Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
2))? 6 (-16)/(-13)62/(-248) -4/13 Evaluate (0 - (-2)/200)((-18424)/(-147))/(-47). -2/75 Calculate (-2 - 19)(-5 + 80/15) + 5. -2 What is (-156)/1822016/(-64)? 27 Calculate (-686)/70 - (-8)/10. -9 Calculate 210(-57)/76(-4)/3. 20 What is 1386/(-121) + -3 + 1 + 64/44? -12 Evaluate ((-216)/32)/27 + (-27)/4. -7 ((-66)/(-18))/((-2)/(-8)(-20)/(-15)) 11 What is the value of ((-105)/5 - -28)(-6)/(-105)? 2/5 What is 520/30(-3)/(-4)? 13 What is (-49)/14 + 11 + -7? 1/2 What is -1 + (-33)/((-495)/300)? 19 What is ((-297)/(-33) + 5 + 2)4/(-8)? -8 What is the value of (43/86)/(8/(-320))? -20 14 + 18/(-14)11 -1/7 (2/(-18))/(((-180)/54)/(-5)) -1/6 What is the value of -42 + (36 - (-39 - -23))? 10 Calculate 1595/220 + (-774)/120. 4/5 What is the value of 31/24/(-26)(19 + -32)? 31 Calculate 1 + ((-4)/12)/(1(-75)/(-207)). 2/25 Evaluate (-11 - (-2313)/198) + (-22)/44. 2/11 What is 5/((-5)/2)(-28 - 720/(-36))? 16 What is the value of (-1)/(26/3038 - (-114)/(-2793))? 31 What is the value of (-28)/21 + 560/(-120)? -6 What is the value of 105/(-1120)(-2)/(-3)? -1/16 What is (-1 + 2/3)/3 + 666/(-81)? -25/3 What is 6/(-18) + -3 + 48/(-18)? -6 (-58)/12 - 14/12 -6 (220/(-56) - -4)-420/(-40) 1/7 What is ((-28)/7 - (-224)/(-12))/(122/183)? -34 What is the value of (36/384)/(3 + (-45)/20)? 1/8 Evaluate (6(-120)/108)/(20/(-15)). 5 What is the value of (-3150)/150 + (-1)/24? -23 Calculate ((-3)/(-2))/((97 - 108) + (-305)/(-28)). -14 (44/33)/(154/63) 6/11 What is the value of ((-4)/(-12))/(((-140)/(-3))/10)? 1/14 Calculate (6/(-5) - 2)(342 - 347). 16 (-171)/399 - 8/(-14) 1/7 ((-3)/(-4) - 1)/(188/(-720)) 5/4 44/((-792)/54)4/(-6) 2 Calculate 1-6 - -514/(-35) - -3. -5 What is ((-3)/(36/16))/(2 - (-13)/(-6))? 8 What is 1568/(-70) + (-6)/(-15)? -22 What is ((-45)/(-40))/((-19)/152)? -9 Calculate (28/182 - 154/156)/(3/2). -5/9 What is (12 + (-1215)/120)(-5 + 7)? 15/4 Evaluate (-5911)/28784 - (1 + 8/(-7)). -1/16 What is the value of 3(-40)/(-54)81/(-54)? -10/3 Calculate (-26)/(-104)(10 - 10). 0 What is the value of (3-88)/11 + 13? -11 Evaluate 74(-56)/98. -16 ((-280)/(-392) + -1)/((-12)/(-7)) -1/6 What is the value of (-8)/(-204) + 158/8058? 1/17 What is 10 - (((-4)/(-54))/1 + 30758/4914)? 11/3 What is the value of -11 + (142 - 7)/9? 4 What is (-54)/(-2) + (-88)/8? 16 What is (-4 - (-96)/15)22/((-176)/(-5))? 3/2 What is -2(-17 + (-517)/(-22)) + 49? 36 What is 1/53/6 + (-54)/(-36)? 8/5 Calculate (-5571)/(-1238)(-28)/9. -14 3 + 1 + (-12)/68 + 3104/(-136) -19 What is 4/(-16)-5(-11 - -15)? 5 What is (((-48)/5)/4)/(64/480)? -18 441/21 - (0 - 19) 40 698/28 + (-3475)/(-48650) 25 What is the value of (-17 + 11)/((-3)/(-2))? -4 (-39 - -41)(30/8)/((-18)/48) -20 Calculate 36/48(1 + -4)/(-9). 1/4 Evaluate -1(65/26 - (-1)/(-2)). -2 What is the value of -3(-130)/728(-2)/52? -3/7 What is the value of -1 - (-3 - (-1 + 1)) - 1587/483? -9/7 What is 90/(-35)2 + (24/(-28))/(-6)? -5 What is ((-4)/(-14))/((1 - -13) + (-44243)/3171)? 6 What is the value of (-2 + (-265)/5)(-2 - 9/(-5))? 11 Evaluate (1 + 14/(-20))/(-61 - 6124/(-100)). 5/4 Evaluate 474/(-869) + 4/((-220)/(-305)). 5 What is (-8)/(-116)-1 - 41/(-174)? 1/6 Evaluate (-90 - (-102960)/968) + -15 + -1. 4/11 What is (-18)/((-5)/9198/(-165))? -27 Evaluate (6/36)/(28/(-987)) + 6/1. 1/8 Calculate (280/210)/(58/6 - -1). 1/8 (-6)/(-13)76076/7524 14/3 (-25)/2(-76)/(-190) -5 Calculate (3/(-130))/(1701/108 - 15). -2/65 What is -4 + -2((-21)/14 - (-6 + -4))? -21 What is ((-52)/273)/((-33)/((-2541)/(-286)))? 2/39 Evaluate ((-3)/(-12))/((-12)/(-816)). 17 Evaluate (5-4 + 1)(10 + 72/(-8)). -19 Calculate 168/378 + (-427)/1386. 3/22 Evaluate (-1507)/(-396)-4 - 18/(-81). -15 1 + (6/8)/((-666)/(-144) - 5) -1 (-2 + -5)23/59826 -7 What is the value of (-2160)/(-81)(-6)/(-8)? 20 Calculate (-1)/(-14) + (-4725)/(-2450). 2 Evaluate (-5)/((-75)/(-42)) + (-210)/(-75) + -3. -3 What is the value of 90 - (-8771)/(-98) - 1(-71)/2? 36 Evaluate (-60)/18(-18)/19019. 6 (1 - (-1 + 6))(104/(-40) + 3) -8/5 Evaluate 1 + 1 + (238/24 - 12). -1/12 What is 32/(-6)((-18)/36)/(4/(-30))? -20 ((-6)/(-35))/(1695/(-43505)) -22/5 Calculate (-2320)/39150 - (-8)/(-108). -2/15 What is (-835)/334(-4)/(-7)? -10/7 What is the value of (-90)/40 + (-25)/(-100)? -2 Calculate (-473)/33 + (29 - 14). 2/3 154/(-20) + (-1640)/(-205) 3/10 Evaluate (68/60)/(2214/4305). 14/9 What is ((-240)/800)/(2/4)? -3/5 What is the value of (-40 - (-1357)/34)((-60)/(-9))/(-5)? 2/17 What is the value of (-289)/(-102) - (-1 - (-8)/(-4))-1? -1/6 Evaluate 3/(-30)-3(-220)/396. -1/6 Evaluate (2/3)/(((-4)/27)/((-38)/(-1083))). -3/19 (-100)/(-120) + 4/(-48) 3/4 What is the value of 133/539 + ((-42)/33)/(-7)? 3/7 What is 312/5462/(-8)? -1/7 Evaluate -5 + (-189)/(-39) - (-19)/(3458/(-4158)). -23 (-36 - 9628/(-290))/((-6)/(-5)) -7/3 What is the value of -5 + 3 + -3 + ((-696)/(-30) - 17)? 6/5 Calculate (-5)/(75/30) + 82/40. 1/20 What is the value of (16/(-3))/((-1270)/(-3810))? -16 Evaluate (1176/(-462))/((-10)/(-55)). -14 What is the value of 0/(7 + 0 + 8 - 19)? 0 Calculate 3/424736/(-48) + 7. -1/21 What is (371/(-265))/((-273)/(-45) - 6)? -21 What is the value of (29 + 870/(-29))/(((-54)/15)/(-3))? -5/6 Evaluate 6858/(-635)(16/12 + -3). 18 What is (-13 + (-4 - -3))/((-34)/(170/(-10)))? -7 (-82 - -16)/(0 + -3) 22 What is 5/(-15)(5580/280)/31? -3/14 Evaluate (-4346)/(-63017) - 901/29. -31 What is the value of (-2)/(3/5 + (-612)/45 - -3)? 1/5 (-260)/(-1170) + 141/(-189) + (-6)/(-14) -2/21 What is the value of 25/(-24) + (-2655)/(-6372)? -5/8 Calculate (-24211)/(-142)(-14)/(-217). 11 Evaluate 1950/(-102) - ((26 - 20) + -25). -2/17 Calculate -7 + ((-87)/(-30) - 7) + 11. -1/10 7 + 105/(-14) + (-39)/(-26) 1 Evaluate (4/(-2))/(1/2) + (41 - 26). 11 Evaluate (8(-2)/40)/((-5)/100). 8 What is the value of ((-19)/(-3))/((-252)/(-756))? 19 Evaluate (-1210)/88 + (-1)/4. -14 (1218/504 - (-4)/(-6))12/3 7 Evaluate (1 - 0) + (5 + -1)/(1 + -11). 3/5 What is the value of -2 - (-10 + (-1914)/(-234) - 2/6)? 2/13 Calculate (2/(-10))/(66/(-1650)). 5 What is (-430)/(-86) - (-1)/(36/(-183))? -1/12 What is (-8)/(-4) - (-276)/(-140)? 1/35 Calculate (-2 - 19) + (377 - 374). -18 Evaluate 2/2(-5 - -2 - 8). -11 What is the value of (-18)/(-15) + (-5446)/(-595) - 10? 6/17 What is the value of (1962/30084)/((-3)/(-69))? 3/2 What is the value of -21(-90)/945((-230)/4)/5? -23 (-994)/(-42) + -11 - (-1 - -13) 2/3 1419/(-99)(-15)/(-55) - -5 12/11 What is (-146)/(-2993) - 2664/9225? -6/25 Calculate (22/242)/((-992)/(-88) - 11). 1/3 Calculate ((-6)/18)/(((-44)/8)/1). 2/33 What is (-104)/(-18)(-778)/(-5057)? 8/9 What is 141/564634/(-3)? -17 Evaluate 150/(-25) + (-3 - -1) + (-10)/(-2). -3 What is (-12 - (-240)/18)/((4/(-3))/4)? -4 0/(2 + -8 + (8 - 1)) 0 What is the value of 1492/(-100) - 1727/1570(-4)/(-55)? -15 What is the value of 27/168 - ((-12)/63)/((-4)/6)? -1/8 Calculate (-752)/282(-3 - 0) + -9. -1 What is the value of (144/84)/(10/(-14))(-55)/33? 4 Calculate 66/(-27) + 2/(-3) - (-34)/306. -3 What is (-6)/(-9) + 14434/(-2562) + 5? 2/61 Evaluate (-60)/(-9)(72/(-60))/(-3). 8/3 ((-23)/((-253)/33))/(19/11 + -2) -11 3 + 32/((-152)/19) -1 Calculate 15 - 2585/175 - 3/(-15). 3/7 What is the value of (-3273)/7637 - (-29)/2(-4)/(-21)? 7/3 Calculate (-2499)/(-1260)-6 - -12. 1/10 (60/(-16) - -9)(-40)/15 -14 Calculate (1(-3)/(-2))/(-12 - 1044/(-88)). -11 What is the value of (-5 - -4) + (-10 - -10)? -1 What is the value of 2992/204(-12)/(-22)? 8 What is the value of ((-6)/(-20))/((-11)/(33/(-12)) + -3)? 3/10 Calculate ((68 - 68)2/2)/3. 0 What is -7 - 300/(-40) - (-42)/(-52)? -4/13 Evaluate 9 + (5760/75)/(-8). -3/5 Calculate 11/4 + ((-52)/48 - (-16)/12). 3 What is the value of (3/(-12))/((7/18)/((-24)/36))? 3/7 Calculate (3/(-2)2)/(40/((-19360)/132)). 11 -232/(-24)(-21)/(-700) 2/25 19/(-12) + (-35)/(-42) -3/4 Calculate (8 - (-5 + 0))(33/(-39) + 1). 2 What is the value of ((-1)/(-3))/((-295)/1770)? -2 Evaluate (21/((-1260)/(-75)))/((-3)/24). -10 What is the value of (1/((-25)/30))/((-50)/(-250))? -6 What is the value of 9 + ((-1004)/(-2008))/((318/1916)/(-3))? -2/53 Evaluate 18/(-15)(-36)/108. 2/5 Calculate (4/11)/(284/1562). 2 What is ((-28)/(-35))/(-5 - (-3 - 2 - -3))? -4/15 What is the	{ "pile_set_name": "DM Mathematics" }
+ (sqrt(65) - ((sqrt(65) - (sqrt(65) + -1sqrt(65)4)) + sqrt(65) - sqrt(65))) + sqrt(65))/(-32sqrt(5)))*2. 0 Simplify (-2 + 2 + -6(sqrt(72) + -1 + sqrt(72) + sqrt(72) + sqrt(72)))*2. -1728sqrt(2) + 41508 Simplify sqrt(76)/sqrt(4)-2 - (sqrt(19) + -2)-3. -6 + sqrt(19) Simplify (sqrt(85)/sqrt(720))*2. 17/144 Simplify sqrt(17)-26 + 5. -12sqrt(17) + 5 Simplify -4sqrt(50) - sqrt(20)/(-1sqrt(10)). -19sqrt(2) Simplify (3sqrt(19)15)*2. 4275 Simplify -3 + -1sqrt(119)/(sqrt(49)/sqrt(7)). -sqrt(17) - 3 Simplify ((-3 + sqrt(7) + -1)*2 + 4sqrt(63))-4. -92 - 16sqrt(7) Simplify (sqrt(55) - (sqrt(55) + 2sqrt(880)))/sqrt(5). -8sqrt(11) Simplify 5 + (-1 + sqrt(475) + -1)*2-6. -2869 + 120sqrt(19) Simplify ((sqrt(84)/sqrt(4))/sqrt(7))2-5. -15 Simplify 4(3 + sqrt(56)/sqrt(8)). 4sqrt(7) + 12 Simplify sqrt(2)-3 + 1 + sqrt(2) - sqrt(72)2. -14sqrt(2) + 1 Simplify sqrt(104)/(sqrt(8) - (sqrt(24)/sqrt(3)-5 + sqrt(8))). sqrt(13)/5 Simplify (sqrt(26)/sqrt(2) + 5)*2 + -3 + 0 + sqrt(13). 35 + 11sqrt(13) Simplify (sqrt(1331) - 3sqrt(1331)) + -5. -22sqrt(11) - 5 Simplify (-6sqrt(119)-1)/(31sqrt(7)). 2sqrt(17) Simplify (3 + -2sqrt(2)4)2 + (((sqrt(72)-1)/sqrt(6))/sqrt(6))*2. -48sqrt(2) + 139 Simplify sqrt(60)/((sqrt(48)/sqrt(36) + sqrt(12) - sqrt(12)) + sqrt(12) + sqrt(12)). 3sqrt(5)/7 Simplify sqrt(1331)-3 - (-1 + sqrt(891)). -42sqrt(11) + 1 Simplify (-6(3 + (sqrt(13) - (1sqrt(78))/sqrt(6))))2. 324 Simplify 5(sqrt(612) + -1)-6-3. -90 + 540sqrt(17) Simplify 4 + (-3sqrt(18) - sqrt(72)). -15sqrt(2) + 4 Simplify -2sqrt(112) + sqrt(112) + -5. -4sqrt(7) - 5 Simplify -6(sqrt(243)1 + sqrt(243)). -108sqrt(3) Simplify ((-4sqrt(192))/(-1sqrt(576) - sqrt(576)))*2. 4/3 Simplify -3(sqrt(2) + sqrt(250)/sqrt(5) + 1)*2. -219 - 36sqrt(2) Simplify ((-1sqrt(1260))/(sqrt(5) - (sqrt(720)-2 + sqrt(720))))*2. 252/169 Simplify (-6(sqrt(19) + -1sqrt(19)) + sqrt(57)/sqrt(3)-3)2 + 4. 175 Simplify (3 + sqrt(10)/sqrt(5))2 - (sqrt(32)-2 + sqrt(2))2. -87 + 6sqrt(2) Simplify sqrt(4)/(-2sqrt(8) + sqrt(2)). -sqrt(2)/3 Simplify 5(sqrt(72)/sqrt(3))/sqrt(8). 5sqrt(3) Simplify (sqrt(120)/sqrt(5))/sqrt(8) + 5. sqrt(3) + 5 Simplify (sqrt(136) - (sqrt(136) + (sqrt(136) - (sqrt(136) + sqrt(136)2 + sqrt(136) - sqrt(136)))))/sqrt(8) - 6(sqrt(34)/sqrt(2) + sqrt(17)). -10sqrt(17) Simplify (3sqrt(384))/sqrt(12). 12sqrt(2) Simplify 5 + -3 + -2 + sqrt(3). sqrt(3) Simplify -4 + (sqrt(66)/sqrt(6) - sqrt(11) - sqrt(11)) + (sqrt(176) + 1sqrt(176))2. -sqrt(11) + 700 Simplify (sqrt(5)-3 + 2 + (5 + sqrt(15)/sqrt(3) - sqrt(5)))*2. -42sqrt(5) + 94 Simplify sqrt(25)/sqrt(80) + sqrt(35)/(sqrt(35)/sqrt(5)). 5sqrt(5)/4 Simplify ((sqrt(147) + 1)-5 + -3)*2. 560sqrt(3) + 3739 Simplify (sqrt(720) + -1)-6-3. -18 + 216sqrt(5) Simplify (sqrt(40)-6)/(sqrt(270)/sqrt(6)). -4sqrt(2) Simplify (-1(sqrt(99) + 1 + sqrt(99))2)2. 48sqrt(11) + 1588 Simplify (-33sqrt(132))/(sqrt(192) + sqrt(192) + sqrt(192)-1 + sqrt(192) - sqrt(12)). -9sqrt(11)/7 Simplify sqrt(18)-53. -45sqrt(2) Simplify (sqrt(17) + (2sqrt(17) - sqrt(17))*2 + -4)4. 4sqrt(17) + 52 Simplify (sqrt(19) + -2)-5 - 3(2 + sqrt(19)). -8sqrt(19) + 4 Simplify 3(3 + sqrt(1216) + 0 + sqrt(1216) - (sqrt(1216) + 1 + 2)). 24sqrt(19) Simplify (sqrt(68)1)/sqrt(4) + 2sqrt(17) + -2. -2 + 3sqrt(17) Simplify sqrt(15)/sqrt(3) + -2 - (sqrt(245) + 4). -6sqrt(5) - 6 Simplify 33sqrt(325)3. 135sqrt(13) Simplify -6(sqrt(128)2)*2. -3072 Simplify -5 + (sqrt(3) + -1)-14. -4sqrt(3) - 1 Simplify ((-2sqrt(99))/sqrt(3))/(sqrt(11) - sqrt(275)-2). -2sqrt(3)/11 Simplify (-3sqrt(91)-2)/(sqrt(49)/(sqrt(21)/sqrt(3)) + sqrt(7)). 3sqrt(13) Simplify (-2sqrt(54))/(sqrt(2) + (1sqrt(72) + sqrt(72) - sqrt(72)) + sqrt(72)). -6sqrt(3)/13 Simplify 4 + (sqrt(70)/(5-1sqrt(10)))22. 114/25 Simplify -3 + sqrt(15)/(-2sqrt(5)). -3 - sqrt(3)/2 Simplify sqrt(12)/(sqrt(384) - sqrt(384)6). -sqrt(2)/40 Simplify sqrt(15)/((-3sqrt(27))/sqrt(9)). -sqrt(5)/3 Simplify (sqrt(2744) + 1sqrt(2744) + sqrt(56))/(6sqrt(24)/sqrt(3)). 5sqrt(7)/2 Simplify (sqrt(80)5)2-2 + 3. -3997 Simplify 1 + (-1-1sqrt(1100)-2)2. 4401 Simplify (-1 + sqrt(3) + -4 + sqrt(3) + 1)-6. -12sqrt(3) + 24 Simplify (sqrt(405)/sqrt(441))2. 45/49 Simplify 3(sqrt(117) + -1) + 0 + sqrt(117) + 0. -3 + 12sqrt(13) Simplify (-4 + sqrt(72)/sqrt(4))2-3. -102 + 72sqrt(2) Simplify ((sqrt(102) - (sqrt(102)2 - sqrt(102)))4)/(sqrt(24)-3). 0 Simplify -6(sqrt(1053)-1 - sqrt(1053)). 108sqrt(13) Simplify (2 + -1 + sqrt(684) + sqrt(684) + (sqrt(475) - 2sqrt(475))-4)2. 64sqrt(19) + 19457 Simplify (-3 + (sqrt(133)2)/sqrt(7))-1. -2sqrt(19) + 3 Simplify (1 + sqrt(32))2 + (sqrt(2)1 + -3)*2. 2sqrt(2) + 44 Simplify (-2sqrt(2178))/(sqrt(54)1). -22sqrt(3)/3 Simplify (-3 + sqrt(7) + 0 + sqrt(7) + sqrt(84)/sqrt(3))2 - (sqrt(84)/sqrt(3) + 1). -26sqrt(7) + 120 Simplify sqrt(15)/(3sqrt(20)). sqrt(3)/6 Simplify (-5(0 + sqrt(200)))*2 + sqrt(200) - (sqrt(10)/((sqrt(5) + sqrt(5) + sqrt(5)-1)4))2. 10sqrt(2) + 39999/8 Simplify (-4 + (0 + sqrt(19) - sqrt(19)) - (sqrt(19)-1 + -2))22. -8sqrt(19) + 46 Simplify sqrt(19) + 0 + -2 + sqrt(95)/(sqrt(5) - sqrt(320)). -2 + 6sqrt(19)/7 Simplify 4(3sqrt(19) + -5). -20 + 12sqrt(19) Simplify 5 + sqrt(75) + 0. 5 + 5sqrt(3) Simplify 4 + sqrt(1900) + 0 - (-1 + sqrt(1900) + sqrt(1900)-1 + sqrt(1900) + sqrt(1900)). -10sqrt(19) + 5 Simplify ((sqrt(7) - (sqrt(7) + -2))-34)*2. 576 Simplify sqrt(12)/sqrt(4)-5 + sqrt(96)/sqrt(2). -sqrt(3) Simplify -3((sqrt(180) + -2sqrt(180) - sqrt(180)) + -1). 3 + 36sqrt(5) Simplify (6sqrt(121)2)/sqrt(11). 12sqrt(11) Simplify ((sqrt(126)-2)/sqrt(7) + sqrt(18))2 + 2. 20 Simplify sqrt(22)/(sqrt(16)/(sqrt(8)-2)). -2sqrt(11) Simplify (-2sqrt(4598))/sqrt(2). -22sqrt(19) Simplify 2 + 3 + sqrt(19)-2. -2sqrt(19) + 5 Simplify (4 + (sqrt(1300) - (2 + sqrt(1300))))-5. -10 Simplify 6sqrt(18)/(5sqrt(6)). 6sqrt(3)/5 Simplify (sqrt(14) - (sqrt(84) + sqrt(84) + sqrt(84) + -2sqrt(84))/sqrt(6))/(sqrt(72)/sqrt(4)). 0 Simplify (6(sqrt(612)2-6 - (sqrt(612) + 1)-5))*2. -15120sqrt(17) + 1080468 Simplify (-5(sqrt(176) + 1 + sqrt(176)))24. 1600sqrt(11) + 70500 Simplify -5 + -2sqrt(13)-6. -5 + 12sqrt(13) Simplify (3sqrt(68) + sqrt(17) + 0 + sqrt(1700))2 + 2 + (sqrt(17) - (sqrt(17)-1 - sqrt(17))2). 5sqrt(17) + 4915 Simplify (sqrt(704) + -1 + -4)*2. -80sqrt(11) + 729 Simplify (sqrt(330)/sqrt(90))/(4(sqrt(3)2 + sqrt(3) + sqrt(3))). sqrt(11)/48 Simplify (sqrt(170) + 1sqrt(170)-1)/(sqrt(20)/sqrt(18)). 0 Simplify 4(4sqrt(209))/sqrt(11). 16sqrt(19) Simplify (sqrt(99)1-6)/sqrt(9)3. -18sqrt(11) Simplify (sqrt(425) + 2)2 + 1(sqrt(17) - sqrt(102)/sqrt(6) - sqrt(17)). 19sqrt(17) + 429 Simplify ((3(sqrt(33) - 5sqrt(33)))/sqrt(11))2. 432 Simplify -4 + -2sqrt(1872). -24sqrt(13) - 4 Simplify ((sqrt(108)-1 + sqrt(9)/sqrt(3) + 4)-6)2. -1440sqrt(3) + 3276 Simplify (6(4 + (sqrt(6)/sqrt(3) - sqrt(2))))2. 576 Simplify 613(sqrt(2) - (sqrt(2) - -4sqrt(2))2). -900 + 18sqrt(2) Simplify (-3sqrt(88)-1)/(sqrt(800) + (sqrt(800) - (-3sqrt(800) - sqrt(800))) + sqrt(800) + sqrt(800) + sqrt(800)). sqrt(11)/30 Simplify 5(sqrt(363) - 2sqrt(363))-6. 330sqrt(3) Simplify (sqrt(6171)2)/sqrt(3)-1. -22sqrt(17) Simplify sqrt(5) - (sqrt(605)1 + sqrt(5))2 - 4sqrt(5)-2. -720 + 9sqrt(5) Simplify sqrt(192) - (4 + sqrt(192) + 3). -7 Simplify (sqrt(18)/(sqrt(60)/(sqrt(10) + sqrt(80)/sqrt(8)) + sqrt(6)))*2. 4/3 Simplify 5((sqrt(110)2)/sqrt(10) + 0)1. 10sqrt(11) Simplify -4(1 + sqrt(684)). -24sqrt(19) - 4 Simplify ((sqrt(3888) + sqrt(3888)-2 + sqrt(27))/(sqrt(9) - sqrt(288)/sqrt(2)))*21. 121/3 Simplify (sqrt(320) + 1sqrt(320) + -5 + (0 + sqrt(320))1)*2. -240sqrt(5) + 2905 Simplify (sqrt(637) - (1 + -5sqrt(637))) + 3. 2 + 42sqrt(13) Simplify -3 + 0 + sqrt(475) + -5. -8 + 5sqrt(19) Simplify (2 + sqrt(1008) + -2)2. 1008 Simplify -1 + sqrt(1872)2 + (sqrt(1872) - (sqrt(1872) + sqrt(1872) + sqrt(1872)-1 + sqrt(1872) + 1))2. 48sqrt(13) + 1872 Simplify 3 + -2(sqrt(76))2. -149 Simplify sqrt(3)-1-4 + -6(sqrt(27))*2. -162 + 4sqrt(3) Simplify (sqrt(378)/sqrt(6)-2)/sqrt(9). -2sqrt(7) Simplify 0 + sq	{ "pile_set_name": "DM Mathematics" }
s - 9)(s - 2)/7 Factor -4z*3 + 404z*2 - 9568z - 32448. -4(z - 52)2(z + 3) Find k such that -k*2/9 + 2k/9 + 8/9 = 0. -2, 4 Factor -2h2/5 + 106h - 528/5. -2(h - 264)(h - 1)/5 Factor -20x3 + 6245x*2 - 7780x + 1555. -5(x - 311)(x - 1)(4x - 1) Factor -2a3 + 12a*2 - 16a. -2a(a - 4)(a - 2) Factor -3l*3 - 72l*2 + 12l + 288. -3(l - 2)(l + 2)(l + 24) What is w in 14w*2 + 92w - 42 = 0? -7, 3/7 Factor -3x5 - 2913x*4 - 11622x*3 - 17418x*2 - 11607x - 2901. -3(x + 1)4(x + 967) Suppose -2s3/17 + 20s*2/17 + 26s/17 - 44/17 = 0. What is s? -2, 1, 11 Factor -3s3/2 + 69s*2/2 - 198s. -3s(s - 12)(s - 11)/2 Factor -4w*4 + 1892w*3 - 5652w*2 + 5644w - 1880. -4(w - 470)(w - 1)*3 Find l such that -4l*3 + 736l*2 - 732l = 0. 0, 1, 183 Determine n, given that 7n2/5 + 128n/5 + 256/5 = 0. -16, -16/7 Solve -44n3 + 2n*2 + 44n - 2 = 0. -1, 1/22, 1 Factor 3f5 - 12f*3 - 6f*2 + 9f + 6. 3(f - 2)(f - 1)(f + 1)3 Factor -4g*4/5 - 224g*3 - 16760g*2 - 151200g - 364500. -4(g + 5)2(g + 135)*2/5 Factor -5r*3 + 65r*2 + 1425r - 19125. -5(r - 15)2(r + 17) Solve 2j2/5 - 42j/5 + 136/5 = 0 for j. 4, 17 Suppose 5d5/3 - 115d*4/3 - 45d*3 + 355d*2/3 + 130d/3 - 80 = 0. What is d? -2, -1, 1, 24 Let 10w4 - 44w*3 + 6w*2 + 44w - 16 = 0. What is w? -1, 2/5, 1, 4 Factor 2d2/13 - 74d/13 - 516/13. 2(d - 43)(d + 6)/13 Factor q*2 - 58q - 120. (q - 60)(q + 2) Factor 2h*5 + 26h*4 + 44h*3. 2h*3(h + 2)(h + 11) Find s, given that -4s*2 - 20200s - 25502500 = 0. -2525 Factor 47045r4 - 1940r*3 + 20r*2. 5r*2(97r - 2)2 Suppose -2t*3/9 - 2t*2/9 + 4t/9 = 0. Calculate t. -2, 0, 1 Factor 2v2/7 + 82v/7 + 60. 2(v + 6)(v + 35)/7 Solve -x*5/5 - 71x*4/5 - 339x*3/5 - 601x*2/5 - 464x/5 - 132/5 = 0. -66, -2, -1 Find m, given that 5m3/2 + 757m*2/2 + 1511m/10 + 151/10 = 0. -151, -1/5 Factor -2r2 + 24r + 506. -2(r - 23)(r + 11) Factor 2i5/5 - 28i*4/5 + 138i*3/5 - 56i*2 + 40i. 2i(i - 5)*2(i - 2)*2/5 What is y in -4y*5/7 - 8y*4/7 + 20y*3/7 + 40y*2/7 - 16y/7 - 32/7 = 0? -2, -1, 1, 2 Factor d*3/9 - 28d*2/3 + 953d/9 - 710/3. (d - 71)(d - 10)(d - 3)/9 Solve -2t5 - 36t*4 - 58t*3 + 104t*2 + 120t - 128 = 0. -16, -2, 1 Find q, given that -3q3 + 9q*2 - 6q = 0. 0, 1, 2 Factor 2v2/11 + 1276v + 2238742. 2(v + 3509)2/11 Solve -p4 - 35p*3 + 36p*2 = 0 for p. -36, 0, 1 Factor 15i*2 + 14180i - 9460. 5(i + 946)(3i - 2) What is k in k2/7 - 16k/7 + 4 = 0? 2, 14 Solve 4l4 + 8l*3 - 52l*2 - 152l - 96 = 0. -3, -2, -1, 4 Solve 13k5/2 + 105k*4/2 + 147k*3 + 167k*2 + 141k/2 + 9/2 = 0. -3, -1, -1/13 Factor -t*3/4 - 15t*2/4 - 25t/2. -t(t + 5)(t + 10)/4 Find m, given that m*3 + 15m*2 + 63m + 49 = 0. -7, -1 Let 3u3 - 43u*2/3 - 64u/3 - 4 = 0. Calculate u. -1, -2/9, 6 Let 2l3/5 - 76l*2/5 + 192l - 4032/5 = 0. Calculate l. 12, 14 Find t such that -3t3 - 63t*2 = 0. -21, 0 Suppose -2v*4/7 - 4v*3/7 + 18v*2/7 + 4v/7 - 16/7 = 0. What is v? -4, -1, 1, 2 Factor -3y4/5 + 21y*3/5 - 24y*2/5 - 48y/5. -3y(y - 4)*2(y + 1)/5 Let -2p2/11 + 52p/11 - 336/11 = 0. What is p? 12, 14 Determine z, given that -3z2/2 + 72z - 264 = 0. 4, 44 Factor 4y3 + 21y*2 - 4y - 21. (y - 1)(y + 1)(4y + 21) Determine l, given that 3l*4 + 24l*3 + 45l*2 - 12l - 60 = 0. -5, -2, 1 Find j such that -4j5/7 - 40j*4/7 - 124j*3/7 - 88j*2/7 + 128j/7 + 128/7 = 0. -4, -2, -1, 1 Find u such that u*2/4 - 133u/4 + 131/2 = 0. 2, 131 Factor 2z2 + 28z - 64. 2(z - 2)(z + 16) Suppose -s*3/4 - 13s*2/4 + 73s/4 + 85/4 = 0. Calculate s. -17, -1, 5 Factor 2b4/15 - 34b*3/15 - 12b*2/5. 2b*2(b - 18)(b + 1)/15 Factor -h4 + 16h*3 - 51h*2 + 36h. -h(h - 12)(h - 3)(h - 1) Factor -15k*3 + 291k*2 + 19626k - 7896. -3(k - 47)(k + 28)(5k - 2) Let k*3/4 - 13k*2/4 + 39k/4 - 27/4 = 0. What is k? 1, 3, 9 Suppose 2d3/9 + 122d*2/9 + 1798d/9 - 1922/9 = 0. What is d? -31, 1 Factor -5s3/3 - 3020s*2/3 - 459025s/3 - 906010/3. -5(s + 2)(s + 301)*2/3 Factor -5j*4 + 15j*3 + 30j*2 - 40j. -5j(j - 4)(j - 1)(j + 2) Factor -d*2/3 - 149d + 448/3. -(d - 1)(d + 448)/3 Solve 2h*2 + 308h - 1920 = 0 for h. -160, 6 Factor 3y2/7 + 57y/7. 3y(y + 19)/7 Factor -3t2/7 - 51t/7 - 90/7. -3(t + 2)(t + 15)/7 Solve 2592f2 + 144f + 2 = 0. -1/36 Let 2x5/9 + 2x*4/9 - 14x*3/9 - 2x*2/9 + 4x/3 = 0. What is x? -3, -1, 0, 1, 2 Suppose 3v2 + 10395v = 0. Calculate v. -3465, 0 Factor -j*3/2 - 297j*2/2 - 591j/2 - 295/2. -(j + 1)*2(j + 295)/2 Suppose 3r2/2 + 16r - 11/2 = 0. Calculate r. -11, 1/3 Find k such that 3k3/4 + 33k*2 + 123k/4 - 129/2 = 0. -43, -2, 1 Factor q*3/3 + 4q*2/3 - 7q/3 - 10/3. (q - 2)(q + 1)(q + 5)/3 Find o such that o*3 - 62o*2 - 400o - 544 = 0. -4, -2, 68 Factor m*4/7 + 9m*3/7 + 4m*2 + 36m/7 + 16/7. (m + 1)(m + 2)2(m + 4)/7 Determine r so that -r*5/11 - 48r*4/11 - 182r*3/11 - 268r*2/11 - 177r/11 - 4 = 0. -44, -1 What is n in 2n5/5 - 4n*3/5 + 2n/5 = 0? -1, 0, 1 Factor s*3 - 93s*2 - 393s + 485. (s - 97)(s - 1)(s + 5) Factor -9u3/2 - 65u*2/2 - 34u - 6. -(u + 1)(u + 6)(9u + 2)/2 Factor 16t*4/3 + 272t*3/3 + 1396t*2/3 + 680t + 300. 4(t + 1)2(2t + 15)2/3 Suppose -2r*5 + 166r*4 - 162r*3 - 166r*2 + 164r = 0. What is r? -1, 0, 1, 82 Factor 2r2/7 - 76r/7 + 74/7. 2(r - 37)(r - 1)/7 What is d in -3d4 - 1653d*3 - 228525d*2 - 226875d = 0? -275, -1, 0 Factor -4p3 + 1884p*2 - 295788p + 15479572. -4(p - 157)3 Determine w, given that 2w*4/3 - 40w*3/3 - 1258w*2/3 = 0. -17, 0, 37 Solve -6w*2 + 2140w - 1424 = 0. 2/3, 356 Determine l, given that -4l4 - 88l*3 - 612l*2 - 1520l - 1232 = 0. -11, -7, -2 Factor 14u3/9 - 38u*2/3 - 110u/9 + 2. 2(u - 9)(u + 1)(7u - 1)/9 Solve x*3/5 - 57x*2/5 + 506x/5 = 0 for x. 0, 11, 46 Find w such that w*2 - 74w - 1131 = 0. -13, 87 Factor b*2/3 + 83b + 494/3. (b + 2)(b + 247)/3 Determine v, given that 27v*5/4 - 9v*4 - 1185v*3/4 + 669v*2/2 + 2280v + 1800 = 0. -6, -4/3, 5 Find y, given that 3y2/5 + 1611y/5 - 3234/5 = 0. -539, 2 Suppose -2k3/3 + 136k*2/3 - 394k/3 + 260/3 = 0. What is k? 1, 2, 65 Factor -3c4 - 9c*3 + 1323c*2 - 1311c. -3c(c - 19)(c - 1)(c + 23) Factor -12p3/7 + 25p*2/7 - 2p/7. -p(p - 2)(12p - 1)/7 Determine u, given that -3u*2 + 39u/4 + 9 = 0. -3/4, 4 Let 30r5 - 185r*4 - 530r*3 + 615r*2 + 950r - 880 = 0. Calculate r. -2, -11/6, 1, 8 Find h, given that -75h4 - 1080h*3 - 3768h*2 - 4896h - 2160 = 0. -10, -2, -6/5 Factor -2y3/13 - 62y*2/13. -2y*2(y + 31)/13 Factor 20c4 + 1952c*3 + 1156c*2 - 776c. 4c(c + 1)(c + 97)(5c - 2) Factor 4w*4 + 64w*3 + 276w*2 + 216w. 4w(w + 1)(w + 6)(w + 9) Determine a so that a*5 + 2a*4 - 2a*3 - 4a*2 + a + 2 = 0. -2, -1, 1 Factor 3o*2 + 3o - 168. 3(o - 7)(o + 8) Factor 3i4 - 81i*3 - 84i*2. 3i*2(i - 28)(i + 1) Factor -4l*2 + 369l - 92. -(l - 92)(4l - 1) Factor -5x5/3 - 40x*4/3 + 640x*2/3 + 1280x/3. -5x(x - 4)(x + 4)3/3 Determine v, given that v4/5 + 8v*3/5 - 37v*2/5 - 44v/5 = 0. -11, -1, 0, 4 Find l such that l5/6 - l4/6 - 7l3/6 + 13l*2/6 - l = 0. -3, 0, 1, 2 Factor 2i*3/3 + 272i*2/3 + 606i + 516. 2(i + 1)(i + 6)(i + 129)/3 Factor -3362t*2/7 + 492t/7 - 18/7. -2(41t - 3)2/7 Factor -r5/7 - r*4 - 3r*3/7 + 23r*2/7 + 32r/7 + 12/7. -(r - 2)(r + 1)3(r + 6)/7 Solve -2n5/9 + 16n*4/9 + 52n*3/9 - 88n*2/3 - 50n + 72 = 0. -3, 1, 4, 9 Let 3s2 - 3504s + 1023168 = 0. What is s? 584 Find v such that v*4 - 9v3 - v2 + 9v = 0. -1, 0, 1, 9 Solve 3n*3 - 21n*2 - 90n = 0. -3, 0, 10 Factor 4g3 - 8g*2 - 2940g - 28800. 4(g - 32)(g + 15)2 Factor m4 - 6m3 - 8m*2 + 96m - 128. (m - 4)*2(m - 2)(m + 4) Factor -10x*2/19 + 1474x/19. -2x(5x - 737)/19 Suppose -5d*2/7 - 338d/7 + 136/7 = 0. Calculate d. -68, 2/5 Factor 4j3 + 56j*2 - 128j. 4j(j - 2)(j + 16) Solve -f3 + 296f*2 - 295f = 0 for f. 0, 1, 2	{ "pile_set_name": "DM Mathematics" }
terms in 3 - 36p + 133146p*2 - 3 - 133151p*2 + 34p. -5p2 - 2p Collect the terms in 19455w3 + 3482w*3 + 5w + 9028w3 - 7w. 31965w3 - 2w Collect the terms in 5724a3 + 5653a*3 + 5665a*3 - 17050a*3. -8a*3 Collect the terms in 4411t*2 + 4393t*2 + 4405t*2 - 17560t*2 + 4384t*2. 33t*2 Collect the terms in -4w*3 - 5883w + 20478w - 5897w - 8698w. -4w*3 Collect the terms in 2u*3 - 1130u + 346u2 - 691u*2 + 345u*2 + 1125u. 2u3 - 5u Collect the terms in -197m2 + 402m*2 - 25m - 10m - 10m - 201m2 + 40m. 4m2 - 5m Collect the terms in -70y2 + 305y*2 + 4y*2 - 4y + 2y. 239y*2 - 2y Collect the terms in 678w - 692w - 698w + 1402w - 691w. -w Collect the terms in -109916r + 2 + 219829r - 109941r. -28r + 2 Collect the terms in 39r*2 + 2242r*3 - 840r + 1672r - 832r - 39r2. 2242r*3 Collect the terms in -495j - 11j - 5 - 53 + 60 - 6. -506j - 4 Collect the terms in -1169393i - 362371i - 469958i - 840168i. -2841890i Collect the terms in 88314c + 34806c - 2 + 6368c + 2. 129488c Collect the terms in -137f + 415f - 22897 - 135f - 142f. f - 22897 Collect the terms in -2k*2 + 777k - 702k - 5133 + 2567 + 2566. -2k*2 + 75k Collect the terms in -779 + 195 + 195 + 199 + 111j + 190. 111j Collect the terms in 123r2 + 55159086 - 55159086. 123r*2 Collect the terms in 262694i + 1 - 35092i - 1. 227602i Collect the terms in -6b3 + 15 - 20 - 3b*2 + 6b*2 + 5 - 12b*3. -18b*3 + 3b*2 Collect the terms in 688u + 1103u + 1663u - 725u + 1915u + 279u. 4923u Collect the terms in -400316953w3 + 800633925w*3 - 400316960w*3. 12w*3 Collect the terms in -24t + 30 + 14t + 3 - 1. -10t + 32 Collect the terms in 52030r - 103966r + 52006r. 70r Collect the terms in 5x - x2 + 12 - 2x*3 + 13 + 0. -2x3 - x2 + 5x + 25 Collect the terms in -173780d - 357408d - 393098d. -924286d Collect the terms in 37k + 848k3 + 1 - 19k - 769k3 - 18k. 79k3 + 1 Collect the terms in 1152t3 + t2 - 2067t3 + 894t3 - t2. -21t3 Collect the terms in 142g + 101g - 13 + 184g + 8 + 5. 427g Collect the terms in -74666y*3 + 24 + 37287y*3 + 0y*2 + 37377y*3 + 0y*2. -2y*3 + 24 Collect the terms in -3333z*2 - 1432z*2 - 1376z*2 + 4. -6141z*2 + 4 Collect the terms in 2l*2 - 336l + 1598 + 605 - 17l - 14l + 367l. 2l*2 + 2203 Collect the terms in -25u*3 + 9u - 25u3 - 33u*3 + 100u*3 + 1199 - 40u*3 - 1197. -23u*3 + 9u + 2 Collect the terms in -3y3 - y - 24 + 19y + 5y2 + 4y*2 - 327y. -3y3 + 9y*2 - 309y - 24 Collect the terms in 5 + 1417l + 18682l + 6112l. 26211l + 5 Collect the terms in -5k - 685 + 1855 + 20k*2 - 22k*2. -2k*2 - 5k + 1170 Collect the terms in 75q2 + 60q*2 - 50 + 2q*3 + 30 + 20. 2q*3 + 135q*2 Collect the terms in -295 + 15627w - 306 + 902 - 301. 15627w Collect the terms in -277r*2 + 92r*2 + 308r*2. 123r*2 Collect the terms in -219 - 2808w + 2808w + 8w*2. 8w*2 - 219 Collect the terms in 2428810791 - 4857621580 + 2428810789 - 4n*3. -4n*3 Collect the terms in 29k - 51k2 - 56 + 275 - 18k - 172 - 49 - 11k. -51k*2 - 2 Collect the terms in 4208i*2 - 5 - 1 - 44i - 4214i2 + 6. -6i*2 - 44i Collect the terms in 31242l - l2 + 29 + 31304l - 62546l. -l2 + 29 Collect the terms in 126847z + 29363 - 126849z - 29363. -2z Collect the terms in 16754x - 8696x - 7x3 - 3x*3 - 8058x. -10x3 Collect the terms in 6678 - 2217 - 651i - 2215 - 2247. -651i - 1 Collect the terms in 32934d*2 + 34403d*2 - 4529d*2. 62808d*2 Collect the terms in 1182738054 - 1182738054 + 28t. 28t Collect the terms in -1 + 4890f*2 + 1 + 17539f*2. 22429f*2 Collect the terms in 73647c + 62328c + 3776c - 17974c. 121777c Collect the terms in -95036w + 181002w + 177250w. 263216w Collect the terms in -4773 - 4729 + t + 83t2 + 9502. 83t*2 + t Collect the terms in 29718h + 188 - 353 + 165. 29718h Collect the terms in -37787c*3 + 37707c*3 - 66 + 66. -80c*3 Collect the terms in 4454595 + 15710q*3 - 15711q*3 + 4q - 4q - 4454305. -q3 + 290 Collect the terms in -26 + 178208l*2 - 45 + 71. 178208l*2 Collect the terms in -169z - 603z + 206z + 178z - 148z. -536z Collect the terms in 2597m - 1140688m2 - 2597m + 1140748m2. 60m*2 Collect the terms in 2170l - 1032l - 1160l. -22l Collect the terms in 0u + 89u + 10u + 14u - 119u + 11u. 5u Collect the terms in 127481 - 63814 - 222r - 63667 + 205r. -17r Collect the terms in -4710476473s - 268s2 + 100s*2 + 4710476473s. -168s2 Collect the terms in -28 + 441 - 31 - 7d*2 - 35 - 321 - 26. -7d*2 Collect the terms in -1 - 2m*2 + 20m*2 - 15m*2. 3m*2 - 1 Collect the terms in -177 + 1145n*3 - 184 + 908 - 180 - 182 - 183. 1145n*3 + 2 Collect the terms in -12l*2 - 5 - 32l*3 - 2l*2 + 235l*3. 203l*3 - 14l*2 - 5 Collect the terms in -13945 + 9b - 9608 + 84b. 93b - 23553 Collect the terms in 71d - 888d + 81d + 697d. -39d Collect the terms in 314 - p3 + 8240p + 65 - 82 - 8442p. -p3 - 202p + 297 Collect the terms in -5 - 239v + 89v + 148v - 30v*3. -30v*3 - 2v - 5 Collect the terms in -4 + 29w3 + 32w*3 + 10w + 11 - 34w3 - 11w*2. 27w*3 - 11w*2 + 10w + 7 Collect the terms in -20351 + 20351 - 227m2. -227m*2 Collect the terms in 1667b + 964b - 4290b - 2859b - 2514b. -7032b Collect the terms in -360d*2 + 77d*2 + 1222d*2. 939d*2 Collect the terms in 386r + 7236606373r2 - 7236606374r*2 + 267r. -r*2 + 653r Collect the terms in -69 - 101702w + 69 - 69598w. -171300w Collect the terms in 26823c + 26179c - 14443c + 7108c. 45667c Collect the terms in 25533s - 328 + 328 + s3 + 2s3 + s2 - 2s3. s3 + s2 + 25533s Collect the terms in 86y3 - 68y - 85y3 + 411y - 191y. y3 + 152y Collect the terms in -17 - 435i + 10 - 31 - 1204i. -1639i - 38 Collect the terms in -449k*2 + 1585k*2 - 418k*2 - 303k*2 - 418k*2. -3k*2 Collect the terms in 6981f*3 + 7386f*3 + 7297f*3 - 6723f*3 + 1377f*3. 16318f*3 Collect the terms in 442g*3 - 99 + 99 - 189g*3 - 224g*3. 29g*3 Collect the terms in -3m + 5m + 270m*3 - 67m*3 - 4m - 87m3 - 92m*3. 24m*3 - 2m Collect the terms in -23 + 2i3 + 54 + 50 - 161 - 4i*3 + 52. -2i*3 - 28 Collect the terms in 6419 + 0c - 12786 + 0c - 363c*3 + 6367. -363c*3 Collect the terms in -12 - 28f - 88 - 2f2 - 1 + 60f - 32f. -2f*2 - 101 Collect the terms in -7483x - 765x - 1465x - 274x - 2086x. -12073x Collect the terms in -652w + 263w + 260w + 261w + 266w - 403w. -5w Collect the terms in -607733092 + 607733092 + 14c. 14c Collect the terms in 854884h2 - 427426h*2 - 427427h*2. 31h*2 Collect the terms in -5192q*2 + 10373q*2 - 13q*3 - 5181q*2 + 0 + 0. -13q*3 Collect the terms in 15u + 236740u2 + 27u - 236728u2. 12u*2 + 42u Collect the terms in 10k - 110 + 68 - 13k - 8k - k2. -k2 - 11k - 42 Collect the terms in 5 + 0 - 13 - 801p + 8. -801p Collect the terms in -6r + 46r - 28r - 116 - 9r + 36. 3r - 80 Collect the terms in 8915 - 17905 + 5o*3 + 8904 + 35o. 5o3 + 35o - 86 Collect the terms in -508v + 9v*3 + 73855790v*2 - 73855790v*2. 9v*3 - 508v Collect the terms in 4a3 + 10023420124a*2 - 10023420124a*2. 4a*3 Collect the terms in 16950264 - 9h*2 - 16950264. -9h*2 Collect the terms in 4r + 7r - 42r + 14r + 23 + 4r + 12r. -r + 23 Collect the terms in -120q*2 + 262q*2 - 249q*2 - 630q - 1104q2 + 631q - 612q2. -1823q*2 + q Collect the terms in 44594l - 44594l - 373051l*2. -373051l*2 Collect the terms in 180916t - 8 - 90741t - 90158t + 8. 17t Collect the terms in -1285185h*2 + 2538543h*2 - 1253360h*2. -2h*2 Collect the terms in -10349u + 5985u + 7724u + 2. 3360u + 2 Collect the terms in 226195o + 226202o + 226189o - 678615o + 967 - 967. -29o Collect the terms in -14536706 + 7268361 + 7268345 - 10w3. -10w*3 Collect the terms in 3q*2 - 363q*3 + 3q*2 - 897q*3 - 6q*2. -1260q*3 Collect the terms in 88y + 132*y	{ "pile_set_name": "DM Mathematics" }
be the first derivative of 53n3/3 + n2/2 - n + 44. What is the units digit of g(1)? 3 Suppose c + q = 554, 2q + 0q = c - 566. What is the units digit of c? 8 Suppose 3v = 4r + 3072, v - 3075 = -2v + 5r. What is the thousands digit of v? 1 Let a be ((-12)/4)/((-1)/1). Let w be (-2 - 1) + (a - -8). Suppose -5q - w = -3q, 0 = 4c - q - 80. What is the tens digit of c? 1 What is the tens digit of (55725/27)/5 - (-10)/45? 1 Let i(m) = m + 1. Let k(t) = 43t + 22. Let a(n) = 5i(n) - k(n). What is the tens digit of a(-3)? 9 Let z(a) = -36a + 8. What is the hundreds digit of z(-14)? 5 Let w(f) = f + 1. Let a(y) = -2y + 10. Let z be a(8). Let i = z - -16. What is the tens digit of w(i)? 1 Let p(m) = 16m2 - 6m + 8. Suppose n = 6n - 10. What is the tens digit of p(n)? 6 Let n = 14 - 10. Suppose 0 = -b - 2q - 7, -8b - 30 = -3b + 5q. Let o = n - b. What is the units digit of o? 9 Let s(l) = 25l*2 + 5l + 2. Let n be s(-2). Let m = 248 - n. What is the units digit of m? 6 Suppose -5r - 7r = -2364. What is the tens digit of r? 9 Let l(n) = n*3 + 4n*2 + 3n + 4. Let w be l(-3). Suppose wo = 14o - 2160. What is the tens digit of o? 1 What is the hundreds digit of ((-5139)/(-18))/((-1)/(-2 - 0))? 5 Let x be (-8)/10(3 - (-22)/(-4)). What is the units digit of 61/x + -5 - (-1)/(-2)? 5 Let g = 9 + -5. Let n be 132(-22)/g. Let x = -90 - n. What is the tens digit of x? 5 Let n(u) = -8u + 4. Let g be n(8). Let q be 3/5 + (-204)/g. Suppose -2i - 3h = -68, 4i + 2h - qh = 168. What is the units digit of i? 0 Let u = -44 + 48. Suppose 0 = ux - 111 - 601. What is the tens digit of x? 7 Let r be ((-12)/5)/(6/75). Let c be 18/r + 54/(-10). What is the units digit of ((-44)/c)/(4/12)? 2 Let x(i) = 3i2. Let v be x(1). What is the tens digit of -35(v + (-62)/14)? 5 Let l be ((-1)/2)/(4/208-2). Suppose lr = 14r - 46. What is the tens digit of r? 4 Let i(b) = 9b - 5. Let j be i(2). Suppose h = -2q + 13, -4q = -3h + 2h + j. What is the units digit of h? 3 Suppose -2r = -81 - 13. Suppose -r = -j - 14. Suppose 0 = -2o - j + 101. What is the tens digit of o? 3 Suppose 2t - 140 = -5b + 2b, -5b + 3t + 265 = 0. Let q = b - 2. What is the tens digit of q? 4 Let w(k) = 373k*2 - 8k + 6. What is the hundreds digit of w(1)? 3 Let f be ((-9)/12 - -2)4. Let k be -2 + f8/(-4). What is the tens digit of (1 + (-13)/4)k? 2 Suppose l + 3j - 832 = 0, 0 = -2j + 69 - 73. What is the hundreds digit of l? 8 Let j = 6513 - 3685. What is the units digit of j? 8 Let c be ((-804)/4)/(-1) + 1. Suppose -2b - c = -4v, v + 4b - 54 = -8. What is the tens digit of v? 5 Let r(l) = 7l3 - 6l*2 + 5l - 7. Let w be r(4). Let y = w + -248. What is the tens digit of y? 1 Suppose -q = 2q - 6, 0 = 4v + 4q - 28. Suppose 4b = n - 10 - 3, vb = 4n - 41. What is the units digit of n? 9 Let q(p) = p*3 - 5p*2 - 8p - 2. Suppose 4l - 34 - 2 = 0. Let a be q(l). Suppose -5v = -0v - a. What is the tens digit of v? 5 Let y(z) = 3z - 25. Suppose 5v = -3s + v + 40, -5s - v + 61 = 0. What is the units digit of y(s)? 1 Suppose -132 = -4q - t, t = 4t. Suppose 0 = -28d + qd - 805. What is the hundreds digit of d? 1 Let v = -1264 - -2371. What is the tens digit of v? 0 Let r = -13 + 108. Let y = -28 + r. What is the units digit of y? 7 Let x be 1-6(-3)/6. Suppose 5q - 284 = -3g, -xg + 266 = -q - 48. What is the hundreds digit of g? 1 Suppose -2t = -0t - 12. Suppose -x + 6 = -t. What is the tens digit of x? 1 Let x(q) = 3q3 + 14q*2 - 9q - 12. Let c(h) = 7h3 + 29h*2 - 18h - 23. Let f(a) = -4c(a) + 9x(a). What is the units digit of f(8)? 0 Let w = 38 - -34. Suppose -93 = -5m + w. What is the units digit of m/4 + 12/16? 9 Suppose -72a + 81a = 10746. What is the hundreds digit of a? 1 Suppose -r + 0 = -2x - 1, -r = -5. What is the units digit of x/(-9) - (-740)/90? 8 Suppose 0 = -3f + 5 + 1. Let k(l) = f + 6l*2 - 2 - 2l + 6 + l*3. What is the tens digit of k(-6)? 1 Let y(p) = -226p + 20. Let r be y(-3). Let j = r - 470. What is the tens digit of j? 2 Let z be (-8)/24 - 20/(-6). Suppose 12 = zu + 2c, c + 0c - 11 = -4u. Suppose -l = -ul + 6. What is the units digit of l? 6 Let l(t) be the first derivative of -11/2t*2 - t - 5. What is the units digit of l(-1)? 0 Let c = 8 - 5. What is the units digit of (3 - c) + 2 - -46? 8 Let w = -11 - -34. Let t = w - 17. What is the units digit of t? 6 Suppose 5x + 1 = v, 2x = 5v - 5 - 0. Suppose x = b + b - 40. What is the units digit of b/16 - 3/(-4)? 2 Let w(m) = m*3 - 12m*2 + 53m - 6. What is the tens digit of w(9)? 2 Let c = 596 + -384. What is the tens digit of c? 1 Suppose -3l - 15 = 0, -l - 7 = -2p + 2. Suppose -pv + 1239 = 5v. What is the units digit of v? 7 Let r(j) = -2j2 + 51j + 4. Let u be r(22). What is the units digit of u/(-6)-3 - -2? 1 Let x(z) = z2 - 8z + 9. Let c = 20 - 34. Let d be (c/(-6))/(3/9). What is the units digit of x(d)? 2 Let r = 1255 - 423. What is the hundreds digit of r? 8 Let f(z) = z*3 - 5z*2 + 5z. Let t be f(4). Suppose -o - to = -a + 11, 4a + 2 = -3o. Let g = 26 + o. What is the units digit of g? 4 Let y = 62 + 136. Suppose -15q + 12q + y = 0. What is the units digit of q? 6 Let p(w) = w - 7. Let d be p(12). Suppose -3v = -3z + 330, -z - 104 = -2z - dv. What is the units digit of z? 9 Let c(k) = k3 - 2k*2 + 7k + 1815. What is the thousands digit of c(0)? 1 Suppose -3k + 26 = 4x + 5, -2x - k = -11. What is the tens digit of ((-2)/x - 22/(-6))6? 2 Let k(b) = 3b - 7. Let t = 12 + -7. Let c be k(t). Let q(v) = 4v + 3. What is the units digit of q(c)? 5 Suppose 0 = -5c - h - 0 + 9, -2c - 2h + 2 = 0. Suppose 0n + 215 = 3n + ct, -3n + t = -221. What is the tens digit of n? 7 Suppose -6o + 106 - 16 = 0. Let n be (-6 - -2)2 - 1. What is the tens digit of (-321)/n + 5/o? 3 Suppose x + 3x - 2j = 7340, 5x - 9149 = -4j. Suppose -11d = 447 - x. What is the units digit of d? 6 Suppose 0 = -4z + 9z + 10, w - 929 = -3z. What is the hundreds digit of w? 9 Let h(u) = 4u + 23. Suppose 0 = 4y - 4w - 60, 0 = 4y - 3y - 3w - 21. What is the units digit of h(y)? 1 Let z = 4071 - 2458. What is the thousands digit of z? 1 Let t(f) = -2f + 10. Let g be ((-1)/(-3))/(1/27). Let n be t(g). What is the tens digit of 4/(-16) - 170/n? 2 Let k = 17 - -3525. What is the thousands digit of k? 3 Let a(g) = 359g + 40. What is the tens digit of a(3)? 1 Suppose -2835 = 17c - 24c. What is the units digit of c? 5 Let i(z) be the second derivative of -z6/360 - z5/120 + 7z4/8 + z3/3 + 3z. Let x(c) be the second derivative of i(c). What is the units digit of x(0)? 1 Let k = 348 + -59. What is the hundreds digit of k? 2 Let h(q) = q3 - 4q*2 - q + 3. Let s be h(3). Let t = s + 13. Suppose -2w = r - 3, -4w + tr = -w + 1. What is the units digit of w? 1 Suppose -10o = -8655 - 34765. What is the thousands digit of o? 4 Let b(p) = -73p - 210. What is the hundreds digit of b(-9)? 4 Let k(b) = b*3 - 3b*2 + 4b - 4. Let j be k(2). Suppose -50 = -5x - jx. What is the units digit of (8/x)/(1/50)? 0 Suppose 12b - 19144 = -5056. What is the thousands digit of b? 1 Let o be 1 + 7 + (-5 - (-1 - 3)). Suppose s - 126 = -2q, -os + 390 = -4s + 2q. What is the units digit of s? 2 Let c be (19/(-5) - -3)-5. Suppose 35 = -j - cj. What is the units digit of 2 + 0 - (j - -1)? 8 Let o = 17 + 10. Let w = -7 + o. What is the units digit of w? 0 Let y = 2060 + -905. What is the tens digit of y? 5 Suppose 5b = 5y + 1420, 2b + y - 61 = 498. What is the hundreds digit of b? 2 Suppose 0 = 3p + 3p - 48. Let t(r) = -r*3 + 7r*2 + 7r + 6. Let g be t(p). Let c(i) = -23i - 3. What is the units digit of c(g)? 3 Let o(k) = 1 - 1 - 3k + 34k2 - 9k*2. Let p be o(2). Suppose 0 = -i + p - 23. What is the tens digit of i? 7 Suppose -4u + 2u - 330 = -z, -5z - u = -1672. What is the units digit of z? 4 Suppose 14h - 23h + 10386 = 0. What is the hundreds digit of h? 1 Let a = 147 + -216. Let c = 28 - a. What is the units digit of c? 7 Let o = -14 + -11. Let d be (-1)/2 - ((-69)/(-2) - -6). Let v = o - d. What is the tens digit of v? 1 Let h(a) = 2a + 1. Let j(u) = -u2 + 3u + 3. Let v be j(3). Let d be v	{ "pile_set_name": "DM Mathematics" }
remainder when 1270 is divided by 224. 150 What is the remainder when 140346 is divided by 193? 35 Calculate the remainder when 2428 is divided by 349. 334 Calculate the remainder when 21262 is divided by 26. 20 Calculate the remainder when 5704 is divided by 79. 16 Calculate the remainder when 130 is divided by 6. 4 What is the remainder when 3119 is divided by 120? 119 Calculate the remainder when 7270 is divided by 6340. 930 What is the remainder when 28100 is divided by 119? 16 Calculate the remainder when 41339 is divided by 1652. 39 Calculate the remainder when 15375 is divided by 85. 75 Calculate the remainder when 11287 is divided by 75. 37 Calculate the remainder when 482722 is divided by 22. 20 What is the remainder when 5316527 is divided by 16? 15 Calculate the remainder when 1944 is divided by 585. 189 What is the remainder when 6798 is divided by 253? 220 Calculate the remainder when 131706 is divided by 3763. 1 Calculate the remainder when 14893 is divided by 29. 16 What is the remainder when 16285 is divided by 11? 5 Calculate the remainder when 5965 is divided by 744. 13 What is the remainder when 87260 is divided by 8? 4 What is the remainder when 23923 is divided by 5871? 439 Calculate the remainder when 32024 is divided by 572. 564 Calculate the remainder when 292810 is divided by 135. 130 What is the remainder when 3220 is divided by 1057? 49 Calculate the remainder when 3296 is divided by 369. 344 What is the remainder when 8487 is divided by 288? 135 What is the remainder when 53584 is divided by 491? 65 Calculate the remainder when 29 is divided by 8. 5 What is the remainder when 8422 is divided by 17? 7 Calculate the remainder when 3891 is divided by 31. 16 Calculate the remainder when 14292 is divided by 762. 576 What is the remainder when 7786 is divided by 3873? 40 Calculate the remainder when 665 is divided by 88. 49 Calculate the remainder when 7973 is divided by 2635. 68 Calculate the remainder when 176289 is divided by 498. 495 Calculate the remainder when 57830 is divided by 27. 23 What is the remainder when 104324 is divided by 1013? 998 Calculate the remainder when 8885 is divided by 114. 107 Calculate the remainder when 205050 is divided by 163. 159 What is the remainder when 3463 is divided by 222? 133 What is the remainder when 4188 is divided by 1643? 902 Calculate the remainder when 19940 is divided by 11. 8 Calculate the remainder when 459 is divided by 43. 29 What is the remainder when 10765 is divided by 5256? 253 Calculate the remainder when 2883 is divided by 2741. 142 What is the remainder when 1281127 is divided by 154? 1 What is the remainder when 4153 is divided by 262? 223 What is the remainder when 4416 is divided by 756? 636 Calculate the remainder when 23790 is divided by 111. 36 Calculate the remainder when 759964 is divided by 37. 21 What is the remainder when 17875 is divided by 16? 3 Calculate the remainder when 593009 is divided by 43. 39 Calculate the remainder when 2108136 is divided by 47. 45 Calculate the remainder when 39124 is divided by 7823. 9 Calculate the remainder when 294333 is divided by 181. 27 Calculate the remainder when 30043 is divided by 341. 35 What is the remainder when 26810 is divided by 1? 0 Calculate the remainder when 207 is divided by 35. 32 Calculate the remainder when 852086 is divided by 344. 342 What is the remainder when 90014 is divided by 5999? 29 What is the remainder when 43048 is divided by 8389? 1103 What is the remainder when 3565 is divided by 54? 1 What is the remainder when 9487 is divided by 4222? 1043 What is the remainder when 5330 is divided by 252? 38 What is the remainder when 133810 is divided by 189? 187 What is the remainder when 149077 is divided by 142? 119 Calculate the remainder when 2565158 is divided by 520. 518 Calculate the remainder when 20573 is divided by 6828. 89 What is the remainder when 97062 is divided by 27? 24 What is the remainder when 51930 is divided by 25? 5 Calculate the remainder when 8487 is divided by 78. 63 What is the remainder when 67496 is divided by 37? 8 What is the remainder when 26077 is divided by 189? 184 Calculate the remainder when 2598 is divided by 805. 183 What is the remainder when 38409 is divided by 194? 191 Calculate the remainder when 801633 is divided by 132. 129 Calculate the remainder when 1998 is divided by 251. 241 What is the remainder when 50217 is divided by 17? 16 Calculate the remainder when 2476 is divided by 771. 163 What is the remainder when 1287030 is divided by 473? 470 What is the remainder when 23236 is divided by 264? 4 Calculate the remainder when 871 is divided by 823. 48 What is the remainder when 53381 is divided by 190? 181 Calculate the remainder when 48300 is divided by 16096. 12 What is the remainder when 53974 is divided by 540? 514 What is the remainder when 5548 is divided by 78? 10 What is the remainder when 2945 is divided by 2921? 24 Calculate the remainder when 146938 is divided by 237. 235 Calculate the remainder when 86137 is divided by 15. 7 Calculate the remainder when 24167 is divided by 37. 6 What is the remainder when 114946 is divided by 8841? 13 What is the remainder when 108019 is divided by 4696? 11 What is the remainder when 12786 is divided by 1272? 66 Calculate the remainder when 2376 is divided by 187. 132 Calculate the remainder when 25155 is divided by 265. 245 What is the remainder when 55781 is divided by 4? 1 Calculate the remainder when 3209 is divided by 3171. 38 Calculate the remainder when 3378 is divided by 110. 78 Calculate the remainder when 4749 is divided by 817. 664 Calculate the remainder when 227790 is divided by 45556. 10 Calculate the remainder when 413906 is divided by 44. 42 What is the remainder when 37 is divided by 12? 1 Calculate the remainder when 582 is divided by 346. 236 Calculate the remainder when 4726 is divided by 1123. 234 Calculate the remainder when 6887 is divided by 151. 92 What is the remainder when 813078 is divided by 10? 8 Calculate the remainder when 150377 is divided by 1729. 1683 Calculate the remainder when 10417 is divided by 274. 5 What is the remainder when 13909 is divided by 94? 91 What is the remainder when 113966 is divided by 208? 190 Calculate the remainder when 2168 is divided by 672. 152 What is the remainder when 15548 is divided by 379? 9 Calculate the remainder when 8011 is divided by 3103. 1805 What is the remainder when 5952 is divided by 116? 36 What is the remainder when 1439 is divided by 58? 47 What is the remainder when 460222 is divided by 153? 151 Calculate the remainder when 40275 is divided by 212. 207 What is the remainder when 2572 is divided by 638? 20 What is the remainder when 2077366 is divided by 78? 70 What is the remainder when 2945 is divided by 57? 38 What is the remainder when 61031 is divided by 23? 12 Calculate the remainder when 31827 is divided by 757. 33 Calculate the remainder when 2118 is divided by 37. 9 Calculate the remainder when 41859 is divided by 92. 91 Calculate the remainder when 7027 is divided by 3489. 49 What is the remainder when 20364 is divided by 240? 204 What is the remainder when 327744 is divided by 321? 3 What is the remainder when 151864 is divided by 43? 31 What is the remainder when 5333 is divided by 935? 658 What is the remainder when 6926 is divided by 6158? 768 Calculate the remainder when 440618 is divided by 1124. 10 Calculate the remainder when 12871 is divided by 2081. 385 Calculate the remainder when 1155464 is divided by 494. 492 What is the remainder when 14954 is divided by 1068? 2 Calculate the remainder when 30890 is divided by 1101. 62 What is the remainder when 27007 is divided by 16? 15 What is the remainder when 92737 is divided by 734? 253 What is the remainder when 148437 is divided by 9? 0 What is the remainder when 13784 is divided by 627? 617 Calculate the remainder when 18644 is divided by 2. 0 What is the remainder when 96474 is divided by 869? 15 Calculate the remainder when 137767 is divided by 1451. 1373 What is the remainder when 15117 is divided by 7515? 87 Calculate the remainder when 779 is divided by 85. 14 What is the remainder when 693366 is divided by 19? 18 What is the remainder when 463865	{ "pile_set_name": "DM Mathematics" }
. Calculate f(t(a)). 33528a2 + 132a + 2 Suppose 0 = 44s - 33s - 66. Let l(b) = 7b2 + 16b - 16b - sb*2. Let d(c) = 14c - 12c + 14c + 12c. What is l(d(a))? 784a*2 Let w(r) = 92r*2 + 3. Let y(v) = -2299v*2 - 76. Let d(a) = -76w(a) - 3y(a). Let b(t) = -t. Give b(d(j)). 95j*2 Let o(c) be the third derivative of -5c*4/2 + 21c2. Let m(t) be the second derivative of -t4/6 - t + 17. Determine o(m(j)). 120j2 Let y(o) = -118o*2. Let b(n) = 671003n. Calculate y(b(c)). -53128913069062c2 Let w(u) = 28u*2. Let q(h) = -5h + 50. Let s be q(8). Suppose sm = 4m - 6. Let g(l) = -l - 1. Let y(a) = 3. Let n(v) = my(v) - 3g(v). Determine w(n(o)). 252o2 Let b(q) = -7540q + 15093q - 7553q - 3q2. Let z(u) = 3u*2 - 5u. Calculate b(z(f)). -27f4 + 90f*3 - 75f2 Let g(q) = -q2. Let y(m) be the third derivative of -47m4/2 + 1134m*2. Give g(y(u)). -318096u*2 Suppose -9x - 1437 = -5613. Let s(j) = 43 - xj + 44 + 152j - 87. Let y(h) = -h*2. Determine y(s(m)). -97344m2 Let q(g) = -g2 - 195g. Let h(v) = 72v - 10. Let d(b) = -202b + 28. Let w(x) = -5d(x) - 14h(x). Calculate w(q(r)). -2r*2 - 390r Let y(l) = l - 7. Let g(t) = -1251097t. What is y(g(b))? -1251097b - 7 Let s(f) = f*2. Let t(o) = -433o + 3. Let j(c) = -2890c + 20. Let v(a) = 3j(a) - 20t(a). What is s(v(q))? 100q*2 Let k be 40/156/4. Suppose 414 = kx + 2s, -2x + 3x + 2s - 96 = 0. Let g(c) = -2c*2 + 106c - xc. Let l(v) = -v2. What is g(l(f))? -2f*4 Let f(u) = 9u*2 + 6u + 54. Let k(p) = -p - 9. Let y(l) = f(l) + 6k(l). Let b(x) = -6x + 7. What is y(b(h))? 324h2 - 756h + 441 Let a(k) = -2k. Let h(b) = -32b*2 - 4b - 111. Let z(m) = -85m2 - 11m - 331. Let f(q) = 11h(q) - 4z(q). Give f(a(y)). -48y2 + 103 Let j(p) be the second derivative of 0p*3 - 3p - 31/12p4 + 29 + 0p*2. Let u(q) = 2q. Let g(r) = -3r. Let b(d) = -5g(d) - 7u(d). Calculate j(b(l)). -31l*2 Let t(n) = -15141n - 244. Let a(m) = 21m. What is t(a(l))? -317961l - 244 Let a(n) = 28n2 - 32. Let y(q) = 9q*2 - 10. Suppose 3k + 0k - 60 = -3m, 60 = 4m - k. Let c(b) = my(b) - 5a(b). Let p(x) = 14x*2. What is p(c(f))? 224f*4 Let a(z) = -z. Let h(q) = 2q*2 - 22q. Let t(p) = -44a(p) + 2h(p). Let r(y) be the first derivative of -6y2 + 10. Determine r(t(l)). -48l*2 Let v(m) = -83m + 106m - 24m. Let d(k) = -118k - 5. Calculate v(d(b)). 118b + 5 Let u(z) = 961z2. Let h(n) = -20n + 5. Let k(b) = 7b - 2. Let t(d) = -2h(d) - 5k(d). What is u(t(q))? 24025q*2 Let u(v) = -4v. Let a(x) = x*2 + 15x - 21. Let h be a(4). Let s(o) = -10o + 0o - 10o + o + ho. What is s(u(i))? -144i Let d(p) = -p + 2540 - 1273 - 1267. Let c(y) be the third derivative of 7y*5/3 - 2y*2 - 4y. Give c(d(i)). 140i2 Let l be (-14 + (-3 - 0))/(-1). Let n(s) = 26 + 5s - ls + 34 - 60. Let i(o) = -7o*2. Give i(n(h)). -1008h*2 Let b(z) = 2z*2. Let j(q) = -8q - 16q + 47q - 9q - 7q - 29. Determine b(j(w)). 98w2 - 812w + 1682 Let i(f) = 32f - 8. Let t(b) = -21b + 5. Let k(z) = -5i(z) - 8t(z). Let u(j) be the first derivative of -j*3 + 7338. What is u(k(m))? -192m*2 Let v(o) = 184o*2. Let g(m) = -17m. Let d(b) = 74b. Let r(t) = -d(t) - 4g(t). Determine r(v(p)). -1104p2 Let x(c) be the second derivative of c7/1260 - c5/120 + 5c*4/6 - 3c - 2. Let j(a) be the third derivative of x(a). Let p(n) = 2n2. What is j(p(m))? 8m*4 - 1 Let u(t) = -37t*2. Suppose -38 = -18w - 2. Let c(x) = -4x2 - 10x2 + xw + 11x2. Calculate u(c(b)). -148b*4 Let t(w) = 1843w - 2w2 - 3658w - 3w2 - 50 + 1815w. Let k(r) = 11r. Calculate t(k(z)). -605z*2 - 50 Let u(p) be the first derivative of -2231p*3/3 - 1792. Let m(x) = 3x*2. What is u(m(d))? -20079d*4 Let j(r) be the second derivative of 67r*4/12 + 11r. Let z(n) be the second derivative of n*3/3 + 2195n. What is z(j(a))? 134a2 Let h(n) = 958633n. Let k(j) = 5j2. Give h(k(g)). 4793165g*2 Let z(s) = 4s + 0s - 5s. Let b(t) be the first derivative of -128t3 + 1863. Calculate z(b(j)). 384j*2 Let a(p) = 3p + 6p + 0p - 6p. Let x(j) be the third derivative of j4/6 + 9j*3/2 - 30j*2 + 40j. Calculate x(a(g)). 12g + 27 Let y(o) = -7701o*2. Let v(k) = 71k. Give v(y(r)). -546771r2 Let x(p) = 47p*2. Let z(d) = 10984153d - 10984187d + 1 - 1. What is z(x(g))? -1598g*2 Let r(d) be the third derivative of -7d5/60 - d2. Let c(f) be the third derivative of 2f5/15 - 1415f*2 + 3f. What is r(c(i))? -448i4 Let k(a) = 531247a*2. Let v(t) = -402t*2. Calculate v(k(c)). -113453796753618c4 Let y(z) = z2 + 39z + 245. Let p be y(-8). Let f(d) = 528d - 14. Let q(h) = 264h - 6. Let v(m) = pf(m) + 7q(m). Let a(n) = n. Calculate v(a(c)). 264c Let v be 2 - (-252)/(-120) - (-1)/10. Let w(c) be the first derivative of vc - 1/3c*3 - 1 + 0c*2. Let k(q) = -54q. Determine k(w(b)). 54b2 Let g(j) = 989j. Let o(b) be the first derivative of -b*3/3 + 411. Determine g(o(r)). -989r2 Let k(j) = j3 - 10j2 - 12j + 13. Let q be k(11). Let x(l) = -3l + 72l*q - 70l*2 + 3l. Let y(s) = 2s + 5. What is x(y(f))? 8f*2 + 40f + 50 Let n(h) = 2h + 11. Let p be n(-6). Let q(v) = 25v*2 - 4v - 16v + 5v2. Let u(t) = -t2 + t. Let o(k) = pq(k) - 20u(k). Let s(r) = -2r. Give o(s(i)). -40i*2 Let z(q) = -4q*2. Let v(h) = 1739543h*2. What is z(v(s))? -12104039395396s*4 Let c(z) = -134z - 1. Let d(r) = 404r2 + r + 83. Calculate c(d(p)). -54136p*2 - 134p - 11123 Let w(o) = -352o. Let s(q) = 73q - 1. What is s(w(p))? -25696p - 1 Let f(r) = -8r + 3. Let h(n) = 14n2 - 2920n - 11. Calculate f(h(a)). -112a2 + 23360a + 91 Let y(n) be the second derivative of n4/3 - n2 + n. Let p(f) be the first derivative of f*2 - 310. Calculate p(y(c)). 8c*2 - 4 Let l(m) be the first derivative of -16 + 1/2m*2 + 4/3m*3 + 0m. Let c(v) = v. What is l(c(s))? 4s2 + s Let r(h) = h2 - 102 + 53 + 49 + 2h. Let s(b) = -b*2 + 15b. Let o(a) = -r(a) + s(a). Let x(j) = j. What is x(o(t))? -2t2 + 13t Let b(l) = 9l. Suppose 119 = 3k + 95. Let h(t) = kt2 - 32t*2 + 15t*2. Determine b(h(i)). -81i*2 Let o(r) = -10r*2. Let g(l) = 1118l - 558l + 5 + 6 - 562l. Determine g(o(x)). 20x2 + 11 Let a(c) = 59c*2. Let p(o) = 114o - 48. Let f(v) = -12v + 5. Let b(j) = 48f(j) + 5p(j). What is a(b(t))? 2124t*2 Let w(l) = -l. Let j(s) = 18s - 6. Let m be j(1). Suppose 4o - m = -0o. Let a(g) = 3 - o - 83g2 + 95g*2. Calculate w(a(k)). -12k*2 Let m(a) = -174a*2 - 5. Let s(l) be the second derivative of -5l*4/12 - 39l - 11. Determine m(s(v)). -4350v4 - 5 Let h(m) = m2. Let p be 21/(-1)4/(-3). Suppose 3z = z + p. Let a(w) = 3w + 4w - zw + 22w. Give a(h(y)). 15y2 Let m(z) = z2 + 31. Let y(p) = -4p2 + 30p + 5. Let c(r) = -6r - 1. Let s(g) = 5c(g) + y(g). Determine m(s(i)). 16i4 + 31 Let g(a) = -198a. Let d(r) = 48r2 - 30r*2 - 7r*2 - 6r*2. What is g(d(x))? -990x*2 Let p = -301 + 328. Let l(k) = 25k + pk + 25k - 80k. Let j(b) = 15b*2 - b. Calculate l(j(r)). -45r*2 + 3r Let n(i) = 2i - 1. Suppose -9h - 14 = 5h. Let z(w) = -w - 1. Let o(c) = -1. Let k(f) = hz(f) + o(f). Calculate n(k(s)). 2s - 1 Let d(t) be the second derivative of t3/6 - 516t - 6. Let x(i) = 7i2 + 432i. Determine x(d(k)). 7k2 + 432k Let b(i) = -4i. Let p = -568 + 847. Let s(a) = -279 - 10a*2 + p. Give s(b(j)). -160j*2 Let i(u) = 1421121u*2 + 2. Let p(w) = w. What is p(i(z))? 1421121z*2 + 2 Let w(v) = 5v. Let h(f) = -377f2 + 58. Let g(r) = -2641r*2 + 435. Let y(m) = 2g(m) - 15h(m). Give y(w(b)). 9325b*2 Let z be (2310/1617)/((-10)/(-224)). Let p(r) be the second derivative of 0 + 0r*2 + 31/6r*3 + zr. Let s(t) = -t. Calculate s(p(x)). -31x Let q(o) = o. Let l(z) = -2z*2 + 4z + 14. Let g(d) = l(d) - 4q(d). Let h(x) be the third derivative of x4/12 + 8x*2 - 40x + 2. Calculate h(g(c)). -4c2 + 28 Let w(i) = 3i*2. Let k(p) = 11p - 7. Let r(a) = 10a - 11. Suppose -3q - 8q - 22 = 0. Let l(x) = qr(x) + 3k(x). Determine l(w(u)). 39u*2 + 1 Let u(j) = -197j*2 - j - 172j**2 + j + 36	{ "pile_set_name": "DM Mathematics" }
de -3 by 4125087. -1/1375029 Calculate 55117618 divided by 2207. 24974 39934392 divided by -6655732 -6 Calculate -44729892 divided by -11182473. 4 6054384 divided by 28 216228 Calculate 865338192 divided by -414434. -2088 What is -2012169 divided by -1? 2012169 Calculate -71 divided by 26960. -71/26960 Calculate 39445 divided by 362. 39445/362 What is 765 divided by -41160? -51/2744 -64889576 divided by 5 -64889576/5 Calculate -236224890 divided by 715833. -330 Calculate 55244800 divided by -1664. -33200 Calculate 152155998 divided by -3. -50718666 Calculate -167322170 divided by 5. -33464434 1 divided by 3302810 1/3302810 -926425996 divided by 231606499 -4 Divide 68182142 by 6. 34091071/3 What is 661594696 divided by 5? 661594696/5 What is 26638 divided by -5848? -13319/2924 Calculate 47 divided by 93629. 47/93629 15667260 divided by -4380 -3577 What is 19158111 divided by 155757? 123 Divide 362860580 by 21452. 16915 Calculate 28435002 divided by -3. -9478334 Calculate -94672416 divided by -138. 686032 Calculate 10046 divided by 11432. 5023/5716 -1110937 divided by 288 -1110937/288 Divide -22101856 by -7. 3157408 Calculate 3048491 divided by 29597. 103 Calculate -37626564 divided by -9406641. 4 What is -10129 divided by -2943? 10129/2943 95819400 divided by 159699 600 Divide -86 by -6108921. 86/6108921 10 divided by -3283103 -10/3283103 Calculate -1197445 divided by 133. -1197445/133 Calculate 286473 divided by 1932. 95491/644 10182003260 divided by 5 2036400652 What is 15224286 divided by -692013? -22 Calculate 3256337 divided by 6. 3256337/6 Divide 222 by -182039. -222/182039 What is -7651268 divided by 1912817? -4 -46976787 divided by 897 -52371 Calculate -2791928 divided by -2791928. 1 -2 divided by 140542125 -2/140542125 179857416 divided by 44964354 4 What is 72583 divided by 737? 72583/737 Calculate -1675984 divided by 21. -1675984/21 Divide 26473 by 26. 26473/26 What is -15 divided by 17537417? -15/17537417 1225569 divided by -408523 -3 Calculate 121614930 divided by -206127. -590 Calculate -58121888 divided by 8. -7265236 What is 34049 divided by -585? -34049/585 -1793446 divided by -31 1793446/31 3465478 divided by -1732739 -2 Divide -14829565 by 2965913. -5 What is -96218472 divided by -4809? 20008 What is -4 divided by 137683036? -1/34420759 Divide 6 by 53286804. 1/8881134 Divide -10277700 by -5. 2055540 Calculate 25792992 divided by -186. -138672 What is -382692 divided by -32? 95673/8 2285328 divided by -1 -2285328 4 divided by 34328441 4/34328441 Divide 0 by 698744. 0 1 divided by -5358504 -1/5358504 52479549 divided by -9 -5831061 What is 1 divided by -501839? -1/501839 Calculate 215261185 divided by -89. -2418665 Calculate 585 divided by 101946. 15/2614 Divide -61 by 510768. -61/510768 What is -108167566 divided by -4160291? 26 Calculate -372144 divided by -1. 372144 -4271321 divided by -6 4271321/6 What is 3702930 divided by 14? 264495 Divide -2648090782 by 1. -2648090782 What is -281094924 divided by 93698308? -3 Divide 138135152 by -164056. -842 -18574472 divided by 763 -24344 What is 3 divided by -4355874? -1/1451958 Calculate 10643990 divided by 371. 28690 Divide 288 by -431656. -36/53957 -2374 divided by -220277 2374/220277 Calculate -2215742 divided by 2215742. -1 Divide 505571 by 45. 505571/45 Divide -194637 by 86. -194637/86 Divide -76103963 by 129649. -587 35335680 divided by -1104240 -32 Calculate 4289877 divided by 1429959. 3 Divide -1502016 by 125168. -12 25364537 divided by 781 32477 Divide -4059501 by -2. 4059501/2 464105 divided by -12 -464105/12 Calculate 107105409 divided by -1322289. -81 Divide -53929315 by 3. -53929315/3 -5 divided by 24722121 -5/24722121 What is 21303968 divided by -8? -2662996 Calculate 4155157 divided by 3. 4155157/3 -8 divided by -72737409 8/72737409 4 divided by -237798998 -2/118899499 What is 1558 divided by -249071? -82/13109 What is 0 divided by 75804554? 0 -2908670 divided by 905 -3214 -2025793 divided by 1 -2025793 8 divided by 362164 2/90541 124170 divided by 5 24834 Calculate -25630 divided by 13127. -25630/13127 Divide -67116388 by 9. -67116388/9 What is 188290713 divided by -793? -237441 -86052983 divided by 2 -86052983/2 Calculate -9947373 divided by 3315791. -3 -1342185 divided by 1342185 -1 -457167384 divided by 369 -1238936 Divide 238651542 by -939573. -254 -71 divided by -563679 71/563679 Calculate -1228605 divided by 270. -81907/18 What is 36754658 divided by 2813? 13066 Calculate -2198 divided by 592. -1099/296 Calculate -61 divided by -701301. 61/701301 -302467 divided by 290 -302467/290 What is 18555516 divided by -19782? -938 -101689788 divided by 6 -16948298 -97 divided by -2361478 97/2361478 What is 2309378 divided by 101? 2309378/101 35930256 divided by -8982564 -4 Calculate -47031088 divided by 2614. -17992 Calculate -16107525 divided by 8. -16107525/8 -30 divided by -395312 15/197656 Divide -3101291 by 6. -3101291/6 Calculate -67462953 divided by -51. 1322803 Divide -1164594 by -1164594. 1 Calculate -5 divided by -2653636. 5/2653636 Calculate -1424627 divided by -336. 1424627/336 Calculate 264872223 divided by 24079293. 11 What is 59832976 divided by 56234? 1064 5 divided by 265654305 1/53130861 What is 90208665 divided by -44155? -2043 Divide 349 by 35675. 349/35675 Calculate -299133753 divided by -29. 10314957 -4 divided by 69167473 -4/69167473 What is -39258627 divided by -17? 2309331 What is 937106 divided by -21? -937106/21 Divide -613261 by 613261. -1 Calculate -38925 divided by -611. 38925/611 What is -7 divided by 1143021? -7/1143021 What is 254925880 divided by -692? -368390 Divide 1 by -386501056. -1/386501056 113750 divided by -95 -22750/19 Divide 4 by -12871868. -1/3217967 Divide 52800 by -800. -66 5045940 divided by -59364 -85 Divide 16187850 by 299775. 54 Calculate -4950200 divided by -7. 4950200/7 Divide -3 by 5628986. -3/5628986 Calculate 24716793 divided by 5. 24716793/5 What is -48287442 divided by -1813? 26634 What is -630704532 divided by 2? -315352266 Divide -718084131 by 14080081. -51 -38171848 divided by 547 -69784 37328308 divided by -4252 -8779 Divide -133849 by 461. -133849/461 Divide 215 by 198651. 215/198651 -12310712 divided by -5 12310712/5 -10311286 divided by 5155643 -2 107800140 divided by -2 -53900070 Calculate 0 divided by 130068354. 0 Divide 9119928 by 2. 4559964 Divide 291685333 by 4. 291685333/4 Calculate -419 divided by 38679. -419/38679 Calculate -3429 divided by 89507. -3429/89507 221075 divided by -353 -221075/353 What is 631 divided by 21095? 631/21095 What is -72858738 divided by -15094? 4827 What is -5082624 divided by -192? 26472 What is 0 divided by 64793356? 0 Calculate -445 divided by -39175. 89/7835 4 divided by -205634905 -4/205634905 What is 47 divided by -174119? -47/174119 Divide 45882364 by 11. 4171124 6117470 divided by -1327 -4610 What is -591885 divided by 45? -13153 What is 5 divided by 20068174? 5/20068174 Divide 19014864 by 6. 3169144 Divide -11006660 by 1100666. -10 Calculate 208364 divided by -16028. -13 Divide -5535000 by -18. 307500 203923580 divided by 1 203923580 485288288 divided by -150992 -3214 Divide 402204 by 33517. 12 Divide 724554 by 13. 724554/13 What is 56452 divided by -377? -56452/377 Calculate -11327854 divided by 25. -11327854/25 Divide -3253600 by 81340. -40 Divide -415 by 167383. -415/167383 What is 22069368 divided by -11034684? -2 -6580035 divided by 104445 -63 -19630302 divided by 282 -69611 Calculate -6838320 divided by -10. 683832 What is 18435058 divided by 4? 9217529/2 Divide -6876362936 by -4. 1719090734 Calculate -2604848 divided by -4586. 568 -807731285 divided by -5 161546257 Calculate 16 divided by -42790025. -16/42790025 What is 1761009980 divided by 4? 440252495 What is 474812 divided by -7? -474812/7 Calculate 2177 divided by 2779. 311/397 Divide -163810944 by -827328. 198 -84370788 divided by 7030899 -12 What is 11 divided by -8395804? -11/8395804 6869016 divided by -63602 -108 Calculate 726360 divided by 145272. 5 -939195 divided by 7 -939195/7 16692 divided by -1489 -16692/1489 What is -17974123 divided by -17974123? 1 5798160 divided by -4 -1449540 11876694 divided by -2 -5938347 -22367523 divided by -5 22367523/5 Calculate -239962 divided by -1415. 239962/	{ "pile_set_name": "DM Mathematics" }
e hb(u) + 6a(u). u*2 - 3u - 2 Suppose -12c - 5 - 7 = 0. Let r(n) = -4n + 17. Let u(y) = -y - 1. Determine cr(j) + 6u(j). -2j - 23 Suppose 256 = 19k + 66. Let o(n) = 8n - 3. Let p(v) = -24v + 10. Determine ko(b) + 3p(b). 8b Let m(s) = 113s*2 + 39. Let p(l) = -340l*2 - 2l - 130. What is 10m(j) + 3p(j)? 110j2 - 6j Let i(o) = -o*2. Let q(s) = -13s*2 - 31s + 2. Determine 4i(x) - q(x). 9x*2 + 31x - 2 Let y(b) = -26b + 866. Let n(g) = 51g - 1665. Determine -5n(d) - 9y(d). -21d + 531 Let x(z) = 246z*2 + z + 4. Let f(l) = -l - 1. Determine -3f(j) - x(j). -246j2 + 2j - 1 Let v be (3/2)/((-168)/392 - 27/(-14)). Let m(w) = -4w - 2. Let p(k) = 1. Calculate vm(d) + 3p(d). -4d + 1 Let w = 355 + -350. Suppose 9 + 11 = wz. Let y(j) = -4j*2. Suppose -2g - 5n - 4 = -3n, 3g + 12 = 3n. Let h(u) = -4u2. Give gh(k) + zy(k). -4k*2 Let l(p) = 4p*3 - 16p*2 + 16p - 16. Let g(w) = -w + 37. Let y be g(40). Let v(r) = -r*3 + 3r*2 - 3r + 3. Give yl(a) - 16v(a). 4a3 Let m(f) = -f + 6. Suppose -4c = -4l, -4c + 342l - 347l = -9. Let g(h) = -4. Let i(d) = -1. Let b(s) = -g(s) + 3i(s). Determine cm(o) - 6b(o). -o Let y(h) be the third derivative of -h4/6 + 5h*3/6 - 2h*2 - 1210h. Let a(x) = -x + 2. Determine -8a(q) + 3y(q). -4q - 1 Let z(j) = -j2 + j. Let f(x) be the first derivative of -8/3x*3 + 5 + 5/2x*2 + 0x. Let u be (-4)/(-8) - ((-18)/(-4))/(-9). Determine uf(b) - 5z(b). -3b2 Let t(c) = -603c + 8. Let q(i) = 606i - 9. Calculate 6q(p) + 7t(p). -585p + 2 Let b(j) = 57j3 + 13j*2 - 9j - 9. Let q(i) = 28i3 + 7i*2 - 4i - 4. Give -4b(u) + 9q(u). 24u3 + 11u*2 Let w(z) = -6z - 17. Let q = -586 - -578. Let n(r) = 4r + 11. Calculate qn(y) - 5w(y). -2y - 3 Let v(p) = 2p2 + 2p - 1. Let l be v(-2). Suppose -lj = 5 - 11. Let s(y) = 1 - 995y + 995y + y2. Let f(n) = -2n*3 + 2n*2 + 2. What is js(g) - f(g)? 2g3 Let t(w) = -w2 - 9. Let m be t(0). Let f(o) = 4o*2 + 818o - 8134. Let p be f(-214). Let q(x) = -13x + 7. Let i(n) = 3n - 2. What is mi(y) + pq(y)? -y + 4 Let x(j) = -j - 5 + 4 + 5. Let m(d) be the first derivative of d*2 - 8d + 7530. What is -4m(o) - 9x(o)? o - 4 Let p(c) = 6c2. Let y(f) = f2. Let v(h) = 2h + 32. Let b be 2 + 4/(-3) + (-374)/3. Let l = 105 + b. Let d be v(l). Give dy(q) + 2p(q). 6q2 Let k be 18(-2)/(-2). Let l(s) = 6s - 22. Let x(q) = -4q + 15. Let n(c) = 5l(c) + 8x(c). Let a(j) = -1. Suppose -105 = -2u - 103. Give ka(d) + un(d). -2d + 2 Let d(j) be the first derivative of -j3 - j2 + 6j - 2024. Let r(g) = g*3 - 10g*2 - 7g + 19. Calculate 7d(c) - 2r(c). -2c3 - c2 + 4 Let k(f) = 23 + 30 + 27 + 29 + 3f*2 - 103 - 2f*3. Let h(s) = -4s*3 + 7s*2 + 13. Determine -2h(l) + 5k(l). -2l3 + l2 + 4 Let q(r) = -8591284r + 8591286r - 5r2 - 3r*2. Let m(f) = -16f*2 + 5f. Suppose 2d - 3d = -3, -h + 11 = 2d. Calculate hq(t) - 2m(t). -8t*2 Let l = -272 - -274. Let n(r) = -1 + 0 - 4 + lr + 3. Let m(h) = 2h - 2. Calculate 5m(o) - 6n(o). -2o + 2 Let p(l) = -l. Let j(i) = i*2 - 7i + 1. Let x be (-2 + 4)/((-10)/(-230)). Suppose 5d = x - 16. Give dp(r) - j(r). -r*2 + r - 1 Let g(o) = -3o - 3. Let q(y) = 4y + 2. Let f(h) = h2 - 13h - 112. Let r be f(19). Let n be 8/44 + (186/33)/r. Give nq(p) + 2g(p). 6p Let v(h) = 4h*2 - 32h + 31. Let p(u) = -2u2 + 22u - 21. Determine 7p(s) + 5v(s). 6s2 - 6s + 8 Let p(g) = g3 - g2 - g. Let j be (15 + 564/(-48))-20. Let y(k) = 52k*3 - 65k*2 - 65k. Give jp(r) + y(r). -13r3 Let y(w) = w2 - 2w - 2. Let s = 5 - 3. Let j(m) = 603m + 21 + 572m - 1154m - 9m2. Calculate sj(z) + 21y(z). 3z*2 Let a(z) = 10z*2 - 4z. Let q(l) = 9l2 - 3l. Let v(p) = -p*2 + 10p - 17. Let c be v(5). Let u be (6/c)/((-48)/(-256)). Determine uq(h) - 3a(h). 6h2 Let k(z) = 4z. Let c(o) be the first derivative of -12o2 - 30 + 12o*2 - 10o*2. Determine 3c(i) + 16k(i). 4i Let t(b) = -b + 3b - 3b. Let h(s) = 6s. Suppose 0 = -121m - 771m + 117 + 775. Calculate mh(i) + 2t(i). 4i Let y(u) = -u. Let c(b) = -10b2 - 8b - 13. Let f(h) = 19h2 + 15h + 22. Let v(t) = -5c(t) - 3f(t). Give -v(j) + 4y(j). 7j*2 + j + 1 Let g(a) be the first derivative of 7a*3/6 + 7a*2/2 + 55a - 43. Let h(c) be the first derivative of g(c). Let b(m) = 20m + 20. What is 6b(y) - 17h(y)? y + 1 Let i(g) = 25g*2 - 13g - 3. Let f(l) = 79l2 - 38l - 10. What is 6f(a) - 19i(a)? -a*2 + 19a - 3 Suppose -10b + 147 = 11b. Let m be -5 + (b - 7) - -11. Let g(k) = k3 + 4k - 4. Let c(j) = -j*3 - 3j + 3. Calculate mc(f) - 3g(f). f*3 Let g(r) = -28r*2 + 158r + 1173. Let m(t) = 15t2 - 85t - 586. Determine 7g(y) + 13m(y). -y*2 + y + 593 Let l(s) = -4s*3 + 124s*2 - 26s - 6. Let v(t) = 4t3 - 122t*2 + 20t + 5. What is 3l(q) + 4v(q)? 4q3 - 116q*2 + 2q + 2 Let v(b) = -15b2 - b + 1. Let d(w) = 76w*2 + 5w - 6. Let y = -20926 - -20937. Give yv(g) + 2d(g). -13g2 - g - 1 Let r(h) = -1243h*2 - 23h + 29. Let n(i) = -1243i2 - 18i + 23. Determine 5n(g) - 4r(g). -1243g2 + 2g - 1 Let t(q) = -31q2 - 4q + 6. Let s(z) = 32z2 + 5z - 5. Calculate 3s(d) + 2t(d). 34d2 + 7d - 3 Let o(t) = 4t2 - 13t - 11. Let i(x) = 4x2 - 3x - 111. Let u(p) = -2p2 + p + 60. Let n(k) = -6i(k) - 11u(k). Give -11n(b) - 6o(b). -2b*2 + b Suppose 15t = 14t - 3z + 21, -4t = 2z - 24. Let v(i) = 4i. Let k(o) = 5o - 1. Determine tk(b) - 2v(b). 7b - 3 Let j(g) = -5g + 2. Let k(u) = -24u + 21. Let w(b) = 2b - 2. Suppose -11h + 11 - 110 = 0. Let c(t) = hw(t) - k(t). Give 3c(z) + 4j(z). -2z - 1 Let k(i) = -3i*3 - 22i + 4. Let m(c) = 9c3 + 44c - 10. Determine 5k(v) + 2m(v). 3v3 - 22v Let x(k) = -3k2 - 5k + 1. Let q(n) = -34n2 + 217n + 1. What is -q(l) + x(l)? 31l2 - 222l Let j(k) = 28k3 + 424k*2 + 14k. Let o(l) = 25l3 + 425l*2 + 12l. Give 8j(a) - 9o(a). -a*3 - 433a*2 + 4a Let l(x) be the third derivative of -x6/20 + x5/20 + 3x2. Let a(z) = 6z*3 - 7z*2 - 2336z + 2336z + 6z*3. Determine 2a(k) + 5l(k). -6k3 + k2 Let z(i) = 7322i3 - 23i*2 + i - 35. Let p(y) = -666y*3 + 2y*2 + 3. Determine -23p(c) - 2z(c). 674c*3 - 2c + 1 Let s(i) = -17 + 7 + 2i - i + 8. Let w be s(5). Let v(b) = -5b*2 - 14b + 17. Let p(q) = 2q2 + 5q - 6. Calculate wv(u) + 8p(u). u*2 - 2u + 3 Let m(q) = q*2 + q - 3. Let p(k) = -8k*2 - 444k + 32. What is -10m(b) - p(b)? -2b*2 + 434b - 2 Let s(j) = 24j - 663. Let h(z) = -53z + 1325. Calculate -4h(c) - 9s(c). -4c + 667 Let i(v) = 3v*2 - 4v - 4. Let a(f) = -3f + 1 - 4 + 2f*2 + 0. Let o be 315/385 - (-4)/22. Let u be ((-19)/(-4) - o) + 99/(-132). Determine ui(y) - 4a(y). y2 Let l(c) = c + 4. Let y(a) = 5a - 810. Let s(r) = 2r - 285. Let h(f) = 17s(f) - 6y(f). Give -6h(u) + 26l(u). 2u + 14 Let g(f) = 57f2 + 11f - 11. Let t(k) = 29k2 + 6k - 6. Let u be 12/(-234)-1366/4. Determine ut(n) - 6g(n). -23n2 Let w(y) = 2y. Let u(c) = -17451c. What is -u(z) - 9695w(z)? -1939z Let v = 16905 + -16907. Let y(b) = 13b. Let r(q) = -14q + 1. Give vr(x) - 3y(x). -11x - 2 Let c(d) = 1208d + 1213d - 3626d + 2d*2 - 7d*3 - 5 + 1203d. Let n(l) = l*3 + 1. What is -c(v) - 6n(v)? v*3 - 2v*2 + 2v - 1 Let g(m) = -9m - 4. Let w(f) = -7f*3 - 4f*2 - 2f + 1. Suppose 4q = 8q + 4. Let p be w(q). Let v(b) = -b + 11b + p - 1. Give -5g(a) - 4v(a). 5a Suppose -6 = 3t, -2q + 3t = 7t + 86. Let f = -34 - q. Let h(x) = 8x + 2. Let a(u) be the first derivative of 7u*2/2 + 2u + 7. What is fh(w) - 6a(w)? -2w - 2 Let s(y) = -y3 + 7y + 4. Let b(g) = -8g3 + g2 + 45g + 24. What is 2b(d) - 13s(d)? -3d3 + 2d*2 - d - 4 Let a(p) = -18357p + 6. Let j(s) = 6127s - 2. Calculate 2a(n) + 7j(n). 6175n - 2 Suppose 2a + 3b + 1 = -1, 0 = -5a + 4b + 18. Let m(w) = 1. Let d = -3343 - -3338. Let x(h) = -h*2 + h + 2. What is ax(v) + dm(v)? -2v*2 + 2v - 1 Let q(j) = 508j2 - 40j - 2. Let g(k) = -2k2 + 2k. What is -20g(r) - q(r)? -468r*2 + 2 Let t(m) = 3m + 4. Let o(h) = -56*h - 77.	{ "pile_set_name": "DM Mathematics" }
6/h. Let k be (2 + 2)/((-1)/r). Calculate the greatest common divisor of 2 and k. 2 Let q be -3 - (1-51)/1. Let h be (36/96)/((-19)/(-1064)). What is the greatest common divisor of q and h? 3 Suppose 0 = 3k + i + 6 + 3, 5i = -15. Let p be (-13)/((-5)/(k - 23)). Let y = -56 - p. Calculate the greatest common divisor of y and 1. 1 Let g(d) = -36d - 254. Let s be g(-12). Let p = 183 - s. Calculate the highest common factor of 395 and p. 5 Let y be (23/5)/((-87)/15 - -6). Suppose 116 = 3l + y. Suppose -z + 33 = 5v - l, 4z - 16 = 0. Calculate the highest common factor of 48 and v. 12 Let q = -489 + 494. Let p(u) = -u3 + 7u*2 - 3u - 5. Let k be p(q). Calculate the highest common divisor of k and 240. 30 Let h = -96 + 96. Suppose 2y - y - 14 = h. What is the highest common factor of 238 and y? 14 Suppose -48c - 3j + 22143 = -46c, 11067 = c - 3j. What is the greatest common factor of 54 and c? 54 Suppose 77j + 6899 = 35466. Calculate the highest common factor of j and 212. 53 Let z(v) = 2v2 + 16v - 3. Let c be z(-8). Let f(q) = 7q + 41. Let l be f(c). What is the greatest common factor of 320 and l? 20 Suppose -2w = -24 + 6. Let d be (-1)/((-1)/4w/738). Let h = -230 + d. Calculate the highest common divisor of h and 14. 14 Suppose 4x - 15 - 797 = 0. Let o = x + -191. Calculate the greatest common factor of 120 and o. 12 Let w be -2 + (-5 - -9) - -5. Suppose -3g - 23 = -8u + 3u, 16 = -4g + 3u. Let k = g + w. What is the highest common divisor of k and 66? 6 Let y = 7621 - 7573. What is the greatest common divisor of y and 1440? 48 Suppose -3z = -5o + 2043, -3o + 5z - 773 = -1970. Calculate the greatest common divisor of o and 18. 18 Let a(n) = 14n - 4. Let t be a(2). Suppose 0 = -tg + 9g + 300. Let j(v) = -81v3 - 1. Let q be j(-1). What is the greatest common factor of g and q? 20 Let i = -45 + 61. Let c(j) = -98j - 1856. Let d be c(-20). What is the greatest common factor of d and i? 8 Let f be (4904 - 0)(-23250)/(-3000). Calculate the greatest common divisor of 62 and f. 62 Let f be (305(-8)/(-80))/(2/(-8)). Let l be ((-22)/(-3))/(f/(-183)). Let h(t) = -6t - 1. Let g be h(-2). Calculate the highest common divisor of g and l. 11 Suppose 0 = -v + 3v - 8. Suppose 3x + 15 = -z - 2x, -26 = -2z + vx. Suppose za - a - 576 = 0. What is the greatest common divisor of a and 18? 18 Let w(b) = 731b*2 - 6b - 3. Let q be w(-1). Let y = -274 + q. Calculate the highest common divisor of y and 60. 20 Let q = -121 + 205. Let a = 126 - q. Suppose 4d = 5d - 126. Calculate the greatest common divisor of d and a. 42 Let t(y) = -y*3 + 12y*2 + 5y + 33. Let l = -178 + 189. Let q be t(l). Calculate the highest common divisor of 22 and q. 11 Let d(t) = t*3 + 18t*2 + 10t + 8. Let k be d(-10). Let b(h) = -h*3 + 25h*2 + 118h + 1. Let v be b(29). Calculate the highest common divisor of v and k. 59 Let c(r) = 6r2 - 23r - 22. Let y be c(-1). Let s = 151 - 18. Calculate the highest common factor of s and y. 7 Let c be 2 + 15/(-10) - (-3)/2. Suppose -m + 12 = -cb + 5b, m = 2b - 3. Calculate the highest common divisor of m and 129. 3 Let n = 2269 - 1846. Calculate the highest common factor of n and 18. 9 Suppose 0 = -13b - 5b + 72. Let z = b + 149. Suppose 2g = 3t + z, -3g - 3t - t = -221. Calculate the greatest common factor of 50 and g. 25 Suppose -189 = -41n + 20n. Let h = -11 + 14. What is the highest common divisor of h and n? 3 Suppose 8p - 1755 = -3l + 4p, -p - 6435 = -11l. What is the highest common factor of l and 1365? 195 Suppose -454 - 24 = -23z + 304. Calculate the greatest common factor of 1649 and z. 17 Suppose -274 = 52p - 482. What is the greatest common divisor of p and 2372? 4 Let u be 7 - (-13)/(4 + -5). Let l(t) = -4t + 88. Let m be l(u). What is the greatest common divisor of 7 and m? 7 Let r = -35160 + 38212. Calculate the highest common divisor of r and 28. 28 Suppose -34 = -29x + 28x. Suppose -36u = -xu - 4. Calculate the greatest common factor of u and 74. 2 Suppose -4 = -6y + 4y. Suppose 3o - 5n = -yn - 15, -n = 4o - 5. Let r be o - 90/(-8 + 5). What is the highest common divisor of 10 and r? 10 Let t be (-18)/(-21)(-2352)/(-96). Calculate the greatest common factor of 12 and t. 3 Suppose -2756 = 232j - 20156. Suppose -4k - 4 = -4y - 0k, -5 = -2y - k. Suppose -yb = 3b - j. What is the highest common divisor of 10 and b? 5 Let d be (27 + -26)/(2/130). What is the highest common divisor of d and 2015? 65 Suppose n - 17 = 2c, n - 4c - 61 = -4n. Let q be 1 + 156 + (6 - n). What is the greatest common factor of 70 and q? 14 Let c be 12 - (-16 + 2598). Let v be 4/(-14) - c/210. What is the highest common divisor of v and 138? 6 Let v = 4646 + -4624. Calculate the highest common factor of 3839 and v. 11 Let u be (5/10)/((-2)/20). Let v = -68 - -80. Let c be (u/(-7 + v))/(1/(-75)). What is the greatest common divisor of c and 30? 15 Let g = -244 - -612. Suppose -6m = -2m - g. Suppose -124 - m = -3l. What is the greatest common divisor of l and 9? 9 Suppose 34 = 2c - 184. Let g = -58 + c. Calculate the highest common divisor of 85 and g. 17 Let f(u) = u*3 - 10u*2 - 147u + 82. Let s be f(18). What is the highest common divisor of 10864 and s? 28 Suppose -8w + 12w + 12 = 0. Let u = 1 - w. Let g be 47 + u3/(-6). Calculate the greatest common factor of 9 and g. 9 Let p = -1243 + 3193. What is the highest common factor of p and 78? 78 Let v(z) = 5z + 32. Suppose 0 = -t - 1 - 1. Let i be 5/((-10)/4) - t. Let u be v(i). Calculate the greatest common factor of u and 4. 4 Let o be 1012 + 3 + (-2 - -5) + -4. Suppose -v = v - o. Calculate the highest common factor of 39 and v. 39 Let g be 3/(12 + 0) + (-710)/(-8). Suppose 0 = -2f - 5w + 44, w - 5w = -3f + g. What is the highest common factor of 3 and f? 3 Suppose 0 = -5t + 2t - 2p + 6, 0 = 5t + 3p - 9. Suppose -2g - g - 9 = t. Let o be -84/g3. What is the greatest common divisor of 32 and o? 32 Suppose -5q - 346 = -3u, 3q = -u + 27 + 79. Let m be (-3 - 117/(-12))56/3. What is the highest common factor of m and u? 14 Suppose 2u + 2t = 309 + 173, 4u + 2t = 970. Suppose -17w + 266 = -u. Let z be 364/12 - 1/3. What is the greatest common factor of z and w? 30 Let b = 3854 - 3728. Suppose -66 = -2q + 4o, q = -2o + 5o + 36. What is the highest common divisor of q and b? 9 Let m = 19618 + -19570. What is the greatest common factor of m and 9312? 48 Let d be 3/((-12)/8) - -18. Let y = 26 - d. Let z = 12 + 28. Calculate the highest common factor of z and y. 10 Let x be 3(-4)/4 - -7. Suppose xr = -72 + 108. Let m(s) = s2 - 3s + 1. Let i be m(3). What is the greatest common divisor of r and i? 1 Suppose 4l = 4j - 912, -458 = -8j + 6j + 4l. Let o = j + -58. Calculate the greatest common divisor of o and 39. 13 Let a(q) = 73q - 2547. Let y(l) = 9l - 364. Let b(u) = -2a(u) + 15y(u). Let m be b(-42). Let i = -11 + 23. Calculate the greatest common divisor of i and m. 12 Let h(p) = 2p*2 - 54p + 174. Let n be h(43). What is the greatest common divisor of n and 2170? 310 Let v be ((-4)/10)/(36/135)-1266. Calculate the greatest common divisor of v and 9. 9 Suppose -n + 4r = -3, -9n + 5n = -3r + 40. Let x be 9/620/(-30)n. Calculate the highest common divisor of 533 and x. 13 Suppose -7d - 2d = -1404. Let m = -102 + d. What is the greatest common divisor of m and 18? 18 Suppose 0 = 5k + 5l + 65, 5l = -4k - 0l - 48. Let x = 19 + k. Let s = -44 - -46. What is the greatest common divisor of x and s? 2 Let g = -7734 + 11406. What is the highest common factor of 24 and g? 24 Let y(d) = 3d3 - 3d*2 + 3d - 2. Let n be y(2). Let q = 467 + -240. Let a = q - 83. What is the highest common divisor of a and n? 16 Suppose -5o = 5k - 100, o + 6k = 2k + 23. Let d be 1/(283/(-190) + (-36)/(-24)). Let w = d + -38. Calculate the greatest common factor of w and o. 19 Let h(j) = j*2 + 4j - 464. Let k be h(-36). What is the greatest common divisor of k and 129? 43 Suppose 415g - 168 = 412g - 4f, g = 4f + 8. Calculate the greatest common factor of 17644 and g. 44 Let t be 689 - (-10 - (5 + -8)). What is the greatest common factor of 24 and t? 24 Let t(s) = s*3 - 35s**2 +	{ "pile_set_name": "DM Mathematics" }
smaller: g or 10? g Let x be (3 - 5)/40/2. Let a be x/1 + (4 - 366/93). Which is bigger: 0 or a? a Suppose 3p - p - 4j + 106 = 0, 2j + 241 = -5p. Let y = 61 + p. Which is smaller: y or 13? y Suppose g + 2r - 999 = -0r, -2r + 1992 = 2g. Let t = 38729/39 - g. Let f be ((-38)/57)/((-1)/((-3)/2)). Is t <= f? False Suppose r + 4t = 1 + 7, 0 = -3r - 2t + 44. Suppose 2g = -5d - r, 3d = 5g + 3 + 6. Let l be 2/9 - (-11)/(-9). Is l at most d? False Let b be -2 + (-2)/((-12)/173). Let y = b + -27. Which is smaller: 0 or y? y Suppose 4c - 8c = -24. Suppose -3b + c = 75. Does -24 = b? False Suppose 2o = 4o + 4a + 34, -2o = -3a + 41. Let n(s) = -s*3 + 4s*2 + 4s + 5. Let j be n(5). Suppose j = 5h + 127 - 27. Which is greater: h or o? o Let r = 365/63 + -47/9. Let f = 17 - 16. Do r and f have different values? True Let q be (-24)/1015/(-2). Let c be (-18 - -7)(-3)/q. Is c at most as big as 2? True Let i = 3377 - 57437/17. Which is bigger: -1 or i? -1 Let k(w) = w2 - 4w + 1. Let s be k(7). Let b = 21 - s. Which is bigger: -2/47 or b? -2/47 Let j be 53820/(-13410) - 2-2. Which is greater: 0 or j? 0 Let u = 2789 - 571744/205. Is 1/3 < u? False Let t(u) = u3 - 4u*2 + 4u - 4. Let r be t(3). Let c(j) = -4j - 5. Let w be c(-4). Let a = w - 11. Which is bigger: r or a? a Let z = 17443/1540 - 9/220. Is z at least 12? False Let b be (-33)/(-297) - (-1460)/(-18). Which is smaller: -83 or b? -83 Let o = -1127 + 1130. Is 42/19 < o? True Suppose -2c + 4q = -c + 21, -3c + 4q - 103 = 0. Which is greater: c or -39? -39 Let d be ((-3)/9)/(3/(-18)). Suppose -5 = o - 5v - 35, 3o - 2v - 25 = 0. Suppose -3x - 5 = m, om + 5x = -0x + 5. Which is bigger: m or d? m Let y = 4417/15 - 295. Are -2 and y nonequal? True Let t = 204 + -214. Which is greater: t or -35/4? -35/4 Let l be ((-24)/(-16))/(-1(-915)/489). Let p = l - -6/61. Is 1 equal to p? False Let a be (165 - 6) + 2 + -3. Let x = a + -121. Are 0.1 and x unequal? True Let j be (3 + (-4)/2)-139. Is -140 less than or equal to j? True Let u = 2.7 + 2.3. Do u and -2 have the same value? False Let g be 1968/8 - 7 - -9. Which is greater: 247 or g? g Suppose -3t = -7r + 3r + 34, -3r = 6. Let w(f) = -f - 14. Let g be w(t). Which is smaller: g or 3/29? g Let r be (-126)/(-126) + 1/((-1)/3). Is -11/7 <= r? False Let c(r) be the third derivative of -r*4/12 - 5r*3 + 11r2. Let w be c(-14). Is -0.22 smaller than w? False Let u be -1 + (32/(-208) - (-12468)/10738). Which is smaller: 0 or u? 0 Let y(r) = -r3 + 5r2 - 6r + 12. Let w be y(5). Let c = w - -21. Which is smaller: c or 6? c Let x(a) = -126a + 9. Let o(n) = -1. Let l(r) = -12o(r) - x(r). Let f be l(-1). Is -124 > f? False Let r be (-6 - (-238)/28)4/(-5). Let y = -32/5 + 83/20. Let s = y + 3/4. Is s greater than r? True Let w = 398 + -453.6. Let t = w + 56. Which is greater: t or -5? t Let l be 42/28 - (-78)/(-68). Is -0.2 at least as big as l? False Let m = 9 - 4. Let g = 11 + -11. Let u = m + g. Which is smaller: u or 3? 3 Let l be (10 + -1)(-10)/(-10). Let k = 35 - 25. Which is smaller: k or l? l Let z be (-580)/28 + 2/(-7). Let a = -892 + 871. Are a and z nonequal? False Suppose -6g = -g - 45. Let a = -8543/4 + 2146. Let p = a - g. Which is bigger: p or -0.1? p Let c = -1.284 - -0.184. Which is smaller: 1 or c? c Let c = -1.35 - -0.25. Let l = 0.94 + c. Let m = 3.16 + l. Is 3 > m? False Suppose 0a - a - 227 = -5f, 2 = -a. Suppose t - 4y + f = 6t, 4y - 18 = -2t. Let b = 0.1 - 0.2. Does t = b? False Let l = 7.11 + -29.31. Is l less than 0.3? True Let l = 18019 + -18039. Let j = 3 + -4. Let d = -2 - j. Which is greater: l or d? d Let t be (-3 - 440)56/34. Let s = -730 - t. Is -1 at least as big as s? False Suppose 0g = 4g + 3356. Let o = g + 3379/4. Let c be ((-45)/(-45))/(1 - (-5)/(-6)). Is c > o? True Suppose 42 = 2q - 10h + 6h, 2q - 33 = h. Which is bigger: q or 19? 19 Let c(r) = r - 11. Let h be c(7). Which is greater: -3 or h? -3 Let j = -24.8 + -595.2. Do j and 0.1 have different values? True Let i = -42.88 - 0.12. Let n = 45 + i. Are n and 27 nonequal? True Let x = -409 - -347. Is x less than or equal to 2/5? True Let q = -24 + 24. Let z = q - -3. Suppose zv - 4 = -v. Is -2/25 > v? False Let n = 1/18 - 11/36. Let s be (((-25)/(-50))/(1/(-6)))/(-1). Which is bigger: n or s? s Suppose -2w - 3w + 10 = 0. Let z = 19 - 18. Is w < z? False Let q be -6(31/(-6) - -5). Is q <= 14/29? False Let x(d) = -3d2 + 5d + 11. Let g be x(3). Which is smaller: -391 or g? -391 Suppose -11y + 10y - 210 = 0. Let d be (-1)/(-2) + (y/(-128))/(-3). Which is bigger: 1 or d? 1 Let u = -25 - -15. Let n = u - -12. Which is smaller: n or 1? 1 Let t be ((-16)/(-24))/(2/6). Suppose -5178 = -5m - o - 3o, -tm = -o - 2079. Let s be m/(-54) + (-4)/(-18). Which is bigger: -20 or s? s Let u be 9/68 - (-2)/(-8). Let j(z) = 2z3 + z2 + 2z + 1. Let h be j(-1). Let n be (2 - (-6)/(-3))/h. Which is smaller: u or n? u Let t = 181 + -180. Does -6/203 = t? False Let s = -12 + 14. Suppose 0 = -3o + o - 38. Let u = o + s. Which is bigger: u or -16? -16 Let g = 5/182 - 661/4186. Let u be (-2)/(-64)40. Which is smaller: u or g? g Suppose 47p - 171 = 38p. Is p bigger than 23? False Let n be 1225/(-14400). Which is greater: n or 3? 3 Let d = 6.4 + -44.4. Let u = d - -36. Which is smaller: u or 5? u Let t be ((19/(-76))/(2/(-664)))/5. Which is smaller: t or 17? t Let b = -2.07 - 0.93. Suppose -3n - 7x = -2x, 2n - 5x = 0. Is n < b? False Let c = 20.8 + -23. Let g = c + 1.95. Let m = g + 4.25. Are -1/2 and m non-equal? True Let o = 7 - 5. Let z be 43/(-18) + (-6)/(-9). Suppose 0 = -zv - ov. Is v greater than -2/33? True Suppose -5 = -r - 3. Suppose c - 2u = 25, -5c - 7u = -ru - 125. Is 24 greater than c? False Suppose 38c + 394 = -8042. Which is smaller: -218 or c? c Let n be (-13)/((-39)/(-2256)) + 3/1. Which is bigger: -2 or n? -2 Let z(x) = -x2 + 9x - 11. Let c be z(8). Let g(f) = 2f + 4. Let q be g(3). Suppose -3m = -m - 2p + q, 5p + 7 = -3m. Which is smaller: c or m? m Let x = -495.99 + 496. Is x bigger than -0.19? True Let l be -9 - -21 - (0 + 13). Which is smaller: l or -52/43? -52/43 Suppose 2o - c + 35 = -0o, o = -3c. Let g be 1/(-2) - o/6. Which is smaller: 1/2 or g? 1/2 Let y = 230 - 221. Is -5 at least y? False Let c(z) = z*3 - 7z*2 - z + 9. Let q be c(7). Suppose -qy = -y + 1. Let p be 1/(-3) - (-3)/6. Which is smaller: p or y? y Let r(z) = -z*2 + 4z + 4. Let i be r(4). Let n = 11 - i. Let j be ((-1)/n)/(108/(-42)). Which is smaller: -1 or j? -1 Let m be -1 + 0/(-2) - -1. Let r = m - -1. Let k be (-1)/(0 - (r + 0)). Is k > 6/13? True Suppose -4x + 0c = c + 8, -5x = 5c + 25. Suppose 16 = -q - 3s, -s - 69 = 3q - 21. Let p be ((-3)/(-8))/(132/q). Which is greater: x or p? p Suppose -2v + 3220 = -4y, -5y - 238 = -v + 1372. Which is bigger: 1/2 or v? v Let v = 0 - 12. Let w = -44438/7 - -6335. Which is bigger: w or v? v Let u be ((-9)/18)/((-3)/(-468)). Does -230/3 = u? False Let o be (-2022841)/1001 - 8/52. Let m = o - -2021. Let g = -180/1001 + m. Which is bigger: g or -1? g Let u(p) = p3 + 9p*2 + 15p + 8. Let b be u(-7). Let h be 24/(-1 + b/(-2)). Which is greater: h or -0.1? -0.1 Let v = 2539 - 58408/23. Let p = -14/23 - v. Which is greater: -1 or p? p Let o be (2 + 0)/2-5. Let v be 2/o + 24/10. Does 13/6 = v? False Let x be (-3 + 2 + 265)(-122)/183. Is x < -176? False Suppose 45g = 74g - 58. Suppose -c + 2c = 0. Suppose 4q + 5n - 20 = c, q = 2q + 4n - 16. Is g at most as big as q? False Let j = 2 - -19. Suppose -5 = 2i - j. Let b be (-1)/4i/18. Is b < 0? True Suppose 2238 + 91 = -5h + 4v, 0 = -h + 5v - 470. Is h at most -465? True Let y(v) = 9v + 5. Let j be y(1). Let c = -12 + j. Which is greater: 2/35 or c? c Let n be (-2)/3 - (-2782)/(-39). Let r be n/(-45)(-10)/4. Let q be -2 - -2 - 8/2. Are r and q equal? True Suppose 7i = 10 - 17. Let m = 12/49 - 191/980. Is m > i? True Let m = 23218723818510846/22771 - 1019662018127. Let u = m - -3/3253. Let j = 164 - u. Which is smaller: 0 or j? j Let v = -1 - -1. Let c = 337 - 8761/26. Is c greater than v? True Let q = 2.3806 + 0.1194. Which is smaller: -12 or q? -12 Suppose 0 = 6j - j - 25. Which is sma	{ "pile_set_name": "DM Mathematics" }
Calculate h(x(f)). -12f4 Let o(b) = 7b*2 - 6b*2 + 0b*2. Let s(n) = 2n + 5. Let t(x) = x + 1. Let a(k) = -s(k) + 5t(k). Give o(a(v)). 9v*2 Let w(c) = c - 41c*2 + 40c*2 - c. Let u(n) = 3n*2 - 5. Let y(d) = 2d*2 - 3. Let k(q) = 3u(q) - 5y(q). Determine w(k(f)). -f4 Let l(n) = -2n2 + n2 + 3n2. Suppose -44 = -5w - 14. Let h(i) = 0i + wi - 2i. Give l(h(x)). 32x*2 Let y(h) = -420h. Let q(o) = o*2. Determine q(y(v)). 176400v*2 Let k(f) be the first derivative of -3f*2/2 - 1. Let a(s) = -2s. Give k(a(d)). 6d Let p(r) = 9r*2 + 6r*2 - 17r2 + r2. Let b(x) = x + 1. Let h(f) = -4f - 3. Suppose -5v + 4v = 3. Let m(q) = vb(q) - h(q). Give p(m(t)). -t*2 Let w(t) = 38t. Let b(s) = 4s - 17. Give b(w(x)). 152x - 17 Let c(j) = 420j2 - j + 1. Let l(d) = -d. Determine l(c(s)). -420s*2 + s - 1 Let a(r) = -8r. Let o(s) = 2s - 1654. Calculate a(o(h)). -16h + 13232 Let o = -2 - -4. Let i(h) = -h + 7h + oh - 4h. Let w(v) = v2. Give w(i(l)). 16l*2 Let m(o) = -2o*2. Let j be 91/(6/4). Suppose h - jh = 0. Let u(p) = -2p2 + p2 + hp2. Give m(u(f)). -2f*4 Let b(n) = -5n. Let r(w) = 52w2. Determine r(b(f)). 1300f2 Let c(p) = -p - 1. Let r(t) be the third derivative of -t4/12 - t3/2 + t2. Let l(b) = 3c(b) - r(b). Let q(v) = 2v*2. Determine l(q(s)). -2s2 Let x(n) = -n2. Let b(m) = 0 - 2 + 3m - 4m. Let a be b(-4). Let q(j) = -10j + 10j - ja. Determine x(q(d)). -d4 Let y(q) = 5q2 + 3. Let d(z) = -14z*2 - 8. Let u(t) = 3d(t) + 8y(t). Let k(w) = -11w. Give k(u(m)). 22m2 Let m(p) = -p2. Let z(k) be the third derivative of 2k*5/15 + 6k*2. Give m(z(g)). -64g4 Let b = -3 + 5. Let q(u) = ub + u - u. Let m(n) = n*2. Let f(z) = -2z*2. Let d(l) = 2f(l) + 3m(l). Calculate q(d(p)). p4 Let m(q) = -q. Let d(v) be the second derivative of -6v + 0 + 0v2 + 3/2v*3. What is d(m(h))? -9h Let q(r) = -3r2. Let m(d) = -d. Give m(q(j)). 3j*2 Let n(c) = 28c*2. Let q(b) = -2b + b + 5b - 6b. Calculate n(q(d)). 112d2 Let b(x) = x2 + 23x. Let a(d) = 2d. Calculate a(b(t)). 2t*2 + 46t Let r(x) = 157x + 4. Let y(n) = -7n*2. What is y(r(v))? -172543v*2 - 8792v - 112 Let k(c) = 92c. Let u(h) = 10h*2. Give k(u(z)). 920z*2 Let i(d) = -2d*2. Suppose -2k = 3k - 25. Let r(y) = 8y - 5y - ky. Calculate r(i(l)). 4l2 Let v(n) = -2n*2. Suppose -2z - 5f - 8 - 7 = 0, 3 = -3z - f. Let c(j) be the first derivative of 1/3j3 + 1 + zj*2 + 0j. Give c(v(q)). 4q4 Let d(g) = -2g + 6. Let r(t) = -2t + 7. Let a(o) = -7d(o) + 6r(o). Let v(l) = -3l*2 + 31l - 72l + 41l. Determine v(a(q)). -12q2 Let j(r) = -12r*2. Let o(w) = 8w - w - 2w - 6w. Determine j(o(s)). -12s2 Suppose 0n + n = -2d + 3, -4d + 9 = 3n. Let s(t) be the third derivative of 0t*3 + 0t*4 + 1/60t*5 + 0 + dt - 2t2. Let k(u) = 4u. What is s(k(b))? 16b2 Let h(p) = -4p*2 - 6p. Let b(v) = v. Let y(n) = -6b(n) - h(n). Let f(z) = -z. What is f(y(x))? -4x2 Let t(j) = j2. Let u(i) = i*2 - 7i - 6. Let c be u(8). Let y be ((-12)/(-20))/(c/10). Let q(m) = -ym + 2m*2 + 3m. Give q(t(g)). 2g4 Let r(f) = 7f. Let v(i) = 5i2 + 33. What is v(r(b))? 245b2 + 33 Let w(t) = -t2. Let d(i) be the first derivative of 0i2 + 4 + 0i + 2/3i3. Give d(w(o)). 2o*4 Let h(p) = -3p. Let x(v) = -v + 6. Suppose 0 = -3i + 4k + 32, 3i - 7 = -0i - k. Let t be x(i). Let c(d) = d - 4d + 2d + td. What is c(h(u))? -3u Let g(y) = -y + 165. Let b(n) = -n. Determine g(b(s)). s + 165 Let b(j) = 5j2. Let g(f) = 132f - 132f - 11f*2. Determine g(b(i)). -275i*4 Let x(v) = 2v2. Let l(z) be the third derivative of -z4/6 + 16z2. Give x(l(y)). 32y*2 Let p(x) = -3x - 8x + 12x. Let v(u) = -7u2. Determine v(p(r)). -7r*2 Let p(t) = 2t. Let w(g) = 2 - 83g - 2 + 36g. Give w(p(o)). -94o Let x(k) be the third derivative of -k4/12 + 12k*2. Let r(m) = m. What is r(x(q))? -2q Let r(t) = 10t. Let b = 877 + -302. Let o(z) = -575z - 2z2 + bz. Determine o(r(p)). -200p2 Let i(b) = b. Let p(a) = 245a. What is i(p(h))? 245h Let t(q) = -17q*2 - 2q. Let r(f) = 375f2 + 45f. Let p(j) = -2r(j) - 45t(j). Let h(z) = -2z. Give h(p(g)). -30g*2 Let f(v) = 7v. Let y(w) = w*2 - 2w. Let q(n) = -n. Let i(b) = -6q(b) + 3y(b). What is f(i(s))? 21s2 Let v(r) = 3r. Let s(b) = b + 1. Let h be s(0). Suppose -2c + 12 = 3l - 1, 3c - 15 = 0. Let g(a) = h - a - l. Determine v(g(o)). -3o Let c(m) = -4m. Let j(b) = -52b. Give j(c(q)). 208q Let q(x) = 4x*2. Let b(w) = 291w - 1. Determine b(q(v)). 1164v2 - 1 Let s(m) = m. Let u(g) = g2 + 3g. Let l(j) = -3s(j) + u(j). Suppose 2 = 4p - n - 1, 2p + 5n = 29. Let o(i) = 2i2 + i2 - pi2. Calculate o(l(x)). x4 Let h(i) = 2i. Let q(b) = 1594b*2 + 1. Calculate q(h(f)). 6376f*2 + 1 Let h(k) = 2k + 5. Let g(u) = 6u + 14. Let n(d) = -5g(d) + 14h(d). Let y(l) = 10l. Give y(n(x)). -20x Let q(m) be the first derivative of 3m*5/20 - 5m*2/2 + 2. Let l(w) be the second derivative of q(w). Let p(k) = k. Give l(p(n)). 9n*2 Let h = 4 - 1. Let q(p) = 5p - 3p - hp. Let m(s) be the first derivative of -2s2 - 16. Calculate m(q(i)). 4i Let u(g) = 44g. Let z(p) = 9p*2. What is z(u(v))? 17424v*2 Let r(x) = -2x*2 + 3x. Let a(w) = -9w2 + 13w. Let q be (39/(-2))/((-3)/(-4)). Let z(n) = qr(n) + 6a(n). Let d(h) = 3h2. Give z(d(s)). -18s*4 Let y(u) = 24u*2 - 4. Let q(n) = -2n*2 - 2n2 - n2 + 6n2. Calculate q(y(k)). 576k*4 - 192k*2 + 16 Let p = 21 - 19. Let x(w) = -p + 0 + 2 - 5w. Let j(z) be the second derivative of -z*4/6 + z. Calculate j(x(n)). -50n*2 Let r(g) = 2g*2. Let v(n) = 56n. Give v(r(b)). 112b2 Let j(w) = -122w + 40w + 43w + 40w. Let c(o) = -3o*2 + 6o2 - o2. Give c(j(d)). 2d2 Let t(g) = -2g*2 - 35g. Let k(f) = 2f. Give k(t(p)). -4p*2 - 70p Let v(n) = -2n. Suppose 0 = -5z - 4i + 18, 4z + 4 = -2i + 16. Let g(p) = -zp - p + 3p + 2p. Determine g(v(w)). -4w Let k(p) = -p2. Let y = -20 + 22. Let b(z) = 15z2 + z2 - z*y. Calculate b(k(a)). 15a4 Let l(o) be the third derivative of -o5/20 + o*2. Let j(r) = -2. Let p(i) = i - 3. Let s(d) = 3j(d) - 2p(d). Give s(l(v)). 6v*2 Let c(u) = -2u. Let z(s) be the third derivative of -s6/720 - s4/8 - s*2. Let n(g) be the second derivative of z(g). Determine n(c(y)). 2y Let b(z) = -12z. Let v(h) = 229h + 1. Calculate v(b(o)). -2748o + 1 Let x(v) = -2v. Let u(t) = t*2 - t. Let m be u(1). Suppose -5a + m = -10. Let w(j) = -2 + a - 5j + 9j. Calculate w(x(y)). -8y Let k(f) = 17f*2. Let o(z) = -2z + 10. Give k(o(v)). 68v2 - 680v + 1700 Let c(t) = -6t2. Suppose 0q = -4q + 8. Let y(g) = 2g*q + 0g*2 - 3g*2. Determine c(y(h)). -6h*4 Suppose -5 = -x - 0. Let n(l) = x - 5 - 3l. Let f(p) = -3p2. Determine f(n(r)). -27r*2 Let m(a) = -13a + 22a2 + 13a. Let q(z) = z*2. What is q(m(p))? 484p*4 Let q(a) = -3a*2 + 7a - 3a - 4a. Let n = -1 + 3. Let j(f) = -2fn - 3 + 3. Give q(j(w)). -12w*4 Let c(h) = -24 + 39 - 15 - 2h. Let o(d) be the first derivative of d4/12 - d2/2 - 1. Let s(j) be the second derivative of o(j). What is c(s(a))? -4a Let t(a) = a. Let d be (-1 - -5) + -2 - 1. Let g(x) = x - 1. Let r(m) = -m - 3. Let w be r(-6). Let i(h) = -5h + 3. Let v(f) = di(f) + wg(f). Give t(v(o)). -2o Let k(p) = 2p - 6. Let a be k(4). Suppose -n - 4b - 1 = -2n, -b = -an + 9. Let c(q) = -n - q - 4 + 9. Let x(j) = 2j. Calculate c(x(i)). -2i Let c(s) = -s + 227. Let y(t) = -15t*2. Give c(y(z)). 15z2 + 227 Let j(w) be the third derivative of -w5/30 - 7w2. Let u(x) = -18x*2. What is u(j(a))? -72a*4 Suppose 2b = b. Let r(j) = -j + 2j + j + bj. Let w(a) = 2a2. Calculate r(w(v)). 4v2 Let f(q) = q2. Let g(y) = 592y. Determine g(f(t)). 592t*2 Let p(n) = -4n. Let y be (2 + -2)/(-12). Let z(r) = 2r - 1 + 1 + y. What is z(p(s))? -8s Let u(z) = -180z*2. Let r(j) = j. Determine u(r(m)). -180m*2 Let o(f) = -2f*2. Let n = 6 + -2. Suppose nb - 4 = -0. Let z(j) = 2j + 2 - b - 1. Determine z(o(t)). -4t*2 Let w(f) = -7f + 1. Let k be w(-1). Let b(t)	{ "pile_set_name": "DM Mathematics" }
3 Express -19k - 26k - 6k in the form n + ik and give i. -51 Rearrange -3 - 6d4 + 8d4 + d3 + 0d4 - 2d + 2 to od3 + p + jd*2 + rd*4 + kd and give k. -2 Express 10 + v - 3 - 2v + 2 in the form kv + p and give k. -1 Rearrange 0p + 1 + 1 + 0p4 + p2 + 2p + 2p*4 to qp*4 + op*3 + g + kp*2 + jp and give q. 2 Rearrange (0 + 3 - 1)(1014 + 0w*2 - 1013 - 5w*2) to the form hw + d + iw2 and give i. -10 Express (-2j*2 + 3j*2 - 3j*2)((-3 - 2 + 6)(0 + 2 + 7) - 2 + 2 - 2 + 2 + 1 - 1) as dj + rj2 + c and give r. -18 Express 6 - 4 + 101z - z*3 - 99z + 6z2 as j + oz*2 + uz + rz3 and give o. 6 Express (3 + 1 - 5)(94 + 5x - 71 - 3x) in the form rx + g and give g. -23 Express (7u + 6u - 7u)(1 - 5 + 3) + 5 - u - u - 1 in the form i + nu and give i. 4 Express 5t + 5t - 3t as m + zt and give z. 7 Express (-3s + s2 + 3s)(40s*2 - 24s*2 - 23s*2) as rs*3 + us + n + ws2 + vs*4 and give v. -7 Rearrange 7x - 13x - 16x to ux + n and give u. -22 Express (727q*2 - 727q*2 + 7q*3)(4q + q - 3q) in the form aq2 + mq*4 + oq + g + dq3 and give m. 14 Rearrange -10p*2 - 2 + 2p*4 + 12p*2 - 3p*4 to the form qp*3 + zp*2 + lp*4 + yp + s and give s. -2 Rearrange -7 + 9 - 2 + 57l to the form fl + s and give f. 57 Rearrange 86q + 90q + 7 - 180q to nq + k and give n. -4 Rearrange ((-5m + 5m + m)(2 - 2 - 2) + 2m + 0m - m)(-12m3 + m - m) to the form cm + qm2 + hm*4 + im*3 + a and give h. 12 Express 4h - 12 - 2 + 4 + 3 as k + ph and give p. 4 Rearrange (a3 + 2a*3 - 2a*3)(-3a + 0a + a) - 22a4 + 13a + 8a4 + 13a*4 to the form ka*3 + r + oa*4 + va + sa2 and give v. 13 Express (-g + 2 - 1 + 0g)(-3 + 4 + 3)(2 - 4 + 1) as l + zg and give z. 4 Rearrange (x - x + 2x*2)(-2 + 1 + 3 + (0 - 5 + 6)(-1 + 3 - 3))(0 + 1 + 5) to the form tx2 + v + fx and give t. 12 Rearrange 2i + 35i*2 - i - i to the form h + ci + qi2 and give q. 35 Express -2d + 0d + d + (3 - 1 - 3 + (-2 - 2 + 3)(-1 - 1 + 0))(-17d - 412 + 412) in the form t + qd and give t. 0 Express (-5r + r + 3r)(-10 + 3 + 1) in the form jr + i and give j. 6 Express -8g - 4g3 + g + 4g3 - g3 in the form xg + w + ag*2 + mg*3 and give m. -1 Rearrange -2r*3 + 2r*2 + 5r3 - r3 + 3 - 2r4 + r4 to cr + z + sr3 + pr*4 + wr*2 and give s. 2 Rearrange (b - 5b - 3b2 + 2b*2)(-2 + 5 + 5) to ob2 + qb + c and give q. -32 Rearrange -v*4 - 2 + 5v4 + 6 - v4 - v*3 to iv + z + wv2 + cv*3 + nv*4 and give n. 3 Express (6 - 6 + 5s)(12s*2 - 2 + 2) in the form js*3 + qs*2 + n + ks and give j. 60 Express (2k2 - 2k2 + k2)(26k*2 - 12k*2 - 17k*2) in the form uk*3 + ak*2 + t + hk*4 + yk and give h. -3 Rearrange (27 + 30 + 7 + 3)(-3f*2 + 4f2 + f2) to j + tf2 + df and give t. 134 Express 3p2 + 4p*2 - 6p*2 + (-4p - p + 2p)(0 + 2p + 0) in the form o + wp + rp2 and give r. -5 Rearrange (0 + 2 - 7)(-5 - 4 - o - 13) to so + z and give s. 5 Rearrange 117h - 407h + 201h to mh + u and give m. -89 Rearrange -3o - 2o2 - 3o + 4o + 63o*4 - 59o*4 to the form bo*4 + wo*3 + io*2 + y + ao and give b. 4 Rearrange -15c2 + 5c*2 + 15c*2 to x + qc*2 + tc and give q. 5 Rearrange -16a + 43a - 17a + 3 - 20a to w + ra and give r. -10 Express (-c3 + 14c3 - c3)(5c + 4c - 3c) in the form a + qc2 + gc*4 + wc + nc3 and give g. 72 Express 61k - k - 4k2 + 3k*2 as l + qk*2 + ck and give c. 60 Rearrange (-2 + 0 - 2)(0s + 2s - 3s + (4s - 2s - 4s)(0 + 8 - 2)) to v + as and give a. 52 Express -2l + 0l3 + 5l - 13l2 + l3 - 4 + 11l*2 in the form x + kl*3 + tl + wl2 and give w. -2 Express d2 - 3d*2 + 3d*2 + (-3d*2 + 0 + 0)(3 - 5 - 4) + (-4 + 3 + 0)(-2d*2 + 2d*2 - 2d*2) in the form cd + l + kd2 and give l. 0 Rearrange 3d3 + d2 + 5d - 3d - 2d3 to wd + bd2 + l + xd*3 and give l. 0 Rearrange 0f*2 - f + 2f*2 - 6f*2 to the form bf + tf2 + g and give b. -1 Rearrange 20 + 13 - 2b + 4 to x + yb and give x. 37 Express (-4f + 0f + 3f)(2f - 3f + 2f)(2 + 6 - 20) as xf*2 + sf + t and give x. 12 Rearrange -32 - 4k3 - k + 32 to the form ok*2 + q + pk*3 + lk and give l. -1 Rearrange (-5t - t + 3t)(-3 - 1 + 0 + 0 - 5 - 1 + (-1 - 1 + 0)(5 - 4 - 3)) to lt + g and give l. 18 Rearrange -s - s + 5s - 2s to the form ns + j and give n. 1 Express 11b2 + 4b*2 - 18b*2 in the form ob*2 + hb + s and give o. -3 Express (0 + 0 - n)(5 - 2 - 2) + 4n + 14n + 9n in the form cn + r and give c. 26 Express (l - l + 3l*3)(-4 - 7 + 0) in the form x + zl + nl*2 + fl*3 and give f. -33 Rearrange 1 - 2k*4 - 1 + (-7k*3 + 2 - 2)(4 - 4 - 2k) to vk*4 + ik*2 + fk + t + gk3 and give g. 0 Rearrange 0 - a + 0 + (2a + a - a)(5 - 3 + 6) to the form ra + n and give r. 15 Express 8 - 7 - d*4 + 0d*3 - 3d*3 as xd*3 + cd*2 + r + bd + zd4 and give z. -1 Rearrange 4 - 1 - 3 - 6i to the form s + mi and give m. -6 Rearrange -4d + 17d + 0d + 12d to ud + f and give u. 25 Rearrange u - 6u4 + 4u4 + 5 - u4 to cu4 + b + lu*2 + qu*3 + au and give b. 5 Rearrange 2s - s + s + 12s to the form ls + p and give l. 14 Rearrange -j2 + 9j4 - j2 - 11j4 + (0j*2 + 4j*2 - 2j*2)(-6j2 + 3j*2 + 2j*2) to bj*4 + y + vj + cj3 + kj2 and give b. -4 Rearrange -j3 - 661j2 + j + 660j2 + j4 - 19j to the form fj + gj2 + zj*3 + d + uj*4 and give u. 1 Rearrange 25 + 2x + x*3 - 9 + 0x to ox3 + r + px*2 + lx and give o. 1 Express 158p - 48p - 30p - 1 as jp + c and give j. 80 Express -65f3 + 64f*3 - 2f + 4f2 - 10 - 2f*2 + 0 in the form wf + j + zf3 + kf*2 and give j. -10 Express 14c - 35c + 14c in the form tc + d and give d. 0 Express (-3k + k + 3k)(3 - 1 - 3 + (2 - 5 + 5)(3 + 1 - 2) - 1 - 1 + 0 + (1 + 0 - 3)(-2 - 4 + 4) + 26 + 23 - 17) in the form zk + q and give z. 37 Rearrange (2f*2 + 3f*2 - 3f*2)(7 - 20f + 8f + 8f) to bf*2 + s + df + xf3 and give x. -8 Express (12 + 1 - 4)(13s2 + 52s - 52s)(-s2 - s2 + 4s2) as vs*4 + a + xs + ts2 + bs*3 and give v. 234 Rearrange -7i + 10i2 - 6i*2 + 8i + 5i2 to z + xi*2 + gi and give g. 1 Express (-3s + 3s - 2s4)(2 + 2 - 3) + 2s - 455s*2 + 455s*2 + 4s*4 in the form ls + ws2 + m + os*4 + is3 and give o. 2 Rearrange (-w2 - 4 + 4)(46w - 11w + 0w) to the form rw3 + bw + iw2 + h and give r. -35 Express (-k + 2k - 3k)(11k2 - 10k*2 + 3k*2) - 2k + 2k3 + 0k*2 + 0k*2 as ok*3 + g + xk*2 + sk and give o. -6 Express 3f3 - 4f*3 + 2f*2 - 4f*2 - 33f*2 in the form hf + n + xf3 + uf*2 and give x. -1 Express -3u - u + 2u + 0u in the form x + hu and give h. -2 Express 0s + 0 - s + 2s - 42 as ns + k and give k. -42 Rearrange 34n3 + 2 - 14n*3 - 14n*3 to bn*2 + an*3 + dn + l and give l. 2 Express -49j3 + 39j3 + j2 + 24j3 in the form b + pj*2 + wj + lj3 and give l. 14 Express 6o - 2 - 11o2 - 8o2 - o4 + 21o2 in the form go*2 + jo + ho4 + yo3 + n and give g. 2 Express 80 + y3 + 4y3 - 77 as jy + f + py3 + ny2 and give j. 0 Express a3 - 2 + 5 - 4 + (0a2 + a3 + 0a*2)(2 + 1 - 7) as ca3 + ya*2 + pa + u and give u. -1 Rearrange -1 + 493l2 + 2 - 3l*4 - 492l*2 to the form al*4 + hl + fl3 + pl*2 + j and give p. 1 Express -55j - 868 + 868 + 2j2 + 2j*3 as wj*3 + l + nj*2 + vj and give v. -55 Rearrange (8 - 140s - 10 + 2)(2s2 + 2s - 2s) to hs + o + rs3 + cs*2 and give r. -280 Rearrange -4j*3 + 13j - 13j + j4 + (2j*3 + 0j*3 - 4j*3)(-2j - 3j + 3j) to bj + nj3 + xj*4 + c + lj*2 and give n. -4 Rearrange 0h*3 - 2h*3 - 5h*2 + 0h3 - 2 + h3 to the form i + xh2 + dh*3 + th and give d. -1 Rearrange -660k2 + 325k*2 + 332k*2 + 9 to h + rk*2 + gk and give r. -3 Rearrange 18y + 9 + 2y*2 - 13y - 8 to the form r + my2 + ty and give t. 5 Rearrange (-4d - 5d - 2d + (-3 + 2	{ "pile_set_name": "DM Mathematics" }
070g3 + 36g*2r*2 What is the third derivative of -6t*6 - 2010t*3 + 2t*2 + 18295t - 4? -720t3 - 12060 What is the third derivative of 3c*6 + 3210c*3 + 294156c*2 wrt c? 360c*3 + 19260 What is the third derivative of -25186d*6 - 2d*4 - 6d*3 + 2025934d*2 wrt d? -3022320d*3 - 48d - 36 Find the second derivative of 119772ow*2 + 12ow + 3o - 1688w wrt w. 239544o Find the second derivative of -4h3 - 122541h*2 + 228829h. -24h - 245082 What is the third derivative of -x6 - 72x*5 - 89x*3 - 8137x*2 - 1? -120x*3 - 4320x*2 - 534 What is the second derivative of -10089v*3z + 2v3 + 16v*2z + v*2 - vz + 166v + 5z - 23 wrt v? -60534vz + 12v + 32z + 2 What is the second derivative of -3d2i*3 + 56d*2i + 2051d2 - 449823di4 wrt i? -18d*2i - 5397876di*2 Find the third derivative of 320991iz3 - 10iz2 - 2iz - 323i wrt z. 1925946i Find the first derivative of 62z*2 - 19z - 254765 wrt z. 124z - 19 Find the third derivative of -6479f*5 - 70f*3 + 497050f*2 wrt f. -388740f*2 - 420 What is the second derivative of -2i*5 + 4i*4 + 1018i*2 - 74i + 424? -40i3 + 48i*2 + 2036 What is the second derivative of 6r*5 + 1889r*2 - r + 131789? 120r*3 + 3778 What is the second derivative of 7471c*2pu2 + 2c*2p + cpu*2 - 21cp - 2cu2 - c - 330pu2 wrt c? 14942pu2 + 4p Find the second derivative of -31328i4 - 9i*3 + 377833i. -375936i2 - 54i What is the derivative of -804722l - 526529? -804722 Find the third derivative of 9j*3m*2y + j*3m*2 + 432j*3my + 4j*2m*2 - 105j*2y + 5j2 + jm*2 - 2m*2y wrt j. 54m2y + 6m2 + 2592my Find the third derivative of -4056613yz5 - 1797y + 36z2 + 4z wrt z. -243396780yz*2 What is the third derivative of 1635l5 + l4 + 2l2 - 1605l - 1 wrt l? 98100l2 + 24l Find the third derivative of -85g5 - 259g4 - g2 + 35g - 212 wrt g. -5100g*2 - 6216g What is the second derivative of -6cv*3 + 12cv2 - 61731cv + c + 7v*3 + 11v*2 + 2v - 1 wrt v? -36cv + 24c + 42v + 22 What is the third derivative of -1271013p3 - 2p*2 - 33963p - 5? -7626078 What is the second derivative of 34499j4x*3 + 2j*4 + 3jx2 + 253x*3 + 7x*2 - 2x wrt j? 413988j2x*3 + 24j*2 What is the second derivative of mnx2 - 2mnx + 5mx*4 - 116mx + 67nx4 - 7nx wrt x? 2mn + 60mx2 + 804nx2 Find the second derivative of 4912c*2u + 18cu - 22c + u + 6 wrt c. 9824u What is the second derivative of -4ux*2 - ux + 2u - 84193x*5 - 2x - 8101 wrt x? -8u - 1683860x*3 Find the second derivative of 14m*4 + 73440m*2 + 6m - 2597. 168m2 + 146880 What is the derivative of -5n*2w + n*2 - 1692n - 100677w wrt n? -10nw + 2n - 1692 Differentiate 2884k - 40320. 2884 What is the third derivative of -140o*2u*5 - 16o*2u*2 + 58o*2u - ou5 + u2 wrt u? -8400o*2u*2 - 60ou2 Find the second derivative of 332b*5 - 275b*4 + 267070b wrt b. 6640b3 - 3300b*2 Differentiate 272822dw - 168500d wrt w. 272822d Differentiate -cnv + cn + 743cv + 49c - 36563nv - 40n wrt c. -nv + n + 743v + 49 Find the first derivative of 54t3 + 1531t*2 + 284096 wrt t. 162t*2 + 3062t Differentiate -3df*2m*3 + 17dm2 + 19f*2 - 18fm3 + 9141m*3 - 1 with respect to f. -6dfm*3 + 38f - 18m3 What is the first derivative of -333104o*3 + 635135 wrt o? -999312o2 What is the third derivative of -x4 + 90709x3 + 999421x*2 + x wrt x? -24x + 544254 Differentiate -c*2prv - 6c2pr + 188prv - 317pr + 4 wrt v. -c*2pr + 188pr What is the third derivative of 81663l*3 + 22560l*2 wrt l? 489978 Find the second derivative of -1207t*5 - 2t*4 - 2t*3 - 234t - 14 wrt t. -24140t3 - 24t*2 - 12t What is the first derivative of 42733z + 44098? 42733 What is the first derivative of -361n*2or - 2nor + or + 17202o + 7r wrt n? -722nor - 2or What is the derivative of 763021q4 + 3q*2 - 2q + 3204973? 3052084q3 + 6q - 2 Find the second derivative of 11l5o - 12093l3o - 14lo + 690l - 9o wrt l. 220l3o - 72558lo Find the second derivative of -18b4 - 2b*3 - 104b*2 - 577b - 8. -216b2 - 12b - 208 Find the third derivative of 683u5 + u4 + 4u*3 - 173996u*2. 40980u*2 + 24u + 24 Find the second derivative of 1468b3m2 + b3mq + b*2m*2 - 16m*2q - 3363469mq wrt m. 2936b3 + 2b*2 - 32q What is the second derivative of -183232i3 - 43611i + 2? -1099392i Differentiate 432540y*4 + 3553457. 1730160y*3 Find the first derivative of -78t*2x3 + t2 + 125t + 125259x*3 wrt t. -156tx3 + 2t + 125 What is the first derivative of 5862w2 + 331w + 255056 wrt w? 11724w + 331 Find the third derivative of 1032b*3d - 15b3w + 2b2d - 2b2 - 29bdw + 55bd + 2bw wrt b. 6192d - 90w Find the second derivative of -781167c4 - c2 + 60c - 5019. -9374004c2 - 2 What is the third derivative of 25332s*6 + 25179s*2? 3039840s*3 Find the first derivative of -20090u + 219136 wrt u. -20090 Find the third derivative of 253565g3 - 2g*2 - 1321g - 13. 1521390 What is the third derivative of 2904o2w*3 + 3o*2w2 - o2w + 6o*2 + 313w*3 + 704w*2 wrt w? 17424o*2 + 1878 What is the derivative of 490897x*2 + 780610 wrt x? 981794x What is the first derivative of -2z3 - 85331z*2 + z + 857241 wrt z? -6z*2 - 170662z + 1 What is the third derivative of 44a3dvw*2 - 2569a*3dvw + 7a2dvw + advw - 375d + 2w2 wrt a? 264dvw*2 - 15414dvw Differentiate -791x2 + 12x + 49631 wrt x. -1582x + 12 Find the third derivative of -80f*5 - 346f*3 + 100242f*2. -4800f*2 - 2076 Find the second derivative of at*2 - 210at - 492045t*2 - 1944t wrt t. 2a - 984090 What is the third derivative of 88u*6 + 5301u*5 - 628680u*2 wrt u? 10560u*3 + 318060u*2 Differentiate -4228c3 - c2 - 8c + 639030 with respect to c. -12684c*2 - 2c - 8 What is the third derivative of -18c3h*3m*2 - 1637c*3h*3m - 4c2h*2 + 2c*2h + ch3 - 5cm2 - 128h*2m wrt c? -108h3m*2 - 9822h*3m What is the third derivative of -2y5 + 3021y*4 - 2y3 + y2 + y - 2623? -120y2 + 72504y - 12 What is the third derivative of 30478t4 - 4t*3 + 1275314t*2? 731472t - 24 What is the third derivative of 4jw*3 + 136jw2 - 56jw - 9870w*3 - 3w*2 wrt w? 24j - 59220 Find the third derivative of -46565w4 - 9w*2 + 4w + 70. -1117560w Find the third derivative of 18t*5 - 151t*4 + 13t3 - t2 + 665t - 145 wrt t. 1080t*2 - 3624t + 78 Find the second derivative of -68y5 + 16789y*2 + 2421318y. -1360y3 + 33578 What is the third derivative of 412co3y*3 + co*3y*2 + 2co3 - 837co2y*3 - 90578coy + o*2y*2 wrt y? 2472co3 - 5022co2 Find the second derivative of 26808h*2z - 5hz - z + 2366 wrt h. 53616z Find the second derivative of -l3v*3 + 218904l*3v2 + l3v + 54l*2v + 2068 wrt v. -6l3v + 437808l3 What is the third derivative of -149pz4 + pz*3 + 3pz2 - 32pz - 2z*4 - 57z*3 - 183z*2 + 2z wrt z? -3576pz + 6p - 48z - 342 Find the second derivative of -386c3 - 17c*2 + 11474c wrt c. -2316c - 34 Find the third derivative of -80351n*3u + 16n2 - 44u wrt n. -482106u What is the second derivative of -v2x*2 + 6157v*2x + v*2 - 7329vx2 - vx - 4x2 - 5x wrt x? -2v2 - 14658v - 8 What is the derivative of -200923z3 + 1440597 wrt z? -602769z*2 Find the second derivative of -28451i*3n*2 - 2i*3n - 82in*2 + 89in - i + 3n*2 - 2n wrt i. -170706in*2 - 12in Find the second derivative of -11d*2jl3 - 10d*2j + 21d2lw - 2djw + 42dl*3w + 2dl*3 + 2jl3w + 22jl*3 wrt d. -22jl3 - 20j + 42lw Find the second derivative of 48606n3 - n2 - 18186n wrt n. 291636n - 2 What is the first derivative of -39f*3w - 822f2w + fw + 2f - 1596w + 88 wrt f? -117f*2w - 1644fw + w + 2 What is the third derivative of -38*a	{ "pile_set_name": "DM Mathematics" }
smallest value in c, z, 2/7? 2/7 Let r = 36 - 39. What is the third smallest value in -0.5, -1, -0.4, r? -0.5 Let v = -0.27 + 0.26. Let y = 248 + -1236/5. What is the second biggest value in -5, y, v? v Let w = -0.9 + 0.4. Suppose 10m + 36 = 7m. What is the biggest value in m, 4, w? 4 Suppose 2 = -3j - 1. Suppose -5t = -2v + 14, t + 2v = -3 - 7. Which is the biggest value? (a) j (b) -0.5 (c) t b Let i = -28.3 + 28. Which is the third smallest value? (a) i (b) -0.5 (c) -4 a Let t = -0.64 + 0.8. What is the biggest value in -0.4, 0, -4, t? t Let r = -169.3 - -169. Which is the second smallest value? (a) -0.5 (b) r (c) -2/9 (d) -1 a Let g = -4 - -4. Let x = 1 - g. What is the second biggest value in -2/9, -2, x? -2/9 Let k = -3.93 - 0.07. Let u = k + 3.5. What is the smallest value in 4/7, 0.2, u? u Let g = -17 - -14. Which is the smallest value? (a) g (b) 0.2 (c) -0.3 a Let u = 0.13 - -6.87. Let t = -9 + u. Which is the third biggest value? (a) 1 (b) t (c) 4 b Let l(h) = -2h - 2. Let o be l(-2). Which is the third biggest value? (a) o (b) -4 (c) 0.5 b Let j = 12 - 15. Let f = -0.4 + 0.7. Which is the third biggest value? (a) j (b) 5 (c) f a Let t(o) = o3 + 5o*2 + 3o. Let n be t(-3). Let j be ((-3)/(-8))/(n/6). Which is the second biggest value? (a) j (b) 1 (c) 2/13 a Let v = 7/2 + -53/14. What is the biggest value in 2, v, -4, -8/7? 2 Let j = -140/3 + 47. Which is the third biggest value? (a) -5 (b) -5/2 (c) j a Let h = -1.2 + 1.6. Let t = -3 - 1. Which is the third biggest value? (a) h (b) 1 (c) t c Let b = -26/15 + 14/15. Let l = 1 - 1.2. Let q = 0.4 - 0.3. What is the second smallest value in l, q, b? l Let p = 0.007 - 1.007. Which is the third biggest value? (a) -4 (b) 2/45 (c) p a Let t(q) = -q*3 - 5q*2 + 4q - 13. Let w be t(-6). What is the fourth smallest value in 6, 0, 5, w? 6 Suppose 4v - 10 = 2v. Let j = -11 - -11.3. Which is the second smallest value? (a) -3/5 (b) v (c) j c Suppose -z = 4z + 25. Let q = -0.21 + -0.29. Which is the second biggest value? (a) z (b) -0.3 (c) q c Let k = 11.2 - 16.3. Let g = -0.1 - k. Suppose -l + c + 8 = 4c, 2 = 3l - 2c. What is the second smallest value in -1, g, l? l Let g = 3.04 + -0.04. Let j = g - 3.5. Let n = j - -0.4. What is the biggest value in n, 2/11, 1/4? 1/4 Let k = -1 + 6. Suppose 0d = 4s - kd + 35, -8 = s - d. Which is the third smallest value? (a) s (b) 4 (c) 3 b Let m = 0.031 - -4.969. What is the third smallest value in -3/7, -0.1, m, 0? 0 Let m = 7 - 6.7. Let t = -47 - -31. Let i = -16.3 - t. What is the smallest value in i, m, -0.4? -0.4 Let t = 1.62 - -0.08. Let s = 2 - t. What is the second smallest value in -0.2, s, 0? 0 Let y = -8 - -6. Let s = -7 - y. Which is the third biggest value? (a) 1/4 (b) s (c) -3/5 b Let z(m) = m3 + 12m*2 + 12m + 6. Let i be z(-11). What is the second smallest value in 0.2, -1/5, i? -1/5 Let n = 7.9 - -0.1. Let q = 5 - n. Let p = -11 - -6. Which is the second biggest value? (a) p (b) q (c) 4 b Let s(q) = -q + 9. Suppose 0 = -3k - k, o - 13 = -4k. Let g be s(o). Let v = -1/300 - 1193/2100. Which is the third smallest value? (a) v (b) g (c) -5 a Let d be (-4)/8 + 0 + 2. What is the second smallest value in d, -0.4, 0.7, 5? 0.7 Let t be -7 + 2 + -1 + 1. Let f = -31.13 + 31. Let a = f - -1.13. What is the second smallest value in a, t, 0? 0 Suppose -2m = 2, -p = 4p + 4m + 24. Let q be 2/3 + p/9. Which is the third smallest value? (a) -0.1 (b) -0.2 (c) q c Let f = -4 + 5. Let w = -4 - -4.4. Which is the third biggest value? (a) f (b) 3 (c) w c Let b = 2 - 6. Let q be (b/(-8))/(22/(-8)). Let r = 1 - 1.1. What is the smallest value in r, q, -5? -5 Let g = 0.376 - -0.024. Which is the fourth biggest value? (a) 0 (b) 2/7 (c) g (d) 2/3 a Let w = -714.92 - -738. Let q = -25.1 + w. Let j = 0.02 + q. What is the second smallest value in j, 0.1, 3/2? 0.1 Let u = 7 + -6.9. Let m = -0.4 - u. Let n be (-1 + -1)3/24. Which is the biggest value? (a) m (b) -1 (c) n c Let x = 1 - -8. Suppose -p - 2p - x = 0. Which is the third smallest value? (a) 2/5 (b) 3/5 (c) p b Let i be -1 + (-1 - -2) + 2. Suppose 3l + 4 = -t, 4l - 3t = 14 - 2. Suppose q = i - l. What is the biggest value in -1/4, -0.1, q? q Let r = 0.9 - 0.4. What is the biggest value in 0, -4, r? r Let y = 24.13 + -24. Let d = y - 0.13. Let u = -0.2 + 0.4. Which is the third biggest value? (a) u (b) d (c) 4 b Let i = 0.2 + -0.1. Let z = 0.9 + -1. Which is the second biggest value? (a) 3/8 (b) z (c) i c Let w be 116/42 - (2 - 0). Let v = -1/3 + w. Let h = -0.9 - 0.1. Which is the third smallest value? (a) v (b) 0 (c) h a Let g = -126 + 885/7. What is the biggest value in 0, -0.3, g? g Let w = -112463/99 + 1136. Let h = 65/99 + w. What is the third smallest value in -5, 5, h? 5 Let m = -8.9 + 7.9. What is the third smallest value in -5/3, m, -1/5? -1/5 Let z be 4/8(-4)/(-6). Let j = 19 - 8. Let t = -7 + j. Which is the second biggest value? (a) z (b) t (c) -2/15 a Let p = 0.011 + -0.411. What is the second biggest value in -3, 5, p? p Let k = -145 + 139. Which is the second biggest value? (a) 3 (b) k (c) -4/9 c Let y = 8.7 - 8.6. What is the second smallest value in 2, y, -1/11, 1? y Let o = 0.6 + -1. Let n = -0.01 - 4.99. What is the smallest value in o, n, -4/5? n Let n = -5/38 + -2/57. What is the second biggest value in 5, 0.1, n? 0.1 Let s = -35 + 31. Let m = -0.3 + 0.2. Let z = m + 3.1. Which is the third biggest value? (a) -0.2 (b) z (c) s c Let j = 21 + -21. Suppose 2h - 2 = -jh. Let w = -9 - -5. Which is the third biggest value? (a) w (b) h (c) 0 a Suppose 35 = 5m + 5. Let u be m/(-21) - 4/14. Let f = -25 + 21. What is the biggest value in 1/8, u, f? 1/8 Let r = 0.09 + -0.06. Let l = r + 4.97. Let p = -3.1 + 3. What is the second biggest value in l, p, 2/11? 2/11 Let h = -48 - -47.79. Let f = -0.11 - h. What is the third biggest value in -5, f, -2/11? -5 Let g = -200/329 - -65201/329. Let h = g + -198. What is the third smallest value in -5, h, -2? h Let n be 25/(-30) + (0 + 1)/3. Which is the third smallest value? (a) -0.21 (b) n (c) 2 c Let q = 24 + -23. Let x = 0 - -2. Let s = x + -2. What is the second biggest value in q, s, 4? q Let k be (2/5)/((-4)/(-6)). Let r = -13 + 8. Which is the smallest value? (a) r (b) k (c) -1/4 a Let a = -9 - -13. Let i = a - 3. What is the second biggest value in i, -1, 1/3? 1/3 Let x = 2852 + -256729/90. Let m = 2/45 + x. Let v = -1 + 0.9. Which is the third smallest value? (a) 3 (b) m (c) v a Suppose i - 8 = -i. Suppose -14 = iq - 54. Let p be 3/(-6) + q/(-12). What is the second smallest value in 3, -0.2, p? -0.2 Let m = -4 - -2. Let a = 25 + -24.9. What is the third biggest value in 4, m, a? m Let g = -23/12 - -323/156. Let u = 0.44 - 0.14. What is the third smallest value in g, -5, u? u Suppose 2u + 13 = 3d, -2d + u = -u - 12. Let j = -0.08 + 0.38. Which is the smallest value? (a) 3 (b) j (c) d b Suppose -3z = -4c, 0 = -5z + 4c + c. Let n be 3 + (-2 - z) - -3. What is the third biggest value in -5, 0.2, n? -5 Let g = 29/10 - 33/10. Let l be 6/12(0 - -4). Let v be 82/(-60) + l/12. Which is the smallest value? (a) v (b) g (c) -5 c Let f = -0.1 - -3.1. Let p = f - 0. Which is the smallest value? (a) p (b) 0.5 (c) -0.3 c Let a = -2.26 - -1.9. Let o = a - -0.06. What is the third smallest value in 3, 0.4, o? 3 Let t = -0.3 + -0.7. Let z = t + 3. Let d = z - 2.5. What is the biggest value in d, -3/4, 0.4? 0.4 Let j = -138 - -142. Which is the third smallest value? (a) 1/3 (b) j (c) -6 b Let w(o) = o - 3. Let q be w(6). Let l be q/12 + 19/4. Let s = -38 - -37.7. Which is the third smallest value? (a) s (b) l (c) 4 b Let b be (-105)/4216/70. Let t be 2/(-6)*1 + 0. What is the smallest value in b, t, 0.2? b Let o = 0.45 - 12.15. Let z = o + 12. What is the third smallest value in 4/7, z, 2? 2 Let o = 25 + -35. Let k = -15 - o. Let n be 7/(-10) + (-3)/(-6). What is the second biggest value in -3, n, k? -3 Let g = -2/991 + 26761/1982. Let q = -14 + g. Which is the biggest value? (a) q (b) 2/11 (c) -3 b Let d be (18/(-16))/((-48)/64). What is the third biggest value in -2/17, d, -2, -0.2? -0.2 Let y be -1 + 1 - (-	{ "pile_set_name": "DM Mathematics" }
nne in kilograms? 10500 What is 50.24454 meters in millimeters? 50244.54 What is 79.85649 decades in months? 9582.7788 Convert 7.084511 centuries to months. 8501.4132 What is three tenths of a litre in millilitres? 300 How many meters are there in twenty-one quarters of a kilometer? 5250 What is 40.05634m in nanometers? 40056340000 How many nanometers are there in 0.699622m? 699622000 How many nanoseconds are there in 0.05655 hours? 203580000000 What is twenty-five quarters of a week in minutes? 63000 What is 0.7747833 millilitres in litres? 0.0007747833 How many seconds are there in one eighteenth of a hour? 200 Convert 954190.4ms to seconds. 954.1904 How many minutes are there in eighteen fifths of a day? 5184 How many kilograms are there in 42/5 of a tonne? 8400 Convert 0.2624771l to millilitres. 262.4771 How many years are there in 47/4 of a century? 1175 How many micrograms are there in 312818.3 milligrams? 312818300 How many millilitres are there in 55/2 of a litre? 27500 How many minutes are there in thirteen ninths of a day? 2080 What is thirteen eighths of a milligram in micrograms? 1625 Convert 778.9966 grams to milligrams. 778996.6 How many years are there in twenty-one fifths of a century? 420 What is 331.6404 minutes in hours? 5.52734 What is five quarters of a hour in minutes? 75 What is 0.8720361 millennia in months? 10464.4332 What is 1/5 of a litre in millilitres? 200 How many millilitres are there in seven eighths of a litre? 875 How many millilitres are there in fifty-seven fifths of a litre? 11400 How many millilitres are there in 8913.935l? 8913935 What is 1/20 of a century in months? 60 How many months are there in 5.401177 centuries? 6481.4124 How many nanometers are there in 27/2 of a micrometer? 13500 What is 4.123906ng in tonnes? 0.000000000000004123906 What is one tenth of a litre in millilitres? 100 What is 13/8 of a kilometer in meters? 1625 What is 42.70387 milligrams in grams? 0.04270387 What is thirteen fifths of a century in decades? 26 How many decades are there in 9.15447 years? 0.915447 Convert 51.14287g to micrograms. 51142870 What is nineteen quarters of a centimeter in micrometers? 47500 Convert 487.5888 litres to millilitres. 487588.8 How many years are there in 12.124548 months? 1.010379 How many grams are there in 64/5 of a kilogram? 12800 What is 12984.92 centuries in years? 1298492 What is eleven quarters of a century in years? 275 How many grams are there in 23514.71 micrograms? 0.02351471 What is fourty-nine fifths of a tonne in kilograms? 9800 How many nanometers are there in 7257.977 kilometers? 7257977000000000 How many months are there in 17243.91 millennia? 206926920 What is three eighths of a millennium in years? 375 What is twenty-one fifths of a millisecond in microseconds? 4200 Convert 0.401939 millilitres to litres. 0.000401939 What is 13358.86 centimeters in millimeters? 133588.6 What is 0.3744674t in milligrams? 374467400 How many millilitres are there in 5/8 of a litre? 625 What is 9609.535 centimeters in millimeters? 96095.35 Convert 322.7247 millimeters to micrometers. 322724.7 What is 1/4 of a decade in months? 30 How many kilograms are there in fifteen quarters of a tonne? 3750 Convert 876735.2cm to nanometers. 8767352000000 What is 3/32 of a meter in micrometers? 93750 Convert 0.794451 decades to millennia. 0.00794451 Convert 9.900969 months to centuries. 0.0082508075 What is 11/2 of a litre in millilitres? 5500 How many micrometers are there in 3/10 of a centimeter? 3000 What is 3/40 of a microgram in nanograms? 75 Convert 14968.359ms to minutes. 0.24947265 What is sixty-four fifths of a meter in millimeters? 12800 How many years are there in 0.438468 months? 0.036539 What is 25/4 of a microgram in nanograms? 6250 How many nanometers are there in 7.522066 centimeters? 75220660 Convert 50.05034 weeks to days. 350.35238 How many micrometers are there in 749.0174m? 749017400 How many litres are there in 3.891643 millilitres? 0.003891643 How many millilitres are there in 26/5 of a litre? 5200 Convert 679800.8 centimeters to micrometers. 6798008000 How many nanometers are there in 29.98967m? 29989670000 What is 3/8 of a litre in millilitres? 375 How many millilitres are there in 27/2 of a litre? 13500 How many years are there in 79/2 of a millennium? 39500 How many micrometers are there in 27/5 of a millimeter? 5400 How many litres are there in 0.3697883 millilitres? 0.0003697883 How many millimeters are there in 27/2 of a meter? 13500 What is one tenth of a millimeter in nanometers? 100000 How many micrograms are there in 0.666414g? 666414 How many nanograms are there in 773935.6t? 773935600000000000000 How many kilometers are there in 507.6595 micrometers? 0.0000005076595 How many centuries are there in 21/5 of a millennium? 42 How many millilitres are there in fifty-three fifths of a litre? 10600 What is seventeen quarters of a microsecond in nanoseconds? 4250 How many grams are there in 43/4 of a kilogram? 10750 How many millilitres are there in 3613.434l? 3613434 How many hours are there in thirteen quarters of a week? 546 How many nanometers are there in twenty-nine fifths of a micrometer? 5800 How many nanoseconds are there in 0.8695342 minutes? 52172052000 Convert 516.614 kilometers to centimeters. 51661400 What is 4/7 of a week in days? 4 What is thirteen fifths of a millennium in centuries? 26 What is five eighths of a week in hours? 105 How many millilitres are there in seventy-one quarters of a litre? 17750 How many millennia are there in 9.139749 decades? 0.09139749 Convert 62649.5um to centimeters. 6.26495 What is 130.7514 micrograms in grams? 0.0001307514 How many months are there in 43/2 of a year? 258 How many decades are there in 910034.7 centuries? 9100347 How many microseconds are there in 4.067798ns? 0.004067798 What is 8.377039 centuries in years? 837.7039 What is 13/4 of a milligram in micrograms? 3250 What is 703605.9 milliseconds in minutes? 11.726765 Convert 1704.0534 months to decades. 14.200445 How many months are there in thirteen fifths of a millennium? 31200 How many microseconds are there in 7.236334 minutes? 434180040 How many nanograms are there in eleven halves of a microgram? 5500 What is 1/5 of a litre in millilitres? 200 How many seconds are there in 910647.2 milliseconds? 910.6472 What is 208.308471 hours in weeks? 1.239931375 How many millilitres are there in seven quarters of a litre? 1750 How many millilitres are there in 17/4 of a litre? 4250 How many microseconds are there in 610.5964 milliseconds? 610596.4 Convert 13125.168 months to decades. 109.3764 How many micrograms are there in 64288.73 milligrams? 64288730 What is one fifth of a kilometer in meters? 200 How many millilitres are there in 3/8 of a litre? 375 How many centimeters are there in 40.01401 nanometers? 0.000004001401 How many months are there in three sixteenths of a millennium? 2250 How many litres are there in 3.29893ml? 0.00329893 How many centimeters are there in 64760.93 nanometers? 0.006476093 How many months are there in 3/10 of a millennium? 3600 What is five quarters of a millennium in months? 15000 How many seconds are there in 1188.117 weeks? 718573161.6 How many grams are there in six fifths of a kilogram? 1200 What is 3/5 of a centimeter in micrometers? 6000 What is 55/4 of a century in months? 16500 How many millilitres are there in seven halves of a litre? 3500 What is 27/2 of a millennium in years? 13500 Convert 15397.21 days to milliseconds. 1330318944000 How many millilitres are there in 18/5 of a litre? 3600 How many grams are there in 3/25 of a kilogram? 120 How many kilometers are there in 558140.7 millimeters? 0.5581407 Convert 625447.4 millilitres to litres. 625.4474 How many milliseconds are there in 0.0108857 microseconds? 0.0000108857 What is 15/4 of a litre in millilitres? 3750 What is 13/4 of a litre in millilitres? 3250 What is six fifths of a millennium in centuries? 12 How many years are there in seventeen quarters of a century? 425 Convert 8.090796m to nanometers. 8090796000 What is one sixth of a year in months? 2 Convert 0.322833 millilitres to litres. 0.000322833 Convert 4693.184 millennia to months. 56318208 How many centuries are ther	{ "pile_set_name": "DM Mathematics" }
Calculate -98 + 5292/49 + -60. -50 What is (-234)/45(55/(-4) + -12 + 27)? -13/2 Evaluate -162 + 118 - (-2 - 19) - (6 + 7). -36 Evaluate (39480/(-600))/(35/(-25)). 47 Evaluate 462/(-22)(28/(-20) + 6 + (-247)/195). -70 What is 12 - (-13)/((-390)/384) - (-1232)/40? 30 15 - ((-4)/(-6))/((-858)/(-1287)) 14 What is 3-21 - (-14418)/534? -36 What is ((-9090)/8080)/(3/(-4))? 3/2 Calculate 4104 + -4231 + (55 - -2). -70 ((-3060)/680)/(-2 + (-14)/(-4)) -3 -1((-5852)/(-49742) + 2002/34) -59 What is (58 - 8)(10 + (-4068)/405)? -20/9 Calculate (-279 + -21)/(-15)-2(-58)/40. 58 Calculate 38/171(34/629 - (-78275)/(-370)). -47 Evaluate (-33485356)/5566283 - (64/(-10) - (-2 + (-16)/(-10))). -2/127 What is 1 - 1-3 - 47724/9312? -9/8 Calculate 2890/136-4 - 13(-2)/(-1 - 1). -98 Evaluate ((-1488)/(-1705))/((-1)/3519 + 223/1561). -24/11 -125(-1980)/(-6525) - -38 2/29 Calculate 56/64 - 26875/1000. -26 Evaluate 93/((-13113)/6) + 8892/1316 + -3. 26/7 (3 + (-91)/33)(-4806)/2136 -6/11 What is the value of (116/32)/(49/196) + 1/2? 15 What is 27/(-66)16313/(-8898)? 3/4 Evaluate (48 - -2) + 1784946/(-35949). 8/23 5/4 - 16123/19628 3/7 14/112-2(62 + -40) -11/2 What is 3/((-6)/58) + (-1465060)/(-51708)? -2/3 81240/720 - 46 -8/9 What is the value of -2(-1)/(-7)(-1683)/(-374)? -9/7 (2 + (-54)/28)/((47310/(-6391))/(-114)) 11/10 What is ((-86)/129 + (-29)/(-3))/((-260)/26)? -9/10 What is the value of 2/56(18 - 15)/(16 + 385/(-22))? -1/14 (-47)/((-4136)/462)(-2 + -2) -21 What is the value of (-12)/(-10(-354)/(-35990))? 122 What is the value of ((-121 - -141)6/225)/((-12)/(-9))? 2/5 What is the value of 1 + (-14)/13 + (-29 - (-41)/(287820/205992))? 4/15 What is the value of (487461/(-8816) - -55) + -4(-2)/76? -3/16 What is the value of 21 + 0 + ((-5060)/180 - -8)? 8/9 What is (297/1485)/(31/(-17980))? -116 (19 - (-1392)/(-58))(24 + (1 - 2) - 1) -110 Calculate (-6)/((-24)/(-10)) - 104/((-604656)/14739). 2/57 -79 + 27 + 37 - ((-8)/(-4) + -12 - 1) -4 ((-94)/(-20)(3 + 177)/12)/((-9)/(-6)) 47 6 - ((-162)/(-54))/((3/(-161))/((-42)/1617)) 20/11 Evaluate (24/45)/(74592/11988). 3/35 Calculate -114(-16)/8-16(-3)/576. 19 Calculate (1078550/(-650))/(-37) + (-4)/(-26). 45 Calculate 808/(-60) - 171496/(-19788). -24/5 Calculate (-110)/(-100)(272/(-935))/(-2). 4/25 What is the value of -1(-115)/(-20)(-2)/(1963/130 + -15)? 115 What is (-100)/(-140) + (-21306)/4692/4? -22 What is the value of (-5105/175)/(((-81)/(-180))/(-9))? 60 Evaluate (((-4)/(-10))/((-1704)/6390))/((-6)/28). 7 Evaluate 12 - -33016/(-384). -7/4 Calculate -103 + 95 + ((-1160)/(-106) - (-10 + 13)). -3/53 Evaluate (1(-2)/(-88))/((-35 - 38)/73). -1/44 What is the value of -22467 + 22544 + 1457/(-19)? 6/19 What is (-99)/(-51) + -2 + ((-51964)/374 - -129)? -10 Evaluate (1 - 2)8832/(-103040). 3/35 2241/8217 - (-6224)/(-880) -34/5 (3156/18936)/((-2)/(-144) - 0) 12 Calculate (-103)/((-3708)/72)(3 - (-110)/(-24)). -19/6 Evaluate 2/(-8)2 - (-330825)/(-12030). -28 What is 609/36546/(-9)? -1/9 10/1((-333)/(-185) + 6 - 7) 8 What is the value of 22/((5/(-4))/(-9 + 1012/88))? -44 Evaluate (-14880)/(-10912)22/36. 5/6 What is the value of 14/28 - 1470/(-60)? 25 Evaluate 2304/(-8064) + (-3)/(-35). -1/5 Evaluate 1/((-598)/(-1210)) - 170499/(-1307159). 28/13 Evaluate (44/(-1540))/(1300/(-525))10. 3/26 Evaluate 125 + (-669655)/5247 - (-2 + 14/9). -24/11 What is the value of ((-1435)/385 - -1)/(3/44(-1 + 0))? 40 What is 3/5 + 243/45 - (20 + 261/(-58))? -19/2 What is the value of (143/2 + 1)/((-409)/24 - 909321/(-51471))? 116 (259/2849 - (-1432)/(-22) - -15) + 7 -43 Evaluate (-3133)/52 + 11 - (-23 + 1044/48). -48 What is (-11557)/3913 + 6 + (4/(-1) - -1)? 2/43 What is the value of (-90)/(-39) + (155838/8892 - 23)? -19/6 Calculate (-28)/(-8)1898/(-1533). -13/3 Calculate (378386596/11438)/(-334) - (-2)/43. -99 Calculate 103/(-6) - (66 + (-38509)/582). -17 Calculate ((2 - 4) + -4)(3141/(-450) + 7). -3/25 (-84)/(-8) + (-25)/10 - (15725/(-750) - -29) -1/30 1(-37504)/624 + 244/2379 -60 What is the value of (21/6)/(-12(-245)/(-50400))? -60 (-294)/(-208) + 6 + 28/(-4) - 1251/3336 1/26 Evaluate 1013/(-9) - (-114900)/20682. -107 What is (7 - 1085967/(-19737)) + -62 + (4/34 - 0)? 6/43 Evaluate (35/51)/7((-1)/2 + (-49)/(-14)). 5/17 Calculate (-81)/(-1) + 29618002/(-369236). 11/14 Calculate (9 - (-34)/(-153))(-972)/(-108). 79 Evaluate 6/16 + (-1)/(112/128686/41713). -6/43 What is 3/(-16) + 32469/(-2192) + (-40)/1? -55 1/(-51) - 5268744/310284 -17 Calculate 2(-21)/7488 + 364/11648. 1/39 Evaluate ((-2)/6 + 507/9)(-177)/(-354). 28 What is the value of 2 + 11 - (7777/(-101) - -37)? 53 1002 - 1082 - (-6 - -11 - 46) -39 What is ((-9842)/42)/19(1 + -4)? 37 Calculate ((-4)/(-16) + 114/(-392))/((-285)/(10 + -580)). -4/49 What is the value of 17 + 93 + -145 + 66? 31 11 + (58 - (-9018)/(-189))(33/9 + 1) 59 Evaluate ((-1102)/29 - -68) + (-92 - 11). -73 Evaluate (-29 + 27 - -10)(-2850)/400. -57 Calculate (-13)/19(-534)/3471. 2/19 What is (-759)/15 - 15/50(-320)/1803? -49 Calculate ((4/417)/(16/6 - 2))/(2547 + -2546). 2/139 What is (6/2)/(15330/252 + -61) - -26? 8 -256/(-12)(-28)/((-672)/(-36)) -14 Calculate (2/(-5))/((-16188)/22515) - (-264)/(-528). 4/71 (((-27)/(-36))/(28/(-272)))/(13/((-1001)/(-88))) -51/8 What is (-2 - 437/57)/((-5)/3)? 29/5 What is (-136)/(-16)2 + 28(-363)/(-231)? 61 Evaluate (-2)/18(66/(-13) - -6)-13. 4/3 What is the value of -2 + -2 + 1857 + -1832? 21 What is the value of 6/(-60(-48)/(-960))? -2 What is the value of -2(-4)/32-826? -52 ((-58982)/(-8043))/(-455/(-4440)) 148 What is (-244725)/12550(1 + 1-2 - (3 - 2))? 39 What is (20/(-25))/2 + (-107)/((-789660)/2592)? -2/41 What is the value of 0 + -45 + 729439/13763? 8 Calculate 248/770 + 14427/441 + -33. 2/55 What is the value of (-55)/(4400/(-128))60/1104? 2/23 What is ((-142)/497)/(4/(-308))? 22 Calculate 4/(27/(12393/(-204))). -9 Evaluate 730/52 + 23/(-598) - (-3216)/(-230). 2/115 Calculate 46/(73/((-14600)/(-100))). 92 Calculate (-288)/11 - (-10050)/55275. -26 -483/11 - (-740)/4070 -30 Evaluate (-140)/4 - (-59)/(472/568). 36 What is (-4788)/(-4256) - 19/88? 10/11 What is the value of (38/969)/(108/35343)? 77/6 What is (-25)/(-1500)-15 - (-477)/(-12)? -40 Calculate (8 - (-4 + 2737/230))/((-6)/(-10)). 1/6 What is the value of 120/24 + (-108)/28(-13 + 16 - 2)? 8/7 What is (-462)/(-35)5 - 13? 53 What is the value of ((-78)/(-10))/(370/(-1850))? -39 (-756)/105(-5760)/432 96 Calculate (-61/(-24))/(265/(-140) + 2). 7/3 Calculate 236/(-6) + ((-476)/(-204) - 1). -38 7692/5769(-1)/(2/(-75)) 50 What is (657/11169)/(18/16218)? 53 801/(-623) + (-1449)/49(-4)/(-6) -21 Calculate (594/(-72))/(8/(-128)(6 + -12)). -22 (58 + -22)/((-266)/21) + 3 3/19 ((-429759)/(-588))/9 + 1210/29645 + (-1)/4 81 What is 315((22456/392 - 57) + 9/(-105))? 63 ((56/219744)/(48/(-216)))/((-2)/8) 1/218 Evaluate ((-668)/(-501))/(9/27). 4 What is the value of -19 + 15 + 10((-1 - (-18)/3) + -6)? -14 Evaluate 230/(-105)(-77)/(-143). -4/13 What is the value of ((-42)/(-126)-79 + 27)438/4? 73 Evaluate (-13)/(-3) + 4402/(-16401)14/(-4). 58/11 Evaluate (-8)/(-6)161703/(-4068) + -112. -65 What is 4083/50357 - (5712/3367 - 1)? -8/13 Evaluate ((-135)/10)/(1692/(-4512)). 36 Evaluate 60(29815/356 - 84). -15 Calculate 48/15(-95700)/5104. -60 What is 8/18(33561/(-1243))/((-12)/34 + 0)? 34 What is the value of 5/(-15)(17/952-610 - -11)? -1/28 Evaluate 39 - (-25 + 0)/(78 - 73). 44 What is 279/15 + ((-504504)/(-910))/(-99)? 13 What is the value of 21/(-4)((18/4)/(-3) + (-8435)/3374)? 21 Calculate ((-45306)/(-378) + -89)(-1)/3 - (-11 - -1). -2/7 Evaluate ((-819)/195 + 4)/((-1)/20) - 1320/315. -4/21 Calculate ((-55458)/(-1620) + -34)20. 14/3 What is (-967)/11 - (10 + 1683/(-121) + (-4 - -8))? -88 (-2)/(250/(-60) - -4) 12 What is (-68)/(-1173)(-54)/12? -6/23 Evaluate 3 + 180/(-55) - (339/452)/((-297)/(-24)). -1/3 (1 + -153)86/688 - -19 0 What is (3743/418-1)/(5/10) + 18? 1/11 Calculate (108/(-200))/(335/(-6834)) + -11. 2/125 What is -24(-80)/9663/(-12)(-2)/(-6)? -35 Calculate 7636/(-138) - -28 - -27. -1/3 What is (-42)/(-5)*(-64580)/(-45206)? 12 What is (8 - 210/24) + (805/(-630))/((-12)/54)? 5 What is the value of (-918)/3213 + (-2886)/42? -69 Calculate (-3	{ "pile_set_name": "DM Mathematics" }
und 0.00000531580688 to 5 decimal places. 0.00001 Round 3.3389014 to 1 decimal place. 3.3 What is -7131046.442 rounded to the nearest one million? -7000000 What is -910740.7144 rounded to the nearest 100? -910700 Round -0.00086363973 to 7 dps. -0.0008636 What is 0.05790353 rounded to two decimal places? 0.06 What is -0.000098336622 rounded to 7 decimal places? -0.0000983 What is 200.1013348 rounded to 1 decimal place? 200.1 Round 17.50342258 to three dps. 17.503 Round -0.00001718946344 to seven dps. -0.0000172 What is -1447.48019 rounded to the nearest 10? -1450 What is 0.493291957 rounded to three dps? 0.493 Round -692.829918 to the nearest 100. -700 Round -0.018712006 to two dps. -0.02 What is -24584.94175 rounded to the nearest 10000? -20000 What is -16.6778249 rounded to the nearest integer? -17 What is 41.08696 rounded to the nearest one hundred? 0 Round -28718.068 to the nearest 10. -28720 What is 0.00083023317 rounded to six decimal places? 0.00083 Round -0.000228054979 to 6 dps. -0.000228 Round -584761.931 to the nearest 1000. -585000 What is -69958.701 rounded to the nearest 10000? -70000 What is 633.373903 rounded to the nearest one hundred? 600 Round 5044570.37 to the nearest one thousand. 5045000 Round -560.92509 to the nearest one hundred. -600 Round 0.001693754873 to four dps. 0.0017 Round -7898098.7 to the nearest ten thousand. -7900000 Round 1777861440 to the nearest one million. 1778000000 Round -0.03245561578 to 4 dps. -0.0325 Round -1036.0754 to the nearest one hundred. -1000 What is -0.00026118739 rounded to six dps? -0.000261 Round 222937.855 to the nearest ten thousand. 220000 What is -18988153240 rounded to the nearest one million? -18988000000 Round -209969532.6 to the nearest ten thousand. -209970000 What is -0.068610284 rounded to 5 decimal places? -0.06861 Round 9727.1979 to the nearest 1000. 10000 What is -878019.904 rounded to the nearest one thousand? -878000 Round -0.00106102701 to six decimal places. -0.001061 Round 0.001210691902 to 4 decimal places. 0.0012 Round 1868.23562 to zero decimal places. 1868 What is -2925.20362 rounded to zero decimal places? -2925 What is -0.0866646743 rounded to 6 dps? -0.086665 What is 0.98241986 rounded to two dps? 0.98 Round -5503857464 to the nearest one hundred thousand. -5503900000 Round -0.083638486 to three decimal places. -0.084 Round -14.58039792 to three decimal places. -14.58 Round -1.044180546 to three decimal places. -1.044 What is 0.00261669595 rounded to 7 dps? 0.0026167 Round 14903.61137 to the nearest 10. 14900 Round -0.176465556 to two dps. -0.18 Round 0.00000050139262 to six dps. 0.000001 What is 17658.88712 rounded to the nearest one thousand? 18000 What is 0.00316297232 rounded to seven dps? 0.003163 Round 69090.985 to the nearest 1000. 69000 What is 0.44016183 rounded to two decimal places? 0.44 What is -11179.68645 rounded to the nearest 100? -11200 What is 13709160.551 rounded to the nearest one million? 14000000 Round -1358912.1 to the nearest one hundred thousand. -1400000 What is 13.766261857 rounded to four decimal places? 13.7663 What is -0.0000032808125498 rounded to 7 dps? -0.0000033 Round 0.514294896 to three dps. 0.514 What is -574.899707 rounded to zero dps? -575 What is 8561.9455 rounded to the nearest ten? 8560 What is -6.802929315 rounded to 2 decimal places? -6.8 What is -10.695681 rounded to the nearest ten? -10 What is 74354038.2 rounded to the nearest one hundred thousand? 74400000 Round 155.961438 to two decimal places. 155.96 Round 251278940 to the nearest one million. 251000000 What is 0.305969879 rounded to four decimal places? 0.306 Round -37.56153025 to 3 decimal places. -37.562 What is -21561061.9 rounded to the nearest 1000? -21561000 Round 1131.7938 to 1 dp. 1131.8 What is -0.000033809003 rounded to seven dps? -0.0000338 What is 0.00073146543 rounded to three decimal places? 0.001 Round 13004.45206 to the nearest one hundred. 13000 What is -4302.26055 rounded to 0 dps? -4302 What is 63743752 rounded to the nearest one hundred thousand? 63700000 What is 394307.851 rounded to the nearest 10000? 390000 What is -24.22104018 rounded to 2 dps? -24.22 Round 204.3501304 to the nearest integer. 204 Round 0.0000201127804 to 6 decimal places. 0.00002 What is -0.02675098618 rounded to three dps? -0.027 Round 3926.4751 to the nearest one hundred. 3900 Round 0.0003052521931 to 6 decimal places. 0.000305 Round -9118448.9 to the nearest 100000. -9100000 Round 31554.6351 to the nearest ten. 31550 Round 0.1388087213 to five dps. 0.13881 Round 0.000007218913 to 6 decimal places. 0.000007 Round -3855.1301 to zero decimal places. -3855 What is -1197457.38 rounded to the nearest ten thousand? -1200000 Round -7319578522 to the nearest 100000. -7319600000 Round -1947325900 to the nearest 1000000. -1947000000 What is 0.0148998257 rounded to five decimal places? 0.0149 Round 1.299005643 to 3 dps. 1.299 What is 280786358 rounded to the nearest 10000? 280790000 What is 283554.6364 rounded to the nearest 100000? 300000 What is 0.677182884 rounded to 3 dps? 0.677 What is -48113.61 rounded to the nearest one thousand? -48000 What is 2945223938 rounded to the nearest 100000? 2945200000 Round 156347.75454 to the nearest 10000. 160000 Round 2.001413761 to one decimal place. 2 Round 140765.923 to the nearest ten thousand. 140000 Round 7.39526389 to 3 decimal places. 7.395 Round 0.46359483 to 4 decimal places. 0.4636 Round 3109.62498 to the nearest one hundred. 3100 What is 0.0057093858 rounded to six decimal places? 0.005709 Round 3699.92583 to the nearest integer. 3700 Round -21845911.83 to the nearest one hundred thousand. -21800000 Round 11347.448979 to the nearest integer. 11347 What is 1.83004271 rounded to 3 decimal places? 1.83 Round 144.5902802 to the nearest 10. 140 Round 67363901.5 to the nearest 1000000. 67000000 Round -6554685 to the nearest one thousand. -6555000 What is -5596.68237 rounded to the nearest ten? -5600 What is 0.0778125249 rounded to four dps? 0.0778 Round -0.008186297475 to 5 dps. -0.00819 Round -1366887.88 to the nearest one hundred thousand. -1400000 What is 2948184.84 rounded to the nearest 10000? 2950000 Round 0.2131754393 to 3 dps. 0.213 Round -93314544.8 to the nearest one million. -93000000 What is 35876.6452 rounded to the nearest one thousand? 36000 What is -8.78033585 rounded to four dps? -8.7803 What is -57204970.4 rounded to the nearest one million? -57000000 What is 39.7638411 rounded to 3 dps? 39.764 What is -0.093566654 rounded to five dps? -0.09357 What is 0.0224095296 rounded to three dps? 0.022 What is -26220.3991 rounded to the nearest ten? -26220 Round -0.000003582873758 to six dps. -0.000004 What is 1.16795271 rounded to 4 decimal places? 1.168 What is 31.81790194 rounded to two dps? 31.82 What is -424728.386 rounded to the nearest one million? 0 Round 5717502510 to the nearest one million. 5718000000 Round -56246.5891 to the nearest 10000. -60000 Round 573489.6 to the nearest 10000. 570000 Round 91742.351 to the nearest one hundred. 91700 Round -0.81877601 to 4 decimal places. -0.8188 Round 0.04312729359 to 3 decimal places. 0.043 Round -88.7328257 to zero decimal places. -89 What is -164485752 rounded to the nearest one hundred thousand? -164500000 What is -449614752.6 rounded to the nearest 10000? -449610000 Round -335.31026 to the nearest 10. -340 What is 0.0167668832 rounded to three decimal places? 0.017 What is -0.0001144659183 rounded to seven dps? -0.0001145 Round 0.000208088387 to seven decimal places. 0.0002081 Round -29.3715852 to 1 dp. -29.4 Round 31.0741483 to 3 decimal places. 31.074 What is 0.358471703 rounded to one dp? 0.4 Round -0.083421966 to 3 dps. -0.083 What is 7507455.9 rounded to the nearest 1000? 7507000 Round -0.001113985476 to 6 decimal places. -0.001114 Round 0.000358641523 to seven dps. 0.0003586 Round 0.0000152868836 to 7 dps. 0.0000153 Round 0.0000135422204 to six dps. 0.000014 What is 1733641.6041 rounded to the nearest 10000? 1730000 What is -10966267.98 rounded to the nearest 10000? -10970000 What is -5094008.314 rounded to the nearest 100? -5094000 Round -5788223.84 to the nearest 100000. -5800000 What is 86.00010966 rounded to two decimal places? 86 Round -1349641110 to the ne	{ "pile_set_name": "DM Mathematics" }
0.35. What is the second biggest value in l, 6, m? l Let c = -64 + 64. What is the fourth smallest value in 0.5, -0.5, c, -4? 0.5 Let v = -1.6 - -0.6. Let k = v + 2. What is the third biggest value in -0.4, k, 0? -0.4 Let c = -0.9 - -0.7. What is the biggest value in -3, -1/4, c? c Suppose 3r = -2g - 2, -5r = -4g - 0g + 40. Let t = 28 + -33.1. Let w = -0.1 - t. Which is the second smallest value? (a) w (b) r (c) 2/15 c Let g = -0.06 + -0.34. Let r = -0.11 - -5.11. Let m = 2 - r. What is the second smallest value in -5, m, g? m Let q(f) = f2 + 6f + 4. Let j be q(-6). Let x = -6 + j. Let k(w) = -w - 5. Let m be k(-6). Which is the biggest value? (a) m (b) -1/4 (c) x a Suppose 1 - 3 = 2y. Let i be (0/(-1))/(-2 + 0). Suppose iv - 20 = -5v. Which is the smallest value? (a) y (b) v (c) 2 a Let j = -35.5 - -11.5. Which is the smallest value? (a) -2 (b) j (c) 1/4 b Let u be (-6)/7510/6. What is the biggest value in -4, 0, u? 0 Let r be ((-16)/(-8))/(1/2). What is the smallest value in 3/4, -0.12, r? -0.12 Let w = 0.34 - -0.04. Let q = 17.38 - w. Let t = q + -12. What is the third smallest value in 2, t, 0.3? t Let u = 0.09 + -0.49. Which is the third smallest value? (a) -3 (b) u (c) -0.2 c Let f = 4 + -4. Let l = f - -4. What is the biggest value in -0.5, -3, l? l Let w = 191 - 189.07. Let z = w - 1.8. Let j = z - 5.13. Which is the second biggest value? (a) -0.3 (b) -1 (c) j b Suppose 3n - 4t = n - 474, -231 = n - 5t. Let c = n + 2649/11. Let p = -73 + 437/6. What is the second smallest value in -1, c, p? c Let z = -60 + 62.7. Let h = z + -3. Let q = h - -0.2. What is the second smallest value in q, 2/15, 3? 2/15 Let y be (6/(-3) - -2) + 18. Let o be ((-2)/8)/(y/16). Let g = 0.2 + -4.2. Which is the second biggest value? (a) g (b) o (c) 0.1 b Let i = 16 - 21. What is the biggest value in 0, -11, i? 0 Suppose 0v - 4v = -20. Suppose -3 = -6f + vf. Which is the third smallest value? (a) -0.3 (b) f (c) -4 b Let n(d) = -d2 - 1. Let y be n(0). Let u be 1/3-1 + (-42)/(-234). Which is the third biggest value? (a) u (b) y (c) -4 c Let t = -0.065 + 30.065. Which is the second smallest value? (a) -5 (b) t (c) 1/5 c Let m be ((-4)/(-2) - -2) + -1. What is the second smallest value in 0, -0.5, -5, m? -0.5 Suppose -4v + 11 + 5 = 0. Let j be v/8(-1 - -2). Which is the biggest value? (a) 0.3 (b) j (c) -1/3 b Let f = 1482688/35 + -42355. Let t = 4101/5 + -828. Let s = f + t. Which is the biggest value? (a) s (b) -0.5 (c) 0.2 c Let a = 95 + -99. What is the third smallest value in 0.06, 6, a? 6 Let b = -3.9 + 3.4. What is the smallest value in b, 5, 0.2? b Let b(f) = -2f - 9. Let i be b(-15). Let m = i - 43/2. What is the third biggest value in -0.2, 1, m? m Let i = -133 - -933/7. Let h = -0.04 + 0.19. Let n = 0.15 + h. What is the biggest value in n, 2/19, i? n Let q = -125/68 - -10/17. Which is the second smallest value? (a) q (b) -0.3 (c) 0.4 b Let w = 0 - 1. Let d = 30 + -26. What is the biggest value in d, w, -0.2? d Let b be (-1 - (2 - 2)) + 2. What is the second smallest value in 0.02, 4, b, 0.3? 0.3 Let v = 74 - 75. What is the third biggest value in v, 5, 4? v Let m = 356889/7 - 50879. Let g be 630/12(3 + -1). Let l = g - m. Which is the third smallest value? (a) l (b) 5 (c) 0.2 b Let h(i) = i*2 + i + 3. Let w be h(0). Which is the third smallest value? (a) w (b) -0.2 (c) 4 (d) 1/5 a Let r = 0.57 + -0.37. Which is the second smallest value? (a) r (b) -0.2 (c) -3 b Let j = 3/2 + -37/22. Which is the second smallest value? (a) j (b) 2/5 (c) 2 b Let m = 0.13 + -0.23. Let h = -2.1 - m. What is the third smallest value in 5, h, 0? 5 Let q = -0.02 - 0.1. Let w = 0.12 + q. Which is the third smallest value? (a) -4/3 (b) -0.4 (c) w c Suppose o - 2 = 2b, -3o = -5b + 6b - 6. Let c = -18 - -22. Suppose -c = 2d + 3r - r, 0 = -od - 4r. What is the second biggest value in -2, d, -1/4? -2 Let k = -0.37 - 0.13. Let f = 4/17 + 6/119. Which is the smallest value? (a) f (b) 2/5 (c) k c Let h = 4.6 + -5. Let y = 0.01 - -0.39. Let q = 37/3 + -25/2. What is the smallest value in q, y, h? h Let a be ((-6)/4)/((-18)/8). Let f = 38 - 25. Let l = 16 - f. What is the third biggest value in a, l, 2/9? 2/9 Let g = -26 - -13. Let s = -12 - g. What is the third biggest value in -1/6, s, -3? -3 Let v be (-6)/24 - (-19)/28. Let g = -2 + 4. What is the smallest value in g, -5, v? -5 Let z(g) be the third derivative of -g5/60 + g4/6 - 2g2. Let w be z(3). Which is the second smallest value? (a) -1 (b) w (c) -3 a Let g = -0.3 + 5.3. What is the second biggest value in -2, g, 0? 0 Let i = 0.092 - 3.092. What is the smallest value in 0.1, 10/3, 0, i? i Let i = 0.955 - -0.045. Which is the second biggest value? (a) 2 (b) i (c) 2/5 b Let d be ((-27)/(-90))/(12/(-10)). What is the third biggest value in 5, 2, -5, d? d Let u = 6.6 - 1.6. Which is the third biggest value? (a) u (b) -2/11 (c) 7 b Let n = -0.26 - 0.04. Let j = n - -0.6. Let h = -19 - -24. What is the second smallest value in h, j, 0.1? j Let f = 32 + -9. Which is the biggest value? (a) 0.5 (b) 2/9 (c) f c Let y = -21 + 19. Which is the biggest value? (a) 4 (b) -3 (c) y a Let z = -1 + 0. Let p = z - -0.5. Which is the second biggest value? (a) -2/3 (b) 5 (c) p c Let y(x) = x2 - 4x + 3. Let m be y(5). Let v be (-2)/8 - m/(-160). What is the biggest value in -3, v, -4? v Let y = -1.8 + 2. Suppose -5n - 3 = -8n. What is the second biggest value in y, 0, n? y Let t be -2 + 5 - (-16)/(-6). Which is the fourth biggest value? (a) 3 (b) t (c) 5 (d) 0.4 b Let n be 1/(-1(0 + 1)). Let d = 0.406 - 0.106. Which is the second smallest value? (a) n (b) d (c) 1/3 b Suppose 0 = 4k + 2w - 8, k + 5w - 7 = 13. Which is the third smallest value? (a) 2/5 (b) -2 (c) k a Let k = -1.887 + -0.113. Which is the smallest value? (a) -3/2 (b) k (c) 3 (d) -18 d Let t be (-111)/(-9) + (-3)/9. Suppose 3v + t = -p, v = -v - p - 7. Which is the smallest value? (a) -2 (b) -0.3 (c) v c Let w = 10 - 6. Let v = w + -8. Let y = 4 + v. What is the second biggest value in 5, y, -5? y Let l = 0.1 + 0.4. Let u(y) = -y*3 + y - 2. Let g be u(-2). Let m = 0.02 - 0.32. Which is the second biggest value? (a) g (b) m (c) l c Let l = 1.4 - 0.9. Which is the smallest value? (a) l (b) 3 (c) 5 a Suppose -2a - 8 = -4a. Suppose -ak - 4 = -20. Let z be 6/(-4) + 12/8. What is the third biggest value in z, -0.5, k? -0.5 Let m = -12.45 - -12. Let v = 1.45 - m. Let c = v + -2. What is the third biggest value in 1, c, -1/2? -1/2 Suppose 0 = v - 3. Suppose 0i = 3s - 4i + 9, 3i + 12 = -4s. Which is the second smallest value? (a) 1/3 (b) v (c) s a Suppose 0 = -o - 4z - 3 - 17, o + 2z + 10 = 0. Suppose -v - v + 10 = o. What is the smallest value in v, -4, -0.4? -4 Let h = -92 - -92. Which is the second biggest value? (a) h (b) -4 (c) -1 c Let g = 169/410 - 1/82. Which is the third biggest value? (a) -4/5 (b) 2/9 (c) g a Let u = -0.51 + 0.81. Which is the third biggest value? (a) 1.1 (b) 0.4 (c) u c Let r = -7 - -9. Let x = 0.2 - 0.1. Let z be -6(-2 + (-8)/(-3)). What is the third biggest value in z, x, r? z Let x = -0.63 - -4.63. Let f be 6/(-4)(-4)/10. Which is the biggest value? (a) f (b) -4 (c) x c Let i = -2.9 - 0.1. Let u = -0.92 + -0.08. Let h = -4 - -5. What is the biggest value in i, h, u? h Let s be (7/2 - 1) + -3. What is the third biggest value in s, -1, -0.1? -1 Let l = -10 + 5. Suppose 0 = -m - 4f - 10, 5m + 2 = -5f - 3. What is the biggest value in 4, m, l? 4 Let r be (2642/25)/(6/(-10)). Let w = -176 - r. What is the third smallest value in 1, 2, w? 2 Let f be (4 + -2)/(2 - 5). Let s = -0.3 - 0.7. Let r = s + 0.9. What is the second biggest value in r, f, 0.4? r Let k = -0.14 + 0.04. Let r = 0.3 - k. Let l be (-9)/(-2) + (-1)/(-2). Which is the second smallest value? (a) l (b) r (c) -2 b Let o = -2 + 2.2. Which is the third smallest value? (a) -13 (b) o (c) -5 b Suppose 1 = -3o + 5v, -10 = -4o + v - 0v. What is the biggest value in o, 0, -3/4? o Let w = -1 - -0.6. Let a = 15 + -17. What is the third biggest value in a, -0.2, w? a Let k = -162.4 + 162. Let d = -18 + 9. Let l = d - -5. Which is th	{ "pile_set_name": "DM Mathematics" }
7. Let m be z(6). Let c(q) = 4q2 - 5. Let v(h) = 5h*2 - 1 + 5h*2 - 13h*2 + 4h*2. Calculate mc(f) + 5v(f). f2 Suppose 2k = m + 11, 31 = -m + 5k + 11. Let g(y) = 2y*2 + 5y + 4. Suppose -3j - 6 - 3 = 0. Let i(w) = -w2 - 3w - 2. Calculate jg(c) + mi(c). -c*2 - 2 Let m(o) = -3o*2 - 5. Let z(q) = -3q + 13. Let v be z(7). Let f = 5 + -10. Let p = v - f. Let i(c) = -2c2 - 4. Give pm(b) + 4i(b). b2 - 1 Let y(i) = 2i + 8. Let o(j) = -6j - 25. Determine 3o(q) + 8y(q). -2q - 11 Let q(g) = g + 1. Let j(f) = f*2 - 5f + 3. What is -j(m) + 2q(m)? -m2 + 7m - 1 Let v(p) = 6p2 + 6p - 5. Let r(f) = -14f2 - 14f + 23. Let n(d) = -7d2 - 7d + 12. Let l(y) = -11n(y) + 6r(y). What is -5l(k) - 6v(k)? -k2 - k Let d(l) be the third derivative of l4/24 + 2l2. Let h(p) be the second derivative of p3/2 - p2/2 + 6p - 5. Calculate -5d(v) + h(v). -2v - 1 Let w be 3/12 - (-11)/4. Let s(h) = -7h2 + 14 + 3h - 20h + wh2 + h2. Let o(g) = g*2 + 6g - 5. Give 17o(f) + 6s(f). -f*2 - 1 Let w(o) = 22o - 12. Let q(h) = -7h + 4. Let f(d) = -10q(d) - 3w(d). Let g(i) = -5i + 5. Calculate 6f(p) + 5g(p). -p + 1 Let l(n) = n + 3. Let t = -7 + 2. Let s(p) = 1. Calculate ts(o) + l(o). o - 2 Let y(p) = -4p*3 + 4p*2 - 4p. Let r(l) = -l3 - l2 + l. What is 4r(j) + y(j)? -8j*3 Let l(x) = -x + 40. Let p(o) = o - 20. Calculate -3l(a) - 5p(a). -2a - 20 Let z(n) = n. Let g(p) = 3p + 1. Determine g(u) - z(u). 2u + 1 Let q(v) = -14v2 - 6. Let p(a) = 41a*2 + 17. Give -6p(g) - 17q(g). -8g*2 Let j(y) = -4y*2 - 3y - 3. Let n(x) = x*2 + x. Give -j(b) - 3n(b). b*2 + 3 Let z(l) = 29l*2 - 8l - 4. Let o(g) = -19g2 + 5g + 3. Give 8o(f) + 5z(f). -7f2 + 4 Let q(i) = 2i*2 - 3i + 1. Let f(u) = -2u2 + 3u - 2. Give -4f(y) - 5q(y). -2y2 + 3y + 3 Let o(z) = 7z2 + 1. Let n(j) = 2j*2 + 1. Let v(q) = -3q*2 - 1. Let r(h) = 5n(h) + 6v(h). Give -6o(w) - 5r(w). -2w*2 - 1 Let x(u) = 12u*3 - 32u*2 + 17. Let v(y) = 3y*3 - 8y*2 + 4. Give -9v(b) + 2x(b). -3b*3 + 8b2 - 2 Let r(q) = -q2 + 3q. Let c(h) = -h2 - h - 1. Let u(a) = 6 + 9a*2 - a + 0a + 0a - a. Let n(i) = -6c(i) - u(i). What is 3n(k) - 8r(k)? -k*2 Let a(i) = i - 1. Let v(r) = 4r + 6. What is 6a(l) + v(l)? 10l Let u(m) = 5m + 29. Let z be u(-5). Let i(h) = 3h + 3. Let f(w) = -4w - 4. Determine zf(s) + 5i(s). -s - 1 Let f(a) = 4a*3 - 2a*2 - 3a. Let z(q) = 5q3 - 2q*2 - 4q - 1. What is 4f(d) - 3z(d)? d*3 - 2d*2 + 3 Let m(b) = 7b*3 + 5b*2 - 5b - 2. Let d(p) = 3p3 + 2p*2 - 2p - 1. Let v = -3 - -8. Suppose -2n = -n + 2. Calculate nm(t) + vd(t). t3 - 1 Let c(j) = -7j + 5. Let d(s) = -9s + s + 4 + 2. Suppose 15 = -5x + n, 5x = 5n - 0n - 35. Let l be -2(3 - (x - -2)). Give lc(f) + 5d(f). 2f Let z(k) = -2k - 1. Let v be z(-2). Let i(d) = -4d + vd - 2d - d. Let r(s) = 3s. Give 4i(h) + 5r(h). -h Let s(v) = 4v3 - 5v*2 - 6v. Let c(r) = -r*2 - r. Determine -10c(a) + 2s(a). 8a*3 - 2a Suppose -4u = -14 + 6. Let x be 2/u(-9)/(-9). Let b(p) = -5p - 2. Let j(n) = -n. Give xb(f) - 4j(f). -f - 2 Let z(d) = -12d + 31d - 23d + 4. Let j(r) = -15r + 15. Give -6j(c) + 22z(c). 2c - 2 Let w(k) = 15. Let o(m) = m - 29. Determine 2o(l) + 5w(l). 2l + 17 Let p be 1/4 - 10/8. Let w(k) = -k2 + 4k - 2. Let l be w(3). Let q(h) = 2h2 - 3h2 - h2 + h. Let c(y) = y. Calculate lc(r) + pq(r). 2r2 Let t(w) = -8w. Let f = -87 - -82. Let z(s) be the second derivative of s*3/6 - s. Give fz(p) - t(p). 3p Let t(h) = 2h*2 - 4h + 1. Let b(j) = 2j + j + 0j - 2. Let n be b(2). Let a = n - 0. Let s(f) = 3f2 - 5f + 1. Determine as(w) - 5t(w). 2w2 - 1 Let g(u) = 36u*3 - 5u*2 + 5u - 5. Let y(l) = -54l3 + 7l*2 - 7l + 7. Determine -7g(t) - 5y(t). 18t3 Let j(q) = -21q. Let w(s) = 85s. Determine -17j(g) - 4w(g). 17g Let b(z) = -19z. Let h(o) = -9o. Calculate -2b(f) + 5h(f). -7f Let u(j) = -2j - 20. Let p(b) = -b - 7. What is -8p(s) + 3u(s)? 2s - 4 Let z(c) = 1. Let d(v) = -v2 - v + 8. Let j be (-63)/128/3. What is jz(t) + 2d(t)? -2t2 - 2t + 2 Let x(z) = z*3 - 2z + 2. Let k(w) be the first derivative of 3/2w2 - 1/4w*4 - 3w + 0w3 - 1. Let b be ((-8)/12)/((-1)/3). What is bk(n) + 3x(n)? n3 Let k(r) be the first derivative of -7r*2/2 - 2r + 47. Let f(v) be the second derivative of -2v3/3 - v2/2 + v. Determine 5f(n) - 3k(n). n + 1 Let g(j) = 4j*2 - 7j. Let a(o) = -11o2 + 20o. Let c = 7 - 13. Determine ca(p) - 17g(p). -2p2 - p Let z(i) be the third derivative of i3/6 - 15i*2. Let m(c) = -3c - 1. What is m(w) + z(w)? -3w Let w(s) = -s2 - 4s. Let p(c) be the third derivative of c*4/24 - 14c2. Give p(o) + w(o). -o2 - 3o Let f(b) = 36b*3 + 5b + 7. Let u(t) = -35t3 - 6t - 8. Calculate -6f(q) - 5u(q). -41q3 - 2 Let h(f) = f2. Let q(s) = -s2. Let l = 16 + -6. Suppose -l + 3 = -w. Determine wq(u) + 5h(u). -2u*2 Let o(n) = 4n*3 + 3n2 - n + 1. Let k(q) = q3 + q*2 + 1. Let y(z) = 14z*3 + 10z*2 - 3z + 5. Let w(x) = -2k(x) + y(x). Calculate 8o(s) - 3w(s). -4s*3 + s - 1 Let p(j) = -4j - 3. Let q(c) = 11c + 30 + c - 8 - 14. Calculate 8p(x) + 3q(x). 4x Let h(p) = 17p2 - 6p + 6. Let a(x) = 6x2 - 2x + 2. Determine 8a(z) - 3h(z). -3z2 + 2z - 2 Let i(p) = -p*3 + 5p*2 + 3p + 1. Let u(f) = -25f - 24f + 48f - 2f*2. Calculate 2i(o) + 5u(o). -2o*3 + o + 2 Let x(l) = -455l*2. Let a(j) = 19j*2. Calculate 143a(q) + 6x(q). -13q*2 Let a(b) = -41b + 2. Let g(y) = -83y + 3. Calculate -5a(c) + 3g(c). -44c - 1 Let a(r) = r. Let l(v) = -1 + 0 + 6v + 3 - 2v. What is -5a(t) + l(t)? -t + 2 Let v(q) = -q2 + q + 1. Let p(i) = i2 - 3i - 3. What is 2p(n) + 6v(n)? -4n2 Let o(z) = 14z - 4. Let q(w) = -42w + 11. What is -11o(l) - 4q(l)? 14l Suppose 6 = 4s - 2. Let h(j) = j2 - sj2 - j3 + 3 - j*3 - 1. Let m(w) = -10w*3 - 6w*2 + 11. Determine -11h(r) + 2m(r). 2r3 - r2 Let j(p) = p*2 - p - 1. Let o(f) = 9 + 0f + 2f + 4f + 3f - 10f*2. Calculate -36j(i) - 4o(i). 4i*2 Let i(m) = -2m - 29. Let x(n) = -n - 14. Determine -3i(u) + 7x(u). -u - 11 Let n(d) = -6d - 3. Let f(z) = -z - 1. Suppose s - 2 = 2. Let q be (-1 - 1)(-6)/s. Let w(h) = h*3 - 4h*2 + 3h - 4. Let i be w(q). Determine if(a) + n(a). -2a + 1 Let r(d) = -27d2 + 13. Let a(v) = -14v*2 + 7. Give 11a(h) - 6r(h). 8h*2 - 1 Suppose -l - 21 = 6l. Let q(c) = c*2 - 4c - 1. Let f(z) = 2z2 - 5z - 2. Calculate lf(g) + 4q(g). -2g2 - g + 2 Let z(o) = -24o*3. Let l(w) = -60w*3. Calculate 5l(n) - 12z(n). -12n3 Let k(d) be the first derivative of d - 14. Let f(g) be the third derivative of -g5/30 + g*4/24 - 5g3/6 - g2. Determine -f(b) - 6k(b). 2b*2 - b - 1 Let h(g) = -7g - 2. Let z(k) = -1. Give -h(j) + 3z(j). 7j - 1 Let w(b) = -8b - 5. Let i(h) = h + 1. Calculate 6i(u) + w(u). -2u + 1 Suppose 6r = 4r - 28. Let m(v) = -6v - 6. Suppose -3q + 4 + 1 = -k, -4q - 30 = -5k. Suppose 5h = kh + 25. Let w(d) = 2d + 2. Give hm(i) + rw(i). 2i + 2 Let a(m) = m + 5. Let w(y) = y + 4. Calculate -6a(i) + 7w(i). i - 2 Let k(t) be the second derivative of 4t*3/3 + 5t*2/2 + 7t. Let v(l) = 20l + 12. What is -12k(f) + 5v(f)? 4f Let u be (5 - 9)/((2 - 1) + 1). Let z(h) = 13h3 + 10h*2 + 7h - 7. Let n(g) = 4g3 + 3g*2 + 2g - 2. What is uz(o) + 7n(o)? 2o3 + o2 Let x(j) = 2j + 2. Let u(q) = 1. Give 2u(o) - x(o). -2o Let y(v) = -12v3 - 3v*2 - 5v + 3. Let u(g) = g3 + g2 + g - 1. Give 3u(h) + y(h). -9h*3 - 2h Let a(d) = -17d2 + 9. Let g(w) = 9w*2 - 5. Determine 4a(s) + 7g(s). -5s*2 + 1 Let u(w) = -2w*3 + 4w*2 - 5w - 6. Let q(m) = 3m3 - 5m*2 + 6m + 7. Let f be -1(-10)/(0 + -2). Determine fu(z) - 4q(z). -2z*3 + z + 2 Let c(j) = -20j + 4. Let x(b) = 20b - 3. Let k(p) = -3c(p) - 4x(p). Let l(d) = -d. Give k(t) - 16l(t). -4t Let x = -10 + 12. Let t(i) = -1. Let d(p) = 2p + 2 + 1 - p. What is xd(o) + 5t(o)? 2o + 1 Let p(l) = 37l*3 + 4l + 4. Let x(j) = 1148j3 + 123j + 123. What is -123p(c) + 4x(c)?	{ "pile_set_name": "DM Mathematics" }
-2)0. Suppose 4k - 10 = t, -k - t = -vk. Differentiate -2 - kh + 2 - 1 wrt h. -2 Let l(g) = -g*2 + 11g + 3. Let n be l(11). What is the first derivative of 6 - 4pn - 6 - 4 wrt p? -12p*2 Let x(n) be the third derivative of -11n*6/120 - 4n*3/3 + 17n*2. What is the derivative of x(g) wrt g? -33g*2 Find the third derivative of -10 + 4w*3 + 10 + 37w*2 - 56w3 wrt w. -312 Let h(o) be the first derivative of o7/70 - 7o4/24 - 7o*2/2 + 2. Let y(d) be the second derivative of h(d). Find the second derivative of y(l) wrt l. 36l*2 Let i(o) be the first derivative of -31o*5/5 + 40o + 18. Differentiate i(p) wrt p. -124p3 Let b(y) be the first derivative of 5y*3/3 + y + 1. What is the derivative of b(w) wrt w? 10w Let d(o) be the first derivative of o*6/6 - 22o*2 - 9. Find the second derivative of d(g) wrt g. 20g*3 Let a(p) be the second derivative of 5p*4/12 + 17p*2/2 + 16p. Differentiate a(k) with respect to k. 10k Let a(i) be the third derivative of -3i*6/40 - 5i*4/6 + 38i*2. Find the second derivative of a(r) wrt r. -54r Let a be 0 - (-3 + 4)-1. Let x be 10/8(3 - -1). Let p(t) = t*3 + 8t. Let g(v) = -v. Let d(j) = ap(j) + xg(j). Find the second derivative of d(h) wrt h. 6h Let d(a) be the first derivative of 3a*4/2 - 22a + 9. Find the first derivative of d(z) wrt z. 18z2 Find the third derivative of 5p*4 + 0p*4 + 4p*2 + 3p*4 wrt p. 192p Suppose 5q - 4z - 2 = 0, 0 - 4 = 5q - 2z. Let n be q/7 + 32/14. Find the first derivative of -2s + 1 + 2s + 2sn wrt s. 4s What is the third derivative of -10z6 + 27z2 + z6 - 6z6 wrt z? -1800z*3 Let b(t) = -3t*2 + 2t*2 + 0t*2. Let c(w) = 7w*2 - 3. Suppose 0 = 3h + 4 - 1. Let i(p) = hc(p) - 6b(p). Differentiate i(x) wrt x. -2x Let c(v) = v3 + 7v*2 + v + 10. Let w be c(-7). Suppose 0 = -i + w - 1. What is the third derivative of 5y*i - 4y2 + y6 + 0y6 wrt y? 120y3 Let n(u) be the third derivative of u7/5040 - u6/360 + u5/20 + 3u2. Let y(l) be the third derivative of n(l). Find the first derivative of y(j) wrt j. 1 Let d(r) be the third derivative of r6/360 + r4/24 + r3/3 + 3r*2. Let i(l) be the first derivative of d(l). What is the derivative of i(h) wrt h? 2h Suppose -3z + 8y = 3y + 9, -5z + 25 = 5y. What is the third derivative of -5u*5 - 2u*2 - 3u2 - uz wrt u? -300u2 Suppose 2x - 26 = -4g, -3x + 2g - g = -11. What is the third derivative of 2j*2 + 2j*2 - 19j*5 + 14j*x wrt j? -300j*2 Let c be (2/(-2))/((-5)/15). Let w(l) be the second derivative of 0l*c + l + 0 - 1/10l*5 + 1/2l*2 + 0l*4. What is the first derivative of w(a) wrt a? -6a*2 Let d(o) be the third derivative of 7o*6/40 - 25o*3/6 + 5o*2 - 6. What is the first derivative of d(n) wrt n? 63n*2 Let y(q) = 2 - 3q*2 + 0 - 2q + 5q. Let h(t) = -t3 - 5t*2 + 5t + 4. Let g(o) = -3h(o) + 5y(o). Differentiate g(z) wrt z. 9z2 Let x(p) be the third derivative of -19p*5/60 + 13p*3/3 + 5p*2. What is the derivative of x(k) wrt k? -38k Let m(y) be the first derivative of -y5/30 + y4/6 - y3/3 + 3. Let f(b) be the third derivative of m(b). Differentiate f(p) with respect to p. -4 Let a(f) = f3 + 6f2 - f - 1. Let c be a(-6). Let y = -1 + c. Find the second derivative of -4q*4 - 3q*y + q + 5q*4 wrt q. -24q*2 Let i(x) = 9x2. Let w(h) = -h2 + 1. Let j(f) = -i(f) - 2w(f). What is the derivative of j(g) wrt g? -14g Let u(g) = 2g2 + 2g + 9. Let q(k) = 6k2 + 7k + 27. Let y(i) = 2q(i) - 7u(i). What is the first derivative of y(o) wrt o? -4o Differentiate t2 + 2t*2 + 0t*2 - 1 - 7 with respect to t. 6t Let t(v) be the first derivative of 31v4/4 - v3/3 - 16v + 21. What is the third derivative of t(m) wrt m? 186 Let a(x) = x + 2. Let k be a(11). Let z = -3 + k. Find the third derivative of -2n6 + 0n*6 + zn*2 - 7n*2 wrt n. -240n*3 Suppose -2 = 2i, -2w - 2i - 7 = -5. Suppose -4b + v + 6 = -w, 0 = -5v - 10. Find the first derivative of -p3 + 0 - b - p3 - 3 wrt p. -6p2 Let w(a) = 24a*3 + 3a*2 - 47a + 3. Let q(f) = 72f3 + 8f*2 - 141f + 8. Let i(d) = -3q(d) + 8w(d). What is the second derivative of i(l) wrt l? -144l Let r(y) = -y3 + 2y*2 + 2y - 2. Let t be r(2). Suppose -5g + 18 = -t. What is the second derivative of -f4 + 2f - f*g - 4f wrt f? -24f2 Let b(z) be the second derivative of -z4/6 - 2z3/3 + z. Let l(s) = s2 + s. Let u(g) = -2b(g) - 6l(g). What is the second derivative of u(r) wrt r? -4 Let f(q) = q - 1. Let i(g) = g. Let z(x) = -6f(x) + 15i(x). What is the derivative of z(y) wrt y? 9 Let y(f) be the third derivative of -f*5/6 - 41f*3/6 + 9f*2. Differentiate y(v) wrt v. -20v Let s = -6 - -8. Find the first derivative of 27 + i - 29 + si wrt i. 3 Let a(z) be the second derivative of z6/15 + 7z*3/6 + 2z. Find the second derivative of a(n) wrt n. 24n2 Let m(h) = 3h*3 - 10h2 - 4. Let x(s) = s3 - s*2 - 1. Let l(u) = m(u) - 4x(u). Find the third derivative of l(d) wrt d. -6 Let c(w) be the first derivative of w3/6 - w2 - 2w + 1. Let t(y) be the first derivative of c(y). Differentiate t(h) wrt h. 1 Find the third derivative of 1170q*3 + 14q4 - q2 - 1170q3 wrt q. 336q Let j(p) be the third derivative of 2p7/105 + 7p*6/120 + 9p*4/4 + 2p*2 + 2p. What is the second derivative of j(c) wrt c? 48c2 + 42c Let p(u) be the first derivative of -5u7/7 + 8u*3/3 - 20. Find the third derivative of p(o) wrt o. -600o*3 Let x(t) = 3t*3 + 11t - 4. Let j(q) = 4q3 + 10q - 3. Let k(o) = 4j(o) - 3x(o). What is the second derivative of k(s) wrt s? 42s Suppose -4d + 2 = -5u, 3u + 5d + 5 - 26 = 0. Let z = 2 + 1. What is the first derivative of -2 - 3 + uq*4 + z - 3q*4 wrt q? -4q3 Let f = 6 - 4. What is the second derivative of -yf + y - 10 + 10 wrt y? -2 Let z(y) = 3y + 4. Let i be z(3). What is the third derivative of -6o*2 + 13o - io - 7o*6 wrt o? -840o*3 Suppose 0 = f + 2a - 3, 0a + 26 = 5f - a. What is the second derivative of -4k + 3k - 4k5 + 2k*f wrt k? -40k*3 Let u(a) be the first derivative of 7a*4/4 + 9a - 9. Differentiate u(g) with respect to g. 21g2 What is the second derivative of -30 + 2o + 2o2 + 30 wrt o? 4 What is the third derivative of -13u*2 - 15u*2 + 19u*2 - 5u*6 wrt u? -600u*3 Let t(u) = -2u - 12. Let d be t(-7). Let r(g) = 9g2 - 13. Let w(v) = 4v*2 - 7. Let i(c) = dr(c) - 5w(c). Differentiate i(m) with respect to m. -4m Let f(j) be the first derivative of j*4/2 - 6j*2 + 10. Find the second derivative of f(u) wrt u. 12u Let x(n) be the second derivative of -17n5/10 + 15n*3/2 + 44n - 1. What is the second derivative of x(s) wrt s? -204s Let f be 2/2(4 + 1). Suppose -4r + 10 = -3t + 1, fr = -3t + 18. Differentiate -j*r + 2j*3 - 2 + 3 wrt j. 3j*2 Suppose i = -4i - 2j + 21, i - 4j + 9 = 0. Find the third derivative of 2z2 - 2z*6 - 8z*3 + 8z*i wrt z. -240z*3 Let j = -18 - -20. What is the second derivative of ju*3 - 6u*3 - 4u + 2u3 - u3 wrt u? -18u Let m(w) be the first derivative of 0w5 - 1/3w*6 + 0w*4 + 0w - 3 + 0w2 + 5/3w*3. What is the third derivative of m(p) wrt p? -120p*2 Let s(z) be the first derivative of -16z*5/5 - 9z + 33. What is the first derivative of s(i) wrt i? -64i3 Suppose -4g = -37 - 3. Suppose 4z + g = 2d + 2, 3z = -5d + 7. Find the second derivative of -5h2 + 3h*2 + dh*2 + 2h + 3h5 wrt h. 60h3 Let t(y) = -y3 - y*2 - 2. Let h be t(-2). Suppose 3v + 2w - 12 = 0, 5v - 2w - 20 = 2w. What is the third derivative of -2o2 - ho*6 + 4 - v wrt o? -240o*3 Let f(y) = 36y*3 + 23y*2 - 17y - 66. Let b(n) = 12n3 + 8n*2 - 6n - 22. Let a(h) = 17b(h) - 6f(h). Find the first derivative of a(u) wrt u. -36u2 - 4u Let x(p) = p*2 - p - 2. Let n be x(-2). Find the second derivative of -j - 2j*3 + nj3 - j3 wrt j. 6j Let t(f) be the third derivative of -31f*5/30 - 5f*4/24 - 12f2. What is the second derivative of t(w) wrt w? -124 Let n(a) = a3 + 14a2 + 12a - 10. Let g be n(-13). Find the third derivative of -2o*3	{ "pile_set_name": "DM Mathematics" }
+ 5q, m + 0q + 7 = -3q. Let o(l) = -2l + 16. What is mo(i) + 16w(i)? 6i Let k(m) = 2m*3 + 4m*2 - 4. Let g(p) = 3p*2 - 2p - 10. Let w be g(-3). Let z = w - 27. Let d(n) = 4n3 + 7n*2 - 7. Determine zd(u) + 7k(u). -2u*3 Let n(h) = 37h - 7. Let m(i) = -3. What is -m(b) - n(b)? -37b + 10 Let n(k) = 8k*3 + 6k*2 + 6k - 9. Let v(u) = -u3 - u2 - u + 1. Let d be (33 - 35) + 4-1. Give dv(c) - n(c). -2c3 + 3 Let d = -254 + 261. Let p(l) = 2l*3 - 3. Let w(u) = -4u3 - u2 + 7. Calculate dp(c) + 3w(c). 2c3 - 3c*2 Let h be ((-10)/(-6) + 1)(-144)/96. Let b(i) = -i. Let k(f) = -4f2 - 4f - 1. Determine hb(t) + k(t). -4t*2 - 1 Let i(t) = 6t - 15. Let n(q) = -3q + 16. What is 3i(z) + 4n(z)? 6z + 19 Let a = -107 + 102. Let s(q) = 6q. Let h(z) = 15z. Give ah(r) + 12s(r). -3r Let g(w) = -10w*3 + 5w + 18. Let l(x) = 15x3 - 7x - 27. Give 7g(p) + 5l(p). 5p3 - 9 Let o(g) = -44g*2 - 5g + 4. Let r(j) = -45j2 - 5j + 5. Determine 5o(k) - 4r(k). -40k2 - 5k Let v(b) = 6b + 289. Let r be v(-47). Let y(t) = 3t*2 + 4t - 4. Let s(p) = -5p2 - 7p + 7. Determine ry(n) + 4s(n). n*2 Let g(a) = 3876a - 153. Let o(d) = 102d - 4. What is 4g(m) - 153o(m)? -102m Let v(o) = 30o3 + 37o*2 - 7. Let b(l) = -10l*3 - 12l*2 + 2. What is 7b(w) + 2v(w)? -10w*3 - 10w*2 Let r = -14 + 2. Let x be r/(-10)(-140)/(-21). Let n = -14 + x. Let t(d) = d. Let m(q) = -q*3 + 2q. What is nt(b) + 3m(b)? -3b3 Let x(l) be the first derivative of l2/2 + l + 270. Let q(o) = o2 - 5o - 5. Give q(n) + 5x(n). n2 Let b(m) = 53m*3 + 5m*2 - 5m + 11. Let z(o) = 26o3 + 3o*2 - 3o + 6. Determine 3b(k) - 5z(k). 29k3 + 3 Let h(n) = -n2 + 2n + 2. Let r = -6 + 2. Let o(v) = -4v2 + 3v + 6. Let z(l) = -11l2 + 9l + 17. Let x(d) = -8o(d) + 3z(d). What is rx(m) + 5h(m)? -m*2 - 2m - 2 Let w(g) = 5. Let o(f) = f*2 + 9f - 30. Let n be o(-12). Suppose nh - 21 = 9. Let y(b) = -b - 4. Calculate hy(d) + 4w(d). -5d Let f(k) = -14k2 + 17k - 773. Let u(o) = -5o2 + 6o - 257. Give -6f(g) + 17u(g). -g*2 + 269 Let r(m) = -4m*3 + 9m - 11. Let o(s) = 2s3 - 5s + 6. Let h be ((-6)/9)/(4/(-36)-3). Let d = -5 + h. Calculate do(c) - 4r(c). 2c*3 - c + 2 Let k(d) = 6d - 9. Suppose 5 = 3h + 2i, -3h = -0i - 2i - 13. Let r(o) = -54 + 26 + 24 + ho. Calculate -2k(q) + 5r(q). 3q - 2 Let k(f) = f - 4. Let w = 608 - 607. Let p(z) = -1. Calculate wk(n) - 3p(n). n - 1 Let g(i) = 6i + 1. Let u(a) = -6a + 2. Let b(r) = -1. Let s(n) = -3b(n) - u(n). What is -3g(p) + 4s(p)? 6p + 1 Let k(n) = n2. Let o(b) = 2b*3 + 5b*2 - 3. Suppose -44v - 4z + 12 = -48v, -3z = 0. Give vk(q) + o(q). 2q3 + 2q*2 - 3 Let d(b) = 291b + 105. Let g(v) = -5. Calculate -2d(n) - 42g(n). -582n Let y = -275 - -270. Let w(x) = 5x + 5. Let n(l) = -9l - 10. Determine yw(j) - 3n(j). 2j + 5 Let q(i) = 5i3 - 6i*2 - 6i + 4. Let k(m) = 4m3 - 5m*2 - 7m + 4. Give 4k(z) - 3q(z). z*3 - 2z*2 - 10z + 4 Let o = 692 + -703. Let u(m) = -9m + 4. Let h(z) = -10z + 3. Let j(s) = 3h(s) - 4u(s). Let g(n) = 17n - 20. Give oj(x) + 4g(x). 2x - 3 Let h(b) = 6b2 - 9b + 13. Let j(g) = 8g2 - 13g + 19. Determine -7h(u) + 5j(u). -2u2 - 2u + 4 Let a(o) = 19o + 11. Let n(d) = 5d + 3. Let x(m) = 23m + 14. Let z(r) = -11n(r) + 2x(r). Determine 4a(k) + 9z(k). -5k - 1 Let h = 38 - 36. Let m(g) = -3g2 + 256 + 2g - 258 + 0gh + g. Let v(r) = -3r*2 + 4r - 3. Give -3m(x) + 2v(x). 3x2 - x Let f(g) = g2 + g + 1. Let n(x) = 11x*2 + 5x + 7. What is -10f(t) + 2n(t)? 12t2 + 4 Let f(w) = w2 + 9w - 13. Let p(v) = -2v2 - 19v + 27. Give -13f(o) - 6p(o). -o*2 - 3o + 7 Let r(s) = -157740s2 - 4063s + 4063. Let d(z) = 233z2 + 6z - 6. Calculate -4063d(f) - 6r(f). -239f2 Let x(f) = -51f*3 - 21f*2 + 21f - 21. Suppose 4 = -117u + 116u. Let g(k) = -10k3 - 4k*2 + 4k - 4. What is ux(h) + 21g(h)? -6h3 Suppose -4a + y = -16, -5y = -6y - 4. Let v(n) = 6n2 - 5n + 11. Let x(b) = -2b2 + 2b - 4. Calculate av(o) + 8x(o). 2o2 + o + 1 Let k(w) be the third derivative of 7w*2 - 1/6w*3 + 0w + 0 - 1/8w4. Let p(r) = -r. Let m(d) = d2 + 7d - 1. Let s be m(-7). What is sk(c) + 2p(c)? c + 1 Let q(p) = 37p - 2. Let f(r) = 78r - 5. Determine -2f(t) + 5q(t). 29t Let l(v) = 3v3 + v2 + v + 1. Let b = 600 - 601. Let m(c) be the first derivative of c4/4 - c3/3 - c*2/2 - c - 1. Give bm(o) - l(o). -4o3 Let q(j) = 5j*2 - j + 2. Let f(v) = 3v*2 - v + 1. Let z be (-42 - -35) + 0 + 1 + 14. Give zf(g) - 5q(g). -g2 - 3g - 2 Let l(t) = 7t3 + 2t. Let n(x) = -2015x3 - 40x*2 - 665x. Let r(h) = 155h3 + 3h*2 + 51h. Let c(s) = 3n(s) + 40r(s). Determine 4c(z) - 90l(z). -10z3 Let a(r) = 3r + 60. Let q(b) = b - 1. Give -a(v) + 4q(v). v - 64 Let o(j) = -8j*3 - 7j2 - 8. Let s(y) = y3 + y*2 + 1. Suppose -3k + 98l - 102l = 35, 0 = 2k + 4l + 30. What is ks(h) - o(h)? 3h*3 + 2h*2 + 3 Let n(c) = -4c*3 + 12c. Let j(y) = 9y + 5y - 24y + 11y. Calculate -12j(o) + n(o). -4o*3 Let n(a) be the third derivative of 0a + 3/2a3 - 1/3a*4 + 21a*2 + 0. Let x(w) = -9w + 10. Give -7n(m) + 6x(m). 2m - 3 Let g(f) = f + 1. Let z be 17/102 + 2(-37)/12. Let x(o) = -8o - 10. Calculate zx(j) - 60g(j). -12j Let p(x) = 5x3 + 6x*2 + 7x - 2. Let w(n) = -10n - 13n*2 - 5n - 11n3 + 3 + 1. Let k = 223 + -210. Calculate kp(h) + 6w(h). -h3 + h - 2 Suppose 0 = -5d - n - 40, d + n + 9 = -3. Let c(z) = -3z2 + 7z + 6. Let g(m) = m*2 - 2m - 2. Let w = -52 + 50. Calculate dg(o) + wc(o). -o*2 + 2 Let c(w) = -10w*2 + w + 53. Let a(x) = 18x*2 - x - 106. What is -4a(t) - 7c(t)? -2t*2 - 3t + 53 Let f(b) = 12b3 - 2. Let p(l) = 120l*3 + 15l*2 - 22. Let y(c) = 60c*3 + 9c*2 - 11. Let v(o) = 3p(o) - 5y(o). Give 11f(m) - 2v(m). 12m*3 Let g(w) be the first derivative of -2w - 743. Let a(f) = f - 1. Calculate -8a(y) + 4g(y). -8y Let p(r) = -29r + 12. Let b(k) = 15k - 6. Give -9b(h) - 4p(h). -19h + 6 Let u(r) = r3 - r2 - r + 3. Let w(j) = 146j3 + 9j*2 + 4j - 18. Determine -6u(t) - w(t). -152t*3 - 3t*2 + 2t Let u(n) = 4n3 + 3n*2 - n - 1. Let t(z) = 7z*3 + 5z*2 - z - 2. Suppose 5c + 37 = -43. Let y = c + 21. What is yu(p) - 3t(p)? -p*3 - 2p + 1 Let q(g) = -g*2 + 1. Let n(t) = -3t2 - t + 4. Let o(w) = -w3 - 17w2 - 13w + 52. Let b be o(-16). Determine bq(p) - 2n(p). 2p2 + 2p - 4 Let t(b) = -5b3 - 2b*2 + 5b + 6. Let j(r) = -16r3 - 6r*2 + 14r + 17. What is -6j(x) + 17t(x)? 11x3 + 2x*2 + x Let r(b) = -b + 0b + 2b. Let h(w) = w + 1. Suppose -4p - 13n + 12n + 9 = 0, 0 = -4n + 4. What is ph(q) - 3r(q)? -q + 2 Let y(o) = -8o3 - o2 - 8o - 7. Let n(b) = -13b*3 - 7b - 6. Determine -7n(s) + 6y(s). 43s3 - 6s*2 + s Let f(z) = -3. Let g(s) = -s + 6. Let m(o) = -2f(o) - g(o). Let i(q) = -4q + 6. Give -i(d) - 6m(d). -2d - 6 Let v(f) = -f2 + 2f + 2. Let p(t) = 30t2 - 50t - 65. Determine p(w) + 25v(w). 5w*2 - 15 Let u(v) = -44v*2 + 19v. Let d(m) = -132m2 + 60m. Give 5d(i) - 16u(i). 44i2 - 4i Let v(t) = 5t + 4. Let d(n) = -4n - 3. Let l be (-3 + 1)/1 - -18. Suppose o = 5o + l. Suppose 3k + y = -14, 12 + 13 = -5y. Give kv(x) + od(x). x Let s(a) be the third derivative of -a6/120 + a5/60 - 42a*2. Let t(y) = -10y*3 + 6y*2. Calculate -6s(r) + t(r). -4r3 Let q be -1 + 2 + (-4)/(-1)-1. Let i be (5/(-4))/(2/(-8)). Let r(a) = -3a - 3. Let h(g) = g2 - 5g - 5. Give ir(n) + qh(n). -3n2 Let y(x) = x2 - 1. Let s(h) = 2h*2 - 102h - 3. Determine s(v) - y(v). v*2 - 102v - 2 Let c(t) = -t*2 - 3t. Let z(h) be the first derivative of -h*3/6 + 10h + 20. Let m(d) be the first derivative of z(d). Give -2c(v) + 7m(v). 2v2 - v Let f(m) = 50m + 5. Let g(y) = -2y - 1. Give -f(x) - 6g(x). -38x + 1 Let d(n) = -5n*3 - 3n*2 - 4n - 2. Let a(y) = -11y3 - 7y*2 - 9y - 5. Give -4a(r) + 9d(r). -r3 + r2 + 2 Let q(m) = 8m - 14. Let t(s) = 15s - 26. Let c(l) = 5q(l) - 3t(l). Let k(r) = -r + 1. De	{ "pile_set_name": "DM Mathematics" }
Suppose 4 = k - 5v, k + v + 10 = 26. Is 11 a factor of k? False Suppose -5g + 15 = -15. Let y = 15 + g. Is y a multiple of 10? False Suppose 3 + 13 = f. Is 7 a factor of f? False Let v(g) = g2 + 8. Let c(m) = -m2 - 8m + 13. Let q be c(-10). Does 13 divide v(q)? False Let a(f) = 2f*2 - 5f - 3. Suppose -6d = -4d - 8. Is a(d) a multiple of 3? True Let y = 4 - -14. Does 9 divide y? True Let k = 20 + -8. Does 4 divide k? True Is 11 a factor of 33/2 - 3/(-6)? False Let r(q) = q*3 + 6q*2 + 6q. Let h be r(-5). Does 6 divide 4/(-20) + (-81)/h? False Suppose 2r + 0h - 5 = 3h, -3r + h = -11. Suppose 0 = -x + 5k + 16, 3x - 5x + 20 = -rk. Is (x/(-4))/(6/(-32)) a multiple of 8? True Let m(z) = z3 - z2 - z + 25. Does 12 divide m(5)? True Suppose -8k = -5k - 156. Does 25 divide k? False Let b(m) = m + 0m - 2m. Let l be b(0). Suppose 0 = 3y - ly - 21. Is 7 a factor of y? True Let y = 32 + 21. Suppose 0 = 5z - 7 - y. Is 7 a factor of z? False Let n be (-33)/4 - (-1)/4. Let x(h) = -h3 - 7h*2 + 2h + 7. Let s be x(n). Suppose -2b = 3b - s. Is b a multiple of 5? False Suppose z + c - 18 = -1, 36 = 2z + 4c. Does 2 divide z? True Suppose 2b + 3 + 3 = 4t, t = -5b - 4. Is (1 - 12)1/b a multiple of 3? False Suppose -3l + 28 = -53. Let m = 53 - l. Is m a multiple of 13? True Does 29 divide (3 - -258) + -7 + 7? True Let t = -4 - -2. Let q(w) = 3w*2 - w + 1. Is 15 a factor of q(t)? True Suppose 2l + 52 = -2l - 4d, -5l = -2d + 79. Does 7 divide (-144)/l - 2/(-5)? False Suppose 0b - 2k - 36 = -4b, 3b - 3k - 27 = 0. Does 6 divide b? False Suppose -6 = o - 4o. Suppose 0 = -4y + 4d + 88, 2y + 0d = -od + 56. Is y a multiple of 10? False Let v = 565 + -325. Is 27 a factor of v? False Suppose 0u + u = 2. Suppose -ub + 72 = 2b. Is b a multiple of 18? True Suppose 0b - 4b = -660. Suppose 9 = 2r - b. Is r a multiple of 29? True Suppose 2p + 2d - 104 = 0, -2d = -2p + 45 + 71. Suppose h + 2j - 2 = 0, 5h + 4j = 3j + p. Is 4 a factor of h? True Suppose 2l - l = 88. Is l a multiple of 21? False Let f = 80 + -59. Does 7 divide f? True Let o be (-1)/1511. Is (-2540)/o + (-4)/22 a multiple of 23? True Let v(q) = q*2 + 4q - 2. Let f be v(-5). Suppose 2b - 34 = -z + fb, -4 = b. Is z a multiple of 15? True Suppose -4j - 16 = 0, 0 = 4l - 2l + 5j - 190. Is l a multiple of 21? True Let v = 134 + -108. Does 26 divide v? True Let t(b) = -b*3 + 13b*2 - 8b - 15. Is 17 a factor of t(12)? False Let a = -62 - -88. Suppose a + 3 = l. Is l a multiple of 12? False Suppose 116 - 24 = 4l. Does 8 divide l? False Is (-2 - -6)((-22)/8)/(-1) a multiple of 2? False Suppose 4g + 5a = 14, 0 = g - 0a - 2a - 10. Let r be (-3 - -4)/(2/g). Is 4 - 1 - (r + -2) a multiple of 2? True Suppose -21 = 2r - 5r. Suppose 3p + 24 = rp. Is p a multiple of 6? True Is (84/(-35))/(9/(-30)) a multiple of 2? True Suppose 0 = -3y + 15. Suppose 24 = g - 0g - yd, 3g = -4d + 129. Is 13 a factor of g? True Suppose -4m + 6 = -3l, 3l - 7l + 3m - 1 = 0. Let i be l/(-3)-6 - -1. Suppose 5z = -c + 2z + 15, ic = -5z + 35. Does 3 divide c? True Suppose -3y + 5 = -2y. Suppose 4 = 3j - y. Is j a multiple of 3? True Let w be (-3 + 145)(-4)/(-8). Suppose 2f - w = -z, -4f = 3z + 52 - 269. Is 25 a factor of z? True Let s(m) = m*3 + 6m*2 + 2m + 4. Is s(-4) a multiple of 8? False Let h(x) = 5x - 35. Is 3 a factor of h(11)? False Let c = -36 + 25. Let y = 13 - c. Suppose -y = -2z - z. Is z a multiple of 8? True Is 11 a factor of (-2)/10 + (-112)/(-10)? True Suppose -4 = -3y + 2. Suppose 44 + 44 = 3i - yr, 2r + 32 = i. Does 11 divide i? False Is ((-2)/4)/(4/(-40)) a multiple of 3? False Let d = -23 - -263. Suppose 5y = 2y - d. Does 10 divide (3/(-2))/(6/y)? True Suppose -3z + 82 = 4q - 65, 0 = -5q. Is 7 a factor of (-14)/z - 100/(-7)? True Let k(j) = -j3 + 4j*2 + 6j - 2. Let a be k(5). Suppose 5w - 14 - 9 = -ad, -5d + 9 = w. Suppose -2 = -s + d. Does 3 divide s? True Suppose -3 = -0u - u. Suppose 5g = ug - 40. Let s = -7 - g. Is s a multiple of 4? False Let l(u) = -u*2 + 15u + 13. Does 2 divide l(15)? False Let b(d) = -3d + 4. Let u be b(3). Suppose -6j + 5j - 34 = 0. Let t = u - j. Is t a multiple of 18? False Let x(m) = -2 + 5m*2 + 7m - 7m. Is 9 a factor of x(2)? True Is 22 a factor of 4(5 - 222/(-4))? True Let r = 17 - -70. Is r a multiple of 19? False Suppose -2i - 7b = -3b + 94, -3b + 243 = -4i. Let s = i + 26. Let a = s + 64. Is 17 a factor of a? False Let p(i) = -i3 + i2 - 3i + 2. Let h be p(2). Let g be -1 + -18 + (-1)/(3/(-6)). Let w = h - g. Is w a multiple of 7? False Let y = -187 - -363. Is y a multiple of 16? True Let t = -67 + 112. Does 15 divide t? True Let b(h) = -2h - 5. Let d be b(-4). Suppose -dl - i + 80 = -2i, 3i = -2l + 68. Is 16 a factor of l? False Suppose -2t = -4p + 10, p + 4p - 2t - 15 = 0. Suppose 5k = pm - 120, -98 = -4m + 4k - 2k. Is m a multiple of 17? False Let c(j) be the second derivative of 4j2 - 1/6j*3 + 2j + 0. Does 14 divide c(-6)? True Let u(y) = -21y2 + 20y*2 - 6y*3 + y + 0y - 3y. Is 16 a factor of u(-2)? True Let i(x) = x3 - 16x*2 + x + 9. Is i(16) a multiple of 16? False Suppose -1 - 1 = k, x = -3k - 14. Let m be 309/(-12) - (-2)/x. Let p = 43 + m. Does 7 divide p? False Does 5 divide 4/6 + 399/9? True Let x be ((-8 - -2) + -2)-1. Suppose -2f + x = -0f. Suppose i - 13 = -n, -i - fi - 35 = -5n. Is 10 a factor of n? True Let z(y) = y2 + 36. Suppose 0 = -0f - 2f + 4. Suppose -ft = 3t. Is z(t) a multiple of 14? False Let c be 3(-3)/3-1. Suppose w = -cz + 15, -2w - 2w + 4z = -60. Is 12 a factor of w? False Suppose 3o + 8 = 5o. Let w be 3/(2/o + 1). Suppose -27 = -wb - r, 0 = 3b + 5r + 13 - 50. Is 7 a factor of b? True Let w = -21 - -36. Suppose 2r + 30 = 3g + 3r, 5r = -w. Is 7 a factor of g? False Let y = 85 + -82. Let n(q) = 5q + 4 + 5q - 4q. Is n(y) a multiple of 22? True Let r = 113 - 56. Is r a multiple of 19? True Is 8 a factor of (-8)/14 - 729/(-63)? False Let a(n) = -2n*2 - 8n + 2. Let r(c) = 3c2 + 9c - 1. Let q(d) = 4a(d) + 3r(d). Let j(g) = g + 2. Let x be j(5). Is q(x) a multiple of 11? False Let u(m) be the first derivative of 2m + 0m*3 + 1/2m*4 + 0m*2 + 2. Is 16 a factor of u(2)? False Let y be 2/10 - (-4)/5. Let s = y - -2. Is 3 a factor of s? True Suppose -3q = -3o - q + 16, -4o + 18 = -q. Suppose -5i = -2i + om - 94, 3i = 3m + 87. Does 5 divide i? True Let i(q) = 28q3 - q2 + q. Let t be ((-1)/(-1))/(0 + 1). Does 28 divide i(t)? True Let g = 410 - 276. Suppose t = 3t - 2s - 192, -5t - 3s + 464 = 0. Let q = g - t. Is 20 a factor of q? True Let j = -24 + 12. Let k(f) = f*2 + 12f + 6. Does 2 divide k(j)? True Let l(j) = -15j. Is 8 a factor of l(-2)? False Let r(k) be the second derivative of k4/12 - k3/2 - 5k*2/2 - k. Does 11 divide r(7)? False Suppose -3t + n = 5, -2t + 4n + 2 = 22. Let b(v) = -v*2 + v + 5. Let x be b(t). Suppose 5i - 128 = -4s, -2i + 125 = 3i + xs. Does 18 divide i? False Suppose 3m + 13 = -5g + 377, 4g = 3m - 373. Is 10 a factor of ((-6)/(-9))/(2/m)? False Let p = -62 + 115. Let u = 42 - 73. Let g = p + u. Does 11 divide g? True Let h(i) = 2i2 + 2i - 4. Suppose -3m = -2o - 7, 0m = -m - 3o + 17. Let d = -8 + m. Does 4 divide h(d)? True Suppose -65 = 2u - 185. Is 16 a factor of u? False Suppose -i - 4j = 3i - 108, 4j = -2i + 60. Is i a multiple of 5? False Let z be (-4)/6 - 16/(-6). Suppose 8 = 3p - 5g - 32, -5g + 5 = 0. Is 5 a factor of pz(-2)/(-12)? True Let x(b) = 5b2 - 6b - 7. Is x(4) a multiple of 22? False Suppose 0 = 5i + 9 + 1. Is i/(-9) + (-710)/(-45) a multiple of 16? True Let z = 12 - 8. Suppose 0 = -zc + 5c - 37. Is c a multiple of 13? False Let m be 2/(-9) + 28/(-36). Let u be 3 + (1 + m)/(-3). Suppose 38 = 3i - p + 14, 0 = -ui - p + 18. Does 7 divide i? True Suppose -10 + 3 = b. Let c = -5 - b. Suppose -26 = -z - 2t, cz + t - 63 = -z. Does 7 divide z? False Let j(d) = 3d*3 + 4d*2 - 6d - 2. Let n(g) = 4g3 + 3g*2 - 7g - 1. Let h(a) = -5j(a) + 4n(a). Is h(8) a multiple of 7? False Suppose 3q = -q - a + 17, 21 = 4q + 5a. Suppose 6 = qj - 6. Suppos	{ "pile_set_name": "DM Mathematics" }
f(k) be the first derivative of -1/5k2 + 4 + 2/5k - 2/15k3 + 1/10k4. Let f(d) = 0. What is d? -1, 1 Let n(t) be the third derivative of t5/24 + 45t4/16 + 275t*3/6 - 227t*2. Factor n(o). 5(o + 5)(o + 22)/2 Let o(a) be the first derivative of -5a*4/4 + 20a*3/3 - 25a*2/2 + 10a + 69. Find s, given that o(s) = 0. 1, 2 Let j(i) = -4i3 - 6i - 5. Let t(n) = 3n3 + n2 + 5n + 4. Let c(h) = 2j(h) + 3t(h). Let s(d) be the first derivative of c(d). Factor s(g). 3(g + 1)2 Let a be (-9)/((-720)/256) - 1/5. Let s(h) be the second derivative of -1/12h*4 + 0 + 5h - 2/3ha + 0h*2. Factor s(w). -w(w + 4) Let x = 8875 + -35499/4. Factor x + 1/4p - 1/4p*2 - 1/4p*3. -(p - 1)(p + 1)2/4 Let f(s) be the third derivative of -s5/180 + 13s4/72 + 167s*2. Factor f(j). -j(j - 13)/3 Let x be (10/3)/(21/(-252)-24). Determine v so that 1/3 - xv + 4/3v2 = 0. 1/4, 1 Let i(j) = -8j*4 + 12j*3 + 40j*2 - 96j + 36. Let q(c) = c4 - c2 + c + 3. Let z(p) = i(p) + 4q(p). Factor z(u). -4(u - 4)(u - 1)2(u + 3) Let d(i) = -9i3 - 176i*2 - 2128i - 7840. Let s(w) = 8w3 + 177w*2 + 2121w + 7840. Let u(o) = -3d(o) - 4s(o). What is y in u(y) = 0? -14, -8 Factor 8h5 + 7032h*3 - 4h*5 - 2270 + 3844 + 324h*4 + 19192h*2 + 5200h + 4510 + 13364h. 4(h + 1)*3(h + 39)*2 Let k(g) = 298g - 2678. Let b be k(9). Factor 0 - 8/9t3 + 0t*2 + 2/9t*b + 0t. 2t3(t - 4)/9 Let w(m) be the second derivative of -m*6/55 - 3m*5/22 - 3m*4/22 + 9m*3/11 + 45m. Factor w(v). -6v(v - 1)(v + 3)2/11 Let v(a) = 10a*3 - 26a*2 + 2a + 44. Let x(q) = q3 - q2 - q + 2. Let i(n) = -v(n) + 6x(n). Factor i(s). -4(s - 4)(s - 2)(s + 1) Let x = -9017 + 9022. Factor -38/3m3 - 32/3m - 2/3mx + 8/3 + 14/3m*4 + 50/3m*2. -2(m - 2)*2(m - 1)3/3 Let g(s) be the third derivative of s8/1008 - s*7/315 - 13s6/360 - s5/18 - 412s2. Suppose g(v) = 0. Calculate v. -2, -1, 0, 5 Suppose 0 = 4j + 2h - 10, 1 = 2h - 9. Let q(t) be the first derivative of 1/2t2 + 1/20t*5 - 3/16t*4 + jt + 0t3 - 6. Find o such that q(o) = 0. -1, 0, 2 Let j(z) be the first derivative of -z5/10 + 2z*4 - 71z*3/6 + 14z*2 + 72z + 377. Factor j(c). -(c - 9)(c - 4)2(c + 1)/2 Let n(r) be the first derivative of r*4/26 + 10r*3/39 + 8r*2/13 + 8r/13 + 166. Factor n(q). 2(q + 1)(q + 2)*2/13 Let f(y) = 8y - 75. Let k be f(10). Suppose kb = 3g - 0g - 60, -4g + 54 = 2b. Let -g - 95/3n*2 - 55n - 5n3 = 0. What is n? -3, -1/3 Let n = 357 - -213. Let j be (-2)/(-19) + 282/n. Factor 3/5g*2 - 3/5g*3 + jg*5 + 0 + 0g - 3/5g4. 3g*2(g - 1)*2(g + 1)/5 Let v(p) be the third derivative of 0 + 1/6p3 + 5/48p*4 + 1/60p*5 + 0p + 13p2. Factor v(x). (x + 2)(2x + 1)/2 Let k = 117 - 57. Let l be (-24)/240 - (-206)/k. Let 4/3y - 2y2 + 0 - ly*3 = 0. What is y? -1, 0, 2/5 Suppose 50 - 80 = -15j. Let p(y) be the third derivative of 2/315y7 - 2y*j + 0y*3 + 0y*4 - 1/90y*6 + 0y + 0 - 2/45y5. Factor p(d). 4d*2(d - 2)(d + 1)/3 Let j(b) be the second derivative of -b6/120 + 61b*5/80 - 899b*4/48 - 961b*3/24 + 345b. Factor j(k). -k(k - 31)2(k + 1)/4 Let u(r) be the third derivative of 0r4 + 1/1620r*6 - 1/6r*3 + 1/270r*5 - 2r*2 + 0 + 0r. Let l(d) be the first derivative of u(d). Factor l(h). 2h(h + 2)/9 Let o(z) = -z*3 - 5z*2 + 7z + 8. Let a be o(-6). Solve 18i - ai*2 + 0i*2 - 3i*2 + 12i - 25 = 0. 1, 5 Suppose -h - 22 = 2b + 89, -45 = b - 3h. Let c be 15(b/(-90))/(2/4). Find s, given that -27s*5 - 6 + cs + 153/2s4 + 9/2s*2 - 66s*3 = 0. -1/2, 2/3, 1 Let s(l) = -12l*2 + 2l - 5. Let o = -41 + 57. Let m(r) = -36r2 + 6r - 16. Let f(p) = os(p) - 5m(p). Let f(g) = 0. Calculate g. 0, 1/6 Let r(o) = -2o4 + 4o*3 + 8o2 - 6. Let m(s) = -s2 + 29 - 12 - s*3 - 16. Let v(h) = 4m(h) + r(h). Factor v(z). -2(z - 1)2(z + 1)*2 Find i such that -60i*3 - 30i*2 - 15i*4 + 49i*3 - 3 - 19i*3 - 15i - 3i5 = 0. -1 Let m(a) = -2a*2 + 6a + 22. Let r be m(5). Suppose 97i3 + 15i*4 - 92i*3 - 58i2 - i5 + 23ir - 4i*5 + 20 = 0. What is i? -1, 1, 2 Let x = -43 - -48. Suppose -4r*4 + 3r4 + rx - 2r4 + 2r5 = 0. What is r? 0, 1 Let r(w) be the third derivative of w6/540 + w*5/135 - 7w*4/108 + 4w*3/27 + 84w*2. Solve r(o) = 0. -4, 1 Let b(r) = 6r*3 + 94r*2 + 104r - 197. Let i(x) = 10x3 + 156x*2 + 174x - 328. Let k(g) = 12b(g) - 7i(g). Solve k(w) = 0 for w. -17, -2, 1 Let u(s) = s*2 - 4s - 1. Let c(l) = 1. Let d(x) = -12c(x) - 3u(x). Factor d(w). -3(w - 3)(w - 1) Let c(j) be the first derivative of -2/3j + 2/9j*3 - 3/2j*2 + 3/4j*4 + 19. Solve c(f) = 0 for f. -1, -2/9, 1 Factor 47o + 2990 + 33o + 4o*2 - 3166. 4(o - 2)(o + 22) Let z = -2991 + 8974/3. Suppose -2/3r + 0 + zr2 + 2/3r*3 - 1/3r*4 = 0. Calculate r. -1, 0, 1, 2 Let p(m) be the third derivative of -11m*7/70 - 9m*6/40 + 23m*5/10 + 9m*4/2 - 4m*3 + 5m*2 + 13. Determine d, given that p(d) = 0. -2, -1, 2/11, 2 Let o(a) be the first derivative of -1/22a*4 + 0a - 11 + 2/11a2 + 2/33a*3. Determine g, given that o(g) = 0. -1, 0, 2 Factor 92/9w*3 + 1226/9w*2 + 1288/3w + 392 + 2/9w4. 2(w + 2)*2(w + 21)*2/9 Let x(r) = -r + 4. Let u be x(5). Let t be (0 - (-2 - -2))/u. Determine g so that -2g*2 + 8 + g + tg - 3g - 4 = 0. -2, 1 Let m(i) = 48i*3 - 20i*2 - 17i + 1. Let x(t) = t*2 + t + 1. Suppose 16 - 8 = 2r. Let n(w) = rx(w) - m(w). Determine a, given that n(a) = 0. -1/4, 1 Let l(o) be the first derivative of o7/5880 - o6/420 + o5/105 - 44o*3/3 - 13. Let n(a) be the third derivative of l(a). Suppose n(j) = 0. What is j? 0, 2, 4 Let t = 71 + -69. Suppose 4k + 9 = tq + 7, q - 1 = -2k. Factor 0a + k + 2/9a*2 + 0a*3 - 2/9a*4. -2a*2(a - 1)(a + 1)/9 Let 1/2a*2 - a + 0 = 0. What is a? 0, 2 Let g be (-13 + 20)(1 + 4). Suppose -2f + 2w = 6, 2f + 5w - g = -3f. Factor a2 - 9a3 + a4 + 2a4 + 5a*f. 3a*2(a - 2)(a - 1) Let i be 115/9 + 4/18. Let k = i + -7. Factor -ku*3 + 2u*3 + 6u*3 + 2u*2. 2u*2(u + 1) Let f(l) be the first derivative of -l7/280 + l6/48 + 3l5/80 + 29l*3/3 + 30. Let q(v) be the third derivative of f(v). Factor q(j). -3j(j - 3)(2j + 1)/2 Let p be (-7)/(-3) + (-2)/(-3). Suppose -f + 28 = 4f + 2n, -pn = 5f - 32. Factor 21v*2 + f - 3 + 3 - 5 + v - 45v*3. -(3v - 1)*2(5v + 1) Let k(t) be the third derivative of -t10/604800 - t9/120960 - t8/80640 - 23t*5/60 - 5t2. Let h(c) be the third derivative of k(c). Factor h(g). -g2(g + 1)2/4 Suppose -224/11s + 0 - 2/11s3 - 116/11s*2 = 0. What is s? -56, -2, 0 Let a be ((1 - -3)/20)/(2/(-66)). Let w = 261/35 + a. Factor -wy*2 + 4/7y + 2/7. -2(y - 1)(3y + 1)/7 Let q(p) be the first derivative of p4/9 - 8p*3/27 - 26p*2/9 - 40p/9 + 136. Suppose q(t) = 0. Calculate t. -2, -1, 5 Let c(i) be the first derivative of 0i4 - 4/5i - 5 + 8/15i3 - 4/25i*5 + 0i*2. Factor c(f). -4(f - 1)*2(f + 1)2/5 Let q(u) be the third derivative of u7/105 - 7u6/60 + 11u*5/30 - 5u*4/12 - 4u*2 - 6. Factor q(p). 2p(p - 5)(p - 1)2 Let s(i) be the second derivative of i7/1050 + i*6/45 + 17i*5/150 + 4i*4/15 - 16i*3/3 + i - 18. Let f(y) be the second derivative of s(y). Factor f(n). 4(n + 1)*2(n + 8)/5 Let q be -133/6 - 3/2. Let h be (q + 3 + 4)2/(-11). Find s, given that 2/11s2 - 2/11s - hs4 + 2/11s*3 + 0 = 0. -1, 0, 1 Let v be 1 + (2/(-6))/((-6)/54). What is a in -4 - 15a*v + 5a*4 + 8a*2 + 6a*4 = 0? -1, 1 Factor 376h*2 + 93h - 16 + 817h + 38h*3 - 84. 2(h + 5)*2(19h - 2) Suppose 29 - 34 = -z. Suppose 6s + 0s = -zs. Factor 0 - 9/4a2 + 3/4a*3 + sa. 3a2(a - 3)/4 Let u = 23 + -20. Factor 6 + 34cu + c4 - 4c*2 - 4c*4 + 8c + c*4 - 42c*3. -2(c - 1)(c + 1)2(c + 3) Let a(b) = -6b - 2b*2 + 3b*2 - 1 - 1. Let i be a(7). Suppose 4q*2 - 2q*4 - 3q*5 - 3q*i + 0q*4 - 2q*4 + 6q*3 = 0. What is q? -1, -2/3, 0, 1 Let f = -1/3554 - -3559/17770. Factor -1/5q*3 + 0q*2 - 1/10 + fq + 1/10q4. (q - 1)3(q + 1)/10 Let o(b) b	{ "pile_set_name": "DM Mathematics" }
4 = w, -2t + w - 8 = -3w. Suppose 16 = -n + 2k - 7k, -9 = 3k. Put n, t, 5, -4 in ascending order. -4, n, t, 5 Let n = -96 - -101. Sort n, -2, 8, -3 in ascending order. -3, -2, n, 8 Suppose y = a - 1, 4y = 5a - 1 - 7. Suppose 6b - b - 25 = 5v, -5v + ab = 22. Let c(d) = d - 2. Let n be c(v). Sort n, 6, 1. n, 1, 6 Let s = 1 + -1. Let o(h) = 8h*2 - 11h + 6. Let x(t) = -3t2 + 4t - 2. Let u(c) = 4o(c) + 11x(c). Let l be u(s). Sort -3/5, l, -0.3. -3/5, -0.3, l Let c be (-7 + -3)(-3 + (-34)/(-10)). Sort -1, c, -5, 45 in descending order. 45, -1, c, -5 Suppose 0 = -3c - 3s + 6, -c + 4 = -2s - 4. Suppose cv + 0v = 4. Let n be (-6)/(-9) + 8/(-18). Sort -3, n, v in descending order. v, n, -3 Let v = 0.98 - -47.02. Let l = v - 53. Put 4, -1, l, 0.3 in decreasing order. 4, 0.3, -1, l Suppose -3k - 4h = 30, -5h = -0h. Sort 5, 6, k, 0 in descending order. 6, 5, 0, k Let p be 10/(-14) + (-2)/7. Let w(d) = d - 3. Let z be w(5). Suppose -y - 2k = 4, -20 = -zy + 7y + 3k. Sort 2, p, y. y, p, 2 Let q(v) = -v + 16. Let y be (15/3)/(-5)-17. Let m be q(y). Put 4, 3, m in ascending order. m, 3, 4 Let l = -3 + 15. Suppose 0u - 6 = -3u. Suppose 4w - 4 = -uo + 3o, 4w = 3o + l. Sort w, -3, 1 in decreasing order. 1, w, -3 Suppose -2q - 3x = -9 - 0, q + 4x - 7 = 0. Suppose -2r = 10, 8r = -qp + 3r - 19. Let f be (-7)/(2 - (p + -1)). Put 0, f, 1/4 in descending order. 1/4, 0, f Let o(h) = h2 + 5h + 3. Suppose 5l + 16 = -4. Let k be o(l). Sort k, 5, -5 in decreasing order. 5, k, -5 Let r = 209 - 208. Put -15, r, 2/11, -2 in descending order. r, 2/11, -2, -15 Let h(d) = -d2 - 13d + 5. Let u be h(-13). Suppose 0 = -uv - 28 + 3. Let a be (-2)/v + 161/35. Sort a, 14, -1 in descending order. 14, a, -1 Let g = -981 + 982. Let t = 0 + 3. Sort t, 11, -2, g. -2, g, t, 11 Let z(g) = g. Let f be z(0). Let p = -59 - -58. Put f, p, 1 in descending order. 1, f, p Let g(z) = -z3 + z2 + 4z + 3. Let n be g(-2). Suppose -na + 10 = -12a. Suppose 4r - 4 = -0. Sort r, 2, a in ascending order. a, r, 2 Let r be (-48)/18(-2 + (-39)/(-18)). Sort 0, r, -4, -0.4 in descending order. 0, -0.4, r, -4 Let r = -426 + 436. Let w = 3 - -2. Let y = 0 - 0.1. Sort y, w, r. y, w, r Let j = 0.154 - 18.154. Sort -4/3, j, 4, -3 in increasing order. j, -3, -4/3, 4 Let q be (-192)/(-28)(-114)/(-9). Let j = q - 87. Sort -0.1, j, 2/7 in decreasing order. 2/7, -0.1, j Let i = 3.4 - -2.6. Let n = -55.9 - -50. Let m = n + i. Sort m, -2/13, 1/3 in decreasing order. 1/3, m, -2/13 Let r be 11 + 2 + -2 + 1. Let a = -9 + r. Suppose 0 = -2u - 2v - 2v + 12, 5v - 37 = au. Sort 15, u, 3. u, 3, 15 Let d(m) = -m*3 - 9m*2 + 13m + 65. Let t be d(3). Suppose p = -2p + 2s + 16, 2s + 20 = 5p. Put 5, 3, t, p in decreasing order. 5, 3, p, t Let m = 104.9 - 105. Sort 0.1, m, -7.7 in ascending order. -7.7, m, 0.1 Let g = -179 - -177.78. Put g, 0.4, 3, -1 in descending order. 3, 0.4, -1, g Let w = -429 - -432. Sort -2, -3, w, -3/4 in descending order. w, -3/4, -2, -3 Let b = 2161 + -2161.2. Put b, -0.16, -0.1, -2/9 in descending order. -0.1, -0.16, b, -2/9 Let q = -7.8 - -8. Suppose -7 = -k + 10. Suppose 2v + k = -5t, -t - 4 = -0v + v. Sort t, 2, q in descending order. 2, q, t Let c = 73 + -76. Put c, -8, 0 in descending order. 0, c, -8 Let r be ((-70)/7 - -8)-2. Put -205, r, -5 in descending order. r, -5, -205 Let d be 06/(-42)1. Put -4, 1, d, 2 in ascending order. -4, d, 1, 2 Let z be 0/(7/(35/(-10))). Put -3/4, 2/7, z in decreasing order. 2/7, z, -3/4 Let i be 145/(-21) + 18/(-189). Sort 4, -9, 0, i in descending order. 4, 0, i, -9 Let v = -3/14 + 43/70. Let x = -134 - -539/4. Let b be (-114)/(-95)(1 + 74/(-54)). Put x, v, b in decreasing order. x, v, b Suppose 3c = 5c - 8. Suppose 2w = cw + 10. Sort -20, 5, w in decreasing order. 5, w, -20 Suppose 2y = -2n - 11 - 1, y = 3n + 14. Suppose -2k = 7 + 5. Let d(l) = -l2 - 8l - 14. Let a be d(k). Sort y, 4, a in ascending order. a, y, 4 Let z = 287 + -148. Let b = z + -140. Sort 5, -3, b, 3 in increasing order. -3, b, 3, 5 Let i = 505 + -494. Let y = -0.16 - -0.06. Put i, y, 2/7 in decreasing order. i, 2/7, y Let b be 3 - (-2)/((-42)/51). Let u = 0.02 - -0.02. Sort -1, b, u in increasing order. -1, u, b Let g(y) = -5y + 18. Let k be g(3). Suppose 4v - 5v - t = -2, 2v - 3t = -21. Put -4, v, 2, k in descending order. k, 2, v, -4 Suppose 101x - 153 = 152x. Sort -2/3, -37/5, x, 5. -37/5, x, -2/3, 5 Suppose 20 = 4x - 0x - 4z, 3x = 2z + 14. Put -4, x, -7, -3 in descending order. x, -3, -4, -7 Let d = 97 + 11. Let x be d/(-24) - 4-1. Put x, -0.2, -2/3 in descending order. -0.2, x, -2/3 Let y(v) = 4v - 1. Let x be y(1). Let r(i) = i*2 - 10i - 22. Let k be r(-2). Sort 5, k, x, 4. k, x, 4, 5 Let v = -99 - -101. Sort 1, 0, -21, v in ascending order. -21, 0, 1, v Let l = 397 + -397.4. Sort 11, -5, l, 1/8. -5, l, 1/8, 11 Let z = -0.1058 - 3.8942. Sort -2/7, -86, z in decreasing order. -2/7, z, -86 Suppose -5 = -5d, 3z - 4d = -3d + 5. Suppose -zn = -2m + 6, -3n + 5m - 5 - 12 = 0. Sort n, -1, 0, -3 in increasing order. -3, -1, 0, n Let s = -6/23 - -7/115. Let v = -3 - -7. Sort v, 3, s in increasing order. s, 3, v Suppose -f - 15 = -4l, 2f + 0l = -3l - 8. Let c be (f/(-3))/(((-10)/(-12))/5). Sort c, -4, -2, -5 in increasing order. -5, -4, -2, c Let g = -0.07 - 4.93. Let h be 2 - (53/11 + -3). Let z be 0 + (10/8 - 1). Sort g, z, h. g, h, z Let w = -3 + 2.5. Let r = 5.62 + -7.62. Let t = -0.3 - -0.7. Put t, r, w in descending order. t, w, r Suppose -5k = -d - 23, 2k - 4 = 3d - 0d. Suppose -5r - 3h = 6, 2r - dh - 2 = 2. Sort r, -1, 4 in increasing order. -1, r, 4 Let d = -18 + 16. Let f be 9/(45/(-20))(-2)/d. Put -1, f, 1 in ascending order. f, -1, 1 Let g = 51.9 + -52. Let l = -50 + 48. Let i = -4.93 - 0.07. Put g, i, l in decreasing order. g, l, i Let r = 3.337 - 0.337. Put 9, -2, 0.4, r in decreasing order. 9, r, 0.4, -2 Suppose -6w - 2w + 80 = 0. Let r be 1/((-4)/w) + 3. Put r, -1, 0.2, 3/2 in increasing order. -1, 0.2, r, 3/2 Let p = 529/6 + -88. Let x be (24/(-48))/(7/(-4)). Put 0, x, p, 0.3 in increasing order. 0, p, x, 0.3 Suppose 0 = 2a - 8 - 0. Suppose -43 + 35 = 8z. Suppose 3f = -j - 10, -4j - 2f = 3f + 5. Sort j, z, a in increasing order. z, a, j Let n be ((-20)/6)/(18/(-27)). Suppose 2i - 3 = h - 0h, -nh = -4i - 9. Let g be 0/((-2)/i2). Put 4, g, -3 in ascending order. -3, g, 4 Suppose 17 - 29 = -4f. Suppose -4k = -12, -fk + 4k - 5 = 2s. Sort s, 4, 2, -2. -2, s, 2, 4 Let g(d) = d2 - 7d + 6. Let c be g(6). Let b be (16/6)/(4/36). Let p be 26/(-65) + b/10. Sort p, -5, c in ascending order. -5, c, p Let n be (-1)/(-9)(-12)/(-3). Let w = -425 + 429. Put n, 0.1, 1, w in decreasing order. w, 1, n, 0.1 Let b(s) = -s3 + 21s*2 + 26s - 91. Let i be b(22). Sort i, -353, -5. -353, -5, i Let v = -0.02877 + -55.00123. Let t = 55 + v. Put -1/3, t, 1/5 in decreasing order. 1/5, t, -1/3 Let y = 273 - 273. Sort -1, -5, y, 4 in increasing order. -5, -1, y, 4 Suppose 3t - 12m + 15m + 3 = 0, -t - 3 = 3m. Put 22, 3, 4, t in descending order. 22, 4, 3, t Let l = -35 - -29. Let i be l/1 + (-3)/(-1) + -2. Suppose -2y - 18 = 2y - 2r, 0 = -3y + 4r - 26. Put 0, i, y in decreasing order. 0, y, i Let k = 1 - 0. Let x = -0.012 + 49.012. Let j = x - 47. Sort j, k, -3 in decreasing order. j, k, -3 Let d = -47.8 + 47.6. Sort d, 2/3, 0.3, -6.2. -6.2, d, 0.3, 2/3 Suppose 4x - 1 = f + 1, -9 = -x - 4f. Sort 63, x, -5, 3 in decreasing order. 63, 3, x, -5 Let h(p) = -p3 - 6p*2 + 3p + 16. Let o be h(-6). Put -65, 5, o in increasing order. -65, o, 5 Let v(k) = -k*3 - 7k*2 - 8k - 14. Let h(x) = -7x3 - x + 2. Let l be h(1). Let g be v(l). Sort 2, g, 9, -5 in ascending order. -5, g, 2, 9 Let n = -55 - -55. Suppose 3o - 52 + 4 = n. Sort 0.4, -4, o, 4 in decreasing order. o, 4, 0.4, -4 Let l(g) = -g - 4g - 1 + 3g. Let x be l(5). Let k be x/(-3) + 9/(-3). Put 1, -1/6, k in decreasing order. 1, k, -1/6 Suppose 0 = 5s - 5g + 30, -9s - 25 = -5s - 3g. Suppose -4q + 28 + 0 = 0. Suppose 2t + 3 = q. Put t, s, -3 in increasing order. s, -3, t Let h = -335 - -349. Sort h, 3, -1. -1, 3, h Let m(f) = 6f + 29. Let p be m(10). Let b = -84 + p. Put 12, -0.4, b in decr	{ "pile_set_name": "DM Mathematics" }
23 - 26. Let p(n) = -n*2 + 9n - 11. Let t be p(8). Let u be 9 + f - (0 - t). Solve uo + 3 = r, 3r = 2o - 2r - 11 for o. -2 Let n = -5 - -13. Suppose -3b + 4b = 4, 0 = -4z + 3b + n. Solve 4d = -c + 5, -5 - 1 = -zd - c for d. 1 Let h(t) = t*2 + 3t - 4. Let z = 5 + -4. Let r be h(z). Solve 12 = 4q - l, 4l = 5q - r - 15 for q. 3 Suppose 0 = -3w - 5a + 31, 0 = 54w - 55w - a + 9. Solve -4o = -4, -4o = 2z - wo - 7 for z. 5 Let f = -1 + 2. Let b be 13/4 - f/4. Suppose 0 = -5o - 4x + 12, 5x - 27 = -5o - 12. Solve 2q = -5v + 3, -7 = 4q - oq - bv for q. -1 Suppose 4n = 2x + 12, 2x - 28 = -4n - 0x. Solve -nh + 37 = 4j, j + 11h - 28 = 6h for j. 3 Let m = -8 - -8. Let d be 1898/(-104) - (-1)/4. Let i = m - d. Solve -3h + 5r + 35 = 0, 2h - r - i = r for h. 5 Let w = 30 - 24. Suppose -wd + 14d = 24. Solve 0 = a + v - 2, a + 2v = -da - 2 for a. -3 Let k(c) be the first derivative of -c*2/2 + 8c - 14. Let h be k(-4). Solve 4v + 4a + 12 = 0, -5v + 2 = 4a + h for v. 2 Suppose 10t - 7t + 126 = 0. Let h = t + 46. Solve -i + 20 = -5z - 6i, -2i = -2z + h for z. -1 Let v(m) = m + m + 48 - 15 + 4m. Let x be v(-5). Solve -5u - 5 = 4t, -xt + 3u = -31 + 1 for t. 5 Suppose 0 = 3k + 12, 33 = -5a - 0k + 3k. Let o be (1/a)/(5/(-60))3. Solve 3 = oi - i + 3h, 19 = 3i - h for i. 5 Let s = 1624 - 1622. Solve 25 = -5i - 4r, -2i - 27 = sr + 3r for i. -1 Let s(u) = u - 11. Let w(v) = -v*2 - 11v + 7. Let g be w(-11). Let t be s(g). Let z = t + 7. Solve -4y - 32 = -3i - 7, -29 = -zi + 5y for i. 3 Let j(k) = 3k - 57. Let b be j(20). Solve 3 = -3x - bm, 4x = -0m - 5m for x. -5 Let q(y) = -4y - 14. Suppose -3j - 2j = 3b + 12, -j = 0. Let h be q(b). Solve -4v = 2r - 0v + 14, 4r = 2v + h for r. -1 Let t be 2/(4/(-40) + 0). Let r = t + 24. Solve -2y - 3 = 3j, -2j + 15 = -ry + j for y. -3 Suppose 3 = -w + 3t - 2t, -2w - t + 9 = 0. Suppose wg + 6 = 2k + 3k, k = -4g + 32. Solve -3j + gd - 4d = 24, -3j + 1 = 2d for j. -3 Let g be 3 + -4 - (3 + 2 + -10). Solve -3x + 0x - 3j + 9 = 0, 0 = -gx - 5j + 17 for x. -2 Let g be 1/(-4) - 13/(-4). Let q(i) = -i2 + 9 - 3 + i3 + 5i2. Let y be q(-4). Solve 0 = -3v + 15, y = -gb + v + 1 for b. 0 Let o(l) = -l3 - 10l*2 - 8l + 12. Let d be o(-9). Suppose -d = -s, 3s = -b + 4s + 20. Solve b = 4m - f, 5f = -4m + 6 - 1 for m. 5 Let l be 1/2 + (-5)/(-40)244. Suppose 2d = 5b + l, 3d + 5 + 6 = -4b. Solve -2o - 2i + 16 = -0i, -di = 5o - 32 for o. 4 Let q = -80 - -86. Suppose -3n - qw + 7 = -7w, 0 = -2n - 4w + 28. Solve -3f = nj + 2, 0j - f = 2j for j. 1 Let v be ((-56)/(-3))/(2/6). Suppose -3w + 5r - 74 = 0, -2r = -0 - 2. Let o = w + v. Solve 0 = -5j - 2c + o, -3j + c + 35 = 6c for j. 5 Suppose -9y + 28y - 342 = 0. Solve -6 = 2c, c - y = 4x + 3c for x. -3 Let s(t) be the third derivative of -t*5/30 - 3t*4/8 + 3t*3 - 23t*2. Let n be s(-6). Solve 7x = 2x, n = 2c - 4x + 4 for c. -2 Suppose 9m + r = 4m + 403, 5m - 3r = 391. Suppose -3j = -4u - m, 4u = 5j - 30 - 90. Solve -5l - j = -3k, 2l + 3 = 4k - 19 for k. 5 Let r(s) = -s3 + 5s*2 - s + 44. Let o be r(6). Solve -2p - 3j + 2 = -2j, 7 = p + oj for p. -1 Let t = -8 + 11. Suppose 0d - d - f + t = 0, -3 = -2d - f. Suppose 2w - 3w + 5 = d. Solve 6 = -2i - s, 15 = -2i - 3i - ws for i. -3 Let m(x) = -2x*2 - 60x - 144. Let c be m(-27). Solve g = 5z + c, -5z + 3z - 6 = -g for z. -4 Let n be ((-8)/16)/(-3(-3)/(-54)). Solve -5q + 10 = -5a + 2a, -2a = -nq + 5 for q. 5 Let s = -1 - 8. Let n = 11 + s. Let o be (-6)/n + 1 + 2. Solve -2g = y + 2g, o = -2y - g for y. 0 Let q(l) = 6l2 + 4l - 5. Let w be q(1). Solve 0 + 20 = -4b, -4v + 13 = -wb for v. -3 Let a(i) = 8i + 1054 - i*2 + 3i - 1061. Let c be a(10). Solve -3f - f + cm = -20, -5 = -f - m for f. 5 Suppose 3n - 84 = 3z, 6z = -3n + 4z + 89. Solve 4h = -3t + n, -2t + h + 4 - 3 = 0 for t. 3 Let x be (-96)/(-14) - 31/(-217). Solve -4f = -3a - 2f - x, -3f = -6 for a. -1 Suppose 31m - 172 = 248 + 510. Suppose -7 + 1 = -2y. Solve -5s + 4i = 45, -3s + 0i + yi - m = 0 for s. -5 Let z(w) = w3 + w2 - 57w + 7. Let g be z(7). Suppose -4q - 6 - 6 = 0, 5x + 3q = 1. Solve 5c + 25 = g, c - 3c = xb + 18 for b. -4 Let d be (-2 + 1)(-129)/(8 + -5). Suppose 5f = -33 + d. Solve 3n - fg - 17 = 0, n + 5g = 4 - 21 for n. 3 Let c = -35 - -55. Suppose -11v = -15v + c. Solve -21 = -4h + 3m + 7, -vm = 20 for h. 4 Suppose -36 = -7z + z. Let t(w) = -w2 + 2w + 2. Let b be t(2). Suppose -22 = -5m - bi, -4m + 11 + z = i. Solve 5j + x - 10 = mx, 2x = -2j - 12 for j. -1 Suppose 4g = -5v + 13, 24 - 16 = 2g + 4v. Solve -2x - 4f - 10 = -0x, -gx + 2f = 10 for x. -5 Suppose 0 = 3g - 0g. Let p(y) = -y*2 - 6y - 2. Let k be p(-5). Suppose 24w - 23w = 15. Solve g = u - 2j - 3, ku + 3j = u - w for u. -3 Suppose -39z = -33z - 18. Solve -zj - 30 = -p + 4p, -2p = j + 15 for p. -5 Let a be (3/(-6))/((-2)/12). Let w be (((-100)/10)/(-5))/1. Solve -p - wv = -1 - 5, -3p + 6 = av for p. -2 Suppose -22k + 25 = -85. Solve -km + 27 = -5j - 3, -5m + 22 = -j for m. 4 Let b = -225 + 230. Suppose 2q - 6 = -q. Solve -2n + 13 = -qs + bs, s + 3n - 2 = 0 for s. 5 Let c = 91 + -90. Solve d + c = -t, 3d + 2t + 0 = 1 for d. 3 Let i be 8(15/4)/3. Let d be -3 - 3 - (-6 + 2). Let v be (d/(-9))/((-4)/(-36)). Solve 2m - 15 = 3y, vy - 2m + 3m = -i for y. -5 Let k = 244 + -244. Solve -4n = -5t + 23, -4 = -kn + 2n for t. 3 Let h be (-12)/60 + (-66)/(-30). Solve 0q + 4 = hd + q, -d = -q - 2 for d. 2 Let q = 103 - 123. Let t(u) = u*2 + 20u + 5. Let n be t(q). Solve -nv = 4f + 1, 4v + 0v = 4f - 8 for f. 1 Let k be 5/(15/9) + -16. Let f be (-3 - -1)/2 - k. Suppose 14q = fq. Solve q = 2u + 2w + 2w + 10, -4w = -u - 5 for u. -5 Let g(r) = -r - 3. Let b be g(-3). Suppose -144 = 2f - 148. Solve b = 2i + fc - c + 3, 3i + 12 = -3c for i. 1 Let o = 3 + 0. Suppose -oc - 14 + 2 = 0. Let u be 2 - (c + 8 - 6). Solve uk + 10 = -2h, -4h = -k - 1 - 6 for h. 1 Suppose 5a = -0a. Solve a = -4s + u - 5, 0s + 5u = -5s + 25 for s. 0 Let q = 396 + -393. Solve -4p + 3y = -0y + 20, -15 = qp + 5y for p. -5 Let w be 20/3-18(-12)/144. Solve -p - y + 3y = 3, 5p + w = 5y for p. -1 Let m = 6 - 4. Suppose 136r = 127r + 27. Suppose -5b + 15 = 2y, 0b + 3b + 5y = -10. Solve -bh = rq - 0q + 1, -2h = 2q + m for q. -2 Let g = 1701 - 1694. Let s(k) = -2k - 4. Let z be s(-5). Let x = z - 3. Solve xa - u - 1 = 0, ga + u = 2a + 7 for a. 1 Let v = 76 - 5. Let u = 76 - v. Solve 2n - uc + 0c = 0, -4c = 3n - 23 for n. 5 Suppose -4p + 3f = 4, 0p + f + 2 = 3p. Let j be (3 - 3)/(1/(-1)). Let g = p - j. Solve 2o - 12 = -4s, -4o + gs = o - 6 for o. 2 Let f(k) = 24k + 12. Let q be f(4). Suppose 10u + q = 16u. Solve -3a - 4s - 20 = 0, 0 = 3a - a + 5s + u for a. -4 Suppose 0 = 2k - j - 10, -2j = 3k + 2 - 17. Suppose -2l + 7 = -3x, kl = 2l - 4x - 15. Let d be l/2 + 15/6. Solve 2 = -i - 5b, 0b = db for i. -2 Suppose 38g - 252 = 36g. Suppose -4n - 3 - 16 = -c, -4c = 4n + 4. Suppose 4k + ck = g. Solve -f + 6f = 2b + k, -5b - 28 = -4f for b. -4 Let n(t) = -t*3 - 5t*2 - 5t - 50. Let u be n(-6). Solve 2r - 6 = 2k, u = 4k - 0r + 3r for k. 1 Suppose 3h = 3, 0 = 3w - h + 3h - 8. Solve -d = -l + 10, wl - 3l = d for l. 5 Let j be ((-30)/(-9))/(1/(-3)). Let a = 13 + j. Suppose 9 = ay - 0y. Solve 3x - 21 = -yr, 0x - r - 5 = -2x for x. 4 Suppose -2j - t + 47 - 8 = 0, j + 3t - 7 = 0. Let h = j + -7. Solve -2s + 5q - 10 = 3q, 4s + 3q - h = 0 for s. 0 Let u(z) = 3z*2 + 3z - 1. Let s be u(-2). Solve -5h = sk + 5, 4k + 3h + 4 = 3 for k. 2 Let p(h) = h*3 + 4h*2 - 2h - 1. Let g be p(1). Suppose 2k = gz - k, -2k - 22 = -5z. Solve -4j - 3t - 19 = 0, -j - 5t - z - 3 = 0 for j. -4 Let y = -35 - -36. Let s be y/4 + (-10)/(80/(-78)). Solve -23 = 4j + 3x - 6, -2j - 2x - s = 0 for j. -2 Let p be -20 - ((-12)/(-4) + -7). Let n = -11 - p. Let a(l) = 4l*2 - 2l - 1. Let q be a(-1). Solve -28 = -no + 2s, -o = -2o + qs + 24 for o. 4 Suppose -42 = -17v + 10v. Sol	{ "pile_set_name": "DM Mathematics" }
9)/((d/(d*(-8)d))/((d*(-5/4)d)/dd))) assuming d is positive. d(-143/20) Simplify (w(2/3)/((w/(w/w(-1/4)))/w))/((w(1/3)/ww)/(w/w*3))((w/(w*1ww))(-4))(-10/7) assuming w is positive. w(-995/84) Simplify (y/(y(-3/4)y)y(-1/4)yy/y(2/3)(y/y*(-5)y)/y)/((y/y(-1))(-4)(y1/y)(-15)) assuming y is positive. y(95/6) Simplify (((c(-8/5)/c)/c)/(c/(cc*4/c)c))(-7/5)/(c(-3/5)/cc/c(2/19)(cc/c(-1/4))/(c/c(-3/8))) assuming c is positive. c(7867/3800) Simplify ((s(s/((s/(s*(-3/8)ss)s)/s))/sss)(12/5)/(s(35/4)/(s*(-36)ss)))47 assuming s is positive. s(-32007/20) Simplify ((v(-2))(-34))(1/32)((vv/(v(-4)v))/v)/v(v(-5)v)/v(v(1/2))(1/20) assuming v is positive. v(3/20) Simplify ((x/(x/(x(-3/8)x)))*(2/53)((xx(-1/4)x)/x)17)(-21) assuming x is positive. x(-14217/53) Simplify (h/h(2/17)hh/(h/(h*(-3/4)h)))*(-11)h*(2/3)h*(-5)hh(h1)1 assuming h is positive. h*(-5057/204) Simplify ((t/((tt(1/6))/t))24t(-13)t/(t/((t/(t/t(-2/31)))/t)))36 assuming t is positive. t(6624/31) Simplify (t4/tt(-1/3))22/(t9t/t(-1/2))42 assuming t is positive. t(-1147/3) Simplify (z1)*24(z/(z/z(-14)))(-7/6) assuming z is positive. z(121/3) Simplify (m(-18)m(-4/9)/m(m/(((m2/m)/m)/m))(-33/5))45 assuming m is positive. m(-1469) Simplify ((uu(-2/5)u)/u)46/(((u(-1)/uu)/u)/u)(-31)((uuuu(-2))/u(-9))(-49) assuming u is positive. u(-2777/5) Simplify u5uu/u(3/4)(u*40uu)2 assuming u is positive. u(361/4) Simplify (f(2/7)ff(1/2))(-5)/((f(-4/9)/(f(-1/5)fff))/(f*(-1/3)ff/f(-2/5)f)) assuming f is positive. f(-1649/630) Simplify (u/u5u)/(u/u(-4/5))(uu(-1/3)/u)(1/15)(uu1)48/((u/(uuu/(uu/(u*(2/5)u))))/(u/((uu1)/u))) assuming u is positive. u(4166/45) Simplify ((g/(g0/g))(-39))(-5)/(((g(g*(-5)g)/g)/g(-4))/(g(-2)/gg(-2/5))) assuming g is positive. g(1933/5) Simplify (((kk*(-3/13)k)/k(-2))/((k(-9)k)/(kk*8kk)))(-5) assuming k is positive. k(-1480/13) Simplify (((m/((m(-2/3)m)/m))/mm)/(m(-4)/m))(-38)/((m(-1)m)*(-35)(mm(-4))/m6) assuming m is positive. m(-733/3) Simplify (q(-2/5)q(q/(q/q(1/2))q)/q)/(q*(-2/21)/(qqq(-1/4)))q*(-8)q*(-5)/q(q/(qq(-2)))(-8) assuming q is positive. q(-11363/420) Simplify l(-27)/((ll*(1/11))/l)((l(ll*(-2/39)l)/lll)/ll)/(l/(l(l(ll*(3/13)ll)/l)/ll)) assuming l is positive. l(-8542/429) Simplify ((t(2/35)(t15/t)/t)/(t/(t/(t(((t/(t/(ttt(tt*(-13)/t)/tt)))/t)/t)/t)))23)(-16) assuming t is positive. t(-161872/35) Simplify ((n11n(-2/7))/((nn*(4/3))/nn(-13)))(-6/11) assuming n is positive. n(-940/77) Simplify (i(1/18)/(i*(2/9)iii))*(-1)(ii(-2/3))19(i/((i*(1/2)/ii)/i))(21/4) assuming i is positive. i(139/8) Simplify ((w/w*1)/ww)*9/(w(ww(2/25))/ww(w0w)/w)(w9w/(ww/w(2/5)))9 assuming w is positive. w(1838/25) Simplify ((k(-2/5)kk)(-42)(k/k(1/2))(-3/34))/((kk(-2)kkkk)/((k(-4/5)k)/k)k(2/15)k/(k(kk7)/k)) assuming k is positive. k(-65461/1020) Simplify (c(-1/20))46/(cc0cc/(c(-22)/c)c) assuming c is positive. c*(-293/10) Simplify ((mm/(m*(2/7)/m)m)*26mm/(m(1/5)/m)mm(-1))/(mm*(2/7)m(6/11))(-2/13) assuming m is positive. m(71252/715) Simplify (d1d(-3/2))(26/7)/(((dd(-1))/d)(3/17))(-1/3) assuming d is positive. d(-228/119) Simplify (y*(-1/2)y*(-6))/(yy(y/y0)/yyy(-2/15))((yyy*(-8))/yy(1/4)/y)/(y(5/4)y(-9)) assuming y is positive. y(-281/30) Simplify (i(-2/3)i*(1/20)(i/(i/(i*(9/2)i)))/((i/(i*(-16)i))/i))(2/65) assuming i is positive. i(-607/1950) Simplify ((w(4/23)/w)/w43(w/(www/w45w))(-28/5))(2/17) assuming w is positive. w(-64176/1955) Simplify ((m(1/2)/m(-3/5))/(m/(m(-1/4)/m))(-22))/(m(-1/7)mm*6(m0)(1/23)) assuming m is positive. m(1531/35) Simplify (q(-15)/((q/(qq(10/11)qqq))/q)q(-5)qq8)29 assuming q is positive. q(-1943/11) Simplify (j2j)/(jj(4/5))j*9j*(-6/5)j(((j2j)/j)/jj)(8/9)(j(-2/5))(2/43) assuming j is positive. j(22754/1935) Simplify ((w(-1/4))12)(-45)(w1w)*(-19/5)/(ww*(-3/2)www(-2)) assuming w is positive. w(1279/10) Simplify ((((b/(b((b(-4)/b)/b)/b))/b)/(bb*(-7)b))/(b*(-24/11)(b/(bb(-1/28)b))/b))27 assuming b is positive. b(125955/308) Simplify (((z/(zzz/z(1/6)))/z)/z2)/(z(-4)/(z(-1/7)/z))(z(-1/4))42/(zz(-1/2))(-30) assuming z is positive. z(53/21) Simplify (u/(u(5/2)/u)u/(u(3/22)/u))/(u(-29)/u(-6/23)) assuming u is positive. u(7616/253) Simplify ww*(-5/2)/ww/(ww(-2))w*(-7/3)/(ww*6)(w*6w)/(w*(-1)w)(w/w0ww)(1/13) assuming w is positive. w(-203/78) Simplify ((((k/k(-2)k)/k)/(k*(1/5)/kk))/(kk(1/2))(3/19))/((kk*(1/4)kk(-5))/(k3k(-4/7))) assuming k is positive. k(20593/2660) Simplify (((bbbb/(b(-1/3)/b)b)/b)/(((b*(-5)/bb)/b)/b)b(1/2)/(b(3/2)b))7 assuming b is positive. b(217/3) Simplify (((c*(-5)c/(c*(-1/7)/c))/(c/((ccc(-3))/c)cc/c0))50)(-3/4) assuming c is positive. c(4125/14) Simplify ((hhh(-3))/(hhh2)(h*(-1/4)h)(-43))/((h0)*(-2/29)(hh6)/h6) assuming h is positive. h(-153/4) Simplify ((ff*(-33)/ff)/(f*(-2/97)f)f(-24)/f(4/7))(2/9) assuming f is positive. f(-78154/6111) Simplify ((t2)(-2/25))(1/19)/((t/(tt(-8)))/(t/t(-3/4)))(-21) assuming t is positive. t(249359/1900) Simplify (jj/(jj*9jj)j(-4))17(jj*(-2/11)(j(-1/9)/j)/j)/(j(2/3)j)8 assuming j is positive. j(-25010/99) Simplify ((l/(l(-7)l))/l*(-2)(l(-1/4))42)/((l2/(l(2/7)/l))/(l*(4/5)l/(lll(-2)))) assuming l is positive. l(-169/70) Simplify ((((hh/(hh/h*(-2/3)h))4)(-38))(-47))(-2/107) assuming h is positive. h*(71440/321) Simplify ((nnn/(n/n(-2/5)))(2/7)/(n(-5/6)n/(n/(n(2/5)/n))))/((n(-1/3))12/(n/n(-3)n8)) assuming n is positive. n(3757/210) Simplify (((l/(ll/(l*16l)))/l)*6((l/((l*13/l)/l)ll)/ll)/(l/(l(l(-25)/l)/l)))20 assuming l is positive. l1100 Simplify ((k(1/2))(-7/8)(k(-2/3))(-7/4))/((k(-1))47/((k*(-1/3)/k)/kk(-1/3))) assuming k is positive. k(721/16) Simplify ((s/(ss/((s/(s(-3)ss))/s)))(11/8)(ss(-4)s)16)(4/13) assuming s is positive. s(-128/13) Simplify ((x(-2)/(x/x*(-2/23))(x/(x/(xx0)x))/xxxxx(2/3))(1/22))3 assuming x is positive. x(-29/506) Simplify (b*(-3/13)b*(-1/2)(b*(-6/17)b)4)(-40) assuming b is positive. b*(-16420/221) Simplify (hhh(3/7)/h)/h(-4)(h0)(-21)(h(-11)(h/(h(-2/3)/h))/h)(-2/75) assuming h is positive. h(8942/1575) Simplify ((b(-1/4)b)(-7/2)b/b*13b(-1/5))(1/9) assuming b is positive. b(-593/360) Simplify ((y/(y(-2/11)y))(-3/16)/(y13yy(-45)))0 assuming y is positive. 1 Simplify ((i/(ii/(i/i*(1/3)i))ii/(ii(-7/3)))/(i(2/3)i(1/2)))/((i(-2/3))(-36)/(i3/ii(i/(i/(i/i(-3))))/i)) assuming i is positive. i(-91/6) Simplify (s(-17)/s(-3/2)(ss*(-1/5)s)(1/21))36 assuming s is positive. s(-19422/35) Simplify u0/u*(1/2)u*(1/2)u/(u/(u/(uu(2/17)uu)))u(-3/5)/u(-1)(uu/(u/u(-1)))(-1/5) assuming u is positive. u(-146/85) Simplify ((h/(h(1/6)/h)h)/h(2/15)h*4hh/(h/h(2/3)))/((h(-2/9)h)39)(-4/3) assuming h is positive. h*(4393/90) Simplify ((cc*15/ccc/(c(-2/3)c))/(c*13/cc)40)(-9) assuming c is positive. c*4530 Simplify (cc/(cc(-10)c)c)(6/25)/((c(-17)/c)/(cc/c(-2/5))) assuming c is positive. c(576/25) Simplify (((((mm(1/4))/m)11)(-2/17))(11/6))35 assuming m is positive. m(-4235/204) Simplify ((a/a0a)/(a/(aa0a)))*(-49)((a(a(-2/17)/aa)/a)/((a/a*(-3))/a))/(aaa0)(-5/3) assuming a is positive. a(-7486/51) Simplify (z/(z/(zz/(zz13))zz))(-2/65)z(-26)/z(-21) assuming z is positive. z(-297/65) Simplify ((t14/(tt(2/7)))/((t/t7t)/(t/(t/((tt(5/3)/t)/t)))))*4	{ "pile_set_name": "DM Mathematics" }
.1. 0.5861 What is 83774 take away -0.06? 83774.06 What is the difference between 0.5 and 10247? 10246.5 What is -0.0238 + 0.729? 0.7052 What is 114.55 plus -2? 112.55 Sum 0 and 0.328. 0.328 Total of -5166 and -0.1. -5166.1 Add together 0.627 and -0.08. 0.547 What is the difference between 8304 and -0.2? 8304.2 Work out -0.1 + 5741. 5740.9 Calculate 2.5 - -1746. 1748.5 Total of -0.3 and 2367. 2366.7 What is -2 plus 137.3? 135.3 Work out 11.24 - -0.01. 11.25 Add -0.018 and 18. 17.982 Calculate 270 - 15. 255 What is -5035806 plus -5? -5035811 Calculate 50.28 + -24. 26.28 What is -2062 less than -0.2? 2061.8 Total of 4.8 and 93. 97.8 What is -366511 less than -4? 366507 Add -35 and 289. 254 Sum -44 and -1137.9. -1181.9 What is the distance between 0 and 2802635? 2802635 -0.2 + 18115.3 18115.1 Work out -4.271 - 0.29. -4.561 Sum -11 and -1657. -1668 What is 22 plus -0.224185? 21.775815 Work out -5 + -50. -55 Calculate -39.18 + 5. -34.18 Add together -18.062 and 0.4. -17.662 What is the distance between -0.04 and -263? 262.96 Calculate -2 - 1063.08. -1065.08 Work out -0.2 - -5119. 5118.8 What is -3150 minus -1527? -1623 What is 844.9 less than 2? -842.9 Total of 1.3241 and 3.2. 4.5241 Work out 65 + -0.4. 64.6 0.3+0.03 0.33 What is -34197 plus -3? -34200 Total of -0.9566 and 100. 99.0434 Work out -0.006 - 2.9. -2.906 Calculate -133.3895 - -6. -127.3895 -910 - 2.164 -912.164 Calculate -260 - -0.2. -259.8 Calculate -602 + -1. -603 What is -442264 - -2? -442262 Calculate -0.203 + -569. -569.203 51.8612 - -3 54.8612 Subtract 0.2 from 26.13. 25.93 What is 1752 take away 0.72? 1751.28 -1001 + -0.4 -1001.4 Work out -3 - -0.0515. -2.9485 39 + -23 16 What is 1 take away -6.77? 7.77 Total of -52.16 and -75. -127.16 What is -11 less than -0.03165? 10.96835 Calculate 418 + 6739. 7157 What is -338 plus -889? -1227 -3554 + -211 -3765 Work out 237 - 13917. -13680 What is the distance between -881 and 4? 885 Work out 0.3 - -2.89848. 3.19848 Subtract 0.3 from -262.3. -262.6 What is 0 + -176? -176 What is 0.014929 minus 1.9? -1.885071 What is 0.255 plus 84? 84.255 Calculate 3 - -85.5. 88.5 Calculate -0.5 - -5.0099. 4.5099 -20029 + 4 -20025 What is -3.14 plus 745? 741.86 What is -26.3 less than -0.2? 26.1 Sum -0.3 and 3146. 3145.7 Subtract -0.3 from -3264. -3263.7 0.9 - -0.05055 0.95055 Add -0.05 and -585. -585.05 Add 4 and -290111. -290107 Work out -0.3 - 0.1205. -0.4205 What is -1460511 take away 0.2? -1460511.2 Add -0.08 and 2.2464. 2.1664 -27037.93 + -0.1 -27038.03 What is the difference between -0.5 and -0.10333? 0.39667 Sum 88106 and -0.1. 88105.9 Calculate -5.003 + 1.2. -3.803 What is the distance between -348200 and -1? 348199 What is -0.5 minus -25059? 25058.5 What is -51062 less than -0.2? 51061.8 What is 0.308 - 19.69? -19.382 -1 - -405 404 Calculate -0.2 - -66444. 66443.8 Sum -2.71 and 690. 687.29 Total of 2817 and -0.4. 2816.6 Calculate 43307.98 + -5. 43302.98 Add -275436 and -0.2. -275436.2 What is -131489 plus -2? -131491 What is -339 plus 1.7? -337.3 Subtract -0.32 from 9300. 9300.32 0.3+10.44899 10.74899 Work out 0.3 - 0.709629. -0.409629 Sum -0.0489 and 0. -0.0489 What is 0.3 take away -21.21? 21.51 Work out 41.8 + 0.043. 41.843 What is -391 less than -58.4? 332.6 -73+-5891 -5964 What is 3 less than 9.278? 6.278 What is 2 take away 131707? -131705 What is -123922 plus 7? -123915 What is 346 plus -78? 268 Total of -6 and -4. -10 Total of 2019 and -0.174. 2018.826 What is 0.1048 minus 30? -29.8952 Work out 5 + 473224. 473229 Add 6 and 13605. 13611 What is the distance between 3 and -746.82? 749.82 What is -0.2 less than 139? 139.2 -11646 + -0.1 -11646.1 Work out 3 - 5.04. -2.04 -0.11+156 155.89 What is -65541 - -8? -65533 Add together -9 and -4.06. -13.06 19.1 + -1 18.1 0.4 - 163780 -163779.6 What is the difference between 0.2 and -0.0521? 0.2521 What is the distance between -0.5 and 5968.65? 5969.15 -337160+-5 -337165 Work out -39 + 264550. 264511 What is 3.91 - -3? 6.91 Sum 0.2 and 0.661. 0.861 287+-2583 -2296 28.7082 - 0.19 28.5182 Sum -43 and 2038.8. 1995.8 What is -1 - -8.7? 7.7 What is 0 + -20698.4? -20698.4 What is 0.3 minus 1924? -1923.7 Put together -0.193 and -18. -18.193 5.6+-11191 -11185.4 Calculate -0.2 + 944. 943.8 What is -1.49968 plus 1? -0.49968 Sum -0.00556 and 0.4. 0.39444 Sum -0.06 and 694. 693.94 What is -255 plus -3.1? -258.1 What is 0.059 minus 0.032? 0.027 What is 0.3 + 2128? 2128.3 Work out 668.5 - 2.11. 666.39 Add 0.1 and -0.1026234. -0.0026234 What is the distance between 5 and 115930? 115925 Put together -15.8 and 0.863. -14.937 What is 0.4 take away -0.687? 1.087 What is the distance between 0.61 and -0.264? 0.874 What is -1104.4 plus -2? -1106.4 What is -53.9 take away 0.02? -53.92 Subtract -10 from -93.65. -83.65 Work out 13018 - 4. 13014 What is -2 less than -9387? -9385 Add together -0.5 and 16863. 16862.5 What is -148980 less than 0.5? 148980.5 Work out 17722 + 0.5. 17722.5 Work out 0.2 - -2047.232. 2047.432 Add -2.127203 and -0.3. -2.427203 2092 - -56 2148 Sum -5.745 and -12.53. -18.275 0.3 + 576337 576337.3 0.08621+618 618.08621 Subtract -142 from 0.03. 142.03 Calculate -16.01 + -0.4. -16.41 What is -228.3 plus -0.9? -229.2 Calculate 0 + -272.8. -272.8 What is -21 plus 122252? 122231 What is -9 - -44? 35 Calculate 3123 - 320. 2803 Put together -1.8136 and -0.6. -2.4136 Work out -26 - -57446. 57420 What is 4 - 10941.57? -10937.57 Work out 1242 + 0.06. 1242.06 What is 0.1 - 80596? -80595.9 317+-0.1712 316.8288 Subtract -0.5 from -13.19. -12.69 What is 890 less than -871? -1761 -1149 - 6 -1155 Sum -1440 and 45. -1395 Calculate 0.7 - -27612. 27612.7 Work out -0.86 + 11.54. 10.68 13 + -0.131 12.869 What is the difference between -6.7 and -20.3? 13.6 What is 3.4 take away -1931? 1934.4 328417+-2 328415 What is -1.2 + -0.03? -1.23 Work out -3 + -87.4199. -90.4199 What is 92 less than -0.06? -92.06 Sum -169 and 108. -61 Calculate 397256 + -28. 397228 What is -0.5 less than -200994? -200993.5 Work out 966 + -0.1. 965.9 What is -5 take away -232? 227 Calculate 0.331 - 2. -1.669 What is the difference between 91694 and 5? 91689 0.26534+-9 -8.73466 Add together -0.083 and -1.03. -1.113 Sum -0.19541 and -0.4. -0.59541 Subtract -5613 from -3. 5610 Calculate -1278 + -0.062. -1278.062 Work out 0.263 - 2.32. -2.057 What is 19 + 14616.4? 14635.4 What is 12284.7 - -2? 12286.7 What is -49 - -11.4? -37.6 What is -2 minus 3.56? -5.56 -353 + -25.08 -378.08 Subtract 505 from 33. -472 Put together -2 and 2366. 2364 Calculate -3 + 190.4. 187.4 Subtract -1097 from 0.17. 1097.17 What is 0.1 less than -2735789? -2735789.1 What is 4.7516 - 29? -24.2484 What is 0.0326 plus -67? -66.9674 -5+0.05595 -4.94405 What is -42.05 take away -2? -40.05 What is 0.147037 minus 27? -26.852963 Calculate -112877 + -3. -112880 What is -0.186 minus -1.007? 0.821 What is 0.1 minus 626.25? -626.15 Work out 13 + -13. 0 -0.8+44.5 43.7 Put together 0.3 and 69.1. 69.4 Sum -0.4 and -0.8899. -1.2899 -1709.868 + 0.3 -1709.568 Work out 11.4 - -2307. 2318.4 Subtract 148746 from 0.3. -148745.7 What is 3.2894 + -2? 1.2894 6.153 + -0.041 6.112 0.331+1 1.331 Sum -88 and 1.5. -86.5 Sum 0.33 and -0.612. -0.282 Calculate 1 + -1104.77. -1103.77 Sum 5 and 141. 146 What is -0.2 take away -4795? 4794.8 Work out -0.2 + -743. -743.2 What is -0.4 minus 47391? -47391.4 What is the difference between 0.019883 and -0.2? 0.219883 Calculate 23 + -20372. -20349 Put together -463.17 and 9. -454.17 Work out -16400 + -1. -16401 Calculate -0.09 + 13.1. 13.01 Calculate -349 + 1547. 1198 What is the distance between 1.88881 and -0.4? 2.28881 Sum 0.3 and -4558. -4557.7 -0.311 - -1551.2 1550.889 What is -27.6 + 28306? 28278.4 Calculate -0.283 - 5.6. -5.883 -124 + 39 -85 Calculate 2071 - 140. 1931 What is 2.486 less than 0.5? -1.986 Calculate -0.4444 + 2.3. 1.8556 Add 0.20862 and -0.6. -0.39138 What is 3 less than 3969? 3966 -6 - 1900 -1906 Add -0.1 and 0.332367. 0.232367 What is -26 - -0.158? -25.842 Calculate -264 + -7328. -7592 Sum 3 and 188. 191 Subtract -8532 from -25. 8507 Put together 2048.8 and 8. 2056.8 What is 4852 take away 0.041? 4851.959 Calculate 9.277 - -432. 441.277 What is -70362 minus -0.1? -70361.9 Total of -6.1 and -7373. -7379.1 Work out -35 - 95. -130 Total of -11.3378 and 0.2.	{ "pile_set_name": "DM Mathematics" }
4171 + 51685 for n. 57 Solve 55v + 2617 - 826 = -3819 for v. -102 Solve 0 = -2035p + 947p + 948p - 11620 for p. -83 Solve -49v + 0v + 110 = -39v for v. 11 Solve 2981 = -11032a + 10761a for a. -11 Solve 2678 = 13593724l - 13593518l for l. 13 Solve 7936 = 26m + 30m + 488 for m. 133 Solve 432n + 3345 = 228n - 2571 for n. -29 Solve 78l + 4116 = 2010 for l. -27 Solve 313o + 242986 = -5699o - 322008 + 78022 for o. -81 Solve -27t + 63792 - 91986 = 102t + 93t for t. -127 Solve -10570 = -941b - 120b + 14894 for b. 24 Solve 80j = -9j - 125j + 2354 for j. 11 Solve 4870 + 5338 = -352f for f. -29 Solve 298n + 4110 + 9992 + 3778 = 0 for n. -60 Solve -13306 - 17081 + 987 = 420r for r. -70 Solve 3k - 5k - 2000 = -66k + 24k for k. 50 Solve 13d - 15d - 2622 = -40d + 38 for d. 70 Solve -1365z - 5031 = 25981 + 5843 for z. -27 Solve -555b - 1132b = 25514 - 104803 for b. 47 Solve 703n = 36n + 13n - 1074n - 134784 for n. -78 Solve 172v = 1331 + 3668 - 183 for v. 28 Solve 13991 = -43n + 155n + 147n + 41445 for n. -106 Solve -765g + 1461g - 771g = -140 - 7885 for g. 107 Solve 3844924d - 3844872d + 2548 = 0 for d. -49 Solve -104q + 0q - 346q - 662q = -4448 for q. 4 Solve -3341r + 1701r + 323454 = 1760r + 3482r for r. 47 Solve -4262842y = -4262926y - 5964 for y. -71 Solve 145j = 2939278 - 2939858 for j. -4 Solve 1538 + 3404 = 75b + 367 for b. 61 Solve 5947 - 15708 = -521z + 26082 - 7709 for z. 54 Solve -48q - 71q - 12136 = 29q for q. -82 Solve 0 = 6254q + 239983 + 123236 - 88043 for q. -44 Solve -591 = 109m - 5496 for m. 45 Solve 38049 + 6681 = 639t - 48790 + 24508 for t. 108 Solve -8y - 16y = -67618 + 66634 for y. 41 Solve -123g = -184g + 2444g + 2455g - 24190 for g. 5 Solve 3784f - 212346 = 434f - 1168f for f. 47 Solve 55324t = 55286t - 2052 for t. -54 Solve -294g + 614g - 6419 = -597g for g. 7 Solve -181q + 1794 = 244q - 100q - 481 for q. 7 Solve 207405 - 192861 = -32j + 234j for j. 72 Solve -5d + 2d + 64 - 62 + 121 = 0 for d. 41 Solve 15636w = 11889w + 131145 for w. 35 Solve 5852n - 1388 - 1096 = 5760n for n. 27 Solve 9867m - 4722m = -540225 for m. -105 Solve 0 = 175q + 251200 - 234400 for q. -96 Solve -1362l + 45382 + 2288 = 0 for l. 35 Solve 328 + 6190 = 326c - 2610 for c. 28 Solve -1394s + 716s + 15039 + 10047 = 0 for s. 37 Solve 2637 = 229b - 1423 - 62 for b. 18 Solve 1005283 = 6673u + 7098u for u. 73 Solve -3384 + 31699 = 1283z + 4483 - 49299 for z. 57 Solve -29525 - 48460 = 1322f - 2553f - 17666 for f. 49 Solve -3707 = -18h - 2861 for h. 47 Solve -4486478 + 4484245 = 29l for l. -77 Solve 438t = -80t + 14450 + 14558 for t. 56 Solve 47845 + 35975 = -3307t + 1402t for t. -44 Solve -222r + 4937 = -638r - 8375 for r. -32 Solve -4050d = -4166d - 1160 for d. -10 Solve 3987r = -1358r + 187854 + 423596 - 167815 for r. 83 Solve 12795 + 16552 = 546f + 2593 for f. 49 Solve -407198 = 1184g - 286430 for g. -102 Solve -78h = -105h - 901h - 72431 + 9327 for h. -68 Solve g + 2743 = 4g + 2842 for g. -33 Solve 61g - 541g + 0g = -20160 for g. 42 Solve -4955d - 2637d = -1473d - 243898 - 514858 for d. 124 Solve -207w + 3050 = -85w for w. 25 Solve 575d - 145d + 111910 = -583d - 792d for d. -62 Solve 457y = 76y - 681y + 60534 for y. 57 Solve 15v - 83 - 324 = -182 for v. 15 Solve -1491410n + 1491438n = 1372 for n. 49 Solve 0 = 948g - 1188g + 1200 for g. 5 Solve 1885o = -346o - 84778 for o. -38 Solve 121s = -11s - 1022s + 63470 for s. 55 Solve 719b + 144552 = 4523b for b. 38 Solve 394z - 40975 = -351z for z. 55 Solve 0 = 5699s - 5740s - 1909 - 551 for s. -60 Solve 18r + 1032 = -25r - 602 for r. -38 Solve -976r + 11439 = -40r + 335r for r. 9 Solve -112418 + 67236 = -3991v - 2508 + 204768 for v. 62 Solve 237p = 543 + 168 for p. 3 Solve 0 = 46742i - 46630i + 46 + 5778 for i. -52 Solve -7486w + 2319w - 795718 = 0 for w. -154 Solve -1152d + 1161d = 7596d + 43396 + 540803 for d. -77 Solve 10528j + 172013 = -41195 + 13176 for j. -19 Solve -84g + 185 - 2540 - 1495 = 350 for g. -50 Solve 88h + 564 = 1073 + 2131 for h. 30 Solve -1372u - 1366u - 18128 - 72157 = 147921 for u. -87 Solve 920n + 9768 = -7n - 11553 for n. -23 Solve -18033 = -355z + 1103z + 24461 - 6590 for z. -48 Solve 414b = 1937 - 3880 + 1943 for b. 0 Solve -52y + 1344 = 2766 - 1214 for y. -4 Solve 214649 = 7k + 214446 for k. 29 Solve -601f - 147711 = 2186f for f. -53 Solve 6887d - 1207d + 4093 = -302627 for d. -54 Solve -398w = -155w + 3402 for w. -14 Solve 287 - 582 = 492c - 787 for c. 1 Solve 3487t - 3443t - 704 = 0 for t. 16 Solve -353312 = 7168d + 1792d - 39712 for d. -35 Solve 18d = -37d + 3d + 22d + 510 for d. 17 Solve -14089q + 775559 - 229305 + 496332 = 0 for q. 74 Solve 839r + 6848 + 28800 = -27431 + 7705 for r. -66 Solve -4985h = -5571h + 8204 for h. 14 Solve -42q - 66 = 1336 + 362 for q. -42 Solve 0 = -33522q + 33211q - 1244 for q. -4 Solve 541224o + 5115 = 541565o for o. 15 Solve 410f + 42000 = -51f - 289f for f. -56 Solve 2161l - 3775l = -1927l - 21597 for l. -69 Solve -731x + 61380 = -1413x for x. -90 Solve 686g + 232 = 3571 + 1616 + 2591 for g. 11 Solve -448p + 26435 = 635p + 472p for p. 17 Solve 21525 + 25741 = -670c + 11756 for c. -53 Solve -5a = 20a + 3a - 308 for a. 11 Solve -118d - 17d - 3d = 12144 for d. -88 Solve 2228t = -202t - 164446 + 205944 + 208792 for t. 103 Solve -176b = 1327b + 1639b - 230604 - 20756 for b. 80 Solve -1256c + 869c + 794c = 15767 + 14351 for c. 74 Solve -53 + 624 + 455 = -27s for s. -38 Solve -82h - 6420 = 183h - 325h for h. 107 Solve 438l - 4307 + 1012 = 4151 for l. 17 Solve 164b + 593b = 13626 for b. 18 Solve -1421575i + 32760 = -1420639i for i. 35 Solve 231u - 4545 = -1749 + 4365 for u. 31 Solve -1722a - 6300 = 1662a - 3474a for a. 70 Solve 6633 - 8562 - 5131 = -984h + 5732 for h. 13 Solve 133 = -12i - 59 - 109 + 25 for i. -23 Solve 1398v + 2559v + 106839 = 0 for v. -27 Solve -1579x - 58921 = 2518x + 756x + 101228 for x. -33 Solve 18666 + 320979 = -3713x + 68596 for x. -73 Solve 1592519u = 1591789u - 1460 for u. -2 Solve -7519 = 52g - 6323 for g. -23 Solve 55x + 27x = -3321 - 1371 + 100 for x. -56 Solve 0 = 3866f - 2488f - 34450 for f. 25 Solve -1719992 + 1727592 = 190p for p. 40 Solve 2097r - 1994r = 1751 for r. 17 Solve -67g - 90g - 11037 = 9g + 117g for g. -39 Solve -1051y + 787y - 6336 = -200y for y. -99 Solve 2297i + 6919 = 2173 - 6739 for i. -5 Solve -145c - 4136 - 800 + 1601 = 0 for c. -23 Solve -707x - 573x - 511x = -314x + 82712 for x. -56 Solve -506m + 7m = -87m - 12772 for m. 31 Solve 0 = 33449s - 33425s - 72 for s. 3 Solve -226o - 28404 = 243o + 1058o - 8553 for o. -13 Solve 0 = -3137g - 3426 + 31659 for g. 9 Solve -3387 + 2628 = -23c for c. 33 Solve -54j + 36284 - 22590 = 416j - 30486 for j. 94 Solve 338u - 721u - 3064 = 0 for u. -8 Solve -74636 + 134988 = -6638v - 185254 for v. -37 Solve 1593p + 14036 = 1714p for p. 116 Solve 54o + 116o - 14976 = -64o for o. 64 Solve 175u + 61160 - 15724 = 1124u + 279u for u. 37 Solve 215i + 464 + 72 = 284 - 823 for i. -5 Solve 19t - 3t - 7 + 5 = -178 for t. -11 Solve 59k + 477 = -614 + 206 for k. -15 Solve 573088i - 573553i + 34875 = 0 for i. 75 Solve -241x = -273 + 6298 for x. -25 Solve -1524z + 3387z - 175878 = -1394z for z. 54 Solve -995c - 20575 = 1347c + 472 + 7057 for c. -12 Solve 43391 = -2708t + 768t - 38089 for t. -42 Solve 104424 + 33332 = -1316c - 2661c + 26400 for c. -28 Solve 6773 - 445 = -8005s + 1677s for s. -1 Solve -2061r - 3559r + 25531 = 155r - 448019 for r. 82 Solve -8236o + 7830o - 9744 = 0 for o. -24 Solve 1266i - 315306 = -238080 for i. 61 Solve -127f + 242f = -121f - 45212 + 29400 for f. -67 Solve -2413 + 265 = 1074p for p. -2 Solve -3995o - 167015 = 56082 - 55307 for o. -42 Solve -79l - 884 = -2228 - 2290 for l. 46 Solve 91y - 1918 = 794 + 1019 for y. 41 Solve 23045 = -1075q + 93995 for q. 66 Solve -2831h - 94617 + 12518 = 0 for h. -29 Solve -7581 = 162l + 681l + 5907 for l. -16 Solve -2935v = -2882v + 265 for v. -5 Solve 132j = -1689j - 9105 for j. -5 Solve -1013f = 5264	{ "pile_set_name": "DM Mathematics" }
sqrt(28) + -4). -75sqrt(7) + 292 Simplify ((-1sqrt(60) - sqrt(60))/sqrt(6) - sqrt(10))/sqrt(5). -3sqrt(2) Simplify 2(sqrt(17) + sqrt(17) + sqrt(1275)/sqrt(3))6. 84sqrt(17) Simplify (sqrt(15)/(sqrt(15)/sqrt(5)))*22. 10 Simplify -4((-4sqrt(420))/sqrt(10))/sqrt(6). 16sqrt(7) Simplify (sqrt(18)/sqrt(9))24 + sqrt(20)/sqrt(10) + 3. sqrt(2) + 11 Simplify (sqrt(605) - ((1 + sqrt(605) - sqrt(605)) + -3 + sqrt(605)))*2 + -4((-2sqrt(605))2 - sqrt(605)). -9676 + 44sqrt(5) Simplify sqrt(17) - (sqrt(17) - sqrt(102)/(-5sqrt(6) - sqrt(6) - sqrt(6))) - sqrt(204)/(sqrt(48)/sqrt(4)). -8sqrt(17)/7 Simplify ((3sqrt(132) + sqrt(132))/sqrt(12) + sqrt(66)/(-1sqrt(6)))5. 15sqrt(11) Simplify (sqrt(25)/(sqrt(5)-3))2 + (sqrt(5) + sqrt(40)/sqrt(288))2. 265/36 Simplify (sqrt(175) + -2)2 - (5 + sqrt(21)/sqrt(3)). -21sqrt(7) + 174 Simplify (3(sqrt(119) - -2sqrt(119)))/((sqrt(49) + sqrt(196)/sqrt(4))/sqrt(7)) + 5. 5 + 9sqrt(17)/2 Simplify -1(sqrt(3)-1-5 - (sqrt(3) - (1 + sqrt(3)))-6). -5sqrt(3) + 6 Simplify (sqrt(1872) + 0 + sqrt(52)-6)2. 0 Simplify sqrt(35)/(sqrt(21)/sqrt(3)-3). -sqrt(5)/3 Simplify ((1sqrt(24))/sqrt(3))/(sqrt(4) - sqrt(16)/sqrt(4)-3)2. sqrt(2)/2 Simplify sqrt(720)-3 + 3. -36sqrt(5) + 3 Simplify ((1 + sqrt(1900))5 - 2(sqrt(1900) + -1 + sqrt(1900)))2. 140sqrt(19) + 1949 Simplify -6(-4 + 2sqrt(153)). -36sqrt(17) + 24 Simplify 1(sqrt(5) + (sqrt(5) - (5 + (sqrt(45))*2))). -50 + 2sqrt(5) Simplify (-3 + sqrt(1900) + 1 + 3)*2. 20sqrt(19) + 1901 Simplify -22sqrt(832) - 6(-1 + sqrt(832)). -80sqrt(13) + 6 Simplify (sqrt(320)/sqrt(10))*2-1-5. 160 Simplify (1 + (sqrt(66)1)/sqrt(6) + sqrt(11))5. 5 + 10sqrt(11) Simplify sqrt(252)-2 + 0. -12sqrt(7) Simplify -4 + 1 + sqrt(2736) + sqrt(2736) + sqrt(2736). -3 + 36sqrt(19) Simplify (((sqrt(450)-3)/sqrt(10))/(sqrt(729)-2 + sqrt(729)))2. 5/9 Simplify (-1(sqrt(156) + sqrt(156)1))/(sqrt(192)-1). sqrt(13)/2 Simplify 2 + 0 + sqrt(13)-1. -sqrt(13) + 2 Simplify (-5 + (sqrt(133)1 - sqrt(133))/sqrt(7))*2 + -2. 23 Simplify (sqrt(847) + 0 + 0 + (sqrt(847) - (sqrt(847) - 2sqrt(847) - sqrt(847)) - sqrt(847)) + 5)*2. 330sqrt(7) + 7648 Simplify -1 + 1(sqrt(12) + -3). -4 + 2sqrt(3) Simplify 2(2 + sqrt(243) + sqrt(243) - (-6(sqrt(3) + -2))*2). -500 + 324sqrt(3) Simplify sqrt(117) + 2 + 1 + ((sqrt(130)22)/sqrt(10))*2. 3sqrt(13) + 211 Simplify (sqrt(78)-1-3 + sqrt(78))/(sqrt(54) - 1sqrt(54) - sqrt(6)). -4sqrt(13) Simplify 2 + (-6(sqrt(891) + -1) - sqrt(891)). -63sqrt(11) + 8 Simplify (sqrt(704) - 1sqrt(704))2 + (-1 + sqrt(11) + 3)2. 4sqrt(11) + 15 Simplify ((-2 + sqrt(3) + 5)3)2. 54sqrt(3) + 108 Simplify (((0 + sqrt(19))-5)2 - (4 + 2sqrt(19) + sqrt(19))) + 1. -3sqrt(19) + 472 Simplify ((sqrt(187) + sqrt(187) + (sqrt(187) - (sqrt(187) + sqrt(187)-3)))/sqrt(11) - (3 + (sqrt(17) - (sqrt(17)1 - sqrt(17)))))2. -24sqrt(17) + 281 Simplify (-2(-2sqrt(45) + sqrt(45)))*2. 180 Simplify ((-1sqrt(324) - sqrt(324))/sqrt(9))/(sqrt(1452)-2). sqrt(3)/11 Simplify (sqrt(54)/(sqrt(9) - ((sqrt(9) - (sqrt(9) - sqrt(72)/sqrt(8))) + sqrt(9))))/(sqrt(162)/sqrt(6)). -sqrt(2)/3 Simplify -5 + (sqrt(21)/sqrt(3)-6 + (sqrt(28) + sqrt(7))-5 + sqrt(7))2. 2795 Simplify ((sqrt(187)2)/sqrt(11) - (sqrt(17) + sqrt(1377) + 1))*2. 16sqrt(17) + 1089 Simplify (((sqrt(1872) + 1)-3 - sqrt(1872)) + sqrt(1872) + (sqrt(1872) - -2sqrt(1872)1))2. 9 Simplify (sqrt(64)-2)/(2sqrt(8)2). -sqrt(2) Simplify (1 + sqrt(612) - (2 + (sqrt(17) + -2 + sqrt(17))*2))-3. -42sqrt(17) + 219 Simplify (2(-4sqrt(7) + sqrt(7) + sqrt(7)) + 3)2. -24sqrt(7) + 121 Simplify sqrt(6)/(sqrt(6)/sqrt(3)5) + 5. sqrt(3)/5 + 5 Simplify ((1sqrt(85)2 - sqrt(85)) + sqrt(85) - sqrt(85))/((-2sqrt(45))/sqrt(9)). -sqrt(17)/2 Simplify 0 + (-1 + sqrt(720) + 1 + sqrt(720))*2. 2880 Simplify 3 + sqrt(22)/(sqrt(24)/(sqrt(84)/sqrt(7)) + sqrt(2)). sqrt(11)/2 + 3 Simplify -4 + (3(2sqrt(70) - sqrt(70)))/sqrt(10). -4 + 3sqrt(7) Simplify (3 + 6sqrt(1053))2. 324sqrt(13) + 37917 Simplify sqrt(2448)-1 - ((sqrt(170) - ((sqrt(170) - -4sqrt(170)) + sqrt(170)))/sqrt(10))*2. -425 - 12sqrt(17) Simplify (-4(sqrt(1088) - (sqrt(1088) + 2sqrt(1088) + sqrt(1088))5)6)*2. 226234368 Simplify (sqrt(11) + sqrt(11)-2-4 + (2sqrt(88))/sqrt(8) + sqrt(66)/(1sqrt(6)5))*2. 34496/25 Simplify (-4sqrt(108))/(3sqrt(30)/sqrt(5)). -4sqrt(2) Simplify -1(sqrt(96)/sqrt(3)2)*2. -128 Simplify (4(sqrt(12) + (sqrt(12) - (sqrt(108)1 - sqrt(12)) - sqrt(12))))2. 192 Simplify ((1sqrt(204) + sqrt(204))/sqrt(12))*2 + sqrt(102)/(sqrt(6) - sqrt(150)). -sqrt(17)/4 + 68 Simplify ((sqrt(720)/sqrt(9) + sqrt(55)/sqrt(44))4 + -5)*2. -180sqrt(5) + 1645 Simplify (-2sqrt(300) + 2)2-3. -3612 + 240sqrt(3) Simplify (sqrt(10)/(2sqrt(72) - sqrt(72)))*2 + 3 + 4. 257/36 Simplify sqrt(252)2 - (0 + sqrt(63))4. 0 Simplify 3 + sqrt(192) + ((1 + sqrt(192) + sqrt(192))2 - sqrt(192)) - (sqrt(192) + 2(sqrt(192)-2)2). -764 + 24sqrt(3) Simplify 4(sqrt(539) + -1 - 2sqrt(176)). -4sqrt(11) - 4 Simplify sqrt(63)/(sqrt(324)3). sqrt(7)/18 Simplify -4 + ((-1sqrt(33))/sqrt(11))2. -1 Simplify (sqrt(1872) - (sqrt(1872) + 3sqrt(1872) - sqrt(1872)))*2 - 5(sqrt(52) + 3). -10sqrt(13) + 7473 Simplify 4 + (sqrt(17) - sqrt(68)/sqrt(4)) + sqrt(85)/sqrt(5)-3. -3sqrt(17) + 4 Simplify (-6sqrt(153)-1 + sqrt(153))/sqrt(9). 7sqrt(17) Simplify sqrt(24)/(sqrt(200)-6)2. -sqrt(3)/15 Simplify (5 + (sqrt(99) - (sqrt(99) + 2)))*2 - sqrt(99). -3sqrt(11) + 9 Simplify (sqrt(2) + 4(sqrt(2) - sqrt(8)/sqrt(4)) - (sqrt(12)/sqrt(6)-4 + sqrt(2)))*2. 32 Simplify ((sqrt(275) + 3 - sqrt(275)) + -2)6. 6 Simplify (4(sqrt(300) - -1sqrt(300))-6)2. 691200 Simplify (sqrt(13) - ((sqrt(156)-1)/sqrt(12))*2) + -2. -15 + sqrt(13) Simplify (-1sqrt(128))*24-4. -2048 Simplify sqrt(45) + 2 + (-2 + 0 + sqrt(5))2. -sqrt(5) + 11 Simplify (sqrt(2)24 - sqrt(10)/(sqrt(5)-1))*2. 162 Simplify 1(1 + sqrt(2) - sqrt(2))2 - (sqrt(128) + sqrt(8))2. -199 Simplify (sqrt(1088) - (-2 + sqrt(1088) + 0 - sqrt(1088) - sqrt(1088)))*2. 64sqrt(17) + 4356 Simplify (-5 + sqrt(176) + -1sqrt(176) + sqrt(176))2. -40sqrt(11) + 201 Simplify sqrt(168)/sqrt(6) - (sqrt(7) + (3(-1sqrt(7) + sqrt(7)))*2). sqrt(7) Simplify (sqrt(72)-2)*2 + sqrt(72) - (sqrt(2) - (sqrt(18) + 2 - sqrt(2))). 7sqrt(2) + 290 Simplify (3 + (sqrt(72) - sqrt(72)13))*2. -72sqrt(2) + 297 Simplify (21sqrt(320) - sqrt(320) - (sqrt(320) - (-1sqrt(320) + sqrt(320)))1)*2. 0 Simplify (-1 + sqrt(1539) + -1 + 1 + 1sqrt(1539))4. -4 + 72sqrt(19) Simplify 1(sqrt(2299) - ((sqrt(2299) - ((sqrt(2299) - 1sqrt(2299))*2 + 4)) + sqrt(2299) + sqrt(2299))). -22sqrt(19) + 4 Simplify (sqrt(209)/(2sqrt(1100) + sqrt(1100) - sqrt(1100)))2. 19/400 Simplify (sqrt(10)/sqrt(2))263. 90 Simplify -5-1(-1sqrt(200) - sqrt(200))2. 4000 Simplify (-1 + sqrt(130)/sqrt(10) + -1)2-3. -51 + 12sqrt(13) Simplify ((3sqrt(9)1)/(sqrt(108)1 + sqrt(108)))2. 3/16 Simplify -4 + (sqrt(2736)-2 - sqrt(2736) - sqrt(19)). -37sqrt(19) - 4 Simplify (4(5 + (sqrt(2) - sqrt(2)1)))2. 400 Simplify ((sqrt(343) + sqrt(343) + 0 + sqrt(343))-2)*2. 12348 Simplify -1sqrt(20)-4. 8sqrt(5) Simplify 3(sqrt(80) + sqrt(5) - sqrt(5))2-3. -720 Simplify 4(sqrt(2)3-1 - (4 + sqrt(72)))2. 288sqrt(2) + 712 Simplify -1 + (sqrt(6)/(sqrt(6)/sqrt(3)))*2 + 2. 4 Simplify sqrt(384)/((sqrt(80) + (sqrt(80)-2 - sqrt(80)))/sqrt(10) + sqrt(8)). -4sqrt(3) Simplify 2 + sqrt(28)/sqrt(4) - (sqrt(21)/sqrt(3) + sqrt(7) + -5). -sqrt(7) + 7 Simplify (sqrt(684) + 2 + sqrt(684) - (sqrt(19) + -5 + sqrt(304))) + 5. 12 + 7sqrt(19) Simplify sqrt(14)/(sqrt(196)/sqrt(2)). sqrt(7)/7 Simplify ((sqrt(231)2)/sqrt(7) + sqrt(33))/(sqrt(3) - sqrt(27)-6). 3sqrt(11)/19 Simplify ((sqrt(2700) - sqrt(2700)-3)/sqrt(9))*2. 4800 Simplify ((1 + sqrt(1900) + 0 + -1)-1)2. 1900 Simplify 5 + (sqrt(13) + 0)2 + (0 + sqrt(13) + 5)*2. 10sqrt(13) + 56 Simplify ((1sqrt(98))/sqrt(2))/(sqrt(21)/sqrt(108)). 6sqrt(7) Simplify 0 + sqrt(152)/(sqrt(24)/sqrt(3)) + ((sqrt(19)-2)2 + -2)-2. -148 + sqrt(19) Simplify (6-5(sqrt(175) - (sqrt(175) + 1)))*2. 900 Simplify (sqrt(7) - sqrt(49)/(1sqrt(7))) + -4. -4 Simplify -2 + sqrt(91)/sqr	{ "pile_set_name": "DM Mathematics" }
ue of 40/42(-2)/(-8)? 5 ((-180)/(-63))/(-10)14/8 -1/2 Evaluate 6(-2)/(-8(-4)/8). -3 Calculate (136/468)/((-1)/(-2)). 1/3 Calculate (-14)/3(-204)/238. 4 ((-21)/(-7))/(12/4) 1 What is (225/6)/(-5)2/12? -5/4 (2/(-8))/((-17)/136) 2 What is the value of 28/112(-4)/(-12)? 1/12 Evaluate (350/105)/((-20)/(-6)). 1 Calculate 2(-7)/(-14)-3. -3 Calculate 40(-6)/(420/14). -8 Calculate 2((-10)/4)/1. -5 Calculate 13/262/2. 1/2 Evaluate (-21)/((-60)/90). 3 What is the value of 48/((-352)/(-11))? 1 Evaluate (-2(-4)/20)/((-5)/75). -6 Calculate (6/4)/(102/544). 8 ((-16)/20)/(-3(-2)/(-30)) 4 (70/14)/(25/15) 3 What is ((-4)/(-8))/(6/(-84))? -7 (-10)/618/(-5) 6 What is 11/(-77)(-84)/32? 3/8 Evaluate 640/(-2640)3/4. -2/11 What is the value of 5/(-1)14/14? -5 What is the value of ((-6)/246)/(9/(-24))? 4 What is (-3)/232/3? -2/23 Evaluate ((-186)/1240)/((-1)/(-4)-1). 3/5 What is (3/3-1)/((-5)/5)? 1 What is the value of (2/10)/(232/(-870))? -3/4 Evaluate (-2)/(-2)(-88)/44. -2 Evaluate ((-7)/14)/(-11/(-8)). -4 Calculate 8/(-6)(-24)/(-64). -1/2 What is (-189)/(-243)(-6)/(-14)? 1/3 What is (-9)/68/(-6)? 2 Evaluate -930/(-80)32/(-12). -9 What is 5/150/(-2)-1? 0 What is the value of ((-1)/(-2)1)/((-13)/(-26))? 1 (0/(-1))/(1(-2)/2) 0 Evaluate (35/10)/(-7)4/6. -1/3 Evaluate ((28/(-1))/(-7))/((-2)/1). -2 Calculate (5/10)/(3(-2)/(-24)). 2 Evaluate 1((-4)/(-5))/((-162)/(-45)). 2/9 ((-8)/7)/((-64)/224) 4 What is the value of (9/(-2))/((84/(-8))/7)? 3 (126/20)/796/216 2/5 What is the value of (1/(-3))/((-9)/36)? 4/3 Evaluate (-1)/(((-6)/1)/18). 3 What is (2/(4/(-2)))/((-34)/(-4))? -2/17 What is the value of 22/(-231)21/33? -2/33 What is the value of (12/10)/(2/20-3)? -4 Calculate 12/905/4. 1/6 What is ((-8)/20)/((-4)/25)2? 5 What is ((-2)/(-3))/((-6)/9-7)? 1/7 Evaluate ((-33)/33)/((-11)/2). 2/11 What is ((-7)/(-12))/(73/(-146))? -7/6 Evaluate (-18)/8(-6)/27. 1/2 What is (6/(-33))/((-54)/198)? 2/3 Calculate 4/24123/2. 3 Calculate (-5)/(-2)408/(-255). -4 What is the value of (8/(-2))/((-280)/490)? 7 (5/20)/((-1)/3-1) 3/4 What is (7/(-6)2)/((-147)/126)? 2 Calculate ((-32)/32)/((-2)/(-6)). -3 ((-42)/49)/(6/(-21)) 3 What is the value of (((-4)/(-1))/12)/1-6? -2 (-114)/3046/9 -1/4 What is the value of (-2)/20(-4)/24? 0 Evaluate 2/(-2)161/23. -7 What is (2/5)/(496/(-310))? -1/4 Evaluate ((-6)/2)/128/(-126). 2/3 What is the value of (-16)/((-416)/65)(-36)/(-10)? 9 Evaluate (3/726)/((-2)/8). -1 Evaluate ((-2)/(-12))/((12/(-2))/(-12)). 1/3 ((-4)/(-15))/((-72)/108) -2/5 What is the value of (-11/1)/((-1976)/(-304))? -2/13 Evaluate (11/2)/(9/2). 1/9 1/(12/(-24)2/(-3)) 3 Calculate ((-58)/(-348))/((-3)/(-4)). 2/9 What is (-28)/741/(-2)? 8 2/(-16)(-16)/6 1/3 What is the value of ((-163)/(-326))/((-1)/14)? -7 Calculate (-211)/(78/78). -2 Calculate ((-6)/(-10))/(-28/80). -3 Calculate ((-168)/462)/(6/(-22)). 4/3 Evaluate ((-3)/((-45)/(-40)))/(8/12). -4 Evaluate 1014/(-385)(-2)/(-4). -2/11 What is 5/2(-16)/20? -2 ((-116)/87)/((-44)/(-6)) -2/11 What is the value of (-3)/((12/2)/(440/44))? -5 Evaluate 990/(-220)(8/6)/1. -6 Evaluate (-9)/(-6)(-24)/9. -4 (-1)/(-3)9/(-1)1 -3 3/41/((-45)/6) -1/10 What is the value of (224/84)/(7/(7/(-2)))? -4/3 Evaluate 16/10(2365/(-44))/(-43). 2 Calculate 7/(126/3)3/(-1). -1/2 Evaluate (10/(-20))/(-1(-1)/10). -5 ((-96)/(-128))/(15/80) 4 (-6)/4(-2)/(-5) -3/5 Evaluate (-15)/20288/54. -4 ((-2)/(-161))/(14/98) 2/23 What is ((-9)/(18/(-4)))/(2/2)? 2 13/((-3)/1) -1 Calculate 15/65/(75/(-24)). -4 What is 1((-11)/22)/((-5)/90)? 9 What is ((-92)/(-23))/(1(-1)/1)? -4 What is ((-6)/(-9))/(2/12)-1? -4 What is the value of (-84)/(-140)125/45? 5/3 What is ((-6)/(-165))/((-39)/(-429))? 2/5 What is 3/4(57/(-18))/(-19)? 1/8 Evaluate 2/(-5)45/(-6). 3 What is the value of (15/20-4)/(-3)? 1 What is (3/(-12))/(1/(-8)2)? 1 Evaluate 1/24/8. 1/4 Evaluate -1(35/5)/7. -1 Evaluate (-156)/39(-1)/30. 2/15 What is the value of (-112)/(-112)-214/4? -7 Calculate (396/(-18))/((-3)/(-6)-4). 11 Evaluate 08/(-104)(-1)/(-2). 0 What is ((-12)/(-15))/((-78)/(-65))? 2/3 Calculate ((-4)/(-2))/((-4)/(-16)-2). -4 ((-111)/37)/((-2)/(4/(-3))) -2 What is -4(-1)/23/14? 3/7 Evaluate (-6)/(512)4. -2/5 Evaluate 28/816/(-28). -2 What is the value of (3/(-12))/(2/8)? -1 (4/1221/14)/(-2) -1/4 Calculate ((10/(-2))/1)/1. -5 What is the value of 18/(-72)(-32)/28? 2/7 What is the value of (83/72)/(1-1)? -1/3 (-2)/(124/166) -1/9 What is the value of 37(-8)/168? -1 Calculate (4/(-6))/((-34)/(-153)). -3 Evaluate (-2)/(-30)(-80)/(-24). 2/9 (1/10)/((-12)/20) -1/6 Calculate -21(-4)/12024/28. 3/5 Evaluate ((-30)/(-10))/(4/123). 3 What is the value of ((-1)/(-3))/((-1)/4)? -4/3 Calculate (-20)/2((-9)/(-6))/3. -5 (294/(-490))/(3/(45/(-3))) 3 What is (12/24)/(5/20)? 2 Calculate 1/15/(-35). -1/7 What is (2/(-14))/((-2)/7)? 1/2 What is (-1)/(1/(22/(-55)))? 2/5 (((-6)/(-3))/((-5)/1))/(-2) 1/5 What is the value of ((-4)/(-10))/(24/(-15))? -1/4 Evaluate 12/(-16)(16/1)/(-4). 3 What is (2/3)/(3/9)? 2 Evaluate 3/((-15)/(-5))5. 5 Evaluate (-24)/(-18)30/(-5). -8 What is (-24)/10-3(-20)/(-16)? 9 Calculate 90/(-135)2(-6)/(-8). -1 Evaluate 20/(-50)4/16. -1/10 What is the value of 18/2(160/(-36))/(-8)? 5 Calculate ((-2)/4)/((-18)/(468/(-13))). -1 Calculate 25/225(-189)/(-3). 7 Evaluate (20/30)/(10/(-45)). -3 What is ((-200)/80)/((-2)/4)? 5 Calculate (((-66)/(-8))/11)/(2/(-8)). -3 What is the value of 6/(-2)(-28)/(-21)-1? 4 What is ((-140)/(-25))/(-4)(-16)/56? 2/5 Evaluate (-2)/((6/(-54)-6)/3). -9 (-39)/782/1 -1 18/(-12)4/(-30)-10 -2 (25/(-45))/(20/(-24)) 2/3 Calculate ((-4)/(-24))/(2/455). 3/4 What is the value of (18/54)/(1/9-1)? -3 What is 14/((-84)/5)3/10? -1/4 What is ((-2)/(-4))/(4/(-2))-12? 3 ((52/4)/(-676))/((-1)/(-4)) -1/13 10/(-1)(-9)/(-135)6 -4 10(-8)/(-320)0 0 Evaluate 1/6(-9)/(378/(-28)). 1/9 Evaluate 72/(-540)((-15)/9)/1. 2/9 What is 3(5/(-20))/(2/(-4))? 3/2 Evaluate ((-9)/45)/((4/10)/(-1)). 1/2 What is the value of (4/10)/(4/(-20)-1)? 2 What is the value of (-5)/2221/((-735)/(-28))? -2/11 Evaluate (((-2)/(-30))/(11/(-99)))/1. -3/5 What is (-98)/(-350)1-5? -7/5 Calculate 512/(-60)2/1. -2 24/605/(-2)2 -2 Evaluate (-24)/(-48)6/(-1). -3 Calculate (6/4)/(-1)(-80)/900. 2/15 What is the value of ((-1)/(-12))/(-14/(-12))? 1/4 What is ((-2)/(-32)-1)/((-227)/(-908))? -1/4 Evaluate (1/(-2))/(122/(-488)). 2 Calculate (-4)/10425/(-34). 5 What is 8/4221/(-14)? -2/7 What is ((-1)/2)/((-119)/68)? 2/7 ((-24)/(-48))/(-1(-1)/2) 1 What is ((-1)/(-1))/(2/4)? 2 What is (-10)/208/(-26)? 2/13 What is the value of ((-455)/91)/((-1)/1)? 5 What is 9/(-6)22/3? -2 Evaluate (7/(-35))/(4/10). -1/2 What is 32/8-25/20? -2 Evaluate ((0/4)/(-3))/((-2)/1). 0 What is the value of 7/3(-14)/(-245)-5? -2/3 ((-68)/(-595))/(6/7) 2/15 Calculate 61/(-427)42/(-10). 3/5 Calculate -1114/(-280)-5. -1/4 Calculate (-5)/2(-68)/85. 2 What is the value of ((-2)/1)/(((-800)/(-10))/(-8))? 1/5 Calculate (10/(-30))/((-45)/(-18)). -2/15 Calculate ((-11)/((-660)/(-18)))/((-2)/(-5)). -3/4 Calculate ((21/49)/3)/((-9)/7). -1/9 What is the value of 2/4-2(-3)/(-5)? -3/5 Calculate (105/(-28))/58/(-3). 2 What is the value of 1/((-10)/12)4/6? -4/5 What is 8/823/(-66)? -1/11 What is (-2)/(-51)(-36)/968? -2/17 What is (0(-2)/16)/(-1)? 0 What is the value of 435/112-4? -5 (15/(-10))/(31) -1/2 Calculate 52/51. 2 Calculate ((-9)/(-27))/((-7)/(-126)). 6 What is the value of (5/350)/((-8)/(-4))? 0 Evaluate 1(31)/((-663)/(-34)). 2/13 What is the value of (36/27)/(4/18)? 6 Calculate (94/(-24))/((-42)/8). 2/7 What is the value of (((-40)/15)/(-4))/(3/(-9))? -2 (-10)/(-5)(-4)/((-100)/(-5)) -2/5 Calculate (-6)/(-15)15/108-2. -1/9 What is (9/5)/(35/50)? 6 What is ((-8)/((-224)/21))/6? 1/8 (-10)/104/(-28) 1/7 (-5)/(-10)27/(-7) -1 Evaluate 8/((-48)/(-6))-1. -1 What is the value of (12/(-8))/(176/(-352))? 1/2 What is the value of 9/2888-4? -1 (2/(-20)-5)/((-1)/10) -5 Calculate (28/126)/((-57)/(-27)). 2/19 (-2)/(-2)-10(-3)/6 5 Calculate ((-2)/(-32))/((-4)/(-48)). 3/4 Calculate 36/(-27)(-15)/(-70). -2/7 Calculate 6/8184/(-483). -2/7 What is the value of (((-9)/6)/((-3)/(-1)))/2? -1/4 Evaluate (-3)/(-21)245/14	{ "pile_set_name": "DM Mathematics" }
f - 2. Let c be h(-13). Let q be -63(-4)/c. Find the first derivative of -12r + 5r + 7r + 16r*q - 24 wrt r. 48r*2 Find the second derivative of 0v + 6v3 + 252v*5 - 207v*5 - 107v*4 + 106v*4 - 296 - 6v wrt v. 900v3 - 12v*2 + 36v Find the third derivative of -339h3 - 1973h*3 + h + 3h - 14h2 wrt h. -13872 Let a(h) be the second derivative of h5/10 + 253h*4/12 - 521h*3/6 - h + 1287. What is the second derivative of a(t) wrt t? 12t + 506 Suppose -t + 10 = t, -5k = 5t - 13260. What is the third derivative of -42d3 + 2802d*2 - 36d*3 - kd*2 wrt d? -468 What is the second derivative of 1558 + 2f - 887 + 2737 + 4f - 5f - 9304f2 wrt f? -18608 Let f(w) be the second derivative of 0w*2 + 0w*5 + 14/3w*4 + 0w*3 + 1 - 37w - 1/14w7 + 1/30w*6. What is the third derivative of f(p) wrt p? -180p*2 + 24p Suppose 5w - 16 = -6. Suppose -wf + 11 - 3 = 0. What is the second derivative of -5a + 4a - 8af + 3a + 3a wrt a? -96a*2 What is the third derivative of 5318r*3 - 62r*2 - 750r - 9 - 26r2 + 751r - 1 wrt r? 31908 Find the second derivative of 749 + 39i2 - 1926i - 748 - 1269i2 wrt i. -2460 Find the second derivative of 803f*2 - 547f + 950f2 - 7062f*2 wrt f. -10618 Let w(c) = -2517c*5 - c + 45. Let k(g) = -2519g*5 - g + 46. Let x(v) = -5k(v) + 6w(v). What is the second derivative of x(z) wrt z? -50140z*3 Let t be (-36)/(-8)(-56)/(-42). Find the third derivative of 72v2 - 1288v + 1286v + 50v*t + 8v*2 wrt v. 6000v*3 Let v(k) = 5k*2 - k + 1. Let m be v(1). Suppose -5d - m = -20. Find the third derivative of -21u5 + 1006u*2 + 5u*d - 1015u*2 - 5u*3 wrt u. -1260u*2 Let h(q) = -13q*2 + 3754q - 3641. Let p(a) = 10a2 - 3755a + 3647. Let c(b) = 4h(b) + 5p(b). Differentiate c(z) with respect to z. -4z - 3759 Let n(j) be the third derivative of -4307j*6/60 - 8021j*4/24 - 7476j*2. What is the second derivative of n(b) wrt b? -51684b Find the first derivative of -281q - 248q + 496q - 272 + 444q + 739q wrt q. 1150 Let z(y) = 3y - 2. Let p be z(6). Suppose -pi + 26 + 6 = 0. What is the third derivative of -37h*3 - 9h*2 + 39h*2 + 2h*i + 8h*3 wrt h? -174 Let x(y) = 61y - 11. Let p(o) = -156 + 45o + 76o + 132. Let f(s) = 6p(s) - 13x(s). What is the first derivative of f(t) wrt t? -67 Let q be (-4)/(-8)2 - -9. Let l be 4/(-20) + 1212/q + 0. What is the third derivative of 122t + 13t2 - 11t*5 + lt - 243t wrt t? -660t*2 Let n(x) be the second derivative of 0x*4 + 0 + 79/30x*6 + 0x*5 - 28x - 47/3x3 + 0x*2. Find the second derivative of n(p) wrt p. 948p*2 Let a(l) be the third derivative of -43l*7/42 - 11l*5/20 - 5l*3/6 + 9l*2 + 7. What is the third derivative of a(t) wrt t? -5160t Let p(g) = -4833g - 1439. Let w(q) = -24152q - 7195. Let o(v) = -11p(v) + 2w(v). What is the first derivative of o(u) wrt u? 4859 Let t(g) be the first derivative of -4g + 25/2g*2 + 164 + 61g*4 + 0g*3. Find the second derivative of t(c) wrt c. 1464c Let i = 7 + -4. Suppose 35x = 36x - 4. Differentiate -x + 0 + iw - 1 - 8 wrt w. 3 Let q(d) = 1372d*2 - d - 41. Let p(i) = 2749i*2 - 7i - 83. Let c(m) = 2p(m) - 5q(m). What is the second derivative of c(w) wrt w? -2724 What is the second derivative of 5b4 + 747b + 79331 - 39670 + 3b4 + 17b*2 - 39661 wrt b? 96b*2 + 34 Find the third derivative of 42606u*6 - 43047u*6 - 99u*2 - 2216u*2 wrt u. -52920u*3 Let n(k) be the second derivative of -41k*6/15 - 3k5/20 + k4/6 - 985k2/2 + 658k. Find the third derivative of n(j) wrt j. -1968j - 18 Let u(c) = -45c*4 + 3c - 13. Let o(w) = -43 + 32 - 34 + 16w - 226w*4 - 23. Let z(g) = -3o(g) + 16u(g). What is the first derivative of z(h) wrt h? -168h*3 Let g(l) = 2l*2 - 19l + 38. Let t be g(7). Let h(o) be the first derivative of -7/5o5 + 0o*2 + 0o*4 + 0o*t - 9 - 5o. Differentiate h(a) wrt a. -28a3 Differentiate -346u*2 + 680 + 871 + 848u*2 - 2u + 876u2 + 1832 wrt u. 2756u - 2 Let n = -103 + 105. What is the third derivative of -8sn - 18s*3 + 0s*2 + 37 - 39 wrt s? -108 Let y = -28 - -47. Let h = 36 - y. What is the second derivative of hf*3 - 87f*2 + 87f*2 - 13f wrt f? 102f Find the first derivative of 1865 - 37j - 290 + 221j2 + 55j - 18j wrt j. 442j Suppose -5o - 24 = -17o. Suppose 0 = 2i + i - oc - 7, 0 = 2i - 4c + 6. What is the third derivative of -3 + 3 - 31di + 4d*2 - 30d*2 wrt d? -1860d*2 Let u(o) = 25797o*2 + 6386o. Let j(s) = -17198s2 - 4266s. Let g(x) = 8j(x) + 5u(x). Find the second derivative of g(p) wrt p. -17198 Let v(y) be the third derivative of 3/14y7 + 67/60y*5 + 28y*2 + 0y*4 + 0y*6 + 0 + 0y + 0y3. What is the third derivative of v(o) wrt o? 1080o Let x be (-2 + -10)18/(-12). What is the second derivative of -x - 23o - 22o - 3o*3 - 47o*2 + 47o - o*2 wrt o? -18o - 96 Let f = -314 - -316. What is the third derivative of 45n - 90n*5 - 10n2 - n2 - 7nf + 16n*2 wrt n? -5400n*2 Let h(l) be the first derivative of 1143l*4/4 + 971l*3/3 - 1121. Find the third derivative of h(d) wrt d. 6858 Let u(o) be the third derivative of -3181o*6/120 + 736o*3/3 + 4o*2 + 395o. What is the first derivative of u(i) wrt i? -9543i2 Let c(l) be the first derivative of -699l*2 + 1076l + 1254. Differentiate c(y) wrt y. -1398 Let o be 130/(-6)(-132)/44. What is the derivative of -80 - o - 90w*3 + 109w*3 + 8w*2 - 5w*2 wrt w? 57w*2 + 6w Let v be 92/(-24)(-37 + 19). What is the first derivative of -60 - vg*2 - 48 - 76g*2 - 44g + 147g2 wrt g? 4g - 44 What is the third derivative of 5z2 + 347z*3 - 1979z*3 - 5z*2 - 24z + 8z2 + 7z*2 wrt z? -9792 Differentiate -6760l*2 + 365411 - 4l - 372354 + 4l wrt l. -13520l Let g be -4 - -2 - 2 - (0 + -6). Differentiate 50 + gs + 2s - 4s - 8s*3 - s with respect to s. -24s*2 - 1 Let s(p) be the first derivative of 553p*6/6 + 5p*4/2 - 342p*3 + 7128. Find the third derivative of s(m) wrt m. 33180m*2 + 60 Suppose 27r - 150 = 39. What is the first derivative of 190 - 271b4 - 3b + rb - 4b + 46b4 wrt b? -900b*3 Let g be -1 - (-1 - (2 + 2)). Find the third derivative of 168o*2 - 43o*g - 67o*2 - 3o5 + o2 wrt o. -180o2 - 1032o What is the second derivative of 2m2 + 21865m*3 + 0 + 134 - 21872m*3 + 2m wrt m? -42m + 4 What is the second derivative of 293s*4 + 118s*2 + 1977s*2 - 95s*4 + 1868 - 100s*4 + 3s - 96s4 wrt s? 24s*2 + 4190 Let h = -3815 - -3815. Let r(p) be the second derivative of 22p + 0 - 11p2 + 0p*3 + 7/20p*5 + hp*4. What is the first derivative of r(d) wrt d? 21d*2 Let k(r) = -4762r*2 + 2510r. Let i(y) = -4765y2 + 2508y. Let z(f) = 2i(f) - 3k(f). What is the second derivative of z(b) wrt b? 9512 Let h(q) = -21q3 + 21q*2 + 1207q - 4. Let t(x) = 22x3 - 23x*2 - 1213x + 5. Let o(i) = 5h(i) + 4t(i). Find the second derivative of o(k) wrt k. -102k + 26 Let v(x) be the second derivative of -5x*7/14 + 7x*6/15 + 676x*3/3 + 202x + 1. What is the second derivative of v(o) wrt o? -300o3 + 168o*2 What is the third derivative of -297i*2 + 170i*2 - 137i*2 - 3i*2 - 582i*2 - 386i*3 wrt i? -2316 Let i = -136909 + 313353. What is the first derivative of 61 - 255h*2 - 176444h + ih wrt h? -510h Let v(k) be the second derivative of 0k2 - 33k + 2 + 29/6k4 - 5/6k*6 + 0k*3 + 0k*5. Find the third derivative of v(t) wrt t. -600t Find the second derivative of 418h + 1621h*5 + 2225h*5 + 938h - 784h5 wrt h. 61240h*3 Let p be 4/(-20) - 742/10. Let z be (-2)/(-5) - 579/p. What is the first derivative of -zo4 - 25 + 11o*4 + 15o*4 wrt o? -52o*3 Let a be 12/102 + (-245)/(-85). What is the second derivative of 20c - 145c + 44c + 2ca - 7c*5 wrt c? -140c*3 + 12c Let c = 141 + -135. Let m(r) = -113r + 127. Let l(k) = 37k - 42. Let o(n) = cm(n) + 17l(n). Find the first derivative of o(x) wrt x. -49 Let w(p) = -p*2 + 3p + 20. Let s be w(-3). What is the derivative of 13gs - 170 + 205 - 162 + g4 - 4g*4 wrt g? -12g*3 + 26g L	{ "pile_set_name": "DM Mathematics" }
x be c(-5). Solve -4r - 4j = -x, j = -3r + 6 + 11 for r. 5 Let n(y) = -8y + 5. Let g(w) = -w + 1. Let o(u) = 42g(u) - 6n(u). Let f be o(-2). Solve 4q - 21 = -5i + q, f = 5i + 2q - 19 for i. 3 Let z = 118 + -128. Let y = z - -16. Suppose -17d = -yd. Solve w - 5w + 23 = 3g, d = 2g - 5w for g. 5 Suppose 1 + 11 = 3p. Let n(s) = s3 - 17s*2 + 39s - 30. Let t be n(11). Let m = -312 - t. Solve g - 2r + m = -0r, pg = 4r - 40 for g. -5 Let l(t) = -t*3 - 7t*2 + 5t - 14. Let p be l(-8). Suppose -2r = -2o + 10, 0o - p = -2o + r. Solve 4y = 4x, -4x - x - oy - 10 = 0 for x. -1 Let w = 35738 + -35723. Solve 5q - 4 = -4v, -2q = -10v + wv - 5 for v. 1 Suppose 2t + 3t + v = 33, 0 = 4t - 5v - 38. Solve -k = -2y - 6, -2k - ty = -12y - 16 for k. -2 Let w = 53 + -49. Suppose 13l + 1 = 27. Suppose -ln + w = 4. Solve 4f + 7 + 3 = -2y, n = 2y + 5f + 14 for y. 3 Let h be ((-5)/(-10))/((-3)/(-48)). Let k = 11 + -5. Suppose k = g + g + 2z, z = -2g + h. Solve -5x - n + 15 = 0, 2x - gn = -0x - 21 for x. 2 Let l(q) = 2q*2 - 5q - 176. Let i(x) = 2x2 - 3x - 177. Let y(c) = 5i(c) - 6l(c). Let p be y(-6). Solve 0b - 3 = -3b, p = -2z - b for z. -5 Let x = 418 - 362. Let u = x + -52. Solve -4y - 2p = -18, -uy + 5y = 5p + 10 for y. 5 Suppose 3v - 595 = -2s, -3s + 405 = -4v + 6v. Let t = v + -191. Solve tu - 9 = -3x, 10 = -x + 5u - 6 for x. -1 Let z(a) = -13a3 - 39a*2 - 4a - 12. Let g be z(-3). Solve 3r = 2w - 3, 5w - 8w - 4r - 4 = g for w. 0 Let f = -393 - -390. Suppose -5 = 3h - 0h - 2t, h - 17 = -4t. Let l be f - h - (0 - 17). Solve -3b = 5n + l, 7n = 2n + 4b - 6 for n. -2 Suppose -8g + 44 = -52. Let l be (-1)/g-3 + 440/32. Solve 2w = -4v + w + 17, -3v = w - l for v. 3 Let s = 2783 - 2779. Solve 2v + sb = 0, 2 = 27v - 28v - b for v. -4 Let m = 7575 + -7555. Solve 3f - 12 = 3g, -6f = -g - f - m for g. 0 Let r = -71 + 73. Let h(i) = i - 38i - 17 - 21i*2 + 40i*r - 21i*2. Let y be h(-18). Solve -y = 2f + d, -13 = 5f - 2d + d for f. -2 Let l = -108 - -143. Let t be (-336)/l + 10 - (-16)/10. Solve 4s + 5p - 3 = 0, -5p - 3 = ts - 2 for s. 2 Suppose 2z = -2, 85b - 87b = -4z - 8. Suppose -3g - 3m + 54 = -3, g = bm + 16. Solve 3n = 3h + g, -3n = 2h - n for h. -3 Let w be (21 - (1 - -20))/(-1). Solve w = -4k - u - 13, 0 = -3k - u + 5u - 43 for k. -5 Let o(n) = -n*3 + 24n*2 + 26n - 21. Let u = -192 - -217. Let c be o(u). Solve 0 = 4j + 4, -4j = -4m - c - 0 for m. -2 Let b(n) = -n3 - 4n*2 - 14. Let r be b(-7). Suppose 129d = rd - 12. Solve 0 = p + y - 2, 5p - 16 = -dy for p. 5 Let b(p) = 5p*2 + 229p + 183. Let j be b(-45). Solve -84a + 25 = -5s - 87a, js - 9 = 3a for s. -2 Suppose 4z + 6 = -x, 3x + 27 = 8x + z. Solve d = 3b - 3 - 5, 0 = -4b - 2d - x for b. 1 Let k = 291 + -236. Let u = 61 - k. Solve -y - 2 = 5l + 10, 0 = 3y + u for l. -2 Suppose -2f + 6 = 0, 3 = -4h - 4f - 5. Let k(l) = -l*2 + 4l + 54. Let x be k(h). Solve 44 = -4z + 5i + x, -5z - 2i = 19 for z. -5 Let t(c) = -4c2 + 33c - 113. Let l(k) = -5k2 + 36k - 114. Let p(r) = 3l(r) - 4t(r). Let u be p(18). Solve -18 = -4q - ub + b, -3q + 10 = -b for q. 4 Suppose 0 = 95u - 37u - 290. Solve 0 = 2m + 3d - 15, m + 7 = ud - 5 for m. 3 Suppose 0 = -2w - 11w. Solve 0 = -7c + 5c + 4i - 16, i - 3 = w for c. -2 Suppose 1554n = 1580n - 78. Solve 1 = -ng + 5s - 1, -5g + 3 = -2s for g. 1 Let v be (-6)/10 + ((-204)/15)/(-1). Let o be 2/v - 34/221. Suppose oa = -a + 4. Solve 2l + c - 2c + 3 = 0, al - 4c + 4 = 0 for l. -2 Let a be (-2384)/(-44) + 4/(-22). Suppose -ay + 30y = -120. Solve 5v + t = 15, -4v + yt + 12 = 2t for v. 3 Suppose 4r + 20 = 2b, 2b + 7r - 70 = 5. Solve 4d = l + b, -4l - 2d + 12 = -5l for l. -4 Let o = 31714 - 31714. Solve 0 = 3h + 4q - 6, 4h + 4q + o = 4 for h. -2 Let t(l) = -l*3 + 5l*2 + 27l - 21. Let g be t(-4). Solve -x - g = -3w, -3w = -6w - 3x + 3 for w. 4 Let o = 13 + -34. Let r = -9 - o. Suppose -40 = -rm + 10m. Solve -12 = -c + 2c - 2t, -c + 4t = m for c. -4 Let n be (0 - 0) + 2 - 0. Let f = 621 - 619. Suppose 0 = -5z - 4j - f, -z + n = 5j + 15. Solve -40 = -5y - 5h, 3h - 1 = 4y + z for y. 3 Suppose 2b = 10, 0 = 5m - 10m - 2b + 30. Let l be 5/35 + (-13)/(-7). Suppose lp + 12 = 5p. Solve -my - pq + 11 = -1, -6 = y - 2q for y. 0 Suppose -5b = -4d - 325 - 65, -5d - 247 = -3b. Suppose 20 = -27t + b. Solve -4j + 16 = 0, -tf - 4j + 2 = -j for f. -5 Let t be -41 - (31 + -44). Suppose -23x + 26x = t. Solve 4h = 0, 2q - q + xh = 0 for q. 0 Let l(m) = -22m - 261. Let w be l(-12). Solve p + 9 = -wc + 2, 0 = 3p + 4c + 6 for p. 2 Suppose 3y = 4p + 2 + 1, 4p = -y + 1. Let k be -1 - (p + -1 - 21). Solve k - 4 = 3g - r, -4g = -5r + 21 for g. 1 Let t(v) = -9v - 203. Let r be t(-23). Suppose 0 = -4p + 8, 5p - 22 = -5g + rp. Solve 5y + 37 = -4u, -gy - 13 = -u + 4 for u. -3 Suppose 318w - 642w + 14 = -317w. Solve 38p - 43p + 11 = -4d, -d + 2p = w for d. -4 Suppose 50t + 6t = 168. Solve 4x = 5u + 9, -6x + tx = 3u for x. 1 Let w(z) = 53z + 282 - 65 - 22z. Let u be w(-7). Solve u = -0v + 4v + 4, -4m = -5v + 3 for m. -2 Let m = 10223 - 10219. Solve 4p = -3v + mv - 19, p = -4 for v. 3 Suppose -10f = -f - 18. Let s = 54 - 49. Let k be 1/((s/50)/((-2)/(-4))). Solve -c - 3c - 8 = fp, -5 = kc for p. -2 Suppose -11r - 56 = 1506. Let i = -136 - r. Suppose ig = 5g + 23. Solve -5w - g = -3t, -2t = w - 4t + 6 for w. -4 Let t = 9180 + -9160. Solve 2f + 2i = 5i - 25, 3i = f + t for f. -5 Let t be (1/(-3))/((-29)/696) + 5. Suppose z - 4p = 17, -3p + t = z + 17. Solve 2b + 5m = -b + 35, -5m = -zb + 5 for b. 5 Suppose -5h + 2r + 9 = 0, 3r - 3 = -11h + 13h. Solve 8y = hy - 3t + 5, 0 = -4y + 4t + 4 for y. 1 Suppose 77q + 534 = 255q. Solve d + 19 = 3v, 2v - qd = -v + 9 for v. 8 Let d(z) = 20z - 19. Let g(k) = -k + 1. Let r(p) = d(p) + 2g(p). Let b be r(-6). Let t = -107 - b. Solve 3q = -5o + 11 + t, 3q = -2o + 17 for o. 4 Let a = -111 + 66. Let n = a - -42. Let w be (27/(-6))/n2 - -21. Solve -3r = -4j - 16, j - 5r = -3j - w for j. -1 Let j be (-4)/7((-182)/4)/13. Suppose -6 = -f - 3a, 5 = 2f + a - ja. Solve 4k + 16 = -fx + x, -k = -5x - 18 for k. -2 Let c = -10 + 20. Let g be 4/(-10) - (-34)/c. Let r be (-1)/(795/80 + -10). Solve -4h = -2o + 10, -gh = 5o + 43 - r for o. -3 Let m be 3(-8)/(-5)(-25)/(-30). Suppose 0 = -3g - 3q + 15, g + 4q - 20 = 3g. Solve u + t - 4 = -mu, -3u + 2t - 8 = g for u. 0 Let f(u) = -27u + 42. Let s be f(-2). Suppose 3k - s + 81 = 0. Solve 3h - ky = -20, 3y = -4h - y + 16 for h. 0 Suppose 4i + 5 = -a, 1 = -3a + 479i - 484i. Solve -5m + 0g + a = -4g, 4m + 5g - 27 = 0 for m. 3 Suppose 3x + 41 = 56. Let f = -7 + 11. Suppose -5o + o - xi + 20 = 0, -o + 16 = fi. Solve 2k = -ok - 3m + 10, k - 3m = 5 for k. 5 Suppose -7r = -633 + 521. Suppose -2t + r = 2g, 0 = -3t + g - 13 + 17. Solve -2l + 5h - 8 = 0, -4h = -tl + 2l - 4 for l. -4 Let o be ((-90)/20)/(3/(-14)). Suppose 9 = 2l - o. Solve -3c = -5z + l, 4z = c - 3c - 10 for z. 0 Let b(f) = -f - 19. Suppose -7w + 240 = -17w. Let g be b(w). Solve gh + 8 = -7, 4i - 4h = 0 for i. -3 Suppose 1100 = 157c - 152c. Suppose c = -20v + 860. Solve 3d = 5x + v, -5x - d - d = 12 for x. -4 Suppose -4v - 3g = -v, g + 42 = 5v. Solve -h + 2 = 7b, -vh - 9 = -6h - 4b for h. -5 Let k = -1897 - -1328. Let h = k - -576. Solve -1 = -s, -4w + 5s = -0s - h for w. 3 Let l = 64 + -116. Let f = 55 + l. Solve 5u = 4v - 19, -2u - 4 = fv - v for u. -3 Let y = -13 + 48. Let u = y - 17. Solve -2d - 6a + 2a = 0, -5d - a + u = 0 for d. 4 Let r = -548 - -571. Suppose -19z - 92 = -rz. Solve 3d + z = -2a + 4, -4a + 17 = -5d for d. -5 Let v be 1 - 6 - ((-20)/(-110) - (-1264)/(-176)). Solve 0 = 4h - 20, 4a + vh - 6 = 2a for a. -2 Let j = 4531 + -4531. Solve -5p + 4u + 35 = 0, -5p + u = -ju - 20 for p. 3 Let b = 18500 + -18500. Solve -2j + 2s = -4, -2j + s + 10 - 4 = b for j. 4 Suppose 0 = v - b - 37 + 13, 2v - 56 = 4b. Solve -3n - 2u + 7 = 19, -4n - v = 4*u for n	{ "pile_set_name": "DM Mathematics" }
v - 275f2 + 11f What is the third derivative of 23463900i3 + 233i*2 + 79168 wrt i? 140783400 Find the third derivative of 30129599s*6 - 2s*2 + 6964382 wrt s. 3615551880s*3 Differentiate 124qy + 312548q - 6621y - 10 wrt y. 124q - 6621 What is the second derivative of 114751452c2 + 98393913c wrt c? 229502904 Find the third derivative of -7c5 - 30211c*4 + 44c*3 - 9131055c*2. -420c*2 - 725064c + 264 Find the second derivative of 4908429g3w*2 - 2g3 + g2w + 2gw3 + 3g + 75w - 4504 wrt w. 9816858g*3 + 12gw Find the second derivative of -506230f*2l*4 + 12f*2l + 8f2 - 313fl - 365l*2 + 631l wrt l. -6074760f2l*2 - 730 Find the third derivative of -12u*5 + 144653u*4 + 2u*3 - 1777167u*2 - u + 1. -720u*2 + 3471672u + 12 What is the second derivative of 22192ln*3 + 112ln2 + 2ln - 14l - 17n3 + 738259 wrt n? 133152ln + 224l - 102n What is the derivative of 544i*2p*2 - 305717ip2 + 665568269p*2 wrt i? 1088ip2 - 305717p*2 What is the third derivative of -5t*3u*3 + 8t*3u*2 - 1003t*3u + 46t2 - 19421523tu3 + 7u*2 wrt u? -30t*3 - 116529138t Find the second derivative of 3j2v - 1614359j2 - 1020j + 290v wrt j. 6v - 3228718 What is the second derivative of -24d4 + 12492d*3 - 5d*2 + 4487945d wrt d? -288d2 + 74952d - 10 What is the derivative of 2912431j4 + 45j*3 - 186154352 wrt j? 11649724j*3 + 135j*2 What is the third derivative of -19427191h*3 + 2312h*2 - 4815 wrt h? -116563146 What is the third derivative of 740047015a*3 - 847793923a*2 wrt a? 4440282090 What is the second derivative of -498744d*4 + 10d*2 - 8375157d wrt d? -5984928d2 + 20 What is the second derivative of -82s*3v + s*3 + 377061s*2v - 567702826sv wrt s? -492sv + 6s + 754122v What is the second derivative of -27970782b2h*2 - 331b*2h - 6b2 + bh + h - 12 wrt h? -55941564b2 Find the third derivative of -26847102m*3r2 + m2r2 + 73m*2r - 2m2 - 384mr2 + 10r*2 - 2r wrt m. -161082612r2 What is the third derivative of -45h*3n*3 - 46421270h*3n - 2hn*2 - 1013998n*3 wrt n? -270h*3 - 6083988 Find the first derivative of -3251346h*2s*3y + 1971401h2s*3 - 44hs3y + 24hs*3 wrt y. -3251346h*2s*3 - 44hs3 Find the second derivative of -7f*3 + 12120935f*2 - 479194f + 44. -42f + 24241870 Find the first derivative of -348463852h*2x*3 + 6854x*3 - 52x*2 - 3 wrt h. -696927704hx3 What is the second derivative of -377290750o*4 + 76105419o? -4527489000o2 What is the first derivative of 9q*3z + 219q3 - 553303q*2z*3 - 2022 wrt z? 9q*3 - 1659909q*2z*2 What is the second derivative of 31279151j*2v*3 + 1615032j*2 - 4v wrt v? 187674906j2v Find the third derivative of 103652540n3v*3 - 2n*3v - 2n3 + 8179n*2v*2 - 2nv2 - 3nv + 14v*2 wrt v. 621915240n*3 What is the first derivative of 2240fr - 36421f + r - 127806594 wrt f? 2240r - 36421 What is the second derivative of 89j*3p*2 + 2j3 + j2p2 - 2j*2 - 2706jp2 - 5046jp + p - 16 wrt p? 178j*3 + 2j*2 - 5412j What is the derivative of 108d2 + 49843d + 41469287 wrt d? 216d + 49843 Find the first derivative of -ax*3 - 34388ax - 4613456a - 15x3 wrt x. -3ax2 - 34388a - 45x2 Find the second derivative of -2911j*2k*2 - 72j*2 + 633jk2 + 6jk - 5j + 30k2 + 2k - 2 wrt j. -5822k2 - 144 Find the third derivative of 31287309v3 - v2 + 407v + 233. 187723854 Find the third derivative of -140984987s*4 - 5s*2 - 112575s - 9 wrt s. -3383639688s Find the third derivative of 4151547i*5 - 8i*3 - 82i*2 + 177i + 131 wrt i. 249092820i2 - 48 What is the derivative of -505q*2 + 18062q + 37757020? -1010q + 18062 Find the first derivative of -24b*3m*2rz - 4652b*3rz - 5b*3 + 18b*2m*2 - 10bm2z - 38bm*2 - 2m wrt r. -24b3m*2z - 4652b3z Find the second derivative of 2b2j + 1998571b2 + 69bj + 7b + 3j + 2058 wrt b. 4j + 3997142 What is the third derivative of 2b3dv - 326167b*3d + 2b3v + 4b3 - 1501b*2dv - 2168bdv wrt b? 12dv - 1957002d + 12v + 24 What is the derivative of -235h3 + 3829h*2 + 18h + 52868789? -705h2 + 7658h + 18 Differentiate -5wx*2 - 15236512wx - 3x*2 - 4328858x with respect to w. -5x2 - 15236512x Differentiate -962298d2t*2 + 2dt2 - 123292t*2 - 76t - 2 wrt d. -1924596dt*2 + 2t*2 Differentiate -74951622g + 139011532 wrt g. -74951622 Find the third derivative of 21745784z6 + 36793z*2 - 351z wrt z. 2609494080z3 What is the third derivative of -3p*6 - 10268979p5 + p3 + 311497p2 + 202 wrt p? -360p*3 - 616138740p2 + 6 What is the third derivative of t4u2 + 195113121t*4 + 2t*2u*2 - 2tu + 51t - 8u2 - 25373u wrt t? 24tu*2 + 4682714904t What is the second derivative of -3997cp*2y*3 - 57cp2y + cp2 - 7cpy*3 - 2cpy*2 + cp - 2008cy - c - 10py*2 wrt p? -7994cy3 - 114cy + 2c Find the third derivative of 75397684j3 - 52j*2 + 326j + 90. 452386104 Find the second derivative of -25670719a4 + 35493201a wrt a. -308048628a2 Find the second derivative of -8078q*4 + 5q*3 + 180q*2 + 5q + 1341235 wrt q. -96936q2 + 30q + 360 What is the first derivative of -4257894g + 24634425? -4257894 What is the second derivative of 980636v*2 - 48v - 17431 wrt v? 1961272 What is the third derivative of -2h5 + 12252h4 + h3 - 25600h2 - 17h - 4 wrt h? -120h2 + 294048h + 6 Differentiate -54070772lr - 32364642l with respect to r. -54070772l What is the first derivative of -2h4 + 4149502h*3 + 3hr + 64231r - 74 wrt h? -8h3 + 12448506h*2 + 3r What is the second derivative of 3y3z + 177659y3 + 4y*2z + 53yz + 2z - 126764 wrt y? 18yz + 1065954y + 8z Find the first derivative of -676z*3 + 9837z - 32930992 wrt z. -2028z2 + 9837 What is the third derivative of -14l*2x*3 + 8l*2x*2 + 1366844lx5 - 7877288lx2 wrt x? -84l*2 + 82010640lx2 Find the third derivative of 89746264l*4 - 229426l*2 - 20 wrt l. 2153910336l What is the third derivative of 1186ns*4 - 381ns3 - 10343ns - 182s*2 wrt s? 28464ns - 2286n What is the third derivative of -5n6 + 1810n*5 - 1190164n*2? -600n*3 + 108600n*2 Differentiate -229301717v*2 - 686235444. -458603434v What is the third derivative of 78534435w3 - 86801918w*2? 471206610 Find the second derivative of -4738811r*4w*3 - 2r*3 - 80rw2 + rw + r - 4w3 + 116w wrt r. -56865732r2w*3 - 12r Find the first derivative of -a*4 - 1137467a*3 - 7236360. -4a*3 - 3412401a*2 Find the second derivative of -207940981ms5 - 2ms + 6199081 wrt s. -4158819620ms3 Differentiate 16768458ck3n - ckn - 157k3n + 15311k3 - 2n with respect to c. 16768458k3n - kn What is the first derivative of -500988h*2v + hv + 5267v - 749 wrt h? -1001976hv + v What is the third derivative of -89189205z4 - 7z*2 - 124z - 10636 wrt z? -2140540920z Differentiate -11b*2fr + 87b*2r2 + b2r - 15b*2 + 24bfr*2 + 4f + 5r - 4 with respect to f. -11b*2r + 24br*2 + 4 Find the third derivative of 743321586lp4 - lp*2 - 233lp + 66l + 1253p wrt p. 17839718064lp Differentiate 131549671n + 20139016 wrt n. 131549671 What is the second derivative of -3n4y + 6586799n2y*2 + 6ny2 + 83786653y*2 wrt n? -36n*2y + 13173598y2 What is the third derivative of -26961b*6 + 11129b3 + b2 + 2b + 48091808 wrt b? -3235320b*3 + 66774 Find the second derivative of 2a*2j2 - a2j - 85a*2 + 16aj3 - 382aj2 + 19aj + 4j*3 - 17j wrt j. 4a2 + 96aj - 764a + 24j Find the third derivative of 383s*3y*3 + 193274s*3y*2 - 10s*2 + 12178sy3 - 68y*3 wrt s. 2298y*3 + 1159644y*2 What is the third derivative of 76o*5 + 3o*4 + 16982o*3 + 3106578o*2 - 2? 4560o*2 + 72o + 101892 Differentiate b*3g - 72380b3 + 666822b*2g*3 - 25b2 wrt g. b3 + 2000466b2g**2 Find the third d	{ "pile_set_name": "DM Mathematics" }
26025 Convert 0.910284 nanograms to tonnes. 0.000000000000000910284 How many months are there in 4.338336 millennia? 52060.032 What is 7/3 of a millennium in months? 28000 What is 28284.55 grams in micrograms? 28284550000 Convert 435.3639l to millilitres. 435363.9 How many months are there in one quarter of a year? 3 What is 182.4333ug in nanograms? 182433.3 What is 1633.26cm in nanometers? 16332600000 What is 63.33507 years in centuries? 0.6333507 What is 21/5 of a decade in years? 42 What is 1/5 of a centimeter in micrometers? 2000 How many months are there in 1/30 of a decade? 4 How many nanograms are there in twenty-nine halves of a microgram? 14500 What is 580.730661 minutes in weeks? 0.05761216875 Convert 9203642.28 seconds to weeks. 15.2176625 Convert 827894.7 milligrams to tonnes. 0.0008278947 Convert 63.91773ml to litres. 0.06391773 Convert 951.2413 centuries to years. 95124.13 Convert 709462.7 years to decades. 70946.27 Convert 4.361993 micrometers to meters. 0.000004361993 Convert 10.5734664 hours to weeks. 0.0629373 How many months are there in one fifth of a century? 240 Convert 0.9124163 kilometers to micrometers. 912416300 How many millimeters are there in 1/5 of a meter? 200 What is 15212778.21 nanoseconds in weeks? 0.000000025153403125 What is 2/75 of a week in seconds? 16128 Convert 0.7489593 litres to millilitres. 748.9593 How many years are there in 23/8 of a millennium? 2875 What is seven quarters of a second in milliseconds? 1750 What is 29/5 of a meter in millimeters? 5800 Convert 173.8866 hours to days. 7.245275 Convert 45499.87 tonnes to micrograms. 45499870000000000 What is twenty-seven halves of a hour in seconds? 48600 How many millilitres are there in 6/25 of a litre? 240 What is 41/2 of a microsecond in nanoseconds? 20500 How many seconds are there in sixteen ninths of a hour? 6400 How many weeks are there in 250.26813ns? 0.000000000000413803125 How many seconds are there in 6/25 of a day? 20736 What is 1087.517 kilometers in meters? 1087517 How many meters are there in 904.5985km? 904598.5 How many millilitres are there in 3/8 of a litre? 375 How many months are there in 18/5 of a millennium? 43200 How many millennia are there in 0.2903522 years? 0.0002903522 How many centuries are there in 203491.11 months? 169.575925 Convert 13.840872 months to decades. 0.1153406 How many kilograms are there in 3/8 of a tonne? 375 How many litres are there in 10.69382 millilitres? 0.01069382 How many grams are there in nine tenths of a kilogram? 900 How many micrograms are there in 0.2010816 grams? 201081.6 How many litres are there in 861823.2 millilitres? 861.8232 How many nanoseconds are there in 40217.42 minutes? 2413045200000000 What is 186.9228 tonnes in milligrams? 186922800000 What is 754.9652 millilitres in litres? 0.7549652 What is thirty-one fifths of a week in minutes? 62496 Convert 10690.8 nanometers to kilometers. 0.0000000106908 What is one fifth of a minute in milliseconds? 12000 What is twenty-seven halves of a millisecond in microseconds? 13500 How many meters are there in 8.41777 kilometers? 8417.77 What is 22484.289 months in centuries? 18.7369075 How many years are there in 874534.3 centuries? 87453430 How many grams are there in 483878.8 tonnes? 483878800000 What is 370.5051g in milligrams? 370505.1 Convert 547.6855 millilitres to litres. 0.5476855 Convert 39422.11t to kilograms. 39422110 How many decades are there in 44524.49 centuries? 445244.9 What is 353.8155 centimeters in micrometers? 3538155 Convert 87047.87s to nanoseconds. 87047870000000 What is 44/5 of a centimeter in millimeters? 88 How many millilitres are there in 817.0109 litres? 817010.9 How many months are there in 17/6 of a decade? 340 What is one tenth of a litre in millilitres? 100 What is 374648.1 weeks in days? 2622536.7 How many milligrams are there in 10.42855t? 10428550000 How many millilitres are there in 46/5 of a litre? 9200 Convert 753.4404 tonnes to kilograms. 753440.4 How many micrograms are there in 0.7931495 kilograms? 793149500 How many centimeters are there in 777276.3nm? 0.07772763 How many nanograms are there in twenty-one fifths of a microgram? 4200 What is 11/4 of a kilogram in grams? 2750 Convert 80648.93 millennia to centuries. 806489.3 How many micrometers are there in twenty-seven quarters of a millimeter? 6750 What is fifty-five halves of a meter in millimeters? 27500 What is eighteen fifths of a litre in millilitres? 3600 How many tonnes are there in 26325.63 kilograms? 26.32563 How many months are there in 43/3 of a century? 17200 What is 416009.9ng in grams? 0.0004160099 How many tonnes are there in 60.4138ng? 0.0000000000000604138 How many litres are there in 6.454463ml? 0.006454463 How many minutes are there in eleven quarters of a day? 3960 Convert 20860.17 kilometers to nanometers. 20860170000000000 Convert 7.4735 meters to centimeters. 747.35 What is 457.3186 decades in months? 54878.232 How many millilitres are there in 3/8 of a litre? 375 Convert 3825.347l to millilitres. 3825347 What is 77/2 of a century in years? 3850 What is 43/4 of a milligram in micrograms? 10750 How many millimeters are there in one fifth of a centimeter? 2 What is fifty-one halves of a minute in seconds? 1530 Convert 0.4214038 millilitres to litres. 0.0004214038 How many millilitres are there in 0.1168414 litres? 116.8414 How many grams are there in 3/25 of a kilogram? 120 What is 399177.5 millilitres in litres? 399.1775 What is 0.557175 days in minutes? 802.332 What is 3/25 of a millennium in decades? 12 Convert 0.4911601ml to litres. 0.0004911601 What is 147.6001 millilitres in litres? 0.1476001 What is 508146.9km in meters? 508146900 How many micrometers are there in three sixteenths of a centimeter? 1875 What is 1728.844l in millilitres? 1728844 How many millimeters are there in fifteen quarters of a meter? 3750 How many tonnes are there in 1.4095 kilograms? 0.0014095 What is eleven eighths of a milligram in micrograms? 1375 What is three fifths of a gram in milligrams? 600 How many millilitres are there in twenty-five halves of a litre? 12500 How many months are there in 0.0223653 decades? 2.683836 How many months are there in three tenths of a millennium? 3600 How many tonnes are there in 575.5025 milligrams? 0.0000005755025 How many millilitres are there in 1/5 of a litre? 200 What is thirty-one halves of a milligram in micrograms? 15500 Convert 6498.112 days to seconds. 561436876.8 How many millilitres are there in fourty-eight fifths of a litre? 9600 What is 7/4 of a gram in milligrams? 1750 What is 8.470182 micrometers in kilometers? 0.000000008470182 What is 82460.86l in millilitres? 82460860 How many meters are there in 67.25404cm? 0.6725404 What is fourty-nine fifths of a kilometer in meters? 9800 How many years are there in 4234.338 decades? 42343.38 What is 59/4 of a gram in milligrams? 14750 Convert 0.9574976km to millimeters. 957497.6 How many millilitres are there in 15/4 of a litre? 3750 What is 3.681235kg in tonnes? 0.003681235 What is five sixths of a day in minutes? 1200 What is 0.966919 millilitres in litres? 0.000966919 How many kilometers are there in 24362.84mm? 0.02436284 What is 25/4 of a litre in millilitres? 6250 How many kilograms are there in 13/5 of a tonne? 2600 Convert 4307.2209ms to hours. 0.00119645025 Convert 1504.214l to millilitres. 1504214 How many grams are there in 3/10 of a kilogram? 300 Convert 881935.8um to nanometers. 881935800 How many litres are there in 2731.7 millilitres? 2.7317 What is 0.9363918 litres in millilitres? 936.3918 How many nanometers are there in 17/4 of a micrometer? 4250 What is 5.244511 meters in micrometers? 5244511 How many nanometers are there in seventy-nine halves of a micrometer? 39500 What is eighteen fifths of a meter in centimeters? 360 How many years are there in 3/50 of a century? 6 What is 1498.271 centuries in decades? 14982.71 How many milligrams are there in 7/4 of a gram? 1750 How many millilitres are there in 235534.1 litres? 235534100 How many seconds are there in 49895.91 hours? 179625276 How many centuries are there in 6.214453 decades? 0.6214453 Convert 5.132272 litres to millilitres. 5132.272 What is eleven quarters of a centimeter in mi	{ "pile_set_name": "DM Mathematics" }
tor of 568253 and 147. 49 Calculate the highest common factor of 12 and 11185380. 12 What is the highest common factor of 220 and 256180? 20 What is the highest common divisor of 266317 and 23? 23 What is the greatest common divisor of 272580 and 322? 14 What is the highest common divisor of 136 and 11203? 17 What is the greatest common divisor of 4631 and 2189? 11 Calculate the greatest common divisor of 5782317 and 309. 309 What is the highest common factor of 5128864 and 26? 26 Calculate the highest common factor of 11891 and 517. 517 Calculate the highest common divisor of 35 and 13785. 5 What is the highest common divisor of 15028 and 252824? 884 What is the greatest common factor of 35464 and 65? 13 What is the greatest common divisor of 27 and 187092? 9 What is the greatest common factor of 1050 and 138390? 210 Calculate the highest common factor of 234 and 76128. 78 What is the greatest common factor of 8858 and 1648? 206 What is the highest common divisor of 30 and 69530? 10 What is the highest common factor of 1331 and 32329? 11 What is the greatest common divisor of 192 and 61926? 6 Calculate the greatest common factor of 1437 and 6335733. 1437 Calculate the highest common factor of 2002 and 24772. 22 Calculate the greatest common divisor of 10563 and 203. 7 What is the highest common factor of 3690 and 51168? 246 What is the greatest common factor of 259664 and 16? 16 Calculate the highest common divisor of 2877 and 468951. 2877 What is the greatest common factor of 62963 and 9? 1 Calculate the greatest common divisor of 79935 and 60. 15 What is the highest common divisor of 270 and 3897? 9 What is the highest common factor of 1909 and 16652? 23 What is the highest common factor of 239 and 1214359? 239 What is the greatest common divisor of 76 and 55? 1 Calculate the highest common factor of 386 and 1143139. 193 What is the highest common factor of 8 and 475976? 8 Calculate the greatest common factor of 162708 and 208. 52 What is the greatest common factor of 5679901 and 641? 641 What is the greatest common factor of 2610489 and 14? 7 Calculate the highest common factor of 42 and 49032. 6 Calculate the highest common factor of 5860 and 45. 5 What is the highest common divisor of 52268 and 8468? 292 Calculate the highest common divisor of 78 and 117442. 26 What is the greatest common divisor of 19435 and 39? 13 What is the greatest common factor of 505 and 564085? 505 What is the greatest common divisor of 25596 and 3600? 36 Calculate the highest common factor of 27 and 159066. 9 What is the highest common factor of 493986 and 2001? 87 Calculate the greatest common divisor of 1056 and 46752. 96 Calculate the highest common factor of 208 and 409084. 52 What is the highest common divisor of 2013 and 2196? 183 Calculate the greatest common factor of 444 and 32892. 12 Calculate the highest common factor of 104 and 72332. 52 Calculate the highest common divisor of 2112 and 4026. 66 What is the highest common divisor of 2542 and 1107? 41 Calculate the greatest common divisor of 88 and 76480. 8 What is the greatest common divisor of 6543 and 117? 9 Calculate the highest common divisor of 5296 and 12. 4 What is the greatest common divisor of 13211 and 3509? 11 What is the highest common factor of 133 and 7931987? 133 What is the highest common factor of 39304 and 408? 136 What is the greatest common factor of 78960 and 15? 15 Calculate the highest common factor of 5094 and 36. 18 What is the greatest common factor of 12438 and 2124? 18 Calculate the greatest common factor of 12528 and 222. 6 Calculate the greatest common factor of 833 and 20573. 7 What is the highest common factor of 292 and 37? 1 Calculate the highest common divisor of 112547 and 241. 241 What is the greatest common divisor of 350 and 34818? 14 What is the greatest common divisor of 2982 and 1239? 21 Calculate the greatest common factor of 125 and 1585. 5 What is the highest common factor of 117 and 1692? 9 What is the highest common divisor of 27214 and 1518? 22 What is the greatest common divisor of 109752 and 48? 24 What is the greatest common factor of 102 and 24191? 17 What is the greatest common divisor of 70 and 3928435? 35 Calculate the highest common factor of 665874 and 9. 9 Calculate the greatest common factor of 3633 and 1120. 7 What is the highest common divisor of 234 and 36? 18 Calculate the greatest common divisor of 4849 and 4303. 13 Calculate the greatest common divisor of 5901 and 77. 7 What is the highest common factor of 181168 and 1040? 208 What is the greatest common factor of 1395 and 11470? 155 Calculate the greatest common divisor of 2714 and 2231. 23 What is the greatest common divisor of 646 and 3268114? 646 What is the greatest common factor of 105636 and 16? 4 What is the highest common factor of 33 and 1711149? 33 What is the greatest common divisor of 136 and 111962? 34 What is the highest common factor of 254135 and 40? 5 Calculate the greatest common divisor of 84 and 95928. 84 What is the highest common divisor of 7 and 31511? 1 Calculate the highest common divisor of 264 and 46002. 66 Calculate the greatest common factor of 2241 and 476088. 249 What is the greatest common factor of 7677 and 1359? 9 What is the greatest common factor of 66 and 13508? 22 What is the greatest common divisor of 3096 and 11481? 129 Calculate the highest common factor of 48 and 355224. 24 Calculate the greatest common factor of 9211 and 755. 151 What is the highest common factor of 169784 and 136274? 2234 Calculate the greatest common factor of 153857 and 2343. 781 Calculate the greatest common divisor of 546 and 43302. 42 What is the greatest common factor of 2239097 and 553? 553 What is the greatest common divisor of 201433 and 5576? 697 What is the greatest common factor of 184 and 1679? 23 What is the highest common factor of 117478 and 302? 302 Calculate the greatest common divisor of 100646 and 5096. 1274 What is the greatest common factor of 925657 and 633? 211 What is the greatest common divisor of 361238 and 46? 46 What is the greatest common factor of 7360 and 167210? 230 Calculate the highest common divisor of 2292 and 173428. 764 Calculate the greatest common factor of 381 and 5969. 127 What is the greatest common divisor of 165113 and 169? 169 Calculate the greatest common divisor of 124423 and 884. 221 What is the greatest common divisor of 1986 and 78? 6 Calculate the greatest common divisor of 136 and 574680. 8 Calculate the greatest common divisor of 12842167 and 482. 241 Calculate the greatest common factor of 401461 and 11509. 677 What is the highest common factor of 133632 and 5184? 576 Calculate the greatest common factor of 2 and 13009. 1 Calculate the highest common divisor of 153 and 36516. 51 What is the highest common factor of 79207 and 3296? 103 What is the highest common divisor of 748350 and 250? 50 What is the highest common divisor of 484365 and 2205? 735 What is the greatest common divisor of 21 and 14223783? 21 Calculate the greatest common divisor of 7432 and 8. 8 Calculate the greatest common divisor of 18 and 82332. 18 Calculate the highest common divisor of 1610 and 2170. 70 What is the greatest common factor of 288 and 161292? 12 What is the greatest common factor of 77 and 70367? 11 Calculate the highest common factor of 162 and 52893. 81 What is the highest common divisor of 1188 and 7172? 44 Calculate the highest common factor of 6442 and 1. 1 What is the greatest common divisor of 89589 and 57? 3 What is the greatest common factor of 714 and 8736? 42 What is the greatest common factor of 1540980 and 2520? 1260 What is the highest common factor of 40060 and 120? 20 Calculate the greatest common divisor of 8 and 53416. 8 Calculate the greatest common divisor of 174161 and 169. 13 Calculate the greatest common factor of 2450489 and 23. 23 What is the highest common factor of 26133 and 372? 93 Calculate the highest common factor of 409 and 4. 1 What is the greatest common divisor of 33957 and 66? 33 What is the highest common factor of 1910200 and 25? 25 What is the highest common divisor of 10962 and 4234? 58 Calculate the greatest common divisor of 929 and 19. 1 Calculate the highest common factor of 112 and 22036.	{ "pile_set_name": "DM Mathematics" }
-w - 51 = -16l. Calculate lk(h) - 3j(h). -h2 - 2h - 4 Let j(u) = 50u3 + 27u*2 + 10u + 14. Let k(h) = -25h3 - 11h*2 - 4h - 6. Calculate -3j(s) - 7k(s). 25s3 - 4s*2 - 2s Let m(q) = -14176 + 61q - 9q + 14174. Let r(s) = s. Give -m(w) + r(w). -51w + 2 Let l(c) = -3578938c + 30107. Let s(d) = 4044d - 34. Determine -2l(a) - 1771s(a). -4048a Let f(r) = -62 - 5r2 - 20r + 127 + 8r2 + 18r*2 - 57. Let o(p) = 7p*2 - 7p + 3. Calculate -3f(c) + 8o(c). -7c2 + 4c Let m(u) be the second derivative of -u*3/6 - 21u*2/2 + 1639u. Let d(z) = -z - 22. Calculate -5d(w) + 6m(w). -w - 16 Let q(j) = 8j - 1. Let v(k) be the second derivative of 20k*3/3 - 3k*2 + 2875k. Determine 22q(o) - 4v(o). 16o + 2 Let i(c) = -2c*3 + 30c*2 + 18c + 3. Let b(p) = -7p3 + 118p*2 + 68p + 11. What is -4b(l) + 15i(l)? -2l3 - 22l*2 - 2l + 1 Let w(h) = 24h + 2. Let n be 20/16 - (-63)/(-8)6/9. Let g(f) = -8f - 1. What is nw(m) - 11g(m)? -8m + 3 Let w(y) = -2y2 - 30y - 3. Let x(a) = -4a2 - 62a - 6. Give 13w(i) - 6x(i). -2i2 - 18i - 3 Let m(y) = 2409y + 6. Let j(g) = 1606g + 4. What is 8j(b) - 5m(b)? 803b + 2 Let g(a) = 1673a*3 - 2a*2 + 4a. Let x(k) = 754521k3 - 903k*2 + 1806k. Give 1806g(l) - 4x(l). 3354l3 Let h(j) = 1. Let n(d) = -6d*2 + 4d - 11. Let q(i) = -3h(i) - n(i). Suppose -16o = 300 - 380. Let f(a) = 7a2 - 5a + 9. Determine oq(g) - 4f(g). 2g2 + 4 Let c(d) = 7d*2 - 10d - 10. Let b(a) = 2a2 - 3a - 3. Let h(m) = 10b(m) - 3c(m). Let q(j) = -3j3 - 5j*2. Determine -5h(k) + q(k). -3k3 Let q(o) = 9o - 35. Let c(f) = 4f - 17. Suppose z = j - 9, 3z - 29 = -3j - 80. Give zc(w) + 6q(w). 2w + 11 Let t(m) = -2m - 9. Suppose -4s + 12 - 4 = 0. Suppose 0j + s = -2j. Let p(q) = -1. Let b be (-6)/(1/1-1). Determine bp(k) + jt(k). 2k + 3 Let q(o) = o3 - o2 - o + 3. Let u(b) = -3b3 + 18b*2 + 15b - 66. Determine 18q(i) + u(i). 15i*3 - 3i - 12 Let b = 291 + -287. Suppose 0r - r - b = -g, -2r = 4. Let v(c) = 4c3 - 4c*2 - 2c + 1. Let o(w) = 13w3 - 13w*2 - 7w + 2. Calculate go(q) - 7v(q). -2q3 + 2q*2 - 3 Let n(f) = 31f*2 - 171f - 11. Let b(a) = 16a2 - 74a - 5. What is 9b(d) - 4n(d)? 20d2 + 18d - 1 Let p(x) = 13x + 11 - 46x - 17x - 12x - 2. Let m(g) = 31g - 4. Determine 9m(k) + 4p(k). 31k Let j(g) = -18g + 14. Let o(i) = 36i - 29. Calculate 7j(k) + 3o(k). -18k + 11 Let l(p) be the third derivative of p5/30 + p4/4 - 4p*3 - 50p*2 + 17p. Let d(j) = -j. Give -6d(x) - l(x). -2x*2 + 24 Let t(f) = -f + 32. Let v(r) = -r + 134. What is 26t(c) - 6v(c)? -20c + 28 Let d(v) = 40v. Let o(h) = -13h. Suppose 3s - 4r + 33 = r, r = 4r. What is so(y) - 4d(y)? -17y Let z(t) = -21t - 22. Let d(q) = 4. What is 6d(r) + z(r)? -21r + 2 Let w(o) = -o2 - o. Suppose 0 = 3i + 2s - 13, -15i + 18i - 3 = 3s. Let p(n) = 4n + 4. What is iw(k) + p(k)? -3k2 + k + 4 Let d(b) = -27686b*2 - 96b - 16. Let m(l) = -5537l2 - 18l - 3. Determine -3d(s) + 16m(s). -5534s2 Let p(u) = -7u - 8. Let a(h) be the third derivative of -h*4/3 - 3h*3/2 - 33h*2 + 7. Let n be (-15)/(-2)4/5. Give na(f) - 7p(f). f + 2 Let i(a) = 6012a - 1 + 6019a + 6015a + 6018a + 6022a - 30088a. Let g(o) = 5o + 3. Let y = 2 - 6. Give yg(w) - 11i(w). 2w - 1 Let n be (-2)/(3 + 3 + -4). Let j(c) = -93c2 - 94c. Let d(f) = 24f2 + 25f. Let z(m) = 15d(m) + 4j(m). Let v(o) = -o. Calculate nz(g) + v(g). 12g*2 Suppose 0 = i - 3, -2i + 8 = t - 0i. Let j be (2 + (-56)/20)/((-6)/15). Suppose -j = -4u + 2. Let z(d) = d + 1. Let s(w) = -1. Determine ts(r) + uz(r). r - 1 Let b(i) = 461734i - 301. Let k(m) = -3078m + 2. Give 4b(r) + 602k(r). -6020r Let i(z) = -18602046z + 26288. Let r(y) = 9907y - 14. What is 7i(h) + 13144r(h)? 3286h Let x(n) = 33n3 + 8783n + 10. Let y(t) = 7t3 + 1756t + 2. Give -4x(r) + 19y(r). r*3 - 1768r - 2 Let r(a) = -9a - 3. Let w(n) = 37874n + 11754. What is 3918r(f) + w(f)? 2612f Let u(q) = 9q2 - 5q + 3. Let z(s) = -s*2 + s - 1. Let o = 71 - 69. Suppose oh = 3w - 10, -2w = -0h + 4h - 12. Determine hu(a) + 5z(a). 4a2 - 2 Let s(b) = -4b*3 + 22b*2 + 11b + 159. Let p(k) = -2k3 + 12k*2 + 6k + 81. Determine 11p(a) - 6s(a). 2a3 - 63 Let q(x) = 7751x*3 + 6x. Let o(y) = 23253y3 + 16y. Give 3o(a) - 8q(a). 7751a3 Let m(k) = -47k*3 - 14k*2 + 7k - 6. Let p(u) = 94u3 + 31u*2 - 15u + 13. Give 13m(w) + 6p(w). -47w3 + 4w*2 + w Let p(o) = 8o*2 - 74o + 8. Let i(b) = 3b2 - 27b + 3. Let t(a) = -11i(a) + 4p(a). Let j(k) = 4k2 - 3k + 41. Determine -j(n) - 3t(n). -n2 - 38 Let h(c) = 9c*2 + 0c + 3c + 7 + 3. Let t(j) = -4j*2 - j - 5. Let l(v) = -299v*2 + 296v + 5. Let g be l(1). Calculate gh(p) + 5t(p). -2p2 + p - 5 Let o(x) = 14x*3 - 9x2 + 947. Let h(a) = -a3 + a*2 - 5. What is -11h(v) - o(v)? -3v3 - 2v*2 - 892 Let v(r) = 11r*2 + 60r + 6. Let h(s) = 9s2 + 56s + 6. What is 4h(q) - 3v(q)? 3q2 + 44q + 6 Let z(y) = -2y + 2y - y. Let o(n) = -3n2 - 7070n + 7071n + 0n*2 + 4n*2 - 3n*2. Let j = 2 - 1. Give jz(q) + o(q). -2q2 Let u(t) = -14t*3 - 4t*2 - 2t + 474. Let h(i) = 62i3 + 18i*2 + 9i - 1897. Give 2h(f) + 9u(f). -2f3 + 472 Let h(u) = 5u - 2. Let a(p) = 29p + 17. Give -3a(n) - 24h(n). -207n - 3 Let y(p) be the third derivative of p6/120 - p5/60 + p*4/24 + 1047p*2. Let j(d) = 4d*3 - 3d*2 + 7d. Give -j(i) + 3y(i). -i3 - 4i Let o(g) = -23774g2 - 5g - 125. Let r(p) = 11888p2 + 3p + 75. Give 3o(z) + 5r(z). -11882z2 Suppose -5k + 2k = -j + 12, j - 18 = 5k. Let u(i) = 2. Let h(o) be the third derivative of o4/24 - o3/3 - 24o2. What is kh(l) - 2u(l)? -3l + 2 Let x(u) = 2u2 - 3u. Suppose -3r - 3w - 3 = -7w, 3r = w - 12. Let i(t) be the first derivative of -t*3/3 + 2t*2 + 24. Calculate ri(o) - 6x(o). -7o*2 - 2o Suppose 3k + 11x = 9x - 12, -x + 20 = -5k. Let j(w) = -25. Let g(v) = -6. Let m(a) = kg(a) + j(a). Let z(y) = y + 3. Give 4m(s) + z(s). s - 1 Let t(i) = -17i - 16383. Let r(s) = 20s + 16369. Calculate -6r(z) - 7t(z). -z + 16467 Let n(s) = -22028s. Let p(b) = 3147b. Determine -3n(h) - 20p(h). 3144h Let l(a) = -11a*2 - a. Let x(m) = -717m*2 + 7m - 1. Give -14l(r) - 2x(r). 1588r2 + 2 Let o = -51 + 50. Let p be ((-9)/(-7) + 40/(-140))o. Let q(j) = 4j3 + j2 - j. Let t(g) = g. Calculate pq(r) - t(r). -4r3 - r2 Let b(k) = -87k - 12. Let z(u) = -13u - 1. Determine -b(p) + 6z(p). 9p + 6 Let j(l) = 859l + 141. Let v(o) = 1718o + 356. Determine -5j(a) + 2v(a). -859a + 7 Let h(f) = 6f + 3. Let a(o) be the third derivative of 5o4/24 + o3/2 + 67o2. Suppose 4y - 26 - 10 = 0. Let n = y - 13. Calculate na(x) + 3h(x). -2x - 3 Let a(h) = -3h*3 - 4h*2 - 4h - 4. Let u(s) be the third derivative of -s6/30 - s5/20 - s4/8 - s3/2 + 338s2 - 2s. What is 3a(v) - 4u(v)? 7v3 Let s(n) = 2n - n + 0n - 5. Let j(q) = 5 - q + 0 - 1. Let m = -1211 + 1216. Calculate mj(a) + 4s(a). -a Let l(q) = -16 + 24 - 11. Let u(z) be the second derivative of -1/6z*3 + 0 + 2z*2 + 15z. Give -3l(h) - 2u(h). 2h + 1 Let w(k) = -23k*3 + 8k*2 - 8k + 8. Let x(u) be the second derivative of 5/2u2 + 0 + 5/12u*4 - 5/6u*3 - 3/4u*5 - 75u. Determine -5w(g) + 8x(g). -5g3 Suppose -2k - 783 + 793 = 0. Let i(z) = 3z2 + z + 3. Let c(t) = -4t + 6t2 - 10 + 6t + 11 + 4. Determine ki(p) - 3c(p). -3p2 - p Let l(g) = g2 + g + 1. Let u(n) = -12n + 43n + 13n*2 + 3 - 15n - 14n - 1. Determine 2l(f) - u(f). -11f2 Let o(c) = c3 + 82c*2 - 7c + 55. Let n(v) = v*3 + 83v*2 - 6v + 46. What is 6n(g) - 5o(g)? g*3 + 88g*2 - g + 1 Let m(y) = -5y - 4. Let p = -22 - -57. Suppose -4j - j + p = 0. Let b(w) = -1 + 14w + 5 + j. What is -3b(q) - 8m(q)? -2q - 1 Let y(h) = h + 29. Suppose -4u + 24 = 2p - 2, 0 = -2p - 5u + 27. Let z(d) = 6. Suppose 10x + 3 = 6x + a, -10 = 2a. What is pz(b) + xy(b)? -2b + 8 Let j(x) = 9x*3 - 5 + 42x - 50x - 2x*2 - 32x + 44x. Let v(w) = 26w**3 - 5	{ "pile_set_name": "DM Mathematics" }
= -4x - 5s + 4s + 54. Let g(t) = 16t*2 + 2t*3 + 7t - 5 - 3t - 3t3. Is g(x) a composite number? False Is 7 - (-9 + 8) - -1247655 prime? True Let t = -382252 + 664455. Is t composite? True Let m(f) = -f3 + 4f2 - 16f - 5. Suppose -5u + 9 = -16. Let g be m(u). Let l = g - -403. Is l composite? False Let d(l) = -87l - 9. Let c be d(-8). Let w = c - 268. Is w a prime number? True Suppose -13c + 15c = 615190. Is c a composite number? True Let x(y) be the second derivative of 535y3/6 - y2/2 - 175y. Suppose 0r - 6 = -3r. Is x(r) composite? False Let d(k) = 4k - 30. Let m be d(8). Let o be (-3 - -3)/((-3)/1) + m. Suppose 0 = -5p - 3b + 12055, 4822 = 2p - 0p - ob. Is p composite? False Let u(n) = 26398n2 + 41n + 26. Is u(-5) composite? True Suppose 443z = 445z - 1046. Suppose 0 = 530u - zu - 18193. Is u a prime number? False Let z(h) = -19h + 37. Let m be z(-11). Suppose -3g + 2g + m = 0. Is 1-1 - -4g/6 a composite number? False Suppose 29q = 61q - 92704. Is q a prime number? True Suppose -g - 3332 = -8g. Suppose -5m - g = -d + 81, 0 = 4m + 8. Let a = 1124 + d. Is a prime? False Suppose 5b + 2i = 208587, 0 = 4b - 349i + 354i - 166856. Is b prime? True Let o be ((11 - 50/10) + -99)-113. Let a(m) = 2282m + 2. Let y be a(-3). Let b = o + y. Is b prime? False Suppose 3j - 2j = -5w - 17061, 4w - j = -13647. Let c = -2026 - w. Let v = c + -899. Is v composite? False Is -48 + 36 - (0 - 1659275) prime? True Suppose 2w - 12 = -3s + 1, 5s - 5 = 0. Suppose wt - 5n - 104985 = -0t, -4t = -3n - 83984. Is t prime? False Let s(o) = 2o + 42. Let t(v) = v + 14. Let b(p) = -4s(p) + 11t(p). Let q be b(3). Is q - -2 - -2 - -1320 prime? True Let u = -171144 + 497398. Is u composite? True Let a(n) = 6716n - 2. Let p be a(1). Suppose -16r + p = 2r. Is r composite? False Let s = -298 - -321. Suppose 46o = so + 2921. Is o a composite number? False Let b(v) be the third derivative of -971v*4/24 - 3v*3 + 24v*2 - 1. Is b(-1) a prime number? True Let c(l) be the first derivative of 133l*2 + 51l + 2. Is c(11) a composite number? True Let m = -191 - -195. Suppose mc + 19248 = 4i - 3544, -5i = 2c - 28525. Is i prime? False Suppose 6s = 3s + 48. Suppose s = -2p + 20. Suppose pl = -l + 1257. Is l a prime number? True Suppose -2d + t - 2t - 145794 = 0, -5t = 4d + 291588. Let j = d - -41689. Is (-4)/14 - j/56 a prime number? True Suppose 79726 + 694578 = 32x. Is x a composite number? False Let o be (-20532)/(-90) - 2/151. Let z = -1034 + o. Let m = z + 1392. Is m composite? True Let s(h) = 2h2 + 12h. Let a be s(-6). Suppose an = -2n + 6. Suppose -3t = -n, 5q + 2t = -2t + 3314. Is q composite? True Is ((-39594)/(-8))/((45/(-36))/(-5)) a composite number? True Suppose -5k = -4h + 106, 0 = 2h - 3h + 3k + 30. Suppose -71318 = -hn - 2n. Is n a composite number? True Suppose 2w - 540 = 2g + 3370, 5w = 25. Let b = 12293 + g. Is b composite? False Suppose 4k - 3b + b + 159874 = 0, 5k = 3b - 199842. Is (-11)/(198/k)(0 - -10) a prime number? False Let c(b) = 330b*2 + 106b - 2323. Is c(20) prime? True Suppose 3 = z + t, 15 = 19z - 14z + 4t. Suppose 2q = d - 365, 0d + 2d + 4q - 690 = 0. Suppose -3v + 4k = -365, -zv + 9k + d = 10k. Is v prime? False Suppose 0 = 34u + 394557 - 1338839. Suppose 12m - u = 13471. Is m composite? True Let h(i) = -5i3 + 5i*2 - 2i + 61. Suppose 5m + 4o + 85 = 9o, -3o = -m - 27. Is h(m) composite? True Suppose -118357 - 616745 = -18m. Is m a composite number? True Suppose -3j = 2x - 1291170 - 718111, 1339538 = 2j - 3x. Is j a prime number? True Suppose 8 = -4y, 20 = 4l + l + 5y. Suppose lv - 24 = 2v. Suppose -7o + 199 = -vo. Is o prime? True Suppose 25y = -12y + 11455163. Is y prime? True Let m(p) be the third derivative of -14/3p3 - 61/8p*4 + 0p - 22p2 + 0. Is m(-5) composite? False Let w(r) = 3r + 5228. Is w(-27) a prime number? True Let b = 7 + -4. Let v be 6/b2 + -2. Suppose 129 = vf - 1. Is f composite? True Let l be -15((-4)/5 + (-3798)/15). Suppose -586x + l = -580x. Is x prime? False Let r(u) = -3u*2 + 13. Let v be r(8). Let i = -253 - v. Let a = i - -337. Is a composite? False Suppose m = 24m - 323702. Suppose 8z = 7z - 4k + 7049, -2z + 4k + m = 0. Is z composite? True Let t be 1114(1/4)/((-1)/(-6)). Let r be (-5)/(-45)6t. Let g = r + -441. Is g prime? True Let c = -94015 - -131797. Let q = c - 21515. Is q a composite number? False Suppose -a + 9771 = 5s, 4a - 4406 = -5s + 5368. Suppose 0 = 19z - 27314 - 39015. Let n = z - s. Is n a prime number? False Suppose -22o = -9o - 39. Suppose 20768 + 55015 = og. Is g composite? False Let i = 217207 + -110916. Is i composite? False Let f be (-2 - 1)(-124)/93. Is (-3)/(-6)-8 + (f - -4439) prime? False Suppose -j = 0, -y + j - 1 = -3. Is (y-457)/((14/5)/(-7)) a prime number? False Let o(k) = k3 + k2 + k + 2. Let h be o(0). Let l be ((-12)/h)/2 + 123. Suppose 438 = 3d + l. Is d composite? True Let g(s) = -10s3 - s2 - 3s - 5. Suppose -8w + 2 = -6w. Let c(i) = -6i3 + i2 + 1. Let r be c(w). Is g(r) prime? True Let u(s) = 3s2 - 14s - 131. Is u(-56) a composite number? False Suppose -15f + 5j = -12f - 335042, -5j + 223353 = 2f. Is f a prime number? False Let b(h) = -1924h - 15. Let y(v) = 1925v + 16. Let n(i) = -6b(i) - 5y(i). Is n(3) prime? False Let l be (105/56)/5 + 765/8. Is (-22215)/(-8) - (-12)/l prime? True Suppose -4h - 34 = 3n, -5h + n + 0n - 33 = 0. Let z(t) = t3 + 9t*2 + 9t + 8. Let q be z(h). Suppose -37r = -qr + 9738. Is r composite? True Suppose 142 = 25k + 392. Let f(q) be the second derivative of q5/20 + q4 - 11q*3/6 - 3q*2/2 + 27q. Is f(k) composite? False Suppose 1133 = 4v - r, v = -0v + 3r + 297. Let c = v - -967. Is c composite? False Suppose 2521 = 9x + 28. Let u = x - -40. Is u a prime number? True Let t(h) = h3 - h + 1. Let d(n) = -n3 - 14n2 + 12n + 14. Let a(s) = -d(s) - 2t(s). Let y be a(13). Suppose -22b = -yb + 347. Is b a prime number? True Suppose -16 = 5v - 9v + 4j, 23 = 2v + 3j. Let m(l) = 668l2 + 36l + 9. Is m(v) a composite number? False Suppose 1 = -4u - 3, 0 = -2t - 4u + 27056. Suppose -11p = -p + t. Let q = 3358 + p. Is q composite? True Let p(z) = z*2 + 4z + 565. Let y(i) = -5i + 10. Let f be y(2). Is p(f) a composite number? True Let l(q) = -q3 - 78q*2 + 95q - 161. Is l(-87) a composite number? True Suppose -14 = -u - 2. Suppose u = 7j - 3j. Is (-3)/(0 - j)481 a composite number? True Let r(u) be the third derivative of 13u*6/120 - 11u5/60 + u4/4 + 4u3 + 115u*2 - 1. Is r(7) composite? True Let w = 1854 + -1846. Let l(k) = 3k + 6. Let j be l(-4). Is 12/w(-232)/j composite? True Let u = 13003 + 4105. Let x = u + -10041. Let m = x + 824. Is m a prime number? False Let f = -59 - -62. Let z be 29/5 + (f + -9)/(-30). Is z(-6)/45 + (-1438)/(-10) composite? True Let i = 1935 + -1166. Let s = i + -546. Is s a prime number? True Let p = -300105 - -512106. Is p composite? True Let x(m) = -m*2. Let r(d) = 15d*2 - 2d - 17. Let k(h) = r(h) + 6x(h). Let i(c) = -c + 14. Let a be i(8). Is k(a) a prime number? False Let t(h) = 14155h*2 + 67h + 65. Is t(4) composite? False Let g(l) = l*3 - 13l*2 - 4l - 6. Let a be g(14). Is (a/(-8))/((-5735)/(-820) - 7) composite? True Let p(k) = -30k2 + 2k + 136027. Is p(0) a composite number? False Let r(i) = -14129i3 + 11i*2 + 12i + 13. Is r(-2) a prime number? False Suppose 3y + 11f = 15f + 425176, -y = -5f - 141740. Suppose -17v - 37697 = -y. Is v prime? False Suppose -17c - 2i = -22c + 321821, -3c + 2i = -193087. Is c a composite number? True Let g = 421 + -416. Suppose -177230 = -gh - 39175. Is h a prime number? True Suppose 4l - 1027884 = 2z, 4l - 3z = 1209502 - 181610. Is l prime? True Is (-2)/((-3736018)/3735974 + (-3)/(-3)) a composite number? False Suppose 0 = 14q - 9q - s - 1987588, -1192536 = -3q - 5s. Is q composite? False Let y(i) = -i2 + 11i + 37. Let b be y(-3). Let g(x) = -19x3 - 3x*2 - 28x - 159. Is g(b) a composite number? False Let a be (-117215)/45 - (-4)/(-18). Is ((a/(-3))/5)/((-1)/(-57)) composite?	{ "pile_set_name": "DM Mathematics" }
= -1533m - 1495m for m. -75 Solve -1314l + 5699168 = 5826626 for l. -97 Solve 84i + 1024399 = 1025743 for i. 16 Solve 452s - 60401 = -727s - 6167 for s. 46 Solve -1313t + 109t = 77056 for t. -64 Solve 5676 + 11850 = -762p for p. -23 Solve 0 = -1042g + 2239g - 51471 for g. 43 Solve -1009t - 35954 - 1379 = 0 for t. -37 Solve -735h + 1911h + 2592h + 256224 = 0 for h. -68 Solve -200y - 9594 = -1072y - 194y for y. 9 Solve -317c - 591c + 34580 = 2c for c. 38 Solve -7422b = -7187b + 22560 for b. -96 Solve 622f = -545f + 1051f + 3781 + 743 for f. 39 Solve -102b - 4942 = 223b + 9683 for b. -45 Solve -1950i + 868i + 1615 = 1101i + 12530 for i. -5 Solve 799k - 2784 = 16392 for k. 24 Solve -16557 = 2034q + 39199 - 6242 + 27778 for q. -38 Solve -803q - 28q + 26002 = -97q - 27580 for q. 73 Solve -618x = 204x + 46854 for x. -57 Solve 7677j = 5582j - 56565 for j. -27 Solve 3208q + 2698q - 152q = 258930 for q. 45 Solve -8464 + 53404 = 1284r for r. 35 Solve -70u + 599u = 57311 - 1766 for u. 105 Solve 639089j - 31812 = 640535j for j. -22 Solve 1084r - 5270 - 35922 = 0 for r. 38 Solve 0 = -320r + 1362 + 1198 for r. 8 Solve -72t + 2578 = 1066 for t. 21 Solve -18553c + 32412 = -18997c for c. -73 Solve -78o - 850o - 465o + 1172 - 97289 = 0 for o. -69 Solve 6985 - 113 = 108h + 1788 - 3556 for h. 80 Solve -52n = -22n + 50n - 3393 + 1233 for n. 27 Solve 237s - 113s = 224s - 3700 for s. 37 Solve 134p - 506p + 70495 = 20275 for p. 135 Solve 7158u - 6438u + 61200 = 0 for u. -85 Solve 530g - 1641g + 1716 = -540g - 538g for g. 52 Solve 0 = -188i + 70704333 - 70705273 for i. -5 Solve -10096f + 279466 + 285910 = 0 for f. 56 Solve -2044c + 1737c + 5709c + 442964 = 0 for c. -82 Solve 0 = 1393i + 429 + 2273 + 84 for i. -2 Solve 6506 = -2957i + 2440 - 1848 for i. -2 Solve -132s - 1515 - 1181 = 208 for s. -22 Solve -873d - 95840 = 2459d - 337d for d. -32 Solve 0 = 1540c + 2138c + 250104 for c. -68 Solve 335 + 117 + 1672 = 292l - 1380 for l. 12 Solve 1506l + 245 + 4947 - 587 = -10455 for l. -10 Solve 943z + 34 - 88 = 483z + 514z for z. -1 Solve 31l - 50l - 257l + 1813 - 10369 = 0 for l. -31 Solve 37h - 14 = -42h - 38h + 116h for h. 14 Solve 842n = 696n + 444 - 3802 for n. -23 Solve -801 = 2s + 2s - 89 - 308 for s. -101 Solve 121k = 46k - 278k - 706 for k. -2 Solve 15340 = -410c + 883c + 707c for c. 13 Solve 263 + 127 = 76k - 218 for k. 8 Solve -700o + 2028o + 32344 = -63272 for o. -72 Solve 0 = 27g - 82855 + 84529 for g. -62 Solve -1326f + 552828 = -357f + 3832f + 1208f for f. 92 Solve 0 = 118h + 1133 + 700 + 4303 for h. -52 Solve -3290 = -1635y + 3250 for y. 4 Solve 430a - 10491 - 322 - 4667 = 0 for a. 36 Solve 65f - 199f + 1820 = -90f - 114f for f. -26 Solve 0 = 52t - 184070 + 186722 for t. -51 Solve 0 = 29646l - 29713l + 1541 for l. 23 Solve -4834g + 53 = -9583g + 4896g + 8726 for g. -59 Solve -2177n - 85n - 565n = 161139 for n. -57 Solve -886o = -417o + 2345 for o. -5 Solve -62v - 378v + 128v + 6685 = 643v for v. 7 Solve -617h = 847h - 419h + 31250 + 16820 for h. -46 Solve 221p - 1594 - 648 - 85 = 325 for p. 12 Solve 94k + 1888 = 244k - 197 + 8835 for k. -45 Solve 300x + 4091 - 3791 = 0 for x. -1 Solve -6463 = 469k + 136k + 4427 for k. -18 Solve 6k - 6059 = -60k + 31k - 38k for k. 83 Solve 25b - 38b = 85 - 293 for b. 16 Solve -509m + 1706 = 22575 for m. -41 Solve 4523 = 891b - 88141 for b. 104 Solve 8441 - 13003 = 808g + 21956 + 14690 for g. -51 Solve 292s - 6804s + 599s - 396171 = 0 for s. -67 Solve -52x + 3057 = 717 for x. 45 Solve 1016n + 13516 + 12381 = 7609 for n. -18 Solve 345 = -1514a + 275a + 14034 + 17286 for a. 25 Solve -1284k + 33015 + 32465 = 23274 - 20710 for k. 49 Solve 351 + 1300 = -20w + 211 for w. -72 Solve 40f - 628 + 2332 = -139f - 247f for f. -4 Solve 399n + 312n = 1102n - 294n + 11058 for n. -114 Solve -473h + 443h - 430h = -21160 for h. 46 Solve 0 = -367y + 9699 + 2412 for y. 33 Solve -11529q - 88775 = -10204q for q. -67 Solve 1153c + 20995 = 2332 - 22845 for c. -36 Solve 53844 + 21653 + 24244 = -838a + 10913 for a. -106 Solve 143y - 288y = -103y + 210 for y. -5 Solve -4478s + 788s - 239s = -3929 for s. 1 Solve -7864c + 671248 + 148976 - 190076 + 179844 = 0 for c. 103 Solve -2146h - 746 + 34362 = 910h for h. 11 Solve -250b - 106b + 8882 = -16038 for b. 70 Solve 408k - 434k = -264k + 8806 for k. 37 Solve 84379 = -4979u + 343287 for u. 52 Solve 143493b = 143498b - 160 for b. 32 Solve -173651 - 57547 = -3961g - 13343 for g. 55 Solve -223 = -23f + 25 + 97 for f. 15 Solve -61484f = -62461f - 92815 for f. -95 Solve 28434v - 28501v = 3752 for v. -56 Solve 851j = -675j + 120554 for j. 79 Solve 88336 + 158699 = 2369t + 48039 for t. 84 Solve -7079 = 1454r + 53989 for r. -42 Solve 365z - 7206 = -5456 + 23435 for z. 69 Solve -217s - 2179 + 3329 = -5897 - 1850 for s. 41 Solve -260 = -35276s + 35302s for s. -10 Solve -723j + 9602 = -2040 + 797 for j. 15 Solve 10c + 6150 + 3066 = -1526c for c. -6 Solve 386i + 749i - 5903 - 5902 = 6355 for i. 16 Solve 656 = -39b - 134b + 1640 + 2130 for b. 18 Solve 908n - 18560 = -120256 for n. -112 Solve -175 + 1478 = 60p - 1097 for p. 40 Solve -314a - 1687 = -59a + 8258 for a. -39 Solve 514f + 10574 + 20800 = 16f for f. -63 Solve 3001z - 425z + 1106z = -48z - 74600 for z. -20 Solve 0 = 5610p - 3657p + 25389 for p. -13 Solve -676s + 31020 = -4808 for s. 53 Solve 96n - 6015 = -57n + 8214 for n. 93 Solve 601611s = 601676s - 1300 for s. 20 Solve -12084 = -880i + 1092i for i. -57 Solve -61262 = -1285p + 128918 for p. 148 Solve 18 + 10 = 725z - 1450z + 718z for z. -4 Solve 0 = -333057n + 332851n + 3090 for n. 15 Solve 37y + 3857 - 737 + 1421 = -565 for y. -138 Solve 38 - 4768 = -94u - 1722 for u. 32 Solve 24507p = -481329 - 204867 for p. -28 Solve 922918 = 6633v + 3151v + 91278 for v. 85 Solve 4617 = 348c - 13131 for c. 51 Solve -86238 = -2815w + 99552 for w. 66 Solve -146630 = -542f + 2539f + 695f + 718f for f. -43 Solve 1913d - 359346 = 659d - 3593d - 2199d for d. 51 Solve -20334k + 20460k + 252 = 0 for k. -2 Solve -1119k = 60k - 69k - 86630 + 6710 for k. 72 Solve 2345p + 31943 = -120482 for p. -65 Solve 4196 - 16 = 2090b for b. 2 Solve 146v - 13v - 27072 = -619v for v. 36 Solve -210c + 433c + 5352 = 0 for c. -24 Solve 0 = -10046b - 2634b - 134854 + 36496 - 256682 for b. -28 Solve -365s + 19698 = 271s - 167s for s. 42 Solve 80x - 34235 + 6986 = 373x for x. -93 Solve 5 = 5k + 63 + 32 for k. -18 Solve 3c + 20c + 47198 - 45686 = -c for c. -63 Solve -31660 = 438u + 15566 - 5848 + 7678 for u. -112 Solve 39y - 1820 = 81y + 37y + 866 for y. -34 Solve -3967 + 18819 = 188n for n. 79 Solve -6224j + 162769 = -236j - 27738 - 55001 for j. 41 Solve 0 = -2616o + 15518 - 96614 for o. -31 Solve -122v - 74617 = 122v + 655v for v. -83 Solve 29y + 698y = -845y - 165060 for y. -105 Solve -17t - 55t + 377 = 23t - 1998 for t. 25 Solve 445f + 399f = 5811 + 4317 for f. 12 Solve 0 = 189z - 198162 + 187389 for z. 57 Solve 2126c - 215710 = -1944c for c. 53 Solve 15995z - 7784z - 7899z + 8112 = 0 for z. -26 Solve 5960c = 6170c - 420 for c. 2 Solve -13884 = -906f + 4541 - 2117 for f. 18 Solve -4191p + 4184p - 80 = 95 for p. -25 Solve -231t + 54t + 1608 = 225t for t. 4 Solve 171f = 1335f + 8535 + 35697 for f. -38 Solve -21965 = 3729f - 260621 for f. 64 Solve 842w - 260w = 0 for w. 0 Solve -2611h + 2318h + 1319 - 1127 = -3324 for h. 12 Solve -10048 - 13036 - 6335 = 946w - 3209w for w. 13 Solve 45q + 11080 = 226q + 96q for q. 40 Solve -1127x + 10712 + 15580 = -21042 for x. 42 Solve 36h - 8h - 4400 = -82h for h. 40 Solve 146065t - 440 = 146045t for t. 22 Solve 315n - 18270 = -91n + 158n - 274n for n. 35 Solve 175g - 111g - 3360 + 510 = 1489g for g. -2 Solve 530 - 244 + 207 = -1242u + 1213u for u. -17 Solve 0 = -2054r + 7070 + 72127 + 7071 for r. 42 Solve 87o = 42629 - 42455 for o. 2 Solve 300g = -223g - 447g + 14550 for g. 15 Solve -5000 + 95 = -128x - 7x + 225 for x. 38 Solve 4664l - 1626l - 3885 = 1529l + 1614*l for l. -37 S	{ "pile_set_name": "DM Mathematics" }
fy (n/(nn2)nn6/n)(-4/13) assuming n is positive. n(-16/13) Simplify m(-1/15)m/(m/(m/((m/(m/((mm28/mm)/m)))/m))) assuming m is positive. m(-391/15) Simplify s/s(6/7)sss(s/(s/((ss/s34)/s))s)/s assuming s is positive. s(-209/7) Simplify (p/p(-2/7))/p(-5) assuming p is positive. p(44/7) Simplify (aa/a(-2/3))(-21) assuming a is positive. a(-56) Simplify (j(1/5)/(j/(j/(j(-2)j))))(-30) assuming j is positive. j(-36) Simplify ((i/i*(2/3))/ii)/i*(-2/7)((((i*(2/5)i)/i)/i)/iiii)(3/4) assuming i is positive. i(701/420) Simplify (ss*(-3/5)s*6s)/(sss*1sssss/s5) assuming s is positive. s(22/5) Simplify (b*12bb)/((b/(bb10))/b) assuming b is positive. b25 Simplify ((d/(dd9))/(d/((d/d(-12))/d)))(-1/3) assuming d is positive. d(-2/3) Simplify (u(-2/7))(-1/5)/(u0/u)(9/10) assuming u is positive. u(67/70) Simplify (y(-16)y)25 assuming y is positive. y(-375) Simplify (qq3qqq/(q*1q))(5/7) assuming q is positive. q(25/7) Simplify (b/((((b*13b)/b)/bb)/b)b15/b)40 assuming b is positive. b*120 Simplify (y/(y/(yyyyy1)))25/(y(-1/9)(y/(((yyy*4)/y)/yy))/y) assuming y is positive. y(1171/9) Simplify (f(1/4))*(-4/7)(fff/(f(1/4)/f))5 assuming f is positive. f(521/28) Simplify ((n/n(-3/7))(1/36))34 assuming n is positive. n(85/63) Simplify (u0)*(-1/25)u*(-1/7)u*(-3/2)u assuming u is positive. u*(-9/14) Simplify (jj*5jj(1/6))/(((jj/(j/(j(-4)/j)))/j)/j(2/11)) assuming j is positive. j(815/66) Simplify ((((r/(r40r))/r)/r)/rr)/r(-23) assuming r is positive. r(-19) Simplify (s/(ss(-22)ss)s)/s(37/3) assuming s is positive. s(26/3) Simplify ((l(ll*18/l)/l)/ll)/l(-10/3) assuming l is positive. l(64/3) Simplify ((m/(m/(m(m(-1/3)m)/mm)))/m(2/11))/(m(1/2))(1/23) assuming m is positive. m(2221/1518) Simplify (j/(j/(j/j(-35))))29 assuming j is positive. j1044 Simplify b4/b(6/29) assuming b is positive. b(110/29) Simplify (uu(-17))/u15 assuming u is positive. u(-31) Simplify (z3z(-21))10 assuming z is positive. z(-180) Simplify (((t(-1)/t)/t)/t(2/17))(-4/7) assuming t is positive. t(212/119) Simplify ((qq3/q)/q(-4))/(qq(-3/4)q)(-35) assuming q is positive. q(203/4) Simplify (b(bb*(-1/2))/bbb)(-12) assuming b is positive. b(-30) Simplify p(2/47)/p(-5/2) assuming p is positive. p(239/94) Simplify d/(d/(d/d(2/3))d)d(-6)(d1)(-3/4) assuming d is positive. d*(-89/12) Simplify ((((f/(ffff*(-6)))/f)/ff)(16/7))27 assuming f is positive. f(1296/7) Simplify ((n13n)/n(nn/n(-3)n)/nn)(-1/2) assuming n is positive. n(-19/2) Simplify (((oo*(-3/10)o)/o)/ooo/(o/(o/(o/(o*(-8)/oo))o))oo)/((oo*5o)/(o/(((oo1)/o)/o))) assuming o is positive. o(-103/10) Simplify (a(-5)/a)/aaa/((a13a)/a) assuming a is positive. a(-18) Simplify (n(-6)n(-2/7)/nn)/(n1)(5/4) assuming n is positive. n(-211/28) Simplify ((f(1/8)/f)/((f*(-3)f)/f))/(f*(1/3)/(ff/(ff(-6)))) assuming f is positive. f(211/24) Simplify (n(1/4))(-21)/(n(-5)/(((nn/n(-6/11))/n)/n)) assuming n is positive. n(13/44) Simplify (z*4/((z(zz(-3))/z)/z))/(z(2/3)/z)(1/23) assuming z is positive. z(484/69) Simplify (((ooo/(o(ooo*(2/7)/oo)/o)o)/o)/(o/(o/o(-2/5))))/(o(-1/3))34 assuming o is positive. o(1307/105) Simplify (((cc/(cc/c(6/5)c)c)/ccc)(-2/23))(-5) assuming c is positive. c(22/23) Simplify ((a/(aa*(-32/3)/aaaa))/a)/a(-5/7) assuming a is positive. a(176/21) Simplify m/m*2m*(3/5)(m/m1)(-38) assuming m is positive. m(-2/5) Simplify k(-1/19)/k(-10/9) assuming k is positive. k(181/171) Simplify ((s(-6))(-7/2))(3/26) assuming s is positive. s(63/26) Simplify ((g(-2)/g)38)(-10) assuming g is positive. g1140 Simplify i(i23i)/iii(-9) assuming i is positive. i16 Simplify (z/(zz(-11)zzz))(-24) assuming z is positive. z(-192) Simplify (j/(jjj/((j/(jj/(j/(((j(-4/11)/j)/j)/j))))/jj)))/j(11/2) assuming j is positive. j(-91/22) Simplify (m/(m*(-2)m))(-6/13) assuming m is positive. m(-12/13) Simplify (v/v*0)/(vv/(v*(-1/4)v)v)(((v*(-3)v)/v)/v)/vvv4 assuming v is positive. v(-5/4) Simplify (h(5/2))15 assuming h is positive. h*(75/2) Simplify ((z(zzz/(zz/(z/((z(z*(-2)/z)/z)/z)z))z)/z)/z2)(-24) assuming z is positive. z(-144) Simplify ll*(-12)ll/l(-12)lll assuming l is positive. l*6 Simplify (((aa/((a/(a/(a/(aaa/(aaa(a/a(-1/2))/aaaa)aa)))aa)/a)aa)/a)/a(1/5))/(a(-2))(25/3) assuming a is positive. a(479/30) Simplify ((j/(j*(-14/9)j))/jj)/j(-9) assuming j is positive. j(95/9) Simplify (j(-2/7))(2/29)(j/(j((j/(j/j(6/11)))/j)/j))/(j(-4/3)/j) assuming j is positive. j(25243/6699) Simplify b15b/(b(-3/4)/b) assuming b is positive. b(71/4) Simplify (((f/((f/f*12f)/f))/f)/f)33 assuming f is positive. f330 Simplify (bb/(b/(b(1/4)/b))b)*(2/17)/(b/(b/((bb*(1/5))/bb))b)(-1/2) assuming b is positive. b(106/85) Simplify ((aa/((a/(a/(a/(a/(aa6)))a))/a)a)/(a(a/(a/(a(a(-1/4)/a)/a)))/a))23 assuming a is positive. a(-69/4) Simplify ((f/f(3/11))/ff(-14)/f)(-8) assuming f is positive. f(1344/11) Simplify d(-8)/(d*(4/5)d) assuming d is positive. d(-49/5) Simplify ((m(5/6)/m)/mm3)/(m2m/(mm5)) assuming m is positive. m(29/6) Simplify (ttt/((t/(((ttt/(t/t(-3)))/t)/tt))/t)t(3/2)tt)/((t/((tt*(-2))/t))/(t/(t/(((tt*3t)/t)/t)t))) assuming t is positive. t(7/2) Simplify (s(-8)sss*4ss)/(s(-3)s*9s) assuming s is positive. s(-7) Simplify (m(-3)/mm/(mmm(-7)m))/(m/(m*2/m)m(-1)) assuming m is positive. m2 Simplify (l/l0)(-5/4)/(l/l(-2/7))(-36) assuming l is positive. l*(1261/28) Simplify ((gg/(g/g(-1/2)))/g)(-4/11)g3g(g/(((((g(-5/4)/gg)/gg)/g)/g)/g)g)/g assuming g is positive. g*(415/44) Simplify ((gg*(-3/4)/g)/(gg*0gg))/((g((((g*6g)/g)/gg)/g)/g)/g5) assuming g is positive. g(-15/4) Simplify (m/m1)/mm8 assuming m is positive. m7 Simplify o(14/9)/(o16oo) assuming o is positive. o*(-148/9) Simplify (qq/((qq(-5))/q))/(q/(q/(q(qqq(q/q5)/qq)/qq))q)(q/(q/(q(-1/5)qq))q)/q(-2) assuming q is positive. q(54/5) Simplify (((t*(5/3)t)/tt)/(t4t))/(t5/(t3t)) assuming t is positive. t(-10/3) Simplify ((aaaa3)/a)/a(-7)(a/(a/a0))(-1/14) assuming a is positive. a12 Simplify ((tt*(1/5)t)/((t/(t*(1/14)tt))/t))(1/26) assuming t is positive. t(23/140) Simplify (y(-2/5))(7/2)(y/(yy/(yy/y*(-2)yyy)))(-4/9) assuming y is positive. y(-61/15) Simplify (y1)32/(y/(y/(y*(2/5)y)yy))(-32) assuming y is positive. y(64/5) Simplify (ii(-1/3))50(i(ii*1/ii)/i)/(i/(iii/i0)) assuming i is positive. i(112/3) Simplify (z*(3/8)z/(zzz/(z/(zz(-11/2))))z)(10/7) assuming z is positive. z(195/28) Simplify (i/i(-1))(-43)/(i*5iiii(-2/17)iii) assuming i is positive. i(-1647/17) Simplify h15/(hh/h4) assuming h is positive. h17 Simplify j(-3/4)j/j(-41) assuming j is positive. j(165/4) Simplify (pp20p)(4/13) assuming p is positive. p(88/13) Simplify (u(-2/3))(7/4)/(u1)(-18) assuming u is positive. u*(101/6) Simplify (s/(ss/(ss/(s/(s/(s/s8)))s)))/(s/s(-19)) assuming s is positive. s(-11) Simplify (q*1q8)(-48) assuming q is positive. q(-432) Simplify (v1/vvvv2)24 assuming v is positive. v96 Simplify y/(y(-1/5)/yy)y19/yy assuming y is positive. y(101/5) Simplify (h(-2)h)50 assuming h is positive. h(-50) Simplify (z9)44 assuming z is positive. z396 Simplify ((k/(k/(k/(kk*(-1)/k))))/(kk(((k/(k2/k))/kk)/k)/kk))/(kk*(3/5)kkk*(1/3)/kk) assuming k is positive. k*(-44/15) Simplify (ii*(-11))/((ii/(i/i*(-8)))/ii) assuming i is positive. i*(-3) Simplify ((aa*(1/2))/(a/(aa/((aa/((a/a(-1/5))/aa))/a))))(9/7) assuming a is positive. a(243/70) Simplify g*(18/5)g(gg**(-18))/g assuming g is	{ "pile_set_name": "DM Mathematics" }
ve y - 3u = -4, w = 2y + ou + 7 for y. 2 Let k(p) = -p2 + 2. Let i be k(0). Suppose 2z - 8 = 2a, ia - 4a - 3z + 12 = 0. Solve 3y + ay = -g + 4, -y = 5g - 20 for y. 0 Suppose -5a = -a + 16. Suppose 7 + 23 = 5j. Let y = j + a. Solve -g = -3g + c - 1, -16 = 2g + yc for g. -3 Suppose -w - 4z = 11, z = -5w - 3z - 7. Let l be 0/4 - (-3 - w). Suppose 3o - 21 = 3q, 2q + 8 = lo - 10. Solve t - 6 = on, 3n - 3t + 6 = 3 for n. -5 Let n = -4 + 6. Let x be (2/(-6))/(n/(-12)). Solve -xk - 2h = h - 9, 11 = 3k + 4h for k. -3 Let z = 14 + -10. Solve -z = -x, -2d + d + 3x - 17 = 0 for d. -5 Let v be (-2 + 3)/(9/8 + -1). Solve -17 = -2i + a - 4a, -a + v = 3i for i. 1 Let z = -21 + 5. Let q = z + 18. Solve -q - 2 = -5g + 4y, -5 = 5y for g. 0 Suppose -3u - 120 = -13u. Let i be 13/((-6)/(-8)). Solve -3t - u = t, 3n + it + 18 = 0 for n. -2 Suppose t - 11 = -2n, -2n + 5t = -5n + 34. Solve w + 2 = 5q - 5, -nw - 4q + 17 = 0 for w. 3 Suppose -3q = -y, 8y = 3y + 4q. Suppose t + t - 8 = y. Let h = 5 - 1. Solve -hl = t, -3l = -4r + 5 - 2 for r. 0 Suppose -3t + a + 2 = -10, -4 = -t - a. Solve -3q - 12 = -th, -2q + 4h - 8 = -0q for q. -4 Suppose s = -8 + 4, -12 = 2r + 5s. Solve -1 = rg - 5m, 5g + 3m - 9 = -m for g. 1 Suppose -6h + 0 = -12. Let s be (1/5)/(2/10). Let p be 5/3 - s/(-3). Solve r + 0r = m + p, hm - 5r = -16 for m. 2 Let i be (-4 + 0 - -7) + 0 + 0. Solve -im + 4q = q, q = 2m + 1 for m. -1 Suppose -3s - 21 = -3j - s, 14 = 2j - 5s. Solve 0 = z - 3u, -u = 2z - 0u - j for z. 3 Let t = 18 + -12. Let z be (t + -9)2/(-3). Solve -i + z = -c - 0, 0 = -2c + 3i - 6 for c. 0 Let o be -738/(-12). Let b = o + -10. Solve bd = -c - 18, -5c = d - 2d - 15 for c. 2 Let v(i) = -i - 3. Let n be v(-3). Let k = n + 2. Suppose -d = 3d - 3u - 18, u = 3d - 11. Solve 0 = dg + 2g - z + 6, 4g = -kz - 2 for g. -1 Suppose -i + 0 = -3. Suppose -3m + i = 5b - 22, -b + 4m = -5. Let l = -6 + 11. Solve -bd = lg - 40, 2g = -2g + 5d - 4 for g. 4 Suppose -3d + 21 = 2q, q - 2d + 0d = 14. Let n = 0 + q. Solve -1 = -3x + 4m + 3, 3m = -n for x. -4 Let l(j) = j + 4. Let p be l(0). Solve -4m - 2o + 7 = m, -pm - 3o = 0 for m. 3 Suppose -2l = -0l - 6. Suppose 0 = 3d - l - 9. Solve 2n - 6n - 4i - 8 = 0, -n = di + 2 for n. -2 Let i(h) = -10h + 5h - 3 + 7. Let m be i(-4). Solve -m = -4y + 4n, 0 = 3y - y - 3n - 16 for y. 2 Let l = -95 - -99. Solve 3w = -t + 12 - l, 2w - 9 = 3t for t. -1 Suppose 0z + 5z = 55. Let a = -2 - -5. Let r = 6 + -4. Solve -5t + 1 = 2k - k, rk = at - z for k. -4 Suppose o = 4v + 1 + 17, 2o + 8 = -3v. Let m(k) = k2 - 2k + 3. Let n be m(o). Solve z + 3h - 9 = 0, 4h - 3 = -5z + nh for z. 0 Let x = -4 - -7. Let k be x(-3)/(-3)-2. Let a be (-10)/(-8) - k/(-24). Solve -4i + 17 = -2o - a, -5o = -3i + 10 for o. 1 Let f(g) = 6g2 - g. Let a be f(-1). Let l = a - 1. Solve -j - 2z - l = 0, -2j = -3z + 4 - 27 for j. 4 Suppose 0k + 10 = 5k. Solve -4j - 4 = -kf, 11f - 6f + 5j = -20 for f. -2 Suppose 3s + 15 = 0, -4 = -u + 5s + 25. Suppose -uh = -8h + 28. Solve -hq - 5l - 16 = -3q, 3q + 4l = -12 for q. -4 Let j = 29 - 9. Let u be 3/6 - j/(-8). Solve -3k + 1 - u = n, 0 = k for n. -2 Let l be -1(6/(-4) + 6/4). Suppose -5r = -20 - 0. Solve 0 = -ro + 12, -3t - 2o - o = l for t. -3 Let h(n) = 4n - 6. Let l be h(6). Let v(i) = -i3 + 4i*2 + 9i - 24. Let k be v(2). Solve 5p + 2z = -5, l = -p + kz + z for p. -3 Let s be (-1)/(-2) - 14/(-4). Let t be 2 - (s + -4 + -1). Solve 0 = -3f + 2d + 7, -tf + 0d - 2d = 1 for f. 1 Suppose 4q - 3 = 9. Solve -4d = 2o - 6, 0 = 4d + qo - 2 - 9 for d. -1 Suppose -2z = -11z + 27. Let i(v) = -v2 + 7v - 6. Let c be i(4). Solve -4q - zm = -c, -m + 8 = 4q + 3m for q. 0 Let v = -72 + 90. Solve 3i - 2i + 5y + v = 0, -2i = 5y + 21 for i. -3 Suppose -2v + 26 = -3k, 3k + 65 = 6v - v. Suppose 0 = -4y - 12, -w + 3y - v = 8y. Solve 15 - 3 = 4c, -3x - 3 = wc for x. -3 Let y = 3 + 2. Solve -yu - 4x = -20, -1 + 13 = 3u - x for u. 4 Suppose -q + 9 = 3i, 4q - 3i = -8i + 22. Suppose 64 = 3t - 4k, -3k = qt + 2t - 126. Solve c + 5v - t = 0, 26 = -c + 5v + 10 for c. 4 Let c = -20 - -23. Let v be ((-3)/3 + 1)/1. Let k(o) = -o. Let w be k(v). Solve 0 = cz + 2q + 13, 2z + w + 9 = -q for z. -5 Let k(d) = -d. Let p(z) = -z*3 + 5z*2 + 9z. Let u(o) = -3k(o) - p(o). Let r be u(6). Solve -6 = -5i + 2a, ri + 5i = a + 3 for i. 0 Let n be -1 + 4/(4/5). Let a be ((-10)/6)/(2/6). Let b = 25 + a. Solve -nk - b = 0, y - 2k = -k + 4 for y. -1 Suppose -4x + 24 + 8 = 0. Suppose -11 = xz - 9z. Suppose -f + 3t = -2, 2f - 2 = f - t. Solve d + z = -2k, 4d + fk - 1 = -27 for d. -5 Suppose -5t + 5z - 3z + 16 = 0, -3z + 26 = 5t. Suppose 0 + 4 = 4w. Let g = t - w. Solve 1 = 4n + gs - 1, 0 = 3n + s - 4 for n. 2 Let g(y) = 13y - 3. Let i be g(2). Suppose -8 + i = 5c. Solve -ck + 0 = -p - 1, 0 = -k - 1 for p. -4 Suppose 0 = 7h - 3h + 52. Let d = 17 + h. Solve 4o = -0o + di - 28, -5i + 10 = 0 for o. -5 Suppose 4n - 8 = -4x, 2x - 7x = -3n - 2. Solve -3v - 9 = 4z, -11 = 4z + n for v. 1 Let m(u) = -3u - 5. Let g be m(-5). Let d = 4 - g. Let k be 30/8 + d/(-24). Solve 2l = -x - 7, -5x + kl - 9 = l for x. -3 Suppose 4n = -2m + 76, -7m + 3n - 71 = -9m. Solve 8c = 3d + 3c + 22, 3d + 5c - m = 0 for d. 1 Suppose 0 = -g + 6g + 5. Let l = g - -9. Suppose l + 4 = 3p. Solve -4n - 2 = -o - 9, 0 = 2n - po for n. 2 Let p(s) = s*3 - 3s*2 + s + 1. Let x be p(1). Solve 2m + 2k = 4m + 2, x = 4m - 3k + 5 for m. -2 Let o be 4/(-8)(1 - 1). Solve o = -d - r, -5d + r = 51 - 21 for d. -5 Let r(d) = d + 10. Let b be r(-9). Suppose 2g = -b + 7. Suppose -10 - 5 = -gq. Solve q = i, -2i = -t - 11 - 1 for t. -2 Suppose n - 4 = 2. Suppose -8 = -5m + 3s, -3s = -3m + nm - 24. Suppose 4w + v = 4v + 48, m = v. Solve w = 5h, -3h + 35 = 4z + 2h for z. 5 Let y = 67 - 57. Solve 0b - y = -5j - 2b, -3j + 7 = b for j. 4 Let x = 7 + -5. Let a = 3 + x. Suppose 0 = aq - 16 - 4. Solve -qb - 5k + k = -12, 4b = k - 8 for b. -1 Let l be -1 - 27/(-2). Let f be (-2)/(-7)(1 + l). Solve -14 = 2z + fa, 2a = z + 4z + 7 for z. -3 Let n(d) = 3d + 17. Let h(w) = -2w - 11. Let y(k) = 8h(k) + 5n(k). Let q be y(-5). Let c = 10 + -10. Solve -a + 14 = -5b - 7, c = qb - 3a - 2 for b. -5 Let k = -22 - -57. Let h = -16 + k. Let p = -2 - -7. Solve 1 = -r - 4r - b, -pb + h = r for r. -1 Let d(v) = v - 8. Let m be d(11). Solve 3 = -mr - 0f - 3f, -3f = -2r + 8 for r. 1 Suppose q + 2u = 11, -5q - 5u + 23 = -4q. Solve -2v = 2o - 3 - q, -2v = -4o + 12 for o. 3 Let i = 0 - -4. Suppose -i = -2j, -4 = 5r - r - 4j. Solve p = 3p + n + r, 0 = 4n + 12 for p. 1 Suppose 2f = -0f + 8. Let l be 4/6 - 350/(-15). Let w(d) = -d + 18. Let o be w(0). Solve p - q - 4q - o = 0, 4p + fq = -l for p. -2 Suppose l - 2 = 0, 3l + 3 - 48 = -u. Solve -4g = 2b - 2, -4b - u + 10 = -3g for g. 3 Let x(f) = -5f - 24. Let q be x(-8). Solve 4n - s = -4s + q, 5n - 20 = 4s for n. 4 Suppose 0 = -5d + 5v + 10, 2v = 5v - 9. Suppose dh - 12 = 3. Solve o = 4m + 16, o + 16 = -ho for m. -5 Suppose 4x + 4u + 9 - 53 = 0, 0 = u. Let y = -7 + x. Solve -2n + l + 1 = -4n, 3n - yl + 7 = 0 for n. -1 Suppose 0 = 4c - 6c + 8. Suppose -4t = -2a + 16, 3a + ct + 16 = -2a. Solve -5s = 2v - 1, -5v - 5s = 5 - a for v. -2 Let s = 11 + -9. Suppose sh - 9 = -h. Solve 2l + 4 = -2n, -5l - hn + 10 = -2n for l. 3 Let n(g) = -15g - 4. Let o be n(-3). Let i be (-3)/6 - o/(-2). Suppose 0 = -4z + 4v - 2v - 10, 4v = 2z + i. Solve -2j = k + 4 - z, -3j - 9 = 0 for k. 2 Let v(p) = -p*2 + 14p + 16. Let a be v(15). Let l be -1(-4 - a/(-1)). Solve -20 = -0g + lg + 4c, 16 = -5g + 2c for g. -4 Suppose 4v - 2j = 20, v - 4j = 2v - 23. Solve -2h - 4t = -4, 0 = 4h + 5t - v - 1 for h. 2 Let y = 20 + -2. Solve -1 = 2p - d, -2p - 4d - y = p for p. -2 Let o = -3 - -5. Suppose ou - 12 = -u. Solve 0 = -3p + uk + 7, -p + k = -1 - 2 for p. 5 Let k(b) = b*2 + 11b - 8. Let o be k(-12). Solve -2t = -3t - 4n - 19, 0 = 4t + o*n + 28 for t. -3 Suppos	{ "pile_set_name": "DM Mathematics" }
What is h(2)? -5 Let r(q) = q*2 + 8q + 16. What is r(-6)? 4 Let w(b) = -5b - 14. Give w(-12). 46 Let m(y) = -2y*3 - 5y + 24. What is m(0)? 24 Let q(z) = z*3 + 20z*2 + 15z - 24. What is q(-19)? 52 Let q(y) = y*3 - 9y*2 + 5y + 9. What is q(8)? -15 Let g(y) = -15y + 105. Calculate g(7). 0 Let u(x) = 2x*3 + 2x*2 - 2. Determine u(-2). -10 Let a(x) = -5x + 43. Give a(10). -7 Let s(w) = 2w2 + w - 3. Calculate s(-4). 25 Let z(w) = -2w*3 - 4w*2 + 7w + 18. Determine z(-3). 15 Let q(r) = 2r - 1. Give q(15). 29 Let f(v) = -v2 + 16v + 35. Calculate f(18). -1 Let h(b) = b*2 - 57b + 222. Determine h(53). 10 Let y(w) = -4w - 35. Calculate y(-10). 5 Let b(c) = -6c + 34. Determine b(3). 16 Let z(n) = 4n2 + 3n + 4. What is z(-3)? 31 Let p(s) = 41s - 346. Give p(8). -18 Let j(y) = 70y - 210. Calculate j(3). 0 Let i(u) = 9u + 216. What is i(-25)? -9 Let r(k) = -6k - 3. Calculate r(2). -15 Let c(k) = -k*2 + 8k - 53. Give c(6). -41 Let q(x) = -x*2 + 26x + 33. Determine q(27). 6 Let f(u) = 2u2 - u + 1. Calculate f(5). 46 Let o(p) = -p2 - p. Calculate o(2). -6 Let c(r) = r2 + 3r + 2. Calculate c(-4). 6 Let m(x) = x*3 + 7x*2 + 4x - 13. What is m(-6)? -1 Let v(o) = o + 3. Calculate v(-3). 0 Let d(s) = -12s + 41. What is d(-3)? 77 Let d(z) = z3 - z2 - z - 14. What is d(0)? -14 Let g(t) = t + 6. Give g(-3). 3 Let u(p) = 3p*2 - 9p - 112. Calculate u(-5). 8 Let r(o) = o*3 - 6o*2 - 24o + 28. Determine r(9). 55 Let y(v) = -2v3 - 5v*2 + v + 4. What is y(-2)? -2 Let s(u) = 6u - 1. Calculate s(-1). -7 Let w(d) = -d*3 - 10d*2 + 12d + 21. What is w(-11)? 10 Let z(c) = 9c2 + 5c - 1. Calculate z(1). 13 Let v(l) = -27l2 + 2l - 2. Give v(2). -106 Let l(a) = -3a - 9. Calculate l(-10). 21 Let h(g) = -g2 + 18g - 12. Determine h(17). 5 Let l(p) = -18p3 - p2 + p + 1. Give l(-1). 17 Let s(t) = t + 20. Calculate s(-10). 10 Let i(p) = -14p + 2. What is i(-2)? 30 Let j(d) = 3d2 + 5d + 1. What is j(-3)? 13 Let s(c) = c*3 - 3c*2 - 15c + 1. Give s(6). 19 Let y(k) = 9k - 29. Determine y(5). 16 Let j(i) = -i3 - 9i2 + i - 16. What is j(-8)? -88 Let f(r) = -r3 + 10r2 + 10r + 13. Give f(11). 2 Let i(d) = 2d2 + 7d - 2. Give i(-5). 13 Let t(y) = 2y2 + 5y - 2. Determine t(-2). -4 Let g(u) = u*2 - 19u - 1. What is g(19)? -1 Let f(n) = -n*2 + 13n - 10. Calculate f(8). 30 Let v(d) = -d*3 + 3d*2 - 2d + 11. Give v(4). -13 Let b(i) = 2i2 - 17i - 13. Determine b(10). 17 Let c(f) = 5f + 81. Determine c(-15). 6 Let r(d) = -2d - 8. What is r(-3)? -2 Let u(b) = -b*2 - 23b - 24. What is u(-11)? 108 Let j(l) = -4l3 - l2 + l + 1. Calculate j(-1). 3 Let d(n) = -n - 8. What is d(0)? -8 Let p(h) = -h2 + 8h + 3. Calculate p(8). 3 Let s(t) = t*2 - 40t + 407. Calculate s(21). 8 Let o(g) = -57g + 43. Determine o(1). -14 Let v(y) = 13y - 56. Determine v(4). -4 Let d(k) = -k*3 + 3k*2 - k - 5. Give d(5). -60 Let m(w) = 5w*2 - 6w - 4. Give m(-1). 7 Let g(k) = k*2 - 4k - 8. What is g(7)? 13 Let y(x) = x*3 + 9x*2 + 10x + 10. Give y(-8). -6 Let r(p) = -2p2 + 7p - 9. Determine r(6). -39 Let u(o) = 3o2 + 10o - 5. What is u(-4)? 3 Let y(l) = l*3 + 12l*2 + 4l - 6. Determine y(-11). 71 Let n(y) = -2y2 - 8y + 91. Give n(-9). 1 Let m(v) = v*2 + 19v + 1. Calculate m(-19). 1 Let z(j) = -j*2 + 9j + 9. Determine z(9). 9 Let n(b) = b*2 + 21b + 11. What is n(-20)? -9 Let b(y) = -32y - 323. Give b(-10). -3 Let a(w) = 2w*3 - 2w*2 - 4w - 3. Determine a(2). -3 Let b(y) = -y*2 - 23y - 56. Give b(-20). 4 Let k(n) = 2n2 - 14n + 5. Determine k(7). 5 Let i(h) = -h*2 + 11h - 9. Determine i(6). 21 Let f(j) = j - 20. Give f(8). -12 Let w(q) = q*3 - 8q*2 + 3q - 6. Determine w(8). 18 Let x(a) = a - 9. What is x(3)? -6 Let i(n) = -6n. What is i(1)? -6 Let h(j) = j3 - 11j*2 - 23j + 126. What is h(12)? -6 Let c(g) = 9g - 111. Calculate c(12). -3 Let h(d) = 5d*2 - 4d + 2. Calculate h(3). 35 Let p(s) = -s*2 + 8s + 9. Determine p(9). 0 Let y(h) = 2h - 37. Give y(0). -37 Let v(o) = -o3 + 11o*2 - 20o. What is v(9)? -18 Let r(p) = -p + 12. What is r(12)? 0 Let h(u) = -u*3 - 14u*2 + 4u + 48. Calculate h(-14). -8 Let q(i) = 2i - 10. What is q(4)? -2 Let z(h) = -h - 35. Determine z(-14). -21 Let s(z) = -2z*3 + 24z*2 - 4z + 31. Determine s(12). -17 Let q(h) = 3h3 + 29h*2 + 20h + 22. Calculate q(-9). 4 Let v(i) = -48i - 234. Determine v(-5). 6 Let r(z) = 2z*2 + 54z - 9. Calculate r(-27). -9 Let i(d) = -d*2 + 8d + 5. What is i(10)? -15 Let r(h) = -10h - 9. What is r(1)? -19 Let t(l) = 11l + 48. Determine t(-5). -7 Let t(d) = -11d - 101. Determine t(-9). -2 Let z(w) = 4w - 86. Give z(19). -10 Let g(y) = y - 20. Give g(6). -14 Let o(s) = -215s + 1071. Calculate o(5). -4 Let r(b) = -7b + 103. Give r(17). -16 Let h(w) = w*3 - 4w*2 - 2w + 7. Calculate h(3). -8 Let c(w) = w*2 - 6w + 3. Give c(5). -2 Let k(v) = -v*3 - 14v*2 - 2v - 21. What is k(-14)? 7 Let x(q) = 15q - 2. Calculate x(1). 13 Let t(y) = -y2 - 24y - 46. What is t(-22)? -2 Let j(x) = -165x - 1316. What is j(-8)? 4 Let d(k) = k3 + 5k*2 + 6k + 2. What is d(-4)? -6 Let r(j) = 13j - 700. Determine r(54). 2 Let k(x) = x2 - 10x + 9. Give k(4). -15 Let s(p) = -8p + 10. What is s(8)? -54 Let a(o) = -o3 + 5o*2 - 4o. Determine a(3). 6 Let l(x) = -4x2 - 6x + 3. What is l(-2)? -1 Let l(z) = -z*3 - 12z*2 - 7z + 24. What is l(-11)? -20 Let w(d) = d + 33. Calculate w(-33). 0 Let g(h) = 38h - 212. Determine g(6). 16 Let b(d) = -d2 + 27. Determine b(-9). -54 Let j(x) = x3 - 3x2 + 2. Give j(2). -2 Let s(f) = f3 - 10f2 + 8f + 15. Determine s(9). 6 Let b(h) = 2h2 - 134h + 136. What is b(66)? 4 Let y(i) = 8i2 - 4. Calculate y(2). 28 Let x(y) = -y - 3. Calculate x(-11). 8 Let h(a) = -a2 + 13a - 9. Calculate h(12). 3 Let l(v) = v*3 - 3v*2 - 5v + 2. What is l(4)? -2 Let j(z) = 2z3 + z2 - 6z - 4. Calculate j(-2). -4 Let k(o) = 57o3 - o2 + o + 1. Give k(-1). -58 Let n(d) = 28d - 48. Determine n(6). 120 Let d(a) = -12a + 1. Give d(-1). 13 Let m(h) = h3 + 16h*2 + 3h + 19. What is m(-16)? -29 Let s(q) = 13q + 172. Determine s(-16). -36 Let f(a) = -a2 + 6a - 4. Calculate f(6). -4 Let g(p) = p*3 - 12p*2 + 19p + 15. Give g(10). 5 Let y(a) = 21a. Give y(1). 21 Let r(d) = -d + 59. Give r(14). 45 Let n(x) = x2 - 13x - 1215. Calculate n(-29). 3 Let k(t) = t*3 + 10t*2 + 12t - 2. What is k(-8)? 30 Let p(u) = u*3 + 9u*2 - 34u + 21. Calculate p(-12). -3 Let i(p) = 48p + 10. Give i(-4). -182 Let t(g) = 30g*3. Give t(-1). -30 Let v(y) = -3y*2 - 54y + 4. Determine v(-18). 4 Let d(z) = z*3 + 5z*2 - 16z - 20. Give d(-7). -6 Let s(h) = -2h2 - 32h - 22. Give s(-15). 8 Let l(o) = o*3 - 13o*2 + 10o - 19. Give l(13). 111 Let m(v) = v*2 - 6v + 5. What is m(6)? 5 Let k(y) = -6y + 38. What is k(7)? -4 Let a(l) = -6l*2 + 6l + 3. Calculate a(-1). -9 Let o(i) = 5i2 - 23i - 6. Calculate o(5). 4 Let d(b) = 3b + 25. Give d(-6). 7 Let s(x) = 5x - 14. Calculate s(7). 21 Let w(u) = -u*2 - 7u + 18. Determine w(-8). 10 Let w(l) = -l*3 - 16l*2 + 78l + 755. Calculate w(-18). -1 Let q(w) = -13w + 248. Give q(19). 1 Let n(f) = -f - 5. What is n(7)? -12 Let q(j) = j2 + 12j + 34. Determine q(-14). 62 Let k(d) = 2d + 62. Calculate k(-25). 12 Let b(g) = -g3 - 14g*2 - 13g + 18. Give b(-13). 18 Let w(f) = 2f3 - 5f*2 + f + 1. Give w(2). -1 Let i(c) = -18c3 + 1. Calculate i(1). -17 Let d(y) = y2 + 2y + 6. Calculate d(-5). 21 Let t(c) = c2 - 22c + 25. Give t(21). 4 Let u(z) = 141z - 415. Give u(3). 8 Let r(j) = j3 - 59j*2 + 62j - 242. Determine r(58). -10 Let m(a) = -3a + 17. Calculate m(7). -4 Let o(t) = t3 + 10t*2 + 19t + 19. Determine o(-8). -5 Let l(a) = a*3 + 18a*2 - 2a - 30. Determine l(-18). 6 Let o(f) = -f*3 + 4f*2 + 8f - 6. Determine o(5). 9 Let z(w) = -4w3 + 2w*2 + 2w + 4. Determine z(3). -80 Let y(r) = -r*3 + 2r*2 + 7r - 5. Calculate y(4). -9 Let x(o) = o*3 - 11o*2 + 15o - 12. Determine x(10). 38 Let i(y) = -2y3 - 2y*2 - 3y - 10. Give i(-2). 4 Let k(a) = 8a3 - 78a*2 - 21a + 13. Give k(10). 3 Let v(r) = -4*r + 23. Give v(	{ "pile_set_name": "DM Mathematics" }
71, 1367 What are the prime factors of 135165? 3, 5, 9011 What are the prime factors of 3164186? 2, 71, 22283 List the prime factors of 3095024. 2, 19, 10181 List the prime factors of 7891748. 2, 137, 14401 List the prime factors of 1206148. 2, 31, 71, 137 What are the prime factors of 407827? 7, 29, 41 What are the prime factors of 510195? 3, 5, 7, 43, 113 What are the prime factors of 169149? 3, 56383 What are the prime factors of 4351905? 3, 5, 97, 997 List the prime factors of 1012806. 2, 3, 56267 List the prime factors of 148740. 2, 3, 5, 37, 67 List the prime factors of 15582525. 3, 5, 7, 67, 443 List the prime factors of 381935. 5, 76387 What are the prime factors of 356624? 2, 31, 719 List the prime factors of 37725962. 2, 73, 233, 1109 What are the prime factors of 250405? 5, 61, 821 List the prime factors of 3531066. 2, 3, 7, 11, 7643 List the prime factors of 1824721. 1824721 What are the prime factors of 16919585? 5, 3383917 List the prime factors of 169013. 13, 13001 What are the prime factors of 81241? 137, 593 What are the prime factors of 332734? 2, 43, 53, 73 List the prime factors of 23042553. 3, 71, 251, 431 List the prime factors of 59589. 3, 2207 List the prime factors of 3678035. 5, 17, 43271 What are the prime factors of 2389970? 2, 5, 11, 21727 List the prime factors of 4326231. 3, 7, 13, 23, 53 List the prime factors of 212511. 3, 13, 5449 List the prime factors of 9835007. 7, 13, 23, 37, 127 What are the prime factors of 549512? 2, 149, 461 List the prime factors of 1505067. 3, 367, 1367 What are the prime factors of 20570946? 2, 3, 11, 311681 List the prime factors of 272791. 53, 5147 What are the prime factors of 1069438? 2, 31, 47, 367 List the prime factors of 465384. 2, 3, 19391 List the prime factors of 8209022. 2, 23, 7759 What are the prime factors of 579006? 2, 3, 19, 1693 List the prime factors of 158085. 3, 5, 1171 What are the prime factors of 34890732? 2, 3, 17, 47, 1213 What are the prime factors of 17163777? 3, 79, 72421 List the prime factors of 3790801. 7, 541543 What are the prime factors of 31495288? 2, 11, 17, 37, 569 What are the prime factors of 116674? 2, 58337 List the prime factors of 132985. 5, 26597 What are the prime factors of 122292? 2, 3, 43, 79 List the prime factors of 25907696. 2, 37, 107, 409 List the prime factors of 348675. 3, 5, 4649 What are the prime factors of 301317? 3, 47, 2137 What are the prime factors of 7619326? 2, 11, 13, 26641 What are the prime factors of 2696975? 5, 233, 463 List the prime factors of 114191. 7, 11, 1483 What are the prime factors of 6760290? 2, 3, 5, 225343 List the prime factors of 10782201. 3, 3594067 List the prime factors of 3567218. 2, 53, 73, 461 List the prime factors of 385120. 2, 5, 29, 83 What are the prime factors of 17489071? 17489071 List the prime factors of 245329. 7, 101, 347 List the prime factors of 1184739. 3, 557, 709 What are the prime factors of 44352? 2, 3, 7, 11 List the prime factors of 10326146. 2, 29, 178037 What are the prime factors of 9050845? 5, 23, 211, 373 What are the prime factors of 451043? 367, 1229 What are the prime factors of 475410? 2, 3, 5, 13, 23, 53 What are the prime factors of 34364404? 2, 619, 13879 What are the prime factors of 278725? 5, 11149 List the prime factors of 9199989. 3, 29, 101, 349 List the prime factors of 72892. 2, 18223 What are the prime factors of 801618? 2, 3, 17, 29, 271 List the prime factors of 7565880. 2, 3, 5, 7, 9007 What are the prime factors of 177712? 2, 29, 383 What are the prime factors of 354336? 2, 3, 3691 List the prime factors of 1751635. 5, 73, 4799 List the prime factors of 165313. 165313 List the prime factors of 15315186. 2, 3, 2552531 What are the prime factors of 3143023? 13, 241771 List the prime factors of 1592583. 3, 530861 What are the prime factors of 91181? 19, 4799 List the prime factors of 18968018. 2, 1049, 9041 List the prime factors of 1456989. 3, 29, 16747 List the prime factors of 4662014. 2, 7, 97, 3433 List the prime factors of 34827967. 34827967 List the prime factors of 1049685. 3, 5, 7, 13, 769 List the prime factors of 158232. 2, 3, 19, 347 List the prime factors of 5371041. 3, 13, 41, 3359 List the prime factors of 34009149. 3, 281, 40343 List the prime factors of 467888. 2, 29243 What are the prime factors of 68753? 197, 349 What are the prime factors of 442246? 2, 7, 31, 1019 What are the prime factors of 782921? 782921 List the prime factors of 65604. 2, 3, 7, 11, 71 List the prime factors of 13528303. 53, 255251 What are the prime factors of 639285? 3, 5, 17, 23, 109 What are the prime factors of 137790? 2, 3, 5, 1531 List the prime factors of 4929497. 653, 7549 List the prime factors of 1719578. 2, 7, 122827 List the prime factors of 1234446. 2, 3, 283, 727 List the prime factors of 6061453. 937, 6469 What are the prime factors of 11944930? 2, 5, 1194493 What are the prime factors of 988195? 5, 13, 23, 661 List the prime factors of 1470327. 3, 173, 2833 What are the prime factors of 340838? 2, 193, 883 What are the prime factors of 3096707? 29, 106783 List the prime factors of 36076340. 2, 5, 1803817 List the prime factors of 80473. 80473 List the prime factors of 217004. 2, 54251 What are the prime factors of 1568078? 2, 784039 List the prime factors of 1464652. 2, 7, 17, 181 List the prime factors of 480970. 2, 5, 7, 6871 List the prime factors of 692630. 2, 5, 69263 List the prime factors of 692633. 31, 22343 What are the prime factors of 101049? 3, 13, 2591 List the prime factors of 361209. 3, 19, 6337 List the prime factors of 409206. 2, 3, 7, 9743 List the prime factors of 12891767. 7, 1841681 What are the prime factors of 12151791? 3, 359, 3761 List the prime factors of 21193341. 3, 13, 19, 37, 773 List the prime factors of 516069. 3, 17, 3373 What are the prime factors of 1469121? 3, 31, 15797 What are the prime factors of 143376? 2, 3, 29, 103 List the prime factors of 462123. 3, 51347 List the prime factors of 12978189. 3, 7, 29429 List the prime factors of 18230907. 3, 701, 8669 List the prime factors of 63372. 2, 3, 5281 List the prime factors of 54741. 3, 71, 257 What are the prime factors of 85271? 71, 1201 What are the prime factors of 346324? 2, 11, 17, 463 List the prime factors of 1973282. 2, 986641 List the prime factors of 1823385. 3, 5, 121559 What are the prime factors of 33199715? 5, 6639943 What are the prime factors of 696071? 61, 11411 List the prime factors of 159932. 2, 39983 List the prime factors of 95952. 2, 3, 1999 List the prime factors of 85002. 2, 3, 31, 457 List the prime factors of 2048964. 2, 3, 73, 2339 List the prime factors of 135524. 2, 17, 1993 What are the prime factors of 128424? 2, 3, 5351 What are the prime factors of 70957? 70957 List the prime factors of 296034. 2, 3, 49339 List the prime factors of 2277491. 79, 127, 227 What are the prime factors of 12861814? 2, 7, 18749 List the prime factors of 132619. 132619 List the prime factors of 1395075. 3, 5, 11, 19, 89 What are the prime factors of 4288243? 19, 225697 What are the prime factors of 287134? 2, 143567 List the prime factors of 14837947. 47, 315701 List the prime factors of 6261285. 3, 5, 417419 List the prime factors of 564987. 3, 47, 4007 List the prime factors of 57946. 2, 7, 4139 List the prime factors of 841584. 2, 3, 89, 197 What are the prime factors of 8544742? 2, 773, 5527 List the prime factors of 167200. 2, 5, 11, 19 What are the prime factors of 1867141? 1031, 1811 List the prime factors of 7774029. 3, 83, 3469 List the prime factors of 561113. 7, 71, 1129 What are the prime factors of 1408324? 2, 352081 List the prime factors of 143173. 29, 4937 What are the prime factors of 5082705? 3, 5, 179, 631 What are the prime factors of 21261917? 17, 1250701 List the prime factors of 1407469. 7, 67, 3001 What are the prime factors of 3622451? 7, 233, 2221 What are the prime factors of 22481712? 2, 3, 11, 19, 83 What are the prime factors of 18584105? 5, 3716821 What are the prime factors of 14053907? 7, 2007701 What are the prime factors of 8964377? 61, 223, 659 List the prime factors of 2216513. 13, 53, 3217 What are the prime factors of 34250595? 3, 5, 29, 78737 What are the prime factors of 24916831? 67, 383, 971 What are	{ "pile_set_name": "DM Mathematics" }
0404583700376196. -4(n + 291721007)2 Suppose -a4 + 3669a*3 - 973855a*2 - 10014225a - 25265500 = 0. Calculate a. -5, 299, 3380 Suppose z*4 + 41048z*3/5 + 41043z*2/5 = 0. Calculate z. -41043/5, -1, 0 Factor -2q*2/5 + 99876q - 3495562/5. -2(q - 249683)(q - 7)/5 Factor v*3/2 + 527v*2 - 423311v/2 + 18332610. (v - 163)*2(v + 1380)/2 Suppose -10l4 - 445l*3 + 1419805l*2 + 2131090l - 1420440 = 0. What is l? -399, -2, 1/2, 356 Let 3l4 + 40617l*3 + 892605l*2 + 6529887l + 15895992 = 0. Calculate l. -13517, -8, -7 Find g, given that g*3/2 - 3829g*2 + 68788g - 213920 = 0. 4, 14, 7640 Factor -t*3 + 2596118t*2 + 15576735t + 23365116. -(t - 2596124)(t + 3)2 Suppose 3h*2/8 + 144519h/8 - 3910761/2 = 0. Calculate h. -48281, 108 Factor -5t2/4 - 3933t/2 - 328993/4. -(t + 43)(5t + 7651)/4 Solve -2r3/11 - 726r*2 - 7903230r/11 + 7911218/11 = 0 for r. -2177, -1817, 1 Solve 2z5/7 + 32870z*4/7 + 591158z*3/7 + 2397098z*2/7 + 3546176z/7 + 1707368/7 = 0. -16417, -13, -2, -1 Let 2p3 + 339982p*2 + 24807880p - 25147864 = 0. Calculate p. -169918, -74, 1 Factor 4l2/9 + 12544l + 4959680/9. 4(l + 44)(l + 28180)/9 Factor 2q2/11 + 996314916q/11 + 124080426480510882/11. 2(q + 249078729)2/11 Find x such that 2x*3/9 - 1367866x*2/9 - 2735750x/3 - 1367878 = 0. -3, 683939 Factor -9z2 - 2613684z - 871227. -3(z + 290409)(3z + 1) Determine j so that -j5/6 - 1871j*4/6 - 37721j*3/3 - 125890j*2 - 421068j - 307440 = 0. -1830, -28, -6, -1 Factor -2f2 - 663806f + 2655256. -2(f - 4)(f + 331907) Find v such that 2662v5/5 + 6975892v*4/5 + 4482914986v*3/5 + 2443842868v*2/5 + 444251224v/5 + 26921776/5 = 0. -1493, -1127, -2/11 Determine y, given that 6y3/5 - 72687594y*2/5 = 0. 0, 12114599 Let 3u*3 + 897u*2 - 64350u + 550800 = 0. Calculate u. -360, 10, 51 Let 3a4 - 103872a*3 + 835964832a*2 + 1093273574400a + 332339505120000 = 0. Calculate a. -588, 17900 What is j in 4j2 + 20934592j + 27391071387904 = 0? -2616824 Suppose -s*3 + 1111760s*2 + 4447053s + 3335292 = 0. Calculate s. -3, -1, 1111764 Suppose 34c2/13 - 138804c/13 - 1251990/13 = 0. What is c? -9, 69555/17 Determine m so that -m*5/2 + 245953m4/2 + m3/2 - 245953m2/2 = 0. -1, 0, 1, 245953 Determine t so that t4/7 + 2022t*3/7 + 16108t*2/7 - 8088t/7 - 64448/7 = 0. -2014, -8, -2, 2 Factor -2z4/7 - 3263630z*3/7 - 97907700z*2/7 - 979073000z/7 - 3263570000/7. -2(z + 10)3(z + 1631785)/7 Factor -2d2 - 12806062d - 38418168. -2(d + 3)(d + 6403028) Determine k, given that 2k2/15 - 1661452k/15 - 3322928/5 = 0. -6, 830732 Solve n*3/8 - 1475n*2/4 + 64437n/8 - 7686 = 0 for n. 1, 21, 2928 Solve 3h3 + 8694h*2 - 139872h = 0 for h. -2914, 0, 16 Let x*5 - 917x*4 - 57993x*3 - 620807x*2 + 8056096x - 16941180 = 0. What is x? -34, 3, 5, 977 Factor 3u2/2 - 49782621u + 826103117876547/2. 3(u - 16594207)2/2 Suppose -3s*5 + 882s*4 + 47064s*3 - 48822s*2 - 47061s + 47940 = 0. Calculate s. -47, -1, 1, 340 Solve -3h2 - 6540021h + 32700180 = 0 for h. -2180012, 5 What is c in 2c4 + 175c*3/2 - 636c*2 - 1093c/2 + 175 = 0? -50, -1, 1/4, 7 Factor -2z2 - 10552212z - 13918647261618. -2(z + 2638053)2 Suppose 34w*3/13 - 80w*2/13 - 5094w/13 - 20340/13 = 0. Calculate w. -113/17, -6, 15 Solve -3i2 + 10508424i - 9202247913648 = 0 for i. 1751404 Factor -10z3 + 188212z*2 - 225840z. -2z(z - 18820)(5z - 6) Let -y*4/8 + 927y*3/4 - 148049y*2/8 - 279081y/2 - 241605/2 = 0. What is y? -6, -1, 91, 1770 Determine g so that 5g5/3 - 5688g*4 + 352934g*3/3 - 187656g*2 - 352939g/3 + 193344 = 0. -1, 1, 9/5, 19, 3392 Suppose -5l4 + 48195l*3 - 2017465l*2 + 20103405l + 22169070 = 0. What is l? -1, 21, 22, 9597 Find s such that 2s5 - 2498904s*4 - 4997814s*3 - 2498908s*2 = 0. -1, 0, 1249454 Determine j, given that -2j*4/13 + 614j*3/13 - 22654j*2/13 - 1732646j/13 + 134976 = 0. -37, 1, 96, 247 Find r, given that 11r4 + 6082r*3/5 - 24724r*2/5 - 16040r - 13728/5 = 0. -572/5, -2, -2/11, 6 Find y such that 8157y5/2 + 4812633y*4 + 9575241y*3/2 - 28847790y*2 - 21222y = 0. -1179, -3, -2/2719, 0, 2 Factor -2y3 - 918y*2 - 69168y - 1436512. -2(y + 44)2(y + 371) Factor 8514s2 - 21745s/2 + 4717/2. (s - 1)(17028s - 4717)/2 Solve 5c5 + 58205c*4 + 232755c*3 + 174535c*2 - 232760c - 232740 = 0 for c. -11637, -2, -1, 1 Find k, given that -9k4 + 22623k*3 + 166614k*2 - 574908k + 302520 = 0. -10, 2/3, 2, 2521 Determine s, given that -17080s5 - 1020256725s*4 - 15236004026790s*3 - 4460188445s*2 = 0. -29867, -1/3416, 0 Find g, given that 28g*2 + 1859298624g + 531228176 = 0. -66403522, -2/7 Suppose -2z5/17 - 1095692z*4/17 - 150036935664z*3/17 + 8405567305740z*2/17 + 8555603145714z/17 = 0. What is z? -273951, -1, 0, 57 Solve k*3/2 + 1685883k*2/2 - 3371774k = 0 for k. -1685887, 0, 4 Suppose 2l3 + 118942l*2 + 118940l = 0. Calculate l. -59470, -1, 0 Factor h*3/4 - 9560353h*2/4 + 19120703h/4 - 9560351/4. (h - 9560351)(h - 1)2/4 Let 2k*2/7 + 107344k/7 + 22134510/7 = 0. Calculate k. -53465, -207 Suppose -p*4 + 676p*3 - 7716p*2 - 166464p - 573696 = 0. Calculate p. -6, 24, 664 Let -q*5/3 - 11647q*4/3 + 104985q*3 - 945351q*2 + 2836782q = 0. What is q? -11674, 0, 9 Let -4q5/3 + 15444q*4 + 371208q*3 + 7520312q*2/3 + 3961700q + 1810692 = 0. What is q? -13, -9, -1, 11607 Factor 5k3 + 22905k*2 + 3959995k - 3982905. 5(k - 1)(k + 181)(k + 4401) Find d such that -4d*3 - 5045924d*2 + 20183748d - 15137820 = 0. -1261485, 1, 3 Suppose 4s2 - 4327260s + 4327256 = 0. Calculate s. 1, 1081814 Suppose x*2 - 27359080x + 187129814611600 = 0. Calculate x. 13679540 Find r, given that -2r3/5 + 506r*2/5 + 249008r/5 + 495976/5 = 0. -247, -2, 502 What is c in 3271042124427c5/8 + 75233981392185c*4/8 + 49065667891203c*3 - 117757140568383c*2/2 - 225546372c - 216 = 0? -12, -2/1044197, 1 Factor -5t3 + 58040545t*2 - 168435214174575t - 168435272215125. -5(t - 5804055)2(t + 1) Find o such that 2o5 - 2206o*4 + 30350o*3 + 156318o*2 - 1822320o - 7840800 = 0. -5, 12, 1089 Factor -2h5/7 - 5798h*4/7 + 29040h*3/7. -2h*3(h - 5)(h + 2904)/7 Factor 4m*2 + 125018056m + 976844645376196. 4(m + 15627257)2 Factor -5r*2 - 48630r - 2851765. -5(r + 59)(r + 9667) What is g in g*2/4 - 103709g + 414832 = 0? 4, 414832 Factor 101x3 - 59699x*2 + 4728x. x(x - 591)(101x - 8) Factor 3y*2/4 + 426y - 2885355/4. 3(y - 737)(y + 1305)/4 Let j*5/2 - 3577j*4/6 + 74641j*3/3 + 16852j*2 = 0. Calculate j. -2/3, 0, 44, 1149 What is o in -4o*2 - 6430736o + 180063744 = 0? -1607712, 28 Suppose -3c4/2 - 38538c*3 - 336117600c*2 - 1230727723992c - 1628573002880616 = 0. What is c? -12354, -4446 Find t, given that -3t4 - 6327t*3 + 355662t*2 - 3023112t + 4674240 = 0. -2164, 2, 8, 45 Factor y*3/7 - 741535y*2/7 - 69710917y/7 - 234036923. (y - 741629)(y + 47)2/7 Solve 4i*4 + 16i*3 - 144i*2 - 576i = 0 for i. -6, -4, 0, 6 Let -2w3/9 - 2812w*2/9 + 21058w/9 + 200332 = 0. Calculate w. -1413, -22, 29 Let 1411u2/6 + 670235u/3 + 9500/3 = 0. What is u? -950, -20/1411 Determine p so that -2p3/5 - 10114p*2/5 + 2640428p/5 - 2079952 = 0. -5306, 4, 245 Determine b, given that 12b3 - 158826225b*2 + 436772019b + 119119644 = 0. -1/4, 3, 13235516 Factor -2y2/3 - 13364323y/3 + 6682162/3. -(y + 6682162)(2y - 1)/3 Factor -r*3 - 6027r*2 + 920224r. -r(r - 149)(r + 6176) Factor 5t4 - 2685t*3 - 69215t*2 - 578835t - 1593270. 5(t - 562)(t + 7)(t + 9)2 Solve -554t*3 - 681422t*2/5 - 41907822t/5 - 30258/5 = 0 for t. -123, -1/1385 Solve -2u2/17 + 47738u/17 + 33790432/17 = 0 for u. -688, 24557 Suppose -7q4/2 - 9241q*3/4 + 206489q*2 - 389279q - 28860 = 0. Calculate q. -740, -1/14, 2, 78 Find g, given that -35g5 - 5335g*4 - 142355g*3 - 1110505g*2 + 1402390g + 32795840 = 0. -121, -14, -11, 32/7 Find a such that -a*2/6 - 77765a - 466588/3 = 0. -466588, -2 Determine g so that -36g4 + 12849g*3 + 159183g*2 + 491400g + 39852 = 0. -6,	{ "pile_set_name": "DM Mathematics" }
58957991. 43, 36254837 List the prime factors of 494450802. 2, 3, 2459, 11171 What are the prime factors of 3676867467? 3, 7, 13, 317, 42487 What are the prime factors of 1011485183? 1011485183 List the prime factors of 9684923. 9684923 What are the prime factors of 1346392909? 43, 31311463 List the prime factors of 2434902684. 2, 3, 71, 2857867 What are the prime factors of 1229123760? 2, 3, 5, 83, 61703 What are the prime factors of 701354592? 2, 3, 811753 List the prime factors of 34564626. 2, 3, 1920257 List the prime factors of 71517872. 2, 281, 15907 What are the prime factors of 163253290? 2, 5, 16325329 List the prime factors of 17204543. 41, 419623 List the prime factors of 815105628. 2, 3, 947, 23909 What are the prime factors of 16869074? 2, 19, 23, 19301 What are the prime factors of 302839233? 3, 19, 293, 18133 List the prime factors of 825219659. 11, 31, 89, 27191 List the prime factors of 49456870. 2, 5, 4945687 What are the prime factors of 5434572113? 157, 34615109 List the prime factors of 4059561832. 2, 47, 3253, 3319 List the prime factors of 2503050411. 3, 834350137 What are the prime factors of 27245803? 13, 2095831 List the prime factors of 127875171. 3, 42625057 List the prime factors of 3848969947. 43, 89510929 List the prime factors of 2274765984. 2, 3, 2632831 List the prime factors of 31744789. 31744789 What are the prime factors of 408526720? 2, 5, 7, 1861 List the prime factors of 4370715. 3, 5, 97127 List the prime factors of 86410111. 29, 47, 63397 List the prime factors of 426174169. 29, 59, 249079 List the prime factors of 70282294. 2, 1783, 19709 List the prime factors of 198027904. 2, 1547093 What are the prime factors of 60582033? 3, 17, 89, 1483 What are the prime factors of 343514168? 2, 42939271 List the prime factors of 693121432. 2, 67, 1293137 What are the prime factors of 4503566? 2, 37, 60859 What are the prime factors of 86122357? 17, 5066021 List the prime factors of 5692313053. 7, 29, 28040951 List the prime factors of 6445882031. 19, 339256949 List the prime factors of 36167967. 3, 11, 365333 List the prime factors of 145528515. 3, 5, 11, 59, 151 What are the prime factors of 56323609? 317, 177677 List the prime factors of 32390170. 2, 5, 37, 87541 List the prime factors of 232868997. 3, 19, 23, 59209 What are the prime factors of 134107305? 3, 5, 17, 367, 1433 List the prime factors of 3643226006. 2, 7, 260230429 What are the prime factors of 4405875242? 2, 2202937621 What are the prime factors of 192336413? 229, 839897 What are the prime factors of 631559932? 2, 167, 199, 4751 List the prime factors of 1862944466. 2, 193, 4826281 What are the prime factors of 40394853? 3, 1453, 3089 List the prime factors of 52100833. 52100833 List the prime factors of 3324166141. 59, 6659, 8461 What are the prime factors of 231783478? 2, 263, 440653 List the prime factors of 37341705. 3, 5, 29, 85843 List the prime factors of 202799950. 2, 5, 109, 127, 293 List the prime factors of 2356455953. 3329, 707857 What are the prime factors of 426608343? 3, 7, 2257187 What are the prime factors of 290223321? 3, 97, 127, 7853 What are the prime factors of 1853135561? 199, 479, 19441 List the prime factors of 757205076. 2, 3, 63100423 What are the prime factors of 8067860928? 2, 3, 97, 127, 379 List the prime factors of 184602047. 7, 26371721 What are the prime factors of 162497337? 3, 1193, 45403 What are the prime factors of 807030294? 2, 3, 7, 392143 What are the prime factors of 38411086? 2, 7, 229, 11981 List the prime factors of 49294484. 2, 12323621 List the prime factors of 169790486. 2, 359, 236477 What are the prime factors of 1471186963? 1471186963 What are the prime factors of 3848329129? 167, 23043887 What are the prime factors of 937802305? 5, 11, 97, 175783 List the prime factors of 198297839. 198297839 List the prime factors of 107022368. 2, 3344449 What are the prime factors of 85563414? 2, 3, 17, 279619 List the prime factors of 2938745783. 17, 172867399 List the prime factors of 2445473565. 3, 5, 19, 139 What are the prime factors of 263207374? 2, 107, 1229941 List the prime factors of 57176301. 3, 7, 13, 19, 73, 151 What are the prime factors of 3237610895? 5, 29, 727, 30713 List the prime factors of 1698108382. 2, 59, 243911 What are the prime factors of 2466258814? 2, 41, 79, 380713 What are the prime factors of 10164546? 2, 3, 7, 80671 List the prime factors of 773902786. 2, 31, 181, 68963 List the prime factors of 25181146. 2, 67, 113, 1663 What are the prime factors of 4689430980? 2, 3, 5, 13, 6012091 List the prime factors of 383210522. 2, 317, 604433 What are the prime factors of 1164895748? 2, 73, 1637, 2437 List the prime factors of 76749944. 2, 9593743 What are the prime factors of 118600465? 5, 1621, 14633 What are the prime factors of 171132719? 23, 757, 9829 List the prime factors of 68712951. 3, 541, 42337 List the prime factors of 471290684. 2, 117822671 What are the prime factors of 75694449? 3, 23, 71, 15451 List the prime factors of 491192798. 2, 17, 14446847 List the prime factors of 8548528. 2, 534283 List the prime factors of 16655884. 2, 7, 84979 What are the prime factors of 4436718944? 2, 7, 211, 93871 List the prime factors of 548166532. 2, 509, 269237 List the prime factors of 877227048. 2, 3, 12183709 What are the prime factors of 392851685? 5, 31, 2534527 What are the prime factors of 99662783? 11, 9060253 List the prime factors of 100260540. 2, 3, 5, 29, 19207 What are the prime factors of 5521862863? 11, 353, 1422061 What are the prime factors of 3607921679? 17, 212230687 List the prime factors of 3257370843. 3, 1085790281 List the prime factors of 745899333. 3, 619, 401669 What are the prime factors of 263128114? 2, 5981, 21997 What are the prime factors of 1885861711? 103, 18309337 List the prime factors of 298189845. 3, 5, 37, 79, 2267 List the prime factors of 301007917. 7, 2447, 17573 List the prime factors of 777345523. 6421, 121063 List the prime factors of 7251927. 3, 2417309 List the prime factors of 74718368. 2, 2334949 What are the prime factors of 36420468? 2, 3, 7, 433577 What are the prime factors of 289927773? 3, 3677, 8761 What are the prime factors of 309161624? 2, 199, 194197 List the prime factors of 575002899. 3, 63889211 What are the prime factors of 198815568? 2, 3, 7, 563, 1051 What are the prime factors of 406021718? 2, 203010859 What are the prime factors of 2705473732? 2, 13, 73, 712717 List the prime factors of 133461328. 2, 7, 11, 13, 641 List the prime factors of 115001990. 2, 5, 677, 16987 What are the prime factors of 1815675337? 7, 857, 302663 List the prime factors of 12776744. 2, 449, 3557 List the prime factors of 13406574. 2, 3, 17, 131437 List the prime factors of 219705352. 2, 53, 283, 1831 List the prime factors of 7992834. 2, 3, 131, 10169 What are the prime factors of 1356156449? 37, 36652877 List the prime factors of 1304269462. 2, 37, 1151, 15313 List the prime factors of 14526411. 3, 83, 227, 257 List the prime factors of 25383073. 37, 686029 What are the prime factors of 77255385? 3, 5, 109, 47251 What are the prime factors of 217972884? 2, 3, 947, 19181 What are the prime factors of 57816365? 5, 23, 71, 73, 97 List the prime factors of 568114736. 2, 7, 71, 71443 List the prime factors of 56051331. 3, 7, 2669111 What are the prime factors of 1204343428? 2, 31, 9712447 What are the prime factors of 53820113? 17, 3165889 What are the prime factors of 822794028? 2, 3, 7, 9795167 List the prime factors of 93935192. 2, 13, 903223 What are the prime factors of 1180282207? 13, 7841, 11579 What are the prime factors of 24229833? 3, 23, 351157 What are the prime factors of 275423444? 2, 3769, 18269 What are the prime factors of 68715483? 3, 599, 38239 List the prime factors of 58849185. 3, 5, 3923279 List the prime factors of 14838008. 2, 17, 109103 List the prime factors of 329799375. 3, 5, 58631 What are the prime factors of 103226135? 5, 613, 33679 List the prime factors of 117004854. 2, 3, 19500809 What are the prime factors of 90413205? 3, 5, 31, 127, 1531 What are the prime factors of 571714823? 1229, 465187 What are the prime factors of 131443348? 2, 31, 479, 2213 List the prime factors of 58495034. 2, 13, 19, 118411 What	{ "pile_set_name": "DM Mathematics" }
i? f Suppose 0 = -2a + 5q - 10q + 45, -q = -2a + 15. Let m be a/15 - (-1 - 3/9). What is the third biggest value in -1, m, 5, -0.1? -0.1 Let l = -1247 + 1252.4. What is the smallest value in l, -1/6, 3/8? -1/6 Let r = -341 + 346. Let f be (0/(-3))/(-1 - 0). Which is the third biggest value? (a) r (b) 4 (c) f c Let d = -20 + 22. Let s = d - 13/6. What is the third biggest value in 0, s, 5, 2/11? 0 Let v = 1.8 + -1.65. Let f = 1.45 + v. Which is the biggest value? (a) 0.3 (b) -5 (c) f c Let w = -309 - -312. What is the biggest value in w, -0.4, -1? w Let g = 2.8 - 3. Let q = -39 - -34. Let r = -43.3 - -43. What is the second smallest value in g, q, r? r Suppose -18 = -2v + 5v. Let q be (v/4)/(399/28). Let y be 12/44/(-12). What is the second biggest value in -2, y, q? y Let k = -39/2 + 19. Let i = 0.355 + -0.055. What is the biggest value in -2, k, i, -1? i Let h be -1 + (-142)/30 + 1. Let y = 22/5 + h. Let n = -2.5 + 0.5. Which is the second biggest value? (a) -3 (b) n (c) y b Let l = 6117/28 + -875/4. What is the second smallest value in -8/9, -3/5, l, -2? -8/9 Let v = 20.974 - 21. Let m = -0.174 + v. Which is the third smallest value? (a) -2/3 (b) m (c) 12 c Let o = 8 - 7.7. Let g = -129 - -128.4. Let l = -0.7 - g. Which is the second biggest value? (a) l (b) o (c) 0.5 b Let p be -46((-48)/42 + 1). What is the second smallest value in 2/7, 0.5, p? 0.5 Let q be 3/2 + (-145)/(-10). Suppose 0 = 15n - 16n - q. What is the third biggest value in -2/3, 0, n? n Let w = 0.5 + -0.4. Which is the third smallest value? (a) 106 (b) 4 (c) w a Let j(d) = -3d3 - 213 + d2 + 213. Suppose -3k + 2y + 6 = k, y = -k. Let s be j(k). What is the second smallest value in -5, s, 5? s Let v = -5/12 + -1/12. Let g = -0.94 - -0.901. Let j = g - -2.039. What is the third biggest value in v, j, 1? v Let l(m) = m + 13. Let q be l(6). Suppose 0 = 5y - v - 2v + q, 3v = -3y + 3. Which is the third biggest value? (a) -2/9 (b) y (c) -5 c Let f = 0.8 - -7.5. Let z = -8 + f. Suppose -1 = j + 1, -j = -5i - 18. Which is the third biggest value? (a) -5 (b) i (c) z a Let q = 103.9 + -102.9. What is the fourth biggest value in -0.5, -0.2, 0.01, q? -0.5 Suppose -4h + 3q = -q - 32, -3h - 5q = 16. Let u be (h - 100/32)(-2 + 0). Let a = -0.3 + -0.7. What is the third smallest value in u, 0.3, a? 0.3 Let w = -0.2 + 0.5. Suppose p - 5s = -s - 60, 5p + s + 300 = 0. Let v be 4(-1)/14 + p/(-63). What is the second smallest value in 4, v, w? v Suppose -6s = s - 504. Let o = 75 - s. Which is the third smallest value? (a) o (b) 0.5 (c) 19 c Let t be 50/(-14) - 72/168. Which is the second biggest value? (a) 3 (b) -0.05 (c) 0 (d) t c Let v = -192 - -578/3. What is the smallest value in 0.5, v, -14/9, 2? -14/9 Let f = 114 - 69. Suppose 43 - f = -d. Which is the third smallest value? (a) d (b) -4/9 (c) 1/7 a Suppose -7 = -66y + 79y + 45. Let g be (-1 + 4)/((-6)/4). What is the smallest value in g, 2/21, y? y Let l = -15.17 - -0.17. Which is the third smallest value? (a) -2/7 (b) l (c) -1/6 c Suppose 4s - 220 - 24 = -4o, 0 = 4s - o - 239. Let f be (-25)/s + 2/3. Let z = 0.15 + -4.15. Which is the smallest value? (a) f (b) z (c) 0.1 b Let v = -35 - -34.79. Which is the second biggest value? (a) 1 (b) 3 (c) -4 (d) v a Let o = 0.248 + 4.672. Let q = -0.08 - o. Let m = -227/580 - 1/116. Which is the second biggest value? (a) q (b) 1/8 (c) m c Let t be (-1)/(-2)390/33 - 6. Let h = -22/3 + 26/3. What is the third biggest value in h, -2, t? -2 Let h = -3.1 + 2.97. Let m = -0.01 - h. Let r = m - 3.12. Which is the second biggest value? (a) r (b) -4 (c) -1/11 a Let p = -6.3 + 6. Let z = -953/1210 + -3/242. Which is the smallest value? (a) p (b) -1/2 (c) z c Let n = 262 + -262. Which is the second smallest value? (a) 1/8 (b) -6.1 (c) n c Let t = -59 + 53.8. Let v = t + 1.2. What is the third smallest value in -0.5, -5, -0.4, v? -0.5 Let x = 12 + -16. Let g be -3 + -135 - x. Let y be (g/(-51))/(2/(-12)). Which is the third smallest value? (a) 0.4 (b) y (c) 1 c Let r = 23.08 + -20.3. Let z = r - -0.22. What is the second smallest value in -1/2, 0.4, z, 1? 0.4 Let l = 40.4 - 41.1. Which is the second biggest value? (a) -1/4 (b) l (c) -1 (d) 4/7 a Let r = -0.3 - -0.4. Let l = 0.031 - 0.531. Which is the second smallest value? (a) -49 (b) -3/7 (c) l (d) r c Let f = 12.4 + -11. Let p = -1.08 + 2.88. Let j = f - p. Which is the second smallest value? (a) -5/6 (b) j (c) 3/7 b Let f be (-2)/(-4) + (-87)/(-6). Let m = f + -18. Let n be (8/(-6))/(2/m). Which is the smallest value? (a) 4 (b) n (c) 0 c Let h(w) = -w*2 + 4w - 8. Suppose -2t = -5t + 18. Let a be h(t). Let u = a + 17. What is the second smallest value in 3/2, 2, u? 3/2 Let j = 15 - 66. Let f = j - -47. Which is the second smallest value? (a) 3 (b) f (c) 1/6 c Let c = -0.01 - -3.01. Let s = 5.923 + 0.077. What is the second biggest value in s, -1, c? c Let u = -17 + 21. Let h = u - 3.8. Let n = 4.8 + h. Which is the third smallest value? (a) -4 (b) n (c) -0.4 b Let u = 14 - 12. Suppose 9m + 34 = -u. Suppose 0 = -x + 2, 4f + 4x - 33 = -1. Which is the third biggest value? (a) 4 (b) f (c) m c Let k(i) = 3i - 1. Let n be k(2). Let z = 2.27 - 0.37. Let t = -0.1 - z. Which is the third smallest value? (a) t (b) n (c) 4 b Suppose -4 = -2u, 5u + 0u - 10 = -2y. Suppose y = 6t + 6 - 0. Let r = -1 + 0.5. Which is the third smallest value? (a) 1/5 (b) r (c) t a Let q = -2 + 2. Suppose -26j + 2j - 6 = 42. Let n = -3.07 - -0.07. What is the biggest value in j, q, n? q Let x = -1103 + 8829/8. What is the third smallest value in -1, x, 5, -0.4? x Let f = -1 + -2. Let a = -16.46 - -16.86. What is the biggest value in -0.2, f, a? a Let y = -78 + 80. Suppose -3d + 4d = yd. What is the second biggest value in -20, 0.1, d? d Let r be 2 + 6 - (-350)/(-45). What is the smallest value in r, 5, 4/5? r Let o = -33.5 - -33. Let i be 60/1812/(-10). What is the second smallest value in -5, i, o? i Let t = 157 - 160.88. Let o = t + -0.12. Which is the third biggest value? (a) 2 (b) o (c) 5 b Let u = 0.087 + -38.587. Let y = -38 - u. What is the second smallest value in y, 3/5, -0.04? y Let i = -50 - -31. Let a = i + 8. Let b = a - -10.9. What is the biggest value in b, -0.2, -1? b Suppose 3o - 5u + 17 = 0, o - 2u + 2 = -5. What is the second smallest value in 3, 2/109, o, -2/3? 2/109 Let x = 42.1 + -39.9. Which is the smallest value? (a) 0.3 (b) -0.5 (c) x b Let c = 5 + -4.7. Suppose 0 = 15b - 139 + 79. What is the third smallest value in -0.2, 0.1, c, b? c Let k = 0.1 + 0.2. Let p = -57/104 + 12/13. Let x be ((-92)/(-20) - 2)5. What is the smallest value in p, k, x? k Let d = 133.7 - -10.3. Let k = d + -140. What is the fourth smallest value in -0.2, -1, k, 0.4? k Let s be ((-1771)/14)/((-2)/4). Let u = 3287/13 - s. Which is the smallest value? (a) 3 (b) u (c) -4 (d) 20 c Let c be (-2)/(-6) + (-46)/3. Let n be ((-26)/3)/((-4)/(-22)). Let o = 47 + n. What is the third smallest value in c, o, 0.5? 0.5 Let c = 598.7 + -599. What is the smallest value in -0.2, 5, c, 2/37? c Suppose 0 = -v + 2d, 2d + 3d = 4v - 15. Let m be (-1)/((-2)/v245/(-21)). What is the fourth biggest value in 0, 4, -0.5, m? -0.5 Suppose 5x - 3 = -w, w = -4x + 4 - 1. Let l be (-34)/(-14) + 0 - w. What is the second smallest value in -0.1, l, 1? -0.1 Let r be 3/(-7)(0 + (-5)/15). Which is the second biggest value? (a) r (b) -2/7 (c) 0.5 (d) -29 a Let v = -2 + 1.6. Let j = -186 - -179. Which is the biggest value? (a) j (b) -3 (c) v (d) 2/7 d Let y = 15.22 - 12.52. Which is the second smallest value? (a) 0.1 (b) y (c) 0.5 c Let z = 5 - 9. Let g(y) = 2y3 + 41y*2 - 16y - 6. Let t be g(-21). Let l = 117 + t. What is the second smallest value in l, z, -0.2? -0.2 Let x(h) = 2h3 + 15h*2 + 9h + 15. Let j be x(-7). What is the fourth smallest value in 2/9, 2, 0, j? 2 Let c be (4/56)/(2/8). Let z = 53.47 + -60.47. What is the smallest value in c, -2/3, z? z Let a = -63.91 + 0.91. Let d = a - -64.06. Let x = 0.06 - d. What is the second smallest value in -1/7, x, 0.5? -1/7 Let g = -469 - -470. What is the biggest value in -1, -0.266, g, -0.2	{ "pile_set_name": "DM Mathematics" }
lve -dj - 2j - 13 = 5x, -3x + 5 = -4j for x. -1 Suppose -3g = -4g. Suppose 4 = -3f - f, 2c - 5f - 9 = g. Solve 2x = cn - 10, 4x - 3n = -7 - 11 for x. -3 Let f be (-4 + 5)/((-2)/(-24)). Let l = -6 + f. Suppose 185z - 182z - 15 = 0. Solve y - zy + l = 2k, 4y + 4k - 4 = 0 for y. 2 Let b = 514 - 509. Solve 0r + 3r - 19 = -bx, 3r = x - 11 for x. 5 Let s(c) = -7c3 - 3c*2 + 4c + 5. Let o be s(-1). Solve og + 3t = 7t + 31, -2g + 3t + 18 = 0 for g. 3 Let a(s) be the first derivative of -11s*2/2 - 7s - 8. Let q be a(-2). Solve -3v - h - q = 0, -5h - 15 = 2v + 8 for v. -4 Let r = -30 - -35. Suppose rv = 5 + 15. Solve 6 = i - 3t, vi - 6 = -0i + 3t for i. 0 Let i = 35 + -23. Let m = 109 - 57. Let z be m/i + (-4)/(-6). Solve -u = 2s - 0s + 6, 4u - 2 = zs for u. -2 Suppose -7 = -2o + 3. Let j = 68 - 240. Let f = j - -187. Solve f = -ot, -2t = -5m + 3m + 16 for m. 5 Let s be ((-2)/(-6))/(21/126). Solve -d = o + 1, -3d - 4o = sd + 1 for d. 3 Let c(u) = -u*2 + 5u - 1. Let f be c(4). Suppose 4j - 2j + 3x = 9, x = 5. Let v = j + f. Solve m - 3m - 5w = 2, v = 3m - 5w + 3 for m. -1 Suppose 62 = y + 1. Let w = 65 - y. Solve 4t - 4 - w = -4g, -2t = 4g - 14 for g. 5 Suppose 2u - 11 = x + 8, 3x = -5u - 2. Let q = x - -11. Suppose s = -2g - 1, -qs = -5g - 31 + 6. Solve 2t = -10, -13 = -sh + 4t + 27 for h. 4 Let y be (-2)/8 - 34/(-8). Suppose 4o + 2 = 6. Solve 2f + h + y = 0, -f - 5h + 4h - o = 0 for f. -3 Let g(z) = -z*2 + 7z + 48. Let s be g(-3). Solve 0 = y + 4c - 7, 0 = -5y + c - 4c + s for y. 3 Suppose 5q = -v - 4v - 20, 32 = -3v + q. Let i = v - -11. Solve 2c + 2h = -5 + 15, -10 = -3c - ih for c. 0 Let t = 2 + 2. Suppose -m + q - 1 = -8, tm = -5q - 17. Suppose -2v = 4 - 12. Solve -3z - 2a - 21 = -5, -2a + v = -mz for z. -4 Suppose -3o + 3 = -3p, 3o = 2p + 7 - 1. Solve -5q - 4y = 2 - p, 0 = -3q + 4y - 25 for q. -3 Let f(g) = 64g - 36. Let s be f(1). Suppose 3k - 8 = 1. Let z be (-1)/11 - -5. Solve -j - kj - 32 = zh, h + s = -5j for j. -5 Suppose 2w + 0 - 6 = 0. Suppose -x + 0r + 12 = wr, -5x = 2r - 8. Solve -3t = 3m - 3, x = -3t + m - 0m + 15 for t. 4 Let r be (-11 - (-15 - 5)) + -6. Solve -rg + 2b = -2 + 4, 3g = -4b + 22 for g. 2 Let y(n) be the first derivative of 7n2/2 + 35n + 53. Let b be y(-5). Solve b = 2s - 2, 0 = -5x - 5s - 15 + 45 for x. 5 Let c(h) = 2h*2 - 8h + 2. Let d be c(4). Suppose 5l + du - 28 - 40 = 0, 4l + 2u - 56 = 0. Let p = 31 - 19. Solve x + p = 5q - 3, 0 = 4q - x - l for q. 3 Let q(l) = -l*2 + 1. Suppose 5k - 35 = -0k. Let y = 8 - k. Let r be q(y). Solve -s + 3n - 6 = 0, r + 1 = -2s - 5n for s. -3 Suppose -370 = 2s - 376. Solve -5x + 20 = 5i, 0 = 4i + sx + 4 - 15 for i. -1 Suppose -638i = -632i - 30. Solve -w + 22 = ig, 0w - 22 = -3w - 4g for w. 2 Let n be (-18)/180 - 204/(-40). Solve -5z + 16 = nf + 6, -20 = -3z + 4f for z. 4 Suppose -2i - j + 6 = 0, -4 = 6j - 4j. Solve z + 10 = -if - z, -5f - 14 = 4z for f. -2 Suppose 4t - 42 = 2t + 4y, -5y = t - 42. Let l be (0 - 0) + (t - -1). Let c(k) = -2k - 10. Let o be c(-7). Solve 0 + l = -4b - on, -4 = n for b. -3 Let y(q) = -33q + 434. Let o be y(13). Solve 0 = t - 2l + o + 2, t + 9 = 4l for t. -5 Let w be 6(-2 - (-15)/6). Let v = w - 1. Suppose -3r + 1 = -26. Solve 4n - 23 = 3j, -j + 0j = -vn + r for j. -5 Suppose -4 = -2k + 2d, -8k + 3k - 3d = 22. Let v = 0 - k. Solve g - v = -w - 7, 0 = -2g - 5w - 25 for g. 0 Let z(x) = 19x + 152. Let j be z(-8). Let a be (-61)/(6/(-4)). Solve 4t - 3n = -jn + 7, 0 = at - 4n - 8 for t. 1 Suppose 2g = c + 26, 0g = -2g + 5c + 26. Suppose -3n + 7n - 4 = 0. Let t = g + n. Solve 4h + 16 = -o, 2h - o + 0 = -t for h. -5 Let q be ((-7)/4 + 6/(-8))-2. Suppose 0 = s - 3w + qw - 8, -2s + 44 = -3w. Solve y - 13 = 2n - 2y, 0 = -3n + y - s for n. -5 Let h(i) = 5i - 45. Let n be h(10). Solve 4m - 7 = -5b + 38, -4b - 5 = -nm for b. 5 Let a(w) = -w - 2w - 6w + 8w. Let n be a(-2). Suppose -3f + 38 = 3o + n, 3f - 4o - 29 = 0. Solve -u + 4u = i - 13, 0 = -2i + u + f for i. 4 Suppose b - 2 = 63. Let t = -32 + b. Suppose -t = -0l - 2l + 5s, 3s + 23 = 2l. Solve 4d - 24 = 4f, -ld - f = -4f - 19 for d. 1 Suppose -39g + 19g + 100 = 0. Solve 13s - 17s + 27 = 5m, 5s - gm = 0 for s. 3 Let g(d) = -3d - 46. Let t be g(-16). Suppose -ts - 5 = -15. Solve -2x + sk = 30, -3x + 0k - 3k = 3 for x. -5 Suppose -w = -2s - s + 59, 0 = 4w + 8. Suppose 5r = -5k - 15, 2r + 27 = 567k - 562k. Solve -5y + s = kd, -2d + y - 14 = -6d for d. 3 Let p be ((-1)/(-3))/((-7)/(-525)). Let g be ((-20)/p)/(2/(-5)). Solve 0 = 4b - j - j, 3b - g = 2j for b. -2 Suppose -u - k = -0k + 2, 4u = 3k + 20. Solve -3t + 3a = -ua - 12, 0 = 4a for t. 4 Suppose y - 17 = -3r, -2y + 7 = -3. Suppose -6w = -10w + 52. Let m = 22 - w. Solve 3x + rv = -m, 5x + 0x - 2v = -15 for x. -3 Let l(a) = 39a + 10. Let i be l(0). Solve -2v = -h - 0 - i, 0 = -3v - h + 10 for v. 4 Let g = -4 + 19. Suppose -5v - g = 5s, 3s + 7 = -4v - 8. Let z(l) = -2l - 7. Let r be z(v). Solve 0 = -2j - 5d + 25, rj - 5 = 3j - d for j. 0 Let u(g) = g + 1. Let l be u(1). Suppose ls - 52 = -2s. Let c = s - 6. Solve p = -3x - 5, -4p + 3x + c - 27 = 0 for p. -5 Suppose 3d = -m + 3, 15m = -d + 10m - 13. Solve 3z - 25 = -dp, -5z - 2p + 30 = -5 for z. 5 Suppose 5l = 4k + 8, -k + 4k + 3l - 21 = 0. Suppose 0 = 2n + 4i - 14, -2i = ki - 15. Solve -5g + 2 - n = -3u, u + 4 = -2g for u. -2 Suppose -3x = 7t - 3t + 6, 5t + 19 = 2x. Solve -xh + 4 + 8 = -4s, s + 2h + 13 = 0 for s. -5 Suppose 5f - 2 - 3 = 0. Let a = 1 + f. Suppose 3x = a + 4. Solve -xo - 18 = 4w, 4w - 3w + 18 = -5o for o. -3 Let w = 390 + -367. Solve -2t + i = 3t - w, -3i = 9 for t. 4 Suppose 0 = 4c + 41 - 57. Let d be -2 + c - (3 - 13). Solve 0 = 4r + 3p - 2 - 25, r - 3p + d = 0 for r. 3 Let f = -19 - -23. Solve 5b - 16 = -4q, -3q + 2q = 2b - f for b. 0 Let v = -335 + 200. Let r = -133 - v. Solve m + rf - 4 = -3, -2f = 4m + 8 for m. -3 Let j(v) = -v - 2. Let t be j(-6). Suppose -11 = -5k + 9. Let l be 35 + (-35)/(1 + 6). Solve -kg - l = 5a + g, 5a + tg = -28 for a. -4 Suppose 2 - 5 = -3c. Let b(h) = h2 + 8h + 5. Let v be b(-7). Let d = c - v. Solve -2o + 11 = -0o - di, i + 5 = o for o. 4 Let r(p) = -p2 - 6p + 5. Suppose -4c = 5v + 5 + 9, -5v + 40 = -5c. Let s be r(c). Solve t - 4 = -sd - 2t, -2t - 8 = -2d for d. 2 Suppose -2y + 7 = -7. Suppose 4m - 33 = y. Solve -g - m = -5q, 0 = 3q - 0q + 3g - 24 for q. 3 Let b be (-2 - -4)/(((-40)/76)/(-5)). Solve -5y = -4r - 5, -3y - b = 2r - 0r for y. -3 Let m(z) = z - 7. Let t be m(7). Suppose -3l = -3k - 9, 0k + k = t. Suppose 33 = -4c + 129. Solve u + lw = -4u - 27, 4u = -3w - c for u. -3 Let c(p) = p3 + 5p*2 + p - 3. Let m = -39 + 35. Let y be c(m). Solve -3o = 3w + y - 0, 4w + 18 = -o for o. 2 Suppose 15 = -5b, 0 = -5j + 9b - 4b + 25. Solve 0a = 5i + a + 27, -2a = ji + 14 for i. -5 Let f = -143 + 147. Solve 2p = -5j - p - 35, f = 4j - 4p for j. -4 Let d be 8/(-6)-3 + 1/1. Suppose 2l + 4 - 12 = 0. Solve dz - 6o + o + 35 = 0, lz = -3o for z. -3 Let v be 441/(-126)(12/7)/(-2). Solve q - 4w - 8 = vq, 4q + 4 = 4w for q. -2 Suppose -2c - 3c + 10 = 0, 0 = -4b - 3c - 130. Let k = b + 36. Solve 4w + 4 = 2g, g = -3w + kw - 4 for w. -2 Suppose 3f + 57 = -3. Let n = f + 27. Suppose -2j + 14 = 4. Solve -b - 2s = -n, b + js = 2s + 11 for b. -1 Let t(n) = 62n + 502. Let b be t(-8). Solve -a = -c - 2, 4a + 3c = b - 12 for a. 0 Let h(x) = x2 - 2x - 4. Let u be h(4). Let k = -22 + 26. Suppose kl + 3c - 25 = 0, -l + 14 = 2c + 4. Solve 4q + l + 4 = -2r, -4r = -uq + 4 for r. -2 Suppose -3n + 30 = b, -n + 22 = b - 2n. Let h be 57/5 - (b/(-15) - -2). Solve -v + 3d = h, -2d + 4d - 18 = -2v for v. 4 Let g(d) = -d2 + 11d + 15. Let c be g(12). Suppose -cs - 4p - 72 = -8s, 4s - 54 = 5p. Solve 4q - s = -y, -4q + 9q + 5y = 20 for q. 4 Suppose -2b - 4 = -8. Solve bw + 0 = -2i - 10, 2w = i - 7 for w. -4 Suppose -5j - 4a + 2 + 8 = 0, 5j = -3*a	{ "pile_set_name": "DM Mathematics" }
m + 2s + 1, -3m - 3s + 3 = 0 for m. -1 Solve 0 = -2x - 2q - 8, 4q + 14 - 4 = -x for x. -2 Solve 5i = 4y + 21 - 5, -21 = -5i - y for i. 4 Solve 4m - 3f = 19, f + 3 = -2 for m. 1 Solve -5u = -2y - 25, 2y - 10 = -3u + u for u. 5 Solve -2t + 2 = 2p, 88t + 25 = -3p + 92t for p. -3 Solve x + v + 5 = 0, 10 = -3x + 4v + 2 for x. -4 Solve 5w = -5r - 5, -r + 16w - 11w - 1 = 0 for r. -1 Solve i + 3x - 2 = 3, -4i - 2x = -20 for i. 5 Solve -3q - 2s = -9, -2 = -q - 2s + 1 for q. 3 Solve 0 = 13p - 14p + 5a, -2p + 2a - 8 = 0 for p. -5 Solve -2h - 11 = -j, -2h + 1 = 3j - 0h for j. 3 Solve 2z = -2r + 1 - 5, r + 6 = -3z for r. 0 Solve -n = -2g + 1 + 4, 0 = 2n - 10 for g. 5 Solve -t + 11 = x, 4x - 14 = 5t - 15 for x. 6 Solve 0 = -a - 4t - 2, 0 = -4a + 9a + 5t - 5 for a. 2 Solve -x = 5i + 12, -5i + i = -x + 15 for i. -3 Solve 2k - 5 = -s - 13, s = -5k - 17 for k. -3 Solve -2p - 2d + 4 = -4, -p + 4d = 11 for p. 1 Solve 2a = -z - z - 8, -2a = -z + 11 for z. 1 Solve 0 = -k + g, -3k + 2k - 3 = -2g for k. 3 Solve 0 = 4w - o + 15, 0 = w + 17o - 15o - 3 for w. -3 Solve -15 = -3u, 0 = 5x + 4u - 55 + 10 for x. 5 Solve 8 = -3g - 4o + 19, 0 = 5g - 5o + 40 for g. -3 Solve -5h + 40 = 8j - 3j, 3j - 21 = -2h for j. 5 Solve 0g - 8 = -3g - n, 2g - 4n = 10 for g. 3 Solve 74l - 71l + y = -1, 3 = 4l - 3y for l. 0 Solve -4t + 5t - 15 = 3b, 0 = 2t - 5b - 25 for t. 0 Solve 5n - 3n = -2, 0 = 2t - 2n - 6 for t. 2 Solve 3o + 6 = 4g, -2o - 5 = g - 1 for g. 0 Solve 0 = -c - 4, -3d + 4c - 3c + 13 = 0 for d. 3 Solve 0 = -0x + 2x - 4h - 12, 0 = -5h - 25 for x. -4 Solve 4l + 4p + 8 = 0, -3l - 8p + 10 = -13p for l. 0 Solve 2w - w = 3b - 11, -b + 4 = 0 for w. 1 Solve 0 = -3k + 4i + 17, -3i + 8i = -5k + 5 for k. 3 Solve 8f + 19 = 5g + 10f, -2g - f = -8 for g. 3 Solve -5j + 2q + 6 + 17 = 0, -2q - 14 = -2j for j. 3 Solve 0 = 4g - 5p + 17, -p + 6p + 7 = -4g for g. -3 Solve 3a = -2y + 6, 53a + 16 = 57a for y. -3 Solve -5g + 25 = 0, -3w - 2g + g = 10 for w. -5 Solve -4v = -22k + 27k - 17, -2v = k - 7 for v. 3 Solve 0 = a + 5, -l - 16a = -13a + 18 for l. -3 Solve 0 = 2u + 8, -j = u - 11 + 18 for j. -3 Solve p + 11 = -5r, 2r + 3p - 2p = -2 for r. -3 Solve -4s + 22 = -2p, 2 - 3 = -p - 2s for p. -5 Solve 0d = 2x + d - 13, 3d + 1 = 4x for x. 4 Solve 4w = 5v + 3w - 20, 4w + 20 = 5v for v. 4 Solve -h = 2f - 7, 0 = 12h - 13h - 4f + 9 for h. 5 Solve -j - 16 = 3c, -3c - 10 = 5j + 22 for c. -4 Solve 0 = -4y - 5m - 5, -23m = -18m + 25 for y. 5 Solve 5l = -b + 21, 56b - 60b = 5l - 24 for l. 4 Solve -4l - 4q = -4, -5l + q + q = -33 for l. 5 Solve t + 3w = -11, 4w = -3t + 5t - 18 for t. 1 Solve -2k = 2z - 4k + 6, 2k - 6 = -2z for z. 0 Solve -4j = 3v + 7 - 19, 0 = 3j + 4v - 16 for j. 0 Solve -y - q = 2q + 10, 0 = 3y + 5q + 22 for y. -4 Solve -4o - 24 = 4m, -2m - 5o - 8 = 7 for m. -5 Solve 3n + 3 = 0, 0 = 2c + 5n - n + 6 for c. -1 Solve 3g + s = 6g - 9, -g + 19 = 5s for g. 4 Solve 3s = 4z + 8, -4s - 17 + 1 = 0 for z. -5 Solve 8a - 3a - 20 = 0, -4i - a + 8 = 0 for i. 1 Solve 5d - 30 = -2p - 10, d = -5p + 4 for d. 4 Solve -k + 4z = -3k - 10, -3z - 12 = -3k for k. 1 Solve 4b + 7 + 7 = 2r, -4r = -3b - 23 for r. 5 Solve 7 = -0p - 2p + 3a, 2p + 4a = -14 for p. -5 Solve g - 4n = 7, -7 + 8 = -n for g. 3 Solve -4z + 12 = -2m, 0 = 2z - 3z + 4 for m. 2 Solve 4r + 13 = q - 2q, -28 = 4r - 4q for r. -4 Solve -18v = -14v + 4o - 28, v - 4o = -13 for v. 3 Solve -2o + 3l - 21 = 0, -16o + 2l + 5 = -21o for o. -3 Solve z - 3p - 11 = -2, 15 = -5p for z. 0 Solve 0 = 3y, -c + 8 = 2y + 4 for c. 4 Solve 3i = 4h - 7, 0 = 3i + 10h - 12h + 11 for i. -5 Solve 8 = 4x, -4 = -2z + 15x - 13x for z. 4 Solve 3n - 13 = 3a - 4, 3n - 5a = 5 for n. 5 Solve 0 = -5c + 5b - 25, -2c - 3b = 2c - 1 for c. -2 Solve -3d = t + 5, -5d + 9d = t + 5 for t. -5 Solve 19 - 5 = -3i + 4f, 5i + f + 8 = 0 for i. -2 Solve -4h + 16 = 0, 31h - 29h = -5g + 33 for g. 5 Solve 0b = 2b + 14, -3c + b = -7 for c. 0 Solve 12 = -2b - 3b - 2g, 0 = 2b + g + 5 for b. -2 Solve f + 3 = 0, -j = -3j + 3f + 9 for j. 0 Solve 12c + 4a = 7c + 15, 0 = -2c - 2a + 8 for c. -1 Solve 0 = 5q - 5k - 35, -2q - 4k + 0 = -2 for q. 5 Solve -5z + 3z + 16 = -3g, 0 = 4g - 3z + 23 for g. -2 Solve 4l - 2l - 3u - 12 = 0, l = -4u - 16 for l. 0 Solve 112t + 2s = 108t - 22, 31 = -2t - 5s for t. -3 Solve -8b - 8 = -2j - 3b, 0 = -3j - 3b + 12 for j. 4 Solve 4k = 3b + 20, 3b - 5k + 24 = -1 for b. 0 Solve -5q - 4y + 16 = 53, 3y = -3q - 24 for q. -5 Solve -v + 5m = -19, -11 = 4v - 9v + 4m for v. -1 Solve 4s - 8 = -0, s + 7 = -3d for d. -3 Solve -4m - 16 = 4g, g = -3m - 3g - 11 for m. -5 Solve -5l = -2x + 3 + 15, -5l - 22 = 2x for l. -4 Solve 5y - 16 = -4i, 2i - 17y = -21y + 8 for i. 4 Solve 4r = -5p + 2, 19p - 3r = 15p - 17 for p. -2 Solve -7n + 2n - 5 = 4w, n - 18 = 3w for n. 3 Solve -2w = -4, 2w + 6 = 3j + 5w for j. 0 Solve -p = -3p + s - 5, 0 = -5p + 2s - 13 for p. -3 Solve 2d - 98 = -c - 101, 0 = -2d for c. -3 Solve -5j - 4s - 21 = 0, 2j + 20 - 8 = 2s for j. -5 Solve 3j = -2w - 7, 2w - 5j + 4j = -3 for w. -2 Solve -k + 2 = 3y + y, -4y = -k + 2 for y. 0 Solve g - 2p + 1 + 2 = 0, -3p = 0 for g. -3 Solve 0 = -c + 3, 3c - 31 = -4l - 6 for l. 4 Solve -2r = -6, r + 6 = 7o - 10o for o. -3 Solve 3w - 7 + 22 = -4v, 5w = -3v - 14 for w. -1 Solve -y + 5d - 6 - 25 = 0, -2 = 2y + 2d for y. -6 Solve -8b + 10 = -5b - l, 5b + 4l = 11 for b. 3 Solve 3t - 12p + 9 = -9p, 0 = -2t - 4p - 6 for t. -3 Solve 5y - 6 = -3d, 0y - d = -2y + 9 for y. 3 Solve -5u + 0l + 2l - 21 = 0, 4l - 24 = 4u for u. -3 Solve -1 = -2y - m - 3, y + 3m = 9 for y. -3 Solve -2b - 3j + 8j = -22, -3b + 11 = -2j for b. 1 Solve 10 = -o - 2p + 3, -29 = -3o + 4p for o. 3 Solve -3c - 15 = -3l + 6l, 3l + 15 = c for c. 0 Solve 2f = -4o, -65o + 61o - 28 = -5f for o. -2 Solve 0 = u - k + 2 - 1, 4u - 5k = -6 for u. 1 Solve -p = 5d - 27, 7d = 11d - 20 for p. 2 Solve -38 = 5d + 4v, 7d + 3v + 36 = 2d for d. -6 Solve 4p - 9 = -5, -21 = 4y - p for y. -5 Solve 5v + f + 103 = 97, -4f + 22 = -3v for v. -2 Solve -d + 5 - 8 = 0, -2 = -g - 2d for g. 8 Solve 3v - 3c = 2c - 8, 17 = -14v + 3c for v. -1 Solve -3l + 3r - 17 = -8, -2l = 5r + 20 for l. -5 Solve 2u + 3g + 3 - 2 = 0, 4 = 2u - 2g for u. 1 Solve -2s = 0, 49s - 3 = b + 48s for b. -3 Solve -3i + 12 = 4u, 3u = 4i - 23 + 7 for i. 4 Solve 2w = 5l + 16, -4l + 3w = l + 19 for l. -2 Solve 7z - 10z + 14 = -2m, m + z + 2 = 0 for m. -4 Solve 0 = -4x - 5i + 12, x - 3x + 6 = 4i for x. 3 Solve 5a + f = -15, 0a - 2 = 3a + 2f for a. -4 Solve 5n - 4c + 13 = 0, 4n + 4c + 51 - 19 = 0 for n. -5 Solve -4d + 30 - 6 = 4b, 10 = 2d + b for d. 4 Solve 2d = s - 6, -12d + s = -18d - 18 for d. -3 Solve 43a - 2u = 39a + 2, 2u + 2 = 2a for a. 0 Solve -5b + 25 = 0, 0 = -2j - b - 0 - 3 for j. -4 Solve 4o + 2h + 14 = 0, -2o - 6h - 19 = -9h for o. -5 Solve 5 = 5f + 5z, 5z = -4f - 1 + 5 for f. 1 Solve 21 = 3i + 3b, -2b = -2i + 2b - 4 for i. 4 Solve -4h - 3x = 24, -4h - 2x - 2x - 28 = 0 for h. -3 Solve 0 = -5l - 2b + 16, 2l - 3b - 15 = -1 for l. 4 Solve 11m - 6m + 2s = -6, -2m = -4s - 12 for m. 0 Solve -9y = -5y + 5g + 8, -2y - 3g = 6 for y. 3 Solve -4f - 26 = 5p - 5, 2p + 4f + 6 = 0 for p. -5 Solve 2i - t - 7 = 0, -i + 0t = 4t + 10 for i. 2 Solve -5p = 4s - 0s - 15, s - 5p = 10 for s. 5 Solve 5k = -3m + 25, -4k = -m - 33 + 13 for m. 0 Solve -5c - 10 = -2k, k + c - 6 = -1 for k. 5 Solve r = -4, -h + 28 = -5h - 3r for h. -4 Solve -c = -z + 1, 3c + z = -2c + 13 for c. 2 Solve -10 = 4a - 8a - 2z, 0 = 3a + 2z - 5 for a. 5 Solve 2b = -5f - 23, -b - 9f + 11f + 11 = 0 for b. 1 Solve -g = 3g - 3d - 6, 0 = 5g + 5d + 10 for g. 0 Solve 0 = 3j - g, -3j + 3g + 8 = -2j for j. -1 Solve 5a - 18 = -2f, 0 = 5a - 2a - 12 for f. -1 Solve 4h = -l - 10, 2h + 2l = 4l for h. -2 Solve -j - 12 = -3g, -3j + 59 = 5g + 25 for g. 5 Solv	{ "pile_set_name": "DM Mathematics" }
ch is the smallest value? (a) 0 (b) 3945.3 (c) 2.17 a What is the smallest value in 3/4, 0.5, 0.05, -49, 0.2, 2, 31/7? -49 Which is the fourth biggest value? (a) -2/21 (b) 730 (c) -0.3 (d) 1/22 (e) 4 a Which is the sixth smallest value? (a) -31 (b) -0.5 (c) 0.0686 (d) 0.2 (e) 1.5 (f) -5 e What is the third smallest value in 1, -3, 574/9, 1/6, 602? 1 Which is the third biggest value? (a) 23103/7 (b) -3 (c) -5 (d) -1 (e) 0.007 d Which is the biggest value? (a) 1.3 (b) -695428 (c) -0.1 a What is the biggest value in -127807, 0.4, -3/134? 0.4 Which is the biggest value? (a) -1 (b) -0.41 (c) -1/5 (d) -12 (e) 1815 (f) -0.4 e What is the fourth smallest value in -1557, 0.1, 1, -0.6? 1 What is the third smallest value in 0.2, -3/5, -2526482? 0.2 Which is the third smallest value? (a) 0.5 (b) 83/2 (c) 4 (d) 56909 b Which is the second biggest value? (a) -57/7 (b) -4/15 (c) 18 (d) 73 (e) 2/5 (f) -2 c Which is the second smallest value? (a) 22 (b) 0.01 (c) 42100 (d) -2/11 b What is the second smallest value in 555, -7, 0.2, 30? 0.2 Which is the second biggest value? (a) -15 (b) -1 (c) -12 (d) 1682 b What is the second smallest value in -353, 0.8, 4/4731? 4/4731 Which is the fourth biggest value? (a) 0.28 (b) 1/3 (c) -13 (d) -5/4 (e) 0.8 (f) -0.2 f What is the biggest value in 3/5, -4/5, -18712? 3/5 Which is the sixth smallest value? (a) 0.03 (b) -55 (c) 2/97 (d) 18/17 (e) 1 (f) -3 d What is the sixth biggest value in 0.80138, 4, 1/5, -4, -69, 2? -69 Which is the fourth biggest value? (a) 5/3 (b) -3 (c) -0.46 (d) -1/5 (e) 18 c Which is the third biggest value? (a) -0.1 (b) 1/3 (c) 1/4 (d) 1.1 (e) -0.11 (f) -370/29 c What is the fifth smallest value in 0.3, 35, 2, 3/4, -184/39? 35 Which is the sixth smallest value? (a) 0.2 (b) -2.105 (c) 37/3 (d) -15 (e) -2/11 (f) -4 c Which is the second biggest value? (a) 1.4 (b) -0.9 (c) 9 (d) -7885 a Which is the fourth biggest value? (a) -2.5 (b) 20 (c) -2 (d) -17636 d What is the fifth biggest value in 0.1, 1, 0.2, 6, 0.3, -5.4, 15/7? 0.2 What is the fifth smallest value in -3, 1, -34, -10/19, 5, -2, 1/3? 1/3 Which is the smallest value? (a) -2 (b) 8/7 (c) -3 (d) -8 (e) 4 (f) 5 (g) -2.11 d What is the second biggest value in -82757, -2/7, 3.1? -2/7 What is the second smallest value in 2, 2/787, 28/3695? 28/3695 Which is the second biggest value? (a) 278 (b) 2329 (c) -9 (d) -1 a What is the second smallest value in -5, -5/2, 1203.2, 0.5, 2, 1? -5/2 Which is the fifth smallest value? (a) -1 (b) 0.008 (c) 5 (d) -3 (e) -65.62 (f) 2 f What is the second biggest value in -0.9, -27/4, -57/64, -5? -0.9 Which is the third smallest value? (a) -4 (b) -10716 (c) -15 (d) 28 a Which is the third smallest value? (a) -11.4 (b) 2/3 (c) -12001/10 (d) -3 d Which is the second biggest value? (a) -26/139 (b) -4 (c) 0 (d) 0.12 (e) 2 d Which is the smallest value? (a) 71 (b) -9 (c) 1 (d) 35/24 b What is the biggest value in 1/3, -43.5, 1/6, -1, -396? 1/3 What is the second smallest value in 3, -0.2, 976/65, -16? -0.2 Which is the fifth smallest value? (a) 28 (b) 5 (c) 21 (d) -1 (e) -2 (f) 3 (g) 1/5 b Which is the smallest value? (a) -34 (b) 2 (c) 2/22193 a Which is the third smallest value? (a) 17 (b) -8/5 (c) -6246/31 a What is the fifth smallest value in -8.9, -0.2, 13, 1/4, -2/7, -23? 1/4 What is the smallest value in -1/390, -1.2, -2/13, 0.2681? -1.2 Which is the third smallest value? (a) -0.3 (b) -4 (c) -344 (d) -0.057 (e) -0.34 (f) 0.5 e What is the third smallest value in -1.4008, 0, 1/2, -0.1, -0.09, 11? -0.09 What is the smallest value in 5, 0.7070949, 0, -2? -2 Which is the smallest value? (a) -2647 (b) 255 (c) 5 (d) 1 (e) 4/3 a Which is the biggest value? (a) -43 (b) 471/19 (c) 0.2 (d) -0.1 (e) 2/5 (f) 5 b Which is the fourth biggest value? (a) 1/2 (b) 0 (c) -3/4 (d) -3 (e) -2.102 (f) 554 c Which is the seventh smallest value? (a) 12466 (b) 1 (c) 4 (d) 2/7 (e) 4/5 (f) 3 (g) -10 a Which is the smallest value? (a) 1 (b) -0.061 (c) -9/5 (d) 3 (e) -2 (f) 2/5 e Which is the second smallest value? (a) -0.2 (b) -2/1223 (c) -0.18 (d) -13/3 a Which is the biggest value? (a) -3/2 (b) -2 (c) -4/1797 (d) 1/2333 d What is the third smallest value in 0.4, -0.7, 10914183? 10914183 Which is the fifth biggest value? (a) -371 (b) -8 (c) -2/3 (d) 13 (e) 2 (f) 4 b What is the fourth smallest value in -0.5, -1.1, 2, -4, 4, 2/13, 66/13? 2/13 Which is the biggest value? (a) 3 (b) -231 (c) -10 (d) -0.07 (e) -4 a What is the biggest value in 0.3, -33, 208, -0.2, -0.5, 1/2, 2/3? 208 What is the fourth biggest value in 174, -0.4, -0.226, -2/9, 4, 0, 0.5? 0 Which is the fourth smallest value? (a) 0.1 (b) 58.60385 (c) 1/66 (d) 2/3 (e) 1/3 d What is the second biggest value in -1, 1255, -0.371? -0.371 Which is the fifth smallest value? (a) 0.7 (b) -73335 (c) -0.2 (d) 4/3 (e) -4/7 (f) 0.2 a What is the third biggest value in -0.82, 0.0648, 43? -0.82 What is the third biggest value in -4, -8, 8512? -8 Which is the second biggest value? (a) 0.1 (b) -5172987 (c) -3 (d) 3 (e) 0.4 (f) 1 f Which is the fourth smallest value? (a) 0 (b) -3 (c) -200 (d) 1 (e) -24 (f) 26 (g) -0.3 g Which is the fourth smallest value? (a) 0.2 (b) 3 (c) -2/7 (d) 2/3 (e) 434 (f) 4 (g) -104 d Which is the second biggest value? (a) -2/5 (b) 0.5 (c) -2 (d) -1/8 (e) 100 (f) -3.06 b Which is the biggest value? (a) 49/5 (b) -0.0171 (c) 3/362 a What is the fourth biggest value in 1644, -4, -0.3453, -1/6? -4 What is the second biggest value in 2/47, 3, -289317? 2/47 What is the fifth smallest value in 4, 65, 0.5, -17/5, -13? 65 Which is the third smallest value? (a) -666 (b) 1 (c) -3055 b Which is the biggest value? (a) -21138 (b) 1/4 (c) 5 (d) 4/7 (e) 3/5 (f) -5 (g) -0.9 c Which is the biggest value? (a) -0.4 (b) -14 (c) 1/4 (d) -2.267 c Which is the fifth biggest value? (a) -0.4 (b) -39 (c) -0.2 (d) -5 (e) 0.2 (f) -180.5 b Which is the third biggest value? (a) 0.2 (b) 348 (c) -57.4 (d) 3/5 (e) -2 (f) -14 a What is the fourth biggest value in -1.6, -29/151, -1/2, -12? -12 Which is the fourth smallest value? (a) 13 (b) 5 (c) -0.5 (d) -2/7 (e) -47 (f) -12 (g) -0.1 d What is the biggest value in -5, -683714, -2/7? -2/7 Which is the fourth biggest value? (a) -0.145 (b) 1 (c) -18 (d) -5 (e) -5/6 (f) -0.073 (g) -0.1 a What is the third biggest value in 9, -19/23, -3, 0.06? -19/23 Which is the biggest value? (a) 15 (b) -2/11 (c) -4 (d) 5 (e) -6/5 (f) 2/57 a Which is the biggest value? (a) 544 (b) -4/19 (c) -5.5 a Which is the fourth biggest value? (a) -3/4 (b) 0 (c) 1 (d) 2 (e) -128.3 (f) 0.14 b Which is the second smallest value? (a) 5 (b) 11/1354 (c) -442 b What is the smallest value in 3, -11, 27, -0.14, 5, -1, -21? -21 What is the third biggest value in 5512, -1, 3651? -1 What is the second smallest value in 0.5, 23, 12, -1, 0.3, -34, 7? -1 Which is the sixth biggest value? (a) -556 (b) -4/3 (c) -2/3 (d) -1/16 (e) 1.2 (f) 4 (g) 0.2 b Which is the fourth smallest value? (a) -5 (b) 3 (c) 4 (d) 42 (e) -4182 (f) -0.5 (g) 12 b What is the second biggest value in -163/8, -3, -10, -123? -10 Which is the biggest value? (a) -2/53 (b) 1 (c) 560055 c Which is the biggest value? (a) 705 (b) 1/4 (c) -15/7 (d) 5 (e) 16 (f) -0.5 a Which is the third biggest value? (a) -16/5 (b) 861/58 (c) -4/3 a Which is the biggest value? (a) 3533 (b) -0.1 (c) 2 (d) 0.187 a Which is the second smallest value? (a) 2 (b) 0.00876 (c) 5 (d) 1/3 d Which is the smallest value? (a) -9/68 (b) 2498 (c) -1 c Which is the fifth smallest value? (a) -4/5 (b) -21 (c) 758 (d) -1 (e) 0.4 c Which is the second smallest value? (a) -2/5 (b) -1/11 (c) 3740 (d) 2/17 (e) -3 a Which is the sixth biggest value? (a) 2 (b) -4 (c) -5/2 (d) -16 (e) 18 (f) 0.1 (g) -0.275 b What is the biggest value in 0, 0.3, 0.5, 0.6, 1/3, 2998? 2998 What is the smallest value in -0.4, 2, -582233? -582233 What is the second biggest value in -13, 5/3, 0.0179, -14? 0.0179 What is the second smallest value in 3/5, 19/5, 138/13, 14, -2/7? 3/	{ "pile_set_name": "DM Mathematics" }
{q: 2, p: 2, s: 1}. Give prob of sequence qpps. 1/30 Two letters picked without replacement from {e: 5, m: 1, r: 11}. What is prob of sequence re? 55/272 What is prob of sequence db when two letters picked without replacement from pbbpbpbvdvvvv? 1/39 Four letters picked without replacement from glleueeegueeellulel. What is prob of sequence glgu? 1/2584 Four letters picked without replacement from didtkkktdkddsktsddkk. Give prob of sequence kkks. 7/1938 Four letters picked without replacement from {v: 3, s: 2, n: 5, p: 7}. What is prob of sequence psvp? 3/680 Three letters picked without replacement from {n: 1, r: 1, g: 5, k: 4}. What is prob of sequence grn? 1/198 Calculate prob of sequence mmmj when four letters picked without replacement from jmjjmmjjjj. 1/120 Two letters picked without replacement from yayppr. What is prob of sequence yy? 1/15 What is prob of sequence uz when two letters picked without replacement from {e: 4, u: 1, k: 2, z: 2, p: 3}? 1/66 What is prob of sequence kk when two letters picked without replacement from {f: 2, o: 5, b: 1, a: 8, g: 2, k: 2}? 1/190 What is prob of sequence hhi when three letters picked without replacement from hhiiihhhihiih? 21/143 Calculate prob of sequence mmi when three letters picked without replacement from {m: 9, i: 3}. 9/55 What is prob of sequence ob when two letters picked without replacement from {n: 2, f: 1, o: 1, d: 1, b: 1, r: 2}? 1/56 Three letters picked without replacement from jojgoojjfsjc. What is prob of sequence gsc? 1/1320 Two letters picked without replacement from {x: 2, q: 8}. What is prob of sequence qx? 8/45 Two letters picked without replacement from itgfn. What is prob of sequence it? 1/20 What is prob of sequence llu when three letters picked without replacement from {a: 2, u: 1, l: 2}? 1/30 Two letters picked without replacement from {i: 1, o: 1, z: 3, a: 3, n: 1, v: 2}. Give prob of sequence an. 3/110 Two letters picked without replacement from bjjjjfnbbmbibbnibiib. What is prob of sequence bb? 14/95 Two letters picked without replacement from {f: 1, x: 2, h: 2}. What is prob of sequence hf? 1/10 What is prob of sequence lg when two letters picked without replacement from alggggggggggoq? 5/91 Four letters picked without replacement from uauujuaajuzz. Give prob of sequence azjz. 1/990 Calculate prob of sequence pppp when four letters picked without replacement from pipipipppppppppp. 11/28 Two letters picked without replacement from {q: 2, h: 5, y: 3}. Give prob of sequence qy. 1/15 Three letters picked without replacement from rjrsjs. Give prob of sequence jrs. 1/15 What is prob of sequence aaa when three letters picked without replacement from {a: 9}? 1 Two letters picked without replacement from {i: 1, k: 2, y: 1, o: 1}. Give prob of sequence io. 1/20 What is prob of sequence occ when three letters picked without replacement from ccoooccocoooc? 35/286 Four letters picked without replacement from {y: 7, h: 6, c: 4}. Give prob of sequence chch. 3/476 What is prob of sequence hxar when four letters picked without replacement from {a: 3, r: 3, v: 2, d: 3, h: 3, x: 5}? 15/10336 What is prob of sequence ee when two letters picked without replacement from fffeffqefqefefeefe? 7/51 Calculate prob of sequence vrv when three letters picked without replacement from rvrvzrrvzrrr. 7/220 Three letters picked without replacement from {l: 2, e: 2, t: 1, y: 1, p: 10, f: 3}. Give prob of sequence ell. 2/2907 Two letters picked without replacement from uvcucpdvppvppvk. Give prob of sequence cd. 1/105 Calculate prob of sequence xx when two letters picked without replacement from xrczczxxczcrzczxzzz. 2/57 Four letters picked without replacement from juxma. What is prob of sequence muja? 1/120 Calculate prob of sequence gw when two letters picked without replacement from {g: 3, u: 2, w: 5}. 1/6 Calculate prob of sequence byk when three letters picked without replacement from {k: 4, g: 1, b: 1, v: 2, y: 2}. 1/90 Calculate prob of sequence inq when three letters picked without replacement from tinnqin. 1/35 Two letters picked without replacement from {p: 5, n: 1, d: 1, g: 3}. Give prob of sequence pg. 1/6 Two letters picked without replacement from mwuwx. What is prob of sequence xw? 1/10 What is prob of sequence pdl when three letters picked without replacement from kpkwwwpwkldfwppflwwk? 1/855 Two letters picked without replacement from xyzwwwwwzywtxtwtxwz. Give prob of sequence wx. 4/57 What is prob of sequence sx when two letters picked without replacement from vxvxaxaxsv? 2/45 Three letters picked without replacement from jhbhqbqjbqbfubb. What is prob of sequence ujf? 1/1365 Two letters picked without replacement from {i: 2, e: 2, k: 1}. What is prob of sequence ke? 1/10 Calculate prob of sequence mmki when four letters picked without replacement from omkkmmimki. 1/70 Two letters picked without replacement from aardlddjlaja. What is prob of sequence aa? 1/11 Four letters picked without replacement from {k: 2, l: 2, d: 4, n: 1}. Give prob of sequence lkdn. 1/189 Calculate prob of sequence ak when two letters picked without replacement from ngaggkzgk. 1/36 Three letters picked without replacement from {n: 12, f: 1, w: 1}. What is prob of sequence nnw? 11/182 What is prob of sequence yy when two letters picked without replacement from {o: 3, y: 3}? 1/5 Three letters picked without replacement from {s: 1, z: 1, a: 4, j: 1, c: 1}. Give prob of sequence sjz. 1/336 Four letters picked without replacement from {g: 4, h: 15}. Give prob of sequence hggg. 5/1292 Two letters picked without replacement from {w: 4, d: 3}. Give prob of sequence ww. 2/7 Calculate prob of sequence fz when two letters picked without replacement from mfzf. 1/6 What is prob of sequence pn when two letters picked without replacement from {l: 3, t: 1, p: 2, u: 1, n: 3}? 1/15 What is prob of sequence ttta when four letters picked without replacement from pttttwwa? 1/70 Calculate prob of sequence ra when two letters picked without replacement from {p: 1, y: 1, r: 1, a: 1, c: 1}. 1/20 What is prob of sequence zzr when three letters picked without replacement from {r: 2, z: 2, b: 2}? 1/30 Two letters picked without replacement from yluyyjky. Give prob of sequence kk. 0 Two letters picked without replacement from nbii. What is prob of sequence bn? 1/12 Calculate prob of sequence cc when two letters picked without replacement from {c: 4}. 1 Four letters picked without replacement from gqquguqqq. Give prob of sequence uqgu. 5/756 Three letters picked without replacement from {p: 9}. Give prob of sequence ppp. 1 Three letters picked without replacement from ztnncinionzni. Give prob of sequence cto. 1/1716 Two letters picked without replacement from {c: 6, e: 3, q: 1, j: 3, i: 3}. Give prob of sequence ie. 3/80 Two letters picked without replacement from gqgqqqg. What is prob of sequence gg? 1/7 Three letters picked without replacement from {w: 3, s: 2, r: 4, z: 2, b: 1}. Give prob of sequence zwb. 1/220 What is prob of sequence prff when four letters picked without replacement from {f: 2, r: 4, p: 5, q: 4}? 1/819 Calculate prob of sequence mezg when four letters picked without replacement from {m: 1, i: 1, z: 4, e: 3, g: 2}. 1/330 Calculate prob of sequence fq when two letters picked without replacement from {k: 1, q: 5, d: 1, f: 4}. 2/11 Three letters picked without replacement from ddddddzolldnddnd. What is prob of sequence nzl? 1/840 Three letters picked without replacement from {n: 3, x: 4}. What is prob of sequence nxx? 6/35 Three letters picked without replacement from hgciwwgcijjc. Give prob of sequence iih. 1/660 What is prob of sequence rg when two letters picked without replacement from {r: 1, n: 1, j: 1, g: 1, y: 1}? 1/20 Three letters picked without replacement from uvuvuqomuuumuwmuvwu. What is prob of sequence wou? 1/323 Calculate prob of sequence nj when two letters picked without replacement from {j: 2, v: 3, t: 1, k: 4, n: 1}. 1/55 Three letters picked without replacement from vvvgvgvg. What is prob of sequence ggg? 1/56 Four letters picked without replacement from ttgh. Give prob of sequence gtth. 1/12 Two letters picked without replacement from vaibvqviiazzz. What is prob of sequence qv? 1/52 What is prob of se	{ "pile_set_name": "DM Mathematics" }
*(-1/2)))/((rr*(-3/5)rr)/(rr*(5/6)/rr)))4 assuming r is positive. r(-164/15) Simplify h*(-2/33)/(hh*(-7)h)h(-1/3)(hh(2/19))/hh assuming h is positive. h(3581/627) Simplify (((c(1/2))(-6))(-13))(-2/153) assuming c is positive. c(-26/51) Simplify (((n/n35)/n)(-7))(2/81) assuming n is positive. n(490/81) Simplify (x*(-2/9)/x)/(x/((((xx*(1/10)xx)/x)/x)/xxxx))x/(x/(x/x(-6))x)x(-3)/x assuming x is positive. x(259/90) Simplify (((kk(-2/5))/k)/k)23k(-3/11)kk/(kk(1/2)) assuming k is positive. k(-3517/110) Simplify ((o*3o(-5))/(o/((o(-4)o)/o)o*(-2/9)o))(-25) assuming o is positive. o(1750/9) Simplify (o*13/oo*(-2/5))/(o(oo(1/17))/ooo11) assuming o is positive. o(-124/85) Simplify b(-1/4)(bb/(b/(b/(((b(1/8)/b)/b)/b)b)))/b(bb(2/5))/b(4/7) assuming b is positive. b(1527/280) Simplify (g1/g)*(1/12)g*19/g(g/g*(1/5)g)/g assuming g is positive. g*(94/5) Simplify (k/(kkk/((k/(k(-24)/k))/k))kk8)5 assuming k is positive. k160 Simplify cc*(1/23)c*(2/31)/c(c(-10))(3/31) assuming c is positive. c(-613/713) Simplify x(-18/5)(x/x(-19))/xx*(-19/2)/(x/(xx*(1/13))x) assuming x is positive. x(647/130) Simplify (c(14/9)/ccccc*(-5/7)c)/(ccc(2/9))(22/3) assuming c is positive. c(-2354/189) Simplify (h/(h(-1/15)/h))*(-2/57)(h/(h*(14/3)h))(-40) assuming h is positive. h(159538/855) Simplify (((c1)(5/2))(-11/2))(11/4) assuming c is positive. c*(-605/16) Simplify yy*31y/(yy(-2/13))(y*(-24)yyy)(-36) assuming y is positive. y(10246/13) Simplify (d/((dddd(-4))/d))/dd*2d(dd/d(-14))/(d15d) assuming d is positive. d5 Simplify (j5)(1/11)(jj(-4/3))(2/67) assuming j is positive. j(983/2211) Simplify (k1)(-42)(k/k*7kk)/(k/(kk(-11))) assuming k is positive. k(-57) Simplify (n*0n*(-4/3)(n0)(-12/17))24 assuming n is positive. n(-32) Simplify u*23/uu*27((u/(u/(u/u*(-11/2))))/u)/(uu(3/23)) assuming u is positive. u(2455/46) Simplify ((u0)(-19))28 assuming u is positive. 1 Simplify (d/(d(-6)/d)d(-2/5))/(d2/d)(-10) assuming d is positive. d(88/5) Simplify l1l*4(l(-4)/l)13 assuming l is positive. l(-60) Simplify (b14bb(1/14))/(b14(b(-6)b)/b) assuming b is positive. b(99/14) Simplify ((v(-1)/v)/((v/v*(-2))/v)(vv(2/5)v)/v(vv(-1/3)/v)/v)(-6) assuming v is positive. v(118/5) Simplify (u(-10)u/(uuu(-3)/u))/(u(2/9))45 assuming u is positive. u(-17) Simplify (l(-4/9)l*(-4)l)/(l*(-27)l30) assuming l is positive. l(-58/9) Simplify ((i/((i(ii/i1)/i)/i))/i(-6)i(-2/21)/iii(4/3)/i)(8/3) assuming i is positive. i(1216/63) Simplify (((jjj(-20))/j5)45)(-32) assuming j is positive. j33120 Simplify z/z(2/55)z*(3/13)z*(5/8)/(z/(zz*12)z) assuming z is positive. z(73327/5720) Simplify (u(-36)/(u*(6/5)u))/(u/u*(-5/2)u)(-18/13) assuming u is positive. u(-2078/65) Simplify (tt(-3/14))/(tt/(tt(-11)))t/(t/(t/t*(1/2)))tt/(t/t16) assuming t is positive. t(44/7) Simplify (((pp*(2/7)p)(-12/13))(2/9))(-23/5) assuming p is positive. p(2944/1365) Simplify (h(1/3)/h)46h10hhh(-4) assuming h is positive. h(-68/3) Simplify (s(-2/7))(-35)(sss(-2/17))/((s(-1)/ss)/s) assuming s is positive. s(236/17) Simplify (n/n16n(nn/((nn*(-18)/nn)/n))/n)/((n*(2/7)n)/nn)(-2/87) assuming n is positive. n(1021/203) Simplify (b(1/2)/b(4/9))/(b1/(b/b(-16))) assuming b is positive. b(289/18) Simplify (((yy(1/9))/y)/(y/y(-9)))/(y(8/7))(-42) assuming y is positive. y(343/9) Simplify (z(-1/3)/z(z/(((z(-8)/z)/z)/z))/z(zz1z)(-23))(6/7) assuming z is positive. z*(-356/7) Simplify ll/((l/(l/(ll/((lll/l(-1/2))/l))))/ll)ll(l/((l6/l)/l))/ll*(8/7)/(ll/(l/(l*(-19)l))) assuming l is positive. l(261/14) Simplify ((q/q(-7/3))/((qq/q(-1))/q))/(q(-2/9)q(-2/13)) assuming q is positive. q(200/117) Simplify (v*(-17)/(vv(-16/9)))(-27) assuming v is positive. v438 Simplify (p3p)(-4)(pp(8/7))45 assuming p is positive. p(563/7) Simplify (s/(s/s(4/15)))/ss*(-21)(s(1/6))(37/2) assuming s is positive. s*(-373/20) Simplify m/(m/(mm/(m/(mm(2/17))mm)mm))mm(m/((m/(m/m*(-33/5)m))/mmmm))/mm((m/(m(-37)/m))/m)/(mm/m*9m) assuming m is positive. m*(4651/85) Simplify ((zz*(-3)(((z/(zz(zz(-1/39))/z))/z)/zz)/zzz)(6/23))(-1/2) assuming z is positive. z(116/299) Simplify ((j10)(-2/21))25 assuming j is positive. j(-500/21) Simplify ((j/j(-2/9))/j)/((j*5/j)/j)((j/(jjjj(-5)jjj))/j)/(jj10) assuming j is positive. j(-133/9) Simplify u(5/7)/u(-2/3)u*(19/3)u/(u/u29) assuming u is positive. u(257/7) Simplify oo9o*(2/3)(o(-1/9))(1/3) assuming o is positive. o*(287/27) Simplify (kk*(-2/17)k(7/6))/(k(-2/5)k4) assuming k is positive. k(-791/510) Simplify (h/h(-24))(-10)(h/(hh/((h(h*11h)/h)/h)))/((hh(-13/3))/h) assuming h is positive. h(-707/3) Simplify ((v(1/31)v)/(vvvv(v(v13v)/vv)/v))/(vv(v/(vv*(-1/9)/vv))/v)(-29) assuming v is positive. v(4256/279) Simplify ((a/(a*(-25)a)a)/aaa(5/3))46 assuming a is positive. a(3818/3) Simplify ((y(-1/3))(-22)/(y(-5)(y*(-7/2)y)/yy))(-41) assuming y is positive. y(-3649/6) Simplify (d2d((dd/d*13)/d)/d)/((dd*20d)/(d/(dd/(d(1/16)d)dd))) assuming d is positive. d(-543/16) Simplify (x/x4xx)(-46)/(x3)(2/7) assuming x is positive. x(316/7) Simplify x*16/(xx*14/x)(xxx(-2))(-1/34) assuming x is positive. x2 Simplify (i(-6)i(2/11)(i*(-2/9)/i)/iii(1/3))(-3/7) assuming i is positive. i(664/231) Simplify pp/((pp/p14)/p)pp(-12)(pp(-6))(-36) assuming p is positive. p184 Simplify (((s/(s/(ss*(-9)s)))/s(-3/2))/(s(-2))(-3/10))(-23) assuming s is positive. s(1403/10) Simplify (z(-3/7))10/(z(1/11)/(zzz/z(4/5))) assuming z is positive. z(-838/385) Simplify (d(-2/43)/(((d19/d)/d)/d))/(d*16ddd(2/29)) assuming d is positive. d(-42542/1247) Simplify (k*(-10)(k/k*(-2/5))/kk*(-2/17)k(-5))(-12/11) assuming k is positive. k*(15012/935) Simplify ((w/(wwww/(w/w(-21))))43)(2/121) assuming w is positive. w(1634/121) Simplify ((gg(-3/5))/gg2/g)/(g/(g(-14)/gg)(g/(g/(g*(2/3)/gg)))/g) assuming g is positive. g(-214/15) Simplify (h/(h(-4)h)hhh/(h/(h/h*(6/13))h))/(((h/(h/(h/h(-4))))/h)/h8) assuming h is positive. h(124/13) Simplify s(-3/10)/ss9/ss(s(3/7))(5/6) assuming s is positive. s(282/35) Simplify (((s(1/3)/s)/s)/s9)(-7) assuming s is positive. s(224/3) Simplify ((r(-11)r)(-24))(-48) assuming r is positive. r*(-11520) Simplify (tt*(-2/35))/(tt*(-18/11))t*(2/57)/(ttt(-27)) assuming t is positive. t(584051/21945) Simplify ((ss(1/2))(-17/6))(2/73) assuming s is positive. s(-17/146) Simplify ((h*(12/11)/hh(2/19))/(h(2/17)/(h/(hh/h11))))(-2/9) assuming h is positive. h(-71618/31977) Simplify (((y/(yy*(-3)y))/y)(-21))(-44) assuming y is positive. y*924 Simplify hh/(h/h*(-29))hh(-18)h/h*(1/30)h34 assuming h is positive. h(-301/30) Simplify (x(-4))(1/8)(x(2/39))(1/23) assuming x is positive. x(-893/1794) Simplify (r(2/9))(1/26)/(r(-3/4)r/r12) assuming r is positive. r(5503/468) Simplify ((t0)34/(t(-7)/t(-7)))(-2/41) assuming t is positive. 1 Simplify (m(-3)m)/m(-3/5)m/(m/(m/m*(4/3)))m/(mm(7/4)) assuming m is positive. m(-209/60) Simplify (q(-2)/((q((q/q*(-11))/q)/q)/q))/((qq*7)/(qqq(3/17)/q)) assuming q is positive. q(-320/17) Simplify (z(-33)z/z40)/((z/(z29z))/z(-8/5)) assuming z is positive. z(-223/5) Simplify (l(lll*(-14)ll)/ll*(-7))/(ll/(l*(-1/8)l)l(-2/7)l) assuming l is positive. l*(-1055/56) Simplify ((mm*(-1)m)/m(-9/5))/((m/m(-24))/mm/(m/((mm*(-3/2))/mmm))) assuming m is positive. m(-217/10) Simplify (((h(9/8)/h)/h)/h(3/8))/(h18h)**44 ass	{ "pile_set_name": "DM Mathematics" }
y + 577502503602267 = 0. -13874467 Find p such that -2p4/5 - 9612p*3/5 + 212162p*2/5 - 1303092p/5 + 2259504/5 = 0. -4828, 3, 6, 13 Solve 5y4 + 306000y*3 + 4710435140y*2 + 875003598000y + 3424667012480 = 0. -30506, -184, -4 Factor -2b2 + 34660b - 1279682. -2(b - 17293)(b - 37) Solve 3c3 - 77247c*2 + 35658792c - 4152859308 = 0. 234, 25281 Factor 4g2 + 1272540608g + 101209974938063104. 4(g + 159067576)2 What is y in 2y*2/7 - 26878y/7 + 38150676/7 = 0? 1613, 11826 Solve 4a4 + 80712a*3 + 144906048a*2 = 0. -18186, -1992, 0 What is n in 45n*5 - 44245n*4 + 273755n*3 - 190095n*2 - 410440n + 97700 = 0? -1, 2/9, 2, 5, 977 Factor 2w2/9 - 145343116w/9 + 2640577671073682/9. 2(w - 36335779)2/9 What is a in 18a*5/19 + 6852a*4/19 + 755036a*3/19 + 18817624a*2/19 + 12294418a/19 + 2035172/19 = 0? -173, -34, -1/3 Factor -j*5/4 + 71j*4/4 + 22161j3/2. -j3(j - 249)(j + 178)/4 Determine l so that -4l3 - 43188l*2 - 10836144l - 10792960 = 0. -10540, -256, -1 Find u such that -2u3/5 + 18528u*2/5 - 8753682u + 790435660 = 0. 94, 4585 Solve p*3/2 - 1089p*2/2 + 8584p = 0 for p. 0, 16, 1073 Suppose -62u2 + 4254808u + 274504 = 0. What is u? -2/31, 68626 Solve 342t4/13 - 7858t*3/13 - 26176t*2/13 - 18392t/13 - 32 = 0. -2, -1, -4/171, 26 Factor -1483490450z3/3 + 11373390470z*2 + 835206z + 46/3. -2(z - 23)(27235z + 1)2/3 Factor q3/7 + 167q*2/7 - 129845q/7 - 18573. (q - 287)(q + 1)(q + 453)/7 Determine j so that 2j2 + 1338196j + 223846066802 = 0. -334549 What is d in -4d3 - 760844d*2 - 8368752d + 9129600 = 0? -190200, -12, 1 Factor -5f2 - 23021785f. -5f(f + 4604357) What is n in -3n4/5 + 651n*3/5 - 37284n*2/5 + 219156n/5 + 592704/5 = 0? -2, 9, 98, 112 Solve -v*3/4 + 26399v*2/4 - 41814520v - 23221449792 = 0. -513, 13456 Factor -2i3 + 11687702i*2 - 11687700i. -2i(i - 5843850)(i - 1) Factor -z2 + 111401809z + 111401810. -(z - 111401810)(z + 1) Factor 3l*2/2 + 139761l - 63478428. 3(l - 452)(l + 93626)/2 Let h*5/3 + 1193410h*4/3 + 356059243838h*3/3 + 1424223847868h*2/3 + 593424912619h + 237369646806 = 0. Calculate h. -596703, -2, -1 Factor -3p3/4 - 5997p*2 + 1085535p/4. -3p(p - 45)(p + 8041)/4 Determine d, given that 4d*2/5 - 17955d + 1143981/5 = 0. 51/4, 22431 Factor t*2/4 + 100503t/2 + 8736192. (t + 174)(t + 200832)/4 Factor -d2/4 + 9100d - 1345431/4. -(d - 36363)(d - 37)/4 Determine r, given that -2r*4/9 - 1288118r*3 + 57965344r*2/9 - 10304952r + 46372288/9 = 0. -5796536, 1, 2 Suppose -226w5 - 61483296w*4 - 5575529994416w*3 - 168538913352722540w*2 - 165550445201643246w + 2982892682567948 = 0. What is w? -90683, -1, 2/113 Determine v so that -3v4 + 7728873v*3 + 54102210v*2 + 123662268v + 92746728 = 0. -3, -2, 2576298 Determine i, given that 3i4 + 40077i*3 + 194111316i*2 + 397133631216i + 279682517096640 = 0. -3948, -1515 Factor -3m2 + 26763m - 13058262. -3(m - 8403)(m - 518) Factor c*3/4 + 6403c*2/2 + 4200462c. c(c + 1484)(c + 11322)/4 Determine b, given that 5b3 - 19990b*2 - 463855b + 5790240 = 0. -32, 9, 4021 Factor g*3 + 346g*2 - 8355g + 48708. (g - 12)(g - 11)(g + 369) Factor 5j3 - 12405j*2 + 82590j + 9896000. 5(j - 2474)(j - 32)(j + 25) Suppose -3o*5 + 798o*4 - 56376o*3 + 1068402o*2 + 12309339o - 288696240 = 0. Calculate o. -15, 16, 49, 167 Determine h, given that -2h5/15 - 68h*4/15 - 40h*3/3 + 1764h*2/5 + 3534h/5 - 4536 = 0. -27, -12, -5, 3, 7 Suppose 4g5 - 8540g*4 - 8580g*3 + 76860g*2 + 76896g = 0. What is g? -3, -1, 0, 3, 2136 Let -4z4/7 - 176z*3/7 + 140z*2 + 9504z/7 - 4608 = 0. What is z? -48, -7, 3, 8 Find c such that -40c5 - 2235c*4 + 65395c*3 - 292815c*2 - 728955c - 368550 = 0. -78, -1, -7/8, 9, 15 Let 2b5 - 205066b*4 - 23604798b*3 - 435404494b*2 - 2907132172b - 6619153632 = 0. What is b? -94, -7, 102648 Let s*2/6 + 10881782s/3 + 21763562/3 = 0. What is s? -21763562, -2 Factor 2i3/23 + 114510i*2/23 - 184431906i/23 + 73249555986/23. 2(i - 789)2(i + 58833)/23 Let 4u4 - 550076u*3 + 12100296u*2 - 76999120u + 109997600 = 0. Calculate u. 2, 10, 137497 Factor 4t4 - 143328016t*3 + 1711910061984024t*2 - 6815686305355693984016t + 6815684593445775328004. 4(t - 11944001)3(t - 1) Find f, given that f*4/2 - 152f*3 + 10387f*2/2 - 37368f + 69426 = 0. 3, 6, 29, 266 Let -2c2/3 - 3154628c - 3731879181894 = 0. What is c? -2365971 Factor 4t3/5 - 304128t*2/5 + 1173372816t - 651417807040. 4(t - 37730)2(t - 572)/5 Find t such that -2t2/15 - 29868280t/3 - 557571343849000/3 = 0. -37335350 Factor f*4 + 3888f*3 + 5518920f*2 + 3350585600f + 718562706000. (f + 498)(f + 1130)3 Find k, given that -7k*5/2 + 1327k*4/2 - 3622k*3 + 6274k*2 - 3312k = 0. 0, 1, 2, 18/7, 184 Suppose 5h2 + 142442h + 56976 = 0. Calculate h. -28488, -2/5 Find z, given that z*4/4 + 193z*3/4 - 1641z*2 - 581463z - 12854700 = 0. -138, -25, 108 Determine y, given that -2y2/9 - 400y/9 + 300694/3 = 0. -779, 579 What is h in 3h4 - 15h*3 - 6144h*2 - 96876h = 0? -26, -23, 0, 54 Determine g, given that 2g5/3 + 850g*4/9 + 7486g*3/3 - 97554g*2 - 2835600g - 17460000 = 0. -75, -12, 97/3 Find y such that y*4 + 4540y*3 - 54275898y*2 - 134903371460y + 882945507931201 = 0. -6703, 4433 Suppose -9r4/8 - 11445r*3/8 + 65793r*2 + 414753r/2 + 140154 = 0. Calculate r. -1316, -2, -1, 142/3 Let 3q5 + 675q*4 - 22563q*3 + 98385q*2 - 76500q = 0. What is q? -255, 0, 1, 4, 25 Determine j, given that -2j5 + 12522j*4 - 18307046j*3 + 18282006j*2 + 18307048j - 18294528 = 0. -1, 1, 2324, 3936 Suppose 34d3/7 - 5316d*2/7 + 17294d/7 + 22644/7 = 0. What is d? -1, 74/17, 153 Determine m, given that 20m3 + 17795m*2 + 343125m - 456750 = 0. -870, -21, 5/4 Suppose -7i5 + 422i*4 - 853i*3 - 4458i*2 + 6264i = 0. What is i? -3, 0, 9/7, 4, 58 Let c*2 - 351119c - 5969312 = 0. What is c? -17, 351136 Factor 3u2 + 1579711632u + 207957403356341952. 3(u + 263285272)2 Let -2m*3/9 + 496m*2/9 + 2201386m/9 - 733960/3 = 0. What is m? -933, 1, 1180 Factor -1121965c3 - 4487805c*2 - 4487640c + 220. -5(c + 2)2(224393c - 11) Suppose 2a*2/5 - 112502a - 10688412/5 = 0. What is a? -19, 281274 Factor -4b3 - 30588b*2 + 59611140b - 26120014596. -4(b - 837)2(b + 9321) Solve -3q4 + 1917q*3 - 185082q*2 + 4897152q - 4713984 = 0 for q. 1, 48, 62, 528 Factor 6f4/5 + 40128f*3/5 + 53248638f*2/5 + 19992087516f/5. 6f(f + 811)*2(f + 5066)/5 Factor 3p2 + 53167470p + 235564988850075. 3(p + 8861245)2 Let 6d*5 - 711590d*4 + 21253442698d*3 - 9180287356554d*2 + 12209684779040d - 3050650153600 = 0. What is d? 1/3, 1, 437, 59080 Find s such that -4s2 - 54631472s - 186537358305424 = 0. -6828934 Factor 5a2/4 - 142225585a/2 + 4045623405718445/4. 5(a - 28445117)2/4 Factor -w2/5 + 9781w/5 - 4485962. -(w - 6110)(w - 3671)/5 Let -a5/6 + 1991a*4/3 - 375971a*3/2 - 573914a*2/3 + 2255834a/3 + 754600 = 0. What is a? -2, -1, 2, 308, 3675 Suppose -2b4/21 + 42b*3 + 102220b*2/21 - 19261248b/7 - 16567040/3 = 0. Calculate b. -245, -2, 344 Suppose 4x5/13 - 2858x*4/13 + 558598x*3/13 - 16728294x*2/13 - 8504154x/13 = 0. Calculate x. -1/2, 0, 37, 339 Find m, given that 35m3 + 500253m*2 - 1529666m + 85776 = 0. -14296, 2/35, 3 Factor -2s3 - 5642s*2 + 40025650s + 124029883194. -2(s - 4557)(s + 3689)*2 Determine v so that 50v*3 - 71085v*2 - 1025510v - 1766280 = 0. -123/10, -2, 1436 Solve -3i3 + 297168i*2 - 19599819i - 19896990 = 0 for i. -1, 67, 98990 Factor -2i2 + 386400i + 386402. -2(i - 193201)(i + 1) What is w in w*4/5 - 5156w*3/5 + 7415326w*2/5 - 1983105876w/5 + 147933313641/5 = 0? 159, 2419 Solve 2a3/15 - 1292a*2/15 + 80726a/15 + 35420 = 0 for a. -6, 77, 575 Find p, given that 3p5/7 - 366p*4/7 + 852p*3 - 37146p*2/7 + 100161p/7 - 14040 = 0. 3, 5, 7, 104 Let v*4/2 - 4893v*3/2 + 6849897v*2/2 - 2032935055v/2 + 1013045025 = 0. Calculate v. 1, 402, 2245 Solve -2r3/15 - 5072r*2/15 + 3386r/5 +	{ "pile_set_name": "DM Mathematics" }
s4 - s4. -2s4 Expand -5i*5 + 678i*3 - 678i3 - i5 - 3i5 + 5i*5 + (2 - 2 - 2i*4)(-i - i + i) + 4i5 + i5 - 4i5. -i5 Expand (4 + 0 - 2)(0d + 0d - 3d)(2 - 2 + 4). -24d Expand (15d + 13d + 5d)(0 - 1 + 2) + 2d - 5d - 1 + 2d. 32d - 1 Expand (7j3 - 29j*3 - 36j*3)(j + 0j + j). -116j*4 Expand -2l*3 + 2l*2 - 2l2 + (1 - 1 + l2)(-20l + 4 - 4). -22l3 Expand -5d2 + d2 + d*2 + 0d2 + d2 - 2d2 + 1 - 1 + 2d*2 + (2d + 2 - 2)(-1 - 2d + 1) + d2 + d2 - 3d2 + (4d - 3d - 2d)(2d + 2 - 2). -9d2 Expand -1 + 3q*5 + 8q*5 - 3q*5 + (7q*3 - 3q*3 - 2q*3)(0q2 + q2 + 3q*2). 16q*5 - 1 Expand (6h*3 - 4h*3 - 4h*3)(56 + 92 - 190). 84h3 Expand (0v - v + 0v + 1)(-8v3 + 6v*3 - 2v4 - v3). 2v5 + v4 - 3v*3 Expand (5p*3 - 5p3 - p3)(1 - 3 + 0)(0 + 0 - 3). -6p3 Expand (10 + 23 - 14 + 3 + 0 - 5 + (-2 - 1 + 2)(2 - 4 + 0))(-k2 + 4k*2 - 5k*2). -38k*2 Expand -2c*4 - 45c*2 - 5c + 45c2 + c4 - 2c + 2c + (c3 + 0c*3 - 3c*3)(-2 + 2 + c). -3c4 - 5c Expand -m*2 + 0m2 - m2 + (2 - 1 - 3)(-m2 - m2 + 3m*2) + 3m - 3m - 2m*2 + 5m - m + 12m2 - 11m*2. -5m*2 + 4m Expand (-2g3 + 3g3 + g3)(-380g - 2g2 + 380g). -4g5 Expand (-2 + 5 - 4)(186 + q*2 + 2q*4 + 183 - 367). -2q4 - q2 - 2 Expand (n - 2 + 2)(n - 2n - 3 - 2n). -3n*2 - 3n Expand (p + 2 - 3p + p)(-1 + 1 + 9). -9p + 18 Expand (-4 - 2c + 2c - 2c3 + (c2 + 0c2 + 2c*2)(2c - 2c + 2c))(3 + 2 + 0). 20c3 - 20 Expand 2o*2 - 22o + 22o + (-2o + 0o + 0o)(2o + 2 + 4 - 4). -2o2 - 4o Expand (2 + 5 + 7u - 5u)(-2u4 + u4 + 4u4). 6u*5 + 21u*4 Expand (2c - 2 + 2)((-1 + 4 + 0)(-3 + 6 - 2) + 2 + 0 - 4)(2 - 7 + 2). -6c Expand (1 - 10 + 0)(1 - 1 - 3 - d). 9d + 27 Expand (-3o2 + o2 + 3o*2)(16o3 + 31o*3 - 11o3) - o2 - o5 + o2. 35o5 Expand (4 - 2 + 0)(2f - f + f) - 3f + 0f + 2f + 2 - 2f + 2f - f. 2f + 2 Expand (-2 - 1 + 5)(4f2 - 4f*2 - 55f*3). -110f*3 Expand (2 - 1 - 10)(0 - 1 - 1)(2m - 3m2 - 2m). -54m2 Expand (3 + 3 - 4z + 6z)(1 - 4z - 1) + 2z - 2z + z2. -7z*2 - 24z Expand (2 - 3f3 + f3 + 4f*3)(-1 - 16f - 8f + f). -46f4 - 2f*3 - 46f - 2 Expand -g5 + g2 - g*2 + (2g*4 - 7g*4 + 3g*4)(2g + 3g - 7g + (-5 + 5 + 2g)(-1 + 0 - 1) + g + 0g - 2g + 0 + 0 + 4g - 2 - 2g + 2). 9g*5 Expand (7 - 3 - 16)(2 - 6 + 1)(-q4 - 2q*4 + 0q*4) - 3q*2 + 3q*2 + 2q*4 + (2 + 2 - 2)(2q4 - 2q*4 + 2q*4). -102q*4 Expand 2u*2 + 4 - 4 - 2u + u*2 + 2u + (-2u + 2u - 2u)(-u + 3 - 3) - 13 + 13 + 10u2. 15u*2 Expand (-520m + 9m3 - 2 + 520m)(-1 + 0 + 3). 18m*3 - 4 Expand (0q*2 + 4q*2 - 3q*2 + 3q - 3q - q2 + (q - 2q - q)(-1 + 2q + 1))(-6 - 1 - 4). 44q*2 Expand (0a - 2a + a)(2a + 3a - 3a)(-7 + 7 + 2a). -4a*3 Expand (-2 + 0 + 4)((-4d - 4d + 2d)(-4 - 1 + 4) + 4d - 4d - 2d)(-3d2 + 2d - 2d)(0 + 0 - d). 24d4 Expand (0 - 2d + 0 + (2 - 4 + 4)(-5 - 2d + 5))(5 + 2 + 2). -54d Expand 3p2 - 3p*2 + 4p*4 + (2p + 2p2 - 2p)(14p + 2p2 - 14p). 8p4 Expand (1 - 3l*2 - 1)(3l + l + 0l)(-l - l + 4l). -24l4 Expand (0 + 4 - 3)(-3 - 2 - 1)(-2k*3 + 2k*3 + 2k*3 - 2k). -12k3 + 12k Expand (-2q3 + 0q + 0q - 5q*2 + 5q*2 + 2q*3 + (-2q + 2q + 2q)(7q*2 - 3q*2 - 3q*2))(-28q + 6q*2 + 28q). 12q5 Expand (-3k*2 + k + 2k*2 + 2k*2)(k + 2k2 - k) - 5k*4 - 2k4 - k4. -6k4 + 2k*3 Expand (-2q*3 + 0q3 + q3)(-90 + 110 + 2q - 3q). q4 - 20q*3 Expand (0 + 4 - 2)(1 + o - 1)(9o*2 - 2o + 2o)(-1 + 1 + 2). 36o3 Expand (-s3 + s3 + 2s*3)(5s2 - 2s*2 - 4s*2) + (3s*3 + 0s*3 + 0s*3)(s2 + s2 - s2). s5 Expand (-3 + 5 + 6)(2x*2 + 0x*2 + 4x*2). 48x*2 Expand 2h*4 + 2h*3 - 2h*3 + (-3 + 2 + 2)(-2h4 + 0h*4 + 3h*4) - 2 + 3h*4 + 2. 6h*4 Expand (1 - 3 - 3)(-h*3 + 2h5 + h3) - 2h2 - h5 + 2h*2. -11h*5 Expand (-1 + 2p + 1)(3 - 3 + 1)(3p4 + 0p*4 - 5p*4). -4p*5 Expand (-7 + 5 - 5)(-4x + 0x + x). 21x Expand 3h*2 - 2h2 + h2 + (-149h + 382h - 163h)(-h - h + 3h). 72h*2 Expand (0 + 1 + 1)(5a - 3a - 4 + 5). 4a + 2 Expand (-l - 3l + 5l + l2)(-3l - 5l + 6l) + (1 - 1 + 4l*3)(-4 - 1 + 3). -10l3 - 2l*2 Expand (2n*3 + 2n*3 - 5n*3)(0n - 6n + 5n) + n - n + 375n*4 - 480n*4. -104n*4 Expand (-1 + 2 + 0)(d + 4 - 4)(10d*2 - 35 - 5 - 12d*2). -2d*3 - 40d Expand -4z4 - 3z*4 + 5z4 + (z2 + 1 - 1)(2z*2 - 4z*2 + 3z2) - z + z - z4 - 28z2 + 28z*2 + 19z*4. 17z*4 Expand (-3 + 0 + 2)(2b + 3b - 3b + (-4 + 4 + 2b)(1 + 0 + 0)). -4b Expand (3 - 3 - 2m)(0 + 0 + 2m) - 2m*2 - m + 2m*2 + 2m*2. -2m*2 - m Expand -4f + 4f + f2 + (6f + 11f + 44f)(2f + 1 - 1). 123f2 Expand (0z - z + 0z)(-2z - 1 + 1) + (-z - 1 + 1)(3z + 0z + 0z) - z2 + 5z*2 - 2z2. z2 Expand (-p*4 + 3p4 - p4)(-3 + 3 + 2p + (4 + 1 - 2)(1 - 1 + p)). 5p*5 Expand (4 + 6 - 3v*2 + 2v*2)(0v + 3v - 2 + 0v). -3v*3 + 2v*2 + 30v - 20 Expand (2p3 + 5p*2 - 5p*2)(-6p + 2p + 2p). -4p4 Expand -x5 + 1 - 1 + (-x3 + x3 - 2x3)(-2x2 + 2x2 + x2) - 6x5 + 5x5 - x5. -5x5 Expand -u4 - u4 + u4 + 3u*4 + 3u*4 - 4u*4 + (0u*2 - 5u*2 + 3u*2)(3 - 2u2 - 3) - 25 + 25 - 53u*3 + 2u*4. 7u*4 - 53u*3 Expand (2q*3 - 15q*4 + 9q*4 - 4q*3)(9 - 9 - 4q + (1 - 3 + 0)(-q - q + q)). 12q5 + 4q*4 Expand (0i - i - 3i)(-3 - i + 3) + 2i + 0i2 - 4 - i2 + 6. 3i2 + 2i + 2 Expand (-2f + 4f - 5f)(-7 + 7 + 17). -51f Expand -3s*3 - 2s*2 + 2s*2 + (4s + 0s - 3s)(5s - 5s - s)(-s - s + 3s). -4s*3 Expand (2y*2 - 2y*2 + 2y*2)(-1 + 1 + 3y) - 4y*3 + 2y*3 + 0y*3. 4y*3 Expand (-2s3 + s3 + 0s3)(-17 + 4 - 17). 30s3 Expand -15p + 1 + 33p + 25p + (-2 + 3 - 3)(-3p + 6p - 2p) + 2p - 2p + p - 3p + 3p - p. 41p + 1 Expand p5 + 2p - 2p + (-1 + 1 - 2p*4)(-2p + 6p - 2p) + (2p*5 + 2p*3 - 2p*3)(3 - 2 + 1). p*5 Expand (-3n*3 + 5n*3 - 4n*3)(0n + 9n + 10n). -38n*4 Expand (0v + 0v - v)(-939 - 16v + 939). 16v*2 Expand (2 + 0 + 0 + 2s*3)(-1 + 0 + 0). -2s3 - 2 Expand (3z*2 + 2z*2 - 4z*2)(-8z + z - z)(5 - 3 + 0 + 2z). -16z*4 - 16z*3 Expand (0b*2 - 3b*3 + 0b*2 + 0b*3 + 4b*3 - 2b3 + (b2 - b*2 - 2b*3)(0 + 5 - 3))(-2b*2 + 0b*2 + 0b*2). 10b*5 Expand (3 - 2 + 1)(26 + 19w - 26). 38w Expand (-3r2 + r - r)(3r2 + 2 - 2 - 1). -9r*4 + 3r*2 Expand (-9v*2 + 142 - 142)(1 - 1 - 2) - 5v + 2v*2 + 5v. 20v2 Expand 0m5 + m5 - 2m5 + (1 + 2 - 1)(-3m5 + 4m*5 - 3m*5) - 17m*5 - 11m5 - m5. -34m5 Expand 30 - 2i - 30 + 17i2 + 2i*2 - 1 + 1 + (0 + 1 - 3)(4i2 - 2i*2 - 4i*2) - 2i*2 - 2i*2 + 3i*2. 22i*2 - 2i Expand (4l2 - 1 - 4l*2 + 2l*2)(457 - 8l - 457). -16l*3 + 8l Expand 5d + 2d*3 - 5d + (-2d3 + 3 - 3)(-2 + 1 + 0) - d*3 + 19d*2 - 19d2 + d3 - 2d3 - d3. d3 Expand 75z*3 - 38z*3 + 108z*3 + (0 + 0 - 2z*2)(3 - 3 - z) + 2z3 + 2z*3 - 5z*3 - 4 + 4 - 2z*3 + 1 - 1 - 2z*3. 142z*3 Expand (2 + 1 - 5)(-1 + 1 - 2b)(-b + 4b + 0b). 12b2 Expand (4k - 4k + 2k)(2 - 2 - 2k) - 3 + 3 + k*2 + (k - k - 2k)(4k - k - 5k) - 6k*2 + 3k*2 + 0k*2. -2k2 Expand u2 - u*2 - 4u*2 + 0 + 2u*2 + 0 + (2u + 0 + 0)(0u + 2u - u) + 4u2 + u2 - 2u2. 3u*2 Expand (2y - 2y - 4y)(-2y*4 + 7y*4 + 4y*4). -36y*5 Expand (-3 + 2k + 3)(11k + 6k - k). 32k*2 Expand (-3 - 1 + 3)(w*4 + 0w*2 + 0w2) + (w3 - 2w3 + 2w*3)(0w - w + 0w) + 37 - 24w4 - 37. -26w*4 Expand -4g*3 - 4g*3 + 3g*3 + (g - 3g + 3g)(2g2 + 3g2 + g2). g*3 Expand (-4 + 0 + 3)(-7 + 7 - 2g). 2g Expand (4q + 0q - 2q)(-3q3 + 6q*3 + 3q*3) - q + q + 2q*4 + (4q - 3q - 2q)(2q*3 - 2q3 + q3). 13q4 Expand (-2 + 5 - 1)(3 - 2 - 2)(-6c*3 + 7c*3 + 3	{ "pile_set_name": "DM Mathematics" }
minutes after 11:58 AM? 2:36 PM What is 277 minutes before 7:26 PM? 2:49 PM What is 142 minutes after 3:06 AM? 5:28 AM What is 35 minutes after 7:04 PM? 7:39 PM How many minutes are there between 2:07 PM and 12:38 AM? 631 What is 610 minutes before 5:34 AM? 7:24 PM What is 367 minutes after 10:11 AM? 4:18 PM What is 117 minutes after 3:27 AM? 5:24 AM How many minutes are there between 8:54 PM and 8:04 AM? 670 What is 36 minutes after 12:07 AM? 12:43 AM What is 142 minutes before 11:47 AM? 9:25 AM How many minutes are there between 8:03 AM and 5:41 PM? 578 What is 443 minutes after 5:39 PM? 1:02 AM What is 539 minutes before 11:35 AM? 2:36 AM How many minutes are there between 9:43 AM and 2:29 PM? 286 How many minutes are there between 9:33 AM and 1:30 PM? 237 What is 667 minutes after 8:23 AM? 7:30 PM What is 9 minutes before 9:02 PM? 8:53 PM How many minutes are there between 4:49 AM and 10:55 AM? 366 How many minutes are there between 9:50 AM and 10:09 AM? 19 How many minutes are there between 10:32 PM and 8:28 AM? 596 How many minutes are there between 3:31 AM and 4:34 AM? 63 What is 142 minutes after 6:08 PM? 8:30 PM How many minutes are there between 10:24 AM and 10:18 PM? 714 What is 36 minutes before 9:09 PM? 8:33 PM How many minutes are there between 10:54 PM and 9:51 AM? 657 What is 456 minutes before 8:04 AM? 12:28 AM What is 676 minutes before 5:29 AM? 6:13 PM How many minutes are there between 12:08 AM and 6:21 AM? 373 How many minutes are there between 7:28 AM and 8:04 AM? 36 What is 211 minutes after 12:07 PM? 3:38 PM What is 115 minutes before 5:06 PM? 3:11 PM What is 703 minutes before 7:26 PM? 7:43 AM What is 705 minutes after 5:43 PM? 5:28 AM How many minutes are there between 3:30 PM and 3:29 AM? 719 How many minutes are there between 6:45 PM and 9:32 PM? 167 What is 641 minutes before 10:54 PM? 12:13 PM How many minutes are there between 4:21 AM and 2:52 PM? 631 How many minutes are there between 9:00 AM and 10:57 AM? 117 How many minutes are there between 11:43 PM and 12:37 AM? 54 What is 315 minutes after 5:44 AM? 10:59 AM How many minutes are there between 2:48 AM and 6:57 AM? 249 What is 231 minutes after 1:18 AM? 5:09 AM What is 714 minutes after 8:22 AM? 8:16 PM What is 446 minutes before 8:01 PM? 12:35 PM What is 264 minutes before 8:40 AM? 4:16 AM How many minutes are there between 1:51 PM and 7:06 PM? 315 How many minutes are there between 10:14 AM and 8:09 PM? 595 What is 657 minutes before 3:34 PM? 4:37 AM What is 345 minutes after 6:10 AM? 11:55 AM How many minutes are there between 1:55 AM and 11:15 AM? 560 How many minutes are there between 8:05 AM and 8:30 AM? 25 What is 586 minutes after 11:58 PM? 9:44 AM How many minutes are there between 10:21 PM and 3:24 AM? 303 What is 277 minutes after 8:11 AM? 12:48 PM What is 88 minutes before 3:52 PM? 2:24 PM How many minutes are there between 12:24 PM and 2:49 PM? 145 What is 616 minutes after 8:16 PM? 6:32 AM What is 292 minutes after 10:08 AM? 3:00 PM What is 123 minutes after 8:30 PM? 10:33 PM What is 88 minutes after 12:49 AM? 2:17 AM How many minutes are there between 1:07 PM and 11:04 PM? 597 What is 514 minutes after 5:12 PM? 1:46 AM How many minutes are there between 12:52 AM and 3:04 AM? 132 How many minutes are there between 5:25 PM and 7:37 PM? 132 How many minutes are there between 6:37 AM and 8:05 AM? 88 How many minutes are there between 8:43 AM and 4:51 PM? 488 How many minutes are there between 12:23 PM and 10:48 PM? 625 How many minutes are there between 7:03 AM and 11:27 AM? 264 What is 374 minutes after 5:15 AM? 11:29 AM What is 323 minutes before 3:25 PM? 10:02 AM How many minutes are there between 10:46 PM and 12:14 AM? 88 How many minutes are there between 4:34 PM and 9:34 PM? 300 How many minutes are there between 3:20 PM and 7:20 PM? 240 How many minutes are there between 8:25 AM and 9:55 AM? 90 What is 710 minutes before 9:22 AM? 9:32 PM How many minutes are there between 4:28 AM and 1:20 PM? 532 What is 170 minutes before 3:52 PM? 1:02 PM What is 323 minutes after 7:30 PM? 12:53 AM How many minutes are there between 3:58 PM and 3:20 AM? 682 What is 625 minutes after 2:14 PM? 12:39 AM What is 328 minutes after 8:59 AM? 2:27 PM What is 628 minutes after 1:01 AM? 11:29 AM How many minutes are there between 1:23 PM and 12:40 AM? 677 What is 128 minutes after 10:20 AM? 12:28 PM How many minutes are there between 3:25 PM and 5:28 PM? 123 How many minutes are there between 2:43 PM and 1:38 AM? 655 How many minutes are there between 7:46 PM and 8:42 PM? 56 What is 367 minutes after 1:57 PM? 8:04 PM What is 203 minutes after 7:01 PM? 10:24 PM What is 324 minutes before 8:35 AM? 3:11 AM How many minutes are there between 12:21 PM and 6:05 PM? 344 How many minutes are there between 4:31 PM and 8:34 PM? 243 What is 408 minutes after 4:47 PM? 11:35 PM What is 266 minutes before 11:22 AM? 6:56 AM How many minutes are there between 3:44 AM and 10:18 AM? 394 What is 204 minutes before 7:38 PM? 4:14 PM How many minutes are there between 4:07 AM and 1:37 PM? 570 What is 101 minutes before 3:38 PM? 1:57 PM How many minutes are there between 11:41 AM and 11:25 PM? 704 What is 60 minutes before 5:42 AM? 4:42 AM How many minutes are there between 2:38 PM and 2:33 AM? 715 How many minutes are there between 11:45 PM and 11:57 PM? 12 How many minutes are there between 2:31 PM and 3:23 PM? 52 How many minutes are there between 9:41 PM and 1:18 AM? 217 What is 197 minutes after 10:49 PM? 2:06 AM What is 298 minutes before 1:02 AM? 8:04 PM What is 503 minutes after 2:47 PM? 11:10 PM How many minutes are there between 11:37 PM and 7:39 AM? 482 What is 184 minutes before 9:50 AM? 6:46 AM How many minutes are there between 3:55 PM and 6:34 PM? 159 What is 328 minutes before 4:22 PM? 10:54 AM How many minutes are there between 12:04 PM and 2:56 PM? 172 How many minutes are there between 7:31 PM and 2:17 AM? 406 What is 155 minutes after 4:03 PM? 6:38 PM How many minutes are there between 5:04 PM and 5:57 PM? 53 How many minutes are there between 1:03 AM and 7:10 AM? 367 What is 217 minutes before 11:43 PM? 8:06 PM What is 136 minutes after 6:34 AM? 8:50 AM What is 502 minutes after 8:06 AM? 4:28 PM What is 345 minutes after 6:15 AM? 12:00 PM What is 688 minutes before 1:49 PM? 2:21 AM How many minutes are there between 8:21 PM and 7:51 AM? 690 How many minutes are there between 5:38 AM and 5:50 AM? 12 How many minutes are there between 12:28 PM and 11:32 PM? 664 How many minutes are there between 7:39 AM and 4:56 PM? 557 What is 719 minutes after 9:42 AM? 9:41 PM What is 252 minutes before 3:50 PM? 11:38 AM What is 342 minutes before 10:14 PM? 4:32 PM How many minutes are there between 6:40 AM and 4:58 PM? 618 How many minutes are there between 10:50 PM and 5:53 AM? 423 What is 446 minutes before 5:15 AM? 9:49 PM What is 197 minutes before 7:13 AM? 3:56 AM How many minutes are there between 7:50 PM and 6:54 AM? 664 How many minutes are there between 2:57 AM and 6:21 AM? 204 What is 372 minutes after 8:36 PM? 2:48 AM How many minutes are there between 10:22 AM and 7:55 PM? 573 How many minutes are there between 4:29 PM and 9:31 PM? 302 How many minutes are there between 2:32 AM and 2:27 PM? 715 How many minutes are there between 12:27 PM and 8:04 PM? 457 What is 549 minutes before 5:12 PM? 8:03 AM How many minutes are there between 11:50 AM and 7:32 PM? 462 What is 454 minutes after 6:48 PM? 2:22 AM How many minutes are there between 6:09 PM and 11:00 PM? 291 What is 401 minutes before 8:36 AM? 1:55 AM What is 420 minutes after 2:44 AM? 9:44 AM What is 165 minutes before 11:26 AM? 8:41 AM What is 166 minutes after 2:05 PM? 4:51 PM What is 372 minutes before 8:00 PM? 1:48 PM What is 678 minutes after 1:49 PM? 1:07 AM What is 305 minutes after 9:45 AM? 2:50 PM What is 217 minutes before 1:11 AM? 9:34 PM What is 596 minutes before 12:51 AM? 2:55 PM What is 687 minutes after 7:45 AM? 7:12 PM How many minutes are there between 6:19 AM and 1:52 PM? 453 How many minutes are there between 6:31 AM and 5:41 PM? 670 How many minutes are there between 10:24 AM and 6:34 PM? 490 What is 237 minutes before 2:04 AM? 10:07 PM How many minutes are there between 8:06 AM and 5:38 PM? 572	{ "pile_set_name": "DM Mathematics" }
-346, -305, -234, -127, 22, 219, 470, 781? s*3 + 9s*2 + 7s - 363 What is the m'th term of 351, 1358, 3019, 5334, 8303, 11926? 327m2 + 26m - 2 What is the u'th term of -8359, -16717, -25075? -8358u - 1 What is the c'th term of -333, -1437, -3283, -5871, -9201, -13273? -371c*2 + 9c + 29 What is the c'th term of -125, -158, -267, -494, -881, -1470, -2303, -3422? -7c3 + 4c*2 + 4c - 126 What is the v'th term of 25886, 51758, 77630, 103502? 25872v + 14 What is the y'th term of -920949, -920948, -920949, -920952, -920957? -y2 + 4y - 920952 What is the g'th term of 240, 684, 1338, 2196, 3252, 4500, 5934, 7548? -g*3 + 111g*2 + 118g + 12 What is the g'th term of -816, -1595, -2358, -3099, -3812, -4491, -5130, -5723? g*3 + 2g*2 - 792g - 27 What is the r'th term of -5261, -10410, -15547, -20666, -25761, -30826, -35855, -40842? r*3 - 5156r - 106 What is the z'th term of 1460, 1448, 1432, 1412, 1388? -2z2 - 6z + 1468 What is the n'th term of 26445, 26502, 26597, 26730? 19n2 + 26426 What is the b'th term of 167, 334, 501, 668? 167b What is the v'th term of 12173, 12170, 12167? -3v + 12176 What is the u'th term of -19016, -19030, -19050, -19076, -19108, -19146, -19190? -3u*2 - 5u - 19008 What is the j'th term of 520, 542, 568, 598? 2j2 + 16j + 502 What is the y'th term of 80413, 160828, 241233, 321622, 401989? -y3 + y2 + 80419y - 6 What is the r'th term of 310, 638, 984, 1360, 1778, 2250, 2788, 3404? 2r*3 - 3r*2 + 323r - 12 What is the s'th term of -2586, -10403, -23428, -41655, -65078, -93691, -127488, -166463? s*3 - 2610s*2 + 6s + 17 What is the n'th term of -776, -800, -824? -24n - 752 What is the m'th term of 132, -31, -178, -309, -424? 8m*2 - 187m + 311 What is the y'th term of -322, -1174, -2600, -4606, -7198? -y*3 - 281y*2 - 2y - 38 What is the m'th term of -14205, -113597, -383375, -908733, -1774865, -3066965, -4870227, -7269845? -14199m3 + m2 - 2m - 5 What is the c'th term of -198, -796, -1788, -3168, -4930, -7068, -9576, -12448? c*3 - 203c*2 + 4c What is the x'th term of 272, 507, 724, 923, 1104, 1267? -9x2 + 262x + 19 What is the k'th term of -97, -148, -203, -262? -2k2 - 45k - 50 What is the h'th term of -25418, -25320, -25234, -25166, -25122, -25108? -h*3 + 105h - 25522 What is the z'th term of -637239, -637247, -637259, -637275, -637295, -637319, -637347? -2z2 - 2z - 637235 What is the n'th term of 251676, 1006726, 2265144, 4026930? 251684n2 - 2n - 6 What is the b'th term of -313, -533, -739, -925, -1085, -1213, -1303, -1349? b3 + b2 - 230b - 85 What is the f'th term of 10704, 10708, 10700, 10674, 10624, 10544? -f3 + 11f + 10694 What is the x'th term of 641, 598, 471, 218, -203? -7x3 + 6x + 642 What is the i'th term of -36119, -36118, -36117? i - 36120 What is the y'th term of -1310, -1311, -1282, -1199, -1038, -775, -386, 153? 4y3 - 9y*2 - 2y - 1303 What is the x'th term of 5037850, 5037851, 5037852, 5037853? x + 5037849 What is the l'th term of 7840, 7827, 7812, 7795, 7776, 7755, 7732? -l*2 - 10l + 7851 What is the z'th term of -971, -2098, -3227, -4358? -z*2 - 1124z + 154 What is the y'th term of 551, 1466, 2749, 4400, 6419, 8806? 184y2 + 363y + 4 What is the a'th term of 97, -203, -1025, -2633, -5291? -44a3 + 3a*2 - a + 139 What is the t'th term of -813, 127, 1067, 2007, 2947, 3887? 940t - 1753 What is the h'th term of -239405, -478815, -718225, -957635, -1197045, -1436455? -239410h + 5 What is the t'th term of -968, -4268, -9766, -17462, -27356, -39448? -1099t*2 - 3t + 134 What is the w'th term of -897, -1790, -2683? -893w - 4 What is the y'th term of -1952663, -1952664, -1952665, -1952666, -1952667, -1952668? -y - 1952662 What is the g'th term of 9325, 18655, 27985, 37315, 46645? 9330g - 5 What is the x'th term of 887960, 887954, 887948, 887942, 887936, 887930? -6x + 887966 What is the v'th term of 382, 372, 354, 328, 294, 252, 202? -4v*2 + 2v + 384 What is the o'th term of 10268, 10273, 10278? 5o + 10263 What is the n'th term of 334122, 668241, 1002360, 1336479, 1670598, 2004717? 334119n + 3 What is the q'th term of 380, 1289, 2730, 4703, 7208? 266q2 + 111q + 3 What is the p'th term of -229, -552, -969, -1480? -47p2 - 182p What is the y'th term of 164, 175, 178, 173, 160, 139? -4y2 + 23y + 145 What is the t'th term of 71632, 143266, 214898, 286528, 358156, 429782, 501406? -t*2 + 71637t - 4 What is the n'th term of 110, 136, 186, 272, 406, 600, 866? 2n3 + 12n + 96 What is the o'th term of -72, -174, -320, -534, -840? -4o3 + 2o*2 - 80o + 10 What is the z'th term of 2218, 4411, 6586, 8743, 10882, 13003? -9z2 + 2220z + 7 What is the a'th term of 877, 862, 887, 970, 1129, 1382, 1747? 3a3 + 2a*2 - 42a + 914 What is the p'th term of 194, 205, 206, 191, 154, 89, -10, -149? -p3 + p2 + 15p + 179 What is the s'th term of 586, 1222, 1858? 636s - 50 What is the o'th term of -947, -2592, -4257, -5948, -7671, -9432, -11237, -13092? -o*3 - 4o*2 - 1626o + 684 What is the f'th term of 67, 143, 271, 451? 26f2 - 2f + 43 What is the y'th term of -1414469, -1414471, -1414473, -1414475, -1414477, -1414479? -2y - 1414467 What is the f'th term of -86, -32, 20, 70? -f2 + 57f - 142 What is the d'th term of -289, -718, -1149, -1582, -2017, -2454? -d*2 - 426d + 138 What is the i'th term of 478, 1367, 2846, 4915, 7574, 10823? 295i2 + 4i + 179 What is the w'th term of -464102, -464113, -464138, -464183, -464254, -464357? -w3 - w2 - w - 464099 What is the n'th term of -3215, -3064, -2915, -2768? -n*2 + 154n - 3368 What is the z'th term of 140500, 280997, 421494, 561991, 702488, 842985? 140497z + 3 What is the q'th term of -116, -96, -68, -26, 36, 124? q3 - 2q*2 + 19q - 134 What is the a'th term of -1526, -1512, -1484, -1436, -1362, -1256, -1112? a3 + a2 + 4a - 1532 What is the c'th term of -1978, -3952, -5926, -7900, -9874? -1974c - 4 What is the f'th term of -879, -861, -843, -825? 18f - 897 What is the k'th term of 167, 885, 2813, 6551, 12699, 21857, 34625? 100k*3 + 5k*2 + 3k + 59 What is the h'th term of -4721, -4742, -4775, -4820, -4877? -6h2 - 3h - 4712 What is the o'th term of 2167, 2045, 1843, 1561, 1199, 757, 235? -40o2 - 2o + 2209 What is the t'th term of 13446, 13427, 13398, 13359, 13310, 13251, 13182? -5t2 - 4t + 13455 What is the y'th term of 739, 1119, 1499, 1879, 2259? 380y + 359 What is the t'th term of 68, 159, 286, 455, 672? t3 + 12t*2 + 48t + 7 What is the l'th term of 8806, 8632, 8342, 7936? -58l2 + 8864 What is the c'th term of -995, -1005, -1017, -1031, -1047, -1065, -1085? -c2 - 7c - 987 What is the i'th term of 2463, 2159, 1329, -291, -2965, -6957, -12531? -44i3 + i2 + i + 2505 What is the t'th term of 3206817, 3206808, 3206785, 3206742, 3206673, 3206572, 3206433, 3206250? -t3 - t2 + t + 3206818 What is the a'th term of -526, -1047, -1566, -2083, -2598, -3111, -3622? a2 - 524a - 3 What is the h'th term of 82091, 164161, 246233, 328307, 410383? h*2 + 82067h + 23 What is the y'th term of -228901, -228874, -228847, -228820, -228793, -228766? 27y - 228928 What is the f'th term of 64664, 129331, 193998? 64667f - 3 What is the u'th term of -625, -657, -755, -955, -1293, -1805, -2527? -6u3 + 3u*2 + u - 623 What is the w'th term of 151203, 302409, 453615, 604821? 151206w - 3 What is the q'th term of -516, -613, -734, -885, -1072, -1301, -1578? -q*3 - 6q*2 - 72q - 437 What is the q'th term of 2310, 9549, 21622, 38535, 60294? q*3 + 2411q*2 - q - 101 What is the r'th term of 562, 702, 936, 1264, 1686, 2202? 47r2 - r + 516 What is the c'th term of -4149977, -4149974, -4149969, -4149962? c2 - 4149978 What is the n'th term of -822, -897, -972, -1047? -75n - 747 What is the b'th term of -263116, -263114, -263112, -263110, -263108? 2b - 263118 What is the w'th term of -3548, -3454, -3296, -3074, -2788, -2438? 32w2 - 2w - 3578 What is the g'th term of 61965, 61966, 61969, 61974, 61981? g*2 - 2g + 61966 What is the g'th term of 6575, 13157, 19741, 26327? g*2 + 6579g - 5 What is the g'th term of 20294, 20285, 20276, 20267, 20258, 20249? -9*g + 20303 What is the y'th term of	{ "pile_set_name": "DM Mathematics" }
1)(g + 8g + 0g) to v + dg and give v. 0 Express 5 - 2v2 - 22v*4 - 12v*3 + 13v*4 - 7 + 8v*4 as gv*4 + yv*3 + hv*2 + z + ov and give y. -12 Rearrange 7n - 16n - 4 - n + 6n to the form kn + v and give v. -4 Express ((-126 + 126 + 28o)(-1 + 0 - 1 + 1 - 2 + 2 + (1 + 1 - 1)(-2 - 1 + 5) - 6 + 4 + 1 - 4 + 2 + 3) - 2o + 2o + 5o)(0 + 0 + 1) as c + bo and give b. 33 Rearrange ((-3 + 1 + 0)(2q - 3q + 0q) - q + q - q + (2 + 2 - 2)(4 + 5q - 4) - 1 + 1 + 2q)(10 - 5 + 7) to the form k + cq and give c. 156 Rearrange 11 + 14u - 4 + 7u - u2 + 0u*2 to lu + fu2 + a and give f. -1 Express (3b + b - 3b)(-7 + 10b + 7 + (2b - b - 3b)(-1 + 2 - 3) + 37b - 202 + 202) as gb*2 + w + hb and give g. 51 Express (1 - 3 + 3s + 1)(6 - 2 + 1)(3 + 0 - 5) in the form bs + a and give b. -30 Express -12z + 23z - 87z - 264z in the form q + sz and give q. 0 Rearrange (-258u - 152u + 48u)(-3 + 2 + 0)(-3 + u + 3) to the form j + zu + xu*2 and give x. 362 Express (5u + 0u - 4u)(-4 + 4 + 2u2) + 0 - u3 + 0 + 2u3 - 1 + 1 - 54u*2 + 29u*2 + 25u*2 + 891u*3 as l + ru*3 + xu*2 + fu and give r. 894 Express -4j + 196 - 54 - 45 + 123 as o + sj and give o. 220 Express (25 + 42 - 23)(2l - l - 5l)(5 - 1 + 5) as a + wl and give w. -1584 Express -i2 - 19 - 5 - 4 + 26 - 6i3 - i4 in the form fi3 + r + ji*2 + mi + ni4 and give r. -2 Rearrange -18j*4 + 109j*2 - 110j*2 + 2j*3 - j - 2j*3 to the form sj*2 + v + ij + lj3 + dj*4 and give i. -1 Express 9 - 33 - 6p*4 + 17736p - 17739p - 2p*2 as zp*3 + ap + ip4 + yp*2 + h and give h. -24 Rearrange -124w*3 - 6w*2 + 65w*3 + 61w*3 - 18 + 5w*2 to sw*3 + dw + y + vw2 and give v. -1 Express a + 132 - 133 + 3a + 23a2 as m + qa + ba2 and give b. 23 Rearrange 8 + 3 - 26f + 28 - 5f3 + 27f to gf3 + vf*2 + p + cf and give c. 1 Rearrange -36g + 12 - 30g + 95g - 34g + 2g3 to the form m + pg*2 + lg + rg3 and give r. 2 Express (g + 5g + 3g)(74g2 - 121g*2 - 119g2) - 1 + 1 + g3 in the form yg3 + zg + og2 + k and give y. -1493 Express (-14a2 + a2 + 8a2)(45a - 72a + 59a) as sa*3 + oa + na2 + v and give o. 0 Express (-10 - 9 + 13)(-c - c + c)(-7c + 6c + 3c) in the form j + zc2 + tc and give z. 12 Express (2n - 4n + 3n + (4 + 1 - 4)(4n + n - 3n) + 0 + n + 0 + (1 - 1 - 1)(n + 1 - 1))(-10 - 5 + 7) as vn + u and give v. -24 Express (-2p*2 + 2 - 2)(-3 - 1 + 2) - 184p2 + 95p*2 + 254p*2 as qp + zp2 + n and give z. 169 Express 46j - 78j + 29j + 48j in the form qj + z and give q. 45 Rearrange -13q - 54q*2 - 1 - 4q*3 + 25q + 56q2 + 2q*4 to vq*4 + tq*2 + k + rq + aq3 and give r. 12 Express (13 - 17 + 6 - 32c)(-1 - 3 - 1) as k + bc and give b. 160 Express (-3 + 3 + 5p)(5 + 6 - 2)(-7p + 14p + 2p) as hp + l + ip*2 and give i. 405 Rearrange (3v*3 + 0v3 - v3)(-9 + 5 + 1) to the form iv*3 + kv + wv2 + g and give i. -6 Express (-261g*2 + 451g*2 - 674g*2)(1 + 3 + 1) in the form tg2 + wg + v and give t. -2420 Express (t*2 + 2 - 2)(-1 - 1 + 0) + 11t2 - 11 + 11 as kt + n + dt2 and give d. 9 Rearrange (57l - 6l + 33l)(-2 + 2 - 2)(-4 + 4 + 3l) + (-1 + 2l*2 + 1)(-2 - 1 + 6) to the form kl2 + d + hl and give k. -498 Express (-1 + 7 + 6)(-3c - 5c + 4c)(2c*2 - 2c + 2c) as nc + d + fc3 + qc*2 and give f. -96 Express -6l4 - l4 + 4l4 + (105 + 43 - 47)(l - l + l*4) as s + bl + ol3 + cl*2 + al*4 and give s. 0 Express 190 - 188 - 41v*4 + 44v*4 - 72v as bv2 + x + mv*3 + hv + gv4 and give g. 3 Express (-c + 3c*2 + c)(c - 4c - c) + (-2 - 2 + 3)(-11c + 11c + 2c3) in the form v + xc*2 + dc + gc3 and give x. 0 Express -3g4 + g3 - 5g3 + 5g*3 - 3g*2 - 4 + 2g*4 as p + zg + ug4 + vg*3 + lg*2 and give v. 1 Express ((3 - 2 - 3)(-1 + 1 - w) - 8 + 8 + 4w + (0w + 0w - 3w)(-3 + 1 + 3))(-1 - 2 + 2)((2 - 4 + 4)(-3 + 1 + 3) - 5 - 3 - 3) as x + yw and give y. 27 Rearrange (18 + 11 - 6)(3 - 7 + 1)(-3 - 2z + 3) to vz + y and give v. 138 Rearrange -5i*4 - 7i*3 + 4i*3 + 14i*4 + 11i*2 + 9i*2 - 11i*4 + 2 to si*2 + qi*3 + l + ki + gi4 and give q. -3 Express -2g - 314g2 - 136g*2 - 932g*2 + 2g as dg2 + ig + u and give d. -1382 Express 104r2 - 4473r + 2237r + 2236r as hr2 + l + ar and give h. 104 Rearrange -3w2 - 2w - 1 - 21 - w*2 + 5 to u + jw*2 + lw and give u. -17 Rearrange 4y2 + 21y*2 - 34 + 3y*2 + 27 + 7y*2 - 2y*3 to by*2 + u + fy*3 + ty and give f. -2 Express 3w - 3w - w*2 + 7 - 35 + 12 + 5w*3 as p + zw + uw3 + nw*2 and give n. -1 Rearrange -2w*4 + w + 23w*3 + 13w*3 - 30w*3 to vw*3 + q + fw + lw4 + dw*2 and give v. 6 Rearrange 2 + 46f*3 - 43f*3 + 278f*2 - 4 + 2 to the form nf*2 + h + vf*3 + wf and give v. 3 Express (-2m + 2m + m)(-1 + 6 - 1)(-5m + 2m + 2m)(0 + 4m + 0) as p + vm + qm2 + ym3 and give y. -16 Express (j3 - 5j3 + 2j*3)(1 + 0 - 2)(j - 15163 + 15131 + 4j) as gj2 + fj + qj3 + d + rj*4 and give r. 10 Rearrange (-24i + 28i + 7i)(-5i*2 - 2i*2 + 4i*2) to the form f + gi*2 + pi*3 + vi and give p. -33 Express -47p2 + 21p*2 - 34p*2 in the form vp + op2 + l and give l. 0 Express (2x - x + 94x + (0x - 3x + x)(0 + 1 + 1) - 3x + 3x + 2x)(0 + 2x + 0) + 0x*2 - 3x*2 + 2x*2 as b + ix + ux2 and give u. 185 Express -1 + o4 + 1 + (74 - 31 + 51)(o*4 + o - o) + (2o*2 - 2o*2 + 2o*2)(2o2 - 2o*2 + 5o*2) as co*3 + vo + so2 + p + yo*4 and give v. 0 Rearrange -2o*2 + 2241 + 7o - 4468 + 2233 + (2o - 2o + 2o2)(6 - 2 - 2) to the form v + po2 + zo and give p. 2 Rearrange (256 - 500 - 240)(-2h - 2h + 3h)(-1 - 4 + 3) + 15h + 3h + 1 - 7h to wh + f and give w. -957 Rearrange -119w + 641w2 + 61w + 58w to d + aw + cw2 and give c. 641 Rearrange 0 + 31w + 5 - 8 to gw + n and give n. -3 Express (-411 + 734 - 316 - 492)(4f - 4f - 2f2) as hf*2 + n + jf and give h. 970 Express 8 + 5 - 22 + 290s + 9 as z + ms and give m. 290 Rearrange 20s2 + 17 + 6s + 2s - 7s - 24 to the form zs2 + q + as and give z. 20 Express -76z2 + 15z*2 - 76z*2 + (1 - 4 + 5)(4z - 4z + 2z2) as jz*2 + l + tz and give j. -133 Rearrange (126 - 55 + 83)(-2 + 2b + 4 - 4b) to y + kb and give y. 308 Rearrange -45f + 4f*2 + 7f*3 + 46f - 2f2 + 6 to tf*2 + r + af*3 + pf and give t. 2 Rearrange (58o - 145o + 70o - 9o*2)(3 + 2 - 3) to the form fo + g + to*2 and give t. -18 Express (-45s*2 - 2s*2 - 19s*2)(-2 + 4 - 4)(-3s + 4s + 0s)(-3 - 1 + 5) in the form ys*3 + ks*2 + js + v and give j. 0 Express 26 - 19 - 880d + 884d + d*2 as n + jd + fd2 and give n. 7 Express 195 - i - 8i - i + 9i as ci + h and give h. 195 Express 6g3 + 22g*2 + 51g - 2 - 2g3 + 18g*2 - 40g*2 as mg*2 + lg + rg3 + x and give r. 4 Rearrange -100o + 98o - o2 + 2o*2 - 17 to the form x + fo*2 + io and give i. -2 Express 21z2 - 3 - 80z + 40z + 2 + 39z as o + sz2 + uz and give u. -1 Express ((-16j2 + j2 - 6j*2)(-1 + 3 + 0) - 3 + j*2 + 3)(-5j + 4j + 3j + (3 - 1 - 3)(j + 0j - 2j)) as nj2 + h + rj + cj3 and give c. -123 Express -662b*2 - 2b*3 + 1263b*2 - 328b*2 in the form jb*2 + a + fb + yb3 and give j. 273 Rearrange 6 - 131q*2 + 148q*2 - 3 - 1 to lq + s + xq2 and give x. 17 Rearrange 5 + 153z - 4 - 384z + 190z + 15 to g + tz and give t. -41 Express -k + 2k*2 + 9k*3 + 9 + 2k*3 - 4 - 10k*3 as gk*2 + wk + a + jk3 and give j. 1 Rearrange (5a3 + a4 - 8a3 - 3a*3)(30 - 18 + 36) to the form la3 + ja + ia4 + u + ha2 and give i. 48 Rearrange 10 - u4 + 2 - 20u3 + 0 + 20u*3 + 5u - 2u2 to the form pu*2 + hu*3 + nu*4 + qu + j and give n. -1 Rearrange (603s - 603s + 87s2)(-2s + 4s - s) to the form hs2 + xs*3 + b + ks and give x. 87 Express 20p + 26p*2 + 172p - 2p2 - 14p*2 - 8p*2 as wp*2 + d + mp and give m. 192 Rearran	{ "pile_set_name": "DM Mathematics" }
ulate c(s(r)). 5456r2 Let d(o) = -3o. Let w(t) be the second derivative of -5t4/12 + t2/2 + 526t. Give d(w(j)). 15j2 - 3 Let k(j) = -17j*2 + 10j - 5. Let o(x) = 60x2 - 36x + 18. Let s(m) = -18k(m) - 5o(m). Let v(q) = -18q2 - 16q + 16q. Determine v(s(i)). -648i*4 Let r(x) = -12x*2. Let g(p) = -4462834p*2. Give g(r(m)). -642648096m*4 Let t(h) = 2h. Let u(z) = 139691648z - 291240. Let m(s) = 12950s - 27. Let x(y) = 32360m(y) - 3u(y). Give x(t(n)). -25888n Let y(z) be the first derivative of -19z*3/3 + 2. Let v(i) = 93i*2 + 99i*2 + 89i*2 - 278i*2. Give y(v(o)). -171o*4 Let a(b) = -8b - 4. Let o(y) be the first derivative of 0y + 0y*2 + 2/3y*3 - 65. Determine a(o(r)). -16r*2 - 4 Let j(y) = -77y*2. Suppose 4o - c - 22 = 0, 2c + 9 = o - 0o. Let t(s) = s + o + 3 - 8. What is j(t(m))? -77m2 Let a be 8 + (2 - (-1)/(-1)). Let w(f) = -5f - 8f - af - 2f. Let s(q) = -3q*2. Determine w(s(r)). 72r*2 Let b(i) be the first derivative of -6 - 9i2 + 13 - 5. Let m(f) be the second derivative of -f3/6 - 33f. Calculate m(b(a)). 18a Let i(p) = 2p. Let s(c) = -66c - 3. Let h(f) be the second derivative of -f3/6 - f2/2 + 2f + 5. Let l(v) = 2h(v) - s(v). Determine i(l(a)). 128a + 2 Let p(c) be the second derivative of -c3/6 + c. Let z(d) be the second derivative of -68d*4 + 10474d. What is p(z(t))? 816t2 Let v(o) = 145o. Let w(p) = -10p2 + 8p + 12. Let n(y) = -10y2 + 6y + 9. Let a(i) = -4n(i) + 3w(i). What is v(a(l))? 1450l2 Let t(n) = -1223n + 16143. Let p(d) = -3d. Calculate p(t(u)). 3669u - 48429 Let d(i) = -24. Let a(c) = -c - 12. Let m(j) = -2a(j) + d(j). Let y(z) = -688z*2. Determine m(y(g)). -1376g*2 Let j(v) = 0 + 0 + v. Let p(u) = 160u + 37498 + 37457 - 74955. What is j(p(g))? 160g Let r(s) = 3s. Let b(g) = -2g2 - 14g - 452. Let y(i) = 2i + 1. Let n(v) = -b(v) - 7y(v). What is r(n(t))? 6t2 + 1335 Let x(t) = 2t - 35. Let y(c) = 269c + 268c - 803c + 267c. Determine y(x(p)). 2p - 35 Let g(j) = -69815626j*2. Let k(u) = 2u. What is k(g(d))? -139631252d2 Let c(y) = 2y2. Let a(v) be the second derivative of v7/1260 + 19v6/180 + 95v*4/12 + 61v. Let x(q) be the third derivative of a(q). What is c(x(s))? 8s4 + 608s*3 + 11552s*2 Let z(s) be the third derivative of 257s*4/24 - 66s*2 - 25s. Let x(b) = 28b2. Give x(z(m)). 1849372m*2 Let x(u) = -u. Let w(g) be the first derivative of -23g*4/6 + 179g - 113. Let f(k) be the first derivative of w(k). Determine f(x(t)). -46t2 Let b(t) = 2t. Let z(x) = -1572170x. What is b(z(g))? -3144340g Let f(p) = -503 + 978 + 52p2 - 475. Let t(y) = 4y*2 - 5y + 5. Let l(s) = 2s2 - 1 + 0 + 0s*2 - 2s + 3. Let v(b) = 5l(b) - 2t(b). What is v(f(d))? 5408d4 Suppose -100 = -13h + 9h. Let c(a) = ha*2 - 36a*2 - 11a*2. Let z(w) = -w. Give c(z(p)). -22p*2 Let d(o) = -372o + 2. Let r(i) = -81i2 + 50i*2 + 29i*2. Determine d(r(x)). 744x*2 + 2 Let z(k) = -4k - 7. Let i(n) be the first derivative of -n*2 + 2n*2 + 7 + 5 + 26. Determine i(z(c)). -8c - 14 Suppose 12o - 21 = 3. Let j(k) = -3k + 1603k2 + 3k - 1602ko. Let i(f) be the first derivative of -5f*2/2 - 3. Determine j(i(l)). 25l*2 Let p(f) = 4f*2 - 1. Let s(g) be the second derivative of 165g + 0 + 1/12g4 + 0g*2 + 0g*3. Determine s(p(r)). 16r*4 - 8r*2 + 1 Let b(v) be the first derivative of 355v*3/3 - 207. Let j(i) = 3i. Calculate j(b(n)). 1065n2 Let a(l) = -2l*2 + 326l - 4708. Let t(r) = 33r2. Determine a(t(k)). -2178k*4 + 10758k*2 - 4708 Let l(a) = -35a*2 - a. Let i(k) = 2k - 6. Let h(w) = 58w - 51w - 12 - 10. Let c(r) = -6h(r) + 22i(r). Calculate l(c(t)). -140t2 - 2t Let s(n) = 44n2 - 32n*2 - 27n*2. Let g(k) be the first derivative of -3k*2/2 + 23. What is s(g(h))? -135h*2 Let c(b) = b. Let p be 3 - (-2 + 1 - -3 - 6). Let n(g) be the second derivative of 11g + pg + 71g*3 - 68g*3. Determine c(n(m)). 18m Let a(k) be the third derivative of -13k4/6 - 916k*2 + 1. Let b(m) = 37m*2. Give a(b(n)). -1924n*2 Let p(i) = -i + 3. Let d(r) = -660152r. Calculate p(d(h)). 660152h + 3 Let h(v) be the first derivative of -v3/3 - 2305. Let z(q) = 3853q*2. Determine z(h(j)). 3853j*4 Let m(d) = -2d*2 + d + 2. Let o(q) = 11q*2 - 7q - 10. Let y(z) = 10m(z) + 2o(z). Let f(i) = 30i. Give f(y(n)). 60n*2 - 120n Let y(l) = -97l. Let c(s) = 6457s - 2. Give y(c(b)). -626329b + 194 Let o(m) = -9m. Let a = 40 + -38. Suppose -4p - 18 = -ah, 5p + 41 = 5h + 11. Let k(j) = 0j + hj - 4j. Determine o(k(f)). 9f Let h(p) = -46915p2. Let g(v) = 5v*2 - 54. Determine g(h(w)). 11005086125w*4 - 54 Let l(m) = -2m*2. Let f(y) = -18569443y*2. Calculate l(f(i)). -689648426660498i*4 Let f(z) = 62z + 12. Let a(k) = -365k - 68. Let m(h) = 2a(h) + 13f(h). Let v(s) = -5s. What is v(m(y))? -380y - 100 Let u(g) = -23g*2. Let x(k) = 6k - 14. Let y be x(3). Let p(a) = 3 + y - 7 + 3a. Give u(p(l)). -207l*2 Let v(z) = 3z*2 - 12698 + 12698. Let o(g) be the second derivative of 0g*3 - 13g + 19/12g4 + 0g*2 + 0. Calculate o(v(b)). 171b*4 Let j(z) = 6z*2 + 11z + 5 - 7z2 - 8z*2 - 4z*2. Let t(o) = 6o*2 - 6o - 3. Let x(l) = 3j(l) + 5t(l). Let r(d) = d*2. Give x(r(n)). -9n*4 + 3n*2 Let u(d) = 7d*2 - 75d - 18d2 + 7d*2 + 75d. Let p(k) = -127k2. What is p(u(a))? -2032a*4 Let j(u) = u + 137164. Let o(t) = 86t. Determine j(o(q)). 86q + 137164 Let z(h) = 11h*2. Let l(b) = -b - 1320890. Give l(z(c)). -11c*2 - 1320890 Let h(n) = 49n*2. Let f(o) = -4922 + 9954 + 2o - 4972. Determine h(f(w)). 196w2 + 11760w + 176400 Let a(o) = -2o2. Let p(i) = -1035i*2 - 5i + 5. Let z(l) = 521l2 + 2l - 2. Let b(j) = 2p(j) + 5z(j). Calculate b(a(c)). 2140c4 Let t(n) = -2n*2 + 51430. Let f(b) = -52b - 2. Give t(f(z)). -5408z2 - 416z + 51422 Let x(z) = -600z - 2 + 194z + 198z - 55z*2 + 208z. Let y(m) = -47m2. Calculate x(y(r)). -121495r*4 - 2 Let f(g) = 3g. Let y be (-1)/4 - (-707)/28. Let s(m) be the first derivative of m3 + m3 - y + 5m3 + m3. What is s(f(r))? 216r*2 Let r(h) = 11h. Let q(o) = 40o. Suppose -43 = 11d + 1. Let a(z) = dq(z) + 14r(z). Let c(f) = -9f2 + 4f. Calculate a(c(u)). 54u2 - 24u Let w(s) = 6705s - 23. Let k(n) = -n + 121. Give k(w(q)). -6705q + 144 Let w(v) = 198v2. Let n(f) = 12f*2 + 581f. Give n(w(h)). 470448h4 + 115038h*2 Let x(r) = -35r*2 + 84r*2 + 19r*2 + 9r*2 + 58r*2. Let o(w) = 3w*2. Give x(o(c)). 1215c4 Let z(j) be the second derivative of j4/4 - j. Let p(t) = -4t2 - t + 72. Let f(w) = -17w*2 - 4w + 276. Let c(y) = -6f(y) + 23p(y). What is c(z(o))? 90o4 + 3o*2 Let s(d) = -289d*2. Let m(t) = 4. Let c(q) = -17. Let v(l) = c(l) + 4m(l). Let i(j) = -j + 5. Let w(p) = -2i(p) - 10v(p). What is s(w(a))? -1156a2 Suppose -3t + 1166 = 5x, 295 = 3x - 2t - 397. Let l(c) = 2c - 30c2 + 232 - 2c - x. Let p(h) = -2h. Give p(l(r)). 60r*2 Let t(d) be the first derivative of -24d*2 + 509. Let q(b) = -3b*2. What is t(q(i))? 144i*2 Let x(c) = 19c*2. Let g(u) = 12247u*2 - 3u + 455. Give g(x(w)). 4421167w4 - 57w*2 + 455 Let t(h) = -100h. Let x(s) be the second derivative of -s*4/3 + 815s. Give t(x(j)). 400j2 Let x(b) = -2b. Let d(p) be the third derivative of -p*2 + 21 + 19/24p*4 + 0p + 0p3. Calculate d(x(h)). -38h Let d(l) = -3l - 1166. Let c(s) = -2s - 587. Let a(j) = -7c(j) + 4d(j). Let q(y) = 2y2. What is a(q(v))? 4v*2 - 555 Let u(a) = -a. Let c(o) = 7o*2 - 6o. Let i(q) = c(q) - 6u(q). Let f(h) = -46h + 6. Let m(y) = 315y - 40. Let n(l) = -20f(l) - 3m(l). What is n(i(g))? -175g*2 Let o(u) be the second derivative of 0u*2 - 5/6u*3 - 12u - 3. Let a(f) = -14f. What is a(o(c))? 70c Let g(n) = 21n - 10. Let l(i) = 19i - 9. Let z(u) = -10g(u) + 11l(u). Let c(q) = -3q. Calculate z(c(b)). 3b + 1 Let t(j) = 135j2. Let h(c) = -65c*2 - 4c - 20. Let k(z) = -2401z2 - 147z - 735. Let s(w) = 147h(w) - 4k(w). What is s(t(n))? 893025n4 Let u(w) be the third derivative of 7w*4/24 - 32w**3/	{ "pile_set_name": "DM Mathematics" }
? 3, 271, 29423 What are the prime factors of 110863261? 110863261 What are the prime factors of 169807820? 2, 5, 7, 13, 7177 List the prime factors of 1442349347. 163, 8848769 List the prime factors of 4459941670. 2, 5, 17, 397, 66083 List the prime factors of 1508344816. 2, 11, 797, 10753 List the prime factors of 3271657531. 17, 157, 461, 2659 What are the prime factors of 99260517? 3, 227, 145757 List the prime factors of 228777763. 199, 1149637 What are the prime factors of 11756364? 2, 3, 19, 51563 What are the prime factors of 225242903? 401, 561703 What are the prime factors of 1205447413? 61, 157, 191, 659 List the prime factors of 46400364. 2, 3, 47737 What are the prime factors of 246545817? 3, 7, 11740277 What are the prime factors of 678079273? 7151, 94823 What are the prime factors of 178324201? 11, 37, 438143 List the prime factors of 668308720. 2, 5, 8353859 What are the prime factors of 552794849? 107, 1709, 3023 What are the prime factors of 62076962? 2, 17, 523, 3491 List the prime factors of 10419172. 2, 643, 4051 List the prime factors of 76159760. 2, 5, 951997 List the prime factors of 330217745. 5, 11, 13, 461843 What are the prime factors of 50738957? 2531, 20047 List the prime factors of 19848496. 2, 821, 1511 List the prime factors of 2804794131. 3, 29, 113, 285301 List the prime factors of 17329532. 2, 11, 393853 List the prime factors of 6325362515. 5, 163, 7761181 What are the prime factors of 1298631258? 2, 3, 17, 1414631 What are the prime factors of 136828853? 7, 179, 109201 List the prime factors of 298563870. 2, 3, 5, 11, 233, 353 What are the prime factors of 39102969? 3, 19, 37, 18541 List the prime factors of 1924602602. 2, 13, 23, 3218399 What are the prime factors of 96695670? 2, 3, 5, 3223189 List the prime factors of 9714068. 2, 7, 13, 26687 List the prime factors of 540265996. 2, 135066499 What are the prime factors of 112702779? 3, 7, 107, 5573 List the prime factors of 2143368375. 3, 5, 37, 179, 863 What are the prime factors of 1288730841? 3, 19, 22609313 List the prime factors of 49597306. 2, 11, 79, 28537 What are the prime factors of 1230353510? 2, 5, 173, 711187 What are the prime factors of 32960556? 2, 3, 41, 137, 163 What are the prime factors of 70166762? 2, 35083381 List the prime factors of 6812864. 2, 106451 List the prime factors of 9931815. 3, 5, 137, 179 List the prime factors of 25918631. 23, 1126897 List the prime factors of 4377063. 3, 37, 47, 839 What are the prime factors of 7868316768? 2, 3, 13, 6304741 List the prime factors of 2299108794. 2, 3, 19, 71, 284051 List the prime factors of 192764682. 2, 3, 11, 29, 59, 569 What are the prime factors of 42436391? 677, 62683 What are the prime factors of 2184952004? 2, 546238001 List the prime factors of 344394793. 41, 8399873 List the prime factors of 27984416. 2, 19, 46027 List the prime factors of 144222. 2, 3, 13, 43 What are the prime factors of 38170716? 2, 3, 3180893 List the prime factors of 303999899. 7, 17, 2554621 What are the prime factors of 1275120959? 7, 182160137 List the prime factors of 329938310. 2, 5, 13, 2537987 List the prime factors of 2786803531. 2786803531 What are the prime factors of 86224528? 2, 13, 257, 1613 List the prime factors of 1528147423. 11, 138922493 What are the prime factors of 4279939633? 97, 3881, 11369 List the prime factors of 73574470. 2, 5, 17, 23, 31, 607 What are the prime factors of 165387976? 2, 13, 31, 43, 1193 List the prime factors of 312567407. 312567407 List the prime factors of 35660803. 43, 193, 4297 What are the prime factors of 30106362? 2, 3, 11, 13, 35089 What are the prime factors of 60220531? 7, 8602933 What are the prime factors of 190038395? 5, 38007679 List the prime factors of 39302905. 5, 7860581 List the prime factors of 3663076551. 3, 647, 1887211 What are the prime factors of 61431659? 17, 113, 283 List the prime factors of 1596270047. 19, 84014213 List the prime factors of 57700045. 5, 13, 887693 What are the prime factors of 219031789? 239, 916451 List the prime factors of 314461034. 2, 557, 282281 List the prime factors of 1208107215. 3, 5, 7, 3835261 What are the prime factors of 86646508? 2, 13, 1666279 List the prime factors of 6377750511. 3, 11, 193265167 List the prime factors of 86187970. 2, 5, 11, 783527 List the prime factors of 7365957031. 19, 387681949 What are the prime factors of 17727732? 2, 3, 11, 89, 503 List the prime factors of 603198258. 2, 3, 13, 7733311 What are the prime factors of 9258511563? 3, 7, 23, 167, 38261 List the prime factors of 51959658. 2, 3, 31, 279353 List the prime factors of 2341899440. 2, 5, 29273743 What are the prime factors of 112418036? 2, 29, 89, 10889 List the prime factors of 1139888965. 5, 7867, 28979 What are the prime factors of 10029404? 2, 7, 11, 32563 What are the prime factors of 135435810? 2, 3, 5, 43, 67, 1567 List the prime factors of 26723347. 7, 3817621 List the prime factors of 512281202. 2, 6197, 41333 What are the prime factors of 482721578? 2, 5323, 45343 List the prime factors of 5826534588. 2, 3, 7, 211, 109579 What are the prime factors of 241964387? 7, 101, 342241 List the prime factors of 625634419. 53, 11804423 What are the prime factors of 1885379003? 79, 1607, 14851 List the prime factors of 140167591. 140167591 What are the prime factors of 3784631315? 5, 756926263 List the prime factors of 304322575. 5, 12172903 List the prime factors of 4225853476. 2, 13, 719, 113027 List the prime factors of 155296824. 2, 3, 6470701 List the prime factors of 87005354. 2, 17, 1297, 1973 What are the prime factors of 63058166? 2, 4621, 6823 What are the prime factors of 5962745879? 97, 107, 574501 List the prime factors of 189301957. 13, 14561689 What are the prime factors of 147911362? 2, 2447, 30223 List the prime factors of 1873885109. 439, 4268531 What are the prime factors of 33568922? 2, 3847, 4363 What are the prime factors of 2645047142? 2, 1322523571 List the prime factors of 50850141. 3, 179, 94693 What are the prime factors of 64672824? 2, 3, 761, 3541 List the prime factors of 69030169. 13, 47, 112979 What are the prime factors of 4564616302? 2, 59, 1787, 21647 List the prime factors of 161719846. 2, 80859923 List the prime factors of 37167515. 5, 7, 11, 19, 5081 List the prime factors of 4779276. 2, 3, 398273 What are the prime factors of 39149060? 2, 5, 1957453 List the prime factors of 55615928. 2, 6951991 List the prime factors of 13863050. 2, 5, 277261 List the prime factors of 2830974918. 2, 3, 23, 43, 477077 What are the prime factors of 36766877? 7, 5252411 What are the prime factors of 1903463951? 47, 40499233 What are the prime factors of 28316951? 13, 17, 37, 3463 List the prime factors of 125736920. 2, 5, 101, 31123 List the prime factors of 22253930. 2, 5, 2225393 List the prime factors of 69075472. 2, 193, 22369 List the prime factors of 12798528. 2, 3, 191, 349 List the prime factors of 71729587. 6007, 11941 What are the prime factors of 560802257? 59, 9505123 What are the prime factors of 216385912? 2, 271, 99809 What are the prime factors of 603003677? 603003677 What are the prime factors of 3135812035? 5, 47, 13343881 List the prime factors of 497865651. 3, 165955217 List the prime factors of 67406393. 103, 127, 5153 List the prime factors of 191347612. 2, 47836903 List the prime factors of 15651090. 2, 3, 5, 7, 13 What are the prime factors of 6282863815? 5, 30781, 40823 List the prime factors of 5098995464. 2, 1453, 438661 List the prime factors of 3086870185. 5, 7, 88196291 List the prime factors of 1979856576. 2, 3, 47, 73133 List the prime factors of 2449111. 7, 181, 1933 What are the prime factors of 645641185? 5, 7, 19, 31, 31319 What are the prime factors of 1331675838? 2, 3, 19, 277, 14057 What are the prime factors of 1086803654? 2, 47, 11561741 What are the prime factors of 1224693565? 5, 2671, 91703 List the prime factors of 1477413130. 2, 5, 1289, 114617 What are the prime factors of 494982427? 47, 883, 11927 What are the prime factors of 1165667046? 2, 3, 194277841 What are the prime factors of 1452735157? 34919, 41603 List the prime factors of 7577319. 3, 83, 30431 What are the prime factors of 1099795562? 2, 41, 1213, 11057 List the prime factors of 600900398	{ "pile_set_name": "DM Mathematics" }
= -2m + 1 + 3. Suppose 0 = -r - 4r + 5s + 175, 0 = -2s. What is the greatest common divisor of r and f? 5 Let u(c) = c*3 - 9c*2 + 9c + 9. Let n be u(7). Let o = -2 - n. What is the highest common divisor of o and 6? 6 Let w(s) = s*2 - 5. Let q be w(-5). Calculate the greatest common divisor of q and 30. 10 Suppose 2k - 8 = -0k + 2i, -5i = -k + 12. Calculate the greatest common factor of 22 and k. 2 Let n = -8 - -32. Let b = -4 + n. Calculate the greatest common divisor of b and 5. 5 Suppose 0 = 4w + 5g - 15, -3w + 15 = -w + 5g. Let m = -2 - w. Let k be (-14)/(-2) + 1 + m. What is the greatest common divisor of 48 and k? 6 Suppose a - 320 = -3a. Let p = -48 + a. Calculate the highest common divisor of p and 48. 16 Suppose -2x = 4i - 122, 5x = 3i - 75 - 36. What is the greatest common divisor of 8 and i? 8 Suppose 3b + 2m = -0b - 6, -5b = m + 3. Suppose 0 = a + 6 - b. Let l(x) = -3x - 6. Let c be l(a). What is the highest common divisor of c and 12? 12 Let h(y) = -11y + 30. Let t be h(-6). Calculate the greatest common factor of 12 and t. 12 Suppose -34l = -38l + 80. Suppose 0 = -4a - 2h + 168, -4a - 2h + 6h + 144 = 0. Calculate the greatest common divisor of a and l. 20 Suppose 3n = -17w + 21w - 49, 0 = 4w + n - 37. Suppose -3f + 36 = -84. Calculate the highest common divisor of w and f. 10 Suppose -4d + 7 + 21 = 0. Let n be (-1 - (-2 - -4)) + 17. Calculate the greatest common factor of d and n. 7 Let y(o) = 16o - 4. Let s be y(4). Suppose 6n - n - s = 0. Suppose -z + 1 = -4l + 7, -5z - l = -n. What is the highest common divisor of 6 and z? 2 Let l = 8 - 9. Let o be ((-36)/(-15))/(l/(-15)). Calculate the greatest common divisor of 24 and o. 12 Let w be 0 + -2 - 2-2. Suppose 0 = -wy + 70 + 196. Calculate the greatest common factor of 19 and y. 19 Suppose -r = -3j + 212, 6r - 2r - 232 = -3j. Calculate the highest common divisor of 9 and j. 9 Let u(i) = -8i + 10. Let m be u(5). Let g = -14 - m. Suppose 2s = -2s + 8. Calculate the highest common factor of g and s. 2 Suppose -2b - w = -33, -b = -0b + 4w - 6. Calculate the highest common divisor of 2 and b. 2 Suppose -1 = -4r + 11. Suppose 3b + 4w - 28 = 0, 0 = rb + w - 4w. Calculate the greatest common factor of b and 20. 4 Let s be 11/(-1)(-17 + 3). What is the highest common factor of 14 and s? 14 Let v = -42 + -18. Let f = v + 151. Calculate the greatest common divisor of f and 13. 13 Let f = -19 - -24. What is the highest common factor of f and 5? 5 Let x(g) = 2g*3 - 8g*2 - 10g + 1. Let s be x(7). Suppose -3u + s = 2u. Calculate the highest common divisor of 5 and u. 5 Suppose -5y + 29 = 6u - 5u, -3u - 4y + 142 = 0. What is the greatest common divisor of 18 and u? 18 Let v(q) = 78q*3 - 2q2 + q. Let f be v(1). Let i(z) = z3 - 5z2 - 5z - 6. Let u be i(6). Let a = u + 7. What is the highest common factor of a and f? 7 Suppose -2l = -4l + 48. Let y(x) = x*2 - 13x + 16. Let n be y(13). What is the greatest common divisor of n and l? 8 Suppose 0g - 4 = -2g. What is the greatest common divisor of g and 1? 1 Let n be 1-38/(-6). Suppose nt + 42 = u - 102, 4u + 2t = 522. Calculate the greatest common divisor of 12 and u. 12 Let o = 25 + -15. Let m be 7/14 + (-196)/(-8). Calculate the highest common factor of o and m. 5 Let y be 21 + -17 - 1/(1/(-5)). Calculate the greatest common factor of y and 3. 3 Let l(v) = 20v3 - v2 + v. Let b be l(1). Let h be (-6 - -11) + -7 + 32. Calculate the greatest common divisor of h and b. 10 Let k be 13-63/(-6). What is the highest common divisor of k and 13? 13 Let i be (-8)/(-28) - (-38)/14. Suppose 1 = -3p + 2s - 9, 2p + 10 = 2s. Suppose pm = -m + 9. Calculate the greatest common factor of i and m. 3 Let w(x) = 4x*2 - 6x + 7. Let r be w(3). Calculate the highest common divisor of 275 and r. 25 Let v(s) = s - 17. Let l be v(31). What is the greatest common divisor of 126 and l? 14 Suppose 5i = 4i + 4. Suppose 3v = iv - 22. What is the highest common factor of 22 and v? 22 Let p = 4 + 0. Suppose -3x + 5x - 4 = 2g, 0 = 4x + pg - 16. What is the greatest common factor of x and 24? 3 Let u(g) be the third derivative of 3g*5/20 - 7g*4/24 + 2g*3/3 - 9g*2. Let a be u(4). Calculate the greatest common divisor of 48 and a. 24 Let m be 5/(14/(-16) + 1). Calculate the greatest common factor of m and 30. 10 Suppose p = -2p - 87. Let i = p - -42. What is the greatest common divisor of i and 117? 13 Let y = 11 - 7. Let v(q) = q*2 + q. Let k be v(3). Let c be ((-1 - 0) + k)y. Calculate the highest common divisor of c and 11. 11 Suppose -3q + 8 = -7. Let p(c) = 2c - 4. Suppose 4h = 8h - 12. Let a be p(h). What is the highest common factor of a and q? 1 Suppose -42l = -43l + 189. Let p be -3314/(-6). What is the greatest common divisor of p and l? 21 Suppose -4v + v + 12 = 0. Let y be (-3)/v(-96)/6. Calculate the greatest common divisor of 3 and y. 3 Let f = 47 - 8. Calculate the greatest common factor of f and 3. 3 Let v(c) = -c*3 - 6c*2 - 7c - 10. Let k be v(-7). Calculate the greatest common factor of k and 8. 8 Let u(b) = b*2 + 10b + 23. Let h be u(-9). Calculate the highest common divisor of 49 and h. 7 Let m = 200 + -57. Calculate the greatest common divisor of 11 and m. 11 Let g be 4 + 6/3 + -2. Let s(p) = -p*3 - 5p*2 + 6p - 5. Let z be s(-6). Let o = 11 - z. What is the greatest common divisor of g and o? 4 Suppose 5v + 961 = 351. Let a be 2/6 - v/(-6). Let q = a - -42. Calculate the greatest common factor of q and 11. 11 Let w(l) = -6l - 26. Let d be w(-6). What is the greatest common factor of 30 and d? 10 Let y = -34 - -56. Suppose -4t + 17 = -2t + 3k, 0 = 2t - 2k + 8. Suppose -4l - t = -9. Calculate the highest common divisor of y and l. 2 Let w(n) = n*2 + 10n + 12. Let t be w(-8). Let l(q) = q*3 + 4q*2 - q + 5. Let y be l(t). What is the greatest common factor of 27 and y? 9 Let t be 32/3 - (-4)/(-6). Suppose y - 38 = 52. Calculate the greatest common divisor of y and t. 10 Suppose -15 = -c - 2c. Suppose 0 = -k - 3d + 43 + 8, -5k - cd + 305 = 0. Let a = -38 + k. Calculate the highest common factor of a and 7. 7 Suppose -7j + 120 = -2j. What is the greatest common divisor of 16 and j? 8 Suppose 2p + 49 = 3p. Calculate the greatest common divisor of 7 and p. 7 Let v = -3 + 6. Let y be 84/3 - v/1. Calculate the highest common factor of 5 and y. 5 Let w be 10/(-25) + 216/(-10). Let z = w + 40. Let i be (z/(-4))/(1/(-2)). Calculate the greatest common divisor of 6 and i. 3 Let j(g) = -g3 - 8g*2 - 9g. Let a be j(-8). Calculate the highest common factor of a and 9. 9 Let w be 48 + (-2 - -2)/3. Let l = -22 + 38. Calculate the highest common factor of w and l. 16 Suppose -6h + 78 + 318 = 0. Let w be 0 + 1 - (-7 - -2). Calculate the greatest common divisor of w and h. 6 Suppose 3f = -2f. Suppose 0 = 5g - fg - 120. Calculate the greatest common divisor of g and 216. 24 Suppose -6d + 11d + 100 = 0. Let k = 84 + d. Let q be 2/(-3) - (-52)/6. Calculate the greatest common factor of q and k. 8 Let q(u) = -u3 - 8u*2 - 11u - 8. Let a be q(-7). Suppose -3k + a = 2k. Calculate the highest common divisor of k and 24. 4 Let a = 15 + 1. Let o be 11/3 + a/48. What is the greatest common factor of 6 and o? 2 Let q be 2/4 + 284/8. Calculate the greatest common factor of 9 and q. 9 Let o(w) = w*2 - 16w + 11. Let c be o(15). Let l(i) = -i*3 - 3i*2 + 3i + 1. Let n be l(c). What is the greatest common factor of 45 and n? 5 Let v(a) = a*2 - 3a + 5. Let h be v(5). Calculate the highest common factor of h and 135. 15 Suppose -7g + 201 + 177 = 0. What is the highest common divisor of g and 18? 18 Let z be -36/(-9) - 41. Let l be -1 + (46 + 0)/(-2). Let k = l - z. Calculate the highest common divisor of 5 and k. 5 Let a be ((-9)/12)/((-3)/12). Suppose -5s = 3b + 154, -b - 68 = 2s - ab. Let q = 54 + s. Calculate the greatest common divisor of q and 2. 2 Let t = -2 + -3. Let n(p) = p - 8. Let a(v) = 2v - 7. Let m(i) = tn(i) + 6a(i). Let d be m(2). Calculate the greatest common factor of d and 120. 12 Suppose -u + 50 = 4q, -4*u + 6 = -2. Calculate the highest common factor of 20 and q. 4 Suppose 0 =	{ "pile_set_name": "DM Mathematics" }
3, -28, -11, -4, 1 Solve -2m3/7 - 41764m*2/7 + 41770m/7 + 83532/7 = 0 for m. -20883, -1, 2 Factor 50d3 - 22592270d*2 - 36147728d - 14459104. 2(d - 451847)(5d + 4)2 Factor m2/3 - 2096740m/3 - 4193492. (m - 2096746)(m + 6)/3 Let 3t*5 + 8403t*4 - 428307t*3 - 1872675t*2 + 1234548t + 8313516 = 0. What is t? -2851, -3, 2, 54 Factor 2x2/9 - 62202x + 58199440/9. 2(x - 279805)(x - 104)/9 Suppose 3j5 - 1257j*4 - 678903j*3 + 680157j*2 = 0. What is j? -311, 0, 1, 729 Determine w so that 27w*5/5 - 10356w*4/5 + 232317w*3/5 - 1209924w*2/5 + 504096w/5 + 96768 = 0. -4/9, 1, 7, 16, 360 Factor 3j2/7 - 644691j/7 + 1289370/7. 3(j - 214895)(j - 2)/7 Suppose 5f5 - 257810f*4 + 1288925f3 = 0. Calculate f. 0, 5, 51557 Let x2/5 + 9569x/5 + 5280828/5 = 0. Calculate x. -8981, -588 Find l such that l4/4 - 2181l*3/4 - 444085l*2/2 - 20612319l + 42117166 = 0. -182, 2, 2543 Factor -t*2 - 4268756t - 4555569446884. -(t + 2134378)*2 Factor -2x*2/5 - 78x/5 - 140. -2(x + 14)(x + 25)/5 Suppose 4t2 - 18368t - 313412 = 0. Calculate t. -17, 4609 Factor -59r3 + 31088r*2 + 33787r + 2640. -(r - 528)(r + 1)(59r + 5) Factor -4q*2/3 - 976q/3 + 325596. -4(q - 387)(q + 631)/3 Determine b so that b*2 + 562525b + 1125046 = 0. -562523, -2 What is d in -2d5/7 - 2480d*4/7 - 718810d*3/7 + 4561940d*2 + 289339200d/7 + 601048512/7 = 0? -639, -4, 46 Factor -3k2 - 99509064k - 825171151513008. -3(k + 16584844)2 What is u in u3/4 - 391u*2/2 - 86817u/4 + 682983/2 = 0? -111, 14, 879 Factor 3u2/2 + 60402909u + 1216170471887427/2. 3(u + 20134303)2/2 Solve -j2/3 - 183557j + 550674 = 0 for j. -550674, 3 Factor -2f4 - 10944f*3 + 18686808f*2 - 7035184800f. -2f(f - 714)*2(f + 6900) Find k such that -477074k3/21 - 440402k*2/21 - 8k/7 = 0. -12/13, -1/18349, 0 Determine g so that 3g2/7 - 88320g/7 + 5288400/7 = 0. 60, 29380 Factor g*3 + 376340g*2 + 35394396772g - 2550347887392. (g - 72)(g + 188206)2 Suppose -2x*2/9 - 52168x/9 - 7677056/9 = 0. What is x? -25936, -148 Let -2d3 - 574d*2 + 151920d - 7565400 = 0. Calculate d. -467, 90 Factor 5r2 + 108635r + 325860. 5(r + 3)(r + 21724) Suppose 2q2/13 + 208992q/13 + 5459707008/13 = 0. Calculate q. -52248 What is g in -2g3/3 + 1762g*2/3 + 35032g/3 - 249600 = 0? -32, 13, 900 Solve v*2 + 5716354v + 8169175763329 = 0 for v. -2858177 Factor -4f4 + 1128032f*3 + 2256080f*2. -4f*2(f - 282010)(f + 2) Find s such that 7s*3 + 15286s*2 - 3505327s + 1000274 = 0. -2393, 2/7, 209 Factor -3j2/8 + 29913j/8 + 14162379/2. -3(j - 11599)(j + 1628)/8 Factor 2f3 + 272930f*2 + 1637526f + 2456262. 2(f + 3)2(f + 136459) Factor 3a3/5 - 717066a*2/5. 3a*2(a - 239022)/5 What is u in 3u2 + 36200982u + 36200979 = 0? -12066993, -1 Solve u*4/4 - 39135u*3/2 + 1532643613u*2/4 - 10717002345u + 74992179409 = 0 for u. 14, 39121 Factor -q*2 + 165572q - 4469715. -(q - 165545)(q - 27) Suppose -2a*5/13 + 2274a*4/13 - 22604a*3/13 + 72204a*2/13 - 85682a/13 + 33810/13 = 0. Calculate a. 1, 3, 5, 1127 Factor 325i4 + 12165i*3 + 5180i*2. 5i*2(i + 37)(65i + 28) Solve 4c3/7 - 217368c*2 + 15864900c - 216022328/7 = 0 for c. 2, 71, 380321 Find d, given that -d*3 + 2018d*2 - 169887d + 3649590 = 0. 42, 45, 1931 Determine k so that -3k4 + 12363k*3 + 6613404k*2 + 830673612k - 837299376 = 0. -246, 1, 4612 Factor 3u2 - 18519u + 699390. 3(u - 6135)(u - 38) Find q such that q*4/8 + 771q*3/8 + 6735q*2/4 - 15791q/2 + 8283 = 0. -753, -22, 2 Determine a, given that -5a4 - 13685a*3 - 1280880a*2 - 1267200a = 0. -2640, -96, -1, 0 Find t, given that 2t2 - 187984836t - 187984838 = 0. -1, 93992419 Factor -5w4 + 874265w*3 - 38216527375w*2 - 38217401645w. -5w(w - 87427)*2(w + 1) Determine p so that 5p4 - 11410p*3 + 715545p*2 - 12863240p + 71219980 = 0. 13, 38, 2218 Let -300j4 + 40560j*3 - 165303j*2 + 31845j - 1572 = 0. What is j? 1/10, 4, 131 Factor -4n2 + 54846720n + 109693456. -4(n - 13711682)(n + 2) What is f in 10f5 + 5045f*4/2 + 97110f*3 - 881960f*2 + 1179400f + 351480 = 0? -202, -58, -1/4, 2, 6 Suppose -c*3/7 + 105c*2 + 66016c/7 + 65280/7 = 0. What is c? -80, -1, 816 Factor -s*2 + 493663s + 4936730. -(s - 493673)(s + 10) Factor w2 + 2451261w. w(w + 2451261) Factor -4u*3 + 7445436u*2 - 3464601485436u - 51970697518140. -4(u - 930687)2(u + 15) Factor x*2/5 - 3111x/5 - 5294926/5. (x - 4333)(x + 1222)/5 Factor 2a*2 - 17782a + 10940580. 2(a - 8226)(a - 665) Factor 4n2/7 + 132827776n/7 + 1102701129819136/7. 4(n + 16603472)2/7 Solve -882x*3 + 64162x*2/5 - 21068x/5 - 2272 = 0 for x. -2/7, 40/63, 71/5 Solve 3n4 + 412979781n*3 + 18950255226325467n*2 + 289854506842752232299039n - 579709089486528673738242 = 0 for n. -45886643, 2 Determine s so that -5s2 + 169357425s + 508072320 = 0. -3, 33871488 Suppose 4v2 - 211288v - 845216 = 0. Calculate v. -4, 52826 Determine j so that 3j2 - 111174912j - 111174915 = 0. -1, 37058305 Let -3u3/4 + 441303u*2 - 19416243u + 213574680 = 0. What is u? 22, 588360 Factor -3l2/2 + 659766l + 6597810. -3(l - 439854)(l + 10)/2 Determine d so that -2d4 - 8594d*3 - 658764d*2 - 2531992d - 2497648 = 0. -4219, -74, -2 Suppose -2h3/13 + 30546h*2/13 - 427332h/13 + 1220720/13 = 0. What is h? 4, 10, 15259 Factor -5p2 - 81795p + 10551680. -5(p - 128)(p + 16487) Determine x so that 2x5 + 55894x*4 + 390209884x*3 - 4296893068x*2 + 15239654178x - 17587119690 = 0. -13979, 3, 5 What is w in 4w2 + 557879w - 8369085 = 0? -557939/4, 15 Solve 2i4/5 - 362i*3/5 + 5272i*2/5 + 1448i/5 - 4224 = 0. -2, 2, 16, 165 Solve p*4/4 + 300p*3 - 188941p*2/2 - 300p + 377881/4 = 0. -1459, -1, 1, 259 Factor h*3/6 - 687h*2/2 - 767501h/3. h(h - 2642)(h + 581)/6 Find r such that r*2 + 10825543r = 0. -10825543, 0 What is p in 162p5/7 - 2844p*4 + 521582p*3/7 - 1382092p*2/7 + 926400p/7 - 183744/7 = 0? 4/9, 2, 33, 87 Factor 3h4/7 - 2625564h*3/7 + 574470777612h*2/7 - 2297851603776h/7 + 2297841101568/7. 3(h - 437592)2(h - 2)*2/7 Factor -3b*2 - 19440b - 2476500. -3(b + 130)(b + 6350) Factor -2u2/3 + 2294272u + 6882818/3. -2(u - 3441409)(u + 1)/3 Determine y, given that -86y3 + 6220y*2 - 19362y - 25668 = 0. -1, 186/43, 69 What is a in a*3/9 - 20243a*2/9 - 101440a = 0? -45, 0, 20288 Suppose -2d5/9 - 232d*4/3 - 11438d*3/3 + 70724d*2/9 - 3968d = 0. What is d? -288, -62, 0, 1 Suppose 2x2/9 - 68626x + 617616 = 0. What is x? 9, 308808 Let -t*3/12 + 19939t*2/4 - 295392057t/4 - 250081751893/12 = 0. Calculate t. -277, 30047 Factor -p*3/2 - 426661p*2 - 91027057264p - 3094426746512. -(p + 34)(p + 426644)2/2 Factor -2r*2/3 - 15538r - 256378444/3. -2(r + 8894)(r + 14413)/3 Solve 2x4/9 + 710x*3/9 - 309056x*2/3 - 43923968x - 130842624 = 0 for x. -528, -3, 704 Factor 4x2/7 + 705980x/7 + 3529200. 4(x + 35)(x + 176460)/7 Factor -3l2 + 64368l + 5492955. -3(l - 21541)(l + 85) Factor 2l2/9 + 1918l + 27711736/9. 2(l + 2132)(l + 6499)/9 Factor 49x3/10 - 24740723x*2/5 - 14137562x/5 - 2019652/5. (x - 1009826)(7x + 2)*2/10 Suppose 226981r*4/7 - 989599950r*3/7 + 1438164517500r*2/7 - 696684614625000r/7 = 0. Calculate r. 0, 88650/61 Find i, given that 66i2 - 8220969i + 1121040 = 0. 3/22, 124560 Let -4v3 - 311484v*2 + 622984v = 0. What is v? -77873, 0, 2 What is i in -i*2/7 - 6129i/7 + 1394656 = 0? -7441, 1312 Suppose y*5/2 + 235y*4/2 + 10815y*3/2 + 13565y*2/2 - 157628y + 145320 = 0. Calculate y. -173, -60, -7, 1, 4 Solve 5t3 + 698335t*2 = 0. -139667, 0 Factor 5a*4 - 2175245a*3 + 315451129410a*2 - 15249748727634300a + 106732784734196040. 5(a - 145014)3(a - 7) What is d in 5d4 - 1560d*3 - 1984890d*2 - 31309160d + 33295605 = 0? -483, -17, 1, 811 Suppose t*3/4 - 119916t*2 + 48917925t/4 - 623670381/2 = 0. What is t? 51, 479562 Let 2y5/3 - 121y*4/2 + 5845y*3/6 - 326y*2 - 17230y/3 - 1400 = 0. What is y? -2, -1/4, 3, 20, 70 Factor -x*2 + 28972x - 202755. -(x - 28965)*	{ "pile_set_name": "DM Mathematics" }
143100893209 = 0. What is x? 133342203 Factor 4k2/5 - 158452k/5 + 7246472. 4(k - 39383)(k - 230)/5 Factor 2c2 + 2103150c + 2103148. 2(c + 1)(c + 1051574) Factor 4o2 + 9688o + 4382560. 4(o + 602)(o + 1820) Factor 2z2/5 + 60266z/5 - 3381168/5. 2(z - 56)(z + 30189)/5 Let 40t4 + 20164t*3 + 139976t*2 - 582604t - 59640 = 0. Calculate t. -497, -10, -1/10, 3 What is l in 3505l3/3 + 68449147l*2/3 + 39058l/3 = 0? -19529, -2/3505, 0 Factor 4z3 - 1208z*2 + 30624z + 548352. 4(z - 272)(z - 42)(z + 12) Factor 2p*3/13 - 1364p*2 + 1023410p/13 - 14815056/13. 2(p - 8808)(p - 29)*2/13 Determine c so that -15c*2 + 1056362473c + 140848330 = 0. -2/15, 70424165 Determine c so that 5c5 + 17018c*4 + 14436475c*3 - 86461874c*2 - 19216341984c + 27032664960 = 0. -1704, -35, 7/5, 38 Factor o*4 - 1044o*3 + 80964o*2 - 2017760o + 16161600. (o - 962)(o - 42)(o - 20)*2 Suppose 5r*2 + 85450635r + 427253050 = 0. What is r? -17090122, -5 Factor -70x4 - 77493x*3 - 29046897x*2 - 3847523031x - 60412001661. -(x + 363)*3(70x + 1263) Factor 5w*4 + 605310w*3 - 1210640w*2. 5w*2(w - 2)(w + 121064) Factor -z2/5 - 33624z + 8249885. -(z - 245)(z + 168365)/5 Suppose 4y*2 + 17804y + 670776 = 0. What is y? -4413, -38 Factor 2w2 + 38099w - 57153. (w + 19051)(2w - 3) Solve 133160x2/7 + 133178x/7 + 18/7 = 0. -1, -9/66580 Factor 5w2 + 34071300w + 545139520. 5(w + 16)(w + 6814244) Factor 4n3 - 1485788n*2 - 2971588n - 1485796. 4(n - 371449)(n + 1)*2 What is b in 5b*3 - 532455b*2 - 73550205b - 2538303345 = 0? -69, 106629 Solve 2n2/7 + 25611060n/7 = 0. -12805530, 0 Find v, given that 2v5 + 1718v*4 + 454088v*3 + 34205856v*2 + 32852160v - 67513824 = 0. -366, -126, -2, 1 Find b such that 4b3 + 111968b*2 + 6592860b + 18770976 = 0. -27933, -56, -3 Find z such that -z*2/5 + 2608523z/5 + 1043410 = 0. -2, 2608525 Determine i, given that 2i2/11 + 12i - 192510/11 = 0. -345, 279 Suppose 2b5/3 + 674b*4/3 + 87518b*3/3 + 5462134b*2/3 + 164095120b/3 + 1905030232/3 = 0. Calculate b. -98, -59, -41 Let -2b2 - 16168b - 2317896 = 0. What is b? -7938, -146 What is t in -t*3/2 + 1766292t*2 - 1559911377402t + 31197521035240 = 0? 20, 1766282 Factor -4952286z2 + 4952266z + 20. -2(z - 1)(2476143z + 10) Let -g3/4 - 2319227g*2 + 18553819g/4 - 4638455/2 = 0. What is g? -9276910, 1 Factor -2n3/3 + 32630n*2 - 17602752n + 7161799168/3. -2(n - 48401)(n - 272)*2/3 Determine b so that 2b*3/9 - 5792b*2/9 + 5547520b/9 - 1759436800/9 = 0. 880, 1136 Solve 5a2 - 47317060a + 111945208352180 = 0 for a. 4731706 Solve 2j3 - 1046436j*2 - 2092880j = 0. -2, 0, 523220 Suppose -5w3 - 1930w*2 - 83745w + 85680 = 0. What is w? -336, -51, 1 Factor 2v2/5 + 2961800v + 44426982/5. 2(v + 3)(v + 7404497)/5 Let v*3/2 - 2885v*2 + 728067v/2 - 1066149 = 0. Calculate v. 3, 126, 5641 Let 10q4/13 + 6644q*3/13 + 2594q*2/13 - 41120q/13 + 31872/13 = 0. What is q? -664, -3, 1, 8/5 Factor 5p3 - 8957585p*2 + 17915150p. 5p(p - 1791515)(p - 2) Let 2x*4 - 10382x*3 + 72540x*2 + 186624x = 0. Calculate x. -2, 0, 9, 5184 Factor -6926645n4 + 346296940n*3 + 1765455n*2 + 2250n. -5n(n - 50)(1177n + 3)*2 Determine r so that -245r*3 - 893095r*2 - 947360755r - 232263633905 = 0. -11537/7, -349 Factor d*2 + 6847680d + 11722680345600. (d + 3423840)*2 Find k such that 3k*5/5 + 594k*4/5 + 16008k*3/5 - 2641134k*2/5 - 136312731k/5 - 122779236 = 0. -101, -59, -5, 68 Factor f*4/3 - 1791726f*3 + 7223188384501f*2/3 - 48154051713540f + 722308088124100/3. (f - 2687579)*2(f - 10)2/3 Let o4 - 82163o3 + 246482o*2 - 164320o = 0. Calculate o. 0, 1, 2, 82160 Factor -4t2 + 71064616t - 315636227951716. -4(t - 8883077)2 Solve -14t*4/5 - 6192t*3/5 - 448872t*2/5 - 6706624t/5 - 375936 = 0. -356, -66, -20, -2/7 Determine w, given that 2w5 - 9078122w*4/3 + 10301623622606w*3/9 - 65242717545418w*2/9 + 24418274724944w/3 - 2543568182440 = 0. 2/3, 5, 756507 Suppose 2z5/5 + 80204z*4/5 - 320842z*3/5 + 240644z*2/5 + 64168z - 320848/5 = 0. What is z? -40106, -1, 1, 2 Find l, given that -l*4/5 + 33l*3/5 + 287l*2 - 16533l/5 + 15066/5 = 0. -31, 1, 9, 54 Factor -3l2 - 3616911l - 130204908. -3(l + 36)(l + 1205601) Factor f*4/5 + 9752f*3/5 + 29211f2. f2(f + 15)(f + 9737)/5 Let -2c4/9 - 4586c*3/9 + 24398c*2/3 + 9129754c/9 + 9051976/9 = 0. What is c? -2308, -37, -1, 53 Factor -a*3/3 - 6129a*2 - 29935997a - 47825178005/3. -(a + 605)(a + 8891)2/3 Factor -4g*3 + 349508g*2 + 2796292g + 2446780. -4(g - 87385)(g + 1)(g + 7) Factor 4s*2 - 7792888s + 3795568961284. 4(s - 974111)2 What is x in -2x*5/11 + 105032x*4/11 - 209992x*3/11 - 3360836x*2/11 - 3150966x/11 + 601524 = 0? -3, 1, 7, 52514 Solve -n*2 - 582751n - 12237330 = 0. -582730, -21 Solve -4w3 - 20w*2 + 10860388w + 6906021236 = 0 for w. -953, 1901 Suppose 2r4/3 + 1010r*3/3 + 18140r*2 - 1556360r/3 - 3322352/3 = 0. Calculate r. -439, -86, -2, 22 Determine v so that -3v3/8 - 3v*2/4 + 248055v/8 + 867825/4 = 0. -285, -7, 290 Factor -4w2 + 965696w - 5794032. -4(w - 241418)(w - 6) Suppose -3x5 - 1698x*4 + 158841x*3 + 142952040x*2 - 430239600x = 0. Calculate x. -420, 0, 3, 271 Factor -4o4 - 123913168o*3 - 959654451324084o*2 + 1919309398300872o. -4o(o - 2)(o + 15489147)2 Factor 3f*3 + 3206397f*2 + 102602400f + 820813056. 3(f + 16)2(f + 1068767) Find m, given that 2m4/21 + 2702m*3/3 - 94768m*2/21 - 66696m - 756960/7 = 0. -9462, -5, -2, 12 Factor g*3 - 9697g*2 - 126200g - 291300. (g - 9710)(g + 3)(g + 10) Find x, given that 336x3 + 37084x*2 + 213432x + 315612 = 0. -8767/84, -3 Determine h, given that -4h4 - 1004376h*3 - 62988896880h*2 + 7446681335392h = 0. -125606, 0, 118 Factor 3q2/2 + 12526641q + 52305578247627/2. 3(q + 4175547)2/2 Suppose -3g*2 - 78124812g - 508623854169612 = 0. Calculate g. -13020802 Solve l*4/3 - 103295l*3/3 - 206599l*2 - 929705l/3 - 413204/3 = 0 for l. -4, -1, 103301 Solve -4a3 + 4892a*2 + 34400a + 49200 = 0 for a. -5, -2, 1230 Factor -4v2/3 + 76204v/3 - 5870904. -4(v - 18817)(v - 234)/3 Solve -3l5/5 + 150372l*4/5 - 300729l*3/5 - 150372l*2/5 + 300732l/5 = 0. -1, 0, 1, 2, 50122 Find v such that 5v3 + 680045v*2 + 23186513175v + 4312130166135 = 0. -67911, -187 Suppose -2q2 + 2192122q - 26305176 = 0. What is q? 12, 1096049 Factor 2g3/3 + 16724g*2/3 - 16870g/3 - 401424. 2(g - 9)(g + 8)(g + 8363)/3 Determine d so that -3d*2 + 95967d + 287928 = 0. -3, 31992 Factor -5f2 - 3482915f + 3482920. -5(f - 1)(f + 696584) Let 2n3/9 - 846n*2 + 1288144n/3 + 7069676576/9 = 0. What is n? -697, 2252 Determine i, given that -665412630498i2/5 - 18457824i/5 - 128/5 = 0. -8/576807 Factor 253794m2 - 761218m - 492. 2(m - 3)(126897m + 82) Factor 2w*2 + 3449844w - 31048758. 2(w - 9)(w + 1724931) Factor -5a2 + 46870a - 84774240. -5(a - 6926)(a - 2448) Solve -3h2 + 358488h + 139544976 = 0 for h. -388, 119884 Find b, given that -b*2 - 5026b + 31029152 = 0. -8624, 3598 Factor 15a2 - 1629a/4 - 273405/2. 3(a - 110)(20a + 1657)/4 Factor -3o*3 - 7116o*2 + 581127o + 588240. -3(o - 80)(o + 1)(o + 2451) Factor -2k*4 + 268082k*3 - 61855794k*2 + 4761070006k - 122177361460. -2(k - 133810)(k - 77)3 Factor h3 - 53379h2 + 3518786h - 6824064. (h - 53313)(h - 64)(h - 2) Suppose -2m2/5 - 100537524m/5 - 100537522/5 = 0. Calculate m. -50268761, -1 What is o in -52o4/5 - 261816o*3/5 + 2642708o*2/5 - 4399176o/5 + 64576 = 0? -5045, 1/13, 2, 8 Factor 14x2/5 + 309636x/5 + 2741392/5. 2(x + 22108)(7x + 62)/5 Determine p, given that p3 - 20317p*2 + 203091p - 426447 = 0. 3, 7, 20307 Find d, given that -d*4 - 316d*3 + 30743d*2 - 370194d + 339768 = 0. -396, 1, 13, 66 Solve -1122y3 - 32093y*2/2 - 27062y + 1086 = 0 for y. -543/44, -2, 2/51 Factor 4u2/3 + 325224u - 3902752/3. 4(u - 4)(u + 243922)/3 Let b*4/8 - 13b*3 - 2617b*2/8 - 155b + 3750 = 0. Calculate b. -20, -4, 3, 12	{ "pile_set_name": "DM Mathematics" }
0, -0.0822. -0.0822, 0, 59 Put -38, 461, 2 in descending order. 461, 2, -38 Sort 122, 2, -0.4, -1/17, 1/4, -0.2 in increasing order. -0.4, -0.2, -1/17, 1/4, 2, 122 Put -2, 1, -11, 18, -3, -0.6 in ascending order. -11, -3, -2, -0.6, 1, 18 Sort 0.2, 2/2209, 1/4, 2.84 in increasing order. 2/2209, 0.2, 1/4, 2.84 Sort 578/9, 5, 2/3. 2/3, 5, 578/9 Put 5, -3, -51 in decreasing order. 5, -3, -51 Put -4, -233172, 4 in descending order. 4, -4, -233172 Sort 5, -3, 130, 159 in increasing order. -3, 5, 130, 159 Put -0.11, -207/32, 1/7 in decreasing order. 1/7, -0.11, -207/32 Put -637, -2, 1/28 in increasing order. -637, -2, 1/28 Sort 3, -5, -9, 5, 11, 0 in increasing order. -9, -5, 0, 3, 5, 11 Sort 12, -5/6, 1/5, 5, 32 in descending order. 32, 12, 5, 1/5, -5/6 Sort 0.1, -30, 4, -0.3 in increasing order. -30, -0.3, 0.1, 4 Sort 2, -3, -34, 4, -11 in increasing order. -34, -11, -3, 2, 4 Sort 8, -67, 254. -67, 8, 254 Sort -1, 1, -2, -5, -7, 227 in descending order. 227, 1, -1, -2, -5, -7 Put -66/23, -12, 1/9 in decreasing order. 1/9, -66/23, -12 Sort -0.0636, 3/10, -12 in descending order. 3/10, -0.0636, -12 Put -1/6, 0.1, -1.633 in ascending order. -1.633, -1/6, 0.1 Put 2/21, 39, -0.01, -32/5 in descending order. 39, 2/21, -0.01, -32/5 Put -16, 5/3, 1, -3/68 in increasing order. -16, -3/68, 1, 5/3 Sort 3/16, -1, 147 in ascending order. -1, 3/16, 147 Sort -2/7, 22, 0, -8/3, 3/8, -1/3 in ascending order. -8/3, -1/3, -2/7, 0, 3/8, 22 Put 2, -0.2, -7695 in descending order. 2, -0.2, -7695 Sort 7, -4, -197, -2, 2, 5 in descending order. 7, 5, 2, -2, -4, -197 Sort 3, 2, 0, -161660 in decreasing order. 3, 2, 0, -161660 Sort -0.3, -29, 0.29 in descending order. 0.29, -0.3, -29 Put 0, -278, -4, -11, -3, 6 in descending order. 6, 0, -3, -4, -11, -278 Sort 162332, 1, -4. -4, 1, 162332 Put 0.1, -2, 4, -1/6 in ascending order. -2, -1/6, 0.1, 4 Put -0.13, -0.5, -64, -0.3, -3/2 in decreasing order. -0.13, -0.3, -0.5, -3/2, -64 Put -2/11, 7, 1, 4, -6 in increasing order. -6, -2/11, 1, 4, 7 Put 1, 4, -4, -15, -5 in descending order. 4, 1, -4, -5, -15 Put 3, 5.7, 131 in descending order. 131, 5.7, 3 Sort -2, -408, -1, 2, -5, 11. -408, -5, -2, -1, 2, 11 Sort -2/3, 0.06, 4/5, 0, 18/11 in ascending order. -2/3, 0, 0.06, 4/5, 18/11 Sort 26, 5, 104. 5, 26, 104 Sort 1/5, 36993, -5, 5 in ascending order. -5, 1/5, 5, 36993 Put 1/9, 1/2, 0.07, 4, -0.08 in decreasing order. 4, 1/2, 1/9, 0.07, -0.08 Sort -5, -3, 4, -12, 1650 in descending order. 1650, 4, -3, -5, -12 Sort -233, -1, 35 in descending order. 35, -1, -233 Put -507, 2/9, -0.03 in descending order. 2/9, -0.03, -507 Put 4, 3351, 1 in descending order. 3351, 4, 1 Put -5, 1, 381/4, 2/13, -29/4 in decreasing order. 381/4, 1, 2/13, -5, -29/4 Put -7, 3, -1744, -5 in decreasing order. 3, -5, -7, -1744 Put -3205, 1/3, 0, -6, 0.1 in descending order. 1/3, 0.1, 0, -6, -3205 Put -2, 3, 4, 2915, -8 in ascending order. -8, -2, 3, 4, 2915 Sort -1/2, -1/8, 200.19. -1/2, -1/8, 200.19 Sort -0.012, 3/2, 5, 0.2, 3/14 in descending order. 5, 3/2, 3/14, 0.2, -0.012 Put -5, -15, -1, -96, 3 in decreasing order. 3, -1, -5, -15, -96 Sort -2/15, -8/185, 4, -0.2, -1 in increasing order. -1, -0.2, -2/15, -8/185, 4 Put -33, 117, 0 in descending order. 117, 0, -33 Sort 10, -0.85, -16. -16, -0.85, 10 Sort 8, 915, -0.3, 4/7. -0.3, 4/7, 8, 915 Put 63836, 0, -0.2 in descending order. 63836, 0, -0.2 Sort 3, -12/25, 0.09 in descending order. 3, 0.09, -12/25 Put -2, -1, 49, 1 in ascending order. -2, -1, 1, 49 Put -6, -2, -25, 0, 2 in increasing order. -25, -6, -2, 0, 2 Sort 0.1, 0.2, 12151, 0, -0.2, -5. -5, -0.2, 0, 0.1, 0.2, 12151 Sort -26, 85, 10, 2, 3, 0 in descending order. 85, 10, 3, 2, 0, -26 Put -5/6, 395/7, -4/7, -4, -3/8 in descending order. 395/7, -3/8, -4/7, -5/6, -4 Put 1, 61/4, -88, -0.5 in ascending order. -88, -0.5, 1, 61/4 Put 2, -6, -1, -119, -5, -3 in increasing order. -119, -6, -5, -3, -1, 2 Sort 6238, -0.5, 34 in descending order. 6238, 34, -0.5 Sort 0, -263, 0.1, -1/4, 1/68, -0.1 in decreasing order. 0.1, 1/68, 0, -0.1, -1/4, -263 Sort 8, 4, 1, 62 in decreasing order. 62, 8, 4, 1 Sort -0.1, 2/5, -0.50018, 1. -0.50018, -0.1, 2/5, 1 Sort 1/4, -57/4, -4, -0.4, 27 in decreasing order. 27, 1/4, -0.4, -4, -57/4 Put -1/52, -1, -1/2, -30, -1/3 in increasing order. -30, -1, -1/2, -1/3, -1/52 Put -29/5, -4, 4, -1/12, -1, 0.4 in decreasing order. 4, 0.4, -1/12, -1, -4, -29/5 Sort -1, -5, -0.7669, -1/2, -4 in descending order. -1/2, -0.7669, -1, -4, -5 Put 122, 0.92, 5 in ascending order. 0.92, 5, 122 Sort 0.1, 557/5, 83 in descending order. 557/5, 83, 0.1 Put -3/7, -0.2, 0.1, 93090 in decreasing order. 93090, 0.1, -0.2, -3/7 Sort -37, 514, 4, 1, 2. -37, 1, 2, 4, 514 Sort -5, -82, 93, 1. -82, -5, 1, 93 Sort 12, -39, 3. -39, 3, 12 Sort 5, 0, 6, -41 in increasing order. -41, 0, 5, 6 Put 25, 1, 11, -21, -4 in descending order. 25, 11, 1, -4, -21 Put 0.1, -0.2, -3, -550, 4, -5 in descending order. 4, 0.1, -0.2, -3, -5, -550 Sort 8, -4, -2189, -36 in decreasing order. 8, -4, -36, -2189 Sort -1415, 44, 2, 7. -1415, 2, 7, 44 Sort -2, -189208, -5 in descending order. -2, -5, -189208 Sort 80, 1, 0, -41, 2, 3 in increasing order. -41, 0, 1, 2, 3, 80 Sort 10, 48, 1, 1828 in decreasing order. 1828, 48, 10, 1 Put -10952, -4, 4, 2 in descending order. 4, 2, -4, -10952 Put 98, -5, -1722 in descending order. 98, -5, -1722 Put 3690, 5, 3, -3, 8 in ascending order. -3, 3, 5, 8, 3690 Put 1, 192.95, 5 in increasing order. 1, 5, 192.95 Put -57, 4, 3, 13/3, -1 in descending order. 13/3, 4, 3, -1, -57 Sort 5, 3, -37, 0, -3 in decreasing order. 5, 3, 0, -3, -37 Sort 167, -0.4, 1.61, 6/5. -0.4, 6/5, 1.61, 167 Sort -3, 412, 5, -1, -21 in decreasing order. 412, 5, -1, -3, -21 Sort 6/5, 3, -6, 0, -1, 0.3 in decreasing order. 3, 6/5, 0.3, 0, -1, -6 Sort 59/4, 2/11, -9, 34, 3 in ascending order. -9, 2/11, 3, 59/4, 34 Sort 4, -2/23, -0.15, 6, -2, 1/4 in ascending order. -2, -0.15, -2/23, 1/4, 4, 6 Sort -2, 1358, 52 in ascending order. -2, 52, 1358 Put -1/2, 48, 1/6, -2/9, -1, -6 in increasing order. -6, -1, -1/2, -2/9, 1/6, 48 Put -1.5, 1/3, -0.04, -290 in descending order. 1/3, -0.04, -1.5, -290 Sort 2/37, -0.1, 0.1, -0.5, -15, 44 in descending order. 44, 0.1, 2/37, -0.1, -0.5, -15 Put 18, -13/17, 5/6 in descending order. 18, 5/6, -13/17 Sort 0, -3, -5, 29, -4, -2 in descending order. 29, 0, -2, -3, -4, -5 Sort 5, -6, -84, -40, 0, 3. -84, -40, -6, 0, 3, 5 Put 2/9, 4/7, 2/3, -45, 0.0735, 1 in decreasing order. 1, 2/3, 4/7, 2/9, 0.0735, -45 Sort -5, -2, -5545. -5545, -5, -2 Put 0, 166, 23 in decreasing order. 166, 23, 0 Sort -2, 3, -80, -1, 13, -4. -80, -4, -2, -1, 3, 13 Sort 1, -5, 4, -4, -246, -107 in descending order. 4, 1, -4, -5, -107, -246 Sort -130, 5, 92, -3, 0 in decreasing order. 92, 5, 0, -3, -130 Put 12.7, 3, 28, 1 in increasing order. 1, 3, 12.7, 28 Put 2, 40, -14, -12, 3 in descending order. 40, 3, 2, -12, -14 Sort 1, -20, -3, -4, 163 in decreasing order. 163, 1, -3, -4, -20 Sort -0.3, -1/11, 3, 7/4 in decreasing order. 3, 7/4, -1/11, -0.3 Put -3/2, -2276, 0.3, 3/2, -5 in descending order. 3/2, 0.3, -3/2, -5, -2276 Sort 3, -2, 11, 46, 4 in descending order. 46, 11, 4, 3, -2 Put 8464, 9, -3, 3 in increasing order. -3, 3, 9, 8464 Sort 0.2, 6, 0, 0.0891 in descending order. 6, 0.2, 0.0891, 0 Sort 7, -32, 5, 27, 1, -5. -32, -5, 1, 5, 7, 27 Put 0.2, -17, 733 in decreasing order. 733, 0.2, -17 Sort 9914, 0.081, 4, 3/2 in descending order. 9914, 4, 3/2, 0.081 Put 10, 0, 5, -0.4, -1, 13 in ascending order. -1, -0.4, 0, 5, 10, 13 Put 1, 2, -6, -5, 70, -4 in descending order. 70, 2, 1, -4, -5, -6 Put -9, -1/6, 4, 0.469, -0.4 in ascending order. -9, -0.4, -1/6, 0.469, 4 Put -2, -41, 7, 6, 0 in ascending order. -41, -2, 0, 6, 7 Sort -51, -312, -5 in descending order. -5, -51, -312 Put 16, 10, -44, -4 in decreasing order. 16, 10, -4, -44 Put 0, -1843, -7 in descending order. 0, -7, -1843 Put 5, -4, 12648, -2 in descending order. 12648, 5, -2, -4 Sort -3/25, -2, -1536. -1536, -2, -3/25 Put 6, -4, -5, 543 in ascending order. -5, -4, 6, 543 Sort 6, 5, -19, -38. -38, -19, 5, 6 Put 166, -50, 4 in descending order. 166, 4, -50 Sort -12, 5, 45, 40, -2 in increasing order. -12, -2, 5, 40, 45 Sort 0.3, -0.206, -2/3, -9/5, 18. -9/5, -2/3, -0.206, 0.3, 18 Sort 12, 93, 7, 3 in decreasing orde	{ "pile_set_name": "DM Mathematics" }
t to -2/5? (a) -8 (b) -3 (c) -5 (d) -1/8 d What is the closest to 0.06 in -1/2, 2/3, -0.2? -0.2 Which is the nearest to -13? (a) -4 (b) 2 (c) 4 a Which is the nearest to 0.903? (a) -4 (b) 5 (c) -3/4 c Which is the nearest to 2? (a) -3/8 (b) -5 (c) -8/3 (d) 4 d Which is the nearest to 11? (a) 2/9 (b) 0.5 (c) -9 b Which is the closest to 0.21? (a) 1/9 (b) -1/5 (c) 72 a Which is the nearest to -1? (a) 59 (b) -0.4 (c) 0.4 (d) -4 b Which is the closest to 1? (a) 3 (b) 14/5 (c) 0.2 (d) 18 c What is the closest to 1/3 in -2/7, -0.2, -2? -0.2 What is the closest to 0.08 in -0.4, 4, 0, 1? 0 Which is the closest to 8? (a) 2/11 (b) 0.4 (c) 0 (d) 5 d Which is the closest to 3? (a) 1/2 (b) 2/7 (c) 3 (d) 5 c What is the nearest to -5/6 in -1/2, 27, 0.2, 1/4? -1/2 Which is the nearest to 2? (a) 1/5 (b) -0.14 (c) 0 (d) 8 a What is the nearest to 0 in 2/5, 3, 1/4, -0.07? -0.07 What is the closest to -0.1 in 165, 0.2, -0.5? 0.2 Which is the closest to -2? (a) -9 (b) -1/2 (c) 1 (d) 2/9 b Which is the nearest to 1/2? (a) -0.5 (b) -0.3 (c) -13 (d) 2 b Which is the closest to -2/3? (a) 0.3 (b) 1 (c) -1/4 (d) 5 c What is the nearest to 2/7 in -0.07, 0, 0.5? 0.5 What is the nearest to 82 in -0.4, -3, 2, 0.5? 2 What is the nearest to -0.1 in -4, 9, -7? -4 Which is the closest to 1? (a) 5 (b) 4 (c) -0.3 (d) -0.1 d What is the closest to -2 in -39, 2/9, -0.1? -0.1 Which is the closest to 0.1? (a) -10 (b) 0.5 (c) -9/2 b Which is the closest to 0.1? (a) -24 (b) 8 (c) -5 c What is the closest to 3 in -0.5, -4, -0.1, 5? 5 Which is the closest to 1? (a) 0.4 (b) 6 (c) 3 (d) -2 a Which is the nearest to -2? (a) 0.5 (b) -4 (c) -0.137 c What is the nearest to 2 in -5, 4, 6, 11? 4 Which is the nearest to 0? (a) -3 (b) 1 (c) -72 b What is the nearest to 0.24 in -3/4, -1, -1/3, 5? -1/3 What is the nearest to -2/125 in -0.5, -2/13, -1/8? -1/8 What is the closest to 2/7 in 7, -1, -2/5, 5? -2/5 What is the nearest to 6 in 1/14, -2/5, 4, -0.1? 4 Which is the closest to -2? (a) -3 (b) -2/35 (c) -2/3 a What is the nearest to 59 in 3, -1, -4, 0.4? 3 What is the closest to 1 in -3, -5, -16, -3/4? -3/4 What is the nearest to 15 in 0.4, 2/13, -3/5, 7? 7 Which is the closest to -1? (a) -2/9 (b) -84 (c) 2 a Which is the closest to -6/7? (a) 8 (b) 17 (c) -2 c What is the nearest to -2/15 in -0.3, 0.06, 3/5, 3? -0.3 Which is the closest to 0? (a) -4 (b) 0.5 (c) -3 (d) 1/14 d Which is the closest to 0.2? (a) 1/3 (b) 2 (c) -2/7 (d) -3/5 a Which is the closest to -3? (a) -41 (b) -4 (c) 40/3 b What is the closest to -3 in -1/6, -1/3, -0.3? -1/3 Which is the closest to -1/5? (a) -1/9 (b) -1 (c) 0 (d) -5 a Which is the closest to -1? (a) 0.3 (b) -0.5 (c) 0.5 (d) 2/11 b Which is the nearest to -1/2? (a) -8/23 (b) -1/7 (c) 2 a Which is the closest to -16? (a) -5 (b) 5 (c) -0.2 (d) -6 d Which is the nearest to -1/3? (a) -8 (b) 0.5 (c) -0.031 c What is the closest to 1/2 in 1/4, 0.072, -4, 2? 1/4 What is the nearest to 883 in -1, 5, -0.1? 5 What is the closest to 3 in -0.2, 1, -2/11? 1 Which is the nearest to 5? (a) -4/3 (b) -2 (c) -4 (d) 1.3 d Which is the nearest to 0.5? (a) 2/3 (b) -2/7 (c) 15 a Which is the closest to -2? (a) 0.4 (b) 2 (c) -4 (d) 0.05 c What is the nearest to -1 in 3, 0.03, 1? 0.03 What is the closest to -1 in 0.14, -0.2, -0.4? -0.4 Which is the closest to -0.1? (a) -4 (b) -151 (c) 0.4 (d) 1 c Which is the closest to 326? (a) -56 (b) -0.4 (c) 0.3 c Which is the nearest to 0? (a) 12 (b) 3/2 (c) -1/4 c What is the closest to 0.2 in -2, 4, -1? -1 Which is the nearest to -0.2? (a) 1064 (b) -0.3 (c) -1 b What is the closest to 0.1 in 0.04, -7, 4/9? 0.04 Which is the nearest to -1.39? (a) 0.4 (b) 3/4 (c) 6 a Which is the closest to -3/8? (a) 2/9 (b) 3 (c) -4/3 a Which is the nearest to 124? (a) -1/3 (b) 0 (c) -2 (d) 4 d What is the nearest to 0.14 in -4, -47, 0.2? 0.2 What is the closest to -2 in -1/3, 1, -1/23, -4? -1/3 What is the closest to 7 in -0.2, 0.2, 6/5? 6/5 Which is the closest to -0.2? (a) -3/8 (b) 0.5 (c) -5 a Which is the nearest to 0? (a) 0.1 (b) -370 (c) 2/9 (d) 0.3 a Which is the nearest to -1? (a) -8/5 (b) 4/9 (c) 0.01 (d) 5 a What is the nearest to -3 in 2, -0.3, -27, -3? -3 Which is the nearest to -2? (a) -2/5 (b) -0.1 (c) -3 c Which is the closest to -1? (a) -1/38 (b) 3 (c) 2/9 (d) -2/27 d Which is the closest to -2? (a) -0.1 (b) -4 (c) 2/11 (d) -0.2 d What is the nearest to 0 in -1/3, 1, 141? -1/3 What is the closest to 5 in 5, 0.04, -3/5? 5 What is the closest to 16 in -5, 2/3, 4, 6? 6 What is the closest to -2/23 in 3, -17/4, 4? 3 Which is the closest to 0.2? (a) -17 (b) -0.2 (c) 1/4 c What is the closest to 2/7 in 14, -0.4, 2? -0.4 Which is the closest to -1? (a) 23 (b) 4 (c) 2 (d) 8 c Which is the nearest to -1/4? (a) -2 (b) -6 (c) 5 (d) 1/49 d What is the nearest to 2/13 in 4, 0, -0.08? 0 Which is the nearest to 0.01? (a) -2/3 (b) 5 (c) 1/3 (d) -0.5 c What is the closest to 0.4 in -7/4, -0.2, -0.3, 0.4? 0.4 What is the closest to -1 in 3, 0.34, 13? 0.34 What is the nearest to 2 in 3, 0, -5, 0.05? 3 Which is the closest to 1? (a) -1 (b) -2 (c) -9 a Which is the nearest to 0.1? (a) 15 (b) -0.1 (c) 2/3 b What is the nearest to 1 in 5, -15, -0.2, -0.1? -0.1 What is the closest to 0.1 in -1, -0.7, 99? -0.7 What is the closest to -0.2 in -1/5, -1/3, 7? -1/5 What is the closest to -1 in 4, 2/3, 20, 0.04? 0.04 Which is the closest to -1? (a) 0.05 (b) -1.5 (c) 3 (d) 5 b What is the closest to 3 in -3, 55, 2, -4? 2 Which is the nearest to 0.2? (a) 34 (b) 0.2 (c) 2 b What is the closest to 1.4 in 4, -2/19, -0.02? -0.02 What is the closest to 2 in 2.2, -0.5, -0.3, -0.4? 2.2 Which is the closest to -1/20? (a) 1 (b) 0.5 (c) -1/2 c What is the nearest to -2 in -4, 0.05, 3/7? -4 Which is the closest to -1? (a) 1.7 (b) -0.4 (c) -114 b Which is the closest to 0.1? (a) 5 (b) -4.1 (c) 0.4 (d) -1 c What is the nearest to -0.5 in 4/7, -2/7, 1/8? -2/7 What is the closest to 3 in 2/19, -2/11, 11, -2/3? 2/19 Which is the closest to 2? (a) 2/13 (b) -0.2 (c) 24 a Which is the nearest to 2/7? (a) -2/13 (b) 2 (c) 237 (d) 3/2 a What is the closest to 0.2 in 1, -5, -4, 4? 1 What is the nearest to -1 in 4, 2/5, 1/4, -45? 1/4 What is the nearest to 0 in -0.2, -5, -0.07? -0.07 Which is the nearest to 2? (a) -2/13 (b) 3 (c) -1 b Which is the closest to -0.1? (a) -4 (b) -2 (c) -0.069 c What is the closest to 0.1 in 5, -2, -8, 2/9? 2/9 What is the nearest to -2/3 in -9, -0.3, 1? -0.3 Which is the nearest to 1/3? (a) -3 (b) -7 (c) 0.2 c Which is the closest to 4? (a) 3 (b) -2/7 (c) -4/7 a What is the closest to -0.1 in -0.5, 19, 1/4? 1/4 Which is the nearest to 1? (a) -0.2 (b) -2/3 (c) -4 (d) 4/5 d Which is the nearest to 1/7? (a) -0.5 (b) 0.2 (c) 0.3 b What is the nearest to 2/29 in -4, -5, -1/9, -0.1? -0.1 Which is the closest to -3? (a) -1/6 (b) 1 (c) -1.9 (d) -0.3 c Which is the closest to 0? (a) -0.1 (b) 1 (c) 6 a Which is the nearest to 1? (a) -0.5 (b) 6 (c) 0.5 c What is the nearest to -13 in -4/9, -2, -6? -6 Which is the closest to 2? (a) 0 (b) 1 (c) -0.52 b What is the nearest to -2/3 in -0.2, -1/15, -1/7, -2? -0.2 Which is the nearest to -0.4? (a) -1 (b) -26 (c) 1/4 a Which is the closest to -0.1? (a) 0.048 (b) -2 (c) 15 a Which is the nearest to 6.68? (a) 1/7 (b) -3 (c) -1/7 (d) 3 d What is the nearest to -1/4 in 3, 3/2, 158, 1/2? 1/2 Which is the nearest to 2/9? (a) 0.3 (b) 1/4 (c) -3 (d) -0.3 b What is the nearest to -0.03 in 2, 1, -3, -4? 1 What is the closest to 1 in -7, 1, -0.02? 1 What is the nearest to 0.4 in -5, 0.25, -0.4? 0.25 Which is the nearest to -11? (a) -2/9 (b) -4/5 (c) 1 (d) 0.044 b What is the nearest to 1/4 in -10, -2, 2, -5? 2 Which is the closest to -1/3? (a) 12 (b) 0.1 (c) 2 b What is the closest to -2 in 4, -5, 3, -0.55? -0.55 Which is the nearest to 0.0295? (a) 0.2 (b) 0 (c) 2/9 b What is the nearest to -1/4 in 0.4, -1, 1/9? 1/9 Which is the closest to -2/21? (a) -2/5 (b) 3/7 (c) 3/13 a What is the nearest to 0 in 1/13, 0, -3/2, -1/3? 0 Which is the nearest to 1/2? (a) 5 (b) 4/5 (c) 73 b What	{ "pile_set_name": "DM Mathematics" }
42860a3s + 3s3 What is the second derivative of -13385u*4 - 6u*2 + 31u - 1705? -160620u2 - 12 What is the third derivative of 9bn3z*3 + 6bn3z*2 - 2bn2z + bn2 + 16bn + 3z*3 + 2z*2 wrt n? 54bz3 + 36bz2 Differentiate 2986b*3m*2 - 12bm2 - 265m*2 - 8m - 2 wrt b. 8958b2m*2 - 12m*2 What is the third derivative of 2m*5o*2 + 14220m*5o - 230m2o*2 + 2m*2 - 3m + 3o2 wrt m? 120m*2o*2 + 853200m*2o Differentiate 2k3s*4 + 194k*3s2 - k3 - 131k + 4s*2 + 6 wrt s. 8k*3s*3 + 388k*3s + 8s What is the second derivative of h5t + 244h2t*3 - 5h*2t*2 - 2ht2 - ht - 72h - 5t*3 wrt h? 20h*3t + 488t3 - 10t*2 Find the second derivative of 84jx3 - 22371jx + 12x*4 - 6x*2 wrt x. 504jx + 144x*2 - 12 What is the third derivative of 49d*2nq3 - d2n - 54d2q3 + n + q3 + 34841q2 wrt q? 294d*2n - 324d2 + 6 What is the third derivative of 325489l*2o*4 + 3l*2o*2 + 32l*2o + 11lo*2 - 3o*2 wrt o? 7811736l*2o What is the second derivative of 6i5 + 31i*4 + 90i*2 + 646149i? 120i3 + 372i*2 + 180 What is the third derivative of 4d*2l*2o*3 - 4d*2l*2o - 46do3 + l2o3 - 2l*2o - 2o2 + 3o - 1 wrt o? 24d2l*2 - 276d + 6l2 What is the third derivative of -140354d*3fo2 + d3o*3 + 2d*2fo2 - 3d*2f + 14874d2o*3 + dfo wrt d? -842124fo2 + 6o*3 What is the derivative of 1562739ds - 103094s + 3 wrt d? 1562739s Find the second derivative of 10589a*3x - 3a3 - 6ax + 8877a + 3 wrt a. 63534ax - 18a Find the second derivative of -4895o*5 - 239o*3 + 277o - 2009. -97900o3 - 1434o Find the third derivative of 229t6 - 23t*5 - 3t*3 - 60209t*2. 27480t*3 - 1380t*2 - 18 What is the derivative of 2ir2z + 3ir*2 - 1032irz - 419ir + i - 8r2 + 2rz + 2r + 39z wrt z? 2ir2 - 1032ir + 2r + 39 Differentiate -23000l + 69631. -23000 What is the third derivative of -8d*6 - 43d*5 - 23d*3 - 23903d*2 - 2d? -960d3 - 2580d*2 - 138 Find the third derivative of 698br3t*2 - br*3 - 4br2t + bt2 + 64r*3t*2 - 46241r*2t wrt r. 4188bt*2 - 6b + 384t2 Find the third derivative of 1210732hq3 + 7hq2 - 13hq - 3h - 3q2 + 28q wrt q. 7264392h Find the first derivative of 76fj - 12962f + 31745j - 8 wrt f. 76j - 12962 What is the second derivative of 3b4r - b*3 + 13157b*2r + 30b - 5049r wrt b? 36b2r - 6b + 26314r Find the third derivative of 5w5y - 4656w3y - 2501w2y + 21y wrt w. 300w*2y - 27936y Find the third derivative of -35998q*4 + 98q*2 + 4q + 6. -863952q Differentiate -2s*4 - 5392s + 35426. -8s3 - 5392 Find the second derivative of -19845t*4 - 69307t. -238140t2 Find the third derivative of 76264a*5 + 99407a*2 wrt a. 4575840a*2 What is the second derivative of -106961j*2 + 147j + 15? -213922 Differentiate -g*2k*3 - 217868gk3 + 3k*3 + 41060k*2 wrt g. -2gk3 - 217868k*3 What is the second derivative of 3j*2o*2 + 6j*2ox2 + 311j*2ux - 4jo2u + 5jo*2x*2 + 19jo - jux2 - oux2 wrt j? 6o*2 + 12ox2 + 622ux What is the third derivative of 6h*2y*3 + 356h*2y*2 + 269h*2y + 404hy*3 + 5y*3 wrt y? 36h*2 + 2424h + 30 Find the first derivative of 14028isuz + 16iuz + iu + 2iz - 2suz - 2uz + 15811 wrt i. 14028suz + 16uz + u + 2z What is the second derivative of -45w*3 - 28754w*2 - 17w - 90753? -270w - 57508 Find the second derivative of -662573m*3 + 1020468m wrt m. -3975438m What is the derivative of -106935z*3 - 82934 wrt z? -320805z*2 Find the second derivative of 92773g*2 - 10g + 4982. 185546 Find the first derivative of 359181m3 - 6m*2 + 2942282 wrt m. 1077543m*2 - 12m What is the derivative of -13350j2n*2 + 71jn2 - 651959n*2 wrt j? -26700jn2 + 71n*2 What is the first derivative of 2dhuv + dhu - 2du - 473dv - 17d + 2hu + 4uv + 28 wrt v? 2dhu - 473d + 4u What is the third derivative of -3w*6 + 2w*5 + 176w*4 - 3w*2 + 3w - 189 wrt w? -360w3 + 120w*2 + 4224w Find the third derivative of -9543g3y - 5695g2y wrt g. -57258y Find the second derivative of -5659x*3 + 2x - 2991. -33954x What is the first derivative of 23216n*2v*2 + 3n*2v - 52531v2 - 2v wrt n? 46432nv*2 + 6nv What is the second derivative of -v4 + 3v*3 + 137v*2 - 3460v + 6 wrt v? -12v2 + 18v + 274 What is the second derivative of 1834028t3 + 255t - 1481? 11004168t Find the first derivative of -560u*3 + 49u*2 + 4u - 1704762. -1680u2 + 98u + 4 What is the second derivative of -72776h3k2 + h3kp*3 + 31h*3p*3 + 3h*2k*2p*3 - 15hp3 wrt k? -145552h*3 + 6h*2p*3 Find the second derivative of 97794t*2 + 1058t + 1 wrt t. 195588 What is the second derivative of 192965j2q*2 + 194jq2 - jq + 36q2 wrt j? 385930q*2 What is the third derivative of 239f*3j*3o + 10f3o3 + f2j2o*3 - 13f*2j*2o - 2fj*3o + 4j3o3 - j3o2 wrt f? 1434j*3o + 60o3 What is the third derivative of 181x*6 - 288x*4 - 3x*2 - 183x - 1 wrt x? 21720x3 - 6912x What is the third derivative of -10o2r*3 - 25o*2r*2 - 41938o*2 - 18322or3 - r3 wrt r? -60o*2 - 109932o - 6 What is the derivative of r*3 - 10r*2 - 208r + 38540? 3r2 - 20r - 208 What is the third derivative of 14h6 - 3881h*4 - 2306h*2 + h + 4? 1680h*3 - 93144h Differentiate -77285f4 + 59182. -309140f*3 Find the second derivative of 39860f*3x*2 + 2f*3x - 2f2x - 122fx - 17 wrt x. 79720f3 Find the second derivative of -28111p4 + p3 - 2p2 + 5367p + 1 wrt p. -337332p2 + 6p - 4 Find the second derivative of -1781818i4 - 319135i wrt i. -21381816i2 What is the third derivative of -117082a*3 - 3a*2 + 2a + 468? -702492 Differentiate -67437b4 - 53758. -269748b*3 What is the third derivative of -126111s*3 + 3s*2 - 993 wrt s? -756666 What is the third derivative of 33t*5 + 78475t*3 + 4784578t*2 wrt t? 1980t*2 + 470850 Find the second derivative of 10284iw5 - 3iw3 + 2iw - 5i - 124w wrt w. 205680iw3 - 18iw What is the second derivative of -96p*4 - 10p3 + p2 + 46079p? -1152p*2 - 60p + 2 Differentiate -147hqvx + 2hqv + 10hx + 269qvx + 9v + 215x wrt q. -147hvx + 2hv + 269vx Find the second derivative of 292a*3bv2 + 4a*3b - 39a2b*2v*2 + 3ab2 + av + 268b2v wrt v. 584a3b - 78a2b*2 Differentiate 2jtv*2 - 5818jv - 2tv2 + 33tv + 460v*2 - 3v + 1 with respect to j. 2tv*2 - 5818v Find the second derivative of -29r3 - 7972r*2 - 4r - 289076. -174r - 15944 Find the third derivative of -1320548t*5 - 380174t*2. -79232880t*2 Find the first derivative of -2b*3k - 1186858b3v + b*3 + 316b*2k - 30bk - 2kv wrt v. -1186858b3 - 2k Find the second derivative of 37bj*2p*2 + bj*2p - 19bp*2 - 2bp - 7j*2p*2 - 271j*2 + 2p*2 wrt p. 74bj2 - 38b - 14j2 + 4 What is the third derivative of 78945n*4 - 3n*2 + 6511n - 1? 1894680n What is the second derivative of 38967c5 - c2 - 98618c wrt c? 779340c*3 - 2 Differentiate -34607n*2 - 4n + 208259 wrt n. -69214n - 4 Find the first derivative of -79396r + 265607. -79396 Differentiate 95l3 + 78l*2 - 160270. 285l*2 + 156l Differentiate -25928y - 39371. -25928 Find the second derivative of 2l*3 - 1040200l*2w*2 + 55lw + 19l - 129w2 wrt l. 12l - 2080400w2 What is the third derivative of -10128y*6 + 295y*2 - 53 wrt y? -1215360y3 Find the third derivative of -s4u3 + 72s*4 - 139s*3u*3 + 2824s*2 + 39u*3 wrt s. -24su3 + 1728s - 834u3 What is the second derivative of 1108881f4 + f2 + 2f - 3465480? 13306572f*2 + 2 Find the second derivative of -26944b*4j*2 - 16bj2 + 471b wrt b. -323328b2j*2 Find the second derivative of 3429721a*5 + 508196a wrt a. 68594420a*3 What is the third derivative of	{ "pile_set_name": "DM Mathematics" }
920, 10557, 12156, 13711? -h3 - h2 + 1739h + 375 What is the d'th term of -12393, -24836, -37279, -49722? -12443d + 50 What is the x'th term of 185, 1540, 5225, 12404, 24241, 41900, 66545? 194x3 + x2 - 6x - 4 What is the h'th term of 90232, 360909, 812038, 1443619? 90226h2 - h + 7 What is the k'th term of 1598, 1505, 1412? -93k + 1691 What is the s'th term of 123, 268, 451, 672, 931? 19s2 + 88s + 16 What is the z'th term of 189769, 189770, 189773, 189778, 189785, 189794, 189805? z*2 - 2z + 189770 What is the z'th term of -130, -235, -554, -1195, -2266, -3875, -6130, -9139? -18z3 + z2 + 18z - 131 What is the t'th term of 14, -132, -362, -664, -1026, -1436, -1882? 2t3 - 54t*2 + 2t + 64 What is the s'th term of 29, 57, 49, -13, -147, -371? -3s3 + 49s - 17 What is the v'th term of -45990, -183952, -413890, -735804, -1149694? -45988v2 + 2v - 4 What is the n'th term of -5597, -5589, -5581, -5573, -5565, -5557? 8n - 5605 What is the a'th term of -1020, -1825, -2418, -2799, -2968? 106a*2 - 1123a - 3 What is the q'th term of 54175, 54208, 54271, 54370, 54511, 54700, 54943, 55246? q*3 + 9q*2 - q + 54166 What is the n'th term of 11662, 11673, 11692, 11719? 4n*2 - n + 11659 What is the a'th term of 4404, 17615, 39634, 70461, 110096, 158539? 4404a2 - a + 1 What is the k'th term of -24, -59, -114, -183, -260? k3 - 16k2 + 6k - 15 What is the d'th term of 23, 66, 123, 194, 279, 378, 491? 7d2 + 22d - 6 What is the l'th term of 109, 247, 435, 691, 1033? 3l3 + 7l*2 + 96l + 3 What is the c'th term of -33, -168, -437, -876, -1521, -2408? -6c3 - 31c2 + 4 What is the k'th term of 473049, 473063, 473079, 473097, 473117, 473139, 473163? k2 + 11k + 473037 What is the r'th term of -126, -79, 2, 117, 266, 449, 666? 17r*2 - 4r - 139 What is the q'th term of -347515, -347517, -347519, -347521, -347523? -2q - 347513 What is the d'th term of 649, 1284, 1911, 2530? -4d*2 + 647d + 6 What is the a'th term of 4028, 4028, 4030, 4034, 4040, 4048, 4058? a*2 - 3a + 4030 What is the j'th term of 128, 249, 444, 713? 37j2 + 10j + 81 What is the f'th term of 9736, 19495, 29268, 39061, 48880? f3 + f2 + 9749f - 15 What is the r'th term of 474, 551, 630, 711, 794, 879? r2 + 74r + 399 What is the u'th term of 570, 576, 590, 618, 666, 740, 846? u*3 - 2u*2 + 5u + 566 What is the n'th term of 2375, 2950, 3525, 4100, 4675? 575n + 1800 What is the k'th term of 222093, 222103, 222125, 222165, 222229, 222323? k3 + 3k + 222089 What is the h'th term of -30410, -30420, -30444, -30488, -30558, -30660? -h3 - h2 - 30408 What is the m'th term of -32, -36, -42, -50, -60? -m*2 - m - 30 What is the j'th term of 433, 1814, 4153, 7462, 11753, 17038? 2j*3 + 467j*2 - 34j - 2 What is the q'th term of -68, -86, -190, -422, -824, -1438, -2306, -3470? -7q3 - q2 + 34q - 94 What is the k'th term of 387, 247, 13, -315? -47k2 + k + 433 What is the b'th term of 1075, 1072, 1091, 1144, 1243, 1400, 1627? 2b3 - b2 - 14b + 1088 What is the f'th term of -31, -96, -191, -334, -543? -3f*3 + 3f*2 - 53f + 22 What is the v'th term of -2163, -2039, -1915? 124v - 2287 What is the o'th term of -1458, -1335, -1122, -819? 45o*2 - 12o - 1491 What is the d'th term of 71603, 286361, 644297, 1145417, 1789727, 2577233, 3507941? d*3 + 71583d*2 + 2d + 17 What is the d'th term of 7050, 28194, 63448, 112818, 176310, 253930, 345684, 451578? d*3 + 7049d*2 - 10d + 10 What is the r'th term of 532, 252, -66, -440, -888, -1428, -2078, -2856? -3r3 - r2 - 256r + 792 What is the s'th term of 4367, 7503, 10639, 13775? 3136s + 1231 What is the x'th term of -137538, -275084, -412630, -550176, -687722, -825268? -137546x + 8 What is the q'th term of 646112, 1292220, 1938328, 2584436? 646108q + 4 What is the h'th term of 2430, 2427, 2424, 2421, 2418? -3h + 2433 What is the k'th term of -44710, -44704, -44688, -44656, -44602? k3 - k2 + 2k - 44712 What is the a'th term of -367, -551, -855, -1279? -60a*2 - 4a - 303 What is the d'th term of -4490, -8974, -13458, -17942, -22426? -4484d - 6 What is the x'th term of -1145, -2376, -3599, -4808, -5997? x3 - 2x*2 - 1232x + 88 What is the t'th term of -1724, -3477, -5242, -7025, -8832? -t*3 - 1746t + 23 What is the r'th term of 31611, 31607, 31601, 31593, 31583? -r*2 - r + 31613 What is the c'th term of 412, 341, 220, 25, -268, -683, -1244, -1975? -4c3 - c2 - 40c + 457 What is the h'th term of 563, 488, 443, 428, 443? 15h*2 - 120h + 668 What is the p'th term of 1964, 2424, 2884? 460p + 1504 What is the m'th term of 2046, 8298, 18750, 33408, 52278, 75366, 102678, 134220? m3 + 2094m*2 - 37m - 12 What is the l'th term of 2176, 3102, 4026, 4948, 5868, 6786? -l*2 + 929l + 1248 What is the y'th term of -113, -224, -421, -710, -1097, -1588? -y*3 - 37y*2 + 7y - 82 What is the u'th term of 275, 647, 1019, 1391? 372u - 97 What is the u'th term of 359, 280, 201, 122, 43, -36? -79u + 438 What is the j'th term of -480, -463, -438, -405? 4j2 + 5j - 489 What is the c'th term of -120, -177, -234, -291? -57c - 63 What is the d'th term of -11770, -11767, -11764, -11761, -11758? 3d - 11773 What is the m'th term of -470, -362, -252, -140, -26? m*2 + 105m - 576 What is the o'th term of 1429864, 2859729, 4289594, 5719459? 1429865o - 1 What is the p'th term of 601573, 1203144, 1804715, 2406286, 3007857, 3609428? 601571p + 2 What is the h'th term of -8673, -8672, -8667, -8658? 2h2 - 5h - 8670 What is the r'th term of -34, -32, -30, -28, -26? 2r - 36 What is the u'th term of -172, -347, -526, -703, -872? u3 - 8u*2 - 158u - 7 What is the y'th term of -801283, -801279, -801275, -801271? 4y - 801287 What is the r'th term of -31675, -63346, -95017, -126688? -31671r - 4 What is the n'th term of 8220, 16414, 24590, 32742, 40864, 48950, 56994? -n*3 - 3n*2 + 8210n + 14 What is the p'th term of -161089, -161083, -161077, -161071? 6p - 161095 What is the h'th term of -1090, -4351, -9786, -17395? -1087h*2 - 3 What is the n'th term of -1228, -1202, -1176, -1150? 26n - 1254 What is the l'th term of -7052, -14095, -21120, -28121, -35092, -42027, -48920, -55765? l*3 + 3l*2 - 7059l + 3 What is the g'th term of 2953, 2917, 2887, 2857, 2821, 2773, 2707, 2617? -g*3 + 9g*2 - 56g + 3001 What is the r'th term of -16, -111, -360, -841, -1632? -13r3 + r2 - 7r + 3 What is the f'th term of -1012436, -1012436, -1012434, -1012430? f*2 - 3f - 1012434 What is the z'th term of 174, 438, 688, 918, 1122? -z3 - z2 + 274z - 98 What is the t'th term of -1870921, -1870924, -1870929, -1870936, -1870945? -t2 - 1870920 What is the u'th term of -597, -1725, -3607, -6243, -9633, -13777? -377u*2 + 3u - 223 What is the w'th term of -107495, -107497, -107499, -107501? -2w - 107493 What is the w'th term of -2545, -2050, -1555, -1060, -565, -70? 495w - 3040 What is the w'th term of -7057, -14172, -21291, -28414, -35541, -42672, -49807? -2w2 - 7109w + 54 What is the x'th term of 44279, 88584, 132889, 177194, 221499? 44305x - 26 What is the b'th term of -1566, -1379, -1060, -603, -2, 749? b3 + 60b*2 - 1627 What is the o'th term of 1724, 3451, 5182, 6917, 8656, 10399? 2o*2 + 1721o + 1 What is the o'th term of 9399, 18828, 28263, 37698, 47127, 56544? -o*3 + 9o*2 + 9409o - 18 What is the j'th term of 1623, 1554, 1485, 1416, 1347? -69j + 1692 What is the w'th term of 5365, 10541, 15719, 20899, 26081, 31265, 36451? w2 + 5173w + 191 What is the b'th term of 728, 656, 584, 512, 440? -72b + 800 What is the b'th term of -128500, -128501, -128502, -128503? -b - 128499 What is the j'th term of 1499, 1482, 1445, 1388, 1311, 1214, 1097? -10j*2 + 13j + 1496 What is the n'th term of -77931, -77932, -77933? -n - 77930 What is the m'th term of 786, 1461, 2004, 2409, 2670, 2781, 2736? -m*3 - 60m*2 + 862m - 15 What is the q'th term of -609, -236, 137, 510, 883, 1256? 373q - 982 What is the s'th term of 456, 375, 158, -261, -948? -11s*3 - 2s*2 + 2s + 467 What is the b'th term of 231, 493, 757, 1023, 1291, 1561, 1833? b*2 + 259b - 29 What is the y'th term of 50956, 101930, 152904, 203878, 254852, 305826? 50974*y - 18 W	{ "pile_set_name": "DM Mathematics" }
-14r + 65 - 9 = 0. Does 4 divide r? True Let w(a) = -a2 - a. Let v be w(-9). Let n be v/276/4. Let t(g) = -g*3 - 2g*2 + 3g - 2. Is 6 a factor of t(n)? True Let r be 4 - 3 - 35/1. Does 11 divide r/(-119) + 159/7? False Suppose 2p = -0x - 2x - 6, 7 = -x - 5p. Let z(c) = -5c3 + c2 - 3c + 1. Is 17 a factor of z(x)? True Suppose -5s = 4m - 2145, -5m + 5s + 294 = -2421. Suppose -5h + 0h = -m. Does 13 divide h? False Let d(r) = 2r2 + 9r - 3. Let z be d(9). Suppose 12a = 9a + z. Is 10 a factor of a? True Let x = -646 - -998. Does 88 divide x? True Let m be (-1)/(-5) - (-1 + 16/5). Let d(o) = -8o3 + 2o*2 - 3o - 3. Is d(m) a multiple of 15? True Suppose 22v - 1638 = 9v. Does 7 divide v? True Is -5 + ((-71)/(-4))/(53/424) a multiple of 10? False Does 43 divide (-95004)/(-195) + 3/(-15) + 0? False Let q(z) = -3z2 + 153z + 48. Does 12 divide q(21)? False Let q(w) = w*2 - 5w + 12w - 4 + 0. Let s be q(6). Suppose 0 = 3z - s - 7. Is 14 a factor of z? False Let p = -139 - -142. Is (p - (-70)/(-21))1-111 a multiple of 2? False Let h(a) = 316a3 - 22a + 46. Is h(2) a multiple of 110? True Let k = -10 + 14. Suppose k + 156 = -4q. Is 13 a factor of 16/24(-1 - q)? True Suppose -3 = -2g + 3g, -5q = 4g - 1698. Is 19 a factor of q? True Let d = -627 + 631. Let u = -3 - -6. Suppose l + 2l - 105 = -uk, dk - 3l = 126. Does 10 divide k? False Suppose 101g + 14697 = 110g. Is 71 a factor of g? True Suppose 4j + 1549 = 2581. Is 43 a factor of j? True Let i = 13 - 10. Suppose -3f = -0f - 33. Suppose -ig + 7 = -f. Is g a multiple of 3? True Let s be 1/4 + (-90)/(-24). Let t(d) = -d + 9. Let j be t(s). Suppose 4y + f - 143 = -0y, 0 = jy - 2f - 182. Is y a multiple of 6? True Does 45 divide (-5)/25 - 2703/(-15)? True Let z(k) = 2k + 25. Let c be z(-9). Suppose 14q - cq - 385 = 0. Is q a multiple of 11? True Suppose h - 2b - 271 = -3b, 5b = 2h - 535. Suppose 11r = 14r - h. Does 9 divide r? True Let t = -78 - -132. Let l = -48 + t. Is 6 a factor of l? True Is 2270 + -1 + -4 + 3 a multiple of 28? True Does 24 divide 1 - 0 - -911(2 + -1)? True Let u be 1138/14 - (-4)/(-14). Let l = 33 + u. Is 8 a factor of (-6)/9l/(-4)? False Let c(m) = 9m - 43. Is c(5) a multiple of 2? True Let c(h) = -2h + 15h*3 - 3h + 11h2 - 16h*3 - 14. Is c(8) a multiple of 23? True Let p(k) = 6k*3 + 5k*2 - 9k + 20. Is 8 a factor of p(4)? True Suppose 5x + 11o - 16o - 1255 = 0, 5x + o = 1249. Is x a multiple of 5? True Let j(z) = 2z + 16. Let u be j(-8). Suppose 0 = -ul - 2l + 316. Let r = -93 + l. Is 17 a factor of r? False Suppose i - 2 + 3 = 0. Is 12 a factor of (i + -9)12/(-10)? True Let g(x) = -2x + 2. Let p be g(-2). Let r = p - 2. Suppose -i = -ri + 48. Is 7 a factor of i? False Suppose -3w + 40 = -w. Let x = w - -16. Is 9 a factor of x? True Suppose -4l + 567 = -2s - 563, l + 4s - 296 = 0. Is l a multiple of 71? True Is 45/(-8 + 11)114 a multiple of 19? True Is 4 a factor of 3/(2/2829)? False Let d(r) = -142r + 134. Is 58 a factor of d(-6)? True Let x = -31 + 32. Suppose 5f = 5, -3f = -v + 2 - 1. Is (-327)/(-12) - x/v a multiple of 14? False Let g(d) = d2 - 10d - 3. Suppose 5f - 5t = 46 + 4, -t = f - 8. Let o be g(f). Is 2 a factor of 1/(-6) - 50/o? True Suppose 5z = -5w + z + 27, 0 = 3w - 3z - 27. Let t(i) = 24i + 7. Is t(w) a multiple of 11? False Let u be 486/3 + -3 - 4. Let p = u - 110. Suppose -2b = l + 2b - p, -4l + b + 129 = 0. Is 11 a factor of l? True Let p(y) = 3y + 12. Let s be p(-8). Let o = 22 - 48. Let l = s - o. Does 6 divide l? False Let q = -52 + 146. Let b = q + 24. Let y = -84 + b. Does 10 divide y? False Is 64 a factor of (-4)/16-268 + -1? False Suppose -4x = 14 - 62. Is 13 a factor of ((-7)/(-6) + (-8)/x)124? False Suppose -13i + 15i - 12 = 0. Does 2 divide i? True Suppose -685 = 11b - 3094. Is b a multiple of 23? False Suppose -t + v = -3v + 6, 2t = v + 2. Let z be -204 + t/40. Is 16 a factor of ((-1)/2)/(2/z)? False Let z be 2241/(-18)(-4)/6. Suppose -2p + 2w + 25 + 1 = 0, 4w = -5p + z. Suppose 5 + p = d. Is 7 a factor of d? False Suppose 0 = -4k + 8 + 20. Suppose 0 = -12g + kg + 30. Does 13 divide 3 + (g/2 - -51)? False Suppose 55 = 3k - 86. Let h = 88 - k. Suppose -3x = -4p - h, -4p - 26 = 4x - 6x. Is x a multiple of 5? True Let g be (-7 - -3)5-4. Let k = -33 + g. Let i = k + -28. Is i a multiple of 10? False Suppose 4m = -3q + 11, -m + 3q - 6q = -5. Is 3 a factor of ((-3)/(-6))/(m/20)? False Let j(c) = -c*2 - 5c + 7. Let t be j(-7). Let r(k) = 7k + k3 + 9k*2 - 2 - 3 + 0. Is 12 a factor of r(t)? False Does 8 divide 22330/116 - (-1)/(-2)? True Let t(v) = 36v*2 + 13v - 5. Does 10 divide t(5)? True Let s(g) be the third derivative of g6/60 - g5/60 - g4/12 + g3/6 - g*2. Suppose 0 = j - f + 1, -2f + 3 + 3 = 0. Is s(j) a multiple of 3? True Let t(w) = 24w2 + 3w - 45. Is 57 a factor of t(5)? True Let s(i) be the first derivative of -5i2/2 - 2i + 17. Is 44 a factor of s(-18)? True Let u = -18 - -29. Suppose 2o - 2 = -3m - 1, 5o = -5m + 10. Suppose og - u = -2w + 39, -w - 53 = -4g. Is 6 a factor of g? True Let z(j) = -j3 - 8j*2 + 43j + 21. Does 15 divide z(-12)? False Suppose 0 = 7n - 3n + 2b - 6, -3n + 2b - 6 = 0. Let g be (0 - n) + (-7 - -9). Let a(i) = 12i - 3. Is a(g) a multiple of 7? True Suppose -27n = -29n + 720. Does 10 divide n? True Let s(n) = n*3 + 6n*2 + n + 3. Let p = 39 - 44. Is 6 a factor of s(p)? False Suppose 17q - 16q = 46. Suppose 0 = -u + 2s + q, 1 = 5s - 4. Is 4 a factor of u? True Suppose 0h = -2h + 4i, -5i = -2h - 1. Suppose -205 = -hc - o, 4o = -5c + o + 513. Is (-32)/12c/(-8) a multiple of 12? False Suppose -2c + 2r = -290, -c + 211 = -2r + 71. Suppose -c = -2m - 0m. Is m a multiple of 12? False Does 19 divide 10/4 - ((-52962)/12)/13? True Let i = 309 - 240. Is 12 a factor of i? False Let t(w) = 94w*2 - w. Is 6 a factor of t(1)? False Let i(f) = -14f - 7. Let v be i(-6). Let r = 140 - v. Is 9 a factor of r? True Suppose -c - 1 = -0c. Let m be ((3 - c)/4)/1. Is 13 a factor of (8/20)/(m/65)? True Suppose -4o + 40 = 2q - 0o, -1 = o. Let y be (7 - 13)/((-4)/q). Does 11 divide 4/4 + y + -1? True Let v = 29 + -44. Let j = 37 + v. Let s = j - 14. Does 8 divide s? True Let r be (21/7)/((-3)/4). Is 11 a factor of (r - -3) + -3 + 48? True Suppose -4051 + 1307 = -14a. Does 7 divide a? True Suppose -5a + 4y = -219, 9y = a + 8y - 44. Is a a multiple of 2? False Let u = -43 + 39. Is 3 a factor of ((-17)/2)/(10/u - -2)? False Let h = 4 - 1. Let n(p) = -4p + 2p - 2p + hp + 18. Is 9 a factor of n(0)? True Does 6 divide 7 + (-11 - -2) - -236? True Suppose s = 5f + 5, -4f + 3s + 0s - 15 = 0. Let z(a) = -a2 + a - 4. Let u be z(f). Is (4 + 5)u/(-3) a multiple of 6? True Let d(y) = 12y2 + 2y - 2. Let l = -8 + 14. Let g = 4 - l. Does 14 divide d(g)? True Suppose 13k - 15k + 10 = 0. Suppose -180 = -l - b, -3l + kb + 729 = l. Is l a multiple of 30? False Suppose 5160 = 99d - 91d. Is 13 a factor of d? False Suppose -6w + 3w + 18 = 0. Let t be 1 + (4 - w)/2. Suppose 0 = -5j + 5, 3r - 266 = -tr - 5j. Is r a multiple of 28? False Suppose -2r = -6r + 432. Suppose z = 7 + r. Does 23 divide z? True Suppose 0 = -5c - 5, 2u = c + 3 + 6. Let q(d) = d*3 + 5d*2 - 6d. Let v be q(-6). Suppose up = -4r + 188, vp + 3p = r - 39. Is 9 a factor of r? True Let o(h) = h*2 - 14. Let j be o(-4). Let l = 10 - j. Is 4 a factor of l? True Let v(l) = 4l*2 + 7l - 10. Let c be v(6). Suppose -3m + 0m - 5g = -257, -g + c = 2m. Is m a multiple of 11? False Let k(d) = 46d2 - 5d - 2. Let c(x) = -1. Let u(v) = -6c(v) + k(v). Is 9 a factor of u(1)? True Let w(q) = -4q - 4q2 + 0 + 6q - 3 - q*3 + 4q. Does 5 divide w(-6)? False Suppose 158b + 2198 = 172b. Is b a multiple of 2? False Let t be 0 + 15/(-5) + 4. Does 29 divide t + 116 + 1 + 4? False Suppose 3u = 4g - 8, 4g + 4 = -4u + 12. Suppose u = n - 61 - 46. Does 29 divide n? False Let n(v) = -11v - 2. Let a be n(-3). Suppose 4b - a = -2d + 5, -36 = -2d + 2b. Does 3 divide 8/3 + 6/d? True Let u = -40 + 24. Let o = u + 20. Suppose 3l = 4z - 246, -178 = -3z + 3*l -	{ "pile_set_name": "DM Mathematics" }
value in q, 1/2, 1, a? 1/2 Let j = -57/250 - 147/1000. What is the third smallest value in -0.15, j, -0.5, 3, -14? j Suppose -88w + 93 + 83 = 0. Which is the fifth biggest value? (a) -5 (b) w (c) -0.2 (d) 3 (e) 2.2 a Suppose -y + 15g + 110 = 19g, -2y + 154 = -14g. What is the fifth smallest value in 2/3, -2/15, y, -1/3, -18? y Let l = 25 + -19. Let w(h) = 2h*2 - 22h + 30. Let a be w(9). Let t be -10 + (30 + a)/4. What is the third biggest value in t, l, -1? t Let i = 3027.7 - 3028. What is the third smallest value in -3.3, i, -2, 0.3? i Let x(q) = 7q2 - 149q + 47. Let v be x(21). Which is the smallest value? (a) 2/9 (b) 0.24 (c) v (d) 2 (e) -2 e Let v = -8634 + 8635. What is the second biggest value in v, -0.2, 16, 2/11, -0.3? v Let q = 1481 + -1296. Let r = q + -190. Let o = 9 - 6. What is the biggest value in 7, o, r? 7 Let m = 0.119 - -49.881. Let h = 49.7 - m. Let t = -86.8 - -87. What is the second biggest value in 1/2, h, -3, t? t Let a = 4708.2 - 4708. What is the second smallest value in 4, 0.52, a, -1/4? a Let p = 6 + -11. Let g = p - 2. Let i(l) = 585l + 5. Let m be i(0). Which is the third smallest value? (a) -3 (b) g (c) m c Let h be ((-896)/(-1680))/((-8)/(-18)). Which is the third smallest value? (a) -0.2 (b) h (c) 0.32 b Let x = 123.9 - 127.9. Let r be (-2)/(-4) + 50/(-84). Which is the second smallest value? (a) r (b) 1 (c) x (d) 2 a Let i = -370 - -741/2. Let n(w) = -2w*2 + 3w + 5. Let p be n(4). Let y be ((-17)/p - 1)/(30/(-50)). Which is the third smallest value? (a) y (b) 1 (c) i b Let v = 112 - 76. Suppose -vs - 4 = -34s. Let z = 118 - 588/5. What is the smallest value in s, z, 0.1? s Let s(i) = -i*2 - 120i - 2816. Let m be s(-32). Which is the biggest value? (a) -0.5 (b) m (c) -0.111 (d) 0.5 (e) 4 e Let u = -369/2 - -2577/14. Let n(h) = -4h2 - 1. Let y be n(1). Which is the third biggest value? (a) 2 (b) 5/2 (c) u (d) y c Let n = 2697/25 + -16207/150. Let l be 1/(-2) + -1 - -1. What is the biggest value in 8, n, l? 8 Let i = -6 - -2. Let q = -0.0159 - -1.0159. Let k be ((-6)/8)/(-15(-1)/40). What is the third biggest value in i, k, q? i Let f = -20.2722 + 17.2722. Let o = 5/3 - 0. Let i = 0.2 - -0.3. Which is the third biggest value? (a) f (b) o (c) i a Suppose -2f + 1 = 3p, -3f - 5p - 3 = -2f. Let j be (f/(-55))/((-3)/(-372)) - -3. Let q = j + 10/11. What is the biggest value in q, 8, 1/6, -2/9? 8 Let v = -6708/5 - -1342. Let q = -0.5 - -0.1. Which is the second smallest value? (a) 0.3 (b) q (c) v a Let v = -2.5567 + 2.1567. What is the fifth smallest value in 1, 0.4, 5, v, 31? 31 Let z = -41 - -31. Let f = -9.5 - z. Let t = -1118/2475 + 2/275. Which is the second biggest value? (a) 0 (b) f (c) t a Let s = -30220 - -30220.5. Let q = -22 - -21.91. What is the second biggest value in -1/8, s, q, -1/3? q Suppose 5r - 827 = -4t + 533, -t = -5r - 340. Let i = t - 4761/14. What is the second smallest value in i, -3, 4? i Let q = -9397 + 9396.6. What is the fourth biggest value in 0.3, -0.22, 5/4, q, 3? -0.22 Let v be (-2 - 13/(-7))/1. Let y = 48 + -44. Suppose -84i + 100i + 144 = 0. Which is the second smallest value? (a) i (b) v (c) y (d) -4 d Let x be 50/48 + 56/(-120) + 14/(-70). What is the third smallest value in -5, -0.3, x, 3/2? x Suppose -15k + 72 = 42. Let l be (-8)/(-5) - (0/3 + k). Which is the second biggest value? (a) 1 (b) -0.3 (c) l (d) 3 a Let v(m) = 3m*2 - 170m + 423. Let x be v(54). Which is the third smallest value? (a) -4 (b) x (c) 1 c Let b = -2/3009 + -1671/1003. Let v = -1685/17 + 99. Let c = -6.3 + 6. What is the smallest value in b, c, 0.3, v? b Let v be 26/(-6) + (-16)/(-4). Let t = -548/3 + 544/3. Let u = -477/19 - -25. Which is the third smallest value? (a) -0.4 (b) t (c) v (d) u c Suppose 5w + 4n - 15 = 30, -4w - 4n + 36 = 0. Let g be (-1 + 4)13/((-39)/4). What is the biggest value in -2, 0.3, w, g? w Let y = 0.3 + -0.2. Let s = 247334 + -247331. Which is the biggest value? (a) s (b) -0.2 (c) 2/93 (d) y a Let o be ((16 - 16)3/(-6))/(-1). What is the fourth smallest value in 1, o, -18, 49/6? 49/6 Let d = 0.1879 - -1.8121. Let u(v) = -v*2 + 8v - 8. Let y be u(6). Let p be (-9)/(27/(-6)) + -1. What is the second biggest value in p, y, d, 2/15? d Let j = -2 + 5. Suppose -14 = -128o + 132o - 2s, -o = s - 13. Let r = 4 - 8. Which is the fourth biggest value? (a) j (b) o (c) 0 (d) r d Let u = -54 + 1240/23. Let w = -2.52 - -2.72. What is the third biggest value in u, -0.4, -2/17, w? -2/17 Let m = -2223.1 + 2223.2. Which is the third smallest value? (a) 0.5 (b) 39/2 (c) m b Let r = 1398 - 1393. Let n = 67 + -67.5. Which is the second biggest value? (a) r (b) n (c) 163 a Let g = -3110 - -3055. Which is the second smallest value? (a) 2 (b) g (c) -2/3 c Let d = 0.552 + -0.052. Let b = 2 - 4. Let m = 0.5735 + 0.4265. What is the fourth biggest value in d, b, 0.07, m? b Let f be (-82440)/(-171) - (-1 + 6). Let k = 477 - f. Which is the second biggest value? (a) k (b) 2/21 (c) 5 (d) -1/12 b Let t = -0.35334 + -0.04666. Which is the biggest value? (a) 2/37 (b) 1 (c) 2 (d) 0.07 (e) t c Let f = 83 + -3. Let t = f + -84. What is the third smallest value in 6, -3/4, -2, t? -3/4 Let m be 6(377/2)/13. Let w = m - 82. Which is the second smallest value? (a) w (b) 0 (c) 2/9 (d) -2 b Let o = 0.786 - 0.486. Which is the third smallest value? (a) o (b) -1/15 (c) -4 (d) 0.02 d Let t = -32 - -35. Let k = 6.4 + -6.37. What is the third biggest value in t, k, 0? 0 Let c = 2761.7 + -2762. What is the biggest value in c, 0.4, 0.1, -210? 0.4 Let l = -4/993 - -1328/993. Which is the smallest value? (a) 0.2 (b) -2/5 (c) -6.6 (d) l c Let l = -0.0713 + -0.4287. Let g = -98 + 129. Which is the second smallest value? (a) g (b) 3 (c) l b Let h = 0.04305 - 0.04305. What is the smallest value in 3/4, -4, h, 74? -4 Let a = 2/15 + -292/1965. What is the second biggest value in -0.3, 1/3, 1/4, a? 1/4 Let v = -4 - -4.01. Let t = 19/694 + -929399/4858. Let h = t + 191. Which is the biggest value? (a) v (b) h (c) -4 (d) 0.2 d Let j = -0.36 + 0.06. Let z = -33976 + 34007. What is the third biggest value in j, 0.5, z? j Let x = 3.28 + -2.24. Let g = x - 1.34. Which is the second smallest value? (a) -0.1 (b) 4 (c) 1 (d) g a Let y = -2.2 + -6.8. Let h be 210/(-126)((-24)/(-15))/(-4). What is the fourth biggest value in 5, -0.3, h, y? y Suppose 71 + 9 = -8q. Let y be 12/q(3 - (-60)/(-18)). Let w be 6/(-2) - (-105)/33. Which is the third biggest value? (a) -2 (b) -5 (c) w (d) y a Let s = -5/406 - 347/37758. Let t(m) = m2 + 44m + 162. Let c be t(-4). What is the smallest value in c, s, -0.3, -2/7? -0.3 Let p = 89.2 - 88. Let w = p - 75.2. Let j = -70 - w. Which is the biggest value? (a) 3 (b) j (c) -2 b Let m = -33 - -35.75. Let t = m + -33.75. What is the second smallest value in -1, 3/7, t, 5? -1 Let n = -39 + 44. Let i = 8 - 8. Let p = i + -5. Which is the fourth smallest value? (a) 19 (b) p (c) -0.3 (d) n a Let x = 148 + -1038/7. Let s = -19357 + 19357.05. What is the fourth smallest value in x, -4, 3, s? 3 Let v = 20.7462 + 0.2538. Which is the smallest value? (a) 2 (b) 5 (c) 2/7 (d) v (e) -5 e Let y = 0.14 - -0.05. Let v = -944.2 + 943.2. Which is the fourth biggest value? (a) y (b) 0.3 (c) v (d) 4 c Let z = -233.4 + 233.2. Which is the second smallest value? (a) z (b) -1 (c) -1.81 (d) 5 b Let v = -81 + 244/3. Let w = -41.07 + 41. Which is the fourth biggest value? (a) w (b) v (c) -3 (d) 3 c Suppose 0p = 4p - 6016. Let y be p/(-10) - (-20)/50. Let o be (-4)/(-8) + y/292. Which is the third biggest value? (a) 3 (b) o (c) 0 b Let x = 479 - 480.79. Let f = 1.59 + x. Which is the third biggest value? (a) 0 (b) 1/6 (c) f (d) -5 c Let b be 3/1(-9)/(-405)-5. Let h = -55 + 55. What is the fourth biggest value in b, h, 5, 2/3? b Let o = -6 + 3. Let v = -2532 + 1309. Let u = -1222.9 - v. Which is the second biggest value? (a) 0.4 (b) o (c) u (d) -3/4 c Let n be (3 - (-6805)/20 - -2)/1. Let z = -346 + n. Which is the fourth smallest value? (a) -0.5 (b) z (c) 2/53 (d) -0.2 c Let a = -13.124 + 10.124. What is the fourth smallest value in -0.137, -12	{ "pile_set_name": "DM Mathematics" }
picked without replacement from {y: 2, t: 5, z: 9, a: 2}. What is prob of sequence zt? 5/34 Three letters picked without replacement from {w: 6, t: 7}. Give prob of sequence wwt. 35/286 Calculate prob of sequence cqcq when four letters picked without replacement from cqqqc. 1/10 What is prob of sequence zvzz when four letters picked without replacement from {v: 11, z: 5}? 11/728 What is prob of sequence vv when two letters picked without replacement from vcgbsbbbcvavgaavg? 3/68 Three letters picked without replacement from {z: 1, x: 1, r: 1, m: 1, p: 1}. What is prob of sequence mxp? 1/60 Calculate prob of sequence mx when two letters picked without replacement from xmxxxxmxxx. 8/45 Calculate prob of sequence uwi when three letters picked without replacement from {f: 1, u: 11, w: 1, i: 2}. 11/1365 What is prob of sequence uq when two letters picked without replacement from uequuuuuuueuuupuu? 13/272 Four letters picked without replacement from {x: 3, y: 9, s: 2, o: 3}. What is prob of sequence yxyo? 27/2380 What is prob of sequence tptp when four letters picked without replacement from ppppttpt? 1/14 Three letters picked without replacement from {i: 8, z: 5}. Give prob of sequence zii. 70/429 Calculate prob of sequence cz when two letters picked without replacement from lclzczlz. 3/28 What is prob of sequence teet when four letters picked without replacement from tttttteettttettttttt? 4/285 What is prob of sequence vcji when four letters picked without replacement from {v: 3, c: 1, j: 1, r: 1, i: 1}? 1/280 Four letters picked without replacement from ttkxqfkkkktkk. Give prob of sequence tkkk. 21/572 Two letters picked without replacement from xuukuaukxkaakkk. What is prob of sequence xk? 2/35 Two letters picked without replacement from acacdawpwadwccaawwc. Give prob of sequence wc. 25/342 Calculate prob of sequence tatt when four letters picked without replacement from ttat. 1/4 Calculate prob of sequence ci when two letters picked without replacement from {i: 2, c: 1, e: 2}. 1/10 What is prob of sequence vfv when three letters picked without replacement from wgwvfvgggrwfgfwwwg? 1/816 Calculate prob of sequence ey when two letters picked without replacement from yneccvxy. 1/28 What is prob of sequence sx when two letters picked without replacement from {y: 1, x: 9, s: 4}? 18/91 Three letters picked without replacement from {c: 2, l: 2, o: 2}. Give prob of sequence loc. 1/15 What is prob of sequence wfw when three letters picked without replacement from {f: 4, u: 9, w: 3}? 1/140 Calculate prob of sequence zyy when three letters picked without replacement from zzzyzyzyzyynzzn. 16/273 Three letters picked without replacement from {t: 2, k: 1, r: 1, s: 3}. What is prob of sequence srk? 1/70 Calculate prob of sequence ctc when three letters picked without replacement from {t: 1, c: 12}. 1/13 What is prob of sequence gygy when four letters picked without replacement from {y: 4, q: 6, g: 4, h: 5}? 1/646 Calculate prob of sequence jjc when three letters picked without replacement from {j: 11, w: 3, m: 1, c: 5}. 55/684 Four letters picked without replacement from rrrrggggggg. What is prob of sequence rggg? 7/66 Calculate prob of sequence iim when three letters picked without replacement from miimmiimii. 1/6 What is prob of sequence hw when two letters picked without replacement from {w: 1, c: 4, h: 8}? 2/39 What is prob of sequence ddqf when four letters picked without replacement from fzfffqfqqqffdqzzq? 0 Four letters picked without replacement from ekeseeeiiwwiweewisig. What is prob of sequence iews? 7/2907 Three letters picked without replacement from {j: 1, z: 2, k: 6, e: 3, d: 3}. Give prob of sequence jke. 3/455 What is prob of sequence ppy when three letters picked without replacement from {v: 1, y: 6, r: 2, p: 3}? 3/110 What is prob of sequence jjjj when four letters picked without replacement from tjjttjjtjjtjtt? 5/143 Three letters picked without replacement from {g: 2, i: 2, m: 1, s: 1, f: 1}. Give prob of sequence mfg. 1/105 Calculate prob of sequence xg when two letters picked without replacement from xgss. 1/12 What is prob of sequence yi when two letters picked without replacement from ycbytbybbibbcbiy? 1/30 Calculate prob of sequence bfb when three letters picked without replacement from fbbfxxbbbxfbbx. 3/52 Four letters picked without replacement from {y: 1, a: 3, w: 1, n: 1, q: 1}. What is prob of sequence aywq? 1/280 Calculate prob of sequence ccxu when four letters picked without replacement from huxxxiixuhxxhxxhcccf. 4/4845 Three letters picked without replacement from {q: 2, x: 1, h: 2, i: 1}. Give prob of sequence hqh. 1/30 Two letters picked without replacement from kkkkgkgggxkkkk. What is prob of sequence kk? 36/91 Four letters picked without replacement from {o: 7, w: 6, c: 1, e: 1}. What is prob of sequence ecww? 1/1092 What is prob of sequence sus when three letters picked without replacement from {u: 6, s: 12}? 11/68 Three letters picked without replacement from fttlleftldelhlhhdl. What is prob of sequence dhh? 1/408 Three letters picked without replacement from xeex. Give prob of sequence xex. 1/6 Four letters picked without replacement from {y: 4, d: 10}. Give prob of sequence dyyd. 45/1001 Three letters picked without replacement from mprerhpeeprrprmr. What is prob of sequence mrh? 1/280 Two letters picked without replacement from {c: 2, z: 1, i: 1, j: 2, w: 1}. Give prob of sequence ci. 1/21 Two letters picked without replacement from {e: 2, n: 3, x: 3, h: 4, z: 2, s: 2}. Give prob of sequence nn. 1/40 Three letters picked without replacement from {k: 2, h: 10, w: 3}. Give prob of sequence wwh. 2/91 What is prob of sequence qe when two letters picked without replacement from {d: 2, e: 1, q: 1}? 1/12 What is prob of sequence sf when two letters picked without replacement from {s: 2, v: 3, f: 5, z: 3}? 5/78 Three letters picked without replacement from wqqqoyoqjyjxox. Give prob of sequence oqw. 1/182 Two letters picked without replacement from {c: 5, q: 14}. Give prob of sequence qc. 35/171 What is prob of sequence eo when two letters picked without replacement from {r: 4, e: 1, a: 1, o: 2}? 1/28 What is prob of sequence mlml when four letters picked without replacement from lllaalmlm? 5/378 Four letters picked without replacement from {x: 3, c: 1}. Give prob of sequence xcxx. 1/4 Calculate prob of sequence vbv when three letters picked without replacement from nbnvzjvvnbvnvbbbbbbb. 1/38 Three letters picked without replacement from {q: 3, a: 6, o: 4, e: 2}. What is prob of sequence aao? 4/91 What is prob of sequence adh when three letters picked without replacement from bazdh? 1/60 Four letters picked without replacement from {g: 4, h: 3}. What is prob of sequence gghh? 3/35 Two letters picked without replacement from rrrrrrrrrrrrtrrtrrr. What is prob of sequence rt? 17/171 Two letters picked without replacement from eqqqqqqsaqqllse. What is prob of sequence ql? 8/105 What is prob of sequence ggg when three letters picked without replacement from qqqgqgchgqgggqqqgq? 35/816 Three letters picked without replacement from {l: 5, h: 1, s: 4, t: 3}. What is prob of sequence sth? 1/143 Two letters picked without replacement from zrvvrsarzbz. What is prob of sequence sa? 1/110 Calculate prob of sequence op when two letters picked without replacement from {p: 1, o: 14}. 1/15 Calculate prob of sequence bybb when four letters picked without replacement from {y: 3, b: 15}. 91/816 Two letters picked without replacement from {x: 7, r: 7}. Give prob of sequence xr. 7/26 Two letters picked without replacement from {p: 5, e: 6, r: 5, z: 1}. Give prob of sequence ze. 3/136 Three letters picked without replacement from {d: 3, l: 12}. What is prob of sequence ddd? 1/455 Calculate prob of sequence wsu when three letters picked without replacement from uwseswwywauu. 1/55 What is prob of sequence ccnn when four letters picked without replacement from cnscscccnsnn? 2/99 Two letters picked without replacement from jhytyyhyhyhytyy. What is prob of sequence th? 4/105 Calculate prob of sequence ull when three letters picked without replacement from ulflfullulfff. 5/143 Four letters picked without replacement from {a: 2, j: 3, i: 7}. What is pr	{ "pile_set_name": "DM Mathematics" }
4u - 31 = -3c. Suppose -s + 2g = -18590, 2g + 38314 = cs - 54676. What is s rounded to the nearest one thousand? 19000 Let u = 2413800922128.9499889 - 2413801080248. Let b = u - -158119. Let m = b - -0.05. Round m to six decimal places. -0.000011 Let q = -8436 - -8365.38. Let h = q + 70. Round h to one decimal place. -0.6 Let q = -54 + 95. Let o = -22 + q. Round o to the nearest 10. 20 Let p(h) = -2h - 7. Let f be p(-6). Suppose k - 1548 = -fu, -2k + 616 = 2u - 0k. Round u to the nearest one hundred. 300 Let o = 3 - 2.8. Let z = o + -1.2. Let f = z - -1.18. What is f rounded to 1 dp? 0.2 Let f = -6 - -5.975. Let k = f + -6.675. Round k to the nearest integer. -7 Let h = 50.673 + -50.94869. Let n = 0.105634 + h. Let c = n - -0.17. Round c to 5 dps. -0.00006 Let n = -1.29 - 0.81. Let x = 5735079 - 5735076.9000045. Let b = x + n. Round b to 6 decimal places. -0.000005 Let h = 0 + -0.1. Let r = 0 - h. Let y = -0.09999936 + r. Round y to 7 dps. 0.0000006 Let f = -0.13 - -0.123. Let z = f - -0.0070037. What is z rounded to six decimal places? 0.000004 Let b = 29.5252 - 26.723. Let f = b + -2.8. Round f to 3 decimal places. 0.002 Let y(f) = -282499f2 - 7f + 6. Let o be y(6). Round o to the nearest one million. -10000000 Let y = -10.8719 + -37.0791. Let o = -25 + -23. Let r = o - y. What is r rounded to two dps? -0.05 Let u = 3 - 5. Let p = u + 1. Let n = 1.000025 + p. Round n to 5 dps. 0.00003 Suppose 35k = 34k + 8200. Round k to the nearest 1000. 8000 Suppose 3d + 5g + 5080015 = -d, -15 = 5g. Round d to the nearest one hundred thousand. -1300000 Let d = -0.029 + 43.029. Let u = -43.059 + d. Round u to 2 dps. -0.06 Let y = -28.401 - -29. Let w = -4.4 + 5. Let i = y - w. What is i rounded to two dps? 0 Let n(u) = -142508u + 32. Let t be n(4). What is t rounded to the nearest one hundred thousand? -600000 Let b = 6.1 - -26.3. What is b rounded to the nearest ten? 30 Let l = 2 + -2. Suppose 0 = -4a - la - 8. Let m = -2 - a. What is m rounded to five dps? 0 Let u = 100.7 + -522.7. Let c = 433.54 + u. Let b = c + -11. Round b to 1 dp. 0.5 Let v(f) = 7f3 + 23f*2 - 6f - 12. Let i be v(-16). What is i rounded to the nearest 1000? -23000 Let p be 2/8 - 1/4. Let t(o) = -o*2 + o - 2. Let u be t(p). Let y be 122(0 + 1 + u). Round y to the nearest 10. -120 Let h = -0.1071262 + 74.1110262. Let s = 0.088 + 73.912. Let b = h - s. What is b rounded to three decimal places? 0.004 Let t = 626.87 + -5.87. Let f = 581.3 - t. Let w = f - -38. What is w rounded to the nearest integer? -2 Let z = -303.87 + 306. What is z rounded to one dp? 2.1 Let k = 0.84 + -0.994. Round k to two dps. -0.15 Let r = -6 + 8. Suppose x - 426491 = -5k, 2x + rx - 85302 = -k. Suppose 0 = 2g - 34702 - k. What is g rounded to the nearest one hundred thousand? 100000 Let c = -189.7 + 176. What is c rounded to the nearest integer? -14 Let v(f) = f*2 - 5f + 4. Let g be v(5). Suppose n - g = -6. What is n rounded to the nearest 10? 0 Let v = -4 - -4. Suppose 6 = -3c - v. Let m = c + 2. Round m to seven decimal places. 0 Let x = 12 - 27. Let l = x - -14.99999935. What is l rounded to 7 dps? -0.0000007 Suppose -5l + y + 11732 = -1624, -2y - 8008 = -3l. Let k = -272 + l. What is k rounded to the nearest one thousand? 2000 Let s be 68/(-6)(4 - 244). Suppose 0 = -5y, -l - l = 3y + s. Round l to the nearest 100. -1400 Let u = -5.4 - -5.3999963. Round u to six dps. -0.000004 Let x(i) = -i3 - 6i*2 - 6i + 10. Let p be x(-7). Suppose -2q + 1 = p. Round q to the nearest 10. -50 Suppose -2v - 4u = -3u + 88599996, -v + u - 44300004 = 0. Round v to the nearest 1000000. -44000000 Let u = -214 + 394. Suppose r + 5p - 133 = 0, -2p = 2r + 40 - 298. Let h = u - r. Round h to the nearest 10. 50 Let t = 1570645.93 - 1570663.92999974. Let c = 13 - 31. Let m = t - c. Round m to 7 decimal places. 0.0000003 Suppose -4 = -3w + 2i - 3, 0 = -4w - 2i + 6. Let z be (w - 1/2)-2. Let t(d) = -d*3 - 2d*2 + 1. Let p be t(z). Round p to 2 decimal places. 0 Let d = 11484 + 3216. Round d to the nearest 1000. 15000 Let f = -1489.3 - -1583. Let l = -1.29 - 85.71. Let m = f + l. Round m to the nearest integer. 7 Let z(k) = -4k*3 + 7k*2 - 5k + 2. Let l be z(9). Let c be (-4)/(-6) + l/(-12). What is c rounded to the nearest 1000? 0 Let y = -9.99993 - -10. What is y rounded to five dps? 0.00007 Let f(z) = 4z3 + 4z + 6. Let t be f(6). Let j = t - -6. Round j to the nearest one thousand. 1000 Let o = 4.6 + -0.6. Let z = 4.0008 - o. What is z rounded to four dps? 0.0008 Let c = 17723 + -17724.0001. Let p = c + 1. Let x = p + 0. What is x rounded to four decimal places? -0.0001 Let k = -0.0032 + -17525.9968. Let m = k - -17468.155. Let l = m - -58. What is l rounded to two decimal places? 0.16 Let k = 50 - 46.9. Round k to the nearest 10. 0 Let q = -0.55 - 0.73. Let i = -1.173 - q. What is i rounded to 2 dps? 0.11 Let j be 1 + -2 + -2 + 1. Let s(i) be the second derivative of 103i4/12 + i3/3 + i2 + i. Let n be s(j). What is n rounded to the nearest 100? 400 Let u be 36/(-45) - 3/((-30)/(-472)). Round u to the nearest ten. -50 Let h = -0.16 + -6.84. Let v = h + 6.27. Round v to one dp. -0.7 Let m(b) = -71999b*2 - 5b. Let t be m(5). Round t to the nearest 1000000. -2000000 Let r = 9.0000012 + -9. What is r rounded to six decimal places? 0.000001 Let z be (-5253)/(-5) + 3/(-5). Let h be 2/8 - z/40. Round h to the nearest 10. -30 Let v = 62 - 61.99999948. What is v rounded to 7 decimal places? 0.0000005 Let h be ((-3)/(-2))/((-8)/(-16)). Suppose -hu + 280 = -0u - 2k, -u = -3k - 84. Round u to the nearest ten. 100 Let p = -1.5 + 0.72. What is p rounded to one dp? -0.8 Let m = -45.0000025 + 45. What is m rounded to six decimal places? -0.000003 Let m = 0 - -0.01. Round m to two decimal places. 0.01 Let q = 45690 - 45618.942. Let a = -187 + 116. Let i = a + q. What is i rounded to 2 dps? 0.06 Let i = 0.25 - 0.5. Let f = i - -0.2. Round f to two dps. -0.05 Let d be 28/(-21)3/(-2). Let g be 260440 + (-2)/d + 1. Let j = -177440 + g. Round j to the nearest ten thousand. 80000 Let a = 162 - 161.9998981. What is a rounded to 5 decimal places? 0.0001 Suppose 4i - 8i = -2k + 51600, 4k = i + 103200. Suppose 4d - d - k = 0. Round d to the nearest one thousand. 9000 Let n = -710.05046 + -188.25144. Let g = n + 902. Let t = g - 3.7. Round t to three decimal places. -0.002 Let q = 4.6 - 1. What is q rounded to the nearest integer? 4 Let n = 7 - 3. Let r(p) = -n + 2001p + 0 - 4. Let g be r(8). Round g to the nearest 10000. 20000 Let o = 45.0000018 - 45. What is o rounded to six decimal places? 0.000002 Let r = 194.49 - -1.51. Let u = 79 - r. Let z = u - -116.99909. Round z to 4 dps. -0.0009 Let z = 0.02 - 0.14. Let t = z - -0.07. Round t to 1 decimal place. -0.1 Let w = -382.717 - -383. What is w rounded to one dp? 0.3 Let n(v) = v2 + v + 560000. Let p be n(0). Round p to the nearest one hundred thousand. 600000 Let h = -47 - -47.0047. What is h rounded to three dps? 0.005 Let m(c) = 36800c*3 - 2c + 10. Let o be m(5). What is o rounded to the nearest 1000000? 5000000 Let b = -0.95425226 + 0.995253. Let u = -34.041 + 34. Let g = u + b. What is g rounded to 7 dps? 0.0000007 Suppose 5i - 19606 = -3601. Suppose -3a = 2a - 50505. Let o = a - i. Round o to the nearest one thousand. 7000 Let g = -15853.4 + 15860.8887. Let u = -7.5 + g. What is u rounded to three decimal places? -0.011 Suppose 150000 = 10x - 8x. What is x rounded to the nearest ten thousand? 80000 Let j = -0.0824 - -0.079. Round j to three dps. -0.003 Let v = -33.99885 - -34. What is v rounded to 4 dps? 0.0012 Suppose -3m - 8026616 = -586616. Round m to the nearest one million. -2000000 Let x = 14.9275372633 + 0.0724632867. Let u = -15 + x. Round u to seven dps. 0.0000006 Let t be -2513/((-13)/(-2320)). Round t to the nearest ten thousand. -60000 Suppose 0 = -5z - g + 176999, -2z + g = z - 106201. What is z rounded to the nearest ten thousand? 40000 Let a = -52.741263 - -62.14108. Let o = 9.4 - a. Round o to five decimal places. 0.00018 Let s be -6((-110000)/12)/(-5). Round s to the nearest 10000. -10000 Let h = 207 - 252.8. Let x = h - 12.2. Let n = x - -57.19. What is n rounded to 1 dp? -0.8 Let	{ "pile_set_name": "DM Mathematics" }
Solve -4d - k + i = -4k, 4d = -rk + 24 for d. 4 Suppose 0 = 6x - 983 + 641. Suppose 2m + 3m - 4r = -274, 5m + 3r = -267. Let o = m + x. Solve 16 = 2y - 4g, -y = 3y - og - 7 for y. -2 Let l be 20/24 - 6305/(-390). Solve 9o - 8o + l = -2p, -4o = -p + 14 for o. -5 Let v be 3 - ((-2)/(-5) + 4048/(-20)). Let h = -201 + v. Let t be ((-4)/(-5))/(2/5). Solve -hx + 7 = -3j - 6, -tj - 7 = -x for j. -3 Suppose 473 = 2y + 469. Solve -2 = 5c - j, -4c - j - y = -4 for c. 0 Let q(c) be the first derivative of -c*4/4 + 37c*3/3 + 29c*2/2 + 347c - 254. Let a be q(38). Solve 3n + 0u + 24 = 3u, 0 = -5n - au for n. -4 Let o be 2 - ((-1)/(-4) + -2) - (-561)/2244. Let q = -5 - -4. Let x be (q - -1)2/6. Solve x = -3j - y - 1, -j - oy + 3 = -15 for j. -2 Let s be (-8)/3((-175)/308 - 2/11). Solve sk = 5x + 7, -2x + 4x + 2 = k for k. -4 Let t(k) = 66k - 2037. Let b be t(31). Solve -a - 6w - 1 = -7w, -w = 4a + b for a. -2 Let r = 336 + 190. Let g = -518 + r. Solve -3n - 4v - 4 = 0, 3v + v + g = -2n for n. 4 Suppose 14g + 41g - 186 = -7g. Solve z = gu - 9, -5z = 5u + 5 - 0 for u. 2 Let r be 5/((-5)/(-22 - 3)). Suppose -9 + r = 4g. Let t be (10/8)/(9/252). Solve -gi - t = -x - 2x, -2x = -4i - 30 for i. -5 Suppose -15z = -27 - 63. Suppose -2r = z, 15n - 10n + 3r = 11. Solve 5p + 25 = -3t, -10 = nt - 5p - 0 for t. -5 Suppose 1461c = 1463c - 5w - 331, -c + 5w = -168. Solve -3a - 11 = -s, -158s + cs - 2a = -10 for s. -4 Let o be (-5)/((-125)/20) - (-95)/(-25). Let i(j) = -j3 - 3j*2 + j + 7. Let s be i(o). Solve -3g = -n, 0 = 3n + 2n - sg for n. 0 Suppose -141 = -4h + 67. Let z be (h/39)/(3(-2)/(-9)). Let y(w) = w + 24. Let v be y(-18). Solve 15 = -3l - 0j + zj, v = 3l + 5j for l. -3 Let f(y) = -y*3 - 31y*2 + y + 35. Let g(r) = -9r*2 + 13r - 21. Let v be g(2). Let c be f(v). Solve -cm = 5p - 12, p - 3m + 6 = -3 for p. 0 Let r be (14 + 16)(16/6)/4. Suppose 5g - r = 9n - 4n, -4g - 5n = 20. Solve -2y + 4u + 8 + 8 = g, 2y + 5u + 20 = 0 for y. 0 Let c be (-2919)/(-695) - 3/15. Solve 8l - 6l + 3 = -3n, -cl - 3 = 5n for n. -3 Let w be (4/(-20))/((-8)/360). Let v be (5 + (-69)/w)(-4 + 1). Solve -3j + j + 3 = -3a, 3j = a + v for a. 1 Let n(d) = -d3 - d2 - d - 1. Let q be (0 - (5 + -4))-1. Suppose -13o + q = 14. Let f be n(o). Solve f = 3i + 4r + 24, -8r - 35 = 5i - 3r for i. -4 Let y(u) = u3 + 17u*2 + 74u + 48. Let i be y(-6). Solve -3o - 4x - 3 = i, 9o + 2x - 21 = 12o for o. -5 Suppose 26 - 5 = 7c. Suppose -cm = -y - 5m, -40 = -3y + 2m. Solve 2h + 2 = 3l + y, 2h + 5l = -24 for h. -2 Let z(s) = -s*3 - 7s*2 - 7s - 6. Let l be z(-6). Suppose 0 = -2d - 0d + k + 410, k + 822 = 4d. Let j = d + -205. Solve 2t = l, t - 1 = -i + j for i. 2 Let l = 25 - 21. Suppose 41 - 33 = ls. Solve 2p + 2p = 2d + 18, 0 = sd + 2p for d. -3 Let k be 8 - 0/((-6)/(-3)). Suppose 35y = 132 + 183. Let i(n) = 3n - 14. Let b be i(6). Solve -2t = 5z + 25, -bt + z - k = y for t. -5 Let o(s) = -396s - s*2 + 819s - 407s - 36. Let z be o(13). Suppose -k - 17 = 5w, 2k = 4k + 4w + 10. Solve -zv = 4u + 15, -2u - u = kv + 12 for v. -1 Let o be 3/(3/81). Suppose -11k + 10k + 2 = 0. Solve 0 = -3g + d + k, -13 = -4g + 5d + o for g. -1 Let i(x) = 619x*2 - 3x. Let a be i(1). Let n = a + -569. Solve 5c + 5d - n = -12, 3c + d = 11 for c. 2 Suppose -a + 8 = 3z, 0 = 3z + 18a - 21a - 12. Solve -zw = -3y + 24, -3y + 14 = -5w - 20 for y. 3 Let t(m) = m2 + 702m - 8565. Let d be t(12). Solve 0 = 3s - 3j + 18 - 27, dj + 15 = 5s for s. 3 Let x = -640 - -646. Suppose 0 = -d - o + 5, -o + x - 5 = -d. Solve -dg + 4 = -4v, 0g + 5v + 2 = g for g. 2 Suppose 44 = -22b - 26b + 140. Solve 0 = 5q + 2y + 17, q + 5 = -4y + by for q. -3 Let b = -225 - -226. Let o be (-12 - -13)/((-3)/(b-15)). Suppose -3l - 9 = -2x - x, -4l = 0. Solve 5d = -4u + 8, od - 2 = -xu + 2u for u. 2 Let o(u) = u3 + 6u*2 - 14u - 93. Let w be o(-5). Solve 7q = 3q + j + 10, -4q = wj - 4 for q. 2 Let l be (2/6)/((-4)/(-12)). Let k = -809 - -813. Suppose -kg = -l - 31. Solve 3r = -u - r - 11, 2u = -r - g for u. -3 Let h(o) = 251o + 9803. Let x be h(-39). Solve -5z = 4d - 16, 21 = xz - 10z - 5d for z. 4 Let k = 11338 + -11328. Solve -4l - 24 = -4b, -5l + 2b + 9 = -kl for l. -3 Let f be 1/(-9) + 75 + -75 - (-185)/45. Solve -2v - 89 = -fd - 95, -3d + 3 = -3v for d. -4 Let w = -42952 + 42955. Solve i + 1 = s, 0 = -2i - 15s + 16s - w for i. -2 Suppose 0 = 11w - 13w + 208. Let h be w/(-130) - 14/(-5). Solve 5i + hr = 14, 2i - 2 + 6 = -4r for i. 4 Let g = -3697 + 3702. Solve -3 = -u + 2k, u + 14 = -k + g for u. -5 Let q = 162 - 160. Suppose -qp - 4j = -5p + 24, 4 = 4p + 4j. Solve 2w - 4w + 3i = -4, 3w - pi = 6 for w. 2 Suppose 15t = 16t + 5g + 7, 2g = 3t - 13. Solve 0 = ta + z + 2 + 11, 4z = a for a. -4 Let k = -7144 - -7146. Solve -17 = 3l - a - 4, kl = 5a - 13 for l. -4 Let j be (19 + 2)(-2)/(-6). Solve 4q + 7n + 27 = 4n, 0 = -q + 2n + j for q. -3 Let g be (-3 - (-2 + -910))1. Let o = g - 89. Let u = 8 - 7. Solve 3z = 5y - 3, 5y + oz - u = z for y. 0 Let o = 860 + -820. Let k be (9 - 390/o)(-4 + 0). Solve u + ku - 1 = 3q, -3q + 3u = 0 for q. 1 Let k = -46 - -45. Let c be -2 + (-5)/k - 3. Solve cu - u + 9 = -2j, 4u + 5j + 3 = 0 for u. 3 Let a be (-102)/1071 - 1/((-42)/508). Solve -n + 1 = q + 7, -2n + a = -4q for n. -2 Let v be (-1 - -2) + 1 + 28. Let w be ((-1)/1)/(8 - (-530)/(-66)). Suppose vq = wq. Solve -4f + r - 8 = q, -7r - 28 = 4f - 3r for f. -3 Suppose -5d + 28 = -d. Let q = -440 + 440. Suppose q = -dr + 3r. Solve 0 = -5n + 3w + 18, n - 6n + 5w + 20 = r for n. 3 Let r be (-36)/(-45) - 9/5-29. Suppose 3k - 4u - r = -7, u - 55 = -4k. Let s be 0 + 4/k + 36/21. Solve 0 = -n - 2t - 6, n - st = t + 19 for n. 4 Suppose -74v = -71v - 3. Let m be ((-1)/v)/((-4)/20). Suppose -2h + 9 = 5. Solve hu - m = -5y - u, -5y - 4u + 5 = 0 for y. 1 Let d = -6445 + 6447. Let m(y) = -y - 8. Let t be m(-7). Let u be ((-38 + t)/3)/(-1). Solve -dj = 3b - 0j - u, 0 = 3b - 5j + 22 for b. 1 Suppose 3f = 5h - 152, -h - 2h + 248 = -5f. Let r = -710 + 763. Let u = f + r. Solve b = -ud - 11 - 5, b + 10 = -2d for b. -4 Let u = 165 + -9. Suppose -5n + u = 8n. Let s be (0 + -3)/(-1)n. Solve 6 + 14 = 4b, -4r - 4b + s = 0 for r. 4 Let s = 18949 + -18947. Solve 5t + 103 - 127 = 3w, -st + 3w = -15 for t. 3 Suppose 26547 = 459q - 22916 - 9748. Solve 5d = 5i - 10, 126d = -4i + qd + 5 for i. -1 Let u = -2214 - -2227. Solve 3m + u = -o, -4m - 19 = 4o - 3m for o. -4 Let v = 8 - 3. Suppose -4z = 3m - m, 5z - 5 = -vm. Suppose 73h - 75h = 0. Solve h = s - p + m - 0, 3s = 4p - 7 for s. -1 Suppose 5t = -3d - 340, -5d + 892t - 896t = 532. Let q be 3/((-6)/4) - 93. Let h = q - d. Solve 0r + 2l = hr + 33, 3r + 4l - 1 = 0 for r. -5 Suppose -37 = -10o - 477. Let q be -4(o/16 - (-6)/8). Suppose -qh + h = -35. Solve 5m + 6 = 3m - 5p, 4m = hp - 12 for m. -3 Let l = -105 - -109. Suppose -3z + 19 = -26. Let g = z - 4. Solve -lw + 0y + y = 13, 2w + g = 5y for w. -3 Let o(d) = 3d2 + 16d + 1. Let j be o(-6). Let h = -355 - -355. Solve 4z - 25 = 3l, h = -z - 0l + 3l + j for z. 4 Suppose -2b + 8 + 0 = 0. Let u be (-40)/12(-6)/b. Suppose -2s - 2s + ux + 27 = 0, -2s - 9 = 5x. Solve 3g - a = 7, -sg + 30 = 2g + 2a for g. 4 Let m be (-474)/(-1027) - (-132)/52. Solve -5r - 4 = -mn, 67n + 12 = 3r + 70n for r. 1 Let q = -65 + 67. Solve 3h = -qw - 5, -w - 2 = 2h + 3 for w. 5 Suppose a + 3b = -19, -3b - 2921 = 2a - 2907. Let v = -5 + 9. Solve u + 32 = vu - al, -2u + 12 = -l for u. 4 Let g = 8280 - 8254. Solve -4a = -3v - 7, -4v - 6a - g = -3a for v. -5 Let o be (1696/512)/(6/10). Solve -6l + 4l - 2t - 14 = 0, -t - o = 0 for l. -2 Let z = 4282 - 4280. Solve 0 = 2w - zk, 8w = 5w + 5k - 6 for w. 3 Suppose -r = -2w + 4, 2r + w - 32 = -20. Solve -2q = -rg, -184q - 4g = -185q + 4 for q. -4 Suppose -7f + 53 = p - 2f, 0 = 5p + 5f - 225. Suppose p = -3y + 91. Solve -2 = -3d - 5g + g, 4g = 4*d + y for d. -2 Suppos	{ "pile_set_name": "DM Mathematics" }
of 174, -563, -1302, -2043, -2786, -3531? -w*2 - 734w + 909 What is the w'th term of 295169, 295170, 295171? w + 295168 What is the j'th term of 4460, 4706, 4954, 5204, 5456, 5710? j*2 + 243j + 4216 What is the t'th term of 2075, 3198, 5081, 7730, 11151, 15350, 20333? t*3 + 374t*2 - 6t + 1706 What is the d'th term of 98, 1751, 6534, 16013, 31754, 55323? 261d3 - d2 - 171d + 9 What is the z'th term of -53282, -213127, -479534, -852503, -1332034, -1918127, -2610782? -53281z2 - 2z + 1 What is the p'th term of -1462, -2927, -4400, -5881, -7370, -8867? -4p2 - 1453p - 5 What is the c'th term of 1994, 1977, 1956, 1931? -2c2 - 11c + 2007 What is the o'th term of -10529, -10516, -10479, -10406, -10285, -10104, -9851, -9514? 2o3 - o - 10530 What is the b'th term of -30450, -30453, -30456, -30459, -30462? -3b - 30447 What is the y'th term of 5954, 11912, 17872, 23834? y*2 + 5955y - 2 What is the z'th term of -8955, -8941, -8917, -8883, -8839, -8785? 5z2 - z - 8959 What is the g'th term of 68, 503, 1684, 3983, 7772, 13423, 21308? 62g3 + g2 - 2g + 7 What is the j'th term of 277, 646, 1023, 1408, 1801, 2202, 2611? 4j*2 + 357j - 84 What is the l'th term of 314, 416, 518? 102l + 212 What is the j'th term of 1834, 3577, 5318, 7057, 8794? -j2 + 1746j + 89 What is the h'th term of 655871, 655869, 655867? -2h + 655873 What is the h'th term of -16858, -33727, -50604, -67489, -84382, -101283, -118192? -4h*2 - 16857h + 3 What is the u'th term of 3585, 3586, 3587, 3588, 3589? u + 3584 What is the y'th term of 159033, 318059, 477085, 636111, 795137, 954163? 159026y + 7 What is the c'th term of -580, -2358, -5326, -9484, -14832? -595c*2 + 7c + 8 What is the o'th term of 146, 170, 194, 218? 24o + 122 What is the g'th term of 510, 531, 564, 609, 666, 735? 6g*2 + 3g + 501 What is the n'th term of 23251, 46505, 69747, 92971, 116171, 139341, 162475, 185567? -n*3 + 23261n - 9 What is the b'th term of 270, 477, 682, 885, 1086, 1285? -b*2 + 210b + 61 What is the m'th term of -1247, -2781, -4317, -5855, -7395, -8937? -m*2 - 1531m + 285 What is the j'th term of -829, -2707, -5839, -10231, -15889, -22819, -31027, -40519? -j*3 - 621j*2 - 8j - 199 What is the p'th term of -43, -28, 67, 248, 521, 892? p*3 + 34p*2 - 94p + 16 What is the o'th term of -4943, -5150, -5489, -5954, -6539, -7238, -8045? o*3 - 72o*2 + 2o - 4874 What is the j'th term of 4867, 9742, 14617, 19492, 24367, 29242? 4875j - 8 What is the t'th term of 47521, 95188, 142855? 47667t - 146 What is the b'th term of 29, 373, 1275, 3011, 5857, 10089, 15983? 46b3 + 3b*2 + 13b - 33 What is the n'th term of -2493, -4989, -7501, -10041, -12621, -15253, -17949, -20721? -2n3 + 4n*2 - 2494n - 1 What is the s'th term of 4459, 8941, 13433, 17941, 22471, 27029, 31621? s3 - s2 + 4478s - 19 What is the r'th term of -1007, -971, -935, -899? 36r - 1043 What is the w'th term of 1198621, 1198616, 1198611, 1198606? -5w + 1198626 What is the n'th term of -297, -341, -375, -393, -389, -357? n3 - n2 - 48n - 249 What is the t'th term of 1180, 1266, 1452, 1774, 2268, 2970? 6t3 + 14t*2 + 2t + 1158 What is the j'th term of -49735, -49744, -49753? -9j - 49726 What is the b'th term of -640374, -1280747, -1921120, -2561493, -3201866, -3842239? -640373b - 1 What is the a'th term of 306, 272, 226, 168, 98? -6a2 - 16a + 328 What is the v'th term of -9421, -18786, -28151, -37516, -46881? -9365v - 56 What is the v'th term of -25, 557, 2127, 5177, 10199, 17685, 28127? 82v*3 + 2v*2 + 2v - 111 What is the m'th term of 93, -260, -619, -984? -3m2 - 344m + 440 What is the y'th term of 285, 1818, 4377, 7962, 12573, 18210? 513y2 - 6y - 222 What is the m'th term of -720, -1477, -2234, -2991, -3748? -757m + 37 What is the s'th term of -17216, -34428, -51616, -68768, -85872, -102916, -119888? 2s*3 - 17226s + 8 What is the t'th term of 52545, 52512, 52465, 52410, 52353, 52300? t*3 - 13t*2 - t + 52558 What is the h'th term of 2177, 4201, 6225? 2024h + 153 What is the z'th term of 263, 988, 2179, 3836, 5959? 233z2 + 26z + 4 What is the t'th term of -16338, -32678, -49030, -65400, -81794, -98218, -114678, -131180? -t*3 - 16333t - 4 What is the y'th term of 7644, 7643, 7608, 7521, 7364? -3y3 + y2 + 17y + 7629 What is the r'th term of 218, 236, 264, 308, 374, 468, 596? r3 - r2 + 14r + 204 What is the k'th term of 56, 33, -6, -61, -132, -219? -8k*2 + k + 63 What is the b'th term of 812, 1761, 2710, 3659, 4608, 5557? 949b - 137 What is the y'th term of 42, 164, 464, 1032, 1958, 3332? 15y3 - y2 + 20y + 8 What is the v'th term of -115, -477, -1089, -1957, -3087, -4485, -6157? -v*3 - 119v*2 + 2v + 3 What is the l'th term of 26134, 52269, 78404, 104539, 130674? 26135l - 1 What is the q'th term of 3988, 3991, 3986, 3967, 3928? -q3 + 2q*2 + 4q + 3983 What is the u'th term of 76935, 76950, 76965? 15u + 76920 What is the t'th term of 331, 1902, 5907, 13564, 26091, 44706, 70627, 105072? 203t3 - t2 + 153t - 24 What is the x'th term of 14797, 14819, 14841, 14863? 22x + 14775 What is the n'th term of 1244468, 1244471, 1244474, 1244477? 3n + 1244465 What is the a'th term of 303, 688, 1087, 1506, 1951, 2428? a3 + a2 + 375a - 74 What is the b'th term of -16026, -16031, -16038, -16047, -16058, -16071? -b*2 - 2b - 16023 What is the g'th term of -422, 191, 806, 1423, 2042, 2663? g*2 + 610g - 1033 What is the r'th term of 2820, 11275, 25366, 45093, 70456? 2818r2 + r + 1 What is the u'th term of 2620, 5288, 7958, 10630, 13304? u2 + 2665u - 46 What is the n'th term of 184, 199, 228, 271, 328, 399? 7n2 - 6n + 183 What is the r'th term of -217718, -217721, -217724, -217727, -217730, -217733? -3r - 217715 What is the m'th term of 1574695, 1574696, 1574697? m + 1574694 What is the q'th term of 431, 376, 277, 128, -77, -344, -679, -1088? -q3 - 16q*2 + 448 What is the t'th term of 1569, 1576, 1583? 7t + 1562 What is the q'th term of -2546, -2549, -2552, -2555? -3q - 2543 What is the i'th term of -31641, -31650, -31673, -31716, -31785, -31886, -32025, -32208? -i3 - i2 + i - 31640 What is the t'th term of -103242, -103378, -103526, -103692, -103882? -t3 - 129t - 103112 What is the y'th term of -162, -251, -402, -615, -890, -1227? -31y2 + 4y - 135 What is the t'th term of -647439, -647438, -647437, -647436? t - 647440 What is the r'th term of -136654, -136655, -136656, -136657? -r - 136653 What is the v'th term of -598, -2370, -5296, -9370, -14586, -20938, -28420? v*3 - 583v*2 - 30v + 14 What is the x'th term of -52343, -104694, -157045? -52351x + 8 What is the l'th term of -2604, -2629, -2650, -2667, -2680? 2l*2 - 31l - 2575 What is the t'th term of -206, -399, -592, -785? -193t - 13 What is the z'th term of -3585, -14314, -32173, -57144, -89209, -128350, -174549, -227788? 3z*3 - 3583z*2 - z - 4 What is the l'th term of -6031, -12050, -18069? -6019l - 12 What is the l'th term of -2090, -1759, -1428? 331l - 2421 What is the p'th term of -289, -536, -783, -1030, -1277? -247p - 42 What is the x'th term of 1120, 2278, 3444, 4618? 4x2 + 1146x - 30 What is the r'th term of 52, -272, -818, -1592, -2600? -r*3 - 105r*2 - 2r + 160 What is the c'th term of -697, -889, -1081? -192c - 505 What is the n'th term of -215, -87, 51, 205, 381, 585, 823? n3 - n2 + 124n - 339 What is the t'th term of -10048, -10069, -10104, -10159, -10240, -10353? -t3 - t2 - 11t - 10035 What is the c'th term of 21298, 85222, 191772, 340948, 532750? 21313c*2 - 15c What is the x'th term of 3104, 4508, 5908, 7304, 8696? -2x2 + 1410x + 1696 What is the i'th term of -7021, -14064, -21107, -28150? -7043i + 22 What is the l'th term of -26787, -26785, -26783, -26781? 2l - 26789 What is the y'th term of 1087, 2108, 3067, 3964, 4799? -31y2 + 1114y + 4 What is the p'th term of 508, 530, 570, 634, 728? p*3 + 3p*2 + 6p + 498 What is the b'th term of -22507, -45015, -67523? -22508b + 1 What is the j'th term of -1602, -1575, -1502, -1359, -1122, -767? 4j3 - j2 + 2j - 1607 What is the i'th term of -546, -1094, -1648, -2214, -2798, -3406, -4044? -i3 + 3i*2 - 550i + 2 What	{ "pile_set_name": "DM Mathematics" }
- a*2 - a. What is f(-5)? -3 Let a(c) = c - 8. Let n be a(5). Let q(p) = 5p*2 + 3p + 5. Let d(s) = 9s2 + 6s + 9. Let m(y) = -4d(y) + 7q(y). What is m(n)? -1 Let j = -2 + 0. Let a(x) = x*3 - 3x - 3. Let h be a(j). Let z(r) = r*3 + 6r*2 + 5r - 4. Calculate z(h). -4 Suppose -5f - 2n - 29 = 0, 3f = -f + 2n - 16. Let d(b) be the first derivative of b*2/2 + 3b + 33. Calculate d(f). -2 Let u be ((-1)/1)/(1/3). Let o(n) = 3n2 - 5n + 5. Let z(f) = -f*2 + 2f - 2. Let v(i) = 3o(i) + 8z(i). Give v(u). 5 Let j(p) = -p*3 - 4p*2 - 3p - 4. Suppose 4k - 21 + 5 = 0. Let m = 9 - k. Let h = 2 - m. Determine j(h). -4 Suppose 0u - 3u = -12. Let l(f) = -f2 + 3f. Calculate l(u). -4 Suppose 4w - 3p = 69 - 0, -5w = -4p - 87. Suppose -o + 5t + 20 + 5 = 0, -5o - w = 3t. Suppose 4b + 2 + 2 = o. Let g(q) = 2q. Give g(b). -2 Let p(v) = 3v*3 - 6v2 - 1. Let f(n) = n3 + n. Let g(y) = 4f(y) - p(y). Let d(o) = o2 - o - 5. Let h = -3 + 3. Let t be d(h). Determine g(t). 6 Let r(d) = 18d*2 + 3d - 5. Let j(x) = 32x2 + 5x - 8. Let q(o) = -31o2 - 5o + 8. Let i(b) = 4j(b) + 5q(b). Let g(y) = 5i(y) + 8r(y). Give g(-1). 10 Suppose 1 = 3x - 5. Let b be x/(-7) + 130/(-35). Let y(i) = -i2 - 5i + 3. Let d(m) = 2m2 + 11m - 7. Let u(f) = -3d(f) - 7y(f). Determine u(b). 8 Let s = -29 + 25. Let x(u) = 5u2 - 3u + 4. Let c(k) = -k*2. Let r(v) = 6c(v) + x(v). Give r(s). 0 Let c(l) = l*2 - 9l - 6. Let b(q) = 3q2 - 19q - 12. Suppose 1 = d + 6. Let w = 3 + -1. Let m(r) = dc(r) + wb(r). What is m(-5)? -4 Suppose 2a - 7a - 4u = -3, 5a = -5u. Let g(k) be the second derivative of 7/6k*a - 2k + 1/12k4 + 0 + 3/2k*2. Calculate g(-5). -7 Suppose -9 = -f - 4k, 2 = 4f - k - 0. Let m be (5/f)/(1 + -2). Let a = -3 - m. Let j(d) = d3 - 2d2 + 2. Determine j(a). 2 Let s(o) = o2 + 5o - 1. Suppose -6y - 28 = y. What is s(y)? -5 Suppose 0 = -3h - 4h + 7. Let d(k) be the second derivative of 11k5/20 + k3/3 - k2/2 - 4k. Calculate d(h). 12 Let i(z) = 157 - z*2 - 157. What is i(-1)? -1 Let h be 2/10 - 16/(-20). Let q(a) = -a - 8a*2 + 4 + 9a2 - a3 + h. What is q(0)? 5 Let w be 8/(-4) + 1 + 3. Suppose wz + z = n - 5, -3z - 26 = 2n. Let u be (-1 - n)6/18. Let i(x) = -x*3 + 2x*2 - 2x + 2. What is i(u)? -2 Let w(h) be the third derivative of -h*5/60 + 5h*4/12 - 3h*3/2 + 17h*2. What is w(6)? 15 Suppose -2w = w + 18. Let a be w/((-1 - 3)/(-4)). Let p(g) = g. Determine p(a). -6 Let n(w) = 2w2 - 2w - 1. Let u be n(2). Suppose -up = -0p + 9. Let b be 0 - 0p/(-9). Let o(l) = l2 + l + 6. Calculate o(b). 6 Let t(m) = 3m + 1. Suppose -3j = -0j - 60. Let o be 44/j - 1/5. Give t(o). 7 Let u(w) = 5w - 1. Suppose g - 2g + 1 = 0. What is u(g)? 4 Let d(u) = u*2 + 7u + 3. Let q be (5 - 2)-1 + -2. Calculate d(q). -7 Let o(x) = -5. Let z(u) = u + 11. Let v(p) = 7o(p) + 3z(p). Suppose 0w + w = 2. Calculate v(w). 4 Let m(z) = -5z3 + 8z*2 - 9z + 3. Let d(a) = 4a3 - 7a*2 + 8a - 2. Let j(q) = 6d(q) + 5m(q). Give j(-2). -3 Let z(y) be the third derivative of y6/120 + y5/60 - y4/24 - y3 - 11y2. Let l = 9 - 9. What is z(l)? -6 Let k(y) = y2 - y. Let j be k(1). Let w(i) = -7i - 13. Let s(n) = -11n - 20. Let l(z) = 5s(z) - 8w(z). Calculate l(j). 4 Let s(q) = q3 + 6q*2 - 8q - 5. Let y be s(-7). Suppose 12 = yb - 4b. Let a(w) = 2w + 4. Give a(b). -8 Let v(c) = c2 - 6c - 2. Let n(f) = -2f2 + 6f + 6. Let p(h) = 2h2 - 6h - 7. Let q(g) = 6n(g) + 5p(g). Let r(a) = -2q(a) - 3v(a). Determine r(-5). -1 Let g(o) = -o*3 + 6o*2 + 7o - 2. Suppose 5v + 126 - 161 = 0. Calculate g(v). -2 Let l(x) = x3 + x2 - x + 7. Suppose h - 3 = m + 2h, 0 = -m - 4h. Let o = 4 + m. Give l(o). 7 Let h(i) = -3i - 5. Let w be h(-3). Let a(g) = -g*2 + 3g - 1. Determine a(w). -5 Let h(b) = 3b2 + 5b + 5 + 0b - 7 - 6b + b3. Determine h(-2). 4 Let p(f) be the third derivative of -f4/8 + 2f3/3 - 3f*2. Give p(4). -8 Let f(q) = -2q*3 + 4q*2 + 3q + 5. Let m(u) = 3u3 - 6u*2 - 5u - 8. Let w(d) = -8f(d) - 5m(d). Let v be (-3)/(-2) + (-8)/16. Give w(v). 0 Let i = 0 + -1. Let q be i/(-3) - (-33)/9. Let o(x) = -qx - 1 + 4x2 + x3 + 0x3 + 7. What is o(-5)? 1 Let b(a) = 4a*2 - 7a + 3a2 - 3 - 8a*2. Suppose 52n - 18 = 55n. What is b(n)? 3 Let z(p) = -2 + 2p2 - p3 - 2p3 + 4p*3. Let s be 2 - (-5 - (2 + 0)). Let u be 12/s(-3)/2. Determine z(u). -2 Let x(s) = s*2 - 10s + 6. Let c be x(9). Let t(q) = -q*2 - 2q + 3. Determine t(c). 0 Let m = -7 - -12. Suppose 0 = w - g - 2g + m, -4w - g = -19. Let c(s) = -5s3 + 6s*3 - 5 - 3s - ws2 - 1. Calculate c(5). 4 Let v(m) = -12 - 27m*2 + 2 + 2m*2 - 4m*3 + 8m. Let a(g) = -g - 3 - g*3 + 71g*2 + 4g - 79g2. Let z(k) = -7a(k) + 2v(k). What is z(5)? 1 Suppose 5y + l = -36, 2l + 38 = -5y - l. Let t(u) = 10u2 - 14u + 24. Let h(s) = 3s2 - 5s + 8. Let p(i) = yh(i) + 2t(i). Determine p(6). -2 Let q(i) = -i*3 - 2i*2 - 3i - 1. Let t = -2 - 0. Give q(t). 5 Let c(v) = 5v2 + 6v - 1. Let f(k) = 0k2 + 26k - 32k - 6k*2. Let x(a) = 7c(a) + 6f(a). Suppose -25 = -5n - 0. Determine x(n). -2 Let g(y) = -y*2 - 5y + 10. Let p be g(-7). Let r be (-1)/(-2) + p/(-8). Let l(t) = t3 - t2 - t + 1. What is l(r)? 0 Let j(q) = -3q + 6. Suppose z + 3 = 3p - 12, -4z = 2p - 10. Give j(p). -9 Suppose -z + 3i + 6 = 0, 5i + 46 = -5z + i. Let t(v) = -v - 1. Determine t(z). 5 Let z(y) = -y2 + y - 9. Let j be 2 - -1 - -11. Suppose jc = 3c + 6. Let q = c - 6. What is z(q)? -9 Let g(r) = r*3 + 6r*2 - 6r + 7. Let p be g(-7). Suppose -5x - 23 - 7 = p. Let l(v) = -v - 11. What is l(x)? -5 Let m(p) = -5p*3 + 2p + 1. Let o(h) = h*3 + 5h*2 - h - 3. Suppose -4r - 8 = 12. Let d be o(r). Suppose -4q - 2 - d = 0. Give m(q). 4 Let p(i) be the third derivative of -i4/24 - 3i*3/2 - 32i*2. Let g be 2(-2)/66. Give p(g). -5 Let x(k) = 13k*3 - 2k*2 + 2k - 1. Suppose -3z - 2z - 24 = g, 7 = 2g - z. What is x(g)? 12 Let j = -1 + -1. Let s(z) = -2z - 18. Let m be s(-9). Let h(d) = d*2 + md*2 - 2 + 0d*2 - 2d. What is h(j)? 6 Let v(c) be the first derivative of -c5/20 - c4/4 + c*3/3 - 7c + 9. Let y(u) be the first derivative of v(u). Calculate y(-2). -8 Let x(m) be the first derivative of m*6/360 - 7m5/120 + m4/4 - m*3/3 - 3. Let n(y) be the third derivative of x(y). Give n(5). -4 Let c = -1 - -14. Let m(x) = -7x*2 - 4. Let v(z) = 15z*2 + z + 8. Let r(a) = cm(a) + 6v(a). Give r(6). -4 Let h(u) be the second derivative of -u3/6 - u2 + u. Let n = -1 + 2. Let x be n/(-1) + -1 + -1. What is h(x)? 1 Let h(x) be the third derivative of x5/30 - x3/6 + 15x2. Give h(-3). 17 Let n(m) = m + 5. Let y(c) = -c2 + 16c - 5. Let b be y(16). What is n(b)? 0 Let b = 25 + -21. Suppose 5l = 3l + 10. Let x(s) = -7s + 3. Let r(y) = -6y + 2. Let k(c) = lx(c) - 6r(c). Determine k(b). 7 Let t(j) = -2j - 2. Let k be t(-2). Let g = 3 - k. Suppose -2l + 4m - g = -11, 15 = -l - 3m. Let f(h) = -h - 2. Calculate f(l). 1 Suppose 0z - 12 = -3z. Suppose 3w - zw + 3 = 0. Let i = 1 + w. Let s(m) = m3 - 3m*2 - 4m - 1. Calculate s(i). -1 Let h(o) = 10o + 2. Let t(q) = q + 1. Let f(w) = -h(w) + 4t(w). Let y(a) = 2a - 1. Let k(d) = -6f(d) - 17y(d). Give k(-4). -3 Suppose -2t + 2 = -4t. Let j(h) = 7h*2 - h + 5. Let a(y) = 22y*2 - 3y + 14. Let c(i) = -6a(i) + 17j(i). Determine c(t). -13 Let x(d) = -1 - 3d2 - 3d + 4d2 + 8d + 6. Let h be x(-4). Let g(q) = 2q - 1. Give g(h). 1 Let o(f) = -f3 + 5f*2 + f - 5. Let n be o(4). Let r(i) = n - 14 - 3i - i. Give r(3). -11 Suppose 2i = -i + 12. Suppose -5x - 5k - 50 = 0, -3x - ik = -2k + 26. Let g(y) = y*2 + 7y - 2. Give g(x). -8 Suppose -5n + 4o + 0o = -41, -5n + 9 = 4o. Let t(m) = -m2 + 0m*2 - 2m - 5m + n. Calculate t(-7). 5 Let u(p) = 0 + p2 + 60p + 3 - 31p - 26p. Let m = -8 - -5. Let f = -1 + m. What is u(f)? 7 Let l(w) = 2w2 + w - 7. Let t(g) = -g2 + 3. Let n(i) = -2l(i) - 5t(i). What is n(2)? -1 Let m = 3 - -2. Suppose mk + 6 = -4. Let u(l) = -2l3 + 2l - 7l - 4l - 2l2 + 10l. Determine u(k). 6 Let d(i) = -4	{ "pile_set_name": "DM Mathematics" }
vide 4120? False Does 30 divide 2587? False Does 65 divide 91130? True Is 27 a factor of 567? True Is 33174 a multiple of 171? True Is 4 a factor of 1679? False Is 5231 a multiple of 35? False Does 8 divide 64525? False Is 816 a multiple of 51? True Is 6030 a multiple of 30? True Is 300 a multiple of 5? True Does 17 divide 1185? False Does 8 divide 2308? False Does 102 divide 26010? True Is 28 a factor of 14093? False Is 168 a multiple of 24? True Does 46 divide 1449? False Is 8212 a multiple of 170? False Does 42 divide 5065? False Does 33 divide 6765? True Is 7707 a multiple of 91? False Is 11 a factor of 4686? True Is 75 a factor of 17325? True Is 16 a factor of 881? False Is 180 a multiple of 12? True Does 75 divide 8250? True Is 25 a multiple of 4? False Does 11 divide 632? False Is 1114 a multiple of 20? False Does 16 divide 160? True Is 13 a factor of 288? False Is 31 a factor of 58869? True Is 1269 a multiple of 27? True Is 23259 a multiple of 162? False Is 23 a factor of 2231? True Is 30 a factor of 6252? False Does 7 divide 8982? False Is 10 a factor of 270? True Is 1278 a multiple of 8? False Is 18 a factor of 2718? True Does 25 divide 5900? True Does 63 divide 8737? False Does 2 divide 7080? True Is 2836 a multiple of 58? False Does 49 divide 7972? False Does 21 divide 3318? True Is 72 a factor of 2880? True Is 1769 a multiple of 45? False Does 37 divide 11334? False Does 52 divide 3068? True Does 38 divide 91? False Does 7 divide 2847? False Is 1539 a multiple of 19? True Is 2568 a multiple of 12? True Is 71 a multiple of 4? False Is 31 a factor of 30969? True Is 2016 a multiple of 48? True Is 3375 a multiple of 25? True Is 3288 a multiple of 51? False Is 10 a factor of 15458? False Does 119 divide 85799? True Does 24 divide 2534? False Is 2 a factor of 31? False Does 107 divide 107? True Does 10 divide 5960? True Does 23 divide 1679? True Does 5 divide 200? True Is 14 a factor of 11578? True Is 98 a factor of 375? False Is 969 a multiple of 57? True Does 3 divide 1004? False Is 876 a multiple of 4? True Is 296 a multiple of 74? True Is 445 a multiple of 83? False Is 12 a factor of 1612? False Is 21 a factor of 6278? False Is 266 a multiple of 9? False Is 3 a factor of 4755? True Is 6380 a multiple of 44? True Is 43 a factor of 3639? False Is 3803 a multiple of 25? False Does 41 divide 7134? True Does 47 divide 1609? False Does 55 divide 4676? False Is 696 a multiple of 58? True Does 49 divide 746? False Is 8118 a multiple of 18? True Is 43 a factor of 3225? True Is 5278 a multiple of 58? True Does 10 divide 3122? False Is 12 a factor of 987? False Is 1953 a multiple of 13? False Is 2321 a multiple of 44? False Is 122 a factor of 35990? True Is 31 a factor of 21110? False Does 14 divide 1230? False Is 7 a factor of 2940? True Is 41 a factor of 14473? True Is 11 a factor of 516? False Does 96 divide 14286? False Is 68904 a multiple of 216? True Is 9 a factor of 27426? False Is 5915 a multiple of 13? True Is 3621 a multiple of 17? True Does 126 divide 44326? False Is 43 a factor of 212? False Does 14 divide 27164? False Does 6 divide 39349? False Is 33900 a multiple of 30? True Does 85 divide 3072? False Does 36 divide 792? True Does 10 divide 520? True Is 41 a factor of 527? False Is 9752 a multiple of 2? True Is 15 a factor of 1186? False Is 570 a multiple of 19? True Is 16 a factor of 1328? True Is 1368 a multiple of 9? True Is 2185 a multiple of 19? True Does 36 divide 6181? False Does 13 divide 2025? False Is 24 a factor of 36792? True Is 86444 a multiple of 15? False Is 122668 a multiple of 28? True Is 1807 a multiple of 16? False Does 54 divide 5616? True Is 8 a factor of 401? False Is 3540 a multiple of 10? True Does 15 divide 2051? False Does 121 divide 968? True Is 9 a factor of 306? True Is 6 a factor of 3972? True Is 2216 a multiple of 14? False Is 5 a factor of 195? True Is 1793 a multiple of 16? False Is 24 a factor of 688? False Does 5 divide 1517? False Is 24 a factor of 2064? True Is 2128 a multiple of 19? True Does 22 divide 264? True Is 152 a factor of 11034? False Is 31247 a multiple of 18? False Is 7 a factor of 82? False Is 5824 a multiple of 17? False Does 122 divide 3556? False Does 92 divide 20405? False Does 10 divide 435? False Is 5 a factor of 982? False Does 60 divide 900? True Is 9528 a multiple of 21? False Does 6 divide 1133? False Is 7 a factor of 4607? False Does 45 divide 82? False Is 233 a factor of 24465? True Does 28 divide 1596? True Is 10 a factor of 330? True Is 78 a factor of 2116? False Is 32 a factor of 18624? True Is 14 a factor of 317? False Is 217 a factor of 6510? True Is 1182 a multiple of 5? False Does 28 divide 434? False Does 8 divide 41909? False Does 32 divide 3936? True Is 2295 a multiple of 22? False Does 177 divide 1593? True Is 44 a factor of 2338? False Does 23 divide 7935? True Does 40 divide 1475? False Does 131 divide 2003? False Is 6 a factor of 156? True Is 133731 a multiple of 33? False Does 12 divide 1392? True Is 4372 a multiple of 22? False Does 27 divide 91395? True Is 26 a factor of 52? True Is 23 a factor of 18753? False Is 198 a multiple of 27? False Is 2 a factor of 34? True Is 23 a factor of 483? True Is 21148 a multiple of 17? True Is 912 a multiple of 28? False Does 4 divide 2690? False Is 301 a factor of 27877? False Is 11 a factor of 245? False Is 117 a factor of 28899? True Is 3803 a multiple of 160? False Is 48 a factor of 528? True Is 3468 a multiple of 12? True Is 18 a factor of 518? False Is 555 even? False Is 28 a factor of 24456? False Is 98 a multiple of 7? True Is 13 a factor of 2561? True Is 3946 a multiple of 6? False Is 29641 a multiple of 12? False Is 435 even? False Is 3312 a multiple of 92? True Is 36 a factor of 4048? False Is 39116 a multiple of 6? False Does 9 divide 225? True Is 13178 a multiple of 54? False Is 11031 a multiple of 12? False Is 4 a factor of 60? True Is 11915 a multiple of 3? False Is 3192 a multiple of 152? True Is 15466 a multiple of 74? True Is 10353 a multiple of 97? False Is 66 a factor of 8448? True Is 2877 a multiple of 14? False Does 22 divide 1602? False Does 17 divide 68? True Is 3430 a multiple of 37? False Is 92870 a multiple of 41? False Is 73 a factor of 33977? False Does 21 divide 29001? True Is 40 a factor of 4680? True Is 11 a factor of 374? True Is 218 a factor of 23161? False Is 2378 a multiple of 29? True Is 26 a factor of 1898? True Is 27 a factor of 241? False Does 18 divide 35659? False Is 6136 a multiple of 50? False Does 13 divide 7922? False Does 36 divide 12977? False Does 21 divide 1147? False Is 9855 a multiple of 15? True Does 206 divide 17304? True Does 3 divide 162? True Is 23 a factor of 15893? True Is 3724 a multiple of 15? False Is 1741 a multiple of 125? False Is 10 a factor of 18410? True Is 2800 a multiple of 25? True Is 184 a factor of 20775? False Is 15 a factor of 6030? True Is 75 a factor of 1273? False Is 15576 a multiple of 66? True Is 6 a factor of 9040? False Is 10 a factor of 3831? False Does 36 divide 402? False Does 2 divide 3955? False Is 1594 a multiple of 24? False Is 3 a factor of 201? True Does 12 divide 492? True Is 768 a multiple of 22? False Is 3841 a multiple of 14? False Is 18 a factor of 1777? False Is 924 even? True Is 2 a factor of 7? False Is 19947 a multiple of 61? True Is 2 a factor of 148? True Is 115627 a multiple of 69? False Is 958 a multiple of 13? False Does 68 divide 476? True Does 32 divide 8592? False Is 89 a factor of 464? False Does 46 divide 28934? True Is 30130 a multiple of 131? True Is 20 a factor of 2348? False Is 129 a factor of 15609? True Is 27 a factor of 622? False Is 16 a factor of 1732? False Is 12944 a multiple of 16? True Is 52 a factor of 2704? True Is 2584 a multiple of 17? True Is 690 a multiple of 23? True Does 24 divide 5756? False Is 27348 a multiple of 91? False Is 3 a factor of 188? False Does 19 divide 1411? False Is 11322 a multiple of 74? True Is 20 a factor of 43985? False Does 200 divide 51107? False Is 18 a factor of 1224? True Does 7 divide 217? True Is 2 a factor of 7036? True Is 122 a factor of 488? True Does 6 divide 624? True Is 7308 a multiple of 28? True Is 111 a factor of 21333? False Is 1046 a multiple of	{ "pile_set_name": "DM Mathematics" }
rounded to the nearest 1000? -120000 What is 0.002343 rounded to four decimal places? 0.0023 What is 0.000006433 rounded to six dps? 0.000006 What is -3948.12 rounded to the nearest 100? -3900 Round -59362 to the nearest 1000. -59000 Round -2173000 to the nearest 10000. -2170000 Round -0.00008767 to five dps. -0.00009 What is -30143 rounded to the nearest 1000? -30000 Round -10845 to the nearest 100. -10800 Round -0.00000371 to seven decimal places. -0.0000037 What is 6.53 rounded to the nearest integer? 7 What is -0.000003369 rounded to seven decimal places? -0.0000034 Round -0.00088 to four decimal places. -0.0009 Round -0.195342 to 2 dps. -0.2 What is 223100 rounded to the nearest 10000? 220000 What is 0.0006786 rounded to four decimal places? 0.0007 What is 0.0000096524 rounded to seven dps? 0.0000097 What is -3321000 rounded to the nearest 1000000? -3000000 What is -524200 rounded to the nearest one hundred thousand? -500000 Round 2.684 to 1 decimal place. 2.7 Round -0.0057312 to four dps. -0.0057 What is -0.0000009545 rounded to 7 dps? -0.000001 Round 0.43154 to 1 dp. 0.4 Round 0.199 to 1 decimal place. 0.2 Round -0.052023 to 4 dps. -0.052 Round -1958.64 to the nearest 100. -2000 Round 0.000321 to five dps. 0.00032 Round -0.00144 to four dps. -0.0014 What is -19.68 rounded to zero dps? -20 Round 0.4305 to two dps. 0.43 Round -75.424 to one dp. -75.4 Round -0.0000005059 to seven decimal places. -0.0000005 Round -133.47 to the nearest 10. -130 Round -0.045407 to four dps. -0.0454 What is 0.000000987 rounded to six decimal places? 0.000001 Round -0.000041449 to six decimal places. -0.000041 Round 5.824 to one decimal place. 5.8 What is -589000 rounded to the nearest 100000? -600000 Round 0.4491 to one dp. 0.4 What is 1.32999 rounded to two decimal places? 1.33 What is 0.00012 rounded to five decimal places? 0.00012 What is -305 rounded to the nearest 10? -310 What is -2510300 rounded to the nearest one million? -3000000 What is 33900000 rounded to the nearest one million? 34000000 What is -63819 rounded to the nearest one hundred? -63800 What is -856200 rounded to the nearest one hundred thousand? -900000 Round 0.0000040724 to 7 dps. 0.0000041 What is -647000 rounded to the nearest one hundred thousand? -600000 Round -1031000 to the nearest 100000. -1000000 Round -1502900 to the nearest ten thousand. -1500000 What is 0.0143692 rounded to 3 decimal places? 0.014 What is 74200000 rounded to the nearest one million? 74000000 Round 0.000025674 to six decimal places. 0.000026 Round 0.000838 to four dps. 0.0008 What is -0.000012796 rounded to six dps? -0.000013 Round 6.84 to the nearest integer. 7 What is 3558 rounded to the nearest one hundred? 3600 What is 45546 rounded to the nearest one hundred? 45500 Round 3236 to the nearest 100. 3200 What is 0.076721 rounded to 4 dps? 0.0767 Round 46.578 to the nearest ten. 50 Round 0.000572 to four dps. 0.0006 What is -7.2183 rounded to 1 decimal place? -7.2 What is 7201 rounded to the nearest one hundred? 7200 Round -65.17 to the nearest integer. -65 Round 0.0128093 to four decimal places. 0.0128 What is 39300 rounded to the nearest 100000? 0 Round 0.00005967 to 5 decimal places. 0.00006 Round 221.64 to the nearest integer. 222 Round 0.056678 to 3 dps. 0.057 What is -387500 rounded to the nearest 10000? -390000 What is -0.00048067 rounded to five decimal places? -0.00048 What is -0.000002808 rounded to 7 dps? -0.0000028 What is 0.000009689 rounded to seven decimal places? 0.0000097 What is 5.7302 rounded to 0 decimal places? 6 What is 647.6 rounded to the nearest ten? 650 What is 0.000144 rounded to five dps? 0.00014 Round -33.65 to the nearest ten. -30 Round 235500 to the nearest 10000. 240000 What is 9980 rounded to the nearest one thousand? 10000 Round 7299900 to the nearest ten thousand. 7300000 What is -0.00037273 rounded to six dps? -0.000373 What is -0.000007343 rounded to 7 dps? -0.0000073 Round 14.0543 to one dp. 14.1 What is -0.05183 rounded to two dps? -0.05 What is -0.0000003206 rounded to seven decimal places? -0.0000003 What is -16.108 rounded to one dp? -16.1 Round 89900 to the nearest 10000. 90000 What is 35.034 rounded to the nearest 10? 40 Round 0.0147391 to four dps. 0.0147 Round -0.000041388 to 6 decimal places. -0.000041 Round 1.739 to one decimal place. 1.7 Round 52800 to the nearest 10000. 50000 Round -9.07 to the nearest integer. -9 What is -0.032411 rounded to two decimal places? -0.03 Round 0.26976 to two dps. 0.27 What is -0.03362 rounded to two dps? -0.03 What is 164.54 rounded to the nearest integer? 165 Round -640130000 to the nearest 1000000. -640000000 What is 0.00183501 rounded to four dps? 0.0018 Round 0.8731 to two decimal places. 0.87 What is 0.10647 rounded to two decimal places? 0.11 Round 0.0027111 to five decimal places. 0.00271 What is -0.000011234 rounded to six decimal places? -0.000011 What is -2760.64 rounded to the nearest one hundred? -2800 Round 139108 to the nearest ten thousand. 140000 Round -0.022923 to 4 dps. -0.0229 Round -0.006113 to four dps. -0.0061 Round 1976.62 to the nearest 10. 1980 What is -9380 rounded to the nearest one hundred? -9400 Round 0.0008534 to 5 decimal places. 0.00085 Round 0.0009381 to four dps. 0.0009 Round 0.0039165 to four dps. 0.0039 Round 679 to the nearest one hundred. 700 Round -14180 to the nearest one thousand. -14000 Round -47784 to the nearest one thousand. -48000 Round -62.1 to 0 decimal places. -62 Round -1510 to the nearest ten thousand. 0 What is -17.071 rounded to the nearest integer? -17 Round -360.9 to 0 decimal places. -361 Round 4487000 to the nearest one million. 4000000 Round 0.003702 to 4 dps. 0.0037 Round -4.2468 to 1 dp. -4.2 Round 0.0011248 to 4 decimal places. 0.0011 What is -2.664 rounded to 1 decimal place? -2.7 Round 4.09 to zero decimal places. 4 What is -83.62 rounded to the nearest integer? -84 Round 0.062933 to 4 dps. 0.0629 What is 42654000 rounded to the nearest 1000000? 43000000 Round -118824000 to the nearest 1000000. -119000000 Round 1.03882 to 1 decimal place. 1 What is 0.00000057344 rounded to seven dps? 0.0000006 Round -0.10931 to 2 decimal places. -0.11 Round 70.3 to the nearest ten. 70 Round -21.21 to zero decimal places. -21 Round 0.0000254 to 5 decimal places. 0.00003 What is -5332000 rounded to the nearest 100000? -5300000 Round 76.5 to the nearest ten. 80 Round -0.0001759 to six decimal places. -0.000176 Round -9808900 to the nearest one hundred thousand. -9800000 What is 0.019237 rounded to 2 dps? 0.02 Round -21122300 to the nearest 100000. -21100000 Round -25130 to the nearest 10000. -30000 What is 0.0000001639 rounded to 7 decimal places? 0.0000002 Round -0.00059192 to five decimal places. -0.00059 What is -0.00038104 rounded to 6 decimal places? -0.000381 What is -1258.59 rounded to the nearest 100? -1300 Round 55162 to the nearest one thousand. 55000 What is 0.0143868 rounded to 4 decimal places? 0.0144 What is 0.0001999 rounded to four dps? 0.0002 Round 35180 to the nearest ten thousand. 40000 What is -161430 rounded to the nearest 1000? -161000 Round 0.0000000731 to 7 dps. 0.0000001 What is 85531 rounded to the nearest 10000? 90000 Round -698700 to the nearest ten thousand. -700000 What is -24493500 rounded to the nearest 1000000? -24000000 What is 18293300 rounded to the nearest 100000? 18300000 Round -0.001099 to 5 decimal places. -0.0011 What is -3.5374 rounded to one dp? -3.5 What is 0.00060188 rounded to 4 decimal places? 0.0006 Round 0.0000113 to six decimal places. 0.000011 What is -6000 rounded to the nearest 1000? -6000 Round 619 to the nearest ten. 620 What is -1969.29 rounded to the nearest 100? -2000 What is 3.44 rounded to one decimal place? 3.4 Round -0.000005735 to 6 decimal places. -0.000006 Round 16.78 to 0 dps. 17 Round -0.0000033438 to six dps. -0.000003 What is -0.000007987 rounded to seven decimal places? -0.000008 Round -1.68 to the nearest integer. -2 What is 53137 rounded to the nearest 100? 53100 What is -285 rounded to the nearest one hundred? -300 What is 56300000 rounded to the nearest one million? 56000000 What is 1944.5 rounded to the nearest 100? 1900 What is 0.002473 rounded to four decimal places? 0.0025 Round 4678 to the nearest 1000. 50	{ "pile_set_name": "DM Mathematics" }
59a + 221a for a. 13 Solve -30j - 496 = -154j for j. 4 Solve 17y - 60y = -129 for y. 3 Solve -63l + 3978 = 243l for l. 13 Solve 274 = 121d - 29d - 1290 for d. 17 Solve -92r + 5757 = 211r for r. 19 Solve -161t - 1490 + 273 = 393 for t. -10 Solve -116l + 448 = -26l - 182 for l. 7 Solve -43g - 202 + 525 = -580 for g. 21 Solve 0 = 76q + 416934 - 419442 for q. 33 Solve -582 - 486 = 178v for v. -6 Solve -1137t - 1914 = -1071t for t. -29 Solve 7819 = 2104j - 987j for j. 7 Solve 246i + 223i - 81i - 3492 = 0 for i. 9 Solve 0 = 75q - 57 - 82 - 11 for q. 2 Solve 548k = 122k - 5538 for k. -13 Solve -14l - 120 = -60l - 810 for l. -15 Solve -29u - 14 - 100 = 118 for u. -8 Solve 0 = 14c - 12268 + 12212 for c. 4 Solve -135 - 753 = -148o for o. 6 Solve -44 = 39s + 123 - 11 for s. -4 Solve -84m - 47m = -19m + 1904 for m. -17 Solve -232z + 39 + 41 = -252z for z. -4 Solve 72q - 26q = -385q - 9482 for q. -22 Solve -4i = 2i - 10i + 68 for i. 17 Solve 97f + 3324 = 374f for f. 12 Solve -17p - 71p - 129 = 223 for p. -4 Solve 28r - 352 = -940 for r. -21 Solve 0 = 229p + 323 + 135 for p. -2 Solve 0i - 17i - 143i - 3360 = 0 for i. -21 Solve 0 = -73o - 439 - 145 for o. -8 Solve 30k - 1202 = -1232 for k. -1 Solve 9b = 34b + 25 for b. -1 Solve 2806 + 19889 = -411b + 5433 for b. -42 Solve -12026w = -12024w + 6 for w. -3 Solve 2996t = 3013t - 17 for t. 1 Solve -126257 + 127246 = 43v for v. 23 Solve 0 = -19i - 335 - 292 for i. -33 Solve 22 = -887z + 876z for z. -2 Solve 8865h - 8852h = 139 - 22 for h. 9 Solve 472i - 451i - 42 = 0 for i. 2 Solve -2894 - 574 = -102a for a. 34 Solve -241d - 1955 = -859 + 832 for d. -8 Solve -6d - 6d = 22d + 170 for d. -5 Solve 70 = -78h + 335h + 70 for h. 0 Solve -363g - 351 = 861 + 3144 for g. -12 Solve 2278a + 20 = 2258a for a. -1 Solve 181g - 153g = -312g + 6800 for g. 20 Solve 35d = -191d + 12 - 12 for d. 0 Solve -24o - 26o - 200 = 0 for o. -4 Solve 3152k + 21460 = 3892k for k. 29 Solve 247z - 1146 + 520 = 1103 for z. 7 Solve 0 = -60g + 19g + 9g for g. 0 Solve 38u + 38u = 58u - 54 for u. -3 Solve 35 - 27 = 11j - 58 for j. 6 Solve 1348 + 1642 - 209 = 103i for i. 27 Solve 0 = 364j + 1430 + 4774 - 744 for j. -15 Solve 39p = -53 - 980 - 488 for p. -39 Solve -1862k - 2550 = -1964k for k. 25 Solve 19o - 103o - 40 = 548 for o. -7 Solve -73v - 1457 = -24v - 1212 for v. -5 Solve 90v = -171 + 420 + 561 for v. 9 Solve 19775n - 1350 = 19865n for n. -15 Solve -64t + 2700 = -334t for t. -10 Solve 36642 = 69l + 38781 for l. -31 Solve -39s + 25s = -24s for s. 0 Solve -9x - 43x = 104 for x. -2 Solve -7i + 90 = 13i + 10i for i. 3 Solve -57i - 46 + 366 + 307 = 0 for i. 11 Solve -40a - 322 = -162a + 166 for a. 4 Solve 2q + 54q - 49 = 63 for q. 2 Solve -12p - 105 - 15 = 3p for p. -8 Solve 0 = -2173d + 2183d - 60 for d. 6 Solve 798 = -44x - 222x for x. -3 Solve -1627 + 217 = 112d - 18d for d. -15 Solve 59n - 931 = 249 for n. 20 Solve 4725x - 4709x = -464 for x. -29 Solve 0 = -2126o + 2129o + 21 for o. -7 Solve -266f + 3224 = 43f + 94f for f. 8 Solve -3578d - 182 = -3552d for d. -7 Solve -11 = -28g - 402 - 1 for g. -14 Solve 43b + b + 174 = -2 for b. -4 Solve -75t = 25t - 600 for t. 6 Solve -6t - t - 280 = -280 for t. 0 Solve 0 = -416x + 10331 - 1572 + 809 for x. 23 Solve 156 + 781 + 57 = -142l for l. -7 Solve -283 = 290a + 727 - 140 for a. -3 Solve -460r = 404r - 4320 for r. 5 Solve -3795 + 718 = -181v for v. 17 Solve -2682 = -81b + 290b + 89b for b. -9 Solve 906g + 9774 - 714 = 0 for g. -10 Solve 778z + 324 = 814z for z. 9 Solve -432433g = -432409g - 624 for g. 26 Solve 0 = -9318p + 9309p - 54 for p. -6 Solve -362h - 709h + 2816 - 674 = 0 for h. 2 Solve -191k - 1537 = -19k + 871 for k. -14 Solve -2067 = 976a - 287a for a. -3 Solve 39g + 85 = 241 for g. 4 Solve 0 = 25h - 6h - 4216 + 3779 for h. 23 Solve 48j + 192j + 8880 = 0 for j. -37 Solve 42m = -80 - 97 + 51 for m. -3 Solve -23r - 7r - 270 = 0 for r. -9 Solve 341h + 231h - 16588 = 0 for h. 29 Solve -54x + 66849 = 67281 for x. -8 Solve -208g + 171 = -227g for g. -9 Solve -98t = -91t + 70 for t. -10 Solve -47p - 16p - 11p = -1184 for p. 16 Solve -81c + 522 = -516 - 501 for c. 19 Solve 409 - 381 = 7w for w. 4 Solve 91k + 2141 - 776 = 0 for k. -15 Solve -17t + 363 - 227 = 0 for t. 8 Solve 3647t + 434 = 3616t for t. -14 Solve -335g + 1651 = -24 for g. 5 Solve -265 = 81l - 751 for l. 6 Solve 755b - 760b = 40 for b. -8 Solve 0 = 17o - 110o - 2697 for o. -29 Solve -72g - 350 - 220 = 222 for g. -11 Solve 2507f = 2498f - 90 for f. -10 Solve 0 = 12098k - 12120k - 308 for k. -14 Solve -8c + 94 = 5c + 68 for c. 2 Solve 547w + 470 + 358 = 639w for w. 9 Solve -252a + 1106 = -2422 for a. 14 Solve 62m + 51 = 361 for m. 5 Solve 12390v = 12352v + 684 for v. 18 Solve -15m - 1686 = -1761 for m. 5 Solve 0 = 269g - 134g - 166g + 248 for g. 8 Solve 247v + 3399 = 144v for v. -33 Solve 8j - 595 + 239 = -84 for j. 34 Solve 483 + 248 = 43c for c. 17 Solve 163r + 2976 - 603 = -398 for r. -17 Solve -172 - 180 = -157o - 195 for o. 1 Solve -32w + 14 - 7 = 39 for w. -1 Solve 624v - 636v + 192 = 0 for v. 16 Solve -96 = 361w - 353w for w. -12 Solve -24i - 160 = 8i for i. -5 Solve 43201m = 43176m + 775 for m. 31 Solve 24h + 24h - 50h = -4 for h. 2 Solve 31u = -3236 + 3422 for u. 6 Solve 46 + 431 + 127 = -302z for z. -2 Solve 48m = 38m - 70 for m. -7 Solve -100a + 2016 = 99a - 31a for a. 12 Solve -38u = 928 - 1536 for u. 16 Solve 1090a = 1030a + 840 for a. 14 Solve 0 = 84q + 36q + 7q + 762 for q. -6 Solve -206l = -201l - 11 - 9 for l. 4 Solve -25f + 3f = 34f - 560 for f. 10 Solve 936g + 137 + 73 = 926g for g. -21 Solve -85v + 32v + 137v = 756 for v. 9 Solve 478g + 850 = -281g + 6163 for g. 7 Solve 683g + 216 = 675g for g. -27 Solve 22 = 10095f - 10106f for f. -2 Solve 476h = -550h + 246h - 12480 for h. -16 Solve -71w - 14w - 9w = -1128 for w. 12 Solve 0 = -39m - 24m - 22m - 680 for m. -8 Solve -28n = -48n - 51n - 923 for n. -13 Solve -269w - 5760 = 91w for w. -16 Solve -5a - 10a = -8a - 0a for a. 0 Solve 1046a = 1093a + 188 for a. -4 Solve 183y + 170y = 332y + 273 for y. 13 Solve -61a - 76a = -8a - 258 for a. 2 Solve -16626x = -16567x + 1711 for x. -29 Solve 12725j - 1400 = 12765j for j. -35 Solve -22w = -37w - 76w + 1001 for w. 11 Solve -45f + 5 - 228 = 47 for f. -6 Solve -728 = 250k + 4682 + 2840 for k. -33 Solve 28 = -2j - 62 + 52 for j. -19 Solve 230f = 220f - 30 for f. -3 Solve 527k + 4685 = -421k + 893 for k. -4 Solve -644h + 632h + 12 = 0 for h. 1 Solve 48 = -34c + 23 - 77 for c. -3 Solve 0 = -432v + 67 + 2626 - 533 for v. 5 Solve 404l + 32 = 406l for l. 16 Solve -1411k = -330k - 22701 for k. 21 Solve -77x - 38 - 608 = 124 for x. -10 Solve -68v + 257 = -33v - 933 for v. 34 Solve -48u - 182 = -950 for u. 16 Solve 0 = -142o + 609o + 467 for o. -1 Solve 251l = 90l + 98l + 63 for l. 1 Solve -845 + 82 = -133j - 98 for j. 5 Solve -17737r + 17562r - 4200 = 0 for r. -24 Solve -27n - 151 + 174 = -382 for n. 15 Solve 0 = -648c + 641c + 112 for c. 16 Solve -2641 + 2281 = 36i for i. -10 Solve 260a - 105a = -155 for a. -1 Solve -1087r = -3604 - 27919 for r. 29 Solve 97i + 300 = -1104 - 245 for i. -17 Solve -482f - 50f = -9576 for f. 18 Solve 92g = 6g + 4g - 1722 for g. -21 Solve -2y - 101 = -13y + 53 for y. 14 Solve 10m - 742 = -2m - 41m for m. 14 Solve -181i = -109i - 1224 for i. 17 Solve 39o - 200 = 19o for o. 10 Solve 362i - 1420 = 60i + 90 for i. 5 Solve 0 = -360x - 342x + 14742 for x. 21 Solve 73 = -6z - 14z + 393 for z. 16 Solve -1582m + 27899 = -3741 for m. 20 Solve -306s + 26 = -1084 - 1032 for s. 7 Solve 5j - 109 + 119 = 0 for j. -2 Solve -20812v = -20775v + 851 for v. -23 Solve 5m + 12m = 10m + 49 for m. 7 Solve -8336h = -8353h - 153 for h. -9 Solve 113b + 48b = -105b - 2926 for b. -11 Solve -121f - f = 15f - 1507 for f. 11 Solve -218v + 84 + 1311 = -311v for v. -15 Solve 0b + 208 = 8b for b. 26 Solve 478k - 4321 = -479k + 1106k for k. -29 Solve -1095 = 1140a - 1213*a	{ "pile_set_name": "DM Mathematics" }
u2 + 1 - 25u*3 + 8u*2 - 101u*3. -446u*3 - 2u*2 + 1 Collect the terms in 40759996i*2 + 2i*3 - 40759996i*2 + 18i. 2i3 + 18i Collect the terms in 119 - 48 - 46 - 25 + 208n3. 208n*3 Collect the terms in 278 + 376 + 271 - 1200 + 275 - 57y*2. -57y*2 Collect the terms in 25 + 10 + 0 + 12 + 19v - 26. 19v + 21 Collect the terms in -15l*2 - 3l*3 - 8263 + 3938 + 4325. -3l*3 - 15l*2 Collect the terms in -6i + 553587 - 553587. -6i Collect the terms in -4767 + 147u - 8989 - 149u. -2u - 13756 Collect the terms in 52052351 - 52052351 + 179u2. 179u*2 Collect the terms in -21295d*2 + 42097d*2 - 17447d*2. 3355d*2 Collect the terms in -17112090564i2 - i3 + 17112090564i2. -i3 Collect the terms in 3594s - 586652 + 586652 - 3563s. 31s Collect the terms in 5502362j + 8381164j + 2695848j + 378667j. 16958041j Collect the terms in -2 - 24645082r - 23017488r + 2. -47662570r Collect the terms in -k + 34k2 - 238k*2 + 10k*2 - 100k*3. -100k*3 - 194k*2 - k Collect the terms in -175w*2 - 494614w + 181w2 + 494614w. 6w2 Collect the terms in 2 - 9i*2 + 58i + 1 - 91i + 35i*2 - 3. 26i*2 - 33i Collect the terms in -2h3 - 4 + 47024687h*2 - 47024687h*2. -2h*3 - 4 Collect the terms in -11n*2 + 41 + 15n*2 - 2n + 45 + n*3 + 9n*2 + 7n. n*3 + 13n*2 + 5n + 86 Collect the terms in 61f2 - 119 + 149f*3 + 119 - 172f*2 + 91f*3. 240f*3 - 111f*2 Collect the terms in 265t + 4 + 265t - 3 - 556t. -26t + 1 Collect the terms in s2 - 4s*2 - 11500 + 45980 - 11493 - 11525 - 11462. -3s*2 Collect the terms in 16943q - 24462q - 22133q. -29652q Collect the terms in 1327518i + 60i2 - 1327518i - 180i2. -120i*2 Collect the terms in 59x - 24 - 24 - 8 + 58. 59x + 2 Collect the terms in -10c*3 - 31c*3 + 54c*3 - 36 + 2c*2. 13c*3 + 2c*2 - 36 Collect the terms in 3347 + 3t + 421 - t. 2t + 3768 Collect the terms in 822 - 1489 + q3 + 4q*2 - 4q2 + 675. q3 + 8 Collect the terms in 82u2 - 517u + 233u + 287u. 82u2 + 3u Collect the terms in 991 + 335l - 2220 + 1229. 335l Collect the terms in 36181z3 + 620 + 653 - 1922 + 649. 36181z*3 Collect the terms in 123232n*3 + 123253n*3 + 123236n*3 - 369711n*3. 10n*3 Collect the terms in -1299 + 8z + 649 + 23z + 33z + 652. 64z + 2 Collect the terms in -1818109321 + 1818109321 + 1925o*3. 1925o*3 Collect the terms in 524v - 524v - 48951v*3 + 10278v*3. -38673v*3 Collect the terms in -15873066n*2 + 31746181n*2 - 15873139n*2. -24n*2 Collect the terms in -3f*2 - 713f + 1449f - 736f - 203. -3f2 - 203 Collect the terms in 5525o + 121o - 2955o. 2691o Collect the terms in 5o - 329o3 + 21o + 352o3. 23o*3 + 26o Collect the terms in 64g + 60g + 3g - 243g - 5 + 65g + 70g. 19g - 5 Collect the terms in 1 + 1312t + 15t + 1609t + 1 - 1 + 1966t. 4902t + 1 Collect the terms in 1646627 - 1646627 - 888i2. -888i*2 Collect the terms in 109l*3 - 44l*3 - 64l*3 - 2l - 2263. l*3 - 2l - 2263 Collect the terms in -17b - 7b*2 - 12b + 3b + 21b*2 - 15b. 14b2 - 41b Collect the terms in -9m3 + 11m - 528m3 - 261m*3 - 77 + 36m*3. -762m*3 + 11m - 77 Collect the terms in -100276048r2 - 100276050r*2 + 200552103r*2. 5r*2 Collect the terms in 3r - 2r - 5471 + 2730 + 4r + 2730 - 3r. 2r - 11 Collect the terms in -2473l - 2475l - 2474l - 2472l - 2441l + 14795l - 2470l. -10l Collect the terms in 30z2 - 31z*2 + 4 - 1 + 3411z - 3411z. -z2 + 3 Collect the terms in 3n*3 + 320 - 24n*3 + 16n*3 - 320. -5n*3 Collect the terms in -17 - 15 - 4379n + 7391n + 11653n + 32. 14665n Collect the terms in 530r + 108 - 95r - 53r - 108 + 414r. 796r Collect the terms in -17248y2 - 35205y*2 - 7105y*2 - 14529y*2 - 8491y*2. -82578y*2 Collect the terms in -1265x*2 + 2711x*2 - 1377x*2. 69x*2 Collect the terms in -3439z*3 + 7125z*3 + 7863z*3 + 372z*3 + 1656z*3. 13577z*3 Collect the terms in -5 - 203g + 973g - 224g - 195g - 205g - 194g. -48g - 5 Collect the terms in 8012t3 - 3577t*3 - 2790t*3. 1645t*3 Collect the terms in -611l + 654l3 - 633l*3 - 21 + 609l. 21l3 - 2l - 21 Collect the terms in 53 + 6607h3 - 3308h*3 - 3300h3 - 100 + 47. -h3 Collect the terms in -2j + 6j - j*3 - 3j*3 + 62j + 7j3. 3j*3 + 66j Collect the terms in -797 + 391 + 39y2 + 41y + 404 + 2429y2. 2468y*2 + 41y - 2 Collect the terms in -51 - 1243x + 2077x + 47 - 836x. -2x - 4 Collect the terms in -1128y3 - 89y*2 - 59y*2 + 242y*2 - 94y*2 - 124y*3. -1252y*3 Collect the terms in -23h*3 - 1757 + h - 2334 + 12h*3 + 12h3 + 588. h3 + h - 3503 Collect the terms in -3y3 + 2394196y*2 - 1198609y*2 - 1195587y*2. -3y*3 Collect the terms in -13q*3 - 28q*3 - 4q*3 - 30q + 160q3 - 113q*3. 2q*3 - 30q Collect the terms in 8 + 5o + 5 - 5o - 19215571o3 + 19215567o*3 - 13. -4o*3 Collect the terms in 289d*2 - 52d*2 + 22 - 52d*2 - 3 - 192d*2. -7d*2 + 19 Collect the terms in -203y + 1486 + 410y - 208y. -y + 1486 Collect the terms in -2550i3 - 39 - 9i - 2548i3 + 5094i*3 - 33i. -4i3 - 42i - 39 Collect the terms in 6566j2 - 26259j*2 + 6580j*2 + 6567j*2 + 6581j*2. 35j*2 Collect the terms in 2967825 + 191w*2 - 2967825. 191w*2 Collect the terms in -19p*3 - 110 + 39p*3 + 88p*3 - 109 + 219. 108p*3 Collect the terms in -181930624h*2 - 181930695h*2 - 8h*3 + 363861319h*2. -8h*3 Collect the terms in -9 + 6303z*2 - 18890z*2 + 6305z*2 + 6302z*2. 20z*2 - 9 Collect the terms in 2414b - 1162b - 353b - 1. 899b - 1 Collect the terms in -9n*3 - 71085262n*2 - 71085270n*2 - 71085261n*2 + 213255793n*2. -9n*3 Collect the terms in 8k*3 - 219307 + 438590 - 219283. 8k*3 Collect the terms in 2f - 134f3 - 17f*3 + 63f*3 - 4f - 115f3. -203f*3 - 2f Collect the terms in -7956z - 5413z - 4312z + 2335z - 2591z. -17937z Collect the terms in 154j + 35 + 31 + 107 - 142j - 173. 12j Collect the terms in 70z*3 + 17z - 15z - 279 + 279 + 43z*3. 113z*3 + 2z Collect the terms in -2 + 181u2 + 79u*2 + 97u*2 + 2. 357u*2 Collect the terms in -214w*2 - 219w*2 - 220w*2 + 1305w*2 - 215w*2 - 216w*2 - 217w*2. 4w*2 Collect the terms in 4 - 2 - 1 - 2 - 322703x*2. -322703x*2 - 1 Collect the terms in 7q*2 - 2 - 2351q + 1273q - 2205q. 7q2 - 3283q - 2 Collect the terms in 185w - 2 - 5w*3 + 23w*3 - 4w*3 - 12w*3 - 5w*3. -3w*3 + 185w - 2 Collect the terms in -22h2 + 15h*2 + 86h*2 + 2h + 15h2 + 45h*2. 139h*2 + 2h Collect the terms in 681089s2 + 681058s*2 - 1362144s*2. 3s*2 Collect the terms in -3181 - 826 - 126v*2 + 64v*2 + 60v*2 - 529. -2v*2 - 4536 Collect the terms in -10r - 56r2 - 61r*2 - 174r*2 + 280r*2. -11r*2 - 10r Collect the terms in 226051v - 72506v + 135341v + 35011v. 323897v Collect the terms in 2185w - 7520w + 1 + 5335w - 1 - 18w3. -18w*3 Collect the terms in -16l*3 + 2 + 118l - 2l2 - 236l + 118l. -16l*3 - 2l*2 + 2 Collect the terms in 2042i*2 + 2046i*2 + 2037i*2 + 1952i*2 - 8061i*2. 16i*2 Collect the terms in -44 - 32 - 37 + 189 - r - 4 - 18. -r + 54 Collect the terms in 136 + 57b - 87 - 48 - 3b. 54b + 1 Collect the terms in 35w + 419 + 417 + 417 - 1253 - 175w. -140w Collect the terms in -1026r*2 + 10r*3 + 52r*2 - 35r*3 + 16r*3 + 10r3. r3 - 974r2 Collect the terms in -3035 - 1957u*3 - 910u*3 + 3035. -2867u*3 Collect the terms in 2n*3 - 215790733n*2 + 215790733n*2. 2n*3 Collect the terms in 1524l*3 + 584l*2 - 584l*2 + 1521l*3 - 3348l*3. -303l*3 Collect the terms in -1619o*2 + 2240 - 3201o*2 - 1120 - 1122. -4820o*2 - 2 Collect the terms in 1485u - 5u2 - 1173u*3 - 1482u - 2u2. -1173u*3 - 7u*2 + 3u Collect the terms in 0s - 1429 + 6s + 110. 6s - 1319 Collect the terms in 1799k - 604k - 597k - 239 - 38 - 600k. -2k - 277 Collect the terms in -107636 - 430k2 + 107636 - 18288k + 9145k + 9143k. -430k*2 Collect th	{ "pile_set_name": "DM Mathematics" }
6 Solve -933r + 929r = 5l, r = 5 for l. -4 Solve -8 = -2a + 4h, 4a = -152h + 178h + 70 for a. -2 Solve 4o = -0o + 5y - 9, -180y + 175y + 17 = -2o for o. 4 Solve -3c - 2j - 4 - 8 = 0, 15280c + 0j + j = 15279c - 5 for c. -2 Solve -2u - 6u + 5u - 2 + 26 = p, 18 - 3 = -3u for p. 39 Solve -1634u - 9 = -9j - 1630u, 129 = -49j + 2u for j. -3 Solve -46 = 4i + f, 451f = 149i + 455f + 184 for i. 0 Solve -3c = t + 33723880 - 33723863, -4t - 19 = 5c for t. 4 Solve 569r - 4b + 350 = 652r, -188 = -2r - 4b for r. 2 Solve k - 8 = 5n - 51 - 17, k + 8n = 83 for k. -5 Solve 22n - 11n - 111 = 24v + 8n, 6v + 4n - 3 = 11v + 10 for v. -5 Solve 18 = v - 2z, -58v + 831 + 326 = -3z for v. 20 Solve 43k + 2d = -4d - 140, 4k + 6d + 13 + 26 = 2d - 5 for k. -2 Solve 114 = -4b + 11p - 21p + 208, 0 = -2b + 4p + 92 for b. 36 Solve 22530g - 22461g = o + 81, 5g - 3o = 41 for g. 1 Solve 3m - 3u = -27, -19u + 1 = 5m - 26u + 56 for m. -4 Solve -w + 2 = -y, 5w + 6701 = -3y + 6751 for w. 7 Solve 0 = -10o + 8o + 3f - 1, -2o + 116 = -1919f + 1877f for o. -5 Solve -13161n + 13156n - 3u - 37 = 0, 3u = n - 7 for n. -5 Solve -38g - 5k = -40g - 65, -g - 2g + 20k = 15k + 105 for g. -40 Solve 3z - 39 - 22 = -8b + 9, 2z - 2 - 13 = b for z. 10 Solve -m - 26 = 24c - 28c, 24m = -c - 915 for m. -38 Solve 2x + 4j - 3 = -13, 5j + 125 = 603x - 601x - 18j for x. 5 Solve 217k + 4s - 2 = 216k + 1, k + 3 = 32s + 6 for k. 3 Solve -16 = -4a - 4v, -26a - 83v + 13 = -22a - 80v for a. 1 Solve 13j - 7j - 11j = 5h + 75, -6j + 148 = -52h + 6 for j. -11 Solve 67 = p - 55n + 53n, -23 - 4 = -26p + 3n for p. -3 Solve -147 = 5q + 4c, 0 = -621374q + 621357q + 2c + 15 for q. -3 Solve 8x - 11x - 18 = 17i + 2x, 2i - 5x + 58 = -0i for i. -4 Solve 16v + 3c + 2 = 14v + 33, -3v = -10c - 3 for v. 11 Solve 5i + 124 = 4487j - 4485j, -2j - i - 32 = 0 for j. -3 Solve 44s + 7 = 4z + 23, 4z - 224 = -4s - 0z for s. 5 Solve v + 0v + v + 5i + 41 = -7v - 69, -75 = 2v + 5i for v. -5 Solve t + 58u + 11 - 61 = 71u, -5u - 10 = -5t for t. -2 Solve -4n - 24 = -3c - 100, c - 2n + 28 = 0 for c. -20 Solve 42z + 43z = 81z - 6t + 5t - 112, -2z = -3t + 42 for z. -27 Solve -7i + 3b + 25 = -26, 3i = b + 21 for i. 6 Solve -2v - 12 = -5a, 1514a - 1510a = 5v + 13 for v. -1 Solve 7d + 3c - c - 10 = 0, -3d - 22712c - 23 + 3 = -22716c for d. 0 Solve 14j = 16j - 2q - 1 + 3, -5j - 225 = 50q - 0q for j. -5 Solve 0 = -3p, -6q - p - 16 = -9q - q for q. 4 Solve s + 0o - 4o + 6 = 27, 5 = 659o - 660o for s. 1 Solve 5t - 5 = -f + 4t, 43 + 108 = 47f + 5t for f. 3 Solve -w - 2b + 11 = 0, -91465w - 3b - 30 = -45743w - 45736w for w. 3 Solve 5j - 206 = -a - 187, -2j + a - 13 + 1 = 0 for j. 1 Solve -15k - 105 = 0, -2v + 2k - 1 = -v - k - 16 for v. -6 Solve -4z + 18p + 245689 - 245661 = 0, z - 4p - 8 = 0 for z. 16 Solve 2s + 5q - 510 + 508 = 0, 0 = -5s + 2q + 63 for s. 11 Solve i + 5t + 52 = 0, 44018i - 4t = 44021i + 35 for i. 3 Solve -20633b + 163 = -4z - 20628b, -2z + 3b = 83 for z. -37 Solve 4r = 3q + 1046 + 1046 - 2093, -15r - 80 = 4q for r. -4 Solve 2q + 5o + 3o - 1 = 8q + 8 + 21, 0 = 5o - 30 for q. 3 Solve -1904o + 1902o - 2x - 26 = 0, -2o = 4x + 44 for o. -4 Solve b = 1, b + 2 = 433z - 430z for z. 1 Solve -12q = x + 8q - 19q + 5, -8x + 5q = 79 for x. -8 Solve 14y = 43z + 41z - 89z - 153, 3z = 2y - 0y - 19 for z. -11 Solve 57i - 52i = f + 17, 4i + 0 - 10 = 2f for f. 3 Solve 5s + 12 = -3c, 4927s - 2 = 4929s + 2c + 10 for s. 3 Solve 0 = 38c + 55c - 5f + 1410, -655f = -c - 660f for c. -15 Solve -4m = 82o - 88o + 98, -4o = m - 47 for o. 13 Solve 3370 = 2y + 3c + 3393, -5y + 323 = -2y - 28c for y. 5 Solve 0 = 3n + 4a - 11, -59n + 534a - 539a = -54n - 10 for n. -3 Solve -129r - 11r + 3w = 980, 35 = -5r + 3w for r. -7 Solve 125071q = 125067q + 2x - 58, -2q + 3x - 35 = 0 for q. -13 Solve -39j - r - 18 = -43j, 0 = 10j + r - 38 for j. 4 Solve 66w - 45w - 791 = -7q, 5q - 10 = 0 for w. 37 Solve -118x - v - 1 = -116x - 3, 0 = -2x - 4v + 2 for x. 1 Solve -150p - 600 = 0, 9p - 2p = -4o + 2p + 6p - 3 + 15 for o. 2 Solve z + 0 - 17 = -6a + 13, -15z = 4a - 38 + 18 for z. 0 Solve 0 = -3b + 5l + 119, -1559l - 120 = 4b - 1553l for b. 3 Solve -5s - u = -9876 + 9885, 26 = -2s - 6u for s. -1 Solve -8l + 17l + 3 - 10 = -4m + 6l + 7, -42 = -19m - 2l for m. 2 Solve 0 = -7o + 2w - 45, 4o - 301w + 304w - 24 = 0 for o. -3 Solve -3k + 25 = -37a + 38a, 10k - 15 = -252a + 251a + 66 for k. 8 Solve -7c + 82469 = -5m + 82539, 0 = 4c + 4m - 8 for c. -5 Solve 0 = 3n + 8r - 246, -14r + 104 = 2n + 4r - 15r + 10 for n. 2 Solve -122g = 3n - 121g - 73, -4n + 4g = -92 for n. 24 Solve -v - 74 = 13l, 0 = -941l + 940l - 4v + 10 for l. -6 Solve 432o - 436o = -3m - 16, 86m - 84m - 6o = -24 for m. 0 Solve -3v + 17h = 36h - 22h - 129, 4v = 3h + 169 for v. 40 Solve 67m = -2r + 254, 18 = -2r - 4m + 3m - 3m + 20 for r. -7 Solve 0 = 2y + 4m - 24, 2y + 1485 = -2y - y - m + 1509 for y. 4 Solve p - 2p + 3t = -0p + 71, -8p + 1873 = -37p - 6t for p. -65 Solve 4g + 156c = 242c - 1306, 4c - 48 = -3g for g. -4 Solve 3u + 10176j - 29 = 10174j, 5u = -17j + 349 for u. -5 Solve -7c + 3c - 124 = 4x, 2c = 2x + 40 + 38 for x. -35 Solve 2t + 4a - 42 = 0, 1164t + 4a - 45 = 1161t for t. 3 Solve 121y + 60y - 1106 = -5r, -r - 26 = -7y + 2y for r. 4 Solve g - 3 + 35 = 0, g - 170 = 4u + 4g - 82 for u. 2 Solve 0o - 5o + 2o + 15 = 0, o + 8 - 21 = 4l for l. -2 Solve -53854m + 436 = -53850m - 5p, 0 = m + 12p - 162 for m. 114 Solve -22 = 3p + 56d + 50, -p + 2d = -2p + 1 + 25 for p. 32 Solve -8n + o + 1817 = -2o + 1779, -3n = -5o - 22 for n. 4 Solve 5b - 6 = 2w, 3w + 2w + 0w - 6 = 2b for w. 2 Solve 10b = 5b - 11b - 2o - 22, -5b + 3 + 1 = -3b - 2o for b. -1 Solve 2w - 4i = 5w + 25, 0 - 2 = -436i + 435i for w. -11 Solve 3332l + 8 = -c + 3334l + 23, 2c - 10l - 84 = 0 for c. -3 Solve 94d - 69 - 134 = 91d + 56v + 124, d - v - 3 = 0 for d. -3 Solve -25 = -15c + 16c + 2q, 17q + 235 = -c for c. 3 Solve 5f + 2794 + 2820 = 5j + 5514, 0 = -2j + 3f + 45 for j. 15 Solve 2b - o = 10, 3b + 169o + 2 = 350o - 173o + 17 for b. 5 Solve -22p - 408z + 404z - 230 = 3p, -2p + z - 49 = 2z for p. -2 Solve -5t + k - 6k = -58 + 118, 2t = -4k + 299 - 343 for t. -2 Solve 0 = -6v + 10v - 4k + 48, -2v = 14k - 50 - 6 for v. -7 Solve 365c - 733 + 951 = 5g + 358c, g - 4c - 128 = -g for g. -4 Solve 5h = 2448n - 2444n + 63, -4h - 4 = 0 for n. -17 Solve 2i + 42 = 2p, -60p - 4i = 64p - 129p + 104 for p. 20 Solve -34 = 2w - 3o, -4w - 104809 = -5o - 104755 for w. 4 Solve -935d + 14957 = 1341w - 1338w, 0 = 5w - 4d + 69 for w. -1 Solve -75042 = -a + 4a + g - 75058, -2g + 16 = 2a for a. 4 Solve 0 = 5v + 3h + 44, 0 = -4v - 542813h + 542815h + 44 for v. 2 Solve 3h = 2m + 138, -238h + 77m = -233h + 71m - 398 for h. 4 Solve -3m = 3t - 105, 0 = -t + 91767m - 91769m + 66 for t. 4 Solve -z - 116a + 70 = -119a, 80 = -4z + z + 2z - 3a for z. -5 Solve -5h = -2p - 44, -9289p + 9259p + 3h = 516 for p. -17 Solve -4w + 168 = -4u, 488w - 485w - 5u - 208 = 0 for w. 1 Solve -469o - 38 = -4i - 468o, -22o + 23o = -5i + 52 for i. 10 Solve -7u + 5k = -274, 22511u + 291 - 91 = 22507u - 4k for u. 2 Solve 5c - h + 37 = 0, 2c - 2 + 13 = 5h + 10 for c. -8 Solve -12 = r + 2i, -3r - 582 = -3r - 3i - 600 for r. 0 Solve -2z = -4k - 34, 11494k - 69 = 11496k - 5z for k. -2 Solve 95u = f - 4841, 2u - 62f + 123f + 110 = 59f for u. -51 Solve -g + 2r = 25, -44g + 85 = -39g + 5r for g. 3 Solve o + 8d = 11d + 31, 13o - 21 - 15 - 7 = -d for o. 4 Solve 7d + 28 = 3t, 12046d = 7t + 12049d + 12 for t. 0 Solve 3r - 2f - 1 - 7 + 1 = 0, 3r - 23f = 69 + 169 for r. -5 Solve 5r = -2685w + 2680w + 95, 0 = 4w + r - 4 for w. -5 Solve -3m + 2m + 12j = -7, -367m + 365m = 6j + 16 for m. -5 Solve 4n = -4o - 20, -2n + 26 = 198117o - 198121*o for o. -6 Solve -	{ "pile_set_name": "DM Mathematics" }
729q2 + 4774q - 4. -265427982 What is the third derivative of -665657f3g*2r*2 - 2f*3gr3 - 3f*2g*2r3 + f2gr + 12461fg*2r*3 wrt f? -3993942g*2r*2 - 12gr3 Find the second derivative of -12325020b*2 + 381094b + 2. -24650040 Differentiate 233486u2 + 18u + 202224 with respect to u. 466972u + 18 Find the third derivative of -195481203t*3 + 439565891t*2. -1172887218 Find the third derivative of -2011a*5 - 1270a*3 - 1206068a*2 - 44a. -120660a2 - 7620 Differentiate 17841307g*2o + 148157g2 + g + 2 with respect to o. 17841307g*2 What is the second derivative of 34dl3 - 12dl2 - 1599482dl + 29d - 519l3 - 30l*2 wrt l? 204dl - 24d - 3114l - 60 What is the second derivative of -3f*3r*2 + 34f*3r - 515005f2 - 1352r*4 - 1082r*3 wrt r? -6f*3 - 16224r*2 - 6492r What is the first derivative of -9335u2 - 50u - 15917115? -18670u - 50 Find the first derivative of 344573672k - 399007657. 344573672 What is the derivative of -7g4 + 3g*3 + 2159005g*2 + 327262781? -28g*3 + 9g*2 + 4318010g What is the third derivative of 51726f3g*2 + 3784f*3g - 44f2g - 813055f2 - 5fg2 - fg wrt f? 310356g2 + 22704g What is the third derivative of 4733b3t*3 - 2b*3t*2 - 496b*2t*3 - 44b*2t*2 - 23982 wrt t? 28398b*3 - 2976b*2 Differentiate -7n*2t + 5nt*2 - 3139450n - t*2 + 32t + 42548 wrt n. -14nt + 5t2 - 3139450 What is the first derivative of 6t*2y*2 + 6t*2y + t*2 - 841802t - 132973y2 - 4 wrt y? 12t*2y + 6t2 - 265946y What is the third derivative of 7278021f5 + f2 - 524567f - 5 wrt f? 436681260f2 What is the third derivative of 20654869h*6 - 115072h*2 - 44h? 2478584280h3 Differentiate -79132j*2 + 40j + 3253541 wrt j. -158264j + 40 Differentiate 33283it2 - 33i + 13113021t2 wrt i. 33283t*2 - 33 What is the second derivative of 4sv2 - 40558515sv - 851738v*2 wrt v? 8s - 1703476 What is the first derivative of 117422816k + 166123440? 117422816 What is the third derivative of 255d*6go + 22962d*3lo - 10d*2glo - 6d2go - 5dglo - 4344gl wrt d? 30600d*3go + 137772lo What is the second derivative of -95l*3 - 156890l*2 + 66268559l wrt l? -570l - 313780 Differentiate -19727827l*3 + 168502606. -59183481l*2 What is the derivative of -11899x*2 + 569x + 23610152? -23798x + 569 What is the third derivative of 3c*3qz - 45c*3q + 1127c3z + c*2qz - 56c*2z - 5cqz - cz + 24qz + 2z wrt c? 18qz - 270q + 6762z What is the first derivative of -11790709k*4 - 1175166 wrt k? -47162836k*3 What is the first derivative of -11864555o + 9737969? -11864555 Find the second derivative of 667j4 + 54j*3 + 8j*2 - 5272144j wrt j. 8004j2 + 324j + 16 Find the third derivative of 421p2x*6 - 1244p*2x*4 - 13552p*2x*2 + 19p*2 wrt x. 50520p*2x*3 - 29856p*2x What is the second derivative of -176893464cd*2 - 751cd + 168234c + 2d2 wrt d? -353786928c + 4 What is the second derivative of 70c4x*2 + 39271c*4 - 2cx2 - 13c + 332791x2 wrt c? 840c*2x*2 + 471252c*2 What is the third derivative of 5192227g*3 - 10179200g*2 wrt g? 31153362 Find the first derivative of -747897008f - 536459625 wrt f. -747897008 Find the second derivative of 14504162k4 + 14846072k wrt k. 174049944k2 Find the second derivative of -2071505f*3s*2 + 966f*3 + 435f*2s - 12f - 3s*2 wrt s. -4143010f*3 - 6 Differentiate 2v*4 - 12v3 - v2 - 13209v - 6686073. 8v*3 - 36v*2 - 2v - 13209 Differentiate -438410220y + 648504630. -438410220 Differentiate -2f*2 - 223476942f + 180878909. -4f - 223476942 Find the first derivative of 12900936t - 11184080 wrt t. 12900936 What is the first derivative of -8605630cvx2 + 2vx - 3v + 2x2 - 45x + 134 wrt c? -8605630vx*2 Find the third derivative of 110317v5 + v4 - 8v3 - v2 + 202977 wrt v. 6619020v*2 + 24v - 48 What is the third derivative of 3a2l*3y + a*2l*2 + 4095al3y - 477al*3 - 12al2y + 2l2y - 10184l2 wrt l? 18a*2y + 24570ay - 2862a What is the third derivative of 3454307f*3y*4 + 92530f*3y*2 - 17f*3y wrt y? 82903368f3y What is the first derivative of -5871218l3 - l2 - 12975690? -17613654l*2 - 2l Find the second derivative of 32s3w*2 + 377s*3 + 1811s*2w*2 - 12sw2 + w2 - 14235w wrt w. 64s3 + 3622s*2 - 24s + 2 Find the third derivative of -1097715395g4 - 496g*2 + 92256. -26345169480g Find the second derivative of 21984629h2 + 5751h - 661. 43969258 What is the second derivative of -259823kx*5 - 18232606k - 15x5 + 2x wrt x? -5196460kx*3 - 300x*3 What is the second derivative of -23755335g*5 - 22556g + 518 wrt g? -475106700g3 Find the third derivative of 478112614p*4 + 179752059p*2 wrt p. 11474702736p What is the second derivative of 4x5 - 9x*4 + 42961x*2 - 162997990x? 80x3 - 108x*2 + 85922 What is the third derivative of -40859873hn3q*2 + 5hn3q + 2hn + 3hq + 2h + 34n*2q*2 - 2nq2 + 6q*2 - 15q wrt n? -245159238hq*2 + 30hq Differentiate -12896286d*2 + d + 159891060 wrt d. -25792572d + 1 Find the third derivative of 64y5 + 43192y4 + y2 - 166y - 86289. 3840y*2 + 1036608y Find the second derivative of -p*5v*2 + 609910p*5 + 29366pv2 + 3v*2 + 3 wrt p. -20p*3v*2 + 12198200p*3 Find the third derivative of -26103241a*3 - 459a*2 + 2a - 104 wrt a. -156619446 Find the second derivative of -26q4 - 27438q*3 + 124q*2 - 614864718q. -312q2 - 164628q + 248 Differentiate -10043549r2 + 7071037 wrt r. -20087098r What is the third derivative of -243568735r3w*3 - 2r*2w*2 - 2r*2w - 41rw - w*3 - 1338w*2 - 1 wrt r? -1461412410w3 What is the second derivative of -b2t3 + 4b*2t - 594327b2 - 2452bt3 + 889t*2 wrt t? -6b*2t - 14712bt + 1778 What is the derivative of -9593332b2 + 10261329 wrt b? -19186664b What is the third derivative of 2b2z*3 - 4b*2z*2 + 4bz3 + 8bz2 + 4b + 28216z3 - 489z wrt z? 12b2 + 24b + 169296 Find the third derivative of -382147682c5 - 213c*2 + 11726. -22928860920c*2 Find the second derivative of -5552ijk + 3ik*2w*2 - 4ik2w + 47524jk*2w - j - kw2 - 19w wrt k. 6iw*2 - 8iw + 95048jw Differentiate -10559966m*2 - 6593324 with respect to m. -21119932m Find the second derivative of 2f2h*2 - 70818f*2h + 3709fh*2 - 12f - 229h3 + 13 wrt h. 4f*2 + 7418f - 1374h What is the second derivative of -255246816x*3 - 1336949570x? -1531480896x Find the third derivative of -148751754s*2v*3 + 31s*2v*2 + 331s*2v - 2sv + 2v - 86 wrt v. -892510524s*2 What is the third derivative of -49204677i*2n*3 + 64i*2n*2 - 2179i*2 + 33i - 1 wrt n? -295228062i2 Find the second derivative of 23508y*4 + 2y*3 + 12678558y wrt y. 282096y2 + 12y Find the first derivative of -217s3 - 5834s*2 - 5s + 75915511 wrt s. -651s2 - 11668s - 5 What is the third derivative of -77055888k6 + 45k*2 + 3k + 191928 wrt k? -9246706560k3 What is the first derivative of -210924843l*2v*2 - 33308l*2 - 121l + 1 wrt v? -421849686l2v What is the derivative of 5bcz2 - 6229bc + 373cz2 - 14c - 18z2 + 13z wrt z? 10bcz + 746cz - 36z + 13 Find the third derivative of -524547833p4 - 42p*2 + 2p + 1968. -12589147992p What is the derivative of 275707263f*4 + 20607501 wrt f? 1102829052f*3 What is the first derivative of -6291289a*2 + 14778694? -12582578a Differentiate 339qt - 6q - 4055t*2 - 98746 with respect to t. 339q - 8110t What is the third derivative of 160k*5 + 3194k*3 - 3063634k*2? 9600k*2 + 19164 What is the second derivative of -168u*3 - 7339u*2 + 173671812u? -1008u - 14678 What is the second derivative of -2r*2v*3 + 24r*2v*2 - 28r*2v + 237r2 + 10rv3 + rv*2 + 136r - 68v3 wrt r? -4v*3 + 48v*2 - 56v + 474 Find the second derivative of -96749763l2r + 1138lr + l - 3*r + 5755 wrt l. -193499	{ "pile_set_name": "DM Mathematics" }
- 3i = -28 for v. 4 Suppose -73d = -75d + 8. Suppose dg + 8 = 6g. Solve -2q = -4r - 14 + g, 0 = 4q - 4 for r. -2 Let p(z) = z*2 + 3z - 11. Let s be p(-5). Let x = s - -3. Suppose xr = 3g + 25, 29 = 2r - 5g - 6. Solve 2u - 5a - r = -u, 2u + 3a - 16 = 0 for u. 5 Suppose -11 = -2d + c + 2, -d - 3c + 10 = 0. Suppose -da - 6 = -9a. Let h = a - 0. Solve -4u = u + 4w - 15, 0 = u + 3w - h for u. 3 Suppose -50 = -7p - 22. Solve -t + 0r = r + p, 0 = -r - 4 for t. 0 Let r(n) = n2 + 3n + 8. Let c be r(-4). Suppose -14q = -cq - 18. Solve -11 = -d - 4t, -5d - 4t - q = -32 for d. 3 Let p(o) = -o2 - 2o + 11. Let d be p(2). Solve -dr = -2m - 9 - 11, 5m + 2r + 12 = 0 for m. -4 Suppose -19 + 1 = -3u. Let m be 0/(4 - 7) + -5. Let i(b) = 3b + 20. Let h be i(m). Solve -4z = hs - 37, -5z = -us + 2s + 5 for z. 3 Suppose 275p - 137p = 181p. Let g be (3/(-4))/((-2)/8). Solve -i = -pi - 3w - g, 3w = 2i for i. -3 Let w = -78 + 84. Let b(g) = -2g + 14. Let y be b(w). Solve t + 9 = yq, 0 = q + 2t - 4 - 3 for q. 5 Suppose 92z - 95z + p = -5, 2z = 2p - 2. Solve r = 2k + 3k - 6, 0 = 5r - zk - 14 for r. 4 Let d = 2 + 5. Suppose 4v + d = 31. Let h = -4 + 6. Solve 0 = r + 3w + 1 - v, -3w + 8 = -hr for r. -1 Let n be ((-90)/(-12))/((-3)/(-12)). Let s be 738/n + 61/(-10). Solve 4j = 20, -2c - 11 = -5j + s for c. -5 Let k(y) = y2 - 18y - 22. Let c be k(19). Let g be ((-10)/(-4))/(c(-1)/6). Solve 0 = 3l + 5a - g, -l + 4a + 5 = -8 for l. 5 Let f = -5 + -3. Let o be (f/6)/(9/(-27)). Suppose 2n - m + 13 = on, -n = -m - 2. Solve -l + 2l - w = n, l = 3w + 7 for l. 4 Let w be 21 - (-2)/1. Suppose -3i + 2r = 37, 0 = 2i - 3r + w + 29. Let l = 12 + i. Solve 5n = -lq + 5 - 33, 4q - 6 = 2n for n. -5 Let g(n) = 6n + 34. Let v be g(-5). Solve -3 = 2r - 5s + 15, 0 = -vr - 4s - 8 for r. -4 Let x = -13 + 18. Suppose 21 = xs - 0n + n, -2n = -4s + 14. Suppose -sh - 16 + 40 = 2g, 2h + 4g = 24. Solve 5q + 3v = 2, 4q + 0v = hv - 24 for q. -2 Let i = 24 + -8. Suppose -h = -4j + i, -h - 7j = -4j - 12. Suppose -2w - 19 + 47 = 0. Solve 3l + 4v = w, 5l + 25 = 3v - hv for l. -2 Let b = -9 - -12. Suppose bg - 6g = -12. Suppose 0 = -8m + gm + 8. Solve h = 4a + 9, a = -3h + mh - 1 for a. -2 Suppose -106 - 92 = -22r. Solve -5v + 0v = -z - r, 4v = -z for z. -4 Let i be (-28)/(-140) + (-24)/(-5). Solve 0 = 5m + 5, -a = im + 3 for a. 2 Let z = 618 + -614. Solve zr - 3m = 12, 5r + 2m - 15 = -0m for r. 3 Let g(n) = 2n2 - 15n + 10. Let y be g(7). Solve 4l - 5d = -10, 6 = -3l + yd - 0 for l. 0 Let n = 3 + -2. Let j(u) = -5u - 48. Let q be j(-11). Let m(t) = 20t - 122. Let y be m(q). Solve n = -h, 2s + 3s - 2h + y = 0 for s. -4 Suppose -4c = -c + 15. Let b be 0(c + 1 + 3). Suppose 0 = a - 0a - 2. Solve 0k = -2t - k, -4t + ak + 8 = b for t. 1 Suppose -10 + 7 = -z. Let o be -4 - 2/(z(-6)/63). Solve 5r = 4j - o, -3j - 31 + 7 = 5r for r. -3 Let v = -698 + 700. Solve 2n - 1 = 5b - 17, 3b - v = 5n for n. 2 Let r = -78 - -69. Let a be 31/r-21 - 4. Solve 0 = p - m + 4m + 5, -25 = 5p + am for p. -5 Let h be 9/(-6)340/(-15). Let i = h + -29. Solve 0 = -4r - 5n - 4, -5 = 4r + r + in for r. -1 Suppose -192 = -5r - 147. Solve -3d + b - 3 = -r, 5d - 24 = -3b for d. 3 Let n = -144 + 105. Let p = n + 49. Let i be 6/1 - (2 + -1). Solve 2d + p = 2t, it - 12 = d + 1 for d. -3 Let c(x) = -x*3 - 15x*2 - 3x - 40. Let l be c(-15). Solve l = j + z + 4z, 0 = -4j - 2z + 20 for j. 5 Let y = -20 - -24. Suppose yq + 39 = 7q. Solve 5z - 12 = 3n, -4z - 2n = -n - q for z. 3 Suppose -p + 0p = 2h - 7, -5p = h - 26. Suppose -4i = -8w + 7w - 3, -w - 5i = -42. Solve 2n + z = 3n - p, -4z = -3n + w for n. 3 Let n = 174 + -172. Let m(p) = 3p2 - p - 1. Let i be m(-1). Suppose 4 = 4o - 0, -3h + 4o = -2. Solve hc = -4v - 0v - 20, -nc - iv = 16 for c. -2 Let i be (-2)/(-4) - 69/2. Suppose f + u + 61 = -u, 3f + 183 = -3u. Let p = i - f. Solve -2x = -0x + g - 7, -3x + p = -4g for x. 5 Let o be (-2)/2(-40 + 3). Let t = -44 + o. Let x = t + 11. Solve 1 = -xb - 2p - 1, -4b + 13 = -3p for b. 1 Suppose b = -0b. Let h(p) = -4p - 1. Let a be h(-5). Suppose bm + t = 2m - a, 5m = 3t + 46. Solve 3x + m = 4u, -3u + 0 + 22 = -5x for u. -1 Let s(y) = y*3 + 4y*2 - 8y + 6. Let g be s(-5). Let m be ((-64)/28)/((-6)/g). Solve 0 = 3d - 2p + 12, 3d + mp + 12 = 3p for d. -4 Suppose 0 = -2a - 5l - 25, 4l = 5l + 5. Solve 14 = -2d + 2p, -2d - 2 = -ap + 2p for d. -4 Let g(h) = -h*3 - 22h*2 - 3h + 4. Let n be g(-22). Suppose 38 = 6q - n. Solve u - q = 4j, -2u = 4j + 2u + 28 for j. -5 Suppose -23b + 28 = -9b. Solve 4f + 7 = bz - 3, 2f + 3z = -1 for f. -2 Let k = 105 - 102. Solve ki + 2i - 3f - 5 = 0, 3i - 4f = 14 for i. -2 Let w(a) = -a*2 - 9a + 3. Let p be w(-9). Let t be (-112)/18 + (-4)/(-18). Let d be -6(6 - p)/t. Solve dm - 2 = o - 12, m = 5o + 20 for o. -5 Let s be (-7 + -1 + 8)/1. Solve 3l + 2 = -i, -3l = -3i - 6 - s for i. -2 Suppose q - 5c + 3 - 29 = 0, q - 10 = c. Solve -5g = -3s - q, -6s + 2s - 8 = -5g for g. 0 Let k(a) = -a*3 - 7a*2 - 4a + 12. Suppose 3h + 18 = -0h. Let b be k(h). Solve b = -2u + 5m - 15, 3u + 5m - 15 = -0m for u. 0 Let v = 153 - 81. Suppose 15s - v = 6s. Solve -3j = u - s - 12, -4u = -2j - 10 for u. 5 Let a be 3 + (-1)/(-2)-2. Let i = 2 - a. Suppose 16t = -13t + 12t. Solve c + 2 = -y - ty, 2y + 3c + 4 = i for y. -2 Let w = 0 - -12. Let z = 12 - w. Let c be 5 - z/((-6)/(-3)). Solve 2 - 9 = 3f + 2v, -4v - 15 = cf for f. 1 Let o = -334 + 340. Solve -5l + 2a - 33 = 0, 0 = -l + ol - 5a + 45 for l. -5 Suppose 3q - 4z + 3 = -0, 6 = 3q - z. Solve 0y = 5u + qy, 2u - 2y + 16 = 0 for u. -3 Let b be -13189/(-81). Let f be b/(-49) - (-360)/21. Let x be 1/(-2 - -4)0. Solve -5c - 15 = 0, xo - f = 2o + 5c for o. -1 Suppose -2w + 3 + 17 = 0. Suppose -26 = -3b + w. Suppose b = 3l - 0. Solve -lq = -4m - 4, -4q - 6m - 1 = -5m for q. 0 Let c be (-6 - -4 - -2)/(-1). Solve c = 5i - 4l - 6, -l - 2 = -i - 0 for i. -2 Let q = 238 + -233. Solve w + 3z = -7 - 12, -5w + 5z + q = 0 for w. -4 Suppose -28 = -0v - 3v + 4u, 2u = -4v + 30. Suppose -2t + 4t - v = 0. Solve -5y + 7 = 2s - 7, 5s - ty = -31 for s. -3 Let r be (5/(-15))/((-3)/36). Suppose 24 = 5d + 4h, rd + h - 2h = 36. Solve 4z = -2a + 14 + 6, 5a = 4z + d for z. 3 Suppose 8z = 6 - 126. Let b be z2/(24/(-4)). Solve 4k - h = 0, 2k - k - bh = 0 for k. 0 Let y(b) = -b + 6. Let t be y(6). Let d = -16 - -11. Let g = d - -8. Solve 5f - gi + 8 + 6 = t, 16 = -5f + 2i for f. -4 Suppose 3l - 2l - 5 = 0. Suppose -6q + 223 = 205. Solve -3w + 6 = q, -ly + 10 = 5w for y. 1 Suppose 2b + 3l = 4l + 216, 114 = b + l. Suppose 4c - 6s + 7s - b = 0, 0 = s + 2. Solve c = -m + 5w, -2m + 3 = -w + 14 for m. -3 Let p(x) be the first derivative of 13x3/3 - x2 + 4. Let o be p(1). Let b = o - 8. Solve -2h - 2 = n + b, n - 5 = 0 for h. -5 Let b(q) = -q2 + q + 1. Let v(l) = -l2 + 24l + 44. Let p(y) = -2b(y) + v(y). Let o be p(-20). Solve -2h - 2x = 3h - 6, -3x = -oh - 9 for h. 0 Suppose -18j + 2 = -17j. Solve -31 = -jd + 4d + 5n, d = 5n + 22 for d. -3 Suppose 434 = 5u + 414. Solve -5v = 2z - 2, -5z + 3z - 2v - u = 0 for z. -4 Suppose -4o - 3c = 3, -2c - 2 = 7o - 5o. Suppose 3b + 4t - 29 = o, 0b = 2b - t - 1. Solve -z + 0 = -bg + 6, 2g + 5z = 21 for g. 3 Suppose -2m - u + 3u + 66 = 0, -13 = -m - 4u. Let i = m + -18. Solve -2w - c + i = 0, -2w - c + 2 = -3w for w. 3 Let l(p) = -p*2 - 10p - 12. Let y be l(-8). Solve 0 = 5s + 5t, -2s + 5t + 3 = -y for s. 1 Let t = 174 - 170. Solve 0 = 3z - tn, -2z + 3z = 5n + 11 for z. -4 Suppose -4l + 3p = -l - 24, -p = -2l + 14. Suppose -25 = 2z - 7z, -3z - l = -r. Solve -3q + 5y = 37, 5y = -5q + 4q + r for q. -4 Let p(l) = 2l2 + 3l - 3. Let f be p(1). Solve 6j - 4 = fj - 2g, -2j + 4g + 12 = 0 for j. 2 Let y = 316 - 316. Solve y = -3l - 2h - 3, 0 = -5l + 2h - 2 - 3 for l. -1 Let b = -49 + 54. Suppose 70 = 2q + bq. Solve 0 = 3a + 5r + 3, q - 3 = -2a - 5*r f	{ "pile_set_name": "DM Mathematics" }
37 Is -5 less than -14.88? False Is -1.806 != 16? True Is 11113 > 122240/11? True Which is smaller: -8/1561 or 21? -8/1561 Which is smaller: 0.158 or -0.93? -0.93 Which is bigger: -135550 or -135548? -135548 Are -7026.59 and -2 non-equal? True Is -397629 >= -397630? True Which is smaller: -30407 or -30400? -30407 Which is smaller: -2/21 or -900445? -900445 Which is greater: 2 or 13719? 13719 Are 746069 and 0.2 nonequal? True Which is bigger: 762 or 9894/13? 762 Which is smaller: 1392 or -2707? -2707 Which is greater: -1 or -1/853929? -1/853929 Is 518 at least 506? True Is 1004883 >= 1004881? True Is -19 > -2284? True Which is greater: 1 or -36/6257? 1 Is 138 at least as big as 1244/9? False Is 0.1 at least as big as -2/9? True Which is greater: -827 or -38033/46? -38033/46 Which is greater: 1/51 or -56/47? 1/51 Which is bigger: 20064/37 or 543? 543 Which is greater: 0 or 1/239998? 1/239998 Which is greater: 105313/7 or 15045? 15045 Which is smaller: 210 or 4601? 210 Is -1 equal to -7/11943? False Which is bigger: -32 or -3939/118? -32 Which is greater: 35 or 10522? 10522 Which is greater: 1 or 292/355? 1 Is 804 smaller than -4? False Do 0 and 19/1516 have the same value? False Is -283 at most as big as -389? False Which is smaller: -740 or -49610/67? -49610/67 Are 5166 and -46 equal? False Which is greater: 1746 or -1.02? 1746 Is 0 != 5/740469? True Which is smaller: -374 or 280? -374 Which is greater: 0.04395 or -14? 0.04395 Which is greater: 0.3 or -17268? 0.3 Which is smaller: -13 or -18915? -18915 Is 41969 < 41970? True Is -1346064 less than or equal to -1346064? True Is -37 != -3885/109? True Is -2556 > -3198? True Is 11.7 at least as big as -149? True Are 6945 and 6945 nonequal? False Is 0.6 >= -0.020052? True Is -55218 smaller than -55169? True Is -3/110 at most as big as -1? False Is -18339 greater than or equal to 1? False Which is greater: 138730 or 0.5? 138730 Is 1095 at least as big as 1095? True Is 2572/357 at most 8? True Do 96 and 383/4 have different values? True Is -34 smaller than -1446? False Is 714 less than 724? True Are -398240 and -398247 equal? False Which is greater: -51/14 or 1/18? 1/18 Is -51461 greater than or equal to -51460? False Is -100 bigger than -2.104? False Which is smaller: -668 or -677? -677 Is -401.525 not equal to 3? True Which is smaller: 137 or 78? 78 Are 20561/84 and 245 unequal? True Is -1 equal to 138690? False Is 64379/25 greater than or equal to 2574? True Which is smaller: -75869/3 or 0? -75869/3 Is 0 > 3/7368178? False Which is greater: -220913 or 3? 3 Which is bigger: -526735 or 1? 1 Is -4/710039 at least -1? True Is 31512 less than or equal to 31516? True Is -13 at least -5367/404? True Is -15738 at most as big as -15737? True Are -0.39 and 7051/17 unequal? True Which is greater: 0 or 1/9254277? 1/9254277 Which is greater: 276217/4 or 69055? 69055 Which is smaller: 8/7809 or 0? 0 Is -48473 bigger than -48471? False Are -0.2 and 19226 equal? False Which is smaller: -729271 or 0? -729271 Is -357018 > -357019? True Which is smaller: 2/3 or 3/1214? 3/1214 Which is smaller: -8872 or -8804? -8872 Are 1112 and 1114 equal? False Is 4000 greater than 51? True Which is smaller: 3758 or 3757? 3757 Do -12/279791 and 1 have different values? True Which is greater: -14765/19 or -776? -776 Is 36862 not equal to -2/3? True Is -16846 equal to -16839? False Which is smaller: 1/4 or -89072? -89072 Which is bigger: 366 or 327? 366 Which is smaller: -0.3 or -64606? -64606 Which is smaller: -2 or -4750837? -4750837 Do -7607 and 377 have the same value? False Is -212 smaller than 0.36? True Which is greater: 2/3 or -42127? 2/3 Is -1/9 greater than 4017? False Which is greater: -2/7 or 92.5591? 92.5591 Do 2412 and 2394 have the same value? False Are 207279 and 207278 nonequal? True Which is smaller: 5210/33 or 158? 5210/33 Which is smaller: 23470 or 281627/12? 281627/12 Which is smaller: 1859 or 1860? 1859 Is 1667 at most 1672? True Which is smaller: -34 or 189? -34 Which is greater: 8650 or 8543? 8650 Which is greater: 1 or -2/215993? 1 Which is bigger: -36/10681 or -1? -36/10681 Is -4122 less than -4116? True Is -223 < -117? True Which is smaller: -5079 or -45718/9? -45718/9 Which is smaller: 61 or 2/589? 2/589 Which is greater: 1 or 2/2042741? 1 Is -235298 < -235296? True Which is smaller: -0.1 or 7224132? -0.1 Is 26729 less than 26729? False Which is smaller: 261 or 352? 261 Is 141389 greater than 141388? True Is 1/278 >= 0? True Which is smaller: -7488 or -22463/3? -7488 Does 13.35 = 6? False Is -35/493 at least as big as 1? False Which is smaller: -45 or -3568/79? -3568/79 Which is smaller: -126608 or -126609? -126609 Is 24022 at most 24022? True Is -4/70673 greater than or equal to 1? False Is 13674 at most as big as 13637? False Which is greater: 589873 or 589874? 589874 Which is smaller: -416.6 or 2/57? -416.6 Do -16/2955 and 2/3 have the same value? False Is 115/38 at least -5/28? True Do 188042 and 188041 have the same value? False Is -17735 at least as big as -17738? True Is 15473 > 1? True Is -1/835320 != 1? True Which is greater: 2 or -1365/17? 2 Is -964923 >= 0.1? False Are -11/5 and -0.9507 nonequal? True Which is greater: 1 or 239/6762? 1 Which is smaller: -0.0086123 or 0.1? -0.0086123 Which is smaller: -17/8958 or 1? -17/8958 Are 47908 and 47907 nonequal? True Is 4 less than 317.097? True Are -2/40887403 and -1 non-equal? True Which is smaller: -29/5221 or -1? -1 Which is smaller: -71 or 235? -71 Which is bigger: 9355 or 9356? 9356 Is -8632 not equal to -8770? True Which is greater: 1/56 or 12671? 12671 Is 12 at most as big as 110.92? True Is 58 != -2630? True Is 25 >= 627/25? False Which is smaller: 69461 or 69463? 69461 Which is smaller: -6118/181 or 0.1? -6118/181 Is -2883 equal to -2900? False Which is greater: 0 or -5/113431? 0 Which is smaller: -169924 or -169915? -169924 Which is smaller: 667 or 15/11? 15/11 Which is greater: -0.3 or 304766? 304766 Which is smaller: -39 or -3361/85? -3361/85 Are 1 and -2/1340591 unequal? True Does 1430 = 1433? False Is -26/5657 not equal to 2/7? True Is 19648/23 at least 854? True Which is bigger: 1/4 or 165520? 165520 Which is smaller: 13020 or 12987? 12987 Which is bigger: 7637/1495 or 5? 7637/1495 Which is greater: 0 or 34349? 34349 Which is bigger: 19.9439 or 0.17? 19.9439 Which is smaller: -926 or -550? -926 Is -811213 <= -811214? False Is 117654 smaller than 117639? False Do 36186/5 and 7236 have different values? True Is -553 smaller than -554? False Which is greater: -21084/11 or -1918? -21084/11 Which is smaller: 158684 or 158687? 158684 Is -319949 > -319946? False Is 2/81911 != 0.11? True Which is smaller: 828 or 267? 267 Is 6 >= 151232? False Which is smaller: -0.2335 or 4/9? -0.2335 Is 44816 smaller than 44798? False Is -879 != -18449/21? True Is 8 > -0.12683? True Is 5153 at most as big as 4922? False Is 805 <= 759? False Which is greater: 3863 or -1/2? 3863 Which is greater: 711 or 717? 717 Is -20711 smaller than -2/201? True Are -1045 and -15683/15 non-equal? True Which is bigger: -254389 or -1271951/5? -254389 Is -2.1 > 2303? False Which is smaller: 404/1113 or 1? 404/1113 Is -1 smaller than -11394? False Which is greater: 243 or 13605/56? 243 Which is smaller: -3034 or -33369/11? -3034 Is 137276 at least 137277? False Is -47 at most as big as 133? True Is 2532 less than 2558? True Is -43932/19 != -2313? True Is -64.16935 at least as big as -1? False Which is greater: -65980/7 or -1/4? -1/4 Is -104797 less than -104797? False Which is smaller: 284 or 1134? 284 Which is smaller: -2.68 or 195/2? -2.68 Which is bigger: -49338 or -49330? -49330 Is -134027 less than or equal to -134027? True Which is bigger: 3322 or 26583/8? 26583/8 Is 1/401069 greater than -1? True Is 971 at least as big as 954? True Is 16402 not equal to 16409? True Which is bigger: -1/2204250 or -1? -1/2204250 Is -667 bigger than -351? False Which is smaller: -184543/27 or -6835? -6835 Which is smaller: -118/713 or -9/7? -9/7 Is -55/9 < -3/25? True Which is greater: -146908/217 or -677? -146908/217 Which is greater: 1 or -37/1963? 1 Which is smaller: -111832/19 or -5885? -111832/19 Which is smaller: 25/2342 or -1? -1 Is -48 less than -112? False Is 41 not equal to 1817/44?	{ "pile_set_name": "DM Mathematics" }
e Is 6319 a prime number? False Is 52443959 composite? False Is 149921311 a composite number? False Is 5060741 a prime number? False Is 15266981 prime? True Is 377671831 composite? True Is 637633 a prime number? False Is 7238809 a prime number? False Is 28001161 prime? True Is 43060309 prime? True Is 10375931 a composite number? True Is 4992511 a composite number? False Is 22692673 composite? False Is 51461789 a composite number? False Is 11549317 a prime number? False Is 211681307 a composite number? False Is 37139251 prime? True Is 353668901 a composite number? True Is 105001181 composite? False Is 53017007 composite? False Is 42255419 a prime number? False Is 4024021 prime? True Is 185580443 prime? False Is 9444971 a prime number? False Is 10434443 prime? True Is 1562609 a composite number? True Is 31689953 prime? False Is 916441 a composite number? False Is 10381799 composite? True Is 4186381 a composite number? False Is 207887371 a composite number? False Is 8761843 a composite number? False Is 32481193 a composite number? True Is 38058923 composite? True Is 780359 composite? True Is 6944843 prime? False Is 83817793 a prime number? False Is 22489951 a composite number? True Is 14315629 a composite number? False Is 6192253 a composite number? False Is 79473809 composite? True Is 57864493 a composite number? False Is 154000027 a prime number? True Is 1325833 composite? True Is 2845499 a composite number? False Is 12982939 prime? False Is 863021 a composite number? True Is 4870219 a prime number? True Is 40164829 composite? True Is 4802335 composite? True Is 194429009 a composite number? False Is 22919803 prime? True Is 239511799 a composite number? False Is 5016773 a composite number? False Is 1432213 composite? True Is 6255173 prime? True Is 15093769 a prime number? False Is 41562182 prime? False Is 1999499 a composite number? False Is 27204007 composite? True Is 136735849 composite? False Is 999107 composite? True Is 1240931 a composite number? False Is 92954177 a composite number? True Is 4804187 a composite number? False Is 158052187 prime? True Is 9109007 a prime number? False Is 4061537 a prime number? False Is 50415499 prime? True Is 240490123 a composite number? False Is 19318102 composite? True Is 280309 a prime number? False Is 25314271 prime? True Is 1979533 composite? True Is 10616113 a composite number? True Is 22982803 composite? True Is 210493 composite? True Is 294592541 composite? True Is 6839549 prime? False Is 4392259 prime? True Is 37849139 a prime number? True Is 164081 composite? True Is 31438177 prime? True Is 8332271 prime? False Is 13610759 a composite number? False Is 5191591 a prime number? False Is 26836021 composite? False Is 15804071 a composite number? False Is 12402187 composite? True Is 103103915 prime? False Is 1277935 a composite number? True Is 1329770163 a prime number? False Is 3345899 prime? False Is 10974737 a prime number? True Is 1110106 prime? False Is 150217589 a prime number? True Is 13305157 composite? False Is 8604991 a prime number? True Is 13616531 a prime number? False Is 72770129 a prime number? False Is 252132871 a prime number? False Is 6869195 a composite number? True Is 746259 composite? True Is 84985267 prime? False Is 4784141 prime? True Is 122760397 a prime number? False Is 5332111 prime? True Is 3260591 a prime number? True Is 9493405 a prime number? False Is 4804661 prime? True Is 3181651 a prime number? False Is 4438523 prime? False Is 6177085 composite? True Is 221201117 a prime number? True Is 59091 prime? False Is 7725829 prime? False Is 3992611 a composite number? True Is 9323723 a prime number? True Is 10575535 prime? False Is 1650043 composite? True Is 14447291 a composite number? True Is 6494443 a composite number? False Is 1539709 prime? False Is 193067599 prime? True Is 41880127 prime? True Is 1460182 prime? False Is 43152823 a prime number? False Is 40675981 a prime number? False Is 3639193 composite? False Is 14669419 a prime number? False Is 147423901 a prime number? True Is 104841059 prime? False Is 65924681 a composite number? False Is 11049877 composite? False Is 379799773 a prime number? False Is 6562351 composite? False Is 22189291 composite? False Is 73100711 a composite number? False Is 14996077 prime? True Is 50042483 a prime number? False Is 1212691 composite? True Is 11967971 a prime number? True Is 31223177 composite? True Is 115325963 composite? False Is 14934497 a composite number? False Is 1751759 prime? False Is 1806281 a prime number? True Is 1900979 a prime number? False Is 766459 composite? True Is 46249393 a composite number? True Is 27937357 prime? False Is 5879333 composite? False Is 357682717 prime? False Is 63927401 prime? True Is 2394059 prime? False Is 1218803 prime? False Is 749231 a composite number? True Is 25704949 prime? True Is 639625243 composite? True Is 30255109 a prime number? True Is 18865139 composite? False Is 215928697 a prime number? False Is 4853209 composite? True Is 3059759 a composite number? True Is 45348679 prime? True Is 105223381 prime? True Is 44048489 composite? True Is 2009831 a composite number? False Is 68699843 prime? True Is 20996159 prime? False Is 247529 prime? True Is 2923351 prime? True Is 109405531 a composite number? False Is 143919221 a composite number? True Is 5068339 a composite number? True Is 17739937 a prime number? True Is 30413798 a composite number? True Is 179002613 composite? False Is 4117957 prime? True Is 6601142 prime? False Is 32145671 composite? False Is 988115561 a composite number? True Is 43047217 composite? True Is 7649027 a composite number? True Is 37160659 a composite number? False Is 10587323 a prime number? True Is 8725877 composite? False Is 80467283 composite? True Is 67579693 prime? False Is 4548851 prime? False Is 45104389 prime? False Is 45865367 prime? True Is 26170853 composite? False Is 9597169 composite? True Is 100396706 composite? True Is 32955007 composite? True Is 7639937 a composite number? True Is 708197447 composite? True Is 53088547 prime? True Is 573065 a prime number? False Is 2378186 composite? True Is 40715551 a composite number? False Is 84983 prime? False Is 12203957 composite? True Is 146203 prime? True Is 13593233 composite? False Is 15844331 a prime number? True Is 268192207 a prime number? False Is 188491 prime? True Is 16290685 composite? True Is 457799009 composite? False Is 1984891 prime? True Is 20600633 composite? False Is 11386409 composite? False Is 379007 prime? True Is 3608039 a composite number? False Is 9338011 a composite number? False Is 98517541 prime? False Is 3912203 prime? False Is 520369 prime? True Is 2099609 a prime number? False Is 7276307 a composite number? True Is 14892415 a composite number? True Is 3456361 a prime number? True Is 890711 composite? False Is 6011231 a prime number? False Is 157488767 composite? True Is 3268073 a composite number? True Is 140150483 prime? False Is 14830703 a prime number? True Is 9188701 a composite number? False Is 191045119 a composite number? False Is 16345229 composite? False Is 240793487 prime? False Is 74039089 a composite number? False Is 3508231 prime? True Is 38113 composite? False Is 43931003 prime? True Is 1876705 a prime number? False Is 74945429 a prime number? False Is 52825679 a composite number? True Is 4470203 a prime number? False Is 30589093 a composite number? True Is 30536069 a prime number? True Is 3629371 a composite number? True Is 410001569 composite? False Is 1626121 a composite number? True Is 1966463 prime? True Is 5472329 composite? True Is 425213 composite? True Is 82677943 prime? False Is 4019047 composite? False Is 2460109 prime? False Is 1066297 a prime number? True Is 5466103 composite? False Is 23014801 composite? False Is 5286607 a prime number? False Is 12040417 a composite number? False Is 506729 prime? True Is 261259 a prime number? False Is 4041407 a prime number? True Is 5899099 a composite number? False Is 398424671 prime? True Is 318153629 prime? True Is 28766947 a composite number? True Is 201139958 prime? False Is 14938457 a prime number? True Is 98955107 composite? True Is 10862411 a prime number? False Is 128710151 composite? True Is 75515537 a compo	{ "pile_set_name": "DM Mathematics" }
et n(m) = 4m2 - m - 5. Let t(v) = 3v*2 - 4. Let a(y) = -2n(y) + 3t(y). Let l be a(-2). Which is smaller: 1 or l? l Let n = 23.011 + -0.011. Let p = -129.2 + 152. Let g = p - n. Which is greater: g or 4/5? 4/5 Let j = -34.48 - 0.52. Let z = 35.8 + j. Let b = 92 - 646/7. Which is greater: b or z? z Let z = -96 + 95.953. Let u = -0.077 - z. Let j = 0.1 - 0.1. Which is greater: j or u? j Suppose -2y = 4m + 90, -m - 11 = 2y + 13. Let x be m/(-8) + 12/48. Let z = 3 - x. Which is smaller: -1/9 or z? -1/9 Let n(b) = b*2 - 6b - 7. Let t be n(7). Suppose -5a - 4 - 11 = -2r, 5r + a + 3 = t. Is r smaller than -1? False Let m = -18 - -14. Let q be 6/m - 124/(-8). Suppose -9k + 25 = -qk. Which is smaller: k or 1? k Let y(t) = -t2 - t - 1. Let l be y(0). Let k = -45 + 40. Let g be (2/l)/(10/k). Is -3/8 greater than or equal to g? False Suppose -4f + 0f + 8 = 0. Let g be (6/(-72))/(f/(-20)). Is 0 bigger than g? False Let r be 12/3 + -3 - 5. Let a be -2 - (-2 - r) - -3. Let u = 5523/20 + -276. Which is greater: u or a? u Let w = 46 - 18. Let l = 28.17 - w. Is -1 greater than l? False Suppose -i - 2 = -0i. Let r(u) = u*3 + 2u*2 - 6u + 6. Let d be r(-4). Is i at most as big as d? True Suppose -4b - 4k = -8, 3b + 4 - 14 = -k. Suppose -4g + 2d = 22, 5g + bd = 3g - 6. Let a = -127 - -124. Does a = g? False Let s be (22/4)/(139/46 + -3). Is -0.1 equal to s? False Let b = -63 - -66. Let r = -4 - -7. Do b and r have different values? False Suppose 88 = -8j + 248. Is j less than 9? False Suppose -3y + 15 = -0y, -40 = 2g - 4y. Let p be ((-16)/(-18))/(g - -9). Let x(m) = m + 9. Let u be x(-9). Do u and p have the same value? False Let b(g) = g2 - 14g + 13. Let p be b(13). Suppose pa - 2a = 0. Is -6/19 bigger than a? False Let j = -125 + 237. Suppose -3d - d = -j. Suppose 7t - 3t = -d. Is t less than -3? True Let l be (4 + 0 - 5)/((-4)/(-92)). Is -31 equal to l? False Let t = 68 + 47.3. Let j = -115 + t. Does j = 3? False Let x be 1(-9)/(-12)52/(-39). Which is greater: 22 or x? 22 Suppose -119 = -4f + 5u, 5f + 5u - 72 = 43. Let s = 65 + -92. Let y = s + 53. Is f < y? False Suppose 2t + 6 - 30 = -2f, -5t = -25. Let g(d) = d - 7. Let c be g(f). Let u be (-8 + 11)(c + 1). Which is bigger: u or 15/4? 15/4 Suppose 50j + 5h = 53j - 8, 4j - 4h - 8 = 0. Let s = 4 - 2. Let q be 17/8 - s1. Is j equal to q? False Let q(l) = 2l3 - l2 + 2l - 2. Let r be q(1). Let x = -31 + 16. Which is smaller: x or r? x Let j(q) = 1 + 2 - 2q - 1 - q. Let t = -18 + 26. Let z be j(t). Is -21 smaller than z? False Suppose 5o + 50 = -0o. Let d be (-4)/o - (-64868)/100. Let k = -649 + d. Are 1 and k non-equal? True Let w be 50/10 - -331. Let l be ((-4)/19)/(-2) - (-1250)/w. Which is bigger: 35 or l? 35 Let a = -6 - 2. Let t be (-15)/(-6) + (-3 - 20/a). Which is bigger: t or 7/9? t Suppose 2t - 37 = -4j - 15, 2t - 6 = 4j. Suppose ti - 2i - 44 = k, -3k = -2i + 28. Suppose 0q = -2q - i. Is -5 at most q? True Let d be (-3)/4 + 3/4. Let n = 386/3925 + -172857126/160925. Let m = n + 1074. Which is greater: d or m? d Suppose 49a = 52a - 15. Suppose ac - 12 = -52. Let l(g) = 11g3 + g2 - g - 1. Let w be l(-1). Which is smaller: w or c? w Suppose 5p = -37 + 422. Let y = -76 + p. Is -2/23 equal to y? False Let n be (-9996)/(-1649) - (-12)/(-2). Is n less than -1? False Let p be (-5)/1 - (-570)/6576. Which is smaller: p or 1? p Let c = -38.006 - -0.006. Let d = -31 - c. Is 0.5 smaller than d? True Let h be 0 + 1 + -3 + 13. Let a = 31 + -34. Let l = 9 - a. Is h greater than l? False Let y be ((-6)/9)/(8/444) - 5. Which is smaller: -286/7 or y? y Let i(u) = -7u - 186. Let y be i(-33). Are y and 47 non-equal? True Let z = 93 - 39. Let d = 53 - z. Is 7 equal to d? False Suppose -47 - 149 = 4y. Let a = y - -99. Suppose 20 - a = 5m. Which is smaller: -3 or m? m Suppose -122 = -h + 5g, 3h + 2g - 417 = -0g. Which is smaller: 139 or h? h Let k be -3 + ((-294)/(-35) - 2). Which is bigger: 3 or k? k Let u = 53/2 - 363/14. Is u at least 0? True Let z be (-10)/412/(-15). Suppose -zv + 0v = 0. Let f be (1 - 5) + 42/11. Which is smaller: f or v? f Let t = -8 + 22. Suppose 41 = 3c - u, 0c + c - 21 = 4u. Which is smaller: t or c? c Suppose 4u = 5u + 5. Let x(s) = 2s + 46. Let f be x(-25). Is f greater than u? True Let i = 569 - 857. Which is greater: 0.1 or i? 0.1 Let i = -1.7 - -29.7. Let g = i + -29. Is 8/5 at least as big as g? True Let v = 447/104 + -51/13. Suppose 0z - z + 1 = 0. Is v greater than z? False Suppose -92o + 503 = -89o - 5i, -3i = o - 149. Does 161 = o? True Let j(m) = -3m + 30. Let p be j(-10). Let h be p/70 + 2/7. Which is greater: h or 0.1? h Let h(s) = 3s*2 + 7s + 18. Let w be h(-2). Is 19 > w? True Let n = -0.11 - -0.22. Let c = 0.89 + n. Let a = 1.4 + -0.4. Is a greater than or equal to c? True Let l be 1/(-3) + (-316)/(-3). Let y = l + -1156/11. Is y equal to 0? False Let i(o) = 3o + 5. Let d be i(-5). Let y be -2 + 5 + -11 + 0/1. Is d less than y? True Let m be 2 - 103/(-12). Let f = 5 - m. Is f >= 3/5? False Let a = -1096/259 + -2/37. Which is greater: -4 or a? -4 Let d be (-611)/(-306) - (1 - 2). Let a be (-7)/(-35) + 801/(-255) + 0. Let i = a + d. Do i and 2/7 have the same value? False Let j = 958 - 538. Let g be j/(-9)(-84)/10. Let o = 7450/19 - g. Which is smaller: o or -1? -1 Suppose -3a + 10 = -8. Suppose -5q = au - u - 15, -5 = -q. Which is bigger: u or 2? 2 Let i = -95/814 + 6/37. Which is smaller: -2/7 or i? -2/7 Let b = 31 + -29. Which is smaller: 34/33 or b? 34/33 Let l(z) = -4z - 34. Let q be l(-5). Suppose -n - 4m = n + 8, -3m + 71 = -4n. Is q at most as big as n? True Let r(u) = -3u2 - 8u - 1. Let f be r(-3). Which is greater: 1.7 or f? 1.7 Suppose 2p - 5c = -2p + 131, c = -p + 26. Suppose -3i - p = 31. Which is greater: -21 or i? i Suppose -6w + 3w = -27. Let m be (-90)/(-5)12/w. Let x be 2(51/m - 2). Which is smaller: x or 0? 0 Let w = 391 + -395. Which is bigger: w or 6? 6 Suppose 3z = -4d - 76, -3z + 9 = -2d - 11. Let a be (25/(-5) - -4)d. Is a < 16? False Suppose -6k = 3k - 1170. Is 131 bigger than k? True Let v = -1 - 3. Let l = -0.67 + 0.07. Let h = -0.7 - l. Which is smaller: v or h? v Let t be 8(255/(-35) + 7). Which is greater: t or -3? t Let g(n) = 3n3 + 2. Let v be g(2). Let l = v - 24. Is 13/5 != l? True Let q(z) = z2 - 17z + 6. Let c be q(17). Let a be ((-2)/c)/((-12)/(-18)). Is 2 greater than or equal to a? True Suppose -18 = -k + 3d, -d + 44 = 4k + d. Let x = k - 9. Let i = -111 + 118. Which is greater: i or x? i Suppose 2j + 120 = 2x - 20, -207 = -3x + 4j. Is x bigger than 71? True Let l = -81/20 - -19/5. Let y = -89/1345 + -36/269. Which is smaller: l or y? l Let v be (98/(-4))/((-5)/(-5)). Let w = v + 24. Suppose 36k + 5k = -82. Which is smaller: k or w? k Suppose -2y + 74 = 14. Do 49 and y have different values? True Suppose 7o - 3o - 2o = 0. Suppose n - 5r - 37 = -on, -2n + r = -65. Which is bigger: 31 or n? n Let g(w) = -5. Let v(t) = t2 - 4. Let i(p) = 3g(p) - 4v(p). Suppose -3l = -5h - 14, -5h + 2l - 11 = -0h. Let c be i(h). Is -3 at most as big as c? True Let j be (-16)/(-40) + (-562)/5. Let u be ((-6)/2)/((-663)/111 - -6). Which is bigger: j or u? u Let s be 1/(-2) - (11 + 1095/(-60)). Suppose -3j - 5o = -8, j = 3o + 10 + 2. Is j at most as big as s? True Let t = 23 + -49/2. Let q(l) be the third derivative of -l4/8 - 13l*3/6 + 4l*2 + 5. Let r be q(-4). Which is bigger: r or t? r Let g = 23 - 25. Let b be (-2)/g - 10/(-20). Are b and 2 equal? False Let x = -669 - -657. Which is smaller: x or -0.06? x Let q = 945 + -1470. Is q less than 2? True Let x be 1 + -3 + 1/(-1). Let k = -95/2 + 46. Which is smaller: x or k? x Let d(h) = 4h*2 - h. Let w be d(1). Let n = w - 2. Let j be (-2)/8(-1 - n). Which is bigger: 1 or j? 1 Suppose 4a + 13 + 11 = 0. Let w = -1 + a. Suppose 0 = 3m + 2m + 25. Is m <= w? False Let m = -1.24 + 0.24. Let i = 17.24 + -17. Is m < i? True Suppose 4j - 21j - 17 = 0. Is 5/227 at least as big as j? True Let z = 0.41 + -0.28. Let b = z + 0.07. Let p be 15/(-21) + 12/(-42). Which is bigger: p or b? b Let z(s) = -s2 - 38s - 22. Let l be z(-36). Is 51 > l?	{ "pile_set_name": "DM Mathematics" }
ur letters picked without replacement from {z: 2, y: 4, j: 1, w: 1}? 1/210 Calculate prob of sequence bf when two letters picked without replacement from {j: 1, d: 2, f: 2, a: 1, b: 2}. 1/14 Two letters picked without replacement from {x: 17, r: 3}. Give prob of sequence xr. 51/380 What is prob of sequence xa when two letters picked without replacement from aaallllmxam? 2/55 Calculate prob of sequence yv when two letters picked without replacement from {y: 5, x: 1, g: 3, s: 1, v: 6, p: 1}. 15/136 What is prob of sequence jpjj when four letters picked without replacement from {t: 4, p: 2, j: 5, i: 4}? 1/273 Three letters picked without replacement from qkdqdk. Give prob of sequence dqq. 1/30 What is prob of sequence hhhr when four letters picked without replacement from hhrh? 1/4 What is prob of sequence co when two letters picked without replacement from {c: 1, r: 5, f: 2, n: 6, l: 1, o: 1}? 1/240 Three letters picked without replacement from edddeeqjdjojjjdod. Give prob of sequence dqo. 1/340 Calculate prob of sequence gj when two letters picked without replacement from jbg. 1/6 Three letters picked without replacement from qlqnl. What is prob of sequence qlq? 1/15 What is prob of sequence yj when two letters picked without replacement from {g: 2, y: 1, e: 1, d: 4, j: 1}? 1/72 Two letters picked without replacement from {s: 1, l: 1, y: 1, v: 1, f: 3}. What is prob of sequence fv? 1/14 Four letters picked without replacement from wlnwpnvwwvne. Give prob of sequence vlwn. 1/495 Three letters picked without replacement from hsaazhafaaahhfzh. Give prob of sequence zaf. 1/140 Two letters picked without replacement from vvsvvssivvsssisvisvi. Give prob of sequence ii. 3/95 Three letters picked without replacement from botottmt. What is prob of sequence oob? 1/168 Calculate prob of sequence xng when three letters picked without replacement from {x: 3, n: 2, m: 2, g: 1, h: 4, l: 6}. 1/816 Four letters picked without replacement from ixiiiiiixxxxxxiixiix. Give prob of sequence ixxx. 77/1615 What is prob of sequence hhll when four letters picked without replacement from lhhhlh? 1/15 What is prob of sequence zh when two letters picked without replacement from {z: 3, w: 5, h: 1, e: 1, j: 3}? 1/52 What is prob of sequence cqcq when four letters picked without replacement from ggqqnggqcngnc? 1/1430 Calculate prob of sequence xgg when three letters picked without replacement from {m: 5, g: 7, d: 3, x: 1, z: 2}. 7/816 What is prob of sequence ddpl when four letters picked without replacement from {l: 2, p: 3, s: 9, d: 3}? 3/4760 Two letters picked without replacement from sslr. Give prob of sequence ls. 1/6 Four letters picked without replacement from {x: 1, y: 4, q: 1, g: 1, s: 9, m: 1}. What is prob of sequence gxsy? 3/4760 Two letters picked without replacement from {u: 2, e: 1}. Give prob of sequence ue. 1/3 Two letters picked without replacement from {n: 1, b: 1, v: 1, o: 10, m: 7}. Give prob of sequence bn. 1/380 Four letters picked without replacement from {l: 8, t: 3, f: 5, o: 1, b: 3}. Give prob of sequence tllo. 7/4845 What is prob of sequence twd when three letters picked without replacement from oowotddbovtdoodwvv? 1/306 Calculate prob of sequence rc when two letters picked without replacement from {w: 4, j: 3, c: 1, r: 2}. 1/45 Calculate prob of sequence lpex when four letters picked without replacement from {p: 5, d: 3, l: 3, e: 1, x: 1, s: 1}. 5/8008 Four letters picked without replacement from {r: 13, u: 2, h: 5}. What is prob of sequence hrhh? 13/1938 Two letters picked without replacement from {c: 5, q: 4, b: 1, o: 1, a: 3, j: 3}. Give prob of sequence jc. 15/272 What is prob of sequence ly when two letters picked without replacement from flrrrykyllbr? 1/22 Calculate prob of sequence pii when three letters picked without replacement from ppoii. 1/15 Two letters picked without replacement from ejje. Give prob of sequence ej. 1/3 Two letters picked without replacement from {a: 5, e: 6, d: 4}. Give prob of sequence aa. 2/21 What is prob of sequence lv when two letters picked without replacement from vvlvvloov? 5/36 Calculate prob of sequence wwww when four letters picked without replacement from {w: 11, v: 2}. 6/13 Two letters picked without replacement from {a: 3, z: 1, v: 1, w: 2}. Give prob of sequence va. 1/14 Calculate prob of sequence nuu when three letters picked without replacement from nuunun. 3/20 Four letters picked without replacement from oxoxxxxoxxxxxo. Give prob of sequence oxxx. 120/1001 Three letters picked without replacement from osssyyy. Give prob of sequence sss. 1/35 Three letters picked without replacement from kkkaaakk. What is prob of sequence kak? 5/28 Four letters picked without replacement from qgtqgbuptqtggqqpqp. What is prob of sequence qbup? 1/4080 What is prob of sequence bppb when four letters picked without replacement from {b: 8, p: 5, w: 3}? 1/39 Three letters picked without replacement from {p: 5, k: 2}. What is prob of sequence kpp? 4/21 Three letters picked without replacement from tettbbbtttbtttbttttt. Give prob of sequence tbe. 7/684 Calculate prob of sequence vovo when four letters picked without replacement from vvooiooviiio. 1/99 Calculate prob of sequence pppp when four letters picked without replacement from ppppppp. 1 What is prob of sequence fmvi when four letters picked without replacement from fmmxvimxmfmf? 1/792 Three letters picked without replacement from yrooyrmm. Give prob of sequence roo. 1/84 Two letters picked without replacement from feffefff. What is prob of sequence ee? 1/28 Two letters picked without replacement from pknnnntttjjy. Give prob of sequence kj. 1/66 What is prob of sequence ee when two letters picked without replacement from eemmem? 1/5 What is prob of sequence nn when two letters picked without replacement from sssssnssssssnsnsnss? 2/57 Three letters picked without replacement from byppgvdy. What is prob of sequence gpv? 1/168 Calculate prob of sequence nn when two letters picked without replacement from {w: 3, n: 7}. 7/15 Three letters picked without replacement from fdfdfddfddfdf. What is prob of sequence fdd? 21/143 What is prob of sequence dly when three letters picked without replacement from ypyyyydqyyyqqlylq? 3/680 Two letters picked without replacement from qlqzqzzqzlqsiszslq. What is prob of sequence zi? 5/306 Two letters picked without replacement from {i: 6, n: 12}. Give prob of sequence nn. 22/51 Four letters picked without replacement from mlmmlllmmumulml. What is prob of sequence luml? 1/78 Calculate prob of sequence rq when two letters picked without replacement from qkkqcqr. 1/14 What is prob of sequence yax when three letters picked without replacement from {c: 4, a: 1, l: 7, y: 2, x: 5, b: 1}? 1/684 What is prob of sequence dz when two letters picked without replacement from {k: 2, z: 2, o: 2, d: 3}? 1/12 Four letters picked without replacement from {c: 4, o: 2, x: 1, h: 3}. Give prob of sequence ohhh. 1/420 Two letters picked without replacement from {h: 1, a: 1, f: 1, v: 1, e: 1}. Give prob of sequence av. 1/20 Two letters picked without replacement from qjubh. What is prob of sequence jq? 1/20 What is prob of sequence hh when two letters picked without replacement from hhhyhhyhyhhyhy? 36/91 Calculate prob of sequence pp when two letters picked without replacement from {g: 1, b: 1, a: 1, p: 3, u: 1}. 1/7 Four letters picked without replacement from mmmmmmmmmm. What is prob of sequence mmmm? 1 Calculate prob of sequence gqbq when four letters picked without replacement from {g: 1, r: 4, q: 4, b: 1, z: 6}. 1/3640 Two letters picked without replacement from vhnavnvaunuuwau. Give prob of sequence un. 2/35 Calculate prob of sequence ky when two letters picked without replacement from eiyokko. 1/21 Three letters picked without replacement from {v: 4, z: 2}. Give prob of sequence vvv. 1/5 Three letters picked without replacement from {a: 1, b: 13, h: 1}. What is prob of sequence bhb? 2/35 Three letters picked without replacement from yyyyjyyyykkyyyyk. What is prob of sequence jyy? 11/280 Three letters picked without replacement from {q: 2, y: 1, o: 4}. What is prob of sequence qyq? 1/105 Three letters picked without replacement from {h: 13, s: 5}. What	{ "pile_set_name": "DM Mathematics" }
33.648? 784633.508 Add -0.4 and -15152157. -15152157.4 Calculate 3 + 5531936. 5531939 What is -42318077 - 0.2404? -42318077.2404 Put together -241 and 1456367. 1456126 Total of 0.37 and 0.0249586. 0.3949586 1396.28212 - -0.6 1396.88212 What is 50983.8 minus -0.246? 50984.046 What is -110817.63 less than 0.2? 110817.83 What is 1.3 take away 21555.7054? -21554.4054 Work out 317 - 278472. -278155 What is -9136502.3 - 0.148? -9136502.448 Work out -31 + -16955118. -16955149 Calculate -1168.8 - -1006. -162.8 Put together 6963 and -0.23624. 6962.76376 What is -275 - 5607464? -5607739 Subtract 365504 from -108. -365612 What is -1348090 plus 0.08? -1348089.92 What is 14266 take away -24165.4? 38431.4 What is 91715 less than -1? -91716 Work out -9298836047 + 0.07. -9298836046.93 What is -0.03062 less than -66.25? -66.21938 Total of 0.1 and 10.893795. 10.993795 Sum -31976 and -8060. -40036 1784.888811+5 1789.888811 What is -591 take away 8165189? -8165780 Put together -7664054 and 0.6789. -7664053.3211 Add together -18806919 and -1. -18806920 3209201 + 84.1 3209285.1 -1646960 - 14442 -1661402 -230.9677 - -175 -55.9677 275+-3191959 -3191684 Sum 169.07 and 609. 778.07 What is 116562 less than 3706? -112856 Calculate 4430 + -1138. 3292 Add together -4 and -59819.413. -59823.413 What is 0.9808 less than -138671? -138671.9808 What is -259030739 plus 0.34? -259030738.66 Put together -2.4 and 1378.6036. 1376.2036 What is -2 + -79.19104? -81.19104 2093+30364 32457 Add together 0.2 and 270.386. 270.586 Work out 16 + -4153902296. -4153902280 0.4 - 30.98316 -30.58316 What is -65.18211 minus -3? -62.18211 Subtract -89 from -3452666. -3452577 Put together -0.077606309 and -352. -352.077606309 Total of 1652.51 and -0.0925. 1652.4175 Work out 243219 + 1243. 244462 Work out -26.41 + 132289. 132262.59 Work out -6828052 + 1.507. -6828050.493 Add -378 and -78986. -79364 5 - 948.5486 -943.5486 Put together 462 and -0.250229. 461.749771 Calculate 0.2 - 37863.729. -37863.529 What is 140 - -622626865? 622627005 What is -6712 minus 3405.78? -10117.78 Work out -4838389 + 3. -4838386 What is -351.5 less than 1853? 2204.5 What is 0.0347685 + -3687? -3686.9652315 -0.29 + -487717 -487717.29 What is the distance between -1.7 and -453441? 453439.3 What is the distance between -0.329821 and 5237? 5237.329821 What is 4288 plus 0.11418? 4288.11418 What is 46 - 109884? -109838 Work out -494217231 + 0.4. -494217230.6 Calculate -12.3177821 - 2. -14.3177821 Calculate 0.005 + -7776830. -7776829.995 Put together 5 and -4868738. -4868733 Add together -31.061 and -271.67. -302.731 Add -84.8814 and 3.4718. -81.4096 6824+0.568 6824.568 What is the difference between 3272.5 and -8207? 11479.5 82269746 + 3.62 82269749.62 What is -9 less than 0.5317888? 9.5317888 Calculate -0.3677095254 + 4. 3.6322904746 Calculate 4409 - 3047212. -3042803 What is 183191 - 3578.4? 179612.6 -1140 - 12676 -13816 What is -96 - 0.313241? -96.313241 -17.058 + -138 -155.058 Put together -21 and -7818261. -7818282 What is -939 plus -33667.946? -34606.946 What is -11666678 minus -0.182? -11666677.818 What is -11 take away -34777.1? 34766.1 Total of -0.5 and -192281920. -192281920.5 What is -1.507 less than 40456634? 40456635.507 What is -13.7 + 158.236? 144.536 Put together 1792562 and -0.033. 1792561.967 Work out 0.397 + -0.04666964. 0.35033036 What is the distance between -101.4 and -0.09898? 101.30102 Calculate -0.1526 - 3604.3. -3604.4526 What is the distance between 76 and -156201973? 156202049 Sum 0.6 and 854.0036. 854.6036 Add together -3511 and 8266. 4755 Total of 128413 and -111. 128302 Work out -0.112099 - 0.978. -1.090099 Subtract -0.2 from -0.2261356386. -0.0261356386 What is 6803942 + 0.24? 6803942.24 -0.66941+-0.02383 -0.69324 Add 0.4 and -539161794. -539161793.6 What is 578 plus -0.4768209? 577.5231791 What is the difference between -235.607 and 0? 235.607 What is the difference between -2.883446 and -465? 462.116554 35.8 + -3975 -3939.2 Subtract 1.49 from 6014.5377. 6013.0477 Work out 0.4 + 0.360702362. 0.760702362 Work out 0.11645 - 0.06773. 0.04872 What is 3863 less than -3215.661? -7078.661 3061 + 566793 569854 Calculate -277 - -164476. 164199 What is 111648195 plus 0.06? 111648195.06 Subtract -4332628401 from -0.14. 4332628400.86 What is 98 take away 457923? -457825 Subtract -0.12 from -53915337. -53915336.88 Calculate 0.02 - 3709.409. -3709.389 What is 20431 take away -50.27? 20481.27 Subtract -12505065 from -5. 12505060 What is 2563.0938 less than -1.3? -2564.3938 Work out -0.295 - -0.5277541. 0.2327541 Subtract -6.2577 from -0.025. 6.2327 Calculate 0.2 + 1035297. 1035297.2 Work out 18292 - -2538860. 2557152 Add -238937 and 121. -238816 What is -3.138 - -63.0322? 59.8942 Subtract 185 from -47830390. -47830575 What is the distance between 715492.5 and 5? 715487.5 Calculate -49.03 - 1511.449. -1560.479 Subtract -20544273586 from -0.4. 20544273585.6 What is 121381675.9 less than 3? -121381672.9 -486.9441 - -308 -178.9441 What is 1461 minus 834.634? 626.366 Calculate 0.32 + 47139. 47139.32 What is -124 minus -3886.7? 3762.7 Add together -0.7 and 14.114827. 13.414827 Subtract -0.6 from 55008708.8. 55008709.4 What is 1170.94 plus 382.4? 1553.34 What is the difference between 0.573 and 2608672? 2608671.427 What is -11111435 - 1.2? -11111436.2 What is 101477.5 less than 0.1057? -101477.3943 What is -0.17 take away -14.211884? 14.041884 Work out -347 + 183.966. -163.034 Subtract 10 from 9.95123. -0.04877 Sum -0.1 and -11.57816. -11.67816 What is the difference between -7459545346 and 5? 7459545351 What is -1020567 - 367? -1020934 Work out 418146775 - -2. 418146777 Subtract 0.2 from -12460401. -12460401.2 Work out -23935203 + 118. -23935085 22+37783 37805 Add 0.01 and -676074704. -676074703.99 What is -86 take away -220.3645? 134.3645 -335 - 19.98108 -354.98108 Sum -47413981 and 23.7. -47413957.3 Add 0.2 and -424051448. -424051447.8 Sum 4000 and -5174. -1174 What is -13 - 1013252? -1013265 What is the distance between -9188695 and 0.11? 9188695.11 Subtract -0.06 from -397203572. -397203571.94 What is 2586.25 minus 7769? -5182.75 Work out -3 + 0.04366122. -2.95633878 What is -0.1227748 plus -0.1? -0.2227748 What is -0.071 plus 11580640? 11580639.929 What is 13 - -264639599? 264639612 What is the distance between -16.7935 and 86175? 86191.7935 What is 0.0802828 + -41806? -41805.9197172 Total of -3072016 and -24. -3072040 Calculate 0.3 + -10566407. -10566406.7 Calculate -65 + -472195. -472260 What is 181.85 - -0.4262? 182.2762 Subtract -7 from 8733.8. 8740.8 Subtract 7724.8 from 5.16. -7719.64 Calculate 2 + -6.62179. -4.62179 What is -27717 take away 7.58? -27724.58 What is 68041942 take away 0.27? 68041941.73 -17335.638 - -15 -17320.638 Work out -0.040909277 - 0.06. -0.100909277 Work out -66226 - -85. -66141 Put together -6094 and -6.478. -6100.478 What is the distance between -12039 and 10109058? 10121097 Subtract 4298 from -26372.48. -30670.48 Calculate -139 - 6310.8. -6449.8 What is 6 less than 10496039? 10496033 Add 3.8725 and -1175. -1171.1275 What is 16.3 minus -4.56381? 20.86381 Calculate 6403.03 - -45. 6448.03 What is 0.19 take away 3052634972? -3052634971.81 What is -18053041902 take away 5? -18053041907 -523332572+-0.1 -523332572.1 Calculate 934925.43 + -4. 934921.43 Put together -4 and -768899706. -768899710 What is 0.1 take away 27.38742997? -27.28742997 What is -204 take away 724740? -724944 -1.1+156416476 156416474.9 Add 0.176768308 and -0.01. 0.166768308 Put together 1209.56 and 34103.3. 35312.86 Add together -487111.89 and 0. -487111.89 16+-559079 -559063 Calculate 0.45 - -2090.6. 2091.05 Work out -0.36 + -55771. -55771.36 What is the difference between -1626 and 0.05361624? 1626.05361624 What is -698.37 plus 0.293? -698.077 Sum -5 and 284875096.69. 284875091.69 What is 0 plus -62599888? -62599888 Put together -912.9 and -0.00325783. -912.90325783 Subtract 22479.534 from -0.4. -22479.934 Subtract 4351389 from -0.281. -4351389.281 What is -523982 + 2146? -521836 0.1 - 3.948456 -3.848456 What is the distance between -2716164643 and 0.2? 2716164643.2 Add together -4 and 11031560. 11031556 Work out 287 - -58255964. 58256251 Put together -0.4 and -955.5279. -955.9279 Put together 0.4267743 and 13213.	{ "pile_set_name": "DM Mathematics" }
-0.3, -1/2, 1/8? 0.04 Which is the nearest to 0.4? (a) 74 (b) 2/9 (c) -0.8 b What is the closest to -1.6 in -1/9, -5, 4? -1/9 Which is the nearest to -3? (a) -0.1 (b) 1393 (c) -2/13 (d) 2/5 c What is the closest to 2 in 4, 0.4, 1, 6? 1 What is the nearest to -0.1 in 4, -65, -23? 4 Which is the closest to -6? (a) -1/3 (b) 0.5 (c) -3 c Which is the nearest to 13? (a) -0.5 (b) -17 (c) -0.3 (d) 3 d What is the closest to 1 in 1, 1/55, -1/5? 1 Which is the closest to 1? (a) 0 (b) -19 (c) -2 (d) -4 a What is the nearest to 0.6 in -4, 8, -5, -1/5? -1/5 What is the nearest to -2/7 in -2, -2/3, -39, 4? -2/3 What is the closest to 0.1 in 5, 2, -0.2, 4? -0.2 Which is the nearest to 1? (a) -123 (b) 2/5 (c) 1/9 b What is the nearest to 1/4 in -0.2, 0.2, 1.35? 0.2 What is the nearest to -11 in -0.1, -0.4, 5, -1? -1 Which is the closest to -0.2? (a) -6 (b) -2/3 (c) 1 (d) 4 b What is the closest to 0.2 in 2, -13, 2/5, -0.1? 2/5 Which is the closest to -1? (a) -40 (b) 3 (c) -4 (d) 0.5 d Which is the nearest to -2? (a) -1/6 (b) -3 (c) 3 (d) 0.4 b Which is the closest to 11/5? (a) -0.1 (b) 0.4 (c) 0.09 b Which is the closest to 1/8? (a) -2/7 (b) 0.2 (c) -2 b Which is the nearest to 0.2? (a) 1/6 (b) 1 (c) 0.054 (d) 2 a What is the closest to -1/2 in 4.1, 2/9, 0.4? 2/9 What is the nearest to 0 in -0.3, 0.31, 1/5, 3/8? 1/5 What is the closest to 3/2 in 1/11, -2, 0, 1? 1 What is the nearest to 2 in -2/13, 0.09, -0.4? 0.09 Which is the closest to -0.1? (a) 0 (b) -3/22 (c) -2/9 (d) -3 b Which is the closest to 0.9? (a) 1 (b) -4/3 (c) 18 (d) 4 a Which is the nearest to -1/5? (a) 4 (b) -1 (c) 2/3 (d) 0 d Which is the nearest to 2? (a) 2 (b) 2/17 (c) -114 a What is the closest to 1/2 in 0.09, 0, 1/2, 0.06? 1/2 Which is the nearest to -2? (a) 1 (b) 13/4 (c) 0 c Which is the nearest to -1/5? (a) -2/3 (b) 1 (c) 10 (d) 20 a Which is the closest to -2/35? (a) -1 (b) 19 (c) -5 (d) 3 a Which is the nearest to -61/2? (a) -0.38 (b) -2 (c) 0 b Which is the nearest to -2? (a) 1/4 (b) -3 (c) -11 (d) -3.9 b Which is the closest to -1/3? (a) -6 (b) 3/2 (c) 42 b What is the closest to -0.1 in -5, 0.19, -3, 1/4? 0.19 What is the nearest to -1 in 0, 1, 4, -0.05? -0.05 What is the closest to 1 in -0.4, 5, -0.2, 0.12? 0.12 What is the closest to -2/5 in 0.05, 4, 145/4, 2/7? 0.05 Which is the closest to -0.6? (a) 2/165 (b) -6 (c) 5 a What is the nearest to 79 in -2/5, 1/5, 4? 4 What is the closest to -1/6 in -4, 0.5, 178, -0.5? -0.5 Which is the nearest to 0.2? (a) -68 (b) 1 (c) -0.5 c Which is the closest to -2? (a) -5 (b) -1/7 (c) 0 (d) -1 d What is the closest to -1 in 0, -2/5, 0.09, 0.4? -2/5 What is the closest to 7 in 4/7, 6, 0.2, 1? 6 What is the closest to 2 in 2/9, -3, 1? 1 Which is the nearest to 0? (a) 0.5 (b) 2/5 (c) -115 b What is the closest to -12 in 1, -4, 83? -4 What is the nearest to -0.21 in -29, 0.3, 0, 0.2? 0 Which is the nearest to 1? (a) 17 (b) 0.9 (c) -0.2 b Which is the closest to 4/3? (a) -11 (b) -1 (c) -1/4 c What is the closest to 0.1 in -0.014, -2/3, 3? -0.014 Which is the closest to -1/2? (a) 2/7 (b) 3/5 (c) 2 (d) 1 a What is the closest to 1 in -0.5, 12, -2/17? -2/17 What is the nearest to -0.3 in -2, 0.5, -8? 0.5 What is the closest to 2/7 in -2/15, -1, 2/7, 2/13? 2/7 What is the nearest to 2/7 in -2, 4, -0.1, 0.5? 0.5 Which is the closest to -1/4? (a) 0.1 (b) -2/15 (c) 1 (d) -5 b Which is the closest to 863? (a) 4 (b) 2 (c) 0 a Which is the closest to 1/3? (a) 5 (b) 4 (c) -0.1 c What is the closest to -15 in 1.4, 2, -0.3? -0.3 Which is the nearest to -2? (a) -11/2 (b) -4 (c) -73 (d) 3 b Which is the closest to 1? (a) -0.05 (b) 1/6 (c) 4 (d) 1/4 d Which is the closest to 26? (a) 5/4 (b) 2/7 (c) -3/4 a Which is the nearest to -0.2? (a) -1/3 (b) 0.06 (c) 0.4 (d) -5 a What is the nearest to 2/7 in 0.1, 14, -0.4? 0.1 Which is the nearest to -1? (a) 0.05 (b) -12/17 (c) -0.3 (d) 1/4 b What is the nearest to 0.1 in 2/63, -2, 0, -8? 2/63 What is the closest to 0.5 in 1, 1/2, 5, -2? 1/2 What is the nearest to -1/3 in 0, -11, -18? 0 What is the nearest to -1 in 191/4, 0, 4? 0 Which is the nearest to -353? (a) -1/2 (b) 0 (c) -0.4 a What is the closest to -0.13 in -0.5, 1, 2, -3/8? -3/8 What is the closest to -0.9 in 3/7, 0.2, 0.8, 14? 0.2 Which is the closest to 0.5? (a) 2 (b) -5 (c) 0.02 c What is the closest to -0.2 in 2, -9, 0? 0 Which is the nearest to 0.1? (a) -12 (b) -1 (c) -2 (d) -4 b What is the nearest to 0 in -1/10, -0.2, -14/9, 0.3? -1/10 What is the nearest to 0 in -0.03, -0.1, 3? -0.03 What is the closest to -2/3 in -5, -26, 1/3, -0.1? -0.1 What is the closest to 3/4 in -0.09, 0.2, 8, -4? 0.2 What is the closest to 3 in -0.4, -0.5, 36, 0.2? 0.2 Which is the nearest to 5/8? (a) -1/4 (b) -1 (c) 1/2 c Which is the closest to -1? (a) 1/2 (b) -2/9 (c) 1/5 (d) -19 b Which is the closest to -1? (a) -2 (b) 1151 (c) 0.4 a Which is the nearest to -1? (a) -0.175 (b) -0.4 (c) -0.1 (d) 2/21 b Which is the closest to 1? (a) -5 (b) -0.12 (c) 3 b What is the closest to 3 in 0.1, 5.92, 0.5? 0.5 Which is the nearest to -3? (a) -3 (b) -1 (c) 94 a What is the nearest to 1 in -1/3, 24, 1/3, 14? 1/3 Which is the closest to 0.1? (a) -93 (b) -3 (c) -0.1 (d) 2/19 d What is the nearest to -9 in -340, -2/13, -0.2, 5? -0.2 What is the closest to -3/2 in -3, 3, -5, 0.2? -3 Which is the nearest to -0.1? (a) 0.3 (b) -4.8 (c) -2 (d) 0 d Which is the nearest to 0.1? (a) 1/5 (b) 2/5 (c) 177 a Which is the nearest to 1/3? (a) 1 (b) -3/161 (c) 3 (d) -5 b Which is the nearest to 1/2? (a) 199/7 (b) 0.2 (c) -0.1 (d) 0.4 d What is the nearest to 0.2 in 1/7, 2, -0.01, -3? 1/7 What is the nearest to -1 in 15, -3, -1.5? -1.5 Which is the nearest to -0.1? (a) 4/7 (b) 0.2 (c) 1.4 b Which is the nearest to -0.1? (a) 0 (b) -1/3 (c) 1 (d) -0.3 a Which is the nearest to -12? (a) 0.4 (b) 0.5 (c) -7 (d) -0.4 c What is the nearest to -0.1 in -3, -4, -1008? -3 Which is the nearest to -13? (a) -2/3 (b) 5 (c) -22 c What is the closest to 2 in 4, -2/45, -3, 0.5? 0.5 Which is the closest to 0? (a) -11 (b) -1/10 (c) 5 (d) 0 d What is the nearest to 3/7 in 1/2, -1/15, 0.1? 1/2 What is the closest to -1 in 15, 4/9, -4? 4/9 What is the closest to 0 in -3, -9/5, 0.02, -2/19? 0.02 Which is the nearest to -1? (a) 5 (b) 2/29 (c) -3 (d) 15 b What is the nearest to -70.02 in -1, 5, 1? -1 What is the nearest to -2/19 in -4, -12, -5? -4 Which is the closest to -0.04? (a) 56 (b) -3 (c) 0 (d) 0.4 c What is the closest to -9 in 0.3, -5, 4.1? -5 What is the nearest to 1/3 in -2/25, 0.1, -3/8, -0.01? 0.1 What is the closest to -0.1 in -12, -2/31, -0.03? -2/31 What is the closest to 0 in -26, -5, -6, 0.4? 0.4 What is the closest to 1/4 in 0.1, 1, -4.6? 0.1 Which is the nearest to -2/5? (a) 0.3 (b) -2 (c) -16.9 a What is the nearest to -0.8 in -1/3, 3/7, 2/3? -1/3 Which is the closest to -14? (a) -0.13 (b) -1 (c) -3 c What is the closest to -10/3 in -4, -0.3, -11? -4 Which is the closest to 2? (a) -129 (b) 1 (c) 2 (d) 2/9 c Which is the nearest to 0.01? (a) 3 (b) 0.1 (c) -7 (d) 2/5 b Which is the closest to 0.1? (a) 0.3 (b) 20 (c) -2/7 a What is the nearest to 0 in 1, 2/11, -1353? 2/11 What is the nearest to 0.2 in 201, -3, -0.5, 4? -0.5 What is the closest to -0.09 in 1/11, -3, 0.3? 1/11 What is the closest to 2/5 in 0.5, -0.2, 1/7, 0.11? 0.5 What is the nearest to 0.1 in 3, -0.14, -0.1, 1/3? -0.1 What is the nearest to -1.6 in 1/3, -3, 0.2, -5? -3 What is the nearest to -5/23 in -4/5, 0.1, -0.1? -0.1 What is the nearest to -1 in -2/5, 0.1, -0.1? -2/5 What is the closest to 2/3 in 1/4, -0.11, -0.2, -5/3? 1/4 What is the closest to -1/2 in -1/4, 6.1, 2? -1/4 What is the closest to 1 in -13, -0.1, 12? -0.1 What is the closest to -1 in 1201, -0.5, 2, 3? -0.5 What is the closest to 11 in 2/5, 5, -1? 5 What is the nearest to 3/5 in 5, -8/7, -2/15? -2/15 What is the nearest to -1 in -0.3, 4/55, -0.5, -2? -0.5 Which is the closest to 1? (a) 2/7 (b) -4 (c) -68 a What is the nearest to 49 in -0.04, -0.3, 23? 23 Which is the closest to 0.0924? (a) -2/7 (b) 4 (c) 2 (d) -0.1 d What is the closest to -3/2 in 3, 5	{ "pile_set_name": "DM Mathematics" }
10 in -449, -425, -3/8? -3/8 What is the nearest to 0 in 15, 0.07, -0.0013, -0.4, 0.2? -0.0013 Which is the nearest to -0.078? (a) 1 (b) 70.1 (c) 1/8 c Which is the nearest to 2? (a) 1390 (b) 0.2 (c) -0.5 (d) -4 (e) 1 (f) 1/12 e What is the closest to 0 in -2.9, -8, 1, -4, 135, -12? 1 What is the closest to 4 in 3/20, 0.122, 0.3, 2/39, -1? 0.3 Which is the closest to 24785? (a) -20 (b) 4 (c) 7 c What is the nearest to 227 in 161, 1, -0.6, -3? 161 Which is the closest to 1/3? (a) 5318/7 (b) -535 (c) 8 c Which is the closest to -2? (a) -0.6 (b) -0.5 (c) -381 (d) 1 a What is the nearest to 0.1 in 1421, 8/19, 18? 8/19 Which is the closest to -306? (a) 1/8 (b) 7958 (c) -5 c What is the nearest to 0.2 in -5, 0.4399, -16/9? 0.4399 Which is the nearest to 1? (a) 7 (b) -53 (c) 3328 a What is the closest to -7 in -1/5, 0.064, 10, -0.37? -0.37 What is the closest to -0.13 in -31, -28488, 1/2? 1/2 Which is the nearest to 136? (a) 384 (b) 1 (c) -0.3 (d) 0.6 (e) 0.4 b Which is the closest to -1/3? (a) 1 (b) -5 (c) -4 (d) -1 (e) -1762 (f) 16 d What is the nearest to -118 in -1/6, -5/8, 1, -4/7, 45, 5? -5/8 Which is the closest to -30? (a) -2941 (b) -0.26 (c) 5 (d) -0.5 d Which is the nearest to 0? (a) 2/79 (b) -0.4 (c) 316/15 a What is the nearest to 3/2 in -196, 5/3, -3904, -0.2? 5/3 What is the closest to 1/23 in -3, -49, 193, 1, -5, 3? 1 What is the nearest to -0.2 in -218, 2, 24/17, 47? 24/17 What is the nearest to 3/6497 in -0.1, -3.2, -3/4? -0.1 What is the closest to -2 in -2120/3, 5.03, 0.1? 0.1 What is the nearest to 49715 in 16, 2/11, -4, -2/9, 4, 5? 16 What is the nearest to 0.1 in 396, -2, -2/117, -124? -2/117 Which is the closest to 0.4? (a) -0.3 (b) -1/294 (c) 23 (d) -2.7 (e) -0.5 b What is the closest to -7 in -2, 0.5, 1193, 13? -2 What is the closest to 2/7 in 5, 2/11, 859, 1132? 2/11 What is the nearest to 1 in -2/19, -1, -2/3, 745/313? -2/19 Which is the closest to -0.9? (a) -92252 (b) 2/7 (c) -5.5 b Which is the nearest to 10? (a) 44/5 (b) 0.3 (c) -1/4 (d) -234/5 a Which is the closest to -1/5? (a) -0.62 (b) 0.06 (c) -6561 (d) -5 b What is the closest to -7 in -1867, -2/15, 5, -5, 0.1? -5 Which is the nearest to 2? (a) -6521/2 (b) 0.4 (c) -4 (d) 2 d Which is the nearest to -4? (a) 6 (b) 18 (c) 2/863 c Which is the nearest to 2/5? (a) 0.7 (b) 233 (c) 16 (d) 1/28 (e) 5/2 (f) 0 a Which is the nearest to 1? (a) -938 (b) 731.3 (c) -3 c What is the closest to -2 in -5, 4/3, -2/9, -49.2, -110, 2/11? -2/9 What is the closest to 2/5 in -0.0047, 194, -1/6, -18? -0.0047 What is the closest to -1/3 in -4, -0.7, 1348, -2/13, -18, -3? -2/13 What is the nearest to -1 in 21099, 0.092, -0.4, 15? -0.4 What is the closest to -1.3 in 9, 5, -0.3, 11.38, -2/23? -0.3 What is the closest to 0.1 in 0.13, -1, 0.324, 326? 0.13 What is the nearest to -2 in 0.4, 2/17, -120, 0.3? 2/17 Which is the nearest to 1? (a) 3/5 (b) 2/19 (c) 7 (d) 0 (e) 54 a What is the nearest to -1/3 in -37, -2, -140.5, 3? -2 What is the nearest to 61 in 892, -0.7, -2/7? -2/7 Which is the nearest to -9044? (a) 4313 (b) -4/5 (c) 4 b Which is the nearest to -470? (a) 0.8 (b) 4/3 (c) 0.008 c Which is the nearest to -2/9? (a) -1.8 (b) 22 (c) 3/4 (d) 0.08 (e) -9 (f) 11 d Which is the closest to 2/9? (a) 607 (b) -7 (c) -10/29 (d) 3 (e) -1 c Which is the nearest to -30? (a) -0.4 (b) 2/3 (c) 6215 (d) -1 d What is the nearest to -2/1333 in 0.5, -1/18, -8/7, -2/9, 3/8, -5? -1/18 What is the closest to 0.3 in 2/5, 3, -2, 3185, 7/26? 7/26 Which is the nearest to -0.01? (a) 9 (b) 2 (c) 11 (d) -1.1 (e) -43 (f) 5 d Which is the nearest to 0? (a) -0.3 (b) -2/23 (c) -1 (d) -1/3 (e) 67907 b What is the nearest to -0.24 in 2, 15492, 4, -0.3? -0.3 Which is the nearest to -1? (a) 118664 (b) 3/2 (c) -0.0844 c What is the nearest to 2/831 in -1/11, -0.26, -10, 10/7? -1/11 Which is the closest to 0.1? (a) 1667 (b) -3/20 (c) 0 (d) -2/21 (e) -0.5 c Which is the closest to -0.1? (a) 1.1575 (b) 0.052 (c) 1 b Which is the closest to 0.3? (a) -18 (b) -2186/25 (c) 0.03 c Which is the closest to 1/3? (a) 1/12 (b) 8/7 (c) -2/5 (d) 3 (e) 49 a Which is the nearest to -0.01? (a) -612646 (b) -3 (c) -3/2 c Which is the nearest to -2? (a) -0.7 (b) 0.166 (c) 2/9 (d) -8/61 a Which is the closest to -2/5? (a) 21/92 (b) 1 (c) -2/7 c Which is the nearest to 1? (a) 252 (b) 249 (c) 15 (d) 2 d What is the closest to -3 in -58/5, 0.18, 0.3, 8, 1/3? 0.18 What is the closest to -2/2601 in 3038, 1, -3? 1 Which is the closest to 517? (a) 0 (b) 2/7 (c) 45/7 c Which is the closest to 19? (a) -0.3 (b) 0.4 (c) -679185 b What is the closest to -0.1 in -487, 2737, 2/7? 2/7 Which is the closest to 167? (a) 0 (b) 10 (c) 7 (d) -1.1 b Which is the nearest to 4/3? (a) 0 (b) -5 (c) -22175 (d) 0.3 (e) 2/13 d Which is the closest to 0.1? (a) 5 (b) -5156 (c) -2.6 c What is the nearest to 0.101 in 0.08, -3/4, -1.53, 0? 0.08 Which is the closest to 0.97? (a) -0.101 (b) -4 (c) -0.4 (d) 85 a What is the closest to 0.1 in -1.4, -9179/2, 2/15? 2/15 Which is the closest to 2936? (a) 4/9 (b) -5 (c) 3 (d) -35 (e) -13 c Which is the closest to -1? (a) 0.11 (b) -0.3 (c) -29.273 b Which is the closest to -1? (a) 0.6 (b) 10 (c) 0.2 (d) 1317 (e) 3 c Which is the closest to 0.1? (a) 27.374 (b) -0.2 (c) 2 b What is the closest to 1 in 1, -3, -1/29552, 0.04, 3? 1 What is the closest to 1/2 in 34, -15130, 5, -3, -0.4? -0.4 What is the closest to 1 in 1/2, -7, 1877115? 1/2 What is the nearest to -0.1 in 2, 19358, 0.01, -4, -2/3, 3/5? 0.01 Which is the nearest to 1? (a) 2/5 (b) -2873 (c) 10/17 (d) 2 (e) 5 c Which is the nearest to -18.1? (a) -0.2 (b) -3 (c) -100/227 b What is the nearest to 0 in 2.1, -1, 65/11, 0, 3, 1/6? 0 What is the nearest to 1 in 3068/5, -10, 0.06, -10/7, -0.2? 0.06 What is the nearest to 1/3 in 4/5, -1, -3/14, 88987? 4/5 What is the closest to -7/3 in 4, -75, 5, 34, 0.1? 0.1 Which is the closest to -1693? (a) -0.09 (b) -0.5 (c) 2 (d) 0.3 (e) 0.05 b Which is the closest to -1/2? (a) 2/5 (b) 4/13 (c) 30 (d) -2/1523 d What is the nearest to -1 in -26, -1433, -0.5, 2, 0, 2/19? -0.5 Which is the closest to 2? (a) -0.2535 (b) 0.2 (c) 2 (d) 4/3 (e) -0.2 (f) -42 c Which is the closest to -1/15? (a) -300126 (b) -1 (c) 0.1 c Which is the closest to -4/9? (a) 0.15 (b) -4 (c) -60 (d) -2 (e) -3/16 e What is the closest to 1.06 in 0.3, 0, 1/5, 1722? 0.3 Which is the closest to 14.3? (a) 996 (b) 1 (c) -3 (d) -0.1 (e) 0.5 b What is the nearest to -0.3 in 453, 5/3, 2/3, -1251.7, 4, 0.4? 0.4 What is the closest to 0.012 in -2, -3/7, -1/5, -25/7? -1/5 What is the closest to -0.1 in -0.06, -5, -4, 68, 3, -8/27? -0.06 Which is the closest to 378? (a) 5 (b) 33 (c) -1.3 b Which is the closest to 1? (a) 0.09 (b) -0.4 (c) 3 (d) -43 (e) 9 a What is the closest to 3 in 5083, -597, -1/4? -1/4 Which is the closest to 118? (a) 3/8 (b) -11 (c) 3 (d) 144 (e) -3 (f) 0.4 d What is the closest to 5 in 6701, -10, 1/8, -3, 0.01, 0.4? 0.4 Which is the closest to -0.3? (a) -1.2996 (b) -4.92 (c) -0.5 c What is the closest to -2 in 3, 1/6, 0.1, -0.2, 0.053? -0.2 What is the nearest to 3 in -28981/10, 1, -1, 1/8, -2? 1 What is the closest to -3 in 7, -0.17, -0.5, 404? -0.5 Which is the closest to -0.39? (a) -3 (b) 3/5 (c) 346/7 (d) -0.3 (e) -1/256 d Which is the closest to 2/27? (a) -797 (b) 53 (c) 16 c Which is the closest to 1? (a) 4 (b) 259 (c) 0.4 (d) -1415 c Which is the nearest to 7? (a) 0 (b) 0.5 (c) -0.4 (d) 40 (e) -9688 (f) -2 b What is the nearest to 3/5 in -5/3, 2, -311.2? 2 Which is the nearest to -1/72? (a) -29/3 (b) -42 (c) 32 (d) -4 d What is the nearest to 27/5 in -0.3, -12, -1/40? -1/40 Which is the nearest to -997? (a) 1 (b) -289 (c) -3/5 b What is the closest to 0.1 in -10, -2.64975, 1/2? 1/2 Which is the closest to -74.5? (a) -59/5 (b) -0.2 (c) -1/13 (d) 2/19 (e) -0.5 a What is the closest to -2/11 in 2/3, -0.3, -2/15, 359.88, 0? -2/15 Which is the nearest to 0? (a) 7 (b) 0.0141 (c) 1 (d) -2/3 b Which is the nearest to 0.1? (a) 16/7 (b) -2334 (c) 0 (d) 10 c What is the nearest to -1/4 in 79, -0.1, -0.3,	{ "pile_set_name": "DM Mathematics" }
k(t) = -t*2 + 9t - 5. Let l be k(7). Suppose -2z + l = -9. Solve 3u = -i + z for u. 2 Let x = 4 + 0. Suppose xk = k + 45. Let w = 17 - k. Solve wc = -c for c. 0 Let u = -56 - -61. Solve -un = -4n + 3 for n. -3 Let r be (-25)/(-7) - (-5)/(-35)-3. Solve 4i - 6i = r for i. -2 Suppose -39p - 38 = -38. Solve pr = r - 3r for r. 0 Suppose 4g = 3k + 14, g + 0g - 4 = k. Let z be (5 + 0 - g) + 0. Solve 1 = -4p + zp for p. -1 Let o(r) = -7r*3 + 3r*2 + r + 9. Let t(g) = 6g*3 - 3g*2 - 8. Let d(b) = -5o(b) - 6t(b). Let w be d(1). Solve wn = n + 4 for n. -4 Let k = 170 - 168. Solve -2n - kn = 0 for n. 0 Let o(b) = 6b2 + b + 1. Let d be o(-1). Let q = -5 - -3. Let w be (6 + -3)/(q/(-6)). Solve -5r + w = -d for r. 3 Let y(o) = o*3 + 9o*2 - 9o + 14. Let i = -23 - -13. Let b be y(i). Solve ba - 12 = a for a. 4 Let t(o) = -14o*2 + 7o + 7. Let r be t(-1). Suppose 3i = 2i - 9. Let k = i - r. Solve k + 0 = -5a for a. -1 Let t be 14/1 + 9/(-3). Suppose u - t = 5i, 3u - 2 = -u - i. Solve -5b - 11 = -u for b. -2 Suppose 2l = -2l. Let d = 10 + l. Let z = 14 - d. Solve -j = -zj + 3 for j. 1 Suppose -2 = 4i - 14. Suppose -2d + id = 2. Solve 0 = -dh - 4 - 0 for h. -2 Suppose j = -4w + 3, -9 = j - 2w - 12. Solve -17 = ji - 5 for i. -4 Let g(o) = -3o + 17. Let b be g(5). Suppose 2 = -c + bc. Solve 5 = cd + 3 for d. 1 Let x(n) = -n3 - 4n*2 - 3n - 9. Suppose -5g + 37 = -3m, -2m + 5 = 3g - 2. Let i be x(m). Solve -ib = 2 - 8 for b. 2 Let a(m) = 2m*2 - 2m - 16. Let t be a(5). Let g be 45/t + (-1)/(-8). Solve -g - 1 = -y for y. 3 Let r(l) = -l*3 - 7l*2 - 4l + 3. Let h be r(-6). Let q = 3 + h. Let u(g) = -g*3 - 6g*2 - g - 4. Let s be u(q). Solve 0 = a + s - 0 for a. -2 Suppose -180 = -h + 4h. Let v = -28 - h. Suppose -2d + 4d - v = 0. Solve k - 5k = d for k. -4 Let m = 115 - 98. Suppose 0 = mo - 5o - 36. Solve -o = -a + 2 for a. 5 Let f = -19 - -18. Let w be (1/(-4) + f)-12. Suppose -i + w = 3x + 2i, 3i - 15 = 4x. Solve -t + xt = 0 for t. 0 Let m be ((-15)/(-3) + 16)7/21. Solve 0 = -ml + l - 6 for l. -1 Let v be (6/(-10))/(5/25) - -9. Suppose -vt - 2i + 8 = -t, -5t - 4i + 16 = 0. Solve t = f + 2f for f. 0 Let a(v) = 5v2 - 2 + 2 + 1. Let w be a(1). Suppose 2i + w = 4i. Solve ir = 2r - 5 for r. -5 Let b(i) = -i - 11. Let r(d) = 3d + 33. Let m(g) = 8b(g) + 3r(g). Let h be m(-7). Solve -7c + 6 = -hc for c. 2 Let t(g) = -3g + 186. Let j be t(-7). Solve -3u + 198 - j = 0 for u. -3 Let h be (-2)/(-15) + (-26)/195. Solve 3q - 10 + 1 = h for q. 3 Suppose -s = -5s + 8. Let j be 0/(s + 0) - -2. Suppose -4x - 38 = -3z, -5z - 2x + 30 = 10. Solve jk = 2 - z for k. -2 Let q = -452 - -458. Solve v = -q + 1 for v. -5 Suppose -115w + 2363 = -972. Solve 13d + 23 = -w for d. -4 Let x = 434 + -431. Solve xq - 1 = -13 for q. -4 Suppose -3v + 8v - 15 = 0, -i = -4v + 9. Let j be (-5)/2(-12)/15. Solve -jg - ig = 10 for g. -2 Suppose 7t = 4t - 3. Suppose 0 = -2m + 3n + 3, 0n = 2m - 2n - 4. Let w be t/m - 154/(-21). Solve q - w = -2 for q. 5 Let f be (19/((-38)/(-12)) - 14)/(-1). Solve fv + 4v = 48 for v. 4 Suppose -4r + 3k - 24 = -38, r + 2k = 9. Solve rm - 10 = 10m for m. -2 Let r = -34 + 36. Let b be (0 - (1 + -7))/r. Solve u + bu = -8 for u. -2 Suppose 2z = -4i - 56, z - i + 33 = -4i. Suppose -y + 120 = 3y + 5m, -5y + 133 = 2m. Let r = y + z. Solve -r = -4q + 13 for q. 5 Suppose 0 = 237c - 233c - 16. Solve c + 8 = 3b for b. 4 Suppose -n - 2o + 4 = 0, 4o + 2 = 4n - 2. Suppose 4k + b - 12 = nk, -5b = -5k. Solve -c - k = -0 for c. -4 Let f be 6/(-27) - 119/(-9). Suppose 67 + f = 5r. Solve 4u = -0u + r for u. 4 Let z(y) = -5y + 7. Let d be z(1). Suppose k - 3k - 3i - 3 = 0, 2i = 3k - d. Solve -p - p = k for p. 0 Suppose 6q - 4 = 8. Let k be q/(-11) - 114/(-22). Let c(f) = 3f + 3. Let o be c(4). Solve -o = kb + 10 for b. -5 Let w be (135/12)/3 - (-2)/8. Suppose -4f = -2f + 2k - 16, 8 = -wf + 4k. Solve -u = -fu for u. 0 Suppose -11 = -h + 2c, 5h + 10 = -4c + 23. Let z = -2 + 2. Solve -ht + z = -20 for t. 4 Let y be (-2)/(-2) + -1 + 5. Suppose -143 = -44w - 11. Solve wb = yb for b. 0 Let l(g) = -2g - 2. Let d be ((-1)/3)/((-10)/(-60)). Let k be l(d). Solve 0 = -q + kq + 2 for q. -2 Suppose a + 8 - 2 = 0. Let t = a - -11. Suppose 71m = 76m - 20. Solve 6 = -tx - m for x. -2 Suppose 28g = 26g + 8. Suppose -8 = -8h + gh. Solve -6r = -4r - h for r. 1 Let p be ((-66)/(-5))/((-20)/(-50)). Suppose -24u + p = -21u. Solve -u - 9 = -5a for a. 4 Let u be 3 + -59/(-15) + -2. Solve ud - 29 = -21 for d. 2 Suppose 0d = d - 10. Let a be (-2)/d - 22/(-10). Solve n = an for n. 0 Let d be ((-2)/3)/(1 - 42/45). Let k be (d/15)/((-4)/30). Solve -ko - 4 = 1 for o. -1 Let o(l) = -l*2 + 7l. Suppose -2w + 8 = -6. Let m be o(w). Solve m = -6t + 8t for t. 0 Let k be (19 + -5 + -2)(-2)/6. Let v be 9/4 - (5 + 19/k). Solve 5 = -j + v for j. -3 Suppose -r - 2r = -9. Suppose 12k = 13k. Let j = k + 7. Solve jf = rf - 8 for f. -2 Let b(y) = 2y*3 + 61y*2 - 33y - 58. Let q be b(-31). Solve qp = -27 + 43 for p. 4 Suppose 0 = -4m + 3k + 59 - 8, m - 19 = 2k. Solve -63 = 18y + m for y. -4 Suppose -2p - 7 = -33. Suppose -2n = 7 - p. Let l = 3 + n. Solve 0j - l = 3j for j. -2 Suppose 0 = 5d - 17d + 48. Solve 1 = dg - 15 for g. 4 Let o = 283 + -279. Solve -7x = -11x - o for x. -1 Suppose -4k = -4z + z - 3, 4k - 6 = 2z. Let f(a) be the second derivative of a3/3 - a2/2 + a. Let r be f(z). Solve -x + r = 4 for x. 1 Suppose 2n - 5n - 63 = 0. Let r be (-4)/(-14) - (-48)/n. Let y be (-4)/(-16)0/r. Solve 0 = -ym - m + 5 for m. 5 Let f be (02/4)/(-18 + 21). Solve f = -26m + 31m - 25 for m. 5 Suppose o = -5y + 22, -2o - 4y = -2y - 20. Solve 2b - ob - 15 = 0 for b. -3 Let d be ((-2)/2)/((-2)/6). Suppose 38m - 37m = 2. Suppose -5r + mp = -6, 3r = p + 3 + 1. Solve -5 = dh - r for h. -1 Suppose 0 = 15s - 19s + 16. Let x be 4 - s - (-16 + 4). Solve -5p - x - 13 = 0 for p. -5 Let j = 501 + -342. Solve -3a - j + 153 = 0 for a. -2 Let f = 163 + -151. Solve 0 = -d + 5d - f for d. 3 Let s be (-2 + -3)/5 + 191. Let b be s/35 - 4/(-7). Solve 0 = 2o - 4o + b for o. 3 Let h = 1738 - 1717. Solve 0 = a + h - 20 for a. -1 Let w(o) = -o*3 + 6o*2 - 5o + 1. Let k be w(5). Let p(l) = -2l3 + 2l*2 - 4l + 3. Let q be p(1). Let a be 6 + (q/k - 2). Solve ab - 6b = -3 for b. 1 Let m(h) = -2h3 + 4h - 7 + h*3 - 5h - 12h2. Let k be m(-12). Solve -i = -ki for i. 0 Suppose 4c - 21 = y, 9c = 4c + 4y + 18. Suppose -2n = -5f + 6, n - 4f + 18 = cn. Let h be (n + 0 + -3)0. Solve -d - 3 = -hd for d. -3 Suppose 0 = -5u - 3h + 31, 3u + 0u - 11 = 2h. Suppose 3i = 10 - 1. Suppose 5d + 3a - 138 = 0, -d + 4 + 14 = ia. Solve uv + 10 = d for v. 4 Let z(w) = -w + 6. Let b be z(6). Suppose b = 4j + 27 + 1. Let c(h) = h2 + 8h + 7. Let y be c(j). Solve t - 3 = -yt for t. 3 Let t be (-92)/(-28) - (-4)/(-14). Suppose 43r - 48r + 5 = 0. Solve l - r = -t for l. -2 Suppose 0 = 19g - 21 - 93. Solve -g = -w + 3w for w. -3 Suppose -2v = -215o + 212o - 50, -4o - 8 = 0. Solve 8k - 14 = vk for k. -1 Let w(t) = -20t - 18. Let z be w(-5). Let o = z + -60. Solve -3g = -o + 10 for g. 4 Suppose -2w - 3k - 76 + 10 = 0, -w = 4k + 38. Let s = 30 + w. Solve -3i - i - 12 = s for i. -3 Suppose 2q = o - 22, -82 = -4o + 6q - q. Let n = o - 18. Solve 0i + 2i + 6 = n for i. -3 Let d = -711 + 719. Solve -8u = -6u - d for u. 4 Suppose -4w + 5i + 170 = 0, -5i - 130 = -3w - 0w. Suppose -5 = 5v - w. Let y be (-22)/77 - (-37)/v. Solve 5g = y + 10 for g. 3 Suppose 2v = 0, v + 44 = 4l + 2v. Solve l = -3w + 2 for w. -3 Let j(v) = -v - 10. Suppose -4s = 5x + 71, 0 = -5x - s - 19 - 55. Let g = x - -3. Let z be j(g). Solve -1 = zf + 1 for f. -1 Let t = 95 + -210. Let c = t + 124. Solve -10 = cu - 4u for u. -2 Let o be ((-5)/(-10))/(2/(-8)). Let v be 34 + (o - 1 - 1). Let x = v + -30. Solve -3z - z + 16 = x for z. 4 Let v(o) = o*2 + 5o + 12. Let b be v(-8). Solve -bw = -31w - 15 for w. 3 Let x be (-4)/(-22) + (-20)/(-11). Suppose 5j = 5 + 230. Let p = -43 + j. Solve -xu = -p*u for u. 0	{ "pile_set_name": "DM Mathematics" }
earest ten. -9520 Round -30.9561 to the nearest integer. -31 Round 0.000184068 to 6 dps. 0.000184 What is -25903.129 rounded to the nearest one hundred? -25900 Round -0.06665589 to five decimal places. -0.06666 What is -703964 rounded to the nearest one thousand? -704000 What is -8066.287 rounded to the nearest one hundred? -8100 Round 0.004128179 to 5 dps. 0.00413 Round -30.2895 to the nearest integer. -30 Round 5.030374 to zero decimal places. 5 What is -6.38284 rounded to 1 dp? -6.4 What is 0.00007065841 rounded to 7 decimal places? 0.0000707 What is -7334860 rounded to the nearest one hundred thousand? -7300000 What is -0.00000376399 rounded to 7 dps? -0.0000038 Round 67353.91 to the nearest 1000. 67000 Round -0.000625434 to 5 dps. -0.00063 Round -0.00000598888 to six dps. -0.000006 What is 306038000 rounded to the nearest one million? 306000000 What is -1850700 rounded to the nearest one million? -2000000 Round 0.00007929914 to seven dps. 0.0000793 Round 216.263 to one dp. 216.3 What is -22.38199 rounded to the nearest ten? -20 What is 247533 rounded to the nearest 10000? 250000 What is -1775.45 rounded to the nearest one hundred? -1800 What is 0.00000057852 rounded to 7 dps? 0.0000006 Round -2225.356 to the nearest 100. -2200 What is 0.1058323 rounded to 3 decimal places? 0.106 Round -0.0000678966 to seven decimal places. -0.0000679 What is -0.0276908 rounded to four decimal places? -0.0277 Round -18777.1 to the nearest 1000. -19000 What is 0.026681333 rounded to 3 dps? 0.027 What is -155.71457 rounded to one decimal place? -155.7 What is -1239930 rounded to the nearest 1000? -1240000 What is 0.3056674 rounded to two decimal places? 0.31 What is -0.0001228227 rounded to 7 dps? -0.0001228 What is -0.000725198 rounded to six dps? -0.000725 Round -0.815815 to 3 decimal places. -0.816 What is -7.618045 rounded to 1 decimal place? -7.6 What is -0.0005408843 rounded to seven dps? -0.0005409 What is -0.029892336 rounded to two dps? -0.03 Round -0.0000155295 to 5 decimal places. -0.00002 Round 826.405 to the nearest ten. 830 Round -0.000011995 to five dps. -0.00001 What is 1317770 rounded to the nearest one hundred thousand? 1300000 What is 0.000004255537 rounded to six dps? 0.000004 What is 53.3572 rounded to the nearest integer? 53 What is 1050.83 rounded to the nearest one hundred? 1100 Round -179464.7 to the nearest ten thousand. -180000 What is 1.07086 rounded to two decimal places? 1.07 Round -0.05732958 to five dps. -0.05733 What is 0.0656764 rounded to three decimal places? 0.066 Round -0.0028291084 to 3 decimal places. -0.003 Round 0.008713638 to five decimal places. 0.00871 What is -0.0114368 rounded to 5 decimal places? -0.01144 Round -162933 to the nearest 100. -162900 What is 0.08900195 rounded to three decimal places? 0.089 Round 0.7602359 to two dps. 0.76 Round 1293633.2 to the nearest one thousand. 1294000 Round -0.00008602896 to seven dps. -0.000086 What is -0.013371404 rounded to four decimal places? -0.0134 What is -0.00000103877 rounded to seven decimal places? -0.000001 What is -22270840 rounded to the nearest ten thousand? -22270000 Round -101316.4 to the nearest ten thousand. -100000 Round -195.697 to the nearest 100. -200 What is -0.00000154978 rounded to seven dps? -0.0000015 What is 661345100 rounded to the nearest one hundred thousand? 661300000 What is -555822900 rounded to the nearest 100000? -555800000 Round 161092.3 to the nearest 1000. 161000 What is -25.58334 rounded to 1 decimal place? -25.6 Round -15351.62 to the nearest one hundred. -15400 What is 2376840 rounded to the nearest ten thousand? 2380000 What is -1589791000 rounded to the nearest 1000000? -1590000000 What is -2912452 rounded to the nearest 1000000? -3000000 What is 0.000270995 rounded to five decimal places? 0.00027 What is 0.0006589963 rounded to 6 dps? 0.000659 Round 0.0706163 to 2 dps. 0.07 Round 1103915800 to the nearest 100000. 1103900000 Round 0.581703 to two decimal places. 0.58 What is -0.00432529 rounded to five dps? -0.00433 What is 587331220 rounded to the nearest 100000? 587300000 What is 713.2963 rounded to the nearest 10? 710 What is 0.00000984838 rounded to six decimal places? 0.00001 Round 18766300 to the nearest one million. 19000000 What is -28320.27 rounded to the nearest 1000? -28000 What is -0.000405521 rounded to six dps? -0.000406 What is 453.09346 rounded to one decimal place? 453.1 Round 264099.2 to the nearest one thousand. 264000 What is -0.0000187011 rounded to seven decimal places? -0.0000187 What is -73.34071 rounded to the nearest ten? -70 What is -4.349256 rounded to one decimal place? -4.3 What is -532334.3 rounded to the nearest 100000? -500000 Round 112014.3 to the nearest 100. 112000 Round -0.24330846 to 2 decimal places. -0.24 Round -0.000998569 to six dps. -0.000999 What is -150.9434 rounded to 1 decimal place? -150.9 What is 2773269000 rounded to the nearest 1000000? 2773000000 What is -3880.7857 rounded to the nearest 10? -3880 What is -0.45840109 rounded to four decimal places? -0.4584 Round -102.07239 to 1 dp. -102.1 What is 27420100 rounded to the nearest one hundred thousand? 27400000 What is 0.629209 rounded to one decimal place? 0.6 Round 0.00311029 to 3 dps. 0.003 Round -0.984635 to three dps. -0.985 Round -858330400 to the nearest 100000. -858300000 Round -0.11841976 to 4 dps. -0.1184 What is 272.0763 rounded to 0 decimal places? 272 Round -19.12081 to two dps. -19.12 What is -0.000008059475 rounded to 6 decimal places? -0.000008 What is 660710 rounded to the nearest 10000? 660000 Round 5473150 to the nearest one million. 5000000 Round 4176200 to the nearest 1000000. 4000000 What is 9453.403 rounded to the nearest ten? 9450 What is -0.01835209 rounded to five decimal places? -0.01835 Round -10268080000 to the nearest one million. -10268000000 What is 9616898 rounded to the nearest ten thousand? 9620000 What is -0.000251439 rounded to six decimal places? -0.000251 Round -339605 to the nearest 100000. -300000 Round -0.0000003582388 to seven dps. -0.0000004 What is -3710190 rounded to the nearest one million? -4000000 What is -0.0000030501 rounded to six dps? -0.000003 What is 1983.03 rounded to the nearest integer? 1983 Round -498197000 to the nearest one million. -498000000 What is -44.6575 rounded to zero decimal places? -45 Round 0.5933162 to 3 dps. 0.593 What is -0.0008709445 rounded to 4 decimal places? -0.0009 What is 0.0000614933 rounded to 6 dps? 0.000061 Round -58276.406 to the nearest 100. -58300 Round 5885.57 to the nearest ten. 5890 What is 0.293121 rounded to four decimal places? 0.2931 Round -0.14759117 to three dps. -0.148 Round 81164.32 to the nearest 100. 81200 Round 0.002977994 to three dps. 0.003 What is 0.38752 rounded to 2 decimal places? 0.39 What is 1352052800 rounded to the nearest one hundred thousand? 1352100000 Round -0.0000009576595 to seven dps. -0.000001 What is -0.0009061221 rounded to 6 dps? -0.000906 Round -88.03413 to the nearest integer. -88 What is -245101000 rounded to the nearest 1000000? -245000000 What is -7858444 rounded to the nearest 100000? -7900000 What is 23387.7 rounded to the nearest one hundred? 23400 Round -0.000396245 to five dps. -0.0004 What is 99729100 rounded to the nearest one million? 100000000 Round 2.907894 to three decimal places. 2.908 Round -11671.11 to the nearest 1000. -12000 Round -0.4023874 to four dps. -0.4024 What is -5337.786 rounded to the nearest 10? -5340 Round -7049770 to the nearest one million. -7000000 What is 0.0014578639 rounded to five decimal places? 0.00146 Round -0.0000261172 to five dps. -0.00003 What is 0.00139207 rounded to four decimal places? 0.0014 What is 0.3543086 rounded to 3 decimal places? 0.354 What is -3247.25 rounded to the nearest one hundred? -3200 What is 412516 rounded to the nearest 1000? 413000 What is -0.0416312 rounded to 2 dps? -0.04 What is 0.002419913 rounded to 6 decimal places? 0.00242 What is -0.094705 rounded to three decimal places? -0.095 What is 14635.088 rounded to the nearest 10? 14640 Round 0.00371973 to six decimal places. 0.00372 What is 0.0002010143 rounded to 5 decimal places? 0.0002 What is -0.000272668 rounded to 6 dps? -0.000273 Round -0.04965266 to four dps. -0.0497 What is 1	{ "pile_set_name": "DM Mathematics" }
2 - 14872m + 14820380 = 0. Calculate m. -4535, 817 Find f, given that 2f5/11 - 420812f*4/11 + 22136604768f*3/11 - 132797747200f*2/11 - 354145280000f/11 = 0. -2, 0, 8, 105200 Solve -2m5/9 - 74m*4/3 + 1636m*3 - 87236m*2/9 - 73174m/3 - 13038 = 0. -159, -1, 9, 41 Factor 3v3/7 - 2169v*2/7 - 165054v/7 + 879120/7. 3(v - 792)(v - 5)(v + 74)/7 Factor r2/3 - 3139238r/3 + 9417687. (r - 3139229)(r - 9)/3 Factor -2t*3/3 - 38t*2 + 108356t/3. -2t(t - 206)(t + 263)/3 Find i such that 2i*5 - 124i*4 - 8366i*3 - 128072i*2 - 753432i - 1540800 = 0. -25, -8, -6, 107 Solve 16f4 - 2290f*3 - 72350f*2 - 127500f = 0 for f. -25, -15/8, 0, 170 Factor r*3/2 - 53r*2/2 - 27729r + 981540. (r - 246)(r - 35)(r + 228)/2 Let -2g2/11 + 22380g/11 - 23287338/11 = 0. Calculate g. 1161, 10029 Let 5k2/4 - 212290k + 36504635/4 = 0. What is k? 43, 169789 What is r in 25r4 + 2920r*3 + 5085r*2 - 10350r = 0? -115, -3, 0, 6/5 Solve 2v4 - 227336v*3 + 6458842934v*2 + 77532715680v + 174462422400 = 0. -9, -3, 56840 Determine i so that -6i5/5 + 3388i*4/5 + 8146i*3/5 - 118072i*2/5 + 15352i + 199584/5 = 0. -22/3, -1, 2, 4, 567 Let 2t5/7 - 318t*4/7 + 6102t*3/7 + 346310t*2/7 + 1292952t/7 + 136152 = 0. Calculate t. -21, -3, -1, 62, 122 Factor q*2/4 - 250969q + 17065603/4. (q - 1003859)(q - 17)/4 Determine c so that -c2/5 - 19043214c - 453304999312245 = 0. -47608035 Factor -3g3/7 + 1620g*2/7 + 176961g. -3g(g - 967)(g + 427)/7 Solve -44s*5 - 43360s*4 - 19172s*3 + 521024s*2 + 930160s + 315200 = 0 for s. -985, -2, -5/11, 4 Factor 3u2 + 13041u - 1184412. 3(u - 89)(u + 4436) Find k, given that 2k2/13 + 42548448k/13 + 226296303401088/13 = 0. -10637112 Suppose -i*4/5 - 1312i*3/5 + 19963i*2/5 + 76894i/5 - 95544/5 = 0. What is i? -1327, -4, 1, 18 Find z such that 5z5 - 630z*4 + 1180z*3 + 158840z*2 - 629760z + 624640 = 0. -16, 2, 16, 122 Factor 100h2/3 + 3056512h/3 + 122260. 4(h + 30565)(25h + 3)/3 Let 5j*4 - 785j*3 - 34595j*2 - 252715j + 288090 = 0. Calculate j. -27, -11, 1, 194 Let -s*3/5 + 32707s*2/5 - 686384s/5 - 719092/5 = 0. Calculate s. -1, 22, 32686 Let -5i5 - 1905i*4 - 246600i*3 - 12283920i*2 - 200931840i - 1030164480 = 0. Calculate i. -144, -69, -12 What is n in 24n2 - 398732n + 3785788 = 0? 19/2, 49813/3 Determine p, given that -3p4/4 - 2741807p*3/4 - 313229172567p*2/2 + 52205395224p + 104409876512 = 0. -456968, -2/3, 1 Let -c*2 + 53775381c + 53775382 = 0. What is c? -1, 53775382 Suppose -201k4/2 + 240585k*3/2 - 40748382k*2 + 2742776994k + 163893144 = 0. What is k? -4/67, 89, 554 Find o such that 40o5 - 3852o*4 - 35928o*3 - 64476o*2 + 22680o = 0. -6, -3, 0, 3/10, 105 Suppose 2f4/11 - 178568f*3/11 - 422176f*2 - 16432864f/11 - 1428960 = 0. What is f? -22, -2, 89310 Let -3t3/5 - 5163t*2/5 - 761982t/5 + 3858888 = 0. Calculate t. -1555, -188, 22 Factor -146m2 + 10506320m/3 - 335818/3. -2(m - 23987)(219m - 7)/3 Find c such that -20c*5 - 2195c*4 + 73090c*3 - 215415c*2 + 49320c = 0. -137, 0, 1/4, 3, 24 Factor 2j3 - 31728j*2 - 508160j. 2j(j - 15880)(j + 16) Factor -118050z*2/7 + 2183457z/7 + 8658/7. -3(2z - 37)(19675z + 78)/7 Suppose 28j4/3 + 3448j*3/3 - 1374412j*2 + 7644352j/3 + 1176208/3 = 0. Calculate j. -451, -1/7, 2, 326 Solve 3p2/2 - 622515p + 3735063/2 = 0 for p. 3, 415007 Factor -2n2/3 + 720011020n/3 - 64801983615180050/3. -2(n - 180002755)2/3 Let l4/9 - 8341l*3/3 + 400036l*2/9 + 633484l/3 + 2000560/9 = 0. Calculate l. -2, 20, 25007 Factor -u*2/4 + 317043u/4 - 8161205. -(u - 316940)(u - 103)/4 Factor 2g*3 + 5114g*2 - 524268g + 4302720. 2(g - 90)(g - 9)(g + 2656) Determine f so that 3f*2/5 + 10844922f/5 + 9801027765507/5 = 0. -1807487 Factor y*2 + 84374y + 4890328. (y + 58)(y + 84316) Find y, given that -2y*4/5 + 2816y*3/5 - 982746y*2/5 - 5975564y/5 - 7997584/5 = 0. -4, -2, 707 Determine o, given that 2o3/11 + 1634480o*2/11 + 6537896o/11 + 6537888/11 = 0. -817236, -2 Factor -4z3 + 129697268z*2 + 259394548z + 129697276. -4(z - 32424319)(z + 1)*2 Find n, given that -3n*3/2 - 1854n*2 - 1014729n/2 = 0. -827, -409, 0 Factor 2a3 - 4080a*2 - 616202a + 2529960. 2(a - 2181)(a - 4)(a + 145) Determine c so that 3c*2/2 - 555090c + 51354151350 = 0. 185030 Factor 147k2/5 - 112689k - 22998/5. 3(k - 3833)(49k + 2)/5 What is m in -m5 - 4413m*4 + 108m*3 + 476172m*2 - 1906416m = 0? -4413, -12, 0, 6 Determine l, given that 180l3 - 11163l*2 + 173166l - 2883 = 0. 1/60, 31 Factor -5f2 + 2643245f + 5286510. -5(f - 528651)(f + 2) Solve -d*4/3 - 56d*3 + 5633d*2/3 - 5236d + 10244/3 = 0. -197, 1, 2, 26 What is v in 4v3/3 + 560v*2 + 27536v/3 - 2504320 = 0? -390, -86, 56 Factor -2l4 + 350700l*3 - 15369251474l*2 - 399778360800l - 2598944646272. -2(l - 87688)2(l + 13)2 Solve a4/2 - 18a3 - 19477a*2/2 - 29040a = 0. -121, -3, 0, 160 Let 4x3/7 + 3708x*2/7 + 438416x/7 - 1813248/7 = 0. What is x? -787, -144, 4 Let -m*5/2 + 173m*4/2 - 6639m*3/2 - 44617m*2/2 - 34310m - 15408 = 0. Calculate m. -4, -1, 72, 107 Factor -3d2/7 - 5965338d/7 + 5965341/7. -3(d - 1)(d + 1988447)/7 Solve -3v2/5 - 16418532v/5 = 0. -5472844, 0 Solve -k*4 + 496311941k*3 - 82108514094291846k*2 + 4527937288024585517711356k + 4527937370133100108315144 = 0 for k. -1, 165437314 Determine y, given that 2y5/7 + 9382000y*4/7 + 11002693589906y*3/7 - 110027611403988y*2/7 + 308077822312920y/7 - 264066897841200/7 = 0. -2345505, 2, 6 Let 3t4 - 315492t*3 + 8296177434t*2 - 82933067028t + 74637205083 = 0. What is t? 1, 9, 52577 Factor -3f4 - 364704f*3 + 48175776f*2 - 2120245248f + 31100678400. -3(f - 44)3(f + 121700) Solve -i*3 + 30080i*2 + 1083852i + 9757584 = 0. -18, 30116 Factor 2i2 + 7978i - 7980. 2(i - 1)(i + 3990) Solve -4u4 - 6936u*3 - 412272u*2 - 6802472u - 16883916 = 0 for u. -1673, -29, -3 Suppose 1297w4 + 18257w*3 - 18069w*2 - 1485w = 0. Calculate w. -15, -99/1297, 0, 1 Suppose 3k4/2 - 7266k*3 + 618969k*2/2 + 887130k - 110182950 = 0. What is k? -17, 30, 4801 Determine u, given that u*5/2 - 1763u*4 + 1267056u*3 + 1270583u*2 - 2534113u/2 - 1268820 = 0. -1, 1, 1007, 2520 Let -84700o4/17 - 316734o*3/17 - 237492o*2/17 - 49406o/17 + 372/17 = 0. Calculate o. -31/11, -1/2, -3/7, 2/275 Suppose -5d4 + 2180d*3 + 141845d*2 + 2061880d + 3573900 = 0. What is d? -38, -19, -2, 495 Let 3z4/2 + 633z*3/2 + 30471z*2/2 - 65433z/2 - 47637 = 0. Calculate z. -134, -79, -1, 3 Factor -5y2 - 244178630y - 2981160167433845. -5(y + 24417863)2 Factor 5c*3 - 1275890c*2 + 81407522005c - 1627640124100. 5(c - 127579)2(c - 20) Suppose -r*2/10 + 18751r/10 + 7830576/5 = 0. Calculate r. -801, 19552 Determine l so that 5l2/2 - 736409655l + 108459835995443805/2 = 0. 147281931 Factor -3f2/5 + 4211916f/5 - 1478353032588/5. -3(f - 701986)2/5 Factor 5q*2 - 3835q - 107190. 5(q - 794)(q + 27) What is o in o*2 + 41238o + 14675561 = 0? -40879, -359 Let -2k5/3 + 3466k*4/3 - 69430k*3 + 1817126k*2/3 - 4045276k/3 + 810992 = 0. What is k? 1, 2, 7, 52, 1671 Factor -4k3 - 370364k*2 + 740744k. -4k(k - 2)(k + 92593) Solve 3k*3 - 26082k*2 - 16056693k - 2390036160 = 0 for k. -293, 9280 Let -2n4 - 34890n*3 - 162700162n*2 - 90261547158n - 90098881884 = 0. Calculate n. -8403, -638, -1 Let y*2/2 + 6151y/2 - 114478 = 0. Calculate y. -6188, 37 Suppose 3z2/5 - 220361982z + 20233084629570135 = 0. Calculate z. 183634985 Factor 3j2 - 11517j + 2111034. 3(j - 3646)(j - 193) Find j, given that 1592j2/7 + 168524j - 2964/7 = 0. -741, 1/398 Suppose 4h5/7 + 34h*4/7 - 32h*3/7 - 942h*2/7 - 2736h/7 - 2376/7 = 0. What is h? -6, -3, -2, 11/2 Factor 2q3/13 - 1834q*2/13 - 788568q/13. 2q(q - 1236)(q + 319)/13 Suppose -6412k*4/3 + 294294326k*3/3 - 1125584865968k*2 - 1922296960834k/3 + 4213252808/3 = 0. Calculate k. -4/7, 1/458, 22949 Determine z so that -5z5 - 8245z*4 + 691600z**3 = 0. -1729, 0, 80 Find x, given that	{ "pile_set_name": "DM Mathematics" }
59. Is q(-2) a composite number? True Let h(g) = -2g - 39. Let r be h(-15). Let p(j) = -j3 + 7j*2 - 6j + 11. Is p(r) a prime number? True Let t = -464 - -653. Let o = t - 115. Is o a prime number? False Suppose -48 = -5c + 17. Is (c/(-4))/(2/(-16)) prime? False Is (-1)/(-6 - 280241/(-46709)) prime? True Suppose 4d - 126756 = 4g, -2g + 20433 + 106311 = 4d. Is d a composite number? False Let u(q) = -7q*3 + 87q + 41. Is u(-20) composite? True Let a(h) = -3h + 4h + 17h2 + 67h*2. Is a(1) a composite number? True Let u = 125 - 121. Suppose h - 1 = 0, 2k + 2h = -2k + 2. Suppose -2v + p - 20 + 101 = k, -uv = -5p - 177. Is v a prime number? False Let d = -7063 - -18170. Is d composite? True Let g be (-11)/(-3 + -4 + (-9068)/(-1296)). Let f = g + -2311. Is f a prime number? False Let g(i) = i3 + 6i*2 + 6i + 9. Let n be g(-5). Suppose -nk + 908 - 192 = 0. Is k composite? False Is (-8 + (-47510)/(-20))(1 + 1) a prime number? False Let z(p) = 2p2 + 5p + 2. Let q be z(-2). Let n be -2 + (q/4 - -3). Is (n/(-1))/((-3)/267) a prime number? True Suppose -8p + 53 = 13. Suppose 0 = -3t + t - 3r + 1133, -t - pr + 556 = 0. Is t composite? False Let j(k) be the first derivative of 5k3 + 3k*2/2 - 17k + 16. Is j(-8) a composite number? False Let k = -1389 - -5378. Is k prime? True Let b = 32681 - 16174. Is b composite? True Let v = 9613 - 4310. Is v composite? False Let z(y) = 1030y2 + 37y + 63. Is z(-2) a prime number? False Suppose 0 = -4h - 4, 5j + 4h = 175461. Is j composite? True Let k(o) = o3 + 7o*2 - 22o - 106. Let t be k(-8). Let b(a) = -11a + 2a - 1 - 6 + 7a2. Is b(t) composite? False Let y(m) = -m2 - 6m + 1. Let z be y(-6). Is z/8 + 3189/24 prime? False Suppose -5l - 191 = 4c, -c + 4l - 6 = 26. Is (-2)/8 + (-15279)/c composite? False Suppose -x = -0x + 5b - 48, -124 = -2x + 4b. Let o(f) = 3 - 9f*2 - xf*3 + 11f*2 - 4. Is o(-1) a composite number? False Suppose g - 259 = -4z + 2g, 5z + g - 317 = 0. Let a be (z/24)/(2/141). Is 6/(-4)a/(-6) a composite number? False Suppose -20b + 18b = -6. Is (-1)/((-1)/b) - (-2 - 182) composite? True Let l = 88 - 86. Suppose 4g = 5w + 3070 - 141, 2w = -l. Is g a composite number? True Suppose -p + 5 = 0, 7 = o + 3o - p. Let k(l) = 7l*3 - 4l*2 + 2l + 7. Is k(o) composite? True Suppose -34690 - 13175 = -15f. Is f composite? False Suppose -5p + 0b - 2b + 15 = 0, 0 = -4p + 5b - 21. Let t(m) = -26m3 + m2. Let z be t(p). Let w = z + 94. Is w composite? True Let m(s) = -2s + 17. Let g be m(7). Suppose -3k + 0q - gq = 15, -25 = -3k + 5q. Is 1 - (k - (-3 - -4)) prime? True Let f be (4 - 6)(2 + -1). Let y be -727 - -2 - (4 + f). Let o = y - -1170. Is o prime? True Let k be 3 + -3 - -2 - (0 + 1). Is k/(-2) - 3(-2644)/8 a composite number? False Let o = 70919 + -12814. Is o composite? True Let g(y) = 1297y + 165. Is g(8) a prime number? False Let b(m) = -m*2 + 94m*2 + 4 + m + 24m*2 + 109m*2. Let z be b(-3). Suppose -7q + z = -2q. Is q a composite number? True Let q = 36625 - 20898. Is q a prime number? True Suppose 2603 = 3g - 2p, g + 2p = 6g - 4341. Is g prime? False Suppose 92u - 106u + 443366 = 0. Is u a composite number? True Suppose 3i + 15 = 0, 0i = -4w + 3i + 35. Suppose -wb = -7 - 18. Suppose 2c = bl + 200, 2c - 3l = -l + 194. Is c composite? True Suppose -447 = c - s, -6c - 4s - 906 = -4c. Is 6/(-2)2/(6/c) composite? False Let a = -37 + 45. Suppose ao - 281 - 1311 = 0. Is o a prime number? True Is 1/((-4)/(-57140)) + (11 - 15) prime? True Suppose z - 7453 = -d, -6618 - 8276 = -2d + 4z. Is d prime? True Suppose 4c + c - 5m + 1315 = 0, 3c + 787 = 4m. Is -32/3 - (0 + c) a prime number? True Let y(m) = m*2 + 12m + 22. Suppose 4a + 52 = 2q, 4q + 0q - 16 = 0. Is y(a) a composite number? False Suppose k - 14 = -37. Let g(i) = -94i + 11. Is g(k) composite? True Is 3716 + (4 - (-1 + (-1 - -3))) a composite number? False Let r = 6006 + 23623. Is r prime? True Suppose 107300 = 18t - 24802. Is t composite? True Let x = 16 + -12. Is (-63)/(-1) - (x + -6)1 composite? True Let o(t) = 6t - 24. Let h be o(4). Suppose -4x = -5p - 5328, hx + 2p = 2x - 2666. Is x composite? True Let x = -33 + 22. Let y(u) = -4u + 8. Let p be y(x). Suppose 4h - 2d - 99 = d, 2h - p = 2d. Is h a composite number? True Suppose 6j + 5 = -2b + 3j, -j + 15 = 4b. Let v(z) = -z*3 + 12z*2 - 3z - 11. Is v(b) a prime number? True Suppose 4x - 2x + 2 = 0. Let a be 6x/((-8)/76). Suppose 2b - 13 = a. Is b prime? False Suppose -19h + 23262 = -13h. Is h prime? True Let r = -899 + 287. Let p = 1255 + r. Suppose 2f = 6f + 2n - 1262, 0 = -2f + 3n + p. Is f a prime number? True Let t(g) be the third derivative of -g6/40 + g5/30 - g4/12 + g3/6 - 13g*2. Is t(-6) a prime number? True Let q be 4/6 + 5460/(-9). Let x = q + 897. Is x a composite number? True Suppose d - 3335 = -4o, -5d + 0d - 2530 = -3o. Is o composite? True Let o(l) = -194l - 1. Let z be o(6). Let m be (3 - z) + -1 + -2. Suppose -m = 2w - 7w. Is w composite? False Let n(l) = -3l3 - 7l*2 + 7l - 6. Let r be n(-8). Suppose d = 0, 3q + 0d = -d + r. Suppose -7m + 3m + 2w = -q, 0 = 5w + 5. Is m a composite number? True Let v(l) = l*2 - 4l - 3. Let g(s) = -s*2 - 8s - 2. Let d be g(-7). Let r be v(d). Suppose -4c + 94 = -rc. Is c a composite number? False Let u = 17602 - 8141. Is u composite? False Let i(r) = -3r + 9. Let b be i(13). Let f = 53 + b. Is f a composite number? False Suppose 2a - 508253 = 6i - 11i, -4i = -12. Is a a prime number? True Suppose -c + 3759 = 2f, -5f - 7674 = 4c - 22713. Is c a composite number? False Is (6 + -5)/((-6)/(-373242)) prime? True Let a(j) = -50144j + 15. Is a(-1) composite? False Let p be 63211/(-6) + (3 - 2)/6. Is p/(-42) - 1/(-6) a prime number? True Let k(v) = 76v*3 - 10v*2 + 38v - 3. Is k(7) prime? True Is (-7057388)/8(-6)/39 a prime number? True Let l = 96 + -91. Suppose 2f - 48 + 379 = lt, t = -5f + 77. Is t composite? False Suppose 25544 = -4x + 6796. Let m = -2563 - x. Is m/4 - (3 + -7) a prime number? False Let i(a) = 5a*2 + 5a + 5. Let k(m) = 5m2 + 5m + 4. Let q(c) = -5i(c) + 6k(c). Let t(b) = b*2 + 18b + 38. Let r be t(-15). Is q(r) a prime number? False Let f(b) = 3b3 - 2b*2 + 3b + 7. Let n be f(5). Suppose -n = -a + 462. Is a prime? True Let f(r) = 6r - 8. Let s be f(3). Suppose so - 12o = -78. Is o prime? False Suppose 0 = -2l - 4n + 13569 + 785, -4n - 21531 = -3l. Is l a composite number? False Let n be -3 + 2 + -2 + (-6 - -13). Is 327 - (-4 + 0/n) a composite number? False Suppose 84b - 49b = 1097495. Is b composite? False Let n(c) = 30c*2 - 26c - 215. Is n(-12) a composite number? True Suppose 187578 = 58l - 1141144. Is l composite? True Let q = 0 + 5. Suppose -4h = 3m - 0m - 24, 5 = 5m - qh. Suppose mi - 402 = -2i. Is i prime? True Let y(t) = -6t + 11. Let d be y(4). Let a(u) = -u3 - 12u*2 + 9u - 9. Is a(d) a prime number? True Let m = 136 + -131. Suppose 3q + 5v - 11975 = 3v, -19925 = -5q + mv. Is q a prime number? True Suppose 3d - c + 1 = -0c, -5d - 4c = 13. Let l be d - 1 - (-12 + 7). Is 5(l - 1744/(-10)) prime? True Let m(n) = 2n3 + 7n*2 - 8n - 9. Suppose -8 = -3y + 2y. Is m(y) composite? False Let q be -28(2 + 0)(-6)/4. Is 1442/(-4)(-48)/q + -1 a prime number? False Suppose 5h = -4y + 3y - 2, 3h - 6 = 3y. Let a(j) = -1 + j*3 + 3j - 2j + 7j + 11j2 + hj. Is a(-9) a prime number? True Let m(d) = 507d + 41. Is m(6) composite? False Suppose 0 = 5w - g - 154086, -w = -0w + 2g - 30815. Is w a prime number? True Let r(k) = 4k + 14. Let c be r(-8). Let b = c + 39. Is b prime? False Let s(p) = p2 - 8p - 11. Let n be s(9). Let i be n/(-13) - (-1051)/13. Let g = 284 - i. Is g a composite number? True Suppose -3 = -5y + 7. Suppose -yc + 92 = -0c. Is 9(0 - c/(-6)) prime? False Suppose q + 4q - 10 = 0. Suppose 0 = 11k - 2k - 17703. Suppose -6h + k = -h + qn, -n = h - 391. Is h composite? True Suppose 11j = 6j + c + 3841, j - 4c = 753. Is j prime? True Let f(c) = 1278c2 + 15c - 31. Is f(4) composite? False Let m(h) = -149*h - 4. Let z be m(-7)	{ "pile_set_name": "DM Mathematics" }
+ (sqrt(5) + 1 - sqrt(5)))-1. 1 + sqrt(5) Simplify (-3 + sqrt(42)/sqrt(6) - sqrt(7)) + sqrt(7) - (5 + (sqrt(7) - (sqrt(7) + 3 - sqrt(7)))). -5 Simplify ((sqrt(88)1)/sqrt(2))*2. 44 Simplify -2sqrt(405)2. -36sqrt(5) Simplify (5(0 + sqrt(612)) + -3(1 + sqrt(612)))*2. -72sqrt(17) + 2457 Simplify (sqrt(20)/(sqrt(10) + sqrt(10)1)-4)2 + -4. 4 Simplify (sqrt(112) + 3 + sqrt(112) + 4 - sqrt(112))2. 56sqrt(7) + 161 Simplify sqrt(51)/(-1(-1sqrt(3) - sqrt(3) - sqrt(3))). sqrt(17)/3 Simplify (-4(0 + sqrt(245) - sqrt(245)))*2 + 2 + 0. 2 Simplify (sqrt(18)16)/(sqrt(66)/sqrt(176)). 24sqrt(3) Simplify (3 + sqrt(11)-1 - (-2 + sqrt(1331)))2. -120sqrt(11) + 1609 Simplify -5((sqrt(80))2 + sqrt(5)) + sqrt(5) + sqrt(45) + -2. -402 - sqrt(5) Simplify (sqrt(1872) + -1)-3-6. -18 + 216sqrt(13) Simplify (sqrt(34)/sqrt(32) + sqrt(17) - (sqrt(204)/(sqrt(24)/sqrt(2)) - sqrt(17)))*2. 425/16 Simplify sqrt(325) - (-1 + sqrt(325) + sqrt(325)) - (sqrt(13) - (sqrt(13)-4 + sqrt(13)))*2-4. -5sqrt(13) + 833 Simplify 0 + sqrt(252) - sqrt(28)/sqrt(4)4. 2sqrt(7) Simplify -4 + -1-11sqrt(1872). -4 + 12sqrt(13) Simplify ((-1 + sqrt(1573))-6 + sqrt(1573))*2. -660sqrt(13) + 39361 Simplify (sqrt(75)-2)2 - (sqrt(3) - (sqrt(72)/sqrt(2))/sqrt(12)). 300 Simplify ((sqrt(7) - (-3 + sqrt(847))) + 4)2. -140sqrt(7) + 749 Simplify (52sqrt(15))/(-2sqrt(243) - sqrt(243)). -10sqrt(5)/27 Simplify 2 + sqrt(19) + sqrt(19) + 1sqrt(19) + (sqrt(19) + sqrt(95)/sqrt(20) + sqrt(19) + sqrt(19))2. 3sqrt(19) + 939/4 Simplify (2 + sqrt(1216))25. 20 + 80sqrt(19) Simplify -4(-1 + (sqrt(48) + 5)*2) + -2. -290 - 160sqrt(3) Simplify (sqrt(128)1 + -1 + sqrt(128) + (31sqrt(128) - sqrt(128)))21. -64sqrt(2) + 2049 Simplify (-4(4sqrt(32)/sqrt(4) - sqrt(648)-1))*2. 21632 Simplify (-625sqrt(15)/sqrt(3))*2. 18000 Simplify 6(sqrt(99)3 - sqrt(99))2. 2376 Simplify sqrt(192)-1 + -2 + sqrt(192) + (4 + sqrt(192) + 2)*2. 96sqrt(3) + 226 Simplify ((1sqrt(1377))2 - (sqrt(17)-2 + 3)) + (sqrt(34)/sqrt(8)4)2. 2sqrt(17) + 1442 Simplify -1sqrt(1872)1. -12sqrt(13) Simplify ((-3 + sqrt(147) - sqrt(147))-3-5)2. 2025 Simplify (-3 + (-4sqrt(425) - (sqrt(187) + 1sqrt(187) + sqrt(187))/sqrt(11)))2. 138sqrt(17) + 9002 Simplify ((sqrt(396) + sqrt(396)-1-1 - sqrt(396))/(sqrt(81)2))2. 11/9 Simplify -6(sqrt(17) - (-2 + sqrt(17))-5) + 2. -36sqrt(17) + 62 Simplify sqrt(55)/(sqrt(55)/sqrt(5)3). sqrt(5)/3 Simplify (sqrt(612) - (-2sqrt(612) + -2) - -5(1 + sqrt(612)))2. 672sqrt(17) + 39217 Simplify ((-1 + 1 + sqrt(1377))-2)2. 5508 Simplify (sqrt(125) + 2sqrt(125)3 + (sqrt(125) + -2)-6)*2. 120sqrt(5) + 269 Simplify -5((-3sqrt(2736))*2-2 + sqrt(2736)). -60sqrt(19) + 246240 Simplify ((sqrt(140)2)/sqrt(7))/sqrt(4)-4. -8sqrt(5) Simplify sqrt(204)/(sqrt(96)/(sqrt(200) + sqrt(8))). 6sqrt(17) Simplify 4(2 + sqrt(275)). 8 + 20sqrt(11) Simplify -55((-3sqrt(7) - sqrt(7)) + 1). -25 + 100sqrt(7) Simplify (sqrt(102)4)/sqrt(6) + ((sqrt(1700) + 1)*2 - sqrt(17)). 23sqrt(17) + 1701 Simplify (sqrt(44)/(-2sqrt(11)))/(sqrt(200) - sqrt(200)-2). -sqrt(2)/60 Simplify (sqrt(77) + 1sqrt(77)1)/(sqrt(396) - (sqrt(396) - sqrt(396)1 - sqrt(396))). sqrt(7)/6 Simplify (sqrt(49) - -1(sqrt(784) - sqrt(49)))/(sqrt(7) + (sqrt(567) - -1sqrt(567))). 4sqrt(7)/19 Simplify -4 + sqrt(320) + 4 + (4 + sqrt(5))*2. 21 + 16sqrt(5) Simplify (3sqrt(147)-5 + -1)*2. 210sqrt(3) + 33076 Simplify ((sqrt(539) - (sqrt(539) + -3 + sqrt(539))) + 4)*2 - sqrt(539). -105sqrt(11) + 588 Simplify (2sqrt(1216) + 1)2. 32sqrt(19) + 4865 Simplify (sqrt(119) + 2sqrt(119)1)/(sqrt(14)/(sqrt(2) + sqrt(6)/sqrt(3))). 6sqrt(17) Simplify (-1-4sqrt(99) + 0 + 3)2. 72sqrt(11) + 1593 Simplify -5 + sqrt(35)/(-1sqrt(7)). -5 - sqrt(5) Simplify sqrt(133)/(sqrt(252)-1) + -5. -5 - sqrt(19)/6 Simplify sqrt(25)/sqrt(5)22. 4sqrt(5) Simplify -5(sqrt(75) + -1). -25sqrt(3) + 5 Simplify (-5 + sqrt(7)-1)*2 + (sqrt(7)13)2 + sqrt(7). 11sqrt(7) + 95 Simplify -5 + ((sqrt(119) + sqrt(119)-25)/sqrt(7))*2. 1372 Simplify sqrt(84)/(4(sqrt(12) + sqrt(48) + sqrt(12) - sqrt(12))). sqrt(7)/12 Simplify (3((sqrt(605) - (1 + sqrt(605))) + 0))2. 9 Simplify (sqrt(36) + -2(sqrt(36) - sqrt(36)1))/sqrt(12). sqrt(3) Simplify ((sqrt(1088) + 0)-2)*2 + sqrt(1088) + sqrt(1088). 16sqrt(17) + 4352 Simplify (1(sqrt(275) + 0 - sqrt(275) - sqrt(275)) + 0 + -1sqrt(275))*2. 1100 Simplify -5(-3sqrt(300) + -1)2. -13505 - 300sqrt(3) Simplify (sqrt(6) - (sqrt(6) - sqrt(60)/(sqrt(50)/sqrt(5))))/(sqrt(3) + (sqrt(6)/sqrt(2) + sqrt(3))5). sqrt(2)/11 Simplify (sqrt(343) + (-2sqrt(343) - sqrt(343)) + sqrt(343))2 + sqrt(343) + (sqrt(343) + 0)2. 7sqrt(7) + 686 Simplify -5(sqrt(13) - sqrt(39)/sqrt(3)-5 - sqrt(13))-6. 150sqrt(13) Simplify -1sqrt(19)-2 - (sqrt(19) + 2 + 5)2. -68 - 12sqrt(19) Simplify (sqrt(36) - (-3sqrt(1296) - sqrt(1296) - sqrt(36)))/(33sqrt(12)). 26sqrt(3)/9 Simplify (-61sqrt(7)5)2. 6300 Simplify (-5 + -5sqrt(76))*2. 100sqrt(19) + 1925 Simplify sqrt(104)/(sqrt(8) - sqrt(8)3) + sqrt(13) - (3 + sqrt(13) + -4). -sqrt(13)/2 + 1 Simplify -2sqrt(7) + 3 + 1. -2sqrt(7) + 4 Simplify ((sqrt(19) + (sqrt(19) + (sqrt(19)-2-6 - sqrt(19)) + sqrt(19) - sqrt(19)))4)2. 51376 Simplify sqrt(84)/(sqrt(12) + (sqrt(108)/sqrt(9) - sqrt(12))) + sqrt(7) + 2 + (sqrt(77)/sqrt(11))2. 2sqrt(7) + 9 Simplify (4-1sqrt(170))/(4sqrt(40)/sqrt(4)). -sqrt(17) Simplify (sqrt(112)-1 + sqrt(112))5 + ((sqrt(112) + sqrt(112) + -2)6 - sqrt(112))2. -1056sqrt(7) + 13696 Simplify (((sqrt(84) - ((-2sqrt(84) - sqrt(84)) + sqrt(84))) + sqrt(84))-6 - sqrt(84) - sqrt(84))/(sqrt(12) - (sqrt(96)/(1sqrt(8)) - sqrt(12))). -26sqrt(7) Simplify (1-2sqrt(832) + sqrt(832) - (1sqrt(832) + 5 + sqrt(832)))2. 240sqrt(13) + 7513 Simplify (sqrt(14)/(sqrt(21)/sqrt(3)))2 - ((sqrt(2) + -1)2 + 3). -4 + 2sqrt(2) Simplify 5(sqrt(7) + -2) + 0. -10 + 5sqrt(7) Simplify -5(sqrt(13)1 + sqrt(13))2. -20sqrt(13) Simplify (sqrt(11) + ((sqrt(11) + 1 + sqrt(11))2 - sqrt(11))*2)2. 26sqrt(11) + 206 Simplify (-2sqrt(56)/sqrt(2)1)2. 112 Simplify (-1 + sqrt(192))6 - ((sqrt(12) + 1)*2 + -2). -17 + 44sqrt(3) Simplify sqrt(2) + sqrt(2)-1 + 2 - ((sqrt(14)/(sqrt(7)-1))*2 + sqrt(2)). -sqrt(2) Simplify 3(-4 + sqrt(8) + sqrt(8) + 0 + 3). -3 + 12sqrt(2) Simplify sqrt(832)3 + -1. -1 + 24sqrt(13) Simplify (sqrt(84)/((sqrt(144) - (sqrt(144)1 + sqrt(144)) - sqrt(144))/sqrt(12)))*2. 7/4 Simplify (sqrt(171) + (sqrt(171) - (sqrt(171) + -52sqrt(171) + sqrt(171) - sqrt(171)) - sqrt(171)))/(3sqrt(9)2). 5sqrt(19)/3 Simplify 2sqrt(11)1 + 0 + sqrt(99) + 0. 5sqrt(11) Simplify 6(4sqrt(612) + 2 - sqrt(612)). 12 + 108sqrt(17) Simplify 2(sqrt(1216) - (-2sqrt(1216) + sqrt(1216) + sqrt(1216)))*2. 2432 Simplify -4 + 4(sqrt(13)2-2 - (sqrt(468) + 1 + sqrt(13))). -44sqrt(13) - 8 Simplify (sqrt(99) + -2 + sqrt(99) + (1 + sqrt(11))-6)*2 + -4. 60 Simplify 6(sqrt(39)/sqrt(3))2 + -3. 75 Simplify (-4 + 0 + sqrt(75) + sqrt(75))2 + 4(sqrt(75) + -1). -60sqrt(3) + 312 Simplify -2sqrt(448)6. -96sqrt(7) Simplify -1 + (-2sqrt(70)-3)/(sqrt(10) - (sqrt(10) - (sqrt(10) + sqrt(10) + (sqrt(40) + sqrt(40)1 - sqrt(40))))). -1 + 3sqrt(7)/2 Simplify (1 + sqrt(3))21 + sqrt(30)/sqrt(10)4. 4 + 6sqrt(3) Simplify sqrt(275)1 - -2sqrt(891). 23sqrt(11) Simplify -1(1sqrt(77) - sqrt(77))/sqrt(7). 0 Simplify sqrt(78)/(sqrt(6) - (6sqrt(486) + sqrt(6))). -sqrt(13)/54 Simplify ((sqrt(209)-3 - sqrt(209) - sqrt(209) - sqrt(209))5)/sqrt(11). -30sqrt(19) Simplify -4 + 5 + 1 + sqrt(7) + 3. sqrt(7) + 5 Simplify -2 + (-1 + sqrt(1100))2. -20sqrt(11) + 1099 Simplify ((1sqrt(132)/sqrt(4))/sqrt(11) + 3)2. 6sqrt(3) + 12 Simplify (4(sqrt(108) + -2))2. -384sqrt(3) + 1792 Simplify sqrt(768) + sqrt(3)-24 + -3. -3 + 8sqrt(3) Simplify ((sqrt(15) - sqrt(60))-6)/sqrt(3)6-3. -108sqrt(5) Simplify (sqrt(76)-45 + sqrt(76))/sqrt(4). -19sqrt(19) Simplify (-4sqrt(1176))/sqrt(8). -28sqrt(3) Simplify -2 + -4 + (sqrt(112) - (sqrt(112) - (3 + sqrt(112) + 0))). -3 + 4sqrt(7) Simplify -2 + (-5-1sqrt(9))/sqrt(3). -2 + 5sqrt(3) Simplify (sqrt(152)3 + sqrt(152))/sqrt(8)3. 12*sqrt(19) Simplify ((	{ "pile_set_name": "DM Mathematics" }
2 - q - 5. Let y be c(0). Let p(d) = d + 4. Let v(t) be the third derivative of -t4/12 - 3t3/2 - 5t*2. What is yp(o) - 2v(o)? -o - 2 Let b(f) = -f + 8. Let i(m) = 8 + 5 - 4 - m. What is 5b(z) - 4i(z)? -z + 4 Let f(w) = 13w*2 - 5w. Let s(r) = 84r2 - 32r. Let o = 4 - -28. What is of(b) - 5s(b)? -4b2 Let h(f) = 2f*3 - 5f*2 - 5f - 5. Let t(c) = -c*3 + 3c*2 + 3c + 3. Let x(s) = 6s + 27. Let w be x(-5). What is wh(l) - 5t(l)? -l3 Let f(i) = -5i*3 + 3i*2 - i + 5. Let v(z) = 6z*3 - 4z*2 + z - 6. Suppose 2s = -s - 12. Determine sf(o) - 3v(o). 2o3 + o - 2 Let j(r) = -4r*3 + 3r*2 + 2r + 1. Let u(x) = x3 + x2 + x + 1. Let l(z) = 19z3 - 3z*2 - z + 2. Let t(d) = l(d) - 6u(d). Calculate 7j(n) + 2t(n). -2n3 + 3n*2 - 1 Let u(d) = -d + 1. Suppose 3z = 2k - 5, -2k - 2z + 30 = -0k. Let j be -3 + 1k/(-2). Let g = 9 + j. Let s(l) = 2l - 3. What is gs(t) + 3u(t)? -t Let k(c) = -1. Let q(s) = -2s2 + 6 + 3s*2 + 4 - 3s*2. Give -10k(b) - q(b). 2b2 Let z(x) = 2x*2 - 4x. Let y be z(3). Let k(i) = 9 - 2 + 3i2 - yi - i3 + i2. Let a(t) = -t*3 + 3t*2 - 4t + 5. Calculate 7a(j) - 5k(j). -2j3 + j2 + 2j Let d(g) be the third derivative of -1/12g4 - 2g*2 + 0 + 0g + 1/3g3. Let j(i) = 3i - 3. Let o be 13/(-4) - 1/(-4). Determine oj(x) - 5d(x). x - 1 Let h(u) = u*3 - 17u - 2. Let c(s) = s*3 - 18s - 3. Determine -4c(w) + 5h(w). w*3 - 13w + 2 Let m(p) = p*2. Let r(d) = 2d*2. What is 5m(z) + 5r(z)? 15z*2 Let d(u) = -51u - 21. Let l(w) = 3 - w - 4w - 5. Determine 2d(q) - 21l(q). 3q Let g(x) = 26x. Let r(o) = -9o. Give 4g(a) + 11r(a). 5a Let b(h) = -2 - 2 - 9h*2 - 5 - 5h. Let v(z) = -4z2 - 2z - 4. Let f be (-7)/(-4) - 4/(-16). Suppose -5s - f + 37 = 0. Give sv(x) - 3b(x). -x2 + x - 1 Let l(o) = 3o + 3. Let p(u) = 4u + 4. Suppose -3g = 5j + g, j + 5g - 21 = 0. What is jp(q) + 5l(q)? -q - 1 Let o(g) = -g3 - g2. Let x(w) = 8w3 + 6w*2 + 77. What is 6o(f) + x(f)? 2f3 + 77 Let f(b) = 4b*2 - 7b - 7. Let h = 3 + 0. Suppose n + 8 = -r + h, -2n + 2r = 14. Let i(t) = t*2 - 2t - 2. Give nf(o) + 21i(o). -3o2 Let m(h) be the second derivative of h4/12 + h3/6 - h2/2 - 12h. Let z(j) = -4j2 - j + 1. Determine -3m(a) - z(a). a*2 - 2a + 2 Let r(x) = 11x2 + 6x + 5x - 11 - 32x*2. Let j(a) = -4a*2 + 2a - 2. Suppose 0k + 8k = 88. What is kj(c) - 2r(c)? -2c2 Let r(o) = -7o*2 - 26o - 2. Let g(h) = 6h2 + 25h + 2. Determine -5g(a) - 4r(a). -2a2 - 21a - 2 Let z(h) = 2h2 - 11h + 5. Let o(m) = 1. Give -5o(j) + z(j). 2j*2 - 11j Suppose -3j = -j - 18. Suppose 3d - 5x = -j, -d + 4x = 6 + 4. Let p(y) = 3y3 - 2y. Let l(b) = 7b3 - 5b. Determine dl(a) - 5p(a). -a*3 Let x(q) = 21q*2 + 11q + 1. Let i(u) = -4u2 - 2u. Determine 11i(t) + 2x(t). -2t2 + 2 Let d(i) = -4i*2 + 2i + i + 2i2. Let p(v) = v2 + 4v. Let j(q) = -q*2 - q. Let y(w) = 4j(w) + 2p(w). What is -4d(o) + 3y(o)? 2o2 Let q(r) be the third derivative of r4/24 - r*3/6 - 15r*2. Let z(l) = -4l*2 + 3l - 3. Calculate 3q(c) - z(c). 4c2 Let v(m) be the second derivative of m2 - m + 1/3m3 + 0. Let x(g) = 2g + 2. Calculate 6v(t) - 7x(t). -2t - 2 Let h(w) = -w3 + w2. Let v(r) = -8r*3 + 3r*2 + 5r - 4. Let u(i) = -i*3 + i - 1. Let f(q) = -4u(q) + v(q). What is f(k) - 3h(k)? -k3 + k Let m(a) be the third derivative of -a6/120 - a4/6 - 7a*2. Let g(v) = -3v*3 - 9v. Give 4g(d) - 9m(d). -3d3 Let b(f) = -f3 - f2 + f. Let s(p) = p3 + p2 - p. What is -7b(j) - 6s(j)? j3 + j2 - j Let o(v) be the second derivative of -v5/5 + 3v4/4 + v2/2 - 6v. Let d(n) = -n3 + 2n*2. Calculate -9d(c) + 2o(c). c3 + 2 Let t(b) = -b. Let h(a) = a - 1. Determine 4h(r) + 5t(r). -r - 4 Let c(i) = -2i - 9. Let a(s) = 3s + 19. Give 2a(p) + 5c(p). -4p - 7 Suppose 0p - 12 = -3p. Suppose p = 2c - 2. Suppose 0 = r - 5m - 6, 2r - 4m - 3 = 3. Let d(n) = 4n - 1. Let t(h) = -h + 1. What is ct(x) + rd(x)? x + 2 Let o(w) = -w. Suppose b = 4j, 0 = -2b + 5j - 0 - 3. Let u(g) = g*2 + 2g. Give bo(q) - u(q). -q2 + 2q Let s(h) = -2h3 - 4h*2 - 5h. Suppose -5u + 15 = 5w, -w - 34 = -4u - 2. Let k = -8 + u. Let x(r) = -r2 - r. What is ks(n) + 4x(n)? 2n3 + n Let b(m) = m2. Let t(a) = a + 2. Calculate -3b(z) - t(z). -3z2 - z - 2 Let b(q) = -q3 - 2q2 + 3q + 2. Let n(c) = -c*3 + 6c*2 - 13c + 1. Let r(x) = -3x2 + 6x. Let f(v) = -2n(v) - 5r(v). What is -3b(y) - 2f(y)? -y*3 - y - 2 Let c(m) = m + 1. Let t(k) = 2k + 6. Determine 2c(r) - 2t(r). -2r - 10 Let i(f) = 4f - 4. Let r(v) = -4v + 5. Calculate 6i(d) + 5r(d). 4d + 1 Let z(u) = 9u + 7. Let o(i) = 8i + 8. Calculate 4o(y) - 5z(y). -13y - 3 Let z(y) = 7y + 3. Let b(h) = -3h - 4. Suppose -2 = 3x + 10. Let m(n) = 11n + 17. Let g(w) = xm(w) - 18b(w). What is 5g(q) - 7z(q)? q - 1 Let c(b) = -3b*3 + 4b*2 + 6b + 2. Let a(i) = -i3 + i2 + i. Suppose -6m - 9 = -33. Let l(h) = h - 6. Let w be l(5). Give ma(r) + wc(r). -r3 - 2r - 2 Let z(r) = 33r2 + 3r. Let f(h) = 495h2 + 44h. Give -3f(k) + 44z(k). -33k2 Let b be (0 + -2)2/(-4). Let s(i) = -i*2 + i + 1. Let p(a) = 4a + 4. Let z(k) = -k - 1. Let o(u) = 2p(u) + 9z(u). What is bs(l) + o(l)? -l2 Let x(u) = 11u*3 + 2u + 2. Let d(g) = 144g3 + 27g + 27. Calculate 2d(w) - 27x(w). -9w3 Let p(h) = 5h*3 - 13h*2. Suppose -5b - 41 = -76. Let f(k) = -2k3 + 6k*2. Give bf(v) + 3p(v). v3 + 3v*2 Let v(c) = -9c*2 + 2c. Let a(b) = -b3 + b2 + b. What is 2a(d) - v(d)? -2d*3 + 11d*2 Let d(z) = 20z + 3. Let w(k) = 41k + 7. Calculate -9d(i) + 4w(i). -16i + 1 Let d(s) = 2s3 + 3s*2 - 2s - 4. Let w(c) = 6c3 + 10c*2 - 7c - 13. Calculate -7d(p) + 2w(p). -2p3 - p2 + 2 Let b(y) = -7y*3 + 5y*2 - y + 3. Let q = 18 - 13. Let h(u) be the first derivative of 11u*4/4 - 8u3/3 + u2 - 5u - 3. What is qh(n) + 8b(n)? -n3 + 2n - 1 Let v(y) = 13y2 - y - 1. Let u(p) = 6p*2 - p. Calculate 5u(j) - 2v(j). 4j*2 - 3j + 2 Let y(z) = -6z3 + 3z - 3. Let m(i) = 7i3 - 2i + 2. Calculate 6m(b) + 4y(b). 18b3 Let a(s) = 4s*3 - 3s*2 - s - 2. Let p = 2 - 1. Let m be -21 - (-5)/p. Let r(t) = 2 + 2t2 - t - 3t*m + 3t - t. Give 2a(u) + 3r(u). -u3 + u + 2 Let k(o) = -o3 + 1. Let z(i) = 5i3 - 17i*3 + 4i*2 + 3i*3 + 3 + 4i*3. Calculate -3k(w) + z(w). -2w3 + 4w*2 Let l(f) = -11f*3 - 13f*2 + 13f + 11. Let a(z) = 5z3 + 6z*2 - 6z - 5. Let q(k) = -k*3 - 9k*2 - k + 4. Let x be q(-9). What is xa(p) + 6l(p)? -p3 + 1 Let c(j) = 30j - 42. Let r(q) = 1. Calculate 3c(v) + 126r(v). 90v Let x = 3 - -14. Let y = x - 11. Let l(v) = 9v*2 - 7. Let u(b) = 4b*2 + 2b - 1. Let k(i) = i + 1. Let a(p) = 4k(p) - 2u(p). Determine yl(q) + 7a(q). -2q2 Suppose h - 2k = 2k + 9, 0 = -4k - 12. Let i(s) = 6s. Let l(w) = 3w. Determine hi(b) + 5l(b). -3b Let h(q) = 1. Let p(k) = -8k + 1. What is h(l) + p(l)? -8l + 2 Let y(g) = g - 1. Let m(i) be the third derivative of i4/4 - 2i3/3 + i2. Suppose -n = -3z + 5, 3n + 11 = z - 2n. Determine zm(q) - 5y(q). q + 1 Let o(d) be the second derivative of -1/2d*5 - 1/2d*2 + 0 - 11/12d*4 + d - 11/6d*3. Let m(c) = -2c*3 - 2c*2 - 2c. Give -11m(j) + 2o(j). 2j3 - 2 Let d(h) = 7h*3 + 2h*2 + 5. Let j(o) be the first derivative of -5o4/2 - o3 - 7o + 6. Determine 7d(f) + 5j(f). -f3 - f2 Suppose 2j - 3j = -14. Let q be 6/10 - j/(-10). Let d be 2/(q + -4 + 0). Let w(x) = -x + 1. Let r(i) = 5i - 5. What is dr(k) - 4w(k)? -k + 1 Let i(o) = 3o2 + 2o + 2. Let q(w) = 6w2 + 5w + 5. Calculate -7i(b) + 3q(b). -3b2 + b + 1 Let q(k) = -k2 + k - 1. Let d(t) = 4t*3 - 4t*2 + 4t - 4. Give -2d(o) + 8q(o). -8o3 Let d(n) = n3 - n + 1. Let b(s) = 2s*3 - 3s + 4. Calculate 2b(g) - 6d(g). -2g3 + 2 Suppose -3q - 72 = 6. Let m = q - -32. Let c(n) = 15n3 + 13n + 13. Let r(o) = -7o3 - 6o - 6. Give mc(i) + 13r(i). -i*3 Let w(z) = -4z - 2. Let i(p) = 5p + 1. Let c(s) = 11s + 2. Let b(q	{ "pile_set_name": "DM Mathematics" }
= -7s + 83. Let d be x(12). Put d, 2, 3, 1 in decreasing order. 3, 2, 1, d Let n = 2.5 + -2.1. Sort 1, 3, n. n, 1, 3 Let n = 0.1 - 0.5. Let l = 11 + -8.6. Let w = n + l. Put 1, w, -1/2 in decreasing order. w, 1, -1/2 Let o(q) = 7q + 3. Let w be o(-3). Let n = w - -11. Sort 5, -5, n in descending order. 5, -5, n Let u = -2 + 1. Let n(j) = j*3 + 8j*2 - 3. Let v be n(-8). Suppose 0b - 1 = 2b + 3x, 0 = 5b - 4x - 32. Put b, u, v in descending order. b, u, v Suppose 5m + 12 = 2m. Sort 0, -2, m in decreasing order. 0, -2, m Let m(k) = -k*2 + 7k - 5. Let z be m(6). Let d be 4/2 + -6 + 1. Let y be 2 - d/((-12)/10). Sort 0.1, y, z. y, 0.1, z Let p be (-15)/(-10) + 0 + (-6)/4. Let i = -16 - -11. Put -1, i, p in descending order. p, -1, i Let j = -6 + 5. Let q = -1396/7557 + 2/687. Sort -2/3, q, j. j, -2/3, q Let f(o) = o*3 + 3o*2 - 13o - 11. Let v be f(-5). Let n = 5 - 3. Sort n, v, -5 in ascending order. -5, n, v Let u = 50 - 49.04. Let s = 0.04 + u. Let r = -3 - s. Put 1, 3, r in decreasing order. 3, 1, r Let g(f) = -f*2 - f + 2. Let z be g(-4). Let v = z - -7. Sort -2, 3, v. v, -2, 3 Suppose 0 = -2m - 2, 2r + 5m = 5r + 10. Put r, 4, -4 in increasing order. r, -4, 4 Let k = 140.9 + -141. Sort -0.5, k, -2/11 in decreasing order. k, -2/11, -0.5 Let y be (-3)/(-9)(-12)/(-1). Suppose -5h - 5p = -5, 9 = h + yp - 1. Suppose 0 = 3u + 3m - 21, -4m + 7 = 3u - 18. Sort u, h, 2. h, 2, u Let s be -4(-3 - 228/(-80)). Sort s, -3, 0. -3, 0, s Let l(k) = 2k + 2k - 8k + 3k - 7. Let u be l(-3). Let x(s) = s*3 + 3s*2. Let b be x(-2). Put 2, u, b in increasing order. u, 2, b Suppose q = -3y + 1, 5y + 0q = -4q - 10. Suppose -16 = yl - 4. Let c = l + 4. Sort c, 4, 3 in descending order. 4, 3, c Let r = -0.01 + -2.99. Let y = 9 - 4. Sort 0.5, y, r in descending order. y, 0.5, r Let b = 21 + -25. Sort -4.2, b, 1/4 in descending order. 1/4, b, -4.2 Let d = -36 + 26. Let v = -9.5 - d. Let w = -1.97 + -0.03. Put 0, w, v in increasing order. w, 0, v Let a(h) = -h*3 - 8h*2 + 5. Let g be a(-8). Put -4, -2, g, 10 in increasing order. -4, -2, g, 10 Let t be -6 + 3 - 12/(-2) - 7. Sort t, 5, 0, 1 in increasing order. t, 0, 1, 5 Let l = -7 - -10. Suppose -3b + 0b = 4u + 15, -7 = u + 4b. Sort u, -2, l. u, -2, l Let p = 6.9 + 0.1. Let q = 3 - p. Let v = q - -4. Sort -4, v, 4 in decreasing order. 4, v, -4 Let o be 5((-2)/5 - -1). Let n be (-2)/(26/10 - 3). Suppose -og = -nc + 7c - 7, -2c = 2g - 6. Put -5, c, -2 in increasing order. -5, -2, c Let a be ((-6)/(-10))/(2 + -1). Suppose -2 = -2m + 4. Put m, a, -2 in descending order. m, a, -2 Let z be (-1 - 1)(-1)/(-6). Let b = 0.4 + 1.6. Sort z, -4/5, b in ascending order. -4/5, z, b Suppose 5 = v - 2. Let b = 10 - v. Put -2, b, 1 in increasing order. -2, 1, b Suppose 0 = 6s - 3s + 9. Sort s, 9, 3. s, 3, 9 Let d = 0.6 - 0.4. Let m = 1.2 - d. Let v = m + -0.7. Put v, -1, -5 in ascending order. -5, -1, v Let d = 1.8 - 2. Sort 3, -2/13, d. d, -2/13, 3 Suppose 0 = -3o - 22 + 7. Let i(s) = -s - 12. Let j be i(-9). Put -2, j, o in decreasing order. -2, j, o Let h = -10/3 + 53/15. Put 5, h, 4 in ascending order. h, 4, 5 Let o(n) = -n*3 + 8n*2 - 8n + 11. Let h be o(7). Sort h, -5, 5 in descending order. 5, h, -5 Suppose 0 = -4d + 8 - 0. Let m = d - -3. Let o = 408 + -413. Put m, -2, o in increasing order. o, -2, m Suppose 5w - 15 = -3m, 3w - 3m = -2w + 15. Let y be (1 + -2)w - 1. Sort 2, 0.3, y in decreasing order. 2, 0.3, y Let u(x) = x2 + 7x - 6. Let p be (-6)/(-9)(-12 - 0). Let i be u(p). Suppose -2h = 2f - 14, ih = 5h + f - 13. Put h, 2, -3 in ascending order. -3, 2, h Let k(p) = -3p*3 - 10p*2 - 2p - 1. Let b(h) = 4h3 + 10h*2 + 3h + 2. Let r(i) = 2b(i) + 3k(i). Let v be r(-10). Sort 4, 0, v in ascending order. 0, v, 4 Let q = 2.4 - -0.6. Let s = -0.013 - 0.487. Put 5, q, s in decreasing order. 5, q, s Let i = 18 + -14. Let q = 8.8 - 8. Let o = q + -0.3. Sort o, i, 2/9 in decreasing order. i, o, 2/9 Suppose 5h = 32 - 47. Let r = -3 + 6. Put 4, h, r in ascending order. h, r, 4 Let b(w) = w2 - 7w + 5. Let x be b(7). Put -8, x, 1/2 in ascending order. -8, 1/2, x Let w = -9.1 + -4.9. Sort -5, 4, w in decreasing order. 4, -5, w Let h(t) = t*2 + 8t + 6. Let l be h(-8). Let m be 7/(-28) + l/8. Sort m, -5, -0.1 in increasing order. -5, -0.1, m Let n = 5.4 - 0.3. Let v = n + -5. Let t = -0.2 - -0.1. Put v, t, -1/2 in decreasing order. v, t, -1/2 Let g(y) = -y*2 + 7y - 7. Let i be g(5). Suppose 4p = -6u + iu + 23, 3p = 3u + 12. Let z be (0 + 0)/(-3 - -2). Put p, z, 3 in ascending order. z, 3, p Let w = 19 - 18.6. Sort -3, 5, w. -3, w, 5 Let x(z) = z2 - 5z + 1. Let p be x(4). Suppose 6m = 3i + 7m - 4, -2i - 2m = 0. Sort i, p, -1 in decreasing order. i, -1, p Let d = -5 - -4.97. Sort d, -1/3, -4 in increasing order. -4, -1/3, d Let l be (9/(-15))/((-5)/25). Let p be -3 + l/(-9)-3. Sort 3, p, 1 in increasing order. p, 1, 3 Let i(q) = -2q3 - 3q*2 - q - 1. Let x be i(-2). Let g = -14 - -10. Let v = 8 - 4. Put x, g, v in ascending order. g, v, x Suppose a - 10 - 9 = 0. Suppose -5v - a = -k - 3k, 4k - v = 7. Let s = 3 - 4. Put s, k, 3/2 in increasing order. s, k, 3/2 Let q = 7.7 - 8. Let g(m) = m. Let f be g(2). Let s be 1/((-1)/f) - 0. Put s, -1, q in decreasing order. q, -1, s Let b = -10 + 15. Suppose -bq = -q + 48. Let a be (-15)/18q/(-45). Put 5, a, 2/19 in increasing order. a, 2/19, 5 Let q = 18 + -58/3. Sort 9, -2/13, q in descending order. 9, -2/13, q Let x = 0.8 + -0.3. Put 4, x, 0.1, 2/5 in increasing order. 0.1, 2/5, x, 4 Let t be (-2)/(-1) - (1 - 4). Let u(i) = 4i - 1. Let c be u(1). Sort t, -3, c in ascending order. -3, c, t Let c = -5 + 3. Let q be 4/(-6)6/(-4). Let j = -1 + q. Sort 1, c, j in increasing order. c, j, 1 Let w = 134.4 - 134. Sort -2, w, -3/4 in decreasing order. w, -3/4, -2 Suppose 0 = 2g + 3v + 3, 7v + 5 = -2g + 2v. Suppose -30r = -37r - 21. Put g, r, 2 in decreasing order. 2, g, r Let n be -2 + 3/(12/16). Put -3, 4, n, -5 in ascending order. -5, -3, n, 4 Let v = 2.1 - 1.1. Let f = v + 2. Sort f, -2/7, -0.1. -2/7, -0.1, f Let d(m) = 4m + 11. Let r be d(-4). Let a(j) = j + 1. Let c be a(5). Let f be 3/c + 2/(-3). Sort 0.4, f, r. r, f, 0.4 Suppose 5y - 11 = -w, -4 = 4w - y - 3y. Suppose 0 = -j + q - 1, 6j + 5q - 25 = j. Suppose j + 1 = u. Put -3, w, u in decreasing order. u, w, -3 Let s be -22(-3)/6 + 1. Let p = s - 7. Sort -5, p, 1 in descending order. p, 1, -5 Suppose 0 = -r + 3g + 8, 5g = -r - 2r - 18. Sort r, 2, -3 in descending order. 2, r, -3 Let u = 26 - 27. Sort 3, -4, 2, u in decreasing order. 3, 2, u, -4 Let t be (-1)/31-6. Suppose -2r - 5 = -3p, tr = -3p - 2r + 35. Suppose -4z - 5l = 21, z + 4l = -0l - 19. Put 0, p, z in ascending order. 0, z, p Suppose -m = f + 3f - 12, -2m = 4f - 16. Let h be (1/f)/(1/2). Let x(o) = o2 - 9o + 11. Let k be x(8). Sort h, k, 2 in decreasing order. k, 2, h Let o be (-1 + 6)(-4)/(-5). Suppose 0 = 9j + 4j + 52. Put j, o, 0 in descending order. o, 0, j Suppose 0 = -4u - 1 - 3. Let d be 0/3 - (3 + u). Put 3, -0.2, d in descending order. 3, -0.2, d Let u = 0.06 - -0.31. Let g = u + 0.03. Let j = -1.1 - -1. Put j, g, -1 in ascending order. -1, j, g Let p be 0/((-2)/(-3 + 1)). Put 2/5, 1/5, 5, p in decreasing order. 5, 2/5, 1/5, p Let q be 1/((-9)/(-6))9. Let p(x) = x - qx + 4x. Let y be p(4). Put 5, y, -1 in descending order. 5, -1, y Let x(d) = -13d + 10d + 4 + d. Let f be x(3). Let t be 86/18 + 2/9. Sort 0, t, f. f, 0, t Let w(x) = -x3 - 7x*2 - 2x - 8. Let l be w(-7). Suppose v + 0 = -l. Put v, 1, 3 in ascending order. v, 1, 3 Let r = 1 + 3. Let z = 19 - 20. Let s = z - 4. Put r, 0, s in decreasing order. r, 0, s Let m = 3/9392 - 361835/760752. Let o = m - 2/81. Sort 0, 0.1, o. o, 0, 0.1 Let b(f) = f + 1. Let d be b(5). Let t(m) be the second derivative of m5/20 - m4/2 + m*2/2 - 3m. Let j be t(d). Put -3, j, 0 in decreasing order. j, 0, -3 Let d be 2 - (-12)/18(-33)/10. Sort -2/3, 0.12, d, 2/3. -2/3, d, 0.12, 2/3 Suppose 0 = -2i + 11i + 36. Suppose 5f - 9 = 4h, -6 = 3h - 3. Sort -5, f, i in decreasing order. f, i, -5 Let o = 24 - 27. Put -4/3, 5, o in ascending order. o, -4/3, 5 Let v = 0.244 - 49.844. Let d =	{ "pile_set_name": "DM Mathematics" }
12-2. Let x(g) = kc(g) - 4q(g). Let s(b) = -3b. Calculate x(s(i)). -162i*2 Suppose 300k - 14 = 302k. Let q(m) = -17m*2 + 7m - 3. Let c(v) = -16v2 + 6v - 3. Let l(b) = kc(b) + 6q(b). Let g(r) = -2r2. Give g(l(y)). -200y*4 - 120y*2 - 18 Let x(n) be the first derivative of -9n*2 + 2n + 41490. Let v(b) = b*2 - b - 1. Let g(k) = 3k*2 - 5k - 5. Let i(m) = g(m) - 5v(m). Determine i(x(y)). -648y*2 + 144y - 8 Let b(v) = 817v - 2451v - 154 + 821v + 815v. Let a(z) = -7z2. Determine b(a(w)). -14w2 - 154 Let q(k) = -k2 + 357k. Let a(t) = 29t*2 - 6. Let s(h) = 34h*2 - 7. Let r(y) = -7a(y) + 6s(y). Determine r(q(o)). o4 - 714o*3 + 127449o*2 Let p(q) = -3q. Let k(l) = -l*2 + 26054867. Give k(p(a)). -9a*2 + 26054867 Let l(z) = 3z*2. Let f(b) = 79573b - 1. What is f(l(w))? 238719w2 - 1 Let m(v) = 35v*2. Let g(u) = -599710u*2. Give m(g(o)). 12587822943500o*4 Let v(x) be the third derivative of 31x*5/30 + 8x*2 - 2x - 90. Let f(p) = -11p. Give f(v(b)). -682b*2 Let o(t) = 8t*2. Let j(n) = 12n - 2. Let y(v) = 145v - 25. Let c(d) = 7d - 5. Let a be c(1). Let u(p) = ay(p) - 25j(p). Calculate u(o(s)). -80s2 Let h(u) = 2 - 56u - 2 + 121u - 69u. Let p(x) = -16x - 2. Give h(p(r)). 64r + 8 Let g(k) = -2k2. Let y(p) = 13p*2 - 6p - 2p + 5p2 + p2 + 3. Let u be y(5). Let b(j) = -438 - 5j + u. Calculate b(g(f)). 10f*2 Let n(d) be the second derivative of 2d*3 - 2 - 2d - 2d - 2 + d - d3. Let j(u) be the first derivative of -11u*2/2 + 2. What is n(j(s))? -66s Let q(p) be the third derivative of 2p + 35p*2 + 0p*3 + 1/5p*5 + 0p4 + 0. Let b(f) = -f2 - 3f + 3f. Determine b(q(i)). -144i4 Let u(i) = 830189i. Let p(q) = 10q2. What is u(p(d))? 8301890d*2 Suppose -6l + 198 = 186. Let i be ((-8)/(-20))/((-2)/(-10)). Let f(c) = 0ci + 6c*2 + 0c*l. Let g(v) = -6v. Calculate f(g(q)). 216q2 Let q(d) = 22d*2. Let z(v) be the first derivative of -1/6v*4 + 12v + 0v3 + 3 + 0v*2. Let o(r) be the first derivative of z(r). Determine o(q(h)). -968h4 Let d(f) = -f. Let h(r) = -r3 + 5r2 - r - 8. Let v be h(4). Suppose -t + v = -l, 5t + 0t + 5l = 0. Let i(k) = -777 + 777 - tk. Give d(i(c)). 2c Let y(b) = 500b. Let o(f) = 187f + 1. Give y(o(k)). 93500k + 500 Let v(t) be the first derivative of t4/24 + t2 - 32t - 50. Let u(f) be the second derivative of v(f). Let s(z) = z. What is u(s(w))? w Let f(q) = 482q. Let r(u) be the third derivative of -u4/12 + 2159u*2. What is f(r(k))? -964k Let t(d) be the third derivative of d*4/12 - 226d*2 - 4. Let n(q) = -q - 93. What is n(t(p))? -2p - 93 Let k(d) = -6189d2 + 3092d*2 + 3096d*2. Let z(c) = 10c - 77. Determine z(k(r)). -10r2 - 77 Let d(s) = 51s*2 - 27s. Let o(w) = -4w2 + 2w. Let t(x) = -2d(x) - 27o(x). Let m(k) = -89k2. Determine t(m(u)). 47526u*4 Let t(a) = 8a. Let n(v) = 38542646v2. Give n(t(m)). 2466729344m*2 Let t(g) = 2g. Let b(v) = v*2 + 9v + 36. Let z be b(-7). Let o(c) = -115c + 69 - 27 - z - 20. What is o(t(k))? -230k Let b(s) = -216s. Let p(f) = -74f*2 + 5f. Let i(r) = 826r2 - 56r. Let c(j) = 5i(j) + 56p(j). Give b(c(y)). 3024y2 Let x(u) = 52413u - 1. Let j(k) = -2k2. Give x(j(m)). -104826m2 - 1 Let o(v) be the second derivative of v5/12 - 2v3/3 - 2v. Let b(t) be the second derivative of o(t). Let c(j) = 2 + 9 + 57j - 11 - 58j. What is b(c(m))? -10m Let r be -10/(-2)(-89 - -90). Let y(x) be the second derivative of rx*3 + 0x*2 - 25/12x*4 + 0 - 15x. Let m(w) = w*2. Give m(y(b)). 625b*4 Suppose -2a = 6 - 18. Let r be -3 + (12 - -1) - 10/2. Let s(w) = r - w - 11 + a. Let q(o) = -21o2. What is s(q(d))? 21d*2 Let h = -17 - -58. Let x(i) = -41 + 3i*2 + h. Let d(w) = -12w + 11. Let b(g) = g - 1. Let y(p) = -22b(p) - 2d(p). Calculate y(x(z)). 6z2 Let f(p) be the first derivative of -p3/3 - 2823. Let u(c) = -18 - 5 - 9 - 2c. Calculate f(u(g)). -4g2 - 128g - 1024 Let i(m) = -3m. Let n(r) = -8641r - 306. Let a(d) = 1080d + 36. Let x(g) = -17a(g) - 2n(g). What is i(x(w))? 3234w Let a be 18(-65)/(-260). Let i(y) = 5 + 72ya - 6 + 2 + 0 + 1. Let x(m) = -m. Give x(i(d)). -72d*2 - 2 Let q(s) = -4s. Let n(j) = 1177j2 - 10j + 12. Let p(k) = 2356k2 - 17k + 20. Let b(w) = 5n(w) - 3p(w). Calculate b(q(z)). -18928z2 - 4z Let q = 187 - 189. Let z(t) = -3t + 4. Let n(y) = -8y + 10. Let v(l) = qn(l) + 5z(l). Let p(d) be the first derivative of -11d3/3 - 1. Give p(v(i)). -11i*2 Let h(r) = -72r. Let t(m) = -2m2 + 17407m - 5. Determine h(t(y)). 144y2 - 1253304y + 360 Let i(k) = -11k2 + 12k - 36. Let z(h) = -264h2 + 286h - 858. Let f(n) = 143i(n) - 6z(n). Let t(a) = -65a. Give f(t(b)). 46475b*2 Let r(k) = 6k. Let h(x) be the first derivative of 0x2 - 3 + 5/3x*3 + 0x. Calculate h(r(p)). 180p2 Let f(z) = 3z*2 - 207. Let p(w) = 431w*2 - 4. Determine f(p(n)). 557283n*4 - 10344n*2 - 159 Let d = -121 + 123. Let l(j) = -5j + 2j - 2j + dj. Let k(w) = 29w. Give l(k(y)). -87y Let y(w) = w. Let g(t) = 2t + 7. Let k = 90 + -109. Let l be g(k). Let x(q) = 2q. Let u(i) = -31i. Let d(o) = lx(o) - u(o). What is d(y(b))? -31b Let i(o) = 21o - 8. Let u(w) = -2185w + 836. Let g be 1/((21/(-14))/((-6)/(-2))). Let x(f) = gu(f) - 209i(f). Let z(l) = -5l2. Give x(z(h)). 95h2 Let d(o) be the third derivative of o5/30 + o*2. Let b(m) = 1399m. Let h(n) = -297n. Let c(j) = 2b(j) + 9h(j). Calculate c(d(k)). 250k*2 Let i(c) = 2588c*2 - 836c - 1. Let k(u) = 2u2. Calculate i(k(r)). 10352r*4 - 1672r*2 - 1 Let u(a) = 0a*2 - 25a*2 - 6a2. Let d(f) be the first derivative of -f2 + 11565. What is u(d(l))? -124l2 Let s be 26/16 - 75/(-200). Let v(u) = 4u - 5u - 2u + s + 6u - 13. Let k(a) = -a. Calculate k(v(m)). -3m + 11 Let j(k) = 760k + 755k + 757k - 3032k + 759k. Let y(z) = 1484z*2. Calculate y(j(s)). 1484s2 Let k(a) be the first derivative of -a5/60 - a*3/3 + 1. Let w(h) be the third derivative of k(h). Let v(i) = 14i - 5301777 + 5301777. Calculate w(v(y)). -28y Let r(k) be the first derivative of k2/2 + 1454. Let p(m) = 191m*2 + 16. Give r(p(t)). 191t*2 + 16 Let m(b) = 5b. Let g(u) = 199u2 + 63u*2 + 1397u*2. Determine m(g(t)). 8295t*2 Let f(m) = -2m*2. Let h(d) be the first derivative of -703d*2 + 2792. Give f(h(g)). -3953672g*2 Let x(t) = 6 + 53t - 14 - 30t + 8. Let z(u) = 120u*2 + 65. Let o(c) = 11c*2 + 6. Let v(q) = -65o(q) + 6z(q). Calculate x(v(b)). 115b*2 Let k(t) = 6t - 34529. Let h(n) = -n. What is k(h(s))? -6s - 34529 Let d(n) = 10n*2. Let b(t) be the first derivative of 36t*3 - 1006. Calculate d(b(g)). 116640g*4 Let i(b) = -29b + 1. Let a(z) = -3z + 51627. What is a(i(p))? 87p + 51624 Let j(n) = 182427757n. Let o(a) = -a. Determine j(o(g)). -182427757g Let c(y) = 2032501y + 6y*2 - 2032501y. Let o(q) = 620q2. What is o(c(k))? 22320k*4 Let k(j) = -8j + 306. Let f(a) = 82a2 + 77. Determine k(f(r)). -656r*2 - 310 Let x(u) = -3525868u. Let z(h) = 4h2. Determine z(x(w)). 49726980613696w*2 Let c(y) = 1324y. Let u(g) = 23741g + 23706g - 47449g. Give u(c(v)). -2648v Let y(l) = l. Let f(b) = -b2 - 199373. What is y(f(s))? -s2 - 199373 Let m(f) be the first derivative of 0f - 262 - 43/3f*3 + 0f*2. Let u(r) = 2r2 + 1 - 1 - r2. Determine u(m(d)). 1849d4 Let o(q) = -2. Let c(n) = 12n + 24. Let z(g) = c(g) + 12o(g). Suppose 4t = 2w - 8, 2t + 6 = 2. Let y(l) = wl - l + 0l + 0l. What is y(z(h))? -12h Let n(c) = 10c - 1. Let s(o) = -763o + 1. Let b(x) = n(x) + s(x). Let r(l) = -4l. Give b(r(t)). 3012t Let t(u) = 2 - 280u - 254u + 530u + 2. Let j(m) = m + 2m - 2m. Calculate t(j(v)). -4v + 4 Let b(d) = -8d. Let z(x) be the third derivative of 171x5/20 - x4/24 - 1229x2 + 2x. Give z(b(n)). 32832n2 + 8n Let o(j) = -876j + 2. Let q(u) be the first derivative of -u3 - 1397. Determine o(q(a)). 2628a*2 + 2 Let o(g) = -95g2. Let z(w) be the third derivative of w5/40 + 125w3/6 + 159w*2. Let k(v) be the first derivative of z(v). Calculate k(o(t)). -285t**2	{ "pile_set_name": "DM Mathematics" }
3l + 319. Calculate the remainder when x(7) is divided by f(7). 1 Let y(q) = q2 + q + 1. Let v be y(2). Suppose vj - 32 = 5j. Suppose 3l - j = 23. What is the remainder when l is divided by 4? 1 Suppose 0 = -4w + 5t - 16 + 79, -3w + t = -50. What is the remainder when 269 is divided by w? 14 Let t = -24 + 39. Suppose v - t = -4n, -5v - 5n + 8 = -82. What is the remainder when v is divided by (8/24)/(2/60)? 9 Let y = 99 - 49. What is the remainder when y is divided by 9? 5 Let u = -32 + 36. Suppose 7q - 66 = uq. What is the remainder when 84 is divided by q? 18 Suppose -5p + 795 = -5y, 3p + y - 489 = -2y. Let c = p - 97. Let d = -33 + c. Calculate the remainder when d is divided by 11. 9 Let u be -1 + 15 + (-8)/8. Let w = u + -3. What is the remainder when ((-3)/(-2))/((-3)/(-74)) is divided by w? 7 Suppose 0w + 84 = w. Suppose -3l + 186 = -3m, 2l = m + 39 + w. What is the remainder when l is divided by 16? 13 Let l = -121 + 165. What is the remainder when l is divided by 35? 9 Let t(a) = -3a + 3. Let d be t(-3). Suppose -d - 14 = -2r. Calculate the remainder when 88 is divided by r. 10 What is the remainder when 140 is divided by -9 + (90 - (2 + 2))? 63 Let x(w) = 24w + 129. What is the remainder when 24 is divided by x(-5)? 6 Let c = 51 - 55. What is the remainder when 36 is divided by c/(-6)(-285)/(-10)? 17 Let b be -4(-4 - (-4 - 25)). Let z = 151 + b. Suppose -p - 6 = -33. What is the remainder when z is divided by p? 24 Let k = 9 - -1. Let j be (5 + 3)/(-1 - -3). Calculate the remainder when 26 is divided by j/k + 387/45. 8 Suppose -2324s - 318 = -2330s. What is the remainder when 293 is divided by s? 28 Let z = 497 + -458. What is the remainder when z is divided by 15? 9 Let z be (57/(-15) - -3)/(8/(-20)). Suppose -4q - 5o - 10 = -5q, zo = 8. What is the remainder when 118 is divided by q? 28 Let f = 13 - 38. Let g = 44 + f. Suppose -67 = -2k + 3p, -5k - 3p = -8p - 170. Calculate the remainder when k is divided by g. 16 Let r be (-12)/(-16) - 362/(-8). Suppose 2t = -5k - 12 - 44, t - 2k = -r. Let h = -23 - t. Calculate the remainder when 56 is divided by h. 11 Let p = -51 + 111. Calculate the remainder when 84 is divided by (-13)/((-26)/p) - 1. 26 Let u(k) = k3 - 5k*2 - 6k. Let p be u(6). Suppose p = -4c + 8, f + 4c + 83 - 322 = 0. Calculate the remainder when f is divided by 39. 36 Suppose 2l = 4l + 6, q = -3l - 4. Suppose -3f + 5f - 84 = 4w, -qf + 154 = 4w. What is the remainder when 100 is divided by f? 32 Let a be 2(-3)/(-2) + -6. Let z be 3(-2)/a1. Suppose -17 = -zh + 57. What is the remainder when h is divided by 10? 7 Suppose 20 = 4f - 0f. Let i(z) = z*2 - 3 + 2z + 1 + 3. Calculate the remainder when i(-4) is divided by f. 4 Let a = 108 - 73. Calculate the remainder when a is divided by ((-8)/(-6))/((-22)/33)-6. 11 Suppose 17t - t - 1152 = 0. What is the remainder when 104 is divided by t? 32 Let b(l) = 2l3 + 7l*2 - 1. Calculate the remainder when -52(2 + (-44)/16) is divided by b(-3). 7 Let j(z) = 5z3 + z2 + 2. Let i be j(2). Let y = i + -31. Suppose 5h = -3c - 1, -13c + 5h = -10c - 49. What is the remainder when y is divided by c? 7 Suppose 137 = 5c + 4i, -2i - 116 = -5c + 3. Suppose 5y - 8y + 18 = 0. Suppose -4k - y = -42. Calculate the remainder when c is divided by k. 7 Suppose -q - 16 = -4a, -3a - 99 = 2q - 23. Let j = -15 - q. Calculate the remainder when j is divided by 7. 3 Suppose -10 = -2f + 4f. Let l(m) = m*3 + 4m*2 - 4m + 2. Let j be l(f). Let c(o) = -12o - 2. What is the remainder when c(j) is divided by 12? 10 Let s = 39 - 37. Suppose 3 = d, -x + sx + 5d - 35 = 0. What is the remainder when x is divided by 4? 0 Suppose -2d + 18 = -0d. Suppose 5n - 1 = d. Suppose -l = -nl + 4. What is the remainder when 15 is divided by l? 3 Let p = -105 + 172. What is the remainder when p is divided by 48? 19 Suppose 5n - 2d - 94 - 76 = 0, -4n = 4d - 164. What is the remainder when 199/3 - (-24)/n is divided by 17? 16 Let l(p) = -48p + 3. Let o be l(-3). Let c = o + -82. Calculate the remainder when c is divided by 17. 14 Suppose 3f - 4l - 8 = f, -f - 3l - 1 = 0. Let d(u) = -2 - 5 - 7 + u2 + 0u*f + 15u. Calculate the remainder when 7 is divided by d(-16). 1 Calculate the remainder when 6 + -7 + -3 - (-130 + -2) is divided by 13. 11 Let g be (1/4)/((-1)/(-20)). Let h(q) = -3q3 - 5q2 - q3 + 5q - gq*3 - 8 + 10q*3. Calculate the remainder when h(6) is divided by 12. 10 Calculate the remainder when 3(-11)/(-2)2 is divided by (2/(-5))/(80/(-2000)). 3 Let m be ((-12)/(-36))/(1 + 4/(-3)). Calculate the remainder when 23 is divided by m/3(-5 - 31). 11 Let k be 2/8 + (-57)/(-12). What is the remainder when 105/(-14)(-16)/k is divided by 7? 3 Suppose -51f + 2773 = 8f. What is the remainder when 796 is divided by f? 44 Suppose p + 39 = 2t, -2t + 3p + 33 = -0t. Suppose t + 9 = 5k - 2b, -2k + 31 = 3b. Calculate the remainder when 13 is divided by k. 5 Let o = 2 - 7. Let t = o + 36. What is the remainder when t is divided by 8? 7 Suppose 2y = 199 + 85. What is the remainder when y is divided by 48? 46 Let n(v) = 3v3 - 3v*2 - 4v + 1. Let p be n(3). Let q = 47 - p. Calculate the remainder when 57 is divided by q. 1 Let d = -88 + 92. Suppose -4h = -dp - p - 312, 0 = -4h + 4p + 312. What is the remainder when h is divided by 9? 6 Let r = 32 + -26. Suppose -r + 4 = 2g. Let o = g - -12. What is the remainder when 53 is divided by o? 9 Suppose -4q + 3 = s, -5 = -q + 2s + 7. Calculate the remainder when 42 is divided by q. 0 Let z(c) = -35c - 1. What is the remainder when z(-1) is divided by (12 - 5) + 13 - (-8)/(-4)? 16 Suppose -2h + m = -6, -6m = -m. Let l = -9 + h. What is the remainder when 51 is divided by (-110)/l + 2/(-6)? 15 Let s(v) = v*2 - 16v + 3. Let q be s(8). Let r = q + 102. Calculate the remainder when 162 is divided by r. 39 Let q = 1 + -65. What is the remainder when -1 + (q/(-4) - -3) is divided by 5? 3 Suppose -s + 4 = -4k - k, 2k - 5s = -20. What is the remainder when 2882/121 - ((-4)/22 - k) is divided by 7? 3 Let v be 10/3 - 8/(-12). Suppose -14 = -2o + 4t, 5o - 3t = v + 3. What is the remainder when 32 is divided by o(-27)/(-6)-2? 5 Let t = -825 - -862. Calculate the remainder when 327 is divided by t. 31 Let f = 56 + -41. Suppose -j = 4j - 145. What is the remainder when j is divided by f? 14 Let c be 31/(-2)8/(-4). Let j be 0 + c + 2/2. Let a = 73 - j. Calculate the remainder when a is divided by 21. 20 Suppose -2x = 2x - 8. Suppose -xv + 36 = 2. Let w(q) = q3 - q2 + q + 9. What is the remainder when v is divided by w(0)? 8 Suppose -d = -f + 17, -4f - 5d - 10 + 78 = 0. Suppose 0 = -5t + f + 8. Calculate the remainder when 30 is divided by t. 0 What is the remainder when (-534)/(-18) - -1 - (-4)/3 is divided by 18? 14 Let m(u) = -3u*3 + 17u*2 - 13u + 40. What is the remainder when 272 is divided by m(5)? 22 Suppose 895 - 1423 = -12o. What is the remainder when o is divided by 2? 0 Let m(p) = p3 - 12p*2 + 8p + 25. What is the remainder when m(12) is divided by 31? 28 Let u(f) = 2f3 + 16f*2 + 7f - 37. What is the remainder when 324 is divided by u(-6)? 64 Suppose -21g + 31g - 370 = 0. What is the remainder when g is divided by 12? 1 Let u be (2 - 5)/((-10)/8 + 1). Suppose 227 + 145 = um. Calculate the remainder when m is divided by 4. 3 Let p = 1266 + -1122. Calculate the remainder when p is divided by 21. 18 Calculate the remainder when 2((-575)/(-75))/(2/9) is divided by 10. 9 Calculate the remainder when 22 is divided by (-10)/55 + 68/11. 4 Let i = -29 - -40. Suppose 3p = 2x + 160, 0 = -p + 2x + 70 - 18. What is the remainder when p is divided by i? 10 Let u(f) = 86 - 134 + f3 + 70 + f. Calculate the remainder when 82 is divided by u(0). 16 Suppose -2m + 5m = 21. Let d be 4/(9/42(-4)/6). What is the remainder when (378/d)/(1/(-2)) is divided by m? 6 Let t(l) = 2l + 3. Let m be t(0). Suppose -4f - 33 = v - 302, 198 = mf + 2v. What is the remainder when f is divided by 18? 14 Let q be 3/6 + 468/8. Let f = 82 - q. Let u(b) = b*3 - 9b*2 + 6b + 12. Calculate the remainder when u(9) is divided by f. 20 Let u = -14	{ "pile_set_name": "DM Mathematics" }
/239. Suppose 2o = -2o + 16. Suppose 4x + 2l = -18, -9x + ox = l + 24. Which is the biggest value? (a) s (b) -3/2 (c) x a Suppose -3u + 2 = -1. Suppose 5n = -5s - 35, 2s + u + 5 = 0. Let i be (-105)/260 + (-1)/n. Which is the third biggest value? (a) -3 (b) -12 (c) i b Let n = 2.9 - 3. Suppose -w + 3b - 100 + 59 = 0, -3w + 2b - 53 = 0. What is the smallest value in 0.07, -5, n, w? w Let z = -0.1711 - -32.6111. Let p = -32 + z. Let o = 3.56 + p. What is the third smallest value in -0.1, o, -3? o Let f = -0.0061 - -0.3061. Let n = -33 + 33.05. Let r be (2/8)/((-27)/24). Which is the second biggest value? (a) 3/4 (b) f (c) n (d) r b Let h = 3.961 + 0.039. Let q = -386 + 393. Which is the second smallest value? (a) h (b) q (c) -1 a Let k(q) = 3q*2 - 217q - 372. Let o be k(74). What is the second biggest value in 1, -56, o, 4? 1 Let m = -0.24 + 0.74. Let f = -58.91 - -59. Let y = f + 0.11. What is the biggest value in 5, m, y? 5 Let s = 51.6 - 52. Let k = -1.1 - s. Let p = 202 + -205. Which is the second smallest value? (a) -4 (b) p (c) k (d) 2/7 b Let y = 482 + -591. Let i = -111 - y. Which is the fourth biggest value? (a) 0.2 (b) 1 (c) -2/7 (d) i d Let r = -143.11 + 143. Let l = -0.51 - r. Let y = 2/19 - 23/38. What is the second smallest value in y, 0.1, l, -3? y Let g = -1.2 + 2. Let l = g + -0.2. Let u = -4810 + 4811. What is the second smallest value in u, l, -4/9? l Let i = -2593 - -2595. Which is the fifth biggest value? (a) -2/7 (b) 1 (c) 4 (d) -4 (e) i d Let m = -70690 - -70694. Let j = 1.3 + -1. Let k = -0.1 - -0.1. Which is the third biggest value? (a) -1 (b) j (c) m (d) k d Let g be ((-8)/(-234)-3)/(((-56)/(-60))/(-7)). Which is the second smallest value? (a) 0.06 (b) 1/3 (c) g b Let d be 614/8. What is the smallest value in 25, d, -0.1, 1/2? -0.1 Let f = 0 - -2. Let h(t) = 3t + 25 + 25 - 56. Let p be h(1). Which is the third smallest value? (a) 4/3 (b) p (c) -0.2 (d) f a Let h = 27.8341 + 0.0659. Let l = h + -28.1. Which is the third biggest value? (a) l (b) 3 (c) 29 a Let s = -5.2 - -0.2. Let b = -1252.426 - -1244.426. What is the biggest value in s, b, 11? 11 Let g = -13/3 + 74/15. Let j = -18.72 - -18. Let i = j + -0.28. What is the smallest value in g, 3, i? i Let y = -8206 - -8205.5. Which is the third biggest value? (a) y (b) -368 (c) 1 b Let t = -292.4 + 292.9. Which is the third smallest value? (a) -2/7 (b) 0.1582 (c) t c Let q = 118 - 121. Let y be (3/2)/(3/(-6)) - q. Which is the fourth biggest value? (a) -4 (b) -2/9 (c) y (d) 1 a Let z = 2147 - 2171. What is the biggest value in -1, 2, 5, z? 5 Let q = -2038 - -2043. What is the biggest value in q, 3/7, -1, 48? 48 Let b = 0.018 - 1.138. Let l = b - -0.12. Suppose 8 = -4q, 4p - 3p + q + 2 = 0. What is the fourth biggest value in l, -0.3, p, -0.5? l Let r = 255948 - 16637018/65. Let l = -144821/13 + 11147. Let i = l + r. Which is the third smallest value? (a) 2 (b) 3 (c) i b Let i be (-6)/(-6 - (-10 - 10)). Which is the third smallest value? (a) 102 (b) i (c) -0.3 a Let x be ((-11)/(-44)24/18)/(-2). Let n = -15 - -33. Which is the fourth biggest value? (a) n (b) 2/7 (c) x (d) 5 c Let a = 15.7 - 27. Let j = -0.99 - 5.31. Let y = a - j. What is the third smallest value in y, -0.2, 2/9? 2/9 Let t = -2.28 + 2.2. Let j = -0.05 + -21.95. Let q = j + 26. Which is the second biggest value? (a) 1/4 (b) q (c) t (d) 0 a Let q be (-5)/(-8)-2 + 1. Let h = 7.39785 + -7.39785. Which is the smallest value? (a) 25 (b) q (c) 1 (d) h b Let f = 0.406 - 0.37. Let h = -3.464 - f. Let q = h - -3.4. Which is the smallest value? (a) 1/2 (b) q (c) 4 b Let g = 3380 - 3382. Which is the second smallest value? (a) -0.04 (b) 4 (c) g a Let y = 6.04 - 0.04. Let r = 1 - y. Let o = 15846/11 - 79208/55. Which is the second biggest value? (a) -0.1 (b) o (c) -0.5 (d) r a Let j = -358 + 358.2. Let v = 2.8 - 3. Let x = -99 + 99.4. Which is the fourth biggest value? (a) j (b) -2 (c) v (d) x b Let u be ((-2)/3)/((-12)/27). Let p = -589 - -732.5. Let o = p + -144. What is the biggest value in -4, 5, o, u? 5 Let x = 1804.3 + -1803.03. Which is the third smallest value? (a) 3/5 (b) 1 (c) -36 (d) x b Let v = -1094 + 632. Let o = -466 - v. Which is the second smallest value? (a) -16 (b) o (c) 0.4 b Let q = 71.2 + -71.777. Let l = -5.577 - q. What is the smallest value in l, 76, 3? l Let m = 4157.8 - 4158. What is the third smallest value in 1/3, -27, m, -1.9? m Let d be ((-130)/140 + (-16)/28)/12. What is the third biggest value in 3, -67, -0.2, d? -0.2 Let t = 0.68854 - -0.01146. What is the smallest value in t, -0.052, -3? -3 Let x = 47.5 - -1.5. Let n = -41.1 + x. Let p = n + -3.9. What is the third smallest value in p, -7, -0.1, 1? 1 Let m = 69 + -35. Let o = 37 - m. Let p = 91.2 - 91.2. What is the third biggest value in o, -1/4, p, -0.2? -0.2 Let y = -0.158244 + -0.041756. Let p be (2/5)/(6/5). What is the second biggest value in y, p, -0.1, 11? p Let z(c) = -121c - 5711. Let a be z(-47). What is the smallest value in a, 1/4, -2/5, -1, 5? a Let z = 20.39 + -16.39. Which is the third biggest value? (a) 0.5 (b) z (c) -1 (d) 2.3 a Let g = -149.70536 - -0.49236. Let s = -0.213 - g. Which is the biggest value? (a) -0.3 (b) 2 (c) s c Let j be ((-22)/(-33))/(39/(-13)). Which is the third biggest value? (a) j (b) 0.61 (c) 2/13 a Let w = 1026.2 - 942. Let d = -92 + w. Let k = d - -8. What is the third biggest value in k, 12, 5? k Let f(h) = -1111h - 4436. Let q be f(-4). Which is the second biggest value? (a) -2/23 (b) -2 (c) -3/8 (d) q a Let n = 640 + -645. Which is the third smallest value? (a) 2/13 (b) -0.5 (c) n (d) 3 a Let j = 8 + -11. Let n be (1/(-4) + 6/168)(-1624)/1392. Which is the third smallest value? (a) -0.1 (b) n (c) j b Let o be -2 + 12/(-78) + (-2604)/(-26). Let t be ((-14)/o)/((-1)/(-1)). Which is the third smallest value? (a) t (b) -3 (c) 0.038 c Let s = -182 + 234. Let z = 50 - s. Which is the second biggest value? (a) -0.14 (b) z (c) -4 b Let i = -9781/2 + 4891. Which is the fourth smallest value? (a) -3 (b) i (c) -7/3 (d) -5 b Let y = -6489.39 - -6466.39. Let s = -1.5 - -2. What is the smallest value in y, s, 0.1? y Let h = -216.2 - -145. Let t = 71 + h. Let r = -0.851 + -0.049. Which is the third smallest value? (a) 1/5 (b) -2 (c) r (d) t d Let g = 3592 - 46698/13. Which is the fourth smallest value? (a) -1/2 (b) -2 (c) 0.03 (d) g c Let t = 0.8156 + -0.5156. What is the third smallest value in t, 8, 21, 3/2? 8 Let n = -36.62 + 32.62. Which is the second biggest value? (a) 0.4 (b) n (c) -152 b Let v = 229626 - 229626.5. Let g = 2 - 2.05. Which is the third biggest value? (a) 3 (b) g (c) -37 (d) v d Let z = -21898 + 22238. What is the second smallest value in -5, z, 3/4, -0.3? -0.3 Let u be (-9)/(-27) + (-14)/24. Let d be (-6148)/2570 + 3 + 21/(-35). Let k = d + -528/1799. What is the smallest value in 0.1, -1, u, k? -1 Let u be ((-18 - 8) + 12)/24/(-126). What is the second biggest value in u, -3, 12, 5, 6? 6 Let q = 189 + -189.4. Let c = -28.55 - -0.55. Let k = 32 + c. What is the second smallest value in k, q, 0? 0 Let g = 0.189 - -125.811. Let l = g + -125.8. Which is the biggest value? (a) 0.5 (b) -4 (c) l a Let i be 1168/(-720) - (-4)/18. Let x = -2/5 - i. Suppose n + 4 = -1. Which is the smallest value? (a) n (b) x (c) -0.5 a Let q = 124/819 - -2/819. Let s = 4807 + -4812. Which is the smallest value? (a) -1/4 (b) q (c) -2/15 (d) s d Let t = 9336 + -9335.5. Which is the third biggest value? (a) 0.9 (b) 9 (c) 2/7 (d) -1 (e) t e Let x = 370 + -350. Suppose xh - 31 = 49. Which is the third smallest value? (a) h (b) 2/17 (c) 2/5 (d) -2 c Let f be 0 - (2 - (-104)/(-46)). Let j = -51.0341 - -50.0341. Which is the second smallest value? (a) -1/3 (b) j (c) f a Let k = -13 + 6. Let j = 1255 - 1254. What is the second biggest value in k, -9, -3, j? -3 Suppose 2u + 4t + 32 = 0, -39u + 41u = 2t + 4. Which is the fourth biggest value? (a) u (b) 177 (c) 1/8 (d) -1/2 a Let i = -0.21204 - -0.31204. Which is the biggest value? (a) -1/8 (b) i (c) 4 (d) 2.8 (e) 1 c Let l = -1.078 + 0.078. Let n = -409 - -409.5. W	{ "pile_set_name": "DM Mathematics" }
erms in -96c - 181406 + 181406. -96c Collect the terms in 1746x + 1335x - 604x. 2477x Collect the terms in 0 - 841i + 335i + 7. -506i + 7 Collect the terms in -1087k*2 - 35k*3 - 37k*3 + 147k*3 - 31k*3 - 43k3. k3 - 1087k2 Collect the terms in -77b*3 + 4b*3 - 9624b*2 + 9624b*2. -73b*3 Collect the terms in 243 + 265 - 991 + 230 + 4z + 7z + 253. 11z Collect the terms in 78t + 70t + 69t - 273t - 48 + 64t. 8t - 48 Collect the terms in 7 - 127715s - 7 + 127586s. -129s Collect the terms in -7 + 2039s + 7 - 6077s + 1995s + 2045s. 2s Collect the terms in 13j2 - 44395j - 63j2 + 44393j. -50j2 - 2j Collect the terms in 2114l + 59598l - 5555l. 56157l Collect the terms in -12 - 7 - 3488w - 36 + 55. -3488w Collect the terms in -31 - 7 - 249450m2 + 38. -249450m*2 Collect the terms in -39 + 5j - 658j - 59 + 98. -653j Collect the terms in 13275 - 5o3 + 17414 - 6473 + 4o3. -o3 + 24216 Collect the terms in 571922470k + k2 - 571922470k. k*2 Collect the terms in -22 - 28u + 8u - 31u - 253u + 116u. -188u - 22 Collect the terms in 315213j + 3 - 315213j - 8j*3. -8j*3 + 3 Collect the terms in 7v*2 - 4v*2 - v + v + 2v - 2824. 3v2 + 2v - 2824 Collect the terms in -3671540a + 1223844a + 1223848a + 1223848a - 10a3. -10a*3 Collect the terms in 392f*3 - 1188f*3 + 421f*3 + 405f*3. 30f*3 Collect the terms in 627081z*2 - 1254191z*2 + 627123z*2. 13z*2 Collect the terms in 672615x*3 + 14x - 672617x3 + 11x + 15 - 8x - 15 + 7x. -2x3 + 24x Collect the terms in 59c2 + 26c*3 + 479 - 238 - 241. 26c*3 + 59c*2 Collect the terms in 121y - 5y2 + 2y2 + y2 - 56y - 6997. -2y*2 + 65y - 6997 Collect the terms in -39 + 7o3 + 18o*2 + 80 + 41. 7o*3 + 18o*2 + 82 Collect the terms in 6 + 100l - 24l - 26l - 15l - 15l - 17l. 3l + 6 Collect the terms in -93j3 + 260j*3 - 113j*3 + j + 0j - j. 54j3 Collect the terms in 55i + 820 + 43i2 - 151i - 25i2 - 820 + 96i. 18i2 Collect the terms in 8j*2 + 17368 - 8j*2 + 2j*3 - 422. 2j*3 + 16946 Collect the terms in 190n + 24 - 296n + 7 + 165n. 59n + 31 Collect the terms in 17910b*3 + 17905b*3 - 53709b*3 + 17895b3. b3 Collect the terms in -3 - 4q2 + 6q*2 + 271q + 198q. 2q*2 + 469q - 3 Collect the terms in -4776b3 - 14821b*3 - 192b*3. -19789b*3 Collect the terms in -2t*2 - 201 - 250 + 728 - 301 - 156. -2t*2 - 180 Collect the terms in 47820x - 16075x - 16074x - 15678x. -7x Collect the terms in -3562704 + 3g + 1781320 - 3g + 1781384 + 3g2 - 2g2. g2 Collect the terms in -9q2 - 49 + q - q + 35q*2 - 32q*2 - 14q*2. -20q*2 - 49 Collect the terms in 25 - 5 + 2682r - 2575r. 107r + 20 Collect the terms in 391r + 278r - 39r2 + 45r*2. 6r*2 + 669r Collect the terms in -3554 + 1797 + 937v2 + 1757. 937v*2 Collect the terms in -2061250220 + 2061250220 + 675p. 675p Collect the terms in 7071v*2 - 528v - 14156v2 - 12 + 7081v*2. -4v*2 - 528v - 12 Collect the terms in 2q3 - 6q*3 + 3q*3 + 0q*3 - 3q*3 + 280. -4q*3 + 280 Collect the terms in 4572 + 4569 - 14961 + 5820 + 54h. 54h Collect the terms in -2120 - j + 1188 - 7332. -j - 8264 Collect the terms in -17220f*3 - 17210f*3 + 51646f*3 - 17220f*3. -4f*3 Collect the terms in 184 - 184 - 30206g*2 + 30692g*2. 486g*2 Collect the terms in -335j + 754j + j2 + 9j*2 - 13j*2 - 419j. -3j2 Collect the terms in 64239148o*3 + 2o - 2o + 0o. 64239148o3 Collect the terms in 27670496x - 13835219x - 13835192x. 85x Collect the terms in 299l - 48l - 551l + 58l2 + 300l + 43l2. 101l*2 Collect the terms in -1337210 + 2t*3 + 1337210 + 1894t*2. 2t*3 + 1894t*2 Collect the terms in 11t*3 - 305 - 308 - 308 + 49t*3 + 922. 60t*3 + 1 Collect the terms in 0n*2 - 6557 - n + 5n*2 + 3287 + 3270. 5n*2 - n Collect the terms in 4 - 299401s + 0 - 4. -299401s Collect the terms in a3 + 133a - 283a - 203a - 290a. a3 - 643a Collect the terms in 2102 - 10218 - 2t + 2101 + 2097 + 1818 + 2100. -2t Collect the terms in -235 + 8040s2 + 235. 8040s*2 Collect the terms in 9k*2 + 9k*2 + 13k*3 + 23k*2 - 41k2 - k3 - 4k3. 8k*3 Collect the terms in 243q - 53q - 53q - 63q - 34q - 54q. -14q Collect the terms in 88458f - 176927f - 17f3 + 88469f. -17f3 Collect the terms in -45 + 47 - 2971m*2 + 2728m*2. -243m*2 + 2 Collect the terms in -122v + 14v + 6v + 78v + 13v + 7v. -4v Collect the terms in 98h2 - 183h + 8h + 68h*2. 166h*2 - 175h Collect the terms in 4h2 + 3635h*3 - 4h*2 - 10753h*3 + 3682h*3 + 4320h*3. 884h*3 Collect the terms in -73d + 42d + 0d + 14d + 6d + 8d + 2d. -d Collect the terms in 4633858 - 2h - 4633858. -2h Collect the terms in 358543096d2 - 18d*3 - 358543096d*2 - 56d*3 + 75d3. d3 Collect the terms in 7x3 + 7382x + 230 - 7382x. 7x*3 + 230 Collect the terms in 116494o + 206847o - 514737o - 545145o. -736541o Collect the terms in 6703 + 2l + 6505 - 4318. 2l + 8890 Collect the terms in -3001548q + 6003225q - 3001676q. q Collect the terms in -1618r*2 + 816r*2 + 802r*2 - 4612r*3. -4612r*3 Collect the terms in -5r*3 - 5503 - 5532 - 5r3 + r3 + 11035 + 0r3. -9r*3 Collect the terms in 129621m*3 - 43131m*3 - 43146m*3 - 43036m*3. 308m*3 Collect the terms in -5051l + 2970196 - 20l3 + 5053l - 2970196. -20l3 + 2l Collect the terms in -593t2 + 9693t + 9887t - 19580t. -593t2 Collect the terms in 7277984c*2 - 3639026c*2 - 3638919c*2. 39c*2 Collect the terms in -t - 13513t*2 - 14103t*2 + 27620t*2. 4t2 - t Collect the terms in 2465 - z2 + 2437 - z*2 - 7365 + 2463. -2z*2 Collect the terms in 949 + 64733o*2 - 949. 64733o*2 Collect the terms in 17g + 3g3 - 24g + 7g - 3 + 25g*2 - 4g3. -g3 + 25g2 - 3 Collect the terms in -159703j*3 + 79915j*3 + 79792j*3. 4j*3 Collect the terms in 2m + 5m + 4476m*2 - 2243m*2 - 2236m*2 + 5m + 4m. -3m*2 + 16m Collect the terms in 652757g3 - 23g*2 + 12g*2 + 11g*2. 652757g*3 Collect the terms in 7193m + 12592m + 1 + 66436m. 86221m + 1 Collect the terms in -807b + 634b - 342b - 1277b - 304b. -2096b Collect the terms in -94 - 2w*2 + 38 + 130 + 161 + 73. -2w*2 + 308 Collect the terms in 11004i - 54953i - 56666i + 21435i. -79180i Collect the terms in -219802n + 5 - 6 + 109912n + 4 + 109870n - 3. -20n Collect the terms in -215 + 12l2 + 132 + 6l - 8l2 + 83. 4l*2 + 6l Collect the terms in -72a2 + 1886a*2 + 58a*2 + 5588a*2. 7460a*2 Collect the terms in 10 - 11 - 2978472353v*2 + 1 + 2978472357v*2. 4v*2 Collect the terms in -159q*2 + 20q + 16q + 20q + 121q - 177q. -159q2 Collect the terms in -262 + 6k - 477 - 312 - 8k2. -8k*2 + 6k - 1051 Collect the terms in -8790d2 + 3014d*2 + 59 + 2901d*2 + 3106d*2. 231d*2 + 59 Collect the terms in -4 + 284u + 17 - 8 - 469u + 23. -185u + 28 Collect the terms in -2058u2 - 2055u*2 + 8228u*2 - 113u*3 - 2060u*2 - 2055u*2. -113u*3 Collect the terms in -502y + 48y + 1145y - 678y. 13y Collect the terms in -2r2 - 168r + 457 - 170r - 171r + 509r. -2r*2 + 457 Collect the terms in -145v - 1379v + 1498v. -26v Collect the terms in 10019 - 5009 - 5010 - 13582o. -13582o Collect the terms in -5844 + 5842 + 130f*2 + 0f - 4f - 5f. 130f2 - 9f - 2 Collect the terms in 1159 + 391f + 2136 + 2f*2 - 472 - 391f. 2f2 + 2823 Collect the terms in 41215v + 70852v + 202657v + 145977v. 460701v Collect the terms in -33g2 + 129g*2 + 32 - 79 + 12 + 35. 96g*2 Collect the terms in -56k*3 + 0 + 3k*2 + 0 + 0 + 510k*3 + 227k*3. 681k*3 + 3k*2 Collect the terms in 3w*2 - 68 - 198w + 22w + 76. 3w*2 - 176w + 8 Collect the terms in 30922 - 30883 + 29y2 + 23y*2. 52y*2 + 39 Collect the terms in -250y*3 + 411y*2 - 197y*2 - 124y*3 - 214y*2 + 376y*3. 2y*3 Collect the terms in 3n*3 - 2n3 - 373443322 + 373443322 + n3. 2n3 Collect the terms in 249o*3 + 248o**3 + 25	{ "pile_set_name": "DM Mathematics" }
p2 Let b(p) = -3p. Let u(y) be the third derivative of -108y2 + 0y*4 - 1/6y*5 + 0 + 0y*3 + y. Determine u(b(q)). -90q*2 Let v(h) = -28h. Let k(j) = -5361 - 5341 + 10647 + 5j2. Give k(v(g)). 3920g*2 - 55 Let m(q) = 87q*2. Let t(a) = 3910325a. Give m(t(x)). 1330285819689375x2 Let r(x) be the second derivative of x4/6 - 4x*3/3 + x. Let m(n) be the second derivative of 0n*2 + 0n*3 - 1/12n*4 + 70n + 5. Determine r(m(i)). 2i4 + 8i2 Let k(f) = -f2. Let o(g) be the second derivative of g*5/60 - 4g*3/3 + 8g*2 + 58g. Let j(m) be the first derivative of o(m). What is j(k(c))? c*4 - 8 Let u(v) be the third derivative of -11v*5/60 - 8v*2 + 17. Let z(b) = -64b. Calculate u(z(m)). -45056m2 Let f(q) = -340q + 1. Let b(y) = 4y2 - y - 2. Let x(c) = 10c*2 - 3c - 6. Let h(z) = -3b(z) + x(z). Calculate f(h(w)). 680w*2 + 1 Let f(n) = -3n*2. Let y(w) = -75w*2 - 17w + 51. Let t(u) = -9u2 - 2u + 6. Let s(g) = -51t(g) + 6y(g). Calculate s(f(d)). 81d4 Let u(c) = 13. Let t(h) = h + 13. Let x(l) = t(l) - u(l). Let f(p) = -2p - 25. Give x(f(z)). -2z - 25 Let h(l) = 4l*2. Let g(w) = 13908809w. Give h(g(q)). 773819871193924q2 Let c(f) = 192f*2 + 2. Let k(s) = -19100s + 38206s + 2 - 2 - 19101s. What is c(k(m))? 4800m2 + 2 Let x(i) be the first derivative of 13i*3/3 - 4747. Let h(y) = 194y. Calculate x(h(j)). 489268j2 Let d(l) = l2. Let y(h) be the third derivative of -2657h*4/4 - 8350h*2. Determine d(y(g)). 254147364g*2 Let k = 338 - 287. Let t(v) = 58v - 17. Let h(a) = 7a - 2. Let i(u) = kh(u) - 6t(u). Let f(p) = 3p*2 - 3p + 3p. Determine f(i(w)). 243w*2 Let d(a) = 2a*2. Let r(n) = 7329n + 36. Let z(c) = 1832247c + 9006. Let m(u) = -1501r(u) + 6z(u). Give m(d(v)). -14694v*2 Let q(u) = -2u*2 + 11. Let n(w) = 12844w - 1. Determine q(n(c)). -329936672c2 + 51376c + 9 Suppose 7n - 20286 = -7n. Let b(s) = -73485s2 - 1449. Let p(c) = 203c*2 + 4. Let a(d) = np(d) + 4b(d). Let m(f) = f2. Calculate a(m(g)). 207g*4 Let z(x) = 3877x*2 - 24x - 1. Let v(m) = 36m2. Calculate z(v(a)). 5024592a*4 - 864a*2 - 1 Let w(n) = -15n*2. Let r(v) = -9v + 6. Suppose -1006 = -0x - x. Let c(i) = x + i - 1011 + 7i. Let h(d) = -6c(d) - 5r(d). What is h(w(k))? 45k2 Let t(p) = -301168p - 1. Let a(l) = 3l. Give t(a(m)). -903504m - 1 Let p(c) = -c*2. Let j(s) be the second derivative of 103s*4 - 10s - 39. What is j(p(u))? 1236u4 Let v(o) = 20648573o. Let u(l) = 3l. Determine u(v(g)). 61945719g Let t(z) be the third derivative of -z*4/12 - 2z*2. Let u(k) be the third derivative of 47k*4/8 - 1436k*2 - 3k. Determine t(u(b)). -282b Let y(z) = 2z. Let q(l) = 9l. Let s(a) = -2q(a) + 10y(a). Let i(n) = 8n + n - 9n + 29n*2. Give i(s(j)). 116j2 Let t(d) be the second derivative of -d4/12 + 9d2 + 31d. Let u(k) be the first derivative of t(k). Let s(w) = -20 + 4w + 16 - w. Calculate s(u(c)). -6c - 4 Let y(b) = -7949000b + 11. Let k(a) = -a2. What is y(k(l))? 7949000l*2 + 11 Let u(g) = -2g*2 + 8g - 6. Let s be u(4). Let p(y) = -13y - 25. Let c be p(s). Let k(v) = -62v - cv + 120v. Let m(w) = -9w. Give k(m(o)). -45o Let n(s) = 29s - 10s + 2108473 - 2108473. Let i(g) = -7g + 9 - 9. Determine i(n(r)). -133r Let o(s) be the first derivative of 6 + 0s + 0s*2 - 1/3s*3. Let w(k) = 11k*2 + 3. Calculate o(w(t)). -121t*4 - 66t*2 - 9 Let a(v) be the first derivative of -1638v*2 + 328. Let s(r) = 3r. Determine a(s(g)). -9828g Let l(p) = 3p + 1. Let u be 39/4551211(0 - -25). Let j(k) = -2k - 2595 + u. Give l(j(h)). -6h + 1 Let i(w) = 22w. Let k(o) = -141052o*2. Calculate i(k(g)). -3103144g*2 Let u(x) = 147817x. Let k(o) = -35o. What is u(k(s))? -5173595s Let r(f) = 15f2 - f - 6. Let s(b) = 60b*2 - 4b - 26. Let d(n) = 26r(n) - 6s(n). Let c(y) be the second derivative of y*4/4 + 52y - 2. What is d(c(l))? 270l4 - 6l*2 Let y(q) = -12367340q. Let i(h) = -h. Calculate y(i(n)). 12367340n Suppose -7t = -9 - 5. Let l(f) be the first derivative of -2ft - 4f - 13f + 17f + 12. Let x(m) = -2m2. Give x(l(r)). -32r*2 Let x = -46 + 48. Let m(y) = 48y - 2yx - 48y - 2y2. Let w(s) = 2s*2 - s. Let k(t) = -17t*2 + 6t. Let i(a) = -k(a) - 6w(a). Calculate m(i(h)). -100h*4 Let s(c) = -7c - 10. Let d(y) = 29y + 22y - 82y + 28y - 4. Let n(a) = 5d(a) - 2s(a). Let g(q) = -416q2. Give n(g(f)). 416f2 Let w(m) be the third derivative of -m4/24 + 6m2. Let k(q) = 25q*2 + 6q. Let s(f) = -49f2 - 15f. Let x(y) = -15k(y) - 6s(y). What is x(w(l))? -81l2 Let p(i) = 3i*2 - 5i. Suppose -11z - 39z + 250 = 0. Let s(u) = 172 - 83 - 89 + zu2. Calculate s(p(a)). 45a*4 - 150a*3 + 125a*2 Let x(m) be the second derivative of 2m*3 - 38m + 5. Let f(r) = 37r2. Determine x(f(h)). 444h*2 Let t(i) = 11i. Suppose 140 = 12l - 160. Let g(b) = -45b. Let d(f) = lt(f) + 6g(f). Let r(q) = -31q. Give r(d(s)). -155s Let r(c) = -39247c2 - 2c - 18. Let p(u) = 39u2. Calculate r(p(y)). -59694687y*4 - 78y2 - 18 Let o(a) be the third derivative of a6/90 - 13a4/12 - 3a*2. Let x(s) be the second derivative of o(s). Let z(q) = 9q. Give z(x(d)). 72d Let q(h) = -h2. Let o be 13 + 26/39 + (-2)/(-6). Let u be 51/119 - (-92)/o. Let p(f) = -240 - uf + 240. Determine q(p(c)). -49c2 Let y(c) = -2c + 386. Let d(n) = -162n2 + 31 + 164n*2 - 31. What is d(y(a))? 8a*2 - 3088a + 297992 Let a(f) be the first derivative of f*2/2 - 10134. Let p(m) = 159m + 25. Determine p(a(j)). 159j + 25 Suppose 6r = 2n + 3r - 3, 0 = n + 4r + 4. Let u(b) = 0 - b + n. Let a(t) = -98t*2 + 119t*2 - 31t*2. Determine a(u(h)). -10h*2 Let z(f) = -25f*2. Let s(t) = 39t*2 + 47t*2 - 124t*2 + 29t*2. What is s(z(c))? -5625c*4 Let y(d) = 2. Let u(s) = s - 7. Let g(z) = -2u(z) - 7y(z). Let q(p) = 9p*2 - 2p*2 - 5p2 + p2. What is q(g(a))? 12a2 Let q(u) = -8u*2. Let a(n) be the second derivative of -2n*3 - 51n - 4. Determine q(a(t)). -1152t2 Let w(k) = 20k*2. Let r(i) = 10i + 50818. What is r(w(b))? 200b2 + 50818 Let z(l) = -l2 + 2l - 2. Let q be (77/(-21) + 4)-3. Let f(g) = g2 - g + 1. Let w(n) = qz(n) - 2f(n). Let c(b) = -2b*2. What is c(w(d))? -2d*4 Let c(k) = -229k2. Let f(i) = -i2 + 4i + 82. Calculate f(c(u)). -52441u*4 - 916u*2 + 82 Let b(w) = 9w. Let m(z) = -1 - 36z + 1 + 63z - 130z. Determine b(m(s)). -927s Let j(p) = -24218p2. Let r(o) = 9o + 1. Calculate r(j(l)). -217962l2 + 1 Let x(m) = -4m - 3m - 7 - 2m + 10m. Let s(c) be the third derivative of c4/8 + 52c*2. Determine x(s(z)). 3z - 7 Let w(z) = -89z + 7. Let s(x) = -619x. Give s(w(n)). 55091n - 4333 Let d(x) be the second derivative of -190x*3/3 + x - 71. Let p(j) = -3j*2. What is p(d(o))? -433200o*2 Let p(g) = -4g + 550. Let s(u) = 1120u2. Determine p(s(o)). -4480o*2 + 550 Let m(r) = 233r. Let j(w) be the third derivative of -7w4/8 + 558w*2. Calculate j(m(h)). -4893h Let y(s) = -189s. Suppose 4v = 2o - 28, 12o = 7o + 10. Let r(u) = -11u - 6. Let l(t) = 13t + 7. Let k(z) = vl(z) - 7r(z). Give y(k(g)). 189g Let x(m) = m + 45386m2 - m - 45237m*2. Let v(k) = 28k*2. Determine v(x(t)). 621628t*4 Let t(w) = -31w - 221414. Let x(s) = 18s. What is x(t(l))? -558l - 3985452 Let s(w) = -141w. Let v(d) = -9d*2 - 8d + 32. Let j(b) = 10b2 + 9b - 36. Let c(o) = -8j(o) - 9v(o). Calculate c(s(t)). 19881t2 Let r(q) = 511q. Let b(l) be the third derivative of l*5/20 - 2175l*2. Determine b(r(y)). 783363y*2 Let x(d) = 7200725d*2. Let g(i) = -5i*2. Give x(g(h)). 180018125h4 Let m(t) be the third derivative of -t5/60 - 2t2. Let g(v) be the third derivative of v5/20 + 95v*4/24 - 5v*2 - 12. What is m(g(l))? -9l*4 - 570l*3 - 9025l*2 Let j(z) = 2z*2. Let i(b) = 166b*2 - 69b + 62. Determine i(j(k)). 664k4 - 138k*2 + 62 Let p(s) = -54929686s. Let q(x) = -2x2. Give q(p(v)). -6034540808117192v*2 Let c(s) be the third derivative of 5s*4/12 - 19s*3/2 + 1709s*2. Let h(y) = -2y. What is h(c(d))? -20d + 114 Let a(h) = 605h -	{ "pile_set_name": "DM Mathematics" }
/(152/64)? 86/5 Evaluate (-68)/(19040/630)(8/(-10))/((-2232)/(-120)). 3/31 (828/(-552))/((-2)/((-60)/99)) -5/11 Calculate (224/230430)/((-5)/(-15)-5). -7/4 Evaluate (4/((-88)/935))/(((-8500)/(-102))/25). -51/4 64(-41)/(-492000)(-10)/(2/1) -2/75 Evaluate 26091/57980(-16)/18. -2/5 Calculate ((-144)/(-40))/((-31)/(6510/441)). -12/7 (10629/(-3543))/(3/(-93)) 93 What is ((-990)/30)/33-61? 61 Calculate ((160/75)/(-8))/(-10(-24)/(-600)). 2/3 What is (6/(-8))/(((350/126)/25)/((-24)/(-9)))? -18 What is (-42419/236)/(-13/(-6))? -82 Evaluate (-26)/((-12324)/(-632)4/39). -13 What is ((-4)/34)/(2334/19839)-69? 69 Calculate -4(-158)/(-1896)4/((-32)/6). 1/4 3/(((-6)/(-2016)-3)/((-10)/105)) 32 ((-6)/27)/((-526)/(-4734)) -2 What is ((-648)/405)/(56/(-40)2/(-1))? -4/7 Evaluate ((-48)/(-42))/8-566/30. -11/7 Evaluate 10/824704/(-19300)(-1)/(-2). -4/5 Evaluate (28352/(-8064))/(-121/(-6)). -11/3 Evaluate ((((-42)/7)/(-36))/((-16)/(64/(-18))))/(-1). -1/27 What is the value of (10/25)/((-3)/(-120))(-4)/((-32)/20)? 40 What is (1/633)/((-5)/2)(-8280)/(-552)? -33 What is the value of (-7)/(-14)6(-21)/((-1071)/(-34))-13? 26 435/(-1914)(-312)/52 15/11 Evaluate 2/(10/(-6)204/5950). -35 What is 1/1(-12)/1032-4364/2? 16 What is the value of (((-96)/9)/8)/(992/36456)? -49 Evaluate (-45)/18-415/(-36)-6. 25 Calculate (-1)/1(-19810)/16980. 7/6 Evaluate -2(-55)/(-1056)(-45)/(-300). -1/64 15/(-18)69/1104(936/30)/(-13) 1/8 What is -66(12(-32)/96)/(-12)(-3)/(-2)? -33 What is (-2)/4(36/(-210))/((-624)/1560)? -3/14 Calculate 96/(-10)(-17730)/(-28368). -6 1956/195625/1 25 What is the value of 15928/(-724)(-6)/(-32)64? -99 What is the value of (-1152)/(-156)(-715)/110? -48 What is (59796/88)/((-16)/12836)? -151 What is 15/(11/(594/135))? 6 What is ((2000/225)/(-40)12/(-8)-1)/10? -1/30 Calculate ((2/(-2)2)/((-4)/(-44)))/((-76)/(-38)). -11 Calculate 1424/132-11(-10)/(-7). -40 What is ((2/4)/((-7)/(-28)))/(-2441/4428)? -9 ((-10010)/(-2002))/(75/6) 2/5 ((56144/4444)/(-58))/(-11) 2/101 What is the value of ((-136)/51(-96)/64)/((-4)/(-45))? 45 Evaluate ((-180)/108)/((-1550)/(-5890)). -19/3 Evaluate ((-92)/6)/(-18(-49)/(-1323)). 23 Evaluate ((-6)/4((-7080)/(-9090))/(-59))/(-1). -2/101 ((-10)/(-15))/(40/45)420/(-252) -5/4 What is (-2)/((4(-220)/(-320)1)/(-3))? 24/11 Evaluate (((-52)/(-6))/(357/153))/(4(-8)/448). -52 What is the value of 19432/215140(-15)/21? -2/31 (9/(-6))/(((-250)/(-1400))/((-160)/(-24))) -56 Evaluate ((-1816)/1135)/(8/(160/(-6))). 16/3 What is ((-14)/112(-30)/(-35))/((-2790)/61845)? 19/8 Evaluate 23/(-23)(-8)/20((-10175)/(-10))/(-11). -37 (-2)/(-9)3((-696)/29)/(6/(-3)) 8 ((-2169728)/670)/(-92)15/(-12) -44 What is 54/(-6840)-1084/(-7)? -18/19 What is the value of (336/672)/((2/(-2))/(((-28)/16)/(-7)))? -1/8 What is 2/(-30)-306305/366? 17 What is 56/44896/(-80)-10? 3/2 What is (321/320)/(-510/375)? -3/4 (45/18)/(2655/(-36108)) -34 What is the value of (-8546)/213652/(-2)(-15)/(-279)-3? -2/31 What is the value of (-2839/(-7280))/((-45)/(-1150))? 23/6 Evaluate (11/2)/(105/3010)3. 43 What is (-101)/((-8181)/3564)2/(-8)? -11 Calculate 2/(-6)(-162)/(-1485)15. -2/11 What is the value of 19/(285/(-15))(-7260)/(-165)? -44 Evaluate ((-2704)/(-2366))/((-54)/5681). -4/27 Evaluate (28/1)/(3392/1272)(-6)/1816. -56 Evaluate ((53136/(-180))/82)/(4/1(-2)/220). 99 Evaluate (66/539)/((540/(-70))/(-6)). 2/21 What is the value of 32/(-80)(28175/(-46))/7? 35 What is ((-4936)/(-39488))/((-1)/2722)? -17 3/(16/(2464/42)) 11 Calculate (3410030/80236)/(((-15)/6)/(-5)). 85 What is ((-77)/((-8855)/(-138)))/(((-2352)/(-5))/(-21))? 3/56 -2918/1566025 -5/6 (904/3955)/(6/(-15)) -4/7 Evaluate (-318)/(-53)(-58)/2349. -4/27 What is ((2/11)/(376/7238))/((-3)/(1692/(-21)))? 94 Calculate (174432/239844)/((-4)/(-33)). 6 (8/(-52))/(-1122/726) 6/13 What is (-2002)/54699/(-21417)? 1/59 Calculate (24/(-96))/((2(-7)/28)/13). 13/2 Calculate (7437/74)/(-67)(-4)/8764. 2/73 What is (6/155)/(144/(-10560)22)? -4/31 What is (-200)/15048/1288/6? -2/3 What is 4(2419/(-1558))/(-59)? 2/19 What is (8/126)/(60/(-45))154/(-4)? 11/6 Calculate ((507/(-71825))/(6/(-10)))/(1/604). 3/17 (((-18)/6)/84)/((-370)/(-2960)) -2/7 What is the value of (-128)/(1344/(-42))((-36)/(-112))/9? 1/7 What is the value of (1/((-18)/(-6)))/(-62(-48)/339264)? 38 Calculate 54/(-2610)5/(-6). 1/58 ((-50)/95)/(77/209) -10/7 (-942084)/(-23790)15/(-18) -33 Calculate (-108)/(-18216)(-13202)/(-287). 3/11 What is 1/(-6)(-9696720)/14692? 110 ((-84)/5)/(9/((-17)/(119/21))) 28/5 What is (((-126)/(-21))/(18/(-4)))/(368/(-69))236? 59 (3/3-1)/(55790/(-3985)) 1/14 What is the value of 11/163714/(-6314)? -111 What is (-140)/185112/(-1136)? 35 (-3)/(8/(-14)(-46)/((-828)/(-315))) -3/10 What is ((-41)/(-328))/((-6)/384)? -8 Calculate ((-10)/45)/(28085/1845). -2/137 What is the value of ((-97)/(-6))/(540/(-3240))? -97 What is the value of ((-26)/((-3432)/(-36)))/(6(-4)/(-16))? -2/11 ((-6930)/5460(-221)/374)/((-6)/(-776)) 97 Calculate -8-32(-78)/6656. -3 What is ((-3)/180)/((-2)/(-14)14)? 0 What is 6/(108/150)(-144)/120? -10 What is 578/(-1260)16/(-52)? 2/21 Calculate ((-1062)/(-6195))/(13/130). 12/7 What is the value of ((-54)/8)/((-3)/(-6))(-21296)/3993? 72 What is 101102/950(-45)/18? -29 Evaluate 29(45504/2291)/(-24). -24 What is the value of (((-870)/580)/((-24)/1568))/(-2)? -49 What is the value of ((3/(66/1595))/10)/((-1)/4)? -29 What is ((-3081)/474)/(1/(-4))? 26 Evaluate ((-8)/45)/((-13725)/274500). 32/9 What is (-17)/(((-1530)/(-2160))/((-6)/24))? 6 Evaluate (2/(-11))/(312/((-1872)/(-48))). -1/44 Calculate (3/(-5))/(144/(-2280))31/(2325/30). 19/5 ((-1578)/(-28930))/((-2)/((-60)/(-3))) -6/11 (4347/1725)/((-35)/(-75)) 27/5 Evaluate (-2830)/283(-11)/(-22). -5 What is the value of (-1578/(-936))/(-511/(-8))? 2/11 8438/4219-34/(-18)150/8 25 What is (-638)/1113/(-26)? 29 Evaluate (-13)/(-585)2/3216/80. 1/25 Evaluate (22960/(-738))/562/(-10). 1/9 What is the value of ((-187)/(944350/(-200)))/(-2)? -2/101 What is the value of 144/((-62)/(-589)-38)? -36 What is (6/(26/((-182)/(-441))))/(-2020/(-56))? 1/75 What is the value of ((-32)/72(-162)/(-36))/3360/4? -60 What is (80/(-24)23/230)/(3/(-459))? 51 ((-8)/(-60))/(17/4539)45/18-1 -89 What is the value of ((-22470)/1284)/(25/(-10))? 7 What is (18/8)/(2/36812/(-2))? -69 What is 164706/(-1132)26/39? -97 What is the value of ((-45)/(-25)28/6)/(2535/(-16900))? -56 What is the value of 168/(-1218)-638(-2)/(-20)? 44/5 What is (-48)/(-2)(-56)/(-420)(-324)/432? -12/5 What is the value of ((1596/(-1463))/6)/((-1)/253)? 46 Calculate (4/368)/(((-51)/(-765))/(16/20)). 3/23 Evaluate 3/363-482/16605-15. 2/27 What is the value of 32/112-14(-34)/(-51)? -8/3 What is -26((-70)/(-12))/((4095/189)/(-13))? 91 What is 26/1((-1275)/34)/25? -39 (-72)/(-96)160/(-180)(-60)/(-35) -8/7 Evaluate (-2)/12(-45)/102320/((-986)/(-17)). 30 (((-28)/144)/(1029/(-441)))/((-1)/4) -1/3 What is the value of ((-9)/15)/(392/392)1/2710? -2/9 Calculate -32123/(-656)(-44)/93. -88 What is (-1265)/17719/(-15)8/12? 2/7 Calculate 79/4424-16(-7)/(-13)2/(-4). 1/13 Calculate (-15)/242/((-35)/84120/(-225)). -45/8 What is the value of (153/(-782))/((-165)/(-110))? -3/23 ((3/(-12))/((-111)/18))/(-4390/7740) -3/37 What is the value of 10(-36)/8836/(-1800)10? 9/11 Evaluate ((-490)/21)/10((-1872)/(-26))/24. -7 What is the value of (-444)/1853/9916/(-48)15? 4/11 ((-136)/28)/(16/(-63)783/2088) 51 What is the value of 378/33611520/270? 48 What is 2/4117/((-272)/(-1184))? 37 What is the value of ((-1)/8)/(100409/(-19592))? 1/41 Evaluate ((-21)/147)/((-240)/(-168)). -1/10 Calculate (-1918)/411(-15)/(-21)6. -20 What is the value of -1(-406)/29142/(-28)? -71 (-14)/623-121/(-252)6 -1/89 What is (863/(-36246)20/(-2))/(10/18)? 3/7 Calculate (7/(28/(-2))8/12)/((-76)/(-494)). -13/6 Calculate (((-126)/1701)/((-24)/162))/((-3)/27). -9/2 1528/(-700)26/27-3 4/5 What is the value of ((-145)/(-87))/(19475/285)? 1/41 Evaluate ((5/80)/((-42)/(-84)))/(7/((-14)/4)). -1/16 Calculate (-1)/((-5)/6)181160/(-9058). -24 What is ((-8)/22)/(387/(510840/(-480)))? 22 (1792/48)/(252/216) 32 Evaluate -225*(-9	{ "pile_set_name": "DM Mathematics" }
434r - 1065 = -443r for r. 71 Solve 0 = 361k - 441k - 1120 for k. -14 Solve 83t - 91 = 174t for t. -1 Solve 563u - 2138u - 82302 = -434u + 1697u for u. -29 Solve -402r - 137r - 25494 - 5969 = 16508 for r. -89 Solve -409j - 624 = -201j for j. -3 Solve -229d + 425d = -3136 for d. -16 Solve -877f + 10672 = 1902 for f. 10 Solve -131 - 1748 = -567u - 10384 for u. -15 Solve -1794i - 17737 = -227i - 20267 + 71478 for i. -44 Solve -2128n - 782 = 65186 for n. -31 Solve -7638m + 8064 = -7512m for m. 64 Solve -1083r - 1037r = -318r - 304r + 95872 for r. -64 Solve -278n - 7130 - 3958 = -586n for n. 36 Solve 93m = 1605m + 1770m + 292m + 53610 for m. -15 Solve -31831h - 31889h + 63788h - 7276 = 0 for h. 107 Solve 2945 = 1077l + 973l + 41l - 5419 for l. 4 Solve 1036 = 75y - 3 - 761 for y. 24 Solve 18r - 43r - 26r - 553 = -3715 for r. 62 Solve -256w + 124w = 159w + 71w + 29322 for w. -81 Solve -82x + 286x - 10608 = 0 for x. 52 Solve 0 = -101495d + 101426d + 552 for d. 8 Solve 65700 = 1867f + 3844f - 56298 - 32199 for f. 27 Solve -15512 = -1443j + 39322 for j. 38 Solve 156w - 6594 + 844 - 3250 = -344w for w. 18 Solve 322g = 266675 - 287605 for g. -65 Solve -1058q + 210q = 676q + 21969 + 28323 for q. -33 Solve -87c + 176 = -128c - 167 - 67 for c. -10 Solve 645061g + 790 = 645072g - 288 for g. 98 Solve -3127 - 935 = -1354u for u. 3 Solve 1376o + 341138 = -2105o for o. -98 Solve 0 = 2451b - 3981b - 110160 for b. -72 Solve -12320 = 25650d - 26002d for d. 35 Solve 71z + 0z - 45z - 1918 = 1072 for z. 115 Solve 0 = 211265i - 208911i + 230692 for i. -98 Solve 11355 = 433s - 336 for s. 27 Solve 36697 + 17738 + 11731 = 1308l + 17770 for l. 37 Solve 90772 = -1916h - 160224 for h. -131 Solve -10n + 695n + 9477 - 41575 - 44622 = 0 for n. 112 Solve -24 = 1173o - 2090 + 26699 for o. -21 Solve 4n - 10 = -9n - 465 for n. -35 Solve -8579751n = -8580027n - 6348 for n. -23 Solve -52n + 1782 + 192 - 518 = 0 for n. 28 Solve 637 - 1598 = 44c - 389 for c. -13 Solve -9g + 57g - 3630 = -7806 for g. -87 Solve -530 = 137v - 226 + 792 for v. -8 Solve 102376996z - 102376970z = 2210 for z. 85 Solve -63874u + 63983u - 4687 = 0 for u. 43 Solve -1008i = 21i + 247i - 63800 for i. 50 Solve -101n + 1240 = 87n - 126n for n. 20 Solve 170522g = 170102g + 29820 for g. 71 Solve 44800 = 5807r - 2808r - 165130 for r. 70 Solve 211 + 429 + 5288 = 114l for l. 52 Solve -7777 - 28099 = 508z - 1840 for z. -67 Solve 9194v - 18512v - 24839 = 15521v for v. -1 Solve -1864d = 138282 - 229618 for d. 49 Solve 292x + 2567 + 1297 = -1307 - 377 for x. -19 Solve 0 = 71b - 4435 + 3370 for b. 15 Solve -1090n + 14400 = 833n + 2635n + 142024 for n. -28 Solve -13215 - 10555 = -493n + 4810 - 3437 for n. 51 Solve 0 = -524w - 423w - 46023 - 70458 for w. -123 Solve 598c = 477c + 1371c + 874c - 59472 for c. 28 Solve 86z - 60z + 10z - 1620 = 0 for z. 45 Solve 93159w = 93009w + 13050 for w. 87 Solve -4800 = -6598x + 6694x for x. -50 Solve -9879571q = -9879368q + 8526 for q. -42 Solve 220879 + 275159 = 3932c + 177546 for c. 81 Solve -10481m + 7214m - 120879 = 0 for m. -37 Solve -3703 + 8344 = -16q + 3697 for q. -59 Solve 110x - 7139 = 129x - 78x for x. 121 Solve -34z - 1325 = 23z - 32z for z. -53 Solve 309 = -79r + 2126 for r. 23 Solve 0 = 346g - 1954 + 916 for g. 3 Solve 1915b = 38430 + 8019 + 47386 for b. 49 Solve -4376 = 782c - 4880 + 34130 for c. -43 Solve -2300q - 203q = -328968 + 86177 for q. 97 Solve -96a - 65a - 1692 = -127a + 246 for a. -57 Solve -1464u - 2475u = -123448 - 372866 for u. 126 Solve 0 = -119i + 366i + 1252i + 46469 for i. -31 Solve 482y + 10030 - 4066 + 29222 = 0 for y. -73 Solve -14k + 190 = 93 - 435 for k. 38 Solve 0 = -86l - 1056 - 479 - 605 - 1386 for l. -41 Solve -4103o + 33654 = -3677o for o. 79 Solve -5014 = 30q - 5854 for q. 28 Solve 1940u = 1692u for u. 0 Solve 669x = 3329x + 186x + 364288 for x. -128 Solve -155t - 142t - 4400 = -533t + 148t for t. 50 Solve 0 = 11u + 51u - 245 - 871 for u. 18 Solve 12u - 19906 + 21070 = 0 for u. -97 Solve -194837 - 191747 = 131c - 401780 for c. 116 Solve -95i - 2581 = 174 for i. -29 Solve 0 = 459c - 158c - 167c - 154c + 2520 for c. 126 Solve -8580s = -8550s + 570 for s. -19 Solve 794h = -16992 - 20372 + 6398 for h. -39 Solve 282t - 3076 = 9332 for t. 44 Solve 188t - 9455t - 2791t - 1338438 = 0 for t. -111 Solve -601b - 104b - 373b + 123970 = 0 for b. 115 Solve 463q - 70q - 48213 = 9q - 103q for q. 99 Solve 1727q - 1593q + 941 = -131 for q. -8 Solve 0 = -74p + 28373 - 28299 for p. 1 Solve 137b + 647 = 170b - 574 for b. 37 Solve -1495a - 5895 = 10550 for a. -11 Solve -12339u + 7532u - 341297 = 0 for u. -71 Solve 0 = -168d - 348803 + 338555 for d. -61 Solve -267c + 97c = -125c + 1176c - 129426 for c. 106 Solve 271o + 51o - 167156 = -1896o - 3546o for o. 29 Solve -34p - 200p - 72p - 1119 = 6837 for p. -26 Solve -66123 = -460f + 3300f + 107117 for f. -61 Solve -4120196o + 1535 = -4120290o - 251 for o. -19 Solve 139516 = 4926b - 233845 - 84757 for b. 93 Solve 1735135 = -37x + 1733248 for x. -51 Solve -54726 - 288788 = 9494s + 131186 for s. -50 Solve 0 = 2930y - 1950 + 125025 + 61834 + 17261 for y. -69 Solve -1860k - 25746 = -1247k for k. -42 Solve -1669 - 1473 + 997 = -3j - 36j for j. 55 Solve -290v + 80 - 38 = -623 - 205 for v. 3 Solve -14554b - 135904 = 1519b + 137337 for b. -17 Solve -817a = -18a + 2260a + 192717 for a. -63 Solve 147w = 495w + 322w + 224w + 45594 for w. -51 Solve -90 = 949217o - 949235o for o. 5 Solve 553b - 282464 = 3269b for b. -104 Solve 8f - 5f = 32f + 3f + 2944 for f. -92 Solve 131307 - 136367 = 115k for k. -44 Solve 96v - 795v - 1539v = -127566 for v. 57 Solve 130k - 7169k - 51411 + 332971 = 0 for k. 40 Solve q + 30q + 165q = -4704 for q. -24 Solve -8948r + 8552r - 38808 = 0 for r. -98 Solve -513v + 190v = 23v + 284v + 53550 for v. -85 Solve -1644r = -880r - 810r - 2714 for r. -59 Solve 400w - 2897w + 339590 = 3358w for w. 58 Solve -g + 5969 - 5904 = 0 for g. 65 Solve 0 = -982g + 3310 + 2582 for g. 6 Solve 0 = 143a + 3627 - 4352 - 9571 for a. 72 Solve -78167y + 39063y = -39055y + 2548 for y. -52 Solve 1232 = 4008z - 1977z - 1943z for z. 14 Solve 115t - 988t + 17245 = 675t + 96193 for t. -51 Solve 5766m - 2573m = -4342m - 126916 - 272439 for m. -53 Solve -2x - 154 = -6x + 318 - 344 for x. 32 Solve -722l + 12122 + 51171 = -14683 for l. 108 Solve -300b - 2042b - 49182 = 0 for b. -21 Solve 3161y - 3910 = 3076y for y. 46 Solve 0 = -317q - 26068 + 21630 for q. -14 Solve -10945y + 5611y = -186690 for y. 35 Solve -1035410i = -1035460i for i. 0 Solve -8455 + 7305 = -50y for y. 23 Solve 12649 = -1249z - 303z - 9355 - 9036 for z. -20 Solve 3r - 108r + 7r = -6860 for r. 70 Solve -437h + 56h = h + 128h + 7650 for h. -15 Solve 2403y - 7587 - 42526 = -8755 + 30732 for y. 30 Solve 133f + 29452 = -829f - 10952 for f. -42 Solve -6979 = 1432t - 1576t + 6120 - 2875 for t. 71 Solve -320i + 212i + 166i = -1276 for i. -22 Solve 3953a = 4544a - 13002 for a. 22 Solve -12989 - 4521 = -352o + 23674 for o. 117 Solve -68t - 20636 = 10t - 132t - 254t for t. 67 Solve 146y + 34688 = -2022y for y. -16 Solve -1030l - 50314 = 3591 + 10292 + 15113 for l. -77 Solve -8478995x + 8479440x + 8455 = 0 for x. -19 Solve -71492t = -71527t - 3325 for t. -95 Solve 126159h - 125741h - 16725 - 19223 = 0 for h. 86 Solve -30957g + 31042g = 1615 for g. 19 Solve 0 = -34i - 4999 + 1970 + 2107 + 2180 for i. 37 Solve 1267l = -286l + 5 + 14 - 19 for l. 0 Solve 232l + 4358l + l = -3745l + 400128 for l. 48 Solve 134465 = -133m + 151888 for m. 131 Solve 124l - 143l + 9177 = -152l for l. -69 Solve 0 = -0h - 21h + 3h + 7h + 66 for h. 6 Solve 31y - 986 - 175 - 309 = -323 for y. 37 Solve -7a + 9263 = 74a + 43a + 33a for a. 59 Solve 1914b + 1558b = 510b + 93637 + 149247 for b. 82 Solve 13684 - 17681 + 87328 + 33549 = -1948s for s. -60 Solve -463k - 24775 = 1355k + 11585 for k. -20 Solve 7144b = 50699 - 186435 for b. -19 Solve 13o - 18 = 65 + 317 + 211 for o. 47	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.