Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
24.6 Add -0.4 and -1152176. -1152176.4 Sum -0.15691308 and 0.13. -0.02691308 Add together -0.018 and -11.3323. -11.3503 Total of -6 and 351414.59. 351408.59 What is 778791 - 0.297? 778790.703 Add together -261 and 107.41392. -153.58608 What is the distance between 214069346 and 0.5? 214069345.5 What is 7905.6 plus 5996? 13901.6 What is the distance between -1950.75 and -31743? 29792.25 What is -0.2456577003 + -10? -10.2456577003 What is 0.02574 take away 0.2832488? -0.2575088 Sum -0.019 and 18.637529. 18.618529 What is 1 minus -2015850? 2015851 Subtract -901 from -23712. -22811 Calculate 0.1 - -8493.799537. 8493.899537 What is -35676 take away -634? -35042 -0.192+-47876 -47876.192 Subtract 1287872 from 17956. -1269916 What is 0.03301 minus 191.409? -191.37599 Work out -307695 + 1192.1. -306502.9 What is -1.849955 minus 328? -329.849955 Add 2.7 and -712252.4. -712249.7 What is 175 less than 0.15711? -174.84289 -467408 + 1047.41 -466360.59 Calculate -0.9 - 468203. -468203.9 Calculate -773780 + -223.22. -774003.22 What is 6850403 + -0.41? 6850402.59 What is 0.048139 less than 2.32? 2.271861 Add 217210143 and 0.2. 217210143.2 Sum -2254195 and -91. -2254286 Sum -59.59664 and 196. 136.40336 Work out 10 - 611444305. -611444295 What is -2 less than -12844964016? -12844964014 Add together -11600316.48 and -0.6. -11600317.08 Calculate -1 - 27444240. -27444241 What is -130.8186 - 18.585? -149.4036 Sum -306.0849 and 1.7. -304.3849 What is the difference between -10.502615 and -959? 948.497385 Calculate 0.1 - 786315311. -786315310.9 Calculate -2351613 + -6. -2351619 What is 93912.0286 - -1? 93913.0286 What is -878787.7298 plus 7? -878780.7298 0.89545747 + 0.0402 0.93565747 Total of 87766097.967 and 0.4. 87766098.367 What is the difference between -921.5 and 0.15039? 921.65039 Sum 147403 and 2571. 149974 -0.158142 - -0.3 0.141858 What is -417282 - -37607? -379675 What is -14851 minus 3459715? -3474566 What is -61220 take away -0.13538? -61219.86462 Subtract -0.59 from -838733. -838732.41 Work out 0.22 + 2.54663. 2.76663 What is -0.061 minus 548105? -548105.061 Calculate -1942332.41 - 0.1. -1942332.51 What is the difference between -2113580.958 and 0.04? 2113580.998 Put together 40979 and 420. 41399 Subtract 18.9368 from -50127. -50145.9368 What is 4869 - -101032? 105901 -68960+790 -68170 What is 44600946.7 less than 0.2? -44600946.5 What is -4562234 - 772? -4563006 4730 + -298002 -293272 Put together -73.711367 and -3. -76.711367 Sum -15901151423 and -0.4. -15901151423.4 What is -21 less than -1452.5993? -1431.5993 What is 0.03542 - -9.559? 9.59442 What is 0.1 take away 14697563784? -14697563783.9 Calculate 24258669 + 1971. 24260640 Put together 0.2538202682 and 1. 1.2538202682 What is 1235103 take away -39? 1235142 Total of -0.5 and 63655136. 63655135.5 1036 + -12286 -11250 Calculate 13256 - 4371. 8885 -21.379922 + -2 -23.379922 What is -0.1 - -0.94113613? 0.84113613 Calculate -55459 - 0.0219457. -55459.0219457 Put together 0.3 and 167220912.1. 167220912.4 Calculate 404897 + 28.35. 404925.35 Calculate 183962.804 - -43. 184005.804 -11+-126.2697 -137.2697 15.246+0.3309 15.5769 What is the difference between -4 and 18832.32? 18836.32 What is -14126730 + -0.6542? -14126730.6542 -1855 - -23.947552 -1831.052448 What is -491.425 take away -14.8? -476.625 What is -213 take away 6773791? -6774004 What is -87272693 + 4? -87272689 -134.463027+2.9 -131.563027 Calculate 11 - -112644625. 112644636 Subtract 218 from -118590. -118808 -3.0839 - 59527.8 -59530.8839 Add -0.1 and 9962424. 9962423.9 Total of -293037 and -74. -293111 What is -18 minus 0.0967013716? -18.0967013716 What is -90.435 + 337164? 337073.565 4 - -3.36708406 7.36708406 What is -87.95 + 0.013492? -87.936508 Work out -2417 + -0.68354771. -2417.68354771 -2.59 - -31690 31687.41 5714.9136 - 0.3 5714.6136 Calculate -710 + -13563.1. -14273.1 Calculate -0.5 - 11317908.556. -11317909.056 Calculate 0.2844 + -826570. -826569.7156 13115182623+2 13115182625 Sum -0.105 and -76930. -76930.105 Add -50138 and 0.8. -50137.2 What is -6 take away 305.5694693? -311.5694693 Put together 738763772.6 and 0.02. 738763772.62 What is -0.4005005 - 4? -4.4005005 What is -50352303 less than -0.8? 50352302.2 What is -0.2 minus -0.656157274? 0.456157274 Add -44752334186 and 0.5. -44752334185.5 Add together 8193133 and 2. 8193135 What is 309 - 74006? -73697 Add -0.23 and -735657283. -735657283.23 What is -0.02 less than 160611879? 160611879.02 Add together 97024 and 633. 97657 Calculate 0.5 - 1466.52059. -1466.02059 What is 2942530 less than -13146? -2955676 What is -1.78349131 less than -0.72? 1.06349131 What is -39 minus 8979184? -8979223 Calculate 100.359 + 203.205. 303.564 What is -0.69 minus 5430.5? -5431.19 Add together -27428 and 31.077. -27396.923 Add together 1215 and 40707358. 40708573 Sum 309 and -587432. -587123 Sum 18884 and 3.052. 18887.052 Calculate 21678 - -10848. 32526 Work out -1.4988 - 0.0416382. -1.5404382 -166+76425.94 76259.94 What is -2.2069 less than -45095.1? -45092.8931 Subtract -4719787979 from -3. 4719787976 What is the distance between -1 and -1713012? 1713011 Add -8510859 and -0.04. -8510859.04 What is 4 - -0.17000914? 4.17000914 Calculate -84.412044 - -1. -83.412044 Put together 380 and 0.064347. 380.064347 What is -28990 plus -1.474? -28991.474 -51714765 - 1 -51714766 What is the difference between 0.0559 and -3.70955? 3.76545 What is -22 - -62022600? 62022578 Total of -141 and 27.1887. -113.8113 2.9 + 4444669.01 4444671.91 Total of 0.022103894 and -0.7. -0.677896106 Add together 3425.1615 and 0.2. 3425.3615 What is -4 + -75064.8087? -75068.8087 Calculate -594.258 - 748. -1342.258 3.175822+-0.39 2.785822 Put together -37554.5 and 1062. -36492.5 What is 20321 minus 10132? 10189 46.8+-122.348 -75.548 What is 14099578 less than -0.032? -14099578.032 What is 1 minus 31743445? -31743444 What is the distance between 4 and 1.2748646? 2.7251354 Calculate 0.1 + -4791574. -4791573.9 What is 911.314791 minus 0.05? 911.264791 Put together 90 and 19689.53. 19779.53 -0.78 + -3887940 -3887940.78 Calculate 155.3365 + 0.134. 155.4705 Put together -2 and 4393.10013. 4391.10013 What is -0.02 + -2514914573? -2514914573.02 What is the difference between -0.162278 and 0.5? 0.662278 Calculate 130270 - 0.062. 130269.938 What is the difference between -736610 and -12778? 723832 Put together -0.22 and -61297429.6. -61297429.82 8 - 26082.23788 -26074.23788 Calculate -0.2285 + 2568377. 2568376.7715 What is the difference between 2148.32 and 12? 2136.32 What is -0.6 plus 1160626070? 1160626069.4 What is the distance between -0.046 and 1334164? 1334164.046 What is 0.01938171 take away -0.05? 0.06938171 Subtract -223 from 55545416. 55545639 Calculate -14.02 + -3746. -3760.02 Work out -159508501 - 0.027. -159508501.027 What is 447607353 take away 0? 447607353 What is 54.77251 plus 2? 56.77251 Sum 0.39539878 and -49. -48.60460122 Sum -5996.35 and -20.19. -6016.54 What is -0.4128587 take away -4836? 4835.5871413 What is 0.651557 + 0.0928? 0.744357 Calculate 0.1 + 184192549. 184192549.1 What is 123.9 plus 1459? 1582.9 Sum -659 and -1134076. -1134735 Calculate 2 - 76403956. -76403954 What is 3 less than -0.264329646? -3.264329646 Work out 4 - -44136.32. 44140.32 What is -1337.97 plus 0.2522? -1337.7178 What is -74879539 plus -0.29? -74879539.29 What is the distance between -77592.4 and 6252? 83844.4 Work out -100.33354 - -1.34. -98.99354 What is -80068.03331 + -9? -80077.03331 What is 1489629 + 6? 1489635 Total of 1126219.583 and 0.5. 1126220.083 What is 32839 - 1348? 31491 What is 1.4549 - -214698? 214699.4549 What is 206005523.3 plus 16? 206005539.3 What is -0.07421715 less than 2? 2.07421715 What is the difference between 175 and -107303? 107478 0.97+-67514039 -67514038.03 What is -0.1 minus 8688.813339? -8688.913339 Work out 366051210 + 0.4. 366051210.4 What is the difference between -22.24932454 and 1.8? 24.04932454 -32.15 + -190000.69 -190032.84 What is -70.7 minus 21626311? -21626381.7 What is the difference between -53944614 and -0.1463? 53944613.8537 What is the distance between 2 and 1451494250? 1451494248 What is -203.7 less than -36.573? 167.127 What is 0.92 + 16499.446? 16500.366 What is the difference between 613295563 an	{ "pile_set_name": "DM Mathematics" }
1/6)/mm)/m)/m(-2) assuming m is positive. m(7/6) Simplify (cc/c*(-1/4)c)(-6/5) assuming c is positive. c(-39/10) Simplify (b/(bbb/b*7))/(b(b(bb*(-15/2))/bb)/b) assuming b is positive. b(21/2) Simplify (t0/t)(-12/11) assuming t is positive. t(12/11) Simplify p*(2/13)/p(p/p*8)/p(pp(3/4))/pp8 assuming p is positive. p(-5/52) Simplify ((bb/b(2/9))(4/5))(1/3) assuming b is positive. b(64/135) Simplify s0(s/s*(1/10))/s(ss(-1))(-3/5) assuming s is positive. s(-1/10) Simplify (v/(v/(vv*18vvv)))/(vv12) assuming v is positive. v9 Simplify ((h/(h0h))/hh2)/((h(-2)h)/h3) assuming h is positive. h5 Simplify (f(2/7))14/(ff1)(2/3) assuming f is positive. f(8/3) Simplify (r/(rrrr*(-13)r))(-1/58) assuming r is positive. r(-5/29) Simplify (z/(zz(12/11)))(-36) assuming z is positive. z(432/11) Simplify (b(-7/2)/bb)(-24) assuming b is positive. b84 Simplify (q*(-7/3)qq9)(-16) assuming q is positive. q(-368/3) Simplify x(-6)x(5/2) assuming x is positive. x(-7/2) Simplify z*(2/49)zz(3/2)z assuming z is positive. z(347/98) Simplify (t(5/2))(4/3) assuming t is positive. t(10/3) Simplify (f0/(f(-9)ff))(3/34) assuming f is positive. f(21/34) Simplify (q(-2/7))(2/51)/(q/q*(-1/3)q)(-3) assuming q is positive. q(2495/357) Simplify ss(7/6)s/(ss(9/7)s) assuming s is positive. s(-5/42) Simplify (j/(j/(j(-2)/j)))(2/37) assuming j is positive. j(-6/37) Simplify k*9k/k*(-8)(k3)(1/52) assuming k is positive. k*(939/52) Simplify (((i/(ii/(i/(i*(2/11)/iii)i)))/i)(-34/7))1 assuming i is positive. i(442/77) Simplify (j(-18)jj(-15))(-1) assuming j is positive. j32 Simplify f(1/10)/(ff6)(f/(f(ff/f*(-2))/ff)f)/(ff(4/5)) assuming f is positive. f(-117/10) Simplify ((hh(-8)h)(1/40))(-7) assuming h is positive. h(21/20) Simplify ((r1)45)45 assuming r is positive. r2025 Simplify m(1/3)/(mm(m(-2/13)/m)/m) assuming m is positive. m(19/39) Simplify h*(-16)h(5/3) assuming h is positive. h(-43/3) Simplify r*26rr(-30) assuming r is positive. r(-3) Simplify (z(-4)/(((zz(-1/6))/z)/z))/(z/((z(1/2)/z)/zz)z/(z((zz*9)/zz)/z)z) assuming z is positive. z(11/3) Simplify ((vv/v0)7)25 assuming v is positive. v350 Simplify u(2/5)/((u(-1/6)u)/u)(u/(u/u(3/4)))/u(-1/3) assuming u is positive. u*(33/20) Simplify (((gg/(g/(g*(5/4)/g)))/gg)/(g/(g(9/2)/g)))31 assuming g is positive. g(465/4) Simplify p(-16/7)p(4/7) assuming p is positive. p(-12/7) Simplify ii*(2/19)ii7i*(6/7)i/(i/(i/(ii8))) assuming i is positive. i(261/133) Simplify fff(-3/5)f*(-2/13)/ff(f(fff(-1))/f)24 assuming f is positive. f*(1641/65) Simplify (p/(pp/(p*(-4)/p)))/ppp/(p/(pp*5)p)((p(-2/3)pp)/pp)/p5 assuming p is positive. p(-14/3) Simplify f*(-24)f/(ff(-22))f assuming f is positive. 1/f Simplify (qq/(qq*(-8/9)qq)q)/q(-3/7) assuming q is positive. q(83/63) Simplify ((c/c(7/2))/c)(4/9) assuming c is positive. c*(-14/9) Simplify ((u(uu/(u/u(1/9)))/u)/u)/(u/((u/u(-2/25))/u)u) assuming u is positive. u*(-407/225) Simplify rr*(4/3)r(-3) assuming r is positive. r(-2/3) Simplify u*5u*(2/3)(u0)(16/9) assuming u is positive. u*(17/3) Simplify pp*0p*(-3)/p(pp0/p)(-3/28) assuming p is positive. p(-3) Simplify (a(2/29))(-1/72) assuming a is positive. a(-1/1044) Simplify (y/(y(-2/5)yy))(-4/35) assuming y is positive. y(12/175) Simplify x8/xx*(-3)xx7/xx/(x(x((x*(-1)x)/x)/x)/x) assuming x is positive. x*13 Simplify (ss*(12/11)ss(-1/6))48 assuming s is positive. s(1544/11) Simplify i(-3/16)/(ii*(-11)ii) assuming i is positive. i(125/16) Simplify (x(1/2))37/(x/((x(((x/(x/(xx(-3/2)x)x))/x)/x)/xx)/x)x(x/x(-1/2))/x) assuming x is positive. x(27/2) Simplify ((((v*(-1/3)/v)/v)/v)/v)/(vvv/v(-14)) assuming v is positive. v(-64/3) Simplify (l(-1/3)ll(3/4))(-5/2) assuming l is positive. l(-85/24) Simplify (r/r1)(2/5)r(rr*(-4))/rr(r/((r(r/(r(r/r(1/2))/rr))/rr)/r)r)/rr assuming r is positive. sqrt(r) Simplify (x6/(xx*(-4/5)))/((xx*(3/10)/x)/xx(-7)/x) assuming x is positive. x(29/2) Simplify (o/(o*4o))/o(5/6) assuming o is positive. o(-29/6) Simplify a*(4/3)aa(5/8)/a assuming a is positive. a(47/24) Simplify (ll/((llll/l(-11)l)/l))/l(2/19) assuming l is positive. l(-249/19) Simplify yy/y(-9)yyy/(yy(-31)y)y assuming y is positive. y44 Simplify (((ss*(-1/6)s)/s)/s)(3/2) assuming s is positive. s(-1/4) Simplify (mmm*0m)(-33)/(m(-6)mm1) assuming m is positive. m(-95) Simplify (vv/v(-1/3))(1/12) assuming v is positive. v(7/36) Simplify (lll/(ll*(-7))l)/(l/((l/l*(-5/6))/l)ll) assuming l is positive. l(47/6) Simplify (z/(zz(-2/3)))(2/7)/((z/z*(-4))/zzz(2/31)z) assuming z is positive. z*(-3824/651) Simplify (x(x*0x)/x)*(-10)xxxxx(x(x*(-1)xx)/x)/xxx(2/9) assuming x is positive. x(-34/9) Simplify (v/v(-1/3))(6/19)(v(-2/5))(-21) assuming v is positive. v(838/95) Simplify ((p(-2))(10/3))(2/13) assuming p is positive. p(-40/39) Simplify y0/yy(2/17)y*(-2/15)yyy(1/6) assuming y is positive. y(587/510) Simplify g*(-20)gg(g((gg/((g/g*(8/7)g)/gg)g)/g)/g)/ggg assuming g is positive. g(-111/7) Simplify y(-1/5)/y(-4/13) assuming y is positive. y(7/65) Simplify ((lll*(-6/19)l)/l)(-21) assuming l is positive. l(-672/19) Simplify (a(aa*(2/3))/aa*(-5)a)/(a1)(-15/4) assuming a is positive. a(17/12) Simplify (z2)*(1/6)(z1)(-3/25) assuming z is positive. z(16/75) Simplify x6/(x/(x/(x/(x/(x/(x/(xx/(xx/x*6))x)x))))) assuming x is positive. 1 Simplify ((hh*(2/5))/h)/hhhh26/h assuming h is positive. h(132/5) Simplify v/(v/(v/(v/(v/v*(-4)v))v))v/v(-3) assuming v is positive. v11 Simplify (yy(-7)/yy)/(y/(y/y*(5/6)y)) assuming y is positive. y(-35/6) Simplify ((n(-2/3))(-17/5))39 assuming n is positive. n(442/5) Simplify (h4hh)/hh(-42) assuming h is positive. h(-37) Simplify c(-1)/cc*(3/7)/c(cc(-1/2)/cc)/(((c/(ccc*(-9)))/c)/cc) assuming c is positive. c(-127/14) Simplify (t(2/7)tt(1/9))(-43) assuming t is positive. t(-3784/63) Simplify j6/(j*0/j)(j/(jj(j/(jj0))/jjj)jj)(2/23) assuming j is positive. j7 Simplify (l(1/3)/l)(-14)/(l5l(-1/2)) assuming l is positive. l(29/6) Simplify (y/(y(-2/13)/y))/y(-2/33) assuming y is positive. y(950/429) Simplify (t(1/8)t)(3/4) assuming t is positive. t(27/32) Simplify (l(-6)/ll(-1/4))/(l1l1) assuming l is positive. l(-37/4) Simplify (m(1/4)/m)/m0 assuming m is positive. m(-3/4) Simplify (c2/c(cc(1/4)c)/cc)(-31) assuming c is positive. c(-403/4) Simplify ((jj/(jj(-2/9))j)/j)(-47) assuming j is positive. j(-517/9) Simplify (h2)10(h/(h/(h(-10/7)hhh)))/hhh0 assuming h is positive. h(151/7) Simplify (tt(-4/5)t)(34/7) assuming t is positive. t(204/35) Simplify (aa(-7/4))(-5) assuming a is positive. a(15/4) Simplify (k/(kk(-2)))(-1/35)/((k*7k)/k3) assuming k is positive. k(-177/35) Simplify ((q/(q*(2/3)q))/q)/(q/((qq(-1/7)qqq)/qq)) assuming q is positive. q(25/21) Simplify (i/(ii/i(-11)))/(i/(i/((i/i(-16))/i))) assuming i is positive. i(-28) Simplify m(-32)/mm/(((m/(m/m(-15)m))/m)/m) assuming m is positive. m(-14) Simplify r14/(r(3/2)/r) assuming r is positive. r(27/2) Simplify (((ii/(i/((i/i1)/i)i))/i)/i(-2/7))/(i(-2/7)/(i(5/2)/i)) assuming i is positive. i(1/14) Simplify h*(1/7)(h*(-7)h)/hhh(h/(h(-1/9)h))/hh(-2) assuming h is positive. h(-488/63) Simplify (d(2/7)d)(-43)/(d(-1)/d)(-7/8) assuming d is positive. d(-1597/28) Simplify (t/t(-2/7))(-11)/(t0)(-2) assuming t is positive. t*(-99/7) Simplify ((vv*(-3/2))/(v/(vv/(vvvv/v(3/7)v))))(-33) assuming v is positive. v(1881/14) Simplif	{ "pile_set_name": "DM Mathematics" }
e greatest common factor of a and 5. 5 Let l = -696 - -732. Calculate the greatest common divisor of 438 and l. 6 Let y(b) = -91b3 + 2b*2 + b. Let p be y(-1). Let t(z) = 215z + 1958. Let q be t(-9). What is the greatest common divisor of p and q? 23 Let g(q) = 7q - 9. Let u be g(7). Let f = 2537 + -2497. What is the highest common factor of u and f? 40 Suppose 0 = -2d + 8 + 52. Let o be (-1)/((-272)/90 + -1 + 4). Calculate the greatest common divisor of d and o. 15 Let z be 5181/9 - (8 - (-125)/(-15)). Calculate the highest common factor of z and 9. 9 Let r = -3849 - -6964. What is the highest common divisor of 35 and r? 35 Let u(q) = 121q - 8. Let h be u(4). What is the greatest common divisor of 28 and h? 28 Suppose -124f + 117f = -126. Calculate the greatest common factor of f and 54. 18 Suppose f = 6f - 80. Suppose 0 = -n - 5u - 16, -u - f = 3u. Suppose -80 = -ny - 4c, 5y - 62 - 29 = 4c. What is the highest common factor of 38 and y? 19 Let h be (-5 + 16)((-1 - -21) + -1). Calculate the highest common factor of h and 19. 19 Suppose 299 = -k + 4k + 2l, -l - 204 = -2k. Let a = 186 - k. Calculate the highest common factor of a and 34. 17 Suppose 0y + y + 2d - 30 = 0, 4y + d = 155. Calculate the highest common factor of y and 15. 5 Let v(g) = -2 + 1 + 0 + 31g*2 - 6g*2 - g. Let y be v(-1). Suppose -1 = -5o - 3a, 0 = 2o + 3o - 5a - y. Calculate the greatest common factor of o and 4. 2 Suppose -17f = -45f + 5152. Suppose -3h = -h - 46. Calculate the greatest common divisor of f and h. 23 Suppose 54x - 1872 = 48x. Calculate the greatest common divisor of 39 and x. 39 Let h = 119 + -113. What is the greatest common factor of 174 and h? 6 Let i(x) = 2x*2 - 44x + 3. Let q be i(22). Suppose -2w + 73 = 3f, 2w + 30 = qw - 5f. Calculate the highest common factor of w and 7. 7 Let n = -153 + 233. Suppose 6b + 197 = 257. What is the greatest common divisor of b and n? 10 Let w = -39 - -43. Suppose -4u + 2184 = wu. Calculate the greatest common divisor of 13 and u. 13 Let r(p) = 59p + 1. Let j be r(1). Let z(y) = y2 - 5y + 14. Let n be z(6). Calculate the greatest common factor of n and j. 20 Suppose -2r = 3r - 60. Let v(y) = 7 + 15 + 2y + y - 4y. Let u be v(r). What is the highest common factor of u and 5? 5 Let z(r) = 9 - 5r + 12r - 8r. Let a be z(3). Let u(h) = h2 + 4h - 1. Let m be u(-5). What is the greatest common divisor of m and a? 2 Let c(m) = m*3 - 19m*2 + 63m - 15. Let v be c(15). Calculate the greatest common divisor of v and 45. 15 Let l = 1 - -2. Suppose 0 = lh - 14 + 47. Let m be -1 - (-2 + 0) - h. What is the greatest common divisor of 108 and m? 12 Suppose -5z = 5x - 80, -47 = -17z + 15z - 5x. What is the highest common factor of z and 8? 1 Let g be (-4)/2-3(-3)/(-9). Suppose 2r - 14 = -g. Let t = -3 - -21. What is the greatest common factor of t and r? 6 Let l be 24/1040/12. Let f = -16 - -17. Suppose -3z = u - 5u + 4, -u - 3z = -f. What is the highest common factor of l and u? 1 Suppose 38 = z - 13v + 10v, 0 = -2z - v + 48. What is the greatest common factor of z and 234? 26 Let j be 12 - (-840)/(1 + 9). Calculate the highest common factor of 48 and j. 48 Let a = -2 + 1. Let c be a + (1 - 3) - -15. Suppose 10 - c = -2s. What is the greatest common divisor of 11 and s? 1 Suppose -4o + 2n = -n - 183, -3n - 228 = -5o. Let m be (9/(-2))/((-69)/460). Calculate the greatest common factor of m and o. 15 Let j be 4 - (-3 + -7 + -2). What is the highest common factor of j and 16? 16 Suppose r - 187 = 3w + 29, -2r = -w - 432. What is the highest common divisor of r and 540? 108 Suppose 52m - 48m - 440 = 0. What is the greatest common factor of m and 30? 10 Suppose -4h - 2s + 6s + 308 = 0, -400 = -5h + 2s. What is the highest common factor of h and 1066? 82 Suppose -h = -62 + 44. Let m = 156 - 107. Suppose 5o = 5s + 40, 0s = 5o + 4s - m. What is the highest common divisor of o and h? 9 Let x be (-1086)/(-17) + -9 + 1395/153. Calculate the highest common divisor of 160 and x. 32 Let s = -707 + 1880. Calculate the highest common factor of s and 69. 69 Let n(l) be the second derivative of -l3/6 + 2l. Let v be n(14). Let q be (-11)/(77/18)v. What is the greatest common factor of q and 9? 9 Suppose 2l - l = 5b - 58, 2l = -6. Let p be 790/8 + (-2)/8 + (-22)/(-44). What is the greatest common factor of b and p? 11 Let i be (2 - -1)/(9/12). Suppose 19 = -is + 55. Let n be (-9)/2((-35)/(-7) + -15). Calculate the greatest common divisor of s and n. 9 Suppose 9x - 2x = -294. Let z be (-15)/x-4(6 - 13). Let q(d) = 2d3 - 5d*2 - 4d + 5. Let v be q(5). Calculate the greatest common factor of v and z. 10 Let q(r) = 2r2 - 73r + 477. Let d be q(29). Suppose w = -5l + 29, -7l + 40 = 2w - 3l. What is the greatest common factor of w and d? 14 Suppose 0 = -2w - 3n + 113, -4n + n + 223 = 4w. Let f = -45 + w. What is the greatest common factor of 25 and f? 5 Suppose 8q - 5q + 1938 = 3s, 5q + 2586 = 4s. Calculate the highest common factor of 28 and s. 28 Suppose -2n - 284 = -2w - 2376, -3n = 5w - 3170. Calculate the highest common divisor of 126 and n. 42 Let y be (-25)/(-5) - (-2 - -1). Suppose 7s + 622 = ys. Let c = -413 - s. Calculate the highest common factor of 19 and c. 19 Let j be (2 - (-91 + -6))/(3/2). Calculate the greatest common factor of 88 and j. 22 Let k = 648 - 616. Calculate the highest common divisor of k and 592. 16 Suppose 25i - 120 = 20i. Let v be 60/6 - 2/(-1). Calculate the highest common factor of v and i. 12 Let z be 1103 - (0 - 2). Suppose 20s - 25s + 20 = 0. Suppose -d = -5r - 3d + 97, -sr = 5d - 64. Calculate the greatest common factor of z and r. 21 Suppose 3r = -24 - 72. Let p = r + 60. Suppose 0m = 6m - 84. Calculate the highest common divisor of p and m. 14 Let t = -4 + 24. Suppose -3d = 4d - 56. Suppose dv = 25 + 7. Calculate the highest common divisor of t and v. 4 Let c = 706 + -451. What is the highest common factor of c and 816? 51 Suppose 5k - 31 + 1516 = 0. Let d = -76 - k. Let t = d + 9. What is the highest common divisor of t and 23? 23 Let h = 808 - 424. What is the highest common factor of h and 24? 24 Let h be 1/10 + 64539/1010. What is the greatest common factor of 2752 and h? 64 Suppose 4i - m - 250 = 0, -i - 4m = -54 - 0. What is the highest common factor of i and 1? 1 Let l(n) = -n + 8. Suppose 2p - 4i = -3p - 10, 0 = -2p + i - 7. Let c = p - -13. Let y be l(c). What is the highest common factor of 1 and y? 1 Let h(s) = 2s*2 + 24s + 50. Let c be h(-2). What is the highest common divisor of 590 and c? 10 Suppose 4x - 2b = -8 + 32, 12 = 2x - 4b. Let d = x + 99. What is the greatest common divisor of d and 21? 21 Let v(m) = -16 + 2m + 6m2 + m3 + 0m3 + 16. Let k be v(-5). What is the greatest common factor of 165 and k? 15 Suppose -8s + 985 = 201. What is the greatest common divisor of 245 and s? 49 Let u be -7-3(-2)/6. Let t(i) = i*2 + 4i - 12. Let k be t(u). What is the greatest common factor of k and 9? 9 Suppose -21c = -580 + 160. Calculate the highest common factor of c and 940. 20 Suppose 5w + 6x - x = 530, 2x - 420 = -4w. Suppose 4a - 57 - 47 = 0. Calculate the greatest common divisor of w and a. 26 Let n be (2 + 1 + -2)-61. Let g = n - -97. What is the greatest common divisor of 54 and g? 18 Let u(b) = b + 28. Let k be u(-23). Suppose -3a = kn - 25, -a = 4a. Calculate the highest common factor of 35 and n. 5 Suppose -p + 2 = -52. Suppose 5i = -43i + 288. Calculate the greatest common factor of p and i. 6 Let n = 1182 - 633. Calculate the greatest common factor of n and 61. 61 Let h be ((-23)/(-3))/((-1)/(-3)). Suppose 3d = -5r + 48, -d + 0d = 4. Let l(s) = 2s - 1. Let z be l(r). Calculate the highest common divisor of z and h. 23 Suppose 3b + 5a - 688 = 0, 4b + b - 1176 = -a. Calculate the highest common divisor of b and 4. 4 Let m(t) = -t2 - t2 + 6 - t3 - 2 + 3t. Let z = -337 + 333. Let k be m(z). What is the greatest common divisor of k and 8? 8 Suppose 4 = -5w + 134. Let o = w + -20. Let g be (o/9)/(4/6). What is the highest common factor of g and 8? 1 Let k(s) = -4s + 4 + 19 + 3. Let x be k(-11). Let i	{ "pile_set_name": "DM Mathematics" }
e l so that l*2 + 348l + 30276 = 0. -174 Let -12q4 + 68q*3 - 112q*2 + 48q = 0. Calculate q. 0, 2/3, 2, 3 What is s in 21s5 - 297s*4 - 2283s*3/7 + 5715s*2/7 + 3000s/7 - 4500/7 = 0? -10/7, 1, 15 Find i, given that 4i5 + 119i*4 - 554i*3 + 803i*2 - 440i + 68 = 0. -34, 1/4, 1, 2 Factor -4n2 + 152n - 148. -4(n - 37)(n - 1) Determine x, given that 4x4 - 8x*3 - 32x*2 + 72x - 36 = 0. -3, 1, 3 Let 128y3/7 + 864y*2/7 - 6270y/7 - 6050 = 0. What is y? -55/8, 7 Factor 500v4/3 - 10900v*3/3 - 4520v*2 - 5488v/3 - 736/3. 4(v - 23)(5v + 2)3/3 What is i in -16i*4 - 172i*3 - 260i*2 - 68i + 36 = 0? -9, -1, 1/4 Let 2k3 - 112k*2 - 350k - 236 = 0. What is k? -2, -1, 59 What is r in 4r5/3 + 16r*4 + 64r*3 + 328r*2/3 + 84r + 24 = 0? -6, -3, -1 Determine k so that k*2/4 + 4k + 16 = 0. -8 Factor -5r2 + 355r - 350. -5(r - 70)(r - 1) Find h such that -100h3 - 608h*2 - 48h = 0. -6, -2/25, 0 Factor -4b3 - 8b*2 + 20b + 24. -4(b - 2)(b + 1)(b + 3) Factor 729z*4 - 2079z*3 + 1138z*2 + 204z + 8. (z - 2)(z - 1)(27z + 2)2 Factor 3v*3/2 + 138v*2. 3v*2(v + 92)/2 Factor 5s3 - 11s*2 + 6s. s(s - 1)(5s - 6) Solve b5/2 - 7b*4 - 23b*3/2 + 404b*2 - 160b - 6400 = 0 for b. -5, 8 Let 2s2/9 + 1480s/9 + 273800/9 = 0. Calculate s. -370 Factor -5m2/3 + 95m/3 + 70. -5(m - 21)(m + 2)/3 Factor 3i4 - 9i*3 + 9i*2 - 3i. 3i(i - 1)*3 Solve -5n*2 + 5n + 30 = 0. -2, 3 Let -3w4/2 - 255w*3 - 30459w*2/2 - 373320w - 3214944 = 0. Calculate w. -61, -24 Factor 4p3/3 + 4p*2 + 8p/3. 4p(p + 1)(p + 2)/3 Factor -4b*3 + 436b*2 - 12508b + 33708. -4(b - 53)2(b - 3) Find n, given that 3n5/5 + 12n*4/5 - 57n*3/5 - 138n*2/5 - 72n/5 = 0. -6, -1, 0, 4 Determine a so that -a4 - a3 + 22a2 + 40a = 0. -4, -2, 0, 5 Suppose o*3 - 259o*2 - 521o - 261 = 0. What is o? -1, 261 Factor -3r3 - 960r*2 - 75831r + 155526. -3(r - 2)(r + 161)*2 Factor -2f*3/23 - 108f*2/23 - 376f/23 + 1200/23. -2(f - 2)(f + 6)(f + 50)/23 Factor 2m*3/13 - 4m*2/13 - 160m/13. 2m(m - 10)(m + 8)/13 Factor -3r*2 + 180r - 177. -3(r - 59)(r - 1) Determine w, given that -5w4 + 800w*3 + 4920w*2 + 9920w + 6640 = 0. -2, 166 Factor 12y3 - 224y*2 + 348y - 136. 4(y - 17)(y - 1)(3y - 2) Factor b*2 + 38b + 37. (b + 1)(b + 37) Factor 3l*3/2 + 1185l*2/2 + 7029l/2 + 10503/2. 3(l + 3)2(l + 389)/2 Factor 4s2 + 332s. 4s(s + 83) Factor -3s3/2 - 24s*2 - 45s/2. -3s(s + 1)(s + 15)/2 Suppose 2t*5/17 + 6t*4/17 - 2t*3/17 - 6t*2/17 = 0. Calculate t. -3, -1, 0, 1 Factor -2z*2/9 + 56z/9 + 64. -2(z - 36)(z + 8)/9 Factor 5x3 + 15x*2 + 15x + 5. 5(x + 1)3 Factor 3y*3 - 108y*2 + 693y - 588. 3(y - 28)(y - 7)(y - 1) Solve -i2/4 + 3i - 9 = 0 for i. 6 Factor b*2/7 - 9b/7. b(b - 9)/7 Factor s2 - 4842s + 5861241. (s - 2421)*2 Factor 978121n*2/5 - 3956n/5 + 4/5. (989n - 2)2/5 Solve -12b*4 + 19b*3 + 22b*2 - 19b - 10 = 0 for b. -1, -5/12, 1, 2 Solve q*2 + 353q/3 - 118/3 = 0 for q. -118, 1/3 Factor -4o4/9 + 40o*3/9 - 12o*2 + 8o. -4o(o - 6)(o - 3)(o - 1)/9 Find q, given that 2q3/17 + 8q*2/17 + 8q/17 = 0. -2, 0 Suppose p*2/4 - 7p/4 + 3 = 0. Calculate p. 3, 4 Let -2g3 + 18g*2 - 52g + 48 = 0. What is g? 2, 3, 4 Find s such that -s*3 - 36s*2 - 405s - 1458 = 0. -18, -9 Find r, given that -15r4/2 - 113r3/3 - r2/2 + 5r/3 = 0. -5, -2/9, 0, 1/5 Solve -4j*2/5 + 4j/5 = 0. 0, 1 What is s in -9s3 + 714s*2 + 1209s + 486 = 0? -1, -2/3, 81 Let -5s5 - 25s*4 - 35s*3 + 5s*2 + 40s + 20 = 0. Calculate s. -2, -1, 1 Solve 2h3/13 - 160h*2/13 + 2666h/13 + 22188/13 = 0 for h. -6, 43 Let 12o2 + 321o - 81 = 0. Calculate o. -27, 1/4 Let 2y3/11 - 4y*2/11 - 10y/11 + 12/11 = 0. What is y? -2, 1, 3 Suppose -3c4 - 249c*3 - 5289c*2 - 5043c = 0. Calculate c. -41, -1, 0 Factor 15a3/7 + 2a*2 - a/7. a(a + 1)(15a - 1)/7 Suppose -27j4 + 681j*3 - 1311j*2 - 1605j + 414 = 0. Calculate j. -1, 2/9, 3, 23 Suppose 5s3 + 135s*2 + 120s - 260 = 0. What is s? -26, -2, 1 Let -5q2 - 225q = 0. Calculate q. -45, 0 Suppose -x*5 - 3x4 + x3 + 7x2 - 4 = 0. What is x? -2, -1, 1 Determine j so that j5/4 - 5j*4/4 - 15j*3/4 + 5j*2/4 + 7j/2 = 0. -2, -1, 0, 1, 7 Suppose 10o3 + 295o*2 + 145o = 0. What is o? -29, -1/2, 0 Let 4v5 - 36v*4 - 884v*3 + 36v*2 + 880v = 0. What is v? -11, -1, 0, 1, 20 Find h such that -4h5/3 + 44h*4/3 + 287h*3/3 + 508h*2/3 + 316h/3 + 64/3 = 0. -2, -1/2, 16 Factor 2l3 - 188l*2 + 902l - 1068. 2(l - 89)(l - 3)(l - 2) Factor 2v*4/3 - 1388v*3/5 + 1664v*2/15. 2v*2(v - 416)(5v - 2)/15 Factor -3w3/5 + 99w*2/5 + 42w. -3w(w - 35)(w + 2)/5 Suppose 3u*2/7 - 78u/7 - 24 = 0. What is u? -2, 28 Factor -3d4 + 24d*3 - 63d*2 + 66d - 24. -3(d - 4)(d - 2)(d - 1)2 Factor -2d*4/7 + 1004d*3/7 - 286d*2 + 1000d/7. -2d(d - 500)(d - 1)2/7 Factor -2w*3/3 - 1832w*2/3 + 2w/3 + 1832/3. -2(w - 1)(w + 1)(w + 916)/3 Factor 472v*2 - 946v + 4. 2(v - 2)(236v - 1) Solve -6u*4 + 1102u*3 - 55486u*2 + 435522u + 151380 = 0 for u. -1/3, 10, 87 Factor -5m5 + 15m*4 - 15m*3 + 5m*2. -5m*2(m - 1)3 Let -n2/4 - 67n/4 - 204 = 0. Calculate n. -51, -16 Factor -7396z*2 + 3440z - 400. -4(43z - 10)2 Suppose u3 + 21u2 + 39u + 19 = 0. What is u? -19, -1 Factor -32a2/7 + 76a - 1308/7. -4(a - 3)(8a - 109)/7 Determine i so that -i4 + 34i*3 - 320i*2 + 542i - 255 = 0. 1, 15, 17 Factor -4q4 - 112q*3 + 12q*2 + 344q + 224. -4(q - 2)(q + 1)*2(q + 28) Factor w*4 - 53w*3 - 224w*2 - 228w. w(w - 57)(w + 2)*2 Factor 2n*3/17 - 2046n*2/17 + 4086n/17 - 2042/17. 2(n - 1021)(n - 1)2/17 Suppose -q3 + 173q2/3 + 20q - 116/3 = 0. Calculate q. -1, 2/3, 58 Let 2h3/3 - 52h*2/3 + 30h + 48 = 0. What is h? -1, 3, 24 Solve 32v4/7 - 80v*3 + 274v*2/7 - 34v/7 = 0. 0, 1/4, 17 Solve 2s3/23 + 2292s*2/23 + 875544s/23 + 111485936/23 = 0. -382 Factor -i*4/4 + 199i*3/4 - 591i*2/4 + 589i/4 - 49. -(i - 196)(i - 1)3/4 Factor 12h*3 + 322h*2 - 390h + 56. 2(h - 1)(h + 28)(6h - 1) Solve -n*2 + 9n + 36 = 0 for n. -3, 12 Let -3c4 - 156c*3 - 1866c*2 + 4212c - 2187 = 0. Calculate c. -27, 1 Factor 2n3/5 + 4n*2/5 - 14n/5 + 8/5. 2(n - 1)2(n + 4)/5 Suppose -2h3/7 + 22h*2 - 64h + 296/7 = 0. Calculate h. 1, 2, 74 Factor -2t3/9 - 34t*2/9 - 158t/9 - 14. -2(t + 1)(t + 7)(t + 9)/9 Suppose 25s*4 + 95s*3 + 114s*2 + 52s + 8 = 0. What is s? -2, -1, -2/5 Factor -t*4 + 5t*3 + 3t*2 - 45t + 54. -(t - 3)*2(t - 2)(t + 3) Suppose -3f*5 + 9f*4 + 114f*3 - 576f*2 + 672f = 0. Calculate f. -7, 0, 2, 4 Factor o*2/4 - 273o/2. o(o - 546)/4 Suppose -2000v*3 - 1800v*2 + 195v - 5 = 0. What is v? -1, 1/20 Find i such that -2i2 + 24i/7 + 8/7 = 0. -2/7, 2 Factor 2s3/5 - 422s*2/5 - 858s/5 + 1278/5. 2(s - 213)(s - 1)(s + 3)/5 Factor -4z*3 - 408z*2. -4z*2(z + 102) Factor -53z2 + 7z. -z(53z - 7) Find k such that -k*3/2 - 63k*2/2 - 480k + 512 = 0. -32, 1 Solve -2z2/3 - 4z - 10/3 = 0. -5, -1 Factor -2i5 + 7i*4 - 4i*3 - 4i2. -i2(i - 2)2(2i + 1) Factor 4f*3/9 - 388f*2/9 - 788f/9 - 44. 4(f - 99)(f + 1)*2/9 Find m such that 4m*2 + 752m + 748 = 0. -187, -1 Let 4d3 + 60d*2 - 4d - 60 = 0. What is d? -15, -1, 1 Factor -f*4 + 9f*3 - 15f*2 + 7f. -f(f - 7)(f - 1)*2 Factor 58564m*3 + 59532m*2 + 972m + 4. 4(m + 1)(121m + 1)2 Factor 9z*4 + 33z*3 - 72z*2 - 60z. 3z(z - 2)(z + 5)(3z + 2) Factor 2s*3 + 278s*2 + 796s - 2720. 2(s - 2)(s + 5)(s + 136) Determine q so that -10q*2 - 32q/5 = 0. -16/25, 0 Find i such that -10i3/11 - 6i*2/11 + 24i/11 - 8/11 = 0. -2, 2/5, 1 Factor -k*5/3 + 2k*4 - 13k*3/3 + 4k*2 - 4k/3. -k(k - 2)2(k - 1)*2/3 What is z in 5z*2/3 + 200z + 595/3 = 0? -119, -1 Factor -3x2 - 99x - 186. -3(x + 2)(x + 31) Let -5k3 - 745k*2 + 23800k - 173460 = 0. What is k? -177, 14 Suppose -3w2 - 381w/5 + 234/5 = 0. What	{ "pile_set_name": "DM Mathematics" }
e Let d = 15 - 12. Suppose dj + 5112 = 7j. Is 16/(-56) + j/14 a composite number? True Suppose 0 = -0r - 9r - 102366. Is 3/2 - r/4 a prime number? False Let x(g) = 70g2 + 71g - 14. Is x(11) prime? False Let u(h) = h + 6. Let i be u(-8). Let s be ((-50)/4)/(1/i). Suppose -3m + s = -86. Is m a composite number? False Suppose 0 = -6g + 7g - 5639. Is g a prime number? True Suppose -34 = -5y + 4d, d = 3y - 2d - 21. Let r(z) = 13z*2 + 16z - 1. Is r(y) a composite number? False Let d = -1040 - -186. Let s = 552 + d. Let l = s + 595. Is l composite? False Let g = 6 - 7. Is ((-2)/(-6))/((-2)/10158g) prime? True Suppose 4s - f - f = 554, 0 = s + 5f - 155. Is ((-53)/(-2))/(14/s) a prime number? False Suppose 0d = -d - 4n + 36, -5n = -5d + 55. Let g be (-1)/(-2) - 328/d. Let t = g + 29. Is t a composite number? True Is (-5630142)/(-189) + (2/(-2))/9 a prime number? True Let n(i) = -i3 + 16i*2 - 4i + 65. Let l be n(16). Let b(g) = 233g + 3 - 99g + 156g. Is b(l) a prime number? True Let k(v) = 4v*2 + 5v + 4. Let q = -13 + 15. Suppose qd - 13 - 5 = 0. Is k(d) composite? False Let d(z) = 1066z - 15. Let j be d(7). Let m = j - 2804. Is m composite? False Let t = -20 + 19. Let d(m) = 3 - 4 + 2 - 142m. Is d(t) prime? False Is ((-6)/(-2))/(48/52016) prime? True Let f = 1048 - 422. Let k = f - -773. Is k prime? True Let o(v) = 3722v + 331. Is o(26) a prime number? True Let d be 33/2 + 5/(-10). Suppose 4i = -48 + d. Is ((-26)/i)/(14/280) prime? False Let h(s) = -s3 - 10s*2 - 8s + 11. Let n be h(-9). Is (1 - n)/(1/(-329)) a prime number? False Let c = -15979 + 27498. Is c composite? False Suppose -4p = 4j - 10 - 6, -j - 2p = -7. Let u be 21/(-12) + j/(-4). Is (-284)/21/u a composite number? False Suppose x + 0f = -4f + 10273, 20510 = 2x - 4f. Is x composite? True Suppose 3j = -j - 36056. Let s = -4896 - j. Suppose -3g - 359 + s = 0. Is g a composite number? True Let s(a) = a*3 + 6a*2 - 8a - 8. Let y be s(-7). Is y/(-4) + 3573/12 a prime number? False Let y = -15 + 22. Let z be (20/y)/(4/14). Suppose 0i - z = -b + 4i, b + 4i - 18 = 0. Is b composite? True Let n(g) = 335g + 377. Is n(7) composite? True Is ((-5)/(-15))/(-2 + (-134119)/(-67059)) composite? True Let q be (48/(-20))/((-1)/5). Suppose qj = 8j. Suppose i + 3 = -ji, 2i = -4y + 78. Is y composite? True Let o be -1 - -265 - (2 - 3). Suppose 0c - o = -p + 4c, 530 = 2p - 3c. Is p composite? True Is 8 + 33/(-3) + 7070 a composite number? True Let q = 22 - 14. Suppose 2 = qo - 7o. Suppose x - 5x - 726 = -5u, -291 = -ou + x. Is u a prime number? False Suppose 5l + 4x - 3100 = 0, -4l - x + 3315 - 846 = 0. Suppose 0 = -4t - 3a + l, t + a = -3t + 624. Is t prime? True Let t be (80/32)/(10/8). Suppose 62 = ts - 3w, 3s - 175 = -3w - 52. Is s composite? False Let z = 3462 + -2402. Let q = z + -181. Is q a composite number? True Suppose 32k - 6071 + 983 = 0. Is k composite? True Is 6800 + (-3 + 1 + 5 - 2) composite? True Is (0 + 6542)(-2)/(-48)12 prime? True Suppose -5y - 10 = 10, -g - y + 9715 = 0. Is g prime? True Suppose 6j = 36 - 6. Suppose 0t + t + 4l = 1155, jl + 1173 = t. Is t a composite number? False Let c be 36/48 - 4217/(-4). Suppose 14v - c = 9v. Is v a prime number? True Let t(u) = -294u3 + 2u*2 - 1. Let g be (5 + -4)/(2/10). Suppose -5z + g - 10 = 0. Is t(z) a prime number? False Let g(a) = 4a3 - a2 + 2a + 32811. Is g(0) a prime number? False Let r(u) = -650u - 2. Let j be r(1). Let o = j - -1449. Is o prime? True Let p = 141 + -1137. Let g = 1757 + p. Is g a composite number? False Let c(b) = 2905b + 37. Is c(6) a composite number? False Suppose -127p + 109p = -1216062. Is p a prime number? True Suppose 5u - u = 0. Suppose -2z = -uz - 30. Let a(x) = x2 - 20. Is a(z) prime? False Let l = -1 + 39. Let r = l - -381. Is r a composite number? False Let i be 1(-6)/(6/5). Is 62 + i - (-3 - -1) a prime number? True Suppose -17290 - 7271 = -3d. Is d composite? True Suppose 2 - 12 = -2q. Suppose -qz + 2z + 22 = 4j, -2j + 6 = -z. Suppose -5a = -jh - 3387, 3h - 295 - 2427 = -4a. Is a prime? False Suppose u - 108 = -0u. Suppose 4v + 2v = u. Suppose -2d + d - 33 = -5b, -2b = 2d - v. Is b a prime number? True Let s = 16 + -22. Suppose 40 = -2v - 14. Is (666/v)/(4/s) a prime number? True Suppose -685 = -9t + 1142. Is t a prime number? False Let t(p) = 841p*3 - 2p*2 - 2p + 3. Let i be t(1). Suppose -a - 5n = -i, 0 = -a + 4n - 2n + 833. Is a composite? True Is (3 + 22/(-6))/((-24)/93780) composite? True Let u(s) = 8s*2 - 12s - 3 + 15 - s. Is u(9) a composite number? True Is (-121923)/(-23) - 321/9 composite? True Suppose -2g + 4y = -g - 65, 4g - 2y = 232. Let l be 36/(-2) + 3 + -5. Let u = g + l. Is u prime? True Is 141155/45 + 34/153 a prime number? True Suppose -3s + 19004 = q + 4097, 0 = 3s + 4q - 14907. Is s composite? False Suppose -4a + 5i = -943, -3i = 4a - 2a - 477. Suppose w - z - 311 = -3w, -3w = -2z - a. Suppose u - 379 = -c - w, -2 = -2c. Is u a composite number? True Let k(v) = -341v*2 + 2v + 4. Let t be k(4). Let q = -3643 - t. Is q prime? True Suppose -250n - 266201 = -263n. Is n a prime number? True Let s(t) = 19t2 + 1. Let j be s(-2). Suppose 7 = 2a + j. Is (-369)/(-7) + (-10)/a prime? True Suppose -2b - 2 = 4. Is -134((-51)/6 - b) composite? True Let a(x) = -3 - 9x2 + 3x - 6 + 12x2 + 4x. Let h(r) = 4r2 + 7r - 8. Let o(l) = -5a(l) + 4h(l). Is o(9) a composite number? False Suppose 0 = b + b + 4, -4w + b + 18 = 0. Suppose -wy + 148 = -348. Suppose 5o - 826 = -5d - 236, -o + y = -d. Is o a composite number? True Let z be -3 - (0 - 3 - -4). Let k be -3 - (z - -1) - -406. Let o = k - 227. Is o a composite number? False Suppose -3p + 5p + 571 = 3w, 4w + 2p - 766 = 0. Suppose 5173 = 12z - w. Is z a prime number? False Let d be ((-654)/8)/(-1 - (-5)/8). Let x be (-3)/((-6)/4) + 1. Suppose -xo + d = -679. Is o composite? True Let t be -1 + (-1 - (-1 - 108)). Suppose 0v + v + t = 0. Is v/(-5) - (-4)/(-10) a composite number? True Let v(m) = m*2 + 6m + 5. Let r be v(-5). Suppose -5g + 4q + 1611 = r, -93 = -g - 5q + 235. Is g a prime number? False Let c = 167 + -235. Let x = c + 1261. Is x a prime number? True Let n = 55 + -83. Let u = 31 + n. Is 363/224/u prime? False Let s(n) be the third derivative of -659n4/8 - 7n*3/6 - 11n*2. Is s(-4) a prime number? True Let m(h) = -2h*3 - 4h*2 - 4h - 3. Let i be m(-2). Suppose ix + 12 + 3 = 0. Is (-348)/(-9)x/(-2) composite? True Let b be 4/(-18)3(-2 + -1). Let q be (-3)/(12/(-98))2. Suppose -p + 77 = 4m, -p = bm - q - 34. Is p composite? False Let t(z) = 2z + 157. Is t(-34) a prime number? True Let t(k) = k*3 + 42k*2 + 128k + 16. Is t(-35) a composite number? False Suppose 0 = 2v - 3v + 2u - 1, -u = 0. Is ((3178)/(-6))/(v + 0) a prime number? False Suppose 198u - 208u = -353930. Is u a prime number? True Let z(m) = -3m + 3m*3 + 9 + 3m*3 - 5m*3 - 3m*2. Let y(f) = 26f + 296. Let g be y(-11). Is z(g) composite? True Suppose -2w + 3s - 7 = 0, w = -s - 5 - 6. Let k(u) = 2. Let o(z) = 2z + 1. Let t(m) = -4k(m) - 2o(m). Is t(w) prime? False Is 4/(24/8430) + -6 composite? False Suppose -13v = 5a - 12v - 41649, -5a + v + 41641 = 0. Is a composite? False Let h(w) = -17w - 1. Let f be h(-6). Let t = 268 - f. Is t prime? True Suppose -19u + 16u = -59403. Is u a composite number? False Let a = 641 - 462. Is a a prime number? True Let p(l) = 12l3 + 3l*2 + 5l - 3. Let j be p(4). Let z = 1752 - j. Is z composite? False Let t = -29 - -13. Let u = 69 + t. Is u composite? False Let i(f) = f*3 - 5f*2 + 13f + 8. Suppose -v - 4a + 11 = 0, 2v - a - 22 = -2a. Is i(v) a composite number? False Let u = -975 - -2956. Suppose 0 = 3x + 12, -k - 2k + u = 5x. Is k composite? True Let l(o) be the third derivative of -o4/24 + o3/2 + 4o2. Let n be l(-5). Suppose -2h + 3 = -2f + 1, -4f + n = -h. Is f a prime number? True Is 265000/35 + (-24)/56 a composite number? True Let b = -28 + 28. Suppose 4q + 909 - 3601 = b. Is q prime? True Let h be 2/(-5) + 24/10. Suppose hq = 6q - 5r - 2967, 0 = 5q + 3r - 3681. Suppose -947 =	{ "pile_set_name": "DM Mathematics" }
True Let v(a) = -a*3 - 14a*2 - 8a - 13. Let u(y) = -y. Let w(i) = -6u(i) - v(i). Let b be w(-13). Which is smaller: -3 or b? -3 Suppose -5o - 2k + 23 = 0, -9 - 4 = -3o - 2k. Suppose s = oi - 15, -3s - 1 = 14. Let j = i - 3. Is j >= 0? False Let h = 0.43 - 0.53. Is 3/26 > h? True Let j = -2351/6 + 390. Let l = j + 19/10. Let d be (6/5 - 1)5. Which is greater: l or d? d Let u = -1 - 1. Let r = u + -1. Let i = r + 2.7. Do 0.1 and i have the same value? False Let b(c) = 3c - 3. Let u be b(2). Let r be (1/u)/((-11)/(-6)). Is r bigger than 0? True Let v(d) = -d2 + d + 3. Let x be v(0). Let k be (-1)/4 + x/12. Is -3/7 <= k? True Let k be 12/(-18)1/(-1). Do k and -2/11 have the same value? False Suppose z + 0 = 3. Suppose -3s - 5 = h, -13 = 5s + 7h - zh. Is s equal to -0.06? False Let p be 33/(-36) - 2/(-3). Suppose 2r - r + 1 = 2x, -3x = -4r + 1. Which is bigger: p or r? r Let t(k) = 2k2 + 2k + 2. Let l be t(-2). Suppose -a = -l + 3. Which is smaller: 1 or a? 1 Let l(v) = -v*2 - 5v - 2. Let h be l(-5). Let r(w) = w + 1. Let j be r(h). Let z be j/(-2)(1 - 1). Which is smaller: z or -1? -1 Let l(k) = k3 + k2 + k - 10. Let b be l(0). Let r be ((-28)/(-175))/((-4)/b). Is r greater than 5? False Let a = 1.24 - 1.34. Is 9.4 less than a? False Let x be (-32)/(-12)(-3)/(-2). Let g be (-1 - x/(-5))3. Which is bigger: g or 4? 4 Let o be ((-1)/(-4))/(-4 + (-102)/(-24)). Let g = 1.1 + -2. Is o at most g? False Let g be 1/((-16)/1586) + -1. Let d = g - -100. Which is smaller: d or 1? d Suppose -4x = -3x. Let n(u) = -u3 - u2 - u + 6. Let v be n(x). Let h be (v/(-6))/((-2)/(-14)). Is h smaller than -7? False Let q(k) = k - 3. Let s be q(3). Let i be s/(5/((-5)/(-2))). Is 1/6 greater than i? True Let p be 0 + 3/1 + -3. Is 2/19 at most as big as p? False Let g = -1 + 0. Let b be -1(1/(-1) - g). Suppose -t = -1 - b. Which is smaller: -1/9 or t? -1/9 Suppose 5h = -0h - 15. Let p = -4 - h. Let f = -2 - p. Which is bigger: f or -2? f Let g be (4/2)/(-3 - -2). Which is greater: g or -7/3? g Let s = -3 + 3. Let k = s + -1. Let p be (k/3)/(1/(-3)). Is p at most 1/4? False Let x(v) = -v*3 - 8v*2 - 7v + 4. Let n be x(-7). Suppose 4z = -5r + 6, -nz + 0 = 4. Which is smaller: r or 2/3? 2/3 Suppose 4 = -0u + 2u, -4y + u - 14 = 0. Let d = y + 6. Let g(v) = -v + 1. Let b be g(-3). Is d < b? True Let a = 1 - -6. Is 8 not equal to a? True Let i = 2.7 + -2.78. Is i equal to -1? False Suppose k + 32 = 4l, -6l = -2l + k - 32. Which is smaller: l or 5? 5 Let x = -1 + 0. Let n(u) = -u2 - 5u - 3. Let i be n(-3). Let h be x - (i/2)/3. Are h and -2 equal? False Suppose -7x + 105 = -4x. Let j = x - 19. Which is smaller: j or 0? 0 Let i be (-18)/20 - 2/(-4). Suppose -4w = -4, -w - 2 = -0b - b. Let o = 4 - b. Are i and o unequal? True Let c = 51 - 48. Which is greater: 5 or c? 5 Let i = -52/25 + 1029/50. Let j = i - 18. Let o = -1 + 3. Which is greater: j or o? o Let c(v) = -3v + 6. Let r(l) = -1. Let q(o) = c(o) - r(o). Let w be q(4). Is -6 >= w? False Let a = -3 - -23. Is -0.1 greater than a? False Let s(g) = -2g - 11. Let b be s(-6). Is b smaller than 6/5? True Suppose -5l + 4 = -2x, 5l - 2l = -3x - 6. Suppose -m + 4m + 3 = l. Is 1 less than m? False Let u(y) = -y*3 + 5y*2 - 6y - 6. Let l be u(5). Let m be ((-4)/l3)/1. Is 0 at least m? False Let p = 0 + 1. Let r = 13 - 11. Which is greater: r or p? r Let c = -37/100 + 3/25. Let f = 3.37 + -3.51. Which is smaller: f or c? c Suppose 4j + 2a - 6 = 0, 0a - 5a + 15 = -j. Let s be 9/(-6)2 - -6. Let f be 1-1(-2 + s). Which is smaller: j or f? f Let g(k) = k*2 + 8k - 4. Let u be g(-8). Which is smaller: u or -6? -6 Suppose -k - 2m - 8 + 2 = 0, -2k + m + 3 = 0. Let h be 6/126(-2 - 1). Which is bigger: k or h? k Suppose 0 = 2v - 6v + 40. Suppose -g - v = 4g. Is g less than 0.3? True Let n = -66/13 + 2416/481. Which is greater: 0 or n? 0 Let s(d) = d*2 + 6d + 13. Let w be s(-5). Which is bigger: w or 9? 9 Let v be (-5)/25-52. Suppose -4o = 5f + 32, 0 = -4f + 5o - 24 - 18. Which is greater: v or f? v Let d(j) = j*3 + 5j*2 - 6j + 2. Let x be 6/1(-4)/4. Let s be d(x). Suppose -sy = 7q - 2q - 10, 25 = 5y. Which is smaller: q or -2/11? -2/11 Suppose -19 = 3y - 2y + 5d, 0 = -4y + 5d + 49. Suppose 10m = ym. Which is greater: m or -4/5? m Let x = 18 + -26. Let v = -1.9 - -2. Is v <= x? False Let z = 632/175 + -25/7. Let g(m) = m*2 + m + 1. Let x be g(0). Is z at least as big as x? False Let s(y) = -y - 7. Let c be s(-8). Suppose -4u - c = 3. Is u smaller than -2? False Let p(j) = j*3 + 3j*2 + 2j - 2. Let a be p(-3). Which is smaller: -10 or a? -10 Let a be (-45)/55 + 26/(-22) + 1. Which is greater: -5 or a? a Suppose 4k + 4 = -16. Let b(n) = n2 + 7n + 7. Let r be b(k). Let s be 2/8 - r/4. Which is smaller: 0 or s? 0 Let n = -18 + 21. Suppose 3d = -ny + 3, -y + 5y = -2d + 4. Is 1 at least y? True Let w = -5673/2047 + 64/23. Which is greater: w or 0? w Let o be (-2)/(-96)4(-9 + 6). Let r = 0.1 + 0.1. Does r = o? False Let i(z) = 4z - 9. Let c be i(3). Which is smaller: 0.5 or c? 0.5 Let k(m) = m2 - 9m + 6. Let a be k(8). Let d be 3 + 7/2a. Which is greater: d or 1/4? 1/4 Suppose 0 = a - 8 - 2. Are a and 12 unequal? True Let n be -2 + -3 + 7 + -4. Let r be (-1 - -1)/(n + -1). Suppose -2a - a = r. Is 2/17 < a? False Let i = 102 + -71. Which is smaller: 30 or i? 30 Let c(j) = -j*3 - 8j*2 - 7j - 1. Let r be c(-7). Let g be (-2)/6 - r1. Suppose 2x - 4f - 2 = 0, -2x - 3f = -1 - 1. Which is smaller: g or x? g Let t = 0 + 12. Are 12 and t non-equal? False Let s = 6 - 0. Let k be (-4)/(-3) - s/18. Let j = -1 - -1. Is k greater than or equal to j? True Let a be 14/2 - (-4 + 3). Suppose a = -4t - 8. Let y be t/69/6. Is -2 less than or equal to y? True Let t = -42.04 - -42. Is t <= -0.1? False Suppose -3w - 5y = 12, -5 = -2w - 3y - 13. Is w at most 0.2? True Let m be 4/(-10) + (-1011)/(-15) + -3. Do m and 64 have the same value? True Let j = 39 + -21. Suppose -j = q - 3q + f, -3q + 28 = -2f. Which is smaller: q or 9? q Suppose -5j + 2j - 9 = 0. Let v be 1/(-1)15/(-3). Suppose -3m = -y + vy, 5y = 2m + 23. Is m <= j? True Let n(q) = -q2 - 9q - 7. Let m be n(-8). Let g = 11 - -39. Let f be (24/g)/(-3)-5. Which is smaller: f or m? f Let w = -7 + 5. Suppose 0 = 2o + 6, 3p - 5o - 17 = 2p. Suppose 0 = 3u - 2f - 4, u - pu - 4f = 8. Which is bigger: u or w? u Let u(x) = -x2 + 5x - 1. Let j be u(4). Suppose ja = -9 + 3. Is -1/2 greater than or equal to a? True Suppose -o = q - 17, -3o - 6 = -5o + 5q. Which is greater: 12 or o? o Let q be (0 - -1)/((-3)/3). Let c be (-2 - (-2 - -2))/q. Let g be 344/16. Which is bigger: g or c? g Let n be (-18)/(-48)(-20)/(-6). Are 0 and n non-equal? True Suppose 17 - 2 = 5u. Suppose 0 = x + 2x - u. Are 3/5 and x nonequal? True Let x = 2 - -6. Let o be ((-3)/2)/(2/x). Suppose -4s + 9 - 33 = 0. Is o < s? False Let f = 11 + -4. Suppose -3d = -fd - 20. Which is greater: -6 or d? d Let m = -111 + 110. Is m at most as big as 6? True Let n = -37 - -142. Are n and 105 non-equal? False Let h(r) = 8 + 3 + r - 2. Let w be h(-10). Is 0 greater than or equal to w? True Let o(d) = 6d - 6. Let k be o(1). Let i = -713/7 + 102. Which is smaller: k or i? k Let t be ((-3)/4)/(-3)28/1. Suppose -9 = -2b - j, -3b - 4j = -j - 15. Is b less than t? True Let c be -6(-3)/((-45)/(-110)). Which is smaller: c or 45? c Suppose 3v - 1 + 4 = 0. Let a be 3 + v - (-1)/1. Suppose 1 = -at - 2. Which is greater: t or -2? t Let z = 333.1 + -333. Let p = 4 - 14. Do z and p have the same value? False Let u(c) = -c*2 - 9c + 12. Let o be u(-10). Which is smaller: o or 1? 1 Let g(x) = x - 6. Let c be g(5). Let l be (54/44 - 1)(-20)/(-25). Which is smaller: c or l? c Let b = 29.9 - 19.8. Let n = -0.1 + b. Let a = 9.7 - n. Which is smaller: a or 0? a Suppose 19 = -3v - 4b, -4v + 12 = -7b + 3b. Suppose 2o - 8 = -2u, 0 = 5o - 2u - 7 - 6. Let r be (1/(-6))/(o/2). Which is smaller: v or r? v Let q = -0.08 - -12.08. Let o = -11.9 + q. Is o smaller than 12? True Let m(w) = w*2 + 5w - 3. Let u be m(-5). Let b = -5 - u. Let z be 3/b*(-8)/(-12). Which is smaller: -2 or z? -2 Let m = -1 +	{ "pile_set_name": "DM Mathematics" }
+ p. Give -4r(i) - v(i). 2i3 + 13 Let m(j) = -j2 + j + 1. Let u(h) = h3 - h2 - 4h. Give -2m(g) + u(g). g3 + g2 - 6g - 2 Let f(b) = 7b. Let r(v) = v*2 + 8v - 1. Let j be r(-9). Let a(i) = 11i. Determine jf(z) - 5a(z). z Let s(u) = u3 + u2 - 1. Let g(o) = -5o3 + o2 - 1. Calculate g(v) - s(v). -6v3 Let h(x) = 13x*3 - 3x2 + 2. Let m(q) = -q2 - 1. Give h(k) - m(k). 13k3 - 2k*2 + 3 Let a(p) = 6p*3 + p - 2. Let c(b) = -7b*3 - b + 3. What is -6a(w) - 4c(w)? -8w*3 - 2w Let s(b) = -b*3 + 6b2. Let y(z) be the first derivative of z3/3 + 30. Give -s(g) + 5y(g). g3 - g2 Let l(t) be the third derivative of -t5/10 - 5t3/6 + t2. Let q(z) be the first derivative of -7z3/3 - 6z + 25. Give 6l(p) - 5q(p). -p*2 Let a(y) = 8y*2 + 2y - 13. Let k(s) = -4s2 - s + 7. What is 6a(m) + 11k(m)? 4m*2 + m - 1 Let v(k) = -5k*2 - 4. Let f(n) = 4n2 + 3. Let j(b) = -b3 - 4b2 - b - 1. Let i be j(-4). Calculate iv(h) + 4f(h). h2 Let v(n) = -8n - 1. Let i be v(-1). Let u(o) = -4o + 4. Let p(q) = 2q - 3q - 2 + 3q. Determine ip(g) + 3u(g). 2g - 2 Let r(z) = 4z3 + 9. Let m(c) = -c3 - 2. Let u be 2/7 + (-240)/(-42). Let i be 22/(-12) + (-1)/u. Calculate ir(n) - 9m(n). n3 Let t(s) = -s3 + 5s2 - 3s + 5. Let k(b) = -b*3 + 4b*2 - 2b + 4. Calculate 3k(d) - 2t(d). -d*3 + 2d*2 + 2 Let r(m) = 13m*3 + 3m*2 - 3. Let s(u) = 13u*3 + 2u*2 - 2. Determine 2r(z) - 3s(z). -13z*3 Let q(l) = -l. Suppose 0 = -3j + 4 + 11. Let h(n) = -3n - 1. Let f = 5 + -3. Suppose -9 = fg + 5t, 0 = g + t + 4t + 7. What is gh(y) + jq(y)? y + 2 Let d(j) = -2j3 - 5j + 5. Let q be 16/7 - (-8)/(-28). Let t(z) = z*3 + 2z - 2. Let k be (-39)/(-3) - (1 + 1). Let h = 16 - k. Give ht(w) + qd(w). w3 Let o(w) = w3 + 4w2 - 3w - 2. Let g(f) = -2f3 - 5f*2 + 4f + 2. Give -2g(a) - 3o(a). a*3 - 2a2 + a + 2 Let l(v) be the first derivative of -v2 + 2 + 2/3v3 + 2v. Let w(n) = -n*2 + n - 1. Let d be -46/(-16)2. What is dl(t) + 8w(t)? -2t*2 + 2t - 2 Let j(n) = 5n3 - 6n*2 + 7n + 7. Let i = 17 - 18. Let h(s) = s3 - s2 + s + 1. Give ij(m) + 6h(m). m*3 - m - 1 Let y(z) = -4z*2. Suppose 2b = -2b - 3i + 24, -4i = 16. Suppose 3f - 3 = 2f. Let t(u) = -3u*2 + 2u*2 + fu*2. Calculate bt(h) + 4y(h). 2h*2 Let i(n) = 3n + 2. Let t(u) = u + 13. Let o be t(-12). Suppose -2p - o = 3. Let q(r) = -15r - 11. Calculate pq(m) - 11i(m). -3m Let y(r) = -2r*3 - 3r*2 + 2r - 1. Let u(n) be the third derivative of -n4/24 + n3/6 - 4n2. Calculate -2u(d) - y(d). 2d3 + 3d2 - 1 Let q(i) = -i3 - 3i2 - 3i - 8. Let y(l) = 2l2 + 2l + 9. Determine -2q(m) - 3y(m). 2m3 - 11 Let g(n) = 11n*2 - 2n - 1. Let w(b) be the third derivative of -b5/15 + b4/24 + 7b2. Determine 3g(i) + 8w(i). i2 + 2i - 3 Let l(t) = t*2 - t - 1. Let g(p) = -8p*2 + 6p + 6. Give 5g(m) + 30l(m). -10m2 Let t(k) = -4k + 3. Let w(h) = 9h - 7. Suppose 7j - 4j = x + 10, 4x - 40 = -4j. Suppose r = xq - 10 - 1, -22 = -2q - 4r. Determine qw(s) + 7t(s). -s Suppose 0k = 2k + 3j + 18, -2k - 20 = 4j. Let x be (-8)/20 - 6/10. Let n(g) = 2g + 15 + 4g - 11 + 2g*3. Let d(z) = -z - 1. Determine kd(f) + xn(f). -2f3 + 2 Let l(h) = h + 4. Let n(q) be the first derivative of -q2 - 4q - 12. What is 3l(c) + 2n(c)? -c + 4 Let c(q) = 18 + 24 - 35 - 7q. Let j(p) = -20p + 20. Determine 17c(b) - 6j(b). b - 1 Let w(x) = -63x. Let i(f) = -1826f. Determine -3i(q) + 88w(q). -66q Let i = 6 - 4. Let h(w) = -4w2. Suppose 3c + 0c = 6. Let o(k) = -1 - k2 - 5kc + k2. Give io(d) - 3h(d). 2d2 - 2 Let c(x) = 4x - 4. Let u(p) = -2p + 2. Determine -4c(a) - 7u(a). -2a + 2 Let m(r) = -r. Suppose 0 = -0b + b + 4. Let o(a) = 3a. Let z(y) = bm(y) - o(y). Let d(f) = 4f. Determine 4d(q) - 14z(q). 2q Let l(n) = n3 + 3n*2 - 9n + 5. Let p(q) = -2q2 + 4q - 2. Calculate 2l(f) + 5p(f). 2f3 - 4f*2 + 2f Let r(o) = 104o3 + 17o + 6. Let i(g) = -35g3 - 6g - 2. Calculate -17i(q) - 6r(q). -29q3 - 2 Let o(t) = 1. Let q(n) = -2n*3 - 5n*2 - 5n + 3. Determine -3o(i) + q(i). -2i*3 - 5i*2 - 5i Let l(a) = -a. Let t(z) = -3z + 1. Determine -2l(v) + t(v). -v + 1 Let o(y) = -18y3 - 5y*2 + 5y - 5. Let d(v) = -522v3 - 144v*2 + 144v - 144. Calculate -5d(u) + 144o(u). 18u3 Let d(f) = 3f - 11. Let i(c) = -3c + 12. Determine 5d(l) + 4i(l). 3l - 7 Let j(u) = 3u - 3u - u + 2u. Let v be j(-3). Let t(m) = -7m + 9. Let s(o) be the first derivative of -2o2 + 5o + 1. Give vt(z) + 5s(z). z - 2 Let v(l) = 2l2 + 5l*3 + l - 1 - 1 - 8l*3 + 4l*3. Let r(a) = -3a*2 - a + 2. Calculate -2r(u) - 3v(u). -3u*3 - u + 2 Let h(i) = -11i*2 + 14i - 20. Suppose -12f = -f + 187. Let u(v) = -4v*2 + 5v - 7. Give fu(j) + 6h(j). 2j2 - j - 1 Let c(g) = -g + 9. Let q(z) = z - 1. What is -c(d) - 3q(d)? -2d - 6 Let t(z) = 2z*3 + 4z*2 - 3z - 3. Let l(x) be the third derivative of x*6/40 + 2x*5/15 - 5x*4/24 - 5x*3/6 + 29x*2. Calculate -3l(c) + 5t(c). c3 - 4c2 Let u(v) = -v3 - 2v. Let i be (-2)/(0 - 8/12). Let y(c) = 4c*i + 4c - 5c3 + 2c3 + c3. Determine -7u(t) - 4y(t). -t*3 - 2t Suppose 0 = 3z + 18. Let m(o) = 15o + 13. Let l(p) = 7p + 6. What is zm(g) + 13l(g)? g Let l(h) = 4h*2 + 15h + 11. Let m(r) = -4r2 - 23r - 12. Let y(p) = 2p2 + 11p + 6. Let f(v) = 3m(v) + 7y(v). Determine 11f(q) - 6l(q). -2q2 - 2q Let f(p) = p + 1. Let n(u) = 11u + 1. Determine -2f(r) + n(r). 9r - 1 Let g(m) be the first derivative of -7m - 10/3m3 + 0m*2 - 10. Let d(y) = 3y*2 + 2. Calculate 21d(l) + 6g(l). 3l*2 Let f = -7 - -9. Let k(v) = v - 13. Let o(i) = 3i - 38. Let d(s) = -8k(s) + 3o(s). Let g(j) = 2. Give fd(a) + 11g(a). 2a + 2 Let z(p) = -p + 1. Let g(q) = -65q*3 + 4q - 4. What is -g(c) - 4z(c)? 65c*3 Let t = -4 - -11. Let d(g) = 3g - 5. Let n(y) be the third derivative of y*4/6 - 7y*3/6 + 10y*2. What is td(j) - 5n(j)? j Suppose 2q + 0q = 22. Let y = q - 12. Let o(v) = -v3 - 6. Let m(z) = 2. Let d(h) = 1. Let i(a) = -d(a) + m(a). Determine yo(p) - 5i(p). p3 + 1 Let h(k) = 11k*2 + 14k - 14. Let v(s) = 7s2 + 9s - 9. Let c(f) = -f - 10. Let j be c(-10). Let x be 2 + 0 + -7 - j. What is xh(o) + 8v(o)? o*2 + 2o - 2 Let w(x) = -6x3 + 3x*2 + 2x + 1. Let t(c) = -6c3 + 4c*2 + 3c + 1. What is 3t(p) - 4w(p)? 6p3 + p - 1 Let b(w) = 1 + 0 + 0. Let u(x) = -x. Let z = -19 - -20. What is zu(v) + 2b(v)? -v + 2 Let c(l) = -3l. Let x(i) = i*3 - 16i. What is 11c(u) - 2x(u)? -2u3 - u Suppose -12 = -5s + 8. Let b(f) = -4f2 - 5f + 2f2 + f + sf2. Let a(d) = d2 + 3d2 + d - 5d*2. Determine 4a(i) + b(i). -2i2 Let t be (15 - 9) + -3 + 1. Let y(p) = 3p*2 + 3p + 3. Let r(k) = -3k2 - 4k - 4. What is ty(c) + 3r(c)? 3c2 Let f(p) = -9p + 5 + 8p - 9. Let s(i) = -5. Calculate 5f(b) - 4s(b). -5b Let g(d) = -30d3 + 5d - 5. Let v(z) = 29z3 - 4z + 4. Calculate 4g(i) + 5v(i). 25i3 Let f(r) = 4r. Let y(g) be the first derivative of -g*2/2 - 7. Let m(l) = -l - 26. Let k be m(0). Determine ky(h) - 6f(h). 2h Let u(j) = 2j2 - 1 - 3j*2 + j + 0j*2 + 2. Let c(d) = -12d*2 + 11d + 11. What is -4c(q) + 44u(q)? 4q2 Suppose -2z = 2w - 2, 13 = -w + 2w - 3z. Suppose 4g = 3g + 1, -3y - 26 = -5g. Let p(b) = 2b + 5. Let a(l) = 4l + 9. Determine wa(x) + yp(x). 2x + 1 Let l(o) = -1 + 0 + 2 - 2. Let r = -7 - -6. Let z(s) = s*3 - 6. Give rz(g) + 6l(g). -g3 Let n(p) = 4p*2 + p - 1. Let y be -1((-12)/(-4) + 2). Let t(w) = 7w2 + w - 2. What is yn(b) + 3t(b)? b2 - 2b - 1 Let y(m) = -10m3 + 7m*2 + 7. Let k(l) = -11l*3 + 6l*2 + 6. Calculate -7k(o) + 6y(o). 17o*3 Let z(i) = -4i*2 - i - 3. Let v(d) = -8d*2 - d - 5. Determine 4v(g) - 7z(g). -4g*2 + 3g + 1 Let q(g) = 3g3 - 2g*2 + 4g. Let m(s) = -4s3 + s2 - 3s. Determine -3m(l) - 2q(l). 6l3 + l2 + l Let m(b) = -2 + 6b*3 - 7b*2 + b + 2. Let n = 9 - 16. Let d(k) = 2k*3 - 2k + 2k - 41k*2 + 39k*2. Determine nd(v) + 2*m	{ "pile_set_name": "DM Mathematics" }
or -5/123688371? -5/123688371 Which is greater: -123862521 or -123862522? -123862521 Which is bigger: 296622 or 296618? 296622 Which is bigger: 458302 or 458794? 458794 Is -641291 at least as big as -641289? False Is -12305904 at least as big as -12305904? True Which is bigger: 0 or 27/7024690? 27/7024690 Which is smaller: -3540915 or -3540916? -3540916 Is 1 != -1/3007374? True Is 401531953 > 401531954? False Are -1 and 3970/34111 equal? False Which is bigger: 1/27 or 12.790093? 12.790093 Which is greater: 0 or 194581628? 194581628 Is -86445 >= -86471? True Are -1 and -63/3992417 unequal? True Is -2899 at least as big as 1144? False Is -959347 >= -959680? True Is -113418 less than -113385? True Is -96225 at least -96234? True Which is bigger: 44 or 58277/1347? 44 Which is smaller: 0 or -302/38051? -302/38051 Which is greater: 482 or 168169/348? 168169/348 Is -3177 smaller than -320820/101? True Which is smaller: 59746.277 or -1/4? -1/4 Do -22222.4 and 2.4 have the same value? False Which is greater: -2428/3337 or 0? 0 Which is smaller: -27104222 or -27104226? -27104226 Is 0 bigger than 41/492921? False Which is bigger: -190347/466 or -408? -408 Which is bigger: -488942 or -488935? -488935 Is 0.70375001 > -3? True Which is bigger: 14/143243 or -1? 14/143243 Are -1 and 14/5070459 equal? False Are 113165 and 113092 non-equal? True Is 2848966 >= 2848968? False Which is smaller: -4 or 0.050352? -4 Is 0 less than 2/10691333? True Which is smaller: -1623/10114 or 1? -1623/10114 Is -9786224 greater than or equal to -9786226? True Is -95415 at least as big as -95408? False Is 46/177747 at most 1? True Which is smaller: -57218 or -57155? -57218 Is 131/605 < 178? True Do -2/909 and 1248/43 have the same value? False Which is smaller: -34000 or -34955? -34955 Which is smaller: -6740692 or -91? -6740692 Is 6154/7 greater than -9581? True Which is smaller: 710191 or 710178? 710178 Is -24 greater than 4327777? False Which is bigger: 4/58600567 or -1? 4/58600567 Which is greater: -27622 or -303833/11? -303833/11 Which is greater: -827769 or -0.2? -0.2 Which is greater: 454/2224085 or 0? 454/2224085 Which is bigger: -1/5800727 or 1? 1 Which is smaller: 7/10967723 or -1? -1 Which is smaller: -819126/265 or -3091? -819126/265 Which is greater: 162 or 11600? 11600 Which is smaller: 11 or 2/39508619? 2/39508619 Which is greater: 18893738/15 or 1259582? 18893738/15 Which is smaller: 1449900 or 8/53? 8/53 Which is smaller: -231428354 or 0? -231428354 Which is smaller: 2/43954567 or -1? -1 Which is smaller: -8783577 or -8783578? -8783578 Is -1 greater than 61/434235? False Is 0 greater than or equal to -23953488? True Which is smaller: -10253 or -10599? -10599 Which is smaller: 4394182 or 107? 107 Which is smaller: 29181 or 29173? 29173 Is 0 greater than or equal to -511/344478? True Which is smaller: 5086878/11 or 462443? 462443 Which is smaller: 33552 or 171? 171 Which is smaller: 153593/526 or 291? 291 Which is smaller: -1535557 or -1535556? -1535557 Is 59 equal to -873778? False Is 0 > -1979833/12? True Do -4826.5326 and -2 have the same value? False Which is smaller: -2098/62235 or 0? -2098/62235 Which is bigger: -443362702 or -443362701? -443362701 Which is bigger: -9500 or 1871? 1871 Is -21629129 greater than or equal to -21629128? False Which is bigger: 21943/2074 or 11? 11 Is 957 at least 454866/475? False Which is bigger: 45 or 51963/1133? 51963/1133 Which is bigger: 663523 or 663536? 663536 Which is greater: -891954 or -891953? -891953 Which is smaller: -30518 or -30657? -30657 Which is greater: -7153/1424 or -4? -4 Is -398068 != -399825? True Which is smaller: -1341100 or -1341082? -1341100 Is 1385/10899 equal to 1? False Which is greater: -1/2 or 4745596? 4745596 Is 301604890 at most 301604890? True Is 1 < -0.03056147? False Which is bigger: 492/91 or 1/376? 492/91 Which is smaller: 7027408 or 7027416? 7027408 Which is bigger: 491/10 or 4625? 4625 Is 21758843 at most as big as -2? False Do 376727 and -602 have different values? True Is -17588 bigger than -17548? False Which is smaller: -1196 or 3453? -1196 Is -1 greater than -2/605725973? False Is -6089/157160 >= 0? False Are -178737 and -178731 equal? False Is 24.45 bigger than 7016? False Is 635780868/13 > 48906222? False Which is smaller: -458814/157 or -2921? -458814/157 Which is bigger: 87/224318 or 0? 87/224318 Which is greater: 22456 or 19677? 22456 Which is smaller: -1764 or -474778? -474778 Which is smaller: 0 or 1/371773544? 0 Which is smaller: 7059392 or 21178172/3? 21178172/3 Which is greater: 1 or -69/622823? 1 Is -0.2 less than 0.44525312? True Which is smaller: -45 or 160/669? -45 Which is smaller: 8235 or 51/5? 51/5 Which is smaller: 4740256 or 2? 2 Which is smaller: 27 or -1646055? -1646055 Is 240 != -1/20105? True Which is smaller: 8 or 3205/394? 8 Is 1 less than or equal to 2/101657853? False Which is bigger: 7462/7447 or 2? 2 Is -4792/1843 at most -2? True Which is smaller: -457572 or -457547? -457572 Which is greater: -254 or -1192? -254 Is -615 greater than -63395/103? True Is -2313810 < -2313805? True Is -1/4 at most -26357574/313? False Is -72/17 at most as big as -1375170? False Which is bigger: 1619187/23 or 70400? 70400 Which is smaller: 0 or -12/2462165? -12/2462165 Which is greater: -1439178 or -32? -32 Is 1 < 18/528119? False Which is smaller: -6428980 or -6428976? -6428980 Which is smaller: -21 or 483166? -21 Which is bigger: 3/348729185 or 1? 1 Is 0.89954 at most -0.61? False Is -43270971 smaller than -43270971? False Which is bigger: -2/47 or 6904082? 6904082 Which is smaller: -1 or 187362? -1 Is 1/176228 less than 0? False Is 332/14803 at most as big as 0? False Which is smaller: -7128 or -14255? -14255 Which is smaller: -59.86 or 341/4? -59.86 Which is smaller: -2241.5584 or 5/3? -2241.5584 Which is smaller: -41/16722533 or -1? -1 Are -1003/322381 and -1 non-equal? True Are -1275/2 and 1044 non-equal? True Is -3 smaller than -459418? False Do 1212 and -7820 have the same value? False Is -211034 at least as big as -211092? True Is -0.28 at least 921445? False Which is greater: 52817 or 52966? 52966 Are 3929558/135 and 29107 nonequal? True Which is greater: -4237241/25 or -169490? -4237241/25 Is 758/82445 less than 0? False Which is smaller: -1 or 4/1141417433? -1 Is 0 at least -1531/13551? True Are 65291 and 64833 equal? False Is -685386 less than -8/13? True Do 0 and 21/52788382 have the same value? False Which is bigger: 5/2732 or 3/4016? 5/2732 Does -3/345816937 = 0? False Do -358/3 and -475/186 have the same value? False Which is smaller: 116468 or 116465? 116465 Which is greater: 57581/106 or 544? 544 Is 1 at least as big as 5110/74867? True Is 2515099 < 67907710/27? True Which is smaller: -9983651 or -9983654? -9983654 Which is greater: 39/191617 or 0? 39/191617 Is 134 greater than or equal to -10658? True Which is greater: 7530129 or 22590388/3? 22590388/3 Which is smaller: 1 or -0.455578? -0.455578 Which is bigger: -113111 or -791781/7? -113111 Is 1/119 <= -43.05182? False Which is bigger: -108500/1523 or -72? -108500/1523 Do -8249790 and -8249796 have different values? True Is -104 smaller than -121238/1161? False Is 1/86750459 smaller than 1? True Which is smaller: 2900 or 13600? 2900 Is -530496 smaller than -530528? False Which is smaller: -1/310745771 or 0? -1/310745771 Which is bigger: 3060086 or 3060098? 3060098 Is -10014559 > -10014559? False Is 2213571 bigger than 1/6? True Is 4.108579 at least as big as -0.1? True Which is smaller: -1884694 or -1884701? -1884701 Which is smaller: -1 or -164/94211? -1 Is 399636 smaller than 41/15? False Which is smaller: 1525 or -2751? -2751 Is 0.6 at most -116989.5? False Which is smaller: -388014 or 277? -388014 Which is smaller: 623.53133 or 20? 20 Is 9695030 bigger than 9695030? False Which is bigger: 2/786049261 or 0? 2/786049261 Which is smaller: 1.2 or -7374887? -7374887 Are 0 and 3086/6839 non-equal? True Is 0.36304922 < -0.02? False Which is smaller: 0 or 1191/2422? 0 Which is smaller: 61 or -4.04224? -4.04224 Which is bigger: 0 or 77.65758? 77.65758 Are -690444 and -689978 equal? False Which is smaller: 13060 or 643? 643 Is -160040 greater than -1082? False Do 2116 and 124930/59 have the same value? False	{ "pile_set_name": "DM Mathematics" }
est value in -0.04, -9, -18, 0.0039? 0.0039 Which is the third smallest value? (a) -141 (b) -0.5 (c) -1/984 c Which is the fifth biggest value? (a) -4 (b) 0.074 (c) -9/5 (d) 2/7 (e) -0.3 a Which is the third biggest value? (a) -5 (b) 0.2 (c) 630 (d) 2 (e) 0.033 (f) -1/2 b What is the second smallest value in -141, -3, 2/13, 4, 3/8? -3 What is the third biggest value in 59/57, 5, 3, -1, -1/3? 59/57 What is the smallest value in -3/7, -43.81, -14, 4? -43.81 What is the smallest value in -2, -3/4, -0.03, 20, 5, -9? -9 Which is the second smallest value? (a) 22 (b) 57 (c) 9 a What is the fifth smallest value in -1, 0.0023, 2, 5, 0? 5 Which is the biggest value? (a) -0.02 (b) 11449 (c) -2/15 b Which is the third biggest value? (a) -0.14 (b) 1689 (c) -2/9 (d) 2/11 a Which is the biggest value? (a) 8 (b) 0.05 (c) -5 (d) 4/3 (e) 5/2 (f) 66 f What is the smallest value in -23, -7, 537? -23 What is the second smallest value in 0.8, 16, -11, -1, 6? -1 What is the fourth biggest value in -3/8, 3/8, -12/5, 2/1739, -1/6, -0.2? -0.2 What is the fourth smallest value in -0.4, -3, -0.01, -5, -1/3? -1/3 What is the fourth biggest value in -14/25, 14, -2/17, 3/4? -14/25 Which is the third smallest value? (a) -13 (b) -48/7 (c) 106 (d) -2 d Which is the fifth biggest value? (a) -1 (b) 0 (c) 33 (d) -0.17 (e) 0.1 a What is the third smallest value in -107, -14910, -1/4? -1/4 What is the fourth biggest value in 0.09, 1/11, 2/7, -9/44? -9/44 Which is the second biggest value? (a) 0.08 (b) 5 (c) -10 (d) 6/19 (e) -3 d What is the third smallest value in 1.1476, -0.5, -2/9, -16? -2/9 What is the fifth biggest value in 1, -2/3, 1.98, -1, -25? -25 What is the fifth smallest value in -3/5, -1.37, 1, 115, 3? 115 What is the third smallest value in 0.35, 21/29, 10? 10 What is the fifth biggest value in 5, -1/15, 2, -15, 3, -0.01? -1/15 What is the second biggest value in -0.2, 340/11, 13? 13 Which is the fourth biggest value? (a) -0.5 (b) -0.01 (c) 4 (d) -3 (e) -30 (f) -0.1 a What is the third smallest value in 5, -16.7, -2/9, -0.5, -1, -4? -1 Which is the third biggest value? (a) -1 (b) -4 (c) 1/10202 (d) 1/3 (e) -2 a What is the third biggest value in 5/11, 4, 0.4, -0.056, 1/14? 0.4 What is the second smallest value in 1, 0, 234, 5, 0.4? 0.4 What is the third biggest value in 0.17, -141, 31/6? -141 What is the third biggest value in -16, 0.299, 5, 1, -0.2, -4/3? 0.299 What is the third biggest value in -0.1, -0.08, -17/5, 0.086? -0.1 Which is the fifth biggest value? (a) 8/7 (b) 0.2 (c) 5 (d) 2/31 (e) -0.5 e What is the third smallest value in 2044, -1/5, 5, -32? 5 What is the smallest value in -202, -101, 3/4? -202 What is the smallest value in -0.2, 2, -2, -150, 0.2? -150 What is the fifth smallest value in 4, -1/588, -4, 0.06, 1, -1/5? 1 Which is the third biggest value? (a) 157 (b) -2 (c) 61 b What is the second biggest value in 0.2, -524, -296? -296 Which is the fourth biggest value? (a) -2/35 (b) -6 (c) 0.9 (d) -0.06 (e) -4 e What is the fifth smallest value in 788.3, -0.2, -2, -5, 2? 788.3 What is the fourth biggest value in 2/5, 4, 0.2, 64/7, -3? 0.2 What is the third biggest value in -1/2, -1160, 0.02? -1160 Which is the fifth biggest value? (a) 5.26 (b) -0.2 (c) 4 (d) -3/7 (e) -0.5 e Which is the third smallest value? (a) 14 (b) 0.5 (c) -9.768 a Which is the second smallest value? (a) 4 (b) 2/33 (c) -2359 b Which is the second smallest value? (a) 160 (b) 0 (c) 83 c Which is the fourth biggest value? (a) 0.3 (b) -2/13 (c) 1/2 (d) 2/23 (e) -1185 b Which is the second smallest value? (a) 5 (b) 1/6 (c) 4137 a What is the second biggest value in -3, -2, -0.05, 1/658? -0.05 What is the third biggest value in 2/9, -2/25, -2, -2/41, 13, 0.5? 2/9 Which is the second smallest value? (a) 2/5 (b) 0 (c) -0.11 (d) -2/11 (e) -0.155 e Which is the smallest value? (a) 4 (b) 4/3 (c) 0 (d) -7 d Which is the fourth smallest value? (a) 0.1 (b) -1 (c) -2/13 (d) -13/9250 (e) -0.2 d Which is the fifth smallest value? (a) 5 (b) -0.2 (c) 4 (d) 6/7 (e) -171.63 a What is the biggest value in 0.075, 2/595, 3/8, 0.5? 0.5 What is the smallest value in -9/11, 0.2, -2, -1/2, 24? -2 Which is the second biggest value? (a) -1/7 (b) 0.1 (c) -1/3 (d) -5 (e) -34 a Which is the third biggest value? (a) 2/13 (b) -0.2 (c) 140 (d) -24/7 (e) -0.08 e What is the sixth smallest value in -0.1, -5, -8/5, -6, -5/3, 2? 2 Which is the third biggest value? (a) 0.009 (b) 6 (c) -5/19 (d) 0.2 (e) 4 d What is the biggest value in -2, 0, 2, -6142.56? 2 What is the second smallest value in 0.8, 0.1, 0.3, 3/4? 0.3 What is the fourth biggest value in 9, 0, 2/13, -1, 1/3, 26.1? 2/13 What is the biggest value in 0.3, -6.2, 2140? 2140 What is the second smallest value in -25, 9/2, -4, 5, 3/8? -4 What is the fourth biggest value in -125.5, -3, -2/11, 2? -125.5 Which is the biggest value? (a) -2 (b) -0.4 (c) -3 (d) 4 (e) -48/31 (f) -1/7 d Which is the second biggest value? (a) 5 (b) -2/7 (c) 0.049 (d) 1/14 (e) -0.1 (f) -2 d Which is the second biggest value? (a) 0.1 (b) 0.4 (c) 43 (d) 3 (e) -1 (f) 4 f Which is the second smallest value? (a) 6 (b) 3 (c) -5 (d) -497 c Which is the fourth smallest value? (a) 6/5 (b) 4 (c) -0.1 (d) -0.05 (e) -80 (f) -1 d Which is the smallest value? (a) -0.2 (b) -1675 (c) 2 (d) -44 b What is the fifth smallest value in -0.4, 4, 194/3, -2, -4? 194/3 What is the third smallest value in 3, -28, -13, -8/13? -8/13 What is the third smallest value in -4, -8589, 1? 1 Which is the fifth biggest value? (a) -0.016 (b) 13 (c) 70 (d) 4/5 (e) -1 (f) -4 e What is the third biggest value in -1/2, 1480, 1/2, -0.02, -1? -0.02 Which is the third biggest value? (a) -2/7 (b) -4 (c) 13497 (d) -2 d Which is the sixth biggest value? (a) 3 (b) -0.1 (c) 2/877 (d) 0.4 (e) 16 (f) -5 f Which is the sixth biggest value? (a) -0.2 (b) -9/5 (c) -0.1 (d) 14 (e) 2 (f) -2/11 b Which is the biggest value? (a) 1/11 (b) -0.063 (c) -5/2 (d) -4 a Which is the biggest value? (a) 1 (b) 93 (c) -66 (d) -0.4 b What is the second biggest value in -2/7, 15816, 2/15? 2/15 What is the third smallest value in -283.4, -1.05, -5? -1.05 Which is the fourth biggest value? (a) -137/4 (b) 0.4 (c) -0.04 (d) -0.4 (e) 2/9 d Which is the fourth smallest value? (a) 59 (b) -0.3 (c) -13 (d) 0 (e) 1 (f) 14 e Which is the fifth biggest value? (a) -5.7 (b) -4 (c) -2 (d) 28 (e) 4 a Which is the smallest value? (a) -443 (b) 2 (c) 17/3 (d) 0.5 a Which is the fifth biggest value? (a) 2/3 (b) 241 (c) 2/11 (d) 0 (e) 3 d Which is the second biggest value? (a) 1 (b) -3 (c) 1532.69 (d) -0.1 a What is the fourth smallest value in -9/2, 3, -2703, -0.2? 3 What is the second smallest value in 4/23, -5, -38, 6? -5 Which is the second smallest value? (a) -2 (b) -19 (c) 97 a What is the fifth biggest value in -2, 4, -4, 0.08, 2/19? -4 What is the biggest value in -2, -230/7, -91? -2 Which is the second biggest value? (a) -5 (b) -159/4 (c) 76.2 a Which is the biggest value? (a) 1/43 (b) -62 (c) -0.4 (d) 6 d What is the smallest value in -0.1, -7, 3/5, -67? -67 What is the second smallest value in -1.8535, -0.1, 15? -0.1 Which is the second smallest value? (a) 200/7 (b) -1 (c) 0.4 (d) -0.1 (e) 3 (f) -36 b Which is the third smallest value? (a) 35 (b) -0.1 (c) 0.0112 a What is the biggest value in -0.162, -3, 14, 50? 50 What is the second smallest value in 1/4, -152, -0.2, 4? -0.2 What is the sixth biggest value in -0.1, 9/2887, 2, -0.5, 1, -0.3? -0.5 Which is the second smallest value? (a) -53/4 (b) -17737 (c) -0.3 a What is the second biggest value in -5, -4, 1, -0.2, -174? -0.2 Which is the second smallest value? (a) 2 (b) 5057 (c) 0.04 a What is the biggest value in 31, -7, -0.2, 0, -1, -6? 31 Which is the smallest value? (a) 50 (b) -8 (c) -63 (d) 3/7 c What is the smallest value in 3/2, -52/9, -2/11, -0.4? -52/9 Which is the third smallest value? (a) 5 (b) -2 (c) -91 (d) 0.01 d Which is the biggest value? (a) 368 (b) -19 (c) -1/3 a Which is the second smallest value? (a) -13/54 (b) -7 (c) -0.2 (d) -3/2 (e) 1.11 d Which i	{ "pile_set_name": "DM Mathematics" }
What is the value of 3-1 - 594/(-231)? -3/7 What is 2 - -203/(-33)? 2/11 What is (-16)/(-56)14 - 1? 3 What is (17/12)/17 - 2/8? -1/6 375/(-55) - 7/(-1) 2/11 What is (588/580 - 1)(57 + -62)? -2/29 What is the value of 2/(-65)15/(-3)? 2/13 Calculate -10 + (4/(-7) - 125/(-35)). -7 Evaluate (0 - 4/(-96))(15 - 6). 3/8 6 + (-26)/(-65)(-95)/6 -1/3 128/48 - 29/12 1/4 -5(-6 - 34/(-6)) 5/3 Calculate (-1)/5 - 6/(-30). 0 Evaluate 1/13(-72)/(-36). 2/13 Evaluate (-2)/6 - (-4)/12. 0 Evaluate 2/22-11(-5)/2. 5/2 What is (-12)/(-14) - 42/49? 0 What is 56/(-2)((-1200)/(-112) + -11)? 8 ((-1)/13)/(1/2) -2/13 What is the value of (-34)/7 + 49 + -44? 1/7 Calculate (4/(-10))/(-2) - 12/10. -1 What is 64/48(-2 - (-34)/16)? 1/6 (-2)/8 - (-22)/(-40) -4/5 348/4352/(-2) -4/5 Evaluate -8 + 1533/119 + (-20)/4. -2/17 Evaluate (-21)/28-7 - 6. -3/4 (6624/351)/23 - 2/3 2/13 Evaluate 345/5755/(-2)1. -3/2 What is (-1147)/518 + (-4)/14? -5/2 1 + (11 - 2)/(3/(-2)) -5 Calculate (0 - (-38)/(-7)) + 60/(-105). -6 Calculate -1 + 0 + -6 + 0/(-58). -7 What is the value of ((-55)/33 + 5)(-6)/25? -4/5 What is (-435/(-42))/(-14)? -5/6 (10/24)/((-55)/(-88)) 2/3 Calculate -7 + -1(-8 + 5). -4 What is ((-486)/1512)/((-6)/(-7))? -3/8 Evaluate ((-8)/8)/(4 + -6). 1/2 What is (12/14)/((-2)/(12 - -2))? -6 What is -8 + -5 + 245/19? -2/19 Calculate (10 - -5)/((-3)/6-6). 5 4 + 9/(-3) - (-28)/(-35) 1/5 Calculate (6/8)/(243/(-72)). -2/9 Evaluate (64/(-14))/1 + 76/19. -4/7 Calculate (3 + 258/(-90))/(8/12). 1/5 Evaluate ((-3)/(-20))/(495/(-44) - -9). -1/15 Evaluate 0 - (35/30)/(-7). 1/6 Evaluate (6 + -8)(-1)/(-2). -1 What is the value of 3(-2)/165(-18 + 23)? -2/11 Evaluate 10/3(-96)/(-64). 5 Evaluate (5/(-42))/5 - 8/56. -1/6 What is the value of 2/(5 + 44/(-12))? 3/2 Evaluate ((-668)/501)/((-8)/(-18)). -3 Calculate (6/(-3))/(-11 - 36/(-3)). -2 What is (5 + (-74)/14)14/(-10)? 2/5 What is the value of (16/(-340))/(2/5)? -2/17 What is (10(-3)/(-18))/(20/24)? 2 10/(-4) + -7 + (-77)/(-14) -4 1/336 - (-994)/462 7/3 1 - (33/(-110) - (-16)/20) 1/2 What is the value of -2(-5)/(-30)0/2? 0 What is the value of (-6 - 66/(-12))/(14/12)? -3/7 What is the value of ((-8)/10)/((-168)/20)? 2/21 What is the value of (-2 - -2)/1 - 4/(-18)? 2/9 ((-2)/(-7))/(96/420) 5/4 What is 3/(-4) - (-2 + 1)? 1/4 Calculate ((-42)/56)/(3/(-2))6. 3 Calculate 10/5(4 + (-52)/8). -5 Evaluate (5/10 + -1)6. -3 6/(-9)(-4)/6 4/9 What is the value of -6-42/(-48)? -1 Evaluate (20/(-70))/((-12)/(-252)). -6 Calculate -1 + 2 + (-3 - -8). 6 Evaluate ((-56)/63 - 0)/((-4)/18). 4 (-7 - (5 - 4)) + 7 -1 Evaluate (-4)/22 - 42/11 - 2. -6 Evaluate ((-112)/(-35) + -3)25. 5 What is the value of 1 + (-27)/21 - (-64)/77? 6/11 ((-70)/21)/((-8)/(-12)) -5 What is the value of (-1 + 55/(-20))2/(-6)? 5/4 What is (7 + 46/(-6))9/2? -3 What is (2/7)/(57/133)? 2/3 What is (-52)/(-18) - (15 - 0)/5? -1/9 Evaluate (-279)/1248/6. -3 Calculate (150/(-26))/5 + 1. -2/13 Evaluate ((-105)/(-10) - 12)4. -6 What is ((-4)/8)/(-10 - -12)? -1/4 Calculate 0/(-14) + (5 - 0). 5 Evaluate (13/117)/((-5)/6). -2/15 What is (0 - (1 + -6) - -2)-1? -7 Calculate (-2)/(-9) + (-340)/180-2. 4 What is the value of 130/52014/(-2)? -7/4 0 - -2 - (-5)/5 3 What is the value of 12/51(-4)/8? -2/17 Evaluate 1/62484/(-242). -2/3 (-3)/6-2 - (-1 - -1) 1 What is 77/1476 - 1/7? 3 (-2)/(-5) - (8 - (-192)/(-20)) 2 What is ((-6)/(-99))/(16/12 + -1)? 2/11 Calculate (6/16 + (-403)/(-248))/(-1). -2 What is (33/154)/(24/80)? 5/7 What is 7/(140/(-16)) + (-19)/(-5)? 3 Evaluate (4 + (-310)/78)/(2/(-12)). -2/13 What is (3/(5 + 4))/(-3 - -2)? -1/3 What is ((-8)/10)/(4/(-10))? 2 Calculate -3 - 32/(-4)1. 5 What is 1/1(4 - 3)? 1 What is 4/(-3)(-3)/2? 2 (2 - 22/12)/((-5)/(-20)) 2/3 Calculate 91/52 - (-1)/4. 2 Evaluate 60/52 + (-14)/91. 1 What is the value of (10/4)/((-1)/2)? -5 Evaluate 0(2-2 + (-9)/(-3)). 0 Calculate 214/30 + (-134)/1005. 7 Calculate -75 + 85 + (-37)/4. 3/4 What is the value of (30/(-45))/(11/3)? -2/11 What is the value of ((-6)/(-10))/((-176)/80)? -3/11 Evaluate (-11 - -11) + 3(-4)/(-30). 2/5 Calculate (-24)/(-20)(-5)/(-2). 3 What is 3/(-4) - (-12943)/1204? 10 (-12)/3124 + 40/(-78) -2/3 Evaluate (-25)/(-35)(-34)/(-85). 2/7 567/405 + 1/(-1) 2/5 Calculate ((-10)/25)/(19/(-25) - -1). -5/3 Evaluate -20(342/30 - 11). -8 What is the value of -1 - -5(-3)/30? -3/2 What is the value of (-1 - 4)(-20 + 6)/28? 5/2 Calculate 4/10 - (17 + 236/(-10)). 7 What is (2 - 86/40)155/186? -1/8 Evaluate 100/50 + (2 - 3) + 7. 8 What is ((-4)/14)/((-64)/56)? 1/4 (-2)/6301/2 -5 What is the value of (20/90)/(80/90)? 1/4 What is (-1 + 4)(15/(-9) + 3)? 4 -2 - (9/90 + -2) -1/10 What is the value of (240/600)/(1/((-10)/(-4)))? 1 What is the value of (-5)/(-45)(-12)/(-8)2? 1/3 What is the value of 11 + 2188/(-32)? -3/4 4/10 + (-4)/(-20) 3/5 What is the value of -62/(-15)(-80)/(-32)? 2 Calculate (-880)/120 + 8/6. -6 (36/8 - 6)/(-1 + -5) 1/4 What is the value of -1(2 + 12)18/(-63)? 4 (-13)/(-78)(-1 - (-3 - -5)) -1/2 Calculate (-351)/51 + 1 - 108/918. -6 Calculate -12((-20)/6 - 1 - -5). -8 Calculate 3031/9526(-8)/(-14)-1. -2/11 (-2)/2 - -5 - 0 4 Calculate (-496)/(-176) - (-2 + 5). -2/11 What is the value of (-44)/(-9) + (8 - -77)/(-17)? -1/9 What is the value of ((-36)/264)/(3/4)? -2/11 Calculate 1/4 + (-891)/(-132) + -15. -8 2/(7 + -1)6/17 2/17 What is the value of (-158 - -156)(-6)/(-4)? -3 Calculate 336/66 - (-12)/(-132). 5 (2/(-6))/((-14)/(-84)) -2 1(-4 - 0) + -1 + 2 -3 100/22 - (104 - 100) 6/11 Calculate 117/(-15) - (-33)/(-165). -8 Evaluate 43/(-36)-15. 5 What is (-42)/(-3) + (9 - (6 + 7))? 10 What is 2 + 6/(-3) - 2/(-18)? 1/9 Calculate ((-2)/12-2)/((-5)/(-90)). 6 Evaluate 8 + -5 - (7/(-1))/(-7). 2 What is 27/6 + 96/(-24)? 1/2 Evaluate -9 + 430/50 - 54/(-10). 5 What is the value of (-2)/17 + 660/(-170)? -4 What is the value of ((-7)/(-28))/((-4)/((-16)/(-5)))? -1/5 Calculate (0 + 4)/4 + 4. 5 What is the value of -1 - ((-4)/(-2) - (-676)/(-234))? -1/9 What is the value of (-28)/(-12) - ((6 - 2) + -2)? 1/3 Calculate (-12)/8 - -3 - (-5)/10. 2 Calculate (-1)/((-7)/(-3)) + (-24)/(-7). 3 What is the value of (-4 + 68/12)4/(-10)? -2/3 What is the value of (-5)/(43/12)? -5 Calculate 3/2 - (-679)/(-582). 1/3 125/(-100) + (434/(-40))/(-7) 3/10 Evaluate -21 + 15 + -2 + 20/3. -4/3 Calculate (-3)/5(-2)/(-6). -1/5 (195/104 - 1)-8 -7 ((-13)/(260/50))/(-1) 5/2 1/(-1) - (-15)/25 -2/5 Evaluate (-57)/(-144)4 + (-30)/40. 5/6 Calculate ((-5)/(-2))/(236/24 - 9). 3 What is (-5)/2(-29)/(-145)? -1/2 What is 4/5(57/(-18) + 4)? 2/3 Calculate (-2)/4 - 11/66. -2/3 Calculate (8 + 4)/4 - 125/40. -1/8 (-7)/(-28) + (-1)/(3 + -2) -3/4 Evaluate -4 - (-2 + (-65)/(-55) + -3). -2/11 Calculate 759/(-132) + (-1)/4. -6 What is the value of (-1)/2 - 1/(-6)? -1/3 (-4)/(-58) - 1053/3915 -1/5 Evaluate (-36)/(-8) + -5 - 13/(-18). 2/9 What is the value of 18/(-324) + (-185)/(-90)? 2 Evaluate (-31)/((-1705)/(-22))10/2. -2 What is 8/14461? 1/3 Evaluate -10 + 225/20 - 106/72. -2/9 What is 2/5 - 7/35? 1/5 What is the value of (-1 - (-11 - -2)) + (-4 - 0)? 4 Calculate 10/(-6) - -104/(-120). -2 What is the value of (-1)/(-5) + (-75)/(-875)? 2/7 2 + 1 + 1 + -4 0 Calculate (1 + (-15)/6)(-2)/(-12). -1/4 Evaluate 2/(-1) - (0 - 48/30). -2/5 What is (-1264)/176 - -1(-2)/(-11)? -7 Evaluate (-1)/(-1) + (-3)/((-30)/(-14)). -2/5 (-4 + (-85)/(-20))/(2/8) 1 Calculate 3 - (-100)/(-30)(-30)/(-36). 2/9 Calculate -2(-5)/(-500)5-2. 1/5 Calculate 11/((-77)/(-56)) - 6. 2 Calculate (7/(42/8))/(4/(-6)). -2 Evaluate 22/(-20) - (-208)/130. 1/2 What is the value of (1/(-6))/((-2277)/(-126) - 18)? -7/3 (5 - (1 - -7)) + 4 1 Evaluate (0 - 4) + 12/4. -1 (-75)/(-65) - 3 - 8/52 -2 What is 3/(-1) + 5 - (-16)/(-10)? 2/5 Evaluate 64/(-160) + 6/15. 1/4 What is the value of (-9 + 528/64)/((-2)/(-16))? -6 What is the value of (6 + -20)(35/(-10) + 3)? 7 80/50 - (-60)/25 4 Calculate 10 + (-3 - ((-1)/1 + 2)). 6 What is the value of 2/4-324/180? -1/5 Calculate (85/25 - 4) + 1. 2/5 What is 1/3((8 - 8) + 0)? 0 What is (325/(-15))/(-5) + -5? -2/3 (-620)/186(-2)/10 2/3 4 + -5 + 4/(-8)-8 3 What is the value of ((-5)/(-35))/(6/21)? 1/2 Evaluate -14 - ((-1)/1 - -2). -5 Calculate -17 + 29 + 14/(-2). 5 (4/42)/(40/120) 2/7 What is (-	{ "pile_set_name": "DM Mathematics" }
+ dj2 and give b. 1 Express (11 - 10m - 11)(-2m3 + m3 + 0m3) - 2m*4 + 4m*4 + 0m*4 in the form w + ym*2 + vm + zm3 + nm*4 and give n. 12 Rearrange (0w*4 + 0w*4 + 4w*4)(0 - 5 + 4)(1 - 3 + 1) to vw*2 + lw + iw3 + ow*4 + t and give o. 4 Rearrange 8j + 36j - 6j to the form o + nj and give n. 38 Rearrange -p - p4 - 6p*2 - 1 + 2p*4 + 3p + 8p2 to ip*3 + bp*4 + xp*2 + wp + u and give x. 2 Rearrange 0s2 - 7s*2 - 17s2 + s2 to the form vs + ws*2 + x and give w. -23 Express -3b4 + b2 + 3b - 1 + 5b2 + b4 - 5b2 as sb + m + ub2 + kb*4 + qb*3 and give u. 1 Rearrange (0g*2 + 2g2 + g2)((0 + 2g + 0)(-4 + 4 + 2) + g + g - 3g) to the form og + kg*3 + hg*2 + r and give k. 9 Rearrange (-4 + 4 + a)(-22 + 1 + 9)(0 + 2 - 4) to w + da and give d. 24 Express -3a2 + 2a*2 + 2a*2 + (-a - a + 4a)(-a + 5a - 5a) as c + ka*2 + xa and give k. -1 Express (-m - m + 0m)(2 + 0 - 3) + 506 + 500 + 55m - 1006 in the form i + um and give u. 57 Express -l*3 - 3 + 2 + 2l - 3l + 0 in the form dl*3 + fl*2 + k + gl and give k. -1 Rearrange 2b - 2b + 2b + (-9 - 3 - 43)(3b - 2b + 0b) to f + tb and give t. -53 Rearrange 2w - 5w + 288 - 6w - 285 to h + gw and give h. 3 Rearrange (-2 + 2 + 2)(0m + m - 2m) - 13m - 6m + 6m + (-5 + 2 + 2)(-3m + 0m + m) + m - 2m + 3m to the form um + w and give u. -11 Rearrange -2 + 0f3 + 2f*3 + 3 + 7f*2 - f - 2f*2 to of*3 + qf*2 + mf + p and give q. 5 Express (-6 - 2 + 3 - 2a)(-1 + 3 + 1) in the form ua + w and give u. -6 Rearrange (-2 + 3 + 0 - 6)(15 - 15 + 11h) to xh + v and give x. -55 Express 0g - g - 5g*3 + 4g*3 as ng*2 + u + pg + sg3 and give s. -1 Express -7s - s - s - 4s as m + us and give u. -13 Express -99 + 99 - 53b as v + nb and give n. -53 Express 37j + 12 - 9 - 3 as dj + i and give d. 37 Rearrange 13n + 3n*2 - 31n + 17n - 1 + 2n*3 to ln*3 + dn*2 + r + on and give d. 3 Express -24u4 - 6u*4 + 8u*4 + (-2u + u*4 + 2u)(1 - 2 - 1) as o + qu*3 + vu*2 + zu + xu4 and give x. -24 Rearrange (-n + 5 - 5)(-1 - 1 - 1 + (-2 + 1 + 0)(0 + 1 + 0) + 0 + 3 - 9) to ln + x and give l. 10 Rearrange (0 + 3 - 4)(22t + 10t - 13t) to the form zt + v and give z. -19 Rearrange -1 - 20o*4 - 2o*2 + 36o4 - o3 - 15o4 + 2o to the form go + zo*2 + no*3 + io*4 + u and give i. 1 Express (3 + 1 - 1 + (-1 + 4 - 1)(3 - 2 - 3))(q4 - 4q*4 + 0q*4) as kq + a + cq4 + wq*2 + yq*3 and give c. 3 Rearrange (-11o + 5o + 4o - 18)(4 - 1 + 0) to jo + v and give j. -6 Express (-6n + 4n + n)(n + 5 - 5 - 3) in the form m + dn*2 + jn and give d. -1 Express -55b4 + 1 + 54b*4 + 2b*3 + 2 + 10b*2 - 1 as jb*4 + s + pb + wb3 + lb*2 and give j. -1 Rearrange (-3c - 9c + 0c)(1 - 4c*2 - 1)(2 - 2 + 1) to the form jc2 + t + ac*3 + gc and give g. 0 Rearrange 0 - 2l + 0 - l + 3l - 4l + (4 + 0 - 1)(-l - 1 + 1) - 3l + 2l + 3l to the form ml + b and give m. -5 Express -4u2 + u2 - 4u*3 - 3u + 3u + 2u in the form pu2 + yu + vu3 + j and give j. 0 Rearrange -3s + 3s - 6s - 3s2 to r + cs + qs2 and give q. -3 Rearrange (124t*4 - 65t*4 - 91t*4)(5 - 2 - 2) to ot2 + ut*4 + xt*3 + rt + m and give u. -32 Express 4d2 - 5d*2 - 4d*2 as td + a + ud2 and give u. -5 Express -4t*2 - 5t*2 + 0t2 + t3 - 2t2 as zt*3 + d + rt + ot2 and give z. 1 Rearrange 25y - 5y - 6y + 11y to the form oy + p and give o. 25 Rearrange -1 - 17c - 4c + 1 to lc + b and give l. -21 Express 5 + 4 - 4y4 - y3 - 12 in the form vy3 + ay + fy4 + i + sy*2 and give f. -4 Rearrange -12z*2 - 5z*4 + 5z*2 + z + 4z*2 to the form oz + kz3 + cz*2 + b + iz*4 and give i. -5 Rearrange 2m2 + m4 - 3m4 - 1 - 28m*3 + 30m*3 to nm*3 + dm*4 + bm + um2 + g and give g. -1 Rearrange n + 0n - 3n + (2 + 3n - 2)(4 - 3 - 4) + 2 - 2 - 2n + 0n + 5n - 4n to the form i + ln and give l. -12 Rearrange -2x2 - 17 - 26 + 34 to the form zx + d + wx2 and give w. -2 Express -2d*2 - 3 + 0d*2 + 6 in the form x + gd*2 + id and give x. 3 Rearrange -4p3 - 4p*3 + 5p*3 - 4p - 9p3 to the form x + yp*3 + zp + hp2 and give y. -12 Express (0 - 2 + 0)(-60x - 53x + 35x) as lx + y and give y. 0 Rearrange (5 + 2 - 3)(24 + w - 15 - 16) to the form iw + b and give b. -28 Express 24 - 10 + 15o - 14 as c + qo and give q. 15 Express -9w - 1 + 7w2 - w3 - 7w2 + 6 as z + uw*3 + yw + ow2 and give u. -1 Express -17 + 145w + 34 - 17 in the form u + qw and give q. 145 Express 3t*2 + 16t*3 - 5t*2 - 14t*3 + 2t - 1 as st + pt*3 + w + yt*2 and give w. -1 Rearrange 2s*2 + 4s*3 + 3s*2 - 2s*2 to the form vs + ts2 + ps*3 + i and give p. 4 Rearrange (5u + 2u - 5u)(42u - 83u - 25 + 43u) to the form yu + mu*2 + s and give m. 4 Rearrange -5q*4 + 5q*2 + 2q*3 - 2 - 15q - q*4 + 16q + 4q4 to the form hq + i + bq3 + vq*2 + aq*4 and give v. 5 Rearrange 10s - 185 + 185 to the form o + cs and give c. 10 Rearrange (-6 - 2g + 3 + 1)(222g - 222g + g2 + 79) to xg + tg2 + o + pg*3 and give t. -2 Rearrange 2 - 4k*2 + 5 + 6k*2 to g + bk + pk2 and give g. 7 Rearrange (-2i - i + i + (1 + 3 - 5)(i + 2i - i) - i + 0i - i)(-i + i - i*3) to the form ci + w + oi3 + di*2 + ni*4 and give n. 6 Rearrange 2b - 6b - 3b to xb + w and give x. -7 Express (2r - 3 + 3 + (-3 + 0 + 2)(1 - 1 - r))(5 - 2 + 0)(0 + 1 + 0)(-50 + 108 - 94) in the form t + kr and give k. -324 Express (3k*3 - 2k3 + k3)(-29 + 7k + 29) as y + tk3 + qk*4 + nk + hk2 and give t. 0 Rearrange -3q*3 + 2q - 2q + (-2q - q*2 + 2q)(2q - 1 + 1) + (-q + q + 5q2)(-4 + 4 + 3q) to the form oq*2 + bq + l + gq3 and give g. 10 Rearrange (2n - 4n + n)(54n3 - 46n*3 + 46n*3 + 97n*3) to qn + sn4 + z + xn*3 + dn*2 and give s. -151 Rearrange 26 - 15 + 7q*2 - 13 to the form hq*2 + d + pq and give d. -2 Rearrange 8y2 - 2 + 4y - 4y - 3y*2 to the form l + sy + my2 and give l. -2 Rearrange (-2b + 5b - 5b - 8)(b + 29 - 29 - 12b*3) to the form hb + fb3 + i + sb*4 + ab*2 and give a. -2 Rearrange 0f - 4f + 8f + f to the form kf + u and give k. 5 Rearrange p4 - 2p*3 + 4p*2 + 4p*3 - 2p*3 - 4p*3 to the form lp*4 + bp*3 + tp*2 + f + op and give t. 4 Rearrange (-z*3 + 7 - 7 - 22z)(4 + 0 - 3) to oz + hz2 + qz*3 + b and give o. -22 Rearrange (6k + 2 + 0 - 7k)(0k + 6k + 6k) to the form dk*2 + uk + z and give d. -12 Rearrange (4r2 + 2r*2 - 4r*2)(190r + 151r - 464r) to the form tr + k + ur3 + xr*2 and give u. -246 Rearrange 3b*2 + 5b*2 + 2b*2 to the form ab + z + yb2 and give y. 10 Rearrange -54o*3 - 64 + 63 - 109o*3 to yo + t + io3 + co*2 and give t. -1 Rearrange 8q - 4 - q*3 - 8q to aq + u + rq*3 + mq*2 and give r. -1 Rearrange -5y - 3y + 2y - 3y to wy + c and give w. -9 Rearrange -2h - 1 + 1 + (-2h + 0h + 4h)(-3 - 3 + 5) - 2h - 3h + 3h + 3h - 3h + 4h to mh + o and give m. -2 Express 27 - k*3 - 2k*2 - 18 - k + k as ck + ok2 + f + tk*3 and give f. 9 Express 2 - 2v2 - v3 + 14v - v2 - 12v - 3v4 - 3v*2 as nv*2 + d + cv*3 + fv*4 + pv and give p. 2 Express -2c2 + 0c*2 + 4c*2 in the form uc*2 + l + bc and give u. 2 Rearrange -25u + 114u - 2u to the form pu + h and give p. 87 Rearrange 50b2 + 27b*2 - 35b*2 + b to nb + rb2 + w and give r. 42 Rearrange (2 - 4 + 1 - 6g)(-9g*3 - 6g*3 - 3g*3) to the form lg*3 + mg*4 + ng*2 + xg + b and give m. 108 Rearrange (-j + 3j - j)(143j2 - 38j*3 - 143j*2) to s + aj*2 + kj*4 + gj*3 + tj and give k. -38 Express (0f - 3f + 2f)((91 - 91 + 25f)(2f + 0f - f) + (0f + 2f + 0f)(f + 3 - 3)) as jf3 + t + vf + nf2 and give j. -27 Rearrange 12u - 3u - 7u - 3u2 - 1 - u3 to the form tu*3 + n + hu + su2 and give s. -3 Express (6 - 1 - 3)(-1 - 1 + 4)(-3i - i + 13i) as m + ui and give u. 36 Rearrange (-3 - i +	{ "pile_set_name": "DM Mathematics" }
form uj3 + bj*2 + lj + z and give u. 7 Express -2j + j + 7 + 12 + (-3 + 2 + 3)(3j + 4j - 6j) as k + zj and give k. 19 Express ((3t - 3t - 6t)(-2t2 + 2t*2 - 2t*2) - t - 2t*3 + t)(-3 - 1 + 3)(15t - t + 3t) as rt*3 + qt*4 + c + pt*2 + kt and give q. -170 Rearrange 20 - 2t2 - 14 + 12 + (-t + 3t - t)(-5t + 6t - 7t) to bt + zt2 + m and give m. 18 Rearrange (o2 + 1 - 1)(-607o + 801o + 355o) to fo + ro*2 + t + uo*3 and give u. 549 Express 3y - 20y + y + 9y + 8y + 7 as gy + l and give g. 1 Rearrange -104c + 104c - 19c2 - 145c*2 to the form pc + z + kc2 and give k. -164 Rearrange (0j*2 + 7j*2 + 12j*2)(-3j2 - 3j*2 + 4j*2 + (-j - j - 2j)(2j + j - 4j)) to the form kj + l + wj4 + zj*3 + vj*2 and give z. 0 Express 1235u - 18u3 + 57u*3 - 1205u as au3 + mu + zu2 + j and give a. 39 Rearrange (6s + 6s - 5s)((-2 - 2 + 3)(-3s + 3s - s) + 6s - 6s + 2s + (4 - 3 - 3)(6s - 4s - 4s)) to ns + m + cs2 and give c. 49 Rearrange -a4 + 3a*4 - 65a3 + a4 + 2a + 0a*4 - 2a*4 to la*2 + n + fa*4 + pa*3 + ja and give j. 2 Rearrange (-22v - 2v + 45v)(3 + 0 - 2)(2 + 2 + 0) to the form h + qv and give q. 84 Express 4 + 10705y4 - 4y - 5y2 - 10707y*4 + 2 + 0 as gy*4 + r + py*3 + qy + sy2 and give g. -2 Rearrange 10 + 80l*2 - 9l*2 - 6 - 1 to the form c + ql + tl2 and give q. 0 Rearrange 65 - 41t - t - 65 to the form vt + g and give g. 0 Rearrange 51 - 23 - 28 - 222o*2 to jo*2 + t + fo and give j. -222 Rearrange 668k + 410k - 12k to the form p + hk and give h. 1066 Express (-3h + 2h*2 + 3h)(-3h2 + h2 + 0h2) + 799h*3 + 179h*4 - 799h*3 as k + dh + wh4 + oh*3 + fh*2 and give w. 175 Rearrange (1 - 2 + 0)(525 - 525 + 33k)(-3 + 9 + 2) to t + zk and give z. -264 Rearrange -136o*3 + 259o*3 - 127o*3 + (0 + 0 + o)(-2 + 2 + o*2) to the form wo + no3 + u + bo*2 and give n. -3 Express -3 - 15 + 18 - 105m as im + w and give i. -105 Express -13511o + 348o2 + 13511o as go2 + mo + a and give g. 348 Express (-2 + 2 + 3o3 + (3 - 3 - 2)(5o3 - 4o*3 + 2o*3))(-7o - 8o - 10o) as no*3 + p + fo*2 + ko*4 + jo and give k. 75 Rearrange (t + 0 + 0)(4t*2 + 4t*2 - 6t*2 + (-t + 5t + 2t)(2 + t - 2) + (t - 2t + 4t)(t - 5 + 5)) to the form nt*3 + ut*2 + j + at and give n. 11 Rearrange (18y + 32 - 32)(3 + 1 - 6)(-474 + 249 + 245) to p + dy and give d. -720 Express -2c + 2c*3 + 2c + (3010 - 3010 + 198c2)(3c - 3 + 5 - 3) in the form zc*3 + v + kc + fc2 and give k. 0 Express 0c*2 - 4c*2 + 2c*2 + (-2c - c + 5c)(2 - 2 - 2c) - 2c*2 + 1 - 1 + (17c*2 + 34c*2 - 20c*2)(3 - 2 + 1) as tc + jc*2 + y and give j. 54 Rearrange 3 - 93957x - 3 + 93860x to the form px + w and give p. -97 Rearrange -121b - 77b + 68b to r + vb and give v. -130 Rearrange 484t3 + 4t*2 - 994t*3 + 473t*3 - 2 + 0 to the form bt*3 + yt*2 + it + v and give y. 4 Express 29z - 1 + 15 - 13 as qz + h and give q. 29 Rearrange (-21784w + 21784w - 10w3 - 2w*2)(3 - w - 3) to kw2 + zw*3 + h + sw*4 + mw and give z. 2 Express 24 + 5r3 - 5r4 - r4 - 55 + 4r4 + 28 as x + ur*4 + hr*2 + gr*3 + dr and give x. -3 Rearrange -19c2 + 25c*2 + 0c - c + (3c2 - c2 + 2c*2)(-4 + 4 + 2) + (-c + 6c - 2c)(6c - 2c - 5c) to v + mc2 + pc and give m. 11 Rearrange (4p2 + 4p*2 - 4p*2)(-3p + 12p + 13p) to kp + wp3 + u + qp*2 and give w. 88 Express 2739 + 367j*2 - 2739 as aj*2 + o + rj and give a. 367 Express (-263r2 + 20333 - 20333)(3r2 - 3r*2 - 2r*2) in the form cr + p + dr4 + hr*2 + gr*3 and give h. 0 Rearrange -331926u + 178u2 + 82u*2 + 331926u to the form qu2 + j + cu and give q. 260 Rearrange -g + 0g + 2g + (-2 + g + 2)(-2 + 1 - 1) + 2g - g - 4g - 3g - 2g + 7g + 2g + g + 0g to the form o + tg and give t. 1 Express -7l4 - l4 + 13l4 + (0 - 1 + 3)(-1 - l + 1)(-l + 0 + 0)(2l2 - 2l*2 - 2l*2) as ml*3 + z + jl + bl2 + hl*4 and give h. 1 Express 10u*2 - 18u2 + u2 + 3u2 - 62u*3 as ou + iu3 + ru*2 + g and give i. -62 Rearrange -3 - 198i + 52i4 - 3 + 196i + 4 - 4i3 + 2i*3 to fi + xi2 + ai*4 + ci*3 + u and give c. -2 Express -2h2 + h2 + 3h2 + (24h + 73h - 27h)(4 + 0 - 1)(-1 + 1 + h) in the form ah + i + yh*2 and give y. 212 Rearrange (14 + 38 - 15)(2 - 1 + 1)(3g - 2g + g) to ug + x and give u. 148 Rearrange (3 - 5 + 3)(45 - 9b - 45) to jb + g and give j. -9 Express (2 - 2 + 5a*2)(-3a - 2 - 2 + 1) as ga*3 + ua + qa2 + h and give g. -15 Express 4a*3 + 4a*2 - 12a*2 - 4a*2 + 4a*4 - 8a*3 + 2a*3 - 2 in the form wa + va3 + ua*4 + ra*2 + q and give r. -12 Express (-4 - 21 - 29)(128v - 28v - 22v) in the form pv + k and give p. -4212 Rearrange 49c3 + 958 + 3c - 958 to the form rc + ic*2 + hc*3 + p and give h. 49 Rearrange -4z + z - z + (6z - z - 4z)(1 + 2 - 2) + 0z + 0z + z + (5 + 5 - 5)(-6z + 3z + z) + 3z - 5z + 4z to p + az and give a. -10 Rearrange (-369y2 - 3487y + 3487y)(6y - y - 3y)(11 + 3 - 5) to the form wy + ky3 + b + ay*2 and give k. -6642 Express (-2j2 - j2 + 5j2)(43j - 66 + 66) - 88j*2 + 88j*2 - 6j*3 as uj + c + pj3 + xj*2 and give p. 80 Rearrange -299c*2 + 299c*2 - 48c*3 + (-2c*2 - 4c*2 + 4c*2)(12c + 477 - 477) to uc*2 + ac + t + kc3 and give k. -72 Rearrange 199 - 611 + 182z + 203 + 209 to the form s + jz and give s. 0 Express (12 - 39 - 44)(-6 + 2 + 2)(-q + 3 - 3) as bq + h and give b. -142 Rearrange -192x4 + 194x4 + x3 + 3 + 3x + 2x*2 - 4 to the form ax*2 + jx*3 + b + fx + zx4 and give f. 3 Express -3 + 21 + 3 - 2n*2 - 3n*3 - 2n*3 + 0n*2 as bn*2 + m + pn*3 + jn and give m. 21 Rearrange (16 + 32 + 13)(2 - 3 - x + 2x) to the form s + jx and give s. -61 Express 740n + 1 + 10 - 11 - 46n as cn + m and give c. 694 Express 5 + 2i + 24i - 2 as u + ni and give n. 26 Express 22t*3 + 1 - 2t*2 + 20t*3 - 43t*3 as ct*2 + zt*3 + r + lt and give r. 1 Rearrange 4 - 4a + 9a - 6a - a to ya + b and give b. 4 Express 9g - 97 + 33g - 46g in the form m + lg and give l. -4 Express -2p - 4p + 4p + 260 - 260 - 21p + (0 + 0 - 3p)(1 + 3 - 6) in the form u + np and give n. -17 Rearrange (w + 0 + 0)(-4 - 3 + 2)(128w - 131w + 0w*2 - 5w*2) to u + mw*3 + fw*2 + rw and give m. 25 Express (27u + 0u + 0u)(u*2 - 6u*2 + 7u*2 + 6u*3) in the form yu + wu2 + i + lu*4 + mu*3 and give m. 54 Express -156a*3 + 311a*3 - 53a - 153a3 - 2 + 2a*2 in the form ya + g + qa3 + ja*2 and give g. -2 Rearrange -16 + 44 - 16 - 216o - 12 to no + i and give n. -216 Express -21w*2 + 42w*4 + 42w*2 - 21w*2 + (6w + 5w - 4w)(w2 - w2 - w3) as jw*2 + xw*4 + k + mw*3 + yw and give x. 35 Rearrange 42 - 655i - 42 + 547i to u + mi and give m. -108 Express -166g*3 + g + 0g + 0g - 46g*3 as v + wg + qg3 + zg*2 and give w. 1 Express -10u + 2u - 10u + 4 - 4 - u + (1 + 0 + 1)(-2u + 1 - 1) + u - 2u + 0u + 1 + 6u - 2u - 5u as yu + w and give w. 1 Rearrange -19h + 71h*3 - 17h - 5h2 - 73h*3 to nh*2 + j + rh*3 + wh and give r. -2 Rearrange 3r - 6r + 13r - 54r*2 + 2 - 10r to the form mr + ur*2 + x and give x. 2 Rearrange 213i*4 - 730i*2 + 1 + 730i*2 + (5i - 3i - 3i)(0i3 - i3 + 3i3) to the form zi*4 + r + ti*2 + ki*3 + qi and give z. 211 Rearrange -29x3 + x - 40x*3 - 3x*2 + 6x*3 + 3x*2 to the form yx*3 + fx + p + vx2 and give f. 1 Rearrange (2 - 2 - 1)(363g + 620g + 230g + 559g) to fg + s and give f. -1772 Rearrange g2 - 2 + 2 + (0 + 0 + g)(5g + 94 - 41 + 72) to the form qg*2 + ag + k and give q. 6 Rearrange -107t3 + 54t*3 + 116t*2 + 57t*3 + 2t to ut + wt*3 + f + bt2 and give w. 4 Express t4 - 139 + 2t3 + 35 - 3t*4 - 11 + 0t*4 in the form nt + at2 + ct*3 + v + wt*4 and give w. -2 Rearrange 2 + 24b*3 - 25b*3 + 26b - 38b to yb + ub	{ "pile_set_name": "DM Mathematics" }
i be (-8)/(-6)(-42)/(-308). What is the nearest to -0.1 in i, 2, q? i Let l = -12.946 + 13.246. What is the nearest to 3 in -1/5, l, 0.07? l Let u = -2729.9 + 2730. Which is the nearest to 0? (a) -0.7 (b) u (c) 10 (d) 2 b Let t = -6226.5558 - -2.5558. Which is the closest to 2/3? (a) 0.4 (b) -3/2 (c) t (d) 1/3 a Let l = -101.41 - -4.81. Let m = 29 - -68. Let s = m + l. Which is the closest to 0.1? (a) s (b) 1 (c) 1/3 c Let p = -3925 - -11461/3. Let s = p + 105. Which is the nearest to s? (a) 1 (b) -1 (c) 2 a Let m = 6954 - 6953.5. Let u = 1.1 - -2.3. Let v = -3 + u. Which is the nearest to 0? (a) v (b) -0.2 (c) m b Suppose 21f - 36f + 13 = -47. Which is the nearest to f? (a) 0.3 (b) -6 (c) -2/7 (d) 2/9 a Suppose 0 = -2l - 4x, -3l + 0x = 3x. Suppose q - t - 2 = l, 5q - 4t - 5 = 6. Which is the closest to -16? (a) 1/4 (b) 5 (c) q a Let u = 10928 - 10932. Which is the closest to -1? (a) -21/4 (b) u (c) 7 b Let p = -99491 - -99490.75. Let k(v) = v + 3. Let z be k(-3). What is the nearest to 1 in -1/2, z, p? z Let u = 89.4 - 89. Let z = -0.084 - -0.034. What is the nearest to z in u, 4, 1.1? u Let s(m) be the first derivative of -m*4/4 - 11m*3/3 - m - 1. Let p be (94/(-141))/((-2)/(-33)). Let w be s(p). What is the nearest to w in -1, 0, -0.3? -1 Let n = -26.73 - -26.63. What is the nearest to n in 5, -342, -0.3? -0.3 Let u = -48.954 + -0.046. Let p = 76 + u. Let g = -28 + p. What is the nearest to 1 in 0.2, g, -1/5? 0.2 Let x = 152/809 + -1318925/5663. Let y = x - -233. What is the closest to -3 in 1/9, -8, y? 1/9 Let o(j) = 2j - 3. Let f be o(0). Let x be -7 + f + (4 - -17). What is the nearest to -1 in -0.5, -1, -3/4, x? -1 Let y be (-4)/(-6) + 6/9. Let m = -2175463 + 2175465. Let p be (-1)/2(-20)/6. What is the closest to -1 in p, y, m? y Let s = 0.25588 + -1.25588. Let z = -0.4 - -1. Which is the closest to -3? (a) z (b) s (c) -4 c Let l = -0.040876 - 0.059124. Let t be (-16)/6-3 - 0. Let m = -11 + t. What is the nearest to l in 3, -2.2, m? -2.2 Let l = 3616 - 50649/14. Let m = l + 16/7. What is the closest to m in 3/5, 0.2, -14? 3/5 Let c = 3989/13 - 307. Let a be ((-192)/(-80))/((6/15)/(-1)). Let z(f) = -f*3 - 5f*2 + 17f + 60. Let u be z(a). What is the nearest to u in c, -4/5, -0.5? -4/5 Let s = 25171.6 - 25174.1. Let c = 8 - 4. What is the nearest to 1/4 in -3, c, s? s Let g = -0.12 + 0.22. Let z be 763/(-21) + (-1)/(-3). Let t be ((-1)/(-3))/(9/z). Which is the nearest to g? (a) -5 (b) 7 (c) t c Let l = 13143/4 + -3286. What is the closest to 688 in 1/5, l, 0? 1/5 Let f = 693.88 - 694.38. Let v = 5 + -16. Let s = v + 6. Which is the closest to 0? (a) -7 (b) f (c) s b Let q = -0.03 + -1.97. Let i = q + 3. Let v = 1709644/38466315 - 2/2564421. Which is the nearest to v? (a) -0.1 (b) i (c) 4 a Let y = -21812.6 + 21813. Let d = 3.92 + 0.08. Let g = 3 - d. What is the nearest to g in -0.4, -1/5, y? -0.4 Let h = 333 - 336. Which is the nearest to -1? (a) 37 (b) h (c) 2/11 c Let t be 11/22(-9)/(117/(-4)). Let j = 19 - 18. Which is the nearest to j? (a) -3/5 (b) -0.1 (c) t c Let m = -9.8011 - 1.1989. Which is the closest to -1? (a) -0.5 (b) 0.5 (c) m (d) -1 d Suppose 5m - 196 = -2m. Suppose -25 = -23j + mj. What is the nearest to 1/2 in j, 3, 1? 1 Let d = 3 + -7. Let q be (112)/(6 + -9 + 5). Suppose 7 - q = x, -5f + 10 = 5x. What is the nearest to f in -7, 0.4, d? 0.4 Let c = 0.037 - 0.066. Let g = -6.629 - c. Let j = g - -6.7. What is the closest to j in 0.2, 2/9, -21? 0.2 Let k = 179 - 182. Which is the closest to 0? (a) -2/9 (b) k (c) -0.1 (d) 2/5 c Let i = -5 - -16/3. Let z = -12608 + 12613. Which is the nearest to i? (a) 0 (b) 0.4 (c) 3 (d) z b Let g = 193 + -192.7. Let d = -105 - -105.06. What is the closest to d in -4, g, 0.02, 0.2? 0.02 Let s = 21 - 20.9. Let m = 3 + -2.884. Let t = -0.116 + m. Which is the closest to t? (a) -0.9 (b) s (c) -5 b Let y(s) = 8s + 217. Let l be y(-27). Let i = 2.92 - -0.08. Which is the nearest to 3? (a) l (b) 0.4 (c) i c Let o = -221.2 - -220.71. Which is the closest to -1? (a) 4/3 (b) -3/4 (c) o (d) 3 b Suppose o = 5 + 104. Let u = 326/3 - o. Which is the closest to u? (a) 3 (b) 3/2 (c) 2/3 c Let k = 1697.04 + -1697. Which is the closest to -2/53? (a) 0.4 (b) -5 (c) k c Let i = -17.5 + 31.2. Let x = i - 17.7. What is the closest to -3/8 in 2, x, -0.4? -0.4 Let w = 0.2883 - -0.0417. What is the nearest to w in 1/3, 0, -0.3? 1/3 Let g = 112 - 112. Let o = -0.008 - 0.222. Let u = o + -0.27. What is the closest to 1/2 in 4, u, g? g Suppose 3k + o = -17, 2o + 18 - 8 = 0. Let w be 5 - (k - -3)-5. Which is the closest to 2? (a) -1 (b) w (c) -0.04 b Let z = 914 - 903. What is the closest to -0.3 in 1.6, 0.4, z? 0.4 Let o = 30 + -30.5. Let p be ((-370)/30 + 12 - 2/3)-3. What is the nearest to 0.1 in p, -1, o, 4? o Let w be 8/240/2. What is the closest to 1 in 3/20, 0.1, w? 3/20 Let l = -11646 - -11495. What is the closest to l in 4, 20, 1/2, 0? 0 Let z be (5/5)/(((-86)/387)/(88/6)). What is the closest to 0.07 in 0.3, 0.5, z? 0.3 Let y be (-1)/15(-9748)/(1 + -5). Let c = y - -488/3. What is the nearest to c in -3, 0.1, -40? 0.1 Let f = -2.553 - -2.153. What is the nearest to -0.2 in 1, f, -9/11, -0.1? -0.1 Let q = 81.49 - 82. Let c = q - -0.86. Let l = 1.35 - c. What is the nearest to 5/4 in l, -2, -2/9? l Let y = 428 - 344. Let s = 40 - -43.8. Let r = y - s. Which is the nearest to 2/7? (a) 1 (b) -1 (c) r c Suppose -2g + 24 = -10. Suppose -19d + gd + 4 = 0. Let h be ((-20)/(-25) - 1)/(d/4). What is the nearest to 1/4 in -5/8, h, -4? h Let w be 3/(-27) + (1 - (-164)/(-144)). What is the closest to -1/2 in 0.5, w, -4/5? w Let g = 0.41 - 2.41. Let n = -153.9 - -154. Let r = -7 + 7.3. What is the closest to n in g, 6/7, r? r Let o = -28167 - -28164. What is the closest to -3/4 in -1, o, 3/5, -744? -1 Let m = -1.6553 + 1.7553. Which is the closest to m? (a) 0.3 (b) 10 (c) 1/5 (d) 5 c Let x = -0.551 - 231.449. Let w = -233 - x. Let u = 0.5 - 0.3. Which is the closest to u? (a) -4 (b) w (c) -5 b Let p be (-1)/(-2)(4185/(-1782) - (-2)/12). Which is the nearest to 0.1? (a) 1 (b) p (c) -1/4 (d) 2/5 d Let x = -7/4 - -5/4. Let u = -198960.3 - -198960. What is the nearest to 1 in 5, u, 3/4, x? 3/4 Suppose 77i - 79i = 6. Let o = -3 - -2.9. Suppose 2q - 13 = -5. Which is the nearest to -4? (a) q (b) i (c) o b Let o = -65 - -70. Let b be (4 + (-132)/32)/(1-2). What is the nearest to 0 in 0, b, o? 0 Suppose -k + 7 = 4. Suppose h - t = 2, 2t - kt = h. Let y = 109/3 + -37. Which is the closest to h? (a) y (b) -4 (c) -0.2 c Suppose 2b = -3x, 5b = 21x - 18x. What is the closest to b in 2, -2/39, -0.4, -0.09? -2/39 Let r be -13(4/(-1) + 5). Let p = -60.61 - -61. Let w = p + -0.29. Which is the closest to w? (a) r (b) -4 (c) 0.3 c Let i = -0.166 + -0.134. Suppose 9n = 8n. Let f = -2 + n. Which is the closest to i? (a) -1 (b) 4 (c) f a Suppose 4l + w - 5 = 2l, -2l + 3w - 15 = 0. Let n be (1(3 + -6))/(450/90). Let j = -151/15 + 57/5. What is the closest to n in 3/8, j, l? l Let i = -12.409 - -11.909. Let h be (0 + 1)/((-45)/18). Which is the closest to 2? (a) 2 (b) i (c) h (d) 4 a Let y(o) = o - 1. Let p be y(2). Suppose -k = 53 - 9. Let z be k/126 + 74/(-333). Which is the closest to 1/7? (a) p (b) z (c) -2 b Let v = 1341 + -660. Let n = -683 + v. What is the closest to 0 in 8, 0, 4, n? 0 Let i(o) = -2o*3 + 15o*2 + 16o - 31. Let h be i(8). Suppose 0 = -15l + hl - 90. What is the nearest to 15 in 4/5, l, -0.5? l Suppose 0 = -g + 3g - 6. Let k be (-2)/g + (-164)/(-84). Let z = -13.03 + 13.43. Which is the closest to -0.1? (a) k (b) 2/11 (c) z b Let g be (2 + (-10)/3)/((21112/252)/29). Which is the nearest to g? (a) 0.06 (b) 2 (c) -3/14 c Suppose 2z = 0, 47 + 46 = 3l - 4z. Let f = 26 - l. Let h = 97.6 - 98.3. Which is the closest to -1? (a) f (b) h (c) -5/4 c Let b = 7193 - 21580/3. What is the nearest to b in -4, 0.4, 32/11? 0.4 Let z = 27.539 + -18.539. Which is the nearest to -2? (a) -0.4 (b) -26 (c) z a Let j = 99/2 - 48. Let q = 1407 + -1404.4. Let o = 0.04 - 0.04. Which is the nearest to o? (a) -0.2 (b) q (c) j a Let z = 0.09376 + 18.90624	{ "pile_set_name": "DM Mathematics" }
alculate the lowest common multiple of 155 and 341. 1705 Calculate the least common multiple of 12 and 198. 396 Calculate the common denominator of -17/72 and -115/18. 72 What is the lowest common multiple of 65 and 22490? 22490 Calculate the smallest common multiple of 934 and 9. 8406 Calculate the common denominator of 43/96 and -85/32. 96 Find the common denominator of 123/10 and -22/37. 370 Calculate the smallest common multiple of 1863 and 81. 1863 Calculate the least common multiple of 24 and 27. 216 What is the common denominator of 25/244 and -87/4? 244 Find the common denominator of 64/75 and 14/225. 225 Calculate the lowest common multiple of 34 and 184. 3128 What is the lowest common multiple of 144 and 48? 144 Calculate the least common multiple of 944 and 24. 2832 What is the smallest common multiple of 70 and 77? 770 Calculate the lowest common multiple of 110 and 10. 110 What is the smallest common multiple of 238 and 204? 1428 What is the common denominator of 2/459 and 131/204? 1836 What is the smallest common multiple of 42 and 74? 1554 Find the common denominator of 87/4 and -13/108. 108 What is the least common multiple of 4750 and 70? 33250 Find the common denominator of 139/432 and -139/3240. 6480 What is the common denominator of 29/1281 and 83/1281? 1281 Find the common denominator of -41/266 and -57/7. 266 Calculate the common denominator of 11/3330 and -103/165. 36630 What is the common denominator of -89/2 and -5/597? 1194 Find the common denominator of -97/7440 and -55/744. 7440 Calculate the least common multiple of 1584 and 1760. 15840 What is the lowest common multiple of 733 and 4? 2932 What is the smallest common multiple of 20 and 1820? 1820 Calculate the common denominator of 13/133 and -13/1015. 19285 Calculate the lowest common multiple of 1251 and 24. 10008 Calculate the common denominator of 28/243 and -77/18. 486 Calculate the least common multiple of 15 and 2289. 11445 Calculate the lowest common multiple of 260 and 140. 1820 Calculate the smallest common multiple of 10 and 8. 40 Calculate the common denominator of 57/2 and -71/2620. 2620 What is the common denominator of 157/168 and 5/924? 1848 What is the least common multiple of 12 and 1158? 2316 Calculate the common denominator of -7/1261 and -103/6. 7566 Calculate the least common multiple of 112 and 116. 3248 Calculate the lowest common multiple of 10 and 5. 10 Calculate the lowest common multiple of 4 and 319. 1276 Calculate the least common multiple of 50 and 10. 50 What is the least common multiple of 10 and 179? 1790 Calculate the least common multiple of 20 and 440. 440 Find the common denominator of 89/3538 and 49/16. 28304 What is the lowest common multiple of 36 and 18? 36 What is the common denominator of -70/171 and 151/36? 684 Calculate the common denominator of 67/2 and 51/1748. 1748 Calculate the common denominator of 15/16 and 35/864. 864 What is the common denominator of 151/186 and -59/276? 8556 Calculate the common denominator of 9/64 and 53/128. 128 Calculate the least common multiple of 12 and 9. 36 Find the common denominator of -49/253 and 27/253. 253 What is the smallest common multiple of 8 and 1912? 1912 Calculate the lowest common multiple of 641 and 12. 7692 Calculate the smallest common multiple of 144 and 36. 144 Calculate the common denominator of 89/105 and -61/630. 630 What is the common denominator of -119/24 and 3/398? 4776 Calculate the least common multiple of 12 and 590. 3540 What is the least common multiple of 6 and 291? 582 What is the least common multiple of 336 and 264? 3696 What is the smallest common multiple of 102 and 45? 1530 Calculate the common denominator of -33/1945 and -39/3890. 3890 What is the common denominator of -9/16 and 57/298? 2384 What is the least common multiple of 12 and 86? 516 Calculate the common denominator of 149/84 and 65/316. 6636 What is the common denominator of 19/3 and 117/56? 168 Calculate the common denominator of -17/6 and -69/13994. 41982 Calculate the lowest common multiple of 102 and 8. 408 Calculate the smallest common multiple of 2073 and 691. 2073 What is the least common multiple of 4270 and 3660? 25620 What is the smallest common multiple of 6219 and 6? 12438 Calculate the common denominator of 179/480 and -127/30. 480 Find the common denominator of -73/4636 and -107/40. 46360 What is the smallest common multiple of 10 and 694? 3470 What is the lowest common multiple of 486 and 162? 486 What is the lowest common multiple of 1595 and 220? 6380 What is the smallest common multiple of 100 and 30? 300 Calculate the common denominator of 58/1197 and 11/210. 11970 What is the smallest common multiple of 10 and 2? 10 What is the common denominator of 1/2028 and -12? 2028 What is the lowest common multiple of 360 and 135? 1080 Calculate the common denominator of -17/378 and -41/30. 1890 Calculate the common denominator of -91/48 and -15/128. 384 Calculate the smallest common multiple of 7 and 259. 259 Calculate the common denominator of 73/513 and 71/171. 513 Calculate the common denominator of -40/287 and -19/126. 5166 Calculate the least common multiple of 22 and 24. 264 Find the common denominator of 76/27 and 31/51. 459 Find the common denominator of 11/246 and -24/11. 2706 Find the common denominator of -123/20 and 67/260. 260 Find the common denominator of -89/10 and 31/90. 90 Calculate the common denominator of 61/525 and -167/4410. 22050 Calculate the common denominator of 19/1560 and 49/156. 1560 Find the common denominator of -31/20 and -187/270. 540 Calculate the smallest common multiple of 129 and 33. 1419 Find the common denominator of 37/11055 and -25/48. 176880 What is the common denominator of 17/4 and -19/20190? 40380 What is the common denominator of -28/25 and -67/245? 1225 Find the common denominator of -91/18 and -99/622. 5598 Find the common denominator of 139/36 and -161/396. 396 Calculate the smallest common multiple of 2894 and 22. 31834 Calculate the common denominator of -29/2 and 29/1248. 1248 What is the common denominator of -37/4 and 16/441? 1764 What is the lowest common multiple of 102 and 9? 306 Calculate the common denominator of -71/612 and 77/34. 612 Calculate the smallest common multiple of 256 and 256. 256 Calculate the lowest common multiple of 28 and 2604. 2604 Calculate the common denominator of 11/387 and 97/1548. 1548 What is the common denominator of 131/12 and -63/530? 3180 What is the least common multiple of 6619 and 7? 46333 Calculate the common denominator of -4/165 and 62/2145. 2145 Calculate the lowest common multiple of 6 and 399. 798 Calculate the common denominator of -31/772 and -21/4. 772 What is the common denominator of -133/1896 and -37/4? 1896 Calculate the smallest common multiple of 364 and 117. 3276 What is the common denominator of 133/18 and 45/32? 288 What is the least common multiple of 58 and 145? 290 What is the least common multiple of 117 and 26? 234 What is the common denominator of 149/990 and -157/7650? 84150 What is the common denominator of -5 and -31/10? 10 Calculate the smallest common multiple of 12 and 36. 36 What is the least common multiple of 4 and 94? 188 What is the lowest common multiple of 30 and 30? 30 Calculate the smallest common multiple of 112 and 4. 112 Calculate the least common multiple of 39 and 130. 390 Calculate the common denominator of -32/27 and -31/2421. 7263 What is the common denominator of -27/586 and 46/879? 1758 What is the lowest common multiple of 248 and 93? 744 Find the common denominator of 31/10 and -47/185. 370 What is the common denominator of -19/70 and 4/9? 630 Calculate the lowest common multiple of 168 and 488. 10248 What is the lowest common multiple of 18 and 328? 2952 What is the lowest common multiple of 1332 and 42? 9324 Find the common denominator of 75/26 and 91/4. 52 Calculate the smallest common multiple of 30 and 150. 150 What is the common denominator of -101/1584 and 13/880? 7920 What is the smallest common multiple of 691 and 13? 8983 Calculate the least common multiple of 145 and 29. 145 Calculate the smallest common multiple of 144 and 8. 144 What is the lowest common multiple of 18 and 1116? 1116 Find the common denominator of 107/1	{ "pile_set_name": "DM Mathematics" }
*4/6 + x. What is r(h(l))? 8l*2 Let o(f) = -6f. Let y(m) = 9m + 6 + 11 - 6m - 17. Give y(o(k)). -18k Let l(w) be the first derivative of 3w*2/2 - 21. Let r(s) = 1 - 6 - 4s*2 + 5. Determine l(r(k)). -12k*2 Let k(v) = -431v*2 + 438v*2 + 0 + 0. Let s(u) = -9u*2. Let p(j) = 14j*2. Let t(i) = 5p(i) + 8s(i). Give t(k(l)). -98l*4 Let o(p) = -2p*2. Let c(j) = 74914j. Give c(o(k)). -149828k2 Let a(l) = -350l - 55. Suppose 3q + 61 = 2q - 3n, -224 = 4q + 2n. Let t(v) = 13v + 2. Let d(i) = qt(i) - 2a(i). Let b(m) = m + 3m - 6m. Give b(d(g)). 30g Let b(s) = 3s*2 - s + 1. Let v(a) = 0a - a*2 - a + 0a + 0 + 1. Let o(w) = -b(w) + v(w). Let n(x) = -6 + 6 + 3x2 + 0. Calculate o(n(c)). -36c*4 Suppose -2 = 5c + 4p - 14, c = -3p - 2. Suppose c = -y + 6. Let q(s) = -113s2 + 49s*y + 55s*2. Let r(z) = -2z. Give q(r(h)). -36h2 Let q(c) = 7c. Let v(n) = 27n - 24. Let k(l) = 242l - 220. Let f(z) = -6k(z) + 55v(z). What is f(q(r))? 231r Let u(w) = -2w. Let b = -17 + 16. Let d(q) = q*2 - 1. Let r(h) = -19h*2 + 6. Let c(s) = br(s) - 6d(s). Calculate u(c(a)). -26a*2 Let v(j) = 2j. Let l(i) be the second derivative of 137i3/6 - 40i + 1. Calculate l(v(n)). 274n Let d(v) = 3v - 48. Let m(h) = -168h - 1. Calculate d(m(u)). -504u - 51 Let m(n) be the third derivative of -n*4/12 + 74n*2. Let i(s) = -24s*2. Give i(m(a)). -96a*2 Let s(y) = -8964y2. Let b(c) = -c2. Determine s(b(m)). -8964m4 Let g(s) = -11182s. Let z(b) = 7b2. What is g(z(v))? -78274v*2 Let z(v) = -2v. Let q(o) = 6003283o2. Determine z(q(a)). -12006566a2 Let n(y) be the first derivative of y2 - 1. Suppose -2l - 2 = -2i, 4i - 2l - 1 - 11 = 0. Let r(t) = 6t + t - it. Calculate n(r(o)). 4o Suppose 4w + 24 = 124. Let u(m) = 9m2 - wm*2 + 15m*2. Let o(l) = 8l. Give o(u(j)). -8j2 Let x(r) = 27r + 22r + 18r - 70r. Let t(i) = 19i. Determine t(x(s)). -57s Let v(s) = -4s. Let d(b) = -2b - 3. Let u(x) = -x - 3. Let m(z) = 4d(z) - 5u(z). Determine m(v(w)). 12w + 3 Let r(g) be the second derivative of g*3/3 - g + 2. Let p(m) = -6m + 5. Let w(h) = h - 1. Let u(z) = -2p(z) - 10w(z). Calculate r(u(d)). 4d Let g(j) = -2694j*2. Let n(f) = -5f - 8. What is n(g(v))? 13470v2 - 8 Let t(i) = -4i*2 + i. Let q(u) = 5u*2 - 18u + 6. Let m(n) = -14n2 + 51n - 17. Let v(k) = -6m(k) - 17q(k). What is v(t(a))? -16a4 + 8a3 - a2 Let r(s) = -369s2 - 372s*2 + 737s*2. Let o(x) = 34x*2 + 1. What is o(r(l))? 544l*4 + 1 Let j(i) = -2i. Let c(w) be the third derivative of 0w3 + 7/60w*5 + 0 + 0w + 0w4 - 5w*2. Determine j(c(p)). -14p*2 Let w(m) = 2m + 2m - 4m + m. Let d(r) = -17r2 - 11r + 11. Let p(y) = 4y2 + 3y - 3. Let n(c) = 6d(c) + 22p(c). Calculate w(n(j)). -14j2 Let z(s) = 15s*2 - 9s. Let f = -21 + 30. Let j(c) = -4c2 + 2c. Let u(k) = fj(k) + 2z(k). Let b(h) = 4h - 2h + 4h - 4h. Give u(b(w)). -24w2 Let l(q) = -q. Let w(n) = -54n - 25. Let i(j) = -81j - 35. Let s(f) = 5i(f) - 7w(f). Determine s(l(o)). 27o Let a(i) = i + 16. Let q(z) = 26z - 12. Give q(a(f)). 26f + 404 Let g(h) = 90. Let r(w) = -w*2 - 2. Let b(s) = g(s) + 45r(s). Let a(l) = -13l2. Calculate b(a(z)). -7605z*4 Let l(b) = 4b. Let j(y) be the third derivative of -4y4/3 - 721y*2. Calculate j(l(h)). -128h Let m(l) = -31l + 19. Let z(u) = -29u. Determine m(z(a)). 899a + 19 Let a(o) = 13o*2. Let x(s) be the third derivative of 0s + 0 - s*2 + 0s*3 + 1/6s*4. Calculate a(x(h)). 208h*2 Let l(v) be the third derivative of -2v*2 + 1/30v*5 + 0v + 0 + 0v4 + 0v*3. Let j(u) = 8u + 0u2 - 2u*2 - 8u. Determine j(l(g)). -8g4 Let b(p) = -3813 - 63p + 1906 + 1904. Let w(r) = -3r. Determine b(w(v)). 189v - 3 Let b(a) = 12a2 - 15a*2 + 0a*2. Let k(t) = t. Determine k(b(r)). -3r*2 Let t(b) = -9b*2. Let k(r) = 2r*2 - 12r + 22. Let i be k(4). Let z(v) = 14v. Let o(m) = -m. Let d(u) = io(u) + z(u). Calculate d(t(f)). -72f2 Let f(b) = -b2 + 22. Let q(x) = -x + 9. Let m(a) = 6. Let t(c) = -3m(c) + 2q(c). Calculate t(f(o)). 2o*2 - 44 Let g(o) = 46o*2. Let i(r) be the third derivative of 5r*4/24 - 11r*2 - r. Determine g(i(c)). 1150c*2 Let t be (-2 + 4)(-2)/(-2). Let i(v) = -2 + tv - 2 + 4. Let r(j) be the second derivative of 5j*4/12 - j. Calculate i(r(d)). 10d*2 Let q(o) = -2. Let z(i) = i - 6. Let s(u) = -6q(u) + 2z(u). Let d(b) be the second derivative of -3b*3/2 - 4b. Give s(d(f)). -18f Let h(v) = -6v. Let b(d) = 400d. What is h(b(s))? -2400s Let l(r) = 43r. Let o(z) = -3z*2 - 42z + 9. Calculate l(o(u)). -129u2 - 1806u + 387 Let d(b) = 2b2. Let n(c) = -6225117c. Calculate d(n(x)). 77504163327378x2 Let l(t) = 671t*2 - 2t. Let x(k) = -4k. Give x(l(g)). -2684g*2 + 8g Let k(z) = 28z2 - 71z*2 + 30z*2 + 28z*2. Let d(g) = -6g. What is k(d(p))? 540p2 Let v(z) = 39z*2 - 18. Let j(a) = a - a - 5 + 11a*2. Let x = 292 + -310. Let b(n) = xj(n) + 5v(n). Let u(k) = -2k*2. What is u(b(d))? -18d*4 Suppose 0 = 8v - 4v. Let j(l) = -4l*2 + vl*2 + 0l*2 + 5l2. Let p(u) be the second derivative of -u4/2 + 14u. Determine p(j(f)). -6f*4 Let d(o) = 4o + 2. Let y(s) = 63145s2. Calculate d(y(c)). 252580c*2 + 2 Let q(h) = -39h. Let p(s) be the third derivative of -s*5/60 - 19s*3/6 - 17s*2. Let x(z) be the first derivative of p(z). What is q(x(o))? 78o Let t(i) = 7077i2. Let d(p) = -6p. Give t(d(g)). 254772g2 Let d(c) be the third derivative of -3c*5/20 - 419c*2. Let j(x) = -7x*2. Determine d(j(p)). -441p*4 Let q(t) be the third derivative of -1/4t*5 + 0t*3 + 0t*4 + 0 - 22t*2 + 0t. Let n(v) = v*2. Determine n(q(c)). 225c*4 Let d(k) = 0 - 2k2 + 0. Let s(m) be the second derivative of m3/6 + 1147m. What is s(d(o))? -2o*2 Let x(y) be the first derivative of 0y*2 + 0y + 2 - 1/3y3. Let n(h) be the second derivative of -h3/2 - 2h. Give n(x(d)). 3d2 Let s(q) = 1838q. Let a(t) = 129t2. Determine s(a(b)). 237102b*2 Let d(t) = 10t*2. Let i be (-3 - (-15)/9)(-1 - 2). Let b(y) = 45y + iy*2 - 45y. Calculate b(d(s)). 400s4 Let b(h) = -8h + 3h - h + 2h. Let j(z) = 4z. Let a(p) = p. Let w(y) = -3a(y) + j(y). Determine b(w(r)). -4r Suppose -2r + 0r = -4. Let o(h) = 8h*r + 6h*2 - 12h*2. Let n(p) = -2p*2 + 2p*2 + 4p*2. Calculate o(n(u)). 32u*4 Let f(j) be the first derivative of -5j*4/24 - 3j*2 - 53. Let u(h) be the second derivative of f(h). Let y(m) = -10m*2. Determine y(u(l)). -250l*2 Suppose -16 = -5s - 3u, 0 = 4s + u - 0u - 10. Let d(x) = -4x*2 - 13 + 3x*s + 13. Let t(n) = -25n*2. Determine d(t(g)). -625g4 Let s(i) = i2. Let q(p) = -3p2 + 1. Let l(m) = 70m*2 + 2. Let a(h) = -3l(h) + 6q(h). Calculate a(s(t)). -228t*4 Let t(o) = -3o*2. Let d(z) = 22z - 2. Let i(s) = 13s - 1. Let p(u) = -6d(u) + 11i(u). Give p(t(l)). -33l*2 + 1 Let s(i) = -3i*2 + 8i. Let x(w) be the first derivative of -5w2 - 665. Give s(x(y)). -300y*2 - 80y Let m(v) = 106v. Let o(k) = 5k*2 + 12k - 6. Let n(g) = -g*2 - 4g + 2. Let d(c) = 3n(c) + o(c). Give m(d(r)). 212r*2 Let c(l) = 4l*2 - 2l - 2. Let w(h) = -h*2 + h + 1. Let y(t) = c(t) + 2w(t). Let q(x) = 239x. What is y(q(f))? 114242f*2 Let j(l) = 45. Let a(c) = c - 15. Let x(m) = -3a(m) - j(m). Let u(h) = -3 + 6h2 + 3. Give u(x(o)). 54o*2 Let j(q) = 21q*2. Let t(k) = -8656k*2. What is t(j(l))? -3817296l*4 Suppose 6f = 20 + 28. Let g(k) = -k + k - fk2 + 7k*2. Let y(q) = 7q + 6. Let p(n) = -6n - 5. Let h(v) = -6p(v) - 5y(v). Calculate h(g(m)). -m2 Let a(b) be the first derivative of -b2 - 256. Let r(t) = 7t - 5. Let h(k) = -k. Let y(v) = -3h(v) - r(v). Calculate a(y(m)). 8m - 10 Let p(i) = -5i2 - 8i. Let x(y) = -y*2 - 5y. Let r(j) = 3p(j) - 7x(j). Let l(m) = 2m. Calculate l(r(n)). -16n*2 + 22n Let f(x) = 7 + 3 + 80248x - 80250x. Let m(s) = -3s2. Determine m(f(a)). -12a*2 + 120a - 300 Let c(r) = 252r2. Let b(x) = 341x*2. Calculate b(c(q)). 21654864q*4 Let i(t) = -3t*2 + 11t. Let p(g) = -18g2 + 58g*2 - 42g**2. Determine i(p	{ "pile_set_name": "DM Mathematics" }
ative of -2x5 - 17x*4/4 + 685x*2/2 - 708. What is the second derivative of a(j) wrt j? -120j*2 - 102j Suppose -g = 0, 3l - 3g - 39 = 51. Find the third derivative of ld2 - 188d*4 + 200d*4 - 12d*2 wrt d. 288d What is the derivative of -13f + 2f*2 + 20 - 66 + 29 - 3f*2 wrt f? -2f - 13 Suppose 0 = -0m + 7m + 7m. Let b(i) be the second derivative of 1/5i*5 + mi*2 + 0 + 0i*3 - i - 1/3i*4. Find the third derivative of b(j) wrt j. 24 Let b(s) = 141s - 281. Let j(x) = -140x + 285. Let d(n) = -5b(n) - 4j(n). Find the first derivative of d(h) wrt h. -145 Let z(p) be the first derivative of 2p*6/15 - 9p*2/2 - 7p + 6. Let v(t) be the first derivative of z(t). What is the derivative of v(d) wrt d? 16d3 Let h(y) = -3y + 6y - 4y + 1. Let a(d) = 3d - 4. Let q(u) = a(u) - 3h(u). Differentiate q(z) wrt z. 6 Let z be (-13)/(((-85)/34)/((-2)/(-4))). Let x(f) be the first derivative of 0f2 + 2f - zf5 - 6 + 0f*3 + 0f*4. What is the derivative of x(m) wrt m? -52m*3 Let w(f) be the second derivative of 491f*3/6 - 42f*2 - 34f - 1. Differentiate w(o) with respect to o. 491 Differentiate 2a4 + 82391a - 313 + 4a2 - 82391a with respect to a. 8a3 + 8a Suppose -4o - 2g + 27 = g, -g = -5o + 10. Suppose -4x + 34 = -ot, -3x + 19 = t - 0t. Differentiate 6 + 1 + x - 8p*3 - 2 with respect to p. -24p*2 Let o(t) = -99t*4 - 2t*3 + 3t*2 - 4. Let s(p) = 296p*4 + 5p*3 - 7p*2 + 11. Let b(n) = 11o(n) + 4s(n). Find the third derivative of b(d) wrt d. 2280d - 12 Let l(s) = -s + 1. Let y(n) = 6 + 33n2 + n - n - 27n*2 + 2n. Let a(x) = -6l(x) + y(x). Find the second derivative of a(d) wrt d. 12 Let o(l) be the second derivative of -19l*5/4 - 19l*2/2 + l - 10. Differentiate o(c) with respect to c. -285c*2 Let d(f) be the first derivative of 0f*6 - 5/7f*7 + 0f*2 + 0f*4 + 0f*5 - 7 - 10/3f*3 + 0f. Find the third derivative of d(y) wrt y. -600y3 Let c(k) be the first derivative of -6k5/5 + k3 - 4k2 - 61. Find the second derivative of c(f) wrt f. -72f*2 + 6 Suppose -3f = -f + 42. Let t(d) = 7d3 - 21d2 + 14. Let w(m) = -m3 + m*2. Let p(z) = fw(z) - t(z). What is the first derivative of p(o) wrt o? 42o2 Suppose -2b + 25 + 3 = 0. Let h be ((-48)/28)/((-4)/b). Find the second derivative of -4q - q - 15q*3 + 5q*3 + hq*3 wrt q. -24q Suppose -4q = 2z + 29 - 15, 4q + 29 = 3z. Let k be (3 - 2)/(2/12). Find the first derivative of -kg3 + zg*3 - 8g*3 + 20 - 15 wrt g. -33g*2 Suppose h = -s, 10h - 4s = 5h + 9. Let r(y) = y + 10. Let u be r(-5). Find the first derivative of -h - 8l4 - u + 0 wrt l. -32l*3 Suppose 4i + i = 2m - 14, 2i + 4 = 0. Find the second derivative of -93y2 - 2y + 4y + 96ym wrt y. 6 Let n(r) = -r2. Let k(m) be the second derivative of -29m4/12 + m3/2 + 24m. Let y(h) = -k(h) + 5n(h). What is the second derivative of y(f) wrt f? 48 Let g(z) = -4z + 5. Let d be g(-6). Find the third derivative of dn2 + 78n*3 + 14n*4 - 78n*3 wrt n. 336n Let o be (5/3 - 3)49/(-196). Let a(t) be the second derivative of -4t - ot3 + 7/12t*4 + 0 + 0t*2. Find the second derivative of a(v) wrt v. 14 What is the second derivative of -356n*2 + 716n*2 + 2n*3 - 360n*2 + 320n + 8n4 wrt n? 96n*2 + 12n Let q(r) be the third derivative of r*8/112 + 22r*7/105 - 8r*4/3 - 4r*2 - 24. Find the second derivative of q(b) wrt b. 60b*3 + 528b*2 Let q(o) be the second derivative of -19o5/20 + o4/12 - 68o3/3 + o2/2 - o - 162. Find the second derivative of q(w) wrt w. -114w + 2 Find the third derivative of -840f5 + f4 - f4 - 46f*2 + 14f*2 + 857f*5 wrt f. 1020f2 What is the first derivative of 47 + y4 - 184y + 408687y*3 - 309 - 408687y*3 wrt y? 4y3 - 184 Let a(z) = -z2 + 10z + 28. Let w be a(9). Find the third derivative of -2 - 2338b*2 - wb*5 + 1 + 2319b*2 wrt b. -2220b*2 Let z = -413 + 933. Find the second derivative of 520 + 12v - z - 5v5 wrt v. -100v*3 What is the second derivative of -3v*3 + 284v + 21v + 437v*4 + 0v - 470v4 wrt v? -396v*2 - 18v Let k(x) be the second derivative of 0x3 + 6x - 1/12x4 + 0 + 7/2x2. Let h(c) = -c2 - 1. Let q(w) = -6h(w) - k(w). Differentiate q(f) wrt f. 14f Let a(i) = i*3 - 8i*2 + 3. Let p be a(8). Find the third derivative of 0q*3 + 24q*2 - 7q*3 + 31q*p wrt q. 144 What is the third derivative of -652n*2 + 331n*2 + 323n2 + n6 - 182 - 72n4 wrt n? 120n*3 - 1728n Suppose -v - 4p = -4v + 21, 0 = -v - 2p - 3. What is the second derivative of -1 - 2b + 1 - 31bv - 8b wrt b? -186b Let f = -5 + 8. Suppose 0 = -t - f + 7. What is the third derivative of 0l*4 - 4l*2 - 2l*t + 5l*4 wrt l? 72l Let p(n) = n*2 - 5n + 2. Let t be p(5). Suppose 17 = tj + z, -4z = -4j - 5z + 35. Differentiate 4 + 2 - 14 - jk2 wrt k. -18k What is the derivative of -2s - 14 + 105s*2 + 29 + s + 2s + 30 wrt s? 210s + 1 What is the third derivative of 65i*2 - 885i*6 + 37i*2 + 728i*6 + 3i*5 wrt i? -18840i*3 + 180i*2 Differentiate -21 + 85 - 338 + 1275n - 478n wrt n. 797 Let i(s) be the third derivative of s7/210 - 7s*5/20 + 7s*3/3 - 87s*2. Differentiate i(b) with respect to b. 4b*3 - 42b Let u(k) = k*2 + k + 1. Let b(q) = 1 + 288q*2 + 43q - 290q2 + 46q*4 - 3. Let i(t) = b(t) + 2u(t). Find the second derivative of i(p) wrt p. 552p2 Let w(s) = -98s*2 - 39s*4 + 98s*2 + 48s. Let o(v) = 19v4 - 24v. Let x(i) = -11o(i) - 6w(i). Find the second derivative of x(a) wrt a. 300a2 Find the second derivative of -1004l + 354l4 - 233l - 25l4 + 278l wrt l. 3948l2 Let i(n) be the first derivative of -17/2n*2 - 7n - 14. Find the first derivative of i(d) wrt d. -17 Let s be 39/65(2 + (-369)/(-3)). Find the first derivative of -m4 - 45 + 18m*2 + s + 2m*2 + 0m*4 wrt m. -4m*3 + 40m Let t(a) be the third derivative of a6/120 - a5/20 + a4/12 + a3/3 + 3a2. Let u be t(2). Differentiate -5s*u - 5 + s - 3s + 2s wrt s. -10s Let t(c) = 40c2 + 6c + 70. Let q(z) = -40z2 - 5z - 69. Let k(n) = -5q(n) - 4t(n). What is the first derivative of k(y) wrt y? 80y + 1 Suppose o + 3 = 2o. What is the derivative of 119m - 5 + 7m*o - 119m wrt m? 21m2 Suppose 7y + 5 = 8y. Let g(p) be the second derivative of -1/2p*2 + 0p*4 + 0p*3 - 4p - 3/20py + 0. What is the derivative of g(b) wrt b? -9b*2 Let h = -111 - -129. Find the first derivative of -4d*2 - 5d*3 + 4d*2 + 7d*3 - h wrt d. 6d*2 Let w(j) = -7j*3 + 13j*2 - 62j - 6. Let n(q) = -13q3 + 25q*2 - 122q - 11. Let z(m) = -6n(m) + 11w(m). What is the second derivative of z(y) wrt y? 6y - 14 Let p be 4(-1 - (-42)/8). Find the second derivative of pw + 11w5 - w5 - 19w wrt w. 200w*3 Let u(d) = -19d*4 - 6d*3 + 12d - 3. Let c(a) = 39a4 + 14a*3 - 24a + 7. Let z(m) = -4c(m) - 9u(m). What is the second derivative of z(l) wrt l? 180l2 - 12l Suppose -5t - 3h + 15 = 0, 3t - 8 - 1 = 3h. Find the second derivative of z - 13z + 5z + z*3 + tz wrt z. 6z Find the first derivative of 2t*3 + 6t*4 - 16t*4 + 70t*4 + 23t*4 + 135 wrt t. 332t*3 + 6t*2 Suppose -28 = -4x - 8. Let a(h) be the second derivative of 0h4 + 1/15h*6 + 0 + h - 1/2h*3 + 0h*x + 0h*2. Find the second derivative of a(n) wrt n. 24n*2 Let j be 3/12 - -2 - 2/8. What is the second derivative of -9a + 4a5 + 48a*j - 48a*2 wrt a? 80a*3 Let n(p) = 755p*2 + 13p + 79. Let a(v) = -377v2 - 7v - 40. Let d(x) = 11a(x) + 6n(x). What is the second derivative of d(c) wrt c? 766 Let s(o) be the first derivative of 46o6/3 + 38o*3/3 + 2o*2 - 182. What is the third derivative of s(u) wrt u? 5520u*2 Let l = 93 + -51. What is the third derivative of 40v*4 + lv*2 - 16v*2 + 4v*4 - 5v*2 wrt v? 1056v Let b(q) = 731q2 + 207q + 10. Let l(z) = 1462z2 + 415z + 16. Let d(c) = 5b(c) - 3l(c). What is the second derivative of d(v) wrt v? -1462 Let v(k) = -k*2 + 6k + 6. Let r(x) = 0x - 4x + 5x. Let b(n) = -6r(n) + v(n). Differentiate b(y) wrt y. -2y Let b(r) = -2r - 4.	{ "pile_set_name": "DM Mathematics" }
hm wrt h? 156m - 1080 What is the first derivative of 2w4 + w3 + 1009w*2 + 3194? 8w*3 + 3w*2 + 2018w What is the derivative of 73f2oq + 3f*2 + 6fq + 4q wrt o? 73f2q Differentiate 5747j2 + 6552 with respect to j. 11494j What is the third derivative of 2c2d*3 + 257c*2d*2k - c*2d*2 - 4cd3k + 12d3k - 2d2k wrt d? 12c2 - 24ck + 72k Find the second derivative of 2y5 + 2338y*2 - 3297y. 40y3 + 4676 Differentiate -bh*3 + 12bh2z*2 - 70bh2 + 4bz2 + 2h*3z*2 - 2h*3 with respect to z. 24bh2z + 8bz + 4h3z Find the third derivative of 46c6 - c4g - 2c2g + 32g wrt c. 5520c*3 - 24cg What is the second derivative of -3f*5k + 79f3k - f + 3k + 3 wrt f? -60f*3k + 474fk Find the third derivative of 142q6 - q2 + 72 wrt q. 17040q3 What is the third derivative of -d6x2 + 23d*4x*2 - 7d*2x + 10dx + x*2 wrt d? -120d*3x*2 + 552dx2 What is the third derivative of 6121k*3 + 1356k*2 + 3? 36726 What is the first derivative of -6l*2r*2 + 6lr2 + 9lr - 12r*2 + 11r wrt l? -12lr*2 + 6r*2 + 9r Find the third derivative of -5hl*4 - 13hl3 - 7hl2 - 2h wrt l. -120hl - 78h Find the third derivative of 55kv4 - 2kv3 - 2kv2 + 71k + 2v4 wrt v. 1320kv - 12k + 48v Find the second derivative of 2g*3i2 + g3i + 2g*2i*3 - 146g*2i - 713i3 wrt i. 4g*3 + 12g*2i - 4278i What is the third derivative of 106c*5k2 - c3y + 2c*2k*2y + 318c2ky wrt c? 6360c*2k*2 - 6y Find the second derivative of -1237z5 - 2682z. -24740z3 Find the second derivative of 3435a*2 - a - 3202 wrt a. 6870 Differentiate 78a*2y2 - a2 - ay3 + 2 wrt y. 156a*2y - 3ay*2 Differentiate 265f*3lo2 - 3f*3 + 2f*2lo2 + 2650f*2o*2 with respect to l. 265f*3o*2 + 2f*2o*2 What is the first derivative of -229c - 40? -229 What is the second derivative of -405i3j*2k - 3i3j*2 + 2i*3jk + 22i*3k - 65i2jk + 4ij2 wrt j? -810i*3k - 6i3 + 8i Find the third derivative of 549x6 + 613x*2. 65880x*3 What is the first derivative of 24143a*3 - 14098 wrt a? 72429a*2 Find the third derivative of -285t*6 - 145t*2. -34200t*3 What is the third derivative of 22d*6t - 153d5t - 2d2t - 1026d2 - 2 wrt d? 2640d*3t - 9180d2t What is the third derivative of 126n3x3 - n3 - 454n2x*3 wrt n? 756x*3 - 6 What is the third derivative of -2fy5 + fy*4 + 310fy3 - 397fy2 + 3y wrt y? -120fy*2 + 24fy + 1860f Find the third derivative of -a*2s*4 + 351a*2 + 6as4 + s4 + 2s*2 wrt s. -24a*2s + 144as + 24s What is the third derivative of -2p*4 - 3439p*3 - 13p*2 + 19p? -48p - 20634 Find the third derivative of 9f*5 - 9f*4 + 987f*2 wrt f. 540f*2 - 216f What is the second derivative of 1343m2 + 1055m? 2686 Differentiate -429f4 - 315. -1716f*3 What is the second derivative of 8384i*5 + 31i + 22 wrt i? 167680i3 Find the third derivative of 435j*3v*6 + 5j*3v - 4v2 wrt v. 52200j*3v*3 What is the derivative of -24ah - amr + 6am + 3ar2 + 245hmr*2 + hr*2 + 6m wrt a? -24h - mr + 6m + 3r*2 Find the third derivative of 5i*5 + 18i*4 + 56i*2. 300i*2 + 432i What is the third derivative of -5725x3 - 2x*2 - 136 wrt x? -34350 What is the second derivative of 292a*4 + 368a? 3504a2 Find the third derivative of 15g*3y + 3g3 + 35g*2y + 9gy wrt g. 90y + 18 Find the second derivative of 2794b*2 + 3686b wrt b. 5588 What is the second derivative of m*2o*2xz - 35m*2o*2 - 4m*2o + 3mo*2xz - 2mx - mz + 22o2xz wrt m? 2o*2xz - 70o*2 - 8o Find the second derivative of 1741b5 + 272b wrt b. 34820b3 What is the first derivative of -n3s - 82n3 - 2n*2s*2 + 68ns2 wrt s? -n3 - 4n*2s + 136ns What is the third derivative of 10986v3 - 114v*2 + 23v wrt v? 65916 What is the second derivative of 2c5 - 14c*3 + 12c*2 - 75c + 18? 40c3 - 84c + 24 What is the third derivative of -176b5w + b*3w*2 + 1041b*2w*2 + 2bw2 + b + 2 wrt b? -10560b*2w + 6w2 What is the second derivative of 358k*2 + 26k - 13 wrt k? 716 What is the third derivative of -12ap*4 + 2ap2 - 246ap + 14p*4 wrt p? -288ap + 336p What is the derivative of -2ov*3 + 9oy - 17o - v*3y - 28vy wrt v? -6ov*2 - 3v*2y - 28y Differentiate -20694n - 26977. -20694 What is the second derivative of 5493z5 - 91z - 1? 109860z3 Find the second derivative of -5fns*2t + fns*2 - 2fns - fnt + fs + 2f - 2ns*2 + 7nt + s2 wrt s. -10fnt + 2fn - 4n + 2 What is the second derivative of -18d*2i*2qv - 2d*2iq2v - 4d2q*3v - 16diq3v + 8diq2 - 2i*2q*3v - 2iq*3v wrt i? -36d2qv - 4q*3v What is the third derivative of -18480g3v*3 + 26g*3 - gv*2 + 2v - 2 wrt v? -110880g3 What is the first derivative of -31diw - 2di + 689i - 2 wrt w? -31di What is the first derivative of 1366y*3 - 194 wrt y? 4098y*2 Differentiate 396i - 1377 with respect to i. 396 What is the first derivative of -4a2m2 + a2m - 6a*2y + 12am - 114m2y wrt y? -6a2 - 114m*2 What is the first derivative of -86a*3f - 37a3 - 2a2 + f3 + 3f2 - 3f + 26 wrt f? -86a3 + 3f*2 + 6f - 3 What is the derivative of -3b2s*2 + 25bs2 + 4b - 2s2 + 220s wrt b? -6bs*2 + 25s*2 + 4 What is the third derivative of -3r*5x*2 + 9r5 - r3 - 22r2x*2 + 3r2 + x2 wrt r? -180r2x*2 + 540r*2 - 6 Find the second derivative of 25p*4 + 8p3 - p2 + 1349p wrt p. 300p*2 + 48p - 2 What is the second derivative of 2bc*5 - 2bc2 + 57b - 10c2 - 9c wrt c? 40bc*3 - 4b - 20 Differentiate -97l3 + l2 + l - 4786. -291l*2 + 2l + 1 What is the second derivative of s*3 + 32s*2 - 232s wrt s? 6s + 64 Find the first derivative of 4ht3 + 227ht2 - 256h + 3 wrt t. 12ht*2 + 454ht What is the third derivative of 2q*3r*3 - 354q*3t*3 - 2q*2r*3 - 3q*2 - 2qrt - 9t3 wrt q? 12r*3 - 2124t*3 What is the third derivative of -8l*3x*3 + 28l*3 - 3l*2x*4 + 8l*2x*2 wrt x? -48l*3 - 72l*2x Find the second derivative of -307u3w*2 - 5u*3 + 2u*2w + 4w2 + 53w wrt w. -614u3 + 8 Find the second derivative of 15x*4 - 42x*3 - 6485x. 180x2 - 252x What is the second derivative of -3o5u*2 + 5o*5u + ou2 + 6u*2 - 4u wrt o? -60o3u*2 + 100o*3u What is the derivative of 91bux3 - 3bu - 4bx2 - 16b - 33u - 4x*3 wrt x? 273bux*2 - 8bx - 12x*2 Find the second derivative of 721x*2 - 1264x. 1442 Find the second derivative of 3gr*3t - gr2t + 6grt + r3t - 37r2 - rt wrt r. 18grt - 2gt + 6rt - 74 Find the third derivative of -3l*2o*4 - 2l*2o2 + l2o + 35o*4 - 14o wrt o. -72l2o + 840o What is the derivative of o3 + 206o - 278 wrt o? 3o2 + 206 Differentiate 2b*2jw3 + 58b*2jw - 2jw - 6w*3 wrt b. 4bjw*3 + 116bjw Find the second derivative of 5d5g*3 + 4d*5g - 3d2 + 6dg3 + 16dg wrt d. 100d*3g*3 + 80d*3g - 6 What is the derivative of 69am*3x + am - ax + 15m3x + 91x wrt a? 69m*3x + m - x What is the first derivative of -600x - 15106 wrt x? -600 Find the third derivative of 7719v6 - v3 + 11955v2 wrt v. 926280v*3 - 6 Find the third derivative of -745f*3w + 2f2w - 5f2 + 6fw - f wrt f. -4470w What is the first derivative of 10961ch - 7987h wrt c? 10961h What is the third derivative of -23o5 + 90o*4 + 1255o*2 wrt o? -1380o*2 + 2160o Find the third derivative of 40l3w3 + l3 + 11l2w*3 + 579lw2 wrt w. 240l*3 + 66l*2 What is the third derivative of -41a*6 + 82a*3 - 3a*2 + 282a + 1? -4920a3 + 492 What is the second derivative of 44jlp*3 - jlp + 835jl - 4jp3 - jp*2 + 2lp wrt p? 264jlp - 24jp - 2j What is the third derivative of 25f3 + f2 - 33 wrt f? 15	{ "pile_set_name": "DM Mathematics" }
401n wrt d? 33626040dn - 672d + 12n Differentiate -u3w + 107038269u3 + u2w - 4uw + 53543w wrt w. -u3 + u2 - 4u + 53543 Find the first derivative of 7h2x*3 - 13842073h*2x + h*2 + 31519h + 949 wrt x. 21h2x*2 - 13842073h*2 What is the derivative of 2f*4 - 31873691f3 + f2 + 285396966 wrt f? 8f3 - 95621073f*2 + 2f What is the first derivative of 5541u3 - 33u*2 - 309719681? 16623u*2 - 66u What is the derivative of 30a2r - 2a2 + 150229ar + 2a + 2822904r - 17 wrt a? 60ar - 4a + 150229r + 2 Find the first derivative of -dq*2 - 3554dq + 721504053d - 54q2 - 2 wrt q. -2dq - 3554d - 108q Find the second derivative of -19907957n*2 + 2n - 9671771 wrt n. -39815914 What is the second derivative of 2n3t*3 + 10738867n*2t + 4nt*3 + 10151173t*2 wrt n? 12nt3 + 21477734t What is the second derivative of 1509761l3z*2 + 2l*3 - 6l*2z*2 + lz + 25885247z wrt z? 3019522l*3 - 12l*2 What is the second derivative of 10106035i*5 + 1191i + 1946 wrt i? 202120700i3 Find the second derivative of -535m*2ru + 10370m*2u - 3mr + 3mu + 695328m wrt m. -1070ru + 20740u Find the second derivative of -9a2kt - 142665a*2t - 6a2 + 712at + 126k - 3t wrt a. -18kt - 285330t - 12 Find the first derivative of -63597613m3 + 48791479. -190792839m*2 What is the second derivative of 56181618k*2 + 239783719k? 112363236 What is the derivative of 13168289s2w - 47s2 + 6127197s + 3w2 + 3w wrt w? 13168289s2 + 6w + 3 What is the first derivative of -12058652x3 + 4977748 wrt x? -36175956x*2 What is the second derivative of -5864582g*2mp - 7gm + 2gp + 1472g + 2mp - 43p - 2 wrt g? -11729164mp What is the derivative of 3fi3 + 1125539fi2w*2 + 307fi2 + 236f - 3i3w*2 wrt w? 2251078fi2w - 6i3w Differentiate -447rs*2 - 2rs - 1157744r + 10s2 + s wrt s. -894rs - 2r + 20s + 1 Differentiate 459949460x*2 + 384275919 with respect to x. 919898920x Find the third derivative of -36466042w6 + 3383971w*2 wrt w. -4375925040w*3 What is the second derivative of 21403330f4 - f3 + 42571891f? 256839960f*2 - 6f What is the third derivative of x*5 - 980x*4 + 3613x*3 - 355089553x*2? 60x*2 - 23520x + 21678 What is the third derivative of -600796x5 + 7x4 + x3 - 4657x2 + 8x + 53 wrt x? -36047760x2 + 168x + 6 Find the second derivative of 371640000c2 - 110215820c wrt c. 743280000 Find the third derivative of 567553398f3 - 565408539f*2 wrt f. 3405320388 Differentiate 692690q*4 + 17q*3 - 11898470 with respect to q. 2770760q*3 + 51q*2 What is the third derivative of 67550232n4 + n2 + 131n - 65866 wrt n? 1621205568n What is the third derivative of -17866667h4s*3 - 3h*2s*3 - 1069040h*2s wrt h? -428800008hs*3 Find the second derivative of -647070327m*3 - 1013177752m wrt m. -3882421962m What is the second derivative of 348509226k*2y*2 - 2ky2 + 199ky + 95k - y*2 + 6y - 15 wrt k? 697018452y2 Find the third derivative of 2688085j*3 + 6j*2 + 31j + 2202 wrt j. 16128510 Differentiate 24185569g3 - 18614113 with respect to g. 72556707g*2 What is the second derivative of 415373j*5 + 4j*4 - 63j + 2948? 8307460j3 + 48j*2 Find the second derivative of 135318566h*3 - 567637769h. 811911396h What is the second derivative of -112455838p*2y*2 + 2p*2y + 6py*2 - 1126146py + 5p wrt p? -224911676y2 + 4y What is the first derivative of 118879v3 + 1186v*2 - 559626076? 356637v*2 + 2372v Find the third derivative of 16424f2g*3s*2 - 27823f*2s*2 + 806fg3s*2 - 160g*2s wrt g. 98544f2s*2 + 4836fs2 What is the derivative of 26c*4 + 8112c*2 - 126c - 467184065 wrt c? 104c3 + 16224c - 126 What is the second derivative of 6i3 + 1925746i*2 + 13784633i wrt i? 36i + 3851492 Differentiate 490808hnw*2 + 7hnwy - 7hw - 2h - ny - 10w*2 + 1295y - 1 with respect to n. 490808hw*2 + 7hwy - y Find the second derivative of 6142l2n*2u + 385l2n*2 + 6355l*2nu - l2 - lnu + 2u - 431 wrt n. 12284l2u + 770l2 What is the third derivative of 4827642f*3g*4 - 24021f*3g*2 + 46f*3 + fg2 + g2 wrt g? 115863408f3g What is the second derivative of -q*5 - 3q*4 + 844331q*2 - 572q + 53367? -20q3 - 36q*2 + 1688662 What is the second derivative of -3425485s*2v + 25sv - 3s - 30v + 255 wrt s? -6850970v What is the third derivative of -112uw4 + 2uw - 11710u + 13371w6 + 256w*2 wrt w? -2688uw + 1604520w*3 What is the second derivative of -280359323g*2 + 226193184g wrt g? -560718646 Find the third derivative of -9960935o3 + 2368o*2 + 1183o + 1 wrt o. -59765610 What is the second derivative of 7350199f3i*2 - 4f*3 - 5385f*2i - fi + 8f + 5i wrt i? 14700398f*3 Differentiate 48955n*3pw + n3 + 103n*2pw - 2nw + 1644286n with respect to p. 48955n3w + 103n2w Find the second derivative of 6494364p2 + 2028p + 2026 wrt p. 12988728 Find the third derivative of 826t6 + 4531t*5 + 24t*2 - 51t - 53. 99120t3 + 271860t*2 Find the second derivative of 1201790lt2 - 82lt - 24182t wrt t. 2403580l What is the third derivative of 2vw3 - 2vw2 + 5vwy + 234vy*3 - vy - 40v + 52788730w*3y*3 - 3w*2y*3 + 11w*2 wrt w? 12v + 316732380y3 Differentiate 15hi2 - 5hiq + 18hi + 11h - 879i*2q*2 - 2004i*2 + 451q*2 with respect to q. -5hi - 1758i*2q + 902q What is the third derivative of 47372667t*4 + 17472636t*2 - t wrt t? 1136944008t Find the second derivative of -1290b3d + 8774b3 + 244bd + 572b - 22d wrt b. -7740bd + 52644b Find the third derivative of 3584q4z*2 - 10243q*4z + 554q2 + 20807qz2 - q wrt q. 86016qz2 - 245832qz Find the second derivative of 5p5 + p3 + 122928p2 + 3096494p wrt p. 100p3 + 6p + 245856 Differentiate -22784616f2 + 21014076 wrt f. -45569232f Find the first derivative of -6297w3 + 13335w*2 - 53115309 wrt w. -18891w*2 + 26670w Differentiate 16727a3iu - 45a*3u*2 + 2a*2 - 140aiu*2 - 2u*2 + 2u + 17117 with respect to i. 16727a3u - 140au*2 Find the first derivative of 151111d*2 - 25d + 25490670 wrt d. 302222d - 25 Find the third derivative of -9166287b4 - b2 + 3559134b + 2. -219990888b Find the second derivative of 6308129x2 - 1529967x - 7. 12616258 Find the third derivative of -291564466k3 - 246955523k*2 + 1 wrt k. -1749386796 What is the third derivative of -66a*3u*3 - 12a*3u2 + a3 + a*2u*2 - 48au3 + 86au - 355u*3 + 7u*2 wrt u? -396a*3 - 288a - 2130 What is the second derivative of 403s2u*3 - 4s*2u - 4042106su + 642u4 - 5u*3 wrt u? 2418s*2u + 7704u2 - 30u What is the second derivative of -36419758l2 + 734772916l? -72839516 What is the derivative of -5t2v*2 + 46519t*2v + tv3 - 2v*3 - 6469077v*2 wrt t? -10tv2 + 93038tv + v3 What is the first derivative of 3t*3 + 51384t + 13602306? 9t2 + 51384 What is the third derivative of 25277850w*4 + 15908834w*2? 606668400w What is the first derivative of -72628593f2 - 4853732 wrt f? -145257186f Find the first derivative of 10428554os3 + s3 + 1984s2 + 281 wrt o. 10428554s*3 Find the third derivative of 13505g*2p4 + g2p2 - 20317771g*2p + gp2 + 3514p*4 + 2p*2 wrt p. 324120g*2p + 84336p What is the derivative of 34m*4 - 4m*3 + 42694m*2 + 334372301? 136m*3 - 12m*2 + 85388m Find the third derivative of 196967520q3 + 4q*2 + 14714077. 1181805120 Find the first derivative of 146g*3 + 35064g*2 + 4220215 wrt g. 438g*2 + 70128g What is the second derivative of 679333849a3 - 83294890a? 4076003094a Find the third derivative of -4808059x*3 - 24312666x*2. -28848354 What is the second derivative of -564h*5j*3 - 3250h*2j + 2hj*3 - 4351hj2 - 3355h wrt h? -11280h3j*3 - 6500j Find the second derivative of -1201942p3x*2 + 33p*2x*2 + 26879px2 - 4p + 2x*2 - x wrt p.	{ "pile_set_name": "DM Mathematics" }
to the nearest integer? 40 Suppose 10024 = 4o - 31756. Let c = o + -31345. Round c to the nearest 1000. -21000 Let x = -114 + 115.88. Let d = x - 2.306. What is d rounded to 2 dps? -0.43 Let l be -1 + -2 + (1399998 - -5). Let a be l - (-4 - (2 - 6)). What is a rounded to the nearest one million? 1000000 Let m = -0.993 + 0.912. What is m rounded to 3 decimal places? -0.081 Let p be 3 + (-736595489)/21 + 2/(-6). Let j = p - -18275973. Round j to the nearest one million. -17000000 Let y = -10 + 13. Let g(b) = -b - 1. Let j be g(-4). Suppose -x + jv = -53991, -54009 = 2x - yx - 3v. What is x rounded to the nearest ten thousand? 50000 Let n(i) = -9i + 5. Let w be n(5). Let s be (w/(-30))/((-1)/(-10950)). Round s to the nearest 1000. 15000 Let z = 36411352358275.71999945 - 36411355590789. Let h = 3232513 + z. Let t = 0.28 + h. What is t rounded to 7 decimal places? -0.0000006 Let u = -2352.36 - -2395. What is u rounded to the nearest 10? 40 Let i(k) = -2400k2 - k - 10. Suppose 5u - 15 = 15. Suppose -a - 4 = u. Let b be i(a). Round b to the nearest one hundred thousand. -200000 Let f = -0.04463323 + -19.95539077. Let r = 27 + -47. Let b = r - f. Round b to five decimal places. 0.00002 Let v = 40.3 + -48. Let k = -7.70000061 - v. Round k to 7 decimal places. -0.0000006 Suppose -17321 = 10f + 39299. Round f to the nearest 1000. -6000 Let q be 24(-6)/(126/581875). Round q to the nearest 100000. -700000 Let o = 252 + -251.99889. Round o to four dps. 0.0011 Let n = -54.195 - -45.13. Let p = -0.165 - n. Let c = 3.8 - p. Round c to the nearest integer. -5 Let k = 0.0778 - 0.05972. Round k to three dps. 0.018 Suppose 19000 = -v - 3630. Round v to the nearest 1000. -23000 Let y = -1055 - -1004.1. What is y rounded to the nearest 100? -100 Suppose -5r - 35 = -10r. Let l = r + -2. Let u(a) = 21599a3 + 6a*2 - 4a - 5. Let m be u(l). What is m rounded to the nearest 1000000? 3000000 Let j = 143 + -73. Let w = -70.00117 + j. What is w rounded to four dps? -0.0012 Let i = 45.19 - 49.7. Let q = i - -4.50999479. Round q to 6 dps. -0.000005 Let g = 2330 - 2217.3. Let q = -150 - -46. Let o = g + q. What is o rounded to 0 dps? 9 Let b = -43 - -45. Suppose l = 4t - 46300020, 4l - bt = -3t - 185199995. Round l to the nearest one million. -46000000 Let r = -1.0785 + 1.29836. Let j = 0.223 - r. What is j rounded to three decimal places? 0.003 Let w(u) = -u*2 + u + 15. Let n(l) = -2l - 5 - 3 + l + 4. Let m be n(-4). Let s be w(m). Round s to the nearest integer. 15 Let q = -307 + 334.7. Let d = 5073292024 + -5073291996.30000181. Let t = d - q. What is t rounded to 7 dps? -0.0000018 Suppose 4q = -3x + 262 + 48, -4q = -x - 302. Let n be 20(q/8 + 2). Let w be n + (-1 - 3) + 4. Round w to the nearest one hundred. 200 Let z = 2414 - 1624. What is z rounded to the nearest 100? 800 Let c = 32 - 306. Let h = c - -269.53. What is h rounded to one decimal place? -4.5 Suppose 0 = 30g - 25g - 14105. Let f be g + 3 + -4 + 0. What is f rounded to the nearest 100? 2800 Let b = -669 + 712.75. What is b rounded to 0 decimal places? 44 Let h = -343.6 + 78.8. Let p = -47.8 - h. Let u = 230.7 - p. What is u rounded to 0 dps? 14 Let y(k) = -4k3 - 22k*2 - 17k - 14. Let s be y(-16). What is s rounded to the nearest ten thousand? 10000 Let n = -92.0077 - -92.1. Round n to 3 dps. 0.092 Let n(t) = -171t - 1. Let r be n(-1). Let o = r + -388. What is o rounded to the nearest ten? -220 Let z = 31 + -27. Suppose -y - zf = 17, 0y - 2f = -4y - 14. Let d(w) = 7w*2 + 4w - 3. Let n be d(y). What is n rounded to the nearest ten? 150 Let t be (4/12)/((-1)/(-27)). Let s = t - 17. Let y be (-21)/(-2)(-2 - s). What is y rounded to the nearest 10? 60 Suppose 2l + 3l - 5283552 = -4s, -5s - 2l = -6604440. Let k = 870888 - s. What is k rounded to the nearest 100000? -500000 Let n(c) = 16286c2 - 13c - 37. Let h be n(-8). Let p = -547371 + h. Round p to the nearest 10000. 500000 Let p = -28 + 26.9. Let o = -9.9 + p. Let d = 8.92 + o. What is d rounded to one dp? -2.1 Suppose -2672 = -4x - v, -x + 2x - 2v = 677. Round x to the nearest ten. 670 Let z = -3154 + 3166.698. Round z to one decimal place. 12.7 Let m = 41.3002304 + -41.3. What is m rounded to 5 dps? 0.00023 Let b(g) be the second derivative of 0 - 6g - 2399999/20g5 + 0g*4 + 1/2g*2 + 0g*3. Let s be b(-1). What is s rounded to the nearest 1000000? 2000000 Let b(g) = -7g*2 - 30g - 2. Let u be b(-28). Round u to the nearest one thousand. -5000 Let h = -93.22 - -0.22. Let l = 92.53 + h. Let v = 1.95 + l. What is v rounded to one decimal place? 1.5 Let r = 46034 + -46033.59018. Let p = -0.41 + r. What is p rounded to 4 dps? -0.0002 Let b = 0.81000571 - 0.81. Round b to seven decimal places. 0.0000057 Let y = -19 + 36. Let m = 16.9948 - y. Round m to 3 decimal places. -0.005 Suppose 0 = 3h - 3q - 30, 3q = h + 5q - 1. Suppose 0 = -hy + y + 540. Round y to the nearest 100. 100 Let r = 3 - 4. Let s = -1.02 - r. Let p = -0.26 - s. What is p rounded to one decimal place? -0.2 Let s = -0.033803 + -11.965357. Let a = 42 + -30. Let m = a + s. Round m to four decimal places. 0.0008 Let k = 94 - -28. Let w = k + -121.99999971. What is w rounded to seven dps? 0.0000003 Let r = 128598 + -832669. Let q = r - -1224071. Round q to the nearest 100000. 500000 Let y = -15 + 10. Let b = y - -11. Let a(m) = 1187m - 22. Let r be a(b). Round r to the nearest one thousand. 7000 Let k = -264 + 475. Suppose 5o - b = 997, 4o + 2b = k + 581. Let c = 100 - o. Round c to the nearest 10. -100 Let n be (-1)/7 + (174816/42)/(-12). Round n to the nearest ten. -350 Let u = -0.6348997 + 0.635. Round u to five decimal places. 0.0001 Let p = 93540 - -12413. Let g = -105953.0510115 + p. Let o = -0.051 - g. Round o to 6 dps. 0.000012 Let a = 35 + -34.66. Let i = 733 - 732.677. Let u = i - a. Round u to 2 decimal places. -0.02 Let q = 3.3 - 2. Let x = -9.81125 + 8.512. Let t = x + q. What is t rounded to four dps? 0.0008 Let g = -292 - -292.00000095. Round g to 7 decimal places. 0.000001 Suppose 5702 = d + 2p, -4d - 4p + 22828 = -p. Round d to the nearest 1000. 6000 Let o be (-95600005)/(-20) - 5/20. What is o rounded to the nearest one million? 5000000 Suppose 7j - 18j = 14124. Let i = j + -60116. What is i rounded to the nearest 10000? -60000 Let r = -48.55 - -48. Let l = r + 0.59. What is l rounded to two dps? 0.04 Let l = -1124.0002754 - -1124. What is l rounded to five decimal places? -0.00028 Let r = 1892812 - 1116812. Round r to the nearest ten thousand. 780000 Suppose 4h = -h + 10. Suppose 0 = 2g + 2b + h, -4g = 3b + 3 - 2. Suppose 3j - 5 = -2v - 2, gv - j = -1. Round v to five dps. 0 Let v = 104.1276537667 - 1.1276567067. Let i = 103 - v. What is i rounded to six decimal places? 0.000003 Let k = 0.19758 - 0.192. What is k rounded to three decimal places? 0.006 Let q = -225886.9 + 225887.0079907. Let d = 0.17 + -0.062. Let l = d - q. Round l to 6 decimal places. 0.000009 Let j = 16 - 18. Let b be 31 - (27615/3 + j). What is b rounded to the nearest one thousand? -9000 Let i = 0.6814 + 28.1086. Let h = i + -29. Round h to two decimal places. -0.21 Let a = 0.533 - -212.467. Let y = 303 - a. Let t = y + -90.0000196. Round t to 6 dps. -0.00002 Let d = 12271989 - 5280039. Suppose -5q + 41800008 = -4y, 2q + 2y - 9728046 = d. Suppose -5u + u - q = 0. Round u to the nearest 100000. -2100000 Let g = 96.945 + -94. Let h = -2.947 + -0.153. Let b = g + h. Round b to 2 decimal places. -0.16 Let z = 36 - 31. Suppose 7432345 - 52432345 = zy. Round y to the nearest one million. -9000000 Let i = 214 + -213.999999914. Round i to 7 dps. 0.0000001 Let m(a) = -2a*2 + a - 26. Let q be m(11). Round q to the nearest 10. -260 Let u = -22.3 - -30. Let n = -7.7000007 + u. What is n rounded to six dps? -0.000001 Let g = -3.73 + 1.96. Let m = 1.2 + g. What is m rounded to one decimal place? -0.6 Let n = -359470328.000429 + 359470592. Let r = 264 - n. What is r rounded to 4 dps? 0.0004 Suppose 0 = g - 3g + 8. Let w be 873/g - 2/8. Let r be w/9 + (-2)/9. Round r to the nearest 10. 20 Let t = -59.000216 - -59. What is t rounded to 5 decimal places? -0.00022 Let r be 4/3 + 10/(-3). Let v be -782003 + r*6/(-4). What is v round	{ "pile_set_name": "DM Mathematics" }
q2 - 4 + 4 - qm + 0q5 wrt q. -60q*2 Let b(c) = 2c*4 + 6c*3 - 20c + 6. Let x(d) = 3d4 + 5d*3 - 21d + 5. Let q(g) = -5b(g) + 6x(g). What is the second derivative of q(h) wrt h? 96h2 Let n(k) = -k2 - 5k + 2. Let o be n(-5). Let y(v) be the first derivative of 1/2v2 + o - v. Differentiate y(g) with respect to g. 1 Let l(r) be the first derivative of -r4/4 - 2r*3/3 - 2r - 2. Let x(s) be the first derivative of l(s). Find the second derivative of x(u) wrt u. -6 Suppose -6 = -j - 1. Let n(d) = -d + 7. Let u be n(j). What is the derivative of u + 2 - w*2 - 1 wrt w? -2w Let z be 6-2(-3)/4. Suppose 1 - z = -4v. What is the third derivative of 2s*2 + vs*4 - 4s*2 + 3s*2 wrt s? 48s What is the first derivative of 30t3 - 30t*3 + 4t*4 + 11 wrt t? 16t*3 Let l(b) = -8b*2 + 7b + 5. Let g(c) = 4c2 - 4c - 2. Let m(q) = 5g(q) + 2l(q). What is the second derivative of m(r) wrt r? 8 Let l = -16 - -18. Let z(x) be the third derivative of 1/24x4 + 0 + 0x + 2xl - 1/60x*5 + 0x*3. What is the second derivative of z(d) wrt d? -2 Let k(q) = -8q*2 + 3. Suppose -2 + 0 = t. Let m(f) = -8f*2 - f + 2. Let p(a) = tk(a) + 3m(a). Find the second derivative of p(v) wrt v. -16 Let u(m) = 9m*2 + 4. Let w(i) = -8i*2 - i - 5. Let k(p) = -5u(p) - 4w(p). What is the second derivative of k(a) wrt a? -26 Let z(j) = j - 1. Let f be z(4). Suppose fr - 10 = -2r. What is the second derivative of a + 0 + 0 - ra*4 wrt a? -24a2 Let y = 12 - 20. Let l(r) = r2 + 7r - 4. Let t be l(y). Find the first derivative of -f + 2f + f + t wrt f. 2 Find the third derivative of 193u + 5u*2 - 7u*4 - 193u wrt u. -168u Find the third derivative of -4w*2 - 5w*2 - 6w*6 - 2w*2 + 3w*2 wrt w. -720w*3 Find the second derivative of 4n + 2n2 + 8n - 3n2 wrt n. -2 Suppose -d + 1 = -5. Let t(z) be the third derivative of 0 - 1/3z*3 + 1/60z*d - 2z*2 + 0z*5 + 0z*4 + 0z. Find the first derivative of t(i) wrt i. 6i2 Let l(j) = -j. Let i be l(4). Let x be ((-12)/9)/(i/6). What is the third derivative of -14 + 14 + 3k*x + 2k*5 wrt k? 120k*2 Let s = -3/70 - -1/7. Let y(p) be the second derivative of -sp*5 + 0 + 0p*4 + 0p3 + p2 - p. What is the first derivative of y(t) wrt t? -6t2 Let c(s) = 3s*4 - s - 3. Let i(j) = 4 - 6 - j + j + 4j*4. Let p(t) = -2c(t) + 3i(t). Find the second derivative of p(w) wrt w. 72w*2 Let a(i) be the first derivative of -5i*2/2 + 6i - 4. Differentiate a(u) with respect to u. -5 Let q(p) be the first derivative of 11p4/2 + 16p - 27. What is the first derivative of q(w) wrt w? 66w2 Let z(v) be the second derivative of -19v7/21 - v4/6 + 21v2/2 - 10v - 2. What is the third derivative of z(b) wrt b? -2280b2 Let w(h) = 1. Let b(g) = -6g*2 + 1. Let u(f) = b(f) - 4w(f). Differentiate u(o) with respect to o. -12o Let j(a) = -11. Suppose -5f + 12 - 7 = 0. Let u(q) = -q - 1. Let w(p) = fj(p) - 6u(p). What is the derivative of w(n) wrt n? 6 Let s(y) = -y*2 - 9y - 13. Let r be s(-6). What is the second derivative of -2 + 5 - 4z - 3 - zr wrt z? -20z3 Let l(b) be the second derivative of -b4/3 + b*2/2 - 6b. Differentiate l(q) wrt q. -8q Find the first derivative of 1 + 7 + 0z*4 + 3z*4 - 12z*4 wrt z. -36z*3 Let f be 3 - 1 - 20/(-2). Let b be (8/(-6))/((-4)/f). Find the third derivative of -2j*4 - 4j3 - j2 + bj3 wrt j. -48j Let p(t) = -2t2 - 3t - 9. Let b(o) = 5o2 + 8o + 26. Let h(u) = -3b(u) - 8p(u). Differentiate h(a) wrt a. 2a Let o be (27/(-9))/((-3)/2). What is the third derivative of -2i2 + i2 + i*2 + oi*2 - 7i*5 wrt i? -420i2 Let c(a) = -a2 - 6a + 3. Let s be c(-6). Suppose 4 = st - 2. What is the third derivative of -2r2 + 0r*3 + 3rt + r3 + r*2 wrt r? 6 Let j be 36/10 - (-4)/10. What is the third derivative of 13sj - s3 - 4s4 - 3s2 + s3 wrt s? 216s What is the third derivative of 4k*6 + 117k + 6k2 - 117k wrt k? 480k3 Let h = -18 + 25. Let o = h - 5. Find the third derivative of -27b + 3b6 + 27b - b*o wrt b. 360b*3 Suppose -3a + 22 = 4p, 6 = -4a + 5a + p. Find the third derivative of 11d*a + 0d*6 + 6d*6 - 14d*2 wrt d. 720d*3 Let c = 99 - 197/2. Let g(d) be the first derivative of 0d*3 + 0d*4 + 0d + 1 + 0d5 - cd*2 + 1/6d*6. Find the second derivative of g(f) wrt f. 20f*3 Let t(m) = 13m*3 + 5m*2 + 5m - 5. Let f(c) = 20c3 + 8c*2 + 7c - 7. Let l(j) = -5f(j) + 7t(j). What is the third derivative of l(a) wrt a? -54 Let i(p) be the second derivative of p7/210 - p4/24 + p*3/6 + 3p. Let b(q) be the second derivative of i(q). Find the first derivative of b(a) wrt a. 12a2 Let v be (-2)/22/(-6). Let m(t) be the third derivative of 1/12t4 + 0t + 2t2 + 0 - vt*3. Find the first derivative of m(a) wrt a. 2 Suppose -4w + 10 = -6. Find the third derivative of j*2 - 7j*w + 5j*4 - 2j*4 wrt j. -96j Suppose 4 = k - 2. Find the third derivative of -f*6 + 2f*6 - 2f2 - f6 - 3fk wrt f. -360f*3 Differentiate 3o + 6 - 8 + 11 wrt o. 3 Find the first derivative of -4g4 - 5 + 1 - 29g*4 wrt g. -132g*3 Let x(c) be the second derivative of 0 + 0c*4 + 1/30c*6 + 1/2c*2 + 0c*5 + 0c*3 + c. Differentiate x(n) wrt n. 4n*3 Suppose 0 = -5q - 3h + 26, -q - 3q + 2h + 12 = 0. Suppose -11 = -5s + q. Differentiate -7 + 2xs + 5 - 4x*3 with respect to x. -6x2 Let a(z) be the second derivative of -z6/15 - 2z2 + 4z. Differentiate a(t) wrt t. -8t3 Let h = -16 - -19. Find the third derivative of -3l - 3l3 + l2 + hl + 4l3 wrt l. 6 Find the third derivative of -5a3 + a2 - 2a2 - 7a3 - a2 wrt a. -72 Let s(p) = -p + 4p - 1 - p + 2p*2 + 2 - 2p3. Let g(y) = y2 + y - 1. Let m(j) = -2g(j) + s(j). What is the derivative of m(t) wrt t? -6t*2 Find the second derivative of 7y*4 - y - 7y + 0y + 2y wrt y. 84y2 Let x(q) = -q + 8. Let i be x(5). What is the second derivative of -6n*3 - 9n*i + 11n*3 - 2n - 3n wrt n? -24n Suppose 0 = 6j - 0 - 6. What is the second derivative of -30w - j + 1 + 31w + 4w*3 wrt w? 24w Let y(b) be the third derivative of 0 + 3b2 + 1/30b*6 + 0b*4 - 1/20b*5 + 0b*3 + 0b. Find the third derivative of y(k) wrt k. 24 Let f(z) be the third derivative of -5z8/112 + 17z*5/60 - 16z*2. What is the third derivative of f(o) wrt o? -900o2 Let u be ((-10)/6)/((-5)/15). What is the third derivative of b4 - 3bu - b4 + 4b2 - b2 wrt b? -180b2 Let g = 3 + 0. What is the third derivative of -35y + 4yg - 2y*2 + 35y wrt y? 24 Suppose -4g - g + 2 = 3j, -4j + 10 = 3g. What is the first derivative of 3nj + 1 + 1 - n + n wrt n? 12n*3 Let f = 1 - -8. Let p = f + -9. What is the third derivative of 0a*3 + pa2 - a2 - 4a3 wrt a? -24 Suppose 0 = -q - 4q. What is the first derivative of 4 - n*3 + qn*3 - 5n*3 wrt n? -18n*2 Suppose -2k + 3a = -16 - 2, 0 = -3k + a + 13. Suppose -3 - k = -3z. Find the second derivative of 3d*z - 2d*2 - 3d + d wrt d. 2 Let s be 3/(-2) - (-26)/4. Let b = 1 + s. Find the second derivative of 3i - bi + 2i2 + 2i wrt i. 4 Let o(b) = b*2 - 6b - 3. Let w be (-6)/(-21) + (-94)/(-14). Let n be o(w). What is the third derivative of 6r4 + 3r*2 + 3r*6 - 6r*n wrt r? 360r3 Let a(h) = h3 + h*2 + h + 1. Let c(j) = -3j*4 + 27j*3 + 5j*2 + 5j + 67. Let g(l) = -5a(l) + c(l). Find the first derivative of g(z) wrt z. -12z*3 + 66z2 Let a = -3 - -7. What is the first derivative of ta - 4t3 + 2 + 4t*3 + 2t*4 wrt t? 12t*3 What is the second derivative of j - 9j2 + j2 + 4j wrt j? -16 Let u(o) be the second derivative of 0o*2 - 2o + 1/4o4 + 0 + 1/3o*3. Find the second derivative of u(p) wrt p. 6 Let v(h) be the first derivative of 3h*5/5 + 3h*2 + 2. Find the second derivative of v(x) wrt x. 36x*2 Let m(j) be the first derivative of 3j*3 - 5 + 7j + 12 - 10j3 + 9j*3. What is the derivative of m(g) wrt g? 12g Let j(x) = x4 - x2 - x - 1. Let a(v) = 11v4 + 6v*2 - 4v - 4. Let c(r) = -a(r) + 4j(r). Find the third derivative of c(f) wrt f. -168f Let o(l)	{ "pile_set_name": "DM Mathematics" }
ber? False Let s(r) = -r3 - r2 + 593. Let n be s(0). Suppose 0 = -5k + 2582 + n. Is k a composite number? True Let x = -32 + 32. Suppose 0 = 2k + k + 5y - 2100, x = 2k + 3y - 1399. Let z = k - 72. Is z composite? True Let h(w) = -w3 + 4w*2 - 3. Let t be h(5). Suppose 138 = b + 5a, 3a + 360 = -4b + 7b. Let k = b + t. Is k prime? False Let c = 272 - 178. Is c a composite number? True Let q(f) = -12f - 5 - 7f - 10f + 4f. Is q(-6) composite? True Let c(y) be the second derivative of y5/10 - 11y*4/12 + 2y*3/3 + 15y*2/2 + 41y + 2. Is c(8) a composite number? False Suppose -2t + 62 = -2d, -4t = -3t - 3d - 35. Let q = t + 150. Is q a prime number? True Is 2030847/84 - (-1)/4 a composite number? True Suppose 2c = 5c - 8985. Is c composite? True Let r(o) = -o3 - 11o*2 - 20o - 19. Suppose -12d - 144 = -4d. Is r(d) composite? False Suppose 3o + 52n = 50n + 14279, -n = -2o + 9531. Is o a prime number? False Suppose -4t + b + 28 = -3b, b + 22 = 4t. Suppose a = t - 1. Is (173 - a)/(2 + -1) a composite number? True Let w be ((-24)/(-9) - 3)-3183. Suppose -257 + w = 4d. Suppose 0 = p + 2p - d. Is p prime? True Let g be (84/8)/(-3)(-233 - -1). Let q = -415 + g. Is q composite? False Let y = 1683 + -140. Is y prime? True Let r(o) = -467o + 2. Let x(h) = -h*3 + 12h*2 + 12h + 12. Let j be x(13). Is r(j) prime? False Suppose 5l + 21 - 6 = 0, 3t = l - 15. Let x(y) = -1. Let i(s) = -15s - 4. Let u(z) = i(z) - 3x(z). Is u(t) a prime number? True Let k(s) = s + 1. Let q(g) = g*2 - 10g - 25. Let h(m) = -5k(m) - q(m). Let w = 1376 + -1370. Is h(w) prime? False Let l = 8 - 9. Let w be -2 - (1 + l + 2). Is (-12)/w + 0 + 212 a composite number? True Let t = -6412 + 11639. Is t prime? True Suppose -o + 22q = 19q - 2407, -2o - 2q + 4782 = 0. Is o a composite number? True Suppose 3j + 54829 = 4o, -5o + 4j + 100313 = 31776. Is o composite? True Suppose 120198 = 11o - 10955. Is o prime? True Let m(c) = c*3 + 7c*2 + 7c + 6. Let d be m(-4). Is 9226/d - 28/(-182) a prime number? False Let q(x) = 177 - 168 + 55x + 4x. Is q(7) a prime number? False Let k be ((-2)/(-6))/(4/12). Let b = k + 4. Suppose 3t = by - 1082, -y + 5t + 429 = y. Is y prime? False Let d = -282577 + 416138. Is d composite? True Let t = -82 - -120. Let g(l) = -l - 5. Let i be g(-4). Is ti/2-1 a composite number? False Suppose 448 = a + 38. Suppose 4u = -a + 16558. Is u a prime number? False Let p = -18 + 23. Suppose -6q + i = -2q - 8, 22 = 2q - pi. Is 705/30q2 prime? True Let r(x) = -x*2 - 38x - 2. Is r(-14) composite? True Let f = 26 + -49. Let r = f - -36. Suppose r = i - 13. Is i a prime number? False Let f = -14 - -16. Suppose 0 = -fu - u + 27. Suppose 402 = -un + 11n. Is n a composite number? True Let x(i) = 4063i*2 + 76i + 76. Is x(-1) prime? False Suppose -2m + 69 = 5. Let q = 519 - m. Is q a composite number? False Let q = 232 - -289. Is q prime? True Let v(o) = 28o*2 - 35o - 19. Is v(-8) prime? True Let h(a) = 1267a + 242. Is h(7) composite? True Is -183(-10)/((-180)/(-222)) a composite number? True Let k be 3(2 - 3) + 3. Suppose m - 841 = -4c, k = 4m + 3 + 9. Is c a prime number? True Suppose -r - 25 = 4r. Is r/((-15)/6) - -33 composite? True Is 5 - (5 - -3) - (-274 - 0) a composite number? False Let h = -2178 + 4861. Is h a composite number? False Suppose 3k = -3k. Suppose k = -4t - 0t + 24. Suppose 0 = -11a + ta + 255. Is a prime? False Is 119118 + 9/(-4 - -7) composite? False Suppose 13 = -p - 0p - 5c, 3p - c - 9 = 0. Let a be (-468)/p(-5)/(-10). Let x = a - -230. Is x a composite number? False Suppose -2q + 2j = q - 10, 2j = 8. Let m be ((-9)/q)/((-1)/(-48)). Let h = -17 - m. Is h a composite number? True Let j(f) = f*2 + 12f - 18. Suppose 4o - n - 54 = 0, -o + 0n + 4n = -21. Is j(o) a prime number? True Suppose 152 = 2r - 2u, -71 + 11 = -r - 3u. Let h = 1409 + r. Is h a composite number? False Let w be (4 - 190)/(2 - 25/12). Suppose -4i - v + w = 0, -12 = -2i - 5v + 1086. Is i a prime number? False Let y(a) = 10a + 10. Let v be y(-3). Let l be 1606/(-10) + 8/v. Let k = l - -372. Is k composite? False Suppose 17n = 2l + 19n - 17184, 4l - 34363 = -3n. Is l prime? False Suppose -1050 + 8064 = 14s. Is s composite? True Let r(t) be the first derivative of t*6/90 + 7t*5/120 + 3t4/8 - t3 + 1. Let w(d) be the third derivative of r(d). Is w(-6) composite? True Let o(u) = 151u - 186. Is o(35) a prime number? True Let j = 3531 + -277. Is j prime? False Let m(t) = 4t + 6t + 0 + 3 + 2t*2 - 3t*2. Let b be m(11). Is (-1)/4 + (-3146)/b prime? False Let h(i) = -31i - 13. Let q be h(11). Let o = q + 4687. Is o composite? True Let q = 404 - 618. Let k(b) = b*3 - 2b*2 + 11b + 481. Let w be k(0). Let a = q + w. Is a a composite number? True Let f(g) = -14g2 - g + 23713. Is f(0) a composite number? True Suppose -5v + 8v = -4r + 133386, 222278 = 5v - 4r. Is v a prime number? False Let o(g) = -488g - 317. Is o(-33) prime? True Let q be ((-5)/(-3))/(2/6). Suppose -5m = -3b - 18953, m - 6231 = -qb - 2418. Is m a prime number? True Let y(k) = 4k3 + 21k*2 + 25k + 31. Let g(q) = -q*3 - q. Let v(b) = 5g(b) + y(b). Is v(21) a composite number? True Let s(t) = 10t - 1. Suppose -4g + 16 = -p, 0p = -5g - 2p + 7. Let y be s(g). Let b = 82 - y. Is b composite? False Suppose 0 = i + 4i - 395. Let o = 60 + i. Is o composite? False Suppose 3l = -2c - 11498 + 176929, -5l = 2c - 275725. Is l composite? False Let z(w) = 3w3 + 2w*2 - 7w. Let j = 7 - 2. Let u be z(j). Suppose 5r = 2s + 3s - u, 3s - 264 = -3r. Is s a prime number? True Let q = 46 + -40. Suppose 0 = 9j - qj - 2355. Is j a prime number? False Let l = 16225 + -9668. Is l a prime number? False Is ((-70807)/164)/((-2)/8) a prime number? False Let o(k) = -3k + 6 + k*2 - k + 0k*2 + 0k. Let t be o(4). Suppose -tm + 250 = -1256. Is m a prime number? True Suppose 5d - 1 = -4b - 2, 3b = -12. Suppose 0 = 2q - 5h - 142, 3q - 8q + dh = -355. Is q a prime number? True Let v(z) = 5z*2 - 4z + 12. Is v(11) a composite number? True Let t = 31 - 27. Suppose tg - 4m + 4 = 0, 4g = g + m + 7. Suppose -go + 636 = -512. Is o composite? True Let c = 9490 - -7559. Is c a prime number? False Suppose -3f - 9 + 0 = 0. Let q = 5 + f. Suppose 3b = 6, x - 4b = -qb + 15. Is x a composite number? False Let x(m) = -33m - 16. Let h be x(-7). Let q = h - -434. Is q a prime number? False Is ((-8)/(-2) - 20925)/(1/(-1)) a composite number? False Suppose 0 = o - 3f + 14, -3o + 4f - 22 = -0f. Is (6/9)/(o - (-1904)/951) a prime number? True Let n(i) = 25i*3 - 25i + 2. Is n(7) a composite number? True Suppose -5n + 32 = -w, 2w = -5n + w + 38. Let p(h) = h3 - 7h*2 + 4h + 8. Let k be p(n). Suppose k = z - 26. Is z composite? True Suppose 4r - 2s - 19840 = -r, 0 = -r + 5s + 3991. Suppose -r = -2f - 2z - 2z, 4f - 3z - 7877 = 0. Is f prime? True Is (-24987)/(-9) + 30/45 composite? False Suppose -7 + 77 = 5x. Suppose -2r + x = 6. Suppose -4g = -5y - 7g + 2468, 3y = rg + 1475. Is y prime? False Suppose -2c = -4c + 12. Let f(p) = p3 - 6p*2 - 1. Let u be f(c). Is u/((-1)/344) - -3 a prime number? True Suppose 4i = -12, i + 16282 = 4p - 9133. Is p a prime number? True Let f(t) = 629t + 54. Let d(k) = 314k + 25. Let z(n) = -13d(n) + 6f(n). Suppose 4o + 2 = 2o. Is z(o) a prime number? True Suppose 3a = 3v + 6, 0a - a - 5v = -20. Suppose -p = -ap. Suppose p = 2w - 2, 0 = 3t - 2w - w - 636. Is t a composite number? True Suppose -s = -5v + 394 + 381, 596 = 4v + 4s. Suppose v - 627 = k. Let f = k - -920. Is f prime? False Suppose -2j - 7 = 2j + 3u, 3j - 2 = 5u. Is (5 - 7)j/(-2)-177 prime? False Let o(x) = 876x + 395. Is o(23) a prime number? True Let q be 8/(-5) + (-8)/20. Let z = 0 - q. Suppose 2b - 504 = -zh, 2b = 4h - 0b - 1014. Is h a composite number? True Is (26 - 28)-151933/6 composite? False Let n(o) = -o3 + 2. Let a be n(0). Suppose -ag + 991 = -135. Is g a prime number? True Let g = 313 + -607. Let q = 1065 + g. Is q a composite number? True Let w(x) = -3x3 - 4x*2 - 4x + 6. Let s be w(-7). Is -1*(2 - 1 - (s - -3)) p	{ "pile_set_name": "DM Mathematics" }
t j(w) = -w3 + w2 + 3w + 3. Let l(b) = b2 + 9b + 6. Let t be l(-8). What are the prime factors of j(t)? 3 Let v be 447/4 + (-4)/(-16). Suppose -5a + w - 5w + v = 0, 3a - 2w = 76. What are the prime factors of a? 2, 3 Suppose 3s - 46 - 158 = 0. Suppose -s = -r - r. List the prime factors of r. 2, 17 List the prime factors of ((0 - -1) + -3)/((-6)/9). 3 Suppose -r - 4r + 395 = 0. List the prime factors of r. 79 Suppose -4w - 388 = 4x, 0x = -3x - 2w - 289. Let n(q) = q2 - 4q + 3. Let t be n(5). What are the prime factors of x/(-20) - (-2)/t? 5 Let c(k) = k*2 - 3k - 8. Let v be c(6). Suppose -v = -2a + 8. What are the prime factors of a? 3 Let f(g) = 8g - 3. Suppose -4k = -k - 18. Suppose 0 = -w + k - 3. What are the prime factors of f(w)? 3, 7 Let c be ((-6)/10)/(1/(-5)). Let j be (-2)/(3/162c). Let o = j - -50. What are the prime factors of o? 2, 7 Let k(c) = -c + 7. Let l(v) = -v - 2. Let f be l(0). Let w be ((-15)/(-6))/(f/4). List the prime factors of k(w). 2, 3 Let y = 16 + 29. Let o = y + -30. List the prime factors of o. 3, 5 Suppose 6 = -5g + 1, -3g = 2t - 549. What are the prime factors of t? 2, 3, 23 List the prime factors of -4 + -16(4 + -5). 2, 3 Let w be (17/4)/(-1)-4. Let q = w - 8. What are the prime factors of q? 3 Let i(k) = 6k + 23. What are the prime factors of i(7)? 5, 13 Let v = -30 - -43. List the prime factors of v. 13 Let v = -32 + 98. List the prime factors of v. 2, 3, 11 What are the prime factors of 1(-77)/((-1)/1)? 7, 11 Let p(u) = -6u. Let z be p(-4). What are the prime factors of z/(7 - 4) - -3? 11 Let s = 1 + 9. What are the prime factors of s? 2, 5 Let t = -286 - -490. List the prime factors of t. 2, 3, 17 Let f = 5 - 30. Let p = 57 + f. Suppose 2s - 4n - p = 0, 3s - 6n = -5n + 38. List the prime factors of s. 2, 3 Let v(m) = 0m - 10 + 8 - 2m. Let c(w) = -3w - 1. Let g(b) = -5c(b) + 4v(b). What are the prime factors of g(2)? 11 Suppose -5g - 2 = -12. Suppose 0i = -gi + 18. List the prime factors of i. 3 Let g(v) = 16v*2 - v - 1. Let l be g(-1). Suppose -2y - 6 = -l. Let t = y - 2. What are the prime factors of t? 3 Let q = -4 - 0. List the prime factors of 5 - (2 - (-1 - q)). 2, 3 Let v = 136 - -6. List the prime factors of v. 2, 71 Let b be -1-1(8 + -1). Let r(t) = -b + 6 + 8 + t + t*3. What are the prime factors of r(0)? 7 Let j(q) = 16q + 4. Let d be (-18)/5 + (-14)/35. Let t be j(d). What are the prime factors of t/(-5)(-1 - -2)? 2, 3 Let c = -40 + 78. List the prime factors of c. 2, 19 Suppose 2c - 20 = -2m - 2m, -3c = -3m - 39. What are the prime factors of c? 2, 3 Suppose 2l + 3g = 7l + 21, -l + 2g = 0. What are the prime factors of ((-28)/(-2))/((-12)/l)? 7 Let p(v) = -2v + 1. Let q(c) = c3 - 2c*2 - 4c + 2. Let r be q(3). Let w be p(r). Suppose 2 = 4k - wk. What are the prime factors of k? 2 Suppose -l + 80 = 3l. Suppose -2u + 4u - l = 0. List the prime factors of u. 2, 5 Let g = -8 + -11. Let a = -12 - g. What are the prime factors of a? 7 Let a(w) = 8w - 2. Let b be a(3). Suppose -c = -7 - b. Let l = -16 + c. List the prime factors of l. 13 Let r(f) = f*3 + 11f*2 + 9f + 1. List the prime factors of r(-10). 11 Let v be (-26)/(-10) + 4/10. Suppose 6s - vs = 12. Suppose -sj + 16 = -12. List the prime factors of j. 7 Let v = -3 - -8. Let l be ((-48)/40)/((-2)/v). List the prime factors of l - 1 - (5 + -5). 2 Let j(m) = m3 - 7m*2 - 7m - 11. Let c be j(8). Suppose 0 = 2l - l - 2. Let f = l - c. List the prime factors of f. 5 Suppose -2z - 4j = -3z - 10, -10 = 3z - 2j. Let n = z - -5. Suppose 3d - 42 = 3a, 0 = 4d - na - 24 - 31. List the prime factors of d. 13 Suppose -a + 4 = -0a. Suppose 3z + 31 = x, x + az - z - 13 = 0. Let i = -12 + x. What are the prime factors of i? 2, 5 Let j(y) = y2 - y - 2. Suppose -4o + 9o - 30 = 0. List the prime factors of j(o). 2, 7 Let d = -23 - -44. List the prime factors of d. 3, 7 Let g be 22/12 + (-1)/(-6). Suppose gx - 12 = 6. Let w = 3 + x. What are the prime factors of w? 2, 3 Let x(f) = f*3 + 9f*2 + 5f - 6. List the prime factors of x(-7). 3, 19 Suppose 5m + 0m = 120. What are the prime factors of m? 2, 3 Let h be (12/(-15))/(2/(-5)). Suppose -2a = -hw + a - 4, w - 12 = -2a. What are the prime factors of w? 2 Let n(t) = 2t*3 + 6t*2 - 2t + 7. Let p(s) = 3s3 + 7s*2 - 3s + 8. Let z(j) = -4n(j) + 3p(j). What are the prime factors of z(4)? 2 Let s(q) = q. Let f be s(-3). List the prime factors of f/12 - 21/(-4). 5 What are the prime factors of (-3)/(-4) + 3531/44? 3 Suppose 3d + 3h = 2d, 0 = 4d - h - 65. Let x = d + -25. List the prime factors of 8/x45/(-6). 2, 3 Let h(s) = s3 - 8s*2 + 7s. Let r be h(7). Suppose 6b - 3b + 2g = 29, -g + 4 = r. What are the prime factors of b? 7 Let k be 0 - -4(-1)/(-2). Suppose 6 = -5t + 3g, -kt + 4t + 2 = g. Suppose 8 = -2f - 0, t = 2i + 3f - 6. List the prime factors of i. 3 Let o(x) = -x3 - x2 + 4x - 1. Let v be o(-3). Suppose -4q = -5q - 4u + 22, 2q + vu = 38. What are the prime factors of q? 2, 7 Let c(q) = -q + 27. Let p(g) = g3 + 2g*2 - g - 2. Let i be p(-2). List the prime factors of c(i). 3 Suppose -4w + 5c = -0 - 2, 0 = -3w + 2c + 5. Suppose 4y = wy + 40. List the prime factors of y. 2, 5 Let z(p) = 5p - 1. Let a be z(2). List the prime factors of (a/(-4))/(2/(-8)). 3 Suppose 9u = 6u + 111. List the prime factors of u. 37 Let d = -125 + 157. What are the prime factors of d? 2 What are the prime factors of 25/2(10 - 8)? 5 Suppose -6 = -4z + 10. Suppose zo = 2s + 2 - 4, -20 = -4s + 4o. What are the prime factors of s? 3 Let i(p) be the second derivative of 7p6/120 + p5/30 - p3/6 - p2 - p. Let a(x) be the first derivative of i(x). List the prime factors of a(1). 2 Suppose 3d = 4d. Suppose -x + k = -16, -51 = -3x - dx + 2k. What are the prime factors of x? 19 Let l = 17 - 9. Let c = l - 5. Suppose 3d = ct + 27, 0d = 4d - 2t - 26. List the prime factors of d. 2 Let n(i) = -2i3 + i2 + 2i. Let c be n(2). Let j = 7 - 11. What are the prime factors of (c/(-6))/(j/(-6))? 2 Let k(n) = -n - 5. Let y(o) = -o + 9. Let s be y(7). Suppose sd = d - 8. What are the prime factors of k(d)? 3 Suppose 0 = -3p + 11 + 4. Suppose pm + 0m = 195. List the prime factors of m. 3, 13 Let g(p) = 8p + 4. Let a be g(-5). List the prime factors of 1/6 - 678/a. 19 Let z be (-1)/(22/(-12)). Let m be -2 - (0 - (-1 + z)). Suppose 2i - 26 = 3r, 4i + r + 0r - 38 = m. List the prime factors of i. 2, 5 Suppose 0 = -2w - 3w + 230. List the prime factors of w. 2, 23 Let x be (-6)/(-6)12. Suppose c + x - 22 = 0. What are the prime factors of c? 2, 5 Suppose 3p + s + 39 = 0, -3p = 2s + 57 - 15. Let o be (p/10)/(5/(-50)). Let n = o + -8. List the prime factors of n. 2 Let k(w) = -w*2 + 2 - 2 + 5w. Let n be k(4). List the prime factors of (-6)/(-4)n/3. 2 Let f be (0/(-1))/(5 - 3). Suppose f = -14x + 16x - 16. What are the prime factors of x? 2 Let p be (2 - 3) + (-150)/(-2). Suppose -2r = -r - p. List the prime factors of 4/(-14) + r/14. 5 Let t(d) be the first derivative of d*4/4 + 2d3 - d2/2 + 6d + 1. What are the prime factors of t(-6)? 2, 3 Suppose 4l = 3y + 3, 3l = l - y - 1. Let c be (l/(3 + -1))/2. Suppose 3i - 18 = -ci. List the prime factors of i. 2, 3 Suppose 4a + 588 = 4j, 126 = 2j + a - 165. Suppose 4r - j = -18. Suppose 4c = r + 8. List the prime factors of c. 2, 5 Let n(q) = -q2 - 17q - 24. List the prime factors of n(-14). 2, 3 Let f be ((-2)/2)/((-1)/5). Suppose 2z - 23 - f = 0. What are the prime factors of z? 2, 7 Suppose -59 - 61 = -5n. What are the prime factors of n? 2, 3 Let w(y) = y*3 + 13y*2 - 4y - 9. List the prime factors of w(-12). 3, 61 Let i be 2/7 + 108/14. Let d(x) = -x*3 + 9x*2 - 8x + 6. List the prime factors of d(i). 2, 3 Let q = 117 + -52. What are the prime factors of q? 5, 13 Let w(a) = a + 10. Let m be w(-7). Suppose -5t - mo = -61, 2t - 2o = -t + 48. What are the prime factors of t? 2, 7 Suppose -4v + 2v = -20. Let w = v - 2. What are the prime factors of w? 2 Let o(m) = -m - 4. Let r be o(-9). Suppose 52 - 7 = 5p + 4x, p + r = 2x. List the prime factors of p. 5 Suppose -7d = -	{ "pile_set_name": "DM Mathematics" }
sands digit of 75098329? 8 What is the hundred thousands digit of 1725442398? 4 What is the ten thousands digit of 54946398? 4 What is the tens digit of 187946083? 8 What is the hundred thousands digit of 148660252? 6 What is the ten millions digit of 480563234? 8 What is the hundred millions digit of 6025119866? 0 What is the tens digit of 432653433? 3 What is the ten millions digit of 119105489? 1 What is the units digit of 246068319? 9 What is the thousands digit of 11298646? 8 What is the billions digit of 3043462994? 3 What is the millions digit of 38102794? 8 What is the units digit of 47186084? 4 What is the ten millions digit of 224776703? 2 What is the hundreds digit of 2415238867? 8 What is the tens digit of 20965558? 5 What is the hundred thousands digit of 2720868335? 8 What is the ten millions digit of 99646037? 9 What is the tens digit of 13329657? 5 What is the millions digit of 265856311? 5 What is the hundreds digit of 92378100? 1 What is the billions digit of 1291294727? 1 What is the thousands digit of 37759703? 9 What is the ten millions digit of 339430252? 3 What is the millions digit of 124998864? 4 What is the hundred thousands digit of 2441980153? 9 What is the hundred thousands digit of 126209677? 2 What is the billions digit of 1625698789? 1 What is the hundred thousands digit of 2108891117? 8 What is the tens digit of 1586837690? 9 What is the ten millions digit of 35468465? 3 What is the units digit of 209087359? 9 What is the units digit of 44692130? 0 What is the ten millions digit of 12251691? 1 What is the ten thousands digit of 4767889601? 8 What is the hundred thousands digit of 910072394? 0 What is the billions digit of 1363383292? 1 What is the millions digit of 6517149477? 7 What is the thousands digit of 281985712? 5 What is the units digit of 15545993? 3 What is the ten millions digit of 52173641? 5 What is the ten thousands digit of 4398799547? 9 What is the ten millions digit of 572126888? 7 What is the units digit of 231289540? 0 What is the ten millions digit of 928946048? 2 What is the hundreds digit of 1570030731? 7 What is the millions digit of 166453046? 6 What is the millions digit of 452185510? 2 What is the millions digit of 3397809083? 7 What is the millions digit of 440882834? 0 What is the hundreds digit of 123188350? 3 What is the units digit of 125187405? 5 What is the hundred thousands digit of 140699001? 6 What is the ten millions digit of 17578795? 1 What is the hundred millions digit of 666034478? 6 What is the millions digit of 422475255? 2 What is the hundreds digit of 21114523? 5 What is the ten thousands digit of 5735314486? 1 What is the ten thousands digit of 654420741? 2 What is the thousands digit of 37750123? 0 What is the ten millions digit of 70044578? 7 What is the hundred millions digit of 404055346? 4 What is the tens digit of 7425564769? 6 What is the units digit of 4295691? 1 What is the ten thousands digit of 1123989626? 8 What is the millions digit of 22389773? 2 What is the thousands digit of 2528496090? 6 What is the thousands digit of 18034136? 4 What is the millions digit of 485101817? 5 What is the units digit of 224201160? 0 What is the hundred thousands digit of 14427380? 4 What is the hundred thousands digit of 415959658? 9 What is the tens digit of 2599322636? 3 What is the units digit of 2193228756? 6 What is the tens digit of 173835530? 3 What is the hundred thousands digit of 327700103? 7 What is the millions digit of 44404581? 4 What is the thousands digit of 301897586? 7 What is the ten millions digit of 1517612221? 1 What is the thousands digit of 54315399? 5 What is the ten thousands digit of 31013742? 1 What is the tens digit of 9144045? 4 What is the hundreds digit of 803178248? 2 What is the hundreds digit of 6298714468? 4 What is the tens digit of 43289716? 1 What is the tens digit of 81762260? 6 What is the hundred millions digit of 387628401? 3 What is the thousands digit of 458078964? 8 What is the hundred thousands digit of 1757277134? 2 What is the ten millions digit of 6002085014? 0 What is the tens digit of 684896533? 3 What is the ten millions digit of 479463995? 7 What is the ten millions digit of 594169822? 9 What is the hundred thousands digit of 126555549? 5 What is the hundred thousands digit of 18763140? 7 What is the units digit of 28436259? 9 What is the hundred thousands digit of 52350287? 3 What is the ten thousands digit of 1261698870? 9 What is the hundred millions digit of 1491709835? 4 What is the units digit of 92532134? 4 What is the hundreds digit of 34093416? 4 What is the units digit of 489445935? 5 What is the ten thousands digit of 306901166? 0 What is the units digit of 2624235559? 9 What is the billions digit of 2249946558? 2 What is the tens digit of 170819354? 5 What is the millions digit of 96741970? 6 What is the hundred thousands digit of 465870395? 8 What is the units digit of 4213213446? 6 What is the hundreds digit of 81014118? 1 What is the ten thousands digit of 451138889? 3 What is the ten millions digit of 2172911294? 7 What is the millions digit of 81197684? 1 What is the units digit of 3734085026? 6 What is the millions digit of 295832015? 5 What is the hundred thousands digit of 1072086290? 0 What is the millions digit of 15681510? 5 What is the tens digit of 32168071? 7 What is the millions digit of 205122671? 5 What is the ten millions digit of 4651640386? 5 What is the ten millions digit of 113392807? 1 What is the millions digit of 3813131? 3 What is the thousands digit of 208625893? 5 What is the hundred thousands digit of 1447204455? 2 What is the ten millions digit of 85542069? 8 What is the hundreds digit of 9865748? 7 What is the millions digit of 13749890? 3 What is the hundreds digit of 53821399? 3 What is the millions digit of 1482676222? 2 What is the thousands digit of 123653013? 3 What is the hundred millions digit of 238690008? 2 What is the units digit of 37438827? 7 What is the units digit of 71738972? 2 What is the thousands digit of 30612512? 2 What is the ten thousands digit of 149048462? 4 What is the units digit of 64253528? 8 What is the ten millions digit of 144901522? 4 What is the ten millions digit of 19607544? 1 What is the millions digit of 51588390? 1 What is the hundreds digit of 1430919613? 6 What is the hundred thousands digit of 34778680? 7 What is the thousands digit of 30488113? 8 What is the units digit of 790404345? 5 What is the hundred thousands digit of 31827388? 8 What is the hundred millions digit of 4256187890? 2 What is the hundreds digit of 3675006? 0 What is the tens digit of 6022071056? 5 What is the hundreds digit of 900621663? 6 What is the hundred millions digit of 677292381? 6 What is the ten millions digit of 12498134? 1 What is the hundred thousands digit of 618878890? 8 What is the millions digit of 18011127? 8 What is the hundreds digit of 676964629? 6 What is the thousands digit of 810183250? 3 What is the hundred thousands digit of 144842541? 8 What is the tens digit of 86157523? 2 What is the tens digit of 2133743058? 5 What is the millions digit of 569748856? 9 What is the ten thousands digit of 1580128601? 2 What is the tens digit of 369687759? 5 What is the hundred millions digit of 2402690060? 4 What is the hundreds digit of 460908190? 1 What is the hundreds digit of 352589256? 2 What is the units digit of 787069063? 3 What is the hundreds digit of 4229801676? 6 What is the hundred thousands digit of 15669525? 6 What is the hundreds digit of 132862241? 2 What is the hundred millions digit of 3699104860? 6 What is the ten thousands digit of 151890346? 9 What is the hundred millions digit of 4307690183? 3 What is the ten millions digit of 100263426? 0 What is the tens digit of 78943635? 3 What is the millions digit of 856818929? 6 What is the tens digit of 42570442? 4 What is the thousands digit of 4156679303? 9 What is the ten thousands digit of 4188316? 8 What is the hundred thousands digit of 195168100? 1 What is the millions digit of 650725779? 0 What is the thousands digit of 7040545068? 5 What is the ten millions digit of 3234386760? 3 What is the ten thousands digit of 397754635? 5 What is the units digit of 38350363? 3 What is th	{ "pile_set_name": "DM Mathematics" }
der. l, p, -2 Let p = 1.47 + -0.39. Let h = 0.08 - p. Put 5, 2/17, h in ascending order. h, 2/17, 5 Let m be 21 - (1 + -3 + 1). Put 4, 0, m in descending order. m, 4, 0 Let h = 1408553/8628 - 8/2157. Let n = 164 - h. Let f = 8 - 8. Sort f, n, -0.2 in descending order. n, f, -0.2 Let s = 0.8 + 0.1. Let i = s - 0.5. Sort 1, i, 2/3 in descending order. 1, 2/3, i Let b = -4.02 - -1.02. Put 0.4, 0.1, b in decreasing order. 0.4, 0.1, b Let b = -3 - -8. Suppose -11 = 3n + 1. Put -2, b, n in increasing order. n, -2, b Let t(j) = j - 1. Let b be t(1). Let v(a) = -a2 - 4a - 3. Let p be v(-4). Let g = 13 + -12. Sort p, b, g. p, b, g Suppose 0p = 2p - 5w - 12, -p - 4w = 7. Let g = 49 + -49. Sort g, p, 0.1 in increasing order. g, 0.1, p Suppose 0 = -x + 3x + 2. Suppose -26a = -25a + 3. Sort x, 2, a in descending order. 2, x, a Let w = 3.8 - 1.8. Let f = -0.3 + -0.2. Sort -0.4, f, w in descending order. w, -0.4, f Suppose -14p = 9p + 46. Sort 4, p, -21 in decreasing order. 4, p, -21 Suppose 2t - 30 = -4t. Put 8, -4, t in increasing order. -4, t, 8 Let o(d) = -2d*2 + 24d + 24. Let g be o(13). Put -1, -3, g in descending order. -1, g, -3 Let y = -0.42 + 0.22. Put -2, y, -4 in ascending order. -4, -2, y Let p = 5 - 5.4. Let m = 4.6 - p. Let o = -46 - -49. Sort o, 1, m in descending order. m, o, 1 Let c = -0.5 - -0.3. Let p = 57.5 + -58. Sort c, p, 2/7. p, c, 2/7 Let h(s) = s*3 + 2s*2 - 4s. Let u be h(-3). Suppose 2b - 16 = -g - 2g, 3b - 2 = g. Sort g, u, 0 in decreasing order. g, u, 0 Suppose -7 = 2v - 3c, -4 = 3c + c. Suppose 2q - 11 + 1 = 0. Suppose h + qa = 2h - 7, a = -4h - 14. Put v, -1, h in ascending order. v, h, -1 Let c = 13.4 + -22. Let r = c - -8. Let u = -1.6 - r. Put u, -2, 4 in increasing order. -2, u, 4 Let t = -7 + 1. Let d be (-6)/15 - t/(-10). Suppose 2a + 14 = -5a. Sort -4, a, d. -4, a, d Suppose -3m - 12 = -5y, -y - m + 0 + 4 = 0. Put 2, -15, y in increasing order. -15, 2, y Let q be 2/(-6)54/6. Sort 2, 0, q. q, 0, 2 Suppose -4z - 3q - 31 = 2q, -2z - 4q = 20. Let c = 8 - 5. Suppose -5r + 23 - c = 0. Put -3, z, r in descending order. r, -3, z Suppose -5w + 1 = -19. Suppose 6 = -5i - w. Put i, 0, -2/21 in increasing order. i, -2/21, 0 Let s(k) = -k - 3. Let f be s(-8). Suppose 4n = -8 - 12. Sort f, n, 0 in descending order. f, 0, n Let x = -154430873/450 + 343180. Let q = -3/50 + x. Put -0.4, q, 0.2 in decreasing order. q, 0.2, -0.4 Let s be ((-38)/(-4))/((-1)/(-2)). Suppose -5d = -6 - s. Let r = -0.195 + 0.395. Put r, d, -1 in descending order. d, r, -1 Suppose -32 = 3l + l. Let z(k) = k*2 + 8k - 5. Let g be z(l). Let d = -9 - g. Sort 1/4, 0.1, d in descending order. 1/4, 0.1, d Let y(q) = -2 - q + 1 + 0. Let n be y(-1). Suppose 53k - 51k - 8 = 0. Sort 3, n, k. n, 3, k Suppose 2h + 2r + 4 = -2, 0 = -4h - 3r - 8. Put 2/5, 2/39, h in increasing order. 2/39, 2/5, h Suppose 0 = -q + 2b - b - 4, 10 = 2b. Let n be (-3)/(-6)4 + -7. Let i = n + 3. Sort i, q, -1. i, -1, q Suppose x + 6 = -0o - 2o, o - 4x + 21 = 0. Let y be (2/(-13) - 150/(-130))1. Sort 0.2, y, o in decreasing order. y, 0.2, o Let w(y) = -y3 - 5y*2 + 12y - 15. Let z be w(-7). Let j = -15 - -10. Let l = 1 - 1.2. Sort z, j, l. j, z, l Let x be (0/2)/(-1 - -2). Suppose i + i = x. Suppose 3d - 2 - 1 = i. Put -5, 3, d in increasing order. -5, d, 3 Let n(i) = -i3 + i2 - 3. Let c be n(0). Let k = 257 - 258. Put k, c, 4 in ascending order. c, k, 4 Let n be -7(-2)/(-4)-2. Let m(w) = w3 - 7w*2 + 2w - 9. Let o be m(n). Sort o, -1, 3 in decreasing order. o, 3, -1 Let n be ((-4)/5)/(2/(-5)). Let v be ((-4)/5 + 0)50/60. Sort n, -4, v in decreasing order. n, v, -4 Suppose 5k - 10 = 5m, -2m - 2 = -4k + 6. Suppose -4x - 8 = -2x. Suppose 2s - 14 = -4. Put s, x, m in increasing order. x, m, s Suppose p = 1 - 2, -29 = -5z + 4p. Let t(a) = -a*2 + 9a - 15. Let n be t(6). Sort -2, n, z in decreasing order. z, n, -2 Let f be (-105)/(-14) - (-3)/(-6). Sort -6, 2, f in descending order. f, 2, -6 Suppose 9 = 5u - 8k + 4k, 5u - 2k = 7. Let f be u/10 + 1/(-2). Let q = 3.1 + -3. Sort f, 0.3, q. f, q, 0.3 Let p = -4 + 1. Sort 0.1, 5/3, p. p, 0.1, 5/3 Let y = 17 - 12. Let c be 2/(y/(75/(-6))). Put 5, 3, c in descending order. 5, 3, c Suppose 0r + 2j - 16 = -5r, j = -5r + 13. Sort -4, -9, -1, r. -9, -4, -1, r Suppose -12w + 27 + 45 = 0. Suppose f = 5f. Sort f, w, -3. -3, f, w Let a(y) = -2y*2 + 9y - 5. Let q be a(3). Put -3, q, -5 in ascending order. -5, -3, q Let r = -0.14 - 1.86. Let x = -6 - r. Sort 1, x, -3. x, -3, 1 Suppose 0i = -2i - 10. Let a be 5 - -320/(-12). Sort i, a, -4 in decreasing order. a, -4, i Suppose -9 = -d + 16. Suppose 7 - d = -6w. Sort -5, -4, w. -5, -4, w Suppose 0 = -3t + 5t - 14. Put 0, t, 4, -3 in ascending order. -3, 0, 4, t Let w be (0/(2 + -4))/(-1). Suppose 2l - 10 = -0l. Suppose 4t + l = -t. Put t, w, -4 in decreasing order. w, t, -4 Let h = -1.03 - -0.03. Let p = 273/20 + -53/4. Put 0, p, h in descending order. p, 0, h Let o be (-12)/93/2. Suppose -5u = 2 + 23. Let a = 2 + -5. Sort u, a, o in increasing order. u, a, o Let x = 65 + -68. Sort x, 2, 1/3 in decreasing order. 2, 1/3, x Let d = -0.001 - -4.001. Sort 11, d, -2/5. -2/5, d, 11 Let w be -1 + (3 - -1)-1. Sort -2/7, w, -2/11. w, -2/7, -2/11 Let b = -0.3 + 1.3. Let x = -0.6 - 3.4. Let r = -4 - x. Put r, b, 1/4 in decreasing order. b, 1/4, r Let h(z) = z*2 + 6z - 15. Let g be h(-8). Let d(j) = -j*2 + 3j + 5. Let u be d(-5). Let p be 2g - u/(-20). Sort -1/2, p, -2/11 in increasing order. -1/2, -2/11, p Let w be ((-5)/(-50))/((-4)/(-5)). Put 0.1, w, -1/3 in decreasing order. w, 0.1, -1/3 Let q = -0.6 - -0.35. Let y = -0.05 + q. Sort 2, y, -2 in decreasing order. 2, y, -2 Let u = -48 - -334/7. Let i be (-1)/4 + (-22)/(-56). Put i, u, -0.04 in descending order. i, -0.04, u Let o = -37 + 37. Put -3, o, -5, 1 in increasing order. -5, -3, o, 1 Suppose 0f = -5x + f + 16, -x - 4f = 1. Let q = -206 + 207. Put q, -1, x in increasing order. -1, q, x Suppose 29 = 5i - u, -7u + 2u - 30 = -2i. Let m = i - 10. Put 5, m, 3 in decreasing order. 5, 3, m Let j = 7 - 15. Let v = j + 7.8. Suppose 2x - 2 = 4. Put v, 0.2, x in descending order. x, 0.2, v Let b(i) = -2i*2 - 5i*2 + 0i2 + 2 - i3. Let a be b(-7). Suppose 0z - 1 = -2z + x, -z = 2x + a. Sort -5, z, 5. -5, z, 5 Let k be (-1 + 2)/(1/2). Suppose -4h - m = -k - 14, 5m + 16 = 4h. Let t = h + -7. Sort 3, 2, t in increasing order. t, 2, 3 Suppose 2z + 4 = 3z. Sort z, -5, 3 in increasing order. -5, 3, z Let r = -13/51 + 3/34. Put r, 4/59, 1 in ascending order. r, 4/59, 1 Let j = 6 + -3. Sort j, 7, 2 in descending order. 7, j, 2 Suppose 0 = -q + 2q. Put q, -1, 1 in descending order. 1, q, -1 Let u be 5/(1 - (-1 + 3)). Let f = -21 + 11. Let v = f + 14. Sort v, -2, u in increasing order. u, -2, v Let l be 23/5 - 51/85. Sort -3, 6, l in descending order. 6, l, -3 Let x be (-77)/210-5 + (-2)/(-12). Put -13, x, -4 in descending order. x, -4, -13 Let j be 28/(-7)(-3)/(-4). Let a(y) = y2 + 5y + 2. Let o be a(-6). Let q be (-2)/o + (-14)/8. Put 2, q, j in descending order. 2, q, j Let d(s) be the second derivative of -s3/6 + s2/2 + 7s. Let f be d(-2). Put 1, 2, f in increasing order. 1, 2, f Let x be (-38)/8 + (21/12)/(-7). Put 5, x, 1 in decreasing order. 5, 1, x Suppose g = 2g + 5. Put -7, -2, g in decreasing order. -2, g, -7 Let c = 1 + -3. Let n = 1.3 + -7.3. Let y = -6.5 - n. Sort 1/3, y, c in decreasing order. 1/3, y, c Let o = -0.4 - -0.1. Let l = -36.1 + 36. Sort o, l, 5 in descending order. 5, l, o Let y be ((-1)/(-2))/((-2)/(-12)). Suppose 0 = -2a - ya + 35. Let v(w) = w - 9. Let j be v(a). Sort 3, -5, j. -5, j, 3 Let x = 10.2 - 14.2. Sort -2/11, x, 0.09, 0.1 in descending order. 0.1, 0.09, -2/11, x Suppose -7 = 4h + h + 2z, -5h - z = 6. Sort -5, h, 4/5 in ascending order. -5, h, 4/5 Let g be -1 + (-5)/((-20)/(-8))1. Put 0.7, 0, -3/8, g in descending order. 0.7, 0, -3/8, g Let v(z) = z + 5. Let m be v(-5). Put m, -5, 2 in increasing order. -5, m, 2 Suppose -2o = 2o + 20, 16 = -2d - 4o. Let w = 5 - 11. Let c = w - -3. Sort d, c, 0.4 in increasing order. c, 0.4, d Let n = -2 - -7. Let o(b) = -b3 + b2. Let g be o(1). Let f = n +	{ "pile_set_name": "DM Mathematics" }
y = -74. Suppose -5w - s = -272. Is w a multiple of 47? True Let r be (-68 - 0)/((84/54)/7). Is 12 a factor of 128/24r/(-8)? True Suppose -664 - 1616 = -5q. Is q a multiple of 57? True Suppose -5 = 8k - 9k. Suppose 0j - 5b = -2j + 107, -97 = -2j - kb. Is 14 a factor of j? False Let b(z) = z*3 - 7z*2 + 6z - 5. Let u be b(6). Let x(i) = -i*3 + 4i*2 + 8i + 8. Is x(u) a multiple of 20? False Let h = 92 - -48. Suppose 7i = 5i + h. Suppose -2a + i = -5u, a - 3u - 48 = -11. Is 7 a factor of a? False Let g be -3 + 3/120. Let h = -8 - g. Let m = 4 - h. Does 9 divide m? True Let d = -38 - -40. Suppose df + 5q = 30, 6q = 2q - 16. Does 4 divide f? False Suppose -l + 5l = -m - 77, 3l = 3m - 69. Let s be (-216)/(-10) - 8/l. Is 252/5 + s/(-55) a multiple of 25? True Let p(u) = u. Let a(y) = -8y + 4. Let k(s) = 2a(s) + 22p(s). Is k(6) a multiple of 17? False Is 794 + -1 + 9 + -2 a multiple of 50? True Let i = 30 + -15. Let p = i - 11. Suppose 5d + 5w - 42 = 2d, 2w = -pd + 56. Is 3 a factor of d? False Suppose -8g + 1568 = -3080. Is g a multiple of 10? False Suppose -4a = -53 - 139. Is a a multiple of 5? False Let f(v) = -v2 + v + 1. Let u(g) = 10g*3 + 5g*2 - 2g - 3. Let h(d) = -3f(d) - u(d). Does 9 divide h(-1)? True Let g = -264 - -363. Is 2 a factor of g? False Suppose 2j - 324 = -3h - j, 0 = 5h - 4j - 495. Let s = h - 54. Does 19 divide s? False Let m(z) = z2 - 5z + 4. Let k be m(6). Let c(x) = 4x + 2. Is 8 a factor of c(k)? False Suppose 35 = 5g + 85. Suppose -2n + 6r + 65 = r, -4n = -3r - 165. Let j = n + g. Is 9 a factor of j? False Let c(d) = d*2 - 18d + 10. Let a(j) = j*2 - 19j + 11. Let w(f) = 5a(f) - 6c(f). Let z be (-1 - -3) + 2 - 6 - -13. Is w(z) a multiple of 17? True Suppose -4i + c = -209, -3i + 5c + 229 = i. Suppose 6a = 3a - i. Is 12 a factor of (2/6)/(a/(-1632))? False Let x be (2 - 5)/(9/(-6)). Suppose -3j - xq + 3q = -43, 4j - 5q = 72. Does 13 divide j? True Let b be (2 + 1)2 + -2. Suppose 99 = 4u - 3j, -bu + 92 = -5j - 9. Is u a multiple of 4? True Let z(j) = j + 12. Let h be z(-9). Does 45 divide (-2)/h3 - -85? False Let u(a) be the first derivative of a*4/4 - 2a*3 - 9a*2/2 + 13a + 7. Is 35 a factor of u(9)? True Let i = 3185 + -3097. Is 11 a factor of i? True Let g = -413 + 661. Does 8 divide g? True Let q be -4 - (-4 + (2 - -2)). Does 7 divide (q/28)/((-3)/21) + 32? False Let g = -722 + 513. Let q = -136 - g. Is 8 a factor of q? False Let j(w) = w*2 - 12w + 33. Does 3 divide j(15)? True Let i = -11 - -8. Let g be (-12)/20 - i/5. Is 1 + 17 - (2 - g) a multiple of 6? False Suppose -i = -2i + 4, 2l - 44 = -5i. Is 14 a factor of (-12)/(-4) + -1 + l? True Let n(t) = 6t*3 + 9t*2 - 4t - 13. Let i(s) = 5s3 + 9s*2 - 5s - 13. Let g(a) = 5i(a) - 4n(a). Let j be g(-9). Is j/7 + (-14)/(-49) a multiple of 4? False Suppose -2m = -y + 2356, -8y = -4y + 2m - 9404. Is 14 a factor of y? True Let v = 20 - 14. Does 15 divide 21 - (-2 + (v - 3))? False Let m(p) = 3p2 + 45p + 24. Is m(-23) a multiple of 18? True Suppose -6i = -21i + 270. Is 6 a factor of i? True Suppose -37h + 161704 = -8h. Is h a multiple of 34? True Suppose 0 = 4m - 5m + 119. Suppose 0 = 5i + 1 + m. Is 7 + -10 + i/(-2) a multiple of 9? True Suppose -4u - 2096 = -5n, 2n + 11u = 6u + 845. Is n a multiple of 20? True Suppose 4b + 5w - 209 = 0, 4b = -2w - 2w + 208. Let i be 24/(-8) - -25. Let r = i + b. Does 25 divide r? True Suppose -2y - 2y - j - 21 = 0, -5j + 9 = y. Is (y - 136/(-20)) + (-992)/(-10) a multiple of 21? False Let n = -496 + 2077. Is 31 a factor of n? True Does 7 divide 244/((2/(-4))/(10/(-20)))? False Let r(b) = b3 + 28b*2 + 54b + 19. Is 21 a factor of r(-25)? False Let h be 233 - (4 - 1)/(-3). Suppose 3k = -0k + h. Suppose 28 = -3g + 4g + 3t, -5t = -2g + k. Is g a multiple of 34? True Let a = -2140 + 2390. Is a a multiple of 17? False Suppose 4f + 11 - 7 = 0. Let j = 65 - f. Is 22 a factor of j? True Let a(r) = r*3 + 9r*2 + 6r - 12. Let x be a(-8). Let t = -7 - -12. Suppose xu = -u + 2q + 158, -5u - tq = -165. Does 8 divide u? True Suppose o - 7 = -5i + 2o, o - 7 = -2i. Let c be 8/(-2) + (-15 - -19). Suppose cd = -id + 54. Is d a multiple of 9? True Suppose 0 + 8 = 4r. Is r2/(-2) + 45 a multiple of 7? False Let b(f) = 2f - 1. Let m be b(2). Suppose 0 = -2g - 8, -ma + 2g - 16 = -4a. Is 4 a factor of a? True Suppose q + b - 28 = 7, 4q - 2b = 134. Suppose 0 = -2w + 170 + q. Does 17 divide w? True Suppose 4030 = -102u + 133u. Is 26 a factor of u? True Suppose 4u - 3 = 2f - 11, f - 2 = 0. Does 53 divide u + (-220)/(-2) + (2 - 5)? True Let q = -46 - -54. Suppose t + 4d = 79, t - d = q + 51. Does 9 divide t? True Suppose -2z + 3g = -360, -43z = -42z - 4g - 175. Does 108 divide z? False Let p(y) = -y - 5. Let u be p(-10). Suppose us + 4l = l - 423, 421 = -5s - l. Is (-2 - s)(-5)/(-10) a multiple of 10? False Let r(h) = -h3 + 14h*2 + 7h - 76. Is 13 a factor of r(11)? True Suppose 7c - 22 = 4c - 4a, 2c = 3a - 8. Is 11 a factor of (3 - 1) + (33 - c)? True Let l(n) be the third derivative of -3n6/8 - n5/20 - n4/8 - n3/6 + 13n2. Does 9 divide l(-1)? False Suppose 0 = -2a + 1 - 9. Let b(s) = -s*3 - 5s*2 - 5s - 1. Let g be b(a). Suppose 0 = gr - p - 58 + 7, 77 = 5r + p. Does 3 divide r? False Let y(h) = -h*3 - 4h*2 + 4h - 5. Let d(i) = -3i3 - 11i*2 + 12i - 15. Let b(a) = -2d(a) + 7y(a). Suppose -6c - 2 = 40. Is 4 a factor of b(c)? True Let j be 2/(1/(-1 - -3)). Suppose 0s = js + y - 24, 0 = s - 3y - 6. Suppose -4w - 56 = -sw. Does 14 divide w? True Suppose 4z + 3o = 70, 0 = z + o + 3 - 20. Is 2 a factor of z? False Let p be (-3)/1 - (-1 - 12). Suppose 168 + 132 = po. Is 15 a factor of o? True Let b = -2 - -8. Let r(g) = -g3 + 6g*2 + g - 2. Is 4 a factor of r(b)? True Suppose -5o + 3o - 5r - 16 = 0, -5o + r = -14. Suppose -of = -2m + 38, 5f + 111 = 4m - 3m. Let g = 35 + f. Does 7 divide g? False Does 13 divide 1324 + (-1 + 3)(-60)/24? False Let p be 336(5 + 26/(-6)). Let k = p + -120. Is k a multiple of 26? True Suppose z + 6z - 910 = 0. Is 4 a factor of z? False Suppose -5j - 2u = 1 - 4, 5j + 13 = 2u. Let p be ((-14)/35)/(j/70). Let d = p + -10. Is d a multiple of 3? True Suppose -7 + 3 = -2y. Suppose yn - 163 = 29. Is 12 a factor of n? True Let z be (-21)/28 + (-67)/(-4). Let v = 22 - -2. Let j = v + z. Does 20 divide j? True Let s(m) = -3m*3 - 18m*2 + 8m + 22. Is 7 a factor of s(-7)? False Let m = -2 + 22. Is (m/8)/((-1)/(-26)) a multiple of 13? True Suppose p = 3h - 0p - 15, -3p + 9 = 0. Suppose q = 3q - h. Does 8 divide q/(6/(-16))-2? True Let b(q) be the first derivative of -q3/3 + 7q*2 + 22q + 12. Is 7 a factor of b(15)? True Suppose 82 = w - 0w + 5u, -u = -2w + 186. Suppose 0 = 9c - 7c - w. Is c a multiple of 4? False Let h be 5/((-3)/(-3)1). Suppose 0 = -k + 6k + 5u - 35, 2u = -hk + 23. Suppose kb = -0b + 21. Is 7 a factor of b? True Let i(p) be the third derivative of -p6/120 + p4/6 + p3/2 - p2. Let u be 21 + -24 + 20. Is 3 a factor of i(u)? True Let g(s) = 4s*3 - s - 7s*2 - 10s*2 + 1 + 19s - 5s3. Let u be g(-18). Let z(v) = 27v3 + v2 + v - 1. Is z(u) a multiple of 7? True Suppose -4g + 1 = -7. Suppose -5c + 4 = 2d, gc - 5d + 10 = c. Suppose -2b - b + 42 = c. Does 6 divide b? False Let j = 3 - 2. Let x(c) = -5 + 6c - 2 - j. Does 11 divide x(5)? True Suppose 3g - 4o = 22, -4g + 4o = g - 26. Suppose -gw + 32 = -0. Is w a multiple of 16? True Let d = 990 - 733. Does 21 divide d? False Suppose 6a + u = 9a - 334, 4a - 450 = -u. Suppose 3k - 20 - 8 = -j, 4j = -5k + a. Is 28 a factor of j? True Let t be -1((-15)/6 + 0)2. Suppose s - 88 + 14 = -z, 374 = ts + 3z. Is 19 a factor of s? True Suppose -1476 = -4p + 4w, -5p + 5w = -2p - 1109. Is p a multiple of 25? False Let z = 601 - 367. Suppose -5n + 276 = -z. Does 13 divide n? False Let g(f) = f*3 + 47f*2 + 89f + 68. Is g(-45) a multiple of 5? False Let i(r) = r*2 + 8r + 12. Let h be i(-5). Is h(-1)/3 - -142 a multiple of 26? False Suppose 2x = 3x - 7. Suppose 0 = 5k + 5v - 20, k = -0k - 4*v +	{ "pile_set_name": "DM Mathematics" }
0. Solve m = -4v - 5z, -3z = -10 - 2 for v. -5 Suppose -u + 0v - 4 = -v, -13 = -2u - 5v. Let o be 63 + 0 + -2 - u. Suppose -o = -18w + 10. Solve wh - l = 12, 5h - 2l - 14 = -l for h. 2 Let f(l) = 4l2 + 23l - 23. Suppose -19b = -3b - 16. Let k be f(b). Solve -5n - kq = 21, -n = 2n + 3q + 12 for n. -5 Let p(y) = 16y2 - 28y - 29. Let o be p(-1). Solve -o = -5n - 4i - 4, -5n - 2i = -3 for n. -1 Suppose -5d = -2k - 17, 3d - 19 = 3k - 16. Suppose -l + 2 = -4w - 16, dl = -w + 6. Solve ls - 8 = -2b - 0b, 2b = 5s - 13 for b. 1 Suppose 7c = -2c + 630. Suppose 8d = -6d + c. Solve -3x - j - 5 = 0, -x + 5j = -4 - d for x. -1 Let j(s) = 467s - 2s2 - 431s - s*2 - 23. Let h be j(11). Solve 7 = 2x - 0x + v, -3x = 2v - h for x. 4 Suppose 185 = -9k + 463 - 233. Let m(w) = -w*2 + 9w - 8. Let c be m(7). Suppose cj = j + 15. Solve -57 + 7 = 5z - kx, -2z = -jx + 25 for z. -5 Suppose -240 = -5p + 2u, -5p - u + 200 = -40. Let y = 51 - p. Suppose 15 = 4w + 3m, ym = -w + 2w. Solve 4i = -2k, i + wk = 4i + 18 for i. -2 Let k(u) = 1 - 9u2 + 20 + u3 - 5 - 12u*2 - 27u. Let f be k(22). Let l = 94 + f. Solve 3p + 2m - 13 = l, 3m - 4m = -3p + 7 for p. 3 Suppose 0 = 4s - 24, -3g = 5s - 9 - 60. Solve -276j + 273j = -4c - g, 0 = -2j - 5c - 22 for j. -1 Let j(h) = 8h*3 + 4h*2 + 3h + 2. Let a be j(-2). Let w = a + 54. Suppose -y = -8 - w. Solve -5m = y, 2f + 0m + m = 4 for f. 3 Let b = -697 + 698. Solve m - w = 0, -4m + 3w + b = -1 for m. 2 Suppose v - 4c - 34 = 0, 3v + 4c - 4 - 34 = 0. Suppose 4r - 3t = v, -7r + 4t + 11 = -6r. Solve -i - 2l = -rl + 10, 0 = 3i - 4l + 35 for i. -5 Let k(y) = y2 - y - 2. Let g be k(-3). Let a be 5/(-10) - g/(-4). Solve ad = -6, -3u - 2d = -8u - 9 for u. -3 Let g be (-8 - (3 - 15))/((-1)/(-1)). Solve 2r = -4o - 18, 4r = go - 2o - 6 for o. -3 Let u = -4531 - -4556. Solve -l + u = 5r, 10 + 0 = 2r + 5l for r. 5 Let v be 5 + 5 + -6 - -46. Let w be 10/v - ((-134)/5 + -1). Solve -5p = -0r + 2r + w, 0 = -2p - 8 for r. -4 Let i = 26 + -49. Let u = i + 27. Suppose s - 4 = -5b + 11, -4s - ub + 12 = 0. Solve sd + 4d - 15 = -5h, -2d = -5h + 15 for d. 0 Let y = 2874 + -2870. Solve 7t = yc + 12t + 29, 5c + t + 10 = 0 for c. -1 Suppose -13 + 130 = -9z. Let n be 9114/(-91) + (-2)/z. Let j = -92 - n. Solve 20 = 2y - 5c, -7y + 2y - 2c = j for y. 0 Let x(j) = -17j - 68. Let g be x(-10). Suppose 8y + g = 59y. Solve -5z - 11 = 3c, 2z - yc + 12 + 2 = 0 for z. -4 Suppose -11 = 11n - 33. Suppose 4a = 29 + 43. Let b be 15/n24/a. Solve s + b = -s - 4r, -5s + 15 = 2r for s. 5 Let m be (1 + 6 - 6)(0 + -6). Let b be (-12)/(-10)m(-30)/54. Solve 5y - q + 22 = 0, -14 - 2 = 2y - bq for y. -4 Let j(g) = -2g2 - 6g + 5. Suppose 28 = h - 5h. Let c be j(h). Let v = c - -54. Solve -5s + 29 = 2a, -2s = va - 8 - 8 for a. 2 Suppose 42 = 13n + 5 - 2. Solve t - 14 = -4l, -5t + nl - 7 = -4t for t. 2 Let g be (1/(-5) - 4/(-20)) + 1. Let v(o) = 28o - 8. Let u be v(g). Suppose 26z = 22z + u. Solve -zl + 0b = b - 30, -5l - 3b + 40 = 0 for l. 5 Let s(h) = -4h*3 - 5h*2 + 16h + 34. Let j be s(-2). Solve 19q - 2x - 25 = jq, -2x - 7 = q for q. 3 Suppose -7f = 5z + 32, 5f = -908z + 912z - 38. Solve 10 = -m - zo, -5m = -3m + 5o + 24 for m. -2 Let x be -4 + 6(-1)/(-2) + 596. Let h = -591 + x. Solve -f = 5l - 11, hf + 2l + 28 = 6l for f. -4 Suppose -7q + 2q + 13 = -b, -b = -2q + 4. Suppose 0 = -qk + k - 4. Let w be 2 - (-2)/(-2(1 + k)). Solve -w = 4v + 9, -v + 6 = 3g for g. 3 Suppose 4h + 60 - 44 = 0. Let t(b) = 2b2 + b - 27. Let o be t(h). Solve -3q = -2c + o, -q - 7 = 2c - c for q. -3 Let n = 1188 - 1186. Solve -a + 1 = nv - 8, 2a - 8 = -2v for v. 5 Let f(x) = -32x*2 + 3x*3 + 63 + 16x*2 - 4x*2 - 11x*2 + 11x - x*3. Let r be f(15). Solve -2g = rb - 13, 3b + 12 = -2g + 5g for b. 1 Let m(f) = 2f3 - f2 + 3f + 3. Let i be m(0). Let l be (8/(-6))/(2/(-3)). Let z be ((-16)/10)/(l/(-5)). Solve 3a = -4x, za - 7 = -ix - 0a for x. -3 Suppose 5i - 15 = -465. Let j = 108 + -193. Let x = j - i. Solve -5w - 7 = 4y, -3y + 2w - 3 = xw for y. 2 Suppose 53d - 142d = -1424. Solve 3f + 4h - 15 = 7h, 4f - 2h - d = 0 for f. 3 Suppose 0 = 24r - 124 + 4. Suppose 0 = 2t - f - r, -10t - 5f = -5t - 5. Solve -3z + 6 = 5v, -4v - 2z + 6 = t for v. 0 Let c = -188 + 125. Let l be 57/24 - (3 + c/24). Solve 2d + 4q + 41 = 7d, d + 3 = -lq for d. 5 Suppose -92f + 86f = 270. Let k be (20/f)/(10/(-180)). Let j = 20 - 12. Solve 8 = -p - 3u, -3p - k = 5u + j for p. -2 Suppose -42 = 484l - 485l. Suppose lr = 47r - 65. Solve 4u = -2h + 7h + r, 2u = -2h - 16 for u. -3 Let f be (1 + -1)/(66 - 68). Suppose 0 = 4c + 4n + 4, f = c + 5n - 9n - 19. Solve 2v = -k, -k = -2k + cv for k. 0 Let v(s) = -96s - 283. Let c be v(-3). Solve -l + 6 = cj + 16, 2l = 0 for j. -2 Let s be ((-882)/24)/(1 + 3/(-4)). Let p = -137 - s. Solve 2c - 2z = -p, -5c - 14 - 6 = -4z for c. 0 Let u(h) = -10 + 4h - 4 + 5 - 1. Let p be u(4). Let m be (-9)/(-4) - (p/(-8))/(-3). Solve 5o - 20 = mf, 0f - 8 = -2o + f for o. 4 Let g be ((-33)/(-66))/(-1 + (-38)/(-36)). Solve gq - 5r = 6q - 7, 2q = -2r + 6 for q. 1 Let p be ((-5)/(15/(-2)))/((-26)/(-195)). Suppose -4j - 5l + 41 = 0, -4j = -pj + 3l - 11. Solve 15 = -3m, jm - 5 = 2n - 21 for n. -2 Let m be -32/(-6)(-1 + 1). Suppose 2p - 3 = 2i - 1, m = -5i + 15. Solve 3d - 18 = 3o, 4d = -po + 2d for o. -2 Let t be 30/(-40) - (-138)/24. Solve -c + 4 = 5b - 7b, tc = -4b - 8 for c. 0 Let h be (13 - 35) + 11011/55. Let u(p) = -2p - 4. Let o(a) = a. Let l(s) = -3o(s) - u(s). Let z be l(4). Solve 0 = 5f - 5, z = -4d - hd + 4f + 8 for d. 3 Suppose 2m - p - 11 = 0, -2m + 104p - 9 = 107p. Solve m = -a - 3j, -15j = 2a - 20j + 6 for a. -3 Suppose 11x = 14x + 3. Let d be ((-1)/2x)/(6/552). Let n = d - 42. Solve 2j = -ny + 2, -j + 0y = -4y - 7 for j. 3 Let d be 8/6 + 3182/111. Suppose -dk + 2 + 28 = 0. Solve -3s - k = 2q, 0q - 3q - 2 = 4s for s. 1 Let j be (1/(7 - 5))/((-6)/(-48)). Solve 0 = jd - 2i + 5 - 27, d - i = 8 for d. 3 Let x = -17442 + 17467. Solve -4t = -u + 16, 37 - x = -4t for u. 4 Let r(s) = 6s + 20. Let t be r(-3). Suppose 2d = 2q - 70, -4q = -td - 122 - 10. Suppose 7n - q = 18. Solve 0 = m + 4g + n, m - 4 = -m + g for m. 1 Let v(c) = c + 1. Let s be v(-12). Let k = s - -11. Suppose kb + 4b - 4 = 3r, -4b + 2r = -4. Solve -3d = -2z - 1, -3z = 3d - 22 + b for d. 3 Let o(b) = 16b - 2. Let h be o(2). Suppose 3p - 11 = -l, -4l - 5p + h = -0l. Suppose 10 + 15 = lg. Solve -8 = y + 2m, 4m + 10 = -gy - 18 for y. -4 Let w be ((-1)/(9/33))/((-1)/3). Let y be ((-3)/(-2) + -2)(-15 + w). Solve 5f = 4m - 28, 4m = yf + m + 14 for f. -4 Let r(c) = c2 - 110c - 335. Let n be r(113). Solve 32 = 4h - ng, -5h - 9g = -12g - 32 for h. 4 Let n(s) = -s2 - 18s + 81. Let b be n(-20). Let z(q) = -3q + 128. Let t be z(b). Solve -5m - 5d - 16 - 14 = 0, -tm - 3d = 28 for m. -5 Let x(r) = -r3 + 5r*2 + 7r - 1. Let s be x(6). Let o be 104/4 + 1008/(-48). Solve -2k = -sf - 0k - 23, -of - k = 26 for f. -5 Suppose -3 = -m, -3z + 7z = -5m + 115. Suppose -9 - 9 = -2a. Let g be (2 + a/3)2. Solve -2p + g = -5x - 4p, -3x + z = -5p for x. 0 Let n = 70 + -68. Suppose -n = -8f + 22. Suppose j - 5j = -16. Solve -ji + fd = -26, 5d + 8 = i - 7 for i. 5 Suppose 5c - 35 + 19 = -2i, 0 = 3c - 3i - 18. Suppose -5m = cw - 70, -w = -5m + 50 + 45. Solve 5j - m = d, -2j + 7j = -d + 12 for j. 3 Let r(w) = 30w + 1570. Let k be r(-52). Solve 4o - 2d = -k, 15 = -0d - 5d for o. -4 Let m(c) = -2 + 6 + 3c2 + 3c - 5. Let s be m(1). Solve -4z + sd - 9 = -2z, -z + 3 = 5d for z. -2 Suppose -85x = -66x - 57. Solve -xw = -2s - 9, -7s + 4s + w - 3 = 0 for s. 0 Suppose 6861 - 6875 = -7y. Solve 11 = -3f - yp, 3p = -7f + 8f + 11 for f. -5 Let b(p) = 4p2 - 240p - 239. Let q be b(61). Solve -qg = -4j + 4, 0j - 3j = -2g - 3 for g. 0 Let u be 20 - ((-42)/(-1))/3. Solve -i - 6 = -3a, -2i + 8a + u = 11*a for i. 0 Suppose -101 - 39 =	{ "pile_set_name": "DM Mathematics" }
ded to the nearest integer? 1719 Round -0.0076094359 to 2 dps. -0.01 What is 32354276.06 rounded to the nearest one hundred thousand? 32400000 What is -3673.47103 rounded to the nearest integer? -3673 What is 828.696865 rounded to the nearest 100? 800 Round -127.6382603 to zero dps. -128 Round 0.004755821382 to 7 dps. 0.0047558 Round 0.00178703813 to 5 decimal places. 0.00179 What is 7790149.818 rounded to the nearest ten thousand? 7790000 What is -59526123 rounded to the nearest 10000? -59530000 What is -0.014187536 rounded to 3 decimal places? -0.014 What is -14134210 rounded to the nearest ten thousand? -14130000 What is -0.0307883413 rounded to five dps? -0.03079 Round 827478967 to the nearest one million. 827000000 What is 8049.6291 rounded to the nearest ten? 8050 What is -0.1384785303 rounded to two decimal places? -0.14 Round 0.1562815 to four dps. 0.1563 Round 96508399960 to the nearest 1000000. 96508000000 What is -264541419.5 rounded to the nearest ten thousand? -264540000 Round -412808.43 to the nearest 10000. -410000 What is -123.28193 rounded to the nearest integer? -123 Round -0.01437631202 to 4 dps. -0.0144 What is 560.78701 rounded to the nearest one hundred? 600 What is 229070.329 rounded to the nearest one hundred? 229100 Round -0.000603566905 to 7 decimal places. -0.0006036 What is 0.1108565963 rounded to five dps? 0.11086 What is -9.4097834 rounded to three dps? -9.41 Round -0.502694111 to 5 dps. -0.50269 Round 81.4723815 to zero decimal places. 81 What is -21.6377806 rounded to one dp? -21.6 Round 0.03402745 to 4 decimal places. 0.034 What is -594482328.6 rounded to the nearest ten thousand? -594480000 Round 3.01454203 to three dps. 3.015 What is 139800641 rounded to the nearest 1000000? 140000000 Round -0.0495929835 to 4 decimal places. -0.0496 What is -280.1244752 rounded to the nearest 10? -280 What is 9899.8809 rounded to the nearest integer? 9900 What is -0.010685346 rounded to 2 dps? -0.01 Round -0.00469998823 to 5 decimal places. -0.0047 Round -101218.011 to the nearest 1000. -101000 Round 10109506.86 to the nearest one hundred thousand. 10100000 Round 0.0000608795449 to 4 decimal places. 0.0001 Round -4167.1765 to 1 decimal place. -4167.2 Round 0.237536874 to two decimal places. 0.24 What is -0.16896057503 rounded to 4 decimal places? -0.169 Round 410922.0586 to the nearest one hundred. 410900 Round 0.001066831302 to six dps. 0.001067 Round -0.00041821639 to four decimal places. -0.0004 Round -3224.1214 to the nearest 1000. -3000 What is 0.049237625 rounded to four dps? 0.0492 What is 889530.8 rounded to the nearest 100? 889500 What is -56938.243 rounded to the nearest ten? -56940 Round -0.00003388271913 to 7 dps. -0.0000339 Round -17330.5923 to the nearest 100. -17300 What is 78328 rounded to the nearest one million? 0 What is 73.8760119 rounded to two decimal places? 73.88 What is 80.22463176 rounded to the nearest ten? 80 What is 16908156.62 rounded to the nearest 100000? 16900000 Round 1370544.53 to the nearest one hundred. 1370500 What is 110137195.5 rounded to the nearest 1000? 110137000 Round 229.28465198 to two dps. 229.28 Round 567.58932 to the nearest integer. 568 What is -0.00061654096 rounded to five dps? -0.00062 Round 6952.43477 to the nearest 10. 6950 What is -0.000388678269 rounded to six dps? -0.000389 Round 117333748 to the nearest one million. 117000000 What is 153949.729 rounded to the nearest 100? 153900 What is -1199282.8 rounded to the nearest one hundred thousand? -1200000 What is -9863910.8 rounded to the nearest one hundred thousand? -9900000 What is 0.0000032994106 rounded to 7 dps? 0.0000033 Round -69.03476 to the nearest 10. -70 Round 24229602.9 to the nearest 1000. 24230000 Round 1.25811604 to 4 decimal places. 1.2581 What is 22949.784 rounded to the nearest one thousand? 23000 What is 2.01952718 rounded to four decimal places? 2.0195 Round 2253896733 to the nearest ten thousand. 2253900000 What is 1.34434572 rounded to one dp? 1.3 Round 3.09540018 to two dps. 3.1 What is -162087217 rounded to the nearest 100000? -162100000 Round -0.00223943818 to 5 decimal places. -0.00224 Round 0.00507716662 to four dps. 0.0051 Round -1574082.6 to the nearest 10000. -1570000 Round 33.9381233 to the nearest integer. 34 Round -0.00001830604793 to 6 decimal places. -0.000018 What is -16672.7528 rounded to the nearest 10? -16670 What is 10295.358586 rounded to the nearest 100? 10300 What is -54290.38681 rounded to the nearest ten thousand? -50000 Round -0.00000423995663 to seven decimal places. -0.0000042 Round 0.3713488361 to five dps. 0.37135 What is -143205.1921 rounded to the nearest integer? -143205 Round 1624089.8187 to the nearest ten thousand. 1620000 Round 0.1971509517 to 2 decimal places. 0.2 Round -1283.54813 to 1 dp. -1283.5 Round 136014.059 to the nearest 10000. 140000 What is 7578940590 rounded to the nearest one million? 7579000000 Round -2705428990 to the nearest 100000. -2705400000 Round 21.6247472 to two decimal places. 21.62 Round 1.848060847 to 2 decimal places. 1.85 What is 0.0000031537619 rounded to six decimal places? 0.000003 Round -729.7006726 to 1 dp. -729.7 What is 741651508.8 rounded to the nearest ten thousand? 741650000 What is -0.0154098355 rounded to 6 dps? -0.01541 What is -928403400 rounded to the nearest one hundred thousand? -928400000 What is 558845.4854 rounded to the nearest 100? 558800 What is -0.063572419 rounded to four dps? -0.0636 Round -380995.736 to the nearest 1000. -381000 Round 0.002423886127 to 4 decimal places. 0.0024 Round 3938168.8 to the nearest 100. 3938200 What is -74.4369792 rounded to 1 decimal place? -74.4 What is 0.000004690049918 rounded to seven dps? 0.0000047 What is -26.11468106 rounded to two decimal places? -26.11 What is 2.49040856 rounded to 3 decimal places? 2.49 Round 1841.08904 to the nearest 10. 1840 Round 141191511.8 to the nearest 10000. 141190000 What is -4.03439118 rounded to 4 decimal places? -4.0344 What is -0.0000169568026 rounded to 5 dps? -0.00002 Round -0.1935000319 to five dps. -0.1935 Round 0.406525192 to one decimal place. 0.4 What is -5.089943066 rounded to one decimal place? -5.1 Round -6096400.372 to the nearest ten thousand. -6100000 Round -1757210.377 to the nearest one hundred. -1757200 Round 0.000001630590763 to 7 dps. 0.0000016 Round -0.00114759757 to 5 decimal places. -0.00115 Round 0.007955423077 to 3 decimal places. 0.008 What is 3872667.77 rounded to the nearest 10000? 3870000 Round -7.1902219 to 3 dps. -7.19 Round -0.095391034 to five decimal places. -0.09539 Round 4454733.4 to the nearest one hundred. 4454700 What is 4892740.6 rounded to the nearest ten thousand? 4890000 What is 0.8056109123 rounded to 4 dps? 0.8056 Round -25.37596724 to three decimal places. -25.376 Round 5602.44893 to the nearest ten. 5600 Round 5030.99337 to the nearest one thousand. 5000 What is 645928665 rounded to the nearest one hundred thousand? 645900000 Round 1320933.55 to the nearest ten thousand. 1320000 Round 177.9433727 to 3 decimal places. 177.943 Round -0.000397387 to 7 decimal places. -0.0003974 Round 50.3109073 to three dps. 50.311 What is -31849116.3 rounded to the nearest one thousand? -31849000 Round -0.000003691318 to 3 decimal places. 0 Round 0.0190477893 to 4 decimal places. 0.019 Round -258.98382 to 0 decimal places. -259 Round -1771.267621 to the nearest 100. -1800 Round -11.7436308 to 3 dps. -11.744 What is 0.0052830932 rounded to 6 decimal places? 0.005283 What is -0.00623191845 rounded to three decimal places? -0.006 Round -0.000306646095 to 7 dps. -0.0003066 What is 0.017298835618 rounded to 7 dps? 0.0172988 What is -1814.2234 rounded to the nearest 10? -1810 What is 76.92905304 rounded to the nearest ten? 80 Round -15780.05696 to the nearest ten. -15780 What is -676338038 rounded to the nearest one million? -676000000 Round -0.00010046953176 to 6 dps. -0.0001 Round -0.0145200007 to 6 decimal places. -0.01452 What is 1765060990 rounded to the nearest 100000? 1765100000 What is 4538111.38 rounded to the nearest 1000? 4538000 Round 379783670 to the nearest 1000000. 380000000 Round 5046.026409 to the nearest one thousand. 5000 What is 818.20077 rounded to zero decimal places? 818 What is -0.301066473 rounded	{ "pile_set_name": "DM Mathematics" }
sqrt(108)). -56sqrt(3) - 7 Simplify (4(sqrt(108) + -2) - sqrt(108) - -2(sqrt(108) + -3)) + 4. -10 + 30sqrt(3) Simplify ((6(-2sqrt(330) + sqrt(330) - sqrt(330)))/sqrt(10))/(sqrt(539) + sqrt(539)-1 + sqrt(539) - (sqrt(704) - (sqrt(704) + sqrt(704) + 2sqrt(704)))). -12sqrt(3)/31 Simplify (-3(sqrt(189) + (sqrt(189) - (sqrt(189) - (-1sqrt(189) - sqrt(189))))))/(-3sqrt(112) - sqrt(7)). -9sqrt(3)/13 Simplify -3(-1sqrt(76))2 - ((sqrt(76) - (sqrt(76) + sqrt(76) + 0)) + sqrt(76) + -5) - -4-5((1 + sqrt(76))2 - sqrt(76)). -1763 - 40sqrt(19) Simplify (sqrt(637) + (sqrt(637) + 2)-6)2 + (sqrt(637)1 + -2)*2. 812sqrt(13) + 16710 Simplify (-4sqrt(117)/((sqrt(54)-2 - sqrt(54) - sqrt(54))/sqrt(6))6)2 + -3. 465 Simplify (sqrt(294)2-5)/(((2sqrt(20) + sqrt(20))-3)/sqrt(10)). 70sqrt(3)/9 Simplify ((-4 + (sqrt(1539) - ((-1 + sqrt(1539) + -1 - sqrt(1539)) + sqrt(1539))))-6)2-3 + 5. -427 Simplify 3 + sqrt(99) + -1 + -5 + (sqrt(22) - sqrt(352)1)/sqrt(2). -3 Simplify (sqrt(42)/(6sqrt(24)/sqrt(4)) + 2 + ((2sqrt(84))/sqrt(12))2)4. 2sqrt(7)/3 + 120 Simplify 4(sqrt(363) + -4 + sqrt(363)1 + -1 + sqrt(363) + 5 + -2). -8 + 132sqrt(3) Simplify (2((sqrt(704) - ((sqrt(704) - (sqrt(704) + -2 + sqrt(704) + sqrt(704)) - sqrt(704)) + sqrt(704) + 2)) + sqrt(704) + 5sqrt(704)-1) + -2)2. 320sqrt(11) + 2916 Simplify ((1 + sqrt(972) - sqrt(12)) + -5 + 5-3sqrt(3))*2. -8sqrt(3) + 19 Simplify (-2(sqrt(176) + -3 + sqrt(176)))2 + (sqrt(176) - ((sqrt(176) + -2)-6 + sqrt(176))) + -3. -168sqrt(11) + 2837 Simplify (-2 + ((sqrt(1573)2 + sqrt(1573) - sqrt(1573)) + 4 - (sqrt(1573) + 0 + sqrt(1573) + 1 + sqrt(1573))) + -1)*2. 1573 Simplify 1sqrt(75) + (1 + sqrt(432))2 - (2 + ((sqrt(243) - (sqrt(243) - (sqrt(243) + -1))) + 3 + sqrt(243) + sqrt(243))2). -1760 - 79sqrt(3) Simplify (((sqrt(85) + sqrt(85)1 + sqrt(85))-4)/sqrt(5) + -2(sqrt(425) + 5))*2. 440sqrt(17) + 8328 Simplify 2(-6(2 + sqrt(2736) + sqrt(2736)))*2 + ((sqrt(2736)3 + -1)-3)2. 6264sqrt(19) + 1009881 Simplify (-6-4sqrt(14)/sqrt(2))*2 + (-5(sqrt(112) + 5 - sqrt(7) - sqrt(7)))*2. 500sqrt(7) + 5357 Simplify -6-1((1sqrt(891))2 + 3). 5364 Simplify (((sqrt(280)-3 + sqrt(280))/sqrt(8))/(sqrt(35)/(sqrt(56)/sqrt(8))))*2. 28 Simplify 4(1 + ((3 + sqrt(27) - sqrt(3)13) + sqrt(15)/((sqrt(105)/sqrt(3))/sqrt(7)))*2). 24sqrt(3) + 52 Simplify -3(-4(sqrt(44) + -3(3 + sqrt(44)))-6)*2. -444096 - 124416sqrt(11) Simplify -6(((sqrt(304)-12 + sqrt(304) + -4)-4)*2 + 2). -30732 - 3072sqrt(19) Simplify (-4(-5 + sqrt(108) + (sqrt(108) - sqrt(108)1)3 + -4) + -3)2. -1584sqrt(3) + 2817 Simplify 0 + ((sqrt(77) + sqrt(77) + 4sqrt(77))3)/(-4sqrt(539)). -9sqrt(7)/14 Simplify (((sqrt(66)/(sqrt(55)/sqrt(5)) - sqrt(6))/sqrt(2) + -41sqrt(3) + -4 + sqrt(12))2)2. 64sqrt(3) + 112 Simplify (-2(2sqrt(896) - sqrt(896) - sqrt(896)))/(2((sqrt(72) - sqrt(72)-1) + sqrt(72)) + sqrt(72)). 0 Simplify (-4sqrt(40) + sqrt(10))/sqrt(5)34. -84sqrt(2) Simplify (sqrt(21)/(sqrt(14)/sqrt(2)) - (0 + sqrt(6)/sqrt(2))) + -3sqrt(27)/(sqrt(36)-2). 3sqrt(3)/4 Simplify -4(-3 + (sqrt(272) - -2sqrt(272)) - (sqrt(272) - ((sqrt(272) + -3 - sqrt(272))-4 + sqrt(272))))*2. -10116 - 864sqrt(17) Simplify 1(sqrt(72) + 0 + 0)2 - (3 + (2sqrt(128)2)2). -1979 Simplify (sqrt(68) + (sqrt(68) - 2(sqrt(68) + (2sqrt(68) - sqrt(68)))))/(-4sqrt(324) + sqrt(4)). 2sqrt(17)/35 Simplify ((2-2sqrt(896))/(sqrt(49)/(1sqrt(7))-2))2 + -1. 511 Simplify 4 + -4 + -2 + 2-63(sqrt(17) - -1sqrt(17))2. -2450 Simplify -2 + (5-4sqrt(114) + sqrt(114))/(sqrt(6) - (sqrt(384) - (3sqrt(384) - sqrt(384)))). -19sqrt(19)/9 - 2 Simplify (4((-2 + sqrt(343) - sqrt(343))-3 + 2 + 2 + sqrt(343) + 2))2. 2688sqrt(7) + 7792 Simplify (-1 + 2 + sqrt(11))*2 + 1 + (sqrt(1100)1 - sqrt(88)/sqrt(2))*2. 2sqrt(11) + 717 Simplify 3(1 + (sqrt(125)-1 + -1)*2 + -3) + 0. 30sqrt(5) + 372 Simplify (sqrt(30) - sqrt(90)/sqrt(3)-6 - (sqrt(30) + -2sqrt(120)))/(sqrt(360)-1 + sqrt(360) + sqrt(810)-1). -10sqrt(3)/9 Simplify (sqrt(24)/(sqrt(12)/sqrt(6)))/((sqrt(6) - sqrt(6)-4)-6) + 2. -sqrt(2)/30 + 2 Simplify ((sqrt(110) + (sqrt(110) - 6-2sqrt(110)) + 5-1sqrt(110) + sqrt(110) + sqrt(110))/(-6((-2sqrt(250) - sqrt(250)) + sqrt(250) + sqrt(250))))2. 1331/900 Simplify (sqrt(190)/(sqrt(10)1) + sqrt(76) + 3)-6 + ((sqrt(304) + -5)2 - (-4 + sqrt(95)/sqrt(5))). -59sqrt(19) + 315 Simplify 0 + ((1 + sqrt(15)/sqrt(3) + sqrt(5))-4)2 + 4 + (sqrt(5) + 1)5 + -2. 69sqrt(5) + 343 Simplify ((sqrt(114) + 2-1sqrt(114))1)/(sqrt(60)/(-2sqrt(40)/sqrt(4))). 2sqrt(19) Simplify (2 + sqrt(5))-5-1 + (2 + sqrt(15)/sqrt(3) - sqrt(50)/(1sqrt(10))). 5sqrt(5) + 12 Simplify ((sqrt(187)/(sqrt(704)-2))2 - (4sqrt(1377) + 3))-2. 751/128 + 72sqrt(17) Simplify -5 + sqrt(2299)-2 + (-1 + sqrt(475))2 - (4 + sqrt(19) + 2sqrt(19) + 0 + -1sqrt(171)). -32sqrt(19) + 467 Simplify (-2sqrt(4719)-4)/(sqrt(96)/sqrt(2) - (sqrt(3) - sqrt(96)/sqrt(8) - sqrt(3))). 44sqrt(13)/3 Simplify (sqrt(468) + 0 + -1 + (sqrt(468) + sqrt(468) + 0 + sqrt(468))-5 + -1-2(sqrt(468) + 0) + -3)*2. 576sqrt(13) + 67408 Simplify (12sqrt(78))/(sqrt(192)/sqrt(8)). sqrt(13) Simplify -1 + 2(5((-1 + sqrt(539) + sqrt(539))-2 + sqrt(539) + 5))2. -14700sqrt(11) + 244999 Simplify ((sqrt(170) - (sqrt(170) - sqrt(170)1)4)6)/(-4sqrt(30)/(sqrt(24)/sqrt(8))). -3sqrt(17)/2 Simplify -44(2 + ((sqrt(10)/sqrt(2))2 - sqrt(5)))-4-6. -2688 + 384sqrt(5) Simplify -1 + ((((sqrt(114) + sqrt(114)-2)5 + sqrt(114) - sqrt(114)) + sqrt(114))5)/((sqrt(600) + sqrt(600)-2)2). -1 + sqrt(19) Simplify (sqrt(75)/(-2sqrt(5)-2))/(4(sqrt(720) + sqrt(720)1 + sqrt(720))). sqrt(3)/576 Simplify -1 + 4 + sqrt(80) + (sqrt(5) - (sqrt(125) + 1)2) + -3. -126 - 5sqrt(5) Simplify (sqrt(55)1-3-3)/(((sqrt(88)/sqrt(2))/sqrt(4) - sqrt(11)) + sqrt(88)/(sqrt(16)/sqrt(2) + sqrt(8))). 18sqrt(5) Simplify (-1 + sqrt(832)5)2 + (-1sqrt(260)/sqrt(5))*2 + 4. -80sqrt(13) + 20857 Simplify (-4 + ((sqrt(396) - (sqrt(396) + -1 + sqrt(396))) + -4 - (sqrt(396) - (4 + sqrt(396)-4) - sqrt(396))) + 1)2. 120sqrt(11) + 9904 Simplify (sqrt(30)/sqrt(2)-1 + sqrt(30)/sqrt(2)5)/(sqrt(160)/sqrt(8)5). 2sqrt(3)/5 Simplify ((sqrt(12) - (sqrt(1728) + (sqrt(1728) - (sqrt(1728) + -3sqrt(1728) - sqrt(1728))) + sqrt(1728)))/(sqrt(4) + 3(sqrt(16)/sqrt(4) + sqrt(4))))*2 + 3. 15270/49 Simplify ((sqrt(2420)-1-4)/(sqrt(28)/(sqrt(140)/sqrt(5))))2. 38720 Simplify -1 + (sqrt(540) + (sqrt(540) - (sqrt(540)2 + sqrt(540) + sqrt(540))))/sqrt(5) + (sqrt(84) + sqrt(21))/sqrt(7) + 2sqrt(48). -sqrt(3) - 1 Simplify ((-2((sqrt(102)2 - sqrt(102)) + sqrt(102)) - -3-1sqrt(102))/(2sqrt(60)/(sqrt(50)/sqrt(5))))*2. 833/4 Simplify (sqrt(20)-3-4)/(sqrt(16)/(sqrt(8)/sqrt(2)) + sqrt(4)). 6sqrt(5) Simplify (43(0 + (sqrt(832) + (-3 + sqrt(832) - sqrt(832)))2 + sqrt(832)))2. -41472sqrt(13) + 1083456 Simplify 4 + ((sqrt(1216) - (2 + sqrt(1216))4)2)*2. 1536sqrt(19) + 44036 Simplify (sqrt(204) + -3(sqrt(204) - (sqrt(204) + sqrt(204)3 + sqrt(204))))/(1sqrt(192) - sqrt(12)). 13sqrt(17)/3 Simplify (3(0 + sqrt(288))6 + -3)*2. -1296sqrt(2) + 93321 Simplify 0 + (2 + (-2 + sqrt(1216))*2 + ((0 + sqrt(1216))-4)*2)-6. -124068 + 192sqrt(19) Simplify (-2sqrt(110)-1)/(sqrt(490)3 - sqrt(490)). sqrt(11)/7 Simplify 0 + -1sqrt(891) - ((sqrt(44) - sqrt(11))2 + 3)1. -9sqrt(11) - 14 Simplify (((sqrt(416) - (sqrt(416) + sqrt(416)2))2)/(((sqrt(4) + sqrt(100))4)/sqrt(2)))*2. 52/9 Simplify (1 + 6sqrt(833)-52)*2. -840sqrt(17) + 2998801 Simplify (sqrt(119) - 2-1sqrt(119) - (sqrt(119) - 52sqrt(119)))/((sqrt(35) - -1sqrt(70)/sqrt(2))/sqrt(5)). 6sqrt(17) Simplify 2(2-5(sqrt(2299) - (3 + sqrt(2299))2))*2. 26400sqrt(19) + 467000 Simplify (-41sqrt(175) + sqrt(175))-4 - ((sqrt(175) - (sqrt(175) + (sqrt(175) - 1sqrt(175))*2)) + 4 - (sqrt(175) + (-4 + sqrt(175)2)*2)). -15sqrt(7) + 712 Simplify ((2sqrt(147)-3 - sqrt(147)) + (0 + sqrt(147))2)5. -175sqrt(3) Simplify (1 + sqrt(200) + 0 + -1sqrt(200))*2-2 + -5 + 4. -3 Simplify (1(sqrt(9)/(-3(sqrt(3) + sqrt(6)/sqrt(2))) - (1sqrt(2592))/sqrt(6)))2. 5329/12 Simplify 5 + -3 + -4sqrt(162)-5. 2 + 180s	{ "pile_set_name": "DM Mathematics" }
culate the remainder when 1501614 is divided by 107226. 450 Calculate the remainder when 263820 is divided by 596. 388 Calculate the remainder when 6218591 is divided by 91448. 127 What is the remainder when 498276 is divided by 510? 6 Calculate the remainder when 179444 is divided by 73. 10 Calculate the remainder when 3055082 is divided by 1702. 1694 What is the remainder when 430367 is divided by 8436? 131 Calculate the remainder when 31788 is divided by 7054. 3572 Calculate the remainder when 16826 is divided by 50. 26 Calculate the remainder when 583676 is divided by 1213. 223 What is the remainder when 388448 is divided by 129403? 239 Calculate the remainder when 240469 is divided by 16022. 139 Calculate the remainder when 52087 is divided by 4300. 487 Calculate the remainder when 43986422 is divided by 183. 176 What is the remainder when 170698 is divided by 15478? 440 Calculate the remainder when 162026 is divided by 643. 633 Calculate the remainder when 2257330 is divided by 86816. 114 What is the remainder when 452049 is divided by 452041? 8 Calculate the remainder when 284299772 is divided by 68539. 0 Calculate the remainder when 12788 is divided by 12780. 8 What is the remainder when 31111 is divided by 1150? 61 Calculate the remainder when 13366 is divided by 3353. 3307 Calculate the remainder when 30176319 is divided by 2514692. 15 What is the remainder when 364584 is divided by 355? 354 Calculate the remainder when 56518 is divided by 376. 118 Calculate the remainder when 5794125 is divided by 724265. 5 What is the remainder when 22244008 is divided by 96713? 18 What is the remainder when 1869342 is divided by 1868535? 807 What is the remainder when 67500126 is divided by 22500035? 21 What is the remainder when 119997 is divided by 4783? 422 What is the remainder when 5422950 is divided by 769? 731 Calculate the remainder when 5494025 is divided by 176. 9 Calculate the remainder when 270480825 is divided by 35. 20 What is the remainder when 43077 is divided by 1335? 357 Calculate the remainder when 285215 is divided by 1378. 1347 What is the remainder when 67190 is divided by 9584? 102 What is the remainder when 812067 is divided by 135296? 291 What is the remainder when 245893 is divided by 245837? 56 What is the remainder when 665781 is divided by 221899? 84 Calculate the remainder when 30577754 is divided by 56. 18 Calculate the remainder when 246450 is divided by 122762. 926 What is the remainder when 59220 is divided by 14800? 20 What is the remainder when 27830 is divided by 5525? 205 What is the remainder when 114979 is divided by 504? 67 Calculate the remainder when 228598 is divided by 45037. 3413 What is the remainder when 13985852 is divided by 2977? 2883 What is the remainder when 24947404 is divided by 12953? 12879 What is the remainder when 19392087 is divided by 2867? 2566 What is the remainder when 161387 is divided by 53056? 2219 Calculate the remainder when 1627090 is divided by 1627079. 11 What is the remainder when 13106099 is divided by 80403? 410 Calculate the remainder when 1238013 is divided by 1497. 1491 What is the remainder when 418584 is divided by 268? 236 What is the remainder when 264578741 is divided by 47? 43 What is the remainder when 196875 is divided by 278? 51 What is the remainder when 10298015 is divided by 1220? 1215 What is the remainder when 584240 is divided by 120? 80 Calculate the remainder when 2025698 is divided by 506367. 230 Calculate the remainder when 741247 is divided by 39008. 95 Calculate the remainder when 4053698 is divided by 506711. 10 What is the remainder when 243303 is divided by 239796? 3507 What is the remainder when 13081314 is divided by 243? 138 Calculate the remainder when 23458086 is divided by 388. 382 Calculate the remainder when 190067167 is divided by 47516791. 3 Calculate the remainder when 22911839 is divided by 224. 223 Calculate the remainder when 52627 is divided by 798. 757 What is the remainder when 6173020 is divided by 799? 745 Calculate the remainder when 205661 is divided by 1435. 456 Calculate the remainder when 45518155 is divided by 30. 25 Calculate the remainder when 20806 is divided by 5902. 3100 Calculate the remainder when 6385688 is divided by 7111. 10 Calculate the remainder when 152892 is divided by 565. 342 What is the remainder when 1781064 is divided by 12283? 29 Calculate the remainder when 2674712 is divided by 1337354. 4 What is the remainder when 180704 is divided by 2771? 589 What is the remainder when 968041 is divided by 69099? 655 What is the remainder when 562019 is divided by 905? 14 Calculate the remainder when 1754480 is divided by 3917. 3581 Calculate the remainder when 134979 is divided by 588. 327 What is the remainder when 55228065 is divided by 726685? 5 Calculate the remainder when 129148 is divided by 35. 33 What is the remainder when 14007905 is divided by 67? 14 Calculate the remainder when 20851 is divided by 18257. 2594 Calculate the remainder when 2146494 is divided by 2766. 78 What is the remainder when 4023285 is divided by 191584? 21 What is the remainder when 162727 is divided by 54240? 7 Calculate the remainder when 136086 is divided by 1915. 121 Calculate the remainder when 619084 is divided by 5830. 1104 Calculate the remainder when 13112458 is divided by 23927. 462 Calculate the remainder when 3504087 is divided by 53092. 15 Calculate the remainder when 1391565 is divided by 278304. 45 What is the remainder when 4123279 is divided by 17252? 51 Calculate the remainder when 142319 is divided by 598. 593 Calculate the remainder when 13291 is divided by 6605. 81 What is the remainder when 9754310 is divided by 2191? 2169 What is the remainder when 347947226 is divided by 19? 17 Calculate the remainder when 81917694 is divided by 268. 10 What is the remainder when 3439936 is divided by 3439932? 4 Calculate the remainder when 4100722 is divided by 2689. 2686 What is the remainder when 20194924 is divided by 59? 50 Calculate the remainder when 939567 is divided by 312785. 1212 Calculate the remainder when 204590 is divided by 769. 36 What is the remainder when 584291 is divided by 12? 11 What is the remainder when 160945 is divided by 2037? 22 What is the remainder when 12418553 is divided by 392? 385 Calculate the remainder when 2131473 is divided by 351. 201 What is the remainder when 2525066 is divided by 8830? 8516 What is the remainder when 1723037 is divided by 28717? 17 What is the remainder when 2458336 is divided by 72? 40 Calculate the remainder when 144773 is divided by 1177. 2 What is the remainder when 353776 is divided by 32143? 203 What is the remainder when 1083046 is divided by 1049? 478 Calculate the remainder when 7200769 is divided by 1081. 228 What is the remainder when 12339836 is divided by 91? 54 Calculate the remainder when 72900662 is divided by 72900640. 22 Calculate the remainder when 482930 is divided by 179. 167 What is the remainder when 346158 is divided by 31467? 21 Calculate the remainder when 1956358 is divided by 293. 290 Calculate the remainder when 3333802 is divided by 14247. 4 What is the remainder when 716624 is divided by 104? 64 Calculate the remainder when 15361962 is divided by 80010. 42 What is the remainder when 510793 is divided by 255367? 59 Calculate the remainder when 7505588 is divided by 3752749. 90 What is the remainder when 15296333 is divided by 443? 429 What is the remainder when 93166 is divided by 5807? 254 What is the remainder when 5197 is divided by 573? 40 Calculate the remainder when 12333185 is divided by 7. 4 What is the remainder when 41789 is divided by 20799? 191 What is the remainder when 12714163 is divided by 157? 146 Calculate the remainder when 143285 is divided by 1936. 21 Calculate the remainder when 330611 is divided by 762. 665 What is the remainder when 214213750 is divided by 1146? 1138 What is the remainder when 1167646 is divided by 110? 106 Calculate the remainder when 4251139 is divided by 39. 22 What is the remainder when 80383220 is divided by 97? 96 Calculate the remainder when 656338885 is divided by 10786. 10785 What is the remainder when 127170 is divided by 253? 164 Calculate the remainder when 531266 is divided by	{ "pile_set_name": "DM Mathematics" }
1938586, 389251446? 97312860x + 6 What is the b'th term of 39279, 77745, 116217, 154695, 193179, 231669, 270165? 3b*2 + 38457b + 819 What is the l'th term of -41359, -41669, -41975, -42277, -42575? 2l2 - 316l - 41045 What is the n'th term of 225976, 226114, 226252? 138n + 225838 What is the w'th term of 894, 751, 790, 1239, 2326? 38w*3 - 137w*2 + 2w + 991 What is the y'th term of 145844, 583238, 1312228, 2332814, 3644996? 145798y2 + 46 What is the m'th term of 180509, 180488, 180467, 180446? -21m + 180530 What is the t'th term of -153, 278, 1387, 3168, 5615, 8722? -t*3 + 345t*2 - 597t + 100 What is the z'th term of 3240, 3331, 3482, 3693, 3964, 4295, 4686? 30z2 + z + 3209 What is the n'th term of 226015382, 452030766, 678046150, 904061534, 1130076918, 1356092302? 226015384n - 2 What is the m'th term of 52535982, 52535983, 52535984? m + 52535981 What is the k'th term of 252722, 252711, 252698, 252683? -k*2 - 8k + 252731 What is the k'th term of -91189, -364622, -820301, -1458220, -2278373, -3280754, -4465357? k*3 - 91129k*2 - 53k - 8 What is the p'th term of -222302, -889242, -2000834, -3557078, -5557974, -8003522, -10893722? -222326p2 + 38p - 14 What is the y'th term of 74117, 147988, 221859, 295730, 369601, 443472? 73871y + 246 What is the g'th term of 8423811, 8423812, 8423813, 8423814, 8423815? g + 8423810 What is the s'th term of 2256, 5599, 11176, 18993, 29056? s3 + 1111s*2 + 3s + 1141 What is the k'th term of 1575, 7743, 18019, 32397, 50871, 73435, 100083, 130809? -k*3 + 2060k*2 - 5k - 479 What is the c'th term of -5492809, -5492626, -5492441, -5492254? c*2 + 180c - 5492990 What is the l'th term of -28962, -57897, -86814, -115719, -144618, -173517, -202422, -231339? -l*3 + 15l*2 - 28973l - 3 What is the l'th term of 24414, 49082, 74008, 99192, 124634, 150334? 129l2 + 24281l + 4 What is the r'th term of -8372, -67052, -226328, -536498, -1047860, -1810712? -8383r3 + r + 10 What is the f'th term of -7889976, -7889977, -7889978? -f - 7889975 What is the b'th term of 1038, 7925, 26454, 62391, 121502? 961b*3 + 55b*2 - 5b + 27 What is the k'th term of 771, 1090, 1201, 1104, 799, 286? -104k2 + 631k + 244 What is the l'th term of -140, 1968, 6378, 13090? 1151l2 - 1345l + 54 What is the y'th term of 3206336, 3206353, 3206382, 3206423, 3206476, 3206541? 6y2 - y + 3206331 What is the p'th term of 52824, 50657, 48490, 46323, 44156, 41989? -2167p + 54991 What is the r'th term of 259, 1295, 4107, 9583, 18611, 32079, 50875? 148r3 + 111 What is the f'th term of -10618, -10513, -10190, -9541, -8458, -6833, -4558? 18f3 + f2 - 24f - 10613 What is the a'th term of -5089, -19409, -42967, -75763, -117797, -169069? -4619a*2 - 463a - 7 What is the u'th term of -5634, -10505, -15378, -20253, -25130? -u*2 - 4868u - 765 What is the q'th term of -1677904, -1677905, -1677906? -q - 1677903 What is the n'th term of 52720, 105427, 158118, 210793, 263452, 316095, 368722? -8n2 + 52731n - 3 What is the f'th term of 3961, 16997, 30021, 43027, 56009? -f*3 + 13043f - 9081 What is the j'th term of -2556, -10130, -22730, -40338, -62936, -90506, -123030? 3j3 - 2531j*2 - 2j - 26 What is the g'th term of 81007, 161998, 242967, 323908, 404815? -g*3 - 5g*2 + 81013g What is the h'th term of -4180, -8751, -13328, -17911, -22500, -27095, -31696? -3h2 - 4562h + 385 What is the w'th term of 2910, 12924, 29996, 54126? 3529w2 - 573w - 46 What is the q'th term of -76742, -153353, -229964, -306575, -383186, -459797? -76611q - 131 What is the j'th term of 354899, 709634, 1064369, 1419104, 1773839? 354735j + 164 What is the h'th term of 162267, 324536, 486805, 649074? 162269h - 2 What is the b'th term of 1087, 2075, 2609, 2689, 2315? -227b*2 + 1669b - 355 What is the o'th term of 8049, 17707, 27353, 36981, 46585? -o*3 + 9665o - 1615 What is the h'th term of -6410987, -12821980, -19232985, -25644008, -32055055, -38466132? -h*3 - 6410986h What is the k'th term of -138388287, -276776574, -415164861, -553553148, -691941435? -138388287k What is the a'th term of 947026, 947033, 947040, 947047, 947054, 947061? 7a + 947019 What is the s'th term of -83107743, -83107741, -83107739, -83107737, -83107735, -83107733? 2s - 83107745 What is the b'th term of 32139, 32146, 32153, 32160, 32167, 32174? 7b + 32132 What is the w'th term of 24209, 48406, 72603, 96806, 121021, 145254? w*3 - 6w*2 + 24208w + 6 What is the i'th term of 293999, 588127, 882253, 1176377, 1470499, 1764619, 2058737? -i*2 + 294131i - 131 What is the k'th term of 205005, 409980, 614955, 819930? 204975k + 30 What is the v'th term of 496296, 990309, 1484322, 1978335? 494013v + 2283 What is the j'th term of 3848, 5827, 7806, 9785, 11764, 13743? 1979j + 1869 What is the s'th term of -60084, -120979, -181876, -242775? -s2 - 60892s + 809 What is the t'th term of -806, -3612, -6426, -9248, -12078? -4t2 - 2794t + 1992 What is the l'th term of 331950, 331891, 331796, 331665, 331498, 331295, 331056? -18l2 - 5l + 331973 What is the n'th term of 179824, 359632, 539440, 719248? 179808n + 16 What is the l'th term of -7195, -57453, -193897, -459619, -897711, -1551265, -2463373, -3677127? -7182l3 - l2 + 19l - 31 What is the q'th term of -1108945, -1108942, -1108939, -1108936, -1108933? 3q - 1108948 What is the l'th term of 27523, 109570, 246317, 437764, 683911, 984758, 1340305? 27350l2 - 3l + 176 What is the l'th term of 3408, 6124, 8206, 9648, 10444, 10588? -l*3 - 311l*2 + 3656l + 64 What is the c'th term of 9923332, 19846657, 29769982, 39693307, 49616632? 9923325c + 7 What is the r'th term of -6674465, -13348928, -20023391, -26697854? -6674463r - 2 What is the q'th term of 1912595, 1912598, 1912599, 1912598, 1912595, 1912590, 1912583? -q*2 + 6q + 1912590 What is the c'th term of -11674959, -23349892, -35024825, -46699758? -11674933c - 26 What is the n'th term of 921, 298, -741, -2196? -208n*2 + n + 1128 What is the w'th term of 4614, 4566, 4530, 4506? 6w*2 - 66w + 4674 What is the v'th term of -3788861, -3788875, -3788897, -3788927, -3788965? -4v2 - 2v - 3788855 What is the x'th term of -8136, -16636, -25136? -8500x + 364 What is the p'th term of -1470, -1812, -2090, -2274, -2334, -2240, -1962? 5p*3 + 2p*2 - 383p - 1094 What is the u'th term of 137659697, 275319393, 412979089? 137659696u + 1 What is the s'th term of -133742523, -133742521, -133742519, -133742517? 2s - 133742525 What is the f'th term of -61211577, -61211578, -61211579, -61211580, -61211581, -61211582? -f - 61211576 What is the y'th term of -2389, -7163, -15121, -26263, -40589, -58099, -78793? -1592y2 + 2y - 799 What is the d'th term of 1740562, 1740556, 1740542, 1740514, 1740466, 1740392? -d*3 + 2d*2 - 5d + 1740566 What is the g'th term of 354445, 708889, 1063333, 1417777? 354444g + 1 What is the t'th term of 49080, 49104, 49056, 48900, 48600? -6t*3 + 66t + 49020 What is the p'th term of -5638782, -11277578, -16916374, -22555170? -5638796p + 14 What is the r'th term of 390085, 390067, 390049, 390031? -18r + 390103 What is the y'th term of -438235, -438051, -437867, -437683, -437499? 184y - 438419 What is the o'th term of 32791, 64214, 95625, 127018, 158387, 189726, 221029? -o3 + 31430o + 1362 What is the j'th term of -531599643, -1063199286, -1594798929, -2126398572? -531599643j What is the f'th term of 3956247, 3956243, 3956239, 3956235, 3956231, 3956227? -4f + 3956251 What is the y'th term of 75508, 74443, 73378, 72313? -1065y + 76573 What is the z'th term of 4485, 9710, 14935, 20160, 25385? 5225z - 740 What is the z'th term of -1663582, -1663601, -1663622, -1663645, -1663670? -z*2 - 16z - 1663565 What is the q'th term of 5309861, 10619717, 15929573, 21239429? 5309856q + 5 What is the r'th term of -29608, -34923, -40238? -5315r - 24293 What is the f'th term of 609, 3288, 8075, 14970, 23973, 35084? 1054f2 - 483f + 38 What is the k'th term of 30831, 41573, 52315, 63057, 73799? 10742k + 20089 What is the h'th term of 179481, 358276, 537071? 178795h + 686 What is the h'th term of 1826221, 3652532, 5478843, 7305154, 9131465? 1826311*h - 90 What is the r'th term of 175844, 35	{ "pile_set_name": "DM Mathematics" }
3/3 - 79. Calculate n(g(q)). -21q4 - 2q*2 Let x(d) = -23242d. Let y(p) = -8p. Calculate y(x(b)). 185936b Let l(z) = -z + 39. Let j(b) = -b - 2. Let q(m) = 9m + 12. Let w(y) = -6j(y) - q(y). What is l(w(s))? 3s + 39 Let n(y) be the first derivative of -y2/2 + 41. Let t(z) = 5z. Let w(p) = 3n(p) + t(p). Let b(c) = -7c - 3. Determine w(b(i)). -14i - 6 Suppose -t - 4 = 2c, -2 = -3t + 2c + 2. Let q(y) = -y - y + ty + 4y. Let p(z) = 2 + 3z - 2. Give q(p(j)). 6j Let r(b) be the third derivative of -b5/30 + b2. Let h(i) be the first derivative of -i*2/2 + 743. Calculate h(r(a)). 2a*2 Let s(r) = -4r - 8. Let y be s(-6). Suppose -8i + 4i + y = 0. Let u(f) = 2f + if - 5f. Let z(v) = 3v. Give u(z(n)). 3n Let c(g) = -12g*2. Let x(n) = -65n*2 + 2n. Calculate x(c(k)). -9360k4 - 24k*2 Let g(m) be the second derivative of -3m*4/2 - 98m. Let j(u) = -2u. Give j(g(n)). 36n*2 Let z(v) be the second derivative of 17v*4/6 - 135v. Let d(r) = -10r. What is z(d(y))? 3400y*2 Let z(o) = -68o + 10o + 54o. Let q(p) = 2p. Determine z(q(i)). -8i Let z(f) be the second derivative of -2f4/3 - 76f. Let c(o) = 12o2. Give z(c(s)). -1152s*4 Let v(t) be the third derivative of 7t4/6 - t2 + 21. Let k(u) = 6u2. Give v(k(q)). 168q*2 Let g(x) = 82x + 4 - 8 + 4. Let w(i) = -33i. Let d(b) = -5g(b) - 12w(b). Let t(o) = -6o + o + 3o. Calculate d(t(k)). 28k Let u(g) = -3g2 - 12g. Let q(x) = -x*2 + x. Let p(k) = -12q(k) - u(k). Let t(a) = 453a + 7 - 448a - 7. Calculate t(p(l)). 75l2 Let c(s) = 5s2. Let j(z) be the second derivative of -z4/2 - 216z - 1. Determine j(c(q)). -150q*4 Let u(s) = 2s*2 - 116s. Let b(w) = 6w + 0w - 7w - 1 + 1. What is b(u(f))? -2f*2 + 116f Let g(f) = 27f2. Let a(o) = 4o*2 + 3o - 3. Let l(m) = 0 - 33m - 9m*2 + 7 + 26m. Let w(z) = 7a(z) + 3l(z). What is w(g(c))? 729c4 Let t(g) = -g2 - 12g + 1. Let d be t(-12). Let i(a) = 55a2 - a + 2. Let v be i(d). Let n(h) = -h2 + vh - 56h. Let w(q) = -7q*2. Give w(n(k)). -7k*4 Let s(g) = 3g*2. Suppose -4z - 4i - 40 = 0, -3i = -7i + 12. Let c = z - -13. Let q(v) = cv + v - 3v + 4v. Calculate s(q(w)). 12w2 Let d(l) = 4l. Let s(n) = 529n - 1049n + 521n. What is d(s(u))? 4u Let h(v) = -6v2 - 15v. Let c(b) = b*2 + 2b. Let n(a) = -15c(a) - 2h(a). Let q(z) be the third derivative of 3z4/8 - 18z*2. What is n(q(i))? -243i*2 Suppose 3b - 14 = 4. Let p(q) = -3q + q + bq. Let t(x) = -4x2 + 8x*2 - 2x*2. Calculate p(t(d)). 8d*2 Let m(q) = -6q*2 + 0q*2 + 0q2. Let a(k) be the third derivative of k4/12 + 329k2. What is m(a(h))? -24h*2 Let c(k) = -16k*2 + 7k*2 + 10k*2. Let b(x) = 26x*2 - 3x*2 - 4x*2. Give b(c(u)). 19u*4 Let s(r) = -8r*2. Let t(x) = -6x. Let o(m) = 2m. Suppose -2h - 4 = 4a, -a + 6 = -h - 8. Let z(u) = ho(u) - 3t(u). What is z(s(p))? 16p*2 Let x(b) = -b - 11. Let h be x(-13). Let w(y) = 76 + 77 - 153 - 2y*h. Let g(r) = -9r. Give g(w(c)). 18c2 Let v(d) = -2d. Suppose 0 = -2n - 4l + 24, -7l + 2l = 4n - 33. Let m be -3 + n + (-24)/(-8). Let o(w) = -13w - 6wm + 13w. Give o(v(f)). -24f2 Let s(k) = -15k*2. Let m(p) = -15p*2 + 40. What is m(s(v))? -3375v*4 + 40 Let j(z) = 50z. Let b(n) = 4. Let v(a) = 4a + 104. Let y(c) = 52b(c) - 2v(c). Give j(y(f)). -400f Let v(w) = 471w. Let y(h) = 18011h + 1 - 18010h - 1. Calculate y(v(z)). 471z Let m(a) = 278a. Let j(z) be the second derivative of z3/3 - 2z - 182. Give m(j(t)). 556t Let f(d) = -18d*2. Let v(k) = 970k. Calculate f(v(m)). -16936200m2 Let f(p) = -4p*2. Let v(w) = -67515w*2. Calculate f(v(m)). -18233100900m*4 Let v(b) = 4b*2 + 4b + 269. Let m(g) = 2g. Calculate v(m(l)). 16l*2 + 8l + 269 Let q(p) = -395 + 2p + 395. Let c(x) = 25x. What is c(q(s))? 50s Let f(y) = 2y + 3. Suppose -10g + 13 = -17. Let i(h) = 4h + 5. Let r(k) = gi(k) - 5f(k). Let c(z) = 31z2. Calculate r(c(a)). 62a*2 Let a(z) = -10 + 32z - 13 + 23. Let g(r) = -3r2. Give g(a(p)). -3072p2 Let m(g) = g2. Let u(x) be the second derivative of -10x2 - 15x + 1/3x3 + 0. Calculate u(m(c)). 2c*2 - 20 Let y(c) = -c. Suppose 2x + 0t + 12 = -4t, 33 = -2x + 3t. Let a = 21 + x. Let g(j) = j - 3j - a + 9. Calculate y(g(b)). 2b Let b(o) = -10o. Let a(g) = 728594g*2. Determine b(a(n)). -7285940n*2 Let k(l) = -l. Let h(c) = c + 2. Let n(j) = 9j + 10. Let o(d) = 10h(d) - 2n(d). Give o(k(w)). 8w Let j(r) = 20 - 3r - 36 + 16. Let h(i) = 3i2. Determine j(h(x)). -9x*2 Let m(d) = -2d*2. Let c(b) be the second derivative of 25b*4/12 - 12b - 4. Calculate m(c(l)). -1250l4 Let u(c) = 3 + 19 - 3c - 33. Let w(t) = -t*2. What is u(w(h))? 3h2 - 11 Let x(o) = o2. Let y(l) be the second derivative of 0l2 - 14l + 25/6l3 + 0. Calculate y(x(d)). 25d*2 Suppose 4o - j - 3 = -0, 4o + 5j = -15. Let y = o - -2. Let s(v) = -7v + yv + 4v. Let z(d) = d2. Give z(s(w)). w2 Let f(d) be the second derivative of 59d*3 + 102d. Let l(y) = 2y2. Give f(l(q)). 708q*2 Let z(n) = -5n + 1. Let l(m) = -1221m2. What is l(z(s))? -30525s*2 + 12210s - 1221 Let n be -1471/(-7)6. Let p(j) = -nj + 61j - 10j2 + 65j. Let a(i) = -3i + 0i + 5i. Calculate p(a(c)). -40c*2 Let k(m) = 2m. Let l(q) = -10059q2 - 7q. Give l(k(z)). -40236z2 - 14z Let x(p) = -7221p. Let c(n) = -2n. Calculate x(c(i)). 14442i Let j(h) = 2h*2. Let q = 31 + -29. Let k(x) = 19x*q - 15 - 81x*2 + 15. Give j(k(n)). 7688n*4 Let p(d) = -1 + 9d*2 + 1 - 11d*2. Let i(j) = 5j - 6. Let a(y) = 2y - 1. Let l(c) = -6a(c) + i(c). What is p(l(f))? -98f2 Let r(j) = 3j. Let s(u) = 87723u. Calculate s(r(z)). 263169z Let k(c) be the second derivative of -2c3/3 - 2c. Let p(n) be the first derivative of -7n2/2 + 429. What is k(p(z))? 28z Let w(c) be the third derivative of -33c5/20 - 23c*2. Let j(u) = 2u*2. Give j(w(r)). 19602r*4 Let z(a) = 4a - 834. Let w(l) = 7l. Calculate z(w(r)). 28r - 834 Let n(k) = -55 + 26 + 17 + k*2 + 18. Let d(y) = 3y. What is d(n(t))? 3t2 + 18 Let w(a) = a. Let r(y) = 158y - 71y + 75 - 85y. What is w(r(d))? 2d + 75 Let k(c) = c - 325. Let o(p) = -790p*2. What is k(o(j))? -790j*2 - 325 Let t(a) = 166a - 206. Let z(n) = n. What is t(z(s))? 166s - 206 Let v(q) = 4165q. Let a(w) = 11w2. What is a(v(k))? 190819475k*2 Let b(c) be the second derivative of 7c*3 - 8c - 2. Let z(s) = 2s. Give z(b(w)). 84w Let y(s) = -s*3 + 4s*2 + 3s + 8. Let w be y(5). Let t(o) = -2o2 + 2. Let v(z) = 3z*2 - 5. Let x(l) = wv(l) - 5t(l). Let d(f) = f. What is x(d(r))? 4r*2 Let h(z) = -56z + 2. Let o(w) = 36425w - 36425w + 3w2. Determine o(h(a)). 9408a*2 - 672a + 12 Let t(v) = 2v. Let w(a) be the second derivative of 0 + 4a + 0a2 - 5/6a*3. Let z(l) = -25l. Let d(h) = -11w(h) + 2z(h). Calculate t(d(f)). 10f Let y(m) = -245m. Let g(r) = -108r2. Determine g(y(w)). -6482700w*2 Let a(h) = -2h - 20. Let o(c) = 3c + 24. Let x(g) = 6a(g) + 5o(g). Let q(f) be the first derivative of f2/2 - 1. Calculate q(x(z)). 3z Let y(i) = 30i2 + 10. Let o(x) = x2 - 2. Let c(p) = -5o(p) - y(p). Let b(l) = 2l2. Give c(b(g)). -140g*4 Let u(j) = 13j*2. Suppose 4y = 10 + 6, 0 = -4d - 4y + 24. Let g(t) = t + dt + 5t - 6t. Calculate u(g(z)). 52z2 Let r(u) be the third derivative of u5/20 - 12u2. Let k(p) = -21 + 7p*2 + 0p*2 + 21. Give r(k(b)). 147b*4 Let y(i) = 30794i*2. Let j(b) = 10b. Calculate j(y(p)). 307940p2 Let i(g) = g + 4492 - 1501 - 1495 - 1496. Let v(z) be the third derivative of -z4/24 + z2. Give v(i(c)). -c Let v(m) = -3m*2. Let u(h) = -6h + 6. Let w(b) = -6b + 7. Let k(f) = 2f*2 + f + 7. Let n be k(0). Let l(c) = nu(c) - 6w(c). Determine l(v(g)). 18g*2 Let g(j) = -3j. Let v(q) be the second derivative of 0q2 + 0 + 4/3q*3 + 9q. Give g(v(o)). -24o Let a(b) = 446b - 2. Let u(i) = -2i2 - 35. What is u(a(g))? -397832g*2 + 3568g - 43 Let n(a) = a. Let p(s) = 1400s + 32. Calculate n(p(w)). 1400w + 32 Let l(k) = -10k. Let h(v) = 303v - 11. Give l(h(p)). -3030p + 110 Let k(c) = 3c	{ "pile_set_name": "DM Mathematics" }
r18 Simplify ((w9/w)/w(-2/11))/(w(-5)/(w/(www/(w/(w/w*(-2/41)ww)))w)) assuming w is positive. w(4570/451) Simplify y(-2)y(-6/5)yy/(y(1/7)/y)y(yy*5y)/y assuming y is positive. y*(233/35) Simplify (((www/w4)/w)/w(2/15))22 assuming w is positive. w(-704/15) Simplify ((qq*(1/5))/q)/(q/(qq/(q/(q(5/2)/q)))) assuming q is positive. q(17/10) Simplify (q/q(-1/4))(2/37)qqqqq/((q/(q/q(-1/3)qqq)q)/q)qqq/(qq(-2/17)) assuming q is positive. q(39697/3774) Simplify i(1/4)/(ii/i*(-12/7)i) assuming i is positive. i(-125/28) Simplify p/((((p/(p(1/10)/p))/p)/p)/pp)p(2/33) assuming p is positive. p(383/330) Simplify (r(-27/4))44 assuming r is positive. r*(-297) Simplify (ttt29/t)/(((tttt*(-2/9)ttt)/t)/t) assuming t is positive. t(236/9) Simplify (o(2/5)/o)/(o/o17) assuming o is positive. o(77/5) Simplify (k(-2/9))39 assuming k is positive. k(-26/3) Simplify (s(1/3))(6/11)/(s/s(-3/2)(s/(ss3))/s) assuming s is positive. s(37/22) Simplify (n*(1/15)/nn)/(n/(n(n/(n/n(-22)n))/n)) assuming n is positive. n(-359/15) Simplify h12h(2/33) assuming h is positive. h(398/33) Simplify g(1/2)/gg*(-1/6)g*(-1/5)g*(1/3)/gg assuming g is positive. g(-8/15) Simplify ((s/s(-1/4))/s)/((s*(4/5)s)/s) assuming s is positive. s(-11/20) Simplify (j(-2/23)j(-4))/(j2jj8) assuming j is positive. j(-347/23) Simplify nnn/(n((n(n/n(3/8))/n)/n)/n)nnn/(nn(((nn(-1/5)/n)/n)/n)/nn) assuming n is positive. n(263/40) Simplify (y/y1)(-1/22) assuming y is positive. 1 Simplify p(8/9)pp(-19/2) assuming p is positive. p(-137/18) Simplify yy(-6)y/(((yy/(y/((y/y(-2/3)yy)/yy)))/y)/y)(y0)(-2/41) assuming y is positive. y(-20/3) Simplify (x/((xx*13x)/x)(x2x)/xx)(-1/14) assuming x is positive. x(5/7) Simplify p(-7)p*(-5)ppp*(7/2)p/p*(2/3)p assuming p is positive. p*(-31/6) Simplify ff*22(((f/f(-18/5))/f)/f)/f assuming f is positive. f(123/5) Simplify m(3/8)/(m(-3/14)/m) assuming m is positive. m(89/56) Simplify (n/(n/(n14n)))/(n/n(-7)) assuming n is positive. n7 Simplify (vv(-2))(-3/32)/(v(1/16)/v(-2)) assuming v is positive. v(-63/32) Simplify k5/(kk/(k(4/5)/kk)) assuming k is positive. k(19/5) Simplify n14(n(n/(n*21n))/n)/n assuming n is positive. n*(-8) Simplify (ttt/((t(1/3)/t)/t)t)*(-1/20)tt(-2)ttt(-2/7)/t assuming t is positive. t(-239/420) Simplify (t(-6)/t)18 assuming t is positive. t(-126) Simplify (((a/(a(-6)/aa)aa)/a)/a)/a0 assuming a is positive. a7 Simplify p3ppp/p*(-41)p assuming p is positive. p*48 Simplify ((((y/(yy*(-1)))/y)/y)/(yy(-2)))2 assuming y is positive. 1 Simplify (q*(-1/3)qq)30 assuming q is positive. q50 Simplify yy/y*(-14)y*(1/14)y assuming y is positive. y*(239/14) Simplify ((((rr*(3/7))/r)/r)/rr(-4))34 assuming r is positive. r(-1326/7) Simplify (t5t(3/11))/((t(2/9)/t)/t)(2/107) assuming t is positive. t(56206/10593) Simplify (xx1)(-19)((x/(xx*(-3/2))x)/x)/(x(-5)/x) assuming x is positive. x(-61/2) Simplify (m/(mm/(mm*(-1)))mm)(-4)(m(-2/5))(-9) assuming m is positive. m(-2/5) Simplify ((c/(c(-1/4)cc))/(ccc(-11)))(-18/5) assuming c is positive. c(-297/10) Simplify ((v0/v)44)(-22) assuming v is positive. v968 Simplify (d(-3)/((dddd/(d/(d1d)))/dd))(-2/3) assuming d is positive. d(16/3) Simplify b(1/21)/bb/(b(-22)/b) assuming b is positive. b(484/21) Simplify (m5)(-6/19) assuming m is positive. m*(-30/19) Simplify qq/q*(-14)q/(qq(28/9)q) assuming q is positive. q(107/9) Simplify i(2/9)ii12 assuming i is positive. i(119/9) Simplify (l*(11/4)/lll/(ll/(llll(-8))))/(l1/(((l/((l(-2/23)l)/l)l)/l)/l)) assuming l is positive. l(-383/92) Simplify q(-12)/(qq(-6/5)) assuming q is positive. q(-59/5) Simplify ((w(-1/5))32)(-14) assuming w is positive. w(448/5) Simplify (l(1/49))(27/4) assuming l is positive. l*(27/196) Simplify (uu*2u)*(-9)((uu/u(2/15)uuu)/uu)/u(2/17) assuming u is positive. u(-7969/255) Simplify (ggg/g(-3/5)g(-3/19))(-25) assuming g is positive. g(-1635/19) Simplify (l(2/99)l)/((ll(-4/29))/l) assuming l is positive. l(3325/2871) Simplify w*(-7/4)/(www(-1/4)w)(ww/w0)(-23) assuming w is positive. w(-101/2) Simplify (r/r4)/(rr(2/21))(r*(2/5)r)5 assuming r is positive. r(61/21) Simplify (c*(-1/7)(cc(2/5))/c)(4/5) assuming c is positive. c(36/175) Simplify p(1/13)/(p(-1/5)/p)(pp(-7)p)/p1 assuming p is positive. p(-307/65) Simplify ((bb/(b/((((bb*(2/7))/b)/b)/b))b)/bb)26bb(2/3)b(-1/5) assuming b is positive. b(934/105) Simplify (t1)3(t(1/3))(12/5) assuming t is positive. t(19/5) Simplify ((((oo*(1/4))/o)/oo)(2/47))4 assuming o is positive. o(2/47) Simplify (z(-3)z)/(zz(z/(zz/(zz(z*(5/2)/z)/z)zzz)z)/zz) assuming z is positive. z(-7/2) Simplify (s(-13)ss(-3))(-8/7) assuming s is positive. s(120/7) Simplify ((v0/v)(-3/16))(14/15) assuming v is positive. v(7/40) Simplify (d/(d0d))(-44)/((d(1/5)/d)/((d/(d/(d(d/(d/d*1))/dd)d))/d)) assuming d is positive. d(4/5) Simplify (f/(f14/f)f)/f9 assuming f is positive. f(-20) Simplify (a(-1/4)/(a(-5/3)a))/(aaa(-2)a)(1/8) assuming a is positive. a(7/24) Simplify (r*(-1/5)/(rr(9/5)/r))/(r(1/6)/(r/(r/((r/r*2r)/r)r))) assuming r is positive. r(-25/6) Simplify (y/((y/((yy*12)/yy))/y))(3/5) assuming y is positive. y(42/5) Simplify v*(-7)/(v/(v(v*(-1/9)v)/v)) assuming v is positive. v(-64/9) Simplify ((p/((p/p(-16))/p))/(p*(6/11)/pp))(9/5) assuming p is positive. p(-1539/55) Simplify ((qq14)/q)/(qq(q/(q(46/5)q))/q) assuming q is positive. q*(111/5) Simplify ((ddd/((ddd(-1/7)d)/d))9)(-11) assuming d is positive. d(-792/7) Simplify (w1w(-2/5))(-42) assuming w is positive. w(-126/5) Simplify ((n/(nn(nn*(-10)n)/nn))(-46))(-1/71) assuming n is positive. n(322/71) Simplify y6y/(y/y*(-4))((y/((yyyy(2/5)y)/y))/y)25 assuming y is positive. y(-83) Simplify (z(-1/5))(-6)/((z*4zzzz)/(z/z(1/12)zzz)) assuming z is positive. z(-173/60) Simplify (m(-2/7)m/(m(-1)m))17 assuming m is positive. m(85/7) Simplify ((((g/g*(-3/2))/gggg)/g)/g)/g(27/7) assuming g is positive. g(-19/14) Simplify (b/b*(-2)b(-1/4))(4/11) assuming b is positive. b Simplify (c(3/35))(-1/28) assuming c is positive. c(-3/980) Simplify t30ttt/((t(-1/5)t)/t) assuming t is positive. t(166/5) Simplify (z(-8)z8/z)(-41) assuming z is positive. z41 Simplify ((o/(o/((o/o(-1))/o))o)/(o*(-4/9)o))/(((o((o/o(-1/4)oo)/o)/o)/oo)/oo)(-1/19) assuming o is positive. o(1069/684) Simplify (oo4)/(o/(o(-7/4)o)) assuming o is positive. o(13/4) Simplify (u(-7/6)/u)(-40) assuming u is positive. u(260/3) Simplify l(-2/25)/(l/(ll*(3/5)))l(ll*(-6))/lll(1/6) assuming l is positive. l(-497/150) Simplify (h/(h0/h))17/((h/h6h)/((hhh6)/h)) assuming h is positive. h45 Simplify (j*(-8/7)jj8j)/(j(-2))(2/63) assuming j is positive. j(562/63) Simplify (k(-1))(-21) assuming k is positive. k21 Simplify ((y*0y)/y)*(-15)y*(-2/7)yy(-3/5) assuming y is positive. y(4/35) Simplify (aa(-2/3))(-7/4)a(5/4)(a*(3/4)a)/a assuming a is positive. a*(17/12) Simplify nn/(nn(39/4))nnn(-9) assuming n is positive. n(-63/4) Simplify i*(-6)i*(-6)(i/(iii/(i(i/i(-1/4)i)/i)))(-10) assuming i is positive. i(-29/2) Simplify (y(1/2))(-1/5)/(y0/(y/(y(-6)y))) assuming y is positive. y(59/10) Simplify (ll/(l/(l*(-1/3)l)))(-2)/(l(-2/7)l/l4) assuming l is positive. l(-1/21) Simplify (i/((i(iiii/((i/i(1/4))/i))/ii)/ii))(-44)/(i(-2)/i)(2/3) assuming i is positive. i189 Simplify y/y38yy34/y assuming y is positive. y(-3) Simplify k/(((k(-1/10)k)/k)/k)((k/k*(8/9))/k)/k assuming k is posi	{ "pile_set_name": "DM Mathematics" }
pose -x + 112 = tx. What is the units digit of x? 8 Let a(b) be the second derivative of -b3/3 - 9b*2/2 + 6b. Let c be a(-10). Suppose p - 13 = c. What is the tens digit of p? 2 Suppose -2r - 2w + 974 = -3w, 1936 = 4r + w. Suppose 5s + q - r = 0, -2s + 97 = -s + q. What is the units digit of s? 7 Let v(z) = z + 14. Let n be v(-10). Suppose -6h = -3h - 9, -4h + 12 = nj. Suppose y - 2r - 12 = 0, j = 2r - r + 2. What is the units digit of y? 8 Suppose 6w + 5698 = 20w. What is the units digit of w? 7 Suppose -p - 638 = -0q - q, -4p = 4q - 2544. What is the tens digit of q? 3 Let u = -40 - -57. Suppose -53 + u = -n. What is the units digit of n? 6 Suppose -34632 + 268 = -22v. What is the hundreds digit of v? 5 Suppose 3i - 1 = 5. Suppose -u - 5v = i, 5u + 57 = 2v + 155. What is the tens digit of u? 1 Let h = 101 - 32. Let j = h + 48. What is the tens digit of j? 1 Let l be 2/6 - (-759)/(-9) - 3. What is the tens digit of (l/2)/(4/(-8))? 8 Suppose -236 - 336 = -d + q, -5d = -4q - 2864. What is the tens digit of d? 7 Let p(y) = y*2 + 3y + 2. Suppose -n - 3i = 9, 8n - 5n + 2i + 20 = 0. Let o be p(n). Suppose -o = -5d + 45. What is the tens digit of d? 1 Let q = 4926 + -2997. What is the units digit of q? 9 Let y = -287 - -311. What is the tens digit of y? 2 Suppose -d + 2u = -3d + 564, 850 = 3d + 2u. Suppose -d = -5y + 79. What is the units digit of y? 3 What is the units digit of 34468/20 - ((-14)/(-10) - 1)? 3 Suppose -4k = 4o - 36, -3k = -0k - 4o + 8. What is the units digit of (42/k)/(63/84)? 4 What is the hundreds digit of ((-633)/(-6))/(-1)-2? 2 Suppose 0 = -4v + 3o - 171, -v + 2o - o - 44 = 0. Let l = v - -84. What is the tens digit of l? 4 Suppose 0 = 4v + 9 - 21. Suppose 4q - 105 = q - vd, -141 = -4q - 5d. What is the tens digit of q? 3 Let r = 73 - 34. Let s = r - 5. Suppose -12 = 2n - s. What is the units digit of n? 1 Let x = -1 - -3. Let l be (0 + (-21)/x)-2. Suppose 4z - l = -o + 5, -27 = -5z - 4o. What is the units digit of z? 7 Suppose -2p = 9p - 55. Suppose 907 = pn + 17. What is the units digit of n? 8 Suppose -4w = -2 - 2. What is the tens digit of 37((w - 4) + 4)? 3 Let m(o) be the second derivative of -o*5/20 + 5o4/12 + o3/6 - 9o2/2 + 22o. What is the units digit of m(4)? 1 Suppose -2p = 3p - 15. Suppose pu - 14 = -2. What is the tens digit of u(9/2 - 2)? 1 Suppose 3r = -r + 3m + 6, 13 = 3r + 2m. Suppose 2n - 5z = 203, -rz - z = 20. Suppose -2o = 3q - 4o - n, q - 37 = -3o. What is the tens digit of q? 3 Let l = 15 + -12. Suppose -lf - 3z + 114 = 0, 4f - 3z - 167 = -2z. What is the tens digit of f? 4 Suppose 10 + 0 = 5l, -l + 292 = c. Suppose 4d - 305 = d + p, 3d + 2p = c. What is the hundreds digit of d? 1 Let x = 222 - 116. Suppose -2 - x = -c. What is the hundreds digit of c? 1 Let i = 5369 - 2778. What is the thousands digit of i? 2 Suppose -21n + 16n = -1385. Suppose -5x - 46 = -r + 40, 3r + 4x = n. What is the tens digit of r? 9 Let u(q) = -3q*3 + 4q*2 + 2q*3 + 4q + 7 - 2q3 - 3. Let n be u(4). What is the units digit of (-4)/8 - n/8? 3 Let q(c) = c3 - 10c*2 - 24c + 5. Let t be q(12). Suppose -10w = -tw - 1340. What is the units digit of w? 8 Let l = -88 + 65. Let y = l + 37. What is the units digit of y? 4 Let j(c) = 507c + 12. What is the tens digit of j(2)? 2 Let d be (22/(-4))/((-2)/(-4)). Let m = d - -18. Let k = m - 3. What is the units digit of k? 4 Let f = 1508 - 1088. What is the tens digit of f? 2 Let x(c) = 3c*2 - 2c + 1. Let f be x(1). Suppose -o - fo + 15 = 0. Suppose -3q - r = -20, q + or + 4 - 6 = 0. What is the units digit of q? 7 Let p = 22 + -8. What is the units digit of (-6)/21 + 88/p? 6 Let y(l) = 446l*2 - 17l + 16. What is the hundreds digit of y(1)? 4 Let y(w) be the first derivative of w - 8 - 19/2w4 + 1/2w*2 + 0w*3. What is the tens digit of y(-1)? 3 What is the hundreds digit of 342/(-12)208/(-3)? 9 Let v = -8 - -10. Let l(o) = vo - 13 + 31 - 17. What is the units digit of l(6)? 3 Let p(m) be the first derivative of 2m*3/3 - 12m - 1. Let f = -272 + 266. What is the units digit of p(f)? 0 Suppose -2s + 0s = 0. Suppose 2g = -sg - 8. What is the tens digit of -45g/61? 3 Suppose 6 = -0y + 2y. Suppose 0 = -0f + yf. What is the tens digit of 6/4(f - -36)? 5 Let v be (-8)/6(-8 + 5). Suppose vz + z = -65. Let r = -6 - z. What is the units digit of r? 7 Let m be ((-1)/(5/(-8)))/((-4)/(-1190)). Suppose -5d = 4y - m, -4d + 389 = -y - 4y. What is the tens digit of d? 9 Suppose 47b - 28400 = 31b. What is the hundreds digit of b? 7 Let p(v) = v + 7v + 10 - 7v. Let g be p(-6). Suppose gt = 9 + 47. What is the tens digit of t? 1 Let j(m) = m + 1. Let s be j(-9). What is the units digit of s/14 - (-1743)/49? 5 Let y(p) = 54p2 + 2p + 2. Let i be (-4)/12-6-2. Let m be 18/24 - (-7)/i. What is the tens digit of y(m)? 5 Suppose 2b - 18 = 2k, -9k = -5b - 7k + 39. Suppose 4r = -4t + 724, bt - 6 = 4t. What is the hundreds digit of r? 1 Suppose 8r - 6r = 274. Let y = r + -72. What is the units digit of y? 5 Let w(c) = c3 - 9c*2 + 4c - 16. Let x be w(9). Let o = x + -19. What is the units digit of o? 1 Let c = 4 - 4. Let m be c + (-8)/(-4) - 5. What is the units digit of m + 3/(-2)-26? 6 Suppose -4b - 7 + 23 = 0. Suppose 4r - 106 = -5n + 28, 2n - 48 = br. Let g = n - 10. What is the tens digit of g? 1 Let u(t) = -40t + 144. What is the tens digit of u(-11)? 8 Let b(w) = w3 + 8w*2 - 9w. Suppose 5p + 0p + 45 = 0. Let t be b(p). Suppose k - 21 = -tk. What is the tens digit of k? 2 Let c be (-1)/(1 + (-48)/45). Suppose -j - c = 2j. Let f = j + 8. What is the units digit of f? 3 Let n be -56 - (-2 + 3)-1. Let a = -177 + 273. Let u = n + a. What is the tens digit of u? 4 Suppose 651 + 717 = 5z + 2w, -2z - w = -548. Suppose -3y + m - 2m = -z, m = 2y - 183. What is the tens digit of y? 9 Let w(v) = -v + 4. Let a be w(4). Let z be a/((-16)/4) + 39. Suppose 5i = 21 + z. What is the units digit of i? 2 Suppose -101b = -106b. Suppose 33 = -bm + 3m. What is the units digit of m? 1 Suppose -3 + 25 = -2o. Let i(v) = -v2 + v + 11. Let h be i(5). Let p = h - o. What is the units digit of p? 2 What is the units digit of (12775/15 - -1) + (-18)/27? 2 Suppose -3i + 110 = -3b - 337, -4i = -5b - 594. Suppose -2n = x - 3x + 160, -2x + i = n. What is the units digit of x? 7 Suppose -13 = -5d + 22. Let g(r) = -5r + 4 + 0r - d + 15r. What is the tens digit of g(3)? 2 Suppose -2i + 165 = -3i - 2g, 4g - 648 = 4i. Let f = 358 + i. What is the tens digit of f? 9 Let m(s) = s + 1. Let b(q) = -13q + 1. Let l(n) = b(n) - 6m(n). What is the tens digit of l(-4)? 7 Suppose -y + 3a + 242 = -552, 2a - 1604 = -2y. Let k be (((-20)/2)/2)/(-1). What is the tens digit of ((-2)/(-5))/(k/y)? 6 Suppose -26 = -3a - 5g, 4a + 4 = 2g + g. Suppose -v - av = s - 85, v - 93 = -s. What is the tens digit of s? 9 Suppose -9k - 93 = -21. Let z(s) = s*2 + 4s - 18. What is the units digit of z(k)? 4 Let d = 1122 + 1299. What is the units digit of d? 1 Let s(y) = -10y + 382. What is the units digit of s(18)? 2 Let i = -5 - -8. Suppose -d + 0 = -i. What is the tens digit of d/((-93)/(-84) + -1)? 2 Let z be (-15)/(-15) - (1 + -8). Suppose -1 = h - z. What is the units digit of h? 7 Let n(t) = 9t*2 - 43t + 155. What is the tens digit of n(10)? 2 Let o = -668 + 1312. What is the hundreds digit of o? 6 Let u = -431 - -1066. What is the units digit of u? 5 Suppose 4l + 37 - 117 = 0. Let f be l/(-3)90/(-24). Suppose 5b - 25 = f. What is the units digit of b? 0 Let m = 818 - 371. What is the hundreds digit of m? 4 Let r be 162/21 + 4/14. Suppose -r = -4z, 2g = -g - 4z - 64. Let n = g - -92. What is the units digit of n? 8 Let d = -76 - -34. Let h be ((-36)/d)/(2/14). Suppose -4m = -h - 186. What is the units digit of m? 8 Suppose -p - 5340 = -2j + p, 10p - 5364 = -2j. What is the units digit of j? 2 Suppose 452 + 76 = 3a. Suppose r + 2p - a = 0, -r - 759 = -5r + 3p. What is the units digit of r? 6 Let y = 388 + 553. What is the tens digit of y? 4 Suppose -4 = c + 3z, -z + 4z + 9 = 0. Suppose c*o - 6 + 1 = 0. Suppose 0 = -k -	{ "pile_set_name": "DM Mathematics" }
be -54(-3)/(-15). Let b(p) = fo(p) + m(p). What is the third derivative of b(a) wrt a? 120a3 Let m(y) = -y4 + y*3. Let x(o) = -31o*4 - 3o*3 + 13o*2. Let f(j) = -3m(j) - x(j). What is the third derivative of f(w) wrt w? 816w Let t(p) be the first derivative of 0p + 9/2p2 - 5 + 2p3. What is the second derivative of t(w) wrt w? 12 Let q(u) be the second derivative of -u9/5040 - u6/360 - u4/6 + u. Let a(p) be the third derivative of q(p). Find the second derivative of a(t) wrt t. -36t2 Let y(q) = -6q*2 - 3. Let o be (1 + 0)/1 - -1. Let z(v) = -ov*2 + 1 - 5 + 3. Let n(p) = 2y(p) - 7z(p). What is the derivative of n(h) wrt h? 4h Let s = 4 - 4. Find the first derivative of 0 + 2 + s - 3l4 wrt l. -12l3 Let r(i) = -i2 + i. Let t(y) = -13y2 - 20y. Let j(f) = -r(f) - t(f). Find the second derivative of j(h) wrt h. 28 Let h(f) = -f*3 - f. Let g(n) = -9n*3 - 12n - 8. Let c(w) = g(w) - 6h(w). Let i(l) be the first derivative of c(l). Differentiate i(a) wrt a. -18a What is the third derivative of 21x2 - 14x2 - x6 + 41x6 wrt x? 4800x*3 What is the second derivative of -9z*5 - 19z + z - 8z wrt z? -180z*3 What is the second derivative of 13s - 70s3 - 10s + 22s + 83s*3 wrt s? 78s Suppose 2o - 4 = o. What is the third derivative of 3 + no + 2n*2 + 0n*4 - 3 wrt n? 24n Let f(s) = s4 + s3 - 1. Let n(a) = -6a4 - 5a*3 - 4a*2 + 5. Let b(z) = -10f(z) - 2n(z). Find the third derivative of b(q) wrt q. 48q Let p(o) be the second derivative of o*6/15 + 5o*2/2 + 6o. Differentiate p(q) with respect to q. 8q3 Let h(s) = -s2 + 2 + 0s + s - 2s. Let p be h(0). What is the first derivative of -8o*2 - 2o*4 + 8o*p + 2 wrt o? -8o3 Let a(r) = -r2 - 7r. Let v(n) = 19n + 3n2 + 0n*2 + n. Let b = -3 - -9. Let m(c) = bv(c) + 17a(c). Find the second derivative of m(k) wrt k. 2 Let m(r) be the second derivative of 0r*2 + 7r - 5/6r3 + 0 - 1/6r*4. Find the second derivative of m(z) wrt z. -4 Suppose -6y + 8 = -2y. Differentiate 6 + yv - 3v - 5 with respect to v. -1 Let r(d) be the first derivative of 0d*3 + 1/2d*2 + 0d + 7 + 3/4d4. Find the second derivative of r(j) wrt j. 18j Find the second derivative of -5w + 0w*4 + 6w*4 + 0w*4 - 2w wrt w. 72w2 Let j(t) be the first derivative of 19t*5/5 + 5t + 15. Differentiate j(p) wrt p. 76p3 Let v(l) = -l2 + l + 1. Let h be (-5 - -3) + 0/1. Let k(q) = 2q + 3. Let m(z) = hv(z) + k(z). What is the derivative of m(w) wrt w? 4w Let x(j) = -28j3 + 16j*2. Let n(p) = 9p*3 - 5p*2. Let q(b) = -7n(b) - 2x(b). Find the third derivative of q(u) wrt u. -42 Let l be 6/(-4)(-8)/6. Suppose 22 = 7y - 6. Find the third derivative of -6a*l + 2a6 - a6 - 2a6 + ya*2 wrt a. -120a*3 What is the first derivative of -115 - 13o + 0o + 104 wrt o? -13 Find the third derivative of 21w*2 + 8w*3 - 8w*3 - 41w*6 - 9w*6 wrt w. -6000w*3 Let o = 1/7 - -5/14. Let z(t) be the second derivative of ot*2 + t + 0t*3 + 0 - 1/6t*4. Differentiate z(g) with respect to g. -4g Let u(c) = -c*2 - 13c - 7. Let s be u(-12). What is the second derivative of -5ds - 10d - 2d5 + 12d wrt d? -140d3 Suppose -5 = 2c + o, -4o - o - 25 = -4c. Suppose cv = 3v - 12. Find the second derivative of 3a - 3av - a + a4 wrt a. -24a2 What is the second derivative of -23b3 - b5 + 12b3 + 11b*3 - 3b wrt b? -20b3 Find the first derivative of 6 + 0 + 9 + 12b*2 - 4 wrt b. 24b Let d(u) = -9u4 - 21u*2 - 5. Let k(p) = -9p*4 - 22p*2 - 4. Let a(v) = 4d(v) - 5k(v). Find the third derivative of a(o) wrt o. 216o What is the derivative of 6 - 6 - 5 - 4o2 - 11 wrt o? -8o Differentiate -5y4 - 212 - 233 + 428 with respect to y. -20y*3 Let z(g) = g - 1 - 2g - 5g. Let p be z(-1). What is the second derivative of b5 + b - pb + 3b wrt b? 20b3 Let i(j) = j2 + 6j - 4. Let c be i(-7). Differentiate -12r + 4r + 8r - r*2 - c with respect to r. -2r Let s(p) be the third derivative of p*8/28 - 13p*5/60 + 2p*2. Find the third derivative of s(g) wrt g. 720g*2 Differentiate 4 - 4f + 0f - 8f + 4 wrt f. -12 Find the first derivative of 13w2 + 6 + 12 + 10 wrt w. 26w Suppose 6s = s. Let f(c) be the second derivative of -1/6c3 + s - c - c2. What is the first derivative of f(p) wrt p? -1 Let j(b) be the first derivative of -17b3/3 - 41b2/2 - 29. What is the second derivative of j(l) wrt l? -34 Let r(y) = -y3 - 3y2 - 2y - 4. Let c be r(-3). What is the second derivative of 5 - 5 - 2d4 - cd wrt d? -24d2 Let n(z) be the second derivative of -z8/84 + z4/8 + z2 + 3z. Let j(v) be the first derivative of n(v). What is the second derivative of j(b) wrt b? -80b3 Let x(q) = -8q*2. Suppose -15 = -4k + 9. Let c(m) = -m4 - m2. Let n(s) = kc(s) - x(s). Find the third derivative of n(l) wrt l. -144l What is the third derivative of -2j6 - 27j*3 + 27j*3 - 3j*2 wrt j? -240j*3 Let r(o) = 3o + 31. Let z be r(-9). Let b(i) be the first derivative of 2 - i*2 + 0i*3 + 3/4i*z + 0i. What is the second derivative of b(g) wrt g? 18g Let x(j) be the second derivative of 5/12j*4 + 0j*6 + 0j*3 + 2/21j*7 + 0 - 2j + 0j2 + 0j*5. What is the third derivative of x(n) wrt n? 240n2 Let j(v) = -v3 + 9v2 - 4. Let t be j(9). Let l = -2 - t. Find the third derivative of s5 + 2sl + s5 + 2s5 wrt s. 240s2 Let h = -3 - -5. What is the third derivative of -t2 - 7th + 5t*6 + 3t*6 + 2t*2 wrt t? 960t3 Let s(f) = f2 + 8f - 12. Let p be s(-10). Find the second derivative of -k5 - 3k - k*5 + pk wrt k. -40k3 Let s be -2(2 + (-51)/6). Suppose 4q + 18 = -2a, 0 = -2a + 5a - 2q - s. What is the second derivative of 1 + 0 + 4r*3 + 4r - a wrt r? 24r Let u(f) be the second derivative of -7f5/20 + f3/6 + 9f. What is the second derivative of u(s) wrt s? -42s Suppose 4a - 13 = q, 5a + 0a = 2q + 20. Find the second derivative of -ai5 + 5i*5 + 3i + 2i5 - 3i*5 wrt i. 40i*3 Let p(t) be the third derivative of 7t*6/30 - 17t*4/24 + 23t*2. What is the second derivative of p(m) wrt m? 168m Let j(r) = 29r3 + 6r*2 - 19r + 6. Let w(i) = -29i3 - 5i*2 + 18i - 5. Let h(m) = 5j(m) + 6w(m). What is the second derivative of h(a) wrt a? -174a Let k(r) = r4 + r3 + r. Let z(l) = l4 + 4l*3 - 11l*2 + 4l. Let n(m) = 4k(m) - z(m). What is the third derivative of n(j) wrt j? 72j Let b(x) = -2x - 5. Let p(q) = -3q - 6. Let z(i) = -4b(i) + 3p(i). Let t be z(-2). What is the second derivative of -3o4 - 2o + 2o4 + 2o*t wrt o? 12o2 What is the third derivative of p2 + 85 + p*2 - 43 - 47 - 35p*6 wrt p? -4200p*3 Let q = -40 - -44. Suppose 5h - 3 - 7 = 0. Find the first derivative of 4 - 1 + 1 - 4cq - h wrt c. -16c*3 Suppose 2 = 4a - 3j, -2a - 2 = -j - 4. Find the third derivative of -7d2 - 3d*3 + 3d*3 + 2d*a - 2d*4 wrt d. -48d Suppose 0 = -4r - r + 25. Let i be (-2)/(-3) - (-104)/24. Find the third derivative of 2d*2 + 0d*2 - 2dr - d5 - id2 wrt d. -180d*2 Let t(s) = -s - 1. Let u(i) = 4i*3 - 5 + 0i2 + i2 - 2i - 3i. Let d(w) = -5t(w) + u(w). What is the third derivative of d(f) wrt f? 24 Let p(f) be the first derivative of f5 + 4f*3/3 + 8. What is the third derivative of p(l) wrt l? 120l Let z(a) = a + 14. Let j be z(-10). What is the derivative of 5h2 + 2h*2 - 6h*2 + 2 - jh*2 wrt h? -6h Let h(i) be the second derivative of 7i5/5 + 35i*4/12 - 58i. Find the third derivative of h(l) wrt l. 168 Let d(l) = 84l + 79. Let c(i) = -17i - 16. Let m(y) = -11c(y) - 2d(y). What is the first derivative of m(n) wrt n? 19 Suppose 2k + 180 = -2k. Let i be k/(-12) + (-3)/(-12). What is the second derivative of -4 + l*i - 2l + 4 wrt l? 12l2 Let n(d) be the first derivative of -d5/5 + d3/3 - 4d + 4. Let a(p) be the first derivative of n(p). Find the second derivative of a(b) wrt b. -24b Let i = -4 + 6. Find the second derivative of 6q - 2qi - 2q + q2 wrt q. -2 Let d(w) = w3 - 4w2 + 3w + 3. Let i be d(3). Find the second derivative of v - iv*	{ "pile_set_name": "DM Mathematics" }
Let h(n) = 11n - 6n + 4n2 - 5n. Determine t(h(w)). 68w2 Let c(r) be the first derivative of -r3/3 - 41. Let t(n) = -20n - 3. Determine c(t(s)). -400s2 - 120s - 9 Let v(t) be the third derivative of 0 + t*2 + 0t + 3/8t4 + 0t*3. Let z(g) = -6g + 6g - g + g + g2. Determine v(z(f)). 9f*2 Let a(b) = -4b. Let n = 609 + -609. Let x(y) be the first derivative of 0y + 3 + ny*2 + 2/3y*3. What is a(x(f))? -8f*2 Let q(k) = 12k + 48. Let b(a) = 1. Let g(j) = -48b(j) + q(j). Let x(i) = -i + 6. Let d be x(3). Let f(l) = dl*2 - 4l*2 + 2 - 2. What is f(g(z))? -144z2 Let z(v) = -v2 - 27v - 5. Let n be z(-25). Let b(a) = -50a - na + 98a. Let h(w) = w*2. Calculate b(h(q)). 3q*2 Let c(l) be the second derivative of -4l*5/5 + 9l*2/2 + 9l. Let m(n) be the first derivative of c(n). Let t(a) = 2a. Give t(m(v)). -96v*2 Let q(k) = 492k*2. Let o(g) = -3g*2. Give q(o(h)). 4428h*4 Let m(h) = -4h + h + 4h. Let w(r) be the second derivative of 2r - 1/3r3 + 0r*2 + 0. Calculate w(m(s)). -2s Let v(o) = -7o. Let c(a) be the third derivative of a8/20160 - a5/12 - 12a*2. Let x(z) be the third derivative of c(z). Give v(x(t)). -7t*2 Suppose -2j + 3j = 5. Let l(z) = 6z*2 - jz2 + z2. Let b(r) = r*2 + 6r. Let m(o) = o*2 + o. Let x(y) = -b(y) + 6m(y). Determine l(x(q)). 50q4 Let f(k) = 7253k. Let b(p) = p. What is f(b(g))? 7253g Let w(a) = 0a + 282 + 0a - 282 - 2a. Let q(c) = -17c - 3. What is w(q(m))? 34m + 6 Let f(g) = -2g2 + g + 1. Let q(d) = -d2 - d - 1. Let i(z) = f(z) + q(z). Let u(h) = -29h. Give u(i(t)). 87t2 Let k(w) = 2w*2. Let a be (1(-18)/6 + 2)-4. Let i(h) be the third derivative of 5h*2 + 0h*3 + 0 - 1/4h*a + 0h. Give i(k(y)). -12y2 Let t(u) = -u2 - 707u. Let h(z) = 33z. Give h(t(s)). -33s*2 - 23331s Let z(a) = -83a - 5. Let t(o) = 16o + 1. Let c(d) = -11t(d) - 2z(d). Let p(q) = 2q2. Calculate c(p(i)). -20i*2 - 1 Let h(k) = -2k + 5. Let f = 1 - 2. Let v = -4 + f. Let y(u) = 1. Let j(g) = vy(g) + h(g). Let i(r) = -11r*2. What is i(j(l))? -44l*2 Let y(s) = -187s + 11. Let p(k) = 12k + 5. Determine p(y(h)). -2244h + 137 Let g(i) be the first derivative of 7i2/2 + 2. Suppose -4x - x = -35. Let p(w) = 5w - 15w + xw + 4w. What is g(p(h))? 7h Let g = 32 + -9. Let b(n) = 15 + 3n*2 - g + 8. Let i(k) be the first derivative of 2k*3/3 - 1. What is b(i(x))? 12x*4 Let o(k) = -k. Let s(b) = -16b - 7. Let p be -2 - -5 - (5 - 4). Let l(j) = -5j - 2. Let z(i) = ps(i) - 7l(i). Calculate z(o(g)). -3g Let x(i) = 2i + 12. Let p(s) = 25s + 27. Calculate x(p(a)). 50a + 66 Let w(b) = -4b + 7b + 6b. Let d(o) = 7o + 9. Let z(h) = -6 + 85h + 2 - 88h. Let u(y) = 4d(y) + 9z(y). What is w(u(q))? 9q Let x be 2/4 - (-75)/6. Let m(d) = 4d2 - 13d + xd. Let y(l) = 6l*2. Give y(m(z)). 96z*4 Let t(n) = -n. Let r(f) = 483675f. Give t(r(i)). -483675i Let s(f) = 3f. Let g(h) be the third derivative of -h*5/30 + 31h*3/6 + 3h*2 - 10. Calculate s(g(x)). -6x*2 + 93 Let m(n) = -6407n. Let u(r) = 58r2. Calculate u(m(c)). 2380879642c*2 Let o(g) be the third derivative of -2g*5/15 - 2g*2 - 32g. Let v(f) be the third derivative of -f*4/6 - 3f*2. Give o(v(x)). -128x*2 Let x = 36 + -34. Let c(u) = -6u*2 + 0u*2 + 2u*2 + xu*2. Let v(b) = -b + 34. Give v(c(f)). 2f*2 + 34 Let z(v) = -v - 397 + 397. Let m(r) = -81r. Give z(m(u)). 81u Let t(z) = -z2 - 6z. Let y(q) = -26q - 7. Give t(y(x)). -676x*2 - 208x - 7 Suppose 1 = 3w - 20. Let q(r) = -4r + wr - r. Let c(l) = 14l. Calculate q(c(n)). 28n Let k(g) = -66g*2. Let h(l) be the third derivative of 0 - 1/24l*4 + 0l + 0l3 - 13l*2. Determine h(k(w)). 66w*2 Let m(v) = 49v - 5v2 - 49v. Let r(o) be the first derivative of 4o3/3 + 11. Calculate r(m(p)). 100p4 Let r(v) = -v2. Let t(n) = -4n2 - 3n - 511. Determine t(r(h)). -4h4 + 3h2 - 511 Let s(q) be the third derivative of -q4/6 + 6q3 + 8q*2 - 10. Let z(f) = 2f*2. Determine s(z(b)). -8b*2 + 36 Let k(m) be the third derivative of -29m*5/60 + 5m*2 - 2m. Let q(w) = w. Calculate k(q(s)). -29s2 Let v(s) be the first derivative of s6/120 - 2s3/3 + 16. Let z(o) be the third derivative of v(o). Let x(u) = u2. What is x(z(r))? 9r4 Let m(i) = i2. Let f(b) = 1315b. What is m(f(d))? 1729225d2 Let f(a) = 19a*2. Let y(k) = -3k + 6k - 5k + 11k. Let q(j) = -4j. Let h(s) = -7q(s) - 3y(s). Determine f(h(d)). 19d2 Let f(p) be the first derivative of -2p*2 + 1 - 18 + 4p*2 + 0p*2. Let h(o) = -4o. Determine h(f(x)). -16x Let x(r) = 181r*2 + 7r + 2. Let w be x(-1). Let p(o) = -221o + 432o - wo. Let t(i) = -2i. What is p(t(z))? -70z Let p(d) = -14d*2. Let m(b) = 5b*2. Let z(j) = -17m(j) - 6p(j). Let v(l) = 0l*2 - 7l*2 + 9l*2 + 3l*2. What is v(z(u))? 5u*4 Let s(d) = -19d*2 - 2. Let x(f) = 20f + 2. Let v(z) = 109z + 11. Let o(g) = 2v(g) - 11x(g). Determine s(o(p)). -76p*2 - 2 Let t(m) = m - 195. Let v(k) = 23k + 7. Determine v(t(i)). 23i - 4478 Let a(f) be the second derivative of -f7/2520 - f4/4 + 23f. Let q(k) be the third derivative of a(k). Let s(j) = 2j2. Calculate q(s(l)). -4l*4 Suppose 5h - 14 = 1. Let o(f) = -7f2 + hf*2 + 4f*2 + 2f*2. Let z(l) = 8l*2. Give o(z(u)). 128u*4 Let x(y) = -4y. Let u(f) = 690014f. Determine x(u(b)). -2760056b Let h(j) = -j*2 - 1. Let i(b) = -20b*2 - 15. Let o(z) = -15h(z) + i(z). Let m(k) = -26k - 16k + 3k2 + 64k - 22k. Calculate o(m(q)). -45q*4 Let l(c) = -7c2 - c + c. Let q(n) = -2. Let p(m) = m2 - 3. Let z(r) = -2r - 13. Let f be z(-8). Let j(w) = fq(w) - 2p(w). Calculate l(j(t)). -28t*4 Let r(m) = 2m*2 - 5m - 5. Let q(t) = -8t2 + 16t + 16. Let h(b) = 5q(b) + 16r(b). Let u(v) = 8v2. Give u(h(p)). 512p*4 Let y(u) = 4u*2 - 8u + 4. Let j(i) = 2i - 1. Let b(d) = -12j(d) - 3y(d). Let m(k) = -6k*2. Calculate b(m(f)). -432f*4 Let f(v) = 2v. Let p be (-20)/25 - (-4)/5. Let h be 50(-1 + p)/(-2). Let x(u) = 6u + 42 - h - 17. Give f(x(a)). 12a Let q(w) = 74w - 135w + 70w. Let d(a) = 9a. Determine d(q(z)). 81z Let z(j) = -4j2. Let s(b) = 29b*2 + 5. Let k(y) = 31y*2 + 6. Let i(h) = 5k(h) - 6s(h). What is z(i(f))? -1444f*4 Let w(f) = 5f. Let j(b) be the second derivative of 0b2 - 2b + 0 + 1/2b3. Determine w(j(h)). 15h Let w(k) = -2k2. Let g(m) be the second derivative of 0m*2 + 1/4m*4 + 0m*3 + 0 + 10m. Calculate g(w(z)). 12z4 Let z(r) be the first derivative of -r3/3 - 1. Let h(t) = -312t*2 - 306t*2 + 620t*2. Give h(z(g)). 2g*4 Suppose 2d - d + 37 = 4t, 73 = -4d + t. Let n = d + 25. Let g(j) = nj - 7j - 2j. Let s(x) = -4x. Calculate g(s(f)). 4f Let u(c) = 2c. Let d(s) be the first derivative of -7s - 2 - 5/3s*4 + 0s*3 + 0s*2. Let q(n) be the first derivative of d(n). Determine u(q(y)). -40y*2 Let r(p) = -73p. Let f(h) = -519h - 12. Determine f(r(a)). 37887a - 12 Let k(q) = -33406q. Let v(d) = 13d. Determine v(k(m)). -434278m Let q(b) = b2. Let a(i) be the third derivative of -69i*4/2 - 202i*2. Give q(a(k)). 685584k*2 Let m(b) = 21b. Let u(x) be the third derivative of -3x5/20 + 157x*2. Calculate m(u(q)). -189q*2 Let d(y) = -35y*2. Let u(w) = 6w + 14. Let f(c) = c*3 + 2c*2 - 3c - 5. Let s be f(-3). Let n(j) = -2j - 5. Let t(a) = su(a) - 14n(a). Give t(d(v)). 70v*2 Let d(y) = -12 - 22 - y + 37. Let w(g) = -g + 1. Let o(a) = -d(a) + 3w(a). Let i(m) = -2m2. Give o(i(x)). 4x*2 Let y(m) = 4m*2. Let o(c) be the first derivative of -7c*4/12 + 45c - 34. Let s(v) be the first derivative of o(v). What is s(y(i))? -112i4 Let z(f) = -43f*2 + 4. Let t(c) = -27c. Give z(t(b)). -31347b2 + 4 Let i(v) = 21v*2 - 11v + 22. Let d(c) = 4c2 - 2c + 4. Let b(k) = 11d(k) - 2i(k). Let a(p) = -33p2. Calculate b(a(w)). 2178w*4 Let n(i) = 128i*2. Let s(g) = 2g + 1. Let u(a) = a*2 + 6a + 3. Let x(r) = 6s(r) - 2u(r). Calculate x(n(f)). -32768f4 Let o(w) = w. Let f(q) = -91q + 86q + 41q + 94q + 1 + 98q. Determine o(f(u)). 228u + 1 Let n(y) = -y*2. Let s(b) be the second deriva	{ "pile_set_name": "DM Mathematics" }
). 0 Let m(l) = -6l3 - 20l*2 + 6l + 17. Let j(i) = -5i3 - 18i*2 + 6i + 14. Let k(w) = 7j(w) - 6m(w). Calculate k(6). 32 Let t(u) = -u*3 - 5u*2 - 9u - 57. Let a(w) = -w*3 - 6w*2 - 9w - 47. Let l(j) = 5a(j) - 4t(j). Determine l(-9). -7 Suppose 2b = 7b - 10. Suppose 37 = g - 4c, -g - 5c = -bg + 42. Let r(y) = -y2 - g - y3 - 8y + 12 - 6y2. Calculate r(-6). 7 Let o(p) be the first derivative of p3/3 + 9p*2/2 - 8p + 14206. Let r = -7 + -4. Give o(r). 14 Let v(l) = 3l2 - 2l. Let c be v(2). Let m(h) = h*2 + c - 21 + 12 - h. Let p be m(-1). Let f(j) = -j. Give f(p). -1 Let r(j) = -2j*3 - 2j*2 + 3j + 3. Suppose -7l + 17k + 121 = -2l, -l - 43 = 5k. What is r(l)? 30 Let z(r) = 1 - 3 - 3 + 6 - 8 - r. Let d be 1/(3/15) - (2 + 8). Give z(d). -2 Let b = 8804 + -8803. Let l(a) = -40a3 - a + 1. Determine l(b). -40 Let c(n) = 6n - 3319 + 0n + 3283. What is c(9)? 18 Let s(d) = -d3 + 8d*2 - 2d + 1. Let a = -4057 + 4065. Give s(a). -15 Suppose -12o + 8o + 4 = 0, 5o - 25 = -5q. Suppose 4l - 6 = -qy + 62, -3y = -3l - 45. Let k(d) = -11 + y - d*2 - 4 - 5d. Calculate k(-4). 5 Let m(f) = -16f2 - 591f + 49. Let y be m(-37). Let c(a) = -a*3 + 14a*2 - 27a - 19. Give c(y). -55 Let d = -19 + 22. Let i(b) = -34 + 14 - db - 13. Let k be i(-9). Let u(z) = -z2 - 7z - 6. Determine u(k). 0 Suppose -14q = -18q + 4. Let s(j) = j*2 - 7j - 5. Let x(y) be the third derivative of y5/60 - y4/3 - y3 + y2. Let o(b) = 7s(b) - 6x(b). Give o(q). 1 Let t(v) = -v*3 + 9v*2 - 8v - 6. Suppose 5 + 26 = m. Suppose -3o + 29 = z, 28o - 26o + 3z = m. Calculate t(o). -6 Let m(k) be the second derivative of -k6/720 - k5/120 + 11k4/4 - k2/2 - 39k. Let w(d) be the third derivative of m(d). Give w(7). -8 Suppose 16q - 48 = 224. Let g(p) = -p2 - 24p + 33. Let d(k) = 3k2 + 70k - 97. Let w(z) = qg(z) + 6d(z). Calculate w(-13). -8 Let p(c) = 43 - 877c3 - 227 - 870c*3 - 878c*3 + 2626c*3 + 25c + 16c2. Determine p(-13). -2 Let o(j) = -j2 + 0j*2 - 5j2. Let n = -171 - -170. Let l be o(n). Let y(g) = g3 + 5g2 - 6g - 1. Calculate y(l). -1 Let i(c) be the first derivative of 2c3/3 - 9c*2/2 + 3c - 437. Determine i(6). 21 Let g(f) = f*3 + 27f*2 + f + 16. Suppose 3v + 85 = -4j, 3v + 22j = 21j - 82. What is g(v)? -11 Let i be (15/135-15)/(2/244). Let r(n) = -n*2 - 10n - 30. Give r(i). -5 Let a = -98 - -101. Suppose s - 6 = as - 5g, 2 = -s + 2g. Let y(i) = -1 + 2 - s + 4i. Determine y(-2). -9 Let q be 1150/(-40825) - (-2552)/(-142). Let i(v) = -10v - 98. Give i(q). 82 Let y(c) = -c. Let b(h) = 3 - 11h + 7h + 0. Let z(g) = b(g) - 2y(g). Let s be -8(-15)/(-10)(-1)/3. Calculate z(s). -5 Let j(c) = -8c - 9. Let i(m) = -2m*2 - 119m - 1371. Let v be i(-44). Calculate j(v). 47 Let p(o) be the first derivative of -3o4/4 + 2o*3/3 + 5o*2/2 - 4o - 41. Let h(z) = -4z3 + z2 + 6z - 3. Let w(t) = 2h(t) - 3p(t). Give w(4). -6 Suppose -4o - 8 = -24. Let j be (-9)/o + (-4)/(-16). Let c(b) = 0 - 3b + 1 - 27b2 - 42b*2 - 35b*2 + 103b*2. What is c(j)? 3 Let n(d) = 20d + 20. Suppose 0 = -384v + 354 + 414. Give n(v). 60 Let z(w) = 16w*2 - 3w + 1. Let u(o) = o. Let q(m) = -u(m) - z(m). Let p = -597 - -615. Suppose 26n - pn = 8. Calculate q(n). -15 Let i(k) = -k*3 - 2k*2 + k - 2. Let t = 7172 - 7176. Calculate i(t). 26 Let k(f) = -6f*2 + 2f + 1. Let o(p) = -14p - 64. Let q be o(-5). Let b be (-3 + q/3)/1. Calculate k(b). -7 Let z be (-1)/(-3) + (171/(-27) - -2) + 7. Let b(w) = w3 - 5w - 6. Determine b(z). 6 Let c(l) be the first derivative of l*3/3 + 7l*2/2 - 3l + 1. Let w be 156/(-1014) - (-4)/(-26)-1. Let v be w - 5 - (2 + -5 + 5). Give c(v). -3 Let s(x) = -13x*3 + 3 - 10x*2 + 5x*3 + 7x*3. Suppose 4p + 2i = -50, -5i = -2p - 159 + 164. Give s(p). 3 Suppose 125v - 3 = 124v. Let a(r) = -1 + 32r*3 + 4 - vr*2 - 6r - 31r3. What is a(4)? -5 Suppose 4455g = 2235g + 2234g + 14. Let y(k) be the first derivative of 3k3 + k2 + 2k - 2 + 0k3 - k. What is y(g)? 8 Let b(u) = -439 - 2u - 439 - 444 + 1289. Give b(-20). 7 Suppose -2v + 6s - s = 17, 5s = -5v - 60. Let k(m) = 5m3 - 16m2 - m - 6. Let x(o) = o3 - 3o2 - 1. Let j(z) = vx(z) + 2k(z). What is j(2)? -9 Suppose -4m = 38 - 78. Let o(u) = -2 - 2 + 11 + 3 - 3u + 1. Determine o(m). -19 Let x be 1(-18)/(-24)4. Let z(j) = 42 - 84 + 41 - 3jx. What is z(1)? -4 Let k(f) = f3 + 7 + 7 + 57f2 - 2f - 52f2. Let p be ((-9)/12)/((-17)/(-2312)17). Give k(p). -10 Let l = -92 + 88. Let b(d) be the second derivative of -5/2d2 - 1/6d*3 + 1/3d*4 + 1/20d*5 - 1 + 3d. What is b(l)? -1 Let l(m) = -m*2 - 10m - 23. Let j be l(-4). Let z(s) = s*2 - 7s + 5. What is z(j)? -1 Let i(u) = -u*2 + 7u - 6. Let w be i(4). Let h = 0 - w. Let z(y) = 8y3 + 7y*2 + 21y - 5. Let b(o) = -o*3 - 2o. Let f(j) = 7b(j) + z(j). What is f(h)? -11 Let w(q) = -q2 + 2q + 3. Let b be (30/(-20))/((-3)/8). Give w(b). -5 Let p = -252 + 348. Let c(n) = -33 - 25 + 4n + p - 36 - n3 - 6n*2. Determine c(-6). -22 Suppose 0 = -39r + 45r + 1944. Let a = r + 331. Let l(z) = -z2 + 7z + 3. What is l(a)? 3 Let b(k) = -15k + 1288. Let i be b(87). Let h(s) = s3 + 18s*2 + 16s + 8. What is h(i)? 25 Let i(s) be the third derivative of 17s2 + 0 + 0s + 1/12s4 + 1/2s*3 - 1/120s*6 - 1/30s*5. Let b be 26/(-8) + 1/4. Determine i(b). 6 Let u(g) = -62g*2 - 2295g - 23. Let o be u(-37). Let p(q) = 10q - 148. Determine p(o). -8 Suppose -5c = -c - 36 + 4, -67 = -3v - 8c. Let t(a) = -1 + 0a - 3a*3 + a + 0a. What is t(v)? -3 Let l(u) = 9u3 - 2u*2 + u. Suppose -16c = -6c - 330. Suppose 0 = -4i - c + 37. What is l(i)? 8 Suppose 564f - 587f = -46. Let m(x) be the first derivative of -6x - 1/2xf - 4. What is m(0)? -6 Let t(p) = p2 - 87p + 53. Let n(u) = u2 - 129u + 80. Let d(a) = 5n(a) - 7t(a). Give d(-19). -9 Let r(d) = -4d3 + 3d*2 - 3d + 1. Let y(v) = 6v - 13. Let o be y(3). Let m(b) = 5b*3 - 3b*2 + 3b - 1. Let z(w) = om(w) + 6r(w). Give z(-3). 10 Let z(c) = -5c3 - 9c*2 + 9c + 155. Let k(t) = -t*3 - 2t*2 + 2t + 39. Let p(l) = 9k(l) - 2z(l). Let h = 6560 + -6560. Determine p(h). 41 Let i(w) be the first derivative of -w*2 - 6w + 7627. Determine i(6). -18 Let v(b) = -57b2 - 14b - 3. Let h(d) = 365d2 + 89d + 18. Let q(p) = 2h(p) + 13v(p). Give q(-1). -10 Suppose -2a + 61 = -2w - w, -3w = -a + 29. Suppose 4o - a + 60 = 0. Let h(x) = -x*3 - 7x*2 + 3x + 3. Calculate h(o). -18 Let q(c) be the first derivative of 2c + 31 + 1/3c*3 - 5c*2. Calculate q(10). 2 Let w(t) = 6t*3 - 6t - 4t3 + 21 - 8t*2 - 35 + 13 - 4t3. Determine w(-3). -1 Let a(p) = p2 + 9p - 11. Suppose -2x + 22 = -42i + 38i, 4x - 23 = 5i. What is a(i)? -25 Let i be -4 + (-4 - -3) + 1. Let v be ((-9)/27)/((4/9)/i). Let a(k) = -2k2 + 2k + 1. What is a(v)? -11 Let p(o) = o2 + o - 18. Let n(h) = -h3 - 4h2 + 6h - 3. Let q be n(3). Let l = 50 + q. Suppose lm = 6m. Calculate p(m). -18 Let l(v) be the second derivative of -23v5/20 - v4/12 + v. Let t(n) be the second derivative of n3/6 - 6n*2 + 127n. Let o be t(13). Determine l(o). -24 Let n(u) be the second derivative of 0 + 1/30u5 + 0u*2 - 2/3u*3 - 1/90u*6 - 12u - 1/8u4. Let p(q) be the second derivative of n(q). Calculate p(2). -11 Let p(z) be the first derivative of -57 - 4/3z*3 + 1/2z*2 + 1/4z*4 + 2z. Determine p(3). -4 Let r(u) = 7u + 3. Let a(m) = -4m - 3. Let q(y) = -3a(y) - 2r(y). Suppose 4o - 2j - 22 = 0, j = o - j - 10. Calculate q(o). -5 Suppose 0 = 5c - 7c - 3z + 20, -5c = -5z. Suppose 9s + 40 = c. Let d(k) = k*2 + 4k - 2. Determine d(s). -2 Let k(h) = -7h + 80. Let o(m) = -m3 - 64m*2 - 5m - 307. Let f be o(-64). Determine k(f). -11 Let x(f) = f*3 - 7f*2 + 20f - 58. Let v be x(5). Let s(p) = p*3 + 8p*2 + 7. Give s(v). 7 Let c be 0 + -2 - (-1 + 3). Let s = -229 + 231. Let n(b) = -3b*s - 5 - 3b*2 + 6b2 + b2 + b. What is n(c)? 7 Let g(m) = -1 - m - 64m3 + 3 - 2 + 72m**3. Suppose z + 8 = -0. Let v = -9 - z. Determine g(v). -7 Let a(i) be the second der	{ "pile_set_name": "DM Mathematics" }
ppose 5d = -5, 0s + 20 = s - 4d. Let l = s - 11. Let q = l - 1. What is the units digit of q? 4 Let d(t) = 3t*2 - 6t + 5. Let n be d(4). Let v = 40 - n. What is the tens digit of v? 1 Suppose -5n = -4g + 2g + 121, 5g - n - 268 = 0. Let h = 78 - g. What is the tens digit of h? 2 Suppose 3c = -k - k - 16, 3c + 18 = -3k. Suppose -2y + 0y = -2. What is the units digit of -2 + y - (-7 - k)? 4 Suppose -9p + 8p = -3. Suppose -6f - 15 = -pf. Let d = f + 15. What is the units digit of d? 0 Suppose 3d - 96 = 5i - 6, -d = 5i - 50. What is the tens digit of d? 3 Let i = -760 + 1109. What is the tens digit of i? 4 Suppose -3s - 7 = -r - 2s, 0 = -3r - 3s - 3. What is the units digit of r? 3 What is the units digit of (-38)/10(-4 + -1)? 9 Let y(u) = -9u + 14. What is the units digit of y(-25)? 9 Suppose -5n - 56 = 3q + 8, 3q - 24 = 3n. Let v = n + 15. What is the units digit of v? 4 What is the tens digit of (-54)/(-4) + 9/6? 1 Suppose -3z + 12 = -3. Suppose 0 = -zr + 41 + 9. What is the tens digit of r? 1 What is the tens digit of -2365/(-30)3? 1 Suppose -35 = -5u + 4f, u + 4f = -u - 14. Suppose 5g + 22 = ut - 13, -4g - 37 = -3t. What is the units digit of t? 5 Let o(v) = v + 1. Suppose 0 = 4t + 4n - 4, 2n = 0. What is the units digit of o(t)? 2 What is the units digit of ((-6125)/(-84) + 6/8)3? 1 Suppose -7d + 2d + 660 = 0. Let p = d + -90. What is the tens digit of p? 4 Let b(m) = 4m*2 + 5m + 7. Let a be (-2)/13 + 185/(-65). What is the units digit of b(a)? 8 Let d be 0 - 4/2-1. Suppose 88 = du - 6u. Let c = 33 + u. What is the units digit of c? 1 Let u(x) = x2 + 7x + 9. Let c be ((-18)/(-15))/(1/(-5)). What is the units digit of u(c)? 3 Suppose 5w + 233 - 38 = 0. What is the units digit of (3 - w/6)2? 9 Let c = -8 - -16. Let o(d) = -d*2 + 10d - 11. Let s(h) = -h + 1. Let y(w) = -o(w) - 2s(w). What is the units digit of y(c)? 9 Let d(l) = l3 - 2l - 1. Let v be d(-1). Suppose 11 = -3x - j, -8j = 5x - 4j + 30. What is the units digit of 4 + 1 - (v + x)? 7 Let u(g) = g*2 + 6g + 7. Let b be u(-8). Let r = b + -1. What is the tens digit of r? 2 Let u = 60 - 39. What is the tens digit of u? 2 Let c(t) be the second derivative of t*3/6 - 9t*2/2 + 8t. What is the units digit of c(10)? 1 Let d(r) = 20r2 - r - 1. What is the units digit of d(-1)? 0 Suppose 4d - 175 = -d. What is the units digit of d? 5 What is the tens digit of 5/(-2)64/(-10)? 1 Let r be (-5)/15 + 20/6. Let y(v) = 2 - 5v - 4v3 + 3v*3 - 1 - 3 - rv*2. What is the tens digit of y(-3)? 1 Suppose -8y + 9y - 60 = 0. What is the tens digit of y? 6 Let l be 2/(-8) - 98/(-8). Let f be 1/(13/7 - 2). Let d = l + f. What is the units digit of d? 5 Let k(x) = -x3 + 5x*2 - 2x - 2. Let f be k(4). Let j = 11 + f. What is the tens digit of j? 1 What is the tens digit of 1/(-7) + (-1037)/(-7)? 4 Let q be 0/(6/(-3 - -6)). Let b(n) = -n*2 + n + 2. Let f be b(q). What is the tens digit of 28/2115/f? 1 Let l be (-3)/(26/32 + -1). Suppose -62 = -5r - w, r + 2w - l = -0r. Suppose r = a + a. What is the units digit of a? 6 Let q = 187 + -113. Suppose -4k - 22 = -q. Let z = 18 - k. What is the units digit of z? 5 Let n = -13 - -23. What is the units digit of n? 0 Suppose 4j - 26 = 86. What is the tens digit of j? 2 Let l(u) be the third derivative of 0u - 1/24u4 + 0 + 11/6u*3 - 3u*2. What is the units digit of l(5)? 6 Let c = 224 - 136. What is the units digit of c? 8 Suppose -10 = -x + 6x. Let f be ((-6)/(-9))/(x/9). What is the units digit of 4/3 - (-1)/f? 1 Let l(d) be the first derivative of 2 + 9d + 1/2d*2 + 1/3d*3. What is the units digit of l(0)? 9 Suppose 13 + 12 = 5h. Suppose -hf + 5s - s + 22 = 0, -32 = -4f - 4s. What is the units digit of f/(-21) - 111/(-21)? 5 Let g be 6/2 + 8 + -1. Suppose -3j + g = -5. Let h = 8 - j. What is the units digit of h? 3 Let h(c) be the second derivative of c3/2 + 2c. What is the tens digit of h(5)? 1 Suppose -2q + 20 = 3q, 2y - 52 = -q. Let p = -11 + y. What is the tens digit of p? 1 Suppose -p - 3p + 2j = -30, 0 = 4p + j - 27. Let d = p - 11. What is the tens digit of 2/d + (-25)/(-2)? 1 Let r be (-40)/(-6)6/4. What is the tens digit of 126/r + 3/(-5)? 1 Let h(d) = 71d - 8. What is the units digit of h(4)? 6 Let j = 14 - -5. What is the tens digit of j? 1 Suppose -6q + 2 = -5q. Suppose qy + 3 = -f - 1, -2f = y - 4. Suppose -3g = -47 - f. What is the units digit of g? 7 Let m = -20 - -15. Let l = m - -11. What is the units digit of l? 6 Suppose 5 = 2a + 4o + 3, 0 = -5a + 4o + 61. What is the units digit of a? 9 Let v(y) = -95y3 - y2 + 2y + 3. What is the tens digit of v(-1)? 9 Suppose x - 4m = 2x - 42, 2m = x - 72. Suppose 3b + 23 = x. What is the units digit of b? 3 What is the units digit of 744/34 + 22/187? 2 Suppose -t + 6 = t, 0 = -5y - t + 3. Let q = 12 - 28. Let r = y - q. What is the units digit of r? 6 Let w be 0(15/6 + -2). Let m be (-4)/(-5) - (-3)/15. Suppose 5g - m = n, wn + 5n + 5g - 115 = 0. What is the tens digit of n? 1 Suppose 5x - 5i + 4 = 9, 3i + 15 = 5x. Let z(p) = p - 8. Let u be z(9). What is the units digit of u + 2(-2 + x)? 9 Let z(p) = -p*2. Let g be z(-9). Let k = -34 - g. What is the tens digit of k? 4 Let z be 2/(-5) + (-144)/(-10). Let q = z + -10. Let b = q - -3. What is the units digit of b? 7 Let q = 502 + -285. What is the hundreds digit of q? 2 Let c = -76 - -122. What is the tens digit of c? 4 Let u be (-14 + 7)(-1 + 0). Let n(p) = p + 2. Let i be n(u). Suppose d = -3 + i. What is the units digit of d? 6 Let u(p) = 2p3 - 6p*2 + 3. What is the tens digit of u(4)? 3 Suppose -p = -2d - 2, -2d - 4p + 8 = -0p. Suppose d = 4s + 4l - 36, 0l = -3l - 15. What is the tens digit of s? 1 Let g = 16 + 88. What is the units digit of g? 4 Suppose -2u + q - 4 = 0, 5u + 2q + 3q = 20. Suppose uy + 5y - 15 = 0. Suppose -a + y = 2. What is the units digit of a? 1 Let r = 40 - 29. Let z = r + -6. Suppose 0v = zv - 20. What is the units digit of v? 4 Let b be 1 + 1 + 6 + -7. Suppose -r + 4 - b = 0. What is the units digit of r? 3 Let b(d) = -3 - 1 + 2d*2 - d + 1. What is the units digit of b(3)? 2 Let h = -3 - -6. Let l be ((-2)/6)/(h/(-873)). Suppose -16 = -4a, 2a - l = -5f - a. What is the tens digit of f? 1 Let s be 0 - (11 + -2 + 3). Let c be (-2)/(-3)s/8. Let m = 3 - c. What is the units digit of m? 4 Suppose -4c - y = -9 - 4, 2y = -4c + 18. Suppose -cz = -0z - 48. Suppose -1 = -5t + z. What is the units digit of t? 5 Let d be ((-12)/(-16))/((-2)/(-8)). Suppose -4h - 5 = 3. Let a = d + h. What is the units digit of a? 1 Suppose -2d + 5d + 33 = 0. Let g be 84/(-22) + 2/d. Let i(h) = h*2 + 3h - 2. What is the units digit of i(g)? 2 Suppose -g + 4l = -l + 6, 2 = -g + 3l. Suppose -2w + gw + 3x - 55 = 0, -5w - 4x = -148. What is the units digit of w? 2 Let m(t) = -2t + 12. What is the units digit of m(-11)? 4 Suppose 5a = 6 - 1. Let x be ((-8)/(-6))/(2/9). Let d = x - a. What is the units digit of d? 5 Let c(o) = o + 7. What is the units digit of c(-6)? 1 Let p(c) = c3 + 8c*2 + c + 5. Let x be p(-8). Let j be 6/(-4)8/x. Suppose 2o + 10 = 3v - 6, 0 = -jv - 5o - 17. What is the units digit of v? 2 Suppose 5u - 4v = -0u + 734, -5u - 3v = -762. What is the hundreds digit of u? 1 Let b(p) = p2 + 2p + 195. What is the tens digit of b(0)? 9 Suppose 3s + 4f + f + 11 = 0, -3f - 15 = -s. Let b(x) = -3 - sx + 3 - 2 - 1. What is the units digit of b(-2)? 3 Let j = -1 - -5. Suppose 6b - b + 5t - 10 = 0, -2b - jt = -2. Suppose 0p + bp - 42 = -4q, q = p + 7. What is the units digit of q? 9 Suppose -q - 10 = -6q. Suppose qc - 10 = -3c. Suppose -o + 5 = c. What is the units digit of o? 3 Let t(p) = 6p2 + 18p - 6. What is the tens digit of t(-7)? 6 What is the hundreds digit of (29715/(-12))/(-7) + 1/4? 3 Suppose -237 + 42 = -5v. What is the tens digit of v? 3 Suppose 23 = 3q - 1. Suppose -3 = w - q. Suppose f + 3v = -7 - 6, -wv - 25 = 0. What is the units digit of f? 2 Let k = -4 + 10. Let j(u) = u*3 + 4u*2 + 3u - 1. Let a be j(-3). Let n = a + k. What is the units digit of n? 5 Let a = -190 + 305. What is the units digit of a?	{ "pile_set_name": "DM Mathematics" }
Let l(z) = z*2 + 5z + 4. Let r be l(-4). Let f = 15 - r. Calculate the remainder when f is divided by 9. 6 Suppose 0 = -4x + 3h - 9, 7h = 3h + 12. Suppose x = 3l + 5n - 1, -2l - 2n + 4n = -22. What is the remainder when l is divided by 4? 3 Let l(p) be the third derivative of -p4/24 + 5p3/3 + p2. Calculate the remainder when l(6) is divided by 1. 0 Suppose 0 = x - 4x + 9. Calculate the remainder when 8 is divided by x. 2 Let q = 23 - 19. Suppose 0v - 4 = -2v. What is the remainder when ((-4)/(-2))/(v/q) is divided by 3? 1 Let p(t) = -t - 2. Calculate the remainder when p(-5) is divided by 2. 1 Let y = -27 + 39. Suppose -y = -7j + 6j. Calculate the remainder when 34 is divided by j. 10 Let w(s) = -s3 + 8s*2 - 6s - 4. What is the remainder when 14 is divided by w(7)? 2 Let g be -6(24/(-9) - -2). Suppose -gm = -40 - 4. Let z = -1 + 33. Calculate the remainder when z is divided by m. 10 Suppose -288 = -5y + l, 0l - 66 = -y + 3l. Let t(q) = -q3 - 4q*2 - 5q - 5. Calculate the remainder when y is divided by t(-4). 12 Suppose 5j - 150 = -4o, -30 = -2j + j - 5o. Calculate the remainder when 58 is divided by j. 28 Let c be 3(0 + 2/3). Suppose -2s - 3w = cs - 30, 2w = 5s - 49. Calculate the remainder when (-17)/2(-14 - -12) is divided by s. 8 Let c(y) = 17y*3 - 2y*2 + 4y + 1. Calculate the remainder when c(2) is divided by 35. 32 Let t = 27 + -15. Suppose -5c + 63 = -102. Calculate the remainder when c is divided by t. 9 Let o = 25 - 15. Suppose 2h = -0h - 58. What is the remainder when h/(-4 + 1 - -2) is divided by o? 9 Let b(z) = z3 + 8z*2 + 10z + 9. Suppose 0 = -3l - 0l + 156. Suppose -4f + 12 = -0f, -5a + f + l = 0. What is the remainder when b(-6) is divided by a? 10 Suppose -18a + 16a = -154. What is the remainder when a is divided by ((-8)/(-3))/((-2)/(-15))? 17 Suppose -4b = -2a - 119 - 13, 0 = -3a - 12. Let v = b - 22. Suppose -4u + 35 + 33 = 0. What is the remainder when u is divided by v? 8 Let t(k) = 4k - 3. Let s(l) = 12l - 8. Let f = 6 + -3. Let i(u) = fs(u) - 10t(u). Calculate the remainder when i(-7) is divided by 12. 10 Suppose i = -3d - 0d + 729, 4i - 972 = -4d. Calculate the remainder when d is divided by 62. 57 Calculate the remainder when 79 is divided by (2 - (-28)/6)3. 19 Suppose s - l = -13, 5l - l = 5s + 60. Let y = s + 14. Let n(m) = m*2 - m - 2. What is the remainder when n(4) is divided by y? 4 Let n(x) = 17x + 6. What is the remainder when n(2) is divided by 15? 10 Let t = -3 + 23. What is the remainder when 37 is divided by t? 17 Let l(m) = -2m - 9. Calculate the remainder when 48 is divided by l(-13). 14 Suppose j = 3j + 132. Let m = j + 133. What is the remainder when m is divided by 23? 21 Suppose v = -0v - k - 2, -4v = 5k + 12. Let l be 117/v-2. Let n = l + 117. Calculate the remainder when n is divided by 14. 12 Suppose 0 = -5r + 9 + 16. Suppose 2o - 15 = -3c, -ro - c + 12 = -2o. Suppose 10 = oa - 2a. What is the remainder when a is divided by 4? 2 Let u be (-8)/28 + (-23)/(-7). Suppose ut - 13 - 276 = 2r, -4r = 8. What is the remainder when t is divided by 24? 23 Suppose 1 + 1 = r. Let o(w) = 2w*2 - w - 2. Let z be o(r). Suppose -zh + 127 + 9 = 0. What is the remainder when h is divided by 18? 16 Let u(q) = -q*2 - 7q - 3. Let m be u(-6). Suppose -64 = j - mj. Let i(y) = -y + 17. What is the remainder when j is divided by i(0)? 15 Suppose 2f - f + 346 = c, -4c + 1368 = 4f. Suppose 0 = 4i - 4x - 280, 7i + x = 2i + c. Calculate the remainder when i is divided by 24. 21 Suppose 3l + 44 = 116. What is the remainder when l is divided by 17? 7 Let i(k) = -13k*3 + 2k*2 + 2k + 1. Let w be i(-1). What is the remainder when 192/w - 4/(-14) is divided by 5? 4 Suppose -3 = 5z - 128. Calculate the remainder when z is divided by 15. 10 Let r(p) = -p3 + 7p*2 - 5p + 7. Let t = 6 + 18. What is the remainder when t is divided by r(6)? 11 Let f = 4 + -3. Let k be f + 0 + (5 - 7). What is the remainder when (-2 - -38) + k + -3 is divided by 17? 15 Let w be (0 + -5)(-16)/40. Suppose wp = -3k + 56, 5p - 59 = -2k - k. Calculate the remainder when k is divided by 10. 8 Suppose 4n - 2s - 3s = 52, 2n + s = 40. Let c = 1 + -1. What is the remainder when (1 - 2 - -35) + c is divided by n? 16 Let r(s) = s3 - 7s*2 + s + 4. What is the remainder when 53 is divided by r(7)? 9 Let m be 2/(6/3) - -3. Suppose 0 = -5z - d + 123, 3z - md + 21 = 104. What is the remainder when z is divided by 13? 12 Let p = 14 - 3. Let h(q) = -q*3 + 12q*2 - 7q - 9. Suppose 0 = 5b + 5w - 20, 2b - 4w - 56 = -2b. Calculate the remainder when h(p) is divided by b. 8 Suppose -5h + 168 = -h. Suppose 33 = 5p - h. Suppose -l = -48 + p. What is the remainder when l is divided by 17? 16 Suppose -9 = 2y - 3y. Suppose 2i = 6i - 60. What is the remainder when i is divided by y? 6 Let k(n) = n2 + n - 2. What is the remainder when k(-10) is divided by 46? 42 Suppose -12 = 3t, 4c + 3t = -0t - 4. Suppose 5 + 5 = -ci. Let b = 8 + i. Calculate the remainder when 9 is divided by b. 0 Let z be ((-8)/(-10))/(2/5). Suppose -5o = 3m + 32 - 4, -4m = o + 26. Calculate the remainder when (z/m)/(1/(-21)) is divided by 3. 1 Let t = 157 - 55. Calculate the remainder when 25 is divided by t/15 - 4/(-20). 4 Let x = -17 - -53. Suppose -p + x = -50. Suppose a + a = p. What is the remainder when a is divided by 15? 13 Let b = -27 - -43. Suppose -q + b = q. Let c(h) = -h2 - 12h + 3. Calculate the remainder when c(-11) is divided by q. 6 Let t = 43 - 22. Let p = 36 - t. What is the remainder when 58 is divided by p? 13 Suppose -3g + 52 = 2p, 101 = 5p + 2g - 18. Suppose 3i - 37 = -3n + 14, -n + 65 = 5i. What is the remainder when p is divided by i? 11 Let f = 113 + -80. What is the remainder when f is divided by 9? 6 Suppose 0 = 4f - 3f. Suppose -5s + 71 + 64 = -3r, -3r + s = 123. Calculate the remainder when (0 + (-1 - f))r is divided by 14. 12 Let w(s) = 54s*2 + 1. What is the remainder when w(1) is divided by 14? 13 Let k be 16/6 - (-6)/(-9). Suppose 5v - 5t = 300, -kt - 178 = -2v - v. Let r = 36 + -16. What is the remainder when v is divided by r? 18 Suppose -g + 11 = 3g + 3a, -1 = -3g + 5a. What is the remainder when 4/164 + 3 is divided by g? 0 Let x(c) = 7c - 41. What is the remainder when 86 is divided by x(10)? 28 Suppose -17c - 16 = -18c. What is the remainder when 62 is divided by c? 14 Suppose 0 = 2k - 2 - 10. What is the remainder when k is divided by 3? 0 Calculate the remainder when 97 is divided by (-330)/5(-1)/2. 31 Suppose 3t - 2v - 28 = 0, -v - 6 = 2v. Calculate the remainder when t is divided by 3. 2 Let f(d) = 2d2 - 7d - 3. What is the remainder when f(7) is divided by 14? 4 Let i(r) = r*3 - 3r*2 - 10r - 20. Calculate the remainder when i(9) is divided by 27. 25 Suppose 2t - 1 = 3. Let l be 3/(-2) + (-7)/(-2). Calculate the remainder when 57 is divided by 30/t(3 - l). 12 Let t(h) = -11h - 21. What is the remainder when t(-9) is divided by 27? 24 What is the remainder when 61 is divided by 6/3 - 33/(-3)? 9 Let y = -5 + 7. Suppose 0k = yk - 170. What is the remainder when k is divided by 22? 19 Let g(j) = j3 - 5j*2 + j - 2. What is the remainder when ((-7)/14)/(2/(-24)) is divided by g(5)? 0 Suppose 31 = h + 2. What is the remainder when 114 is divided by h? 27 Calculate the remainder when 21 is divided by 18/(-42) - 52/(-7). 0 Suppose o - 3o = p - 181, 0 = -3o - 3p + 264. Calculate the remainder when o is divided by 12. 9 Let y be ((-3)/(-6))/(1/(-2)). Calculate the remainder when 11 is divided by 1 - 2/y1. 2 Suppose 39 = -5g + 4k, -g + 0k - 27 = 4k. Calculate the remainder when 22 is divided by (g + -1)/(5/(-5)). 10 Let f(y) = 3y + 1. Let v(a) = 6a + 1. Let c(b) = -5f(b) + 3v(b). Calculate the remainder when c(6) is divided by 9. 7 Let y(n) = n2 + 3n + 8. Suppose -4h + 2h + 10 = 0. Suppose -2f = -h - 13. What is the remainder when y(-6) is divided by f? 8 Suppose 3t + v - 7 = 0, 5v - 2v = -15. Calculate the remainder when (-6)/30 + (-46)/(-5) is divided by t. 1 Suppose -270 = -5v - 3d, 4v + 0v - 216 = -d. Calculate the remainder when v is divid	{ "pile_set_name": "DM Mathematics" }
7/42 + d4/6 + 9d2. What is the second derivative of v(t) wrt t? -60t*2 Let s = 4 + -2. What is the second derivative of 4j*s - j - j - 2j wrt j? 8 Find the third derivative of -7i4 + 2i*4 - 30i*3 + 8i*2 + 30i*3 wrt i. -120i Let i(n) = -n*2 - 8n - 2. Let t be i(-4). Suppose h + 3h + 5v + 17 = 0, 2h - t = 2v. What is the second derivative of -j + 7j - 3j + 3jh wrt j? 6 Let s(j) be the second derivative of j3 - 5j*2 + 35j. What is the derivative of s(r) wrt r? 6 Suppose 0 = -0u + u - 4. Suppose 3l - 4 = y, -10 = -uy - 0l - l. Differentiate 3 + yt2 - 6 + 4 - 4 with respect to t. 4t Let w(t) be the second derivative of t3/6 - t2/2 - t. Let o be w(3). Find the third derivative of 0l4 + 2l4 + lo + 2l2 wrt l. 48l Let k(g) = g*2 - 7g + 8. Let a be 104/18 + 4/18. Let n be k(a). Find the third derivative of 2z2 - 3 + 3 - nz*4 wrt z. -48z Find the third derivative of -35i6 - i6 - 34i*2 + 21i*2 wrt i. -4320i*3 What is the second derivative of -3850 + 34r*4 + 45r + 3850 wrt r? 408r2 Let j(d) = -7d*5 + 4d*4 - 4d*3 - 15d. Let i(o) = 7o5 - 3o*4 + 3o*3 + 14o. Let k(s) = -4i(s) - 3j(s). Find the second derivative of k(g) wrt g. -140g3 What is the third derivative of 14n*6 + 2n*6 + 0n*2 - 8n*2 wrt n? 1920n*3 Let x = -8 - -10. What is the third derivative of 2y*x - 7y2 + y5 + 9y2 - 6y*5 wrt y? -300y*2 Let w = 5 - 1. What is the second derivative of 2n - 5nw + 6n*4 - 3n*4 wrt n? -24n*2 Let i(y) = y - 4. Let c be (207/(-115))/((-6)/10). Let d(n) = 2n + 2 - 2 - 3. Let r(k) = cd(k) - 2i(k). What is the derivative of r(w) wrt w? 4 Suppose -8 = -4j + 4. What is the third derivative of -j - i5 + 2i*2 + 3i*5 + 3 wrt i? 120i2 Let v(p) = -p2 + 3p + 1. Let t be v(3). Let g be -1(2 - t)-1. Differentiate -2 + 0 - g + 0 - 3f wrt f. -3 Let v = -5 + 8. Suppose 2s + 2 = vs. What is the third derivative of -3y3 - y2 + sy*3 + 2y2 wrt y? -6 Let o(n) = -n3 - n*2 - n. Let t = 9 + -5. Let g(s) = s + 3s*2 - 4s*3 + 5s*3 + ts. Let y(u) = -g(u) - 3o(u). Find the second derivative of y(f) wrt f. 12f Let v(n) be the second derivative of -n7/420 + n6/180 + 5n3/6 + 4n. Let w(s) be the second derivative of v(s). Find the third derivative of w(a) wrt a. -12 Let a(k) = -14k3 - 5k - 11. Let h(d) = -21d3 - 8d - 17. Let o(s) = 8a(s) - 5h(s). Differentiate o(b) wrt b. -21b2 Let o = 1 + 31. Suppose -2y - 2y + o = 0. Find the second derivative of -ya + 2a2 + 0a*2 + 9a wrt a. 4 Let k(r) be the second derivative of 0r6 - 1/8r*8 + 1/6r*4 + 0r*7 + 0r*3 + 0r*5 + 0r*2 - 6r + 0. What is the third derivative of k(h) wrt h? -840h3 Let i(n) be the first derivative of n4/4 + 2n*3/3 - 6n - 2. Let q(y) be the first derivative of i(y). Find the second derivative of q(v) wrt v. 6 Let u = 7 + -4. Let x(a) be the third derivative of 0au + 1/60a*5 + 0a + 0 + a*2 - 1/8a*4. What is the second derivative of x(y) wrt y? 2 What is the third derivative of 86r*4 + 15r*2 - 82r*4 - 2r3 + r3 wrt r? 96r - 6 Find the first derivative of 32p*4 - 10125p + 20 + 10125p wrt p. 128p3 Let d(v) = -v3 - v*2 - v - 1. Let l(n) = -7n3 + n2 - 6n - 6. Let r(y) = -6d(y) + l(y). What is the third derivative of r(s) wrt s? -6 Let h(c) = -c - 3. Let o be h(-4). Let n = o - -1. Find the first derivative of -3l4 + nl*4 + 1 + 1 wrt l. -4l*3 Let j be 2/(-8) + (-18)/(-8). Find the second derivative of -3 + 2 + jm + 1 - 2m3 wrt m. -12m Let l(b) = 2b2 - 1. Let w(p) = 17p*2 - 4p + 1. Let m(q) = 6l(q) - w(q). What is the first derivative of m(j) wrt j? -10j + 4 Let l(p) = -24p - 19. Let f(d) = -8d - 6. Let s(h) = 8f(h) - 3l(h). What is the derivative of s(w) wrt w? 8 Let p(k) = k*2 - k. Let r be p(2). Find the third derivative of -3i*r - 2i*2 - 14i*4 + 18i*4 wrt i. 96i Let w(g) be the second derivative of -g*4/8 - 5g3/6 - g2 + 4g. Let q(l) be the first derivative of w(l). What is the derivative of q(d) wrt d? -3 Let g(y) = -20y*2 + 17y + 3. Let r(b) = 1. Let q(o) = 2g(o) - 6r(o). What is the second derivative of q(k) wrt k? -80 Let w(k) = 2k4 - 6k*3 - 6k*2 - 3k. Let d be (2/3)/(1/9). Let j(x) = x3 + x2. Let z(f) = dj(f) + w(f). What is the second derivative of z(a) wrt a? 24a*2 Let v(o) be the first derivative of 8o*3/3 + 14o - 7. Differentiate v(s) wrt s. 16s Let c(q) = q3 + 2q - 2. Let t be c(2). Suppose -4n + t = -6. What is the derivative of 2m*4 + 4 - n - 2 wrt m? 8m*3 Let z(t) be the second derivative of 0 + 1/3t*3 + 0t*2 - 2t + 0t4 + 1/5t*5. Find the second derivative of z(d) wrt d. 24d Differentiate 5 + 9z2 - 11z*2 + 6z*2 wrt z. 8z Let z(f) be the second derivative of f*4/2 + 2f*2 - 4f. Differentiate z(y) with respect to y. 12y Suppose -5m - 2 = -17. Find the first derivative of q*2 - mq*2 + 6q*2 - 3 wrt q. 8q Let p(n) = n*2 + 6n - 11. Let z be p(-8). What is the derivative of -2g - z + 2g - 4g2 + 2g*2 wrt g? -4g Let c(b) be the second derivative of 5b + 0b*4 + 0 - 2b*2 - 3/20b*5 + 0b*3. What is the first derivative of c(a) wrt a? -9a*2 Let z be (-2 + 2)(-3)/(-6). Let j(u) be the second derivative of 1/12u4 - 1/6u*3 + 3u + zu2 + 0. What is the second derivative of j(x) wrt x? 2 Let z(n) = -n3 + 5n*2 - 5n + 5. Let l be z(4). What is the derivative of 6g + 1 - 2g + l wrt g? 4 Suppose 4o - 2 = -2r, 0 = -2r - 8 - 2. Suppose -h + 13 = 3p + 2, 5h = p + 7. Find the third derivative of -ok*4 + 3k*h - 2 + 0k*2 + 2 wrt k. -72k Let n(p) = p2 - p + 3. Let g(k) = -k + 1. Let w(d) = -d2 - 6d + 1. Let j be w(-5). Let a(s) = jg(s) - 2n(s). What is the second derivative of a(y) wrt y? -4 Suppose 3m = -0m. Differentiate -8a + m + 4a - 3 wrt a. -4 Let f(g) = -g4 + g3 + g2. Let n(i) = i4 - 8i*3 - 8i*2 - 5i. Let x(z) = -24f(z) - 3n(z). What is the second derivative of x(o) wrt o? 252o2 Let d(i) be the second derivative of 5/2i*2 - 5/6i*3 + 0 + 4i. What is the derivative of d(u) wrt u? -5 Let d(u) be the third derivative of -u6/20 - u3/6 - u*2. What is the first derivative of d(s) wrt s? -18s2 Let h(b) be the second derivative of b6/360 + b4/8 + b3/6 + b. Let n(v) be the second derivative of h(v). Differentiate n(j) wrt j. 2j Let a(g) be the first derivative of -g6 + 2g*2 + 3. What is the second derivative of a(t) wrt t? -120t3 Let o(m) = m2 - m. Let u(v) = -2v2 + 2v. Let f(b) = 9o(b) + 4u(b). Find the second derivative of f(j) wrt j. 2 Let s(a) = -22a4 - 5a*3 + 5a*2 + 5a - 3. Let z(m) = -11m4 - 3m*3 + 3m*2 + 3m - 1. Let x(r) = -3s(r) + 5z(r). Differentiate x(j) wrt j. 44j3 What is the second derivative of 0c + 5c3 - 4c + 4c4 - 5c*3 wrt c? 48c*2 What is the third derivative of -4g2 - g4 + 6g4 - 17g*4 wrt g? -288g Differentiate 21 + 12 - 30l2 + 28 wrt l. -60l Let r be (3/6)/((-1)/4). Let c be r/((-4)/18) - 2. Find the first derivative of 11v3 + 2 - 13v*3 - c wrt v. -6v2 Let v(g) = g2 - 2g - 4. Let l be v(3). Let m be ((24)/l)/(-2). What is the second derivative of -2i + 0i - 3im + i4 wrt i? -24i*2 Let m(l) be the second derivative of 5/42l*7 + 1/3l*3 + 0l*5 + 0l*2 + 0 - 5l + 0l6 + 0l*4. What is the second derivative of m(v) wrt v? 100v*3 Let s be (-2)/9 - 220/(-18). Suppose 0 = 3o + o - s. What is the third derivative of -3j + j2 + 2j*3 + oj wrt j? 12 What is the derivative of -8v4 + v4 + 5v*4 - 2 - 3 wrt v? -8v*3 Let i(s) = 5s + 55. Let k be i(-11). Let l(f) be the first derivative of 0f3 + kf4 + f2 + 0f + 2/5f*5 - 2. Find the second derivative of l(x) wrt x. 24x*2 Let v be 1/(2/4) - -1. What is the second derivative of -va5 + a5 - 2a - a wrt a? -40a*3 Find the second derivative of 56t - 12t4 - 22t - 24t wrt t. -144t2 Let y(o) be the second derivative of o5/30 + o3/2 + o2 - 4o. Let t(x) be the first derivative of y(x). Differentiate t(g) with respect to g. 4g Find the third derivative of 14h2 - 33h**3 - 242 + 242 wrt h. -198 Let n be 3/12 -	{ "pile_set_name": "DM Mathematics" }
6/8. Solve u = 3c + 2m, 2m = -3c - 2m + 12 for c. 0 Suppose 1 = -g, 4l + 0 = -g - 9. Let n be (l/6)/((-5)/30). Solve 0 = -5u + 6d - 3d + n, 2u = -2d + 4 for u. 1 Let u(b) = 2b - 7b - b + 4b - 2 + b2. Let l be u(3). Solve l = j, 13 = -0r - 3r + 4j for r. -3 Let m be 9/(-9) + (-14)/(-1). Let v = 13 - m. Solve 2w + 5h + 13 - 1 = v, -2h + 4 = 3w for w. 4 Let s(l) = l*2 + 3l - 1. Let k be s(2). Let p(d) = 2d + 5. Let u be p(k). Solve 5h + u = -y, -5h - 2y = -4y + 14 for h. -4 Suppose -7 = -j - 2. Solve 2m = -3c + 17, -8 = -2m - jc + 15 for m. 4 Let y(q) = -q3 + 19q*2 - 17q - 15. Let p be y(18). Solve 4u + 2g = -6, u - 3u = -5g - p for u. -1 Suppose -q = 4q - 20. Solve -4c = 4f - q, 2c + 35 = 5f - 3c for f. 4 Let y = -6 + 6. Let l = y - -4. Suppose lk - 27 = 5t, -t - 15 = -2k + 2t. Solve -o + 1 = 5i + 11, -4i - ko = -3 for i. -3 Suppose 5s - 99 = 16. Suppose -5m - 3 = -s. Solve 0 = w - 4z - m, 22 = -5w + w - 3z for w. -4 Let f(i) = -i + 1. Let l be f(1). Solve -2g = -u - 3g + 3, 5u + 3g - 7 = l for u. -1 Let c(w) = -w*2 - 4w - 2. Let t be c(-1). Let p be (t/(-2))/(17/(-136)). Solve 2s + 18 = -ph, -4h - 23 = 2s + s for s. -5 Let b(y) = -20y. Let n be b(-1). Suppose -3d - j = -4d + 14, -n = -2d - 2j. Let v be (2/2 - 1) + d. Solve -5z + 4f + 15 = f, -2f = -4z + v for z. 3 Suppose -7 = -4x + 2m + 3, 5x + 3m = -15. Let o = x + 5. Solve 3f - 4d - 12 = -7d, -5d - 10 = -of for f. 3 Suppose -3c - 9 = -5g, 4g - 4 - 4 = 2c. Solve -l + 12 = 5j, -3l + 0l = -gj for l. 2 Let j be (6 - 1)5/5. Let m = j + -5. Solve m = 5b + 3o + 14, -o + 18 = -2b + 4o for b. -4 Suppose 5g + 4a + 0a = -27, 0 = 3g + a + 19. Let p = g - -7. Solve u = -pn - n + 3, 0 = 3n + u - 9 for n. 3 Let y(a) = a2 + 8a + 10. Let j be ((-2)/(-1))/(10/(-35)). Let i be y(j). Solve 0 = -3h - 2g, g + i = 2g for h. -2 Let w = -10 + 14. Suppose 0s + 16 = 4s. Suppose 0k = -sk. Solve -q = -5b + b - 16, k = wq + 5b + 20 for q. 0 Let x = -17 - -24. Solve -5o - 3 = -2i, -2i = -o - 0o - x for i. 4 Let g(p) = p*2 + 6p + 5. Let w be g(-6). Suppose 0 = wf + 2d - 4, 2f - 13 = 3d - 0d. Solve -2u = u - ft - 11, 0 = -u - 2t + 1 for u. 3 Let d be ((-4)/8)/((-3)/12). Solve -2t + 20 = 5m, 16 = 2t + 2t - dm for t. 5 Let g = 26 + -18. Let l = g + -3. Let i(n) = -n2 - 4n - 2. Let p be i(-2). Solve -2y + s + 0s = -p, -ls - 24 = 4y for y. -1 Suppose -2d = 3d - 20. Let n be -2(-3 + 2) + d. Let f be 4 + 5/((-15)/n). Solve fs + 15 = -4g - 1, 0 = 2g + 10 for s. 2 Let l(x) = x*2 - 3x + 2. Let q be l(5). Let t be q/(0 - -2) - 2. Solve ta - 2p = -0a - 2, 4p = 4a + 8 for a. 1 Let y(d) = -3d - 9. Let i be y(-4). Let s = -2 + 3. Solve 5t + iq = -8, 4t + 0 + s = 3q for t. -1 Let j be (-1)/(2/(-22)) - (-14 + 15). Solve 5f - 5t = 10, 5t - j = 2f - f for f. 5 Suppose 3j + 22 = 61. Solve 3c + 2w - w - j = 0, -2w - 14 = -2c for c. 5 Let a(d) = -d2 - 7d - 3. Let o be a(-6). Suppose -67 = -4x - 4c + c, -2x + 36 = 2c. Suppose x = 2f - f. Solve -ob + f = 4y, 10 + 2 = -3y + 5b for y. 1 Let j(y) = y + 14. Let t be j(-9). Solve -4z + 5 = tk, -2k - 3z + 5 = 2k for k. 5 Suppose 28 = 3y + y. Let w be 9/68/6. Suppose 5m + 10 = 0, -25 = -wj - 5m - 1. Solve -2o = 4b - 18, -2b + yb = 3o + j for b. 4 Suppose -4z = -6z + 6. Solve h + 15 = -4v, v + 2h - z = 4v for v. -3 Suppose -8 = d - 10. Solve -dq + 5t + 4 = 0, 1 = q - 5t - 6 for q. -3 Suppose 7y - 3y - 84 = 0. Suppose 4q = t - 0q - 22, 2t = 4q + 24. Suppose -r - 15 = -4b + tr, 5r = 15. Solve -n - y = 3p - 2, 2p + b = n for p. -5 Let p(w) = -w + 8. Let q be p(-18). Let b be ((-2)/2 - -1)/2. Solve 5l + 29 = -2s - bl, -3s = 4l + q for s. -2 Suppose 4s - 4 - 3 = -r, s - 1 = -r. Solve -3n + f = sn + 13, -5f + 7 = 4n for n. -2 Suppose 4r - 14 = -2h, 0h = -2r + h + 13. Let w(l) = l3 - 6l*2 - 4l + 6. Let c be w(7). Solve -5b = 3o - 6o + 31, rb = o - c for b. -5 Suppose -4l + 4 = -16. Let y(h) = -h3 - h + 24. Let k be y(0). Solve 2u + k = -lf, 0f - 5f = -5u + 10 for f. -4 Let g(d) = -d - 10. Let r be g(-12). Solve 0 = c - 5j - r, 0 = -c + 5c - 2j - 8 for c. 2 Suppose -6g + g = 5. Let c = 14 - g. Let p = c + -11. Solve -m = 5l - 0l - 29, pl + 4m = 36 for l. 5 Let i(s) = -s + 11. Let q be i(7). Suppose 5o - 5k = 20, -qo + 6 + 0 = k. Solve -2u + 1 - 2 = 5x, 0 = ou - 5x - 9 for u. 2 Let w = 20 + -14. Let m be 3 + w/3 + -3. Suppose -ms + 10 = 3s. Solve -t - sr = -3, -2r = -3r for t. 3 Let f = 3 - -7. Let x = -11 - -5. Let c = f + x. Solve -l = -5u - 18, cl + 24 = -0u - 4u for l. -2 Let s be (-2)/((-8)/6 - 6/9). Solve 0 = -5n - 3w + 3, 4n - s = 4w - 5 for n. 0 Let b be (3/(-2))/(12/(-120)). Suppose 3y + 4p = 15, -y - 2y - 2p = -b. Solve -2r - r = 5d - 11, -23 = -yd + r for d. 4 Let n be (-54)/(-10) + ((-39)/(-15) - 2). Solve -a - 2s + 6 = a, 2a = 4s + n for a. 3 Let i(m) = -2m3 + 14m*2 + m - 5. Let y be i(7). Solve r - 4w + w - 17 = 0, 2w + 14 = yr for r. 2 Suppose 15m = 10m. Solve -5q + 2p + 22 = 0, -17 = -mq - 5q - 3p for q. 4 Let p = -1 - -10. Suppose 1 + p = 2o. Solve 6m - m = -4j - 16, -3m - oj = 7 for m. -4 Let t(j) = j + 1. Let m be t(2). Solve 2s - 8 = -3u, 2s - 3u - 5 = m for s. 4 Let s be (-3)/12 + 39/12. Suppose 2f = -2f. Suppose fg - 4 = -g. Solve -4h - 2w - g = 0, 1 = -5h - sw - 4 for h. -1 Let h(k) = k3 - 12k*2 + 9k + 26. Let t be h(11). Solve -u - t + 3 = 0, 5w - 3u = 13 for w. 2 Suppose 5j + 13 = 3l - 5l, -2l = 4j + 8. Let y = l + -6. Solve -15 = q - 6q + s, y = -2q + 5s + 29 for q. 2 Suppose 5u - 3v + 2v - 30 = 0, 4u - 30 = 2v. Solve 0 = -3h + 6h - uf - 22, -5f + 6 = 4h for h. 4 Let u be ((-110)/25 - -4)/(3/(-270)). Solve 3 = -2t - 5, 0 = 5s - 4t - u for s. 4 Let q be (-132)/(-20) - (-2)/5. Let n = 12 - q. Solve -a + 1 = h - na, h + a = 6 for h. 5 Let l be (0/(-4 + 8))/3. Solve -4p = l, 8 = -2a + 3p - 4p for a. -4 Suppose 0 = -h - 2h - 15. Let w be -9(-2)/63. Let f = h + w. Solve u = -5b + 24 + f, 4u - 32 = -4b for u. 3 Let a(p) = p*3 + 2p*2 + p. Let r be a(-1). Solve 0j - 2j - t + 3 = 0, r = -4j - t + 7 for j. 2 Let q be (-8)/12 + (-38)/(-3). Let b = -7 + q. Solve -5w - bx = -45, 3x - 17 = -3w + 2x for w. 4 Suppose -c + 0c = -5. Let x be (1/(-2))/((-1)/4). Suppose -2p - p + 3z + 27 = 0, 8 = -xz. Solve a = 4n - 9, -ca + 8 = -3a + pn for a. -1 Suppose -3h = -2h - 15. Solve f - 6 = p, -5f + 4p + 13 = -h for f. 4 Suppose h - 2d = 5h + 2, -h + 7 = -d. Solve 3l - hm = 4, -3l = -2m + 4m - 20 for l. 4 Let z(q) = -2q - 38. Let a be z(-19). Solve -5o = -ah + 2h, 25 = 5o - 3h for o. 2 Suppose 0 = t - 4t. Suppose -2w + s + 1 = t, 0 = -2w - w + 2s. Solve -5m + 12 = -3h - 1, wm - 7 = 3h for h. -1 Let t(m) = 2 + 3 - 2 - m. Let s be t(0). Solve a + a = -f - 3, -4a + s = 5f for a. -3 Suppose -a + 6 = a. Solve 11 = av - c, -3v = -4v - 5c - 7 for v. 3 Let m = 24 - 36. Let b be 42/(-11) - m/(-66). Let r(u) = -2u - 4. Let f be r(b). Solve fs = 4a, 0 = 2a - s - 0 + 4 for a. -4 Suppose c + 0c = 16. Let q be (-116)/c - (-2)/8. Let h(k) = -2k + 9. Let m be h(q). Solve d - g - 15 = -6g, 3d + m = 2g for d. -5 Suppose 4j + 5l + 12 = 0, 4j - 5l - 14 = 14. Let v be -7((-40)/(-28) - j). Solve 2p + 1 - 3 = 2b, -4b - 2p = v for b. -1 Let a = -27 - -20. Let v be (63/6)/a-2. Solve -6b + 4x = -3b, -21 = 3b + vx for b. -4 Let s(d) = 9d2. Let w be s(-1). Let f = w + -6. Solve -6 = -fb + v, 4b - 6v + v = -3 for b. 3 Let h(g) = -2g - 17. Let a(s) = s + 9. Let n(u) = 5a(u) + 2h(u). Let y be n(-6). Solve -5x = -25, yx = -p - p + 29 for p. 2 Let q(k) = 6k*2 + 3k + 1. Let i be q(-2). Let y = -4 + 4. Suppose y = -4b - 9 + 25. Solve 3x + bw = -i + 6, 2x - 5w - 22 = 0 for x. 1 Let t be 32/(-12)0. Solve t = -4u - n - 2n + 4, -u + 1 = -5n for u. 1 Suppose 2j + 4t - 16 = 0, -9j - 2 = -4j - 4t. Solve 0 = -0s - 5s - l + 9, jl = -s + 9 for s. 1 Let n = 66 - 66. Solve 3m - h + 13 = n, m = -m + 5h for m. -5 Let i be (-18)/(-5) - (-8)/20. Suppose 15 = v - 3d, -v - 3d - 2*d - 17 = 0. Let o be	{ "pile_set_name": "DM Mathematics" }
2p - 1. Determine -3t(k) + 8v(k). -2k*3 - 4k*2 - 32k + 1 Let t(h) = -4h2 - 27h - 7. Let w(f) = -2f2 - 14f - 3. Suppose -10o - 21o + 24 = -43o. Determine ot(n) + 5w(n). -2n*2 - 16n - 1 Let z(h) = -7h - 8. Let n = 14 - 13. Let v(b) = -2. Let q(k) = k + 13. Let x(a) = q(a) + 6v(a). What is nz(c) + 5x(c)? -2c - 3 Let f(h) = 27h*2 + 20h + 8. Let n(v) = -v*2 - 6v - 1. What is f(i) + 6n(i)? 21i*2 - 16i + 2 Let f(v) = 23831v - 13. Let n(u) = 115182u - 63. Calculate 63f(b) - 13n(b). 3987b Let c(p) = 31p*2 - 289p - 2. Let q(a) = 14a2 - 144a - 1. Calculate -4c(l) + 9q(l). 2l2 - 140l - 1 Suppose 4w + 3t - 35 = 0, 3t + 2t = -2w + 21. Let q(m) = -11m*2 + 3m - 8. Let u(d) = 0 - 5 - 1 - 3 + 5 - 7d2 + 2d - 1. Give wu(x) - 5q(x). -x*2 + x Let k(c) = -5c*3. Let d be 18/24(-5 + 1). Let a(z) = 6z3. Determine dk(n) - 2a(n). 3n*3 Let p(x) = 23x - 1. Let v(d) = 91d + 2129. Calculate 4p(u) - v(u). u - 2133 Let l(g) = g - 191. Let y(j) = 3j - 291. Determine -7l(u) + 4y(u). 5u + 173 Suppose -12z + 25z = 0. Suppose z = -52j + 174 - 18. Let t(v) = 2v*2 + 3v + 3. Let r(g) = -g + 0g + 0 - 1. Determine jr(q) + t(q). 2q2 Let p(r) = -r3 + r2 + 2r - 4. Let n(a) = -20646a3 - 12a*2 - 24a + 48. Determine n(o) + 12p(o). -20658o*3 Let j(b) = -6b - 7b + 16b*2 + 6b*3 + 5 - 13b*2 - 11b*2 + 15b. Let q(y) = -4y3 + 5y*2 - y - 3. Calculate -5j(p) - 8q(p). 2p*3 - 2p - 1 Let n(r) = 38r3 + 9r*2 + 10r + 8. Let o(u) = u*3 + 3u*2 + 3u + 2. Determine n(b) - 4o(b). 34b*3 - 3b*2 - 2b Let y(h) be the third derivative of -h4/8 + h3/2 + h*2 + 10. Let u(v) = 6v - 6. Let g be (-1 - (0 - -2))/(171/(-627)). What is gy(t) + 6u(t)? 3t - 3 Let i(k) be the first derivative of 2k*3/3 - 2k*2 + 2k - 244. Let g(d) = d. Calculate 3g(a) + i(a). 2a2 - a + 2 Let d(a) = a + 3. Let u = -8907 - -8902. Let t(r) be the first derivative of -r2/2 - 4r - 3. Determine ud(y) - 6t(y). y + 9 Let y(h) = 2h*3 - 7h*2 + 5h - 1. Let o be y(2). Let l(m) = 5m. Let b(k) = 361 - 361 + 24k. Determine ob(t) + 16l(t). 8t Let l(g) = -7g*3 - 6g*2 - 3086. Let w(h) = -15h*3 - 13h*2 - 6172. Determine -13l(y) + 6w(y). y3 + 3086 Let a(h) = 2h*3 - 10h*2 + 4h + 7. Let y(q) = 2q3 - 11q*2 + 5q + 8. Suppose 3i = 5p - 23, -9i - 4 = -5p + 55. Calculate ia(d) + 5y(d). -2d3 + 5d2 + d - 2 Let j(c) = -c2 + c - 1. Let r(d) = 2d2 + 4 + d + 2d + d - 8d. Let f be 80 - (0/1 - 3). Let s = f - 87. Determine sj(z) - r(z). 2z2 Let t(k) = -2186k*3 + 8k*2 + 7k - 24. Let w(x) = -2189x3 + 9x*2 + 8x - 28. Determine -7t(j) + 6w(j). 2168j3 - 2j*2 - j Let j = -11120 + 11117. Let k(u) = 79u*2 - 7u - 9. Let c(x) = 39x2 - 3x - 4. Calculate jk(b) + 7c(b). 36b2 - 1 Let a(y) = -9y - 186. Let m(p) = -20p - 365. Calculate -9a(j) + 4m(j). j + 214 Let y(m) = m2 - 175m + 1339. Let p be y(8). Let c(l) = -l*2 + 4l - 1. Let t(h) = -3h. What is pt(q) + 2c(q)? -2q*2 - q - 2 Let q(b) = 34b*2 + 29b + 6. Let i(r) = 66r2 + 59r + 10. Give 4i(l) - 7q(l). 26l2 + 33l - 2 Let y(q) = -66q2 - 24q. Let g(d) = -70d2 - 21d. Give -6g(k) + 5y(k). 90k2 + 6k Let a(s) = -17s - 2. Let g(x) = -4x*3 - 518x*2 + 262x + 257. Let r be g(-130). Let y(p) = 1. Calculate ry(o) - a(o). 17o - 1 Let o(i) = 197i + 1185. Let d be o(-6). Let t(k) = 34k - 14. Let p(z) = -7z + 3. Let x = -16 + 30. What is dt(f) + xp(f)? 4f Let d(t) = -63t - 295. Let s(a) = 53a + 296. Determine -5d(r) - 6s(r). -3r - 301 Let j = -1589 + 1606. Let p(q) = -57q*3 + 6q*2 + 3. Let b(x) = 19x*3 - 2x*2 - 1. Calculate jb(g) + 6p(g). -19g*3 + 2g*2 + 1 Let x(o) = -o + 2. Let c(t) = 21t - 10. Let s(m) = -47m + 20. Let u(i) = 7c(i) + 3s(i). Let d(z) = z3 + 7z*2 + 2. Let j be d(-7). Give ju(f) + 11x(f). f + 2 Let j(x) = -x + 161. Let c(d) = d - 177. Let s(f) = -10c(f) - 11j(f). Let m(h) = 76h - 57. What is -m(q) + 57s(q)? -19q Let j be (3 - 2 - -1) + 90/(-10). Let y(v) = 12v - 7. Let q(z) = 23z - 15. Let m(g) = jy(g) + 3q(g). Let l(k) = 8k - 2. Calculate 5l(s) + 3m(s). -5s + 2 Let v(l) = -30l2 - 14l - 21. Let d(n) = 28n2 + 12n + 16. Give -6d(b) - 5v(b). -18b2 - 2b + 9 Let j(w) = -24w3 + 3w*2 + 28w - 8. Let t(a) = -2a3 - a2 - a + 2. Give -j(m) - 3t(m). 30m3 - 25m + 2 Let h(x) = -3x2 - x3 + 69 + 39507x - 81 - 39504x. Let k(o) = -o2 - 1. Calculate h(g) - 3k(g). -g*3 + 3g - 9 Suppose 0 = -v + 4x + 8, -2v + 139 - 130 = -x. Let n(h) = 3 + 2 - h - 2 + 0. Let g(s) = 6. Let y(i) = 2. Let m(d) = 2g(d) - 7y(d). Give vm(q) + 3n(q). -3q + 1 Let b(l) = 2l*2 + 8l + 23. Let f(k) = 2k2 + 9k + 30. What is 5b(q) - 4f(q)? 2q2 + 4q - 5 Let s(y) = -7y3 - 2y*2 - 1488y - 2. Let k(t) = -11t3 - 3t*2 - 1487t - 3. Calculate -2k(z) + 3s(z). z*3 - 1490z Let v(d) = 4d - 6. Suppose -7c + 90 = -12c. Let k(g) = -6g - 113. Let r be k(c). Let b(q) = -4 + 2 - 3 + 4q. What is rv(f) + 6b(f)? 4f Let g(d) = -41d2 - 35d - 4. Let v(b) = -2b2 - b - 1. Determine -g(z) + 6v(z). 29z2 + 29z - 2 Let t = -68817 + 68839. Let d be (-6)/(-2)(-8)/6. Let f = d + 2. Let b(k) = k + 1. Let m(p) = -p2 + 10p + 10. Determine fm(y) + tb(y). 2y2 + 2y + 2 Let c(t) = t*2 - 31t - 94. Let h(i) = 9i + 31. Give 2c(o) + 7h(o). 2o*2 + o + 29 Let j(x) = -21x2. Let p(t) be the second derivative of -t4/12 + 47t - 12. Calculate j(u) + 3p(u). -24u2 Let z(a) = 3a*2 - 285a + 16. Let f(i) = -7i2 + 570i - 34. What is -8f(q) - 17z(q)? 5q2 + 285q Let r(x) = 4x2 + 3x + 13. Let s = 1848 + -1845. Let i(v) be the first derivative of 1/2v2 + 1/3v*s + 10 + 4v. What is 7i(b) - 2r(b)? -b2 + b + 2 Let p(n) = n3 + 962n2 + 8n - 2. Let x(h) = -2h3 - 1923h*2 - 20h + 5. Calculate 5p(z) + 2x(z). z*3 + 964z*2 Let k(z) = -127z - 34. Let o(n) = 380n + 96. What is 14k(f) + 5o(f)? 122f + 4 Let h(n) = 33129n2 - 409n. Let p(c) = -404c2 + 5c. Give -5h(q) - 409p(q). -409q2 Let w be 2/4(-8 - 0). Let x(g) = -g*2 - 41g - 145. Let q be x(-37). Let v(u) = 12 - q - u - 6u2 - 13. Let m(h) = 7h*2 + h + 5. What is wm(a) - 5v(a)? 2a*2 + a Let y(x) = -2x - 4. Let o(c) = -2c2 - 49c - 42. Let h be o(-24). Let p be 8/36 + -2(-38)/h. Let m(d) = 5d + 11. Calculate pm(a) - 11y(a). 2a Let s(c) = 7c*2 + 5c + 4. Suppose 0 = -2b - b + 12. Let k(o) be the first derivative of -20o*3/3 - 7o*2 - 11o - 370. What is bk(r) + 11s(r)? -3r2 - r Let d(p) be the second derivative of 3p*2/2 + 3p. Suppose -247y + 190y + 399 = 0. Let c(z) = -z - 10. Give yd(a) + 2c(a). -2a + 1 Let c(l) be the first derivative of -l3/3 + l2/2 + 12l + 1906. Let p(j) = j*2 - 2j - 12. Give -4c(f) - 3p(f). f*2 + 2f - 12 Let b(n) = -13n3 - 27n*2 - 5n + 2. Let f(l) = 26l3 + 68l*2 + 11l - 4. Give 5b(o) + 2f(o). -13o3 + o2 - 3o + 2 Let v be ((-12)/4 - -5)/(14/(-21)). Let x(w) = w*3 - 3w*2 - w - 1. Let z(c) = -58c2 + c3 + 2 + 53c2 - 3c - 4 + 2c. What is vz(k) + 5x(k)? 2k*3 - 2k + 1 Let v(n) = -2n2 + n - 1. Let j(o) = 1536o*3 + 240o*2 - 120o + 120. Give j(z) + 120v(z). 1536z*3 Let t(q) = 14q*3 - 3q + 9. Let f(y) = 37y2 + 116y - 7 - 37y2 + 11 + 7y*3 - 117y. Calculate -5f(k) + 2t(k). -7k3 - k - 2 Let g(j) be the second derivative of 5j*3/6 + 5j*2 - 113j. Suppose 0 = -3z - 4b, b = -4z - 0z + 13. Let k(f) = zf + 13 - 6 + 2. Give -5g(d) + 6k(d). -d + 4 Let c(g) = 105g - 283. Let p(z) = -2z + 36. Determine -c(l) - 8p(l). -89l - 5 Let b(u) = 14u - 59. Let v(y) = 3y + 1. Give b(l) - v(l). 11l - 60 Let t(u) = 29u3 - 46u*2 + 43u - 7. Let c(n) = -3n3 + 4n*2 - n. Give 11c(q) + t(q). -4q3 - 2q*2 + 32q - 7 Let o(d) = -15d2 + 2d. Let s(y) = -22y2 - y + 11y*2 + 10y*2 + y. What is -o(l) + 2s(l)? 13l2 - 2l Let w = 407 - 246. Suppose -149 = -2r - w. Let k(v) = -11v*3 - 6v*2 - v - 6. Let m(b) = 10b*3 + 5b*2 + b + 5. Calculate rm(n) - 5k(n). -5n*3 - n Suppose -537s - 56s - 414 = 179. Let v(z) = 3z - z - 6 + 4. Let b(w) =	{ "pile_set_name": "DM Mathematics" }
= 4 - 0. Let p be (-138)/(-15)2/(-4). Let m = 97/20 + p. What is the closest to m in 0, y, 0.2? 0.2 Let s = -3 - -1. Let h be s/(-8) - (-11)/20. Let o(q) = -q - 4. Let x be o(-3). What is the nearest to -1 in h, -1/2, x? x Suppose -5w + 83 + 77 = 0. Suppose 4z - w = -3q, 4z = 2q - 7 + 19. Suppose m - z = 2m. Which is the nearest to 1? (a) 5 (b) m (c) -2/3 c Let b = 0.3 + 0.2. Let x be ((-44)/99)/((-8)/6). What is the closest to x in 5, -0.1, b? b Let n be (-3)/(-6) - 5/20. What is the nearest to -1 in -1, n, 0.1? -1 Let d = -0.228 + 0.028. Which is the nearest to 1? (a) 4/5 (b) d (c) -3/8 a Let x = 12 + -12.12. Let l = -0.02 - x. Let s = 0.2 + 0. Which is the closest to -0.1? (a) -4 (b) s (c) l c Suppose q + 13 = 15. Which is the closest to 1? (a) q (b) -4 (c) 4/7 c Let p be (103/(-24))/(36/(-48)). Which is the closest to -0.1? (a) -0.01 (b) 5 (c) p a Suppose 3h - 2p = -1, -3p = -8p - 5. Let s = -6.97 + 7. Let u = 1.97 + s. What is the closest to 0 in u, h, 0.3? 0.3 Suppose -2b - 3b + g - 4 = 0, -g = 1. Let m = 7 + -7.03. What is the nearest to 1/4 in -5, b, m? m Let z = 98/15 - 22/3. Which is the closest to 0? (a) -2 (b) z (c) 2/15 c Let v = 19 + -17. Let s = -3.1 - -3. Let r = -1.1 - s. What is the closest to r in 4, -3, v? -3 Let g be (6 - 3)(-4)/6. Let v = -1.5 - -1.7. What is the nearest to -0.1 in -0.3, v, g? -0.3 Let i = -71/2 - -139/4. Let v = 0.12 - -0.38. What is the nearest to 2/3 in v, i, -5? v Suppose -2h = 3h - 15. Let l be (-1)/4(1 + h). What is the closest to l in 1, -0.1, 0.1? -0.1 Let d be 9/(-2)(-12)/9. Let m be (d/(-4))/(14/(-7)). What is the nearest to 0 in -0.3, 5, m? -0.3 Let m be (-2)/921/(-14)2. Which is the nearest to m? (a) -0.5 (b) -5 (c) 7 a Let o = 1/63 - -13/63. Which is the nearest to o? (a) 3 (b) 1/2 (c) -5 b Let v = -4.3 + 0.3. Let h = 11 + -25. Let z be 20/h - 1-2. What is the closest to -0.1 in 1, v, z? z Let x be ((-6)/(-15))/(8/5). Let g be (-25)/14 - (-22)/77. Which is the closest to x? (a) -0.3 (b) 2/3 (c) g b Let x(r) = r - 18. Let j be x(17). Let y = 1 - 1.1. Suppose -3i - 1 = 2d, 0i = -2d + 5i + 23. Which is the nearest to y? (a) 2 (b) j (c) d b Let v be 10/(-12)(-4)/(-15). Let y = -16/35 + 3/5. Which is the closest to -2/3? (a) y (b) v (c) 4 b Let v = -1.1 + 2.1. Let r = 1 + v. What is the closest to r in -2/7, -2, -0.4? -2/7 Suppose -3z + 1 + 2 = 0. Let t = 0.33 + -0.13. Which is the nearest to 0? (a) z (b) t (c) -0.3 b Let u = 2/89 - -83/267. Let g = -0.8 - -0.3. Let n = 1.5 - g. Which is the nearest to 0? (a) u (b) n (c) -1/5 c Let h be 17/8 - (3 + -1). Let i = -7.8 + 2.8. Which is the nearest to -0.1? (a) i (b) h (c) 0 c Let j = 11 - 11. Let x = 5.9 + -6. Which is the closest to j? (a) x (b) -4 (c) 5 a Let n(v) = v2 + 4v. Let l be n(-4). Let w be -2 + 2/128. What is the closest to w in l, 5, 4? l Let v(q) = q3 + 5q*2 + q - 4. Let u be v(-5). Which is the closest to 1? (a) u (b) 0.4 (c) -1/2 b Let v = -0.2 + 0.3. Let a = -0.45 - -0.45. What is the closest to a in -0.4, v, 1/2? v Let s = 52 - 105. Let q = -263/5 - s. Let x = 8 - 13. What is the nearest to -1 in q, -0.3, x? -0.3 Let q = 26/3 + -9. What is the nearest to -1 in q, 5, 3? q Let y = 41 - 43. Let i = -0.3 + 0.5. What is the nearest to -2 in i, 2/5, y? y Let o = -4 + 5. Let d be (4/(-8))/(o/2). Let u = 1.5 - 2.5. What is the nearest to d in 5, 1, u? u Suppose -16 = d - 5d, i - 5d = -16. Let v = -24 - -23. Let t = 27 - 55/2. Which is the closest to t? (a) 2/5 (b) v (c) i b Let q be (1/9)/(1/(-2)). What is the nearest to 0.1 in q, 0.1, 0.4? 0.1 Let t = -8 - -12. Let y = -8.8 - -9. Which is the nearest to 0.1? (a) y (b) t (c) 3 a Let v = 0.9 - 0.4. Let h = -1.9 - -2. Let q = 8 + -9. What is the closest to q in h, -1/9, v? -1/9 Let i = 5 + -7. Let k = 1 - 3. Let q be k/5(-1)/2. What is the closest to 0 in i, q, 3? q Let l be 2/(-6) - (-91)/147. Let t = -38.8 + 39. What is the nearest to l in -1/2, 2/15, t? t Let x = -1 - -0.7. Let p be (-2)/(-8)(-20)/(-5). Which is the closest to p? (a) x (b) -6/5 (c) 0.5 c Let k be (6294/(-20))/((-3)/(-1)). Let l be (-1048)/10 + 14/(-70). Let s = k - l. What is the nearest to -1 in 1/2, 4/5, s? s Let t(j) = j2 + 11j + 2. Let v be t(-12). Let s = v + -11. Let w(q) = -q - 4. Let k be w(-3). Which is the nearest to 2/5? (a) s (b) -4 (c) k c Let u = 1 + 0. Let m = 1 - u. Let o = -0.1 + m. Which is the nearest to o? (a) 2 (b) -0.1 (c) -1/6 b Let g be (-2)/6 + (-5)/(-6). Let x = -2.84 + 2.5. Let l = -4.66 + x. Which is the closest to -0.1? (a) 3/7 (b) g (c) l a Let l = -0.3 - -0.4. Let i = -3.1 + l. Let h = i + 2.9. What is the closest to 1 in 2/11, 4, h? 2/11 Suppose -2n - 6 = -8. What is the nearest to n in 2/3, -2, 0? 2/3 Let t = 6 + -6.08. Let w = 0.02 - t. Which is the closest to w? (a) 2 (b) 3 (c) 1/6 c Let w = -0.67 + 0.47. Which is the closest to 1/4? (a) -2/11 (b) 2 (c) w a Let z = -5 + 1. Let j = -3 - -3.5. Let g = -0.3 + 2.3. What is the closest to g in -3/4, j, z? j Let j = -5 - -9. Let p = -0.9 + 0.8. Let i = p + 1.1. What is the nearest to i in -3, 2/5, j? 2/5 Let x = 1 - 9. Let c be (-1 - -2) + (-2)/x. Let p = 8.3 + -8. What is the closest to -0.1 in p, 5, c? p Let l = 6.9 + -9.9. Let v = -0.3 + 0.2. Which is the closest to -2/7? (a) -1/3 (b) v (c) l a Let j = -0.3 - 0.1. Which is the nearest to 1? (a) j (b) 1 (c) -4/5 b Let d(n) = n - 4. Let p be d(6). Let i = -3 + 2. Which is the closest to i? (a) 1/7 (b) 5 (c) p a Let n = -0.07 + 0.03. Let d = n - -0.14. Suppose 4 = -2y - 0. What is the nearest to 0 in y, d, -0.2? d Let t = 0.57 - 0.6. Let g = 0.43 + t. Let i = g + 0. What is the nearest to -0.1 in i, -1, 1/11? 1/11 Let p be (20/15)/(14/(-3)). What is the closest to p in -1, 11, 0.4? 0.4 Let g = 29 + -147/5. Let p = 1 + 1. Let w = p - 1.6. What is the closest to g in 0.3, w, 1/6? 1/6 Let p = 1 + 0. Suppose 4f - 5 = 3. Which is the closest to p? (a) -2/9 (b) 1 (c) f b Let m = 5 - 3. Let n be 1 - (m - (-1)/(-1)). What is the closest to n in -4, 0, -0.4? 0 Let h = -1.7 - 6.3. Let z = h - -12. Let o = 6 - z. Which is the closest to 2? (a) -3/4 (b) o (c) -4 b Let s = 3.9 - 3.8. Which is the nearest to s? (a) 1 (b) -2 (c) -1 a Let b be (1/7)/((-7)/21). Let a = 0.8 - -0.2. What is the closest to a in -2, b, 1/3? 1/3 Let j = -5/21 + -2/21. Which is the closest to -1? (a) j (b) -3/5 (c) 2 b Let o = 1.141 + -0.141. Let l = 4 - 11. Which is the closest to l? (a) -3 (b) o (c) 1/3 a Let b(m) = m3 + 3. Let d be b(0). Let z be 1/37/((-175)/(-30)). Suppose 16 = -3c - c. What is the nearest to z in c, 0.3, d? 0.3 Let t = 1 - 6. Let h = -4 - -7. Suppose -y = -hy. Which is the closest to y? (a) t (b) -1 (c) -0.5 c Let t = 2.4 + -2. Let n = -11 + 9.9. Let v = n + 1. Which is the closest to v? (a) 2/9 (b) 0.2 (c) t b Let h = 0.2 - 0.3. Suppose f - 11 = w, 74 - 25 = -5w + 2f. Let t be (-3)/9w - 7. What is the nearest to h in t, 0.2, -1? 0.2 Let y = 1 + -2. Let r = 43 - 39. Which is the nearest to 1? (a) r (b) y (c) -2/7 c Let o be (1 - 0 - 0)6/(-42). Let a = 3.9 - 4. Suppose 5x - 2 = -12. What is the closest to a in o, -5, x? o Let o = -0.3 + -0.7. Suppose 1 = 2q - 5. Let p = 219/4 + -55. Which is the nearest to p? (a) o (b) q (c) -0.3 c Let w = 15 + -15. Suppose 4p - 4q + 8 = -0p, 0 = -p + 3q - 4. Which is the nearest to 0.01? (a) w (b) -0.5 (c) p a Let o(f) = f*2 - f + 2. Let z be o(0). Suppose d + 6 = -zd. Let m = d + 1. What is the closest to -1 in 0.3, -0.3, m? m Let b = 0.6 - -0.4. Let v be -2((-8)/6 + 2). What is the closest to b in v, -0.1, -2/3? -0.1 Suppose 0 = -q - 2q. Let k = 0.13 - 0.43. What is the closest to k in 0.4, q, 4? q Let l = -2 + 6. Let x be 40/(-42) - l/(-14). Let u = -3 + 4. What is the closest to x in u, 5, -5? u Let m = -12 - -8. Let s be (-5)/2 - (-4 - m). Let h = -11/4 - s. What is the nearest to -2 in h, 5, -1? -1 Let j be 6/(-10)30/(-6). Suppose jo + 30 - 9 = 0. Let r(q) = -q - 3. Let i be r(o). Which is the closest to -0.1? (a) 0.2 (b) i (c) -3 a Let g = -2/61 + 71/305. Which is the nearest to 0.1? (a) -0.3 (b) g (c) 3 b Let a(b) = b*2 + 4b. Let i be a(-3). What is the nearest to 4 in -4, i, -0.2?	{ "pile_set_name": "DM Mathematics" }
- 2)(l + 1) Let -5f*4 - 45f*3 - 115f*2 - 15f + 180 = 0. Calculate f. -4, -3, 1 Factor -237g3 - 939g*2 - 912g + 36. -3(g + 2)2(79g - 3) Factor 2v*3/13 - 10v*2/13 - 28v/13. 2v(v - 7)(v + 2)/13 Factor k4 + 51k*3 + 192k*2 + 188k. k(k + 2)2(k + 47) Factor 2m2/3 - 662m. 2m(m - 993)/3 Let -4u4 + 24u*3 + 124u*2 - 624u - 720 = 0. What is u? -5, -1, 6 Factor -l*2/2 + 6189l - 38303721/2. -(l - 6189)2/2 Factor -k2/4 - 2690k - 7236100. -(k + 5380)2/4 Factor r4 + 3r*3 - 69r*2 - 35r + 900. (r - 5)*2(r + 4)(r + 9) Let -6h*5 - 15h*4 + 357h*3/8 + 231h*2/8 - 87h/4 + 3 = 0. Calculate h. -4, -1, 1/4, 2 Factor 2s4 + 16s*3 + 42s*2 + 44s + 16. 2(s + 1)2(s + 2)(s + 4) Let -32o*2 - 148o - 80 = 0. What is o? -4, -5/8 Solve -3t4 - 15t*3 - 18t2 = 0 for t. -3, -2, 0 Determine u, given that u2/7 - 655u/7 + 654/7 = 0. 1, 654 Find a such that 8a*3/3 - 22a*2 - 56a/3 + 6 = 0. -1, 1/4, 9 Factor 3t4/2 + 3t*3/2 - 6t*2 - 6t. 3t(t - 2)(t + 1)(t + 2)/2 Factor -21w4/4 - 87w*3/2 - 477w*2/4 - 108w. -3w(w + 3)*2(7w + 16)/4 Solve -81x*5 - 90x*4 + 309x*3 + 258x*2 - 228x - 168 = 0 for x. -2, -1, -2/3, 1, 14/9 Find b, given that -3b2 - 768b + 4716 = 0. -262, 6 Determine l so that -l*5/2 + 17l*4/2 - 21l*3 - 2l*2 + 28l = 0. -1, 0, 2, 14 Factor 3w2 + 2049w. 3w(w + 683) Factor -3v3 - 945v*2 - 18000v - 88500. -3(v + 10)2(v + 295) Suppose d*2/2 + 6406d + 20518418 = 0. Calculate d. -6406 Let -15q5 - 10q*4 + 270q*3 + 660q*2 + 545q + 150 = 0. What is q? -3, -1, -2/3, 5 Suppose 2d3/3 - 14d*2 - 64d - 200/3 = 0. Calculate d. -2, 25 Find q such that 3q2/5 + 87q/5 + 72 = 0. -24, -5 Determine o so that 3o2/8 + 3o + 21/8 = 0. -7, -1 Factor 3v3/8 - 9v*2/2 + 135v/8 - 75/4. 3(v - 5)2(v - 2)/8 Factor c*3 - 215c*2 + 1056c - 1260. (c - 210)(c - 3)(c - 2) Suppose 38z2/5 - 8z + 2/5 = 0. What is z? 1/19, 1 Factor -3p5 - 6p*4. -3p*4(p + 2) Determine p, given that -5p3 - 3095p*2 - 480495p - 477405 = 0. -309, -1 Factor 4h5 - 68h*4 + 224h*3 - 208h*2. 4h*2(h - 13)(h - 2)2 Factor 2s*5/5 - 14s*4/5 - 16s*3/5. 2s*3(s - 8)(s + 1)/5 Factor -1612a*2/15 - 1074a/5 + 4/15. -2(a + 2)(806a - 1)/15 Suppose 10g*4/13 - 14g*3/13 - 76g*2/13 + 152g/13 - 48/13 = 0. Calculate g. -3, 2/5, 2 Factor 2v3/15 + 226v*2/15 + 44v/3 - 448/15. 2(v - 1)(v + 2)(v + 112)/15 Determine c so that -2c*4/7 + 6c*3/7 + 18c*2/7 - 54c/7 = 0. -3, 0, 3 Let -4y2/7 - 4344y/7 - 1179396/7 = 0. Calculate y. -543 Solve -p*2/5 - 264p/5 - 17424/5 = 0. -132 Find o such that 338o5/9 - 3068o*4/9 + 5402o*3/9 + 2360o*2/3 + 200o = 0. -6/13, 0, 5 What is q in 2q5/7 - 2q*4/7 - 10q*3/7 - 6q*2/7 = 0? -1, 0, 3 Let 3h*2/4 + 33h/2 + 30 = 0. Calculate h. -20, -2 Factor -4y3 + 96y*2. -4y*2(y - 24) What is c in 3c4 - 12c*3 + 6c*2 + 12c - 9 = 0? -1, 1, 3 Factor 2a3 + 172a*2 + 3520a - 7744. 2(a - 2)(a + 44)2 Factor f3 + 11f2 - 4f - 44. (f - 2)(f + 2)(f + 11) What is z in z*5/5 - 2z*4 - 3z*3/5 + 28z*2/5 + 4z = 0? -1, 0, 2, 10 Factor 20h4 - 220h*3 + 885h*2 - 1540h + 980. 5(h - 2)2(2h - 7)2 Suppose v3/6 - v2/6 - 4v/3 + 2 = 0. What is v? -3, 2 Factor 3a2 + 1356a - 1359. 3(a - 1)(a + 453) Let -2b3/7 - 468b*2/7 - 4498b/7 - 576 = 0. What is b? -224, -9, -1 Let i*2/4 + i/4 - 3 = 0. Calculate i. -4, 3 Factor -2n*4 + 26n*3 + 166n*2 + 246n + 108. -2(n - 18)(n + 1)*2(n + 3) Factor -b*3 + 31b + 30. -(b - 6)(b + 1)(b + 5) Suppose 3m3/8 - 9m*2/2 - 129m/8 - 45/4 = 0. Calculate m. -2, -1, 15 Factor m*2/6 + 1708m + 4375896. (m + 5124)*2/6 Solve 2o*4 + 170o*3 + 164o*2 - 336o = 0 for o. -84, -2, 0, 1 Let -4a4 - 60a*3 - 108a*2 - 52a = 0. Calculate a. -13, -1, 0 Suppose -2d2/13 - 60d/13 - 450/13 = 0. Calculate d. -15 Factor -3o3 + 471o*2 - 17760o - 57600. -3(o - 80)2(o + 3) Suppose -10a2 - 52a + 510 = 0. Calculate a. -51/5, 5 Let p*3 - 109p*2 + 3024p - 2916 = 0. What is p? 1, 54 Factor 2w4 - 40w*3 + 74w*2 - 36w. 2w(w - 18)(w - 1)2 Factor -l3 + l2/3 + 4l - 4/3. -(l - 2)(l + 2)(3l - 1)/3 Solve 18s*2/7 + 34s/7 + 16/7 = 0. -1, -8/9 Determine h, given that 30h5 - 85h*4 - 165h*3 + 65h*2 + 135h + 20 = 0. -1, -1/6, 1, 4 Let -2q3 - 24q2 = 0. Calculate q. -12, 0 Suppose z4/10 + z*3/2 + 2z2/5 = 0. What is z? -4, -1, 0 Determine i, given that -i2 + 1817i + 1818 = 0. -1, 1818 Factor 21x*3/2 + 102x*2 + 303x/2 + 60. 3(x + 1)(x + 8)(7x + 5)/2 Factor -f*4/2 - 53f*3/2 - 545f*2/2 + 4553f/2 + 2523. -(f - 6)(f + 1)(f + 29)*2/2 Factor -5x*2 - 295x - 1590. -5(x + 6)(x + 53) Let -y*3 + 5y*2/2 - 2y + 1/2 = 0. What is y? 1/2, 1 Factor 2z3/3 - 66z*2 + 1132z/3 - 496. 2(z - 93)(z - 4)(z - 2)/3 Factor 5p*3 - 78p*2 + 108p + 56. (p - 14)(p - 2)(5p + 2) Factor w4/3 - 4w*3 + 35w*2/3 - 8w. w(w - 8)(w - 3)(w - 1)/3 Factor -d2 - 13056d - 42614784. -(d + 6528)2 Factor q4/5 + 44q3/5 + 598q*2/5 + 2508q/5 + 3249/5. (q + 3)*2(q + 19)2/5 Factor -g4 + 31g3 - 57g*2 - 1287g - 2430. -(g - 27)(g - 10)(g + 3)*2 Let 3t*3/5 - 27t*2/5 + 81t/5 - 81/5 = 0. What is t? 3 Factor 46p3/3 - 376p*2/3 + 616p/3 - 32. 2(p - 6)(p - 2)(23p - 4)/3 Determine f, given that f*2 - 2423f - 4850 = 0. -2, 2425 Factor -m*4/4 + 5m3/2 + m2 - 77m/2 - 147/4. -(m - 7)2(m + 1)(m + 3)/4 Factor i4/2 + 21i*3/2 + 39i*2/2 + 19i/2. i(i + 1)2(i + 19)/2 Factor 5a5/3 + 20a*4/3 + 25a*3/3 + 10a*2/3. 5a*2(a + 1)*2(a + 2)/3 Solve -2q3/7 - 48q*2 = 0. -168, 0 Factor -20v*3 - 145v*2 + 1165v + 300. -5(v - 5)(v + 12)(4v + 1) Factor -3f3 + 426f*2 + 861f + 432. -3(f - 144)(f + 1)*2 Factor -2k*3 - 3k*2 + 3k + 2. -(k - 1)(k + 2)(2k + 1) Solve -u3 + 50u*2/3 - 116u/3 + 56/3 = 0 for u. 2/3, 2, 14 Factor -107811b4/4 + 29403b*3 - 5049b*2/2 + 75b - 3/4. -3(b - 1)(33b - 1)3/4 Determine a so that -2a*4 + 52a*3 + 2742a*2 + 24248a + 21560 = 0. -14, -1, 55 Factor 2k4/3 - 38k*3 + 204k*2. 2k*2(k - 51)(k - 6)/3 Factor k3 + 11k2. k2(k + 11) Factor -m2/3 + 1471m/3 - 2938/3. -(m - 1469)(m - 2)/3 Factor 2k*5 + 14k*4 + 4k*3 - 128k*2 - 192k. 2k(k - 3)(k + 2)(k + 4)2 Determine u so that u5/6 - 2u4/3 - u3/6 + 2u*2/3 = 0. -1, 0, 1, 4 Factor -3c*2/7 + 3c/7 + 330/7. -3(c - 11)(c + 10)/7 Find q such that -4q3 + 8q*2 + 4q - 8 = 0. -1, 1, 2 Factor 15g3 - 385g*2 - 140g + 260. 5(g - 26)(g + 1)(3g - 2) Factor 5p3 + 85p*2 + 280p + 260. 5(p + 2)2(p + 13) Factor -5x3/3 - 610x*2/3 - 6400x - 12000. -5(x + 2)(x + 60)*2/3 Solve -2o*3 - 16o*2 - 42o - 36 = 0 for o. -3, -2 Factor -4k2/3 + 256k + 1552/3. -4(k - 194)(k + 2)/3 What is i in -2i5 - 32i*4 + 112i*3 - 44i*2 - 110i + 76 = 0? -19, -1, 1, 2 Factor a*3/4 + 7a*2/4 - 17a/4 + 9/4. (a - 1)*2(a + 9)/4 Solve 8q2/7 - 50q/7 + 12/7 = 0. 1/4, 6 Suppose t5 - t4 - 5t3 + t2 + 8t + 4 = 0. What is t? -1, 2 Factor -87t2 - 171t + 6. -3(t + 2)(29t - 1) Factor m2/2 + 1152m - 2305/2. (m - 1)(m + 2305)/2 Factor -19k*3/5 - 44k*2/5 - 12k/5. -k(k + 2)(19k + 6)/5 Determine x so that -8x*4/5 + 68x*3/5 - 88x*2/5 + 28x/5 = 0. 0, 1/2, 1, 7 Determine k, given that -3k4 - 18k*3 - 15k*2 = 0. -5, -1, 0 Factor -3y*4 - 462y*3 - 19539y*2 - 134904y - 255792. -3(y + 4)2(y + 73)2 Factor -t5 + 141t4 + 285t*3 + 143t2. -t2(t - 143)(t + 1)*2 Factor -4o*3 + 28o*2 + 192o - 720. -4(o - 10)(o - 3)(o + 6) Find y such that 2y*2 - 10y - 28 = 0. -2, 7 Determine g, given that -2g2/3 - 74g + 2420/3 = 0. -121, 10 Factor 4c3/5 - 28c*2/5 - 196c/5 + 1372/5. 4(c - 7)2(c + 7)/5 Find d, given that 25d5/2 - 135d*4/2 - 150d*3 + 70d*2 = 0. -2, 0, 2/5, 7 Let 14700o*5 - 15120o*4 + 423o*3 - 3o*2 = 0. What is o? 0, 1/70, 1 Find w such that -5w*5 + 50w*4 - 85w*3 + 40w*2 = 0. 0, 1, 8 Factor 3c*4 - 39c*3 - 9c*2 + 111c + 78. 3(c - 13)(c - 2)	{ "pile_set_name": "DM Mathematics" }
- 2)(-2t*2 + 4t*2 + 0t*2). -28t*4 Expand (-2c + 0c + c)((2 - 2 + 2c)(0 + 0 + 2) + 0c - 2c - c + 0c + 0c + 2c). -3c*2 Expand (-1 + 1 - 2u)((5u + 2u + 2u)(2u + 2u - 3u) + 0u2 - 3u*2 + 5u*2). -22u*3 Expand (-9g*2 + 4g*2 + 3g*2)(0g2 - g3 + 0g*2). 2g*5 Expand (3 - 3 + 1)(2d - 24 + 24) + (2 - 1 + 1)(d + 2d - 5d) - 1 + 1 + d. -d Expand (-s - 2s + 4s)((-3 + 1 + 4)(6s - 2s - s) + 2 - s - 2). 5s2 Expand 0b5 + b5 + 0b5 - 2b4 - b5 + 2b4 + 5b5 + b5 - 2b5 + (5 - b2 - 5)(-4b + 4b + 2b3). 2b*5 Expand (2k + 3 - k - 9)(7k - 30k + 9k). -14k2 + 84k Expand (1 + 1 - 1)(p + p + 0p)(-2 - 1 + 2). -2p Expand (5t + t2 - 5t + (0t - 2t + 4t)(-3t + t + 0t) - 2t2 - 3t*2 + 3t*2 + 0t*2 + 2t*2 - 3t*2)(0t + 2t - t). -6t3 Expand 2 + 2x*2 - 2 + (3 - 3 + 2x)(-32x - 22x + 52x + x + x - 4x + (0 + 1 + 1)(3x + 0x - 5x) + 2x + 3x - 3x). -10x2 Expand -3g + 2g + 2g + (g - 2g + 0g)(-4 + 2 + 0). 3g Expand 0 - x + 1 + 0 + (-3 - 2 + 4)(-4x + 2x + 3x). -2x + 1 Expand (r + 3r - 6r)(-1 + 0 + 2)(0 + 0 - 5). 10r Expand (0d + 0d - d*2)(0d + 4d - d) + 2d3 + 3d*3 - 3d3. -d3 Expand (-2i + 4 - 4)(-1669i2 + 1669i*2 + 45i*3). -90i*4 Expand (3g*2 + 1 - 4g*2 + 3g*2)(2g + g - g). 4g*3 + 2g Expand ((-3x + 2x - x)(-3x - 2x + 3x) - 7x2 - 33x*2 - 78x*2)(1 - 2 + 2). -114x2 Expand (d3 - 2d3 - d3 + (-4d + 4d + 2d2)(2d + 0d - 3d) - 5d*3 + 3d*3 + 3d*3 + 3d*3 - 3d*3 + 2d*3)(0d2 - d2 + 4d*2). -3d*5 Expand 2q*2 - 3q*2 + 0q*2 + (0q + 0q - 2q)(q + 1 - 1) - 3q*2 + 0q + 0q + 0q*2 - 2q + 4q - 2q2 + (q2 - 2q + 2q)(1 - 2 + 2). -7q*2 + 2q Expand (3g2 + 1 - 1)(2g + g - 5g) - 3g3 + 3g*3 - 2g3 + (g - g + g2)(3g - 6g + g). -10g3 Expand (u4 + 2u4 - u4)(3u + 23u + 6u). 64u*5 Expand 0 + q + 0 + (-q + 3q - q)(-1 - 3 + 5) + 2 - 2 - 2q + 1 - 1 + 2q. 2q Expand (-5 + 1 + 2 + 2 + 0 - 4 + (-1 - 1 + 0)(-2 - 3 + 3) - 1 + 2 - 2 - 2 + 1 - 3)(2y + 3y*2 - 2y). -15y2 Expand (-3 + 1 + 1)(2j + j2 - 2j) + 0j2 - 2j*2 + 0j*2 + (j + j - 4j)(-2j - j + 5j) - j - j2 + j. -8j*2 Expand (-o - 2o + o)(0 + 0 - 4) - 4o - 4o + 2o. 2o Expand -2 + 2b - 3b - b + (0 + 4 - 5)(4 - 4 + b). -3b - 2 Expand (1 - 1 + b)(-7 + 8 - 7). -6b Expand (k2 - 7k*2 + 2k*2)(-1 - 2 + 4)(1 + 2 - 4). 4k2 Expand (g2 - g*2 + 2g*2)(g - 3g + 0g) + (6g2 - 4g*2 + 2g*2)(5g - 4g - 3g). -12g*3 Expand -4a + 3a + 2a + (6 - 1 - 1)(-a - 7a + a). -27a Expand (1 + 3 - 6)((-z + 0 + 0)(-2z4 - z3 + z*3) - 2z*5 - 4z + 4z + (-2 + 3 - 3)(-3z5 - 4z*5 + 3z*5)). -16z*5 Expand (4 - 3q - 4)(2q - 3q + 0q) + (3q - q + q)(q + q - 1 + 3q). 18q*2 - 3q Expand (2d - 3d + 3d)(-4d3 + 9d3 + d3) - 2d2 + d4 + 2d*2. 13d4 Expand (t4 - 3t4 - t4)(2t - 3t - t)(0 + 1 - 2). -6t*5 Expand (-14c + 3c2 + 14c)((3c - 4c - c)(3 + 2c2 - 3) - c - c3 + c). -15c*5 Expand -g + 5g - 3g + (6g - 5g + 9g)(-2 - 4 + 3). -29g Expand (200g + 2 - 200g + 46g2)(0g + g + 3g). 184g3 + 8g Expand (-2v2 + 3v - 3v)(2v2 - 4v2 - v2) - 6v4 + 5v*4 - 4v*4 + 6v. v*4 + 6v Expand (-3 + 2 - 1)(-2q*3 + 5q3 - q3) + 39 - 2q3 - 38 + 3q*3. -3q3 + 1 Expand h3 - 3h3 + 3h*3 + 0h*3 + 4h*3 + 0h*3 + 0h*3 + 0h3 - h3 + (0h + 0h + 2h2)(2h - 2h - h). 2h3 Expand (-7 - 7 + 5)(-2 + 5 - 1)(-2u - 3u + 0u + (-3 + 3 + 2u)(-3 - 1 + 5)). 54u Expand -4l*5 + 3l5 - l5 + 4l5 + 7l*5 + 10l*5 + (-2l*3 - 2l*3 + 6l*3)(-2l2 + 2 - 2). 15l*5 Expand (3 + 5v*3 - 6v3 - v4 + 3v3)(33 - 5v - 33). 5v*5 - 10v*4 - 15v Expand (0 + 2t2 + 0)(3 + 2t - 3) + (0 + 0 - t)(-28t2 - 8t*2 + 10t*2)(-2 - 4 + 4) + (2t2 - 1 + 1)(-3t + 3t + 2t). -44t*3 Expand (-3z*3 + 3z*3 + 2z*3)(2 - 6 + 2)(5 - 2 - 2) - 2z*3 - 2z*2 + 2z*2. -6z*3 Expand (-2 + 1 + 2)(9l3 + 46l*2 - 46l*2). 9l*3 Expand (2d*3 + 2d*3 - 3d*3)(1 - 2 - 2 + (1 - 1 - 1)(-2 + 2 - 2)). -d3 Expand x5 - 17x*5 - 18x*5 + (2x2 + x2 - 5x2)(2x - 2x*3 - 2x) + 2x5 - x5 + 0x5 + x2 - x*2 + 2x*5. -27x*5 Expand (-3 + 3 - 2)(-t4 + t4 - 4t4). 8t*4 Expand -6u*4 + 2u*4 + 2u*4 + (0u - 2u + 3u)(-u3 + 5u*3 - 5u*3) + (2 - 2 + 2u)(-u2 - u3 + u2) + (-2 + 6 - 3)(2u + 3u*4 - 2u). -2u4 Expand ((-3f - 3f + 5f)(4 - 7 + 2) - f + f + 2f + 1 - f - 1)(2f*3 - 4f3 + f3) - f*4 + 3f*4 - 4f*4. -4f*4 Expand (38 + 33 - 22)(2n2 + 2n*3 - 2n*2) + 3n*3 - 5n*3 + 0n*3. 96n3 Expand (44 - 44 + v2)(-3 + 2 + 3)(-3v2 + 5v2 - v2). 2v4 Expand 0z - z - z + 4 - z - 4 + (3 - 3 + 1)(-z - z + 0z) - 3z - 2z + 4z. -6z Expand 4i3 + i3 - 3i3 + i3 + 3i3 - 2i3 + i3 - i*3 + 2i*3 + (2i - i - 2i)(-4i2 - 2i*2 + 5i*2) - i - 3i*3 + i. 4i*3 Expand 0m*2 + 3m*2 + 0m*2 + (-5m + 3m - m)(-2m + 6m - 2m) + (2m - 2 + 2)(-5m + 2m + 5m) + 0m2 + m2 - 3m2. -m2 Expand (1 + 5 + 4)(-4x + 5x + 2x). 30x Expand r2 + 0r - 2r + 3r + (-2 - 5r + 2)(-3r + 0r + 4r). -4r*2 + r Expand (-3z*2 + 3z2 - z3)(3 - 3z - 7 + 6). 3z4 - 2z*3 Expand (-4 + 0 + 2)(-4a + 2a + 3a) - 2 - 5 + 6 - 5a. -7a - 1 Expand (0s + 2s + 0s)(0s + 0s - s) + (-5s + 5s + 6s)(s + 0s + 0s). 4s*2 Expand (2c*3 - 1 + 1)(-2 + 2 - 2c) + 25c4 + 0 + 0 + (c3 + c3 - c3)(-5c + 2c + c). 19c*4 Expand (-3l + l + l)(3 + 0 - 4) + 6l - 2l - 2l - l + 2 - 2. 2l Expand 0d5 - d5 + 0d5 + (-5d - 3d + 5d)(-5 + 2 + 1)(-2d4 + 2d4 - d4). -7d5 Expand (-1 + 5 - 3)(2c3 - 4c + 4c) + c2 - c3 - c2 + (6c*2 - 2c*2 - 2c*2)(3 + 2c - 3) - 7c*3 - 3 + 3 + (-4 + 4 - 2c*2)(-2c - 1 + 1). 2c*3 Expand (w + 17 + 0w - 19)(-4w - 2w + 4w)(-w + 4w - 5w). 4w*3 - 8w*2 Expand (-2j + 7j - 3j)(-6 - 72 - 9). -174j Expand (0j + 0j - j)(-2j3 + j3 + 2j3) + 3j*4 - 3j4 - j4 + 313j + 2j*3 - 313j - 3j4. -5j*4 + 2j*3 Expand -m + 6m*3 - 16m*2 - 8m*2 + 21m*2 + (-m + m - 2m)(5m*2 - 2m*2 - 5m*2). 10m*3 - 3m*2 - m Expand 4y - 2y + 0y + (1 + 1 + 6)(-2 + 2 + 2y). 18y Expand (7t - 10t + 0t)(4t - 2t - t). -3t*2 Expand (-13l*3 - 4l + 2l + 14l*3)(1 + 1 + 0). 2l3 - 4l Expand 2j2 - 2j2 - j3 + j + 3j3 - j - j3 + 4j3 - j3 + (-j*3 + 2j*3 + 0j*3)(1 + 0 + 1) + 0j - 2j*3 + 0j. 4j3 Expand (-u + 2 + 0 - 1)(-4u3 - 18u3 - u3). 23u4 - 23u*3 Expand (-2r + 0 + 0)((3r + 0r + 0r)(4 - 1 - 2) + r - r - 4r). 2r2 Expand (5u - 5u - 3 + u)(-2u - 3u + 2u)(-u3 - u2 + u*2). 3u*5 - 9u*4 Expand (v - v - v)(-4 + 4 + 2)(-4v*2 + 0v*2 + 2v*2). 4v*3 Expand -3 + 3 + f + 1 - 1 - 4f + (5 - 1 - 2)(-2f + f - f). -7f Expand -3 + 3 + 3h*3 + (1 + h - 1)(h*2 + 0h + 0h) + 10h*2 + 0h*3 - 7h*2 - 2h*3. 2h*3 + 3h*2 Expand (-1 + 2 + 0)(0w - 2w*2 + 0w) + (4w - 20w + 0w)(w + 2w - 4w). 14w2 Expand -3y - y + 6y + 0y + y + y + (2 - 2 + 2y)(3 - 1 - 1) - 2 + y + 2 + 34y - 5y - 16y. 20y Expand (4k - k + k)(1 - 2 + 0) - 4k - k + 4k + (2k - 2k - k)(-2 + 1 + 2). -6k Expand (r*3 + 2r*3 - 4r*3)(-r + 5r - 3r) + (r*3 + 0r3 + r3)(2 - 2r - 2) - 3r4 + 3r*4 - 2r*4. -7r*4 Expand -18l3 + l3 + 4l3 - 2l*3 - 2l*3 + 5l*3 + 2l*3 - 2l*3 - 2l*3 + (0l + l*2 + 0l)(-3l + 3l - l). -15l*3 Expand (3l - 7l + 3l + (0l - l - 2l)(-4 + 4 + 1) + l - l - 2l)(-l2 + 0l + 0l). 6l*3 Expand (-10x - 5x - x)(4 - 2 - 1 + (-1 - 2 + 1)(2 + 1 - 2)). 16x Expand (o - o + o*2)(-o*3 + 0o*3 + 0o*3) + 0o*2 + 168o5 - o2 - 178o5. -11o5 - o2 Expand (b + 2b - b - 3b + 2b + 2b + (3 + 2b - 3)(-3 + 2 + 3) + 6b - 2b - 2b)(13b3 + 3b*3 - 9b*3)(2b - 3b - 2b). -189b*5 Expand (3q + 0q - q)(5 + 1 + 0) + 0q - q - q. 10q Expand (-2v*3 - 4	{ "pile_set_name": "DM Mathematics" }
e 0 = -199q + 198q + 10. Find the common denominator of -21/5 and 3/3013(1 - q). 10 Let x(j) = -2j2 - 14j + 108. Let y(b) = -43b3 + 2b*2 + b. Calculate the smallest common multiple of x(-11) and y(-1). 220 Let c = -1398 + 1402. Calculate the smallest common multiple of 10 and c. 20 Find the common denominator of 49/108 and 475/1140(-66)/40. 432 Suppose -4o = -o - 4752. Calculate the common denominator of 2 - 40/18 - (-649)/o and -39/14. 112 Let t be (3 + -1)14/(-28). What is the smallest common multiple of (15 - 5)/((-2)/t) and 4? 20 What is the common denominator of 79/144 and 30/105(-5012)/(-240)? 720 Suppose 0 = 3h - 5o - 70386, o = -2h + 7h - 117310. Let q = h + -445605/19. Let s = q + -4657/380. Find the common denominator of s and 37/66. 660 Let k(j) = -j2 - 7j + 1. Let o be k(-5). Suppose oa + 56 = 15a. Suppose -3d + 15 = -3q + 8q, -2d = 10. What is the smallest common multiple of a and q? 42 Let i = 63 - 57. Suppose -110 = -7b + 310. Calculate the smallest common multiple of i and b. 60 Find the common denominator of -21/47 and (-14)/(-21) + 454/(-24) + 1. 188 Let n(w) = -w3 + 3w*2 + 4w + 1. Let k be n(4). Suppose -4f = -7f + 6. What is the lowest common multiple of f and 0 + 0 + k3? 6 Suppose 5p + 4p - 294930 = 0. Let n = p - 589709/18. Calculate the common denominator of n and 3((-9)/(-8) - 1). 72 Suppose 5w = 562 - 482. Calculate the least common multiple of 5 and w. 80 Let i = 30 - -42. Calculate the common denominator of 87/40 and (-6 - -1) + 1254/i. 120 Find the common denominator of 125/84 and 143/12 + (-19 - -16). 84 Find the common denominator of -85/18 and (-6 - 1) + 22712/2924. 774 Suppose -42 = -7d + 70. What is the least common multiple of d and 178? 1424 Suppose -5z - 2k = -280, -3z + 203 = k + 34. What is the lowest common multiple of 3 and z? 174 Let w = -65319836 + 392844161/6. Let q = w - 154538. Let a = q + 336. Calculate the common denominator of a and -59/10. 30 Suppose -8x = 239 - 1199. What is the lowest common multiple of x and 12? 120 Let o = 1/6094 - -82231/231572. What is the common denominator of o and -53/32? 608 Let a be 34/(-1(4 + -3)). Let f = a + 36. Suppose 25 = 3y - 2j + 7, 2y = 5j + 23. What is the lowest common multiple of y and f? 4 Find the common denominator of (-122)/(-2)2/4 and 13/39 + (2 - (-67)/12). 12 Find the common denominator of (-3)/7 - (-1392)/203 and 133/18. 126 Suppose 0 = -2n + 5s + 313, 5n - 3s = 1221 - 486. Suppose 6p - 150 = n. What is the common denominator of -10/3 and p? 3 Suppose -44 = 2f + 5n, f + 16 = -n - 0. Let t(s) = 5s*3 - 6s + 7. Let m be t(-3). What is the common denominator of 12/4 - m/f and 73/2? 6 Let r = -8525/24 - -355. What is the common denominator of (75/(-16))/(9/6) and r? 24 Suppose 0 = w - 3r - 73, -3w + 8r = 5r - 189. Let u = 61 - w. What is the lowest common multiple of u and 16? 48 Suppose 0 = -6i + 84 - 72. Calculate the least common multiple of i and 54. 54 Let k(t) = -2t*2 + 7t - 7 + 0t2 + t2. Suppose -58f + 16 = -50f. What is the lowest common multiple of k(5) and f? 6 Suppose 44 = -21y + 212. Calculate the lowest common multiple of y and 18. 72 Let q(h) be the first derivative of -h*2/2 + 2h - 6. Let d be q(-2). Suppose dv - 18 = v. What is the smallest common multiple of v and 16? 48 Let r = -11 - -15. Suppose -f + 505 = rf. Suppose 2h = 3n - f, 0h + h = n - 32. Calculate the common denominator of n and 23. 1 Let o = -10 - -8. Let u = o + 3. Find the common denominator of 52/(-40) + u + 1 and -27/22. 110 Let a(l) = 18l*3 + 2l*2 + 2l - 1. Let k be a(5). Let y = 1225993/30 + -192838/5. Let c = y - k. Calculate the common denominator of 19/18 and c. 18 Let p = -160 + 43. Let i = -533/4 - p. Let v = 2351/3 - 51611/66. Calculate the common denominator of v and i. 44 Suppose -171 = -17w + 84. Calculate the least common multiple of w and 171. 855 Let i be 7/(-6)3/(-60)-5. Let y = 923/120 + i. What is the common denominator of y and -51/10? 10 Let h be (-7386)/36 + -13. Let z = -206 - h. Let y = 7543/16 - 471. What is the common denominator of z and y? 48 Suppose 7z - 26z + 3382 = 0. What is the least common multiple of z and 8? 712 Let k = 6271/8 + -790. Calculate the common denominator of -5 - -7 - (0 + (-65)/18) and k. 72 Let p be (28 - (-1 - 3))/(-1). Calculate the least common multiple of 20 and 412/p2 + 23. 20 Let x = 126467/18 + -2662343/180. Let q = x + 7771. Find the common denominator of q and -85/12. 60 Suppose -23 = 4z - 15. What is the common denominator of -103/56 and (-1465)/650 + z/(-13)? 280 Suppose 4n + 352 = 5r, 2r = 5n + 126 + 8. What is the smallest common multiple of 14 and r? 504 Let z be 84/69(-25)/(-12). Let w = -3/23 - z. Find the common denominator of 372/108 - (-1)/(-1) and w. 9 Suppose 0 = -0k - k. Suppose -4d + 3v - 348 = 0, k = 5v - 2 + 22. Find the common denominator of ((-4)/d)/(3/105) and -25. 9 Let n be 10/(-70)(-1)/(-169). Let j = n - -43779/9464. What is the common denominator of j and 9/4175/(-21)? 8 Suppose 4s - 104 - 4 = 0. Let i = s + 0. What is the lowest common multiple of i and 33? 297 Suppose 39q + 5h + 151 = 41q, 0 = -q + 5h + 83. Calculate the smallest common multiple of 44 and q. 748 Let h = 49317/10 + -4944. Let m be 150 - -2 - (4 - 2). Find the common denominator of 2 - (m/(-9) + 2) and h. 30 Suppose -4z + 70 = 14. Let t be 2/(16/(-4)) - 75/(-2). Suppose t = 7o - 89. Calculate the least common multiple of o and z. 126 Let f(m) be the third derivative of -691m4/4 - m3/6 - 4m2. Let n be f(1). Let x = n - -33247/8. What is the common denominator of x and 49/24? 24 Let h = 1044168/79 + -13217. Calculate the common denominator of h and -74/9. 711 Calculate the common denominator of -99/100 and -5 + (-3)/((-420)/472). 700 Let q = 38 + -42. Let b(v) = -v + 4. Calculate the lowest common multiple of b(q) and -11 + 22/2. 40 Let q(n) = n*2 - 2n + 27. Let t be q(0). Let s = 27 - t. Calculate the common denominator of (0 - (43 - s))/4 and 13/8. 8 Suppose 0 = 5z - 17 + 7. Suppose 0 = -5d + 4d + 3. Suppose 9 = -ds, -a + 2s = -s - 21. Calculate the least common multiple of z and a. 12 Let a = 11 - -5. Calculate the smallest common multiple of 4 - (-7 + -4) - (-1 + 0) and a. 16 Suppose 2p + 4 = -2w, 22 = -4p + 2. Suppose -6i + 3i + 6 = 5v, -i + 6 = wv. Let k = 36 + -26. Calculate the lowest common multiple of v and k. 30 Let q(n) = n*2 - n - 14. Let w be q(5). Suppose 5f - 7 = a + 3, -3f + 6 = 4a. Calculate the smallest common multiple of 4 and (w - -1) + f/2. 8 Let r = -42 + 44. Suppose -114 = -7b + 2b + ru, 0 = -2b - 2u + 54. What is the smallest common multiple of 18 and b? 72 Suppose 3h = 0, 124 = -4t - 3h + h. Let l = t + 35. Suppose -5a = -4b + 45, 0 = 2b + 3b + 4a - 5. What is the smallest common multiple of b and l? 20 Let n be (3 - (-17)/(-5)) + (-7968)/5. What is the common denominator of 32/240 - n/420 and 53/2(-1)/7? 14 Let c(q) = 4q2 + 25q + 9. Calculate the smallest common multiple of 55 and c(-7). 330 Find the common denominator of 35/9 and 2/19 + (31480/2375 - 11). 225 Find the common denominator of 6/5 + 21474/1080 + -11 and -9/104. 312 Suppose 4q - 87 = -5y - 31, 96 = 4q - 5y. Calculate the lowest common multiple of q and 7. 133 Suppose 0 = -9k + 13k - 64. Calculate the least common multiple of k and 9. 144 Let b(h) = 5h2 + 37h - 74. Let v = 25 + -9. What is the lowest common multiple of b(2) and v? 80 Let s(r) = -r*2 - 12r - 26. Suppose 0 = -i - 9i - 60. What is the lowest common multiple of s(i) and 14? 70 Let v = 495939 + -133903681/270. Find the common denominator of -119/270 and v. 270 Let v be (-4905)/(-6)(0 + 8). What is the common denominator of 3 - (-3 - (-218)/36) and ((-1)/(-24))/(45/v)? 18 Let i(v) = v*3 - 6v*2 + 4v + 9. What is the smallest common multiple of i(5) and 42? 84 Let n be 12((-20)/8 - -2). Calculate the common denominator of n/(-15) - 1026/40 and (-21)/35 + (-786)/(-160). 16 Find the common denominator of 140/(-21) - -6 - (-382)/60 and ((-104)/(-36))/(16/(-66)). 60 Let g be 15/25 + (-84)/(-10). Let u(d) = -10d*2 - 2d - 13. Let l be u(g). Let o = 15097/18 + l. What is the common denominator of o	{ "pile_set_name": "DM Mathematics" }
n - 90827 = 264n. What are the prime factors of x? 181, 251 Suppose -2n + 6352 = -3h + 567, -14529 = -5n - 2h. List the prime factors of n. 2903 Let i = 396 + -927. Let f = 1265 + i. What are the prime factors of f? 2, 367 Let y(i) be the first derivative of 47i*3 - 5i*2/2 + 18i + 189. List the prime factors of y(3). 2, 3, 53 Suppose 0 = 135j - 123j + 96. Let s(v) = 3 + 4 - v*3 - 10v - 8v2 - 4. List the prime factors of s(j). 83 Let v(r) = r3 - 5r*2 + 2r - 10. Let m be v(5). Suppose m = 5k + 2x - 1620, -k + 3x = x - 324. What are the prime factors of k? 2, 3 Let d = -811 + 2233. Suppose -4t = 3o - 2144, t + d = 2o - 0t. What are the prime factors of o? 2, 89 Suppose 10p + 3073383 = 7p + 84p. List the prime factors of p. 19, 1997 List the prime factors of (-359785)/(-55) - ((-702)/99)/(-13). 31, 211 Suppose 4v = 5x - 547, v + 273 = -v + 3x. What are the prime factors of 7/((-14)/(-30))v/(-18)? 5, 23 Suppose z - 41 = -g + 135, 0 = -4z + 20. Let l = g - 80. Suppose y + 0y + 3k - 26 = 0, -4y + l = -k. List the prime factors of y. 23 Let g = 991 + -448. Let k = g - 312. List the prime factors of k. 3, 7, 11 Suppose -6t + 72 = 36. Suppose 0 = -5v + tp - p + 2085, v = 4p + 417. List the prime factors of v. 3, 139 Suppose -20 = -5n, l = -2n + 5565 + 1626. What are the prime factors of l? 11, 653 Let u be 10/(-4) + ((-62)/(-4) - -3). Let q(o) = 12o + 62. List the prime factors of q(u). 2, 127 Suppose -3f - 182 = -4f + 4z, 886 = 5f + 4z. Suppose s - 6s = -5w + 285, -3w + f = 4s. Let r = 79 + w. What are the prime factors of r? 137 List the prime factors of -2 - -6770 - (-4 + 336/24). 2, 31, 109 Let j = 89765 + -25617. What are the prime factors of j? 2, 7, 29, 79 Let g(t) = -t*2 + 23t + 55. Let x be g(25). Suppose -11 = -xs - 1. Suppose -2m - 414 = -2q, q - 621 = -2q + sm. List the prime factors of q. 3, 23 Let q be 710/16 + (6 - (-408)/(-64)). Let b = 47 - q. Suppose -r - 76 = -bh, -3r + 100 = 5h - 50. What are the prime factors of h? 3 Let m be 0 + -27(-2)/6. List the prime factors of 180/15690/m. 2, 5, 23 Suppose 4o - 5l = 53095, -309l - 2 = -311l. What are the prime factors of o? 3, 5, 59 Let s(k) = -6k + 65. Let h be s(11). List the prime factors of (-4)/((h - (-1078)/(-269)) + 5). 2, 269 Let s(h) = 2h + 4. Suppose -9f + 35 = -2f. Suppose -3w + m + 49 = 0, 2w + fm + 65 = 5w. List the prime factors of s(w). 2, 17 What are the prime factors of 1670/(-4)(-264)/(-55)-2? 2, 3, 167 Suppose 3w - 837 + 3027 = 0. Let d = -276 - w. Suppose -d + 62 = -14k. What are the prime factors of k? 2, 7 Let q = 3989 - 3343. Let r = -3 - -7. Suppose -3a + 2j = -143 - 330, -q = -ra - 5j. What are the prime factors of a? 3, 53 Let q = -3604 + 612. Let m = -1749 - q. List the prime factors of m. 11, 113 Let x be 8-2109/4. Suppose 3r = -10 + 19, -3r + 33 = 4i. What are the prime factors of i/(-9) - x/6? 2, 3 Let v = 14 - -4. Let t be (13 - 1)/(1/v). Let x = t + -119. What are the prime factors of x? 97 Let u(p) = -2p*2 + 4p + 6. Let t be u(3). Suppose 5r + 3607 = 3w, t = -w + 3w - 5r - 2408. List the prime factors of w. 11, 109 Let m(l) = -34l - 236. Let u(k) = -8k + 169. Let p be u(22). List the prime factors of m(p). 2 Let a = -15 - -15. Suppose v - 19 = -a. Suppose 5c - 51 - v = 0. What are the prime factors of c? 2, 7 Let s = -39 + 27. Let c be 4/(-6) + (-8)/s. Suppose -4t = -12, o + 5t = -co + 39. List the prime factors of o. 2, 3 Let u(n) be the first derivative of -3n2 + 310n - 34. List the prime factors of u(0). 2, 5, 31 Let m = 5112 - 14592. What are the prime factors of (2/4 - 0)m/(-20)? 3, 79 Let b = 1303 + -690. Let k = b - 280. List the prime factors of k. 3, 37 Let n = 80 - 73. Suppose 3b = 22 - n, -3b + 3 = -4w. List the prime factors of ((-15)/10)/(w/29)-2. 29 Let l be (-69)/(-115) - 429/15. List the prime factors of (26/(-4) + 4)l5. 2, 5, 7 Suppose 2x - 5x + 84 = -3y, -y + 3 = 0. Let l = 242 - 225. Let z = x + l. List the prime factors of z. 2, 3 Let o = 7035 + -3602. List the prime factors of o. 3433 Let o = 16540 - -7202. What are the prime factors of o? 2, 3, 1319 Let h be (-28)/12(-5 + -244). Let z = -386 + h. List the prime factors of z. 3, 5, 13 Let x = 38 + 464. Let s = x - 1226. List the prime factors of 33/(-22)(s/6 + 0). 181 Let m be (-70)/((10/4)/(30/24)). Let z(r) = 12r + 5. Let c be z(-6). Let h = m - c. What are the prime factors of h? 2 Let h(i) = -2i - 9. Let u be h(-9). Suppose -p + 4p = -u. What are the prime factors of (-14)/(p + (-2 - 14/(-3)))? 2, 3, 7 Suppose -4t - 5h = -4649, t + 7h = 12h + 1181. Let o = t - 557. What are the prime factors of o? 3, 7, 29 Let l(f) = -187f - 23. Let r(v) = v*3 + 5v*2 + 7v + 2. Let x be r(-3). List the prime factors of l(x). 2, 41 Suppose 4b - 21 = -69. Let i = b - -19. Let n(w) = 2w*2 + 2w + 15. List the prime factors of n(i). 127 Suppose -5 = -7y + 9. Suppose -s = yk - 391, -k - 2k = s - 387. What are the prime factors of s? 3, 7, 19 Suppose -k + 5288 = 3v, 7k = 2k - 3v + 26488. List the prime factors of k. 2, 5, 53 Let a(o) = 24o*2 + 10o + 6. Let k be a(7). Suppose -k = -7d - 412. List the prime factors of d. 2, 3, 5 Suppose -5i + 61 - 36 = 0. Suppose 9k - 8 = ik. Suppose -a + ka = -3g + 413, -147 = -g - 5a. What are the prime factors of g? 137 Let s = 4907 + 33339. List the prime factors of s. 2, 13, 1471 Suppose 2p - 24334 = -v - 2690, 3p - 2v - 32445 = 0. What are the prime factors of p? 31, 349 Let h = 32257 - 10824. What are the prime factors of h? 21433 Suppose q + 4 = 0, 4u - q - 26836 = q. What are the prime factors of u? 19, 353 Let i be (-2 - 44/(-10))(1 + 4). Let v(b) = -b + 16. Let c be v(i). Suppose -h + 49 = p, 0h + 190 = cp + h. What are the prime factors of p? 47 Suppose 43w - 1279786 - 1109408 = -26w. List the prime factors of w. 2, 3, 29, 199 Suppose 3l + 4d = -7, 13 + 3 = -4d. Suppose -4u - 1864 = -5t, 0u - lu = 3. List the prime factors of t. 2, 3, 31 Suppose 2h - 123 = -99. Suppose -1035 = -hb + 1257. List the prime factors of b. 191 Suppose -5l + 37965 = 3x, -5x - 16989 = -l - 80236. What are the prime factors of x? 2, 5, 11, 23 Let t(j) = -23j + 970. What are the prime factors of t(-36)? 2, 29, 31 Suppose 724497 - 1085815 = -117x + 1784345. List the prime factors of x. 3, 6113 Let d = 44 + -42. Let h be 104 - -5 - (-2)/d. Let i = h - -93. What are the prime factors of i? 7, 29 Let n(o) = 4o3 - o2 - 7o + 7. Let x be n(1). Suppose -4963 = -5i + 4l - 1268, xl = 0. List the prime factors of i. 739 Suppose -i + y = 4y + 12, -i = 2y + 7. Suppose 0u = u - i. List the prime factors of 188 + -3(4 - u). 5, 37 Suppose -3x + 28 = x - 4r, 5r = 2x - 26. Let p be (-1)/(-6) + x + 7287/18. Let y = -238 + p. List the prime factors of y. 2, 5, 17 Suppose 0n - 5n - 4x = -463, -3n = -2x - 291. Let v = -98 + n. What are the prime factors of ((-920)/60 - (-4)/2)v? 2, 5 Suppose 71636 - 204004 = -4k - 2u, 5k = 2u + 165496. List the prime factors of k. 2, 3, 7, 197 Let g(x) = 2x + 17. Let n be (-52)/39 + (-11)/3. Let w be g(n). What are the prime factors of (w/21)/((-1)/471)-1? 157 Let r(q) = -246q*3 + 2q*2 + 8q + 5. Let j be r(-2). Suppose 1304 = 2b + a, -14b + 3a = -11b - j. What are the prime factors of b? 653 Let l = 129 - 127. Suppose -942 = -3a - lh + 263, -h = 4a - 1600. List the prime factors of a. 3, 7, 19 Suppose -4i - 13g = -10g - 18, -10 = -4i + g. Suppose 36 = ik - 987. What are the prime factors of k? 11, 31 Suppose 52p - 56p + 4236 = 0. Let h = -724 + p. List the prime factors of h. 5, 67 Suppose 31n + 59811 = 292404. List the prime factors of n. 3, 41, 61 Suppose 2a - 89699 = -4i + 5637, i - 4a = 23870. List the prime factors of i. 2, 3, 29, 137 Let f be 20/(2 + 8) + 9. Let c(q) be the second derivative of -q*5/20 + 13q*4/12 - 5q*3/2 + 7q*2 + q. What are the prime factors of c(f)? 7, 13 Let f(b) = -b + 1. Let w(n) = 2n. Let q(s) = -f(s) - w(s). Let m be q(-10). Suppose -1915 = -mo - 340. List the prime factors of o. 5, 7 Let m(l) = l3 - 7l*2 - 7l - 4. Let z be m(8). Suppose 1492 = 2s - 4w, -4644 = -z*s + w - 1646. What are the prime factors o	{ "pile_set_name": "DM Mathematics" }
)? -1/68 What is ((-54)/(-81))/(110/(-17787)-11)? 49/5 Calculate (-5)/(-2)(-904)/(-226). 10 Evaluate (2/(-45))/((-15)/(-72)-29246/(-29725)). -8/9 What is the value of ((-2)/1488-6)/(46/184)? 1/31 Evaluate (6/9)/(106738/(-3858)). -2/83 ((-22)/2)/((-657/19)/(-54)) -33 ((-2)/(-10))/((-303)/6363)4/3 -28/5 (1(-4)/2)/(68/(-714)6762/56) 4/23 (-72)/((-197208)/83)(-3)/(-5) 1/55 What is 8/(-18)-22115/(-104340)? -2/111 Calculate (8/440)/(144/360(-3)/2). -1/33 (34005/15869)/((-20)/(-6)) 9/14 Evaluate (-6)/(((-804)/15)/134-1-51). 3 What is the value of (-6)/(-18)48/(-2)(-54)/(24/4)? 72 12/(-27)(-111474)/18016 11/4 Calculate ((-9)/((-234)/4))/((1468/14313)/(6/(-9))). -1 What is the value of ((-6)/4)/(22455/124750)? -25/3 Evaluate (-50)/(10300/(-1751))-10. -85 14/(-20)6794/(-71337) 1/15 What is ((-1)/1)/((6/16)/(14/((-952)/(-1479))))? -58 (-10)/4205/(15375/1650) -55 Calculate 2/((-63)/(-54)(-24)/882). -63 34(-2518)/(-3777)-13 -24 Evaluate ((-12)/(-10))/((11523/(-276))/((-5)/605)). 2/167 36/160(-2112)/(-99)(-15)/2 -36 What is (2/((-8)/(-6)))/((12/10)/((-7952)/(-3195)))? 28/9 What is ((-2)/(-8))/(4/52)((-2988)/(-20501))/6? 3/38 Calculate 14/5636/9. 1 What is ((204/5)/(-984/360))/(126/882)? -136 Calculate (-102)/(-119)-17(-38)/(-513)63. -68 11168/36503/(-12) -2/25 Evaluate ((263/3682)/((-4)/(-14)))/(69/24). 2/23 Evaluate ((-270)/(-125))/(93/465)(-20)/6. -36 Calculate (-317)/((-57694)/(-520))(-14)/4-7. -70 Evaluate 6238/12476(-3)/(177/2). -1/59 What is the value of (((-12)/96)/(-1))/(63/(-126))(-16)/(-26)? -2/13 What is (6468/(-550))/147(-5)/(-22)? -1/55 Calculate (2240/840)/((-2)/3)(-33)/2409. 4/73 Evaluate ((-5)/(-1))/(-2018/3312). -46 What is the value of (3/9)/(24/(-16)22/(-165))? 5/3 What is the value of (1956/8476)/(59/13)? 3/59 Evaluate ((-121)/(-33))/(135/90(-4)/(-18)). 11 Calculate (-46)/16561880. -40 Evaluate (-1(-2)/(-232))/(((-2760)/480)/23). 1/29 Evaluate 3/(-24)359/(108059/(-860)). 5/14 What is (6/27)/(94/((-2068)/(-22)))? 2/9 What is 6632/(-1664)-26? 33 What is (1595/(-29))/(-11)(-986)/145? -34 Calculate (-2)/(-2)((-400)/60)/(-20)-1-5. 5/3 Calculate (2(-1)/(-12))/((48/3808)/(549/1281)). 17/3 Calculate 1300/(-2925)(-45)/16(-72)/5. -18 What is the value of (15/3(-28)/((-840)/54))/(3/(-22))? -66 What is ((-214)/3219/(-42))/(1/5)? 5/7 What is the value of (((-264)/(-20))/11)/((-20)/175)(-2)/39? 7/13 Evaluate ((-1218)/(-15))/(((-252)/(-420))/((-3)/(-7))). 58 What is the value of ((196/(-8))/(-7))/((-95)/1330)-1? 49 What is the value of (47/13113)/((-26)/(-117)5/10)? 1/31 What is 494/7622/(-66)? -13/6 Evaluate 34/(-6)336/112. -17 What is the value of 13/(-2)11964/1671969? -2/43 What is the value of 167/(-1336)(-16)/(-38)? -1/19 100/(-26250)105(-10)/(-218) -2/109 What is the value of (136/85(-9)/(-2835)15)/((-8)/(-14))? 2/15 Evaluate ((-1)/11)/(255/12903). -23/5 Evaluate (9375/(-2500))/(135/(-144)). 4 What is the value of 66/8(-63216)/(-14487)? 36 ((-8959)/(-582335))/(26/(-20)) -2/169 What is ((-24)/(-7))/(336/(-5292)1)? -54 Evaluate ((-45648)/(-2536))/((-27)/(-15)). 10 What is (12/(-45)18130/6216)/(5/3)? -7/15 What is the value of (-102)/75075/(-870)? 85 What is the value of ((-237)/(-4)(-2994)/(-4491))/((-1)/2)? -79 Calculate ((-21540)/(-11488))/((-6)/(-32)). 10 Calculate ((-36)/40)/((-12)/20)10/115. 3/23 What is the value of 11826/(-6570)((-5)/136)/(9/12)? 3/34 Evaluate 33/55-2417/((-612)/(-24))-5. 48 Calculate (315/2205)/((-1)/105). -15 Evaluate (((-201)/(-2010))/(3/(-132)-1))/(4/(-20)). -22 What is the value of ((-8)/15(-8435)/6266)/(2/(-3))? -14/13 What is the value of (2079/(-735))/11363/(-9)? 27/5 Evaluate 16/335949/(-4168). -46 Evaluate (21/(-14))/(-820/(-4160)). -39 Calculate (312/9(-17)/(-136))/((-5)/3). -13/5 What is the value of 5/60-62228/(-114)? 31/3 What is ((-300)/(-2450)(-70)/45)/(30/9)? -2/35 Calculate (-17)/(5355/(-252))(-3010)/28. -86 Calculate (33/(-22))/(1820/12720). -53 ((48/18)/(-1))/(128/64)3/(-10) 2/5 What is 3/2488/854(-28)/(-2820)? 2/235 Evaluate (((1160/(-20))/232)/(1/252))/(9/(-3)). 21 Calculate 4704/2688884/13. 119 What is (1(-5)/10)/((185310/116)/71)? -1/45 (4/(-3))/(8/10494265) -33/5 Evaluate (-50)/(-125)(-12425)/70. -71 What is the value of -651(1352/(-546))/(-26)? -62 (10/(-15))/(277/1662) -4 Evaluate 40/(-1920)((-51)/68)/((-9)/24). -1/24 Evaluate ((96/6)/208)/(-1)2. -2/13 584/1751900/(-258210)(-6)/8 2/151 (-5)/(5/((11132/(-22))/(-11))) -46 Calculate ((-66087)/5245)/(-1(-18)/404/(-3)). 21 What is 6/1811116/(-1191)? -28/9 (2295/(-81))/5(-6)/765 2/45 Calculate (560/(-15680))/((-1)/126). 9/2 What is ((-26)/(-12))/(14833/3423)6/(-31)? -3/31 Calculate 3/2(-55)/(-231)246/41010. 15/7 (240/(-5400))/(-11(-20)/110) -1/45 Calculate 20/18(-5)/((2775/(-540))/37). 40 What is (2/(-2))/(-19((-112)/(-24))/14)? 3/19 What is (63/98)/(-13(-69)/(-2093))? -3/2 Evaluate 4/(70/18(5624/(-259))/(-38)). 9/5 What is ((-37)/(4144/(-42)))/(2898/168)? 1/46 Evaluate (((-6580)/(-15))/47)/(3(-44)/(-1683)). 119 What is 37/(2220/(-100))(-24)/(-4)? -10 (2/8)/(1/(-3))6090/(-45675) 1/10 Evaluate ((192/84)/(-8))/((-6596)/679). 1/34 What is ((-120)/(-900)15/2)/((-35)/147)? -21/5 Calculate ((-6)/(-4)(8/(-90))/(-1))/(25/(-875)). -14/3 1/((-10)/(-5))1/(((-51)/(-90))/17) 15 What is the value of (1904/80)/17(-360)/(-9)? 56 What is ((-7172)/(-652)(-12)/(-110)5)/((-6)/(-103))? 103 What is the value of (4/2)/(-12)2091/(-1394)? 1/4 Calculate (120/(-1216))/((1980/(-16))/(-99)). -3/38 Evaluate (8/12)/(8((-6)/(-3))/(-24)). -1 Calculate ((-27)/45)/(318/(-4346)). 41/5 Calculate (3(-19)/1149/(-9))/(170/(-20)). -1/17 What is 84/81(-2883)/6727? -4/9 ((-200)/(-58))/(552/8004) 50 266/14-34(-38)/646(-3)/(-2) 57 Calculate (618/48)/((-5121)/116076). -51 What is the value of (-5)/(65/(-12))(-71370)/(-3660)? 18 Evaluate (24/(-112))/((-3938)/10024)(-418)/(-6). 38 Calculate (-238)/16811/((-88)/96). 17 Evaluate 66/44/(((-8)/12)/((-96)/(-288))). -33 What is the value of (76/(-2394)-189)/((-3)/18)? -36 -2((-84)/(-126))/(14/(-3)) 2/7 Evaluate 2/2(258055/101)/(-35). -73 Evaluate (((-109)/763)/((-44)/(-14)))/(15/((-32760)/14)). 78/11 Evaluate (3/33)/(6/817/3570-28). -10/11 What is -30-2917/(-2465)110/(-33)? 20 Calculate (-3)/(75/(-50))(-266)/280. -19/10 What is the value of (376005/(-21486))/(2065/(-4))? 2/59 Evaluate (4/4)/(-8150/106800). -89 What is the value of 1275/2550(-20)/10? -1 Calculate (-43032)/(-1956)6/44(-16)/1. -48 What is the value of (-1)/(1539/351)? -3/5 Evaluate -2821/(-5880)-310. -31 What is the value of (-7329)/36645275/(-3)? 55/3 What is 2((-4)/(-148))/(15/(-90))? -12/37 What is (1953/(-837))/((-315)/(-10))? -2/27 Calculate ((-9)/128)/((-8)/(-2)). -3/2 Evaluate (-20)/(-14)1(7/(-57))/((-216)/648). 10/19 (-109)/314/14(-16)/((-160)/(-30)) 109 What is the value of 245187/33323/((-30)/(-32))? 44 Calculate ((-7722)/(-2064348))/(3/4-1). -2/401 Evaluate -11-21/(72/(-54))2. -33 Evaluate ((-868)/(-1116)-31)/(4/(-24)). 14 What is 220/(-17325)(-4)/89/(-3)? -2/105 What is ((-144456)/(-210665))/((-3)/(-5))? 8/7 What is (625/30)/(5635/(-33810))? -125 What is the value of 1/((-57)/8)75/(-200)156/(-13)? -12/19 What is the value of (6/720-6)/(3/24)? -2/5 Calculate (405/2268)/(((-26)/(-2))/273). 15/4 (-744)/(-434)(-91)/7827 -54 What is 45/(-72)(1856/(-160))/29? 1/4 What is ((145/58)/(-1)(-2)/(-15))/((-53)/21306)? 134 10/(246/(-984)5/((-60)/(-32))) -15 Evaluate ((19500/(-175))/52)/((-25)/70). 6 What is 361/((-166060)/(-23575))(24/5)/(-3)? -82 Calculate (-1742)/(-156)104/24(-216)/60. -67 Evaluate (9196/(-847))/((-20)/(-35)). -19 (-3)/((-3)/(-146))(-85462)/170924 73 Evaluate (-6)/(-45)(-385)/2618. -1/51 Calculate (114/(-2565))/((-80)/6300). 7/2 Evaluate (81/(-18))/((-7626)/(-124)). -3/41 Evaluate (-3)/((-9)/510)1/((210/6)/7). 34 Evaluate 26(4004/(-88))/91. -13 What is the value of (57/296452)/25? 1/25 Calculate (((-405)/(-30))/27)/(15/1275-10). -17/4 Calculate (-9)/((-54)/15)92/(-115)(-6)/6. 2 What is the value of ((-8)/7)/(330/(-2079)4/20)? 36 Evaluate ((-5)/(-6))/5190400/(-952)(-9)/(-6). -50 What is the value of (204/(-2618))/((-4)/(112/(-12)))? -2/11 What is the value of -2113/(-72)25	{ "pile_set_name": "DM Mathematics" }
72)302 + 3/(-4). 126 Let r be 934134/18(-15)/100. Let f = -3113 - r. Calculate the common denominator of f and 149/18. 90 Let v = 118 + -233/2. Find the common denominator of -93/76 and v. 76 Let q(j) = 53j + 1. Let u be q(-1). Let a = u + 61. Calculate the least common multiple of 9 and a. 9 Let b be (-369)/36694/2088. Let x = b - 8/261. What is the common denominator of x and ((-1)/(-6))/(11/81)? 176 Let y = -3 + 7. Calculate the least common multiple of 32/(-20) + 2 + (-216)/(-10) and y. 44 Let p(k) = 4k + 42. Let u be p(-11). Calculate the common denominator of -65/4 and u/(-7) + (-1463)/490. 20 Let a = -12087026628 - -188086221463786/15561. Let g = a - 1/1729. What is the common denominator of -55/8 and g? 72 Let t = 118/57325165 + -5011310169479/762883295820. Let g = 16/1109 - t. Find the common denominator of (-194)/63/(-2) and g. 12 Find the common denominator of -39/70 and 4/(-14) - (-2622)/1680. 280 Let g(d) = 8d + 4. Suppose 0 = 4q - 36 - 36. Let v = -22 + q. Find the common denominator of -10/3 and g(v). 3 Let d(t) = -2t - 9. Let z be d(-7). Suppose zw = 6w + 3. What is the common denominator of -67/8 and (95/w)/(10/(-15))? 8 Let c = 12268/9 - 1361. Find the common denominator of c and 7/45. 45 Suppose a - 30 = -35, 2a = q - 154. What is the least common multiple of 324 and q? 1296 Let w(v) = v2 + 2v - 7. Suppose 5m + 9 = 4l, -4l - m - 23 = -26. What is the least common multiple of l and w(-5)? 8 Let k = -30 - -47. What is the least common multiple of k and 16? 272 Let h = 12655/21 - 603. Find the common denominator of -34/39 and h. 273 Let q = -49943281/15 + 3326769. Let m = 2780 + q. Find the common denominator of m and 47/15. 15 Let d = -7093/2080722 + 6/3241. Let s = -7387/2568 - d. Calculate the common denominator of s and -1 - 2 - (-546)/(-308). 88 Let o be (-18)/(-8) + 1/(-4). Suppose -5p - o = -32. Let z(g) = -g + 27. Calculate the least common multiple of z(17) and p. 30 Suppose -2r + 2 = 2f + 4, -f - 5r = 13. Suppose 0 = fd, -3x + 2d = 4d - 33. What is the least common multiple of x and 12? 132 Let l(r) = -12r - 6. Let c be l(-5). Let h be 234014/72 + 12/c. Let p = 3263 - h. Find the common denominator of 9/22 and p. 132 Let i = -62379/70 + 891. Calculate the common denominator of 61/14 and i. 70 Calculate the common denominator of 29/284 and (222/4)/(24/(-2) + -8). 2840 Find the common denominator of -53/86 and 7/2-1(-7)/5. 430 Let w = 109/6 - 211/12. Calculate the common denominator of w and 11/21. 84 Let j = 86867 - 8860505/102. What is the common denominator of 93/14 and j? 714 Let p(t) = -2t + 12. Let a(h) = -h3 + 11h*2 - 11h + 14. Let j be a(10). What is the lowest common multiple of 20 and p(j)? 20 Calculate the common denominator of 131/170 and ((-684)/(-204))/(8 - 12). 340 Let s(x) = -4x3 + 6x*2 - x - 14. Let w be s(-12). Let n be 4351627/(-560) + (-2)/(-10). Let l = w + n. What is the common denominator of l and -61/6? 48 Let n = -614 + 648. Calculate the least common multiple of n and 30. 510 Let b(p) = 32p - 62. Let n = 8 + -5. What is the lowest common multiple of b(2) and n? 6 Suppose -p - 3 = 0, 1 = 4r + 3p - 6p. Let h(c) = -c3 + c2 + 3c + 2. Suppose 46v + 30 = 49v. What is the lowest common multiple of v and h(r)? 40 Let n = 75 - 51. Let u = -16 + n. Suppose 69t - 66t = 18. Calculate the least common multiple of u and t. 24 Let j = -6141921/80 + 76775. Calculate the common denominator of 17/90 and j. 720 Suppose 134x - 138x + 36 = 0. Let v(j) = j*2 + 3j + 1. What is the smallest common multiple of x and v(-4)? 45 Find the common denominator of 29/4 and ((-195)/20)/(10/(140/(-1221))). 1628 Suppose -x + 2x = 3. Suppose 0 = xp + 14 + 100. Let r = -24 - p. What is the least common multiple of 16 and r? 112 Let d = 154084829671/36387313628 + 6/23385163. Let t = -6/389 - d. Let o = 1420 + -17009/12. Calculate the common denominator of t and o. 12 Find the common denominator of (12 - 2893/242)/((-6)/(-152)) and 145/246. 2706 Let c = 146957/88 - 1669. Find the common denominator of 33/16 and c. 176 Let x(q) = -q*3 - 3q*2 + 7q + 4. What is the smallest common multiple of -311/((-33)/8) and x(-5)? 152 Let z be 112/24(-363)/8. Let n = z - -210. Let b = -7/4 + n. What is the common denominator of 21/40 and b? 40 What is the common denominator of 1/(-10)2 - 5436/120 and 49/8? 8 Let f = -2619/4 - -673. Let z = -4/415 - 40247/830. Calculate the common denominator of f and z. 4 Let w = 82 + -973. Let n = w - -1723/2. What is the common denominator of n and 43/9? 18 Suppose j - 5 = -w, 0 = -5j + 2j. Suppose 43 - 13 = 3v. Calculate the lowest common multiple of v and w. 10 Find the common denominator of -31/30 and 10030/816 - 7/1. 120 Suppose -6u + 3t - 81 = -u, u + 2t + 11 = 0. Find the common denominator of 25/33 and (4 + (-41)/9)16/u. 297 Let c = 3 - -7. Suppose 43 = -d + 116. Let x = d - 65. Calculate the lowest common multiple of c and x. 40 Suppose -180 = -72h + 27h. Calculate the lowest common multiple of 96 and h. 96 Let v = 12205/12 + -1016. Find the common denominator of 65/132 and v. 132 Let d be (2/6)/((-6)/(-108)). What is the least common multiple of 12 and d/18 + 46/6? 24 Let g(o) = 6o2 + o. Let x = -11 - -6. Calculate the smallest common multiple of x(0 - 12/10) and g(-2). 66 Let j = -551388 - -54588317/99. Let z = 92/11 - j. Calculate the common denominator of (-190)/32(8 - 10) and z. 72 Let i = -15 - -5. Let l = i + 21. What is the least common multiple of 13 and l? 143 Let t = -38 - -1049/24. What is the common denominator of t and -25/12? 24 Calculate the smallest common multiple of 350 and -6(-280)/14412/10. 350 Find the common denominator of 5 + (-5536)/336 + 15 and ((-7)/(-75))/(4/(-130)). 210 Let r = 12 - 2. Let t = -66 + 119. Let o = t - 33. Calculate the lowest common multiple of r and o. 20 Let c = -2783 - -2801. What is the least common multiple of c and 66? 198 Let t = 20 - 11. Suppose 0 = 2b - 4, r + 4b = 5 + 6. What is the lowest common multiple of r and t? 9 Let d be 236/(-6)(-87)/26. Let f = 116829/884 - d. Let i = f - 2939/340. Calculate the common denominator of -47/5 and i. 10 Let z = -1026137/28600 + 4731/143. Let k = z - 21/200. Calculate the common denominator of 36/8 - (0 + -1) and k. 10 Let z(b) = -3b - 13. Let p be z(-6). Suppose q - 8 - 9 = -n, q = -p. What is the smallest common multiple of 2 and n? 22 Let n be 1843708/(-22)(1 - 14/12). Let j = n - 13970. Calculate the common denominator of 61/3 and j. 33 Suppose 3g + 2t + 26 = 3, -4g - 28 = 2t. Let d = -10 - g. What is the least common multiple of 5 and (40/25)/((-2)/d)? 20 Suppose 3 = -u + p + 13, -85 = -4u - 5p. What is the lowest common multiple of 24 and u? 120 Let t(b) = 2b2 + b - 2. Suppose i - 1 - 1 = 0. Calculate the lowest common multiple of -2 + (-84)/(-18) + (-4)/6 and t(i). 8 Let s be (3/9)/(2/6)2. Let u be 63 + -2 + (-4 - -3). Suppose -v = sv - u. Calculate the smallest common multiple of v and 16. 80 Calculate the common denominator of (8/54)/((-150)/(-261)) and 43/30. 450 Let f(q) = 7q*2 - 7q + 14. Suppose 3r = 4u - 2 - 2, 2u - 2r = 0. Calculate the smallest common multiple of 8 and f(u). 392 Suppose -26o = -28o - 22116. Let h = o + 177013/16. What is the common denominator of h and 51/2? 16 Let p(j) = -2j - 7. Let w(h) = 14h - 9. Let z be w(-3). Let r = 56 + z. What is the least common multiple of p(-5) and r? 15 Let q be ((-16)/20)/((-4)/10). Suppose -3s + 2f = -s - 40, 0 = qs + 2f - 40. Calculate the least common multiple of 14 and s. 140 Let l = -196/79 + 37203/316. Let h = l + -9613/84. Find the common denominator of h and -76/15. 105 Let t = 37 - 21. Suppose -t = 3i + 20. What is the common denominator of (-2)/i(-339)/9 and 1/14? 126 Let l = 369 - 245. Let p = 132 - l. Let i = 7 - 4. Calculate the least common multiple of i and p. 24 What is the smallest common multiple of 10 and 3(-10)/105 - (-3009)/119? 50 Suppose 25 = -5z, -4q + 5z - z + 396 = 0. Let y = q + -73. Calculate the lowest common multiple of 18 and y. 126 Suppose 16 = -3s + 52. Let m = -14 + s. Find the common denominator of -91/8 and 342/44m/6. 88 Let m(w) = -127*w + 336. Calculate the least common multiple of 33 and m(	{ "pile_set_name": "DM Mathematics" }
y: 3, v: 12}. Give prob of picking 4 v. 11/68 Two letters picked without replacement from pgp. Give prob of picking 2 p. 1/3 Two letters picked without replacement from {n: 3, u: 1, t: 1, d: 2, k: 2, f: 3}. Give prob of picking 2 k. 1/66 What is prob of picking 2 h and 2 q when four letters picked without replacement from {o: 5, q: 3, i: 4, h: 4}? 9/910 Three letters picked without replacement from {l: 1, i: 3, m: 3, u: 3, g: 2, a: 2}. Give prob of picking 1 u, 1 m, and 1 g. 9/182 Calculate prob of picking 1 y and 1 a when two letters picked without replacement from {a: 3, x: 1, y: 1, j: 2, k: 3}. 1/15 Calculate prob of picking 2 s and 1 n when three letters picked without replacement from snss. 3/4 Calculate prob of picking 1 s and 2 v when three letters picked without replacement from {v: 4, l: 3, s: 4}. 8/55 Two letters picked without replacement from zzzzzzzzizzzzzzzzz. Give prob of picking 1 i and 1 z. 1/9 What is prob of picking 1 g and 1 o when two letters picked without replacement from {g: 10, l: 1, u: 1, e: 1, o: 1}? 10/91 Calculate prob of picking 2 i and 1 d when three letters picked without replacement from iddiidiididdddid. 27/80 What is prob of picking 1 f and 3 r when four letters picked without replacement from {f: 6, t: 1, c: 2, l: 1, r: 3}? 6/715 Calculate prob of picking 1 q and 2 d when three letters picked without replacement from hhhhhdqwqhhhqhwhdhq. 4/969 What is prob of picking 4 r when four letters picked without replacement from {w: 5, r: 5}? 1/42 Two letters picked without replacement from {r: 7, p: 2}. What is prob of picking 1 r and 1 p? 7/18 Four letters picked without replacement from xxxxx. What is prob of picking 4 x? 1 Four letters picked without replacement from ppzspppppszpppwpzzp. What is prob of picking 2 s and 2 p? 11/646 Three letters picked without replacement from kkkeekeeee. Give prob of picking 3 k. 1/30 Four letters picked without replacement from hxxllcjgxgxgxlxlgxxh. Give prob of picking 1 l, 1 h, 1 c, and 1 j. 8/4845 Two letters picked without replacement from {q: 4, d: 3, b: 6, s: 2}. Give prob of picking 1 d and 1 s. 2/35 Three letters picked without replacement from {p: 6, v: 2}. What is prob of picking 3 p? 5/14 Two letters picked without replacement from {q: 4, x: 1, p: 3, j: 2, w: 4}. What is prob of picking 2 p? 3/91 Four letters picked without replacement from {x: 1, i: 1, l: 1, q: 2, a: 2, u: 1}. What is prob of picking 1 i, 1 x, and 2 u? 0 Three letters picked without replacement from {s: 1, j: 4, m: 7, t: 3, g: 1}. What is prob of picking 1 t, 1 m, and 1 j? 3/20 Calculate prob of picking 3 o and 1 v when four letters picked without replacement from {v: 3, o: 8}. 28/55 Calculate prob of picking 1 p, 2 w, and 1 u when four letters picked without replacement from ppwwpuwwrwwr. 1/11 Two letters picked without replacement from {c: 9, n: 1, k: 1}. What is prob of picking 1 k and 1 c? 9/55 Four letters picked without replacement from {b: 9, s: 2}. Give prob of picking 1 s and 3 b. 28/55 Calculate prob of picking 3 z and 1 q when four letters picked without replacement from {q: 4, z: 3}. 4/35 What is prob of picking 1 w and 1 b when two letters picked without replacement from {c: 1, l: 1, r: 9, w: 7, b: 2}? 7/95 Two letters picked without replacement from hfiik. Give prob of picking 1 k and 1 i. 1/5 Four letters picked without replacement from {u: 9, a: 3, k: 4, m: 2, d: 1}. Give prob of picking 1 d, 2 k, and 1 a. 3/646 Three letters picked without replacement from sbefaybeesff. What is prob of picking 1 f, 1 s, and 1 b? 3/55 Calculate prob of picking 3 t when three letters picked without replacement from {t: 4, h: 2, i: 3, s: 1}. 1/30 Four letters picked without replacement from jojsojjjssjvvc. Give prob of picking 4 j. 15/1001 Two letters picked without replacement from lllllllljllll. Give prob of picking 1 l and 1 j. 2/13 Two letters picked without replacement from yyqaa. Give prob of picking 1 y and 1 a. 2/5 What is prob of picking 2 w, 1 s, and 1 b when four letters picked without replacement from cswpbbwbccpcwbbc? 3/364 Calculate prob of picking 1 r and 1 o when two letters picked without replacement from zrrrooorozooozoozlo. 40/171 Calculate prob of picking 2 a and 1 u when three letters picked without replacement from ahuuauhhuaaaahu. 15/91 What is prob of picking 1 g and 2 h when three letters picked without replacement from ahagaqagwawhqwgahga? 4/323 Two letters picked without replacement from {t: 2, j: 1, g: 2, s: 1, p: 1, n: 1}. Give prob of picking 1 j and 1 s. 1/28 Calculate prob of picking 2 d when two letters picked without replacement from odoooodooooo. 1/66 Four letters picked without replacement from tteet. Give prob of picking 2 t and 2 e. 3/5 Two letters picked without replacement from {f: 1, b: 2, d: 1, r: 1}. Give prob of picking 1 b and 1 f. 1/5 What is prob of picking 4 n when four letters picked without replacement from nnnf? 0 Two letters picked without replacement from {v: 2, m: 5, i: 2, y: 11}. Give prob of picking 2 v. 1/190 Four letters picked without replacement from {l: 3, i: 4, h: 1}. Give prob of picking 1 h, 2 i, and 1 l. 9/35 Calculate prob of picking 1 a and 2 c when three letters picked without replacement from ckeekaceeccdkxdckek. 10/969 Three letters picked without replacement from {k: 5, y: 9}. Give prob of picking 3 y. 3/13 Four letters picked without replacement from fkmwkfwpwbpbpw. What is prob of picking 1 b, 1 m, and 2 w? 12/1001 Three letters picked without replacement from {v: 2, e: 1}. What is prob of picking 3 v? 0 Calculate prob of picking 1 n and 1 d when two letters picked without replacement from bnmmd. 1/10 Two letters picked without replacement from {i: 1, x: 2, l: 3, n: 3, w: 2, s: 1}. Give prob of picking 2 x. 1/66 Calculate prob of picking 4 d when four letters picked without replacement from rbdd. 0 Two letters picked without replacement from {d: 3, a: 2}. What is prob of picking 2 a? 1/10 What is prob of picking 1 b and 1 f when two letters picked without replacement from {b: 2, f: 5, z: 4, a: 2, j: 4}? 5/68 Calculate prob of picking 4 o when four letters picked without replacement from {y: 2, w: 3, h: 3, o: 11}. 55/646 Calculate prob of picking 1 c and 1 q when two letters picked without replacement from ddchhhhmcqmd. 1/33 What is prob of picking 1 r and 1 e when two letters picked without replacement from exhxezherhxzgg? 3/91 Calculate prob of picking 2 g when two letters picked without replacement from ccccccgg. 1/28 Four letters picked without replacement from {h: 1, x: 6, c: 4}. Give prob of picking 2 x and 2 c. 3/11 Four letters picked without replacement from {g: 1, x: 1, u: 2, r: 1, w: 2, n: 11}. Give prob of picking 1 n, 1 x, 1 u, and 1 g. 11/1530 Three letters picked without replacement from {k: 3, c: 1, r: 1, t: 3, b: 2, h: 1}. What is prob of picking 1 h, 1 k, and 1 t? 3/55 What is prob of picking 1 s, 1 n, and 1 k when three letters picked without replacement from agnsgagssaakah? 3/364 Two letters picked without replacement from {y: 1, t: 4, z: 2, j: 2}. Give prob of picking 1 t and 1 z. 2/9 What is prob of picking 2 f when two letters picked without replacement from tieeetcefedfedeeed? 1/153 What is prob of picking 3 w and 1 a when four letters picked without replacement from {w: 10, a: 2}? 16/33 What is prob of picking 1 b and 1 x when two letters picked without replacement from {x: 4, e: 6, w: 1, b: 2}? 4/39 What is prob of picking 2 b when two letters picked without replacement from {b: 3, c: 13}? 1/40 Four letters picked without replacement from jeojxjo. Give prob of picking 1 j, 1 x, 1 e, and 1 o. 6/35 Two letters picked without replacement from jwjww. What is prob of picking 2 j? 1/10 What is prob of picking 1 y and 1 k when two letters picked without replacement from {k: 1, l: 2, i: 2, x: 2, y: 1}? 1/28 Three letters picked without replacement from {r: 6, h: 7, t: 4, y: 1, z: 2}. What is prob of picking 3 t? 1/285 Two letters picked without replacement from dvvveyxxxeeedxyebexd. What is prob of picking 1 d and 1 x? 3/38 Two letters picked without replacement from {w: 1, u: 1, n: 2, z: 1, b: 1, l: 1}. What is prob of picking 1 n and 1 l? 2/21 Four letters picked without replacement from ibbbbbi. What is pr	{ "pile_set_name": "DM Mathematics" }
) = 2o2. Let d(q) = 623q*2 - 2608q + 2. Calculate d(z(n)). 2492n4 - 5216n*2 + 2 Let q be (4 - 117) + 2 + 5. Let f = q + 142. Let o(c) = -20c + fc - 15c. Let v(j) = 32j2. What is v(o(b))? 32b*2 Let h(j) = -1398j + 21. Let w(c) = 133c - 2. Let m(u) = 6h(u) + 63w(u). Let s(g) = 24g. What is m(s(x))? -216x Let n(d) = 455d2. Let r(b) be the second derivative of b4/12 - 10b2 - 178b. Let v(o) be the first derivative of r(o). What is v(n(l))? 910l2 Let g(v) = -v. Let m be 1 - (-2 - (5 - 5) - -3). Let q(j) = -44 + mj - 7j + 2j + 6j + j. Determine g(q(o)). -2o + 44 Let d(j) = 14117j + 481. Let v(m) = -m. Give d(v(s)). -14117s + 481 Let p(u) = -2191043u. Let y(f) = f2. Calculate p(y(s)). -2191043s*2 Suppose -3p - 9 = 3, 3p - 220 = -4s. Let i = s - 56. Let m(o) = -15o2 + 4o*2 + 13o*i. Let z(y) = -10y*2. Determine z(m(g)). -40g*4 Let n(u) = 3u + 1. Let k(y) be the third derivative of -13y5/20 + 2y*2 + 22y - 11. Determine k(n(o)). -351o2 - 234o - 39 Let z(w) be the first derivative of w*5/120 + 2w*3/3 - 4w - 14. Let g(m) be the third derivative of z(m). Let y(u) = -185u2. Give g(y(q)). -185q*2 Let w(q) = -3q. Let z(t) = 17 + 13 + 17t + 2t - 30. Let a(j) = 6w(j) + z(j). Let o(p) = 26p. Give o(a(d)). 26d Let u(a) = -259a*2 - 9392a. Let k(i) = -2i. Determine u(k(x)). -1036x*2 + 18784x Let t(j) = -73j. Let d(i) = 39i*2 + 2i - 232. Calculate t(d(c)). -2847c2 - 146c + 16936 Let u(s) = s*3 + 8s*2 - 26s - 51. Let t be u(-9). Let a(p) = 279p - tp - 98p - 107p. Let b(j) = 3j - 5j + 4j. Give a(b(k)). -56k Let f(p) = -2p. Let a(h) = -88623h - 8015. Let n(i) = -221i - 20. Let k(d) = -4a(d) + 1603n(d). What is k(f(q))? -458q Let a(y) = 47y + 3854. Let p(u) = -28u. Give p(a(m)). -1316m - 107912 Let r(q) be the second derivative of -29q*4/12 + q + 1. Let i(b) = -92b. Calculate r(i(g)). -245456g2 Let o(d) = 3d - 1. Suppose 25l = 20l + 4z - 76, l - z = -16. Let f(a) = 13a - 4. Let x(p) = lo(p) + 3f(p). Let m(y) = -8y + 11y + 7y. Give m(x(n)). 30n Let d(n) be the first derivative of -734n3/3 - 5980. Let p(j) = 2j. What is p(d(z))? -1468z2 Let m(p) = -23p*2 + 3448. Let i(l) = -132l. Calculate i(m(r)). 3036r2 - 455136 Let g(k) = 1331k. Let y(z) = 597625z. Give g(y(v)). 795438875v Let t(h) = -38 + 11 + 36 - 3h - 9. Let l(j) = -12j - 20. Calculate t(l(s)). 36s + 60 Let t(u) = -3u + 12. Let b(a) = 2a - 10. Let r(k) = -6b(k) - 5t(k). Let v(o) be the first derivative of -5o*3/3 - 2. Calculate r(v(n)). -15n*2 Let k(x) = 159x*2 - 135x - 428. Let p(i) = -2i. What is p(k(u))? -318u*2 + 270u + 856 Let a(m) = -32m - 1. Let k(c) = -20c. Let d(u) = 3a(u) - 5k(u). Let f(r) = -2r2 - 11. Calculate d(f(s)). -8s*2 - 47 Let l(y) = 10y. Suppose -281 = 12x - 869. Let s(c) = -28c*2 + xc*2 - 24c*2. Calculate l(s(d)). -30d*2 Let c(t) = -21525t + 160. Let a(u) = 23160900u - 172200. Let b(q) = 4a(q) + 4305c(q). Let w(h) = h. Give b(w(v)). -21525v Let m(o) = 35o. Let y(w) = 14 - 28 + 13 + 30w - 20w - 20w. Calculate m(y(s)). -350s - 35 Let j(s) = -s2. Let p(a) be the first derivative of -703a*2/2 + 1088. Give p(j(m)). 703m*2 Let i(v) = -2v. Let a(q) = -13q2 + 2273q + 4. What is i(a(l))? 26l2 - 4546l - 8 Let h(g) = -5g + 2g + 2g. Let t(a) = -12908 + 4326 + 4310 + a + 4332. What is t(h(f))? -f + 60 Let l(u) be the third derivative of u4/24 + u2 + 2u - 16. Let k(t) be the first derivative of -11t3 + t - 1. Give k(l(m)). -33m2 + 1 Let r(g) = g2. Let j(q) = 1195q2 - 171027q + 2. Calculate j(r(p)). 1195p4 - 171027p*2 + 2 Let q(u) = 9u*2 - 7u. Let j(o) = -98220o. Give q(j(x)). 86824515600x*2 + 687540x Let u(v) = -63570041v. Let z(d) = 2d. Determine z(u(w)). -127140082w Let v(s) = 6394s*2 - s + 3422. Let z(c) = -2c. Calculate z(v(n)). -12788n2 + 2n - 6844 Let h(b) = 2b2. Let x(p) = -25p*2 - 40p - 105. Let d(l) = 3l2 + 162l + 8 - l*2 - 79l - 80l. Let w(j) = 40d(j) + 3x(j). Determine h(w(u)). 50u*4 + 100u2 + 50 Let y(a) be the second derivative of a5/120 - a*3/6 + 8a*2 + 3a - 35. Let v(d) be the second derivative of y(d). Let n(l) = -262l - 2. What is n(v(g))? -262g - 2 Let x(f) = 1848f. Let q(y) be the first derivative of y2 + 1899. Give q(x(t)). 3696t Let f(z) = 31z2 - 5z + 20. Let r(d) = 6d2 - d + 4. Let y(u) = f(u) - 5r(u). Let a(l) = l + 146. What is y(a(o))? o*2 + 292o + 21316 Let o(j) be the third derivative of -j*5/60 + 8j*2 - 464j. Suppose 0 = 5a - 4w - 35, -2a - 2w = -0w + 4. Let f(g) = g + 3 - a. Calculate o(f(z)). -z2 Let u(v) be the first derivative of 2v*3/3 - 16310. Let o(f) be the third derivative of -49f4/24 - f2. Give o(u(g)). -98g2 Let n(k) = 239k. Let p = -58 - -60. Let z(y) = y*2 - 12y*2 + 9y*p. Give z(n(g)). -114242g*2 Suppose h = 24 + 1. Let f(q) = 18 + 2q - 43 + h. Let c(z) = -9z2 + 3z. Give f(c(a)). -18a2 + 6a Let n(w) = 2w2. Let g(a) be the second derivative of -11/2a*2 + 1/6a*3 + 0 - 4a. Let o(p) = -2p + 24. Let m(l) = 5g(l) + 2o(l). Calculate m(n(y)). 2y2 - 7 Let o(g) = -g + 1. Let v be o(-1). Let x(b) = 520 - 520 - bv + 5b2. Let j(d) = -3d. Give j(x(s)). -12s2 Let k(i) = 9i*2 + 9i + 5423. Let m(f) = -22f2. What is k(m(o))? 4356o*4 - 198o*2 + 5423 Let h(c) = c - 249. Let t(l) = 2l - 581. Let m(u) = -7h(u) + 3t(u). Let v(j) = 592j - 3. Determine v(m(y)). -592y - 3 Let d = -131 - -138. Let q(p) = -dp + 3p*2 - 20 - 3p + 29 + 10p. Let j(g) = -3g*2. Calculate j(q(s)). -27s*4 - 162s*2 - 243 Let u(a) = 59a + 2. Let s(k) = -3k - 255915k*2 + 3k + 255912k2. What is s(u(t))? -10443t*2 - 708t - 12 Let y(s) = s2 - 1. Let z(m) = m2 + 14m + 22. Let g be z(-2). Let j(x) = -7x*2 + 2. Let k(l) = gy(l) - j(l). Let c(d) = 31d. Calculate k(c(f)). 4805f2 Let n(t) = t2 + 40t. Let p(s) = -19s + 2025. Calculate n(p(a)). 361a2 - 77710a + 4181625 Let p(g) = -159g. Let t(z) = -27z*2 + 306z + 13. Determine p(t(s)). 4293s2 - 48654s - 2067 Let r(x) = 445x. Let i(g) = -4g + 39. Let q(o) = -o + 13. Let h(m) = 2i(m) - 6q(m). Determine r(h(l)). -890l Let u(n) = -2322n. Let q(a) = -45557a. Give u(q(p)). 105783354p Let c(o) = 0o - 967692 + 0o + 967689 + 16o2. Let a(b) = 36b*2. Determine a(c(v)). 9216v*4 - 3456v*2 + 324 Let u(j) be the first derivative of 13j*3 + 3j + 12246. Let f(z) = -z*2. Give f(u(c)). -1521c*4 - 234c*2 - 9 Let t(d) = -18 - 2362d + 2362d + 16 + 138d2. Let k(i) = i2. Let w(v) = v*2. Let m(o) = 6k(o) - 5w(o). Determine m(t(l)). 19044l*4 - 552l*2 + 4 Let c(p) = -160p + 10. Let a(n) = -162n + 15. Let l(x) = 2a(x) - 3c(x). Let m(v) = -15v*2. What is m(l(r))? -365040r*2 Let g = 400 - 398. Let f(v) = 3v*2 - 16v*g + 6v*2. Let u(o) = 4o*2 + 3o2 - o2. Calculate u(f(s)). 294s4 Let a(j) = 705551j - 1. Let y(t) = -2t. Calculate y(a(z)). -1411102z + 2 Let h(a) be the second derivative of -3a4/4 + 11a*3/6 - 13a + 33. Let x(k) = 7k. Calculate h(x(o)). -441o*2 + 77o Let j(w) be the second derivative of -3w3/2 + 2w - 440. Let y(t) = -2t2 - 47t. Calculate j(y(d)). 18d2 + 423d Let v(h) = 12789541h2. Let z(p) = 38p*2. Calculate z(v(n)). 6215749641645878n4 Let h(z) be the second derivative of -z4/12 - 3z. Let j(m) be the second derivative of -8m - 2 - 2/3m3 - 3/2m*2. What is j(h(r))? 4r*2 - 3 Let j(s) = 11761 - 2s - 11761. Let t be 24 + (-4)/(-12)9. Let k(l) = -11l - 12l - 6 + tl. Calculate k(j(g)). -8g - 6 Let w(s) = 42s. Let h be 1(40 - 5)/7. Let x(z) = -19 - hz*2 + 9 + 4z*2 + 10. Calculate w(x(p)). -42p*2 Let r(n) = 2n. Let z(k) = -1. Let s(j) = j - 22. Let c(w) = 4s(w) - 84z(w). Calculate c(r(b)). 8b - 4 Let k(a) = 78865a. Let g(c) = -409c. Determine k(g(f)). -32255785f Let g(h) = -h*2 - 32. Let o(m) be the second derivative of 0m*2 - 1/2m*3 + 11m + 0. Calculate o(g(z)). 3z2 + 96 Let f(r) = -12r + 33. Let v(k) = 57k - 154. Let h(p) = -14f(p) - 3v(p). Let s(y) = 10y. Let g(d) = -5d. Let t(o) = 9g(o) + 4s(o). Calculate t(h(u)). 15u Let a(i) = -2*i + 43.	{ "pile_set_name": "DM Mathematics" }
r(b) be the third derivative of b7/1680 - b6/360 + b5/240 - b3/6 - 2b2. Let u(d) be the first derivative of r(d). Solve u(p) = 0 for p. 0, 1 Find b such that 0b - 1/3b2 + 0 = 0. 0 What is u in -3/8u*2 + 1/8u*3 - 1/8 + 3/8u = 0? 1 Factor -7c - 16 - 3c2 - c2 + 9c + 18c. -4(c - 4)(c - 1) Let m(u) = -2u2 - 2u - 8. Let a(n) = n - 1. Let j(t) = -4a(t) + m(t). Factor j(c). -2(c + 1)(c + 2) Let y = 7/22 - -9/110. Factor -yx*3 - 2/5x*4 + 0 + 2/5x*5 + 2/5x*2 + 0x. 2x2(x - 1)*2(x + 1)/5 Factor -6/7z3 + 0 + 0z + 6/7z2. -6z*2(z - 1)/7 Let -4/7v3 + 0 - 16/7v + 16/7v2 = 0. What is v? 0, 2 Suppose -6y = -3y - 9. Find b, given that -3b*2 - y + 3 - 9b - 6 = 0. -2, -1 Let m(a) = -a*3 - 23a*2 - 42a + 2. Let n be m(-21). Let r(o) be the third derivative of 1/30o5 - no*2 + 0 + 1/3o*3 + 0o + 1/6o4. Factor r(u). 2(u + 1)*2 Let t(x) = x + 13. Let o be t(-11). Let w(b) be the first derivative of -4/3b*3 + 4/5b*5 - 1/2b*4 + 0b + b*o - 2. What is q in w(q) = 0? -1, 0, 1/2, 1 Let q = 1015/3 + -333. Let o(a) be the first derivative of 19/2a*4 + qa*3 + 4 + 0a - 4a2 + 14/5a*5. Determine c, given that o(c) = 0. -2, -1, 0, 2/7 Let a(z) be the first derivative of -1/3z*3 + 3/10z*5 + 1/4z*4 + 1/12z*6 - 1/2z - 3/4z2 - 2. Factor a(p). (p - 1)(p + 1)4/2 Let n(z) be the second derivative of z3/6 - z*2/2 + 2z. Let o be n(5). Factor -8j + 0j*2 - 3j2 - j3 - o - 2j2. -(j + 1)(j + 2)*2 Let a(h) = 3h*3 - 10h*2 - 21h - 3. Let i(r) = 2r3 - 10r*2 - 20r - 4. Let z(n) = -4a(n) + 5i(n). Solve z(w) = 0. -2, -1 Let c(z) be the first derivative of -3z5/10 + 3z*4/2 + 5z*3/2 + 30. What is r in c(r) = 0? -1, 0, 5 Let f(z) = 5z*3 - 3z*2 - 2z. Let s(i) = i2 + i - i2 + i*2 - 2i*3. Let c(u) = 3f(u) + 7s(u). Solve c(t) = 0 for t. 0, 1 Factor 0 + 2f4 + f2 + 5/2f3 + 0f + 1/2f5. f2(f + 1)*2(f + 2)/2 Factor 8 - 3r - 2r*2 + 4 + 0r + r. -2(r - 2)(r + 3) Suppose 0t + 8 = 4t. Suppose tk = -3k + 10. Factor -kx4 + 4x*5 + 0x*3 + 4x5 - x3. x*3(2x - 1)(4x + 1) Let r(g) = -g2 - 11g - 4. Let o be r(-7). Suppose 5l - l = 4u + 4, u - o = -4l. Factor -v2 - vl + 0v*5 + 4v4 + v3 - 3v4. -v2(v - 1)*2(v + 1) Let q(k) = -k*3. Let a(p) = -18p*4 - 11p*3 + 10p*2 - 2p. Let j = -4 - -9. Let m(d) = jq(d) - a(d). Factor m(l). 2l(l + 1)(3l - 1)2 Let l(p) = p2 + 5p. Let o = 9 + -3. Let d = 27 + -10. Let s(x) = -3x2 - 14x. Let k(n) = dl(n) + os(n). Factor k(q). -q(q - 1) Let q(l) be the second derivative of l5/5 + l4/3 - 2l*3/3 - 2l*2 + 12l. Factor q(s). 4(s - 1)(s + 1)*2 Let h(l) = -3l*3 + 8l*2 - 8l. Let o(b) = 2b3 - 5b*2 + 5b. Let q(f) = -5h(f) - 7o(f). Let z be q(4). Factor 2m2 - m2 - zm*2 + 4m2. m2 Suppose -29u + 15 = -24u. Let z(g) be the first derivative of 1/2g4 + g2 + 4/3g*u + 0g + 1. Factor z(b). 2b(b + 1)*2 Suppose 2p + 10 = b - 0p, -2b - 2p + 2 = 0. Let q be 4/(-6) + b/6. Factor 2/3j*2 + q - 2/3j*3 + 0j. -2j2(j - 1)/3 Let q be 4(3 - (-13)/(-2)). Let c = 16 + q. Find o such that -2/3o + 1/3 + 1/3oc = 0. 1 Let u(y) be the third derivative of -y7/63 + 11y*6/90 - 11y*5/30 + 5y*4/9 - 4y*3/9 + 3y2. Solve u(o) = 0 for o. 2/5, 1, 2 Let j(x) be the second derivative of x4/12 - x3/6 + x2/8 - 18x. Factor j(v). (2v - 1)*2/4 Let t = 38 - 189/5. Factor -1/5d*3 + 1/5d - 1/5d4 + td*2 + 0. -d(d - 1)(d + 1)2/5 Factor 4/5v*4 + 0v*3 + 0 - 4/5v*2 + 0v. 4v2(v - 1)(v + 1)/5 Let v = 6 - 7. Let w be 26/8 - 0/v. Let -62u*4 - 151/4u*3 + wu - u*2 - 28u5 + 1/2 = 0. Calculate u. -1, -1/4, 2/7 Let r(g) be the third derivative of -g5/60 - g4/8 - g3/3 + 22g2. Solve r(l) = 0. -2, -1 Factor -29 + 3h*2 - 32h + 93 + h*2. 4(h - 4)*2 Determine o, given that 4 + 7o*2 - 12o - 8o3 - 4o + 13o2 = 0. 1/2, 1 Let m(t) be the second derivative of 0 + t + 1/80t*5 - 1/24t*3 + 0t*2 - 1/48t*4 + 1/120t*6. Factor m(z). z(z - 1)(z + 1)2/4 Let h(y) be the third derivative of -y8/112 + y7/70 + 3y6/40 - y5/4 + y*4/4 - 10y2. Suppose h(z) = 0. Calculate z. -2, 0, 1 Let c(b) be the first derivative of -b7/2940 - b6/420 - b5/210 + b*3/3 - 3. Let z(a) be the third derivative of c(a). Determine i so that z(i) = 0. -2, -1, 0 Let j be (-32)/(-20)(-2)/(-8). Suppose 4 = 3l - 2. Solve 0u - 4/5u3 - 2/5u*4 + 0 - ju*l = 0. -1, 0 Factor 0 + 2/5j - 16/15j2 + 4/5j*3 + 0j*4 - 2/15j*5. -2j(j - 1)3(j + 3)/15 Factor -7z4 + 6z*3 + 11z*4 - 3z*4 + 9z2. z2(z + 3)2 Let o(t) = -2t*2 - 3. Let h(n) = -14n*2 - 22. Let v(f) = -6h(f) + 44o(f). Let v(p) = 0. Calculate p. 0 Let c(x) = -5x*3 - 20x*2 - 20x. Let o(m) = -5m3 - 20m*2 - 20m. Let q(w) = 6c(w) - 5o(w). Solve q(l) = 0 for l. -2, 0 Suppose -10 = -7z + 9z. Let c be z/15 + (-2)/(-3). Find q, given that 1/3q3 + 2/3q*2 + 0q - cq4 + 0 = 0. -1, 0, 2 Factor -64n*5 - 2 + 9 + 432n*4 - 85n - 876n3 - 29n + 2 + 505n2. -(n - 3)2(4n - 1)3 Suppose -5p + 33 - 33 - p*2 = 0. Calculate p. -5, 0 Let t(b) = 4b*5 - 6b*3 + 2b*2 + 4b. Let n(z) = -9z5 + 13z*3 - 5z*2 - 9z. Let p(w) = -2n(w) - 5t(w). Let p(l) = 0. What is l? -1, 0, 1 Let b be ((-3)/(-54)-16)/((-4)/6). Factor b - 2g*3 - 4g + 1/3g4 + 13/3g2. (g - 2)2(g - 1)2/3 Suppose -2k - k = -15. Suppose 5q + 4 = -3j, kj = -4q - q. Factor js2 + 0 - 1 - 4s*4 + 3s4. -(s - 1)2(s + 1)2 Let a(o) = -o - 1. Let w(l) = -5l*4 + 25l*3 - 45l*2 + 37l - 8. Let q(t) = 2a(t) + w(t). Factor q(z). -5(z - 2)(z - 1)3 Find p, given that 4p*4 + 7p*3 + 0p*4 + 3p - 14p2 + 0p*3 = 0. -3, 0, 1/4, 1 Let y be 4 - 62/4. Let t = 3 - y. Factor -2/3qt - 8/3 - 8/3q. -2(q + 2)2/3 Let j(c) be the second derivative of -c5/5 + c4/3 + 2c*3/3 - 2c*2 - 6c. Factor j(m). -4(m - 1)2(m + 1) Determine c so that 15c - 3 - 15/4c*2 - 15c*3 + 27/4c*4 = 0. -1, 2/9, 1, 2 Let a be 10 - 2/(-4)-2. Let w = -4 + a. Factor 6lw - 2l*3 - l - 5l*5 + 2l. l(l - 1)2(l + 1)*2 Suppose -3b - 12 = -6b. Let c = 22 - 19. Solve 1/2o*c + 0o + 1/4o2 + 1/4o*b + 0 = 0. -1, 0 Let a(w) = 11w - 2. Let l(s) = -5s + 1. Let i(k) = 4a(k) + 9l(k). Let o(q) = q2 + q - 1. Let u(d) = 3i(d) + 6o(d). Factor u(t). 3(t + 1)(2t - 1) Let u(v) be the second derivative of -v4/16 - v3/4 + 9v2/8 - 16v. Factor u(i). -3(i - 1)(i + 3)/4 Let v(k) be the third derivative of k8/1848 - k7/385 + k6/220 - k5/330 - k2. Find j, given that v(j) = 0. 0, 1 Let a(h) = h3 - 5h2 - 8h. Let g(m) = -15m + 5m*3 - 3m3 - m2 - 8m2. Let w(q) = -11a(q) + 6g(q). What is j in w(j) = 0? -2, 0, 1 Suppose 2c = -3f + 4f + 7, -7 = -c - 3f. Let m(b) be the third derivative of 2b*2 + 0b + 0b3 + 1/210b*5 + 0 + 0b*c. Factor m(s). 2s*2/7 Let d(f) = 3f*2. Let o be d(1). Factor -10m*5 - 21m + 4 - 13m + 44m*4 + 64m*2 + 8m - 76mo. -2(m - 1)*4(5m - 2) Let b be 2/(-12) + (-122)/(-12). Let w be ((-4)/b)/(6/(-5)). Factor -1/3t*2 - 2/3t + wt3 + 0. t(t - 2)(t + 1)/3 Suppose 2f = -3n + 18, -2n + 23 = 2f + 3f. What is p in 3pf - p + 4 - 2p*3 - 2p*2 - 2 = 0? -1, 1, 2 Let k(b) be the third derivative of 1/40b*5 - 1/24b*4 + 0b*3 + 0b + 0 - 4b2 - 1/240b*6. Factor k(h). -h(h - 2)(h - 1)/2 Let z(k) = -2k - 4. Let d be z(-4). Factor 4c3 - 2c + 0c - 2c*3 - 1 + 0c*3 + dc*2 - 3c4. -(c - 1)2(c + 1)(3c + 1) Let x(w) be the second derivative of -w4/6 - w3/3 - 2w. Find c such that x(c) = 0. -1, 0 Let x(y) = y*2 + y + 1. Let i(d) = -8d*2 - 16d - 4. Let o(z) = i(z) + 4x(z). Suppose o(u) = 0. Calculate u. -3, 0 Let a(j) = -17j*3 + 7j*2 - 29j - 5. Let g(r) = -6r3 + 2r*2 - 10r - 2. Let d(h) = 4a(h) - 11g(h). Factor d(l). -2(l - 1)3 Let y(m) be the third derivative of m5/120 + 5m*4/48 + 12m*2. Factor y(v). v(v + 5)/2 Let c = -37 - -149/4. Let k be (-4)/1015/(-12). Solve -1/4 - kl - cl2 = 0 for l. -1 Suppose 27y*4 + 21y*5 - 80y*3 - 12y*4 + 12y*2 + 32y**3	{ "pile_set_name": "DM Mathematics" }
(-6/11))40(yy(-4))(3/20))(-1/28) assuming y is positive. y(4899/6160) Simplify (y3yy(y/((y/(y*(1/8)/y))/y))/yy)/((((y/y(-2/3))/y)/y)/y(4/7))(y1)(19/2)(y/(yy(-3/7)y))/y(-3) assuming y is positive. y(431/24) Simplify ((n(-1/4))(3/32)n(-2/7)((nn(1/2))/n)/nnn)/((nn*(-2/3)nnn(-4/5))/(n1)(-23)) assuming n is positive. n(-313723/13440) Simplify (((c*6(c/(((c*(2/7)/c)/c)/c))/c)/((ccc(-1/4)cc)/(c(c/(c/c*(-2/7))c)/c)))(-47))(1/5) assuming c is positive. c(-7473/140) Simplify ((p/(p(-3)p))/pp*26(p(-28)/p)/((p(-1)p)/pp))(-14/11) assuming p is positive. p(14/11) Simplify z*(-9)/zzz(2/13)(z40)22 assuming z is positive. z(11325/13) Simplify ((v(2/13)v)/v(-2))/((v/v1vv)/(v/v(4/5)))((v/(vv/(v(1/4)vv)vv)vvv)/v)*(-40)/(vv1)(-30/7) assuming v is positive. v(-18234/455) Simplify z(-2)zzz(-2)z*(-3)/(zz*1)(z(-2/3)/z)17z(1/3)/z5 assuming z is positive. z(-40) Simplify t2t*(-2/3)(t*(-2/11)t)/t*(3/8)((t*5/t)/(tt/(t*(1/5)t)))/(tt0)(-15/7) assuming t is positive. t(65783/9240) Simplify (((((q(-2/5)/q)/q)/q)/q)(-2/41)/((qqq(-2/9)qq)/q(2/9)))/((q(2/5))19/((q(1/6)q)/(q/(q/q(-3))))) assuming q is positive. q(-24997/3690) Simplify (r*5/((rr/r*(-2))/r)r*(-5)/r(r/(r*(-8)/rr))/r)/((r*(2/3)r*(-1)r)/((rr(-4)/rr)/r(-7))) assuming r is positive. r(22/3) Simplify (k(-41))(-42)/((k/(k/((k/((k*(-1/30)/k)/k))/k))k)/(((k*22k)/k)/k)) assuming k is positive. k*(52199/30) Simplify (((b(((b/b*(1/4)b)/b)/b)/b)/bbb(-1))/((b(-1)/bb)/b(-6)))/(b1(b/((b/(b*0bb)bb)/b)b)/b)(-48) assuming b is positive. b(359/4) Simplify ((r*(-1/10)r)*23r*(-4)r14)(2/31) assuming r is positive. r*(307/155) Simplify (((z(zz(1/5))/z)/z)/((z1/z)/z))35((zzzz(-1/4))(-36))(-2/113) assuming z is positive. z(4944/113) Simplify j(-1/10)(j*(2/5)/j)/j(j0)(-22/3)((jj*4)/(jj(-5)))(-1/17) assuming j is positive. j(-379/170) Simplify (k(4/7)/(kk/(kk*(-13)k)k))/(k(1/68)/k(-3)) assuming k is positive. k(-7827/476) Simplify (((ii(-1/8))/i)(-28))*(-1/12)/((iii(-2/9)i7)/(i2)(-50)) assuming i is positive. i(-7853/72) Simplify ((s(-2/7)/s)/s)(-2/31)s(2/3)/((s/(s6/ss))/s)(s(1/4))(-18)s*(2/15)s(-2) assuming s is positive. s(971/2170) Simplify ((aa(-5)a)*(1/3)(a0/a)(-9/10))(4/37) assuming a is positive. a(-2/185) Simplify (ll1)(-14)((ll(2/3)/l)/l)(-47)(l*1l)(-14)/((l7/l)/l(l/(ll7))/l) assuming l is positive. l(-112/3) Simplify (((bb/b(-1))/b)/b)/(bb*7/bb)(b1)(-4)(b8/b(5/4))(4/15) assuming b is positive. b(-46/5) Simplify m*(3/5)/(mmm1/m)mm(1/55)mm(-7/6)mm assuming m is positive. m(479/330) Simplify (f(2/7))7/(f/(f/(ff(-1))))30(f(-11/3)fff(-2/17))(-26) assuming f is positive. f*(2468/51) Simplify ((((kk(-1))/k(-3))/(k*(-1/2)kk(k*(6/11)k)/k))(3/35))25 assuming k is positive. k*(45/22) Simplify ((ww/w*2w/w7)/(w/w1)2)/((w(-2/3)/w)*(-5/8)(ww(1/2))(1/5)) assuming w is positive. w(-881/120) Simplify (d/(dd(-1)))(7/5)((d(d/d*4)/dd)/dd)/dd*1((d*(-7)/d)/ddd/(dd*(-4/3)d))(-42) assuming d is positive. d(1607/5) Simplify (((xx1)(-17)xx/((x(-6)xx)/x)x(x(2/3)xx)/x)(-3/22))(-1/52) assuming x is positive. x(-73/1144) Simplify (o/(o/(o(-33)o)))(-2/5)/(o(2/31))(-1/11) assuming o is positive. o(21834/1705) Simplify ((u(-2/7)/u)/u)34/(u4/u(-1/13))(u14/(u10u))(-1/19) assuming u is positive. u(-141690/1729) Simplify ((n1/n)/n)(-22)/(nn(1/2)(n*(2/13)/n)/n)((n0)(2/87))(2/101) assuming n is positive. n(581/26) Simplify (((j*(-2/7)jj(2/3))/(j/(jj*(-1)jjj)j/(j/j(-7/4))j))(-17))0 assuming j is positive. 1 Simplify ((nn0/n)38)(-26)n1/(n/n(-2/3)n)(nn1)/(((n/(n/(n/(n/(n(-6)nnnn)))))/n)/n) assuming n is positive. n(13/3) Simplify (n5n(-7))(-28)/((n/((nn1n)/n))(-1/12)/((n/(((n/n(-6))/n)/n))/nn(-5))) assuming n is positive. n(551/12) Simplify (((a16a)/a)/(a*(2/19)a)(a/a2)(5/3))(-28) assuming a is positive. a(-21112/57) Simplify (((o(-6)o)/ooo6)/(o(-2/5))(-8))(8/3) assuming o is positive. o*(-88/15) Simplify (hh/(h*9/h)h*(-1/8)h(8/7)/(h/(((h(3/2)h)/h)/h)h))(3/13) assuming h is positive. h(-1089/728) Simplify (l/(l/(l/l*(2/17)))(ll(-2))/ll(-3)/((l/l(1/6))/l))/((l(-1/3))(-43))(17/4) assuming l is positive. l(-4411/68) Simplify l*(-1/5)ll(3/4)((ll(-1/2)l)/l)*(-39)((ll(-2)/l)(1/32))(-18/5) assuming l is positive. l(-709/40) Simplify (g/(g/g(-29))ggg*(24/7)g)/((gg(-2/109)/g)/((g18g)/gg)) assuming g is positive. g(-2711/763) Simplify (ww*(2/39)ww)(7/2)/(ww/(w/w*(-11/7))ww/w(-7)w) assuming w is positive. w*(683/546) Simplify ((ll*(1/2)l)/l)/(l/(l/l*4))l*5l*(-3)(l*6/lll/(l(-4)l))/(l*1l)(-6/25) assuming l is positive. l(499/50) Simplify (k*(2/17)/(kk/(k/(k*5k))))*(-10/17)((k1/k)/(k(-4)/k))/(k/(((kk0/kk)/k)/k)k5) assuming k is positive. k(592/289) Simplify ((y/y(-20))/(y/(y/(yyy/(y(-5)/y))))(yyy/((y/y*(-3))/yy))(-2/17))(-13/5) assuming y is positive. y*(-2678/85) Simplify (cc*(-34)/cc/(c/(c*4c))c/(c(cc/c(1/21))/c)cc(6/19)/cc)6 assuming c is positive. c(-22852/133) Simplify (bbbb/b(-30)((b*(-25)/bb)/bb)/bb(b(-1/9))26)(3/8) assuming b is positive. b(55/24) Simplify (h(2/3))(-49)h/h*4h*(-2)hh(((h/(h/((h*6h)/hh)))/hh)/(hhh*(-1)))/((hh(1/2))/h3) assuming h is positive. h(-169/6) Simplify ((c4/(cc/(cc*(-3/2)cc)cccc))/(c0)(-4/9))/(((c/c(1/3)c)/(c/(c(-1/5)/c)))/((c/(c1/c))/c)24) assuming c is positive. c(1/30) Simplify (o(-14/5))(-5/7)o19(o/((o/(ooo((((o(4/11)oo)/o)/o)/o)/oo)oo)/o))/oo assuming o is positive. o(246/11) Simplify (b12b)*(-1/11)b*(-1/12)b/b(-1/22) assuming b is positive. b(-29/132) Simplify ((c*(-4)c*1)/(c/((((cc/c*(-7))/cc)/c)/c)cc*(-2)))/(c/(cc/(cc/(c(-5)c)))cc(1/4))(-1/20) assuming c is positive. c*(69/16) Simplify (q(qq1)/q)(-48)/(q1/q)41(q/(q*2/q)q(-2/15))/(q(-4)/(q/(q*(-1)q))) assuming q is positive. q(-1367/15) Simplify ((v(-7)v)(-5)(v/v(1/6))(26/7))(-33) assuming v is positive. v(-7645/7) Simplify (((g/(g/(gg(-13)g))g)/(((gg/(gg/((g(-2/7)/g)/g)))/g)/g))/(g/(g((gg(-3))/g)/g))(-22/5))(-1/11) assuming g is positive. g(-416/385) Simplify (c(-2/17)/(c(2/5)/c)(c*8c)/(c/c(2/9)))(14/9) assuming c is positive. c(93226/6885) Simplify (j(1/2)j(-1/23))(-42)/((j/(jjj(-2)/jj))*(-49)/((jj1)/j)(-5/11)) assuming j is positive. j(7431/253) Simplify x1/(xx/x(-5))x/(xx(1/5))xx(-3)x(x(-1))(-6)x*(3/5)/xxx(1/13) assuming x is positive. x(-34/65) Simplify (q16/q)(-1/15)/(q(-49)/(qq(3/7)/q)) assuming q is positive. q(339/7) Simplify ((l/(l/l(-1/5)))(4/13))*47l*(-2/9)/(l(l/l*(5/3)ll)/l)l(-5)/l6 assuming l is positive. l(-9037/585) Simplify ((y(-4)y)(8/11))(-32)(yy(2/7))(-40)/(yy*5y/(y/(yyy*(-2))y)) assuming y is positive. y(1031/77) Simplify (f/f(2/5)ff*(-5/3)/f)/(fff/(ff*(-1/5)/f)f*(-1/3)f)((ff3)/(f4f))48 assuming f is positive. f(-794/15) Simplify ((s/(s/(s5s)))/(s*(1/5)s))*(-3/10)/((s/(ss/(s/s(-2))))/s(-3/2))18 assuming s is positive. s(-1611/25) Simplify ((tt10)/tt1)(3/7)((t/(tt*(-4/7)))/tt((t(t*5t)/t)/t)/t)43 assuming t is positive. t(1409/7) Simplify ((i/i*(-7)i*(4/17))/(ii(-1/4))(-13/2))(-10/17) assuming i is positive. i(-8915/1156) Simplify ((((p(3/5))(1/8))(-11/5))(-2/67))(1/13) assuming p is positive. p(33/87100) Simplify ((yy/(y/y1))/yy(-1/4))(7/2)/(((y/(y/y*(-3)y)y)/y(-6))/((y/(yy*0)y)/(y/(y4/y)))) assuming y is positive. y(21/8) Simplify (w0/w)47/(w/(w/w*(-1/2))(ww*(1/9	{ "pile_set_name": "DM Mathematics" }
iggest value in 2, 9.4, 0.6, 0.85, 1/11, -11, -0.1? 9.4 Which is the sixth smallest value? (a) 1 (b) 14 (c) -29 (d) -14 (e) -5 (f) -0.26 b What is the fifth smallest value in 5, -188.1, -40, -1/4, 4? 5 What is the third smallest value in 40/31, -1/4, -441, 2/21? 2/21 What is the fifth smallest value in 2, 0.4, -8, -4/5, -3836? 2 What is the second biggest value in -0.5, 41, -1700/743? -0.5 What is the smallest value in 2/11, -473822, -8? -473822 What is the second biggest value in 0.012, 1/2, 364.1, 7/6, -0.3? 7/6 Which is the third smallest value? (a) -16.8 (b) -14/15821 (c) -15 b What is the fourth biggest value in 4, 2/3, 3/37, -2579? -2579 Which is the second smallest value? (a) -0.4 (b) -1 (c) 6704 (d) 9 (e) -4 (f) -2 f What is the second biggest value in -2/9, 7113, 5, 42? 42 What is the biggest value in -187, -180, -0.85? -0.85 What is the biggest value in -2/97, 4, 40659/4? 40659/4 What is the fifth biggest value in -0.0289, 1, 0, 20, 3, 0.3, -266? 0 Which is the fifth smallest value? (a) 1.3 (b) -249 (c) 320 (d) 1/6 (e) 0.06 c What is the second smallest value in 520526, 0.5, -3/16? 0.5 What is the third biggest value in 4579, 1, 2, 3/2, -4, -30.7? 3/2 Which is the biggest value? (a) -1 (b) -29662 (c) 138.8 c What is the second biggest value in -11353, -177, 0? -177 What is the fourth biggest value in 5, -1.18, -7784, 127, -2? -2 Which is the second smallest value? (a) 2/11 (b) 0.4 (c) 1384588 b What is the fifth smallest value in -70, 5, 5/2, -21, -0.036? 5 Which is the sixth smallest value? (a) -4 (b) 8 (c) -2/23 (d) 3 (e) -0.2596 (f) -13/3 b What is the smallest value in 117780, -4, 3, 4/59? -4 What is the third biggest value in 2/7, -2, 5/4, 21, -119, -2/7? 2/7 What is the fifth biggest value in -0.0259, -2/15, 1/4, 3, -61, -125/2? -61 Which is the second biggest value? (a) 57582 (b) -2/7 (c) 1 (d) -0.4 (e) -1 (f) -1/2 (g) 0.3 c What is the third biggest value in -294, 0.1, -5, -0.113, -3/7, 0.11, 2? 0.1 What is the smallest value in -2, -0.27, 12, 0.31, 0.8, 2? -2 Which is the fourth smallest value? (a) 0.11751 (b) -2/81 (c) -0.1 (d) -1/6 a Which is the biggest value? (a) -3/2 (b) 0.0755 (c) -6/89 b What is the third smallest value in 0, -575, -0.3, 6.65, 0.2, -4, -0.4? -0.4 Which is the third smallest value? (a) -0.5 (b) -1 (c) -0.1 (d) 9.9 (e) -14695 a What is the smallest value in -4, 0.2, 3231, -5, 171/52? -5 Which is the fourth biggest value? (a) -1/5 (b) 1.8 (c) -0.5 (d) -0.0921 c What is the second smallest value in 0.02082, 1/4, -257? 0.02082 What is the third biggest value in -2/3, 1/4, 21/2, -745, 0.3, 7? 0.3 What is the third biggest value in 2/25, -2/9, -2/3, 23/28? -2/9 What is the second smallest value in 246, 0, 106/5, -31/5? 0 What is the third biggest value in 2/33, 246/3133, -1/5, 7? 2/33 Which is the fourth biggest value? (a) -3/7 (b) 5 (c) -12 (d) 12.414 c What is the third biggest value in 570, 0.497, -8? -8 What is the third biggest value in 0, -23571, -1/6, 26/3? -1/6 What is the second smallest value in -0.4, -1913, 10101? -0.4 Which is the fifth biggest value? (a) 84 (b) -2 (c) -5 (d) 0.004 (e) 18 (f) 4 b What is the second smallest value in -2545229, -1/4, 3? -1/4 What is the fourth smallest value in 2046, -313, 58, 0? 2046 Which is the second biggest value? (a) -53 (b) -5 (c) -0.8 (d) 0.4 (e) 71 (f) 33 (g) 1 f What is the third smallest value in -9, -1/8, -686/961? -1/8 Which is the biggest value? (a) 0.5 (b) 0.4 (c) -0.0671923 (d) 1/45 a What is the third biggest value in 4/24903, 1134, 1/4, -2/13, -4, 4? 1/4 Which is the fourth smallest value? (a) -0.5 (b) 8 (c) -0.4 (d) -2/7 (e) 2942184 b What is the second smallest value in -795, -2/3, 0.17, 386? -2/3 What is the third biggest value in -3/2, 61/155, -14357? -14357 Which is the third smallest value? (a) 5/7 (b) -139 (c) -16/3 (d) -0.4 (e) -0.3 (f) 0.1 d Which is the sixth smallest value? (a) -5/4 (b) -0.5 (c) 22 (d) 43 (e) -1 (f) 10/9 d Which is the third smallest value? (a) 12 (b) 7/6 (c) -33680 a Which is the third biggest value? (a) 0 (b) -8/5 (c) -7 (d) -1/65 (e) 1/2 d What is the smallest value in -25, -17, -5, -1/827? -25 What is the third biggest value in -123, -53114, 0? -53114 Which is the third smallest value? (a) -1 (b) -1/10 (c) 39 (d) 1 (e) -0.7 (f) 65 (g) 3 b What is the third smallest value in -24, -0.15, 3/389? 3/389 What is the smallest value in 2.6, -897, 2, -85? -897 What is the second biggest value in 19956, -3, 2/857? 2/857 Which is the second smallest value? (a) -6 (b) 1899 (c) 4 (d) 25 (e) -4/7 (f) 0.2 e What is the fourth biggest value in -5, 20/7, -1/9, -58, -1/6? -5 Which is the biggest value? (a) -0.0513 (b) 4 (c) 24 (d) 1 (e) 8/3 c What is the smallest value in -73, -391, 1/83? -391 Which is the fourth smallest value? (a) -17 (b) -1 (c) 4 (d) -5 (e) 0.36 (f) 0.3 (g) 2.4 f Which is the seventh smallest value? (a) 92101 (b) -0.2 (c) 2/7 (d) 0.13 (e) -0.4 (f) -2 (g) -4 a Which is the third biggest value? (a) 24/2363 (b) 3 (c) 1 (d) 47 c What is the second biggest value in 0.2, -7, 115/683? 115/683 Which is the second biggest value? (a) -25.919 (b) 195 (c) 0 (d) -1 c What is the sixth smallest value in 2, -4, -1/2, 4, 1220, -64? 1220 Which is the fifth biggest value? (a) -34 (b) -1/2 (c) 6 (d) -3 (e) -0.1 (f) 1/13 (g) 1/5 b Which is the smallest value? (a) -10 (b) 4/3 (c) -1/9 (d) -2.98 (e) -0.01 (f) 1/6 a What is the fourth smallest value in -0.4, -30/17, -25, -29? -0.4 What is the biggest value in 1, -5/2, 0.18, -1/4, 9207/7? 9207/7 Which is the fifth smallest value? (a) -0.3 (b) 1/13 (c) -23 (d) -2 (e) -7 (f) 2.2 (g) -3/7 a What is the fourth smallest value in -4169, 1, 0.5, 30/13? 30/13 What is the biggest value in 15, -0.1, -4461, 10? 15 Which is the smallest value? (a) -0.1 (b) 37 (c) -3/2 (d) 75 (e) 0.5 c What is the third smallest value in 0.2, 1, -8, -5, 0.4, -109? -5 Which is the third smallest value? (a) 2/17 (b) 3969 (c) 2 (d) -0.1 (e) -13 a What is the third biggest value in 4, 599.74, 1/3, -0.54? 1/3 Which is the sixth biggest value? (a) -2 (b) 0.1 (c) -7/17 (d) -5 (e) -1/7 (f) 0.312 (g) 2/11 a What is the fifth smallest value in 1621, -0.038, -5, 19, 3/7? 1621 What is the fifth smallest value in 36, 0.3, 0.5, 0, 46.49, 2? 36 Which is the fifth biggest value? (a) 0 (b) 5/1583 (c) -2.3 (d) 1 (e) 13 (f) 0.5 a What is the smallest value in -10.4, 0.1, -1/18, 0.24993? -10.4 Which is the smallest value? (a) 11/159 (b) 0.08 (c) 3/8 (d) -0.07 d What is the second smallest value in 2/15, -3/17, 4/3, 9, -2/9, 10, -0.03? -3/17 Which is the smallest value? (a) 1 (b) 6 (c) -4 (d) 2/407 (e) 0.5 (f) 14.9 (g) 3/8 c Which is the smallest value? (a) -28.064 (b) -1 (c) -3323 c Which is the fifth smallest value? (a) 0.1 (b) -4/7 (c) -477 (d) 3 (e) -0.4 (f) -8 a Which is the fourth biggest value? (a) 15 (b) 2/7 (c) 0.5 (d) 0.02 (e) 0 (f) 0.7 (g) 0.45 g What is the biggest value in 2/1107, -58, -0.166? 2/1107 What is the third smallest value in -0.4, 24/97, 3/5, -4.717, -2/11? -2/11 Which is the fifth biggest value? (a) 0 (b) 5 (c) 101 (d) 4/1395 (e) 2/13 a Which is the third biggest value? (a) -9 (b) 104528 (c) 0.3 (d) -0.14 d Which is the smallest value? (a) -5/2 (b) 5 (c) 0.4 (d) 0 (e) -1010 e Which is the smallest value? (a) -11 (b) -4 (c) -50 (d) -0.1 (e) 2 (f) 1.1 (g) -5 c What is the biggest value in 1, 7, -0.2, -0.032, 11, 4, 1.4? 11 Which is the fourth smallest value? (a) -2 (b) 3/5 (c) 3 (d) 4 (e) -2/15 (f) 1081 (g) -0.04 b What is the fourth biggest value in 34, -4/3, -0.04, 77/3, -0.119, -5? -0.119 What is the biggest value in -2/13, 0, 0.4, 227.9, 3? 227.9 Which is the third smallest value? (a) -17 (b) 24/19 (c) -5/9 (d) -11 c What is the third biggest value in 5499, -7, -5? -7 Which is the fourth smallest value? (a) 0.3 (b) 1841 (c) -1/14 (d) -372 b Which is the smallest value? (a) 0.1 (b) 19 (c) -27 (d) 0.03 (e) -1/2 (f) 4 (g) -5 c What is the third smallest value in -7/1290, -1/5, -2/9, 5, -10? -1/5 Which is the second biggest value? (a) -3/2 (b) -1/2 (c) -1156	{ "pile_set_name": "DM Mathematics" }
hat is t rounded to the nearest one million? -11000000 Let o = -324.181 + 324. Let y = -1148.1697 + 1148. Let m = o - y. Round m to 2 dps. -0.01 Let h = 81.8026 - 81.49. What is h rounded to 1 decimal place? 0.3 Let c = 90.5 - -20.5. Let n = 79.5 - c. Let t = 35 + n. What is t rounded to the nearest 10? 0 Let m = 478.82 - -115. Let z = m + -1328.49. Let u = z - -742. Round u to the nearest integer. 7 Let y be 85/40 + (-5)/40. Suppose yx + 17700000 = -x. What is x rounded to the nearest 1000000? -6000000 Let u = -33165 + 33164.978513. Round u to 2 decimal places. -0.02 Let q = 42.1 + -22. Let w = q + -20.0748. Round w to 3 dps. 0.025 Let a = 302.4 - 276. Let l = a + -26.405. What is l rounded to 1 dp? 0 Let f = 0.050724 - 49615.050724. Let n = 49636.053 + f. Let z = -21 + n. What is z rounded to 2 decimal places? 0.05 Let o = 0.3965906 - 0.3941. What is o rounded to 4 decimal places? 0.0025 Let s = -8.189991221 - -8.19. Round s to 7 dps. 0.0000088 Let m = 10254.03 - 10117. What is m rounded to the nearest ten? 140 Let n(g) = 3g + 10. Suppose -164h + 163h = 3. Let u be n(h). Let i(c) = 67001c2 + 2c - 3. Let j be i(u). Round j to the nearest ten thousand. 70000 Let l = 31379.13281 + -31379. Round l to 2 dps. 0.13 Suppose k + 33889 = 181489. Round k to the nearest one thousand. 148000 Let r = 2498.22 + -2533. Let i = r - -33.377. Round i to two decimal places. -1.4 Let i = -833 + 777.38. Round i to the nearest integer. -56 Let a = -21586.61912 - -21586. Round a to three decimal places. -0.619 Let b = 26 + -19. Suppose 10 = -2p + bp. Let c be (-8)/(-20) - (270000008/10)/p. What is c rounded to the nearest 1000000? -14000000 Let a = 886 + -1839. Let m = -952.999197 - a. What is m rounded to four dps? 0.0008 Let z(u) = 3920u3 - u + 5. Let g be (-3)/9 + 61/3. Suppose 16f + g = 20f. Let r be z(f). What is r rounded to the nearest 100000? 500000 Suppose 355049200 = -b + 20b + 190b. What is b rounded to the nearest one million? 2000000 Suppose 199r - 200r = -3. Suppose -3q = 4y - 3594020, -4791990 = -4q - y + ry. What is q rounded to the nearest ten thousand? 1200000 Suppose 3372 = -7f - 2018. Let h = f + -7430. What is h rounded to the nearest ten thousand? -10000 Let p = -17121 + 17121.0026256. Round p to 5 decimal places. 0.00263 Let p = 2336.1631789 + -61085.1333579. Let l = p + 58749. Let s = l - 0.03. What is s rounded to 5 dps? -0.00018 Let f(t) = -146297t3 + 10t*2 - 25t - 4. Let j be f(3). Let c be (-20)/25-10 + j. Round c to the nearest one hundred thousand. -4000000 Let p(n) = 2n*2 + 15n + 18. Let a be p(-10). Suppose h - 13 = -4z - 41, -3h + 4z = a. Let w be (0 - 2)1860/h. What is w rounded to the nearest ten? 160 Let y = 18866 + -15849.2. What is y rounded to the nearest one hundred? 3000 Let h be 99 + -104 + 24. Let i be 4 + -8 - (h - -2111). What is i rounded to the nearest 10? -230 Let b = 3497.231 - 3492. Let k = 5.35 - b. What is k rounded to 2 dps? 0.12 Let t(r) = r*3 - 23r*2 + 20r - 16. Let s be t(22). Let n be -996 + -1 + (s/10 - -1). What is n rounded to the nearest one hundred? -1000 Let p be 17/(-3)(1 + (-12 - -8)). Let u(r) = -8r*2 - 44r + 30. Let h be u(p). What is h rounded to the nearest 100? -3000 Let f = 0.7026 - 0.7030061. Round f to 4 dps. -0.0004 Suppose -36v = -27v. Suppose -5i - 5a - 316450000 = v, 0 = -4i + 13a - 10a - 253160000. What is i rounded to the nearest 1000000? -63000000 Suppose 2j - 59 = 85. Let y be (-16)/j - 3111/(-27). Suppose 0 = x + 4x + y. What is x rounded to the nearest ten? -20 Let r = -1097.36665 + 1097. What is r rounded to two decimal places? -0.37 Let d = -19009 - -44678. What is d rounded to the nearest 100? 25700 Let k = -64133295175786.27805006071 - -64133295175522. Let x = k - 0.72194929829. Let p = 265 + x. Round p to seven dps. 0.0000006 Let r = 16165 + -16164.9862172. Let p = 0.0137 - r. What is p rounded to 5 decimal places? -0.00008 Let x be 1/6 - 3293/(-222). Let u(q) = -4452q*2 - 20q. Let p be u(x). Round p to the nearest 100000. -1000000 Let g = 1569833.16 + -1570155.327229. Let j = -918.16769 - g. Let x = j - -596. Round x to 5 dps. -0.00046 Let i = -59 - -63. Suppose k + ig - 497396 + 4277408 = 0, 4k + 3g + 15120009 = 0. Round k to the nearest one hundred thousand. -3800000 Suppose -2p - 3v = -v - 445620, -4v = 0. Suppose 0 = -5g + 2 + 13. Suppose gy - 197190 - p = 0. What is y rounded to the nearest 100000? 100000 Let g = -63229.1109956 + 63229. Let p = g + 0.111. Round p to five decimal places. 0 Let f = 1869592204.5587985 - 1869595180. Let z = 2995.4412 + f. Let r = z + -20. Round r to six decimal places. -0.000002 Let h = -440.072 + 271.1. Let u = h + -0.028. Let t = 168.99567 + u. Round t to three dps. -0.004 Let r = -19223 - -19222.9999981066. What is r rounded to 7 dps? -0.0000019 Let q = 8555.847 + -8693.56603. Let t = 137.7 + q. Round t to 3 decimal places. -0.019 Let q = 2358.1999993136 - 2358.2. Round q to seven decimal places. -0.0000007 Let n = 762 - -2337. What is n rounded to the nearest 100? 3100 Let z = -17 + 37. Let j(s) = -25 + 27s - 53s - 10s2 + 24s - 35. Let m be j(z). Round m to the nearest 1000. -4000 Let d = -6058850086 + 6058850161.99999846. Let h = -66.5 - 9.5. Let p = d + h. What is p rounded to seven dps? -0.0000015 Let f be (-3)/4 - (966/(-24))/7. Let g(i) = 3i - 13. Let d be g(f). Suppose -7 = -5s - u - 6, -ds = -u + 1. What is s rounded to the nearest 10? 0 Let k(i) = -32i*2 + 31i*2 - 17i + 12 + 7. Let m be k(-9). Suppose 2 = -3c - 1, -g - m = 3c. Round g to the nearest 10. -90 Suppose 47654 + 66386 = -14a + 8228. Round a to the nearest 1000. -8000 Let a = 642 + -1095. Let v = a + 452.99486. What is v rounded to 3 decimal places? -0.005 Suppose -3d - 2c + 12 = c, -14 = -5d + c. Let a be 805/(-1 + d - 3) + 0. Let t = 405 + a. What is t rounded to the nearest ten? -400 Let z be 23 + -3 + -15 + -72195. What is z rounded to the nearest one thousand? -72000 Let d = -18189 + 18320.27. What is d rounded to the nearest integer? 131 Let i = -152.3875 - -149.04. Round i to one dp. -3.3 Let w(u) = 494377u2 + 23u + 60. Suppose 5y + 0n = -4n - 4, 0 = -n + 4. Let m be w(y). What is m rounded to the nearest 1000000? 8000000 Let p = -0.22007 - -0.2243. What is p rounded to 4 dps? 0.0042 Let z(r) = r2 - 8r + 11. Let u be z(12). Suppose -3l - 3b + u + 10 = 0, -l + 14 = 4b. What is l rounded to the nearest ten? 30 Let k be (0 - 3)/((-4)/8). Suppose ki - 11 + 779 = 0. Let v = i - -1528. Round v to the nearest 100. 1400 Let u = -125317663 - -125316987.999254. Let k = u - -675. Round k to 4 decimal places. -0.0007 Let x = -145.1 - -145. Let s = -0.099552 - x. Round s to 5 decimal places. 0.00045 Let j = -526 - -526.1272. Let x = j - -0.305. What is x rounded to 1 dp? 0.4 Let q = -1484304 - -2566304. What is q rounded to the nearest one million? 1000000 Let h = 147 + -125. Let o = -41211 - -41232.9838. Let m = h - o. What is m rounded to 3 dps? 0.016 Let l = -66.047 - -66. Let t = l + -2.703. Round t to zero decimal places. -3 Let j(b) = 0b2 + 1 - b3 - 7b*2 - b + 10b*2. Let o be j(3). Let f be 0 - 17/(o(-1)/(-30)). What is f rounded to the nearest 100? 300 Suppose 5z - 20 = 5j, 4z + j = z - 4. Suppose zw - w = 1. Let k be 9 - 6 - (1510004 + w). What is k rounded to the nearest one hundred thousand? -1500000 Let h = -0.0216 + 25.1206. Round h to 1 decimal place. 25.1 Let q = -40.17 + 38.2. Let f = 1.969622 + q. What is f rounded to 5 dps? -0.00038 Suppose 0 = -j + 2i - 929989 - 8862011, -2i = 0. Round j to the nearest one hundred thousand. -9800000 Let l = -10655.4 + 11225. What is l rounded to the nearest ten? 570 Let y be (207/138)/(3/57740). What is y rounded to the nearest 1000? 29000 Let g(v) = 156v3 + 24v*2 + 165v - 3. Let o be g(-17). What is o rounded to the nearest ten thousand? -760000 Let d = -680.8 - -524. Let k = -185 - d. What is k rounded to the nearest ten? -30 Let l = -1.233 + 567.233. Let j = -565.9999619 + l. What is j rounded to five decimal places? 0.00004 Let v = -541.7999976854 + 541.8. What is v rounded to seven decimal places? 0.0000023 Let w = 12155.82346 - 12156. Round w to 2 dps. -0.18 Let x = -215.0529 - -0.0529. Let h =	{ "pile_set_name": "DM Mathematics" }
-313.5 - -311.5. Which is the nearest to k? (a) o (b) 0.4 (c) -4/7 (d) 0.25 c Let w = -13999.1 + 13999. Which is the nearest to -1/13? (a) -2/9 (b) w (c) -0.001 b Let k = 0.64622 + 0.05378. Which is the closest to -1/22? (a) -3 (b) k (c) -1/6 c Let q = 0.886 + -608.886. Let y = q - -605. Which is the closest to 15? (a) y (b) -5 (c) -2 c Let w = 0.1972 - -0.8028. Let u = -11 - -13. Let k be 2/3 + 40/(-42). Which is the closest to w? (a) u (b) k (c) -2 a Let h be (-8)/(-5) - (-14112)/(-20). Let j = h + 718. What is the nearest to -1/2 in 4, 3, -1, j? -1 Suppose 4s + 40 = -4x, -8s + 36 = -5x - 6s. Which is the closest to 0? (a) x (b) -3 (c) 1 (d) 3/4 d Let f = -0.117 + -10.883. Let u = 7.7 + -6.7. Which is the closest to -2? (a) -0.2 (b) u (c) f a Let l = 0.02 + 4.98. Let f(t) = 29t + 58. Let x(q) = -2q2 + 18q + 18. Let u be x(-1). Let y be f(u). Which is the nearest to 1? (a) 3 (b) l (c) y c Let x be (-17)/33 + (-7)/(-21). Let u = 13872 - 55493/4. Which is the closest to -3? (a) 0.1 (b) x (c) u (d) 3/5 c Suppose 4 = -3y - y + x, -3y + 2 = -2x. Let u be (-80)/(-24)(-6)/5. What is the nearest to y in -5, -4/5, u? -4/5 Let j be 6/((-108)/(-33)) - (-18)/(-12). Let t = -4.08 - -2.68. Which is the nearest to 0? (a) t (b) 2/7 (c) j b Let d = -12.5 + 12.27. Let j = 0.07 - d. Let n be 3 - 4/169. Which is the nearest to n? (a) -1 (b) 4/7 (c) j b Let g = 10.15 + -10. Let z = g - 0.15. Let t = 24.52 - 24.02. Which is the nearest to z? (a) -1/4 (b) t (c) -3 a Let m = 3042 + -9130/3. Let y = 52 + -466/9. Which is the closest to y? (a) m (b) 15 (c) -5 a Let j = 1063 - 1071. What is the closest to -2.9 in j, -0.2, -2? -2 Let c(s) = -s3 + s2 + s + 103. Let b be c(0). Suppose -502 = 13r - 1906. Let h = b - r. What is the nearest to h in 1/6, 3, 0.4? 1/6 Let l = 5700 + -5701. Which is the closest to 1? (a) 0.4 (b) 1/4 (c) -5.8 (d) l a Let m be ((-1426)/(-2139))/(1(-4)/6). Let g = -0.3 + 0.5. Let f = 0.1 + g. What is the nearest to -1 in m, f, 3? m Let d = 22 + -17. Let m = d + -5. Let i = 148/159 + -14/53. Which is the nearest to i? (a) 5 (b) m (c) -4/9 b Let h be 6 + 2 + ((-95)/9 - -3). What is the nearest to -1 in 0.08, 0, h? 0 Let w be (-2)/((-8)/129) - 8/12. Which is the closest to 2? (a) w (b) -1 (c) 0.1 (d) -5 c Let o = 1 + -2. Let j = -2831 - -2830.5. Let z(t) = -6t + 4. Let r be z(2). What is the nearest to o in j, r, 4? j Let d = -1226 - -1232. Which is the closest to 5? (a) 0.1 (b) d (c) -2/7 b Let s(x) = x2 - 37x - 311. Let y be s(44). What is the closest to -11 in y, -13, -3/5? -13 Let m = 0 - -0.5. Let k = -51/52 + 763/884. Suppose 0 = o - 5 + 7. What is the closest to o in m, k, 0.4? k Let n = -0.048 - -215.048. Let v = -219 + n. Let t = 35 - 20. What is the closest to 0.1 in 0.2, t, v? 0.2 Let z = -4355 + 4357. Let f = -0.45 - -0.05. What is the nearest to 0.1 in z, f, -9? f Let y = 76.5 + -109. Let d = y + 21.5. What is the nearest to -1/4 in 0.5, -0.3, d? -0.3 Let g = -0.7798 + 0.7798. Which is the closest to g? (a) -2 (b) -0.4 (c) 0.8 (d) 0.1 d Let u be 2280/(-1120)-7 + (-14)/1. Suppose -k + 0k + 3x = 4, 14 = 5k + 2x. What is the nearest to -4 in 4, k, u? u Let y = -14/25 + 4/25. Let t be (75/(-10))/(-15)0. Suppose t = 2k - u, 0 = -11u + 8u - 12. What is the nearest to y in 4, 2/9, k? 2/9 Let j = -60.8 + -13.2. Let o = 3215 + -3288. Let n = j - o. What is the nearest to n in -3, 2, 2/5? 2/5 Let i = 30.57 - 0.57. Let s = i + -1. Let g = s + -29.09. What is the nearest to -1/3 in g, -4, -2? g Let q = -2 + -5. Let j = 109/228 + -87/76. Which is the nearest to j? (a) -4 (b) q (c) -2 c Let m = 8116 + -8115.954. Which is the closest to 0.05? (a) -1/2 (b) m (c) -5 (d) 1 b Let d be 108/252(-7)/(-6). Let g = -3 + 2.5. What is the closest to d in 4/11, 2, g? 4/11 Suppose -5v = -2k + 5k - 772, -v - 268 = -k. Let l be ((-72)/k)/((-1)/(-877)). Let f = -239 - l. What is the nearest to -0.3 in 0.1, 0.2, f? 0.1 Let b = 8.077 + -8.577. What is the closest to -4/3 in 2/7, -6, b? b Let u(v) = 2v*2 - 3v - 1. Let z be u(-5). Let g be 833/4245/(-14). Let s = z + g. Which is the closest to 2/9? (a) s (b) 0 (c) -0.05 a Let l(z) = z2 - 3z + 1. Let x be l(2). Let g = 19/6 + -11/3. Let t(u) = -u*2 + 10u - 12. Let s be t(9). Which is the closest to g? (a) s (b) x (c) -2/11 c Let n(f) = -9f2 - 5f + 5. Let b be n(3). Let u be 0 - (-1460)/(-32)2. Let y = b - u. What is the closest to 1 in -0.6, y, -0.5? y Let z be ((-4)/10)/((-3)/5). Suppose 4n - 5w = 35, 2 = n + 2w - w. Suppose -11 + 6 = -nl. Which is the nearest to 4? (a) l (b) -2/9 (c) z a Suppose -182 - 145 = -76w + 53. Which is the nearest to -1/4? (a) -0.5 (b) w (c) 2/5 (d) 0.18 a Let p be 1/2 - (-1)/2. Suppose x - p = 2x. Let o be (-6 - (-6)/9) + (-10)/(-2). Which is the closest to x? (a) 1 (b) o (c) -0.1 b Suppose 8k = 1 - 105. Let i = 47 - k. Let o be (i/(-32))/((-3)/(-2)). What is the nearest to -1 in 0.2, o, -4? o Let o be 2/6-1148/14. Let p = o - -90/7. Let u = p + -26/3. What is the nearest to u in -0.2, -1/4, -6? -0.2 Let l = -1 + 1.2. Let s(g) = -g*3 + 11g*2 - 18g - 5. Let v be s(9). Let p be v + 1 + 234/54. Which is the closest to -13? (a) -1 (b) l (c) p a Let p = -7990.1 - -7990. What is the nearest to p in -0.11, -0.4, 0.29? -0.11 Let q = -0.44396 + 2.44396. Which is the nearest to -20? (a) 1.5 (b) 3/7 (c) q b Let u be (-15)/10 - -1 - (-27)/6. Suppose 9g = ug + 2o + 12, -3g = 3o - 3. Which is the nearest to -6? (a) -1/2 (b) 3 (c) g a Let p = -163 - -158.7. Let n = 4.5 + p. Which is the nearest to -0.1? (a) -3/8 (b) n (c) -2/11 (d) -3 c Let b be (5/1 + -2)/(-7). Let d = -2 - -2.1. Let t = 244.6 + -245. What is the nearest to d in t, b, 1/7? 1/7 Let m(g) = -7g*2 - 332g + 189. Let t be m(-48). What is the closest to 1 in 25, t, -0.5, 4? -0.5 Let a be 2(-90)/55 - 108/(-396). Let o = -1714/13 - -132. Let w = 2867/13 - 221. What is the closest to 1/3 in a, o, w? o Let u = 373.5 + -373.9. What is the closest to 0.2 in u, -0.2, 0.2, 1/2? 0.2 Let d = 7002 - 104776/15. Let x = d + -49/3. Let u = 1.5 + -2. Which is the closest to -7? (a) u (b) -5 (c) x b Let n = -0.1866 - 1.1734. What is the closest to -0.1 in 1/3, 3, n? 1/3 Let i = 136 + -678/5. Let w = 0.083 - -0.017. Let t = -24.9 + 24.4. What is the closest to i in t, -2, w? w Suppose -11 = -x - 4w, -4x + 47 - 16 = 3w. What is the closest to 12 in 4, 2/3, x? x Let h = 1 + 195.5. Let k = -197 + h. Which is the closest to -1/5? (a) -2/7 (b) 2/3 (c) k a Let z = -4476 - -4468. Which is the closest to -1/2? (a) 3/2 (b) z (c) -1/2 c Suppose 6a - 2o - 30 = 3a, -3a - 4o = -12. Suppose 0g + g + 8 = 3b, -4g + 4b - a = 0. What is the closest to -1.2 in g, -0.3, 0.07? -0.3 Let x be 28/294 + (-2606)/211. Let u be (x/(-31))/((-9)/(2/2)). What is the closest to 18 in -5, -2/7, u? -2/7 Let a = -487/9 + 481/9. What is the nearest to -6 in 5, a, 1/10, 3/2? a Suppose 5j = 5w - 3590, -j + 4w - 650 = 68. Let o = -1439/2 - j. What is the closest to o in 12, -4, 0.1? 0.1 Let w = 1.1 + -2.1. Let t = -6782 - -6781.6. Let j = 6 - 4. Which is the nearest to j? (a) t (b) 3/5 (c) w b Let a = -66.67 + 67.07. What is the closest to -2/3 in 0, a, -9, -1/7? -1/7 Let h be (-11 - (-6 + -1)) + ((-2838)/(-63))/11. Let j be -2(-9)/8 + -2. Which is the nearest to j? (a) h (b) 4 (c) 0 a Suppose 2i - 62 = y, -3y - 90 = -2i + 92. Let t = -299/5 - y. Let s = 72/205 + 2/41. Which is the nearest to s? (a) t (b) -3 (c) 0.4 c Suppose -12 = 39y - 42y - 4s, -3y - 3s = -9. Which is the nearest to y? (a) -6 (b) 3/7 (c) -4 b Let l = 20.9 - -1.1. Let w = 21.7 - l. What is the nearest to 4/3 in 2/7, w, 5? 2/7 Let g = 121 + -120.115. Let x = g + 0.085. Let o = -1.17 + x. What is the closest to 0.1 in o, 8, 1/3? 1/3 Let o be (2 - 1) + -3 + 0. Let r = 4.47 + -853.47. Let m = -845 - r. Which is the closest to m? (a) 0 (b) o (c) 0.1 c Let k = 1.00405 - 0.00405. Which is the closest to k? (a) -2/11 (b) -1.3 (c) -2 a Let u = -0.18 + -0.12. Let v = -443 - -14615/33. Which is the closest to u? (a) v (b) 5 (c) 1/3 a Let o = 9351/14 + -668. Let p = 321/7 + -46. What is the closest to 2/3 in 1/2, o, p?	{ "pile_set_name": "DM Mathematics" }
3. Let c(q) = 7r(q) + 2u(q). Let a be c(-6). Suppose aw = -w + 350. Does 10 divide w? True Let p(t) = 207t - 89. Is p(7) a multiple of 68? True Suppose -22 = 2k - 2t, 4k + 26 = -t - t. Let v(j) = -13j - 29. Is v(k) a multiple of 15? True Suppose 0 = -4g + g + 3x + 615, -3x - 209 = -g. Is 15 a factor of g? False Let m(r) = 187r + 1. Let y be m(1). Let t be y/20 + (-2)/5. Suppose -4c + tc - 120 = 0. Is 12 a factor of c? True Suppose 3i = 310 + 398. Is i a multiple of 22? False Let n = 4169 + 593. Is 15 a factor of n? False Let s = 143 + -119. Is 5 a factor of s? False Let d be 4 + (-5)/(20/(-4)). Suppose 2w - 3y - 151 = 0, -3w + 314 - 88 = -dy. Is w a multiple of 18? False Let y(o) = o3 + 5o*2 + 6o + 10. Suppose -7g = -4g + 12. Is y(g) a multiple of 2? True Let x = 115 + -205. Let z = x - -150. Is z a multiple of 15? True Let v be -32/(-6) - 11. Let d = v + 5. Is (5 - d)2/4 even? False Let r(h) be the second derivative of 0 + 2h2 - 2/3h*3 + 10h + 1/12h4. Does 7 divide r(-5)? True Suppose -u + 11u = -10. Does 42 divide (20 - u)/((-14)/(-42))2? True Let n(w) = w3 - 12w*2 - 23w + 22. Let h be n(15). Suppose -2z - h = -4c, c + 3z = -0z + 88. Is c a multiple of 21? False Suppose 0w + 19w - 4123 = 0. Is 4 a factor of w? False Suppose 5f + 2u - 363 = 0, 3f = 4u - 10 + 233. Suppose f = w + 30. Is w a multiple of 4? False Let n be (5 + (-4 - -2))14/6. Suppose 50z - 49z = n. Is 2 a factor of z? False Suppose -4y - 8 = 2a, 0y + 3y + 15 = 3a. Suppose 142 = av + 2. Does 12 divide v? False Does 3 divide 4 + (1165/(-3))/(2/(-6))? False Let v(k) = 4k*3 - 6k2 - k - 9. Let a(m) = -m3 + 1. Let b(h) = -5a(h) - v(h). Is b(-4) a multiple of 11? False Let z be (35/21)/(2/84). Let r = -50 + z. Is r a multiple of 4? True Let k(q) = q3 + 6q*2 - 7q + 2. Let w be k(-7). Is 75/1 - (-8)/w a multiple of 10? False Suppose 5f - 5q = 1845, 3f - 6q = -q + 1107. Is f a multiple of 23? False Suppose 18v = 3v + 360. Does 12 divide v? True Let y = 73 + -68. Suppose 4t - 2t = yw + 173, -t - 4w + 80 = 0. Is t a multiple of 28? True Let g(o) = o*3 - 8o*2 + 7o + 8. Let k be g(7). Let y be (-28)/1k/16. Is 11 a factor of (-4)/y + 306/7? True Let q(r) = -4r3 - r2 + r + 1. Suppose -3 + 5 = -2p. Let j be q(p). Suppose 37 = ju - 41. Is 15 a factor of u? False Suppose 19n - 7 = 31. Suppose -3j = -nt - 36 - 128, -4j + 218 = -3t. Does 21 divide j? False Is 6 a factor of (-18920)/(-90) + (-4)/18? True Suppose -b - 4b = -95. Suppose -1 = l + 4o + 2, 3o = -5l + b. Suppose -80 = -0h - lh. Does 7 divide h? False Let u(m) be the first derivative of -m2/2 + m + 3. Let p be u(-1). Suppose -n + 60 = -0z - pz, 3n = -3z + 135. Is 25 a factor of n? True Suppose 4q = 5y - 140, -2q + q - 77 = -3y. Suppose -2l - 5p - 22 = 0, 5l = -0l + 3p - y. Let x = 22 - l. Is x a multiple of 14? True Let w(r) be the third derivative of -r5/60 + r4/6 - r*3/3 - 2r*2. Let c be w(3). Does 4 divide (-6)/(-4)(13 - c)? False Let w be (7/(14/4))/1 + 1. Suppose -f - 509 = -3t - t, 4f - 396 = -wt. Does 9 divide t? False Suppose l + 4l - 3c - 25 = 0, 3l - 3c - 21 = 0. Let a(b) = -3b*l - 2 + 2b*2 + b + 2b*2. Does 16 divide a(-8)? False Let z = -4 - -10. Let y(b) = zb - 3b3 - 7b*2 + 4b*3 + 14b*2 + 0b*3. Does 10 divide y(-5)? True Let t(q) = 3q*2 + 2q + 1. Let n be t(-2). Let s = -6 + n. Suppose -v + 0v = -sp - 50, 2p = -6. Does 9 divide v? False Suppose 3q = -5j - 3 - 37, -15 = 5q - 2j. Let m(f) = -21f. Is 15 a factor of m(q)? True Let i = 3371 + -2385. Does 29 divide i? True Suppose n = -5 + 8. Does 20 divide 2/(-1) + 40 - n? False Suppose 0 = 5c - 3360 + 810. Does 39 divide c? False Let z = 1356 - 108. Is 96 a factor of z? True Let y = 22 - 18. Suppose 484 = yh - j, 7 + 233 = 2h - j. Does 32 divide h? False Is 49 a factor of ((-9)/(-2) + -4)/(3/2526)? False Let u(c) = -4c - 4. Let l be u(2). Is l/6 + (47 - 3) a multiple of 14? True Suppose -8 = 4h + 2k, -4 + 29 = -5h + 5k. Suppose v + 24 = 2v. Does 2 divide (-10)/h - 8/v? False Let r = 1958 - 167. Is 43 a factor of r? False Let f = 235 - -117. Is f a multiple of 16? True Suppose 122 = o - 2t + 3t, -2o + 3t + 259 = 0. Suppose -18c + 17c = -o. Is c a multiple of 25? True Let x be 162/(-12)(-4)/(-3). Let a(z) = -z*2 - 22z - 3. Does 19 divide a(x)? False Suppose 5o - 2o = 114. Suppose -130 = -22z + 21z. Suppose -5b = -5l - z, b + 6l = l + o. Is b a multiple of 14? True Let x = 8 + -6. Suppose xa + 45 = -a. Let k = a - -59. Is k a multiple of 14? False Suppose 0 = -5p - 4p - 2295. Let h = 366 + p. Does 30 divide h? False Let k(x) = x*2 - 2x - 1. Let l be k(6). Let d = 93 - l. Let t = 102 - d. Is t a multiple of 16? True Suppose 0 = -3v - 5k + 149, -236 = -5v + 2k + 64. Suppose -z - 4g = -g + v, -181 = 4z - 5g. Let f = -33 - z. Does 4 divide f? True Suppose -3s + d = 192 - 32, -3s - 3d - 144 = 0. Let r(o) = 2o3 - 5o*2 - 7o - 2. Let u be r(5). Let j = u + s. Is 11 a factor of j? False Let n(g) = -8g - 5. Let k = 43 - 46. Does 3 divide n(k)? False Suppose 0 = -4r - 193 + 13. Does 6 divide -18(r/10 - -4)? False Suppose -f + 4f - 2220 = -3a, 5f - 3672 = 2a. Is f a multiple of 32? True Suppose -5p + 3c + c = -107, 60 = 3p - c. Suppose -4i + 13 = -p. Does 28 divide 230/i - (-3)/(-4)? True Let j = 42 - 63. Let c = j + 40. Does 8 divide c? False Suppose -5t = -5k + 40, -5k + 9k + 4t = 16. Suppose -kz + 203 = -91. Is z a multiple of 16? False Let b = -2 + 2. Suppose by = 2y - 5p - 77, -3y + 107 = p. Suppose c + y = 3c. Is c a multiple of 9? True Let n(q) = 13q - 2. Let r be n(6). Let y be r/28 + (-6)/(-21). Is 15 a factor of y2/330? True Let q(c) be the third derivative of c6/120 - 13c*5/60 + 7c*3/6 + 13c*2. Let w be q(13). Suppose 8m = wm + 27. Is m a multiple of 12? False Let a(n) = 2n + 0n - 3n + 0n + 17. Let v be a(7). Is (-1005)/(-75) + (-4)/v a multiple of 10? False Let i(j) be the first derivative of j3/3 + 3j*2 - 6j + 198. Let c(f) = -f*3 + 4f*2 - 2f. Let u be c(4). Is i(u) a multiple of 2? True Let p = -13 + 15. Suppose po - 136 = -d, -4d + 5o + 635 = d. Is d a multiple of 26? True Let g be 5-6(-256)/30. Suppose -5b - 4w = -g, -2b + 27 + 61 = -2w. Does 6 divide b? True Does 97 divide ((-308)/55)/(2/(-220))? False Suppose -5t - y - 147 = 0, 3t - 4y = 52 - 154. Does 44 divide 4/t + 106197/315? False Suppose 0l = -2l + 1490. Is 18 a factor of l/25 + 1/5? False Let q(d) = -2d2 - 26d + 11. Let n be q(-13). Does 7 divide (-3)/((n - 8) + 48/(-14))? True Let s be (66/(-18))/(2/42) + -2. Let t(y) = -128y3 - y2 - y - 1. Let z be t(-1). Let j = z + s. Does 12 divide j? True Suppose -15 = 5n + 2l, -27 = 2n - 4l + 3. Let i(a) = -3a*2 - 3a - 1 + 2a2 - 4 - 4a2 - a3. Does 5 divide i(n)? True Suppose -5 = -0r - r. Let m(k) = -k3 + 21k*2 - 18k - 37. Let t be m(20). Suppose 0 = -2w - 2a + 31 + t, rw = -4a + 90. Is 8 a factor of w? False Let d(x) = 9x - 8. Let l = 15 + -19. Let p = 3 - l. Does 11 divide d(p)? True Suppose 5d - 19 = 1. Is 2/d - (-334)/4 a multiple of 21? True Let h(s) = 13s2 + 33s - 49. Does 6 divide h(9)? False Let f(s) = -1. Let y(o) = 2 + 7 - 36o2 + 4o*2 - 5. Let v(q) = -3f(q) - y(q). Does 31 divide v(1)? True Let y(w) = w - 8. Let g be y(12). Suppose 0 = 5v + z - 1176, gv - 204 = -3z + 739. Is v a multiple of 47? True Suppose g + 27 = 4a - 412, 0 = 5a - 5g - 560. Does 7 divide a? False Suppose -15c = 163 - 27163. Suppose 5s = -3s + c. Is s a multiple of 21? False Let a = 104 - -346. Does 9 divide a? True Let y be -2 + 261 - 6/2. Suppose 0 = -5g + 2h + 699, -5g + 5h + y = -434. Is g a multiple of 35? False Let w(q) = 2q - 14. Let t be w(8). Suppose -3p + 4n + 95 = 0, -4n = -tp - 39 + 97. Is p a multiple of 8? False Let u = -76 + 73. Let c = 28 - u. Is 2 a factor of c? False Let v be 0 + ((-45)/(-15) - -1181). Suppose -3q - 22 = -v. Does 14 divide q? False Let o = -7 + 165. Suppose 2q + 120 + o = 4y, 5y - 385 = -5q. Is 6 a factor of y? True Suppose -5o = -7o + 48. Let m = o - -53. Suppose 5x = m + 53. Is 6 a factor of x? False Suppose -36w - 139	{ "pile_set_name": "DM Mathematics" }
98, 10, -3, 0, -16. -498, -16, -3, 0, 10 Sort 27, -5, 3, -4/7, -1/4, 2 in ascending order. -5, -4/7, -1/4, 2, 3, 27 Sort 3, 168, 0, -5 in descending order. 168, 3, 0, -5 Sort -5, -83, -1, 5, 4, -50 in decreasing order. 5, 4, -1, -5, -50, -83 Sort -1021, 2, 1, -80 in decreasing order. 2, 1, -80, -1021 Put -2, 124, 4, -1, 5, -8 in decreasing order. 124, 5, 4, -1, -2, -8 Sort 339, 197, -4, 4 in descending order. 339, 197, 4, -4 Sort 3, -29, 33282 in decreasing order. 33282, 3, -29 Sort -3/7, -4, 0.5, 12236 in descending order. 12236, 0.5, -3/7, -4 Sort 4, 5, -85, -0.4. -85, -0.4, 4, 5 Sort 0, -113, 1, 2, 755 in descending order. 755, 2, 1, 0, -113 Put -2, -50001, 5, -1 in increasing order. -50001, -2, -1, 5 Sort -25/9, 4/5, -3, 0.4, 2/9, 0.2 in decreasing order. 4/5, 0.4, 2/9, 0.2, -25/9, -3 Sort -4, 12, 4, -707, -3 in decreasing order. 12, 4, -3, -4, -707 Put 1, 0, 5, -4, -424, 4 in decreasing order. 5, 4, 1, 0, -4, -424 Sort 0, -9, -11, -1 in ascending order. -11, -9, -1, 0 Sort 1, -119, 12, -2, -1 in ascending order. -119, -2, -1, 1, 12 Put 10, 69, -14, 0 in ascending order. -14, 0, 10, 69 Sort 5, -226, -15, 4 in descending order. 5, 4, -15, -226 Put 9, -0.14, 0.2, -0.4, -2 in descending order. 9, 0.2, -0.14, -0.4, -2 Sort 0.44, 0.09, 3/484, -4 in descending order. 0.44, 0.09, 3/484, -4 Sort 1/3, -15.1, -1, 0.2. -15.1, -1, 0.2, 1/3 Put -2/163, 124, 4 in decreasing order. 124, 4, -2/163 Sort -4, 4, 12, -6, 830 in increasing order. -6, -4, 4, 12, 830 Sort 0.013, -2/11, 0, -1/774. -2/11, -1/774, 0, 0.013 Sort -1/7, -4, 4, 4457, -2 in increasing order. -4, -2, -1/7, 4, 4457 Put -4, 4, 5, 3, -863 in descending order. 5, 4, 3, -4, -863 Sort 2/3, -2/11, 0.005, 5/9, 1/8 in descending order. 2/3, 5/9, 1/8, 0.005, -2/11 Sort -0.4, 0, -2282, 1/3, -14 in increasing order. -2282, -14, -0.4, 0, 1/3 Sort 3, -12, 0, -4958 in ascending order. -4958, -12, 0, 3 Put -0.01, -2, -2/7, -1/4 in decreasing order. -0.01, -1/4, -2/7, -2 Put 1.4277, -3/4, -0.1, -1, -4/5 in decreasing order. 1.4277, -0.1, -3/4, -4/5, -1 Sort -2/7, 2, 59, 1, 0.04, 7 in decreasing order. 59, 7, 2, 1, 0.04, -2/7 Sort -0.04, 2/721, -0.5, 4 in decreasing order. 4, 2/721, -0.04, -0.5 Sort -2, -22, -2282. -2282, -22, -2 Sort 2, -0.1, -0.5, 8, -4, -4/7. -4, -4/7, -0.5, -0.1, 2, 8 Put -9, -3, -1, -186 in increasing order. -186, -9, -3, -1 Sort -6904, 4, 2, -3. -6904, -3, 2, 4 Sort -19/2, 4/3, 5, -0.12, 1/23 in decreasing order. 5, 4/3, 1/23, -0.12, -19/2 Put -5, -18/25, -6, 1/2, -0.4, 2 in decreasing order. 2, 1/2, -0.4, -18/25, -5, -6 Sort -0.7, 0, -116, -5, -0.1, 4/3 in descending order. 4/3, 0, -0.1, -0.7, -5, -116 Put 0.1, -3882, -0.3, 2 in descending order. 2, 0.1, -0.3, -3882 Put -66, -16.6, 3.9 in descending order. 3.9, -16.6, -66 Put -1/5, -3, -1.86, -126.4 in decreasing order. -1/5, -1.86, -3, -126.4 Sort 46, -2/5, 0.29968 in increasing order. -2/5, 0.29968, 46 Sort -380, 49, -1, -2, 0 in descending order. 49, 0, -1, -2, -380 Sort 37162, -4, 2. -4, 2, 37162 Sort 3, 594, 60 in decreasing order. 594, 60, 3 Sort 9, -50, 5, 1. -50, 1, 5, 9 Sort 16, -8, -352, -2, -3, -4 in descending order. 16, -2, -3, -4, -8, -352 Sort -11, 35, 4.47. -11, 4.47, 35 Put -2, -13, -154, 28 in increasing order. -154, -13, -2, 28 Sort 1/2, 0, 14, -0.1, 34 in ascending order. -0.1, 0, 1/2, 14, 34 Sort -1354, -14, -4 in ascending order. -1354, -14, -4 Put -2, 3, -3, 0, -44 in descending order. 3, 0, -2, -3, -44 Put 128, 9, -4 in descending order. 128, 9, -4 Put 1, -3, -13, -1, 139 in ascending order. -13, -3, -1, 1, 139 Sort -3/8, -4, -7045, -2/5. -7045, -4, -2/5, -3/8 Sort -140, 5, 63 in decreasing order. 63, 5, -140 Put 4, -1, 3, -39, -2, -6 in ascending order. -39, -6, -2, -1, 3, 4 Put 0, 2/11, -5, 30/79, -0.12 in decreasing order. 30/79, 2/11, 0, -0.12, -5 Sort 15, 531, -3 in ascending order. -3, 15, 531 Sort -44/5, 0.9, 1, 0.12 in increasing order. -44/5, 0.12, 0.9, 1 Sort 2, -3, -7, 1, 4, -2 in descending order. 4, 2, 1, -2, -3, -7 Put -2, 296, 714 in descending order. 714, 296, -2 Put -23, -2, 676 in increasing order. -23, -2, 676 Put -89, 5, 135 in descending order. 135, 5, -89 Sort -3, -5, 322, 0.5, 2 in decreasing order. 322, 2, 0.5, -3, -5 Put 1, -7, 15, 71 in descending order. 71, 15, 1, -7 Put -175, -59, 3 in ascending order. -175, -59, 3 Sort 9, -531, -5, 1/6. -531, -5, 1/6, 9 Sort -3/71, 3/11, -0.3 in descending order. 3/11, -3/71, -0.3 Sort 2/21463, -472, -0.2 in decreasing order. 2/21463, -0.2, -472 Put 3, 5663, 27 in descending order. 5663, 27, 3 Sort -5, -1/4, -0.2, -0.042, 2/11 in ascending order. -5, -1/4, -0.2, -0.042, 2/11 Sort -4.22, 7/4, -2. -4.22, -2, 7/4 Sort 1, -53958, 11/3 in ascending order. -53958, 1, 11/3 Put 1, -35, 2, -82, 0, 5 in descending order. 5, 2, 1, 0, -35, -82 Sort -3, -1, 3, -66, -22 in decreasing order. 3, -1, -3, -22, -66 Put -1380, 2, -45 in increasing order. -1380, -45, 2 Sort -14, 12, 31, 4, 0.05, -2 in ascending order. -14, -2, 0.05, 4, 12, 31 Put 0.1, 1/9, 220, -0.5, -84 in descending order. 220, 1/9, 0.1, -0.5, -84 Put 0.1, -2, -17, -0.3, -2665 in decreasing order. 0.1, -0.3, -2, -17, -2665 Put 5, 2, -6, 1, 8 in descending order. 8, 5, 2, 1, -6 Sort 10, -13, -8, -1 in ascending order. -13, -8, -1, 10 Sort -0.1, 2/5, 177, -905/3 in increasing order. -905/3, -0.1, 2/5, 177 Put -24, 4, -213 in ascending order. -213, -24, 4 Put -65, -2/15, 4, -124, -4/7 in decreasing order. 4, -2/15, -4/7, -65, -124 Put 4, 0, 11, 1130 in descending order. 1130, 11, 4, 0 Sort 767, -95, -4 in ascending order. -95, -4, 767 Put 8/17, -3, -0.5, 1/4, 32 in increasing order. -3, -0.5, 1/4, 8/17, 32 Sort 3, 274, -13, 6, 1. -13, 1, 3, 6, 274 Sort 0.3, -2, 440, -0.12, -0.3 in decreasing order. 440, 0.3, -0.12, -0.3, -2 Put 428, 0.7, -1, -6 in descending order. 428, 0.7, -1, -6 Sort -43, -1/2, 130, 0.3 in increasing order. -43, -1/2, 0.3, 130 Put -3, 3.722, 4, 1/4, 6/11 in decreasing order. 4, 3.722, 6/11, 1/4, -3 Sort 3/5, -0.45, -0.59, 4, 5/6 in decreasing order. 4, 5/6, 3/5, -0.45, -0.59 Sort -3, -4, -439, 1, -310 in descending order. 1, -3, -4, -310, -439 Put 0.5, 0.09064, -2 in descending order. 0.5, 0.09064, -2 Sort 1, 85, 4, 20 in descending order. 85, 20, 4, 1 Sort 4, -226, -38, -4. -226, -38, -4, 4 Sort 225, 3, -3, -1 in increasing order. -3, -1, 3, 225 Put -4, 0.3, -263, 4, 0.18, -5 in descending order. 4, 0.3, 0.18, -4, -5, -263 Sort 0.071, -1, 0.4, 1, -0.9 in decreasing order. 1, 0.4, 0.071, -0.9, -1 Put -5, -2/8243, 0, 3/5 in descending order. 3/5, 0, -2/8243, -5 Put -1, 32/9, 2/95, 0.2, 2 in decreasing order. 32/9, 2, 0.2, 2/95, -1 Sort 0.3, -2, -22, -228, 122 in descending order. 122, 0.3, -2, -22, -228 Sort -4, 4/19, 0.1, 1/4, 32.5. -4, 0.1, 4/19, 1/4, 32.5 Sort -5, 0.2, 33307 in descending order. 33307, 0.2, -5 Sort -4, -412062, -3. -412062, -4, -3 Sort -60, 0, 23. -60, 0, 23 Sort -9, 4, -8, -1 in increasing order. -9, -8, -1, 4 Put -2, 1, 4, 140, -11, 5 in increasing order. -11, -2, 1, 4, 5, 140 Sort 35, 207, 3/7 in ascending order. 3/7, 35, 207 Put -3/14, 0, -5, 4, -0.5 in decreasing order. 4, 0, -3/14, -0.5, -5 Put 0.4, -3/7, -3/1036 in ascending order. -3/7, -3/1036, 0.4 Sort -4, -466, 4, -60. -466, -60, -4, 4 Put -195, 814, 5, -12 in decreasing order. 814, 5, -12, -195 Sort 2/5, -0.10972, 5/3 in descending order. 5/3, 2/5, -0.10972 Sort 3152, -2, 108 in descending order. 3152, 108, -2 Sort 2/33, 1, 2135, 16 in descending order. 2135, 16, 1, 2/33 Sort 1507, 4, 12. 4, 12, 1507 Sort 235, 2, 20 in ascending order. 2, 20, 235 Sort 1, -128, -0.02, -3 in ascending order. -128, -3, -0.02, 1 Put 13, -1, 37, -2, 6 in descending order. 37, 13, 6, -1, -2 Sort 67, 5, 2, 16 in decreasing order. 67, 16, 5, 2 Sort -0.2011, -6, 0.5, -1, 5 in increasing order. -6, -1, -0.2011, 0.5, 5 Sort -0.2, -0.3, 3952 in decreasing order. 3952, -0.2, -0.3 Put -5, 1, 10, 3255, 2, -2 in decreasing order. 3255, 10, 2, 1, -2, -5 Sort 44, -2/11, -83, 0.07. -83, -2/11, 0.07, 44 Put 0.1378, -0.3, -41 in increasing order. -41, -0.3, 0.1378 Sort 2, -2, -1, 3786, -4, 5 in decreasing order. 3786, 5, 2, -1, -2, -4 Put 95, 1/2, -720/7 in decreasing order. 95, 1/2, -720/7 Sort 5, -1, -44, 1, -2, -4 in decreasing order. 5, 1, -1, -2, -4, -44 Put 94, 1, 14, -7, -5, -3 in decreasing order. 94, 14, 1, -3, -5, -7 Sort 0	{ "pile_set_name": "DM Mathematics" }
z Let j(b) = -2b. Let q(g) = g*2 + 3g. Let f(s) = s*2 - 8s + 1. Let o be f(5). Let a(l) = 2l2 + 7l. Let t(z) = oq(z) + 6a(z). Calculate j(t(p)). 4p2 Let d(q) = 2q*2. Let v be (-4)/(-3 - (-4)/4). Let j(b) = 4b - 4b + vb. Give d(j(p)). 8p2 Let b(a) = 13a. Let q(l) = -4l. Let w(r) = -10r. Let o(d) = 17q(d) - 6w(d). Determine o(b(z)). -104z Let d(q) = 3q. Let m(z) = -3z2. Give m(d(y)). -27y*2 Let k = 5 - 3. Let j(y) = 2 - k - 2y. Let v(a) = 6a. Determine v(j(p)). -12p Let k(v) = 0 + 8v + 1 + 5. Let b(o) = -o - 1. Let q(a) = 6b(a) + k(a). Let d(m) = 2. Let n(u) = -u + 5. Let j(p) = -5d(p) + 2n(p). Determine j(q(w)). -4w Let x(p) = p2 - 1. Let a(s) = 4s*2 - 5. Let j(f) = -a(f) + 5x(f). Let g(v) = 10v2. Determine j(g(u)). 100u*4 Let r(i) be the third derivative of 0i3 - i2 + 0i + 0 - 1/60i*5 + 0i*4. Let l(o) = -16o. Calculate r(l(n)). -256n2 Let f(s) = 5s2. Let o(r) = -r2. Let v(h) = 6f(h) + 33o(h). Let t(b) = 8b. Give v(t(d)). -192d*2 Let f(p) = -5p. Let i(g) = -55g. Determine f(i(w)). 275w Let l(a) = -a. Let y(f) = 21 + 28 - 49 + 5f. What is y(l(b))? -5b Let h(y) = 4y2 - y. Let k(o) = -7o*2. Determine h(k(z)). 196z*4 + 7z*2 Let q(p) = 4p. Let l(h) = 189h2. What is l(q(m))? 3024m*2 Let n(b) = -2b + 4. Let z(a) = 3a - 5. Let h(o) = -5n(o) - 4z(o). Let c(g) = -22g*2. What is c(h(j))? -88j*2 Let x = 2 - 2. Let m(p) = 6p + xp - 3p - 5p. Let t(q) = -q2 - 4q - 4. Let l(j) = -j*2 - 5j - 5. Let u(n) = 4l(n) - 5t(n). What is u(m(y))? 4y2 Let v(t) = -16t*2. Let m(p) = -17p. What is v(m(k))? -4624k2 Let t(r) = 6r + 4. Let z(u) = -2u. Determine t(z(d)). -12d + 4 Suppose 0 = -2c - 2i + 25 - 7, -c + i - 1 = 0. Let p(w) = -4 - w + c - w. Let t(x) = 8x2. What is t(p(h))? 32h2 Let d(y) be the third derivative of y7/840 - y*4/8 + 2y2. Let q(h) be the second derivative of d(h). Let t(k) = k2. Calculate q(t(a)). 3a4 Let d(f) = 12f*2. Let u(x) = 57x. Give u(d(z)). 684z2 Let z(m) = -m. Let g(d) = -3d*2 + 6. Let s(k) = 2k*2 - 5. Let u(n) = -5g(n) - 6s(n). What is z(u(a))? -3a*2 Let u(n) = 24n. Let b(m) = m - 35. What is u(b(q))? 24q - 840 Let a(h) = 7h*2. Let y(f) = 43f - 2. Give y(a(m)). 301m2 - 2 Let h(z) = -z. Let d(r) be the first derivative of -8r*2 - 57. What is h(d(t))? 16t Let v(q) = 17q - 6. Let d(t) = 37t - 13. Let j(s) = 6d(s) - 13v(s). Let z(o) be the second derivative of 0 - o + 1/6o3 + 0o*2. Give j(z(b)). b Let m(g) = 2g. Suppose d + 0 = 4. Let y be 1 + d/2 + -2. Let p(x) = -4x2 - 3x - 3. Let o(v) = v*2 + v + 1. Let c(q) = yp(q) + 3o(q). Calculate c(m(h)). -4h*2 Let j(f) be the first derivative of 3f*2/2 - 1. Let s(a) = -24a + 2a2 + 24a. What is j(s(p))? 6p2 Let h(v) = 575v*2. Let u(c) = 2c. Determine u(h(n)). 1150n2 Let l(p) be the first derivative of 3 + 0p + 0p2 - 1/3p*3. Let y(n) = 2n + 0 + 0. What is y(l(s))? -2s2 Let d(n) = -49n. Let y(u) = -u*2 - 7u. Let q(g) = g. Let b(v) = 21q(v) + 3y(v). Give b(d(t)). -7203t2 Let r(h) = -5h*2 + 6h. Let z(d) = d*2 - d. Let m(j) = -r(j) - 6z(j). Let k(f) = -2f. Calculate k(m(w)). 2w*2 Let j(g) = 4g*2. Let d(i) = 3i*2. Let r = 5 + -2. Suppose 3 = ru + 3y, 0 = -u + 2u + 2y - 4. Let z(n) = uj(n) + 3d(n). Let x(w) = -w. Give x(z(t)). -t2 Let j(l) = -l2 + 5l - 5l. Let i(m) = 24m + 24m - 45m. Calculate j(i(h)). -9h2 Let s(f) be the third derivative of -f4/8 - 2f*2. Let q(l) = -3l - 6. Let t(n) = 2n + 5. Let u(y) = -5q(y) - 6t(y). Determine u(s(w)). -9w Let g(p) = -17p. Let c(v) be the third derivative of -v5/30 + 5v*2. What is g(c(s))? 34s*2 Let n(x) = -x. Let b(g) = 4g - 57. Calculate n(b(o)). -4o + 57 Let x(n) = -100n*2 - 35n - 35. Let j(p) = 17p2 + 6p + 6. Let r(i) = -35j(i) - 6x(i). Let q(d) = 8d2. Calculate q(r(k)). 200k*4 Let l(u) = -2u*2 - 2. Let j(t) = 6t*2 + 7. Let k(s) = -6j(s) - 21l(s). Let x(m) = 3m2 - m2 - 4m2. Determine x(k(g)). -72g*4 Let z(t) = 40t*2. Let q(o) = 3o*2. Calculate z(q(i)). 360i*4 Let z(y) = -14816y*2. Let p(a) = -2a. Determine z(p(j)). -59264j2 Let b be (-7 + 5)/((-4)/6). Let q(x) = bx - 2x + x - x. Let i(a) = 2a. What is q(i(y))? 2y Let c(j) be the second derivative of j4/12 - j. Let f(l) = 2l + l + 7l - 7l. Give c(f(r)). 9r2 Let p(x) = 393x*2. Let b(i) = 2i. Determine b(p(l)). 786l2 Let w(u) = -4u*2 + 3. Let r(a) = 9a*2 - 7. Let h(m) = 3r(m) + 7w(m). Let g(i) = -2i*2. Give g(h(q)). -2q*4 Let h(d) = -6d. Let t(l) = 1412l2. What is h(t(v))? -8472v*2 Let v(w) = -36w. Let j(q) = -4q2 - 21q. Give v(j(a)). 144a2 + 756a Let u(j) = 3j + 2. Let c(f) = f + 1. Let b(q) = -2c(q) + u(q). Let m(x) = -30x2. Determine m(b(h)). -30h2 Let v(z) = -z2 - 173. Let n(w) = -4w2. Calculate n(v(q)). -4q*4 - 1384q*2 - 119716 Let n(a) be the first derivative of -58a*3/3 - 31. Let t(b) = -2b*2. What is t(n(y))? -6728y*4 Let c(n) = 2n. Let r(t) = -40t2. Let v(q) = -200q*2. Let l(p) = -16r(p) + 3v(p). Calculate l(c(a)). 160a*2 Let j(c) = -12c*2. Let l(z) = -4z - 8. Let p(d) = d + 3. Let k(y) = -3l(y) - 8p(y). Calculate k(j(a)). -48a2 Suppose 0 = -5o + 4l - 1 + 31, 5o = l + 15. Let r(q) = 4q2 - 3q2 - o + 2. Let s(w) = w. Calculate r(s(k)). k2 Let c(w) = -w - 1. Let o be c(-3). Let x(l) = 0l + 0l + 0lo - 2l*2. Let a(z) = -z. Give x(a(u)). -2u*2 Let k(i) = -9i. Let y(n) = -13n - 2n + 12n. Calculate k(y(t)). 27t Let m(n) be the first derivative of 0n + 1 - 1/3n*3 + 0n*2. Let d(q) = -3q*2. Calculate d(m(r)). -3r*4 Let f(r) = 89r. Let g(y) = 19y2. Give g(f(z)). 150499z*2 Let h(w) = 1. Let n(v) = 6v - 4. Let u(t) = 4h(t) + n(t). Let s(x) be the third derivative of x4/8 - 20x*2. Calculate u(s(d)). 18d Let r(o) = -26o. Let u(x) = 85x - 1. Give u(r(v)). -2210v - 1 Let l(v) be the second derivative of -2v*3 - 42v. Let f(s) = s*2. Give f(l(j)). 144j*2 Suppose 0d + 60 = 5d. Let z(a) = -da*2 + 21a*2 - 11a*2. Let s(h) = -2h*2. What is z(s(b))? -8b*4 Let k(b) = -2b. Let r(q) be the second derivative of q*3/3 - 2q. Calculate r(k(p)). -4p Let c(n) = -n - 2. Let l(j) = 4j. Calculate c(l(m)). -4m - 2 Let k(p) = 2p. Let z(r) = 4r2 - 38r. Give k(z(s)). 8s2 - 76s Let f(v) = -4v2. Let i(y) = -y - 1. Let o(q) = q + 1. Let d(x) = -5i(x) - 4o(x). Let w be d(1). Let z(c) = c2 + 0c*w - 2c*2. Calculate f(z(k)). -4k*4 Let r(d) = 9d*2 + 4d - 4d - 7d*2. Let l(y) = 3y. Determine r(l(a)). 18a2 Let y(i) = -21i. Let m(q) = 142q. Calculate y(m(u)). -2982u Let d(v) = -158v. Let w(o) = 11o*2. Determine d(w(n)). -1738n*2 Let y(f) = -2f2. Let z(r) = 6. Let u(o) = o2 - 34. Let c(j) = 6u(j) + 34z(j). Determine y(c(q)). -72q4 Let r(l) = -37l. Let u(w) = -7w2 + 35w. Calculate r(u(y)). 259y2 - 1295y Let f(p) = -8p - 4p + 9p + 0p. Let o(v) = 16v. What is o(f(h))? -48h Let v(p) = 6p2 - 8p - 8. Let x(g) = g*2 - g - 1. Let o(b) = v(b) - 8x(b). Let a(t) = 25t. Determine o(a(m)). -1250m*2 Let d(x) = -3x*2 - 3x. Let m(l) = l. Suppose 2w - 3 = 3. Let z(o) = wm(o) + d(o). Let u(p) = p*2. Give z(u(b)). -3b*4 Let i(j) = -j. Suppose a - 6 = c - 6c, 0 = 3a + c - 18. Let u be 38/a - (-2)/(-6). Let w(p) = p + up - 4p. What is i(w(n))? -3n Suppose -g = -3g - k - 1, -33 = -4g + 5k. Let i(l) = 5l*2 - gl2 - l2. Let t(r) = -3r. Determine t(i(z)). -6z*2 Let j(s) = 8s*2 - 10s*2 + 0s*2. Let w(b) = -14b. Give w(j(u)). 28u2 Let x(j) = j + 18. Let m(o) = -8o*2. Calculate x(m(c)). -8c*2 + 18 Let p(l) be the first derivative of -1/2l*2 + 1/12l*4 + 2 + 0l + 0l3. Let s(o) be the second derivative of p(o). Let a(d) = d. Determine s(a(g)). 2g Let g(z) = -16491z. Let v(d) = -2d*2. Determine v(g(i)). -543906162i*2 Let g(n) = 3n. Let m be 3/(-2) + (-9)/2. Let v(k) = -4k. Let q(h) = mg(h) - 4v(h). Let i(b) = b. Calculate q(i(l)). -2l Let z(a) = -7a2. Let x(d) = 2d - 114. Calculate z(x(w)). -28w2 + 3192w - 90972 Let n(t) be the second derivative of -5t4/12 - 2t. Let k(a) be the first derivativ	{ "pile_set_name": "DM Mathematics" }
of m(-3) and d. 45 Let o be 1/2(-401038)/77. Let p = 2596 + o. What is the common denominator of (171/10)/(27/45) and p? 14 Let s = 10979/30 + -1724/5. Let q = -299 - 368. Let u = q - -2051/3. What is the common denominator of s and u? 6 Let d(m) = -m3 - 9m*2 - 28m - 33. What is the smallest common multiple of d(-6) and ((-132)/10)/(1/(-5))? 594 Let k(u) = 98u2 + 10u - 12. Let q be k(-7). Let i = q - 188773/40. Calculate the common denominator of i and -43/24. 120 Let z be (-105)/(-20)(-32)/(-12). Suppose 5l - z + 4 = 0. What is the lowest common multiple of l and 3? 6 Let l be (2/15)/(48/(-1492758)). Let k = 4148 + l. Calculate the common denominator of k and (-1269)/(-90) + -6 - 8. 20 Suppose -80 = w + 52. What is the common denominator of -27/10 and (-7 - -5)/(w/(-117))? 110 Let y = 17185/1452 - 1/484. Calculate the common denominator of 113/54 and y. 54 Suppose 5z - 23 = -u, u - 4z - 11 = -6z. Let r(f) = -3f - 9. Let b be r(-4). Suppose 2v - b = v. What is the smallest common multiple of v and u? 3 Find the common denominator of ((-1)/15)/(12 - 13712/1272) and -121/18. 8730 Let n(k) = -10k*3 - 2k*2 - 12k - 22. What is the least common multiple of 9 and n(-2)? 666 Suppose 0 = -2f + 3 + 1. Suppose -483 = 5o - 2l, -4l = 5o + f + 457. Calculate the common denominator of -10o/(-60) + 3 and 95/12. 12 What is the common denominator of -14(-365)/(-585) - -9 and -95/52? 468 Let o = 13093 - 13079. Calculate the lowest common multiple of 176 + -1 + 2/2 and o. 1232 What is the common denominator of 53/14 and ((-84)/630)/((-14)/(-36))? 70 Let k(z) = -z2 - 3z + 2. Let a be k(2). Let l = -33461/20 + 1672. What is the common denominator of ((-77)/(-22))/(a/26) and l? 40 Let s = 2/2891137 - -519303136775/40475918. Let z = -12838 + s. Find the common denominator of ((7/(-12))/7)/((-192)/5664) and z. 168 Let d be ((-24)/(-80))/(6/4435). Let x = d - 1129/5. Calculate the common denominator of x and -451 + (-12)/(-24). 20 Let c = -28 - -32. Calculate the least common multiple of 12/(-8)-2 - -2 and c. 20 Let a(v) = v*3 - 6v*2 + 6v + 6. Suppose -4t = -19 - 1. Let l = 16 - 9. Calculate the smallest common multiple of l and a(t). 77 Let f(w) = 3370w - 12. Let l be f(-6). Let q = 34576486/1709 + l. Let m = q + 213661/30762. What is the common denominator of 85/8 and m? 72 Let x be -6 - -275 - (-2)/(-2). What is the lowest common multiple of (1/(-3))/(2/(-42)) and x/32 - (-6)/(-16)? 56 Find the common denominator of 65/6 and ((-1)/(-12) - 0)/((-30)/3630). 12 Calculate the least common multiple of -2 + -96(2 - 3/1) and 18. 846 What is the common denominator of -49/152 and (-26200)/80(-1)/(-60)? 456 Let r = -25 - -13. Let z(m) = 2m2 + 14m - 15. Let x be z(r). Calculate the common denominator of 1834/x(-15)/12 and -55/38. 114 Suppose -10 = s + 3z + 2, 2s = -z - 9. Let j be 2/(1(1 + -2)). What is the common denominator of -17/12 and j28/176 + s? 132 Let b = 153 - 98. Calculate the lowest common multiple of 65 and b. 715 Let t(m) = m2 - m. What is the lowest common multiple of t(2) and 20? 20 Let d be ((-8)/(6/(-3)))/(-2). Let h = -20 - -33. Let l = d + h. What is the smallest common multiple of 2 and l? 22 Let v = -6053 - -338977/56. Find the common denominator of -9/14 and v. 56 Let k = -583961/32 + 18251. Find the common denominator of k and -101/8. 32 Suppose -42d - 11d + 106 = 0. Let o = -1 - -9. Calculate the least common multiple of o and d. 8 Let q(i) = -i - 3. Let m be q(-11). Suppose 3o - 19 = m. What is the lowest common multiple of 1 and o? 9 Suppose -5t = 3m - 57, 24 = -3t - 2m + 59. What is the common denominator of 1086/(-72) + (t/3)/(-18) and 87/8? 8 Let i = -1009/134330 - 131/505. What is the common denominator of i and -3/8? 1064 Suppose -6 = 8a + 2. What is the least common multiple of (1/a)/((-4)/40) and 16? 80 Suppose 4a + 5m = m + 21580, 10778 = 2a + 5m. Let j = -64643/12 + a. Calculate the common denominator of 53/30 and j. 60 Let o be (-1)/(-4) - 106/8. What is the common denominator of (-89)/12 - -1 - 1 and ((-10)/(-7))/(((-8)/o)/2)? 84 Find the common denominator of 59/68 and ((-105)/(-850))/(45/195). 340 Let r be 24/(2 - -4) + (10 - 0). Suppose -rs + 40 = -6s. Calculate the least common multiple of 53 and s. 265 Let v(f) = -f2 - 5f + 2. Let u be v(-5). What is the common denominator of (-2)/1 - (-222)/20 and (u/10)/(-3 - (-1333)/445)? 10 Let i = 7573/380 + -410/19. Calculate the common denominator of i and -3/22. 220 Let g = 1269209/51653 - 3/7379. Let u = -4751/168 + g. Calculate the common denominator of u and -11/20. 120 Let z be (-984)/10 - (-4)/10. What is the common denominator of (-1 - 0) + z/(-6) and ((-78)/(-4))/((-737)/134)? 33 Let y(k) = k*2 + 5k - 7. Let b be y(-6). Let v be 2 + (8 - (b - 1)). Find the common denominator of 79/4 and v/(-6) - 178/(-12). 12 Suppose 4 = 5o - 4d, -4o + 2d + 12 = o. Let s be 4(4/(-8) + o). What is the lowest common multiple of (-4)/s - 45/(-35) and 11? 11 Let u be (-61)/(-3) - (-5)/(-15). What is the common denominator of (-4)/u - (-627)/135 and -115/6? 18 Let f be (50/125)/(((-1)/(-1))/5). Suppose 0 = fm - 5h - 28, -m - h - 1 = 4h. What is the least common multiple of m and 6? 18 Suppose 28y = 30y + 8. Let f = y + 13. Calculate the least common multiple of 2 and f. 18 Let o(n) = 7n2. Let l be o(-1). Suppose -602 = 5r - l. Let m = r - -77. Calculate the common denominator of -29/6 and m. 6 Let r = -245 + 357. Let x = r - 135/2. Let v = -10639/13104 + -1/1638. Calculate the common denominator of x and v. 16 Calculate the common denominator of (-626)/112 + (-6)/21 and (-177)/782/(-4). 104 Let y(t) = -t2 - 13t + 4. Let s be y(-13). Suppose sq - 38 = -10. Suppose 2c = -5 + 9. What is the least common multiple of c and q? 14 Calculate the common denominator of (-3)/(-4)296/(-636)-1 and (-18)/(-27) + 598/(-24). 212 Calculate the common denominator of 15/(-120)151/(-12) and 12. 96 Let t = -8832779/180 + 49072. Let l = 126389/14 + -9033. Calculate the common denominator of t and l. 1260 Let f be (-2 - 1)(-15)/9. Suppose 3r + 16 = fr. Suppose 28 = 4h + r. What is the smallest common multiple of 4 and h? 20 Let y(x) = -16x - 161. Let s be y(0). Let v = -157 - s. What is the smallest common multiple of 4 and v? 4 Let s = 449365/32 + -14044. Calculate the common denominator of s and -121/48. 96 Suppose 0 = 4l - 2l. Let f(s) = -s + 14. Suppose 2i - 43 + 3 = 0. Calculate the lowest common multiple of f(l) and i. 140 Let w(u) = -u2 + 12u + 26. Let b be w(14). Calculate the smallest common multiple of 18 and 2b - 344/(-4). 738 Let g = -1941 - -1963. Suppose 3x - 74 + 27 = -u, 2x = -3u + 43. What is the smallest common multiple of x and g? 154 What is the least common multiple of 91 and (-5)/10(-44 + -5 + -3)? 182 Let n = 4247 + -25337/6. What is the common denominator of 26/183 and n? 366 Let j = 495 + -267. Suppose 0 = -r + 7r + j. Calculate the common denominator of 77/8 and r. 8 Suppose 3y + 5 = -3w + 7y, -15 = -3y. Suppose 2b + 168 = 5b. Suppose -wu = -u - b. What is the least common multiple of u and 14? 14 Let n = 60 - 54. Suppose 15 = 3p + 3l, 3p = -4l - l + 17. Calculate the smallest common multiple of p and n. 12 Let m = -4/2043 + -13585/365697. Let j = 9501/358 + m. Calculate the common denominator of j and 33/20. 20 What is the common denominator of 83/14 and (-4)/6 - (-28 + 19) - 1? 42 Let d = -2/613 - 32335/47201. Find the common denominator of 4/63 and d. 693 Suppose -2p + 7p = 10. Suppose -4i + 22 = t, 5t = -3i - 2 + 61. Suppose 0o - 5o = 2a - t, 30 = 2a - 5o. What is the lowest common multiple of a and p? 10 Let o(v) = 4v - 32. Let z = 14 + -6. What is the lowest common multiple of z and o(9)? 8 Let j be (-2 - -1) + -3 + 5. Let u(q) be the first derivative of 13q4/4 - 2q3/3 + q2 - q - 8. What is the least common multiple of 14 and u(j)? 84 Let c = 2689/25 + -69399/650. Find the common denominator of c and 5/143. 1430 Suppose -3w + 2f = -5, 0 = 5w - f + 6f - 25. Let y be 2/26/2. What is the least common multiple of (6(-4)/y)/(-2) and w? 12 Let z = 23 + -13. Calculate the least common multiple of z and (5/10)/(3/60). 10 Let o be 5 - (-2 + 2)/1. Suppose 0 =	{ "pile_set_name": "DM Mathematics" }
129191? 1 Is -1/36296147 not equal to 1? True Is 194688 not equal to 195290? True Which is greater: -37164 or -36764? -36764 Which is greater: 0 or 603/129622? 603/129622 Is 901/678809 less than -1? False Which is bigger: -22.3 or 129485? 129485 Is -56271621 equal to 5? False Which is smaller: 174/20027 or 0? 0 Is -54726833/3 equal to -18242279? False Is -2232/56977 less than or equal to 0? True Which is greater: -7920998 or -8.1? -8.1 Are -18280 and -12524 non-equal? True Which is smaller: -2401928 or -2401926? -2401928 Which is bigger: -7.83 or -21668? -7.83 Is 61088864 > 61088866? False Is 2127350 at most as big as 2127308? False Which is greater: -101/161488 or 1? 1 Are 1517429 and 1517428 equal? False Is -12/30067511 bigger than -1? True Which is bigger: -57524 or -8341186/145? -57524 Is -3777764 less than -3777765? False Is 1 bigger than 1/24132145? True Which is bigger: 5 or 29292/8303? 5 Is -1 at most 190/55149881? True Is -966 not equal to -13906? True Is -84834479 less than or equal to -84834480? False Which is smaller: 17126/97 or 0.0598? 0.0598 Is 1 > 4/720471939? True Do -0.260552 and 17 have the same value? False Which is smaller: -18253836/37 or -493346? -18253836/37 Is -17936/1437 at least -11? False Is 383 not equal to 28481? True Is 24790752 bigger than 24790753? False Which is smaller: 1244/49 or 505? 1244/49 Which is bigger: 34896 or 290? 34896 Is 13851673 less than or equal to 13851682? True Do 630/3161 and -1 have the same value? False Is 69126478 at least as big as 69126477? True Which is smaller: -54975 or -6322197/115? -6322197/115 Which is smaller: 75429997 or 75429996? 75429996 Is -111947 less than -112110? False Which is bigger: -1 or -20700.748? -1 Which is greater: 2/4255595 or 1? 1 Is -4/2595725 at most -1? False Are 6889055/9 and 765450 equal? False Which is smaller: 38833 or 38905? 38833 Which is smaller: -126896444/3 or -42298816? -42298816 Is -375381 less than or equal to -375344? True Is -60561 > -60466? False Which is smaller: -46963 or 283? -46963 Is 13591/13393 smaller than 1? False Is -661923 at most -662237? False Is 2/135 less than -6456946? False Which is smaller: -73517/197 or 2/13? -73517/197 Is 9 bigger than 274.521? False Is -243/1999537 bigger than 1? False Is 213081/53 > 4021? False Are -160979 and -161008 non-equal? True Is 45930020/3 < 15310008? True Which is smaller: 19388345/4 or 4847085? 4847085 Is -20259/43 at least 251? False Is 0 greater than 1/149606383? False Is 0 at most as big as 539/33832? True Is -3862878 != -3862881? True Is 0 at least 973216363? False Is -7.3489602 > 1/9? False Is -1 at most as big as 728/950527? True Is -1331/24264 < 1? True Which is smaller: -99069 or -99047? -99069 Is -32997/415 smaller than -81? False Is -2/6729307 greater than or equal to 0? False Is 83846 less than 83740? False Which is greater: 97376 or 97190? 97376 Is -1800430 at least as big as -1800429? False Which is bigger: 1 or 11703/205388? 1 Is 527932 less than or equal to 527861? False Is 1162 at most as big as 45786/5? True Is 2 at least 83368/26109? False Which is greater: 680863 or 680852? 680863 Is -134128 != -134227? True Is 11.1965 at least as big as 8? True Which is greater: -28684 or -9.123? -9.123 Is 3831 at least as big as -7157? True Which is bigger: 0.40727926 or -5? 0.40727926 Is -7610/53337 at least 0? False Which is bigger: -8684787 or -8684803? -8684787 Which is smaller: -53623 or -44261? -53623 Is 3 less than 73780/207? True Which is smaller: -4970428 or -4970429? -4970429 Which is bigger: 17/6541 or 328? 328 Which is smaller: -5473112 or 0.3? -5473112 Is 62594064 at most as big as 62594064? True Is -1607.165 > 38? False Is 0 > 43554186.2? False Which is smaller: -11103 or -2/671? -11103 Is -24/5564927 greater than -1? True Which is bigger: -8995167 or -8995172? -8995167 Which is smaller: 68/39400995 or -1? -1 Is -1705/65581 greater than or equal to 1? False Is 25/1666746 equal to -8? False Which is smaller: 40 or 51860/1273? 40 Which is bigger: 15658312 or 15658313? 15658313 Is 3/4 at least 139854? False Which is greater: 54164084 or 54164090? 54164090 Are -169649540 and -169649541 equal? False Is -1 at least as big as -109/64266? False Which is smaller: 407711 or 30/47? 30/47 Is -6660778 bigger than -6660779? True Which is smaller: -1/2 or 4612773? -1/2 Which is greater: 32554475 or 32554477? 32554477 Does 2.9023789 = -1? False Is -28015220 > -28015218? False Is -17889235 at most -17889235? True Is -8/55940045 smaller than 1? True Is 8/485 greater than or equal to 4729? False Which is bigger: -350264 or -350266? -350264 Which is greater: 3464833 or 12? 3464833 Are 7/8957205 and 0.2 equal? False Is 7/418404218 at least -1? True Is 4767 greater than 1885? True Which is smaller: -2949797 or -2949794? -2949797 Is -1 equal to -2505/55771? False Which is bigger: 41 or 37375/916? 41 Is -169 at least -288? True Is -1559482 <= -1559477? True Which is bigger: -357 or 0.47676? 0.47676 Which is smaller: -14442/2941 or -4? -14442/2941 Is -1 at least 438/1496419? False Which is bigger: 1654 or -29279? 1654 Is 26081 at most 2112502/81? False Is -3032804 at least as big as -3032809? True Is 1 equal to 203/4903245? False Is -31087 > -30878? False Is -1/3 bigger than 23357982? False Is 75801/40 at least as big as 1895? True Are 37306/55 and 1 nonequal? True Is 7848894 at least 7848895? False Which is smaller: -0.32 or 3636547? -0.32 Which is smaller: -25 or -75813/3110? -25 Does 189268 = 188962? False Which is bigger: 1004285204 or 1004285206? 1004285206 Is -201208 at least as big as -201382? True Which is smaller: 191994330 or -1? -1 Which is greater: -158157 or -158283? -158157 Is 329842/175 at least -1? True Are 46316109 and 46316108 unequal? True Which is smaller: -846 or 2028? -846 Is -423 > 8558? False Which is smaller: 0 or -126/7873909? -126/7873909 Which is bigger: -295256 or 0.058? 0.058 Which is greater: 306/173761 or -1? 306/173761 Is -5475681 > -5475730? True Is 0 <= -5/22625469? False Is 563841/1256 greater than or equal to 448? True Which is bigger: -1 or 55/702838? 55/702838 Which is greater: -141292 or -621? -621 Is 1724017 at least as big as 1724021? False Is -1050526 greater than or equal to -1050507? False Which is smaller: 4903 or 2993? 2993 Which is greater: -3602938 or -3602937? -3602937 Which is smaller: -5 or -1451/81? -1451/81 Which is smaller: -23928634 or -23928633? -23928634 Is 3 > -8619729? True Is -132860744 bigger than -132860744? False Which is smaller: -8065 or -8035? -8065 Is 28049/10 < 0.007? False Which is bigger: -3060.4 or -5692? -3060.4 Is -341 greater than 169199? False Is -17/500490 bigger than 1? False Is 9600050 greater than or equal to 9600065? False Which is smaller: -15 or -7.25689? -15 Which is smaller: -3541224 or -3541160? -3541224 Which is greater: 21 or 18148/861? 18148/861 Do 211 and 89129/425 have the same value? False Which is greater: -740014385 or 2? 2 Does -4024997 = -4024998? False Is 35457 < 35601? True Which is bigger: 0.26 or -33696886? 0.26 Is 555 bigger than 138116/249? True Is -176 greater than or equal to 279898? False Is 14/1042929 greater than or equal to -1? True Is 1 less than -387471852? False Is -1868161 bigger than -1868188? True Which is smaller: -83091326 or -83091333? -83091333 Does 50/61 = 26407? False Do -27193 and -27596 have different values? True Are -14665451 and -14665450 unequal? True Is 0 equal to 10/126468547? False Which is bigger: -11253 or -7.0212? -7.0212 Which is bigger: 6273576.1 or 0? 6273576.1 Is 273 < 10636? True Is -3017331 less than -51294606/17? True Are 117888593 and 117888593 nonequal? False Do 156/10369 and 0 have the same value? False Is -3/10 smaller than -40047? False Is -12/21609583 > 0? False Which is smaller: 3/410841149 or 0? 0 Is -647181911/4 < -161795477? True Is -38909096 not equal to -38909093? True Which is smaller: -45729719 or -45729724? -45729724 Which is greater: -7787 or -8376? -7787 Is 0.41 at least as big as -5528743? True Is 91194 < 91296? True Is -1147/320796 smaller than -1? False Is -3681/9754 > -1? True Which is bigger: 336/7997 or 3/4? 3/4 Which is smaller: -8818633 or -8818624? -8818633 Is -325927 <= -325895? True Is -14432536/21 greater than -687263? False Which is	{ "pile_set_name": "DM Mathematics" }
Let s(d) = -553418d2 - 697d. Let c(g) = 5562g2 + 7g. Let n(w) = 697c(w) + 7s(w). Let k(a) = -2a. Determine k(n(u)). -5576u*2 Let f(s) = -89s*2. Let o(u) = -34844u + 17418u + 3 + 17390u - 2. Give f(o(m)). -115344m2 + 6408m - 89 Let h(b) = 27b. Let s(r) = -9r - 9r + 5r. Let z(q) = 4h(q) + 7s(q). Let m(p) be the third derivative of p*5/12 + 3211p*2 + 3p. Determine m(z(g)). 1445g2 Let f(x) = -21x. Let j be 4 - 7 - 1-13. Let s = j + 5. Let a(c) = -21c + 52c - sc - 14c. What is f(a(q))? -42q Let o(w) = -121278w. Let n(f) = -224f. Give o(n(a)). 27166272a Let t = -60 + 69. Let y(f) = -7f + 4f - tf. Let k(w) = 4w2. Determine k(y(x)). 576x*2 Let t(x) = -x - 828. Let w(z) = 246 - 87 - 82 - 3z*2 - 77. What is w(t(d))? -3d*2 - 4968d - 2056752 Let f(k) = 10k2 + 135k + 270. Let u(v) = 3v + 6. Let o(i) = 2f(i) - 90u(i). Let c(b) = -2b*2 + 399. Determine c(o(m)). -800m*4 + 399 Let i(j) = 66j - 17. Let z(d) = -62d2. Let c(s) = 555s*2. Let x(g) = c(g) + 9z(g). Determine i(x(w)). -198w2 - 17 Let b(g) = -25g*2 - 4g. Let y be (189/(-6) + -1)18/(-5). Let p(f) = 728f*2 + 117f. Let l(t) = yb(t) + 4p(t). Let j(d) = 13d. Calculate l(j(m)). -2197m*2 Let j(w) = -574w*2. Let d(n) = -145164n*2. Give d(j(o)). -47828054064o*4 Let y(h) = 17h - 26. Let q(j) = -4j + 6. Let i = 185 - 179. Let w(g) = iy(g) + 26q(g). Let m(x) = 3x + 4 - 4. Give m(w(d)). -6d Let k(h) = -2h2 - 52 + 52. Let g(f) be the first derivative of f5/20 + 7f2/2 + 17. Let l(b) be the second derivative of g(b). What is k(l(z))? -18z4 Let l(j) be the second derivative of -j3/3 + 27j2/2 + 1736j + 4. Let d(o) = -o*2 + 3. Let s(b) = -1. Let w(g) = d(g) + 3s(g). What is w(l(r))? -4r2 + 108r - 729 Let j(q) = 27q2. Suppose 3b - 5 = -k, -2b + 4k + 14 = 3b. Let x(t) = -19 - 6t + 8 + 9 + b. Determine x(j(s)). -162s2 Let s(j) be the first derivative of -6j*3 + 57j + 531. Let v(q) = -3q. Calculate v(s(h)). 54h*2 - 171 Let y(j) = 54j. Let d(u) = -2u2 + 4u. Let h be 6 + ((-4)/(-3))/(28/(-42)). Let l(m) = -4m2 + 9m. Let g(k) = hl(k) - 9d(k). What is y(g(t))? 108t2 Let f(p) = -455p - 458p + 908p. Let b(o) be the second derivative of o5/30 - o3/2 - 2o. Let a(i) be the second derivative of b(i). Give a(f(s)). -20s Let m(h) = 4h2 + 6h - 6. Let o be m(1). Let p(t) = 4 - 15t - o - 5t. Let k(z) = -2z2. Give k(p(l)). -800l*2 Let v(i) = 6i. Let u(a) be the third derivative of 20a2 - 1/3a*3 + 2a + 0 - 1/3a4. Determine u(v(m)). -48m - 2 Let d(w) = 21w + 16w + 14w + 4 - 48w + 36. Let x(y) = 5y. Determine x(d(h)). 15h + 200 Let u(h) be the first derivative of h*3 - 46. Let m(t) = -810t*2. What is u(m(x))? 1968300x*4 Let c(t) = -126t + 6. Let f(r) = -48262r + 2301. Let k(q) = -1534c(q) + 4f(q). Let h(l) = -6l*2. Give h(k(u)). -334176u*2 Let q(g) = -1204214g - 14g2 + 1204214g. Let s(h) be the second derivative of 8h3/3 - 34h. Calculate s(q(r)). -224r2 Suppose 7 = 7x - 7. Let p(w) = -5 - 3 + 0 + 3wx + 4 + 3. Let r(d) = 8d*2. Determine p(r(n)). 192n*4 - 1 Let w(a) = -4492a + 865. Let v(b) = -10b. Calculate w(v(k)). 44920k + 865 Let w(n) be the second derivative of 2n3 - n2/2 - n + 230. Let j(t) = -10t. Determine w(j(a)). -120a - 1 Let v(t) = -t2. Let j(x) = -4x*2 + x - 1. Let r(p) = 5220p*2 - 1740p + 1740. Let w(n) = -1740j(n) - r(n). Calculate w(v(f)). 1740f*4 Let q be ((-6)/(-8))/((-1)/(-4))1. Let y(a) = 5a2 + 67. Let z(f) = -12f*2 + 43 + 16f*2 + 25. Let r(i) = qz(i) - 2y(i). Let b(u) = u. What is b(r(w))? 2w*2 + 70 Let a(q) = -43q*2 - 3q - 6. Let x(n) = 272n2 + 19n + 38. Let k(i) = -38a(i) - 6x(i). Let b(s) = 5s2 + 61. Calculate k(b(d)). 50d*4 + 1220d*2 + 7442 Let t(b) = b. Let m(z) be the second derivative of 959z*3/3 + 1654z. What is m(t(c))? 1918c Let f(u) be the first derivative of 3u*3 - 414. Let x(d) = -63d*2. Determine f(x(l)). 35721l*4 Let n(f) = 11f*2 - 17. Let l(a) = 5a*2 - 6a*2 + 124 + 126 - 250. Calculate l(n(g)). -121g*4 + 374g*2 - 289 Let w(v) = 131v + 39. Let s be w(27). Let c(m) = -s + 3576 - m. Let p(r) be the first derivative of r*2/2 + 55r - 1. Calculate p(c(b)). -b + 55 Suppose -4f = -4l - 2f + 10, 5l - 5f - 15 = 0. Let i(a) be the first derivative of -312 + 0al + 330 + a2. Let z(j) = j - 11. Determine z(i(g)). 2g - 11 Let d(u) = -219u + 2951. Let r(c) = -131c + 1476. Let n(t) = 3d(t) - 5r(t). Let g(h) = h2. Calculate n(g(f)). -2f*2 + 1473 Let t(j) = 47j. Let d(p) = -76p2 - 1310p + 3943p - 1318p - 1315p. Calculate d(t(b)). -167884b*2 Let j = -88 + 105. Let y(u) = j + 2u*2 - 17. Let i(d) = -63d*2 - 77d. Let n(m) = -m*2 - m. Let b(o) = 2i(o) - 154n(o). What is b(y(h))? 112h*4 Let s(p) = -11p*2. Suppose -3t - 3u + 274 + 152 = 0, 5t = 4u + 683. Let z(b) = -2b + 139 - t. What is z(s(r))? 22r2 Let w(y) = -28y*2 - 14. Suppose 23 = -3d + 29. Let s(p) = p*2 + 1. Let a(n) = dw(n) + 28s(n). Let o(b) = 0b + 3b - 5b. Calculate a(o(c)). -112c2 Let p(q) = 3q*2 + 0q*2 + 40q*2 - 7q*2 - 37q*2. Let o(h) = -94h - 4. Determine o(p(j)). 94j2 - 4 Let q(s) = -4s*2 + 3s. Let f(d) = -12d2 + 8d. Let c(y) = -3f(y) + 8q(y). Let w(l) be the third derivative of 23l4/24 - 799l*2. Determine w(c(i)). 92i*2 Let w(t) = -2t2. Let r(k) = -k2 + 1. Let z(o) = -4o2 + 36. Let p(m) = 144r(m) - 4z(m). What is p(w(v))? -512v4 Let r(i) be the third derivative of -i4/12 + 158i2. Let o(u) = u2 - 1746. What is r(o(j))? -2j*2 + 3492 Let i(l) = -1100 + 2666 - 1566 + 58l*2. Let f(s) = -2s - 3. Let g(t) = 10t + 14. Let q(r) = 14f(r) + 3g(r). Give q(i(y)). 116y*2 Let j(w) = 527w*2. Let a(z) = 45z*2 - 4z - 12. Let o(k) = 79k2 - 7k - 21. Let u(f) = 7a(f) - 4o(f). Determine j(u(c)). 527c4 Let a(b) be the first derivative of -b2 + 134b - 321. Let t(w) = 581w2 - 289w*2 - 291w*2. Calculate t(a(i)). 4i*2 - 536i + 17956 Let u(q) = -2q2 - 51. Let z(c) = 6606c + 2. Give z(u(g)). -13212g2 - 336904 Let g(h) = 291h*2 + 2. Suppose 12 - 46 = 17q. Let y(c) = -6400c2 - 45. Let b(o) = qy(o) - 45g(o). Let u(j) = 2j*2. Give u(b(k)). 174050k*4 Let i(q) = 52044085q*2. Let z(l) = -5l. Calculate z(i(a)). -260220425a2 Let p(j) = -16j. Let g(n) = -613543n. Calculate p(g(b)). 9816688b Let c(g) = -58991653g2. Let b(v) = 8v*2. Calculate b(c(f)). 27840120989379272f*4 Suppose -60 = -13i - 34. Let a(p) = -299p2 + 3 + 280p*i - 4 + 1. Let z(q) = 3q. Determine a(z(f)). -171f2 Let a = 148 + -146. Let k(c) = 672 - 335 - 337 - 19c*a. Let b(t) = -5t. What is b(k(g))? 95g2 Let f(s) = -1128s - 15. Let j(m) = -565m - 6. Let w(g) = -2f(g) + 5j(g). Let u(l) = l2. Give w(u(b)). -569b*2 Let i(k) be the third derivative of 1/24k*4 + 0k3 + k2 + 0 + 0k. Let n(z) be the first derivative of -5z*3/3 - 1511. What is n(i(d))? -5d*2 Let c(z) be the second derivative of 0z*2 + 0 + 1/2z*3 - 14z. Let u(r) = -21r - 10r + 37r. Calculate u(c(i)). 18i Let g(w) = w. Let i(a) = 9a + 4. Let n(o) = 13o + 7. Let y(m) = 6m3 + m2 + m + 1. Let d be y(-1). Let h(k) = dn(k) + 8i(k). What is g(h(p))? 7p - 3 Let k(l) be the second derivative of -7/6l3 + 0 + 151l + 0l2. Let r(g) = -8g*2 - 5g. Let d(u) = u*2 + u. Let c(w) = 5d(w) + r(w). What is k(c(h))? 21h2 Let n(h) = -91 + 1065h + 89 - 2051h + 1031h. Let c(r) = 12r - 1. Calculate n(c(a)). 540a - 47 Let l(w) = -13w - 116. Let o(y) = -23y - 203. Let x(t) = -7l(t) + 4o(t). Let r(z) = -z. Let p(n) = 80n + 2. Let d(i) = -p(i) - 6r(i). What is d(x(j))? 74j - 2 Let a = 1011 - 1005. Let y = -17 + 32. Let l(p) = -17p*2 + yp*2 - ap*2. Let w(s) = -5s*2. Calculate l(w(g)). -200g*4 Let o(g) = -10679 + 10679 - 2g*2. Let k(b) = 2278b*2. Calculate o(k(w)). -10378568w4 Let b(u) = u2 - 35u + 252. Let x be b(7). Let m(z) = xz - 36z - 25z. Let j(r) = 6r2. Give j(m(q)). 150q*2 Let a(v) be the first derivative of -7v*3/3 - 837. Let g(o) = 3o - 58. What is a(g(q))? -63q2 + 2436q - 23548 Let y(j) = -5*j - 47. Let o(p) = -335385	{ "pile_set_name": "DM Mathematics" }
e 3. 12011111002000 Convert 11c145 (base 14) to base 8. 2246221 Convert 30024430 (base 5) to base 13. 836b4 What is 3324555 (base 6) in base 8? 506067 261550 (base 9) to base 2 100110101110110011 Convert -11105541 (base 6) to base 8. -1217445 Convert 194b78 (base 12) to base 11. 283687 What is 3b373 (base 15) in base 16? 2e557 -30533355 (base 6) to base 8 -3275247 What is -88688 (base 12) in base 2? -101100000111001000 -636733 (base 9) to base 6 -12042220 -252786 (base 9) to base 11 -a4a57 Convert -11101001110100111 (base 2) to base 14. -318b5 2c3b45 (base 13) to base 6 35240001 Convert 243322 (base 8) to base 11. 57950 29465 (base 14) to base 7 604355 48461 (base 13) to base 15 29435 What is -34133442 (base 7) in base 13? -7cb327 3541204 (base 6) to base 9 310754 10b287 (base 12) to base 14 6da75 Convert -244594 (base 10) to base 2. -111011101101110010 What is 23304221 (base 6) in base 10? 724117 -194a6 (base 13) to base 14 -13ca6 What is -1b395b (base 13) in base 16? -a9594 Convert -b7c800 (base 14) to base 5. -3043010342 What is -757a382 (base 11) in base 2? -110010110100100011000000 Convert -21071 (base 14) to base 9. -131257 1170be (base 15) to base 14 179c16 Convert 11c421 (base 15) to base 13. 23a709 -10100111001111010 (base 2) to base 9 -140410 Convert -526334 (base 9) to base 13. -ac621 What is 2362641 (base 7) in base 5? 34114014 -1414186 (base 10) to base 5 -330223221 -103551 (base 10) to base 14 -29a47 Convert -931412 (base 12) to base 15. -307a0e Convert -130222301030 (base 4) to base 13. -1731893 Convert 114103 (base 10) to base 8. 336667 1412a6 (base 12) to base 11 208972 Convert -5794a (base 13) to base 15. -32512 What is 5c3dd (base 14) in base 7? 1630166 -39692 (base 16) to base 2 -111001011010010010 What is -10110110001100100100 (base 2) in base 5? -142340101 -d685 (base 14) to base 16 -9065 Convert 10001111101110111001011 (base 2) to base 6. 244540443 1100212001011 (base 3) to base 5 141203021 Convert -111100011000010100011 (base 2) to base 5. -1001303111 1d7c10 (base 15) to base 4 11200200000 What is -163a90 (base 15) in base 7? -12066651 What is -95358 (base 10) in base 15? -1d3c3 What is 101110111110010101110 (base 2) in base 13? 41b7c7 What is -12102012200 (base 3) in base 10? -106587 -560513 (base 8) to base 2 -101110000101001011 What is -8e41da (base 15) in base 4? -121323211300 -318d03 (base 15) to base 13 -64778a 2655a7 (base 14) to base 6 44151411 Convert -57676 (base 14) to base 7. -1543506 -3686ab (base 12) to base 13 -250202 What is 11260660 (base 8) in base 10? 2449840 Convert 5b425 (base 13) to base 8. 507377 What is 2220112202 (base 3) in base 2? 1101111110101100 Convert 1110111010001000 (base 2) to base 16. ee88 What is -158d3 (base 16) in base 11? -60360 Convert 100100001001111111 (base 2) to base 12. 71853 Convert -a85480 (base 11) to base 7. -20513626 What is -26910 (base 11) in base 4? -21113200 What is 2764406 (base 8) in base 13? 214384 -101000100010000100110 (base 2) to base 11 -827964 What is 33003313 (base 5) in base 13? 9b2bb Convert -a0697 (base 11) to base 14. -3b934 What is 8b200 (base 12) in base 4? 231031200 Convert 581544 (base 9) to base 4. 1111023223 What is -101200110202 (base 3) in base 10? -210296 2346515 (base 10) to base 4 20330320103 What is -2425054 (base 8) in base 5? -132304111 What is 2053201 (base 8) in base 11? 3435a8 -4c097 (base 13) to base 2 -100010010110111100 Convert 340153034 (base 6) to base 2. 10111100011001101001110 What is 5433b (base 12) in base 11? 764a4 What is -757aa (base 11) in base 13? -3b16c What is -2a7059 (base 11) in base 12? -1b0685 What is -1251414 (base 6) in base 13? -25582 What is -2444a (base 12) in base 6? -1014534 What is -212262633 (base 7) in base 3? -212210001100100 Convert -9b2162 (base 13) to base 8. -15755243 What is -11000100101001011 (base 2) in base 3? -12010010000 What is -d15a (base 16) in base 13? -1b518 What is -454130525 (base 6) in base 3? -120122112021022 Convert -4620788 (base 9) to base 8. -11406603 What is 2110202211012 (base 3) in base 11? 81846a Convert -3352167 (base 12) to base 16. -95b75f What is -1cc29 (base 13) in base 6? -1115500 What is 7c23a (base 14) in base 13? a7788 Convert -31403 (base 7) to base 10. -7745 154233105 (base 6) to base 15 44d99e What is 2012023041 (base 5) in base 10? 4017271 What is -1055543252 (base 6) in base 14? -17c00c8 What is -6d716 (base 14) in base 6? -5422412 What is -15131125 (base 8) in base 16? -34b255 What is -78ccc8 (base 15) in base 3? -101211211201222 Convert 8265 (base 13) to base 8. 43115 Convert -7669dc (base 14) to base 3. -21112220202001 What is -1000101100011011110101 (base 2) in base 9? -4253366 What is -1b9c34 (base 14) in base 8? -3610546 -271113 (base 8) to base 4 -113021023 What is 4c7415 (base 13) in base 6? 103304533 -6514 (base 11) to base 2 -10000110011110 What is 222302201 (base 4) in base 3? 22220102022 -435043 (base 7) to base 8 -224621 What is 1100010100101111011 (base 2) in base 10? 403835 What is -2232204 (base 5) in base 16? -9aff Convert a3671 (base 11) to base 3. 21200102021 -46a17 (base 14) to base 10 -172109 189b4 (base 14) to base 7 346414 What is 65333241 (base 7) in base 15? 755bc3 -36713 (base 12) to base 8 -217577 What is 11111011100100000110 (base 2) in base 3? 1221100110012 -13232333 (base 5) to base 7 -1064056 What is 2b87c (base 15) in base 16? 22404 What is -211430351 (base 6) in base 8? -16143373 What is 10004103 (base 5) in base 9? 128802 What is -42102402 (base 5) in base 13? -c207a Convert 344654 (base 14) to base 12. 719882 Convert -1023211321 (base 4) to base 12. -12b221 81af5 (base 16) to base 6 15215113 -372511 (base 8) to base 3 -20112000221 Convert 3202325 (base 8) to base 2. 11010000010011010101 What is 1441462 (base 7) in base 2? 101111100111111000 -864344 (base 11) to base 15 -1c4729 What is -455335 (base 9) in base 6? -5503305 What is -56205 (base 9) in base 15? -b0eb What is cc7670 (base 15) in base 3? 200100002201220 212202102110 (base 3) to base 10 467598 What is 141678 (base 9) in base 6? 1504455 Convert -5022312 (base 10) to base 5. -2241203222 197837 (base 10) to base 16 304cd Convert 14700b (base 13) to base 16. 7a4bf -275b4a (base 12) to base 14 -13001c 3042400 (base 5) to base 14 1419b What is -796899 (base 11) in base 5? -311040223 -113032230 (base 4) to base 8 -271654 Convert 6234284 (base 11) to base 10. 11001049 Convert -19a074 (base 12) to base 10. -452824 132130332300 (base 4) to base 6 443034240 Convert 91c4b6 (base 16) to base 3. 122222100100201 What is 12135326 (base 8) in base 6? 133113422 -486997 (base 16) to base 2 -10010000110100110010111 65de2 (base 15) to base 9 543105 Convert 231336 (base 8) to base 6. 1403410 What is 253564 (base 11) in base 3? 202022122220 What is 535378 (base 9) in base 8? 1156647 What is 15252 (base 11) in base 6? 243551 2373017 (base 8) to base 11 406519 Convert -68a94 (base 11) to base 7. -563661 -2123646 (base 8) to base 2 -10001010011110100110 Convert 29e5e1 (base 16) to base 8. 12362741 Convert -10113124 (base 7) to base 9. -1525477 -1100220102101 (base 3) to base 8 -2612567 What is 133408 (base 9) in base 10? 81251 What is 154513532 (base 6) in base 7? 40052144 Convert 5437c (base 14) to base 4. 301233222 Convert 804985 (base 11) to base 3. 2102210021210 7b3446 (base 14) to base 10 4196422 Convert 103032 (base 6) to base 4. 2003330 Convert -1230030210 (base 5) to base 14. -574876 Convert -c4c0 (base 16) to base 2. -1100010011000000 What is 1c1707 (base 13) in base 14? 14963a -115361353 (base 7) to base 16 -6e80d8 What is -11101010001000101 (base 2) in base 12? -59459 What is 443205 (base 6) in base 5? 2141023 Convert 1616522 (base 10) to base 5. 403212042 What is -340de (base 16) in base 15? -43294 -11025651 (base 7) to base 14 -1a96d1 What is -8b277 (base 13) in base 2? -111101110010100011 What is 24154314 (base 7) in base 14? 3dcb44 2c482 (base 16) to base 12 88b6a 6675033 (base 8) to base 16 1b7a1b What is -73266 (base 12) in base 6? -3121410 What is 1534233 (base 6) in base 12? 44379 What is -33160 (base 11) in base 13? -18b83 Convert -400304023 (base 5) to base 3. -2221212220121 -181290 (base 11) to base 14 -73db5 -44033344 (base 5) to base 15 -76c19 -11010120000201 (base 3) to	{ "pile_set_name": "DM Mathematics" }
Let t = 3 + 2. Let b = 27 + t. Calculate the remainder when b is divided by g. 10 Suppose -36 = -k - 3v + 99, -5v = 4k - 568. Calculate the remainder when k is divided by 15. 12 Let o = 17 - 18. Let t = 20 + o. Calculate the remainder when t is divided by 7. 5 Suppose -n - 3n + 16 = 0. Suppose -nq + 4 = -2q. What is the remainder when 28 is divided by q + (-13)/1-1? 13 Let y = 89 + -28. Let h = y + 0. What is the remainder when h is divided by 16? 13 Suppose -v + 176 = v + 5o, -4v + 332 = 5o. Calculate the remainder when v is divided by 42. 36 Suppose 390 = -7f + 9f. What is the remainder when f is divided by 33? 30 Suppose 4f + 4r + 2362 = -11590, 2f = -5r - 6976. What is the remainder when f/(-60) - (-4)/(-30) is divided by 12? 10 Suppose -4i + 36 = -16. Calculate the remainder when 88 is divided by i. 10 Let y(l) = 3l*2 + 3l - 2. Suppose 0 = 4u + 3d - 126, u + 10 - 44 = -2d. What is the remainder when u is divided by y(-3)? 14 Suppose 0 = -6r + 3 + 45. Calculate the remainder when 15 is divided by r. 7 Let l = 5 + 9. Let v = -13 - -9. What is the remainder when l is divided by (-3 + v/(-2))-5? 4 Suppose 4m - 212 = 4s, s + 3s + 156 = 3m. Suppose 2j + 2j = -4w + m, w - 38 = 5j. What is the remainder when 33 is divided by w? 15 Let t(s) be the second derivative of -s2/2 - 2s. Let w(f) = -f + 2. Let u(l) = -5t(l) - 2w(l). Calculate the remainder when 14 is divided by u(2). 4 Let y(s) be the third derivative of -s6/120 + s5/10 - s4/8 + s3/2 + s*2. Calculate the remainder when y(5) is divided by 6/(-33) + 237/33. 6 What is the remainder when 3 - (-98 + 2/(-1)) is divided by 26? 25 Let z(f) = 3f + 3. Suppose 3p - 7 = 2. Calculate the remainder when z(p) is divided by 21(-14)/(-4). 5 What is the remainder when 142 is divided by 3/(-4)1(5 - 29)? 16 Suppose -5b + 3z + 126 = 0, 7b - 124 = 2b + 2z. Let i = b - 19. Suppose 2j - 16 = -0j. What is the remainder when j is divided by i? 3 Let z = 0 + 18. Calculate the remainder when z is divided by 7. 4 Let l = 363 - 256. Suppose -4g + 6n - 3n - 117 = 0, -4g - l = -5n. Let j = -23 - g. Calculate the remainder when j is divided by 4. 2 Let r(l) = l + 7. Calculate the remainder when r(4) is divided by 3. 2 Suppose -767 = -4v - 9v. What is the remainder when v is divided by 15? 14 Let h be 3/(-2) + (-4)/8. Calculate the remainder when (34/h - -4)-1 is divided by 5. 3 Let z(a) = 6a + 16. Calculate the remainder when z(4) is divided by 22. 18 Let f(a) = a3 - 11a*2 + a + 14. What is the remainder when f(11) is divided by 13? 12 Let j(g) = g - 4. Let b be j(6). Let o be ((-63)/2)/(-7)b. Suppose 5a = -15, 0f - o = -f - 4a. Calculate the remainder when 41 is divided by f. 20 Let j be 8(-1 + (-9)/(-6)). Suppose -i - 33 = -ji. What is the remainder when 21 is divided by i? 10 Let r = 50 - 42. What is the remainder when r is divided by 4? 0 Let s(v) = -v3 + 10v*2 - 10v + 6. Let i be s(9). Let l = -1 - i. Calculate the remainder when 1 is divided by -2(-1 + 1/l). 0 Let y(i) = -i + 8. Let w(o) = -o3 - 6o2 - o. Let q be w(-6). Let n(f) = f3 - 5f2 - 3f - 14. Calculate the remainder when n(q) is divided by y(6). 0 Suppose -4x + 99 = -17. Calculate the remainder when x is divided by 17. 12 Suppose -79 = -4h - 3v + 61, -5v = -h + 12. Calculate the remainder when h is divided by 17. 15 Suppose -c - 131 = -132. Let t = 2 - 2. Suppose -3d - d + 4 = t. Calculate the remainder when d is divided by c. 0 Let l(t) = t2 - 11t + 7. Let s be l(11). Suppose -8 = -3h + 5o, -4h - 4o = s - 39. Calculate the remainder when h is divided by 4. 2 Suppose 54 = -b + 4b. Suppose 2d - b = -d. Let l = -7 - -11. Calculate the remainder when d is divided by l. 2 Suppose 66 - 24 = 2o. What is the remainder when o is divided by 6? 3 Let m(r) = -26r + 4. Let d be m(-3). Let u = d + -59. Calculate the remainder when 43 is divided by u. 20 Let x = 120 - 81. Calculate the remainder when 114 is divided by x. 36 Let d(t) = -t*3 - 5t*2 + 11. What is the remainder when d(-6) is divided by 13? 8 Let k = -18 + 13. Suppose -2m + 24 = -c, -c - 66 = -0m - 5m. Calculate the remainder when 1/k + (-272)/(-10) is divided by m. 13 Let u = -19 + 14. Let l(w) = -w*3 - 3w*2 - 7w + 2. Calculate the remainder when l(u) is divided by 22. 21 Let d(v) = -v - 1. Let n be d(8). Let m be (-6)/((n/(-6))/1). What is the remainder when 18/5 - m/10 is divided by 2? 0 Calculate the remainder when (-4)/(-10) + (-253)/(-5) is divided by 13. 12 Suppose 0 = -h, 0l = 4l + h - 8. Let m = l - -1. What is the remainder when 3 is divided by m? 0 Suppose -22 = -o + 4i, 5o + i = 10o - 148. Calculate the remainder when o is divided by (14)/(3/6). 6 Suppose -25v = -22v - 129. Calculate the remainder when v is divided by 17. 9 Suppose 0 = -3n + o + 10, -4n + 3o + 1 = -14. Calculate the remainder when 10 is divided by n. 1 Suppose 3v - 2v = 4c - 7, -5c - v + 20 = 0. Suppose n + c - 12 = 0. What is the remainder when 33 is divided by n? 6 Suppose -49 = -4v + 3. What is the remainder when v is divided by 8? 5 Let j(w) = -w*3 - 8w*2 - 14w - 6. Calculate the remainder when 8 is divided by j(-6). 2 Suppose -5s + 3c + 32 = 0, -6c = -2s - c + 28. Calculate the remainder when 19 is divided by s. 3 Calculate the remainder when 66 is divided by 3 + (-30)/(-8)16/4. 12 Suppose -1 = 3y + a - 42, -5y - a = -71. Suppose -3g - 2s - s + 69 = 0, 4s = 4g - 132. Calculate the remainder when g is divided by y. 13 Let l(t) = t3 + 7t*2 + 5t - 3. Let i be l(-6). Suppose -5j = g - 30, 0j + i = j. Let b = 112 - 53. What is the remainder when b is divided by g? 14 Suppose -3v = 3i - 21, 5i + v - 5v - 8 = 0. Calculate the remainder when (11/4)/((-2)/(-8)) is divided by i. 3 Let d = 15 + 102. What is the remainder when d is divided by 17? 15 Suppose -2z + 5z - 24 = 0. Let p(g) = g*3 - 8g*2 + 2g - 8. Let f be p(z). Suppose 3v + 160 = fv. Calculate the remainder when v is divided by 11. 10 Suppose 4o - o - 57 = 0. Calculate the remainder when 54 is divided by o. 16 Suppose w = -3j + 10 - 1, 2j - 17 = 3w. Let u = 4 + 6. Suppose u = f - j. Calculate the remainder when f is divided by 8. 6 Suppose 0 = -4h + v + 21 - 9, 5v - 24 = -h. Suppose -12d = -53 - 7. Calculate the remainder when d is divided by h. 1 Suppose 0 = 4n - 7n + 42. Let t(j) = 2j*2 + 5j - 2. What is the remainder when t(-6) is divided by n? 12 What is the remainder when 1053/45 + (-8)/20 is divided by 78/9 + (-4)/6? 7 Let j(i) = 4i2. Let u be j(3). Calculate the remainder when 20 is divided by (-2)/10 - u/(-5). 6 Suppose 4o = 3c + 216, -3o - 5c + 108 = -o. Calculate the remainder when ((-3)/9 - -1)o is divided by 19. 17 Let i(c) = 12c + 4. Calculate the remainder when 63 is divided by i(1). 15 Let a(l) = -l2 - l + 8. Let s be a(0). Let p(w) = 2w - 6. What is the remainder when 19 is divided by p(s)? 9 Suppose 2a + 450 = 7a. Calculate the remainder when a is divided by 13. 12 Let v = -16 - -24. What is the remainder when 25 is divided by v? 1 Suppose -5d + 50 = -2c + 15, 35 = 2d - 5c. What is the remainder when 28 is divided by d? 3 Let g(o) = -o*3 + 7o*2 - 2o. Let z be g(6). Let x = -10 + z. Calculate the remainder when 41 is divided by x. 13 Let l(v) = -v*3 + 6v*2 + v - 3. Let n = 11 + 8. Suppose 0 = -2i - 0m - 3m - 11, -3i = 5m + n. Calculate the remainder when l(6) is divided by i. 1 Suppose -3s + 22 = -11. Suppose -z + 32 = -3u, 5u + 0u + 40 = z. What is the remainder when z is divided by s? 9 Let l(k) = 3k - 9. Let v be l(6). Suppose -9 - v = -y. Let i = 56 - 22. What is the remainder when i is divided by y? 16 Let d(t) = 21t*2 + 3t - 11. Calculate the remainder when d(2) is divided by 27. 25 Suppose -12c + 18c - 534 = 0. Calculate the remainder when c is divided by 24. 17 Calculate the remainder when 89 is divided by (-1)/(-3) + -1 + (-276)/(-9). 29 Suppose 3d - s - 284 = 0, 3d - 2s - 127 = 153. Calculate the remainder when d is divided by 14. 12 Let z(t) = t3 - 6t*2 - 8t + 9. Let g = -3 - -3. Let n = g - -3. What is the remainder when n is divided by z(7)? 1 Suppose 0a + 3a = 15. Suppose 2c = 3u + u - 72, -18 = -u - c. Let r =	{ "pile_set_name": "DM Mathematics" }
1760 What is the least common multiple of 68 and 58? 1972 What is the least common multiple of 18 and 1156? 10404 Calculate the least common multiple of 2 and 34082. 34082 Calculate the smallest common multiple of 12 and 240. 240 What is the least common multiple of 20 and 452? 2260 Calculate the lowest common multiple of 3887 and 4732. 108836 Calculate the smallest common multiple of 8 and 28. 56 What is the common denominator of -21/4 and -5/6? 12 Calculate the common denominator of -27/2542 and -89/14. 17794 What is the smallest common multiple of 48 and 138? 1104 Find the common denominator of 49/64 and 61/656. 2624 Find the common denominator of 45/8 and 103/58. 232 Calculate the least common multiple of 602 and 258. 1806 What is the common denominator of 53/279 and -9/496? 4464 Calculate the common denominator of -16/5 and -1/73637. 368185 Calculate the common denominator of 143/1026 and -139/72. 4104 What is the common denominator of -5/72 and -13/384? 1152 What is the smallest common multiple of 8 and 48? 48 Calculate the smallest common multiple of 32 and 88. 352 Find the common denominator of 49/1070 and 55/4. 2140 Calculate the common denominator of 4/23 and -25/78. 1794 What is the smallest common multiple of 36 and 72? 72 Calculate the common denominator of -3/14 and 76/69. 966 Calculate the common denominator of 47/121 and 70/3. 363 Find the common denominator of 127/24 and 97/30. 120 Calculate the least common multiple of 24 and 32. 96 Find the common denominator of 101/12 and -119/6. 12 Find the common denominator of 53/2571 and 47/72. 61704 Find the common denominator of -8/435 and 23/3. 435 Calculate the common denominator of -87/364 and -113/14. 364 What is the common denominator of 109/14 and -45/1792? 1792 What is the common denominator of -46/1521 and 43/9? 1521 Calculate the lowest common multiple of 56 and 616. 616 Calculate the lowest common multiple of 5 and 86. 430 Calculate the common denominator of -53/198 and -11/10. 990 Calculate the common denominator of 22/11015 and -16/15. 33045 Find the common denominator of 151/9348 and 77/4674. 9348 What is the lowest common multiple of 45 and 20? 180 What is the least common multiple of 96 and 60? 480 What is the least common multiple of 10 and 494? 2470 What is the common denominator of 1/9 and 85/798? 2394 What is the common denominator of 87/76 and -79/18? 684 Calculate the smallest common multiple of 2352 and 504. 7056 Calculate the common denominator of 70/3 and -25/7. 21 Calculate the lowest common multiple of 10 and 57. 570 Find the common denominator of -67/14 and -95/16. 112 Calculate the common denominator of -13/8 and 43/574. 2296 Find the common denominator of 33/1831 and 34. 1831 What is the least common multiple of 5622 and 54? 50598 What is the lowest common multiple of 4896 and 153? 4896 What is the lowest common multiple of 2838 and 2064? 22704 What is the common denominator of 67/34 and 79/24? 408 Calculate the lowest common multiple of 705 and 40. 5640 What is the lowest common multiple of 29 and 9? 261 What is the common denominator of -85/32 and -19/40? 160 What is the lowest common multiple of 84 and 378? 756 Calculate the lowest common multiple of 17 and 182. 3094 What is the smallest common multiple of 105 and 1045? 21945 What is the common denominator of 91/141110 and -109/22? 1552210 Calculate the common denominator of -77/1126 and 87/22. 12386 What is the smallest common multiple of 10 and 2376? 11880 Calculate the common denominator of 59/48 and -151/126. 1008 Find the common denominator of -8/315 and -64/15. 315 What is the least common multiple of 99 and 27? 297 What is the common denominator of -89/280 and 73/2520? 2520 What is the common denominator of 19/39 and -35/13? 39 Find the common denominator of -73/6 and 47/823. 4938 Calculate the lowest common multiple of 1700 and 3740. 18700 Find the common denominator of 85/632 and -89/18. 5688 Calculate the least common multiple of 564 and 126. 11844 Find the common denominator of 115/6 and 7/22. 66 Find the common denominator of -18/1211 and 25/3633. 3633 What is the common denominator of 11/1687 and -43/28? 6748 Calculate the smallest common multiple of 4 and 22. 44 What is the common denominator of -76/99 and -13/99? 99 Calculate the common denominator of 101/242 and 109/858. 9438 What is the common denominator of -53/45 and -1/135? 135 What is the lowest common multiple of 242 and 18? 2178 Calculate the lowest common multiple of 3 and 135. 135 Calculate the lowest common multiple of 117 and 130. 1170 Calculate the smallest common multiple of 2690 and 7. 18830 What is the common denominator of -111/7072 and 59/68? 7072 What is the common denominator of -77/11360 and -73/180? 102240 Calculate the lowest common multiple of 224 and 256. 1792 What is the common denominator of -87/4390 and -59/1317? 13170 What is the common denominator of -101/36 and 64/63? 252 Calculate the common denominator of -93/22 and -15/46. 506 What is the common denominator of -55/8 and 32/441? 3528 Calculate the common denominator of 145/36 and 113/2744. 24696 Calculate the smallest common multiple of 75 and 1710. 8550 Calculate the least common multiple of 8879 and 130. 88790 Calculate the lowest common multiple of 21 and 12. 84 Calculate the common denominator of -41/140 and 113/570. 7980 Calculate the common denominator of 22/315 and 31/3915. 27405 What is the smallest common multiple of 2 and 423? 846 Find the common denominator of -25/2682 and -119/72. 10728 Calculate the common denominator of -11/164 and 77/4. 164 What is the common denominator of 19/6501 and 91/6? 13002 Calculate the common denominator of 57/2821 and 32/217. 2821 Find the common denominator of -17/115 and -12/185. 4255 Calculate the common denominator of -73/9690 and 23/8. 38760 What is the lowest common multiple of 5 and 205? 205 What is the common denominator of 59/3624 and 3/755? 18120 Calculate the smallest common multiple of 16 and 40. 80 Find the common denominator of -23/70 and -17/1162. 5810 What is the lowest common multiple of 284 and 9? 2556 Find the common denominator of -5/59 and 35/4. 236 What is the common denominator of -105/104 and -3/208? 208 Calculate the common denominator of -25/22 and 47/4. 44 Calculate the lowest common multiple of 140 and 308. 1540 Find the common denominator of -43/87 and 40/2103. 60987 Calculate the common denominator of 52/3459 and -1/57. 65721 Calculate the smallest common multiple of 423 and 261. 12267 Calculate the lowest common multiple of 14 and 70. 70 What is the common denominator of -38/1179 and -43/78? 30654 Calculate the least common multiple of 4 and 28. 28 What is the lowest common multiple of 40 and 216? 1080 Calculate the common denominator of -29/2058 and 13/1323. 18522 Calculate the smallest common multiple of 24 and 141. 1128 Calculate the common denominator of -101/98 and -123/7546. 7546 Calculate the common denominator of 89/96 and 67/72. 288 Find the common denominator of -59/447 and 101/1192. 3576 What is the smallest common multiple of 913 and 581? 6391 Find the common denominator of -157/180 and -121/126. 1260 Calculate the common denominator of 85/32 and 21/8. 32 Find the common denominator of -63/80 and 43/11. 880 What is the common denominator of -9/1798 and -50/39? 70122 What is the least common multiple of 320 and 440? 3520 Calculate the least common multiple of 138 and 920. 2760 What is the least common multiple of 1666 and 196? 3332 What is the common denominator of -50/21 and -59/741? 5187 Find the common denominator of 1/73 and -8/9. 657 What is the lowest common multiple of 8652 and 21? 8652 Calculate the common denominator of 35/3203 and 24/7. 22421 Find the common denominator of -11/45462 and 15/16. 363696 What is the common denominator of 7/8 and 67/540? 1080 Calculate the smallest common multiple of 5200 and 40. 5200 Calculate the common denominator of -8/95 and 46/35. 665 What is the common denominator of -22/13 and -22/613? 7969 What is the smallest common multiple of 996 and 8466? 16932 What is the smallest common multiple of 27 and 45? 135 Find the common denominator of -49/958 and -99/14. 6706 Calculate the smallest common multiple of 6426 and 1008. 51408 C	{ "pile_set_name": "DM Mathematics" }
5. Let p be s(-5). Which is the second biggest value? (a) -3/7 (b) -0.5 (c) l (d) p d Let z be ((-80)/(-8) + -5)(-6)/(-765). Let n = 205 - 204.5. Which is the third biggest value? (a) z (b) n (c) 1 (d) -1 a Suppose -3b - 372 = -4y - 5b, -y = b - 92. Let t = -92 + y. What is the fourth smallest value in -1, 0.2, t, 3? 3 Let n = 35 - 33. Let j = -819 - -2458/3. What is the third smallest value in 3, n, j? 3 Let v = -45.87 + -0.13. Let j = 22843 - 22841. What is the second smallest value in j, v, 1? 1 Let h be (-42)/(-10) + (-256)/(-320). Suppose j + 5l + 11 = 8l, -2l + 3 = -hj. Which is the third smallest value? (a) j (b) 4 (c) -9 b Let r be 20/72(-164)/205. What is the biggest value in -51, -7, 0, r? 0 Let t = -11 - -10.86. Let o = t - -2.14. Let k = -2 - o. Which is the biggest value? (a) 0.4 (b) k (c) -5 a Suppose -5k - 24 + 49 = 0. Suppose -m = -9 + k. Let p = -119/171 + 9/19. Which is the second biggest value? (a) p (b) m (c) 1/3 c Let v = 470.4 + -441.4. Which is the second smallest value? (a) -5 (b) v (c) -0.06 c Let k be 3 + 28/(-10) + -7 - -7. What is the second smallest value in 6, k, -9, 9, -3? -3 Let d be 8/62/12. Let r be ((-6)/945 - 0)28455/(-1505). Let f = 4/301 + r. Which is the second smallest value? (a) f (b) -0.3 (c) d a Suppose -5p - 3z + 43 = 0, 39 = 3p + 3z + 12. Let g be (-138)/117 + p/6. Which is the smallest value? (a) -0.2 (b) 0 (c) -2 (d) g c Let y = -1489.7 - -1490. Which is the second smallest value? (a) y (b) 3 (c) -5 (d) 0.5 (e) 11.2 a Let v = 17 - 13. Let m = -0.896 + 0.796. Which is the second biggest value? (a) -1.4 (b) -3 (c) v (d) m d Let j = -6/2537 + 5128/22833. What is the smallest value in 234, 5, j? j Let u be 15/64 - 2. Let g(j) = j - 8. Let f be g(u). Let q = 0.0695 - -4.9305. Which is the fourth smallest value? (a) f (b) -5 (c) q (d) 0.2 c Let l = 0.1 + 0.9. Let r(f) = -2f*3 - 4f*2 + 4f - 60. Let c be r(-9). Let q = c - 4163/4. What is the third smallest value in l, -0.1, q? l Suppose -99x = -120x. What is the biggest value in 3, 1405/3, x? 1405/3 Let z = 2.519 + -2.819. What is the third biggest value in -6.2, z, -0.02? -6.2 Let o = -0.074 - 4.826. Let b = 7.9 + o. Let u = -5.59 + 1.59. What is the third biggest value in u, -2/5, b? u Let t = 3 - 2.95. Which is the third biggest value? (a) -0.01 (b) 2 (c) t (d) 3/5 (e) 5 d Let d = -4.8 - -0.8. Let l = 4212 + -4198. Let s be (-2)/(-4) - 27/(-6). What is the second biggest value in l, s, d? s Let p be 297/1089 - (-219)/165. Let h = 11 + -15. Which is the third biggest value? (a) h (b) p (c) -0.5 a Let d = -312.59 + 311. Let q = 47.91 - d. Let y = q - 50. Which is the smallest value? (a) y (b) -1 (c) -8 c Let p be (28 - 8138/312) + 10/(-6). Which is the third smallest value? (a) -2 (b) 2.5 (c) 1 (d) p c Let y be 1/(-14)8/(-1). Let f = -883.1 + 882.8. Which is the third smallest value? (a) 3 (b) y (c) f (d) -1 b Let m = 1213/2 + -8495/14. What is the fourth smallest value in -5, -2/3, 0.2, -0.7, m? m Let t = 69 - 66. Let p = -0.297 + 1.297. Which is the third biggest value? (a) p (b) -2/5 (c) t b Suppose -q - 311 = -627. Let d = 314 - q. What is the smallest value in 4, d, 0.7? d Let h = 13803.5 - 13868. What is the biggest value in -5, h, -0.6? -0.6 Let t = 13277 - 13276.8. Which is the second smallest value? (a) -0.109 (b) -1/6 (c) t (d) -5 (e) 1/3 b Let t = 6570.013 - 6546. Let n = t + -0.013. Let d = -24.5 + n. What is the second smallest value in d, 5, -0.6? d Let g = 2.61 - 2.55. What is the fourth biggest value in g, 3, 12, -8? -8 Let j be -99(-56)/(-1540)8/(-3). What is the smallest value in j, -1, 3/4? -1 Let j = -150 - -149. Let n be (j - -2)-1 + 9/7. Which is the third biggest value? (a) -0.2 (b) 0.4 (c) n a Let j(t) = -6t2 + 15t + 1. Let o be j(3). Let k be 1085/840 - 3/o. Which is the second smallest value? (a) -1/6 (b) k (c) 2 (d) 2/5 d Let d be 23 + 35848/(-1560) + (1 - (-39)/(-45)). Which is the biggest value? (a) 5 (b) d (c) -11087 a Let k = 4200 - 4266. What is the biggest value in k, -5, 1, 0.4? 1 Let d = 36/7 - 173/35. Suppose 0 = 7z - 309 + 64. Let r be (1/3)/((-3)/(42/z)). What is the smallest value in -1, -4, d, r? -4 Let k = 33.717 + -28.717. Which is the fifth biggest value? (a) 2/3 (b) -48 (c) k (d) -3 (e) 132 b Suppose -14 = -2k - 5i, 2i + 4 = 11k - 15k. Let a be 1/25(2 - (k - 0)). What is the second smallest value in a, -1.96, 1? a Let t = -1225 + 13449/11. Let y = t - 3/22. What is the fourth biggest value in -0.1, 0.5, -1, y? y Let z = 3467.7 + -3467.8. Which is the smallest value? (a) 0.2 (b) 4.33 (c) z (d) -5 d Let v be 1/4 - (-189)/(-36). Let q = 0 + 0.08. Let y = 0.42 + q. What is the fourth smallest value in -4, v, y, 3? 3 Suppose 2x + 3 + 7 = 0. Let t = -256 + 263. Suppose 18 + 129 = -tv. What is the second biggest value in x, v, 0? x Let a = 61/48 - 3265/2544. Let r = 26 - 181/7. What is the third smallest value in r, a, -5? r Let j = 101/45 + -19/9. Let s = -0.14 + 0. Let b = 0.44 + s. What is the third smallest value in -1/4, b, -2, j? j Let l be -4((-9 - -1) + (-8 - -12)). Let j be (-456)/(-352) - 12/l. Which is the second biggest value? (a) j (b) 0.3 (c) -1/3 b Let w be (113/(-5) - -3)(-2)/(48/60). What is the third smallest value in 0, w, 5? w Let r(h) = h + 3. Suppose 5w - 47 = -62. Let g(q) = -q*2 - 2q + 1. Let i be g(w). Let u be r(i). Which is the smallest value? (a) u (b) 2 (c) -1/5 c Let w = -25/3 - -8. Let h be (-32)/(-8) + ((-36)/14 - (35 - 33)). Which is the third smallest value? (a) h (b) -2 (c) w (d) -25 a Let q = -86.29 + 0.29. Let l = 85.7 + q. What is the smallest value in -5, l, -1/5? -5 Let s = -31134/5 + 6227. Which is the biggest value? (a) s (b) -399 (c) -1.3 a Let k be 44/40(0 + 5). Suppose 5d - 13 = -3p - 6, 5 = -p + kd. What is the third biggest value in -0.092, p, 0.3? p Let o = -4943 - -4940. What is the biggest value in 5, -4, o, 0.1? 5 Let w = -623 + 622.8. What is the third biggest value in -3, 0.4, -44, 0, w? w Let g be (-3)/(-6) + (-19)/30. Let w = -7689/13 - -61499/104. Which is the biggest value? (a) g (b) w (c) 2/9 (d) 1/4 d Let s = 1.8 - 2.2. Let x = -189 - -135.5. Let g = x + 54. Which is the second biggest value? (a) s (b) -5 (c) g a Let j = 1163 + -633. Let x = -530 + j. What is the fourth smallest value in -2/13, -2, x, 0.13? 0.13 Suppose -855 = -236z + 325. What is the third smallest value in -8, z, 168? 168 Let p be (1300/(-30))/5(-18)/4. Let z be 1(2 + -1)p/234. Which is the third biggest value? (a) -0.1 (b) z (c) -3 (d) 0.5 a Let p = -27 - -32. Let d = -1.1 - 2.9. Let i = -1 - d. What is the second biggest value in p, i, -3/4? i Let o = -95.1 + 102. Let k = 58.9 - 51. Let q = k - o. Which is the third biggest value? (a) -2/5 (b) -3 (c) q (d) 2 a Let p = 2.88326 - -0.11674. What is the smallest value in p, 5, 6974? p Let r = -21528 - -21528. What is the second smallest value in r, -1/6, -1.2, -2/13, -1/4? -1/4 Let c(m) = m3 - 13m*2 - 6m + 74. Let l be c(13). What is the biggest value in 0, -1/93, l? 0 Let o = -17897.06 - -17466. Let s = o + 431. Which is the third smallest value? (a) s (b) 4 (c) 0.1 b Let z(m) be the first derivative of m*3/3 - 2m*2 - 10m + 26. Let i be z(4). What is the third smallest value in -2, -0.2, i? -0.2 Let l = -3333 + 3333.14. What is the fourth smallest value in -4, 3/5, 1/3, -1/4, l? 1/3 Let z = -1 + 0.5. Let f = -1/184 + 743/1288. What is the third biggest value in -5, z, -3, f? -3 Let w be 3 - -1 - (0 + 28). Let p be -2 + w/(-9) + -2. Let k = -80 - -79.7. Which is the fourth smallest value? (a) 2 (b) k (c) p (d) -1/10 a Let v = 31414 - 31414. Let p = -5 + 7. Which is the fourth biggest value? (a) -7 (b) 5 (c) v (d) p a Let c = -69443/7 + 9921. What is the third smallest value in 1/3, c, -0.0312? c Suppose 147r = 66r - 111*r + 192. Which is the fifth smallest value? (a) 2 (b) r (c) 0 (d) 4 (e) -3/2 d Let f = 29056/9 + -3232. Which is the third smallest value? (a) -2/43 (b) f (c) 2/3 c Let z = -49 - -48. Let j = 39.7 + -39.9. Which is the second smallest value? (a) z (b) 13 (c) j c Let w = 1.8 - 1.6. Let o = 0.147 + -0.147. Which is the third	{ "pile_set_name": "DM Mathematics" }
3. What is lc(d) - 2w(d)? 2d - 1 Let u(o) = o2 - o + 1. Let c(v) = 9v*2 + 9. Let f(p) = c(p) - 4u(p). Let k(y) = y*2 + y + 1. Calculate -f(q) + 4k(q). -q*2 - 1 Let c(n) = 6n*3 - 3n2 + 7. Let w(o) = -o3 + o*2 - 1. Determine -c(z) - 3w(z). -3z3 - 4 Let q(o) = -o. Let x be (-6)/(-6) - (0 + 0). Let z(n) = 6n - 1. Determine xz(y) + 5q(y). y - 1 Let f(o) = 23o - 23. Let x(y) = -1. What is f(c) - 23x(c)? 23c Let m(n) = -3n + 3. Let r(x) = 2x - 2. Let d be (-8)/16 + 31/2. Suppose 0 = -0b - 5b + d. What is bm(q) + 5r(q)? q - 1 Let d(x) = 17x*2 + 5x + 11. Let s(h) = 11h2 + 3h + 7. Give -5d(y) + 8s(y). 3y2 - y + 1 Let l = -8 - -5. Let o(h) = 5h + 2. Let w(y) = 6y - 54 + 0y + 121 - 64. Calculate lw(q) + 4o(q). 2q - 1 Let c(i) = 4i*2 + 5i. Let o(p) = -21p2 - 26p + 1. Let a(v) = 11c(v) + 2o(v). Let m(u) = u*2 + u. Determine a(s) - 3m(s). -s*2 + 2 Let a(m) = 10m - 19. Let i(k) be the first derivative of 3k2/2 - 6k + 7. Determine 2a(v) - 7i(v). -v + 4 Let i(y) = 4y3 + 6y*2 + 5y - 3. Let j(m) = 8m3 + 13m*2 + 11m - 7. What is -9i(x) + 4j(x)? -4x3 - 2x*2 - x - 1 Let k(t) = -t - 6. Let q(n) = n + 7. Calculate 4k(a) + 3q(a). -a - 3 Let z(m) = 7m - 4. Let f(k) = 7k + 5. Let r(b) = 5b + 4. Let d(v) = -3f(v) + 4r(v). What is 4d(a) + z(a)? 3a Let b(z) = -z - 2z + 4z*2 - 5 - 2z*2 - 2z. Let s(j) = 2j2 - 4j - 4. What is 4b(v) - 5s(v)? -2v2 Let h(i) = -20i*3 - 4i + 4. Let b(a) = -a*3 - a + 1. Calculate -4b(y) + h(y). -16y3 Let l(p) = 1. Let x(r) = 2r. Determine 4l(z) - 2x(z). -4z + 4 Let x(s) = -2s*3 + 7s*2 + 2s - 6. Let q(k) = -2k3 + 6k*2 + 2k - 5. Let a be 64/489/(-2). Give aq(u) + 5x(u). 2u3 - u2 - 2u Let k(n) = 4n2 - n2 + n*2 + 5 + 0n*2. Let q(j) = -10j*2 - 12. Determine 12k(v) + 5q(v). -2v*2 Let j(l) = -5l*3 - 3l*2 - 6l + 6. Let q(f) be the second derivative of -f5/20 - f4/12 - f3/6 + f2/2 + 32f. What is -j(o) + 6q(o)? -o*3 - 3o*2 Let g(x) = x - 1. Let s(m) = 4 + 45m + 48m - 98m. What is -11g(d) - 2s(d)? -d + 3 Let m(v) = -7v3 - v2 + v. Let t(i) = -i3 - i2. Determine m(g) - 6t(g). -g*3 + 5g*2 + g Let b(f) = -3f*2 + 6f - 1. Let j(v) = 4v2 - 7v + 1. Give -6b(m) - 5j(m). -2m2 - m + 1 Let k = -18 - -12. Let x = 10 - 15. Let d(l) = 7l*2 + l - 7. Let m(h) = 2h*2 + 8 - 5h*2 - 5h*2 - h. Determine kd(r) + xm(r). -2r*2 - r + 2 Let r(k) = -4k. Let v(b) = -b*2 - 8b. Calculate -5r(t) + 2v(t). -2t2 + 4t Suppose -13 = 3r + 5q, 5q + 4 = -r - 7. Let m(d) = -2d + 4. Let a(u) = -u + 2. Let w(f) = 9a(f) - 4m(f). Let c(l) = -l + 1. Determine rw(i) + 2c(i). -i Let w(b) = b*2 - b - 1. Let f(g) = 5g*2 - 7g - 2. Calculate -f(h) + 4w(h). -h2 + 3h - 2 Let r(u) be the third derivative of u5/60 + u4/6 + u*2. Let f be r(-4). Let o(k) = f - 1 + 0. Let m(b) = -b + 3. What is -m(c) - 2o(c)? c - 1 Let y(l) = -1. Let t(g) = -5g + 15. Determine -t(d) - 4y(d). 5d - 11 Let l(p) be the third derivative of -5p4/24 - p3/6 + p*2. Let v be 41/2 - 1. Let m(w) = 0 - 19w + 5w - v - 1. Calculate -8l(d) + 3m(d). -2d + 2 Let h = -6 - -4. Let w(r) = 2r2 - 3. Let j(l) = -l2 - l - 1. Let g(p) = p*3 - 6p*2 - 6p - 7. Let k(v) = -g(v) + 6j(v). Calculate hk(t) - w(t). 2t3 - 2t*2 + 1 Let j be (-2)/6 + 20/(-12). Let p(k) = -1. Let i(s) = -2s + 6. Let c(z) = 4z - 11. Let b(l) = -3c(l) - 5i(l). Calculate jp(v) - b(v). 2v - 1 Let t(r) = -r3 + 4r*2 + 1. Suppose 3i - 2i - 4 = 0. Let k be t(i). Let z(n) = n3. Let w(o) = 2o*3 + 2. Calculate kw(b) - 4z(b). -2b3 + 2 Let k be 0 - (-5 + 0/(-2)). Let i(m) = -m3 + 6m2 - 2m + 13. Let l be i(6). Let n(q) = l - q + 5q - 6q. Let t(g) = g. Calculate kt(w) + 2n(w). w + 2 Let s(l) = 3l2 - 5l - 5. Let t(c) = 2c2 - 4c - 4. Suppose -3m - 3 = j - 2, -2m = 4j + 14. Give js(a) + 5t(a). -2a2 Let c(b) = b + 1. Let m(j) = -j2 + j + 7. What is -5c(l) + m(l)? -l2 - 4l + 2 Let p(s) = 8s2 - 2s - 5. Let z(g) = 7g2 - 2g - 4. What is 4p(q) - 5z(q)? -3q2 + 2q Let n(d) = 9d + 7. Let x = -1 - -1. Suppose -6 = -2f - x. Let u(w) = 3 + w + 0w + fw. Give -2n(k) + 5u(k). 2k + 1 Let c(w) = -w - 6. Let v(i) = i + 7. Determine 5c(t) + 4v(t). -t - 2 Let s(p) = -p + 9. Let l(m) = m - 4. Suppose -3q - y + 10 = -0, 3q = 5y - 14. Calculate qs(o) + 5l(o). 3o - 2 Let i(s) = -5s*3 - 35s*2 + 8s + 11. Let k(r) = -3r3 - 23r*2 + 5r + 7. Calculate -5i(f) + 8k(f). f*3 - 9f*2 + 1 Let y(x) = 2x3 - x2 + 2x - 5. Let s(q) be the first derivative of q4/4 + q2/2 - 2q - 7. Give 5s(m) - 2y(m). m*3 + 2m*2 + m Let y(c) = 2c. Suppose 4s = 2z + 8, 0 = s + 2z - 0 - 2. Let i(j) = -2 + 5j - j + sj + 3. Let q be (1 - -20)1/3. Calculate qy(f) - 2i(f). 2f - 2 Let z(l) = -l - 2. Let h(t) = 3t3 - t2 + 1. Let c = -1 + 2. Let y be h(c). Let q(p) = p + 2. Let o = 21 + -19. Determine oq(u) + yz(u). -u - 2 Let h(d) = -28d3 + 2d*2 - 3. Let b(v) = 27v*3 - 2v*2 + 2. Determine 3b(m) + 2h(m). 25m*3 - 2m*2 Let n(f) = 9f*2 - 9f + 3. Suppose -3p + p = 4o + 16, -5p - 2o = 0. Let h(u) = 4u2 - 4u + 1. Give pn(r) - 5h(r). -2r2 + 2r + 1 Let y(s) = 7s + 5. Let p(k) = -k - 1. Give 6p(r) + y(r). r - 1 Suppose m - 2 = -g, m - 3g + 2 = -0. Let h(w) = -w. Let t(u) = 5u - 1. Give mt(k) + 3h(k). 2k - 1 Let z(q) = 6q*3 - 4q*2 + 1. Let u(p) = 11p*3 - 7p*2 + 3. Determine -4u(x) + 7z(x). -2x*3 - 5 Let r(f) = 21f*2 - 11f + 16. Let h(a) = a*2 + 2a + 2. Let b(o) = -2o2 - 2o - 3. Let y(c) = 5b(c) + 6h(c). Give -2r(d) - 11y(d). 2d2 + 1 Let u(k) = -k3 - 7k*2 + k - 2. Let l(j) = 2j*3 + 15j*2 - 2j + 5. Calculate 2l(r) + 5u(r). -r*3 - 5r*2 + r Let b be 3/2(6 - 0). Let o(y) = 2y - 7. Let g(t) = 3t + 0t - 2t - 3. Calculate bg(r) - 4o(r). r + 1 Let s(z) = -3 - 2z + 2 + z. Let c(o) = o3 - 9o*2 - o + 11. Let q be c(9). Let f(p) = 2p + q - p + p. Calculate -4f(t) - 7s(t). -t - 1 Let x(q) = -2q3 + 3q*2 - 3q + 9. Let w(g) = -7g3 + 8g*2 - 8g + 26. Determine -3w(b) + 8x(b). 5b3 - 6 Let k(p) = -3p*2 + 3p + 3. Suppose -3q + 1 + 8 = 0. Let z(i) = 6i*2 - 7i - 7. Determine qz(l) + 7k(l). -3l2 Let d(n) = -22n - 3. Let r(b) = 23b + 4. Give 4d(w) + 3r(w). -19w Let z(f) = -3 + 0f + 0f + 0f + f. Let a(j) = -j + 4. Let k(m) = -4a(m) - 5z(m). Let y(c) = 3c + 2. Calculate 4k(l) + 2y(l). 2l Let w(l) = 2l*3 - 7l*2 + 5l - 1. Let c(b) = -3b3 + 11b*2 - 8b + 2. What is -5c(z) - 8w(z)? -z3 + z2 - 2 Let p(y) = -y*2 - y + 1. Let a(t) = -48t*2 - 33t + 33. Calculate -2a(o) + 66p(o). 30o2 Let h(s) = -2s + 2. Let y(l) = -1. Let u = 11 + -18. Let b = u - -6. Determine bh(i) - 3y(i). 2i + 1 Let d be 9/(-2)(-4)/3. Let i(j) = 2j2 + j + 5. Let z(q) = 1. Give dz(r) - i(r). -2r2 - r + 1 Let d(t) = 9t - 4. Let b(o) = o + 9. Let g be b(-4). Suppose 2v + 1 = g, -2m = 5v. Let n(w) = w - 6w - 2 + 10w. Calculate mn(f) + 3d(f). 2f - 2 Let r(t) = -t - 1. Let k = 28 - 14. Let q = -15 + k. Let n(b) = 3b + 5. What is qn(v) - 5r(v)? 2v Let z(q) = -3q3 - q2 + q + 4. Let h(c) = -5c*3 - 2c*2 + 2c + 7. Suppose 0 = -b - 8 + 1. Give bz(o) + 4h(o). o3 - o2 + o Let b(a) = -3a2 + 2. Let q(r) be the second derivative of r5/20 - r4/12 + r2/2 - 7r. Determine b(t) - q(t). -t*3 - 2t*2 + 1 Let q(w) = -4w*3 + 2w*2 + 2w - 42. Let v(p) = -13p3 + 7p*2 + 7p - 126. Give 7q(t) - 2v(t). -2t3 - 42 Let k(q) = 6q*2 - 2q - 5. Let x(v) = 12v2 - 5v - 11. What is -9k(h) + 4x(h)? -6h2 - 2h + 1 Let n = -56 - -58. Let z(p) = -3p3 + 3p*2 - 3. Let s(y) = -3y*3 + 2y*2 - 2. What is nz(u) - 3s(u)? 3u*3 Let h(u) = -u - 5. Let f(y) = 12y + 66. Calculate -2f(t) - 27h(t). 3t + 3 Let p(l) = -4l*3 - 2l. Let v(j) = 19j3 + 11j. Calculate 22p(z) + 4v(z). -12z3 Let h(w) = 6w*3 + 2w*2 + 2. Let a(c) = -7c*3 - 3c*2 - 2. Let v(m) = 2m*2 - 3. Let r be v(-2). Give rh(n) + 4a(n). 2n*3 - 2n*2 + 2 Let m = -95 - -101. Let n(l) = 6. Let c(s) = -s - 3. What is mc(p) + 3n(p)? -6p Let m(g) = g**2 + g + 1.	{ "pile_set_name": "DM Mathematics" }
978, 4023, 5480? 7349 What is next in 811325, 1622639, 2433953, 3245267, 4056581? 4867895 What comes next: 452858, 3622629, 12226290, 28980785, 56603058, 97810053, 155318714? 231845985 What comes next: 3093, 5011, 6925, 8835, 10741, 12643, 14541? 16435 What comes next: -1440, -5882, -13306, -23718, -37124, -53530? -72942 What is next in 17087938, 34175869, 51263800? 68351731 What is next in -1611, -12858, -43361, -102744, -200631? -346646 What is next in -2364909, -2364821, -2364657, -2364405, -2364053, -2363589? -2363001 What is next in -21477, -43452, -66417, -90870, -117309, -146232? -178137 What is next in -3789688, -7579350, -11369012, -15158674? -18948336 What is next in 349, 2073, 6557, 15187, 29349? 50429 What is the next term in -60, 2834, 10678, 25944, 51104, 88630, 140994? 210668 What is next in -396146, -396091, -395998, -395867, -395698, -395491, -395246? -394963 What is the next term in -159298, -159302, -159326, -159376, -159458? -159578 What comes next: 8412536, 8412470, 8412404, 8412338, 8412272? 8412206 What comes next: -962, -1041, -1178, -1391, -1698, -2117, -2666? -3363 What is the next term in -475214, -950999, -1426782, -1902563? -2378342 What is next in 326332320, 652664640, 978996960, 1305329280, 1631661600? 1957993920 What is the next term in -228, -724, -1520, -2628, -4060, -5828? -7944 What is next in 1981385, 3962769, 5944153, 7925537, 9906921? 11888305 What comes next: -608836, -1217281, -1825694, -2434069, -3042400? -3650681 What is next in -20650650, -20650643, -20650636, -20650629? -20650622 What is next in -1365673, -2731353, -4097037, -5462725? -6828417 What is the next term in -16637, -130462, -439417, -1041068, -2032981, -3512722, -5577857, -8325952? -11854573 What comes next: -123578, -123581, -123572, -123545, -123494, -123413, -123296? -123137 What is next in -11387589, -11387617, -11387647, -11387679? -11387713 What is next in -5513, -2830, -147, 2536? 5219 What is the next term in -502642, -502643, -502644? -502645 What is next in 5013, 5061, 5111, 5163, 5217, 5273, 5331? 5391 What is next in -736, -716, -696, -688, -704, -756, -856? -1016 What is next in 11360, 88732, 298142, 705608, 1377148, 2378780? 3776522 What comes next: -141117135, -141117160, -141117199, -141117258, -141117343, -141117460? -141117615 What is the next term in -14944, -14723, -14502, -14281? -14060 What comes next: 2096, 5353, 8610, 11867? 15124 What is next in 664055, 1328561, 1993067? 2657573 What comes next: 327465, 327233, 326845, 326301? 325601 What is the next term in -2441, -2807, -3771, -5633, -8693? -13251 What is the next term in 34459, 69006, 103637, 138352, 173151, 208034? 243001 What is next in -568002, -1136629, -1705256, -2273883, -2842510, -3411137? -3979764 What comes next: 38264, 59305, 80356, 101423, 122512? 143629 What is next in -1471, -5994, -13541, -24112, -37707, -54326? -73969 What is the next term in -14360, -28678, -52540, -85946, -128896, -181390? -243428 What is the next term in -1909043, -7636201, -17181477, -30544871, -47726383? -68726013 What comes next: 263843, 529207, 794571, 1059935? 1325299 What comes next: 4486, 7425, 10338, 13225, 16086, 18921? 21730 What comes next: -3262, -11098, -24150, -42412, -65878? -94542 What is the next term in 1719, 3474, 5243, 7038, 8871, 10754, 12699? 14718 What comes next: 253778, 507538, 761298, 1015058, 1268818? 1522578 What comes next: 19356, 19287, 19214, 19137? 19056 What comes next: -10276309, -10276308, -10276307? -10276306 What is the next term in -138631, -1108913, -3742547, -8871211, -17326583, -29940341? -47544163 What is the next term in 9105, 9552, 10297, 11340, 12681, 14320? 16257 What is the next term in -1449, -1586, -1805, -2106, -2489, -2954, -3501? -4130 What is next in 2934651, 2934656, 2934661, 2934666, 2934671? 2934676 What comes next: 618, 1112, 1536, 1890, 2174, 2388, 2532? 2606 What is next in 1023, 2251, 3791, 5799, 8431, 11843, 16191? 21631 What is next in 82756, 162448, 242126, 321784, 401416, 481016, 560578? 640096 What is the next term in -447, -830, -1213, -1596, -1979? -2362 What is next in 397356525, 794713052, 1192069577, 1589426100? 1986782621 What is next in 2066, 9999, 23220, 41729? 65526 What is next in 3657, -672, -7887, -17994, -30999, -46908, -65727? -87462 What is next in 401091, 803044, 1204997, 1606950, 2008903, 2410856? 2812809 What comes next: -677709, -677659, -677607, -677553, -677497, -677439, -677379? -677317 What is next in 4974479, 4974486, 4974497, 4974512, 4974531, 4974554? 4974581 What comes next: -92911, -371756, -836535, -1487248, -2323895? -3346476 What is the next term in -13947, -27399, -40851, -54303? -67755 What comes next: -36395317, -72790629, -109185937, -145581241, -181976541, -218371837, -254767129? -291162417 What comes next: 2359554, 2359557, 2359544, 2359509, 2359446, 2359349? 2359212 What is next in -505, -1946, -4283, -7480, -11501, -16310? -21871 What is next in 4898193, 19592739, 44083641, 78370899, 122454513, 176334483? 240010809 What is next in -12677, -11928, -11177, -10424? -9669 What is next in -700, -3199, -7412, -13339, -20980? -30335 What comes next: -161, -523, -1033, -1691, -2497, -3451, -4553? -5803 What is the next term in -22664, -17271, -11878, -6485? -1092 What comes next: -6796, -7485, -8632, -10237, -12300, -14821? -17800 What is the next term in 10744, 10765, 10802, 10855, 10924? 11009 What is the next term in 27384, 27096, 26808, 26520, 26232, 25944? 25656 What is next in 22081, 88242, 198491, 352828, 551253? 793766 What is the next term in 1718, 14483, 49004, 116159, 226826? 391883 What is next in -49565, -49694, -49827, -49964, -50105, -50250, -50399? -50552 What is next in -112815, -112588, -112323, -112020, -111679, -111300? -110883 What is next in 4339, 34596, 116693, 276550, 540087, 933224, 1481881, 2211978? 3149435 What is the next term in -61412, -122483, -183552, -244619? -305684 What is next in 2331, 3907, 5483, 7059? 8635 What comes next: -1582, -1113, -644, -175? 294 What is the next term in 99568, 99883, 100196, 100507, 100816, 101123, 101428? 101731 What comes next: 350287266, 700574532, 1050861798, 1401149064, 1751436330, 2101723596? 2452010862 What comes next: -1105, -450, 1317, 4754, 10419? 18870 What is the next term in -47422, -42172, -36922? -31672 What is the next term in 3597, 6182, 7741, 8286, 7829, 6382? 3957 What is the next term in -419, 0, 801, 2068, 3885, 6336, 9505, 13476? 18333 What comes next: -5341486, -10682982, -16024478, -21365974, -26707470? -32048966 What comes next: 8, -31, -182, -523, -1132, -2087, -3466? -5347 What is next in -991139622, -991139624, -991139626, -991139628, -991139630, -991139632? -991139634 What comes next: 3181519, 6363038, 9544557, 12726076? 15907595 What comes next: 431, 864, 1261, 1616, 1923, 2176, 2369? 2496 What is the next term in -6854, -26589, -59194, -104663, -162990, -234169, -318194? -415059 What comes next: -152804963, -305609927, -458414891, -611219855, -764024819? -916829783 What is the next term in -607, -1576, -2549, -3532, -4531, -5552? -6601 What is next in 17500, 28936, 40362, 51772, 63160, 74520, 85846, 97132? 108372 What comes next: 11491, 22778, 34079, 45394, 56723? 68066 What is the next term in -2016, -2890, -3770, -4656? -5548 What is the next term in -26375, -69831, -113289, -156749, -200211, -243675? -287141 What is the next term in -1155764, -1155772, -1155784, -1155800? -1155820 What comes next: -3372612, -3372641, -3372670, -3372699, -3372728, -3372757? -3372786 What is the next term in 583, 90, -1277, -3956, -8385? -15002 What comes next: 497970, 995942, 1493914, 1991886, 2489858? 2987830 What comes next: -365086, -730561, -1096038, -1461517? -1826998 What comes next: 15776, 15680, 15586, 15494? 15404 What is the next term in 6605, 26397, 59397, 105617, 165069, 237765, 323717, 422937? 535437 What is the next term in 18191, 8353, -1485, -11323, -21161? -30999 What is next in -89522, -179069, -268640, -358241, -447878, -537557, -627284, -717065? -806906 What comes next: -372811, -371821, -370171, -367861, -364891? -361261 What is next in 32, 416, 1102, 2090, 3380? 4972 What comes next: 3998, 3976, 3916, 3812, 3658, 3448, 3176? 2836 What is the next term in -228500, -457110, -685846	{ "pile_set_name": "DM Mathematics" }
5? 36200 Calculate the lowest common multiple of 14649 and 114. 29298 Calculate the common denominator of 49/186 and -31/1105. 205530 What is the smallest common multiple of 16 and 994326? 7954608 What is the least common multiple of 4944 and 927? 14832 Calculate the lowest common multiple of 105588 and 36. 105588 Calculate the lowest common multiple of 335832 and 5. 1679160 Calculate the smallest common multiple of 792 and 6. 792 Calculate the common denominator of 11/96368 and 47/532. 674576 Calculate the lowest common multiple of 1083 and 3. 1083 What is the least common multiple of 1763277 and 9? 5289831 What is the common denominator of -49/18363 and 47/2809539? 2809539 Calculate the lowest common multiple of 625 and 1800. 45000 What is the smallest common multiple of 6516 and 1? 6516 Calculate the common denominator of -179/1206660 and -29/172380. 1206660 Find the common denominator of -19/8397 and -3/11. 92367 What is the common denominator of -41/56948 and -49/828? 512532 What is the smallest common multiple of 3198 and 10578? 137514 Calculate the lowest common multiple of 1720 and 708. 304440 Calculate the least common multiple of 4197 and 8394. 8394 What is the least common multiple of 744 and 35? 26040 What is the lowest common multiple of 179508 and 280? 1795080 Calculate the lowest common multiple of 320 and 46432. 464320 Find the common denominator of -139/720 and -109/3600. 3600 Calculate the common denominator of -29/745 and 76/9105. 1356645 Calculate the common denominator of -49/1536 and 107/4608. 4608 What is the common denominator of -40/258021 and 21/286690? 2580210 Calculate the common denominator of 97/8 and 89/616002. 2464008 What is the least common multiple of 2 and 172371? 344742 Calculate the common denominator of 31/2844 and 77/41238. 82476 Calculate the lowest common multiple of 228 and 152. 456 What is the least common multiple of 22050 and 8820? 44100 What is the least common multiple of 32605 and 65210? 65210 Calculate the lowest common multiple of 625 and 21975. 549375 Calculate the smallest common multiple of 200 and 528. 13200 Calculate the common denominator of -28/335331 and -161/63270. 3353310 Calculate the common denominator of -47/24 and 65/113528. 340584 What is the smallest common multiple of 2156 and 1618? 1744204 Calculate the common denominator of 33/602 and -74/4257. 59598 Find the common denominator of 83/5012 and -145/252. 45108 Calculate the smallest common multiple of 19266 and 1368. 231192 What is the smallest common multiple of 301 and 20468? 20468 Find the common denominator of -65/4288 and -61/484. 518848 What is the smallest common multiple of 7 and 119961? 839727 Find the common denominator of -29/94055 and 6/15917. 1034605 Calculate the common denominator of 25/88 and 4/22869. 182952 Calculate the smallest common multiple of 513 and 37962. 37962 What is the common denominator of 7/107445 and 79/80? 1719120 Calculate the smallest common multiple of 62670 and 41780. 125340 Calculate the common denominator of 15/7 and 24/85883. 85883 What is the least common multiple of 46480 and 140? 46480 What is the lowest common multiple of 78 and 43488? 565344 Calculate the least common multiple of 711 and 168902. 1520118 Find the common denominator of 8/19895 and -41/5750. 994750 What is the common denominator of 34/21 and 34/6737? 141477 Calculate the lowest common multiple of 14 and 98618. 690326 Calculate the common denominator of 7/5 and -143/54900. 54900 Calculate the least common multiple of 906 and 5388. 813588 Calculate the lowest common multiple of 1789124 and 9. 16102116 Find the common denominator of -55/10224 and -77/3834. 30672 What is the common denominator of 23/12610 and 43/40? 50440 Calculate the common denominator of -139/1980 and 167/20748. 3423420 What is the smallest common multiple of 516 and 147576? 147576 Calculate the common denominator of -109/22860 and 49/21590. 388620 Calculate the common denominator of -61/2604 and 11/15624. 15624 Calculate the lowest common multiple of 434478 and 941369. 5648214 What is the least common multiple of 498 and 46314? 46314 Calculate the common denominator of 115/12768 and 93/128. 51072 What is the smallest common multiple of 26 and 5343? 10686 What is the common denominator of -37/3315 and -38/1599? 135915 What is the smallest common multiple of 34074 and 11358? 34074 What is the common denominator of -13/7962 and -16/1327? 7962 What is the lowest common multiple of 13600 and 1700? 13600 Calculate the common denominator of 45/368 and -103/35232. 810336 Find the common denominator of 95/97632 and 109/10848. 97632 Calculate the smallest common multiple of 875435 and 238755. 2626305 Calculate the least common multiple of 4710 and 4239. 42390 Calculate the least common multiple of 70665 and 181710. 1271970 Calculate the common denominator of -10/303719 and -7/116815. 1518595 Find the common denominator of 59/53120 and 31/26560. 53120 What is the lowest common multiple of 7938 and 77? 87318 Calculate the common denominator of 33/11675 and 48/115. 268525 Calculate the common denominator of -19/3003960 and -73/90. 9011880 Calculate the common denominator of -7/10560 and -139/2772. 221760 What is the common denominator of 103/1584 and -75/56? 11088 Find the common denominator of -145/6696 and 53/94860. 569160 Calculate the common denominator of -79/3468 and -71/249. 287844 What is the lowest common multiple of 847 and 15730? 110110 What is the smallest common multiple of 88 and 26466? 105864 What is the common denominator of 35/78866 and 77/16? 630928 Calculate the smallest common multiple of 3842 and 357. 80682 What is the smallest common multiple of 6 and 47025? 94050 What is the lowest common multiple of 77586 and 3? 77586 What is the common denominator of 101/16 and -151/59430? 475440 What is the least common multiple of 28752 and 2976? 1782624 What is the common denominator of -43/324094 and -57/4? 648188 What is the least common multiple of 5640 and 10152? 50760 Find the common denominator of 19/13180 and -121/160. 105440 Find the common denominator of -121/259584 and 49/32448. 259584 Calculate the lowest common multiple of 3086 and 2. 3086 Calculate the common denominator of 97/280 and -113/12940. 181160 Calculate the common denominator of -26/236125 and 68/55. 2597375 What is the least common multiple of 2334477 and 1116489? 25679247 What is the common denominator of -57/574 and -57/287164? 2010148 Calculate the common denominator of -109/50220 and -44/125. 1255500 What is the common denominator of -13/7684 and -37/1344? 2581824 Calculate the lowest common multiple of 247266 and 27. 247266 Calculate the common denominator of -67/6669 and 56/6669. 6669 What is the common denominator of 39/266 and 29/61726? 1172794 What is the lowest common multiple of 11224 and 1288? 78568 Find the common denominator of -71/207495 and 67/1044. 829980 What is the smallest common multiple of 70 and 7682? 268870 What is the lowest common multiple of 672 and 33352? 2801568 Find the common denominator of 31/15143 and -50/11. 166573 Calculate the lowest common multiple of 18 and 14160. 42480 Find the common denominator of 37/196476 and -33/163730. 982380 Find the common denominator of 97/41068 and 131/18. 369612 What is the lowest common multiple of 355290 and 13? 355290 What is the common denominator of 17/588 and 89/48321? 1352988 Calculate the smallest common multiple of 22049 and 187. 242539 What is the lowest common multiple of 168 and 2597? 62328 Find the common denominator of 167/37506 and 62/4935. 187530 Find the common denominator of -29/1960 and -75/64. 15680 Calculate the common denominator of -17/5744 and -59/24. 17232 Calculate the common denominator of -127/1218 and 11/21112. 63336 What is the smallest common multiple of 247596 and 1316? 1733172 Calculate the least common multiple of 4701 and 75. 117525 What is the common denominator of 31/94444 and 13/1818047? 7272188 What is the smallest common multiple of 21204 and 8835? 106020 What is the lowest common multiple of 18 and 13968? 13968 What is the common denominator of -14/64539 and 19/2208668? 19878012 What is the least common multiple of 5996 and 1282? 3843436 Calculate the smallest common mu	{ "pile_set_name": "DM Mathematics" }
3.04 - 3953. Which is the closest to -2? (a) 0.4 (b) 7 (c) q c Let k = -0.012 + -39.988. Let v = k - -40.68. Let t = v + 0.32. What is the nearest to 0.1 in 5, -1/9, t? -1/9 Let n = -723.9 + 721.9. Which is the closest to 2/7? (a) -2/13 (b) -6 (c) n (d) 0 d Let t be (-15)/(-55)2/(-3). Let o be (-302)/140 + (-21)/(-14). Let p = o - -6/7. What is the closest to -3 in -2, t, p? -2 Suppose -78 + 48 = -h. Suppose 2g + h + 2 = z, -100 = -4z + g. Suppose 24w - z = 30w. Which is the closest to -2? (a) w (b) 0.8 (c) 6/7 a Let u = 1.873 - 1.573. What is the nearest to 10 in u, 4, -2/3, -7/5? 4 Let t = -0.25297 + 0.55297. Let j = 8 + -13. Which is the nearest to t? (a) j (b) 0 (c) -0.1 b Suppose 0 = -20u - 322 - 518. Let k be (4 + 166/u)(-4 - -10). What is the closest to k in -1, -84, -2/3? -2/3 Let t = -43 + 24. Let o = -20 - t. Let y = o + 0.5. What is the closest to 2/41 in 0, y, 0.2? 0 Let m = 20763 - 20758. Let z = -1.02 - -0.02. Which is the nearest to -1/2? (a) m (b) z (c) 0.12 (d) -3/8 d Suppose -201f + 13 = p - 196f, 2p = -3f + 12. Which is the closest to -0.5? (a) 2 (b) -8 (c) p (d) -2/5 d Let u(i) = i2 + 184i + 1237. Let c be u(-7). What is the closest to c in 2, -0.1, 3/8, 0.6? -0.1 Let m = 0 - -1. Let d be (-4)/(-5)((-726)/(-54) - 14). Let o = 0.245 + 0.855. What is the nearest to m in 2/3, o, d? o Let q = 456 - 456. Let w = -0.27 + 13.27. Let u = w - 9. Which is the nearest to -1? (a) u (b) 2 (c) q c Suppose -y + 58 = -32. Let s be -27(6/(-10))/(y/(-50)). Which is the nearest to 3? (a) s (b) -1/8 (c) 1 c Let n(g) = -36g - 2740. Let x be n(-76). Which is the nearest to 1/4? (a) -7 (b) 1/12 (c) 0 (d) x b Let u = -0.1662 + 0.22. Let v = u - -3.9462. What is the nearest to 2/7 in 1/4, v, 2/9, 0.4? 1/4 Let s be (-195)/35 - (-36)/63 - 2. Let v = 0.3 + -0.2. Which is the nearest to 3? (a) v (b) -1/5 (c) s a Let t = -1.89 - -1.954. Let y = -5.064 + t. What is the nearest to -1/2 in 0.16, -0.2, y? -0.2 Suppose -2d + z + 140 = 0, 0d - 4d - z + 280 = 0. Let j = -68 + d. Let q be j/(-16)-2 + (-154)/(-440). Which is the closest to 0.1? (a) -0.2 (b) -4 (c) q a Let w = -0.2785 + 0.3785. What is the nearest to -0.1 in w, 26, 6? w Let m = 1353.2 - 1353. Which is the closest to -6/11? (a) 0.3 (b) m (c) -15 (d) 0.1 d Let z = -0.246 + -138.754. Let u = 145 + z. What is the nearest to 0 in u, -2/11, 1/3? -2/11 Let q = 3758 + -3748. What is the nearest to 1 in -5, q, 0, 2/11? 2/11 Let v = 40/11 + -167/55. Suppose -5s - 2l + 19 = 0, -5s + 2l + 19 = -12. Let r be 2/(-28)(27 - 7)/s. Which is the nearest to r? (a) v (b) -3/4 (c) 2 b Suppose 105 = -29p + 22p. Let m = 73/5 + p. Which is the closest to m? (a) 2/9 (b) 1/2 (c) 0.4 a Let l = -2.653 - -55.653. Which is the closest to 2/13? (a) -0.1 (b) l (c) 2 a Let p = -1364 + 1366. Suppose w - 5 - 5 = -5u, 2u = -w + 4. Let t be 1/((8/u)/8). What is the nearest to p in t, -0.3, -3? t Let v = 62.7 - 32. Let r = v + -33.7. What is the nearest to -0.3 in -0.4, -2/15, r? -0.4 Let l be 4/(-438)594/990. Which is the nearest to 0.2? (a) 1/2 (b) -2 (c) l c Let h = 19 - -89. Let n = -107.8 + h. Let t = 0.2 + -0.7. Which is the closest to 1/4? (a) 4/15 (b) n (c) t a Suppose -10 = -21y + 26y. Let f be (-2)/(77/98 + y/7). What is the nearest to -59 in -2, 0.4, f? f Let v be (-496 - -495)(-15 - -2). What is the closest to 2/3 in -3, v, 0.1, -9? 0.1 Let m be (-8)/(-12)(-3)/92. Let l = m + 14/115. Let k = 0.031259 - 2.031259. Which is the closest to -0.1? (a) l (b) 4 (c) k a Let v(i) = -i3 - 16i*2 - 15i + 16. Let h be v(-15). Let y be 6/(-8) - (-140)/h. Which is the nearest to y? (a) -2/3 (b) -1 (c) 5 c Let f = 9455 + -9454. Which is the nearest to f? (a) -154 (b) 4 (c) 2 c Suppose 2i - 26 = -4c, 7c + 19 = i + 12c. What is the nearest to -0.31 in 0.2, 1, i? 0.2 Let l = 194 + -211. Let s be -60 - ((-6)/(-9))/((-6)/9). Let g = 58 + s. Which is the nearest to g? (a) l (b) -5 (c) 1/4 c Let a be 20/(-88)(-540)/75. What is the nearest to 3 in a, 4, -1? 4 Let m = 81 + 71. Let y = m - 151. Let p = 285/1768 - 1/136. What is the nearest to 0.1 in p, -1, y? p Suppose -5l + 2b = 23, 1 = 2l + b + 3. Let w(z) = z*3 + 5z*2 + 5z - 1. Let t be w(l). Let d = -0.06 + 0.12. What is the nearest to d in -6/11, t, -4? -6/11 Let s = 926 + -924. Let f = -0.15 + 0.15. Which is the closest to -0.1? (a) f (b) s (c) 19 (d) 1/6 a Let p = -7383/4 - -1857. Let h = -311/28 + p. Which is the closest to 0.2? (a) h (b) 5/2 (c) -0.5 a Let q(x) = -x*3 + 22x*2 + 48x + 2. Let u be q(24). Let l = 4 - 4. Suppose 3k = 3p - 24, -2p - k + uk + 11 = l. What is the closest to -0.1 in p, -5, -1? -1 Let g = -665/1298 + 8/649. Suppose 8 = -w - w. Which is the nearest to 3? (a) -0.1 (b) w (c) 4 (d) g c Let n be (-4)/(-8) - 495/110. What is the closest to 30 in n, 2, 2/11? 2 Let i = 1 - 0. Let u = -1526.08 - -1522.08. Which is the nearest to -3? (a) u (b) i (c) 1/5 (d) 9 a Let q(m) = -5m2 - 35m - 4. Suppose 27 = -7o - 22. Let l be q(o). Let k = 2 - 2. What is the closest to l in 0.1, 0.02, k? k Let t = -244 - -334. Let c = 90.1 - t. Let l = 11 - 7. What is the nearest to -0.1 in c, 1/3, l? c Let r = 0.4 + -0.1. Let q = -5.2 + 5.3. Let i = -16 - -15.8. What is the closest to q in 1, i, r? r Let x = -14153 - -183987/13. Which is the nearest to -0.13? (a) 14 (b) x (c) -7 b Let v = 6.734 + 0.066. Let m = v - 2.8. Suppose 4q + 3 = -1. Which is the nearest to q? (a) m (b) 0.1 (c) -3 b Suppose i + 5a = 0, 4a + 3 = i - 15. Let v = i - 17. Let p = -862 + 863. What is the nearest to v in 5, p, -3? -3 Let x = -1708/9 - -39554/207. Let f = -37/46 + x. Which is the closest to -0.1? (a) -1 (b) -4 (c) f c Let v = -37 - -55. Let k be (3/(-4))/(27/v). Let h = -0.11 - -0.01. Which is the closest to h? (a) -0.1 (b) -3 (c) k a Let q be (-4)/(-10)(-76)/(-152). Which is the closest to -2/27? (a) 0 (b) 1/6 (c) 2/11 (d) q a Let y(c) = 44c - 592. Let s be y(14). What is the closest to 1/2 in -3, s, 0.6? 0.6 Let y = -490 + 489. Let k be (15/3)/(-18 + 12). Which is the nearest to k? (a) -0.2 (b) y (c) 5 (d) 0.3 b Let z = 15704 - 15702. Which is the closest to z? (a) -3 (b) 5 (c) -0.3811 c Suppose -3s - 24 = 12. Let f be -4(27/18)/((-9)/s). Which is the closest to 1? (a) -4/7 (b) -1 (c) f a Let f = -58/715 + -4/55. Let v = -7.0858 + 0.0858. What is the closest to v in f, -5, 2/13, 0.4? -5 Let g = 2 - 2.5. Let k = 1684 - 1676. Which is the closest to k? (a) -3/7 (b) g (c) 3 c Let h = 139.7 - 143.7. Let v = -0.1 - 0.2. What is the nearest to h in 2/5, -1, v, -2/5? -1 Let l = -120.51 + 120.5. Which is the closest to -3? (a) 3 (b) l (c) -4 (d) 0 c Let z = 0.4 - 0.5. Let a = -6.678 - -6.8. Let b = -2.878 - a. What is the closest to z in b, -0.6, 1? -0.6 Let d(m) = -m*2 - 4m - 1. Let u be d(-4). Let k = 284.03 - 288.03. What is the closest to -38 in 4/7, u, k? k Let t = 0.03483 - 0.23483. What is the closest to t in -0.5, -4, -5, -1/13? -1/13 Suppose -337 + 130 = -23i. Which is the nearest to 0.1? (a) 5 (b) i (c) 0.4 c Let h = 483.3 - 482.9. What is the nearest to 3/10 in h, -0.2, -2/9? h Let r = -4809.8 + 4810. Which is the closest to 27? (a) -4 (b) 5 (c) 3 (d) r b Let p = 462 - 265. Let m = p + -198. Which is the nearest to m? (a) 3 (b) 0 (c) 15 b Let n be 2/(-4)(0 + 1). Let s = -1.3079 - 0.6921. What is the closest to 1/4 in s, 7, n, 0.4? 0.4 Let o be (9 + 2)24/445/16. What is the closest to -1 in -1/6, 1, 3/5, o? -1/6 Let k = -144 - -140. Suppose 0 = -5x - x + 30. Suppose 3s - 14 = xp - 0p, 5s = 4p + 19. What is the nearest to p in -1/2, 0.9, k? -1/2 Let m = -2514.9 - -2515. Which is the closest to 2/37? (a) -1 (b) 0.17 (c) 4 (d) m d Let h = -1129 + 450. Let f = -680 - h. What is the nearest to f in -2/13, 0, -2/5? -2/5 Let u = -18.42 - -15.42. Which is the nearest to -1/22? (a) -0.02 (b) -1 (c) u (d) 1/5 a Let d be 2/(-17) - ((-1135)/255 - -5). Let o = 0.132 + -0.132. What is the nearest to o in 0.3, d, -12, 0.1? 0.1 Let z = 37 - 15. Let v = z + -25. Which is the nearest to 2? (a) v (b) 0.2 (c) 5 b Let w be (3 - 38/12) + (-240104)/528. Let c = -455 - w. What is the closest to 0 in 148, c, 0.5?	{ "pile_set_name": "DM Mathematics" }
se 2. -101101000 3342 (base 10) to base 5 101332 537 (base 16) to base 2 10100110111 What is 2167 (base 12) in base 2? 111001011111 Convert -1075 (base 13) to base 5. -33133 -2221 (base 13) to base 12 -2907 -4443 (base 7) to base 15 -719 -2317 (base 8) to base 13 -739 Convert 325 (base 9) to base 4. 10022 b22 (base 14) to base 12 1322 -4413 (base 6) to base 10 -1017 What is -588 (base 14) in base 9? -1452 What is -6453 (base 7) in base 4? -203310 -18656 (base 15) to base 3 -11000110000 17c3 (base 14) to base 11 3248 141177 (base 8) to base 2 1100001001111111 What is -4194 (base 13) in base 11? -6903 -1acd (base 16) to base 15 -2076 What is -121 (base 16) in base 4? -10201 5646 (base 7) to base 16 7fb What is -2860 (base 11) in base 10? -3696 Convert -202000010 (base 3) to base 5. -431313 -d20b (base 14) to base 4 -20303223 2200 (base 5) to base 16 12c What is -121a (base 15) in base 6? -25454 What is -360 (base 11) in base 15? -1d9 -114400 (base 5) to base 16 -10fe Convert 650 (base 8) to base 14. 224 -691 (base 10) to base 14 -375 Convert -10110001011111 (base 2) to base 6. -124331 Convert -12322 (base 5) to base 6. -4242 -11701 (base 8) to base 10 -5057 What is 11300 (base 4) in base 2? 101110000 What is 2000201 (base 3) in base 13? 898 Convert -8893 (base 12) to base 8. -35357 What is -221201 (base 3) in base 14? -378 -11123 (base 5) to base 15 -378 Convert 1327 (base 9) to base 10. 997 What is 1200020 (base 3) in base 7? 3363 1156 (base 7) to base 3 121001 -5352 (base 7) to base 6 -12443 What is 745 (base 8) in base 14? 269 What is 21022110 (base 4) in base 12? 19870 Convert -314 (base 7) to base 15. -a8 409c (base 16) to base 2 100000010011100 230 (base 9) to base 2 10111101 What is 51 (base 12) in base 14? 45 Convert 100001011111 (base 2) to base 9. 2841 What is -1102413 (base 5) in base 16? -4aa4 4333 (base 5) to base 6 2425 2847 (base 11) to base 9 5040 -23020101 (base 4) to base 3 -2022112100 -91 (base 15) to base 7 -253 -2cb (base 16) to base 3 -222111 525 (base 12) to base 11 621 What is -822 (base 11) in base 3? -1100202 Convert -26522 (base 11) to base 14. -db4d What is 1052 (base 11) in base 2? 10101101100 What is -111330 (base 7) in base 6? -231143 14827 (base 9) to base 12 5a5a -2323 (base 8) to base 12 -86b Convert -1000001111001011 (base 2) to base 9. -51247 -206 (base 15) to base 3 -121220 Convert -11328 (base 10) to base 2. -10110001000000 What is 1435 (base 6) in base 13? 236 What is -7a6 (base 15) in base 7? -5022 Convert -2332 (base 5) to base 13. -204 -bdc (base 16) to base 15 -d76 Convert -3b16 (base 13) to base 9. -12550 What is -3015 (base 11) in base 13? -1a95 -230313 (base 6) to base 2 -100110001100101 What is 7696 (base 10) in base 15? 2431 Convert 5512 (base 13) to base 6. 130501 What is a7c (base 13) in base 3? 2110102 -18471 (base 10) to base 14 -6a35 What is 112300 (base 4) in base 6? 10424 -582 (base 11) to base 3 -221202 Convert -32431 (base 5) to base 13. -1035 What is -6bc (base 13) in base 3? -1121022 What is -622 (base 9) in base 5? -4011 What is 1282 (base 12) in base 9? 2808 1a1a (base 16) to base 15 1ea7 Convert -53 (base 9) to base 5. -143 Convert 349 (base 16) to base 13. 4c9 2b90a (base 12) to base 7 345064 -1111011 (base 3) to base 12 -764 Convert 3960 (base 12) to base 14. 2560 1100001 (base 2) to base 3 10121 Convert 1740 (base 10) to base 15. 7b0 6227 (base 9) to base 5 121221 -43447 (base 9) to base 10 -28798 What is -157003 (base 8) in base 11? -39779 What is -aa (base 14) in base 12? -106 Convert -1002 (base 3) to base 16. -1d Convert -320 (base 8) to base 14. -10c Convert 5423 (base 6) to base 11. a27 What is 2022002 (base 3) in base 15? 76b Convert 175 (base 11) to base 2. 11001011 What is -2460 (base 7) in base 9? -1236 What is -2c4d (base 16) in base 12? -6691 -1000101101 (base 2) to base 7 -1424 -132215 (base 7) to base 14 -907c 3745 (base 8) to base 3 2202212 224313 (base 5) to base 10 8083 What is -10100000100111 (base 2) in base 15? -30a4 What is -193 (base 11) in base 9? -267 Convert 521 (base 9) to base 15. 1d4 33 (base 15) to base 5 143 What is -1b6 (base 16) in base 2? -110110110 What is -12c (base 16) in base 15? -150 What is -20415 (base 6) in base 5? -41442 -149 (base 14) to base 10 -261 2246 (base 7) to base 15 398 Convert 36b (base 13) to base 15. 29b -1a376 (base 12) to base 15 -b643 -91 (base 16) to base 11 -122 434225 (base 6) to base 2 1000110001101001 What is 4858 (base 14) in base 8? 30516 What is -873 (base 10) in base 12? -609 What is 73571 (base 8) in base 4? 13131321 What is b724 (base 14) in base 5? 2002323 -111111110110 (base 2) to base 16 -ff6 What is 273 (base 13) in base 10? 432 Convert 3335 (base 13) to base 10. 7142 -3230331 (base 4) to base 5 -441130 2001012 (base 3) to base 5 21430 Convert -116 (base 7) to base 10. -62 What is -5f2 (base 16) in base 15? -6b7 -3541 (base 12) to base 2 -1011101000001 What is 3685 (base 10) in base 12? 2171 What is 28c (base 13) in base 14? 246 Convert 434 (base 5) to base 7. 230 Convert -383 (base 13) to base 12. -432 Convert -1737 (base 13) to base 6. -23510 What is 3057 (base 9) in base 12? 1367 Convert 201022 (base 4) to base 9. 2817 What is 20280 (base 12) in base 3? 2010102020 What is -995 (base 13) in base 12? -b4b What is -303131 (base 4) in base 13? -1664 What is 4411 (base 6) in base 8? 1767 -11000101110 (base 2) to base 3 -2011121 What is -1000000001 (base 2) in base 13? -306 Convert 2213 (base 6) to base 2. 1000000001 What is -53 (base 16) in base 6? -215 539 (base 12) to base 14 3c9 -1cf (base 16) to base 2 -111001111 1aa (base 14) to base 9 424 Convert 22021222 (base 3) to base 8. 13637 103403 (base 7) to base 16 4673 38866 (base 10) to base 16 97d2 What is 2757 (base 10) in base 4? 223011 Convert 30200322 (base 4) to base 11. 35569 Convert 36a5 (base 11) to base 7. 20044 What is 337 (base 14) in base 15? 2c7 Convert -2020 (base 5) to base 14. -148 Convert 12f3 (base 16) to base 8. 11363 Convert 87 (base 15) to base 12. a7 -100022221 (base 3) to base 8 -15222 Convert -1000011 (base 2) to base 9. -74 Convert -52 (base 11) to base 13. -45 Convert 1015 (base 14) to base 13. 1347 Convert -3286 (base 13) to base 14. -27cb What is -43335 (base 8) in base 11? -126a2 40aa7 (base 11) to base 7 336416 4a08 (base 11) to base 7 25034 Convert 375 (base 12) to base 7. 1343 12143 (base 10) to base 3 121122202 Convert 14e (base 15) to base 11. 252 Convert -5131 (base 6) to base 8. -2157 What is -11233 (base 4) in base 5? -2432 What is -102110120 (base 3) in base 7? -33240 11c3 (base 16) to base 4 1013003 Convert 1014 (base 5) to base 7. 251 28a2 (base 13) to base 11 4464 What is 11fc (base 16) in base 8? 10774 2431 (base 5) to base 6 1410 Convert -1d32 (base 14) to base 11. -4011 What is -200201201 (base 3) in base 16? -3556 32020 (base 5) to base 2 100001010111 What is -15bb (base 12) in base 7? -10361 Convert 111222020 (base 3) to base 6. 115053 Convert 122021102 (base 3) to base 2. 11000100110001 -111111 (base 5) to base 3 -12100200 Convert 63521 (base 8) to base 9. 40247 What is 17659 (base 10) in base 16? 44fb What is 3041 (base 9) in base 7? 6325 What is -311 (base 4) in base 2? -110101 Convert -2022010 (base 4) to base 11. -6703 Convert 11012021 (base 3) to base 10. 3058 -66a3 (base 12) to base 5 -330410 What is -1034 (base 7) in base 11? -305 -94b1 (base 13) to base 3 -1001020201 What is c41 (base 14) in base 12? 1489 674 (base 8) to base 5 3234 Convert 1766 (base 8) to base 4. 33312 -20443 (base 8) to base 15 -27a8 -100 (base 16) to base 7 -514 What is -103130 (base 4) in base 15? -57e Convert 25201 (base 10) to base 8. 61161 Convert -1430414 (base 5) to base 6. -351221 -272 (base 16) to base 3 -212012 What is 97b (base 13) in base 3? 2020010 Convert -100000 (base 2) to base 16. -20 What is -212152 (base 8) in base 7? -413206 What is 421506 (base 7) in base 11? 4a622 What is 478 (base 14) in base 2? 1101111010 Convert 2147b (base 12) to base 9. 66155 What is -3240 (base 5) in base 15? -1ea Convert -10112001 (base 3) to base 14. -d14 What is -c69 (base 13) in base 15? -960 Convert 10102202 (base 3) to base 8. 4710 23887 (base 10) to base 13 ab46 What is -3554 (base 11) in base 10? -4657 -409 (base 15) to base 16 -3	{ "pile_set_name": "DM Mathematics" }
5, -3, 2/13, -10? -10 What is the second smallest value in -0.418986, -5/6, 0.3? -0.418986 Which is the second biggest value? (a) 19 (b) -157.67 (c) -6/25 c Which is the fourth smallest value? (a) -3 (b) -11 (c) -2/3 (d) 0 (e) 1173591 (f) 1/4 (g) -0.2 g What is the biggest value in -1, -5557, 0.4, 206? 206 What is the second smallest value in -3/9718, -0.1, -93? -0.1 What is the third smallest value in -1/8, -4/5, -8, 3, 1/237, 5, -1? -4/5 What is the third biggest value in 4/33, 72, 5/397? 5/397 Which is the seventh smallest value? (a) -4 (b) -3/5 (c) 2/13 (d) 1/2 (e) -1 (f) 0.337 (g) 10 g What is the third smallest value in 12, -2/11, 80631? 80631 Which is the third biggest value? (a) -15 (b) -136.47 (c) 96 (d) 1/5 a Which is the second smallest value? (a) -157400/9 (b) 1 (c) -2 c Which is the fourth smallest value? (a) -2 (b) 198 (c) -2/13 (d) -8 (e) -4/9 (f) 195 (g) -1/3 g What is the third biggest value in 2/5, 3, 0, 0.05, -63.13, 6? 2/5 What is the smallest value in -3, -639, -225, 1, -0.3? -639 Which is the sixth smallest value? (a) 0 (b) -0.1 (c) -2/19 (d) 37579 (e) 2/7 (f) -3 d What is the third biggest value in -63, -7, 0.5, -7/3, 11/2? -7/3 Which is the third biggest value? (a) -11 (b) -2 (c) 72 (d) -3 (e) 70 b Which is the smallest value? (a) -24 (b) 0.53 (c) -1/5 (d) 0.1 (e) -1016 e What is the sixth smallest value in 2.9, -0.4, 4, 19.9, 2/13, -3, 0? 4 Which is the biggest value? (a) -2 (b) -23922.77 (c) 0.11 (d) 4 (e) -0.2 d Which is the biggest value? (a) 25 (b) 2/13 (c) 95 (d) -2.8 (e) 17 (f) -3 c Which is the third smallest value? (a) -1/6 (b) 2 (c) -11.12 (d) -0.064 d Which is the third smallest value? (a) -3121/351 (b) 31 (c) -0.5 b Which is the fifth biggest value? (a) 43.6 (b) -0.5 (c) 2 (d) -10 (e) 2/9 d Which is the second biggest value? (a) -7/17 (b) -826/239 (c) -5 b Which is the second smallest value? (a) 0.1 (b) -4 (c) 0 (d) -14 (e) 344.61 (f) 5 b What is the sixth smallest value in -1, 1, 1.449, -2, -846, 3? 3 What is the second biggest value in -0.6, 1042, 188? 188 Which is the second biggest value? (a) 2/13 (b) -3 (c) -0.4 (d) 4 (e) -2467 (f) 0 a What is the second smallest value in -5, 2.1, 0.13, -7.1? -5 What is the fifth smallest value in -0.2, -1, 0.1, -18653/27, 1/11? 0.1 What is the second biggest value in -2/7, 5/171, -2773, -0.2? -0.2 What is the sixth smallest value in -192, -3/11, 6/13, -1, -51, 0, -0.1? 0 What is the smallest value in 0.2, -7575, -843, -0.2? -7575 What is the smallest value in -9, -1/6, 94.35, 1/6, 3, -3? -9 What is the second smallest value in 25/2, 0, -21, -51, 5, -6? -21 Which is the sixth biggest value? (a) 4.3 (b) -10 (c) -1 (d) 1/7 (e) 6 (f) 3 b Which is the sixth smallest value? (a) 576 (b) 123 (c) -0.1 (d) -1.54 (e) -2/3 (f) -3 a What is the smallest value in 3/4, 122.128, 19? 3/4 Which is the sixth smallest value? (a) 7.197 (b) 2 (c) 6 (d) -59/6 (e) 0 (f) -5 a Which is the smallest value? (a) -1 (b) 20 (c) -2/3 (d) -0.2 (e) -0.3 (f) 13 (g) 1/4 a What is the third smallest value in -1.4, -1/5, 3, 19026? 3 What is the fifth biggest value in -3, 3, 18, -4, 13, -0.6? -3 What is the fifth smallest value in 225, -2/6721, 56, -1/5, 2? 225 What is the biggest value in 22, 4/5, -11/9, 374/21? 22 Which is the second smallest value? (a) -2/3 (b) -1147 (c) -1 (d) 4 (e) 0.5 (f) 0.13 (g) 109 c What is the smallest value in 2/18299, 2/5, -4211? -4211 Which is the fifth smallest value? (a) -18 (b) 2/3 (c) 2 (d) -2/23 (e) -0.013104 (f) -0.2 b What is the smallest value in 2/5, 6.5, 0.3, -1/28, 0, 8? -1/28 What is the third smallest value in -366, 3.5, 2/35? 3.5 What is the third smallest value in 4250, 0, -3, 0.8, 7? 0.8 Which is the sixth biggest value? (a) 2.8 (b) -0.0513 (c) 5 (d) 2 (e) -24/23 (f) 0.3 e Which is the third biggest value? (a) -5 (b) 21588 (c) 2.27 a Which is the fourth biggest value? (a) 2/51 (b) -0.3 (c) -82.5 (d) -2.6 c What is the smallest value in -1/9, -121/2, 1977? -121/2 What is the second biggest value in 17, 1/3, 1/6, -35928? 1/3 What is the biggest value in 0.02, 0.1, 1/497, -5, 49, 0.3? 49 What is the third smallest value in -5/3, 0.1, 726, -136, 0.5, -0.02, 4? -0.02 What is the smallest value in 5, -1423/39, -3? -1423/39 Which is the fifth biggest value? (a) 0.5 (b) 107 (c) -49/4 (d) -22.99 (e) 0 d Which is the third smallest value? (a) -1 (b) -243 (c) 9 (d) -9 (e) -2 e What is the smallest value in -2, -199111, 7? -199111 What is the fifth smallest value in 2/25, 0.3, -10/77, 2.71, -3/8, 2/11? 0.3 What is the second biggest value in 345, -1030, 40? 40 What is the fifth smallest value in 4, 0, 32, -1.8, -0.9, 3? 4 Which is the second biggest value? (a) 4 (b) 1/546 (c) 6/5 (d) 1/8 (e) 1 c What is the biggest value in 158, 30392, -1/7, 2? 30392 What is the smallest value in 55, 1045, -18? -18 What is the biggest value in 48608, -1/4, 2.7? 48608 What is the third smallest value in 1/9, 2000, -169, -2/19? 1/9 What is the sixth biggest value in -0.2, -19, -9, 1/13, 4, -2/639? -19 Which is the biggest value? (a) -2/5 (b) 8 (c) 0.7 (d) 5 (e) 19/1990 (f) 0.4 b Which is the third smallest value? (a) 13/3 (b) 48 (c) 60.415 (d) 3 b Which is the seventh smallest value? (a) 11 (b) -4 (c) 0 (d) 0.5 (e) 2/13 (f) 13/3 (g) 2/29 a What is the third biggest value in 1/5, -134, -4/5, 5, 0.08, 6/121? 0.08 What is the third biggest value in 7, 12494, 0.2, 2/29? 0.2 Which is the smallest value? (a) -114 (b) -4952 (c) -3.5 b Which is the smallest value? (a) -1/6 (b) 41 (c) 3/3095 (d) -3/2 (e) 1/4 (f) -2 f What is the second smallest value in 15, -12.447, -0.33? -0.33 Which is the third smallest value? (a) 5 (b) 2/23 (c) 226/11 (d) 0 (e) -3/2 (f) 0.24 (g) -3 d What is the biggest value in 45.164794, -1/3, -5? 45.164794 Which is the smallest value? (a) -0.06 (b) 0.29 (c) -211/76 (d) -0.08 c What is the fifth biggest value in 0.1, -5/31, 7, -20, 1/8? -20 Which is the second biggest value? (a) -0.04 (b) -1/3 (c) 3/4 (d) 0.09 (e) -0.3 (f) -5 (g) -4/7 d Which is the smallest value? (a) 53 (b) -4322/5 (c) -5 b Which is the biggest value? (a) 34/685 (b) 256.4 (c) -3/7 b Which is the third biggest value? (a) -9 (b) -7/24 (c) -0.5 (d) 1557 (e) 0 b What is the third biggest value in -155080, 4, -38? -155080 What is the second biggest value in -0.011, 3/4, 2122/3, 3? 3 Which is the sixth smallest value? (a) 2 (b) 0.2 (c) -8.9 (d) -3 (e) 0.06 (f) -2/9 (g) 0.5 g Which is the sixth biggest value? (a) 3/4 (b) 3/7 (c) -1 (d) -8/11 (e) -185 (f) -0.1 e What is the smallest value in 15, -0.008, 0.3, 2, 1/7, -210? -210 What is the biggest value in 2/7, 2/13, 3/4919, -2, 2, 1/5, 0? 2 What is the third smallest value in -0.05, -5, -4, 2151, -0.321? -0.321 What is the third smallest value in -4, 0.1, 3, 4/109, -1023, 4? 4/109 Which is the seventh smallest value? (a) 3 (b) -1 (c) 0.3 (d) 8 (e) 0.9 (f) -2/309 (g) -0.7 d Which is the third biggest value? (a) -2 (b) 4 (c) -0.91 (d) -2/21 (e) -25 (f) 40 d What is the second smallest value in 7, -39, -2, 25, 9, 1/3? -2 What is the biggest value in -623, 4, 56, -6, -2/3? 56 What is the third smallest value in -165.5, -1/29, -1, -1/2? -1/2 Which is the fifth smallest value? (a) -9/2 (b) -106/15 (c) -0.1 (d) -3 (e) 1648 e What is the third biggest value in -1/9, 191, 7, -4/17, -2, -1/3? -1/9 Which is the second smallest value? (a) 361 (b) 33 (c) -107/5 (d) -52 c What is the third smallest value in -1/3, 5, -34, -12, -1.14, -2/9, 47? -1.14 What is the smallest value in 246, -13, -4, 1/5, 4, 12? -13 What is the third smallest value in -1/88, -1.9, -0.7, -4003? -0.7 Which is the third smallest value? (a) -5434 (b) -4 (c) -29/7 b Which is the fifth smallest value? (a) 5 (b) 2/5 (c) -48/43 (d) -3 (e) 88 (f) 2 (g) -4 f Which is the fourth smallest value? (a) 150/11 (b) -8 (c) 3 (d) -232 (e) 0.2 c What is the smallest value in 35323, -0.58, -3, 2/5? -3 What is the fifth smallest value in 39, 0, 0.1, -3, 1, -11, 3931? 1 Which is the second biggest value? (a) 3101934 (b) 0.048 (c) 3 c Which is the third biggest value? (	{ "pile_set_name": "DM Mathematics" }
0005 What is 0.000002337 rounded to seven decimal places? 0.0000023 What is 0.00001386 rounded to 7 dps? 0.0000139 What is -0.000050931 rounded to 7 dps? -0.0000509 What is 0.000072 rounded to 5 decimal places? 0.00007 Round -0.000005918 to 6 decimal places. -0.000006 Round -178510000 to the nearest one million. -179000000 Round -131985 to the nearest one thousand. -132000 What is -0.019116 rounded to three dps? -0.019 Round 0.0000000423 to 7 dps. 0 What is -621930 rounded to the nearest ten thousand? -620000 Round -21973000 to the nearest one million. -22000000 What is 0.2955 rounded to 2 dps? 0.3 Round 4.7014 to 0 decimal places. 5 Round -0.00001458 to seven decimal places. -0.0000146 What is -67.17 rounded to 0 dps? -67 Round 91.262 to the nearest integer. 91 Round 1135 to the nearest ten. 1140 What is -0.00017732 rounded to five decimal places? -0.00018 What is 3942 rounded to the nearest 1000? 4000 Round -0.000003262 to six decimal places. -0.000003 Round 281630 to the nearest 10000. 280000 Round -0.010069 to four decimal places. -0.0101 Round -0.00004291 to 5 dps. -0.00004 Round 0.00003149 to 5 dps. 0.00003 Round 0.00001379 to 5 decimal places. 0.00001 Round -0.37311 to 3 dps. -0.373 What is 121680 rounded to the nearest 1000? 122000 Round -0.0000063987 to six decimal places. -0.000006 Round -0.002043 to three decimal places. -0.002 Round 0.00558 to 2 decimal places. 0.01 Round 21.53 to the nearest ten. 20 What is -0.08858 rounded to three dps? -0.089 Round -0.0047821 to 3 decimal places. -0.005 Round -0.014024 to three dps. -0.014 What is 0.000427829 rounded to 6 decimal places? 0.000428 What is -0.021179 rounded to four decimal places? -0.0212 What is 309.33 rounded to the nearest ten? 310 What is 16027.7 rounded to the nearest 10? 16030 What is -17.68 rounded to the nearest 10? -20 What is -0.002479 rounded to four decimal places? -0.0025 Round 0.0007201 to five decimal places. 0.00072 What is 103.424 rounded to 0 decimal places? 103 Round -0.0122237 to three dps. -0.012 Round -3.218 to 1 dp. -3.2 What is 0.00976 rounded to two dps? 0.01 What is 18258300 rounded to the nearest 100000? 18300000 Round -34898 to the nearest 10000. -30000 What is 0.00000016235 rounded to seven decimal places? 0.0000002 What is 0.0066 rounded to 2 decimal places? 0.01 Round -33.42 to 0 decimal places. -33 Round 0.14715 to 3 dps. 0.147 What is -185.3 rounded to the nearest one hundred? -200 What is -0.2091 rounded to two dps? -0.21 What is 0.00002175 rounded to 6 dps? 0.000022 Round 66.27 to the nearest integer. 66 What is -58710 rounded to the nearest 10000? -60000 What is -167440000 rounded to the nearest 1000000? -167000000 What is 35.341 rounded to 1 decimal place? 35.3 Round 0.0000198098 to 6 decimal places. 0.00002 What is 0.00000069196 rounded to 7 dps? 0.0000007 What is -0.004395 rounded to 4 dps? -0.0044 Round 0.00030486 to four dps. 0.0003 What is 0.303969 rounded to two decimal places? 0.3 What is 208700 rounded to the nearest ten thousand? 210000 What is -123280 rounded to the nearest ten thousand? -120000 Round 171.568 to 0 dps. 172 Round 9.896 to the nearest integer. 10 Round 1.814 to 1 dp. 1.8 What is -0.000008198 rounded to 6 dps? -0.000008 Round -129370000 to the nearest 1000000. -129000000 What is 3.674 rounded to one dp? 3.7 Round 0.020259 to 4 dps. 0.0203 What is -254.35 rounded to 0 dps? -254 What is -0.0000033855 rounded to seven decimal places? -0.0000034 What is -89160 rounded to the nearest one thousand? -89000 What is 152.8 rounded to the nearest 10? 150 Round -1108.19 to the nearest 10. -1110 Round -22488 to the nearest 100. -22500 Round 0.000060885 to five decimal places. 0.00006 What is -0.4016 rounded to one decimal place? -0.4 Round -0.37966 to three decimal places. -0.38 What is -0.14474 rounded to 2 decimal places? -0.14 Round -29.81 to zero dps. -30 What is -0.000044773 rounded to 6 decimal places? -0.000045 Round 0.4269 to 1 dp. 0.4 What is 0.0647742 rounded to 2 decimal places? 0.06 Round -0.52147 to one decimal place. -0.5 Round -17200 to the nearest 10000. -20000 What is -5340000 rounded to the nearest 100000? -5300000 Round 535700 to the nearest 100000. 500000 Round -6.9873 to 0 dps. -7 Round -207717 to the nearest ten thousand. -210000 What is 73860 rounded to the nearest 1000? 74000 Round -144360 to the nearest ten thousand. -140000 Round 0.0000017568 to 6 decimal places. 0.000002 Round 352520 to the nearest one hundred thousand. 400000 What is -21.031 rounded to 1 decimal place? -21 What is -35760 rounded to the nearest 1000? -36000 Round -69440 to the nearest one hundred thousand. -100000 Round -103910000 to the nearest 1000000. -104000000 What is 0.0000074418 rounded to 5 dps? 0.00001 What is 6105 rounded to the nearest 100? 6100 Round 91.02 to zero decimal places. 91 What is 877400 rounded to the nearest 100000? 900000 What is -2983.28 rounded to the nearest ten? -2980 What is 0.6 rounded to 0 dps? 1 Round -88.7 to the nearest one hundred. -100 Round -0.000276 to 4 dps. -0.0003 Round -0.077954 to two decimal places. -0.08 Round -28.93 to 0 dps. -29 What is 0.001401 rounded to 3 decimal places? 0.001 What is -5.49 rounded to the nearest 10? -10 Round -58115000 to the nearest one hundred thousand. -58100000 Round -0.0000008253 to 7 dps. -0.0000008 Round 0.03 to two dps. 0.03 What is -0.000159804 rounded to six dps? -0.00016 Round 0.064021 to 2 dps. 0.06 Round 615000 to the nearest 1000000. 1000000 Round 87216000 to the nearest 1000000. 87000000 What is 3790 rounded to the nearest one thousand? 4000 What is -428600 rounded to the nearest 100000? -400000 Round -2698 to the nearest one hundred. -2700 What is 0.071509 rounded to 2 dps? 0.07 What is -0.0000711 rounded to six decimal places? -0.000071 Round 0.0000062334 to six decimal places. 0.000006 What is -0.00074 rounded to 4 decimal places? -0.0007 Round -0.116304 to two decimal places. -0.12 Round 473970 to the nearest 10000. 470000 What is 163 rounded to the nearest ten? 160 Round -0.00061186 to five decimal places. -0.00061 Round -44110000 to the nearest one million. -44000000 What is 152.09 rounded to zero decimal places? 152 What is 0.000001344 rounded to seven decimal places? 0.0000013 Round -44125000 to the nearest one hundred thousand. -44100000 Round -10.8352 to 1 decimal place. -10.8 What is -0.0701 rounded to one decimal place? -0.1 What is -0.21249 rounded to 2 decimal places? -0.21 What is 749.8 rounded to the nearest one hundred? 700 Round 0.000012292 to six decimal places. 0.000012 Round 7678 to the nearest one hundred. 7700 What is 0.00396 rounded to 3 decimal places? 0.004 What is 0.06049 rounded to 2 dps? 0.06 What is -23970000 rounded to the nearest 1000000? -24000000 Round 0.1154 to 2 dps. 0.12 What is -0.00001888 rounded to five dps? -0.00002 Round -1583200 to the nearest one hundred thousand. -1600000 Round -1627000 to the nearest one million. -2000000 What is 0.000020079 rounded to 7 dps? 0.0000201 Round -3750 to the nearest one hundred. -3800 Round -0.000016357 to six dps. -0.000016 What is 0.0158596 rounded to 4 dps? 0.0159 Round 0.0046032 to five decimal places. 0.0046 What is 10.68 rounded to zero decimal places? 11 What is -9933000 rounded to the nearest one hundred thousand? -9900000 What is 0.41666 rounded to one dp? 0.4 What is -0.0003424 rounded to 4 dps? -0.0003 What is 0.21852 rounded to 3 decimal places? 0.219 Round -0.071829 to three dps. -0.072 What is -0.236 rounded to 2 decimal places? -0.24 Round -9140 to the nearest 1000. -9000 Round 245560 to the nearest 1000. 246000 What is 7413 rounded to the nearest one hundred? 7400 Round 94.86 to the nearest integer. 95 What is 0.00000481 rounded to seven dps? 0.0000048 What is -0.14209 rounded to two decimal places? -0.14 What is 2.5868 rounded to two dps? 2.59 Round 0.00196698 to 4 decimal places. 0.002 What is -0.00000759 rounded to 5 dps? -0.00001 What is -63441 rounded to the nearest 10000? -60000 What is -0.07688 rounded to three dps? -0.077 What is 267.5 rounded to the nearest 100? 300 Round -0.04083 to 4 decimal places. -0.0408 Round -0.0683 to 2 decimal places. -0.07 What is 0.0002459 rounded to five decimal places? 0.00025 Round 0.06776 to three decimal places. 0.068 Rou	{ "pile_set_name": "DM Mathematics" }
es? -0.00001 Let u = -0.07 + 0.01. Let c = u + 0.0597. What is c rounded to 3 dps? 0 Let i = -4 + 3. Let q = 0.98 + i. Let z = -0.019998 - q. What is z rounded to 5 decimal places? 0 Let r = 1117.79 + -1126. What is r rounded to the nearest integer? -8 Let x = -31.4921451 + 10.49214565. Let p = 21 + x. What is p rounded to seven dps? 0.0000006 Let y be 11700006/(-9) + (-16)/(-24). Round y to the nearest one million. -1000000 Let i = 37 + -36.99999961. What is i rounded to 7 dps? 0.0000004 Let i = -414.23196 + 414.52595881. Let m = i + -0.294. What is m rounded to seven decimal places? -0.0000012 Let s = -1.05067 + 0.05047. Let z = 1 + s. Round z to three dps. 0 Let x be (-2)/(-3) - 11/3. Let h(c) = 8c2. Let f be h(x). What is f rounded to the nearest ten? 70 Let y = 0.42343 - -19.57357. Let h = -20 + y. What is h rounded to three decimal places? -0.003 Let s = -19 - -18.99999972. Round s to seven decimal places. -0.0000003 Let k = -0.03 + 0.03. Let b = k + -52.2. Let p = -57 - b. What is p rounded to the nearest integer? -5 Let h = 45621.9348094 - 45535.9348. Let i = -54 - -140. Let w = h - i. Round w to 6 dps. 0.000009 Let q = -3 + 1. Let d = -7 - q. Let s = d - -3. What is s rounded to the nearest 10? 0 Let y = -1495229167 + 1495229098.9673931. Let o = y + 0.0380069. Let h = o - -68. What is h rounded to 3 dps? 0.005 Suppose 3l + 12 = -3m, -4l + 2m - 1 = -9. Suppose lz + 1540000 = -2z. What is z rounded to the nearest one hundred thousand? -800000 Let u = -3 + 2.9957. What is u rounded to 3 dps? -0.004 Let o(k) = -195556k - 4. Let b be o(-9). What is b rounded to the nearest one hundred thousand? 1800000 Let d = -77.99965 - -78. What is d rounded to 4 decimal places? 0.0004 Let v = -63.0292 - -63. Round v to three dps. -0.029 Let s = 0.311 - -145.689. Let k = s + -146.00123. Round k to 4 decimal places. -0.0012 Let u = 1118.7 - -112016.3. Let s = -113163.9924 + u. Let p = -29 - s. Round p to three decimal places. -0.008 Let p = 0.5414356 + 6.45856515. Let c = 7 - p. Round c to seven dps. -0.0000008 Let f = -189.63 + 191. What is f rounded to one decimal place? 1.4 Suppose 4c - 9 = 3a, 4a - 3c = -0a - 12. Let s be (a/(-2))/((-2)/(-4)). Suppose 0 = -sf - f + 16000. Round f to the nearest 10000. 0 Suppose -h + 1 = 3. Let g be 22(h + 1)/(-1). What is g rounded to the nearest 10? 20 Let v be (2 - 1) + -7 + -3099994. Round v to the nearest 1000000. -3000000 Suppose -4 = 3t + 2. Let n(x) = x*3 + 2x*2 - x - 2. Let p be n(t). Suppose p = -5u - 0u - 400. What is u rounded to the nearest ten? -80 Let m = -3 - -7. Let b = m - 4.00082. What is b rounded to four dps? -0.0008 Let p = 153.2 - 289.1. Let s = -125 - p. Let m = -10.89999921 + s. What is m rounded to seven decimal places? 0.0000008 Let s = -654.2 - -657.201. Let a = s + -3. What is a rounded to 3 dps? 0.001 Suppose 4 = -2b - 4. Let w(c) be the second derivative of 1033c3/2 - 2c*2 - 3c. Let z be w(b). Round z to the nearest one thousand. -12000 Let c = -97.765 + 53.682. Let q = 0.083 + c. Let g = 44.00000201 + q. What is g rounded to 7 dps? 0.000002 Let f = -64956 + 2218708. Let o = -4853752 + f. Round o to the nearest one million. -3000000 Let d = -66.0000288 + 66. What is d rounded to 5 dps? -0.00003 Suppose 0 = s + 2g + 690008, -349773 + 1039785 = -s - 3g. Round s to the nearest 100000. -700000 Suppose -11 - 1 = -4s. Suppose -5i + 0i - 4p = -1, si - 1 = -2p. Let m(n) = -5901n + 1. Let w be m(i). What is w rounded to the nearest one thousand? -6000 Suppose 5u - z - 34436 = -3105, 0 = -z + 4. Let n be (3 - 2) + (u - 1). Let l = -967 + n. What is l rounded to the nearest 1000? 5000 Suppose 2t + 29 = -5. Let i = t - -134. Round i to the nearest 10. 120 Let v(k) = -5k*2 + 11k + 24. Let m be v(11). What is m rounded to the nearest 1000? 0 Let u = -61 + -25. Let c = -1258.9 - -1334. Let h = u + c. What is h rounded to 0 dps? -11 Let o = 11.902 - 12. Let d = 0.0979949 + o. What is d rounded to 6 dps? -0.000005 Let o = 4 - 4. Suppose -2x + 3739876 + 6460124 = o. Round x to the nearest 1000000. 5000000 Let n = 54 - 53.53. What is n rounded to 1 dp? 0.5 Suppose -s + 2560 = -0s. What is s rounded to the nearest 100? 2600 Let n be ((-180)/(-27))/((-1)/(-33000)). What is n rounded to the nearest one hundred thousand? 200000 Let i = 0 - -4. Suppose 5u + 5l = 750000, 3u + il = -0l + 450000. What is u rounded to the nearest one hundred thousand? 200000 Suppose -8n + 13n - 30 = 0. Suppose 0l + 3l - 3x + 2399991 = 0, 0 = 2x + n. What is l rounded to the nearest 100000? -800000 Let v be (-1 + -1)/(1/(-8)). Let q(o) = 21o*3 + 9o*2 - 20o. Let y be q(v). Round y to the nearest 10000. 90000 Suppose -5g + 3x = -0x - 84781181, 67824967 = 4g + 5x. Suppose 4r = 5r - 4. Suppose -ri + g = -10243762. Round i to the nearest 1000000. 7000000 Let u = 7.09 + -0.09. Let j = 0.00978 + -7.01138. Let f = j + u. What is f rounded to 3 decimal places? -0.002 Suppose 3b = -2v + 3v - 17, -2b = 2v + 14. Let r be 86002/(b/(-2 - 1)). Let g be (-1)/5 + r/5. Round g to the nearest one thousand. 9000 Suppose -r = 5g - 4, -3g - 47 = -5r - g. Let p = -1 + r. Let h(w) = 12w3 - w2 + 2w + 4. Let m be h(p). What is m rounded to the nearest one thousand? 6000 Let i = 6202434 - -897566. Round i to the nearest 1000000. 7000000 Suppose 5p - p = 100000. What is p rounded to the nearest 10000? 30000 Let i = -0.020254 - -24390.020254. Let f = 24390.39996 - i. Let d = 0.4 - f. What is d rounded to four dps? 0 Let v = 37.8 - 41. Let s = v + 3.1935. Round s to three dps. -0.007 Let n = 154630 - -107370. What is n rounded to the nearest 10000? 260000 Let q = 6 + -3. Suppose 2s + q + 4 = -r, 20 = -2r + 2s. Round r to the nearest integer. -9 Suppose -5u - 1800 = -0u. What is u rounded to the nearest one hundred? -400 Suppose 0h - 3s + 23 = h, -3s = -h - 7. Let w = h - 5. Suppose 0 = -wt + t - 8800000. Round t to the nearest 1000000. -4000000 Let j = 31 - 21. Suppose 2z = 2x - 10, jz + 10 = 5z + 2x. Round z to four dps. 0 Let h be (61/2)/(1/(-15514)). Let w = 153177 + h. Round w to the nearest 100000. -300000 Suppose -38569286 + 16069286 = 5c. What is c rounded to the nearest 1000000? -5000000 Suppose 4w + 3152 = 352. Round w to the nearest 1000. -1000 Let g = -37.993 + -0.007. Let b = g + 38.21. Round b to one dp. 0.2 Let f(s) = s2 + 8s + 10. Let a be f(-7). Suppose 0 = ah + 52075 - 18175. What is h rounded to the nearest one thousand? -11000 Let p be 554/151. Let j be (-1015204)/p - 6/(-27). Let i be j/1(-50)/(-6). What is i rounded to the nearest 100000? -500000 Let y be 4 - (2/(-1) - -1). Suppose 2j - 3l - 1250 = 2l, 0 = -j - yl + 625. Suppose 0u - 5n = 4u + j, u + n = -155. Round u to the nearest one hundred. -200 Suppose 5z + 7868 - 1718 = 0. What is z rounded to the nearest 100? -1200 Let l = -29339 - -73339. What is l rounded to the nearest 10000? 40000 Let j = -126 - -274. Let d = j - 148.00134. Round d to 4 decimal places. -0.0013 Let g = -20 + 8. Let l = g + 12.4. Round l to zero decimal places. 0 Let h = -62.00036 - -62. What is h rounded to four dps? -0.0004 Let q be (-1 - -1)/2 - 2. Let t(o) = 7o3 + 2o*2 + o - 2. Let j be t(q). Round j to the nearest 10. -50 Let q = 5.8031 + -5.8. Round q to 3 decimal places. 0.003 Let o = -0.061 + 27.061. Let m = 20.5 - o. Round m to zero dps. -7 Let q = 14 - 18.8. Round q to 0 dps. -5 Let s = 0 + 4. Let l = 4 - s. What is l rounded to 1 dp? 0 Let k be -450-186(-100)/9. Round k to the nearest one hundred thousand. -900000 Let r = 2.5902 - -27.4163. Let q = r - 30. Round q to 3 decimal places. 0.007 Suppose 5w = w. Let f = 0 - w. Round f to 5 decimal places. 0 Let o be 30/(-20)(-10)/(-3). Let w(l) be the second derivative of 383l*5/20 - 5l*4/12 - l. Let y be w(o). What is y rounded to the nearest ten thousand? -50000 Let y(u) = 11 + 3u + u + 10u + 13u*2 - 4u. Let g be y(8). Suppose f = -343 + g. Round f to the nearest 100. 600 Let a be 760/(0 + (-2)/(-1000)). Suppose -x = 4x - a. What is x rounded to the nearest ten thousand? 80000 Suppose 4x - 4t - 376592 = -2t, -188284 = -2x - 2t. Suppose -2p = 4i + 119990, -55864 = 5i - 2p + x. Round i to the nearest 100000. 0 Let	{ "pile_set_name": "DM Mathematics" }
2 Suppose -i - 2a + 2 = 0, i + i - 4a = 36. Suppose -1225 = iy - 17y. Calculate the remainder when y is divided by 11. 10 Suppose -7v + 2 = -12. Suppose -101 = -5c - vw, 19c - 5w = 15c + 61. Suppose 2n = 66 + 8. What is the remainder when n is divided by c? 18 Let c = -2 + 65. Let k = 41 + c. Let j(s) = s3 + 9s*2 - 14s - 5. Calculate the remainder when k is divided by j(-10). 34 Let u be 2/(-4) + (-9)/6 + 12. Suppose 5l - 309 = -3d, -d = l - u - 95. What is the remainder when d is divided by 46? 16 Suppose 0 = -12j + 16j - 3580. Let l = j + -275. Calculate the remainder when l/30 - 2/3 is divided by 12. 8 Let w(k) = 2k2 - 23 - 3k*3 + 5 - 3k*2 + 14 - 5k. Calculate the remainder when 112 is divided by w(-2). 8 Let z(n) = 4n2 - 177n + 2040. Suppose -101 - 103 = -3a. What is the remainder when z(29) is divided by a? 67 Let n(b) = 13b*2 - 2164b + 378. Calculate the remainder when n(167) is divided by 219. 14 Calculate the remainder when 539565/1495 - 4/(-46) is divided by 116. 13 Suppose -2949 = 110q - 12418 - 11101. Suppose 0 = -3i - 17 + 149. Calculate the remainder when q is divided by i. 11 Let r = -657 + 666. Let g(i) = -3i + 2i + 5i + 26 + 0i. What is the remainder when g(r) is divided by 23? 16 Let c = -28 + 37. Suppose 2z + w - c = 0, -z + w + 3 + 6 = 0. Calculate the remainder when 3 + (7/(-4)-4 - 0) is divided by z. 4 Suppose m + 15 = 45. Let x(d) = 35d + 139. Let r be x(-3). Suppose -5w + 38 = s, s = r - 36. Calculate the remainder when m is divided by w. 6 Suppose 4w = 5z + 22197, 2w + 3z - 11100 = 5z. Suppose -17o - w = -26o. Calculate the remainder when o is divided by 20. 17 Let f(q) = -q + 27. Let h(r) = -60r + 7. Calculate the remainder when h(-2) is divided by f(-1). 15 Let s = 176 + -118. Suppose -10p + s = -172. Calculate the remainder when 90 is divided by p. 21 Let x = 618 + -92. Let j(u) = 11u*2 + 78u + 73. What is the remainder when x is divided by j(-7)? 64 Let z(b) = -261b3 - b. Let m be z(-1). Suppose -3i + 267 = 3d, 0 = -3i - 4d + 6d + m. Calculate the remainder when i is divided by 9. 7 Suppose -29h = -16h + 104. What is the remainder when (-827)/(-8) - (-3)/h is divided by 19? 8 Let n(c) = 5c - 11. Let d be n(3). Suppose 323 = 4x + ds + 35, 5x - 358 = -4s. Suppose x - 42 = 2p. What is the remainder when p is divided by 13? 1 Suppose -k + 2363 = 16k. Let b = -46 + k. Suppose -95d + 98 = -bd. What is the remainder when d is divided by 17? 15 Suppose -5a = -14i + 11i - 593, 8i = -5a + 527. Calculate the remainder when 4816 is divided by a. 101 Calculate the remainder when 381 is divided by 2 - ((-19723)/99 + 4/18 + 0). 180 Let n(z) = -6z + 125. Let r be n(0). Let l = r + -124. Calculate the remainder when (-4 - l) + 68/1 is divided by 22. 19 Suppose -2u + p + 13 - 3 = 0, 10 = u + 2p. Suppose 0 = 2x - u - 4. Let s = x + 16. Calculate the remainder when s is divided by 11. 10 Let c = 463 + -241. Let d = 95177 - 95174. Calculate the remainder when c is divided by d. 0 Let k(l) = 0l - 2 - 13l - 6l. Let q be k(-6). Suppose -63 = -5u + q. What is the remainder when u is divided by 12? 11 Let u be ((-10)/4)/(3(-7)/126). Suppose u = -0f - 3f. Calculate the remainder when 21 is divided by 15/41/f-20. 6 Suppose 2d = -a - 503, 5d + 4a - 494 = -1750. Let o = d - -271. What is the remainder when 57 is divided by o? 0 Let d(i) = 24i2 - 134i - 559. What is the remainder when d(-4) is divided by 84? 25 Let s = -9 - 28. Let m = s - -43. Suppose -md + 16 = -5d. Calculate the remainder when 27 is divided by d. 11 Calculate the remainder when 45 - 1 - ((10 - -5) + -17) is divided by 3/(-2)(20 - 26). 1 Let g = 5548 - 5544. What is the remainder when 48 is divided by g? 0 Let p(d) = d3 + 50d*2 + 262d + 5. Calculate the remainder when 3066 is divided by p(-44). 90 Calculate the remainder when -8 + (40/100 - (-3696)/10) is divided by 132. 98 Let f(c) = -c*2 + 5c + 26. Let p be f(-3). Calculate the remainder when 87 is divided by 0 + 5 - (-24 - p). 25 Suppose 0 = 5f - 5p - 105, f + 5p + 41 = 2f. Calculate the remainder when 505 is divided by f. 9 Suppose 0 = -4d, 20 = 7m - 2m - 3d. What is the remainder when (-1)/m - (6025/20)/(-5) is divided by 17? 9 Suppose -167n = 10n - 13983. Calculate the remainder when 2163 is divided by n. 30 Let c(f) = -83f3 - f2 + f - 1. Let m be c(1). Let z be (-9)/6 - (-2 + m/8). Suppose 3b = zb - 1616. Calculate the remainder when b is divided by 51. 49 Suppose 20v = 1022 + 636 - 338. Let n(m) be the third derivative of m*5/60 + 5m4/24 - m3/3 - 3m2. Calculate the remainder when v is divided by n(4). 32 Let a = 1784 - 1745. Calculate the remainder when 71 is divided by a. 32 Suppose 2t - 3s - 1308 = 0, -s = -13t + 12t + 656. Suppose 5a + t = 9a. Let c = a - 77. Calculate the remainder when c is divided by 23. 19 Suppose -2 = n + 2t, -5n + 4t - 22 - 30 = 0. Suppose -3q + 3r = -21, -2q = -5q - 4r + 7. What is the remainder when (51/(-12))/(n/32) is divided by q? 2 Suppose 4b = -5h + 120, -h + b + 3b + 48 = 0. Suppose -16d = 674 - 738. What is the remainder when h is divided by d? 0 Suppose -5q + 3m + 6 = -3q, 0 = 4q - m - 12. Suppose qg - 95 = -5. Calculate the remainder when g is divided by (-7)/((-175)/20)20. 14 Let c(m) = -m3 + 50m*2 - 26m - 541. What is the remainder when c(30) is divided by 83? 79 Suppose -4v - 718 = -750. Let x(i) = 1. Let r(m) = 3m - 33. Let n(b) = -r(b) + 3x(b). Calculate the remainder when 191 is divided by n(v). 11 Let m(i) = i3 + 7i*2 - 11. Let b be m(-6). Let t = b + -22. Suppose -3p + 38 = -3j + 5, -49 = -4p + tj. What is the remainder when 36 is divided by p? 4 Suppose -64p + 359542 = -301480 - 85154. Calculate the remainder when p is divided by 13. 11 What is the remainder when 1354 is divided by (-7 - -3 - -2)/(82/(-4182))? 28 Let q(t) = -t + 4. Let x be q(6). Let z(d) = 4d2 + 3d + 2. Let m = -72496 + 72553. Calculate the remainder when m is divided by z(x). 9 Let m = -587 - -590. Suppose y + 4w = -0y - 14, 4y = -mw + 9. Calculate the remainder when 50 is divided by y. 2 Let a = -2199 - -2205. What is the remainder when 583 is divided by a? 1 Suppose 0 = 3z - 36 - 3. Let w = 585 + -582. Calculate the remainder when z is divided by w. 1 Let c be 2 + (-2)/((-10)/35). What is the remainder when 24 is divided by c(-10)/(-18)3? 9 Let y(w) = 1038w*2 - 87w + 87. What is the remainder when y(1) is divided by 36? 30 Let n(b) = b*2 - 151b + 1194. What is the remainder when 64 is divided by n(8)? 14 Suppose 3q + 3q = 18. Suppose qg = 108 - 21. What is the remainder when 30 is divided by g? 1 Suppose -5k + n + 6889 = 0, -3k - 9n + 2413 = -1682. What is the remainder when k is divided by 283? 245 Let r = -378 + 674. Suppose -4l = -5h - 1355 - r, -3l + 1239 = -3h. What is the remainder when l/5 - 60/75 is divided by 21? 19 Suppose 0o = -o + 3. Suppose -502 + 121 = -ou. Let f = 11123 - 11091. What is the remainder when u is divided by f? 31 Let b(f) = f + 8. Let r be b(-6). Let k(h) = h*3 - 15 + h + 18 + h + 4hr. What is the remainder when 44 is divided by k(-3)? 2 Let g(f) be the first derivative of -f4/4 + 5f3/3 + 7f*2 - 19f + 289. Calculate the remainder when g(5) is divided by 10. 1 Suppose -3d - 2p = -4629, -910 = -2d + 8p + 2232. What is the remainder when d is divided by 510? 17 Let c(l) be the first derivative of -l*2 + 25 + l + 34/3l*3. Calculate the remainder when 97 is divided by c(1). 31 Calculate the remainder when 596 is divided by 4/(-26) + (-25666)/(-533). 20 Suppose -5h + 9 = -21. Let m = -57 - -219. Let y = m - 158. Calculate the remainder when h is divided by y. 2 Let r = 31 - 17. Suppose 2h - 3 + 1 = 0. Let k(v) = 25v*2 - v + 1. What is the remainder when k(h) is divided by r? 11 Suppose -3d + 8o + 298 = 6o, 2d + 5o - 167 = 0. What is the remainder when 1055 is divided by d? 95 Suppose -8p = 4i - 7p - 207, 3p = -5i + 257. What is the remainder when 243 is divided by i? 35 Let x(a) = -a2 + a + 8. Let h be x(3). Suppose -ho - w + 0w + 25 = 0, 0 = 2o + 2*w - 26. Calculate the remainder when 21 is divided by o. 9 Let r = 352 - 270. Suppose -	{ "pile_set_name": "DM Mathematics" }
s the units digit of 61598? 8 What is the ten thousands digit of 282212? 8 What is the units digit of 11409934? 4 What is the units digit of 325270? 0 What is the millions digit of 3620188? 3 What is the thousands digit of 27460393? 0 What is the hundred thousands digit of 2234226? 2 What is the hundreds digit of 2200061? 0 What is the ten millions digit of 17912258? 1 What is the hundred thousands digit of 5768253? 7 What is the tens digit of 98726? 2 What is the tens digit of 25209542? 4 What is the thousands digit of 1022037? 2 What is the units digit of 1848419? 9 What is the tens digit of 9714365? 6 What is the hundreds digit of 252862? 8 What is the hundred thousands digit of 1825537? 8 What is the tens digit of 203732? 3 What is the hundreds digit of 345205? 2 What is the hundreds digit of 63315? 3 What is the thousands digit of 1781226? 1 What is the millions digit of 1889854? 1 What is the millions digit of 3370978? 3 What is the hundred thousands digit of 2504521? 5 What is the millions digit of 5369511? 5 What is the tens digit of 18860897? 9 What is the thousands digit of 28158046? 8 What is the ten thousands digit of 223708? 2 What is the hundreds digit of 3241074? 0 What is the thousands digit of 5274040? 4 What is the ten thousands digit of 388447? 8 What is the ten thousands digit of 854463? 5 What is the millions digit of 14851136? 4 What is the hundred thousands digit of 2582608? 5 What is the hundreds digit of 148932? 9 What is the hundreds digit of 3998122? 1 What is the hundred thousands digit of 220951? 2 What is the ten thousands digit of 3446375? 4 What is the hundred thousands digit of 5239460? 2 What is the units digit of 1576542? 2 What is the units digit of 759531? 1 What is the ten millions digit of 20675185? 2 What is the hundred thousands digit of 309102? 3 What is the units digit of 7718024? 4 What is the ten thousands digit of 157273? 5 What is the units digit of 949000? 0 What is the hundreds digit of 163000? 0 What is the hundred thousands digit of 272165? 2 What is the thousands digit of 4292846? 2 What is the units digit of 1188957? 7 What is the units digit of 4289462? 2 What is the units digit of 118624? 4 What is the units digit of 139592? 2 What is the ten millions digit of 13744592? 1 What is the hundred thousands digit of 20074277? 0 What is the tens digit of 77544? 4 What is the millions digit of 13859837? 3 What is the hundred thousands digit of 649905? 6 What is the units digit of 105931? 1 What is the tens digit of 280832? 3 What is the units digit of 1574050? 0 What is the thousands digit of 5330797? 0 What is the thousands digit of 6577688? 7 What is the tens digit of 11906? 0 What is the units digit of 3038555? 5 What is the hundred thousands digit of 4613678? 6 What is the tens digit of 420208? 0 What is the tens digit of 3013614? 1 What is the hundred thousands digit of 5482135? 4 What is the units digit of 261806? 6 What is the tens digit of 455021? 2 What is the hundreds digit of 8398057? 0 What is the hundreds digit of 1391173? 1 What is the tens digit of 4703368? 6 What is the thousands digit of 1201587? 1 What is the thousands digit of 490759? 0 What is the thousands digit of 11249134? 9 What is the ten thousands digit of 73936? 7 What is the ten thousands digit of 512290? 1 What is the ten thousands digit of 113786? 1 What is the thousands digit of 257833? 7 What is the hundred thousands digit of 358475? 3 What is the millions digit of 8464281? 8 What is the units digit of 11048622? 2 What is the millions digit of 2054077? 2 What is the thousands digit of 303015? 3 What is the ten thousands digit of 1780535? 8 What is the thousands digit of 64720? 4 What is the ten thousands digit of 151459? 5 What is the ten thousands digit of 455320? 5 What is the ten thousands digit of 157784? 5 What is the tens digit of 518847? 4 What is the ten thousands digit of 703521? 0 What is the thousands digit of 2278276? 8 What is the tens digit of 610358? 5 What is the units digit of 125239? 9 What is the hundreds digit of 342861? 8 What is the tens digit of 2745618? 1 What is the hundreds digit of 6328578? 5 What is the millions digit of 9322425? 9 What is the hundred thousands digit of 197681? 1 What is the units digit of 46351? 1 What is the ten thousands digit of 203587? 0 What is the thousands digit of 13998? 3 What is the millions digit of 1223250? 1 What is the ten thousands digit of 30219? 3 What is the millions digit of 5045743? 5 What is the hundreds digit of 16873? 8 What is the millions digit of 8334697? 8 What is the millions digit of 11669569? 1 What is the thousands digit of 1045113? 5 What is the hundreds digit of 147597? 5 What is the millions digit of 17840767? 7 What is the units digit of 133974? 4 What is the thousands digit of 30352? 0 What is the ten thousands digit of 226058? 2 What is the millions digit of 12141626? 2 What is the ten thousands digit of 424949? 2 What is the ten thousands digit of 358757? 5 What is the millions digit of 4964308? 4 What is the thousands digit of 2734259? 4 What is the hundreds digit of 5560417? 4 What is the millions digit of 10831744? 0 What is the ten thousands digit of 279110? 7 What is the hundreds digit of 104753? 7 What is the tens digit of 2850863? 6 What is the ten thousands digit of 3214462? 1 What is the units digit of 3829822? 2 What is the ten thousands digit of 7460257? 6 What is the thousands digit of 37351? 7 What is the hundreds digit of 83233? 2 What is the hundred thousands digit of 182563? 1 What is the hundreds digit of 16629? 6 What is the units digit of 1853230? 0 What is the hundred thousands digit of 4650382? 6 What is the hundreds digit of 377094? 0 What is the thousands digit of 10040884? 0 What is the hundreds digit of 9186254? 2 What is the hundreds digit of 3483895? 8 What is the hundred thousands digit of 1763835? 7 What is the thousands digit of 611618? 1 What is the ten thousands digit of 8476684? 7 What is the ten thousands digit of 4547374? 4 What is the units digit of 13026200? 0 What is the ten thousands digit of 277522? 7 What is the hundreds digit of 351962? 9 What is the millions digit of 4857209? 4 What is the hundred thousands digit of 5122728? 1 What is the tens digit of 5307753? 5 What is the millions digit of 1423947? 1 What is the ten thousands digit of 229610? 2 What is the tens digit of 280067? 6 What is the tens digit of 5229409? 0 What is the ten thousands digit of 3116007? 1 What is the hundreds digit of 34593? 5 What is the tens digit of 399823? 2 What is the ten thousands digit of 2095772? 9 What is the tens digit of 29382? 8 What is the hundred thousands digit of 241929? 2 What is the ten thousands digit of 131435? 3 What is the units digit of 3852364? 4 What is the thousands digit of 33127123? 7 What is the units digit of 640817? 7 What is the hundreds digit of 7310319? 3 What is the hundreds digit of 151219? 2 What is the hundred thousands digit of 174788? 1 What is the units digit of 2177302? 2 What is the tens digit of 252488? 8 What is the tens digit of 40077? 7 What is the ten thousands digit of 20219473? 1 What is the hundreds digit of 158692? 6 What is the millions digit of 5901462? 5 What is the millions digit of 3443748? 3 What is the units digit of 91118? 8 What is the units digit of 12003538? 8 What is the tens digit of 3040082? 8 What is the tens digit of 19039132? 3 What is the thousands digit of 383425? 3 What is the millions digit of 16422968? 6 What is the ten thousands digit of 67448? 6 What is the ten thousands digit of 153322? 5 What is the thousands digit of 11848284? 8 What is the units digit of 1771238? 8 What is the hundreds digit of 569964? 9 What is the hundred thousands digit of 15767501? 7 What is the thousands digit of 3496780? 6 What is the hundreds digit of 72787? 7 What is the hundred thousands digit of 10968608? 9 What is the ten thousands digit of 270215? 7 What is the units digit of 50144? 4 What is the ten thousands digit of 325429? 2 What is the ten thousands digit of 346032? 4 What is the thousands digit of 1855738? 5 What is the tens digit of 8837748? 4 What is the ten thousands digit of 15385394? 8 What is the ten millions digit of 14791177? 1 What is the	{ "pile_set_name": "DM Mathematics" }
erms in 2v + 100v*2 - 2294144 + 4588290 - 2294146. 100v*2 + 2v Collect the terms in -399728r - 418856r - 33473r - 531521r. -1383578r Collect the terms in 162 - 553l + 278l + 277l + 183 + 307. 2l + 652 Collect the terms in -120587263r*2 - 2r + 23r + 120587376r*2. 113r*2 + 21r Collect the terms in 9f2 + 1416f*3 + 333f*3 - 9f*2 + 20f*3. 1769f*3 Collect the terms in -530l*2 - 598l*2 - 896l*2 + 2524l*2. 500l*2 Collect the terms in 851 + 29i*2 + 694 - 110. 29i*2 + 1435 Collect the terms in -1640i - 235i - 2889i - 841i + 2227i. -3378i Collect the terms in -4067u*2 - 2239533u + 2239533u. -4067u*2 Collect the terms in 3102m + 243m2 - 5774m - 240m2 + 2672m. 3m2 Collect the terms in -26 - 115 - 232n - 229n + 958n - 496n. n - 141 Collect the terms in -399b*3 + 21 - 40 - 4931b*2 + 19 + 4931b*2. -399b*3 Collect the terms in -452x*3 - 400x*3 + 626x*3 + 2x. -226x3 + 2x Collect the terms in 0 - 32p2 + 2 - 42p*2 - 68p*2 + 177p*2. 35p*2 + 2 Collect the terms in -173u - 52 + 107 - 55 - 10u. -183u Collect the terms in 78 + 31 - 7171u + 21237u. 14066u + 109 Collect the terms in 87409 + 87411 + 3y + 87409 - 262229. 3y Collect the terms in -11212h*3 + 5608h*3 - 10h*2 + 5617h*3. 13h*3 - 10h*2 Collect the terms in 1219h*2 - 7h - 15h + 25h - 1230h2 - 3h. -11h2 Collect the terms in -3z + 1817426 - 1817426 + 0z. -3z Collect the terms in -26859l + 11477l + 15382l - 2l*2. -2l*2 Collect the terms in 7q*2 + 38q*2 - 190q*2 + 138q*2 + 56q*3. 56q*3 - 7q*2 Collect the terms in 12t*2 + 374809t*3 - 7t*2 + 4t*2 - 9t*2. 374809t*3 Collect the terms in -15p*2 + 8p*2 + 128774p + 11p2. 4p*2 + 128774p Collect the terms in -25z - 31 - 337z + 18z + 70 - 39. -344z Collect the terms in s + 75s2 + 132s*2 + 36 + 24s*3 - 58s*2. 24s*3 + 149s*2 + s + 36 Collect the terms in 498c + 569c + 557c - 2756c + 567c + 562c. -3c Collect the terms in -4080l + 12242l - 4082l - 4080l - 2219l3. -2219l*3 Collect the terms in 11197s*3 - 2 - 22139s*3 + 11098s*3. 156s*3 - 2 Collect the terms in 6063z*3 - 10014z*3 + 5827z*3. 1876z*3 Collect the terms in 3235f*3 + 3087f*3 - 12567f*3 + 3202f*3 + 3226f*3. 183f*3 Collect the terms in -5w - 4w - 5w + 9w + 4w + 3w + w. 3w Collect the terms in 23d2 - 460 - 445 + 905 + 33d*2. 56d*2 Collect the terms in 48c - 388c + 38c + 83c + 50c + 63c. -106c Collect the terms in 16007q + 15217q + 20087q + 79717q + 39820q. 170848q Collect the terms in 24004 - 6013 - 6022 - 5960 + 5m2 - 6009. 5m*2 Collect the terms in 0 - 50527g*2 + 1 + 3 - 37361g*2. -87888g*2 + 4 Collect the terms in -23 + 230c*2 + 20 + 0 - 42c*2 - c + 184c*2. 372c*2 - c - 3 Collect the terms in -72m*3 + 88m*3 - 5m*2 + 15m*3 + 6m*2 + 3m*2. 31m*3 + 4m*2 Collect the terms in 742 - 1766 - 326 - h. -h - 1350 Collect the terms in 2809389x + 683649x + 1145717x. 4638755x Collect the terms in 426d*2 + 404d*2 - 820d*2 + 10 + 1. 10d*2 + 11 Collect the terms in 1875894l*2 - 938398l*2 - 937503l*2. -7l*2 Collect the terms in -56t*3 + 8t + 28t3 - 1359 + t2 + 32t*3. 4t3 + t2 + 8t - 1359 Collect the terms in -2 - 48l + 207l + 215l - 50l - 83l + 247l. 488l - 2 Collect the terms in 75z + 26z*2 - 28z - 29z - 18z - 29z. 26z*2 - 29z Collect the terms in 8948q3 - 3619353q - 8886q3 + 3619351q. 62q3 - 2q Collect the terms in 487p + 5041 - 5041 + 1108p. 1595p Collect the terms in -797 + 7h - 6h + 1196. h + 399 Collect the terms in -1914q*2 - 14925q*2 - 250q*2 + 280 + 3q - 282. -17089q2 + 3q - 2 Collect the terms in -29s2 + 90s*2 - 31s*2 + 78s*2 + 99 - 103. 108s*2 - 4 Collect the terms in 223 - 1902f*3 - 110 + 1912f*3 - 113. 10f*3 Collect the terms in 10637401 + 10637419 + 10637417 + 3a2 - 31912237 - a2. 2a2 Collect the terms in -t + 0t + 37t3 + t - 77t*2 + 4t - 27t2. 37t*3 - 104t*2 + 4t Collect the terms in -1390 - 23w - 6130 + 7520. -23w Collect the terms in 9838w2 - 4952w*2 - 9w*3 - 10w*3 - 4886w*2. -19w*3 Collect the terms in p + 0p + 32p + 25p - 40p - 20p + p. -p Collect the terms in 1418 - 7369 + 4d - 2086 + 6d. 10d - 8037 Collect the terms in -185778917y*3 - 185778911y*3 - 41y*2 + 371557827y3. -y3 - 41y2 Collect the terms in 91o*2 - 9130708o + 4565352o + 4565356o + 1. 91o2 + 1 Collect the terms in m - 131742 - 106192 + 82258. m - 155676 Collect the terms in 821534r*3 - 411385r*3 - 410148r3. r3 Collect the terms in -1 + 3709v + 3741v + 3656v - 10947v. 159v - 1 Collect the terms in 123547r*3 + 13r*2 + 13r*2 - 26r*2. 123547r*3 Collect the terms in -59t*2 + 47t - 103t + 58t - 168. -59t2 + 2t - 168 Collect the terms in 764 - 199 - g + 959 - 149 + 1000. -g + 2375 Collect the terms in -64u2 + 8519328 - 8519328 + 48u*2. -16u*2 Collect the terms in -101 - 135h - 87 + 133h + 162. -2h - 26 Collect the terms in 0d2 + 519d + d*2 + 527d + 5d2 + 515d - 1529d. 6d*2 + 32d Collect the terms in 40g + 41g - 164g + 38g + 10g + 35g - 2g3. -2g*3 Collect the terms in 609t + 20239 - 10083 - 10156 + 239t. 848t Collect the terms in -k*3 + 4k + 517 - 1025 + 518 - 4k. -k3 + 10 Collect the terms in -10 + 1169d - 9 + 30 - 9 - 12. 1169d - 10 Collect the terms in 7300081u*3 - 3680281u*3 - 3619797u*3. 3u*3 Collect the terms in 154 - 863 + 157 + 391 + 161 + 2i. 2i Collect the terms in 2142866x*3 - 4285494x*3 + 2142767x*3. 139x*3 Collect the terms in 2411z*2 + 404z - 201z + 3749z*2 - 203z. 6160z2 Collect the terms in -19291i*3 - 18980i*3 + 38272i3. i3 Collect the terms in -7c + 229c*3 - 11c + 60c2 - 1 + 3. 229c*3 + 60c*2 - 18c + 2 Collect the terms in -47 - 55 + 151c + 258 - 47 - 47 - 64. 151c - 2 Collect the terms in 5962604t + 5962590t - 11925199t. -5t Collect the terms in 23 + 244 - 279s + 237 - 745 + 241. -279s Collect the terms in 2 + 1177528g2 - 1176841g*2 - 2. 687g*2 Collect the terms in 803k + 2k3 + k3 + 0k*2 - 6k*3 + 0k*2 - 2. -3k*3 + 803k - 2 Collect the terms in -192 - 96118w + 48063w + 48054w. -w - 192 Collect the terms in 302888v*2 + 15 - 4v - 302886v2 - 8v. 2v2 - 12v + 15 Collect the terms in 3 + 184y - 498y - 175y + 173y + 182y + 163y. 29y + 3 Collect the terms in 126 - 2q*3 + 203 - 157 - 172. -2q*3 Collect the terms in 1101u*3 - 370u*3 + 592u*3 + 419u*3 - 152u*3. 1590u*3 Collect the terms in -13c*2 - 94 + 7 - 36c*2 + 78c*2 - 13c*2 - 11c*2. 5c*2 - 87 Collect the terms in -2474010g - 2474013g + 7422050g - 2474018g. 9g Collect the terms in 27 - 8v2 - 26092v + 26092v + 6v*2. -2v*2 + 27 Collect the terms in 2332x*3 - 571x*3 - 564x*3 - 602x*3 - 606x*3. -11x*3 Collect the terms in -4593i*3 + 1 + 3 - 4 + 38973i*3. 34380i*3 Collect the terms in 13z*2 - 50z*2 + 40z*3 + 13z*2 - 8z*2 + 32z*2. 40z*3 Collect the terms in -11g - 11g - 470 + 2050 - 527 - 525 - 531. -22g - 3 Collect the terms in 258l2 - 4 - 17 + 82l*2. 340l*2 - 21 Collect the terms in -1712w*2 + 5058w*2 - 1680w*2 - 1726w*2. -60w*2 Collect the terms in -15611n + 46978n - 15548n - 15686n - n2. -n2 + 133n Collect the terms in -348079930c3 + 696159871c*3 - 348079937c*3. 4c*3 Collect the terms in 9m - 85m + 2m + 32m + 5m. -37m Collect the terms in -20m*2 + 2237167 - 2237167. -20m*2 Collect the terms in -102m + 70m + 14m + 9m. -9m Collect the terms in -135v2 - 56v*2 + 200v*2 - 784. 9v*2 - 784 Collect the terms in -25 + 19j + 24 + 123j - 2j*2. -2j*2 + 142j - 1 Collect the terms in -78 - 85 - 77 + 23v2 - 27v*2 + 244. -4v*2 + 4 Collect the terms in -46o + 0o3 + 100o + 3 - 54o - 13o*3. -13o*3 + 3 Collect the terms in -8103g + 89g2 + 8103g. 89g2 Collect the terms in -2252894 + 4z - 2z + 4505798 - 2252904. 2z Collect the terms in -11020k - 25382k - 18457k - 13428k. -68287*k Collect the terms in -147 + 14	{ "pile_set_name": "DM Mathematics" }
ainder when 609304 is divided by 609244. 60 Calculate the remainder when 1358199 is divided by 2058. 1977 Calculate the remainder when 304486 is divided by 2066. 784 What is the remainder when 671792 is divided by 134335? 117 Calculate the remainder when 3288308 is divided by 219220. 8 Calculate the remainder when 101609 is divided by 1923. 1613 What is the remainder when 6673314 is divided by 1665? 1659 Calculate the remainder when 780827 is divided by 265. 137 What is the remainder when 114780330 is divided by 23415? 0 What is the remainder when 49669277 is divided by 210463? 9 Calculate the remainder when 171453 is divided by 3608. 1877 Calculate the remainder when 3322555 is divided by 830636. 11 Calculate the remainder when 2681265677 is divided by 2960. 2957 Calculate the remainder when 56543949 is divided by 614608. 13 Calculate the remainder when 256570 is divided by 127757. 1056 What is the remainder when 12428442 is divided by 5657? 13 What is the remainder when 10287 is divided by 1353? 816 Calculate the remainder when 205284447 is divided by 1050. 1047 Calculate the remainder when 19835966 is divided by 90575. 41 What is the remainder when 317671 is divided by 2527? 1796 What is the remainder when 535217 is divided by 5299? 18 What is the remainder when 2296309 is divided by 367? 357 Calculate the remainder when 4964017 is divided by 17235. 337 Calculate the remainder when 481483 is divided by 5664. 43 Calculate the remainder when 444223 is divided by 5346. 505 What is the remainder when 1281731 is divided by 204? 203 Calculate the remainder when 16971967 is divided by 183. 181 Calculate the remainder when 2064413 is divided by 113. 16 Calculate the remainder when 1831164 is divided by 2902. 2 What is the remainder when 15771424 is divided by 315428? 24 What is the remainder when 17254989 is divided by 13? 11 What is the remainder when 1807081 is divided by 350? 31 Calculate the remainder when 528043 is divided by 52651. 1533 What is the remainder when 863095 is divided by 98? 9 What is the remainder when 18420 is divided by 191? 84 What is the remainder when 468883 is divided by 2368? 19 Calculate the remainder when 112287773 is divided by 56143886. 1 What is the remainder when 967589 is divided by 1843? 14 What is the remainder when 173415 is divided by 57350? 1365 Calculate the remainder when 46673084 is divided by 902. 898 Calculate the remainder when 4594083 is divided by 171. 168 Calculate the remainder when 169704 is divided by 300. 204 What is the remainder when 1988354 is divided by 116? 114 What is the remainder when 427308 is divided by 229? 223 What is the remainder when 306866 is divided by 51035? 656 What is the remainder when 95418 is divided by 362? 212 What is the remainder when 845084 is divided by 4268? 20 Calculate the remainder when 1627211 is divided by 813555. 101 Calculate the remainder when 1298030 is divided by 2388. 1346 Calculate the remainder when 931406 is divided by 931398. 8 Calculate the remainder when 48213029 is divided by 113. 110 What is the remainder when 8960934 is divided by 179218? 34 Calculate the remainder when 2464566 is divided by 21. 6 Calculate the remainder when 16110708 is divided by 63. 33 What is the remainder when 71370 is divided by 23666? 372 Calculate the remainder when 3129559 is divided by 1369. 25 Calculate the remainder when 66006 is divided by 100. 6 What is the remainder when 285994 is divided by 95291? 121 Calculate the remainder when 108297 is divided by 1452. 849 Calculate the remainder when 45455687 is divided by 17. 16 What is the remainder when 966584 is divided by 17? 15 Calculate the remainder when 41830683 is divided by 7781. 27 What is the remainder when 73639 is divided by 457? 62 What is the remainder when 35027350 is divided by 182? 176 What is the remainder when 79410 is divided by 39480? 450 Calculate the remainder when 139389 is divided by 1040. 29 Calculate the remainder when 364343 is divided by 28026. 5 What is the remainder when 3929008 is divided by 357182? 6 What is the remainder when 22277694 is divided by 2230? 2224 What is the remainder when 57384078 is divided by 871? 856 Calculate the remainder when 165691 is divided by 36. 19 What is the remainder when 4338262 is divided by 289217? 7 What is the remainder when 88572 is divided by 7418? 6974 Calculate the remainder when 140241 is divided by 515. 161 What is the remainder when 43104 is divided by 21286? 532 What is the remainder when 6184444 is divided by 81? 13 What is the remainder when 1199275 is divided by 11? 0 Calculate the remainder when 8955793 is divided by 11815. 23 Calculate the remainder when 94457616 is divided by 765. 6 What is the remainder when 700504 is divided by 1158? 1072 What is the remainder when 972002061 is divided by 22? 19 What is the remainder when 52182014 is divided by 2096? 2094 Calculate the remainder when 181608914 is divided by 1488. 2 What is the remainder when 7087 is divided by 19? 0 Calculate the remainder when 129483357 is divided by 324. 321 Calculate the remainder when 58492284 is divided by 1233. 1230 Calculate the remainder when 119512 is divided by 1406. 2 What is the remainder when 1091073 is divided by 2? 1 Calculate the remainder when 6233657 is divided by 5546. 5499 Calculate the remainder when 1810791 is divided by 30691. 22 What is the remainder when 782867 is divided by 41? 13 What is the remainder when 1194355 is divided by 555? 550 What is the remainder when 368315 is divided by 789? 641 What is the remainder when 173119 is divided by 24? 7 What is the remainder when 24761528 is divided by 4? 0 What is the remainder when 12555428 is divided by 502215? 53 Calculate the remainder when 34644 is divided by 38. 26 Calculate the remainder when 543981 is divided by 189. 39 Calculate the remainder when 130330447 is divided by 496. 495 What is the remainder when 4770879 is divided by 320? 319 What is the remainder when 9745390 is divided by 38? 24 Calculate the remainder when 55428 is divided by 2705. 1328 Calculate the remainder when 166109 is divided by 6122. 815 What is the remainder when 6883322 is divided by 2726? 172 What is the remainder when 3536888 is divided by 230? 178 Calculate the remainder when 22946215 is divided by 533632. 39 Calculate the remainder when 106866 is divided by 2756. 2138 What is the remainder when 6119708 is divided by 1754? 2 Calculate the remainder when 24991978 is divided by 40180. 18 Calculate the remainder when 290692 is divided by 3266. 18 What is the remainder when 5007005 is divided by 385147? 94 Calculate the remainder when 1901883 is divided by 4191. 3360 Calculate the remainder when 148091 is divided by 12492. 10679 Calculate the remainder when 2537005 is divided by 2537000. 5 What is the remainder when 7577718 is divided by 40? 38 What is the remainder when 726270 is divided by 9? 6 What is the remainder when 235632 is divided by 116? 36 Calculate the remainder when 142749 is divided by 4757. 39 What is the remainder when 11373003 is divided by 673? 649 What is the remainder when 103694 is divided by 50932? 1830 What is the remainder when 527776 is divided by 6070? 5756 Calculate the remainder when 754570 is divided by 1711. 19 What is the remainder when 8564441 is divided by 713703? 5 What is the remainder when 1695274 is divided by 1321? 431 Calculate the remainder when 246608 is divided by 1124. 452 Calculate the remainder when 316602718 is divided by 1960. 1958 What is the remainder when 14008311 is divided by 1400831? 1 Calculate the remainder when 652960 is divided by 54409. 52 Calculate the remainder when 35993074 is divided by 7198610. 24 Calculate the remainder when 220989 is divided by 527. 176 What is the remainder when 9690398 is divided by 4472? 4046 Calculate the remainder when 2136635 is divided by 3775. 3760 What is the remainder when 619873 is divided by 34249? 3391 Calculate the remainder when 57356 is divided by 952. 236 Calculate the remainder when 1984807 is divided by 184. 183 Calculate the remainder when 6223783 is divided by 271. 268 What is the remainder when 23454368 is divided by 7818121? 5 Calculate the remainder when 1287558 is divided by 1652. 650 Calculate the remainder when 6	{ "pile_set_name": "DM Mathematics" }
3 and l. 3 Suppose -5z = 2v - 72 - 17, 0 = 3v + z - 127. What is the common denominator of (v/27)/(6/(-9)) and (-3)/(-2)(-8)/(-15)? 15 Suppose 2s + 11 = -3j, -3s + 2j - 5j - 12 = 0. Calculate the common denominator of (-1131/s)/(-10) and (-2)/7 - 15/(-21). 70 Suppose 3g - 3l = 45, g + 3l = 2g - 25. Calculate the lowest common multiple of 30/(-9)6/(-10) and g. 10 Calculate the least common multiple of (48/(-10))/(-6)5 and 5. 20 Suppose s - 6s + 10 = 0. Suppose 0 = -sp + 7 + 1. What is the least common multiple of 6 and p? 12 Let m(x) = 151x + 2. Let i be m(8). Let f = -2321/2 + i. Find the common denominator of -3 - -1 - 12/5 and f. 10 Let l = 1769868131/60 - 29498759. Let d = 2855/3 + l. Calculate the common denominator of d and -71/8. 40 Suppose 2m = -8w + 4w - 64, 0 = -3m + 5w - 41. Calculate the common denominator of (-2)/4 - (-87)/m and -13 + 12 + (-134)/(-6). 33 Let y be (1572/198)/((-8)/1446). Let m = 1436 + y. What is the common denominator of 47/16 and m? 176 Let y = -372 - -1127/3. What is the common denominator of y and -43/10? 30 Suppose -2b - 39 = 5f, f - 2f + 5b + 3 = 0. Let i = f - -8. Calculate the lowest common multiple of i and 8. 8 Let i = 69 - 47. What is the smallest common multiple of i and 22? 22 Let f = -7/48 + 49/48. Find the common denominator of f and -64/81. 648 What is the least common multiple of 24/32 + 2/8 and 6? 6 What is the least common multiple of 24 and 4 - 0 - (-29 - 0)? 264 Let y(l) = -l*2 - 15l - 12. What is the lowest common multiple of y(-14) and 4? 4 Let n = 2/253 + 19971/2024. Calculate the common denominator of n and -87/32. 32 Let c = 7685/6 - 1266. Find the common denominator of c and 151/42. 42 Suppose -2v - 4v + 48 = 0. Let g = 1 - -1. What is the smallest common multiple of g and v? 8 Let a = -2166 + 21687/10. Find the common denominator of a and -9/14. 70 Let d be (2 + 2)2/4. Let f be 1/d118. Calculate the common denominator of 33/10 and 759/(-72) - (-6)/f. 40 Let a be 4/636/8. Let j = -5200 + 114491/22. Calculate the common denominator of (-166)/(-12)a/(-6) and j. 132 Let i be 81/455 + (-5)/25. Let n = 289/728 + i. What is the common denominator of n and -23/22? 88 Let z = 29 + -26. What is the smallest common multiple of 10 and z? 30 Let w = 53519/10 - 5342. Calculate the common denominator of w and (-10)/15 + 3 + (-69)/9. 30 Let l be 320/(-56) - (-4)/(-14). What is the common denominator of (-628)/80 - l/(-15) and 43/20? 20 Let a(o) = -2o*2 + 3o - 3. Let w be a(2). Let x = 19 + w. What is the lowest common multiple of 20 and x? 140 Suppose 0 = d - 6d + 100. Suppose -57 = -3l + 3u, -2l + 105 = 3l + 5u. What is the lowest common multiple of l and d? 20 Calculate the lowest common multiple of 18 and (11 - 17)/((-3)/14). 252 Suppose 0 = 5o + 2l + 3l - 5, 5o + 1 = l. Suppose oa - 2 = -a. Suppose 0 = 2v - 10 - a. Calculate the least common multiple of 11 and v. 66 Suppose 127 = 4o - 117. Let v = -41 + o. Suppose -5c = -2r - 4, 4r - 3c = -0r + v. Calculate the lowest common multiple of 6 and r. 24 Let g(h) = 3h + 2. Let k be g(-4). Let r = 680/3 - 240. What is the common denominator of (37/(-5))/((-12)/k) and r? 6 Suppose 10 = -2r - 2j, 0r - r + 10 = -2j. Calculate the common denominator of 121/6 and 19/22 + r/2. 66 Let h = -3682 - -73697/20. What is the common denominator of -81/40 and h? 40 Calculate the common denominator of -55/4 and 30/(-4)(-85)/(-187). 44 What is the common denominator of (29/(-8))/(7/(-84)) and -55/18? 18 Let r(q) = -2q + 4. Let u be r(5). Calculate the common denominator of 11/18 and 4/u999/60. 90 Let b(n) = n*3 - 31n*2 - 33n + 42. Calculate the smallest common multiple of b(32) and 40. 40 Find the common denominator of (-4)/24 - (-142)/(-120) and -1/20. 20 Let g = 22 + -18. What is the common denominator of -57/8 and 86(162/40 - g)? 40 Let q = 3007/204 + -354/17. What is the common denominator of 74/3 and q? 12 Let o = 13 - 96/11. Let t = 47/2 + -85/4. Calculate the common denominator of t and o. 44 Let h = 612 + -6788/11. Find the common denominator of 106/60 + (-2)/3 and h. 110 Let q be (-1)/((-21)/9 + 2). Suppose -v + q - 6 = 0. What is the common denominator of -143/6 and (-687)/(-90) - v/15? 6 Let f = -335/588 + -2/147. Calculate the common denominator of f and -19/18. 36 Suppose 5c + 0c = 5a + 120, -111 = -4c - a. What is the least common multiple of c and 6? 54 Let c = -2/85 + 354/595. Let p = -929 + 2729/3. Find the common denominator of c and p. 21 Suppose -2f + 4 = -0f. Find the common denominator of 489/40 - (-3)/(-5) and 68/80 + f/2. 40 Suppose -9 = o + 3t, -4o - 5t = 2 + 13. Let l = 1 + o. Find the common denominator of 45/14 and l + 0 - (-594)/(-24). 28 Let i = -2620 - -5339/2. Calculate the common denominator of i and -89/10. 10 What is the common denominator of (15 + 88)/(2-4) - -2 and -107/20? 40 Suppose 0 = -2j - m + 7, 8m = 2j + 3m + 11. Suppose 0i = -ji + 12. What is the lowest common multiple of 20 and i? 60 Let u(g) = -4g - 1. Calculate the lowest common multiple of 18 and u(-1). 18 Let b = -3 + 6. Let l = -516 - -1529/3. What is the common denominator of (-3)/541/b and l? 15 Let q = 90324351845/13428 - 80718899/12. Let y = 18/373 + q. Find the common denominator of -1/10 and y. 90 Let a(i) = 14i*2 - i. Calculate the least common multiple of a(-1) and 24. 120 Suppose 5t = 38 - 8. Calculate the lowest common multiple of t and 10. 30 Suppose 1 = 2l - 3. What is the lowest common multiple of 34 and l? 34 Let q be (-4)/61-3. Let v be q/(-3) - 16/(-6). Suppose 9 = 3l + 2p, -l = -vl - 5p + 3. Calculate the smallest common multiple of 8 and l. 24 Suppose -2 = -2s - 4o + 6, -4s - o + 16 = 0. What is the smallest common multiple of (-65)/(-9) - (-12)/(-54) and s? 28 Let a = -2909 + 1087. Let f = 3282 + a. Let m = f + -11623/8. What is the common denominator of 89/4 and m? 8 Find the common denominator of 27/8 and (25 + (-1 - 3))/10. 40 Suppose -54 = -3t - 0t - 2q, 0 = -5q. Let s = 24 - 14. Calculate the lowest common multiple of t and s. 90 What is the lowest common multiple of ((-72)/14)/((-24)/224) and 16? 48 Let r(w) = -w*2 - w + 4. Let z be r(0). Suppose -z = -p + 1. Find the common denominator of (-2)/p(-33)/(-8) and 107/22. 220 Let r = 19149/11 + -1739. Find the common denominator of r and -27/5. 55 Let c = 51/4 - 73/4. Let a = -5 - -2. What is the common denominator of ((2 + -42)/2)/a and c? 6 Suppose 0a + 2a - 12 = 0. Suppose -2t = -at + 40. Calculate the smallest common multiple of t and 3. 30 Suppose -7 = -12m + 5. Calculate the least common multiple of 13 and m. 13 Suppose 3o - 5x + 14 = 0, -o - 2x = 2 - 12. Let m(n) = -n*2 + 8no + n2 - 1 + n. What is the least common multiple of 9 and m(1)? 72 Let g = 57 - 231/4. What is the common denominator of 178/41/(-2) and g? 4 What is the common denominator of -73/22 and ((-158)/(-20))/(16/40)? 44 Let m = -20101/9 + 2238. Calculate the common denominator of m and 11/8. 72 Let g = -7553/870 - 22/145. Calculate the common denominator of (-2)/4 + (-142)/(-36) and g. 18 Suppose 2k = 21 - 57. What is the common denominator of (27/(-6))/((-21)/k) and -1/3? 21 Calculate the common denominator of -107/22 and 135/66 - (-1 + -2). 22 Let b = 114 + -110. Calculate the least common multiple of b and 82. 164 Let o = 25 - 62. Let c = 173 - o. Calculate the common denominator of 13/11 and (-3385)/c + 4/14. 66 What is the common denominator of ((-146)/10)/((-18)/(-5)) and -47/6? 18 Let g = -172023/20 + 8595. Let r = -38/25 + 403/150. Calculate the common denominator of g and r. 60 Suppose 3o - 34 = 2i, -4i = -3o + 7 + 31. Suppose -5a = 3u - 212, 0a = 5a - 5u - 180. Calculate the lowest common multiple of a and o. 40 Let h be (3/(-4))/((-18)/116). Let z = h + -221/24. What is the common denominator of 1/18 and z? 72 Let n = -5423/14 - -387. Suppose 1083 = -32k + 31k. Let j = 2209/2 + k. Find the common denominator of j and n. 14 Suppose -2 = f + 4v, -f = -0v + 5v + 5. Suppose -6i = -40 - 68. What is the least common multiple of f and i? 90 Let c(y) = 7y + 1. Let a be c(-4). Let v = 32 + a. What is the lowest common multiple of v and 3? 15 Let k = 15 - 6. Suppose 0 = -4*p + 290 + 158.	{ "pile_set_name": "DM Mathematics" }
a - 14. Let q(l) = -f(l) + 4r(l). Give q(-12). 22 Let f(b) = 0b*2 - 7b*2 + 12b*2 - 4b*2 - 4. Determine f(0). -4 Suppose 3c + 21 = 4z, z - 3c - 6 = 6. Let p(i) = -5i - 673. Let x(n) = -n - 96. Let y(u) = p(u) - 7x(u). Determine y(z). 5 Let q(f) = f - 18. Suppose 3v - 26 = 2g, v - 7g + 3g = 12. Give q(v). -10 Let s(i) = 3i + 7. Suppose -3r + l + 3l - 63 = 0, -l + 37 = -2r. Let f(q) = -8q - 20. Let c(o) = rs(o) - 6f(o). Determine c(2). -5 Let b(c) = c3 - 5c*2 + c - 2. Let i = 18 - -46. Let l be (i/40)/((-4)/(-10)). Give b(l). -14 Suppose 0w = 3w + 2h - 28, -48 = -5w - 2h. Let z(s) = -6s - 5s - 7 + ws. Give z(-7). 0 Suppose 17 = b + 4r, 2b - 2r = 3b - 11. Let o(y) = 7y - 3. Let d(w) = -3w + 1. Let q(p) = 5d(p) + 2o(p). Give q(b). -6 Let a(p) be the second derivative of -p6/360 + p5/60 + p4/24 + p3/6 - 6p. Let o(l) be the second derivative of a(l). Calculate o(3). -2 Let b(a) = -15a + 479. Let x be b(32). Let g(m) = 11m + 2. What is g(x)? -9 Suppose 0c - 3c - 3l = 42, 5c + 4l + 65 = 0. Let d(x) be the second derivative of -x5/20 - 5x*4/6 - 3x*3/2 + 3x*2 - 134x + 3. Give d(c). 6 Let v(r) be the first derivative of -1/2r2 - 5 - 1/4r*4 - 3r*3 - 3r. Give v(-9). 6 Let u(c) be the first derivative of 2/3c3 - c + 33 - 1/2c*4 + 0c2. Give u(1). -1 Let p(t) be the third derivative of -t5/30 - 5t4/12 - 3t*3 + 68t*2 - 4t. Give p(-4). -10 Let d be (-1)/(-5)3 + (-1568)/80. Let u(p) = -p2 - 17p + 39. Let b be u(d). Let f(j) = -8j2 - 2j + 1. What is f(b)? -9 Let b(y) = 4430y - 4431y + 2 - 8. Let v = -13 - -8. Calculate b(v). -1 Let w be 1/(64/(-20) - -3). Let q(a) be the first derivative of -a*3/6 + 5a*2/2 - 2a + 4. Let x(i) be the first derivative of q(i). Determine x(w). 10 Let v be (-18)/21 + 41/7. Let o(x) = -1 - 5x2 + 0 + 0x + x*3 + 5 + 3x. What is o(v)? 19 Suppose 5y - 9 = 3r, -7y + 17 = r - 2y. Let o(d) = 3d2 - 5d*2 + 3d*2 - rd*2 + 2 + 2d. Calculate o(3). -1 Let i(f) = -f*3 + 6f*2 - 3f + 3. Suppose -2c + 2k + 6 = 0, 0 = -c - 5k - 6 + 3. Let s be (1 + 29)/(3/c). Let p = -14 + s. Determine i(p). -15 Let c be (-6)/8 - 3/(-4). Let y(g) be the second derivative of c - 1/20g*5 + g + 2/3g*3 + 1/3g*4 + 5/2g2. What is y(5)? 0 Let u(j) be the second derivative of j4/12 + 5j3/6 + 4j*2 - 192j. What is u(-7)? 22 Suppose 45g - 32 = 29g. Let q(b) = 36b - 7b*g + 42b - 79b. Suppose -f + 6 = -5m, -4m - 5 = -1. Calculate q(f). -8 Let g(q) = -13q - 89. Let o(i) = 12i + 79. Let f(p) = -8g(p) - 9o(p). Give f(5). -19 Let l(a) be the second derivative of 0 + 0a*2 - 4a - 1/6a3. What is l(-7)? 7 Let n be (-3)/15(-3 + 5 - 7). Let m(h) = -51h2 - 2h + 1. Determine m(n). -52 Let q(p) = -5p + 6. Let o(v) = v - 1. Suppose -2 = -4r + 2. Let a(n) = rq(n) + 4o(n). Suppose -279b + 292b = 78. Determine a(b). -4 Let w(v) = -v + 2. Let m(d) = 3 + 10 + 4d - 4d - d. Let t be m(12). Let a be (t - -3) + -1 + 0. Calculate w(a). -1 Let v(h) = h + 19. Let l be v(-19). Suppose l = 3x + 4k - 11, -6 = -4x + 2k + 16. Let w(q) = q*2 + 4q - xq + q + 6q - 1. What is w(-4)? -9 Let u(k) = k*3 - 9k*2 + 8k - 3. Let r be -4 - 85/(-10)2. Suppose -r = -y + h, -5y + 60 = h - 5h. Calculate u(y). -3 Let j(n) = 2n*3 - 3n*2 + 2n - 3. Let p be (2/(-8) - 51/340)-5. Determine j(p). 5 Suppose 0 = 5g - 20, -j - 18 = -19g + 17g. Let l(k) = -k*2 - 10k + 3. Calculate l(j). 3 Let u(n) = 4n2 + 3n - 4. Let f(k) = -5k - 147. Let g be f(-30). Give u(g). 41 Let x(n) = -n3 - 5n*2 - 4n - 6. Suppose 20 = 5p, -3r = -2p + 4p - 107. Let u = r - 32. Let c be u/((-15)/6)10. Give x(c). -6 Let a(l) be the first derivative of 7l3/3 + l2/2 - l + 113. Calculate a(1). 7 Let s(p) = -p*3 + 2p*2 + p + 1. Suppose -45c + 137 = 47. Give s(c). 3 Let j be 3 + (-28)/8 + 3/6. Let t(g) = g*3 - g + 40. Determine t(j). 40 Let h(b) = -4b*2 - b. Let f be (-10)/(-4)((-192)/15 - -12). Calculate h(f). -14 Let s be (2/(-6))/((-5)/45). Suppose a = 4w - 3w - 2, sw = -4a + 20. Let i(q) = q*3 - 3q*2 - 5q - 1. What is i(w)? -5 Suppose -3u + 36 = -90. Suppose -g = -4g + 6, -u = 5a - g. Let p(y) = -y2 - 8y + 7. Let j be p(a). Let t(r) = r*3 - 8r*2 + 9r - 9. Calculate t(j). 5 Let y = -13 + 10. Let v(c) = c*2 + 3c + 3. Let x be v(y). Let u(n) = x - 6 - 1 - n. Determine u(0). -4 Let c(j) = j*3 - 5j*2 + 3j + 2. Suppose 8k + p = 11k + 52, -3p = -2k - 44. Let n be (-158)/(-8) + (-1)/(-4). Let t = n + k. Determine c(t). -2 Let w(r) = r*2 - 2r + 1. Let s be (-2 - 3) + (-1 - -4). Let n be s - (-3 + 6/(-2)). Suppose na = -a + 10. Give w(a). 1 Let z = -1443 + 1445. Let q(p) be the third derivative of 1/120p*6 + 0 + 1/3p*3 + 1/24p*4 + 0p + 10pz - 1/12p*5. Give q(4). -10 Let b(q) = 3 - 5q*2 + 3 - 1 - 5q + 4q2. Calculate b(-5). 5 Let u(z) = 4 + 7 - 21 + 1 - 2 - 2z. Calculate u(-11). 11 Let w(r) = r*2 - r - 5. Suppose -5s + 3s + 4 = 0. Determine w(s). -3 Let m(u) be the third derivative of -u6/120 + u5/15 + u4/4 - u3/6 + 2u*2 + 13u. Calculate m(4). 23 Let l(r) = -4r + 5. Suppose 0 = -6n + 40 + 8. Let d be (-1)/(-2) + -1 + 36/n. Give l(d). -11 Let t(l) be the second derivative of -l*3/3 + 2l2 + l. Let x(j) = -j3 - 11j2 - 21j - 24. Let m be x(-9). Calculate t(m). -2 Let s(p) = 29p + 54. Let w be s(-2). Let b(u) = -u2 - 3u + 5. Determine b(w). 1 Suppose -z = 2z - 36. Let c(u) = -19u*2 + 14u*2 + zu*2. Let x be (-1)/3 - 16/(-12). Give c(x). 7 Let y be (9/6)/((-1)/(-2)). Suppose 0 = yl + 4a - a - 3, 0 = -2l + 4a + 8. Let v(s) = -s + 2s + sl + s2 + s. Calculate v(2). 12 Let s be 606/(-8) + 25/(-100). Let a = s + 73. Let y(f) = -f*3 - 3f*2 + 3f - 4. What is y(a)? -13 Let l(p) = -3p3 + 13p*3 + 0p - 11p3 + 6 - 7p*2 - 11p. Give l(-4). 2 Let z(v) = 4 + 8v - 5 + v2 + 3 - 9 - 10. Give z(-10). 3 Let h(j) be the third derivative of -j6/120 + j5/10 - j4/4 + j3/3 - 154j2. Calculate h(5). -3 Let d be 2 - 0/(3 + 0). Let s(j) be the third derivative of -j6/120 + j5/12 - j4/12 + j*3/6 - 7j*2 - j. Determine s(d). 9 Let x(m) = 0m + 4m - 3m. Let r(n) = -3n + 2. Let a(l) = -r(l) - 4x(l). Suppose 68h = 20h. Determine a(h). -2 Let w(t) = 7 - t + 6t - t2 - 8 + 2t + 10. Give w(8). 1 Let s(r) be the first derivative of r3/3 - r2/2 + 2r - 70. Give s(3). 8 Let p(g) = 3g*2 + 3g + 3g2 - 4g - 7g2. Let f be p(-3). Let y be 4/f(7 + -4). Let h(o) = o*3 + 2o*2 - o. Determine h(y). 2 Suppose 77p + 27 = 86p. Let w(u) = u2 - 4u + 2. Calculate w(p). -1 Let f(g) be the first derivative of g*4/4 + 2g3 + g2 - 7g - 68. What is f(-5)? 8 Let h(j) = 2j - 2. Suppose -37 = -4m + 7. Suppose 5b + m = 1. Give h(b). -6 Let k(q) be the third derivative of -q6/60 - q5/20 - q4/12 - q3/3 - q*2 + 127q. Give k(-2). 6 Let q(v) = -v - 1. Let y(n) = -n*3 + 7n*2 - 4n - 9. Let k be y(6). Suppose 2x + 3p + 1 = -k, 3x + 3p = -3. Determine q(x). -2 Let l be (-24)/4((-20)/8 - -4). Let f(y) = y3 + 10y*2 + 8y - 12. Determine f(l). -3 Suppose -5b + 3b = 8. Let i = 161 + -158. Let m(k) = -5k3 + 3k*3 - 160k - 3k2 + ki + 3 + 164k. What is m(b)? 3 Let s(r) = -4r - 4 + r - 2r*2 + 1. Suppose -3n - 12 = 0, 113q - 2n - 16 = 117q. What is s(q)? -5 Let k(y) be the third derivative of -y7/5040 + y6/90 + y5/6 - 13y*2. Let a(t) be the third derivative of k(t). Give a(7). 1 Let t(c) = -4c*3 + 3c*3 + 1610c + c*2 - 1 - 1606c. Determine t(3). -7 Let z(r) = -4r - 54. Let c(q) = q3 - 8q*2 + 15q - 32. Let s be c(6). Calculate z(s). 2 Let t(v) be the second derivative of -v4/12 - v3/6 + 5v2/2 - 5v - 12. Let l be ((-1)/3)/((-2)/(-24)). Give t(l). -7 Suppose -2p + 15 = -3p - 5a, 4a = -4p + 4. Let c(m) = 3m - 5 + 0m - m2 + 4m. Calculate c(p). 5 Let l = 3 - 1. Let q(m) = 3 + m*2 - 3m - l - 2m2. Let w = -1141 - -1135. Calculate q(w). -17 Let t be 14 - (2 + -1). Suppose -5l = -32 - t. Let i(x) be the first derivative of -x2 + 8x - 9. Determine i(l). -6 Let b(s) = s*3 + 9s*2 - s - 1. Let k be ((-4)/(-12) - 4/(-24))-18. What is b(k)? 8 Let v(x) be the second derivative of x**5/	{ "pile_set_name": "DM Mathematics" }
8. -248, -127, -49, -3, 1, 4 Sort 4, 0.2, -6/1222223 in descending order. 4, 0.2, -6/1222223 Sort -2, 4, -2363103, 2, 1. -2363103, -2, 1, 2, 4 Put -292/103, 1, -145.4 in decreasing order. 1, -292/103, -145.4 Put -172, 0, -25, 1, 2 in increasing order. -172, -25, 0, 1, 2 Put 5, 1/7, -65, -5, -4844 in decreasing order. 5, 1/7, -5, -65, -4844 Put 1, 8866, -1425, 4 in ascending order. -1425, 1, 4, 8866 Put 1, -43, 0, -3/7, 3, 50, -3 in descending order. 50, 3, 1, 0, -3/7, -3, -43 Put -157833, 8, -53 in increasing order. -157833, -53, 8 Put -2/3, -42, 0.2, 2553405, 0 in decreasing order. 2553405, 0.2, 0, -2/3, -42 Sort 0.408529, 11, -0.4. -0.4, 0.408529, 11 Put -7430, 0.97, -4/3 in decreasing order. 0.97, -4/3, -7430 Sort -31.68, 1/13, -1, -304 in increasing order. -304, -31.68, -1, 1/13 Put -6, -1, 5, 0, 137, -3, -643 in decreasing order. 137, 5, 0, -1, -3, -6, -643 Sort 0, -95, -532, -107. -532, -107, -95, 0 Sort -2, -0.2, -0.4, 1.3, 147764 in ascending order. -2, -0.4, -0.2, 1.3, 147764 Put -3, 3160, 3, 9, 0, -5, -1 in decreasing order. 3160, 9, 3, 0, -1, -3, -5 Sort -11/6, 0.305, 1/213 in descending order. 0.305, 1/213, -11/6 Sort 3, 0.2, -0.6, 154364 in descending order. 154364, 3, 0.2, -0.6 Sort 4, -12, 5, -3, -1233, -4 in descending order. 5, 4, -3, -4, -12, -1233 Sort -103, -4, 194, 0, -1, 5 in ascending order. -103, -4, -1, 0, 5, 194 Put -19/2, -340, -95/7, 9 in ascending order. -340, -95/7, -19/2, 9 Put 1655, 395, 4, -67, -4 in increasing order. -67, -4, 4, 395, 1655 Put -8, 3, -3, -29425 in ascending order. -29425, -8, -3, 3 Sort 1, 6.173, 1.6, -5, 21, -4 in ascending order. -5, -4, 1, 1.6, 6.173, 21 Sort -5/31, 43, -6, -8/23, -0.5 in descending order. 43, -5/31, -8/23, -0.5, -6 Sort -2, 232, -0.09, -3, -113, 1/2 in increasing order. -113, -3, -2, -0.09, 1/2, 232 Sort -5, 5/6, -31.3, 0, 9/2, -2/9 in increasing order. -31.3, -5, -2/9, 0, 5/6, 9/2 Sort 47, -5, 0, 4632, 3. -5, 0, 3, 47, 4632 Put -213, 4, -11, 9, 2 in decreasing order. 9, 4, 2, -11, -213 Put -126, 3, -28, 16, -34, 0 in ascending order. -126, -34, -28, 0, 3, 16 Sort 5/2, 3, 2/86507, 2/5, -3/5 in decreasing order. 3, 5/2, 2/5, 2/86507, -3/5 Sort -3/5, 2, 3/14, 5, -323 in decreasing order. 5, 2, 3/14, -3/5, -323 Put -31, 6/13, 156, -7 in increasing order. -31, -7, 6/13, 156 Sort -36882, 0, 17, 5, -4 in ascending order. -36882, -4, 0, 5, 17 Sort 2594.7603, 0.3, -5 in increasing order. -5, 0.3, 2594.7603 Sort 61, -9, 91903 in decreasing order. 91903, 61, -9 Put 319, -4, 9, 391, 1, -2 in decreasing order. 391, 319, 9, 1, -2, -4 Put -2, -13, 4, -137, -4, -9, 84 in descending order. 84, 4, -2, -4, -9, -13, -137 Put -2, 6, 923, 2, 121, 5 in decreasing order. 923, 121, 6, 5, 2, -2 Sort 5, -25, 1, 0, 2, 346 in descending order. 346, 5, 2, 1, 0, -25 Put -112, -6, -1, -28315 in increasing order. -28315, -112, -6, -1 Sort -5, -82, 1, -159. -159, -82, -5, 1 Put 14748, 0.1, 2/615 in ascending order. 2/615, 0.1, 14748 Sort 2, -59, -9, -534, 5 in increasing order. -534, -59, -9, 2, 5 Put 2, -0.325916, 16/7 in decreasing order. 16/7, 2, -0.325916 Sort 0, 0.5, -0.1, -15, 358.8 in descending order. 358.8, 0.5, 0, -0.1, -15 Put -96, 4, 0.425, -1/8, 2 in descending order. 4, 2, 0.425, -1/8, -96 Put -1, 5, 0, -6, 2, 112 in decreasing order. 112, 5, 2, 0, -1, -6 Sort 23767, 386, 3 in decreasing order. 23767, 386, 3 Sort -4, 1, -233, -143, 4, 13 in ascending order. -233, -143, -4, 1, 4, 13 Put 1, 1992, -51/23, 0 in ascending order. -51/23, 0, 1, 1992 Sort 1, -1390, -7, 2, 6, 5, -1 in ascending order. -1390, -7, -1, 1, 2, 5, 6 Put 2/15, -1, 0.080076, -1/7, 1/4 in decreasing order. 1/4, 2/15, 0.080076, -1/7, -1 Put -4/7, -3, 1, -8/21, 3, 4588 in decreasing order. 4588, 3, 1, -8/21, -4/7, -3 Put 3, 4, 5, 305, -24, 78 in descending order. 305, 78, 5, 4, 3, -24 Put 5, 2, 960, 5.95, 0.5 in increasing order. 0.5, 2, 5, 5.95, 960 Put 1/4, 8, 7.16, -0.4, -1, 1 in decreasing order. 8, 7.16, 1, 1/4, -0.4, -1 Put 3/8, -8, 0.5, 10.3, 239 in descending order. 239, 10.3, 0.5, 3/8, -8 Sort 17, 256, -2, 11, 0 in decreasing order. 256, 17, 11, 0, -2 Sort -3, -168, -43, 16 in descending order. 16, -3, -43, -168 Sort 2, -466097, 6, 1 in ascending order. -466097, 1, 2, 6 Sort 51, -3, 2.1, 4, -0.32, -47 in descending order. 51, 4, 2.1, -0.32, -3, -47 Put 0.1881, 4, 11, 1/3 in increasing order. 0.1881, 1/3, 4, 11 Put -4079/18, 153, -1 in increasing order. -4079/18, -1, 153 Sort -387, 4, -22, -5, 27, 3 in increasing order. -387, -22, -5, 3, 4, 27 Put 0, 127718, 4, 13 in increasing order. 0, 4, 13, 127718 Sort -25, -6, -30131, -3, -1. -30131, -25, -6, -3, -1 Sort -2, 0.07, 907970 in descending order. 907970, 0.07, -2 Put 231, -302, -1/8, 6, 1/4, -5 in descending order. 231, 6, 1/4, -1/8, -5, -302 Sort -12, 1156, 17, 20, 2. -12, 2, 17, 20, 1156 Sort 1/3, -6.33, 386/9, -3.6 in increasing order. -6.33, -3.6, 1/3, 386/9 Put -2836/25517, 3, -0.5, -1, 2 in increasing order. -1, -0.5, -2836/25517, 2, 3 Put 4770, 709, 4 in decreasing order. 4770, 709, 4 Sort -2/7, -871, -4, -2, -25.1. -871, -25.1, -4, -2, -2/7 Sort -4/7, 4/21, -107, -0.2, -0.1. -107, -4/7, -0.2, -0.1, 4/21 Sort -1564, -4, 510, -2 in decreasing order. 510, -2, -4, -1564 Sort 3, -5, -2, 2, 16, 12, -414 in ascending order. -414, -5, -2, 2, 3, 12, 16 Put 4, 2, -19.3, -13.86 in descending order. 4, 2, -13.86, -19.3 Put 7, 3, -1, -16924, 0 in decreasing order. 7, 3, 0, -1, -16924 Sort 0, -5, -4, -236, -2, -1, 4 in increasing order. -236, -5, -4, -2, -1, 0, 4 Sort -0.4, 61/2, 144.42 in descending order. 144.42, 61/2, -0.4 Sort -85992, -6, -5, -1, 0, 1 in descending order. 1, 0, -1, -5, -6, -85992 Put -19, -33403, 5 in ascending order. -33403, -19, 5 Sort -10, 5, -3, -105913. -105913, -10, -3, 5 Put -2/13, 0.3, -6, 0, -3, -781622 in decreasing order. 0.3, 0, -2/13, -3, -6, -781622 Put 3, -4616.2, -1, 1/2, -26 in descending order. 3, 1/2, -1, -26, -4616.2 Sort -2, 4, -4/7, -1/8, -1/2, -1987 in descending order. 4, -1/8, -1/2, -4/7, -2, -1987 Sort -23, 3, -4, -6, -622, -3, 1 in increasing order. -622, -23, -6, -4, -3, 1, 3 Sort 402/25, 475, -4. -4, 402/25, 475 Sort 665372, 0.1, 3, 66 in ascending order. 0.1, 3, 66, 665372 Put -0.1, 447, -0.01, 0.2 in decreasing order. 447, 0.2, -0.01, -0.1 Sort -296481, 0, -4, -3, 4, 3, 2. -296481, -4, -3, 0, 2, 3, 4 Sort 1, 13, 114, 3, -4, -165, -1 in decreasing order. 114, 13, 3, 1, -1, -4, -165 Put 0.14, 25, -13, -5, 5, -1/3, -1 in decreasing order. 25, 5, 0.14, -1/3, -1, -5, -13 Put -5, -0.03, 5/12, 1, 0, 85 in increasing order. -5, -0.03, 0, 5/12, 1, 85 Sort 212, -4/3, -84843 in ascending order. -84843, -4/3, 212 Put 1, -5, 5, -2, -94, -7, 12 in increasing order. -94, -7, -5, -2, 1, 5, 12 Sort -19696, 3, 28, -3, 5 in ascending order. -19696, -3, 3, 5, 28 Put -2/7, 5, -0.2, -6468, 0, -0.01 in ascending order. -6468, -2/7, -0.2, -0.01, 0, 5 Put 150.1557, 2/3, 0.5, -5 in decreasing order. 150.1557, 2/3, 0.5, -5 Sort 1, -874, 5, 300, -3. -874, -3, 1, 5, 300 Put 1, -2/7, 25, 71/6, 0 in decreasing order. 25, 71/6, 1, 0, -2/7 Put -2/7, -3, 1/6, -303, -1/3, 249 in decreasing order. 249, 1/6, -2/7, -1/3, -3, -303 Sort 295/3, 0.22, -2/3, 4, 0, 7. -2/3, 0, 0.22, 4, 7, 295/3 Put -1831, -0.6, -60 in decreasing order. -0.6, -60, -1831 Sort 5, 6340784, -2, 0, -4 in increasing order. -4, -2, 0, 5, 6340784 Put 1, -18599, 3, -12, 2 in decreasing order. 3, 2, 1, -12, -18599 Sort -5, 23, -242, -271, 3 in increasing order. -271, -242, -5, 3, 23 Put -588.096, -4, 0.27 in descending order. 0.27, -4, -588.096 Sort 2, 3, -2, -4, 1, -784065, 0 in ascending order. -784065, -4, -2, 0, 1, 2, 3 Put -0.2, 0.3, 80473887 in increasing order. -0.2, 0.3, 80473887 Sort 0.3, -0.0775, -3/5, 0.116 in ascending order. -3/5, -0.0775, 0.116, 0.3 Sort 5, 4, -1220, -3790 in increasing order. -3790, -1220, 4, 5 Put 2, 4005762, -3 in descending order. 4005762, 2, -3 Put -0.11, 5, 139239, -2 in descending order. 139239, 5, -0.11, -2 Sort 19, 118, 5, -9, -380 in descending order. 118, 19, 5, -9, -380 Sort 213, -226, 38. -226, 38, 213 Put 116, 25, -80, -32 in ascending order. -80, -32, 25, 116 Sort 1, -16, -4, 2, 13, -36, -362 in ascending order. -362, -36, -16, -4, 1, 2, 13 Put -9, 5, -1, -7, 4, 244, -3 in descending order. 244, 5, 4, -1, -3, -7, -9 Sort 1, -0.06, -0.0086, 78, 1/	{ "pile_set_name": "DM Mathematics" }
3:06 AM How many minutes are there between 9:32 PM and 2:24 AM? 292 What is 90 minutes before 7:10 AM? 5:40 AM How many minutes are there between 12:37 PM and 1:10 PM? 33 What is 141 minutes after 9:24 PM? 11:45 PM How many minutes are there between 4:11 PM and 1:52 AM? 581 How many minutes are there between 12:18 PM and 11:33 PM? 675 What is 709 minutes after 7:07 AM? 6:56 PM What is 406 minutes after 8:14 AM? 3:00 PM How many minutes are there between 8:40 PM and 11:12 PM? 152 What is 617 minutes after 11:44 PM? 10:01 AM What is 488 minutes before 11:47 AM? 3:39 AM How many minutes are there between 10:49 PM and 11:58 PM? 69 How many minutes are there between 1:30 AM and 4:53 AM? 203 What is 703 minutes after 6:47 PM? 6:30 AM What is 137 minutes after 12:39 AM? 2:56 AM How many minutes are there between 9:21 AM and 8:22 PM? 661 What is 662 minutes after 7:12 PM? 6:14 AM How many minutes are there between 8:25 PM and 12:31 AM? 246 What is 474 minutes before 8:10 AM? 12:16 AM What is 660 minutes before 2:33 PM? 3:33 AM What is 416 minutes after 9:15 AM? 4:11 PM What is 388 minutes before 12:33 AM? 6:05 PM What is 253 minutes after 9:01 PM? 1:14 AM What is 687 minutes before 11:49 AM? 12:22 AM What is 238 minutes after 10:39 PM? 2:37 AM What is 703 minutes after 9:05 PM? 8:48 AM What is 141 minutes after 1:31 PM? 3:52 PM What is 132 minutes before 8:28 PM? 6:16 PM What is 419 minutes after 4:29 AM? 11:28 AM How many minutes are there between 3:43 AM and 1:54 PM? 611 How many minutes are there between 9:35 AM and 8:54 PM? 679 What is 675 minutes after 9:00 AM? 8:15 PM How many minutes are there between 11:40 PM and 9:52 AM? 612 What is 655 minutes after 2:09 AM? 1:04 PM How many minutes are there between 2:29 AM and 1:56 PM? 687 What is 387 minutes before 11:32 PM? 5:05 PM What is 706 minutes after 7:05 PM? 6:51 AM How many minutes are there between 6:13 PM and 10:17 PM? 244 How many minutes are there between 4:44 AM and 3:08 PM? 624 What is 207 minutes before 11:24 AM? 7:57 AM What is 255 minutes before 9:56 AM? 5:41 AM What is 670 minutes after 12:55 PM? 12:05 AM How many minutes are there between 5:29 PM and 4:12 AM? 643 What is 543 minutes after 10:38 AM? 7:41 PM What is 283 minutes after 12:33 AM? 5:16 AM How many minutes are there between 2:25 PM and 4:12 PM? 107 What is 504 minutes after 3:08 AM? 11:32 AM How many minutes are there between 3:22 PM and 11:14 PM? 472 What is 470 minutes before 5:50 PM? 10:00 AM What is 139 minutes after 2:11 AM? 4:30 AM What is 688 minutes after 7:56 PM? 7:24 AM How many minutes are there between 6:25 AM and 11:48 AM? 323 What is 172 minutes after 11:43 AM? 2:35 PM What is 557 minutes before 8:30 PM? 11:13 AM What is 59 minutes after 8:15 PM? 9:14 PM How many minutes are there between 6:12 AM and 3:18 PM? 546 How many minutes are there between 1:30 AM and 5:07 AM? 217 How many minutes are there between 3:42 AM and 9:07 AM? 325 How many minutes are there between 1:48 AM and 2:29 AM? 41 How many minutes are there between 11:01 PM and 8:47 AM? 586 How many minutes are there between 8:45 AM and 1:24 PM? 279 What is 690 minutes before 6:25 PM? 6:55 AM What is 332 minutes before 12:00 AM? 6:28 PM What is 641 minutes after 2:21 PM? 1:02 AM What is 525 minutes after 2:48 AM? 11:33 AM How many minutes are there between 1:55 PM and 9:04 PM? 429 What is 401 minutes before 7:12 AM? 12:31 AM What is 40 minutes before 2:06 AM? 1:26 AM What is 60 minutes before 10:28 AM? 9:28 AM What is 657 minutes before 3:55 PM? 4:58 AM What is 462 minutes after 1:09 AM? 8:51 AM What is 704 minutes after 5:45 AM? 5:29 PM What is 423 minutes before 3:07 AM? 8:04 PM How many minutes are there between 6:56 AM and 11:51 AM? 295 What is 428 minutes after 11:15 AM? 6:23 PM What is 167 minutes after 10:47 PM? 1:34 AM How many minutes are there between 1:11 PM and 9:05 PM? 474 How many minutes are there between 1:34 PM and 12:41 AM? 667 How many minutes are there between 10:28 AM and 1:15 PM? 167 What is 492 minutes after 9:49 PM? 6:01 AM How many minutes are there between 12:02 AM and 9:15 AM? 553 How many minutes are there between 4:59 AM and 10:21 AM? 322 What is 596 minutes before 7:26 AM? 9:30 PM What is 458 minutes after 8:19 PM? 3:57 AM What is 505 minutes after 12:02 PM? 8:27 PM What is 305 minutes before 2:40 PM? 9:35 AM How many minutes are there between 4:47 AM and 5:35 AM? 48 What is 88 minutes before 1:34 AM? 12:06 AM What is 639 minutes after 3:22 AM? 2:01 PM What is 277 minutes after 3:17 PM? 7:54 PM How many minutes are there between 7:51 AM and 5:07 PM? 556 How many minutes are there between 4:43 PM and 2:42 AM? 599 How many minutes are there between 1:43 AM and 3:11 AM? 88 How many minutes are there between 2:17 PM and 9:07 PM? 410 How many minutes are there between 1:50 PM and 2:59 PM? 69 What is 670 minutes before 6:02 AM? 6:52 PM How many minutes are there between 4:27 AM and 7:13 AM? 166 What is 404 minutes after 8:34 AM? 3:18 PM What is 195 minutes after 2:14 AM? 5:29 AM How many minutes are there between 7:24 PM and 8:13 PM? 49 What is 88 minutes after 3:04 PM? 4:32 PM What is 492 minutes before 3:58 PM? 7:46 AM How many minutes are there between 7:08 AM and 8:08 AM? 60 How many minutes are there between 1:52 AM and 8:34 AM? 402 What is 419 minutes after 1:23 PM? 8:22 PM How many minutes are there between 12:02 PM and 2:57 PM? 175 How many minutes are there between 12:33 PM and 1:25 PM? 52 How many minutes are there between 7:26 PM and 10:02 PM? 156 How many minutes are there between 4:55 AM and 12:33 PM? 458 How many minutes are there between 5:13 AM and 7:35 AM? 142 What is 194 minutes before 2:16 AM? 11:02 PM What is 144 minutes after 1:49 AM? 4:13 AM What is 103 minutes after 10:49 AM? 12:32 PM What is 54 minutes before 7:30 PM? 6:36 PM What is 680 minutes after 7:46 PM? 7:06 AM How many minutes are there between 3:19 PM and 10:18 PM? 419 How many minutes are there between 7:55 PM and 10:05 PM? 130 How many minutes are there between 3:36 AM and 9:13 AM? 337 What is 69 minutes before 4:00 PM? 2:51 PM How many minutes are there between 12:53 PM and 1:32 PM? 39 How many minutes are there between 3:38 AM and 3:17 PM? 699 What is 677 minutes after 1:24 PM? 12:41 AM How many minutes are there between 6:48 AM and 6:35 PM? 707 What is 576 minutes after 6:34 PM? 4:10 AM How many minutes are there between 2:47 PM and 5:51 PM? 184 How many minutes are there between 7:07 AM and 3:00 PM? 473 What is 52 minutes after 6:17 AM? 7:09 AM What is 492 minutes before 5:00 AM? 8:48 PM What is 91 minutes after 2:30 PM? 4:01 PM How many minutes are there between 8:34 AM and 6:51 PM? 617 What is 376 minutes before 4:55 AM? 10:39 PM What is 420 minutes after 11:03 AM? 6:03 PM What is 341 minutes before 10:14 PM? 4:33 PM What is 332 minutes before 10:30 PM? 4:58 PM How many minutes are there between 4:52 AM and 6:55 AM? 123 How many minutes are there between 2:40 AM and 3:19 AM? 39 How many minutes are there between 6:57 PM and 6:17 AM? 680 What is 289 minutes after 4:47 AM? 9:36 AM How many minutes are there between 10:54 PM and 9:56 AM? 662 What is 310 minutes after 2:40 PM? 7:50 PM What is 445 minutes after 7:48 PM? 3:13 AM What is 697 minutes after 6:04 AM? 5:41 PM What is 682 minutes before 2:01 PM? 2:39 AM What is 466 minutes after 7:38 PM? 3:24 AM How many minutes are there between 5:54 AM and 12:35 PM? 401 How many minutes are there between 5:48 AM and 11:06 AM? 318 How many minutes are there between 4:41 PM and 1:25 AM? 524 How many minutes are there between 9:05 PM and 3:19 AM? 374 How many minutes are there between 10:29 PM and 11:32 PM? 63 What is 101 minutes after 8:59 AM? 10:40 AM How many minutes are there between 8:47 PM and 6:30 AM? 583 How many minutes are there between 3:57 AM and 3:14 PM? 677 What is 439 minutes after 4:26 PM? 11:45 PM How many minutes are there between 5:30 AM and 6:11 AM? 41 How many minutes are there between 12:21 AM and 3:36 AM? 195 How many minutes are there between 9:45 AM and 4:10 PM? 385 How many minutes are there between 9:55 PM and 3:00 AM? 305 How many minutes are there between 7:16 PM and 4:59 AM? 583 What is 123 minutes after 4:48 PM? 6:51 PM How many minutes are there between 8:21 AM and	{ "pile_set_name": "DM Mathematics" }
= -142h + 792. Give l(0). 792 Let s(l) = 115l*2 + 490l + 3342. Give s(-7). 5547 Let p(f) = 141f + 11192. Determine p(-79). 53 Let o(v) = -v2 + 861v + 360020. Give o(-308). -32 Let l(g) = -g*2 + 16362g + 491765. Give l(-30). 5 Let p(d) = -3d2 + 3227d - 84976. What is p(27)? -34 Let f(i) = -i*3 - 38i*2 + 455i - 117. Give f(-48). 1083 Let l(s) = -15793s - 3600808. What is l(-228)? -4 Let l(d) = 28d*3 - 195d*2 + 70d - 511. Calculate l(7). 28 Let g(b) = -8b3 + 11b*2 + 223b + 16. Calculate g(0). 16 Let d(q) = -1654q - 5892. Give d(-3). -930 Let f(b) = -675b + 7202. Calculate f(11). -223 Let c(g) = 13g2 - 210g + 827. Calculate c(4). 195 Let y(a) = 4562a + 1386865. Calculate y(-304). 17 Let s(j) = j3 - 738j*2 - 19882j - 466. Give s(-26). 2 Let m(c) = -52c2 - 63c - 427. Give m(-7). -2534 Let x(v) = 3020869v - 12083474. Determine x(4). 2 Let j(y) = 299y + 76235. Give j(-255). -10 Let i(k) = -967k2 - 278496k + 8. Calculate i(-288). 8 Let m(w) = -1453w + 21505. Determine m(18). -4649 Let t(z) = -3046z - 27423. Determine t(-9). -9 Let w(k) = -72k + 1101. Give w(18). -195 Let b(p) = 25190p - 327357. Calculate b(13). 113 Let x(n) = 3n3 + 5n*2 + 11n + 6. Calculate x(-1). -3 Let g(p) = 139p2 + 416p - 831. Give g(2). 557 Let o(g) = 46138g - 184891. Determine o(4). -339 Let d(l) = 6l*2 + 387l - 6985. What is d(15)? 170 Let o(j) = j*3 + 73j*2 + 1166j - 2999. Determine o(-29). 191 Let l(j) = -18656j - 727639. Calculate l(-39). -55 Let k(c) = 4258c - 1102826. Calculate k(259). -4 Let y(m) = 74m2 - 143m + 301. Give y(0). 301 Let m(w) = 91359w + 91353. What is m(-1)? -6 Let d(s) = -2s*3 - 80s*2 - 61s - 664. Calculate d(-39). -1327 Let p(t) = -t*2 - 20t + 539. Determine p(8). 315 Let m(c) = c*2 - 6914c - 152676. Calculate m(-22). -84 Let z(c) = -12c2 + 3168c + 29484. Determine z(273). 0 Let l(c) = -c*3 - 37c*2 + 855c + 20285. Calculate l(-46). -1 Let a(y) = -42068y - 1219969. Calculate a(-29). 3 Let c(v) = -25v*2 + 521v + 41. What is c(22)? -597 Let s(x) = 8x + 137. What is s(16)? 265 Let m(u) = -1976u + 94981. Calculate m(48). 133 Let v(s) = -2s2 + 881s + 116506. Calculate v(547). -5 Let h(q) = 8q2 + 140q - 42. What is h(-17)? -110 Let o(m) = 2027152m + 18244367. Determine o(-9). -1 Let z(o) = -1363o - 526817. What is z(-386)? -699 Let s(f) = 2862f2 - 145961f - 31. Give s(51). 20 Let t(c) = -9c3 - 91c*2 + c + 21. Give t(-7). -1358 Let m(h) = -4h*2 - 22h + 442. Give m(11). -284 Let o(n) = -n*3 - 21n*2 + 1408n + 17192. Calculate o(-12). -1000 Let r(s) = -101s + 4021. Give r(36). 385 Let k(o) = 984o - 364073. What is k(370)? 7 Let o(t) = 3t3 + 180t*2 + 1309t + 6. What is o(-8)? -482 Let p(w) = -14734w - 309407. Give p(-21). 7 Let u(k) = -k3 + 54k*2 + 127k - 828. What is u(56)? 12 Let f(j) = j*3 - 10j*2 - 4048j + 63241. What is f(16)? 9 Let x(h) = 7h2 - 494h - 1485. Determine x(-3). 60 Let l(o) = -480o2 + 60o - 15. What is l(1)? -435 Let c(h) = -h*3 - 6h*2 + 324h + 2625. Give c(-9). -48 Let n(v) = -12003v + 1236312. Calculate n(103). 3 Let k(d) = -5183d + 1181694. What is k(228)? -30 Let v(w) = 18207w + 691503. Determine v(-38). -363 Let f(r) = 5516r*2 - 55197r + 365. Give f(10). -5 Let w(v) = v*2 + 2012v + 12022. Determine w(-6). -14 Let t(l) = -242l - 1838. What is t(-7)? -144 Let n(m) = 8m*2 - 7524m + 30255. Determine n(4). 287 Let u(r) = -r*3 + 35r*2 - 43r - 484. Calculate u(33). 275 Let p(n) = -14n3 + 2000n*2 + 335n - 6997. Give p(143). 10 Let x(r) = 21r2 - 34r + 33. Calculate x(-5). 728 Let k(x) = -93x - 4840. Give k(-54). 182 Let h(z) = -87442z + 612107. Give h(7). 13 Let j(u) = -u*3 - 43u*2 - 515u - 21. Calculate j(-24). 1395 Let j(g) = -8398g - 32372. Calculate j(-4). 1220 Let u(g) = -2g*3 - 118g*2 + 374g + 175. What is u(-62)? 51 Let q(u) = -43u3 - 301u*2 - 11u - 7. Give q(-7). 70 Let c(k) = -476155k + 1. Give c(0). 1 Let a(l) = -l3 + 14l*2 + 220l + 7662. Give a(30). -138 Let o(s) = 182s - 920. Determine o(6). 172 Let d(i) = -110i + 3113. Determine d(23). 583 Let m(x) = -2x3 + 352x*2 + 1074x + 367. Determine m(179). 367 Let m(p) = -283236p + 2265861. Calculate m(8). -27 Let k(x) = 21x*2 - 124x + 4. What is k(6)? 16 Let d(l) = -9l2 - 138l - 476. What is d(-8)? 52 Let p(u) = -u*3 - 21u*2 + 203u + 292. What is p(-28)? 96 Let b(n) = n*2 - 298n - 4716. Give b(313). -21 Let f(a) = 6a3 - a2 - 195a + 195. What is f(1)? 5 Let l(c) = -16c2 + 287c + 269. Determine l(19). -54 Let j(n) = 3n3 - 204n*2 - 412n - 566. Calculate j(70). -6 Let o(d) = -2247d + 38265. Give o(17). 66 Let v(s) = -2s*2 - 15833s + 47523. Determine v(3). 6 Let n(p) = 55p3 - 3p*2 - 58p - 91. Determine n(-2). -427 Let x(q) = -30q2 - 571q - 2341. Give x(-13). 12 Let j(g) = -1215g + 120261. Calculate j(99). -24 Let z(t) = -3t*3 - 142t*2 + 129t + 1094. Determine z(-48). -490 Let m(w) = -w*3 - 96w*2 + 801w + 350. What is m(8)? 102 Let t(d) = 2d3 + 30d*2 - 181d + 84. Determine t(4). -32 Let y(m) = 96m2 - 2395m - 5241. What is y(27)? 78 Let r(z) = -z*2 - 2248z + 29435. Calculate r(13). 42 Let o(q) = -7q3 + 250q*2 - 111q - 2245. What is o(35)? -5 Let b(z) = 107z2 - 213z - 392. What is b(3)? -68 Let b(t) = 434t2 + 49037t - 565. Give b(-113). 0 Let x(a) = -5a3 + 199a*2 + 406a + 9. Determine x(-2). 33 Let l(t) = -t*2 - 642t + 70753. Give l(93). 2398 Let i(t) = -4t2 + 567t - 19182. Give i(86). -4 Let c(t) = -235t2 + 2138t + 1. Determine c(9). 208 Let l(q) = 10q3 + 122q*2 + 308q + 3347. What is l(-12)? -61 Let b(z) = 5z2 + 214z - 300. Determine b(-55). 3055 Let k(j) = -4j2 + 139j - 714. Calculate k(23). 367 Let h(a) = -a*3 - 5a*2 + 34a - 22. What is h(-7)? -162 Let a(r) = r*3 - 215r*2 + 358r + 14483. Determine a(213). -1 Let c(v) = 2402v + 21579. Determine c(-9). -39 Let d(i) = -2981i - 17804. What is d(-6)? 82 Let i(x) = 3x2 + 1283x + 68022. Calculate i(-62). 8 Let c(x) = -10026x + 59875. What is c(6)? -281 Let g(z) = z3 - 31z*2 + 1324z - 20808. What is g(19)? 16 Let v(b) = -4b3 + 43b*2 + 10b - 191. Calculate v(9). 466 Let i(j) = 3j3 - 882j*2 + 1745j + 2003. Calculate i(292). -41 Let j(c) = 2c3 + c2 - 47c - 77. Calculate j(-5). -67 Let b(k) = 1807470k - 11. What is b(0)? -11 Let j(a) = -42a*2 - 128a + 1275. Determine j(-7). 113 Let c(z) = 5z3 + 79z*2 + 327z + 113. Determine c(-6). -85 Let i(l) = -8311l + 14004039. What is i(1685)? 4 Let a(u) = -330u + 4023. Give a(12). 63 Let u(w) = w*3 - 533w*2 + 574w - 22388. What is u(532)? -44 Let z(t) = 16t - 3410. Determine z(215). 30 Let h(r) = 18r*2 - 10r - 432. Give h(-7). 520 Let l(f) = -14f2 + 609f + 7496. What is l(-10)? 6 Let i(h) = h*3 - 96h*2 + 268h + 1016. Calculate i(93). -7 Let v(m) = -909m + 4875. Determine v(4). 1239 Let t(r) = 3317r + 1695022. Give t(-511). 35 Let k(m) = -2m3 - 6m*2 - 596m - 2405. Calculate k(-4). 11 Let h(p) = 19p2 + 11733p + 140598. Give h(-12). 2538 Let k(m) = -1903m + 36031. Calculate k(19). -126 Let b(q) = 16q*2 + 3280q + 5950. Give b(-203). -546 Let b(l) = 80l + 4558. Determine b(-51). 478 Let p(g) = 23568g + 4124386. Give p(-175). -14 Let z(h) = 1154583h + 2309131. Calculate z(-2). -35 Let u(j) = 5j*2 + 17j + 1. What is u(-1)? -11 Let w(p) = 3p3 + 61p*2 - 10p - 500. Calculate w(3). 100 Let v(x) = -7484x + 785830. Give v(105). 10 Let h(u) = 789u*2 + 2515u - 2. Give h(-3). -446 Let j(w) = w*3 - 86w*2 - 41w + 4745. What is j(86)? 1219 Let u(c) = 10c3 + 13c*2 + 38c + 13. Calculate u(-3). -254 Let w(t) = -2t3 - 14t*2 + 451t + 3824. What is w(-13)? -11 Let g(h) = h*2 + 1832h + 71770. What is g(-40)? 90 Let v(q) = 5q2 + 8q + 62. Calculate v(-9). 395 Let s(b) = 628b2 + 95452b - 651. What is s(-152)? -43 Let v(r) = -r*3 - 49r*2 - 524r - 72. What is v(-33)? -204 Let z(y) = -58y2 + 265y + 395. Give z(-1). 72 Let x(p) = p*2 - 93p + 1256. Calculate x(38). -834 Let l(v) = -537v + 84836. Give l(158). -10 Let d(m) = -8313m - 108450. What is d(-13)? -381 Let z(f) = -2f2 + 82f + 67270. Calcu	{ "pile_set_name": "DM Mathematics" }
g*2 + 124g + 633 + 221. -23g2 + 854 Collect the terms in -4081u + 12218u - 4070u + 2 - 2 - 4071u. -4u Collect the terms in 104347 - 206888 + 2p - 3p + 102541. -p Collect the terms in 302 - 2036f2 + 255 + 2040f*2 - 557. 4f*2 Collect the terms in 1 - 79194m*3 - 79619m*3 - 1 + 158816m*3. 3m*3 Collect the terms in 2378v + 120v - 2041v. 457v Collect the terms in 558040 + 19u + 557936 - 1115973. 19u + 3 Collect the terms in -23 + 294778o - 294776o + 6. 2o - 17 Collect the terms in 3125q - 3q*2 + 5q*2 - 8449q + 5324q. 2q*2 Collect the terms in -1667 - 1674 - 613 + 2o*2 + 3954. 2o*2 Collect the terms in -14059q*2 - 66 + 29652q*2 - 14921q*2 + 66. 672q*2 Collect the terms in -49607l + 49609l - 40l*2 + 60l*2. 20l*2 + 2l Collect the terms in -2779u + 5289u - 2519u. -9u Collect the terms in -30664t3 - 115720t*3 - 195505t*3. -341889t*3 Collect the terms in -137849l + 156562l + 235163l + 51818l. 305694l Collect the terms in 1152 - 290 - 287 - 283 - 290 - 384n. -384n + 2 Collect the terms in 2015z2 + 4z*3 + 2031z*2 + 2038z*2 - 6084z*2. 4z*3 Collect the terms in 401 - 170 - 72 + 877p - 159. 877p Collect the terms in 15v*2 - 25v*2 - 77 + 1294v + 77 + 12v2. 2v*2 + 1294v Collect the terms in -1164a3 - 4575719029a + 1168a3 + 4575719029a. 4a3 Collect the terms in -1852860f*3 + 926693f*3 + 926186f*3. 19f*3 Collect the terms in 32f + 5 - 17f + 26f - 11f + 2f + 14f. 46f + 5 Collect the terms in 729 + 1554 - 7g2 + 3989 - 2g*2 + 1354. -9g*2 + 7626 Collect the terms in -546 - 497 - 15q + 1554 - 510. -15q + 1 Collect the terms in 1542446154 - 1542446154 + 437h - h2. -h2 + 437h Collect the terms in 110m*2 - 1801769 + 1801769. 110m*2 Collect the terms in -2597 - 22234c + 2597 + 22031c. -203c Collect the terms in 3121 + 2j - j - 3981 - 5271 - 3741 + 378. j - 9494 Collect the terms in 9389499k*2 + 9382545k*2 - 18772047k*2. -3k*2 Collect the terms in -248 - 226 + 14m + 570m2 + 475 - 14m. 570m2 + 1 Collect the terms in 3 - 1352d*2 + 5655d*2 + 2d - 5. 4303d2 + 2d - 2 Collect the terms in 49839z2 - 112063z*2 + 131287z*2 + 143569z*2. 212632z*2 Collect the terms in -1812 - 449m*3 + 450m3 + 75. m3 - 1737 Collect the terms in 518230 + 3m + 518245 - 1036472. 3m + 3 Collect the terms in -21611125575v3 + 1 - 1 + 21611125578v*3. 3v*3 Collect the terms in 296y - 1575y2 - 46y + 1571y2 - 54y - 126y. -4y*2 + 70y Collect the terms in 10d + 1895 + 2210 - 4112. 10d - 7 Collect the terms in -1703q - 2452q - 1708q - 1704q + 7572q. 5q Collect the terms in -351o + 23 + 186o + 50o - 23 + 52o + 58o. -5o Collect the terms in 3869k + 3775k - 15153k + 3770k + 3764k. 25k Collect the terms in -743 + 12k + 2194 + 4k - 697 - 751. 16k + 3 Collect the terms in 859 + 758u - 703 - 156. 758u Collect the terms in -2512o - 1121o - 766o - 3617o. -8016o Collect the terms in -4q3 + 415994q + 415897q + 415897q - 1247788q. -4q*3 Collect the terms in -105f - 4f3 + 28233 + 105f - 14117 - 14122. -4f3 - 6 Collect the terms in 7k + 593699504 - 593699504 + 34k. 41k Collect the terms in -797m + 257m + 242m + 227m. -71m Collect the terms in 4429817 + 110n - 4429817 - 693n. -583n Collect the terms in -11o + 13 - 21o*2 - 8 + 0 + 24o*2. 3o*2 - 11o + 5 Collect the terms in -1391n - 3765430 - 1285n + 3765430. -2676n Collect the terms in -1055y - 93 - 42y - 23y + 93. -1120y Collect the terms in -1715601412 - 345p + 1715601412. -345p Collect the terms in 11434b*3 - 1208777164 + 1208777164. 11434b*3 Collect the terms in 35 - 257w - 25 - 60w + 19. -317w + 29 Collect the terms in 19156l3 - 2l - 9615l3 + 2l - 9554l3. -13l*3 Collect the terms in 16950247o - 4765003o + 42763744o. 54948988o Collect the terms in 36h + 37h + 24h + 39h - 603 - 125h. 11h - 603 Collect the terms in 1 + 1 - 932i + 300i - 1401i - 4. -2033i - 2 Collect the terms in -2v + 29370v2 - 57549v*2 + 2v + 28884v2. 705v*2 Collect the terms in 1407569721 - 1407569721 + 2o*3. 2o*3 Collect the terms in -l + 19l + 8l - 7l + 5l - 27l. -3l Collect the terms in 0i + 30 + 3i - 3i + 860i2 - 3i + 114i2. 974i*2 - 3i + 30 Collect the terms in -1612026z3 - 82711z*3 - 2119447z*3. -3814184z*3 Collect the terms in 9y*2 + 19y*2 - 19y*2 - 9y*2 - 8164y*3. -8164y*3 Collect the terms in 7941u*3 - 6187u + 6187u. 7941u*3 Collect the terms in -1057c*2 - 2c*3 + 9388c*2 + 8c*3 + 6c*3. 12c*3 + 8331c*2 Collect the terms in 81l*2 - 840l*2 - 212l*2 - 201l*2. -1172l2 Collect the terms in u3 + 2u3 - 9u*3 - 224 + 914u + 5u3. -u3 + 914u - 224 Collect the terms in 890z3 - 1438z*3 - 1185z*3 + 874z*3 + 885z*3. 26z*3 Collect the terms in -1726b + 613b + 562b + 545b. -6b Collect the terms in 17 + 1269l - 427l - 419l - 426l + 7. -3l + 24 Collect the terms in 25 - 2106p*2 - 25 - 2090p*2 + 6279p*2 - 2072p*2. 11p*2 Collect the terms in -59 + 90 + 123621u - 31. 123621u Collect the terms in 17237x*2 - 40676x*2 - 2x*3 + 15617x*2. -2x*3 - 7822x*2 Collect the terms in -48 + 17c*2 - 9c*2 + 1 + 1 - 7c2 + 39 - 2. c2 - 9 Collect the terms in -479131p - 479122p + 958258p. 5p Collect the terms in 4l + 68 - 13l - 172 + 31 + 37. -9l - 36 Collect the terms in -901v + 573 - 144 + 901v + 50 - 4v*3. -4v*3 + 479 Collect the terms in -1380n*2 + 10825n*2 + 1881n*2. 11326n*2 Collect the terms in -76702p*3 + 408117p*3 - 956202p*3 - 1042023p*3. -1666810p*3 Collect the terms in 952 + 28u*2 - 362 - 295 - 295 - 27u2. u2 Collect the terms in -45 + 213 - 501w - 87 - 81. -501w Collect the terms in -10 + w + 8 + 10 + 3w2 - 9 + 9. 3w*2 + w + 8 Collect the terms in 497t*2 - 1511t*2 + 506t*2 - 20t*3 + 7t*3 + 16t*3 + 508t*2. 3t*3 Collect the terms in 2p + 9p + 8277 - 7p - 8308. 4p - 31 Collect the terms in -72439243434 + 72439243434 + 15q*2. 15q*2 Collect the terms in -7006114 + 7006114 + 182h - 181h. h Collect the terms in -13445 + 24w*2 - 2w + 13445. 24w2 - 2w Collect the terms in 6a + 1765 - 449 - 556. 6a + 760 Collect the terms in -13284s2 - 41296s*2 - 39418s*2 + 19809s*2. -74189s*2 Collect the terms in -421719t - 421738t + 843451t. -6t Collect the terms in -9271c + 177c + 9091c. -3c Collect the terms in 142 + 182 + 78f*2 - 60f*2 - 6 + 54. 18f*2 + 372 Collect the terms in 3r - 12r + 10r + 1662 - 1672. r - 10 Collect the terms in 8 - 2v3 - 4 - 3v - v - 6 + 1. -2v3 - 4v - 1 Collect the terms in 5613m - 2 + 2 - 11348m + 5745m. 10m Collect the terms in 12177808137858 - 2q3 - 12177808137858. -2q*3 Collect the terms in 37797146q + 1 + 1801q2 - 37797146q - 1. 1801q2 Collect the terms in 24301977v*3 - 24301975v*3 + 52v - 52v. 2v*3 Collect the terms in -66f*3 - 3 + 61 + 57 + 15f - 115. -66f3 + 15f Collect the terms in 476d2 + 120 - 160d*2 - d - 163d*2 - 160d*2 - 16d*3. -16d*3 - 7d*2 - d + 120 Collect the terms in 57q*2 + q + 23q*2 + 57q*2 + 58q*2 - 199q*2 - q. -4q*2 Collect the terms in -2 + 30 - 10 - 19661n + 25. -19661n + 43 Collect the terms in 14238b*3 - 14239b3 + 1286 - 1286. -b3 Collect the terms in 2579333197 - 2z - 2579333197 - z2 - 3z*2. -4z*2 - 2z Collect the terms in -1583o + 30 + 803o - 174 + 810o. 30o - 144 Collect the terms in 724f2 - 21f*3 - 7f*3 - 369f*2 - 355f*2. -28f*3 Collect the terms in -927u + 201u + 178u + 175u + 176u + 177u. -20u Collect the terms in -1765g + 12592 + 1765g + 6g2 - 12617 - 3g*3. -3g*3 + 6g*2 - 25 Collect the terms in -30l*2 - 58l*2 - 48l*2 - 72l*2 + 256l*2. 48l*2 Collect the terms in -31 + 30810543234z*2 - 30810543234z2 + z3. z*3 - 31 Collect the terms in 14862z*2 + 2z*3 - 7432z*2 - 7430z*2. 2z*3 Collect the terms in -269685319211 + i + 269685319211. i Collect the terms in 1826 - 3649 + 9006i*2 + 1823. 9006i*2 Collect the terms in -10x - 29x - 17385 + 19x + 21*x. x - 17	{ "pile_set_name": "DM Mathematics" }
ch is the second smallest value? (a) 1 (b) u (c) j c Let k = 1178.235 + -1175. Let v = -0.235 + k. Which is the biggest value? (a) v (b) 0.8 (c) -0.06 a Let w be (2 + 0)/(1 - (-1 - 0)). Let l(s) = -3s2 - s - 4. Let k be l(0). Which is the second biggest value? (a) k (b) w (c) 2 (d) -35 b Let v = -852.007 + 852. Which is the second biggest value? (a) v (b) -2/7 (c) 2/9 a Let z = -91 + 91.108. Let t = -0.508 + z. Which is the third biggest value? (a) 0.8 (b) t (c) 1 (d) 3 a Let q = -137 - -233. Let g = q + -95.892. Let j = g + -0.008. What is the biggest value in -0.4, 4, j? 4 Let l be 2 + 10/(-2) + 6. Suppose -14 - 4 = -ly. Let i = -2062 + 2066. Which is the second smallest value? (a) 2 (b) y (c) i c Let b = -1 + 62. Let j = 6449.02 + -6388. Let k = b - j. What is the second smallest value in k, -1/6, 3, 0.4? k Let u be (-3)/(-5)(17 + (-689)/39). What is the second smallest value in 1, u, -749? u Let h = -76.2865 + 76.77. Which is the biggest value? (a) -2/15 (b) 5 (c) -2 (d) h b Let z = -7548 + 7543. Which is the second smallest value? (a) 1/7 (b) z (c) -8 (d) -2 b Let v be (-85)/120 - (-4)/(-96). Which is the smallest value? (a) 219 (b) 0.3 (c) 1 (d) v d Let m = -2.25077 - -0.25077. Let p = -101/5 - -1081/55. What is the third smallest value in m, p, 2/19? 2/19 Let p = 4.4 + -23.8. Let x = 15.4 + p. What is the fourth biggest value in 0.2, 3, x, -0.5? x Let p be ((-6)/4 + -1)/((-4)/(-16)) - -7. Which is the biggest value? (a) p (b) -4 (c) 0.1 (d) 122 d Let b be (2 - (-1 + 16))(-2 - (-4)/4). What is the third smallest value in -1, b, -0.02? b Let g = -375 + 383. Let v be 1 - ((-56)/(-21))/g. What is the second smallest value in v, -4, -2/5? -2/5 Let u = -384.31 - -382. Let z = -1.69 + u. What is the third smallest value in 13, z, 0.2? 13 Let k = 0.12 + -0.62. Let i = 2535 - 2535.3. What is the fourth smallest value in i, 0.2, k, -4? 0.2 Let c = -179/99 + 15/11. Suppose 6r - n + 43 = 7, -13 = 5r + 2n. What is the third smallest value in 2/5, r, c, 3? 2/5 Let m be ((-10)/6 + (1 - 0))(-96 - -102). Which is the smallest value? (a) 2/17 (b) m (c) 15/2 (d) 10 b Let z = -0.0757 + -0.9243. Let i = -2.94 + 3.04. Which is the third smallest value? (a) -9 (b) 1 (c) i (d) z c Let u = -28/5 - -278/55. Suppose -2i = -0i + 3v - 4, 3v = -i + 5. Let x be i(-21)/((-2)/(-4)). Which is the biggest value? (a) u (b) -0.3 (c) x c Let q = 0.0166 + 332.9834. Let x = -332 + q. Let d = 1 - 3. What is the biggest value in d, 5, -4/7, x? 5 Let n = 208 + -208.047. Let s = n + 0.747. Let b be (-1 - 0)/(61). What is the second smallest value in s, b, -2? b Let n = 10217.5 + -10217. Let d = -4.135 + 0.035. What is the second smallest value in -0.2, n, d? -0.2 Let r(b) = b3 - 6b*2 + 5b + 14. Let a be r(4). Let p be -11(a/(-10))/(15/(-25)). What is the third biggest value in -0.4, 0.5, p? p Let x = -1162 - -1161.9. What is the third smallest value in 0.6, 0.2, x, -274? 0.2 Let h = -7 + 27/4. Let r = 373.819 - 374. Let x = r - -0.281. What is the smallest value in h, -2, x? -2 Let f = 2554 - 2555. What is the biggest value in 3, f, 4, -0.2, 0.4? 4 Suppose 0 = 8u - 10u. Suppose -2k = -0k - 8. Suppose 0g + 4g - 3y + 3 = u, -5 = -kg - 5y. What is the second smallest value in 5, -6, g? g Let f = -2/411 - -2063/1644. Let i = -1348 + 1285. Which is the biggest value? (a) f (b) 0.3 (c) i a Let m be 6/(-4)(-40)/(-870). Let u = 146 - 309. Let t = u - -162. What is the third smallest value in 0, m, t? 0 Let z be -8(2/20 + 0). Suppose 182w - 40 - 72 = 252. What is the fourth smallest value in -2/5, w, -4, z? w Suppose -3 = -3o + 3d, 0 = 25o - 23o + 3d - 12. Let j be 9/42(-11 + 9). What is the third smallest value in o, 1/2, j, -53? 1/2 Suppose -14l - r = -16l - 2549, 3r - 1262 = l. Let h = l + 7625/6. What is the smallest value in -2/11, -2/13, h? h Let i = -210.77 + 212. Let a = i + -0.83. What is the second biggest value in 0.5, 12, a, -0.3? 0.5 Let a = 0.2387 - -4.7613. What is the smallest value in 37/4, a, -4? -4 Suppose -4p = -3j - 26, -3p - 6j = -2j - 7. Suppose 0 = -5h + 3f - 16, ph - f = 7h + 13. Which is the smallest value? (a) -1 (b) 0.3 (c) h (d) -1/3 c Suppose -5h = -9p - 136, p - 15h = -10h + 16. Which is the smallest value? (a) -0.02 (b) p (c) 2 b Let b = -438.1 - -442. What is the second smallest value in 0.4, -2, b? 0.4 Let o = 571 - 1272. Let d = -710.9 - o. What is the third smallest value in 0, 1, d? 1 Let n = 2.62 - 1.43. Let v = n - 0.79. Let w = 797/26 + -61/2. Which is the biggest value? (a) -5 (b) -1 (c) w (d) v d Let h = -5.875 + 7.875. Which is the biggest value? (a) 1/7 (b) -87/73 (c) h c Let a = -34011 + 34015. What is the third biggest value in 6, -0.05, a, -7? -0.05 Let w = -379 - -378. Let x(v) = 2v*2 + v - 34. Let m be x(0). What is the third smallest value in m, -0.2, w? -0.2 Let l = -5654/63 - -622/7. What is the third biggest value in l, 40, -1/2? l Let f = -1 - -4/5. Let o be (-4)/12 - (-88)/396. What is the second biggest value in o, f, 4? o Let j = 173 + -228. Let h be -1(5 + 265/j). What is the third smallest value in h, 5, 2.8? 5 Let y = -7072/10599 + 2/3533. Which is the smallest value? (a) -1/2 (b) -23 (c) y b Let v = 8466/11 - 270945/352. Which is the biggest value? (a) v (b) 0.3 (c) -12 b Suppose -5m + 0m + 5q + 95 = 0, 0 = 5m + 4q - 50. Which is the biggest value? (a) m (b) -45 (c) -0.5 a Let o = 0.973 + 0.027. Let g = 108 - 103. What is the third smallest value in o, -1.1, 4, g? 4 Let v = -5.825 + 6.025. Which is the second biggest value? (a) 2 (b) -12 (c) 0.3 (d) -3/4 (e) v c Let l = -369 - -125. Let j = 243.9 + l. Let d = 1 + -2. Which is the third smallest value? (a) j (b) d (c) 11 c Let a = 0.8 - -2.8. Let s = 24.4 + a. Let p = s + -28. What is the biggest value in -2/17, p, -0.3? p Let u be ((-9)/24(5 - 7))/((-30)/(-24)). What is the second biggest value in -2/359, -4, u, -0.5? -2/359 Let m be -1 + (-1 - -2) + 2. Let t = -85 - -92.9. Let o = -8 + t. Which is the second smallest value? (a) o (b) 2/13 (c) m (d) -2/5 a Let o = 15 - 9. Let l = 122141/60 - 30524/15. Which is the smallest value? (a) 1/4 (b) l (c) o (d) -1/2 d Let n = 0.0514 + -41.0514. Let w = -46 - n. Which is the third biggest value? (a) w (b) -0.382 (c) 0.3 a Let t = -0.6 - -0.95. Let i = 0.05 - t. Suppose 7953p = 7949p + 20. Which is the third smallest value? (a) i (b) p (c) 2/9 (d) -14/3 c Let w(g) = -g*2 - 6g + 3. Let z be w(-6). Suppose -1120 - 332 = -11k. Let o = -529/4 + k. What is the third biggest value in -1, o, z, -1/3? -1/3 Suppose 8 = l - 3f - 14, 5f + 32 = -3l. Let n = -8 + 8.06. What is the second biggest value in l, 4, n? l Let l = 3845 + -3847. Which is the second smallest value? (a) l (b) 0.06 (c) 9 (d) -5 a Let v be (-5)/(-20)8/10. Let s = -6 - -3. Let t be 2/3(-1 - -2). Which is the third biggest value? (a) v (b) s (c) t b Let f = 4404 + -4405. Which is the second smallest value? (a) f (b) 1/9 (c) -3/5 (d) 3 c Suppose -k - 42 = 2n - 3k, -3k = 3n + 87. Let f be (6/9 - 1)10/n. Let p = -0.11 - 4.89. Which is the fourth biggest value? (a) 3 (b) -2 (c) f (d) p d Let u = -19 + 20. Suppose 6x + 2x = -352. Let l be 16/(-24) - (-2 - x/6). Which is the third biggest value? (a) u (b) l (c) -4/5 b Let d = 162791 + -162793. Let i = 1 - 1. What is the biggest value in d, 0.5, 2, i? 2 Suppose 681 = 3j + 3x, -8x + 3x + 909 = 4j. Let t be (-19)/(-133) + j/182. Which is the smallest value? (a) -6/7 (b) t (c) 2 a Let x = 1809 - 5425/3. Let t = 0.7 + -2.3. Let n = -6.6 - t. What is the second smallest value in n, -1/18, x? -1/18 Let t = 100.4 + -13.4. Let s = t - 87.2. What is the smallest value in 0, s, -0.03? s Let g = 28235 + -28408. Let y = 1.6 + -1.2. Which is the second smallest value? (a) g (b) 4 (c) -0.3 (d) y c Let t be 2/10 - 42/10. Let g = -46433 + 46433.6. What is the biggest value in t, g, -0.2? g Let x = 255 + -176. Suppose -xr - 5 = -78r, 0 = -4i + 3r + 31. Let k be 24/182 - (-2)/(-7). Which is the third smallest value? (a) 3/4 (b) k (c) i (d) 2 d Let p be (-11)/(-3) + (-4)/6. Let y = 1137969/4 - 284493. Which is the biggest value? (a) p (b)	{ "pile_set_name": "DM Mathematics" }
, 113 List the prime factors of 5814. 2, 3, 17, 19 List the prime factors of 423. 3, 47 List the prime factors of 163. 163 List the prime factors of 201. 3, 67 What are the prime factors of 65589? 3, 21863 List the prime factors of 190. 2, 5, 19 List the prime factors of 2930. 2, 5, 293 What are the prime factors of 11324? 2, 19, 149 What are the prime factors of 10220? 2, 5, 7, 73 List the prime factors of 5730. 2, 3, 5, 191 List the prime factors of 513. 3, 19 List the prime factors of 1753. 1753 List the prime factors of 8545. 5, 1709 List the prime factors of 1337. 7, 191 List the prime factors of 2511. 3, 31 What are the prime factors of 1674? 2, 3, 31 What are the prime factors of 1016? 2, 127 List the prime factors of 159. 3, 53 List the prime factors of 2587. 13, 199 What are the prime factors of 164787? 3, 7, 19, 59 List the prime factors of 846. 2, 3, 47 List the prime factors of 2410. 2, 5, 241 What are the prime factors of 2780? 2, 5, 139 What are the prime factors of 260? 2, 5, 13 List the prime factors of 595. 5, 7, 17 What are the prime factors of 50000? 2, 5 What are the prime factors of 2764? 2, 691 List the prime factors of 73407. 3, 24469 What are the prime factors of 742? 2, 7, 53 What are the prime factors of 4907? 7, 701 List the prime factors of 440. 2, 5, 11 What are the prime factors of 3628? 2, 907 List the prime factors of 89987. 29, 107 List the prime factors of 4460. 2, 5, 223 List the prime factors of 88. 2, 11 What are the prime factors of 967? 967 What are the prime factors of 1262? 2, 631 What are the prime factors of 1262? 2, 631 List the prime factors of 4196. 2, 1049 What are the prime factors of 7318? 2, 3659 What are the prime factors of 4257? 3, 11, 43 What are the prime factors of 10915? 5, 37, 59 List the prime factors of 14177. 14177 List the prime factors of 6635. 5, 1327 List the prime factors of 7938. 2, 3, 7 List the prime factors of 27543. 3, 9181 List the prime factors of 119818. 2, 139, 431 What are the prime factors of 304? 2, 19 What are the prime factors of 53267? 53267 What are the prime factors of 2941? 17, 173 What are the prime factors of 5239? 13, 31 List the prime factors of 1357. 23, 59 What are the prime factors of 3294? 2, 3, 61 What are the prime factors of 3517? 3517 List the prime factors of 46001. 157, 293 List the prime factors of 12179. 19, 641 What are the prime factors of 104484? 2, 3, 8707 List the prime factors of 184. 2, 23 What are the prime factors of 36259? 101, 359 List the prime factors of 885. 3, 5, 59 List the prime factors of 4134. 2, 3, 13, 53 What are the prime factors of 1187? 1187 What are the prime factors of 1803? 3, 601 List the prime factors of 39666. 2, 3, 11, 601 What are the prime factors of 1004? 2, 251 List the prime factors of 3319. 3319 List the prime factors of 502. 2, 251 List the prime factors of 19692. 2, 3, 547 List the prime factors of 15219. 3, 19, 89 List the prime factors of 1540. 2, 5, 7, 11 List the prime factors of 1523. 1523 What are the prime factors of 997? 997 What are the prime factors of 5875? 5, 47 What are the prime factors of 12327? 3, 7, 587 What are the prime factors of 9199? 9199 What are the prime factors of 1053? 3, 13 What are the prime factors of 1186? 2, 593 List the prime factors of 627. 3, 11, 19 List the prime factors of 3076. 2, 769 What are the prime factors of 141545? 5, 28309 What are the prime factors of 28545? 3, 5, 11, 173 List the prime factors of 25324. 2, 13, 487 List the prime factors of 8376. 2, 3, 349 List the prime factors of 17547. 3, 5849 List the prime factors of 2593. 2593 What are the prime factors of 19451? 53, 367 List the prime factors of 797. 797 What are the prime factors of 1345? 5, 269 What are the prime factors of 52217? 11, 47, 101 What are the prime factors of 16254? 2, 3, 7, 43 List the prime factors of 3600. 2, 3, 5 What are the prime factors of 5944? 2, 743 List the prime factors of 1101. 3, 367 What are the prime factors of 32284? 2, 7, 1153 List the prime factors of 8431. 8431 List the prime factors of 27809. 27809 What are the prime factors of 16897? 61, 277 What are the prime factors of 7718? 2, 17, 227 What are the prime factors of 1351? 7, 193 List the prime factors of 2530. 2, 5, 11, 23 What are the prime factors of 8181? 3, 101 List the prime factors of 146. 2, 73 List the prime factors of 41. 41 What are the prime factors of 18841? 83, 227 What are the prime factors of 41? 41 List the prime factors of 31830. 2, 3, 5, 1061 What are the prime factors of 5451? 3, 23, 79 List the prime factors of 3460. 2, 5, 173 List the prime factors of 565. 5, 113 What are the prime factors of 59092? 2, 11, 17, 79 What are the prime factors of 328? 2, 41 What are the prime factors of 129071? 337, 383 List the prime factors of 1632. 2, 3, 17 List the prime factors of 1235. 5, 13, 19 List the prime factors of 15353. 13, 1181 What are the prime factors of 65403? 3, 13, 43 List the prime factors of 1259. 1259 What are the prime factors of 86496? 2, 3, 17, 53 What are the prime factors of 588? 2, 3, 7 What are the prime factors of 4213? 11, 383 List the prime factors of 52932. 2, 3, 11, 401 What are the prime factors of 5598? 2, 3, 311 List the prime factors of 1912. 2, 239 List the prime factors of 3761. 3761 List the prime factors of 5039. 5039 What are the prime factors of 110919? 3, 36973 What are the prime factors of 31399? 17, 1847 What are the prime factors of 96538? 2, 13, 47, 79 What are the prime factors of 7382? 2, 3691 What are the prime factors of 22370? 2, 5, 2237 List the prime factors of 19085. 5, 11, 347 List the prime factors of 768. 2, 3 List the prime factors of 6596. 2, 17, 97 What are the prime factors of 20042? 2, 11, 911 List the prime factors of 791. 7, 113 List the prime factors of 792. 2, 3, 11 What are the prime factors of 13374? 2, 3, 743 What are the prime factors of 355? 5, 71 List the prime factors of 41429. 17, 2437 List the prime factors of 46685. 5, 9337 List the prime factors of 1256. 2, 157 What are the prime factors of 1075? 5, 43 List the prime factors of 1049. 1049 List the prime factors of 1599. 3, 13, 41 List the prime factors of 14819. 7, 29, 73 What are the prime factors of 592? 2, 37 What are the prime factors of 65545? 5, 13109 What are the prime factors of 698? 2, 349 List the prime factors of 3407. 3407 What are the prime factors of 5135? 5, 13, 79 List the prime factors of 1285. 5, 257 What are the prime factors of 1645? 5, 7, 47 What are the prime factors of 11682? 2, 3, 11, 59 List the prime factors of 1172. 2, 293 List the prime factors of 76252. 2, 11, 1733 List the prime factors of 60386. 2, 109, 277 List the prime factors of 36978. 2, 3, 6163 List the prime factors of 75686. 2, 13, 41, 71 What are the prime factors of 4051? 4051 List the prime factors of 1665. 3, 5, 37 List the prime factors of 19736. 2, 2467 What are the prime factors of 6160? 2, 5, 7, 11 What are the prime factors of 122282? 2, 61141 What are the prime factors of 10399? 10399 List the prime factors of 992. 2, 31 List the prime factors of 115580. 2, 5, 5779 List the prime factors of 35345. 5, 7069 What are the prime factors of 5677? 7, 811 What are the prime factors of 3354? 2, 3, 13, 43 List the prime factors of 660. 2, 3, 5, 11 List the prime factors of 3429. 3, 127 List the prime factors of 10160. 2, 5, 127 List the prime factors of 27446. 2, 13723 List the prime factors of 1954. 2, 977 What are the prime factors of 364? 2, 7, 13 What are the prime factors of 37064? 2, 41, 113 What are the prime factors of 30632? 2, 7, 547 List the prime factors of 807. 3, 269 List the prime factors of 1242. 2, 3, 23 What are the prime factors of 6872? 2, 859 List the prime factors of 1742. 2, 13, 67 List the prime factors of 2067. 3, 13, 53 What are the prime factors of 999? 3, 37 What are the prime factors of 12796? 2, 7, 457 What are the prime factors of 3310? 2, 5, 331 What are the prime factors of 8306? 2, 4153 What are the prime factors of 1768? 2, 13, 17 List the prime factors of 24296. 2, 3037 List the prime factors of 5991. 3, 1997 What are the prime factors of 1471? 1471 List the prime factors of 2297. 2297 What are the prime factors of 820? 2, 5, 41 What are the prime factors of	{ "pile_set_name": "DM Mathematics" }
4, i: 3}. 6/91 Three letters picked without replacement from {a: 2, p: 3, h: 1, m: 6}. Give prob of sequence mhm. 1/44 Four letters picked without replacement from {t: 2, z: 3, e: 2, l: 9, g: 3, y: 1}. Give prob of sequence zegg. 1/3230 What is prob of sequence oa when two letters picked without replacement from oooaooaoo? 7/36 Four letters picked without replacement from {c: 1, l: 7, k: 1, d: 5}. Give prob of sequence lckd. 5/3432 Two letters picked without replacement from {t: 1, z: 5, b: 2, g: 1, n: 3, w: 8}. What is prob of sequence nw? 6/95 Four letters picked without replacement from mmymmmmymmmmymmmmmy. What is prob of sequence mmmm? 455/1292 What is prob of sequence bpxh when four letters picked without replacement from {h: 1, b: 1, x: 2, c: 1, p: 2}? 1/210 Three letters picked without replacement from {t: 1, h: 1, c: 1, d: 3, v: 1}. Give prob of sequence ddt. 1/35 What is prob of sequence mh when two letters picked without replacement from mmmmmmmmmmmmmmhhmhhh? 15/76 What is prob of sequence qs when two letters picked without replacement from {m: 2, t: 1, s: 5, i: 5, q: 1, g: 2}? 1/48 Three letters picked without replacement from {z: 7, j: 6, r: 1}. What is prob of sequence jzr? 1/52 Three letters picked without replacement from {k: 4, d: 2, h: 1, u: 1}. What is prob of sequence dku? 1/42 Calculate prob of sequence hccl when four letters picked without replacement from qquchhhclcccuccqcm. 7/3060 Two letters picked without replacement from {w: 8, u: 4, d: 2}. What is prob of sequence dw? 8/91 Three letters picked without replacement from {i: 4, s: 10}. What is prob of sequence iii? 1/91 Four letters picked without replacement from {q: 2, c: 1, v: 1, w: 1}. Give prob of sequence qvcw. 1/60 Three letters picked without replacement from bhbbhhnrhhsshrn. Give prob of sequence hbh. 3/91 Calculate prob of sequence vv when two letters picked without replacement from {l: 3, a: 2, h: 2, j: 3, t: 3, v: 1}. 0 What is prob of sequence oooo when four letters picked without replacement from {o: 6}? 1 Two letters picked without replacement from jhyyjhhzhjjzyjyjhj. What is prob of sequence yh? 10/153 Calculate prob of sequence xx when two letters picked without replacement from {c: 2, x: 3}. 3/10 What is prob of sequence yy when two letters picked without replacement from {y: 2, j: 4, e: 2}? 1/28 Four letters picked without replacement from {i: 2, w: 1, m: 2, p: 1, b: 2}. Give prob of sequence ibpb. 1/420 Calculate prob of sequence mrr when three letters picked without replacement from {f: 12, r: 6, m: 1}. 5/969 Calculate prob of sequence gg when two letters picked without replacement from uguuuuuugugu. 1/22 Calculate prob of sequence tr when two letters picked without replacement from rnntntnnrtr. 9/110 What is prob of sequence pmqq when four letters picked without replacement from {p: 6, q: 4, m: 1}? 1/110 Calculate prob of sequence dffd when four letters picked without replacement from ffffdffffffffdffff. 1/153 What is prob of sequence bgf when three letters picked without replacement from cgihgiccbbcbccfbc? 1/510 What is prob of sequence ayam when four letters picked without replacement from {y: 4, a: 8, m: 2}? 8/429 What is prob of sequence ze when two letters picked without replacement from {e: 2, o: 4, z: 4}? 4/45 What is prob of sequence sskk when four letters picked without replacement from {s: 2, k: 2}? 1/6 Three letters picked without replacement from {l: 1, u: 2}. What is prob of sequence uul? 1/3 Three letters picked without replacement from ddfpnfpnddff. What is prob of sequence pdd? 1/55 Two letters picked without replacement from qbqqbqqqbqqqqqqq. What is prob of sequence bq? 13/80 Three letters picked without replacement from {t: 3}. What is prob of sequence ttt? 1 Two letters picked without replacement from {w: 1, g: 2}. Give prob of sequence wg. 1/3 What is prob of sequence nm when two letters picked without replacement from mxnnnxnxnmnnx? 7/78 Calculate prob of sequence gp when two letters picked without replacement from {p: 4, g: 16}. 16/95 Three letters picked without replacement from kkmmmkmckmmcc. Give prob of sequence cck. 2/143 What is prob of sequence eed when three letters picked without replacement from ddxxxxddxxxdxdxxxeed? 7/3420 Calculate prob of sequence acrt when four letters picked without replacement from ttrazazzztrctt. 5/6006 Two letters picked without replacement from paaayozeapapeazaa. Give prob of sequence py. 3/272 Four letters picked without replacement from qeqyq. Give prob of sequence yeqq. 1/20 Calculate prob of sequence lx when two letters picked without replacement from eppexxelxxnpeexlxe. 2/51 Three letters picked without replacement from rceqrvz. What is prob of sequence rzc? 1/105 Four letters picked without replacement from {j: 2, f: 5, w: 2}. Give prob of sequence wjjf. 5/756 Two letters picked without replacement from whmmpwflfhmf. Give prob of sequence wl. 1/66 What is prob of sequence vzzz when four letters picked without replacement from vzzzzv? 2/15 What is prob of sequence pjpp when four letters picked without replacement from {j: 3, p: 13}? 33/280 Two letters picked without replacement from dfddgfdgggffgg. Give prob of sequence ff. 6/91 Calculate prob of sequence lqvr when four letters picked without replacement from qlqrvr. 1/90 Two letters picked without replacement from ababqblxxaqa. Give prob of sequence al. 1/33 Three letters picked without replacement from dndalxnnaad. Give prob of sequence ndx. 1/110 Calculate prob of sequence ei when two letters picked without replacement from hnininiehhnhinghhngh. 1/95 Four letters picked without replacement from {h: 1, v: 1, f: 2}. What is prob of sequence ffvv? 0 Three letters picked without replacement from rxxjjaxjrj. What is prob of sequence rrr? 0 Three letters picked without replacement from {a: 3, h: 3, m: 2}. What is prob of sequence mhm? 1/56 Calculate prob of sequence dpd when three letters picked without replacement from pppdpdpppppp. 1/66 Four letters picked without replacement from qqcqqcqqqiqiqq. What is prob of sequence iiqc? 5/3003 Three letters picked without replacement from {i: 2, z: 10, o: 6}. Give prob of sequence zoo. 25/408 Calculate prob of sequence fz when two letters picked without replacement from vqvqxvufzxvvx. 1/156 What is prob of sequence qssq when four letters picked without replacement from {s: 3, q: 13}? 3/140 Calculate prob of sequence zz when two letters picked without replacement from {z: 2, m: 2, q: 1}. 1/10 Three letters picked without replacement from {q: 1, t: 1, v: 1, a: 2, g: 1, j: 1}. Give prob of sequence gta. 1/105 What is prob of sequence ff when two letters picked without replacement from {f: 2, g: 2, m: 9}? 1/78 Two letters picked without replacement from {g: 3, w: 3, k: 1, n: 2, a: 1}. Give prob of sequence nw. 1/15 Three letters picked without replacement from xswxaxxzwxxexsesxxx. What is prob of sequence zxs? 5/969 Calculate prob of sequence sgt when three letters picked without replacement from {g: 6, n: 2, s: 1, e: 3, t: 3}. 3/455 What is prob of sequence cc when two letters picked without replacement from {c: 7}? 1 Two letters picked without replacement from {o: 4, x: 5, r: 10}. Give prob of sequence ox. 10/171 Two letters picked without replacement from vssssyhsv. Give prob of sequence hy. 1/72 Calculate prob of sequence pq when two letters picked without replacement from {p: 1, s: 4, f: 3, q: 2, t: 7, u: 1}. 1/153 Four letters picked without replacement from {r: 2, t: 1, q: 8, h: 7, n: 2}. Give prob of sequence nhqh. 28/4845 What is prob of sequence dr when two letters picked without replacement from {s: 12, r: 1, d: 3}? 1/80 What is prob of sequence fyf when three letters picked without replacement from {s: 2, y: 1, u: 1, l: 1, f: 4}? 1/42 Calculate prob of sequence ocoo when four letters picked without replacement from {o: 6, c: 12}. 1/51 Calculate prob of sequence kkw when three letters picked without replacement from whhkwkrhhhrhhkwkhhhw. 2/285 Two letters picked without replacement from {o: 14, y: 1, e: 2}. Give prob of sequence ey. 1/136 Two letters picked without replacement from llllkvlvlkvlmlvav. What is prob of sequence av? 5/272 Calculate prob of sequence pcp when three letters	{ "pile_set_name": "DM Mathematics" }
0.32. Let k be -2(1 + -2 + 2). Which is the nearest to k? (a) j (b) l (c) 1 b Let p(b) = -b + 7. Let v be p(6). Let o = 3.761 + -0.261. Let q = o + -3. What is the closest to 0.04 in v, q, -4? q Let h = 0.1532 + 0.0468. What is the closest to h in 1/2, -0.4, -0.037? -0.037 Let g be 0/(4 - 0)273/(-546). Which is the closest to -0.1? (a) -4 (b) g (c) 6 (d) -30.7 b Let r(t) = 2t2 - 100t + 1108. Let w be r(46). Which is the closest to 0? (a) w (b) 2/7 (c) -0.2 c Let i = 25 - 20. Let q = 11 - 11.283. Let y = q + -0.017. Which is the nearest to y? (a) 1/4 (b) i (c) -1/6 c Let k(q) = -18q - 94. Let p be k(-5). Let c be ((-3)/4)/((-1)/(-12)). Let o be c/(-6)8/18. What is the closest to 2/11 in 0.2, o, p? 0.2 Let z = -634 + 619. Suppose 5q - 3c - 11 = 0, 8c = -q + 3c - 9. Let u be (-18)/(-27) - q/(-3). What is the nearest to u in -1/4, z, 2/11? 2/11 Let v be (-20)/70 + 360/35. Let k = -6 + 10. Which is the nearest to -0.4? (a) k (b) v (c) -1/7 c Suppose -7z = -4h - 9z + 210, -4h - 3z = -211. Let w be -6 - -1h/9. Which is the nearest to 4? (a) w (b) -4 (c) -6 a Let l = -0.2 + -244.8. Let o = l - -255. Which is the nearest to o? (a) 2 (b) 2/7 (c) 4 c Let m = 7 + -6. Let u = -89.8 + -1.2. Let v = -91.3 - u. What is the closest to m in v, -5, 3? v Let n = -8941827/575 + 15551. Which is the nearest to -0.2? (a) 4 (b) n (c) -0.1 c Let n = 84.95 + -82.95. What is the closest to 1 in -1, n, -0.035, -7? n Let h = 13864 - 13866. What is the closest to 3 in 1.2, -3/4, 3/2, h? 3/2 Let g = 2253 + -2252. Let q = 23/154 + 3/22. What is the nearest to g in -2/11, -11, q? q Let q = -64 - -76. Suppose q = 3v + 2c, -5v - c + 26 = 6. What is the closest to 0.1 in -2/15, v, 10? -2/15 Let o = -4829 + 4829. What is the nearest to 1/7 in -0.04, -0.5, -0.3, o? o Let j = 1.4 - 0.4. Let s = -49/264 + 2/33. Which is the nearest to 0.1? (a) -4 (b) j (c) s c Let v = 5062 - 5062. What is the nearest to -1/3 in v, -0.3, 0.3, 7? -0.3 Suppose 7h + 18 = -3. Let j be ((-20 + 21)/((-1)/2))/1. Which is the nearest to 2? (a) h (b) -1/8 (c) j (d) -0.4 b Suppose 3p + 2p - 10 = 0. Let w = -187 + 192. Let n be (-6)/10 - 442/(-85) - w. Which is the nearest to 3? (a) 3 (b) n (c) p a Let l = 97 + -195/2. Which is the closest to l? (a) -1/2 (b) -1 (c) 10 (d) 0.2 a Let t be (-2)/(-20)(8/2 + -8 - 4). Which is the closest to t? (a) 3 (b) 0.6 (c) -2/63 c Let n = 1264.64 - 1264.94. Let p = 4 + -6. Which is the closest to p? (a) n (b) 3/2 (c) 0.3 a Let h = 0.9 + -0.8. Let v be (-11 - 0 - -1)-310/(-20). Which is the nearest to 0.1? (a) v (b) -0.1 (c) h c Let s = 0.8353 + -0.6353. What is the nearest to 3.8 in -21, s, -4? s Suppose o - 770 = -4x - 4o, -2o + 574 = 3x. Suppose -xg = -184g. Which is the closest to -1/4? (a) -3/4 (b) g (c) -0.3 c Let t = -2561061 - -1887502491/737. Let o = 12/67 - t. Let x = 559/1960 + 1/1960. Which is the nearest to x? (a) o (b) -2/3 (c) 4 a Suppose -33l - l - 10132 = 0. Let g = -298 - l. Suppose 0 = -m + 1, -4o + 5m - 2 = 3. Which is the closest to g? (a) 3/7 (b) o (c) -5 b Let l = 266.74 - 270. Let m = l + -1.74. Let s(u) = u*2 + u - 1. Let h be s(3). Which is the nearest to 0? (a) h (b) -1/7 (c) m b Let k = -1004 - -865. Let v = -141.47 - -0.47. Let r = v - k. What is the nearest to -1/2 in 0.09, 5, r? 0.09 Let g = 28.7 - -8.3. Let a = -37 + g. Let l = 0.01 + -3.01. What is the nearest to 2/9 in a, -4, l? a Let g = -6.236 + 6.266. Which is the nearest to 1/2? (a) g (b) -0.4 (c) -37 a Suppose -57n = -390 + 162. Which is the nearest to 1/4? (a) 4/3 (b) n (c) -4 (d) 403 a Let d = 17 - 16.6. Let j = -0.7856 - 0.2144. Which is the nearest to 2/3? (a) j (b) 4 (c) d c Let q be -5 + (0 - 0)/(-2). Let k(l) = l*2 + 40l - 11482. Let c be k(-129). What is the closest to -1/44 in q, 3, c, 2/7? 2/7 Let s be 0 + 0 + 0 + 18/81. Which is the closest to s? (a) 0.1 (b) -0.2 (c) -7 (d) -8 a Let z = 56031/22 + -2547. Which is the nearest to -1/5? (a) 0.5 (b) -11 (c) z c Let w(z) = z*3 + 5z*2 + z + 7. Let h be w(-5). Let p = -103.7 + 104. Suppose 4o + y = -8, 31 = -5y + 11. Which is the closest to o? (a) p (b) -3 (c) h a Let j = 1.885 + -2.085. What is the closest to 0 in j, 6, -2, 8/7? j Let q(t) = 2t*3 - 2t*2 + 3t - 5. Let g be q(2). Suppose -gr + 4 = 4. Let b = -2/249 + -484/1743. What is the nearest to r in 2, 0.3, b? b Let w = 0.1 + -0.1. Let d = -391 - -433.9. Let l = 43 - d. What is the nearest to w in -3/5, 2, l? l Suppose 2t + 15 = -t. Let q = -0.7113 + 0.4113. What is the closest to 0 in -0.03, 1/4, t, q? -0.03 Let x = 11.564 + -9.364. What is the nearest to 0.2 in 0.3, x, -0.1, -9? 0.3 Let y = -2915 + 2819.2. Which is the closest to -0.1? (a) y (b) -2 (c) 1/2 c Let w = 0.1 - 0.2. Let l = 1443/4 + -212353/588. Let m = 3/49 + l. What is the closest to w in -3/7, m, 0.6? m Let r = 587.02 + -587. Which is the nearest to -1? (a) 4 (b) r (c) 1/3 (d) 0 d Let y = -28987 + 28986. Let v = 17 - 3. Let k be 4/v - (-264)/(-630). What is the closest to y in -5/17, 3, k? -5/17 Let d = -170889 - -170887. Let q(r) = r*3 - 6r*2 + 5r - 8. Let o be q(6). Which is the closest to -0.1? (a) o (b) 5 (c) d c Suppose -8 = -4t - 2x, -2t + 6t - 3x - 8 = 0. Let z = -28.9 + 65.5. Let m = -38.6 + z. Which is the closest to -2? (a) 0.5 (b) t (c) m c Let f be 17 + -16 + 8/(-10). What is the nearest to 1/3 in 9, f, 0.3? 0.3 Let x = 0.162 - 11.362. Let t = x + 11.1. Which is the nearest to t? (a) 5 (b) 2 (c) 1/5 c Let i = -22798/7 + 3257. What is the closest to -1 in -3, -1/5, i, 0.4? -1/5 Let s = -2279 - -2183. What is the closest to -0.2 in -2/15, s, 4/7? -2/15 Let d = -25562 + 25527. Which is the closest to 2/3? (a) -4/9 (b) d (c) 0 c Let q = 3.35 - 170.35. Let g = -166.5 - q. What is the nearest to 0.5 in g, 1/4, 3? g Let q = -7286 - -65575/9. Let c = 0 - -0.1. What is the nearest to c in q, 2/5, -0.4? q Let s = 246 - 147. Let z = s - 99.1. Let o = 230 - 3448/15. What is the closest to z in -1, o, 1/2? o Let j = -1175 + 1178. Let n be ((-19)/(-285))/((-1)/(-2)). Which is the closest to 2? (a) n (b) -2 (c) j c Let x = 287 + 342. Suppose 624a + 5 = xa. What is the nearest to a in -12, 1, 5? 1 Suppose 4y + 4f - 797 = 7y, f = -5y - 1290. Let h = 6.28 - 6.08. Which is the closest to y? (a) 4 (b) -2 (c) h (d) 1 b Let x = 1235 + -1245. Let m = -165 + 161. Which is the nearest to -2/5? (a) 0.2 (b) m (c) -5 (d) x a Let f = -0.1 + 4.1. Suppose -5i = i + 156. Let v be 3/12(3 + i/6). Which is the nearest to v? (a) 2/3 (b) f (c) 0 c Let v = 125 - 210. Let z = v - -28. Let g = z - -66. Which is the closest to -1/2? (a) g (b) -0.3 (c) -3/4 b Let p(v) = -v2 + 3. Let c be p(0). Suppose -3q - 12 = 0, -cm - 36 = m + 4q. Let u = -11175 - -11174. What is the nearest to u in -0.5, 1, m? -0.5 Let l = 38 - 37.8. Let w be (-21)/42 + (-305)/190 + 2. Which is the nearest to -2? (a) -0.2 (b) w (c) l (d) 2 a Let i = -306 + 304.21. Let r = 1.39 + i. What is the nearest to -2 in r, -0.3, 3? r Let w be 12(-4)/2. Let r be ((-9)/(-6))/(-2 + (-213)/(-102)). Let h be (8/12)/(r/51). Which is the nearest to 0.1? (a) w (b) h (c) 0 c Let i = -2.47 + -20.93. Let b = -24.1 - i. What is the closest to -1 in 0.1, 0.3, b? b Let v = 164283 - 164283.1. Suppose 7k = 2k - 340. Let w = 206/3 + k. What is the nearest to v in 0.1, 0, w? 0 Let j = 3230.6 + -3231. Let h be ((-6)/(-14))/(8/(-14)). Let y = -1 - -3. Which is the closest to y? (a) h (b) -2/9 (c) j b Let k = -14.1 - -14.4. Let j = -17 + 20. Let t = 413 - 403. Which is the nearest to 2? (a) t (b) k (c) j c Let r = 65/357 + 18/119. What is the closest to 0.08 in r, -6, -0.1? -0.1 Let g = -389.9 - -393.9. Which is the closest to 86? (a) -3 (b) 0.5 (c) g (d) 0.4 c Suppose -184q = -198q - 14. Which is the closest to 0.1? (a) -1/3 (b) -15 (c) q (d) -7 a Let k be 4/(-16) - (121/220)/(-11). Which is the nearest to -2/11? (a) k (b) -2/19 (c) 2 a Let x = 6407 - 6402. What is the nearest to 0.1 in 2, -4, x, 10/13? 10/13 Let i = -17147 - -68591/4. Which is the closest to -1/21? (a) -0.5 (b) -5 (c) -6 (d) i a Suppose -2n + 2 = -3w + 23, 5w = 4n + 37. Let u = 2.4529 + -1.4529. Which is the	{ "pile_set_name": "DM Mathematics" }
29 Let i = 2 + -1.9572. Let t = -0.0427427 + i. Round t to 5 dps. 0.00006 Let i = -0.694 + -226.306. Let r = i + 222.49. What is r rounded to 0 decimal places? -5 Let g = 12.2397 - 1.9602. Let s = -2.3 - 8. Let f = g + s. What is f rounded to 2 dps? -0.02 Let h = -5666 + 5661.1923. What is h rounded to one dp? -4.8 Let f(t) = 823t2 + 6t - 5. Let k be f(-5). Suppose 4a - 4u - 64 = 0, 3a + 2u = a + 24. Suppose aw - k = -101740. Round w to the nearest one thousand. -6000 Let t(h) = h + 5. Let o be t(12). Let m(f) = -f3 + 17f*2 - 7f + 50. Let w be m(o). What is w rounded to the nearest one hundred? -100 Let y = -34.934 + -0.066. Let r = 34.993 + y. Let h = -0.0069704 - r. Round h to five dps. 0.00003 Let f = 456694.332911 + -456930.967. Let m = 234.564 + f. Let u = 2.07 + m. Round u to five decimal places. -0.00009 Let f = -678.82 - -676. Let o = -0.23715 - 2.582963. Let w = f - o. Round w to 5 decimal places. 0.00011 Let c = -10502 + 10505. Let f = 131659632 - 65059632. Suppose 0 = ck + 6k + f. What is k rounded to the nearest 1000000? -7000000 Let v = 3663.25564 - 3663. What is v rounded to one dp? 0.3 Let c(i) = 2i + 50. Let n be c(-23). Suppose 0 = -nj + 1285819 + 638181. Round j to the nearest 100000. 500000 Let y = 4817 + 15519. Suppose 0 = -28o - 32528 - y. Round o to the nearest 100. -1900 Let l = -56202.51 - -55964. Let b = 32.2 - 274.2. Let k = l - b. What is k rounded to the nearest integer? 3 Let y = -323 + 323.0411. Let w = y + -0.02855. What is w rounded to three dps? 0.013 Suppose -s - 6 = s, d + 2748 = -5s. Suppose -2i + 102322 = -3u, -u = -6i + 2i + 204664. Let m = d - i. What is m rounded to the nearest 10000? -50000 Let i = -1913 - -1931.87. Let q = i + 151.93. Let r = q + -148. What is r rounded to the nearest integer? 23 Let g = -33.031 + 11.779. Round g to one decimal place. -21.3 Suppose -84334 = -4v + 4602. Let j = 12224 - v. Round j to the nearest 1000. -10000 Let s(f) = 5f - 2. Let h be s(0). Let v be 36/(-15)(h - (-3127 + 0)). Round v to the nearest one thousand. -8000 Let n = -19278 + 19315.324. What is n rounded to the nearest ten? 40 Let o = 27386.9707 - 27385. Let y = o - -0.0443. What is y rounded to 1 decimal place? 2 Let h be -6 - 748/(-121) - (-8032212)/(-66). Round h to the nearest 100000. -100000 Let p = -82 + 17. Let v = -60 - p. Suppose vi + 414 = 7i. Round i to the nearest ten. 210 Suppose -4z = 69785513 + 39489595. Let g = -18488777 - z. Round g to the nearest 1000000. 9000000 Let d = 334806 + -931309. Let t be (-102)/17(-1 + d/(-3)). Round t to the nearest 100000. -1200000 Suppose 0 = -161f - 2243532 - 1752488. What is f rounded to the nearest 10000? -20000 Let o = -1667.33 + 1660. Let b = o - -23. Round b to 0 decimal places. 16 Let f = -2560229319905923.99999951 - -2560229499823816. Let i = f + -179917894. Let q = 2 + i. Round q to seven decimal places. 0.0000005 Let a(y) = -y*2 - 9y - 11. Let k be a(-2). Suppose 10u = 5u - 2q - 391990, 0 = -4u + kq - 313615. What is u rounded to the nearest 1000? -78000 Suppose 9g - 47g + 2597110 = 0. Let n be 52/14 - 6/(-21). Suppose nu - g = -1248345. What is u rounded to the nearest one hundred thousand? -300000 Suppose 137u = b + 142u + 1840, -15 = 3u. What is b rounded to the nearest one thousand? -2000 Let x = 55.4 + 6.6. Let m = -97 + x. Let h = -35.087 - m. Round h to two dps. -0.09 Let x = -182 + -126. Let z = x - -309.985. Let c = z - 2. What is c rounded to 2 decimal places? -0.02 Let c = 104265797.000328 - 104265423. Let n = c + -374. Round n to 5 dps. 0.00033 Let h = 325611690.0000309 + -325611705. Let d = 1521 - 1536. Let u = h - d. Round u to 6 dps. 0.000031 Let c = -103.6 + 176.5. Let i = c - 72.9000371. What is i rounded to five dps? -0.00004 Let t = -0.13033 - -116.19033. Let j = 7.66 - t. Round j to zero dps. -108 Let w = 2434 + -2392.24. Let o = 41 - w. Let f = o - -0.7600114. Round f to 6 dps. 0.000011 Let a = -52648840297661289.99999933 + 52648837204244424. Let i = a + 3093416701. Let q = 165 + i. What is q rounded to seven dps? 0.0000007 Let f = 181.85 - 185. Let w = 3.149999956 + f. What is w rounded to 7 decimal places? 0 Let a = -9438.91196 - -9439. Round a to 3 decimal places. 0.088 Let h = 21.776 + 0.344. Let x = -33 + h. What is x rounded to the nearest integer? -11 Let a(c) = 457499c*2 - 9c + 22. Suppose 34m - 29 = 39. Let d be a(m). What is d rounded to the nearest one hundred thousand? 1800000 Let t = 7331 + -7330.9999989555. What is t rounded to seven decimal places? 0.000001 Let i = 12037 - 11790.4. What is i rounded to the nearest ten? 250 Suppose 0 = -5z + 9z - 5u + 13986, 4u = z + 3502. What is z rounded to the nearest one hundred? -3500 Let c(z) = z + 14. Let t be c(-13). Let m be (t/2 - 1)-10. Suppose -30334003 - 61665997 = -mu. What is u rounded to the nearest one million? 18000000 Suppose 10 = -3w - 5. Let i(l) = 20l2 - 2l - 4. Let u be i(w). What is u rounded to the nearest one hundred? 500 Let l = -451.9392 + -0.0608. Let y = -452.694 - l. Round y to 1 dp. -0.7 Let a = 6.76 - 0.26. Let x = 3.37 - a. What is x rounded to 1 decimal place? -3.1 Let j = 0.0213 + 3.1987. Let a = j + -3.22458. What is a rounded to four dps? -0.0046 Let h = -1.3 - -4.8. Let m = -3.454 + h. Let y = m + 4.354. Round y to zero decimal places. 4 Let y(s) = -s*3 + 6s*2 + 18s - 11. Let h be y(8). Suppose -n = 5, -hn = 4b - 3843 + 392. Let q = b + -204. Round q to the nearest one hundred. 700 Let h = 0.108316004 - 0.1083. What is h rounded to 7 dps? 0.000016 Let n = 0.1208352 - 0.0077775. Let o = n - 0.113. What is o rounded to five decimal places? 0.00006 Suppose -2l + 3l = 466096. Suppose -i = 3h - 9068404, -h - l + 3488880 = -4i. Let v = h + 377200. What is v rounded to the nearest 1000000? 3000000 Let v = -809.5902197 - 249.409678. Let c = v + 1059. What is c rounded to five decimal places? 0.0001 Let g(b) = -14b - 81. Suppose -a + 48 = 9o - 4o, -2o = 5a - 10. Let k be g(o). Round k to the nearest 100. -200 Suppose -2v + z + 10 = 0, 0 = -5v - z - z + 16. Suppose 0 = -15p + 11p - 12, -vw - 46086 = 2p. What is w rounded to the nearest one thousand? -12000 Let w be -2 - 213/(-21) - 25/175. Let q be ((-4)/w)/(4/353600). Round q to the nearest 10000. -40000 Let p = -0.06244 - 1.28616. Round p to 2 dps. -1.35 Let s = 1055647.666529777 + -26703.076030887. Let o = 1029013.5905 - s. Let d = o + -69. What is d rounded to 7 dps? 0.0000011 Let u = 17612.8675 - 17614. Round u to 1 decimal place. -1.1 Let v = 114.679986006 - 114.68. Round v to 6 dps. -0.000014 Let h = -0.19 - -0.236. Let m = -6950.9 + 6950.853897. Let y = m + h. Round y to 5 decimal places. -0.0001 Let s = 16554 - 16506.716. What is s rounded to the nearest integer? 47 Let x = 2921381 + -7143481. What is x rounded to the nearest one million? -4000000 Let k = 148.21 - 140.6519. Let h = -834 - -841.5. Let o = k - h. Round o to three decimal places. 0.058 Let l be 1/(-4) + (-34)/(-8). Suppose 0 = lr + r - 10. Let x be r/1 - (10 - -899992). Round x to the nearest one million. -1000000 Let t = 433 + -253. Let j = 2148468 - 2148647.9917. Let n = j + t. What is n rounded to three decimal places? 0.008 Let j(f) = 9125f3. Let n(w) = 5w + 2. Let b be n(0). Let c be j(b). Round c to the nearest 10000. 70000 Let b = 176.98 + 1374.82. Round b to the nearest 100. 1600 Suppose -50505430 = -42l + 140636570. Round l to the nearest 1000000. 5000000 Let h = -86 + -385. Let v = -470.9999569 - h. What is v rounded to six decimal places? 0.000043 Let u = 130 - 108. Let l(i) = 1290i - 42 + 549i + 572i + 0. Let c be l(u). What is c rounded to the nearest 10000? 50000 Let n = 13585 + 192900. Let v(y) = -ny - 1003511y - 2 - 10. Let a be v(3). Round a to the nearest 1000000. -4000000 Let q be (8/(-100)-5)/(3/15). Suppose 93000 = v + y, -qv = -3y + 116587 - 302587. What is v rounded to the nearest one hundred thousand? 100000 Let t = 45 - 47.98. Let s = t - -1.69. Let f = s - -1.2900312. Round f to five dps. 0.00003 Let r = 74.458708011234 + 0.076745970766. Let d = r - -0.464549738. Let w = -75 + d. What is w rounded to 6 dps? 0.000004 Suppose -4c + 55 = 127. Let i be 40/(-180) + (-6844)/c. What is i rounded to the nearest one th	{ "pile_set_name": "DM Mathematics" }
8.03. 0.2409 What is 0.001 times 190? 0.19 0.97 times -0.3 -0.291 -3 * 0.0051 -0.0153 What is -53 times -0.05? 2.65 -9 * 258 -2322 What is -9.4 times -2.1? 19.74 Product of -14 and 15. -210 Calculate 1.8-4. -7.2 0.1233 23.3 Work out -523 * 1. -523 Product of -1 and 17.05. -17.05 Multiply -130 and -0.1. 13 5 * 0.94 4.7 Multiply 0.775 and 3. 2.325 0.21686 times -0.5 -0.10843 -12.872 * 4 -51.488 Calculate 0.49-0.5. -0.245 What is the product of -0.4 and -3.1? 1.24 Work out 1168 -0.3. -350.4 Product of 0.5 and 0. 0 741-6 -4446 -3123 -936 215 times 5 1075 227 154 6-6 -36 Work out 1.8 * -11. -19.8 0.03 times 270 8.1 Multiply 0.01 and -420. -4.2 What is 0.7 times -38? -26.6 What is -3 times -252? 756 3682 736 What is the product of -0.3 and 1458? -437.4 -43.34-0.2 8.668 What is -113.06 times -0.4? 45.224 121.25 times -2 -242.5 13451 1345 Work out 141 -0.42. -59.22 What is -0.78 times -0.3? 0.234 7197 times 0.5 3598.5 5.5 times -0.42 -2.31 -1190.3 -35.7 18 times -3.13 -56.34 What is the product of -0.3 and -75? 22.5 Work out 0.3 2.32. 0.696 What is 73 times 2? 146 What is 0.17 times -336? -57.12 Calculate -0.066. -0.36 9 0.28 2.52 Multiply -0.051 and -0.28. 0.01428 Calculate -0.4337. -15.91 -705.4 0.1 -70.54 Multiply -77 and 5. -385 Product of 19 and 0.037. 0.703 Work out -1.65 * 0.1. -0.165 Multiply 17 and -73. -1241 What is the product of -1505 and 4? -6020 Work out -5194 * 0.4. -2077.6 Multiply -756 and -2. 1512 Product of 16755 and 2. 33510 What is 925 times -0.2? -185 Product of 1.56 and 0.19. 0.2964 Product of 1 and -0.131. -0.131 Calculate 26.40.3. 7.92 Product of -33 and 7. -231 What is the product of -0.4 and -0.326? 0.1304 Product of -4 and 714. -2856 What is -41 times 5? -205 Multiply 28 and 42. 1176 38 0.03 1.14 What is -6 times -82? 492 -0.67 * -2.2 1.474 -1.7-16 27.2 What is the product of 12.9 and 0.01? 0.129 Work out 0.109 0.3. 0.0327 Calculate -21100.03. -63.3 Product of -10683 and 4. -42732 What is the product of 0.81 and 0.5? 0.405 What is -0.3 times -33? 9.9 What is -67 times 0.32? -21.44 Product of 18 and -0.08. -1.44 Calculate -0.021755. -0.10875 What is 5 times 1.15? 5.75 Work out 41 * 0. 0 Calculate 7.48. 59.2 0.2-4.91 -0.982 What is 86 times -0.1? -8.6 What is the product of 0.7 and -0.144? -0.1008 Calculate -1.241. -49.2 What is the product of -18.3 and 9? -164.7 Product of -146 and -24. 3504 What is the product of 1.5 and -0.03? -0.045 What is 2 times 8? 16 Product of 21 and -3. -63 -3-14 42 What is -131 times -5? 655 Multiply -2 and -80. 160 0.91-40 -36.4 What is the product of -0.1 and -7.4? 0.74 Multiply -0.0219 and 69. -1.5111 -4001.6 -640 -0.828 * 17 -14.076 Calculate -0.4151.8. -60.72 982 4 3928 0.5303 151.5 Multiply -879 and 0.1. -87.9 Product of -2397 and 0.2. -479.4 Product of -1895 and -5. 9475 113.07 33.77 What is -0.4 times 38? -15.2 What is the product of -747 and 0.3? -224.1 0.51 times -45.1 -23.001 -0.3 times 6629 -1988.7 Work out -0.4 * 46. -18.4 Calculate 209-0.1. -20.9 What is the product of 28 and -4? -112 Calculate -0.50.172. -0.086 Product of -0.5 and -1.04. 0.52 Calculate 0.1380.15. 0.0207 -1.85 -1 1.85 What is the product of 0 and -3? 0 Product of 4.9 and 3.7. 18.13 Work out -225 * 0.2. -45 -1 * 3606 -3606 Multiply 0.46 and 0.4. 0.184 What is the product of -3 and 14.6? -43.8 Calculate -0.0610. -0.6 Multiply -0.035 and -8. 0.28 Product of -732 and 5. -3660 0.0582 times 0.3 0.01746 What is 1.95 times 0.057? 0.11115 Work out 91.7 -12. -1100.4 Work out 0.6832 * 0.2. 0.13664 What is the product of -14 and -425? 5950 Calculate -0.1672. -67.2 What is the product of -64 and -4? 256 Calculate -2.83290.5. -1.41645 What is -0.1 times 5? -0.5 What is the product of -2.373 and 4? -9.492 5220.4 208.8 Calculate -242.5. -60 0.5 times -0.051 -0.0255 -0.06 * -12 0.72 2 * 15.6 31.2 16 times 0.33 5.28 Product of -14 and -7. 98 1.0040.3 0.3012 3821 0.3 1146.3 What is the product of 2 and -1.5? -3 0.0747 * 9 0.6723 0.0591 * 5 0.2955 5 * -1.96 -9.8 -0.2 * 113 -22.6 -0.3 times -0.7224 0.21672 What is the product of -61 and 0.1? -6.1 Calculate -5700.4. -228 -0.06 -3.3 0.198 Calculate -26-0.114. 2.964 What is the product of 554 and 11? 6094 Product of 1.06 and 0.6. 0.636 -0.0019 5 -0.0095 What is the product of 33 and 95? 3135 -0.2 * -2.26 0.452 What is the product of 1 and 5? 5 Multiply 428 and -10. -4280 What is 936 times -0.2? -187.2 Work out -2 * 0.0037. -0.0074 Multiply -0.7 and -1.7. 1.19 What is the product of -42.26 and -0.5? 21.13 What is -75.16 times 0.3? -22.548 Work out -403 * -0.4. 161.2 Work out -12.8 * -1. 12.8 -0.24 times -23 5.52 Multiply 446.8 and -4. -1787.2 0.3-26 -7.8 What is 5 times -0.096? -0.48 What is 0.34 times 0.15? 0.051 Product of 0.4 and -11. -4.4 -34 0.4 -13.6 Multiply 8 and 12.4. 99.2 0.05 * -0.16 -0.008 0640 0 -16.5 2 -33 Multiply 0.5 and 38.9. 19.45 -3 times 1.275 -3.825 Multiply 2 and 16. 32 Calculate -8480-0.2. 1696 What is 0.3 times 7? 2.1 -0.019-5 0.095 Multiply 0 and -0.0093. 0 Work out -4 * -1450. 5800 -2.61.1 -2.86 Multiply 193.3 and 4. 773.2 Multiply 108.2 and 3. 324.6 Product of 1.27 and 6. 7.62 Work out 0.14 -0.4. -0.056 What is 1 times -0.222? -0.222 What is 0 times -395? 0 Multiply 17.7 and 4. 70.8 Multiply 0.116 and 4. 0.464 What is 0.9 times -0.017? -0.0153 0.0574 times -1 -0.0574 Product of 0.05 and -322. -16.1 What is 0.0321 times -2? -0.0642 Multiply -0.1 and 2297. -229.7 68 * -6 -408 23.9 times 0.2 4.78 -266 * 1 -266 What is the product of 4 and -5139? -20556 0.057 * -29 -1.653 -0.0356 * -5 0.178 Multiply 0.1 and 1339. 133.9 What is the product of -80 and 0.2? -16 -60 times -0.3 18 Work out -0.1 * -10.26. 1.026 -0.04 * 0.1 -0.004 Product of -0.095 and 100. -9.5 What is 9.59 times 0.5? 4.795 Calculate 310.1. 3.1 What is 3 times -27? -81 What is the product of -2.5 and -0.2? 0.5 -824.1 -336.2 Calculate 2.831. 86.8 -47 28 -1316 Calculate -0.0740.2. -0.0148 What is the product of -1.7 and -0.101? 0.1717 What is the product of 2 and 104.9? 209.8 -750 times 0.5 -375 Multiply -2 and -0.76. 1.52 -0.034-2 0.068 Calculate -139. -39 Multiply 0 and 111.2. 0 Calculate 17-4.4. -74.8 Work out 0.4 * -0.2. -0.08 What is the product of -90 and 1.3? -117 Multiply -3 and 0.389. -1.167 What is the product of 110 and -0.3? -33 What is the product of -236 and -0.5? 118 Multiply -5 and -0.62. 3.1 0.21-0.5 -0.105 Multiply -0.4 and -0.07. 0.028 What is the product of 3.3 and 381? 1257.3 Product of 3.84 and -0.4. -1.536 Product of 1.66 and 1. 1.66 Calculate -20.0135. -0.027 -668 * -1.3 868.4 Multiply 3 and 155. 465 Calculate 0.40.1. 0.04 Multiply -485.8 and 2. -971.6 -0.111.75 -0.1925 What is 0.4 times 0.1655? 0.0662 What is the product of -11 and 116? -1276 Calculate 3.53. 10.5 What is the product of -0.035 and 0.0087? -0.0003045 Product of -7 and 9.2. -64.4 Work out -4 -276. 1104 Multiply -0.1 and -0.34. 0.034 What is the product of -20.8 and -1.2? 24.96 -5-2358 11790 0.4 -0.059 -0.0236 -21 times -0.02 0.42 What is -232.8 times -5? 1164 -0.04 times -1119 44.76 -0.680.08 -0.0544 -0.26 -0.5 0.13 What is the product of -5 and 127? -635 11115 1115 -3 times -834 2502 Work out 2 -2241. -4482 -0.114 times 5 -0.57 What is the product of -13440 and 3? -40320 -0.54 * 0.4 -0.216 Work out 0.02477 * 0. 0 What is -0.019 times 0.09? -0.00171 Product of -0.07921 and -5. 0.39605 -0.3873 -1.161 Multiply -0.205 and 0.6. -0.123 Product of -860 and -0.1. 86 Work out 0.12 16. 1.92 What is -238 times -0.1? 23.8 2 * 133 266 Product of 18.01 and 0. 0 0.25-0.2 -0.05 Multiply 1.88 and 7. 13.16 0.4-29 -11.6 5 * -263 -1315 Product of -1.6 and -0.12. 0.192 Calculate -0.0093. -0.027 0.14 times -2.52 -0.3528 Multiply -0.4 and -0.08. 0.032 Product of 54 and 0.002. 0.108 -0.4 -853 341.2 What is 194 times -4? -776 Multiply 27 and -11. -297 -0.1 times 5517 -551.7 30.9 2.7 Work out -114 -0.3. 34.2 What is -8 times 382? -3056 Multiply -0.4 and 85. -34 What is the product of -4 and -0.44? 1.76 Product of -28 and -12. 336 Calculate 1-290. -290 1279 times 0.12 153.48 Multiply -0.3 and 204. -61.2 Calculate -0.40.2. -0.08 182 36 Multiply -626 and 0.12. -75.12 Calculate -16330.5. -816.5 Multiply -0.2 and 148. -29.6 Product of	{ "pile_set_name": "DM Mathematics" }
of 2q5/15 - 7q*4/24 - 7q*3/6 - 6q*2. Let w = -4 - -10. Give wy(a) + 7t(a). -a2 Let y(r) = -r - 1. Suppose -13 = -5b + 12. Let n(w) = -9w2 - 14w - 17. Let g(f) = -5f2 - 7f - 9. Let l(m) = -11g(m) + 6n(m). Determine by(k) - l(k). -k2 + 2k - 2 Let s(g) = -g*2 + 3g - 5. Let c(t) = -t + 1. Let u(x) = 3c(x) + s(x). Let w(a) = -5a + 2. Let o be w(1). Let v(h) = h*2 + 3. Give ou(k) - 2v(k). k2 Let i(d) = 2d - 5. Let c(v) = 3v - 6. What is 4c(b) - 5i(b)? 2b + 1 Let g(f) = -6f3 + 6f*2 - 25f - 1. Let o(c) = 7c3 - 7c*2 + 26c + 1. Calculate -5g(k) - 4o(k). 2k3 - 2k*2 + 21k + 1 Let c(h) = 6h - 3. Let p(j) = -17j + 8. Suppose 0i - i + 2 = 3l, 4i - 8 = 5l. Let k be 11(l - 1)1. Calculate kc(d) - 4p(d). 2d + 1 Let h = -38 + 21. Let b(c) = 2c - 6. Let y(f) = 1. Let j(v) = b(v) - y(v). Let n(i) = -6i + 20. Suppose -9z - 70 + 16 = 0. Determine hj(a) + zn(a). 2a - 1 Let d(f) = -13f*2 - 6f. Let c(m) = 12m2 + 5m. Give 6c(k) + 5d(k). 7k2 Let v(p) = 5p*2 - 4p - 1. Let w(h) = h*2 - h - 1. Calculate v(y) - 4w(y). y*2 + 3 Let g(c) = 3c2. Let w(t) be the first derivative of t2/2 - 3. What is g(z) - w(z)? 3z2 - z Let m(g) = g + 1. Let w(i) be the third derivative of -i7/5040 - i6/720 + i5/10 + 4i*2. Let y(c) be the third derivative of w(c). Give -3m(q) - 4y(q). q + 1 Let k(a) = 8a3 - 7. Let m(d) = -d3 - 5d2 - 5d + 1. Let f(i) = i*2 + i. Let h(b) = 5f(b) + m(b). Calculate 6h(u) + k(u). 2u*3 - 1 Let u(d) = 3d*3 - 3d - 1. Let w(o) be the second derivative of -o3/6 - o2/2 + 10o. Determine u(p) - 3w(p). 3p3 + 2 Let t(o) = -5o + 1. Let b = 19 + -25. Let k(l) = 4l - 1. Calculate bk(r) - 5t(r). r + 1 Let b(n) = n - 1. Let z(f) = -4f + 4. What is 11b(y) + 2z(y)? 3y - 3 Let y(w) = -3w*3 - 5w*2 - 4w - 2. Let u(s) be the first derivative of s4/2 + s3 + s*2 + s - 3. Determine -5u(p) - 3y(p). -p3 + 2p + 1 Suppose 7 - 17 = 5m, 0 = 2o - 3m + 2. Let u(z) = z2 - 5z + 5. Let y(s) = s*2 - 2s + 2. Determine ou(t) + 10y(t). 6t2 Let q(s) = -s2 + s. Suppose -o + 9 = 2o. Let m(u) = -5u2 + u - 1. What is oq(x) - m(x)? 2x2 + 2x + 1 Let a(p) = -3p - 2. Let f(y) = -2y. Let s(h) = -6h - 9. Let g(b) = -5f(b) - s(b). Give 11a(u) + 2g(u). -u - 4 Let f(z) = z - 1. Let d(t) = 8t - 15t + 5 + 5t. Let w be (-6)/15 + 36/(-10). Calculate wf(b) - d(b). -2b - 1 Let a(t) = -2t + 4. Let h(o) = -3o + 4. Determine 3a(x) - 4h(x). 6x - 4 Let q(z) = 2 + 3z + 5 - 4. Let g be q(10). Let p(b) = 5b*2 - 2b. Let d(a) = -81a2 + 33a. Calculate gp(s) + 2d(s). 3s2 Let n be 4-1(-2)/4. Let o(g) = -5g*3 + 3g*3 - n - 3g + 2. Let x(m) = 4m3 + 7m. Calculate 7o(i) + 3x(i). -2i3 Let f(q) = -5q + 1. Let n(r) = -10r + 3. Give 5f(y) - 2n(y). -5y - 1 Let f(w) = w*2 + 9w + 3. Let d(c) = 5c + 1. Give 5d(v) - 2f(v). -2v*2 + 7v - 1 Let v(q) = 26q2 + 20q - 6. Let i(b) = -9b2 - 7b + 2. Calculate 11i(d) + 4v(d). 5d2 + 3d - 2 Let r(u) = 10u. Suppose m - 3m + 10 = 0. Let a(f) = -5f. Calculate ma(c) + 2r(c). -5c Let n(c) = -c + 14. Let f(u) = 2u - 28. Calculate -4f(t) - 7n(t). -t + 14 Let r(x) be the second derivative of 2x - 3/20x5 - 2/3x*3 + 0 + 0x*2 - 1/3x*4. Let z(p) = 4p*3 + 5p*2 + 5p. Calculate 5r(d) + 4z(d). d3 Let u(y) = y2 + y + 1. Suppose 5q + 13 = -8q. Let h(p) = -6p2 - 4p - 3. What is qh(f) - 4u(f)? 2f2 - 1 Let d(k) = 3k*3 - 10k*2 + k. Let z(f) = -16f*3 + 51f*2 - 5f. What is 11d(v) + 2z(v)? v*3 - 8v*2 + v Let s be (-9)/(-18)(0 + 10). Let z(b) = b*3 + b - 1. Let h(a) = 8a*3 + 2a*2 + 5a - 5. What is sz(q) - h(q)? -3q*3 - 2q*2 Let i(s) = 1. Let o(f) = 2f + 9. Calculate -4i(k) + o(k). 2k + 5 Let f(a) = a*3 - 3a. Let z(x) = 4x. Calculate -4f(l) - 3z(l). -4l*3 Let y(j) = -9j*3 - 10j*2 + 9j + 9. Let q(u) = u*2 - u - 1. Determine 18q(d) + 2y(d). -18d*3 - 2d*2 Let z(f) = f - 4. Let g(u) = -1 + u + 0 - 2. Suppose x + 3t + 9 = 6x, 4t = -x + 11. Calculate xg(h) - 2z(h). h - 1 Let g(a) = 15a + 15. Let t(n) = 7n + 7. Determine -3g(f) + 7t(f). 4f + 4 Let p(t) = 3t*2 - 2t + 2. Let a(x) = -6x2 + 5x - 5. Suppose -7 = c + 2h - 2, 2h = 0. What is cp(q) - 2a(q)? -3q2 Let m(q) = 15q*3 - 8q*2 - 8q - 8. Let k(f) = -10f3 + 5f*2 + 5f + 5. Suppose 0b - 4b - 18 = -z, -3b - 4z = 23. What is bm(v) - 8k(v)? 5v3 Let l = -100 - -140. Suppose 2s + 3s + l = 0. Let g(j) = 5j*2 - 6j - 8. Let i(h) = -3h2 + 4h + 5. Give si(u) - 5g(u). -u*2 - 2u Let v(q) = -q*2 - q + 6. Let t(k) = -3k*2 - 2k + 17. Calculate -3t(c) + 8v(c). c*2 - 2c - 3 Let r(o) = -o - 1. Let v(x) = 6 + 4x - 5x + 6x + 1. Calculate 4r(f) + v(f). f + 3 Let v(y) = 20y + 32. Let t(o) = -5 + 12 + 4 + 7o. Let w(k) = 11t(k) - 4v(k). Let h(z) be the first derivative of -z*2 - 4z - 8. What is 10h(s) - 6w(s)? -2s + 2 Let g(w) be the third derivative of -w6/120 - w5/30 + w4/8 + w3/6 + 23w*2. Let t(z) = -3z + z3 + z2 + 2z + 0z. What is -g(s) - 2t(s)? -s3 - s - 1 Let x(j) = j. Let u(c) = -c - 1. Let y(o) = -2o + 3. Let k(z) = 5u(z) + y(z). Give -k(d) - 5x(d). 2d + 2 Let y(s) = -6s*2 + 3s - 5. Suppose 4g - 5g = -3. Let t(u) = -7u2 + 4u - 6. Calculate gt(d) - 4y(d). 3d2 + 2 Let g(f) = 3f + 6. Let m(y) = -4y - 6. Calculate -5g(p) - 4m(p). p - 6 Let g(r) = 2r - 1. Let z be (-3)/(-12) - (-5)/(20/(-21)). Let y(d) = d. Calculate zy(a) + 2g(a). -a - 2 Let w(g) = -g*2 + g - 1. Suppose -4b + 2s + 0 - 6 = 0, 5b + 4s = 25. Let o(f) = -5f*2 + 2f - 2. Let z be 4/14 + 208/(-91). Calculate bo(v) + zw(v). -3v2 Let t(a) = 3a*2 - 7a + 4. Suppose 0 = h - 4m - 23 + 7, 5h = -2m + 14. Let d(z) = 8z*2 - 20z + 11. What is hd(b) - 11t(b)? -b*2 - 3b Let p(c) = 5c2 - 4c. Let d(j) = j*2 + j. Calculate 4d(m) + p(m). 9m2 Let m(l) = 2l + 3. Let o(q) be the second derivative of -q*3/2 - 7q*2/2 + 6q - 1. What is 7m(a) + 3o(a)? 5a Let y = 13 + -12. Let p be y + -4 + 1 + -2. Let b(v) = -14v - 5. Let x(s) = -5s - 2. Determine pb(k) + 11x(k). k - 2 Let g(l) = 5l*2 - 2l - 4. Let u(j) = -j*3 + 11j*2 - 5j - 7. Give -5g(n) + 2u(n). -2n3 - 3n*2 + 6 Let d(z) = -5z. Let p(j) = j. Calculate -4d(a) - 36p(a). -16a Let q(p) = 2p*2 - 4p - 5. Let d(n) = -4n2 + 16n + 4. Let g(j) = -4j2 + 15j + 5. Let l(a) = 6d(a) - 7g(a). Determine 6l(y) - 13q(y). -2y2 - 2y - 1 Let u(k) = -16k + 5. Let p(b) = -1 + 4b - 1 + 1 - b. Determine -22p(c) - 4u(c). -2c + 2 Let q(i) be the third derivative of -i5/60 - i4/8 + i3/6 + 27i2. Let a(g) = g2 + 3g - 1. Determine 3a(o) + 2q(o). o2 + 3o - 1 Let j(q) = 8q2 - 5q - 2. Let b = 10 - 4. Let a(m) = m*2 - m. Let n = -2 + 1. Give ba(c) + nj(c). -2c*2 - c + 2 Let x(o) = 7o*3 + 5o*2 - 4o + 5. Let k(r) = 3r3 + 3r*2 - 2r + 3. Give -10k(j) + 6x(j). 12j3 - 4j Let g(k) = 3k2 + 2k - 1. Let z(v) = 7v2 + 4v - 3. Give -5g(n) + 2z(n). -n*2 - 2n - 1 Let m(h) be the first derivative of 4h3/3 - h2/2 - 4h - 10. Let k(j) = 2j2 - j - 2. Determine -5k(n) + 3m(n). 2n*2 + 2n - 2 Let l(x) = x*3 - 2x*2 + 3x + 4. Let n(s) = -4s3 + 9s*2 - 13s - 17. Determine -26l(q) - 6n(q). -2q3 - 2q*2 - 2 Let p(j) = 2j*3 + 17j*2 - 13j + 11. Let t(m) = m*3 + 8m*2 - 6m + 5. Determine -6p(n) + 13t(n). n*3 + 2n*2 - 1 Suppose -3n + 2 = -2q, 2q + 2 + 0 = 5n. Let v(u) = -u2 + 4u + 7. Let l(z) = -z - 1. Give qv(o) - 5l(o). o2 + o - 2 Let j(s) = -s2 + s + 1. Let c be 4/18 - 88/(-9). Let x(b) = -2b2 + 2b + 2. Calculate cj(i) - 4x(i). -2i2 + 2i + 2 Let h(l) = -l*3 - 9l + 6. Let n(t) = 3t3 + 26t - 17. What is 17h(s) + 6n(s)? s*3 + 3s Let a(f) = 36f3 + 21f*2 + 21. Let q(n) = -7n*3 - 4n*2 - 4. Suppose -4w + 2y + 0y - 82 = 0, 3y = 5w + 102. Give wq(s) - 4a(s). 3s3 Let q(x) = x2 + 3x - 3. Let k be q(-6). Suppose -5w = -2w + k. Let g(f) = -4f3 + 5f + 3. Let t(l) = -2l3 + 2l + 1. Give wt(u) + 2g(u). 2u3 + 1 Let q(s) be the first derivative of 9/2s*2 + 2 + 2/3s*3 + 5s. Let o(m) be the se	{ "pile_set_name": "DM Mathematics" }
= 4b + 7. Let a(g) = 3t(g) + 5y(g). Let x be a(7). Let n = x + 38. Calculate the remainder when n is divided by 6. 3 Suppose -4m = m - 5u - 30, -4m + 6 = 5u. Suppose 0 = 5h - 2h + ml - 23, -h + 25 = -3l. Let p = -15 + 20. What is the remainder when h is divided by p? 3 Let b(m) = m - 2m + 2m + 8. Let q be b(-7). Suppose 4 = 5t - q. What is the remainder when t is divided by 1? 0 Suppose 3a = -12, 6v - 3v = 4a + 37. Suppose 4m + 211 = 5p, -p - m + 2 = -33. What is the remainder when p is divided by v? 4 Suppose 436 - 16 = 10q. What is the remainder when 125 is divided by q? 41 Let s = -978 + 1050. Calculate the remainder when 207 is divided by s. 63 Let j(k) = -k3 + 8k*2 + k - 10. Let v be 4/(51/10). Let s be j(v). What is the remainder when 105 is divided by (162/12)/(s/(-4))? 24 Suppose -5k - 17 = -37. Suppose 126y = 129y - 21. Calculate the remainder when y is divided by k. 3 Let z(q) = -2q + 59. Suppose -10w + 8w - 14 = 0. What is the remainder when z(w) is divided by 37? 36 Let v(b) = -11 - 16b + 5b + 13b. What is the remainder when v(15) is divided by 7? 5 Let c be -2 + 2 + -1 + 0. Suppose 5m + 4b - 18 = 0, -b = -m - 6 + 15. What is the remainder when 20/2 + 1 + c is divided by m? 4 Suppose 3j + 6r = -0j + 270, 5r + 292 = 3j. Calculate the remainder when 225 is divided by j. 37 Calculate the remainder when 173 is divided by (-225)/(-6)(-38)/(-57). 23 Suppose -12 = 20o - 152. Suppose 4l + 3c = 123, 4c - 133 = -4l - 5. What is the remainder when l is divided by o? 6 Let n = -45 - 2. Let k = n - -67. What is the remainder when 58 is divided by k? 18 Let v(g) = g*2 + 8g - 7. Let b be v(-7). Let c(p) = p*3 - 3p - 2p + 11p*2 - 17 + 3p*2 + 0p. What is the remainder when c(b) is divided by 28? 25 Let a(n) be the third derivative of -n6/60 - n5/60 - n*4/8 - 2n*3/3 - 9n*2. What is the remainder when 53 is divided by a(-2)? 11 What is the remainder when 242 is divided by -9(-61)/((-40)/(-60))? 80 Suppose -2k - 2o + 54 = 14, -2k = -3o - 40. What is the remainder when 346/6 + 2/6 is divided by k? 18 Let t = -1513 + 1569. What is the remainder when t is divided by 31? 25 Suppose -2j = -7 - 3. Let b = 9 - j. Suppose p - 7 = -2l - l, p - 11 = -bl. Calculate the remainder when 14 is divided by l. 2 Let i = -23 - -126. Suppose 5u - 10 + 0 = 0. Suppose 3o + 43 = uf, 18 = -4f + 5o + i. What is the remainder when f is divided by 7? 6 Let g = -741 - -808. Calculate the remainder when 135 is divided by g. 1 Let g be (-4 - -3)/((-3)/6). Suppose -7 - 33 = -gb. Suppose o + 5j = 4 + b, 5o - 2j = 66. Calculate the remainder when o is divided by 8. 6 Suppose 5z - 5j - 4 = 21, -z = 2j - 8. Calculate the remainder when 17 is divided by z. 5 Suppose -3f = -w - 5, -7w + 3 = -f - 2w. Suppose 0 = 5i + 5x - 20, 8i - 23 = 3i - fx. Calculate the remainder when 11 is divided by i. 1 Suppose -11 = -m + 27b - 32b, -3b = 0. Calculate the remainder when 62 is divided by m. 7 Suppose v + 4 = -4o, 4v + o = -0v + 14. Calculate the remainder when 23 is divided by (-2v/(-3))/(4/18). 11 Let o(s) = s3 + 10s*2 + 12s - 7. Suppose -5k + 1 = -a, -4a - 13 - 9 = -2k. Calculate the remainder when o(a) is divided by 48/3 + (2 - 1). 14 Let n(v) = -5v*3 - 1. Let p(t) = t + 3. Let a be p(-4). What is the remainder when n(a) is divided by (-47)/(-15) - (-46)/(-345)? 1 Suppose -96 = h - 147. What is the remainder when h is divided by 11? 7 Let f(q) = 22q3 - q2 - 37q + 39. Suppose -3h - 52 + 322 = 0. What is the remainder when h is divided by f(1)? 21 Suppose s = -2s + 18. Let f = 36 + -26. What is the remainder when s/f + 335/25 is divided by 5? 4 Let g = 17 - 12. Suppose -12v + 228 = -0v. What is the remainder when v is divided by g? 4 Let u(c) = 3c + 1. Let r be u(-4). Let p = -11 - r. Suppose p = -5l - h + 38, -3l + h - 10 = -4l. What is the remainder when l is divided by 5? 2 Let n = -806 + 816. Let d(u) = -u. Let b(s) = -37s*2 - 3s. Let g(f) = -b(f) + 2d(f). Calculate the remainder when g(1) is divided by n. 8 Let j(m) = m3 + 13m*2 + 22m + 49. Calculate the remainder when j(-10) is divided by 41. 6 Suppose -4j = -7j + 24. Let t(v) = 5v - 9. What is the remainder when t(j) is divided by 18 - (-1 + 3 - 1)? 14 Let x = 32 + -52. Let p = x + 96. What is the remainder when p is divided by 5 + -3 - 1 - -25? 24 Let r(m) = 2m - 1. Let a(l) be the second derivative of -l5/20 + l4/3 - 2l2 - 3l. Let v be a(3). Calculate the remainder when 16 is divided by r(v). 7 Let i be (6/10)/((-2)/(-10)). Suppose 5k - 35 = -iv + 31, 0 = -4k - 4v + 48. Suppose 0 = -2t + 413 - 297. What is the remainder when t is divided by k? 13 Let i(c) = 4c*3 - 3c*2 + 2c - 1. Suppose 2d - 70 = 2r - r, -3r - 214 = -2d. What is the remainder when i(2) is divided by 162/r32/(-6)? 11 Let n = 8 - 5. Suppose -y - 6 = -4g, -y + n = -g + 6. Suppose 5m + g = 11. What is the remainder when 6 is divided by m? 0 Suppose -3z - 56 = -170. Let l = 59 - z. Calculate the remainder when l is divided by 12. 9 Let v = 45 + -23. Suppose 261 = -4t + n, -255 = 3t + t - 3n. Calculate the remainder when 38 is divided by (-516)/t + 4/v. 6 Suppose 86l = 85l + 1790. Calculate the remainder when l is divided by 16. 14 What is the remainder when 27 + 3 - (2 - 8) is divided by 10? 6 Suppose 65 - 21 = -2c. Let w = 37 + c. Calculate the remainder when 73 is divided by w. 13 Let k = 379 - 231. What is the remainder when (-11)/(-22)((2 - 0) + k) is divided by 39? 36 Let h(t) = -t3 - 17t*2 - 2t - 25. Let m be h(-17). Calculate the remainder when 61 is divided by (-96)/m(-6)/4. 13 Let g(m) = -m - 6. Let s be g(-10). Let y = s - 1. Let h = 31 - 21. What is the remainder when h is divided by y? 1 Suppose 0 = q - 2x + 1, -22 = x - 25. Let j(m) = 7m - 7m*2 - 5 + 6m + 0m + m3. Calculate the remainder when 19 is divided by j(q). 9 Let j(i) be the first derivative of 3 + 1/4i*4 + 0i*3 + 0i - i*2. Calculate the remainder when j(2) is divided by 2. 0 Suppose -5b + 1 = -9. Suppose -ba - y - 3y + 106 = 0, -4a + 5y = -212. Calculate the remainder when 102 is divided by a. 49 Let t = -502 - -519. Calculate the remainder when 98 is divided by t. 13 Suppose -3h - 20 = -479. Calculate the remainder when h is divided by 32. 25 Let k(w) = 8 + 4 - 3 + w. Let h be k(-8). Calculate the remainder when 51 is divided by 1 + 13 - h - 0. 12 Suppose -3g + 8 + 25 = 0. Let x be ((-1)/(-3))/(4/36). Suppose u - 40 = x. Calculate the remainder when u is divided by g. 10 Calculate the remainder when -3(-3)/(9/8) is divided by 6. 2 Suppose 3t + 133 = -4t. What is the remainder when 0/(-1) - (t - 8) is divided by 1/(1/(-7)-1)? 6 Let l = -149 + 240. What is the remainder when l is divided by 31? 29 Let n = -4 + 9. Suppose 15 = -2a + na. Suppose -ak + k = -44. What is the remainder when 30 is divided by k? 8 Suppose 5q - 14 = -44. Calculate the remainder when 10/5(-15)/(-2) is divided by (q/2)/(4/(-12)). 6 Let p(n) be the first derivative of -1/2n*2 + 18n - 2. What is the remainder when 7 is divided by p(13)? 2 Suppose -3z + m = -1, 5z = -0z - 4m - 4. Suppose s + 4c - 63 = -2s, -3c = z. Let d = 10 + s. What is the remainder when d is divided by 16? 15 Let r(t) = -3t + 50. Suppose -71n + 75 = -66n. What is the remainder when 14 is divided by r(n)? 4 Calculate the remainder when 108 is divided by ((-21)/6)/(14 + -15)8. 24 Calculate the remainder when 4(-21)/28 + 228/1 is divided by 58. 51 Suppose 4p + 20 = 0, 3p + 10 = 2z - 69. What is the remainder when 285 is divided by z? 29 Let f(g) = 8g - 1. Suppose 24d - 13d - 1111 = 0. Let o = d + -87. Calculate the remainder when f(5) is divided by o. 11 Let w(q) = -q*3 - 55q*2 - 156q + 42. What is the remainder when 88 is divided by w(-52)? 4 Let i be 12/(-10)(-50)/(-20). Let d = i + -1. Let l = 29 + d. What is the remainder when l is divided by 7? 4 Suppose 36 = 13o - 4o. Let c be 1/(-3 - (-952)/317). Suppose -3k = 5m - c - 105, -om + 3k = -316. What is the remainder when m is divided by 14? 12 Suppose 2a + 47 = 3q - 49, 64 = 2q + 4*a. Calculate the remainder when 222 is divided by q. 30 Let u(w) be the third derivative of	{ "pile_set_name": "DM Mathematics" }
(d) 2 d Let y = -2913614/7 + 417314. Let u = y + -1083. Let o = 0 + 2. Which is the closest to o? (a) 15/2 (b) u (c) 0 b Let f(u) = 6u + 4. Let n be f(-1). Let x = 0.03891 + 0.06109. Which is the closest to x? (a) -5 (b) -6 (c) n (d) 1 d Let j = 19/70 - -1/70. Let g be (-3)/(-2)((-303)/99 + 3). What is the nearest to j in -0.1, -0.2, g, -4/9? g Let o(w) = 1349w - 4042. Let p be o(3). Which is the closest to 96? (a) p (b) -2/17 (c) 0 a Let c = 5.3 - 6.3. Let o = -696 + 712. What is the closest to 0.1 in 3, -3, c, o? c Let f = 19.0514 - 0.0514. Let l = f + -33. What is the nearest to l in 1/2, 0.2, -0.1, 3? -0.1 Let s = -0.3476 + -7.6524. What is the closest to -2 in 0.1, s, 0.2? 0.1 Let h = 7.56 - 997.56. What is the closest to 2/3 in 5, -0.1, h? -0.1 Let n = 151 + -150.4. Which is the closest to -1? (a) 3 (b) 82 (c) n c Let g = 2364 + -2363.9. What is the nearest to -2/3 in 0.2, g, -8, -11? g Let q be 7 + -10 - 11/(-4). Let z(v) = v3 + 11v*2 - v - 4. Let o be z(-11). Suppose p - op = -p. What is the closest to q in 0.4, p, -3/8? -3/8 Let d = -57.5 - -57.49. Which is the nearest to 0? (a) -5.1 (b) d (c) -0.3 b Let l = -44.56 + 41.46. Which is the nearest to -1? (a) 1/3 (b) l (c) 0.1 c Let j be 2/(-5) - 17610/225. Let u = 79 + j. Suppose 2q - 3y + 5 = 0, 0q - 3y = -3q - 6. What is the nearest to u in 4, q, 0.4? 0.4 Suppose 24z + 335 = 29z. Let h = -537/8 + z. Which is the closest to 1? (a) 0.4 (b) 0.1 (c) h a Let f be (32/(-192))/((-6)/4). Let w = -0.18 - -0.18. Let s be 24/(-60) + 24/110. What is the closest to f in w, s, -3? w Suppose -5d + d = 20. Let q be (-2)/(-10) + (d - (-186)/(-5)). Let p = q - -48. Which is the nearest to -0.1? (a) p (b) -0.4 (c) -2/7 c Let x = -4391 - -4392.1. What is the nearest to 0 in x, -0.3, 4, 11? -0.3 Let s be (2/(-9) + (-32)/(-63))/((-842)/5894). What is the nearest to 33 in 0.4, s, 0.6? 0.6 Let j(q) be the first derivative of 8q2 - 101q + 15. Let h be j(6). Which is the nearest to 1/2? (a) -4 (b) 3 (c) h b Suppose 6d + 3 = 3d. Let f = -2.2 + 1.5. Let t = -0.7 - f. Which is the nearest to 2? (a) 3 (b) t (c) d a Let w be -255(-6 + 6 + (1 - 0)). Let k = 769/3 + w. Which is the nearest to -5? (a) 1/3 (b) -0.3 (c) k b Let f be 12/(-9) + -31 + 11900/375. Let p = 0.31 + -0.3. Which is the closest to 0? (a) 0.3 (b) f (c) p c Let r = 7606 + -7653. What is the nearest to -0.1 in 10/9, r, 3, -0.2? -0.2 Let x be -2 - (0/3)/((-174)/(-29)). What is the closest to -0.1 in -1/8, x, -100, 0? -1/8 Let o = 29/33 + -211/165. What is the nearest to 1 in o, -5, 0.15, -2.4? 0.15 Let y = -12453 - -12454. Let s = 15 - 11. Let z = 1 - s. Which is the closest to -0.1? (a) y (b) z (c) 2/3 c Let s = 0.24574 + -2.24574. Let u be 12/16 - 2/8. Which is the nearest to u? (a) s (b) -0.5 (c) 0.3 (d) 20 c Let j = -352/9 + 116/3. Let p be (0/((-44)/4))/3. Which is the nearest to 3/26? (a) p (b) 1/4 (c) j a Let h = 1 - 1. Let u = -377649/10 - -37765. Which is the nearest to h? (a) -4 (b) u (c) -0.4 b Let f = 1650 - 1651. Let v = -311 + 3418/11. Which is the closest to f? (a) 1/4 (b) -2 (c) v c Let p = 338 - 339. Let z = -93 - -95. Which is the closest to p? (a) z (b) 8/7 (c) -9 b Suppose 6h - 13 = -5a + 5, -a = 0. What is the closest to h in -2, 1.3, 2/15, -2/7? 1.3 Let s be (-90)/(-133) + (-8)/76. Suppose -2a - 3a + t = 93, 3a = t - 55. Let h be (-33)/44 - a/20. What is the closest to -2 in s, h, 3? h Let r be -1 - (-6 + 0)/6. Let x be (-29)/(-58)((-2)/4 - r). Which is the closest to -2/7? (a) 48 (b) x (c) -0.5 b Let z = -18720.3 + 18720. Let q = 5.8 + -0.8. Which is the closest to -1? (a) z (b) q (c) 0 (d) 3 a Let q = 6079/7728 + -1/1104. Let y = -9/7 + q. Let k be 1/(-5)(12 + (-119)/17). Which is the closest to y? (a) 1 (b) k (c) -5 b Suppose -5z + 5j = 15, 5j - j = 20. Let f = 338 + -335. Which is the nearest to z? (a) f (b) -19 (c) -5 a Let j be 164547/23547(0 - -1) + -7. Which is the nearest to 0.1? (a) j (b) 0.1 (c) -0.3 b Let i be (-8)/90 - (665/(-75) - (-54)/6). Which is the nearest to i? (a) 3 (b) -7/206 (c) 0 b Let m(x) be the first derivative of -x*3 - 9x*2/2 + 2x + 65. Let g be m(-3). Which is the closest to g? (a) 5/2 (b) -0.07 (c) 1 a Let l = 304/115 + -24/23. Let w be ((-1)/1)/((-118)/590). What is the nearest to l in -5/2, 0.1, w? 0.1 Let s = 4 - 2. Let v = 1 - s. Let a(f) = f*2 - 197f - 3179. Let h be a(-15). What is the nearest to h in 2/5, 1, v? 1 Let g = 82.8 - 84.8. Which is the nearest to 1/3? (a) 3 (b) g (c) -5/7 (d) 1 d Let p be ((-1)/3)/(20/12 + -2). Let o be -1 - -1 - 11/(-11 + 66). Which is the closest to 0.1? (a) -0.43 (b) o (c) p (d) -2/7 b Let z = -403451/36 + 11207. What is the closest to 1 in z, -6/7, -0.1? z Suppose -4 = q - 0q - x, -11 = 5q + 4x. Let o = 41 - 42.65. Let j = o + -0.35. Which is the closest to -4? (a) 4 (b) q (c) j b Let w = 1639 - 1638. What is the nearest to w in -5, -2, -32/3, -4? -2 Let k = -4/3 - -1. Let n be (-5)/15453/1. Let z = 452/3 + n. Which is the nearest to k? (a) -0.2 (b) z (c) 7 b Let q = 48 + -15. Suppose 2y + 9y = -q. Let v = -1/20 - 11/180. What is the closest to -1/3 in v, y, -2? v Let h be (-32 - (-35 + 1))/(-2). Let l = 0.9 - 1. Suppose -1 = -2m - 13. What is the closest to h in l, 2/3, m? l Let z = 3534 + -3530. Which is the closest to 1? (a) z (b) -0.01 (c) -0.1 (d) 0.4 d Let d be 1/(10/(-16)) + 0. Let u be (-1 - 46/(-10)) + -31. Let w = -1.4 - -1.4. What is the closest to w in u, 0, d? 0 Let o = -142 - -142.38. Let y = o - -0.62. Which is the closest to y? (a) -0.4 (b) -3 (c) -0.2 c Let d = -18/211 - 34195/2321. Let i = d + 15. Let g = -7/37 + -173/259. Which is the closest to 2/5? (a) 0 (b) g (c) i c Let z be (-9)/54 - 17/(-17). Let v be (18/(-12) + 1)/(1/(-6)). What is the closest to 0.11 in 0, 2/9, z, v? 0 Let v = 0.005 - 0.055. Let m = 1.27 + v. Let j = m - 2.22. What is the nearest to 0.1 in j, 0.4, -16? 0.4 Let u be (-36)/(-19872)46 + (-10)/56. What is the nearest to 237 in -3, 1, u, 18/7? 18/7 Let l = 10.9 - 10.5. Let q = 39 + -59. Let t = -39/2 - q. What is the nearest to t in 3, l, 0? l Let f = 42 + -37. Let s = 198 + -196. What is the nearest to f in 2/5, -0.1, s? s Let d be ((-50)/3)/((-429)/54 - -8). Let s be (24/d)/((-8)/(-10)). Which is the closest to 1? (a) 1/4 (b) s (c) 1/5 a Let d = -1.94 + -0.06. Let f = 1 + d. Let o be (60400/(-180))/(-20) - 17. Which is the nearest to f? (a) 1 (b) o (c) 2/5 b Let k = -10.17 - -10.2. Let v = 0.02 - -0.48. Let c = -22 - -24. What is the nearest to c in -0.2, v, k? v Let n = -0.24 + -0.26. Let t = -4937.17 - -4937. Which is the closest to 0.1? (a) n (b) -0.4 (c) t c Suppose 12 = 3g + 3m, -6m = 3g - 5m - 8. Suppose 4 = -l - g. Which is the closest to 0.1? (a) -4 (b) l (c) 0.5 c Suppose -12m + 79 = -5. Let u be (-1)/m551/152. Let z = -3/8 - u. Which is the nearest to 17? (a) 0.5 (b) -2/3 (c) z a Let b = -22 + 25. Let y = -249.9 + 231. Let g = -18.9 - y. What is the nearest to 1 in b, 4, g? g Let j = 3555 - 3559. Which is the closest to -1? (a) j (b) 1 (c) 6/7 (d) 4 c Suppose 3i - 8 = -v, 5i - 9 = 2v + 8. Let c = 4204 + -67265/16. What is the closest to -2/11 in 0.2, v, c? c Let u be (-45)/(-60) - (1 + 21/(-4)). Let q = -46.86 - -47. Suppose -3 = -4o - 4k + 13, -2o + 4k = 16. Which is the closest to o? (a) 0.4 (b) q (c) u b Let k = -470 - -469.94. What is the nearest to -0.1 in -1, -0.4, 5, k? k Let h be 108520/(-76000) - (1 - 7/4). Let q = -13/25 - h. Let c = -28/57 + q. What is the nearest to -1/3 in c, 4, 0.1? c Let o(w) = -941w - 5633. Let y be o(-6). Let p = -0.2 - 2.8. Which is the nearest to -2? (a) p (b) -0.1 (c) y a Let v = -74.006 + 0.006. Let j = 73.695 + v. Let f = j - 0.095. Which is the nearest to 1? (a) f (b) -5 (c) 0 c Let s = -157 - -157.968. Let z = 0.99 - s. Let k = z + 0.088. Which is the nearest to k? (a) 5/4 (b) 0 (c) 0.5 b Suppose -4w = -105z + 109*z - 32, w = z - 10. What is the closest to w in -49, -0.5, -3/8? -0.5 Let m = -102.77 - -102.85. Which is the closest to m? (a) -2.4 (b) 0 (c) 0.1 (d) -1/7 c Let f = 86.07 + -86. Let n = f + 28.93. Let k = -29.1 + n. Which is the closest to 1? (a) 1/3 (b	{ "pile_set_name": "DM Mathematics" }
vided by 9. 6 Let o(g) = -g*3 + 5g*2 + g - 1. Let m be o(5). Suppose -5p = c - 235, 0 = 5p - mc - c - 235. Calculate the remainder when p is divided by 12. 11 Suppose 14 = 4q - 3q. Let c be 12/(-1)(-2 + 0). Let v = c - -3. What is the remainder when v is divided by q? 13 Let l(k) = -k3 - 3k*2 + 4k + 10. What is the remainder when 57 is divided by l(-4)? 7 Let x(i) = i*2 - 6i - 16. Let r = 23 + -10. Calculate the remainder when x(10) is divided by r. 11 Suppose 5q - 2n = 23, 34 = 5q + 3n + 6. Calculate the remainder when q is divided by 3. 2 Let y = -37 + 9. Let j = 14 - y. Calculate the remainder when j is divided by 22. 20 Suppose h = 3o - 14 - 59, -47 = -2o - h. What is the remainder when o is divided by (-13)/(2/((-2)/1))? 11 Suppose n - 24 = s, -5n + 4s - 73 + 189 = 0. Calculate the remainder when 58 is divided by n. 18 Let c(q) = q*3 + 1. Let a = 8 - -2. Calculate the remainder when c(3) is divided by a. 8 Let l(u) = 3u + 4. Let p(o) = -2o + 3o + 4o + 9. Let b(t) = -7l(t) + 4p(t). Calculate the remainder when 3 is divided by b(7). 0 Suppose -117 = -27h + 18h. Suppose -3b + b + 100 = 0. Calculate the remainder when b is divided by h. 11 Let n = -34 - -73. Calculate the remainder when n is divided by 6. 3 Let g = -35 + 60. Calculate the remainder when g is divided by 7. 4 Suppose d + 2 = 0, -4g - 4d = -29 - 51. Suppose l + 32 = 3n, -34 = 3l + n + g. Calculate the remainder when (-328)/l + (-2)/5 is divided by 9. 7 Suppose 3s + 3w = 2s + 34, -5s = 5w - 140. Suppose -5b + 5f = -50 - 335, b = 2f + 82. Calculate the remainder when b is divided by s. 22 Let l(n) = -n2 + 15. Calculate the remainder when 39 is divided by l(0). 9 Let o(y) = -y2 + 7y + 1. Calculate the remainder when 30 is divided by o(5). 8 Suppose -5h = 3v - 262 - 30, -h + 61 = -2v. Let z = 22 - -23. Let y = -25 + z. Calculate the remainder when h is divided by y. 19 Let p(q) = 12q2. Suppose -h = 2i + 2i + 9, -2h = -5i + 5. Suppose -d = -43 + 8. What is the remainder when d is divided by p(i)? 11 Let h(v) be the second derivative of -v3/6 - v2 - v. Calculate the remainder when (-4)/(-6) - 13/(-3) is divided by h(-5). 2 Calculate the remainder when 47 is divided by -3 + 13 + 0 + 3 + -3. 7 Let o(c) = -4c*2 - 8 - 5c - 3c2 + 4c. Let z be o(6). What is the remainder when 45 is divided by 4/(-6) + z/(-21)? 9 Let t be 2/(-9) - 227/(-9). Let s = -9 + t. Calculate the remainder when 2/5 + s/10 is divided by 2. 0 Suppose -2t = t + 6, -3a + 12 = -3t. What is the remainder when 23 is divided by a(1 + 3 + 2)? 11 Suppose -2v + 3v + 7 = 0. Let u(k) = 5 + 5k2 + 4k*2 + 11k + k*3 + 0k*2. Calculate the remainder when u(v) is divided by 9. 8 Suppose 0 = 4t - 4 - 8. Calculate the remainder when 5 is divided by t. 2 Suppose -4m - 2q + 59 = 3q, -5m - 3q = -77. Suppose -2r + 12 + 48 = 0. Calculate the remainder when r is divided by m. 14 Let q(m) = -m - 10. Let p be q(-7). Let i = 1 + p. What is the remainder when 28 is divided by ((-10)/8)/(i/24)? 13 Let d(p) = -p*3 + 3p*2 + p + 3. Let i = -2 - -4. What is the remainder when 119 - 4/i is divided by d(3)? 5 Let p = 368 + -252. Let u = 120 + -187. Let y = p + u. What is the remainder when y is divided by 17? 15 Suppose -9 = -u - 4w, 3w - 18 = -2u + 5w. Calculate the remainder when u is divided by 5. 4 Let h(m) = m*3 + 5. What is the remainder when h(4) is divided by 10? 9 Suppose 0 = 3b - p + 4, -8 = 3b - 5p - 0p. What is the remainder when 14 - b - 3/1 is divided by 7? 5 Let x(a) = -a3 + 8a*2 + 8a + 2. Let v be x(9). Let h(s) = -s*3 - 8s*2 - 8s - 3. What is the remainder when h(v) is divided by 2? 0 Let k be (36/27)/((-2)/(-3)). Suppose -kz + 75 = z + 5p, 3z - 3p - 75 = 0. What is the remainder when 97 is divided by z? 22 Let j = -24 + 28. Suppose 178 - 10 = jq. Suppose 0 = 3l + l - 12, t - 3l - 6 = 0. Calculate the remainder when q is divided by t. 12 Let u be (-12)/10 + (-5)/(-25). Let z(w) = -12w*3 - w. Let n(a) = 24a*2. Calculate the remainder when n(1) is divided by z(u). 11 Let z = 19 + 77. What is the remainder when z is divided by 14? 12 Suppose -4g - 402 = -7g. Suppose 4p - 178 = 3z + 2z, -3p + g = -4z. Calculate the remainder when p is divided by 15. 12 Let z = -5 + 12. Suppose z = 4p - 13. What is the remainder when 19 is divided by p? 4 Let g(s) = s2 + 7s + 3. Let v(c) = -c*2 - 8c - 3. Let z(n) = 6g(n) + 5v(n). Let j = 0 - -7. What is the remainder when z(-5) is divided by j? 4 Let f = 178 + -127. Suppose -4s + j = 2j - f, 5s = -5j + 60. Calculate the remainder when 62 is divided by s. 10 What is the remainder when 25 is divided by 8/2 - (-2 - 1)? 4 Suppose 0 = t + 3 - 2. Let n be (-4)/(-14) + 158/(-14). Calculate the remainder when 26 is divided by -5 - -4 - (n - t). 8 Suppose -4z = -5i + 29, -4z = -5z - i + 4. Let r(o) = -o*3 + 6o*2 + 5o + 8. What is the remainder when r(6) is divided by -26((-2)/(-4) + z)? 12 Let y(h) = -3h + 6. Calculate the remainder when y(-5) is divided by 11. 10 Let r = 73 - 18. Suppose -5x = r - 160. Calculate the remainder when x is divided by 11. 10 Suppose -2h - 1 + 9 = 0. Let z = 109 + -77. Calculate the remainder when z is divided by (18/h + 1)2. 10 Let u(l) = -4l*2 + l. Let z be u(1). What is the remainder when 56 is divided by (-58)/(-3) + 1/z? 18 Let l(s) = 40s3 - s2 - s + 1. Calculate the remainder when l(1) is divided by 21. 18 Suppose 0 = 4g - 5m - 188, 2g + 2m = -0g + 76. What is the remainder when 124 is divided by g? 40 Let m(o) = -o2 + 2. Calculate the remainder when (188/12)/2 is divided by m(0). 0 Suppose 4w = 12, 6z - 5z = 4w + 35. What is the remainder when z is divided by 25? 22 Suppose 15 = 4v - 3n, -5v + 7n + 20 = 2n. Suppose 0 = vi - 5 - 64. What is the remainder when i is divided by 12? 11 What is the remainder when 712/20(-10)/(-4) is divided by 31? 27 Suppose -2q = -5l - 69, -3l = q - 4l - 27. Calculate the remainder when q is divided by (6/(-5))/((-2)/20). 10 Suppose 31 = -5s + 151. Let j = -11 + s. Calculate the remainder when j is divided by 7. 6 Suppose -3y = -0y + 3. Let i be (-2 - -3)4/y. Let n = 9 + i. Calculate the remainder when 8 is divided by n. 3 Calculate the remainder when 148 is divided by 49/196 - 310/(-8). 31 Suppose 20 = 4h - 0h. Suppose 3r - 8 = -hc + 47, c + 5r = 11. Calculate the remainder when c is divided by 6. 5 Suppose 5l + 5z = 30, -2l - 3z + 26 = 3l. Suppose li - 49 = -3q, -i = 5q - 2 - 6. Suppose 0u = u - 25. What is the remainder when u is divided by i? 12 Suppose 4r - 100 - 148 = 0. Calculate the remainder when r is divided by 16. 14 Suppose -r - 3 = -3g, -3g - 1 = -4g + 4r. What is the remainder when 4 is divided by g? 0 Let h(l) = -l*3 + 6l*2 + 3l - 4. Suppose -g = -3g + k + 235, 5g = 5k + 600. Suppose -3s + g + 8 = 0. Calculate the remainder when s is divided by h(6). 13 Suppose -4l + 181 = 45. Suppose -n = 2 - l. What is the remainder when n is divided by 11? 10 Let k(v) = -3v - 10. What is the remainder when 38 is divided by k(-5)? 3 What is the remainder when 94 - (1 - (4 - 0)) is divided by 11? 9 Suppose 4n - 33 = 3. What is the remainder when n is divided by 2? 1 Suppose -5y + 8 = -2. Let j = -35 + 53. Suppose 0 = f + yf - j. What is the remainder when f is divided by 2? 0 Suppose h - 2h - 5t + 16 = 0, 0 = h - t + 8. Let k = h + 8. Suppose x = kx - 12. Calculate the remainder when 7 is divided by x. 3 Let v = -65 + 215. Calculate the remainder when v is divided by 17. 14 What is the remainder when 7256/72 + 2/9 is divided by 26? 23 Suppose 0 = 2i - 0i - 4. Suppose 3f + 4b + 24 = 0, -ib = -f + b - 21. What is the remainder when f16/(-6) + -1 is divided by 11? 9 Suppose 0 = j - 7j + 84. What is the remainder when 38 is divided by j? 10 Suppose -2b - 8 = 0, -4b + 9b + 132 = 4w. Suppose x - 5i = -3i + 61, 5x + 4i = 249. Calculate the remainder when x is divided by w. 25 Let j = 7 - 2. Suppose -jg + 0g = 0. Calculate the remainder when 10 - (g/(-1) + 1) is divided by 5. 4 Suppose 0 = -4k - 5i - 3, 0 = -3k - 0k + 3i + 18. Calculate the remainder when 8 is divided by k. 2 Suppose -h - 5b + 48 = 8, -5b = -25.	{ "pile_set_name": "DM Mathematics" }
? False Suppose -5v + 3079610 = 5m, 48v - 3079586 = 43v + 3m. Is v prime? True Suppose 5p = 3f + 13, -7f - 9 = -4p - 6f. Suppose -4s + 20 = 0, 3l = -pl + 5s + 19140. Is l a prime number? True Let y = 73944 - 36000. Let i = 82555 - y. Is i a prime number? False Let f be 348/(-24) + (-6)/4. Let t = 36 + f. Is 1559((-5)/(-7) - t/(-70)) prime? True Let f(h) = 2h*3 - 4h*2 + h + 4. Let b be f(3). Let w = b + -19. Let u(p) = 11p*2 - 7. Is u(w) prime? True Let s = 234723 + -141856. Is s composite? False Suppose 6121 = -5d - 4879. Let f = -1217 - d. Let a = f - 588. Is a a composite number? True Suppose -8263 - 8477 = -4s. Let p = -2454 + s. Is p composite? True Let g be 5(-4 - (-26)/5). Suppose -gk = -22k + 3440. Is k a prime number? False Let g(d) = 38 + 0d2 + 6d*2 - 37 + 2d. Let n = -61 + 66. Is g(n) composite? True Let y(k) = 83203k2 - 3k - 3. Is y(-1) prime? True Let l(h) = 2h3 - 4h*2 + 5h - 3. Let w(t) = t*3 - 3t*2 + 4t - 4. Let j(o) = -5l(o) + 6w(o). Is j(-10) a prime number? True Is (-141)/(-1833) + 3800543/(-13)-2 prime? True Let t = 70 + -67. Suppose -2o + 8339 = -tp, p + 2802 = o - 1370. Is o composite? False Let p(q) = -155q*3 + 4q*2 + 6q + 4. Let b be p(-2). Let z = b - -3305. Is z composite? True Suppose 337 = -12m + 5053. Let p = 595 - m. Is p a composite number? True Is (8/22)/((-548)/(-10087858)) a composite number? True Let i(u) = 923u - 31. Let w be i(5). Suppose -10p + w = -6p. Suppose -4j + 4222 = p. Is j a prime number? True Suppose 45n - 42n = 15, 5y + 3n = 3596900. Is y prime? True Suppose 4v = -150335 + 988971. Suppose 9d + 58828 = v. Is d composite? False Suppose -6 - 14 = -4b, 5k = -b + 830. Suppose k = -4t - 87. Let s = t + 2998. Is s a prime number? False Let c be 657(-44)/(-6) + -4. Let z = 6791 - c. Suppose -x + z = -1222. Is x a prime number? False Let a(m) = 133495m - 2988. Is a(3) a composite number? True Let d be ((-125)/(-45)6)/((-1)/(-3)). Suppose 0 = db - 56b + 4302. Is b a composite number? True Let d be ((-3730)/(-15))/(-4 + (-316)/(-78)). Suppose -4o + 14635 + d = 0. Is o a prime number? True Let g(j) = -j*2 + 12j + 12. Let d be g(14). Let y = -28 + d. Is (-8)/y - 3450/(-22) a composite number? False Let c(p) = 9p - 8p*3 + 4 - 2p + 2p2 + 5p*2. Let h be c(-5). Suppose 4k - 2f - h = 3k, -3k = -f - 3457. Is k prime? False Suppose 231v - 235v = 4u - 321652, -5u - 402005 = -5v. Is v prime? True Let d(v) = -1362v2 - v - 1. Let i be d(1). Let o be (-4 + 622)/(1 - i/(-1356)). Is (-4)/(-14) - o/63 composite? False Is (-19392 - -106)/(10/(-235)) a composite number? True Is 76/(-304) + (-2168031)/(-12) a composite number? True Suppose -3a + 1 = -4q, -2a - 2 = -5q + q. Suppose av - 21081 = -3228. Is v prime? False Suppose 4293 + 8343 = 4t. Let p = t + -1621. Is p a prime number? False Let b(h) = 3793h*2 - 8h + 1. Is b(6) a prime number? True Let l(o) = 350o + 5. Let c be ((-4)/6 - 0)3 - -14. Suppose -8a - 4 = -ca. Is l(a) a composite number? True Suppose -2p = 10, 0 = -5w - 4p - p + 1685. Let k = 74 + w. Let d = k + 485. Is d prime? False Suppose -1634p = -f - 1633p + 365509, -f + 365505 = p. Is f a prime number? True Suppose 0 = 21v - 7v + 280. Let b be 4/14 + (-1380)/(-70). Is (-8168)/v + 12/b prime? True Suppose -2v - 5w + 10w + 10 = 0, 2 = -3v - w. Suppose 1032 = p - vp + 3z, p + 4z - 1031 = 0. Suppose 0 = -19j + 4j + p. Is j prime? False Let d be 4/10(-40)/8 - -6175. Let c = d + -3388. Is c a composite number? True Let d(m) = m3 - 20m*2 + 28m + 5. Let n be d(20). Suppose -8529 = -4g - n. Is g composite? True Let t(s) = 139s + 43. Let x be t(-3). Let y = 667 + x. Is y a prime number? True Let q = 3147 - 3143. Let m(h) = 2h2 - 8h - 2. Let a be m(6). Is ((-254)/q)/(a/(-132)) prime? False Let k be 11 + -7 + 3 + -9. Let o be (-12)/105/k. Suppose -5c = y - 14214, c + oc = -2y + 11370. Is c a composite number? False Suppose y = 3v - 15, -17y - 26 = -5v - 15y. Suppose -17j - vj = -10353. Is j composite? True Suppose 5f - 1026 = -5q + 5604, 2q + 1329 = f. Is f composite? False Suppose 62q + 0q - 1444414 = 0. Is q composite? False Suppose -7c = -d - 8c + 19043, 3c - 76173 = -4d. Let u = d - 11051. Is u a composite number? False Let v be ((-18)/(-12))/((-3)/(-3620)). Is (-4)/(v/907 + -2) a composite number? False Let s(a) = -4a*3 - 236a*2 - 65a + 56. Is s(-59) a composite number? True Let o = 332 + -289. Let t = -1112 - -2286. Suppose t = oa - 41a. Is a a prime number? True Let k = 51639 - 5590. Is k a composite number? False Let k = 21392 - 9551. Suppose k = 2d + 1327. Is d a composite number? True Suppose 3s + 69x - 70x - 36185 = 0, 4s + 5x = 48272. Is s a composite number? True Suppose 3q = 3a - 15, -11a + 5 = -10a - 4q. Suppose 0 = d - 0i - 3i - 4034, -20265 = -ad - 4i. Is d a composite number? False Let u = 64 - 51. Let h = -9 + u. Suppose -2i = -hb + 1786, -b + 0b + 451 = 4i. Is b composite? True Let o be (7(-7)/(-21))/(2/66). Suppose oq = 64q + 2639. Is q a composite number? True Suppose -5v + 3p = -52, 4p - 16 + 1 = -v. Suppose 0 = -2z + 10, -2o - 2z + v = -9. Suppose -3g - 1042 = -b - b, -5b + og = -2595. Is b a prime number? False Let m(j) = -5j - 4 + 1 + 5. Let w be m(-2). Let c(i) = i*3 - 10i*2 - 21i - 5. Is c(w) a prime number? True Let r(t) = 358t3 - 2t - 2. Let g be r(-1). Let u be 183(-2 + 2/(-2)). Let s = g - u. Is s a prime number? True Let r(f) = 2f3 - f2 - 3f + 5. Let b(a) = -a2 - 11a - 3. Let p be b(-11). Let h be r(p). Let s = 198 + h. Is s prime? True Let v(g) = -g*2 + 5. Let i be v(0). Suppose -2w + 8470 = 5u - 3w, u = iw + 1718. Is u composite? False Let u(p) = 9p - 34. Let h be u(4). Let o(k) = k*2 + 2k - 4. Let t be o(h). Let s(y) = 492y - 34. Is s(t) a composite number? True Suppose -2s = 3u + 19, 5s + 30 = 2u + 11. Let t(j) = j3 + 7j*2 + j + 6. Is t(u) a composite number? True Let u(n) = 3n*2 + n - 6. Let g = -7 + 10. Let r be u(g). Let a = r + 53. Is a a composite number? True Suppose -k + 5f + 5 = 0, 0 = 2k - 2f - 19 + 1. Suppose z - 5h + k = 0, 4z - 5h = -0 + 5. Suppose -4u = -r - 2352, zr = 3 - 23. Is u a composite number? False Is (109776 - -11) + 23 + -11 a prime number? False Let p = -60 - 80. Let a = 903 - p. Is a a prime number? False Suppose -3j - 22008 = -z, -4z - 2j - 23536 = -111498. Is z prime? False Let u be 2672/(-8)(1 - 26/(-4)). Let o = -1665 - u. Let a = 1661 - o. Is a prime? True Suppose 2q = -3f - 0q + 3862, 0 = q - 2. Suppose 0 = -8y - 14 + f. Is y a prime number? False Let m be (-16)/(-5) - 1/5. Let u(n) = -n3 + 8n*2 + 4n + 1. Let z be u(-6). Suppose 4k = b + z, 4k + 8b - mb = 451. Is k a composite number? True Suppose 0x - 10x - x + 492019 = 0. Is x prime? True Suppose 4o + 107h - 109h - 364308 = 0, 4o - 5h - 364296 = 0. Is o a composite number? False Let d(z) = 7366z*2 + 2z - 3. Let t be d(1). Let s = t + -3254. Is s composite? False Suppose v = 2v + 2u - 5965, -v - 3u = -5962. Suppose v = n - x, n = -0x + 5x + 5971. Is n prime? False Let n(p) = 379p*2 - 4p - 34. Let g(t) = 380t2 - 2t - 35. Let h(u) = -5g(u) + 6n(u). Is h(-5) composite? False Suppose -9p + 0p = 5229. Let x = -202 - p. Is x composite? False Let z(y) be the second derivative of -y*7/2520 - 11y6/720 - y5/30 + 7y4/6 + 5y. Let a(q) be the third derivative of z(q). Is a(-5) a composite number? True Let b = 522018 - 268969. Is b prime? True Let h(m) = -m - 17. Let o be h(-20). Suppose 0q - 9862 = -q + ot, -q - 4t = -9883. Is q prime? True Let f be ((-5262)/(-1))/(4(-3)/12). Let m = -2979 - f. Suppose 9l = 6l + m. Is l a composite number? False Let p(i) = -12i3 - 2i*2 + 59i - 39. Is p(-19) composite? True Let p(t) = t*3 + 9t*2 - 8. Let r be p(-9). Let k be 1/(-1)(163 + r/2). Let o = 466 + k. Is o prime? True Let r(s) = 117s2 + 3s + 124. Suppose 4v - y + 41 = 0, 3v - 6y + 12 = -9y. Is r(v) a composite number? True Let y be 16400/(4 - -1) + -4. Let k = -2189 + y. Is k a composite number? False Let h(r) = r*3 + 4r*2 - 2r - 3. Let z be (-36)/18 - (0 + (2 - 0)). Let f be h(z). Suppose -4*k + 17709 =	{ "pile_set_name": "DM Mathematics" }
-0.03. What is the closest to 1 in w, m, 2/7? 2/7 Let u(g) = 3g - 14. Let f(k) = 3k - 14. Let h(o) = -5f(o) + 6u(o). Let n be h(5). Which is the nearest to 1? (a) n (b) -3/7 (c) 1/8 a Let r = -108.3 - -108.4. What is the closest to 2/3 in 2, r, -0.1? r Let b = -10 + 4. Let l = 5.92 + b. Let y = 0.22 - l. What is the nearest to -1 in 1, y, 1/7? 1/7 Let p = -485 - -485.1. Suppose 4k - 2h = 6, -6h + 25 = -h. Which is the closest to p? (a) k (b) 2/7 (c) -0.5 b Let t = 11 - 11.1. Let r = -0.1 + 5.1. Which is the closest to t? (a) -2 (b) 4 (c) r a Let l(j) = -4j*2 - 2. Let o be l(2). Let r be (3/(-24))/((-3)/o). Let t(w) = 3w*2 - w. Let d be t(-1). Which is the closest to 0? (a) -5 (b) d (c) r c Let t = 0.0674 + -0.0674. Which is the closest to t? (a) 2 (b) -8/5 (c) -1 (d) 0.3 d Let c = 0.16 + -0.2. Let n = 59 + -121. Let o = -62 - n. What is the nearest to o in 0.4, c, 1? c Suppose -6s - 241 = -259. What is the nearest to -0.1 in 1/7, s, -0.3, 0.2? -0.3 Let p = -7 - -7. Let s be -4196/12 - 1. Let j = -67 - s. What is the nearest to 0 in 5, p, j? p Let a = 0.0255 + -0.2255. What is the closest to -17 in a, -0.5, -3, -7? -7 Let k be -3(13/(-6) + 2). Let t = 780 + -776. What is the closest to 0 in t, -5, k? k Let l(b) be the second derivative of -b*3/3 - 11b*2 + b. Let o be l(-13). Let s be (6/o)/(7/14). What is the closest to s in 1/5, -2/23, 1/2? 1/2 Suppose 43 + 20 = 9z. Let h be (-21)/(-1)(z - 6). Which is the closest to h? (a) -0.2 (b) -0.3 (c) -3 a Let z = -1.163 - 15.837. What is the closest to 10 in z, 4, -3? 4 Let x = 7.56 - 6.56. What is the nearest to x in 0.1, -0.01, -3, 3? 0.1 Suppose 5d + 47 + 53 = 0. Let m be ((-6)/14)/((-30)/d). Let f be (-2)/(-6) + 2/(-6). What is the nearest to m in f, -1/3, -2? -1/3 Let j(c) = c*2 + 11c + 21. Let d be j(-9). Let v = 97 - 95. What is the closest to v in d, 4, 1/4? d Suppose 4j + 437 = 81. Let b = 87 + j. What is the nearest to -0.1 in b, 0.5, -5? 0.5 Let d = 3 - 2.9. Let u = 1.54 + -1.84. Which is the nearest to -1? (a) -3 (b) u (c) d b Let k = -25/42 + 2/21. Let b = -469 + 467. What is the nearest to 1 in b, 0.2, k? 0.2 Let j = 101 - 100.57. Let u = j - 17.43. Let i = u + 16. Which is the closest to i? (a) 0.1 (b) -3 (c) -2 c Let q = -190.9 - -191. Which is the closest to 2/5? (a) 4 (b) 2/7 (c) q b Let p = 0.531 + -0.031. Let h be 5 + -1 - (-88)/(-24). Which is the nearest to 1? (a) h (b) -2/11 (c) p c Let l = 93/110 + -1/22. What is the nearest to -4 in l, -0.6, -0.5? -0.6 Suppose -15m - 12m = 0. Which is the nearest to -1? (a) m (b) -4 (c) 1/9 a Let o = -178/63 + 28/9. Suppose z = 3z - 8. Let u be (10/(-4))/((-2)/z). Which is the closest to 1? (a) o (b) 3 (c) u a Let c = 12/25 + 1/50. Let u = -0.4 - -0.4. Let w = 0.2 - u. What is the closest to -1 in c, w, -1/6? -1/6 Let o be ((-4)/(-130))/(25/(-125)). Which is the closest to 0.3? (a) 1 (b) 0.03 (c) o b Let s = 411 - 411.4. Let z = -18/7 + 15/7. Which is the nearest to -0.2? (a) s (b) z (c) 3 a Let g = 174.9 + -175. Which is the nearest to g? (a) -4 (b) -9 (c) -3 (d) -0.3 d Let i = 7 + -22/3. Let m = 3.99 + -4. Which is the nearest to m? (a) -2 (b) 3 (c) i c Let d = 0.0361 + 0.3639. Let u(b) = b + 1. Let g be u(4). What is the closest to -1 in g, 2, d? d Let k = 1.3 - 2.3. Let d(t) = t + 10. Let h(v) = -v - 10. Let b(r) = 5d(r) + 4h(r). Let n be b(-7). What is the closest to 2 in n, 1/3, k? n Let y be -17 + 16 - (2/(-1) - -2). Let j = -6 - -4. What is the closest to 1 in j, y, 0.2? 0.2 Let d = 1664.2 + -1664. Let k = -4.88 - 0.12. Which is the nearest to 1? (a) -3/4 (b) d (c) k b Let u(k) = -10k + 116. Let i be u(12). Which is the closest to 0.1? (a) -0.36 (b) i (c) -0.1 c Let n(p) = p + 13. Let d be n(-9). Suppose 3t - d - 5 = 0. Which is the closest to 0? (a) -0.1 (b) 1/3 (c) t a Let p = -127 + 127.1. What is the nearest to 1/2 in p, -1/5, -11? p Suppose 4v - 9 = -41. Let r be (6/9)/(v/(-12)). Let l = 0.33 + 0.07. Which is the closest to r? (a) 2 (b) -4 (c) l c Suppose 2v + 4 + 4 = -5z, -2z + 3v - 7 = 0. Suppose 0 = 4r - 4d - 24, r - 24d - 16 = -21d. What is the nearest to r in z, 0.13, 0? 0.13 Let p = -2.32 + 8.32. What is the closest to -0.5 in 2/5, 0, p? 0 Let y be 11/(-2) - (9 - 21/2). Let m = 0.3 + 0.1. What is the closest to -2 in y, m, 2? y Let d = -302/5 + 63. What is the nearest to -1 in d, 1/5, -2/13? -2/13 Let k = 288 - 1733/6. Let i be (-3)/(-6) - 42/(-12). Suppose 3l = 5w + 2, -2l + 4 + 2 = -w. Which is the nearest to 1/3? (a) w (b) i (c) k c Suppose -270 = 2i - h, 4h + 394 = -5i + 2i. Let l = -133 - i. What is the nearest to -0.4 in -2, -1/5, l? -1/5 Let q be ((-17)/1 - -12) + (-18)/(-4). What is the nearest to q in -13, -0.4, 0.2, -3? -0.4 Let g = 19 + -19. Let q be 3/12 + (-5)/12. Let j = -12 + 13. What is the nearest to j in -1/2, g, q? g Suppose -q - 2v - 4 = v, 0 = -4v - 12. Suppose 185 = 5h - 5x - 280, -3x = h - 77. Suppose 5m + h = 19. Which is the nearest to 0? (a) 0.5 (b) q (c) m a Let k be -30((-21)/(-9))/(-7) - 5. What is the closest to 1/5 in 3/7, k, 2? 3/7 Let y = -986 + 986.2. What is the closest to -1/3 in y, -4, 0, -97? 0 Let t = 0.0943 - -0.9057. What is the nearest to -0.2 in -92, t, 3/2? t Let k = 13 + -9. Let t = -4.4 + k. Let p = 1 - 5/4. Which is the closest to p? (a) 1/4 (b) 2 (c) t c Let f(n) = 6n*2 - 34n - 5. Let s be f(7). Let m be s/(-204) + (-14)/(-24)1. Which is the nearest to 0.2? (a) 0 (b) 2/3 (c) m c Let t = 0.1825 + -0.4825. Suppose m = 3p + 8, 0 = -8p + 4p + m - 11. Which is the closest to 1? (a) -0.5 (b) t (c) p b Let x = 1/10 - 3/5. Which is the nearest to x? (a) -0.5 (b) -1/4 (c) -38 a Let m be ((-11)/(-1))/((-7)/896). Let p = -16879/12 - m. Let z = p - 3/4. What is the closest to z in -4/5, 0.5, -5? 0.5 Let s = -10.2 - -4.4. Let y = -5.9 - s. Which is the nearest to 2/3? (a) 3 (b) 5 (c) y c Let h = 31 - 43. Let r be 16/24 + 2/h. What is the closest to 2/3 in r, 1, -2/7? r Suppose -5h - 1 = -4i, 5i + 4h = 4i + 16. What is the closest to 93 in -0.5, 0.1, i? i Let b = -4.7 - -4.7. What is the nearest to -1/6 in 2, 1/6, b? b Let d = -90.06 - -88. Let m = -0.06 - d. Let k = -224 + 893/4. Which is the nearest to 2/3? (a) m (b) -0.5 (c) k b Let m(h) = -h3 - 4h*2 - 2h - 3. Let x be m(-4). Let z = -179 + 357/2. Let g be 22 + -15 - (3 - -1). Which is the nearest to g? (a) -1 (b) x (c) z b Let x = 28 + -28.1. Let h = 96 - 93. Which is the closest to x? (a) h (b) -0.1 (c) -3/2 b Let a = 0.09 + -1.79. Let g = -0.3 + a. Let d = -0.484 + -0.016. What is the closest to 2 in g, d, -5? d Let m = -0.68 - -1.68. What is the nearest to m in 1/4, 0.5, -4? 0.5 Let y be 61/(-7) - (-26)/(-91). Let w be (y/54)/((-1)/(-2)). Which is the nearest to w? (a) 2 (b) -5 (c) 4/3 c Let g(r) = 2r + 8. Let p be g(-3). Suppose 2 = -3k + p. Which is the closest to -2/7? (a) 2/23 (b) k (c) -4 b Let j = -27.1 - -31.1. Let u = -397131/68 + 5841. Let m = 3/34 - u. What is the closest to 1 in 0.2, m, j? 0.2 Let s be 7249/19770 + 3/10. Let r = 1 + -1. Suppose rg + 2 = -2g. What is the closest to 2 in 1/2, g, s? s Let p(d) = -d*3 - 7d*2 + 2d. Let f be p(-7). Let y be 26/7 - f/49. Let w = 2234/9 - 248. Which is the closest to y? (a) w (b) -0.3 (c) 0 a Let t = -130/473 + 4/43. What is the nearest to 1/4 in 3/8, t, 0.5? 3/8 Let q = -8.09 - -7.09. Which is the closest to 4? (a) q (b) 5/2 (c) -4 b Let w = 0.211 - 3.211. What is the closest to w in 0, 0.2, 4? 0 Let l = 3.419 + -0.419. What is the closest to 2/11 in 5, l, -0.1, -0.5? -0.1 Let q(c) = -5c2 - 2c + 8c + 10 + 0c + c*3 - 2c**2. Let z be q(6). Let o be z/(-5) + (-14)/(-8). What is the closest to o in -0.2, 0, -0.4? -0.2 Let d = -2462/11 - -224. Let v = 7 + 6. Let x be 2/v + 48/195. What is the nearest to -0.1 in 0, d, x? 0 Let d = 4 + -6. What is the nearest to 2/7 in d, 5, -0.4? -0.4 Let g = 7.01 - 7. Let x = 2.01 - g. Let c = x + -4. What is the nearest to 2/5 in -5, c, 4? c Let y = -2 - -7. Let g = -10 + 5. Which is the closest to 1/3? (a) g (b) y (c) 2/13 c Let g = -28 - -65. Let y = g - 32. Which is the closest to y? (a) -0.3 (b) -0.4 (c) -1/4 c Let v = -457327 + 36583883/80. Let s = v	{ "pile_set_name": "DM Mathematics" }
*3 + 11j*2. Differentiate k(l) with respect to l. -52 Let s(z) = -3794z - 2959. Let v(y) = -7589y - 5901. Let f(d) = 7s(d) - 4v(d). Differentiate f(u) wrt u. 3798 Let k(h) = -h3 + 14h*2 + 16h - 13. Let o = 72 + -57. Let y be k(o). What is the second derivative of 37q2 - 32q - 18qy - 10q*2 wrt q? 18 Let o be 24 + 18288/(-992) + 2/(-31). Let u(k) be the first derivative of 0k*3 + 9 + 0k - ok2 + 5/2k*4. What is the second derivative of u(i) wrt i? 60i Suppose -6y - 27y = -99. What is the third derivative of -2g3 + 69g + g*y - 7g*5 - 7g*5 + 15g*5 + 2g*2 wrt g? 60g*2 - 6 Find the second derivative of 1251 - 1723q*5 + q - 171q*5 + 63q*5 + q wrt q. -36620q*3 Let i(a) = -4a*2 + 43a + 33a + 5a*3 + 4 - 8a3. Let y(r) = -r4 - r*2 + r + 1. Let g(h) = -i(h) + 4y(h). Find the second derivative of g(w) wrt w. -48w2 + 18w Let x(m) be the third derivative of 2m7/35 + m5/60 + 41m*4/24 - 2321m*3/3 - 3m*2 + 85m - 4. Differentiate x(y) wrt y. 48y3 + 2y + 41 Let d(n) be the third derivative of -9n8/56 + n6/20 - 1057n4/24 + n3/6 + 1747n2. What is the second derivative of d(s) wrt s? -1080s*3 + 36s Let l(t) = -1597t2 + 2t + 15. Let u(h) = 4h2 - 2h + 1. Let i(w) = -l(w) - 7u(w). Find the second derivative of i(p) wrt p. 3138 Let t be 11/((-62)/112 - 21/(-49)). Let y be 5 - 1 - t - (-1 - -1). What is the derivative of -yp + 13p2 - 91p + 12 + 183p wrt p? 26p Let t(n) = 3363n4 - 23n*2 + 3n - 17. Let u(s) = -6727s4 + 45s*2 - 7s + 32. Let v(j) = 7t(j) + 3u(j). Find the third derivative of v(l) wrt l. 80640l Suppose 1330 = 2m + 7t - 3t, -3341 = -5m - 2t. What is the first derivative of 633p2 - 1386p*2 + mp*2 - 58 wrt p? -168p What is the second derivative of 4021h - 550h + 301h5 + 3184h*5 wrt h? 69700h3 Let p(s) = s3 - 2s2 + 2s + 6. Let y be p(-3). Let d = -43 - y. Find the second derivative of -16z + 156z*2 - 82z*d - 82z*2 wrt z. -16 Let t(c) = 2c*3 - 1. Let o(p) = 10p*3 - 62p*2 - 40p + 17. Let z(r) = -o(r) + 4t(r). Find the second derivative of z(d) wrt d. -12d + 124 Let p(h) be the second derivative of -787h5/5 + h4/6 - 2255h*2 + 2058h. Find the first derivative of p(q) wrt q. -9444q2 + 4q Let x = 11 - 12. Let f be x/(-2) - (-1228)/8. Differentiate -3 + 160c - 1 - fc with respect to c. 6 Let z(s) = s*3 + 10s*2 + 20s. Suppose 3p - 5 = 2r, -2p - 27 = -0r + 3r. Let c be z(r). Differentiate cx*2 - 3 + 15x*2 - 3x*2 - 9 wrt x. 38x Let a(s) be the second derivative of -1087s7/21 + 3s*5/20 - 19s*3/2 - 28s*2 - s - 303. What is the second derivative of a(g) wrt g? -43480g*3 + 18g Suppose 15k + 57 = 34k. Let h(q) be the third derivative of 1/3qk - 1/5q*5 - 14q*2 + 0q*4 + 0 + 0q. Find the first derivative of h(g) wrt g. -24g Let c(w) be the second derivative of -293w*7/42 + 296w*4/3 - 2w + 770. What is the third derivative of c(k) wrt k? -17580k2 Let x be 137 + 1 - 31/(-31). Let a = x + -7. Find the second derivative of a + 19r3 - 32 + 13r wrt r. 114r Suppose -20 = -o - 3o. Suppose or + 1 = 4j - 1, 2r = 4. Find the third derivative of -18u*2 + 35u*2 - 6u*3 - 4u*j wrt u. -60 Let q(x) be the first derivative of -2x*5/5 + 649x4/4 + x3/3 - 29x - 1999. Find the third derivative of q(d) wrt d. -48d + 3894 Let u(d) = 6176d - 5851. Let b(a) = 3087a - 2924. Let g(j) = -17b(j) + 8u(j). Differentiate g(v) wrt v. -3071 Suppose -62 = -3o - 242. Let l be (-6)/8o/15. What is the derivative of 6g3 + 21g*l + 28 + 1 wrt g? 81g*2 Let a = -10493 + 10493. Let h(j) be the third derivative of -1/12j*4 - 8j*2 + 17/60j*5 + 0 + aj + 0j3. What is the second derivative of h(q) wrt q? 34 Let s = -598 + 601. Find the third derivative of 55w*s - 25w*3 - 354w*2 + 26w*2 - 28w*3 wrt w. 12 Differentiate 173887 - 171586 - 429x*4 - 5464x*4 - 3539x*4 wrt x. -37728x*3 Let c = 50 + -33. Suppose 3i + o - 51 = c, 3i - 3o = 48. Find the first derivative of -17v + 8v + i + 5v3 + 9v wrt v. 15v2 Let v = -91 - -100. What is the second derivative of 28b - 20b4 + vb + 2b3 - 3b wrt b? -240b2 + 12b Let l be 6 + 2-11. Suppose 4o - 58 = -42. What is the first derivative of -6 + 1 + 33p*l - 24p*o wrt p? 36p*3 Let h(w) be the second derivative of 0w*4 - 2/5w*5 - 1 + 2/3w*3 + 20w*2 - w. Differentiate h(r) with respect to r. -24r*2 + 4 Suppose -10 + 2 = -4j. Suppose -jr + 4 = -0. What is the second derivative of 17h*2 - 18h - 18h2 + 8h*r wrt h? 14 Suppose -5w + 2i = -8w + 36, 3i = -3w + 36. Find the third derivative of -175u2 + 2u + 10u + 15u*2 - 84u*3 - wu wrt u. -504 Let o be (1/2)/((35/10)/7). Let x(w) = 93w3 - w2 + 2w. Let i(r) = r*2 - 1. Let n(a) = ox(a) + i(a). Find the second derivative of n(t) wrt t. 558t Suppose y = -5v - 2 + 11, -v = y - 1. What is the second derivative of -65w - 33w*3 - 5wv - w2 + 5w2 + w2 + 2 wrt w? -198w Suppose -3k = 2k - 15. Find the first derivative of -2u3 - 4u*k - 8010 + 8066 wrt u. -18u2 Let d(t) be the third derivative of -t9/252 - t8/28 - t6/120 + 2t5/15 - t4/24 - 2t*3 + 5162t*2. Find the third derivative of d(v) wrt v. -240v*3 - 720v*2 - 6 What is the third derivative of 541 - 541 - 210o*2 + 785o*3 + 15o*2 wrt o? 4710 Find the second derivative of 502 - m - 26 + 15m*4 - 5997652m*3 + 5997663m*3 wrt m. 180m*2 + 66m Suppose 34 = 11q - 10. Find the third derivative of -22o + 36o + 3o5 + oq + 19o2 - 16o + 23o2 wrt o. 180o*2 + 24o Let r(y) be the second derivative of -369y8/14 - y7/42 + 148y*4/3 + y + 172. What is the third derivative of r(a) wrt a? -177120a*3 - 60a*2 Let w = 5193 - 5191. Suppose -k + c = -4k + 62, -5k = 3c - 98. Differentiate kp - 17 - 22p - 4pw + 6p*2 wrt p. 4p Suppose -2a = -4 - 0. Find the third derivative of 115x*a - 16x*2 - 7x*2 + 53x*5 wrt x. 3180x*2 Differentiate 3729s - 4950s + 3174s - 1994 wrt s. 1953 Suppose -14l - 3l = 12l. What is the third derivative of -41a + la5 + 23a*5 - 91a*2 + 41a + a*3 wrt a? 1380a*2 + 6 Let v(n) be the first derivative of -755n*4 + 416n + 10551. Differentiate v(u) wrt u. -9060u2 Let h(z) be the first derivative of z6 - 51z*5/5 - 4z*3/3 - 9z*2/2 + 40z + 8201. Find the third derivative of h(x) wrt x. 360x2 - 1224x Let x(l) be the third derivative of -l*7/210 - 211l*6/30 - 7l*5/60 - 59l*4/24 - 55l*2 + 8l. What is the third derivative of x(y) wrt y? -24y - 5064 Let s be 2(27 + (-16)/(-4)). Let m = 64 - s. What is the second derivative of -23w - mw + 12w - 32w*3 - 14w wrt w? -192w Let o(r) be the first derivative of -12r + 109/4r4 - 5/3r*3 + 58 + 0r*2. Find the third derivative of o(u) wrt u. 654 Let p be 11 - (-1)/(7/(-63)). What is the derivative of 102 - 324b*p + 86b + 82b - 168b wrt b? -648b Let l(d) be the first derivative of 111d5 - d4/2 - 43d2/2 + 8d + 1197. What is the second derivative of l(m) wrt m? 6660m2 - 12m Let t be ((-7)/2)/((120/(-16))/15). Differentiate 13p - 6p + 10p2 - 8p + 45 - t with respect to p. 20p - 1 Let a(o) be the third derivative of 2029o*5/20 - 17o*4/8 - 29o*3/6 - 2o*2 - 2o + 984. What is the second derivative of a(f) wrt f? 12174 What is the first derivative of 301p2 - 98p + 204p + 2405p*2 + 10351 - 106p wrt p? 5412p Suppose 4d + 5g = 119, 4d + 5g - 26 = 3d. Suppose -36t = -dt - 30. Find the third derivative of q*3 - 21q*2 + 3q*3 - tq*3 + 4q*3 wrt q. 12 Let u be (0/1)/(-85 - -82). Find the second derivative of 14 + 290k*4 - 10k + uk + 0k*4 - 95k*4 wrt k. 2340k*2 Let s(g) be the first derivative of 151g*4/4 - 184g3/3 - g2 + 831. What is the third derivative of s(t) wrt t? 906 Let q(v) be the third derivative of -v*6/60 - 1039v*5/60 + 49v*4/24 - 2v3/3 - v2 + 134v. What is the second derivative of q(p) wrt p? -12p - 2078 What is the derivative of 172236f4 - 560 - 172286f*4 + f + f wrt f? -200f*3 + 2 What is the third derivative of -36w*2 - 33w*2 - 11 + 76w*2 - 2w*3 - 21	{ "pile_set_name": "DM Mathematics" }
hat is c rounded to six decimal places? 0.000025 Let a = -1.94 + -11.76. What is a rounded to the nearest 10? -10 Let p(c) = 2c. Let f be p(3). Suppose -fu - 180000 = -3u. What is u rounded to the nearest one hundred thousand? -100000 Let d = -0.32 + 15.32. Let h = d - 14.1. Let c = h + -0.1. What is c rounded to 1 decimal place? 0.8 Let t be (-2 - -2)/(-1 - -3). Suppose tu = u. Suppose u = 4x - 4j + 111 + 21, -5x = -2j + 156. What is x rounded to the nearest 10? -30 Suppose -2o - 3o + 29 = -3y, -3y + 3o = 39. Let p = y + 13. Let z be 180002/p + 2/5. Round z to the nearest ten thousand. -40000 Suppose 3c + 4u - 2220008 = 2u, 2c = -2u + 1480008. Round c to the nearest one hundred thousand. 700000 Let j be (0 + 0)3/6. Suppose v - 3v - 6392 = j. Let s = v - -12396. What is s rounded to the nearest one thousand? 9000 Let o = -0.5 + 0.4. Let n = 0.14 + o. Let f = n + -0.040028. Round f to 5 dps. -0.00003 Suppose -2v = -5i + 3v - 20, -5i - 4v + 16 = 0. Suppose -5j + ij - 1000000 = 0. Round j to the nearest 1000000. 0 Let j = 25 - 29. What is j rounded to the nearest 10? 0 Let o = 6 - 4. Suppose -oz + 2422776 = -593818. Suppose 0 = 2y + 371703 + z. What is y rounded to the nearest 100000? -900000 Let c = 155 - 154.9961. What is c rounded to 3 dps? 0.004 Let k = 0.0900002 + -0.09. Round k to 6 dps. 0 Suppose 7f - 2f = 30. Let r(d) = 26d*3 - 6d2. Let u be r(f). What is u rounded to the nearest 1000? 5000 Let v(y) = y3 - 5y2 - 5y - 7. Let a be v(6). Let k be (a - -4)/(1/(-7)). Let c = -11 - k. Round c to the nearest ten. 10 Let v = 0.15 + 0.29. Round v to 1 dp. 0.4 Let g = 1 + 1. Suppose -5r = -2p + 4p + 8990, -8996 = 2p + gr. Round p to the nearest one thousand. -5000 Suppose -3j - 2j + 10 = 0. Suppose ji - 200 = 3i. Round i to the nearest one thousand. 0 Let r = 6.67 - 10. Let b = 0.63 + r. Let w = b - -2.70000017. Round w to seven dps. 0.0000002 Let i(t) = -t2 + 3t + 4. Let x be i(4). Round x to seven dps. 0 Let n be 3988/(-10)(-7 + 2). Suppose -5d + 437 + n = -2l, 2d - 980 = -3l. Suppose 1213 + d = 2f. Round f to the nearest 100. 900 Let j = -31.9 + 0.9. Let v = j + 20. Let y = -11.0018 - v. Round y to 3 dps. -0.002 Let y = -6 - -23. Let l = y - 17.00000008. Round l to seven dps. -0.0000001 Let d = -117 + 106.2. Let t = -0.44 + d. Let u = -11 - t. Round u to 1 dp. 0.2 Let i = -21.89 - 1.51. What is i rounded to the nearest integer? -23 Let l = -3.93 - 0.07. Let c = l + 3.999944. Round c to five decimal places. -0.00006 Let b = -0.5 - -0.3. Let z = 0.21 + b. Let n = z - 0.1. What is n rounded to 1 dp? -0.1 Let h = 510798703.29999921 + -510798732.3. Let g = -29 - h. Round g to seven decimal places. 0.0000008 Suppose 4d = 3d + 4. Suppose 0 = -x + dy + 100, 331 = 5x + 3y - 146. What is x rounded to the nearest ten? 100 Let a = 79.3 + -79.30000331. What is a rounded to 6 decimal places? -0.000003 Let x = -69.123 + 69. What is x rounded to two dps? -0.12 Suppose 334 = -d + 879. Let m = d - 339. Suppose 0 = 5i - m - 294. What is i rounded to the nearest 1000? 0 Suppose 0 = 3m - 2k - 3k - 436, -5k - 578 = -4m. Round m to the nearest 10. 140 Let l(j) = 2 - 6 + 0 + 2 + 566666j. Let o be l(-3). What is o rounded to the nearest 1000000? -2000000 Suppose -5v - m - m = 44500010, 35600025 = -4v - 5m. What is v rounded to the nearest one million? -9000000 Suppose 0 = 5y + 5t + 13 + 2, -2y - 3t - 10 = 0. Let v be y - (26 + 0 + 2). Round v to the nearest ten. -30 Let s = -18770981941 + 18770981707.811416554. Let k = -1.188573146 - s. Let t = k + -232. Round t to 6 decimal places. 0.00001 Let f = -29 - -29.017. Let c = -0.2 + 0.21. Let v = f - c. What is v rounded to 3 decimal places? 0.007 Let n = 20 + -14.8. What is n rounded to 0 dps? 5 Let z(v) = v2 + v - 1. Let c be z(1). Let x be ((-4 + 4)/(1 + -3))/(-3). Let n be -2((-6)/c - x). Round n to the nearest ten. 10 Let c = -7 - -37. Let w = c - 44. Let q = -13.964 - w. What is q rounded to 2 decimal places? 0.04 Let d = 85 + -135. Let b = d + 55.8. Round b to the nearest integer. 6 Let s = 58 - 58.055. Round s to two dps. -0.06 Let d = 10 - 6. Suppose 3c - 225978 - 104022 = 0. Suppose -dp + c = p. Round p to the nearest ten thousand. 20000 Let w = -22.82 - -23. Let t = -0.1868 + w. Round t to three decimal places. -0.007 Let f(h) = -385h. Let y be 104/40 - 6/10. Let k be f(y). What is k rounded to the nearest 100? -800 Let z be (-164)/6(10/5 - -1). What is z rounded to the nearest integer? -82 Let f be -10(-1 - -3)/((-3)/6). Round f to the nearest 100. 0 Suppose -2d + 17 + 193 = 0. Suppose -2g - 3n - d - 2 = 0, g - 5n + 73 = 0. What is g rounded to the nearest ten? -60 Let p = -15 + 10. Let r = p + 2.1. Let v = r + 3.92. What is v rounded to one decimal place? 1 Let a = 4820114 + -934601. Let z = 3885512.95099899 - a. Let r = z + 0.049. What is r rounded to seven decimal places? -0.000001 Suppose d + 3399996 = 2d + 2p, 0 = -4d + p + 13600002. Round d to the nearest 1000000. 3000000 Let o be (9/12)/((-1)/(-4)). Suppose -3 = 5z - 13, -op + 5z + 239 = 0. Round p to the nearest ten. 80 Let t be 3(-8)/6 - -21004. What is t rounded to the nearest one thousand? 21000 Let n = -0.4 + 1.1. Let s = 0.1 + n. Let v = s - 0.799976. Round v to 5 dps. 0.00002 Let m = -50.0074 + 50. What is m rounded to 3 decimal places? -0.007 Let k = 0.16 - 0.08. Round k to two decimal places. 0.08 Let l = -0.0608 - -0.07295. What is l rounded to three dps? 0.012 Let x = 1.787 - 0.067. Let c = 0.9 - 3.1. Let u = x + c. What is u rounded to 1 decimal place? -0.5 Let a = -27.04 - -13.07. Let k = -0.03 + a. Let m = k + 13.978. Round m to 2 decimal places. -0.02 Let f = 39 + 19. Let w = 58.224 - f. What is w rounded to 2 decimal places? 0.22 Let l = 38 + -37.808. What is l rounded to 2 decimal places? 0.19 Let i = -5.2 + 5.62. Let c = 3.046 - 0.066. Let d = i + c. What is d rounded to zero decimal places? 3 Suppose 0 = c + 1, 0 = -2y + 4y + 4c. Suppose -ya - 13 + 3 = 0, 0 = 4i + 2a + 282. Let g = -130 - i. Round g to the nearest ten. -60 Let c be (-100)/(1/809/2070). Round c to the nearest 100000. -1800000 Let i be ((-20)/12)/((-2)/(-6)). Let l be 6(1 - 10/6). Let h = i - l. What is h rounded to the nearest 10? 0 Let w = 6 + -4. Let y = 2 - w. Let u = y + 0.000008. What is u rounded to five decimal places? 0.00001 Let q = -22.986 + 23. Round q to two dps. 0.01 Suppose 4w - 343 = 277. Round w to the nearest 10. 160 Let g = 7.88836 - 9.889. Let s = -2 - g. What is s rounded to 4 decimal places? 0.0006 Let l(v) = -3601v*2 - 2v - 1. Let z be l(-1). What is z rounded to the nearest one thousand? -4000 Let o = -663237.000003 - -663243. Let g = o - 6. Round g to six decimal places. -0.000003 Let q = 1289.21 + 50658.79. Let z = q - 51959.0066. Let n = 11 + z. What is n rounded to 3 decimal places? -0.007 Suppose 3193743 = -2i + 5i. Let a = 564581 - i. Round a to the nearest 100000. -500000 Let d = 42.3 + -11.5. Round d to the nearest integer. 31 Let l = 0.3159 - 957.8159. Let a = -957.0001 - l. Let v = a + -0.5. What is v rounded to three dps? 0 Suppose -8i - 320000 = -4i. Round i to the nearest 10000. -80000 Let l(p) = 19p3 - 6p*2 + 21p - 14. Let d be l(6). Round d to the nearest one thousand. 4000 Let x = -51 - -51.00000033. What is x rounded to 7 dps? 0.0000003 Suppose j = -o - 0j + 79, -3j = -4o + 309. Let u = o + -47. Round u to the nearest 10. 30 Let z = 0.08 - -4.92. Let x = z - 5.0003. What is x rounded to 3 decimal places? 0 Let g(u) = -u2 - 11u - 5. Let n(j) = -j*2 + j + 2. Let f be n(-3). Let m be g(f). Let z be (-40002)/m - (-4)/10. What is z rounded to the nearest 1000? -8000 Let s = -11.1 - -11.0929. What is s rounded to three dps? -0.007 Suppose i = -4i + 60135. Suppose -5a - u = 975 + i, 0 = -3u - 6. What is a rounded to the nearest 1000? -3000 Let b = 34 - 62. Let k = 27.9999946 + b. What is k rounded to six dps? -0.000005 Let x = 0.484 - 0.094. Let r = -0.26 - x. Round r to one dp. -0.7 Let v = -22 + 25.2. Let r = 238.9 + -229. Let g = r - v. Round g to the nearest integer. 7 Let r be (-1876004)/(-14) - (-6)/(-21). What is r rounded to the nearest ten thousand? 130000 Suppose g = -67 - 14. Let y = g + 986. Sup	{ "pile_set_name": "DM Mathematics" }
-6 2((-25)/(-12) - (-29)/(-348)) 4 Evaluate (-1 - 24/(-28))1. -1/7 Calculate -17 + 14 - (-1 + (-48)/22). 2/11 What is (-44)/(-10) - (112/(-20) + 6)? 4 What is the value of ((-16)/((-320)/30))/(1/(-2))? -3 -4 + 42/12 - 3/(-14) -2/7 Evaluate (-282)/30 + 6 + 4. 3/5 Evaluate (-270)/(-243) - 26/(-9). 4 Evaluate 27/(-2) - (-46)/6. 2/3 What is (6/162 - 0)/(4/24)? 2/9 What is the value of ((-63)/28 - -4)/(6/(-24))? -7 Evaluate 54/9 + (-3 - 1) - 6. -4 Calculate (0 + -1)/(4/12). -3 (-12)/(-27)1/(-2) -2/9 What is the value of (-34)/(-28) + 30/(-20)? -2/7 What is -12(-112)/(-1617) + 4/14? -6/11 What is (168/60)/(-7)(-15 + 0)? 6 Evaluate (-2)/4(7 + -3). -2 Evaluate (23/46)/((-38)/(-8)1). 2/19 ((-3)/(-12))/(-1) - (-455)/140 3 Evaluate 12 + -2 + -13 - (-13)/3. 4/3 What is the value of 2 - -2(-1)/(-2)? 3 0 + (45/24)/(-5) -3/8 ((-150)/(-375))/((-3)/5) -2/3 Calculate ((-30)/12)/(2/4). -5 Evaluate -12 + (-294)/(-24) - (-27)/4. 7 What is the value of (3 + 4 + -6)3? 3 ((-1)/(-9))/(6 + (-70)/12) 2/3 Calculate (27 + -23)(-1)/2. -2 Evaluate ((-2)/5)/(-1) + (-54)/10. -5 Evaluate -8 - ((-608)/77 + (-52)/182). 2/11 Evaluate (-24)/(5 + -9) - 1. 5 (-14)/63 + 4/18 0 (-4 + 6 + -3)/1 -1 What is 140/282/(-2)? -5 Evaluate (6 - 3) + -4 + 3/5. -2/5 (-4)/(-3)(-60)/(-16) 5 What is the value of 0 - (18/(-3) - (-78)/14)? 3/7 6/(-14) + -13 + (-676)/(-91) -6 What is (5/10)/(6/(-8))? -2/3 Calculate (24/(-10) - -2)/(138/115). -1/3 Calculate 2/30(-2)/((-10)/(-15)). -1/5 Evaluate 329/(-238) - (-12)/8. 2/17 What is 161/(-280) + (-24)/(-64)? -1/5 72/4414/(-42) -6/11 Evaluate ((16/(-10))/(-2))/(17/(-85)). -4 Calculate 9/((-243)/(-6)) + (-129)/(-27). 5 Calculate 50 + -51 + (-9)/(-5). 4/5 What is the value of (-4 - -7)6/(-117)? -2/13 Evaluate (2/12 - 10/60)1. 0 What is the value of 1-9 + (-3465)/(-378)? 1/6 Calculate (-147)/54 + (-4)/(-18) - -2. -1/2 Calculate (-11 - -15 - 5)91. -9 Evaluate -4 + 220/275 + (-31)/(-5). 3 What is (6 + (2 - 8))/((-4)/2)? 0 Evaluate (1/5)/((-90)/150). -1/3 What is the value of -7 + (-6 + 60)/6? 2 Calculate ((-96)/238 - 2/(-7))-1. 2/17 What is 16/10((-30)/8 - -4)? 2/5 -1 - 1/(-7) - (-4)/7 -2/7 What is the value of -1 - (408/(-792) + 2/11)? -2/3 Calculate (-2)/(5 + -6 - -3). -1 Evaluate (-3 + -1)(10 - 81/9). -4 Evaluate ((-32)/120)/(10/(-25)). 2/3 What is the value of ((-2)/30)/(17 + (-608)/36)? -3/5 What is the value of ((-4)/(-14))/((-1)/(-7)) - 7? -5 What is the value of 4/(8/(-14)) - (-7 - -5)? -5 Evaluate ((-5)/(-4) + -2)/((-3)/(-2)). -1/2 What is ((-10)/(-4))/(6/(-12))? -5 Evaluate 24/14 - 14/(-49). 2 What is 15/6(-68)/(-34)? 5 (340/55 - 6) + (-52)/165 -2/15 50/(-10) - (-66)/6 6 1(-6)/(-8)16/(-4) -3 (2/4)/((-438)/(-292)) 1/3 Evaluate (-70)/(-315) - 68/(-18). 4 Evaluate 1/((-5)/(-4))310/(-1364). -2/11 -6 - 205/(-15) - 8 -1/3 What is the value of (-10)/80 - (-18)/80? 1/10 Calculate (-209)/(-264) + (-1)/8. 2/3 What is the value of 4/10 - (-11)/((-495)/48)? -2/3 Calculate 17/(-3) - 84/(-126). -5 -31/21 - (-6)/(-7) -1 What is ((-123)/15 - -1) + (-5)/(-25)? -7 Evaluate (16/(-10) - 0)/((-18)/45). 4 What is the value of 245/(-343) - (-80)/14? 5 ((-3)/(6/4))/(-1 - -3) -1 Calculate (28/(-35))/((-8)/(-80)). -8 Calculate 8/(-15) - 3/(-60)4. -1/3 ((-2)/(-24))/((-45)/12 - -4) 1/3 2 - 5/(110/33) 1/2 Evaluate -7 - (-10 - 78/13). 9 (-98)/(-441)-31/(-4) 1/6 Calculate (-2)/3 + (15/9 - 0). 1 What is the value of ((-12)/7)/((-240)/(-42) - 6)? 6 What is the value of (-40)/(-69) + -1 - 27/(-81)? -2/23 What is (-18)/54 + (-13)/(-3)? 4 Calculate 0 - (-4)/(5/2 + -2). 8 What is 4 - -40(-8)/60? -4/3 ((-3)/(-99))/(18/(-324)) -6/11 Evaluate (39/(-9))/((-12)/9) - 3. 1/4 Evaluate (3/9)/(-94 + 92). -1/6 Evaluate ((-8)/20)/(8/100). -5 What is the value of 3234/68? 3 What is the value of 2/(-45)(-125)/50? 1/9 Calculate -4 - 8((-21)/4)/7. 2 Calculate (1 - 3) + 5(-72)/(-200). -1/5 -4((-2)/16 - 18/48) 2 What is the value of -4((-28)/(-84))/(8/(-6))? 1 What is (6/24)/(((-2)/2)/2)? -1/2 What is the value of 8/(-2)(-14)/(-84)? -2/3 Evaluate -6 + 3 + (-539)/(-176). 1/16 What is the value of 5 + -3 + 1 - (6 - 7)? 4 Calculate (12/(-48)4)/(2/12). -6 Evaluate -3 + 3 + 0 - -2. 2 Calculate (-4)/(-20)(5 - 90/42). 4/7 Calculate 58/14 - 3/21. 4 Calculate 3/(-15 + 3) - (-2)/8. 0 Evaluate 1/(-3) - (-9)/(-27). -2/3 Calculate (-35)/(-11) + 26/(-143). 3 What is the value of (-80)/70(-56)/32? 2 12(105/30 - 22) -6 (-4)/1030/(-1 + 4) -4 -4 - (16/7 + (-6)/21) -6 What is (1/(-3))/((-2)/61)? 1 What is (-2)/10 + 1530/400 + -4? -3/8 Calculate (-4 - (-44)/12)(-3 + 3). 0 What is the value of -8(-5)/(-10)1? -4 What is ((5/(-15))/1)/(-1)? 1/3 Evaluate ((-16)/(-32))/((-2)/(-28)). 7 What is the value of 57/(-38)4/(-30)? 1/5 What is the value of 138/(-42) + 3 + (-64)/(-126)? 2/9 Evaluate (56/24)/(14/(-42)). -7 What is the value of 1-4 - (8 - 11)? -1 What is the value of 56/(-30) + 6 + -1? 4 What is 2/10(-15)/(-9)? 1/3 What is -7 - 8/16236/(-14)? 10/7 What is ((-2)/(-3))/(10/60)? 4 What is the value of 441/91 + (-12)/(-78)? 5 What is the value of (30/(-3)(3 - 2))/2? -5 Evaluate (2 - 5/(-1))52/(-182). -2 Evaluate (-30)/(-50)(-4)/3. -4/5 Evaluate 4/(1(-10)/5). -2 Calculate (3/(-4))/((-3 + -2)/(-20)). -3 Calculate (6/(-30))/((-2)/(20/6)). 1/3 What is the value of -20(-44)/(-216) + 8/2? -2/27 Evaluate 533/(-52) - 2/24-3. -10 Evaluate 1 - (-29)/(-30) - (-15)/150. 2/15 Calculate (-8)/10(-49)/(-392). -1/10 Calculate (-1)/(6/(-16))(-42)/(-28). 4 Evaluate (-11)/(-2) + 66/(-44). 4 1 + -7 - (-3 + 2) -5 Calculate -3(-5)/(-30)2. -1 Calculate 21/(-7)(3 + (-30)/9). 1 What is the value of ((-21)/(-4) - 3) + (-3)/4? 3/2 -4 + (2100/(-16))/(-21) 9/4 What is -5 - -8 - 16? -3 ((-8)/(-10))/((4/20)/1) 4 What is 3/616/(80/(-45))? -9/2 What is the value of 9/(-72) + (-7)/8? -1 ((-5)/(-10))/(75/(-90)) -3/5 Evaluate (4/(12/(-3)))/(2/2). -1 What is (12 + -5 - 6) + 0 + -5? -4 What is the value of (-272)/1122 + -1 + 12/9? 1/11 (9/(-3 + (-6)/(-4)))/2 -3 What is ((-3)/18)/((-6)/(-40)5)? -2/9 Evaluate -6 - (1/4 + 1068/(-176)). -2/11 ((-1)/2)/(11/88) -4 Evaluate (-6)/(-4) - 2189/(-398). 7 90/36(0 + 2) - 4 1 What is the value of (3 - (-66)/(-18))(-9)/2? 3 (-80 - -85) + 22/(-4) -1/2 What is -6 + (-8)/(-12)9? 0 Calculate (-1)/((-76)/(-8) + -5 - 2). -2/5 Calculate (39/9 + -5)/((-156)/(-18)). -1/13 What is (-720)/(-288) - 10/(-4)? 5 What is 4 + (-1180)/380 + (-2)/2? -2/19 (-1)/(-7) - 400/56 -7 What is (-15)/(-8)(-18)/27? -5/4 (-6)/(-39) - 384/1144 -2/11 Calculate (6/21)/(1/2-1). -4/7 (-8)/(-5)90/72 2 Evaluate ((-126)/378)/((-1)/(18/4)). 3/2 What is (-102)/12 - 20/(-8)? -6 What is 0 + 2 + 63/(-27)? -1/3 What is the value of -22(-15)/20? 3 What is the value of 5285/6644 + (-1)/4? 6/11 What is the value of (-10)/(-6) - 98/(-42)? 4 Evaluate (-26)/(-14) + (-8 + 17)/63. 2 Calculate 272/(-72) + 2 - (-2 + 0). 2/9 Evaluate 4(803/(-1694) + (-6)/(-14)). -2/11 What is 6/16 + (-3)/(-120)? 2/5 What is 0(1/1 - 2)? 0 24/15(-1)/(-2) 4/5 Calculate (-64)/(-40)10/8. 2 Evaluate (-20)/8 + (5/(-2))/5. -3 (2 - (-8 - -4))(-6)/(-45) 4/5 (1-2)/(43/((-4257)/22)) 9 3 + (-1)/1 - 3/1 -1 What is (-10)/412/(-255)? 2/17 Evaluate 22/55(-6)/4. -3/5 (-3)/(30/(-4))15/(-4) -3/2 Evaluate (-27)/1805 - (-19)/36. -2/9 Evaluate 3/(-12)(-34)/51. 1/6 What is 6/4(-7)/(252/(-8))? 1/3 What is (-6)/(-14) + 308/196? 2 What is the value of (-10)/15 - (-7)/(-3)? -3 What is the value of 9 - -51205/(-675)? 2/27 What is (10/(-25))/(1/10)? -4 340/4335(-3)/2 -2/17 Evaluate 24/(-3) - (-3 - 1). -4 What is 6 + 306/(-48) - 0? -3/8 Evaluate (-3 - -4) + (1/3 - 1). 1/3 Calculate 11/5 + (-3)/15. 2 What is ((-2)/9)/(-2)(-411 + 405)? -2/3 What is (-6 - 0)(-17 - (-49)/3)? 4 (5 + -6 - -7)/(-14) -3/7 What is 88/42 + 3 + 2 + -7? 2/21 10/4(112/40 - 4) -3 ((-3)/90)/((-16)/(-120)-3) 1/12 0 + (24/7 - 15/35) 3 What is the value of (-26 + 8 - 3)(-1)/3? 7 Calculate 247/572 - ((-2)/(-8) - 0). 2/11 Evaluate 1 - -5 - (-9)/(-1). -3 Calculate (-5)/(-25) + -1 + 0. -4/5 (-44)/(-55)(-60)/(-8) 6 What is 246/451 - (-204)/(-495)? 2/15 Evaluate 1/6 + (665/(-90))/19. -2/9 What is ((-216)/162)/(6/45)? -10 What is the value of (651/(-4))/3112/(-9)? 7 Calculate (-3)/(2/(-7) - 37/(-56)). -8 Evaluate (0 + 4/60)*(-5 - -2). -1/5 0 + 1 + -3 - 18/(-36) -3/2 Evaluate (	{ "pile_set_name": "DM Mathematics" }
2f093 Convert 1486424 (base 13) to base 2. 11001000000001011110101 What is -150321 (base 7) in base 4? -13010232 What is -1535714 (base 8) in base 15? -8ab47 Convert 20200121120002 (base 3) to base 13. 976175 10112223 (base 4) to base 11 12444 Convert -1784 (base 15) to base 4. -1033102 -17cf5 (base 16) to base 3 -11221210001 Convert -9842742 (base 10) to base 9. -20461630 -14043101 (base 5) to base 11 -98919 Convert 11122100200 (base 3) to base 2. 10110010011111010 51552255 (base 7) to base 4 100201223010 Convert 445b6d (base 14) to base 15. 30ca3d What is 1121101202111 (base 3) in base 12? 352404 Convert -130023221 (base 4) to base 6. -2250225 What is 78786 (base 10) in base 3? 11000002000 What is -1517675 (base 10) in base 6? -52310135 -42b79d (base 14) to base 10 -2259823 What is 2002121100 (base 3) in base 10? 41265 76074b (base 12) to base 13 504c20 What is 3341442 (base 6) in base 13? 5bb29 -10220202121 (base 3) to base 12 -38751 Convert -366021 (base 8) to base 5. -13012334 -59536 (base 13) to base 4 -213322030 What is -232922 (base 10) in base 8? -706732 Convert 22232000332 (base 4) to base 12. b3613a Convert 1557261 (base 8) to base 4. 1231322301 -100110111000111 (base 2) to base 3 -1000022110 What is 2012001111121 (base 3) in base 5? 244144033 Convert 7419988 (base 10) to base 9. 14858271 What is 1720327 (base 8) in base 7? 4151341 Convert -29963b (base 12) to base 2. -10101011000101001111 Convert 435061 (base 7) to base 3. 10212111211 6019008 (base 11) to base 9 22041243 2072164 (base 11) to base 13 9a986c What is 4404396 (base 10) in base 8? 20632254 What is 5466007 (base 10) in base 13? 1194c31 What is -17a689 (base 11) in base 13? -99504 What is 112201221000 (base 3) in base 10? 290088 Convert 497ac (base 15) to base 16. 39474 What is 244644101 (base 7) in base 8? 72612236 -101010100001000111001 (base 2) to base 9 -2553110 Convert 556c37 (base 13) to base 14. 3a622a 36031112 (base 7) to base 5 1303343002 What is -47083 (base 14) in base 6? -3412511 -236465 (base 8) to base 12 -3abb1 10110001010011111 (base 2) to base 5 10401113 14284621 (base 9) to base 13 160ca92 -1011031131300 (base 4) to base 3 -1021010202122020 What is -4033345 (base 6) in base 10? -191297 Convert 3742145 (base 13) to base 5. 13400321332 Convert -42033505 (base 6) to base 8. -4512361 -2123bb9 (base 12) to base 13 -13b6699 Convert 223102302112 (base 4) to base 14. 1715db0 Convert -5488b (base 12) to base 16. -1b4eb -14db11 (base 14) to base 4 -2302003303 Convert -406623 (base 8) to base 3. -20211120020 -3459982 (base 10) to base 11 -1a53599 10101111110010101 (base 2) to base 9 146415 Convert -10010011001100010111100 (base 2) to base 9. -10061202 -132863 (base 14) to base 7 -5416553 265013 (base 9) to base 12 792a9 1112121020220 (base 3) to base 8 3077245 85d6 (base 14) to base 8 55120 3412231234 (base 5) to base 10 7539569 Convert -617461 (base 14) to base 5. -1320113222 Convert 191a90 (base 12) to base 13. 124908 Convert -66421c (base 13) to base 14. -469919 4b557 (base 12) to base 13 379c0 What is 12210011120112 (base 3) in base 12? 1042a4b -2756631 (base 8) to base 9 -1414627 11310212 (base 4) to base 6 302222 Convert -554121433 (base 6) to base 8. -46101575 What is -1225452045 (base 6) in base 16? -d9b6dd Convert 122003321102 (base 4) to base 6. 402232122 -38799a (base 12) to base 3 -1202001002101 What is -34240 (base 6) in base 11? -3708 What is 261601 (base 8) in base 7? 526222 Convert -259e6 (base 15) to base 4. -131120232 -84a9a2 (base 14) to base 8 -21070742 -10111100110111100100101 (base 2) to base 3 -102122102111012 -123063026 (base 7) to base 16 -76b7c1 Convert -50d72 (base 16) to base 13. -b793c -210011005 (base 6) to base 8 -15706555 -101001101101111000001111 (base 2) to base 13 -235b802 1101432340 (base 5) to base 8 11034717 285447 (base 9) to base 13 61618 Convert 1a7dd7 (base 15) to base 5. 312324002 Convert -135134412 (base 6) to base 8. -12431110 Convert 2440225 (base 7) to base 5. 34442442 11100113100 (base 4) to base 2 101010000010111010000 526063 (base 12) to base 6 43440203 What is -b8d4 (base 14) in base 11? -21aa5 -17614653 (base 8) to base 3 -21210002121201 Convert 6102744 (base 9) to base 14. 60845a What is 124443311 (base 5) in base 10? 624831 Convert 1221201212 (base 3) to base 15. b5ce -5415230 (base 7) to base 4 -2201003330 Convert 256a620 (base 12) to base 9. 14755226 -10210102122110 (base 3) to base 10 -2016156 Convert -571624 (base 8) to base 16. -2f394 What is 478ba (base 15) in base 5? 24244400 -1548a (base 11) to base 12 -107b2 Convert -521a13 (base 14) to base 5. -1202130143 What is -33331123 (base 4) in base 13? -239a7 What is -25d54d (base 16) in base 13? -68a72c What is 122112202122 (base 3) in base 13? c1283 What is 1299a (base 12) in base 11? 18269 Convert -875853 (base 9) to base 16. -7f9a4 What is -17c837 (base 13) in base 14? -118406 Convert -a44a9a (base 11) to base 12. -6898b1 Convert 122102210100122 (base 3) to base 15. c309be What is 60295 (base 12) in base 5? 12443232 What is 313177 (base 8) in base 2? 11001011001111111 Convert -2eb90a (base 15) to base 13. -614926 11c0b (base 14) to base 9 65628 What is 2769139 (base 11) in base 9? 8870758 What is -10031032201 (base 4) in base 5? -240242003 210103542 (base 6) to base 9 6768748 Convert -940592 (base 14) to base 15. -68a0c8 Convert 10011111000110100 (base 2) to base 12. 3b184 911462 (base 14) to base 10 4882446 -128566 (base 10) to base 6 -2431114 1303002 (base 4) to base 9 11080 50341305 (base 6) to base 4 11130300221 What is 5744 (base 16) in base 15? 6945 What is 6084728 (base 9) in base 7? 36402413 -101011001101100100000110 (base 2) to base 10 -11327750 Convert 237462 (base 8) to base 13. 2b269 Convert 33412412 (base 5) to base 8. 1077514 -291cbf (base 16) to base 11 -1580326 What is 3b1629 (base 12) in base 7? 11210013 -10132132221 (base 4) to base 14 -2278b7 -2b96835 (base 12) to base 5 -4240013210 873c5 (base 16) to base 15 ae1d5 -31204560 (base 7) to base 3 -11221021211120 Convert -2130334112 (base 5) to base 15. -5eb13c What is 7003702 (base 9) in base 8? 16147133 Convert 210120212121 (base 3) to base 10. 424915 What is 3c54a (base 15) in base 12? 9402a -210424 (base 10) to base 2 -110011010111111000 2302231110 (base 4) to base 6 23404500 Convert 1430100102 (base 6) to base 13. 3869b10 What is -108561 (base 10) in base 12? -529a9 -222100030 (base 4) to base 10 -173068 Convert 110100111000001010 (base 2) to base 5. 23412321 What is -210010112002002 (base 3) in base 13? -2432423 Convert -12100122012022 (base 3) to base 6. -141004012 -644a20 (base 12) to base 11 -992354 Convert -111102002102 (base 3) to base 2. -1000000011100011011 What is 110112101110 (base 3) in base 16? 3c39c Convert -1ab527 (base 12) to base 5. -110212301 Convert -1104444312 (base 5) to base 7. -26404510 What is 321111200 (base 4) in base 14? 6182c 3929a (base 12) to base 2 10011000101010110 Convert -832c88 (base 14) to base 10. -4425800 Convert 6528c4 (base 15) to base 5. 2213134414 Convert 2584342 (base 10) to base 4. 21312330112 Convert -426421 (base 8) to base 10. -142609 What is -440738 (base 10) in base 15? -8a8c8 154110033 (base 6) to base 13 8a88a1 Convert 1120304013 (base 5) to base 15. 348a08 Convert 48b617 (base 13) to base 10. 1738861 Convert 2382206 (base 9) to base 10. 1294143 146614 (base 9) to base 12 4421a 3066e (base 15) to base 12 74895 What is 36e3da (base 16) in base 6? 205034014 53202 (base 11) to base 14 20318 What is 1fe763 (base 16) in base 6? 112451511 What is -64283 (base 11) in base 15? -1ca88 What is -30414d (base 14) in base 11? -a0a742 284416 (base 10) to base 2 1000101011100000000 Convert -13213103232 (base 4) to base 5. -1002333024 -1388416 (base 9) to base 7 -6343605 What is -36243 (base 8) in base 14? -592b 37661 (base 11) to base 5 3212113 What is -30352 (base 6) in base 14? -167a -3475816 (base 9) to base 6 -104151110 What is -151413413 (base 6) in base 15? -4260a3 What is -24111434 (base 5) in base 7? -1615254 What is 13027432 (base 8) in base 15? 3c2e7c What is -528888 (base 9) in base 5? -40034202 Convert 23610263 (base 7) to base 14. 3ca7a3 Convert 14355041 (base 6) to base 15. 9c5ed Convert 85a391 (base 11) to base 7. 14455605 What is 39	{ "pile_set_name": "DM Mathematics" }
) assuming f is positive. f(-1120/17) Simplify ((x/x(-1))*(-3/26)xx7/xx(-2))(-11) assuming x is positive. x(-682/13) Simplify ((f(-1)/ff(f*(5/6)f)/f)/((f/f0)/f)14)(-4/5) assuming f is positive. f(2/15) Simplify (h(-1/2)/(h/(h/(h(-22)h))h))/(h*(2/9)hh14) assuming h is positive. h(77/18) Simplify (n(-3/29)/(n/(n32n)n))/((n/n(13/2))/n(-4)) assuming n is positive. n(1879/58) Simplify (x(-2/3)/(x/(xx*(-1))))/(xxx/(x(-13)x)xx10/x) assuming x is positive. x(-80/3) Simplify (d/d(-2))/(d(4/9)/d)(ddd(-3/4))42 assuming d is positive. d(1009/18) Simplify (g(1/2)/gg((g/(g/(g/(gg*8g))))/ggg)/g)/((gg(5/2))/(gg13)) assuming g is positive. g2 Simplify (g*11g*1g*1g(2/15))33 assuming g is positive. g(2167/5) Simplify ((g(-2/19)(g/((g(-2/9)/gg)/g))/g)19)47 assuming g is positive. g(8977/9) Simplify (d/d6dd)/(d*(2/3)/dd)d(2/7)/(d(-12/5)/d) assuming d is positive. d(2/105) Simplify ((t(2/7))39/(t(2/7)(tt(-3))/tt))(-1/3) assuming t is positive. t(-30/7) Simplify p*(-1/4)/(pp/(p*5/p))(p(1/6))(-22) assuming p is positive. p(-23/12) Simplify (n3)*(9/4)(n*5n)(-2/27) assuming n is positive. n(227/36) Simplify ((w/(ww/(w(-13)w)w)w)/w)/(((w/w*(5/4)w)/w)/w)(w(ww/w4)/ww)(-1/75) assuming w is positive. w(-3821/300) Simplify ((nn(-1/5)/nnn)/n)(-18)(n/((n*(-3)/n)/n))/((n/(nn*(-2/9))n)/n) assuming n is positive. n(-388/45) Simplify x(-3/4)/((xx/((x/(x(-4/11)/x))/x)x)/xx)x*(2/13)/(xx6) assuming x is positive. x(-5281/572) Simplify (((q/(q/(q/q1)))/q4)(-2/33))(-8/7) assuming q is positive. q*(-64/231) Simplify (zz*(-1)zz7)(-3/11) assuming z is positive. z(-24/11) Simplify ((i(-8)/i10)/((i(1/7)/iii)/i)(-42))(-25) assuming i is positive. i300 Simplify l(1/13)/(l/(l(l/l*(-2/17)l)/l))((l/l8ll)/l)/l(-11) assuming l is positive. l(1369/221) Simplify j(-11)/j(-4)j*(2/19)j(-7)/j assuming j is positive. j(-283/19) Simplify ddd*(9/7)(ddd*(-4/7)d)/dd(-27)/d(-19) assuming d is positive. d(-23/7) Simplify h(-3)/hh/(h/(h*(-1/9)hh))((hh(-2/55))/h)/((h/(h17h))/h) assuming h is positive. h*(7847/495) Simplify (r((rr(r*37/r)/r)/rrr)/rrrr)/r*(-2/69)(r(-4/7))(-7) assuming r is positive. r(3107/69) Simplify ((f2/f)/ffff)(-2/3)f*(2/67)/f((f/(f/(ff(-3/13))))/f)/ff assuming f is positive. f(-2788/871) Simplify (r/(r(-4)r))/(r/(r(-1/14)/r))(r/(r*(-18)r)r)(5/4) assuming r is positive. r(719/28) Simplify ((k/(k(-2/67)k)k)/k)/k10k*7((k/k12)/k)/k assuming k is positive. k(-1070/67) Simplify (((tt(-5/3))/(t/(t(1/9)tt)))/(t1)(-30))(1/26) assuming t is positive. t(137/117) Simplify ((v/((vv/(v/v*12)v)/v))16)(-4/11) assuming v is positive. v(768/11) Simplify (y(-6/11))(-3/14)/(y(2/55)/y(-4)) assuming y is positive. y(-1509/385) Simplify d/((d(dd*0d)/d)/d)d/((d/(dd*0))/d)(d/d(-1))(-3/26) assuming d is positive. d*(23/13) Simplify ((yy/(yy(-1/2)/y))/(y7/y)y/y*(1/4)y/(y(-3/2)/y))(-18) assuming y is positive. y(-27/2) Simplify ((d(1/3))*(24/7)(dd(-2/29))/d(-2))13 assuming d is positive. d(10751/203) Simplify (i/(iii(i/i*(-5/2)i)/i))(-40)/(i17ii(-2/25)) assuming i is positive. i(5052/25) Simplify (((rr4)/rr/(rrr(2/23)))(1/13))(1/55) assuming r is positive. r(67/16445) Simplify (y(yy(-11))/y)/(y/(y/(y(2/11)yyy)))yy8(y*(1/14)y)/y assuming y is positive. y(-633/154) Simplify ((k(1/8)/k)/k)(-41)/(k(1/22)k(-1/37)) assuming k is positive. k(250245/3256) Simplify (s/((s(ss4s)/s)/s)s)28(ss13)/ss(5/4)/s assuming s is positive. s(-283/4) Simplify (a*(-4)a*(-3/4)(a2/a)(-4/29))44 assuming a is positive. a(-6237/29) Simplify (d(1/6))(-1/15)/(dd(-1/2)d(3/4)) assuming d is positive. d(-227/180) Simplify (z*0z5)/((z(1/14)z)/z(-1/7)) assuming z is positive. z(53/14) Simplify (h(-2/9)/h(-3/13))/(h(-3))(7/5) assuming h is positive. h(2462/585) Simplify ((s(-8))34)(3/14) assuming s is positive. s(-408/7) Simplify (u/(u/(uu(u/u(4/7)u)/u)))*(-25)/(uu(-3/2)/u)18 assuming u is positive. u*(-236/7) Simplify (q/(q/(q/(qqqq/(q/q*(-14)))))((q*(-3)/qq)/q)/q)/((qq/(q/((qq/(q/(q/q(-2/17))))/q)))/(q/((q/q(-6))/q))) assuming q is positive. q*(-2/17) Simplify (bb/b*(-23)((b28/b)/b)/b)/(b(-22)/bb(-14)) assuming b is positive. b87 Simplify (((q(qqq*(1/4)q)/q)/q)/qq)(-20)/(((qq*(-3/5))/q)/qq(((q(-27)q)/q)/q)/qq) assuming q is positive. q(-82/5) Simplify (s(-4/5)/(s5ss))/(s(-2/49)/(ss(-6))) assuming s is positive. s(-3126/245) Simplify ((u(-16))(4/7))23 assuming u is positive. u(-1472/7) Simplify (mm(-49)mm(16/9)/mm)(-18) assuming m is positive. m814 Simplify (x*(-11)x)*(2/47)x(-26)/(x/(x(-7)x)) assuming x is positive. x(-1571/47) Simplify (r(3/5)/rr(-3))(1/10) assuming r is positive. r(-17/50) Simplify (y7)*(-4/9)/(yy*0y)(2/35) assuming y is positive. y(-1016/315) Simplify (((nn(1/8)nn)/((nn(nn10/n)/n)/n))/(n(-2/29)nn1))(-4/15) assuming n is positive. n(681/290) Simplify (g/g(1/41))/g*(-25)(ggg(-8/5)/g)/(g/g(2/9)) assuming g is positive. g(45383/1845) Simplify ((w/w2w)/ww)(-34)/(w(-2)/w(1/6)) assuming w is positive. w(13/6) Simplify (((i/((i/i*(-1)i)/i))/((i/(i/i(-7)))/i))/(i/(i8/i)ii(-4/3)))(-43) assuming i is positive. i*(-1720/3) Simplify (((ww*(-8/7)w)/((w/(ww0w)w)/w))(-3/8))(-43) assuming w is positive. w(1677/56) Simplify (g(11/2)/g(-2/7))/(g/((gg(7/3))/g))(15/7) assuming g is positive. g(121/14) Simplify (a/a(-1/4)a15)/(a(-4/7)(a*14a)/a) assuming a is positive. a(79/28) Simplify i7i(1/4)i(ii*(-4))/ii*(-12)i assuming i is positive. i*(-27/4) Simplify (i/(ii(-15)))(-3/22)(i/(i/(ii(i/(i/(i/(((((ii*(12/11))/i)/i)/i)/i)i)))/i)))/(i(-26)/i) assuming i is positive. i(657/22) Simplify (((l(ll27)/l)/l)/(l41/ll))(-1/63) assuming l is positive. l(2/9) Simplify (((d/d(-8))/d)(4/33))(-1/56) assuming d is positive. d(-4/231) Simplify (((gg*1/g)/(gg(2/25)))(15/7))28 assuming g is positive. g(-24/5) Simplify ((d(-5))(-34))(4/19) assuming d is positive. d(680/19) Simplify (r(-6)/r)39/((rr/(rr*(-1/8)))/rrrrr/(r(2/5)/r)rrr) assuming r is positive. r(-11229/40) Simplify (((y(-6))(-1/63))(1/37))34 assuming y is positive. y(68/777) Simplify p(-1/16)/p(-1)(p(-7/3)/p)/(p/(pp/(p*(-1/6)p)p)) assuming p is positive. p(-59/48) Simplify ((z/((zzz(3/5)/zz)/z))/z)(-1/18)/(z/z(1/5)(zz(-12))/z) assuming z is positive. z(508/45) Simplify s*10s*(2/5)ss(-23)/(sss/(s/(ss*(-21)s)ss)) assuming s is positive. s*(37/5) Simplify dd*9/dd*(4/9)d(dd(2/9)/d)/((d/d(-4))/d) assuming d is positive. d(20/3) Simplify ((t(1/2)/t)*(-35)t/(tt/t(-1/2)ttt)t(-1/3))(8/9) assuming t is positive. t(304/27) Simplify s(-5)ss(1/18)((ss/(s/((s(2/9)/s)/s)s))/s)11 assuming s is positive. s(-69/2) Simplify ((y(1/9))(11/6))(2/127) assuming y is positive. y(11/3429) Simplify ((ss13)/s)/(s/((s((s/(ss(-27/5)/ss))/s)/s)/s))(ss(-4/7))31 assuming s is positive. s(1004/35) Simplify (r/((r/(r/(((r/r(1/2))/rr)/r)))/r)r/(r/r*6)(rr/(r(-4)/r)r)/((rr1)/r))(4/31) assuming r is positive. r2 Simplify (ccccc(1/4))(-44)c/c*(3/2)c(-9) assuming c is positive. c(-393/2) Simplify (((m*(2/3)m)(-1/29))(-3/29))4 assuming m is positive. m(20/841) Simplify (k/k*(-4/3)k*(2/7)k(k(-2/7)kk)37)(8/13) assuming k is positive. k(11264/273) Simplify (b5/(b/b(-4))b*(-4)b2)(-11) assuming b is positive. b*22 Simplify iiii*(-6)/iiii*9i*11/ii/(i/i2) assuming i is positive. i19 Simplify ((r/r*(-2/11)rr(2/5))/((r/(r(-4)r))/r(-1/3)))5 assuming r is positive. r*(-289/33) Simplify ((c/(cc**(	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.