -0.0051 to four dps. -0.0051 Round -96340 to the nearest 10000. -100000 What is -0.06217 rounded to three decimal places? -0.062 What is -0.000020362 rounded to 7 decimal places? -0.0000204 Round -0.00588 to four decimal places. -0.0059 What is -24708000 rounded to the nearest 1000000? -25000000 What is 0.464992 rounded to 1 dp? 0.5 What is 226740000 rounded to the nearest one million? 227000000 Round -0.111433 to 3 decimal places. -0.111 Round -0.075878 to 4 dps. -0.0759 Round 82900000 to the nearest one million. 83000000 What is 16.355 rounded to the nearest one hundred? 0 Round -22123000 to the nearest one hundred thousand. -22100000 Round 179600 to the nearest 10000. 180000 Round -1846.46 to the nearest ten. -1850 Round -61650000 to the nearest one million. -62000000 What is 0.01328 rounded to 3 decimal places? 0.013 What is -747000 rounded to the nearest 100000? -700000 Round -858400 to the nearest 100000. -900000 What is -6376.67 rounded to the nearest one hundred? -6400 Round -31660 to the nearest ten thousand. -30000 What is -0.02329 rounded to four decimal places? -0.0233 Round 0.3269 to one dp. 0.3 What is 742700 rounded to the nearest 10000? 740000 Round -0.0003313 to 4 dps. -0.0003 Round 0.000065157 to seven decimal places. 0.0000652 Round 6.8861 to zero decimal places. 7 What is -200320 rounded to the nearest 1000? -200000 What is 21.285 rounded to the nearest integer? 21 What is -142.9 rounded to the nearest 10? -140 What is 676.3 rounded to the nearest 100? 700 What is 15610000 rounded to the nearest 1000000? 16000000 Round -0.0015308 to 5 dps. -0.00153 What is -12151000 rounded to the nearest 1000000? -12000000 What is 0.00000082449 rounded to 7 dps? 0.0000008 Round -3721.7 to the nearest one hundred. -3700 What is -0.000015896 rounded to seven decimal places? -0.0000159 What is -42650 rounded to the nearest one thousand? -43000 What is -27772100 rounded to the nearest 1000000? -28000000 What is -0.000006322 rounded to 6 decimal places? -0.000006 What is -155332 rounded to the nearest 1000? -155000 Round 51.935 to one dp. 51.9 What is 519.53 rounded to the nearest 10? 520 What is -7.72 rounded to zero decimal places? -8 What is 12034000 rounded to the nearest 100000? 12000000 Round -0.000000616 to six dps. -0.000001 Round -121880 to the nearest 1000. -122000 Round 0.0049 to 4 decimal places. 0.0049 Round -0.000089 to three decimal places. 0 What is 3270840 rounded to the nearest one million? 3000000 What is 1232300 rounded to the nearest 100000? 1200000 What is 0.000006952 rounded to six dps? 0.000007 What is 0.0000491 rounded to 5 decimal places? 0.00005 What is -4689 rounded to the nearest one hundred? -4700 Round 1967700 to the nearest ten thousand. 1970000 Round 3466200 to the nearest 100000. 3500000 What is 0.000001804 rounded to 7 dps? 0.0000018 Round 1.7184 to 1 dp. 1.7 Round 559390 to the nearest 100000. 600000 What is -9436 rounded to the nearest one thousand? -9000 Round 19193.1 to the nearest one thousand. 19000 What is 405000 rounded to the nearest one million? 0 What is 0.0000005 rounded to 5 decimal places? 0 Round -0.000506 to 4 decimal places. -0.0005 Round 6273130 to the nearest ten thousand. 6270000 Round 0.000031551 to six dps. 0.000032 What is 191520000 rounded to the nearest 1000000? 192000000 Round 0.0057149 to 3 dps. 0.006 Round -567220 to the nearest one hundred thousand. -600000 What is 0.00000006946 rounded to seven dps? 0.0000001 What is 0.000002694 rounded to seven decimal places? 0.0000027 What is -0.00006688 rounded to 6 decimal places? -0.000067 Round -365447000 to the nearest 1000000. -365000000 What is -0.00000357 rounded to 6 dps? -0.000004 Round -0.05163 to 3 decimal places. -0.052 What is 9.45	{ "pile_set_name": "DM Mathematics" }
3 Suppose -o = -0o. Suppose 5n + 10 + 15 = 0. Put -3, n, o in ascending order. n, -3, o Let g = -9 - -4. Let a = g + 4. Let t = 39 + -38. Sort a, -5, t. -5, a, t Let f = -5 + 11. Suppose 0 = -3l - f - 6. Sort 5, -2, l. l, -2, 5 Suppose 3u = -0u. Let i = 0.14 + -0.16. Sort u, -1/6, i in descending order. u, i, -1/6 Let n = -109 + 111. Let v = -4 - 0. Sort n, -0.1, v in ascending order. v, -0.1, n Let a(h) = h + 3. Let i be a(-4). Suppose 2p - 2k + 4k + 2 = 0, 3k = 4p + 32. Let r be (6/(-15))/((-1)/p). Sort i, r, 5 in descending order. 5, i, r Let b be (-21)/(-4) - 1/4. Put -3, -17, b in increasing order. -17, -3, b Let q(d) = -d - 14. Suppose 5p + 0t + 3t - 3 = 0, 4 = -t. Let n be (-96)/9 - 1/p. Let k be q(n). Sort 0, -4, k. -4, k, 0 Suppose -26 = -2n + 4a, -3n - 2a = -0a + 1. Let z(f) = f - 9. Let u be z(10). Put n, u, -3 in decreasing order. n, u, -3 Let i(p) = -p*2 - 3p - 2. Let l be i(-3). Let t be (4/(-1))/((-2)/(-4)). Let q be 3/(1 + 14/t). Sort 0, l, q. q, l, 0 Let n(z) = -z*3 + 5z*2 - 5z + 2. Let p be n(3). Sort 4, -4, p. -4, 4, p Let l = -21 - -23. Put -2, -10, l in ascending order. -10, -2, l Let n = -5 + 7. Suppose 0c - 8 = nc. Let r be (-4)/18 + (-2)/(-9). Put r, c, 3 in decreasing order. 3, r, c Let c be (-5)/3 - (2 + -4). Let g = 2.94 + 0.06. Put -0.1, g, c in descending order. g, c, -0.1 Let i = -115 + 97. Sort 2, i, 5. i, 2, 5 Let z(v) = -v*2 - v - 3. Let o be z(0). Suppose -4q - 6 = h + 18, 27 = -3q - 3h. Put o, 1, q in decreasing order. 1, o, q Let w = 1.7 + -5.7. Let m = w + 6. Sort 0.5, m, -2/3 in ascending order. -2/3, 0.5, m Let y = -63/2 + 317/10. Suppose 2a = -3u + 35, a - 50 = -3a - 2u. Suppose 24n = 29n + a. Sort n, -2/17, y in increasing order. n, -2/17, y Let c = -0.44 - -0.14. Let p(q) = -5q2 - q + 1. Let j be p(1). Put j, -0.5, c in decreasing order. c, -0.5, j Let d(n) = n2 + 13n + 9. Let x be -4 - (7 - (-4 - -3)). Let u be d(x). Let z(k) = k*3 - 5k*2 - k + 4. Let a be z(5). Sort a, 3, u. u, a, 3 Suppose -8o - 8 = -12o. Let g be o/(-8) + 9/18. Sort 0.3, g, -1 in ascending order. -1, g, 0.3 Let k = 0.06 + 0.14. Let r = 3.03 + -0.03. Let a = r - 2.7. Put a, k, 2/5 in decreasing order. 2/5, a, k Let z = 44/7 - 139/21. Sort z, -11, 4, -2 in decreasing order. 4, z, -2, -11 Suppose 6 + 2 = 2y. Put y, -2, 2 in ascending order. -2, 2, y Let y(l) = -l*3 - 5l2. Let o be y(-5). Let n = 0 + -6. Let c = -2 - n. Put o, c, -5 in ascending order. -5, o, c Let s(z) be the third derivative of -z4/24 - 7z3/6 + 2z2. Let w(j) = -j2 + 2j - 2. Let p be w(3). Let x be s(p). Put x, 1, -5 in ascending order. -5, x, 1 Let i be (0/2)/(-1) + 2. Let f be (-2)/(-4) - 1/i. Sort f, 4, -2 in descending order. 4, f, -2 Let r be (6/5)/(5/(-25)). Let x be 9/r + (-9)/(-6). Sort 3, x, 1 in ascending order. x, 1, 3 Suppose 3 = -4v + 5i, -2i - 4 = 2i. Suppose -2y + 9 = m - 0, 0 = -m - 5y + 15. Suppose -3t - 4 = t. Put m, v, t in increasing order. v, t, m Suppose -5a - 4q = -242 + 89, 2a = 3q + 75. Suppose 8 = 5i + a. Suppose t = 4d - 15, 0 = 3d + 3t - 19 - 11. Sort 3, d, i in descending order. d, 3, i Let i be ((-2)/4 - -1) + -1. Let d = -0.2 + -0.2. Sort i, 1, d. i, d, 1 Suppose 4m - m = -3m. Sort 3, 2, -3, m in descending order. 3, 2, m, -3 Suppose 5o - d - 7 = 0, -o + 4o - 18 = -4d. Suppose -4s + ox = 28, -s - s - 4x = -6. Put -1, 3, s in increasing order. s, -1, 3 Let m = -104 - -132. Sort -1, 2, m, -5 in decreasing order. m, 2, -1, -5 Suppose p - 4j - 17 = -0p, -2p + 86 = 5j. Let o be 22/p + 5/(-12). Sort 0.1, -3, o in decreasing order. o, 0.1, -3 Let q = 14 - 12. Sort q, 4, 9 in decreasing order. 9, 4, q Let a(g) = 2 + 9g - 1 - 10g. Let t be a(1). Let f(i) = i*3 - 9i*2 + i - 10. Let c be f(9). Put t, c, -2 in descending order. t, c, -2 Let g = -19 - -20. Let z = -0.3 + 0.2. Let t = 0 - z. Put -0.1, t, g in descending order. g, t, -0.1 Let s = -365 + 365. Let l be 4/(-14) + 16/7. Put l, 3, s in increasing order. s, l, 3 Suppose -3 = 4z + 5d, -d - 1 = 3z + 4d. Put z, 1/4, -0.5 in descending order. 1/4, -0.5, z Suppose 0 = -13w - 47 - 5. Put w, -69, -2 in increasing order. -69, w, -2 Let g = -29 + 28.7. Put 4, g, -2 in descending order. 4, g, -2 Let y = -54 - -59. Put -4, y, 10 in descending order. 10, y, -4 Let d be (-1)/((-22)/(-8) + -3). Sort -1, 1, -2, d in decreasing order. d, 1, -1, -2 Let b = 8278811/886130 - -5/25318. Let f = 64/7 - b. Sort 0, f, -1/4 in decreasing order. 0, f, -1/4 Let p = 48 + -191/4. Let w = 30 + -181/6. Suppose -5i = 3b - 34, i = 5b - 3i + 5. Sort p, w, b in ascending order. w, p, b Let z(d) = 3d + 2. Let g be z(6). Suppose 0a + g = -4a. Put 2, a, -3 in decreasing order. 2, -3, a Let b = 4 - 2. Let p be 68/(-22) - (18 - 0)/(-6). Put b, p, -2/9 in descending order. b, p, -2/9 Let v = -4 + 3. Let q be (2/6 + 0)/(4/6). Sort v, -0.1, q. v, -0.1, q Let r = 6/77 - 232/1001. Let n(y) = -26y - 3. Let g be n(-2). Let b = g - 195/4. Sort b, -1, r. -1, r, b Suppose -2x + 1 = -1, 5q + 2x = 27. Put -1, -5, q in descending order. q, -1, -5 Let x(r) = r + 3. Let u be x(-5). Let s = -33 - -33.3. Put 2, u, s in descending order. 2, s, u Suppose 18 = 3u - 2f, -3f + 6f - 3 = -3u. Sort u, -3, -4. -4, -3, u Let k = -1.3 + -2.7. Sort 1, -1/4, -3/7, k in ascending order. k, -3/7, -1/4, 1 Let u = 45 - 37. Put 4, u, 3, 2 in ascending order. 2, 3, 4, u Let v = -1 + 1. Let u(a) = 3 + 0a + 3a*2 - 4a*2 + 6a. Let z be u(7). Sort 4, z, v. z, v, 4 Let z be (-1)/1 + -1 + 0. Let y = 12 - 3. Let a be 6/y(-2)/8. Put a, z, -1/4 in decreasing order. a, -1/4, z Let o be (-64)/(-20)5/2. Let d = o + -12. Sort 3, 5, d. d, 3, 5 Suppose 34 = -4t + 4l - 9l, -2t + 3l - 28 = 0. Let b = -15 - t. Put -3, b, -5 in decreasing order. -3, b, -5 Let b = 46 - 46. Sort -5, b, 1 in decreasing order. 1, b, -5 Let c = 7 - 5. Let v = -120 - -120.2. Put -4/7, c, v in decreasing order. c, v, -4/7 Let t = 140 - 140. Sort 9, t, -1, -5 in descending order. 9, t, -1, -5 Let n(c) = -c2 - 5c + 3. Let p be n(-6). Sort 5, p, 0. p, 0, 5 Let d(a) = -a*3 - 8a*2 - 7a + 4. Let i be d(-6). Let b be i/(-221) - (0 + 0). Sort -3/4, b, 5 in ascending order. -3/4, b, 5 Let b(m) = m*3 - 8m*2 + 6m + 2. Let q be b(7). Sort -6, q, 1 in decreasing order. 1, q, -6 Let t = 449 - 453. Let b = 2 + 1. Sort t, b, -7 in decreasing order. b, t, -7 Let x = -3.9 + 0.9. Put x, -4, 0.1 in increasing order. -4, x, 0.1 Let z = 2 - -4. Suppose 2o = -2y + 6o + 24, 3y + 2o - 68 = 0. Suppose -2s + zs = y. Sort -1/2, -0.2, s in increasing order. -1/2, -0.2, s Let j = -0.5 + 0.49. Let m = 0.41 + j. Let q = m - 0.9. Sort 1/5, 3, q in ascending order. q, 1/5, 3 Let v(i) = -109i + 1. Let u be v(1). Let y be u/30 - 4/10. Put -1, y, 2 in decreasing order. 2, -1, y Let d = -9 + 5. Let p(o) = -o*2 + 7o + 3. Let l be p(7). Suppose 0 = -6i - 15 - l. Put -1, i, d in decreasing order. -1, i, d Let g be (-30)/(-10) - 0 - 4/1. Sort g, -5, 1 in decreasing order. 1, g, -5 Let u be 12 + (-4)/(28/(-21)). Let m be (2 - 1) + 21/(-3). Sort m, -4, u. m, -4, u Let v be (-2 + 2)(-3)/3. Put 1, 3, v in decreasing order. 3, 1, v Let i(r) = -r3 + r2 - r + 3. Let f be i(0). Suppose -7 = -2a + 5w, -26 = 5a + fw - w. Sort 4, -1, a. a, -1, 4 Suppose 9 = -2g + 1. Sort -2, 2, 4, g in decreasing order. 4, 2, -2, g Let a = 34.95 + -35. Sort -0.4, a, 0.1 in increasing order. -0.4, a, 0.1 Let u = 15 - 9. Suppose 3f + u = 5t, -8 = 6f - 2f - 5t. Suppose -q - 16 = 3q. Put 3, q, f in increasing order. q, f, 3 Let m(z) = -z - 17. Let j be m(-13). Put 5, 1, j in decreasing order. 5, 1, j Let c be ((-4)/(-6))/(2/(-12)). Let r = -128 + 126. Put -5, r, c in descending order. r, c, -5 Let p = 4/21 - 6/7. Put p, 3, -2/11 in decreasing order. 3, -2/11, p Let k be (-4)/(-3) + 8/(-6). Sort 2, 1, k. k, 1, 2 Suppose -11t + 108 = -2t. Sort 1, -1, t in decreasing order. t, 1, -1 Let d = -1.3 - -0.8. Put d, -1/3, 5, 0.3 in ascending order. d, -1/3, 0.3, 5 Let d be (-4)/18 + 2/9. Let g = d + -4. Suppose 0 = 3r + s - 2, -4r - 5*s = r - 10. Put g, r, -1 in ascending order. g, -1, r Let q = 3 - 2.9. Let t = q - 0.1. Let g = 27 - 22. Put g, -1, t in ascending order. -1, t, g Let s be (-4)/(-70) - 7/35. Put 0, 35,	{ "pile_set_name": "DM Mathematics" }
derivative of -7372702u3 - 7215298u. -44236212u Find the third derivative of -5303642l*3 + 153829l*2 - 975l. -31821852 What is the third derivative of 7032125m2o*3 - 22m*2o*2 + 15950m*2o - 31mo*6 + 2m - 6o2 - 1 wrt o? 42192750m*2 - 3720mo3 Find the second derivative of -4ar3 + 6ar + 27a - 1866r3 - 3313r*2 + 48793r wrt r. -24ar - 11196r - 6626 Find the first derivative of -14hu2 - hu - 31385998h + 76627u*2 wrt u. -28hu - h + 153254u Find the third derivative of -7236794v3w*3 - 100v*3w - 18871vw*2 wrt w. -43420764v*3 Find the third derivative of 338705969b*2z4 - b2z2 - 6459bz - 277z*2 wrt z. 8128943256b*2z Differentiate 84656341s3 + 99980130. 253969023s*2 What is the second derivative of 158108408w*2 + 396054375w? 316216816 Find the second derivative of -22753186a4 + 142208916a wrt a. -273038232a2 What is the third derivative of -61407335h*3 - 463h*2 - 37077h wrt h? -368444010 Find the second derivative of 42928016i3 - 5492502i wrt i. 257568096i What is the second derivative of -29185f*2i + 54f2 - 53707fi - 47 wrt f? -58370i + 108 Differentiate -292575732z3 + 273638879 wrt z. -877727196z*2 What is the third derivative of 230f*4 - 843f*3 - 1335048f*2? 5520f - 5058 What is the third derivative of -305208911y3 - 104539y*2 + 3y - 59? -1831253466 Find the second derivative of -62145818s2 - 73884s + 250. -124291636 Find the third derivative of -53859583m6 - m4 + 85067286m*2 wrt m. -6463149960m*3 - 24m Find the second derivative of 352760872z4 - 4429476z + 116 wrt z. 4233130464z2 What is the second derivative of -26155631h*2 + 27179h + 762? -52311262 Find the second derivative of 101977076y4 + 30201792y. 1223724912y2 Find the third derivative of 24946714p*4 - 25812873p*2 wrt p. 598721136p What is the first derivative of 2498712b2 + 17bg - 16822010g wrt b? 4997424b + 17g Find the second derivative of 123832382q4 + 169263108q. 1485988584q2 Find the third derivative of 6630c*6 - 301c*5 + 37c*3 - 20c*2 - 22873c + 60 wrt c. 795600c3 - 18060c*2 + 222 What is the first derivative of -320048jr2y - 2jr + j + 4ry*2 + 119143y*2 wrt r? -640096jry - 2j + 4y*2 Find the third derivative of -421810428u*3 - 347744734u*2 - u. -2530862568 What is the third derivative of 5394jl4 + 342jl3 + 5jl2 - 624jl - 2j + 10l wrt l? 129456jl + 2052j What is the second derivative of 2jt*3 + 896704jt2 + 10595jt + 48j + 2t wrt t? 12jt + 1793408j Find the third derivative of -901l6 + 3269l*3 + 2501l*2 - 10254l. -108120l3 + 19614 Find the second derivative of 4a*3n*2 - 42a*3n + a*2n - 8205a2 + 20286852an5 + 26n wrt n. 8a3 + 405737040an3 Find the second derivative of -386k*2n*3 - 20k*2n - 7073k2 - 338kn2 + 88n*3 wrt n. -2316k*2n - 676k + 528n Find the third derivative of -125701oq*3x*2 + 17oq3x - 6oq*2x*2 - 111ox - 4q*2x*2 + 6q*2 - 11q wrt q. -754206ox*2 + 102ox Find the second derivative of -108bi3 - 118bi2 - 10531bi - 77b - 24i2 wrt i. -648bi - 236b - 48 Differentiate 27409260iy*2 - 13i + 874708 wrt y. 54818520iy Find the third derivative of 4528y4 + 1212y*3 - 84992683y*2. 108672y + 7272 What is the third derivative of -9l3w3 - l3w + 2348l*3 + 226243161l*2w2 + w3 wrt l? -54w3 - 6w + 14088 What is the first derivative of -56838869w2 + 118880378? -113677738w Differentiate 5172390q4 - 25q*2 + 716373346 wrt q. 20689560q*3 - 50q What is the second derivative of -44029j2w*2 + 2j*2 - 51j - 9579w2 wrt j? -88058w*2 + 4 What is the third derivative of 27148v*6 - 3746v*3 - 74802v*2 + v - 63 wrt v? 3257760v*3 - 22476 Find the second derivative of -7a*2mn - 228a*2m - 33319a2n - 163amn + am - 2an - 6715mn + 94m wrt a. -14mn - 456m - 66638n What is the third derivative of -20hq3 + 28hq - 2h - 10q4 - 443q*3 - 5q*2 + 2704q wrt q? -120h - 240q - 2658 What is the third derivative of -7768174x3 + 11535131x*2 - x? -46609044 Find the third derivative of -3874018u*3 - 4926u*2 + 2u - 163. -23244108 Find the second derivative of -167323630g2m*2s*3 - 4967gm2s - 3gm*2 + 20gms*3 + 6m*2s3 - s3 wrt g. -334647260m2s*3 What is the third derivative of -50424h*6 - 81h*4 - 8157918h*2? -6050880h*3 - 1944h What is the first derivative of 14633003w - 6314372? 14633003 What is the derivative of 313b*3f - 67926b3 + 608bf + 30f wrt f? 313b3 + 608b + 30 What is the third derivative of -65452283z3 + 5z*2 - 2909z + 6? -392713698 What is the derivative of 65076236p2s*2 - 30661555p*2 wrt s? 130152472p*2s Find the third derivative of 463352r6 + 3612r*2 - 192r wrt r. 55602240r3 Differentiate 12439h*2z - 2h2 - 3hz2 - hz - 5506857z2 wrt h. 24878hz - 4h - 3z2 - z Find the third derivative of -46396976c*3q + 66c2q + 8427cq wrt c. -278381856q What is the third derivative of 204436940b*5 + 1402b*2 + 687b - 14? 12266216400b2 Differentiate 447l*2pz + 2l*2p + l*2 + 2lpz + 21234pz + 4512491p with respect to z. 447l*2p + 2lp + 21234p Differentiate 44122379u*3 + 2u*2 + 2u - 73361549. 132367137u2 + 4u + 2 What is the first derivative of 3143566y3 + 4649450? 9430698y*2 Find the third derivative of -45240545z*3 + 356240z*2 - 11z + 6 wrt z. -271443270 What is the third derivative of -777819n4 - n3 - 7629618n*2 wrt n? -18667656n - 6 Find the second derivative of -24152939g4 + 50423g + 123. -289835268g2 Find the second derivative of -546926s*4 + 29s*3 + 7525s + 6137. -6563112s2 + 174s What is the second derivative of -k*4 + 12343611k*2 + 132903179k - 1? -12k2 + 24687222 What is the third derivative of 25432c*2i*3m + 1330478c2i*2m2 - c2i2 - c2im3 - 20341i*3m*3 - 23i*2m*3 - 2m*3 wrt i? 152592c*2m - 122046m3 Differentiate -34336468r*2 + 366786202 with respect to r. -68672936r Find the third derivative of -15461277s6 - 2s*2 - 53s + 133003 wrt s. -1855353240s3 What is the derivative of -109i*4 - 1082i*3 - 2i + 5261252? -436i3 - 3246i*2 - 2 What is the second derivative of 213110585i*4 + 87i + 185163 wrt i? 2557327020i2 Differentiate 119635585hi - 197950979h with respect to i. 119635585h What is the derivative of 23j*2wx + j2x*2 - 3017726j*2x - 2jx*2 - 51698wx2 wrt w? 23j*2x - 51698x2 Find the third derivative of 17y*5 - 10y*4 - 10161y*3 - 71654y*2 + 585 wrt y. 1020y*2 - 240y - 60966 What is the first derivative of 2z2 + 6270473z + 8727176? 4z + 6270473 What is the second derivative of v4 + 12261v*3 + 1240589v + 2? 12v2 + 73566v Find the second derivative of -76619a4gh - 41a*2g*3h - 1510ag*3h - 3ag*3 + 4ag2h - 16ag - 3g3 + 2gh wrt a. -919428a*2gh - 82g*3h Differentiate 638z2 - 199621z + 178183833 with respect to z. 1276z - 199621 Differentiate -7565525w*2 - 17249807 wrt w. -15131050w What is the first derivative of 33588768a4 + 46694629 wrt a? 134355072a*3 Find the second derivative of -32cf2n*2 - 1055008cf2n + 3cfn2 + 8cf + 6cn2 - 37cn - 3fn2 - 25 wrt f. -64cn2 - 2110016cn What is the first derivative of -99529944l - 73106871 wrt l? -99529944 What is the second derivative of -314840t3 - 8t*2 - t + 2091068? -1889040t - 16 What is the second derivative of -3l5 + 74444l*4 + 19l*2 - 2607l + 36556 wrt l? -60l3 + 893328l*2 + 38 Find the third derivative of 11l*6 - 126045l*4 - 20548392l*2 wrt l. 1320l*3 - 3025080l What is the second derivative of -14122054h2 - 215512h + 50 wrt h? -28244108 What is the second derivative of 4686i3 - 812i*2 - 4953106i wrt i? 28116i - 1624 Find the second derivative of -198226316hn4y*3 - hny2 - 2ny3 + ny*2 - 3ny + 473604n wrt n. -2378715792hn*2y*3 Find the third derivative of -3461s5 + s4 + 4790s*3 -	{ "pile_set_name": "DM Mathematics" }
derivative of 9q2 - 2/3q*3 + 0q + 39. Let w(b) = 2b2. Determine x(w(m)). -8m*4 + 36m*2 Let m(a) = -183a. Let o(j) = 4760j2. Calculate m(o(w)). -871080w*2 Let n(p) = 2p*2. Let h(q) be the second derivative of 0 - 1/3q*3 + 0q*2 + 16q. Determine h(n(z)). -4z2 Let c(u) = -2u*2. Let y be (-2 - (-2 + 4)) + 4. Let d(r) = 2 + y - 2 - 2r. Give c(d(a)). -8a2 Let h(o) = 3o*2 + o + 1. Let u(y) = 24y*2 + 10y + 10. Let d(x) = 10h(x) - u(x). Let f(n) = 3n + 2n - 4n. Give f(d(m)). 6m2 Let l(t) = -6t + 16t - 2t - 4t. Let j(k) be the first derivative of -3k*2/2 + 3. Calculate j(l(x)). -12x Let b be 192/14 + 2/7. Let o(w) = -2w2 + 14 - b. Let t(z) = -4z*2. Determine o(t(v)). -32v*4 Let c(d) = -d. Let g(t) be the first derivative of -3t*2 + 0t2 - 20 + t2 - t*2. Give c(g(z)). 6z Let a = -4 + 7. Let x(f) = -3 + 0f - 2f + a. Let r(s) = -5s2. What is r(x(n))? -20n*2 Let t(c) = 2c*2. Let i(g) = 77g - 9. Let k(a) = -2a + 3. Let m(d) = i(d) + 3k(d). Determine t(m(r)). 10082r2 Let t(b) = 46b2. Let r(c) = c2 + 6c2 - 6c*2 - 4c*2. Give r(t(x)). -6348x*4 Let v(w) = -12w*2. Let n(h) = h - 7 + 8h - h. Let r(f) = f - 1. Let z(g) = -3n(g) + 21r(g). Give z(v(p)). 36p2 Let m(k) = 8k. Let z(s) = 10s + 10s + 5s - 2s + s. Give m(z(r)). 192r Let b(a) = -2a*2. Let p be (-2 - (-9 - 3)) + -10. Let d(v) be the second derivative of 0 + 1/6v*3 - 7v + pv2. What is d(b(r))? -2r*2 Let c(b) = -4b*2 - 11b. Let m(w) = 92w - 92w - 35w2 + 32w*2. Determine c(m(s)). -36s*4 + 33s2 Let b(o) = -o2. Let z(f) = 3f + 511. What is b(z(x))? -9x*2 - 3066x - 261121 Let i(r) = -2r2. Let t(x) = 45x*2 - 187x*2 + 76x*2 - 235x*2. What is t(i(n))? -1204n4 Let q(n) = -n. Let c(o) be the first derivative of -o3 + 89. Give c(q(l)). -3l2 Suppose -x = -4x + 51. Let w = -15 + x. Let a(u) = -2uw + 0u*2 + 5u*2 + 4u*2. Let h(g) = 2g*2. Calculate h(a(f)). 98f*4 Let x(t) = -16t2. Let a(p) be the second derivative of p4/12 - 15p2/2 + 2p. Let h(v) be the first derivative of a(v). Calculate x(h(d)). -64d2 Let q(i) be the third derivative of i5/20 + 17i2. Let n(s) = s2 - 3s - 3. Let a(r) = 4r + 4. Let o(w) = 3a(w) + 4n(w). Calculate q(o(x)). 48x4 Let n(i) = -366i. Let r(y) = -186y. Give r(n(o)). 68076o Suppose -29j + 16 = m - 25j, 0 = 4m - 4j + 16. Let i(b) be the third derivative of 11b2 + mb*3 + 0b + 0 - 1/6b4. Let n(s) = -4s*2. Give n(i(k)). -64k*2 Let f(r) = -12r*2. Let a(b) = -11149b. Determine f(a(u)). -1491602412u2 Let y(x) be the first derivative of -8x*3 - 6. Let m(d) = 10 - 10 - 2d*2. Determine y(m(a)). -96a*4 Let g(d) = -d. Let c be 1/4 + (-14)/(-8). Let h(m) = -2m*2 + 17m + 57. Let q be h(11). Let l(o) = -3o2 - 6o*q + 0o*2 - co*2. Determine g(l(y)). 11y*2 Suppose -b = -5g + 16, 1 = -g - b + 3. Let l(v) be the second derivative of 0vg + 0 - 1/12v*4 + 0v*2 + 6v. Let m(n) = n2. Determine m(l(s)). s4 Let q(c) = 7c2. Let o(m) = -6m - 234. Calculate q(o(f)). 252f2 + 19656f + 383292 Let d(h) = -2h + 11611 - 11611. Let y(i) be the first derivative of -i - 3 - 2i - 4i3 + 3i. Determine d(y(l)). 24l2 Let l(y) be the third derivative of y5/20 + 2y*2 - 8. Let c(r) = -21r - 3. Give c(l(s)). -63s2 - 3 Let i(x) = -x2. Let w(u) be the third derivative of u4/12 - 13u*3/6 + 8u*2. Let z be w(8). Let c(d) = -11d + d - zd + d. Give c(i(n)). 12n*2 Let r(h) = -6h - 1. Let z(i) = -5i2 + 33i*2 - 12i*2 - 18i*2. Determine z(r(j)). -72j*2 - 24j - 2 Suppose 3d - 20 = 5d. Let r(l) = -12l - 10. Let m(f) = -f - 1. Let w(q) = dm(q) + r(q). Let c(b) = -49b. Give w(c(h)). 98h Suppose 5o + 4l = 24, -5o + 6l - 2l + 56 = 0. Let b(t) = -ot + 1 - 1. Let d(j) = -3j + 5j - 2j + j. Give d(b(i)). -8i Let l(s) = -2s. Let k(n) = 3512432n + 2. Calculate k(l(j)). -7024864j + 2 Let r be 7/35 - (-48)/10. Let v(j) be the first derivative of 1/2j*2 + 0j - r. Let x(m) = -2m2. What is v(x(b))? -2b*2 Let i(s) = -2s + 19. Let w be i(8). Let k(v) = -7v2 - 3v - 3. Let t(m) = 8m2 + 2m + 2. Let q(o) = wt(o) + 2k(o). Let h(n) = -n*2. What is h(q(u))? -100u*4 Let y(n) = 7n*2. Let a(m) = -11m*2 + 5. Let p(h) = 6h*2 - 3. Let x(r) = -3a(r) - 5p(r). Determine y(x(d)). 63d4 Let y be (4/(-7))/(-1) - 10/(-7). Let l(o) = o2 + 11 - 6oy - 11. Let r(c) be the second derivative of -c4/6 + c. Calculate r(l(s)). -50s*4 Let d(x) = -8x*2 - 3x*2 - 3x + 20x + 21 - 4. Let j(q) = -4q*2 + 6q + 6. Let o(p) = -6d(p) + 17j(p). Let z(b) = 6b2. Calculate z(o(s)). 24s*4 Let s(p) = -2p + 6. Let k(o) = -6o + 28. Let r(j) = -3k(j) + 14s(j). Let z(v) = 11v. Give r(z(i)). -110i Let x(h) = -5h. Suppose 4v = 2f + 301 - 297, f = -v + 4. Let r(m) be the third derivative of -1/24m4 + 13m*f + 0m + 0 + 0m3. Give x(r(j)). 5j Let v(k) = 91k + 6. Let a(l) = -36l. Determine v(a(h)). -3276h + 6 Let c(i) = i + 0i + 0i. Suppose 7 = -6s - 5. Let d(a) = -10a2 + 2a. Let x(v) = v*2 - v. Let t(h) = sx(h) - d(h). Give t(c(b)). 8b2 Let m(t) = 309t*2 + 305t*2 - 635t*2. Let z(c) = 43c. Determine m(z(k)). -38829k2 Let q(p) = 1711p. Let f(t) = -8t. Determine f(q(l)). -13688l Let x(g) be the third derivative of g*5/12 + 52g*2. Let p(h) = h + 8h - 6h. Determine p(x(z)). 15z*2 Let a(c) be the first derivative of 124c*3/3 - 753. Let v(b) = 5b*2. Give a(v(o)). 3100o*4 Let c(h) = 2h. Let y(g) = -3g2 + 2g - 74. What is y(c(r))? -12r2 + 4r - 74 Let b(s) be the third derivative of -3s4/2 - 13s*2 + 3s. Let w(t) be the first derivative of -t*3/3 - 1. What is w(b(f))? -1296f*2 Let k(u) = 31u - 1 - 12u + 1. Let l = 8 - 0. Let j(d) = -6d*2 - 5d*2 + 21d*2 - ld*2. Calculate k(j(y)). 38y*2 Let f(h) = -3h + 496h2 + 5h - 497h2. Let g(o) = -o. Let c(d) = f(d) + 2g(d). Let l(j) = -3j. Give l(c(m)). 3m*2 Let s be (0 - -3)(2 + -1). Suppose 0 = -h + sh - 4. Let d(f) = hf + 3 - 4 + 1. Let m(n) = -3n2. What is d(m(o))? -6o*2 Let n(d) = 139d. Let j(s) = 470s2 - 14. What is j(n(w))? 9080870w2 - 14 Let q(i) be the second derivative of i3/2 - 116i + 2. Let b(s) = -252s. What is q(b(r))? -756r Let u(c) be the third derivative of -7c*4/24 - 89c*2. Let t(g) = 4g*2. Calculate t(u(x)). 196x*2 Let i(p) = 2p*2. Let h(y) = -3190y*2. Determine i(h(t)). 20352200t*4 Let c(k) = 10k2. Let a(v) be the third derivative of v7/1260 - 3v4/8 - 8v*2. Let y(j) be the second derivative of a(j). Determine y(c(i)). 200i*4 Let h be 0/(13(-1)/(-13)). Let s(j) be the third derivative of 4j2 + 0j*3 + 1/3j*5 + hj*4 + 0j + 0. Let w(k) = 2k. Determine w(s(v)). 40v*2 Let p(v) = 41v*2. Let i(q) = 156q + 2. Calculate i(p(o)). 6396o2 + 2 Let p(c) = -26c*2. Let d(m) = 31103m. Determine d(p(w)). -808678w2 Let f(u) = 250539u. Let y(j) = -2j. Calculate f(y(m)). -501078m Let g(i) = -2i + 2i + 2 - 29i2 + 87i*2. Let j(k) = -k - 6. Let o(t) = -t - 4. Let y(f) = 2j(f) - 3o(f). What is g(y(p))? 58p*2 + 2 Let h be ((15/5)/12)/((-2)/(-16)). Let g(f) = 8f*2 + 24f*h - 33f*2. Let k(l) = 63l*2. Calculate k(g(m)). 63m*4 Let k(w) be the second derivative of -1/30w*5 - 7/2w*2 + 0w*3 + 0w*4 - 5w + 0. Let t(b) be the first derivative of k(b). Let x(c) = 4c. Give t(x(s)). -32s*2 Let q(g) = 101g - 1. Let f(c) = 831c2 + 3c - 2. Calculate q(f(u)). 83931u2 + 303u - 203 Let a(j) = 2j. Let t(v) = -2v - 9. Let d be t(-5). Let c(b) = -154b + 153b - 1 + d. Calculate a(c(o)). -2o Let i(b) be the first derivative of -4 + 0b + 3/2b2. Let f(z) be the third derivative of z4/4 + 27z*2. What is i(f(o))? 18o Let c(h) = -40h2. Let q(p) = 10733p. What is c(q(u))? -4607891560u2 Let i(x) = 4x. Let y(z) be the second derivative of -z*4/4 + 2z + 49. Determine i(y(f)). -12f2 Let s(u) = u2. Let y(j) = 4j - 22. Determine y(s(i)). 4i2 - 22 Let l(h) = -14h. Let c(p) = 3p - 4. Let x(v) = v - 1. Let j(z) = -c(z) + 4x(z). Let s(b) = 10j(b) + l(b). Let a(q) = 4q. Calculate a(s(i)). -16*i Let m be (-7)/(-4) - (-11)	{ "pile_set_name": "DM Mathematics" }
rt b. -651325x3 What is the first derivative of -1640o + 8012 wrt o? -1640 What is the third derivative of 485a3l*3q + 2a3 + 2a*2l*2 - 2a*2q - al2q - 678aq - 55l3 wrt l? 2910a*3q - 330 Differentiate 12coy + 2co + 22217cy + 5c - 156oy + 16o + y - 1 wrt o. 12cy + 2c - 156y + 16 Find the first derivative of 1866fr + 15f + 11ru*2 + 136u*2 wrt r. 1866f + 11u2 What is the first derivative of -125072p*2 + 133801 wrt p? -250144p Find the second derivative of -348264a3u*3 + 11311a*3 - 4au3 + 10u wrt u. -2089584a3u - 24au Find the third derivative of -180583a5 + 1050310a*2. -10834980a*2 Find the third derivative of -5ns3 + 64ns - 385n - 59s5 + s2 wrt s. -30n - 3540s2 Find the second derivative of 225746o*2 - 9256o + 1. 451492 Find the first derivative of fm3 - 10f + 25191m3 + 1486 wrt m. 3fm2 + 75573m*2 Find the second derivative of 55665cu3 - 3cu + 7c - 2u5 - 35837u wrt u. 333990cu - 40u3 Find the second derivative of -513767i*3 + 1604926i wrt i. -3082602i Differentiate -42c*2f - 9c2 + 80c + 126f + 6575 wrt c. -84cf - 18c + 80 What is the third derivative of 398622t6 + 3t*2 + 83t - 208? 47834640t3 What is the third derivative of -47675a*3b + 232a2 + 107b - 2 wrt a? -286050b Find the first derivative of -26h*3k*2 + 7h*3x - 7k3x - 2080k3 + 531x wrt x. 7h3 - 7k*3 + 531 Find the first derivative of -900f*3 + 15f*2 + f - 60335. -2700f*2 + 30f + 1 Find the third derivative of -467f4 - 29f*3 + 2343f*2 + 6f. -11208f - 174 Differentiate 978a*4 + 4a*3 - 5a - 1875212 with respect to a. 3912a3 + 12a*2 - 5 Find the third derivative of -12x*3y*2 + 2x*3y + 2683x3 - 14x*2 + 1914y*2 wrt x. -72y*2 + 12y + 16098 Differentiate -nt2 + 2nt - n + t2 - 31808t + 93856 wrt t. -2nt + 2n + 2t - 31808 What is the third derivative of 2d3s*3 + 20307d*3su + 56d*2s*3 + 30d*2s*2 + 2d*2su - 2d*2 - 2s*2u wrt d? 12s3 + 121842su What is the second derivative of -7g*3j - 122974g3 - 12gj - 846g + 2j - 13 wrt g? -42gj - 737844g What is the second derivative of 16b2mz2 + 2b*2mz + 91731b*2m - 61bmz2 + b - 47z*2 wrt z? 32b*2m - 122bm - 94 Find the third derivative of 51212y4 - 46913y*2. 1229088y Find the second derivative of 295f5t - 118f4t + 457ft + 37t - 1 wrt f. 5900f*3t - 1416f2t What is the second derivative of -59h5 - 27h*4 - 4340h + 2? -1180h3 - 324h*2 Find the second derivative of -215o*4 + 4632o*2 + 2328o + 11. -2580o2 + 9264 Differentiate 165s*2 - 79sy + 901884y with respect to s. 330s - 79y Differentiate -z*4 + 370z*3 + 20z*2 - z + 685103 wrt z. -4z*3 + 1110z*2 + 40z - 1 Differentiate 41901m3 - m2 - 5m + 132535 with respect to m. 125703m2 - 2m - 5 What is the first derivative of 2hz*2 - 28081h - 127z4 + 2z*2 wrt z? 4hz - 508z*3 + 4z Find the third derivative of -3dow3 - 2dow*2 - 107do - 2dw3 - 2dw2 + 33dw - 139ow3 + 6ow2 + 65w*3 wrt w. -18do - 12d - 834o + 390 Find the third derivative of 6893v*6 - 4v4 + v2 + 24v wrt v. 827160v*3 - 96v What is the first derivative of 14dgy3 + 7401dgy*2 + 4116dy3 + 3dy + 30y*3 - y wrt g? 14dy3 + 7401dy2 What is the second derivative of -187486z*3 - 2z - 27189 wrt z? -1124916z Find the second derivative of 3520516o*2v - 92ov - 15o + 536v wrt o. 7041032v What is the third derivative of -2128n*3u*2 - 174n*3u - 2n3 - 1416n*2u*2 + 4n*2u - u*2 - u - 20 wrt n? -12768u*2 - 1044u - 12 Find the third derivative of r*6 + 377303r*5 - 61r*2 + 2473 wrt r. 120r*3 + 22638180r*2 Find the first derivative of -583359jw2 - 83941w*2 + 1 wrt j. -583359w*2 What is the third derivative of 23y*6 + 9y*5 + 4y*4 + 36713y*2? 2760y*3 + 540y*2 + 96y Find the third derivative of 32955o3q + o*3 - 301653o*2 - q wrt o. 197730q + 6 What is the third derivative of 500p3s*3 + 8p*3s - 3p2s - 38p2 + 4ps + s3 wrt p? 3000s*3 + 48s Find the third derivative of 1641828b3 - 504964b*2. 9850968 What is the third derivative of -7222x*3 + 90984x*2? -43332 What is the second derivative of -256155h*2 + 26738h? -512310 Find the third derivative of -17799z3 - 14936z*2 - 1 wrt z. -106794 What is the third derivative of -106347x*4 + 346x*2 - 2x? -2552328x Find the first derivative of -6gk3 - 747gk - 193584g - 19k4 wrt k. -18gk2 - 747g - 76k3 Differentiate -5z*3 - 2z*2 - 3289z - 28598 with respect to z. -15z2 - 4z - 3289 What is the derivative of -118u3w + 2u3 - 449u*2w + 2771u2 + 3 wrt w? -118u*3 - 449u*2 Differentiate -222jkrt + jkt2 + 2kr - 961rt2 with respect to j. -222krt + kt2 Find the third derivative of -986093c*3 + 162535c*2 - c + 1 wrt c. -5916558 What is the second derivative of 7342ab3i - 2ab*3 + 2abi + ab + 3ai + 3b*3 + 5b + 206i wrt b? 44052abi - 12ab + 18b What is the second derivative of -420574r*2 - 30913r + 6 wrt r? -841148 Find the third derivative of 396496j3 - 322600j*2. 2378976 What is the third derivative of -123466cv6 + 8cv2 - 1990c - 3v2 + 5v wrt v? -14815920cv*3 Differentiate -205477w - 101886 with respect to w. -205477 Find the third derivative of 455367a3m - 8a2m - 713a2 - 38m wrt a. 2732202m Differentiate 11l*2o*2 - 1572l*2 + 30711o*2 + 2o with respect to l. 22lo*2 - 3144l Find the second derivative of 24691t5 + 2t*4 - 131158t. 493820t3 + 24t*2 What is the derivative of -62r*2 + 496r - 113426 wrt r? -124r + 496 Find the first derivative of 19766d + 76555 wrt d. 19766 What is the derivative of 245647o2 + 598401? 491294o What is the derivative of 96m2 + 2433m + 316036? 192m + 2433 What is the third derivative of -54162o*4 + 2o*3 + 39o*2 - 907o wrt o? -1299888o + 12 Differentiate g3q*3 + 316g*3 - 2532g*2q*3 - 24 with respect to q. 3g*3q*2 - 7596g*2q*2 What is the second derivative of -39b*5 - 27b4 - b3 + 15b - 1404? -780b*3 - 324b*2 - 6b Differentiate -30224d4 - 6646. -120896d*3 What is the second derivative of -27x*3y - 3x2y*3 + 267x*2y*2 + 941xy3 - x - 46y*2 wrt x? -162xy - 6y*3 + 534y*2 Find the second derivative of -3408068y*2 + 1846704y. -6816136 What is the derivative of 1811b4 - 4b*3 - 3b*2 + b - 2416058 wrt b? 7244b*3 - 12b*2 - 6b + 1 Find the second derivative of 10d3u4 - d3u - 327d*3 + 2d*2u + 850u4 - 7u wrt u. 120d3u*2 + 10200u*2 Find the third derivative of 21v*6 + 260v3 + v2 - 31v - 1. 2520v*3 + 1560 What is the third derivative of -41m*3t*2v*3 - 16m*3t*2 + 21450m*3v3 + m3v2 + 2mtv*2 - mtv + 4t*2 wrt v? -246m*3t*2 + 128700m3 Differentiate -g2l - 2g*2 - gl*2 - 113g + 456l2 - 5 with respect to l. -g2 - 2gl + 912l Differentiate 107946p + 4707 with respect to p. 107946 What is the second derivative of 2232cf3 + cf*2 - cf + 507709c + 3f3 - f2 wrt f? 13392cf + 2c + 18f - 2 Find the third derivative of -11c2z*6 - 5c*2z*2 - 84iz6 + 2iz2 - i - 119z*2 wrt z. -1320c*2z*3 - 10080iz3 What is the third derivative of -8p*4 + 2815p3 + p2 - 9p + 35844 wrt p? -192p + 16890 Find the second derivative of 16482i2 - 80i - 503 wrt i. 32964 What is the second derivative of -13207c2m*2 - 3c*2m + 323c2 + cm*2 + 4cm wrt m? -26414c*2 + 2c Find the first derivative of jq - 12258j + 14534q + 1 wrt j. q - 12258 What is the third derivative of -708414a*3 + 14a*2 + 189a - 93? -4250484 What is the first derivative of 641k3l*2 + 10139k*3 + 5kl2 wrt l? 1282k*3l + 10kl What is the second derivative of 6d2u*2 - 28d*2u - d*2 - 1379du4 - 3u - 2 wrt u? 12d2 - 16548du2 What is the second derivative of -97b*3 + 67b*2 - 8602b? -582b + 134 Differentiate 1372155j**3 - 644532. 41164	{ "pile_set_name": "DM Mathematics" }
? False Is 25 a factor of 4368772? False Does 519 divide 792147624? True Does 10 divide 46482060? True Is 995 a factor of 131391740? True Is 323 a factor of 50045297? True Is 3535 a factor of 732947382? False Is 633 a factor of 2338417405? False Does 154 divide 337374422? True Is 88065209 a multiple of 15? False Does 83 divide 147999956? True Is 15 a factor of 37241580? True Does 23 divide 86144614? True Is 30151385 a multiple of 43? True Is 5 a factor of 235958240? True Does 57 divide 38023800? False Is 149746476 a multiple of 4? True Is 2205348658 a multiple of 446? False Is 99 a factor of 190395513? True Does 88 divide 21073487? False Is 22 a factor of 3333395? False Does 4 divide 189590443? False Is 6856389375 a multiple of 121? True Does 1561 divide 34727567? True Does 11128 divide 202916096? False Is 28488177 a multiple of 1179? True Is 120 a factor of 24188040? True Does 392 divide 48627600? True Is 159 a factor of 2376704652? True Does 90 divide 10860534? False Is 148317 a multiple of 39? True Is 315 a factor of 30860899? False Does 4324 divide 865370829? False Does 399 divide 63925386? True Is 20328245 a multiple of 8? False Is 16 a factor of 440378382? False Is 576770080 a multiple of 437? True Does 34 divide 167387795? False Does 2139 divide 213326748? True Is 621588271 a multiple of 95? False Is 2570 a factor of 145410600? True Does 17 divide 13893007? False Is 43 a factor of 55765351? False Is 671622098 a multiple of 7? True Does 143 divide 15697570? False Is 65029500 a multiple of 100? True Is 85446387 a multiple of 9? True Is 10 a factor of 1092168120? True Does 203 divide 11185503? True Is 162873653 a multiple of 80? False Is 956 a factor of 5364815792? True Does 2000 divide 1854062386? False Is 369421294 a multiple of 38? True Is 6506940 a multiple of 22? True Does 208 divide 2100670804? False Does 2894 divide 1755335442? True Is 11422601 a multiple of 707? False Is 1288290860 a multiple of 146? True Is 150650183 a multiple of 155? False Does 195 divide 39726983? False Does 121 divide 6290548? True Is 275426850 a multiple of 2850? True Is 5994020524 a multiple of 29? False Is 16 a factor of 753635407? False Is 9 a factor of 686943170? False Is 6219176 a multiple of 808? True Is 11 a factor of 74562212? False Is 310 a factor of 1510543820? True Is 294259684 a multiple of 4? True Is 48542160 a multiple of 30? True Does 93 divide 62459927? False Is 8 a factor of 227438048? True Is 9377819 a multiple of 2? False Does 66 divide 66186450? True Is 233582054 a multiple of 77? False Is 2549383452 a multiple of 126? True Is 75 a factor of 30266400? True Is 12359510 a multiple of 5? True Is 32735162 a multiple of 358? True Is 2200165 a multiple of 3? False Is 83 a factor of 4564751? True Does 9 divide 329858163? True Does 5 divide 47766345? True Is 114853339 a multiple of 25? False Is 95694727 a multiple of 499? True Is 11410812 a multiple of 449? False Does 871 divide 288834099? False Is 2643498 a multiple of 858? True Is 344 a factor of 351175840? True Is 185 a factor of 590606950? True Does 2 divide 37297118? True Does 10 divide 27529050? True Is 98 a factor of 110614047? False Is 254818200 a multiple of 2366? True Is 417158646 a multiple of 323? False Is 2488745 a multiple of 26? False Is 1081 a factor of 2558548635? True Is 25841628 a multiple of 1226? True Is 22 a factor of 492894182? True Does 1357 divide 159032458? False Is 1172 a factor of 16320728? False Does 35 divide 946293215? True Does 232 divide 16123821? False Is 490 a factor of 1084852160? True Is 226070360 a multiple of 901? False Does 52 divide 23040212? True Is 124 a factor of 68440505? False Is 551 a factor of 302742839? False Is 1526017158 a multiple of 3141? True Does 31 divide 822864? True Is 5319583 a multiple of 748? False Is 870905010 a multiple of 310? True Is 1531762350 a multiple of 25? True Does 184 divide 14367456? True Does 2241 divide 5543073289? False Is 4977613 a multiple of 19? False Does 3160 divide 701908680? True Does 348 divide 100291146? False Is 1224670655 a multiple of 2015? True Is 144510741 a multiple of 31? False Does 956 divide 1367950815? False Does 6 divide 35424726? True Does 9 divide 1277521668? True Does 13 divide 4129085347? False Is 117894731 a multiple of 17? False Is 2230131164 a multiple of 823? False Does 24 divide 998591352? True Is 3751 a factor of 187693154? False Is 17 a factor of 116784866? True Is 16 a factor of 59781408? True Does 64 divide 158392960? True Does 56 divide 906837736? True Does 151 divide 139166281? True Is 553201185 a multiple of 485? True Is 292 a factor of 21237859? False Does 2069 divide 1818651? True Is 8408870 a multiple of 31? False Is 127 a factor of 571977647? True Is 19 a factor of 424177698? True Is 17165924 a multiple of 6? False Does 12 divide 873275772? True Is 26 a factor of 2715707505? False Is 2252 a factor of 707330680? True Is 1324653958 a multiple of 3053? True Does 23 divide 630379719? False Does 528 divide 49559664? True Does 212 divide 10365700? False Does 1530 divide 371465640? True Does 7 divide 3844034? False Is 26142036 a multiple of 4? True Is 980366712 a multiple of 19? True Is 433 a factor of 28801562? False Is 2805141 a multiple of 805? False Does 79 divide 456886191? False Is 2060685440 a multiple of 110? True Is 10 a factor of 5601940? True Is 2 a factor of 651058? True Does 1210 divide 47600190? True Does 42 divide 32842820? False Is 5425490889 a multiple of 2457? True Does 13 divide 10335819? True Does 16 divide 107900464? True Is 115512769 a multiple of 541? False Is 3 a factor of 76510422? True Is 3326639932 a multiple of 7? True Does 40 divide 904453240? True Does 13 divide 5618637? False Is 360155986 a multiple of 137? False Is 2866462560 a multiple of 31? False Is 46 a factor of 5679758? True Is 46 a factor of 24763502? True Is 3 a factor of 23419347? True Is 13 a factor of 74608735? False Does 1531 divide 5465458350? False Is 88 a factor of 861890079? False Is 9029467 a multiple of 137? False Is 102516798 a multiple of 174? True Is 193834698 a multiple of 366? True Is 473118660 a multiple of 801? True Does 952 divide 9020200? True Is 7356192 a multiple of 327? True Is 6 a factor of 30315882? True Does 2628 divide 2289809904? False Is 260780389 a multiple of 34? False Does 229 divide 30151719? False Is 390699576 a multiple of 18? True Does 22 divide 34058838? True Is 956 a factor of 99771028? True Does 4 divide 130098167? False Is 8083902 a multiple of 138? True Is 59854681 a multiple of 4998? False Does 4615 divide 227044155? True Is 504 a factor of 130558013? False Is 1613 a factor of 10282875? True Is 105183743 a multiple of 119? True Is 2954 a factor of 24028104? False Does 38 divide 8930114? True Is 63 a factor of 834995322? True Does 323 divide 30519576? False Is 155 a factor of 1125145775? True Does 3 divide 121015308? True Does 6404 divide 517565164? False Is 1751703 a multiple of 53? True Is 7 a factor of 3171896? True Is 440819928 a multiple of 139? False Is 567628722 a multiple of 54? True Does 639 divide 466469576? False Is 26 a factor of 776311874? True Does 539 divide 212368695? True Is 7066786 a multiple of 6? False Is 462958700 a multiple of 50? True Is 20188293 a multiple of 2? False Does 2372 divide 391759520? True Does 11 divide 38946787? True Is 243269735 a multiple of 191? False Is 265677717 a multiple of 10? False Is 36216060 a multiple of 60? True Is 86 a factor of 208901701? False Is 29475955 a multiple of 15? False Is 19439095 a multiple of 17? False Is 656488216 a multiple of 103? True Is 37654248 a multiple of 20? False Does 73 divide 10957918? False Is 1132 a factor of 24985148? False Is 816 a factor of 244898736? True Is 49889686 a multiple of 406? True Does 5457 divide 354246711? False Is 278375857 a multiple of 258? False Does 24 divide 6786624? True Does 1851 divide 655972490? False Does 219 divide 584239002? True Does 21 divide 6410759066? False Does 254 divide 871349794? True Is 229835356 a multiple of 755? False Does 641 divide 111234087? False Does 22 divide 5414728? True Is 3909 a factor of 286499137? False Is 978 a factor of 24256257? False Is 60 a factor of 75171960? True Is 408 a factor of 617465157? False Is 121 a factor of	{ "pile_set_name": "DM Mathematics" }
i))/i assuming i is positive. i(515/7) Simplify ((u(-1)uu)(-17/4)(u/(u/u1))/u(1/19))(2/7) assuming u is positive. u(-251/266) Simplify ((oo/(oooooo*(-27))o)/o5)(1/30) assuming o is positive. o(2/3) Simplify ((p(-4)/((((pp/(p/p(-1/6)))/pp)/pp)/p))(1/14))(-26) assuming p is positive. p(299/42) Simplify ss*(-1/3)s*1s*(4/3)ss(-17/2) assuming s is positive. s(-9/2) Simplify (f11f)*(-38)f(-4/11)/(f/f(-20/3)) assuming f is positive. f(-15313/33) Simplify (((f/(f/f14))/ff)/f(2/37))/(ff/(f/f*3)f*(-15)f) assuming f is positive. f*(886/37) Simplify (kkk(1/12)k)*(-26)k6/(k/(k/(k/(k/k(-4/5))))) assuming k is positive. k*(-2201/30) Simplify (t/((tt5)/t))(3/11)(t(t/(t/(tt(2/3))))/t)3 assuming t is positive. t(43/11) Simplify (uuu(-4)/uu)(-31)/(((u12/u)/u)/(u/(u/(uu(-4/11))))) assuming u is positive. u(579/11) Simplify (b(-2/9)/bb*(-3)/b)/(bb*(3/2)b(-3/5)) assuming b is positive. b(-641/90) Simplify ((((o*2o)/o)(-21))(-2/15))(-15) assuming o is positive. o(-84) Simplify (q(-4/9))(-1)/((qq(-15)/q)/q)(6/7) assuming q is positive. q(892/63) Simplify (v/(vv8))/(v12vv)v7vv(-2/17) assuming v is positive. v(-240/17) Simplify (s0)(1/36)/(s/s(-7)s/(ss/((s(1/6)/s)/s))s) assuming s is positive. s*(-37/6) Simplify ((ffff(2/25))/f)(-6/25)/(f*(-21)/ff2) assuming f is positive. f(12188/625) Simplify (ss(-15))(45/4)(ss10s)(-33) assuming s is positive. s(-1107/2) Simplify ((p*(-6)/pppp(-4))/(p/(p/p1p)pp(-1)))(-7/4) assuming p is positive. p(63/4) Simplify (m(2/5)/mm)(1/27)/(m1)(-2/19) assuming m is positive. m(308/2565) Simplify (zz(-1))(-9)/(zz(10/3))(-8) assuming z is positive. z(104/3) Simplify (k(2/89)/(k/k(-19/6)))/(k/(k(-40)k)kkk(-4/11)) assuming k is positive. k(-268915/5874) Simplify dd(1/3)dd(5/3)/d(ddd*(-3)d)(15/7) assuming d is positive. d3 Simplify (b*0/bb)2/(b(-2/5))(1/10) assuming b is positive. b(1/25) Simplify ((i/(ii(-12)))/i)/i(-1/15)(ii(2/7))(-47) assuming i is positive. i(-5183/105) Simplify (z(-8/11)z/z*(-2/25))/((zz(-8/7))/z(1/35)) assuming z is positive. z(1009/1925) Simplify (k(-4/3))(-2/31)/((k/(k(1/10)k))/(k(kk/(k(-5/6)/k))/k)) assuming k is positive. k(623/155) Simplify (i/i(1/19)(i(-1/4)/i)/i)(-7/2) assuming i is positive. i(693/152) Simplify ((p(-4/3)pp*(1/7)p)/(p/(pp0))(-20/7))(2/41) assuming p is positive. p(34/861) Simplify ((z1/z)(8/7)(z*(-1)z)37)(-2/103) assuming z is positive. 1 Simplify f12/(f/(f6f))f((f4/f)/fff)/fff/(f/(f/((f(f/f*2)/f)/f)f))f assuming f is positive. f28 Simplify (t(1/2)/t(-19))/(t/t(-3/8)t(-22)) assuming t is positive. t(321/8) Simplify (h(-30/11)/(h(6/7)h))/(hhh22)(-3) assuming h is positive. h(5191/77) Simplify (vv(v(-18/7)/v)/v(vv39)/v)(-5) assuming v is positive. v(-1275/7) Simplify (v/(v/(v/(v(-5)/v))))(-2/179)v*(-18/7)v5 assuming v is positive. v(2945/1253) Simplify (((rr7/r)/r(-3))(2/105))(1/15) assuming r is positive. r(4/315) Simplify ((((ll*(2/15)ll)/l)(1/6))30)39 assuming l is positive. l416 Simplify t(21/5)tt/(t/(tt*27))tt/(tt*(-2/5)t)tt/(ttt*(-32)t) assuming t is positive. t*(323/5) Simplify ((ss*(-4/3))/(ss(-6/17)))/((s(-1/5)/s)/(ss(-10)/s)) assuming s is positive. s(-2494/255) Simplify ((p(-3)p)/pp)(-22/9)/(p/(pppp*(-2/27))pp/(p(-10/7)/pp)p) assuming p is positive. p(451/189) Simplify ((a(-2/11)/(aaa(-1/2)))/(a(-2/9)/a(-1)))(-4/7) assuming a is positive. a(974/693) Simplify i/(ii/i*(-3/10))ii11i(i(3/2))(-2) assuming i is positive. i(87/10) Simplify (kk(2/15))/(k(5/8)/k)(k(1/19)/k)(-44) assuming k is positive. k(98479/2280) Simplify ((y(-3)/y)/y3(yy1)(11/3))(-45) assuming y is positive. y(-15) Simplify (a/((a/(aa*(-2/9))aaa)/aa))/(a/(aa*(-1/16)a))(a(1/12))(1/11) assuming a is positive. a(-2023/1584) Simplify (c1/c)(-27/7)/(cc*(-14/9)c(cc(-17))/c) assuming c is positive. c(149/9) Simplify (y(-22)/(y23y))/(y(1/40)(y/(yy/y(-1/6)))/y) assuming y is positive. y(-5263/120) Simplify (r/(r/(r/(r/(r(rr((((r*(2/17)r)/rr)/r)/r)/r)/r))))rr/r(-7))/(r(1/20)/rr/(rr(-1/6))) assuming r is positive. r(10099/1020) Simplify (((a((a*3a)/a)/a)/(aa(-3)/a))/(a(-2)/a)(-2/13))(-4/5) assuming a is positive. a(-288/65) Simplify (zz*(-1/7)z)(-49)/(z/(z(-10)/z))19 assuming z is positive. z(-319) Simplify (g3/(g/(g(8/5)gg)))/(g*(6/5)(gg(-6/7)/g)/g) assuming g is positive. g(219/35) Simplify ((z/z(1/5)z)/(zzzz(-6)))/(z(-2/7)/z)(-34) assuming z is positive. z(-1362/35) Simplify qq*(1/17)q*(7/2)(qq(-34))/q7 assuming q is positive. q(-1205/34) Simplify (z(-1/2)z/((zzz/z*17z)/z)z)/(z(-10/7))0 assuming z is positive. z(31/2) Simplify q(-3)qq(6/5)qq(q(qqq/(q/(q(2/13)q)))/q)/qqq/(q*(-9/2)q) assuming q is positive. q(1151/130) Simplify (c/(c/(c(-3/13)/c)))/(c*13c)c(6/17)c/((cc/c0)/c)c assuming c is positive. c(-3067/221) Simplify ((o/(o(-1)o))(-4/5)/(o(-2/11)/o(-5)))50 assuming o is positive. o(-3090/11) Simplify (t(-4/9)t)*(2/67)/(tt*(-3)((t/(t/t*(-17)))/t)/tt) assuming t is positive. t*(12070/603) Simplify ((g/(((g/(g/(g/(gg*(-4)g)g))g)/g)/gg)gg6)(-2/21))38 assuming g is positive. g(-304/21) Simplify (x1x)*40/(xx/((x*(-2)x)/x))35 assuming x is positive. x(-60) Simplify k/k*17k*(-15)(k/k*(-24))/(kk(3/4)) assuming k is positive. k(-31/4) Simplify ((b(9/5)/b)(-7))(-21/8) assuming b is positive. b(147/10) Simplify (v7)(-49)v(-9)vvvvv27 assuming v is positive. v(-321) Simplify ((z*(1/42)/z)/(zz29))(-5/3) assuming z is positive. z(6505/126) Simplify (o(-4))*(-5/2)/(o(o/(o*7/o))/oo)(-4/11) assuming o is positive. o(94/11) Simplify ((vvv/v*5v)/(v/(vv5))(v3/v)/v(-8))(-22) assuming v is positive. v(-308) Simplify t*(-22)tt(20/3)(tt(-1))/(ttt(2/13)/t) assuming t is positive. t(-604/39) Simplify q/(qqq/(q18qq))qq(3/4)(qq/(qq(2/5)))/q(1/9) assuming q is positive. q(3643/180) Simplify ((j(-5)/(jj10j))(1/22))48 assuming j is positive. j(-408/11) Simplify (u/u(-1))(-1/35)/(((u/(u/u(-9)))/u)/(u/(u/u*(-1/2))u)) assuming u is positive. u(731/70) Simplify (u/u(-19)u(-4/3))0 assuming u is positive. 1 Simplify (d17d(-1/3)/d)(-5/11) assuming d is positive. d(-235/33) Simplify (z(-2/61))*(-30/7)z/(zz(2/31))zzzzzz/(((z/z(6/11))/z)/z)zzz assuming z is positive. z*(1546558/145607) Simplify ((aa/(a/a*13)a)/(a*(2/19)a))/((a*(-1)/a)/aaa/(a/(a/(a(a*(-2/41)a)/aaa)))aa) assuming a is positive. a*(12344/779) Simplify (xx/x(8/11))/x22x(-2/37)x10/x assuming x is positive. x(-4795/407) Simplify (tt/t10t)/(t*(4/3)/t)t*1t/t*1t assuming t is positive. t(-16/3) Simplify ((z/z17)/z8)/(((z/(z(-23)zz))/z)/(z*(-3)/zz)) assuming z is positive. z(-48) Simplify (p(2/9)p/p(-16))/((pp*9p)/(p/(p(p/(ppp(2/5)p))/p))) assuming p is positive. p(433/45) Simplify (((r/r5)/r)/rr/r(-1/5)(r/(rr/(r((r/r*(1/3)r)/r)/r)))/(r*(-2)/rr))(-1/5) assuming r is positive. r(47/75) Simplify ((g*(-2/29)/(gg/g(4/5)))/(g(-1/9)g(1/4)))47 assuming g is positive. g(-345403/5220) Simplify (x/(x(-3/13)x)xx)*9(x(-7)/x)(-43) assuming x is positive. x*(4733/13) Simplify (d(dd(2/17)d)/ddd/(d*(6/5)/d))/(dd*(2/11)dd/(d/d(-9))) assuming d is positive. d(10038/935) Simplify (gg(-4/5))17(gg/(gg(-1/18)))/(gg*(3/8)/gg) assuming g is positive. g(1109/360) Simplify (w(-2/13))*(2/107)(w/(w/(w/(w/(ww(-1/16))))))/(www(-1/36)) assuming w is positive. w(-207835/200304) Simplify n/n40nn/n(1/20)nn23((n*(-24)n)/n)/n assuming n is positive. n*(-761/20) Simplify (v	{ "pile_set_name": "DM Mathematics" }
0.375 Round -1498.126 to the nearest one hundred. -1500 Round -71.6839838 to the nearest ten. -70 Round 105325.9267 to the nearest one thousand. 105000 Round 19826622.17 to the nearest ten thousand. 19830000 What is -26485770.9 rounded to the nearest ten thousand? -26490000 Round 31.15042868 to 2 dps. 31.15 What is 11.6628845 rounded to the nearest integer? 12 What is -0.001629039146 rounded to three decimal places? -0.002 Round 11.858168 to one dp. 11.9 What is 0.00080703295 rounded to seven dps? 0.000807 Round -0.00002002810035 to 7 decimal places. -0.00002 What is -249275.819 rounded to the nearest one thousand? -249000 Round -596278.0573 to the nearest 1000. -596000 Round -0.165889087 to 2 decimal places. -0.17 What is -0.4162218811 rounded to 5 decimal places? -0.41622 Round 348456.696 to the nearest 1000. 348000 Round 0.00176491449 to 5 decimal places. 0.00176 What is -2170153.794 rounded to the nearest 1000? -2170000 What is 1723.43035 rounded to 0 decimal places? 1723 What is -145810.343 rounded to the nearest ten thousand? -150000 Round 0.00000248754038 to 6 dps. 0.000002 What is 0.0003155865813 rounded to seven decimal places? 0.0003156 Round 9860.69822 to 0 dps. 9861 Round -192481.372 to the nearest 10000. -190000 Round 3272.912407 to zero dps. 3273 Round -119346227 to the nearest one hundred thousand. -119300000 What is -200.892138 rounded to the nearest ten? -200 Round 0.0618465177 to three decimal places. 0.062 What is 0.75243105 rounded to four decimal places? 0.7524 Round -14385898 to the nearest 100000. -14400000 Round 219.093241 to the nearest ten. 220 What is 5.5298615 rounded to the nearest 10? 10 Round -0.0003171768338 to 5 decimal places. -0.00032 Round -7504326.138 to the nearest one thousand. -7504000 What is 676.87833 rounded to one dp? 676.9 Round 1.16513898 to one dp. 1.2 Round 0.301748078 to two dps. 0.3 What is 0.000610863488 rounded to four decimal places? 0.0006 What is 806.7096024 rounded to the nearest integer? 807 Round -480024.757 to the nearest one hundred thousand. -500000 Round -70.9343821 to the nearest integer. -71 What is 5002807.29 rounded to the nearest 10000? 5000000 Round -31.62626 to the nearest one hundred. 0 Round -0.41133624 to three decimal places. -0.411 What is -0.00578660466 rounded to three dps? -0.006 What is -34.668876 rounded to one decimal place? -34.7 Round -1872.07058 to the nearest one thousand. -2000 Round -253.3757959 to one decimal place. -253.4 Round 15240.17639 to the nearest ten thousand. 20000 What is 0.0000739817269 rounded to six decimal places? 0.000074 Round 150.02708 to the nearest integer. 150 What is -30744035.8 rounded to the nearest one thousand? -30744000 Round 1043.581978 to the nearest 100. 1000 Round -0.00728607784 to 5 dps. -0.00729 What is 6446.452269 rounded to the nearest one thousand? 6000 Round -2.725225588 to four dps. -2.7252 Round 0.0000282356781 to 5 dps. 0.00003 Round -8939688.913 to the nearest 10000. -8940000 What is -15064.45622 rounded to the nearest ten? -15060 Round -113732223 to the nearest one hundred thousand. -113700000 What is -0.053498287 rounded to 2 decimal places? -0.05 What is -2633415.899 rounded to the nearest 100? -2633400 What is 0.00192951952 rounded to five dps? 0.00193 Round 921601042 to the nearest 100000. 921600000 Round 3.5908627 to 1 dp. 3.6 Round 4.72213501 to zero dps. 5 Round -480171.78 to the nearest one hundred thousand. -500000 What is -21.6183369 rounded to 2 dps? -21.62 What is -293.362037 rounded to the nearest one hundred? -300 What is 0.000173453018 rounded to 7 decimal places? 0.0001735 Round 152124.561 to the nearest ten thousand. 150000 What is 3789.67852 rounded to the nearest one thousand? 4000 Round 0.00272497254 to six dps. 0.002725 What is 67844308.23 rounded to the nearest 10000? 67840000 Round 342544.2596 to the nearest 10000. 340000 What is 8745325.4 rounded to the nearest 1000000? 9000000 What is 0.000097803826 rounded to 5 dps? 0.0001 What is -3.900917053 rounded to 1 decimal place? -3.9 What is 33.14931 rounded to the nearest integer? 33 What is -0.1124072717 rounded to 3 dps? -0.112 What is -93.025885 rounded to one dp? -93 Round -14550.6057 to the nearest one hundred. -14600 What is 0.000530317095 rounded to seven decimal places? 0.0005303 Round -0.19947928 to four decimal places. -0.1995 Round -0.00211517606 to seven decimal places. -0.0021152 Round -0.00424531366 to 5 decimal places. -0.00425 What is 279700.644 rounded to the nearest one hundred? 279700 What is 3.98095722 rounded to 4 dps? 3.981 What is -3627.077661 rounded to 1 dp? -3627.1 Round -9430416.86 to the nearest one thousand. -9430000 Round -0.0024265405 to six dps. -0.002427 Round 148989.8703 to the nearest one hundred. 149000 What is -0.00586610013 rounded to seven dps? -0.0058661 Round -378.8536776 to 1 decimal place. -378.9 Round -962436.97 to the nearest one thousand. -962000 What is 0.00000024029821 rounded to 7 dps? 0.0000002 Round 222832.015 to the nearest ten thousand. 220000 Round 0.000335750855 to 6 dps. 0.000336 Round 0.15263674 to four decimal places. 0.1526 What is 0.34418177 rounded to five decimal places? 0.34418 Round -0.020655115374 to 7 dps. -0.0206551 Round 1.617612414 to three decimal places. 1.618 What is -0.0001501305617 rounded to 7 dps? -0.0001501 What is -0.00482086873 rounded to 4 dps? -0.0048 What is -273083210 rounded to the nearest one hundred thousand? -273100000 Round 766.168249 to the nearest 100. 800 Round -20302216.86 to the nearest one thousand. -20302000 Round 256378445 to the nearest one million. 256000000 What is -0.0001007780132 rounded to seven dps? -0.0001008 Round -1.24192711 to three decimal places. -1.242 What is -0.0001693888492 rounded to 6 dps? -0.000169 What is -19.3597045 rounded to two decimal places? -19.36 Round -0.53424595 to one dp. -0.5 What is -0.00012260063 rounded to 6 dps? -0.000123 Round -3589.1033 to the nearest 1000. -4000 What is -1419.77441 rounded to 0 dps? -1420 What is 0.00298515583 rounded to 6 decimal places? 0.002985 Round -0.0000215837881 to six decimal places. -0.000022 Round -1.023676341 to four dps. -1.0237 Round -1070.7339262 to 2 dps. -1070.73 Round -15144313.5 to the nearest 1000000. -15000000 What is -0.80005015 rounded to three decimal places? -0.8 What is -4.16213539 rounded to the nearest integer? -4 What is 202313.7841 rounded to the nearest 10000? 200000 Round 9.76892431 to two decimal places. 9.77 What is -7834.4046 rounded to the nearest 1000? -8000 Round -0.00000095692771 to seven decimal places. -0.000001 What is -0.85200631 rounded to three decimal places? -0.852 Round 0.00008689868 to 4 decimal places. 0.0001 What is -1327.206151 rounded to one decimal place? -1327.2 Round -24188.451 to the nearest one thousand. -24000 What is 0.0000083476089 rounded to 7 decimal places? 0.0000083 What is 1250160.271 rounded to the nearest 1000? 1250000 Round -22.4132741 to the nearest 10. -20 Round 0.00007391854289 to 6 dps. 0.000074 What is 1068613.687 rounded to the nearest 1000? 1069000 Round -0.0172869418 to 6 decimal places. -0.017287 What is 87.153241 rounded to two decimal places? 87.15 What is 8746021200 rounded to the nearest one million? 8746000000 Round 0.0151903822 to six dps. 0.01519 Round 42.152358 to 2 dps. 42.15 Round 0.749963341 to 4 decimal places. 0.75 What is 655673.94 rounded to the nearest 10000? 660000 Round -44.62354354 to three decimal places. -44.624 Round 55286415.2 to the nearest 10000. 55290000 Round 28643555.15 to the nearest ten thousand. 28640000 Round -59651.7416 to the nearest 100. -59700 Round 2.049549199 to 3 dps. 2.05 Round 518614.5809 to the nearest one hundred. 518600 Round 2.97654294 to three dps. 2.977 Round 0.000043240326 to 5 decimal places. 0.00004 What is 2722660340 rounded to the nearest one million? 2723000000 What is 16867544370 rounded to the nearest one million? 16868000000 What is 11.00398755 rounded to 0 decimal places? 11 Round 511347.727 to the nearest 1000. 511000 What is 0.00000627251167 rounded to six decimal places? 0.000006 Round 0.00791666379 to 6 decimal places. 0.007917 Round -796859.0618 to the nearest 100. -796900 What is 112770.88577 rounded to the nearest one thousand? 113000 Round 0.0000087254	{ "pile_set_name": "DM Mathematics" }
. 1471 Express 1353 - 992 - 24769l - 361 in the form wl + b and give w. -24769 Express 5a - 4670 - 4555 + 9695 in the form i + fa and give i. 470 Rearrange -2337 + 1163 + 1213 - 2d2 - 3d*3 + 15d + 4d3 to ud*2 + zd + s + id3 and give i. 1 Express (-u + 0u - 3u)(5 + 10u - 5)(247 - 206 + 1003 + u) as vu3 + hu*2 + mu + d and give v. -40 Express 0z4 - 10z*3 - 12 + 2z*4 + 10z + 15 - 8 + 0z4 in the form dz*2 + cz*4 + qz*3 + wz + r and give w. 10 Rearrange -158v + 3940624 - 43v - 3940628 to wv + y and give y. -4 Express 2f + 196f3 - 318484430f*2 + 318484430f*2 - 2f*4 in the form of*2 + sf + g + wf4 + af*3 and give s. 2 Rearrange -126n - 1274n3 - n4 + 2545n*3 + 5 + 95n - 198n - 1268n*3 to r + xn*2 + qn*3 + yn + vn4 and give q. 3 Express 9616q*2 + 0q - 7023q2 + 7165q*2 - q in the form wq*2 + f + lq and give l. -1 Express -17877s - 17927s - 38 + 35702s in the form t + gs and give g. -102 Rearrange (4 - 4 - 3q + (2q - 2q + 2q)(-1 + 2 - 3) - 1 + 1 - 2q)(-209 + 267q - 133q - 132q) to g + wq2 + jq and give w. -18 Rearrange (10r + 12r + 16r - 11r)(-6r + 3r - 3r + (-6 - 5 + 6)(0r + 2r + 0r)) to xr2 + ur + k and give x. -432 Express (1626 + 218j - 1626)(-2j + 2j - j)(0j - j + 6j) + 7j*3 - 2j*3 - 4j*3 - 1 as rj + gj3 + yj*2 + d and give d. -1 Rearrange 2589w*3 + 537w*4 - 2589w*3 + (38 - 28 - 18 + 4w)(4w - 4w + 2w*3) to the form nw*2 + xw + j + pw3 + gw*4 and give g. 545 Rearrange (-2 - 1 + 2)(-1 + 1 + 2)((-2 - 2 + 6)(-15a - 17a + 8a) + (-a - 6a - 2a)(-6 + 2 - 4)) to k + qa and give q. -48 Express -22 - 2o*2 - 10180o + 5110o + 5058o in the form zo2 + wo + b and give z. -2 Rearrange 7t3 + 268 - 199 - 70 - t4 + 17t + 2t2 to v + xt*4 + kt*3 + dt*2 + ot and give d. 2 Express -1969r2 + 1577r*2 - 3063r*2 in the form wr + t + fr2 and give f. -3455 Rearrange -615543 + 19597m + 973m + 615543 to q + rm and give r. 20570 Rearrange (2f + 3f + 0f)(-2f + 3f - 2f) + 66f*2 + 45f*2 - 80f*2 + (2f + f - f)(-77 - 14f + 77) to the form df + v + gf*2 and give g. -2 Express -32z*3 + 155z - 59z + 3z as kz2 + nz*3 + y + dz and give d. 99 Express 67k3 + 12k*2 - k - 72k*3 - 6 - 11 + 12 in the form tk*3 + lk*2 + fk + y and give l. 12 Express (2h + 5 - 5 + (h + 2h - 4h)(-1 - 2 + 4) - 327h + 159h + 30h)(3 - 5 + 1)(5 - 3 + 1)(4h - 4h - 2h) as dh + t + vh2 and give v. -822 Express (2x - x + x)(-18 - 27 - 48)(-5 - 3 + 0)(-2 - 2 + 6)(-x - 4x + 3x) in the form px2 + y + rx and give p. -5952 Rearrange -89l - 57 + 21027l*2 + 89l + 57 to the form ml + pl*2 + f and give p. 21027 Express (2w*4 + 2w - 2w)(341 - 421 + 266)(-3 + 4 + 1) + (1 - 1 + 3w)(-4w*3 + 0 + 0) as pw + v + lw4 + sw*3 + gw*2 and give l. 732 Rearrange (109u*2 + 92u*2 + 31u*2)(6 - u - 8 + 3) to ku2 + cu + g + au3 and give g. 0 Express (23c - 64c2 - 23c)(4c - 3c - 2c)(1 - 1 - 13c)(7 - 18 + 3) in the form lc*3 + jc*2 + k + zc + pc4 and give p. 6656 Rearrange ((2t4 + t4 - 2t4)(6 - 1 - 4) - 307t + 307t + 24t4)(-1 - 15 - 6) to the form ht4 + wt + b + at2 + st*3 and give h. -550 Express (166 - 166 + 21u)(-1 - 1 - 3)(1 + 2 - 2)(-3 + 8 - 6) as h + fu and give h. 0 Express -169 + 140 + 773 + 648 + m as i + gm and give i. 1392 Rearrange -8500o*2 + o + 661 + 17008o*2 - 8505o*2 - 82 to r + so*2 + wo and give r. 579 Rearrange (4v - 2v - v)(-v + v + 2v) + (4v2 - 4v*2 - 2v*2)(0 + 3 - 2) + 511v2 + 45v*2 + 29v*2 to the form kv + g + bv2 and give b. 585 Express -4 + 36 + 450m - 29 in the form n + vm and give v. 450 Rearrange (-6d*3 - 5d*3 - 5d*3)(-55 - 13d + 55 + 5 - 5 - d + (6 - 12 - 8)(d + 0d + 0d)) to the form nd4 + w + id*3 + fd*2 + hd and give n. 448 Express -100476 + 100476 + 5007g as tg + f and give t. 5007 Express 3418t - 821t + 3061t as b + rt and give r. 5658 Rearrange -7x - 7x*2 - 11x*2 + 2x + 21x2 + 4x + 331 to nx2 + s + tx and give n. 3 Rearrange 1662h2 + 7006h*2 - 5h*3 + 1190h*2 + 5897h*2 + 7h*3 to the form jh*3 + gh + q + lh2 and give l. 15755 Express 4 + 29q + 45q - 73q - 397q in the form rq + l and give l. 4 Rearrange -57872g2 + g4 - 1 - 2g*3 + 19g + 28937g2 + 28927g*2 to the form t + mg*4 + ng*3 + ig*2 + hg and give h. 19 Express -6n + 0n - 453 - 10n - 7n + 10n as t + ln and give l. -13 Express (-4p - p + 3p)(277 + 188 + 141 - 200) + 4 + 2p - 4 + (0 + 4 - 5)(-3p - 4p + 5p) as v + jp and give j. -808 Express 2139t + 1275t - 64 + 78 - 14 in the form u + gt and give g. 3414 Express (j + 0j - 4j)((-19 + 4j + 19)(-2 - 1 + 7) - 2j + j + 5j)(-2 + 0 + 0) - j*2 - 11j*2 + 3j*2 in the form pj*2 + qj + f and give p. 111 Express 2324m2 - 4411m*2 + 2310m*2 - 3m + 3m - m2 + (-m + 2m + 0m)(-m + 2 - 2) + 2m2 - 4m + 4m as tm + k + lm2 and give l. 223 Rearrange (3z + 0z + 0z)(-5 + 55 + 4) - 17z + 21z + 6z to p + cz and give c. 172 Rearrange (1472u*3 + 12u*3 - 299u*3)(25u - 4 - 13u - 18u) to the form su*2 + cu*4 + xu + r + vu3 and give c. -7110 Express (9 + 12v - 15v - 9v)(-v - 3v + 2v) - 1058 + 527 + 17v*2 + 534 as sv + wv2 + f and give w. 41 Rearrange (-124o - 34o2 + 417o - 206o)(-6 - 4o + 6) to the form yo*2 + p + no*3 + uo and give n. 136 Express (-6 + 2 + 3)(3224 - 6438 + 3214 - 1523w) in the form i + cw and give c. 1523 Rearrange -y2 + 3y*2 + 2y*2 + (6y - 5y + 8y)((0y - y + 0y)(1 + 4 + 2) + 109 - 55 + 3y - 50 - 1 + 2y + 1) to the form ky + c + ny*2 and give k. 36 Express 821078x*2 + 2x - 823534x2 + 2x as wx2 + vx + c and give v. 4 Rearrange 1611 - 1586 + f*4 + 0f*4 + (3f*3 - 2f3 + f3)(14f - 13f + 25f) to tf3 + a + xf + rf4 + zf*2 and give r. 53 Express (-5q - q + 5q + (-4 - 1 + 4)(0q - 5q + 3q) + 3q - 3q + 2q + 31q - 22q + 14q)(9 + 3 - q + 2) in the form r + jq2 + lq and give r. 0 Rearrange ((2j - 3j + 2j)(0 + 2 - 3) + (3 - 9 + 0)(-98j + 137j - 84j))(-7j + 2 + 9j + 4j) to the form pj + kj*2 + h and give p. 538 Express (-3 - 1 + 2)(-3b - b + 3b)(-34 + 27 + 61)(-165b - 166b + 387b) in the form rb + j + ub2 and give u. 6048 Express ((0 + 3 - 1)(0 - 3 + 4) + 220 + 154 - 73)(1 - 3 + 4 + (-1 + 0 + 2)(3 + 1 - 2))(-3w - 2w2 + 3w) in the form uw2 + o + jw and give u. -2424 Rearrange i + 10i - 25i*2 + 2i*3 + 24i2 - i4 - 1 - 7i + 2i*4 to ji + f + bi2 + yi*3 + di*4 and give y. 2 Rearrange 8829 - 3003a - 8829 to the form ia + c and give i. -3003 Express (-3 - 1 + 42)(106k - 358k - 231k) in the form lk + i and give l. -18354 Express (6k - 2k - 3k)(-11 + 853335k - 852948k + 25) in the form nk2 + f + vk and give v. 14 Rearrange (1 - 2z - 1)(-z*2 + 0z*2 + 6z*2) - 2z*3 + 2z*3 - 3z*3 - 1 - 105z*2 to the form kz*2 + gz + uz3 + b and give b. -1 Express (5 + 3 - 2)(1095r - 177799 + 177799 + 137r) as d + mr and give m. 7392 Express (12a*3 - 17a*3 - 12a*3)(0 - 6 - 3) as l + ma3 + za*2 + ya and give m. 153 Express (0 + 6 - 2)(-2 + 2 + 4q) - 115q - 9q - 246q + 86q as mq + g and give m. -268 Rearrange 10341k - 5929k + 6173k + 3488k to fk + c and give f. 14073 Express -8t2 + 13 - 113 - 41t + 99 as b + st2 + ft and give b. -1 Express 660z - 529 + 528 - 660z + 15079z3 in the form qz + hz2 + j + tz*3 and give t. 15079 Express (4947 + 4571 - 1337 - 174 - 699)(-r*4 - 3r*4 - 2r*4) in the form i + pr*2 + qr*4 + kr*3 + ur and give q. -43848 Rearrange 3p + 182 + 2p*3 - 1643286p*2 + 1643286p*2 to the form x + jp*3 + hp*2 + qp and give x. 182 Express 1059 - 449 - 520 + 32f4 + 0f*4 + 5f*4 - 3f4 + (f3 + 0f + 0f)(f + 4 - 4) in the form wf*2 + bf*3 + o + rf + lf4 and give l. 35 Rearrange 531652p*3 - 531663p*3 - 2p*2 - 3p - 1 + 1 + 5p4 to xp + mp4 + vp*2 + i + wp*3 and give v. -2 Express -24y*3 + 0y*3 - 14y**4	{ "pile_set_name": "DM Mathematics" }
derivative of -223l2ny + 8l*2n + 4l2 + ny wrt y? -223l2n + n What is the third derivative of 165c6q - 2c4iq - c3i + 2c2i + 84iq - 6i wrt c? 19800c*3q - 48ciq - 6i Find the third derivative of -644b3 + 8250b2. -3864 Find the third derivative of s2t4 - 213s*2 + 118st4 - 5st2 wrt t. 24s*2t + 2832st Differentiate -51u4 + 3u - 69 wrt u. -204u3 + 3 What is the second derivative of b3j4 - b3j - 17b*3 + 330bj4 + 2j wrt j? 12b3j*2 + 3960bj2 Find the third derivative of -2r*2s*4 - 2r*2s2 + r2s + rs*4 - 20rs3 - 6rs wrt s. -48r*2s + 24rs - 120r Find the third derivative of 78a*3l2 + a2 + 27l2 + 1 wrt a. 468l*2 What is the third derivative of 1616cx3 + 19cx2 + 27cx + 2c wrt x? 9696c Find the third derivative of -2350j*5 + 6j*2 - 26j wrt j. -141000j2 Find the first derivative of -2k*2 - 52k + 85 wrt k. -4k - 52 Find the third derivative of -843j*3 + 357j*2. -5058 What is the second derivative of -423u*4 - 151u wrt u? -5076u2 Find the second derivative of -30b*2 - 16b + 15. -60 What is the third derivative of 9721c3 - 6876c*2 wrt c? 58326 Find the second derivative of -153o*2 + 139o + 2 wrt o. -306 Find the second derivative of 40o5 + 7o*2 - 11152o. 800o3 + 14 What is the derivative of 336t*4 - 362 wrt t? 1344t*3 What is the third derivative of 6401ad5 + 4ad2 - ad + 13a + d2 wrt d? 384060ad2 What is the third derivative of 3275y*3 + 935y*2? 19650 What is the second derivative of 10734l*2 - 8022l? 21468 What is the second derivative of -2965f3 - 3473f? -17790f Differentiate -45u*3 + 74 with respect to u. -135u*2 What is the second derivative of 2515q*3s - q*2s2 - q2s + 12qs2 + qs - 19s2 wrt q? 15090qs - 2s*2 - 2s What is the second derivative of 43b2v*3 - 52b*2v + 6bv*3 - 2bv wrt v? 258b*2v + 36bv Differentiate -2586l - 2453 with respect to l. -2586 Find the third derivative of -796w*4 - 2w*3 - 59w*2. -19104w - 12 Find the third derivative of -1152p3z*4 + 2p*3z*3 - 19p*3z2 - p3z - 27pz2 - 2z*4 wrt z. -27648p*3z + 12p3 - 48z Find the second derivative of -j*5 + 15j*2 + 123j wrt j. -20j3 + 30 What is the second derivative of -61b*4 + 1309b wrt b? -732b2 Find the second derivative of -24d*4 - 5d*2i + 17di + d - i wrt d. -288d2 - 10i Find the second derivative of -a*5 - 927a*4 - 2a*2 - 5170a wrt a. -20a3 - 11124a*2 - 4 Find the third derivative of -gl*6 - 2gl3 + g - 3l*2 + 21l wrt l. -120gl*3 - 12g Find the third derivative of 30ht - 580hu*3 - tu*5 + tu*2 + 37u wrt u. -3480h - 60tu2 Find the third derivative of 447m*3 - 3m*2 - 101m wrt m. 2682 Find the third derivative of -130n6 - 35n*3 + 2n*2 - 9n - 28. -15600n3 - 210 Find the second derivative of 2r*4 + 47r*3 + 5r + 12 wrt r. 24r2 + 282r What is the third derivative of 1140d3 + 3d*2 + 499d? 6840 What is the third derivative of 4301m4o*2 + 3m*4o - m*3 - 4m*2o*2 + 989m*2 wrt m? 103224mo2 + 72mo - 6 Find the second derivative of -2v*3 + 18v*2 + 23v. -12v + 36 Find the second derivative of 29944q*2s*3 - qs*3 - 2qs + 35q - 32s3 wrt q. 59888s*3 What is the second derivative of -464lo2t - 2lo + 3o2t*3 - 17ot + t3 wrt o? -928lt + 6t*3 Find the first derivative of -2c*3k - 798c2k - 10k - 2 wrt c. -6c*2k - 1596ck Differentiate 92f4 - 28f*3 - 13220 with respect to f. 368f*3 - 84f*2 Differentiate 3875w*3 + 2243 with respect to w. 11625w*2 Find the second derivative of 181p*2v2 + p2v + 17prv*2 + 4prv + 22rv wrt v. 362p2 + 34pr What is the second derivative of -8554lo2 + 2lo + 7547l wrt o? -17108l What is the second derivative of 1281n*3 - 18n + 16 wrt n? 7686n Find the second derivative of 2ty3 - 4ty2 + 2ty + 578t - 6y3 + y wrt y. 12ty - 8t - 36y What is the second derivative of 772k*5x*2 - 2k - 529x2 wrt k? 15440k*3x*2 Differentiate -77a*2cj + a2cx + 7acjx + 7acx + 8ac - 4x wrt j. -77a*2c + 7acx Find the third derivative of 2162l*3p*2 - 2l*2p - 21l2 - 3p*2 wrt l. 12972p*2 Find the third derivative of -1354f*4 + 760f*2 wrt f. -32496f Differentiate -408a2o*4 - 2734a*2 + ao*4 wrt o. -1632a*2o*3 + 4ao3 What is the second derivative of 3d*5 + 3d*4 - 27d*3 - 4025d wrt d? 60d3 + 36d*2 - 162d Find the first derivative of 2705mw - 1498w wrt m. 2705w What is the third derivative of 2pq*4 + 523pq3 - 12pq2 + 2p - 19q2 + 1 wrt q? 48pq + 3138p What is the second derivative of -7p5z + 3p2y + 5p2z + 30pyz + 2py - 5p - yz wrt p? -140p*3z + 6y + 10z What is the first derivative of 24s4z + 7s2z - sz + 4z - 271 wrt s? 96s3z + 14sz - z Find the second derivative of 3jq*3 - 76jq2 + 13342jq - 6q3 - q2 wrt q. 18jq - 152j - 36q - 2 Differentiate 2r4 + 844r + 3135. 8r3 + 844 Find the third derivative of 1080d*3v*4 - 3d*3v*3 - 7d*3v*2 + 12d*2v*2 + 35v*2 wrt v. 25920d*3v - 18d3 What is the second derivative of -7py3 - 2py2 + 77p - y*2 + 3y wrt y? -42py - 4p - 2 What is the second derivative of 3t*3 + 775t*2 - 2t - 1272 wrt t? 18t + 1550 Find the third derivative of -18a5 + a3 + 588a2 wrt a. -1080a*2 + 6 Differentiate -539f*2 + f + 248 with respect to f. -1078f + 1 What is the first derivative of 70p3 - 180 wrt p? 210p*2 What is the first derivative of -55k*3n*2 + 5k*3n + 98k3 - 10k*2 wrt n? -110k*3n + 5k3 Find the first derivative of 132fk + 2f + 4637k wrt f. 132k + 2 What is the second derivative of -221x5 - 53x - 5? -4420x3 What is the derivative of 2h*3v + 376h3 - 71h*2v wrt v? 2h3 - 71h*2 Find the first derivative of -554h - 402 wrt h. -554 Find the third derivative of 2591n3 - 3621n*2. 15546 Differentiate 3823m*2 - 3259 with respect to m. 7646m Differentiate -12826a + 7004 wrt a. -12826 What is the derivative of -71w*2 - 77w + 10281 wrt w? -142w - 77 Differentiate 5164z + 11200 wrt z. 5164 Find the third derivative of 10x4 - 5x*2 + x wrt x. 240x Find the third derivative of -36f2p*3v*2 - 6f*2p*2v*2 - 2f*2pv2 + f2v - p*3v*2 - 2p*3 - 2p*2v wrt p. -216f2v*2 - 6v2 - 12 Find the third derivative of v5y - 3v*4 + 248v*3y - v*2 + 8y wrt v. 60v2y - 72v + 1488y Find the second derivative of 627i5 + 38i - 6 wrt i. 12540i3 Find the second derivative of 9136q*2 + 2q + 919. 18272 What is the second derivative of 6h3l + 2h2l + 200h2 - 2hl + 14h - 2l - 5 wrt h? 36hl + 4l + 400 Find the third derivative of 4afl - 8al3 + a + 23fl3 + 82fl2 + 2l*3 wrt l. -48a + 138f + 12 What is the third derivative of 10n*5v + 9n5 + 2n*2v + 20nv wrt n? 600n2v + 540n2 Find the third derivative of 27jt4 - 2jt3 - 211jt2 - jt + 2t4 wrt t. 648jt - 12j + 48t What is the third derivative of -6f*4 - 4f*2 - 39f wrt f? -144f Find the third derivative of -210h*3 - 3h*2 + 22h wrt h. -1260 Differentiate 52z2 + 47 wrt z. 104z Differentiate -74as*2tw - 8ast*2w - s*2t*2 + 47s*2w - 2st*2 + stw with respect to a. -74s*2tw - 8st2w What is the second derivative of -r4 - r3 + 13r2 - 19668r? -12r2 - 6r + 26 Differentiate 2l3u - 17l2u*3 + 51u*3 wrt l. 6l*2u - 34lu*3 Find the second derivative of -825l*2 + 23l - 10 wrt l. -1650 Find the second derivative of bh3 - 669bh2 + bh + h3 - h2 - 226h wrt h. 6bh - 1338b + 6h - 2 Find the third derivative of 818m*4 + 21m*2 - 8 wrt m. 19632m What is the third derivative of k*2pu2 - 77k*2u*3 - 2k*2u*2 - 13kpu*3 + 21ku2 - 8pu wrt u? -462k*2 - 78kp What is the derivative of -9bx2 + 218x*2 wrt b? -9x*2 What is the second derivative of -4k*3s2 - k3s + ks*3 - 24k*s -	{ "pile_set_name": "DM Mathematics" }
wrt b. -114b - 12 Let y(z) = -48z*3 - 17z*2 + 2z. Let h(t) = 97t3 + 36t*2 - 5t. Let b(i) = 2h(i) + 5y(i). What is the third derivative of b(l) wrt l? -276 Find the second derivative of -3n - 351n*3 + 539n*4 - 151 - 70 + 2n + 351n3 wrt n. 6468n*2 Suppose 10 = -5w + 25. Differentiate 27 + 12 - 17 + 2k3 + kw with respect to k. 9k*2 What is the second derivative of -28q*2 + 15q - q*4 - 4q + 2q4 - 2q + 23 - 3q4 wrt q? -24q*2 - 56 Let o be (-1)/6 + 1/6. Suppose o = 5r - 39 + 4. What is the derivative of -2 + 2 + r + 3c2 wrt c? 6c Let z(k) = k*2 - 51k + 52. Let u be z(50). Let y(d) be the first derivative of 0du + 8 + 6d - 10/3d3. Differentiate y(g) wrt g. -20g Let o(z) = -7128z4 - 2343z*2 + 110z. Let h(f) = -891f4 - 293f*2 + 14f. Let g(r) = 55h(r) - 7o(r). Find the third derivative of g(a) wrt a. 21384a Let v(t) = 9t*3 - 61t*2 - 10t + 63. Let o(a) = 2a3 + a2 - 2a + 1. Let u(c) = 5o(c) - v(c). What is the first derivative of u(y) wrt y? 3y*2 + 132y Let x(y) be the third derivative of -679y6/120 - y5/12 - 31y*4/24 - 127y2. Find the third derivative of x(a) wrt a. -4074 Let s(j) be the first derivative of -j2 - j + 25/2j4 + 28 + 0j*3. What is the second derivative of s(a) wrt a? 300a Let f(p) be the second derivative of -p*8/840 + 5p*4/8 - 7p*3/3 + 17p. Let r(q) be the second derivative of f(q). Find the first derivative of r(x) wrt x. -8x3 Let p = 21 - -2. Find the second derivative of 5j*2 + 5j - 5j2 - pj*3 + j wrt j. -138j Let i(u) be the second derivative of 1/12u4 + 5/42u*7 + 6u + 0u5 + 0 + 0u*6 + 0u*3 + 0u*2. What is the third derivative of i(s) wrt s? 300s*2 Let u(v) be the second derivative of 13v5/10 - v4/12 + 41v3/2 + 174v. What is the second derivative of u(z) wrt z? 156z - 2 Let v(y) be the third derivative of y9/36 - 19y*5/60 + 2y*2 + 28y. What is the third derivative of v(j) wrt j? 1680j3 Differentiate -23y - y*3 - 24 + 43 - 24y + 35 + 72 with respect to y. -3y2 - 47 Let w be 6/39 - 4/26. Suppose -c + 2 - 1 = w. What is the first derivative of -3 + c - 9l*2 - 8 wrt l? -18l Let v(u) be the third derivative of -5/24u6 + 0u - 16u2 + 0 + 0u*5 + 1/24u*4 + 0u*3. What is the second derivative of v(o) wrt o? -150o Find the second derivative of -12r2 + 2r*4 + 4r*2 + 11r*2 + 546r + 44r4 wrt r. 552r*2 + 6 Let g(a) = -12a*2 - 6a - 3. Let j(s) = 4 - 2s2 + 10s2 + s2 + 7s + 3s*2. Let u(x) = 4g(x) + 3j(x). What is the second derivative of u(l) wrt l? -24 Suppose 0 = 4d - 9d - 2t + 90, -20 = 4t. What is the third derivative of da*2 - 2a*2 - 7a*2 + 2a*4 wrt a? 48a Let y = 204 - 200. Let z(q) be the second derivative of 0 + 0q2 - 1/3q*y - 2/3q*3 - 3q. What is the second derivative of z(m) wrt m? -8 Let f(i) = 174i2 + 17i - 25. Let s(n) = -172n2 - 15n + 24. Let t(d) = 6f(d) + 7s(d). What is the second derivative of t(x) wrt x? -320 Let g(w) = -113w2 + 66w. Let o(y) = -6y2. Let m(x) = -2g(x) - 18o(x). Find the second derivative of m(v) wrt v. 668 Let b(m) = m3 + 5m*2 - m. Let t be b(-5). Find the second derivative of 4l + tl + 20l*5 + 8l wrt l. 400l3 Let f(u) = -603u + 691. Let y(d) = 301d - 346. Let c(v) = -3f(v) - 5y(v). What is the derivative of c(m) wrt m? 304 Let b(s) be the second derivative of 4s*5 + 10s*3/3 + 123s. What is the second derivative of b(l) wrt l? 480l Let t(l) = 167l*6 + 4l*3 + 211l*2 + 4l + 4. Let r(i) = -i6 - i3 + i*2 - i - 1. Let d(a) = -4r(a) - t(a). Find the third derivative of d(m) wrt m. -19560m3 Suppose -5u + 4a = -0 - 20, 4u + a = 16. Suppose 17 = 3w + 11. Differentiate -z - w - uz - 3z with respect to z. -8 Find the third derivative of 14w + 146w5 + 12w + 22w - 74w*5 - 3w*2 wrt w. 4320w*2 What is the third derivative of -18i*2 - 70i*4 - 94i*2 - 92i*2 + 0i*2 wrt i? -1680i Let v = 26 - 10. Suppose -a + v = 12. Differentiate -h4 - 4 + ha - 5h4 with respect to h. -20h*3 Let w(q) be the first derivative of -8q*7/7 + 2q*5/5 - 16q*3/3 - 9. What is the third derivative of w(g) wrt g? -960g*3 + 48g Let p(m) = 5m + 30. Let x be p(-6). Let l(o) be the first derivative of xo*3 + 0o + 2 + 7/2o2 - 5/4o*4. Find the second derivative of l(s) wrt s. -30s Let c = 9 + -9. Suppose 4q = 12 - c. Differentiate 0 + 15r*3 + 6 - 7r*3 - 9r*q with respect to r. -3r*2 Suppose -5k - 5m + 17 = -3k, 3k - 17 = m. What is the third derivative of 2l*3 - kl*5 - 2l*3 - 14l*2 - 4l*5 wrt l? -600l2 Let k(n) be the second derivative of -n8/48 + n*5/5 + 7n*2/2 - 8n. Let p(g) be the first derivative of k(g). What is the third derivative of p(x) wrt x? -420x2 Let l be 4/(-6)(1 + (-69)/6). Let i = 2 - -2. What is the derivative of -1 - if2 + 0 + 5f*2 - lf*2 wrt f? -12f Let o(i) = 28i2 + 107. Let n(y) = -58y*2 - 213. Let m(z) = 2n(z) + 5o(z). Differentiate m(h) with respect to h. 48h Let h(t) = t*3 + 6t2 - 1. Let l(z) = z3 - z*2 + z. Let q(g) = h(g) - 3l(g). What is the second derivative of q(c) wrt c? -12c + 18 Let y(k) be the first derivative of k5/5 + k4/2 - 2k2 - 7. Let l(p) = -p3. Let n(b) = 2l(b) + y(b). What is the second derivative of n(f) wrt f? 12f*2 What is the second derivative of 888b*4 + 33b - 888b4 + 174b*5 wrt b? 3480b3 Let i(l) be the first derivative of l9/56 + l*5/15 - 3l*2 - 14. Let t(h) be the second derivative of i(h). What is the third derivative of t(u) wrt u? 1080u*3 Suppose 49 = d - 2d. Let u be (-14)/d - (-24)/14. Differentiate 3ru + r - r + 3 + 0 with respect to r. 6r Let t(w) be the third derivative of w7/252 + w5/30 - w*4/4 - 10w*2. Let u(v) be the second derivative of t(v). Differentiate u(p) with respect to p. 20p Let k(n) = n*3 + 6n*2 + 3n - 2. Let g be k(-5). What is the second derivative of -gj + 0j + 4j2 + 3j wrt j? 8 What is the second derivative of -r + 7r2 + 89r*5 - 310r*5 - 10r*2 + 3r*2 wrt r? -4420r*3 Let y(h) = 6h + 13. Let o(k) = 5k + 13. Suppose 2v + 3 + 18 = 5q, 6 = -2v. Let u(z) = qy(z) - 2o(z). What is the first derivative of u(w) wrt w? 8 Let l(f) = -90f6 - 125f*2 + 12f + 4. Let p(w) = 270w6 + 374w*2 - 34w - 11. Let i(d) = -17l(d) - 6p(d). Find the third derivative of i(b) wrt b. -10800b3 What is the first derivative of 20d - 202 + 4 - 33d - 31d - 12d wrt d? -56 Let g be (-1 + 0 - 0) + 14. Suppose 0 = -3r - 1 + g. Find the second derivative of -24 - ri + 7i*3 + 24 wrt i. 42i Let f(c) be the second derivative of 2c + 1/3c*6 + 0c*5 - 1 - 1/2c*3 + 1/4c*4 - 13/2c*2. What is the second derivative of f(m) wrt m? 120m*2 + 6 Let f = 55 + -53. Find the second derivative of -16o - o*2 + 6o*3 + 12o*2 - 11o*f wrt o. 36o Suppose 2g + 38 = 2f, -2f - 2g - 83 = -7f. Find the second derivative of 7o*5 - 5o - 10o - fo*5 - 5o*5 wrt o. -260o*3 Let u(d) = -240d*3 + 2d*2 + 257d. Let y(q) = 238q3 - 2q*2 - 258q. Let z(v) = 2u(v) + 3y(v). Find the third derivative of z(s) wrt s. 1404 What is the second derivative of 29 + 125h5 + 8h*5 - 50 + 48h + 21 wrt h? 2660h3 Find the third derivative of -2203305l6 + l5 + 862l2 - 207l*2 + 2203157l*6 wrt l. -17760l*3 + 60l2 Let j(c) = -c2 + 10c - 13. Let o be j(8). What is the second derivative of -2v + 4v5 - ov*5 + 15 - 2v*5 wrt v? -20v*3 Find the second derivative of -299z*5 - 17 + 540 + 358z*3 - 358z*3 + z wrt z. -5980z*3 Suppose -3w = w + 5l - 140, 3w - 5l = 70. What is the second derivative of 13n*5 + w - 29n - 12 - 18 wrt n? 260n3 Let p(j) be the third derivative of 133j*6/60 - 167j5/60 + j4/24 + 28j2 + 9j. What is the third derivative of p(m) wrt m? 1596 Suppose 0 = 5m - 304 - 426. What is the first derivative of 3 + 253f*4 - 143f*4 - mf*4 wrt f? -144f*3 Let k(q) = -3q - 32. Let t be k(-14). Differentiate -tr3 - 18r*3 + 31 - 53 wrt r. -84r*2 Let d(z) be the first derivative of -4z6/3 + z3/3 + 31z2 + 256. Find the second derivative of d(i) wrt i. -160i**3 +	{ "pile_set_name": "DM Mathematics" }
, -2, 4 Put -8, -4, 4, 3 in decreasing order. 4, 3, -4, -8 Put 47, 27, 2 in decreasing order. 47, 27, 2 Sort -101, 1/4, -6 in descending order. 1/4, -6, -101 Put 4, -9, -5, -18 in descending order. 4, -5, -9, -18 Sort -3, -1, 95 in increasing order. -3, -1, 95 Sort -0.2, -5, 4, -84. -84, -5, -0.2, 4 Sort -99, 0, 52, 2 in increasing order. -99, 0, 2, 52 Sort 33, 1, -5, -4. -5, -4, 1, 33 Sort 4, 2, 0, 20 in decreasing order. 20, 4, 2, 0 Put -43, 7, -17 in descending order. 7, -17, -43 Put -3, 80, -4, -2 in descending order. 80, -2, -3, -4 Sort 2, 16, 4 in decreasing order. 16, 4, 2 Sort 2, -3, 0.4, -0.3, -36/23. -3, -36/23, -0.3, 0.4, 2 Put -103/5, 0.2, -3/2, -1/3 in ascending order. -103/5, -3/2, -1/3, 0.2 Put 14, -4/9, 4 in increasing order. -4/9, 4, 14 Sort 1, 5, 4, -4, -2 in decreasing order. 5, 4, 1, -2, -4 Sort 4, 10.6, -4/3 in increasing order. -4/3, 4, 10.6 Sort 0.32, -1/6, 0.3 in increasing order. -1/6, 0.3, 0.32 Put 9, -11, 3 in decreasing order. 9, 3, -11 Sort 1, -2, 1/8, -0.5 in descending order. 1, 1/8, -0.5, -2 Sort -2/7, 4, -0.059, -2/17 in descending order. 4, -0.059, -2/17, -2/7 Put -246, -6, 4, 1 in decreasing order. 4, 1, -6, -246 Sort -3, -1/9, -5/6. -3, -5/6, -1/9 Sort -0.11, -2, 0.4, 20. -2, -0.11, 0.4, 20 Sort -0.01, 141, 4, 3, -5 in decreasing order. 141, 4, 3, -0.01, -5 Sort 124, -2, 5, -5, 3 in decreasing order. 124, 5, 3, -2, -5 Sort 4, -167, 7, 5. -167, 4, 5, 7 Put -17, 22, 5 in decreasing order. 22, 5, -17 Sort -3/2, 0, -1/6, -0.09. -3/2, -1/6, -0.09, 0 Sort -7, 59, -5, -2, 2 in descending order. 59, 2, -2, -5, -7 Sort 4, -30, -2, 3 in descending order. 4, 3, -2, -30 Sort 1/2, -14, -3, -16 in descending order. 1/2, -3, -14, -16 Sort 1/13, -5, 0.2, 4, 0. -5, 0, 1/13, 0.2, 4 Put 25, -3, 7, 2, -1 in decreasing order. 25, 7, 2, -1, -3 Sort -1, 24, 2, 1/7. -1, 1/7, 2, 24 Put 286, 2, 0, -5 in increasing order. -5, 0, 2, 286 Sort 0, -5, 21, 5, -4 in increasing order. -5, -4, 0, 5, 21 Sort -2/13, 508, -2/11. -2/11, -2/13, 508 Sort 3, 5, 2, -3, -55 in decreasing order. 5, 3, 2, -3, -55 Sort -3, -1/4, 34, 0.05, 0 in increasing order. -3, -1/4, 0, 0.05, 34 Sort -2, -3.6, 1/7 in increasing order. -3.6, -2, 1/7 Sort 1, 0, 8, 4. 0, 1, 4, 8 Put -4, 0, 2, -8 in ascending order. -8, -4, 0, 2 Put 2/13, -1/7, 6/13, 2/135, 2 in ascending order. -1/7, 2/135, 2/13, 6/13, 2 Put -3, -1/4, -1/5, 5, -1/3 in descending order. 5, -1/5, -1/4, -1/3, -3 Put 1/4, 0.07, 40 in descending order. 40, 1/4, 0.07 Sort -3/91, -3, 0.3 in decreasing order. 0.3, -3/91, -3 Sort 1, -3, 10, 0, 4 in descending order. 10, 4, 1, 0, -3 Sort -4, -51, -2, 1. -51, -4, -2, 1 Put 1, 3/2, -1/9, -4/3 in ascending order. -4/3, -1/9, 1, 3/2 Put -0.4, 24, 0.5, -0.1 in decreasing order. 24, 0.5, -0.1, -0.4 Sort -5, 2, -3 in decreasing order. 2, -3, -5 Put -1, 10, -191 in increasing order. -191, -1, 10 Sort -1/10, -13.8, 0.4 in ascending order. -13.8, -1/10, 0.4 Put 0, -3, -4, 4 in decreasing order. 4, 0, -3, -4 Put 4, 0, 1, -227 in descending order. 4, 1, 0, -227 Put -4, -1, -327 in descending order. -1, -4, -327 Put -2, 2, 4, -27 in ascending order. -27, -2, 2, 4 Put -4/3, -5/3, -5 in descending order. -4/3, -5/3, -5 Put -4, -0.1, 3, -2.7 in decreasing order. 3, -0.1, -2.7, -4 Sort 5, -1046, -4, -3. -1046, -4, -3, 5 Sort -19, 5, 168, 3, -3 in decreasing order. 168, 5, 3, -3, -19 Put 1, -57, -1 in increasing order. -57, -1, 1 Sort 2/15, -0.4, 0.1, -0.7 in descending order. 2/15, 0.1, -0.4, -0.7 Sort -5, 858, 4, -3, -1 in increasing order. -5, -3, -1, 4, 858 Sort 0, 0.4, 1/6, -533. -533, 0, 1/6, 0.4 Put -4, -2, 514 in increasing order. -4, -2, 514 Sort 0.13, -3, 2/9, -0.05 in ascending order. -3, -0.05, 0.13, 2/9 Sort 9, 2, -1 in decreasing order. 9, 2, -1 Sort -3, 21, 4, 10 in descending order. 21, 10, 4, -3 Put 2, -4, -5, -7 in decreasing order. 2, -4, -5, -7 Sort -2, -5, 0.4, -36/5. -36/5, -5, -2, 0.4 Put -4, 5, 69 in increasing order. -4, 5, 69 Put -2, -41, -3, 5, 1 in increasing order. -41, -3, -2, 1, 5 Sort -1, -20/9, -0.1, 0, -2/9 in descending order. 0, -0.1, -2/9, -1, -20/9 Put 5, -13, -62, -1 in descending order. 5, -1, -13, -62 Sort 6, -6, 9 in decreasing order. 9, 6, -6 Sort 0, 22, 15, 5, -2 in decreasing order. 22, 15, 5, 0, -2 Put 6, -9, 0, 2 in ascending order. -9, 0, 2, 6 Sort -26, -5, -70 in decreasing order. -5, -26, -70 Sort 7, 29, -1/3 in descending order. 29, 7, -1/3 Sort 1/2, -0.4, 49/6, 6/7 in increasing order. -0.4, 1/2, 6/7, 49/6 Put 106/5, 0.4, 0, 2/3 in ascending order. 0, 0.4, 2/3, 106/5 Sort 67, 0, 3 in decreasing order. 67, 3, 0 Sort -3, 6, -5, 3 in increasing order. -5, -3, 3, 6 Put -5, 0, -0.13 in descending order. 0, -0.13, -5 Sort -3, 9, -1 in decreasing order. 9, -1, -3 Sort 5, -2/7, 1, 17 in decreasing order. 17, 5, 1, -2/7 Sort -20, 3, -0.4 in descending order. 3, -0.4, -20 Sort -28, 0, 2, -399 in decreasing order. 2, 0, -28, -399 Sort 0.3, -1, 5, 4/47. -1, 4/47, 0.3, 5 Put 0.1, -21, -0.3, 5 in ascending order. -21, -0.3, 0.1, 5 Put -8, -5, 1, -2 in increasing order. -8, -5, -2, 1 Sort -5, 3, 7, -2 in increasing order. -5, -2, 3, 7 Put 8, -1, 0, 1 in ascending order. -1, 0, 1, 8 Sort 19, -273, 1 in decreasing order. 19, 1, -273 Put 24, -3, -56 in decreasing order. 24, -3, -56 Sort 23, -1.3, -2, 8 in decreasing order. 23, 8, -1.3, -2 Put 0, 61, 31, 5, -3 in decreasing order. 61, 31, 5, 0, -3 Put -2, -26, 0, -6 in decreasing order. 0, -2, -6, -26 Put 2, -4, -3, 990 in increasing order. -4, -3, 2, 990 Sort -4, 1, -55, -3 in descending order. 1, -3, -4, -55 Sort -1, -4, 75, 1 in descending order. 75, 1, -1, -4 Sort -4, 0, 5. -4, 0, 5 Sort -4, 0, 106/5 in increasing order. -4, 0, 106/5 Put 5, -31, 4 in descending order. 5, 4, -31 Sort 2, 3, 62. 2, 3, 62 Sort 5, -2/7, 562 in decreasing order. 562, 5, -2/7 Sort -0.5, -2, -1, -0.3, -591. -591, -2, -1, -0.5, -0.3 Sort -0.05, 0.3, -35. -35, -0.05, 0.3 Put -20, -1, -2, 6 in decreasing order. 6, -1, -2, -20 Sort -1, -6, -4, 7. -6, -4, -1, 7 Put -3/7, 162, -3, 3/8, 2 in decreasing order. 162, 2, 3/8, -3/7, -3 Put 4, 0.4, 0.3, 1 in ascending order. 0.3, 0.4, 1, 4 Put 7, 2, -11, 3, 1/7 in increasing order. -11, 1/7, 2, 3, 7 Sort 2, -33, -10 in decreasing order. 2, -10, -33 Put 4, -3, -22, -1 in descending order. 4, -1, -3, -22 Sort -5, -22, -4, 1 in decreasing order. 1, -4, -5, -22 Put 2/5, 0, 2, -3 in ascending order. -3, 0, 2/5, 2 Put -4, 2, -5, -107, 4 in ascending order. -107, -5, -4, 2, 4 Sort 3/4, -31, 4. -31, 3/4, 4 Sort 6/11, 0.2, -12 in decreasing order. 6/11, 0.2, -12 Sort -0.5, -0.1, -0.16 in increasing order. -0.5, -0.16, -0.1 Sort 1, 3, -1/82. -1/82, 1, 3 Put 0.5, -75, -2/5, -1.3, 1/4 in ascending order. -75, -1.3, -2/5, 1/4, 0.5 Put -29, 4, -5 in ascending order. -29, -5, 4 Sort -0.3795, 2/21, 0.5, -2/9 in ascending order. -0.3795, -2/9, 2/21, 0.5 Sort 14, -5, 4 in descending order. 14, 4, -5 Sort -0.3, 15, 0 in increasing order. -0.3, 0, 15 Sort 0.5, -1/5, -1/26, 3 in increasing order. -1/5, -1/26, 0.5, 3 Put -58, 4, -1 in ascending order. -58, -1, 4 Sort -156, 1/3, 3 in decreasing order. 3, 1/3, -156 Sort -1, 26, 5, -3 in increasing order. -3, -1, 5, 26 Put 0, 3, -2226 in decreasing order. 3, 0, -2226 Put 2/11, -2, -2/21, -1.6, -0.2 in descending order. 2/11, -2/21, -0.2, -1.6, -2 Put -1/8, -4/15, 1/4, 0.3 in decreasing order. 0.3, 1/4, -1/8, -4/15 Put 8, 2, 6 in descending order. 8, 6, 2 Sort -1/2, -0.3, -740/17 in increasing order. -740/17, -1/2, -0.3 Sort -1, 2/43, 0.4, -0.4. -1, -0.4, 2/43, 0.4 Put 5, -3, -12, -4 in descending order. 5, -3, -4, -12 Sort 2/199, 0.3, -0.2, 21 in increasing order. -0.2, 2/199, 0.3, 21 Sort 29, 3, 4, -3 in ascending order. -3, 3, 4, 29 Sort 9, -10, -5 in increasing order. -10, -5, 9 Put 3, 9, 4, 996 in decreasing order. 996, 9, 4, 3 Put -18, -0.1, -0.5, -3 in decreasing order. -0.1, -0.5, -3, -18 Sort -5, 27, 4. -5, 4, 27 Sort 0, -5, 9, -4, 4 in ascending order. -5, -4, 0, 4, 9 Put 52, -3, -1 in increasing order. -3, -1, 52 Sort 2, 2/3, -1, 428 in decreasing order. 428, 2, 2/3, -1 Sort 0, 5/2, 15, 1/6, -1. -1, 0, 1/6, 5/2, 15 Put 2/9, 5, -107/5 in decreasing order. 5, 2/9, -107/5 Sort 4, -4, -1.3, -5. -5, -4, -1.3, 4 Put -37, 4, -4, 3 in decreasing order. 4, 3, -4, -37 Sort -2, 36, 4, 3, 1 in increasing order. -2, 1, 3, 4, 36 Sort 0, -2, -5 in decreasi	{ "pile_set_name": "DM Mathematics" }
1 - 2 = 0. -1/4, 1 Let t(q) = 2q3 - 12q*2 + q - 1. Let s be t(6). Let y(n) be the first derivative of 18/5n + s - 6/5n2 + 2/15n*3. Factor y(o). 2(o - 3)*2/5 Suppose -9 - 6 = z. Let c = 33/2 + z. Let -9/2p + 0 - cp2 = 0. What is p? -3, 0 Let h be ((-72)/70)/(75/(-175)). Factor -8/5v*2 + 0 + 2/5v + 2/5v5 + hv*3 - 8/5v*4. 2v(v - 1)4/5 Let m(o) be the first derivative of 361o*4/6 - 304o*3/9 + 16o*2/3 - 111. Factor m(u). 2u(19u - 4)*2/3 Let i = -92 - -89. Let k be (3 + i)(0 - 1). Factor -8/9m4 + 0m - 2/9m5 - 8/9m*3 + k + 0m*2. -2m*3(m + 2)*2/9 Factor -1/5h*5 - 6859/5 + 2527h - 11h4 - 950h*2 - 194h3. -(h - 1)2(h + 19)3/5 Let -106/11y + 4 - 10/11y2 = 0. What is y? -11, 2/5 Let g be (-7 - (-27 + -6))/2 - 11. Factor 3/2i*g + 0 + 0i. 3i2/2 Suppose 265k + 127 = -13k + 1239. Determine b, given that 1/7b*3 + 0b + 0 - 1/7bk + 2/7b*2 = 0. -1, 0, 2 Let f = 16 + -11. Suppose 0 = -p + fp - 8. What is o in 2 - 3o2 - 3o + 3o3 + 4 - 3op = 0? -1, 1, 2 Let v(c) = -c3 + 5c2 + 8c - 9. Let b be v(6). Let y be (-3 - (-9)/b)/(-1). Factor -1/2s4 + ys - 1/2s2 - s3 + 0. -s2(s + 1)2/2 Let f(u) be the third derivative of -u8/728 - 29u7/1365 - 49u*6/390 - 21u*5/65 - 9u*4/52 + 9u3/13 - u2 - u. Find t such that f(t) = 0. -3, -1, 1/3 Let d(p) = 5 - 15 - p + 4. Let w be d(-8). Factor f*5 - 79f*3 + 79f*3 - wf*5 - 2f4. -f4(f + 2) Solve 0 - 2/3v*4 + 8/3v*3 + 4v + 22/3v2 = 0. -1, 0, 6 Let y be ((-16)/156)/(18/3591). Let i = y + 2174/91. Factor ik + 36/7 + 4/7k2. 4(k + 3)*2/7 Let i(j) be the first derivative of 4j - 2/3j3 - j2 - 2. Factor i(z). -2(z - 1)(z + 2) Let o(f) = f2 + 9f + 6. Let x be o(-9). Let s be 1/(x/(-4) + 2). Suppose -3y2 + 8y*2 + 6y + 10ys + 3y*4 + 6y*3 + 6y*3 = 0. Calculate y. -2, -1, 0 Let m(k) = -5k*4 - 26k*3 - 304k*2 - 1000k + 4. Let l(r) = 14r4 + 79r*3 + 911r*2 + 3000r - 11. Let i(x) = -4l(x) - 11m(x). Factor i(b). -b(b + 10)3 Let 9/4i*2 + 3/4i + 3/4i4 + 0 + 9/4i*3 = 0. What is i? -1, 0 Suppose -74u + 78 = -48u. Suppose -4/13y*u + 14/13y*2 - 14/13y + 4/13 = 0. What is y? 1/2, 1, 2 Let l(m) be the second derivative of -m*5/10 - 8m*4/3 - 49m*3/3 + 66m*2 - 2m - 400. Factor l(w). -2(w - 1)(w + 6)(w + 11) Let y be ((-4)/(-132))/(2/142). Let x = y - 20/11. Factor 0n - xn2 + 1/3. -(n - 1)(n + 1)/3 Let y(f) be the second derivative of f*4/48 - 19f*3/6 + 361f*2/2 + 3f + 41. Solve y(m) = 0. 38 Factor -1/6i4 - 1/2i*3 + 0 + 0i*2 + 2/3i. -i(i - 1)(i + 2)2/6 Let k(g) be the third derivative of -g8/560 - 13g7/1050 - g6/75 + g5/25 - 51g*2 - 1. Determine s so that k(s) = 0. -3, -2, 0, 2/3 Let h be 222/(-2)(-20)/(-30). Let w = h - -75. Find f, given that f - 1/4f2 - w = 0. 2 Suppose 0k = -2k + 2. Suppose 0 = -4m + 5y + 20, 5m + 4y - k = -17. Find u such that -2/3u*2 - 14/3u*4 - 2u*5 + m + 0u - 10/3u3 = 0. -1, -1/3, 0 Let z(o) be the second derivative of -o4/4 + 109o*3/2 + 165o*2 - 144o + 3. Determine y, given that z(y) = 0. -1, 110 Let u = -3883 - -3886. Factor 10/21ru - 4/21r*2 + 0r + 0. 2r2(5r - 2)/21 Factor f4 - 337f*2 - 4f + 2f3 + 5f*4 + 2f*5 + 331f*2. 2f(f - 1)(f + 1)*2(f + 2) Let l be (-1 - 1)/(-2)2. Let u = 15325/4 + -3831. Factor -u + 1/4k*l + 0k. (k - 1)(k + 1)/4 Let p = -12820 - -12820. Factor 2/15a*5 + 0 - 2/5a*3 + pa*4 + 0a + 4/15a2. 2a*2(a - 1)*2(a + 2)/15 Let o be ((23625/120)/21)/(2/24). Factor -3/2l3 - 45/2l*2 - 375/2 - ol. -3(l + 5)3/2 Let o be (-1)/(-15) - 440/6600. Factor 4/5j*4 + 0j + 4j2 - 24/5j*3 + o. 4j*2(j - 5)(j - 1)/5 Let x(j) be the third derivative of 4j*2 + 3/2j*5 + 7/3j*4 + 0j + 0 + 4/3j3 - 7/15j*6 - 7/15j7. Solve x(r) = 0 for r. -1, -2/7, 1 Let p(r) be the second derivative of -r7/189 + r6/27 + r5/15 - 16r4/27 - 32r*3/27 - 9r + 2. Find d, given that p(d) = 0. -2, -1, 0, 4 Let t(c) = c*3 + 5c*2 + 4c + 2. Let h be t(-4). Suppose -6 = -hx - 0. Determine k, given that -3k*2 + 3k3 - k2 + 3kx - 2k*3 = 0. 0, 1 Let y(j) = -4j - 25. Let r be y(-6). Let i be -3 - ((-12)/4 + 6/r). Suppose -iv - 2v*2 - 6 - 2/9v*3 = 0. What is v? -3 Let y(m) be the second derivative of 2m*2 + 0 - 1/540m*6 - 1/27m*3 + 1/108m*4 + 1/270m*5 + 7m. Let j(z) be the first derivative of y(z). Factor j(r). -2(r - 1)2(r + 1)/9 Determine o, given that 4/9o - 2/3o*2 + 2/9o3 + 0 = 0. 0, 1, 2 Let b(z) be the second derivative of z6/15 - 28z5/5 + 109z*4/6 - 18z*3 + z + 3. Factor b(v). 2v(v - 54)(v - 1)*2 Let k be (12/54 + (-17)/36)288/(-20). Factor ko2 - 3/5o*3 - 27/5o + 0. -3o(o - 3)2/5 Let u(x) be the third derivative of -x6/30 - x*5/3 - 2x*4/3 - 515x*2. Factor u(f). -4f(f + 1)(f + 4) Suppose -5j + 6 = 2a + 2, 3j = 4a - 8. Let g(c) be the third derivative of 2/33c3 - 5/132c*4 - 1/660c*6 + 0 + 3c*a + 0c + 2/165c5. Factor g(m). -2(m - 2)(m - 1)2/11 Find k such that 4k*4 + 2/3k*5 + 2k*3 - 16k + 0 - 52/3k2 = 0. -4, -3, -1, 0, 2 Let a be (-18)/(-63)(2 - 1). Let n(q) = -q - 3. Let l be n(-3). Factor 0 + ay3 - 2/7y*2 + ly. 2y2(y - 1)/7 Find x such that 0 - 16/5x2 - 12/5x - 4/5x3 = 0. -3, -1, 0 Let j be -3 - (-5 + (-3)/(-1)). Let v = 0 - j. Factor y5 - v + 1 - 3y*5. -2y*5 Let c(o) be the second derivative of -3o*5/20 + 2o*4 + 45o*3/2 + 54o*2 - 284o. Solve c(x) = 0 for x. -3, -1, 12 Suppose -24 = -56d + 50d. Find z such that -2z + 2/11z*d - 18/11z*2 - 8/11 - 2/11z*3 = 0. -1, 4 Suppose 43 + 11 = 6o. Let g be (1/4)/(o - 8). Factor 0m + gm*4 + 1/4m*5 - 1/4m*3 - 1/4m2 + 0. m2(m - 1)(m + 1)*2/4 Find v such that 56v*3 + 2472v - v*4 - 396v*2 - 1331 - 30v*3 + 8v*3 - 778v = 0. 1, 11 Let n be ((-3)/(-9))/((-1)/(-9)). Suppose 0h + 12 = nh + 4t, 0 = -t. Solve 5j*4 - 3jh + j3 - 3j5 + j5 + 3j*5 = 0 for j. -1, 0 Factor -1618d + 629d + 2187 - 28d*3 - 140d*3 - 906d + 3d4 + 2514d*2 - 2641d. 3(d - 27)2(d - 1)*2 Let j = 107 + -103. Let k(p) be the second derivative of -11/4p*j + 3/10p*6 - 6p*2 + 1/14p*7 + 5p - 6p3 - 3/20p*5 + 0. Factor k(l). 3(l - 2)(l + 1)3(l + 2) Let c = -2/9673 + 19356/48365. Let m be (2/30)/((-2)/(-8)). Factor 2/15o2 - co + m. 2(o - 2)(o - 1)/15 Let x(w) be the first derivative of 8w3/63 + 12w*2/7 + 54w/7 + 19. Suppose x(a) = 0. Calculate a. -9/2 Let v(n) be the first derivative of 0n2 + 0n*3 + 37 - 9/8n*4 + 6/5n*5 + 0n - 1/4n6. Factor v(b). -3b*3(b - 3)(b - 1)/2 Let t(q) be the third derivative of 1/30q*5 + 5/12q*4 + 0q + 0 + 4q2 + 0q*3. Factor t(n). 2n(n + 5) Suppose 4z - z = 0. Let f = 4808 + -4804. Factor 2/7rf + 0r*2 + 0 - 2/7r*3 + zr. 2r3(r - 1)/7 Suppose 10n - 124 = 8n. Let b be (-2)/10 + (-3 - n/(-10)). Factor -2/11vb - 2/11v + 4/11v2 + 0. -2v(v - 1)2/11 Let w(d) = 9d*5 - 33d*4 - 196d*3 - 501d*2 - 450d - 125. Let a(n) = n5 - n2. Let p(o) = 22a(o) - 2w(o). Find g, given that p(g) = 0. -5, -1, -1/2 Let k(c) be the first derivative of 6 - 1/6c + 0c*2 + 1/18c*3. Factor k(t). (t - 1)(t + 1)/6 Let o(b) be the first derivative of -b3/3 + b2 + 15b + 18. Suppose o(p) = 0. Calculate p. -3, 5 Let t(w) be the second derivative of -w6/120 - 9w5/80 - w4/2 - 5w3/6 - 6w + 22. Let t(b) = 0. What is b? -5, -2, 0 Let l(j) be the second derivative of j*5/50 + 9j*2/2 + 9j. Let n(q) be the first derivative of l(q). Let n(v) = 0. Calculate v. 0 Factor -1/4s3 - 19 - 37/2s*2 + 151/4s. -(s - 1)*2(s + 76)/4 Suppose -51 = -4g - c - 2c, -g + 17 = 5c. Let y be (g/(-16))/(6/(-16)). Find x, given that 0x + 2/3xy - 2/3 = 0. -1, 1 Let n = -85 - -96. Suppose -18t = -nt. Solve 1/2y*4 + 0y + 0y2 + t - 1/2y*3 = 0. 0, 1 Let n(m) = 5m*4 + 4m*5 - 43m*2 + 43m*2 - 5 - 9m*3. Let u(c) = 12c*5 + 16c*4 - 28c*3 - 16. Let r(k) = -16n(k) + 5u(k). Solve r(y) = 0 for y. -1, 0, 1 Let f(p) = p + 6. Let a be f(5). Factor 4t*4 + 18t + at4 - 140t*3 - 57t*2 + 164t**3. 3	{ "pile_set_name": "DM Mathematics" }
the nearest integer? 75 What is the fifth root of 608 to the nearest integer? 4 What is 1217 to the power of 1/3, to the nearest integer? 11 What is 947 to the power of 1/10, to the nearest integer? 2 What is 1166 to the power of 1/2, to the nearest integer? 34 What is 6136 to the power of 1/2, to the nearest integer? 78 What is the third root of 9473 to the nearest integer? 21 What is the eighth root of 2155 to the nearest integer? 3 What is the seventh root of 10890 to the nearest integer? 4 What is the tenth root of 15891 to the nearest integer? 3 What is the eighth root of 2776 to the nearest integer? 3 What is the eighth root of 2747 to the nearest integer? 3 What is the cube root of 25 to the nearest integer? 3 What is 3154 to the power of 1/9, to the nearest integer? 2 What is 14897 to the power of 1/10, to the nearest integer? 3 What is 2191 to the power of 1/3, to the nearest integer? 13 What is the seventh root of 11187 to the nearest integer? 4 What is the third root of 20245 to the nearest integer? 27 What is 201103 to the power of 1/4, to the nearest integer? 21 What is the third root of 1071 to the nearest integer? 10 What is 810 to the power of 1/9, to the nearest integer? 2 What is 12411 to the power of 1/5, to the nearest integer? 7 What is 8791 to the power of 1/8, to the nearest integer? 3 What is the third root of 4404 to the nearest integer? 16 What is the cube root of 4800 to the nearest integer? 17 What is the third root of 2714 to the nearest integer? 14 What is 1634 to the power of 1/7, to the nearest integer? 3 What is 12435 to the power of 1/3, to the nearest integer? 23 What is 123955 to the power of 1/3, to the nearest integer? 50 What is the third root of 558 to the nearest integer? 8 What is the sixth root of 13200 to the nearest integer? 5 What is the eighth root of 4392 to the nearest integer? 3 What is 10478 to the power of 1/4, to the nearest integer? 10 What is 1558 to the power of 1/2, to the nearest integer? 39 What is 132010 to the power of 1/6, to the nearest integer? 7 What is the square root of 8857 to the nearest integer? 94 What is 82326 to the power of 1/2, to the nearest integer? 287 What is the third root of 14005 to the nearest integer? 24 What is the cube root of 16183 to the nearest integer? 25 What is 4753 to the power of 1/7, to the nearest integer? 3 What is 22095 to the power of 1/2, to the nearest integer? 149 What is 2096 to the power of 1/2, to the nearest integer? 46 What is 3918 to the power of 1/8, to the nearest integer? 3 What is the square root of 17130 to the nearest integer? 131 What is 11516 to the power of 1/4, to the nearest integer? 10 What is 17874 to the power of 1/3, to the nearest integer? 26 What is the fifth root of 9107 to the nearest integer? 6 What is the square root of 30699 to the nearest integer? 175 What is the ninth root of 1043 to the nearest integer? 2 What is the seventh root of 97184 to the nearest integer? 5 What is the cube root of 5922 to the nearest integer? 18 What is the cube root of 74 to the nearest integer? 4 What is 66741 to the power of 1/4, to the nearest integer? 16 What is the ninth root of 5942 to the nearest integer? 3 What is the seventh root of 131599 to the nearest integer? 5 What is the eighth root of 8007 to the nearest integer? 3 What is the third root of 24530 to the nearest integer? 29 What is the tenth root of 5163 to the nearest integer? 2 What is 56546 to the power of 1/2, to the nearest integer? 238 What is 4409 to the power of 1/8, to the nearest integer? 3 What is 95 to the power of 1/9, to the nearest integer? 2 What is 1497 to the power of 1/2, to the nearest integer? 39 What is the seventh root of 192 to the nearest integer? 2 What is the third root of 13756 to the nearest integer? 24 What is 10602 to the power of 1/2, to the nearest integer? 103 What is the square root of 4977 to the nearest integer? 71 What is 14201 to the power of 1/7, to the nearest integer? 4 What is 33940 to the power of 1/10, to the nearest integer? 3 What is the cube root of 4416 to the nearest integer? 16 What is the cube root of 525 to the nearest integer? 8 What is 2736 to the power of 1/2, to the nearest integer? 52 What is 459 to the power of 1/5, to the nearest integer? 3 What is the fifth root of 15249 to the nearest integer? 7 What is 1282 to the power of 1/4, to the nearest integer? 6 What is 694 to the power of 1/2, to the nearest integer? 26 What is 68396 to the power of 1/10, to the nearest integer? 3 What is the square root of 215 to the nearest integer? 15 What is the square root of 53 to the nearest integer? 7 What is the third root of 128615 to the nearest integer? 50 What is 29827 to the power of 1/2, to the nearest integer? 173 What is 401 to the power of 1/8, to the nearest integer? 2 What is 1629 to the power of 1/3, to the nearest integer? 12 What is the square root of 1916 to the nearest integer? 44 What is 2158 to the power of 1/7, to the nearest integer? 3 What is 681 to the power of 1/2, to the nearest integer? 26 What is 5098 to the power of 1/9, to the nearest integer? 3 What is the fourth root of 800 to the nearest integer? 5 What is 2031 to the power of 1/8, to the nearest integer? 3 What is 730 to the power of 1/3, to the nearest integer? 9 What is the third root of 5457 to the nearest integer? 18 What is the fifth root of 7821 to the nearest integer? 6 What is the eighth root of 55415 to the nearest integer? 4 What is the eighth root of 1722 to the nearest integer? 3 What is the cube root of 140071 to the nearest integer? 52 What is 1146 to the power of 1/3, to the nearest integer? 10 What is the third root of 3354 to the nearest integer? 15 What is the fourth root of 10465 to the nearest integer? 10 What is the cube root of 17188 to the nearest integer? 26 What is 81831 to the power of 1/9, to the nearest integer? 4 What is the third root of 31128 to the nearest integer? 31 What is the third root of 17764 to the nearest integer? 26 What is the cube root of 2056 to the nearest integer? 13 What is 924 to the power of 1/2, to the nearest integer? 30 What is the sixth root of 27982 to the nearest integer? 6 What is 10883 to the power of 1/2, to the nearest integer? 104 What is 14981 to the power of 1/5, to the nearest integer? 7 What is 69334 to the power of 1/8, to the nearest integer? 4 What is the third root of 220 to the nearest integer? 6 What is the cube root of 21256 to the nearest integer? 28 What is 344 to the power of 1/7, to the nearest integer? 2 What is the square root of 24328 to the nearest integer? 156 What is the cube root of 62075 to the nearest integer? 40 What is 4252 to the power of 1/6, to the nearest integer? 4 What is 1499 to the power of 1/10, to the nearest integer? 2 What is the cube root of 742 to the nearest integer? 9 What is the third root of 2953 to the nearest integer? 14 What is 5285 to the power of 1/2, to the nearest integer? 73 What is 3750 to the power of 1/3, to the nearest integer? 16 What is 1127 to the power of 1/3, to the nearest integer? 10 What is the square root of 42373 to the nearest integer? 206 What is the square root of 9019 to the nearest integer? 95 What is 4222 to the power of 1/2, to the nearest integer? 65 What is 754 to the power of 1/3, to the nearest integer? 9 What is 19515 to the power of 1/10, to the nearest integer? 3 What is 4591 to the power of 1/4, to the nearest integer? 8 What is 1700 to the power of 1/3, to the nearest integer? 12 What is the third root of 1769 to the nearest integer? 12 What is the cube root of 1641 to the nearest integer? 12 What is 94 to the power of 1/2, to the nearest integer? 10 What is 1576 to the power of 1/2, to the nearest integer? 40 What is the cube root of 4568 to the nearest integer? 17 What is the square root of 106015 to the nearest integer? 326 What is 3075 to the power of 1/2, to the nearest integer? 55 What is the square root of 1603 to the nearest integer? 40 What is 29255 to the power of 1/2, to the nearest integer? 171 What is the third root of 1532 to the nearest integer? 12 What is the fourth root of 913 to the nearest integer? 5 What is 358 to the power of 1/3, to the nearest integer? 7 What is the ninth root	{ "pile_set_name": "DM Mathematics" }
21? False Let p = 0.4 + 0. Let g = p + -0.395. Let x = -943 - -943. Which is bigger: x or g? g Let f be 10/8(119 - -11). Let v(r) = -14r + 10. Let j be v(-10). Is f at most as big as j? True Suppose 9t - 10113 - 5217 = -12t. Which is smaller: 2925/4 or t? t Let o = 259897746 - 1223858464602/4709. Let v = o + -77/17. Let r = v - -839/2216. Is r <= -1? False Let s be -1 + 1 - (-24)/48. Let n = -0.00751 + 24.07751. Let m = 24 - n. Does m = s? False Suppose 0 = 96n - 105n + 990. Suppose -nl + 107l = -1053. Is 351 at most l? True Let k = 58 + -61. Let p be (k - -5)5/10. Which is greater: p or 4/97? p Let w = -5985 + 5983. Let v be (-11)/(-9) + (-6)/27. Let q = v + -2. Which is smaller: q or w? w Let z(v) = 22v + 355. Let i(h) = -7h - 118. Let t(r) = -11i(r) - 4z(r). Let d be t(-11). Is d less than -1/143? True Let k = -36643/2651 - -1/241. Which is smaller: k or -14? -14 Suppose 5f - 29 = -n, f - 17 = -4f + 2n. Suppose fh = 3h + 1086. Let w = h + -2724/5. Is -1 equal to w? False Let i = -26 - -26. Suppose i = 2a + 8 - 16. Suppose 6l = 10l + 25l. Are l and a equal? False Suppose 585 = -c + 16c. Suppose -88k + 2007 = -1425. Is k at least as big as c? True Let y(l) = -l - 66. Let n be y(0). Let f be n/10 + (-8)/20. Let g = 77959 - 77967. Which is smaller: f or g? g Let c = -4134 + 144679/35. Let y = c + 3/5. Suppose 5s + 30 = -5t, 34 = s - t + 30. Which is bigger: s or y? y Let s = 25989/35 - 5209/7. Is 1.768 greater than s? True Suppose 15 + 50 = a - t, 5t = 4a - 266. Is a not equal to 418/7? True Let j = 5158 - 5689. Do j and -3720/7 have the same value? False Let q = 2616.1 - 2616. Does -0.6691 = q? False Let j = 14991 + -209143/14. Which is smaller: 52 or j? 52 Suppose 5004a + 65 = 4939a. Is a at least 4/1665? False Let l(c) = -21c*2 - 126c. Let i be l(-6). Which is greater: i or 9/2491? 9/2491 Suppose -735 = -6f - 15f. Let l = f + -874/25. Is -1 at least l? False Let k be 212/(-6) - 2(-2)/12. Let o = -26 - -16. Let w be o/k + 93/(-7). Which is bigger: w or -12? -12 Let r = 125 + -42. Let s be 1/((-5)/2025-5). Which is smaller: s or r? s Let q be 4/3 - 6/(-9). Let o be (-3 - 18/(-12))(-134)/3. Let t = o + -64. Which is smaller: t or q? q Let r be (-1794)/12 - (-2 + (-14)/(-4)). Let b = -152 - r. Let n = -64 + 371/6. Which is bigger: n or b? b Suppose 0b - 7 = -2y + 3b, y - 2 = 2b. Let h be 12/(-3) + (-1)/y-34. Which is smaller: h or 1/2? h Let m = 0.6756 + 96.3244. Is m less than -2/13? False Let c(j) = 10j - 20. Let d(y) = -2y*2 - 11y - 10. Let m be d(-4). Let v be c(m). Let p be (-1 + v)/((-11)/(-11)). Which is smaller: p or -5/19? p Let c = -0.045 + -5.155. Let h = 4.8 + c. Let n = 0.1 + h. Which is smaller: n or -3? -3 Suppose -3i + 1258 - 124 = 0. Let x = -355 + i. Are x and 23 non-equal? False Let j be 12/(-3)10/(-4). Let t = 43751 - 43743. Is j less than t? False Let s = 104.9 - 16.9. Let r = 130 - s. Let a = 2707/154 - 393/22. Which is smaller: r or a? a Let m(u) = u*3 - 4u*2 - 12u - 5. Let l be m(6). Let r be l - -2 - 168/(-62). Is r > 1? False Let c be (-12)/42 - 19190/(-133). Which is bigger: c or 27? c Let u = 69698 - 69694. Let g = -13 + 44. Which is smaller: g or u? u Let h = -2906.99 - -2907. Suppose -12 - 6 = -3q. Let n be (-6)/(-9)q/8. Which is greater: n or h? n Suppose -o + 49c - 54c = 22, c + 14 = -5o. Let q = 42 - 5. Is o at least q? False Let q(f) = f3 - 2f*2 + 4f - 2. Let x be q(2). Suppose 5m + 4o + 1150 - 1164 = 0, -40 = -4m + 4o. Suppose -c = -m + x. Which is greater: c or 1/70? 1/70 Suppose -5y + z + 325 = 0, 260 = 4y - 52z + 56z. Which is greater: 102 or y? 102 Let p be (-448)/54887/(-123). Which is bigger: -1 or p? p Let b be 19968/84 + (-4)/(-14). Suppose 22t - 15t + b = 0. Does t = -69/2? False Let h be 110/(-1463)161/3657. Which is smaller: h or 1/3? h Let g = -18053 - -2567. Is g at most -15487? False Suppose -t + 14 + 47 = -5g, -4t + 3g + 210 = 0. Let h = 47271 - 47218. Which is smaller: h or t? t Let s(p) = -10p - 40. Let g be s(-4). Suppose g = -2u - 10u - 588. Which is bigger: u or -47? -47 Let q = -272 + 272. Suppose -23s + 8 - 31 = q. Which is bigger: 4/9 or s? 4/9 Let j = -3946/817 + 90/19. Let q = 23 - 23. Which is smaller: j or q? j Let h(i) = -i3 - i + 2. Let x be h(0). Suppose -xp = -2s + 118, 3p + p + 3s + 264 = 0. Let b = p + 64. Which is smaller: b or -3? -3 Let v be ((-544)/24 + 4 - 4)6/4. Is v != -163/5? True Suppose -t + 67 = -5t - 5q, -2t - 5q = 31. Suppose -3b + r + 7 = 0, -b - 2r + 0 = -7. Let o be 27/(-6)2/b - 15. Is o not equal to t? False Let c = 4/21 + -163/84. Let d be (-816)/425 - 8/100. Do c and d have different values? True Let h(p) = 115p*2 - 5p + 25. Let v be h(3). Suppose -3d - 412 = -i, 5d - 353 = -i - v. Is d at most -139? False Suppose 4 = q, -12q - 17 = 3x - 8q. Let n be (2/84)/(x/88). Which is smaller: n or 1? n Let q = 806 - 805.7. Is q at most 33? True Suppose 11f - 17 = 192. Suppose -w = -2t + 7, -t - f = 2w - 0w. Is w less than -6? True Let m be (-2800)/3300(-2 + -235). Which is bigger: m or 200? m Let y(j) be the first derivative of -2j2 - 57j - 2. Let h = 2560 - 2574. Let b be y(h). Is b > 6/53? False Let t be (103)/(1 + 1). Let f be (-174)/7 + (-8)/56. Let p = f + 36. Is p greater than t? False Suppose 40z + 201z = 343396 + 1157070. Is 6229 at most as big as z? False Let v = 26 - 15. Let b(h) = 6h*2 - 23h - 80. Let u be b(6). Which is smaller: u or v? u Suppose 0 = -683h + 688h - 30 - 70. Let o = 15 + -9. Let q be 38/o(-3)/(-1). Does q = h? False Let t(u) = 6u + 102. Let v be t(-17). Suppose -5d - 3s + 565 = v, 6d - s = 10d - 445. Is 108 >= d? False Let n = 2464 - 2334. Which is smaller: 0.2 or n? 0.2 Let l be ((-8)/10)/(3/(-15)) - 1. Suppose -99 = 3j + lu, 0 = -5u + 2u. Which is greater: j or -30? -30 Let m = -11 - -17. Suppose 29 = ms - 43. Let u(b) = b2 + 12b + 11. Let a be u(-12). Is a != s? True Let x = -462491/141245 - -21/3445. Which is smaller: -2 or x? x Let l = 470 + -478. Which is bigger: l or 35? 35 Let z = -1411/3 - -437. Let v = 1340 + -1373. Which is smaller: z or v? z Let y = -281 + 307. Let d be (10(-3)/(-18))/(y/5226). Is 335 bigger than d? False Let r be -17 + (-3248)/(-192) + (-26)/(-24). Is r at most as big as -2/9249? False Let u = 1/10277 - 10468/1962907. Is u greater than or equal to -9? True Let n = 1886 - 1292. Are n and 594 equal? True Let m be 274 - (-13 + -13 + 2). Are m and 326 equal? False Let h(x) = 204x + 551. Let c be h(-5). Which is smaller: c or -472? -472 Let p(l) = 2l3 + 28l*2 - 30l - 13. Let m be p(-15). Let i be 15 + -1 + 8/(-4). Let s be (3 - i - 1)/1. Which is greater: m or s? s Let q = -486 + 489. Are q and 3 equal? True Let a(u) = -9u3 - 2u*2 - 7u - 6. Let s(r) = -r*2 + 30r - 30. Let p be s(29). Let y be a(p). Which is smaller: y or 86/11? 86/11 Let t(v) be the first derivative of v*4/4 - 7v*3/3 + 3v*2 + 13v + 963. Suppose -2u + 6 = -6. Let q be t(u). Is q at most as big as 13? True Suppose -47591 - 110004 = 159j + 244357. Are -2530 and j equal? False Let m = 35234 + -35043. Which is greater: 1718/9 or m? m Let f = -6233.22 - -6211. Let t = -72 + 70.78. Let c = t - f. Is c not equal to 1? True Let o(m) = -8m3 + 177m*2 - 24m + 43. Let q be o(22). Which is smaller: q or 10/1331? q Let n(m) = -27m + 80. Suppose -25c + 13c + 36 = 0. Let u be n(c). Is 51/2 < u? False Let q be ((-81)/(-6) + -1)(-180)/225. Which is smaller: q or -229/23? q Let v(i) = -i*3 + 4i*2 - 4i + 7. Let q be v(3). Suppose -99 + 7 = -qf. Suppose 2c = -3u - f, 3c = 7c - 2u + 22. Do 0 and c have different values? True Let x be 82/56 + (-78)/(-21). Suppose -p + 0 = -3n + 6, 0 = xn + 4p - 24. Is n at most 60/17? True Let c be 5 + 1 + -2 + -445. Let b = c + 605. Do 164 and b have different values? False Suppose 5y - 2y + 4a + 114 = 0, 3y + 3a + 111 = 0. Let b = 0.01681 - 0.21681. Is b at least y? True Let m = 11 - -55. Suppose -3k + m + 54 = 0. Suppose 7g = -k - 289. Which is smaller: g or -48? -48 Let l = -200 - -43. Let q = l - -157. Which is greater: q or 3? 3 Let i = -1317 + 1333. Are 9 and i equal? False Let m(j) = j3 + 3j**2 - j - 2. Let x be m(-4). Let s be ((-27)/18)	{ "pile_set_name": "DM Mathematics" }
is the third biggest value in p, -2, f? -2 Let w(q) = -q*2 + 7q - 5. Let d be w(5). Which is the second biggest value? (a) d (b) 2/7 (c) 0 b Let i = -744/1885 + -2/377. What is the second biggest value in -4/7, i, -2, -0.9? -4/7 Let j be 3/(-12) - 11397/(-84). Let h = -135 + j. What is the third smallest value in -0.5, h, 3? 3 Let w = -0.03 + 5.03. Let u = w + -4.9. Let k be (1/12)/(6/(-16)). Which is the second biggest value? (a) k (b) u (c) 5 b Let t(s) = -s*3 - 3s*2 + s. Let r be t(-3). Let g = -10/39 + 1/156. Which is the second smallest value? (a) 4 (b) g (c) r b Let w = -66 + 329/5. Which is the biggest value? (a) w (b) 5 (c) -4 b Let z = -0.87 - -0.57. Which is the biggest value? (a) z (b) -4 (c) -1 (d) 1/6 d Let g = 1/50 + 9/50. Let j = 1.1 - 6.1. Which is the second smallest value? (a) g (b) j (c) -4 c Let j = 3 - 2.7. Which is the second smallest value? (a) j (b) 0.5 (c) -1/5 a Suppose 1 = z + 3. Let i = z - -1. Suppose -5t = 4j, 3j - 7j + 4 = 4t. Which is the second biggest value? (a) -2/11 (b) j (c) i a Let z be (-52)/10 + 3/15. Let s(v) = -v*2 - 7v - 4. Let l be s(z). Let f be 12/9 + l/(-4). Which is the third smallest value? (a) 2/3 (b) f (c) -1/2 a Let r = -940/7 + 134. What is the smallest value in -5, 0.3, r? -5 Let t = -0.05 - 0.15. Let d(l) = l*2 + 7l + 5. Let z be d(-6). Which is the second biggest value? (a) t (b) z (c) -4 b Let l = -20.5 + 20. Which is the third biggest value? (a) -4 (b) 1 (c) l a Let n = -4.8 - 0.2. Let q = 21.8 - 22. Which is the second biggest value? (a) q (b) n (c) -0.1 a Let u(h) = -4h - 49. Let k be u(-12). Which is the fourth smallest value? (a) -0.4 (b) 5 (c) k (d) -0.2 b Let d = 0.05 - -2.95. Let o = -209/3 + 70. Which is the biggest value? (a) d (b) -4/5 (c) o a Let x = 0.4 - 0.3. Let d = 15 - 11. What is the second biggest value in d, x, -5? x Let z be 18/42 - 10/56. Let r = 25 + -18. What is the third smallest value in 2/9, r, z? r Let n(a) = -2a - 5. Let f be n(-7). Let q be 5/(-7)f/(-15). What is the second biggest value in -0.4, -5, q? -0.4 Let l(t) = 8t*2 - 5t - 3. Let u(j) = j*2 - j - 1. Let v(f) = l(f) - 4u(f). Let n be v(1). Which is the second biggest value? (a) -0.4 (b) n (c) 0.7 c Let j be 6/(-4) + 2/(-4). What is the second biggest value in -5, j, 0.1? j Let l = -21 - -20.7. Let u = 0.8 + l. Which is the second biggest value? (a) u (b) 0.4 (c) 0.04 b Let p = -1.5 + 2. Let v be (6/15)/(4/50). Let k = v + -5. What is the biggest value in p, k, 5? 5 Let k be ((-4)/(-70))/((-9)/90). Let c = 1.9 + 0.1. What is the third biggest value in c, 1/2, k? k Let q be (18/(-40))/(33/88). What is the third biggest value in 8, 3, -5, q? q Let o = 4165/3 + -1254. Let j(w) = -5w2 + 3w + 7. Let t be j(-5). Let y = o + t. What is the third biggest value in -0.2, y, -0.1? -0.2 Let f = 1574/13 + -16061/78. Let z = 85 + f. Which is the third smallest value? (a) -4/9 (b) z (c) -4 b Let l = 0.2 + -5.2. Let k = -1.9 - 0.1. Let f = 3 - k. What is the second biggest value in -4, f, l? -4 Let f = -1/67 + -127/469. Let s = 193/374 + 1/34. What is the smallest value in s, f, -2/15? f Let k be (-45)/3(1/(-9) + 0). What is the third smallest value in k, 2/25, 1/6, 0.4? 0.4 Let q be 10 + (-1 - -3) - -2. Let w = -9 + q. Which is the second smallest value? (a) -5/4 (b) -5 (c) w a Let k be (-28)/238 + (-66)/(-272). Which is the fourth biggest value? (a) -1/11 (b) -3/4 (c) k (d) 1/2 b Let g = 100/3 + -33. Let h = -14 + 20. What is the second biggest value in g, h, 2/7? g Let j = 2.3 + -15.3. Let m = -17 - j. What is the biggest value in 2, -1/8, m? 2 Suppose -2x + 2 = -2m + 4, 2x - 22 = -4m. Suppose -7 = 4n - x. Let q be n - 14/36-2. What is the smallest value in q, 0.3, -2? -2 Let s = 6 - 5. What is the smallest value in s, -2, -0.5? -2 Suppose -3y - y = -8. Suppose -ym - 3m = 0. Let i = -4 - -7. Which is the smallest value? (a) m (b) 0.4 (c) i a Let q = 197/13 + -15. Let u be (-1 + -2)(-28)/12. Suppose 5n - 31 + u = -2l, -4n = -2l - 12. Which is the third smallest value? (a) q (b) 1/6 (c) l c Let x = -90.5 - -90. What is the second smallest value in -2/15, x, -0.2, 0.5? -0.2 Let q(j) = -j2 - 11j + 4. Let u be q(-11). Let r = 2 - u. Which is the second biggest value? (a) r (b) 2/7 (c) 2 b Let r = -29 + 146/5. Which is the biggest value? (a) -0.3 (b) r (c) -0.02 b Suppose 0y = 2y. Let p be (1354/(-10) + -2)-1. Let j = 137 - p. What is the second biggest value in -1/11, y, j? -1/11 Let f = -679051967/132706089 + 2/776059. Let w = -47/9 - f. What is the second biggest value in 3, w, -2/9? w Let c(b) = -b. Let k be c(-3). Let y = 4 + 1. Let m = 0.5 - 0.1. What is the smallest value in y, m, k? m Let l be 2 + 100/(-26) - -2. Let t = 77 - 80. Which is the third smallest value? (a) l (b) t (c) 0.04 a Let h = 21 + -22. Let p = -0.2 - -2.2. What is the second biggest value in 1, p, h? 1 Let n = -0.2 + 0.25. Let s = n + 0.05. Which is the third biggest value? (a) s (b) 4 (c) -4 c Let l = 1.7 - 2. Suppose -2p - 6 = -g - g, -5 = 5g + 5p. Let t be 2 - (0 + (g - -2)). Which is the second smallest value? (a) 5 (b) t (c) l c Suppose h = 5h - 220. Let x = h - 221/4. Which is the third biggest value? (a) -3 (b) x (c) -2/7 a Let k = -0.2 + 0.7. What is the third biggest value in k, 0.3, -4, -5? -4 Let j = -3/2 - -4/3. Let f(k) = k + 7. Let q be f(-5). Suppose -3 = 2g - 1, -5g - q = w. Which is the second smallest value? (a) 3/7 (b) w (c) j a Let m = -6.4 - -6.9. Let i = 16 + -11. Which is the second smallest value? (a) i (b) m (c) 0.3 b Suppose -1 = p + 1. Let o = -0.06 - 4.94. Let r = o + 5.4. Which is the third biggest value? (a) -0.1 (b) r (c) p c Let r be ((-5)/2)/(11/22). What is the second biggest value in r, 0, 1? 0 Let r = 6 + -11. Let u = 2.05 - 0.05. Suppose -4 = 6p - 4p. Which is the third smallest value? (a) r (b) u (c) p b Let y = 678 - 2599/4. Let h = -29 + y. Which is the smallest value? (a) -1 (b) 2/7 (c) h a Let g = 0.078 + 0.422. Let k be 1 + 0 - 2 - 3. Which is the third smallest value? (a) k (b) 5 (c) g b Let p = 4.7 + -5. Which is the second biggest value? (a) 27 (b) p (c) 2 c Let s = 27 + -33. Which is the smallest value? (a) s (b) 0.5 (c) 2 a Let f = 79 - 79.02. Which is the third biggest value? (a) 1 (b) -3 (c) f (d) 2 c Let z = -83 - -82. What is the third smallest value in 2/9, z, -2/17, -0.5? -2/17 Let t = -0.26 - 0.04. Let b = -6 - -6. Let h = b - t. What is the second biggest value in 1, 3, h? 1 Let y(v) = 3v3 + v2 - v + 1. Let q be y(1). Let i = -0.512 + 0.012. What is the third smallest value in i, 3/7, q? q Let v = 335 - 3013/9. Let s = 0.1 + -0.2. Which is the third biggest value? (a) s (b) -1 (c) v b Let c = 1.2 + -5.2. Let j(l) = -2l2 - 2l - 2. Let a be j(-2). Let y = a + 10. What is the biggest value in -1/5, c, y? y Let k = -11 - -10.7. What is the biggest value in 0.1, k, -4? 0.1 Suppose -t = d + 1, t + 3 = 4d + 27. Which is the smallest value? (a) -4 (b) d (c) -3 b Let k = 38 + -65. Let l be 8/9 + 18/k. Which is the biggest value? (a) l (b) -0.2 (c) 0.1 a Let o = -47 - -49.9. Let u = o - 0.1. Let k = 3 - u. Which is the third smallest value? (a) 1 (b) k (c) 0.5 a Let h = 1.94 - -0.06. Let z = -5 + 4.7. Let r = z - -0.2. What is the second smallest value in r, 0, h? 0 Let f = -6 - -6.3. Let d be (131/12)/(44 - 3). Let w = 2/123 - d. What is the second smallest value in f, w, 5? f Let q be (-7 - (-292)/40)10/(-12). Which is the second biggest value? (a) 5 (b) q (c) 3/4 c Let h = -0.2 + -0.3. Suppose -36 = 5j - 4r - 10, 0 = 3j + 4r - 10. Let v = 0.6 + -0.3. Which is the smallest value? (a) h (b) j (c) v b Let j be 32/40 - 3/10. Let i = 0 + -2. What is the biggest value in i, 2/3, j? 2/3 Let h = 0.47 + -5.47. Let n = 4 + -4.3. Which is the third biggest value? (a) h (b) 2/13 (c) n a Let w = 0.04 + -0.12. Let r = 0.08 + w. What is the smallest value in r, 3, -5? -5 Let z = 5623/18 + -312. Let q = z + 1/9. Let g = 5.6 - 6. Which is the second smallest value? (a) 1 (b) g (c) q c Suppose -m + 10 = -3m - 5n, 15 = -3m - 2n. What is the second smallest value in 2, m, 0.1? 0.1 Let w(t) = -t3 + t2	{ "pile_set_name": "DM Mathematics" }
mber? False Is 132626712451 prime? True Is 201366643 composite? False Is 252763301 prime? False Is 80893811629 composite? False Is 89014043 a composite number? False Is 823142279 a composite number? False Is 1407047947 composite? False Is 1781183791 a composite number? False Is 1279363994 prime? False Is 29840483051 prime? True Is 7157462737 prime? True Is 75624517 a composite number? True Is 5696006755 a prime number? False Is 47845152179 composite? True Is 322724839 a composite number? False Is 8431416557 a composite number? False Is 15469503173 a composite number? True Is 202217143 a prime number? False Is 3841731742 composite? True Is 14293347571 prime? True Is 608509709 prime? False Is 14027181263 a composite number? False Is 144204787 composite? False Is 53521171023 a prime number? False Is 623511857 a prime number? True Is 260495089 a composite number? True Is 17396198671 prime? True Is 19476533 prime? False Is 24041730767 a prime number? True Is 4409991059 prime? False Is 1848720689 composite? True Is 29054776531 a composite number? True Is 16333915223 a composite number? False Is 9879502607 a prime number? False Is 2901696547 a prime number? False Is 33232472803 a prime number? True Is 39002165693 prime? True Is 6515539759 a prime number? False Is 9677910071 prime? True Is 6511822303 composite? True Is 603454147 a composite number? True Is 19193851459 a composite number? True Is 15112444201 a prime number? True Is 19005433971 a prime number? False Is 3283228303 composite? False Is 52371828607 prime? False Is 2256640277 a composite number? True Is 95598372089 prime? False Is 7414528987 prime? True Is 6031907381 composite? False Is 203924767 prime? True Is 7803400669 a composite number? False Is 71859869 composite? True Is 200117873 composite? False Is 1757824429 composite? True Is 533451461 composite? False Is 1276953319 a prime number? False Is 655730741 a prime number? True Is 4305127013 composite? True Is 7981580273 a prime number? True Is 134584381 prime? True Is 14738919353 composite? False Is 585689053 a prime number? True Is 933795191 a prime number? False Is 4242282781 composite? True Is 10212431765 a composite number? True Is 276634349 composite? True Is 957658829 a prime number? True Is 13231639559 a prime number? False Is 18031481333 a prime number? False Is 9765960959 prime? False Is 18116041529 a composite number? False Is 4125113637 composite? True Is 2052704657 prime? True Is 3687345053 composite? True Is 1005957809 a composite number? False Is 62689580117 composite? True Is 930750113 a composite number? True Is 353343281477 prime? True Is 9503679463 composite? True Is 2818027439 a composite number? False Is 24594246973 prime? False Is 2801125007 composite? False Is 183842401081 prime? False Is 6010901893 a prime number? True Is 8418891491 prime? True Is 77890249 composite? False Is 4708279657 prime? True Is 883683011 a composite number? True Is 3105811919 a prime number? False Is 18322947527 prime? True Is 89205407909 a composite number? False Is 32793679211 a prime number? True Is 2671814051 composite? True Is 763050319 a prime number? True Is 220694801 a prime number? False Is 145813841 composite? False Is 5901371923 prime? False Is 99650077 a composite number? False Is 947928154 a composite number? True Is 966866963 composite? False Is 751223779 composite? False Is 6348516371 prime? True Is 12095591519 prime? False Is 11695666837 a composite number? False Is 51178166267 a composite number? False Is 30275206427 a composite number? True Is 49175366351 a prime number? False Is 5627349713 composite? False Is 14621522891 prime? True Is 714971107 composite? True Is 458067179 composite? True Is 55000474913 a composite number? False Is 107546963 prime? False Is 3375267277 a prime number? False Is 1476168373 prime? True Is 1707605051 a composite number? False Is 1448372119 prime? True Is 6485056121 prime? True Is 1491781567 a prime number? True Is 2044846393 a composite number? False Is 740349217 prime? False Is 140651249 prime? False Is 5859940393 a prime number? True Is 39597545101 a prime number? True Is 112315077205 composite? True Is 183876449 composite? False Is 29242818431 prime? True Is 82797577887 composite? True Is 10651707041 a composite number? False Is 260197451 a composite number? True Is 1564855499 composite? False Is 3200545379 a composite number? False Is 5910621917 a composite number? False Is 426996154703 a composite number? False Is 88656454207 a composite number? True Is 320527021 a prime number? True Is 1379823733 a prime number? False Is 4254839513 a prime number? True Is 355405693 composite? False Is 289138559 prime? True Is 28123149773 a composite number? True Is 3179212481 a composite number? True Is 219344091 prime? False Is 30638073259 a composite number? False Is 6297199903 prime? False Is 798944329 composite? False Is 10320514679 composite? False Is 6588216995 a composite number? True Is 649752121 composite? True Is 19298653027 a prime number? False Is 4624891762 composite? True Is 401547397 prime? False Is 841595669 a prime number? False Is 8199041989 a composite number? False Is 5956859603 composite? False Is 47962298687 composite? True Is 126411755 a prime number? False Is 5686654501 a prime number? False Is 11328153743 composite? False Is 38027187587 prime? True Is 28896960769 a prime number? True Is 175429187 prime? True Is 846192539 a prime number? True Is 329087539 a composite number? True Is 2951045159 composite? False Is 152984807 a prime number? True Is 117951375943 composite? True Is 2712923473 prime? False Is 4089581 prime? True Is 27272287639 composite? False Is 81151463 prime? False Is 46548679 prime? True Is 1915834673 prime? False Is 24955379167 composite? False Is 1358301653 a composite number? True Is 489919093 a composite number? True Is 1331805833 prime? False Is 49072763813 a prime number? True Is 401641277 a prime number? True Is 9230732717 a composite number? False Is 2811926219 prime? False Is 1643455727 composite? True Is 4759588909 a prime number? False Is 5239179343 composite? True Is 4353033697 a composite number? True Is 7517936926 composite? True Is 308219911 prime? False Is 624921121 prime? False Is 1807426297 composite? True Is 156308767 composite? False Is 692580107 a composite number? True Is 1991700427 prime? False Is 51102299 prime? False Is 13567104349 a prime number? True Is 39528697907 a prime number? True Is 126266147 composite? True Is 43767337443 prime? False Is 7584735407 composite? False Is 2268320227 composite? False Is 209179079 a prime number? True Is 5980748759 a composite number? False Is 38529162803 composite? False Is 17898446053 prime? True Is 1490652797 composite? True Is 25478591771 a composite number? True Is 6518855197 a composite number? True Is 19685081683 a prime number? True Is 8136680473 prime? False Is 1992663389 a prime number? False Is 7221018347 composite? True Is 138811921 a composite number? False Is 594576533 a composite number? True Is 8613668041 prime? False Is 1784533885 a prime number? False Is 3404427071 prime? True Is 4757525657 a composite number? True Is 465070577 prime? False Is 20354104861 prime? False Is 49729270147 composite? True Is 10401340447 composite? False Is 20537539235 a composite number? True Is 976514173 a composite number? True Is 9925218599 a composite number? False Is 12704203957 prime? False Is 1535634979 prime? False Is 111838127 prime? True Is 5607694349 a composite number? True Is 612260245 prime? False Is 408868237 a prime number? False Is 32846725427 prime? True Is 14321544487 prime? False Is 6587562829 composite? False Is 7322428397 composite? True Is 10313555803 a prime number? True Is 369833909 prime? True Is 656010167 composite? False Is 5219934497 composite? False Is 390913079 a composite number? True Is 50622452777 prime? False Is 60624397081 a prime number? False Is 156874306949 composite? True Is 611762377 composite? False Is 10726342667 prime? True Is 7598368153 a prime number? True Is 3912932027 a composite number? False Is 222044974889 a prime number? False Is 240828277 prime? True Is 828083309 composite? False Is 102232124359 composite? False Is 145797709 composite? False Is 4307714	{ "pile_set_name": "DM Mathematics" }
2sqrt(432) - sqrt(432)))/(sqrt(9) - (sqrt(9) - -1sqrt(9) - sqrt(9))-4). 0 Simplify (sqrt(63) + sqrt(63) + 1 + 5)2. 72sqrt(7) + 288 Simplify 6(-2sqrt(3)-5)2-4. -7200 Simplify 2(sqrt(209) + (sqrt(209) - (sqrt(209) - -3sqrt(209)2)))/(sqrt(1100)2 + sqrt(11) + sqrt(11)). -5sqrt(19)/11 Simplify -6(2 + sqrt(320))*2-4. 768sqrt(5) + 7776 Simplify sqrt(684) + sqrt(684) + -2 + 2 + sqrt(684). 18sqrt(19) Simplify (sqrt(152) - -4(sqrt(152)-2 + sqrt(152)))/(sqrt(32)/sqrt(4)3). -sqrt(19) Simplify (sqrt(2420) + (1sqrt(2420) - sqrt(2420) - sqrt(2420)))/(sqrt(40)/sqrt(16) - sqrt(10)). 0 Simplify 5sqrt(39)/sqrt(3)4. 20sqrt(13) Simplify (1(sqrt(70) + (sqrt(70) - -1sqrt(70))))/(-5sqrt(40)/sqrt(4)). -3sqrt(7)/5 Simplify ((1 + sqrt(5))3)*2 - sqrt(5)-2-2 - ((sqrt(45) - sqrt(45)-1)2)2. -666 + 14sqrt(5) Simplify ((sqrt(60) - sqrt(180)/sqrt(3))/sqrt(12)-1)2. 0 Simplify 0 + (sqrt(720) - (sqrt(720)2 + -1)*2). -2881 + 60sqrt(5) Simplify 5sqrt(171) - 1sqrt(475). 10sqrt(19) Simplify (sqrt(17) - (sqrt(204)2)/sqrt(12) - (5 + 1 + sqrt(17)))*2. 24sqrt(17) + 104 Simplify 3sqrt(3) + 4 + sqrt(3) - (sqrt(3) + 2 + -5). 3sqrt(3) + 7 Simplify (4 + (sqrt(68)-1)/sqrt(4))5-1. -20 + 5sqrt(17) Simplify -1 + sqrt(76) - ((sqrt(133)/sqrt(7) + 2)*2 - sqrt(19)). -24 - sqrt(19) Simplify ((sqrt(1539) - (sqrt(1539) + 2))-5 - (-2 + sqrt(1539) + -1sqrt(1539)))2. 144 Simplify sqrt(40)/((sqrt(88)-3)/sqrt(11)). -sqrt(5)/3 Simplify (sqrt(242) + (sqrt(242)2 + sqrt(242))-6)*2. 69938 Simplify (sqrt(13) + 2)-6 - (5 + sqrt(78)/sqrt(6) + sqrt(13)). -8sqrt(13) - 17 Simplify ((sqrt(245) + -1)1)*2 + sqrt(245) + -1. -7sqrt(5) + 245 Simplify (-2sqrt(11) + 0)2 + 4. 48 Simplify (sqrt(3)3 + 5)2. 10 + 6sqrt(3) Simplify 3-4sqrt(33)/sqrt(275). -12sqrt(3)/5 Simplify sqrt(63) + 2 + (3sqrt(112))*2. 3sqrt(7) + 1010 Simplify (sqrt(171) + sqrt(19))6 + 1. 1 + 24sqrt(19) Simplify sqrt(224)/(-2sqrt(7)). -2sqrt(2) Simplify 4 + (sqrt(15)/(-2sqrt(3)) - (sqrt(5) - -4sqrt(5)2)2). -401 - sqrt(5)/2 Simplify (1(sqrt(30)4)/sqrt(10)4)*2. 768 Simplify sqrt(1452) + 1. 1 + 22sqrt(3) Simplify (2sqrt(80) - sqrt(5)) + ((sqrt(5) - sqrt(25)/sqrt(5))-3)*2 + sqrt(5). 8sqrt(5) Simplify (sqrt(52) - (sqrt(364)/sqrt(7) + 2))*2. 4 Simplify (0 + -2sqrt(2))-2. 4sqrt(2) Simplify (sqrt(176) + sqrt(176) + 0 + sqrt(176))*2 + -5. 1579 Simplify sqrt(5) + sqrt(20) + 2 - (sqrt(5) - 5sqrt(10)/sqrt(2)). 2 + 7sqrt(5) Simplify sqrt(18)/(sqrt(9)-3 + sqrt(9)) + (2sqrt(8))2. -sqrt(2)/2 + 32 Simplify (-45sqrt(77) + sqrt(77))/sqrt(11). -19sqrt(7) Simplify (sqrt(405) + -1 + sqrt(405) + -1)5. -10 + 90sqrt(5) Simplify sqrt(931)2 + -1. -1 + 14sqrt(19) Simplify (sqrt(152)/sqrt(72) - sqrt(304)-6)2. 101251/9 Simplify ((sqrt(119)/sqrt(28))2-5 + -1)3. -267/4 Simplify ((sqrt(204) + (sqrt(204)1 - sqrt(204))2 + sqrt(204) - sqrt(204)) + sqrt(204))/(sqrt(108)/sqrt(36)). 4sqrt(17) Simplify (sqrt(99)/(sqrt(576) + 3sqrt(576)))2. 11/1024 Simplify (sqrt(280)/(sqrt(24)/sqrt(3)))/sqrt(5). sqrt(7) Simplify (sqrt(112)-3 + sqrt(7) + sqrt(7) - (0 + sqrt(7)2)) + -4. -12sqrt(7) - 4 Simplify -6(-1 + sqrt(180)). -36sqrt(5) + 6 Simplify -4(0 + (sqrt(2880)-1)/sqrt(10)). 48sqrt(2) Simplify ((-1sqrt(98))/sqrt(7))/((sqrt(140)/sqrt(4))/sqrt(5)). -sqrt(2) Simplify 3 + (sqrt(2) - sqrt(2)-1)2 + -4. 7 Simplify (5 + -1 + (sqrt(52)/sqrt(4) - sqrt(13)) + sqrt(13) + 5)2. 18sqrt(13) + 94 Simplify (-3sqrt(4235))/sqrt(7). -33sqrt(5) Simplify (-5 + sqrt(98) + -2sqrt(98))2. 70sqrt(2) + 123 Simplify (sqrt(208) + sqrt(208)-2 + sqrt(208))/(sqrt(16)-2). 0 Simplify 4 + 0 + sqrt(720). 4 + 12sqrt(5) Simplify 1 + (-2 + sqrt(272))2 + sqrt(85)/(sqrt(5)2). -31sqrt(17)/2 + 277 Simplify 0 + sqrt(102)/((sqrt(66) + (sqrt(66)2 + sqrt(66) - sqrt(66)))/sqrt(11)). sqrt(17)/3 Simplify (1 + sqrt(425) + sqrt(425)-3)2. -20sqrt(17) + 1701 Simplify (sqrt(637) - (sqrt(637) - (sqrt(637) + ((sqrt(637)-2)2 - sqrt(637)) + 3)))1 + -5. 2546 Simplify 5 + 3sqrt(288) + 5. 10 + 36sqrt(2) Simplify ((sqrt(816) - (sqrt(816) - (sqrt(816) + sqrt(816) + sqrt(816) + sqrt(816)-1)) - sqrt(816))/sqrt(3))2. 272 Simplify (-5sqrt(85)1)/sqrt(5)6. -30sqrt(17) Simplify (0 + (sqrt(1900) + -1)2)6. -120sqrt(19) + 11406 Simplify sqrt(60)/(1sqrt(972) + sqrt(972)) + -1. -1 + sqrt(5)/18 Simplify (sqrt(5)24)*2 + sqrt(360)/sqrt(8). 3sqrt(5) + 320 Simplify 1((sqrt(325) + sqrt(325) + -1)2 + sqrt(325)). -15sqrt(13) + 1301 Simplify ((sqrt(833)-1 + sqrt(17) + sqrt(153) + 1)3)*2. -54sqrt(17) + 1386 Simplify -1 + sqrt(272) + 1. 4sqrt(17) Simplify (sqrt(1053) + -2)2-5 + ((5(sqrt(1053)-1 + sqrt(1053)))*2 - sqrt(1053)). -5285 + 171sqrt(13) Simplify (sqrt(25)/sqrt(5)-3 + sqrt(405) + 2)2. 24sqrt(5) + 184 Simplify (6(-2sqrt(1900))*2 - sqrt(1900)) + -1. -10sqrt(19) + 45599 Simplify sqrt(136)/(sqrt(32)/sqrt(4)) + sqrt(1377) + -1 + -4. -5 + 10sqrt(17) Simplify (-2 + -2sqrt(3)-1 + sqrt(24)/(sqrt(24)/sqrt(3)))2. -12sqrt(3) + 31 Simplify -3((sqrt(18) + 1)-5)*2. -1425 - 450sqrt(2) Simplify 4 + ((sqrt(84)/sqrt(3))/sqrt(4) - sqrt(7) - sqrt(7)). -sqrt(7) + 4 Simplify ((sqrt(117) + -1)-5 + sqrt(117))2 + 0 + 0. -120sqrt(13) + 1897 Simplify -2sqrt(200) + sqrt(200) + -2. -10sqrt(2) - 2 Simplify (sqrt(99)/(6(sqrt(144) + sqrt(9) + sqrt(9))))2 + 1. 1307/1296 Simplify (sqrt(832) + (sqrt(832) + 0 + sqrt(832))5)*2 + 2. 100674 Simplify (sqrt(44)-5 - sqrt(11))*2 - sqrt(55)/(sqrt(125) - sqrt(5)). -sqrt(11)/4 + 1331 Simplify (sqrt(325) - (-2sqrt(325) + -4))*2 + sqrt(325) - (3sqrt(325) + -3 - sqrt(325))*2. 185sqrt(13) + 1632 Simplify (-3(sqrt(55) + sqrt(220)/sqrt(4) - sqrt(55)))/(2sqrt(80)). -3sqrt(11)/8 Simplify ((sqrt(68) + -2sqrt(68))2-1)*2. 272 Simplify 4sqrt(931) - (5 + sqrt(19))-3. 15 + 31sqrt(19) Simplify -33(sqrt(19) + 0). -9sqrt(19) Simplify 3(-1(sqrt(1377) + 1) - (0 + sqrt(1377))5)*2. 324sqrt(17) + 148719 Simplify 2 + sqrt(700) + -4 + 4. 2 + 10sqrt(7) Simplify (-3 + -5sqrt(1300))*2. 300sqrt(13) + 32509 Simplify (1sqrt(42)/sqrt(3) - sqrt(14))/(sqrt(98) + (sqrt(98) + sqrt(98)1 - sqrt(98) - sqrt(98)) + sqrt(98) - sqrt(2)). 0 Simplify ((-3 + sqrt(13))-2)21-4. -352 + 96sqrt(13) Simplify (-2 + sqrt(55)/(sqrt(20)/sqrt(4)))*2. -4sqrt(11) + 15 Simplify 0 + ((5sqrt(104) - sqrt(104)) + sqrt(104))/sqrt(8). 5sqrt(13) Simplify sqrt(98)-2 + sqrt(2400)/sqrt(12). -4sqrt(2) Simplify sqrt(152)/(2sqrt(392) + sqrt(392)) - sqrt(57)/(sqrt(27) + (sqrt(27) - sqrt(432) - sqrt(27)) - sqrt(3)). 31sqrt(19)/210 Simplify (-4 + -1sqrt(832) + 2 + sqrt(832) + sqrt(832))2. -32sqrt(13) + 836 Simplify (sqrt(104)15)/((sqrt(16)1)/sqrt(2)). 5sqrt(13) Simplify (sqrt(208)-2 - sqrt(208))-2. 24sqrt(13) Simplify 0 + sqrt(125) + (sqrt(405) + 1 + sqrt(5))2. 25sqrt(5) + 501 Simplify (3(sqrt(65) - (-2sqrt(65) + sqrt(65))) - sqrt(65))/(sqrt(5) + (sqrt(405) - sqrt(405)1)). 5sqrt(13) Simplify 5((sqrt(1053) + -1)6)*2. -3240sqrt(13) + 189720 Simplify (-2(-2sqrt(243) + sqrt(243) - sqrt(243)))*2 + ((sqrt(243) + 0)-6)*2. 12636 Simplify -5(-1 + sqrt(3)4 + 0). -20sqrt(3) + 5 Simplify (sqrt(135) - (sqrt(135) + sqrt(135)2 + sqrt(135)))/sqrt(3)3. -27sqrt(5) Simplify (sqrt(17) - (sqrt(17) - (sqrt(17) + -1(-1 + sqrt(17))))) + (sqrt(1088)2 + sqrt(1088))2. 9793 Simplify ((2sqrt(153) + 1)-1)2. 12sqrt(17) + 613 Simplify (-1(-3 + sqrt(27) - sqrt(27)))2. 9 Simplify (sqrt(38) - (sqrt(3078) - sqrt(3078)5))/sqrt(2). 37sqrt(19) Simplify 1 + ((sqrt(252)-2)*25 + sqrt(252) - sqrt(252) - sqrt(252)). -6sqrt(7) + 5041 Simplify (sqrt(36)/(-6sqrt(48)/sqrt(4)) + -4)5. -20 - 5sqrt(3)/6 Simplify ((((sqrt(245)-1 - sqrt(245)) + sqrt(245) + sqrt(245))/sqrt(7))/sqrt(7))2. 0 Simplify sqrt(5) + 1 + sqrt(5) + sqrt(5) + 1 + ((sqrt(180) - (1 + sqrt(180))) + sqrt(180))2. -9sqrt(5) + 183 Simplify (sqrt(240)1)/(sqrt(9)/(sqrt(3) + (sqrt(3)-2 - sqrt(3)))). -8sqrt(5) Simplify -1 + -2 + sqrt(833) + sqrt(833). -3 + 14sqrt(17) Simplify -4(sqrt(44) - (sqrt(44) + -2)2). -40sqrt(11) + 192 Simplify (-3 + 4 + (sqrt(180) - (-1 + sqrt(180))) + 1)*2. 9 Simplify -3(sqrt(637)3 - sqrt(637))3. -126*sqrt(13) Simplify (0 + sqrt(4)/(sqrt(2) + (sqrt(2) - (sqrt(72)/sqrt(4))/s	{ "pile_set_name": "DM Mathematics" }
luate (8/6 - 629/510)2. 1/5 Calculate (0 + -1)/(2/(-6 + 12)). -3 Evaluate (-2)/14 - (-2 - 371/(-147)). -2/3 What is the value of (-4)/(-3)(-3)/(-10)? 2/5 6/2 - 1297/315 2/15 Evaluate 5 + -10 + (6 - 6). -5 Calculate (-4)/(((-135)/(-10))/(-9)) + -2. 2/3 What is the value of 27/42(-2)/(-15)5? 3/7 What is (108/216)/((-1)/14)? -7 What is the value of 5 - (-1)/(-4 + (-162)/(-42))? -2 What is (2/(-8))/((-197)/(-28) + -7)? -7 (-87)/(-168) - 2/14 3/8 What is (-2)/5 + 3/459? 1/5 What is -2 - (-321)/33 - (-111)/407? 8 (-4)/5(-40)/(-176) -2/11 Calculate ((-19)/(-2) - 7)/(3/2). 5/3 Calculate (-7)/(154/4) + 155/(-55). -3 Evaluate ((-275)/(-770))/(10/(-8)). -2/7 Evaluate ((-3)/(-9))/(30/(-20)). -2/9 What is -1((-20)/(-1 - 3))/(-1)? 5 Evaluate -11146/(-219). 2/3 Evaluate 0 + (2/56)/((-4)/(-14)). 1/8 (-511/220)/(7/8) -2/7 What is the value of 2 + -3 - -5 - (2 + -2)? 4 Evaluate -4(-3)/(-36)-21 - 2. 5 Evaluate 4/615/40. 1/4 Calculate (0 + -2)1 + (-6020)/(-3311). -2/11 What is the value of (28 + -31)(-6)/(-45)? -2/5 Evaluate ((-2)/(-1) - 4)2. -4 What is (-30)/240 + 7/(-72)? -2/9 (96/(-240))/(-3 - 74/(-30)) 3/4 What is the value of (-7)/((-7)/3) + 1-2? 1 What is 0 + -1 + 1 - (-2)/(-4)? -1/2 Calculate 2/(-2 - 0) + (-3)/(-4). -1/4 Calculate (-9)/15(1 + 4). -3 Calculate (130/52)/(1/(-2)). -5 Calculate (-252)/168(-3 - 1). 6 Evaluate (30/40)/(-3) - 1/(-4). 0 75/(-20)(-72)/(-54) -5 Calculate (-48)/1605/2. -3/4 Evaluate (-1)/(-5 - (-64)/(-56) - -6). 7 (-6)/(-15)(12 - 2) 4 What is (1/6)/((-67)/(-335))? 5/6 (-64)/(-22) + (-20)/(-220) 3 Calculate (0/3 - 0)/1. 0 Evaluate (-30)/(-8) - 360/480. 3 Calculate 6/(-4)(-176)/924. 2/7 Calculate (-5)/3(-14 - 2227/(-170)). 3/2 Calculate 2/(-1) + -4 + 3/3. -5 What is the value of -17 + (-1704)/(-96) - 6/16? 3/8 Calculate (30/(-150))/((-9)/(-15) - 3). 1/12 Evaluate (-6)/(322/6). -3 What is (-38)/(-95) - (2 + 14/10)? -3 Evaluate (25/50)/(-1 + 12/(-8)). -1/5 What is the value of (406/116)/(-3 - (-86)/24)? 6 Evaluate ((-6)/(-20))/(2 + 9/9). 1/10 Calculate 1575/135 + 36/(-3). -1/3 What is the value of (-16)/32(-2)/(-18)6? -1/3 What is the value of 2/11 + 817/(-1892)? -1/4 Calculate (6 + -5 + 1)/5. 2/5 Calculate ((-32)/(-6))/8 + (-44)/30. -4/5 Calculate (3(-5)/(-2))/(96/64). 5 What is (-5)/(-2)72/135? 4/3 What is the value of 3 + (-20)/7 + 56/(-98)? -3/7 -1 - 143/(-13) - 11 -1 What is 15/(-40) - 36/32? -3/2 What is 2 + (3/((-15)/20) - 0)? -2 3/(15/2) - 28/70 0 75/(-100)(-2)/3 + -1 -1/2 Calculate (3/6)/((-73)/584). -4 15/6342/(-105) -2/21 What is the value of (2/10)/((-3)/(-45))? 3 Evaluate (3/18010)/(2/(-8)). -2/3 What is the value of 3 + (-47)/15 - 217/735? -3/7 Calculate 3/(-8) + (-57)/(-456). -1/4 Calculate ((-4)/(-8))/((-10)/(-3) + -3). 3/2 Evaluate 4/14 + (-192)/476. -2/17 (-9)/22(3 - (-124)/(-36)) 2/11 What is -4 - ((-6)/(-51) + 159/(-51))? -1 What is (-372)/90 - 14/(-105)? -4 Calculate -2(-6)/(-54) - 244/36. -7 6/33 - 52/(-1287) 2/9 Evaluate ((-1)/((-1)/(-1)))/((-1)/(-5)). -5 What is the value of -5(4 - (1 + 2))? -5 What is 9/15 - (-24)/(-40)? 0 Calculate (0 - (-16)/(-10))/(6/(-15)). 4 What is 32/55 + (-24)/10568? 2/5 What is the value of (-10)/((-60)/(-18)) + 0 + 2? -1 Calculate 0 - 2/(-4)42. 4 308/(-77) + (-2)/((-10)/23) 3/5 (-1125)/(-180) + 2 + (-9)/4 6 (-10)/7(-12)/20 6/7 4 + (-9)/36 + (-15)/4 0 (-28/(-12))/6 2/9 8 - -1068/(-112) 3/7 Calculate (7/(-28))/(18/16). -2/9 What is the value of 4/(-11) + 570/2717? -2/13 Calculate (5/1)/(210/4). 2/21 What is -5 + 0 - 216/(-48)? -1/2 (-368)/96-2 - (-1)/3 8 Calculate 7/(-21) - 21/(-9). 2 Evaluate (-4)/(-6)(1 + (-4)/16). 1/2 Calculate -2 - -2 - 13/65. -1/5 Evaluate ((-1)/(-2))/((-1)/(-8)6). 2/3 6 + -3 + (-50)/(-36)-2 2/9 What is 19/133 - 58/14? -4 What is the value of 5/21 - (-51)/153? 4/7 What is (11/(-2))/(1177/(-428))? 2 ((-28)/12 - -2)/(22/(-12)) 2/11 Evaluate 3/(-2)(-91 - -93). -3 Evaluate -11/(-2)-2. -1 What is the value of 21/(-98)-8 + 2/7? 2 Calculate (-10)/50 - 12/15. -1 Evaluate -741/(-90) - (-3)/(-5). 2/9 176/(-495)3 + 4/6 -2/5 What is 77/668/14? 2/3 Calculate ((-1)/(-4))/(16 - 15). 1/4 (-17)/((-952)/(-294)) - 15/(-3) -1/4 What is the value of (-1 + (-10)/(-15))/((-1)/9)? 3 Calculate 10/(-4)(147/(-35) + 3). 3 What is ((-14)/(-105))/(3/5)? 2/9 (65/30 + -2)14 2/3 What is 4/(-2)1 - 2? -4 What is the value of (-588)/(-2205)3/(-2)? -2/5 What is the value of 456/720 + 22/(-30)? 1/2 7/(7 + (-14)/4) 2 Evaluate 9(-23)/((-2277)/22). 2 What is the value of 2/(-7) + ((-1248)/42)/8? -4 (4 + -4)(1 + 2)/18 0 Evaluate 2 + (-15)/(-25) + (-12 - -8). -7/5 Calculate 10/10 + (-10)/6. -2/3 Calculate 387/(-215) - (-6)/45. -5/3 34/364 - 4 -2/9 What is the value of 36/40 - (-20)/(-50)? 1/2 Calculate 56/(-192) - 2/(-12). -1/8 Calculate -1 + (-7)/(196/(-21)). -1/4 Calculate -17 + (-390)/(-24) - 1/(-4). -1/2 Calculate 54/(-45)(0 - 5/4). 3/2 (-3)/15 + (-5)/(225/(-324)) 7 What is the value of -1 + -1 + -2 - -3? -1 Calculate (6/49)/((-45)/(-105)). 2/7 Evaluate (-3)/22 + (-49 - -51). -1 What is the value of ((-1)/(-2))/((-16)/16)0? 0 (-3 - 8)1 + 4 -7 What is (-7)/(-248 + -4) + 2/9? 1/4 Evaluate 3/18 + (-116)/(-24). 5 What is (-1 - 1/(-1)) + 222/37? 6 Calculate 8/(-6)2057/10640. -1/7 Calculate 5/4 - (-2806)/(-1464). -2/3 Calculate -2((-30)/(-12) - 0). -5 Calculate (-4 - 2) + (36 - 36). -6 What is (-6 - (-140)/21)9/(-2)? -3 Calculate 9 + (-6 - 32/11). 1/11 Evaluate (-1)/((-8)/(-4) - 6/4). -2 Calculate (-1 - 24/(-27))(1 + 1). -2/9 Calculate ((-4)/8)/((-3)/3). 1/2 Calculate 35/11 + 28/(-154). 3 49/(-14) + 4 + -1 + 1 1/2 Calculate (-9)/6 - (175/(-38) + 3). 2/19 24/(-13) + 8 + -6 2/13 What is (-660)/(-105)(-35)/(-25) + -8? 4/5 Evaluate -5 - (-3 + -12 + 5). 5 What is 30/56 + -6 + (-69)/(-12)? 2/7 What is 5/180-9 + (-38)/(-56)? 3/7 Evaluate (26/195)/(2/6). 2/5 91/78 + (-41)/12 -9/4 What is (-23)/(20631/26)(1 + 2)? -2/23 Evaluate 20/25(5 - (-825)/(-170)). 2/17 What is the value of -6 - 15/(-45)17? -1/3 (8 + -7)/(4/12) 3 Calculate (-63)/12 + 0 + 2/8. -5 Evaluate 1 - (50/8 + 33/44). -6 What is the value of 48/112 + (-9)/(-77)? 6/11 13/(-84) - 3/(-12) 2/21 Evaluate 17 - 3 - 43. 2 What is the value of (233 + -231)6/20? 3/5 What is 30/453/10? 1/5 What is the value of (-2)/(-10)(-25)/(-20)? 1/4 (-6)/57 + (3 - 328/133) 3/7 What is -4 - (7 - 11) - 0? 0 What is the value of (-14)/16 - (-31 - -30)? 1/8 Calculate (-36)/(-8) - -1 - 7. -3/2 Evaluate 35/(-14) + 3 - (-9)/6. 2 What is 28/8 + (-3 - (-4)/8)? 1 Evaluate (-1)/((-2)/((-6)/15)). -1/5 105/25 + (-2)/10 4 What is ((-10)/16)/((-3)/24)? 5 Calculate (-24)/(-8)1(-1)/15. -1/5 (-800)/(-120) - 1/(-3) 7 What is the value of (42/16)/(66/12)? 1/11 What is (-2)/(-4)(-4)/(-18)? 1/9 What is (19/(190/(-180)))/(-2)? 9 Calculate 2(0 - (-24)/(-16)). -3 What is the value of (-5)/108 + 0? -4 What is the value of -6 - (-2)/(8/12)? -3 What is the value of (-7)/(-21)30/(-35)? -2/7 Calculate 55/(-22)(-4)/(-5). -2 Evaluate ((-27)/162)/(1/2). -1/3 -21(-20)/(-195) + (-4)/(-26) -2 What is the value of 15/(-10)(-4)/(-36)? -1/6 0 - (1 - -9) - -6 -4 Calculate 42/6(-2)/(-14). 1 Calculate (-1(-4)/6)/((-6)/45). -5 Evaluate 107/428 + ((-45)/(-4))/3. 4 18(-13)/195(-3)/9 2/5 6 + (-22)/8 + -3 1/4 What is (-34)/(-20) + 57/(-38)? 1/5 What is (-84)/980 + (-4)/(-14)? 1/5 -1 + 4 + (-5)/((-5)/(-6)) -3 Calculate (14/(-35) - 252/(-55)) + -4. 2/11 Evaluate (1/(-2))/((-3)/18). 3 What is ((-152)/(-64))/(-19)-24? 3 Calculate ((8/(-12))/(-2))/((-2)/(-24)). 4 -1 + (0 - 5) + 3 -3 Evaluate 1 - (87/(-27) - (-19 + 15)). 2/9 What is the value of (24/(-80)-1)/(3/(-6))? -3/5 Calculate 247/598 - (25/(-10) + 3). -2/23 What is (-55)/33 + 92/48? 1/4 (1/(-2))/((-77)/66) 3/7 Evaluate (-54)/(-189)(-14)/(-16). 1/4 Evaluate -4((-4)/(-18) - 22/18). 4 Evaluate (-3)/3 + 4/101. -3/5 (4/(-12))/(2/(-18)) 3 What is the value of (14/(-28))/((-1)/(-1 - -3))? 1 What is 1-4 + 4 + 4/(-4)? -1 Calculate (1/(-5) + (-24)/30)1. -1 (100/(-28) - -4) + 3/(-7) 0 Evaluate (36/(-10) + 3)-1. 3/5 (-4)/14 + 184/84 + -2 -2/21 What is the value of 21/(-63) - 2/(-12)2? 0 What is the value of (-19)/(-12) + (-30)/24? 1/3 (-19)/4 - 9/36 -5 Evaluate 88/55*(1/(-2) - -3). 4 Evaluate ((-1)/(-28))/(114/16 + -7). 2/7 Evaluate (9/6)/(6/8). 2 (140/63 - 2)/(8/(-3)) -1/12 What is	{ "pile_set_name": "DM Mathematics" }
f*2 + 35f*2 - 2f - 3f2 - 28f2 + f3. Calculate 3j(r) - 2w(r). r*3 + r - 2 Let n(y) = -2037y*2 + 10y + 2. Let u(h) = 63147h2 - 315h - 63. Determine -63n(q) - 2u(q). 2037q2 Let i(o) = -13o*3 - 2o*2 + 10o + 5. Let j(z) = 12z3 + 2z*2 - 9z - 4. Suppose -23080 + 23176 = 16n. Determine nj(y) + 5i(y). 7y*3 + 2y*2 - 4y + 1 Let j(v) = -228v3 - 7v - 5. Let x(c) = 227c3 + 6c + 4. Calculate 4j(s) + 5x(s). 223s3 + 2s Let s(w) = -16w + 52. Let y(t) = -22. Let h(o) = -s(o) - 2y(o). Let g(r) = -r + 1. Calculate -8g(k) - h(k). -8k Let p(b) = 5b + 0 + 5b - 4. Suppose -5s + m = 39, -47s - 22 = -45s - 2m. Let j(a) = 19a - 7. Determine sp(r) + 4j(r). 6r Let u(k) = 305k3 + 9. Let w(c) = 609c*3 + 19. Determine -7u(j) + 3w(j). -308j*3 - 6 Let o(s) be the first derivative of 3s*2/2 + 2s - 7287. Let x(f) = 8f + 6. Determine -14o(r) + 5x(r). -2r + 2 Let r(n) = 7n + 36901. Let v(h) = -17h - 92281. Determine -12r(j) - 5v(j). j + 18593 Let h(j) = 223j3 - 2j*2 + 11j - 4. Let a(f) = 222f3 - 3f*2 + 11f - 6. Calculate -2a(u) + 3h(u). 225u3 + 11u Suppose 6q - 4 = 2q. Let i(a) = 3a + 1. Let p(g) = g. Let w be 22/6 - 2/3. Let b(d) = d3 - 2d*2 - 3d - 1. Let z be b(w). Calculate qp(v) + zi(v). -2v - 1 Let a(o) = o - 5. Let l(n) = -255n + 150. Determine -90a(p) - 3l(p). 675p Let i(b) = -106b*2 - 4b - 1. Let o(x) = -316x2 - 12x - 3. Calculate -17i(p) + 6o(p). -94p2 - 4p - 1 Let z(t) = -95t + 44t + 50t - 2 + 2. Let g(m) be the first derivative of -m2/2 - 1. Let o(h) = h - 2. Let r(f) = 2g(f) - o(f). Calculate r(b) - 5z(b). 2b + 2 Let z(b) = -b2 - b - 1. Let n(g) = g3 - 22g2 - 4g - 4. Suppose w - 12 = -5j, -3w - 864 = -885. Calculate jn(s) - 4z(s). s*3 - 18s*2 Let x(s) = -37s*2 - 727s - 6. Let t(v) = -9v2 - v - 1. What is -4t(n) + x(n)? -n*2 - 723n - 2 Let w(o) = -o - 1. Let g(u) = -6u - 4. Let s(t) = g(t) - 5w(t). Let q = -423 - -426. Suppose qd + 2 = d. Let k(x) = -8x + 8. Calculate dk(z) + 6s(z). 2z - 2 Let l(t) = 6t*2 + 4t + 4. Let u(n) = n*2 + n. Let f(o) = -o + 14. Let a be f(8). Let g be 0/(20/(a + -1)) + -4. Determine gu(p) + l(p). 2p2 + 4 Let n(c) = -2c*3 - 2c*2 - 5c. Let j = -8047 + 8042. Let x(b) = b. Calculate jx(y) + n(y). -2y*3 - 2y*2 - 10y Suppose -4o - 20 = 2f, 5o + 27 = -2f + 5. Let k(r) = 7r + 6. Let m(z) be the second derivative of -5z*3/2 - 6z*2 + 27905z. Calculate fm(w) - 13k(w). -w - 6 Let r(j) = 4j2 + 5j + 176. Let a(g) = g*3 - 11g*2 - 14g - 529. Determine -4a(n) - 11r(n). -4n3 + n + 180 Let t = 36 - 32. Let b(y) = 2y*2 - 10y + 10. Let h be b(t). Let a(g) = -g + 3 - h + 0. Let o(v) = -4v + 5. Determine 5a(x) - o(x). -x Let f(o) = -o*3 - 2o + 43. Let l(g) = 6g3 + 9g - 172. What is -9f(y) - 2l(y)? -3y3 - 43 Let m(l) = 6494801l*3 - 3121l*2 + 6242l. Let z(r) = -6245r3 + 3r*2 - 6r. Calculate 3m(x) + 3121z(x). -6242x3 Let d(g) = -g - 5. Let m(n) = n + 5. Let b(l) be the second derivative of -3l*3/2 + 47l*2 + l - 4. Let o be b(10). Determine om(q) + 3d(q). q + 5 Let u(n) = 889755n*3 + 345n*2 + 8280n - 345. Let k(c) = -5173c3 - 2c*2 - 48c + 2. Calculate 345k(p) + 2u(p). -5175p3 Let v(a) = a2 - 35a - 1. Let x(k) = 5k2 - 211k - 6688. What is -6v(t) + x(t)? -t2 - t - 6682 Let s(d) = -d2 + 3d - 5. Let k(b) = 72b2 - 13b + 23. Let r(q) = -k(q) - 5s(q). Let h(w) = -3887w*2 - 117w + 117. Give 2h(p) - 117r(p). 65p2 Let d(v) = -39v*2 + 7v + 7. Let y(t) = 79t2 - 15t - 15. Let l(u) = -u*2 - 93u - 743. Let f be l(-84). What is fd(p) + 6y(p)? -33p2 + p + 1 Let m(r) = -1054r*3 + 12r*2 - 4r. Let t(q) = -2066896q3 + 23535q*2 - 7845q. Calculate 7845m(a) - 4t(a). -1046a3 Let v(x) = x - 12. Let q(r) = -11. Suppose 0 = 195g - 350 - 23 - 212. Calculate gv(k) - 4q(k). 3k + 8 Let w(u) = -u - 1. Let h(o) = 2o + 2. Suppose -5m - 10b = -6b - 3, -3m + 21 = -4b. Calculate mh(g) + 8w(g). -2g - 2 Let x(k) = -2k3 - 10k*2 + 3k - 15. Let q(m) = m*3 + 4m*2 - m + 8. What is 9q(z) + 4x(z)? z3 - 4z*2 + 3z + 12 Let s(p) = 2p + 1. Let f(v) = -2v - 2 + 17 - 5 - 11. Let x be 8 + (0/(-1))/2. Let i be (-69)/(-12) + 2/x. Give if(c) + 7s(c). 2c + 1 Let t(v) = 10v*2 - 27v. Let i(b) = -11b2 + 25b + 1. Give -3i(g) - 4t(g). -7g2 + 33g - 3 Let j(t) = -38t2 + 21t + 16. Let y(a) = -39a2 + 21a + 12. Give -3j(h) + 4y(h). -42h2 + 21h Suppose -o = 5t - 30, -4o - 1024 = -5t - 994. Let f(u) = -5u*3 - 3u*2 + 2u + 6. Let w(d) = -14d3 - 8d*2 + 6d + 17. Calculate tw(p) - 17f(p). p*3 + 3p*2 + 2p Let g(v) = 243v3 - 38v*2 - 13v + 6. Let q(w) = 243w3 - 44w*2 - 14w + 7. What is 7g(m) - 6q(m)? 243m3 - 2m*2 - 7m Let l(k) = -54 - k + 77 + 4k - 5k. Let s be l(8). Let g(o) = -9o2 - 6. Let q(i) = 5i*2 + 3. Determine sq(u) + 4g(u). -u2 - 3 Let p(i) = -1 - i2 + 1 + 227i*3 + 228i*3 - 459i*3. Suppose -10o = -2o - 8. Let t(s) = -s3. Give op(k) - t(k). -3k3 - k2 Let u(y) = 540y - 55. Suppose 100m - 327 = 511 + 4662. Let k(a) = 20a - 2. Calculate mk(x) - 2u(x). 20x Let k(n) be the third derivative of n6/20 + n5/30 - 5n4/24 - n3 + 965n2. Let d(u) = 5u*3 + 2u*2 - 4u - 6. Give 5d(o) - 4k(o). o*3 + 2o*2 - 6 Let p(d) = 222d - 8216. Let w be p(37). Let u(i) = -i*2 - 5i + 21. Suppose 0l - 18 = -2l. Let m(c) = -c + 5. Give lm(z) + wu(z). 2z2 + z + 3 Let k(a) = 24a*2 + 277a + 1351. Let x(z) = 2z2 + 23z + 113. What is 2k(f) - 25x(f)? -2f2 - 21f - 123 Let i(t) = 4t3 + 10t*2 + 8t + 8. Let g(d) = 3d3 + d2 + 2d + 2. Let v(z) = 4g(z) - i(z). Let y(a) = a3. Calculate v(m) - 3y(m). 5m3 - 6m*2 Let p(o) = -82o*2 + 153o - 5. Let i(w) = -65w2 + 153w - 4. Determine 6i(g) - 5p(g). 20g2 + 153g + 1 Let c(k) = -7k3 - 19k2 + 8. Let g(h) be the third derivative of -h6/20 - 3h5/10 + 7h*3/6 - 2h*2 - 180. Give 5c(j) - 6g(j). j3 + 13j*2 - 2 Let m(o) = -7o*2 - o. Let d(v) = -15v*2 - 2v. Suppose g + 30 = -2n, 2n - 3g - 17 = 1. Let q = 9 + -5. What is nm(y) + qd(y)? 3y*2 + y Let h = 6 + -2. Let d(g) = -5g*3 - 3g + hg + g3. Let p(z) = 23z*3 - 6z. Suppose 2987 = -207f - 2579 - 1472. Determine fd(q) - 6p(q). -2q*3 + 2q Let j(u) be the first derivative of -u*2/2 - 2u + 71. Let a = 6 - 7. Let m(q) = -q*2 - 1. Give aj(f) + 3m(f). -3f*2 + f - 1 Let b(k) be the third derivative of -13k*4/24 + 2k*3/3 + 1122k*2. Let u(g) = 27g - 9. Give 5b(p) + 2u(p). -11p + 2 Let b(p) = -1. Let s(l) = 0l + 2l + 3 + 8l + l. Let c(i) = -8i3 + 217i*2 - 24i - 82. Let t be c(27). What is ts(w) - 3b(w)? -11w Let c(n) = 28602n*2 + 74n. Let x(u) = -9535u2 - 26u. What is -6c(p) - 17x(p)? -9517p2 - 2p Suppose 0 = 236h - 233h - 3d, -4h = 2d - 18. Let y(x) = -24x - 5. Let j(f) = 49f + 9. Give hj(v) + 5y(v). 27v + 2 Let u be 4/6 + 2/6. Let b(w) = 4w - 3. Let n(y) be the second derivative of 1/12y*4 + 4y - 1/2y2 + 1/6y*3 + 6. Calculate ub(l) - 3n(l). -3l*2 + l Let w(p) = 4p*2 + 3p + 2. Let i be 9/((-162)/(-3))-29. Let q(u) = -5u2 - 4u - 3. Give iw(a) - 2q(a). -2a2 - a Let z(d) = 2d + 5. Let n(c) = c + 3. Let u = 17268 + -17266. Give uz(l) - 5n(l). -l - 5 Let l(m) = -353m - 130. Let k(i) = -i - 32. Calculate 4k(x) - l(x). 349x + 2 Let j be 2/8 + (-27)/12. Let f(t) = -t2 - 1. Let h(u) = 39u*2 + 15u + 5. Let d(k) = 19k2 + 8k + 2. Let w(a) = 2d(a) - h(a). What is jw(q) + f(q)? q*2 - 2q + 1 Let z(j) = -3j2 + 8j + 8. Let f(k) = -6k2 + 15k + 15. Suppose 3p = 12127 - 12160. Determine pz(v) + 6f(v). -3v*2 + 2v + 2 Let r(z) = 4z + 19. Let x(s) = -9s - 38. Suppose 18a - 92 = a - 7. Determine ar(h) + 2x(h). 2h + 19 Let l(t) = t. Let f(w) = -3w + 1. Let y(u) = -f(u) - 4l(u). Let k = -545 - -546. Suppose 918x = 917x - k. Let z(q) = -2q - 7. Give xz(c) + 4y(c). -2c + 3 Suppose 0 = -c + 8c - 21. Suppose 5g - 3f - 18 = -5, 0 = g + 2f. Let w(m) = 6m - 2. Let u(j) = -5j + 1. What is cu(h) + gw(h)? -3h - 1 Let g(q) = -2q +	{ "pile_set_name": "DM Mathematics" }
1, 4 Sort -0.2, 19, -0.4 in ascending order. -0.4, -0.2, 19 Put 1/2, 4.1, -2/5 in ascending order. -2/5, 1/2, 4.1 Put 50, 5.3, 4 in decreasing order. 50, 5.3, 4 Sort 5/2, -1, 0.4, -2 in descending order. 5/2, 0.4, -1, -2 Sort 16, -0.2, 1, -0.5. -0.5, -0.2, 1, 16 Put -0.4, 17/3, -45 in descending order. 17/3, -0.4, -45 Sort 3, -13, 2, 1, -5. -13, -5, 1, 2, 3 Put -1, 2, 12, 5 in decreasing order. 12, 5, 2, -1 Sort 421, 10, -2 in descending order. 421, 10, -2 Put 2, -152, 0 in ascending order. -152, 0, 2 Put 8, -133, -3 in increasing order. -133, -3, 8 Put 25, -1, -4, 5 in decreasing order. 25, 5, -1, -4 Sort -2, -8, 3, 7 in increasing order. -8, -2, 3, 7 Sort 2, 4, 110, -3, -2 in descending order. 110, 4, 2, -2, -3 Sort 3, 0, -3, -13 in descending order. 3, 0, -3, -13 Sort 0.3, -5, 9 in ascending order. -5, 0.3, 9 Sort -0.2, 2/17, 2/7. -0.2, 2/17, 2/7 Put -1, 5, 20, -4, 0 in decreasing order. 20, 5, 0, -1, -4 Sort 3/7, 2, 2/11, -0.3, -0.4 in decreasing order. 2, 3/7, 2/11, -0.3, -0.4 Sort 2, -0.008, -1, -4. -4, -1, -0.008, 2 Put 1/3, 1/6, 0.1, -1/16, 4 in descending order. 4, 1/3, 1/6, 0.1, -1/16 Sort 1075, -1, 4 in decreasing order. 1075, 4, -1 Sort 1, -54, 4, -15. -54, -15, 1, 4 Sort -75, 0.3, -1/2 in decreasing order. 0.3, -1/2, -75 Sort -4, -0.4, 4, 2 in decreasing order. 4, 2, -0.4, -4 Sort -4, 19, 2, -5. -5, -4, 2, 19 Put 0, -4/19, -1/5, 4 in decreasing order. 4, 0, -1/5, -4/19 Sort 1, 2, 12 in decreasing order. 12, 2, 1 Put -1, -2/9, 0.2, -621 in descending order. 0.2, -2/9, -1, -621 Sort 3, -118, 1. -118, 1, 3 Sort -71, -5, -3, 0, 31 in ascending order. -71, -5, -3, 0, 31 Put 0, 5, -6, -3, 4 in ascending order. -6, -3, 0, 4, 5 Sort 10, -4/9, 1/45. -4/9, 1/45, 10 Put 5/4, -3, -0.1, 0.5 in decreasing order. 5/4, 0.5, -0.1, -3 Put -24, 0.1, -6, -6/7, 0 in ascending order. -24, -6, -6/7, 0, 0.1 Sort -1, -56, 0, -4. -56, -4, -1, 0 Put -4, -2, -1, -7, 0 in ascending order. -7, -4, -2, -1, 0 Sort 3, 0.5, 65, -0.2 in descending order. 65, 3, 0.5, -0.2 Sort -160, 1/3, 3, 0 in decreasing order. 3, 1/3, 0, -160 Put -71/6, -1/4, 0.5, 5 in decreasing order. 5, 0.5, -1/4, -71/6 Put 3, -156, -4, -3 in descending order. 3, -3, -4, -156 Put -3, 3, -0.145 in decreasing order. 3, -0.145, -3 Sort 5, 1, -5, -2 in descending order. 5, 1, -2, -5 Put 1, 5, 540, 3, 0 in ascending order. 0, 1, 3, 5, 540 Sort -1, 5, 33, 8, 4 in increasing order. -1, 4, 5, 8, 33 Put 180/19, -4, -7 in decreasing order. 180/19, -4, -7 Sort 0, 6, 1, 3 in ascending order. 0, 1, 3, 6 Sort 3, 57, -7, 1, -4 in decreasing order. 57, 3, 1, -4, -7 Put 7/5, -0.03, -0.1 in decreasing order. 7/5, -0.03, -0.1 Put 7, -1, 4 in descending order. 7, 4, -1 Sort 3, 5, -37, 2. -37, 2, 3, 5 Put 4, -2, 6/11, 5 in ascending order. -2, 6/11, 4, 5 Sort -45, -3, 2 in ascending order. -45, -3, 2 Sort -5, 5, -2, -6 in increasing order. -6, -5, -2, 5 Put -2, 4, 0.3, -0.017 in descending order. 4, 0.3, -0.017, -2 Sort -53, -3, -9 in ascending order. -53, -9, -3 Put 27, 3, 8, -4 in increasing order. -4, 3, 8, 27 Sort 3, 3/2, -7.1 in increasing order. -7.1, 3/2, 3 Sort 25, 4, 0 in descending order. 25, 4, 0 Put -2, 1, 246 in ascending order. -2, 1, 246 Put 2, 3, -11, -2 in ascending order. -11, -2, 2, 3 Sort 7, -2/7, -5, -1/5. -5, -2/7, -1/5, 7 Sort -532, 2/3, -4/5. -532, -4/5, 2/3 Sort -1/2, 10, 1/3. -1/2, 1/3, 10 Sort 0.5, 4, -4/563. -4/563, 0.5, 4 Put 1.5, 0.5, -0.3 in increasing order. -0.3, 0.5, 1.5 Sort 6, 20, 2/5, -0.4, -0.3 in decreasing order. 20, 6, 2/5, -0.3, -0.4 Put -34, 3, -1, 4, -2 in descending order. 4, 3, -1, -2, -34 Sort 5, -19, -1, 2 in descending order. 5, 2, -1, -19 Sort -0.4, -5, -0.177 in decreasing order. -0.177, -0.4, -5 Sort 1, 3, -5, -4 in ascending order. -5, -4, 1, 3 Put 0.5, -2, 545 in ascending order. -2, 0.5, 545 Put 1, -1, -18 in increasing order. -18, -1, 1 Put 2/17, 7, 5 in decreasing order. 7, 5, 2/17 Put 4/9, 2/7, -1, -0.2 in descending order. 4/9, 2/7, -0.2, -1 Put -11, -8, -3/11 in increasing order. -11, -8, -3/11 Put 0.22, 1/3, -0.8, -0.5, 1/4 in descending order. 1/3, 1/4, 0.22, -0.5, -0.8 Put 4, 5, -483 in ascending order. -483, 4, 5 Sort -0.3, 104, -3, -1 in ascending order. -3, -1, -0.3, 104 Sort -2/23, -1/4, 10. -1/4, -2/23, 10 Sort 0, -0.3, -121 in increasing order. -121, -0.3, 0 Sort 13, 0, -7 in increasing order. -7, 0, 13 Put 0.2, -4, -14/11, -4/7 in descending order. 0.2, -4/7, -14/11, -4 Sort -3, 1/5, 5, -35 in decreasing order. 5, 1/5, -3, -35 Sort -5/2, -3, 0.5, 3/7, 0.01 in descending order. 0.5, 3/7, 0.01, -5/2, -3 Sort -5, -3, -2459. -2459, -5, -3 Sort 0, 5/7, 0.3, 4 in decreasing order. 4, 5/7, 0.3, 0 Sort -11/12, -3, -1 in ascending order. -3, -1, -11/12 Put -7/4, 5/3, -1, -0.2 in ascending order. -7/4, -1, -0.2, 5/3 Put 290, 7, 0 in ascending order. 0, 7, 290 Sort 71, -1, -4, 3, 4 in ascending order. -4, -1, 3, 4, 71 Sort 9, -0.02, 1, 3/7. -0.02, 3/7, 1, 9 Sort -5/3, 41, -5 in descending order. 41, -5/3, -5 Put 3, 50, -7, -3, -1 in ascending order. -7, -3, -1, 3, 50 Sort 2/11, 1, 284 in ascending order. 2/11, 1, 284 Put -2, 2, 5/2, 0.3 in decreasing order. 5/2, 2, 0.3, -2 Sort -5, -52, -14, 4, 3 in decreasing order. 4, 3, -5, -14, -52 Sort 5, 17, 0.1. 0.1, 5, 17 Put -7, 16, 1/6 in decreasing order. 16, 1/6, -7 Put 16, -2, 5, 0 in descending order. 16, 5, 0, -2 Sort -14, 2, 1. -14, 1, 2 Put 4, -2/5, -4/5, -0.05 in ascending order. -4/5, -2/5, -0.05, 4 Sort -4, -30, 1, -27. -30, -27, -4, 1 Sort 1, 2, 5, 4. 1, 2, 4, 5 Sort -5, -69, 107 in increasing order. -69, -5, 107 Put -2, 5, 5/9 in decreasing order. 5, 5/9, -2 Sort 5, -19, -3/8, 0.1. -19, -3/8, 0.1, 5 Sort -0.5, -0.1, 1/11, -2 in descending order. 1/11, -0.1, -0.5, -2 Sort -6, -5, 2, 5 in decreasing order. 5, 2, -5, -6 Put -1, -0.49, 1/6, 1/7 in decreasing order. 1/6, 1/7, -0.49, -1 Sort -3/2, 0.1, -0.16, -0.023 in increasing order. -3/2, -0.16, -0.023, 0.1 Sort 0, -1, -2/7, 0.35 in increasing order. -1, -2/7, 0, 0.35 Sort 55, 1/9, 1, -1. -1, 1/9, 1, 55 Sort -0.2, 4, 0.19, 0.6 in increasing order. -0.2, 0.19, 0.6, 4 Sort 2/5, 1, -0.5, 29 in decreasing order. 29, 1, 2/5, -0.5 Sort -3, 7, 2, 4, 0. -3, 0, 2, 4, 7 Sort 7, 176, -4, 5 in decreasing order. 176, 7, 5, -4 Sort 6, -5, 3/8 in decreasing order. 6, 3/8, -5 Put -239, -4, 1 in ascending order. -239, -4, 1 Sort 0, -27, 52 in descending order. 52, 0, -27 Sort -1, -2, 12, 1 in decreasing order. 12, 1, -1, -2 Put 0.5, -2/373, 3 in decreasing order. 3, 0.5, -2/373 Put -5, 29, -8, 0 in ascending order. -8, -5, 0, 29 Sort -1, -9, -0.1, -4 in ascending order. -9, -4, -1, -0.1 Sort 0, 1, -4. -4, 0, 1 Sort -1, 14, -41. -41, -1, 14 Put 1, 4, -404/7, -2 in increasing order. -404/7, -2, 1, 4 Sort 5, 212, 1 in ascending order. 1, 5, 212 Sort -12, -219, 4 in decreasing order. 4, -12, -219 Sort 20, 16, -1. -1, 16, 20 Sort 0.2, -2/491, -4, -11 in increasing order. -11, -4, -2/491, 0.2 Sort -4/7, -3/7, 9/11 in increasing order. -4/7, -3/7, 9/11 Sort 1.9, -1/6, 5/2, 2/7, 4 in decreasing order. 4, 5/2, 1.9, 2/7, -1/6 Sort -5, -2, 87, -1 in decreasing order. 87, -1, -2, -5 Sort 22, -4, -1. -4, -1, 22 Sort 1/5, -2, 5, -5 in descending order. 5, 1/5, -2, -5 Sort 0.07, -0.9, 0.4, -2, 8 in decreasing order. 8, 0.4, 0.07, -0.9, -2 Sort -37, -5, 6, 5, -2 in decreasing order. 6, 5, -2, -5, -37 Sort -1, 1/4, -200 in descending order. 1/4, -1, -200 Put 0, 84, 4, 5 in descending order. 84, 5, 4, 0 Put -15, -0.5, -1, 5 in ascending order. -15, -1, -0.5, 5 Sort -83, 5, -1, 4 in increasing order. -83, -1, 4, 5 Put 2/9, -1.1, -1 in descending order. 2/9, -1, -1.1 Put 0.5, 0.3, 4, -69 in ascending order. -69, 0.3, 0.5, 4 Sort -9, 5, -2, -5 in increasing order. -9, -5, -2, 5 Put 5, -4, -3, 1 in decreasing order. 5, 1, -3, -4 Put 1, 0, -113 in descending order. 1, 0, -113 Sort 22, -2, -6 in increasing order. -6, -2, 22 Sort 11, -43, 4, -4 in increasing order. -43, -4, 4, 11 Sort 1375, -6, 0. -6, 0, 1375 Sort 4, 3, 65, -30. -30, 3, 4, 65 Sort -2, -24, -52 in descending order. -2, -24, -52 Sort -199, 0, 1/3, -3 in decreasing order. 1/3, 0, -3, -199 Sort -0.7, -5, -0.2, 0.3 in descending order. 0.3, -0.2, -0.7, -5 Sort -5, -3, -129, -4 in increasing order. -129, -5, -4, -3 Put -0.2, 84, 0.4, -2/3 in decreasing order. 84, 0.4, -0.2, -2/3 Sort -5, 18, -1, 0, 26. -5, -1, 0, 18, 26 Sort 0,	{ "pile_set_name": "DM Mathematics" }
0r2 - 2025 Let u(z) = 137z + 13. Let d(y) = y*2 - 15. What is d(u(n))? 18769n*2 + 3562n + 154 Let n(y) = -9y - 44. Let o(m) = m + 4. Let k(t) = -2n(t) - 22o(t). Let u(b) = -273b*2. Give u(k(w)). -4368w2 Let u(v) = v2 + 2v2 - 2v*2. Let a(k) = 112k*2 + 123k*2 - 312k*2 + 12k + 75k2. Calculate a(u(y)). -2y*4 + 12y2 Let g(k) = k2 + 4k + 24. Let b be g(-6). Let x = 38 - b. Let m(h) = -2h*x - 15 - 16 + 31. Let w(q) = 5q*2 + 4q. Calculate m(w(y)). -50y4 - 80y*3 - 32y*2 Let y be (-4)/(24/27)-2. Let w be (-4)/6 - (-24)/y. Let i(n) = -16n2 - 10n*2 + 11n*2 - 14nw. Let d(r) = r2. Give i(d(c)). -29c4 Let d = -507 - -513. Let m(w) = -6w + 4 + 1 + d - 2. Let z(i) = i*2. Calculate m(z(u)). -6u*2 + 9 Let b(a) be the second derivative of 0 + 0a*2 - 8/3a*3 - a. Let c(l) = 2l2 + 11. Let h(u) = u2 + 6. Let p(w) = -6c(w) + 11h(w). Give b(p(x)). 16x2 Let h(x) = 13x*2 + x. Let p be 10(126/20)/21. Let w(a) = -8a + 0a + pa + 3a. Determine h(w(d)). 52d2 - 2d Let i(p) = -4p2 + 4329p + 1. Let u(r) = 66r2. Give i(u(w)). -17424w*4 + 285714w2 + 1 Let w(t) be the third derivative of -t5/60 + 5t2. Let c be -5 - (-8 - (-6)/2). Let o(n) = 0n - 24n2 + cn + 54n2. Calculate w(o(a)). -900a*4 Let x(q) = q. Let u(t) = -284t*2 - 4667t. Give x(u(v)). -284v2 - 4667v Let s(a) = -3a. Let d(y) = -47071897y - 1367 - y*2 + 47071897y. Calculate d(s(g)). -9g2 - 1367 Let y(x) be the second derivative of -17x*6/180 - 11x3/6 - x2 + 88x + 2. Let k(f) be the second derivative of y(f). Let b(l) = -4l. Give b(k(p)). 136p2 Let q(u) = -u. Let i(a) = -4a - 4. Let c = 98 + -74. Let v(j) = -10j - c - 29j + 16j. Let z(x) = -34i(x) + 6v(x). Determine z(q(n)). 2n - 8 Let x(z) = -z + 2. Let v(t) = -4t + 7. Let s(f) = 2v(f) - 7x(f). Let w(k) be the first derivative of k3/3 + 23k2/2 - 680. Give s(w(r)). -r2 - 23r Let x(s) = -8s. Let i(b) = 171 + 20b + 12b + 10b - 53b + 9b. Determine x(i(h)). 16h - 1368 Let i(f) = -4f + 94. Let h be i(23). Let u(y) = -36y*2 - 40y*2 + 98y*h - 46y*2. Let j(z) = 2z. Determine j(u(t)). -48t2 Let g(k) = 6k*2. Let v(t) = -572t*2 - 631t*2 - 2 + 1189t*2. What is g(v(m))? 1176m*4 + 336m*2 + 24 Let p(b) = 2b - 3. Let w(y) = -3290y + 30. Calculate p(w(h)). -6580h + 57 Let s(r) = -54 - 77r + 54. Let i(a) be the third derivative of a5/30 - 357a*2. What is s(i(p))? -154p*2 Let o(p) = 3p. Let c(r) = 10267720r. Give c(o(n)). 30803160n Let m(a) = a*3 + 7a*2 + 5a + 4. Let l be m(-3). Let b(o) = 11o + 12o - lo. Let z(j) = -14j - 2j - 3j - 2j. Give z(b(d)). 42d Let z(y) = -2y. Let k(v) = -5 + 10 + 52207v*2 + 37 - 52208v*2 + 15. Determine z(k(m)). 2m*2 - 114 Let n be 310/7 + (8/(-14))/2. Let x(w) = nw + 27w - 73w. Let q(d) = 14d + 2. Calculate x(q(r)). -28r - 4 Let c(o) = 17o2. Let i(k) be the first derivative of 5k*2 + 119. Calculate i(c(v)). 170v2 Let b(m) be the first derivative of m2 + 668. Let n(u) = 2u + 325. Give b(n(f)). 4f + 650 Let u(v) = 396v2. Let p(h) = 2h + 63764. Calculate p(u(q)). 792q2 + 63764 Suppose 480u - 474u = 0. Let m(k) = u + 102k + 0 - 76k + k2. Let l(j) = j. Calculate m(l(v)). v2 + 26v Suppose 5y - t + 19 = 11y, 3y + 3t - 12 = 0. Let d(i) be the second derivative of -1/2i3 - yi + i2 + 0. Let s(k) = -k2. Give d(s(u)). 3u2 + 2 Let i(p) = 8p*2. Let u(o) = -107o*2 - 12186o. Give u(i(j)). -6848j4 - 97488j*2 Let z(i) be the first derivative of -2i*3 - 2805. Let m(t) = -65t*2 - 1. Calculate z(m(q)). -25350q*4 - 780q*2 - 6 Let r(i) = 3i + 6. Suppose 2x = -d, 15 + 9 = -2x + 5d. Let z(q) = q + 3. Let u(w) = xz(w) + r(w). Let k(f) = -87f2. Calculate u(k(y)). -87y*2 Let n(o) = 69o*2. Let a(w) = -84330w*2. Determine n(a(q)). 490696874100q*4 Let f(p) = 3p2. Let w = 32 + -29. Let b(y) be the first derivative of y3 + 14 + 0yw - 61y + 61y. Give b(f(g)). 27g*4 Let g(f) = -8484f*2 - 20f + 80. Let p(v) = 1210v2 + 3v - 12. Let z(n) = -6g(n) - 40p(n). Let r(w) = -w. Calculate r(z(s)). -2504s2 Let t(c) = -3424c + 2. Let p(b) = -36b + 814. Let d(w) = -2w + 44. Let o(z) = 37d(z) - 2p(z). What is t(o(n))? 6848n + 2 Let f(z) = -z2 + 6z - 4. Let o(d) = -d - 10279. What is f(o(x))? -x*2 - 20564x - 105719519 Let x(h) = 3h2. Let f be -5 + (27 - 15) - (2 - 1). Let k(d) = 4d*2. Let z(a) = 4a*2 - 3a*2 - 2a*2. Let b(n) = fk(n) + 26z(n). Determine b(x(r)). -18r*4 Let v(h) = 833373h - 2. Let l(a) = 24a2. Calculate v(l(d)). 20000952d*2 - 2 Let f(w) = -19939w. Let g(l) = -26l2 + 1. Determine g(f(q)). -10336656746q*2 + 1 Let r(u) = 11u*2. Let m(v) = 14v. Let f(y) = 96y + 240. Let c(i) = -i - 2. Let k(z) = -120c(z) - f(z). Let l(h) = 5k(h) - 9m(h). Give r(l(x)). 396x2 Let h(b) = -432b - 428b - 406b + 1283b. Let n(p) = p - 54. Determine n(h(r)). 17r - 54 Let r(x) = 36147x2. Let f(u) = u2 - 58. What is f(r(t))? 1306605609t*4 - 58 Let o be (-6266)/(-14) - -6(-9)/(-126). Let i(h) = 24081 - 24081 + oh. Let p(w) = -2w. What is p(i(m))? -896m Let a(h) = 2h*2. Let k(u) = 1385199u - 53. What is k(a(q))? 2770398q2 - 53 Let v(d) = -12d. Let g = 572 - 471. Let u(q) = 220q - gq - 107q. Calculate v(u(j)). -144j Let d(p) = -76p2 - 3p. Suppose m = 4 - 2. Let g(r) = -77r2 - 2r. Let c = -28 - -25. Let u(l) = cg(l) + md(l). Let q(f) = 2f. Give u(q(v)). 316v*2 Let v(z) = 2474z*2. Let r(m) = m - 8814 + m + 8814. Give r(v(o)). 4948o2 Let q(c) = c3 + 18c2 + 3c + 27. Let w be q(-18). Let x = w + 29. Let y(p) = -105 + 105 + 4px. Let z(f) = -f2. Calculate z(y(m)). -16m*4 Let c(t) = -2t. Let y(u) = -2u - 20. Let x be y(-11). Let z = 2 + x. Let d(i) = zi*2 - 5i*2 + 6i*2. Calculate d(c(g)). 20g*2 Let u(s) = -127752s*2. Let i(m) = -25m. What is u(i(b))? -79845000b2 Let r(a) = -76821a. Let x(n) = 209n2 + 3n. What is r(x(b))? -16055589b2 - 230463b Let c(q) be the first derivative of 7q3/3 + 476. Let x(g) be the first derivative of 2g*2 + 2. Give c(x(u)). 112u*2 Let r(m) = 21462m - 42923m + 21459m. Let d(q) = 8q2 + 13q - 3. What is d(r(v))? 32v2 - 26v - 3 Let n(f) = -5f2 + 12f + 24. Let r be 48/18(-108)/48. Let w(c) = -4c*2 + 10c + 20. Let g(u) = rw(u) + 5n(u). Let b(y) = -3 + 3 - 10y. Give g(b(k)). -100k*2 Let l(c) be the third derivative of 10c*2 + 0 + 0c - 1/60c5 - 7/6c*3 + 0c4. Let a(w) be the first derivative of -w3/3 + 30. Give a(l(u)). -u*4 - 14u*2 - 49 Let k(r) = -2r. Let j(i) = 15771161i. Give j(k(g)). -31542322g Let z(w) = 0 - 2 - 2 + 17w. Let j(g) = -544 + 167 - 2g2 + 185 + 192 + g2. Give j(z(f)). -289f2 + 136f - 16 Let k = 52 - 46. Let n(m) = km2 + 367m - 367m. Let t(x) = 19x. Calculate n(t(h)). 2166h2 Let y(o) = -o. Let c(n) = -12n + 1. Let s(h) = -2907h + 247. Let w(v) = -1482c(v) + 6s(v). Give w(y(m)). -342m Let x(h) = 228h2 + 225h*2 - 459h*2. Let f(v) = -83v - 2. Calculate f(x(u)). 498u2 - 2 Let q(c) = 2c - 40. Let b(o) = -2o + 48. Let r(x) = 5b(x) + 6q(x). Let t(z) = 3340z*2. Determine r(t(i)). 6680i*2 Let w(p) = -68p*2 - 63p*2 + 203p*2 - 70p*2. Let y(g) = -4269g*2. What is w(y(v))? 36448722v*4 Let i(x) = -9x*2 - 306x. Let m(z) = 1116 - 554 - 562 + 4z2. Determine i(m(u)). -144u*4 - 1224u*2 Let j(y) = 2y*2. Let r(l) = -59461586l. Give r(j(o)). -118923172o2 Let b(x) = 55x - 14x - 8x - 21x - 13x. Let w(v) = 2v2 + 3v + 3v - 6v. Determine b(w(h)). -2h2 Let g(v) = -5v*2 + 9. Let p(k) = -16k*2 + 27. Let d(z) = 12g(z) - 4p(z). Let f(n) = 3915n. Determine d(f(s)). 61308900s2 Let x(q) = -3q*2. Let j(n) = 714n + 254n + 653n. What is j(x(k))? -4863k2 Let a(h) = 28h. Let p(u) = -103345u2. Calculate a(p(y)). -2893660y*2 Let w(o) = 19o*2. Let f(r) = -1039966r. Calculate f(w(g)). -19759354g2 Let y(m) = 59m*2 - 6m + 51. Let k(o) = 176o2 - 16o + 136. Let x(v) = 12k(v) - 32y(v). Let a(l) = 17l2. What is x(a(w))? 64736w*4 Suppose -5 - 1 = -3s. Let c(k) = 6k2 + 24k*2 - 28k*s. Let w(q) = 4q + 0q + 9q.	{ "pile_set_name": "DM Mathematics" }
ess -4j + 2j*3 + 10j*4 + 32j*2 + 3j - 32j2 as y + hj*2 + aj + fj4 + cj*3 and give c. 2 Express (-3f + 0f + 2f)(-5 - 2 + 4) - 3f + 3f - 2f - f - 4f + 2f in the form w + bf and give b. -2 Rearrange -45a*2 + 21a*2 + 22a*2 to the form h + ga*2 + xa and give g. -2 Express -2b + 3 - 3 - 12b as m + pb and give p. -14 Rearrange -2c + 18c - 7c to s + jc and give j. 9 Express (-3 + 5 - 5)(-11o + 0 - 1 + 2) as io + r and give i. 33 Rearrange -2 + 2 - 2t2 + (t2 - 4t*2 + 2t*2)(10 - 3 - 37) to xt + b + mt*2 and give m. 28 Express (-7 - 1 + 0)(s + 4s - 4s)(-2s*2 + 0s - s - 2s) in the form bs*2 + ds + x + ys3 and give b. 24 Rearrange -4 + 4 + 12p + 15p to h + yp and give y. 27 Express -4t2 + 197t*3 - 198t*3 - 3t*2 - 3t as x + ft3 + ut*2 + kt and give f. -1 Express 2978 - 2963 - i - i in the form g + xi and give g. 15 Rearrange 2m*2 + 0m*2 - 2m4 + m3 - 3m2 - m2 + 2 to am*2 + d + qm*3 + rm*4 + pm and give q. 1 Rearrange 0g3 - 3g*3 + 2g*3 + (2g - 2g - 6g)(-4g*2 + 5g*2 - 24g2 + (0 - g2 + 0)(-5 + 1 + 3)) to dg*2 + l + qg + cg3 and give c. 131 Express -1 + 2 - k4 + 2k + 3k4 - 4k*4 - 2k*3 in the form rk*3 + bk + fk4 + yk*2 + v and give v. 1 Rearrange (2h*4 + 0h*4 - 7h*4)(0 + 12 + 10 + (0 - 3 + 4)(-2 + 3 - 3) + 0 - 1 - 1) to z + xh*4 + mh*3 + yh*2 + lh and give y. 0 Express (1 + 3k + 5k + 2)(0k + k - 2k) in the form g + pk + bk2 and give b. -8 Rearrange -6l*4 - 2 + 8l*3 + 5l*4 - 5l - 6l3 to the form ql + a + il4 + hl*2 + tl*3 and give i. -1 Rearrange 26j - 54 + 54 to the form t + ij and give t. 0 Rearrange -8n*4 - 5n*4 - 2n + 11n4 + n - 4 - 5n*3 to jn*3 + qn*4 + sn + wn2 + x and give x. -4 Rearrange -20z + 0z - z to the form az + k and give k. 0 Express 4b - 3b - 20b as fb + n and give f. -19 Express k + 1 + k*3 - 2k - 3 - 2k as q + dk*3 + zk + yk2 and give d. 1 Express 2c + 2 + 0c4 - 9 - 2c*4 + 6 + 4c*2 in the form s + yc + hc4 + ac*2 + vc*3 and give a. 4 Rearrange -24j*2 + 87j*2 - 12j*2 - 30j*2 to qj*2 + bj + m and give q. 21 Express -i + 92 + 4i2 - 92 in the form bi*2 + si + k and give b. 4 Express (1 - 6 + 3)(1 + 7 - 7 - n + 2n + n - n + (0 + 2 - 3)(-4n + n + n) - 6n + 0n + 4n) as wn + j and give w. -2 Rearrange 15t2 + 12t*2 - 4t*2 - 7t*2 to the form pt + q + kt2 and give q. 0 Express (2l - 4l + l)((-3l - l + 3l)(2 + 1 - 1) - 3 + 4l + 3) + (-l - l - 5l)(2l + 3l - 3l) in the form s + pl + hl2 and give h. -16 Express -16n*2 - 10n*2 - 4n2 + n2 as an + z + on*2 and give z. 0 Express ((-3 - 1 + 3)(2 - 2 + u*2) - 2u2 + u2 + 0u2)(-3u2 - u2 + 0u*2) in the form tu*4 + yu + l + ku2 + nu*3 and give k. 0 Rearrange -4 + 9d + 6 - 2 to a + fd and give f. 9 Express l2 - 5l*2 - 6 + 6l*2 in the form ul*2 + h + tl and give u. 2 Rearrange (0v - 2v + v)(185v*2 - 181v*2 + 4v - 2v + 3) to the form wv + dv3 + c + mv*2 and give w. -3 Rearrange (2 - 5 + 1)(2h2 - 4h2 - h2 + (h + 1 - 1)(-3h + 4h + 0h)) + 2h2 + 0h*2 + 0h*2 to th*2 + bh + c and give t. 6 Rearrange (5a - 2a - a)(2 - 3 - 3) + 2a - 5a - a to the form m + qa and give q. -12 Rearrange (z + 2 - 2 + (3 - 1 - 4)(1 - 2z - 1))(132 - 70 - 52) to the form r + sz and give s. 50 Express (2g - g2 - 2g)(4g - 4g - g) - 38g*2 + 7g + 2g3 + 38g*2 in the form xg*3 + pg*2 + yg + u and give x. 3 Express -2 + 5 + 25n - 2n - 6 as jn + l and give j. 23 Express (-3 + 3 - 11i)(-2i + 2i - 2i) + 3 - 3 + 4i2 as u + di*2 + si and give d. 26 Express g*3 + 2g4 + g2 - 33g + 3g*4 - 3g*4 + 34g as hg4 + vg*3 + tg*2 + bg + j and give b. 1 Rearrange -7h - 2h - 2h - h to the form o + bh and give b. -12 Express 2q3 + 2q*4 - 2 + 2q*3 - 4q*4 as y + oq*4 + fq*3 + pq*2 + hq and give o. -2 Rearrange 7r2 - r - 3r*2 + 2 - 2r*2 + 0 to the form sr + w + kr2 and give k. 2 Express (-4 + 0c - 2c + 0c)(2 + 3c - 2) as bc2 + o + lc and give o. 0 Rearrange (-86 - 80 - 99c + 166)(2c2 + c2 - 6c*2) to uc*3 + pc*2 + gc + x and give u. 297 Rearrange -14n - 6n - 3n2 - 8n - 9n to yn + w + tn2 and give y. -37 Rearrange 2 + 25o*3 - 6o*3 - 1 to the form so*3 + to + i + zo2 and give i. 1 Rearrange p2 + 0p + 2p + p2 to xp + ip2 + b and give x. 2 Express -23g*2 - 22g*2 + 7g*2 as ng + zg2 + l and give z. -38 Express (4q - q - 2q)(-4 + 6 + 2)(-2q*2 + 12q*2 + 5q*2) as gq*3 + r + oq + nq2 and give g. 60 Express -69g*2 + 134g*2 - 3g + 8g - 64g*2 as c + mg + xg2 and give m. 5 Rearrange t + t - 3t - 16t to at + l and give a. -17 Express -3a + 3a + a + (1 + a - 1)(11 - 3 + 8) in the form l + za and give z. 17 Express ((-2 - 3 + 6)(0 + 0 - 2) + 1 + 2 - 1 - 10 + 6 - 15 - 1 + 0 - 1)(3p2 - 3p*2 + 2p*2) in the form cp + rp2 + i and give r. -42 Rearrange 116z3 - 1 - z4 - 116z3 - 3z + 2z2 to the form cz*2 + mz*3 + bz + hz4 + v and give v. -1 Express (-4t - t + 2t)(0t + 0t - 2t2) - t2 + 2t*3 - 5t*3 + t + 5t*3 in the form xt + lt2 + st*3 + q and give x. 1 Rearrange -39m - 43m - 71m + (-3m + 7m - 2m)(-3 + 2 + 2) to bm + j and give b. -151 Rearrange (-4 - 1 + 1 + (-1 + 1 - 3)(1 + 0 - 3) + 1 - 3 + 4)(0j + 3j2 - 2j - j*2) to the form ij*2 + bj + w and give i. 8 Express 3j3 + 3j*3 - 3j*3 + 2j - 6j3 as cj*3 + wj + uj2 + q and give w. 2 Express 2 + 3a*3 + 1 - 59a*2 + 58a*2 in the form ya + la3 + r + ma*2 and give r. 3 Rearrange -2t - 42 - 51t3 + 42 to c + pt*3 + mt*2 + jt and give j. -2 Express (-111 + 111 + 13i2)(-3 - 1 + 5) in the form v + gi2 + fi and give g. 13 Express -41n3 + 0n + 2n + n2 + 22n*3 - 3 + 23n*3 in the form u + in*3 + jn + mn2 and give i. 4 Rearrange (0n*2 - 2n2 - n2)(-1 + 0 - 1) + (-2 + 2n + 2)(n + 0n - 2n) to o + in*2 + qn and give i. 4 Rearrange 6t - 27t + 6t to yt + z and give y. -15 Express -2m4 - 1 + m4 - 2m*2 + 5m*4 in the form jm*3 + y + xm + tm2 + gm*4 and give g. 4 Express 7 + 2 - 4 + 2l + 9 as f + tl and give t. 2 Rearrange -2b + 2b2 + 5b - 2b2 + 2b*3 to u + hb*2 + qb*3 + ib and give q. 2 Rearrange (20m - 20m + 16m + 78m)(-1 + 3 + 0) to am + l and give l. 0 Express -28q + 2q2 - q4 + 23q + 4 - 3 - 3 + q3 in the form rq + sq4 + aq*2 + dq*3 + z and give a. 2 Express -3c + 8c - 10c - 15c in the form pc + a and give p. -20 Express 141k + k3 - 20k2 + k3 - 143k as p + qk*3 + ok*2 + zk and give o. -20 Express (-3l + 6l + 2l)(0l2 + l2 - 3l*2) - 3l2 - l3 + 5l2 - l - 3l as xl + pl*3 + j + bl*2 and give x. -4 Express (t - t - t)(1 - 3 + 3) - 3t - 2t + 2t in the form rt + x and give r. -4 Rearrange -234s2 + s + 208s*2 - 2s to xs2 + cs + r and give x. -26 Express (3f3 - 5f3 + f3)(-2 - 4 + 4)(4 - 2 - 1)(3 - 1 + 2f - 7) as nf4 + hf + zf3 + if*2 + p and give n. 4 Rearrange -6w + 6w + 78w*2 - 15w*2 to the form lw + sw2 + h and give h. 0 Express -5i*3 - 4i + 4i + (i + i - i)(-1 + i*2 + 1) + 3i*3 + 4i*3 - 5i*3 - 2i*3 - 4 + 4 in the form zi + n + li3 + ai*2 and give l. -4 Express (6w*2 - 2w2 - w2)(w - 4w + 2w) + w3 - 9w*2 + 3w*2 + 3w*2 in the form ow + b + tw3 + nw2 and give n. -3 Rearrange -m2 - 4m2 + 8 - m2 - 3 to gm*2 + bm + w and give w. 5 Rearrange g - 3g - 5g2 + g3 - g3 + g3 to dg2 + tg + y + ig3 and give i. 1 Rearrange (37d*2 + 4d*2 + 17d*2)(d - 3d + 0d) to pd2 + bd*3 + y + ad and give b. -116 Rearrange 1 - 3u3 - u3 + 3u*3 + 0u3 - u2 to the form du + qu*3 + yu*2 + r and give y. -1 Express (3d*2 - 4d*2 + 2d*2)(4 - 5 - 1) + 12d2 - 8d + 8d + 2 + 4d*2 - 2 as zd + cd2 + o and give c. 14 Rearrange -28c*2 + 28c*2 + 15c*3 + (7c*2 - 3c*2 - 3c*2)(-c + 3c - c) to the form rc*2 + hc*3 + fc + i and	{ "pile_set_name": "DM Mathematics" }
1, v: 1, z: 2, m: 1, y: 1, n: 1}. 1/42 Calculate prob of sequence jjj when three letters picked without replacement from ejnmnm. 0 Two letters picked without replacement from {i: 7, x: 5}. Give prob of sequence ii. 7/22 Three letters picked without replacement from {d: 1, u: 1, o: 1}. Give prob of sequence dou. 1/6 What is prob of sequence ta when two letters picked without replacement from {n: 1, f: 6, t: 2, x: 2, a: 4}? 4/105 Four letters picked without replacement from xwowwowxxwjowox. Give prob of sequence wojo. 1/455 Calculate prob of sequence ny when two letters picked without replacement from {w: 4, d: 2, b: 1, n: 6, y: 2, g: 4}. 2/57 What is prob of sequence sn when two letters picked without replacement from tjtgtjtjtjtsqtntt? 1/272 Calculate prob of sequence yy when two letters picked without replacement from {y: 2, u: 16}. 1/153 Calculate prob of sequence ru when two letters picked without replacement from {c: 2, r: 3, f: 5, v: 1, h: 1, u: 1}. 1/52 Three letters picked without replacement from {a: 2, v: 2, y: 1}. Give prob of sequence yaa. 1/30 Calculate prob of sequence iibw when four letters picked without replacement from {q: 8, w: 1, x: 2, i: 2, b: 2}. 1/8190 What is prob of sequence csp when three letters picked without replacement from lkkcsspslclssksk? 1/280 Calculate prob of sequence ug when two letters picked without replacement from cccugggg. 1/14 Two letters picked without replacement from {e: 4, t: 1, c: 1, w: 2}. Give prob of sequence te. 1/14 Three letters picked without replacement from trrrrotmnmokrmr. Give prob of sequence ntt. 1/1365 Two letters picked without replacement from miqlvwiq. What is prob of sequence wl? 1/56 What is prob of sequence pq when two letters picked without replacement from {q: 1, p: 1, x: 2}? 1/12 Four letters picked without replacement from {g: 5, s: 2}. What is prob of sequence sggs? 1/21 Three letters picked without replacement from ififflf. What is prob of sequence lfi? 4/105 Three letters picked without replacement from oou. Give prob of sequence uoo. 1/3 Calculate prob of sequence kyh when three letters picked without replacement from {k: 4, y: 3, w: 4, h: 4}. 8/455 Three letters picked without replacement from uuhuhuuhuuuu. What is prob of sequence hhh? 1/220 Calculate prob of sequence gs when two letters picked without replacement from rygersrr. 1/56 Four letters picked without replacement from auauuaauuuuau. What is prob of sequence uuuu? 14/143 What is prob of sequence zzz when three letters picked without replacement from {v: 9, r: 5, z: 2, y: 2}? 0 Three letters picked without replacement from mhnmhmh. Give prob of sequence nmh. 3/70 Calculate prob of sequence akb when three letters picked without replacement from aawfabwfgafkbg. 1/273 Four letters picked without replacement from ppppppp. Give prob of sequence pppp. 1 Two letters picked without replacement from xccxxxxxxxc. Give prob of sequence xc. 12/55 Calculate prob of sequence vkx when three letters picked without replacement from {k: 5, v: 3, y: 4, x: 4}. 1/56 Calculate prob of sequence nf when two letters picked without replacement from {f: 4, t: 6, n: 4, v: 5}. 8/171 Calculate prob of sequence ppxn when four letters picked without replacement from xxpnxxxnpnnxxpxp. 4/455 Four letters picked without replacement from {z: 2, d: 6, b: 5}. Give prob of sequence bbdd. 5/143 What is prob of sequence qq when two letters picked without replacement from bbqbbbbq? 1/28 Calculate prob of sequence gu when two letters picked without replacement from ugguuuuuuu. 8/45 Four letters picked without replacement from xcsxcxc. Give prob of sequence xccs. 3/140 What is prob of sequence ga when two letters picked without replacement from ggga? 1/4 Four letters picked without replacement from {i: 3, q: 17}. Give prob of sequence iiii. 0 What is prob of sequence ggv when three letters picked without replacement from {v: 6, g: 4}? 1/10 Calculate prob of sequence fmyf when four letters picked without replacement from {f: 12, y: 1, m: 1}. 1/182 Four letters picked without replacement from eqkk. Give prob of sequence keqk. 1/12 Two letters picked without replacement from odynkkro. Give prob of sequence yr. 1/56 Three letters picked without replacement from {s: 3, o: 5, x: 2}. What is prob of sequence ooo? 1/12 Three letters picked without replacement from ggtwwwwgwgwtwgggggt. What is prob of sequence gtt? 3/323 Three letters picked without replacement from ekevkeeenkntvtett. What is prob of sequence kek? 3/340 Calculate prob of sequence llz when three letters picked without replacement from {z: 1, n: 3, t: 1, l: 7, j: 2}. 1/52 Three letters picked without replacement from tzzeztzzqtteql. What is prob of sequence qzz? 5/273 What is prob of sequence fam when three letters picked without replacement from {f: 1, m: 5, a: 3, l: 1}? 1/48 Calculate prob of sequence at when two letters picked without replacement from ttam. 1/6 What is prob of sequence cc when two letters picked without replacement from axxcaaxacaxaxaaa? 1/120 Two letters picked without replacement from xssxsxxsssxsssss. Give prob of sequence sx. 11/48 Four letters picked without replacement from {g: 2, w: 2, x: 8, m: 4, f: 3, l: 1}. What is prob of sequence ffww? 1/9690 Four letters picked without replacement from {n: 2, o: 4, f: 2, d: 7, b: 2, u: 2}. Give prob of sequence dffu. 7/23256 Three letters picked without replacement from {j: 3, e: 5, y: 8}. Give prob of sequence eje. 1/56 What is prob of sequence en when two letters picked without replacement from {b: 1, n: 7, e: 2, g: 1, j: 3}? 1/13 Four letters picked without replacement from dzidddddsieeddiddde. Give prob of sequence deed. 55/7752 Four letters picked without replacement from qwwsqqqdiqw. What is prob of sequence disq? 1/1584 What is prob of sequence zzr when three letters picked without replacement from mmcczmrcmbbzzmccm? 1/680 Four letters picked without replacement from wwtwtwt. What is prob of sequence twtw? 3/35 Two letters picked without replacement from {n: 11, k: 9}. Give prob of sequence nn. 11/38 Two letters picked without replacement from {r: 2, z: 4, g: 7}. Give prob of sequence rz. 2/39 What is prob of sequence drd when three letters picked without replacement from {d: 2, u: 4, y: 1, r: 3, c: 2}? 1/220 Calculate prob of sequence oogg when four letters picked without replacement from {g: 3, o: 9}. 2/55 Three letters picked without replacement from {v: 5, b: 6, e: 4}. What is prob of sequence vvv? 2/91 Four letters picked without replacement from {t: 1, u: 1, d: 1, r: 1, y: 1}. What is prob of sequence rtyy? 0 Two letters picked without replacement from {k: 1, h: 3, r: 5}. What is prob of sequence rh? 5/24 Calculate prob of sequence tu when two letters picked without replacement from {u: 1, e: 3, b: 1, t: 2}. 1/21 Four letters picked without replacement from {r: 3, t: 2, g: 4}. Give prob of sequence grtt. 1/126 Calculate prob of sequence hnnh when four letters picked without replacement from gnnhghjvgghghvghvj. 1/1836 Three letters picked without replacement from yvctvvdtvtcv. Give prob of sequence ydv. 1/264 Three letters picked without replacement from eoorrersoxe. Give prob of sequence orr. 1/55 Three letters picked without replacement from {t: 2, a: 1, c: 1, i: 1}. What is prob of sequence iaa? 0 What is prob of sequence ij when two letters picked without replacement from {i: 8, s: 4, j: 1}? 2/39 What is prob of sequence td when two letters picked without replacement from vdtxtx? 1/15 What is prob of sequence ft when two letters picked without replacement from tftft? 3/10 Four letters picked without replacement from qqqqqqwwoqqqoqq. Give prob of sequence owoq. 11/8190 Calculate prob of sequence wii when three letters picked without replacement from {w: 6, i: 12}. 11/68 Calculate prob of sequence qqp when three letters picked without replacement from {q: 2, x: 6, f: 1, a: 4, t: 3, p: 2}. 1/1224 Two letters picked without replacement from iigixccigiic. What is prob of sequence cg? 1/22 What is prob of sequence ppf when three letters picked without replacement from wfbpvpbbb? 1/252 Three letters picked without replacement from jqqqfqnfcncqfffnfffj. What is prob of sequence fnc? 2/285 Three letters picked without r	{ "pile_set_name": "DM Mathematics" }
*m - 2/11p2 + 0 = 0. -1, 0 Let s(w) be the second derivative of w6/80 + 363w5/20 + 39123w*4/4 + 2125522w*3 + 12519843w*2 + 260w - 3. Suppose s(h) = 0. What is h? -322, -2 Let k(t) be the second derivative of 2t6/15 - 87t*5/5 + 585t*4 + 4050t*3 - 195t + 2. Let k(r) = 0. What is r? -3, 0, 45 Let t(d) be the third derivative of -d*5/2 + 5d*4/4 - 3d*3/2 + 37d2. Let v(q) = -q2. Let a(r) = -t(r) + 5v(r). Find b, given that a(b) = 0. 3/5 Let k = 131 + -106. Let p = 7 + -9. Let s(v) = -85v*2 + 155v. Let d(w) = -7w2 + 13w. Let t(y) = kd(y) + ps(y). Factor t(f). -5f(f - 3) Let n(v) be the second derivative of -5v7/42 + 161v*6/6 - 6715v*5/4 + 31205v*4/4 - 2016v. Factor n(i). -5i2(i - 79)*2(i - 3) Let z(l) be the third derivative of -21/160l5 + 4l + 0 + 1/280l7 + 11l*2 - 1/64l*4 + 7/16l*3 - 11/320l6. Find a such that z(a) = 0. -1, 1/2, 7 Let u(a) = a2 + 31a + 56. Let r(l) be the third derivative of -5l*4/4 - 55l*3/6 + 37l*2. Let s(t) = 4r(t) + 5u(t). Suppose s(f) = 0. What is f? -4, -3 Suppose 562 = -54p + 670. Factor 9/7t + 3/7t*3 + 12/7t*p + 0. 3t(t + 1)(t + 3)/7 Let x(j) be the third derivative of j*5/12 - 635j*4/12 + 1265j*3/6 + 10j*2 - 131j. Factor x(o). 5(o - 253)(o - 1) Let y(o) = 14 + 2o2 - 3o*2 - 19o + 12o2 - 7o. Let l(t) = -65t2 + 155t - 85. Let r(g) = 6l(g) + 35y(g). Factor r(p). -5(p - 2)2 Let h(t) be the third derivative of -109t*2 + 0t - 3/280t7 + 1/1344t*8 + 0t*3 + 0 + 5/96t*6 - 9/80t*5 + 5/48t*4. Factor h(b). b(b - 5)(b - 2)(b - 1)*2/4 Factor -90t - 14t3 + 0t*4 + 39t2 - 194805 + t4 + 194805 + 24t2. t(t - 6)(t - 5)(t - 3) Let n(m) = -7m2 - 125m - 3. Let d be n(7). Let k be (9 + d/135)-190. Factor 16/9 + 56/9q + 16/9q4 + kq*2 + 50/9q*3 + 2/9q*5. 2(q + 1)*2(q + 2)*3/9 Suppose 956/3d*3 + 1848d*2 + 2/3d*5 + 11858/3d + 24d4 + 0 = 0. Calculate d. -11, -7, 0 Let f(u) be the first derivative of 23u*4/2 - 997u*3/6 - 167u*2/4 + 11u + 437. Determine v so that f(v) = 0. -1/4, 2/23, 11 Let l(u) be the first derivative of -u*3/27 + 245u*2/9 - 976u/9 + 2787. Solve l(m) = 0 for m. 2, 488 Let y(f) be the second derivative of 114f + 0 + 53/11f*2 - 2/55f*5 - 71/11f*3 + 36/11f*4. Determine k so that y(k) = 0. 1/2, 53 Let u = -788 + 1243. Determine o so that uo - 900o + 452o - o*2 + 30 = 0. -3, 10 Let w(m) = 4m*2 - 347m + 266. Let p be w(86). Let l(s) be the first derivative of -ps + 3 + 8/3s*3 - 6s*2. Solve l(f) = 0. -1/2, 2 Factor -198226y*2 - 228y + 99110y2 + 99118y*2 - 1694. 2(y - 121)(y + 7) Suppose -2z - 40y = 432, 52z + 5y = 56z - 71. Let j = 0 + 2. Suppose 4/3r3 + 8/3r*2 + 2/3r*5 - jr + 0 - 8/3rz = 0. What is r? -1, 0, 1, 3 Let k(w) = -1532w + 4. Let i(n) = -n*2 - 2n - 1. Let x(v) = -4i(v) - k(v). Factor x(t). 4t(t + 385) Let p be 114/(-20)-1 + 57/(-190). Let z = -103/20 + p. Suppose zy2 + 1/2y + 0 - 1/4y3 = 0. What is y? -1, 0, 2 Suppose -2/5r*3 - 188/5r - 194/5r2 + 384/5 = 0. Calculate r. -96, -2, 1 Let g = -1/98 - -25/49. Suppose 4 = 17q - 47. Determine k so that 1 - gk - k2 + 1/2k*q = 0. -1, 1, 2 Let b(o) = 13o*2 + 2. Let c be b(1). Let k(a) be the first derivative of 7a*4 + 48a - 4 - 79a4 - 144a*2 + 184a*3 + ca*5 - 18a*4. Factor k(s). 3(s - 2)*2(5s - 2)2 Let k be (-4)/5 + ((-7791)/140)/(-53). Let y be (-4)/18 + 35/36. What is z in -yz*5 - 9/4z*2 + kz*4 + 1 - z + 11/4z*3 = 0? -2, -2/3, 1 Let u(q) be the first derivative of 2q*3/45 - 28q*2/5 - 558q/5 - 4966. Find f such that u(f) = 0. -9, 93 Let h be (-6 + 2)(0 + 1). Let c be (h/10)/((-10)/75). Factor 2m*3 + 10m*2 - 4m*2 - 5m*c. -3m*2(m - 2) Suppose -5a + 3n - 5 + 20 = 0, 4n = -4a + 12. Solve -3/2k3 + a - 15/2k + 6k2 = 0 for k. 1, 2 Let w be (-17)/(544/72) + 1060/400. Factor -2/5p*2 - 8/5p + wp3 + 8/5. 2(p - 2)(p - 1)(p + 2)/5 Let s = 90 + -84. Factor 13d3 + sd*3 - 24d*2 - 23d*3 - 36d. -4d(d + 3)2 Let y(v) be the first derivative of -v6/900 - v*5/24 + 13v*4/120 + 140v*3/3 + 38. Let j(g) be the third derivative of y(g). Factor j(d). -(d + 13)(2d - 1)/5 Let i(z) be the second derivative of z4/12 + 28z*3 - 169z*2/2 - 13z + 6. Factor i(w). (w - 1)(w + 169) Suppose -124b = -17b. Let -1/4s*4 - 1/4s3 + s + b + s2 = 0. What is s? -2, -1, 0, 2 Factor 62/9f2 + 0 - 2/9f*3 - 24f. -2f(f - 27)(f - 4)/9 Let y be (-477)/(-3180)(-4 - -9). Factor -7v + yv*3 + 1/4v*4 - 3/2v*2 - 6. (v - 3)(v + 2)*3/4 Solve -1/3f*2 - 274576/3 - 1048/3f = 0 for f. -524 Let t(k) = 2k2 + 84k - 166. Let u(j) = -50j - 1. Let n(b) = t(b) + 2u(b). Let n(i) = 0. What is i? -6, 14 Let u = -265 + 268. Determine p so that -79p - 20p*u - 5p*2 + 83p + 21p3 = 0. 0, 1, 4 Let f = 4508 - 4505. Let w(z) be the third derivative of 0 + 1/96z*4 - 24z*2 + 1/240z*5 + 0z - 1/480z6 - 1/24zf. Factor w(v). -(v - 1)2(v + 1)/4 Let o(y) = 2y*2 + 56y + 104. Let a(f) = f + 2. Let n(h) = 6a(h) + o(h). Suppose n(g) = 0. What is g? -29, -2 Let g(o) = 9o + 136. Let n be g(-12). Let z be (n + -30)/(15/(-66)). Factor -zq - 16/5 - 6q*2. -2(3q + 2)(5q + 4)/5 Let a(y) = y3 + 8y*2 - 6y - 5. Let n be a(-9). Let g = 36 + n. Determine w so that -7w3 + 4w*5 + 0w*3 + gw - w3 = 0. -1, 0, 1 Let h(z) be the first derivative of -z6/36 + 13z5/15 - 49z*4/24 + 4z3/3 + 216. Factor h(w). -w2(w - 24)(w - 1)*2/6 Let -234/7t - 108 + 6/7t2 = 0. What is t? -3, 42 Let l(z) be the first derivative of z6/48 + 7z5/80 + z4/8 + 50z3/3 + 34. Let v(a) be the third derivative of l(a). Factor v(r). 3(r + 1)(5r + 2)/2 Let s(p) = -p*3 - 37p*2 + 2103p - 340. Let r be s(-68). Factor 2m3 + 0 + rm*2 - 49/3m*5 - 7/3m*4 + 0m. -m*3(7m - 2)(7m + 3)/3 Let j(r) = -101r*3 - 164r*2 - 1500r - 1118. Let k(y) = 7y3 + 12y*2 + 107y + 80. Let i(o) = 2j(o) + 29k(o). Factor i(s). (s + 1)(s + 7)(s + 12) Let s(y) = 11 - 8 + 4y - 2y*2 - 2y2. Let x(r) = -r2 + 7 + 8 - 14 + r. Let n(k) = -s(k) + 3x(k). Factor n(h). h(h - 1) Factor 4/3n - 1/3n3 + 4 - n2. -(n - 2)(n + 2)(n + 3)/3 Solve -8x2 - 58258x - 6x4 + 16x*3 + 2x*4 + 58258x - 4x2 = 0 for x. 0, 1, 3 Let u(t) be the third derivative of t6/480 - 3t5/40 + t4/12 + 16t3 + 4693t*2. Factor u(w). (w - 16)(w - 6)(w + 4)/4 Let h(w) be the first derivative of -5w*4/4 - 565w*3/3 - 8640w*2 - 72900w + 1377. Factor h(l). -5(l + 5)(l + 54)*2 Suppose -3m = w - 58, 6w + 5m + 95 = 404. Let x(h) be the first derivative of 17 - wh - 1/3h*3 - 7h2. Factor x(j). -(j + 7)2 What is i in 4/7i3 + 2908/7i - 1460/7i2 - 1452/7 = 0? 1, 363 Let u be (-12)/(-54)27/3. Let g(s) = -s4 - s3 - s*2. Let h(b) = 4b4 - b3 - 8b2 - b. Let a(y) = ug(y) - h(y). Factor a(q). -q(q - 1)(q + 1)(6q + 1) Let v(b) = -1. Let g(u) = u*2 - 10u + 3. Let s be 12(-1)/26-13. Let i(q) = sv(q) - g(q). Factor i(h). -(h - 9)(h - 1) Suppose 13 = 5h + 3. Suppose 10y - hy - 1352 = 0. Solve -yb*3 - 4b*2 + 85b*3 + 80b*3 = 0. -1, 0 Factor 1096g - 248g + 430g - 134g + 327184 + g2. (g + 572)2 Let w(t) be the second derivative of 2 + 16t - 3/5t2 + 1/30t*4 + 2/15t*3. Factor w(i). 2(i - 1)(i + 3)/5 Factor -857 - 11x*2 + 1712 - 855 + 12x*2 - 1609x. x(x - 1609) Let k = -16/1239 - -44812/16107. Factor 0 + ky - 2/13y2. -2y(y - 18)/13 Let l(x) be the first derivative of -x6/2340 - 8x*5/195 - 64x4/39 + x3/3 + x*2 - 91. Let a(b) be the third derivative of l(b). Factor a(z). -2(z + 16)*2/13 Let x(u) be the first derivative of 15u*4/4 + 72u*3 + 759u*2/2 + 270u - 3512. Let x(f) = 0. Calculate f. -9, -5, -2/5 Let q = -3 + 6. Suppose -qv + 6v - 6 = 0. Let 2i5 - vi*4 + 9i*4 - 7i*4 = 0. Calculate i. 0 Let i(g) be the third derivative of -3g + 0 + 1/21g4 + 1/735g*7 - 1/14g*5 - 31g*2 + 1/210g*6 + 20/21g3. Find y such that i(y) = 0. -5, -1, 2 Let l(o) be the second derivative of o4/12 + 811o3/3 - 3816o. Factor l(g). g*(g + 1622) Let t(w) be the third derivati	{ "pile_set_name": "DM Mathematics" }
f'th term of -650892, -1301776, -1952660, -2603544, -3254428, -3905312? -650884f - 8 What is the u'th term of -1103818, -1103979, -1104140? -161u - 1103657 What is the u'th term of 28147, 28543, 28939? 396u + 27751 What is the f'th term of -8910116, -8910110, -8910102, -8910092? f2 + 3f - 8910120 What is the w'th term of 1868, 3726, 5580, 7430, 9276? -2w2 + 1864w + 6 What is the y'th term of -6553, -13021, -19489, -25957, -32425? -6468y - 85 What is the k'th term of 3313205, 3313204, 3313203, 3313202, 3313201, 3313200? -k + 3313206 What is the l'th term of 11814, 23187, 34568, 45957, 57354, 68759, 80172? 4l*2 + 11361l + 449 What is the q'th term of -989020, -989153, -989286, -989419, -989552, -989685? -133q - 988887 What is the q'th term of -7104, -8512, -9920, -11328, -12736, -14144? -1408q - 5696 What is the l'th term of -7939, -8154, -8669, -9634, -11199, -13514, -16729? -25l3 - 40l - 7874 What is the j'th term of -13329, -28731, -44117, -59481, -74817, -90119? j*3 + 2j*2 - 15415j + 2083 What is the m'th term of 27103, 53331, 79561, 105793, 132027, 158263, 184501? m*2 + 26225m + 877 What is the z'th term of -57363, -114667, -171971, -229275, -286579? -57304z - 59 What is the k'th term of -3188, -9889, -16590, -23291? -6701k + 3513 What is the l'th term of 222, 737, 1566, 2685, 4070, 5697, 7542, 9581? -4l3 + 181l*2 + 45 What is the q'th term of -1899126, -1899101, -1899076, -1899051? 25q - 1899151 What is the t'th term of 1768268, 3536525, 5304782, 7073039? 1768257t + 11 What is the l'th term of 6543, 14135, 21715, 29283, 36839? -6l*2 + 7610l - 1061 What is the j'th term of 172727, 345212, 517697, 690182, 862667, 1035152? 172485j + 242 What is the c'th term of 7, 261, 1149, 3049, 6339, 11397, 18601, 28329? 63c*3 - 61c*2 - 4c + 9 What is the r'th term of 371, 3138, 10749, 25658, 50319, 87186? 409r3 - 32r*2 - 6 What is the p'th term of 1137, 2502, 4195, 6378, 9213? 27p*3 + 2p*2 + 1170p - 62 What is the m'th term of 34705075, 34705076, 34705077, 34705078, 34705079, 34705080? m + 34705074 What is the n'th term of -4022, -6218, -6538, -4976, -1526, 3818, 11062, 20212? n*3 + 932n*2 - 4999n + 44 What is the g'th term of 1146, 2884, 5800, 9894, 15166, 21616, 29244? 589g2 - 29g + 586 What is the s'th term of -3945111, -7890214, -11835319, -15780426, -19725535, -23670646? -s*2 - 3945100s - 10 What is the z'th term of 1362, 3100, 4838, 6576, 8314, 10052? 1738z - 376 What is the a'th term of 4016, 32296, 108998, 258332, 504508, 871736? 4035a3 + a2 + 32a - 52 What is the u'th term of 38136, 38150, 38164, 38178, 38192, 38206? 14u + 38122 What is the q'th term of 1659, 3994, 6471, 9162, 12139, 15474, 19239? 12q3 - q2 + 2254q - 606 What is the b'th term of 12185082, 12185075, 12185064, 12185049? -2b2 - b + 12185085 What is the s'th term of -61027, -61052, -61077, -61102, -61127? -25s - 61002 What is the s'th term of 2213204, 4426439, 6639676, 8852915? s*2 + 2213232s - 29 What is the b'th term of -966, -3610, -8028, -14226, -22210, -31986? -b*3 - 881b*2 + 6b - 90 What is the f'th term of -698155, -698151, -698147, -698143, -698139, -698135? 4f - 698159 What is the x'th term of 9831, 38254, 85627, 151950, 237223? 9475x*2 - 2x + 358 What is the p'th term of -25081, -24989, -24897? 92p - 25173 What is the u'th term of 7735624, 15471311, 23206998, 30942685, 38678372? 7735687u - 63 What is the o'th term of -49118, -60634, -72150, -83666, -95182, -106698? -11516o - 37602 What is the y'th term of 2101748, 2101738, 2101728, 2101718? -10y + 2101758 What is the v'th term of -32574, -65214, -97854, -130494, -163134? -32640v + 66 What is the o'th term of 17491, 140094, 472859, 1120864, 2189187, 3782906? 17513o*3 + 3o*2 + 3o - 28 What is the y'th term of 1764807, 1764771, 1764735, 1764699, 1764663, 1764627? -36y + 1764843 What is the u'th term of 2112423, 4225029, 6337635, 8450241, 10562847, 12675453? 2112606u - 183 What is the o'th term of 32128067, 32128064, 32128061, 32128058? -3o + 32128070 What is the s'th term of 19683, 33450, 47217? 13767s + 5916 What is the i'th term of -899, -3581, -10867, -25061, -48467, -83389, -132131? -384i3 + 2i2 - 517 What is the k'th term of 1407446, 2814854, 4222264, 5629676? k2 + 1407405k + 40 What is the t'th term of 37371, 34807, 30535, 24555, 16867, 7471, -3633? -854t*2 - 2t + 38227 What is the d'th term of -137532, -137421, -137310, -137199? 111d - 137643 What is the q'th term of 74108, 148223, 222354, 296501, 370664, 444843, 519038? 8q*2 + 74091q + 9 What is the o'th term of -194, -51, 244, 769, 1602, 2821, 4504, 6729? 13o3 - 2o*2 + 58o - 263 What is the o'th term of 95516, 193470, 291424, 389378? 97954o - 2438 What is the x'th term of -6145, -11993, -17335, -21919, -25493, -27805? 42x3 + x2 - 6145x - 43 What is the b'th term of 42686, 85393, 128094, 170783, 213454? -b3 + 3b*2 + 42705b - 21 What is the f'th term of 68290, 138186, 208078, 277966, 347850? -2f2 + 69902f - 1610 What is the b'th term of -6703285, -26813131, -60329537, -107252503, -167582029, -241318115? -6703280b2 - 6b + 1 What is the h'th term of -10779900, -10779924, -10779948, -10779972, -10779996? -24h - 10779876 What is the l'th term of 588, 1226, 1934, 2712? 35l*2 + 533l + 20 What is the t'th term of 543811, 543806, 543797, 543784, 543767? -2t2 + t + 543812 What is the u'th term of -100703, -201467, -302365, -403463, -504827, -606523? -11u3 - u2 - 100684u - 7 What is the i'th term of -93684, -102661, -111648, -120651, -129676? -i3 + i2 - 8973i - 84711 What is the w'th term of -24555, -98118, -220685, -392256, -612831? -24502w2 - 57w + 4 What is the w'th term of 249914, 501409, 752904? 251495w - 1581 What is the v'th term of -1979877, -1979876, -1979867, -1979844, -1979801? v3 - 2v*2 - 1979876 What is the f'th term of 25966, 26495, 27024, 27553? 529f + 25437 What is the k'th term of 2726152, 2726258, 2726364, 2726470, 2726576? 106k + 2726046 What is the i'th term of -10668, -13381, -17908, -24255, -32428? -i3 - 901i*2 - 3i - 9763 What is the o'th term of -19822956, -19822958, -19822962, -19822968, -19822976, -19822986, -19822998? -o*2 + o - 19822956 What is the v'th term of 823846, 3295366, 7414514, 13181248, 20595526, 29657306, 40366546? -7v*3 + 823856v*2 + v - 4 What is the c'th term of -527, -487, -381, -185, 125, 573, 1183? 4c*3 + 9c*2 - 15c - 525 What is the k'th term of -445427, -445410, -445391, -445370, -445347, -445322? k*2 + 14k - 445442 What is the j'th term of -38, -99, -244, -479, -810, -1243? -j*3 - 36j*2 + 54j - 55 What is the q'th term of 6590, 13206, 19786, 26330, 32838, 39310? -18q2 + 6670q - 62 What is the p'th term of 6292, 10978, 14058, 15526, 15376, 13602, 10198? -p*3 - 797p*2 + 7084p + 6 What is the f'th term of -9986, -8434, -5852, -2240, 2402, 8074? 515f2 + 7f - 10508 What is the r'th term of -111692, -223399, -335106, -446813, -558520, -670227? -111707r + 15 What is the a'th term of -518916, -1037818, -1556720, -2075622, -2594524? -518902a - 14 What is the f'th term of 759558, 1519062, 2278566, 3038070? 759504f + 54 What is the y'th term of 994, 2690, 5082, 8170? 348y*2 + 652y - 6 What is the f'th term of -1512814, -1512882, -1512950, -1513018, -1513086? -68f - 1512746 What is the q'th term of -16079072, -64316272, -144711604, -257265068, -401976664? -16079066q*2 - 2q - 4 What is the a'th term of 1817, -3031, -7879, -12727, -17575, -22423? -4848a + 6665 What is the v'th term of 42070, 90789, 139508, 188227? 48719v - 6649 What is the o'th term of -12734, -101590, -342846, -812726, -1587454? -12704o3 + 24o*2 - 54 What is the z'th term of -381260, -762489, -1143692, -1524869, -1906020, -2287145, -2668244? 13z*2 - 381268z - 5 What is the t'th term of 1602490279, 1602490280, 1602490281, 1602490282, 1602490283, 1602490284? t + 1602490278 What is the s'th term of -5113, -20629, -46781, -83809, -131953? -40s3 - 5078s*2 - 2s + 7 What is the n'th term of -4329, -17303, -38929, -69213, -108161, -155779, -212073, -277049? -n*3 - 4320n*2 - 7n - 1 What is the k'th term of 1867, 3790, 5749, 7744, 9775? 18k*2 +	{ "pile_set_name": "DM Mathematics" }
w(-2/17))(6/25))(-9/2))(-42) assuming w is positive. w*(4104/425) Simplify (ii*(-1/2)i(-11))(-1/61)ii/i*(5/3)ii/i(-1/2)(i*(2/13)iii)/(ii6) assuming i is positive. i(-2000/2379) Simplify ((k2)35)(2/17)/((k(1/7)k)/kkkkk(2/5))(-2/15) assuming k is positive. k(77716/8925) Simplify (((a20/a)/(a(-10)/a))/(a(3/23)/(a*(-21)a)))(-19/5) assuming a is positive. a(-4313/115) Simplify (f/(ff(f/((f/f*(1/2))/f))/ff))49/(f(-5)f/(ff*(-3)))((f((fff(-1))/f)/f)/(f(2/11)/f))/(ff*6f/(ff(-1)/f)) assuming f is positive. f(-2831/22) Simplify ((tt*(1/47)t*(-3/28))/(((tt9/t)/t)/t)(-25))(-25) assuming t is positive. t(-5787575/1316) Simplify ((yy(2/5)y)*(-2/45)(y0)(8/5))/(y(-8)/(y/((y/y6y)/y))y*6yyy*(-3/2)y) assuming y is positive. y*(959/150) Simplify ((((wwwww17ww)/w)/www/w(2/19))/((((w12w)/w)/w)/(wwwww*(2/15)w)))(7/5) assuming w is positive. w(33971/1425) Simplify (((z*(-11/4)z)/(z/(((z/z(-4))/z)/z)))/(z(15/8)/z3))(8/15) assuming z is positive. z(11/15) Simplify ((o(-2/9)/oo)(-4/17))27(o(-2/13)/o1)/(o*(2/25)o*(-2/13)o) assuming o is positive. o*(-284/425) Simplify ((c((c/((cc(-39))/c)c)/c)/c)/c)/(c/c*(2/43))(cc7c)(-2) assuming c is positive. c(862/43) Simplify (((pp6)/p)/(pp*(-1/6))((p0/p)/p)/p(-6))/((p5/p)/(p/p(-6))p1/(p(1/2)/p)) assuming p is positive. p(32/3) Simplify ((f/f(-2/9))(-2/5)((f/(f/f(-2/5)))/f)(2/11))/((f1)28)14 assuming f is positive. f(-194408/495) Simplify ((c*(1/15)cccc/(c/c(1/30)))(-1/11))(-1/15) assuming c is positive. c(31/1650) Simplify ((z/z1)(1/13)(zz(2/9))/(z/(z(-1)/z)z))/(z*(-2/11)z/z*(1/3)(zzz*(-2/3)z)(-11)) assuming z is positive. z(2218/99) Simplify (x*0xxx*(-1/7)x)(-1/8)/(((x/x2xx)/x)/(xx(-4)))(-20/7) assuming x is positive. x(115/14) Simplify (((qq/(q*(-5)q))/((q(-4/3)/q)/q))/(q(-2)/q(-8)))/(((q/q1)/((q/q*(-3/7))/q))/(qq*(-4)q(-6))) assuming q is positive. q(-110/21) Simplify (p(p/p(-1/4))/p)(-47)p*(6/11)p*(3/4)(p(-4/11)/(p(-3/2)p))(1/41) assuming p is positive. p(-4711/82) Simplify ((y(-4/9)/y(-2/7))/(y0y*(-3/5)))/((y((yy(-2/5))/y)/y)/(yy*(2/3)/y)y*(-1/6)yy/(yy(-2))) assuming y is positive. y(-167/126) Simplify (((s/s*(-1/11))/ss(4/13))/(s(-6/13)s(-5/3)s))(-40) assuming s is positive. s(-26200/429) Simplify (((b(2/83))(-23))(-5/13))(-3/8) assuming b is positive. b(-345/4316) Simplify ((v6/v4)/(v(-2/3))(-42))/((v(4/3)v)/v1)46 assuming v is positive. v(-262/3) Simplify ((w(w/w*(-9))/ww)/w(5/3))(3/2)((w(1/4))(7/9))(6/31) assuming w is positive. w(2611/186) Simplify (((l(-1))43/((l/(l/(l((l1/l)/l)/l)))/l)(-8))29)36 assuming l is positive. l(-61596) Simplify (((p/(p/(p/p7p)))/p(1/4)(p/p*9)/(pp/(pp(p*7p)/p)))(2/39))31 assuming p is positive. p*(-775/78) Simplify ((f/(fff/((f4/ff)/f)f))/f(1/4))/((ff(-6))/f(3/2))((f/((f/f(-2/7))/f)f)/(f*(-2)f))(2/71) assuming f is positive. f(12577/1988) Simplify (x/((x*3xx)/x)x(3/8))29((x(5/6)xx)/x2)/(x(2/3))(-7/9) assuming x is positive. x(-16151/216) Simplify (vvv(-1/4)/v)(-24/13)/(v1v)*(-2/5)(v*0/((v/(vvvvv(-1/4)vv))/v))/((v/v(3/7))/(vv*2vv)) assuming v is positive. v(17461/1820) Simplify (((y/y(-7))/y)/(yy*(8/5)y))(6/7)/((y/(y/y1))*45/(yyy/y(-5)(y/(yyy/(y/y*(-5))y))/y)) assuming y is positive. y(-1123/35) Simplify ((((p20p)(-29/4))43)(-11/3))(1/11) assuming p is positive. p(8729/4) Simplify ((f/(f4f))/f(-2/7))/(f(-3)/(ff(-6/5)/ff))(f(-1))11(f(-1/3))(-24) assuming f is positive. f(-137/35) Simplify ((z10/z27)/(z25z/z(-14)))(-24) assuming z is positive. z1368 Simplify ((cc*(-30)(c*(-6/11)cc)/c)/(c22(c/(c/((cc/(c(ccc*3/cc)/c)c)/c)c))/cc))(2/89) assuming c is positive. c(-1024/979) Simplify (((v(-2/11)v)/v)/v*(-2/9)(v/((v/(v*(1/5)/v))/vv))/vv(-4/5))/((v(2/3))24(v(-3/11)/v)/v(5/4)) assuming v is positive. v*(-31753/1980) Simplify (ss(-2))(2/15)(s(-2/5))(18/5)(s1)(3/43)/(ss5s*(1/3)s) assuming s is positive. s(-28499/3225) Simplify (q(-4/9))*(-1/8)q(-4/11)/(q/q(1/32)) assuming q is positive. q(-4045/3168) Simplify (q(-2/5))*(-2/59)(q(-1)/q)(3/8)((q0q)(5/4))(3/29) assuming q is positive. q(-5194/8555) Simplify ((((u(-6/13)u)/u)/u)/(u5u))(1/11)/((u/u(4/3))(10/17))(-4) assuming u is positive. u*(-10667/7293) Simplify ((rr*(2/37))/((rr*(-1/6))/rr))*16/(((rr*(-3)r)/(r/(r/(r*0rrrr)r)))/((rr(-8)r)/r6)) assuming r is positive. r(-496/111) Simplify ((l/((l/l*32)/ll))*(-1/16)(l(-17))(-3/7))(-2/27) assuming l is positive. l(-74/189) Simplify ((y/y(-6))/(y/y(-6)))/((yy/(y3y)yy)/(y*(-1/3)y))(y(3/5)/yyy/(y5y))(18/13) assuming y is positive. y(-1058/195) Simplify (l/(lll*2)l*(-3/2)/l(ll0)(-3/14))/(((l/((l/(ll*7l))/lll))/(l/(ll/(l(5/2)ll))))/(l1/l)21) assuming l is positive. l(-143/14) Simplify ((((s(2/3)/s)/s(3/8))(-28))(2/99))39 assuming s is positive. s(1547/99) Simplify ((uu*26u(-1/5))/((u23/u)/((u/(u/u*14u))/u)))(-47) assuming u is positive. u(-3948/5) Simplify (((g/g(-1))/g)/g)40/(g*1g)*(-44)g*(1/2)gg4(((g/(g/g*(-2/11))gg)/g)/g)/gg(-1/2) assuming g is positive. g(1010/11) Simplify (z*(6/11)/(((zz*(-12)zz)/z)/z)(z/(z/(zz(-4/3))z)zzz)(-15))(-1/77) assuming z is positive. z(148/847) Simplify t(1/13)t*(-2/19)(t/t*(-4/7)t)/(t(-19)/t) assuming t is positive. t(38977/1729) Simplify (((((w7/w)/w)/w)/w(-2)(w(-1))(2/3))(-31))(-2/31) assuming w is positive. w(32/3) Simplify c(-1/18)c*(-25)(c*7/cc)(3/17) assuming c is positive. c(-7289/306) Simplify ((m(-1))(-4))13/((m0)(-2/13)/(m(-1/7)/mm(3/4))) assuming m is positive. m(1445/28) Simplify (o(1/4)/(oo*(2/5)o)o(2/3)oo(-1/3)/o)/(((oo/((o/o*(-1))/oo))/o)(-24))(-1/39) assuming o is positive. o*(-937/780) Simplify (((wwwww11/www)/(((wwww(-1/4)/w)/w)/w))/((w(2/17)/w)/(w*0w)))(-28) assuming w is positive. w(-8631/17) Simplify ((f*(-6/5)(ff/((f(-8/3)f)/f))/ff)/((ff/f*16)/(f/(f/(ff*(-1/6)))f)))(2/9) assuming f is positive. f(193/45) Simplify ((i*(3/8)ii(-10/9))/(i(2/9)ii(-1/7)))(-11/3) assuming i is positive. i(1507/504) Simplify ((d1d(-28))/(d(1/33)dd/d3))(-4/21) assuming d is positive. d*(3436/693) Simplify (((vv(vv/v*5)/v)/(v/(vv*(-5)v)))/(v(-1/3)/v)(6/17))/(((v/v(-2/3))/v)(3/4))24 assuming v is positive. v(-298/17) Simplify ((((p(1/7)/p)/p(2/5))/(p*(4/3)p*(1/4)p))(-12))42 assuming p is positive. p(9678/5) Simplify (t0)*(-4/31)/(((tt((t(-1/2)/t)/t)/ttt)/t)/t)(-9/5)((tt(-1/2)t)(-2))(-5/12) assuming t is positive. t(-29/20) Simplify ((q(2/7)q(-7/3))/(qq(1/3))(-27))/(((q*0q)/q)(2/73))(-9/8) assuming q is positive. q*(713/21) Simplify ((ff*(-2/3)f)/f)/(f*(2/9)f)(f(-5)f)/f*(-3/8)(f*(1/11)/fff/f(1/4))(1/7) assuming f is positive. f(-24359/5544) Simplify ((rr/r*(-17)(r/r*(-9/4)r)/r)/(rr5)(27/2))6 assuming r is positive. r(-705/2) Simplify ((v(-1/4))7)(-17)/(((v(-1/2)v)/vvv)(1/4)/(v(-2)v5/v)) assuming v is positive. v(251/8) Simplify ((qq(q/(((qqq7q)/q)/q))/q)/q(-3/2))11/((q(-1))(2/41)(q1)(-2/5)) assuming q is positive. q(-20111/410) Simplify (s(s/s*(9/8))/s((sss(sss/s(-23/5)s)/s)/s)/ss/s(-27)ss(3/7)/s)(-5/3) assuming s is positive. s(-10333/168) Simplify ((g/g(1/7))/(g/(ggg/(ggg/g4g)gg))(ggg(-2/9)g)(1/27))/((g1)(-2)/(g(-2/7)/g)(10/3)) assuming g is positive. g(4549/1701) Simplify (((aa(-3/5)a(-13))/(a(5/3)/(aaa1)))(5/8))(-2/77) assuming a is positive. a(169/924) Simplify (t*1t)46/(t(-1/4))*(-10)((t**(2/9)/t)/(	{ "pile_set_name": "DM Mathematics" }
c Let u(g) = 1614494g. Let k(h) = 4h*2. Determine k(u(v)). 10426363504144v*2 Let n(i) = -i. Let d(b) = -6b. Suppose -3l = 3f - 2f + 6, -5f - 8 = 4l. Let k be l/6(1 + 2). Let j(c) = kd(c) + 5n(c). Let m(t) = 4t. Give m(j(a)). 4a Let a(x) = -2x. Let d(f) = 300562f + 1. Calculate d(a(t)). -601124t + 1 Let r(h) = -6h. Let m(n) be the first derivative of 2 - 6n2 - 14/3n*3 + 0n. Let f(x) = -x*2 - x. Let d(u) = -12f(u) + m(u). What is r(d(s))? 12s2 Let q(c) = c2. Let v(j) = 14j + 5. Let z(s) = -7s - 2. Let a = -10 + 5. Let x(m) = az(m) - 2v(m). Give x(q(n)). 7n*2 Let y(j) = 9j*2 + 4j + 12. Let u(w) = 5w. Calculate u(y(k)). 45k*2 + 20k + 60 Let p(u) = 3u. Let d(s) = 6309s*2. Determine p(d(m)). 18927m*2 Let l(d) be the first derivative of -2 - 5/3d*3 + 0d + 0d2. Let x(n) be the third derivative of n5/60 - 2n*2 - 84n. Calculate x(l(j)). 25j4 Let b(v) = 6v. Let c(m) = 6m2 + 5m. Let k(l) = 7l2 + 6l. Let o be 132/(-20) - (-6)/10. Let y(u) = oc(u) + 5k(u). Determine b(y(g)). -6g2 Let b(t) = 0t - 6t2 + 0t. Let z(f) be the first derivative of -3f2/2 + 145. What is z(b(g))? 18g*2 Let y be (-1)/((3/(-6))/1). Let h(x) = 2x2 - x2 + 0xy - 5x2. Let w(n) be the second derivative of n4/3 + n. Give h(w(o)). -64o4 Let t(u) = u3 + 2u*2 + 7u - 12. Let g be t(3). Let p(z) = gz - 115z + 58z. Let a(k) be the third derivative of -k5/30 - 2k*2. What is p(a(y))? 6y*2 Let l(w) = 120656w. Let z(o) = 2o. Determine l(z(k)). 241312k Let k(o) = 2o. Let c(z) be the first derivative of z2/2 + 5. Let m(x) = -7c(x) + 4k(x). Let v(d) be the second derivative of d3/3 - d. Calculate v(m(u)). 2u Let c(o) = -1024o2. Let h(z) = 1587z*2 - 2. Determine h(c(i)). 1664090112i*4 - 2 Let v(g) = 2g*2. Let u(k) be the first derivative of 135k*2/2 - 132. What is u(v(r))? 270r*2 Let q(s) = -9s. Let x(y) = 3y. Let n(o) = 6q(o) + 17x(o). Let w(a) = -89a - 100a + 280a - 95a. Determine n(w(g)). 12g Let q(t) = -3t2. Suppose 3c - 37 = -4. Let w(k) = -ck - k - k + 5k. Give w(q(v)). 24v2 Let g(p) = -3p*2. Let j(a) be the third derivative of 3a*4/8 + 8a*2 - 17. Determine g(j(n)). -243n2 Let x(i) be the second derivative of i4/6 - 12i - 3. Let w(z) = 2z + 2. Calculate w(x(t)). 4t2 + 2 Let w(k) = k2. Let u(f) be the first derivative of 28f3/3 + 2. Let c(l) = -l2. Let z(i) = 21c(i) + u(i). What is z(w(b))? 7b*4 Let s(c) = -4c*2 - 9c. Let i(b) = b*2 + 3b. Let h(y) = -6i(y) - 2s(y). Let o(d) = 7d2. Give h(o(x)). 98x*4 Let j(c) = 27c. Let y(n) = -171n. Calculate j(y(t)). -4617t Let u be 5 - 2/(-6)-3. Suppose -ut + 18 = 4o - 18, -t - 12 = -2o. Let i(z) = z - oz - 6z - 2z. Let f(y) = -y. What is f(i(j))? 14j Let n(v) be the second derivative of -v7/2520 - v4/12 - v. Let r(o) be the third derivative of n(o). Let p(f) = -49f + 98f - 50f. What is r(p(b))? -b2 Let w(z) = -3z. Let n(r) be the third derivative of 17r5/60 + 328r*2. Give n(w(m)). 153m*2 Let f(u) = -4u + 3. Let r(o) = -4 + 5 - 6 - 2 + 9o. Let i(g) = 14f(g) + 6r(g). Let l(k) = 2k. Give i(l(b)). -4b Let p(t) be the first derivative of 100t*3/3 + 149. Let z(l) = -3l. What is p(z(d))? 900d2 Let s(p) = 5p*2. Let r(j) = 8339j - 1. What is r(s(z))? 41695z2 - 1 Let r(d) = -55d + 8 - 8 + 54d. Let g(f) = 28f*2 - 2. Calculate g(r(c)). 28c*2 - 2 Let r(u) = 4u*2. Let v(i) = 552989i. Give r(v(j)). 1223187336484j2 Let n(i) = -2i*2. Let k(b) = 2b*2 + b - 4. Let c(a) = 49a*2 + 4a - 17. Let m(r) = -c(r) + 4k(r). What is n(m(l))? -3362l*4 + 164l*2 - 2 Let l(w) = 38061w2. Let a(d) = -d2. Give a(l(j)). -1448639721j4 Let o(x) = -4x. Let z(p) = 9p2 + 5p - 5. Let w = 14 + -12. Let r(c) = -wc + 2 + 5c*2 - 9c*2 + 0c. Let d(i) = -5r(i) - 2z(i). Calculate o(d(q)). -8q2 Let g(q) be the second derivative of q3/6 - 9q. Let v(o) = -6o2. Calculate g(v(t)). -6t*2 Let d(j) = 23j*2. Let t(u) = -6u*2 + 8u. Let b(y) = 35y2 - 50y. Let r(c) = -4b(c) - 25t(c). Determine d(r(h)). 2300h4 Let j(z) = 30z. Let y(w) be the first derivative of -4w3 - 65. Calculate j(y(h)). -360h*2 Let q(b) = -2995b*2. Let f(a) = 91a*2. Give f(q(w)). 816272275w*4 Let x(g) = 27g. Let t(y) = 43y2 - 47. Give x(t(f)). 1161f*2 - 1269 Let a(o) = 2o*2. Let b(p) = -161p + 37p + 85p + 2. Give a(b(l)). 3042l2 - 312l + 8 Let d(g) = 3g + 55. Let i(v) = -v - 20. Let s(o) = 4d(o) + 11i(o). Let h(r) = -597r*2. Calculate h(s(m)). -597m*2 Let y(a) = 16649a*2 + 3a + 1. Let x(c) = 2c. Calculate x(y(q)). 33298q*2 + 6q + 2 Let n(q) = 2q. Let f(v) = 114v - 1731. What is n(f(c))? 228c - 3462 Let r(m) be the second derivative of m4/4 + 24m + 2. Let b(d) = -8d2. What is b(r(u))? -72u4 Let r(l) = l2 + 59. Let b(j) = -4309j2. Calculate r(b(a)). 18567481a4 + 59 Let n(d) be the first derivative of d6/180 + 5d3 - 2. Let f(i) be the third derivative of n(i). Let k(v) = -18v. Determine k(f(h)). -36h2 Let g(c) = 11c + 3c - 16c - 2c. Let j(l) = -2 + 3l*2 + 2. What is j(g(s))? 48s*2 Let b(q) = 2q. Let c(z) = 857897z. Calculate b(c(o)). 1715794o Let f(j) = -7j - 6. Let x(c) be the third derivative of -7c*4/12 - 5c*3/3 - 2c*2 + 19c. Let z(k) = -5f(k) + 3x(k). Let y(b) = -4b. Determine z(y(v)). 28v Let i(r) = 2r2. Let q(s) = s2 + s + 1. Suppose 10 - 8 = -w. Let f(d) = d2 - 2d - 2. Let l(o) = wq(o) - f(o). Calculate l(i(t)). -12t*4 Let s(j) = j. Let h(a) be the third derivative of -1/120a*5 + 0 + 0a - 8a2 - 1/3a*3 + 0a*4. Let y(w) be the first derivative of h(w). What is y(s(o))? -o Let u(g) = -2g*2. Suppose 49 + 31 = 4k. Let w = -17 + k. Let m(s) = ws - 2s + 3s - 3s. What is m(u(o))? -2o2 Let r(f) = 5f. Let d = -78 + 83. Let n(j) = -7j. Let z(s) = -4s. Let l(i) = dz(i) - 3n(i). What is l(r(b))? 5b Let a(w) = -w2 + w + 4. Let h be a(2). Let x(t) = -4t + ht + t. Let f(m) = -24m. What is x(f(d))? 24d Let f(m) = -6m*2 - 6. Let g(y) be the third derivative of 5y*4/24 - 616y*2. Calculate g(f(t)). -30t2 - 30 Let h(v) be the third derivative of v8/6720 + v*5/10 + 20v*2. Let s(g) be the third derivative of h(g). Let i(x) = -x. Give s(i(d)). 3d*2 Suppose -2o - 25 = -77. Let h(y) = oy2 - 15y*2 - 9y*2. Let c(v) = 1 + 6v - 1. Calculate h(c(t)). 72t2 Let l(x) = 2x. Let t(p) be the first derivative of -29p5/60 - p2 - 2. Let o(v) be the second derivative of t(v). Calculate o(l(z)). -116z*2 Let o(z) = 12039z2. Let a(c) = -c2. Give a(o(r)). -144937521r4 Let n(f) = -5f + 1. Let j(d) = 3d2 - 5d + 5. Let o(m) = -m*2 + 2m - 2. Let b(l) = 2j(l) + 5o(l). Give b(n(k)). 25k2 - 10k + 1 Let g(d) = -10d. Let u(s) = 26603s*2 + 1. Give u(g(p)). 2660300p*2 + 1 Let n(y) = -1047y - 17. Let x(m) = 3m2 + 11m. What is n(x(t))? -3141t2 - 11517t - 17 Let j(r) = -r*2 + 11r - 6. Let w be j(10). Let q(k) = wk + 9k + 0k. Let s(a) = -5a*2 + 0a*2 + 4a*2. What is s(q(l))? -169l*2 Let g(b) = -4b. Let w(n) = -67n + 35n + 30n - 2n2. Let a(i) be the third derivative of i4/24 - i*2. Let m(j) = 2a(j) + w(j). Determine m(g(c)). -32c2 Let i(w) = 2w*2. Let z(d) be the second derivative of -95d*3/6 - 236d. Determine z(i(s)). -190s2 Let u(k) = -2k. Let d(n) = 9n + 1. Let q be d(-1). Let g = q + 10. Let b(j) = 9j*2 - 2jg - j2 - j*2. Give u(b(c)). -10c*2 Let w(r) = -3r*2. Let p(g) = 91g*2 - 2g - 40g2 - 62g*2. Determine w(p(u)). -363u*4 - 132u*3 - 12u*2 Let u(v) be the second derivative of -3v3/2 + v. Let j(l) be the first derivative of -l2/2 - 1010. What is j(u(i))? 9i Let t(b) = 35625b. Let o(r) = -2r2. Determine t(o(m)). -71250m*2 Let z be 1/(-1)(-2)/1. Let d(s) = 143 - 143 - 2sz. Let p(i) = -20i. What is d(p(w))? -800w2 Let y(s) = 33s - 50s + 18s. Let d(k) = 2k2 + 40k. Give y(d(g)). 2g2 + 40g Let u(q) = 7q2. Let x(y) = -176299y*2. Give u(x(r)). 217569361807r*4 Suppose -9n = -8n - 2. Let h(b) = 3b*2 - 26b*2 + nb*2. Let t(f) = -2f. Calculate t(h(c)). 42c*2 Let v(g) = g + 80. Let u(a) = a. What	{ "pile_set_name": "DM Mathematics" }
mber? False Suppose 12 = -l + 3q, -2l + 4q - 15 = 5. Let y be 25891/9 + 1/(-27)l. Suppose j - 4192 = y. Is j a composite number? False Suppose -7q = -6q + 51. Let m = -47 - q. Suppose mi + 221 - 729 = 0. Is i prime? True Suppose 25k - 28k - 36 = 0. Is (153/k)/((-3)/548) prime? False Let y = -59341 - -129900. Is y prime? False Suppose 3h - x + 49 = -2x, -h - 5x = 35. Is (3158/(-12))/(h/(-45))-22 prime? False Let r = 4992 - 5009. Let y(g) be the first derivative of g3/3 - 23g*2/2 - g + 1. Is y(r) composite? True Suppose 0 = 30g - 3294625 - 5615945. Is g a prime number? True Suppose -6 = 3q, -35349 = 15p - 16p + 4q. Is p a prime number? False Let d = -4258 + -5695. Let l = 18304 + d. Is l prime? False Is (3 - (-21)/(-6))/(46/(-7313356)) prime? True Is (-361917)/6(-11)/5540/12 a prime number? True Let i = 477246 - 296617. Is i a prime number? True Let b(s) be the first derivative of -5s2/2 + 21s + 14. Let u be b(6). Let t = u + 76. Is t a prime number? True Suppose 5m + 2g = -1015 - 590, -5m - 1605 = -5g. Suppose 0 = 3t - 5341 + 295. Let x = t + m. Is x composite? False Suppose 0 = l - 1207 - 161. Suppose -4q + 3q - 5k + l = 0, -1365 = -q - 2k. Is q composite? True Suppose 36738 = 5o - 4y, -4y = -3y - 3. Suppose 6d = -0d - o. Let i = -522 - d. Is i prime? False Let y(u) = u - 1. Let d be y(-4). Let r = d + 9. Suppose -823 = -ri + 1341. Is i a composite number? False Suppose 6c + c = 64435. Let b = c + -3062. Is b prime? True Let c(n) = -4n - 40. Let y be c(0). Let t = y - -42. Suppose -3w + ti + 3722 = -1473, -3i = -5w + 8659. Is w a composite number? False Let p be (5/4)/((-15)/(-60)). Suppose 2h = pj - 30, j - 6 = h - 0. Is ((933/2)/3)/(3/j) a composite number? False Suppose 8p - 5p + 113 = 4b, p - 49 = -2b. Is 20 - b - (-21514 - (3 - 2)) composite? True Let f be (-5 - -3) + 1-1. Let v(d) = -14 + 28d*2 + 0d + 10 - 5d. Is v(f) prime? True Let h(q) = 19876q - 4425. Is h(4) a composite number? False Let t be 1/(-1) - (-1 - -4)/(-1). Suppose -7d = td - 81333. Suppose 8p = p + d. Is p a prime number? True Suppose -143c = -145c + 3f + 200468, -2f + 200458 = 2c. Is c a prime number? False Let o(x) = -34x2 + 8x - 51. Let y(v) = -34v2 + 7v - 51. Let h(i) = -3o(i) + 2y(i). Is h(5) composite? True Let i(k) be the second derivative of k6/24 - k5/12 - k*4/8 - 7k*3/6 - 13k*2 - 7k. Let s(m) be the first derivative of i(m). Is s(8) composite? True Let k = 219841 + -146490. Is k a prime number? True Let f(b) be the first derivative of 24 + 5272/3b3 - 2b*2 - 3b. Is f(-1) prime? True Suppose 0 = -11f - 2f + 143. Suppose 0 = -fp + 40456 - 12923. Is p composite? False Let u be (-12935)/10(2 - 0). Let b = u + 6508. Is b a prime number? False Let x(d) = -63 - 4d + 121d*2 + 63. Let t be x(2). Suppose -34b + 30b + t = 0. Is b a composite number? True Let z = 5355 - -17056. Is z a prime number? False Suppose 0 = -5d - 121 + 141. Is ((-12)/d - -434)/(3/3) a composite number? False Let q = 371889 + -147916. Is q prime? False Suppose -2d - 5x = d - 115884, -d + 5x = -38648. Suppose 11861 + d = 2q. Is q a prime number? True Suppose 2i + 2f + 33 = 5f, 5i + 40 = -f. Let q be i/6(-8)/6. Suppose 5r + 5c = qc + 3586, 5r - 3c - 3604 = 0. Is r a prime number? True Suppose 13 + 7 = d + 2h, 4d - 89 = -5h. Suppose 52797 = dn - 23n. Is n composite? False Let b = 60169 + 21162. Is b prime? True Let q(w) = 1036w + 1735. Is q(24) a composite number? True Let g = 220 + -225. Is g(-95543)/175(-2 + 7) a composite number? False Suppose 0 = -9n + 13n + 3x - 462263, 5n - 577883 = 4x. Is n a composite number? False Suppose -8m + 6m = -43m + 3388199. Is m a composite number? True Is (-9)/(-6)685384/42 prime? False Let s(g) = 124g*2 + 22g + 1234 + 183g2 - 1256. Is s(1) prime? True Suppose -26917 = -4x - 7x. Let t = x - 686. Is t a prime number? False Let t be (3/6)/(3/6). Let q be (2399 - 0) + t + 2. Is q/22 + (-4)/22 a prime number? True Let u = -15 + -9. Let f = 27 + u. Suppose fc + 3v = c + 239, 2c + 2v = 236. Is c prime? False Let x(s) = -s3 - 18s*2 + 31s - 1. Let i = 136 + -66. Let g = 50 - i. Is x(g) a prime number? True Let k(o) = -22o3 - 15o*2 - 93o + 17. Let m be k(-9). Let y = -3226 + m. Is y a prime number? True Let l(z) = z + 9. Let o be (-39 - -3)1/(-2). Let s be l(o). Is (-2720 + -2)(s/(-6) - -4) composite? False Suppose 164i - j = 162i + 88764, -2j = -2i + 88766. Is i a prime number? True Let g = 105601 + 77148. Is g a composite number? True Suppose 0q + 11q - 176 = 0. Suppose -2f = -f - 5i + q, 0 = -f - 4i + 20. Is ((-1984)/(-96))/(1/(66/f)) composite? True Is 45/18(-195010)/(-25) a prime number? True Let g = -2824 - -6657. Suppose 15h = 14h + g. Is h prime? True Suppose 17s + 34434 = -s. Let a = s + 2924. Is a prime? False Let n(p) = p2 - 3p - 3. Let f be n(11). Let l = f + -80. Suppose z = -2u + 104 + l, -5u = 2z - 215. Is z a composite number? True Suppose 230 = -0t - 5t. Suppose 1 = -2r + 2z - 3z, 0 = -5r - 5z + 5. Is t/(-23)(-331)/r prime? True Let k be 4 - 4 - ((-15)/(-1))/(-3). Suppose 0 = -ku + b + 30, -u - 3u = 4b. Suppose um - 6m = -799. Is m a composite number? True Suppose 337j - 341j + 5448 = 0. Suppose 5c - j = 4r + 3087, -3r = 3. Is c prime? False Suppose 339j - 1989012 = -4u + 347j, -3j + 497263 = u. Is u prime? True Let x(d) = -7d*3 + 19d*2 - 16d - 7. Let i(a) = a - 12. Let m be i(8). Let c(f) = -3f3 + 9f*2 - 8f - 3. Let k(j) = mx(j) + 9c(j). Is k(8) composite? False Let u = -118 + -53. Let q be 1/(-5) - u/(-45). Let f(n) = -51n - 3. Is f(q) a prime number? False Let r(d) = 7d*3 + 9d*2 + 26d + 131. Is r(14) a composite number? False Let k = -16 - -7. Let p be 7/14 + k/(-2). Suppose -745 = ph - 6h. Is h a prime number? False Let t = 33993 + -23967. Let q = t + -6433. Is q a prime number? True Let k be ((-52)/26)/(4/(-13818)). Let l = 16166 - k. Is l a prime number? True Let f(y) = 213y2 - 140y - 5480. Is f(-63) a prime number? True Let d(o) = 839o2 - 85o - 965. Is d(-19) prime? True Let v(m) be the third derivative of -349m4/24 - 104m*3/3 - 79m*2. Is v(-18) a composite number? True Let d = -252 - -107. Let l(i) = -5i*3 - 9i*2 + 9i - 19. Let k be l(5). Let g = d - k. Is g a composite number? True Let x = 260441 + -162568. Suppose 29j - 2844 = x. Is j composite? True Suppose -v - 4k = -4146, k + 12438 = v + 2v. Let x = -2391 + v. Suppose 5b = x + 1140. Is b prime? False Is 23 + -7 + -31 - -101368 composite? True Let m(t) = t*2 + 19t + 18. Let w be m(-18). Let q(y) = -2y2 + 9871. Is q(w) a prime number? True Suppose 5617027 = 71j - 8744640. Is j a composite number? False Suppose 11k = 163k + 20k - 75957092. Is k composite? True Suppose -z - 2c = c - 20, 4z - c - 15 = 0. Suppose i + 65 = 5n + zi, -2i - 26 = -4n. Suppose -h = -5o + 267, o + nh - 4h = 43. Is o a prime number? True Let w = 6 + -7. Let d be (3 - w) + -3 + -2 - 3130. Let n = d - -4824. Is n prime? True Let r(q) = -76q3 - q2 + 6q - 9. Let z be r(-6). Suppose -5l + z = 4105. Is l prime? False Let z(l) = 5905l3 + l + l2 - 22 + 23 + 0l - 2l. Is z(1) a composite number? True Is 754/189(-348709)/(-2) a prime number? True Suppose 5a - 3t - 5839 = 0, -3a + 27t = 26t - 3505. Is a a composite number? True Suppose -v = 4s - s - 635, 4v - 2s = 2498. Suppose 0 = -4a - 20, -5k + 3a + 174 = -v. Is k prime? True Is (0/(-10) - -7177)(23 - 4) prime? False Let k be (5 - 9) + 6 - -7827. Let z = 12082 - k. Is z prime? True Let x(o) = -1533o - 36. Let h(j) = 1532j + 37. Let d(c) = 5h(c) + 6x(c). Is d(-6) composite? True Let q(p) be the third derivative of -5/3p3 + 12p*2 + 0p - 79/24p4 + 0. Is q(-9) prime? True Suppose -1740018 + 10266 = -12a. Is a a composite number? True Let r = -15713 - -71476. Is r a composite number? False Let t(b) = 3b - 4. Let o be ((-20)/(-5) - 3)5. Let c be t(o). Suppose -ci + 19i = 4136. Is i a composite number? True Suppose -3d = -5f + 132264, 12d - 88176 = 14d + f. Let a = -23765 - d. Is a a composite number? False Suppose o = m + 3, -10o = -15o - 2m + 8. Suppose ob + 9195 = 7*b. Is	{ "pile_set_name": "DM Mathematics" }
at is 2 + 1121010? 1121012 In base 5, what is -1001321 - -10? -1001311 In base 11, what is 23 + 5? 28 In base 14, what is a33c - 1? a33b In base 11, what is -7 + 3? -4 In base 3, what is 1010 - -212? 1222 In base 11, what is 2 - 34? -32 In base 16, what is 226e + 5? 2273 In base 15, what is -245 + -9? -24e In base 13, what is -5 + 1b0? 1a8 In base 3, what is 0 - 111010? -111010 In base 9, what is 2 + -682? -680 In base 8, what is -1340 + 0? -1340 In base 11, what is -424 - 9? -432 In base 16, what is 52 - -98? ea In base 6, what is 1 - 100? -55 In base 4, what is 11130 - 12? 11112 In base 13, what is 0 + 304? 304 In base 7, what is 24 - 63? -36 In base 15, what is -ac - -4? -a8 In base 2, what is 1101000 - 1001? 1011111 In base 15, what is -2ec - 0? -2ec In base 5, what is 0 + 202100? 202100 In base 6, what is -1421 + 2? -1415 In base 9, what is -3 + -173? -176 In base 14, what is a - 394? -388 In base 6, what is 0 - -132? 132 In base 10, what is 1 + 744? 745 In base 2, what is 101011 - 101? 100110 In base 6, what is 243 - 3? 240 In base 12, what is 2 + -446a? -4468 In base 13, what is -66 - 2? -68 In base 6, what is 1044 + -14? 1030 In base 5, what is 2 + 4110? 4112 In base 13, what is -481 + 3? -47b In base 14, what is c56 + b? c63 In base 3, what is 12 + -102? -20 In base 13, what is 51 + -19c? -14b In base 2, what is 111001111 - -10000? 111011111 In base 15, what is 2 + -8a? -88 In base 14, what is 25b + 5? 262 In base 7, what is -4 + 31? 24 In base 6, what is -5 + 123? 114 In base 3, what is 2120 + -112002? -102112 In base 10, what is -2 + -48? -50 In base 14, what is -34 - 3? -37 In base 13, what is 2 + -30? -2b In base 4, what is 111 - -232? 1003 In base 13, what is -2755 - 0? -2755 In base 13, what is 21 + -15? 9 In base 5, what is 3 + 101? 104 In base 7, what is 23105 - -2? 23110 In base 4, what is -210233 - 11? -210310 In base 8, what is 3 - 366? -363 In base 3, what is 2 + 202000? 202002 In base 8, what is 2 + -121? -117 In base 12, what is -43 + -6? -49 In base 9, what is -2 + 614? 612 In base 8, what is 2 - 305? -303 In base 7, what is 144151 - 5? 144143 In base 16, what is -1a + -10? -2a In base 7, what is 0 - 2116? -2116 In base 14, what is -34 + -c? -42 In base 6, what is 121 + 3? 124 In base 16, what is d8 - 2? d6 In base 14, what is 9 - -5c? 67 In base 16, what is 5 + -1? 4 In base 6, what is -31 + -404? -435 In base 3, what is -2 - 1112? -1121 In base 9, what is 6 - -2? 8 In base 2, what is -110110000 - 11? -110110011 In base 9, what is -82 - 1? -83 In base 12, what is b + -147? -138 In base 8, what is -316 + -1? -317 In base 15, what is e - -3e? 4d In base 12, what is 3 + -59? -56 In base 15, what is -17 - 0? -17 In base 16, what is 1a - 5? 15 In base 13, what is 4 - b39? -b35 In base 12, what is 125 - -1? 126 In base 15, what is 24 - 3d? -19 In base 10, what is 2994 + -2? 2992 In base 10, what is 4 - -356? 360 In base 4, what is -3 - -1320? 1311 In base 15, what is 98 + 1? 99 In base 16, what is 45 - 6? 3f In base 3, what is -20022010 + 0? -20022010 In base 6, what is 0 + -33? -33 In base 16, what is -1 + -25? -26 In base 15, what is b + -22? -16 In base 6, what is 150 - -2? 152 In base 11, what is -9 + 174? 166 In base 15, what is 96 - 5? 91 In base 6, what is 24 - -2525? 2553 In base 15, what is -50 + -17? -67 In base 9, what is -6182 + 5? -6176 In base 2, what is 11000 + 11000? 110000 In base 16, what is -1e + 0? -1e In base 12, what is -1 + 31? 30 In base 6, what is -11 - -105? 54 In base 11, what is -187 + 4? -183 In base 11, what is -5 - -466? 461 In base 6, what is -5233 + 3? -5230 In base 4, what is 11111 - -1? 11112 In base 10, what is 100 - -1? 101 In base 4, what is 2 + -1203? -1201 In base 10, what is -3414 - -6? -3408 In base 5, what is -34 - 2? -41 In base 14, what is 2c3 + -b? 2b6 In base 11, what is -5 + 125? 120 In base 7, what is -1062 + 2? -1060 In base 14, what is 4 + -c2? -bc In base 14, what is -1b8 + -10? -1c8 In base 15, what is -25 + -17? -3c In base 4, what is 3 + 22? 31 In base 7, what is 0 + 220? 220 In base 5, what is 212 - -1200? 1412 In base 8, what is 3 - 125? -122 In base 8, what is -5747 + -3? -5752 In base 11, what is 3 + -8a5? -8a2 In base 14, what is -1290 + 1? -128d In base 3, what is -11 + 1011? 1000 In base 12, what is -3 + -1b? -22 In base 16, what is 4c + e6? 132 In base 10, what is -3 - 73? -76 In base 6, what is 131 - -22? 153 In base 11, what is 1294 + -5? 128a In base 15, what is 1d - -e6? 114 In base 3, what is -20 - 0? -20 In base 11, what is -202 + 9? -1a4 In base 4, what is 2322 - -232? 3220 In base 11, what is 436 - -2? 438 In base 9, what is -10 - 2? -12 In base 11, what is -1a65 + -4? -1a69 In base 15, what is -1e - 29e? -2bd In base 4, what is -3 - -3210? 3201 In base 9, what is 0 - -57? 57 In base 2, what is -1010001 - 10? -1010011 In base 3, what is 12 - 12101? -12012 In base 13, what is -4516 + 3? -4513 In base 11, what is -1 + -74? -75 In base 3, what is -201212 - 1? -201220 In base 11, what is 5 - a3? -99 In base 7, what is -5 + -20052? -20060 In base 8, what is 4 + 1354? 1360 In base 8, what is 13 + -2? 11 In base 4, what is 12 - -12? 30 In base 15, what is -5d - 3? -61 In base 11, what is -4 - -25? 21 In base 11, what is 1570 - -5? 1575 In base 12, what is -8b + -8? -97 In base 2, what is -101 + -10000110011? -10000111000 In base 12, what is -9 - -1a? 11 In base 3, what is 1001 - 100? 201 In base 8, what is -431 - -1? -430 In base 10, what is -19050 - -2? -19048 In base 12, what is -173 + 1? -172 In base 16, what is 477 + -6? 471 In base 3, what is -22 + -10122100? -10122122 In base 3, what is 110 + 10102? 10212 In base 7, what is -11 + 12? 1 In base 11, what is -637 + -1? -638 In base 13, what is -105 - 4b? -153 In base 4, what is 2 - -333? 1001 In base 4, what is 21123 - -2? 21131 In base 13, what is 1 + 7? 8 In base 8, what is 144 - 2? 142 In base 2, what is 10 - -110110? 111000 In base 10, what is -3 - 248? -251 In base 9, what is -8500 - -3? -8486 In base 5, what is 3 - -312? 320 In base 6, what is 3230 - -4? 3234 In base 3, what is 1020012 + 10? 1020022 In base 15, what is -1b - 113? -12e In base 11, what is 124 + -5? 11a In base 12, what is -7 - b2? -b9 In base 9, what is -183 + -14? -207 In base 11, what is 27 - -13? 3a In base 3, what is 110001 + -12? 102212 In base 10, what is 2974 + -1? 2973 In base 6, what is -5 + -54? -103 In base 16, what is 9 - 381? -378 In base 9, what is -254 - 3? -257 In base 8, what is -2 + -3? -5 In base 6, what is 2304 + -5? 2255 In base 9, what is 7542 - 0? 7542 In base 5, what is 0 + 11? 11 In base 16, what is -4 + -33? -37 In base 12, what is 3 - -3a18? 3a1b In base 9, what is -4 - 723? -727 In base 2, what is -11101 - 11100? -111001 In base 16, what is -1 + 42? 41 In base 16, what is 1 + -6db? -6da In base 15, what is -e + 14? 5 In base 5, what is -402410 - 10? -402420 In base 4, what is -311 - -10? -301 In base 6, what is 1 + 3115? 3120 In base 9, what is -240 - 7? -247 In base 3, what is -10022201 + 12? -10022112 In base 8, what is -5 - 6? -13 In base 12, what is -3 + -1b8? -1bb In base 16, what is 19 + 4? 1d In base 11, what is -51 + 3? -49 In base 2, what is -111 + -1000000111101? -1000001000100 In base 6, what is -41 + 102? 21 In base 9, what is -75 - -28? -46 In base 15, what is d - 56? -48 In base 7, what is 3 + 123? 126 In base 2, what is 1001111 + 101? 1010100 In base 15, what is -3 - 198? -19b In base 2, what is -11 + 10100000? 10011101 In base 12, what is -4 + 6? 2 In base 8, what is -4 + 601? 575 In base 16, what is -4 - -11? d In base 14, what is -9 - -3b? 32 In base 15, what is 14 - -171? 185 In base 7, what is 231 - -11? 242 In base 5, what is -13 + -243? -311 In base 15, what is -9 - -8? -1 In base 11, what is -21 - -8? -14 In base 13, what is 22 + -b1? -8c In base 8, what is -53 + -435? -510 In base 7, what is 3 + 3534? 3540 In base 10, what is 459 + -1? 458 In base 5, what is 12 + 10301? 10313 In base 9, what is 5 + -1316? -1311 In base 3, what is 11 - 100120022? -100120011 In base 10, what is 134 - 18? 116 In base 5, what is 4 - -310? 314 In base 15, what is -5 + a0? 9a In base 10, what is -2 - 561? -563 In base 15, what is -74 - -4? -70 In base 8, what is -37 - 2? -41 In base 8, what is -2 - 345?	{ "pile_set_name": "DM Mathematics" }
is the highest common divisor of 11 and v? 11 Suppose -4i = -i - 90. Suppose 0 = 3t + 5d - 287, -i = -t - d + 69. What is the greatest common divisor of t and 13? 13 Let w(s) = s3 - 10s*2 + 13s - 2. Suppose -2r + 17 = -3. Let i be w(r). What is the highest common divisor of 16 and i? 16 Let k be (-1 - (2 - 2))-9. Suppose 4w - 5q = 645, w + 4q = -4w + 755. Let b be (-8)/36 + w/k. What is the highest common factor of b and 119? 17 Let z = -51 - -56. What is the greatest common divisor of 5 and z? 5 Let t = 13 + -5. Suppose 60 = x + 5i, -3i - 32 = -x - i. Calculate the highest common factor of x and t. 8 Let g(j) = 14j2 - j + 2. Let f be g(2). Suppose -3u = 2u + 3n - 46, 0 = -3u + 2n + 20. Calculate the highest common factor of u and f. 8 Let s = 14 - 8. Let w = -48 - -96. What is the highest common divisor of s and w? 6 Let p(h) = h*2 + 17h + 9. Let b be p(-13). Let a = -1 - b. Calculate the highest common factor of 6 and a. 6 Let t = 133 - 82. Suppose -5s - t = -171. What is the highest common factor of 6 and s? 6 Let z be ((-2)/1)/(-5 - -4). Let y = z - -16. Let v be 2/9 + 428/y. What is the greatest common divisor of v and 3? 3 Suppose 3w - 2w = 2. Suppose -3i + 75 = wi. Suppose 3h + i = 0, 9y - 140 = 4y - 2h. Calculate the highest common factor of 6 and y. 6 Let i be 7-65/(-21). What is the greatest common factor of i and 15? 5 Let a(u) = 2u. Let v be a(2). Suppose -z = 2w + vz, w - 18 = 2z. Let r = 91 - 11. Calculate the greatest common factor of r and w. 10 Let v = 8 - 10. Let j be 0 - 0 - (-19 - v). Let w = 19 + j. Calculate the highest common divisor of w and 18. 18 Let g be (63 + 1)/(-43/(-12)). Calculate the highest common factor of g and 16. 16 Let f be ((-5)/(-4))/((-1)/4). Let b(m) be the second derivative of -m*3/3 + 5m*2/2 - 2m. Let v be b(f). Calculate the highest common divisor of v and 135. 15 Suppose 2l - 3q - 41 = 0, l + q - 4 = -3q. Let g = -6 + 10. Calculate the highest common factor of g and l. 4 Let k(q) = 11q*3 + q. Suppose -5x = g + 1, -5g - 4x - 2 - 3 = 0. Let y be k(g). Let o = 24 + y. What is the highest common divisor of o and 4? 4 Let z(w) = 6w - 2. Let l(c) = -c. Let i(j) = -5l(j) - z(j). Let t be i(-12). Calculate the greatest common divisor of 28 and t. 14 Let i be (-24)/32 + (-22)/(-8). Suppose 3k - 4v - 77 = 0, 2k - 12 = iv + 36. Calculate the greatest common divisor of 209 and k. 19 Suppose -4 = -5q + 11. Suppose -2i + 7i - 17 = 3o, 2o = -4i + 18. Calculate the greatest common factor of q and o. 1 Let s(a) = 8a2 + 6a - 10. Let t be s(3). Let n be (-1)/2 + 260/8. Calculate the greatest common factor of n and t. 16 Let z(a) = -a + 2. Let i be z(-3). Let c be (3 - 0) + 16 + i. What is the greatest common factor of 36 and c? 12 Suppose -j + 0j - 5 = 0. Let n = j + 8. Suppose n = -b + 17. What is the greatest common factor of 35 and b? 7 Suppose 20 = 3c + 2c. Suppose -4i - 2 = -u, -cu + 3i = -12 + 4. What is the highest common factor of u and 8? 2 Let k = -42 + 43. What is the greatest common factor of k and 7? 1 Let o be 0 - ((-6)/4 + (-317)/2). Calculate the greatest common factor of 10 and o. 10 Let i(u) be the third derivative of u6/24 - u5/30 + u3/6 + u2. Let p be i(1). What is the highest common divisor of p and 8? 4 Let b(v) = 0 + 3v - 3 - 1 + 3v*2 + 1. Let c be b(2). Suppose 4m + 196 - 871 = 5s, -2m = -s - 333. Calculate the greatest common factor of c and m. 15 Let o(j) = 12j. Let t be o(7). What is the greatest common factor of t and 12? 12 Let f be 4 + (-1 - (-2 + 0)). Let p(t) = -t + 6. Let m be p(f). Let o be (4/6)/(2/6). What is the greatest common divisor of o and m? 1 Let z = -30 + 50. Let m be 1/(-2) + (-418)/(-4). Let j = m - 44. Calculate the greatest common divisor of z and j. 20 Suppose 3q + 9a = 4a - 5, -a = -2q + 14. Suppose 2i - 67 - q = 0. Suppose -5x - 6x + 264 = 0. Calculate the highest common divisor of i and x. 12 Let r(c) = -c*3 - 3c*2 + 9c + 1. Let a be r(-5). Suppose h = -5i + 5h + 322, -128 = -2i + 2h. Calculate the highest common divisor of i and a. 6 Let d be (-3)/2((-224)/21)/2. Calculate the greatest common divisor of d and 72. 8 Let v(i) = -3i + 5. Let q be v(8). Let w = q - -27. Let x(r) = 7r2 - 5r - 4. Let d be x(4). Calculate the highest common divisor of d and w. 8 Let t = -50 - -86. Suppose 3z - 63 = g - 5g, -5g + 4z = -102. What is the highest common divisor of g and t? 18 Suppose 5b = -0b - 85. Let r = b - -28. What is the highest common divisor of r and 1? 1 Let f(u) be the second derivative of u4/2 - u3/2 - 3u2/2 + 3u. Let n be f(-3). Calculate the highest common factor of n and 40. 20 Let x be (-273)/(-15) - (-4)/(-20). Calculate the highest common factor of x and 9. 9 Let j = 23 + -20. What is the greatest common divisor of 1 and j? 1 Let w(p) = p*2 + p + 9. Let x be w(0). Suppose z - 10 - 9 = -r, 0 = -3z - x. Calculate the highest common divisor of r and 88. 22 Let v = -6 - -14. Let r(u) = 5u - 72. Let o(b) = b. Let h(q) = 6o(q) - r(q). Let y be h(0). What is the highest common divisor of y and v? 8 Suppose -7u = -4u - 99. Calculate the highest common divisor of 33 and u. 33 Let d = 28 + -15. Suppose -k = 3k - 52. Calculate the greatest common factor of d and k. 13 Suppose -8t + 440 = -3t. Calculate the highest common divisor of 11 and t. 11 Let q = -20 - -44. Suppose -5p = -59 - 121. Calculate the highest common factor of q and p. 12 Let g = 1 - 1. Let n be 4 - 0 - (-2 - g). Let s be (-2)/n + (-122)/(-6). What is the highest common divisor of 10 and s? 10 Let h(m) = m*2 - 7m + 99. Let f be h(18). Let p = -54 - -87. What is the highest common factor of f and p? 33 Let p(a) = 2a - 8. Let r(j) = 4j - 16. Let c(l) = 5p(l) - 2r(l). Suppose -4m + 8 = -20. Let d be c(m). Calculate the highest common divisor of 18 and d. 6 Let y(u) = u + 0u + 0u + 19. Let t be y(-10). Calculate the highest common divisor of 36 and t. 9 Suppose a = 4w + 12, -7a + 3w + 61 = -3a. Calculate the highest common divisor of a and 24. 8 Suppose 2 = j + 15. Let r = j - -61. Calculate the greatest common factor of 12 and r. 12 Let f be 76/6(-9)/(-6). Suppose f = 5r - 26. Calculate the highest common divisor of r and 27. 9 Let c be ((-30)/4)/((-9)/18). Calculate the greatest common divisor of c and 165. 15 Let k = 122 + -70. Suppose 0 = -19m + 21m - 52. What is the greatest common divisor of k and m? 26 Let i be 2/(-3) - 34/(-6). Suppose 25 = ix - 0. Suppose -2m = -n - 95, 2n - 80 = -0m - 2m. What is the greatest common factor of x and m? 5 Let w be (-10)/(-20) + 2/(-4). Suppose w = 2r - 0r - 4. Calculate the highest common factor of 4 and r. 2 Suppose -4u - 5h + 31 = 0, 5u - 3u + 4h = 8. Calculate the greatest common factor of u and 42. 14 Let n = -1 + 3. Calculate the greatest common factor of 7 and n. 1 Suppose v - 5 = 3f - 0v, -5v - 1 = -2f. Let k be f + 2 + 2 + -2. Suppose 18 = -ko + 3o. What is the highest common divisor of o and 54? 6 Suppose -4d + 9d - 21 = n, -5n = -2d - 10. Suppose 4b - 180 = -0b. Calculate the highest common divisor of d and b. 5 Let a(r) = r2 - r. Let s(m) = 2m*2 - 4m + 10. Let d(y) = -3a(y) + s(y). Let g be d(0). Calculate the highest common divisor of 20 and g. 10 Let x(a) = 61a*3 - 2a*2 + a. Let i(p) = -2p + 3p + 3 + 5. Let j be i(-7). Let s be x(j). What is the highest common factor of 12 and s? 12 Let w = -1 + 1. Let l be 1(-2 + 1 - w). Let r be (70/(-8))/(l/4). What is the greatest common divisor of r and 5? 5 Let y = -65 + 107. What is the greatest common divisor of y and 42? 42 Let s be 124(-2)/((-32)/(-12)). Let h = s + 163. What is the highest common divisor of 10 and h? 10 Let g be (-4)/(-7) - 808/(-56). Calculate the greatest common divisor of g and 165. 15 Suppose -61 = -5d + 4z + 17, 4d = -z + 75. What is the greatest common divisor of 2 and d? 2 Let g be (-4)/22 - 62/22. Let k be (-585)/(-6) + g/(-6). Calculate the greatest common factor of 14 and k. 14 Suppose 6 = 2q - 2g, -30 + 6 = -5q + 2g. Calculate the highest common divisor of q and 6. 6 Suppose 4z - 9 - 47 = 0. Let l(t) = -23t - 2. Let o(m) = 22m + 2. Let u(f) = 3l(f) + 2*o(f). Let s be u(-4). Wh	{ "pile_set_name": "DM Mathematics" }
ater: 9/256 or 0? 9/256 Is 0 bigger than 4/5921? False Is 1 greater than -0.02519? True Which is smaller: 9 or 7? 7 Is -4916 greater than or equal to -4918? True Do 37.22 and 2/3 have the same value? False Are -8/349 and 1 nonequal? True Which is smaller: -276 or 0.2? -276 Does -625 = -4383/7? False Is 41 less than 45? True Which is smaller: -244 or -243? -244 Which is bigger: 993 or 1000? 1000 Are -268 and -267 equal? False Is 10 >= 10? True Which is smaller: -0.1 or 103? -0.1 Which is bigger: 90 or 92? 92 Which is bigger: 411 or 410? 411 Which is greater: -0.2 or 1344? 1344 Does -4/31 = -2? False Is 5 >= -215? True Is -0.294 at most 2? True Which is smaller: -3 or -9/4? -3 Which is bigger: 625 or 624? 625 Is 3 at most as big as -0.161? False Is -10 equal to -115/11? False Which is smaller: -110 or 4? -110 Are -4153 and -4156 equal? False Which is bigger: 1382/7 or 197? 1382/7 Which is greater: -9/4 or 77/2? 77/2 Is 2/189 > 1? False Which is smaller: -1 or 19/682? -1 Which is smaller: -1.089 or -1? -1.089 Which is smaller: -2233/2 or -1116? -2233/2 Is -4253 at most -29772/7? False Is 39/16 >= 1? True Which is smaller: 4/65 or 1? 4/65 Is -1/3670 less than -1? False Which is greater: 40 or 0.18? 40 Is -7/299 bigger than 1? False Is -1.58 greater than or equal to 2? False Which is smaller: 4 or 10/3? 10/3 Which is smaller: -56 or -45? -56 Which is smaller: 300/11 or 26? 26 Which is smaller: -122 or -123? -123 Which is smaller: 0 or -25.8? -25.8 Is -8 at least as big as -4/21? False Is 0 greater than -0.8297? True Which is smaller: 663/2 or 331? 331 Which is bigger: 71 or -20? 71 Is 198 bigger than 201? False Which is smaller: -318 or -0.07? -318 Which is bigger: 6576 or 6574? 6576 Is 19139 > 19139? False Is 641 <= 641? True Which is greater: 0 or 0.02172? 0.02172 Which is smaller: 398 or 395? 395 Which is smaller: -83 or -84? -84 Are 1 and -2/61 unequal? True Is 9150 at least 9149? True Which is bigger: -2/871 or -0.22? -2/871 Which is smaller: -139.8 or 0.2? -139.8 Which is greater: 1/498 or -0.5? 1/498 Is -467 < -442? True Are 2/1551 and 0 non-equal? True Is -268/7 less than -39? False Is 17598 smaller than 17599? True Are -1 and -1/3426 unequal? True Is -3270 less than -2/9? True Is 2914 at least 2914? True Is 373 greater than 743/2? True Which is smaller: -33/5 or -4? -33/5 Is -70 greater than or equal to 1? False Is 1690 equal to 1690? True Is -1/793 smaller than 1? True Is -2/5 at least as big as -0.28309? False Are -1 and -4/99 nonequal? True Which is greater: -1/2 or 7087? 7087 Which is smaller: -4/35 or 0? -4/35 Are 114 and 344/3 non-equal? True Is -138 >= -138? True Which is greater: -1 or -18/17? -1 Are -27 and 57 non-equal? True Which is smaller: -397 or -401? -401 Is 54 not equal to -3.9? True Which is smaller: 1/889 or 0? 0 Is -1044/23 bigger than -44? False Are 7 and 8 equal? False Do -3.8 and -2/11 have the same value? False Which is greater: -17/16 or -1? -1 Is -2/3 at least as big as 20/9? False Are -70 and -12 unequal? True Which is smaller: 26 or -9? -9 Which is smaller: 5 or 10? 5 Is -1 at most as big as -3303? False Which is bigger: 287 or 286? 287 Which is bigger: 1 or -136/19? 1 Which is bigger: 1 or 3/662? 1 Which is bigger: 5 or -0.11? 5 Is 73 greater than 25? True Which is greater: -2/7 or -144? -2/7 Is -7 <= -1/5? True Are -141 and -94 non-equal? True Which is smaller: -32/5 or -6? -32/5 Which is greater: -627/2 or -313? -313 Is -2 at least as big as 59.5? False Is -22947 != -22947? False Are -38 and -37 nonequal? True Which is smaller: -660 or -707? -707 Are 54596/7 and 7800 nonequal? True Which is greater: 0.064 or 9? 9 Which is greater: 32 or 98/3? 98/3 Are 0 and 659 unequal? True Is 91 >= 147? False Which is smaller: -2/3623 or 1? -2/3623 Which is smaller: -381 or -380? -381 Which is bigger: -0.1 or 69.9? 69.9 Is 1 at least as big as 1/864? True Is 14 bigger than 19? False Which is smaller: -3 or 2/43? -3 Is 0.2 at most as big as -211? False Which is smaller: -3 or 0.0191? -3 Which is smaller: 0.167 or 1? 0.167 Is -532 smaller than -2/9? True Which is greater: 181/6 or 31? 31 Which is greater: 1/3 or -0.922? 1/3 Which is smaller: 0 or -1/13778? -1/13778 Which is greater: -228 or -237? -228 Are -1 and 150/23 equal? False Do 1663 and 1665 have different values? True Which is smaller: 2 or 96/77? 96/77 Which is bigger: 121/30 or 3? 121/30 Which is smaller: -283 or 0? -283 Is 95 at most 187/2? False Do 220 and 14 have different values? True Which is smaller: 128/5 or 0? 0 Which is smaller: -1 or 1/993? -1 Which is bigger: 0.2 or 48? 48 Is 0 greater than 20/1049? False Which is bigger: 1 or 32/7? 32/7 Is 1/27976 less than or equal to 1? True Which is smaller: -52/33 or -1? -52/33 Which is greater: 0 or -2/591? 0 Which is smaller: 1 or -1216? -1216 Is -1 at least as big as 1? False Are 61/37 and 3 equal? False Do 24/35 and 1 have different values? True Which is smaller: 13/29 or 1? 13/29 Is 1.5 at most -2? False Does 1 = -2/1055? False Which is smaller: 0 or -11175/2? -11175/2 Which is smaller: 14866 or 14868? 14866 Is -3949 at most as big as -3949? True Is -308 at most -310? False Which is smaller: -2/13 or 2/67? -2/13 Is -12125 at most as big as -12124? True Which is greater: -1 or 38/393? 38/393 Which is smaller: -0.06 or 43? -0.06 Which is smaller: 10 or -24? -24 Which is bigger: -6 or 556/3? 556/3 Is 0.8 greater than 10.6? False Does -17293 = -17292? False Which is greater: -2/19 or -39.5? -2/19 Is 5/69 > 2? False Does 3113 = 3110? False Which is bigger: -413 or -412? -412 Are -2209 and -2208 non-equal? True Is 2/3 at most as big as 1371.3? True Which is smaller: 1/15 or -8? -8 Which is bigger: -121 or -118? -118 Is -27292 > -27293? True Is -6281 < -6284? False Which is bigger: -2/629 or -1? -2/629 Is -30 < -6? True Is 460 at most as big as 3215/7? False Which is greater: 1 or -14/1921? 1 Which is greater: -87 or -90? -87 Which is bigger: 0.3 or 313/5? 313/5 Are -2 and -330 nonequal? True Is 239 equal to -1.7? False Is 2188 >= 2186? True Which is smaller: 1/8 or 2/93? 2/93 Which is greater: -1/207 or -1? -1/207 Is -182 equal to -182? True Is -2/7 < 24? True Which is greater: -86 or -63? -63 Is -1 less than or equal to 7/8241? True Is 885/32 != 29? True Which is smaller: 0.11 or 37.9? 0.11 Which is greater: 46/217 or -1? 46/217 Is -24 less than or equal to -83? False Which is greater: 1 or 39/1139? 1 Is 85 less than or equal to 0.61? False Is -8 at least 331? False Which is smaller: 9 or 262/27? 9 Which is greater: -121/10 or -12? -12 Is -1 at least -4/67? False Is -0.2 < -616/9? False Do -9871 and -1 have the same value? False Is 25357 at least 25356? True Which is smaller: 16/3 or 0.24? 0.24 Are -2 and -917 non-equal? True Which is greater: -27 or -17? -17 Is 121 >= 606/5? False Which is bigger: 5 or 2600? 2600 Which is greater: -3 or -3/20? -3/20 Is -1/9417 at most as big as -1? False Which is smaller: -206 or -207? -207 Are 4/4401 and 1 equal? False Is 153 less than or equal to -4? False Is 1214 at least 1214? True Is -22/7 at least as big as -4? True Is -1 at least as big as -12/1309? False Which is bigger: 7342 or 7343? 7343 Is -2/9 != 549? True Is -13/2 greater than or equal to -2/9? False Which is bigger: -12148 or -12149? -12148 Which is smaller: -5850 or -5849? -5850 Is 2473 < 2466? False Which is greater: 1843 or 1842? 1843 Is 80 greater than 187? False Which is bigger: 314 or 316? 316 Are 2236/3 and 744 equal? False Is 8840 bigger than 8841? False Which is bigger: 2/3 or -14? 2/3 Which is greater: -83/4 or -20? -20 Is -269 at most as big as 53? True Does 10/9 = -8? False Which is smaller: -1 or 2/51? -1 Is -6/785 less than 1? True Is -8/49 >= -0.1? False Are 16/3 and -4 equal? False Is 330 at most as big as -2/3? False Which is smaller: 0 or -30? -30 Is 7630 at most as big as 7630? True Is -2 equal to 2.4? False Are 2749/5 and 551 equal? False Is -1/4 < -3/9175? True Is -451 greater than -449? False Which is smaller: -175 or 0? -175 Is -2015 less than or equal to -2016? False Is 2/2645 >= 0? True Is 1 at least as big as -53? True Which is greater: 1 or 1/37766? 1 Is 12729 greater than or equal to 12731? False Are 56 and 689/12 equal? False Are 1 and 1/226 unequal? True Which is bigger: 5/3648 or -1?	{ "pile_set_name": "DM Mathematics" }
- 2k2 in the form tk*2 + l + nk*3 + jk*4 + zk and give n. -3 Express u + 0u - 2u - u + u - u + (-4u + 2u + 4u)(0 + 0 - 2) - 3 + u + 3 + (-2u + 2u + 2u)(-5 + 1 - 1) in the form ju + y and give j. -15 Express 2k*2 + 0k2 + k2 + (2k - 2k - k)(3 - 3 + 2k) - 3k2 - 20 - 20 + 45 as ok + xk2 + i and give i. 5 Rearrange -3j*2 - 13j + 13j to rj + sj2 + v and give s. -3 Rearrange 2 + 6l*3 - 7l*3 - 5l*4 + 6l*4 - l to the form ol + jl2 + z + sl*3 + hl*4 and give h. 1 Rearrange (-6x*2 - 25x + 25x)(-1 + 2 + 5)((2 + x - 2)(2 - 2 + 2x) - x2 + 0 + 0) to q + px + dx2 + yx*4 + vx*3 and give y. -36 Express 15k3 - 3 + 0 - k2 - 16k3 - 15 as wk*2 + dk*3 + hk + u and give d. -1 Express (-p3 - p3 + p*3 + (23p + 14p2 - 23p)(-1 - p + 1))(3p + p - 5p) in the form hp4 + u + op*2 + zp + qp3 and give h. 15 Rearrange (2 + 3p - 4p - 4)(-5 + 7 + 21) to n + tp and give t. -23 Rearrange -2l*4 + 0l*3 + 3l*3 - 152l*2 + 150l*2 to yl*4 + ul*3 + b + zl*2 + il and give u. 3 Rearrange u*2 + 16 + 12u - 14u + 23 to lu*2 + a + ju and give a. 39 Express 32 - 32 - 18q2 as gq*2 + yq + a and give g. -18 Rearrange -f - 9f - f + f - 4f + 2f + (-1 + 5 + 1)(-3f - f + 3f) to of + j and give o. -17 Express -h3 - 2h*3 + 8 + 4h*3 as ih*2 + rh + dh3 + n and give i. 0 Express 12t - 12t - 5t2 - t2 in the form it + nt*2 + o and give o. 0 Rearrange (-4 + 4 - 2j)(2j3 + j3 - 2j3) + j4 - 5j*4 + 3j*4 + j - 2j - 2j - 8j*4 to b + qj + oj2 + nj*4 + sj*3 and give q. -3 Rearrange (1 - 4 + 1)(16t + 10t - 1 + 4) to ut + a and give u. -52 Express -27a*3 + 9a*3 + 8a*3 + 6a*2 - 2a*4 + 8a*3 as s + ha*4 + xa*3 + da*2 + fa and give h. -2 Rearrange (2w + 1 - 1)(-10w - 19w - w) + (1 + w - 1)(2w - 1 + 1) to kw + g + tw*2 and give t. -58 Express (2 - 5 + 0)(22j3 + 2j*4 - 22j*3) as mj*3 + zj*2 + x + fj*4 + aj and give f. -6 Rearrange 31f + 3 - f - 3 to the form n + gf and give g. 30 Rearrange b*3 - 7b*2 + 2b*3 - 39 + 41 to v + pb*2 + ib + mb3 and give v. 2 Rearrange (-2o + 0o + 0o)(-5 + 4o*2 + 5) + 2o*3 + 0o*3 + 0o*3 + 2o*3 + 2o*3 - 5o*3 to the form fo*2 + ro*3 + mo + l and give m. 0 Express (8 + 9h - 8)(2h + 3 - 3) - 6h*2 + 0h*2 + 2h2 - h2 + 0h + 0h + 4h - 4h - 3h2 in the form ph*2 + uh + m and give p. 10 Express (-11h + 1132 + 2h*3 - 1132)(h - 8 + 8) - 2h4 + 3h*4 - 2h*4 as ch*3 + dh*4 + ph*2 + t + gh and give p. -11 Express 531a2 - 525a*2 - 4 - 6 in the form ma*2 + za + c and give z. 0 Rearrange 2j2 - 2j + 4j + 2j*3 + 2j - j*4 to the form dj*4 + wj + x + fj3 + bj*2 and give d. -1 Rearrange 46 + 12 - 2 - 2s to ds + k and give d. -2 Rearrange 4u - 6u + 0u + (4u + 0u - 5u)(-1 - 2 + 6) + 30u + 38u - 77u to r + tu and give t. -14 Rearrange (-2n2 - n2 + 4n*2)(n - 7n - 5n)(-4 + 3 - 1) to un + zn3 + ln*2 + b and give z. 22 Rearrange -4 - 2 + 2h*3 + 2h + 9h4 + 0h*3 + 8 to the form ih + n + dh3 + sh*4 + kh*2 and give s. 9 Express (-m + 0 + 0)(4m - 8 - 6m + 11 - 22m3) as lm*2 + v + am + sm3 + qm*4 and give q. 22 Rearrange (77h - 8h - 2h)(4h + 2h - 4h)(-1 + 2 - 4) to z + uh*2 + ih and give z. 0 Express 5h - 11h + 13h in the form vh + a and give v. 7 Express (-2 - 20o2 - 1 + 1)(-2 + 0 - 2) in the form go + do*2 + u and give u. 8 Express (-9 + 5 - 21 + t)(-3t + 0t + 2t)(2t + t - t) in the form ut + xt2 + s + ct*3 and give c. -2 Express 1019j*3 - 3 + 3 - 989j*3 - 2j as v + pj3 + yj*2 + lj and give p. 30 Express -s*2 + 116s*3 - 2s*4 + 3s - 116s3 as j + qs*4 + bs*3 + hs + ks2 and give b. 0 Rearrange 5 - 6d*2 + 7 - 3 to the form sd*2 + m + ad and give m. 9 Rearrange -2s3 + 2 + s3 - s - s3 + 2 to x + qs + ds3 + us*2 and give q. -1 Rearrange -4i*2 + 2i*2 + 4i*2 + (2 - 2 + i)(-3i + 6i + i) to hi + v + pi2 and give v. 0 Express (p3 + 0p3 - 2p*3)(2p + p - 6p) + (-p2 + p2 - 2p2)(-2p2 + 2p - 2p) as up*3 + mp*2 + o + wp*4 + hp and give w. 7 Express (-301 + 301 + 72a)(4a2 - a2 - a2) in the form o + na + xa3 + ma*2 and give x. 144 Express 10y*2 - 6y - 2y2 + 2y*2 - 7y*2 in the form cy + v + ny2 and give c. -6 Rearrange (-l + 4l - 2l)(1 - 16l + 4l + 0l)(1 + 3 - 5) to the form m + yl + dl*2 and give y. -1 Express (1 + 4 - 3)(-2x + 1 - 1) - x + 0x + 2x + 0x - 2x + 4x + 2 - 2 - 2x + (-2 + 2 + 1)(1 + 16x - 25x - 2) as c + fx and give f. -12 Rearrange 108s*2 + 91s*2 - 153s*2 to the form zs + t + ls2 and give l. 46 Express -16l + 14l + 7l as ql + p and give q. 5 Express -60s*4 - 5 + 59s*4 + 9s + 3 - 2s - 2s*3 in the form as*3 + os + ys4 + ks*2 + d and give k. 0 Rearrange 734w*3 + 22 - 730w*3 + 6 to kw*2 + sw*3 + m + rw and give s. 4 Express 150q - 150q - 80q2 in the form sq*2 + bq + j and give s. -80 Express (-20r2 - 6r*2 - 4r*2 - 2)(4r - 4r - 2r) as y + vr*2 + ar + wr3 and give a. 4 Express m4 + 3m + 57m2 - 59m2 - m + m3 - 2m3 as jm*3 + p + wm*4 + cm*2 + ym and give y. 2 Rearrange (2 - 2 + o)(-5 - 1 - 3) to yo + g and give y. -9 Rearrange (3y - 3y - 2y3)(0 - 1 + 0) + (2y - y2 - 2y)(-y + 0y - 2y) - 2y*2 + 2y*2 - 3y*3 to cy + g + ky2 + iy*3 and give i. 2 Rearrange -22g*2 + 34g*2 + 20g*2 + 28g*2 to dg*2 + bg + a and give d. 60 Rearrange (-1 + 3 - 1)((3 - 2 - 2)(0n + 4n - 2n) - 96 + 96 + 17n) to jn + u and give j. 15 Rearrange 0f + 2f + 16 - 3f + 2f to xf + i and give i. 16 Express l*4 + 4l*3 + 0l*4 + 12l*2 - 9l*2 as al + il3 + fl*4 + nl*2 + s and give n. 3 Express (80858 + 4n - 5n2 - 80858)(4n - 3 - 2n + 1) as cn2 + yn + sn3 + u and give c. 18 Express (4 + j - 4)(-2j3 + 4j*3 - 4j*3) + (2j + 0j - 7j)(2j2 + j3 - 2j2) as wj*4 + pj*2 + k + nj*3 + aj and give a. 0 Rearrange 2c2 - 27c*2 - 12c*2 to the form tc*2 + dc + l and give t. -37 Express 48d2 - 21 - 28 + 49 as rd + o + bd2 and give o. 0 Express 13v*3 - 3 - 14v3 - v2 + 2v2 as nv + dv2 + zv*3 + y and give z. -1 Express -17u - 35u - 15u in the form ou + x and give o. -67 Express (2 - 5 + 1)(-56v2 + 1330v - 1330v) as j + xv*2 + dv and give x. 112 Express 3z - 3z + z + 0z - 2z + 0z + (-2 - z + 2)(5 + 1 - 4) - 2z - 2z + 2z + 1 + 2z - 1 + (-1 - 3z + 1)(4 - 4 + 1) in the form mz + o and give m. -6 Rearrange (-5d - 3d2 + 3d + 4d - 3 + 3 + 2d*2 + (-d + 4d + 2d)(-4d + d + 5d))(2 - 5 + 1) to kd*2 + id + o and give k. -18 Rearrange -3u4 - 4u*3 - 2 + 0u*4 - 2u + 6u3 to the form vu + du3 + b + ku*2 + qu*4 and give v. -2 Rearrange -2j*3 - 2j*2 + 1 + 2 - 3 - 2j to lj + g + aj*2 + nj*3 and give n. -2 Express (6 - 2 - 3)(3c3 + 2c*3 - 2c*3)(1 - 1 - 7c) as bc*2 + dc + j + ac3 + fc*4 and give f. -21 Rearrange (2g + 0g - 4g)(g + g + 0g - 6g2) to lg + h + ng2 + jg*3 and give j. 12 Rearrange -4a + 58a - 35a + 85a to za + j and give z. 104 Express (2w - 2w*2 - 6w + 5w)(-2 + 6w + 2)(2 + 1 - 2) as k + cw3 + aw*2 + dw and give d. 0 Express 3z3 + 0z - 23 - 2z + 0z + z in the form fz + hz*3 + az*2 + r and give f. -1 Rearrange 8n*2 - 5 - 2n*3 - 17n*2 + 8n*2 to the form wn + x + un2 + kn*3 and give u. -1 Rearrange (-4k + 0k + 2k + (4 - 2 - 3)(-k + k + k) + 2 + 2k - 2)(0k - 2k + 4k) to ik2 + vk + a and give a. 0 Rearrange (2i - 4i - 2i)((2 + 2 - 1)(-5i + 0i + 3i) + (-3 - 1 + 2)(-3i - 5i - 2i)) to the form li + bi*2 + y and give b. -56 Express -3 - 2q + 10q3 + 1 - 5q*3 as cq*2 + f + rq*3 + nq and give n. -2 Rearrange (4k - k - 4k)(-20k + 20k + 21k*3) to lk*4 + sk*3 + mk + i + ck2 and give l. -21 Express 13d + 5d - 2d in the form wd + j and give j. 0 Rearrange -3b + 3 + 1 + 2b4 - b3 - 2 + 4b to the form tb + zb*3 + cb*2 + sb**4 +	{ "pile_set_name": "DM Mathematics" }
- 136. What is the units digit of c(-9)? 7 Let x(t) = -t - 3. Let u be x(-3). Suppose 155 = 4r + 3k, ur + 2r + k = 75. What is the tens digit of r? 3 Let h(w) = -37w2 - 3w + 6w + 63w*2. Let p be h(-2). Suppose -p = b - 3b. What is the units digit of b? 9 Let i = 9 - -11. Suppose -i = -4h - h. What is the units digit of h? 4 Suppose -9 = -2n + 5n - 3r, 4n + 12 = 5r. Let s be n - (-3 - (8 + -3)). Suppose 3g - 2g - s = 0. What is the units digit of g? 5 Suppose 7r = 31r - 9936. What is the units digit of r? 4 Let i = -530 + 964. What is the units digit of i? 4 Let o(a) = -2a3 - 14a*2 - 15a + 50. What is the tens digit of o(-7)? 5 Let d = -391 + 68. Let l = -129 - d. What is the hundreds digit of l? 1 Let j(z) = 139z2 + 6z - 13. What is the hundreds digit of j(-3)? 2 Let q(w) = w*3 - 3 - 8w + w - 3w2 + 6w + 13w2. What is the units digit of q(-10)? 7 Let c = -9 + 15. What is the units digit of 7312/96 + (-1)/c? 6 Let n = -11 + 15. Suppose -2h = -h - n. Suppose -8 = -4f - 4m, -h = -2f - 0m - m. What is the units digit of f? 2 Let i(u) = u. Let j(k) = -14k. Let v(t) = -t2 - 6t + 1. Let c be v(-6). Let s(h) = cj(h) - 3i(h). What is the tens digit of s(-1)? 1 Let m(r) = 111r - 458. What is the hundreds digit of m(13)? 9 Let d = -51 + 31. Let a(c) = -c - 49. Let t be a(20). Let m = d - t. What is the tens digit of m? 4 Let z(a) be the second derivative of a7/2520 - a6/360 - a5/40 + a4/12 + 8a. Let i(h) be the third derivative of z(h). What is the tens digit of i(6)? 2 Let n(h) = 15h + 19. Let v(f) = 14f + 20. Let g(w) = 2n(w) - 3v(w). What is the units digit of g(-8)? 4 Let s = -23 - -43. Let k = s + 5. Suppose -3q + k = -29. What is the tens digit of q? 1 Suppose -23i + 15548 = 2254. What is the hundreds digit of i? 5 What is the thousands digit of 2/10 - 141102/(-90)? 1 Let a be (20/(-25))/(1/5). Let p be a/2(9 - 8). What is the units digit of -1p/(-4)-4? 2 Let v be (-4)/(-20) + 138/10. Let g = v + -12. Suppose -2f = 5h - 137 + 10, -3h + 117 = gf. What is the tens digit of f? 5 Suppose 4l - 9 - 167 = 0. Let o(z) = -2z2 + 11z. Let i be o(5). Suppose -49 = -ig + n + 30, -4n + l = 4g. What is the tens digit of g? 1 Suppose -t - 5u - 3 = 0, 3t + 0t + 4u - 2 = 0. Suppose -ts + 520 = 2w, 0 + 8 = 2w. What is the tens digit of s? 5 Suppose 0 = -57k + 60k - 42. Suppose -kb = -10b - 600. What is the units digit of b? 0 Let s(l) = 21 - l*2 - 3l - l3 - 27 + l2. Let o be s(0). Let u(n) = n*2 + 2n + 7. What is the tens digit of u(o)? 3 Let f = -152 - -154. Let s = 3 + 4. Suppose l - s = -f, -l = o - 12. What is the units digit of o? 7 Suppose -7r + 4943 + 2806 = 0. What is the thousands digit of r? 1 Let k(d) = -2d*2 + 5d - 5. Let c be k(-5). Let m be (36/(-10))/(32/c). Suppose 10g - mg = 5. What is the units digit of g? 5 Let o = -85 + 33. Let p = -37 - o. What is the units digit of p? 5 Let f(m) = 4m - 8. Let o be f(2). Suppose o = 4z + 4d - 384, -285 = -3z - 4d - 0d. What is the units digit of z? 9 Let n be (-1 - -13) + (-16)/8. Suppose -11 = j - 4t, 4j - 8j - 2t + 28 = 0. What is the units digit of (n - 3)(j + -2)? 1 Suppose n = -n - 3k + 253, 2n = 5k + 213. Let s = n + -78. What is the tens digit of s? 4 What is the hundreds digit of 5451/2158/237? 8 Let x = 1849 + 2167. What is the thousands digit of x? 4 Let z(f) = -3f*3 - 6f*2 + 11f - 11. What is the tens digit of z(-7)? 4 Let o = 1531 + 996. What is the units digit of o? 7 Let r = 5365 + -3121. What is the units digit of r? 4 Let s be (589 - -2)/3 - -2. Let a = -97 + s. What is the units digit of a? 2 Let n = -8 + 0. Let p = n + 12. Suppose 4 = pm - 16. What is the units digit of m? 5 Let l be (5 - (3 + 0))/((-2)/(-3)). What is the units digit of (0 - (l + 16/(-6)))-117? 9 Let v be (-20)/(-15) + -1 + 506/(-6). Let z = v + 158. What is the tens digit of z? 7 Suppose 0 = -9v + 12v - w - 2396, -5w = -5v + 4000. What is the hundreds digit of v? 7 Let h be 0 + -1 - (0 + -713). Suppose 4c - h = -2g, 2g - 7g = -c + 189. What is the hundreds digit of c? 1 What is the units digit of (1 - 12/(-8))4718/35? 7 Let m = -191 + 81. What is the units digit of 0 + (0 + 0 - m - -3)? 3 Let d(w) = -11w + 18. Suppose 4z + 44 + 0 = 0. What is the hundreds digit of d(z)? 1 What is the hundreds digit of (-3804)/(-24) + (-9)/(-6)? 1 Let x(d) = -3d*3 - 33d*2 + 16d + 323. What is the tens digit of x(-16)? 0 Suppose 3k + 5a = 2k + 971, -4a = -8. What is the units digit of k? 1 What is the tens digit of 2/(-4)11(-211 + -1)? 6 Let r be 15/(-6)(-6 - (-16)/4). Suppose ro = -3i + 360, -296 = -4o - 5i + i. What is the units digit of o? 9 Let y(h) = 11h*2 - 10h + 7. What is the units digit of y(-7)? 6 Suppose 5h + 7182 = 4b, 47b + 3h = 46b + 1787. What is the units digit of b? 3 Suppose k = -5u + 11030, 5k - 29 = -4. What is the hundreds digit of u? 2 Let m(j) = j2 + 11j + 29. What is the tens digit of m(15)? 1 Let f(o) = -o*3 + 13o*2 + 15o - 11. Let w be f(14). Let g = 14 + -9. Suppose -gk - 55 = -l, wk + 4 = -k. What is the tens digit of l? 5 Let h(y) = 4y2 - 5y + 6. Suppose 3o = 6o - 48. Suppose -3c + 4b = c - o, -2c - 4b + 2 = 0. What is the tens digit of h(c)? 2 Let n be ((-24)/28)/(2/(-84)). Let t = 98 - n. What is the tens digit of (t - (-2 + 2)) + -3? 5 Let j(w) = w*2 + 10w - 7. Let s(m) = m + 2. Let q be s(-6). Let c be -8 - (0/q - -3). What is the units digit of j(c)? 4 What is the units digit of (-1)/(-3)(4846 + 5)? 7 Suppose 2d = d. Suppose 2y + dy = 58. What is the units digit of y? 9 Suppose 2w = 679 - 175. What is the units digit of -2 + w - (7 - 4)? 7 Let j = -781 - -1796. What is the thousands digit of j? 1 Let w = -2045 - -3329. What is the units digit of w? 4 Suppose -2p = 36 + 76. Let j = p + 134. What is the units digit of j? 8 Let m = 3096 + 1419. What is the units digit of m? 5 Let a(o) be the third derivative of o5/6 + o4/3 - o*3/2 + 4o*2. What is the tens digit of a(3)? 1 Let w be 3 + (-2)/(-4)2. Let a = w - 18. Let m = a + 24. What is the units digit of m? 0 Let u be -1 - ((-60)/(-2) + -1). What is the units digit of (78/(-15))/(4/u)? 9 Let t be 0/(-4) + 0 - -7. Let i(r) = r*3 - 8r*2 + 8r - 4. Let h be i(t). What is the tens digit of 28 - (h/3)/(-1)? 2 Let f = -137 - -80. Let v = 22 - f. What is the units digit of v? 9 Suppose -3 = 2r - 7. Suppose 3w = 3, -rw = 3d + 2w - 355. What is the tens digit of d? 1 Let j(i) = i2 + 18i - 19. Let m be j(-21). Let h = m + -2. What is the units digit of h? 2 Suppose 5p - z = 970, p + 0z - 3z - 180 = 0. Let k = p + -57. What is the tens digit of k? 3 Let j = 1052 - -99. What is the hundreds digit of j? 1 Let v be (-2 - -19) + 8 + -11. Let b be (v/5)/(18/45). Let q(s) = 2s*2 - 14s + 2. What is the units digit of q(b)? 2 Let b be (4/(-6))/(1 + 125/(-135)). Let o(z) = 2z2 - 9z - 23. What is the units digit of o(b)? 0 Suppose 0 = 2g - 43 + 39. Suppose -m + 205 = 2w, -w - 4w + 490 = -gm. What is the hundreds digit of w? 1 Suppose 0 = -2n + 5x - x + 40, 0 = 5x - 25. What is the units digit of 5/n + (-29)/(-6)? 5 Let k(n) = n2 - 10n + 13. Let t be k(-8). Suppose 3f - 96 = f - 3g, 3f = 2g + t. What is the tens digit of f? 5 Let g be 35/(-45) + 4/(-18). Let y = 4 - g. Suppose -3k = -yq + 129, -q - 3k + 4 + 29 = 0. What is the tens digit of q? 2 What is the units digit of (4(-21)/(-14) - -977)/1? 3 Suppose 117 = 3h - 2v, -3v + 97 = 2h + 2v. Let s = h + -69. Let t = -6 - s. What is the units digit of t? 2 Let b = -88 + 93. Suppose 235 - 910 = -ba. What is the tens digit of a? 3 Let r(h) = h*2 - 17h + 34. Let t be r(15). What is the units digit of 57/t + (-3)/(-4)? 5 Suppose -2a = -10a + 7848. What is the hundreds digit of a? 9 Let z be 202/22 + (-24)/132. Suppose 7k = zk - 280. What is the units digit of k? 0 Suppose 135n = 139n - 152. What is the tens digit of n? 3 Suppose -1992 + 5268 = 2w. What is the tens digit of w? 3 Suppose 8h - 20h - 12 = 0. What is the units digit of 616/35h(-10)/4? 4 What is the tens digit of (-287)/82(-4656)/7? 2 Let z = -2 - 3. Let h = z + -4. Let u = 26 - h. What is the tens digit of u? 3 Let a(j)	{ "pile_set_name": "DM Mathematics" }
68) - 2sqrt(68))4))/((sqrt(168)/(sqrt(6)-1))/sqrt(7)))2. 833 Simplify (3sqrt(102)-1 + (sqrt(102) - -4sqrt(102)-2 - sqrt(102)))/(sqrt(600) + 1sqrt(600)-4 - sqrt(600)). 11sqrt(17)/40 Simplify (5(-5 + sqrt(72) + -1 + 1))22. -3000sqrt(2) + 4850 Simplify -1(sqrt(11)1 + 4)2 + (sqrt(11) - (sqrt(176) - sqrt(11))) + -5 + sqrt(11) + sqrt(44)-2. -13sqrt(11) - 32 Simplify (sqrt(17) - (sqrt(17) + (sqrt(1700) + 2 + sqrt(1700))2)) + -1 + -6(sqrt(833) + 0). -6805 - 122sqrt(17) Simplify 3(-6sqrt(55)-3 - sqrt(55))/(sqrt(405)-3). -17sqrt(11)/9 Simplify (sqrt(165)/(sqrt(243)2 + sqrt(243)))/(sqrt(539)-1-6 + sqrt(539)). sqrt(5)/1323 Simplify (sqrt(119)1-5)/(sqrt(112)-6)-3. -5sqrt(17)/8 Simplify -3(4 + (sqrt(300)-2)/((sqrt(32)-1)/sqrt(8))). -30sqrt(3) - 12 Simplify (1sqrt(102)-3)/(sqrt(6)2-6). sqrt(17)/4 Simplify (sqrt(57) + (sqrt(114)/sqrt(2) + sqrt(57))-4 - (sqrt(912) + (sqrt(912) - sqrt(912)1) + sqrt(57)))/(sqrt(27)/(sqrt(1089)-1 - sqrt(1089))). 264sqrt(19) Simplify (sqrt(189)/(sqrt(112) - (sqrt(112)3 - sqrt(112)))1)*2. 27/16 Simplify 4(sqrt(405)2-6 + (1sqrt(405) - sqrt(405)) + sqrt(405) + 0 + 4)2. -3168sqrt(5) + 196084 Simplify (sqrt(567)-2-5)/(sqrt(9) - sqrt(45)/sqrt(5)6) + -2. -6sqrt(7) - 2 Simplify (2sqrt(495) - sqrt(495) - sqrt(495))/(sqrt(60)/sqrt(432)). 0 Simplify ((sqrt(190)/((sqrt(100)/sqrt(2))/sqrt(5)))2 - (-1sqrt(190)-1 - sqrt(190))/sqrt(10)) + -3. 16 Simplify (-4 + 2-1sqrt(1377)2-5 + -4)2. -2880sqrt(17) + 550864 Simplify ((-3sqrt(495))/sqrt(9))/(sqrt(88)/sqrt(8)3). -sqrt(5) Simplify (1 + (-5-2sqrt(170))/((2sqrt(80) - sqrt(80))/sqrt(8)))1. 1 + 10sqrt(17) Simplify ((1(sqrt(36) + sqrt(576)))/sqrt(6))/(sqrt(3)1-5-5). sqrt(2)/5 Simplify ((6-2sqrt(117))/(sqrt(1296) + (sqrt(1296) - (sqrt(1296) + sqrt(1296) + -3sqrt(1296)) - sqrt(1296))))*2 + 1. 17/4 Simplify (sqrt(52)/(sqrt(2) + (sqrt(88)/sqrt(4))/sqrt(11)))/(sqrt(12)/(sqrt(6) - -2sqrt(600) - sqrt(6))). 10sqrt(13) Simplify 1(sqrt(85)/sqrt(5) + sqrt(17))*2 - (sqrt(153)1 + sqrt(17)) - (-5 + (sqrt(68)/sqrt(4))*2 + sqrt(17) + -3). -5sqrt(17) + 59 Simplify (sqrt(280)/sqrt(5)1)/(sqrt(512)1) + 5. sqrt(7)/8 + 5 Simplify ((2sqrt(245))22 - (sqrt(245) - -4(sqrt(245) + -2)2)) + ((sqrt(245) + -2)21 - sqrt(245)) + (sqrt(245) - (2sqrt(245))2-1). 77sqrt(5) + 2193 Simplify (-3 + -1(-5 + sqrt(175)6)-1)*2. -480sqrt(7) + 6364 Simplify (-46sqrt(220)/sqrt(4))/(-41sqrt(125)). 6sqrt(11)/5 Simplify (21sqrt(187))/(3sqrt(1331)). 2sqrt(17)/33 Simplify (-2sqrt(4455) - 2sqrt(220))/(4sqrt(25)/(2sqrt(5)))1. -11sqrt(11) Simplify (-5(0 + (2sqrt(704) + -5 - sqrt(704) - (4 + (sqrt(704) - (-2sqrt(704) - sqrt(704)))))))*2. 10800sqrt(11) + 160425 Simplify (sqrt(48)/(1sqrt(512)))/(4(sqrt(162) + sqrt(162)-1 + sqrt(162) - sqrt(2))). sqrt(3)/256 Simplify (-4sqrt(68)-1 - sqrt(68))/(-4sqrt(100)). -3sqrt(17)/20 Simplify (-4 + -42sqrt(1584))2 + 3(-3(sqrt(1584) + sqrt(1584)-2))*2. 768sqrt(11) + 144160 Simplify (-1sqrt(117)-1 + (sqrt(117) - -3((sqrt(117) - (sqrt(117) - sqrt(117)2)) + sqrt(117))))/(-6(sqrt(81) - sqrt(9))-4). 11sqrt(13)/48 Simplify (sqrt(104)3-4 - sqrt(104))/(sqrt(88)/(sqrt(66)/sqrt(6))). -13sqrt(13) Simplify ((sqrt(2057) - (-4 + sqrt(2057) + -4)) + (sqrt(2057) - (-1 + sqrt(2057)3)))3-4. -108 + 264sqrt(17) Simplify 5 + (1(sqrt(104) - sqrt(104)1))/sqrt(8) + sqrt(52)/sqrt(64) + sqrt(13) + sqrt(130)/(sqrt(10) + sqrt(40) - sqrt(10)). 5 + 7sqrt(13)/4 Simplify (sqrt(400) + (sqrt(400) - (sqrt(400)3 - sqrt(400))))/(sqrt(50)/(-3sqrt(10) - sqrt(10)))1. 0 Simplify ((sqrt(156) - sqrt(156)1-3) + sqrt(156))/(sqrt(972)-4 + sqrt(12)). -sqrt(13)/7 Simplify ((2sqrt(286))/sqrt(11) + sqrt(26) + sqrt(26)-16)/(sqrt(16)/(sqrt(96)/sqrt(3))). -6sqrt(13) Simplify (-4 + sqrt(14)/sqrt(2) - ((2sqrt(7))*2 + sqrt(7) - sqrt(7))5) + -3 + -3. -150 + sqrt(7) Simplify ((sqrt(252)/((sqrt(864) - (-2sqrt(864) - sqrt(864))) + sqrt(864)))/(sqrt(216)-1 + (sqrt(66)1)/sqrt(11)))2. 7/90000 Simplify (sqrt(136)11 - (2sqrt(136)5 - sqrt(136)))/((5-2sqrt(48) + sqrt(48))/sqrt(6)). 8sqrt(17)/9 Simplify 3 + -6(-6sqrt(550)1)/sqrt(11). 3 + 180sqrt(2) Simplify ((-3sqrt(189))/(sqrt(1008)-1))*2. 27/16 Simplify 1 + ((-5 + 1 + sqrt(108))3)*2. -432sqrt(3) + 1117 Simplify 2 + (sqrt(352)2)/sqrt(32) + -3. -1 + 2sqrt(11) Simplify (-1(-1sqrt(637) + sqrt(637) + 1))*2 - -6((sqrt(637) + 2 + sqrt(637) + 5)*2 - sqrt(637)). 1134sqrt(13) + 15583 Simplify (3(2 + sqrt(1700) + 1 - (-2 + 2 + sqrt(1700))))2. 81 Simplify (-3 + 3sqrt(275)-2 + -3)24. 1440sqrt(11) + 39744 Simplify 3(sqrt(132) - -42sqrt(132))/(sqrt(108)5) + 2. 2 + 9sqrt(11)/5 Simplify (2 + sqrt(1539) + sqrt(19)6 + -2)-3. -45sqrt(19) Simplify sqrt(27)/sqrt(9)2 + 4 + (6sqrt(3)2 - 3sqrt(12)/sqrt(4))2. 2sqrt(3) + 247 Simplify (-2 + (2 + -2 + sqrt(13) + sqrt(13) + 0)-5)-3. 6 + 30sqrt(13) Simplify 5(-1 + sqrt(325) + -3 + sqrt(325)-3 + -2)2. 600sqrt(13) + 6680 Simplify 5 + 1 + sqrt(539) - (sqrt(539) + 3 + (-1sqrt(539) - sqrt(539)) + sqrt(539) + sqrt(539) - sqrt(539)). 3 + 7sqrt(11) Simplify (3(-4 + (-2 + sqrt(2) - sqrt(2) - sqrt(2)) + -5))2 + (2sqrt(640))/sqrt(5). 214sqrt(2) + 1107 Simplify ((sqrt(75) + -2 - sqrt(75)) + -3 + (sqrt(75)-15 - sqrt(75) - sqrt(75))2)-4. -14680 Simplify 2sqrt(128)1 + -1 + (-1sqrt(128) - sqrt(128))-1 + 3(0 + sqrt(128)). -1 + 56sqrt(2) Simplify (3sqrt(28)/sqrt(4)6-466)2. 47029248 Simplify ((6-6sqrt(110)/sqrt(5))/(3(sqrt(176) + sqrt(176)-4)))2. 2 Simplify (2(1sqrt(143)2)/sqrt(11)2)2-6. -4992 Simplify (1(sqrt(500) + 0 + sqrt(500) + sqrt(500) + sqrt(500)) - (sqrt(500) + 0)5) + 4. -10sqrt(5) + 4 Simplify (((sqrt(36) + sqrt(108)/sqrt(3))/sqrt(2))/((sqrt(324) + sqrt(36))/sqrt(4) - sqrt(9))-1)*2. 8/9 Simplify -2((sqrt(35) - sqrt(140)/sqrt(4))1)/(sqrt(7) + -1sqrt(847))-1 + -4. -4 Simplify -5 + ((sqrt(20)/sqrt(90))2 + (sqrt(128)-2)2 - (sqrt(2) + sqrt(8)/sqrt(4) + -2)2-2). -16sqrt(2) + 4781/9 Simplify (2 + 1sqrt(180) + (sqrt(180)1 - sqrt(180))1 + -3)2. -12sqrt(5) + 181 Simplify -2(sqrt(2448) + sqrt(2448) + sqrt(2448) + 0) + (5(sqrt(1666) - sqrt(34)))/sqrt(2). -42sqrt(17) Simplify (3sqrt(76)2 + 3sqrt(76)1)/(sqrt(40)/sqrt(90)5). 27sqrt(19)/5 Simplify (1 + -1 + sqrt(27) + (1 + sqrt(27))2 + 4-1sqrt(3))1. 5sqrt(3) + 28 Simplify sqrt(45) + -2 - (sqrt(10)/sqrt(2) + 1) - (sqrt(5) - ((-1 + sqrt(5))5)*2)1. -49sqrt(5) + 147 Simplify -3(-1sqrt(220))/(sqrt(11) + 2sqrt(704)). 6sqrt(5)/17 Simplify (-1 + sqrt(1008)-1 + -2 + sqrt(1008)1 + sqrt(1008) + (sqrt(1008) - 3(sqrt(1008)-1 + sqrt(1008))) + -1)2. -192sqrt(7) + 4048 Simplify -6(-2sqrt(45)/(sqrt(18)/sqrt(2)) + (1sqrt(30))/sqrt(6)-5)*2. -1470 Simplify (sqrt(143)/(sqrt(11) - -11sqrt(11)) - (2 + -2 + -3 + sqrt(13) + sqrt(13)))2. -3sqrt(13) + 6 Simplify (sqrt(55)/((-2sqrt(121))/sqrt(11) + sqrt(11)) + 2 + 3)3. -3sqrt(5) + 15 Simplify 5((-2 + sqrt(17))1 + -2 - 2(-6sqrt(85)/sqrt(5) - sqrt(17))). -20 + 75sqrt(17) Simplify ((sqrt(684) + 5 + sqrt(684))-62 + 1)24. 67968sqrt(19) + 1589860 Simplify ((2-1sqrt(13)-6)*2 + (sqrt(91) - (sqrt(91) + sqrt(91) + (sqrt(91) - (sqrt(91) + 2sqrt(91) + sqrt(91))-5)))/sqrt(7) + -2)-6. -11220 + 132sqrt(13) Simplify (sqrt(13)1 + 4 - sqrt(468)/sqrt(4)) + ((-1 + sqrt(468) + sqrt(468))-6)2. -866sqrt(13) + 67432 Simplify (sqrt(17) - ((2sqrt(136))/sqrt(8))2) + sqrt(17) + sqrt(85)/sqrt(45) + (2sqrt(1377) - (sqrt(153) + 1))*2. -83sqrt(17)/3 + 3758 Simplify ((sqrt(228)-1 + sqrt(228))/sqrt(12) + -1 + -1 + sqrt(19) + sqrt(76) + 3 + sqrt(76)/sqrt(4) + -5)2. -32sqrt(19) + 320 Simplify 4(32sqrt(117)5)*2 + -4 + 0. 421196 Simplify (sqrt(108)1 + sqrt(108))/(3sqrt(81))6. 8sqrt(3)/3 Simplify -3 + (-4((sqrt(8)-4 - sqrt(8))/sqrt(4) - sqrt(12)/(sqrt(18)/sqrt(3))))2. 1149 Simplify (5(-3sqrt(1900) + 4) - (5 + 6(0 + sqrt(1900))))*2. -6300sqrt(19) + 838125 Simplify sqrt(1053)2 + -1 + 5 - (-1 + 3 + (sqrt(39)/(sqrt(12)/sqrt(4)))2). -11 + 18sqrt(13) Simplify -1(3 + 451sqrt(468) + 4). -120sqrt(13) - 7 Simplify sqrt(700) + 3sqrt(700) + 3 + (sqrt(700) - ((sqrt(700) - (-3 + sqrt(700)1)) + sqrt(700))). 40sq	{ "pile_set_name": "DM Mathematics" }
of (-16272 + 6)/((-186)/15 + 12)? 0 Suppose 746u = 678u + 180540. What is the units digit of u? 5 Suppose -3n + 184141 = o, -4n + 33268 = 5o - 212224. What is the ten thousands digit of n? 6 Let t = 239 + -226. Suppose -4z + 235 = q, -2q + 16z + 503 = tz. What is the hundreds digit of q? 2 Suppose 15 = 10g - 5. Suppose gq - l = l - 4, 0 = -l + 2. Suppose qv = v - 2u - 67, -3u = v - 72. What is the units digit of v? 9 Let h(b) be the first derivative of -b*2 + 375b + 22. What is the units digit of h(0)? 5 Suppose 43w - 1081024 = 11w. What is the tens digit of w? 8 Suppose 4y + 6 = -z, 11y - 8 = -5z + 10y. Let g(i) = 45i2 + 10i - 21. What is the tens digit of g(z)? 7 Suppose -v = v + 58. Let g(s) = s*2 - 27s - 148. Let r be g(30). Let t = v - r. What is the units digit of t? 9 Suppose -4796 = -5m + g, 2m + 0m - 1916 = g. Suppose 321b - 326b + m = 0. What is the tens digit of b? 9 Let h = 562 + -559. Suppose -3188 = -hu - 5m, 3u + 1712 = -2m + 4888. What is the thousands digit of u? 1 What is the thousands digit of 5/((-70)/88)(-8771)/14? 3 Let j = -5752 - -14375. What is the hundreds digit of j? 6 Let q = -2132 - -5252. Suppose 0 = -136m + 121m + q. What is the tens digit of m? 0 Suppose -w + 4l + 274 + 400 = 0, -2w - 5l = -1322. Let j = -122 + w. Suppose -j - 976 = -8k. What is the tens digit of k? 9 Suppose 2s - 123 = 10661. Suppose 3h = -2t + s - 543, -3h = t - 4853. What is the hundreds digit of h? 6 Let l(p) = 39p3 + p2 - 13p - 20. Let h(r) = 77r3 + 2r*2 - 25r - 39. Let w(g) = -6h(g) + 11l(g). What is the tens digit of w(-2)? 6 Let s(u) = 27u + 11. Let h be s(-2). Let o = 47 + h. Suppose -or + 0r - 2j + 412 = 0, -r + 4j + 112 = 0. What is the units digit of r? 4 Suppose 37n = 11n + 92872. What is the units digit of n? 2 Suppose 5o - 44 = o. Let i = o + -1. What is the tens digit of 1014/10 + (-4)/i? 0 Suppose -2r - q + 6 = 3, -3r + 4q = -21. Suppose ra - 4y = -0y - 700, 0 = -4a + 5y - 935. Let v = -136 - a. What is the hundreds digit of v? 1 Suppose -4d = 2c - 4800, 3c + 4d = 2c + 2396. What is the hundreds digit of c? 4 Let s(g) = -3g*2 + 27g + 78. Let u(q) = 5q2 - 28q - 79. Let o(a) = 4s(a) + 3u(a). What is the hundreds digit of o(-17)? 5 Let q be -3(-10)/6 - -9. Suppose 4 - 18 = -ql. What is the tens digit of (232/(-16))/(((-2)/l)/12)? 8 Let y be (3 - 1/3)/(2/660). Let p = y + -543. What is the tens digit of p? 3 Suppose 3u - 5667 = -3t, -5t + 5u + 8946 = -509. What is the hundreds digit of t? 8 Let z = 301 + -298. Suppose 0 = -l + 5q + 249, -1050 = -zl - l + 2q. What is the hundreds digit of l? 2 Suppose -47a = -51a + 25416. What is the thousands digit of a? 6 Let w be (-36)/(-8) + (-50)/20. Suppose -q = -5q - 5j + 7660, 5j = wq - 3800. What is the thousands digit of q? 1 Let s = 44052 + -22739. What is the tens digit of s? 1 Let q be (-14)/(-8) - (0 - (-6)/8). Let l be (-4 - 0)(-13 - -4) + q. Let u = 90 - l. What is the units digit of u? 3 Let x = 35 + -150. Let r = 272 + x. What is the units digit of r? 7 What is the thousands digit of (-44)/((-528)/770838) - 6/(-4)? 4 Suppose -78a + 3658781 = 975503. What is the units digit of a? 1 Let k(o) = o + 1. Let u(d) = -32d - 11. Let t(q) = 3k(q) + u(q). Let l be t(-4). Let w = l - 40. What is the units digit of w? 8 Suppose -23 = 8q + 113. Let t = 207 + q. What is the hundreds digit of t? 1 Let y(q) be the third derivative of 11q5/60 + 193q*3 + 71q*2 + 1. What is the units digit of y(0)? 8 Let v = -96 + 108. Let f(k) = -16k + 39k - vk + 5 + 6k2. What is the units digit of f(5)? 0 Suppose -16150 = -8s - 2326. Suppose -8w + 5w + s = 3p, -5p - 2880 = -5w. What is the hundreds digit of w? 5 Let g(f) = -87f + 30. Let b(p) = 174p - 59. Let m(n) = -6b(n) - 11g(n). What is the tens digit of m(-3)? 8 What is the units digit of ((-16037)/609)/((-1)/483)? 9 Let k(q) = -8q*2 - 27q + 223. Let x be k(10). Let g = 1550 + x. What is the units digit of g? 3 Let h = 110 - 56. Let s be 1 + -3 + h/9. Suppose -sw + r = -122, -r = -0w + w - 33. What is the units digit of w? 1 Suppose -47 = -17m + 21. What is the hundreds digit of (-930)/m((-56)/21)/2? 3 Suppose 2 = -2l + 2t, 17t + 23 = 2l + 20t. Suppose -ld - 348 = -2q - 932, -584 = -4d + q. What is the units digit of d? 6 Suppose 2g + 2s - 2228 = 0, -9 = 4s + 3. Suppose 4w + g + 660 = 3a, w + 2973 = 5a. What is the units digit of a? 5 Suppose -5 + 11 = 3a. Suppose -al + 338 = 82. Suppose -g = -u - 3u + 242, 2u + 3g = l. What is the tens digit of u? 6 Suppose 3y + 8125 - 23586 = -4n, -2y = 4n - 15458. What is the thousands digit of n? 3 Suppose 0 = -76h + 71h + 45. Let n(u) = 3u*3 - 13u*2 + 4u + 63. What is the units digit of n(h)? 3 Let h(p) = 2p2 - 31p + 89. Let d be h(12). Suppose -899 - 449 = -4b - c, -20 = dc. What is the units digit of b? 8 Let d be 2/(-9) - (105190/18)/5. Let y = -394 - d. What is the tens digit of y? 7 Let r = -149 + 154. Suppose -rq + 10q = 2y - 3783, 5y = -2q + 9472. What is the units digit of y? 4 Suppose 24z - 4400496 = -120z. What is the units digit of z? 9 Let m = -70 + 54. Let q = m - -21. Suppose d - 796 = -qu, 4u = u + 4d + 496. What is the tens digit of u? 6 Let r = -7080 + 16532. What is the thousands digit of r? 9 Let u(b) = 280b - 1065. What is the units digit of u(31)? 5 Let k(c) = -99c*3 - 9c*2 - 24c - 263. What is the thousands digit of k(-6)? 0 Suppose -2f - 3640 = -0f - 25428. What is the thousands digit of f? 0 Suppose 26b - 12775 = 131948 + 86625. What is the tens digit of b? 9 Let h = -1267 - -1825. Let m be h - 8/(-10)(-10)/(-4). Suppose z + 4z = m. What is the units digit of z? 2 Suppose 49a + 9a + 8a - 1974324 = 0. What is the thousands digit of a? 9 Suppose -6h - 2582 = -11h - 3q, -2h + 4q + 1012 = 0. Let b = -271 + h. What is the hundreds digit of b? 2 Let o = -144 + 23. Let f = 32 - o. Suppose z + 64 - f = 0. What is the units digit of z? 9 Let m be (-21)/(-49) - (398/14 + -1). Let y = m + 40. What is the tens digit of y? 1 Let a be (66/165)/(4/(-7690)). Let s = a - -1415. What is the units digit of s? 6 What is the ten thousands digit of 388984/(-44)(-12 + (-26)/(-4))? 4 Let v be (-2)/510/8-4. Suppose -9l + 16 = -v. Suppose 2s + 3t = 3s - 159, ls = -4t + 308. What is the tens digit of s? 5 Let r(b) = b*3 + 13b*2 + 12b + 39. Suppose 2y + 36 = -4f + 6y, 0 = 5f - 4y + 48. What is the units digit of r(f)? 9 Let z = 19371 - 2031. What is the ten thousands digit of z? 1 Suppose 5n + 25 = -3r, -4n - 4r - 38 + 10 = 0. Let y be (2 - 1) + (-6 - 0). What is the tens digit of (y/n - 2)28? 1 Let y = -42 + -5. Let m be (8/4)/(-2)y. Suppose f - m = 9. What is the units digit of f? 6 Let s = 7546 + -4991. Suppose 220d = 215d + s. What is the units digit of d? 1 Suppose 5t - 7t = -6. Let i(k) = -4k*t + 6k + 2k2 - 1 - 6k - k3. What is the units digit of i(-2)? 7 Let m = 106264 - 72096. What is the thousands digit of m? 4 Let r(o) = o3 - 14o2 - 17o + 36. Let j be r(15). Let x = j - -232. What is the units digit of x? 8 Suppose 2p + 2841 - 15259 = -2r, 4p = 3r + 24843. What is the tens digit of p? 1 What is the hundreds digit of 27843/4 + (-11)/(-44)? 9 Suppose 107802 = 5l - 3n, 126l - 127l + n + 21558 = 0. What is the hundreds digit of l? 5 What is the units digit of 132(-12)/5417-15? 0 Suppose 1060y = 4v + 1058y - 289406, 217050 = 3v - y. What is the ten thousands digit of v? 7 Let z(r) = 6r*2 + 2. Let c be z(-1). What is the tens digit of 3246/c + (-72)/96? 0 Let v = -172489 - -254751. What is the tens digit of v? 6 Let s be ((-76)/(-12) + -6)/(3/11403). Let u = -1 - 9. What is the hundreds digit of 0 + (s/5 - (-4)/u)? 2 Let t(n) = -7n + 1. Let l = -71 + 67. What is the units digit of t(l)? 9 Let v(p) = 95p3 - 13p*2 + 48p - 170. What is the thousands digit of v(7)? 2 Suppose 188q - 201q = -2509. Suppose -189r + qr = 6232. What is the hundreds digit of r? 5 Let t(i) = 6i2. Let u be t(-1). Let d(n) = -3n + u + 4n + 14. What is the units digit of d(-18)? 2 Let z(x) = -x3 + 37x*2 - 39x + 108. Let m be z(36). Suppose m = 3*l - 2167 - 362. What	{ "pile_set_name": "DM Mathematics" }
= -0u. Suppose -6 = -uv - 0. Solve -c - vc = 9 for c. -3 Let x(c) = -c2 - 7c + 2. Let f be x(-7). Suppose -h + 9 = -2d, 3h - fd - 12 = h. Solve -6 = hi - i for i. -3 Suppose 2h - 14 = -6. Solve -3a - 2 = -ha for a. 2 Let z = 37 + -34. Solve -1 = -zq - 7 for q. -2 Let l be (3 + 0)36/27. Solve 2c + 2c = -l for c. -1 Suppose -5c - 2d - 5 = -7d, 0 = 4d - 4. Suppose c = -5x + 26 - 6. Suppose b = 2, 2 = 2i - b - 0. Solve xm = im for m. 0 Let k = 38 - 27. Solve 1 - k = -5r for r. 2 Let n = 6 + -4. Suppose 4d - 14 = -0f + nf, -d - 10 = -5f. Solve -4v = -1 - f for v. 1 Let l be (16/(-6))/(4/(-6)). Suppose -lh + 0o - 3o + 49 = 0, -5o = -2h + 5. Solve 5i + 0i + h = 0 for i. -2 Let h = -122 - -124. Suppose 6 = 2b + b. Solve hu = b + 2 for u. 2 Let k(i) = i3 - i2 - 2i + 3. Let s be k(2). Solve 2 = -2l + sl for l. 2 Let i be (1 - (-28)/12)36/10. Solve 2p + 2p - i = 0 for p. 3 Let d(u) = -u*2 + 10u - 6. Let x be d(9). Solve i - 5 = -x for i. 2 Let v(l) = -l*3 + 5l*2 - l - 8. Let o be v(4). Solve oq + 5 + 11 = 0 for q. -4 Suppose -2k = -6 - 8. Suppose 3 - 16 = -3p + c, -3p - 5c + k = 0. Suppose 0n + 16 = pn - 4q, 2q - 1 = -n. Solve 0 = 5b - nb for b. 0 Suppose -4 = -2j, -4j = -u + 5u - 20. Solve 5 + 4 = -ui for i. -3 Let j(n) be the second derivative of -n5/20 + n4/3 + 3n2/2 + 3n. Let d be j(4). Let z = -11 + 19. Solve zi + 5 = di for i. -1 Suppose 7m = -7m + 28. Solve 1 = -mr - 1 for r. -1 Let w(b) = -b + 1. Let r(a) be the second derivative of a4/6 + a3/2 - a2/2 + 2a. Let n(o) = r(o) + 2w(o). Let j be n(-2). Solve -18 = 5l + j for l. -5 Let o be 2/(-4)-2 - 1. Solve -p - p - 10 = o for p. -5 Suppose 4j - 53 = 51. Suppose 0o - 4o + 5n + 4 = 0, j = 3o + 2n. Let w(b) = -b2 + 5b + 6. Let a be w(o). Solve aq + q = -1 for q. -1 Let w be (-32)/(-24)(-6)/(-4). Solve 0 = -ws + 4s - 2 for s. 1 Let l(k) = k - 4. Let s be (9/(-6) + 2)6. Let g be l(s). Let j = -1 - g. Solve j = 3t - 0t for t. 0 Let l = 1 - 1. Suppose -4h + 7 = 4d - 33, l = -3d + 3h + 42. Suppose -4r = -2r - d. Solve -5t - 4 - r = 0 for t. -2 Suppose 0p = p - 6p. Solve 5r + 0r + 25 = p for r. -5 Suppose 0 = 4a - 5y + 1 + 2, 5y - 6 = 3a. Solve au + 2u = 25 for u. 5 Let i = 87 - 87. Solve in - 3n = -3 for n. 1 Let h be (3 - 2) + (-2 - -2). Let z = 3 - h. Solve -5 + z = -y for y. 3 Let j(z) = 2z3 - z2 - z - 2. Let k(y) = 8y*3 - 5y*2 - 5y - 9. Let t(w) = -9j(w) + 2k(w). Let u be t(-1). Solve -um + 0m - 2 = 0 for m. -1 Let k(z) = z*3 - 4z*2 + z + 5. Let w be k(4). Solve -w + 3 = 2r for r. -3 Let k be ((-14)/(-6))/((-6)/(-18)). Suppose 4s - k = 1. Solve -s = h - 0h for h. -2 Let x(i) = i*3 + 10i*2 - 12i - 7. Let y be x(-11). Suppose -10 = -yd - d. Solve d + 18 = -5k for k. -4 Let a(y) be the first derivative of y*2/2 + 14y - 1. Let x be a(-9). Solve -8 - 7 = -xg for g. 3 Let y(o) = -o2 + 8o + 3. Let z be y(8). Solve -z = -r + 2 for r. 5 Suppose -3j - 2l - 5 + 1 = 0, -3j = 3l + 9. Solve -4p = j + 6 for p. -2 Let d = 23 + -8. Suppose 5l = -4a + a + 37, l = 5a - d. Suppose 0 = lp - 2c - 2 - 16, 5c = -p + 9. Solve 2 + p = 3k for k. 2 Suppose 4b - 13 = -3q, 7q - 12q = 25. Solve 2n = bn + 15 for n. -3 Let w(k) = -3k - 6. Let i be w(-6). Let d be (-8)/i(-6)/4. Solve -6 + d = f for f. -5 Let k(b) = 3b2 + 10b + 1. Let s(z) = 8z2 + 29z + 4. Let y(x) = 11k(x) - 4s(x). Let i be y(7). Let f be i/(3/61). Solve fg - 2g = -10 for g. -5 Let q(o) = o2 + 2o + 1. Let l be q(-4). Let m = -7 + l. Solve ms - 5 = -1 for s. 2 Let k be 52/((-16)/(-4)) - -1. Suppose 2m - k + 3 = -p, 2p - 2m = -2. Let t(y) = -y*3 - 3y*2 + 2y - 5. Let s be t(-4). Solve -sd + 3 + p = 0 for d. 2 Let v be 3/3 + -2 - -1. Let k = -4 - -10. Suppose -3 = -3d + k. Solve 3 = df - vf for f. 1 Suppose 0h = 2h - 6, 2h = 4i - 2. Suppose 2p + 56 = 5d, -3d - ip + 14 = -d. Solve -5c - d = -3c for c. -5 Let l be (24/(-14))/(4/(-14)). Solve -c = -lc - 10 for c. -2 Let d(g) = 3g - 5g2 - 3g*2 - 11 + 0g3 + g3 + 7. Let a be d(8). Solve 0 = 3q + q + a for q. -5 Suppose -3l - 4b = -29, -6l = -10l + 5b - 13. Let x be (-2 + 2)/(-2) + 2. Solve xj = lj + 1 for j. -1 Let c = 107 - 70. Suppose 4j = -5 + c. Suppose 3v = 3z - 12, v - 13 = -4z + 18. Solve -5i - j - z = 0 for i. -3 Suppose 3n + 8 = 7n. Let m(z) = -10z*2 - 16z - 5. Let j(u) = 2u2 + 3u + 1. Let c(v) = nm(v) + 11j(v). Let f be c(-3). Solve -p - f = -5p for p. 4 Suppose 2s = -3s + 90. Let g(i) = 27i*2 - i - 1. Let z be g(-1). Let o = z - 21. Solve -o = -3x - s for x. -4 Let n(a) be the second derivative of 0 - 5/3a3 + a - 2a*2 - 1/12a*4. Let h be n(-9). Solve 3f + h = 2f for f. -5 Suppose 0 = -4k - 3b + 108 - 45, 5k = 5b + 70. Solve 0 = -4h - h + k for h. 3 Suppose 0 = -4d - x + 17, 0d - 4x - 27 = -3d. Let r = -3 + d. Let u be (22/8)/(r/8). Solve 0 = -3p - u - 4 for p. -5 Let h = 47 + -43. Solve hc - 5 = 3 for c. 2 Let q(v) = -v*3 - 8v*2 - 8v - 3. Let a be q(-7). Suppose -2n = 5m - 15, 12 - 3 = 3m - n. Solve 3 = az - mz for z. 3 Let g = 60 + -4. Let m be 3/(-9) - g/(-6). Solve 5o + m = -16 for o. -5 Suppose -5i = -2i - 3, 2g + 5i = 29. Let k = -8 + g. Let r be (0 - -4)1/2. Solve -u = r - k for u. 2 Let c(p) = -p3 - 3p*2 + 4p + 2. Let o be c(-4). Solve -os + 1 + 1 = 0 for s. 1 Let u be (-28)/22/(-4). Suppose s - 2 + 1 = -r, s - 5r = u. Solve 5g - s = 3g for g. 1 Let d(i) = i3 + 6i*2 + 3. Let x be d(-6). Suppose 2v - t = 9, xv + 2 - 3 = -t. Let m be (0 + 2 + -2)/(-4). Solve mc - 2 = -vc for c. 1 Suppose 31 = 4w - 9. Solve -2 - w = -3s for s. 4 Let c be 1(-2 - (-4 + 0)). Solve 0 = -cd + 6d for d. 0 Suppose -4c = 5w - 2c - 6, 8 = -w - 5c. Suppose 2r - 3 = 7. Solve -g + w = r for g. -3 Let y = 0 + 3. Suppose -y = -a + 2. Let p = 147 - 143. Solve -ag = -pg + 2 for g. -2 Let k be 2/(-4)(0 - 0). Suppose 2q - 3s - 4 = -k, -8 = -4q - 4s. Solve -qd = -0d + 10 for d. -5 Suppose -k - 42 + 45 = 0. Solve k = -0h + h for h. 3 Let v(x) = x2 + 7x. Let u be v(-5). Let c be ((-3)/(-2))/((-5)/u). Solve -6 = f - cf for f. 3 Suppose 0 = -l - 5 + 18. Suppose -li + 16i = 0. Solve 4d = 4 - i for d. 1 Let w(k) be the first derivative of -k*4/4 + 7k*3/3 - 3k*2 + 7k - 1. Let h be w(6). Let n = 9 - h. Solve 2x = 2 + n for x. 2 Suppose -1 = 4s - 5q - 2, -6 = -2q. Suppose 0 + 4 = v. Suppose 0 = vw - 0w - 24. Solve -n = -sn + w for n. 2 Let l(o) = o3 - 7o*2 + 7o - 6. Let h be l(6). Suppose r - 12 = -hr. Let u(y) = -y2 + 6y - 3. Let q be u(5). Solve 2f = -qf + r for f. 3 Suppose -5j = g - 7, -5g - j + 6 = -5j. Suppose 1 = gt - t. Solve 5i = t + 4 for i. 1 Suppose 3i + 6 = 5i. Solve 4k = 3k + i for k. 3 Let r be (4/24)/((-2)/6)-4. Solve -r = x - 1 for x. -1 Suppose -2g - 1 + 13 = 0. Suppose 2n - 12 = -4l, -5n - l - 15 = -gl. Let d = 0 - -3. Solve -d + n = -x for x. 3 Let c be (39/(-9) - -3)(-3)/2. Solve -cq = q for q. 0 Let h = -8 - -12. Solve d = -hd - 15 for d. -3 Let j(s) be the third derivative of s4/24 + s3/2 - 2s2. Let i be j(0). Suppose 0 = -0t + it. Solve t = -0b + 3b - 12 for b. 4 Let x = 16 + -10. Suppose 3g = 5g - x. Solve -3o = 12 + g for o. -5 Suppose -2 + 10 = 2v. Let l = -2 + v. Solve -n + l = -3 for n. 5 Let o = 8 - 4. Suppose -6z + 30 = -2z + 2s, -z + 3 = 2s. Let m = z - o. Solve -m = x - 0 for x. -5 Let j be 2 - (-1 + 2(-2)/(-4)). Solve jp + 2 = p for p. -2 Suppose 0 = 5h - 4p - 17, -4h + 23 = 2p - 1. Solve -5g - h = -0g for g. -1 Let l be 8/(-12) - 11/(-3). Solve -lm + m = -8 for m. 4 Let n be 18/(-27) + 2/3. Solve n = -4s + 13 + 7 for s. 5 Let n = 7 - 5. Let p be ((-9)/6 + 2)n. Suppose -5d - 3b + 12 = 0, -4d = -b + 5 - p. Solve d = 3z - 11 - 4 for z. 5 Suppose 14 + 31 = -5a + 4i, 0 = -2i. Let n be (2/(-6))/(a/54). Solve 1 = 3q - n for q. 1 Suppose -j + 3g - 21 = 0, -2j + 33 = -4j + 3g. Let t be 0 + (j/2)/(-2). Let z be (1/(-2))/(1/(-4)). Solve 5i = t + z for i. 1 Let i be 1 + 3/1 + 2. Solve -8 = -2f + if for f. -2 Let s = 14 + -12. Solve -b = -0 + s for b. -2 Let t be (4 - (-5 + 6)) + (-3)/3. Solve 8 = ta - 2 for a.	{ "pile_set_name": "DM Mathematics" }
b of picking 1 d and 1 h when two letters picked without replacement from {r: 2, w: 4, h: 1, d: 6}? 1/13 Three letters picked without replacement from {v: 8, h: 11, n: 1}. Give prob of picking 3 v. 14/285 What is prob of picking 2 r, 1 m, and 1 z when four letters picked without replacement from {r: 3, i: 3, z: 9, k: 2, m: 1}? 3/340 Calculate prob of picking 1 y and 1 o when two letters picked without replacement from kwkjyojwokwywc. 4/91 What is prob of picking 3 h and 1 m when four letters picked without replacement from hvvhmzzvhz? 1/210 What is prob of picking 1 w, 2 v, and 1 q when four letters picked without replacement from vqqqwqsqsswv? 2/99 What is prob of picking 2 w and 1 f when three letters picked without replacement from ffffwdwof? 5/84 Two letters picked without replacement from {e: 3, a: 1, l: 2, q: 4, u: 2}. What is prob of picking 2 u? 1/66 Four letters picked without replacement from ixsvxsmixxvxvvxixr. What is prob of picking 2 i, 1 v, and 1 m? 1/255 Calculate prob of picking 1 i, 1 m, and 1 s when three letters picked without replacement from {k: 3, i: 1, s: 2, m: 1}. 2/35 Calculate prob of picking 1 y and 1 m when two letters picked without replacement from {r: 1, y: 1, m: 13}. 13/105 What is prob of picking 2 h when two letters picked without replacement from {j: 2, h: 11}? 55/78 What is prob of picking 1 v and 1 n when two letters picked without replacement from {v: 2, n: 3}? 3/5 Calculate prob of picking 1 o, 2 j, and 1 i when four letters picked without replacement from fojffojjoojijfqfo. 5/238 Two letters picked without replacement from {h: 4, c: 6}. Give prob of picking 1 h and 1 c. 8/15 Three letters picked without replacement from {y: 1, c: 1, w: 2, s: 4, p: 3}. Give prob of picking 1 c, 1 s, and 1 y. 4/165 Two letters picked without replacement from {c: 4, g: 1, r: 4, w: 1}. What is prob of picking 2 g? 0 Two letters picked without replacement from {k: 6, u: 12}. What is prob of picking 2 k? 5/51 Two letters picked without replacement from {e: 7, r: 5}. What is prob of picking 2 e? 7/22 Two letters picked without replacement from {o: 1, d: 1, i: 1, n: 2, y: 1, z: 1}. Give prob of picking 1 d and 1 o. 1/21 What is prob of picking 1 o and 1 y when two letters picked without replacement from zohyhzhhyovzyhbhozz? 1/19 Three letters picked without replacement from dhuhubhhnybhddhbudu. Give prob of picking 1 y and 2 d. 2/323 What is prob of picking 1 a and 1 x when two letters picked without replacement from avvvvaavvvaaadvxvav? 7/171 What is prob of picking 1 v, 1 t, and 1 s when three letters picked without replacement from {s: 12, t: 7, v: 1}? 7/95 Calculate prob of picking 1 e and 2 r when three letters picked without replacement from {e: 1, r: 2, q: 6, g: 1, z: 2}. 1/220 Calculate prob of picking 2 y when two letters picked without replacement from yyyyy. 1 Four letters picked without replacement from wwwtotewhet. What is prob of picking 1 e, 2 t, and 1 h? 1/55 What is prob of picking 1 p and 1 m when two letters picked without replacement from nopppoiomnmsn? 1/13 Three letters picked without replacement from cjcjjjjcjc. What is prob of picking 3 c? 1/30 Four letters picked without replacement from {w: 7, n: 3, h: 6, v: 1}. Give prob of picking 3 h and 1 v. 1/119 Calculate prob of picking 1 d and 1 k when two letters picked without replacement from {d: 6, k: 5, n: 3, s: 1}. 2/7 Two letters picked without replacement from {g: 3, f: 2, k: 1, o: 2, m: 1, t: 3}. Give prob of picking 1 o and 1 g. 1/11 What is prob of picking 1 v, 1 u, 1 z, and 1 y when four letters picked without replacement from vhgggvzyhuyv? 2/165 Two letters picked without replacement from {j: 1, q: 2, e: 1, r: 5, x: 3}. Give prob of picking 1 x and 1 e. 1/22 Four letters picked without replacement from {u: 2, z: 2, l: 5}. What is prob of picking 3 l and 1 u? 10/63 What is prob of picking 1 y and 1 d when two letters picked without replacement from dyym? 1/3 What is prob of picking 3 s when three letters picked without replacement from {a: 2, s: 14, e: 1}? 91/170 What is prob of picking 2 g, 1 c, and 1 b when four letters picked without replacement from ggaabcr? 1/35 Two letters picked without replacement from {w: 6, e: 4, o: 2, i: 1, p: 4}. What is prob of picking 2 e? 3/68 Four letters picked without replacement from rlrlclccprlclccrlrl. What is prob of picking 1 p, 1 c, and 2 l? 21/646 Four letters picked without replacement from llhlllhllll. Give prob of picking 4 l. 21/55 What is prob of picking 3 o when three letters picked without replacement from {o: 8, n: 3}? 56/165 Four letters picked without replacement from ggqgqgqqygygqqqyqg. Give prob of picking 1 y and 3 g. 7/204 What is prob of picking 2 p and 2 o when four letters picked without replacement from qmqqqqqpopomqmqoq? 3/2380 Two letters picked without replacement from {g: 1, h: 6, s: 7, q: 1}. Give prob of picking 1 s and 1 q. 1/15 What is prob of picking 2 k and 1 p when three letters picked without replacement from {k: 2, p: 9, h: 8}? 3/323 Three letters picked without replacement from pwpp. What is prob of picking 3 p? 1/4 What is prob of picking 2 n, 1 j, and 1 f when four letters picked without replacement from {w: 1, f: 4, n: 2, j: 1}? 2/35 Calculate prob of picking 2 l and 1 t when three letters picked without replacement from {d: 6, t: 1, l: 7, g: 3}. 21/680 What is prob of picking 1 d and 1 k when two letters picked without replacement from fxkvkvvxvkfxdkvx? 1/30 Two letters picked without replacement from {m: 2, d: 8}. Give prob of picking 2 m. 1/45 Two letters picked without replacement from {r: 3, z: 3, b: 6, k: 3, e: 1}. Give prob of picking 1 e and 1 k. 1/40 What is prob of picking 1 u and 2 x when three letters picked without replacement from ggcucxuxxguhggrrgucx? 2/95 Four letters picked without replacement from mekkejjf. Give prob of picking 1 e, 2 k, and 1 f. 1/35 Calculate prob of picking 1 q, 1 t, and 2 g when four letters picked without replacement from {l: 2, t: 6, q: 2, g: 3, f: 5}. 1/85 Four letters picked without replacement from {w: 1, x: 9, b: 4}. Give prob of picking 3 b and 1 w. 4/1001 Three letters picked without replacement from tkkyttyt. Give prob of picking 2 k and 1 t. 1/14 Two letters picked without replacement from rqkkrakkgsaa. What is prob of picking 1 g and 1 s? 1/66 Three letters picked without replacement from kkkkkkvkkv. Give prob of picking 2 v and 1 k. 1/15 Two letters picked without replacement from xebeebbaxb. Give prob of picking 1 a and 1 x. 2/45 Two letters picked without replacement from ififf. Give prob of picking 2 f. 3/10 Calculate prob of picking 1 o and 1 n when two letters picked without replacement from {y: 1, o: 1, x: 1, n: 1, j: 13, f: 1}. 1/153 What is prob of picking 2 r and 1 c when three letters picked without replacement from rrvvrrcvrrervrr? 36/455 Three letters picked without replacement from ahajjhhjheah. Give prob of picking 1 a and 2 j. 9/220 What is prob of picking 1 g and 3 a when four letters picked without replacement from {a: 5, g: 2}? 4/7 Three letters picked without replacement from okkfokrkkffkkfkr. Give prob of picking 2 f and 1 r. 3/140 Two letters picked without replacement from {q: 3, b: 1, c: 6, z: 1, v: 3}. Give prob of picking 2 q. 3/91 Calculate prob of picking 1 m and 1 r when two letters picked without replacement from rmr. 2/3 Two letters picked without replacement from qkkqq. What is prob of picking 2 k? 1/10 What is prob of picking 1 s, 1 v, and 1 e when three letters picked without replacement from {w: 1, v: 2, y: 1, e: 3, s: 4}? 8/55 What is prob of picking 1 u and 1 t when two letters picked without replacement from zztzhtu? 2/21 Four letters picked without replacement from quuceuquceceu. What is prob of picking 1 c, 1 q, and 2 e? 18/715 Four letters picked without replacement from {x: 3, m: 7, q: 1, e: 2, s: 1}. What is prob of picking 2 x, 1 s, and 1 m? 3/143 What is prob of picking 2 u when two letters picked without replacement from mumubbxbbbxmmyub? 1/40 Two letters picked without replacement from {t: 2, p: 8}. Give prob of picking 1 t and 1 p. 16/45 What is prob of picking 3 d and 1 x when four letters picked without replacement from xxxd? 0 Four letters picked without replacement fro	{ "pile_set_name": "DM Mathematics" }
Which is the nearest to 1? (a) -70 (b) -5 (c) -0.2 c What is the nearest to -3 in -2/3, -7, -3, 0.1? -3 Which is the closest to -1/3? (a) -2 (b) 268 (c) -3 (d) -0.2 d Which is the closest to -0.1? (a) 4 (b) -3/7 (c) -1/3 c Which is the closest to -1/4? (a) -4 (b) 4/13 (c) 0.3 (d) -4/9 d What is the nearest to -2 in 0, 5, -26, 4/7? 0 Which is the nearest to 862? (a) 0 (b) -5 (c) 2/3 c Which is the nearest to -0.1? (a) -4 (b) -2/11 (c) 4 b What is the closest to 21 in 5, -4/9, 4, -1? 5 What is the closest to 24 in -3, -0.1, -2/3, 4/7? 4/7 Which is the closest to -1? (a) -1 (b) 0.5 (c) 38 a What is the nearest to -1/6 in -0.5, -4, -7? -0.5 Which is the closest to -1/4? (a) 2 (b) -0.1 (c) 0.5 (d) 2/11 b What is the nearest to 7 in 5, 0.5, -15, -5? 5 Which is the closest to -2/5? (a) 0.4 (b) -8 (c) -5 (d) -3 a What is the closest to 3 in 2/5, 0.2, -5, -3? 2/5 What is the nearest to 3.8 in -5, -1, 2? 2 Which is the closest to -5? (a) -3 (b) -1/9 (c) 5 (d) 19.4 a What is the nearest to 2 in -5, 0.2, -0.3, 2.5? 2.5 Which is the closest to -0.2? (a) -0.3 (b) -8 (c) 5 (d) 3 a What is the nearest to -7/3 in 5, 0.2, -3, 2? -3 What is the nearest to -2/59 in 0.2, -4, 3/7, -1? 0.2 Which is the closest to 1? (a) -0.18 (b) -0.4 (c) 24/13 c What is the nearest to -1/4 in 71, -5, 4, -4? -4 Which is the closest to 0.1? (a) -0.5 (b) 5 (c) 72 a Which is the closest to -8? (a) -4 (b) -0.4 (c) 3/4 a What is the nearest to -1 in 2/3, 0.0443, 0.2? 0.0443 What is the nearest to -2 in 1/12, 1/2, 1/5, -0.3? -0.3 What is the closest to -1.3 in 0, -1/4, -4/5, -1/3? -4/5 Which is the nearest to -7? (a) -5 (b) 4 (c) -0.08 a What is the nearest to 2/3 in 3, -1882, -2, 1/5? 1/5 What is the closest to 1/6 in 0.2, 24, -2? 0.2 What is the closest to -0.3 in 1.5, -4, 1, 2/3? 2/3 Which is the nearest to 8/11? (a) 4 (b) 1 (c) -2 b What is the closest to 30 in -2, -0.1, 5, -4? 5 What is the nearest to 1/3 in 99/14, -5/3, 1/8? 1/8 What is the nearest to -2/5 in -0.8, -2/9, -0.2, 5? -2/9 Which is the closest to -2/5? (a) -0.2 (b) -1/4 (c) -4 b Which is the nearest to 1? (a) 2 (b) 5/3 (c) -2/9 (d) 0.3 b Which is the closest to 0.04? (a) 14 (b) -2 (c) 0.1 c What is the nearest to -2 in -5, -1/6, 2/15, 1/31? -1/6 What is the nearest to 1/3 in 1/4, 4, 3, 5? 1/4 What is the nearest to 2 in 0, 15/7, 2, 2/27? 2 Which is the closest to 0.2? (a) -0.2 (b) 0 (c) -4 (d) 0.5 b Which is the nearest to -0.1? (a) 15 (b) -0.5 (c) -0.3 c What is the nearest to -1 in -0.5, -1, 42? -1 What is the nearest to -4/3 in -0.5, 5, -4? -0.5 What is the nearest to -12 in 7, -2, 5? -2 What is the nearest to 0.3 in 1, -351, 2/5? 2/5 Which is the nearest to 1.5? (a) 1 (b) -5 (c) 0.4 a Which is the nearest to 1/4? (a) 4 (b) 3/2 (c) 0.5 (d) 2/7 d Which is the nearest to 0? (a) 10 (b) -0.05 (c) 0.9 b What is the nearest to -39 in -5, -1, 2/7, -3? -5 What is the nearest to -3 in 0.02, 3/5, -0.02, 5? -0.02 Which is the closest to -5/4? (a) -14 (b) 0.1 (c) -1 (d) 0.3 c What is the closest to 16.7 in 3/2, 5, 1? 5 Which is the closest to 1? (a) 5 (b) 0.3 (c) 15 b Which is the nearest to 0.14? (a) 2/5 (b) -10 (c) -15 (d) 0.3 d Which is the nearest to -1? (a) -1 (b) 2 (c) -3/7 (d) -5 a What is the closest to 338 in -1/6, -2, 0.5? 0.5 What is the closest to -14 in 3, -0.4, 1, 1/4? -0.4 Which is the nearest to 0.2? (a) -0.08 (b) -7 (c) -0.2 (d) 2/29 d What is the nearest to -0.1 in 2, -0.09, 1/2, 17? -0.09 Which is the closest to -1/2? (a) -1/71 (b) -7 (c) -0.06 c What is the closest to -1 in -7, -0.2, -1/3, -3? -1/3 What is the nearest to 1 in 2/13, -3, -1/2, -5? 2/13 Which is the closest to 1? (a) 0.2 (b) -1/6 (c) -3 (d) -20/3 a Which is the nearest to -0.1? (a) 143 (b) -2 (c) -3 b What is the nearest to -16 in -2/5, -5/9, 4? -5/9 What is the closest to 5 in 0.3, -0.034, -4? 0.3 Which is the nearest to -2? (a) 6 (b) 0.05 (c) 3/5 (d) -0.2 d What is the nearest to -1 in 0.5, -1/4, -17, -18? -1/4 What is the closest to 0.2 in -0.161, -4, 0.1? 0.1 What is the nearest to 1/4 in -1/2, 1/7, 0.3, -2479? 0.3 What is the nearest to -1.3 in 0.08, 0.18, 3? 0.08 Which is the closest to 0? (a) -2 (b) 3 (c) 0.03 (d) 5 c What is the closest to 1 in 0.1, -280, -2? 0.1 Which is the closest to -13? (a) -0.1 (b) -5 (c) -2/21 (d) 1 b Which is the closest to 0.28? (a) 13/4 (b) -0.4 (c) -2/7 c What is the closest to -1 in 64, -0.4, 0.2? -0.4 Which is the nearest to -0.03? (a) 0.1 (b) 0.5 (c) 2 a What is the closest to 1 in 1/59, 0.5, 2/3, 5? 2/3 What is the closest to -0.82 in -1/7, 3, -0.5, 0.1? -0.5 What is the closest to -2 in 3, -4/3, 4? -4/3 What is the nearest to 423 in -1, -2, 1? 1 Which is the nearest to -1/4? (a) 10 (b) 1/7 (c) 81 b What is the closest to 0 in -2/19, 492, 3? -2/19 Which is the nearest to 0.1? (a) 1/5 (b) 0.05 (c) 2 (d) -0.2 b What is the nearest to 0.1 in -126, 0.5, 3? 0.5 What is the closest to -1 in 0.3, -76, -4? 0.3 What is the closest to -1 in -5, 220, 1, -2/9? -2/9 What is the nearest to -3 in -4/7, -2, 3/4? -2 Which is the closest to 0? (a) -85 (b) -0.5 (c) 3/2 (d) -5 b What is the closest to 1 in 255, -0.03, 0.2? 0.2 What is the nearest to 413 in -2/3, 3/2, 4, 3? 4 Which is the nearest to -1? (a) 0.4 (b) 1034 (c) -0.5 c What is the nearest to 0.2 in -3/4, -1.3, -1.4, 3? -3/4 What is the nearest to -1 in 0.3, -2/11, 5? -2/11 What is the closest to 0.2 in -6, -66, -9? -6 What is the nearest to -13/2 in 5, 0.9, 4? 0.9 What is the nearest to 9 in -2/13, -3, 0.5, 7/9? 7/9 What is the nearest to 0.2 in 4, 29, 5? 4 What is the nearest to -1.7 in -2/71, 2/9, -5? -2/71 What is the closest to -2/57 in 1/4, 5, 0.1? 0.1 What is the nearest to -5 in -2/13, -5/8, -2, -3? -3 Which is the nearest to -2/3? (a) -3 (b) -7 (c) -0.07 c Which is the closest to -1? (a) 1/5 (b) -0.1 (c) 2 b What is the closest to -87 in 1/5, -3/5, -2, -0.2? -2 Which is the nearest to 0.07? (a) -4/5 (b) 1 (c) 2/11 c Which is the closest to -1? (a) 1/4 (b) 5/2 (c) -0.09 c Which is the closest to -2/5? (a) -1 (b) -30 (c) 3 (d) 4 a Which is the closest to 0.1? (a) 7/6 (b) 3 (c) 0.7 c What is the closest to -2/3 in 2/13, 0.5, -0.7, 5? -0.7 Which is the nearest to 93? (a) -0.05 (b) -3 (c) 2 (d) -0.2 c Which is the nearest to 0? (a) -0.5 (b) 2/49 (c) -2/5 b What is the closest to -0.1 in -2, -9, 0.2? 0.2 What is the nearest to 2.8 in 3/2, -1, 0.4? 3/2 What is the closest to 15 in 0.5, -0.1, 2, 2/13? 2 Which is the nearest to 6? (a) -0.4 (b) -0.5 (c) 5 (d) 2/3 c What is the nearest to 0.4 in 1, 1/2, -2, 2? 1/2 What is the nearest to -1 in 1, -9.2, -2/3, 0.4? -2/3 Which is the closest to 0.2? (a) 3 (b) -4 (c) 1 (d) 0.16 d What is the closest to 9 in -2/5, 4, -0.5, 11? 11 What is the closest to 7 in -1/5, 1/4, 2/31, -19? 1/4 Which is the closest to 0? (a) -1/6 (b) -59 (c) 4 a What is the nearest to 2 in 2/5, -2/45, -2? 2/5 Which is the closest to -3? (a) 22 (b) 0.4 (c) 2/25 c Which is the nearest to 0.2? (a) -10/27 (b) 10 (c) 0.5 c What is the closest to 0 in -3/7, -4, 1/3, 1? 1/3 Which is the nearest to -0.4? (a) -2 (b) -1/7 (c) 0 (d) 58 b What is the nearest to -4 in -1, 1/3, 0, 4/3? -1 Which is the closest to -1? (a) -5 (b) -0.081 (c) -4 b What is the closest to -11/2 in -5, 3/5, 0.08? -5 Which is the closest to 0.1? (a) 1/2 (b) -9.5 (c) -6/5 (d) 0.01 d What is the closest to 0 in -0.01, -2, -12, 0.1? -0.01 Which is the nearest to -1/2? (a) -0.3 (b) 5 (c) -13/6 a What is the nearest to -2/17 in -3.1, 2, -5? 2 Which is the closest to -0.1? (a) 1 (b) 1/11 (c) -0.16 c Which is the closest to 0.2? (a) -4 (b) -9 (c) 1 c What is the closest to -120 in 0.5, 2, -1/3? -1/3 What is the closest to -4/3 in -3, -9, 0.4? -3 Which is the closest to -0.0121? (a) 2/5 (b) -1 (c) 2/7 (d) 4 c What is the closest to 1 in 0.3, -0.02, -3/2? 0.3 What is the closest to 2 in -0.16, -1, -0.5, 2? 2 Which is the closest to 0.1? (a) -4 (b) -0.4 (c) -9 (d) 1 b What is the nearest to 2/9 in -3, 1/4, -2? 1/4 What is the closest to 2 in -0.1, 6, 0.1? 0.1 Which is the nearest to -2? (a) 0.2 (b) 4 (c) -0.4 (d) 9/5 c Which is the closest to 0? (a) 0.33 (b) -0.07 (c) 2 (d) 4 b W	{ "pile_set_name": "DM Mathematics" }
, -w - 4o = -0w + 11 for w. -3 Suppose 0 = -2d - 3j - 621, -2d - 260 = -3j + 379. Let i be d/(-20) + 3/12. Solve 5n - 15 = g, n - i = -3n for g. 5 Let g = 148 + -145. Solve -5p - gk - 6 = 0, 5p - 3k - 1 = -25 for p. -3 Let r = 81 - 89. Let d(a) be the second derivative of -a*4/12 - 7a*3/6 + 5a*2 - a. Let x be d(r). Solve -xj - 2b = 6, -b = -2j + b + 10 for j. 1 Suppose 4g = -f + 42, -85 = -5f + 5g - 0g. Let y = f + -9. Suppose -75 + y = -2o. Solve -5m + 2n + o = 0, 0m + 4m = 4n + 32 for m. 5 Let q be 4/(-9 + (21 - 11)). Solve -m + qk - 9 = 0, 0 = -3m - m + 4k for m. 3 Suppose -20 = 2c - 6c, -q + 12 = c. Let b be q/(-5)50/(-2). Solve -b = -4m + 3o, 3m = -2o + 6 - 1 for m. 5 Let o(j) be the first derivative of -j*2/2 + 9j - 10. Let h be o(7). Let l be 35/28(h - -2). Solve -4b + lq = -12, -q - 2 = -0b - b for b. -2 Suppose 16v - 27v = -44. Solve 8 = -4w + vx, 2w - 4x = -3w - 10 for w. -2 Let y(s) = 40s + 322. Let a be y(-8). Solve r - 14 = 4b, 4b - ar = -3r - 18 for b. -4 Suppose 0 = 2l - 5n + 8, 3l - 2n - 23 = -13. Solve -f = 2z + f, -4z - f = l for z. -2 Let q(g) = g*2 - g + 206. Let z be q(0). Let m = z + -76. Let j be 370/m - (-2)/13. Solve 2n + 3 = -ja + 7, -4a - 5n + 17 = 0 for a. -2 Suppose -3p - 8 = x - 79, -3p = 2x - 73. Suppose 5i - p = -o - 3, 32 = 4o + 4i. Suppose 25 = od + 5. Solve 0 = -3j - dn - 5, 3 = 4n - n for j. -3 Suppose 9 = 5v - 6. Suppose 2p = -vp + 10. Solve 5r = 5a - 5, -2a + 0a - pr = -18 for a. 5 Let r be (1/2)/(((-30)/(-24))/5). Solve rb + 4 - 1 = -3m, 0 = -b + m - 4 for b. -3 Let u = -2013 - -2015. Solve -ua + 8 = -6a + 3m, 3m = 2a + 10 for a. 1 Suppose 0 = 3j - 1 - 38. Let k(z) = -z3 + 14z*2 - 13z + 8. Let n be k(j). Let x be (6/4)/((-4)/(-8)). Solve 0i + 4i = -xu + 17, -i + 3u + n = 0 for i. 5 Suppose -398k - 36 = -410k. Solve kw + 2 = r - 6, -r = -4w - 9 for r. 5 Let r = 1 + 1. Let s(a) = 7a2 - 16a + 10. Let m be s(2). Solve 4o - rp = 0, -mp + 3p = 2o + 16 for o. -2 Let q be (-11)/((-132)/(-90))-20. Suppose 0 = -112r + 118r - q. Solve -h - 3 - 22 = 5t, -2h - r = 5t for h. 0 Let i(o) = -2o - 7. Let n be i(-3). Let z = 1 - n. Suppose 3t - 12 = 3m - 0t, 0 = m + zt - 8. Solve -q - 7 = -3x, 2x - q - 2 - 1 = m for x. 4 Let a(k) = -k + 4. Let s(l) = 2l2 + l + 1. Let u be s(-1). Suppose -x - 8 - u = 0. Let d be a(x). Solve -j - 3c + 0 = 3, d = 2j - 4c for j. 3 Let z be 5 + (-2)/3(-9 + 126/12). Let x = 41 - 25. Let q(f) = 6f - 1. Let s be q(3). Solve 2g = -g + zu - s, -2u = -4g - x for g. -3 Let j(h) = 2h + 14. Let a be j(-6). Suppose 2u - 12 = -au. Solve 3f = u, g + 3f = -2 + 4 for g. -1 Suppose -3n = -5k - 34, -32 - 34 = -5n - k. Let j = -11 + n. Solve 5y + 40 = -5b, jy + 8 = -5b - 17 for b. -3 Let w = 159 + -159. Solve -4u = 2t - u, -t - 5u = w for t. 0 Let g(v) = 6v - 42. Let i be g(11). Suppose -2x = 4o - i, 2o + o - 4 = 2x. Solve n - 2y + 1 = -3y, -n = xy - 2 for n. -2 Let c = 0 + 3. Let b be (1 - 0)/((-2)/(-34)). Suppose -r + 3q + b = 0, 3r + 2r = 2q + 33. Solve rv - cd = 5, 3v = 4v - 4d - 18 for v. -2 Suppose -y - 4y = -80. Suppose 0 = -s + 2 - 0. Suppose 4j = -sp + 26, j + 7 = 5p - 3. Solve 2i - p = -1, -i + y = 5f for f. 3 Suppose -20 = -4q + 4y - 12, -4q + 5y = -7. Solve -z + 2 = -qs + 4, 6 = -3z + s for z. -2 Let u = -281 + 287. Solve 2w - w + 5d + 2 = 0, -3w + u = 3d for w. 3 Let w(s) = s + 9. Let j be w(4). Suppose ji - 16i = -36. Solve n - i = -4d, -3d - 4n - 6 = -15 for d. 3 Suppose -15z - 6 = -17z. Let r = 1 - -1. Solve -3l + 5q = rl - 50, -zl - 5q = 10 for l. 5 Let t be 74/14 - (-2)/(-7). Suppose 0 = -7o + 9o + 3d - 15, 0 = o - 4d + 20. Solve o = l - r - 6, tl + 2r - 3r = 18 for l. 3 Suppose -o = 3b - 41, -6o + 3o = -b - 3. Suppose 2f + 4 = b. Solve -3s + 27 = 4m, -fm + 10 + 22 = 4s for s. 5 Let z be (-1 + 2)/2 - 29/(-2). Suppose 4u + z = -1, -3b + 4u = -22. Solve -3a - a = i - 6, -4 = bi for a. 2 Suppose -4v + 8 = u - 6v, -5v - 10 = 0. Let s(r) = -10r*2 - 4 - 8r - 4r3 + 17 + 3r*3. Let d be s(-9). Solve -ui + 0 = 4z - 20, -dz + i = -5 for z. 2 Suppose 0 = -6m + 3 + 9. Suppose -4 - 2 = -mi. Solve -p = 5u + 30, iu - 5p = -2p for u. -5 Let m be 5((-108)/20 + 1). Let y = -19 - m. Let l = -22 + 36. Solve z - yp = 2p - l, 5p + 2 = -3z for z. -4 Let m be 13/(-2) + 27/18. Suppose 2k = -0k + 18. Let b = k + m. Solve -5 = -n - bx + 3x, x - 4 = 0 for n. 1 Let m = -2270 - -2274. Let x(y) = y2 + 5y - 3. Let s = -15 - -9. Let b be x(s). Solve -mh - 5z + 12 = -2z, bz + 9 = 3h for h. 3 Suppose 0 = 3b - 5y + 8y - 18, 5b + 4y = 27. Solve 4r - 28 = 4p, 0 = -br + 5p + 35 - 4 for r. 2 Let z = 22 + -12. Suppose 0 = -r + z + 4. Let s be (-5)/15 - r/(-6). Solve sa + 4 = 2x, -a + 8 = -0x + 4x for x. 2 Let s = -1251 + 1255. Solve -4b - w + 11 = 0, 3w = -sb - 0w + 9 for b. 3 Let j be ((-8)/10)/(1/(-18 + 3)). Suppose 3b = -6 + j. Solve -p = 3f + 11, 0 = -4f - bp - 2p - 12 for f. -4 Let s = -5 + -11. Let k be (41 - s/(-4)) + -3. Let m = -34 + k. Solve 3d - 2r - 10 = m, 0r - 6 = -4d - r for d. 2 Suppose v = 3v + 30. Let y be (-143)/(-7) - v/(-35). Solve 0 = 5a - 5j + y, -3j = -0a + a - 4 for a. -2 Suppose 5z - 5 = f + f, -3f = 0. Let o(d) = 2d2 + 3d - 1. Let k be o(z). Solve 0 = -h - 3h + kx + 8, 4x = -16 for h. -2 Suppose -5d + 7h - 2h = 175, 0 = d + 2h + 50. Let j = d + 44. Solve -2 = -3t + 4m - 2m, 5t - 4m - j = 0 for t. 0 Let g be 6 + -3 + -2 - (-2 + 2). Let o be 31/2 - (-2)/(g - 5). Solve -4d + 5 = 3s, 0 = 2s + d - 2d + o for s. -5 Let p(n) = 2n2 - 3n - 2. Let x be p(-1). Suppose xq + 2m = -0m - 4, 5q - 3m = 25. Solve 5i = qv + 8, 0i + 4i = -2v + 10 for v. 1 Let q(h) = -2 + 5h2 - 2h*3 - 5h + 4h3 + 0. Let d be q(-3). Solve 0 = -3r + 4y + 6, -5r = dy - 10 for r. 2 Suppose 3t - 2g = 3, t + 3g - 18 = -2g. Solve 0 = 4m - 2c - tc - 6, -c = m - 6 for m. 4 Suppose -t - 5z = -41, -2z + 3 = -4t + 57. Suppose -2a = -5d + 12, -2a + a = -5d + t. Solve f + 1 = -as - 16, -5f = 4s + 21 for s. -4 Let m be ((-24)/(-8))/(-2 + 3). Suppose -m - 5 = -j. Suppose -j - 2 = -5v. Solve q - 3 = -2z, -5z - 1 = -q + v for q. 3 Let p(f) = -15f + 95. Let j be p(6). Solve -1 = -l + 5h, -jl + 3h + 11 - 28 = 0 for l. -4 Let y(p) = -p2 - 7p - 3. Let z be y(-5). Let x(m) = -m + 15. Let a be x(z). Solve -3j + 28 = -h + a, 4h - 4j = -40 for h. -5 Let s = 16 - 10. Solve -s = -t - 2y, -4y + 10 = -3t + 4t for t. 2 Let p(s) = s3 - 2s*2 - 12s + 18. Let j be p(4). Solve -6 = 2o - 2v, 3o - v + 3 = j for o. 1 Suppose j - 2j + 2 = 0. Let d = 3 + -3. Suppose 2g + 2 - 12 = d. Solve jb + 5 = 3a - 7, 0 = -ga + 10 for b. -3 Suppose 0 = -11i - 30i + 533. Solve z + 3 - 10 = -w, w = -4z + i for w. 5 Suppose 0 = -v + 3v - 4, -4l + 64 = -4v. Suppose 6 = 8g - l. Solve 14 = 4z + gd - 0d, -3z - 4 = -5d for z. 2 Let w(i) = -65i - 255. Let d be w(-4). Solve -g = 4k + 2 + 9, 3g - 1 = dk for k. -2 Let u = -110 - -113. Solve -3i = ur, r = -0r + i + 4 for r. 2 Suppose -d = i + 14 - 20, 0 = 3i + 4d - 21. Solve t = 5k + 10 + 3, -ik - t = 3 for k. -2 Let u(q) = -6q - 22. Let o be u(-4). Let c = -4 - -8. Suppose -3r + 34 = 5i, -6r - ci = -4r - 26. Solve -3x - 5 - 2 = -od, 22 = -2x - rd for x. -5 Suppose -32w - 6 = -35w. Solve -wk + p - 4 = 0, -4k + 17 - 41 = 2p for k. -4 Suppose 0 = 4z - 18 - 18. Suppose z = -4a - 5g + 31, -a + g = -10. Solve a - 1 = -3y + 4k, -12 = 2y + k for y. -5 Let n(s) = s*3 + 8s*2 - 13s - 16. Let t be n(-9). Suppose -q + 11q - t = 0. Solve 4m + 16 = 4h, qh = 4m + 17 + 1 for m. -5 Let a(c) = -c2 - 16c - 15. Let o be a(-15). Solve 9f - 4f + r - 7 = o, 5f - 4r - 22 = 0 for f. 2 Suppose -55 = -4c + 3i, 0 = c - 3i + 5i. Solve v - 2f - 14 = 0, 5v + f - 5 = c for v. 4 Let a = -20 - -34. Let i(w) = -5w2 - 3w - 2w3 + 4w*3 + 6w + 3 - 1. Let m be i(2). Solve -5r + a - m = 3b, r - 2 = b for b. 0 Let z(d) = d + 8. Let w be z(-5). Suppose -3q - wh = -2q - 3, -9 = -3q + 2h. Let y = 7 + -4. Solve -ys + 5 = 4n, -n - 1 = -qs +	{ "pile_set_name": "DM Mathematics" }
21 Calculate the remainder when 197643430 is divided by 5662. 5658 Calculate the remainder when 3290864 is divided by 25116. 668 What is the remainder when 11777735 is divided by 467? 462 What is the remainder when 11271723 is divided by 536747? 36 What is the remainder when 93874 is divided by 3363? 3073 What is the remainder when 11723396 is divided by 4065? 4001 What is the remainder when 1697169 is divided by 84848? 209 Calculate the remainder when 46311 is divided by 2009. 104 What is the remainder when 1211564 is divided by 2628? 56 What is the remainder when 107928 is divided by 7864? 5696 What is the remainder when 181018 is divided by 556? 318 Calculate the remainder when 62992430 is divided by 21. 11 What is the remainder when 6152801 is divided by 372? 293 What is the remainder when 2766752 is divided by 1046? 82 Calculate the remainder when 1355729 is divided by 5315. 404 What is the remainder when 154277 is divided by 839? 740 Calculate the remainder when 135210891 is divided by 2081. 2078 What is the remainder when 4243242 is divided by 9471? 234 What is the remainder when 4862490 is divided by 99? 6 What is the remainder when 2454173 is divided by 39? 20 Calculate the remainder when 5268680 is divided by 585407. 17 Calculate the remainder when 1804865 is divided by 1192. 177 Calculate the remainder when 6824086 is divided by 26. 22 Calculate the remainder when 3914307 is divided by 87. 3 Calculate the remainder when 81280 is divided by 244. 28 What is the remainder when 732233 is divided by 48812? 53 What is the remainder when 1453264 is divided by 19? 11 What is the remainder when 110016338 is divided by 14? 12 What is the remainder when 53028094 is divided by 795? 4 Calculate the remainder when 5195504 is divided by 21. 20 What is the remainder when 61184 is divided by 4674? 422 Calculate the remainder when 79613 is divided by 86. 63 Calculate the remainder when 810233 is divided by 80. 73 Calculate the remainder when 16667092 is divided by 311. 291 What is the remainder when 94688259 is divided by 653? 647 What is the remainder when 33494 is divided by 72? 14 Calculate the remainder when 798935 is divided by 1607. 256 Calculate the remainder when 14338907 is divided by 14. 9 Calculate the remainder when 757420 is divided by 151. 4 Calculate the remainder when 512697481 is divided by 68. 57 What is the remainder when 13519275 is divided by 1602? 1599 What is the remainder when 676626 is divided by 373? 4 Calculate the remainder when 257474 is divided by 651. 329 Calculate the remainder when 271390 is divided by 5719. 2597 Calculate the remainder when 113961 is divided by 11883. 7014 What is the remainder when 59773 is divided by 3133? 246 What is the remainder when 45575 is divided by 18635? 8305 What is the remainder when 2595898 is divided by 648580? 1578 What is the remainder when 130622 is divided by 388? 254 What is the remainder when 68111944 is divided by 485? 484 Calculate the remainder when 1224384 is divided by 250. 134 Calculate the remainder when 9298482 is divided by 2205. 2202 Calculate the remainder when 2489819 is divided by 64. 27 Calculate the remainder when 66272 is divided by 710. 242 What is the remainder when 1377925 is divided by 70? 45 What is the remainder when 175274 is divided by 1359? 1322 What is the remainder when 138413 is divided by 8138? 67 What is the remainder when 123654 is divided by 336? 6 What is the remainder when 137774 is divided by 6560? 14 Calculate the remainder when 38774 is divided by 988. 242 Calculate the remainder when 27469019 is divided by 10. 9 What is the remainder when 33489 is divided by 15735? 2019 Calculate the remainder when 6743053 is divided by 1165. 33 What is the remainder when 12369983 is divided by 121274? 35 What is the remainder when 1456388 is divided by 151? 144 Calculate the remainder when 192856 is divided by 1914. 1456 What is the remainder when 2184945 is divided by 546225? 45 Calculate the remainder when 1503667 is divided by 221. 204 What is the remainder when 10987212 is divided by 10987210? 2 What is the remainder when 174758 is divided by 43667? 90 What is the remainder when 6286 is divided by 976? 430 What is the remainder when 21470882 is divided by 264? 26 What is the remainder when 581498 is divided by 193829? 11 What is the remainder when 63283324 is divided by 8? 4 Calculate the remainder when 1173365 is divided by 46. 43 What is the remainder when 7412727 is divided by 1058952? 63 What is the remainder when 2892249 is divided by 6558? 171 Calculate the remainder when 131371994 is divided by 281. 279 Calculate the remainder when 57774 is divided by 2078. 1668 What is the remainder when 2594369 is divided by 29150? 19 Calculate the remainder when 5344665 is divided by 3959. 15 Calculate the remainder when 42424834 is divided by 295. 294 What is the remainder when 1781529 is divided by 19? 13 Calculate the remainder when 2599430 is divided by 14939. 44 Calculate the remainder when 1439097 is divided by 7. 2 Calculate the remainder when 1272565 is divided by 74. 61 What is the remainder when 1718078 is divided by 280? 278 What is the remainder when 4527069 is divided by 26? 1 Calculate the remainder when 27282000 is divided by 43. 5 Calculate the remainder when 2310248 is divided by 160. 8 Calculate the remainder when 152389 is divided by 16889. 388 What is the remainder when 578424 is divided by 1013? 1 Calculate the remainder when 53595433 is divided by 8932570. 13 Calculate the remainder when 139299148 is divided by 30. 28 What is the remainder when 261502 is divided by 21781? 130 What is the remainder when 410291 is divided by 164? 127 Calculate the remainder when 387375 is divided by 6477. 5232 What is the remainder when 19175001 is divided by 16250? 1 Calculate the remainder when 626622 is divided by 625929. 693 Calculate the remainder when 96071 is divided by 11957. 415 What is the remainder when 5828201 is divided by 2913975? 251 What is the remainder when 75425737 is divided by 393? 391 What is the remainder when 605186915 is divided by 19? 17 What is the remainder when 1594859 is divided by 18? 5 Calculate the remainder when 7378556 is divided by 6159. 74 Calculate the remainder when 639253 is divided by 13864. 1509 What is the remainder when 19348285 is divided by 49? 47 Calculate the remainder when 3090583 is divided by 50. 33 Calculate the remainder when 909594 is divided by 909577. 17 Calculate the remainder when 42361370 is divided by 53. 7 What is the remainder when 3464086 is divided by 6846? 10 What is the remainder when 489427 is divided by 48929? 137 Calculate the remainder when 806985 is divided by 1564. 1525 What is the remainder when 154568 is divided by 2723? 2080 What is the remainder when 3126576 is divided by 6407? 6367 What is the remainder when 157706475 is divided by 776? 771 Calculate the remainder when 16174 is divided by 5244. 442 What is the remainder when 139459 is divided by 2209? 292 What is the remainder when 622158 is divided by 206984? 1206 What is the remainder when 297985711 is divided by 1484? 1479 What is the remainder when 2772685 is divided by 752? 61 What is the remainder when 1212425472 is divided by 25? 22 Calculate the remainder when 54618523 is divided by 355. 353 What is the remainder when 626979 is divided by 737? 529 What is the remainder when 259792 is divided by 14423? 178 What is the remainder when 131845 is divided by 3877? 27 What is the remainder when 4091765 is divided by 93? 44 Calculate the remainder when 97122 is divided by 8090. 42 Calculate the remainder when 69180927 is divided by 16. 15 Calculate the remainder when 10994722 is divided by 191. 189 Calculate the remainder when 15037435 is divided by 1024. 1019 Calculate the remainder when 503544 is divided by 13361. 9187 Calculate the remainder when 9928481 is divided by 807. 767 What is the remainder when 19128112 is divided by 27? 16 What is the remainder when 16158410 is divided by 702539? 13 Calculate the remainder when 1742525 is divided by 553. 22 What is the remainder when 18589469 is divided by 9294731? 7 Calculate the remainder when 2721 is divided by 204. 69 Calculate the remainder when 740587 is divided by 9595. 1772	{ "pile_set_name": "DM Mathematics" }
3.89. Let a = 21 - g. Let y = -97/7 + 14. What is the closest to -0.1 in y, 0.3, a? y Let s = 0.2 + -5.2. Let p = 3 + s. Let v be (-1 + 6)(-1)/3. Which is the closest to 0? (a) 0.4 (b) v (c) p a Suppose 0q + 9 = 3q. Let y = -101 - -102. What is the closest to 1/3 in q, 5, y? y Let j = 40 - 40. What is the nearest to 0.1 in j, -0.1, 4? j Let p = 0.1 - 0.1. Let c = 82/11 + -80/11. Let a be 2/5 + (-26)/90. What is the nearest to p in a, 2, c? a Let p = 22.5 - 23. Which is the nearest to 0.3? (a) p (b) -5 (c) 1 c Let r = 0.2 + -0.2. Let p = -34 - -34.1. What is the closest to p in 2, -0.1, r? r Let l = 56 + -57. What is the closest to l in -1, 0.3, 0? -1 Let a = 14 + -13. Let d = -0.36 - -0.06. What is the nearest to a in d, 2/15, 0.4? 0.4 Let x = 1.4 + -1.3. Which is the closest to x? (a) -1 (b) 3 (c) 1/3 c Let j = -1 + 7. Let x(o) = -o + 4. Let s be x(j). Let r = 25/3 - 8. What is the closest to -0.1 in s, 1, r? r Let v = 6 - 8. Let l be 2 + (-9 - 4/v). Which is the nearest to 2? (a) 2 (b) -1 (c) l a Let s = 7 - 5. Let x = -4.01 - -0.01. Let z = 4.5 + x. Which is the nearest to s? (a) -0.4 (b) -3 (c) z c Let o be -1((-4)/1 - -2). Suppose -12 = -oi - i. Let u = i - 7. Which is the nearest to 0.2? (a) 0.3 (b) u (c) -0.4 a Let q = 3.91 - -0.09. Let s = -4.4 - 0.6. Let g = q + s. Which is the nearest to 1? (a) -5 (b) -3 (c) g c Let r = -0.01 - -1.01. Suppose 0 = l + 11 - 6. What is the nearest to -1 in 5, r, l? r Let t = -107 - -106. Let z = -2 + 0. What is the closest to 2 in 0.1, t, z? 0.1 Let j = -0.1 - 0.1. Let u = 4/5 - 1/5. What is the nearest to -1 in -1/2, j, u? -1/2 Let v = -20 - -11. Let s be 5/v - 2/(-6). What is the closest to -4 in -1, s, 1? -1 Let h = 11 + -12. Which is the closest to 0? (a) -4 (b) -3/4 (c) h b Let o = -107 + 753/7. What is the nearest to 1 in -5, o, 0.4? o Let b = 143/3 + -47. What is the nearest to -1 in -3, b, -1/6? -1/6 Let z = -6 - -7. Suppose 5g + 4 = -1. What is the closest to 0.1 in 3/2, g, z? z Let v = 0 - 0.1. Let c(d) = -d*2 - d + 4. Let h be c(-2). What is the closest to 2/7 in 0.2, h, v? 0.2 Let d = -2/89 + 451/267. What is the closest to -0.2 in -2, d, -5? -2 Let u be -4 + ((-90)/(-14) - 2). What is the closest to 0 in -1/2, u, 0? 0 Let l = -0.18 + 4.18. What is the closest to -2/7 in l, 5, -0.1? -0.1 Let f = 2.27 + -0.27. Let h = 1.2 + -1. Let n = -3 - -4. Which is the nearest to h? (a) n (b) f (c) -4 a Suppose 5g + 4x = 21, x - 2 = -2g + 7. Let o be (-12)/(-9)2/(-8). What is the nearest to o in -0.5, g, 0? -0.5 Let c be (-3362)/56 - (-6)/21. Let b = 60 + c. Let g be (-2)/72 + 1/4. What is the nearest to b in -3, 0.2, g? g Suppose 0 + 7 = 7i. Let n = -2.5 + 0.5. Which is the closest to n? (a) i (b) -4 (c) -2/9 c Let s = -1.2 - -1. Let t = 383 - 388. Which is the nearest to -3? (a) t (b) s (c) 0.2 a Let u = -6.9 - -6.87. Which is the closest to 1? (a) -2/3 (b) u (c) -2/5 b Let v = -266 - -5056/19. Which is the nearest to -1? (a) v (b) 1 (c) 4/5 a Let l = 1.1 + -0.1. Let r = 7 + -12. Let z = -112 + 782/7. What is the closest to z in 2/5, l, r? 2/5 Let p be (((-1)/(-1))/3)/(-1). Let q = 19/6 - 23/6. Let x = 2.5 - 2. What is the nearest to q in p, x, 3? p Suppose 3j = -5d - 27, 0 = 2j - d - 0d + 5. Which is the nearest to 0? (a) -3/8 (b) j (c) -3/5 a Let q = 907/9 + -101. Which is the nearest to 0? (a) q (b) 5 (c) 3 a Let p = -2 - -2.03. Let r = 0.97 + p. Let d = -5 + r. What is the closest to 1 in d, -0.3, 0.5? 0.5 Let o = 0.1 + -0.02. Let w = o + -0.02. Let s = 0.04 + w. What is the nearest to s in -4, 2/7, -3? 2/7 Let j be ((-8)/340)/((-2)/50). Let r = -33/85 + j. Let w be (2 + -4)/((-2)/1). What is the nearest to 0 in w, r, -4/5? r Suppose -2 = -t - 4x, -4t - 2x - 5 = x. What is the nearest to 1/2 in 2, t, 1? 1 Let i(w) = w2 + 6w - 8. Let d be i(-7). Let o be (-1)/(d/(-1)-5). What is the nearest to -1 in o, 0.3, -2/5? -2/5 Let v be 1/75 - 1. Let j be (998/(-21))/(4/(-6)). Let y = -71 + j. What is the closest to -1/2 in v, y, 0.2? v Suppose 0 = 9o - 14o - 5. What is the nearest to -1 in o, -2/7, -3? o Let g be 4/(-6)-1 - (4 - 2). Let k be 4/(-3)1 + 2. Which is the nearest to k? (a) -2/5 (b) g (c) 0 c Let f = -0.16 - -0.26. What is the closest to f in 3, -0.1, 5? -0.1 Let f = -80 - -238/3. Which is the closest to f? (a) 0.4 (b) 3/2 (c) -5 a Suppose -5z = -25, 5z - 31 = 2i - 12. Suppose -8f = -if. What is the closest to 1 in 1/2, 0.2, f? 1/2 Let c = 0.6 + -0.3. Let d(j) be the third derivative of j6/120 + j5/12 + j4/6 + j3/6 - 3j*2. Let t be d(-4). What is the closest to t in c, -3, -0.5? c Let z(s) = -3s*2 - 18s + 3. Let v be z(-7). Which is the closest to v? (a) 0 (b) -1 (c) 4 b Suppose -17 = -6o - 47. Which is the closest to -2? (a) o (b) 0 (c) 6 b Let r = 38 + -67. Let f = r + 29. Which is the closest to f? (a) 0.4 (b) 2/3 (c) 2 a Suppose a - 4 + 5 = 0. Let g = 289/10 - 29. What is the nearest to a in 1, g, -4/5? -4/5 Let q = 3 + 8. Let u = q + -8. Let g = -29/9 + 3. Which is the nearest to -0.1? (a) -4 (b) u (c) g c Let t = -80 + 80. Let j be ((-6)/(-32))/((-3)/(-2)). What is the nearest to t in 0, j, -1/6? 0 Let t = 0.41 - 0.01. Which is the nearest to -0.03? (a) t (b) 5 (c) -0.2 c Let d be (-2)/(20/9) - -1. Let t = -4.04 + 0.04. Let f be (-14)/(-8) - (5 + -3). What is the closest to 2 in d, f, t? d Let i(l) = l3 + 8l*2 - 11l - 22. Let p be i(-9). Which is the closest to 0.6? (a) p (b) 0.3 (c) -4/9 b Let h be (5 + -1)2/6. Which is the closest to 2/5? (a) h (b) -6 (c) -1 a Let s = -85.06 + 85. What is the closest to -2 in s, -5, -3? -3 Let x be 3 + -34/12. Which is the closest to x? (a) -5 (b) 4 (c) -0.2 b Suppose 0 = -6p + 4p. Let y = 0.1 + 0. Which is the nearest to p? (a) -0.5 (b) 0.4 (c) y c Let g = -1 - -6. Let p = 0.14 - 0.01. Let k = 0.13 - p. Which is the nearest to k? (a) -1/2 (b) g (c) -4 a Let a = 1.8 + -1.7. Let i = 0.4 - a. What is the nearest to 0 in 0, i, -5? 0 Let i = 1.52 - 1.32. Which is the nearest to i? (a) -2 (b) 6 (c) -0.5 c Let p be 1 + (-1 - 1/(-2)). Let q = -8 - -7.4. Let g = q - -0.6. Which is the nearest to g? (a) -5 (b) 0.2 (c) p b Let s be (-5)/(-15) - (-116)/(-330). Let q = 62/385 + s. What is the closest to -1 in 1/2, q, 0? 0 Let v = -7 - -9. Which is the nearest to -0.4? (a) 1/2 (b) v (c) -3 a Let k = 1.5 - -0.5. Which is the nearest to -1/3? (a) 2/7 (b) -0.3 (c) k b Let i = 11.1 - 11. Let h = i - -1.9. What is the nearest to 0.1 in 0.5, 1, h? 0.5 Let n = 25.4 + -25. What is the closest to 0 in -0.5, n, -0.2? -0.2 Suppose 2y = 7 - 1. Let c = -2.4 - -0.4. Let o = c - -1. What is the closest to 2/9 in y, o, -1/3? -1/3 Let z = -10 - -5. Let n be (-2)/(-3)z/(-10). Let v be ((-3)/((-33)/(-2)))/(-1). Which is the closest to 0? (a) v (b) n (c) -3 a Let x = 179 + -175. Which is the closest to 1? (a) x (b) 2/5 (c) -0.1 b Suppose -17 = 4o - 2s + 11, 0 = -3o + 4s - 31. What is the closest to -1 in -2/7, -1, o? -1 Suppose 37 = 5g - 3. Which is the nearest to 2/3? (a) -5 (b) 4/3 (c) g b Let q = -39 - -18. Let x be (-13)/q + (-6)/18. What is the nearest to 1 in 5, 0.1, x? x Let v be 3/5 - 4/4. Suppose -3t + 6 = 5f, 4t = 6t - f - 4. Suppose -4 = 2n + t. Which is the closest to v? (a) 2 (b) -2/17 (c) n b Let r = 4 - 3. Let m = 1 + r. Let z be (3/(-3)m)/5. Which is the closest to z? (a) -1 (b) 3 (c) -0.5 c Let i = 179 + -1429/8. What is the nearest to -0.3 in i, -1/5, -1/3? -1/3 Let j = -29 + 29. Let n = -8 + 6. Let a = n + -1. What is the nearest to j in a, -1/5, -4? -1/5 Let h(s) = s3 - 3s*2 + 3s - 1. Let z be h(2). Let y be 2 - (253 - (0 + 0)). Let v = y + 2261/9. Which is the nearest to 1? (a) 2/3 (b) z (c) v b Let s = 3.1 + -15.1. Which is the closest to 0? (a) -1 (b) 2 (c) s a Let g = 2/3 + -4/3. Let a = 0.1 + 0. What is the nearest to a in 3, 0.4, g? 0.4 Let s = -3 + 3.2. Let f = -337 + 357.1. Let d = -20 + f. What is the closest to s in d, 0, -0.1? d Let m = -9 - -8. Let g = -77/40 + 9/8. Which is the closest to m? (a) 0.4 (b) g (c) 2/7 b Let o be -2*(2 + (-3)/2). Let r = 6 + -7. Let f be (-120)/65 - (-1 + r). What is the nearest to 1 in o, 0.2, f? 0.2 Let w = -4.6 + 4. Let o = 0.1 + w.	{ "pile_set_name": "DM Mathematics" }
(2 + (-27 - -10 - -3))) + -25. -12 What is the value of (61 + -81 - -101) + -16? 65 Calculate -1 + (7 - 0) + -40 + 1 + 6. -27 What is 11 - (-71 + -61 + 134 + (-2 - -2 - 12))? 21 What is the value of 29 - -2 - (14 - ((21 - -1) + (-377 - -368)))? 30 Evaluate -3 + 6 - (-12 + 32 - 0 - -13). -30 Calculate (235 - 263 - (0 - -30)) + 1 + -15. -72 What is the value of -29 + 49 + -21 + 6 + (0 - 5 - 50)? -50 What is the value of 9 - (35 + -11 - 51)? 36 What is 10 + 1 - (-8 + 55 + -74 + 16)? 22 What is 1 - 5 - 6 - (6 - (-25 + 43)) - 11? -9 Calculate -6 + -53 - (-3 + (-9 - -3) + -33 + 53). -70 Calculate -73 - (-100 - (111 - 51)). 87 Calculate -87 - -72 - ((-9 - (2 + -4)) + (-102 - 5)). 99 Evaluate 185 + -86 + 46 - 80. 65 Evaluate 8 - (-55 + -17 - -44). 36 Calculate (14 + -4 - 0) + (-141 - -104). -27 Evaluate -26 - (23 + -7 - 2). -40 Calculate -3 + (-6 - 2) + 14 + -3 - 6. -6 Calculate (54 - -1) + -22 + -18 + (-3 - 1). 11 Calculate 23 + (-1 - -10) + 8 + -9 + (7 - 11). 27 Calculate -8 + (-2 - ((-21 - -2) + -38 + 43)). 4 Calculate 2 - (-1 + (12 - 10) + -1 + -6 + 6). 2 -22 - (71 - 43) - 8 -58 Evaluate -51 - (-6 + 9 + -6 + -3 + 18 + -10). -53 What is 8917 - 8968 - (1 + -94)? 42 7 + 3 + 58 - (-5 + 12 - 12) 73 Calculate 13 + (-23 - (2 - (23 - 4))) + -22. -15 What is the value of 0 + 4 + (33 - (35 + -18)) + (-20 - -2)? 2 Calculate -1 + 9 + (-37 - -9 - 0). -20 What is -8 + -1 + ((5 - 16) + 98 - -12)? 90 What is (-48 - -75) + -145 + 4 + 31? -83 What is the value of (23 - 31) + (-3 - (17 + -13))? -15 What is the value of -31 + 11 + -51 + 47? -24 What is -2 - (-96 + 3 + 204 + -191 + (8 - -1))? 69 What is the value of 32 - (-34 + (45 - 11) + -51)? 83 Evaluate (-23 - -104) + -21 - (18 + 11 + -13). 44 Evaluate 42 + -24 - (22 - 0) - 24. -28 What is the value of -8 + (-16 - (-8 - 36)) + 11 + -1 + -2? 28 Calculate 17 - (66 - (48 - -35)). 34 Evaluate -42 + 67 + -62 + 89 + 33. 85 Calculate -2 + (-5 - (-9 - (1 + -12))) + (-3 - 32). -44 What is (-44 - -18) + 20 - (7 - 13 - -31)? -31 What is the value of 48 + 65 + -124 - 39? -50 What is the value of 7 + 7 + -14 + (-98 - -48)? -50 What is (418 - 385) + (3 - (14 + -2)) - 16 - -70? 78 What is 0 + 24 + (-39 + -11 - -69)? 43 (-264 - -346) + 9 + -9 + 5 + (0 - 17) 70 25 + (-27 - (-8 + 4)) 2 Calculate (-9 - (-30 + 9)) + -31 - -30 - (1 - 76). 86 Evaluate -53 + -27 + 55 + -17. -42 Calculate -1 - (-20 - ((9 - 6) + -24 - -13)). 11 Evaluate -31 + (30 + 5 - (-82 - -84)). 2 -11 - (-28 + (8 - -52)) -43 What is the value of (0 - 2) + (-180 - -144) - 3? -41 What is the value of -39 + 95 - (-3 + -8 + 15) - (-13 - -1)? 64 What is (78 + 56 - 27) + -6 + -5 + 8 + -3? 101 What is the value of -101 + 136 - 132 - -37? -60 Calculate -1 - -50 - 0 - (-4 - -24). 29 What is the value of -174 + 193 + -21 + -11? -13 -8 - (0 - -2) - (-1 + 4) - -10 -3 What is the value of -7 + 164 + -42 + -62? 53 What is -42 - (-86 - -31) - (1 + 20)? -8 What is the value of -50 + (273 - 271) - (2 - 1)? -49 Calculate -1 - 9 - ((13 - -55) + -85). 7 Calculate -70 - (-84 - (38 - 93)). -41 -48 - (24 + -99 + 70) -43 Evaluate 24 - ((-7 + 7 - 17) + 10). 31 (-19 + (56 - 1) - (24 - 39)) + -4 47 80 - (28 - -62 - 53) 43 Evaluate 10 + (-31 - (9 - (-11 + (24 - -8)))) + 24. 15 What is the value of 0 + 79 - (583 - 538)? 34 Evaluate 22 - (0 + 14) - (4 + 3) - (51 - 2). -48 What is the value of (-20 - -10) + 80 + -129? -59 What is the value of (0 - -30) + (16 - (-28 + 29) - (11 - -2))? 32 Evaluate (-6 + 34 - 124) + 14 + 39. -43 Calculate 40 - (81 - (-27 + 81)). 13 Evaluate -48 - -126 - (12 - -149). -83 Calculate -58 + 46 + 3 + 13. 4 Calculate 350 + -320 + (-67 - 1). -38 -110 - 50 - -80 - -32 -48 109 - (12 - (2 - 54)) 45 What is -71 - ((-18 - (1 - 32)) + -25)? -59 What is the value of -17 - -7 - (-21 + 20) - (1 - 71)? 61 Evaluate -36 - (-4 + 13 + (1 - (5 - 6))). -47 Calculate 38 - (-2 - (-21 - -15 - -9)). 43 Evaluate -15 - -18 - -15 - (25 - -28). -35 What is (24 - -2) + (-179 + 154 - (-23 + 2))? 22 What is -68 + (424 - 126) + -120? 110 What is the value of 32 + (-43 - 32) + (5 - -1) + 18? -19 Evaluate -6 - (29 + -91) - (-7 + 10). 53 -36 - (-64 - -11) - (-3 + (-1 - 59)) 80 Evaluate (25 - 27) + -2 + -9 + 56 + -5. 38 -20 + 3 + 5 + -3 + (78 - 73) + 11 1 (36 + -24 + 1 - 2) + -20 -9 Calculate 2 - -10 - (18 + 17 + -21). -2 Evaluate -2 - (-2 + -74) - ((56 - -26) + -35 + -31). 58 Calculate -10 + -19 + 14 + 53 + -11. 27 -20 + 2 - (115 + -102) -31 Evaluate (16 - 88) + 107 - (22 + 0). 13 What is the value of -149 - -114 - (-1 - 68)? 34 Evaluate -70 - (8 - (13 - (16 + 16 + -26))). -71 470 + -499 + 21 + 0 + 38 30 Calculate 12 - (-5 - (-82 - -22) - 23). -20 Evaluate -2 + (12 - (52 + 59 + (-1 - -1))). -101 Calculate -28 + 96 + (-75 - -52). 45 Calculate 1 + -1 + 0 - (0 - 2) - (41886 - 41828). -56 What is 1 + -30 - (72 + -158 - -47)? 10 Evaluate 153 - (77 - -3) - -17. 90 Calculate -3 + (-7 - -80 - 12) - 2 - 11. 45 What is the value of -16551 + 16468 - (-1 - (3 + 9 + -2))? -72 What is -6 - (33 - 38 - 20)? 19 -2 + -2 + -9 + 259 + -269 -23 What is (-94 - 83 - -135) + (19 - 0)? -23 What is -124 - (-125 - (-169 + 90))? -78 Evaluate 12 + -1 - (156 - (62 + 8 + -45)). -120 What is -8 + (-6 + 16 + -1 - (56 + -57)) - 31? -29 Calculate 181 - 149 - (30 - 9). 11 Evaluate 1594 + -1651 - (-3 + -5 - -3). -52 What is 49 - (139 - 126 - (5 - 0))? 41 Calculate 3 - 1 - (-11 + (7 - (12 + -2)) - -36). -20 (-3 - (-8 + -5)) + 4 - (-16 + 15) 15 Calculate 59 + -19 + 43 - (14 + -2) - -12 - 8. 75 What is the value of (4 - -4 - -85) + 6 + -34 + 14 + 9? 88 (40 - 75) + 90 + -39 16 -14 + 9 + -9 - (10 - 65) 41 Evaluate 35 + (1 + -17 - (-28 + (15 - 7))). 39 ((2 - -7) + -2 - (-282 - -286)) + -5 + 24 22 What is 27 - (39 - (7 + -13 + 14))? -4 Evaluate 18 - 27 - -19 - (2 + 106). -98 What is the value of 73 + (55 - 94) + -76? -42 Evaluate -12 - -14 - (-1 + 2 + -5). 6 Evaluate -54 - ((6 - 94) + 3). 31 What is the value of 16 - (91 - -38 - -36)? -149 Calculate (37 + (-6 - 22) - (-40 + -2)) + -12. 39 What is the value of -3 - 22 - (1879 + -1846)? -58 120 - ((18 - 46) + 33 + 17) 98 Calculate (1 - (-2 - (4 + 2)) - (7 + -3)) + -27. -22 Calculate 11 - (25 - (-9 - -24)) - (-51 + (3 - 2)). 51 (-169 - -204) + (-21 - 0) - -13 27 Calculate -57 + (13 + 4 - 0) + -10 + 0. -50 Calculate -1 + -5 + (-1 - -71) - (45 + -5 + -31). 55 Evaluate (-51 - 4) + (-16 + 15 + 9 + -11 - 7). -65 What is the value of -93 + 94 + 10 - -76? 87 Calculate -87 - (15 - (147 + -34)). 11 Evaluate 1 + -2 + (-9 + (-22 - -53) - 29). -8 What is -70 + (-8 - -4) + (-18 - -77) + -53? -68 Evaluate 2 + 96 + (13 - 15) - (-8 - (-77 + 61)). 88 What is the value of 15 + 1 - (-42 + 69 - 30 - -19)? 0 ((-4 - -4) + 2 - -28) + -119 + 122 - -7 40 Evaluate -7 + (-27 - -10 - -111 - -3 - -2). 92 What is 41 - 17 - 28 - (2 - 24)? 18 Calculate -8 + (6 - (8 + -29) - 5) + -59 + -10. -55 What is ((-12 - 59) + (1 - -9) - -16) + 1 + -8? -52 Evaluate ((-1 - -3) + -1 - 5) + (0 - -4). 0 Calculate -81 + 70 + 23 - (0 - (27 - 5)). 34 What is -30 + (14 - (18 + -13)) - 17? -38 Evaluate (-32 - (-8 + 0)) + (5 - 10 - (1 + 2)). -32 Evaluate (11 + 10 - 12) + (7 - (10 - (-3 - -6))). 9 What is -11 + -12 + 12 + 24 + (5 - -5) - 12? 11 Calculate -48 - (52 + (22 - 122)) - (-1 - -5). -4 -32 + (54 - 11) - (1 - 2) - -11 23 -43 + 13 + 373 + -380 -37 Calculate (11 + -35 - (-27 + 5)) + -42. -44 Calculate -132 + 0 + 136 - (-1 - 9). 14 Evaluate 29 + -22 + 11 - (-5 + (0 - -16)). 7 (0 - (-13 + 3) - 17) + 11 + -1 + -12 -9 What is the value of -20 - ((1 - 14) + -1) - -10? 4 Calculate 4 + -14 - (1084 + -948). -146 What is the value of 6 + (-9 - (-14 - 11)) + -5 + -1? 16 41 + 1 - (-25 - -15) - 13 39 What is the value of -59 + (-8 + -1 - (-157 + 153))? -64 Calculate -57 + (181 - 123) + (1 - (2 + 35)). -35 Evaluate (43 - 19 - 103 - -26) + 4 + -22. -71 Evaluate (-78 - 41 - -41) + 0 + 23. -55 What is (16 - (26 - 65) - 5) + 12? 62 Calculate -5 + (-9 - (16 - 12)) + 15 + -1. -4 Evaluate (-6 - 13) + 13 + 13 + -29. -22 -31 + -122 + (-73 - -105) -121 (178 - 137) + (-8 - -1) + (6 - 16) 24 Evaluate -113 + -56 + 206 + -73. -36 Calculate (1 - (-9 + -13)) + 1 - (-8 - (-12 - -6)). 26 -51 - (20 - -1 - (-168 - -175) - (-18 + 34)) -49 What is the value of -80 + 76 + (49 - 8)? 37 What is the value of 1 + 0 + 23 + (-6 + 15 - (5 - -9))? 19 Calculate -27 - -27 - (-19 - -5 - (0 +	{ "pile_set_name": "DM Mathematics" }
). Suppose -4y = -cy - 4. Determine i(y). 0 Let b(z) = z*3 + 6z*2 + 4z + 2. Let n = -52 + 47. Calculate b(n). 7 Let a(h) = h*2 + 0h2 - h + h3 - 4h2 - 4. Suppose -2u + 3 = -u. What is a(u)? -7 Let t(a) be the second derivative of -a4/12 + a3/3 + a*2/2 - a. Calculate t(-3). -14 Suppose -4s - 3 = 5m - 1, m = -2s - 4. Let h(y) = y*2 + 2y - 3. What is h(m)? 5 Let a = -8 - -15. Let i(w) = -w*3 + 6w*2 + 14w - 8. Let f(x) = x*3 - 6x*2 - 15x + 8. Let t(k) = 5f(k) + 6i(k). Give t(a). 6 Suppose -4f + 6 = -f. Let z(b) = 2b*f - 4b - 1 - 3b2 - b + b. Determine z(-2). 3 Let f(p) = -p3 + 6p*2 - 7p + 4. Let o(d) be the first derivative of d*4/4 - 5d*3/3 + 3d*2 - 3d + 2. Let z be o(4). Determine f(z). -6 Let p(b) be the second derivative of b5/30 - b4/4 + b*3/6 - 3b. Let o(h) be the second derivative of p(h). Determine o(4). 10 Let o(y) = 2y2 - y. Let g(w) = -w + 1. Let d(x) = g(x) - o(x). Let m = 1 - -1. Determine d(m). -7 Let w(x) be the second derivative of -1/4x*4 + 3/2x2 + x3 - 1/20x5 - 3x + 0. Determine w(-4). -5 Let g = 24 + -17. Let t(f) = f*2 - 9f + 9. Let u be t(g). Let v(m) = m - 1. What is v(u)? -6 Suppose 2f + 2 = 3f. Let c be f - 0/(9/(-3)). Let x be c/(-4)20/(-2). Let u(l) = -l3 + 6l*2 - 5l - 5. Give u(x). -5 Let y(o) = o - 7. Suppose 3f - q - 13 = q, -3q = -5f + 22. Suppose p - 7 - 8 = fc, 5p + c = -55. Let g = p + 15. What is y(g)? -2 Let y = 0 + -1. Let n(v) = v3 + 5v*2 + 7v - 5. Let l(u) = 2u3 + 14u*2 + 20u - 14. Let c(q) = 6l(q) - 17n(q). What is c(y)? 4 Let z(r) = 0r2 + r2 + 1 - 4r - r. Let f = -41 + 46. Give z(f). 1 Suppose -5z + 3o + 20 = -o, 0 = -2z + o + 5. Let d(c) = -c - 2. Give d(z). -2 Let y(m) = -3m*2 + 2. Let g = -4 + 2. Let z be (g + 4)(1 - 0). Determine y(z). -10 Let m(w) = w*2 + 3w*3 + 0 - 2w*3 + 2 - 3w + 2w. Suppose 2s = 2o - 4 - 0, -3s + 2 = o. Give m(s). 2 Suppose f + 28 = 5f. Let v(q) = -q3 + 6q*2 + 6q + 9. Give v(f). 2 Let z(f) be the third derivative of -f5/30 + f3/6 - 10f2. Let c be 4/(-18) + (-114)/(-27). Let k = c + -2. Determine z(k). -7 Suppose 38 = 5v + b, 40 = 3v - 5b + 6. Suppose -5l - 3h + 10 = -v, -2l - 3h = -9. Let k(a) = -a*3 + 3a*2 + 3a - 2. What is k(l)? 7 Let t be 48/21 + 8/(-28). Let l(x) = -6x + 2 + tx + 8x. Calculate l(2). 10 Let u(w) = w + 1 + 0w + 1. Suppose 20 - 16 = -h. Give u(h). -2 Let c(i) = -21i + 1. Let d(t) = -3t. Let z(s) = -c(s) + 3d(s). Let m be 6/(-9) + (-10)/(-6). Determine z(m). 11 Let i(n) = 1. Let x(j) = -6j - 8. Let q(g) = -6i(g) - x(g). Calculate q(-2). -10 Let p(w) = -w + 7. Suppose -3h = -2h. Let f(o) = o3 - o2 + 4. Let q be f(h). Suppose 11 = 2b - u, 0b + qu = b - 16. What is p(b)? 3 Let t(v) = 7v - 5. Let c(l) = l + 1. Let x(i) = -5c(i) - t(i). Let r(s) = 2s - 9. Let h be r(5). Give x(h). -12 Let n(r) = -4 + r - 5 + 8r + 2. Let o(t) = -9t + 6. Let c(x) = 5n(x) + 6o(x). Determine c(1). -8 Let s(x) = 2x - 1. Let p be s(2). Let u(g) = -2g + pg*2 + 2 + 0g - 1 + 3g + g3. Let k(f) = -3f + 3. Let v be k(2). What is u(v)? -2 Suppose -v - 3z = v, 3v + 2z = 5. Let o(j) = -2j + 2j2 - 2j + 1 + 0 - 2. Determine o(v). 5 Let b = -21 + 24. Let w(v) = -v2 + v + 2. Give w(b). -4 Let b = -6 - -4. Let h be 1/((1 - b)/6). Let j(d) = 5 - 5 + dh. Calculate j(-1). 1 Let p = 12 + -18. Let o(i) be the first derivative of i*4/4 + 2i3 + i2/2 + 4i + 2. Calculate o(p). -2 Let h(n) = -3n2 - n - 2. Let q(k) = -k2 + k. Let b(l) = h(l) - 2q(l). What is b(3)? -20 Suppose -2v - 7 + 1 = 0. Let o = v - -6. Let s(h) = -h*o + 3 + 4h*3 + 3h*2 - 2h*3 + 4h. What is s(-2)? -1 Let p(w) = -w*3 + 3w*2 + 8w - 5. Let u(j) = j*2 - 10j - 19. Let o be u(12). What is p(o)? -15 Let v(m) be the first derivative of -m3/3 + m2 + m + 6. Let x = -3 + 5. Determine v(x). 1 Let m(z) = -z - 5. Let d be m(-13). Let t(l) = 2l + 3. Calculate t(d). 19 Let z(o) = o2 + 5o - 2o + o3 - 2 + 3o2. Give z(-3). -2 Let f(n) = -n - 11. Let b(y) = y2 - 8y + 8. Let a be b(3). Calculate f(a). -4 Let s(y) = y + 4. Suppose 2j - 7 = 3i, 0 = 3j + j + 4i + 16. Let c = -3 - j. Give s(c). 2 Let a(x) be the second derivative of -x4/12 + 2x*3/3 + 3x*2/2 + 3x. Let o be ((-1)/(-2))/(((-28)/48)/(-7)). What is a(o)? -9 Let i(m) be the second derivative of 2/3m3 + 7/2m*2 - 1/12m*4 + 0 - m. Suppose -2p - 2k + 19 = -5k, -9 = -3p - 2k. What is i(p)? 2 Let w(n) = -2 + n + 3 - 2. Let y be w(-1). Let t(o) = -27o3 + 3o*2 + 3o + 67o3 - 39o3 + 2. Give t(y). 0 Let t(m) = m3 + 2m2 + 2m + 1. Suppose 14 = 4q + 3g, 4q - 2q - 4g + 4 = 0. Suppose 0s + qs = 0. Let v = -2 + s. Calculate t(v). -3 Let c(j) = -3j + 3. Suppose -4q = -13q + 18. Calculate c(q). -3 Let j = 18 - 13. Suppose 5d - j = -0d. Let l(t) = -2t2 - 4t*2 + 1 - t + 0t2. What is l(d)? -6 Let p(n) = n + 1. Let i(k) = -k2 - 7k - 1. Let v(s) = -i(s) - 4p(s). Suppose -5o - 4 = -4o. Calculate v(o). 1 Let l = 4 + -2. Suppose 5u + 4o - 8 = 3u, 0 = -5u + lo + 20. Let h(c) be the third derivative of c4/24 - c3/6 - c2. What is h(u)? 3 Let y(t) = 4t*2 + t - 17. Let k(i) be the third derivative of 0 + 0i + 2i2 + 0i*4 + 1/60i*5 - 2/3i*3. Let c(l) = 9k(l) - 2y(l). Calculate c(3). 1 Let z(f) = f3 - 4f*2 + 5. Suppose 0 = 2d + d, -y - 5d = -4. Let p be z(y). Let x(j) = j - 4. Determine x(p). 1 Let c(i) = i3 - 2i - 2. Let l(n) = -4n3 + 5. Let p(u) = -5u*3 - u + 6. Let k(w) = -4l(w) + 3p(w). Let s(h) = -3c(h) + 2k(h). What is s(2)? -6 Let k(i) = i - 8. Let x(v) = -v3 + v2 + 2v - 1. Let w be x(-2). Suppose 19 - w = 2j. What is k(j)? -2 Let m(f) = f2 - 7f + 9. Let y be m(5). Let n(v) = 6v3 + 1. What is n(y)? -5 Let h(s) = 20s*3 + 17s*2 + 8s - 14. Suppose -10 = -8i + 3i. Let f(m) = 1 + 9mi - 6 + 3m - 3m2 + 7m*3. Let z(p) = 17f(p) - 6h(p). Give z(2). -3 Let z(t) be the first derivative of t2/2 - 5t + 16. Give z(7). 2 Let a(j) = -j + 11. Let g be a(9). Suppose gd = 3t - 4, 0 = -0d + 4d + t + 8. Let z be 1 - -1 - (2 - d). Let k(m) = -3m2 - 3m - 1. What is k(z)? -7 Let w(a) be the third derivative of -a4/24 - a3/6 + 3a2. Let o(q) = -7q*3 + 2q*2 + q. Let x(r) = o(r) - w(r). Determine x(-1). 8 Suppose -3o + 33 = 2d, -d + 0o + 21 = 3o. Let r be d/18 + 20/6. Let l(q) = -q2 + 6q - 6. What is l(r)? 2 Let v(b) = 17b - b2 + 4 - 9b - 11. Let z = 14 - 9. Give v(z). 8 Let r(h) be the first derivative of -h*4/4 + 7h*3/3 + 4h + 3. Determine r(7). 4 Suppose -2 - 3 = -2b - 3h, h = b + 10. Let u(y) = y - 5. Give u(b). -10 Let o = 6 - 4. Let r(h) = 4h2 + 2h + 2 - 3ho - 5h. Let t be r(3). Let y(p) = p - 3. Give y(t). -1 Suppose t + 2d = -4, 1 = 3d - 8. Let f = t + 5. Let x(l) = -2l - 3. Calculate x(f). 7 Let v(u) = -2u*3 + 2u + 1. Suppose -h = 3n + 5, -3h = -7h + 4n - 4. Determine v(h). 13 Let d(a) = 2a - 2. Suppose -2s + 2u = 12, 2s + 5u = -0s - 5. Give d(s). -12 Let q be (-14)/18 - (-10)/(-45). Let o(f) = -36f - 5. Let v(b) = 7b + 1. Let m(d) = -2o(d) - 11v(d). Determine m(q). 4 Let b(n) = -5n3 - 41n*2 + 6n - 46. Let o(u) = -u*3 - 8u*2 + u - 9. Let w(t) = -2b(t) + 11o(t). Determine w(-6). -1 Let f(j) = -2 - 6 + j + 4. Suppose -5w - k - 9 = 0, -3w - 2w + 3k = 13. Let m = w + 5. Determine f(m). -1 Let m = -32 - -39. Let h(v) = -2v + 9. What is h(m)? -5 Let v(n) be the second derivative of n4/3 - n3/2 - 2n2 + 2n. Let t(x) = -3x2 + 3x + 3. Let f(o) = 3t(o) + 2v(o). What is f(5)? -9 Let k be 10/(-2) + 3 + -2. Let j = k + 7. Let g(v) = -v*3 + 3v*2 + 1. What is g(j)? 1 Let y(f) = 3f + 7f2 - 4f*2 - 2f*2 - 8f. Let i be 3(2 - (-2)/(-3)). What is y(i)? -4 Let y(c) = -6c*2 + 4 - 3c + 4c + c3 + 2c*3 - 4c*3. Suppose -3w + s - 14 = -0, 3s = 3w + 6. What is y(w)? -2 Let u be (49/21)/(35/30). Let z(y) = -2y3 - 2. Calculate z(u). -18 Let t(f) = -3f + 3. Let c(a) = 2a - 3. Let h(u) = -5c(u) - 4t(u). What is h(-4)? -5 Suppose 0 = w - 2y + 5, -2 + 12 = -2w - 2y. Let f(s) = -s*3 - 6s*2 - 3s + 5. What is f(w)? -5 Let j = 9 + -5. Suppose -5g + 23 = jq, 2 = -2q - 3g + 5*g. Suppos	{ "pile_set_name": "DM Mathematics" }
c3d + 641c3 + 2 wrt d? -29735c*3 Find the first derivative of -3dp3z - 3dpz - 31dt + 2p*3tz - 9p*3t - 4p3 - 3t wrt d. -3p3z - 3pz - 31t Differentiate 6ab3 + 2ab2 + 2abz - ab + b3z + 10bz wrt z. 2ab + b*3 + 10b What is the second derivative of -4395n2 + 4n - 77? -8790 Differentiate -2278o - 321. -2278 Find the second derivative of 122b*2kt2 + 13b*2t3 + b2t2 + 48bk + 14bt3 - bt wrt b. 244kt*2 + 26t*3 + 2t*2 Find the third derivative of 437p5 + p4 - 693p2 wrt p. 26220p*2 + 24p What is the second derivative of -6r4 + 2r*3 + 88r*2 + 3r - 246? -72r2 + 12r + 176 What is the second derivative of -39d5 - 5d*3z - dz - 3z - 104 wrt d? -780d3 - 30dz Find the second derivative of 17j*2o*3 - 3j*2o + 10j2 + 4o*3 - 2 wrt o. 102j*2o + 24o What is the third derivative of -71i*4m*2 - 13i*4 + 76i*2m*2 + 6im2 - 2i wrt i? -1704im*2 - 312i Find the third derivative of 2jk*2o*3 - 4jk2 - 2jko + jk - 10jo4 + k2o*2 - 5o*5 wrt o. 12jk2 - 240jo - 300o*2 What is the second derivative of -10m*3u + 85m3 - mu + 880 wrt m? -60mu + 510m Find the second derivative of -b3p + 5b2p*2t + 52b2pt - 3bt - 3p*2 + 3pt + 32t wrt b. -6bp + 10p2t + 104pt What is the third derivative of -153z4 - z2 + 2? -3672z Differentiate 2f3rw + 8f*3r + 2fr - 21rw*2 - 2rw - 5r + 2w2 with respect to w. 2f*3r - 42rw - 2r + 4w What is the derivative of 2785i3 + 7842 wrt i? 8355i*2 What is the second derivative of 4h*2x*3 + 388h*2x*2 - 27hx3 + 18hx2 wrt h? 8x*3 + 776x*2 Differentiate -428t*3y*2 + 2t*3y - 37t3 - t2 + 2ty2 with respect to y. -856t*3y + 2t3 + 4ty What is the second derivative of 3l*3s*2 + 4l*3s + 23l2s*2 + 1274l - 2s2 wrt l? 18ls2 + 24ls + 46s*2 Find the first derivative of 70s*3 - 17s*2 + 27272. 210s*2 - 34s What is the third derivative of -516b2h*4 + 17b*2 + bh*4 - 2bh2 + 3 wrt h? -12384b*2h + 24bh Find the second derivative of 2f3i*2w + 54f3i*2 - 13f*3 - 31i*2w*2 - 755iw2 wrt i. 4f*3w + 108f3 - 62w*2 Find the third derivative of -2a*2v*4 - 56a*2v - 224v5 + 2v*2 wrt v. -48a*2v - 13440v2 What is the second derivative of 727p4 + p3 - 2096p? 8724p*2 + 6p Differentiate -4im*4 + im + 45ip + 5mp*2 - 10p*2 wrt m. -16im3 + i + 5p*2 What is the third derivative of -2d*3k*2px3 - 3d*3k*2x + d3 + d2kpx + 85dkpx3 - 4dpx*2 + 2k*2x wrt x? -12d3k*2p + 510dkp Find the second derivative of 128h*5t + ht - 17t - 1 wrt h. 2560h3t What is the first derivative of 1496k + 1313? 1496 What is the derivative of 31cm2q + 2cm*2 - 7cm + mq*2 - 2mq wrt q? 31cm2 + 2mq - 2m What is the first derivative of -60ix*3 - ix*2 - 1744i - 5x3 - 2 wrt x? -180ix2 - 2ix - 15x*2 What is the derivative of -1389d + 490? -1389 Find the third derivative of 117f3j*2 - 3f*3q - f*2 - 9fj2 + 18fq + j wrt f. 702j*2 - 18q Find the third derivative of -6407x3 + 4315x*2. -38442 Find the first derivative of 2164x - 1881 wrt x. 2164 What is the third derivative of -122h3 - h2 + 26? -732 What is the second derivative of -4019x*4 + 21x - 3? -48228x2 Find the second derivative of 5p*3 - 333p*2 - 7658p. 30p - 666 Find the first derivative of -2m*3 + 224m*2 - 502. -6m*2 + 448m What is the third derivative of 3s4u*2 + 1119s*4u - 2s3u - 8s2u*2 + 650su2 wrt s? 72su2 + 26856su - 12u Find the third derivative of 2924w6 - 2w*4 - 2w*2 + 4023 wrt w. 350880w*3 - 48w What is the first derivative of 14a2 + 3a - 969 wrt a? 28a + 3 What is the third derivative of 32j*5 + 2j*2 - 320 wrt j? 1920j*2 What is the second derivative of -261x*4 + 104x - 2? -3132x2 What is the second derivative of 2691p*4 + 1479p? 32292p2 What is the first derivative of 973o*4 + 2o*2 + o - 6840 wrt o? 3892o*3 + 4o + 1 Find the second derivative of -27c5 - 2c*2 - 10c - 6 wrt c. -540c3 - 4 What is the third derivative of -16f*4 - 17f*3 - 1016f*2 wrt f? -384f - 102 Find the third derivative of -1427p3 - 2481p*2 wrt p. -8562 What is the derivative of 103c*2 + 6c + 11053 wrt c? 206c + 6 What is the second derivative of 9dw4 - dw*3 - dw*2y*3 + 2dwy*2 - dwy - 3dw - 11y*3 wrt w? 108dw2 - 6dw - 2dy3 Differentiate p2 + 235p + 253 wrt p. 2p + 235 Find the second derivative of -526w*5 + w + 130 wrt w. -10520w*3 What is the first derivative of fr*3 - 2frv*2z - 131fv*3z + 2r3v*2z + 4r2v*3z - 483r2v*2z wrt f? r*3 - 2rv2z - 131v3z What is the first derivative of 3h2j*3p + 2h2j*3 + 398hj3p + 2hj*3 - 307j*3 wrt p? 3h*2j*3 + 398hj3 What is the third derivative of 2uv2x*3 - 3uv2x*2 - 4uv - 3v*2x*3 + 27v*2x + 2v2 + 411vx3 wrt x? 12uv2 - 18v*2 + 2466v Find the second derivative of 5231f2 + 6250f. 10462 Find the third derivative of -6q4v*3 + 38q*3v*3 + 3q*2v2 + q2 - 18v3 wrt q. -144qv3 + 228v3 What is the third derivative of l3u3 + 551l*3 + 8l*2u*3 + 4l*2u*2 + 5lu wrt l? 6u*3 + 3306 Find the second derivative of -6t*4 - 8t*3 + t - 140 wrt t. -72t*2 - 48t Differentiate -cq4 - 56cq3 + 5c + 94 with respect to q. -4cq*3 - 168cq2 What is the derivative of im*3 + 331im2 + 1204i + 2m - 1 wrt m? 3im2 + 662im + 2 What is the second derivative of -2k*3v*2 + 4k*3v + 11k2v*2 - 26k*2v - 3kv*4 wrt v? -4k*3 + 22k*2 - 36kv2 Find the third derivative of -3r*3w*3 - 25r*3w*2 - 69r*2w3 - r2w wrt r. -18w*3 - 150w*2 What is the second derivative of -209r*5 + 2r - 60? -4180r3 What is the derivative of 721g*2r*3w - 4g2r3 - g2r2w + 1037r3 wrt w? 721g*2r3 - g2r2 Find the second derivative of -15817c*4 - 6c + 1057 wrt c. -189804c2 Find the first derivative of 17sw - 2s - 38w + 158 wrt w. 17s - 38 What is the third derivative of 3312q5 + q3 + 4q*2 - 2q + 41? 198720q2 + 6 Find the second derivative of 192i*5 - 535i. 3840i3 Find the first derivative of 344f*2r - f*2 + 205f wrt r. 344f2 What is the second derivative of -15h*2i - h*2 - 331hi + 1 wrt h? -30i - 2 What is the derivative of 2471t3 + 2679? 7413t*2 Find the third derivative of -3h*4z*2 - 81h4 + h3z2 - 310h*2z*2 - hz*2 wrt h. -72hz2 - 1944h + 6z2 What is the third derivative of -12gk3p*3 - gk*3q + 2gk*3 - gkp3 - gkp2 + 2gkq - 5k2p + 3k2q wrt k? -72gp*3 - 6gq + 12g Find the second derivative of -56x2 - 18x wrt x. -112 What is the second derivative of 153g3h*2 + 524g*3m + g*2h - 76gh*2m + 2gm + h wrt h? 306g3 - 152gm What is the first derivative of w4 + 87w*2 + 272 wrt w? 4w*3 + 174w Find the second derivative of -qy3 + 30qy2 - 15qy - 2q - 30y3 + 36y wrt y. -6qy + 60q - 180y What is the derivative of -2n2v3 + n2v2 - 4nv - 386v*3 + 2v*2 wrt n? -4nv3 + 2nv2 - 4v Find the third derivative of -7069v4 + 4086v*2 + 3v. -169656v Find the third derivative of 8s*4 - 42s*3 + 54s*2 + 2s wrt s. 192s - 252 Differentiate 133f*4z3 - f4 - 5z3 + 2z*2 wrt f. 532f*3z*3 - 4f*3 What is the third derivative of 13lp3u*3 - lp*3 + 9lp2u*2 + 2p*2u*3 - 5p*2u*2 wrt p? 78lu3 - 6l Find the third derivative of -252s4 - 95s*2 wrt s. -6048s Differentiate 50r4 + 43r*3 + 792 wrt r. 200r*3 + 129r*2 What is the first derivative of 8flq*2 + 2flv - 2fqv2 - 2fv - 7lq2v*2 + 66q*2 wrt l? 8fq2 + 2fv - 7q*2v*2 What is the derivative of -365a*3x + 19a3 - 12a*2 wrt x? -365a*3 Differentiate fj*2z + fj2 - 19fj + 19fz + 2j*2 - 23 with respect to j. 2fjz + 2fj - 1	{ "pile_set_name": "DM Mathematics" }
m {o: 10}. What is prob of picking 3 o? 1 Calculate prob of picking 1 m and 1 y when two letters picked without replacement from mmymyymmmymmmmmmmmmm. 32/95 Four letters picked without replacement from yncxyxnyc. What is prob of picking 1 c, 2 y, and 1 n? 2/21 Four letters picked without replacement from {x: 3, v: 1, s: 3, z: 1, y: 4, k: 5}. Give prob of picking 1 k and 3 y. 1/119 Four letters picked without replacement from {h: 3, k: 8}. Give prob of picking 3 k and 1 h. 28/55 What is prob of picking 1 k, 1 e, and 1 b when three letters picked without replacement from ekbkekeeeekbbbb? 24/91 Calculate prob of picking 2 f and 1 s when three letters picked without replacement from fsfscccfsfccfcsff. 21/170 Four letters picked without replacement from {x: 2, n: 3, y: 1, w: 4, e: 1}. What is prob of picking 4 e? 0 What is prob of picking 1 v and 1 y when two letters picked without replacement from vucyw? 1/10 Calculate prob of picking 1 t, 1 y, and 2 q when four letters picked without replacement from qqtqtyttt. 5/42 Three letters picked without replacement from {t: 2, l: 2, o: 1}. Give prob of picking 1 o and 2 t. 1/10 Four letters picked without replacement from incceiiiwnew. What is prob of picking 2 c and 2 w? 1/495 What is prob of picking 1 a and 3 x when four letters picked without replacement from xaaxaxaaaxaax? 16/143 What is prob of picking 1 v and 1 t when two letters picked without replacement from udtjvfuj? 1/28 Two letters picked without replacement from afklbfkbblkbkk. Give prob of picking 1 k and 1 b. 20/91 Calculate prob of picking 1 w and 1 g when two letters picked without replacement from {w: 2, h: 1, s: 1, g: 2, x: 2, b: 1}. 1/9 What is prob of picking 2 l when two letters picked without replacement from {y: 4, a: 1, c: 2, q: 1, l: 2, j: 2}? 1/66 Two letters picked without replacement from {m: 19, y: 1}. Give prob of picking 1 m and 1 y. 1/10 Two letters picked without replacement from {c: 1, e: 2}. Give prob of picking 2 e. 1/3 What is prob of picking 3 k and 1 e when four letters picked without replacement from kbebkbekbebe? 4/495 Four letters picked without replacement from qbekqkkwkkqwkqqkbq. What is prob of picking 1 k, 1 e, and 2 w? 7/3060 Four letters picked without replacement from gxgxggxgxxgg. What is prob of picking 3 g and 1 x? 35/99 What is prob of picking 1 y and 1 v when two letters picked without replacement from {t: 1, y: 1, j: 2, v: 3, h: 10}? 3/136 Four letters picked without replacement from {d: 4, u: 2, c: 8}. Give prob of picking 2 d and 2 u. 6/1001 Two letters picked without replacement from ggtmmt. Give prob of picking 2 t. 1/15 Three letters picked without replacement from gtgbggbtgiggbgbg. What is prob of picking 1 i, 1 t, and 1 g? 9/280 What is prob of picking 4 d when four letters picked without replacement from ddjddjdd? 3/14 What is prob of picking 1 d and 1 x when two letters picked without replacement from dooxoddxde? 8/45 Three letters picked without replacement from {q: 1, b: 1, e: 4, g: 3, p: 7, o: 4}. What is prob of picking 1 p and 2 o? 7/190 What is prob of picking 1 j, 1 p, and 1 y when three letters picked without replacement from pyyyjddxdyjykddd? 1/56 Calculate prob of picking 3 l when three letters picked without replacement from pppppplpplplppll. 1/56 Three letters picked without replacement from {h: 10, w: 5, f: 4, v: 1}. Give prob of picking 1 v and 2 w. 1/114 Three letters picked without replacement from {k: 6, s: 4, z: 7}. What is prob of picking 3 k? 1/34 Three letters picked without replacement from aaatatttttattaat. Give prob of picking 3 t. 3/20 Calculate prob of picking 2 t and 1 s when three letters picked without replacement from sssssssssssssttsss. 1/51 Calculate prob of picking 2 y when two letters picked without replacement from {t: 1, z: 4, y: 2, s: 7, f: 2, v: 1}. 1/136 Two letters picked without replacement from szzzzznsnzzzzzzszz. What is prob of picking 1 s and 1 z? 13/51 Two letters picked without replacement from {v: 5, n: 1, b: 1, x: 3, f: 1, d: 4}. Give prob of picking 1 d and 1 n. 4/105 Two letters picked without replacement from xxdvyqqddyxxpp. Give prob of picking 1 v and 1 p. 2/91 Calculate prob of picking 1 i and 3 a when four letters picked without replacement from {a: 9, z: 5, u: 3, i: 3}. 84/1615 Two letters picked without replacement from {h: 4, q: 2}. Give prob of picking 2 q. 1/15 Calculate prob of picking 1 t and 3 j when four letters picked without replacement from {j: 7, t: 5}. 35/99 Calculate prob of picking 2 k and 2 n when four letters picked without replacement from {n: 2, u: 1, i: 4, k: 3, a: 1}. 1/110 What is prob of picking 1 c and 3 v when four letters picked without replacement from vvcvvvvvvvvvvcvc? 33/70 Two letters picked without replacement from {x: 3, p: 5, o: 3, d: 1, h: 1, j: 2}. Give prob of picking 1 p and 1 d. 1/21 Two letters picked without replacement from jkxjkkkkxkjxjkjkxjkk. What is prob of picking 2 k? 9/38 Two letters picked without replacement from {n: 7, g: 1, k: 1, e: 4, t: 3, i: 4}. What is prob of picking 1 t and 1 k? 3/190 Three letters picked without replacement from {e: 4, r: 4, w: 7, m: 4, g: 1}. What is prob of picking 1 e and 2 m? 2/95 Four letters picked without replacement from ecceecewewwecewccecw. What is prob of picking 4 e? 14/969 Calculate prob of picking 1 d and 1 s when two letters picked without replacement from {j: 2, s: 1, d: 1, p: 2}. 1/15 Two letters picked without replacement from {z: 2, e: 11}. Give prob of picking 2 e. 55/78 Four letters picked without replacement from {n: 15, m: 5}. Give prob of picking 1 n and 3 m. 10/323 Four letters picked without replacement from chjjbjzzhhzczhhjh. Give prob of picking 2 z, 1 b, and 1 h. 9/595 Four letters picked without replacement from {q: 2, u: 9}. Give prob of picking 2 u and 2 q. 6/55 Calculate prob of picking 4 p when four letters picked without replacement from {x: 2, l: 2, p: 4}. 1/70 Two letters picked without replacement from {g: 1, e: 8, s: 2, c: 4}. What is prob of picking 1 e and 1 g? 8/105 Four letters picked without replacement from nnnnnrrrxrxn. Give prob of picking 2 x and 2 r. 2/165 Two letters picked without replacement from dduzdijzgdug. What is prob of picking 2 d? 1/11 Four letters picked without replacement from totbtttpjfoop. Give prob of picking 1 t and 3 j. 0 What is prob of picking 3 o when three letters picked without replacement from oozoz? 1/10 Calculate prob of picking 2 r, 1 c, and 1 m when four letters picked without replacement from vzzcrrzmycr. 1/55 What is prob of picking 1 e and 1 m when two letters picked without replacement from {c: 1, w: 2, m: 1, e: 4, l: 1}? 1/9 Three letters picked without replacement from {y: 4, x: 6}. What is prob of picking 3 y? 1/30 What is prob of picking 4 k when four letters picked without replacement from kkkknkkkkkknnkkk? 11/28 Two letters picked without replacement from {l: 8, b: 5}. Give prob of picking 1 l and 1 b. 20/39 What is prob of picking 3 w and 1 i when four letters picked without replacement from {w: 3, a: 4, i: 1, u: 1, x: 4}? 1/715 Four letters picked without replacement from pppppvvvpppppv. Give prob of picking 3 v and 1 p. 40/1001 Calculate prob of picking 2 l when two letters picked without replacement from {l: 7, w: 4, v: 2}. 7/26 Calculate prob of picking 1 n and 1 g when two letters picked without replacement from hghghngngnhhhngghghg. 16/95 Two letters picked without replacement from {z: 4, f: 1, y: 8, k: 6, o: 1}. What is prob of picking 1 y and 1 k? 24/95 Two letters picked without replacement from kkckkcckkcmkmck. Give prob of picking 2 c. 2/21 Three letters picked without replacement from duuzguuuu. What is prob of picking 1 d, 1 z, and 1 u? 1/14 Three letters picked without replacement from {k: 9}. Give prob of picking 3 k. 1 Three letters picked without replacement from {u: 17, x: 2}. What is prob of picking 1 x and 2 u? 16/57 Calculate prob of picking 2 f and 1 l when three letters picked without replacement from {l: 3, j: 4, f: 4}. 6/55 Three letters picked without replacement from {l: 5}. What is prob of picking 3 l? 1 Calculate prob of picking 1 b and 2 n when three letters picked without replacement from {n: 2, b: 1, m: 1}. 1/4 Calculate prob of picking	{ "pile_set_name": "DM Mathematics" }
34628 a multiple of 25? False Does 20 divide 581? False Is 23 a factor of 690? True Is 110097 a multiple of 15? False Is 117 a factor of 3604? False Does 71 divide 142? True Is 2 a factor of 58? True Does 58 divide 5452? True Is 16 a factor of 1765? False Is 1836 a multiple of 108? True Is 42331 a multiple of 18? False Is 118 a factor of 17346? True Is 10 a factor of 1313? False Is 3 a factor of 41? False Does 6 divide 1730? False Is 36 a factor of 8784? True Is 121 a factor of 15416? False Is 39755 a multiple of 48? False Is 920 a multiple of 56? False Is 11 a factor of 836? True Is 18 a factor of 9722? False Is 32 a factor of 16557? False Is 4 a factor of 836? True Is 25947 a multiple of 9? True Is 25 a factor of 334? False Does 10 divide 679? False Is 604 a multiple of 12? False Does 111 divide 7144? False Is 450 a multiple of 15? True Is 12 a factor of 6942? False Is 88 a factor of 4576? True Is 191 a factor of 25262? False Is 72 a factor of 71830? False Is 19 a factor of 12259? False Is 217 a factor of 5349? False Is 19 a factor of 1158? False Is 20 a factor of 2404? False Does 9 divide 972? True Does 12 divide 312? True Is 11 a factor of 242? True Is 36034 a multiple of 285? False Is 8 even? True Is 5 a factor of 50? True Does 26 divide 1664? True Does 59 divide 15694? True Is 79 a factor of 237? True Does 112 divide 39536? True Does 59 divide 1206? False Is 37603 a multiple of 43? False Does 17 divide 697? True Does 15 divide 153? False Does 14 divide 20016? False Does 27 divide 12625? False Is 18 a multiple of 3? True Is 53 a factor of 371? True Is 4326 a multiple of 15? False Does 34 divide 26826? True Does 8 divide 15728? True Is 1568 a multiple of 3? False Does 13 divide 11154? True Is 60 a multiple of 9? False Is 87 a factor of 37740? False Is 27935 a multiple of 151? True Is 19 a factor of 15800? False Is 37561 a multiple of 66? False Does 23 divide 1066? False Is 19408 a multiple of 13? False Does 4 divide 14344? True Is 6 a factor of 64263? False Is 123 a multiple of 20? False Does 52 divide 84313? False Does 56 divide 56654? False Does 27 divide 14445? True Does 6 divide 2544? True Does 108 divide 62532? True Is 2131 a multiple of 24? False Does 12 divide 1068? True Is 52 a factor of 1352? True Is 11 a factor of 4246? True Is 60 a factor of 15734? False Does 42 divide 30282? True Does 79 divide 6399? True Does 9 divide 5174? False Does 3 divide 439? False Is 780 a multiple of 39? True Is 36519 a multiple of 47? True Is 4 a factor of 6553? False Does 9 divide 39416? False Does 13 divide 5877? False Does 66 divide 16632? True Is 15 a factor of 1815? True Is 21 a factor of 14453? False Is 81 a factor of 4373? False Does 33 divide 5901? False Does 7 divide 13944? True Is 5576 a multiple of 136? True Does 25 divide 3834? False Is 1989 a multiple of 51? True Is 2057 a multiple of 20? False Is 23280 a multiple of 74? False Is 50 a factor of 9123? False Is 123 a factor of 1544? False Is 4 a factor of 7552? True Does 4 divide 128? True Does 97 divide 29355? False Does 6 divide 757? False Is 15 a factor of 75? True Is 48118 a multiple of 98? True Is 40548 a multiple of 111? False Is 6629 a multiple of 7? True Does 22 divide 1141? False Is 4 a factor of 882? False Does 8 divide 1297? False Is 10726 a multiple of 31? True Is 119 a factor of 21087? False Is 9 a factor of 6264? True Is 11175 a multiple of 149? True Is 3 a factor of 10709? False Is 770 a multiple of 58? False Is 11 a factor of 7103? False Does 109 divide 28356? False Is 1365 a multiple of 91? True Is 15 a factor of 2561? False Is 462 a multiple of 2? True Is 5220 a multiple of 87? True Is 12 a factor of 7793? False Is 1183 a multiple of 13? True Is 11 a factor of 156? False Is 11 a factor of 221? False Is 17 a factor of 3366? True Is 650 a multiple of 25? True Is 13 a factor of 12116? True Is 3 a factor of 3962? False Does 116 divide 7888? True Is 4680 a multiple of 4? True Does 40 divide 14030? False Is 13 a factor of 1281? False Is 46 a factor of 598? True Is 22 a factor of 1433? False Does 8 divide 40? True Does 10 divide 3220? True Is 186 a factor of 3534? True Is 43 a factor of 20307? False Is 648 a multiple of 24? True Does 27 divide 1080? True Is 33 a factor of 603? False Does 9 divide 1763? False Does 46 divide 14582? True Is 45953 a multiple of 9? False Is 461 a multiple of 11? False Is 2546 a multiple of 37? False Does 21 divide 756? True Is 288 a multiple of 24? True Is 26 a factor of 38484? False Is 97 a factor of 191? False Is 21 a factor of 377? False Does 29 divide 11571? True Is 69 a factor of 2760? True Is 14856 a multiple of 55? False Is 12 a factor of 5602? False Does 30 divide 660? True Does 6 divide 1468? False Is 17 a factor of 2484? False Does 10 divide 630? True Is 41433 a multiple of 10? False Is 234 a multiple of 18? True Does 11 divide 1738? True Does 55 divide 2310? True Is 5 a factor of 90? True Is 1612 a multiple of 124? True Is 5894 a multiple of 2? True Is 381 even? False Is 2269 a multiple of 30? False Does 11 divide 209? True Does 33 divide 27654? True Is 1385 a multiple of 38? False Does 195 divide 49140? True Is 8 a factor of 4554? False Does 11 divide 4433? True Does 23 divide 11115? False Is 1076 a multiple of 4? True Does 10 divide 534? False Is 2 a factor of 4018? True Does 6 divide 33446? False Does 16 divide 183? False Is 97 a multiple of 4? False Is 25 a factor of 425? True Does 9 divide 73936? False Is 720 a multiple of 9? True Is 12 a factor of 267? False Does 33 divide 5732? False Does 17 divide 1519? False Is 5 a factor of 3296? False Is 8 a factor of 448? True Is 4905 a multiple of 15? True Is 48 a factor of 2242? False Is 2935 even? False Does 32 divide 1688? False Is 4279 a multiple of 47? False Is 3540 a multiple of 4? True Is 2071 a multiple of 44? False Is 9 a factor of 3883? False Is 20 a factor of 8380? True Is 2588 a multiple of 17? False Does 10 divide 1469? False Does 124 divide 5747? False Is 170665 a multiple of 202? False Does 4 divide 1242? False Is 7 a factor of 553? True Is 3192 a multiple of 64? False Does 12 divide 3057? False Is 26 a factor of 119? False Does 19 divide 418? True Does 76 divide 228? True Is 5 a factor of 53080? True Does 19 divide 684? True Is 40 a factor of 3360? True Is 9 a factor of 1089? True Does 91 divide 601? False Does 16 divide 111174? False Is 21 a factor of 7298? False Is 25 a factor of 3094? False Does 5 divide 83? False Is 3964 a multiple of 8? False Is 5 a factor of 4160? True Is 44 a factor of 1169? False Is 478 a multiple of 10? False Does 179 divide 52984? True Does 6 divide 1714? False Is 111 a factor of 4472? False Is 75 a factor of 2475? True Is 50546 a multiple of 44? False Does 165 divide 14915? False Is 19802 a multiple of 124? False Does 7 divide 2282? True Is 65 a factor of 1690? True Does 71 divide 116298? True Is 11 a factor of 294? False Is 13 a factor of 563? False Is 36091 a multiple of 86? False Does 30 divide 5317? False Is 886 a multiple of 22? False Does 84 divide 50851? False Is 7135 a multiple of 14? False Is 34 a factor of 5718? False Is 361 a multiple of 2? False Is 10 a factor of 2410? True Does 19 divide 635? False Is 2 a factor of 132? True Is 6587 a multiple of 6? False Is 3960 a multiple of 8? True Does 43 divide 344? True Is 1355 a multiple of 3? False Does 26 divide 676? True Is 4 a factor of 7477? False Is 15 a factor of 26475? True Is 1244 a multiple of 21? False Does 89 divide 2823? False Is 66 a factor of 832? False Does 35 divide 3500? True Is 3146 a multiple of 4? False Is 4 a factor of 2368? True Is 9 a factor of 324? True Is 470 a multiple of 5? True Is 82 a factor of 984? True Is 21400 a multiple of 12? False Does 25 divide 208? False Is 30 a factor of 2907? False Is 37410 a multiple of 145? True Does 4 divide 472? True Is 204 a factor of 11628? True Is 1197 a multiple of 19? True Does 3 divide 15? True Is 51 a factor of 1246? False Does 333 divide 45968? False Is 1152 a multiple of 21? False Does 70 divide 32690? True Does 10 divide 90? True Is 21457 a multiple of 29? False Is 82 a factor of 738? True Is 32 a factor of 5280? True Does 21 divide 4830? True Is 12 a factor of 108? True Is 14 a factor of 17990? True Does 11 divide 1339? F	{ "pile_set_name": "DM Mathematics" }
prime factors of y. 41 Let a = -5 - -1. Suppose -2j + 2r - 26 = -3j, r - 4 = 0. Let o = a + j. List the prime factors of o. 2, 7 Suppose -12g + 6 = -10g. Suppose 12 = gr - r. What are the prime factors of r? 2, 3 Let v = -1416 - -2811. What are the prime factors of v? 3, 5, 31 Suppose -42d + 44d = l + 2907, -2d - 2l + 2904 = 0. What are the prime factors of d? 1453 Suppose -5 = -3f - 14. What are the prime factors of (1/f)/((-7)/294)? 2, 7 Let j = 19 + 39. List the prime factors of j. 2, 29 Suppose 2t = 3q + 169 - 38, -5t + 317 = 3q. Suppose 5p - 126 = -4s, 2s - 4s + t = 2p. What are the prime factors of s? 2, 17 Let k = 4651 + -3159. What are the prime factors of k? 2, 373 Let r = -100 - -108. What are the prime factors of (-20905)/(-105) + r/(-84)? 199 Let a(z) = -15z3 - 4z*2 + 10z + 25. What are the prime factors of a(-6)? 3061 Let u(m) = 11m2 + 1. Let h(v) = v + 5. Let t be h(-8). What are the prime factors of u(t)? 2, 5 Let l be (-164)/(-14) + 4/14. Let r = 490 - 477. Suppose -lh + rh = 28. What are the prime factors of h? 2, 7 Let w = 21 - 7. Suppose 299 = 3z + w. List the prime factors of z. 5, 19 Let c be (2 + (-2 - 0))/3. Suppose x + x - 50 = c. Let j = 43 - x. List the prime factors of j. 2, 3 Suppose 5p - 594 = 966. Suppose 5b = -5g + 810, -3g + g + b + p = 0. List the prime factors of g. 2, 79 Suppose 7453 + 1763 = 8w. What are the prime factors of w? 2, 3 Suppose 0a = -5o - 3a + 1736, -2a = 3o - 1041. List the prime factors of o. 349 Suppose -2s - 2d = 42, s + 1 = 3d - 16. Let n be (5 + -1)(-615)/s. Suppose 0 = 6c - 3c - n. List the prime factors of c. 41 Suppose -130k + 124k + 24 = 0. Let s = 5 + -3. Suppose 0 = -q + kq - 5t - 110, t = -sq + 56. What are the prime factors of q? 2, 3, 5 Let a(x) = 6x3 + x3 + x - 6x3 + 7 - x2 + 0x*2. List the prime factors of a(4). 59 Suppose 4a - 5a = -3w - 376, 3a - 1188 = -3w. What are the prime factors of a? 17, 23 Suppose -2u - 5y = 3u, -2u + 14 = -5y. Suppose -3k - 3 - 3 = 0, -4k = uq - 4. What are the prime factors of q? 2, 3 Let x(q) = 73q2 - 3q + 7. List the prime factors of x(2). 293 Let a = -24 + 24. Let j be a + 0 + 2/(-2). What are the prime factors of (180/24)/(j/(-2))? 3, 5 Suppose 114189 = 46z - 11207. List the prime factors of z. 2, 29, 47 List the prime factors of (54/90)/(1/6935). 3, 19, 73 Let x be -5(12/5 - 3). Suppose 0 = xb + o - 340, -o - 2o - 462 = -4b. List the prime factors of b. 2, 3, 19 Suppose -5 = 5a, -3r - 4a - 20 = -121. Let m be 14/r + 28/5. Suppose mb = 3b + 12. List the prime factors of b. 2 List the prime factors of (-4727)/(-5) - (-69)/115. 2, 11, 43 Suppose -2s = 3s. Suppose 4p - 5r - 138 = s, 0r = p - 4r - 40. List the prime factors of p. 2 Suppose 60 = -n + 11n. Suppose -nc + 9c - 774 = 0. List the prime factors of c. 2, 3, 43 Let c be -3296(0 + (-3)/9). Let o = c + -191. List the prime factors of o. 3, 5, 7 Let h = -742 - -2174. What are the prime factors of h? 2, 179 Suppose -o - 27 = -4n, -5n + 21 = -n + o. Suppose -nr + 2r = 52. Let w = -7 - r. What are the prime factors of w? 2, 3 Suppose 518 = 5v - 27. Suppose 2g - 3n + 7n - 118 = 0, 0 = 2g + n - v. Suppose 0 = -3r - 3c + 99, -r - c = -4c - g. List the prime factors of r. 2, 19 Suppose 0 = -7k + 37 + 12. Suppose -4z = -kz + 267. List the prime factors of z. 89 List the prime factors of ((-224)/(-4))/(-8) - -1348. 3, 149 Suppose 111 = -2c + x, 0 = 5x - x + 12. Let k be (-1)/(3 - (-174)/c). Suppose -2u + 5f = -k - 0, 3f = u - 10. What are the prime factors of u? 7 Let n = 2261 - 1959. List the prime factors of n. 2, 151 Suppose -3635 = -25y + 20y. What are the prime factors of y? 727 Let s(b) be the second derivative of 83b*3/6 + 9b*2/2 - 10b. List the prime factors of s(1). 2, 23 Let y(s) = -s*3 + 32s*2 + 34s - 21. What are the prime factors of y(33)? 2, 3 Let w = 35 + -34. What are the prime factors of -1(-42 + w + 0) + 0? 41 Let k = -1553 + 651. What are the prime factors of (1 + k/(-6))(-18)/(-12)? 227 What are the prime factors of ((-176)/(-24))/(6/153)? 11, 17 Let c = 2 - -10. Let x(y) = y*3 - 13y*2 + 7y + 14. Let v be x(c). Let l = v - -92. List the prime factors of l. 2, 23 Suppose -214x - 1400 = -219x. What are the prime factors of x? 2, 5, 7 Let y(t) be the second derivative of t4/12 - t3/6 - 9t2/2 + t. List the prime factors of y(9). 3, 7 Let v(i) = 0i + 4 - 21i3 + 22i3 - i2 + 8 + 3i. List the prime factors of v(5). 127 Let z = 18 + -16. Let q be (195/6)/(4/8). Suppose 0 = -2p - z, 56 + q = 4s - p. What are the prime factors of s? 2, 3, 5 Suppose 12m = 10m - 6. Let r = m + 105. What are the prime factors of r? 2, 3, 17 Suppose -3h + 9 = 3. Let t(w) = -2w3 - w2 + 3w + 3. Let y be t(-2). Suppose -hp = -y - 95. What are the prime factors of p? 2, 13 Let s = -36 + 37. What are the prime factors of (2 + -2 - -3 - -101)/s? 2, 13 Suppose -37 = 5p - 132. Suppose 4m - 28 = 4g, 5m + 0 = -3g + p. Suppose -3c + mk + 104 = 0, -3k - 31 = -c + 9. What are the prime factors of c? 2, 7 Let p(w) = w2 - 21w + 39. Let t be p(19). List the prime factors of t/(-2)-4(-338)/(-4). 13 Let d(p) = 15p - 15. Let b be d(4). Let o = b + -31. Suppose -11 = -v + o. What are the prime factors of v? 5 Suppose i + 2m - 236 = 0, 0m + 9 = -3m. List the prime factors of i. 2, 11 Suppose -5d - 29 = -2r, 5r - 2d + 0 = 20. Suppose 0 = -rv + 91 - 371. What are the prime factors of ((-4)/10)/(4/v)? 2, 7 Let n(f) be the second derivative of f4/12 + 4f*3/3 - 9f. Let y be n(-4). What are the prime factors of (y/(-12))/((-4)/(-6))? 2 Suppose -5j = -3j - 12. Let n = 5 - j. What are the prime factors of (0 - -1)/(n/(-22))? 2, 11 List the prime factors of -9(20/45)/(-2). 2 Let f = -7 + 7. What are the prime factors of 15(-2 + 6) + f? 2, 3, 5 Let k(f) = 7f + 1. Let q be k(-13). Let p be (-48)/(-10)q/(-4). Suppose -5g = -9g + p. What are the prime factors of g? 3 Suppose -2c = -7j + 11j - 2340, j = 5c - 5872. List the prime factors of c. 2, 587 Let a = 41 - 43. What are the prime factors of (243 - -2) + ((-8)/2)/a? 13, 19 Suppose -22h + 7h + 2505 = 0. Suppose h = 2j - 15. What are the prime factors of j? 7, 13 Suppose x = -3b - 395, -3 - 5 = 4x. Let c = b - -218. What are the prime factors of c? 3, 29 Let x = 184 + 147. List the prime factors of x. 331 Let a = 21 + -10. Let u(l) = -7l - 2l + al. What are the prime factors of u(12)? 2, 3 Suppose -5f + 19396 = -3q, -9584 = -5f + q + 9808. List the prime factors of f. 2, 7, 277 Suppose -2v = -7v + 10. Suppose 5b + 5u = 145, -4u + 6 + 2 = 0. Suppose i = vi - b. What are the prime factors of i? 3 Let h(b) = -3 + b2 - b - 1 - 5 + 4. Let l be h(3). What are the prime factors of 29 - (2 + l)/3? 2, 7 Let b = -26 - -59. Suppose -4 - b = -l. What are the prime factors of l? 37 Let w = -154 + 92. Let n = -39 - w. What are the prime factors of n? 23 Suppose 5j - 32 = -2s, j - 2s - 1 = 3s. Let r = -1 + 4. List the prime factors of 88/j + (-2)/r. 2, 7 Let r(x) = -x2 - x. Let p be r(-1). Suppose -4d = -16, -3k + pk + 2d - 2 = 0. What are the prime factors of 36 - (-9)/(k + 1)? 3, 13 Let c be 30/4 - 9/18. Let w(n) be the first derivative of n4/4 - 8n*3/3 + 5n*2 - 2n - 6. What are the prime factors of w(c)? 19 Suppose -2l + 6 = 3t, -12 = -2t - 7l + 3l. Suppose t = -2q + 77 + 67. Suppose 0 = -4g + 3y + q, 4 - 22 = -g - y. List the prime factors of g. 2, 3 Let c be -1 + -2(-2)/1. Suppose -cl - 54 = -v, 2v - 210 = -3v + 3l. Let p = v + 13. List the prime factors of p. 2, 13 Let h be (1 - (1 + 0))/(-3). Suppose hp = 2p - 106. What are the prime factors of p? 53 Let k = 1686 - 1165. List the prime factors of k. 521 Let q(z) = 42z*2 - 21z - 10. List the prime factors of q(-5). 5, 229 Let b be (-3)/(-9) + (-1)/(3/(-1469)). Suppose 0 = 5f - 395 - b. What are the prime factors of f? 3, 59 Let d(p) = -40p. What are the prime factors of d(-5)? 2, 5 Let i(k) = -7k + 7. Let r = 13 - 21. Let s be i(r). Let h = s + -36. List the prime factors of h. 3 Suppose 4w = -2x + 22518, -4w - x = -20624 - 1897. What are the prime factors of w? 3, 1877 Suppose -4*q + 1	{ "pile_set_name": "DM Mathematics" }
ulate the remainder when 21107740 is divided by 112. 108 Calculate the remainder when 47193236 is divided by 13. 12 Calculate the remainder when 1894296 is divided by 946269. 1758 What is the remainder when 16703 is divided by 605? 368 Calculate the remainder when 397850 is divided by 585. 50 Calculate the remainder when 27468294 is divided by 1379. 1372 What is the remainder when 382037769 is divided by 2890? 2889 What is the remainder when 3694330 is divided by 51? 43 Calculate the remainder when 107672 is divided by 1015. 82 What is the remainder when 35999 is divided by 7? 5 Calculate the remainder when 5551446 is divided by 1850480. 6 Calculate the remainder when 43899 is divided by 1979. 361 What is the remainder when 276978 is divided by 2396? 1438 What is the remainder when 309752 is divided by 44225? 177 What is the remainder when 58006 is divided by 57305? 701 What is the remainder when 445895 is divided by 2753? 2662 What is the remainder when 3519175 is divided by 879792? 7 Calculate the remainder when 12021094 is divided by 2542. 2518 Calculate the remainder when 11446428 is divided by 3422. 3260 Calculate the remainder when 21011116 is divided by 7003662. 130 What is the remainder when 1674050 is divided by 209253? 26 Calculate the remainder when 3496812 is divided by 62. 12 Calculate the remainder when 1019440 is divided by 10125. 6940 Calculate the remainder when 1241901 is divided by 245. 241 Calculate the remainder when 218745 is divided by 1968. 297 What is the remainder when 3330 is divided by 1915? 1415 Calculate the remainder when 6059235 is divided by 3637. 3630 What is the remainder when 39249740 is divided by 2180541? 2 What is the remainder when 35879 is divided by 25908? 9971 What is the remainder when 297657986 is divided by 114? 110 Calculate the remainder when 136772 is divided by 135917. 855 Calculate the remainder when 2314726 is divided by 2736. 70 Calculate the remainder when 53210857 is divided by 9536. 9513 What is the remainder when 11865921 is divided by 101418? 15 Calculate the remainder when 21627643 is divided by 292. 79 Calculate the remainder when 129709 is divided by 4054. 4035 What is the remainder when 29136 is divided by 14060? 1016 Calculate the remainder when 246755 is divided by 290. 255 Calculate the remainder when 14155 is divided by 13539. 616 Calculate the remainder when 5381767 is divided by 97849. 72 What is the remainder when 39006951 is divided by 2572? 2571 What is the remainder when 51658 is divided by 6247? 1682 Calculate the remainder when 7314464 is divided by 7314460. 4 Calculate the remainder when 940402 is divided by 217. 141 Calculate the remainder when 85132 is divided by 4431. 943 Calculate the remainder when 4144755 is divided by 1475. 5 Calculate the remainder when 1455798 is divided by 2226. 2220 Calculate the remainder when 111601 is divided by 35645. 4666 Calculate the remainder when 769520 is divided by 769211. 309 Calculate the remainder when 3838957 is divided by 17939. 11 What is the remainder when 50872 is divided by 163? 16 What is the remainder when 553860 is divided by 21? 6 Calculate the remainder when 623811742 is divided by 72. 70 Calculate the remainder when 2492558 is divided by 379. 254 Calculate the remainder when 7711112 is divided by 208408. 16 What is the remainder when 7698 is divided by 3691? 316 Calculate the remainder when 98561287 is divided by 443. 432 Calculate the remainder when 5733244 is divided by 1906. 1902 Calculate the remainder when 63707 is divided by 283. 32 What is the remainder when 78082 is divided by 47? 15 Calculate the remainder when 8995051 is divided by 178. 177 What is the remainder when 1090443 is divided by 439? 406 What is the remainder when 1792996 is divided by 18664? 1252 Calculate the remainder when 30277255 is divided by 272768. 7 Calculate the remainder when 1942882 is divided by 394. 68 What is the remainder when 233605 is divided by 17751? 2842 Calculate the remainder when 18712806 is divided by 4678197. 18 What is the remainder when 146130 is divided by 18250? 130 What is the remainder when 690744 is divided by 1041? 561 What is the remainder when 1145128 is divided by 6935? 853 Calculate the remainder when 987459482 is divided by 53. 52 What is the remainder when 3163319 is divided by 489? 467 What is the remainder when 596725 is divided by 3573? 34 What is the remainder when 1628963530 is divided by 7? 5 What is the remainder when 1114728 is divided by 95? 93 Calculate the remainder when 471897 is divided by 2785. 1232 Calculate the remainder when 2850439 is divided by 126. 67 What is the remainder when 1147801 is divided by 573899? 3 Calculate the remainder when 145267108 is divided by 4909. 4889 Calculate the remainder when 17582240 is divided by 3795. 5 Calculate the remainder when 6440370 is divided by 1910. 1760 What is the remainder when 11074710 is divided by 561? 9 Calculate the remainder when 8101002 is divided by 329. 35 Calculate the remainder when 22021465 is divided by 1195. 5 What is the remainder when 1730845 is divided by 432699? 49 Calculate the remainder when 2832229 is divided by 28605. 334 What is the remainder when 749136 is divided by 2025? 1911 What is the remainder when 196502 is divided by 1097? 139 Calculate the remainder when 1082879 is divided by 541402. 75 Calculate the remainder when 5458455 is divided by 61. 53 What is the remainder when 82577 is divided by 40664? 1249 What is the remainder when 134433 is divided by 7898? 167 Calculate the remainder when 178237 is divided by 9899. 55 Calculate the remainder when 18174852 is divided by 18174848. 4 Calculate the remainder when 2735352 is divided by 2777. 7 What is the remainder when 14340518 is divided by 11? 5 What is the remainder when 957051 is divided by 11815? 36 Calculate the remainder when 344973 is divided by 4480. 13 What is the remainder when 156452239 is divided by 6004? 7 What is the remainder when 2034938 is divided by 78? 74 Calculate the remainder when 23973 is divided by 3414. 75 Calculate the remainder when 2302825 is divided by 943. 19 Calculate the remainder when 180595 is divided by 16911. 11485 Calculate the remainder when 584045 is divided by 97329. 71 What is the remainder when 5027153 is divided by 30? 23 What is the remainder when 269803 is divided by 19927? 10752 What is the remainder when 13134 is divided by 11482? 1652 What is the remainder when 228982 is divided by 45791? 27 Calculate the remainder when 730900 is divided by 75. 25 Calculate the remainder when 59752358 is divided by 79. 76 Calculate the remainder when 15328648 is divided by 3836. 3828 What is the remainder when 14798926 is divided by 2959780? 26 Calculate the remainder when 76572 is divided by 12654. 648 Calculate the remainder when 9841515 is divided by 383. 330 Calculate the remainder when 2052103 is divided by 73. 0 What is the remainder when 73389247 is divided by 41? 26 Calculate the remainder when 49028 is divided by 44. 12 Calculate the remainder when 67997884 is divided by 224. 220 What is the remainder when 3155655 is divided by 90? 75 What is the remainder when 2803580 is divided by 1401790? 0 Calculate the remainder when 8377413 is divided by 2792467. 12 Calculate the remainder when 1822542 is divided by 30. 12 Calculate the remainder when 1312432 is divided by 12114. 4120 Calculate the remainder when 27609 is divided by 10841. 5927 What is the remainder when 187428 is divided by 21? 3 What is the remainder when 30509 is divided by 15136? 237 What is the remainder when 2966241 is divided by 1025? 916 What is the remainder when 154983 is divided by 1575? 633 Calculate the remainder when 57132 is divided by 1386. 306 Calculate the remainder when 1735236558 is divided by 178. 176 Calculate the remainder when 12523893 is divided by 341. 327 Calculate the remainder when 56060622 is divided by 562. 560 Calculate the remainder when 57783704 is divided by 28891852. 0 What is the remainder when 68969319 is divided by 116? 11 Calculate the remainder when 9284929 is divided by 2353. 2344 What is the remainder when 505782 is divided by 82? 6 Calculate the remainder when 208583 is divided by 8340. 83 Calculate the remainder when 166766 is	{ "pile_set_name": "DM Mathematics" }
rrhkwrrkjjj. 9/85 Two letters picked without replacement from {k: 1, g: 2, q: 1, n: 4, p: 1}. Give prob of picking 1 g and 1 q. 1/18 What is prob of picking 2 k, 1 t, and 1 o when four letters picked without replacement from momoototojjkjkmosjoo? 16/4845 Two letters picked without replacement from {e: 3, g: 3, y: 2}. Give prob of picking 2 y. 1/28 What is prob of picking 1 b, 2 q, and 1 r when four letters picked without replacement from {q: 2, o: 1, b: 1, y: 1, r: 2}? 2/35 Two letters picked without replacement from nlbbbbblnnn. Give prob of picking 2 l. 1/55 What is prob of picking 2 w and 2 b when four letters picked without replacement from wbwwwbw? 2/7 Calculate prob of picking 2 y and 2 n when four letters picked without replacement from {y: 4, n: 3}. 18/35 What is prob of picking 1 o and 1 j when two letters picked without replacement from {i: 3, j: 1, n: 3, l: 2, o: 1, e: 1}? 1/55 What is prob of picking 1 k and 2 m when three letters picked without replacement from {v: 5, k: 1, o: 1, m: 6, n: 1}? 15/364 What is prob of picking 1 r and 1 a when two letters picked without replacement from {r: 3, a: 1}? 1/2 Calculate prob of picking 1 r and 1 n when two letters picked without replacement from gghnhrhnh. 1/18 What is prob of picking 2 r and 2 z when four letters picked without replacement from {z: 1, r: 1, h: 8, p: 9}? 0 Three letters picked without replacement from lsaeadldsddkdad. What is prob of picking 1 e and 2 d? 3/91 What is prob of picking 1 x and 1 z when two letters picked without replacement from wlslxzxdd? 1/18 What is prob of picking 1 t, 1 c, and 1 n when three letters picked without replacement from yynyyytnyycn? 3/220 Three letters picked without replacement from bbndnnb. What is prob of picking 1 d and 2 b? 3/35 Calculate prob of picking 1 y and 1 v when two letters picked without replacement from {o: 3, y: 3, v: 2, j: 3, b: 3}. 6/91 Two letters picked without replacement from {g: 7, v: 2, o: 1, s: 4, h: 3}. Give prob of picking 2 g. 21/136 What is prob of picking 1 z, 1 f, and 1 r when three letters picked without replacement from {t: 2, b: 3, r: 1, h: 1, z: 3, f: 1}? 1/55 Three letters picked without replacement from mlllllllllllllllllll. Give prob of picking 1 m and 2 l. 3/20 Calculate prob of picking 2 g, 1 h, and 1 j when four letters picked without replacement from {e: 1, h: 1, c: 2, j: 2, g: 2}. 1/35 Calculate prob of picking 2 i when two letters picked without replacement from {n: 5, y: 4, e: 4, i: 2}. 1/105 Three letters picked without replacement from {y: 3, x: 1, b: 3}. Give prob of picking 3 b. 1/35 Two letters picked without replacement from jjjeejjjjjjjjjjejej. What is prob of picking 1 e and 1 j? 20/57 Four letters picked without replacement from {z: 2, y: 3, s: 1, h: 3, r: 1}. What is prob of picking 1 y, 1 r, and 2 z? 1/70 What is prob of picking 1 z and 3 k when four letters picked without replacement from kkkzkkzzzxzzkkkkk? 36/119 What is prob of picking 1 k and 1 z when two letters picked without replacement from zzkzkzkzzz? 7/15 Two letters picked without replacement from {p: 16, t: 4}. Give prob of picking 2 t. 3/95 Calculate prob of picking 1 b and 1 f when two letters picked without replacement from bbfbfbbbb. 7/18 Three letters picked without replacement from {s: 4, p: 10, d: 5, n: 1}. Give prob of picking 1 s and 2 p. 3/19 Calculate prob of picking 2 t when two letters picked without replacement from etteett. 2/7 What is prob of picking 2 m and 1 j when three letters picked without replacement from {j: 4, m: 3}? 12/35 Two letters picked without replacement from knllkllkllklwklllll. What is prob of picking 1 n and 1 k? 5/171 Two letters picked without replacement from aajajajcjjcjjj. What is prob of picking 1 c and 1 j? 16/91 Two letters picked without replacement from uuuskdkfsuusfstuff. What is prob of picking 1 s and 1 u? 8/51 What is prob of picking 2 p, 1 s, and 1 t when four letters picked without replacement from tscspcsrccspssscs? 2/595 Two letters picked without replacement from hmmmhccchhdsh. What is prob of picking 1 d and 1 c? 1/26 Calculate prob of picking 4 c when four letters picked without replacement from cgcg. 0 Three letters picked without replacement from {u: 4, t: 7}. What is prob of picking 1 u and 2 t? 28/55 Calculate prob of picking 4 x when four letters picked without replacement from {a: 2, x: 6}. 3/14 Calculate prob of picking 4 y when four letters picked without replacement from {y: 6, m: 2}. 3/14 Three letters picked without replacement from xzfstssst. Give prob of picking 1 f, 1 x, and 1 t. 1/42 Four letters picked without replacement from {l: 3, p: 1, y: 12}. What is prob of picking 4 y? 99/364 Four letters picked without replacement from {q: 4, r: 2, v: 3}. Give prob of picking 3 q and 1 v. 2/21 Calculate prob of picking 1 e and 1 w when two letters picked without replacement from {w: 1, c: 1, e: 2, a: 2, f: 1, q: 1}. 1/14 Two letters picked without replacement from {k: 2, v: 4, u: 1, d: 3}. What is prob of picking 2 v? 2/15 Calculate prob of picking 1 e and 1 v when two letters picked without replacement from eerveervm. 2/9 Three letters picked without replacement from {c: 2, k: 2, z: 2, r: 3}. What is prob of picking 2 z and 1 k? 1/42 Calculate prob of picking 2 k and 1 w when three letters picked without replacement from kkkqqqwq. 3/56 Three letters picked without replacement from lrsjsrjksj. Give prob of picking 1 k and 2 s. 1/40 What is prob of picking 4 p when four letters picked without replacement from pppppppppp? 1 Two letters picked without replacement from zazpppppzpwpzqwpzwz. Give prob of picking 1 w and 1 q. 1/57 Three letters picked without replacement from vvptpzzdtnzvvznztz. What is prob of picking 1 p and 2 n? 1/408 What is prob of picking 2 f when two letters picked without replacement from {x: 3, z: 1, f: 4, p: 6}? 6/91 Four letters picked without replacement from ccouomzz. What is prob of picking 2 o and 2 z? 1/70 Calculate prob of picking 3 l when three letters picked without replacement from lmll. 1/4 Two letters picked without replacement from xjx. What is prob of picking 1 j and 1 x? 2/3 Two letters picked without replacement from {v: 1, c: 2}. What is prob of picking 1 c and 1 v? 2/3 Four letters picked without replacement from hffhfhfhhf. Give prob of picking 4 f. 1/42 Calculate prob of picking 3 m when three letters picked without replacement from {m: 4}. 1 Four letters picked without replacement from smmjmmmjb. What is prob of picking 1 s, 1 m, and 2 b? 0 Calculate prob of picking 3 a when three letters picked without replacement from aaaaaaaaaaaaaiaaaaaa. 17/20 What is prob of picking 1 c and 1 m when two letters picked without replacement from ddcddmdcjjdcqjdmjj? 2/51 Two letters picked without replacement from {k: 7, b: 2}. What is prob of picking 2 k? 7/12 Two letters picked without replacement from {y: 5, d: 2, h: 6, x: 2, t: 3, u: 1}. What is prob of picking 2 t? 1/57 Two letters picked without replacement from {z: 8, l: 3}. What is prob of picking 1 l and 1 z? 24/55 Calculate prob of picking 1 k, 1 t, and 1 z when three letters picked without replacement from utzkkzet. 1/7 Calculate prob of picking 1 s, 1 t, and 1 d when three letters picked without replacement from {s: 6, j: 1, t: 1, d: 1}. 1/14 What is prob of picking 1 b and 2 u when three letters picked without replacement from {u: 4, p: 4, b: 2, t: 3, f: 3}? 3/140 Four letters picked without replacement from aagaaggagagg. What is prob of picking 3 a and 1 g? 8/33 What is prob of picking 1 r, 1 g, and 1 q when three letters picked without replacement from {k: 4, r: 1, q: 2, g: 2, e: 2, w: 1}? 1/55 What is prob of picking 1 z and 1 k when two letters picked without replacement from zzkkzkz? 4/7 Three letters picked without replacement from mrmejcrf. Give prob of picking 1 e, 1 j, and 1 r. 1/28 Two letters picked without replacement from {q: 4}. What is prob of picking 2 q? 1 Three letters picked without replacement from nnnnnneedn. Give prob of picking 1 d and 2 n. 7/40 Three letters picked without replacement from noooonn. What is prob of picking 3 o? 4/35 Three letters picked without replacement from {h: 7, a: 7}. Give prob of picking 3 h. 5/52 Four letters picked without	{ "pile_set_name": "DM Mathematics" }
-230 - x. Let k = 66 + n. Which is bigger: k or 0.3? 0.3 Let z be (-36)/(-21)14/(-10). Let b be (-10 - (-29 + 18))-3. Are b and z equal? False Let p(a) = -8a + 56 - 134 + 46. Let z be p(-9). Is z at least 40? True Let z = 18969 + -18988. Which is smaller: -575/29 or z? -575/29 Let n(z) = -126z + 6612. Let t be n(93). Which is greater: -5105 or t? -5105 Suppose 2c = -t + 5, 4c + 30 + 5 = 3t. Let b be t/(-15) + (-6)/(-10). Let a = -0.8 + 0.8. Is a at most as big as b? True Let a = 1383374/79 - 17512. Are -1 and a nonequal? True Suppose 0 = -3r + 2f + 35, 4r - 4f - 50 = 2. Suppose -10m - r = -19. Is -1/8 at most m? True Let q = -1.7 + 1.601. Let r = q - -53.099. Let o = 48 - r. Which is bigger: 1/2 or o? 1/2 Let t be (-3 - -17)20/5. Which is greater: t or 100? 100 Suppose 2n = -5z - 69, 4z + 35 = -4n - 25. Let j(b) = 4b + 56. Let c be j(z). Suppose -k = 4t, -3t + t = -ck. Which is smaller: t or -1/37? -1/37 Let v = -101 - -100.7. Suppose -2s + 5d + 11 = 0, 5d + 39 = -14s + 12s. Which is bigger: v or s? v Let c = 166.234 + -166. Let x = -0.05 + c. Let r = -0.106 - x. Which is greater: r or -1? r Suppose 5h + 49 = 19. Let j be -1((0 - h) + -2). Let q = j + 2. Which is smaller: -1 or q? q Let i(z) = z*3 - 14z*2 + 11z + 56. Let r be i(13). Let f(c) = -c*3 + 5c*2 + 4c - 1. Let x be f(4). Which is smaller: x or r? r Let t = -64852/3 + 449335/21. Let i = 131 - 350. Let h = t - i. Is 0 less than h? False Let r(y) = y + 4. Let q be r(-10). Let x be q/714/(-4). Do 2 and x have the same value? False Let v = 4350 + -13052/3. Which is smaller: 5179 or v? v Let n be 1365/702(-4)/(-749)-3. Is 1 equal to n? False Suppose 3y - 2u + 4u - 5 = 0, -u + 4 = 3y. Let k = 166 + -171. Let s be 4/(-30)k/120-20. Is y <= s? False Suppose 4j = -0j - d - 1968, j - 19d = -492. Which is greater: j or 5? 5 Let x be ((-36)/21)/(654966/567). Is 1 greater than x? True Let n = 10 + -11. Let f be (135/(-54))/((-1)/2). Suppose -4b - 60 = 4v, fb + 44 + 14 = -4v. Which is greater: n or v? n Let t = 2128/2475 - -22895189/17325. Let j = -1322 + t. Let w = 1/35 + j. Do -4 and w have different values? True Let p(j) = 528j - 5809. Let g be p(11). Let t be 2782/(-13860) + (-1)/(-5). Which is smaller: t or g? g Let g = -0.09 + 0.048. Let q = 1035 - 1043.958. Let s = q + g. Do 2 and s have different values? True Let y(t) = 212t*2 + t - 3. Let c be y(1). Suppose 4k - 9k = -c. Is k smaller than 43? True Suppose -96g + 90g - 18 = 0. Let a be ((-24)/(-45) + -2)/(g/70). Which is smaller: a or 34? 34 Let y be 20/8 - (-433)/(-2). Let x = 213 + y. Let c = 2 - 2.1. Is c > x? True Let k = -340.2 + -77.8. Let p = k + 417. Which is smaller: 14/11 or p? p Let f = -6949/4408 + -25/232. Let d = -19552 - -19550. Is d at most f? True Let d = -3 - -2.8. Let z = 5.05 - 3.58. Let h = z + -1.5. Which is smaller: d or h? d Let f(m) = -3 + 2 + 268m*3 + 2m - 199m3. Let w be f(1). Let g = 516/7 - w. Which is bigger: 4 or g? 4 Let t = 371 + -365. Suppose 4s = -3o - o + 16, s - o = t. Which is bigger: s or 4? s Suppose -11j - 2114 - 1851 - 6496 = 0. Is -952 >= j? False Let u = 1/29454 - -29343547/14727. Is 1992 > u? False Let u = -8493 + 8466. Is u >= -72? True Let q be -51 + 253/23. Suppose 3c - q = 4d, -d = 5c - 8 - 2. Suppose -cp = o + 41, 19 = o - 5p + 46. Does -38 = o? False Let r be 81/108(28/(-12) - -2). Is r at least as big as 129? False Suppose 0 = -12v - 2370 - 1566. Is -329 > v? False Let n be 3/12 - -3(-303)/(-12). Suppose -4r - 80 = -4h - r, -2r - n = -4h. Is 1 > h? False Suppose 40 = 201a - 209a. Let k be (5976/2985 + -2)a. Is k > 0? False Let p = -194191/8 - -24506. Let s = p + -232. Which is greater: 0 or s? s Let z = -120/391 + -248707/1173. Is -213 equal to z? False Let q = 267/52 - 119/208. Let r = q - 3691/816. Is r < 0? False Let r = 54 - 61. Let v be (-2 - 121/(-77)) + (-675)/r. Is 97 <= v? False Let k(d) = d*3 + 13d*2 - 18. Suppose 2g - 3g + 3r - 22 = 0, -5g = -5r + 80. Let b be k(g). Let y(q) = -39q + 138. Let p be y(4). Is p greater than b? False Let b = -68 + 140. Suppose -5y - b - 8 = 0. Let l = 13595 + -13610. Which is smaller: y or l? y Let n = 4555 + -5559. Which is smaller: n or -1003? n Suppose -77t = -118 + 2505. Is t not equal to -43? True Let l be (-4)/14 - (-976)/(-14). Let j be 2/9 + l/180. Let v = -7261 + 7261. Does v = j? False Let s = -43 - -43. Suppose 4j + 54 = 58. Let z be (1995/(-20))/(-19) - (4 - j). Is z greater than or equal to s? True Suppose -125v - 2209314 = -86v + 138v. Is v at most as big as -12484? False Let c be ((-504)/60 - (-14)/10)2. Which is smaller: 504 or c? c Let z(r) = -9r. Let g be z(1). Let u(t) = -8t - 82. Let x be u(g). Is x smaller than -5? True Let i = -10713 + 7372. Which is smaller: -3342 or i? -3342 Let u = -0.23897 - 2.76103. Is u not equal to -1956? True Let g(i) = -10i + 164. Let p be g(16). Suppose 60 = 2q - m - 333, pq - 791 = m. Which is smaller: q or 200? q Let n be (-718)/32 - (-637)/49. Which is smaller: -8 or n? n Let t = -150.39 - 3.61. Let r = t - -154.081. Let v = 0.219 + r. Which is bigger: v or 0? v Let z = -0.4 + -0.6. Let t = z - -2. Let k = 2.882 + -0.882. Is t greater than k? False Let a(n) = n2 + 17n + 28. Let l be a(-21). Suppose d = 3r + l, 4d - 6r + 10r = 528. Is d <= 126? False Let j = -1928 + 1921. Is j at most 246? True Suppose -8247 = 3n + 4z, -75n = -78n - z - 8238. Is n at least as big as -2743? False Let v be (-7)/(-14) - (-267)/(-6). Let c = 9 + v. Let l be ((-10)/c)/((-3)/(-12)). Which is smaller: l or 2? l Let t = -173/5 - -35. Let j = 5.34 - -19.61. Let k = j - -2.05. Which is greater: t or k? k Let v = 35.5 - -127.5. Let s = v - 163. Are -1.44 and s non-equal? True Let x be -5 - (-13 + (-221655)/(-27706)). Is 1 not equal to x? True Let r be 60/(-200)475/13680. Suppose t + 5 = 6t. Is r bigger than t? False Suppose 0 = 5w + 5c - 35, 4w + 26 = 5c. Which is smaller: 27/481 or w? 27/481 Let t = -57 - -61. Suppose 0 = 8p - 36 - 52. Suppose -9i = -pi + 6. Is t smaller than i? False Let f(n) = -n + 1. Let v be f(-5). Suppose 0 = -5z + 2d + 4, -vz + 5d = -z - 10. Is z at most as big as 3/71? True Suppose 5w = -4c + 17, 5c = -0c - 2w + 17. Suppose -3o + 6 = -cp - 24, 30 = -2p - 3o. Are -13 and p equal? False Let r = -446.85 - 120.15. Is 2 not equal to r? True Let a = -167.6 + 168.6. Is a > -287? True Let u be ((-4)/88)/((-12753)/4874). Let k be (-135)/(-1890) - (-3611)/(-50358). Let y = k + u. Which is smaller: y or 1? y Let z(r) = 10r2 - 4r - 5. Let j be z(-6). Let h be (-11 - -10)(-14 + -365). Does h = j? True Let p be (-8)/(-10)(-150)/2400. Which is smaller: p or -7/3466? -7/3466 Let v(k) = -2k - 12. Let r be v(-2). Let a be (-17)/136 - 601/r. Which is greater: a or 76? 76 Suppose -2m = -5a + 86, 49m + a = 44m - 188. Are m and -9/2 unequal? True Let v be (-2 + 724/14)(-14)/(-1). Let l = -2691/4 + v. Suppose 3p + p = 5b - 115, -3b = -2p - 69. Which is smaller: l or b? b Let b = 152 - 215. Let l = 1645/9 + -183. Which is smaller: l or b? b Let n = -70 - -66. Let j = n + 24. Is j bigger than -0.3? True Let f(l) = l3 - 127l*2 + 127l - 435. Let n be f(126). Is n at most as big as -313? False Let y = 1457 - 1456. Is -104 less than y? True Suppose 46966 = 18f + 2056. Is 2494 at most f? True Suppose 2r = -5y + 22, -265r - 9 = -262r - 3y. Which is smaller: -50/117 or r? -50/117 Let k be (-20)/(-1170)603(14 + -1). Which is smaller: k or 121? 121 Let l be (2/(-3))/(18/(-27)). Let k be (0 - -3l)/((-2)/6). Let u be (8 - (0 - -1))-1. Is k equal to u? False Let s = 2158 - 2164. Let d be ((-93)/30)/((-2)/(-5)) + 2. Is d >= s? True Let c(u) = u*2 + 8u - 88. Let s be c(-14). Let t(y) = y*2 + 2y - 8. Let z be t(s). Which is bigger: -1 or z? z Let y(c) = c*3 - 46c*2 + 89c - 42. Let z be y(44). Suppose 4u = -5a + za, 3a = u. Is 2/893 at most a? False Let q be 1(-6 + 150/25). Let c = 34 - 131/4. Is c less than q? False Let w = -16941 + 15854. Is w equal to -1090? False Suppose -529 = 3b - 5v, 160b - 156b - v = -694. Is b bigger than -205? True Let z be ((-40)/90)/((10/9)/(-5)). Let d be z/14(35/(-5) + 9). Which is smaller: -2 or d? -2 Let n(z) = 25z*3 + z	{ "pile_set_name": "DM Mathematics" }
5u3 - 15u*2/2 - 20u - 15/2. 5(u - 3)(u + 1)(2u + 1)/2 Factor -3p2/7 - 1230p/7 - 696. -3(p + 4)(p + 406)/7 Factor -2a3/7 - 22a*2/7 - 20a/7. -2a(a + 1)(a + 10)/7 Factor -o4 + 60o3 + o2 - 60o. -o(o - 60)(o - 1)(o + 1) What is h in 4h2 - 56h - 128 = 0? -2, 16 Factor i*3 - 14i*2 - 49i - 34. (i - 17)(i + 1)(i + 2) Factor -4q3 - 292q*2 - 5180q + 5476. -4(q - 1)(q + 37)*2 Factor 2d*2/7 - 32/7. 2(d - 4)(d + 4)/7 Factor 3p*5/2 + 12p*4 + 33p*3 + 36p*2 + 27p/2. 3p(p + 1)*2(p + 3)*2/2 Find t such that 7t*4/5 - 234t*3/5 + 92t*2/5 + 234t/5 - 99/5 = 0. -1, 3/7, 1, 33 Solve g*3/9 - 298g*2/3 + 595g/3 - 892/9 = 0. 1, 892 Determine d, given that 4d2 - 1200d - 1204 = 0. -1, 301 Determine q, given that 100q5 - 380q*4 - 744q*3 + 752q*2 - 160q = 0. -2, 0, 2/5, 5 Factor 3o3/4 - 999o*2/4 + 1989o/4 - 993/4. 3(o - 331)(o - 1)*2/4 Determine l so that 4l*3 - 208l - 384 = 0. -6, -2, 8 Let 2d4 - 10d*3 + 2d*2 + 42d - 36 = 0. What is d? -2, 1, 3 Factor p*4 - 2p2 + 1. (p - 1)2(p + 1)2 Suppose 3s*5/4 - 21s*4/4 + 45s*3/4 - 39s*2/4 + 3s = 0. Calculate s. 0, 1, 4 Factor -g*3/2 - 40g*2 + 163g/2 - 41. -(g - 1)*2(g + 82)/2 Let -2n5/9 + 4n*3/3 + 16n*2/9 + 2n/3 = 0. Calculate n. -1, 0, 3 Suppose -2b2 + 296b = 0. Calculate b. 0, 148 Solve i*4 + 5i*3 + 3i*2 - 5i - 4 = 0. -4, -1, 1 Find v, given that v*2 - 27v - 28 = 0. -1, 28 Solve 4k5 - 124k*4 + 1156k*3 - 3364k*2 + 3736k - 1408 = 0 for k. 1, 2, 11, 16 Determine y so that 3y4 - 212y*3 + 4640y*2 - 30000y + 18000 = 0. 2/3, 10, 30 Solve 3j2 - 126j + 123 = 0 for j. 1, 41 Determine s so that 3s4/7 + 30s*3/7 - 3s*2/7 - 246s/7 + 216/7 = 0. -9, -4, 1, 2 Determine g, given that 10g5 - 152g*4/3 + 26g*3 + 188g*2/3 + 16g = 0. -3/5, -1/3, 0, 2, 4 Find w such that w*2/2 - 4w - 24 = 0. -4, 12 Solve -3c3/4 - 15c*2/4 + 6c + 9 = 0 for c. -6, -1, 2 Factor -2c3/7 + 22c*2/7 - 36c/7. -2c(c - 9)(c - 2)/7 Solve -x5/8 + 19x*4/8 - 27x*3/2 + 45x*2/2 = 0. 0, 3, 6, 10 Let -5s*4 + 30s*2 - 40s + 15 = 0. What is s? -3, 1 Suppose -14z5/3 - 74z*4/3 + 176z*3/3 + 560z*2/3 - 288z - 96 = 0. What is z? -6, -3, -2/7, 2 Factor -f*2/3 + 42f + 127/3. -(f - 127)(f + 1)/3 Suppose -2r*4/5 + 4r*3/5 + 18r*2/5 - 4r/5 - 16/5 = 0. What is r? -2, -1, 1, 4 Let 36r5 + 24r*4 - 140r*3 - 96r*2 - 16r = 0. What is r? -2, -1/3, 0, 2 Factor -25a4 + 49a*3 + 102a*2 - 196a - 8. -(a - 2)*2(a + 2)(25a + 1) Suppose -l*3/4 - 5l*2 - 17l/4 + 19/2 = 0. What is l? -19, -2, 1 Let -4x2 - 20144x/3 - 13424/3 = 0. What is x? -1678, -2/3 Solve -2a5/3 - 20a*4 - 616a*3/3 - 2380a*2/3 - 594a + 4840/3 = 0. -11, -5, -4, 1 Determine o so that 21o4 - 100o*3 - 38o*2 + 68o - 15 = 0. -1, 1/3, 3/7, 5 Factor 2n5 + 78n*4. 2n*4(n + 39) Factor 138675s2 - 5160s + 48. 3(215s - 4)2 Suppose r2/4 - 3r/2 = 0. What is r? 0, 6 Solve 4o*3 - 56o*2 + 28o + 312 = 0 for o. -2, 3, 13 Find i such that -171500i3 - 58800i*2 - 6720i - 256 = 0. -4/35 Factor -3o3 - 37o*2 - 45o - 11. -(o + 1)(o + 11)(3o + 1) Let -l5/5 - 9l4/5 - l3 + 29l2/5 + 42l/5 + 16/5 = 0. What is l? -8, -1, 2 Suppose -2y3 + 276y*2 - 12696y + 194672 = 0. What is y? 46 Find b, given that 2b4/19 + 26b*3/19 + 22b*2/19 - 26b/19 - 24/19 = 0. -12, -1, 1 Let 9h5 + 24h*4 - 33h*3 - 84h*2 - 36h = 0. Calculate h. -3, -1, -2/3, 0, 2 Determine b so that -2b4/7 + 34b*3/7 - 136b*2/7 + 200b/7 - 96/7 = 0. 1, 2, 12 Find j such that 20j4 - 32j*3 - 36j*2 + 32j + 16 = 0. -1, -2/5, 1, 2 Find o such that o*3/6 - 12o*2 - 153o/2 - 117 = 0. -3, 78 Suppose k*4 - 27k*3 - 30k*2 + 56k = 0. What is k? -2, 0, 1, 28 Suppose b4/3 + b3 + b*2/3 - b - 2/3 = 0. Calculate b. -2, -1, 1 Determine z, given that -2z*3 - 6z*2 + 32z + 96 = 0. -4, -3, 4 Solve d*5 - 1883d*4 + 887358d*3 - 876074d*2 - 4421759d - 2656443 = 0 for d. -1, 3, 941 Suppose 5z3 + 20z*2 - 400z + 960 = 0. Calculate z. -12, 4 Determine u so that -2u3/15 + 812u*2/5 + 2u/15 - 812/5 = 0. -1, 1, 1218 Factor 26d3/7 + 186d*2/7 + 288d/7 + 40/7. 2(d + 2)(d + 5)(13d + 2)/7 Factor g*4/2 + 5g3/2. g3(g + 5)/2 Find v such that -3v*3 + 42v*2 + 51v - 90 = 0. -2, 1, 15 What is y in 2y5/9 - 110y*4/9 + 1664y*3/9 - 4048y*2/9 - 416y/9 + 5408/9 = 0? -1, 2, 26 Factor -2n3 - 28n*2 + 98n - 68. -2(n - 2)(n - 1)(n + 17) Let 6j*4 - 40j*3 - 72j*2 + 64j = 0. Calculate j. -2, 0, 2/3, 8 Suppose r*4/5 + 19r*3/5 + 7r*2 + 17r/5 = 0. Calculate r. -17, -1, 0 Let -4k2 + 416k - 2352 = 0. Calculate k. 6, 98 Factor -3u3/7 - 27u*2/7 - 24u/7 + 180/7. -3(u - 2)(u + 5)(u + 6)/7 Let 2j*2 - 900j + 101250 = 0. What is j? 225 Find n such that -16n3 + 2740n*2 + 2068n - 688 = 0. -1, 1/4, 172 Factor -3s4/5 - 132s*3/5 - 378s*2/5 - 372s/5 - 123/5. -3(s + 1)3(s + 41)/5 Factor -11k2 + 15k - 4. -(k - 1)(11k - 4) Factor x*2/5 - 11x/5 - 26/5. (x - 13)(x + 2)/5 Let 4x*2 + 88x + 484 = 0. Calculate x. -11 Factor 2o2/9 - 20o/3 + 448/9. 2(o - 16)(o - 14)/9 What is n in 5n4 + 90n*3 - 215n*2 - 300n = 0? -20, -1, 0, 3 Factor 6v2 - 11v - 2. (v - 2)(6v + 1) Factor 5p2 + 3820p + 729620. 5(p + 382)2 Find z such that -5z*3 + 2210z*2 - 6585z = 0. 0, 3, 439 What is x in 4x2/9 - 88x/9 + 28/3 = 0? 1, 21 Let 4t4 - 1820t*3 - 7328t*2 - 7344t = 0. What is t? -2, 0, 459 Solve -k*5 - 47k*4 + 97k*3 - 49k*2 = 0. -49, 0, 1 Factor -4s*4 + 36s*3 - 80s*2. -4s*2(s - 5)(s - 4) Determine r so that -5r*5/2 + 165r*4/2 - 735r*3/2 + 995r*2/2 - 210r = 0. 0, 1, 3, 28 Let -2n3/9 + 8n*2/3 + 22n - 2420/9 = 0. Calculate n. -10, 11 Find y, given that 3y5/5 + 22y*4 - 514y*3/5 + 768y*2/5 - 449y/5 + 82/5 = 0. -41, 1/3, 1, 2 Suppose -2b3/9 + 58b*2/9 - 98b/3 + 46 = 0. What is b? 3, 23 Factor -h*3/4 - 17h*2/4 - 31h/4 - 15/4. -(h + 1)*2(h + 15)/4 Factor 8q5 - 26q*4 + 29q*3 - 11q2 - q + 1. (q - 1)3(2q - 1)(4q + 1) Determine k, given that 3k5 + 6k*4 - 12k*3 - 6k*2 + 9k = 0. -3, -1, 0, 1 Factor 2o5/7 + 30o*4/7 + 160o*3/7 + 320o*2/7 - 512/7. 2(o - 1)(o + 4)4/7 Factor -2t*3/9 + 160t*2/9 - 466t/9 + 308/9. -2(t - 77)(t - 2)(t - 1)/9 Solve 2c*4/13 - 20c*3/13 - 2c*2/13 + 20c/13 = 0 for c. -1, 0, 1, 10 Determine x, given that 5x5 + 10x*4 - 65x*3 + 50x*2 = 0. -5, 0, 1, 2 Solve -4s*2/7 + 382s/7 + 192/7 = 0. -1/2, 96 Determine q so that 2q4/13 + 8q*3/13 - 36q*2/13 + 40q/13 - 14/13 = 0. -7, 1 Factor -4x5/7 + 32x*4/7 - 88x*3/7 + 96x*2/7 - 36x/7. -4x(x - 3)*2(x - 1)2/7 Solve -w3 - 45w2 - 168w + 8624 = 0. -28, 11 Determine b so that b5/8 - b4/2 - 53b3/8 - 19b*2/2 + 13b/2 + 10 = 0. -4, -2, -1, 1, 10 Factor -n*5 + 68n*4 - 384n*3 + 752n*2 - 496n. -n(n - 62)(n - 2)*3 What is w in -153w*2 - 24w = 0? -8/51, 0 Suppose h*3/3 + 3h*2 + 20h/3 + 4 = 0. What is h? -6, -2, -1 Factor -10i3/3 + 2i*2 + 724i/3 + 96. -2(i - 9)(i + 8)(5i + 2)/3 Determine m so that 2m2 - 17m - 9 = 0. -1/2, 9 Solve -3z2 - 30z + 117 = 0 for z. -13, 3 Factor -b*2/5 + 1256b/5 + 2516/5. -(b - 1258)(b + 2)/5 Let -2d*3 + 8d*2 - 2d - 12 = 0. Calculate d. -1, 2, 3 Factor 5g5 + 15g*4 - 30g*3 - 40g*2. 5g*2(g - 2)(g + 1)(g + 4) Factor 5z2 + 105z - 810. 5(z - 6)(z + 27) Find f, given that 4f4 + 512f*3 + 4244f*2 - 4760f = 0. -119, -10, 0, 1 Let 75c3/7 + 2745c*2/7 - 1107c/7 + 111/7 = 0. Calculate c. -37, 1/5 Factor -2n3/7 - 138n*2/7 - 330n + 350. -2(n - 1)(n + 35)2/7 Factor i2 - 130i + 4225. (i - 65)2 Suppose -16s*3 + 92s*2 - 56s - 20 = 0. Calculate s. -1/4, 1, 5 Factor 2w4/3 + 2w*3/3 - 48w*2 - 72w + 576. 2(w - 8)(w - 3)(w + 6)2/3 Find h such that -2h*2 - 48h - 88 = 0. -22, -2 Factor 5p5 - 18p*4 + 17p*3 - 4p. p(p - 2)(p - 1)*2(5p + 2) Let g4/2 + 107g*3/2 + 1890g*2 + 21384g - 23328 = 0. What is g? -36, 1 Factor -3z2 + 696z - 40368. -3(z - 116)2 Factor -3y*4 + 24y**3	{ "pile_set_name": "DM Mathematics" }
-7762? -11509 What is the next term in 5781798, 5781799, 5781800? 5781801 What is next in 512480925, 512480924, 512480923, 512480922, 512480921, 512480920? 512480919 What is the next term in -4616, -8383, -12154, -15929, -19708? -23491 What is next in -84603, -82191, -79775, -77355, -74931, -72503? -70071 What comes next: -921, -961, -983, -981, -949? -881 What comes next: 10259949, 10259916, 10259895, 10259892, 10259913, 10259964? 10260051 What is the next term in -59518907, -119037814, -178556721? -238075628 What is next in 33048, 33463, 33782, 33957, 33940, 33683, 33138? 32257 What comes next: 12797, 49575, 110897, 196763, 307173, 442127, 601625? 785667 What is next in 1437212, 1437219, 1437226, 1437233, 1437240, 1437247? 1437254 What is the next term in -3123, -589, 3633, 9543? 17141 What comes next: 89096, 86535, 83974, 81413, 78852? 76291 What is the next term in 10048, 9986, 9890, 9742, 9524, 9218, 8806, 8270? 7592 What is next in -7842938, -15685874, -23528810, -31371746? -39214682 What comes next: -23654, -46442, -69228, -92012? -114794 What is the next term in -114, -156, 300, 1674, 4386, 8856, 15504, 24750? 37014 What is next in -57345003, -57344997, -57344989, -57344979, -57344967, -57344953, -57344937? -57344919 What comes next: 10790, 16881, 22974, 29069, 35166, 41265? 47366 What is next in 8203, 16606, 25009, 33406, 41791, 50158, 58501, 66814? 75091 What is the next term in 4755, 4670, 4585? 4500 What is the next term in -42030, -42250, -42616, -43128, -43786, -44590? -45540 What comes next: -2008988, -2009023, -2009058? -2009093 What is next in 18469, 73800, 166019, 295126? 461121 What is the next term in -4116, -13144, -27088, -45948, -69724? -98416 What is the next term in 217121, 217386, 218117, 219548, 221913? 225446 What is the next term in -3636448, -7272896, -10909344, -14545792, -18182240, -21818688? -25455136 What comes next: -17739, -33952, -48643, -61812? -73459 What is the next term in -1195383, -4781595, -10758625, -19126479, -29885163, -43034683? -58575045 What is the next term in 109, 1832, 7143, 18034, 36497? 64524 What is the next term in -11322851, -45291398, -101905637, -181165562, -283071167? -407622446 What comes next: 35312888, 35312891, 35312894? 35312897 What is the next term in -13281, -13306, -13295, -13230, -13093, -12866, -12531? -12070 What comes next: -53911441, -53911440, -53911439? -53911438 What is the next term in 3166669, 3166726, 3166815, 3166930, 3167065, 3167214, 3167371? 3167530 What is next in -734782223, -734782222, -734782221, -734782220, -734782219? -734782218 What is the next term in -1252, -4648, -10324, -18292, -28564, -41152, -56068, -73324? -92932 What is the next term in -10027954, -40111821, -90251598, -160447285, -250698882? -361006389 What comes next: 18291, 18526, 18869, 19320, 19879? 20546 What comes next: 13164, 26470, 39784, 53112, 66460, 79834? 93240 What is the next term in -2254, -4274, -6048, -7576, -8858, -9894? -10684 What is the next term in 3475, 3626, 3667, 3598, 3419, 3130, 2731? 2222 What is next in -5600, -5360, -4966, -4418? -3716 What is next in -421483, -421975, -422467, -422959, -423451, -423943? -424435 What is next in -180, -1208, -3038, -5766, -9488? -14300 What comes next: -3829, -12496, -21163? -29830 What comes next: -40080, -80229, -120378, -160527, -200676? -240825 What is next in -83191, -83219, -83265, -83329, -83411, -83511, -83629? -83765 What comes next: 4630, 22475, 52216, 93853, 147386, 212815? 290140 What is the next term in 144523032, 144523030, 144523026, 144523020? 144523012 What comes next: -884447554, -884447553, -884447552, -884447551? -884447550 What is next in -1352, -3774, -7812, -13466, -20736, -29622, -40124? -52242 What comes next: 11220, 22255, 33290, 44325? 55360 What comes next: -210769, -211323, -211877? -212431 What is next in 1626470448, 1626470449, 1626470450? 1626470451 What is next in 365690, 731001, 1096308, 1461605, 1826886, 2192145? 2557376 What is the next term in -7808, -7746, -7684, -7622, -7560? -7498 What is next in 34024, 35363, 37594, 40717? 44732 What is the next term in 29616490, 29616481, 29616472? 29616463 What comes next: -2346, -16470, -30594, -44718, -58842? -72966 What is next in -790, -747, -710, -703, -750, -875, -1102, -1455? -1958 What comes next: -427, -459, -495, -547, -627? -747 What is next in -13907, -27717, -41537, -55373, -69231, -83117, -97037? -110997 What comes next: 6519, 5987, 4437, 1359, -3757, -11421, -22143, -36433? -54801 What is next in -276424, -275601, -274778, -273955, -273132, -272309? -271486 What is next in -146081, -146093, -146105, -146117, -146129, -146141? -146153 What is next in -4982, -11437, -17880, -24305, -30706? -37077 What is next in 6661, 11094, 15527, 19960? 24393 What is next in -355527, -711147, -1066853, -1422639, -1778499? -2134427 What is the next term in -1469, -1428, -1399, -1394, -1425, -1504, -1643? -1854 What is next in -12297, -14864, -17431, -19998, -22565? -25132 What is the next term in -307, -437, -801, -1519, -2711, -4497, -6997, -10331? -14619 What is next in 104214, 208939, 313664, 418389, 523114? 627839 What comes next: -61, 368, 1507, 3704, 7307, 12664? 20123 What comes next: 55950, 55191, 53936, 52191, 49962? 47255 What is next in 46819, 47188, 47803, 48664? 49771 What is the next term in -26205562, -52411123, -78616684? -104822245 What comes next: 31014843, 62029679, 93044515, 124059351? 155074187 What comes next: 15246447, 15246446, 15246445, 15246444? 15246443 What is the next term in -360837, -721954, -1083357, -1445046? -1807021 What comes next: -1034, -1493, -1866, -2165, -2402, -2589? -2738 What comes next: -1442, -10957, -36784, -87077, -169990? -293677 What comes next: 16423, 65650, 147691, 262546? 410215 What comes next: 1348401, 1348431, 1348461, 1348491? 1348521 What is next in -17873, -17773, -17573, -17273, -16873, -16373, -15773? -15073 What is next in -362751, -725491, -1088231, -1450971, -1813711? -2176451 What is next in 3785, 15217, 34275, 60959, 95269, 137205? 186767 What comes next: 150557, 148286, 146015, 143744? 141473 What is next in 2452, 4636, 6846, 9094, 11392, 13752? 16186 What is next in -13133, -22715, -28745, -31223, -30149, -25523? -17345 What comes next: 32668792, 65337586, 98006380, 130675174, 163343968, 196012762? 228681556 What comes next: 10300, 10171, 10086, 10063, 10120, 10275, 10546? 10951 What is the next term in 9155, 18365, 27577, 36797, 46031, 55285? 64565 What comes next: 3159, 7716, 12279, 16842, 21399, 25944, 30471? 34974 What is the next term in -77549176, -155098344, -232647512? -310196680 What is the next term in -419952, -839802, -1259652? -1679502 What comes next: 293235, 586449, 879673, 1172919, 1466199? 1759525 What comes next: -639, -1092, -1409, -1590, -1635, -1544, -1317? -954 What comes next: 10088992, 40355978, 90800956, 161423926? 252224888 What is the next term in -650, -5770, -19746, -47006, -91978? -159090 What comes next: -354467, -354664, -354873, -355094, -355327, -355572, -355829? -356098 What is the next term in 5601, 22410, 50413, 89610, 140001, 201586, 274365? 358338 What comes next: 664, 2339, 5096, 8935, 13856, 19859, 26944? 35111 What comes next: 114937, 229811, 344665, 459493, 574289? 689047 What is next in 6826, 12238, 17650, 23062? 28474 What is next in 1820552925, 1820552923, 1820552921? 1820552919 What is the next term in 32123940, 64247883, 96371828, 128495775, 160619724, 192743675, 224867628? 256991583 What is the next term in -15020859, -15020861, -15020865, -15020871, -15020879, -15020889, -15020901? -15020915 What comes next: 2642837, 5285662, 7928487, 10571312? 13214137 What comes next: -3184, -3303, -3444, -3619, -3840, -4119? -4468 What is the next term in -10482019, -20964040, -31446061, -41928082, -52410103? -62892124 What is the next term in 69950879, 69950882, 69950885? 69950888 What comes next: -1071, -417, 239, 897, 1557, 2219? 2883 What is next in -4179, -4873, -6029, -7647, -9727, -12269? -15273 What is the next term in -653, -2354, -4693, -7676, -11309, -15598, -20549, -26168? -32461 What is the next term in 2062, 9463, 16864, 24265, 31666? 39067 What is next in -7342, -14718, -22084, -29440? -36786 What comes next: 470845420, 470845411, 4708453	{ "pile_set_name": "DM Mathematics" }
= 0 for c. 4 Let k be (-1)/(3/15)-2. Suppose -4h = h - k. Suppose 4 = ht - 4. Solve n = -tn for n. 0 Let t be (0/(-2))/((-3)/3 + 2). Suppose t = 16s - 19s + 51. Solve 3x + 2 = s for x. 5 Suppose 104 = -4d + 520. Solve -p = -108 + d for p. 4 Let u = -218 + 219. Solve -u + 5 = -4m for m. -1 Let x be (8 - 9/3) + -1. Suppose 5u + j - 1 = -0j, 3 = -xu + 3j. Solve 0 = -ub + 5b + 10 for b. -2 Let d be -9(-2 - 10/(-6)). Suppose -4 = -b, p + 24 = -dp + 4b. Let l be (p/(-5))/(5/50). Solve 0 = -3a + la for a. 0 Let v = 39 - 25. Let n = 20 - v. Let k be 200/30 + 2/n. Solve -3w + 5 + k = 0 for w. 4 Let g be 1/((1 - -2)/6). Let d be (100/(-15))/10-6. Solve -dp - 2 = -gp for p. -1 Let j be (-1)/(52/(-48) - -4 - 3). Solve -2n - j = n for n. -4 Suppose -5u + 49 = -3f + 2, 5f + 20 = 0. Suppose 0 = 3d - 2d - u. Let b = -2 + d. Solve 27 - 7 = -bh for h. -4 Suppose -26l = -23l. Suppose 3n + ln = 3. Let p be 33/9 + n/3. Solve pj + 11 + 5 = 0 for j. -4 Let s be 4/(-4)(0 + 2). Let h(b) = -b + 2. Let w be h(s). Solve -wa + 3 = -a for a. 1 Suppose -2f + 381l = 377l - 32, 0 = -2l - 16. Let q = 4 + -6. Let g = q + 5. Solve -g = y - f for y. -3 Let h(o) = -4o + 146. Let c be h(33). Solve -cg - 36 = -2g for g. -3 Let g(k) = -k - 1. Let u be g(-6). Let s = u + -1. Suppose 0 = sh - 2h + 4, h = -4y + 98. Solve -5f - y = -10f for f. 5 Suppose 3s - 187l = -185l + 205, 4s - 266 = -l. Solve 0 = -64c + sc for c. 0 Suppose -c = -2m + 16, -3m - 6c + c = -11. Solve -mq + 9 - 44 = 0 for q. -5 Let h be (-3)/(4/(-12)3). Let g(y) = -y3 + 5y*2 - 2y - 6. Let r be g(h). Solve rm - m = -15 for m. -3 Let g(w) = -w - 2. Let o be g(-5). Suppose op + 5c + 14 = 0, 5p - 5c - 25 = 5. Let x be (-2)/4 - (-2)/4. Solve 0 = s + p - x for s. -2 Let o(j) = -6j*3 - 205j*2 - 35j - 32. Let l be o(-34). Solve -6x + lx = -20 for x. 5 Let r(n) = 2n2 + 29n. Let p be r(-15). Solve 10q + p = 5q for q. -3 Let n be 72/(-16)(-4)/3. Let z(p) = p - 7. Let t be z(n). Let f be (2 + t)-1-5. Solve f = 2i - 5 for i. 5 Suppose -v + 3g - 1 = 0, g - 19 = -4v + 2v. Let x be 26/v - 4/16. Solve 0 = xf + 2 - 5 for f. 1 Suppose -o = -4i + 12, 2o + o = 5i - 15. Solve s + 4s + 20 = o for s. -4 Let f = 74 - 71. Suppose -4v + c = -0c + f, 9 = 3c. Solve -5y + 3y = v for y. 0 Let u = -749 - -766. Solve 16 = z + u for z. -1 Let a = 5 + -3. Let b be a/(13/6). Let x be 0/((-10)/(-5) + 0). Solve xi - 16 = -bi for i. 4 Let f = 767 + -762. Solve 0 = -2h + fh + 15 for h. -5 Let x = -740 - -773. Solve -3 = 10m - x for m. 3 Let y(w) = 3w + 5. Let a be y(-3). Let i(m) = -2m + 5. Let c be i(a). Let k = c + -11. Solve 0s + k = s for s. 2 Let q be 3/(3/4) - 0. Let a = -1 + 1. Suppose -4p + 40 = qn, n = 4p - an - 20. Solve h + 2 = p for h. 4 Suppose -22 = -3o + 6l - l, 2o - 5l - 18 = 0. Suppose -j = 2m - 33, -oj + m = -0j - 114. Let i = j + -22. Solve -a - 4 = -i for a. 3 Suppose 0 = 11z - 16z. Suppose z = g - 2g. Solve 0 = -m - g + 1 for m. 1 Suppose 5q = -q + 48. Suppose 0 = 2f + 2 - 8. Solve -o - q = fo for o. -2 Let h = 1 - -32. Suppose 3a + 2a - h = -y, 0 = -3y + a + 35. Solve 5g + y = -2 for g. -3 Let p be (-24)/(-3) - 4 - -15. Let l = p - 16. Suppose 3s - d + 6 = 3d, 12 = ls + 2d. Solve -8 - s = 5a for a. -2 Let p(l) be the second derivative of -2l3/3 - 3l*2 - 17l. Let z be p(-4). Solve -6u + u = -z for u. 2 Let w = 63 + -61. Solve 18 = wj + 22 for j. -2 Let s = 951 + -942. Solve 3 = -3f + s for f. 2 Suppose 192 - 92 = 5m. Solve k + m = 5k for k. 5 Let v = 1337 - 1305. Solve -2k - v = -10k for k. 4 Let l be 0 + (3 - 1) + -2. Suppose lw + w + 11 = 0. Let a be (w - -7)(-2)/4. Solve az - 8 = -2z for z. 2 Let k(d) = -d2 + 14d + 9. Let x be k(12). Suppose w = 5h + 27, -2h + x = 4w + 3h. Suppose 3g + 5b = 56, -g + 2b + w = 7b. Solve 5r + g = -3 for r. -5 Let f be 3 - ((-2 - -2) + 2). Suppose -5 = r + 1. Let u = 16 + r. Solve 0 = -3p + u - f for p. 3 Let t = 197 - 193. Solve -t = -4d - 8 for d. -1 Let p(h) = -h3 - 7h*2 + 6h - 16. Let s = 35 - 43. Let z be p(s). Solve z = -5x + 4x + 3 for x. 3 Let w = -1524 + 1597. Solve 75j - 10 = wj for j. 5 Let d = 1 - -3. Solve -5y - d = -7y for y. 2 Let t = 15 + -11. Let d = 4 + -1. Solve to - d = 1 for o. 1 Suppose -4s = -16s. Solve -4c + 3c = s for c. 0 Let o(l) = l - 1. Let v(i) = -i3 + 8i*2 - 3i - 1. Let g(p) = 5o(p) - v(p). Let x be g(7). Let n be (3 - 4)(-6)/x. Solve -nk - k = -12 for k. 4 Let h(a) be the second derivative of a5/20 - a4/4 - 2a*3/3 - 3a*2/2 - 2a. Let b be h(4). Let i = b - -3. Solve it = 2t + 10 for t. -5 Let h(c) = -c*3 - 2c + 6. Let a(w) = w3 - w2 + 2w - 6. Let v(y) = -3a(y) - 2h(y). Let s be v(3). Let z = 11 + -6. Solve zu - 5 = -su for u. 1 Let i = 239 - 236. Solve is + 10 = 22 for s. 4 Let w = -1599 + 1653. Solve 0 = 2q - 62 + w for q. 4 Suppose 13x - 212 = 230. Solve 33i - xi = 2 for i. -2 Suppose 0 = 15w + 4w - 133. Solve 8 = 3r - w for r. 5 Let h = 80 + -60. Suppose 5w + 2n = -10, w - 4n = 4w + h. Solve 0 = -z - wz for z. 0 Let i(h) = h*3 + 12h*2 + 22h + 20. Let t be i(-10). Solve -6m - 16 - 14 = t for m. -5 Suppose 2t + 185 = 6t - 5q, -5t + 190 = 2q. Let n be 2 + t/(-22) - (-384)/66. Solve n - 2 = -h for h. -4 Suppose 1156f = 1160f - 24. Solve -fi + 20 = -10i for i. -5 Let v(x) be the third derivative of x6/120 + x5/30 - x4/24 + x3/6 + 4x2. Let m be v(1). Solve 3 = ma - 0 for a. 1 Suppose 4z + 0 - 16 = 0. Suppose zm = -0m. Solve b + 5 = -m for b. -5 Let m be -11 - (3 - 16). Let r be 6/3 + -2 - m. Let w = 15 + r. Solve 0 = -wf - 0f - 6 for f. -2 Let p = 3 - -1. Let y = -828 - -831. Solve p = -yg - 2 for g. -2 Let w = -1 + 5. Suppose 0 = l + wl. Let c(v) = v*3 - 16v*2 + 15v + 6. Let h be c(15). Solve l = 4f - hf - 6 for f. -3 Let g be (-2 - (-7)/3)15. Let u = 116 - 113. Suppose -uo = -go. Solve oz + 5z = 0 for z. 0 Let o(m) = 35m + 1098. Let v be o(-31). Solve -9a = -va for a. 0 Suppose 41 = -3z - 49. Let c be 2/(-10) + -4 + (-366)/z. Solve -3j = -c - 4 for j. 4 Let b(u) = -u*2 + 15u + 3. Let s be b(15). Suppose o = -so - 12, 5m - 4o = 27. Let n(r) = -r2 + 15r - 5. Let v be n(14). Solve -2z - v = -m for z. -3 Suppose d + 4l + 754 = 6d, -4 = 4l. Solve 4u - 130 = -d for u. -5 Let g = 16 + -13. Suppose -3s = -3i - 63, -3 + 54 = gs + i. Suppose 2x - s = -x. Solve 0 = 3v - 0v + x for v. -2 Let r = 5152 + -5151. Suppose 2s + j = 0, 3s - 1 = -2j - 3. Solve r + s = -i for i. -3 Let w(c) = 2c + 30. Suppose 4t + 20 = -2x, -5x = 4t - 3t + 32. Let i be w(x). Solve -i = 5a + 7 for a. -5 Let x = -228 - -234. Solve xv - 8 = 16 for v. 4 Let w(p) = -5p - 5. Let c be w(-5). Suppose 5 = x - 4f, 2x + f = -0f + 1. Let a = 7 - x. Solve -c = -2z + az for z. -5 Suppose -2z + 22 = 3d + d, 3d + 9 = 0. Solve 21 = -4n + z for n. -1 Suppose x - c = 25, -4c = 4x + 34 - 142. Let v = x - 24. Solve 0 = -5r + 8 + v for r. 2 Let z be 6/10 + 110/25. Suppose 9q = zq + 16. Suppose -t + q = 3v - 3, -3t = -5v + 21. Solve i = -vi - 4 for i. -1 Let h = -308 - -331. Solve -25w = -hw for w. 0 Let s = 640 + -613. Solve 0 = 5l + s - 7 for l. -4 Let j be ((-235)/282)/(1/(-6)). Solve 11r - jr - 12 = 0 for r. 2 Suppose 4s = -9i + 8i + 304, -91 = -s - 4i. Solve sa - 76a = 2 for a. -2 Let i be ((-135)/(-90))/(-41/(-168)). Solve 0 = 57k - ik - 18 for k. -3 Suppose 0 = s + 3 - 1, -k + 10 = -5s. Suppose k = -z - 3 + 7. Solve 7 = l + z for l. 3 Suppose 3d + 4z = -10, -3z + 8 = 2d - 4z. Suppose f + 2i - 7 = 0, -df + 4i + 3 + 3 = 0. Solve -f = s - 7 for s. 2 Let v(g) = 23g3 + 2g*2 + 2g - 3. Let u be v(1). Suppose 5y = q - u, 3y + 6 = y. Solve 4 - q = 5f for f. -1 Suppose 0m = 2m - 2z - 14, -3z = -2m + 19. Let k be 32/(-56)(-14)/4. Solve mt - 8 = k for t. 5 Suppose -4r - 17 = d, -2d - 2r = -r - 1. Solve 0 = dm + 2m for m. 0 Suppose -2k - 1 = -7. Suppose -45a = -40a - 55. Solve kn = a + 1 for n. 4 Suppose 0 = -5n + 9n - 128. Let l be n/(5 - 1) + -3. Solve 3q - 2 = lq for q. -1 Suppose m + m - 10 = 5b, -5m = -5b + 5. Let y = 6 + b. Let p = y - 2. Solve p = o + 2*o f	{ "pile_set_name": "DM Mathematics" }
40 Convert 75888.94 micrometers to nanometers. 75888940 How many kilograms are there in fifty-four fifths of a tonne? 10800 Convert 995858.3m to centimeters. 99585830 Convert 8039.687 years to centuries. 80.39687 What is thirty-one halves of a minute in seconds? 930 What is 6.849646t in kilograms? 6849.646 What is 5/4 of a litre in millilitres? 1250 How many nanometers are there in seventy-one fifths of a micrometer? 14200 What is thirty-one fifths of a kilogram in grams? 6200 What is 425.6258 kilometers in micrometers? 425625800000 How many months are there in three tenths of a century? 360 What is 0.4863519 tonnes in kilograms? 486.3519 What is 0.4369117 years in millennia? 0.0004369117 What is 0.4473156 months in centuries? 0.000372763 Convert 66722.523 hours to weeks. 397.157875 What is 953164.6l in millilitres? 953164600 How many millilitres are there in fourty-six fifths of a litre? 9200 What is 3/50 of a milligram in micrograms? 60 Convert 544.30758 nanoseconds to hours. 0.00000000015119655 How many litres are there in 643169.6ml? 643.1696 How many months are there in seven halves of a century? 4200 What is 35.73132 milligrams in nanograms? 35731320 What is 26909.99ml in litres? 26.90999 How many millilitres are there in 18/5 of a litre? 3600 How many millilitres are there in 21/4 of a litre? 5250 What is 328.4917s in milliseconds? 328491.7 How many centimeters are there in 2959.91m? 295991 What is 3/5 of a kilogram in grams? 600 Convert 0.898716l to millilitres. 898.716 What is 390.909 months in decades? 3.257575 What is 0.9436596l in millilitres? 943.6596 What is 6507.278 millennia in decades? 650727.8 What is 583.4496 centuries in months? 700139.52 What is six fifths of a second in milliseconds? 1200 How many meters are there in 2596.012cm? 25.96012 Convert 779733.6 millilitres to litres. 779.7336 How many nanograms are there in 42.44348 grams? 42443480000 What is 3/40 of a gram in micrograms? 75000 Convert 0.2080862 micrograms to grams. 0.0000002080862 What is 6/25 of a millennium in decades? 24 How many decades are there in 6/5 of a millennium? 120 What is three sixteenths of a day in seconds? 16200 Convert 917798.7 nanoseconds to milliseconds. 0.9177987 Convert 3552.366ms to minutes. 0.0592061 How many nanoseconds are there in 53443.49 days? 4617517536000000000 Convert 75517.308 minutes to days. 52.442575 How many centimeters are there in 3/8 of a kilometer? 37500 How many centuries are there in three fifths of a millennium? 6 Convert 818.9857l to millilitres. 818985.7 Convert 261933.12 months to centuries. 218.2776 How many nanometers are there in 5/8 of a micrometer? 625 What is 250.15209 months in years? 20.8460075 What is 1036.00377ms in days? 0.000011990784375 What is 56.4206517 minutes in weeks? 0.005597286875 How many years are there in 89/2 of a decade? 445 What is 10943.397us in days? 0.0000001266596875 What is 275.4826 kilometers in meters? 275482.6 Convert 29906.53 milligrams to tonnes. 0.00002990653 How many nanograms are there in 56482.82ug? 56482820 What is 8028.318 centimeters in meters? 80.28318 What is 287.05071 months in centuries? 0.239208925 What is 143657.2l in millilitres? 143657200 How many millilitres are there in 34/5 of a litre? 6800 What is 13/4 of a litre in millilitres? 3250 How many months are there in 5/8 of a century? 750 What is 3.438427 decades in centuries? 0.3438427 Convert 93.63178 centimeters to micrometers. 936317.8 What is fourty-three thirds of a day in minutes? 20640 How many grams are there in 21/8 of a kilogram? 2625 What is 73/5 of a kilometer in meters? 14600 How many decades are there in fourty-three halves of a millennium? 2150 How many nanograms are there in 27/2 of a microgram? 13500 What is seven quarters of a tonne in kilograms? 1750 How many decades are there in 881.0555 centuries? 8810.555 How many meters are there in one quarter of a kilometer? 250 How many milligrams are there in 5.561065 kilograms? 5561065 What is 75/4 of a litre in millilitres? 18750 What is 82437.1 decades in months? 9892452 Convert 98.94875ml to litres. 0.09894875 How many micrograms are there in one quarter of a milligram? 250 How many seconds are there in 1/54 of a week? 11200 What is 2130.1794us in hours? 0.0000005917165 What is 18/5 of a decade in months? 432 How many nanograms are there in 8.385568t? 8385568000000000 What is 527594.7s in nanoseconds? 527594700000000 Convert 845493.3 nanometers to micrometers. 845.4933 What is 3/50 of a kilogram in milligrams? 60000 How many milligrams are there in 874.6809t? 874680900000 What is 27/2 of a millennium in years? 13500 How many nanoseconds are there in one tenth of a microsecond? 100 Convert 28797.033 hours to days. 1199.876375 How many seconds are there in 17/6 of a hour? 10200 What is one tenth of a week in seconds? 60480 How many litres are there in 623.7445ml? 0.6237445 How many hours are there in 3/8 of a day? 9 How many milligrams are there in one fifth of a gram? 200 How many millimeters are there in 41499.73 nanometers? 0.04149973 What is 937.728 litres in millilitres? 937728 What is 398.7507us in seconds? 0.0003987507 How many millilitres are there in 2.49895l? 2498.95 What is 65.80081l in millilitres? 65800.81 How many nanograms are there in 478342.5 tonnes? 478342500000000000000 How many decades are there in fifty-seven halves of a millennium? 2850 What is one quarter of a milligram in micrograms? 250 How many nanometers are there in 0.065119km? 65119000000 Convert 0.1664257 millilitres to litres. 0.0001664257 How many grams are there in eleven tenths of a kilogram? 1100 How many decades are there in 13/4 of a millennium? 325 Convert 0.4727994 months to millennia. 0.00003939995 How many millilitres are there in 17968.6l? 17968600 How many litres are there in 1.869625 millilitres? 0.001869625 How many nanometers are there in 3/8 of a micrometer? 375 Convert 965325.5 micrograms to tonnes. 0.0000009653255 What is 32/7 of a week in days? 32 How many centimeters are there in 6/25 of a meter? 24 How many centimeters are there in nine tenths of a meter? 90 Convert 949769.9 tonnes to nanograms. 949769900000000000000 Convert 29432.493 months to millennia. 2.45270775 Convert 78028.69mm to nanometers. 78028690000 How many months are there in one tenth of a millennium? 1200 What is 9/10 of a litre in millilitres? 900 How many millilitres are there in 5.274176 litres? 5274.176 What is 37/5 of a litre in millilitres? 7400 How many micrograms are there in 43014.3g? 43014300000 How many millimeters are there in 3/10 of a centimeter? 3 Convert 147747.3kg to milligrams. 147747300000 What is 57/5 of a millennium in centuries? 114 How many nanoseconds are there in 19/4 of a microsecond? 4750 How many micrograms are there in 6/5 of a milligram? 1200 How many hours are there in 1/4 of a week? 42 What is seventy-nine halves of a decade in years? 395 What is 1.650945l in millilitres? 1650.945 What is seventy-seven halves of a meter in millimeters? 38500 How many days are there in 23159.178 minutes? 16.0827625 Convert 1.846791 tonnes to kilograms. 1846.791 Convert 3.704106 months to years. 0.3086755 How many milligrams are there in 3/25 of a gram? 120 How many hours are there in 11/14 of a week? 132 Convert 48.94433 millennia to decades. 4894.433 How many millilitres are there in 1/4 of a litre? 250 How many millilitres are there in 704.8069l? 704806.9 What is 11/8 of a litre in millilitres? 1375 How many nanometers are there in 36549.19 meters? 36549190000000 What is seven halves of a day in hours? 84 What is 3/50 of a tonne in grams? 60000 Convert 3.881224 millilitres to litres. 0.003881224 Convert 45820.39 millilitres to litres. 45.82039 How many grams are there in six fifths of a kilogram? 1200 What is 27/4 of a litre in millilitres? 6750 How many kilograms are there in twenty-one quarters of a tonne? 5250 How many millilitres are there in 3/40 of a litre? 75 Convert 66870.02g to nanograms. 66870020000000 What is five eighths of a second in milliseconds? 625 How many decades are there in 17/2 of a century? 85 What is 6/25 of a litre in millilitres? 240 Convert 5.288309 milligrams to tonnes. 0.000000005288309 Convert 611465.3nm to micrometers. 611.4653 How man	{ "pile_set_name": "DM Mathematics" }
/19)vvv)((v/(v/v34))/v)(-2/37) assuming v is positive. v(-17029/4921) Simplify (n(-38)/(n/n*(18/5)n))/(n/(nn25n)n)(1/22) assuming n is positive. n(-3879/110) Simplify (lll28)/(l38/ll)ll(llll*(-7/2))/ll(-3/10) assuming l is positive. l(-39/5) Simplify ((k/k*0kk)9/((kk4)/(((k/(k/k(-4)k))/k)/k)))(1/28) assuming k is positive. k(15/28) Simplify (o(-1/17)/o)(7/11)/(o(oo(14/3))/ooo22/o) assuming o is positive. o(-15899/561) Simplify (((v/(vv(2/3)))(-32))19)(-34) assuming v is positive. v*(-41344/3) Simplify (qqq/(q/(q/q(-10))))(1/18)/(q(5/2)/qq(-7/2)) assuming q is positive. q(49/18) Simplify (p*31/(p/(p/((ppp/p(5/7))/p))))/(p9)(3/35) assuming p is positive. p(1013/35) Simplify (((vv(2/21))/v)/v(1/7))(-36) assuming v is positive. v(12/7) Simplify (u/(u/u*(-9)u))(-20/7)/(u1/u)(-39/2) assuming u is positive. u(200/7) Simplify (((h*(1/5)h)/hh/(h(-1/10)/h))(-14))44 assuming h is positive. h(-7084/5) Simplify ((y(-1/3)yyy/((y(yy*(4/7))/yyy)/y))(3/26))(7/6) assuming y is positive. y(1/78) Simplify (u(-2)uuu/u(-5/3))(1/27) assuming u is positive. u*(8/81) Simplify (kk/k*(-5)k)14/(k(-7))(-1/20) assuming k is positive. k(2233/20) Simplify (cc/(cc*(-3)))/(cc*(-2/37)c)(c(3/7)/c)(1/20) assuming c is positive. c(2623/1295) Simplify (zz*(-1/5)z)/(z/z*(2/49))z*(-21)z(1/19) assuming z is positive. z(-93596/4655) Simplify ((f*(5/4)f*(-4)f)/(f*(4/9)f(-10)))(-43) assuming f is positive. f*(-12083/36) Simplify m/(mm*(2/9))m*(-12)m*14m/m7 assuming m is positive. m(-38/9) Simplify (y/(y(yy(-2/21))/y))(7/4)(y(3/13)/y)/yy(3/8)/y assuming y is positive. y(-695/312) Simplify (y*(-1/11)yy(2/9)y)/((y/y*(-2))/(yy/y(-3))) assuming y is positive. y(409/99) Simplify s/s*(-4)s*34s/(s*(-27/5)s)s25/s assuming s is positive. s(342/5) Simplify (v(v/v*(-1/3))/vv*4vvv/(v/(v/v*(-2/9)vv)v)vv/(vv0))(-42) assuming v is positive. v(-1330/3) Simplify ((ll14)/(l21l))/(l(1/18))12 assuming l is positive. l(-23/3) Simplify ((q(-4/15)/q(-12))1)12 assuming q is positive. q(704/5) Simplify ((cccc*(2/9)c(c/c3cc)/c)(-7/2))(-38) assuming c is positive. c(3857/9) Simplify ((aa/((aa(-1/42))/a)a)/(a*(1/6)a))/(aaa(a/(a/((a(16/7)/a)/aa)))/aa(1/36)) assuming a is positive. a(-367/252) Simplify (((k(-3/10)k)/k)/k(kk*(-2/7))/kk((kk(k1/k)/kk)/k)(-2/15))(1/2) assuming k is positive. k(-151/420) Simplify (f(5/2)ff(-11))(-40) assuming f is positive. f300 Simplify ((v(2/5)/v)/vvv/(v*(-3/7)/v)v(-10)/(v(-2/27)vv))(-1/5) assuming v is positive. v(9542/4725) Simplify ((qq(qq(-2/13))/qqq)/(qq(q(-12)/q)/q))/(qq/((q*(1/4)q)/q))(-1/87) assuming q is positive. q(71779/4524) Simplify (b*(16/3)b)/b*(-13)(b/(b*2b))/b(-5/6) assuming b is positive. b(109/6) Simplify o*(-11/5)(o(o/(o/(ooo0o)))/o)/oo(-16/5)o*(-26)o assuming o is positive. o(-142/5) Simplify (z(-6)z)(1/2)/(((z16z)/z)/zz9) assuming z is positive. z(-53/2) Simplify ((y(-5/7))40)(-9/4) assuming y is positive. y(450/7) Simplify (zz*7zz)32z*(-16/3)(((z25/z)/z)/z)/z assuming z is positive. z(1007/3) Simplify ((s*(3/7)s)/s)25/(s(-6))(1/5) assuming s is positive. s(417/35) Simplify (ss/s(-2/55)s)/s*(2/49)((s(-1)/s)/s)1 assuming s is positive. s(-12/2695) Simplify (w/(w(-6)w))(1/20)/(w/(ww(ww(2/7))/w))(-21) assuming w is positive. w(-267/10) Simplify (p(-18)/((pp/p12)/p))/((p(-7)/p)/p)(-3/5) assuming p is positive. p(-62/5) Simplify (t3t)(2/21)/(t(-1/2)/t)(-2/11) assuming t is positive. t(25/231) Simplify ((g/(g/g11))/(g/g(6/7)))(-34) assuming g is positive. g(-2584/7) Simplify w/(w*(-1/14)/w)ww(-1/31)(w(1/3))2 assuming w is positive. w(4825/1302) Simplify (a(-4))*46/((aa8)/(a(-14)/a)) assuming a is positive. a(-208) Simplify ((y(5/3)/y)/y(-3/8))/(y(2/5)y(yy(-1/4)y)/yy) assuming y is positive. y(-253/120) Simplify (a(2/9))(1/10)/(a(2/23)/(a(-1/28)a)) assuming a is positive. a*(26069/28980) Simplify (((h/(hh/(h/h6)))/(h/h(5/3)))/(h(2/13)/h1))(-9) assuming h is positive. h(525/13) Simplify (oo(1/7)o(8/3)/o)/(o(2/9))(-13) assuming o is positive. o(359/63) Simplify (a(-3/11)/a(-1/2))30 assuming a is positive. a(75/11) Simplify (g(-21)/(g(11/4)/g))/(g/g(-2/9))(2/63) assuming g is positive. g(-51685/2268) Simplify w(11/5)ww*(3/4)(w/w(1/9))22 assuming w is positive. w(4231/180) Simplify (o(-2/9))*15(o3)(-2/19) assuming o is positive. o*(-208/57) Simplify (x(xx19)/xx)/xx(-11/6)(x5)7 assuming x is positive. x(319/6) Simplify q(-5/4)q0q*5qqq(-11) assuming q is positive. q(-21/4) Simplify ((n/(n*(5/4)nn)n(-2/19))/(n(-6/7)/(nn(-2/7))))(2/123) assuming n is positive. n(-139/10906) Simplify (a(-1/4))(-3/31)/(a(2/7))(-27) assuming a is positive. a(6717/868) Simplify (b5bb/b(-3/2))/(bb(b/(bbb5b))/bbb/b(-6/11)) assuming b is positive. b(263/22) Simplify zz(-7/5)z*(-1/4)zz(-13/2)zz(-1/9) assuming z is positive. z(-947/180) Simplify ((z(-1/3))(-39)(z(2/9)/z)/(z/(z/(z/z5))z))(8/11) assuming z is positive. z(1096/99) Simplify (m(-6))(-1/5)(m(m/m(2/15))/m)/(mm(2/23)) assuming m is positive. m(338/345) Simplify (d(-1/10)/d(2/5))/(((d/d*(-14)d)/ddd)/dd/((d/((ddd(dd/((dd/d*9)/d))/dd)/d))/d)d) assuming d is positive. d(-61/2) Simplify (((oo/(o/((o(-2/55)/o)/o)))/o)/o12)(-1/5) assuming o is positive. o(772/275) Simplify l*11(l/(((ll(-1))/l)/l))/l(l(-5))14 assuming l is positive. l*(-57) Simplify (((((zz*(1/7)z)/z)/z)/z(-5))/(z/z(-2/3)z)(-2/27))(2/17) assuming z is positive. z(6056/9639) Simplify u(-12)u*5u((u/(u/(uu/(uuuu(-2/17)))))/u)(3/14) assuming u is positive. u(-762/119) Simplify (((d/(dd(d(dd(-2))/d)/dddd))/d)/d)37/((d(-2/9)d)/d)(3/7) assuming d is positive. d(-3106/21) Simplify (d/((d6/d)/d)d/(d/((d*(-4)/d)/d)))/(dd*(-10/7)d/(dd(-9))) assuming d is positive. d(-123/7) Simplify (((u/(u/(u(-3/16)/u)))/u)/(u7u))/(u/u*(-3/10)u7) assuming u is positive. u(-1479/80) Simplify ((l(-8/3)/(l/(l(5/3)l)))(-2/55))(-2/15) assuming l is positive. l(-4/825) Simplify ((m/m(-2/15))/(m/(m(-1)m))m(-2/13)m*1m)(5/2) assuming m is positive. m(193/39) Simplify ((m32/(m/m(-3/5)))(-4/7))(-11) assuming m is positive. m(6688/35) Simplify ((r(-7)/r)/r*(-2/21)r*(-6)/rr(1/4))(-44) assuming r is positive. r(13541/21) Simplify ((o(-1/9)o)/o)(8/13)/(o(-1/11)o(4/5)/o) assuming o is positive. o(1432/6435) Simplify (w*4w/(ww6))/(w19w(-15)) assuming w is positive. w(-6) Simplify (v*(-4/13)/vv)*(-2/27)(v*(-9/7)v)/v8 assuming v is positive. v(-20302/2457) Simplify m(1/7)/(m(-3)/m)(m/(m/m(-2/9)))(-37) assuming m is positive. m(779/63) Simplify ((t(-5)t)/tt/t(-3/4)(t/(t*7/t))/tt4)(-48) assuming t is positive. t252 Simplify v15/v*27v*(-12)vv15vv assuming v is positive. v(-6) Simplify (y3y/(y(yy*(-3/4))/yy)y(1/5)y(-6/7))16 assuming y is positive. y*(1172/35) Simplify (((ll*2)/lll(-1/8))(-7))(-3/20) assuming l is positive. l(483/160) Simplify ((y/y21y)/y(1/35))/(y(8/7)(y/(y9y))/y) assuming y is positive. y*(-356/35) Simplify (rr2)20/(r/(rr/r(2/11)))(2/11) assuming r is positive. r(7278/121) Simplify ((((a/(aa*7))/a)/a(a/(aa/(aaaa*(4/5))))/a)/(a/(aaa(-2/5)aaa))(-4/3))(8/3) assuming a is positive. a(-32) Simplify (h(5/3)h32)/(h/h1h/h(-25)) assuming h is positive. h(23/3) Simplify (q*(1/11)q/(q(-3/29)/q))/((q(12/11)/q)/(qq(-17)/q)) assuming q is positive. q(-432/29) Simplify (((k(k/(k/k*(-3))k)/k)/k)/kkk*4)/(k(k/(kk(1/4)k))/kk(-1/11)) assuming k is positive. k*(103/44)	{ "pile_set_name": "DM Mathematics" }
24972? -24972 Do -5106 and -4123 have the same value? False Is -1 at most as big as -1/2738340? True Which is greater: 167345 or -12? 167345 Which is greater: 145163 or 0.03? 145163 Are -0.0058857 and -1/2 non-equal? True Is 1286/391 bigger than 2? True Which is bigger: -1509 or 1.4? 1.4 Is 3086099 >= 3086099? True Which is greater: -0.1136837 or -0.1? -0.1 Which is bigger: 1/57099 or -1? 1/57099 Which is smaller: -8022731 or -8022732? -8022732 Is 3/226 != 213.9? True Does -4850/221 = -21? False Is 0 smaller than 1/618102? True Which is bigger: -53/2381 or -1? -53/2381 Is -1.257 at most as big as 40? True Which is bigger: 0.66 or 1422? 1422 Which is smaller: 14491 or 14490? 14490 Is -6/132097 at least as big as -1? True Which is greater: 3305/148 or 21? 3305/148 Which is bigger: -75 or -173? -75 Which is smaller: 1859 or 0.7? 0.7 Is -0.6 <= -0.8153? False Is -539 at least -4858/9? True Which is smaller: -2233/5 or -5/6? -2233/5 Which is smaller: 37742 or 1/3? 1/3 Which is smaller: -335 or -0.001? -335 Is -443855/6 != -73976? True Is -2/23 < -87.2? False Which is smaller: -11 or -0.051115? -11 Which is bigger: -1 or -50/6907? -50/6907 Which is bigger: 1.108 or 0.2? 1.108 Is -2074 less than -1978? True Is -1/178 <= -26.11? False Is -74 at least as big as 0.379? False Does -925 = -565? False Does -1571777 = -1571776? False Which is greater: 1641497 or 1641500? 1641500 Is -2110093 bigger than -2110093? False Which is smaller: -7511 or -52586/7? -52586/7 Which is bigger: 80 or 2639/33? 80 Are 70423 and 70430 equal? False Is 35883 < 35881? False Which is bigger: 3/85801 or 1? 1 Which is smaller: 1 or 472/359? 1 Which is bigger: 6483 or 6456? 6483 Which is bigger: 19585 or 19583? 19585 Are -53/329 and 0 non-equal? True Is 432789 greater than 432788? True Which is greater: 1 or -6/18541? 1 Which is smaller: 376 or 21415/57? 21415/57 Is -131300 greater than -131301? True Which is greater: -5378 or 3/7? 3/7 Which is smaller: -293766 or -293763? -293766 Is 0.5241 at most -4/3? False Is 22913 less than 0? False Which is greater: 0.01 or 3/47? 3/47 Which is bigger: -1171 or -1183? -1171 Is -1/211253 equal to -1? False Is -6 bigger than 26094? False Is -32/859 != 1? True Do 2536 and -99 have different values? True Which is greater: 4/351483 or 0? 4/351483 Which is smaller: -946 or -617? -946 Which is smaller: 48 or 105? 48 Is 1/2365755 at least as big as 0? True Is -63301 at most as big as -63301? True Is 3.4 at least as big as 11492? False Are -1600 and -5.1 equal? False Is -15100/33 greater than -2? False Which is smaller: -4263 or -173? -4263 Is 58193 at most 232767/4? False Is 1327.9 greater than 0.01? True Which is bigger: -2428 or -493? -493 Is 509 less than or equal to 503? False Which is smaller: 28 or 1.8376? 1.8376 Which is smaller: -1378 or -1479? -1479 Is -511559/6 > -85259? False Which is smaller: -3/38948 or -1? -1 Is -1.411 != -15? True Is 55838 greater than 2? True Which is greater: -3 or -219553/5? -3 Which is smaller: -7007 or -7? -7007 Which is greater: -63081 or -63058? -63058 Are 1696253 and 1696251 unequal? True Which is smaller: 182071 or 182070? 182070 Is -1/836 at least as big as 5/4? False Which is greater: 0 or 1/65211? 1/65211 Is 0 at most -2/30865? False Is 1/3759 smaller than 79? True Is -292735 equal to -292736? False Which is bigger: -70.599 or 0.1? 0.1 Which is greater: 27 or -2265/22? 27 Do 507/86 and -1/2 have the same value? False Is -41.99 equal to -0.099? False Which is smaller: 2.9 or 1904/27? 2.9 Is -1792 less than -1837? False Is 556555 at most as big as 556556? True Which is smaller: -254 or -291? -291 Is -5390 <= -5388? True Are 0 and 9/520 equal? False Is -941 smaller than -790? True Which is greater: -49 or -10.015? -10.015 Is -1605 > -1586? False Which is smaller: -3334 or -45? -3334 Which is greater: 17/1829 or 0? 17/1829 Is -2/4097989 < -1? False Is 488/291 less than 1? False Is -5690 != -5697? True Which is smaller: 32/9 or -165? -165 Which is bigger: -5 or -253/2? -5 Which is smaller: 99484 or 99481? 99481 Which is smaller: -101197 or -303587/3? -101197 Which is bigger: -6069 or -6040? -6040 Which is smaller: 35975 or 35976? 35975 Is -563 not equal to -386? True Which is smaller: -7395414/11 or -672310? -7395414/11 Is -8830 at least as big as -8831? True Which is greater: -4415 or -88319/20? -4415 Which is smaller: 458 or -682/15? -682/15 Is 2/5 != -2049742? True Is -4/803 greater than -2? True Is -1 at most -103/22387? True Which is bigger: 17757/7 or -2/3? 17757/7 Is -74 < -424? False Is -87746 > -87743? False Is 35608 >= 35606? True Does 26546/57 = 467? False Which is smaller: -741 or -4453/6? -4453/6 Is -6/3097 at most as big as 52? True Which is smaller: -335/126 or -2? -335/126 Which is bigger: -2571/124 or -22? -2571/124 Which is smaller: 3770608 or -0.1? -0.1 Is 40357 less than 40357? False Which is smaller: -1/9 or 3625.94? -1/9 Is -4910 smaller than -4899? True Is 72235 less than 72280? True Which is greater: -10 or 8530? 8530 Do 942 and 10354/11 have the same value? False Which is smaller: -7785 or -7784? -7785 Is 35992/3 <= 11998? True Which is smaller: -57/5 or -2582? -2582 Is 1 > 17/1697? True Which is smaller: 0 or -515863? -515863 Is -16062 equal to -0.1? False Which is smaller: 53741 or 53746? 53741 Is -93268 != -93262? True Which is bigger: 9901292/3 or 3300432? 3300432 Do 13 and 9054/691 have the same value? False Which is greater: -2/25 or 252420? 252420 Which is greater: 2450776 or 12253887/5? 12253887/5 Which is bigger: 869 or 906? 906 Is -280 smaller than 1213? True Is -1/3 less than 1994279? True Which is smaller: -11469 or -57341/5? -11469 Which is greater: -1257.51 or 0? 0 Are 15/195293 and 1 non-equal? True Is -85 equal to -352? False Which is smaller: -1316 or -13? -1316 Is 2 smaller than 797/397? True Which is smaller: 495 or 391? 391 Is -16948/287 greater than or equal to -58? False Does 1 = 3/36454? False Which is bigger: -92/53 or -2? -92/53 Is -12402 at least -0.168? False Is 30946 less than or equal to 30946? True Which is greater: 732 or 27120/37? 27120/37 Which is bigger: -12601 or -12602? -12601 Is -18274 at least -217? False Which is bigger: 539455 or 8? 539455 Which is smaller: 1 or 4/423785? 4/423785 Are -59390 and -59392 unequal? True Which is smaller: 20019 or 20009? 20009 Which is smaller: -118815 or 9? -118815 Are 9316 and 9314 nonequal? True Is -73277 equal to -73284? False Is -13/12063 <= 1? True Is 1 < -3/23863? False Is 880/2183 less than -1? False Which is smaller: -770 or -705? -770 Is 9 at most as big as 203? True Which is bigger: 0 or -1459/16? 0 Is 753/2425 less than or equal to 1? True Is -453 less than 405? True Is 19/32 at least as big as 294? False Is 2 >= 2780? False Which is smaller: 645 or 567? 567 Which is greater: 1404948 or 1404945? 1404948 Which is bigger: 17973 or 17981? 17981 Is 24183 smaller than 24194? True Is 1 less than or equal to -109/2970? False Is -0.2 not equal to -641/21? True Is 394815 at least as big as 394813? True Which is smaller: -0.1 or 53/91? -0.1 Which is smaller: 43018/75 or 575? 43018/75 Is 103/6504 less than or equal to -1? False Are 10.6 and 262 equal? False Is -16594 <= -16590? True Which is smaller: 84219/10 or 8421? 8421 Which is smaller: -2941/33 or -89? -2941/33 Which is bigger: -4126 or -4139? -4126 Is 1790730 at least as big as 1790730? True Which is greater: 3290 or 31? 3290 Which is smaller: -65072 or -65073? -65073 Which is bigger: -3 or 181851/2? 181851/2 Are -7 and 44 unequal? True Which is smaller: 1/76820 or -1? -1 Which is greater: 125488 or 125489? 125489 Which is smaller: 309 or -95? -95 Is 2/9 smaller than -34/1729? False Which is greater: -2314 or -6941/3? -6941/3 Do 260397/4 and 65098 have the same value? False Which is smaller: -150448 or -150447? -150448 Is -2 not equal to -8971? True Is -1699169 != -1699169? False Which is greater: 4/174505 or -1? 4/174505 Which is bigger: 0 or -40216? 0 Which is smaller: 301/8656 or 1? 301/8656 Is -1/5 >= 45.7141? False Which is bigger: -5 or -1875/331? -5 Is -2 <= -8.4057? False Is 73 equal to 2/2245? False Which is smaller: 244 or 234? 234 Is 2990 at most as big as 2925? False Which is smaller: 1314225/4 or 328555? 328555 Is 13 less than -390? False Which i	{ "pile_set_name": "DM Mathematics" }
2)(-2 - 2z3 - 2 + z3). -2z3 - 8 Expand -16l*5 - 17l*5 + 13l5 + (l2 + 2l - 2l)(-4l*3 + 5l3 + l3) - l*5 + 5l*5 - 3l*5. -17l*5 Expand (s - s + s)(2s + 0 + 0) + 0 - 7s*2 + 0 + (-s - 3s + 3s)(3s - 2s - 5s). -s2 Expand (3 + 2z4 + z4 - 2)(3 - 3 + 2). 6z*4 + 2 Expand (-c + 2c + 2c)(-2c - 5 + 0c + 4). -6c2 - 3c Expand (2u - u + 0u)(-10 - 13u3 + 10) + (u3 - 2u3 + 0u*3)(-2u + 4 - 4). -11u*4 Expand (5 - 4 - 3)(-5 + 5 + 5a3)(-2a - a + 5a + (-2a - 2a + 3a)(2 - 1 + 0)). -10a4 Expand (4f*3 + 2f*3 + 4 - 4f*3)(18 - 18 - f*2). -2f*5 - 4f*2 Expand (0y + y + y)(-2y + 1 - 1) + (0 + 0 - y)(-1 + 5y + 1). -9y2 Expand (-2 - 3 + 3)(-8 + 5 - 1)(-3f4 + f4 - f*4). -24f*4 Expand (3 - 2 + 4)(-3 + 2 - 1)(-4z2 + z2 + 2z2). 10z*2 Expand ((1 - 3 - 1)(2 + 2 - 2) + 1 + 0 + 1)(w + 1 - 1). -4w Expand (4 - 7 + 2)(-194g*2 - 137g*2 + 401g*2). -70g*2 Expand (2j - 4j + j)(-2j2 - 3j*2 + 4j*2)(j - j + 2j). 2j*4 Expand (-4 - 3 + 1)(5q + 3q - 5q). -18q Expand -8z2 + 7z*2 + 8z*2 - 6z2 + z2 + 3z2 + (-4z2 + z2 + 5z2)(-3 + 1 + 0) + z*2 - 2z*2 + 2z2 + 1 - 1 - z2. z*2 Expand (5 - 4o - 2 + 7o)(-1 - 2o3 - o + o). -6o*4 - 6o*3 - 3o - 3 Expand 2m5 + 0m5 - m5 + (2m + 2m - m)(0m4 - m4 + 4m4) - 3m*5 + 3m5 + m5. 11m5 Expand (-45 + r + 45 + 5r*3)(-r*2 + 5r*2 - 3r*2). 5r5 + r3 Expand (1 - k - 1 + (2k - 2k - 2k)(-4 + 1 + 4))(1 - 1 - 2k)(-3k + 5k + k). 18k*3 Expand (-3 + 3 - 8h)(3h*4 + 0h*4 - 4h*4 + (6h + 0h - 4h)(0h*3 + 2h3 - h3) - h4 + h2 - h2 + h4 + 0h4 - 3h*4). 16h*5 Expand (-2j2 - 3 + 4 + j2)(-2j*2 + 5j*2 + 0j*2). -3j*4 + 3j*2 Expand (18s - 18s - 20s*2)(3s - 3s + s + (-s + 2s + 0s)(3 + 1 - 3)). -40s*3 Expand (14r*2 - 14r*2 + 7r*2)(0 + 0 + 3r)(0 - 2 + 0)(0r + 3r - 4r) + 4 - 4 - 2r4. 40r*4 Expand 4n - 4n + 2n + 2n - 4n + 4n - 3n - 2n + 4n + (-2 + 2 - 2n)(3 + 0 - 1) + 2n + 2n + 5n + 2 - 2 - 2n. 6n Expand (3 - 3 - i)(3i2 + i2 - 3i*2) + 2i*3 + 0i*3 - 4i3 + i3 - 2i3 - i3 - 2i*3 + 3i*3 - 14i3 + i3 + 3i3 - 3i*3. -17i*3 Expand (2n + 5n - 2n)(0n*2 + 2n*2 - 3n*2) + 0n*3 - 4n*3 + 3n*3 + (-4n + 3n + 2n)(-4n*2 + 3n*2 + 3n*2). -4n*3 Expand (-2a*3 + 2a3 - a4)(-9 - 24 - 29). 62a*4 Expand (-5z*4 + 4z*4 + 0z*4)(0z + 2z + 590 - 589). -2z5 - z4 Expand (16 - 10 + 10)(1 - 1 + 2i) - 2 + 1 + i - 3i. 30i - 1 Expand (-22 - 36 + 10)(0 - s + 1 + 1). 48s - 96 Expand b2 + b2 + 0b*2 + (b - b - 2b)(2b - 5b + 0b) + (-2b - b + 5b)(-3b + b + 0b) - 2b*2 - 3b*2 + 7b*2. 6b2 Expand -c5 + 0c5 + 0c*5 + (-2 - 1 - 1)(2c5 + c5 - 4c*5) + 5c5 - c5 - 2c5. 5c*5 Expand (1 - 2j*3 - 1)(0j + 4j - 6j)(1 - 3 + 5). 12j4 Expand 6 + 3p*2 - 6 + (4 - 4 + 3p)(2p + 5p - 6p) + 2 - 2 - 2p2 + 2p2 + p2 - 4p2 + (0 + 2p + 0)(-2p + 2p - 2p). -p*2 Expand -3o5 + o2 - o*2 - 3o*4 + 2o*5 + 3o*4 + (3o*4 + 4o*4 - 5o*4)(-4o + 3o + 4o). 5o*5 Expand -21a*2 - 15 + 15 + (2a - 3a - a)(-a + 2a + 0a) - a*2 + 0a + 0a. -24a*2 Expand (-3u*3 + 2u + 8u3 - 4u)(2 + 3 - 3). 10u*3 - 4u Expand d - 2d - d + (-d - 2d + d)(-3 + 7 - 2) - d + 2d - 2d - 1 + 4d - 9d - 8d. -20d - 1 Expand (2a2 + a2 - 2a2)(-5a + 2a - 2a + (0a + a - 2a)(-3 + 4 - 3)). -3a3 Expand (-z + 2z + z)(z + 0z - 6z). -10z*2 Expand 3c4 + c4 - 3c4 + (-2c + 2c + 2c*2)(-2c2 + 4 - 4) + (0c - 5c + 4c)(-5c*3 + 4c*3 + 0c*3) + 0c*4 - 6c*4 + 0c*4. -8c*4 Expand -2c*4 + 3c - 3c + (6c*3 - 3c3 - c3)(-6c + 3c + 2c) + (c - 3 + 3)(c3 - c3 - c3). -5c*4 Expand -o - o + 0o + (0 + 3 - 1)(-o - 2 + 2) - o + o - o - o + 5o - 2o + (-4 - 2 + 5)(-o + 4o - 2o). -4o Expand (-3 - 4 + 2)(0 - j + 0)(-2j - 2j + 3j). -5j2 Expand (1 + p - 1)(-6 - 2 + 1). -7p Expand -27p*2 - 7p*3 + 27p*2 + (-4 + 4 - 2p)(0p + 2p2 + 0p). -11p3 Expand 2o + 2 - 2 + (3 - 2o - 3)(3 - 2 + 0) + 6o + 44 - 44. 6o Expand (2 - 2 + i)(-3i + 4i - 2i) + (3i + 2i - 8i)(4i - 3i - 2i). 2i*2 Expand (-19x + 25x + 14x)(-3x*2 + 4x2 + x2). 40x3 Expand (-3 + 2 - 2)(0 + 0 - 1)(-4o*5 + 9o - 9o). -12o*5 Expand -4u - 3u3 + 4u - 2u3 - u3 + 5u*3 + (0u3 + u3 - 2u3)(2 + 0 + 2). -5u3 Expand (-1 - s + 1)(-6 + 6 + 7). -7s Expand (2a - 5a + a)(68a2 - 68a*2 + 9a*3). -18a*4 Expand 0u*5 + 2u*5 + 0u5 + (0 + 0 - u2)(u3 - u3 - u3) + 10u - 4u5 - 10u. -u*5 Expand (0n*2 - 2n2 + n2)(50 + 87 - 22). -115n*2 Expand (3l - 2l - 2l)(-1 + 0 + 0)(3l - 13l + 9l)(-1 + 1 - 3l2). 3l*4 Expand (9d*2 + 2 - 7d*2 + 2)(2 + 2 - 3). 2d2 + 4 Expand ((-4 + 4 + 2)(4b - 2b + b) + 5b - 2b - 2b + 4b + 0b - 3b)(-6b2 + b2 + 4b2). -8b3 Expand -y3 + 2y3 + y3 + (0y*2 - 2y*2 + 0y*2)(-3y - 5y + 4y) - y - y3 + y. 9y*3 Expand (1 - 1 - 1)(2 + 1 - 5)(4k - 5k + 2k). 2k Expand (-18 - 3 + 1)(2y - y - 2y). 20y Expand -i2 + i2 + 2i*3 - 3i*3 + 2i*3 + 3i*3 + (1 + 2i - 1)(6i*2 + 0i + 0i). 16i*3 Expand (1 + 2h - 1)(-1 - 3 + 3) + (1 - 1 + h)(2 - 4 + 1). -3h Expand (-2c*2 + 3c2 + c2)(-7c + c*2 + 7c) + 3c4 + 2c*4 - 4c*4 - 3c*4 + 2c4 - c4. c*4 Expand (-59a*2 - 12a*2 + 12a*2)(-a + 2a + a). -118a*3 Expand 3s*3 - 3s3 + s5 + (2s2 + s5 - 2s*2)(1 + 0 + 1) - 40s2 - 33s*2 - 2s*5 + 45s2. s5 - 28s2 Expand (2p - 3 - 3p + 1)(5 - 1 + 11). -15p - 30 Expand (-h + 2 - 3 + 2h)(12 + 8h - 12). 8h2 - 8h Expand (-5q + 0q + 4q)(-4 + 3 + 2) + (-1 - 3 + 5)(5 - 5 - q). -2q Expand (-j - 3j + 2j)(-2j - 5j + 4j)(-3 + 8 + 6). 66j*2 Expand (m - 14 + 27 - 2m)(2 - 3m*2 - 2). 3m*3 - 39m*2 Expand (-12x*5 + 17x*5 - 12x*5)(0 + 4 - 7). 21x5 Expand (3i4 + i4 - 2i4)(5 + 1 + 2). 16i4 Expand (2c2 + c2 - c*2)(0 + 0 + c) - 126c3 - 141c*2 + 141c*2. -124c*3 Expand (-v - 3 + 3 + (1 - 1 + v)(1 - 9 + 0))(2v + 0v - v). -9v*2 Expand (3u + u - 3u)(284u2 - 1 + 135u*2 + 1). 419u*3 Expand (-4z - 2 + 2 + (0 + 0 + 3)(z - 3 + 3))(-4 + 2 + 0). 2z Expand (-2c*2 + 2c*3 + 2c*2)(-54c2 - 53c*2 + 108c*2). 2c*5 Expand 78d - 31d - 33d + (4 + d - 4)(-1 + 4 - 4) + 3d - 5d + d. 12d Expand (5k3 - 4k + 4k)(-3k2 + k2 - k2 + (-3k + 2k + 3k)(-6k + 3 - 3)). -75k5 Expand 16i*4 + 34i*4 - 13i*4 + 3i*4 - 2i*4 - 2i*4 + (-2i + 3i - 3i)(-2i - i*3 + 2i) + 2i - 2i + 2i4. 40i*4 Expand (0 + 2 - 3)(u2 - u2 - u*2)((u + 0u - 2u)(0u*2 - 4u*2 + 2u2) - u2 + u2 + u3). 3u5 Expand -5z*3 + 0z*3 + 2z*3 + (1 + 1 + 0)(-3z3 - z3 + 2z*3) + 0z*3 - 3z3 - z3. -11z3 Expand (0c + 2c - c)(-2c4 + 3c4 + c4) + 4c5 - 2c5 - c5 + 8401 - 4c5 - 8406 - 10c*5 + (-2c - c + c)(4c4 - c4 - 2c4). -13c*5 - 5 Expand (3w - 2w2 - 3w)(-2w*3 + 3w*3 - 3w*3) - 2w*2 + 2w*2 - 2w*5 + (-2 + 2w*4 + 2)(-2w - 3w + 6w). 4w*5 Expand (-2t - t + 2t)(-t + t + t)(-5t - 22t + 7t). 20t3 Expand -u2 + 4u*2 - 5u*2 + (0 - u + 0)(5 - 3u - 5) + 0u*2 + 3u2 + u2 + (2 + 1 - 2)(-3u*2 + 4u*2 - 2u*2). 4u2 Expand (10 + g2 - 10 + 3g)(-g + 0g + 3g)(1 + 3 - 2). 4g*3 + 12g*2 Expand (4 - 2 - 1)(-2g2 + 6g*2 - 2g*2) + (g + g + 0g)(4g - 2g - 4g). -2g2 Expand (-9h - 4h + 19h)(h + 1 - 1). 6h*2 Expand (-3 + 3 - l)(4l - 23 + 23) + l2 - l2 + 2l2 + (-l2 + 5l2 - 2l*2)(3 - 3 - 2). -6l2 Expand (-2 + 5 - 1)(l5 + l2 - l*2) - 13l5 - l4 - 155l + 155l. -11l5 - l4 Expand (3i + 3i - 3i)(0 - 3 + 4). 3i Expand (2a - a + a)(-3 + 3 + a - a + 4a - a + (4a - 3a - 3a)(2 - 3 + 3) + 1 - 1 - a)(4 - 2a - 4). 8a*3 Expand (2 - 1 + 0)(-q + q + 2q2). 2q*2 Expand (2n - 3n - n)(-2 - 1 + 1) - 21n - 38n	{ "pile_set_name": "DM Mathematics" }
t of 0.7 and -12668160. -8867712 Multiply -123.72519 and 0.31. -38.3548089 Multiply 0.4 and -26763756. -10705502.4 Multiply 4 and 132707.005. 530828.02 Work out 359612 * -1.217. -437647.804 Product of 15425087 and 0.5. 7712543.5 What is 323 times -36579? -11815017 Product of -2 and -2329956. 4659912 -11 times -6206251 68268761 -57563683 -47777788 What is the product of -3746.3 and 0.031? -116.1353 -2862211 -0.9 2575989.9 Work out -2467 * 55.309. -136447.303 Multiply 347.6 and 1.219. 423.7244 3 * 204474733 613424199 Calculate -0.033-0.014631. 0.000482823 Work out -3.2751 -22. 72.0522 -93.797495 * 3 -281.392485 What is 6 times -85.024? -510.144 Work out -13474511 * -9. 121270599 Product of -0.63 and 202.768. -127.74384 What is -0.14 times 132176? -18504.64 What is the product of 15602084 and 2? 31204168 Product of 1025847 and -1.5. -1538770.5 What is the product of 121603 and -68? -8269004 -4.93967.979 -39.4130684 Work out -2850 -9617. 27408450 Work out 2635.4 * 75.8. 199763.32 What is 0.3 times 271.45092? 81.435276 -873.2 times -0.0021 1.83372 Multiply -24 and -2.11382. 50.73168 Work out 0.020975 * 134.5. 2.8211375 Multiply 1789399.62 and 0.1. 178939.962 What is the product of 0.6 and -27588083? -16552849.8 Product of 0.07 and -31.02441. -2.1717087 0.5-0.598795 -0.2993975 Calculate 68290014-0.5. -34145007 Multiply 15330.4593 and -0.1. -1533.04593 Calculate -7-0.35750023. 2.50250161 What is the product of -0.394 and 3.3? -1.3002 0.08-131447917 -10515833.36 -0.0059 * 3453 -20.3727 -13 * 110.6248 -1438.1224 Calculate -0.11.1850714. -0.11850714 Multiply 130347 and 0.4. 52138.8 -8.48 times -37568 318576.64 4391 10963 48138533 -5676.44 * 12 -68117.28 Work out -0.964913 * -2. 1.929826 Calculate 2.41019255. 12.0509625 Calculate 0.333758-688. -229.625504 Work out -75 * -853.93. 64044.75 Multiply -186 and 21.578. -4013.508 -4166897.5 -4062630 What is the product of 0.3 and -4844417? -1453325.1 -1.1571872 -2165.904 Product of -251.52 and 0.0689. -17.329728 0.5 times -39.011593 -19.5057965 Multiply -4384261 and 0.15. -657639.15 Product of 179.4 and 150509. 27001314.6 Calculate 219919183-5. -1099595915 What is the product of 4 and -333790208? -1335160832 Product of -11047 and -0.0602. 665.0294 Calculate -0.4-15263375. 6105350 Multiply -5.82446 and -0.141. 0.82124886 -2 * -38191421 76382842 What is the product of 0.38 and -932081? -354190.78 -75878209-0.9 68290388.1 -1497040 times 357 -534443280 1061 times 266.6 282862.6 Calculate 3-191535.3. -574605.9 Product of -0.5022 and 0.12716. -0.063859752 Calculate 9381102. 1033676 Calculate -0.351304006. -456402.1 0.2 * -70907191 -14181438.2 What is 88898539 times -3? -266695617 Multiply 4939 and 1095. 5408205 -6754-1.1951 8071.7054 -0.287163 times 44 -12.635172 Product of -5 and -22.41523. 112.07615 Calculate 478682.0752. 99335.6736 -261695-2668 698202260 What is -818007.9 times -0.5? 409003.95 150.5 -231620 -34858810 -3.3 * 46206 -152479.8 Product of -5183889 and 1. -5183889 Work out 7 * 14244215. 99709505 31267.66 * 8 250141.28 -0.27 * -20.3632 5.498064 Work out -0.04 * 0.01495552. -0.0005982208 Calculate -3.4741722. -76.43174 -236-3164.496 746821.056 -2.56 times 25215 -64550.4 0.0714 * 1390.2 99.26028 Calculate -4663-134162. 625597406 Multiply -0.2 and -19135604. 3827120.8 Product of 0.19 and 9445.796. 1794.70124 2.8 -170990 -478772 Product of -6.37 and 10.27849. -65.4739813 Calculate 249309240.1. 2493092.4 What is -84382 times 363? -30630666 -2459730 times 81 -199238130 Multiply -1.1069 and -0.186. 0.2058834 What is -17 times 39050731? -663862427 Work out -35.6 -27109. 965080.4 What is 124554846 times -1? -124554846 -0.0504-1074 54.1296 What is the product of 19391 and 1.76? 34128.16 What is the product of 0.03 and -7462158? -223864.74 -283.5386 7 -1984.7702 What is the product of 4 and 2.1713056? 8.6852224 What is -0.2 times -2074459? 414891.8 Work out -25.763 * -8.3. 213.8329 Work out 2.2 * 327695. 720929 -209676688-1 209676688 What is -4557 times 0.09552? -435.28464 Product of 10.3754 and -61. -632.8994 Multiply 109 and -1.5608. -170.1272 What is -17 times -8199384? 139389528 What is the product of 1560 and -2.46? -3837.6 Product of -1 and 27519.852. -27519.852 Work out -80 -0.06871991. 5.4975928 What is -32.3554 times 5? -161.777 Calculate 340.0106178. 0.3610052 Product of 2 and 3507.7099. 7015.4198 -2 167388915 -334777830 355.8 * -14180 -5045244 What is -2701237 times 12.3? -33225215.1 Work out -4.8 * -3056.421. 14670.8208 Product of -2 and 48702.6. -97405.2 Calculate 3.9458-1092. -4308.8136 -716784472 -117491304 Calculate 23671.87-8. -189374.96 Calculate 84212304. 19401984 What is the product of 3 and 0.694581? 2.083743 Work out 1223856 * 0. 0 Multiply 0.347 and 3.8977. 1.3525019 Calculate 21888-49.01. -1072730.88 944736 -0.08 -75578.88 What is the product of 19 and -1.26778? -24.08782 Product of -93978064 and -0.4. 37591225.6 -1.1 * -736894 810583.4 Calculate -121139023. -13668276 -20 times -15582244 311644880 What is the product of 3 and 30910575? 92731725 Work out 31 -103940. -3222140 Multiply -4428 and -143.9. 637189.2 107576 times -31 -3334856 1 * 3577944 3577944 Calculate -0.015867-4159. 65.990853 What is -3136.219 times -5.4? 16935.5826 Product of -0.18 and -1.94082. 0.3493476 Calculate 28892.4-4.42. -127704.408 -23 * -12.86915 295.99045 Multiply -2207 and 16.614. -36667.098 2363070 times -2 -4726140 Product of -1.9 and 26356.6. -50077.54 What is 1142 times -170119? -194275898 Work out -0.0338 * -155727. 5263.5726 Multiply 1405 and 0.06857. 96.34085 Calculate -0.23906240. -781248 What is -9540336 times 0.5? -4770168 Multiply 0.292 and -0.12976. -0.03788992 Work out -15378 22.3. -342929.4 What is -0.0045408 times 41? -0.1861728 Product of -130 and 50684. -6588920 Multiply 103.8 and -6143. -637643.4 Calculate 2355314643. 344886579 Multiply -0.027973 and 0.0367. -0.0010266091 Calculate 447-3.1102. -1390.2594 What is 59751 times -492? -29397492 Multiply -33715793 and -1. 33715793 35261-291 -10260951 What is the product of -136745837 and 0.4? -54698334.8 What is the product of 126645920 and -0.2? -25329184 -765 -1390.19 1063495.35 553037231-0.5 -276518615.5 Multiply 1915.0203 and 3. 5745.0609 Product of -0.1 and -0.39552118. 0.039552118 Multiply -13807 and -2384. 32915888 Calculate -5844-10632. 62133408 What is 3.5961 times 2274? 8177.5314 Work out 0.061541 * 31.5. 1.9385415 Work out 121.3 * -195036. -23657866.8 Product of 25.4426 and 0.02368. 0.602480768 -728 times -1348.7 981853.6 Work out -3828.4 * -2800. 10719520 Multiply 5110 and -2916. -14900760 Multiply 0.07 and -5.9375045. -0.415625315 Work out -1231380 * -2.1. 2585898 What is -0.3 times -0.11239263? 0.033717789 -195903.1 times 0.454 -88940.0074 What is the product of 25985956 and 0.5? 12992978 9414742 * -9 -84732678 What is the product of 139.577 and 47.5? 6629.9075 What is -3 times -2000825? 6002475 0.2 times 5308.94 1061.788 What is 0.27 times 95315? 25735.05 -6974696 -4184814 Calculate -50643832.6. -16509878.8 -638243 * -7 4467701 -1112759 * -17 18916903 Product of 497.715 and -0.1. -49.7715 What is the product of -0.9813 and -0.1161? 0.11392893 -0.62642223 -139.69166 What is -0.04 times -48575150? 1943006 Work out -3.9 82212. -320626.8 Multiply -13.6 and -152473.3. 2073636.88 Multiply -63239 and -2.5. 158097.5 What is 563.55 times 258? 145395.9 Work out 0.2 * -82463645. -16492729 Work out 30 * -632.6. -18978 What is the product of -1496110 and 7.4? -11071214 What is 0.3 times 11297538? 3389261.4 Multiply 0.46413174 and 1. 0.46413174 Product of -18359.66 and -0.007. 128.51762 561847 * 3.68 2067596.96 Work out 0.08 * -107.791928. -8.62335424 Work out 8.8 * -118035. -1038708 Work out -2126 * -1237.3. 2630499.8 -3463191 times 4 -13852764 What is the product of -770 and 1.2807? -986.139 Product of 5 and 0.059956211. 0.299781055 Work out -1.39 * -330802. 459814.78 Multiply 0.5 and -1.8136042. -0.9068021 -6377 times -340.1 2168817.7 Multiply -214681837 and 2. -429363674 266.3 times -372.182 -99112.0666 What is 194.7 times -0.10074? -19.614078 Work out 0.2 * 374.77269. 74.954538 Product of -16.40672 and 10. -164.0672 -0.5*-145641661 72820830.5 What is -0.45 times 957.21	{ "pile_set_name": "DM Mathematics" }
-2, 3, 11913, -5 in descending order. 11913, 3, -2, -5 Sort -4, -2, -1085, -25 in ascending order. -1085, -25, -4, -2 Sort -367, 1/2, -3/2, 5, 3. -367, -3/2, 1/2, 3, 5 Put -4, 4, 240/11, 2/9 in descending order. 240/11, 4, 2/9, -4 Put 4, -9, 6, -5, -1377 in decreasing order. 6, 4, -5, -9, -1377 Sort 3, 9, 21, -24, -1 in descending order. 21, 9, 3, -1, -24 Sort 3/4, 10, -0.2, 0.4, 0.12 in descending order. 10, 3/4, 0.4, 0.12, -0.2 Sort 2, 1/2, -18.4, 0.1, 1/8, 1.06 in descending order. 2, 1.06, 1/2, 1/8, 0.1, -18.4 Sort -3485, 7, 2/11 in increasing order. -3485, 2/11, 7 Put 41, -2, -6, 1 in increasing order. -6, -2, 1, 41 Sort 5, 7, -2, 294 in descending order. 294, 7, 5, -2 Put -556, -2, -4, 2, -1 in descending order. 2, -1, -2, -4, -556 Sort 9, -5, 252, -2 in increasing order. -5, -2, 9, 252 Sort 0.05, -3/7, -3, 2070, -4 in increasing order. -4, -3, -3/7, 0.05, 2070 Sort -7, -23, -18, 13 in decreasing order. 13, -7, -18, -23 Sort -2, 7, -18, 1, 2, 3. -18, -2, 1, 2, 3, 7 Sort -2, 7/5, 5.5, -1, -5 in descending order. 5.5, 7/5, -1, -2, -5 Sort 33, 0.3, 1/2, -6/989 in decreasing order. 33, 1/2, 0.3, -6/989 Sort -0.5, -37/4, -2.413. -37/4, -2.413, -0.5 Sort 238, 3, 18 in decreasing order. 238, 18, 3 Sort -5, -0.0323, 298, 5. -5, -0.0323, 5, 298 Put -4, -2, -6, -801, -76 in decreasing order. -2, -4, -6, -76, -801 Put 2, 59, 8 in decreasing order. 59, 8, 2 Sort -1/2, 1/5, 32, 0.3, 329 in decreasing order. 329, 32, 0.3, 1/5, -1/2 Put -317, 1, 68 in ascending order. -317, 1, 68 Sort 20.6, -211, -1/3. -211, -1/3, 20.6 Put -1/12, -19.2, -3, 2/53, -1.2 in descending order. 2/53, -1/12, -1.2, -3, -19.2 Sort -1, -350297, 3, 0 in ascending order. -350297, -1, 0, 3 Sort -16, -2, 213. -16, -2, 213 Sort -0.075, 65, 2, 4 in ascending order. -0.075, 2, 4, 65 Sort -5, 8095, 0.1 in descending order. 8095, 0.1, -5 Sort -890.9, -0.5, 2, -1 in decreasing order. 2, -0.5, -1, -890.9 Sort -0.318, -0.5, -0.2, 0, -592 in ascending order. -592, -0.5, -0.318, -0.2, 0 Put 0, -5, 9, -2, -373, 5 in decreasing order. 9, 5, 0, -2, -5, -373 Put 4/5, -616, -54 in descending order. 4/5, -54, -616 Put -2007, 139.5, 1/3 in increasing order. -2007, 1/3, 139.5 Put -2/17, 1/5, -412, -1/9, -11 in descending order. 1/5, -1/9, -2/17, -11, -412 Sort 1/8, 0.5, 31.8, 4, 29. 1/8, 0.5, 4, 29, 31.8 Put 1/55, 55, 0.3, -30, 3, -4 in decreasing order. 55, 3, 0.3, 1/55, -4, -30 Put -2, 4, 0, -1, -1918, -22 in decreasing order. 4, 0, -1, -2, -22, -1918 Sort -2, 10/9, -3/5, 266 in descending order. 266, 10/9, -3/5, -2 Put -227, 4, -619 in decreasing order. 4, -227, -619 Put 5, 2, -27, -3, 45 in decreasing order. 45, 5, 2, -3, -27 Put -9, -2.5, 0.5, -3/7, -24, -4 in descending order. 0.5, -3/7, -2.5, -4, -9, -24 Put 1, 5, 0.5, -3, 52971 in decreasing order. 52971, 5, 1, 0.5, -3 Put -6, -820, -4 in decreasing order. -4, -6, -820 Sort -0.05624, -20, 3/2, 0.4 in increasing order. -20, -0.05624, 0.4, 3/2 Sort -3, 0.064, 1/3, 0.2, 1, -0.01 in ascending order. -3, -0.01, 0.064, 0.2, 1/3, 1 Sort -2, -11, -223.85. -223.85, -11, -2 Sort -35.61, -14, 0 in decreasing order. 0, -14, -35.61 Put 57, 10045, 0.4 in increasing order. 0.4, 57, 10045 Sort -18, 3, -30, -4. -30, -18, -4, 3 Sort 9, 4, 32, 0, -4 in descending order. 32, 9, 4, 0, -4 Sort 6, 934, -3, -0.2 in decreasing order. 934, 6, -0.2, -3 Put -2/7, -3/4, -2/53, -1/4, -0.69 in descending order. -2/53, -1/4, -2/7, -0.69, -3/4 Put 7, 4, 25, 1, -3, 23 in increasing order. -3, 1, 4, 7, 23, 25 Sort 0, 1, 231, 3, -131 in decreasing order. 231, 3, 1, 0, -131 Put 2/19, -0.5, 5, 76 in descending order. 76, 5, 2/19, -0.5 Put -12, 4, -3/2, -0.2, -6/13 in ascending order. -12, -3/2, -6/13, -0.2, 4 Sort -30, 14, 4, 16. -30, 4, 14, 16 Put 0, -5, 5, 227, -0.09 in decreasing order. 227, 5, 0, -0.09, -5 Sort -1.7, -2/5, -1650 in descending order. -2/5, -1.7, -1650 Sort 4, 0.58, -3, -4, -2/13, -327. -327, -4, -3, -2/13, 0.58, 4 Sort -6, 5381, -28 in decreasing order. 5381, -6, -28 Sort 54, -1/2654, -3/7, -3. -3, -3/7, -1/2654, 54 Put -7, 0.4, 0.04, 1, -0.4 in ascending order. -7, -0.4, 0.04, 0.4, 1 Put 0.1, 16, -117, 5 in increasing order. -117, 0.1, 5, 16 Put -32, -2, 8, 3 in ascending order. -32, -2, 3, 8 Sort -145, 15, -0.08, 3 in decreasing order. 15, 3, -0.08, -145 Put 10, -2/11, 2, 4/9, 0.4 in descending order. 10, 2, 4/9, 0.4, -2/11 Put 0, 2/7, 5877, -6, -3 in decreasing order. 5877, 2/7, 0, -3, -6 Put 4, 3, -5, -9, -388 in decreasing order. 4, 3, -5, -9, -388 Put 0, 8, -1, 7, 40 in decreasing order. 40, 8, 7, 0, -1 Sort -2, -3, 61, 4, 10, 1 in increasing order. -3, -2, 1, 4, 10, 61 Sort -1, 6, -5429. -5429, -1, 6 Sort 140181, -11, -0.3 in increasing order. -11, -0.3, 140181 Sort -197, 114, -3 in decreasing order. 114, -3, -197 Sort -832644, 1/4, -5. -832644, -5, 1/4 Sort -0.3, -4, -8.66, -0.5, 4 in decreasing order. 4, -0.3, -0.5, -4, -8.66 Put 20, 3, -6, -5, -17 in increasing order. -17, -6, -5, 3, 20 Put -2, 52, 121 in descending order. 121, 52, -2 Sort 943, -3, 7 in descending order. 943, 7, -3 Sort 51, -4, -790 in ascending order. -790, -4, 51 Sort 3, 2, -197494 in decreasing order. 3, 2, -197494 Put 1, -5, -4, -51482, -11 in increasing order. -51482, -11, -5, -4, 1 Sort 0.4, 2, -683, 2.1 in decreasing order. 2.1, 2, 0.4, -683 Put 3/10, -87.9, 1/82 in increasing order. -87.9, 1/82, 3/10 Sort 25, 1, 0, 3, 87, -2. -2, 0, 1, 3, 25, 87 Put -57, -1, -0.1, -1/11 in increasing order. -57, -1, -0.1, -1/11 Put 1, -4, 4, 7, -3254 in ascending order. -3254, -4, 1, 4, 7 Put -0.5, -5, -3/2, 3, 38, 154 in descending order. 154, 38, 3, -0.5, -3/2, -5 Put -9, -1, -58, -4, 1 in descending order. 1, -1, -4, -9, -58 Sort -48.13, 93, -3/4 in decreasing order. 93, -3/4, -48.13 Sort 0.01, -0.5, 3/16, 16.6, -4 in descending order. 16.6, 3/16, 0.01, -0.5, -4 Sort -4, 2, 3, -8, 255 in ascending order. -8, -4, 2, 3, 255 Sort 3, -2, -13, -1/5, -5 in decreasing order. 3, -1/5, -2, -5, -13 Put 0, 2, 1, 208, -46, 5 in decreasing order. 208, 5, 2, 1, 0, -46 Sort 12/7, 194, -0.5, 0.4 in increasing order. -0.5, 0.4, 12/7, 194 Put -1, 657, 72 in ascending order. -1, 72, 657 Put -5, 19.5, 0.08, -3, -0.2 in decreasing order. 19.5, 0.08, -0.2, -3, -5 Sort 21, 0, -4, -12, -22 in descending order. 21, 0, -4, -12, -22 Sort -23, -0.2, 1, 1.444. -23, -0.2, 1, 1.444 Put -5, 4, -23, -4/7, -0.4 in decreasing order. 4, -0.4, -4/7, -5, -23 Sort -3/4, -90, 0.4, 2, -2/11, -3 in increasing order. -90, -3, -3/4, -2/11, 0.4, 2 Put 810, -1, -3, 22 in ascending order. -3, -1, 22, 810 Put 1, 8, 4, -48 in decreasing order. 8, 4, 1, -48 Sort 2, 1002, 0.2. 0.2, 2, 1002 Put -98, 4, 9683 in descending order. 9683, 4, -98 Put -34, 23, 0 in decreasing order. 23, 0, -34 Put -188, 6, 0, -88 in descending order. 6, 0, -88, -188 Put 0.82, -2, -1680, 0.2 in decreasing order. 0.82, 0.2, -2, -1680 Put -16, 185, -3, 0 in decreasing order. 185, 0, -3, -16 Sort 12, 1, -2/3, -4, 1.8, -0.5 in decreasing order. 12, 1.8, 1, -0.5, -2/3, -4 Sort -3, -4, -60, 5, 373 in decreasing order. 373, 5, -3, -4, -60 Sort 0.15, 0.3, -3/3481, 0.5, 0.1 in descending order. 0.5, 0.3, 0.15, 0.1, -3/3481 Sort -5, 187, -52, 3 in decreasing order. 187, 3, -5, -52 Sort 2/15, 4, 0.3, -308 in descending order. 4, 0.3, 2/15, -308 Put -3, 8, -2/7, -0.09, -0.1, 2 in increasing order. -3, -2/7, -0.1, -0.09, 2, 8 Sort -121.6, -110, 0.2, -0.3 in decreasing order. 0.2, -0.3, -110, -121.6 Sort 4, 0.5, -43, 67, -2/9, -6. -43, -6, -2/9, 0.5, 4, 67 Put -4542, -2, 4, -31 in decreasing order. 4, -2, -31, -4542 Sort 0.026, 2/299, -4/9, 0.25 in descending order. 0.25, 0.026, 2/299, -4/9 Sort 6, -4, -89, 3 in ascending order. -89, -4, 3, 6 Sort 7767, -3, 0, -4, 9 in descending order. 7767, 9, 0, -3, -4 Sort -8, 24, -26 in descending order. 24, -8, -26 Sort 4, 410, 0, -22, 1/2, -4. -22, -4, 0, 1/2, 4, 410 Sort 2/7, 178532, -1 in increasing order. -1, 2/7, 178532 Sort 19, -1, 14402 in increasing order. -1, 19, 14402 Sort 30, -41, -3, -5, -1 in descending order. 30, -1, -3, -5, -41 Put -2, -10, 2849, -4 in decreasing order. 2849, -2, -4, -10 Put -3/10, 1, -1, 132, 5, 1/3 in descending order. 132, 5, 1, 1/3, -3/10, -1 Sort 8.7, 0.09, 6, -1, -0.04 in descending order. 8.7, 6, 0.09, -0.04, -1 Sort 0.2, -3, 3/2, 2/15, 49, 2/11 in decreasing order. 49, 3/2, 0.2, 2/11, 2/15, -3	{ "pile_set_name": "DM Mathematics" }
8, -102? -176 What is the next term in 185642, 371297, 556952, 742607? 928262 What comes next: -1062, -1676, -2290, -2904, -3518? -4132 What is the next term in -34, -107, -242, -481, -866, -1439, -2242, -3317? -4706 What comes next: -1912, -1824, -1684, -1498, -1272, -1012? -724 What comes next: 128, 240, 412, 632, 888, 1168? 1460 What comes next: 364, 9, -346, -701? -1056 What comes next: -101049, -404203, -909461, -1616823? -2526289 What is next in -84, -692, -1712, -3144, -4988, -7244? -9912 What is the next term in -191821, -191820, -191819, -191818? -191817 What comes next: -68174, -136343, -204512, -272681? -340850 What is the next term in -219, -237, -281, -363, -495, -689, -957? -1311 What is next in 1599, 1715, 1831? 1947 What comes next: 2663, 2567, 2475, 2387, 2303, 2223, 2147? 2075 What comes next: -1942, -3891, -5846, -7807? -9774 What comes next: -335818, -335813, -335808, -335803, -335798, -335793? -335788 What comes next: 32972, 33037, 33088, 33119, 33124, 33097? 33032 What is the next term in 20046, 39931, 59812, 79689, 99562, 119431? 139296 What is the next term in 92, 394, 906, 1628? 2560 What is next in -9147, -18316, -27485, -36654? -45823 What is the next term in 132, 944, 2284, 4140, 6500, 9352? 12684 What is next in -1434, -1444, -1454, -1464, -1474? -1484 What is next in 4205, 16857, 37943, 67463, 105417, 151805? 206627 What is next in -737, -693, -649, -605, -561? -517 What is the next term in 370, 563, 756, 949, 1142, 1335? 1528 What is the next term in 7494, 7487, 7474, 7455, 7430, 7399, 7362? 7319 What is next in 4405, 4688, 5159, 5818? 6665 What comes next: 196, 477, 948, 1609? 2460 What comes next: 352, 745, 1158, 1585, 2020, 2457, 2890, 3313? 3720 What is next in -10220, -20435, -30652, -40871, -51092? -61315 What comes next: 6, -57, -176, -351? -582 What is next in -210167, -210168, -210169, -210170, -210171, -210172? -210173 What comes next: -244678, -244684, -244694, -244708, -244726, -244748, -244774? -244804 What is next in -867114, -867113, -867112, -867111? -867110 What is the next term in -73146, -292578, -658304, -1170330, -1828662? -2633306 What is the next term in 16590, 33098, 49606, 66114, 82622? 99130 What is next in 1, -7, -35, -89, -175, -299, -467? -685 What is next in -572, -3510, -11478, -26990, -52560? -90702 What is the next term in 13146, 26337, 39530, 52725, 65922, 79121? 92322 What comes next: 6622412, 13244823, 19867234? 26489645 What is the next term in -173, 428, 1029, 1630, 2231, 2832? 3433 What is next in 159, 67, -107, -381, -773, -1301, -1983? -2837 What comes next: 175411, 350823, 526235, 701647? 877059 What comes next: 451, 1895, 4301, 7669, 11999? 17291 What comes next: -58823, -235301, -529431, -941213? -1470647 What is next in -3449, -3428, -3405, -3380, -3353? -3324 What is the next term in -144668, -289338, -434008? -578678 What comes next: -2405, -4850, -7283, -9698, -12089, -14450? -16775 What is next in -1945, -3956, -5963, -7966? -9965 What is next in 873, 889, 915, 951, 997, 1053, 1119? 1195 What is next in -149, 405, 959, 1513, 2067? 2621 What comes next: 2516, 4739, 6962, 9185, 11408? 13631 What comes next: -42, -73, -80, -51, 26, 163, 372? 665 What comes next: 562, 2079, 4548, 7969, 12342, 17667, 23944? 31173 What is the next term in 13, 98, 251, 484, 809? 1238 What comes next: 5119226, 5119227, 5119228, 5119229, 5119230? 5119231 What comes next: 37158, 74309, 111462, 148617, 185774, 222933, 260094? 297257 What comes next: -1562, -2970, -4378, -5786, -7194? -8602 What comes next: -106, -381, -830, -1453? -2250 What is the next term in 101, 183, 277, 383, 501? 631 What is the next term in 152278, 152277, 152276, 152275, 152274? 152273 What is the next term in 1089, 4335, 9745, 17319? 27057 What is the next term in 191442, 191430, 191402, 191352, 191274, 191162, 191010, 190812? 190562 What is the next term in 70, 138, 210, 286, 366, 450, 538? 630 What is next in 52290, 52288, 52286, 52284? 52282 What comes next: -771, -1500, -2189, -2832, -3423, -3956, -4425? -4824 What is next in -3328, -6656, -9996, -13354, -16736, -20148, -23596, -27086? -30624 What comes next: 28394, 28392, 28390, 28388? 28386 What comes next: -124, -269, -398, -511? -608 What is next in 15576, 15569, 15562? 15555 What comes next: -124, -251, -380, -511, -644? -779 What is the next term in 205264, 205257, 205238, 205201, 205140, 205049, 204922? 204753 What is the next term in -2469, -9850, -22155, -39390, -61561, -88674, -120735, -157750? -199725 What is the next term in 13, -24, -159, -440, -915, -1632? -2639 What comes next: 54, -22, -188, -468, -886, -1466? -2232 What is next in -204, -185, -150, -93, -8, 111, 270? 475 What is next in -817, -1354, -1891, -2428, -2965? -3502 What comes next: 11088, 22197, 33310, 44427? 55548 What is the next term in 738950, 1477896, 2216842, 2955788, 3694734, 4433680? 5172626 What comes next: 2058, 1878, 1698, 1518, 1338, 1158? 978 What is next in -6217, -24858, -55927, -99424? -155349 What comes next: -1977785, -1977788, -1977793, -1977800, -1977809, -1977820, -1977833? -1977848 What is next in 302, 307, 318, 335, 358, 387? 422 What comes next: 6346, 50741, 171250, 405931, 792842, 1370041, 2175586? 3247535 What comes next: -123831, -247651, -371469, -495285, -619099, -742911, -866721? -990529 What comes next: -89076, -178176, -267276, -356376, -445476? -534576 What is next in 34, 74, 82, 40, -70, -266? -566 What is next in 150, 102, 38, -48, -162, -310, -498, -732? -1018 What is next in -815, -3155, -7051, -12503, -19511, -28075, -38195? -49871 What is next in 9579, 9582, 9583, 9582, 9579? 9574 What is the next term in 64, 193, 410, 721, 1132, 1649, 2278? 3025 What is the next term in 3773, 30028, 101277, 240014, 468733, 809928, 1286093? 1919722 What is next in 367, 697, 945, 1117, 1219, 1257? 1237 What comes next: -13954, -13973, -14018, -14101, -14234? -14429 What comes next: 54, 96, 208, 426, 786? 1324 What is the next term in -175, -684, -1531, -2710, -4215, -6040, -8179? -10626 What comes next: -35202, -35201, -35200, -35199, -35198? -35197 What comes next: -441, -396, -351, -306, -261? -216 What is the next term in 264, 441, 518, 483, 324, 29, -414, -1017? -1792 What comes next: 595, 1033, 1763, 2785, 4099, 5705, 7603? 9793 What is next in 216, 628, 1746, 3924, 7516, 12876, 20358, 30316? 43104 What is the next term in -17521, -17513, -17497, -17467, -17417, -17341? -17233 What comes next: 24443, 48893, 73341, 97787, 122231, 146673, 171113? 195551 What is the next term in 152, 336, 538, 764, 1020, 1312, 1646? 2028 What is the next term in -3638, -14590, -32852, -58430, -91330, -131558? -179120 What comes next: -4, -153, -390, -709, -1104? -1569 What is the next term in 19262, 19190, 19118, 19046, 18974, 18902? 18830 What comes next: 286, 266, 212, 106, -70, -334, -704, -1198? -1834 What is next in -20656, -82620, -185894, -330478, -516372? -743576 What is next in 4298, 17153, 38550, 68465, 106874, 153753? 209078 What is next in 305, 1237, 2801, 4997? 7825 What comes next: -12811, -25550, -38289? -51028 What comes next: -263, -2244, -7637, -18146, -35475? -61328 What is the next term in 460, 382, 170, -242, -920? -1930 What is the next term in -465419, -465416, -465413? -465410 What comes next: -457, -1103, -1937, -2959, -4169, -5567, -7153? -8927 What is next in -61925, -495374, -1671885, -3962990, -7740221, -13375110? -21239189 What comes next: -14648, -14631, -14614, -14597, -14580? -14563 What comes next: -308, -1148, -1988, -2828, -3668? -4508 What is the next term in 6758, 54019, 182294, 432089, 843910, 1458263? 2315654 What comes next: 1101, 1054, 1007, 960, 913, 866? 819 What is the next term in 515, 1049, 1605, 2195, 2831, 3525, 4289, 5135? 6075 What is next in 2735, 2810, 3003, 3374, 3983, 4890? 6155 What comes next: -17308, -17293, -17266, -17221, -17152, -17053? -16918 What comes next: 104, 419, 936, 1655? 2576 What comes next: -410, -625, -840, -1055, -1270? -1485 What is the next term in 2403, 9578, 21517, 38208, 59639, 85798, 116673? 152252 What comes next: -934, -1884, -2834, -3784, -4734? -5684 What is next in 102, 99, 60, -21, -150, -333? -576 What is the next term in 4528, 4535, 4554, 4591, 4652? 4743 What comes next: -325, -340, -35	{ "pile_set_name": "DM Mathematics" }
(b) p (c) 2/13 c Suppose 13l + 93 = 15. Let m be 76/168 - l/(-21). Which is the closest to m? (a) -3 (b) -0.5 (c) -0.2 c Let s = -1.97144 + -0.02856. Which is the nearest to 0.2? (a) s (b) 2/21 (c) -6/7 b Suppose -20l = 14l - 51l - 442. What is the closest to 10 in l, 4, -6/7, -2? 4 Let h = 349 - 1049/3. Let q = 2/69 - -59/345. Which is the closest to 0? (a) h (b) q (c) -5 b Let l = -4696 + 4698. Which is the closest to -0.07? (a) l (b) -0.9 (c) 4 b Suppose -83c + 81c - 6 = d, d = 5c + 1. Let q = -1.93 - -2. What is the nearest to c in -3, q, 2/3, -0.16? -0.16 Let j = 247.55 + -291. Let t = j - 0.55. Let q = t + 43.9. Which is the closest to -1? (a) -5 (b) q (c) -3 b Let r(q) = 66q + 3693. Let k be r(-56). Which is the closest to 0.2? (a) 0 (b) k (c) 3/4 (d) 0.02 d Suppose 0c = -2c - 8. Let t = 3505.6 + -3506. What is the nearest to 1 in -0.5, t, c? t Let n = -1.2218 + -12.7782. What is the closest to 0.03 in -4, -3/2, n? -3/2 Let o be 11/77 + (-12)/(-63). Let j = -25.7 - -29.48. Let h = j - -0.22. What is the closest to o in 2, h, 0.3? 0.3 Let x = 203 + -813/4. Let m = 131 + -261/2. What is the nearest to m in 2, -0.2, x? -0.2 Let o = 12677 - 12673. Which is the nearest to 0? (a) -36 (b) o (c) 0.3 c Let h = 0.0059 + 2.6241. Let p = 12930 - 12928.63. Let s = h + p. Which is the closest to -1? (a) -27 (b) 1 (c) s b Let a be ((-2618)/(-371) - 2) + -12 + (-9 - -16). What is the closest to -1 in 0.1, 0.2, a, 1/4? a Suppose -9r = -3v - 5r + 1, -9 = 5v + 4r. Which is the nearest to 2? (a) -0.11 (b) -8 (c) v a Let v = 2 - 1.7. Let o = 5299 + -42403/8. What is the closest to o in v, 2/7, 3? 2/7 Suppose 4n + 2o = 8, -3n - 2o + 1 = -3. Let s(m) = m2 - 601m + 16591. Let i be s(29). Which is the nearest to n? (a) -8 (b) i (c) -2 b Suppose -3c - 189 = 2z - 167, 0 = -z + 2c - 4. What is the closest to 0.1 in -0.3, -5, z? -0.3 Let k = 881/25608 - 5/264. Let q = k + -2021/5238. What is the nearest to -1 in 0, q, 2? q Let d = 0.76 + 47.24. Let h = d - 12. Let q = h - 32. What is the nearest to -1.2 in -3, -1/8, q? -1/8 Suppose 3p - 15 = 4g, -2p + 20 = 2p + 4g. Let h = -2 + -2. Let v = -3 - h. What is the closest to v in p, -0.5, 2/5? 2/5 Suppose 5l + 2z - 71 = -76, -2z - 10 = 0. What is the nearest to l in 0.5, 9, 0, 1/4? 0.5 Let x = 31.032 - 30.5. Let c = -0.032 + x. What is the closest to -21 in c, -1, 3? -1 Let l = 386 + -542. Let s = l + 153. Which is the closest to 2? (a) -1/5 (b) s (c) -3/2 a Let y be (-1 - 39/(-52))(-2)/(-4). Which is the nearest to y? (a) -2/5 (b) 0 (c) 115 b Suppose 8z - 430 = -78z. What is the nearest to 4 in -215, -1/7, z? z Let m = 275277/55 - 55062/11. Let g = 0.6 - 2.6. Let x = -3 - g. What is the nearest to x in 0.5, 0.6, m? m Let d(a) = 3a3 - 10a + 1. Let l be d(-2). Let u = 0.07 - 1.07. What is the closest to u in -1, 0.02, l? -1 Let g = 0 + -0.2. Let q = -0.3 - g. Let z = -144379 + 721897/5. Which is the closest to q? (a) -2/11 (b) 1/7 (c) z a Let l = -140 - -144. Let g = 503/8 - 63. Let i = g - -5/8. Which is the nearest to 0.3? (a) i (b) -4/9 (c) l a Let m = -311 - -294.3. Let s = 16.9 + m. Suppose 7h + 42 = 7. Which is the nearest to s? (a) 0.4 (b) 32 (c) h a Let t = -247/6 + 41. Suppose 0o - 104 = 4o. Let n = o + 30. Which is the closest to n? (a) 2/5 (b) -4 (c) t a Let n = 5.2928 - 2.2928. Which is the closest to n? (a) -2/71 (b) -4 (c) -0.3 (d) 4 d Let r = -23.8 - -23.9. Suppose 4s = -4z - 68, z = -4z - 20. Which is the nearest to r? (a) s (b) -1 (c) 1/3 c Let x = -47.09 - -46.99. What is the closest to x in -1, -3, 0.2, 5? 0.2 Let d = -16/57 + 86/171. Let g = -205 - -209. Which is the nearest to -6/19? (a) d (b) g (c) 0.1 c Let v = 18164.5 + -18164. What is the nearest to -2/9 in -2, -2/13, -0.3, v? -2/13 Let y = -4.8 + 4.8. Let f be 3/(-60) - 5/(-80)4. Which is the closest to y? (a) 0 (b) f (c) -0.04 a Let h = -2390 - -2389. Which is the closest to h? (a) 6 (b) 0 (c) 3/5 (d) 0.5 b Suppose 2j = 12j - 50. Suppose 2y - 12 = -ju + 8u, -3y + 5u = -19. Which is the nearest to 1? (a) 2 (b) -0.7 (c) y (d) 8 a Let r = -139 - -970/7. What is the closest to 2/7 in -0.5, 91, r, 1/4? 1/4 Let i = -101 - -708/7. Let n = 728 + -730. Which is the closest to 2? (a) n (b) i (c) -0.1 b Let x(i) = i*2 - 87i + 334. Let z be x(4). Let o = -5.1 - -0.1. Let k = 9/10 + 8/5. Which is the closest to z? (a) o (b) -2 (c) k c Let i = -1018 - -1018.2. Let x = -105 - -101. Which is the nearest to i? (a) x (b) -1 (c) -1.3 (d) 2 b Suppose -818s - 1667 = 88s + 145. Let x = -3/46 + 101/138. Which is the nearest to 0? (a) s (b) x (c) -2/7 (d) -7 c Let q = -34 - -243. Let f = 205 - q. What is the closest to -0.3 in -1, 2/7, f? 2/7 Let z = 30465 - 30465. Let l = 22 - 25.1. Let f = 3 + l. What is the closest to f in 0.01, z, -0.1? -0.1 Suppose 106z - 49z + 124 = -67z. Let s = 6 + 52. Which is the nearest to s? (a) z (b) -0.2 (c) 1/5 c Let w be (24/(-18) + 1)/((-1462)/(-12)). Let n = w + -723/2924. Let h = 0.1 + 0. What is the nearest to -0.2 in -5, h, n? n Suppose -9q + 7q + h = 8, -7h - 28 = 0. What is the closest to -1/4 in 3, q, -155/4? 3 Let k be (-4(-5)/(-60))/((-5)/15). Which is the nearest to 2/3? (a) -5/3 (b) k (c) 4.6 (d) 2 b Let l = -14 + 281. Let i = -270 + l. Let y = 0.4 - 1.4. What is the nearest to y in 0.2, 0.6, i? 0.2 Let w = 62443/15 + -4163. What is the nearest to w in 0.5, 1/3, 0.6? 1/3 Let z be (-14)/4((-60)/(-56))/(-15). Which is the closest to z? (a) -5 (b) 7/5 (c) 6 (d) -0.1 d Let q = 12.1 - 0.1. Let t = 11 - q. Let o be 4/26 - (730/351 - 2). Which is the closest to t? (a) 1 (b) o (c) -1 c Let x(n) = -n. Let p(a) = -12a - 36. Let i(o) = p(o) - 6x(o). Let b be i(-6). Let w = 1 + -1.1. What is the closest to b in w, -3, 0.05? 0.05 Let f = 0.9 - 0.4. Let n be -15 - 6 - 24 - -46. What is the nearest to n in 1, f, -1/3, 0.17? 1 Let f = 151/35 + -337/70. What is the nearest to -5 in -0.67, 3, f? -0.67 Let p be (9/(-7) - (-10)/10) + 54/42. Which is the nearest to 1? (a) p (b) 0.12 (c) -1/3 (d) -1.2 a Let i = -206 - -206. Which is the nearest to i? (a) 4 (b) 3 (c) 0.02 (d) -5 c Let r be (8/(-14))/((-1096)/959). What is the closest to 0.4 in r, 1, -25? r Let v = 3707 + -3706. Which is the closest to v? (a) -0.1 (b) 2/3 (c) -5 (d) 6 b Suppose -51 + 24 = -3p. Let h(x) = -p + 13 - x + 10 + 7. Let j be h(15). Which is the nearest to 2/7? (a) j (b) 5 (c) -2/5 c Let u = 1001 + -1000.5. Let w(k) = -k3 - 3k*2 + 3k + 10. Let x be w(-3). Which is the nearest to x? (a) u (b) 5 (c) 0 (d) -7 a Let t = -0.37628 - -0.37628. Which is the nearest to 19? (a) -1/9 (b) -5 (c) t c Let c = -3.81264 + -1.18736. Let x = -27/58 - 1/29. Suppose 0 = 2k + 3k + 20. What is the nearest to 0.2 in c, k, x? x Let j = -0.033 + 0.733. Let q(k) = k + 5. Let c be q(-8). Let o be (-3 - (-3)/c)-1. What is the nearest to j in o, 5, 2? 2 Suppose -n - 3 = 0, 3v = -14n + 19n + 12. Which is the closest to 1/3? (a) 1 (b) v (c) -2 a Let i = 2.02 + -2. Let k = 5760 - 5760.1. Which is the nearest to 2? (a) k (b) -2 (c) i c Let r = 3/352 - 761/6688. Let a = 847 + -836.66. Let s = a - 6.34. What is the closest to -2 in s, 1, r? r Let p = -1899943/4010 + 2369/5. Let l = 807/4010 + p. Let j = 1 - 1. Which is the nearest to -1? (a) l (b) 4 (c) j c Let w = 16816 - 16814. Which is the closest to -0.3? (a) -0.03 (b) w (c) -4/9 (d) -2/7 d Let f = -9017 - -9023. Which is the closest to 8? (a) f (b) -2 (c) -0.21 a Let t be 2/4((7 - (-126)/14) + -15). Let n = -0.1 - -0.1. What is the nearest to t in n, -1/4, 0.07? 0.07 Let d = -1451 + 1451.02. What is the closest to 0.15 in -1, d, -3? d Suppose -q - 9 = -1. Let c = 9 + 14. Suppose c = -3s - 2j + 6j, 5s - 5 = -2j. What is the closest to s in q, 3, -3? -3 Let f(v) = -v*2 - 92v - 4. Let a be f(0). What is the closest to 1/2 in -73, a, 0.4? 0.4 Let g = 80.18 - 0.98. Let z = g - 79. Let b = -0.3 + 1.3. What is the closest to b in 1, -3, z? 1 Let n(j) = j*3 - 9j*2 - 13j + 189. Let l be n(7). Which is the nearest to l? (a) -0.5 (b) 1 (c) -4 (d) 8/3 a Let y(g) = -1460*g - 4381. Let j be y(-3). Which is the nearest to j? (a) 1.	{ "pile_set_name": "DM Mathematics" }
eters? 4200 How many micrograms are there in twenty-seven fifths of a milligram? 5400 How many seconds are there in 5.895007 nanoseconds? 0.000000005895007 What is 17/2 of a centimeter in millimeters? 85 Convert 0.861876ng to milligrams. 0.000000861876 What is one fifth of a kilometer in centimeters? 20000 How many millimeters are there in one fifth of a centimeter? 2 What is fourty-four fifths of a centimeter in millimeters? 88 What is 19/4 of a millimeter in micrometers? 4750 How many millimeters are there in 0.2037067cm? 2.037067 What is 0.2250254us in seconds? 0.0000002250254 How many millimeters are there in 52549.09m? 52549090 What is seventy-four fifths of a day in minutes? 21312 How many centimeters are there in 75702.71 micrometers? 7.570271 What is 8/3 of a year in months? 32 Convert 69.24345 litres to millilitres. 69243.45 How many nanograms are there in 1/5 of a microgram? 200 How many litres are there in 2.01766 millilitres? 0.00201766 How many litres are there in 19058.61ml? 19.05861 What is thirty-seven halves of a microgram in nanograms? 18500 How many millilitres are there in 22.67759 litres? 22677.59 What is fourteeen ninths of a hour in seconds? 5600 How many months are there in 1/5 of a decade? 24 What is twenty-six fifths of a millennium in decades? 520 How many weeks are there in 134580.7764 seconds? 0.222521125 What is 46/5 of a gram in milligrams? 9200 How many meters are there in 62905.87 micrometers? 0.06290587 What is 5.876901 millennia in years? 5876.901 How many milliseconds are there in 1/5 of a minute? 12000 What is 5.087988 millennia in decades? 508.7988 What is 342.2789ml in litres? 0.3422789 How many months are there in 15/4 of a decade? 450 What is 71/4 of a kilometer in meters? 17750 How many micrograms are there in eleven quarters of a milligram? 2750 What is 6/25 of a litre in millilitres? 240 Convert 53.26034km to meters. 53260.34 What is 0.9199411 centuries in decades? 9.199411 How many centuries are there in 27/5 of a millennium? 54 Convert 153.20457 months to decades. 1.27670475 Convert 363.7847 millennia to years. 363784.7 What is 3/32 of a tonne in grams? 93750 How many nanometers are there in five eighths of a micrometer? 625 What is 4752.887g in kilograms? 4.752887 How many minutes are there in 62189.2 days? 89552448 How many millilitres are there in 1/5 of a litre? 200 What is twenty-five eighths of a tonne in kilograms? 3125 How many seconds are there in twenty-one quarters of a hour? 18900 How many centimeters are there in 98.25996m? 9825.996 What is 855.5235 centimeters in meters? 8.555235 How many minutes are there in three fifths of a hour? 36 What is 5.272941 millennia in months? 63275.292 How many millilitres are there in three tenths of a litre? 300 How many nanoseconds are there in 30.14427 milliseconds? 30144270 Convert 444.1054 nanoseconds to microseconds. 0.4441054 How many millilitres are there in 3.650863l? 3650.863 How many litres are there in 0.4753285 millilitres? 0.0004753285 How many nanograms are there in seven halves of a microgram? 3500 How many millilitres are there in 3/25 of a litre? 120 What is eleven eighths of a litre in millilitres? 1375 What is 1/10 of a decade in years? 1 Convert 421473.9 weeks to days. 2950317.3 How many kilograms are there in 2.348933t? 2348.933 What is twenty-seven quarters of a meter in millimeters? 6750 Convert 0.131218 litres to millilitres. 131.218 What is 13/4 of a gram in milligrams? 3250 Convert 424.2309 years to decades. 42.42309 What is 8/25 of a millimeter in micrometers? 320 Convert 0.7441242 millilitres to litres. 0.0007441242 What is 89689.33ng in grams? 0.00008968933 Convert 2.068492 centuries to decades. 20.68492 What is eight fifteenths of a minute in seconds? 32 How many millilitres are there in 68497.58l? 68497580 What is 13/5 of a micrometer in nanometers? 2600 How many minutes are there in fourteeen ninths of a week? 15680 How many millilitres are there in 3/10 of a litre? 300 What is seventy-two fifths of a kilometer in meters? 14400 What is twenty-nine halves of a litre in millilitres? 14500 What is 793615.3ml in litres? 793.6153 What is sixty-nine halves of a decade in months? 4140 How many millimeters are there in twenty-seven halves of a meter? 13500 Convert 0.0268662l to millilitres. 26.8662 How many decades are there in six fifths of a millennium? 120 How many nanoseconds are there in 11/10 of a microsecond? 1100 What is 17/4 of a litre in millilitres? 4250 What is one fifth of a litre in millilitres? 200 How many millilitres are there in one twentieth of a litre? 50 How many millilitres are there in 33/5 of a litre? 6600 What is 131724.8km in centimeters? 13172480000 How many kilograms are there in 3/25 of a tonne? 120 How many seconds are there in four thirds of a minute? 80 Convert 81232.59km to nanometers. 81232590000000000 How many microseconds are there in 16.23475ms? 16234.75 How many kilograms are there in six fifths of a tonne? 1200 What is 736045.7 nanograms in tonnes? 0.0000000007360457 How many minutes are there in 24698.37 seconds? 411.6395 How many meters are there in 3/8 of a kilometer? 375 How many meters are there in 0.0705079um? 0.0000000705079 What is 31.25128t in nanograms? 31251280000000000 What is six fifths of a gram in milligrams? 1200 Convert 17.158 seconds to nanoseconds. 17158000000 How many litres are there in 36.1452ml? 0.0361452 How many decades are there in six fifths of a millennium? 120 How many litres are there in 639635.2ml? 639.6352 Convert 2784.76 days to nanoseconds. 240603264000000000 How many milliseconds are there in 3.756798 seconds? 3756.798 How many milliseconds are there in 4/15 of a minute? 16000 How many meters are there in 79.89782 nanometers? 0.00000007989782 How many micrograms are there in 1/64 of a gram? 15625 What is 51/5 of a litre in millilitres? 10200 What is 3/10 of a centimeter in micrometers? 3000 How many grams are there in twenty-five quarters of a kilogram? 6250 What is 2.451483ng in kilograms? 0.000000000002451483 What is fourty-five eighths of a hour in seconds? 20250 How many grams are there in 21/8 of a kilogram? 2625 What is 33/5 of a milligram in micrograms? 6600 How many nanometers are there in ninety-three quarters of a micrometer? 23250 How many months are there in five sixths of a year? 10 What is 4/15 of a century in months? 320 What is 721.0277ng in milligrams? 0.0007210277 How many millilitres are there in twenty-seven halves of a litre? 13500 How many millilitres are there in 580.017 litres? 580017 Convert 2.649826 millilitres to litres. 0.002649826 What is 30.22398 litres in millilitres? 30223.98 How many months are there in 0.2192778 centuries? 263.13336 How many micrograms are there in 56129.13t? 56129130000000000 How many tonnes are there in 276.0252 micrograms? 0.0000000002760252 How many centimeters are there in three tenths of a meter? 30 What is 187.7724 kilometers in centimeters? 18777240 What is three tenths of a millimeter in micrometers? 300 What is 2.3580822 months in decades? 0.019650685 How many millilitres are there in 29/2 of a litre? 14500 How many kilometers are there in 222.61nm? 0.00000000022261 What is 77/5 of a micrometer in nanometers? 15400 What is 384071.5ml in litres? 384.0715 How many hours are there in 19/4 of a day? 114 Convert 205.1038 centuries to millennia. 20.51038 How many microseconds are there in 0.587954 days? 50799225600 What is 2847.564 millennia in decades? 284756.4 What is fourty-one halves of a kilometer in meters? 20500 Convert 6.405409 years to centuries. 0.06405409 How many milligrams are there in six fifths of a gram? 1200 How many decades are there in 7328.247 centuries? 73282.47 How many decades are there in 35.5104 millennia? 3551.04 How many months are there in 4/15 of a century? 320 What is eleven halves of a millennium in centuries? 55 What is 1624.2627 months in millennia? 0.135355225 How many centimeters are there in one quarter of a meter? 25 How many years are there in seventeen halves of a millennium? 8500 What is 55/3 of a week in hours? 3080 How many meters are there in 0.2581803km? 258.1803 How many nanometers are there in 79/2 of a micrometer? 39500 How many seconds are there in 2	{ "pile_set_name": "DM Mathematics" }
(-8)? True Let g be (-30)/(-1)128/20. Suppose -4p = 5s - 18, 0 = 4p + 11s - 15s. Suppose -pt - g = -5t. Is 16 a factor of t? True Let a(c) = -c*3 + 23c*2 - 27c + 9. Is a(9) a multiple of 30? True Suppose 3c - 25 = -2c. Suppose 4n + 16 = 0, 0h - cn = -4h + 8. Is 6 a factor of h - -1(-44)/(-4)? False Suppose -36 = 5b + 4c, -4b - 5c - 32 = -b. Let j be 8/b + 38 + -1. Suppose 3d - 8d = -j. Is 7 a factor of d? True Let a = 9 - 4. Suppose 3w + n = -a + 12, 4w - 4 = -4n. Is (6/w - 3)-13 a multiple of 13? True Suppose k - 5u = -u + 5, 109 = 5k + u. Let q = k + -18. Suppose 0 = -0t + qt - 93. Is 8 a factor of t? False Is 13509/24 - (-8)/64 a multiple of 17? False Let d = 2999 - 1715. Suppose -5x - d = -17x. Is x a multiple of 13? False Let k(x) = -x2 - 41x + 18. Is 15 a factor of k(-9)? False Does 12 divide 3174/15(-45)/(-18)? False Let y(v) = -v2 - 11v + 12. Suppose 0 = 2p + l - 32, -2l = -3l - 4. Suppose 2d = 4d + p. Does 9 divide y(d)? False Let w = 14 - -71. Suppose -5c + 425 + w = 0. Is 17 a factor of c? True Let d(k) = -k + 1. Let n be d(-4). Let m = -384 + 434. Suppose 0 = -2q - 3t + 26, 3q + q + nt = m. Is q a multiple of 2? True Suppose 5r + 243 = 2r. Let d be (-1)/(-2) - r/18. Suppose -l + 3o + 72 = l, 4l = -do + 144. Is 9 a factor of l? True Suppose -23b - 2260 = -27b. Is 28 a factor of b/7 - 14/(-49)? False Suppose -1 = -3h + 8. Suppose 0 = -hy - 17 - 28. Let i(x) = x2 + 14x + 15. Does 30 divide i(y)? True Suppose 10l + 4s - 4990 = 8l, -s = l - 2490. Is 77 a factor of l? False Suppose -7u + 29928 = 51u. Is u a multiple of 8? False Let k(c) be the second derivative of -c5/20 - 13c4/12 - c3/3 - 5c2/2 + 19c. Is 5 a factor of k(-13)? False Suppose -165 = -j + 190. Is j a multiple of 6? False Let p be 3/1 + (-1 - -34). Let v = p + -36. Suppose -r + 4g = -0r - 4, g - 4 = v. Is r a multiple of 20? True Suppose 3u = -t + 1637, u - 6t - 551 = -5t. Let d = u + -371. Is 22 a factor of d? True Let r = -8 - -5. Let h be r + -19 + -1 + 0. Does 4 divide 1(1 + -3 - h)? False Is 15 a factor of (11/(22/(-28)))/((-4)/6)? False Does 13 divide 5/(15/949)3? True Suppose -4d - 1 = 4o - 9, 3o + 5d = 12. Let q(y) = 28y*3 - 2y*2 + 1. Let b be q(o). Does 19 divide 10/(-5) - (b - 1)? False Suppose 0 = -i - i - 5u + 9, -5u + 26 = 3i. Does 8 divide i? False Suppose -5i - 18 = -3, d + 3i = 398. Does 30 divide d? False Suppose -5d - 5d + 3360 = 0. Suppose 0 = 61v - 64v + d. Is v a multiple of 28? True Let d be ((-12)/10)/(-5 - (-5118)/1020). Let n = d + 110. Is n a multiple of 7? True Suppose -4c = -5h - 5, -2h + h - 1 = c. Let g be -6 - -2 - (-4 + -1). Does 6 divide (gh)/((-6)/120)? False Let x(l) = -35l3 - 8l*2 + l + 3. Is x(-3) a multiple of 25? False Suppose -1 = -3n + 11. Suppose 0 = nw - 8. Suppose -q = wq - 225. Is 25 a factor of q? True Suppose 7w = w. Let u(z) = -z2 + 27. Is 17 a factor of u(w)? False Is 10 a factor of ((-5)/(-10))/(3 - 5037/1680)? True Let c(d) = -d2 + 12d - 2. Let x be c(10). Suppose 3b - x = -3y, -4b + y + 32 = 3y. Suppose 2q - 38 = b. Does 12 divide q? True Let l(f) = f2 + 15f + 18. Let z be l(-14). Suppose zd = 77 + 47. Is 16 a factor of d? False Suppose 660 = 7l + 3l. Is l a multiple of 3? True Does 41 divide 525/751/(21/4644)? False Let t = 73 - 43. Let j = t + -26. Suppose jb - 92 = 76. Is 21 a factor of b? True Let a be (-3 + -1 - -1) + 1335. Let j be (-2)/(-5) - a/(-45). Let s = j + -2. Is 8 a factor of s? False Let s(i) = -37i - 503. Does 57 divide s(-41)? False Let z = -206 - -406. Is 10 a factor of z? True Suppose 0 = -4r - 141 + 701. Let c = r + 42. Suppose 360 = 4u + 5o, 2o - c = -5u + 3u. Is u a multiple of 23? False Suppose 10598 = -8g + 22g. Does 9 divide g? False Let f(p) be the first derivative of p*4/4 - 2p*3 + 3p*2 - 3p + 12. Is 9 a factor of f(6)? False Let a = 10 - 13. Let w be 0a/(-12) - -7. Let f(p) = p2 - 2p - 4. Is f(w) a multiple of 14? False Suppose -158 = 7h + 31. Is 9 a factor of (-6)/h + 302/18? False Let i be (4/((-32)/2))/(2/(-56)). Is 14 a factor of -1 + 5/i + (-13949)/(-91)? False Is 8 a factor of (-480)/(-18)126/35? True Suppose 0 = 52x - 57x. Suppose b + 7 - 127 = x. Does 12 divide b? True Let q(v) = 7v - 52. Let j be q(7). Let i = j + 31. Is i a multiple of 7? True Suppose 0 = -5h - 0 + 15. Suppose hc - 30 = 3o, -50 = 3o + 3c - 8. Let m = o - -26. Is 7 a factor of m? True Let u(s) = 9s2 - 5s + 4. Suppose -20 + 59 = 13j. Is 3 a factor of u(j)? False Suppose 4f - 2c + 5c = 106, f + 4c - 20 = 0. Let v be (0 + 1)/((-2)/f). Let d = 26 + v. Does 11 divide d? False Suppose 50h = 54h + 5o - 1807, 0 = -4o - 4. Does 30 divide h? False Suppose 0 = 4u - u - 4q - 4196, 0 = -u - 4q + 1388. Is 67 a factor of u? False Let h(v) be the third derivative of v*6/120 + 7v*5/60 + 4v3/3 + v2. Let k be (-5 + (11 - 3) - 3) + -6. Does 16 divide h(k)? False Let a be 32/(-6) - 2/(-6). Let w(q) = q*2 + 3q - 6. Let p be w(a). Let v = p - -7. Is 3 a factor of v? False Suppose -3q + t = -2q + 15, 8 = 2t. Let r(n) = -7n - 5. Does 8 divide r(q)? True Let m(a) = a*3 + 15a*2 + 8a - 48. Is 24 a factor of m(-12)? True Suppose -i + 4m - 5 = 0, -i - 2m + 13 = -0i. Let a(o) = 26o + io - 9o + 5 + 19o. Is 15 a factor of a(2)? False Let q = 35 - 28. Let l = 75 + q. Suppose -4h = -8, l = 2s - 0s + 5h. Is 18 a factor of s? True Suppose -2h - 2268 = 5h. Is 8 a factor of (h/6)/(4/(-2))? False Suppose -3j + 0o + 4o = -29, 2o = 4j - 22. Suppose 0 = 2z + 2b - 210, -jb + 0b - 493 = -5z. Is z a multiple of 21? False Let d be 43/8 - 42/112. Suppose 1598 = db + 12b. Is 22 a factor of b? False Let a(u) be the first derivative of u4/2 - 2u3/3 - u2 + 2u + 168. Let o = -4 - -7. Is a(o) a multiple of 8? True Let f(k) = 23k*2 - 16k + 164. Is f(8) a multiple of 13? True Suppose 16 = 28a - 20a. Let p(r) = r*2 - 3r + 1. Let d be p(4). Suppose 70 + 95 = di - 2q, 0 = 4i + aq - 150. Is 6 a factor of i? False Suppose 0 = r + r + 12. Let m(a) be the third derivative of -7a4/24 + 2a*3/3 + 148a*2. Is 23 a factor of m(r)? True Let u(r) = 5r - 6. Let b(a) = -3a + 29. Let q(i) = i - 10. Let t(d) = 4b(d) + 11q(d). Let h be t(-2). Is u(h) a multiple of 8? False Let p be 16/(-6)(-6)/4. Suppose 0 = -10w + 60 + 60. Does 14 divide 243p/w? False Suppose -3t - 57 = -d - 0d, -4t - 118 = -2d. Suppose n = -2q + 67, d = -0n + n + q. Is 21 a factor of 3/((-6)/(-8)) + n? True Let a be (-1176)/32 + 1/(-4). Let d = a + 11. Does 2 divide d/(-6) - (-2)/(-6)? True Suppose -3c + c - 3s = -1679, -4s = c - 827. Is c a multiple of 77? True Is ((-3)/2 - -3)(-19184)/(-24) a multiple of 51? False Let h(w) = -34w - 9. Let n be h(-7). Let c = n - 163. Does 6 divide c? True Let t(f) be the first derivative of -29f2/2 + 2f + 11. Is 13 a factor of t(-1)? False Suppose 4m = b - 2, -3b - m = -2m - 6. Suppose 20 = bk + 3k. Suppose kx = -x + 200. Is 17 a factor of x? False Suppose -g + 76 = -5d, 0g + 2g - 4d = 140. Is 4 a factor of g? False Suppose -l - g + 61 = -4g, 5l - 281 = 3g. Suppose -q + l = -0q - 2y, y = 3q - 180. Let h = q - 37. Does 6 divide h? True Suppose 2t = q + q + 132, 3q = -4t - 198. Let a = -11 - q. Is 12 a factor of a? False Let f = 1745 + -380. Is f a multiple of 35? True Let b(g) be the second derivative of g4/24 + g3/3 + 3g*2/2 + 5g. Let u(l) be the first derivative of b(l). Is u(10) a multiple of 12? True Suppose 20i + 120 = 21i. Suppose 9t + i = 13t. Is (-1873)/(-15) + 4/t a multiple of 24? False Let b = 283 - -557. Is 12 a factor of b? True Suppose 3v + 2 - 1 = u, 3u = 3v + 9. Let m = u + 7. Does 11 divide m? True Suppose 4w = 3w. Suppose w = 3t + 18 + 6. Does 8 divide 12/(((-12)/3)/t)? True Suppose 8j = j + 28. Suppose 0 = jl + 6 - 646. Does 40 divide l? True Let f be (129/6)/(1/2). Let b = 78 - f. Is 4 a factor of b? False Let g(m) = -10m3 - 2m*2 - 2m - 1. Let r(x) = -x*2 - 2x - 1. Let o be r(0). Is 2 a factor of g(o)? False Let v(s) = 2s2 + s - 8. Is 35 a factor of v(6)? True Suppose 17l - 619 - 724 = 0. Is l a multiple of 9? False Suppose 575 = x - 180. Suppose 5*b	{ "pile_set_name": "DM Mathematics" }
-1 Solve 0 = j + s + 1, 2j + 4s + 23 = 9s for j. -4 Solve h + 6v + 12 = 2v, 0 = -2h - 2v - 12 for h. -4 Solve 4p + 14 = -2k + p, -2k = 5p + 18 for k. -4 Solve -4 = -4d - 2t + 4, 24 = 6d - 3t for d. 3 Solve 5i + 14r - 23 = 13r, -2i + 5r = -20 for i. 5 Solve 2v = 3n - 2 + 5, -2v = 0 for n. -1 Solve 0 = -j - 4, -3v = j + j + 17 for v. -3 Solve w = -w - 2y - 4, -2y + 5 = 5w for w. 3 Solve 9 = 4i - g, 5i + 3g = 2i + 3 for i. 2 Solve -2n = n + 6, 0 = -z + 2n + 9 for z. 5 Solve y + 14 = -3o, -9y - o = -10y + 2 for y. -2 Solve -u + 2s - 11 = 0, 3u + 136 = -s + 124 for u. -5 Solve 2a - 2n = 10, -4n + 10 = 5a - 6 for a. 4 Solve -23w + 28w + 20 = -5g, 11 = -5g + 4w for g. -3 Solve 2g - 5g + q = 2, g + q + 2 = 0 for g. -1 Solve -3w - 15 = 0, -5f = -0f - w + 10 for f. -3 Solve 4c - 20 = -v, -2c + 9v = 6v - 10 for c. 5 Solve 4k - 4n = -6n - 10, 24 = -3k + 4n for k. -4 Solve h + 8 = x + 10, 2x + 6 = 4h for h. 1 Solve 4x + 3 = -2f + 21, f = 5x - 26 for x. 5 Solve n = 3l, 0l - 4l = 4n - 16 for l. 1 Solve 3z + 20 = 4s, 0 = 5s - 3z + 2z - 14 for s. 2 Solve 4 = j + 4j + 2u, -4 = -2u for j. 0 Solve -3j - 4x + 15 = 0, 11x - 15 = 6x for j. 1 Solve -5k - f = -7k + 11, 44 = 5k + 3f for k. 7 Solve 3l = -c - 11, 4 + 3 = -3l + c for l. -3 Solve -4w + 17 = -4q + 1, 5w - 16 = q for w. 3 Solve 2 = 2u + k, 15k = 13k - 8 for u. 3 Solve 0 = -5l + 2q - 7, -4l + 2 - 6 = -2q for l. -3 Solve -j - 4z + 24 - 7 = 0, -2z = 5j - 13 for j. 1 Solve 0 = 2w + 2k - 2, -2k + 13 = 3w - 4k for w. 3 Solve 0 = -4o + 8, -4o - 10 = -4a + o for a. 5 Solve 57o = 55o + h + 2, -5o + 5h = 5 for o. 3 Solve 5i + 2a = -19, 9i + 2 = 8i - a for i. -5 Solve -4 = 3h - 2h - 5b, 4h + 2b = 6 for h. 1 Solve 0 = 3w - n + 4, -4w + 6w - n + 4 = 0 for w. 0 Solve -q + 3p + 15 = 0, 2q - 4p + p = 18 for q. 3 Solve y + r = 2y + 1, 5r - 35 = -5y for y. 3 Solve 72 - 69 = -3l - 3w, -3l - w = 11 for l. -5 Solve -4w + 3n = 0, 3w - 5n = -12 + 1 for w. 3 Solve 0 = -l + 4x + 1, 0 = -3l + 9x - 4x + 10 for l. 5 Solve 4m = -d - 4d - 35, -4d = m + 17 for m. -5 Solve 4l - 14 = 2l + 2k, -l + 2k + 12 = 0 for l. 2 Solve 3q + 14 + 11 = 2k, 20 = k - 3q for k. 5 Solve 4r + 1 = -3t - 3, 4t + 3r = -3 for t. 0 Solve 663n - 660n = 4s - 22, 0 = 2n + 4 for s. 4 Solve -2o - 3o + h = 25, 4o - 3h + 31 = 0 for o. -4 Solve -2m - 14 = -3m + 5w, -5m = -2w - 1 for m. -1 Solve -9 = 3v, 6f - 11f - v = -12 for f. 3 Solve q - 2o = 1, -7o = -3q - 6o - 7 for q. -3 Solve y = m - 1, -8y - 18 = -4y + 3m for y. -3 Solve 0 = -4u - h - 1, 5u - 2u + 5h = -22 for u. 1 Solve 5u = 2b + 9 + 12, -26 = -3b - 4u for b. 2 Solve -4t = -4z + 8, 0 = -5z + 6z - 5t + 2 for z. 3 Solve 5r + 30 = -3t, -3r + 0 + 11 = -4t for t. -5 Solve -3p + 2l = -3, 5p - 2l - 2 = p for p. -1 Solve 5j = -s - 21, 5j - 4j = 2s - 13 for s. 4 Solve f - n = 3, 4 = 3f - 7n + 5n for f. -2 Solve -3h - 4 = -2f, 3f - 18 = -3 for h. 2 Solve -4d = 2v - 4, 0 = -d - 4d + v - 9 for d. -1 Solve 0 = t - 3, 0 = -2f - t + 6t - 17 for f. -1 Solve -4d = 5g + 12, 9 = -2d - 5g - 7 for d. 2 Solve 4q + 6 = -10t + 11t, 4t - 2q + 4 = 0 for t. -2 Solve 4a + f - 42 + 58 = 0, 5a - 5f + 20 = 0 for a. -4 Solve 4 = -4g + y, 2g - g + 14 = -3y for g. -2 Solve -5c = -2b - 4c - 12, -16 = 2b - 3c for b. -5 Solve 5q - 4c = -1, -2c - c = -4q for q. 3 Solve -14j - 2b = -18j, -5b = -j + 9 for j. -1 Solve 2h + 16 = -3z, 5z = 9z - 5h - 17 for z. -2 Solve 0q + q - 5l + 17 = 0, 0 = -4q + 4l - 20 for q. -2 Solve -f - 2c = -9, 5f - 1 = f - c for f. -1 Solve 3v - 9 = -g, v - 3g = 3v - 13 for v. 2 Solve -3d + 2d + 21 = -5y, 4d + 16 = -5y for y. -4 Solve 0 = 5f + 5r - 4r - 10, -f + 11 = 2r for f. 1 Solve -2v + 5 = 6m - 7m, 3m = -4v + 25 for v. 4 Solve 0 = 2b - 4y + 14, -3y - y + 8 = 0 for b. -3 Solve 9k = 4k - t - 15, 5k - t = -5 for k. -2 Solve 19m - 37 = 5j + 23m, 3j - 2m = -9 for j. -5 Solve 0 = -3l + 5z + 9 + 23, -3z - 12 = 0 for l. 4 Solve 0 = 5l - 5w - 15, -4l = 5w - 0 - 3 for l. 2 Solve 1 = 3s + 7, 0 = 4z + 3s - 6 for z. 3 Solve 0 = -4q + 5h + 24, -360h + 365h = q - 21 for q. 1 Solve 2m + 4t - 163 + 165 = 0, 0 = 5m + 5t for m. 1 Solve -23c + 20c = h + 13, -2c - 20 = -5h for c. -5 Solve -s - 3j = -8j - 13, 0 = -s - 2j - 8 for s. -2 Solve 6w = -4x - 10, -2w + 7w + 4 = x for x. -1 Solve 5h + 12 = 22, -4h + 8 = -p for p. 0 Solve -3t + 8 = 2a, -3t + 2a - 5a + 9 = 0 for t. 2 Solve -5a - 2w = 28, 4w = -a - 9 - 11 for a. -4 Solve 0 = z - 3z - 5r + 30, -3z + 19 = r for z. 5 Solve 2i = y + 4y - 5, -3i + 1 = y for y. 1 Solve -5a + 3k - k = -16, 5a = 5k + 10 for a. 4 Solve -6 = 2m - j + 1, 2j = 6 for m. -2 Solve w + 7 = -2i, 2i - 4w - 2 = 6 for i. -2 Solve 0 = 2l - 3v + 5 - 3, -3l - 3 = 2v for l. -1 Solve -16 = 4s + 4h + 8, 5h + 30 = 0 for s. 0 Solve 0 = 3o - 2o + 4c - 29, -20 = o - 3c for o. 1 Solve l + 3v + 13 = 0, 4l = v - 2v - 8 for l. -1 Solve 5f - 5w - 225 = -235, -f + 2 = 3w for f. -1 Solve 0 = 5x - 9q + 12q + 2, 4x = -4q for x. -1 Solve -3v - 28 = -4z, 59v - 63v - 24 = -2z for v. -4 Solve -5k - i + 9 = 0, -8i + 11i - 7 = -5k for k. 2 Solve 3c - 3n - 18 = 0, 0n = -3c + n + 10 for c. 2 Solve 5f + 4z + 3 = 0, -4z + z + 18 = -3f for f. -3 Solve -2v - 3n + 92 - 88 = 0, 11 = -v + 5n for v. -1 Solve -4w - 16 = i, -3w + 4w = 4i + 13 for i. -4 Solve -4n - n = k - 9, -3k + 16 = 4n for k. 4 Solve -o - 3o + 26 = 3j, 16 = -2j + 4o for j. 2 Solve 6o - 5 = o - 2n, -o - 2n = -1 for o. 1 Solve 2l - 20 = -6j + 4j, -3j = 4l - 35 for j. 5 Solve -37l + 5 = -5x - 32l, 5l + 4 = -4x for x. -1 Solve 4h = 16, 3l + 48h = 47h - 11 for l. -5 Solve -7 = 2j - q, 17j = 18j + q - 1 for j. -2 Solve 2h + 4p - 9p + 20 = 0, 5h = p - 4 for h. 0 Solve -a - y - 20 = 4y, -3a + 2y = -8 for a. 0 Solve -4d + 3 = 3x, -3x + 50 = -2d + 29 for x. 5 Solve -2i = 3v - 3, 3v + 23 - 14 = -4i for v. 5 Solve -w - 2g = -3w, -2w - 3g = -10 for w. 2 Solve a - 10 - 1 = 3h, -3a = 4h - 7 for a. 5 Solve -3j + 19 = 2c, -13 = 166j - 169j + c for j. 5 Solve -4c - 8 = -i, -29i + 12 = -32i for c. -3 Solve x = k + 2, -42k + 44k = -2x for x. 1 Solve 30 = 5u - 5q, -4u = -20q + 24q + 24 for u. 0 Solve v - 5n - 8 = 0, 4n + 18 = v - 6v for v. -2 Solve n = -d - 2d - 17, -32 = 4n + 3d for n. -5 Solve 3f + 24 = -3u, -29u + 31u = -f - 12 for u. -4 Solve -5k + 4s = -7k + 2, 0 = k - s + 5 for k. -3 Solve -3y - 5p = 34, 3y + 15 + 4 = -2p for y. -3 Solve -5c + 45 = -5x, -4x - 2c - 3 = 9 for x. -5 Solve 5j - 4d = -11, 15j - 4d + 20 = 19j for j. 1 Solve 0 = -2x - 8, x + 2x + 6 = 3w for w. -2 Solve -2y - 2j - j = 17, -3 = j for y. -4 Solve x = -2k - 5, 32k - 28k + 5x = -1 for k. -4 Solve 3h - 3m - 6 = 0, 3m + 13 = -3h - 5 for h. -2 Solve 18 = -2u - 2b, u - 4b = 9 + 2 for u. -5 Solve 10 = 3m + 5j, 6 = -3m - 0m + 3j for m. 0 Solve 3k - 8k + 5d - 5 = 0, 4k = 2d + 2 for k. 2 Solve -3v + 2h + 0 + 1 = 0, h + 3 = 4v for v. 1 Solve -2y + 6 = -4o, 0y + 21 = -5y - 2o for y. -3 Solve 2l - 7l = 2d - 16, -3l + 2d + 16 = 0 for l. 4 Solve -5r - 3k = -9 - 1, -3r + 6 = k for r. 2 Solve 4k = 8, 0 = -4g - 4k + 21 + 7 for g. 5 Solve -24 = -5w + 2a + a, 3a + 9 = 0 for w. 3 Solve -4w - 6 = -2l, 4w + 10 = -l + 1 for w. -2 Solve 0 = u - 3x - 6, 3u + 5x - 4 = -0x for u. 3 Solve -2 = 4u - 2u + h, 0 = 3u + 2h + 1 for u. -3 Solve 0 = a + 5, -16 = 4v - 5a - 21 for v. -5 Solve -5c + 4z - 24 = -9c, 4z = -3c + 21 for c. 3 Solve -9 = k + 5i - 33, -2i = -2k - 12 for k. -1 Solve -m = -4l + 11 + 6, -4m - 32 = -4l for l. 3 Solve 5t + 3 = c, 6t - c = 4t for t. -1 Solve 9a = 4a + 2t - 24, 0 = 3a - t + 14 for a. -4 Solve -r + 7 = -3j, -92j + 87j = -4r + 21 for r. 4 Solve 2l = 7l + 3z - 3, 5z = 5l - 35 for l. 3 Solve -2o + 3o = 4x - 5, -2o + 4 = -x for x. 2 Solve -j + 4 = 3j + 4b, -25 = 3j - 4b for j. -3 Solve -16 = -4z - u, 0 = -3z - z + 3u for z. 3 Solve 4h - 3f = -5, 4h + 12 = -4*f - 0 for h. -2 S	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.