Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
and 31951? 351461 Calculate the least common multiple of 50022 and 14. 50022 What is the least common multiple of 6795 and 1890? 285390 What is the common denominator of 79/31752 and -117/686? 222264 Find the common denominator of -121/1000 and -43/40. 1000 Calculate the smallest common multiple of 94 and 401. 37694 Calculate the common denominator of -77/1676 and 55/252. 105588 Calculate the common denominator of 12/621325 and -57/173971. 4349275 Find the common denominator of -39/160 and 67/34720. 34720 Calculate the lowest common multiple of 818085 and 1636170. 1636170 Calculate the smallest common multiple of 65925 and 7325. 65925 Calculate the smallest common multiple of 3455 and 1255. 867205 Find the common denominator of 91/4 and -23/5300. 5300 Calculate the smallest common multiple of 920 and 6120. 140760 Calculate the common denominator of 101/6800 and 107/1530. 61200 Calculate the common denominator of -47/5964 and -35/32. 47712 Calculate the lowest common multiple of 12777 and 12. 51108 Calculate the common denominator of 95/6 and -68/4255. 25530 Find the common denominator of 97/5416 and 23/1352. 915304 Calculate the common denominator of 106/105 and -52/6289. 660345 Calculate the least common multiple of 1416 and 35636. 213816 Calculate the lowest common multiple of 1298 and 1595. 188210 What is the smallest common multiple of 76804 and 1688? 153608 Calculate the least common multiple of 2611 and 2611. 2611 Calculate the common denominator of 26/113 and -10/1197. 135261 Calculate the common denominator of 41/18634 and 65/238. 316778 What is the common denominator of -97/409918 and -58/9? 3689262 What is the common denominator of 129/5500 and 113/264? 33000 Calculate the least common multiple of 8 and 36556. 73112 What is the least common multiple of 357 and 15096? 105672 What is the common denominator of 169/336 and 59/8232? 16464 What is the common denominator of 121/168266 and -23/510? 2523990 What is the lowest common multiple of 9650 and 1930? 9650 Calculate the common denominator of 44/25 and -64/245535. 1227675 Calculate the least common multiple of 64920 and 30. 64920 What is the lowest common multiple of 155714 and 47912? 622856 Calculate the least common multiple of 355382 and 16. 2843056 Calculate the lowest common multiple of 40426 and 328. 161704 Calculate the common denominator of 57/238 and 27/2465. 34510 Calculate the common denominator of -3/892 and -11/8240. 1837520 Calculate the least common multiple of 36990 and 24660. 73980 Calculate the common denominator of -145/41832 and -107/28. 41832 What is the common denominator of 73/26 and 58/19167? 498342 What is the smallest common multiple of 3420 and 33? 37620 Calculate the common denominator of -14/15677 and -44. 15677 Calculate the smallest common multiple of 448 and 22848. 22848 Calculate the common denominator of -59/310 and -22/26133. 261330 What is the least common multiple of 27972 and 20424? 1286712 Calculate the least common multiple of 111558 and 9. 334674 Calculate the least common multiple of 548 and 268. 36716 What is the lowest common multiple of 164116 and 1958? 1805276 Find the common denominator of -29/16 and -93/72056. 144112 What is the common denominator of -58/543 and 19/492? 89052 What is the common denominator of -17/851968 and -119/1040? 4259840 Calculate the common denominator of -47/82446 and 65/48. 659568 What is the common denominator of 29/156 and -17/86710? 520260 What is the common denominator of 3/4745 and -72/715? 52195 Calculate the lowest common multiple of 46 and 1816. 41768 Find the common denominator of 43/803594 and 25/16. 6428752 Calculate the smallest common multiple of 1590 and 52470. 52470 Calculate the common denominator of 49/684 and -109/70. 23940 What is the common denominator of -131/374040 and 13/540? 1122120 Find the common denominator of -87/36476 and 157/198960. 2188560 What is the common denominator of 64/1395 and -67/135? 4185 What is the common denominator of -87/22846 and -17/6? 68538 What is the common denominator of 5/7326 and 61/288? 117216 Calculate the common denominator of 85/1020236 and 17/7024. 4080944 Calculate the smallest common multiple of 30186 and 20124. 60372 Find the common denominator of 55/57152 and -71/256. 228608 Find the common denominator of -125/4774 and 163/14322. 14322 Calculate the common denominator of 83/8 and 4/107629. 861032 Find the common denominator of 83/290520 and 73/72630. 290520 What is the least common multiple of 204 and 83661? 5688948 Calculate the common denominator of 33/480940 and -2/519. 1442820 Calculate the least common multiple of 852 and 2556. 2556 Calculate the smallest common multiple of 167870 and 75. 2518050 What is the least common multiple of 72 and 23104? 207936 What is the smallest common multiple of 162 and 63048? 1702296 What is the common denominator of -38/1631 and -55/168? 39144 Calculate the least common multiple of 84397 and 6. 506382 What is the common denominator of -27/79376 and 125/64944? 714384 What is the common denominator of -7/54946 and 10/82419? 164838 Calculate the smallest common multiple of 957 and 4224. 122496 Calculate the least common multiple of 992 and 3968. 3968 Calculate the least common multiple of 24720 and 535. 2645040 Calculate the common denominator of 163/624 and -37/268. 41808 What is the smallest common multiple of 126 and 4977? 9954 What is the common denominator of 187/25020 and -23/33360? 100080 Calculate the lowest common multiple of 223 and 54. 12042 What is the lowest common multiple of 908064 and 20? 4540320 What is the lowest common multiple of 299460 and 85560? 598920 Calculate the smallest common multiple of 44 and 104132. 1145452 What is the common denominator of 29/52402 and -75/3458? 681226 Calculate the common denominator of -127/756 and 157/2814. 50652 Find the common denominator of -23/202 and -76/18513. 3739626 Find the common denominator of -67/132 and -115/6564. 72204 Find the common denominator of 85/1584 and -143/228. 30096 What is the smallest common multiple of 9485186 and 20? 94851860 Calculate the lowest common multiple of 394680 and 660. 394680 Calculate the smallest common multiple of 410710 and 55. 4517810 Find the common denominator of 16/70817 and -57/4. 283268 What is the lowest common multiple of 559 and 8554? 367822 What is the least common multiple of 15960 and 6384? 31920 What is the common denominator of 7/18 and -79/88700? 798300 Calculate the least common multiple of 7 and 927693. 6493851 What is the smallest common multiple of 1358 and 11676? 1132572 Calculate the common denominator of -85/2332 and 41/375452. 375452 Calculate the lowest common multiple of 9810 and 198. 107910 Calculate the least common multiple of 110 and 300410. 300410 What is the common denominator of 103/187230 and 57/869? 2059530 What is the lowest common multiple of 308 and 87428? 611996 What is the smallest common multiple of 212 and 94340? 94340 Calculate the smallest common multiple of 27426 and 6. 27426 Find the common denominator of -103/7560 and 17/3360. 30240 Find the common denominator of -95/6606 and -181/11010. 33030 What is the smallest common multiple of 60 and 34120? 102360 What is the common denominator of -65/297 and -131/1585386? 1585386 Find the common denominator of 67/36052 and -59/40. 360520 Calculate the least common multiple of 19 and 2044. 38836 Find the common denominator of -47/60907 and -47/99. 548163 Calculate the common denominator of 22/855 and -46/5. 855 Find the common denominator of 6/74347 and -45/40033. 520429 What is the smallest common multiple of 101565 and 67710? 203130 Calculate the lowest common multiple of 27 and 846. 2538 What is the lowest common multiple of 151928 and 28? 151928 What is the smallest common multiple of 18300 and 200? 36600 What is the smallest common multiple of 199868 and 88? 4397096 Calculate the smallest common multiple of 261 and 146367. 4244643 Find the common denominator of 62/40635 and 77/30. 81270 Calculate the lowest common multiple of 76958 and 16730. 384790 What is the least common multiple of 4113340 and 5? 4113340 What is the common denominator of -17/15340 and -109/1040? 61360 What is the smallest common multiple of 240 and 14760? 29	{ "pile_set_name": "DM Mathematics" }
ming b is positive. b(-17/4) Simplify (u(-1/3))38 assuming u is positive. u(-38/3) Simplify w*1/ww*3(w/w*(-1/4))/ww((w6/w)/www)/w assuming w is positive. w(37/4) Simplify (q8q)/q(9/2) assuming q is positive. q(9/2) Simplify (i(-1))(-1)(i(2/9)i)/i(-4) assuming i is positive. i(56/9) Simplify x*(1/2)xx/x(-3/7)(x/(x/x(2/15)))/(x/x4) assuming x is positive. x(1273/210) Simplify (x(2/17)/(x/(xx(3/4)x)))/(x(-1))(-2/5) assuming x is positive. x(499/340) Simplify (k4)39 assuming k is positive. k156 Simplify c*(-7)/cc*(-5)c assuming c is positive. c(-12) Simplify (l(-2))*(-10)/(ll*(3/4)lll8/l) assuming l is positive. l(37/4) Simplify j17/j(-15/8) assuming j is positive. j*(151/8) Simplify (o(o(2/53)/o)/o)7 assuming o is positive. o(-357/53) Simplify (j(-1/2))*(-15)/(jj/((j(j/(j(1/3)/j))/j)/j)j(-3/5)) assuming j is positive. j(203/30) Simplify (f/(f/(ff/(f(-2)/f)f)))(-2/15)/(((f/(f/f(-5)))/ff)/(((((fff7/f)/f)/f)/f)/f)) assuming f is positive. f(41/5) Simplify o(-2/5)oo/o(4/7)(o/(o/(o/o(5/2))))/o(-2/5) assuming o is positive. o(-1/14) Simplify m(-23)/(m/(m*(-33)m)) assuming m is positive. m(-56) Simplify ((n1/nn)/(n/(nn*4)))/(nn*(-3)/nn/n3) assuming n is positive. n10 Simplify ((n(-3/5))(-2))12 assuming n is positive. n(72/5) Simplify z*(-9)zz/(zz*26z) assuming z is positive. z*(-35) Simplify ((oo1/o)(-3/19))(11/3) assuming o is positive. o(-11/19) Simplify (hh(1/7))(-27) assuming h is positive. h(-216/7) Simplify (p9)44 assuming p is positive. p396 Simplify (h(-11)/h)(-8/5) assuming h is positive. h(96/5) Simplify p/p(-23/5)p*(-2/93)pp assuming p is positive. p(3524/465) Simplify (v/v(-36))/v21 assuming v is positive. v16 Simplify (m/m23m)(-22) assuming m is positive. m462 Simplify (kk(-2/17)k)40 assuming k is positive. k(1280/17) Simplify ((s/s(-1/2))/s(-2/13))/(((ss/s(-1)ss)/s)/s)(-2/3) assuming s is positive. s(95/26) Simplify x(xx7)/xxx/(xxx/(x(2/7)xx)xx)xxx(2/9)/(x2/xx) assuming x is positive. x(473/63) Simplify (t/(tt/(t/(tt/t(-21)t))))(-11) assuming t is positive. t264 Simplify y/(y/y*(1/2))y10 assuming y is positive. y(21/2) Simplify (n*(-16/3)/(n/(n(nn(-7/4))/nnn)))24 assuming n is positive. n(-122) Simplify (z(-37)z)/(z/z(4/7)) assuming z is positive. z(-255/7) Simplify ((cc(-7))(-34))(-38) assuming c is positive. c(-7752) Simplify ((n/((nn11)/n))/n(2/43))(-22) assuming n is positive. n(9504/43) Simplify (n/(nn(-2)n))*(21/2)n*(-2/11)nn(3/7) assuming n is positive. n(1809/154) Simplify u/(u/u(2/11))((uu(-8))/u)/uu/u*5u/u(-1) assuming u is positive. u(-119/11) Simplify k/(kk1k)kkk/(k(2/19)/k)(((k/(k(k(3/2)/k)/kk))/k)/k)/(k(-7)/k) assuming k is positive. k(281/38) Simplify ((zz(-1/2)/z)/zz(2/15))/(z(2/11)zz/(z(1/9)/z)) assuming z is positive. z(-4393/990) Simplify ((xx0/xx)/x)(-1/15)/(x9/x*8) assuming x is positive. 1/x Simplify (ii/i(-3/7))(12/17) assuming i is positive. i*(12/7) Simplify (g(g/(gg(-37)))/g)/gggg(-2/77) assuming g is positive. g(2924/77) Simplify ((g0)(-28))(-1/10) assuming g is positive. 1 Simplify (i/i(-2))/(i/(i(i/i(1/4))/ii))(ii*0ii)(-7/9) assuming i is positive. i(17/12) Simplify f/f(-13)f(2/19) assuming f is positive. f(268/19) Simplify v(((v/v(-22)v)/v)/v)/vv20 assuming v is positive. v42 Simplify (u/(u0/uu)u)48(u/u*(2/13))/(uu*2u) assuming u is positive. u(1207/13) Simplify (p47/p)7 assuming p is positive. p322 Simplify (w/(w(-2)/w))(-37)/((w(w/(w/(w(-8)/w)))/w)/(w/(w/w8))) assuming w is positive. w(-131) Simplify (t5t)/t*9(t/t*8)/tt(t(2/5)t)/t assuming t is positive. t(-48/5) Simplify h/h(-8)(hhh/(h/((h/(hhh(2/7))h)/h))h)/h assuming h is positive. h(68/7) Simplify (b(-2/29)bb)/(b/(bb/(bbb/b*(2/15))))(bb(-1/7))/(b(-2/7)/b) assuming b is positive. b(6721/3045) Simplify (uu/u(-12))/(u/(u/u(-24))) assuming u is positive. u*38 Simplify ((oo(-2/9))(-46))(-10/11) assuming o is positive. o(3220/99) Simplify (uuu*(-1/2)u)*(-12)uu/(uu*(-2/15))u/(u/(u*2/u))u assuming u is positive. u*(-403/15) Simplify ((rr(2/9))/r7)/((r/(rrr*0/rr))/(rr7)) assuming r is positive. r(29/9) Simplify ((z/(z/z(-5)))/z(((zz(-3))/z)/z)/z)/((z(2/9)/z)/(z(-3)z)) assuming z is positive. z(-110/9) Simplify ((r(-17)r)/(rr/r18))33 assuming r is positive. 1 Simplify (pp10p10)39 assuming p is positive. p*819 Simplify tt*(-2/3)t*(-2/7)(tt2t)/(t/t(-2)) assuming t is positive. t(22/21) Simplify (q/(qqq*(2/3))q)*1(q(2/7)/q)(-18) assuming q is positive. q(256/21) Simplify z(-8)/((z*(-5)z)/z)z(-7)zz9 assuming z is positive. 1 Simplify c(15/8)c(-12) assuming c is positive. c(-81/8) Simplify ((u/u*(-4))/(u/(u(((u*(-2/3)u)/uu)/u)/u)))/((u(2/3)uu)/uu)34 assuming u is positive. u(-262/3) Simplify (j*9jj(j*2/jj)/j)(-2) assuming j is positive. j(-24) Simplify (u(u/((((u(-2/11)u)/uu)/u)/u)uu)/uu(1/10))/((u(-5)u)/(uu1)) assuming u is positive. u(1131/110) Simplify x*3(x((xx/(x/x*(-7)))/x)/x)/x((xx(1/3))/xx)(-2/41) assuming x is positive. x(-623/123) Simplify ((s/(s/s*(2/3)))/s(ss(-8))/s)(18/5) assuming s is positive. s(-30) Simplify (j(jjj/(j0/j))/j)(-3/8)(jj(-2))(-6/5) assuming j is positive. j*(-3/10) Simplify (ll/(ll13/l))/l(-22) assuming l is positive. l11 Simplify u(-2/13)u*(-2)(u1)(-8/3) assuming u is positive. u(-188/39) Simplify (m(2/9))*(-34/5)/((mmmm(2/19))/(m(1/11)/m)) assuming m is positive. m(-51967/9405) Simplify m/(m/m(-37)m)mmm/(mm43)mm assuming m is positive. m(-77) Simplify (bb(-3/14))/b11 assuming b is positive. b(-143/14) Simplify ((k/k(-2/3))(3/20))(1/4) assuming k is positive. k*(1/16) Simplify l(l*(-19)l)/ll(-2)/l assuming l is positive. l(-21) Simplify (u/(u/u(-2/7)))(3/20)(uuu/u3)/u(-2/21) assuming u is positive. u(11/210) Simplify b(-2/17)b(-2/7)((bbb*6b)/bb)/((b/(b/(b/b(-7))))/bb) assuming b is positive. b(71/119) Simplify (r(-1/9)/(r(r/(((r((r(r(-2)/r)/rrr)/r)/r)/r)/r))/r))48 assuming r is positive. r(-736/3) Simplify ((g2g)/(g/(ggg(-6/11))))3 assuming g is positive. g(114/11) Simplify (f(-1/2)ff)/((f(-8)/f)/f) assuming f is positive. f(23/2) Simplify (p((ppp4p)/p)/p)(2/37) assuming p is positive. p(12/37) Simplify (p*(6/5)(p/(p*(4/9)/p)p)/p)(-34) assuming p is positive. p(-4216/45) Simplify (q/(q*5/q)q(-6))/((q/(q/q8))/q(-5)) assuming q is positive. q(-22) Simplify v*6v*(1/9)(vv0/vv)(1/21) assuming v is positive. v(388/63) Simplify ((w*23/ww)/w)(1/7) assuming w is positive. w(22/7) Simplify x(-1/2)/((x(-9)/xxx)/xx)x/(x*(-1)/xx)x/x(5/3)x assuming x is positive. x(59/6) Simplify (s(2/5)/s)(-34)/(s/(s/(s(1/3)s))s)(-18) assuming s is positive. s(312/5) Simplify q/q*(2/47)q/q(1/25) assuming q is positive. q(2253/1175) Simplify ((vv(1/4)v)/(v(-6/5)/v))/((((v(-3/8)/v)/v)/vv)/(v/(v/(v(-8)/v)))) assuming v is positive. v(-87/40) Simplify y8y(-4/19) assuming y is positive. y(148/19) Simplify (d(-2/7))(-2/11)/(d*(-3/8)/dddd/((d*(1/4)dddd)/d)d) assuming d is positive. d(417/616) Simplify ((z2/z)/z)/(((z/(z/(z/(zzzz/(z6/z)))))/zz)/z)(z/(zzz(4/5)))/z3 assuming z is positive. z(-29/5) Simplify c(2/79)c(-3/4)/c assuming c is positive. c(-545/316) Simplify (z/(z/(z(1/3)/z)))/z6(z1)(-45) assuming z is positive. z(-155/3) Simplify (mm/m15)48 assuming m is positive. m(-624) Simplify (v(-3/22))(-4) assuming v is positive. v(6/11) Simplify (g*(-6/5)gg)(14/9) assuming g is positive. g(56/45) Simplify (l2)(-1/36)((l*(-1/2)/l)/ll)/(l(1/4)/l) assuming l is positive. l(-29/36)	{ "pile_set_name": "DM Mathematics" }
at is the biggest value in 2/3, 2/13, k? 2/3 Let b = -379 - -379.3. What is the third smallest value in -1/7, b, 2/29? b Suppose 5k + g + 228 = -3g, 0 = -2k + 3g - 105. Let s be 4/(k/(-58)) - 1. Let j = -19/6 + s. Which is the second biggest value? (a) j (b) 0.5 (c) -5 b Let w = 2 + 11. Let u = 0.6 + -12.6. Let f = u + w. Which is the smallest value? (a) -3 (b) f (c) 0.5 a Let q be (-44)/(-11) - (208/28 - 3). What is the second biggest value in q, 1, 17? 1 Suppose 48 = 2z - 188. Suppose -2r - z + 110 = 0. What is the second smallest value in -1/3, r, 84? -1/3 Let f = 157 + -153. What is the fourth smallest value in 0.1, -3/5, f, 1/3? f Let l be -2 + 0 + 3 - -3. Which is the second smallest value? (a) -5 (b) -2/7 (c) l b Let g(x) = -2x - 7. Let k be g(-13). Let o = k - 37. Let j be 15/o(-6)/10. Which is the third biggest value? (a) j (b) -2/9 (c) -4/3 c Let y = 283.8 - 284. Which is the second biggest value? (a) -4 (b) y (c) 1 b Let r = 69 - 72.3. Let q = 3.4 + r. Let z(j) = j*3 - 6j*2 + 6j - 2. Let u be z(5). Which is the second smallest value? (a) q (b) -0.1 (c) u a Let z = 12.75 + 0.25. Let i = 13.19 - z. Let n = 0.24 - i. What is the second smallest value in n, -2, -5? -2 Let q be (-7 + 5)(-442)/4. Let o = 4201/19 - q. Which is the third biggest value? (a) o (b) -12 (c) 2 b Let f = -246.4 - -270. Let d = f + -24. Which is the third biggest value? (a) -0.5 (b) d (c) 5 a Let d = 23 - 23.4. Let v = 11 + -14. What is the third biggest value in d, -3/5, v? v Let f = -409 - -408.9. Which is the second biggest value? (a) -0.5 (b) -4/7 (c) f a Let m = -4.37 - -0.37. Let p = -3 - -3.6. Let l = 2888/13 + -222. Which is the biggest value? (a) p (b) m (c) l a Let z = 19 + -18. Let m = 145.8 - 146. Which is the third smallest value? (a) -0.5 (b) z (c) m b Suppose n - 4 = 0, 2n - 38 = -6g + 3g. Let y be (((-2)/(-4))/((-5)/g))/2. What is the biggest value in y, -4, 6? 6 Suppose 11k = 6k + 35. Let i(f) = -2f2 + 13f + 6. Let p be i(k). What is the third smallest value in 4, 1/4, p? 4 Let a = 40/357 - -2/357. What is the third biggest value in a, 0.3, 3, 1/2? 0.3 Let q = -8 - -4. Let n = 1.9 + 2.1. Let j = n - 1. Which is the biggest value? (a) q (b) -0.5 (c) j c Suppose 11 = -2x - 23. Let n = -42.7 - -43. Which is the fourth biggest value? (a) x (b) -2 (c) n (d) -3 a Let s(f) = f2 - f. Let k be s(-1). Let t(m) = 6m*2 + 2m - 1. Let p be t(-2). Suppose 4o + 35 = p. What is the smallest value in 4, k, o? o Let k(m) be the second derivative of m4/12 - 2m*2 - 3m. Let x be k(-3). Suppose x = a + 4a. What is the third smallest value in 0.3, a, -2/3? a Let s = -98/3 + 181/6. Let z = 112779613/5432 + -166099/8. Let o = z + 1/97. What is the biggest value in s, -1/4, o? -1/4 Let b be (-21 - -19)/(65/(-5)). What is the biggest value in 0.3, b, 2.2? 2.2 Let l be 53/318 - (-3 - 26/(-12)). What is the smallest value in l, -0.4, 0.1, -8/5? -8/5 Suppose m - 20 = -4m. Suppose mn = 3n + 1. What is the second smallest value in 0.5, n, -3? 0.5 Let b(s) = s*2 + 2s - 31. Let i be b(-7). Let j be (-2 - -1)/(0 - -1). Let m be j/4 + 2 + -2. What is the biggest value in 3/8, i, m? i Let t = 3.01 - 3.51. Let x = -0.27 - 0.13. Which is the second smallest value? (a) 0.1 (b) 2 (c) t (d) x d Suppose -32x + 28x + 2u + 2 = 0, 7 = -x + 3u. Which is the smallest value? (a) -1/7 (b) -3/5 (c) x (d) 1 b Suppose 25 = -5q, -i - 2q = -6q + 27. Let g = i - -283/6. Let y = -1 - -2. Which is the third biggest value? (a) 3/8 (b) g (c) y b Let n = 0.196 + 0.204. Which is the third smallest value? (a) -1/3 (b) n (c) 4 c Let q = 6.83 + 0.17. Let v = 3 - q. Let p be -2 + 5 - 44/11. What is the third smallest value in -5, v, p? p Let k(y) = y3 - 3y*2 + 4y - 3. Let w be k(2). Let j be (-7)/(-2) - (-2)/(-1). Let p = 9.9 + -9.5. Which is the third biggest value? (a) w (b) p (c) j b Let a = -5642/17 - -332. Let g = 2134 + -2129. Let h = -1.3 - -1. What is the biggest value in a, h, g? g Let h = -21 + 70. Let g = h + -48.7. Which is the biggest value? (a) g (b) 2/9 (c) 0.1 a Let y = -1518 + 1507. Which is the third biggest value? (a) 0 (b) 2/7 (c) y c Let k be -2 + (0 - 2 - 0). Let g be (-60)/(-60)-31. Let s be (5/k)/(g/(-8)). Which is the second smallest value? (a) s (b) 0 (c) -2 c Let w(z) = 35z + 7. Let y be w(14). Let m = -10439/21 + y. Which is the biggest value? (a) -1/4 (b) 5 (c) m b Let i = -0.596 + -0.034. Let v = -0.23 - i. Let o = 0.7 + -3.7. Which is the smallest value? (a) 3 (b) v (c) o c Let y(p) be the third derivative of -p4/24 + p3/3 + 2p*2 - 1. Let o be y(-10). Which is the fourth biggest value? (a) o (b) -2/11 (c) 3/5 (d) 2/11 b Let p = 353 + -361. Let u = -0.04 + -3.96. What is the second smallest value in p, u, -0.5? u Let p be (-28)/(-84) - 22/60. Let d = -845/36 + 93/4. What is the third biggest value in 4, 0, p, d? p Suppose 4n = n - 15. Let k be (-38)/(-4) + (-8 - 0). What is the biggest value in -2, n, k? k Let s be 14/1216/28. Let z = 37 - 37. Which is the second biggest value? (a) s (b) 3 (c) 2 (d) z c Let q = -0.0426 - 1.9254. Let v = 0.032 - q. Which is the third biggest value? (a) 0.1 (b) v (c) -2/3 c Let g be ((-4)/6)/((-17)/(-3)). Let z be 50/(-4)7/((-175)/10). Which is the third biggest value? (a) g (b) 2 (c) z a Let z = -52.43 + 52. Let t = z - -5.43. Which is the third smallest value? (a) -8 (b) t (c) -2 b Let s be (1 + -3)/(2/4). Let j = -25.95 + 26.95. Which is the smallest value? (a) 0.19 (b) j (c) s c Let j(p) = p*3 + 4p2 + 1. Let f be j(-6). Let d = 211/3 + f. Let g = 0.4606 + -0.0606. What is the third biggest value in 2, g, d? d Let r = -2.6431 + 0.6431. Let l be 2/6 + (-2)/12. Which is the fourth smallest value? (a) 4 (b) r (c) -0.3 (d) l a Let z be 16/(-30) - 26/195. Let q = 0.028 - 1.028. Which is the biggest value? (a) 1/4 (b) q (c) z (d) -4/5 a Let z = 2/2965 - -5776/228305. Which is the second smallest value? (a) 2 (b) z (c) -0.5 (d) -5 c Let s = -5.6 - -9.5. Let o = 6.9 - s. Which is the third biggest value? (a) 0.3 (b) 3/8 (c) -5 (d) o a Let i(s) = -s3 + 10s2 - 21s - 20. Let x be i(6). Which is the second biggest value? (a) x (b) 0.4 (c) -22/23 c Let s(z) = -4z - 7z*2 - 2z - 2z3 - 3 + z3. Let u be s(-6). Which is the fourth biggest value? (a) 4/7 (b) -2 (c) 0 (d) u d Let x = -49 + 102. Let j = x - 48. What is the smallest value in -18, -2, 0, j? -18 Let v be (0 - -6)(128/12)/2. Suppose 3l + 2l - 15 = 0, 4w = -3l - 3. Let f be w/(-26)v/(-24). Which is the biggest value? (a) f (b) 4 (c) -1/4 b Let h = 3.5 + -3. Suppose 2k - 2 = 4j, -14j = -13j + 5k + 17. Which is the second smallest value? (a) -0.5 (b) h (c) j a Let p be (-20)/(-25) - 856/70. What is the smallest value in p, -2, 0? p Let k(l) = -8l - 4. Let u be k(8). Let r = u - -341/5. Let y = -6 - -8. Which is the smallest value? (a) -1 (b) y (c) r a Let s = -0.6 - -2.6. Let w = 149 - 79. Let z be (-26)/(-91) - 6/w. What is the third smallest value in z, 2/5, s? s Let w = 0.0794 + 0.1206. What is the second biggest value in 3, w, 4, 1/3? 3 Let s be -1 - (4 + 0 + -3). Let v be ((-16)/(-12) - 1)(-3)/s. Which is the second smallest value? (a) v (b) 2/9 (c) 3 a Let t(j) = j*3 - 13j*2 + 12j - 18. Let u be t(12). Let i be -6 + (2 - 2) + (-5 - -5). Let a be (3/u)/((-2)/i). What is the biggest value in 0.5, a, -2/3? 0.5 Let d = -5.95 + -0.05. Let w = d + 3. Let r = -794 - -794. What is the second biggest value in w, -0.1, r? -0.1 Let p(k) = k*3 + 3k*2 - 4k - 3. Let w = -66 + 62. Let c be p(w). What is the third smallest value in 4, 2, c? 4 Let l = -10.16 + 6.16. Suppose -5b - 2 = -2j + 1, 21 = 5j + b. What is the third smallest value in 2, l, -2/13, j? 2 Suppose g + 8 = -2r, 2g - g - 3r - 7 = 0. Let s be (-1 - 11/(-3))((-36)/8 - -6). What is the second biggest value in g, s, -2/23? -2/23 Let r = -335.9 - -359. Let g = r + -0.1. Let b = -22.5 + g. What is the smallest value in -3, 0.1, b? -3 Let i = -1735.9 + 1737. Which is the third smallest value? (a) i (b) 3 (c) -2 (d) 0 a Let l be (-5 - 10/(-3))18/(-10). Let a = 2877/2 - 520741/362. Let c = a - -368/543. What is the thir	{ "pile_set_name": "DM Mathematics" }
Let n be (-3)/(2/(-2 - 0)). Suppose x = nx - 66. What is the greatest common divisor of x and m? 11 Suppose -2z + 10 = s - 15, -2z + 22 = 2s. What is the highest common factor of 154 and z? 14 Suppose -5k - 14 = -o - 5, 2o - 51 = -k. Let a = 263 + -257. Calculate the highest common divisor of o and a. 6 Let s be (0 + -1)(-1 + -2). Suppose -41 = -sg + 4x, -2g + 4x = -x - 39. Let t be 76 - (-1 + 1 + -1). Calculate the highest common factor of t and g. 7 Suppose q - 3q + 8 = 0. Let u be 0 + -1 + 1 + 44. What is the greatest common factor of q and u? 4 Let m be 2/(-3)45/(-10). Suppose 0 = mf - 3n - 303, 5f + 2n = -3n + 495. What is the highest common divisor of f and 25? 25 Suppose 98 = 5s - 22. Suppose -s = -g - 3g. Let h be (-501)/(-12) + 2/8. What is the highest common factor of h and g? 6 Suppose 0 = -2m - 4r - 41 - 29, -2r = -4m - 140. Let g be 31/(-5)m. Calculate the greatest common factor of 14 and g. 7 Let l = -5 + 15. Let n(j) = -10j + 2. Let g be n(2). Let o = 7 - g. What is the greatest common divisor of o and l? 5 Let r be 4/(-10) - 6(-16)/15. What is the highest common factor of 66 and r? 6 Let j be -1 + -3 - 8/4. Let i = j - -10. Suppose 0v - 36 = -iv. Calculate the greatest common divisor of v and 72. 9 Let j be 8/1 - 2/1. Suppose 5 = 2y + 3y + 5f, -3f - 9 = 0. What is the highest common factor of j and y? 2 Let u = -35 + 56. Let y be 91 - (-1 - -3). Calculate the greatest common factor of u and y. 7 Let p be (-3 - -4)/(1/59). Let x = 5 + p. Suppose x = h + h. Calculate the highest common factor of 4 and h. 4 Let l = 86 - -61. Suppose -m = 2m - l. Let t = 5 - -2. What is the greatest common factor of m and t? 7 Let n be 0 + (-12)/9-3. Let q = 154 - 90. Suppose 0s - q = -ns. What is the greatest common divisor of s and 24? 8 Let a be (-1204)/(-6) + (-4)/6. Suppose -4w - w = -a. Suppose -40 = -4j + 5y, -w = -2j - 2j - 5y. What is the highest common factor of j and 80? 10 Let x(w) = 4w - 21. Let l be x(21). What is the greatest common factor of 105 and l? 21 Suppose 2x - 47 - 17 = 0. Let u be (-3)/9-121. Calculate the highest common factor of x and u. 4 Suppose -28l = -24l - 20. Suppose 12 - 42 = -2v. What is the highest common factor of v and l? 5 Suppose -2w + 2a = -220, 2w + 5a - 220 = a. Calculate the greatest common divisor of w and 10. 10 Suppose 2v + 0 = 10, 2o = v - 49. Let x = -9 - o. What is the greatest common factor of x and 65? 13 Suppose 4b - 2 = 2w, 4b - 5w = -9 + 2. What is the highest common factor of b and 34? 2 Suppose -4t - 35 = -3z, 13 + 37 = 5z - 5t. Suppose 3i - f = 13, zi - 11 - 12 = 2f. Let l = -2 + i. Calculate the greatest common divisor of 8 and l. 1 Suppose 3z = z. Suppose z = n + 3n - 52. Calculate the highest common divisor of n and 104. 13 Let k(t) = -3 - 4t*3 + 5t*3 - 6 + 8t*2 - 10t. Let h be k(-9). Suppose 0 = w + 2a - 92, h = 4a - 2 - 2. What is the highest common factor of w and 10? 10 Let v be 24 - (1 - -1). Let z(k) = -k3 + 5k*2 + 7k - 3. Let g be z(v). Calculate the greatest common divisor of 3 and g. 3 Let c(l) = -l*3 - 7l*2 + 13. Let t be c(-8). What is the highest common factor of 7 and t? 7 Let s(i) = -i - 2. Let j be s(-3). Let f = -13 - -20. What is the highest common factor of j and f? 1 Let o be 1(-3)/(-9)6. Suppose -3v = -2s + 95, 3s + ov + 0v - 136 = 0. What is the greatest common factor of s and 115? 23 Suppose 0 = -3p + 163 + 23. Let c = p + -38. Calculate the highest common divisor of c and 6. 6 Suppose 0v = 3v + 27. Let c = 12 - v. What is the greatest common factor of 21 and c? 21 Suppose 5 + 7 = 3l. Suppose l = 6b - 2b. Let g be b/(-2)52/(-2). Calculate the highest common factor of g and 13. 13 Suppose -4c = -444 - 380. Suppose n + 3y - c = 0, 2n + 131 = 5y + 565. Let v = 356 - n. What is the highest common factor of v and 16? 16 Let u(r) = -2r - 4. Let d be u(-3). Suppose dv + 0n = 2n + 24, n = -v + 16. Let w = 3 - 1. Calculate the highest common factor of w and v. 2 Let i(x) be the third derivative of 2/3x*5 + 0x*3 - 3x*2 + 0x*4 + 0x + 0. Let h be i(1). Calculate the highest common divisor of 8 and h. 8 Let p = 57 + -46. Calculate the highest common divisor of 22 and p. 11 Suppose 3o - 14 = -2. Calculate the highest common divisor of 36 and o. 4 Let j = -41 - -90. Calculate the highest common factor of j and 7. 7 Let z = 1 - -3. Let n = 2 + 18. Calculate the greatest common factor of z and n. 4 Suppose -4z - 112 = -b, 4z = b - z - 113. Let v(o) = 16o + 1. Let q be v(2). Let c = -21 + q. What is the highest common divisor of c and b? 12 Let d = 76 - 52. Let m = -15 + 25. Let t = 16 - m. What is the highest common factor of d and t? 6 Let b = -9 + 16. Calculate the greatest common divisor of 49 and b. 7 Let c = 11 - -13. Let b = -15 + c. Suppose -4k - 9 = -5k. What is the greatest common factor of b and k? 9 Let s = 8 + -11. Let w = 7 + s. What is the greatest common divisor of w and 44? 4 Suppose 155 + 130 = r. Suppose -3q + 2y = -2y - r, 4q - 2y - 380 = 0. What is the greatest common divisor of q and 38? 19 Let j be ((-264)/30)/((-1)/10). Let w(n) = 21n3 + n2. Let t be w(1). What is the greatest common divisor of j and t? 22 Let s = 3 - 0. Suppose -2h + 1 = -1, 27 = 4q + sh. Let t be 13 + 1(2 - 0). Calculate the highest common divisor of q and t. 3 Suppose 25 = 3o + 2o. What is the greatest common divisor of o and 2? 1 Suppose 3r - j = 14, 0r + 4j - 46 = -5r. Suppose -5t - 69 = -2s, -s + rt = t - 47. Suppose -s = -g - 0. What is the highest common divisor of 33 and g? 11 Suppose 6j = 3j - 4a + 31, 0 = -a + 4. Suppose 5y = 4c + c + 295, 0 = jc + 15. What is the highest common factor of 7 and y? 7 Suppose s - 42 = 5j + 2s, -6 = j + s. Let q be ((-24)/j)/((-4)/(-54)). What is the highest common factor of 54 and q? 18 Let l be (70/(-3))/((-4)/18). Calculate the greatest common divisor of l and 15. 15 Let b(w) = w2 + 10w + 11. Let v be b(-8). Let x = 3 - v. Suppose 2 + 3 = 5n. What is the highest common factor of n and x? 1 Let z(r) = -2r + 2r - r + 7. Let u be z(7). Suppose 4j = 4, uk + 2k = 4j + 32. Calculate the greatest common divisor of 54 and k. 18 Suppose -5u - 5g = -260, u - 8 - 38 = 5g. Calculate the highest common factor of 34 and u. 17 Let l = -3 - 1. Let v be 28/21(-6)/l. Let n be (v - -3) + -2 + 9. Calculate the highest common divisor of 30 and n. 6 Let p(h) be the first derivative of -9h4/2 - h3 - 3h2/2 - 2h - 7. Let c be p(-2). What is the highest common factor of c and 17? 17 Let y(l) be the first derivative of -l*3/3 - 7l*2/2 + 9l - 1. Let g be y(-8). Let v be g/((-33)/18 - -2). What is the highest common factor of v and 66? 6 Let p = -4 - -9. Suppose -k - pr + 3r = -51, 0 = -k + 4r + 63. Calculate the highest common divisor of 5 and k. 5 Let m = 1 - 19. Let c be (-52)/(-9) - 4/m. What is the greatest common factor of 48 and c? 6 Let i(o) = 11o - 3. Let f be i(7). Suppose 5h - f = 2q + q, 2h - 41 = 5q. What is the greatest common divisor of h and 117? 13 Let b be 6/(-10) - (-2 + (-18)/5). What is the highest common divisor of 20 and b? 5 Let y(x) = x*2 - 12x + 9. Let q be y(11). Let v(b) = -5b - 1. Let a be v(q). Let n = 158 - 95. Calculate the greatest common factor of n and a. 9 Suppose 0 = 5l + 156 + 164. Suppose 2s = -5d + 2d - 3, 2s = -5d - 9. Let w be (s/(-2))/(12/l). Calculate the greatest common factor of w and 32. 8 Let s(j) = j3 + 28j*2 + 26. Let d be s(-28). What is the highest common factor of d and 39? 13 Suppose 0 = -4u + u + 318. Suppose -7f + 20 = -3f, 4f = 3c - u. What is the highest common divisor of 14 and c? 14 Let k be ((-13)/(-2))/(3/6). Let l = k - -20. Suppose -2f + 4f - 44 = 0. Calculate the highest common divisor of f and l. 11 Let c(n) = 2n - 1. Let k be c(2). Suppose 16 = 7a - ka. Suppose 4 = 3v + 4y, 2v - 3y - 15 - 16 = 0. What is the highest common divisor of v and a? 4 Let b(z) = z2 + 2z. Let v be b(-2). Let m(y) = y3 + y2 + y + 10. Let d be m(v). Calculate the highest common factor of 1 and d. 1 Suppose -2u = -x - 6 - 9, -4x = 4*u - 24. Let h = -46 + 95. What is the highest common factor of u and h? 7 Let v	{ "pile_set_name": "DM Mathematics" }
alue in 5/33, 1, -1681.04? 5/33 What is the third smallest value in -26, 2/5, -6/7483, -5, 2/3, 3? -6/7483 Which is the fourth biggest value? (a) -32 (b) 1 (c) -0.811 (d) -3 (e) -11 e What is the fifth smallest value in -2, 0.2, -24, -0.2, -0.5, -351320, -2/3? -0.5 What is the fifth biggest value in 3274, -2, 0.2, -2/49, -27/5, 0.3? -2 Which is the third smallest value? (a) 105 (b) -108 (c) -4 (d) -33 c What is the third biggest value in -3, -8, -0.07, 2/29, 1/3, 3, 143? 1/3 Which is the fourth biggest value? (a) 1/1965 (b) -3/11 (c) -4/7 (d) 0 (e) -0.3 (f) 260 b Which is the third smallest value? (a) 0.8125 (b) -1/4 (c) -3/2 (d) 5/3 a Which is the second smallest value? (a) -1.1 (b) 5 (c) 1/6 (d) -4/7 (e) 18/11 (f) 1/1288 d Which is the fifth smallest value? (a) -13 (b) -93/2 (c) 152 (d) -2/17 (e) -2 c What is the fifth smallest value in -0.015, 4/691, 0, -0.1, -0.4, 1? 4/691 What is the fourth smallest value in 0.3, 1/2, -4, 2896, 90, 2, 1? 1 Which is the fourth biggest value? (a) -37 (b) -12 (c) 1.6 (d) 0.6 (e) 0.02 b Which is the fourth smallest value? (a) -2/37 (b) 14 (c) 2/3 (d) -158 (e) 0.4 (f) 1 c Which is the second smallest value? (a) 0 (b) -0.289 (c) -1.1 (d) -154 c Which is the biggest value? (a) 0 (b) 8633 (c) 6.5 (d) 5 (e) -2 b What is the sixth smallest value in 2.174, 5, -0.4, 0.4, -1, 2, -0.3? 2.174 What is the sixth smallest value in -1, 0.22, -2/5, -1/3, -0.8, -0.2, -34? -0.2 What is the biggest value in 0.3, -0.3, 20, -3, 4, 39/206? 20 Which is the smallest value? (a) 2/11 (b) -5/326 (c) 302 b Which is the smallest value? (a) 3 (b) -3/22 (c) 2.785 (d) 2/17 b Which is the second biggest value? (a) -2/13 (b) -3/5 (c) -0.033 (d) 6/11 (e) -5 (f) -1/429 (g) -2 f What is the fourth biggest value in -196827, 5, -4/7, -5, -0.5? -5 What is the third biggest value in 12.787, -0.4, -0.01, -10? -0.4 Which is the sixth smallest value? (a) 3 (b) 1/6 (c) 114 (d) 1 (e) 15405/8 (f) 0.1 e Which is the fourth biggest value? (a) -5 (b) 3/7 (c) 0.02 (d) -943 (e) 174 a Which is the biggest value? (a) 19.6934 (b) 0.2 (c) -5 a What is the fourth smallest value in 9, 30, -4/7, -20, -2, -2/21? -2/21 Which is the biggest value? (a) -3 (b) -3/740 (c) -2/7 (d) 4 (e) 0.016 (f) 7 f Which is the sixth biggest value? (a) 310 (b) 5 (c) 0.5 (d) 0.664 (e) 0.4 (f) -1 (g) -6 f Which is the fifth smallest value? (a) -2 (b) 3 (c) -4 (d) 67 (e) -4/5 (f) -5452 (g) -2/7 g Which is the biggest value? (a) 0.22 (b) 0.16 (c) -0.05 (d) -2/13 (e) -6 (f) 40 f What is the second biggest value in 25/7, 2, 2/3, 8/437? 2 Which is the smallest value? (a) -2 (b) 1/516 (c) 3 (d) -3 (e) -4 (f) 8 (g) 0.25 e What is the fourth biggest value in -0.01, -1, 6, 3/7, 0.03, 61/3, 8? 3/7 Which is the third smallest value? (a) -260 (b) -12.361 (c) 1 (d) -1/7 d What is the fifth smallest value in 2, -0.3, 24/163, -2/23, 11? 11 What is the third biggest value in -2, -20, -3/19, 0.5, 1/5, 15? 1/5 What is the third biggest value in 53, 0.2387, 4, -5, -0.2? 0.2387 What is the fourth biggest value in 53, -1, -738, 13, 1/9, 0.5, 1/5? 1/5 Which is the smallest value? (a) -0.24 (b) 104 (c) -22267 c What is the fourth smallest value in 4.5, -104/11, -3/2, 0.1? 4.5 What is the third biggest value in 1/3, 3, 74, 1289? 3 Which is the biggest value? (a) -0.2 (b) -5 (c) -314729 (d) 8 d What is the third biggest value in -104, -4.398, 169? -104 What is the second biggest value in 2/11, 246, 265627, -1? 246 Which is the second smallest value? (a) 36 (b) 1/41 (c) 0.0246 c What is the third biggest value in -3, 1, -1, -4.96, 44.579? -1 Which is the seventh smallest value? (a) 5 (b) 1/914 (c) -2/5 (d) 32/5 (e) 2 (f) -0.7 (g) -0.3 d Which is the second biggest value? (a) 353/8 (b) -4 (c) 1/2 (d) 1.03 d Which is the third biggest value? (a) 5 (b) 0 (c) 76 (d) 7 (e) 0.334 a What is the third biggest value in -128, 15/4, -0.6, 1237? -0.6 What is the fourth smallest value in -3, -0.114, 0.5, 0, -0.244, -6/13? -0.114 What is the smallest value in 2/5, 301, 61.7? 2/5 What is the second smallest value in -0.05, -0.4, -4, 3, 351, -3/2? -3/2 Which is the fifth biggest value? (a) 1/8 (b) 126/19 (c) 5 (d) 1/9 (e) 0.3 (f) -1/3 (g) -0.2 d What is the third biggest value in -53742, 0.03, 53? -53742 Which is the biggest value? (a) 23 (b) 90.8582 (c) -2/21 b What is the smallest value in -14124, 5/2, -4/9, 4? -14124 What is the biggest value in 4/7, 9/11, 90593.1? 90593.1 Which is the biggest value? (a) -293 (b) -28 (c) -0.27 (d) 5/2 (e) 1/3 (f) 6/13 d What is the third smallest value in 1/4, 3, -5.66, -16/11, 1, -16, -0.4? -16/11 Which is the third biggest value? (a) -29 (b) -2/63 (c) -60125 c What is the fifth biggest value in 31, 0, 153, 16, -2? -2 What is the second biggest value in -2, 106.6, -2/3, -5, 0.3, -277? 0.3 What is the smallest value in -134, -17, -0.5, -7.5, 2/5, 0.1, -3? -134 Which is the sixth smallest value? (a) -0.03 (b) 2/11 (c) -0.5 (d) 0.04 (e) 0 (f) 3 (g) -253 b Which is the second smallest value? (a) -5 (b) -2/1157 (c) 0 b What is the second biggest value in -1/2, -9503619, 0? -1/2 Which is the second biggest value? (a) -2/7 (b) -4 (c) -2002 (d) -2287 b What is the fourth biggest value in -1/3, 0, -1612, 209? -1612 Which is the fifth smallest value? (a) -9 (b) 2/9 (c) 5 (d) -0.2 (e) -29 (f) -3 (g) 4/19 g Which is the seventh smallest value? (a) 4/11 (b) -1768 (c) -3/2 (d) 4 (e) 1 (f) 0.08 (g) 0.4 d What is the second biggest value in -0.352, -97.528, -3/7, 4? -0.352 What is the fifth biggest value in -0.3, 3/5, 10.7782, 1/10, -3? -3 What is the second smallest value in 2/433, 2/5, 5, 2/13, -1/2, 2? 2/433 What is the biggest value in 0.5, -170, -1440, 3? 3 Which is the third biggest value? (a) -1/4 (b) 0.03 (c) -2 (d) 131 (e) -4 (f) 0.245 b What is the third smallest value in -3, -2/11, -4/7, 939, 0.5, 16656? -2/11 What is the biggest value in 756, -18, -2/9, -1.6, 1.6? 756 What is the sixth smallest value in 0.3, -0.044, 1/5, 4/9, 1141, -4/3? 1141 What is the second biggest value in 13, -10.3, 18424? 13 What is the fourth biggest value in 2, 2/19, -0.11, -1, 2/61, -38? -0.11 Which is the biggest value? (a) 6/7 (b) -29543 (c) -1.3 (d) 1/7 (e) 1/2 a Which is the third biggest value? (a) -1 (b) -0.503 (c) 3 (d) -2 (e) 13 b What is the fifth smallest value in -0.6771, -0.02, -2/9, 1/9, -28? 1/9 What is the second smallest value in 1752, -1/3, 4688? 1752 What is the biggest value in 1, 3, -2218, 36064? 36064 Which is the second biggest value? (a) -3/10 (b) 294.6 (c) -0.2 (d) 1.24 d What is the fourth smallest value in -1, -0.1, 0.4, 0.6197, 0.5, 1/4, -5? 1/4 Which is the biggest value? (a) -2302 (b) 4115 (c) -5 b Which is the biggest value? (a) 3/7 (b) 1.5 (c) -600 (d) 156 d Which is the second biggest value? (a) -9/2 (b) 203 (c) 2 (d) 0.1 (e) 0.03 c Which is the fifth biggest value? (a) 0.4 (b) -0.04 (c) -15/28766 (d) -4 (e) -1/10 d What is the sixth smallest value in -62, -1/6, -2/39, -2, -5, -126? -2/39 What is the sixth smallest value in 2.6, -3, 2, 0.2, -1117, -40? 2.6 Which is the biggest value? (a) 19 (b) -106/5 (c) 0 (d) -298 a Which is the third biggest value? (a) -4 (b) 90588/65 (c) -44/5 c Which is the fourth biggest value? (a) -0.001538 (b) 3 (c) 49 (d) 4 a What is the smallest value in 10/81, 349, -0.595? -0.595 Which is the seventh biggest value? (a) 5 (b) 1 (c) 6 (d) 1/3 (e) 2/2183 (f) 2/3 (g) 87 e Which is the seventh smallest value? (a) 4 (b) 9/4 (c) 0.3 (d) -2/19 (e) 9 (f) 0.52 (g) -1 e Which is the biggest value? (a) -16 (b) 1/4 (c) 24124 c Which is the fifth smallest value? (a) -2.3 (b) -4 (c) -1/2 (d) 395 (e) 5 (f) 77 (g) 1/4 e Which is the third biggest value? (a) 5584 (b) -6/7 (c) 0.2 b What is the fourth biggest value in -2, -0.1, 3/12683, 0.2, -0.5, 2/3? -0.1 What is the smallest value in -0.4, 2/11, -3, -1195126? -1195126 Which is the third biggest value? (a) 27.61874 (b) 14 (c) -0.2 (d) 3 d Which is the second biggest value? (a) 1/4 (b) -9.7 (c) -2 (d) 3 (e) 4.6 (f) 1 d What is the third smallest value in -1	{ "pile_set_name": "DM Mathematics" }
446 What is 1615 divided by -4? -1615/4 Calculate -5227656 divided by -6. 871276 -1254748 divided by 1 -1254748 -2556 divided by -12 213 Calculate 44612 divided by -38. -1174 What is -234 divided by 6941? -234/6941 Calculate -1 divided by -32920. 1/32920 -347 divided by 155 -347/155 192136 divided by 28 6862 Calculate 119112 divided by 4. 29778 Calculate 220384 divided by 776. 284 Divide 3 by -6244. -3/6244 Calculate -96 divided by -5039. 96/5039 2437 divided by 12 2437/12 What is 37728 divided by 9432? 4 1 divided by 1029923 1/1029923 What is 11 divided by -12532? -11/12532 What is -3 divided by 9515? -3/9515 Calculate 4 divided by -577003. -4/577003 Divide -1826 by 83. -22 Divide 267504 by 5573. 48 What is 231254 divided by -2? -115627 46 divided by -603 -46/603 Calculate -3 divided by 23526. -1/7842 Calculate -663232 divided by -64. 10363 Calculate -3242568 divided by -14. 231612 What is -1263 divided by 2? -1263/2 Divide 71856 by 5988. 12 -114044 divided by 10 -57022/5 Divide 1693026 by 188114. 9 Divide 3 by 10622. 3/10622 Calculate -21391 divided by 21. -21391/21 Divide 79700 by 39. 79700/39 Divide -1494501 by 3. -498167 29359 divided by 1 29359 -80620 divided by -58 1390 Calculate 4 divided by 226672. 1/56668 What is 2218 divided by 1109? 2 Divide -1150 by -177. 1150/177 Divide -186562 by -5. 186562/5 Calculate -20556 divided by -5139. 4 Calculate -67197 divided by -5169. 13 What is 308830 divided by -694? -445 Divide -710860 by -710860. 1 22230 divided by 190 117 What is -90 divided by -2? 45 What is 121574 divided by 4? 60787/2 Calculate -7919 divided by 99. -7919/99 What is -1604 divided by -2? 802 What is 8932 divided by -2233? -4 Divide 2 by 19438. 1/9719 Calculate -2914 divided by 58. -1457/29 What is 8274 divided by -52? -4137/26 -4881 divided by 3 -1627 93125 divided by -18625 -5 -16 divided by 3893 -16/3893 Divide -124716 by 3. -41572 Divide 1351806 by 6. 225301 Divide -14574 by -7287. 2 Divide 1139920 by -4. -284980 4044079 divided by 221 18299 Calculate -28770 divided by 21. -1370 Calculate -19932 divided by 63. -6644/21 Calculate 418479 divided by -3. -139493 What is 464211 divided by 154737? 3 What is 104 divided by -374? -52/187 Divide 197504 by 24688. 8 34120 divided by -20 -1706 What is -67272 divided by -16818? 4 Divide 18406 by -6. -9203/3 Calculate 928012 divided by -232003. -4 0 divided by 1018 0 What is -142260 divided by 35565? -4 Calculate -236572 divided by -1. 236572 What is -432626 divided by -1? 432626 Divide 199260 by 2214. 90 Calculate 11 divided by 4638. 11/4638 -1397764 divided by 349441 -4 -4 divided by 18039 -4/18039 -19074 divided by 6 -3179 What is 458384 divided by 8? 57298 Divide 133263 by -117. -1139 Calculate 7 divided by -719252. -7/719252 Divide -28 by -43032. 7/10758 What is -8410 divided by -10? 841 Calculate 2322 divided by -1. -2322 -1 divided by 403987 -1/403987 Divide -126378 by -118. 1071 1725210 divided by -6 -287535 Divide -371630 by 37163. -10 3 divided by -24197 -3/24197 -116 divided by 786 -58/393 Divide 8624 by 4. 2156 Divide 14912 by -8. -1864 Calculate 257154 divided by 1. 257154 62628 divided by -8 -15657/2 70110 divided by 19 3690 What is 5 divided by -1484670? -1/296934 What is -235 divided by 14? -235/14 -181194 divided by -299 606 Calculate 5948 divided by -19. -5948/19 -174820 divided by -34964 5 Calculate 1627770 divided by -30. -54259 Divide -91813 by 5. -91813/5 0 divided by 3111 0 Calculate 0 divided by -170. 0 Calculate 133 divided by -7643. -133/7643 124 divided by -701 -124/701 What is 103929 divided by -21? -4949 Calculate 15 divided by 87073. 15/87073 Divide -3 by -37012. 3/37012 4 divided by 685899 4/685899 133887 divided by 44629 3 Divide 0 by -11314. 0 Calculate -1318410 divided by 4883. -270 -7338 divided by -617 7338/617 -23692065 divided by 3 -7897355 What is -602 divided by 260? -301/130 -986 divided by -198 493/99 599540 divided by 9670 62 Divide -2605 by -43. 2605/43 Calculate 113130 divided by -18855. -6 What is -61249 divided by 1? -61249 What is 962 divided by -9? -962/9 Calculate -4 divided by 273586. -2/136793 Calculate -5 divided by -263748. 5/263748 Calculate 1292460 divided by 107705. 12 Divide -379518 by -13. 379518/13 Divide 5 by -1428. -5/1428 What is -3659 divided by -53? 3659/53 What is 13728 divided by -39? -352 -9 divided by -678 3/226 What is 3294 divided by -54? -61 What is 21534 divided by 3? 7178 465840 divided by -5823 -80 44942 divided by -23 -1954 Calculate 6927 divided by -457. -6927/457 Divide 8024 by 68. 118 656825 divided by 131365 5 -24 divided by -1839 8/613 1316 divided by 2 658 Calculate 31 divided by -3083. -31/3083 4592 divided by 656 7 Divide 22533 by 5. 22533/5 Calculate 4 divided by -839. -4/839 1564595 divided by -19805 -79 Calculate 1220791 divided by -8537. -143 Divide -379880 by -5. 75976 Calculate -6496 divided by 116. -56 What is 13437 divided by -3? -4479 What is -9982 divided by -246? 4991/123 -1 divided by -750 1/750 What is -656 divided by 37? -656/37 Divide -914 by 35. -914/35 What is 773070 divided by 365? 2118 -239235 divided by 4 -239235/4 Calculate -8562500 divided by 12500. -685 What is -2 divided by -52948? 1/26474 3 divided by 6501 1/2167 Divide 119 by -78. -119/78 What is 1604 divided by -1192? -401/298 -22770 divided by -345 66 Divide -5 by 1911. -5/1911 Calculate 88257 divided by 13. 6789 Calculate 2 divided by 48170. 1/24085 3 divided by 56093 3/56093 0 divided by 256713 0 15335 divided by 3067 5 Divide -113520 by 8. -14190 Calculate -1000248 divided by -852. 1174 Calculate 5828 divided by 6. 2914/3 422080 divided by 6595 64 Calculate -7997 divided by 230. -7997/230 Calculate -363948 divided by 26. -13998 Divide -319739 by 3. -319739/3 Calculate 30593 divided by 2. 30593/2 What is -4 divided by 3969? -4/3969 Calculate -311499 divided by -3753. 83 77 divided by -36 -77/36 What is -15456 divided by -12? 1288 Calculate 39 divided by -12. -13/4 What is 28432 divided by 5? 28432/5 What is 32430 divided by -94? -345 Divide -3213 by 3. -1071 Calculate -1 divided by 58395. -1/58395 What is 438460 divided by -44? -9965 What is -214272 divided by 108? -1984 Calculate 719505 divided by -1355. -531 What is -453 divided by 1? -453 Calculate -282200 divided by -10. 28220 What is 169008 divided by 8048? 21 What is -1337724 divided by -222954? 6 Divide -7433080 by 34. -218620 Divide 76704 by -799. -96 Calculate 17568 divided by -96. -183 What is 201921 divided by 67307? 3 1 divided by -211340 -1/211340 Divide 318 by -205. -318/205 4396 divided by -28 -157 Calculate 3 divided by 138320. 3/138320 What is -86034 divided by 15? -28678/5 -53835 divided by 111 -485 Divide -185658 by 16878. -11 Divide -525728 by -8. 65716 Calculate 12567 divided by 71. 177 What is 1440 divided by 60? 24 Divide -43 by -88. 43/88 Divide -23 by 2241. -23/2241 Calculate -114240 divided by 16. -7140 What is -4 divided by -7011? 4/7011 What is -146814 divided by -1? 146814 -266824 divided by 66706 -4 What is 35 divided by 986? 35/986 Calculate -303930 divided by -5. 60786 Calculate -11 divided by -8996. 11/8996 What is -400 divided by 32? -25/2 What is 47008 divided by 4? 11752 -13636 divided by 2 -6818 Calculate 1104 divided by -4356. -92/363 Calculate 1364670 divided by 118. 11565 -26570 divided by 5314 -5 -2540248 divided by -635062 4 Calculate -4 divided by -1385. 4/1385 What is -4 divided by 51367? -4/51367 Divide 261 by 219. 87/73 What is 146616 divided by 6? 24436 What is 25330 divided by 17? 1490 Calculate 0 divided by 39340. 0 1305 divided by 609 15/7 Divide -461360 by -632. 730 What is 0 divided by -32894? 0 What is -3 divided by -3915? 1/1305 -47930 divided by 5 -9586 -28405 divided by -437 65 Divide -103265 by 1. -103265 5201 divided by -74 -5201/74 What is -9911910 divided by 145? -68358 Divide -3320 by 15. -664/3 Divide 30954 by 6. 5159 What is 8378 divided by 18? 4189/9 391215 divided by 2371 165 Divide -3 by -28819. 3/28819 Divide -972 by -95. 972/95 195 divided by 405 13/27 What is -934529 divided by 2? -934529/2 What is 4 divided by -651480? -1/162870 Divide -8861 by 28. -8861/28 Calculate 83232 divided by 4. 20808 Calculate -1039 divided by 59. -1039/59 Calculate -49 divided by -21172. 49/21172 Calculate -3 divided by 123119	{ "pile_set_name": "DM Mathematics" }
ve -5k - 4h = 7, -37k + 32k + 2 = h for k. 1 Solve 5 = -3o + 4z + z, o + z - 9 = 0 for o. 5 Solve -220j + 218j + u = 7, -j - 2u - 11 = 0 for j. -5 Solve c = -5r - 15, -8c = -4c - r + 18 for c. -5 Solve -3s + 5 = -a, 34s = -5a + 39s - 25 for a. -5 Solve 3j - 7j - 2t = 10, -2j - 5t = -7 for j. -4 Solve -b - 3s - 1 = -4, s = b + 1 for b. 0 Solve -2a - 21 = -5f, 3f + 3 - 22 = -2a for f. 5 Solve -o = 4, -7o - 72 = -5w - 24 for w. 4 Solve -6o + 3o - 8 = 4j, -4o - 11 = 5j for j. 1 Solve m - 2r - 16 = 3r, 16 = -3m - r for m. -4 Solve 2y = 5i - 5, -5 = -3y - 2i - 3 for y. 0 Solve -3y + 5y - d = 6, 0 = y + 3d - 3 for y. 3 Solve 5j + 14 = 10j - 3a, 3j - 3a - 6 = 0 for j. 4 Solve 5a + 1 = -2g + 5, 4a + 2g = 4 for a. 0 Solve r - 3n = -10, 4r + n + 39 - 25 = 0 for r. -4 Solve 3r + 76u = 74u - 7, -5u - 5 = -5r for r. -1 Solve g + g = -3x + 20, 0 = 2x - 8 for g. 4 Solve -2m - 2h - 2h - 6 = 0, 5m = h + 29 for m. 5 Solve 0 = j - 4, -4 = -k - 2j + 6 for k. 2 Solve 2w - 1 = 4a - 5, 4w = -3a - 8 for w. -2 Solve -3m - 5a = 33 - 11, 0 = -2m - 2a - 8 for m. 1 Solve 29a = 23a + 2p + 10, -5p + 32 = 4a for a. 3 Solve 4d - 7 = 3q, -2q + 5q = -4d + 25 for d. 4 Solve -b = -4u + 2 + 1, -5b + 2 = -3u for u. 1 Solve -5o + 8 = -2m + 2, -m + 3o - 4 = 0 for m. 2 Solve -2t + 4t - 2i - 12 = 0, -2i - 13 = -3t for t. 1 Solve -a = -2t + 4, 2 = 4a - 51t + 52t for a. 0 Solve -28 = 4b - 6f, -b + 13 = -3f + 26 for b. -1 Solve -2x = 4d + 16, 3x = 9d - 11d - 4 for x. 2 Solve -5h - 8 = -2b, -2b - 5h - 10 - 2 = 0 for b. -1 Solve -11 = c + 2v, 3c + 5v - 10v = 11 for c. -3 Solve -25 = -5q, 4f - 3q - 174 + 201 = 0 for f. -3 Solve 5k = 0, 0 = 3t + k - 7 + 1 for t. 2 Solve 5v + 10 = 5g, 2g = 6v - v + 1 for v. 1 Solve 17 = -u + 5h, -3u + h - 5h + 25 = 0 for u. 3 Solve 0 = 2r - g, 0g + 12 = 2r + 5g for r. 1 Solve 0u = 4h - u + 1, -4u = 5h + 17 for h. -1 Solve v + v + 5m = 17, -2v - 10 = -4m for v. 1 Solve 4s = 6s - 2q, 5 = 5q for s. 1 Solve 10x = 14x, -q - 2 = -4x - 0x for q. -2 Solve 1 - 6 = 5p, 3n - p = 1 for n. 0 Solve 3o + 6 = -2z, 4z - 17o = -12o + 32 for z. 3 Solve -6j + 2q = -3j + 13, -4j - 18 = -3q for j. -3 Solve 12 = -5q + 3k + 31, 2q + k - 1 = 0 for q. 2 Solve 0d - 14 = -3d - n, 3d = -2n + 13 for d. 5 Solve -3j = -3b - 14 - 4, -5b + j = 14 for b. -2 Solve 3k + 3w = -6, 3k - 2w = 2w + 8 for k. 0 Solve 5p - 3l = -13, -9p + 5p = -l + 16 for p. -5 Solve -4x + 4g = 0, 4g = 3x - 2x - 3 for x. -1 Solve -2t + 3i + 10 = 0, 5i + 16 = t - 3 for t. -1 Solve -10k + 6k + 4 = 2o, -5k + 5o = -35 for k. 3 Solve -2y + 2z + 6 = -2, 5y - 3z - 18 = 0 for y. 3 Solve 5a + 20 = -2b + 7b, -4a + 2b - 6 = 0 for a. 1 Solve 2a + 18 = -17j + 19j, 5a - 3j + 37 = 0 for a. -5 Solve -3m - 10 = -5j + 3j, 2m = -5j - 13 for j. -1 Solve y + 2s = -3, 4y - 7y - s - 4 = 0 for y. -1 Solve j = -5x - j - 33, -2x + 3j = -2 for x. -5 Solve f + 24 = -5i, -15i + 11i - 3f = 17 for i. -5 Solve -10 = -2x - 4m, -3x + 4m + 2 = 37 for x. -5 Solve 0 = 4n + 2f - 6, n + 1 = 9f - 7f for n. 1 Solve -27 = -3t + 3u, 2u - 10 + 3 = -3t for t. 5 Solve 0q - q + l = 0, q = -3l - 16 for q. -4 Solve 3p - 5s = -10s + 23, -4s + 16 = 0 for p. 1 Solve 2y + 7t - 4 = 5t, -3y + 4t = 29 for y. -3 Solve 2w = -5d + 8 + 3, -d + 16 = 5w for w. 3 Solve 0 = 4i - 4t + 16, -7t = -5i - 5t - 8 for i. 0 Solve 8o + c + 1 = 7o, 5o - 3c = 3 for o. 0 Solve 2i = -4u + 22, 3u = -17i + 13i + 24 for i. 3 Solve 3 = n, -6o + 4o + 3n = 13 for o. -2 Solve 31i - o = 29i, 5i + 9 = -2o for i. -1 Solve 8 = -w + 2a, 38 = -3w - 3a + 32 for w. -4 Solve 5h - 5 = -4r, -1 + 6 = r for h. -3 Solve 59 = 4s + 47, -3s + 12 = 3j for j. 1 Solve 0 = -b - 3, -4 = 2c + 5b + 5 for c. 3 Solve 24 = 4j - 4s, -6 = -5j - 5s + 4 for j. 4 Solve -4w - 26 = -3c, 2 = -5w - 4c - 15 for w. -5 Solve -u = 4y - 5, -4y = -2y - 2u for y. 1 Solve 8o + 4w = 3o + 22, -4o - 4w + 20 = 0 for o. 2 Solve -5r - 30 = 4v, 5v + 4 = 3r - 15 for v. -5 Solve -2n + 5z + 0 + 3 = 0, 2n = -z + 9 for n. 4 Solve -4y + 3p = 6p - 18, -y = -p - 1 for y. 3 Solve -5q = 5m + 20, 3q - 3m = -q - 9 for q. -3 Solve -1 - 3 = 4k + w, -3w + 10 = k for k. -2 Solve 0 = y - 4r + 2r + 1, 12 = 4r for y. 5 Solve 0 = 5z + 2f - 4, -3f = 2z - 3 + 8 for z. 2 Solve 0 = -2z - 5r - 31, 0 = 2z - 5r + 3 - 22 for z. -3 Solve 2k = -2t + 12, k + 47 = 2t + 38 for t. 5 Solve 5p - 2h - 14 = 16, -3p + 2 = 2h for p. 4 Solve -5m = 3v, 0v = -v + m for v. 0 Solve -5u + 5b + 35 = 0, 6b - 3 = -u + 5b for u. 5 Solve 0h + 7 = -4h - v, 3v - 15 = 0 for h. -3 Solve 5i = 0, 4l = -l + 3i + 20 for l. 4 Solve 3g + 9x = 7x + 12, -5g + x + 20 = 0 for g. 4 Solve 0 = 2p + p + 5n, 13 = 5p + 4n for p. 5 Solve -5k - 2 = -v, -4v + 8 = 151k - 153k for v. 2 Solve 5m = 3m - 5c - 16, 7 = -5m + 4c for m. -3 Solve -5n + y = 22, 4n - 4y = -0y - 8 for n. -5 Solve -t - 3i + 1271 - 1259 = 0, 17 = -4t + i for t. -3 Solve 9q - 4g + 5 = 8q, -q + 3g = 4 for q. -1 Solve -2f = 5y - 5f - 22, 3y + 3f + 6 = 0 for y. 2 Solve 8 = -2l, o + l = 1 - 0 for o. 5 Solve -k + 15 = -5c, 4c + 11k - 14k + 12 = 0 for c. -3 Solve -5n + 5m + 25 = 0, 14n - 11n + 6m = 15 for n. 5 Solve -l + 29 = 5c, -4l - 25c = -20c - 41 for l. 4 Solve -4b - 28 = 4x, 0b = 4x + b + 19 for x. -4 Solve -3a - 4 = -2p + 2, -5a = 5p + 35 for p. -3 Solve 0 = -l + 2p - 5, -3p - 16 = -4l - 7p for l. 1 Solve -5z - 5 = -5n, 21n = -z + 17n - 11 for z. -3 Solve 0 = 2v - p + 13, 4v - p = 3p - 32 for v. -5 Solve -5u - 6 = -2x - 4, -x = u - 1 for x. 1 Solve 2s - 2g - 103 + 105 = 0, 14 = -2s - 2g for s. -4 Solve g - 6x + 13 = -3x, 18 = 2g + 5x for g. -1 Solve f = 0, 5q - f - 15 = 4f for q. 3 Solve -5r + r + 21 = -3b, -r = -2b - 9 for b. -3 Solve -2q + 4 = 10, -4f = -q - 23 for f. 5 Solve -y - 22f + 23f = 0, 9 = 3f for y. 3 Solve 0 = -i - 4l + 11, 0 = 3i - l + 12 + 7 for i. -5 Solve 5c - 5y - 7 = 8, 0 = -y - 1 for c. 2 Solve 4k - 8h + 5h = -13, -5k = h + 21 for k. -4 Solve h - 5h = 5z - 21, 0 = -5h + 2z + 18 for h. 4 Solve -81t + 2p + 24 = -77t, 0 = 5t + 5p - 15 for t. 5 Solve -4u - 7 = g + 5, -g - 9 = 3u for u. -3 Solve -2 = p, 0 = -2q - 3p + 12 - 6 for q. 6 Solve -o + j = o - 5, -o + 2j - 2 = 0 for o. 4 Solve 3m - 5m = -5w + 6, -3w - 4 = -5m for w. 2 Solve -5q - 12 = -2s, 29s - 33s = -q + 12 for s. -4 Solve -o = -2y - 4o - 1, 15 = 3y - o for y. 4 Solve -3f + 4o = -21, -7f - 5o = -6f + 12 for f. 3 Solve 3k - 1 = 6d - 4d, -3k - 3d = -21 for k. 3 Solve 0 = 5y - 2z + 4, -y + 44z = 46z + 8 for y. -2 Solve 5b - 11 = 35t - 31t, -3t - b = -6 for t. 1 Solve 0 = -b - 4z - 17, b - 12 = 5b + 2z for b. -1 Solve -22x + 24x + 2u = -18, 0 = u + 4 for x. -5 Solve -4s - 16 = 2d, 18s - 19s - 4d + 3 = 0 for s. -5 Solve -4t + v = -6t, 0 = -3t + v for t. 0 Solve 0 = 7x - 6x + 2n - 2, 0 = 4n for x. 2 Solve 5f = -3z - 9, -4z = -3f - 50 + 33 for f. -3 Solve 2t = -4m + 8, 2t - 3m = 2m - 19 for t. -2 Solve 2k + 4o - 8 = 0, -3k + 10 = -2k + 5o for k. 0 Solve -4 = 2f - 4f, -2h + 4 = -f for h. 3 Solve -3h + 9m - 4m = 5, -13 = h + 4m for h. -5 Solve 0 = -3l + 4n + 35, 0n + 5n = -3l - 10 for l. 5 Solve -2j = 2z + 4, -j + 5 = -z + 1 for j. 1 Solve -4r + 9 + 7 = 4f, -4f + 17 = 5r for f. 3 Solve 0 = -2c + 2v - 2, 0 = 3c - 3v - v + 8 for c. 4 Solve 0 = 3l - 6, -6 = 2h + 2l - 4 for h. -3 Solve -2l = 5v - v + 10, -5v = 4l + 5 for l. 5 Solve m + 24 = -5c - 3m, 0 = -4m - 4 for c. -4 Solve -4y = -3d - 4, 0 = -5y - 5d + 45 - 40 for y. 1 Solve 15 = x + 3g, -10x - 2 = -8x - 2g for x. 3 Solve -4i = -2i - 4p + 10, -i - 2p + 15 = 0 for i. 5 Solve 4j = -3u - 19, 0 = -u - 2 + 1 for j. -4 Solve 9 = 3t, -m - 624t + 622t + 9 = 0 for m. 3 Solve t + 4 = -y, 2 = 4y - 3t + 11 for y. -3 Solve 4t = 5m - 37, -5t = -4m + 47 - 12 for t. -3 Solve -6j = -j - 5g - 5, -3g = -2j + 4 for j. -1 Solve m + 19 = -5q, -4q + m + 21 = 38 for q. -4 Solve 2s + f = 3 - 11, 3s =	{ "pile_set_name": "DM Mathematics" }
actor of 1241920484? True Does 99 divide 36229784? False Does 75 divide 726870525? True Does 76 divide 100070972? False Is 88521238 a multiple of 607? True Does 2399 divide 29452523? True Is 641951576 a multiple of 871? False Is 77029320 a multiple of 2840? True Is 18893942 a multiple of 35? False Is 1928372400 a multiple of 141? True Is 173442500 a multiple of 1190? True Does 3220 divide 493775409? False Is 6 a factor of 6995580? True Does 5 divide 675387055? True Is 256564 a multiple of 1597? False Is 739231 a multiple of 2? False Does 47 divide 3692430820? False Is 705096 a multiple of 36? True Is 18 a factor of 105003720? True Is 288649232 a multiple of 126? False Does 376 divide 2849329128? True Is 204583425 a multiple of 25? True Does 4933 divide 365425475? False Is 1495184304 a multiple of 516? True Does 275 divide 496883200? True Is 724794924 a multiple of 244? True Does 2725 divide 93165025? True Is 68568912 a multiple of 582? True Is 327528887 a multiple of 2688? False Is 54933414 a multiple of 26? False Is 60 a factor of 30389940? True Does 8 divide 5128144? True Is 337 a factor of 44515066? False Does 103 divide 445000405? False Does 57 divide 80725167? True Does 133 divide 496749946? True Does 226 divide 119209802? True Does 700 divide 46620000? True Is 896702222 a multiple of 38? False Is 5 a factor of 7887411? False Is 1608 a factor of 788183712? True Is 50 a factor of 762100347? False Does 76 divide 2785185528? True Is 299354306 a multiple of 13? False Does 21 divide 3442677? True Is 69139047 a multiple of 1377? False Does 6703 divide 803112580? False Is 18 a factor of 117849240? True Is 9855878 a multiple of 17? False Is 7625 a factor of 467368112? False Is 5631305 a multiple of 31? True Is 23737160 a multiple of 269? False Is 873139021 a multiple of 11? False Is 88092307 a multiple of 40? False Does 191 divide 277726033? True Is 16 a factor of 743138? False Does 13 divide 2789835319? False Is 3107597868 a multiple of 4518? True Is 42 a factor of 9268938? True Is 633346625 a multiple of 125? True Is 206437158 a multiple of 746? False Does 1543 divide 103036373? False Does 1617 divide 237501028? False Does 97 divide 273683366? True Is 7128 a factor of 3099681241? False Is 57 a factor of 58558722? True Is 43 a factor of 124794686? True Is 442313497 a multiple of 73? True Does 149 divide 6975921468? False Is 163432932 a multiple of 156? True Does 2277 divide 1113108956? False Does 1797 divide 124758222? False Is 107310024 a multiple of 47? True Is 745 a factor of 236194800? True Does 48 divide 282592608? True Is 117 a factor of 14874795? True Does 84 divide 46612526? False Is 1052462958 a multiple of 31? True Is 9779 a factor of 1124360083? True Does 2481 divide 1628572919? False Does 703 divide 211556602? True Is 47416834 a multiple of 113? True Is 6843 a factor of 1009155043? False Is 32 a factor of 599422491? False Is 3042 a factor of 514694232? True Is 122465729 a multiple of 46? False Is 51928327 a multiple of 251? False Is 20 a factor of 46289220? True Is 272 a factor of 42419010? False Does 311 divide 449506338? True Does 17 divide 114017464? False Is 3668533428 a multiple of 14686? True Is 36618812 a multiple of 5? False Is 26 a factor of 204119543? False Is 1088717912 a multiple of 168? False Does 4 divide 38879? False Is 38 a factor of 74132119? False Is 8232545 a multiple of 6? False Does 207 divide 33700014? True Is 27585001 a multiple of 15? False Does 104 divide 141209432? True Does 65 divide 20086237? False Is 12307848 a multiple of 1281? True Does 17 divide 17455622? False Is 67 a factor of 24755191? False Is 313104607 a multiple of 11? False Is 24 a factor of 1532537952? True Is 7219516649 a multiple of 2159? False Is 380682161 a multiple of 151? False Is 157988467 a multiple of 193? False Is 1005052715 a multiple of 409? False Does 12 divide 87162163? False Is 537837249 a multiple of 43? True Is 196603977 a multiple of 159? True Is 792 a factor of 23737314? False Does 10 divide 1296920? True Is 145 a factor of 99391955? False Does 91 divide 109397925? True Is 108671688 a multiple of 12? True Does 847 divide 67022082? False Is 59 a factor of 157165439? True Is 41 a factor of 2010682886? True Is 750771780 a multiple of 30? True Is 10 a factor of 108934634? False Is 64 a factor of 67252948? False Is 2030 a factor of 492780741? False Is 145 a factor of 179893670? True Does 5489 divide 251626738? True Is 117695890 a multiple of 3558? False Is 76 a factor of 10860972? False Does 7477 divide 626721039? False Does 719 divide 87351733? False Does 109 divide 6433862? False Is 47852640 a multiple of 1881? True Is 11603306 a multiple of 22? True Is 14591444 a multiple of 1198? False Is 16 a factor of 1398184352? True Is 133718328 a multiple of 963? True Is 71 a factor of 175238224? True Does 2883 divide 319251888? True Does 313 divide 4110044629? True Is 80 a factor of 172900800? True Is 83833461 a multiple of 81? True Is 3173 a factor of 951354244? True Does 420 divide 81213864? False Is 2059 a factor of 738377057? False Does 224 divide 107722272? True Is 20326020 a multiple of 2860? True Is 7713476 a multiple of 15? False Is 24762926 a multiple of 43? True Is 53389953 a multiple of 18? False Is 5 a factor of 14767677? False Is 236901642 even? True Is 98908323 a multiple of 199? False Does 417 divide 10403388? False Does 187 divide 128189663? False Is 163058675 a multiple of 131? False Does 2427 divide 42210384? True Is 865776360 a multiple of 2281? True Is 3 a factor of 20783983? False Is 12 a factor of 1970480? False Is 21 a factor of 92512959? True Does 435 divide 2632273020? False Is 40138811 a multiple of 8? False Is 2621 a factor of 9066126? False Is 98295084 a multiple of 678? True Does 570 divide 2112607530? True Does 33 divide 485709239? False Is 162 a factor of 51817479? False Is 10945365 a multiple of 1078? False Is 1117 a factor of 170084473? True Is 4 a factor of 143208? True Is 20 a factor of 2287715080? True Is 1552 a factor of 123532664? False Is 393597320 a multiple of 113? False Does 69 divide 72770022? True Does 34 divide 623758812? False Does 327 divide 470397338? False Is 2691 a factor of 28294489? False Does 25 divide 807474800? True Is 106461712 a multiple of 931? True Does 241 divide 298286857? False Does 1670 divide 377560280? True Does 1065 divide 15061230? True Is 20227760 a multiple of 656? True Does 14 divide 607941684? True Is 1032 a factor of 38765718? False Does 862 divide 3219456261? False Is 5410288 a multiple of 104? True Is 33726798 a multiple of 33? False Is 4100 a factor of 565349000? True Does 10 divide 41667151? False Does 4 divide 58307364? True Does 4428 divide 540871344? True Is 467327160 a multiple of 45? True Is 29006328 a multiple of 372? True Is 181 a factor of 36287785? True Is 130559561 a multiple of 64? False Does 53 divide 29100607? False Is 821614666 a multiple of 1013? False Is 32907420 a multiple of 1372? True Does 9 divide 518783976? True Is 440 a factor of 20408223? False Is 23 a factor of 12837071? False Is 38 a factor of 13532630? False Is 112177548 a multiple of 81? True Is 67441653 a multiple of 96? False Does 164 divide 901326780? True Does 101 divide 814813561? True Is 1798 a factor of 62579244? False Is 54 a factor of 10677258? True Is 1021488709 a multiple of 45? False Does 7331 divide 596384181? True Does 14 divide 1215036928? True Does 26 divide 677248042? False Is 455088876 a multiple of 44? True Is 106479011 a multiple of 423? False Is 36122765 a multiple of 2? False Is 18 a factor of 53543383? False Does 3057 divide 20047806? True Is 12519955 a multiple of 2345? True Is 2990 a factor of 296437910? False Is 121833128 a multiple of 2284? True Does 3838 divide 324560295? False Is 30004775 a multiple of 179? False Is 1997 a factor of 96884402? False Is 17 a factor of 3080757? True Does 813 divide 5978620? False Is 1490 a factor of 162934480? True Does 300 divide 233931900? True Is 103899924 a multiple of 276? True Does 20 divide 4723070? False Is 9620754 a multiple of 444? False Is 2 a factor of 2713117? False Is 6 a factor of 1764556581? False Does 4 divide 3228785? False Is 571530793 a multiple of 1093? True Does 33 divide 298501566? True Is 15500190 a	{ "pile_set_name": "DM Mathematics" }
cked without replacement from {o: 13, k: 4, l: 3}? 156/1615 Two letters picked without replacement from {l: 7, x: 1}. What is prob of picking 1 l and 1 x? 1/4 Calculate prob of picking 3 x when three letters picked without replacement from xxeepxepe. 1/84 Three letters picked without replacement from {z: 4, v: 7}. Give prob of picking 1 v and 2 z. 14/55 What is prob of picking 1 q and 3 f when four letters picked without replacement from qfffqfqqqffffqqfffqq? 99/323 What is prob of picking 1 y, 2 s, and 1 l when four letters picked without replacement from {j: 3, s: 1, y: 3, o: 5, l: 1}? 0 Calculate prob of picking 2 j when two letters picked without replacement from zzjjjzjjjzjzzjzjjzzj. 11/38 What is prob of picking 1 m, 1 q, and 2 r when four letters picked without replacement from {q: 1, b: 1, m: 2, r: 3, l: 1, w: 3}? 1/55 Four letters picked without replacement from yasctycctcayaycycy. What is prob of picking 1 y, 1 t, and 2 c? 1/17 What is prob of picking 1 y and 2 v when three letters picked without replacement from {y: 3, v: 15}? 105/272 Three letters picked without replacement from {s: 1, i: 2, x: 4, u: 1, y: 1}. Give prob of picking 3 x. 1/21 Three letters picked without replacement from {h: 1, m: 2, r: 10, a: 5, w: 2}. What is prob of picking 1 r, 1 m, and 1 h? 1/57 Calculate prob of picking 1 e, 1 v, 1 t, and 1 y when four letters picked without replacement from {t: 1, v: 1, m: 1, e: 1, y: 2, u: 2}. 1/35 Two letters picked without replacement from mhjrc. What is prob of picking 1 c and 1 h? 1/10 Three letters picked without replacement from {w: 5, e: 3, f: 1, i: 1, n: 5}. Give prob of picking 1 i, 1 n, and 1 f. 1/91 Three letters picked without replacement from {v: 2, b: 3, t: 10}. Give prob of picking 2 v and 1 b. 3/455 What is prob of picking 2 j and 1 f when three letters picked without replacement from {w: 2, j: 2, f: 1, t: 7}? 1/220 Two letters picked without replacement from sqyym. What is prob of picking 1 y and 1 q? 1/5 What is prob of picking 3 t when three letters picked without replacement from {t: 4, e: 3, j: 5}? 1/55 Two letters picked without replacement from {n: 10}. What is prob of picking 2 n? 1 Four letters picked without replacement from {v: 1, a: 5, g: 5}. What is prob of picking 3 a and 1 v? 1/33 Two letters picked without replacement from sqsciqsssis. Give prob of picking 1 c and 1 s. 6/55 Calculate prob of picking 1 w and 3 t when four letters picked without replacement from {w: 2, b: 1, t: 4, e: 2}. 4/63 Four letters picked without replacement from {p: 6, i: 3, z: 5, e: 1, o: 3, d: 1}. What is prob of picking 2 i, 1 z, and 1 e? 5/1292 What is prob of picking 1 b and 1 v when two letters picked without replacement from {b: 1, v: 1, g: 2, x: 1, y: 1, i: 1}? 1/21 What is prob of picking 1 a, 1 q, and 1 n when three letters picked without replacement from naqqhhzhnzqzqznhzznz? 4/285 Calculate prob of picking 1 u, 1 b, and 1 y when three letters picked without replacement from ubxbpxxypykubx. 3/91 What is prob of picking 1 z, 1 v, and 1 g when three letters picked without replacement from {l: 1, h: 1, w: 1, g: 2, z: 1, v: 1}? 2/35 Calculate prob of picking 1 q and 1 a when two letters picked without replacement from mjnmqqqjnmam. 1/22 Two letters picked without replacement from {z: 15, s: 3}. Give prob of picking 2 s. 1/51 Two letters picked without replacement from wwwwhwhwwwwhwhwwwh. Give prob of picking 2 h. 10/153 Four letters picked without replacement from {t: 2, k: 6, e: 4, p: 1, j: 2}. What is prob of picking 2 t and 2 e? 2/455 Two letters picked without replacement from rrmjx. Give prob of picking 1 x and 1 j. 1/10 Two letters picked without replacement from {t: 2, h: 2}. Give prob of picking 1 t and 1 h. 2/3 Three letters picked without replacement from {d: 2, l: 3, t: 1, x: 1, y: 4}. Give prob of picking 1 t, 1 y, and 1 l. 4/55 Calculate prob of picking 1 u and 3 i when four letters picked without replacement from {m: 2, q: 5, r: 1, u: 2, p: 1, i: 5}. 1/91 Four letters picked without replacement from eeeeeeeeeheeeee. What is prob of picking 4 e? 11/15 Three letters picked without replacement from {n: 2, u: 3, i: 4, k: 1, e: 1, r: 1}. What is prob of picking 1 i, 1 n, and 1 e? 2/55 Calculate prob of picking 1 t and 2 o when three letters picked without replacement from oiimoooomomiotdiooo. 15/323 Calculate prob of picking 1 r and 1 i when two letters picked without replacement from {m: 1, r: 1, i: 1, k: 2}. 1/10 What is prob of picking 1 n and 1 r when two letters picked without replacement from xgxpgixrxgnrrg? 3/91 Four letters picked without replacement from woooooowow. What is prob of picking 2 w and 2 o? 3/10 Calculate prob of picking 1 t and 1 y when two letters picked without replacement from yjtqqptky. 1/9 Two letters picked without replacement from yyyypyyyyyypyypy. Give prob of picking 1 p and 1 y. 13/40 What is prob of picking 3 g and 1 s when four letters picked without replacement from gewspgwwwgwg? 4/495 What is prob of picking 1 n and 1 h when two letters picked without replacement from chschssshsshszsn? 1/30 What is prob of picking 1 q, 1 y, and 2 m when four letters picked without replacement from {m: 5, q: 1, y: 5, v: 1}? 10/99 What is prob of picking 2 p when two letters picked without replacement from eteppppettteppp? 1/5 Four letters picked without replacement from {b: 2, t: 3, m: 3, h: 2, i: 3}. What is prob of picking 3 m and 1 i? 3/715 What is prob of picking 1 e and 1 k when two letters picked without replacement from {k: 2, w: 1, p: 3, d: 3, e: 1, o: 1}? 2/55 Calculate prob of picking 3 b when three letters picked without replacement from {h: 1, p: 4, b: 3}. 1/56 Four letters picked without replacement from uucvuuucchgvvghhu. Give prob of picking 3 h and 1 g. 1/1190 Calculate prob of picking 2 x and 1 b when three letters picked without replacement from {b: 5, x: 4, y: 7}. 3/56 Calculate prob of picking 1 m and 1 p when two letters picked without replacement from lzvlzpvlmcmllvvll. 1/68 What is prob of picking 1 t and 1 y when two letters picked without replacement from ytytyt? 3/5 What is prob of picking 2 m when two letters picked without replacement from nuiuumuio? 0 Two letters picked without replacement from {u: 3, q: 2, i: 4, j: 1}. What is prob of picking 1 i and 1 j? 4/45 Two letters picked without replacement from {o: 3, l: 3, p: 1}. What is prob of picking 2 o? 1/7 Two letters picked without replacement from {l: 4, v: 6}. What is prob of picking 2 l? 2/15 Four letters picked without replacement from ufuuffqquqbubqbqqqqq. What is prob of picking 1 f and 3 u? 2/323 What is prob of picking 2 s when two letters picked without replacement from fsfffssssffsfs? 3/13 What is prob of picking 4 t when four letters picked without replacement from ftteetteeffeetee? 1/364 Three letters picked without replacement from fddfdddd. What is prob of picking 3 d? 5/14 Four letters picked without replacement from zzuuuzyu. Give prob of picking 2 u, 1 z, and 1 y. 9/35 Two letters picked without replacement from {g: 1, r: 11}. What is prob of picking 2 r? 5/6 Two letters picked without replacement from hhzhzhhhzh. Give prob of picking 1 z and 1 h. 7/15 Three letters picked without replacement from swsrosswssrosms. What is prob of picking 1 m and 2 r? 1/455 What is prob of picking 2 y and 1 z when three letters picked without replacement from yyhhpnhzphyhzphpp? 3/340 What is prob of picking 1 x and 1 c when two letters picked without replacement from {g: 7, x: 2, c: 6, h: 3, y: 1}? 4/57 Calculate prob of picking 2 s, 1 k, and 1 e when four letters picked without replacement from {e: 2, d: 2, k: 2, s: 4}. 4/35 Calculate prob of picking 1 a, 1 d, and 2 s when four letters picked without replacement from {c: 5, p: 3, s: 5, d: 4, a: 1}. 2/153 What is prob of picking 2 b and 1 s when three letters picked without replacement from {n: 5, b: 4, s: 1, y: 2, o: 1, t: 2}? 6/455 What is prob of picking 4 k when four letters picked without replacement from {o: 12, k: 6}? 1/204 Calculate prob of picking 1 y, 2 r, and 1 s when four letters picked without replacement from rsrryry. 12/35 Two letters picked without replacement from {k: 1, b: 9, m: 2, u: 2}. Give prob of picking 1 b and 1 u. 18/91 Three let	{ "pile_set_name": "DM Mathematics" }
tor of 70 and i. 14 Let c be (-4)/18 + (-7552)/36. Let r = -78 - c. What is the highest common factor of r and 33? 33 Let x be 5 - -3 - (-4 - -11). Calculate the highest common factor of x and 6. 1 Let g(n) = -4n2 + 81n + 3. Let o be g(18). Let i be ((-6)/4)/(2/(-20)). What is the highest common divisor of i and o? 15 Suppose -9x = -7x + 24. Let n be (-222)/(-11) - x/(-66). Calculate the highest common factor of 20 and n. 20 Let k be 3 - ((-1)/1 + -2). Let h = 67 - 39. Suppose -b + kb + 2v - 52 = 0, -3b + 2v = -h. Calculate the greatest common factor of b and 110. 10 Let l = 335 - 63. What is the greatest common divisor of l and 170? 34 Let q(f) = f3 + f2 + f + 1. Let o be q(-1). Suppose op - p + 12 = 0. Suppose -160 + 40 = -2n. Calculate the greatest common factor of n and p. 12 Let m = 94 + -73. What is the greatest common divisor of 42 and m? 21 Let z(v) = v + 1. Let q be z(4). Suppose -3s + 20 = -6g + g, 0 = -qs - g - 4. Let t be (s + -1 + 13)/1. What is the greatest common divisor of t and 48? 12 Let d be (-552)/(-115)(-10)/(-4). Let i be 1/(4 + 30/(-8)). Calculate the highest common divisor of i and d. 4 Let u be ((-8)/6)/((-44)/(-1914)). Let t = u - -84. Calculate the highest common divisor of 78 and t. 26 Let j(z) = -z*3 + 3z*2 + 2z - 1. Let b be j(4). Let w = 0 - b. Suppose 3c - 2c - 54 = 0. Calculate the highest common factor of c and w. 9 Let r(u) = -u*3 + 21u - 20. Let z be r(-6). Calculate the highest common divisor of z and 80. 10 Let j(l) be the third derivative of 2/3l3 - 1/24l*4 + 11l*2 + 0 + 0l. Let w be j(3). What is the highest common factor of w and 2? 1 Let x be 5/20-1 + (-98)/(-8). Let d be (1 - (-198)/x) + 3/2. Calculate the greatest common factor of d and 114. 19 Suppose m + 2m = -3w + 273, 4m - 363 = -3w. Calculate the greatest common factor of m and 105. 15 Let o(h) = 2h*2 - 12h - 7. Let n = -16 + 23. Let b be o(n). What is the greatest common factor of 1 and b? 1 Suppose -2c + 0 = 3h - 14, 17 = 3h + 5c. Let k(b) = -b*2 + 7b - 4. Let z be k(h). What is the greatest common factor of 12 and z? 4 Let i = -3440 - -5409. Calculate the greatest common divisor of 11 and i. 11 Let i = 6 - -16. Let v = i - 3. Let j = -199 + 294. What is the highest common divisor of v and j? 19 Suppose b - 3i = 2b - 7, 0 = -4b + 3i + 103. Let r be 3/6(-3)/1(-22)/3. What is the highest common factor of b and r? 11 Let n = 254 - 247. Calculate the greatest common divisor of n and 707. 7 Let s = -92 + 1901. Calculate the greatest common divisor of s and 18. 9 Suppose -3p + 1972 = 57d - 56d, -d = 2. What is the greatest common factor of 14 and p? 14 Let p(n) = -n - 6. Let v be p(-16). Suppose -9k = -vk + 140. What is the greatest common factor of 56 and k? 28 Let y(o) = -o3 - 6o*2 - 4o - 3. Let g be y(-6). Let n(l) = 5l + 23. Let c be n(-4). What is the greatest common factor of g and c? 3 Suppose -162 = 31u - 34u. Calculate the highest common factor of 450 and u. 18 Let s be (-538/(-15))/((-1)/(-6)). Calculate the highest common divisor of s and 532. 76 Suppose b - 19 = 3n, 4n = 2b - 3b - 16. Suppose 0 = bi - 0i - 16. Let l = 27 - i. What is the highest common divisor of l and 46? 23 Suppose q + 2j = 14, -q - 4j - 42 = -4q. What is the highest common divisor of q and 16? 2 Let w be (5 - 6) + (-14)/(-1). Let p be -5 + w + 2/(-1). Suppose -4h + 2n = -52, 5h + 3n = pn + 64. What is the greatest common factor of h and 42? 14 Suppose h - 150 = -5h. Let n = 12 - h. Let c = 28 + n. What is the highest common divisor of 3 and c? 3 Suppose 2u - 3b = 242, u + 5b = -0u + 95. What is the greatest common divisor of 46 and u? 23 Let g(b) = -2b + 10. Let a be g(-4). Calculate the highest common factor of 342 and a. 18 Let x be (-139)/((2/(-8))/((-12)/(-16))). Calculate the highest common factor of x and 3. 3 Let o(b) = b*3 + 2b*2 + b + 1. Let u be o(-1). Calculate the greatest common factor of 19 and u. 1 Let t = 1345 + -1055. What is the greatest common factor of 50 and t? 10 Suppose -10f + 33 = -1087. Calculate the highest common factor of 560 and f. 112 Suppose -5w = 4m - 311, 0w + 248 = 4w + 4m. Let u(a) = 2a*2 + 43a - 8. Let d be u(-22). What is the highest common factor of w and d? 7 Suppose 4a = -5z - 3150, -789 = 2a - 2z + 777. Let g be a/(-30) + (-2)/12. Calculate the greatest common divisor of g and 26. 26 Let n be 22 - 13/(-13). Suppose -56 = -k - nj, 2k + 4j = 88 + 24. Suppose 2z + k = 3l, l - 2z - 2 = 2z. What is the highest common divisor of l and 55? 11 Let o be 2/(-13) + 435/39. Let m be ((-4)/(-10))/(7/630). Suppose -m = 3k - 168. Calculate the highest common divisor of k and o. 11 Let h(l) = -l3 - 10l*2 - 10l + 27. Let r be h(-9). Calculate the highest common divisor of r and 369. 9 Let f(z) = -z*3 + 7z*2 - 5z - 5. Let y be f(5). Calculate the highest common factor of y and 20. 20 Let o(u) = -u*3 - 4u*2 - 3u. Let q be o(-4). Let g be 0/(-2 - -4) + 48. Calculate the highest common factor of q and g. 12 Suppose -7h + 463 = 239. What is the greatest common divisor of 608 and h? 32 Let o(c) = 65c + 943. Let l be o(-14). Suppose -5a + 5j - j = -998, 2a = -2j + 392. Calculate the greatest common factor of l and a. 33 Suppose 5s = -5t - 0s, 16 = 3t - s. Suppose 0 = -tn - 12, 4y = -y - 2n + 219. Let k be (-71)/(-4) + 8/32. What is the highest common factor of k and y? 9 Let j(g) = g2 + 6g + 5. Suppose 5i - 12 + 42 = 0. Let v be j(i). Suppose 0y + 4h = 4y, vy = 4h + 5. What is the greatest common factor of 1 and y? 1 Let n(l) = -l - 3. Let f = 19 - 23. Let o be n(f). Calculate the highest common factor of o and 4. 1 Let g(j) be the third derivative of -j*6/120 - 7j*5/60 + 7j4/24 + j3/3 - 13j2. Let o be g(-8). What is the greatest common factor of o and 80? 10 Let f = -1861 + 2165. Calculate the highest common factor of 38 and f. 38 Suppose -4l + 455 = -3l. What is the highest common factor of 35 and l? 35 Suppose 1012 = 37c + 7c. Calculate the greatest common factor of c and 667. 23 Let z(t) = 7t + 13. Let s be z(4). What is the greatest common divisor of 2 and s? 1 Let o be (240/84)/(0 - (-1)/14). Calculate the greatest common factor of o and 64. 8 Suppose -16 = -2c - 2x, c + 11x - 5 = 7x. Suppose -7h + ch = 24. Calculate the greatest common factor of 228 and h. 12 Let q be -53(0 - -1)/(-1). Suppose -3k = 2l - 36, 0l + q = 3l + 4k. Suppose -33 - 1167 = -10u. Calculate the highest common divisor of l and u. 15 Let v be (-47 - -22) + 22/(-4). Let p be (-11)/9 + v/(-117) - -3. What is the highest common factor of 1 and p? 1 Let l = -630 - -1065. Calculate the highest common divisor of 87 and l. 87 Let j = -2 - -11. Suppose 5a - ja + 132 = 0. Suppose 2b = -b + a. Calculate the highest common divisor of b and 55. 11 Let o(a) = -35a. Let y be o(1). Let c be (y/2 + 1)/(6/(-16)). Calculate the highest common divisor of 66 and c. 22 Suppose 0 = -9c + 734 + 814. What is the greatest common divisor of c and 4? 4 Let x(k) = 7k - 1. Let w be x(1). Let n be (23/(-2))/(((-44)/(-24))/(-11)). Let b = 84 - n. Calculate the greatest common divisor of b and w. 3 Suppose -n - 4q = -46 + 6, 4q = n - 48. What is the highest common factor of 11 and n? 11 Let x be 4/(-6)(-195)/10. Let c = -3 + x. Let a = 2 + c. What is the highest common divisor of a and 8? 4 Let v(b) = b3 - 5b*2 + 7b + 1. Let o be v(3). Suppose k = 3k - o. Calculate the highest common divisor of 14 and k. 2 Let h be (-2512)/(-6) + 96/72. What is the highest common divisor of 294 and h? 42 Let u(q) = 7q*2 + 4q - 1. Let s be u(-3). Suppose 0f + s = 5f. Let v = 7 + -2. What is the highest common divisor of f and v? 5 Suppose 11u - 14u = -12. Suppose un = t + 124, -4t - 40 = -2n - 9t. What is the highest common factor of n and 15? 15 Suppose 82u - 83u = -21. What is the greatest common divisor of 63 and u? 21 Let d(i) = -6i + 1. Suppose 4t + 12 = 4m, -2t - 3m + 0 = -4. Let x be d(t). Calculate the highest common factor of x and 14. 7 Let g(n) = -n. Let v be g(-1). Let f(y) = 18y*2 - 2. Let a be f(v). Let x = -39 + 55. Calculate the greatest common factor of a and x. 16 Let n be (6 - 0)10/15. Su	{ "pile_set_name": "DM Mathematics" }
decimal places? -1.36 What is -13.452 rounded to the nearest ten? -10 What is -1379500 rounded to the nearest 100000? -1400000 Round 0.068071 to 2 dps. 0.07 What is 5793000 rounded to the nearest 100000? 5800000 Round 140300 to the nearest one thousand. 140000 What is -0.000000324 rounded to 7 decimal places? -0.0000003 Round 0.00008583 to 5 dps. 0.00009 Round 862.35 to the nearest 100. 900 Round -0.009718 to 4 dps. -0.0097 What is -0.001001 rounded to 4 decimal places? -0.001 What is -0.001776 rounded to four decimal places? -0.0018 What is 0.05813 rounded to 2 dps? 0.06 Round 0.000000496 to 7 dps. 0.0000005 Round 16.457 to the nearest one hundred. 0 What is 0.0000003005 rounded to seven dps? 0.0000003 Round 168380 to the nearest one hundred thousand. 200000 What is -7400 rounded to the nearest 100? -7400 Round 0.00171 to four dps. 0.0017 Round -2116100 to the nearest ten thousand. -2120000 What is -1742 rounded to the nearest 1000? -2000 Round 5.32 to zero decimal places. 5 What is -0.99094 rounded to two decimal places? -0.99 Round 0.30356 to one dp. 0.3 Round -0.000050304 to 5 decimal places. -0.00005 Round -0.000000064397 to seven decimal places. -0.0000001 What is -20.673 rounded to the nearest integer? -21 What is 0.00198 rounded to 4 decimal places? 0.002 What is -11.853 rounded to zero dps? -12 Round -8396 to the nearest one hundred. -8400 Round 2896900 to the nearest 10000. 2900000 What is -306.8 rounded to the nearest ten? -310 What is 18.33 rounded to 1 dp? 18.3 Round 117.639 to zero dps. 118 Round 6.2234 to 2 decimal places. 6.22 What is -683280 rounded to the nearest 10000? -680000 Round -1012.35 to the nearest integer. -1012 Round -53724000 to the nearest 100000. -53700000 What is -0.000011104 rounded to 7 decimal places? -0.0000111 Round 0.0012094 to four dps. 0.0012 Round 0.000094 to five dps. 0.00009 What is 82800 rounded to the nearest ten thousand? 80000 What is 11399 rounded to the nearest 100? 11400 What is 0.0006147 rounded to four dps? 0.0006 Round 42.85 to the nearest ten. 40 Round -3315000 to the nearest one million. -3000000 What is -0.000001778 rounded to six decimal places? -0.000002 Round -0.000769 to five dps. -0.00077 Round -0.000008319 to 6 dps. -0.000008 What is 63009000 rounded to the nearest 1000000? 63000000 What is 0.000011777 rounded to 6 decimal places? 0.000012 What is -0.0000040125 rounded to 7 dps? -0.000004 Round 1.7911 to one decimal place. 1.8 Round 527.6 to the nearest 10. 530 What is -965300 rounded to the nearest 100000? -1000000 What is -0.00071481 rounded to five decimal places? -0.00071 What is 0.0029122 rounded to 4 dps? 0.0029 Round 0.03819 to 3 decimal places. 0.038 Round -1247.59 to the nearest one hundred. -1200 Round 105420 to the nearest 1000. 105000 What is -0.00186784 rounded to 4 decimal places? -0.0019 What is -0.21382 rounded to three decimal places? -0.214 What is -752270 rounded to the nearest 1000? -752000 Round 0.00218683 to 4 dps. 0.0022 What is -0.000545151 rounded to five dps? -0.00055 What is 9.31 rounded to 1 decimal place? 9.3 Round 0.0000039861 to six decimal places. 0.000004 What is -0.62848 rounded to one decimal place? -0.6 What is -0.0000069 rounded to five decimal places? -0.00001 What is 0.095 rounded to two decimal places? 0.1 Round 0.005648 to 3 dps. 0.006 What is 0.00481 rounded to three dps? 0.005 Round 13560 to the nearest 1000. 14000 What is -276140000 rounded to the nearest one million? -276000000 Round -0.0000032555 to seven dps. -0.0000033 Round 654300 to the nearest 10000. 650000 What is -3816700 rounded to the nearest ten thousand? -3820000 What is -6.48 rounded to the nearest integer? -6 What is -0.00051 rounded to 4 dps? -0.0005 Round 105240 to the nearest ten thousand. 110000 What is 2.33986 rounded to one decimal place? 2.3 Round 0.2604 to two decimal places. 0.26 Round -0.000057408 to seven decimal places. -0.0000574 What is 0.021897 rounded to 3 decimal places? 0.022 Round 10620000 to the nearest one million. 11000000 What is 0.008908 rounded to four dps? 0.0089 What is 0.000002721 rounded to seven dps? 0.0000027 Round -16050 to the nearest one thousand. -16000 What is 0.000126192 rounded to six decimal places? 0.000126 What is 146.18 rounded to the nearest 10? 150 Round 0.050801 to 2 decimal places. 0.05 Round 1.4018 to 2 decimal places. 1.4 What is -11454 rounded to the nearest 1000? -11000 Round 1228740 to the nearest 100000. 1200000 What is -62770000 rounded to the nearest 1000000? -63000000 What is -0.00251 rounded to three decimal places? -0.003 Round -9154000 to the nearest 1000000. -9000000 Round 157510 to the nearest ten thousand. 160000 What is 0.2535 rounded to 2 dps? 0.25 What is -0.43939 rounded to three dps? -0.439 Round -0.1206 to 3 dps. -0.121 What is 1.315 rounded to 2 dps? 1.32 What is -0.6138 rounded to one decimal place? -0.6 What is -1075 rounded to the nearest one hundred? -1100 What is -0.000113 rounded to four decimal places? -0.0001 Round -0.08076 to 2 decimal places. -0.08 What is -445.65 rounded to the nearest one hundred? -400 Round 108100 to the nearest 100000. 100000 Round -5032000 to the nearest one hundred thousand. -5000000 Round -185640 to the nearest ten thousand. -190000 What is 0.0012147 rounded to four decimal places? 0.0012 What is -0.000065148 rounded to 6 decimal places? -0.000065 Round -0.022723 to three dps. -0.023 What is 0.208808 rounded to three dps? 0.209 What is -0.042233 rounded to three dps? -0.042 Round -939.4 to the nearest one hundred. -900 What is -134991 rounded to the nearest ten thousand? -130000 Round -715.8 to the nearest ten. -720 Round -129170 to the nearest one thousand. -129000 What is 0.000005765 rounded to seven dps? 0.0000058 Round 8015000 to the nearest 10000. 8020000 What is -0.12587 rounded to two decimal places? -0.13 What is -0.01897 rounded to two decimal places? -0.02 What is 2381530 rounded to the nearest 10000? 2380000 Round -2537000 to the nearest one hundred thousand. -2500000 What is 0.000000192 rounded to 7 dps? 0.0000002 Round -166900 to the nearest ten thousand. -170000 Round 151600 to the nearest 1000. 152000 Round 52.09 to the nearest integer. 52 Round 21.66 to the nearest ten. 20 What is 0.022262 rounded to three decimal places? 0.022 What is -85.185 rounded to one dp? -85.2 Round 0.00882 to 4 decimal places. 0.0088 What is 22493400 rounded to the nearest 100000? 22500000 Round 0.0063661 to 4 dps. 0.0064 What is 1.6268 rounded to zero dps? 2 Round -2538.1 to the nearest one hundred. -2500 Round -0.0040781 to 5 decimal places. -0.00408 What is -0.00011544 rounded to 6 decimal places? -0.000115 Round 3060.81 to the nearest one hundred. 3100 Round 2017 to the nearest 100. 2000 Round 126.61 to the nearest integer. 127 What is 0.00050225 rounded to 4 dps? 0.0005 Round -238.93 to 0 decimal places. -239 What is 4430000 rounded to the nearest 100000? 4400000 What is -0.000073824 rounded to six decimal places? -0.000074 Round 4.19 to one dp. 4.2 What is 2289000 rounded to the nearest 100000? 2300000 What is 162250 rounded to the nearest ten thousand? 160000 Round -0.03057 to 4 dps. -0.0306 What is 6.92 rounded to the nearest 10? 10 Round 0.00731 to 3 decimal places. 0.007 What is -0.000000127177 rounded to seven decimal places? -0.0000001 Round 3.7847 to 0 decimal places. 4 What is -8740 rounded to the nearest one thousand? -9000 Round -280130 to the nearest 10000. -280000 Round -0.0000000189 to seven dps. 0 Round -0.00048005 to six dps. -0.00048 Round 215.87 to the nearest 10. 220 Round -6290 to the nearest one hundred. -6300 Round -639.8 to the nearest one hundred. -600 What is -0.37136 rounded to 2 dps? -0.37 What is 86390000 rounded to the nearest one million? 86000000 Round -116450 to the nearest 10000. -120000 What is 0.024331 rounded to 2 decimal places? 0.02 Round -1371620 to the nearest ten thousand. -1370000 Round 0.07293 to two decimal places. 0.07 What is -223.9 rounded to the nearest 100? -200 What is 8314000 rounded to the nearest one million? 8000000 Round 0.18239 to three dps. 0.182 Round 232.5 to the nearest ten. 230 Round 15.7665 to the nearest integer. 16 What is 0.2297 rounded to two dps? 0.23 Round -4687000 to the nearest one hundred thousand. -470	{ "pile_set_name": "DM Mathematics" }
. Which is the closest to 0? (a) -5 (b) o (c) 3 b Let v be 20/(-9) + 6/27. Let i = -0.28 - -118.28. Let r = i - 119. What is the closest to r in -17, v, -0.4? -0.4 Let d = 1.83 + -2.5. Let g = -6.33 + d. Let s = 4 + g. Which is the closest to 0.3? (a) -5 (b) 1 (c) s b Let l = -2493 + 2493. What is the closest to 3 in 72, -1, l? l Let a = -427/5 - -85. Let i = -688 - -19255/28. Let f = -5/28 + i. What is the closest to f in 2, a, 4? a Let h = -0.4086 + 0.0086. Which is the closest to -0.19? (a) -0.01 (b) h (c) 0 a Let t = 2/27709 - 221690/249381. What is the closest to -8 in t, 1/4, -3, 15? -3 Let l = -0.32 + 0.72. Let n = 10.01 + -103.91. Let a = n + 94. What is the nearest to a in l, 3, 1/8? 1/8 Let z be (-1 - -2)(-12 + (-150)/(-12)). Which is the closest to z? (a) 40 (b) -2 (c) 0.24 c Let x = 55427/6 + -9238. Suppose 2p = -2p - 4. Which is the nearest to 0.1? (a) p (b) -1/11 (c) x b Let n = 14.2 - -50.6. Let o = n + -65. Which is the closest to -1/4? (a) -4 (b) -0.1 (c) o c Let w = -10.9 + 11. Let j = -0.3 + w. Suppose 7512u + 54 = 7494u. What is the nearest to j in 2/47, -0.3, u? -0.3 Let q = -0.20664 + 0.14664. What is the closest to q in -4, 3/5, 0.048, -5? 0.048 Let s = 16 - 14. Suppose sl = 3l + 10. Which is the closest to l? (a) -2/17 (b) 1 (c) 5 a Suppose 0 = 2p + 6p + 16. Let u = 1.1 + 3.9. Suppose 0 = 6g - 10 + 40. Which is the closest to -4? (a) g (b) p (c) u a Let g be (3/2)/(6/8). Let h = -264 - -265. Let v = -4 - h. Which is the closest to g? (a) v (b) 1 (c) 1/3 b Let w be (-7)/(-49) + 6/50444. What is the nearest to -0.4 in 19, -1, w? -1 Suppose 581 = 5w - 0g - 4g, 3g + 238 = 2w. Which is the closest to w? (a) 2 (b) -3 (c) 1/2 a Let n be ((-3)/(-66))/(2/(-8)). Let g be (-2)/3 + 5/3. Let b be (-2)/6g30. What is the nearest to -2 in n, -3, b? -3 Let q = 0 - -1. Let s be 1/q2/14. Let o be 345/207(9 + (2 - 9) - (-18)/(-10)). Which is the nearest to o? (a) 0.7 (b) 3 (c) s c Let k = -1.0817 + 1.1817. Which is the nearest to k? (a) 2 (b) 0.84 (c) 2/3 (d) -4 c Let m = 39560 - 39559.9. Let p = 3.2 + 0.8. What is the closest to m in 13, -0.4, p? -0.4 Let y = 0.5815 - 0.4815. Which is the nearest to y? (a) -2/3 (b) 3 (c) -11 (d) -2 a Let d be (-451)/(-8) - 48/128. Let y = d - 50. What is the nearest to y in -2/5, 0.2, -2/7? 0.2 Suppose 3y + 162 = -168. Suppose 3m = 2a + 325 - 338, -5m = 35. What is the nearest to 1 in y, -5, a? a Let r = -8589 - -17179/2. Which is the nearest to -2/9? (a) 15 (b) r (c) 24 (d) 4 b Let o = 0.33607 + -0.23607. What is the closest to -1326 in o, 3/5, 2/13? o Let n = -3177.9 + 3178. Which is the closest to -2? (a) -1/5 (b) 17 (c) n (d) 1 a Let n = -0.35 - -0.45. Let o = -8.8 + 17.8. What is the closest to 1 in n, 0.5, o? 0.5 Let l = -4557 - -4525. Which is the closest to 0.2? (a) 4 (b) 2 (c) l b Let k(o) = -o3 - 5o*2 + 6o - 3. Let g be k(-6). Let j = -155493.96 - -155494. What is the closest to -0.1 in j, -0.5, g? j Let o = -0.1271 - -0.1271. Let g = -39 + 42. Let l = -21/22 - -5/11. What is the closest to 4/11 in l, o, g? o Let z = -6.7 + 7. Let u(g) = 1045g + 143163. Let j be u(-137). Which is the nearest to j? (a) z (b) 3/4 (c) -8 (d) 1/3 a Let r = -268 - -268. Let u be (-10 + 8)(3/3 - 0). What is the closest to r in -1/9, 2/9, u? -1/9 Let w = -119/6 - -20. Let s = -4.59 - -4.363. Let i = s + 0.127. Which is the nearest to 1? (a) w (b) 3/4 (c) i b Suppose 0 = 3x - 5p + 26, -2205x + 2206x = -4p + 31. What is the nearest to -2/7 in -76, x, 0.1? 0.1 Let x = 9.3 - 3.3. Let i = 370/3 + -124. Let z = 0.2 + 0.1. What is the closest to x in z, i, -2/11? z Let x = 5.03675 + -0.03675. Which is the closest to 2/3? (a) x (b) -1 (c) -2/7 (d) -7/15 c Let k = 3992/6051 - -14/2017. Which is the closest to -1/7? (a) -0.3 (b) 2/7 (c) -1 (d) k a Let m = -1561 - -1463.7. Let v = -97.2 - m. Let o = 2 + -1.9. Which is the nearest to o? (a) v (b) 2/9 (c) -28 a Let y(h) = h3 - 4h*2 - 4h + 6. Let p be y(5). Suppose p = -3a - r, -17 = 3a - r - 4r. What is the nearest to 1 in a, -3/5, 5? -3/5 Let c = -184.234 + 184. Let r = 20.034 - 20.1. Let f = c + r. What is the nearest to 0 in f, -3, -1? f Let z = -7.08 + 7.48. Which is the nearest to z? (a) 1/5 (b) 2/7 (c) -2 (d) 3 b Let n = -23496 - -70486/3. Which is the nearest to n? (a) -98 (b) -2 (c) -10 b Let h = -3791 + 22745/6. What is the nearest to 1/2 in h, -0.2, 8, 2/13? 2/13 Suppose 0 = -0o - 3o - 5d + 29, 2d = 5o - 7. Let g = -4.6 + 4.3. Let j = -0.6 + 0.6. What is the closest to j in 4, o, g? g Let n = 2053 + -2048. What is the nearest to 2/21 in 1, 1/2, n? 1/2 Let u = -419.5 + 420. Let d = 5.8 - 5.6. Which is the closest to 7? (a) 3 (b) d (c) u a Let v = 35.662 - 36.662. What is the nearest to v in 3/2, -5, 4, -0.01? -0.01 Let x = -174 - -194. Let k be -12x/56 + 4. Which is the nearest to -3? (a) 2 (b) -3/2 (c) k b Let w be ((-162)/24 + 0)/((-3)/12). Let t = -29 + w. Let q = 0.3 + 1.7. Which is the nearest to 2/3? (a) t (b) -1/4 (c) q b Let h = 11348 + -79308/7. Let m = h + -626/35. Which is the closest to m? (a) -0.6 (b) -1/5 (c) -0.4 b Let t = -85.5 + 85.6. Which is the closest to -21? (a) 0 (b) -0.14 (c) 0.5 (d) t b Let u = 131 - 395/3. Let y = 6.28 + -6.18. What is the nearest to u in y, 0.3, 8? y Let z = 2704 - 2704.3. Suppose -3f + 18 = -3. Which is the closest to f? (a) 0.1 (b) z (c) 9 c Suppose 5q = 7 - 132. Let o = -0.04 + 5.04. Which is the closest to -1? (a) q (b) o (c) -5 (d) 1 d Suppose 3t - 5y = -951, -2y = y. Let s = t + 322. What is the closest to -2/5 in 2/3, s, -0.19? -0.19 Let p = -0.9 + 1. Let z = -0.001 + -14.799. Let c = 15 + z. What is the closest to c in p, -9, -5? p Let g(f) = 6f3 - 2f*2 - 37f + 37. Let l be g(1). Which is the nearest to -5? (a) l (b) -0.05 (c) -1/3 c Suppose -4y - 2y = 210. Let k = y - -26. Let c be (k/6)/((-22)/4). What is the nearest to 2/5 in -1/3, c, -0.1? c Let n = 39.77 - 3.17. Let t = n + -26.6. Which is the nearest to -1? (a) -0.2 (b) t (c) 0.3 a Let z be 12/(15/5)(-12)/(-24). Suppose 0t + 3 = -3t - 3f, 2t = -3f - 5. What is the closest to z in -1/17, t, -0.1? t Let s be (10 - 172/16)/(((-342)/(-48))/1). Which is the closest to -2/19? (a) -4 (b) 3 (c) -2 (d) s d Let m = -8368.2 - -8368. What is the nearest to -7 in m, -2/7, -4/21? -2/7 Let w = -0.602 - -55.002. Let h = w + -58.4. What is the nearest to -0.1 in -1, -5, -0.01, h? -0.01 Let n = -4.6946 + -0.3054. What is the closest to 0.22 in -2, n, -4? -2 Let o = 0.24 + 0.06. Let x = 103 + -102.8. Let g = -34/19 - -18/95. Which is the closest to -1/4? (a) g (b) o (c) x c Let b = -304 + 303.819. Let j = b + 0.081. What is the nearest to 1/26 in j, 2/3, -4? j Let s = -72 + 498. Let x = s + -427. What is the nearest to x in -91, 2, -2/17? -2/17 Let j be 2(-1)/4(25 - 707). Suppose -340 = o - j. Which is the nearest to -1? (a) 5 (b) o (c) 0.5 (d) -0.3 d Let q = 71676704/330012153 - -664/73483. Let t = -2/499 + q. Which is the closest to 1/3? (a) -0.3 (b) t (c) -5/3 b Let f = -0.82 - 4.68. Let w = -1.5 + f. Let q = w + 6. What is the closest to 0.1 in -0.05, q, -3? -0.05 Let h be (-4)/(-22) - (-29)/22. Let b = 115725 - 115720.0089. Let j = 0.0089 + b. What is the closest to 0.08 in -0.1, h, j? -0.1 Let d = -0.4 - 0. Let o = -311/5 - -73. Let q = o - 11. What is the nearest to 1 in -1, d, q? q Let f = 9 - 33. Let o = f + 7. Let v = o + 16.6. What is the nearest to -3/4 in -0.5, v, -5? -0.5 Let j = -7.005 - -13.005. Which is the closest to 0.2? (a) -1 (b) j (c) 2 (d) -3/7 d Let s = -163 + 165. Suppose 2 = -16d + 82. Let y be (-4)/(-10) + (-14)/(-15). What is the nearest to s in d, y, -0.1? y Suppose -7p + 4p = -21. Suppose p - 22 = -3w. Suppose -48 = -wh - a, 3h + 3a - 39 + 3 = 0. What is the nearest to h in 2/9, 5, 3/4? 5 Let j = -6704 - -33519/5. Which is the closest to -6/113? (a) -0.5 (b) -3 (c) j c Let z = 7573 - 7573.6. Which is the nearest to 0.2? (a) 0.3 (b) z (c) -20 a Suppose -1356q + 1306*q = 100. Which is the nearest to q? (a) 0 (b) 9 (c) 5 (d) 1 a Let b = -5.53 - -5.13. Let c = 207 - 206.96. What is the nearest to -2 in b, 4, 0.2, c? b Let s be 12/70 + (-6)/(-15	{ "pile_set_name": "DM Mathematics" }
pose 3h + a = 18, -8h + a = -7h - 6. Solve b = -cw - w - h for w. -2 Let x be 12/(-30) + (-38)/5. Let h be x/40 - 4/5. Let m be h/7 + (-90)/(-42). Solve -9 = -mu - 1 for u. 4 Let l(m) = 3m3 - m2 - m + 4. Let c be l(0). Suppose -f - 6 = f + 5x, 0 = -f - 3x - c. Solve -2y = fy + 12 for y. -3 Suppose 3 - 29 = -2r - 4l, 0 = -2l - 2. Solve 0 = 3j + r - 12 for j. -1 Let i(b) = b*3 + 3b*2 - 3b - 11. Let a be i(-4). Let l be 3(1 + a/(-5)). Solve -5v = -v + l for v. -3 Suppose 2 = 2c - 4. Suppose 0 = 2k - 9 + c. Let u be -3(-3)/(9/k). Solve -10 = 5l - ul for l. -5 Let h(p) = 2p + 15. Let v be h(-4). Solve -vi + 10i = 12 for i. 4 Suppose -2k = 5y - 35, -k + 4y - 10 = y. Let w be (-8)/20 + 7/5. Solve z - w = -k for z. -4 Let u = 8 - 5. Suppose 4p + 5q + 4 = 0, 2p - 12 - 8 = uq. Let v(r) = r3 - 4r*2 + 2r - 5. Let y be v(p). Solve -yc = c + 20 for c. -5 Let a(r) = r2 + 5r - 9. Let n be a(-6). Let l be (2/4)/((-203)/70 - n). Solve ls = -0s for s. 0 Suppose -2q + 4a = -16, 11 = 4q + 2a - 3a. Solve -qk - 4 = 2 for k. -3 Suppose 4d - d + 3d = 0. Suppose n + 2y = 6, -3n - 2y = 2y - 12. Suppose 3a - 2a - 1 = n. Solve dp - a = -p for p. 1 Suppose -24j + 6j = -36. Solve h + jh = -6 for h. -2 Let u = 1 + -6. Let r be (0/2)/(5/u). Solve r = -5h - 5 for h. -1 Let b = 2 - -2. Suppose 3z + 5g - 12 = 0, -3g + 0 = z - b. Let p be 1/1 - 0/(-3). Solve 0 = -3s + z - p for s. 1 Suppose 0 = -2o - o - w - 8, -5w - 30 = 5o. Let n be 4 + (3/o)/3. Let l be (-1)/((n + -5)/2). Solve 2z = -l - 5 for z. -3 Suppose 112 = 41v - 175. Solve 0 = n + 6 - v for n. 1 Let z be -2 + 1 - 20/(-10). Let r be (6 - -1 - z)1. Suppose -2q = 2b, 2q - 6 = 2b + r. Solve q = -5d + 8 for d. 1 Suppose -5j - 27 = 4a - 0j, 0 = 2j + 6. Let w be a/(-4) + 69/4. Let g be (2 + -1)/((-2)/(-6)). Solve -go + 3 - w = 0 for o. -5 Let d be (-994)/(-126) - 3/(-27). Solve -d = -11b + 13b for b. -4 Suppose -x - 4g = -15, -4x = -5g - 0 + 3. Suppose -2k - 11 = -l - 2l, 0 = xk + 3. Suppose -7 - l = -s. Solve 3h + 2h = -s for h. -2 Let h be (16/(-6))/(16/(-24)). Suppose -hp + p + 24 = 0. Suppose v = -0c + 2c + p, 2v - 9 = -3c. Solve -s + v = s for s. 3 Let s(p) be the second derivative of p6/720 - p5/40 + 5p4/12 + 3p. Let a(x) be the third derivative of s(x). Let l be a(7). Solve -3f = -f + l for f. -2 Suppose 4u - 10w + 6w - 36 = 0, w + 15 = 2u. Solve u = -12n + 10n for n. -3 Let h(b) = b3 + 9b*2 + 6b - 13. Let d be h(-8). Suppose -2a = 4 - 10. Suppose g - 2 = v, -2g = ag - 4v - 10. Solve r - d = g for r. 5 Suppose -5s + 11 = 6s. Solve s = -h - 2 for h. -3 Let q be 45/(-18)(-36)/10. Suppose -5o + 15 = 3l, 0o + 3l = -o - q. Solve f - o = -3 for f. 3 Let l be 24/60 + 78/5. Suppose 4 = 4w - l. Solve 5 = -wb - 0 for b. -1 Let l = -43 + 56. Let s be l + (-32)/(-48)(-18)/4. Solve u + s = -4u for u. -2 Let m(u) = -3u - 12. Let y be m(-4). Let w be -3 - (-3 + y - 2). Solve q + w = 5 for q. 3 Let h(a) = -a*3 - 10a*2 + 45a - 118. Let n be h(-14). Solve 17w + n = -w for w. -2 Suppose 37 = -4a + 57. Suppose -4m + 2y - 22 = 0, 5m - 3y + 29 + 0 = 0. Let g = m + 7. Solve 2 + g = -aw for w. -1 Suppose -4o + 48 = 4s, 2s + 2s - 2o = 36. Suppose -2h - 2u = -s - 14, h - 27 = -4u. Solve 5 + h = 3f for f. 4 Let y = 53 + 37. Let q be (-4)/18 + 470/y. Solve -17 = qu - 7 for u. -2 Let v = -6 + 9. Solve 4 = -vq - 5 for q. -3 Let l be 12/4 - (0/1)/2. Let s(d) = 2d - 3. Let m be s(3). Solve -m = -2q + lq for q. -3 Let b = 37 + -35. Suppose -6r + 16 = -br. Solve -rg + 0g = -8 for g. 2 Let n = -4 + 16. Suppose -3h - 3q = -n, -7h + 19 = -2h + 4q. Solve h = -4t - 13 for t. -4 Suppose -16x + 20 = -12x. Suppose xk + 2c + c - 8 = 0, 2k - c - 12 = 0. Solve -2l + 6 = -kl for l. -3 Suppose 4q + 7 = 3p + 4, 0 = q + 2p - 2. Suppose -y - 3y + 26 = 2w, -22 = -4y + 2w. Solve q = -5o + 2o + y for o. 2 Let u(a) = 2a*2 + 3a - 4. Let v be u(-3). Let t be ((-8)/(-2))/4-1 - -1. Let y be v + 3 - (t - -3). Solve yo + 9 = -16 for o. -5 Let i = 26 + -24. Suppose 5r - ir - 10 = -2f, 5f = -3r + 25. Let q be 8/12-3 + f. Solve 0c + c - q = 0 for c. 3 Let c(a) = a - 10. Let m = -2 - -18. Let u be c(m). Solve 3q + 0 - u = 0 for q. 2 Suppose 2 + 0 = 2t. Suppose 0 = -2s + t + 7. Let q(n) = 5n2 + 5n - 98. Let m be q(-5). Solve 0 = -mx + 3x + s for x. -4 Let n be ((-280)/50 - -6)/(1/25). Let p = -9 + 3. Let f = p + n. Solve 12 = -fx - 0x for x. -3 Let j be (6/4 + -1)0. Suppose 5m = -jm + 25. Suppose -5n + 3s + 4 = 0, -mn = s - 9 - 3. Solve -nk - k = 0 for k. 0 Let a = 56 - 51. Suppose ab + 4f - f = 22, 5f - 18 = b. Solve -bu = -0u + 4 for u. -2 Let i(d) = -d*2 + 29d + 351. Let z be i(-9). Solve -zj = 1 + 8 for j. -1 Suppose 4b + 4g = -20, 0 = -3b - 0g + 4g + 13. Let o be b(-2)/46. Solve -6r + 6 = -or for r. 2 Suppose -7o = -12o - q + 190, 3o + 4q = 114. Solve 33x - ox - 5 = 0 for x. -1 Suppose 0 = q + 2q + 24. Let l(j) = -j - 4. Let i be l(q). Let t(w) = 26w - 491. Let k be t(19). Solve io - o - k = 0 for o. 1 Let g be (-75)/(-27) + (-4)/(-18). Let y(w) = -6w*2 - 526w - 326. Let n be y(-87). Solve 5f - n - g = 0 for f. 5 Let v = -43 - -20. Let z = 36 + -53. Let c = z - v. Solve -2u = -cu + 4 for u. 1 Let q(y) = y3 - 12y*2 + 39y - 9. Let d be q(6). Solve 0 = 20h + d - 69 for h. 3 Let q = -84 + 95. Suppose -15 = -3n + 2r + r, 0 = 3n + r - q. Solve -j - n = -2 for j. -2 Suppose -4o + 30 = -5x, o - 3x + 4 = 3o. Suppose 3q = -z + 2, -2q = -oz - q + 42. Suppose 0 = -zh + 6h + 10. Solve -3t + 1 = -h for t. 2 Let i(z) = -z*2 - 2z + 17. Let v be i(-9). Let p = v - -48. Solve -ps = s for s. 0 Let g be 23/7 + 8/(-28) - 1. Solve -gc + 7 - 3 = 0 for c. 2 Let u(w) = w*3 - 4w*2 - 46w. Let g be u(-5). Solve -3 = gl - 2l for l. -1 Suppose -2h + 7 - 7 = 0. Let p be ((-10)/(6 - 1))/(-1). Solve hg = pg + 4 for g. -2 Let k be -2 + 6 + (-1 - -2). Suppose 3b = -5q + 171, -kb + 57 = -q + 3q. Solve q - 11 = 5d for d. 5 Let m be (5/(-2))/((-2)/4). Let l(k) = 21k2 - 483k + 3. Let c be l(23). Solve 6 = mg - cg for g. 3 Let q be (-3)/12 - (-111)/12. Let f(b) = 3 - q - 5 - 2b + 3b. Let p be f(12). Solve -u = -0u + p for u. -1 Let t(c) = 5c*2 + 5c + 2. Let d be t(-2). Suppose -dg = -7g - 45. Solve 10j - gj = -4 for j. -4 Let t be 1/(((-3)/(-9))/((-14)/(-6))). Suppose -2z + 2u - 43 = -5z, 5z + u = 67. Let w = z - t. Solve 4 = 5m - w for m. 2 Let h = 47 - 35. Let k be (-32)/h(-3)/4. Solve k - 4 = n for n. -2 Let a(p) = -p*3 - 26p*2 - p + 14. Let y be a(-26). Solve 5b = -3b - y for b. -5 Let d(b) = -4b*2 - 7b + 2b3 + 14b - 3b3 + 3. Let z be d(-5). Let t(h) = -2h - 9. Let s be t(z). Solve -5 = -su + 20 for u. 5 Let w be 6 + (-10 - -2) + 6. Solve 17 - 1 = wm for m. 4 Suppose 0s + 2s = 4f + 30, 50 = 4s - 3f. Solve sr - 13r + 2 = 0 for r. 1 Let t(f) = -4f - 1. Let u be t(-2). Let b = 11 + -10. Let q(w) = -3w + 3. Let z be q(b). Solve z = -2o + uo for o. 0 Let v(f) = f2 + 3f - 24. Let o be v(4). Solve 0 = -oq - 19 + 3 for q. -4 Suppose 5d = 4u - 49, 5d = -13 - 12. Suppose uw = w + 5. Suppose -2 + 12 = 2s. Solve w - 6 = -sf for f. 1 Let g be 2/9 - (-1 - 10/(-45)). Let v be (g/3)/((-7)/(-42)). Solve -vl - l = -12 for l. 4 Suppose 4q = -3z - 3, 2q + 12 = 5z + 43. Let m be 3 + (-1 - (z - -3)). Solve -my + 3 + 1 = 0 for y. 1 Let w(a) be the third derivative of a5/20 + a4/8 + a3/6 - 6a*2. Let k be w(-2). Solve 16 = -kv + 3v for v. -4 Suppose 0 = -4m - 5u + 25, 3m - 21 = -5u + 4. Let d = -77 - -77. Solve m = -2t - dt + 4 for t. 2 Let v be 4/28 + (404/14 - -3). Solve 5o + v = 13o for o. 4 Let t be (10 - 3) + (-2)/1. Suppose i - 2x = -t, 0 = -x + 5 - 0. Suppose -2d = -3c + 4, -d = -3c + ic - 5. Solve -4v + 5v = -c for v. -2 Let h(b) = -3 - 32b + 9b + 12b + 10b. Let m be h(-6). Solve -20 = -mg - 5 for g. 5 Let p be (4 + 0)/43. Suppose -pb - 5j + 3j = 5, 0 = -2b + j + 6. Solve b + 14 = 5q for q. 3 Suppose -5z + 6 = -2h, 3h = -2z + 2h + 6. Solve -13 = -zl - 5 for l. 4 Suppose 0 = -3o - 346 + 511. Solve -55 = -3*w - o for w. 0 Suppose 0 = 1	{ "pile_set_name": "DM Mathematics" }
0 = 5r - nb - 19, 16 = 7r - 3r - 4b for r. 3 Let h be ((-104)/32)/(1/(-4)). Suppose hj = 18j - 25. Solve -c = jz - 6 - 23, -4z + 8 = -3c for z. 5 Let k(s) = 2s2 - 2. Let j be k(-3). Let n be (-13)/4 - (-4)/j. Let q be (-14)/n - 3/(-9). Solve -14 = -3a + 3p - 5p, qa + p - 21 = 0 for a. 4 Suppose 93 = 5p + 83. Solve q - 4q = pc - 6, 0 = 5q - 2c - 26 for q. 4 Let f = 138 + -134. Let x(j) be the first derivative of j4/4 - j3 - 2j2 + 5j + 1. Let r be x(f). Solve 5p + 5z = -r, p - 1 = -4z - 5 for p. 0 Let x = -14 + 14. Suppose x = 2t + 2 - 6. Suppose tl = 6l - 12. Solve 12 = -4j + 4r, -lj + 4 = -2r + 9 for j. 1 Suppose 15p = 19p + 31p. Solve -9 = 5r + s - 3, p = -2r - 2s - 4 for r. -1 Let s = -1 - -5. Suppose sa = a + 12. Solve o + 0o = w, w = ao + 6 for w. -2 Suppose 11m + 10m = -0m. Solve 0 = -l - i, 4i = -2l - mi + 4 for l. -2 Let h be -1 - -3 - 0 - -2. Suppose 5t + 2 - 3 = -3l, 5 = 3l + ht. Solve -4w = -2k + 26, 0 = -2k + lk - 4w - 41 for k. 5 Let c = 7 + -4. Let k(h) = 5h2 - 44 - 8h - 4h2 + 0h*2 + 39. Let t be k(9). Solve -tz - 5x = 4 + 9, -cz = -5x - 34 for z. 3 Suppose -5g = 4b - 16, 3b - 5b - 3g = -8. Solve -2w + 2 = -bo, 5o + 0w + 3w + 19 = 0 for o. -2 Suppose s + s - 4 = 0. Let a(b) = 2b*2 + 5b + 1. Let v be (-38)/247 - (-2 - 189/(-39)). Let x be a(v). Solve xz + 2 = -5j, s = 4j + 5z - 0 for j. -2 Let j(h) = -h*3 + 4h*2 + 21h - 50. Let y be j(6). Solve -7s + 3s = -t, 4s = -yt + 20 for t. 4 Suppose -5r - 10 = 3t, 5r = 4t - 22 - 23. Solve 1 = 3h - to + 14, 3h + 3o - 27 = 0 for h. 4 Suppose 5x - 21 + 1 = 0. Suppose -xl + 0l - 5j = -81, 0 = -3l + 2j + 55. Solve 0u + l = 3y - u, 4y = -2u + 12 for y. 5 Let f be (1 + 11)(-1)/(-4). Solve m = 3l + 3, 6 = 3m - f for l. 0 Let w(f) = f3 + 19f*2 + 2f + 4. Let p be w(-19). Let y = 54 + p. Solve 3i = -4z - 4, -4i + 0i = -z - y for i. 4 Let s = 72 - 42. Let n = -30 + s. Suppose n = -2z - 3z + 10, 106 = 4i + 3z. Solve -8u + 3u + 2f - 25 = 0, -f - i = 5u for u. -5 Let c be ((-35)/(-25) - -2 - 3)5. Solve b = 2, v - c = 6v - b for v. 0 Suppose 4s - 2s = -2, 0 = -3z + 5s - 22. Let c(o) = -o*3 - 2o*2 + 6. Let j be c(-4). Let d = j + z. Solve 3x - 18 - 5 = -4m, 0 = 4x + 5m - d for x. 1 Let k = 1 + -1. Let v be (k - -2) + (-8 - -19). Suppose 1 + 5 = 2o, 0 = -4z + o + v. Solve -w + 17 = 3t, -zw + 3 + 10 = t for t. 5 Suppose -13n + 258 = -7n. Let d = 45 - n. Solve -3b + 1 + 9 = 2h, 0 = -5h + db - 13 for h. -1 Let a be (-204)/(-153) - 22/(-6). Solve 4p + ai - 2 = 0, -3i - 8 = 2p - 5i for p. -2 Let x(r) = r*2 + 30r + 239. Let k be x(-11). Solve 5y = -a + k, 6a - a = -2y + 35 for a. 5 Let c = -18 - -21. Suppose 7m - 2 = 26. Solve 4w = ck - 8, 16 = mw + 2k + k for w. 1 Let x(t) = t*2 - 13t. Let z be x(13). Let g be z((-6)/4 + 2). Solve a + 4o - 15 = g, -2o = 4a + 13 - 3 for a. -5 Suppose -7a - 19a = -18a. Solve -j - 4d + 5 = a, -5j - 5d + 14 - 4 = 0 for j. 1 Let n = -26 + 17. Let r(j) = -14 - 3j + 5 - 12. Let i be r(n). Solve -2c - 2 = -5t + 1, 3t = -3c + i for t. 1 Suppose -5m + 65 = 20. Let y = -9 + m. Let z(t) = t*3 + 3t*2 - 4t - 7. Let h be z(-3). Solve 0 = 3i - 3, -3c + 4c + hi - 9 = y for c. 4 Let g be 18/8 - 3/12. Suppose -2a = -5k + 28, a = 4k + 2a - 12. Solve -w - 3 = z - 1, kz = -2w - g for z. 1 Let u(o) = -o*3 - 5o*2 + 28o + 133. Let m be u(-4). Solve -11 = -3y - 2j + 6j, my + 3j = 28 for y. 5 Let d = 24 - 24. Suppose -2c + 21 + 9 = d. Suppose h + 4 = -h, w = 4h + 33. Solve 2o - l - c = 0, -3o + 2l + 0l + w = 0 for o. 5 Let v be (2 + 4)/(-2 - 10/(-8)). Let p(m) = 5m + 46. Let g be p(v). Solve d - 3h = -h + g, -2d = -2h - 10 for d. 4 Suppose -6z + 5z = 23. Suppose -o + 4x = -35, -o + 19 = -3x - 14. Let h = z + o. Solve 0 = -ha + 3a + 3m - 10, 0 = 5m - 15 for a. -1 Let t be (-3)/30 + (-510)/(-100). Solve 2m = 2x + 5m - 14, 6 = -x + tm for x. 4 Suppose -4t + 3a + 39 = 0, -2t + 0t + 32 = -4a. Suppose -tc + 15 = -3c. Solve -p + 4 = 5n - 1, 4p = cn + 20 for p. 5 Suppose 20u - 39 = 7u. Solve 2m - 23 = -0m + uf, 3f - 5 = -5m for m. 4 Let j be 8 + -11 - (-20)/4. Solve -2r + 0r + 2 = -2g, -5r - 23 = jg for g. -4 Let x = -74 + 36. Let n be (x/3)/((-6)/36). Let b be (-1)/4 + 627/n. Solve y = 2l + b, 3y + 1 = 5l - 4l for y. -2 Let x = 283 - 280. Solve 5c - 2o + 12 = -1, 4o = -xc + 13 for c. -1 Let f(u) be the third derivative of u4/8 + 5u*3 - 7u*2. Let t be f(-9). Solve -tk = w - 8k + 17, 0 = w + 3k - 15 for w. 3 Let q be -23/6 + 10. Let o be (-4)/((7 + -1)(-3)/q). Solve -2i = oi + c, -3i = -c for i. 0 Let a(b) = b2 + b + 2. Let c be a(-2). Let k(i) = 25i - 612. Let j be k(25). Solve -t + 27 = 5w + 11, 3w + ct - j = 0 for w. 3 Let b(v) = 7v - 282. Let l be b(41). Suppose 5q = 3a - 24, 5a + 2q - 6 = 3. Solve -5y - li = -ay - 33, -2i = 5y - 30 for y. 4 Let p(o) = o2 - 5o + 8. Let b be p(6). Let a = 18 - b. Solve -au = 2j - 14, j = 3 - 2 for u. 3 Let v(n) = -n*2 + 19n + 25. Let b be v(19). Suppose b = -r + 6r. Solve -3z - rt - 5 + 0 = 0, -5z = 2t + 21 for z. -5 Suppose 35t = 39t. Solve t = 2v - 5l + 4 - 1, -4v - l = 17 for v. -4 Let f(s) = -8s2 + 5s + 3. Let t be f(4). Let q = t + 110. Solve -20 + q = -c - 5x, -x + 3 = c for c. 0 Let y = 314 + -311. Solve ya + 8 = 2x - 0x, -8 = -2x - 4a for x. 4 Suppose -22 = -69m + 65m - 2z, -3m + 21 = -3z. Suppose 7h = 2h. Solve -5i - 4t - 9 = h, -5i = mt - t + 5 for i. -5 Let v be (10/40)/((-1)/(-8) - 0). Solve 0w + 2m = -2w - v, 6 = -4w - 5m for w. 1 Suppose -x + 3u - 1 = 0, u + 9 = -2x + 14. Suppose 3s = 4s + 1. Let q = 9 + s. Solve -5 - 11 = 2n + 5g, 4n = xg - q for n. -3 Let i = -20 + 25. Suppose -h + 10 = -3f - ih, -3h - 4 = 4f. Suppose -2n + v = -4n + 9, -fn - 1 = 3v. Solve 2x - y = -8, -x = 2y + 2 + n for x. -5 Suppose -2 = 3s - 68. Suppose -10 + s = 3j. Solve 5t + 14 + 11 = 5r, t = jr - 20 for t. 0 Let r = 173 - 275. Let l = r - -282. Suppose -5d - d = -l. Solve -v = -3m + 2v + d, 0 = 2m - v - 15 for m. 5 Let u(v) = -2v*2 - 7v - 4v2 - 3v + 18 + v*3 + v. Let k be u(7). Solve -ko - 40 = 4l, 11 = -5o + l - 9 for o. -5 Let f(v) = 18v2 + 10v + 11. Let c be f(-1). Solve 0 = 3m + 3i + 3, 2m - 3i = -6 + c for m. 2 Let t = -873 + 876. Let s = 8 - 5. Suppose sg - 2g = 9. Solve 3w - 13 = 3a - 4, g = -ta - 5w for a. -3 Let i(l) = -l*2 - 3l + 14. Let c be i(-5). Let w be c + (-2 - -4) + -3. Solve -5a = 3g + 10, -4g = -wg for a. -2 Let d = 82 - 82. Let p be 2/(-5) + d + (-17)/(-5). Solve 1 = -pg + 5z + 10, 6 = 2g + 4z for g. 3 Let l be 288/24 + 1-10. Solve s = 2t + lt - 10, -5t = 5s for t. 2 Let f(d) = 60d + 1. Let a be f(2). Suppose 18w - 7w = a. Solve -2n - w = -c, -3n + 2c - 14 = -n for n. -4 Let i(m) = 3m*2 - 2m + 6. Let o be i(2). Suppose 5x = 4r + 4x - 3, -3r = -4x + o. Solve -14 = -w - 2w - 5l, 0 = rw + 2l - 4 for w. -2 Suppose 3l - 7 = -1. Suppose 10t - 8t - 2 = 0, 6 = h + 2t. Solve -9 = w - lw + b, b = -h for w. 5 Let v(w) be the second derivative of w*4/12 - 5w*3/2 - 7w*2 + 12w. Let q be v(16). Suppose 10u - 5u = 0. Solve qa = 2l - 6, -4l + ul = 0 for a. -3 Let f be ((-3)/(-2))/((-39)/(-182)). Suppose z - f = -a, -2 = a - 3z + 11. Solve 1 = -ac - 1, 0 = -o - 5c - 6 for o. -1 Suppose 0 = z - 2z. Let v(g) = g*2 + 6g + 2. Let l be v(-7). Suppose l = r + 6. Solve 0 = 3c - 5n + 11, -c + zn = -rn + 9 for c. 3 Suppose -5d - 1 = 4h, d - 3d + 18 = -3h. Solve 11 = f - 5t, f = -df - 3t - 2 for f. 1 Let i be -12(57/(-6))/1. Let w = i - 109. Solve -3t = -3b - 10 + 1, -wt + 19 = -3b for t. 5 Let j = -256 - -301. Solve 5a + j = -5f, f + 2a + 12 + 1 = 0 for f. -5 Let k(r) = -r2 + 5r - 4. Let v be k(4). Suppose 0 = 2j - vx - x + 2, 5j + 2x + 5 = 0. Let b = 9 + j. Solve -4q = 2n + b, -q + 4n = q - 6 for q. -1 Let j(v) = -3 + 3 + v2 - 8 + 3 + v. Let r be j(-3). Solve 0 = -5y + 4y + m + r, -2m = -5y + 2 for y. 0 Suppose 0 = -17s + 13s + 20. Solve -21 = -sa - 3o, a - 5o - 2 = -3*a for a. 3 Let u = -2828 - -2835. Solv	{ "pile_set_name": "DM Mathematics" }
, what is 11 - 202201? -202120 In base 6, what is -5 - 3315? -3324 In base 15, what is ad - 5? a8 In base 11, what is 1 - 16? -15 In base 12, what is -2 - 156? -158 In base 4, what is -2 + -20012? -20020 In base 8, what is 0 - -22? 22 In base 7, what is 21 - -1002? 1023 In base 15, what is -489e - 3? -48a2 In base 9, what is 517 - 8? 508 In base 9, what is -40 - 22? -62 In base 2, what is -101110 - 1? -101111 In base 10, what is -112 - 50? -162 In base 6, what is -12134 - -4? -12130 In base 5, what is 110 - -111? 221 In base 11, what is 6 - -23? 29 In base 6, what is -4 + -201? -205 In base 7, what is 12 + 135? 150 In base 4, what is 0 - 1030032? -1030032 In base 10, what is -4 + 507? 503 In base 16, what is -5 + -5? -a In base 8, what is 7 + 36? 45 In base 13, what is 12 - -26? 38 In base 9, what is 133 - 16? 116 In base 14, what is 1 + 493? 494 In base 5, what is -10 - -21443? 21433 In base 13, what is 11 + -15? -4 In base 12, what is -5 - -307? 302 In base 15, what is -1de + 0? -1de In base 2, what is 11110000 + 11? 11110011 In base 11, what is -5 - 684? -689 In base 12, what is -529 + -4? -531 In base 9, what is -2 - 5? -7 In base 3, what is 10 - -1022? 1102 In base 9, what is 245 + -47? 187 In base 15, what is -1b19 - -5? -1b14 In base 5, what is 2 + 11? 13 In base 4, what is -22 - -11? -11 In base 13, what is -4 + 5a3? 59c In base 11, what is -138 - -4? -134 In base 4, what is -10130 - -11? -10113 In base 12, what is 493 + 4? 497 In base 7, what is 1 - -12241? 12242 In base 10, what is -320 - -6? -314 In base 6, what is -1 - 122? -123 In base 15, what is -1c28 + 3? -1c25 In base 4, what is -2122 + 21? -2101 In base 3, what is 11 + 22? 110 In base 13, what is 4 - 20? -19 In base 5, what is 4 + -143? -134 In base 9, what is 0 - -47? 47 In base 11, what is -30 - -559? 529 In base 8, what is 16435 + 2? 16437 In base 13, what is 7 - -34a? 354 In base 2, what is -1001 - -1100100011? 1100011010 In base 14, what is -2 + -7a0? -7a2 In base 16, what is 4 + -ac? -a8 In base 15, what is -1 - 2e? -30 In base 6, what is 1223 + 5? 1232 In base 14, what is -26 + -c? -34 In base 9, what is 3 + -153? -150 In base 7, what is 16 - 3? 13 In base 5, what is -3124 + -3? -3132 In base 13, what is 66 + -16? 50 In base 4, what is 3 - -10310? 10313 In base 4, what is -10 + -1321? -1331 In base 15, what is 292 - 5? 28c In base 5, what is 112 - 30? 32 In base 2, what is -10011000100 - -1? -10011000011 In base 13, what is 3 + c2? c5 In base 5, what is -10 - 1? -11 In base 6, what is 2 - -5431? 5433 In base 4, what is 1002100 + -1? 1002033 In base 2, what is 1001101011 - 1? 1001101010 In base 15, what is 54d + -3? 54a In base 3, what is -10 - -10? 0 In base 10, what is 8 + 1705? 1713 In base 2, what is 100 - 10000101101? -10000101001 In base 6, what is 2 - 203? -201 In base 9, what is 145 + -50? 85 In base 8, what is -123 - 0? -123 In base 13, what is 1 + 3? 4 In base 9, what is -3 - -46? 43 In base 15, what is 14 - -65? 79 In base 12, what is -5 - -b9? b4 In base 7, what is 240 + 3? 243 In base 10, what is -36 - 14? -50 In base 3, what is -11 + -20020020? -20020101 In base 13, what is 41ab + 5? 41b3 In base 8, what is -1 + -741? -742 In base 14, what is 368 - -14? 37c In base 4, what is 11 - 11301? -11230 In base 3, what is 120112 + 1? 120120 In base 14, what is -2 + 1bc? 1ba In base 11, what is 3 - -117? 11a In base 2, what is -101000 + 11000? -10000 In base 14, what is -14 + -19d? -1b3 In base 9, what is 8 - 23? -14 In base 2, what is 10 + 11110? 100000 In base 10, what is 19 + -106? -87 In base 11, what is 4 - -a9? 102 In base 10, what is 1057 - 1? 1056 In base 5, what is 20314 - -1? 20320 In base 8, what is 737 + 7? 746 In base 12, what is 177 - 7? 170 In base 5, what is 0 - 3332? -3332 In base 14, what is -2a - 4? -30 In base 3, what is -101102 - 11? -101120 In base 15, what is -12d - 0? -12d In base 2, what is 111001100 - 100? 111001000 In base 15, what is -29 + 2? -27 In base 16, what is -11f - -21? -fe In base 16, what is 3 - -39? 3c In base 12, what is -5 + -3bb? -404 In base 5, what is -11 - -42? 31 In base 5, what is 2310 + 2? 2312 In base 5, what is 1242 - 10? 1232 In base 6, what is 23 + -4450? -4423 In base 4, what is -12232 + -2? -12300 In base 4, what is 2 - -10301? 10303 In base 6, what is 1442 + 2? 1444 In base 7, what is -14303 - -2? -14301 In base 3, what is -12 - 1210201? -1210220 In base 16, what is 3515 - 4? 3511 In base 8, what is 175 + -2? 173 In base 12, what is 12 - -124? 136 In base 16, what is -b - -6? -5 In base 9, what is -25710 - -4? -25705 In base 16, what is 3 + -151? -14e In base 4, what is 10 - -222? 232 In base 12, what is -6 - -1279? 1273 In base 4, what is -10 - -1310? 1300 In base 10, what is -61 + 1? -60 In base 13, what is 5 + -175? -170 In base 12, what is -5a - 1? -5b In base 14, what is -3 + -20cb? -20d0 In base 6, what is 50 - 5232? -5142 In base 16, what is 1e7 + -2? 1e5 In base 2, what is 1011 + 1001110101? 1010000000 In base 8, what is 200 + -11? 167 In base 5, what is -1012033 + -4? -1012042 In base 11, what is 7 - 18? -11 In base 10, what is 33 + -2? 31 In base 3, what is 1102112112 + 12? 1102112201 In base 16, what is -12b - 3? -12e In base 8, what is -4 - 63? -67 In base 4, what is 3 - -10? 13 In base 13, what is 5 - -3b? 43 In base 11, what is -3 + 18? 15 In base 5, what is 0 + 220? 220 In base 4, what is 1300 + 3? 1303 In base 8, what is 44 + -102? -36 In base 2, what is 1101001000001 - 101? 1101000111100 In base 15, what is d8a + 5? d90 In base 2, what is 10101 + -110101? -100000 In base 8, what is 260 + 5? 265 In base 4, what is 3 + 12213? 12222 In base 4, what is -12302 - 111? -13013 In base 3, what is -110 + -20? -200 In base 16, what is 2c0 + -2? 2be In base 13, what is -17 - -6? -11 In base 4, what is 11 - -13? 30 In base 6, what is -1 + -45? -50 In base 11, what is 40 + 3? 43 In base 12, what is -149 + -36? -183 In base 5, what is 224 + -2? 222 In base 13, what is -b0 + 1? -ac In base 9, what is -71 + 21? -50 In base 3, what is 12 - -1012? 1101 In base 10, what is -525 - 20? -545 In base 13, what is 9 - 38? -2c In base 15, what is 5965 + 3? 5968 In base 16, what is -1 - 530? -531 In base 12, what is 2 + 13? 15 In base 11, what is -42 + -2? -44 In base 13, what is 5 + -4c4? -4bc In base 4, what is -31 + -102? -133 In base 3, what is -21200 + -10? -21210 In base 16, what is -3 - 7f2? -7f5 In base 10, what is -8 + 1161? 1153 In base 15, what is d + -37? -29 In base 15, what is 3 - 6d? -6a In base 16, what is f5c - 5? f57 In base 12, what is -2 - 131? -133 In base 14, what is 14 + 31? 45 In base 13, what is 7 + -b? -4 In base 7, what is 22 + 3013? 3035 In base 3, what is 111021 - -1112? 112210 In base 10, what is -73035 - 4? -73039 In base 7, what is 466 - -4? 503 In base 4, what is 101 + 10122? 10223 In base 11, what is 37 + 4? 40 In base 5, what is -3 + 1043? 1040 In base 13, what is 3b5 + 1a? 402 In base 14, what is 68 - -1? 69 In base 8, what is 1542 + 1? 1543 In base 6, what is -1534 - -12? -1522 In base 3, what is 10 + 1110? 1120 In base 4, what is 202 - 0? 202 In base 4, what is -23 + -22? -111 In base 2, what is 10100100011 - 1111? 10100010100 In base 3, what is -12110 - 20? -12200 In base 11, what is -2725 - 1? -2726 In base 7, what is 4 + 3445? 3452 In base 10, what is 6 - -2811? 2817 In base 14, what is 5 + 85? 8a In base 16, what is -4be + 0? -4be In base 9, what is 336 - 1? 335 In base 9, what is -3 + -60? -63 In base 16, what is 5 - e45? -e40 In base 11, what is 1244 + 5? 1249 In base 15, what is 0 - 1c5? -1c5 In base 13, what is -2b8a + 3? -2b87 In base 8, what is -16 + -4? -22 In base 12, what is -2898 - 5? -28a1 In base 4, what is -11 - 311323? -312000 In base 16, what is 229 - -5? 22e In base 5, what is 4 - -131? 140 In base 8, what is -33 + 4? -27 In base 7, what is -36 + 14? -22 In base 4, what is -1 + -332011? -332012 In base 10, what is -2 + 295? 293 In base 14, what is -4 + d19? d15 In base 13, what is -5a + 2? -58 In base 2, what is -10 - 1001100? -1001110 In base 8, what is 132 - 225? -73 In base 8, what is 70 - -31? 121 In base 11, what is -712 + 2? -710 In base 8, what is -2 - 215? -217 In base 14, what is 114 - 1? 113 In base 11, what is -71 - -1? -70 In base 10, what is -5 - -	{ "pile_set_name": "DM Mathematics" }
e product of -842 and 0? 0 Work out -54.9 * 0.1. -5.49 Work out -0.2 * -189. 37.8 Multiply -0.3 and 3.3. -0.99 Product of -6 and -1922. 11532 What is 4 times -10.9? -43.6 What is the product of -108 and 0.06? -6.48 -1079 * 3 -3237 Product of 114 and 0.17. 19.38 Product of 580 and 0.6. 348 Multiply -299 and 1.8. -538.2 0.59 * 0.1 0.059 Work out -0.3 * 418. -125.4 -3-1583 4749 What is -149 times 0.04? -5.96 241 0.3 72.3 -14091 -1409 Product of 4 and -24. -96 -0.7299-4 2.9196 -11.3-16 180.8 Work out 135 19. 2565 3.714 * 5 18.57 What is the product of -5 and -0.4? 2 Calculate -0.2665. -1.33 Calculate -0.02-1. 0.02 What is the product of -0.3 and 2.02? -0.606 0.631 times -1 -0.631 -9.1 times -0.29 2.639 -0.00591 * -0.5 0.002955 Calculate 4115. 460 0.296-23 -6.808 Work out 0.2 * 0.052. 0.0104 Work out -0.04 * -289. 11.56 What is the product of 0 and -17? 0 Product of -1221 and 0. 0 Product of -69 and -0.3. 20.7 Multiply -100 and -0.1. 10 Work out -9.7 * 0.4. -3.88 Calculate 0.3984. 295.2 What is the product of 2 and -2.08? -4.16 What is -0.087 times 4? -0.348 What is the product of 0.1 and 0.89? 0.089 5 times -195.9 -979.5 Multiply -2 and 2.11. -4.22 Calculate -3-76. 228 -30.55 -1.65 Multiply 19 and 0.3. 5.7 Work out 1 931. 931 112 * -0.4 -44.8 Product of 0.174 and 0.1. 0.0174 What is the product of 0.94 and 0.1? 0.094 Work out 1 * -1.33. -1.33 Multiply 2.608 and 0.5. 1.304 Work out 869 * 0.06. 52.14 What is the product of 3 and 1233? 3699 Multiply 3 and -0.61. -1.83 Product of -1.594 and 0. 0 Calculate -29-0.44. 12.76 Multiply -0.1 and 72. -7.2 8.5 times 0.9 7.65 Product of 0.191 and 0.5. 0.0955 Product of 11 and -1.43. -15.73 -5 -0.071 0.355 Work out -3 * 12. -36 What is -6 times -3.24? 19.44 What is the product of 1 and -3.3? -3.3 -41 * 6.6 -270.6 Calculate 0.058. 0.4 Multiply -22 and -13.7. 301.4 -5 -2.546 12.73 0 * 107 0 6-73 -438 Work out 5.333 0.3. 1.5999 Product of -0.1 and 0.37. -0.037 What is -0.3 times -36? 10.8 -1.633.3 -5.379 Work out 586 -0.11. -64.46 Calculate 5154. 770 Work out 11.9 -4. -47.6 Work out 0.3061 * 4. 1.2244 Work out -3 * -1.2. 3.6 Calculate -203.30.5. -101.65 Calculate 4-73.3. -293.2 What is -19 times 0.05? -0.95 Calculate 2.10.1. 0.21 What is -0.34 times 2? -0.68 Product of 4 and -0.059. -0.236 What is the product of -2 and 75? -150 Multiply 0.4364 and 0.2. 0.08728 Multiply -3 and -252. 756 What is 1231 times 5? 6155 Calculate -0.4185. -74 Calculate 0.5285. 142.5 3-782 -2346 4563 1368 Product of 0.2 and -8. -1.6 Multiply -0.04365 and 0.2. -0.00873 Multiply -2.5 and -0.2. 0.5 -0.14-3 0.42 Work out -4593 * 0.3. -1377.9 Product of 0.052 and -3. -0.156 0.61 * -0.4 -0.244 Work out -1.3 * -61. 79.3 0.04 times 3.09 0.1236 Product of -393.5 and -0.3. 118.05 Work out -12.37 * -4. 49.48 Work out -0.4 * -2232. 892.8 Multiply -1.8278 and 0.4. -0.73112 Work out -0.5 * -1035. 517.5 What is 18 times -53? -954 -0.5-97 48.5 What is -2 times -0.002? 0.004 -17303 -7303 Calculate -21-2.6. 54.6 -0.04-0.02 0.0008 Product of 3 and 24.4. 73.2 0.8 times -31 -24.8 What is 11 times -9? -99 -476 times -3 1428 Work out 2 * -0.0164. -0.0328 Product of -0.029 and -1.34. 0.03886 What is -4 times 1411? -5644 054 0 What is -0.0132 times 0.3? -0.00396 What is -0.5 times 96? -48 3.1-35 -108.5 Work out -3 * -6.652. 19.956 What is -5 times -2.3? 11.5 Multiply 240.2 and 0. 0 Calculate 12414. 4968 -13 times -15 195 Calculate 1-5.4. -5.4 0.03 times 1242 37.26 4 * 82 328 Multiply -268 and -0.2. 53.6 0.035-0.033 -0.001155 What is the product of 0.047644 and -0.3? -0.0142932 -0.143 0.05 -0.00715 Product of 10 and 7.03. 70.3 Product of -0.12 and 0.5. -0.06 -156 * -0.7 109.2 What is -3 times -717? 2151 -0.022-3 0.066 -1.07 -3 3.21 Multiply -258 and -1.8. 464.4 -3837-0.4 1534.8 Work out -4 -3.4. 13.6 Multiply 0.5 and -89.6. -44.8 0 * 3.491 0 -0.4 times -0.036 0.0144 2050.4 * -0.3 -615.12 -12.736 times 0.3 -3.8208 -0.1-2.2 0.22 What is the product of 0.1 and 785? 78.5 Multiply 12736 and -0.1. -1273.6 -0.130 -3 -0.182.2 -8.22 Calculate -0.1-0.2. 0.02 2.3 times -16 -36.8 What is 0 times -29.9? 0 53.2-0.29 -15.428 0.10.009 0.0009 9 * -0.41 -3.69 Multiply 0.6 and -0.2. -0.12 Product of 0.2 and 0.0463. 0.00926 What is -0.26 times 6? -1.56 What is the product of 5 and -295? -1475 -41-0.8 32.8 -1.4 times -3 4.2 Product of -0.1 and 0.202. -0.0202 -0.18925 times 0.4 -0.0757 What is 63.9 times -7? -447.3 What is the product of 3 and 81? 243 Work out -270 -4. 1080 5.62 times -0.6 -3.372 32105 3360 -5 0.345 -1.725 -3.2-4 12.8 Calculate -2.5-10. 25 20 times -5 -100 -5536 -2680 What is 6.32 times 0.06? 0.3792 Product of -36 and 0.2. -7.2 -2 times 61 -122 0.79 times -0.1 -0.079 5 -6.936 -34.68 What is -23 times 0.114? -2.622 What is the product of -1.19 and 5? -5.95 Multiply -87 and -3. 261 What is -433 times -0.4? 173.2 Product of -0.4 and 141.2. -56.48 What is 3 times 5.6? 16.8 Calculate 30.217. 0.651 -4 times 1910 -7640 -0.16 times -29 4.64 0.3-530 -159 -0.06108 -6.48 Product of 130 and -2. -260 What is the product of -1414 and -0.4? 565.6 What is the product of -0.5 and -0.0934? 0.0467 What is -0.678 times 1? -0.678 0.1 times -18 -1.8 Work out 0.5 2.4. 1.2 Calculate 0.0085-49. -0.4165 Multiply -1922 and 0. 0 What is the product of -0.518 and 0.6? -0.3108 Multiply -5385 and 5. -26925 What is 0.7 times 1? 0.7 Product of 0.4 and 15. 6 What is the product of 1.1 and -0.05? -0.055 -0.016 times -1.8 0.0288 Product of 0.5 and -49. -24.5 Multiply 2 and -403. -806 -0.2 times -1170 234 What is the product of 0.88 and -0.1? -0.088 What is -0.0016 times -0.4? 0.00064 -119.6 -105.6 Product of 0.2 and -0.0009. -0.00018 Product of 30 and -0.5. -15 Calculate 3050.3. 91.5 Product of 0.1 and 0.82. 0.082 Calculate -53333. -16665 Work out -0.04 * -1108. 44.32 -125 * -0.4 50 2 times 2.8 5.6 Calculate -5.331-0.5. 2.6655 -129.1-0.4 51.64 Calculate -5026-1. 5026 -3237 -2 6474 -0.1 * 44 -4.4 0.106 times 12 1.272 -1 * 0.053 -0.053 What is the product of -0.08 and -374? 29.92 0.026 * 86 2.236 Work out -0.1 * -0.014. 0.0014 What is -11 times 0.13? -1.43 2.9 times 3 8.7 Multiply 3 and 4962. 14886 Product of -15 and 8. -120 Multiply -0.033 and -0.02. 0.00066 0.09267 * 2 0.18534 Calculate -2.90334. -11.6132 What is the product of 0.6 and 81? 48.6 4 0.019 0.076 Work out 0.9 * 76. 68.4 Product of 4 and -2405. -9620 Multiply 288 and 4. 1152 What is the product of -5 and -2118? 10590 Calculate 6660.5. 333 -0.161-6.8 1.0948 What is the product of 0 and -40? 0 14.6944 58.776 What is the product of 56 and -0.07? -3.92 What is -5 times -0.047? 0.235 4-92 -368 What is the product of 0 and -0.115? 0 Multiply 3 and -9. -27 Calculate -53.7-0.5. 26.85 Product of 0.06 and 905. 54.3 What is the product of 283.9 and 4? 1135.6 What is -4 times 2012? -8048 41-0.0563 -2.3083 What is 271 times 0.4? 108.4 Work out 6 * -1.9. -11.4 -0.1-629 62.9 Calculate 29-392. -11368 What is -0.55 times 1? -0.55 What is the product of -57 and -0.3? 17.1 Work out 73 * 4. 292 34 * -4 -136 82 times 2 164 0.2 times -0.49 -0.098 What is the product of -0.1 and -67.3? 6.73 What is 0.03 times 0.056? 0.00168 28 * -1.7 -47.6 -51.7 -8.5 What is 72 times 6.8? 489.6 -1265 -630 What is -121 times -36? 4356 Multiply -20 and -174. 3480 Work out 1.16 * -1. -1.16 Product of -0.54 and 16. -8.64 Calculate -0.2808-5. 1.404 4.2 times 0.06 0.252 Multiply 4 and -0.072. -0.288 Work out -120.3 13. -1563.9 -3900 times -0.3 1170 What is the product of 0 and 0.04? 0 -0.214-1.1 0.2354 -553-5 2765 4 times 2.874 11.496 0.080.019 0.00152 -0.0639 -2.34 What is the product of -3 and 0.28? -0.84 Work out -0.11 * 1.6. -0.176 -0.04-0.22 0.0088 -0.0480.7 -0.0336 Work out 4 * 0.04604. 0.18416 Multiply -7 and -21. 147 What is the product of 0.03 and 5? 0.15 Product of -4328 and 0.5. -2164 Calculate 2-6309. -12618 0.2 19 3.8 Work out -1565 * -0.5. 782.5 158 120 What is the product of 0.5 and 0.048? 0.024 Calculate 11.4-7. -79.8 Product of 46 and -0.114. -5.244 Product of -0.07 and 198. -13.86 1 times 0.029 0.029 -19206 -3914 Calculate -0.063785. -227.1 -211 * 4 -844 Work out 25 * 6.7. 167.5 What is 5 times 5060? 25300 -430.3 -12.9 590.01 0.59 Multiply 0.138 and -	{ "pile_set_name": "DM Mathematics" }
4 + 9b - 9b + (0 + b2 + 0)(6b2 + 0b + 0b) + 2b*4 - 4 + 4 + (-b + 4 - 4)(3b3 - b3 + 0b*3). 3b*4 Expand 15h*5 - 21h*5 - 91h*5 + (2h*2 - 2h*2 - 2h*2)(h*3 + 3h*3 - 2h*3) - 7h*5 + 4h5 - h5. -105h5 Expand 75f*3 + 100f*3 - 154f3 + (-f2 + 3f2 - 4f*2)(-5f + 5f + f). 19f3 Expand (-5 + 5 - 33)(-2 + 4 + 1)(3 + z - z - z). 99z - 297 Expand (-2x4 - 7 - 4 + 13)(-1 + 1 - 1) + (-x4 - x3 + x*3)(-3 - 1 + 2) - 4x4 + 2x*4 + 3x*4. 5x*4 - 2 Expand 4s + 4 - 4 + (-10s + 2s - 2s)(-2 + 0 - 3). 54s Expand (-2 - 2 + 0)(5 - 3 - 3)(67q*2 - 873 + 873)(q - 3q + 3q). 268q3 Expand (-o + o + 3o)(170 + 4o*4 - 99 - 6o*4). -6o*5 + 213o Expand (120 + 47 + 202)(h2 + 1 - 1). 369h*2 Expand (-4c4 + c4 + 2c4)(-2c - 1 + 1) + c5 - 3c*5 - 5c5 + (-c3 + 3c3 - 3c*3)(4c2 - 3c*2 - 4c*2). -2c*5 Expand (-22w*3 + 13w*3 - 37w*3)(-2w + 0w + w). 46w4 Expand (-16 + 45 - 19)(-1 - 2o + 1)(-8 + 473o - 32 - 475o). 40o2 + 800o Expand (w*4 - 2w4 - w4)((-1 + 0 + 2)(2 + 0 + 0) + 127 - 43 + 43 - 3 - 1 + 2 + 1 + 1 + 0). -258w4 Expand (4 - 6 + 0)(-1 - 4 + 4)(4 - 7 - 3)(0 + 0 + l) - l - 2 + 2 - l - 2l + 2l + (-2 + 0 + 3)(5 - 5 - l). -15l Expand 6i3 - i3 - i3 + (-i3 - 2i3 + i3)(-2 - 2 + 3) + 2i*3 + 3i*3 - 3i3 + i3 + 2i3 - 4i*3 - 4i*3 - 2i*3 + 3i*3. 4i*3 Expand (-1 - 5 + 3)(3u + 0u - 6u)(21u2 + 13u*2 - 10u*2). 216u*3 Expand (1 - 2 + 0)(22m - 23m + 285m - 42m). -242m Expand (-6 + 6 + 3b)(3b - b - 3b)(61 - 27 + 7). -123b2 Expand (1 - 2 + 2)(0j + 0j - j) + (-7j + 3j + 2j)(0 + 3 + 0) + j - 31j - 63j + 0 + 0 + j. -99j Expand 106q*2 + 69q*2 + 59q*2 - 2 + (-1 - 5 + 4)(-2q2 + q2 + 3q*2) + (3q - 3q - q2)(3 - 2 - 2). 231q2 - 2 Expand (-r3 - 7 + 7)(2 - 7r + 8r - 8r2 + 2r). 8r5 - 3r*4 - 2r3 Expand 0 + 0 - l2 + (1 + 2 - 1)(7l*2 - 2l*2 + 2l*2)(15 + 26 + 0). 573l2 Expand (-4 + 0 - 1)(2i3 - 1 + 1) + (1 - 3 + 4)(-9i + 9i - i*3). -12i*3 Expand (f + 3f - 3f)(-4f2 + f2 + f2) - 3f*3 + 2f3 - f3 + 39f3 - 166 + 166 + f3 + f2 - f2 + (4f + f - 3f)(3f2 - 5f*2 + 4f*2). 40f*3 Expand -3p3 + p3 + 9p3 + (2p*2 + 2p*2 - 3p*2)(2p - p + p) + (4p + 1 - 1)(p2 + 1 - 1). 13p3 Expand ((i2 - i2 + i2)(1 + 1 + 30) - 4i*2 + 2i2 - i2)(4 - 2i - 4). -58i3 Expand (-59d*2 - 35d*2 - 101d*2)(3d - 5d + 0d)(3 - 2 + 0). 390d3 Expand 2s5 + s4 - s*4 + (27 + 24 - 53 + 27s)(0 + 4 - 3)(-5s - 4s*4 + 5s). -106s5 + 8s*4 Expand (-2f + 0f + f)(5 + 1 - 5)(-1 - 5 - 1) + 1 + 2f - 1 + (-6f + 4 - 4)(3 - 2 + 0). 3f Expand (35 + 15 + 31 - 300)(0m + 2m - 4m). 438m Expand (-24p - 22p + 34p)(3 - 2p - 3 + (3 + p - 3)(1 + 2 - 2) - 4p + 0 + 0). 60p*2 Expand (-6c - 2c + 3c)(-3c + 2c - 2c + (0c + 4c - 3c)(-1 + 2 - 3)). 25c2 Expand (k2 + 2k*2 + 5k*2)(8k3 + 10k*3 - 29k*3). -88k*5 Expand (5x3 - 1 - x3 - 3x3)(156713x - 582x*2 - 156713x). -582x5 + 582x*2 Expand (-7t - 5t + 7 + 13t)(-3t*2 + 2t*2 + 3t*2). 2t*3 + 14t*2 Expand -5r + 11 - 11 + (-2 - 1 + 1)(-3r + 5r - r) + (-r - r + r)(0 - 1 - 1) - 29 - 25r + 29. -30r Expand 0 + 0 + 2z2 + (-5z + 3z + 3z)(2 - 2 - 2z) - 1941z2 + 929z*2 + 941z*2. -71z2 Expand (-8 + 4 - l2 + 0l2)(-4l2 - 13l2 - l2). 18l4 + 72l2 Expand -y3 + y3 - y4 - 224y4 + 24251y*2 - 24251y*2 + (2y - y*3 - 2y)(y + 0 + 0). -226y*4 Expand (-1252 - 1253 + 2505 - 1702c)(3 - 4 - 2)(2c4 + 3c*2 - 3c*2). 10212c*5 Expand (159w*2 + 109w*2 + w - 355w*2)(-1 + w + 4 - 1). -87w3 - 173w*2 + 2w Expand 2 - 2 - 2d3 + (-4d + 4d + d)(73d2 - 4d*2 - 28d*2) + (1 + 1 - 4)(0 - 1 - d*3 - 1). 41d*3 + 4 Expand (-2m + 5m - m)(-3 + 2 + 3) + 5 - 2m - 5 + 2m - 2m + m - 7m + 47m + 14m. 57m Expand (8c*2 - 2c*3 - 8c*2)(-4 + 161c + 4 - 464c). 606c4 Expand (-4t + t + 4t)(-t + 2 + 0 - t + 2t + t + 2t + (0t - 5t + 2t)(-1 + 0 + 0)). 6t2 + 2t Expand (-1 - 3 + 0)(1 + 2 + 2)(6 - 3 - 2)(-4q - q - 5q). 200q Expand (-3 + 0 + 2)(-1 - 9 - 1)(-6k - k - 2k)(-2k*3 + 2k*4 + 2k*3). -198k*5 Expand (-2 + 3 + 0)(-4 + 3 + 2)(8388r*3 + 91r*4 - 8388r*3). 91r*4 Expand (-3b + 0b + 2b)(44 + 3b*2 + 6 + 15). -3b*3 - 65b Expand (-110 - 562 + 40 + 83)(-2 - q2 + 2). 549q*2 Expand (-1 + 2 + 0)(-201 - 45s + 201) - 10 + 8 - 2s - 3. -47s - 5 Expand (4d + 8d - 2d)(-3 - 1 - 1)(-5 - 6d2 + 5). 300d*3 Expand (-8z + 11z - 7z)(-2z + 2z + z2)(26 + z + 38 - 49). -4z4 - 60z*3 Expand (-3t + 3t - t)((t - 1 + 1)(4t - 3t + 0t) + t*2 + 0t + 0t + 353t*2 + 141t*2 - 350t*2). -146t*3 Expand (-16 + 22 + 23)(2 - 6 + 1)(0t + 2t - t + (t - 2 + 2)(1 + 3 - 2) + 5t - 3t - 3t). -174t Expand (-3n2 + 3n*2 - 6n*3)(1 - 4n2 - 1) - 5n5 - n5 - 2n5 + (n4 - n5 - n4)(0 + 2 - 4) + 6n5 - 3n*5 - 2n*5. 19n5 Expand (k3 + 3k - 3k)(91 + 37 - 232 + 2k*2). 2k*5 - 104k*3 Expand (3 - 5 + 1)(-o*3 - 2o*3 + 5o*3) + 0o3 - o3 + 3o3 + (0o + o - 3o)(-7o2 + 2o*2 + 3o*2). 4o*3 Expand (38k*3 + 4k*3 - 2k*3)(-3 - 3 + 3)(-k + 2 - 2). 120k*4 Expand (5 - s - 5)(0 + 0 + 2)(0s + 2s + 0s)(-5s + 0s - 3s)(-7 - 2 - 4). -416s*3 Expand (2b + 0b + 0b)(-24b*2 + 24b*2 - 9b*2)(-b*2 - 4b*2 + 2b*2). 54b*5 Expand (158k + 158k - 105k*4 - 316k)(2k + 3k - 2k). -315k5 Expand (-3h + 0h + 2h - h + 3h - 3h + (-h - h + 3h)(4 - 3 - 3) + 2h - 6 + 6)((0 + 0 + 2h)(0h - 3h + h) + 7h2 - 18h*2 - 9h*2). 48h*3 Expand (47m*3 + 49 + 15m - 12m + 3m*2 - 49m*3)(3 + 5 - 4). -8m3 + 12m*2 + 12m + 196 Expand 3z + z - 3z + (-3 + 1 + 0)(-2z - 2z + 6z) + 0 + 25z + 0. 22z Expand (3 + 0 - 1)(4i - 2i + 0i) + (2 + 1 - 4)(28i + 182i + 231i). -437i Expand (-n + n - n)(5n - 15n - 25n)(-1 + 1 - 2). -70n2 Expand (3r*2 + 0r*2 - 2r*2)((1 + 3 - 2)(4 + 4 - 6) + (0 + 2 + 5)(-2 + 5 - 2)). 11r2 Expand (1 - 1 + u2)(-2u3 + 3u*3 + 0u*3) + 0u*4 + 8u4 - u5 + 2u5. 2u*5 + 8u*4 Expand (-22 + 64 - 471 - 405)(3k + k - 2k). -1668k Expand (-2s + 0s - s)(8 - 23 - 15). 90s Expand (-3r*2 + 4 - 3 + 0)(r + 3r - 7r). 9r3 - 3r Expand (-4n4 + 0n*4 + 2n*4)(5n - 3n - n + (0 - 2n + 0)(1 + 2 - 6) + 4 - 4 - 2n + 2 + 2 + 8n - 5). -26n5 + 2n*4 Expand (-2a*2 - 4a*2 + 5a*2)(-4 - a*3 + 4) + 2a*5 + a - a - 3a - a*5 + 3a + 90a4 + 113a*5 - 90a*4. 115a*5 Expand (-4k - k + 4k)(-352 + 570 - 447) + (-1 + 4 - 1)(-k + 2k - 3k). 225k Expand ((-5y2 + 2y*2 + 2y*2)(-y + 2y + y) - 14y*3 - 273 + 273)(-y*2 + 4y*2 + 4y*2). -112y*5 Expand (-j + 0j + 3j)(-3 + 2 + 5)(1 - 5 + 1)(-4 + 0 + 2). 48j Expand -3i*4 + 2i*4 + 3i*4 + (-34i + 304i - 22i)(-18i*2 + 18i*2 - 3i*3). -742i*4 Expand (-2l*2 + 2l2 - l4)((l - 3 + 3)(-3 - 2 + 6) + 3 - 3 - 2l + 0l + 3l - 5l + 23l + 86l + 160l). -266l*5 Expand (-5 + 4 + 6)(11b2 + 7b - 7b). 55b*2 Expand 4p - 3p + 0p + (1 + 2 - 4)(0p - 3p + 4p) + 1 - p - 1 - p - 3p + 3p + 29p - 14p + 6p. 19p Expand (-2 + 5v + v - 11v)((-6v + 6v + 8v)(-2v - 4 + 4) - 2v2 - 2v*2 + 3v2 - v2 - 4v2 + 4v*2). 90v*3 + 36v*2 Expand (3a + 0a - a + 0 + 0 + a + (a + a + 0a)(0 - 3 + 2))(1299 + 15a - 1299). 15a*2 Expand (-i + i + 3i*2)((-3i - 2i + 3i)(2i + i - i) - 90i2 - 181 + 181 + i2 - i2 - i2). -285i4 Expand (3 - 3 + 3d)(-66 - 131 + 17 - 64). -732d Expand -2l3 + l5 + 2l*3 + (176l*2 - 176l*2 - 53l*3)(-2l2 - l2 - 5l*2). 425l*5 Expand (-8a + 3a + 0a)(-a + 0a + 2a)(12a - 12a + 4a3 + (-1 - 2 + 2)(2a3 + 0a*3 + 0a3) + a3 - 2a + 2a + 3a3 - 3a*3 + 2a*3). -25a*5 Expand (60 + 820 - 242)(-u - 3u + 3u)(-4u + 3u - 2u). 1914u2 Expand j - 4j*4 - j + (0 - 5 + 0)(2j4 + 0j + 0j) - j4 + 0j*4 + 4j**	{ "pile_set_name": "DM Mathematics" }
Let x(u) = 2 + 5u + 0 - u2 + 2u*2 + 0u*2. What is the units digit of x(z)? 2 Suppose 2i - 13 + 59 = 0. Let d = -14 - i. What is the units digit of d? 9 What is the tens digit of (-6)/91 - (-1376)/12? 1 Let k = 154 - 72. What is the tens digit of k? 8 Let f(x) = -4x - 1. Let v(y) = -y + 1. Let i(u) = f(u) - 3v(u). Let a be i(-7). Suppose aq = 7 - 1. What is the units digit of q? 2 Let m(w) be the first derivative of w*3/3 + 5w*2 - 2. Let i be m(-10). Let d = i - -2. What is the units digit of d? 2 Let v = 37 + -20. Suppose -v = -5n - 2p, 0n - 4p = 2n - 10. What is the units digit of n? 3 Let b be (-5 + 4)/((-1)/2). Suppose -bk - 3q + 17 + 118 = 0, 2k - 5q = 95. What is the units digit of 2/(-5) - k/(-25)? 2 Let t = -47 - -67. Suppose 0h = h - t. Suppose 0 = -4i + h, -g - 3i + 18 = 2g. What is the units digit of g? 1 Let z be 153/36 - 2/8. Suppose -zd - 8 = -8d. Suppose s + 1 = ds. What is the units digit of s? 1 Let t(n) = -n3 - 8n*2 - n - 12. What is the units digit of t(-9)? 8 Let y = 160 + -110. Suppose y = 3p - 2d + 7d, -5p + 4d + 34 = 0. Suppose -3n = -n - p. What is the units digit of n? 5 What is the hundreds digit of 43(48/(-80))/(1/(-5))? 1 Let t(f) be the first derivative of f*2/2 + 2f - 2. Let c be t(3). Suppose -4u - 16 - 5 = cx, 3u = -4x - 17. What is the units digit of u? 1 Suppose -5z + 5v = -0v - 1735, -z - 2v + 359 = 0. What is the units digit of z? 1 Suppose 3f - 6f + 237 = -g, 0 = g. What is the tens digit of f? 7 Let h = -1 + 9. Let z be (2/(-6))/(h/48). Let t(m) = -m*3 - 2m*2 - m + 1. What is the units digit of t(z)? 3 Suppose 5i - 189 - 611 = 0. What is the tens digit of i? 6 Suppose 0 = -3i + 6. Suppose 2j = -3q + 13, 3q + 3j = 6 + 6. Suppose iu = 2l + 28, -u - ql + 0 = 10. What is the units digit of u? 0 Suppose -3a + a = -10. Let d be (1 + 3)1/1. Suppose -df - 16 = -r + 10, 0 = ar - f - 35. What is the units digit of r? 6 Let o(r) = -r*3 - 7r*2 - 2r - 9. Let y be o(-7). Suppose 5l - 3g = 9, yl - 5g + 2 = 17. Suppose l = -4n + 15 - 3. What is the units digit of n? 3 Let r(n) be the first derivative of -n2 + 6n - 3. Let y be r(4). Let h = 5 - y. What is the units digit of h? 7 Suppose -2v - 2v = -16. Let g = -6 + v. What is the units digit of 10/3(-3)/g? 5 Let y = -5 + 6. Suppose 0 = -2x + 29 + y. What is the tens digit of x? 1 Let z be ((-8)/4 - -19)/1. Suppose 3v + 0v + 4a - z = 0, -v - 5 = -4a. What is the units digit of v? 3 Let j(f) = -f + 4. Let o be j(0). What is the units digit of (-6)/(-9)66/o? 1 Suppose 2v + 5 = 5q, -4v = 2q + 3q - 35. What is the units digit of 3/v - (-12)/30? 1 Suppose i = 2s + 14, 2i - 21 = -2s - s. Suppose -i = -4c - 0. Suppose -42 = -cv - 0. What is the units digit of v? 4 Let q = -233 + 344. What is the units digit of q? 1 Suppose -o = 5f - 206, 7f = -5o + 2f + 990. Suppose -b = 4d - 27, -o - 2 = -5b + d. What is the units digit of b? 9 Let d(v) = -v2 + v - 5. Let c be d(0). Let a(b) = b2 - 8b + 7. Let h be a(7). Let p = h - c. What is the units digit of p? 5 Suppose 31 = 4s + 3q + 2q, s = q + 1. Suppose t = -u - 2t - 19, st = -20. Let l = -2 - u. What is the units digit of l? 2 Let n(h) = -h3 + 7h*2 + 9h - 3. Let p be n(8). Suppose 0 = -pz + 7z - 34. Let q = z + -12. What is the units digit of q? 5 Suppose 2q - 37 = 3k + 2k, 4k + 3q + 25 = 0. What is the units digit of k/(-4) - (-1)/4? 2 Let i(h) = 1. Let o(q) = -5q + 7. Let j(r) = -6i(r) + o(r). Let p be j(-6). Let k = -15 + p. What is the tens digit of k? 1 Let m(p) = 3p*2 - 10 + 4p - 3p2 + 6p*2 - 5p*2. What is the units digit of m(4)? 2 Let w be (30/(-25))/((-2)/(-10)). Let o = 7 + w. Suppose f + 5b = 11, -5f - 6 + o = -5b. What is the units digit of f? 1 Let s(p) be the first derivative of -p*6/360 - 3p5/40 - p4/8 + p*3/3 + 4. Let n(r) be the third derivative of s(r). What is the tens digit of n(-5)? 1 Suppose 2h - 4 = 8. Suppose 36 = 5a + f - 4f, -a - h = -5f. What is the units digit of a? 9 Suppose -c - 2 = -6. Suppose 0t = 2x + 4t - 14, cx = -2t + 10. What is the units digit of x? 1 Let i = 6 - 2. Suppose -4z - 4 = -3c, 3z = ic - 0c - 3. Suppose -3m + cm = -24. What is the units digit of m? 8 Let m(v) = -v2 + 7v - 8. Let f be m(7). What is the units digit of 36/f(-56)/12? 1 Suppose -f - 2 = 3i - 1, f + 1 = 4i. What is the units digit of f/6 - (-148)/24? 6 Suppose 2t - t + 287 = 3v, 5t - 275 = -3v. What is the tens digit of v? 9 Let z be (-2 + 2/2)5. Let f be 2/z + 388/20. Suppose -f = -3d + 23. What is the units digit of d? 4 Let i be (18/27)/((-1)/3). Let f(a) = -3a3 - a2 + 4a + 3. What is the tens digit of f(i)? 1 Let p be (1 + -3)/(3/(-12)). Let s(y) = -y + 8. Let j be s(p). Suppose 0 = -4z + 16 - j. What is the units digit of z? 4 Let w be -2(-1)/(4/(-6)). Let m be 1/w - (-16)/3. Suppose 2j + 3d + 5 = j, m = 2j + d. What is the units digit of j? 4 Suppose 9k - 4 = 8k. What is the units digit of k? 4 Let g = -31 + 120. What is the tens digit of g? 8 Let r = 2 - 0. Suppose rn - 30 = 8. What is the units digit of n? 9 Let m(o) = -o3 - 4o*2 + 3o - 32. Let a(b) = b*2 - b - 1. Let l(r) = -3a(r) - m(r). What is the tens digit of l(0)? 3 Suppose 5f + 409 = 2z, 0 = -2z - f + 128 + 263. What is the tens digit of z? 9 Let f = -16 + 26. Let b(x) = -x3 - 19x*2 - 20x - 11. Let h be b(-18). Suppose -5z = -fz + h. What is the units digit of z? 5 What is the units digit of (-207)/15(-10)/3? 6 Let w = 4 + 29. Let t = w - 60. Let s = t + 39. What is the tens digit of s? 1 Let s be (3/90)/(-1). Suppose 2 = -n - sn. Let a = -1 - n. What is the units digit of a? 1 Suppose 0 = 2m + r - 6, 2m + 2m - r = 0. Let w be 33 + (m/(-1))/1. Suppose 5k - k - w = 0. What is the units digit of k? 8 Let r(z) = -z3 - 8z*2 - 8z - 2. Let i be r(-7). Suppose -9 = -v + i. What is the tens digit of v? 1 What is the tens digit of (9/6)/(6/100)? 2 Suppose -7a = -2a - 2s - 28, 5a - 26 = 4s. What is the units digit of 108/a(-1 - -2)? 8 Let c be 2/8 + (-5)/4. Let v = 1 + c. Suppose vp - 28 = -4p. What is the units digit of p? 7 Suppose -2k + 307 = -193. What is the tens digit of k? 5 Suppose -t + 1381 - 277 = 3p, -5p + 5t = -1840. What is the hundreds digit of p? 3 Let m(x) = -x*3 + 17x*2 - 17x + 16. Let y be m(16). What is the tens digit of (-1 - y) + (-204)/(-6)? 3 Suppose -2z = p - 62 + 10, 3 = -3z. What is the units digit of p? 4 Let j(c) = -34c - 12. What is the tens digit of j(-11)? 6 Suppose 5p + 2 = 3i, -3p = -0i - i - 2. Let s(o) = o3 + 6o*2 + 4o - 5. Let j be s(-5). Suppose j = u + pu - 51. What is the tens digit of u? 1 Let f = 17 + -11. Suppose 6 + f = 2g. What is the units digit of g? 6 Suppose 0 = -d - 2d - 15. Let z(t) = t. Let y(l) = l2 + 4l + 6. Let s(a) = dz(a) - y(a). What is the tens digit of s(-4)? 1 Suppose -17 = -5l + 8. Let z(k) = k*3 + 5k*2 + 3k - 2. Let o be z(-4). Suppose la - 10 = -3y, oa - 2y + 0 = 20. What is the units digit of a? 5 Let q be (-16)/20 - (-11)/(-5). Let x(f) = 2f2 + f - 1. Let r be x(2). What is the units digit of 33/r + (-1)/q? 4 Let n(i) = 2i*3 - 2i*2 - 3i + 2. Let h be n(2). Suppose -l = -g + 10, -5g + hl + 58 = l. What is the tens digit of g? 1 Suppose 0 = -5j - 20 - 0. Let v = -2 - j. Suppose -v + 6 = 2i. What is the units digit of i? 2 Let i = 3 - -10. Suppose -t = -4m + i, -15 = -0m - 5m + t. Suppose 0 = -mj + j - 2q + 5, 3q = -3j + 15. What is the units digit of j? 5 Let a be 5/3(-252)/(-6). Suppose a = 4p + 2. What is the units digit of p? 7 What is the tens digit of (-4)/1 + 24 - -3? 2 Let l(t) = t - 2. Let i be l(6). Suppose 3q - 3j = -0q + 3, 0 = q + 4j + i. Let a = 3 - q. What is the units digit of a? 3 Let h(o) = o3 + 2o*2 - o. Suppose 0 = 5m - 2d + 5, -4m - 6 + 0 = -2d. What is the units digit of h(m)? 2 Let x(u) = u3 + 9u*2 + 13u + 7. What is the tens digit of x(-5)? 4 Suppose -3r + 1 = 10. What is the units digit of ((-4)/r)/((-2)/(-12))? 8 What is the units digit of 37 - 2 - 0/1? 5 Let j = -132 - -160. What is the units digit of j? 8 Let z be ((-6)/4)/((-12)/40). Let n(o) = o3 - 6o*2 + 5o + 7. What is t	{ "pile_set_name": "DM Mathematics" }
e? True Is 1248631 composite? False Is 671483 a composite number? True Is 334563 prime? False Is 29819 prime? True Is 61823 composite? True Is 74653 prime? True Is 262097 prime? False Is 132571 prime? False Is 146563 composite? False Is 409573 a prime number? True Is 15349 composite? False Is 853 composite? False Is 888047 a prime number? True Is 1996907 composite? True Is 701809 a composite number? True Is 83833 composite? False Is 206749 a prime number? True Is 246242 a composite number? True Is 349963 a composite number? False Is 23657 a composite number? True Is 40301 a prime number? False Is 177883 a prime number? True Is 1271227 prime? True Is 87103 prime? True Is 169427 a prime number? True Is 427213 a composite number? False Is 8051 composite? True Is 44771 prime? True Is 6767 a prime number? False Is 463283 a prime number? True Is 560438 prime? False Is 2746 a prime number? False Is 108343 composite? False Is 68093 a prime number? False Is 1791865 prime? False Is 5921 a prime number? False Is 76459 a composite number? True Is 4583 a composite number? False Is 36521 prime? False Is 2492161 a composite number? True Is 28169 composite? True Is 91229 composite? False Is 5437 a composite number? False Is 4373 a composite number? False Is 3037 a prime number? True Is 33679 composite? False Is 474857 composite? False Is 467963 a composite number? False Is 5221 a prime number? False Is 3847 a prime number? True Is 24763 a prime number? True Is 4327 a composite number? False Is 465683 composite? True Is 31669 composite? True Is 78377 prime? False Is 36902 a composite number? True Is 3985 prime? False Is 38011 a composite number? False Is 48099 prime? False Is 52229 prime? False Is 129629 a prime number? True Is 31469 a composite number? False Is 23869 prime? True Is 880513 prime? True Is 2589 a prime number? False Is 713807 a prime number? True Is 3271 a composite number? False Is 1468591 a prime number? True Is 21253 prime? False Is 2291 a prime number? False Is 918839 a composite number? False Is 10057 a composite number? True Is 470021 composite? False Is 2303359 a composite number? False Is 484691 a prime number? True Is 260849 a prime number? True Is 30437 prime? False Is 33926 composite? True Is 469363 composite? False Is 14377 a composite number? True Is 124378 composite? True Is 1710061 composite? False Is 58703 composite? True Is 71927 a prime number? False Is 489 a prime number? False Is 712393 prime? False Is 9217 a composite number? True Is 186377 a prime number? True Is 468803 composite? False Is 4783 prime? True Is 27663 a prime number? False Is 3713 a composite number? True Is 264514 composite? True Is 5381 prime? True Is 9813 a prime number? False Is 986165 composite? True Is 368609 composite? False Is 409 a composite number? False Is 1066595 prime? False Is 9059 composite? False Is 279581 prime? False Is 443 prime? True Is 40003 a composite number? True Is 26419 composite? True Is 299987 a composite number? True Is 114447 composite? True Is 1387 a prime number? False Is 355297 prime? True Is 72677 prime? False Is 17783 a composite number? False Is 33557 prime? False Is 85549 prime? True Is 17863 composite? False Is 2306 a composite number? True Is 3473 a composite number? True Is 1949 prime? True Is 7571 a prime number? False Is 1305541 prime? False Is 9383 a composite number? True Is 2447 a prime number? True Is 5809 a prime number? False Is 4169 prime? False Is 10015 prime? False Is 1183823 prime? False Is 8143 a prime number? False Is 480839 a composite number? False Is 142673 composite? False Is 491 prime? True Is 211 composite? False Is 154519 a composite number? True Is 4117 prime? False Is 26387 composite? False Is 12053 prime? False Is 5591 a composite number? False Is 150862 a prime number? False Is 227813 composite? True Is 64741 a prime number? False Is 21407 prime? True Is 69733 a composite number? True Is 44539 a prime number? False Is 256621 a composite number? True Is 27381 a prime number? False Is 926293 composite? False Is 5951 composite? True Is 1686469 a prime number? False Is 49141 prime? False Is 3989 a composite number? False Is 419231 a composite number? False Is 94769 composite? True Is 629407 prime? False Is 56033 composite? True Is 17231 a composite number? False Is 5737 a composite number? False Is 338659 composite? False Is 31715 prime? False Is 9923 composite? False Is 6337 a prime number? True Is 516973 a composite number? False Is 995 a prime number? False Is 26137 a composite number? True Is 29077 a prime number? True Is 8819 a composite number? False Is 123139 prime? False Is 289015 a prime number? False Is 14507 composite? True Is 48427 a composite number? True Is 31985 a composite number? True Is 18457 prime? True Is 244973 composite? True Is 14107 composite? False Is 28901 prime? True Is 149 prime? True Is 575917 composite? True Is 273631 a prime number? False Is 871 prime? False Is 11197 prime? True Is 39643 prime? False Is 36193 composite? True Is 563401 prime? True Is 232741 prime? True Is 58657 prime? True Is 146513 composite? False Is 395069 a composite number? False Is 45233 prime? True Is 38326 a prime number? False Is 4721 composite? False Is 35011 a composite number? True Is 341641 a composite number? False Is 2165 a composite number? True Is 8639 a composite number? True Is 63113 a composite number? False Is 36383 prime? True Is 103081 a prime number? False Is 93371 prime? True Is 7871 composite? True Is 1154 a prime number? False Is 56285 a composite number? True Is 914777 composite? False Is 331433 prime? False Is 97987 a composite number? False Is 26449 composite? False Is 20323 prime? True Is 65951 prime? True Is 665282 a composite number? True Is 1731 prime? False Is 19463 a prime number? True Is 36241 a composite number? False Is 3587 composite? True Is 5579 a composite number? True Is 5042 a composite number? True Is 1757579 a prime number? False Is 25735 a prime number? False Is 1921991 a prime number? False Is 2843 prime? True Is 54515 a composite number? True Is 91731 a prime number? False Is 2901 composite? True Is 2073 a prime number? False Is 106619 prime? True Is 162251 prime? True Is 98999 composite? False Is 6101 composite? False Is 1739 a composite number? True Is 3863 composite? False Is 20813 prime? False Is 181045 prime? False Is 13705 a prime number? False Is 17947 a prime number? False Is 633 prime? False Is 11141 a prime number? False Is 21077 composite? True Is 122443 a prime number? True Is 73382 a prime number? False Is 524047 a prime number? True Is 708409 a prime number? False Is 172871 a prime number? True Is 1117959 composite? True Is 12007 a composite number? False Is 10427 a prime number? True Is 133831 a composite number? False Is 250103 prime? False Is 894503 a composite number? False Is 7897 a composite number? True Is 76595 a prime number? False Is 282197 composite? True Is 15089 prime? False Is 53683 a prime number? False Is 1049057 composite? False Is 476713 composite? False Is 95943 a prime number? False Is 16609 a composite number? True Is 45161 a composite number? False Is 30241 prime? True Is 3607 prime? True Is 26493 composite? True Is 3299 a composite number? False Is 10037 composite? False Is 21169 a prime number? True Is 3199 a composite number? True Is 4507 a prime number? True Is 28383 a composite number? True Is 6883 a prime number? True Is 182581 a composite number? True Is 25697 a composite number? True Is 42677 composite? False Is 143867 composite? True Is 19237 prime? True Is 54251 prime? True Is 104605 composite? True Is 1943 a composite number? True Is 68131 a prime number? False Is 25841 a prime number? True Is 583577 composite? False Is 11369 prime? True Is 134243 composite? False Is 148061 prime? True Is 1171189 a prime number? True Is 5399 a prime number? True Is 11129 a prime number? False Is 75467 a prime number? False Is 1779661 composite? True Is 179897 prime? True Is 2893 a composite number? True Is 4907 prime? False Is 15131 prime? True Is 943 prime? False Is 12849 prime? False Is 16574 a composite number? True Is 6109 composite? True Is 7607 a prime number? True Is 17851 prime? True Is 395377 prime? True Is 9661	{ "pile_set_name": "DM Mathematics" }
5k2 + 4k - 5. Let y(u) = -u3 + u2 - u + 1. Give -c(z) - 5y(z). 11z*3 + z Let f(r) = -5r - 6. Let w(c) = 10c + 13. Give 13f(t) + 6w(t). -5t Let y(p) be the third derivative of p6/120 + p5/60 - p*3/6 + 40p*2. Let d(g) = -2g2 + g + 1. Calculate -d(t) - y(t). -t3 + t*2 - t Let q(n) = -4n2 - 4. Let b(j) = j3 - 3j2 - 3. Let l = 36 - 32. Calculate lb(d) - 3q(d). 4d3 Let y(u) = u3 - 9u - 9. Let b(h) = -h3 + 3h*2 + 4h - 3. Let n be b(2). Let r be (-5 + 9)n/(-4). Let k(j) = 2j + 2. Determine rk(m) - 2y(m). -2m3 Let f(z) = -2z*3 + 3z - 37. Let o(k) = -5k3 + 8k - 112. What is 8f(u) - 3o(u)? -u*3 + 40 Let v(w) = -6w*3 - 13w - 16. Let g(f) = 2f3 + 4f + 5. Give -7g(z) - 2v(z). -2z3 - 2z - 3 Let w(l) = 4l2 - l + 3. Let k(b) = 12b*2 - 4b + 8. Calculate -3k(n) + 8w(n). -4n2 + 4n Let g(y) be the third derivative of y*4/24 + 7y*3/6 - 11y*2. Let c(z) = z + 8. Determine 6c(s) - 7g(s). -s - 1 Suppose -2a + 15 - 3 = 0. Let p(i) = -i*2 + 6i + 3. Let u be p(a). Let c(n) = 2n - 1 - 1 + 1. Let m(z) = 2z - 1. Give um(t) - 4c(t). -2t + 1 Let p(o) = -4o. Let a(j) = -14j - 2. Let l(b) = 13b + 1. Let k(w) = 2a(w) + 3l(w). Determine 3k(y) + 8p(y). y - 3 Let a(y) = 2y3 + 5y*2 - 2y. Let t(b) = 8b3 + 20b*2 - 8b. What is -9a(s) + 2t(s)? -2s3 - 5s*2 + 2s Let a(i) = i + 1. Let n(d) = 20d3 + 3d + 1. Give 2a(k) - n(k). -20k*3 - k + 1 Let h(i) = 2i + 7. Let r(p) be the second derivative of -p*3/3 - 4p*2 - 4p. What is 7h(a) + 6r(a)? 2a + 1 Let p(r) be the second derivative of -3r + 2r2 - 1/6r*3 + 0. Let a(k) = 1. Determine -4a(n) + p(n). -n Let x(q) = 14q3 - 6q*2 - 6q + 6. Let j(c) = c*2 + c - 1. Give 6j(p) + x(p). 14p3 Let h(m) = -m2 - m + 1. Let d(r) = -r2 + 4. What is -d(i) + 3h(i)? -2i2 - 3i - 1 Let q(d) = -2d2 + 3d - 3. Suppose 2n + 10 = 4n. Let f(w) = -3w2 + 5w - 5. Suppose -p - 3p = -52. Suppose -5t - 2 = p. Determine nq(s) + tf(s). -s*2 Let m(f) = 2. Let j(t) = 2t*2 - 2t - 2. Let r be j(2). Let q(g) = g*3 + 7. Give rq(v) - 7m(v). 2v*3 Let q be ((-1)/2)/((-5)/30). Let k be 2/q + (-55)/15. Let t(h) = -3h*2 + 2h. Let d(i) = 4i2 - 3i. Determine kt(u) - 2d(u). u*2 Suppose -2w - 14 = 3q, 4q = -7 - 9. Let j(y) = y. Let m(t) = -t*2 - 2t*2 + 2t*2 - t - 1. Calculate wm(x) - 3j(x). x2 - 2x + 1 Let h(o) = -5o2 - 2o. Let r(x) = x*2. What is -h(w) - 4r(w)? w*2 + 2w Let g(b) = -9b. Let z(n) = 18n. Determine 9g(p) + 5z(p). 9p Let x(b) = 3b. Let p(w) = 1. Determine 3p(s) - x(s). -3s + 3 Let p(w) = -2w2 - 1 - 5 + 1 + 0w2. Let g(o) = o2 + 3. Calculate 5g(c) + 3p(c). -c*2 Let w(f) = 4f*2 - 2f - 15. Let y(a) = -2a2 + a + 7. Let z be (-6)/(-10) - 186/(-15). Calculate zy(n) + 6w(n). -2n*2 + n + 1 Suppose 0 = -c + 10c - 45. Let k be 1 + 1/(-1) + 1. Let u(z) = z*2 + z + 1. Let l(s) = 2s*3 - 5s*2 - 5s - 5. What is cu(x) + kl(x)? 2x3 Let l(a) = 4a - 3. Let v be l(-2). Let s(x) = -5x3 - 11x2. Let r(q) = -q3 - 2q2. What is vr(k) + 2s(k)? k3 Let f = -1 + 4. Suppose -fw + 48 = -0w. Let o(i) = 10i*3 + 16. Suppose 3 = -3v - 6. Let x(b) = 2b3 + 3. What is vo(p) + wx(p)? 2p*3 Let p(y) = -7y + 3. Let h(n) = -14n + 4. Let j(g) = -2g. Let w(a) = -2h(a) + 4j(a). Determine -17p(i) - 6w(i). -i - 3 Let w = 34 + -23. Let u(d) = d*3 + 5. Let a(l) = -4. Let j(v) be the first derivative of -5v - 3. Let c(p) = -4a(p) + 3j(p). What is wc(s) - 2u(s)? -2s3 + 1 Suppose 0 = -4g + 3l + 4, -4g + 8g = -4l + 4. Let d(t) = 2t - 6. Let n(p) = -1. Determine gd(q) - 8n(q). 2q + 2 Let t(n) = -3n3 - 5n*2 - 5n + 5. Suppose 3q = 4v + 3 - 5, 4q - v - 6 = 0. Let z(l) = -l3 - 2l*2 - 2l + 2. Determine qt(k) - 5z(k). -k*3 Let b(r) = -5 + 2 - 11r*2 + 6r + 3r. Let w(q) = -5q*2 + 4q - 1. Let z be (16/(-10))/((-20)/(-50)). What is zb(s) + 9w(s)? -s2 + 3 Let g(y) = y3 + 22y2 - 6y - 5. Let p(k) = -k*3 - 21k*2 + 5k + 4. Give 4g(f) + 5p(f). -f*3 - 17f2 + f Let q(v) = -v3 + v - 1. Let b(f) = -4f3 - 36f - 4. Give b(w) - 5q(w). w3 - 41w + 1 Suppose -l + 2q + 4 + 1 = 0, -2l = -3q - 8. Let p(k) = -k - 1. Suppose -1 = 2i - 5. Let a(z) = -8z + 11z + i + 1. Determine la(s) + 4p(s). -s - 1 Let v(x) = x*3 - 3x*2 - 2x - 3. Let h = 4 - 6. Let l = 2 - h. Suppose la = a - 6. Let s(z) = -2z*2 - z - 2. Calculate av(i) + 3s(i). -2i*3 + i Let a(r) = r. Let u be (2/5)/(2/(-20)). Let n(k) = 5k + 5. Let z(h) = 5h + 4. Suppose 0 = -4p + 7 + 5. Let q(c) = pn(c) + uz(c). Calculate -4a(g) - q(g). g + 1 Let b(u) = -u + 6. Let y(m) = -m + 5. Suppose w = -h + 6w + 25, w + 19 = 3h. Let k = -4 - 2. What is hb(f) + ky(f)? f Let c(d) = 27d*3 - 3d*2 + d + 1. Let x(h) = -27h*3 + 4h*2 - 2h - 1. What is -4c(u) - 3x(u)? -27u3 + 2u - 1 Let q(a) = -57a2 - 5. Let v(m) = 58m*2 + 6. What is 5q(f) + 4v(f)? -53f*2 - 1 Let n(q) = q - 1. Let z(k) = -6k + 6. Let o(f) = -2f + 2. Let g(b) = -10o(b) + 3z(b). Determine 3g(v) - 5n(v). v - 1 Let o be 5 + (0/2)/(-1). Suppose -4x + 6 = -v - 8x, -ox = -4v + 60. Let y(u) = -2u*3 + 5u2. Let d(j) = -j3 + 3j2. Calculate vd(q) - 6y(q). 2q*3 Let m(j) = -9. Let x(r) = r + 9. Give 4m(u) + 3x(u). 3u - 9 Let c(a) = -5a2 + a + 2. Let h(m) be the third derivative of m5/15 - m4/24 - m3/6 + 5m*2 + 2m. Give -2c(q) - 3h(q). -2q2 + q - 1 Let c(d) = -11d*2 - 5d + 6. Let k(i) = 4 + 4i2 - 3i - 8i2 - 3i*2. Give 5c(f) - 8k(f). f2 - f - 2 Let y(p) = p3 - p2 + p - 1. Let c(i) = 9i*3 - 12i*2 + i - 7. Let q(o) = -3o*3 + 4o*2 + 2. Let x(v) = 4c(v) + 11q(v). What is -x(m) + 4y(m)? m*3 + 2 Let a(z) = -5z*3 - 4z*2. Let h be (-10)/2(-22)/10. Let n(w) = 14w3 + 11w*2. Calculate ha(m) + 4n(m). m3 Let q(l) = 5l*3 + 6l*2 - 6l - 9. Let m(k) = k3 + k2 - k. What is 6m(t) - q(t)? t3 + 9 Let y(w) = 14w*3 - 2w*2 - 5w. Let z(h) = 29h3 - 4h*2 - 11h. Calculate 13y(i) - 6z(i). 8i3 - 2i*2 + i Let a(t) = -12t*2 + 9. Let b(d) = 1 - 44d*2 - 1 + 2 + 41d*2. Determine 2a(y) - 9b(y). 3y*2 Let m(b) = 0 + b + 7 - 1 - 2. Let t(g) = -1. Calculate -3m(h) - 12t(h). -3h Let o(t) = -2t - 3. Suppose -12 + 8 = -x. Let v(p) = p + 2. Determine xo(g) + 5v(g). -3g - 2 Let s(c) = -9c3 - 5c*2 - 3c. Let b(i) = -46i3 - 24i*2 - 14i. Give -3b(y) + 14s(y). 12y3 + 2y*2 Let a(h) = -12h*3 + 4h*2 + 3h + 1. Let w(x) = -11x3 + 3x*2 + 2x + 1. What is 3a(g) - 4w(g)? 8g3 + g - 1 Let y(m) = -42m*3 + 17m*2 - 17m. Let j(r) = -14r3 + 6r*2 - 6r. Determine 17j(b) - 6y(b). 14b3 Let i = 5/16 + 51/16. Let a(l) be the second derivative of 0 + il*2 + 0l*3 + l - 1/3l*4. Let g(d) = -6d*2 + 10. What is 7a(o) - 5g(o)? 2o*2 - 1 Let s = 1 - -2. Let u(x) = 2x*3 + 4x*2 - 4x*s + 0 - 3x + 1. Let g(t) = -4t3 + 7t*2 - 5t + 1. Suppose 0m - 6 = -2m. Calculate mg(q) - 5u(q). -2q3 + q2 - 2 Let t(f) = -3f + 4. Let y(m) be the first derivative of -3 + 7/2m2 - 9m. Suppose -5q - 26 = 5j - 11, 10 = -2q. Give jy(o) + 5t(o). -o + 2 Let b(a) = 2a*2 + 4a - 5. Let z = -67 - -1. Let o be (2/6)/((-2)/z). Let p(r) = -5r2 - 11r + 14. Give ob(s) + 4p(s). 2s2 + 1 Suppose -2n + 11 = -7. Let q(b) = -5b3 - 17b*2 + 13b. Let h(s) = s*3 + 4s*2 - 3s. Determine nh(d) + 2q(d). -d*3 + 2d*2 - d Let w(q) = -2q*3 + 4q*2 - 4q - 4. Let b = -11 + 19. Suppose -bz - 27 = -5z. Let d(y) = 5y3 - 9y*2 + 9y + 9. Give zw(a) - 4d(a). -2a3 Let n be 11 + (1 + -2)0. Let r(h) be the first derivative of h*4 + 3h*3 - 3h*2 + 36. Let u(f) = -2f*3 - 5f*2 + 3f. Determine nu(g) + 6r(g). 2g3 - g2 - 3g Let u(n) = -7n + 2. Let r(s) be the third derivative of -s4/4 + s3/3 + 2s*2. Suppose q - 15 = 4q. Give qr(y) + 4u(y). 2y - 2 Suppose 4 = -b + 2b. Let i = b - 2. Let c(l) = 2l2 - 2l - 2. Let v be c(i). Let z(x) = 3x. Let o(a) = -2a. Determine vz(h) + 4o(h). -2h Let x(d) = d2 - 2d + 1. Let p(v) = -v*2 + v. What is -3p(h) - x(h)? 2h*2 - h - 1 Let r(w) = -w + 8. Let j be r(7). Le	{ "pile_set_name": "DM Mathematics" }
-1 a prime number? True Suppose 15 = 6n + 3. Suppose -w = -2d + 7d - 261, -nw + 486 = -2d. Let j = -83 + w. Is j a composite number? False Is ((-109042)/5)/((-214)/535) composite? False Suppose -66b = -53b - 122083. Is b a prime number? True Let a = -1718 - -4277. Is a a composite number? True Suppose -2b + 19930 = -4i, 0 = -4i + 4 - 12. Is b a composite number? True Let w(p) be the first derivative of p2/2 + p - 5. Let m be w(-8). Let v = m + 29. Is v composite? True Suppose -3942 - 8931 = -21w. Is w composite? False Let q(n) = 37n - 8. Let u(f) be the second derivative of f3/6 - 4f*2 - 9f. Let b be u(15). Is q(b) prime? True Let g = 3223 - -2656. Is g a composite number? False Let n(k) = k*3 - 31k*2 + 28k - 119. Is n(37) prime? False Let z be ((-16)/(-8))/(2/5). Suppose 5o - b - 832 = 0, -zo - b = 4b - 850. Let a = o - 46. Is a composite? True Let t(v) = -38v + 28. Let j be t(13). Let q = 839 + j. Is q a composite number? False Let p = 17639 + -11500. Is p composite? True Let b be ((-4)/10)/((-2)/(-40)). Let d = b - -10. Suppose 0s - 5n + 143 = ds, 2s = -4n + 138. Is s a prime number? True Let n(u) = -21u + 22. Let k be n(-6). Let t = k - -1231. Is t prime? False Let y(c) = -18c2 + 47c - 44. Let d be y(19). Let v = -3316 - d. Is v a prime number? True Suppose -4a + 25 = 3b + 5, -3b = -4a - 4. Suppose -4d = -11 - 5. Suppose 4h - 84 = -am, 7m = 3h + dm - 72. Is h a prime number? False Let x(h) = h*3 + 6h*2 + 8h + 6. Let i be x(-5). Is 1940/3 + (-3)/i a composite number? False Let r(c) = -11c - 70. Let h be r(-37). Suppose 54 + 116 = 5v. Suppose o = h + v. Is o prime? False Suppose 0n = k + 3n - 2288, 3n = k - 2282. Is k a composite number? True Let k(z) = 23z*2 - 13z + 163. Is k(10) prime? True Suppose t + 3x + 453 = 2x, 5x + 25 = 0. Let g = -17 - t. Is g a composite number? False Let c be -3 - 2(-20)/8. Let w be (6c)/((-10)/(-150)). Let r = w + 383. Is r composite? False Let l(x) = 350x + 2. Let u be l(6). Let w be 3/9 - u/(-3). Suppose -2y - w = -3q, q - 1167 = -4q + 4y. Is q a prime number? False Let k = 30 + -14. Let z = -13 + k. Is -6 + (6 - z) + 422 a prime number? True Let g be 25731/18(-12)/(-9). Let l = g + -1005. Is l a composite number? True Let h(w) = 3w*3 - 5w2 + w + 2. Let c(j) = j2 + 5j + 7. Let n be c(-4). Let l be h(n). Suppose q + l = 3b - 3q, -2b + 39 = -5q. Is b prime? True Suppose i = -5m + 24186, 2m + 868 - 10545 = -3i. Is m composite? True Suppose 2z = -z + 21. Let v = -3 + z. Is 500/16 + (-1)/v a composite number? False Let s be (-1 + 2)/((-2)/(-16)). Let b be 22/12 - s/(-48). Suppose -5i + bi = -537. Is i prime? True Let a(f) = -f2 + f. Let m(x) = -2x*2 + 14x + 8. Let g(j) = 3a(j) - m(j). Let n be g(-11). Is ((-4)/n)/(1/1790) composite? True Suppose -5a + 7 = 4q - 22, 3q - 5a - 13 = 0. Suppose f - qf - 3355 = 0. Let w = 978 + f. Is w composite? False Suppose 3b = b. Suppose 3c - 7 - 8 = b. Is 3830/50 + 2/c composite? True Suppose 0 = 2m - 2695 + 185. Is m composite? True Let q(r) = 58r + 41. Suppose -4t - 3n + 69 = -2n, -50 = -3t + n. Is q(t) a prime number? False Suppose -13g + 135274 = 41219. Is g composite? True Let k = 222 - 37. Is k prime? False Let f(x) = -x3 - 5x*2 + 1. Let q be (-74)/14 + (-12)/(-42). Let o be f(q). Is (2 - (-141 + 3)) + o a composite number? True Let i(o) = -6o3 + o2 + 4o - 1. Let b = 48 - 51. Is i(b) a prime number? False Let a(t) = 13t - 4. Let h be a(1). Suppose 1984 = 4c - 436. Is 10/(-45) + c/h prime? True Is 36/(-162) + 16211/9 a composite number? False Suppose 0 = 6a + a - 13104. Let w = 3233 - a. Is w a composite number? False Let b(x) be the second derivative of x5/20 - x4/4 + x3/6 - x2/2 + 3x. Let r be b(3). Is r/4440/4 composite? True Let l(m) = 2m2 + 6m + 13. Is l(-7) a prime number? False Suppose -2t + 1775 = z, -1789 = -z + t - 8. Is z a prime number? False Let x = 48 - 51. Let f(y) = -18y*3 + 4y*2 - y - 4. Is f(x) a composite number? False Suppose 0 = 5x - 23q + 25q - 2031, -q + 812 = 2x. Is x a prime number? False Suppose -3s + 6q + 20735 = 8q, 4q - 4 = 0. Is s a prime number? True Let t(d) = -d + 135. Is t(-14) prime? True Suppose -5d - 4h = -2h - 10763, h = 3d - 6460. Is d a composite number? False Let w be 924 - (-2 - (-4)/((-3)/(-3))). Let x = 167 + 462. Let s = w - x. Is s a composite number? False Let k(o) = -o3 - 8o*2 - 9o - 41. Is k(-14) composite? True Let j(d) = 5d - 25. Let u be j(5). Suppose -8c + 15c - 4102 = u. Is c composite? True Let f = 29 - 24. Suppose -104 = -fl + 1551. Is l composite? False Suppose 0 = 4l + 7 + 5, 3l + 34782 = 3u. Is u composite? True Suppose -2q + 3q - 5 = 0. Let n(o) = -8o + o*3 - qo - 6o2 + 19 - 6o*2 - 14o. Is n(18) a prime number? False Suppose 67x - 1734355 = 32x. Is x composite? True Let f be (-1)/9 - (-478)/9. Let h = 36 + f. Is h a composite number? False Let f be (-6)/27 + (-7172)/(-36). Suppose -5q - f = 511. Let r = -39 - q. Is r prime? True Is (-558520)/22044/(-8) prime? True Suppose 5u - 4x - 16127 = 0, 4u - 4x - 7416 = 5488. Is u composite? True Suppose 2v = -3t - 3v + 274, -3v - 468 = -5t. Let u(m) = m2 - 14m + 4. Let d be u(14). Suppose dw - 91 = t. Is w a composite number? True Is (106/(-8))/(40/(-18080)) composite? True Let a(i) = -i. Let d be a(0). Suppose d = 4s - 3u - 1916 - 3612, 3s + 4u = 4171. Is s a prime number? False Let r be (5 - 5 - (-6)/(-2)) + 15. Is (-2 + (-20367)/r)1-4 a prime number? False Suppose -3a + g = 4g - 24, 0 = 4a + 2g - 22. Suppose ar = 2n + n + 81, -2n = 4r - 78. Is r a prime number? False Let m = -22 + 26. Suppose 0 = -j - m, -2j = 2t + 3j - 2778. Is t a prime number? True Let b be (-3)/15-490. Suppose 2u + 3i - b - 110 = 0, 5u + i - 455 = 0. Is u a composite number? True Let x be -3 + 3 + 0 + 2. Suppose j - x = -2g + 9, 0 = -2j + g + 12. Suppose 3u - ju = -1324. Is u a prime number? True Let l be 3 + 57/3 - -3. Suppose 3a + l + 14 = 0. Is -388(3 - a/(-4)) prime? True Let p(h) = 627h*2 - 59h - 17. Is p(-14) a composite number? False Let i = 1278 + 667. Is i composite? True Suppose -10l + 23104 = -73446. Is l prime? False Let x = -44 + 43. Is 234 + 13 + x + 3 composite? True Suppose 3a + a + 448 = 0. Let t be a/(-63) + (-4)/(-18). Suppose -1523 = -to - 261. Is o a composite number? False Let d(l) = -l. Let h be d(10). Let x = h - -10. Suppose -4i + 2c = -3c - 1762, -4i - c + 1774 = x. Is i composite? False Suppose 0 = -5w - 20, 0 = n - 3w - 16. Suppose r - nk = -4r + 13, -r = -4k + 7. Suppose 112 + 73 = rj. Is j prime? True Let n(g) = -2g*3 + 8g*2 + 5g - 7. Let s be n(-5). Suppose 119 = -b + 2f + s, 1451 = 5b + f. Is b composite? True Suppose -5q = 2n - 21 + 6, 4n = -2q + 6. Suppose -2y - 10 = n, 2b + 2y - y - 263 = 0. Is (0 - (-1)/2)b prime? True Let y(m) = -m*2 - 6m - 1. Let z be y(-5). Let v be 1/(z4/64). Is ((-109)/v)/((-2)/8) a composite number? False Suppose 44k - 4k - 99920 = 0. Is k composite? True Suppose -7 = i + 4v, -3i - i + 5v = -56. Let c be 1(8 + 3/(-1)). Let g = c + i. Is g a prime number? False Suppose 0 = 6n - n, 5q + 4n = 1085. Is q composite? True Let n = -14240 + 22463. Is n a composite number? True Let x(d) = d*3 - 2d*2 - 2d - 1. Suppose -4z + 0z = -12. Let k be x(z). Suppose -ks = 2, o + 5s = 501 - 135. Is o composite? True Let d(u) = 28u - 6. Let w(m) = 29m - 7. Let r(l) = -4d(l) + 3w(l). Let p be r(-3). Let x = p - 41. Is x composite? False Suppose 0y - y = -3w + 26986, 5w - 2y - 44977 = 0. Suppose -8j + 3j = -w. Is j prime? False Let c(p) = p*3 - 2p*2 + 2p - 2. Let r be c(3). Let h = 239 + -231. Suppose hx - rx = -325. Is x prime? False Is (1/3)/(-1)(-56 - 60781) composite? True Let q(v) = -136v - 1. Let w be q(-7). Suppose 0 = 12k - 15k + w. Is k a prime number? True Let g be (-2)/((-12)/39) + 1/(-2). Suppose 0 = gb - 1764 - 3570. Is b composite? True Suppose 3k + 533 = 2l - 3113, 0 = -3l + 3k + 5463. Let j = 72 + l. Is j a composite number? False Let i be (-2)/8 + 111/12. Suppose -r + 7 - 4 = 2u, 4u + 3r = i. Suppose 3g - f - 155 = u, 4f = -0*g - g + 69. Is g prime? Tr	{ "pile_set_name": "DM Mathematics" }
-12l + 10l = 3j - 76811, 2j - 51177 = 3l. Does 49 divide j? False Suppose 158j - 153j = 12a - 513, -5a + 2j = -214. Does 11 divide a? True Suppose -c = -4m - 273 + 6897, -4968 = -3m - c. Suppose -2a = -6a + m. Does 18 divide a? True Is 7/(-3)38232/(-18) a multiple of 28? True Let g = -239 + 1416. Suppose -g = -12t + 167. Is 14 a factor of t? True Does 19 divide (0 + (6 - -199))(0 - -1)? False Suppose -7n = -2n + 2v - 58189, 6 = -2v. Is n a multiple of 12? False Let u(x) = 2x*2 - 2x - 14. Let y be u(-7). Suppose 0 = -2j + 5k - 2, 5j - 2j - 19 = 2k. Suppose -y = -jq + 2q. Is 2 a factor of q? True Suppose -2g = 4f - 138, 5g = 2g - 2f + 195. Let s be 5/4g/154. Is (-1667)/(-7) - -2 - 3/s a multiple of 40? True Suppose -5z + 12z = 42. Let w(a) = -3a2 + 30 - 7a - 40 + 5a2. Is w(z) even? True Is (-32)/72 - 79000/(-36) a multiple of 98? False Let i = -6 + 61. Let t = 58 - i. Suppose 3f - 696 = -p, -tp - 232 = -f + 2p. Is 29 a factor of f? True Suppose 0 = 5g - 9g - 8. Let d(x) = x*3 + 4x*2 + 4x + 3. Let f be d(g). Suppose 0 = -fp + 3z + 354, 0 = -5p - z + 4z + 582. Is p a multiple of 15? False Suppose 0 = 4r - 5 - 3, 16 = 2k + 3r. Suppose k = -2f + 17. Suppose -fc + 4c + 12 = 0. Does 2 divide c? True Suppose -k + 3424 = -5c, 127k = 132k + c - 17146. Is k a multiple of 3? True Suppose -127w - 137262 = -2823312. Does 94 divide w? True Suppose 2x = 3q + 10381, -16q + 13q = -x + 5195. Is x a multiple of 70? False Suppose -2q + 326 = -5o - 385, 3o + 15 = 0. Suppose -5c - 18 + q = 0. Suppose -g + 206 = 3d, d + 5g = g + c. Does 13 divide d? False Suppose -5x - 20p + 44 = -24p, 4x + p - 52 = 0. Is -218(2/(-5))/(x/15) a multiple of 4? False Let l = -221 + 1300. Suppose 3n - 118 = l. Is 82 a factor of n? False Let l(q) = -6q3 + 7q*2 + 4q - 1. Let s be l(6). Let y = 2005 + s. Is 82 a factor of y? True Suppose -3o + 2701 = 2k, -28o + 30o + 4k = 1814. Let c = o - 406. Is c a multiple of 10? False Let m(x) = 60x - 16. Does 14 divide m(39)? True Suppose -27t = -97168 - 141971. Does 17 divide t? True Suppose -3j + 2j = -2u + 382, 0 = -4j - 5u - 1593. Let x be (-2)/11 + j/22 + 0. Is x/6 + (38 - 1) a multiple of 17? True Suppose 69x - 65x - t - 1272 = 0, 3x - 8t = 954. Is 159 a factor of x? True Does 14 divide (-17568)/(-35) + 2 + (-282)/(-4935)? True Let l(d) = d*3 + 4d - 6. Let s be l(-6). Let y = 448 + s. Suppose -4t + y = n + 74, -n + 4t = -96. Is 30 a factor of n? False Let i(g) = 10g + g - 7g - 33. Let a(w) = -20w + 166. Let y(m) = 2a(m) + 11i(m). Does 7 divide y(16)? False Does 7 divide -5 - (17/(-68) - ((-219159)/12)/(-3))? True Suppose -48r + 51161 + 103591 = 0. Does 52 divide r? True Is 4 a factor of -4(-5)/(-30) + (-1841)/(-21)? False Let p = -41121 + 96801. Is p a multiple of 82? False Suppose 27s + 22s = 9s + 2245440. Is s a multiple of 8? True Let c(f) = 4f2 + 27f - 101. Let v be c(5). Let d = -14 + v. Does 15 divide d? True Suppose 10 = 8r - 6. Suppose rz - 158 = 18. Is 11 a factor of z? True Let l be (-61 - -26) + 0/((-6)/2). Is ((-28)/l)/((-6)/(-4200)) a multiple of 20? True Suppose 0 = 4n - 5v + 13 + 2, 0 = 4v + 20. Let q be 5/(n/8) + 8. Suppose 5g - 612 = -qd, 5g - 4d + 185 = 773. Is 15 a factor of g? True Let c be ((-3)/2)/(21/(-3206)). Let o = 1034 - c. Suppose 5k = -3n - 2n + o, -k + 146 = -2n. Is k a multiple of 26? True Suppose -2i = 4j + 60, 5j = i + 3j + 14. Let n = 19 - i. Is 10 a factor of 1 + n - (3 - 4)? False Let v = 659 + -455. Let p = 234 - v. Does 4 divide p? False Is 6 a factor of 1926/2(-32)/3075/(-30)? True Let d(r) = -1. Let f(h) = -41h - 5. Let o(w) = -2. Let j(i) = f(i) - 4o(i). Let v(c) = 3d(c) - j(c). Is 33 a factor of v(9)? True Suppose 2d - 5678 - 15377 = -h, -4h - 20 = 0. Is d a multiple of 30? True Suppose -93p = -48530 - 235306. Does 2 divide p? True Suppose 2 - 182 = -9o. Let r = 46 - o. Let y = r - -52. Is y a multiple of 26? True Let k = 10 + -3. Suppose 0 = -n + 1 - k. Is n/(-4)(3 - 1 - -4) a multiple of 4? False Let v(a) = -42a + a*3 - 44a + 75a + 10a*2 + 16 + 0a*3. Is 45 a factor of v(8)? True Let t(v) be the first derivative of 152v*2 - 21v - 113. Does 13 divide t(1)? False Let r be ((-360)/(-140))/(-1(-2)/56). Suppose 43b - rb = -7337. Is 14 a factor of b? False Let y be 166/(-913) - 12588/(-22). Suppose 2w + 4n - y = 0, 9n = 3w + 12n - 846. Is 29 a factor of w? False Let t(m) = m*3 + 4m*2 - m - 2. Suppose -f = 3d + 10, -d = -2d - f - 2. Let s be t(d). Suppose 0 = 5g + 25, 2g - 288 = -sw + 4g. Is 27 a factor of w? False Let t be 0/(3/(-1(4 + -5))). Is 1191 - -1 - (t + (-12)/3) a multiple of 14? False Let v be 9/(-4 - 3/(-18)22). Let o = -22 - v. Suppose p - 71 = -5m, -5m = -0p - op + 295. Does 13 divide p? False Let j(b) = b2 + 8b + 776. Let t be j(0). Is t + (-23)/((-115)/(-30)) a multiple of 55? True Suppose 199f = 146394 + 122256. Is f a multiple of 6? True Let p(t) = 116t*2 + 505t*2 - 46t*2 + 45t - 87t - 11 + 54t. Does 36 divide p(1)? True Suppose -11w = -15w + 40. Let h be (-16)/(0 + (-4)/w). Suppose 2y - 3y + 31 = 3m, -4m - 2y + h = 0. Is 11 a factor of m? True Let d = -7160 - -12195. Is 265 a factor of d? True Suppose 0 = 4b + 4, 0 = 2w + 126b - 133b - 3063. Is 3 a factor of w? False Let b be (12/(-20))/((-1)/65). Let v = b - -22. Suppose 95 = 6g - v. Is 3 a factor of g? False Let p(o) = o*2 - 42o - 11. Let s = -130 - -121. Is p(s) a multiple of 14? True Let f = -1611 + 1655. Suppose 105 = -4r + u, -6 = -u + 3u. Let z = f + r. Is z a multiple of 17? True Let p be (0 - 294)/(2 + (-28)/8). Suppose -5z - p = -z. Let h = z + 109. Does 19 divide h? False Suppose 0 = -z + 2d + 41 + 195, 0 = -z - 4d + 206. Suppose -10 + 16 = 3s. Suppose sy = 12 + z. Is y a multiple of 17? True Let k(y) = -y2 + 4y - 1. Let q be k(3). Let a(c) = 30c - 3. Is a(q) a multiple of 6? False Suppose y = -1, y + 1481 = -5i + 9i. Suppose x = 5l + 368, i = -x + 2x - 3l. Is x a multiple of 6? False Let l be (24/16)/3-28. Is 6 a factor of (-1342)/l + -1 - (-64)/448? False Suppose -193r + 1403904 = 47r - 2107296. Is 22 a factor of r? True Let q be (-23)/(-2) - 5/(-10). Suppose 0w - 4b = w - 49, q = 3b. Let l = w + -24. Is l even? False Let k = -859 + 2329. Suppose 9f - k = -26f. Does 41 divide f? False Let j(b) = -97 + b - 22b + 45. Let d be j(-7). Is 10/d - (-1195)/19 a multiple of 21? True Is 68 a factor of (0 - 9)/((-20)/9000)? False Let v(w) = 50w*2 - 8w - 60. Is v(-6) a multiple of 149? True Let l(p) = p*3 - 3p*2 - 4p + 833. Suppose 23i + 28i = 22i. Is 25 a factor of l(i)? False Let g(p) = p3 - 11p*2 - 10p + 4. Suppose 5o + 200 = 3l - 3, -5l = 3o - 327. Suppose 3t = -i + 7 + 27, 5t - 3i - l = 0. Is g(t) a multiple of 15? False Let a(x) = 437x - 2541. Is a(18) a multiple of 15? True Let w be 5/((-180)/(-17097)) - (-2)/24. Let u = -139 + w. Is 14 a factor of u? True Let p = -12 + 3. Suppose -4r + 106 = -d - 16, -r + d = -29. Let v = p + r. Is 10 a factor of v? False Is ((-90)/8)/(-7 - 3/((-43320)/101065)) a multiple of 38? True Let s(g) = 70g*3 + 6g*2 - 46g + 188. Does 55 divide s(4)? False Let j(n) = 469n - 1394. Is 33 a factor of j(20)? True Let b = -44534 + 79214. Is 120 a factor of b? True Suppose -81 = r - 71. Let q(w) = -18w - 60. Is 24 a factor of q(r)? True Let i be 20(-12)/(-56) - (-8)/(-28). Suppose 186 = ig - 23p + 26p, 3g - 5p = 154. Is 4 a factor of g? True Suppose 53 = -3f - 7. Let m be (-160)/12 + f/(-6) + -3. Let x = -7 - m. Is x a multiple of 3? True Is (-1 + 15 + -2)/(420/65240) a multiple of 8? True Let v(z) = 5z + 158. Let y be v(21). Suppose 1331 = 2l - y. Is l a multiple of 39? False Let b = -12807 - -18333. Is 121 a factor of b? False Let j = -36959 - -58019. Is 54 a factor of j? True Let a be 2/14 - 54730/(-70). Let t = 1189 - a. Is t a multiple of 11? True Suppose -8730 = 12s - 27s. Let d = s - 410. Does 43 divide d? True Suppose -543 = -3p - 0p - 111. Does 4 divide p? True Suppose -349a + 345a + 25805 = -5c, -5c = -2a + 12905. Is 258 a factor of a? True Suppose 47454 = 4j - 85274 - 12692. Does 66 divide j? False Suppose 4p - 31 =	{ "pile_set_name": "DM Mathematics" }
989. -5 What is -3 divided by 11211? -1/3737 Calculate -10220 divided by -5110. 2 What is -5 divided by -9827? 5/9827 -90 divided by 20 -9/2 Calculate 23 divided by -191193. -23/191193 Calculate -1589703 divided by -3. 529901 -990264 divided by 2904 -341 4 divided by -21881 -4/21881 Divide 111573 by -12397. -9 What is 134440 divided by -5? -26888 2964 divided by 30 494/5 Calculate 5 divided by -57425. -1/11485 21757 divided by -11 -21757/11 What is 344490 divided by 22966? 15 Divide -1049598 by 27. -38874 What is -12659 divided by 4? -12659/4 What is 288132 divided by 4? 72033 What is -32 divided by 399? -32/399 Calculate -66474 divided by -9. 7386 Calculate -33327 divided by -9. 3703 Divide -1136 by -16. 71 -2609158 divided by 41 -63638 Divide -2064 by -129. 16 Divide -124748 by -13. 9596 Calculate -19 divided by 2495. -19/2495 What is -213180 divided by 44? -4845 131 divided by -5790 -131/5790 -367 divided by -212 367/212 Calculate 68390 divided by -9770. -7 What is 574 divided by 2? 287 -102780 divided by 2 -51390 Divide -6 by -627789. 2/209263 Calculate 4 divided by -26514. -2/13257 Calculate -77477 divided by 2. -77477/2 -30388 divided by -62 15194/31 What is 140776 divided by -2? -70388 0 divided by 54931 0 -86955 divided by -561 155 What is -5314 divided by 1006? -2657/503 Divide 1466352 by 162928. 9 Divide 252594 by 126297. 2 Calculate 375609 divided by 13. 28893 What is -8316 divided by -42? 198 -138180 divided by -588 235 7705 divided by -335 -23 Calculate 90542 divided by -5. -90542/5 1480685 divided by -5 -296137 -15240 divided by 762 -20 What is -582673 divided by -4381? 133 -28 divided by -1293 28/1293 What is 7948 divided by -1? -7948 Calculate 3 divided by -4009. -3/4009 34706 divided by -134 -259 Divide -453201 by 3083. -147 Divide -114254 by 1. -114254 Calculate -464165 divided by 2509. -185 542 divided by 2 271 12 divided by 399 4/133 -17816 divided by 130 -8908/65 What is 3021 divided by -19? -159 What is 25288 divided by -3161? -8 What is 92906 divided by 451? 206 Divide 1222350 by 4. 611175/2 What is -9231 divided by -6? 3077/2 Calculate -1846764 divided by 9. -205196 Calculate 324248 divided by -2. -162124 What is -585432 divided by -173? 3384 Calculate 150627 divided by -4071. -37 107481 divided by -11 -9771 Calculate 181021 divided by 157. 1153 119482 divided by 1 119482 What is 119552 divided by 3736? 32 What is 5707 divided by 13? 439 -65726 divided by -6 32863/3 Divide -341 by 22. -31/2 -1327 divided by -33 1327/33 Divide 449 by 325. 449/325 -70527 divided by 23509 -3 Divide 3211 by -1087. -3211/1087 What is -6848 divided by 2? -3424 -3221 divided by -580 3221/580 -274703 divided by 3 -274703/3 -3 divided by 54788 -3/54788 Calculate 103656 divided by 56. 1851 What is -2570 divided by -6? 1285/3 -258860 divided by -4 64715 What is 11 divided by 16498? 11/16498 What is 566995 divided by 113399? 5 Divide 21068 by -4. -5267 Divide -76627 by 109. -703 What is -3 divided by -1572? 1/524 What is -550 divided by -491? 550/491 What is -316 divided by -227? 316/227 What is -81235 divided by 2321? -35 Calculate 3 divided by -222216. -1/74072 Calculate 4 divided by 52112. 1/13028 Calculate -112 divided by 22577. -112/22577 Divide -38344 by 4. -9586 -13 divided by -150 13/150 Calculate 3048 divided by 6. 508 What is 7147036 divided by 274886? 26 What is 45588 divided by -5? -45588/5 0 divided by -551013 0 293611 divided by -89 -3299 11550 divided by 5775 2 What is -2488 divided by 1244? -2 2 divided by 19039 2/19039 134592 divided by -32 -4206 Calculate -37150 divided by 7430. -5 -260 divided by -165 52/33 What is 132274 divided by 4? 66137/2 Divide -679254 by -5. 679254/5 Calculate 221850 divided by -25. -8874 Calculate -69924 divided by 6. -11654 4558 divided by 8 2279/4 -4300 divided by 430 -10 What is -1419 divided by 138? -473/46 -54 divided by 3100 -27/1550 What is 0 divided by 11673? 0 Divide -20550 by -20550. 1 114 divided by -72 -19/12 What is -440770 divided by 5? -88154 What is 2027340 divided by 405468? 5 Calculate -44695 divided by -2. 44695/2 Calculate -46824 divided by 7804. -6 What is -7 divided by 2574? -7/2574 Calculate -10048 divided by -2. 5024 Divide 811 by -49. -811/49 What is 0 divided by 1002207? 0 What is 100080 divided by -2? -50040 -18942 divided by 9471 -2 Calculate 6456 divided by 1614. 4 33888 divided by -8472 -4 Calculate -44 divided by 30550. -22/15275 What is 922560 divided by 9610? 96 What is -3791245 divided by -758249? 5 What is 33384 divided by -8346? -4 Calculate 532674 divided by -3. -177558 Divide 49951 by 49951. 1 Calculate 1489020 divided by 28635. 52 Divide -3479 by 1. -3479 Calculate -765391 divided by -11. 69581 71 divided by 17887 71/17887 483151 divided by 8189 59 What is 87814 divided by -46? -1909 Calculate -50730 divided by -16910. 3 -164673 divided by -2 164673/2 Calculate -70104 divided by 24. -2921 What is 38195 divided by -1? -38195 Calculate 1957 divided by 163. 1957/163 Calculate -12162 divided by -12162. 1 Calculate 44940 divided by -1070. -42 What is 4963 divided by -153? -4963/153 Divide 18421 by 3. 18421/3 What is -4639365 divided by 655? -7083 Divide -227910 by 3. -75970 What is -1763 divided by 61? -1763/61 Divide 33 by -1528. -33/1528 What is 15162 divided by -7? -2166 What is 69681 divided by 7? 69681/7 Divide -84168 by -1. 84168 Divide 51 by -127671. -17/42557 Divide -11398 by -82. 139 -179484 divided by 29914 -6 -15975 divided by 5 -3195 Divide -1875120 by 468780. -4 Calculate 141076 divided by 1. 141076 Calculate 1 divided by 121677. 1/121677 4878216 divided by 348444 14 8570 divided by -3 -8570/3 115206 divided by -5486 -21 What is -6707 divided by 271? -6707/271 -1498350 divided by -99890 15 Divide 19026 by -9513. -2 Calculate -450687 divided by 150229. -3 -70221 divided by 267 -263 28674 divided by -118 -243 What is -31592 divided by -10? 15796/5 Divide -27768 by -156. 178 -990 divided by -2358 55/131 What is 4536 divided by 8? 567 3892 divided by 3892 1 What is 1641049 divided by -4? -1641049/4 What is -10334 divided by -48? 5167/24 What is -399102 divided by -6? 66517 10967 divided by 10967 1 Calculate 13 divided by 63338. 13/63338 What is 568 divided by -52? -142/13 What is -103760 divided by 25940? -4 -20985 divided by -1399 15 -884387 divided by 4 -884387/4 38540 divided by -9635 -4 Calculate 238825 divided by 5. 47765 What is -986 divided by 239? -986/239 -205200 divided by -13680 15 11520 divided by -1440 -8 Divide 11292204 by 6. 1882034 What is -51000 divided by 340? -150 What is -1322608 divided by 482? -2744 What is 46593 divided by 15531? 3 Calculate 0 divided by -57611. 0 Calculate -121900 divided by -23. 5300 59852 divided by 4604 13 What is -537077 divided by -1? 537077 33 divided by -1505 -33/1505 46671 divided by 993 47 What is 1776 divided by 24? 74 What is -33852 divided by 28? -1209 Calculate 15 divided by -3796. -15/3796 Calculate 17808 divided by -3. -5936 -4 divided by -312229 4/312229 Calculate 3856 divided by -1928. -2 Calculate 118144 divided by -26. -4544 Divide -370278 by -18. 20571 What is -997696 divided by -3668? 272 What is 0 divided by -8948? 0 379890 divided by 12663 30 Calculate 1269384 divided by 423128. 3 Calculate 736389 divided by 153. 4813 Divide -143580 by -28716. 5 Divide -8205 by -25. 1641/5 Calculate 26143 divided by 2. 26143/2 Divide 1 by -565394. -1/565394 What is 83784 divided by -6982? -12 Divide -4356 by -121. 36 What is 196352 divided by 128? 1534 Divide 5140 by 6. 2570/3 Divide -178563 by 3. -59521 What is -61 divided by -92? 61/92 Calculate 82136 divided by 4. 20534 What is 330480 divided by 612? 540 Calculate -32644 divided by 8161. -4 What is -5 divided by -62213? 5/62213 What is -1899 divided by -105? 633/35 Calculate 126663 divided by 1. 126663 Calculate 2 divided by -50379. -2/50379 Calculate -80143 divided by 6. -80143/6 What is 3 divided by -2648? -3/2648 -323664 divided by 14712 -22 Divide -6 by 111159. -2/37053 1172 divided by 7 1172/7 Calculate -19586 divided by -1. 19586 What is -26032 divided by 4? -6508 Divide 61424 by 41. 61424/41 What is -3109 divided by -95? 3109/95 Divide -864204 by 4. -216051 -15363 divided by 569 -27 Divide -901 by -205. 901/205 Divide -36695 by -5. 7339 Calculate -774	{ "pile_set_name": "DM Mathematics" }
actors of y. 2 Let l(u) = u*2 + 4u. List the prime factors of l(3). 3, 7 Suppose 0 = -9n - n + 90. List the prime factors of n. 3 Let k(g) be the first derivative of g5/60 - g4/12 + g3 - 2. Let t(h) be the third derivative of k(h). What are the prime factors of t(2)? 2 Suppose 0 = -3n - 2w - 34, 0n + 4w + 58 = -5n. Let j = 0 - 4. List the prime factors of n/j(-2 - -4). 5 Suppose 4s - 18 = -2h, 2h + 0 = s + 3. Suppose hk - 11 = 2k. What are the prime factors of k? 11 Suppose -t - 13 = o, -4o - 3t + 6t - 45 = 0. Let n = -7 - o. Suppose -5k - 2g + 42 = -17, nk = -3g + 61. List the prime factors of k. 11 Let z be (10 - 3 - 1) + -2. Suppose -3n - 1 = -i - 3, 5n + 6 = 4i. List the prime factors of (i - z) + 4 + 0. 2 Suppose -2b + 3v + 13 + 10 = 0, 5b + v = 15. Suppose -75 = n + bn. Let u = n + 23. What are the prime factors of u? 2 Let w(c) = -2c - 5. Let z be w(-5). Suppose p = 4f + 18, -zp + 0f + 18 = -2f. Let x = p + 0. List the prime factors of x. 2 Suppose 2x + 5 = -3x. Let p(g) = g2 + g + g3 - g3 - 3g*3. What are the prime factors of p(x)? 3 Suppose 0 = 7s - 106 - 6. List the prime factors of s. 2 Suppose -2c - 5d = -0d + 25, c - 15 = 3d. List the prime factors of c + (-3)/((-3)/2). 2 Let h be (-2 - -4)(-3)/2. Let a(s) = 4s + 3. Let r(g) = 4g + 2. Let f(w) = 5a(w) - 6r(w). What are the prime factors of f(h)? 3, 5 Let o = 6 - 15. Let i = 14 + o. Suppose -49 - 6 = -iv. What are the prime factors of v? 11 Let k(w) = -5w + 1. Let q be k(1). List the prime factors of -6 - q - -51. 3 Suppose 4a + 6 = -10, 2y - 4a = 68. What are the prime factors of y? 2, 13 Let f(o) = -5o - 14. List the prime factors of f(-14). 2, 7 Suppose 2s - 5u = -21, -2s - 5u = -0s - 29. Suppose -2 - 4 = -sv. Suppose -44 = -vp - p. What are the prime factors of p? 11 Let l(g) = g2 + 2. Let y be l(-2). Suppose -d - 3o + 30 = 0, -5d + yo - o = -110. List the prime factors of d. 2, 3 Suppose 0 = 6m - 4m - 5c - 30, -5c = 0. Suppose -5g + 4g + m = 0. List the prime factors of g. 3, 5 Let y = 0 + 1. Let f = 1 + y. Suppose 0 = 3j - 32 + f. What are the prime factors of j? 2, 5 Let z = 10 + 21. What are the prime factors of z? 31 Let t(w) = 2w*2 - 6w - 2. What are the prime factors of t(6)? 2, 17 Suppose -3m + 20 = m. Suppose 0 = -4x - 4l + 44, 0 = -3x + x - ml + 34. What are the prime factors of x? 7 Let t(f) = 36f3 - f2 - f + 2. Let i be t(1). Suppose -i = -5c - 4h + 18, 0 = 4h + 16. List the prime factors of c. 2, 7 Let j(c) = 3c - 7. Let h be j(5). Let g = 19 - h. Let z = 22 - g. What are the prime factors of z? 11 Let g(w) = w*3 + 8w*2 - 9w. Let j be g(-9). Suppose p + 28 = 3c - jp, -c + 5p = -14. List the prime factors of c. 3 Suppose -151 = -3g - 34. What are the prime factors of g? 3, 13 Let j(k) = 16k2 - k + 3. List the prime factors of j(-2). 3, 23 Let y be (-5)/(1 - (0 - -2)). Let r(k) = k2 - 4k - 1. Let i be r(y). Suppose 5c - 2o - 31 = 0, -o + i = o. What are the prime factors of c? 7 Let b = -25 - -42. Suppose -5n = -2r - b, -2r = -3r + 3n - 9. List the prime factors of ((-10)/r)/((-1)/(-3)). 5 Suppose -2v + 91 = 1. What are the prime factors of v? 3, 5 Let q(i) = -i*2 - 7i - 5. Let m(o) = -o. Let n(z) = 5m(z) + q(z). What are the prime factors of n(-10)? 3, 5 Let u(n) = -n2 + 15n - 4. Let x be u(11). Suppose 2j = -3j + x. List the prime factors of j. 2 Suppose -5k - 37 = -532. What are the prime factors of k? 3, 11 Suppose j - 5l = 40 + 103, 0 = 4j - 5l - 632. List the prime factors of j. 163 Let x(r) = 8 + 0 - r + 25. List the prime factors of x(0). 3, 11 Let v(g) = -3g + 4. Let f(u) = u2 + 7u - 3. Let z be f(-7). Let k be v(z). List the prime factors of k/4 + (-1)/4. 3 Let v(k) = -k3 + k2 + k - 20. Let r be v(0). Let n be (-11)/(-4) - 5/r. Suppose 11 = -nc + 4c. List the prime factors of c. 11 Let z(r) = 101r + 3. What are the prime factors of z(1)? 2, 13 Suppose 5i + 4l - 45 = 0, 3i - 5l - 20 = -6l. Suppose 0 = -4v + iv - 25. List the prime factors of v. 5 Let n = 29 + -29. Suppose n = d - 39 - 2. What are the prime factors of d? 41 Let z be -3 + (2 - -3) + -4. Let x(p) = p*3 - 2p*2 - 3p + 2. Let d be x(3). List the prime factors of z(-5 + 2) + d. 2 Let o be ((-12)/10)/((-15)/1150). Suppose -4a = -0a - o. What are the prime factors of a? 23 Suppose -b - 6 = 2b. What are the prime factors of (26/(-10) - b)-25? 3, 5 Let l = 2 - -1. Suppose -5w = -17 - l. List the prime factors of (-28)/w1-1. 7 Let w = -41 - -156. What are the prime factors of w? 5, 23 Let b(c) = -50c + 5. Let n be b(2). Let d = -48 - n. What are the prime factors of d? 47 Suppose 5 = 2r - 11. What are the prime factors of r? 2 List the prime factors of 212/7 - 18/63. 2, 3, 5 Let f(x) = -x*3 - 3x*2 - x - 3. Let m = 8 + -12. Let c be f(m). Let d = -8 + c. List the prime factors of d. 3 Let q = 28 + -17. Let m(l) = -l + 1. Let n be m(0). Suppose q - n = r. What are the prime factors of r? 2, 5 Suppose a - 6 = -2a. Let j(s) = -2s2 - 9s - 3. Let v(u) = -2u2 - 8u - 2. Let q(k) = 5j(k) - 6v(k). What are the prime factors of q(a)? 11 Let v(u) = -u*2 - 5u + 3. Let d(q) = -4q2 + 4q - q*3 - 3q*2 + 8 + 2q*2 + 4q. Let s be d(-6). What are the prime factors of v(s)? 7 Let g be (90/35)/((-2)/98). List the prime factors of g/(-12) + 2/(-4). 2, 5 Let s(j) = j*2 - 8j - 6. Let a be s(9). Suppose 0 = p - a - 0. What are the prime factors of p? 3 Suppose -5v + 105 = 15. What are the prime factors of v? 2, 3 Suppose 0o = o - 21. Let n = o - 6. What are the prime factors of n? 3, 5 Suppose 3y - 3o + 12 = 0, 2y + 0o + 3o = 12. Suppose y = -4z - 5p + 69, 6z - 11 = 5z + 5p. What are the prime factors of z? 2 Let c(h) = -h*2 - 9h + 5. List the prime factors of c(-9). 5 Let q = -49 - -97. List the prime factors of q. 2, 3 Let v = 18 - -3. List the prime factors of v. 3, 7 Suppose -5b + n - 2n = -24, -2b + 2n = 0. Suppose -4s = 0, -v + s = -bs - 3. List the prime factors of v. 3 Suppose -a = -1 - 32. List the prime factors of a. 3, 11 Suppose -4s + 3s + 41 = 5u, 6 = u - 2s. Let d = 11 - u. Suppose -q - 10 = -p, -2p - dp - 2q + 85 = 0. What are the prime factors of p? 3, 5 Let b = 28 - 21. Let c = 34 - b. List the prime factors of c. 3 Let p = -72 - -152. List the prime factors of p. 2, 5 Suppose f - 15 = 5g + 2, -5f + 131 = -2g. Suppose 81 - f = 2x. What are the prime factors of x? 3 What are the prime factors of 4/((-4)/(-205)) + (10 - 11)? 2, 3, 17 Let c(l) = -l2 - 12l - 11. Let b be c(-10). Let y(g) = -17g3 + 1. Let n be y(-1). Let r = n - b. What are the prime factors of r? 3 Let c be (4/(-6))/((-3)/1350). What are the prime factors of c/28 + 2/7? 11 Let v(z) = z3 - 9z*2 - z + 11. What are the prime factors of v(9)? 2 Let c be (-646)/(-12) - (-2)/12. Suppose 0 = 5w + 3v - 0v - 159, -c = -2w + 2v. List the prime factors of w. 2, 3, 5 Suppose 0 = 6w - 2w - 952. List the prime factors of w. 2, 7, 17 Suppose -2j = 2j + 4. List the prime factors of 3/j - 46/(-2). 2, 5 Let t be 1/4 + 1253/28. Suppose 5s - 110 = -t. What are the prime factors of s? 13 Let d = -5 + 8. Let l = d - 3. Suppose -p + 0 + 3 = l. List the prime factors of p. 3 Let z be (1 - 1)(-4)/(-8). Suppose 10 = 2h + h + 4l, -l + 25 = 3h. Suppose 5v + h = z, 6c - v - 38 = 2c. List the prime factors of c. 3 Suppose -3p = -22 - 2. Suppose l + c = 11, -c + p = -l + 27. What are the prime factors of l? 3, 5 Let s(l) = l3 - l2. Let j(k) = 3k*3 - 10k*2 - 10k - 5. Let f(v) = -j(v) + 2s(v). What are the prime factors of f(9)? 2, 7 Let s be ((-54)/(-12))/(3/4). Suppose -n - 2 = -2n. Suppose 5f - 22 = 3o, no - 18 = -f + so. List the prime factors of f. 2 Let r = 131 + -92. Let a = -20 + r. What are the prime factors of a? 19 Suppose -6 = -2d - 2. Let i(x) = dx - x - 8 + 4x + x2. What are the prime factors of i(-7)? 2, 3 Let l(r) = 3r - 6. Suppose 3s = s - 10. Let n be l(s). List the prime factors of 98/n(-3 - 0). 2, 7 Suppose 3v = -4s + 15, s - 4v + 0v = -1. Suppose 2k + 2 = 0, 5g - 2k + 25 = 3k. Let q = s - g. List the prime factors of q. 3 Let i = -3 + 2. Let c be ((i + 0)0)/(-2). Suppose 5m	{ "pile_set_name": "DM Mathematics" }
0.5. Let b = 187 - 184. Put -2, b, w in descending order. b, w, -2 Let r be (-120)/(-36) + 2/(-6). Suppose -2t + 19 = -2s - s, 5s + 2t + 21 = 0. Let q = -9 - s. Put 4, r, q in decreasing order. 4, r, q Let j(q) = -q*3 + 5q*2 - 5q + 1. Let s be j(4). Let t = s - 0. Let a = 4.4 - 4. Sort a, -2/9, t in increasing order. t, -2/9, a Let u(y) = y*3 + 1 + 1 - 4 + 3y*2 - y. Let i be u(-3). Put 4, 0, i in increasing order. 0, i, 4 Let z be 2/4(1 - -1). Suppose 3x - z = 5. Suppose -xh = 2h + 4. Sort h, -4, 3. -4, h, 3 Let f = 28.6 - 29. Sort f, 0.07, 5 in ascending order. f, 0.07, 5 Suppose 0 = -4v - 6 + 2. Sort 6, v, 0 in decreasing order. 6, 0, v Let s = 1.1 + 0.9. Sort s, 0.3, 1/4. 1/4, 0.3, s Let c be 2(-1)/(-2) - -3. Sort c, 7/3, -0.5 in decreasing order. c, 7/3, -0.5 Let a(f) = f2 + 4f. Let b be a(-2). Let p = -31 + 32. Put p, 2, b in increasing order. b, p, 2 Let a = 5 + -6. Let l = 12 + -10.8. Let u = l + 3.8. Sort u, a, 1/4 in decreasing order. u, 1/4, a Let z = -23/176 + 5/16. Let u = 6 + -8. Sort u, -0.3, z in ascending order. u, -0.3, z Suppose 2a - 3f = -3, 5f - 5 = -2a + 7a. Put a, -2, 4 in decreasing order. 4, a, -2 Let m = 0 - 1. Let j be (1 - 2) + 2 + m. Let x(r) = 3r + 2. Let l be x(-2). Put j, l, 1 in ascending order. l, j, 1 Let f = 8.1 - 2.1. Sort -3, -2/11, f, -0.3 in ascending order. -3, -0.3, -2/11, f Let t = 57 + -58. Put t, 2, -31 in descending order. 2, t, -31 Let z = -0.05 - -2.05. Let r be (4/48)/(3/(-8)). Sort r, -5, z in increasing order. -5, r, z Let v(h) = -h - 10. Let y be v(-3). Sort 1/2, y, 4. y, 1/2, 4 Let o = -30.7 - -29. Let l = o - -3.1. Let b = -1 + l. Sort 1, b, -0.06. -0.06, b, 1 Let o(i) = 0 + 4 + i + 3 - 3. Let k be o(-9). Sort 1/7, 2/5, k in increasing order. k, 1/7, 2/5 Let t = -33 - -28. Let f = -3 - -2. Sort -0.5, t, f in increasing order. t, f, -0.5 Let f = -1593/7 - -228. Sort f, 1/2, -4 in descending order. 1/2, f, -4 Suppose k - 9 = 3d + 6k, 5k = 2d + 6. Suppose -l + 13 = -0l - 2r, 5l - 17 = -2r. Put 1, d, l in descending order. l, 1, d Let q(f) = -f*3 - 9f*2 - 7f - 3. Let r be q(-8). Let s(l) = -l - 6. Let n be s(r). Let g be (-4)/10 + 17/5. Sort n, g, -2 in ascending order. -2, g, n Let f = 28 + -31. Sort 3, 1, -4, f in descending order. 3, 1, f, -4 Let t = -95.9 + 101. Let z = t - 0.1. Let i = -4 + 6. Put z, 1/2, i in increasing order. 1/2, i, z Let j = -1/61 - 113/549. Let l = -3 + 3.53. Let u = 0.03 - l. Sort 0, j, u. u, j, 0 Suppose -i + 0 - 6 = -2k, -2k = i - 14. Put k, -5, -2 in descending order. k, -2, -5 Let z(l) = -l*2 + 18l + 14. Let g be z(19). Put 1/5, 3/8, g in decreasing order. 3/8, 1/5, g Let y(g) = -g*3 - 6g*2 + 2. Let n be y(-6). Suppose na = -a + 6. Let i = 0.6 - 0.4. Put i, a, -0.2 in decreasing order. a, i, -0.2 Suppose -3g - 2 - 5 = 2h, -2h - 12 = -2g. Suppose 0 = 5s - 0s - 20. Sort h, 3, s in descending order. s, 3, h Let c(j) = -j*2 + 7j + 1. Let b be c(7). Let l = -2 - -1. Suppose 4 = 2q - 2n, -4n = n - 15. Put q, b, l in increasing order. l, b, q Let b = -8 + 5. Let y = 6 + -8. Let d = -4 + 3. Put b, y, d in descending order. d, y, b Let m = 1.1 - 0.8. Suppose -5s + 10 = 2r - 22, 0 = 5s - 20. Let o be (r/(-4))/(3/(-8)). Sort m, o, -3. -3, m, o Let l = 47 + -42. Put 10, l, -3 in descending order. 10, l, -3 Let g be (-2)/8 - 5/(-36). Let d = 0.3 + -0.5. Sort d, g, -2/11 in descending order. g, -2/11, d Let z(s) = s2 + s - 3. Let y be z(3). Let p = y - 8. Put -4, 9, p in descending order. 9, p, -4 Let b = 51 + -51.5. Sort b, -1, -0.2, -0.1 in decreasing order. -0.1, -0.2, b, -1 Let a(b) = b3 - 2b2 - 2b + 1. Let g be a(2). Let z be (-2)/4 + (-26)/(-4). Suppose -3m = -zm + 15. Put 1, m, g in ascending order. g, 1, m Let a(g) = -2g - 6. Let h be a(-5). Suppose -hl + 11 = -1. Put -2/3, l, -5/3 in descending order. l, -2/3, -5/3 Let y be (3/(-6))/(52/(-16)). Put -4, 0.5, y in increasing order. -4, y, 0.5 Suppose 5u + 14 = -4y, -2u = 2y + 3 + 3. Let i = y - -4. Let r(j) = -j + 4. Let m be r(i). Sort m, 0, 5. 0, m, 5 Let n = -5 - -9. Let y = 2.06 - 0.06. Let p = y + -5. Sort p, n, 2/5 in ascending order. p, 2/5, n Suppose 0 = -6n + 2n - 4. Let b = 3 + n. Let x(d) = -d*2 - 2d + 4. Let g be x(-4). Put 0, b, g in decreasing order. b, 0, g Suppose 16 = -4d - 2z, -6 = 3d - z + 6. Let y = -6.3 + 6.2. Put d, -1/2, y in increasing order. d, -1/2, y Let s be (-1)/(-1) - 4/(-4). Let y = 0 - s. Sort y, 1, 5 in ascending order. y, 1, 5 Let o be (((-21)/(-4))/1)/(54/(-12)). Put 2/11, o, -5 in decreasing order. 2/11, o, -5 Let w be (-8)/(-6)3/46. Let n = 3 - 3. Sort w, -3/5, n in descending order. w, n, -3/5 Let g = 1 + 1. Let z be 9/6(-2)/(-3). Put 4, g, z in ascending order. z, g, 4 Let m = -6 - -10. Let c = -10 + 8. Put c, -5, m in increasing order. -5, c, m Let v be ((-3)/6 - -1)2. Suppose -5p = -a - 6, 0 = 5p + 5a - 2a - 22. Put v, -4, p in decreasing order. p, v, -4 Let o(l) = 11l2 + 16l - 12. Let x(s) = 4s2 + 5s - 4. Let d(w) = 3o(w) - 8x(w). Let n be d(-9). Sort n, -4, -2/7. -4, -2/7, n Let p = 119 + -114. Sort -2, p, -0.5, 5/2 in increasing order. -2, -0.5, 5/2, p Let g(r) = r*3 - 7r2 - r + 9. Let v be g(7). Suppose v = -c - c. Put c, 4, -3 in descending order. 4, c, -3 Let z be (3/2)/(6/16). Sort z, -4, 13, 0. -4, 0, z, 13 Let x = -9 + 5. Let a(r) = r3 - 6r2 + 5r + 1. Let p be a(5). Sort -2, x, p in decreasing order. p, -2, x Let m = 2.8 + -2.9. Sort -1/3, -0.07, m. -1/3, m, -0.07 Let d = 3.1 + -3. Let g = 1.9 + d. Let c = 157 + -1728/11. Put c, g, 1 in increasing order. c, 1, g Let d(x) be the first derivative of -x*4/4 + 7x*3/3 - 5x*2/2 - x + 4. Let f = 2 - -4. Let y be d(f). Put y, -3, -1 in descending order. y, -1, -3 Let k = -0.1 + 0.1. Let a = 126.5 - 127. Sort a, k, -0.2 in decreasing order. k, -0.2, a Let q = 175 + -527/3. Sort 3/4, -5, q. -5, q, 3/4 Let x = -0.2 + -1.8. Let o(k) = k - 14. Let p be o(10). Let n be p/(-6) - 8/9. Sort 2/7, n, x in ascending order. x, n, 2/7 Let k = -34 + 20. Let w = k + 25. Put w, 2, 5 in decreasing order. w, 5, 2 Let i = 2 + 0. Suppose 3x - 22 = 5t, -2x + i = -2t - 6. Let z be ((-4)/6)/((-4)/(-18)). Sort -0.2, z, x. z, x, -0.2 Suppose 15 - 43 = 7m. Suppose -1 = 3z + 4r, 5z = z - 2r + 2. Let w be (2 - 1)/z - 0. Put w, m, 4 in decreasing order. 4, w, m Let k be -9(-1)/(-1 + 0). Let i(h) = 10h + 58. Let s be i(-6). Sort k, -3, s in increasing order. k, -3, s Let o = -35.3 + 34. Let k = o - -5.3. Sort k, 5, 4/7 in decreasing order. 5, k, 4/7 Let j = -4 + 2. Put j, 3, -4 in decreasing order. 3, j, -4 Suppose -f = -0f - 1. Let z = 1 - f. Let a be (-154)/(-44) - 2/(-4). Sort -2, z, a in increasing order. -2, z, a Let t = 27 + -23. Put 0.2, t, -2 in ascending order. -2, 0.2, t Let w = 142 + -146. Put -6, 2, w in descending order. 2, w, -6 Let b = 8 - 0. Suppose 2 = 2t - 4a, t - b = 5t - 4a. Let v(p) = p2 + 4p - 6. Let k be v(t). Put 3, -4, k in descending order. 3, k, -4 Let j be 1/(-3)36/228. Sort -5, j, -2/3 in descending order. j, -2/3, -5 Let z be (-8)/92 + ((-16)/(-184) - -4). Suppose 5 = 4q + 5y + 42, 5q + 3y + 30 = 0. Sort 3, z, q. q, 3, z Let z be 5((-6)/(-15) + 1). Put 0, 2, z in increasing order. 0, 2, z Let c = -1.7 + 3.7. Let d = 14/15 - 3/5. Put c, -5, d in increasing order. -5, d, c Suppose -p + l - 7 = 0, 2l + 1 = -2p - p. Let n(c) = -c*2 - c + 1. Let m be n(0). Put m, p, 0 in decreasing order. m, 0, p Let x = 0.1 + 3.9. Let l = 0.36 - -0.04. Sort l, x, -3. -3, l, x Suppose -12 = b - 2c, 3b + 6 = -4c - 0. Let y be (3 + -2)/(2/b). Sort 5, 0, y in decreasing order. 5, 0, y Suppose -4n - y + 0y + 11 = 0, 5y = -25. Let q = 8 + -6. Let o = -28 - -29. Put n, o, q in descending order. n, q, o Let t = -0.34 + 4.34. Sort 1, t, 1/3, 3 in increasing order. 1/3, 1, 3, t Let z = -12 - -9. Let i(j) = -j - 2. Let k(y) = -2y + 9. Let p be k(6). Let t be i(p). Put -1, t, z in ascending order. z, -1, t Suppose -4h = -5d + d - 20, -4d - 12 = 0. Put -5, 30, h in increasing order. -5, h, 30 Let h = 0.41 + -0.33. Sort 0.2, h, -1 in descending order. 0.2, h, -1 Let b be (5/(-2))/(7/(-14)). Let l = 0.2 + -1.2. Sort b, 0.5, l in descending order. b, 0.5, l Let v be 0 - ((-2)/(-2) - 0). Suppose 0 = -2w - 2, -w	{ "pile_set_name": "DM Mathematics" }
m of -1040, -2272, -3698, -5312, -7108, -9080? w*3 - 103w*2 - 930w - 8 What is the d'th term of 19541, 39121, 58701, 78281? 19580d - 39 What is the q'th term of -1192, -1920, -2646, -3370, -4092, -4812? q2 - 731q - 462 What is the o'th term of 43740, 43762, 43800, 43854, 43924, 44010, 44112? 8o2 - 2o + 43734 What is the s'th term of 24, 35, 62, 117, 212, 359? 2s3 - 4s*2 + 9s + 17 What is the z'th term of -16390, -16392, -16402, -16426, -16470, -16540? -z*3 + 2z*2 - z - 16390 What is the k'th term of -40600, -162355, -365280, -649375? -40585k2 - 15 What is the b'th term of -100, -63, -24, 17, 60? b2 + 34b - 135 What is the p'th term of 142, 89, -94, -485, -1162? -13p*3 + 13p*2 - p + 143 What is the b'th term of -41395, -41389, -41383, -41377? 6b - 41401 What is the a'th term of -376, -355, -320, -271? 7a2 - 383 What is the j'th term of -8121, -15855, -23589, -31323? -7734j - 387 What is the s'th term of -134948, -134950, -134952, -134954, -134956? -2s - 134946 What is the p'th term of -36287, -72563, -108839, -145115? -36276p - 11 What is the i'th term of 96881, 193767, 290655, 387545, 484437? i*2 + 96883i - 3 What is the y'th term of 21206, 21204, 21200, 21194, 21186, 21176? -y2 + y + 21206 What is the a'th term of -34311, -68612, -102903, -137178, -171431, -205656, -239847? a3 - a*2 - 34305a - 6 What is the h'th term of 4183, 4031, 3879, 3727, 3575? -152h + 4335 What is the y'th term of -223, -145, -21, 143, 341, 567? -y3 + 29y*2 - 2y - 249 What is the r'th term of -230951, -923817, -2078595, -3695285? -230956r2 + 2r + 3 What is the f'th term of -19, -163, -565, -1357, -2671, -4639? -22f3 + 3f*2 + f - 1 What is the x'th term of -39, -8, 29, 60, 73, 56? -2x*3 + 15x2 - 52 What is the k'th term of 18263, 36535, 54807, 73085, 91375, 109683, 128015? k3 - 6k2 + 18283k - 15 What is the h'th term of 8, -72, -224, -442, -720? h*3 - 42h*2 + 39h + 10 What is the q'th term of 31664, 31666, 31668, 31670, 31672? 2q + 31662 What is the j'th term of 181987, 727966, 1637943, 2911924, 4549915? j3 + 181993j*2 - 7j What is the a'th term of 14539, 14555, 14571, 14587, 14603, 14619? 16a + 14523 What is the v'th term of -2393, -4744, -7045, -9290, -11473, -13588, -15629? v3 + 19v*2 - 2415v + 2 What is the i'th term of -14762, -29519, -44262, -58985, -73682, -88347, -102974, -117557? i3 + i2 - 14767i + 3 What is the x'th term of 21576, 21544, 21512, 21480, 21448, 21416? -32x + 21608 What is the o'th term of 878, 3727, 8480, 15143, 23722, 34223? o*3 + 946o*2 + 4o - 73 What is the q'th term of 767334, 1534669, 2302004, 3069339, 3836674, 4604009? 767335q - 1 What is the h'th term of 5268, 5369, 5638, 6159, 7016, 8293, 10074? 14h*3 + 3h + 5251 What is the a'th term of 307, 1158, 2583, 4588, 7179, 10362? a*3 + 281a*2 + a + 24 What is the k'th term of 494305, 988608, 1482911? 494303k + 2 What is the w'th term of 3357, 13447, 30277, 53853, 84181, 121267, 165117? w*3 + 3364w*2 - 9w + 1 What is the m'th term of -5101, -10201, -15301, -20401? -5100m - 1 What is the k'th term of -253, -601, -949? -348k + 95 What is the j'th term of -383, -767, -1135, -1481, -1799, -2083? j*3 + 2j*2 - 397j + 11 What is the f'th term of -186, -314, -388, -408, -374, -286? 27f2 - 209f - 4 What is the a'th term of -913, -2664, -4415, -6166, -7917? -1751a + 838 What is the m'th term of -9532, -19056, -28580, -38104? -9524m - 8 What is the b'th term of 56072, 56068, 56064, 56060? -4b + 56076 What is the w'th term of 18000, 36019, 54024, 72009, 89968, 107895? -w3 - w2 + 18029w - 27 What is the s'th term of 7240, 14446, 21652, 28858? 7206s + 34 What is the a'th term of -163767, -327520, -491275, -655032, -818791? -a2 - 163750a - 16 What is the a'th term of -154, -251, -348, -445? -97a - 57 What is the l'th term of 865, 1256, 1647, 2038, 2429, 2820? 391l + 474 What is the q'th term of -126980, -126981, -126982, -126983, -126984, -126985? -q - 126979 What is the o'th term of -1562518, -1562517, -1562514, -1562509, -1562502? o*2 - 2o - 1562517 What is the f'th term of -6206, -12414, -18622, -24830, -31038? -6208f + 2 What is the h'th term of -180, -385, -580, -759, -916, -1045? h3 - h2 - 209h + 29 What is the z'th term of -379, -450, -569, -736, -951, -1214, -1525? -24z2 + z - 356 What is the c'th term of 124, 1141, 2158? 1017c - 893 What is the t'th term of 539, 1096, 1671, 2270, 2899, 3564, 4271, 5026? t*3 + 3t*2 + 541t - 6 What is the u'th term of -749855, -1499708, -2249561? -749853u - 2 What is the q'th term of 578, 953, 1578, 2453? 125q2 + 453 What is the d'th term of -77952, -77958, -77950, -77922, -77868, -77782, -77658, -77490? d3 + d*2 - 16d - 77938 What is the u'th term of 77, 84, 67, 14, -87? -2u3 + 21u + 58 What is the o'th term of -180, -373, -566, -759, -952, -1145? -193o + 13 What is the n'th term of -2679, -5482, -8521, -11916, -15787, -20254, -25437? -20n*3 + 2n*2 - 2669n + 8 What is the z'th term of 100, 95, 90, 85, 80, 75? -5z + 105 What is the b'th term of -85, -691, -2333, -5527, -10789? -86b*3 - 2b*2 + 2b + 1 What is the r'th term of 5003, 10013, 15023, 20033, 25043? 5010r - 7 What is the a'th term of 2090, 2094, 2100, 2108, 2118? a2 + a + 2088 What is the z'th term of -7766, -7764, -7762? 2z - 7768 What is the a'th term of 5254, 42385, 143172, 339445, 663034, 1145769, 1819480, 2715997? 5305a3 - 2a*2 + 2a - 51 What is the d'th term of -247772, -247769, -247766? 3d - 247775 What is the c'th term of 8160, 32620, 73386, 130458, 203836? 8153c*2 + c + 6 What is the s'th term of -262, -482, -1120, -2386, -4490? -35s3 + s2 + 22s - 250 What is the t'th term of -5074, -20296, -45666, -81184, -126850, -182664? -5074t*2 What is the o'th term of -174, -1227, -4072, -9603, -18714, -32299, -51252, -76467? -149o*3 - 2o*2 - 4o - 19 What is the i'th term of -115, -79, -41, -1, 41? i*2 + 33i - 149 What is the t'th term of -14071, -28143, -42215, -56287, -70359? -14072t + 1 What is the t'th term of 128840, 257680, 386520, 515360? 128840t What is the m'th term of -1660, -1638, -1616? 22m - 1682 What is the m'th term of -2191, -4259, -6329, -8401, -10475? -m2 - 2065m - 125 What is the i'th term of -1714, -6756, -15164, -26938? -1683i2 + 7i - 38 What is the u'th term of 105, 1156, 4113, 9930, 19561, 33960, 54081, 80878? 159u3 - u2 - 59u + 6 What is the y'th term of -2461, -2514, -2611, -2758, -2961, -3226, -3559? -y*3 - 16y*2 + 2y - 2446 What is the f'th term of -344, -355, -382, -431, -508? -f*3 - 2f*2 + 2f - 343 What is the g'th term of 1203053, 2406106, 3609159, 4812212? 1203053g What is the o'th term of 87, 73, 37, -27, -125, -263? -o3 - 5o*2 + 8o + 85 What is the v'th term of -72189, -72188, -72187, -72186, -72185, -72184? v - 72190 What is the x'th term of -22, -49, -44, 5, 110? 2x3 + 4x*2 - 53x + 25 What is the q'th term of -140785, -281570, -422355, -563140, -703925, -844710? -140785q What is the g'th term of -14188, -14183, -14174, -14161, -14144, -14123, -14098? 2g*2 - g - 14189 What is the p'th term of -1907, -3785, -5693, -7643, -9647, -11717? -2p*3 - 3p*2 - 1855p - 47 What is the s'th term of -3329, -3104, -2881, -2660, -2441, -2224, -2009? -s*2 + 228s - 3556 What is the b'th term of 981, 3301, 7161, 12555, 19477, 27921, 37881, 49351? -b*3 + 776b2 - b + 207 What is the r'th term of 3429, 6842, 10241, 13620, 16973, 20294, 23577? -r3 - r*2 + 3423r + 8 What is the v'th term of 7331, 12949, 18567? 5618v + 1713 What is the k'th term of -4885, -9848, -14829, -19834, -24869, -29940, -35053, -40214? -k3 - 3k*2 - 4947k + 66 What is the g'th term of -1518, -1605, -1692, -1779? -87g - 1431 What is the c'th term of -76388, -305335, -686914, -1221125, -1907968? -76316c*2 + c - 73 What is the x'th term of 89, 265, 421, 557? -10x*2 + 206x - 107 What is the d'th term of -111827, -223694, -335555, -447404, -559235, -671042, -782819, -894560? d*3 - 3d*2 - 111865d + 40 What is the o'th term of -3602, -7642, -11682? -4040o + 438 What is the q'th term of -608, -1133, -1572, -1925, -2192? 43q*2 - 654q + 3 What is the m'th term of 14112,	{ "pile_set_name": "DM Mathematics" }
der when 2588 is divided by 70. 68 Calculate the remainder when 3527 is divided by 704. 7 What is the remainder when 31 is divided by 16? 15 Calculate the remainder when 22039 is divided by 16. 7 Calculate the remainder when 5051 is divided by 79. 74 Calculate the remainder when 830 is divided by 61. 37 Calculate the remainder when 260 is divided by 167. 93 What is the remainder when 10782 is divided by 16? 14 Calculate the remainder when 3110 is divided by 518. 2 What is the remainder when 189 is divided by 40? 29 Calculate the remainder when 39 is divided by 7. 4 What is the remainder when 1117 is divided by 361? 34 Calculate the remainder when 1278 is divided by 61. 58 Calculate the remainder when 247 is divided by 15. 7 Calculate the remainder when 1112 is divided by 13. 7 Calculate the remainder when 1527 is divided by 304. 7 Calculate the remainder when 781 is divided by 131. 126 Calculate the remainder when 10255 is divided by 5123. 9 Calculate the remainder when 600 is divided by 105. 75 Calculate the remainder when 138 is divided by 14. 12 What is the remainder when 410 is divided by 156? 98 What is the remainder when 166 is divided by 14? 12 What is the remainder when 1208 is divided by 110? 108 Calculate the remainder when 196 is divided by 38. 6 What is the remainder when 51 is divided by 50? 1 What is the remainder when 359 is divided by 15? 14 Calculate the remainder when 3521 is divided by 87. 41 What is the remainder when 363 is divided by 11? 0 What is the remainder when 111 is divided by 19? 16 Calculate the remainder when 103 is divided by 11. 4 What is the remainder when 131 is divided by 7? 5 Calculate the remainder when 547 is divided by 65. 27 Calculate the remainder when 198 is divided by 35. 23 Calculate the remainder when 269 is divided by 122. 25 Calculate the remainder when 460 is divided by 149. 13 What is the remainder when 6761 is divided by 23? 22 Calculate the remainder when 723 is divided by 29. 27 What is the remainder when 3572 is divided by 11? 8 Calculate the remainder when 445 is divided by 422. 23 Calculate the remainder when 160 is divided by 43. 31 What is the remainder when 3694 is divided by 231? 229 What is the remainder when 15433 is divided by 15? 13 Calculate the remainder when 435 is divided by 49. 43 What is the remainder when 63 is divided by 3? 0 What is the remainder when 115 is divided by 63? 52 Calculate the remainder when 2266 is divided by 13. 4 Calculate the remainder when 244 is divided by 42. 34 Calculate the remainder when 2723 is divided by 47. 44 Calculate the remainder when 8436 is divided by 13. 12 What is the remainder when 322 is divided by 158? 6 What is the remainder when 527 is divided by 40? 7 What is the remainder when 879 is divided by 16? 15 Calculate the remainder when 88 is divided by 33. 22 What is the remainder when 5932 is divided by 56? 52 Calculate the remainder when 195 is divided by 84. 27 What is the remainder when 57 is divided by 40? 17 What is the remainder when 8743 is divided by 159? 157 What is the remainder when 5838 is divided by 146? 144 Calculate the remainder when 339 is divided by 73. 47 Calculate the remainder when 80 is divided by 70. 10 What is the remainder when 256 is divided by 18? 4 What is the remainder when 8976 is divided by 4484? 8 Calculate the remainder when 1106 is divided by 33. 17 What is the remainder when 4828 is divided by 8? 4 What is the remainder when 616 is divided by 214? 188 What is the remainder when 333 is divided by 130? 73 What is the remainder when 1285 is divided by 39? 37 What is the remainder when 99 is divided by 40? 19 What is the remainder when 1727 is divided by 173? 170 Calculate the remainder when 1465 is divided by 147. 142 What is the remainder when 773 is divided by 51? 8 What is the remainder when 108 is divided by 29? 21 What is the remainder when 1559 is divided by 5? 4 What is the remainder when 29 is divided by 15? 14 What is the remainder when 223 is divided by 75? 73 Calculate the remainder when 41 is divided by 22. 19 Calculate the remainder when 220 is divided by 15. 10 What is the remainder when 119 is divided by 25? 19 What is the remainder when 2057 is divided by 109? 95 Calculate the remainder when 781 is divided by 51. 16 What is the remainder when 129 is divided by 52? 25 Calculate the remainder when 1983 is divided by 455. 163 Calculate the remainder when 239 is divided by 78. 5 What is the remainder when 220 is divided by 16? 12 What is the remainder when 702 is divided by 19? 18 Calculate the remainder when 135 is divided by 28. 23 What is the remainder when 548 is divided by 10? 8 What is the remainder when 644 is divided by 108? 104 Calculate the remainder when 211 is divided by 50. 11 What is the remainder when 176 is divided by 89? 87 What is the remainder when 8962 is divided by 11? 8 Calculate the remainder when 67 is divided by 36. 31 What is the remainder when 46 is divided by 31? 15 What is the remainder when 145 is divided by 21? 19 What is the remainder when 1338 is divided by 445? 3 Calculate the remainder when 12299 is divided by 75. 74 What is the remainder when 5633 is divided by 47? 40 What is the remainder when 284 is divided by 77? 53 Calculate the remainder when 177 is divided by 45. 42 What is the remainder when 1292 is divided by 186? 176 What is the remainder when 1110 is divided by 87? 66 Calculate the remainder when 342 is divided by 3. 0 What is the remainder when 1249 is divided by 25? 24 What is the remainder when 308 is divided by 26? 22 Calculate the remainder when 454 is divided by 114. 112 Calculate the remainder when 3846 is divided by 1917. 12 What is the remainder when 89 is divided by 30? 29 Calculate the remainder when 512 is divided by 173. 166 Calculate the remainder when 161 is divided by 61. 39 What is the remainder when 473 is divided by 96? 89 Calculate the remainder when 873 is divided by 431. 11 What is the remainder when 37 is divided by 13? 11 Calculate the remainder when 322 is divided by 121. 80 Calculate the remainder when 3520 is divided by 141. 136 Calculate the remainder when 2322 is divided by 194. 188 What is the remainder when 93 is divided by 10? 3 Calculate the remainder when 186 is divided by 63. 60 What is the remainder when 137 is divided by 18? 11 Calculate the remainder when 134 is divided by 116. 18 What is the remainder when 1528 is divided by 170? 168 What is the remainder when 135 is divided by 51? 33 What is the remainder when 2272 is divided by 53? 46 Calculate the remainder when 1333 is divided by 167. 164 Calculate the remainder when 1030 is divided by 316. 82 Calculate the remainder when 17999 is divided by 40. 39 What is the remainder when 765 is divided by 252? 9 What is the remainder when 167 is divided by 158? 9 What is the remainder when 1525 is divided by 120? 85 Calculate the remainder when 620 is divided by 32. 12 What is the remainder when 133 is divided by 75? 58 Calculate the remainder when 76 is divided by 11. 10 Calculate the remainder when 1588 is divided by 134. 114 What is the remainder when 2430 is divided by 32? 30 What is the remainder when 2711 is divided by 23? 20 What is the remainder when 1369 is divided by 41? 16 What is the remainder when 1593 is divided by 28? 25 Calculate the remainder when 347 is divided by 116. 115 What is the remainder when 714 is divided by 29? 18 Calculate the remainder when 457 is divided by 66. 61 What is the remainder when 2242 is divided by 22? 20 What is the remainder when 83 is divided by 14? 13 Calculate the remainder when 1362 is divided by 194. 4 What is the remainder when 119 is divided by 26? 15 Calculate the remainder when 4207 is divided by 61. 59 Calculate the remainder when 61 is divided by 21. 19 Calculate the remainder when 74 is divided by 8. 2 Calculate the remainder when 1050 is divided by 8. 2 What is the remainder when 10293 is divided by 100? 93 What is the remainder when 84 is divided by 83? 1 Calculate the remainder when 4836 is divided by 966. 6 What is the remainder when 239 is divided by 228? 11 Calculate the remainder when 208 is divided by 43. 36 Calculate the remainder when 82 is divided by 29. 24 What is the remainder when 154 is divide	{ "pile_set_name": "DM Mathematics" }
= 2l, 3t + zl = 191 + 31. Calculate the greatest common divisor of 8 and t. 8 Let l(j) be the second derivative of j4/12 + 7j*3/3 - 3j*2 + 8j. Let f be l(-13). Let q = f + 28. What is the greatest common divisor of q and 9? 9 Let u(i) = -i - 12. Let m be u(-13). What is the highest common divisor of m and 2? 1 Let o = 10 + -138. Let b be (-6)/(-27) - 2/9 - o. What is the highest common factor of 16 and b? 16 Suppose f = 2f - 4x - 33, 0 = 3x + 15. Suppose 0 = m + f - 14. What is the greatest common factor of 11 and m? 1 Suppose -4q - 2o = -3266, 2o + 1085 = 5q - 3020. What is the highest common factor of 63 and q? 63 Let t(v) = v3 + 3v*2 - 2v - 3. Let k be t(-5). Let s = k - -58. What is the highest common factor of 165 and s? 15 Let w = 123 + -87. Suppose p + w = 3p. Calculate the highest common divisor of 18 and p. 18 Suppose 0 = -160d + 114d + 3864. What is the highest common factor of d and 644? 28 Let b(r) = r3 - 3r*2 + 3r - 2. Let f be b(2). Suppose 5w = -fw + 1030. Let g be (-10)/(-40) + w/8. What is the highest common divisor of 130 and g? 26 Suppose 343 = 12a + 43. Let b = a - -23. Suppose 0 = -5u - 4n + n + 57, 3u = -4n + 32. What is the greatest common divisor of b and u? 12 Let s(k) = -3k*3 + 28k*2 + 2k + 1. Let t be s(8). Calculate the highest common divisor of t and 63. 21 Let f(j) = -j*2 - 14j - 6. Let r be f(-6). Suppose -5z + 3k = -185, -z - k + 37 = 4k. Let u = -16 + z. What is the highest common divisor of u and r? 21 Suppose 2i - 24 = 6i. Let h(p) = 2p*2 + p - 3. Let b be h(i). Calculate the highest common factor of b and 9. 9 Suppose -25d = -35d + 2430. What is the greatest common divisor of 3 and d? 3 Let o(w) = -2w + 3. Let b(h) = -h*3 + 13h*2 - 13h + 11. Let j be b(12). Let g be o(j). Calculate the greatest common factor of 10 and g. 5 Let n = 163 + 165. What is the greatest common divisor of 8 and n? 8 Let k be (-32)/112 + 60/14. Suppose -7b + ki + 370 = -2b, 5i + 95 = b. Let l be ((-32)/20)/((-2)/35). What is the greatest common divisor of b and l? 14 Suppose 451o - 452o = -224. Calculate the highest common factor of 1456 and o. 112 Suppose -4i = 0, 26 = 3m - 5i - 34. What is the greatest common divisor of 140 and m? 20 Let m be (5/(-1))/204-290. Calculate the highest common divisor of m and 15. 5 Suppose 15 = -3y + 39. Let a = y + 17. What is the greatest common factor of 275 and a? 25 Suppose -8f + 8 = -32. Let l be ((-4)/f)/((-1)/30). Calculate the greatest common divisor of l and 48. 24 Suppose 8 = 4x, -3t - 2t = 2x - 1889. Calculate the highest common factor of 29 and t. 29 Let f = -644 - -710. Calculate the highest common divisor of 96 and f. 6 Let q(b) = -b3 + 8b*2 - 4b + 11. Let j be q(8). Let g be ((234/4)/9)/(2/12). Let v = j + g. Calculate the highest common divisor of 27 and v. 9 Let i(o) be the second derivative of -o*4/12 - 5o*3/6 + 4o*2 + 2o. Let y be i(-8). Let p = y + 17. Calculate the greatest common factor of 2 and p. 1 Suppose 3n = -4t + 2292, 5n = 3t - 1722 - 26. What is the highest common factor of 72 and t? 72 Let x(r) = -r + 17. Let j be x(7). Let y = j - 14. Let o be (-3 - y)130. Calculate the greatest common factor of 10 and o. 10 Let h(f) = -40f + 682. Let j be h(16). Calculate the greatest common divisor of 1344 and j. 42 Let l(c) = 32c + 10. Let g be l(10). Let d be (20/2 - 1)/((-24)/(-80)). Calculate the highest common factor of g and d. 30 Let l be 0 + -7 + (-3 + 5 - 2). Let w(i) = -9i - 25. Let c be w(l). Calculate the highest common divisor of c and 266. 38 Let s(t) = t3 + 2t - 1 + 3 - 3t2 - 1. Let i be s(2). What is the highest common divisor of 9 and i? 1 Let q(n) = 2n*2 + 10n + 6. Let k be q(-6). Let d(j) = -j*3 + 11j*2 - 7j - 93. Let b be d(7). What is the highest common factor of k and b? 18 Let s = 1383 + -1346. Calculate the highest common factor of 1961 and s. 37 Let p be 51112/5. Let b be ((-416)/p)/((-2)/14). Let x(q) = q*3 + 9q*2 + 2q + 8. Let k be x(-6). What is the greatest common divisor of b and k? 26 Suppose 0 = 20w - 15w - 60. Let m = w + 1. Calculate the greatest common divisor of m and 221. 13 Let i = 70 - 181. Let r = i + 315. Calculate the highest common divisor of 34 and r. 34 Let l = 340 - 307. Calculate the greatest common factor of l and 77. 11 Let a = 55 + -18. What is the greatest common factor of 296 and a? 37 Let i = 31 - 35. Let n be -8i/162. Suppose 0 = -4x - 20, 2g - 60 = 5x - 23. Calculate the highest common factor of n and g. 2 Suppose -3j - 420 = -7j. Calculate the greatest common factor of 45 and j. 15 Let b(c) = -c2 - 24c - 139. Let n be b(-12). Let p(y) = y*3 + 5y*2 - 6y - 5. Let u be p(-5). Calculate the highest common divisor of u and n. 5 Suppose 5u - 134 = -2k, u - 30 = 5k - 14. What is the greatest common divisor of u and 208? 26 Suppose -179 = -5d + 2d + 4o, 0 = -o - 2. Let q = -33 + d. Calculate the greatest common divisor of q and 60. 12 Let b = 113 + -77. Suppose 0 = -w + 4a + b, w + 3a - 28 = 1. Let d = -1148 - -1164. What is the greatest common factor of d and w? 16 Let k(p) = 7p2 - 3p + 2. Let j be k(2). Suppose 0 = 2w + w - j. Suppose -11 - 61 = -9y. What is the greatest common divisor of w and y? 8 Let j be 6 - ((-16)/(-12))/((-6)/9). Suppose 2 = -jw + 10w. Suppose 2u = -u + 15. Calculate the greatest common factor of w and u. 1 Let h(b) = b3 + 15b2 + 9. Let p(y) = y2 - 1. Let c(t) = h(t) + 6p(t). Let f be c(-21). What is the greatest common factor of f and 2? 1 Let j = 227 + -211. What is the highest common factor of 368 and j? 16 Let n be (-96)/(-9) - 4/6. Suppose 4x = -3x + 280. Calculate the greatest common divisor of n and x. 10 Let y = -1389 - -2120. What is the greatest common divisor of 129 and y? 43 Let f(y) = y2 - 52y - 9. Let c be f(53). Calculate the greatest common divisor of c and 506. 22 Suppose -15 + 3 = 3h. Let j(k) = -11k - 9. Let y be j(h). Calculate the highest common factor of y and 14. 7 Let u = -32 - -59. Let d(v) = -3v - 8. Let a be d(-7). Let q(c) = c3 - 14c*2 + 13c + 3. Let h be q(a). Calculate the highest common factor of u and h. 3 Let w be 1 + 185/3 - (-1)/3. Suppose -3a - 3 = -15. Suppose 16 = aj - 20. Calculate the highest common factor of j and w. 9 Let u(j) = 5j2 - 12j + 5. Let b be u(3). Calculate the highest common factor of 63 and b. 7 Suppose 5 + 13 = 6t. Suppose 0w = tw - 3l - 24, -4l = 2w - 16. Let f be 1 + 2/(-2) - -24. What is the greatest common factor of f and w? 8 Suppose -q = -4, 0 - 2 = -2n + q. What is the greatest common factor of n and 6? 3 Suppose -1632 = -i - 15i. Calculate the highest common divisor of 6 and i. 6 Suppose 0 = -y + 2y. Suppose y = 3o - 68 - 202. What is the highest common divisor of o and 10? 10 Let x(r) = -6r3 - 4r*2 - 3r - 2. Let q(h) = h*2 - 8h + 10. Let m be q(6). Let b be x(m). Calculate the greatest common factor of 24 and b. 12 Let c be (-6)/(-3) + 5 + 2. What is the greatest common factor of c and 33? 3 Suppose 127 = j + 14o - 18o, 4j - 5o = 563. Calculate the highest common factor of j and 42. 21 Let z(j) = -26j + 26. Let h be z(14). Let q be (h/39)/(2/(-6)). What is the greatest common factor of 39 and q? 13 Let o(n) = -60 + 66 + 2n*2 + 0n - 3n. Let v be o(4). What is the highest common divisor of 13 and v? 13 Let r(y) = -y3 + 28y*2 - 49y - 30. Let g be r(26). Calculate the greatest common divisor of g and 2688. 48 Let b = 203 + -126. Let t = 15 + -8. Calculate the highest common divisor of b and t. 7 Suppose 5k + 2k = 7. Let f be (-21k)/(0 - 3). Let z be (-2)/(-8) + 3/4. What is the highest common divisor of z and f? 1 Suppose 35 = 4j + 5h - 2h, 2h - 15 = -j. Suppose -2y + 123 = -3l, -5y + jl + 295 = -0y. What is the highest common divisor of 81 and y? 27 Suppose g - 3g + 4h = -34, -5g + 2h = -45. Let l(c) = 2c2 - 6c - 17. Let d be l(g). Let p = 81 - d. Calculate the highest common factor of 6 and p. 6 Suppose -3v = 4d - 2044, -5597 = -5v + d - 2175. What is the highest common divisor of v and 19? 19 Suppose -2f + 6 = 4, 4t = f + 31. Calculate the greatest common factor of 104 and t. 8 Let v(r) = -7r**3 - r. Let z be v(1). Le	{ "pile_set_name": "DM Mathematics" }
59, 1338, 1671, 1482, 495? -46z3 + 291z*2 - 2z - 33 What is the a'th term of 6672647, 6672607, 6672567, 6672527, 6672487? -40a + 6672687 What is the a'th term of 6015, 3881, 1747, -387, -2521, -4655? -2134a + 8149 What is the w'th term of 53949, 53960, 53979, 54006, 54041? 4w2 - w + 53946 What is the z'th term of 3101, 1235, -1879, -6241, -11851, -18709? -624z*2 + 6z + 3719 What is the c'th term of 164043816, 164043819, 164043824, 164043831, 164043840, 164043851? c*2 + 164043815 What is the v'th term of 77055, 77165, 77275, 77385, 77495? 110v + 76945 What is the k'th term of -143429846, -143429851, -143429856, -143429861, -143429866, -143429871? -5k - 143429841 What is the f'th term of 106541, 106937, 108015, 110117, 113585, 118761, 125987, 135605? 57f3 - f2 + 106485 What is the j'th term of -51085325, -102170651, -153255977, -204341303, -255426629? -51085326j + 1 What is the j'th term of 4096726, 8193364, 12289916, 16386382? -43j*2 + 4096767j + 2 What is the f'th term of 51618, 103255, 154892? 51637f - 19 What is the y'th term of -12591, -10443, -8295, -6147? 2148y - 14739 What is the c'th term of -487212, -487180, -487148, -487110, -487060, -486992? c*3 - 6c*2 + 43c - 487250 What is the t'th term of -1009, 288, 3931, 9920? 1173t2 - 2222t + 40 What is the f'th term of -301176, -301157, -301162, -301203, -301292, -301441? -2f3 + 33f - 301207 What is the s'th term of 209209, 837015, 1883355, 3348229? 209267s2 + 5s - 63 What is the y'th term of -76473, -149249, -222025, -294801? -72776y - 3697 What is the w'th term of -28468438, -28468441, -28468444, -28468447, -28468450? -3w - 28468435 What is the b'th term of 956, 1122, 1564, 2426, 3852, 5986, 8972, 12954? 24b3 - 6b*2 + 16b + 922 What is the l'th term of -1473975, -1473922, -1473833, -1473708, -1473547, -1473350? 18l2 - l - 1473992 What is the q'th term of -381985, -3056036, -10314209, -24448564, -47751161, -82514060? -382010q3 - q2 + 22q + 4 What is the g'th term of 8824, 16700, 22680, 25816, 25160, 19764, 8680, -9040? -158g*3 + 8982g What is the g'th term of 4993, 5929, 6865, 7801? 936g + 4057 What is the b'th term of -18780, -1887, 15006, 31899? 16893b - 35673 What is the j'th term of 732055, 1464107, 2196159, 2928211? 732052j + 3 What is the b'th term of -321, 1386, 7009, 18504, 37827, 66934, 107781? 326b*3 + 2b*2 - 581b - 68 What is the p'th term of -6415, -28207, -65379, -117931? -7690p2 + 1278p - 3 What is the b'th term of -98275, -197713, -297151? -99438b + 1163 What is the l'th term of 489946, 489919, 489888, 489853? -2l*2 - 21l + 489969 What is the g'th term of -23067065, -23067064, -23067063, -23067062, -23067061, -23067060? g - 23067066 What is the a'th term of 1060, 3449, 5842, 8239, 10640, 13045? 2a2 + 2383a - 1325 What is the a'th term of 2600, 11907, 27420, 49139, 77064, 111195, 151532? 3103a2 - 2a - 501 What is the c'th term of -2193, -4164, -5919, -7458, -8781, -9888, -10779? 108c2 - 2295c - 6 What is the n'th term of -2504011, -5008087, -7512163, -10016239, -12520315? -2504076n + 65 What is the q'th term of 1524004, 1523990, 1523966, 1523932? -5q*2 + q + 1524008 What is the v'th term of -70658490, -141316983, -211975476, -282633969, -353292462? -70658493v + 3 What is the t'th term of -7806903, -7806902, -7806901, -7806900, -7806899? t - 7806904 What is the w'th term of -21763, -42976, -64193, -85420, -106663? -w*3 + 4w*2 - 21218w - 548 What is the k'th term of -585, -4490, -15103, -35784, -69893? -560k3 + 6k*2 - 3k - 28 What is the m'th term of 1075, 4294, 9453, 16384, 24919, 34890, 46129? -28m3 + 1138m*2 + m - 36 What is the y'th term of 64115288, 128230589, 192345890, 256461191, 320576492? 64115301y - 13 What is the n'th term of -8815, -8813, -8811, -8809? 2n - 8817 What is the l'th term of 25773, 103929, 234175, 416499, 650889, 937333, 1275819? -2l*3 + 26057l*2 - l - 281 What is the b'th term of 4972, 39911, 134770, 319519, 624128, 1078567? 4995b*3 - 10b*2 + 4b - 17 What is the x'th term of -78824, -78700, -78576, -78452, -78328? 124x - 78948 What is the y'th term of 147792842, 147792837, 147792832, 147792827, 147792822, 147792817? -5y + 147792847 What is the w'th term of 3984, 10320, 16656? 6336w - 2352 What is the f'th term of 89251, 89258, 89291, 89350, 89435, 89546? 13f*2 - 32f + 89270 What is the a'th term of 37794, 37867, 38050, 38397, 38962, 39799, 40962? 9a3 + a2 + 7a + 37777 What is the q'th term of -34233825, -68467658, -102701491, -136935324? -34233833q + 8 What is the o'th term of 504, 1462, 3048, 5268, 8128, 11634, 15792, 20608? o3 + 308o*2 + 27o + 168 What is the d'th term of -2860, -2138, -932, 758, 2932? 242d2 - 4d - 3098 What is the j'th term of 61912, 248173, 558608, 993217? 62087j2 - 175 What is the a'th term of 2644, 2946, 3248? 302a + 2342 What is the a'th term of -248836, -248734, -248632, -248530, -248428, -248326? 102a - 248938 What is the t'th term of -103743, -103915, -104089, -104265, -104443, -104623, -104805? -t2 - 169t - 103573 What is the b'th term of -103, 4475, 16907, 41123, 81053, 140627, 223775, 334427? 655b3 - 3b*2 + 2b - 757 What is the l'th term of 55723, 108974, 162225? 53251l + 2472 What is the s'th term of 6929, 27767, 62501, 111131, 173657? 6948s*2 - 6s - 13 What is the l'th term of 740, 1580, 2936, 5066, 8228, 12680, 18680, 26486? 43l3 + 539l + 158 What is the k'th term of 1957, 9185, 24305, 49831, 88277, 142157? 419k3 + 1432k2 - k + 107 What is the z'th term of 8326, 33156, 74498, 132358, 206742, 297656? z3 + 8250z2 + 73z + 2 What is the f'th term of 68893, 72293, 75693, 79093, 82493? 3400f + 65493 What is the n'th term of -17202, -16693, -16168, -15621, -15046, -14437? n3 + 2n*2 + 496n - 17701 What is the o'th term of 13428684, 13428651, 13428558, 13428375, 13428072, 13427619, 13426986, 13426143? -5o3 + 2o + 13428687 What is the h'th term of -23, -733, -1969, -3725, -5995, -8773? h*3 - 269h*2 + 90h + 155 What is the n'th term of 48831479, 48831472, 48831465, 48831458, 48831451, 48831444? -7n + 48831486 What is the p'th term of -271987, -271990, -271993, -271996, -271999, -272002? -3p - 271984 What is the i'th term of -15076809, -15076815, -15076821, -15076827, -15076833, -15076839? -6i - 15076803 What is the d'th term of 86539153, 86539151, 86539149, 86539147, 86539145? -2d + 86539155 What is the m'th term of 1010321, 2020275, 3030229, 4040183, 5050137? 1009954m + 367 What is the d'th term of 380476, 760846, 1141216, 1521586, 1901956, 2282326? 380370d + 106 What is the i'th term of -12940, -13398, -13854, -14308, -14760? i*2 - 461i - 12480 What is the k'th term of 40, -391, -822? -431k + 471 What is the u'th term of -94467085, -188934169, -283401253, -377868337, -472335421, -566802505? -94467084u - 1 What is the g'th term of -9122, -18310, -27676, -37310, -47302? -15g3 + g2 - 9086g - 22 What is the c'th term of 4237535, 4237555, 4237591, 4237643? 8c2 - 4c + 4237531 What is the j'th term of -652, -1005, -1604, -2455, -3564? -j*3 - 117j*2 + 5j - 539 What is the m'th term of 10911, 21984, 33057? 11073m - 162 What is the r'th term of 97648, 781297, 2636916, 6250489, 12208000, 21095433? 97664r3 + r2 - 2r - 15 What is the m'th term of -15133, -21449, -27765? -6316m - 8817 What is the t'th term of -7367, -59356, -200741, -476306, -930835, -1609112, -2555921? -7464t3 + 86t*2 + t + 10 What is the t'th term of 12800, 23084, 33368, 43652, 53936? 10284t + 2516 What is the z'th term of 2441, 2341, 2213, 2045, 1825, 1541, 1181, 733? -2z3 - 2z*2 - 80z + 2525 What is the j'th term of -7558, -30211, -67966, -120823? -7551j2 - 7 What is the g'th term of -854, -1669, -2476, -3281, -4090, -4909, -5744, -6601? -g3 + 10g*2 - 838g - 25 What is the i'th term of 809, 1363, 1429, 779, -815? -38i3 - 16i*2 + 868i - 5 What is the t'th term of 10572, 22496, 34420, 46344, 58268? 11924t - 1352 What is the d'th term of -13409482, -26818956, -40228430, -53637904, -67047378? -13409474d - 8 What is the j'th term of 154736, 155430, 156128, 156830? 2j2 + 688j + 154046 What is the y'th term of 14, -576, -2196,	{ "pile_set_name": "DM Mathematics" }
0/13y2 + 20/13 = 0. -5, -2/7, 1 Suppose -6g = -8g - 4. Let r be (((-8)/(-20))/1)/(g/(-10)). Factor -8a*2 - 10a*r + 2a*4 - 10a*2 + 26a*2. 2a*2(a - 1)(a + 1) Let j(o) = -o3 + 5o*2 - 59o - 79. Let q be (-2)/(-2)-6 + 39 + -35. Let v(w) = -2w*2 + 20w + 26. Let s(x) = qj(x) - 7v(x). Find t such that s(t) = 0. -4, -1, 3 Suppose -15223b = -14826b - 1588. Factor 4t + 4/3 + 1/3t*b + 2t*3 + 13/3t2. (t + 1)2(t + 2)2/3 Let o(y) = -2y + 28. Let h(n) = n + 1. Let z be h(12). Let j be o(z). Let -17f - 6f*3 + 30f - 15f + 6f*j + 2f*4 = 0. What is f? 0, 1 Let 8/9s + 0 + 50/3s2 - 13/3s*3 - 19/9s4 = 0. What is s? -4, -1/19, 0, 2 Let z = -10 - -12. Let n(x) be the first derivative of -xz + 1/3x3 - 2 + 0x. Factor n(w). w(w - 2) Let s be (2/(-2 - -28))/((-322)/23184) - -6. Factor -6/13 + 2/13r*3 - 2/13r + sr2. 2(r - 1)(r + 1)(r + 3)/13 Determine z, given that 3z - 3z + 122z2 + 116253z*4 - 120z*3 - 116255z*4 = 0. -61, 0, 1 Let z = -6439/42 - -6445/42. Find s, given that -10/7s*2 + zs*3 - 23/7s - 12/7 = 0. -1, 12 Let t(n) be the third derivative of 11n6/480 - 21n5/160 - n4/16 - 217n3/6 + 153n*2. Let c(h) be the first derivative of t(h). Factor c(s). 3(s - 2)(11s + 1)/4 Let t(m) = 11m2 + 582m - 2. Let c(i) = -520i2 - 27355i + 95. Let s(f) = 2c(f) + 95t(f). What is q in s(q) = 0? -116, 0 Let f be 15/(-35)(8 - (-390)/(-45)). Suppose -13 = -4a + 5k, 5a - 5k - 8 = 7. Determine n so that fn*a + 10/7 - 12/7n = 0. 1, 5 Let o = 1092 - 185. Let r = 9979/11 - o. Let 72/11 + rx3 + 48/11x - 2x2 = 0. What is x? -1, 6 Let h be (-1 - -16)142/3088529. Factor -3/2y*3 - 1/3y*h + 6y + 4/3. -(y - 2)(y + 2)(9y + 2)/6 Let l(j) = 621j + 2487. Let i be l(-4). Let m(w) be the third derivative of 0w - 1/30w*6 + 0 - 1/3w*5 - 26w*2 + 0w*i - 2/3w*4. Factor m(b). -4b(b + 1)(b + 4) Let a = 111 - 51. Suppose -6t = -2t - a. Factor 2z2 - 4z*2 - tz + 14 + 0z2 + 3z. -2(z - 1)(z + 7) Let j(m) be the second derivative of m*6/165 - 4m*5/55 + 3m*4/22 + 6m*3/11 + 225m. Factor j(z). 2z(z - 6)(z - 3)(z + 1)/11 Let q(t) be the first derivative of t*5/150 - 13t*4/20 + 38t*3/15 + 10t*2 + t + 130. Let h(b) be the second derivative of q(b). Factor h(o). 2(o - 38)(o - 1)/5 Let u = -50/3 - -17. Let o(s) = s3 - 82s*2 + 442s + 1067. Let n be o(76). Suppose 7/3r2 + ur + nr4 + 0 + 5r*3 = 0. What is r? -1, -1/3, 0 Let z = 2056/369 + -192/41. Let s(b) be the first derivative of 0b - 4/5b5 - zb*3 + 0b*2 + 3/2b*4 + 6 + 1/9b*6. Factor s(h). 2h*2(h - 4)(h - 1)2/3 Let c = 226 + -176. Let 10q*2 - 4q*4 + 19q*3 - cq + 6q + 2q*2 - 7q*3 + 24 = 0. Calculate q. -2, 1, 3 Factor 2/11p*2 - 400/11 - 34/11p. 2(p - 25)(p + 8)/11 Let s(w) be the second derivative of 2w7/147 - 74w*6/105 + 239w*5/35 + 1873w*4/21 + 320w*3 + 504w*2 - 115w - 27. Find i such that s(i) = 0. -2, -1, 21 Let p(f) = -f*2 + 2f + 1. Let l(n) = n*3 + 10n*2 - 3n - 2. Let g be 2 + (-4 - -4) - (-4)/(-4). Let o(i) = gl(i) + 5p(i). What is r in o(r) = 0? -3, -1 Suppose -u + 44 = 7w - 3w, -2w + 76 = 2u. Solve -um4 - 2m*2 + 38m4 + 1 - 1 = 0 for m. -1, 0, 1 Let d(r) be the first derivative of r6/33 + 4r5/55 - 2r*4/11 - 4r*3/33 + 3r*2/11 - 739. What is g in d(g) = 0? -3, -1, 0, 1 Let u be (2/12)/(12/54). Let f(s) be the first derivative of 3/5s*5 + 0s*2 - 2 + 0s - 2s3 + us*4. Factor f(a). 3a*2(a - 1)(a + 2) Let u(p) be the second derivative of -p4/42 - 31p*3/7 - 26p*2 + 5131p. Factor u(s). -2(s + 2)(s + 91)/7 Factor 4/5z3 + 0 - 188z*2 + 0z. 4z2(z - 235)/5 Let x(p) = 35p2 + 2105p + 2085. Let d(y) = 64y2 + 4211y + 4174. Let w(r) = 5d(r) - 9x(r). Factor w(g). 5(g + 1)(g + 421) Let n(v) be the first derivative of v*7/147 - 4v*6/105 + 3v*5/70 - 95v + 4. Let s(c) be the first derivative of n(c). Determine g so that s(g) = 0. 0, 1, 3 Suppose -5t + 6i = 4i - 10, 5i - 4 = -2t. Find s such that 675 + 17s*t - 873s + s*3 - 1062s - 284s2 - 10s*3 = 0. -15, 1/3 Let y(g) be the first derivative of -80g*3 - 715g*2/2 + 15g - 1580. Suppose y(i) = 0. Calculate i. -3, 1/48 Let w(d) be the first derivative of 490d5/9 + 1120d*4/9 + 1628d*3/27 - 64d*2/3 + 2d - 2560. Factor w(b). 2(b + 1)2(35b - 3)2/9 Let z(m) be the second derivative of 2/15m*6 - 6m*2 - 10/3m*3 - 2/21m*7 + 75m + 2/3m4 + 0 + 6/5m*5. Factor z(r). -4(r - 3)(r - 1)(r + 1)3 Let y(s) be the second derivative of s5/80 + 11s4/16 - 1009s. Factor y(d). d*2(d + 33)/4 Let x(v) be the first derivative of v - 112. Let u(q) = -q*2 - 2q + 9. Let p(m) = 4u(m) - 36x(m). Factor p(g). -4g(g + 2) Let v be (-570)/(-140) - (702/36 - 18). Factor -2/7 - 48/7z2 + 32/7z*3 + vz. 2(z - 1)(4z - 1)2/7 Let h(m) be the second derivative of m7/231 + 7m*6/55 - 81m*5/110 - 221m*4/66 - 40m3/11 + m + 2268. Suppose h(j) = 0. Calculate j. -24, -1, 0, 5 Let w(z) be the third derivative of z7/210 + 11z6/120 + 37z*5/60 + 15z*4/8 + 3z*3 - 839z2. Determine x, given that w(x) = 0. -6, -3, -1 Let l(h) be the first derivative of -h6/69 + 44h5/115 - 165h*4/46 + 904h*3/69 - 128h*2/23 - 1536h/23 + 651. What is c in l(c) = 0? -1, 3, 4, 8 Let b(d) = -25d - 24 + 3d*3 + 3399d*2 - 3364d*2 - 16 - 24. Let m(p) = -2p*3 - 34p*2 + 26p + 64. Let r(j) = 6b(j) + 7m(j). Factor r(t). 4(t - 4)2(t + 1) Let m = -1033 + 1036. Let u(d) be the second derivative of 1/25d6 + 0 + 0d*4 - 7d + 1/25d5 + 0d*2 + 0d*m. Factor u(k). 2k*3(3k + 2)/5 Let z be 0 + (-38)/8 + 20 + -34 + 19. Factor -x + 2x*2 - 5/4x*3 + 0 + zx*4. x(x - 2)*2(x - 1)/4 Let u(p) = -p*2 + p + 5. Let n(c) = 10c*2 - 799c - 184. Let d(b) = -3n(b) - 15u(b). Determine q, given that d(q) = 0. -1/5, 159 Let j(l) be the first derivative of 0l3 - 15 + 0l + 5l2 + 1/570l*5 - 1/228l*4. Let k(a) be the second derivative of j(a). Factor k(h). 2h(h - 1)/19 Let g = -1065473 - -1065476. Factor 76j*2 - 25j*g - 1/4j*5 + 4j*4 + 64 - 112j. -(j - 4)*3(j - 2)*2/4 Suppose -h = -6h + 30. Suppose 0 = 3r - 3b - 30, -2r + hb - 2b + 26 = 0. Factor -11o + 0o2 + 17 - 16o + 3o2 + r. 3(o - 8)(o - 1) Let w be 2/5495/99. Find r such that -5/8r4 + 5/8r*w + 0r + 1/8r3 - 1/8r*5 + 0 = 0. -5, -1, 0, 1 Factor -110z - 128z - 4z*3 + 116z*2 + 58z + 108 - 40z. -4(z - 27)(z - 1)2 Factor -4g*3 + 221g + 160 - 13128g2 + 11g + 13196g2. -4(g - 20)(g + 1)(g + 2) Let w(p) be the third derivative of -p*7/630 - 157p*6/180 - 182p*5 - 62475p*4/4 + 128625p*3/2 + 1038p*2. Suppose w(a) = 0. What is a? -105, 1 Suppose 171 = 11u + 8u. Suppose -b - 3d = -u, -2d - 19 + 25 = b. Suppose b + 2n*2 + n + 3/4n*3 = 0. Calculate n. -2, -2/3, 0 Let h be 22(-27)/(-891)(-279)/(-4). Let -84c - 32 - 18c2 + 9/2c*5 + 83c*3 + hc*4 = 0. What is c? -8, -2, -2/3, 1 Let k(i) be the first derivative of -16i*5/45 + 19i*4/3 + 56i*3/3 - 454i*2/9 + 64i/3 + 1157. Find b such that k(b) = 0. -3, 1/4, 1, 16 Let u(y) be the third derivative of -y*6/180 - 3359y*5/90 - 2822399y*4/36 - 2819041y3/9 - y2 + 444. Factor u(s). -2(s + 1)(s + 1679)*2/3 Let c(q) be the first derivative of 1/2q*4 + 0q - 4/9q3 + 0q*5 - 1/9q*6 + 113 + 0q*2. Factor c(n). -2n*2(n - 1)*2(n + 2)/3 Suppose 3/4 + 78h3 - 6h - 15/2h2 + 315/4h*4 = 0. What is h? -1, -1/3, 1/7, 1/5 Let z be (-5)/((-75)/9) + (-2115)/(-225). Let i(v) be the third derivative of 5/12v*4 + 0 + 1/12v*5 + 0v*3 + zv*2 + 0v. Factor i(k). 5k(k + 2) Suppose -5n = 2o + 51, 536o + 2n + 32 = 541o. Factor -11/10v*o + 3/5v + 0 + 2/5v3 + 1/10v*4. v(v - 1)*2(v + 6)/10 Suppose -35 + 27 = 2t. Let l be (-5 + 4)/(2/t). Factor f3 - 14f*l + 11f*2 + 6f - 4f. f(f - 2)(f - 1) Let 57988x*3 + 57984x*3 - 115967x*3 - 90x*2 - 200x = 0. Calculate x. -2, 0, 20 Let n be 4736/310814/4(-27)/(-72). Let -98/17g3 - 532/17g*n - 48/17 + 328/17g = 0. What is g? -6, 2/7 Let r(s) be the first derivative of s5/100 + s4/30 - s**	{ "pile_set_name": "DM Mathematics" }
059. Calculate the remainder when i is divided by 21. 16 Let y(l) = -l*2 + 5l - 2. Let a be y(3). Let j(t) = t*2 + 5t - 3. What is the remainder when j(-7) is divided by (a - 5-2)/2? 4 Suppose 2a - 114 = -q, -38q + 34q = -5a - 508. Suppose 5l = 3c - 155 + 52, -185 = -5c + 5l. Calculate the remainder when q is divided by c. 40 Suppose -2f + 5n = f - 144, 218 = 5f - n. What is the remainder when 127 is divided by f? 41 Let g(m) = 164m - 37. What is the remainder when g(5) is divided by 98? 97 What is the remainder when 104 is divided by (-28 + 0)/4 - -30? 12 Let d(r) = -2r*3 - 3r*2 + 3r + 4. Let l be d(-3). Suppose 5b - l = 13. Calculate the remainder when b is divided by ((-1)/12(-67 - -49))/((-1)/(-2)). 1 Let v(o) = o*2 - 6o + 9. Let w(h) = -h + 3. Let m be w(-4). What is the remainder when (1/(-2))/(2/(-248)) is divided by v(m)? 14 Suppose 5h + 21 + 364 = 0. Let k = 146 + h. Calculate the remainder when k is divided by 24. 21 Let o(l) be the third derivative of l5/60 - l3/6 - 5l2. Let n be (-8)/2 - -4 - -4. Calculate the remainder when 42 is divided by o(n). 12 Let x(q) = -q2 - 12q - 9. Let l be x(-12). Let z(u) = -u3 - 9u*2 + u + 9. Let a be z(l). What is the remainder when (-4)/16a + 83 is divided by 17? 15 Let j be ((-16)/(-10))/(-2)-15 + 3. Let g(m) = -m3 + 15m*2 - m + 28. Calculate the remainder when g(j) is divided by 9. 4 What is the remainder when 24 is divided by (-102)/(-12) + -8 - (-38)/4? 4 Suppose -q - 4b + 48 = 0, -3q - 5b - 129 = -7q. What is the remainder when q is divided by (-3 - (-28)/(-21))(-3)/1? 10 Suppose 0 = 2m - 6t + 2t - 66, 0 = -3m - 3t + 54. Let d = m + 1. What is the remainder when d is divided by 14? 10 Let g(m) = 4m - 19. Let v be g(9). Suppose -14z = -vz + 141. Calculate the remainder when z is divided by 12. 11 Let g = -62 + 54. Calculate the remainder when (g/10)/(0 + (-3)/105) is divided by 8. 4 Let j(t) = t*2 - 23t + 93. What is the remainder when j(23) is divided by 19? 17 Suppose -2b + 4h = -2, 4b = 3b - 3h + 21. Suppose 0 = 6c - 3c. Suppose f - 4 - 11 = c. Calculate the remainder when f is divided by b. 6 Let o = 18 + -9. Let w = 18 + -7. Let h = w - -24. What is the remainder when h is divided by o? 8 Suppose 0 = 3j + 2x - 9, j - x + 6 = 4j. Let l be 4 - 12/4 - (-10)/2. Let a = l - j. Calculate the remainder when a is divided by 4. 1 Suppose 0 = -29h + 26h + 15, 5f - 2h = 165. What is the remainder when 172 is divided by f? 32 Suppose -43 = -5l - 13. Let g(z) = -6z - 5. Calculate the remainder when g(-3) is divided by l. 1 Let n be 754/10 - -1 - 4/10. Suppose -n = -2h - 2h. What is the remainder when 55 is divided by h? 17 What is the remainder when (-81)/(-189) - (-1)/7361 is divided by 5? 2 Let p(o) = o3 - 2o*2 + 5o - 4. Suppose -5g + 2 = -l, -4l + 12g + 24 = 8g. Calculate the remainder when p(3) is divided by l. 4 Let m be 0/(-3 + (2 + 13)/3). Suppose z = 3o - 2o + 76, m = 5o + 10. Calculate the remainder when z is divided by 11. 8 Suppose -28 = -11d + 7d. What is the remainder when 23 is divided by (-6)/5(-35)/d? 5 Let h(c) = -c*3 - 6c*2 - 3c + 4. Let v = -2852 - -2938. What is the remainder when v is divided by h(-6)? 20 Let j = -15 + 19. Suppose 3y = -h - 6 + 33, 3h + jy - 101 = 0. Let o = h + -17. Calculate the remainder when o is divided by 13. 9 Let u = -295 + 325. What is the remainder when 98 is divided by u? 8 Let j = 221 - 205. Calculate the remainder when 78 is divided by j. 14 Suppose 0 = 4z - 4m - 24, 2 = 5z + 9m - 7m. Let y = 2 + 4. Suppose zd = yd - 20. Calculate the remainder when 13 is divided by d. 3 Suppose -4w + 2d + 126 = 0, -5w + 144 = 16d - 14d. Calculate the remainder when 86 is divided by w. 26 Suppose -4p + 2g + 0g = -60, -5g = -5p + 75. Let i = 10 + p. Calculate the remainder when i is divided by 10. 5 Let h = -21 + 30. Suppose 4n + h = n. Calculate the remainder when 2 is divided by (-3 + 2)(n + 1). 0 Suppose 5u + 434 - 19 = 0. Let x = u - -142. Suppose -5h = 5t - 60, 0 = 4t + 5h - 47 - 1. Calculate the remainder when x is divided by t. 11 Suppose -2d = d - 2568. Calculate the remainder when 169 is divided by (-1)/(-3 - (2 - d/172)). 40 Suppose 57 - 111 = 3g. Suppose -u = z + 4 - 51, 3u = 3z - 141. Let b = g + z. Calculate the remainder when b is divided by 8. 5 Let m = -80 - -96. Suppose 5s - m = 39. Calculate the remainder when 26 is divided by s. 4 Let w(n) = 10n - 218. Calculate the remainder when 21 is divided by w(23). 9 Suppose -11p + 8p = -321. Suppose n + 1 = 0, -3g + 27 = -2n - p. What is the remainder when 86 is divided by g? 42 Suppose 0 = 4z - 1 - 11. Let x be (-2)/1 + 0 + z. What is the remainder when 37 is divided by x/(3/27) - -1? 7 Suppose 0 = 69z - 70z + 3. Calculate the remainder when z is divided by 2. 1 Calculate the remainder when ((-140)/(-16)10)/(13/26) is divided by 16. 15 Let j(r) be the third derivative of r5/30 + r4/4 - 11r*3/6 - 5r*2. What is the remainder when 49 is divided by j(-6)? 24 Suppose -5s + 4z = -0z - 6, -z + 1 = 0. Suppose -sd - i + 50 = 0, 5d = i + i + 107. Calculate the remainder when 45 is divided by d. 22 Let w be (-291)/(-17) + (-2)/17. Suppose 8q = 47 + w. Calculate the remainder when q is divided by 7. 1 Let m = 28 - 12. Suppose 0 = 7z + 308 - 2205. Suppose 5s + 36 = z. What is the remainder when s is divided by m? 15 Suppose 3b - 75 = -2b. Calculate the remainder when 88/33783/36 is divided by b. 13 Suppose 5r - 3 = 2. Let v = r + 56. Calculate the remainder when v is divided by 15. 12 Let w = 218 - 101. Suppose w = -0k + 13k. Calculate the remainder when k is divided by 3. 0 Let w = 4079 - 4060. Let u = 224 - 150. Calculate the remainder when u is divided by w. 17 Suppose -2u + 4u - 3y = 499, -u - 2y = -267. What is the remainder when u is divided by 43? 42 Suppose h - 467 = -432. Calculate the remainder when 85 is divided by h. 15 Let d = -55 - -96. Calculate the remainder when (-3)/5 + 1666/10 + -4 is divided by d. 39 Let m = 82 + -49. What is the remainder when m is divided by 9 + (-39 + 3)/(-4)? 15 Let h(f) = 12f + 25. Calculate the remainder when h(5) is divided by 34. 17 Suppose 6u - 2u = 4d + 136, 5u - 170 = d. Let h(g) = g*2 + 4g + 6. What is the remainder when u is divided by h(-6)? 16 What is the remainder when 45 is divided by 4-1 - 735/(-105)? 0 Let f = 1224 + -305. Calculate the remainder when f is divided by 84. 79 Suppose -5g + 15 = 0, 3c - 165 = 9g - 6g. Calculate the remainder when 324 is divided by c. 34 Let b(v) = v3 - 11v*2 + 26v + 16. Suppose -4p - n = -497, 236 = 4p - 2p - 2n. Calculate the remainder when p is divided by b(8). 27 What is the remainder when ((-66)/(-12)-7)/(3/(-12)) is divided by 13? 11 Let f = 670 - 637. Calculate the remainder when f is divided by 18. 15 Suppose -26 = m - 90. Suppose -4t + 66 = -2. What is the remainder when m is divided by t? 13 Suppose -15l + 270 = -2580. What is the remainder when l is divided by 48? 46 Suppose -172 = -15w + 83. Let d be (-3)/1 + 2 - -3. Suppose -6y + dy = m - 82, -3y = -12. What is the remainder when m is divided by w? 15 Let h(s) = -2s*3 + 28s*2 + 2s - 18. What is the remainder when 39 is divided by h(14)? 9 Calculate the remainder when 5 is divided by (1 + -7 - -2) + 7. 2 Suppose 5 - 10 = -3m + 5j, -3j - 3 = -m. Suppose 74 = 4q + 30. Calculate the remainder when (-2)/(-4)(m + 64) is divided by q. 10 Suppose 3 - 35 = -2p. Calculate the remainder when (8/(-48)-6)/((-2)/(-40)) is divided by p. 4 Let u = -19 + 38. Suppose 4r = -u + 115. Suppose z - 4n = -z + 134, z + 2n = 71. Calculate the remainder when z is divided by r. 21 Let m(q) = q + 2. Let l be m(3). Let c(n) = -2 + 7n + l - 5 - 5. What is the remainder when 26 is divided by c(3)? 12 Let c = -19 - -35. Suppose g + 12m + 10 = 9m, g + 15 = -4m. Suppose 5q + 49 = 10q + y, y = gq - 41. What is the remainder when c is divided by q? 7 Let z(n) be the second derivative of n4/6 - 11n*3/6 + 6n*2 - 19n. What is the remainder when 65 is divided by z(7)? 32 Suppose 0 = -5d + 260 - 10. Let q = -16 + d. Calculate the remainder when q is divided by 12. 10 Suppose 0 = -5l - q + 23	{ "pile_set_name": "DM Mathematics" }
16. 16 Find the common denominator of -53/16 and -17/416. 416 Calculate the least common multiple of 2061 and 1603. 14427 Find the common denominator of -34/11 and -13/633. 6963 Calculate the common denominator of 43/90 and 41/40. 360 Calculate the common denominator of 53/2 and 59/336. 336 What is the least common multiple of 60 and 70? 420 What is the common denominator of 19/288 and -101/198? 3168 Calculate the common denominator of 53/10 and 5/1137. 11370 Find the common denominator of 3/130 and -11/39. 390 Calculate the lowest common multiple of 132 and 260. 8580 Calculate the smallest common multiple of 60 and 2120. 6360 What is the common denominator of 1/12 and 85/146? 876 Calculate the lowest common multiple of 99 and 15. 495 Calculate the least common multiple of 21 and 2. 42 Calculate the least common multiple of 355 and 710. 710 What is the least common multiple of 72 and 80? 720 Calculate the smallest common multiple of 7 and 110. 770 Calculate the least common multiple of 200 and 8. 200 Calculate the lowest common multiple of 3 and 513. 513 What is the least common multiple of 12 and 24? 24 What is the common denominator of 129/140 and 44/259? 5180 Calculate the common denominator of -47/5 and -137/490. 490 What is the smallest common multiple of 5 and 1165? 1165 What is the common denominator of -21/22 and 127/11000? 11000 Calculate the lowest common multiple of 32 and 32. 32 Calculate the common denominator of -15/976 and -29/36. 8784 Calculate the common denominator of 97/688 and -83/516. 2064 What is the common denominator of 13 and -83/246? 246 What is the smallest common multiple of 13 and 391? 5083 What is the common denominator of 29/85 and 18/85? 85 Calculate the common denominator of -149/6 and -14/1583. 9498 What is the common denominator of -47/1246 and -73/70? 6230 Calculate the least common multiple of 1125 and 450. 2250 What is the lowest common multiple of 4 and 650? 1300 Calculate the lowest common multiple of 198 and 162. 1782 What is the common denominator of -58/1475 and 34/175? 10325 Calculate the common denominator of 23/48 and 55/36. 144 What is the common denominator of 29/604 and -55/6? 1812 Find the common denominator of 1/348 and 13/2. 348 Find the common denominator of 33/1900 and -31/1710. 17100 Calculate the common denominator of -26/21 and -4/4515. 4515 Calculate the common denominator of 31/483 and 41/84. 1932 What is the lowest common multiple of 3 and 406? 1218 What is the common denominator of -89/4120 and 93/10? 4120 What is the common denominator of -41/44 and 149/24? 264 What is the common denominator of -43/126 and 97/8? 504 Calculate the lowest common multiple of 7 and 8. 56 Calculate the least common multiple of 55 and 160. 1760 Find the common denominator of -15/9431 and -5/6. 56586 Calculate the common denominator of -11/156 and -37/76. 2964 Calculate the lowest common multiple of 8 and 60. 120 What is the lowest common multiple of 21 and 63? 63 Calculate the lowest common multiple of 1337 and 382. 2674 What is the smallest common multiple of 336 and 40? 1680 Calculate the smallest common multiple of 52 and 234. 468 Calculate the common denominator of 29/186 and -17/207. 12834 What is the lowest common multiple of 8 and 507? 4056 What is the least common multiple of 4053 and 579? 4053 Find the common denominator of 15/976 and 9/488. 976 What is the lowest common multiple of 12093 and 957? 133023 What is the least common multiple of 1 and 104? 104 What is the smallest common multiple of 812 and 14? 812 Calculate the smallest common multiple of 30 and 660. 660 What is the common denominator of -41/8 and 101/3264? 3264 Calculate the common denominator of -23/66 and 137/48. 528 What is the common denominator of -109/594 and 133/432? 4752 Calculate the smallest common multiple of 99 and 22. 198 What is the common denominator of -101/104 and -21/1105? 8840 Calculate the lowest common multiple of 4624 and 2890. 23120 Calculate the smallest common multiple of 68 and 1052. 17884 What is the common denominator of 125/12 and 79/40? 120 Find the common denominator of -23/244 and -43/460. 28060 What is the lowest common multiple of 49 and 133? 931 Calculate the common denominator of 125/72 and -71/9. 72 Calculate the smallest common multiple of 112 and 176. 1232 Find the common denominator of 55/76 and -53/152. 152 Calculate the lowest common multiple of 39820 and 4. 39820 Find the common denominator of -29/78 and 63/260. 780 What is the common denominator of 7/99 and -17/90? 990 Calculate the smallest common multiple of 377 and 39. 1131 What is the least common multiple of 8 and 58? 232 Calculate the least common multiple of 104 and 156. 312 Calculate the smallest common multiple of 32524 and 10. 162620 Calculate the lowest common multiple of 45 and 120. 360 What is the common denominator of 131/144 and -47/3? 144 Calculate the lowest common multiple of 336 and 168. 336 What is the common denominator of 101/816 and 57/4? 816 What is the least common multiple of 18 and 30? 90 Calculate the lowest common multiple of 84 and 2. 84 Calculate the smallest common multiple of 3 and 21066. 21066 What is the common denominator of -119/54 and 65/22? 594 Calculate the smallest common multiple of 960 and 400. 4800 Calculate the common denominator of 46/47 and -9/8. 376 Find the common denominator of -145/486 and -62/81. 486 Calculate the common denominator of 47/192 and 127/432. 1728 Calculate the lowest common multiple of 154 and 70. 770 Calculate the common denominator of 23/13902 and -103/56. 55608 Calculate the lowest common multiple of 6 and 7245. 14490 Calculate the lowest common multiple of 94 and 40. 1880 Find the common denominator of 79/576 and -83/102. 9792 Calculate the common denominator of 71/36 and -79/48. 144 Calculate the lowest common multiple of 30 and 174. 870 What is the common denominator of 19/181 and -32/11? 1991 What is the common denominator of 29/153 and -121/138? 7038 Calculate the common denominator of -71/45 and -67/55. 495 What is the least common multiple of 119 and 490? 8330 Find the common denominator of -70/3 and 115/324. 324 Calculate the lowest common multiple of 40 and 116. 1160 What is the common denominator of 103/6 and 83/7828? 23484 Find the common denominator of 53/156 and 32/351. 1404 What is the lowest common multiple of 592 and 12? 1776 Calculate the least common multiple of 49 and 7. 49 Calculate the common denominator of 143/204 and 109/36. 612 Calculate the lowest common multiple of 54 and 36. 108 What is the lowest common multiple of 4 and 32? 32 Calculate the least common multiple of 64 and 12. 192 What is the common denominator of 17/22 and -83/5464? 60104 Find the common denominator of 79/422 and -35/79. 33338 What is the common denominator of -61/594 and 79/495? 2970 What is the common denominator of -71/2 and -25/7878? 7878 Calculate the common denominator of 163/126 and -37/9. 126 Find the common denominator of -43/2296 and 155/1968. 13776 Calculate the least common multiple of 9 and 11241. 11241 What is the least common multiple of 483 and 77? 5313 What is the lowest common multiple of 49 and 112? 784 What is the common denominator of -41/9 and 139/18? 18 Find the common denominator of 37/6 and 113/84. 84 Find the common denominator of -89/60 and -121/168. 840 Find the common denominator of -16/1703 and -101/262. 3406 Calculate the smallest common multiple of 11 and 261. 2871 What is the lowest common multiple of 2244 and 528? 8976 Calculate the lowest common multiple of 1176 and 735. 5880 Calculate the smallest common multiple of 432 and 44. 4752 What is the least common multiple of 42 and 66? 462 What is the common denominator of -77/24 and -35/688? 2064 Calculate the lowest common multiple of 70 and 105. 210 What is the common denominator of 133/54 and 77/90? 270 Calculate the common denominator of 13/1900 and -111/200. 3800 Calculate the common denominator of -41/132 and 101/748. 2244 Calculate the common denominator of 7/612 and -43/102. 612 Find the common denominator of -57/16 and -67/14. 112 Calculate the lowest common multiple of 2 and 9. 18 Find the common denominator of 41/2120 and -157/90. 19080 What is the lowest common multiple of 368 an	{ "pile_set_name": "DM Mathematics" }
- 12. Let y(v) = 8c(v) - 3q(v). Suppose -3a - 4h = 2a - 46, 3a - 34 = -4h. What is y(a)? -8 Let h be 9/(-8) + (4/32 - 0). Let o(i) = -23i*3 - i. Give o(h). 24 Let t(j) = j. Suppose -2f + 5 = 3f. Suppose 5i + 6 - 1 = 0. Let w be (f - 1) + i + 1. Determine t(w). 0 Let m(x) = -x*3 + 5x*2 - 2x - 1. Let f(a) = -a*3 + 6a*2 + 2a - 4. Let y be f(6). Suppose 3t - yt = -20. Determine m(t). 7 Let y(p) be the third derivative of p*4/24 - 2p*3/3 - 17p*2. Determine y(5). 1 Let g be (-24)/(-40) + (-7)/(-5). Let n(u) be the third derivative of 0 - 1/12u*5 + 2u*g + 1/120u*6 + 0u + 1/2u3 - 1/12u4. Calculate n(5). -7 Let o(d) = -d2 - 3 - 2 - 3d + 5. What is o(-4)? -4 Let g = 122 - 118. Let y(w) be the second derivative of w4/12 - 5w*3/6 - 3w*2/2 + w. What is y(g)? -7 Let h be 4/(-6)3/2. Let x(v) be the third derivative of -v5/24 + v4/24 - v*3/6 - 2v2. Let z(w) be the first derivative of x(w). Determine z(h). 6 Let v(q) = -q3 - 9q2 + 9q - 8. Let b be v(-10). Let k(o) = -2o + 3o - bo. Give k(-2). 2 Let s(j) be the first derivative of 8j3/3 - j2 + j - 5. Give s(1). 7 Let i(m) be the third derivative of m4/24 - m3/3 + m*2. Let f be (-63)/(-4) + (-2)/(-8). Suppose 5g - 3 = -3t, 4t + g - 3 = -f. Calculate i(t). -6 Let m(y) be the first derivative of -2y3/3 + 3y2 + y - 7. Give m(5). -19 Let p(x) be the second derivative of x5/20 - 5x4/12 + x3/2 - x2 + 88x. Let n(c) = -c*3 + 9c*2 - 9c + 12. Let m be n(8). Give p(m). -6 Let f(k) be the first derivative of k5/20 - k4/8 + k3/3 - k2/2 - 5. Let w(y) be the second derivative of f(y). Determine w(2). 8 Let q(u) = -5u - 5 + 0u + u*3 + 10u*2 - 6u2. Let a(s) = s2 + 4s - 10. Let n be a(-5). Calculate q(n). -5 Let p(h) = -h2 - 5h + 2. Suppose 2z + 14 + 7 = -3l, 0 = 5l - 5z + 10. What is p(l)? 2 Let x(v) = -v*3 + 4v*2 - 2v - 1. Let i be -1(0 + -7 - -2). Suppose 2 = -iy - 3. Let b = 4 + y. Determine x(b). 2 Let d(w) = -4w3 - 4w*2 + 15 + 3w*3 - 13. Calculate d(-3). -7 Let u(g) = 3 + 3g3 + 1 - g2 + 2g2 - g. Let n(t) = 10t*3 + 4t*2 - 2t + 13. Let r(v) = -2n(v) + 7u(v). Give r(2). 0 Let y be (-44)/6 - (-6)/(-9). Let z = y - -13. Let b(v) = -5v + zv - 2v. Calculate b(-1). 2 Let c(n) = -n2 + n - 2. Let l = 76 + -74. What is c(l)? -4 Let h(m) = m3 + 5m*2 + m + 7. Let s(d) = -5d. Let b be s(1). Determine h(b). 2 Let a(p) = -p*3 + 2p*2 + 2p - 2. Let u(i) = 0 + 5i - 3i + 3 + 0i. Let x be u(0). Give a(x). -5 Let c(g) be the first derivative of -4g*4 - 2g3/3 - g2/2 + 32. Determine c(-1). 15 Let n(y) be the first derivative of -23y4/4 + y2 - y + 21. Calculate n(1). -22 Let g = 3 - 4. Let b(t) = -t2 - t. Let n be b(-1). Let w = n + g. Let f(u) = -3u*2 - 2u - 1. Give f(w). -2 Let t(x) = -5x + 4. Let u(o) = 1. Let i(v) = t(v) - 5u(v). Give i(3). -16 Let c(q) = -q*3 + 8q*2 - 7q + 2. Let k(x) = -2x3 + 17x*2 - 15x + 3. Let l(r) = 5c(r) - 2k(r). Determine l(5). 4 Let v(y) = -y*3 + 3y*2 + 5y + 1. Let q be v(4). Let s(o) = o - 6. What is s(q)? -1 Let n(l) = 3l - 7l + l*2 + 0 - 2l*2 + 1. Suppose 3 = -c - f + 1, 2f - 4 = 0. Calculate n(c). 1 Let x(o) = o*3 - 2o2 - o. Let n be x(-1). Let w(f) = -f + 2. Let j be w(0). Let s(m) = 2 + 2 + m - j. Give s(n). 0 Let r(j) = -j3 - 4j2 - 3j. Let c = -10 - -14. Let w(k) = -k*2 + k + 3. Let d be w(c). Let x = d + 6. Determine r(x). 0 Suppose 0 = -h + 3q - 6, 3h + 2q + 8 = q. Let z(y) be the first derivative of y*2 + 3y + 7. Determine z(h). -3 Suppose 2 + 0 = n. Let f be (2/6)/(n/30). Let o(c) = -1 - 1 + 2 - 2c. Determine o(f). -10 Let w(f) = -f2 + 2f + 3. Suppose -3y + 22 = -3l + y, 5l + y = -6. Determine w(l). -5 Let w(u) = 3u*2 - 3u + 1. Let l = 20 - 1. Let r = l - 17. Determine w(r). 7 Suppose -h + 14 = -3t, -2h + 3t + 2 = -7h. Let o(n) = -2n + h - n + 4n. Give o(-4). -2 Let u(x) be the first derivative of 1/60x5 + 0x + 1/6x3 - 1/2x*2 + 3 - 1/4x*4. Let l(z) be the second derivative of u(z). Give l(6). 1 Let y(j) = 5j + 7. Let b(r) = 5r + 6. Let d(w) = -4b(w) + 3y(w). What is d(-2)? 7 Let h(b) be the first derivative of -5b3/3 + 2. Let w(t) = t3 + 2t2 - 4t. Let d be w(-3). Suppose 2y + 21 = 4i - dy, 3i - 2 = y. Calculate h(i). -5 Suppose -3u - 11 = -0u + 5z, u - 1 = 3z. Let g = -7 + 10. Let k(n) = -4ng - 2 - 3n*2 + 3n*3 + 0n*2 - 3n + n. Determine k(u). -2 Let p(r) = -r*2 + 3r + 3. Suppose -2a - 65 = 3a. Let o = -8 - a. Give p(o). -7 Let o(s) = 5s - 11. Let l be o(6). Let m(n) = -l + 2n + 19 - 3n. What is m(1)? -1 Let y(b) = 3b + 3. Suppose 2o + 21 = -3p, -2o - 9 = 4p + 17. Calculate y(o). -6 Suppose -17 = -2s + 39. Suppose -5 - s = -3q - 5z, 4z - 24 = -2q. Let b(h) = -h3 + 7h*2 - 6h + 5. What is b(q)? 5 Let x(s) = s*2 + 5s - 3. Let j(t) = -6t3 + 2t2 - t - 1. Let r be j(1). Determine x(r). 3 Let v(j) = -j2 + 4j + 2. Let a(u) = u3 - 8u2 + u - 3. Let y be a(8). What is v(y)? -3 Let t(a) = -a3 - 7a2 + 12a + 2. Let d be 8 + -5 + -1 + -10. Give t(d). -30 Suppose -4 + 24 = 5d - 2r, 0 = -2d - 5r + 8. Let o(z) = -4z3 - 2z*3 - 4 + 5z*2 - 5z + 5z3. What is o(d)? -8 Let x(n) = 2n - 2 - 5n2 + 1 + 4n2 + n3. Suppose -8 = -12f + 16. Determine x(f). 7 Suppose -5y = -3f - 17, 2 = -f - y - y. Let v(m) = 2m + 6. Give v(f). -2 Let x(m) = 2m. Let z(t) = 3t. Let y(b) = 6x(b) - 2z(b). Let j(f) = f3 + f2 - 2f - 1. Let a = -15 + 13. Let k be j(a). Determine y(k). -6 Let q(r) be the second derivative of r5/60 + r4/24 - 5r*3/6 - 3r*2/2 - 2r. Let y(t) be the first derivative of q(t). Give y(0). -5 Let v(w) = w*2 - 6w - 3. Let t be v(7). Let p(h) = t + 0h + h - h2 - 2h + 6h. Let l be 4 + (-1)/(-1 - 0). What is p(l)? 4 Let a(x) be the third derivative of x8/6720 - x7/630 + x5/40 + x4/12 - x2. Let b(h) be the second derivative of a(h). Determine b(4). 3 Let f(r) = -5r + 1. Let o(c) = -c*3 - 6c*2 - 4c + 7. Let y be o(-5). Let t(j) = j*3 - 2j*2 + j - 1. Let n be t(y). Calculate f(n). -4 Suppose 3t - 6t = 3. Let n(q) be the second derivative of 7q5/20 + q3/3 + q*2/2 - 13q. What is n(t)? -8 Let n(r) = 2r - 4. Let a(m) = -m + 1. Let c(p) = 4a(p) + n(p). Suppose -1 = d + f, 0f - 6 = 2f. Calculate c(d). -4 Suppose -3w - 28 = -n - 8w, 4n + 13 = 5w. Suppose -3f + n = -2u, 4u + u = 5f. Let l(d) = -d*3 + 2d*2 + 4. Determine l(u). -5 Suppose 3f - 11 = 4c - 2c, 3c = -12. Let m(z) = f - z - 2 - 3. Suppose -2y - 12 = 2y. What is m(y)? -1 Let r(w) = 9w*2 - 8w + 9. Let m(b) = 3b2 - 3b + 3. Let i(q) = -8m(q) + 3r(q). Let a(g) be the first derivative of i(g). What is a(-1)? -6 Let o(l) = -l - 7. Let s be o(-10). Suppose -2p = -1 - s. Let d(w) = -2w*2 + pw*2 - 2w*2 + 7 - w + 3w*2. Give d(0). 7 Suppose 0 = 4d + 3w - w + 14, -3w + 6 = -3d. Let t(y) = -y3 - 4y2 - y + 2. Determine t(d). -4 Let i(r) = -r3 + 5r2 - 4r - 1. Let b = -17 - -21. Determine i(b). -1 Suppose 5 = 4l - 5h - 0, 2l - 5h = -5. Let u(q) = l + q2 - 5 - q. Let z(b) = -b2 + 9b + 20. Let t be z(11). Determine u(t). 6 Let d be (10/(-15))/(2/6). Let j(c) = c + 2. Determine j(d). 0 Let c be 4/5(-105)/(-6). Let i(d) = 0d + 16 + d - c. Calculate i(3). 5 Let m(y) = -1 - 8y + 1 + 9y. Give m(-3). -3 Let p = 8 + -6. Suppose -f - 4l + 14 = 0, 4l + 0l = 8. Let d = f - p. Let u(h) = h - 2. What is u(d)? 2 Let t(i) = i*3 + 8i*2 + 2i - 2. Let a(x) = -x*2 - x + 1. Let u(w) = -2a(w) - t(w). Calculate u(-6). 0 Let f = 83 + -84. Let u(b) = -17b3. Calculate u(f). 17 Let o(n) = n3 + 3n*2 - 4n + 5. Let p = -3 - 1. Let f be o(p). Let x(q) = 0q - 2 - f + q - 2. Calculate x(5). -4 Let z(t) = 0t - t - t*2 + 0t + 1 - 6 + t*3. Suppose -4h + 5u + 10 = 0, -2h + h - 4u = 8. What is z(h)? -5 Let b be ((-6)/4)/((-16)/(-32)). Let w(p) be the first derivative of 5p*2/2 + 3p + 1. Determine w(b). -12 Let f(c) = -9c + 1. Let r be -6(-2 + 1)-2. Let v be (18/r)/((-3)/2). Give f(v). -8 Let a = 10 - 6. Let k(p) = -3p - 2 + ap + 0p. Calculate k(3). 1 Let c(j) = -6j + 2. Let g(n) = 6n - 2. Let i(m) = -4c(m) - 3g(m). Determine i(2). 10 Let	{ "pile_set_name": "DM Mathematics" }
- (-4 - -9)) -17 Calculate -6 + (-3 - 1) + 2 + 5. -3 Calculate -5 + 7 - (24 + -4 + -3). -15 37 + (46 - 28 - 38) 17 Evaluate (-15 - 12 - -9) + 41. 23 Calculate -10 + -13 - (26 - 28). -21 Evaluate (0 - -1) + (9 - 6) - (45 + -60). 19 -5 - (35 - 21 - -6) -25 Evaluate -36 + 77 + -65 - (21 - 3). -42 Evaluate 33 + -30 + -1 + 6 + -11. -3 What is 3 + (-4 - (-4 + -1)) - (1 + 6)? -3 -3 + 4 + -11 + 4 + 2 + -4 -8 What is -1 - -3 - 43 - (449 + -467)? -23 What is the value of -4 + 3 + -3 + (17 - 0) + -5? 8 Calculate -13 - (9 - (15 + -10 + 7 - 4)). -14 -8 + (9 - 14) - -16 3 Evaluate -20 + 26 + (23 - 42). -13 Calculate 5 + (-7 - 33 - -17). -18 Evaluate -9 + 1 + 2 + 2 + (-49 - -62). 9 Evaluate -13 + 2 + -4 + (-1 - -9). -7 Calculate 2 - (-9 + 5 + -7). 13 Evaluate 0 + 31 - (194 + -182). 19 Evaluate -142 - -110 - (-14 + 20). -38 Evaluate -1 - (-78 + 85 + 2 + -2 + -21). 13 Calculate -6 + -3 + -3 + (71 - 65). -6 (-39 - -39) + 1 + -9 -8 What is the value of (-11 + -9 + 10 - -7) + 7 + 0? 4 -6 - 0 - (13 - 19 - (-9 + 3)) -6 Evaluate -15 - ((-1 - -6) + -5). -15 Evaluate 4 + -7 + (-1 + 1 - (-6 + 7)). -4 -8 - (-3 + 3 + 7 + -8) -7 -930 - -935 - (1 + 8) -4 What is -15 + (-4 - (-5 + -7)) + 17? 10 Calculate -1 + 7 + -3 + 4 + 2 + -15. -6 Calculate 14 + 0 + -4 + -58 + 46. -2 (328 - 305) + -14 + 1 10 What is the value of -15 - (4 + -14) - -18? 13 What is the value of 14 + (-56 - 6) + (5 - (4 - 9))? -38 Calculate 6 + -4 + 2 + (4 + -2 - 4). 2 Calculate (-1 + 3 - -4) + (5 - (3 - -1)). 7 Calculate 2 - -14 - (109 - 101). 8 What is the value of -11 - (-8 - -2) - (-3 - (16 - 5))? 9 (10 - (8 + 0)) + -12 -10 What is the value of (16 - 12 - (20 + -7)) + 15? 6 Calculate -29 + (-24 - -37 - 6). -22 What is the value of -5 - (13 + (1 + 6 - 2 - 7))? -16 Evaluate 9 - 0 - ((-1 - (-2 + 10)) + 8). 10 What is (-27 - -4) + -6 + (9 - 10) + 5? -25 What is 0 + 23 - (1 + 4)? 18 What is 1 + 24 - (962 + -943)? 6 What is (-11 - -14) + (-10 + 5 - -3)? 1 -9 + 12 + 101 + -123 -19 What is the value of (-2 - -1) + -10 + (41 - 46)? -16 4 - ((-17 - -5) + 9 + -1) 8 What is -2 - (-2 + -7) - (-128 - -126)? 9 What is 30 - (17 - 9 - -34)? -12 Calculate -15 + 10 + -22 - (3 - (1 + -1)). -30 What is 1 - (-1 + -7 - -11) - 11? -13 9 - ((7 - 16) + 14) 4 -1 - (18 - 10) - -3 - (-1 + -3) -2 9 + (-14 - -14) + -14 -5 What is 6 - (-27 - -36 - -1)? -4 What is (-10 - 4) + -90 + 97? -7 Evaluate (24 - (4 + 7)) + -10. 3 What is the value of 5 + (-1 - (-14 - (-5 + 0)))? 13 Evaluate (16 - (43 - 8)) + 6. -13 What is the value of -29 - (1 + -29) - -5? 4 Calculate 0 + 13 - -16 - 17. 12 Evaluate -56 + 33 + -5 + 21. -7 Evaluate 5 + 3 + 4 + -9 - 17. -14 What is the value of -1 + (-14 - (-36 + 25))? -4 39 + -30 - 22 - (-16 + 1) 2 What is 14 + (-93 - -108 - (3 - (-1 - 6)))? 19 What is -2 + (-19 - -2) + -32 + 20? -31 Calculate 4 - (13 - (-8 - 3)). -20 Calculate 0 + (6 - (3 - -20)) + -5. -22 -6 + (-3 - -5) - (-7 + -3 + 3) 3 Calculate (4 + (-3 - -11) - 2) + -6 - 25. -21 What is -3 + 7 + -6 + -13? -15 What is the value of (6 - 1) + (158 - 151)? 12 1 - 1 - -3 - (88 - 80) -5 Calculate (3 - -1) + 5 - (-12 + 20). 1 What is the value of -6 + (-8 - (-55 + (2 - -9)))? 30 What is the value of (-2 - -10) + 49 + -63 + -23 + -1? -30 What is the value of -20 + -6 + (1 - (-5 - 16))? -4 -27 - (-3 + (17 - 4) + -26) -11 Evaluate -9 - (-8 + 7 + -23 + 3). 12 Evaluate -2 - ((-9 - (5 + -8)) + (1 - 4)). 7 What is the value of -193 - -175 - (7 + -9)? -16 What is the value of -54 - (-43 - (-34 - -26))? -19 Evaluate (-3 - -11) + (339 - 365). -18 -9 + 5 + 22 - 4 14 What is (4 - 12) + 17 - (10 + -3)? 2 11 + -5 - (20 + -11 + 5) -8 Calculate (-2 - 26) + (-809 - -838). 1 17 + (-22 - 4) - 8 -17 -4 + 5 + -1 + 21 - 8 13 Calculate -3 + 1 + -7 + 1 + 13. 5 Calculate 15 - (11 - -3) - ((0 - -11) + 5). -15 Calculate (-5 - -13) + (-23 - 0). -15 Calculate (827 - 814) + (-2 - 23) + -1. -13 What is the value of -39 + 58 + -17 - (10 - -1)? -9 What is -12 - ((-18 - 0) + -133 + 131)? 8 Calculate 10 - (-17 - (-5 - 7)) - 3. 12 Evaluate 16 + -2 + -21 + 10. 3 Evaluate -4 + 8 + (2 - (-7 - -13)). 0 What is 4 + (-146 - -134) + (-17 - -1)? -24 Evaluate (19 - 6) + 12 + -4 + 1. 22 What is the value of 5 + -12 + 9 + 1? 3 (82 + -43 - -13) + -34 18 What is 0 + 25 + -20 - (10 - 0)? -5 -743 + 748 - (-1 + -4) 10 What is the value of -4 - (199 + -215 - (0 - 7))? 5 ((1 - (8 + -1)) + 5 - -1) + -3 -3 What is (-39 - -33) + (2 - 4 - 3)? -11 Calculate 9 + (9 - (13 + -2)) + 7. 14 What is 11 + 1 + -9 + -12? -9 Evaluate 17 - ((1 - 1) + 57 + -45). 5 Calculate -2 + (1 - 1) - (-2372 + 2346). 24 Evaluate 11 + -10 + (5 - 26) + 9. -11 40 + -55 + (-2 - -2) + 3 -12 -33 - (-3 - -3) - -65 32 Evaluate -5 - -12 - (-17 + 11). 13 Evaluate -2 + (-7 - 5) + 2. -12 Calculate (38 + 9 - 25) + 8. 30 What is the value of (-10 + 3 - (-8 - 2)) + -3 + -21? -21 What is the value of -38 + 59 + -9 + 1 + -10? 3 What is the value of 9 + 3 + 3 + -10 + (-2 - -3)? 6 What is the value of 4 + -16 + 1 + 3? -8 Calculate 8 + -20 - (5 + -13) - 17. -21 Calculate 10 - ((0 + -7 - -17) + -4 - 11). 15 4 + (2 - 0) - (-14 - (-8 + -6)) 6 What is 18 + (18 - (-11 + 36) - 5)? 6 Calculate 21 + -13 - (-7 + 10). 5 What is (-3 - 1) + (1 - 6 - -1) + -1? -9 Evaluate (35 - 41) + (-14 + 7 - 6). -19 Evaluate 4 + (-16 + 3 + 8 - (3 + 1)). -5 What is 0 + -2 + 2 + (68 + -53 - 14)? 1 What is the value of (-5 + 12 - (3 + -4 + 4)) + -6? -2 What is the value of (-1646 - -1653) + (0 + -17 - 1)? -11 What is the value of -2 - (-6 + -8 + (4 - 4))? 12 Calculate 4 + (38 + 1 - (-51 - -56)). 38 Calculate (-3 + 1 + -21 - 1) + -211 + 201. -34 (-7 + 3 - -9) + -3 + 12 14 Calculate -7 + -7 + 10 + (4 - 13). -13 What is 2 - 7 - (3 + 11 + -19) - -10? 10 18 + (3 - 30) + 24 + 0 15 -24 + 13 + 12 + (6 - 26) -19 What is 4 + (-12 - (-1 - 2) - -6) - -3? 4 What is the value of (2 - (-2 + 8)) + (-2 - (-14 - 4))? 12 Evaluate -2 + 0 + -8 + 18 + -28. -20 Evaluate -11 + -4 - (11 - 6 - (6 - -4)). -10 49 + -31 - -1 - (1 + 6) 12 Calculate 53 - 15 - (-21 + 25). 34 -11 - 1 - (1 + -9) - (-8 - -1) 3 24 + -17 + 4 - 14 -3 Calculate 2 + -1 - (-15 - -21 - 18 - 2). 15 Calculate 1 + -2 + 5 + -1 + -9 - 1. -7 22 + (8 - -1) + -39 -8 Calculate 9 + 6 + (-78 - -38). -25 What is the value of -7 - (-38 - -39) - (17 + -1 + -1)? -23 What is (-6 - (-3 - (-2 - -5))) + -3 + -9? -12 Calculate 8 + (0 - (2 - 10)) + -49. -33 Evaluate -1 + (-14 - -8 - -9) + 4. 6 What is -9 - (-18 - -21 - 13)? 1 Calculate 6 + -5 + 6 + -6 + -2. -1 Calculate -7 - (18 - 28) - (-7 - 0). 10 Evaluate ((-11 - -14) + -18 - -7) + 7 + -2. -3 Evaluate (2 + 1 - -2) + 13 + -6. 12 9 - (-1 + 4) - 1 - 5 0 What is -8 + -12 - -10 - -23? 13 Calculate -1 + 8 + -8 + -3. -4 Evaluate 0 - 21 - (9 + -10 + 1). -21 What is the value of 2 + 0 + (-9 - (-1 - 2)) + -6? -10 What is 20 + (2 - (-13 + 17))? 18 What is 3 - (4 + 6 - 9) - (-2 + 6)? -2 Evaluate (-13 - -5) + 4 + -16 + 10. -10 -2 + (0 + 4 + 2 - (-3 - -13)) -6 Calculate 14 + (-2 - (-3 + 4) - 31). -20 Calculate -12 - (10 + -6 + -9). -7 What is -2 - (-18 + -4 + 27 - (-3 + 0))? -10 (50 - 45) + (13 - 1) + -6 - 9 2 Evaluate 185 + -174 - (1 - -48 - 4). -34 Evaluate (-8 - 0) + (2 + -11 - -4) + 1. -12 What is the value of 21 + 27 + -39 - 8? 1 (-8 - -2) + 3 + 5 + -8 -6 -1 + 19 - (-321 + 336) 3 What is the value of (-1 - (-8 - (-4 - 2))) + 4 + 3? 8 What is 23 - (-30 - -15 - -4) - 14? 20 What is the value of -10 + (11 - 0) + 199 + -212? -12 9 - (-34 + 49 - 8) 2 What is (10 - 2) + -10 + -1 + 0? -3 Evaluate 30 + 9 + (-32 - 17). -10 What is the value of 153 + -127 - (4 - -5)? 17 What is the value of -7 - (5 - (4 + 15) - -5) - 7? -5 What is 7 + -20 - (0 + -12 + 4)? -5 Evaluate -26 - (-18 - (-8 + -1 + 4)). -13 Evaluate -27 + 22 - 7 - -17. 5 119 + -114 + (-3 - -2) 4 -11 + 5 - ((4 - 27) + 3 + 2) 12 What is the value of 18 + (4 - (1 + -7 + -4) - 7)? 25 Evaluate (77 - 34) + 19 + -32. 30 Evaluate (-2869 - -2862) + (0 - 1 - -7). -1 What is 2 + -3 + (93 - 81) - (0 - -2)? 9 What is the value of -5 - -6 - (-5 + 5 + -3)? 4 5 + (-3 + 3 - 2) + -4 + -3 -4 What is the value of (3 - (-3 - (8 - 10))) + -4? 0 What is 0 - -2 - (-26 + 14)? 14 Evaluate -24 + (-8 - -43) - -6. 17 Evaluate -12 + -2 + 16 + -13. -11 (-192 - -182) + (-2 - -30 - 2) 16 What is 4 + 8 + -10 + 7 + -2? 7 What is 12 + 11 + -1 + -24? -2 Evaluate -10 + (-2 - -5) + 2 - (32 + -37). 0 What is (-4 -	{ "pile_set_name": "DM Mathematics" }
for h. 3 Let y(c) = c*3 + 33c*2 - 444c + 143. Let h be y(10). Solve 32i - 36i - l + 12 = 0, 0 = -hi - 5l + 9 for i. 3 Let d be -6 - -6 - -4 - -72. Let v = d + -73. Solve -3 = -4w + w - vb, -5b + 19 = -2w for w. -2 Let f be 6480/(-70) - (-9)/(-21) - 2. Let m = f - -106. Solve -2c + p - m = 1, 3c = 2p - 20 for c. -4 Let m = -15 - -15. Let v(j) = -j3 + 10j*2 - 9j + 4. Let b be v(9). Suppose -br = -m - 12. Solve -2d = rq + 3d + 32, 4q + d + 20 = 0 for q. -4 Suppose 2k - 23 = -214s + 213s, 2k - 18 = 0. Solve -s = -2f - o, 5f + 265 = 3o + 272 for f. 2 Suppose w + 3 = -2p, 2p = 3w - 7 - 0. Let i be (-20)/(-20)(p - -7). Solve -3o = 4z - io + 28, 2z - 5o = -30 for z. -5 Suppose l + 2h - 20 = 0, -2l + 4h + 99 - 123 = 0. Solve 16a + 13 = 3w + 17a, 2w + la = 2 for w. 5 Suppose -2x = 3k + 27 - 74, 79 = 4x + 3k. Solve -5y = -2g - 6, -4y - 4g + x = -0g for y. 2 Let r(h) = -9h + 31. Let f be r(-11). Suppose 0 = -fm + 134m. Solve -4l + 7 = 2n - 3, m = 2l + 4n - 2 for l. 3 Let n(p) = -3p*3 + 10p*2 - 6p + 13. Let h be n(3). Solve -16 = 2a + 3j, ha - 1 - 3 = 3j for a. -2 Let o be (-57)/(-38)12/2. Suppose 7y + 4 = oy. Suppose -7 = -yl + x, -l - 2x + 10 = 4. Solve 0u - lu - v = 2, 3u = 5v + 10 for u. 0 Let a = -25949 - -25951. Solve -19 = -u - an - 21, -5 = -5n for u. -4 Suppose 3j - 4p + 1271 = -116, j - 2p + 463 = 0. Let f = -459 - j. Solve fl - 2y - 4 = 0, -l + 2 = 4y - y for l. 2 Suppose 256 - 712 = 8f. Let i be (f - -51)(-4)/3. Solve 3h - 2m = 2m + i, -3 = -h + m for h. 4 Let o(b) = -b*2 + 9b + 253. Let k be o(-12). Solve -4y + f = 4f + k, -f = 5y - 7 for y. 2 Let a(y) = -2y*3 - 22y*2 - 2y - 3. Let r be a(-11). Suppose -3b - z + r = 0, -6 = 4b - z - 22. Solve -2x = 2u - u + 13, -2x = bu + 33 for u. -5 Let r = -7718 - -7726. Solve -r = -2z - z - 4q, q = -3z - 7 for z. -4 Suppose -3z = -z, w = z + 32. Let t(f) be the second derivative of f4/12 - f3/3 + f*2 - 62f. Let o be t(3). Solve 4c - w = -oh + c, c = h for h. 4 Let g be (-4)/(-6) - (-20)/6. Let i be 0 + -4 + 0 - -7. Suppose -ir = 5j - 9, j - 1 = -r + 2. Solve -5k - 22 = -rd, -5k - 2 = gd - 8 for k. -2 Suppose -3s - s = 6s - 280. Solve -2p - s = 4i, 2p = 5i + 8 + 9 for p. -4 Let z be (-7 + 2)/(-15) + 680/12. Let u = z + -49. Solve u = 2d, -2k - 4d + 25 = k for k. 3 Let u = -70 - -85. Let o be (((-8)/6)/4)/(u/(-45)). Let y = 6 - 4. Solve -2x - 3 = 3q + y, 0 = 4q - 3x + o for q. -1 Suppose 29t + 102 = 508. Solve -4i - 29 = 3d - 0, -3d = i + t for d. -3 Suppose 0 = 9c - 7c. Let j = 655 - 652. Solve s - 9 = 5q + j, c = -4q - s - 6 for q. -2 Let l be 3 - 1(0 + 0). Suppose 18j - 2u = 14j - 1142, 3j + 3u + 834 = 0. Let y = j + 300. Solve -x + 0m - y = lm, -m - 3 = -x for x. -2 Let r = 25823 - 25818. Solve -f = -ra - 7, -f = 5a + 237 - 224 for a. -2 Suppose 15u - 40 = 5u. Let g be u + (-5)/(-25)5. Suppose go - 84 = -3c, -45 = -2o - 2o + 5c. Solve 43 = 4i + 3r + o, 3i - r - 8 = 0 for i. 4 Let r(b) = -b - 1. Let j be r(-4). Suppose -14c + 144 = -197 + 187. Solve -jk - 14 = t, -c = -3k + 2t + 2t for k. -3 Let r = 51 - 51. Suppose 138 = -2w - r. Let p = w - -72. Solve -ps + 2h = 17, 3s = 4s - 4h + 9 for s. -5 Let x(l) = l3 - 12l*2 + 23l + 21. Let o be x(3). Solve -5u + 7b - 8 = 11b, o = 3b for u. -4 Let t be (-114)/(-76) - 21/(-2). Let w be 15((-160)/t)/(-10). Let d be (-2)/5 - (-54)/10. Solve 0 = s - dh - 10 - w, -35 = -3s + 4h for s. 5 Suppose 6 = 2a + 4. Let u be (-2)/9 + (-173)/(-9) + a. Solve -5r = -c + 2 + 3, 5r = -4c + u for r. 0 Suppose 0 = 7q - 4m - 45, 5q + 175m - 3 = 173m. Solve -3r = qo, o = r - 3 - 1 for o. -2 Let u = -8688 - -8700. Solve -u = 3x + 6g - 5g, -20 = 5x - 2g for x. -4 Suppose 2t = -2r + 294 - 284, -r + 5 = -4t. Solve t = -2u + 3n - 7, -19n - 5 = u - 21n for u. 1 Suppose -5o = 2z + 2602, 5z + 1189 = 4o + 3264. Let u = -520 - o. Solve -16 = 4l + 4b, u = -5l + 2b + b + 4 for l. -1 Suppose d = 3o - 11, -348 = -5d - 373. Suppose g + 5 = -2u, -3g + 5g - 4u = 30. Solve -oy + 4p + 12 = 0, -2p = -gy - 3p - 3 for y. 0 Suppose -b + 1167 = -4c + 1175, -16 = -2c - b. Solve -3i + 8i - 15 = -2n, 4n = ci - 12 for n. 0 Let d(h) = h3 + 9h*2 + 7h - 8. Let f be d(-8). Let s = 210840 - 210836. Solve -8g + 5g - 17 = 5k, f = -sk + g - 17 for k. -4 Let r(n) = 2n - 27 - 2n2 - 25 - n + 54 - n3. Let t be r(-2). Solve t = -v + 6v - 4z - 22, -3z = 9 for v. 2 Let f be ((8 + 32)/4 + -20)1/(-2). Solve -3a + u - 4u = -15, fa - u = 25 for a. 5 Suppose 3s + 5 = 4i - 9, 5i - 20 = 5s. Let n = -3107 + 3107. Solve n = 2p + ig, 0 = 4p + 5g - 2g - 1 for p. 1 Let m(t) = t3 + t2 - t - 2. Let a be m(2). Let v be (4/(-3))/(a/(-12)). Let c = -586 + 591. Solve 0 = vq - s - c, -2q - 3s = -6s - 11 for q. 1 Suppose 5972 - 5847 = 25o. Solve -2l + 4h = -18, -ol = -5h - 22 - 8 for l. 3 Let t = -48 + 67. Suppose 0 = -3r - 3c + 78, -2r - 22c = -17c - 61. Let z = r - t. Solve -6s + zq = -3s + 9, q = 3s + 9 for s. -3 Suppose 4v = 2x + 19 - 7, -10 = -v + 4x. Let r(a) = 2a*2 + 8a - 8. Let k be r(-5). Let g be (0 + 12)/(3/k). Solve -i - 2t - t + g = 0, 8 = vt for i. -4 Let p(w) = w*3 + 16w*2 - 3w + 90. Let a be p(-14). Suppose r = -a + 528. Solve -3g = t - 4, -48 = rt - 4g - 16 for t. -5 Suppose 2f - 5l = -1600, -92f + 5l - 3970 = -87f. Let w = f - -797. Solve p - w = -2n, p = 3p + 2 for n. 4 Suppose -1675 = -23g + 7686. Suppose g - 167 = 10u. Solve -x = -5o - u, 0 = -3x - 0o + 2o + 7 for x. -1 Let u = 131 - 127. Suppose 5f - ur = 16, -5f = r - 3 - 18. Suppose q - d = 4d + 6, -5q = -fd - 30. Solve -q = -5p - 5g + 14, 2g = 3p + 13 for p. -1 Let l be 4/6 - (-8)/6. Suppose -20s - 2w = -21s + 7, 15s + 4w - 37 = 0. Solve ly + sy - 5 = -d, 4y - 4d - 4 = 0 for y. 1 Let w = 17830 - 17830. Solve -8a - 4l + 26 = -3a, 4a - 2l = w for a. 2 Suppose 0 = -4i + 5i - 2. Suppose il + 5 = 9. Let k(o) = 38o + 81. Let q be k(-2). Solve -7 = f - lc - 0, 0 = 3f - qc + 20 for f. -5 Let q be ((-41)/(-82))/((-9)/(-10) - (-4)/(-10)). Solve -f = 2x, -2f + q = -x + 11 for x. 2 Let i be (-38/18)/(6/(-9)). Solve f = 0, 0 = -ir + 2f + 5 - 3 for r. 1 Let m = 3340 + -3335. Solve 20 = 5q - mb, 12b - 13b = -3q + 14 for q. 5 Let r be (-372 + -10)1/2. Let x = 194 + r. Solve 22 = 3w - 4i, -2w + 22 = xw - 3i for w. 2 Let w = -2856 - -2861. Solve -21 = -f + wb, -2f - 3b + 6b + 14 = 0 for f. 1 Let f = 16190 - 16182. Solve -3w = 4x - 13, -4w - x - 2x + f = 0 for w. -1 Let u be 2/4 + ((-74)/4)/1. Let p be (-213)/u - (-7)/42. Let h be -10(2/(-5) + 0). Solve 3v - 6v = -p, 0 = 4c - hv for c. 4 Let b be 1/(-13) - 6625/(-1625). Solve -t + 0 = br + 5, -t = -r for r. -1 Let u(a) = a2 + 7a + 3. Let z(c) = -c - 16. Let d be z(-9). Let f be u(d). Suppose -401p - 29p = -3520 + 80. Solve fl = l + p, k - 3 = -2l for k. -5 Suppose 0 = -45h + 131 + 139. Let k(w) = -w3 - 6w*2 + 5w - 14. Let c be k(-7). Solve -o = 2g + 2, c = -3o + h for g. -2 Suppose 0 = -4b + f + 161 + 160, -235 = -3b - 5f. Suppose -5n + c + 53 + b = 0, -3c = -n + 21. Solve -g = 3, -p - 2p + 4g = -n for p. 5 Let p = -7751 - -7765. Solve -3q + pr - 9 = 17r, -2q - 9 = -r for q. -4 Suppose 4f - 6f + 44 = 0. Suppose -25v + fv = 36. Let s be -3 - 6/9v. Solve -sc + 20 = 4o - 5, -3o = 4c - 19 for c. 1 Let z = 7012 - 7001. Solve z = -3s - q, -3 = -3s - 5q - 34 for s. -2 Suppose 17z - 1687 + 1262 = 0. Solve zw - 21w + 2a + 8 = 0, 2w + 2a = 0 for w. -4 Let u(j) = -7j*2 - 92j - 9. Let c be u(-13). Solve 0i + 4 = 2i + cb, 2b = -4i - 10 for i. -4 Suppose -4s + 440 = -6f + 2f, 2s - 200 = -2f. Suppose 111 = 2y + s. Solve 2i = -3t - 10, -yi + 4t = -i - 4 for i. -2 Suppose 40 - 43 = -3r, 4x - r = 7. Solve -xz + 5i + 0i = 13, 2i = -2z + 8 for z. 1 Suppose -4m + 25 = 3k, -3m = -6m + 3k + 3. Let b = 57 + -55. Solve 5c = -bq - 30, c + mc + 5 = 3q for q. -5 Let f = -68 + 71. Suppose -y + 5 = 2u + fu, -4u - y = -3. Let x be (3 - u - -1)/1. Solve 2p - p = -4v - 4, -3p + x = -2v for v. -1 Let g be (-	{ "pile_set_name": "DM Mathematics" }
escending order. 5, 0.2, w Suppose -2 = -4o + 6. Sort -2, 0, o in decreasing order. o, 0, -2 Suppose -d = -3d. Suppose d = n + 2n - 6. Put -5, 4, n in descending order. 4, n, -5 Let n be ((-2)/(-4))/((-11)/(-22)). Let b be -3(n - 68/66). Put b, -0.4, 0.5 in decreasing order. 0.5, b, -0.4 Let k = 0.006 + -2.806. Put 0, 0.2, k in decreasing order. 0.2, 0, k Let v = 62 + -308/5. Let x = -2 - -2. Let f = 352/1503 - 2/167. Put f, x, v in decreasing order. v, f, x Suppose -3c + 6 = 3. Sort c, -0.2, -0.1 in decreasing order. c, -0.1, -0.2 Let x = 3 - -2. Let y = x - 2. Sort -2, y, 4 in increasing order. -2, y, 4 Let l = -0.52 + 0.02. Let g = 0 - 1. Let h = g - l. Put h, -2/13, -3 in ascending order. -3, h, -2/13 Suppose 5a - 4a + 4 = -k, -5k = -2a + 27. Let i = 5 + -8. Let w be (-4)/10 + (-4)/(-10). Sort w, k, i. k, i, w Let s be (-4)/6(-1 - -7). Suppose 11 = 7i - 10. Sort 0, i, s. s, 0, i Let i be (-51)/(-7) + 2/(-7). Suppose -2o = 2o - 20. Let y = i - o. Sort -5, 3, y in descending order. 3, y, -5 Suppose 0 = 4f + f - 25. Let h(t) = t*3 - t - 1. Let i be h(-1). Put i, f, 3 in ascending order. i, 3, f Suppose -5 + 4 = -i. Put 0.1, -3/8, i in decreasing order. i, 0.1, -3/8 Let s be (-4)/(-3)(-9)/(-6). Suppose -sy + 4 = 2. Let v be (3/9)/(y/9). Put -0.4, v, 4 in increasing order. -0.4, v, 4 Suppose 0n - 2n - 6 = 0. Let t be (-1)/(0 - (-2)/4). Let i(w) = 3w - 7. Let k be i(4). Put n, k, t in ascending order. n, t, k Let m = -49 - -195/4. Sort 2, 5, m in ascending order. m, 2, 5 Let p = 0 + 0.5. Let l = 47 + -142/3. Sort 5, p, l in descending order. 5, p, l Let q = -0.4 - 0.1. Let y = q + 0.7. Let k = 1 + -1.1. Sort y, -0.3, k in descending order. y, k, -0.3 Let m = 2279/9 - 253. Let v be (-2)/(-1) - -1 - 9. Sort v, -0.5, m. v, -0.5, m Suppose -b - 1 - 3 = 0. Let x = b - -4. Put x, 3, 2 in increasing order. x, 2, 3 Suppose -2w + 10 = -0, 5w - 21 = -4d. Put d, 8, -2, 2 in increasing order. -2, d, 2, 8 Let v be -3((-40)/6)/4. Let j = 3 + -4. Sort j, v, 3 in ascending order. j, 3, v Let v(z) = -z*2 - 12z - 14. Let u be v(-11). Put u, 1, -4 in descending order. 1, u, -4 Let x = -1067/7 - -152. Let i = -0.6 + 0.3. Put x, i, 0.4 in ascending order. x, i, 0.4 Let m = -1 - -4. Suppose -mc + 7c = 0. Put c, 1, -3 in decreasing order. 1, c, -3 Let z = 18 + -13. Let f(b) = -b*2 + 5b + 8. Let t be f(6). Suppose 3k = -13 - t. Put k, -3, z in increasing order. k, -3, z Let y = 3 - 0. Let v = -8.4 - -8. Sort 1, y, v in descending order. y, 1, v Let r = -15.22 + 0.22. Let g = -8 - r. Let m = 7.4 - g. Sort 2, m, 1. m, 1, 2 Let g = -1 + -3. Let u = -24 + 13. Let z = u + 8. Put 3, g, z in decreasing order. 3, z, g Let l = 0.21 + -0.24. Sort -0.4, l, 2/17 in descending order. 2/17, l, -0.4 Let r be 0 + (3 - 1)/(-6). Sort r, 2/11, 0.3, 1/9 in increasing order. r, 1/9, 2/11, 0.3 Suppose 4 = q - 0. Suppose -10 = -2f + 7f. Sort q, -5, f in descending order. q, f, -5 Let g(t) = 3t*2 - 1. Let q be g(-1). Let l(y) = 9y - 24. Let b be l(3). Put q, 5, b in descending order. 5, b, q Let b be 58/(-18) - -3 - 116/(-36). Put 2, 8, b, -2 in decreasing order. 8, b, 2, -2 Let a = -33 - -48. Suppose 0 = 5w - 10w + a. Put 2, -4, w in increasing order. -4, 2, w Let w be -1 + 0 + (-3)/(-9). Sort 4, w, 1/9 in descending order. 4, 1/9, w Let l be 9/(-6)10/(-15). Suppose -8v = -3v + 20. Sort l, v, -5. -5, v, l Let d(v) = v2 - 3v - 5. Let l be d(3). Put -1, -4, 4, l in increasing order. l, -4, -1, 4 Suppose -7 = 3t + 2. Put -10, 4, t in decreasing order. 4, t, -10 Let y(u) = -2u + 7. Let h(v) = -5v + 20. Let m(z) = 4h(z) - 11y(z). Let n be m(-2). Put n, 2, -2 in increasing order. -2, n, 2 Let h = 3 + -2.9. Let m = 2.1 - h. Put m, -1/6, -2 in increasing order. -2, -1/6, m Let h = -8 - -4. Let o = 19.38 - 1.98. Let q = o + -17. Put 5, h, q in descending order. 5, q, h Let y(n) = -n2 - 3n + 9. Let o be y(-5). Sort 3, 2, o in decreasing order. 3, 2, o Let r = -35 + 31. Sort 1, 2, r in descending order. 2, 1, r Suppose -4p = 2w - 18, 3p - 2w - 1 = 2. Suppose -1 = -4t + p. Sort 0, -3, t. -3, 0, t Let d(o) = -o - 1. Let v(p) = -5p - 2. Let f(z) = 3d(z) - v(z). Let l be f(1). Let c be -2(-2)/((-12)/(-9)). Put l, 2, c in increasing order. l, 2, c Suppose 3y + 3k = -12 - 3, 4y = 3k - 13. Suppose 2 + 14 = 4z. Sort z, -5, y in descending order. z, y, -5 Let c(j) = -3j + 4. Let t be c(3). Suppose 3a + 8 = a. Put 5, t, a in descending order. 5, a, t Let h = 2 - 4. Let o be 78/12 - (-1)/(-2). Sort o, 5, h. h, 5, o Suppose -4q = q. Let u = 12 + q. Suppose 3x - 2o + 9 = -u, 4o = 12. Sort -4, x, 5 in ascending order. x, -4, 5 Suppose 3o = 5o + 5x - 69, -4o - 4x = -120. Let v be 21 + (-48)/o. Put 3/4, 0.4, v in descending order. 3/4, 0.4, v Suppose g + u - 3 = 0, 3g + 0u + 2u - 9 = 0. Suppose 0 = gq - 5k + 17, -4k + 2 + 2 = 0. Sort -1, 4, q in decreasing order. 4, -1, q Suppose 0t + t + 5 = 0. Suppose -6 = -2y + 4y. Let q be (y/4)/((-18)/32). Put q, 4, t in decreasing order. 4, q, t Suppose 4p + 65 - 9 = 0. Let z = 10 + p. Put z, -2, 3 in descending order. 3, -2, z Let g = -6 - -6. Let m be (-3 + g)/(3/(-10)). Suppose 10 = -5u - m. Sort 4, -5, u in increasing order. -5, u, 4 Let p = 337 + -340. Suppose z - 5 + 0 = 0. Put z, -2, p in decreasing order. z, -2, p Suppose 2v - 2 = -0v - z, 0 = 5z. Let b = -18 - -20. Put b, v, -4 in increasing order. -4, v, b Let z = 3.02 - 3. Let u = 30.98 + -33. Let b = z + u. Sort -4, b, 0.3 in decreasing order. 0.3, b, -4 Let q be (54/(-11) - -3) + 1. Let f = 91/88 + q. Put -0.1, -4, f in ascending order. -4, -0.1, f Let w be (9 + -7)10/(-4). Sort -3, 2, w, 0 in decreasing order. 2, 0, -3, w Let m = -1.6 + 1.8. Sort 2, 3, m in ascending order. m, 2, 3 Let s = 339/5 + -68. Put s, -1.7, 4 in ascending order. -1.7, s, 4 Let q = 55/3 - 547/30. Let u = 0 + 0.2. Sort 2, q, u. q, u, 2 Let f = 1.8 - 2. Put 5, 0.1, 2/31, f in decreasing order. 5, 0.1, 2/31, f Suppose 0v = 3k - 3v + 6, 5k + 2v = -17. Put 7/3, 0.5, k, 1 in descending order. 7/3, 1, 0.5, k Suppose -5g + 5y - 7 - 3 = 0, -2y + 8 = 0. Sort 3, 4, g in decreasing order. 4, 3, g Let j = 0.11 + -5.11. Let v = 76.5 - 76. Put v, j, 4/7 in decreasing order. 4/7, v, j Let z = 6.9 + -7. Let c = 2.2 - 9.7. Let a = c - -7. Put a, z, 5 in decreasing order. 5, z, a Let l = -6 + 11. Let v = -6 + 5.9. Sort -5, l, v. -5, v, l Let u = -2 + 3. Let f = -65 + 321/5. Put u, f, 5 in descending order. 5, u, f Let g = -0.13 - -3.13. Let a = -4 + g. Sort a, -0.3, -1/4. a, -0.3, -1/4 Let u = 0.8 + -6.8. Put 2/3, u, 0.1 in decreasing order. 2/3, 0.1, u Let c = 4 + -2. Let d be (-4)/(4 - 6 - -4). Put c, d, -1 in increasing order. d, -1, c Suppose -5w + 3o = o + 24, -5o = -w - 14. Put -6, w, 0, 2 in increasing order. -6, w, 0, 2 Let l(w) = 2w - 3. Let m be l(4). Let r(p) = -p + 13. Let j be r(11). Sort m, 4, j in descending order. m, 4, j Let a be (-1)/((3/(-2))/3). Let k = 0 + a. Suppose -2h - 2 + 0 = 0. Sort k, h, 1. h, 1, k Suppose 4x = 8x. Put 2, -5, x in descending order. 2, x, -5 Let v = 2/79 - 168/395. Let z = 0 + -1. Let i be (2/(-32))/(z/6). Sort -2, v, i in decreasing order. i, v, -2 Let y = 11 - 10. Sort 9, y, 5 in descending order. 9, 5, y Let g = 0.6 - -1.4. Let f be -2 + 5 - 21. Let a be (2 - (-22)/(-10))/f. Sort g, a, 4 in decreasing order. 4, g, a Suppose 3i = -i. Let u be i + 2 + (-18)/6. Put -3, 2, u in decreasing order. 2, u, -3 Let u = 18 - 22. Let m = -4 + 6. Put m, -3, u in increasing order. u, -3, m Let d = -0.08 + 3.08. Suppose 3k + 5f - 10 = 0, k - 9 = -k - f. Put -4, k, d in decreasing order. k, d, -4 Let t = -2 - -5. Let b(h) = h3 + h2 - h - 1. Let q be b(-1). Let m be q - (2 - (-1)/1). Sort -2, t, m in descending order. t, -2, m Let k = 20 - 20.05. Sort k, 2, -4 in decreasing order. 2, k, -4 Let i = -0.2 + -1.8. Let g = i + -1. Let l = 1 - g. Put l, -2, 0.1 in descending order. l, 0.1, -2 Let q = -1 - -6. Let l be (16/(-40))/(1/q). Let g(o) = -2o. Let y be g(l). Put y, -4, -3 in decreasing order. y, -3, -4 Suppose 2p = -2d - 4, -6p + 2p - 5 = d. Put 0.03, -0.4, p in descending order. 0.03, -0.4, p Suppose 5 = -2*g - 1. Put 129, 5, g in descending order. 129, 5, g Let n = -20 - -12. Let f be n/(4/(1 + -3)). Let	{ "pile_set_name": "DM Mathematics" }
(mm36m/(m/m*39))/(m/(mmm/(m/(mm*(-2/43)))mm)m(-2/39)) assuming m is positive. m(134168/1677) Simplify (l(-1/14)/l(-3))/(ll1)(-2/43)(((ll/(ll*(1/4)l))/l)/(l*5l))(2/23) assuming l is positive. l(16554/6923) Simplify (((p*(3/11)pp7)34)(-1/13))4 assuming p is positive. p(-952/11) Simplify l(2/17)/(l((l/l*(-10))/l)/l)(l/l*40ll)/ll/(ll(23/3))lll assuming l is positive. l*(-2680/51) Simplify (cc*0c)(-8)/(c1)*(-1/7)(c(-4)/((c/(c(-1/7)/c))/c))/(cc6cccc(-2/11)cc) assuming c is positive. c(-361/11) Simplify ((t1/t(1/2))/(t(-1/2)/(tt0)))/(t(-1/5)tttt*(-1/4)tt)41 assuming t is positive. t(-3691/20) Simplify (o(-6)/(o/(o(ooo*(-1)oo)/o)o))*4(o*(3/4)oo(-5)/o)(-4) assuming o is positive. o(-3) Simplify (u/(u(15/2)u)u)32/(u/((u/(u/u22))/u))8 assuming u is positive. u(-48) Simplify ((c/c(6/13)(cccc(-2/3)c)/c)/((c/c*(-20))/(cc2)))34 assuming c is positive. c*(-20060/39) Simplify (((aa/(aaaa(-2/5)aa)aa)/a)(-31)(a/(a/a(-2)))26)38 assuming a is positive. a(-456/5) Simplify (r/(r*(-1/4)/r)r(-3/8))(1/40)/((r1)(-25)/(((r/(r*6r))/r)/rr3)) assuming r is positive. r(1283/64) Simplify ((o(-6/7)ooo*(-2)o*(-4)o3)(1/8))40 assuming o is positive. o(-65/7) Simplify ((v(-3/5)/v(-11)v(-2/23)/(vv(3/4)))(-10/7))(-6) assuming v is positive. v(11817/161) Simplify (((p(-22)/p)/p)/((p/p(1/34)p)/p))/((p6p)/(pp(-4/15))) assuming p is positive. p(-15931/510) Simplify (pp*(-3/2)p*4ppp)/(p/p*1p/p*(-5/2))(p(-1/2)/p)(-8/13)/(p(1/3))(-8/3) assuming p is positive. p*(563/117) Simplify (g/((g((gg1g)/ggg)/g)/g)g(-1/3))(-4/19)/((gg*(-1/2)g)(3/31))28 assuming g is positive. g*(-6314/1767) Simplify (ww*(9/4)ww11ww9ww5w)(-9/2) assuming w is positive. w(-1161/8) Simplify ((kk(-2/15)k)/(kk(-2/15)k)(k(-1/3)k)16)(19/4) assuming k is positive. k(152/3) Simplify ((d(5/12)/d)/(d/(d*(-18)d))(d(-7/5))(-48))(39/2) assuming d is positive. d(37921/40) Simplify (a(16/7)a)/(a/a*(-1/26))a32/a(-22) assuming a is positive. a*(10237/182) Simplify ((w/(ww*5w))/ww(-2))/(w(-3)w(w/(w(-1/3)/w))/w)(((w*(2/5)w)/ww)/w(-3))(-3) assuming w is positive. w(-323/15) Simplify ((a(-28/9)a(-2/71))(2/47))(-1/17) assuming a is positive. a(236/30033) Simplify (s*(-2/61)s/(sss*38)sssss/(ss/(((s/s(-2/3))/s)/s)s)s(3/41))(-2/69) assuming s is positive. s(559618/517707) Simplify (((k/(k/(kk*(-4/7))k))/(k/(k*(2/13)/k)))/(kkk(-6))(1/21))(-12/11) assuming k is positive. k(2432/1001) Simplify (((r(-8)/(r/r(2/5)))/(r(2/9))(10/9))(12/11))(1/6) assuming r is positive. r(-7166/4455) Simplify (((b(-6)b)/(b/(bb(-8)b)))/(b/(b*(-5)b)bb/(b/(b/(b((b((b/b*(-6))/b)/b)/b)/bb))b)))/(b(1/7)/(b/b13))(4/3) assuming b is positive. b(-592/21) Simplify (k/((k(k/(k/((k/k*(1/3))/k)))/k)/k))/(((kk*(4/5))/k)/k)(k1)(-5/4)((k(-2/3))(2/11))(-6/7) assuming k is positive. k(6409/4620) Simplify (uu/(u*(-3/10)u)uuu(-16)/uuu8/u(u*(-1/6)u)/u)9 assuming u is positive. u(-264/5) Simplify ((q15/q)39/(q*16q((q/q10)/q)/q))(1/57) assuming q is positive. q(180/19) Simplify (k22)24(k/k(3/14))(-2/147) assuming k is positive. k(543301/1029) Simplify ((m(-2/13)m)/(m/((mmm/(m/(m(-5)m)))/m)))(25/3)/(m(-1)/((mm/m6)/m)(m(-1/3))9) assuming m is positive. m(-1064/39) Simplify ((p/(p1/p))(-21/2)/(p2/(pp/(p/p(3/8)))))/((p1)(-36)/(p0)(2/3)) assuming p is positive. p(199/8) Simplify ((c(-1)/(c(-2/7)c))/(cc(-5)c*(2/5)))/((c(c/(c/c*(-2/7)))/cc)(-4/5))(-2/157) assuming c is positive. c*(10322/5495) Simplify (dd*13/dd*(-1/11)((d/d*(-10/7))/d)/(d(d*(4/5)d)/d))(-10) assuming d is positive. d(-9654/77) Simplify ((v(-3/13))(-25)(v/v(-5/3)vv)20)33 assuming v is positive. v(42515/13) Simplify ((l/l13)(-5)/(l/(ll*(-11))l(-4/5)))(-36) assuming l is positive. l(-8964/5) Simplify ((h/(((h(-8)hh)/h)/h)h)(-1/4)/(hh*(-3/5)h17))(20/11) assuming h is positive. h*(-398/11) Simplify (j/(j/(((jj/(j/j(1/3)))/j)/j)))(-45)/((jjj*(-3)j)/(j*(-3/2)/j))j1/j1(j((j/(j/j*5j))/j)/j)/(jj2) assuming j is positive. j(55/2) Simplify ((((mm*0)/m(m/(mm((m/(mm5m))/mm)/m))/m)(-5/6))(-4/9))(10/7) assuming m is positive. m(500/189) Simplify ((j1)(-25)(j(-1/3))32)/((j1)(-16/7)/(j*(3/4)j3)) assuming j is positive. j(-2489/84) Simplify (((m/m(1/2))(7/2)((mmm4/m)/m)(-2/41))19)1 assuming m is positive. m(4845/164) Simplify z(2/103)/(z/z(-6))z/((z(zzz/(z(2/57)/z))/z)/zzz)z(-1/47) assuming z is positive. z(-3026138/275937) Simplify (t(2/3))18/(t(1/3))(-32)(((t(10/3)/t)/t)/tttt/(t/(tt(-14)t)))13 assuming t is positive. t(-103) Simplify ((n*0nnn)*(1/19)(n0)(-2/169))/((n*0/nnn)(-16)/(n(-2/3)n)(-30)) assuming n is positive. n(117/19) Simplify (ff4ff/f1)32f(-1/7)/f(-1/9)(f1f)(1/4) assuming f is positive. f(24251/126) Simplify ((((vv/(v/v9))/v(2/13))/(vv*(2/11)vvv)(-6/23))43)(-8) assuming v is positive. v(-538016/143) Simplify (o*(-10)o*12oo(-5)o/(oo5))29 assuming o is positive. o(-203) Simplify (j/j(-1/6)jj(-3)(j(-1))(4/5))/(jj1j1)(-8) assuming j is positive. j(671/30) Simplify ((p3/pp)(-20))(-1/20)((((pp(-4))/pp)/pp)/p)/pp*(2/5)(p*(2/9)p)40 assuming p is positive. p(2128/45) Simplify (i/(ii13)ii(1/6)/i)32/(((i7ii)/(i/(i(-3)ii)))/(i/((i1ii)/i)i)(3/23)) assuming i is positive. i(-1253/3) Simplify (((s(1/26)/s)/s(-21))/(s*(2/13)/s(s/(s/s(-4/5)))/s))(1/2) assuming s is positive. s(2949/260) Simplify (j(-31))*(-41)jj/(j/(j(-42)/jj))j30 assuming j is positive. j1260 Simplify (i(3/2)i(((i(-16)/i)/ii)/iii)/iiiiii(3/8)iii(-10))(-1/25) assuming i is positive. i(29/40) Simplify (o0)*(2/19)o0/(o/((o/(o/o7))/o))(o(-7)/(o/o(3/5)))(41/5) assuming o is positive. o(-1392/25) Simplify (q/(q(-2)q)qq1)(2/61)/((q/(qq(2/7)))(-6/7)/(q(-1/4))(-40)) assuming q is positive. q(29550/2989) Simplify (i2)(-19)(i2)(-2/17)(i/(i/((i(-5)i)/i)))/(i*(-8)i)(ii1)(-2/47) assuming i is positive. i(-29020/799) Simplify j(-7)/j*19j(j(2/11)/j)/jj((j/j(-4/17)jj)/j)/j assuming j is positive. j(-4597/187) Simplify (f/f1f*(-4)(f1)(-12/11))/((f(-1))(12/5))44 assuming f is positive. f(5528/55) Simplify ((iii(-3))/i1(i(-1/2))(-3/5))/((ii/(i*(-2/11)i))/i(i0/i)/i)(-9/5) assuming i is positive. i(-547/110) Simplify (((dd*3d)/d)/(d(-7)/d))17(((d(-3/7)d)/d)(-32))42 assuming d is positive. d780 Simplify ((u(3/7)u(3/4))/(u16uu14))(2/3) assuming u is positive. u(-835/42) Simplify ((m(2/49)mmm*(-28))/(((mmm5m)/m)/((m/m17)/m)))(-15) assuming m is positive. m(36720/49) Simplify z14/(z*(-1/41)z)((z/(zz*(11/2))z)/z)49 assuming z is positive. z(-21031/82) Simplify ((p/(p/(pp(2/5)/p))p(p/(p(1/5)/p))/pp)/(p*6p*(1/3)ppp))/((p/(p/p(1/2)))(-22)/(p(-1))(4/3)) assuming p is positive. p(53/15) Simplify ((q2q)(-38/5))(-31)(qq0)29q*3q/(q7/q) assuming q is positive. q(3669/5) Simplify (((c/(c/c*(-2/11))c)/c(-3/11))/(c(1/2))*24)/(((cc*9c)/c)/(cc4ccc))(-32) assuming c is positive. c(584/11) Simplify (k/(k/(k/(k/k*(2/3)))kk)kk0k)/((k(-2/9)/k)/k(-3/8))((k(-1)k)8)14 assuming k is positive. k(109/72) Simplify (c/c(-11)c/((c/c(-3/2))/c))33(c*0cc)0/(c(-2))(1/8) assuming c is positive. c(1519/4) Simplify ((p14p/(p*(-14)p))/((pp/(p/(p/(((ppp13/p)/p)/p)))p)/p(-7)))(2/107) assuming p is positive. p(60/107) Simplify ((b1bb*(2/25)(b/b(1/24))/b(-4/9))46)(24/5) assuming b is positive. b**(288374/375) Simplify	{ "pile_set_name": "DM Mathematics" }
)(-2 - 1 + 1) - 2h + 0h + h in the form fh + n and give f. -13 Express -11a + 49a + 51a as ga + j and give g. 89 Express (-1 - 5 + 2)(4 - 7s - 4)(2s*2 - 2s + 2s) as us*3 + zs*2 + p + ds and give u. 56 Rearrange -s*3 - 6s*3 + 0s*3 + 0s - 2s to the form vs + ms2 + ns3 + q and give v. -2 Express -5 - c - c2 - 1 + 5 in the form tc2 + a + nc and give n. -1 Rearrange -x2 + x3 + 15 - 15 - 5x to ax*3 + dx + gx2 + h and give a. 1 Rearrange (-5 + 1 - 2)(-30a2 - 34 + 34) to the form ia*2 + ua + k and give i. 180 Rearrange 0 + 0 - 2u + 0u - 3u + 0u + 2u + u - 2u + (-2 + 0 + 4)(2u + 4 - 4) + 3 + u - 3 - u - 5 + 2u - 3u to w + au and give a. -1 Express 38q + q*2 - 2 + 12 - 35q in the form aq + gq*2 + d and give d. 10 Rearrange 7m*2 - 1 + 1 - 5m*2 + 3m to the form v + cm + km*2 and give c. 3 Rearrange (2 - 2 - m)(1 - 1 - m*2) + 22m - 22m - 5m*3 + 0m*3 + 2m*3 + 0m3 + m3 + 0m3 - 3m*3 to am + gm2 + i + nm*3 and give g. 0 Rearrange (-3 + 2n + 3)(1 - 4 + 1) + (1 + 3 - 5)(-17n - 32n + 16n) to h + cn and give c. 29 Express i*4 + 3i*3 - 20i - 19i - 3i*2 + 6i*2 + 36i in the form qi + ui*2 + b + ai*4 + ni*3 and give n. 3 Express -60s*4 + 2s + 59s4 - 2s*2 + 3 - 1 in the form ms*2 + as*4 + os*3 + us + p and give a. -1 Express 3r + r - r + (2 - 4 + 3)(2r + 154 - 154) as sr + w and give s. 5 Rearrange 3 - 4 + 6 - 2g3 + 0g*3 to the form qg*3 + u + sg*2 + ng and give q. -2 Rearrange (3q - 5q + 0q)(-3 - 2 + 3) + 29q + 3 - 5 + 4 to bq + p and give p. 2 Rearrange b - b*2 - 4b + 2b3 - b2 - 2b to mb2 + jb*3 + kb + w and give m. -2 Rearrange (2w2 - 9w*2 + 4w - 5w)(-5 + 5 - 3) to dw + pw*2 + f and give p. 21 Express -3 + 3 - 6o*3 - 11 as qo*3 + no*2 + p + uo and give q. -6 Express (3 - 6 + 4)(2 + 1 - 1)(-161u4 + 312u*4 + 2u + 53u2 - 153u*4) as ou + b + vu2 + zu*4 + du*3 and give v. 106 Rearrange 62c + 2 + 4 - 5 to the form ac + b and give a. 62 Express (2t - 3t - t)(-3 + 4 - 5) - 2 - 1 + 5 - 2t in the form jt + q and give j. 6 Express (4 - 3 + 0 + (-4 + 1 + 2)(0 - 7 + 4))(2 + 2f - 2) as o + uf and give u. 8 Rearrange (-2 + 0 + 5)(p + 2p + 2p) to l + ip and give i. 15 Express -f4 - f3 + 8 - 31 + 10 + 14 in the form kf3 + lf*2 + zf + c + jf4 and give k. -1 Rearrange (c3 + 2c3 + c3)(2 - 2 + 1) to o + zc*2 + hc*3 + uc and give h. 4 Express (20n2 + 15n*2 - 16n*2)(-1 + 1 + 2n) - 5n - 5n3 + 5n as sn2 + hn + jn3 + z and give h. 0 Rearrange (4 - 2 - 1)(0y - 3y + 2y) + 23y - 16y - 99y to i + wy and give i. 0 Rearrange (-o2 - o2 + o2)(-59 + 5o + 59 + (0 + 3 - 4)(-o - 5 + 5)) to the form to2 + ao*3 + ko + m and give t. 0 Rearrange (65 + 33 - 72)(-4k + 4k + 2k) to xk + i and give x. 52 Express (-8c*2 + 3c*2 + 4c*2 + 3c)((3c + c - 2c)(-3 + 1 + 1) - c - 3 + 3)(-1 + 3 + 0) in the form vc + yc2 + q + uc3 and give v. 0 Express m4 - 6m4 - m3 + m2 - m3 in the form dm*3 + jm*4 + pm + nm2 + r and give d. -2 Rearrange -5 + 18f + 3 + 2 to bf + s and give b. 18 Express (3h*3 + 0h3 - h3)(5h + 0h + 2h) + 3h - 3h - h4 + h4 + 4 - 4 as nh2 + sh*3 + qh + ph4 + k and give p. 14 Rearrange 0m3 + m4 + 4m4 - 2m*2 - 4m4 + m3 - 2m to the form wm*3 + tm*2 + z + rm*4 + cm and give t. -2 Express 0i + 6i + 6i + 6i as b + vi and give v. 18 Rearrange -4r*3 + 14r - 11r + 2r*3 to fr*3 + x + ir*2 + qr and give f. -2 Rearrange 4w - 4w + w*3 + (-4w + 4w - 2w)(-2w*2 - 3w*2 + 2w*2) to b + qw*2 + cw + vw3 and give v. 7 Rearrange 3s*2 - 1 - 41s*3 + 42s*3 + 4s - 7s to as*3 + ks + zs2 + d and give a. 1 Express -7a*3 - 12a*3 - 8a*3 + (-4a*3 + 3a*3 + 3a*3)(1 + 1 - 6) as i + oa2 + ta + ua3 and give u. -35 Rearrange (0 + 0 - 13h)(6h*2 - 29 + 29) to xh + th2 + nh*3 + b and give n. -78 Rearrange -7 - 2m*3 - 3m*4 + m - 2m*2 + 3m*2 + 9 to the form lm*3 + hm*2 + pm*4 + cm + k and give h. 1 Express (6 + 3 - 7)(-5t + 3t + 4t) in the form rt + n and give r. 4 Rearrange 8g - 7g + 2 + 12g - 4 to tg + s and give s. -2 Rearrange (3w - 14w + 0w)(2w*3 + 2w*2 - 2w*2) to vw + t + fw4 + pw*3 + zw2 and give f. -22 Express -i3 + 0i3 - 9i + 18i as y + hi + ai3 + ki*2 and give a. -1 Rearrange -1 - 2d*3 + 0d*3 - 3d + 3 - 2d4 + 0 to the form sd*4 + ld*2 + m + bd + td3 and give m. 2 Express -r + 603r*3 - 2 - 603r*3 + 7r*4 in the form nr*2 + jr*4 + o + dr*3 + zr and give z. -1 Express (0p3 + 0p3 + p3)(-1 + 4 + 0 + (0 + 2 - 3)(-1 - 4 + 3) - 5 + 6 - 3 - 1 + 0 + 4) in the form op3 + wp*2 + jp + z and give o. 6 Rearrange -8a2 + 0a*3 - 9 - 3a - a*3 + 2a + 7 to i + oa2 + ba + za3 and give z. -1 Express ((4s + 0s - 2s)(1 - 2 + 3) + (3s - s + s)(2 + 1 - 2))(s*2 - 3 + 3) in the form bs + ts2 + i + xs*3 and give x. 7 Express 4b*3 - 2 + 2 + 2b*2 as sb*3 + zb*2 + ob + i and give s. 4 Express 28k2 + k4 - 28k*2 + 2k*3 - 2k in the form ak + hk*3 + v + xk*4 + yk*2 and give a. -2 Rearrange (-2 + 3 + 1)(-3i + 0 + 0) - 4i - 8i - 2i to the form p + ki and give k. -20 Rearrange -3f*3 + f + 5f*4 + 2f*3 - 1 + 7f*4 - 6f*4 to the form if*2 + rf + mf3 + u + bf*4 and give r. 1 Express 7 - 18y - 7 as j + hy and give h. -18 Rearrange -7 + 5i + 7 to fi + p and give f. 5 Rearrange (1229 - 9q*3 - 1229)(-q + 2q - 1 + 2) to the form pq + gq2 + uq*4 + k + zq*3 and give z. -9 Rearrange 37r*4 - 21r*4 + 8r*2 - 17r*4 + (6r - 2r - 2r)(0r3 + r3 + 0r3) to the form cr*2 + or*4 + wr + n + lr3 and give c. 8 Rearrange (l2 + 0l2 + l2)(0l + 2l - l) - l3 - 5 + 5 + 3l - 2l3 - 3l - l + l + 2l3 to the form a + vl*3 + gl + ul2 and give v. 1 Express (3 - 4 + 0)(13 + 29 - 60 - y) as ny + p and give n. 1 Rearrange -115 + 49r + 115 to y + kr and give k. 49 Express (0 + 1 - 2)(-2 + 4 - 4)(2q + 0 + 0) in the form nq + s and give n. 4 Express (-4 - 2l + 4)(-1 + 4 - 5) + (5 - 7 + 6)(l - 1 + 1) as ml + y and give m. 8 Rearrange o + 11 - 21 + 10 to the form a + co and give c. 1 Express 7t3 - 3t*3 + 16 - 2t*3 as ft*3 + r + zt*2 + lt and give f. 2 Express -3q2 - 3 - 4q*3 + 2q*3 + 2 + 9q*2 as gq*2 + hq + n + aq3 and give n. -1 Express (-n + n + 2n)(-1 - 2 + 2)(-11 + 12 + 15) + (-5n + 2n + n)(0 + 3 - 1) in the form u + pn and give p. -36 Express -108i - i2 - 2i*3 - 6 + 109i + 1 as pi + n + ti*3 + bi*2 and give t. -2 Rearrange -49u*2 + 2u*3 - 3085u + 2 + 3085u to du*2 + o + su + pu3 and give d. -49 Express -6z + 0z + 5z + 35z2 as az*2 + uz + g and give u. -1 Express ((2 - 2 - 1)(0t - 3t + 4t) + 0t - 2t + 4t)(4 + 5 + 2) as it + z and give i. 11 Express -2i*3 - 6i - 9i2 + 0 - 1 + 4i + 8i2 - 2i*4 as q + di*3 + zi*4 + vi*2 + mi and give d. -2 Rearrange -10a - 22a + 65a to the form i + va and give v. 33 Express (1 + 6 - 5)(3 + 6u - 10u - 2) as gu + d and give d. 2 Express a - 3a + 5a in the form g + na and give n. 3 Express (0 + 0 + 2a*3)(13 + 40 + 14) in the form l + pa + ga*2 + sa*3 and give s. 134 Rearrange (10t + 21t - 6t)(10 + 0 - 5)(-1 - 4 + 3) to the form ht + d and give h. -250 Rearrange -2f*2 + 8 - 8 + (0f + 4f + 6 - 4)(-2f + 2f + 2f) to the form uf*2 + w + if and give i. 4 Express -w - 7w2 + 6w + 8w2 as y + vw*2 + ow and give o. 5 Rearrange -130t + 70t + 71t to the form it + y and give i. 11 Rearrange 4l3 - 5l*3 - 2l*2 - 10l*2 to zl*3 + sl + dl2 + r and give d. -12 Express -5o + 0o - 3o as z + go and give g. -8 Express (q + 2 - 2)(-25 + 6 + 56)(2 + 2 - 2) in the form tq + o and give t. 74 Express (-12 + 2 + 8)(3m4 - m4 - 4m4) in the form lm + hm3 + gm*2 + xm*4 + j and give j. 0 Express -71 - 2o*4 + 74 - 2o + 0o - 3o*3 as ko*2 + x + lo*4 + no + to3 and give n. -2 Rearrange (-7p*3 + 7p3 + p4)*(	{ "pile_set_name": "DM Mathematics" }
5)oo/o*(3/5)o(o(-2/13)/o)/o assuming o is positive. o(172/65) Simplify k(2/15)k/(kkkk(-2/9))(k/(k/(k*6k)))/(k/((((kk6)/k)/kk)/k)) assuming k is positive. k(421/45) Simplify ((j(-8)j)/j)/jjj(-2/9)(j(-1/2))1 assuming j is positive. j(-157/18) Simplify ((f(-2/7))(11/2))(1/11) assuming f is positive. f(-1/7) Simplify ((q/(q(-1/11)qqqq))/(q/q*(-3)))/(qq*(2/3)q*(1/6)q) assuming q is positive. q(-643/66) Simplify (((w/w0)/w)/w)/((ww(1/5)ww)/w)w*(-3/7)(w/(ww(-11)ww))/w assuming w is positive. w(153/35) Simplify nnnn*3nn/((n/n(1/3))/n) assuming n is positive. n(25/3) Simplify (z32z)/(zz(-28)zz) assuming z is positive. z58 Simplify (g/g(-17))/gg*(-19)/gg assuming g is positive. g(-2) Simplify (s(2/45))(21/4) assuming s is positive. s(7/30) Simplify (g(-1/11))34 assuming g is positive. g*(-34/11) Simplify ((a/(aa/(aa8)))/(a(-3/2)a))/(a*(-1)/(a(a/a*(-1/2))/aa)) assuming a is positive. a12 Simplify (a8)7 assuming a is positive. a56 Simplify l*(-1/3)/(ll/((lll(lll(-2/31))/lll)/l)) assuming l is positive. l(242/93) Simplify j5/(j/(j(jj/j4)/j))(j/j(3/5))(21/5) assuming j is positive. j(92/25) Simplify w9w(-5)ww1(w(w(-2/5)/w)/w)/w assuming w is positive. w(18/5) Simplify (ss(s/(s32s))/s)/ss18 assuming s is positive. s(-14) Simplify (d(-1))(-3/4) assuming d is positive. d(3/4) Simplify (z(3/23)/z)/(z(4/11)/zz) assuming z is positive. z(-312/253) Simplify g(3/11)/(g/(g11/g)) assuming g is positive. g(102/11) Simplify q(-34)/q(1/14) assuming q is positive. q*(-477/14) Simplify (rr(2/15))/r(-2) assuming r is positive. r(47/15) Simplify p/p(2/3)p(-6/13) assuming p is positive. p(-5/39) Simplify (i6/i)/(i5i)((ii/i(-1))/i)(-20) assuming i is positive. i(-41) Simplify ((h/h4h)/(h(6/11)h))(-50) assuming h is positive. h(1950/11) Simplify (c*(2/3)cc/(c2c))/(cc(3/5)(ccc*4)/cc) assuming c is positive. c*(-119/15) Simplify (((gg*19g)/g)/(((((g*7gg)/g)/g)/g)/g))(-12) assuming g is positive. g(-180) Simplify (b(-10)b/(bb(5/4)b))/(bb(1/4))(-17) assuming b is positive. b9 Simplify (h(-4)/(hhhh/((h*(-2/5)/h)/h)hh))21 assuming h is positive. h(-1302/5) Simplify k/(kk*(-1/6)k)k/(k/(k/(kk/k10))) assuming k is positive. k(49/6) Simplify ((bb(-7))/bb/b(-11/5))46 assuming b is positive. b*(-874/5) Simplify (ttt0/t)(-3/17)/(ttt1/t(ttt(-7))/t) assuming t is positive. t(65/17) Simplify (t/(t/t*(1/11)))/ttt/t(-20) assuming t is positive. t(232/11) Simplify (g(-2/13)ggg(-3/10))(-9/5) assuming g is positive. g(-1809/650) Simplify (h4)(-16) assuming h is positive. h(-64) Simplify (r*(-27)r)/r(-10) assuming r is positive. r(-16) Simplify (((oo(-2))/o)(-1/8))50 assuming o is positive. o(25/2) Simplify ((((bb(-3))/b)/b)(2/15))40 assuming b is positive. b(-64/3) Simplify (s(1/3))(14/5)/((s/(s/s4))/(s/((s/(s/(s(3/2)/s)))/s)s)) assuming s is positive. s(-17/30) Simplify ((d(2/11)/d)/(d/d(6/13)))(-2) assuming d is positive. d(388/143) Simplify f(-1/3)(f/(((f/f*(-1/4))/ffffff)/f))/ff/(f/((f(-9)/f)/f))f(-9) assuming f is positive. f(-295/12) Simplify ((w*(-2/23)ww)/w)(23/3) assuming w is positive. w7 Simplify b((b*(-2/15)bb)/b)/b(bb(-2/35)b)/b assuming b is positive. b*(38/21) Simplify (uu*(-2/27)u*1uu)(-1/38) assuming u is positive. u(-53/513) Simplify (n/(n/(((n/n0)/n)/n)))(10/11)/(n0)(8/3) assuming n is positive. n(-10/11) Simplify (o(-10)o)/o15 assuming o is positive. o(-24) Simplify ((r/(r/(rr(-1/5)r)))/r)/(rr((r/(r/(r*(-14)/r)))/r)/rrrr) assuming r is positive. r*(64/5) Simplify (x/(xx/(x*(-10)/x)x))38 assuming x is positive. x(-494) Simplify p1/(p/p0) assuming p is positive. 1 Simplify ((d*(3/4)/d)/(dd/(dd(-2/37))))(-11) assuming d is positive. d(2123/148) Simplify a(aa/((a/((aaa(-1/39)/aaa)/aa))/a)a)/aaa/a(-8/5)a assuming a is positive. a*(2062/195) Simplify (m/(mm/((m/m(1/11))/m)))35 assuming m is positive. m(-420/11) Simplify (m(1/15)/mm/(m(2/45)/m))35 assuming m is positive. m(322/9) Simplify (bb/((bb(-7))/b))/b(3/2)b*8/(b(b/(bbb/(b/(bb7))))/b) assuming b is positive. b(49/2) Simplify (u/(uu(-1/5)))35 assuming u is positive. u*7 Simplify ((f/(ff*4)f)/f0)/((f(-8)f)/((fff(1/8))/f)) assuming f is positive. f(41/8) Simplify ((zz(z/(zz*(-3)))/z)/z)/(zz/(z/z*0))z*1z(-2) assuming z is positive. z Simplify (r/(r(-7)/r))25 assuming r is positive. r225 Simplify (q*(-1/3)qq1)(-27) assuming q is positive. q(-45) Simplify (a16/a(1/5))(-2/27) assuming a is positive. a(-158/135) Simplify ((y/((y/(y(-1/4)/y))/y))/y)/y(-9)(y(-5)/y)/(y(-3)/y) assuming y is positive. y*(23/4) Simplify ((gg9)/(g/(g3gggg)))/(g(1/12)/g(-4)) assuming g is positive. g(143/12) Simplify ((v/(v/(v/(v(-1/5)/v)v)))/v)/(v/(vvv/(v/(v/(v/v(9/4))))v))v3/(vv(3/8)) assuming v is positive. v(323/40) Simplify h*(-2/7)h(2/5) assuming h is positive. h(4/35) Simplify (a19)40 assuming a is positive. a*760 Simplify (rr/(rrr3))(-31) assuming r is positive. r*93 Simplify (yy(-3/4))(-5/7) assuming y is positive. y(-5/28) Simplify (k(-3)(kkk/k(-2/25))/k)/(k(-2/5)/kk)(-41) assuming k is positive. k(-433/25) Simplify (c*(-3)/cc*(2/9)/c)/((cc*(-5))/(c(c/(cc(-3)/cc))/c)) assuming c is positive. c(20/9) Simplify (s(-2)/s)*(8/5)s*6s*(6/11)s assuming s is positive. s(151/55) Simplify (v/v(-2/13))/((v/v(-2/9))/v) assuming v is positive. v(109/117) Simplify j(-1/16)/j(-1/14) assuming j is positive. j(1/112) Simplify (t(-1/5))(-2/27) assuming t is positive. t(2/135) Simplify (p*(2/5)p)(-23)/(p(2/7))(-3/32) assuming p is positive. p(-18017/560) Simplify z10/z(-2/15)((z(-4/3)z)/z)/z0 assuming z is positive. z(44/5) Simplify ((uu(7/4))/u)/u7 assuming u is positive. u(-21/4) Simplify ((xx/(((x/(x/x(-13)))/x)/x))/(x(1/2)/x))(-5/6) assuming x is positive. x(-175/12) Simplify (rr(5/7)(r/(rr(-20)))/r)(-7/2) assuming r is positive. r(-145/2) Simplify (j/(j/j0))(-7)/(j(-2)/(jj/(jj/(j/j(-3/4))))) assuming j is positive. j(15/4) Simplify (g/(gg/(gg(-1/41))))/g(6/17) assuming g is positive. g(-263/697) Simplify k/(kkk/k(-6/7))kk14/k assuming k is positive. k(78/7) Simplify u(-7)/u7u*7/((uu/u(-3))/u) assuming u is positive. u(-11) Simplify (tt8)(4/19) assuming t is positive. t(36/19) Simplify (f(-18)f)/(f/(f*20/ff)) assuming f is positive. f2 Simplify (u(-2/5)uu)*(-20)u*(1/6)/(u/((u(u/(uuuu(2/11)/uu)u)/u)/uu)) assuming u is positive. u(-2245/66) Simplify (g(-1))*43g(-4)/(g0g) assuming g is positive. g(-48) Simplify v/(v/(v/(v/(vv*2v))))vvv(1/5)v*(-5)v0 assuming v is positive. v(6/5) Simplify n(-8)/n(-10) assuming n is positive. n2 Simplify (o(-1)(o/(o/(oo/o(-1/2))))/o)31 assuming o is positive. o(31/2) Simplify (z0/z)*(-1/25)z(5/4)/(z(-2/3)/z) assuming z is positive. z*(887/300) Simplify (a(a/(a/(a*(3/5)a)))/aa)/aa*(2/15)(a*1a)(-2) assuming a is positive. a(-34/15) Simplify (((a/a8)/a)(-2/11))(-37) assuming a is positive. a(-592/11) Simplify (q0)(3/14)q(-4/9)(q/(qq(1/7)/qq))/q assuming q is positive. q*(-100/63) Simplify a(a/a*1)/aa(((a/a(2/3))/a)/a)/a(a(-2/7))(-1/72) assuming a is positive. a(-419/252) Simplify ((p(3/2)/p)(14/13))(-50) assuming p is positive. p(-350/13) Simplify (g/(g(-1/4)gg))*(-2/35)gg(-1)g(-7) assuming g is positive. g(-487/70) Simplify z*3z/(zz(-6))(z(1/3)/z)/(z7/z) assuming z is positive. z(7/3) Simplify a(-3/4)aa*(2/7)a*(-9)a(a/a5)/aa assuming a is positive. a(-321/28) Simplify y(-11/4)/((y/(yy(-6)))/yy) assuming y is positive. y(-35/4) Simplify (x(-1/3))(-2/23)/(x4*	{ "pile_set_name": "DM Mathematics" }
2. Let w be g(a). What is the third smallest value in -4, w, 2/7? w Let f = 31.6 + -32. Which is the third biggest value? (a) -2 (b) 2/5 (c) f (d) 4 c Let s = -0.5 + 0.4. Let k = -20.5 - -20. Let v = 0.3 + 0.7. What is the second smallest value in s, v, k? s Let m = 9/10 + -13/20. Suppose -2k - 1 = -b - 2b, 20 = 5k. Suppose 0 = br + 2r. What is the third biggest value in -4, m, r? -4 Let i = 0.462 - 0.062. Let x = -2 - -1.9. Which is the third smallest value? (a) i (b) -0.04 (c) x a Let i = -0.006 - 0.494. Which is the biggest value? (a) i (b) -1 (c) 0.03 c Suppose 5k + 4a - 656 = 8a, -8 = 2a. Suppose 2u + p = k, 4u + 5p = 2u + 136. Let n = u + -314/5. What is the smallest value in n, -1/9, -0.1? -1/9 Let o be 8 + -3 + -1 - 2. What is the smallest value in 4/7, 5, o, -3? -3 Suppose 2f = 7f + 20. Let o be (-4)/f(-2)/18. What is the biggest value in 1, o, 0? 1 Let y = -3.18 - -0.18. Which is the biggest value? (a) 3 (b) -5 (c) y a Let h = 1.2 - 0.9. Let x be (-8)/(-6)9/(-2). Let m be ((-1)/x)/(3/(-4)). What is the second smallest value in -5, m, h? m Let w = 0.7 - 0.6. Let i = -0.1 - -0.3. Let p = 0 + 0.5. Which is the second smallest value? (a) w (b) p (c) i c Let y = -0.34 - -0.53. Let i = y - -0.01. Which is the third biggest value? (a) 5 (b) i (c) -2 c Let b = -97 + 67. Let a be ((-4)/(-6))/(4/b). What is the third biggest value in -2/7, a, -3/4? a Let i = 0.19 - -0.81. Let l = -6 + i. What is the third biggest value in 2/3, 1/3, l? l Let v = 2 - 2. Let l = -5 + 10. What is the third smallest value in l, v, -4? l Let v = -1.7 + -2.3. Let c = 6 - 6.3. What is the second biggest value in v, c, -0.2? c Let i = 24 + -28. Which is the second biggest value? (a) -5 (b) 0.5 (c) 0.3 (d) i c Let z be (-1)/((-4 + 76/20)2). Which is the second biggest value? (a) 0 (b) 5 (c) -5/4 (d) z d Let y = -0.9 - -0.7. Let q = y + -0.3. Which is the smallest value? (a) -0.2 (b) -4 (c) q b Let g = 156 + -1402/9. What is the smallest value in 1/4, -0.2, 2, g? -0.2 Let o be 1/(-2 + 21/9). Suppose 0 = -5z + oq + 34, 19 = 3z + 2z + 2q. Which is the biggest value? (a) -1/5 (b) z (c) 4 b Suppose d = -5 + 7. Let s = -662189/21 - -31539. Let h = s + -19/3. What is the biggest value in 1, d, h? d Let o = 10/13 - 27/52. What is the second smallest value in o, 5, -3, 0? 0 Let u = 2 + -4. Let j = 0.9 + 9.1. Let v = j + -11. Which is the smallest value? (a) v (b) -0.3 (c) u c Let o = 0.1 - -4.9. Let v = o - 3. Let m = 2 - v. Which is the smallest value? (a) 0.3 (b) 1/5 (c) m c Let z = -0.6 + -5.4. Let x = 6.3 + z. Suppose w + 4w = 5. Which is the second biggest value? (a) x (b) -0.3 (c) w a Let y be 24/7 + -2 + 0. Let o = y + -33/28. Which is the biggest value? (a) -0.5 (b) 1/3 (c) o b Let s = 5 + -9. Let r = -3.14 + 0.14. What is the second biggest value in 1/4, s, r? r Let t = -4.4 + 4.1. Let z = -4/7 - -1/14. What is the second smallest value in z, t, 0.5? t Let i(s) = -s*3 + 5s*2 + 6s + 2. Let r be i(6). What is the third smallest value in -1, r, -1/2? r Let u = -0.6 + 0.9. Let s = -0.2 - u. Let r = -42 + 42.3. Which is the third biggest value? (a) r (b) 2/11 (c) s c Suppose -1 - 5 = -k. Let g be (-10)/4 + (-3)/k. Let j = 8 + g. What is the third biggest value in j, 0.1, -4? -4 Let t = -9.9 + 10.4. What is the third smallest value in 3/7, t, -2/7? t Let o = -6.04 - -0.04. Let u = -6.2 - o. What is the smallest value in 0.3, u, -0.1? u Let a be 0 + (-8)/10 - 0. Let k = 8.3 - 6.34. Let r = 0.04 + k. What is the biggest value in a, 2/5, r? r Let f be 0 - -2 - (11 - 3). Let x be (-3)/(-2)f/(-45). Which is the second biggest value? (a) 4 (b) x (c) -4/5 b Let t = 10 - 15. Which is the biggest value? (a) t (b) -0.03 (c) -1 b Let p be (-2)/(-13) - 60/(-117). What is the biggest value in p, -3, -0.2? p Let o = 14 - 13.6. Let m(k) = -k. Let s be m(-1). Which is the second biggest value? (a) o (b) s (c) 0 a Let g be -18 + 3/(12/16). Which is the second smallest value? (a) g (b) 1/2 (c) 5 b Let x be (-3 + 1 - 1)1. Let r = -2 + -2. Let w = -0.2 + 0.1. What is the second smallest value in r, x, w? x Let q = 2.51 + -7.64. Let l = -0.12 - 0.01. Let a = q - l. What is the third smallest value in a, 0.4, 1/3? 0.4 Let l = -3 - -4. Let h = l - 2. Let u = 40 - 40.5. What is the smallest value in 0.5, h, u? h Let g = 18 - 18.2. Which is the second biggest value? (a) 1 (b) g (c) -5 b Let m = -62 + 680/11. Let c = 3.92 + 0.08. What is the smallest value in 1, c, m? m Let o = -0.29 + -0.71. What is the second biggest value in o, 2/21, -5, 0.2? 2/21 Let t = 1 + -0.6. Let h = -9 + 0. Let s = h - -9.3. Which is the biggest value? (a) t (b) 2/25 (c) s a Let i = 2.096 - 0.096. What is the fourth biggest value in 0.04, 1/4, i, -2? -2 Let m be 6/(-15) + (-86)/10. Let u(q) = -q - 6. Let z be u(m). What is the biggest value in -5/2, z, 5? 5 Let v = -16 - -8. Which is the third smallest value? (a) 0.2 (b) -2/17 (c) v (d) -0.2 b Let h be (5/25)/(16/30). Let n be (-1)/(39/(-12) + 3). What is the second biggest value in h, 0, n? h Suppose 0 = 3o - 10 + 31. Let d = o - -12. Suppose -4s - 5q - 13 = 0, 0 = 3s - 6q + q + 1. Which is the second biggest value? (a) s (b) d (c) 1/6 c Let z = 0.3 - 1.3. Let t = -44 - -48. Which is the smallest value? (a) z (b) t (c) 5 a Let c = -2.929 + -0.071. What is the third biggest value in -0.1, 5, c, -2/11? -2/11 Let k = -0.05 + -0.01. Let l = k + 0.07. Which is the second biggest value? (a) l (b) -0.2 (c) 5 a Let u be (-2 - -11)/3-1. Which is the smallest value? (a) u (b) -4 (c) 0.8 b Let y = -0.26 - -0.2. Let m = 5.06 + y. Let b be -2(-1)/(-12 - -1). What is the third smallest value in -0.2, b, m? m Let r = -8 + 12. Suppose 2f + u = 12, 3f - 7u + 3u = 40. Let w be f/(-32) - (-21)/52. Which is the biggest value? (a) w (b) 1 (c) r c Let n = -15 - -11. Which is the biggest value? (a) 0.06 (b) n (c) 2/9 c Let s = -56/135 - -2/135. What is the second smallest value in s, 4, -4? s Let u = -0.47 + 0.17. Which is the smallest value? (a) 1 (b) u (c) -1/2 c Let u = 0.025 - 4.025. Which is the fourth smallest value? (a) u (b) -2/9 (c) 2/7 (d) -2 c Let b = -18.15 + 0.15. What is the second smallest value in -4, -0.2, b? -4 Let w = -21 + 20. What is the smallest value in 2/9, -3/5, w? w Let w = 0 - 0. Let z = w + 0. Suppose 5t - 3m - 6 = 0, -t - 18 = m - 24. Which is the second smallest value? (a) 1 (b) t (c) z a Let m = 122 + -121.6. Let g be (-14)/35 + 34/(-40). Which is the second smallest value? (a) g (b) 1/8 (c) m b Let j(x) = x3 - 2x*2 - x - 1. Let l be j(3). Which is the smallest value? (a) -2 (b) -0.3 (c) l a Suppose 4h = 2h - 8. Let f be h/(-18) + (-4)/(-144). What is the third smallest value in f, -2/23, 5? 5 Let q be 446/450 + 3/(-3). Let d = -247/2475 - q. Which is the biggest value? (a) -1/4 (b) 0 (c) d b Let x be (-1)/(-2) - 0/2. What is the third smallest value in x, 5, -4? 5 Let q = 8 - 7.7. Let i = 4 - 4. Let d = 4 + -1. Which is the second smallest value? (a) i (b) q (c) d b Suppose p = -5 - 0. What is the second smallest value in -2/3, -3, p? -3 Let o = -61.4 + 61. Which is the third smallest value? (a) o (b) -2/29 (c) 1/3 c Let z be 0 - (75/(-4))/(-3). Let m = 6 + z. Let i = -46 + 47. Which is the biggest value? (a) 0.3 (b) i (c) m b Let y = 125/156 + -2/39. Let p be 17 + -2(4 - 3). Let t = -16 + p. What is the smallest value in y, t, 2/11? t Let t(d) = -d - 1. Let o be t(-5). Which is the second smallest value? (a) 1 (b) -4 (c) o a Let i = 147/5 + -29. What is the fourth smallest value in -3, -2, i, -0.2? i Let l be (50/28 - 8/28)2. Which is the second smallest value? (a) -1 (b) l (c) -1/3 c Let n = 10 + 4. Let w be (16/n - 0) + -1. What is the biggest value in -2/5, 2, w? 2 Let z = 0 - -2. Let q = -14 - -10. Let w = 0 + 3. Which is the second smallest value? (a) q (b) w (c) z c Let w be 1((-72)/21 - -3). Let d = 1 + -0.4. Let p = d - 0.7. Which is the second smallest value? (a) w (b) p (c) 0.5 b Let l = -83 + 60.5. Let u = l - -22. What is the biggest value in u, 3, 3/4? 3 Let n be 14/(-105)*(-3)/(-2). Let o = -8 - -5. Which is the smallest value? (a) o (b) n (c) 0.5 a Let f = 0 - -0.1	{ "pile_set_name": "DM Mathematics" }
-0.2 (c) -5 (d) 0.02 c Which is the closest to -1? (a) 1.6 (b) -0.4 (c) 92 b Which is the nearest to -2/3? (a) -104 (b) -0.34 (c) 5 b Which is the closest to -0.4? (a) 2537 (b) 3 (c) 10 b Which is the closest to 0? (a) 24582 (b) 5/7 (c) -1 b Which is the closest to -1/2? (a) 4 (b) -16.61 (c) 1 (d) -1.1 (e) -0.3 e What is the closest to -1 in 760, 2, -3/2? -3/2 What is the closest to 2 in -1, 0.1811, 0.36? 0.36 What is the closest to 1.2 in -0.2, 0.2, 6.2? 0.2 Which is the nearest to -240? (a) 3 (b) -3 (c) -6 (d) 5 (e) -1/3 c Which is the closest to 1? (a) 5/3 (b) -4/5 (c) 10/7 c Which is the nearest to -0.05? (a) 751 (b) 2 (c) -0.1 (d) 0.1 (e) 0.39 c Which is the closest to -1? (a) 2/7 (b) 0 (c) -0.7 (d) 0.2 (e) -14 c Which is the nearest to -6? (a) 0.5 (b) 0.2 (c) 1 (d) 5/3 (e) 274 b What is the closest to 5 in 0.5, 2/79, -0.19, -2/11? 0.5 What is the closest to 1 in -2, 2/3, -0.5, -15, 2/7? 2/3 Which is the closest to -0.03? (a) 3/2 (b) 1/3 (c) 1/6 (d) 0 (e) 1/46 d What is the nearest to 0 in 1, 78.22, -0.5? -0.5 Which is the nearest to 0.3? (a) -0.35 (b) -1/3 (c) -0.4 (d) -1 b Which is the closest to 3? (a) -2.62 (b) -2/15 (c) 3 (d) -0.02 c What is the closest to -7 in 4, -0.3, -3, -251, 6? -3 What is the nearest to 0.2 in -15, 2/3, 0.1, 1/4, -4.6? 1/4 What is the nearest to -0.3138 in -13, 2/17, 0.4? 2/17 What is the nearest to 0 in -0.03, -1/4, 98? -0.03 What is the closest to 1 in 125, -4/3, 2/11, -0.065, -0.2? 2/11 Which is the nearest to -4? (a) -4 (b) -663/7 (c) 2/9 a What is the closest to 89 in -2/19, 1.8, 5, -2/11? 5 What is the nearest to 0.3 in -0.5, -5/4, -102/5, -2? -0.5 What is the nearest to -1 in 16, 1, -3/10, 0.01, -0.1? -3/10 Which is the closest to 2? (a) 8 (b) 16.59 (c) -1/3 c Which is the closest to 3? (a) 3/7 (b) -2/13 (c) -1752 (d) -1 a What is the closest to -2/5 in 1/4, -5, -3/2, -5/3, -3? 1/4 What is the nearest to -13.8 in -0.72, 1/2, 4? -0.72 What is the closest to 25 in 0.1, 5, -11, 2/5, -69/5? 5 What is the nearest to 3 in -24/25, 0.073, 0.3, 3? 3 What is the nearest to -1 in -24, 3, 25, -3? -3 Which is the nearest to -0.1? (a) 2.8 (b) -98 (c) -5/102 c Which is the nearest to 0.3? (a) -3/7 (b) -2 (c) -5361.1 a What is the nearest to 3644 in -4, 0.4, -42? 0.4 What is the nearest to -2/13 in 50, -8, -0.1, 4/3? -0.1 What is the nearest to -1 in 2, 0, 16, 1.1, 1? 0 What is the closest to 0.6 in -2/5, 6, -6838, 0.3? 0.3 What is the closest to -2 in -2, 5, 1.3, -1? -2 What is the closest to 1/3 in 4, -19, -2/5, 2/7, -0.38? 2/7 Which is the nearest to 1? (a) 13 (b) -23035 (c) 3 c Which is the nearest to -5? (a) -2.4 (b) 0.4 (c) -1 (d) 10/3 (e) -0.4 a Which is the closest to -3/2? (a) 1/6 (b) -0.4 (c) -2/77 (d) 4 b Which is the nearest to 1? (a) -0.05 (b) -15 (c) -51.3 (d) 1/6 (e) -2 d Which is the nearest to -2/9? (a) 2 (b) 19/67 (c) 1/2 (d) -1/2 (e) -2 d What is the closest to 0.031 in -5, 5/3, 5? 5/3 Which is the nearest to 1? (a) 4 (b) 2 (c) -448.1 b Which is the nearest to 1/4? (a) 1 (b) 10/13 (c) -8 b What is the closest to 1 in -0.3, 1/27, -4, -2/11, 0.3? 0.3 What is the closest to 12 in 2.7, 0.1, 35, 5? 5 Which is the closest to -8? (a) 0.02 (b) 3 (c) -3 (d) -5 (e) -4 d Which is the closest to 3? (a) 6 (b) -40/13 (c) -2 (d) -0.5 a Which is the closest to 0? (a) 1.1 (b) -1 (c) -5414 (d) 2/5 d Which is the nearest to 2? (a) 14 (b) 2/7 (c) 0.02 (d) -1 (e) 37 b What is the nearest to -4 in -1, -3, 2.7, 0, 0.5? -3 What is the nearest to -4 in -459, 0.1, 0, 1? 0 Which is the nearest to 2/9? (a) -0.5 (b) 0.3 (c) 10 (d) -0.6 b Which is the nearest to 5? (a) 0.1 (b) 0.019 (c) 0.09 a Which is the closest to -46? (a) 4 (b) -13/3 (c) 2/7 b What is the nearest to 1 in 3, 9892, 5, 4? 3 What is the nearest to -1 in -5, -1/3, 0.7, 6083? -1/3 Which is the closest to 54/23? (a) -0.3 (b) 4 (c) -10 (d) -0.4 (e) 8 b Which is the closest to 3? (a) -100 (b) 0.1 (c) 2 (d) 0 c Which is the closest to -2/29? (a) -7 (b) -3 (c) 3/2 (d) -0.5 (e) 2.7 d What is the nearest to 8/29 in -0.05, 13, -0.5? -0.05 What is the nearest to 2 in -12, 2, -13, 0.02? 2 What is the closest to 3.883 in 0.1, -2/9, 0.4, 0.3, 2/3? 2/3 What is the nearest to -8/3 in -30, 5, -27? 5 What is the closest to 0 in -48/187, 3, -0.1? -0.1 What is the nearest to 0.2 in -3, 2/2017, 2? 2/2017 What is the closest to -3 in 0.2, 4.41, -192? 0.2 What is the closest to 27 in 5, -1, 3, 91? 5 Which is the closest to 2/3? (a) -2 (b) 0.3 (c) 1/3 (d) -39 (e) -1.9 c What is the nearest to 20 in -6/7, 2/3, 0, 0.6? 2/3 What is the nearest to 0.1063 in -9/2, 0.5, -4, 1? 0.5 What is the nearest to 1 in 545.1, -0.3, 2? 2 Which is the closest to -2? (a) 2 (b) 46101 (c) -3/5 c What is the nearest to 2 in -73, -3, -0.3, -12? -0.3 What is the nearest to 2.4 in 2/7, 1, -6, 1/8? 1 Which is the nearest to -0.2? (a) 1 (b) -2/5 (c) -26/19 b What is the nearest to -129 in -6, -2/9, 10, -1? -6 Which is the closest to 1? (a) -0.19 (b) -0.05 (c) 1/6 (d) 168 c What is the closest to 0 in 8, -5, -3/23? -3/23 Which is the closest to 12/7? (a) -54 (b) 2/5 (c) 1/6 (d) 0.6 d Which is the closest to -2? (a) 955 (b) 2 (c) -0.26 c What is the closest to 100/3 in 11/2, 1.96, -0.1? 11/2 What is the closest to -1015 in -2, -13, 0.4? -13 What is the nearest to 0 in -2/9, 2/7, -5, 2, 17/4? -2/9 Which is the closest to -9? (a) -6/47 (b) -2/9 (c) 2/9 (d) -2/3 (e) -3 e What is the closest to 1 in -1/5, 5, 0.2, -0.01, 2088? 0.2 Which is the nearest to -82? (a) 0.2 (b) -0.1 (c) -13 c Which is the nearest to 0.1? (a) -57 (b) 1 (c) -2.1 (d) 3/14 (e) -0.5 d Which is the nearest to -0.252? (a) -1/2 (b) -1 (c) 0.3 (d) -5 (e) 124 a What is the closest to 0.02 in 4, -1, -842, -5? -1 Which is the closest to 107? (a) 3 (b) 5 (c) 316/5 c Which is the closest to -15? (a) 0.4 (b) -2 (c) 1 b What is the closest to 0.1 in 166, 30, 29? 29 What is the nearest to -1 in 5, -1/3, -1, -3/65, -2? -1 What is the nearest to 0.3 in -14, 2/11, -1/7, 1/2? 2/11 What is the closest to -1 in 46, 19, 0.3, -1/2, 4.1? -1/2 Which is the closest to 2? (a) -7 (b) -0.38 (c) -3 (d) 9/7 (e) -4 d What is the nearest to 0.1 in -7, -22, -2, 2? 2 What is the nearest to -39 in 1/2, 0.3, -4, -48/11, 5? -48/11 What is the nearest to -1 in -1, 0.1, -10, -27, -6? -1 What is the nearest to 0 in -1/5, -2/17, -2/1947? -2/1947 What is the closest to 1 in 1, -1/2675, 0, 0.1, -4? 1 Which is the nearest to -24/7? (a) 4 (b) 69 (c) 0.3 (d) 0.02 d What is the nearest to 0.103 in -7, -3, -2? -2 Which is the closest to -1? (a) -10 (b) -149 (c) 2/21 c Which is the closest to -2? (a) -3/118 (b) -1 (c) 1/5 (d) -4 b What is the closest to 2/7 in -0.3, 9, -8, -15/7, 1/3? 1/3 Which is the closest to -2/569? (a) 0.5 (b) -4 (c) -1 (d) 1 a What is the nearest to -102 in 5, -5, 0.4, -1? -5 What is the closest to -1 in 5, -34, 4, -535/6? 4 What is the closest to -1/3 in -8, -2, 5/3, 0.83? 0.83 Which is the closest to 186? (a) 2/5 (b) -1 (c) 0 (d) -7 a Which is the nearest to 2? (a) -88/9 (b) 0 (c) 0.08 c Which is the nearest to 17/5? (a) -3 (b) 1/4 (c) 0.3 c Which is the closest to 2/27? (a) 22 (b) -0.1 (c) -1.2 (d) 7 b What is the closest to -1/4 in 166/23, 19, 2? 2 Which is the closest to 2? (a) 5 (b) -5 (c) 27/17 (d) -0.4 c Which is the closest to 2/5? (a) -5/4 (b) 188 (c) 145 a Which is the nearest to -0.1? (a) -1 (b) 136 (c) -3/8 (d) 1/2 (e) -0.29 e Which is the nearest to -1/4? (a) -0.2 (b) -410 (c) -5 (d) -13 a Which is the closest to -2? (a) -2/15 (b) 3 (c) 5/8 (d) 4.77 a What is the nearest to 2/11 in 0.3, 0.103, 1/6, -8, 5? 1/6 Which is the closest to -0.1? (a) 0 (b) 0.05 (c) -2339 a Which is the nearest to 1/2? (a) -345 (b) -0.5 (c) -31 b What is the closest to -59/2 in 4, 3/4, -5.9? -5.9 Which is the nearest to 7182? (a) 2/15 (b) -4 (c) 1/5 (d) 0.1 c Which is the nearest to -1? (a) -6.2 (b) -6 (c) 1/3 (d) -1 d What is the closest to 0 in 0, -0.007, -7/4? 0 Which is the closest to 52/9? (a) -13.4 (b) -4/9 (c) 2 c Which is the nearest to 0.1? (a) 5 (b) 0.1 (c) 6.4 (d) -13 (e) 4 b What is the closest to 0.2 in 537, -	{ "pile_set_name": "DM Mathematics" }
factor of 6755104 and 416. 32 What is the greatest common factor of 32584013 and 407? 407 Calculate the greatest common factor of 56 and 41701366. 14 What is the greatest common factor of 4880 and 2249131? 61 What is the greatest common factor of 39226 and 3674? 22 What is the highest common divisor of 58330785 and 195? 15 Calculate the highest common divisor of 38 and 53807126. 38 What is the highest common factor of 145 and 59144485? 145 Calculate the highest common factor of 387855 and 565305. 2535 Calculate the greatest common factor of 18259344 and 216. 216 What is the greatest common factor of 6294 and 653030823? 3147 What is the highest common divisor of 133 and 97268619? 133 Calculate the highest common divisor of 18412646 and 4396. 2198 Calculate the highest common divisor of 60927313 and 173. 173 Calculate the highest common divisor of 690 and 5926470. 30 Calculate the greatest common factor of 48 and 1049772. 12 Calculate the greatest common divisor of 9008248 and 368. 8 Calculate the highest common divisor of 478622 and 130260. 334 Calculate the highest common factor of 201556 and 10168. 164 What is the highest common factor of 72 and 15112? 8 What is the greatest common divisor of 2902 and 139345334? 2902 What is the greatest common divisor of 143840 and 7064? 8 What is the highest common divisor of 86 and 6582182? 86 What is the greatest common factor of 3484106 and 635189? 6289 Calculate the highest common factor of 56981 and 7086637. 2999 Calculate the highest common factor of 957 and 41893313. 319 Calculate the highest common divisor of 9827104 and 399. 133 Calculate the highest common divisor of 660 and 1156815330. 330 Calculate the greatest common divisor of 420 and 405175540. 140 Calculate the highest common factor of 16 and 385011840. 16 Calculate the highest common divisor of 5278 and 289373. 7 What is the greatest common divisor of 170771 and 94527? 389 Calculate the highest common divisor of 74 and 10309162. 74 What is the highest common factor of 30185661 and 2508? 627 Calculate the greatest common factor of 5592477 and 5754. 411 What is the greatest common divisor of 478577 and 583? 11 What is the greatest common factor of 2361306 and 18? 6 Calculate the greatest common divisor of 9590 and 104531. 959 What is the greatest common divisor of 91583454 and 459? 51 Calculate the highest common divisor of 9686 and 1179020. 334 Calculate the greatest common divisor of 112309 and 52150440. 4883 What is the greatest common factor of 634283 and 243373? 1261 What is the greatest common divisor of 182 and 248144? 26 What is the highest common factor of 19257363 and 72? 9 Calculate the highest common factor of 273666 and 11067. 51 What is the highest common factor of 113855268 and 12? 12 What is the greatest common divisor of 2162635 and 80? 5 Calculate the greatest common divisor of 32 and 232059184. 16 What is the greatest common divisor of 16925345 and 895? 895 What is the greatest common divisor of 759 and 76560? 33 What is the highest common factor of 850551008 and 4448? 4448 What is the highest common factor of 468696 and 1912? 8 Calculate the highest common divisor of 14960 and 754732. 748 What is the highest common divisor of 6722199 and 495? 99 Calculate the highest common factor of 15653 and 601304. 11 What is the highest common divisor of 459516687 and 7? 7 Calculate the highest common factor of 7603813 and 7. 7 What is the greatest common factor of 1505 and 11151620? 215 What is the highest common divisor of 573279 and 189? 21 Calculate the highest common factor of 3850758 and 16214. 134 Calculate the greatest common factor of 147 and 119874237. 147 Calculate the greatest common factor of 9269 and 2023057. 23 Calculate the highest common divisor of 89726 and 588642. 986 What is the highest common divisor of 6312820 and 50? 10 What is the greatest common factor of 107991 and 277184? 71 What is the greatest common factor of 737952 and 240? 48 Calculate the greatest common factor of 2840 and 1320955. 355 What is the highest common factor of 2128614 and 328098? 894 What is the highest common divisor of 49106109 and 3149? 67 Calculate the greatest common divisor of 2440564 and 196. 28 Calculate the greatest common divisor of 682 and 97871092. 682 What is the highest common factor of 17357 and 16405? 17 What is the highest common divisor of 289183 and 2272? 71 What is the greatest common divisor of 14170 and 10902398? 2834 What is the greatest common divisor of 7581736 and 767? 59 Calculate the highest common factor of 63963 and 4577835. 309 Calculate the highest common factor of 3674208 and 132. 12 Calculate the highest common divisor of 644319284 and 20244. 6748 What is the highest common divisor of 322 and 7218106? 14 What is the highest common factor of 684236 and 68698? 98 What is the greatest common divisor of 13964688 and 1296? 144 What is the highest common factor of 11729468 and 24? 4 What is the highest common divisor of 49244580 and 3420? 3420 What is the highest common factor of 123 and 452845? 41 What is the greatest common divisor of 17629226 and 29412? 1634 What is the greatest common factor of 27594 and 78462? 54 Calculate the greatest common factor of 447144 and 744. 744 What is the highest common factor of 818414 and 21318? 34 Calculate the greatest common factor of 300 and 9736575. 75 Calculate the highest common factor of 3739 and 1783. 1 What is the greatest common divisor of 3479701 and 88700? 887 What is the highest common divisor of 42 and 4106532? 6 What is the greatest common divisor of 2795 and 3139469775? 2795 What is the greatest common divisor of 9417 and 196897? 43 What is the highest common factor of 32589 and 44091? 1917 What is the greatest common divisor of 27988 and 197854169? 6997 What is the highest common factor of 10728 and 23625? 9 Calculate the greatest common divisor of 336960 and 11872. 32 What is the highest common factor of 73836 and 41692? 28 Calculate the greatest common divisor of 65 and 390883870. 65 Calculate the greatest common divisor of 6069 and 59423313. 867 What is the greatest common divisor of 14997192 and 63? 21 What is the highest common divisor of 1444 and 442548? 76 Calculate the highest common divisor of 3544190 and 60. 10 Calculate the greatest common factor of 75600 and 107190. 270 Calculate the greatest common factor of 2 and 46283. 1 Calculate the highest common divisor of 1943 and 2048994. 67 Calculate the highest common factor of 49280 and 201040. 560 Calculate the greatest common divisor of 16039 and 53578. 43 Calculate the greatest common factor of 1325 and 62534753. 53 Calculate the greatest common divisor of 17204 and 13096292. 1012 Calculate the highest common divisor of 19208345 and 1105. 65 What is the greatest common factor of 59438483 and 169? 169 Calculate the highest common divisor of 4165 and 11464285. 245 What is the greatest common factor of 883523 and 52244? 37 What is the highest common factor of 13505770 and 665? 95 What is the highest common factor of 9894 and 81413? 17 What is the highest common divisor of 261934883 and 5789? 5789 Calculate the highest common divisor of 1042 and 207628399. 521 What is the greatest common divisor of 663 and 1183? 13 Calculate the highest common factor of 3794945 and 22. 11 Calculate the greatest common divisor of 452556 and 1924. 52 Calculate the greatest common divisor of 11428300 and 1430. 130 Calculate the highest common divisor of 3913 and 51259. 13 What is the greatest common factor of 121089 and 16725? 669 What is the highest common divisor of 32046199 and 23? 23 What is the greatest common divisor of 1283627 and 1189? 29 Calculate the greatest common divisor of 144 and 4253168. 16 What is the greatest common divisor of 14 and 69357036? 14 Calculate the highest common factor of 2988 and 1152108. 36 What is the greatest common factor of 413985 and 624? 39 Calculate the highest common factor of 11198723 and 69. 23 What is the greatest common factor of 37931 and 360573? 457 What is the highest common factor of 12456653 and 121? 11 What is the highest common factor of 374 and 2871594? 22 Calculate the greatest common divisor of 33116 and 486. 2 What is the highest common factor of 1560942 and 9162?	{ "pile_set_name": "DM Mathematics" }
55000 What is twenty-one halves of a litre in millilitres? 10500 What is 1151.958 years in decades? 115.1958 What is nine tenths of a century in years? 90 What is 21/8 of a centimeter in micrometers? 26250 How many nanoseconds are there in 273302.4us? 273302400 How many grams are there in 87893.65 micrograms? 0.08789365 What is 93.72652t in micrograms? 93726520000000 What is 1/15 of a minute in milliseconds? 4000 What is 24.99164 grams in micrograms? 24991640 What is 8401.7844 milliseconds in hours? 0.002333829 How many millilitres are there in 1/5 of a litre? 200 What is 0.3110771 millilitres in litres? 0.0003110771 What is 3/16 of a day in seconds? 16200 What is three eighths of a litre in millilitres? 375 Convert 0.2393816ng to grams. 0.0000000002393816 How many years are there in 31.84634 millennia? 31846.34 How many millilitres are there in twenty-five quarters of a litre? 6250 How many months are there in thirty-four fifths of a century? 8160 Convert 0.6908052ug to milligrams. 0.0006908052 How many years are there in 17/4 of a millennium? 4250 Convert 96605.26ml to litres. 96.60526 Convert 86.21088 litres to millilitres. 86210.88 What is 43.80956 centuries in years? 4380.956 What is 68424709.5 microseconds in weeks? 0.00011313609375 How many centuries are there in 3/5 of a millennium? 6 How many decades are there in 27/2 of a millennium? 1350 How many millilitres are there in 13/5 of a litre? 2600 Convert 7.3346 kilograms to micrograms. 7334600000 How many centimeters are there in three tenths of a meter? 30 What is 100.958m in centimeters? 10095.8 What is eleven halves of a gram in milligrams? 5500 How many centimeters are there in 64.82495mm? 6.482495 What is 21/5 of a kilometer in meters? 4200 Convert 214498.2 nanometers to meters. 0.0002144982 What is 37.59907 meters in nanometers? 37599070000 What is 346.9084 micrograms in milligrams? 0.3469084 How many millimeters are there in three tenths of a meter? 300 Convert 6.16752ml to litres. 0.00616752 What is eleven halves of a decade in years? 55 How many centimeters are there in three fifths of a kilometer? 60000 What is 0.6941561s in nanoseconds? 694156100 Convert 0.6791405mm to kilometers. 0.0000006791405 What is fourty-five eighths of a microsecond in nanoseconds? 5625 How many decades are there in one twentieth of a millennium? 5 How many nanograms are there in 1/20 of a milligram? 50000 What is 0.1759543l in millilitres? 175.9543 What is five eighths of a litre in millilitres? 625 What is fourty-two fifths of a litre in millilitres? 8400 How many micrograms are there in thirteen fifths of a milligram? 2600 What is 0.2095 microseconds in nanoseconds? 209.5 What is 40.6721mm in kilometers? 0.0000406721 What is five quarters of a millennium in years? 1250 Convert 415.452 tonnes to nanograms. 415452000000000000 Convert 19913.166 minutes to hours. 331.8861 What is 26/5 of a microgram in nanograms? 5200 What is 18/5 of a millennium in centuries? 36 How many days are there in 7741.899 minutes? 5.37631875 How many milliseconds are there in 8042.31 minutes? 482538600 How many tonnes are there in 0.473661 nanograms? 0.000000000000000473661 What is seven halves of a century in years? 350 What is fourty-two fifths of a tonne in kilograms? 8400 How many years are there in 13/5 of a decade? 26 What is 8/25 of a kilogram in grams? 320 How many decades are there in 10214.985 months? 85.124875 What is 4.734057um in nanometers? 4734.057 What is one fifteenth of a minute in seconds? 4 How many milliseconds are there in fourty-six fifths of a second? 9200 What is 18/5 of a meter in millimeters? 3600 What is twenty-one quarters of a milligram in micrograms? 5250 How many weeks are there in 78.927534 hours? 0.46980675 Convert 2.4084177 months to years. 0.200701475 How many kilograms are there in 15/4 of a tonne? 3750 What is 5193.373 kilograms in micrograms? 5193373000000 What is 10/9 of a day in minutes? 1600 What is 8.364021 millennia in centuries? 83.64021 How many years are there in 70.91157 decades? 709.1157 How many milligrams are there in 6/5 of a gram? 1200 How many litres are there in 0.093617 millilitres? 0.000093617 What is ninety-one quarters of a milligram in micrograms? 22750 Convert 477.9451 decades to millennia. 4.779451 How many grams are there in 3/10 of a kilogram? 300 How many micrometers are there in six fifths of a millimeter? 1200 How many microseconds are there in 866.515ms? 866515 What is 0.1495962 tonnes in micrograms? 149596200000 Convert 899313.9 kilometers to meters. 899313900 What is 1.9669362 months in millennia? 0.00016391135 What is 47/4 of a milligram in micrograms? 11750 What is 48684.6ml in litres? 48.6846 What is 8.790564 kilometers in meters? 8790.564 What is 9.240482nm in meters? 0.000000009240482 How many millimeters are there in 76/5 of a centimeter? 152 How many weeks are there in 1681084.503 seconds? 2.7795709375 What is twenty-five quarters of a millennium in decades? 625 How many nanoseconds are there in eleven halves of a microsecond? 5500 How many litres are there in 7611.81 millilitres? 7.61181 What is 89849.59 centimeters in meters? 898.4959 What is 48807.06l in millilitres? 48807060 Convert 224644.6ml to litres. 224.6446 What is one tenth of a kilogram in grams? 100 What is 7.435187l in millilitres? 7435.187 How many meters are there in 71.58839 millimeters? 0.07158839 What is fourty-five quarters of a micrometer in nanometers? 11250 Convert 414.9308kg to nanograms. 414930800000000 How many years are there in fourty-one halves of a century? 2050 What is 1/4 of a meter in millimeters? 250 What is sixty-three eighths of a gram in milligrams? 7875 What is thirty-seven fifths of a second in milliseconds? 7400 How many minutes are there in 1/4 of a day? 360 How many months are there in 230874.6 millennia? 2770495200 How many centuries are there in 112549.26 months? 93.79105 What is 46/5 of a kilogram in grams? 9200 What is 17/4 of a tonne in kilograms? 4250 What is thirty-one fifths of a litre in millilitres? 6200 What is seventeen halves of a litre in millilitres? 8500 How many litres are there in 0.3332192 millilitres? 0.0003332192 Convert 764.0014 nanometers to kilometers. 0.0000000007640014 What is 1/5 of a week in minutes? 2016 What is seven quarters of a hour in seconds? 6300 How many years are there in 6/25 of a millennium? 240 What is fifteen quarters of a litre in millilitres? 3750 How many meters are there in 4718.143 nanometers? 0.000004718143 Convert 85.56494m to micrometers. 85564940 What is 17/2 of a kilometer in meters? 8500 What is 0.022377 years in months? 0.268524 How many millilitres are there in 5/4 of a litre? 1250 Convert 0.8229527us to seconds. 0.0000008229527 What is 714.81555ms in hours? 0.000198559875 Convert 9879.762 centuries to millennia. 987.9762 What is twenty-one halves of a litre in millilitres? 10500 Convert 5374.976 tonnes to grams. 5374976000 What is one twentieth of a gram in micrograms? 50000 Convert 119.0432187 microseconds to weeks. 0.00000000019683071875 What is 81541.99 litres in millilitres? 81541990 What is twenty-one eighths of a centimeter in micrometers? 26250 How many millilitres are there in 1/20 of a litre? 50 What is 13/8 of a litre in millilitres? 1625 How many centimeters are there in 0.3530845mm? 0.03530845 What is fifty-one halves of a meter in millimeters? 25500 What is 685153.3ng in micrograms? 685.1533 Convert 97441.38l to millilitres. 97441380 What is seven quarters of a litre in millilitres? 1750 Convert 4.787321mg to tonnes. 0.000000004787321 How many years are there in seventeen halves of a century? 850 How many millilitres are there in fourty-two fifths of a litre? 8400 What is 75.764601 milliseconds in hours? 0.0000210457225 What is 53147.87 decades in months? 6377744.4 What is eleven quarters of a tonne in kilograms? 2750 How many kilograms are there in thirteen quarters of a tonne? 3250 What is three tenths of a centimeter in millimeters? 3 How many nanograms are there in five quarters of a microgram? 1250 What is one sixteenth of a meter in micrometers? 62500 What is 4.01745 millilitres in litres? 0.00401745 How many millilitres are there in 37/2 of a litre? 18500 Convert 1.291151 millili	{ "pile_set_name": "DM Mathematics" }
/5 (b) -2.3 (c) 395 (d) 2 d Which is the closest to 0.4? (a) 0.4 (b) -0.1 (c) 0.1 (d) -58032/5 (e) -2 a Which is the nearest to 1/2? (a) -4 (b) 0.21 (c) 0 (d) -6.26 (e) -49 b Which is the nearest to -1? (a) 1.5 (b) 12658 (c) -419 a What is the nearest to -1 in 1/6, 188889, 1/12? 1/12 Which is the nearest to 5? (a) 843 (b) 0.42 (c) -0.1 (d) 5 (e) -1/2 (f) -2/7 d What is the nearest to 390 in -2, -1/5, -2/553, -0.75? -2/553 Which is the nearest to -0.01299? (a) 0 (b) 0.31 (c) 386 (d) -1 a What is the nearest to -0.2207 in -0.1, 0, -0.5, 2/15, 6? -0.1 Which is the closest to 0? (a) 0 (b) 0.0614214 (c) 1/2 a Which is the nearest to -29? (a) -3/8 (b) -12 (c) -8 (d) 1 (e) -0.2 b What is the nearest to 0.06 in -2/17, 673/12, 16? -2/17 Which is the closest to 2/5? (a) -2 (b) -14613 (c) -0.2 c Which is the nearest to -0.43? (a) 9 (b) 28 (c) 40 a Which is the closest to -2? (a) 1/25 (b) 67 (c) -664 a Which is the closest to 0? (a) -285089/2 (b) -5 (c) 0.2 (d) 4/5 c What is the closest to 71768 in 1, -3, -1/6, -5, -2.6? 1 What is the closest to -5 in -1802, -7, -388? -7 What is the closest to -3.257 in -0.13, 2, 0.006, -0.5, 1? -0.5 What is the nearest to -1/19 in 31, 13.9, 1.1? 1.1 What is the nearest to 36/25 in 7, -2, 596? -2 Which is the nearest to 1.01? (a) 5 (b) -4 (c) 6 (d) 119 (e) -2 (f) -3 e What is the closest to -2 in 14, -7627/4, 6? 6 What is the nearest to -45799 in 2/11, -296, 0.3? -296 What is the nearest to -1/4 in 2/13, 44, 1, -1/8, 0.01571? -1/8 What is the closest to 0 in 0.1, 0.034, 3, 144/5, -6? 0.034 Which is the nearest to -0.1? (a) -2/7 (b) -5 (c) 106585 (d) 2/25 d Which is the nearest to 1/7? (a) 0 (b) -37863 (c) -0.48 a What is the nearest to -0.3 in 97, 0.3, 10, 0.4, -329, -5/3? 0.3 Which is the closest to -0.06? (a) 2/13 (b) -52/11 (c) -5 (d) 22 (e) -2/19 e Which is the closest to -2/5? (a) -1 (b) -3 (c) -14027885 a What is the nearest to 950 in -5, -2/65, 1/3, -2/9, 2? 2 What is the closest to -5 in 1, -2/19, -4, -6430, 0.1? -4 What is the closest to -1 in -9/5, 547, 127? -9/5 Which is the closest to 2/5? (a) -5/4 (b) 1839 (c) 1391 a Which is the closest to 2/5? (a) 0.5 (b) 1/31590 (c) -120 a Which is the nearest to 6/7? (a) -3 (b) -5 (c) 14 (d) 3/4 (e) 2/77 d What is the nearest to -2 in 4, -14, -0.3, 3/185, 2/3? -0.3 What is the closest to -0.142 in 5/4, 0.47, -0.1, -0.64? -0.1 What is the closest to -0.1 in -7, -116748, -4, 7? -4 Which is the nearest to -1? (a) -26 (b) -155 (c) 0.2 (d) -0.0288 d What is the nearest to -60 in 19, -5, 0.89, -3/2? -5 Which is the closest to 12/89? (a) -1 (b) 1.2483 (c) 0.3 (d) -5 c What is the closest to -130 in -0.06, -0.2, 0.025, -3, 1/5? -3 Which is the nearest to -2/7? (a) -0.1 (b) -2/3 (c) -1.38426 (d) 1/4 a What is the closest to 532 in 10, 1627, 0, -0.2, 1/5? 10 What is the nearest to -4 in 0.05244, 3/11, 0.5, 0.05? 0.05 What is the closest to -1 in -3/5, 1, -33459448? -3/5 Which is the nearest to 154/13? (a) 0.4417 (b) 1 (c) -88 b Which is the nearest to 0.4? (a) 0 (b) 159058 (c) -0.077 (d) -5 a Which is the closest to 1? (a) -0.2 (b) 58 (c) 3/7 (d) -4/11 (e) -4/3 c What is the nearest to -2/3 in 129, -25873, 2? 2 Which is the nearest to 1? (a) 261 (b) -5 (c) 7.18 (d) -2.8 d Which is the nearest to -50? (a) -0.2 (b) 207568 (c) 1 a What is the nearest to 5 in 0.03, 0.3, -15, 0.1, -0.07? 0.3 Which is the closest to -2/5? (a) -4 (b) 0 (c) 1.795 b What is the closest to 2/11 in 3, 418, 4, -13? 3 What is the closest to 0.4 in 1, 150/97, -13, 5? 1 Which is the nearest to 1/3? (a) -3/20 (b) 0.144 (c) 7 (d) -3 (e) 5 b Which is the nearest to 6261? (a) 5/3 (b) -5 (c) 17 (d) 1 c What is the closest to -10040 in 0.01, 0.1, 5/2, 2, 2/5? 0.01 Which is the closest to 0? (a) -5 (b) -2/5 (c) 4 (d) -11 (e) -0.07368 e What is the nearest to -2/5 in -2/7, 50, -2/15, -1, 40501? -2/7 What is the nearest to -0.2 in 58977, 12/11, 5? 12/11 Which is the closest to -0.3? (a) -25 (b) -2 (c) 0.4 (d) -1/2 (e) -0.67 d What is the nearest to -0.1 in 1/89, -7.93, -0.6, 0.12? 1/89 What is the closest to -0.1 in -1.11, 0, -1, 266? 0 Which is the closest to 0? (a) 24 (b) -0.65 (c) 0.1 (d) -0.5 (e) -10/33 c Which is the closest to -1/18? (a) -16 (b) 1258 (c) -5/6 c Which is the closest to -0.16? (a) -2518 (b) -2/231 (c) -3 (d) -0.4 b What is the closest to -6 in 2/13, -2/3, -82, -2, 62? -2 What is the nearest to 1 in -2/599, 1, 2/13, -2? 1 Which is the nearest to 6/5? (a) -10/3 (b) -0.5 (c) -2/15 (d) -352/3 c Which is the nearest to -2/3? (a) -1/3 (b) 3/4 (c) 0 (d) -2 (e) 26 (f) -72 a What is the nearest to -2 in 2/11, 3.4, 4678, 1, -0.2, 66? -0.2 Which is the closest to -0.6? (a) -1/2 (b) 2134 (c) 3/2 (d) -2/3 d Which is the nearest to -0.1? (a) 3/2 (b) -1/4 (c) 1388 (d) 1/3 (e) -2 (f) 615 b Which is the closest to 1? (a) -2 (b) -7 (c) -1 (d) 12/82397 (e) 0.7 e What is the nearest to 22 in 1, -20, -0.12, -0.1? 1 What is the closest to -2 in 1, -1/2658, -2/3, 2, -3/4? -3/4 Which is the closest to 1? (a) -0.4 (b) -1 (c) -4 (d) -31431 (e) -6 (f) 0.04 f What is the closest to -1/25 in -0.2, -533, 1/12, -2, -24? 1/12 What is the nearest to 7 in -5, 0.2, -4, 1, 64.3, -223? 1 What is the closest to 7397 in 69, 0.3, -2? 69 Which is the closest to -0.1? (a) -2/85 (b) -4/9 (c) -86 (d) 37 (e) -1/9 (f) -0.1 f What is the nearest to -2/7 in -0.4, -259/3, 47, -5, 14? -0.4 What is the nearest to -1/3 in -2, -0.4, -7/227, 0.04, -0.45? -0.4 What is the nearest to -2 in -0.2, 2654.1, 3/8, 2/3? -0.2 What is the nearest to 4 in 9/13, -0.003, -0.4, 2/71, 0.06? 9/13 Which is the closest to 0.1? (a) -0.4 (b) 46915 (c) -3 (d) 1/3 d What is the closest to -0.23 in -5, 0, 41348, -3, -0.1, 2? -0.1 What is the nearest to 1 in 15, 365/3, -3/4, 6? -3/4 Which is the closest to 1? (a) 5/84 (b) 5.6539 (c) -4 a Which is the closest to -2/7? (a) 1 (b) 4 (c) -338 (d) 0.1 (e) -2/5 (f) -3 e What is the closest to -14.36 in -3, 2/21, 2/3, -2/7, 21? -3 Which is the closest to 2/3? (a) -30 (b) -1 (c) 2721 (d) -13 b Which is the closest to 4? (a) 4/19 (b) -2 (c) 3035 a What is the nearest to -45.11 in -1, 0.2, 0.5? -1 Which is the nearest to 0.12? (a) 0.6783 (b) -2 (c) 11/5 a Which is the closest to 2/141? (a) -1/5 (b) -10 (c) 0 (d) 0.5 c What is the nearest to 0.09 in 0.0289, 2, -1/67, -3? 0.0289 What is the closest to -1/12 in -103.4, -0.1, 2? -0.1 What is the closest to 441 in 0.1, -1/88, -0.69, 0? 0.1 What is the closest to 3337 in 6, -2/9, 9, 4? 9 Which is the closest to 1/2? (a) 6/31 (b) -5 (c) -1.2 (d) -4536 a What is the closest to -1363 in 55, 1/2, -0.1, -7? -7 Which is the nearest to 0.2? (a) 2.1 (b) -194 (c) 0.02 c Which is the closest to -1? (a) -445 (b) -1/5 (c) 42 (d) -1/2 d Which is the nearest to -1/5? (a) 1/243 (b) 1/3 (c) 25/452 a Which is the closest to 67? (a) 0.04 (b) -1/3 (c) 0.5 (d) -2/21 (e) 110 e What is the nearest to -2 in -6, -20, 3.1, 0, -3? -3 Which is the nearest to 2/5? (a) -5 (b) 0.3 (c) -2665 (d) 5 (e) 4/9 e What is the nearest to -1 in -0.06, -39, 9, 0.5, -1/4? -1/4 What is the closest to -2 in -0.09, 17.21, 38? -0.09 What is the nearest to 0.014 in 1, -4, 4/45, 27, 4? 4/45 What is the closest to -0.1 in 5, 14308, 0, -0.4, -3? 0 Which is the nearest to -49? (a) 1/5 (b) -16 (c) 745/7 (d) -3/2 b Which is the nearest to -110? (a) -0.4 (b) 264 (c) 5 (d) -5 (e) 1 (f) 16 d What is the closest to 0.2 in 0.1, -5, -2, -1053432/7? 0.1 What is the closest to -179181 in -0.4, -6, -5, 0.5? -6 What is the closest to -227/6 in 9/26, -3, -111? -3 Which is the closest to -1/10? (a) -0.08 (b) -67 (c) 5 (d) -4 (e) 3.6 a Which is the closest to 133? (a) 0.5 (b) -528 (c) -4 a Which is the closest to -0.19? (a) 0.1 (b) 1.16 (c) 193 a What is the nearest to -1 in 13, -5/4172, -2/3? -2/3 What is the nearest to 0.1 in -132, 3, 983, 5? 3 Which is the nearest to -0.1? (a) -44 (b) 2/3 (c) -154/3 (d) -4/11 (e) -6/5 d Which is the nearest to -0.2? (a) -0.2 (b) -3 (c) 4/5999 (d) -2 a Which is the nearest to -18? (a) -0.2 (b) -15 (c) -0.6 (d) 1092 b Which is the closest to -878? (a) -1/3 (	{ "pile_set_name": "DM Mathematics" }
)/(15/(-70)2). 2/15 What is the value of ((-174)/44 - -4)(-2 - 2)? -2/11 What is the value of ((-624)/(-117))/(10/6 - 1)? 8 6/1234/18 1/3 Evaluate ((-6)/(-21))/((-1)/(21/(-36))). 1/6 Calculate ((-84)/(-126))/((-4)/18). -3 What is the value of ((-64 - -10)/6)/(-1)? 9 What is ((-6)/(-4) - 4)(-8)/(-90)? -2/9 What is the value of (-8)/(-50)10(-1)/(-4)? 2/5 Calculate (-14)/(-63) - (-22)/(-18). -1 Evaluate 2/11 - 13/11. -1 Evaluate (-2)/183(-8 - -9). -1/3 0 + -47/28 -1 What is the value of -13 + (-78)/(-6) - 2? -2 What is (-1236)/252 + (-15)/(-3)? 2/21 What is the value of (22/(-88))/(2/8)? -1 Calculate (-156)/54 + 1/(-9). -3 Evaluate 2/12 + -57(-2)/(-36). -3 What is (6/(-14))/((-54)/(-2 - 7))? -1/14 What is the value of 48/(-9) + 2 - -2? -4/3 (-1 + (-96)/(-42) - 5) + 4 2/7 5/6(-640)/(-400) 4/3 What is the value of 18/15 + -10 + 127/15? -1/3 Evaluate -1 + 6 + (-40 - -33). -2 43/387(-6)/(-4) 1/6 Calculate ((0/4)/(2 + -1))/3. 0 What is 6((-261)/(-33) + -8)/1? -6/11 What is the value of 4/(3 - -1)-2? -2 What is 75/(-12) - 2/(-16)2? -6 Calculate ((-2)/43)/((-45)/(-12)). -2/5 Calculate (-40)/24 - 23/(-12)1. 1/4 Calculate ((-6)/20)/(7(-36)/(-672)). -4/5 (-8)/14 + (-6)/14 -1 What is the value of ((-1184)/28)/8 + 5? -2/7 What is (-10)/62(-2)/30? 2/9 Calculate ((-15)/20)/1 + 1. 1/4 What is (-5 - 45/(-10))-12? 6 Calculate 3/(-5)8/(-12). 2/5 12/(-21)(-7)/2 2 What is the value of (2 + 3)4/30? 2/3 (760/836)/((-6)/11-2) 5/6 What is the value of -3 - -3 - (1 + 4/(-8))? -1/2 What is the value of (-3)/4 - 1/((-184)/122)? -2/23 What is 2/2 - (-1)/(-1 + -2)? 2/3 2(-1 - 3) - -6 -2 Evaluate ((-32)/(-20))/(2/(-5)). -4 What is 4 + (1 + 1 + 32)/(-9)? 2/9 What is the value of ((-48)/(-36))/(-1 + (-23)/3)? -2/13 What is the value of (-190)/45 + -65/(-135)? -4 What is (-4)/30 - (-6)/(-90)? -1/5 What is 81/(-108) + 7/20? -2/5 What is the value of 5/(-5) + 1 + 5? 5 What is the value of 35/154/(-14)? -2/3 What is -9 + 720/81 + 0? -1/9 Evaluate 4(-3)/30 - 34/(-10). 3 What is the value of -5 - -2 - (-19 + 16)? 0 What is the value of 6(45/(-10))/(-9)? 3 (-9)/2 + 24 + -19 1/2 What is the value of -6 - -10 - 86/14 - -2? -1/7 What is the value of 45/(-270) - (-2)/4? 1/3 Calculate -1(5 + 0)/(-5)-1. -1 What is ((-2)/(-4))/(8/8)? 1/2 Evaluate (2/(-4))/(50/200). -2 Calculate (0 + (-6)/4)/(1/2). -3 What is -1 + (-9)/2(-32)/176? -2/11 Evaluate (2/(-15)3)/((-32)/160). 2 What is (-18)/24 - (-34)/(-8)? -5 Evaluate 42/(-5) + (-78)/(-195). -8 What is the value of 99/(-891) + 29/18? 3/2 Evaluate (-1)/(((-7)/(-21))/((-8)/(-6))). -4 2/6 + (-13)/((-78)/28) 5 (-42)/(-8) + 1 + 35/(-28) 5 What is the value of -3 - (75/(-9) + 20/15)? 4 What is ((-32)/(-24))/((8/3)/(-4))? -2 -2 + ((-4)/8 - (-22)/(-44)) -3 Evaluate (-7)/((-252)/222) - 6. 1/6 What is (-909)/1377 + 1 - 4/18? 2/17 3/(-7) + 48/84 1/7 What is 3 - (-234)/81(-6)/8? 5/6 Evaluate 3/(18/(-4)) + 21/(-63). -1 What is (12 + -9)/((-3)/2)? -2 Calculate (4 + 19 - 19) + 9/(-2). -1/2 What is ((-3)/1 + 6)/(-1) - -3? 0 (8/(-35))/((-8)/(-40)) -8/7 What is the value of (-44)/28 - 6/14? -2 What is (-17 + 13)2/4? -2 (-1)/3 + 3/(-9) -2/3 Calculate 144/24 - 115/20. 1/4 (-1 - (-28)/35) + 18/15 1 38/((-3648)/252) + 3/1 3/8 (3 - 7) + 1/((-1)/(-6)) 2 What is -18(-658)/(-752)? -7 Evaluate 24/144 + ((-31)/6)/1. -5 (-1715)/2275 + 3/5 -2/13 (-170)/(-100) + (0 - (-3)/(-15)) 3/2 Calculate (-104)/(-78) + 2 + -4. -2/3 Calculate (-2)/(-7)(-63)/72. -1/4 Calculate 2/(-8)((-3)/6)/(-1). -1/8 Calculate 15/(-24)(-2)/5. 1/4 What is (54/(-108))/((1/(-3))/1)? 3/2 Calculate 2 + ((-2)/2 - 3). -2 (-1)/(-5)(11 + -6) 1 What is the value of (-6)/((-12)/6 + 3)? -6 Calculate (2 - -1)((-10)/3 - -2). -4 Calculate (0 - -4)((-75)/(-20))/(-5). -3 What is the value of 54/(-9)(-2)/(19 - 1)? 2/3 Calculate ((-4)/16)/(15/60). -3 Calculate (-3)/(1(-3 - -2)). 3 Evaluate 29 + -34 - -17. 2 What is 4/9(-13)/26? -2/9 Calculate 12/(-24) - 18/(-4). 4 Evaluate -6(10 + -4)/12. -3 Calculate (0/((-6)/(-1)))/(-3). 0 Calculate (-4)/18 - ((-532)/(-18))/(-7). 4 4 - (7/3 - (-33)/198) 3/2 What is the value of (-1)/(-5)(-1380)/(-483)? 4/7 Evaluate (-22/12)/(6/(-54)). 3 12/22 - (-1625)/(-4290) 1/6 What is the value of (6/5)/(6/20)? 4 Calculate 58/(-56) - (-3 - (-95)/35). -3/4 Evaluate (-2 - (-26)/10) + (-374)/(-85). 5 1 - (-7)/(-4) - 9143/(-6244) 5/7 What is 2/15 - (221/(-30) + 6)? 3/2 Evaluate 294/378 + (-2)/(-9). 1 Calculate (6/6)/(-1 + (-4)/(-5)). -5 What is 36/(-6)(-4)/42? 4/7 (-320)/(-120)(-9)/(-6) 4 What is the value of (-41)/(-205)4/385? 2/19 15/(360/(-32))(-3)/2 2 (-9(-3)/(-45))/(45/6) -2/25 0 + (-80)/(-36) + 2/(-9) 2 Evaluate 9 + 9/288-284. 1/8 What is (-1)/(0 + (-2)/(-4))? -2 What is the value of 2/(15/(-6 - -1))? -2/3 What is the value of 1/(-1) - 3/((-3)/5)? 4 Evaluate 4/9 + 276/(-378). -2/7 Calculate -3(12/9)/(-2). 2 0/4 + 6 + -2 4 Evaluate (6 - 7)/((-5)/(-15)). -3 0 + -3(246/63 - 4) 2/7 What is the value of (-64)/84 - 9/(-21)? -1/3 What is (-3848)/(-11396) - (0 + (-1)/11)? 3/7 Calculate 54/135 + 16/10. 2 What is 14(-6 + 176/28)? 4 1 - (3/(-4) - -3 - 2) 3/4 What is the value of 57/(-760) + 1/5? 1/8 Calculate (2 - 1-2)/(412/515). 5 What is the value of 4/35 - 2/5? -2/7 592/40 - 14 - 4/(-10) 6/5 Calculate (4/20)/(0 - (-5)/(-15)). -3/5 What is the value of ((-4 - 1)/20)/((-2)/(-6))? -3/4 Calculate 0 + -3 - 28/(-5) - 3. -2/5 Evaluate 48/(-56) + (-48)/(-7). 6 Evaluate (-2)/410/20. -1/4 What is -43/(-4) + 21/(-3)? -4 What is the value of (-42)/(-28)4/27? 2/9 (-1(7 + -5))/5 -2/5 (-150)/(-264) - (-9)/(-12) -2/11 Evaluate (-3)/(-12) + 75/20. 4 What is the value of (4 - 5)/((54/(-48))/9)? 8 Evaluate (-19)/((-133)/(-42)) - (-6 + -11). 11 What is -3-1(-2)/(-6)? 1 What is (9/(-24))/(6/(-4))? 1/4 1/(-3)(-108)/(-60) -3/5 What is (-6)/(-10)(-235)/188? -3/4 -9 + 30/6 + 3 + 0 -1 What is 3/3 - (-14)/(-16)? 1/8 Evaluate 91(-4 + 520/132). -6/11 What is the value of 14(3 + -7 + 3) - -5? -9 Calculate -6 + (6/5)/(36/120). -2 What is the value of (-10 + 15 + -6)-4? 4 What is (6/6)/((-5)/25)? -5 What is the value of 1 + 1/4 + 6/(-8)? 1/2 Calculate (0 + -1)/((-6)/(-30)). -5 What is ((-3)/((-126)/(-4)))/(2/6)? -2/7 Calculate (-22)/44 - 22/4. -6 Evaluate (-236)/168 + 2/(-21). -3/2 What is the value of (-64)/(-10) + (39/15 - 3)? 6 What is the value of (-3 - (-352)/60) + -3? -2/15 What is the value of (312/130)/((-6)/20)? -8 Calculate 277 + -287 - (-2)/2. -9 Evaluate (114/95)/((-42)/(-15) + -3). -6 ((-12)/28)/3 - (-57)/(-42) -3/2 What is the value of 2 - ((-117)/9 - -12)? 3 Evaluate -6 - (172/(-60) + -13). -2/15 What is the value of 6(-1)/(-6)(-3 - -3)? 0 (9/108-8)/(2 - 0) -1/3 96/(-54) - 3/(-54)-4 -2 Calculate (608/(-95))/(-3 + 2) + -6. 2/5 9/(-72)(-16)/6-6 -2 Evaluate (-1)/2(-20)/35. 2/7 What is (2/(-6))/(4/60)? -5 Evaluate (2 + 3 + 69/(-12))-4. 3 What is (6 + -3 - 8) + 5? 0 Calculate -2 - (9/6)/((-12)/20). 1/2 What is the value of -1(-5)/(-35)71? -1 What is the value of (-6)/(-28)(-12)/(792/(-77))? 1/4 What is 135/(-50) + 32/160? -5/2 What is 1 + ((-4)/5 - (-48)/(-15))? -3 What is the value of 21/(-2)94/(-141)? 7 What is the value of 15/35 + (8/4 - 2)? 3/7 What is the value of 3-2 - (-2400)/390? 2/13 (-10)/(-4)2/(-1) -5 What is the value of 1/(-4 + -5 + 19)? 1/10 Evaluate 20/25(-20)/8. -2 What is the value of 15/3510/15? 2/7 Calculate (-1)/(-2) + (-11)/6. -4/3 What is the value of (5 + (-4)/((-168)/(-213)))4? -2/7 What is (4 + 36/(-8) + 2)/3? 1/2 Calculate (720/(-192))/(10/(-4)). 3/2 437/380 + 10/(-8) -1/10 14/(-7) + 1 + 0 -1 Evaluate 1/(13/12 + (-8)/6). -4 6/(((-18)/7)/((-24)/42)) 4/3 What is 68/(-273) + 14/147? -2/13 Evaluate -1 + 2 + -1 + 6/63. 2/21 (-2)/5 - 143/55 -3 Calculate ((-14)/3(-18)/12)/1. 7 What is (-3 + (2 - 1))/(2618/187)? -1/7 Calculate 7 + 268/36-1. -4/9 -19 - 2/6-27 -10 Calculate ((-45)/(-25) - -4) + -6. -1/5 Calculate (3/(-7))/(4290/(-1820)). 2/11 What is (-13)/(-20) + (-10)/25? 1/4 Calculate 0/(-1 + 1 + 1 - 3). 0 Calculate ((-252)/10)/(-3) - (-237)/395. 9 What is the value of (6/5)/((-24)/(-30))-1? -3/2 Calculate ((1 - -5)/(7 + 3))/(-1). -3/5 What is 3(-11)/(99/6)-1? 2 What is (-6)/(-60)(-11 + 5)? -3/5 Calculate (20/(-4) - -5) + -1. -1 What is 20/10 - (0 + 6 + -1)? -3 Evaluate (-3015)/108 + 22 + 1/(-12). -6 Calcu	{ "pile_set_name": "DM Mathematics" }
3 + 5r*2 + r + 1. Let n(c) = 42c*2 - 14c - 2. Give 2l(s) + n(s). 2s*3 + 52s*2 - 12s Let a(w) = -w. Suppose 5l - 6 = -d - 1, d = 2l + 5. Suppose -2k - 4t + 6 = l, -6t + 5t = 3k - 14. Let g(y) = -2y. Give ka(p) - 3g(p). p Let i(g) = -5g2 - 13g + 6. Let u(h) = 5h2 + 16h - 7. Calculate -6i(c) - 5u(c). 5c2 - 2c - 1 Let y(u) = -19u2 + 115u - 16. Let d(t) = 18t2 - t - 1. Calculate -d(s) - y(s). s2 - 114s + 17 Let v(a) be the third derivative of -11a6/24 + 11a*5/10 + 11a*4/4 + 11a*3 + 168a*2 - 2a. Let j(y) = -y3 + y2 + y + 1. Determine -66j(d) + v(d). 11d*3 Let o(f) = 45f*2 + 40f. Let v(k) = k*2 + k. Suppose 5c - 5x + 580 = 0, -96c - 2x - 608 = -91c. Determine cv(l) + 3o(l). 15l2 Let t(u) = 17732372u*3 - 46130u*2 - 23065u - 23065. Let b(p) = -4613p3 + 12p*2 + 6p + 6. What is 23065b(q) + 6t(q)? -4613q3 Let c(f) = -f3. Let b(h) be the second derivative of -h5/20 + h4/12 + 1148h. Calculate 2b(t) + 6c(t). -8t3 + 2t*2 Suppose 0 = -86w - 17w - 103. Let l(m) = 3m - 4. Suppose 4 = -s - 0. Let t(f) = -f. Calculate st(h) + wl(h). h + 4 Let q(m) = -8m3 + 22m*2 - 3317m + 5. Let i(x) = 3x3 - 8x*2 + 1107x - 2. What is -11i(g) - 4q(g)? -g*3 + 1091g + 2 Let y(k) = 1300k + 165. Let x(c) = -c - 3. Determine -165x(z) - 3y(z). -3735z Let h(a) = 10a - 3. Let p(u) = -2u + 1. Let z(j) = -2h(j) - 9p(j). Let c(x) = -5x - 9. Let n = 19 + -8. Determine nz(v) - 4c(v). -2v + 3 Let v = -3635 - -3636. Let g(t) = -t + 1. Let h(q) = 29q - 5. Give vh(f) + 6g(f). 23f + 1 Let a(p) = -6p + 1. Let u(k) = 36k + 340. What is 3a(g) + u(g)? 18g + 343 Let g(s) = -6s - 7. Let p(h) = -5h - 8. Let q be -223 + 250 - (0 - -21). Give qg(v) - 7p(v). -v + 14 Let y(u) = u*2 + 6. Let g(k) = 8k*2 - 8282k + 60. Calculate g(f) - 10y(f). -2f*2 - 8282f Let z(l) = 5l2 - 7. Let r = 2393 - 2400. Let a(u) = 1 - 3u*2 - 1 + 5. Determine ra(q) - 5z(q). -4q*2 Let s(m) = -10m*2 + 8. Suppose 5u = -u - 372. Let q = 64 + u. Let g(z) = -z*2 + 21zq - 15 - z2. What is -6g(a) - 11s(a)? -4a2 + 2 Let v(b) be the third derivative of -b6/120 - b5/60 + b4/24 + 53b2 + 2. Let y(l) = l3 - 2l2 + 3l - 1. Determine -6v(n) + 2y(n). 8n3 + 2n*2 - 2 Let x(p) = -19p*2 - 3p + 5p - 14p*3 - 2 + 0 - 21p*2 + 43p*2. Let v(n) = -15n*3 + 4n*2 + 3n - 3. Calculate 2v(a) - 3x(a). 12a3 - a2 Let t = 165354 + -165353. Let o(v) = -3v*2 + 2v + 8. Let q(d) = d - 1. Let c(a) = a*2 - 4a + 2. Let i(g) = -c(g) - 3q(g). What is to(n) - 4i(n)? n2 - 2n + 4 Let h(m) be the first derivative of -m + 2. Suppose -x - 2x = 3. Suppose -1217277 = -6r - 1217271. Let b(k) = 2k - 2. Give rb(d) + xh(d). 2d - 1 Let u(n) = 69n - 11. Let r(j) = 23j - 4. Let s = -5855 - -5859. Give su(c) - 11r(c). 23c Let d(h) = 2h*3 + 3h*2 + 6h + 2. Let u(t) = 9t3 + 115284t - 115259t + 9 + 0t*2 + 13t*2. Give -26d(o) + 6u(o). 2o*3 - 6o + 2 Let x(p) = -1189p3 - 8p*2 + 8p. Let i(o) = -526726o3 - 3543o*2 + 3543o. Calculate 8i(y) - 3543x(y). -1181y3 Let n(p) = 2406p*3 - 8p*2 + 11p + 8. Let v(h) = -801h3 + 3h*2 - 4h - 3. Determine -3n(a) - 8v(a). -810a3 - a Let g(o) = -4o*2 + 5o - 22. Let l(u) = 9u2 - 13u + 42. What is -14g(q) - 6l(q)? 2q2 + 8q + 56 Let l(a) = 2124a + 26. Let v(p) = 4244p + 56. Calculate -13l(u) + 6v(u). -2148u - 2 Let i(v) = 20v*3 - 120v*2 - 22v - 29. Let p(g) = -11g3 + 62g*2 + 12g + 15. Calculate -6i(y) - 11p(y). y*3 + 38y2 + 9 Let o(t) = t3 - 9t2 - 71t + 17. Let q be o(14). Let z(f) = -f*2 - f - 1. Let l(y) = 5y*2 + 6y + 2. Determine qz(s) + l(s). 2s*2 + 3s - 1 Let k(c) = 233c + 3. Let p(b) = -33b + 1. Give 2k(z) + 14p(z). 4z + 20 Let n(c) = -11c*2 - 442c - 6. Let t(g) = 15g2 + 589g + 8. Determine 9n(p) + 7t(p). 6p2 + 145p + 2 Let o(d) = -785d3 + 9d*2. Let q(l) = 1177l*3 - 15l*2. Give -8o(c) - 5q(c). 395c*3 + 3c*2 Let x(a) = 402a3 + a2 - 2a - 3. Let i(g) = -4822g*3 - 11g*2 + 24g + 38. Give 2i(z) + 25x(z). 406z3 + 3z*2 - 2z + 1 Let l(o) = -o*2 - 3o - 3. Let t(u) be the third derivative of u5/20 + u4/3 + 3u3/2 + 975u*2. Determine -8l(d) - 3t(d). -d2 - 3 Let h(b) = -1. Let m(u) = -2u + 2. Let c(p) = -p*2 + 2p + 39. Let a be c(7). Suppose 3g + 3 = 0, -v + 6 = -6v + ag. Calculate vh(o) - m(o). 2o Suppose -5h = 20, -166 = -q + 5h - 148. Let r be (-18)/8 - (-2)/8. Let s be r3/(-1 + 7). Let t(b) = b - 2. Let m(n) = n + 1. Determine qm(y) + st(y). -3y Let z(k) be the third derivative of -k4/2 - 2k*2. Suppose 2r + 0 + 10 = 0. Let q(c) = 0 - 5 + 15 + 14c + 28c - 10. Determine rq(h) - 18z(h). 6h Let v(x) = -10x*3 + 14x*2 - 12x - 12. Let n(l) = 1 - 423l + 860l - 436l - l2. Give -12n(b) - v(b). 10b3 - 2b*2 Let l(v) = -7693v + 686. Let k(m) = 45m - 4. Determine -343k(z) - 2l(z). -49z Let n be (-16)/4 - -1 - -9. Let f(b) = -9b - 7. Let u(r) be the second derivative of 5r*3/3 + 4r*2 + 4r - 48. Give nf(p) + 5u(p). -4p - 2 Let u(t) = -141t*3 + 50t*2 + 4t. Let a(s) = -283s3 + 90s*2 + 7s. Calculate -5a(o) + 9u(o). 146o3 + o Let f(b) = 5b + 75 + 82 - 116. Let d(j) = j + 10. Determine 9d(c) - 2f(c). -c + 8 Let w(y) = 9y3 + 24y*2 + 7y + 8. Let q(n) = 2n3 + 4n*2 - n + 2. Let i(k) = 6q(k) - w(k). Let o(f) = 2f3 - 6f + 2. Calculate 3i(g) - 5o(g). -g*3 - 9g + 2 Let y(m) = -929m2 - 2m + 8. Let q(d) = 1857d2 + 5d - 18. Calculate 4q(p) + 9y(p). -933p2 + 2p Let i(c) = 7c2 + c + 5. Let l(p) be the second derivative of 3/2p*2 + 1/6p*3 + 0 + 1/3p*4 - 105p. Determine 3i(u) - 5l(u). u*2 - 2u Let f(u) = -2u3 - 3u*2 - 13u + 3. Let r(s) = -s3 - s2 - s + 1. Let j = 8774 + -8777. Determine jr(p) + f(p). p3 - 10p Let a(f) = -685f3 + 4f*2 + 2f + 3. Let b(z) = 3426z3 - 21z*2 - 11z - 15. Give 11a(d) + 2b(d). -683d3 + 2d*2 + 3 Let q(c) = -14. Let s = -11691 - -11686. Let g(x) = x + 27. Determine sq(j) - 3g(j). -3j - 11 Let z(g) = g*2. Let u be (-3 - 10/(-4))-2 - -2. Suppose -y + uy = -22. Let a = -12 - y. Let r(d) = -21d*2. Give ar(h) - 18z(h). 3h*2 Let l(k) = -8k*2 + 7k + 5. Let w be l(-1). Let t be 4/w(-285)/19. Let o(f) = 9f + 6. Let v(u) = -17u - 11. Give tv(n) + 11o(n). -3n Let l(p) = 1774696p + 15824. Let u(m) = -673m - 6. What is -6l(i) - 15824u(i)? 1376i Let r(z) = -3z*2 + 12z - 46. Let c(h) = 3h2 - 13h + 40. Give 7c(n) + 6r(n). 3n2 - 19n + 4 Let g(v) = 3v3 - 7v*2 + 8v. Let t(h) = 34h3 - 88h*2 + 94h. Calculate -25g(o) + 2t(o). -7o3 - o2 - 12o Let l(o) = -7o2 - 2o + 8. Let b(j) = 5j2 + 4j - 8. Calculate -3b(m) - 2l(m). -m*2 - 8m + 8 Let q(h) = -50h3 + 3h*2 - 76h - 7. Let t(l) = -51l3 + 4l*2 - 91l - 8. Determine -6q(r) + 5t(r). 45r3 + 2r*2 + r + 2 Let u(f) = 3f + 1 - 2f + 2. Let r be u(0). Let b(c) = -c - 5. Let a(k) be the second derivative of k3/6 + 3k*2 + k + 633. Calculate ra(o) + 4b(o). -o - 2 Let x(w) = 198w*3 + 14w*2 - 30w + 2. Let j(v) = -200v3 - 9v*2 + 30v - 1. Calculate -3j(p) - 2x(p). 204p3 - p2 - 30p - 1 Let y(f) = -10f + 0f - 1 + 9f. Let x(c) = 4c + 3. Let p be 50(-12)/552 + (84/(-92) - -1). Calculate px(s) - 6y(s). 2s + 3 Let l(b) = 104b2 + 11b + 5. Let v(u) = -17u2 - u. Calculate -l(h) - 6v(h). -2h2 - 5h - 5 Let f(s) = -5s - 6 - 5 - 7 + 17. Let p(g) be the second derivative of -3g3/2 - g2/2 + 48g. Calculate -11f(b) + 6p(b). b + 5 Let x(i) = -9i*3 - 5i*2. Let y be 150/456/4. Let l(t) = -yt2 + 2t3 - t2 + 8t2 + t2 + 3t*3. Give 5l(g) + 3x(g). -2g*3 Let x(q) = 2 - 6q + 5q + 0q. Let t = -102 + 104. Suppose 0 = 3p - b - 11 - 49, 0 = -tp + b + 39. Let j(m) = -3m + 7. Calculate px(z) - 6j(z). -3z Let h(k) = 27k + 29. Let c(a) = a - 10. Calculate -3c(p) - h(p). -30p + 1 Let z(w) = -10w - 2. Let m be (0 - 4) + 1(-2)/(-1). Let u(c) be the second derivative of -5c*3 - 7c*2/2 + 102c + 1. Determine mu(l) + 7z(l). -10l Let l(x) = 15x*3 + 15x*2 + 39x. Let v(c) =	{ "pile_set_name": "DM Mathematics" }
What is the remainder when 112868 is divided by 24? 20 Calculate the remainder when 83444 is divided by 843. 830 What is the remainder when 1363498 is divided by 674? 670 Calculate the remainder when 216130 is divided by 72020. 70 Calculate the remainder when 5883 is divided by 56. 3 What is the remainder when 160 is divided by 46? 22 Calculate the remainder when 62582 is divided by 652. 642 What is the remainder when 1200 is divided by 432? 336 What is the remainder when 17593 is divided by 1939? 142 Calculate the remainder when 978922 is divided by 347. 35 What is the remainder when 42404 is divided by 1112? 148 Calculate the remainder when 44077 is divided by 14675. 52 What is the remainder when 201511 is divided by 25? 11 Calculate the remainder when 2951 is divided by 34. 27 What is the remainder when 31007 is divided by 7750? 7 What is the remainder when 5853 is divided by 54? 21 Calculate the remainder when 6956 is divided by 1193. 991 Calculate the remainder when 331269 is divided by 337. 335 Calculate the remainder when 3443 is divided by 933. 644 Calculate the remainder when 53400 is divided by 204. 156 What is the remainder when 11926 is divided by 3784? 574 Calculate the remainder when 28024 is divided by 59. 58 Calculate the remainder when 146359 is divided by 8. 7 What is the remainder when 47452 is divided by 1233? 598 Calculate the remainder when 227 is divided by 15. 2 Calculate the remainder when 1498 is divided by 499. 1 Calculate the remainder when 7989 is divided by 726. 3 What is the remainder when 2324 is divided by 75? 74 What is the remainder when 258656 is divided by 19892? 60 Calculate the remainder when 2553 is divided by 170. 3 What is the remainder when 3119 is divided by 1788? 1331 Calculate the remainder when 4753 is divided by 281. 257 What is the remainder when 566 is divided by 280? 6 Calculate the remainder when 429 is divided by 398. 31 What is the remainder when 64946 is divided by 9271? 49 Calculate the remainder when 43279 is divided by 72. 7 Calculate the remainder when 27296 is divided by 13643. 10 Calculate the remainder when 169839 is divided by 86. 75 What is the remainder when 1055463 is divided by 176? 167 What is the remainder when 4671 is divided by 353? 82 Calculate the remainder when 1040 is divided by 233. 108 What is the remainder when 105234 is divided by 35? 24 What is the remainder when 30702 is divided by 62? 12 What is the remainder when 6743 is divided by 1109? 89 What is the remainder when 8581 is divided by 2361? 1498 Calculate the remainder when 544752 is divided by 4696. 16 Calculate the remainder when 12988 is divided by 183. 178 What is the remainder when 5152 is divided by 1993? 1166 Calculate the remainder when 111820 is divided by 148. 80 Calculate the remainder when 123022 is divided by 466. 464 What is the remainder when 8345 is divided by 1773? 1253 What is the remainder when 7956 is divided by 42? 18 What is the remainder when 865979 is divided by 849? 848 Calculate the remainder when 287507 is divided by 194. 193 What is the remainder when 781430 is divided by 139? 111 What is the remainder when 1394931 is divided by 4? 3 What is the remainder when 21630 is divided by 21621? 9 Calculate the remainder when 1393 is divided by 856. 537 What is the remainder when 210900 is divided by 105444? 12 Calculate the remainder when 1734 is divided by 854. 26 Calculate the remainder when 615885 is divided by 16. 13 What is the remainder when 14142 is divided by 272? 270 Calculate the remainder when 13172 is divided by 12. 8 Calculate the remainder when 5214 is divided by 2029. 1156 What is the remainder when 317543 is divided by 42? 23 Calculate the remainder when 4110 is divided by 1689. 732 Calculate the remainder when 40973 is divided by 13421. 710 Calculate the remainder when 32347 is divided by 5390. 7 What is the remainder when 292032 is divided by 649? 631 What is the remainder when 64720 is divided by 9245? 5 Calculate the remainder when 1916 is divided by 388. 364 Calculate the remainder when 48680 is divided by 123. 95 Calculate the remainder when 5235 is divided by 4598. 637 Calculate the remainder when 91976 is divided by 44. 16 Calculate the remainder when 4232 is divided by 1119. 875 What is the remainder when 822 is divided by 210? 192 Calculate the remainder when 49033 is divided by 15. 13 What is the remainder when 94831 is divided by 1042? 9 Calculate the remainder when 30906 is divided by 10302. 0 What is the remainder when 47422 is divided by 398? 60 Calculate the remainder when 52772 is divided by 840. 692 Calculate the remainder when 6429 is divided by 209. 159 Calculate the remainder when 22702 is divided by 398. 16 Calculate the remainder when 33542 is divided by 16766. 10 Calculate the remainder when 10792 is divided by 680. 592 Calculate the remainder when 7582 is divided by 111. 34 Calculate the remainder when 2452 is divided by 430. 302 What is the remainder when 36084 is divided by 347? 343 What is the remainder when 3436 is divided by 1703? 30 Calculate the remainder when 12934 is divided by 21. 19 What is the remainder when 81297 is divided by 100? 97 What is the remainder when 26181 is divided by 194? 185 Calculate the remainder when 55394 is divided by 486. 476 What is the remainder when 158125 is divided by 48? 13 What is the remainder when 42202 is divided by 18? 10 Calculate the remainder when 10115 is divided by 121. 72 Calculate the remainder when 528314 is divided by 1964. 1962 Calculate the remainder when 65828 is divided by 65825. 3 What is the remainder when 36968 is divided by 5278? 22 What is the remainder when 56691 is divided by 603? 9 Calculate the remainder when 2081 is divided by 558. 407 Calculate the remainder when 1183 is divided by 372. 67 What is the remainder when 5370691 is divided by 12? 7 What is the remainder when 18436 is divided by 129? 118 What is the remainder when 546678 is divided by 447? 444 Calculate the remainder when 73613 is divided by 48. 29 Calculate the remainder when 4888 is divided by 176. 136 Calculate the remainder when 44747 is divided by 91. 66 Calculate the remainder when 4304 is divided by 309. 287 Calculate the remainder when 23147 is divided by 162. 143 Calculate the remainder when 16539 is divided by 126. 33 What is the remainder when 28780 is divided by 7185? 40 What is the remainder when 9070 is divided by 36? 34 What is the remainder when 10151 is divided by 10151? 0 What is the remainder when 1079 is divided by 1066? 13 What is the remainder when 62687 is divided by 139? 137 Calculate the remainder when 109655 is divided by 352. 183 Calculate the remainder when 33146 is divided by 25. 21 What is the remainder when 172128 is divided by 317? 314 Calculate the remainder when 4316 is divided by 1434. 14 What is the remainder when 13765 is divided by 314? 263 What is the remainder when 62699 is divided by 196? 175 What is the remainder when 25586 is divided by 12786? 14 Calculate the remainder when 83378 is divided by 1389. 38 Calculate the remainder when 23445 is divided by 720. 405 Calculate the remainder when 4993 is divided by 85. 63 Calculate the remainder when 8126 is divided by 810. 26 What is the remainder when 5294 is divided by 30? 14 What is the remainder when 3592592 is divided by 153? 152 What is the remainder when 669739 is divided by 257? 254 Calculate the remainder when 59043 is divided by 22. 17 Calculate the remainder when 11614 is divided by 399. 43 What is the remainder when 1004 is divided by 165? 14 Calculate the remainder when 20724 is divided by 49. 46 What is the remainder when 209799 is divided by 50? 49 Calculate the remainder when 211858 is divided by 90. 88 Calculate the remainder when 1893826 is divided by 89. 84 Calculate the remainder when 90739 is divided by 349. 348 What is the remainder when 26303 is divided by 79? 75 Calculate the remainder when 20250 is divided by 28. 6 Calculate the remainder when 172753 is divided by 250. 3 Calculate the remainder when 93324 is divided by 791. 777 What is the remainder when 17303 is divided by 56? 55 Calculate the remainder when 54554 is divided by 925. 904 What is the remainder when 5357972 is divided by 175? 172 Calculate the	{ "pile_set_name": "DM Mathematics" }
rob of sequence nkkn when four letters picked without replacement from kkknnnknnknnn? 28/429 Calculate prob of sequence wb when two letters picked without replacement from {a: 3, c: 2, j: 1, w: 2, b: 6}. 6/91 What is prob of sequence aa when two letters picked without replacement from {a: 6}? 1 What is prob of sequence uu when two letters picked without replacement from {o: 1, x: 4, l: 1, u: 2}? 1/28 What is prob of sequence efv when three letters picked without replacement from {b: 1, e: 1, v: 1, f: 1, s: 5, c: 4}? 1/1716 Three letters picked without replacement from iiiiitiiiiiiiiiiiti. Give prob of sequence iti. 16/171 What is prob of sequence tdtt when four letters picked without replacement from {d: 6, t: 13}? 143/1292 What is prob of sequence nd when two letters picked without replacement from {l: 4, c: 2, e: 1, d: 2, g: 2, n: 1}? 1/66 Two letters picked without replacement from phu. What is prob of sequence up? 1/6 What is prob of sequence gk when two letters picked without replacement from {g: 1, q: 3, f: 2, k: 1}? 1/42 Three letters picked without replacement from {l: 3, g: 3, i: 4, x: 2, e: 7}. What is prob of sequence gxg? 2/969 Two letters picked without replacement from {g: 2, v: 9}. Give prob of sequence gg. 1/55 Calculate prob of sequence zz when two letters picked without replacement from {z: 2, m: 3, d: 4, i: 2, j: 2, h: 1}. 1/91 Three letters picked without replacement from {a: 1, j: 5, z: 2, s: 4, n: 2}. What is prob of sequence zza? 1/1092 Three letters picked without replacement from bgeeecgggeg. What is prob of sequence cgg? 2/99 Two letters picked without replacement from {u: 3, y: 1, r: 2, d: 1}. What is prob of sequence rd? 1/21 Four letters picked without replacement from iwaawiawiwwaw. What is prob of sequence iwia? 6/715 What is prob of sequence lll when three letters picked without replacement from {m: 11, l: 5}? 1/56 Calculate prob of sequence ozzo when four letters picked without replacement from {z: 4, o: 3}. 3/35 What is prob of sequence cnc when three letters picked without replacement from {p: 1, n: 1, c: 14}? 13/240 Calculate prob of sequence dsdi when four letters picked without replacement from psdsssddsssfisvifs. 1/680 Calculate prob of sequence tt when two letters picked without replacement from tttttxtxtt. 28/45 What is prob of sequence djd when three letters picked without replacement from ddjdjddjddjddjjddd? 11/68 Two letters picked without replacement from pjpkiklijpjppjkcjpik. What is prob of sequence jk? 1/19 Two letters picked without replacement from {z: 1, l: 1, c: 1}. Give prob of sequence lc. 1/6 What is prob of sequence xnru when four letters picked without replacement from {r: 1, x: 1, h: 1, u: 1, n: 1}? 1/120 What is prob of sequence qq when two letters picked without replacement from bqqbbbqbbbbqbb? 6/91 Four letters picked without replacement from {c: 7, t: 4, e: 6}. Give prob of sequence etce. 1/68 What is prob of sequence pu when two letters picked without replacement from xpupxpufuuxztxupfxp? 25/342 Calculate prob of sequence rr when two letters picked without replacement from {u: 5, e: 4, i: 4, r: 2}. 1/105 What is prob of sequence it when two letters picked without replacement from trtwii? 2/15 Two letters picked without replacement from fxwnfdfxiwdw. Give prob of sequence ww. 1/22 What is prob of sequence hsh when three letters picked without replacement from shhhhhshhhh? 8/55 Four letters picked without replacement from cqccaaca. What is prob of sequence caqc? 3/140 What is prob of sequence efk when three letters picked without replacement from {k: 2, y: 2, e: 4, l: 1, f: 3}? 1/55 Two letters picked without replacement from ddcco. Give prob of sequence dc. 1/5 Four letters picked without replacement from {c: 9}. What is prob of sequence cccc? 1 Four letters picked without replacement from {a: 2, b: 5, i: 4, o: 4}. What is prob of sequence iibb? 2/273 Two letters picked without replacement from qovoovvvqvoqvqvv. What is prob of sequence qq? 1/20 Calculate prob of sequence mq when two letters picked without replacement from qhm. 1/6 Two letters picked without replacement from ddjhdddjh. What is prob of sequence jd? 5/36 Two letters picked without replacement from {z: 5, p: 4, a: 1, o: 3, c: 1}. What is prob of sequence oz? 15/182 Three letters picked without replacement from {g: 2, v: 4, z: 4}. What is prob of sequence gvv? 1/30 Two letters picked without replacement from viihhd. Give prob of sequence ii. 1/15 What is prob of sequence ww when two letters picked without replacement from {w: 2, f: 2}? 1/6 What is prob of sequence tf when two letters picked without replacement from flffltoftfof? 1/11 Two letters picked without replacement from {z: 4, b: 2, m: 1, w: 7}. Give prob of sequence mb. 1/91 Three letters picked without replacement from rnomk. Give prob of sequence mrn. 1/60 Four letters picked without replacement from ycysccyccjycccyy. What is prob of sequence cscc? 1/130 Calculate prob of sequence bvtt when four letters picked without replacement from zytttbzvt. 1/252 Calculate prob of sequence lcl when three letters picked without replacement from cnlncccnlyn. 4/495 Four letters picked without replacement from qoqoioq. Give prob of sequence ioiq. 0 Three letters picked without replacement from {t: 18, m: 2}. What is prob of sequence ttm? 17/190 What is prob of sequence ho when two letters picked without replacement from {e: 4, f: 1, o: 2, h: 1}? 1/28 Three letters picked without replacement from {h: 4, i: 2, o: 2, g: 2}. What is prob of sequence oog? 1/180 What is prob of sequence qsel when four letters picked without replacement from {e: 1, s: 1, l: 3, j: 2, q: 2, m: 6}? 1/5460 What is prob of sequence qqrr when four letters picked without replacement from rqqrrrrqqq? 5/63 Three letters picked without replacement from {x: 4, m: 1, t: 2, i: 3}. What is prob of sequence xtm? 1/90 Calculate prob of sequence vvbt when four letters picked without replacement from btvtbttbtbbtbtvtvvbb. 32/4845 What is prob of sequence ff when two letters picked without replacement from {f: 16, i: 2}? 40/51 Two letters picked without replacement from {a: 3, f: 1, b: 1, r: 2, s: 11}. What is prob of sequence ba? 1/102 What is prob of sequence yee when three letters picked without replacement from leely? 1/30 Calculate prob of sequence nghn when four letters picked without replacement from nnnhnnnnnngggnn. 11/1092 Calculate prob of sequence acy when three letters picked without replacement from cyeyyayceyesyse. 2/455 Three letters picked without replacement from {l: 1, f: 1, g: 6, y: 1}. Give prob of sequence fgy. 1/84 Four letters picked without replacement from idiiiiiiiizidiiii. What is prob of sequence ddiz? 1/2040 What is prob of sequence lil when three letters picked without replacement from {l: 2, i: 2}? 1/6 What is prob of sequence qww when three letters picked without replacement from {n: 2, q: 8, w: 2, c: 1, k: 2}? 8/1365 Four letters picked without replacement from {d: 4, v: 3, s: 5}. Give prob of sequence vvdv. 1/495 What is prob of sequence cszc when four letters picked without replacement from {z: 1, p: 2, m: 1, x: 2, s: 1, c: 2}? 1/1512 Two letters picked without replacement from xhlllllxhxhxxhrx. What is prob of sequence rx? 1/40 Four letters picked without replacement from tttttotoot. What is prob of sequence ooot? 1/120 Three letters picked without replacement from {z: 1, v: 2, i: 1, e: 2, c: 1, d: 1}. Give prob of sequence dzi. 1/336 Three letters picked without replacement from {b: 6}. What is prob of sequence bbb? 1 Four letters picked without replacement from nxxttxxxt. What is prob of sequence ttxt? 5/504 Calculate prob of sequence kpk when three letters picked without replacement from {x: 11, p: 4, k: 4}. 8/969 Calculate prob of sequence nss when three letters picked without replacement from {r: 2, n: 3, s: 7, f: 7}. 7/323 Calculate prob of sequence vw when two letters picked without replacement from hwjvjvjjjjvjvv. 5/182 Two letters picked without replacement from {g: 3, o: 3, t: 2}. Give prob of sequence og. 9/56 Four letters picked without replacement from qygyqqqyyyqyyyqqyyqy. What is prob of sequence yygq? 22/2907 Two letters picked without replacement from ooosujaxx	{ "pile_set_name": "DM Mathematics" }
ed without replacement from {k: 2, z: 4, u: 1, v: 3, t: 1}. 1/55 Four letters picked without replacement from {y: 5, z: 4, c: 3, o: 1}. Give prob of picking 2 c and 2 z. 18/715 Three letters picked without replacement from {u: 7, q: 4, w: 7}. Give prob of picking 1 q and 2 w. 7/68 What is prob of picking 2 f when two letters picked without replacement from {f: 9, i: 2}? 36/55 What is prob of picking 1 q, 1 v, and 2 m when four letters picked without replacement from {p: 3, q: 3, v: 2, e: 2, m: 3}? 18/715 Two letters picked without replacement from xexxexxexxxexxexue. Give prob of picking 1 u and 1 x. 11/153 Calculate prob of picking 1 i and 1 t when two letters picked without replacement from {q: 2, i: 6, t: 2, w: 8}. 4/51 Four letters picked without replacement from {r: 1, y: 11}. Give prob of picking 1 r and 3 y. 1/3 Calculate prob of picking 3 i when three letters picked without replacement from lciiiilliiliillilll. 28/323 Calculate prob of picking 1 b, 1 p, and 1 j when three letters picked without replacement from ppbsbppbjb. 2/15 Four letters picked without replacement from {a: 2, b: 1, p: 1, v: 4, z: 2, e: 5}. What is prob of picking 1 b, 2 z, and 1 p? 1/1365 Calculate prob of picking 2 i and 2 s when four letters picked without replacement from sssssisssis. 6/55 Two letters picked without replacement from {z: 7, x: 1}. What is prob of picking 2 z? 3/4 Calculate prob of picking 2 h and 1 i when three letters picked without replacement from iiivhhiiii. 7/120 Three letters picked without replacement from njnnnjjjjjjnjjjjnjj. Give prob of picking 1 j and 2 n. 65/323 Two letters picked without replacement from iiiiiiiuiiiiuiiiiii. Give prob of picking 2 u. 1/171 Two letters picked without replacement from jwfwgjgfwwjwwgww. Give prob of picking 2 w. 7/30 Calculate prob of picking 2 i when two letters picked without replacement from isxsib. 1/15 Four letters picked without replacement from {y: 7, b: 1, z: 2}. Give prob of picking 1 z, 1 b, and 2 y. 1/5 Three letters picked without replacement from uauuavvwuuaawvauw. What is prob of picking 1 w and 2 v? 9/680 Two letters picked without replacement from {q: 1, s: 1, x: 1, m: 1, h: 2, d: 1}. What is prob of picking 1 d and 1 h? 2/21 Calculate prob of picking 2 a, 1 i, and 1 p when four letters picked without replacement from {a: 3, i: 1, p: 1, j: 2}. 3/35 Calculate prob of picking 1 w, 1 g, and 1 k when three letters picked without replacement from {w: 4, g: 3, k: 4}. 16/55 Two letters picked without replacement from {m: 13, i: 2, c: 1, r: 3, v: 1}. Give prob of picking 2 i. 1/190 What is prob of picking 1 r and 2 k when three letters picked without replacement from rrkvkrvrrkkkrrkkvrr? 63/323 Four letters picked without replacement from ffvveettthhtee. Give prob of picking 1 v, 1 t, and 2 f. 8/1001 Calculate prob of picking 1 h and 1 n when two letters picked without replacement from {n: 1, h: 1, u: 1, w: 1, y: 2, q: 1}. 1/21 Three letters picked without replacement from {w: 3, b: 2, t: 1, m: 3, g: 1, e: 2}. What is prob of picking 1 m, 1 e, and 1 b? 3/55 Four letters picked without replacement from {s: 4, b: 4, y: 7, t: 1, u: 4}. What is prob of picking 1 u, 1 y, and 2 s? 56/1615 Calculate prob of picking 2 p and 1 c when three letters picked without replacement from {r: 4, p: 3, c: 2}. 1/14 What is prob of picking 2 k when two letters picked without replacement from {k: 4, n: 3, i: 4, m: 1, r: 1}? 1/13 What is prob of picking 4 a when four letters picked without replacement from {a: 1, g: 3, z: 1, v: 5, l: 1}? 0 What is prob of picking 2 z and 1 w when three letters picked without replacement from zwzwzzzzz? 1/2 Two letters picked without replacement from googogdgddoooogo. Give prob of picking 2 o. 7/30 What is prob of picking 1 k and 2 y when three letters picked without replacement from kpymkmkykyy? 8/55 What is prob of picking 1 v and 1 a when two letters picked without replacement from ayayayayyyyyayyyyvyy? 1/38 Calculate prob of picking 1 z and 1 a when two letters picked without replacement from {a: 11, z: 1}. 1/6 Calculate prob of picking 1 e and 3 q when four letters picked without replacement from {t: 6, q: 3, e: 4, c: 2}. 4/1365 What is prob of picking 1 e, 2 d, and 1 p when four letters picked without replacement from {w: 1, e: 5, d: 7, c: 1, p: 1, b: 2}? 3/68 Calculate prob of picking 1 j and 1 y when two letters picked without replacement from {j: 2, g: 4, i: 5, a: 1, y: 2}. 4/91 Four letters picked without replacement from yffdgzyfgfzyuug. What is prob of picking 3 f and 1 z? 8/1365 Calculate prob of picking 1 m and 2 a when three letters picked without replacement from aggmaaggmg. 1/20 Two letters picked without replacement from {e: 1, i: 7, a: 1, g: 4}. What is prob of picking 1 i and 1 g? 14/39 Calculate prob of picking 4 n when four letters picked without replacement from {n: 6}. 1 Calculate prob of picking 2 c when two letters picked without replacement from {p: 3, c: 4, q: 1}. 3/14 Four letters picked without replacement from {g: 2, h: 18}. What is prob of picking 4 h? 12/19 Calculate prob of picking 1 i and 1 c when two letters picked without replacement from {c: 2, i: 1, x: 3, a: 9, g: 2}. 1/68 Four letters picked without replacement from {i: 1, b: 2, l: 2}. Give prob of picking 2 l, 1 b, and 1 i. 2/5 Three letters picked without replacement from {d: 2, w: 10}. What is prob of picking 1 d and 2 w? 9/22 Two letters picked without replacement from abkeeekeeeaeebbbbmee. What is prob of picking 1 k and 1 a? 2/95 Calculate prob of picking 1 m and 3 y when four letters picked without replacement from {y: 3, z: 4, m: 1}. 1/70 Three letters picked without replacement from {e: 7, b: 5}. Give prob of picking 2 e and 1 b. 21/44 Calculate prob of picking 1 n and 3 t when four letters picked without replacement from tttttttnttttttttnttt. 32/95 What is prob of picking 2 i when two letters picked without replacement from tisitiiiiitit? 14/39 Calculate prob of picking 2 c, 1 i, and 1 a when four letters picked without replacement from accwaiz. 2/35 Two letters picked without replacement from wpwwqipiqwpppwqy. What is prob of picking 2 q? 1/40 What is prob of picking 3 r when three letters picked without replacement from {o: 6, a: 1, r: 8}? 8/65 Three letters picked without replacement from fssoswlfscssfsssocws. What is prob of picking 1 w and 2 s? 3/38 Calculate prob of picking 1 h, 1 d, and 1 x when three letters picked without replacement from dxxh. 1/2 Three letters picked without replacement from {e: 3, l: 2, m: 2, b: 4}. Give prob of picking 2 l and 1 e. 1/55 Calculate prob of picking 1 j and 1 f when two letters picked without replacement from mpfjdmjd. 1/14 What is prob of picking 3 i when three letters picked without replacement from iuiiiiui? 5/14 What is prob of picking 1 c and 1 t when two letters picked without replacement from cttthhhhtttghttc? 2/15 Two letters picked without replacement from rqqrwqwqqqrq. Give prob of picking 2 q. 7/22 What is prob of picking 1 x and 1 p when two letters picked without replacement from {p: 1, x: 13, l: 1}? 13/105 Calculate prob of picking 2 i and 1 z when three letters picked without replacement from yiimizily. 1/14 Two letters picked without replacement from {z: 6, x: 2, v: 9}. What is prob of picking 2 v? 9/34 Two letters picked without replacement from {i: 1, b: 4, e: 1, j: 4, u: 1}. What is prob of picking 1 i and 1 u? 1/55 What is prob of picking 2 b and 1 f when three letters picked without replacement from lfljllllljlbbjlj? 1/560 Calculate prob of picking 1 w, 1 s, and 1 g when three letters picked without replacement from {s: 2, k: 1, w: 2, e: 1, u: 3, g: 6}. 24/455 Calculate prob of picking 1 x, 1 y, and 1 i when three letters picked without replacement from liilbyxiixlylx. 6/91 Two letters picked without replacement from stbbaqbqbaqqtbqa. Give prob of picking 1 t and 1 a. 1/20 What is prob of picking 4 x when four letters picked without replacement from xxxxxxxoxxxoxo? 30/91 Three letters picked without replacement from {g: 4, e: 3, c: 5}. Give prob of picking 1 g and 2 c. 2/11 What is prob of picking 2 c when two letters picked without replacement from zziiccijcitiiccct? 15/136 Four letters picked without replacement from i	{ "pile_set_name": "DM Mathematics" }
4. Let r(h) be the first derivative of h*4/4 + 2h*3 + 19. Calculate the remainder when r(-3) is divided by p(6). 7 Suppose -25169 = -79r - 65r + 69151. Calculate the remainder when r is divided by 109. 1 Let v(o) = 18o + 126. Let s be v(-7). Suppose j - 2f + 56 = 113, -3f = s. Let t = -11 + 42. Calculate the remainder when j is divided by t. 26 Let j be 0/(-1(3 + -2)). Suppose 15m - 345 = -jm. Let x = 14 - 11. Calculate the remainder when m is divided by x. 2 Let u(m) = -3m*3 - 64m*2 + 42m - 13. What is the remainder when u(-22) is divided by 2(2 - (-14)/4)? 9 Suppose -32t - 491 = -c, -5t + 2848 - 723 = 5c. Calculate the remainder when c is divided by 137. 16 Suppose 5c - 26 = -3h, -44h + 49h = c + 6. Suppose -ht + 44 = -3u, -33 = -3t + 4u + 33. What is the remainder when 43 is divided by t? 21 Suppose -i + 3y + 8 + 10 = 0, -5y - 13 = 4i. Let x = -173387 - -173679. Calculate the remainder when x is divided by i. 1 Suppose 3p = -x + 1400, -16p - 7096 = -5x - 19p. What is the remainder when x is divided by 34? 30 Suppose -2441 - 199 = -176m. Suppose 2 = -4o + 18, -5y = 4o - 526. Calculate the remainder when y is divided by m. 12 Suppose 435 = -2u + 5i, -5u + 5i = 1722 - 672. Let v = 254 + u. What is the remainder when 186 is divided by v? 39 Let j(a) = -7a2 - 59 + a3 + 58 + 2a2 + 0a*3 + 7a. Let q be j(5). Suppose -qb + 35 = -29b. Calculate the remainder when 13 is divided by b. 6 Let k = 19290 - 11274. Calculate the remainder when k is divided by 243. 240 Suppose 3l = 2x, 4x - 4l = -0l - 4. Suppose 4o - 31 - 61 = 0. What is the remainder when (-2)/x-6 + 86 is divided by o? 13 Suppose 0 = 10k - 16k + 198. Let z(v) = -v2 + 17v*2 + 7 - 6v - 11v2. What is the remainder when z(-5) is divided by k? 30 Suppose -3s - 8n + 3n = -230, -s + 88 = -4n. Suppose 1205 = 60t + 79t - 1992. What is the remainder when s is divided by t? 11 Let b be 2/12 + 1298/(-12). Let n = -51 - b. Let s = 3169 + -3139. What is the remainder when n is divided by s? 27 Let i = 6886 + -6649. Calculate the remainder when i is divided by 73. 18 Let b(x) = -x3 + 49x*2 - 78x - 156. What is the remainder when 1207 is divided by b(47)? 15 Let i = -12035 + 14668. Calculate the remainder when i is divided by 164. 9 Let k(j) = 220j - 138. What is the remainder when 324 is divided by k(1)? 78 Let o be 4462/8 - 33/44. Suppose 4w = -2z + 760, -3w + 7z + o = 2z. What is the remainder when w is divided by 24? 21 Suppose 5d + 3h = 681, -10h - 278 = -2d - 14h. What is the remainder when 64 is divided by (-3 - d/(-25))/(-2)-5? 4 Let q(d) = -5d - 1. Let x(r) = -39r + 243. What is the remainder when x(5) is divided by q(-3)? 6 What is the remainder when -4 + 3((-2320)/(-6) - 28/(-14)) is divided by 32? 10 Let j be -66/(-9) + -36. Let d = j + 38. What is the remainder when (d/(-15))/(10/(-100)) is divided by 2? 0 Let l = 1969 + -1676. What is the remainder when l is divided by 148? 145 Let b(q) = -22q3 - 13q*2 - 19q + 14. Let l be b(-7). Suppose 4d + l = 53d. What is the remainder when d is divided by 21? 18 Let b be (-3)/6 + (-9)/(-18). Suppose b = -6l + l + 270. Suppose 2m = -0m + 38. What is the remainder when l is divided by m? 16 Suppose -6192 = -26n + 32n. Calculate the remainder when n/16(-24)/9 is divided by 58. 56 Suppose 20 - 16 = -u. What is the remainder when 70 is divided by 4 - (-4 - (u - -2))4? 10 Let b be 5/20 + (317/(-4) - -3). Calculate the remainder when 473 is divided by (-5)/1 + 149 + b. 65 Let d(z) = 39z*2 + 83z - 253. What is the remainder when d(4) is divided by 115? 13 Let r(k) = 9k + 7. Let s = 53101 - 53069. Calculate the remainder when r(6) is divided by s. 29 Suppose 0c - 2c = -24. Let l(m) = 37 - 8m + 33m - 14m - cm. Calculate the remainder when l(9) is divided by 9. 1 Suppose -10m + 1128 = 928. What is the remainder when 477 is divided by m? 17 Let d(b) = b*2 + 21b - 44. Let c be d(-23). Suppose 5q - 6 = cq, 54 = 2m - 3q. Suppose -6o + 356 = -2o. Calculate the remainder when o is divided by m. 29 Suppose -64 = -12a - 4. Suppose -a = 3u - 41. Suppose 3l - ul = -99. Calculate the remainder when l is divided by 4. 3 Let o be (-4)/10 + ((-213)/5 - 5). Let a = o + 191. Let h = -58 + a. What is the remainder when h is divided by 15? 10 Let g = 740 + 138. Calculate the remainder when g is divided by 221. 215 Suppose -3o - 35 = -4f - 6, o - 22 = -5f. Suppose -3v - 8u + fu + 42 = 0, 3u = 4v - 91. Calculate the remainder when 31 is divided by v. 12 Let p(l) = 133l + 538. What is the remainder when 1563 is divided by p(-4)? 3 Suppose -116r + 3348 + 6052 = -22r. What is the remainder when 205 is divided by r? 5 Suppose 6v = 2v - 3w + 37, -2v + 21 = -w. Calculate the remainder when 203 is divided by v. 3 Let y be -3 - -239(-1 + 2). Suppose 22g = 138 + y. What is the remainder when 34 is divided by g? 0 Let z(c) = 4c + 30. Let g be z(-7). Suppose 6 = 2x - g. Suppose 4i = -j + 26, 4i - 10 = i + xj. What is the remainder when 22 is divided by i? 4 Let f be 348/(-9)(0 + 3) - 4. What is the remainder when 697 is divided by (-34)/(-10) + -3 + (-3312)/f? 25 Let q be (-3 - 6)/(1/2 - 2). Let u = 50 + -27. What is the remainder when u is divided by 3/(q/(-54)-3)? 5 Let c be ((-2)/(-4))/(1/(-20)). Calculate the remainder when ((-24)/15)/(1/c) is divided by 9. 7 Let y = 166 - 224. Let g = -41 - y. What is the remainder when 83 is divided by g? 15 Let v(u) = -328u + 3105. Calculate the remainder when v(8) is divided by 108. 49 Suppose 0 = 2u + m + 3m - 4, 5m = -2u + 3. Suppose -uz - 18 = -46. Suppose 0 = 18j - 38j + 1200. Calculate the remainder when j is divided by z. 4 Suppose -159u = -163u - 2a + 1150, -a - 2549 = -9u. Calculate the remainder when u is divided by 50. 34 Let l(x) be the first derivative of 21 + 11x - 15/2x2. What is the remainder when l(-13) is divided by 52? 50 Let q(z) = z3 + 10z2 - 34. Let k be q(-11). Let s = k - -198. What is the remainder when s is divided by 9? 7 Suppose 7v - 2v = 80. Suppose 0 = 2i + w - 165, -2i + 499w = 495w - 130. What is the remainder when i is divided by v? 15 Suppose 3i = -h + 25, 28 + 22 = 2h + i. Suppose -hf = -19f - 624. Calculate the remainder when f is divided by 16. 8 Let u(v) = 7v - 212. Calculate the remainder when u(31) is divided by 4. 1 Let b(t) = t*3 + 3t*2 - 6t + 8. Let p = 74 - 68. Suppose -3j - 3m - 9 - p = 0, 5j + 18 = 2m. Calculate the remainder when 26 is divided by b(j). 10 Suppose 19p + 260 = 29p. What is the remainder when p is divided by 9? 8 Let a(w) = -21w - 427. What is the remainder when 187 is divided by a(-21)? 5 Suppose 5y + 0m = -4m - 5, y - 5m = 28. Let g(f) = -39 + 32 - 12 - yf. What is the remainder when g(-20) is divided by 21? 20 Suppose 4x + 49 = -3q + 290, 5q = 3x + 421. Calculate the remainder when q is divided by 20. 3 Let z(k) = 200k3 - k + 543. Suppose 0 = 5x - 15, 3v + 114 = 6v + 4x. Calculate the remainder when z(0) is divided by v. 33 Suppose 0 = l - 2l + 90. Suppose -471 = -61d + 64d. Let t = d - -203. Calculate the remainder when l is divided by t. 44 Let z = -5977 - -6154. What is the remainder when z is divided by 17? 7 Suppose -m + 2m + 8 = 3v, 3m = -3v. Suppose -5s + q + 48 = -vq, 2s - 17 = -q. Calculate the remainder when (-28 - -3)/((6/(-3))/2) is divided by s. 7 Suppose 37j - 136 = 20j. Let c = -229 + 276. Calculate the remainder when c is divided by j. 7 Let t(o) = -12o*3 - 50o*2 + 2o + 10. What is the remainder when t(-5) is divided by 4? 2 Let t(z) = 9z2 - 7z + 2. Let i be t(1). Suppose 3u + 375 = -4o, -5o + 0u = -iu + 430. Let q = o - -95. What is the remainder when 31 is divided by q? 1 Suppose -o + 3n - 250 = 0, 1196 = -7o + 2o - 3n. Let v = o - -257. What is the remainder when 142 is divided by v? 14 Suppose 3l = 1106 + 145. What is the remainder when l is divided by ((-2835)/28)/(-5) + (-2 - 33/(-12))? 18 Let k(i) = i*3 + 12i*2 + 8i. What is the remainder when 1 + (1188/(-55))/(10/(-75)) is divided by k(-11)? 31 Let m = -29 + 84. Let y be 3(-5)/302. What is the remainder when m is divided by (210 + -206)*(3 - (0 - y))? 7 Let w(r	{ "pile_set_name": "DM Mathematics" }
4c. Let q be -15 - (-70)/(-7)-1. Calculate n(q). -30 Let p(w) be the second derivative of -w*3/6 - 7w*2/2 - 70w. What is p(0)? -7 Let i(r) be the third derivative of r4/24 - r3/6 - 3r2. Let a(k) = -7k + 13. Let v(s) = a(s) + 6i(s). Let b(g) = g - 2. Let t be b(5). Determine v(t). 4 Let a(i) = i3 + i2 - i. Suppose -5t - 2c - 2c + 16 = 0, 0 = 2t + 4c - 4. Suppose -4q = -2q - 2, -tq = -5k + 1. Determine a(k). 1 Let y(l) = l + 16. Let t(r) = 2r + 30. Let n(c) = -3t(c) + 5y(c). What is n(-5)? -5 Let g(r) = -7r*3 + 5r*2 - 3r - 9. Let m(k) = -15k3 + 11k*2 - 7k - 19. Let a(q) = 13g(q) - 6m(q). Calculate a(2). -9 Let w(u) = -3u + 4. Let s(l) = -1. Let f(i) = -s(i) + w(i). Let j be f(3). Let q(o) = o2 + o - 3. Determine q(j). 9 Suppose -3u + 8u = 130. Suppose uf - 21f = 10. Let t(i) = i3 - 2i*2 + 1. Calculate t(f). 1 Let v = 35 - 28. Suppose -2n - 2n + v = -m, -4m + 17 = -n. Let c(s) = 1 + 4 + s + 0 - n. Determine c(5). 7 Let d(j) = 5j + 0 - 8j - 2. Let f(z) = -2z3 + z2 + 3z - 1. Let a be f(2). Let i(o) = -5o - 5. Let b(p) = ad(p) + 3i(p). Calculate b(-2). -13 Suppose -s + 15 = -4z + 8, 4s = -5z - 14. Let q(j) = -j + 3. Determine q(z). 5 Suppose -n - 5q = 20, -2q = 2n - 5q + 1. Let j(l) = l*2 + 4l. What is j(n)? 5 Let g = -978 + 966. Let i(z) = z + 5. Determine i(g). -7 Let l(d) = 3d + 15. Let t(c) = -13c - 62. Let o(a) = 9l(a) + 2t(a). Let x be (-1)/(-1)9/3. Suppose 3b + b = -xr - 9, -b + 5r - 31 = 0. What is o(b)? 5 Let i(s) = -41 - s*2 + 87 - 47. Let k(d) = -2d*2 + 7d - 3. Let b(g) = -3i(g) + k(g). Give b(-5). -10 Let i(b) = -25 - 4b*2 + 5b*2 + 24 + 6b3 - b3. Let j(a) = a*3 + 4a*2 - 6a - 4. Let k be j(-5). Give i(k). 5 Let k(g) = g*3 - 12g*2 - 12g - 11. Let w be k(13). Suppose -wd + 20 - 28 = 0. Let b(l) = 2l*2 + 5l - 3. What is b(d)? 9 Let w(c) = -c*2 - 10c - 1. Let g(t) = t*2 + 22t + 32. Let o be g(-21). Let b(j) = 2j2 - 22j - 7. Let z be b(o). Calculate w(z). 20 Suppose 45g - 159 = -69. Let k(r) be the first derivative of 1/2r*g + 9 + 3r. What is k(5)? 8 Let q(p) be the second derivative of p*3/6 + 3p*2/2 - 2p. Let n be q(-7). Let i(h) = 6h + 3 + 4h*2 + 1 - 3h*2. Calculate i(n). -4 Suppose q = -2q. Suppose 4x + 4j - 12 = 0, j + q = 3. Let l(z) = -25z - 26z - 3 - 22z + 74z. Calculate l(x). -3 Let w(h) be the third derivative of 1/144h6 + 0 + 1/120h*5 + 0h3 - h2 - 5/24h4 + 0h. Let y(c) be the second derivative of w(c). What is y(3)? 16 Let t(i) = -5i - 3. Let l(n) = n + 1. Let x(j) = 3l(j) + t(j). Let c be ((-12)/18)/(2/(-3)). What is x(c)? -2 Let t(j) = -j*3 + 7j*2 - 2j + 4. Let r = 564 + -558. What is t(r)? 28 Let o(m) = -m2 + m + 84. Let c be o(-8). Let b(p) = -p3 + 11p2 + 16p + 7. What is b(c)? 55 Let j(l) = -l*2 - 2l + 3. Let w(g) = -4g2 + 6g - 5. Let i be w(1). What is j(i)? 0 Let z(a) = a + 13. Let b(d) = -d*3 + 3d*2 + 3d - 2. Let f be b(4). Let o be z(f). Let u = o + -5. Let s(m) = -5m + 3. Determine s(u). -7 Suppose 5n + 0o = -5o + 35, 4o - 14 = 3n. Let s(r) = -32r2 - 7r + n + 33r2 + 2r. Give s(8). 26 Suppose 42 = -16g + 9g. Let q be (-4 + g/(-2))/(4/28). Let y(k) = k*3 + 7k*2 - k - 2. Determine y(q). 5 Let m(p) = -2p*3 - 2p*2 + 2. Suppose 27z + 26z + 106 = 0. Give m(z). 10 Let x(p) = 3p - 14p2 + 7p*2 + 0 + 8p2 + 4. Determine x(-3). 4 Let q(n) be the first derivative of -n4/4 - 2n3 + 4n + 3. Let o be ((70/25)/(-7))/((-2)/(-30)). Calculate q(o). 4 Let j be -5((-33)/(-55) + (-1 - -1)). Let o(l) = -l - 32l*3 + 3l*2 - 28l*3 - 29l*3 + 2 + 90l3. Give o(j). 5 Let s = 43 + -35. Let b(m) be the second derivative of m5/60 - 5m4/12 + 3m*3/2 - 2m*2 + 11m. Let j(a) be the first derivative of b(a). Determine j(s). -7 Let c(z) = -z*3 - 7z*2 - z + 5. Let m be c(-7). Let q = m + -11. Let g(v) = -18v*2 - q + 13v2 - 4 + v3 - 3v. Determine g(6). 13 Let m be (2/8)/(246/48 + -5). Let s(n) = n + n + 9 - n + m. Calculate s(-8). 3 Let d(l) = l3 - 6 - 9 + 16 + 0l*2 + 4l*2 + 2l. Let x be d(-4). Let f(k) = -k - 6. Calculate f(x). 1 Suppose -15c + 16c - 3d + 4 = 0, -2c + 5d = 11. Let o(j) = j3 + 15j*2 + 25j - 17. Determine o(c). -4 Let a(f) be the first derivative of -f*4/4 - 4f3/3 + f2 - 2f - 130. Let j(q) = q + 1. Let p be j(-6). What is a(p)? 13 Let p(n) = n2 + 3n - 1. Let s = -569 + 565. Give p(s). 3 Let y be -8 + 1 - ((-5)/(-1) + -9). Let r(j) = j*3 + 3j*2 + 3j + 3. What is r(y)? -6 Let y(c) = 4c - 9c2 - 3 + c3 + c*2 + 4c*2. Determine y(3). 0 Let z be ((-4)/6)/(1/3). Let r be 8 + 1 + z + 5. Suppose i = -i + r. Let f(o) = -4o + 7. Give f(i). -17 Let t(f) = 3f + 1. Suppose -s + 1 = 4. Let j(h) = -2h - 1. Let a(q) = st(q) - 4j(q). Let y be -10 - ((-4)/4 + -4). What is a(y)? 6 Suppose 5u - 210 = -10u. Let i(x) = x*2 - 12x - 29. Give i(u). -1 Suppose -2 = 3d - 4l + 8l, -4l = -5d + 18. Suppose 2x + dx = 0. Let t(a) = -a2 + 7. Determine t(x). 7 Suppose -3u + 11 = -2b, 2b - 7 + 3 = 0. Let o(n) = -1 - 14n + 6n + un. Determine o(1). -4 Let z(b) = -2b - 12. Suppose 11c + 320 = 16c. Let y = -73 + c. What is z(y)? 6 Let z be 10(0 + -3)1. Let m be (-50)/(-4)z/(-25). Let n = m + -12. Let a(l) = l2 - 3l + 3. What is a(n)? 3 Let x(i) = 5i3 - 2i*2 + 61i - 53. Let c(p) = p3 - p2 + 15p - 13. Let l(w) = -9c(w) + 2x(w). Calculate l(-7). 4 Let r(u) = -2u + 13. Let f = 1324 + -1315. Give r(f). -5 Let p(c) = -c*3 + 6c*2 + 6c + 7. Let u = 15 + -8. Let y be p(u). Let f(v) = 1 + 8v2 - v - 19v*2 + 12v2. Calculate f(y). 1 Let v(l) = -l2 - 2l + 1. Suppose o + 4b = -13, -3o - 3b + 46 - 49 = 0. Calculate v(o). -14 Let h be -41/(-2) - -2. Let q(o) = -5o + 6o + h - 3. Calculate q(4). 5 Let d(h) = h2 - 2h + 5. Let o be 1 - (-5 - 12/3). Suppose 4b = 30 - o. Let s(i) = -i2 + i - 5. Let a(t) = bd(t) + 6s(t). Determine a(-5). -10 Let j = -11361 + 11360. Let y(g) be the first derivative of -g5/24 - g4/24 + g3/3 + 1. Let m(c) be the third derivative of y(c). Calculate m(j). 4 Let x(t) = -4t - 23. Let n be x(-7). Let b(w) = w*2 - 6w - 4. Calculate b(n). -9 Suppose 36 = 3o + 9. Let w(t) = -72 + 14t - 15t + 73. What is w(o)? -8 Let w(q) be the second derivative of q3/6 - 3q*2/2 + 59q. What is w(-9)? -12 Let u(t) = 76t - 6 - 142t + 67t. Calculate u(6). 0 Let g(h) = -2 + 2h + 3h2 - 2h*2 + 3 + 1. Let k = -13 - -10. Let x be (4 + -3)(k + 1). Determine g(x). 2 Suppose 81v - 82v = -33. Suppose -3u - v + 27 = 0. Let a(k) = 2k*3 + 3k*2 - 1. Calculate a(u). -5 Let x(y) = -y - 2. Let w(s) = -3s - 5. Suppose 7 = 3z - 5. Let d(v) = zw(v) - 11x(v). Suppose 6 = -3p + 2h, 5p - h - 6 = -3h. Calculate d(p). 2 Let s be (3 - (-55)/(-20))36. Suppose 2o = 3 + 13. Let y = o - s. Let r(l) = -4l. Calculate r(y). 4 Let t(f) = f + 1. Suppose 10c = 5c - 55. Calculate t(c). -10 Let f(p) be the first derivative of 29p4/4 - p2/2 + p - 3. Calculate f(1). 29 Let o(v) = -6v*3 - 2v*2 + 8v - 5. Let s(f) = f*3 + 2f*2 + 1. Let y(c) = o(c) + 5s(c). Give y(9). -9 Suppose -q - 3 = -4q. Let y(s) = -14s*2 - 5s + 6. Let u(n) = -n*2 + n - 1. Let j(g) = -5u(g) - y(g). Determine j(q). 18 Let b(t) = -4t - 1. Suppose 1 = 2d + f, 0 = d + 5f - 2f + 2. Determine b(d). -5 Let m(w) = -4w - 2. Let q(i) = 5i + 1. Let x(a) = -6m(a) - 5q(a). Let h be 2 + -2 - 3/(-1). Suppose 1 = -b, hc - 22 = -2b + 3b. Determine x(c). 0 Let o(t) = t3 - 2t*2 - 7. Let b be o(3). Let a(h) be the third derivative of 3h4/8 - h3/3 - 32h2. What is a(b)? 16 Let w(j) be the second derivative of j4/12 + j3 + j2/2 + 11j - 3. Give w(-5). -4 Let c(g) = 6g - 10. Let f be c(7). Let s(r) = -f + 35 + 4r + 4r2 - 2r. Give s(-2). 15 Suppose 16 = 3b - 4d + 4, 2b = d + 3. Suppose b = -7i + 4i. Let m(z) = -z2 + z + 1. Calculate m(i). 1 Suppose -6g = 36 - 186. Let x = -75 + 106. Let f = x - g. Let z(h) = -h*2 + 6h + 5. Calculate z(f). 5 Let k(c) = -4c2 + 5c - 5. Let m(v) = 3v2 - 5v + 4. Let b(t) = 2k(t) + 3m(t). Suppose 8w - 13 = 19. Calculate b(w). -2 Let w(l) be the first derivative of l*3/6 + l - 12. Let n(j) be t	{ "pile_set_name": "DM Mathematics" }
j + 2j + a. Suppose j = 4w - 3w. Do 2 and w have the same value? True Let y = -986 - -990. Is -72 at most y? True Let k(c) = c*3 - 13c*2 + 14c - 19. Let q be k(12). Suppose 2z = 3n - z + 33, qn + 3z = -23. Which is smaller: n or 3? n Suppose -415 = -17l + 146. Is l bigger than 168/5? False Let w(k) = -18k + 2. Let c be w(2). Let s = 55 + c. Let n = s + -15. Is n at least 5? True Suppose -4q - 3d = -3, -4q - 4d = -3d - 9. Suppose 6o = qo + 2n, -5n = o - 17. Suppose -3u + 15 = ou. Is u greater than 3/2? True Let r = 147.48 + -143. Let z = r - 0.28. Is 1/3 at most as big as z? True Let h = 55 - 34. Let m = h - 19. Are 3/2 and m equal? False Let g = -8010 - -857076/107. Which is smaller: 0 or g? 0 Let g be (2 + (-188)/8)/(6/(-12)). Is g < 265/6? True Let v be (-685)/4470 + 4/24. Is v smaller than 0? False Suppose 10 = 2u + 3u. Let d(a) = a3 - 5a + 1. Let n be d(u). Let k = 4.92 + -5. Which is greater: n or k? k Let j be 4/(-14) - (-432)/(-56). Let g(f) = -f*2 + 6f + 1. Let h be g(7). Which is smaller: j or h? j Suppose 4v + 60 = -12. Let a be (-4)/v - 291/(-27). Which is smaller: 9 or a? 9 Let a = -2069/3 - -690. Is a less than -525? False Let f = 67/24 + -21/8. Suppose 7c + 12 = 4c, -4c + 38 = -3x. Let n = x - -19. Which is smaller: f or n? f Let n = -3 + 2.8. Let a = 19 + -19.62. Let j = a - -0.72. Which is smaller: n or j? n Let s = -1144/7 + 106385/651. Let h(j) = 2j + 3. Let k be h(-2). Which is smaller: s or k? k Let g be 12/4 - (-10)/(-224)67. Which is bigger: g or -1? g Suppose -2a + 84 = 2g, g + 3 = -0. Let t be (0 - -1)/((-15)/a). Which is smaller: 0.5 or t? t Let f = -617.9 - -618. Is f less than or equal to 679? True Let f be (11 - -5)/((-2)/(-2)). Let o = -13 + f. Suppose -4n = -17 - o. Is n >= 1/3? True Let m be (-4)/38 - (-10322)/(-494). Which is smaller: m or -20? m Let p(y) = 4y2 - 9y - 3y2 + 29 - 15. Let s be p(7). Is -22 greater than or equal to s? False Suppose 5u + 13 = a, -4a + 5 = -4u + 1. Let m be 2/u - (-368)/(-24). Do m and -19 have different values? True Let l be (176/(-43))/(-2) + -2. Let d = 243 + -243. Is d >= l? False Let g = -981 - -948. Do 11 and g have the same value? False Let u = 5689/136 + -281/8. Does 8 = u? False Let f be (4 - 6)/((-6)/15). Suppose -5o + 3c + c + 92 = 0, -fo + c = -98. Suppose 5h + 5s = -o, -3h + s - 6 = -14. Which is smaller: h or 0.2? 0.2 Let h = 797/4 + -156. Which is smaller: h or 1/4? 1/4 Let h = -1 + 1.3. Let v = -0.2 - h. Is -1/4 smaller than v? False Let y be -1(-1 - 35/(-33)). Which is smaller: y or -24? -24 Let h = -1.4 + -166.6. Which is greater: h or 0.1? 0.1 Let o be (-1)/718/(-20). Let n = -688/3905 - o. Are n and 0.2 non-equal? True Let u = 442 + -441. Do 3/178 and u have the same value? False Suppose -5l + 1295 + 387 = 2z, -4l + 2z + 1342 = 0. Which is bigger: l or 339? 339 Let a be 3/(-10)(-2 + (-1412)/(-696)). Which is bigger: -1 or a? a Suppose i + 0i - 3 = 0. Suppose -w - 1 = z + i, 3w = 3z - 18. Let o = -16 - -10. Which is bigger: o or w? w Suppose -16 = -4f, i = 2f - 4 - 1. Suppose 0 = 2r - 3g - 19, 5r - 6 = -ig + 10. Suppose -4o - r = o. Is o <= -3/7? True Let k = 67/2 + -33. Let n(j) = 4j*2 + 8j + 9. Let z(v) = 5v2 + 8v + 9. Let r(i) = -6n(i) + 5z(i). Let p be r(9). Which is bigger: p or k? k Let q = 20392/7 + -2892. Which is bigger: 22 or q? 22 Let z(l) = 6l2 - 3l + 2. Let v be z(1). Suppose -r + 10 = 2q + 4r, r - 2 = -vq. Which is smaller: 2/19 or q? q Suppose y + 434 = 714. Which is smaller: 278 or y? 278 Let b(n) = -n3 - 7n*2. Let u(a) = -a - 2. Let v be u(-4). Suppose vf = 4f + 14. Let j be b(f). Which is smaller: 1/20 or j? j Let m = -371 - -370. Which is smaller: 2/679 or m? m Let i(n) = -5n*3 - 10n*2 + 9n - 13. Let o be i(-4). Is 1 < o? True Let z(v) = 2v2 + 4v - 6. Let i be z(3). Let u be (126/i)/(-1) + 3. Let s(b) = -b*2 + 8b - 10. Let a be s(7). Do u and a have different values? True Let u be 16/24 - 17504/(-312). Which is greater: u or 57? 57 Suppose 8 = 2s - 2. Let t = -3 + 21. Suppose -3c - 3c + t = 0. Is s < c? False Let o be 3/(-9) + (-39)/(-9). Let y(k) = k3 - 3k*2 - 4k + 4. Let q be y(o). Let m be (-8)/(-1) - (4 + -2). Which is smaller: m or q? q Let l be (-108)/(-24) - (0 + 2/4). Let w be ((1 + 0)/(-66))/(l/(-16)). Is w > 1? False Suppose -5q - 4h = -196, 3q - 3h = 7q - 156. Let i be (q/(-54))/((-8)/9). Are i and 2 non-equal? True Suppose 6 = 22l - 192. Let u(g) = -5 - g + 6 + 6. Let o be u(l). Is -2/3 greater than o? True Let i = -99.7 - -93. Let y = -5.7 - i. Let c = 0.09 + -0.1. Which is bigger: y or c? y Suppose -35p = -34p. Let g = -6109/5610 + -1/510. Is p at most as big as g? False Suppose -6n - 8 = -8n. Let v(i) = -i*2 - 4i - 11. Let g(f) = -f*2 - 3f - 10. Let y(c) = 2g(c) - 3v(c). Let r be y(-4). Which is smaller: n or r? n Let v = 9853/7 + -1405. Suppose 4f = 3 + 5. Which is smaller: v or f? f Suppose 12s = 15s - 15. Suppose -r + 6 = s. Which is greater: 2 or r? 2 Let s(f) = -10f - 58. Let k be s(-6). Let t be 6/(-9) + (-62)/(-39). Which is smaller: k or t? t Suppose -49 - 77 = -3b. Let w be (4/b)/((-19)/228). Which is bigger: -1/4 or w? -1/4 Suppose -115m = -116m + 2h + 1, -2 = h. Let c = -34766/3 + 11490. Let o = c - -97. Which is greater: m or o? o Let p = -307 + 305.826. Is -0.1 at least p? True Suppose -2k - 4 = -0. Let h be ((16 - 11) + -6)0/(-1). Is k <= h? True Let q(g) = -308 - 6g2 + 0g*3 + 2g + 304 - 2g3. Let a be q(-4). Is 19 at most a? True Let u(o) = o2 - 3o - 6. Let t be u(5). Suppose tk - 1 = 15. Let q be (5/20)/(11/k). Are 1 and q nonequal? True Let l = 343 + -2335/7. Which is bigger: -0.1 or l? l Suppose -30 = 2u - 2i, -i = 2u - 0u + 15. Let y be (u - -6)/128/18. Which is greater: y or 1? 1 Let k be ((-594)/570 + 1)70. Which is bigger: k or -2? -2 Let n = -10.8 - -8.8. Let q be (-8)/82/6. Is q less than or equal to n? False Let w be 50((-48)/(-15) - 2). Let a be 0((-45)/w)/((-3)/2). Which is bigger: a or -4? a Suppose -3 + 2 = h. Let x(g) = -5g2 - 4g + 13. Let n be x(-6). Let t be -3 + 4/(-2) + (-726)/n. Is h bigger than t? False Let y = -12 - -9. Let z be (y + 21/6)/(-1 + 0). Do z and 24 have the same value? False Suppose 2s - 4 = -5m + s, 5m + 2s - 8 = 0. Which is smaller: m or 0.1? m Let g = 31 - 31.1. Is g at most as big as -1/69? True Let i = -71.4 - -71.3. Do i and 21.4 have the same value? False Let v be 24(-1 + (-8)/(-16)). Which is bigger: -10 or v? -10 Let x be (-3)/(-12) + (-381)/(-12). Let g(c) be the first derivative of -7c*2 - 51c + 3. Let y be g(-6). Which is smaller: x or y? x Let u = 1399 - 8413/6. Is -4 bigger than u? False Let d = -0.95 - -1.06. Let s = -0.31 + d. Is s less than or equal to -22? False Let g = -9 - -7. Let h = -5 + 9. Suppose 0 = 5r - ho + 11, 0 = -3o - 0 + 12. Which is greater: g or r? r Let j = -38 - -38.225. Let c = j + 0.095. Which is smaller: 1/3 or c? c Let y(d) = -38d*3 + d - 1. Let q be y(2). Let n = q + 627/2. Is n > -1/3? True Let c be ((-473)/(-55) - 9)/((-2)/(-5)). Which is smaller: -2/43 or c? c Let k = 120 + 176. Which is bigger: k or 297? 297 Suppose -3s = -2 - 10. Suppose sm + 9m - 5m = 0. Suppose 0 = -3l + 3 - 0. Is l equal to m? False Let x = -68 - -21. Let v = x - -59. Is 12 < v? False Let l = -0.49 - -0.17. Let q = l - -0.32. Let y = q - -5. Which is greater: 1/2 or y? y Let h = 23 + 8. Let v = h + -31. Is -5 equal to v? False Suppose 4 - 19 = -5p. Suppose py = -4 - 8. Let s be (-1)/y + 3/4. Is 9/5 bigger than s? True Let u be 4/12 + 500/(-42). Let m = -12 - u. Let n be 0/(6 - 2 - 2). Which is smaller: m or n? m Suppose -4x + 60 = n, -5n - 16 = 4x - 236. Do n and 40 have different values? False Let g = 680 + -686. Which is smaller: g or -98? -98 Let n(r) = -r + 1. Let w = -8 + 10. Let x be ((0 - -1) + -1)/w. Let i be n(x). Which is smaller: 10 or i? i Let t = 0.33 + 15.67. Does t = -0.06? False Let s(c) = c2 + 1. Let i(j) = 11j*2 + 4j. Let g(p) = i(p) + 5s(p). Let k be g(-1). Is 17 greater than or equal to k? True Let p = -43.1 + 46. Let x = -81.7 - -79. Let o = x + p. Is -0.3 >= o? False Let z = 28 - 25. Let t be (1 - 0)z - 1. Is 2 <= t? True Let a(x) = x*3 + 4x**2 -	{ "pile_set_name": "DM Mathematics" }
ate -3m3r - 482m3w - 150mrw - 2mw with respect to r. -3m*3 - 150mw Find the third derivative of 11664d5 + d3 - 1334d2 + 2d wrt d. 699840d2 + 6 Find the first derivative of -83k*2 - 1848. -166k Find the first derivative of 200n4q*2 - 2n*4q + 2q2 - 3q wrt n. 800n3q*2 - 8n*3q Find the first derivative of 331t + 681 wrt t. 331 Find the second derivative of 2gi2y + 51giy2 - 2giy + 4gy + 565i2y*3 - 2iy3 wrt i. 4gy + 1130y*3 What is the second derivative of 902m*2 - 16m - 5 wrt m? 1804 Differentiate -11fn*2 + fnw + 10211fw - 103n*2w with respect to n. -22fn + fw - 206nw Find the first derivative of 11672by2 + 17368y*2 wrt b. 11672y*2 Find the third derivative of -2575p*3u*3v + p*3u*2v + 5p2u*3 + 3puv + 9u3v - 2u2 + 7v wrt p. -15450u3v + 6u2v What is the first derivative of -2qx*3 - 119q + 4x4 + x wrt x? -6qx2 + 16x*3 + 1 What is the third derivative of 3d*6u + 100d3u*2 - 2d*2u*2 + 288u*2 wrt d? 360d*3u + 600u2 Differentiate 3m*3t*2u + 3m3t*2 + 5m*3t - 30m3u + 2t2 wrt u. 3m*3t*2 - 30m*3 What is the third derivative of -7718hw3 + 230hw2 + 2h + w*2 - 4w wrt w? -46308h What is the second derivative of bo*3 - 9bo2 + 109bo - 12o*3 wrt o? 6bo - 18b - 72o What is the second derivative of -u5 - 184u*4v*2 + 807uv2 wrt u? -20u*3 - 2208u*2v*2 What is the derivative of 203i*4l - 2i2l*3 - 10l*3 + 6 wrt i? 812i*3l - 4il*3 Find the third derivative of -18y6 - y5 - 25y3 + 27400y*2 wrt y. -2160y*3 - 60y*2 - 150 Find the third derivative of -5f*4v*2 + 2f*4 - 3f*3v*2 + 2f*2v + 5fv*2 wrt f. -120fv2 + 48f - 18v2 Differentiate r3 + 75r*2 + 239 with respect to r. 3r*2 + 150r What is the third derivative of 2h6 + 17h*4 + 29h*3 + 2h*2 + 20h + 1 wrt h? 240h3 + 408h + 174 What is the second derivative of -p*5 + 9p*4 - 68p + 3? -20p3 + 108p*2 Find the third derivative of 84k*5 + 2k*3 + 2k*2 - 933k wrt k. 5040k2 + 12 What is the second derivative of -22c*3 - 2c*2 + 277c? -132c - 4 What is the first derivative of -2c*3f - 3c3g + 3c2g - 4cfg - 45f + 65 wrt f? -2c3 - 4cg - 45 Find the third derivative of 1528q*5 - 1276q*2 wrt q. 91680q*2 Differentiate -1312ag3 - 15g*3 - 7g*2 with respect to a. -1312g*3 Find the second derivative of -5082r*5 + 29r + 45. -101640r3 What is the third derivative of -130q*6 + 2q*4 - 2q*3 + 2387q*2? -15600q*3 + 48q - 12 Find the third derivative of -102p3 - 352p*2 wrt p. -612 What is the second derivative of -79f*4g*2 + 27f*4 + fg - 1325g2 wrt f? -948f*2g*2 + 324f*2 Find the third derivative of 2gk5 + gk*3 + 207gk2 - 6k*5 wrt k. 120gk2 + 6g - 360k2 Find the first derivative of 11gkw*3 - 6gkw + 3gw*2 + 3kw3 - 9w*3 wrt k. 11gw3 - 6gw + 3w*3 Find the first derivative of 278n*4 - 2230. 1112n*3 What is the third derivative of -5h*5m + h*4 - 151h*3m*2 - 1073h*2m - 2m2 wrt h? -300h*2m + 24h - 906m*2 Differentiate 16c*2m + 2051c2 + 4cm + m4 with respect to m. 16c*2 + 4c + 4m3 What is the derivative of 11164g - 6131? 11164 What is the second derivative of -23x3 + 29x*2 + 2x - 933 wrt x? -138x + 58 Find the third derivative of -2dt4 + 4dt2 - dt - 2t4 - 15t*3 + 9 wrt t. -48dt - 48t - 90 Find the third derivative of -26m2n*4 + 2m*2nu - 7mn2u - 159mu + n*5u - 4n3u wrt n. -624m2n + 60n2u - 24u Differentiate jo*3v + j - 68o3 - 29v with respect to o. 3jo*2v - 204o2 What is the second derivative of -356y*5 + 439y wrt y? -7120y3 What is the third derivative of 175s*6 - 513s*2 wrt s? 21000s*3 What is the second derivative of -6ah4 + 13ah3 + ah - a wrt h? -72ah*2 + 78ah What is the third derivative of 5y*4 + 14y*3 - 709y*2? 120y + 84 What is the second derivative of 170o2 - 5o + 129 wrt o? 340 What is the derivative of -3a2dj + 3a*2j - 3adj2 - 5aj2k + 13dk + 3j2k wrt d? -3a2j - 3aj*2 + 13k Find the first derivative of -4141s2 - 3246 wrt s. -8282s Find the second derivative of 254l3 - 324l. 1524l Find the second derivative of -1114d*2 + 17d. -2228 What is the third derivative of -3l5z + 112l4z*2 - 7l*2z*2 - lz*2 wrt l? -180l*2z + 2688lz*2 Find the second derivative of 425r*4t - 15r2t*2 - 9470rt2 - rt wrt r. 5100r2t - 30t2 Find the second derivative of -3io5w + 27io*2w*2 - 2iow*2 - 3io - 3i + o wrt o. -60io*3w + 54iw*2 What is the first derivative of 318m*4r*3 + 22r*3 - 3 wrt m? 1272m*3r*3 What is the third derivative of -292i*3w*3 + 50i*3 + 2i*2w*3 + 6iw2 + i + 4w*3 wrt w? -1752i*3 + 12i*2 + 24 What is the second derivative of -16z*5 - 4z4 - z2 - 6145z? -320z*3 - 48z*2 - 2 Find the third derivative of -172x*6 - 762x*2. -20640x*3 Find the third derivative of -138f*3x + 13f3 + 122f*2x - f*2 + x wrt f. -828x + 78 Differentiate 964g4 - 83 with respect to g. 3856g*3 Find the third derivative of -1000g*3 - 2g*2 - 329g. -6000 What is the first derivative of 3568j2 + 2330 wrt j? 7136j What is the third derivative of -26744a5 + 10768a*2 + 1 wrt a? -1604640a*2 Find the first derivative of 13g*2nx + 5gn + 2gx + 3nx - 2n wrt g. 26gnx + 5n + 2x What is the second derivative of -127s*2w*3 - 2s*2w - 48sw*3 - s + 1 wrt s? -254w*3 - 4w What is the third derivative of 366f3 - 3f*2 + 7f? 2196 Find the second derivative of 3s4 - 45s*3 - 1055s. 36s2 - 270s Find the first derivative of -923j3 - 2j*2 - 1138. -2769j*2 - 4j What is the third derivative of -d*5l*2 + 22d*4l*2 - 69d*2 - dl*2 wrt d? -60d*2l*2 + 528dl2 Differentiate 19c*2p*3x + 5c2p*3 - 16c*2px + 149p*3 wrt x. 19c*2p*3 - 16c*2p Find the second derivative of -8w5 + 9w - 3 wrt w. -160w3 Find the second derivative of -dr*5 - 4dr3 - 7d - 13r2 - r wrt r. -20dr3 - 24dr - 26 Find the third derivative of -2788js3 + 2js2 + 15s*2 + 2s - 1 wrt s. -16728j Differentiate -6o*3rv - 59o3 - o2v + 11o*2 - 11r*3 - 8r*2v + 1 with respect to r. -6o3v - 33r2 - 16rv Differentiate -2q*3z*2 + 7q*3 - 62q*2z*2 - 6q with respect to z. -4q3z - 124q2z What is the second derivative of 13993k5 + 746k - 8? 279860k3 Find the second derivative of 6s*2t*3 + 2s*2t - 12s2 + 5st3 - 68t*3 wrt s. 12t*3 + 4t - 24 What is the first derivative of -aq - 781av - 4q - 18v wrt a? -q - 781v What is the second derivative of -214a2p - ap - p - 3 wrt a? -428p Find the third derivative of -8f4l*3 + 63f*4v - f*3v + 3f2l*2 - 2f*2l + 2fl*3v + 14l3v wrt f. -192fl*3 + 1512fv - 6v What is the third derivative of 2093b3t*2 + 163b*2 + 7bt2 wrt b? 12558t*2 Find the first derivative of 76r - 2117 wrt r. 76 Find the first derivative of -2a2 + 7a + 127 wrt a. -4a + 7 Differentiate bl*2p - 4bl*2 + 3bp - 13b - 4l2p - 9lp with respect to l. 2blp - 8bl - 8lp - 9p What is the second derivative of -1064ks*2 - 10ks + 10s wrt s? -2128k Find the second derivative of 105w*4 + 8w - 5 wrt w. 1260w2 What is the first derivative of -16b*2k*2 - 102b*2 - 3k*2 wrt k? -32b*2k - 6k Find the third derivative of -61qw4 + 137qw2 - 2qw + w3 wrt w. -1464qw + 6 Differentiate 11298x + 10020 wrt x. 11298 Find the third derivative of -49f3x*3y*3 + 6f*3x*3y2 - f3x2y*2 - 9f*2xy3 + 10fx2y*3 - 2fx2 wrt x. -294f*3y*3 + 36f*3y*2 What is the second derivative of -25076s*3 + 1084s + 5 wrt s? -150456s Find the third derivative of -35k*4v + 2k3w*2 - 3k*2vw + 4kvw*2 + 2v + 2w wrt k. -840kv + 12w*2 What is the third derivative of 10j*2t*4 + 2j*2t*3 + 34j**2 +	{ "pile_set_name": "DM Mathematics" }
4h = -2r + 76. Let a be (r/(-12) + l)/(-3) - 1. What is the second biggest value in 3/4, -3, a? a Let l = 6759.1 + -6759. Let a be (-6)/(-9)(-2)/4. What is the fourth smallest value in l, a, -1, 5/4? 5/4 Let x = -608 - -607.7. What is the fourth biggest value in 1, -12, -1/7, -5, x? -5 Let w = 5808.03 - 5808. Which is the second smallest value? (a) -4 (b) w (c) -3/8 c Let l = 0.9 - -4.1. Let y = -519247/8 + 64906. Which is the smallest value? (a) 0 (b) y (c) l a Let q be ((-5)/(-15))/(4/(-6) - 1). Let h = -372 + 372.5. Which is the second biggest value? (a) -3/8 (b) q (c) h b Let s = 7.41 - 7.51. What is the fourth smallest value in 0.05, 3/4, -2/7, s? 3/4 Let p = -51 + 25. Let k = p + -12. Let m be 4k/36 - -4. Which is the second biggest value? (a) m (b) 4 (c) -1 a Let s = -4363/5 - -17447/20. Let l = 5 - 2. Let u = 1 - 0.8. Which is the fourth biggest value? (a) l (b) s (c) u (d) 5 b Let s = 2.44 - 19.64. Let z = s + 37.2. Which is the second biggest value? (a) 4 (b) z (c) -0.2 (d) 0.2 a Let q = 1.96 - -0.04. Let y = -47008 - -47007. What is the third biggest value in y, -3, -11/3, q? -3 Let h = -396.1 + 396. Let s = 728 - 3636/5. What is the third smallest value in 1/8, s, 4, h? s Let k = -0.2 + 0.3. Let c = -1.512 - -1.302. Let r be ((-3)/(-9))/(5/3 - 2). What is the third smallest value in r, c, k? k Let z be (-160)/(-4) + (-1)/1. Suppose 0 = zv - 35v + 24. Let m be (-6)/3025/v. What is the third smallest value in -4, 6/13, m? m Suppose -x = -0x. Let y = -924.6 - -919.027. Let s = -0.427 + y. What is the biggest value in x, -3, s? x Let g be -2 - ((-7)/3)/1. Suppose -9953t + 10041t = 88. Which is the third smallest value? (a) t (b) 143 (c) g b Suppose -3y + 2555i - 2551i + 7 = 0, 4y - 2 = -2i. Let t = -22 + 17. What is the third smallest value in y, -25, t? y Let t = -999 + 1002. What is the fourth smallest value in -3, t, -3/5, 0.099? t Let l = -21526 - -21531. Which is the smallest value? (a) 7/3 (b) 0 (c) l (d) 1.5 b Let d = -4 - -6. Let y be d/(-7) - 80/(-182). Suppose 3z + 11 = -4q, 4q + 7 = 5z - 28. Which is the second biggest value? (a) y (b) 5 (c) z c Let g = -1.663 + 2.363. Which is the fourth smallest value? (a) 0.3 (b) g (c) 4 (d) -0.3 c Let k = 1041.9 + -1145.9. What is the third smallest value in 0.5, 2/5, k? 0.5 Let o = 19.6 - 9. Which is the fourth biggest value? (a) 0.4 (b) -0.2 (c) o (d) 4 b Let n(t) = t3 + 5t*2 + 8t + 5. Let p be n(-3). Let l = 2.9758 - 0.0108. Let o = -0.035 - l. Which is the biggest value? (a) o (b) p (c) -1/9 (d) -5 c Let v = 151 + 3. Let x = v + -142. What is the third biggest value in -1/4, x, -4? -4 Let z = -0.02886 - 5.97114. What is the second smallest value in z, -0.113, 0? -0.113 Let g(d) = 28d + 2. Let o be g(7). Let j = -198 + o. What is the third biggest value in 5, -1, j, -0.3? -0.3 Let b be 2/12(-3)/2. Suppose -3c + 6c - 19 = -h, -h + 5 = -4c. What is the fourth smallest value in 6/11, h, b, 3/2? h Let w = -5.89 - -6.29. Let p be (-4(-12)/(-8))/(2 - 0). What is the third biggest value in p, w, 2, 10? w Suppose 2v - 2q - 11 - 1 = 0, 2v + 13 = -3q. Let t be v/1 + (-60)/28. What is the second smallest value in -0.6, t, 2/3? -0.6 Let s = -120.2 - -120. Let l = 0.89 - 0.39. Which is the third biggest value? (a) 0.1 (b) 14 (c) l (d) s a Let o = 0.7 - 4.7. Let m = 0.98 - -7.19. Let u = 8 - m. What is the second biggest value in o, -4/7, u? -4/7 Let c be (-18)/52 + 1/2. Let w = -3.963 + 4.2. Let t = w - -0.063. What is the second biggest value in 1, -0.1, c, t? t Let j = -202.47 + 222.47. Which is the second smallest value? (a) -77 (b) j (c) 2 c Let h be (-144)/45(-105)/(-252)(-6)/(-10). Which is the second biggest value? (a) -2251 (b) 1/2 (c) h c Suppose -96 = -216r + 210r. Suppose 0 = -22m + rm - 30. What is the second biggest value in 3, m, 0, -1/3? 0 Let d = 2 + -1.9. Let r be (((-49500)/(-594))/250)/((-2)/(-6) + -2). Suppose -l + 5n = -22, -4n - 3 = -5l + 2. What is the biggest value in r, l, -8, d? d Let t = -0.7 + 0.8. Let i = 1.9 + t. Let s be 833/686 + 6/(-28). Which is the smallest value? (a) s (b) i (c) 5 a Let l = -2.282 + 2.282. Let h = -19042/35 - -544. What is the third smallest value in l, 6/5, h, -2? l Let c = 208 + -201. Let a = -28.9 + 25.9. What is the smallest value in a, c, 2? a Let u = 1 + -0.5. Let r = -121 - -113. Let q = r - -7.5. Which is the second smallest value? (a) u (b) 2/5 (c) q b Let n be (22/(-385))/(-8(-12)/224). Which is the third biggest value? (a) 4 (b) 1.683 (c) 0.5 (d) n (e) 2/7 c Let q = -0.01104 - 0.18896. What is the third smallest value in -2, -5.6, 2/7, 1, q? q Let t = -3462.4 + 3462. What is the third smallest value in -3, 3, t, 0.4, -2? t Let t = -5.25 - -4.25. Let x = 61 + -60.94. Let f = -1 - -4. Which is the second biggest value? (a) x (b) t (c) f a Let b = -262 - -417. Let m be b/(-434)(-4)/15. What is the second biggest value in -0.5, m, 9? m Let d = 39.2 - 36. Let j be ((210/(-49))/(-6))/((-4)/(-14)). Let p = -31/10 + j. Which is the third biggest value? (a) d (b) -5 (c) p b Suppose 5d = -78 - 147. Let z = 51 + d. Let f be 1/6 + 17/z. What is the smallest value in f, -2, -16? -16 Let u = -0.6329 + -3.3671. Which is the smallest value? (a) -872 (b) 0 (c) -2/11 (d) u a Let q(d) = 5d. Suppose 0 = 5z + 21 + 4. Let r be (2/10)/((-1)/z). Let o be q(r). Which is the second smallest value? (a) -2/7 (b) 2 (c) o b Let p(r) = -2 + 0r + 7r*3 + 4r - 2r2 - 2r*2 - r. Let y be p(1). Which is the smallest value? (a) 17/2 (b) -4/3 (c) y b Let t = -40 + -62. Let g = t + 100. Let l = 3 - 2. Which is the second biggest value? (a) g (b) l (c) 2/3 (d) 0.2 c Let y = 0.197 - 0.407. Let t = -1.21 - y. Which is the third smallest value? (a) t (b) -0.4 (c) 0.108 c Let x = 0.3592 - -0.6408. Which is the second smallest value? (a) x (b) -4 (c) 2/5 (d) -2/9 d Let s = 9.19 + -7.69. Let f = 3.03 + -0.03. What is the smallest value in 0.5, s, f, 5? 0.5 Let u be -311/(264/56) - (-7 + -2). Let j(z) = -z*2 - 7z - 7. Let d be j(-5). Which is the second biggest value? (a) u (b) -0.8 (c) d a Let p be 1/(-3) + (-16)/(-12). Let o = 104 - 254. Let r = 153 + o. Which is the biggest value? (a) p (b) 2/17 (c) 2 (d) r d Let z = -3.6965 + 4.5065. What is the third biggest value in 4, -3, 3/7, -4, z? 3/7 Let j = 21420 + -128519/6. Which is the smallest value? (a) 2 (b) j (c) 160 b Let f be -13 - (-11)/((-4235)/(-5012)). Which is the third smallest value? (a) -6 (b) -2 (c) f c Let v = 7.736 - 8.136. What is the smallest value in 11, -4, v, -5, 7? -5 Let x = -12.8 - -14. Let d = x + 1.8. Let k = -6/335 - -207/335. Which is the third biggest value? (a) d (b) 3/7 (c) k b Let r = 3472 - 6971/2. Which is the fourth biggest value? (a) 1.2 (b) r (c) 4 (d) -2/9 b Let k = -1/33 + 103/132. Let l = k + -5/4. Let q be ((-1)/11)/(((-50)/(-12))/25). Which is the third biggest value? (a) 2/11 (b) l (c) q c Let r = 3 - 2.6. Let j = -212216 - -212221. Which is the smallest value? (a) -0.2 (b) r (c) j (d) 7 a Let g = -1.99 - -2. Let h = 36889/350265 - 1/18435. What is the fourth biggest value in h, 0.4, -2/33, g? -2/33 Suppose 2j = 4a + 10, a - 24 = -4j + 23. Suppose j = 10k - 109. What is the smallest value in k, -2/7, 0? -2/7 Let f = 652/5 - 131. Let c = -25 + 13. Let i(z) = -z*3 + 5z*2 + 10z - 27. Let m be i(6). What is the second biggest value in f, m, c? m Let d = 62.7514 - -0.2486. Let t = -0.17 - -2.17. Which is the smallest value? (a) -0.3 (b) t (c) d a Let x = 9 - 14. Suppose 143 = 12v - 49. Suppose 0 = -vm - 0m. What is the biggest value in m, x, -1? m Let p = 21456.9 - 21457. Let w = -59 - -297/5. Let r = w + 4/15. Which is the biggest value? (a) r (b) p (c) -13 a Let h = 935.8 - 936. Let s = 3 + -1. Let p be 32/(-10)(-2)/(-8). What is the second smallest value in s, h, p? h Let g = 0.43 - 0.33. Let l = 1451.4 + -1451. What is the third biggest value in g, -0.2, 1, l? g Let f(b) = 2b2 + 7b - 9. Let g be f(-3). Let h = 12 + g. What is the biggest value in 18, h, 3, 0.3? 18 Let n = -630/517 + 6/47. Let o = 111 + -111.1. Which is the second smallest value? (a) o (b) n (c) -4 b Let m = 873.8815 - -0.	{ "pile_set_name": "DM Mathematics" }
n be q(c). Solve 7m - 3m - 16 = n for m. 4 Let y be (-1)/(-4) + (4 - 135/(-20)). Solve -2l = -y + 1 for l. 5 Suppose -3k - 11 = -3w - w, -w = 2k - 11. Solve kg = 1 + 2 for g. 1 Let q = -65 + 65. Solve q = -5x - 2 + 12 for x. 2 Let y = -39 + 64. Solve -6w + w = y for w. -5 Suppose 0 = 3c - 6 - 0. Solve cp - 18 = -8 for p. 5 Suppose -3u + 12 = -0u. Let w = 7 - u. Let z = 6 + -2. Solve o + z = -wo for o. -1 Let d(m) = -5m - 37. Let u be d(-9). Suppose 2y = 4v - 18, -y - 5v + 6 = 1. Let r = y + 9. Solve -u = -2s + rs for s. -4 Let j(w) = w*2 - 5w - 3. Let o be j(6). Suppose -3 = -3i + 9. Suppose -iq = -2 - 2. Solve 4 = ot + q for t. 1 Let a be -3 - ((-7)/(-42) - 75/18). Suppose 3t - 12 = -2w, 3w + t - 4 = 6w. Solve a = u - w for u. 1 Let f be (11/2)/((-2)/(-4)). Let c be (-2)/11 + 2/f. Solve -2v = -cv - 6 for v. 3 Let y be 1 - (1 + 1 + -2). Let z be (-2 + (-3)/2)-2. Suppose 4r - 5 = z. Solve 4a - r - y = 0 for a. 1 Suppose -5 = 2h + 7. Let w = h + 7. Let s be w - (-3)/(-6)-4. Solve 7d + s = 4d for d. -1 Suppose 26 = -0m + 5m + 2g, -5m = -2g - 14. Solve 0j - 20 = mj for j. -5 Let c be ((-6)/7)/((6/(-3))/14). Solve 3s + c = s for s. -3 Suppose 0 = -4q - 19 + 59. Let h be 2/10 - 2/q. Solve hn = -4n - 20 for n. -5 Let d be (-2 - 2)/(-2) - -1. Solve m + 0m = -d for m. -3 Let o be (0 - 0 - 0)(-34)/102. Solve -11u + 8u + 12 = o for u. 4 Let x(j) = -7j - j*2 + 4 - j + j + 4. Let z be x(-8). Solve 6w - 3w - 6 = z for w. 2 Let u(y) be the second derivative of -y5/20 + 3y4/4 + y3/6 - 3y2/2 + 2y. Let d be u(9). Solve m - d = 4m for m. -2 Let q = -6 - -13. Suppose 2l + 1 = l, z - l - q = 0. Solve -2 + z = 4u for u. 1 Suppose -1 + 6 = 5p. Suppose 5l = 4l + p. Let t = l - -2. Solve tv + 5 + 7 = 0 for v. -4 Suppose -2i + 4p = -4, -3i - p = -3p - 6. Solve -ij + 7j = 15 for j. 3 Let l(g) = 2g*2 - 4g - 4. Let r be l(4). Let y = 12 - r. Let u be 1-3(-1)/1. Solve u = -yp - 3p for p. -1 Suppose 0 = -f - 4u - 17, 0f + 2f + 3u + 39 = 0. Let v = f - -21. Solve v = 5g - 0g for g. 0 Let o(d) = d3 + d2 + 9. Let j(g) = g*3 + 5g*2 - g - 5. Let p be j(-5). Let f be o(p). Suppose -4b = -2b - 3m + 9, -3m = -f. Solve 3 = -3x - b for x. -1 Let r = -2 - -13. Let o = -3 + 8. Solve r + 4 = od for d. 3 Let y(o) = o3 + 2o*2 - 6o - 5. Let w be y(-3). Solve -wk = k for k. 0 Suppose -3a + 6 = -15. Suppose a - 5 = h. Solve 2f - h = 3f for f. -2 Suppose -3s = 2s - 10. Solve 0 = -su + 2 + 4 for u. 3 Suppose 0 = -0o - 2o - 10. Let k = o - -5. Suppose kp = -5p + 15. Solve v = pv for v. 0 Let l = -5 - -10. Solve -lp + p - 8 = 0 for p. -2 Let r = -5 + 8. Suppose -5l + 5 = 0, -4l = -2w - w - 4. Solve rv = -wv for v. 0 Let m = -5 + 10. Suppose -18 = -mq + 32. Let j(p) = -p2 + 5p + 8. Let r be j(6). Solve -q + 2 = rx for x. -4 Suppose 0l = -3l + 12. Solve ly + 6 = -14 for y. -5 Let t(q) = q*2 - 14q + 5. Let c be t(14). Solve cm - 4 = 11 for m. 3 Let h(a) = a3 - 4a*2 - 2a - 11. Let i be h(5). Solve 0r - 20 = -ir for r. 5 Let l = -46 - -49. Solve 0 = -lj - j for j. 0 Suppose 0 = s - 5s + 3f + 21, 0 = -5s + 2f + 21. Suppose -5o = -6n + n, sn = -5o + 40. Solve -4r + nr = 1 for r. 1 Let u(z) = z2 - z + 2. Let n be u(-4). Solve 4d - 6 = -n for d. -4 Let b be (22/(-12))/(21/(-126)). Solve 3h + bh - 5 = 0 for h. 1 Let r = 26 - 26. Solve 0 = -4f - rf - 16 for f. -4 Let r(l) = l2 - l - 2. Let a be r(-2). Let s = a + 2. Let f = s - 3. Solve fx + 5 = -7 for x. -4 Suppose n + 3n - 20 = 0. Solve -5l + n = -0 for l. 1 Let n(g) = g*2 - 87g + 252. Let r be n(3). Suppose 3h = 75 + 57. Suppose 5b - h = b. Solve 5m + b - 31 = r for m. 4 Suppose 6l + 2f = 8l, -3l = -5f + 8. Solve -l = 5z - z for z. -1 Let d(n) = -n2 - 10n + 17. Let w be d(-12). Let r = 5 + w. Let j(s) = -2s. Let q be j(r). Solve -qv + 8v + 20 = 0 for v. -5 Suppose -3z = -4t + 35, 2t = -5z - 19 + 4. Suppose -y = ty. Solve yu + u + 3 = 0 for u. -3 Suppose 3y = 10 + 5. Let w(s) = s*3 - 6s*2 + 7s - 4. Let x be w(y). Suppose p + p = x. Solve 2 + p = 5d for d. 1 Let f = 36 - 31. Solve 2l - 3l - f = 0 for l. -5 Let z be (4/3)/((-5)/(-30)). Let k(v) = v + 7. Let w be k(-3). Solve wl = z + 4 for l. 3 Let t(n) = -n*2 + 8n - 4. Suppose -4j + 28 = -0j. Let w be t(j). Solve w - 23 = 5y for y. -4 Let j(n) = n2 + 2n + 3. Let l be j(-4). Solve -3f - 5 = -l for f. 2 Let m be 103/(-3)-9. Suppose 4q + 5a = m, -2q = -4a - 0a - 32. Let u be 3/12 + (-30)/(-8). Solve 8w - q = uw for w. 5 Let l(f) = -f2 + f - 4. Let u(b) = -b2 + b - 3. Let k(o) = 5l(o) - 6u(o). Let h be k(2). Suppose -3z + hz = 0. Solve zs = s + 3 for s. -3 Suppose -5f + 5 = 2w, 3f - 5w = -2f + 40. Solve d - fd + 6 = 0 for d. 3 Suppose 4t = -2i - 32, -4i + t + 2t - 108 = 0. Let z be (25/(-15))/(2/i). Solve 2j + z = -2j for j. -5 Let t(x) = -x - 5. Let g be t(-5). Let o = 9 + g. Suppose 0f = 3f - o. Solve -fs - 12 = -0 for s. -4 Let l be 8 + 2 + 0/(-1). Let c be (-2)/(-6) + (-10)/(-6). Let g be (1 + c + -1)1. Solve -gt + 0 = l for t. -5 Suppose -2c + 8 = d - 0, 0 = -3d + 2c - 8. Solve 2b + 2b = d for b. 0 Let s = 42 + -36. Solve -2v = -sv - 8 for v. -2 Let v(g) = g3 + 3g*2 - 3g + 1. Let l be v(-3). Suppose 2 - l = -2u. Solve -7 = h - u for h. -3 Suppose 4u - 87 = -3q, 3q - 5q + 4u = -38. Suppose 5 = t, t - 3 = 3d - q. Solve a - d = 4a for a. -3 Let a(u) = u*3 + 7u*2 + 4u - 6. Let o be a(-6). Solve n - on = 0 for n. 0 Suppose -6d = -d + 5u, -5d - 4u + 5 = 0. Solve 5 + 0 = dm for m. 1 Let y be (-2 - 4-1) + -2. Suppose y = -2p + 9 - 5. Solve -pm - m - 15 = 0 for m. -5 Suppose 2s - c = 39, -3s + 3c - 23 = -4s. Solve u - s = -3u for u. 5 Let k(j) = j*2 - 8j + 1. Let n be k(8). Let c = 1 - n. Solve 0 = -cm - 5m for m. 0 Let f(w) = -w*2 + w - 5 + 2w + 6w. Let m be f(8). Suppose 0 = -5g - mj + 18, -4g = 2j + 3 - 17. Solve gn = 4n for n. 0 Suppose 3o - 2o = 2. Let q(a) = -3a + 1. Let l(r) = -6r + 2. Let u(g) = -2l(g) + 5q(g). Let w be u(-1). Solve op = p + w for p. 4 Let h(n) = n*3 + 4n*2 + 2n - 1. Let x = 8 + -3. Let t(w) = w - 7. Let b be t(x). Let i be h(b). Solve iy + y = -8 for y. -2 Let m(p) = p3 - 8p*2 + 2p - 3. Let h(c) = c - 1. Let q(k) = 3h(k) - m(k). Let r be q(8). Solve 5f + r = -7 for f. -3 Let f be 0/(-2)3/(-6). Let i = -15 - -16. Solve i + f = -x for x. -1 Let s(m) = m + 2 - m3 + m2 + 3m*2 - 3. Let h be s(4). Solve -hd + 7 = -2 for d. 3 Let a(o) = -o + 10. Let c be a(6). Suppose -5p = -f + 2, 5p = -cf + 3p + 8. Solve 0 = 2j + f for j. -1 Let f be (2/(-6))/(1/(-3)). Let a be -7 - -10 - (f - 2). Suppose -4 = c + 2d - 3d, 2c + d = a. Solve 25 = -ck - 5k for k. -5 Let h(a) = -a*2 - 11a - 6. Let w be h(-10). Solve l = -0l + w for l. 4 Let y(u) = u. Let z(c) be the second derivative of 5c*2 + 3c. Let a(i) = -y(i) + z(i). Let f be a(7). Solve fq - 2q = 5 for q. 5 Let x(i) = -i + 4. Let a be x(-2). Solve h = 3h + a for h. -3 Let l(v) = 20v*2 - 1. Let s be l(-1). Let g = s - 3. Solve 0 = -6h + 2h - g for h. -4 Let k = -13 - -19. Suppose 0s - 8s + 2s = 0. Solve -5m + k - 21 = s for m. -3 Let y(h) = h3 - 4h*2 - h - 1. Let x be y(3). Let b = x + 19. Solve -4t - b + 14 = 0 for t. 2 Let c be 2 + -5 + 1 + 2. Solve c = f + f for f. 0 Suppose -2l + l = 0. Suppose 2z - z = l. Solve z = -d - 0d + 5 for d. 5 Let k = -18 - -31. Solve 3m - k = -1 for m. 4 Let x(w) = w - 4. Let n be x(4). Solve n = -2s - s for s. 0 Let u be ((-42)/9)/(6/9). Let c = -6 - u. Let p be 2c/(1/1). Solve 0 = pf - 7f - 25 for f. -5 Suppose -3a = 14 - 23. Solve 12 = -ay - 0 for y. -4 Let m(i) = 9i3 - 1. Let a be m(1). Let g(x) = -x + 14. Let s be g(a). Solve -5w - s = 9 for w. -3 Let t be (1 - 1) + 16/(-4). Let a be 33/(-12) - (-1)/t. Let m = 6 + a. Solve mh + 4 = 4h for h. 4 Suppose q = -5y - 11, -27 = -3q + 3y + 2y. Let l be -22/q-4. Solve -lm + 9m - 10 = 0 for m. 2 Suppose 16 = 6q - 80. Let j be q/32 + 62/4. Suppose -4n = n - f - 36, -n + 3f = -10. Solve ny = 3y - j for y. -4 Let n(k) = -6k - 16. Let b be n(-3). Let h be 5-12/(-5). Solve h*s + b = s for s. -2 Sup	{ "pile_set_name": "DM Mathematics" }
be the first derivative of -d*4/4 + 4d*3/3 + 2. Find the third derivative of w(v) wrt v. -6 Let x(q) be the third derivative of 13q*7/210 - 7q*3/3 + 13q*2. Differentiate x(m) with respect to m. 52m*3 Find the second derivative of -8g + 0g + 12g + 13g2 wrt g. 26 Let n = 8 - 8. Find the second derivative of 0i*4 - 2i*5 + ni*4 + 4i wrt i. -40i3 Let z be 2 - 4/(-6)-3. Find the second derivative of a - 4a + za*2 + 2a*2 wrt a. 4 Let p = -1 + 0. Let i(q) = -2q. Let r be i(p). What is the third derivative of 3a2 + 3a2 - a2 - 3ar + 3a*4 wrt a? 72a What is the first derivative of 1227t2 - 5t*3 + 10 + 3t*3 - 1227t*2 + 13t wrt t? -6t2 + 13 Suppose -2 = w - 2w. Suppose -2d - 2u + 16 = 0, -wd + 5u - 13 - 6 = 0. Find the third derivative of -2r2 - 2r*6 + dr6 - r2 wrt r. 120r3 What is the first derivative of 100v + 95v - 295v + 114v - 14 wrt v? 14 Let k(g) = -11g*2 + 23g + g*3 - 6 + 6. Let z(b) = 4b*2 - 8b. Let l(t) = -4k(t) - 11z(t). Find the second derivative of l(m) wrt m. -24m Suppose 3r = 2m + 19, 0m + 22 = 3r + m. What is the derivative of 19u*3 - 19u*3 + 7u*4 - r wrt u? 28u*3 Let s(i) be the first derivative of -5i*6/2 - 20i*3/3 + 9. What is the third derivative of s(c) wrt c? -900c*2 Suppose -s + 4d + 16 = 0, 4d - d + 9 = 0. Suppose c - s = -3. Differentiate 0 + x + 1 - 1 + c wrt x. 1 Suppose l + 4l = 15. Suppose lu - 8u + 15 = 0. Find the second derivative of 3d5 + 4d - 2 + 2 - ud wrt d. 60d*3 Suppose 5m - 15 = 0, 4m = -3o + 1 + 11. Let b(w) be the second derivative of -1/6w4 + 0 + w + ow3 + w2. Find the first derivative of b(r) wrt r. -4r Differentiate 32 + 13 + 5501n*4 - 5526n*4 with respect to n. -100n*3 Find the second derivative of -7d - 343d3 + 343d*3 + 7d*4 wrt d. 84d*2 Let m(r) = -r. Let s be m(-5). Differentiate 3 + v + v - s wrt v. 2 Let v(q) = 11q*3 - 2q*2 + 39q - 2. Let f(g) = -33g3 + 7g*2 - 117g + 7. Let h(t) = 2f(t) + 7v(t). What is the second derivative of h(k) wrt k? 66k Let c be 1 + 3 + (0 - 0). Let q be c/12 + 14/3. Find the first derivative of 2m*3 - 4 + 4 + 3 - q wrt m. 6m2 Let z(k) = k2 + k + 1. Let w be 6/42/3. Let h(x) = 13x*2 + 7x + 6. Let d(s) = wh(s) - 6z(s). What is the second derivative of d(f) wrt f? 14 What is the first derivative of 11l + 8 - 3l - 11 wrt l? 8 Let h(j) be the second derivative of -j7/70 + j4/12 - 3j2/2 + 2j. Let x(i) be the first derivative of h(i). What is the second derivative of x(l) wrt l? -36l2 Let t(b) be the second derivative of -b7/7 + 3b*4/4 + 7b. Find the third derivative of t(u) wrt u. -360u2 Suppose 3 = -3g + 9. Suppose gz - 6z = -3o + 12, o = 2z + 4. Find the third derivative of 4i5 + 37i*3 - oi*2 - 37i*3 wrt i. 240i2 Let i(o) be the third derivative of -o8/1680 + o5/60 - o4/4 - 2o2. Let l(c) be the second derivative of i(c). Differentiate l(t) wrt t. -12t*2 Let t(a) be the third derivative of 7a*2 + 0a*4 + 0 - 1/60a*5 + 7/6a*3 + 0a. Differentiate t(y) wrt y. -2y What is the derivative of 4 - 5 + i2 + 4 - 2i*2 wrt i? -2i Find the second derivative of 19v5 + 38v + 8v5 - 2v5 - v5 wrt v. 480v3 Let b(c) = 0c2 - c - 4 + c2 - c + 4c. Let k be b(-4). What is the second derivative of s + 4s + 0sk - 2s - 3s4 wrt s? -36s*2 What is the first derivative of -15c + 19c + 38c + 38 wrt c? 42 Suppose 1 = -4l - 7. Let v = l - -3. Find the first derivative of 2j + 1 + v - 4j wrt j. -2 Suppose -i + 134 = 5y, 2y + 4i = i + 64. Suppose 4z - y = -10. What is the derivative of 2w*z + 2w*4 - 18w*2 + 4 + 18w*2 wrt w? 16w*3 Let i = 10 - 10. Differentiate 2d + id + 0d - 2 - 4d wrt d. -2 Let y be (1/(-3))/((-3)/18). What is the third derivative of -6i*2 - 18i*5 + 16i*5 + 2i*y wrt i? -120i*2 Let d = 5 + -3. Find the second derivative of -2v*2 + dv*3 + 2v + 4v2 - 2v*2 wrt v. 12v What is the first derivative of 30f3 + 0 - 6 - 23f*3 wrt f? 21f2 Let h(v) = v3 - v*2 + v + 3. Let y be h(0). Suppose -10 = -ym + 8. Find the third derivative of d*2 + m - 6 - 2d*4 wrt d. -48d Let x(r) = -7r4 - 2r*2 - 11. Let u(b) = -27b*4 - 9b*2 - 44. Let s(n) = -2u(n) + 9x(n). Find the first derivative of s(q) wrt q. -36q*3 Suppose 3p - 2b = 5 - 1, 4p + 2 = -b. Find the second derivative of 8g2 - 5g - 4g2 + pg wrt g. 8 Let t(p) = -63p2 + p - 8. Let w(h) = 188h*2 - 3h + 23. Let f(i) = -7t(i) - 2w(i). What is the second derivative of f(d) wrt d? 130 Let n(r) = 2r2 + 3r. Let g be n(-2). Find the third derivative of 5q4 - 4q*2 - 2q*4 + 0q*g wrt q. 72q Let t be 14/4 + (-9)/6. Let b be (-1)/t(-12)/3. What is the first derivative of 1 + 4g*b + g - g wrt g? 8g Let g(w) = -w - 9. Let f be g(-11). Suppose -3z + f = -1. Differentiate 2 + 0 + t - z with respect to t. 1 Find the second derivative of 443d*2 + 4d + 13d - 463d*2 wrt d. -40 Suppose 2 = i - 3. Let k(q) = -7 + 2 - 4q - 1 + iq. Let g(h) = h - 7. Let s(y) = -3g(y) + 4k(y). Differentiate s(d) wrt d. 1 Let b(u) be the third derivative of 4u5/15 - u4/6 - 21u2. What is the second derivative of b(h) wrt h? 32 Let s(l) be the second derivative of 2l - 1/12l4 + 0 + l3 + 0l2. Find the second derivative of s(j) wrt j. -2 Let h(w) = 1 + w2 + w + 3w - 4w + 5w. Let l(n) = -2n - 1. Let b = 0 - -5. Let c(z) = bl(z) + 2h(z). Differentiate c(i) with respect to i. 4i Let y(f) = -32f*2 - 17. Let b(j) = 31j*2 + 16. Let a(t) = -6b(t) - 5y(t). What is the derivative of a(c) wrt c? -52c What is the third derivative of 6n2 - 20n*2 + 9n*5 - 17n*5 wrt n? -480n*2 Let k(l) be the first derivative of -2l - 2 + 0l3 - 3/4l*4 + 0l*2. What is the derivative of k(j) wrt j? -9j*2 Let z(x) = -4x*3 - 8x*2 + 3x - 3. Let n(o) = 8o3 + 15o*2 - 5o + 5. Let j(f) = 3n(f) + 5z(f). Find the third derivative of j(p) wrt p. 24 Let v(y) = y*2 + 9y + 11. Let r be v(-8). Find the second derivative of -rj - j3 + 5j - 5j wrt j. -6j Find the second derivative of 4x5 - 2x - 2x + 8x wrt x. 80x3 Let b(p) be the second derivative of -p + 0 + 3/10p*5 + 4p*2 + 0p*4 + 0p*3. Differentiate b(v) wrt v. 18v*2 Find the third derivative of 3c*4 - 6c*2 + 0c*4 + 12c*2 wrt c. 72c Let s = -9 + 15. Differentiate -2 - 369g2 + 369g*2 - sg*3 with respect to g. -18g2 Let b(m) be the second derivative of m7/70 - 5m4/24 + m2/2 - 4m. Let k(d) be the first derivative of b(d). Find the second derivative of k(l) wrt l. 36l2 Let x(f) be the first derivative of 5f2/2 + 5. Let o(b) = -b2. Let n(r) = -6o(r) - x(r). What is the second derivative of n(y) wrt y? 12 Let d be ((-2)/(-1))/((-2)/(-4)). What is the third derivative of 3l2 - ld - 4l6 - 4l6 + l4 wrt l? -960l3 Let x(c) = -18c - 1. Let q be x(-2). Let j be 8/(-5)q/(-14). Find the first derivative of 4b + b*j - 3b - b + 1 wrt b. 4b3 Let w(i) = i - 1. Let q(f) = -5f*2 - f + 22. Let v(s) = -q(s) + w(s). What is the first derivative of v(r) wrt r? 10r + 2 Let k(d) be the second derivative of d7/1260 + d5/24 - d*4/6 - 4d. Let v(w) be the third derivative of k(w). Differentiate v(h) with respect to h. 4h Let k(x) = 9x*4 - 5x*3 - 5x*2 - 19. Let d(z) = -18z*4 + 9z*3 + 9z*2 + 39. Let s(p) = 5d(p) + 9k(p). Differentiate s(a) wrt a. -36a3 Let n(i) = -i3 - 5i2 + 8i + 4. Let g be n(-6). Let s = 11 + g. What is the first derivative of 8y2 - 8y*2 - 2 + 2y*s wrt y? 6y*2 Let n(z) = -3z*2 - 3. Let g(a) = -5a*2 - 5. Let l(h) = -5g(h) + 8n(h). Find the first derivative of l(i) wrt i. 2i Suppose -4y - 23 + 7 = 0. Let t(u) = -u2 - 2. Suppose -2b = -9 + 3. Let o(l) = -2. Let f(c) = bt(c) + yo(c). Find the first derivative of f(z) wrt z. -6z What is the derivative of -10 - 13h4 - h4 - 1 - 4h4 wrt h? -72h*3 Let c(n) = 39n*2 + 9n - 57. Let w(x) = -19x2 - 5x + 28. Let q(k) = -5c(k) - 9w(k). What is the first derivative of q(p) wrt p? -48p Find the first derivative of 15 + 5 - 46s + 29 + s wrt s. -45 Let p(k) = -21k + 15. Let i(c) = 10	{ "pile_set_name": "DM Mathematics" }
j + 98408j2. j3 + 78268j2 Collect the terms in 85384j + 39995j3 - 85384j. 39995j3 Collect the terms in -3g + 162 + 76 - 415 + 91 + 86. -3g Collect the terms in 11p + 1007p2 - 929p*2 - 31p + 20p. 78p*2 Collect the terms in 9711a + 9753a - 41a*2 - 38978a + 9756a + 9761a. -41a2 + 3a Collect the terms in v - 1646 - 1520 + 3190. v + 24 Collect the terms in -452942r - 452957r + 905920r. 21r Collect the terms in 47i3 + 37 + 14 + 44i*3 - 138i*3 + 41i*3. -6i*3 + 51 Collect the terms in -114v*2 + 7844900161 - 7844900161. -114v*2 Collect the terms in -109x + 124x + 6x*3 + 2 - 9x*3. -3x*3 + 15x + 2 Collect the terms in -2504379 + 8y3 + 2y*3 - 13y*3 + 5y*3 + 2504379. 2y*3 Collect the terms in -s - 5s + 9s - 5s + 3s - 18830. s - 18830 Collect the terms in 30719v - 63764v - 70046v - 918v. -104009v Collect the terms in 2044v - 4276v + 2453v. 221v Collect the terms in -30o + 5 - 3 - 4 + 6277o*2. 6277o*2 - 30o - 2 Collect the terms in 2311861z + 10z*2 + 11z*2 - 2311834z - 20z2. z2 + 27z Collect the terms in 1028002t3 - 490 + 490. 1028002t*3 Collect the terms in -1823k*3 + 1484k*3 + 0k*2 + 0k*2 + 1151k*3. 812k*3 Collect the terms in -8w*2 - 378723w - 378870w + 757593w. -8w2 Collect the terms in 2208u*3 + 1718u*3 - 1048u*3. 2878u*3 Collect the terms in -83a*3 + 412a + 16a3 - 412a + 38a3 + 14a*3. -15a*3 Collect the terms in -8b*2 - 1517b - 53b + 1570b + 10b2. 2b*2 Collect the terms in -1650b*2 - 183b + 781b2 + 834b*2. -35b*2 - 183b Collect the terms in -259369 - 259376 + 518745 - 7i3. -7i*3 Collect the terms in 2313403y + 2 + 2313402y - 4626823y. -18y + 2 Collect the terms in 360 + 160616m*2 - 165 - 160612m*2 - 195. 4m*2 Collect the terms in 2p + 927 - 296 - 329 - 257. 2p + 45 Collect the terms in 973k + 1000k + 991k - 3008k. -44k Collect the terms in 2w3 - 212 - 13w + 21492417w2 - 21492417w*2. 2w*3 - 13w - 212 Collect the terms in 119 + 254p + 462p + 225p. 941p + 119 Collect the terms in 4 - 10 + 3 + 6 + 13t3 - 2045t + 1884t. 13t*3 - 161t + 3 Collect the terms in 678 + 682 - 802 + 679 - 14f - 1237. -14f Collect the terms in -5095 - 5092 + 15288 - 5101 + 53u. 53u Collect the terms in 218w - 1036w*3 - 695w*3 - 1 - 108w - 109w. -1731w*3 + w - 1 Collect the terms in 63155y - 2 - 39054y + 2. 24101y Collect the terms in 739r + 2r*3 - 4r*3 + 133r + 164r - r2. -2r3 - r2 + 1036r Collect the terms in -33w + 6w + 27w - 9282w2. -9282w*2 Collect the terms in 549y + 560y - 3330y + 555y + 546y + 564y + 555y. -y Collect the terms in -1108108m - 9024852m + 2 - 20394590m. -30527550m + 2 Collect the terms in -58842 - 4b - 2218b*2 + 2b + 2216b2. -2b*2 - 2b - 58842 Collect the terms in -14577l + 4848l + 4893l + 4876l. 40l Collect the terms in -132 - 494o + o*2 + 534o*3 + 494o. 534o3 + o2 - 132 Collect the terms in 646 - 17x + 915 + 638 - 2199. -17x Collect the terms in 3 - 151l - 464l - 171l + 12. -786l + 15 Collect the terms in -390d - 534d - 489d - 31d - 834d. -2278d Collect the terms in -1 - 24730m + 49455m - 24725m - m*2 - 377m*3. -377m3 - m2 - 1 Collect the terms in 4818x2 + 50341x + 296x2 - 50341x + 1790x2. 6904x*2 Collect the terms in 12874k*3 - 3k + 3k + 42696k*3. 55570k*3 Collect the terms in 20x*2 - 14x*2 - 1206x*3 + 3605x*3 - 6x*2. 2399x*3 Collect the terms in 8o*3 + 305734210175 - 305734210175. 8o*3 Collect the terms in -54 + 38m - 19m - 12m - 9m + 46. -2m - 8 Collect the terms in -2925f2 + 6560 - 1554f*2 - 6560. -4479f*2 Collect the terms in -30w*2 - 225w + 5w2 + 11w*2 + 2w*2. -12w*2 - 225w Collect the terms in 5c2 - 2c2 + c - c2 + 2895 - 2890 - 5c2. -3c*2 + c + 5 Collect the terms in -271m + 260m - 5216562 + 5216564. -11m + 2 Collect the terms in -31k3 - 443k + 443k - 816 + 1788 - 972. -31k*3 Collect the terms in 5 - 6 - 15 + 9d*3 - 18d*3 - 4. -9d*3 - 20 Collect the terms in 2j*2 + 19310 - 942820 + 27397. 2j*2 - 896113 Collect the terms in 33a - 327a3 - 33a + 4911a3. 4584a*3 Collect the terms in 113v + 116v - 16 - 12 + 43 - 15 - 225v. 4v Collect the terms in 210l - 892l + 3 + 230l + 219l + 237l. 4l + 3 Collect the terms in 11028576g + 11028579g - 33085627g + 11028472g - 4g*3. -4g*3 Collect the terms in -8 + 87 + 59 - 28 + 56a. 56a + 110 Collect the terms in 976648r*3 - 488525r*3 - 488066r*3 + 1. 57r*3 + 1 Collect the terms in -12165 + 5650 + 23t*2 - 13485 - 2t. 23t2 - 2t - 20000 Collect the terms in -4 + 15049l - 1 - 9 + 13. 15049l - 1 Collect the terms in -11820q + 3987q - 27209q. -35042q Collect the terms in -311277187215v3 - 311277187213v*3 + 622554374431v*3. 3v*3 Collect the terms in 1 + 16536041n - 16536874n - 1. -833n Collect the terms in 105o + 189o + 172o - 689o + 91o. -132o Collect the terms in -2820d + 1564d + 1710d. 454d Collect the terms in 2l - 2l - 6l2 - 8762 + 17522 - 11l*2 - 8762. -17l*2 - 2 Collect the terms in 229x*3 + 102x*3 + 5x*2 - 167x*3. 164x*3 + 5x*2 Collect the terms in -91x*3 + 237 + 208 - 5x*3 - 2x*2 + 16x*2 - 446. -96x*3 + 14x*2 - 1 Collect the terms in -59h*3 - 364702h*2 + 364702h*2. -59h*3 Collect the terms in 32266085 + c - 10755211 - 10755437 - 10755437. c Collect the terms in 477r + 79439 - 39721 - 39718. 477r Collect the terms in 536i*3 - 2 - 274i3 + i2 - 273i3 + 57i. -11i3 + i2 + 57i - 2 Collect the terms in 32810a2 + 29172 - a - 29172. 32810a*2 - a Collect the terms in -43n3 - 719051 - 719074 + 1438125 + n3. -42n3 Collect the terms in -13184 - 13349 - 151y + 26533. -151y Collect the terms in -599 + 1144 - 545 - 951k. -951k Collect the terms in -9351 + 7i*3 + 9344 - 5i*3 + 8i*3. 10i*3 - 7 Collect the terms in 2a - 3a2 + 197a*3 - 336a*3 + 900a*3 + 6a*2. 761a*3 + 3a*2 + 2a Collect the terms in -3177127132 + 3177127132 - 6i3 + i3. -5i*3 Collect the terms in -30 + 35172g*2 - 49927g*2 + 16 + 14. -14755g*2 Collect the terms in 2441n - n*2 + 2439n + 2443n - 9759n + 2437n. -n2 + n Collect the terms in -d - d + 0d + d - 82714 - 111734. -d - 194448 Collect the terms in -244i2 + 70i*2 - 1197 + 598 + 599. -174i*2 Collect the terms in -24311164717y + 6y3 + 24311164717y. 6y3 Collect the terms in -2798l + 1405l - 20l*2 + 1393l. -20l2 Collect the terms in 146 - 18838651575v*2 + 18838651573v*2 - 146. -2v*2 Collect the terms in -356t*2 - 532t*3 - 550t*3 - 534t*3 - 2541t*2 + 1665t*3. 49t*3 - 2897t*2 Collect the terms in -15601285o + 15601285o - 18o*2 + 42. -18o*2 + 42 Collect the terms in 537m*3 + 549m*3 - 1073m*3 - 828m*3 - 1349m*3. -2164m3 Collect the terms in o2 + 1174654 - 2349304 + 1174652 - 2o2. -o2 + 2 Collect the terms in 32f - 869 - 25f - 468. 7f - 1337 Collect the terms in 184f3 - 930f*3 + 18f*2 + 178f*3 + 560f*3. -8f*3 + 18f*2 Collect the terms in 85 - 85026047d*2 + 85026054d*2 - 85. 7d*2 Collect the terms in 1830u*3 + 42u*3 - 1141u*3 + 2262u*3. 2993u*3 Collect the terms in -192270 - 20105y*3 + 192270. -20105y*3 Collect the terms in -946 + 1813 - 867 - 17u*3 - 3u. -17u3 - 3u Collect the terms in -163 + 50 - 13a3 + 2a*3 + 58 + 55. -11a*3 Collect the terms in 6970y*3 + 1265y*3 - 1710y + 1709y. 8235y*3 - y Collect the terms in -1014017v - 1013946v + 2027969v. 6v Collect the terms in -2u + 124u2 + 175u*2 - 4u + 6u - 287u*2. 12u*2 Collect the terms in -7g + 7g - 7650g*2 + 3983g*2 + 3663g*2 + 29. -4g*2 + 29 Collect the terms in -t + 36t - 2151t2 - 35t. -2151t2 Collect the terms in 26l*3 + 426l - 425l - 29l*3. -3l*3 + l Collect the terms in 818p + 5 - 1621p - 5 + 824p + 0. 21p Collect the terms in 1250 + 1257 + 1251 + 1079c*2 - 3758 + 5752c*2. 6831c*2 Collect the terms in -2 - 84 - 75 - x + 161 + 5x + 276x2. 276x*2 + 4x Collect the terms in 154a + 269a**2	{ "pile_set_name": "DM Mathematics" }
cement from rrrkkrkkkkrrr. 42/143 Calculate prob of picking 1 c and 2 t when three letters picked without replacement from {z: 4, e: 1, t: 2, c: 3, o: 2}. 3/220 Calculate prob of picking 1 k and 2 n when three letters picked without replacement from ljjnjnsnjnnssnnk. 3/80 Four letters picked without replacement from pppppppeep. What is prob of picking 4 p? 1/3 What is prob of picking 1 b and 2 r when three letters picked without replacement from bbbbbrbbbobroobbrbbo? 13/380 Two letters picked without replacement from rrrvvrrvttv. Give prob of picking 2 v. 6/55 Three letters picked without replacement from xxxyybqqqyxyl. Give prob of picking 1 y and 2 l. 0 What is prob of picking 2 u when two letters picked without replacement from gwugqpxu? 1/28 Calculate prob of picking 1 r and 1 t when two letters picked without replacement from {r: 4, b: 2, z: 1, m: 1, t: 2}. 8/45 Three letters picked without replacement from {u: 17, g: 1}. What is prob of picking 1 g and 2 u? 1/6 Four letters picked without replacement from {l: 8, e: 4, g: 4}. Give prob of picking 3 l and 1 e. 8/65 Calculate prob of picking 1 v and 1 w when two letters picked without replacement from {w: 8, v: 5, r: 5, k: 1}. 40/171 What is prob of picking 3 x when three letters picked without replacement from xxxzxxxxzzxzz? 28/143 What is prob of picking 1 j and 2 u when three letters picked without replacement from {v: 1, j: 2, m: 5, u: 8}? 1/10 What is prob of picking 1 x and 1 h when two letters picked without replacement from {h: 4, x: 1, s: 2, z: 1}? 1/7 Two letters picked without replacement from kkopo. What is prob of picking 1 p and 1 k? 1/5 Calculate prob of picking 1 s, 1 p, and 1 f when three letters picked without replacement from {m: 2, f: 7, s: 4, p: 2, r: 1}. 1/10 What is prob of picking 1 x and 1 y when two letters picked without replacement from yyrxc? 1/5 Two letters picked without replacement from {u: 1, b: 1, s: 1, e: 1, h: 1}. What is prob of picking 1 u and 1 e? 1/10 Calculate prob of picking 2 u and 2 i when four letters picked without replacement from {z: 4, i: 10, n: 1, u: 3}. 3/68 Calculate prob of picking 2 a when two letters picked without replacement from aaaaaaa. 1 Three letters picked without replacement from ooooeoogoeg. What is prob of picking 1 o and 2 g? 7/165 Calculate prob of picking 2 l when two letters picked without replacement from {l: 6, z: 8, j: 1, n: 1}. 1/8 Three letters picked without replacement from drkrkrrrrdrrkkrkrrk. Give prob of picking 2 k and 1 d. 10/323 Calculate prob of picking 1 g and 2 s when three letters picked without replacement from llgllgsggsl. 4/165 What is prob of picking 1 w and 2 y when three letters picked without replacement from ntnnywttnwy? 2/165 What is prob of picking 2 p when two letters picked without replacement from {p: 3, x: 8}? 3/55 What is prob of picking 2 m when two letters picked without replacement from {h: 1, l: 1, m: 2}? 1/6 What is prob of picking 3 f and 1 a when four letters picked without replacement from ffffffafaffa? 28/55 What is prob of picking 3 x and 1 e when four letters picked without replacement from xeuxeeuxxxxxuue? 4/39 What is prob of picking 2 h when two letters picked without replacement from {j: 2, h: 2, r: 11}? 1/105 Three letters picked without replacement from emxemmxeeeeemxmamx. Give prob of picking 1 a, 1 x, and 1 e. 7/204 Calculate prob of picking 1 u and 2 s when three letters picked without replacement from {b: 5, h: 4, u: 6, s: 1}. 0 Calculate prob of picking 2 k when two letters picked without replacement from {c: 3, k: 15}. 35/51 Three letters picked without replacement from lllolllllllo. Give prob of picking 1 o and 2 l. 9/22 Three letters picked without replacement from {u: 15, v: 3}. Give prob of picking 2 v and 1 u. 15/272 What is prob of picking 1 d and 1 m when two letters picked without replacement from mmmmmmdmmmmmmmmmmmmm? 1/10 What is prob of picking 1 a and 1 g when two letters picked without replacement from {i: 4, a: 2, g: 3, y: 6}? 2/35 What is prob of picking 1 m, 1 z, and 2 f when four letters picked without replacement from amlazaaafmlzf? 4/715 What is prob of picking 4 d when four letters picked without replacement from {d: 7, r: 5, i: 6, y: 1}? 35/3876 Calculate prob of picking 2 n and 2 j when four letters picked without replacement from {j: 9, n: 2}. 6/55 What is prob of picking 3 t and 1 w when four letters picked without replacement from {w: 5, t: 9}? 60/143 Two letters picked without replacement from xelllllxllxleelllll. What is prob of picking 1 e and 1 l? 13/57 Three letters picked without replacement from ddsdsdssddssdsdddsss. Give prob of picking 1 d and 2 s. 15/38 What is prob of picking 1 m and 1 j when two letters picked without replacement from yymuuuymjmu? 3/55 What is prob of picking 2 l and 1 n when three letters picked without replacement from nlnlnlnxnnl? 12/55 What is prob of picking 2 c when two letters picked without replacement from ddddtcddddddd? 0 What is prob of picking 3 b when three letters picked without replacement from {v: 2, b: 5}? 2/7 What is prob of picking 1 i and 2 j when three letters picked without replacement from iiiijiiiiij? 3/55 Calculate prob of picking 2 r and 2 w when four letters picked without replacement from {r: 9, w: 2}. 6/55 Two letters picked without replacement from voolqoqoivqvoooonl. What is prob of picking 1 v and 1 i? 1/51 What is prob of picking 4 n when four letters picked without replacement from {o: 5, a: 3, z: 1, n: 6}? 1/91 Calculate prob of picking 2 k and 1 b when three letters picked without replacement from bbkbkkbbbkkbbbkkbkk. 120/323 Three letters picked without replacement from dokkodhkhowwwhww. Give prob of picking 1 h, 1 k, and 1 o. 27/560 Two letters picked without replacement from {k: 6, n: 1, g: 1, c: 3, z: 2}. Give prob of picking 1 g and 1 c. 1/26 Three letters picked without replacement from ffofmffffkkmfqoffom. What is prob of picking 1 q, 1 m, and 1 o? 3/323 Two letters picked without replacement from {a: 2, d: 1, w: 1, x: 1, k: 2}. Give prob of picking 1 d and 1 x. 1/21 Two letters picked without replacement from {r: 4, k: 5, a: 5}. Give prob of picking 2 k. 10/91 Four letters picked without replacement from rseiwsijj. What is prob of picking 2 i, 1 e, and 1 w? 1/126 What is prob of picking 1 y and 1 x when two letters picked without replacement from {x: 1, a: 2, y: 1}? 1/6 What is prob of picking 4 y when four letters picked without replacement from {c: 5, y: 8}? 14/143 Three letters picked without replacement from lssllznnunnsllslnrsn. Give prob of picking 1 u, 1 s, and 1 n. 1/38 Two letters picked without replacement from ubppppuuppuuppppppb. What is prob of picking 2 b? 1/171 Calculate prob of picking 1 d, 1 p, and 2 v when four letters picked without replacement from qvdvdvpqdvd. 4/55 Two letters picked without replacement from rrjsshjshsrsrrnj. What is prob of picking 1 h and 1 n? 1/60 Calculate prob of picking 2 z when two letters picked without replacement from zrrzrrrrrrz. 3/55 Two letters picked without replacement from rweotwrttrm. Give prob of picking 2 r. 3/55 What is prob of picking 4 o when four letters picked without replacement from {x: 1, o: 4, w: 2}? 1/35 What is prob of picking 1 a, 2 q, and 1 h when four letters picked without replacement from {y: 4, b: 3, a: 2, q: 2, h: 2, i: 1}? 4/1001 Calculate prob of picking 2 k when two letters picked without replacement from {x: 3, k: 4}. 2/7 What is prob of picking 1 f and 1 z when two letters picked without replacement from {p: 1, z: 1, f: 3, b: 2}? 1/7 What is prob of picking 2 z when two letters picked without replacement from zzazdxxdz? 1/6 Two letters picked without replacement from {j: 1, w: 3, h: 1}. Give prob of picking 2 w. 3/10 Two letters picked without replacement from nneuunnnnnnnnn. What is prob of picking 2 n? 55/91 Four letters picked without replacement from {v: 4, x: 6, p: 2, j: 4, m: 2, r: 2}. What is prob of picking 2 x, 1 j, and 1 p? 8/323 What is prob of picking 1 n, 2 y, and 1 m when four letters picked without replacement from {w: 3, u: 3, n: 2, m: 3, y: 2}? 6/715 Calculate prob of picking 1 l and 1 o when two letters picked without replacement from llooloo. 4/7 Two letters picked witho	{ "pile_set_name": "DM Mathematics" }
2 - -3 - (-3 + 8))? 4 9 - 2 - (-8 + 14) 1 2 + -6 + 9 + -6 + 2 1 Calculate -1 + (-8 - -6) + 1. -2 (-3 - 1) + -6 - (-1 + -5) -4 Calculate (-1 - 2) + 3 + 4 - 4. 0 -90 + 92 - (-1 - 2) 5 What is the value of 9 - (11 + -8 - -8)? -2 What is -6 + -9 + 4 + 7? -4 What is the value of -5 - 0 - (1 + -4 + 2)? -4 Evaluate 4 + 3 + -6 + 1. 2 Calculate 3 + -4 + 1 - 1. -1 What is 13 + (-1 + -2 - 16)? -6 Calculate -39 + 37 - (0 - 1). -1 Evaluate (-3 - -1) + 6 + 3 + -8. -1 What is the value of (4 - (-1 + 1)) + -7? -3 Evaluate 1 + 2 - (1 + 3 - 5). 4 Evaluate 18 - 32 - (-3 - 1). -10 What is the value of 3 + (4 - -1) + -2 + -2? 4 What is 2 + (0 - -1 - 0) - 1? 2 Calculate -3 - (-1 + (3 + 3 - 3)). -5 What is -1 - 5 - (-44 + 47)? -9 What is the value of (0 - -7) + -3 - -1? 5 Evaluate (-1 - 0) + (10 - 14). -5 Evaluate 15 + 1 + -6 + -10. 0 What is the value of (5 + -9 - 2) + 2 + 12? 8 Evaluate 2 + -7 + 1 + (0 - 0). -4 4 - (4 - (1 - 1)) 0 Calculate 13 + -16 - 7 - -8. -2 Evaluate (3 - (-3 + 3)) + 0. 3 What is the value of -4 + 7 + 0 + -1? 2 7 + (8 - 7 - 10) -2 What is the value of -10 - (4 - 6 - 6)? -2 What is the value of (1 - 4 - -4) + 1 - -2? 4 What is (-2 - 0 - -4) + -6? -4 -1 + 1 + 1 + 4 5 Evaluate 8 - 9 - ((-1 - 1) + -2). 3 Calculate 58 - 53 - (-5 - (0 - 2)). 8 What is -14 + 1 - (-35 - -27)? -5 What is 6 - (2 + (2 - 0) + -6)? 8 What is -4 + (2 - (6 - 3))? -5 -2 - (-1 - 1) - -4 4 Evaluate (-3 + 2 - 6 - -4) + 1. -2 (1 - ((3 - 2) + -1)) + -4 -3 What is the value of 2 - (-4 + 2 - -1 - -2)? 1 2 - (-4 - -12 - 3) -3 What is the value of -3 - -6 - (6 - 2)? -1 Evaluate -3 - (-3 - -5) - (1 + -3). -3 What is the value of 19 + -10 + -3 + 3? 9 Evaluate (10 - (15 - 12)) + -12. -5 What is the value of -3 + (2 - ((-2 - -2) + 0))? -1 What is -2 + (-2 - (0 + -7))? 3 Calculate 16 + -10 - (7 - (-2 + -2)). -5 Calculate (-3 - -9 - 8) + 6. 4 -8 - -3 - (0 + 0 + -2) -3 Calculate 1 + -10 - (6 - (15 - 5)). -5 1 + 11 - (8 - 2) 6 Evaluate 14 + -2 - (6 + -1 - 1). 8 What is 3 + -6 + 2 + 3 + -2? 0 -13 - (13 + -18 + 2) -10 0 - (-5 - -9) - (6 + -6) -4 19 + (-2 - 6 - 3) 8 Calculate (5 - 2) + -4 + (5 - 5). -1 Calculate 1 + -9 + (13 - -2) + -14. -7 Evaluate 6 + (2 - (-1 - -4)) + 1. 6 What is (-3 - 3) + (4 - (-3 - -2))? -1 What is the value of -12 + 5 + 2 + -1? -6 What is the value of 6 + (-14 - -10) - (4 - -1)? -3 -4 + (-4 - -4 - (-9 + 5)) 0 Evaluate 1 + -2 - -2 - (11 - 6). -4 Evaluate -8 + ((9 - 5) + -4 - -3). -5 What is the value of -17 + 11 - (-3 + 1)? -4 Calculate 0 - (-11 + 15) - 3. -7 Calculate (-23 - (9 + -22)) + 6 + -1. -5 -10 - -4 - (0 + -4) -2 Evaluate -2 + (3 - -4) + -9 + 1. -3 What is 2 - 0 - (-1 - -2 - -1)? 0 Evaluate (-4 + 6 - 3) + 4. 3 What is the value of 0 + 1 + (16 - 14)? 3 What is 7 - 6 - (0 + -2)? 3 What is the value of (-2 - 1) + (3 - (2 + 0))? -2 Calculate 2 + (52 + -60 - (-1 + 4)). -9 What is the value of 9 - ((1 - 5) + 5)? 8 2 + 4 - (6 + (0 - -6)) -6 What is -6 - (-2 - 4) - -6? 6 What is -6 + 15 + 1 + -5 + -6? -1 ((-6 - -3) + 6 - -2) + -9 -4 Evaluate -12 - (-19 + (20 - 10)). -3 What is the value of (1 - (6 + -1) - -3) + 5? 4 5 + -6 - (1 + -5) - -1 4 What is -4 + -4 + 5 - 1? -4 2 - (-1 + -4 + 3) 4 What is 2 + -2 - (6 + -10)? 4 Evaluate (-124 - -124) + (7 - (1 - 3)). 9 Evaluate -5 - (1 - 9) - (1 - 0). 2 What is the value of (3 - 3) + 2 + 1 + 2? 5 What is the value of (1 - (-2 + 0) - 3) + -7? -7 What is (17 - 9) + -17 - -10? 1 What is -2 + 1 + 1 + (51 - 50)? 1 Calculate 3 + -6 + (-10 - -13) + -7. -7 What is the value of 3 + (-1 - -2) + 10 + -10? 4 What is the value of 4 + -6 - (-5 + 0)? 3 What is the value of 4 + -1 + -4 + (1 - -3)? 3 What is the value of 4 + (-16 - (-6 - 2))? -4 Calculate (-10 - -4) + (10 - -1) + 0. 5 What is -1 + 4 + (2 + -12 - -8)? 1 What is -9 - (-1 - (5 - 4 - -1))? -6 Calculate (-1 - -4) + -6 + (2 - -4). 3 Calculate 11 + (-1 - -7 - 12). 5 (10 - 3) + -5 + -2 + 4 4 What is the value of -1 + 1 - (-6 - -2)? 4 (-67 - -63) + (-3 - (-3 - -2)) -6 What is the value of (-9 - -3 - -1) + 9? 4 What is (3 - -1) + (-4 - -5)? 5 What is the value of (8 - (1 + 0)) + 3 + -16? -6 What is the value of (-3 - -6 - 8) + 5 + -3? -3 What is the value of (5 - 14) + 2 - -14? 7 (-9 + 2 + 11 - 14) + 2 -8 Evaluate 4 + (-7 - -10) - 4. 3 (2 - 6 - -8) + 1 5 Evaluate 2 + 4 - (0 + -3). 9 -1 + 0 + 1 + 1 1 What is -16 - -22 - ((-1 - -1) + 8)? -2 What is the value of -3 + 7 + 1 + (-2 - 3)? 0 What is the value of (-9 - -8) + (-2 - -2)? -1 Evaluate 1 + (-2 + 4 - 6) + 8. 5 Evaluate -5 - -21 - (1 - -7). 8 Calculate -4 + (7 - 2 - 4) + 2. -1 What is the value of 4 + -2 + 3 - 3? 2 Evaluate (-8 - 3) + 1 + 7. -3 -3 + -1 + (0 - 5) + 12 3 What is -1 - (1 - 1 - (11 + -10))? 0 What is -10 - -2 - (0 + -6)? -2 What is the value of -1 - (-10 + 11 - (1 + 4))? 3 Evaluate 5 + -2 + (2 - -1) + 1. 7 What is -6 - ((-5 - -1) + 3)? -5 What is the value of (0 - (-5 - -4)) + 7 + -11? -3 -4 + 8 - (-1 + 6) -1 Evaluate 13 + -4 + 3 + -4. 8 (-12 - -5 - 0) + (6 - -7) 6 Calculate -7 - (21 + -11 + -16). -1 Calculate -1 - (-2 + 7 - 4) - -1. -1 What is the value of (-7 - -2) + 2 - (1 - 5)? 1 What is the value of -3 + (2 + -5 - -1)? -5 Calculate 5 + 3 + -10 + 6. 4 Calculate -6 + 5 + (-2 - (-4 - -5)). -4 Evaluate (2 - -11) + (-4 - (6 + -2)). 5 What is (13 - 11) + 2 + 0 + -1? 3 1 + 2 - 3 - 4 -4 What is 0 + (-3 - 1) + 6? 2 -4 + -9 + 16 - (1 - -6) -4 Calculate 0 - (-5 + (6 + -8 - 0)). 7 What is the value of (7 - 7) + (3 - 2)? 1 4 + -6 + 3 - -1 - -4 6 6 - (2 - -1) - (-6 - -11) -2 Evaluate (5 - (7 + -3 - 1)) + 2. 4 What is 31 + -22 - (7 - (2 + -1))? 3 Evaluate -3 + -8 + 4 + 4. -3 What is the value of 9 + (-1 - ((-2 - -8) + -1))? 3 What is the value of 7 + -2 + -14 + 0 - -5? -4 Evaluate 1 + -2 - (-10 + 5) - 4. 0 Evaluate 7 + -5 - 5 - -2. -1 What is 3 + -1 + (3 - 4)? 1 Evaluate (4 + -6 - 2) + 1. -3 2 - 0 - (-20 + 6 - -15) 1 Evaluate (-4 - -8) + (6 + -3 - 7). 0 What is (8 - 1) + (-64 - -60)? 3 What is the value of 2 + (-17 + 5 - -17)? 7 Evaluate 0 - (-11 + (0 - -5)) - 13. -7 Evaluate -11 - (-7 - -6 - (-2 + 2)). -10 What is 1 - (-8 - -5 - 6)? 10 Evaluate 5 + (5 - 6) - 2. 2 Calculate 7 + 8 + -6 - 7. 2 What is -6 + 2 + (6 - 5)? -3 What is -8 + 2 + (7 - -6) + -7? 0 Calculate -4 + 4 + 4 + -3 + 3. 4 Calculate -1 + -2 - (5 - 14 - -4). 2 What is the value of ((-4 - -13) + -3 - 4) + 0? 2 Evaluate 13 + (3 - 8) - 1. 7 What is the value of 0 - -3 - (2 + (7 - 2))? -4 Calculate 3 + (-12 - -3) + 3 + 2. -1 What is -1 + (-5 - -8 - -1)? 3 Evaluate -3 - -2 - (-7 - -1). 5 What is the value of (0 - -4) + -8 + 7? 3 What is -1 + 1 + (-34 - -37) + 1? 4 What is the value of 5 + (-6 + -4 - -5)? 0 (0 - -4) + (0 + -8 - -5) 1 2 - (5 + -8) - 3 2 Evaluate -1 + (-7 - (3 + -14)). 3 Calculate (-5 - (1 - 2 - 7)) + 0. 3 Calculate 2 - (-4 + 8) - (-6 + 1). 3 Calculate 8 + -1 - (1 - -3). 3 Evaluate -18 + (3 - -21) + (-12 - -1). -5 What is the value of (2 - (2 + 2)) + 6? 4 Calculate 13 + -6 + 8 + 3 + -9. 9 What is 7 + -9 + 6 + (-3 - 0)? 1 What is 1 + (-4 - (10 + (-8 - -2)))? -7 What is the value of (-2 - (-6 + 1)) + 2? 5 Calculate 4 - (11 + -11) - 9. -5 Calculate -1 + (-2 + 3 - (3 - 1)). -2 Calculate 1 + -3 + 2 + -6 + 3. -3 31 + -39 + 4 + -1 -5 Calculate 1 - ((-3 - -5) + -3 - 1). 3 (0 - (8 + -4) - -5) + -7 -6 0 + (-3 - -9 - (-2 - -5)) 3 Evaluate -2 + (4 - -2) + -1 + 4. 7 Calculate -17 + (-9 - -18) - 0. -8 Evaluate (10 - (8 - 4)) + -2. 4 Calculate 0 + (1 - -1 - (-2 + 8)). -4 Calculate 4 + 0 - (-5 + 6 + -2). 5 -3 + (-7 - (2 + -18)) 6 What is the value of 4 + -4 + -3 + -3 - -1? -5 What is the value of -1 + (5 - 5 - (-2 + 0))? 1 Calculate -36 + 33 + -1 + 0 + -1. -5 What is 1 + 5 + (-20 - -10)? -4 Evaluate 10 + 2 + -13 - 6. -7 Calculate (2 - -3) + -4 - (0 - 5). 6 Evaluate (-5 - -18) + -6 + -10. -3 Evaluate 9 + -4 + 2 + -2. 5 What is 1 - (11 + (1 - 9))? -2 (4 - (3 + -1)) + -1 1 Evaluate (-5 - 2) + (3 - 3). -7 What is the value of 10 - (-5 - (-9 + 7 + -3))? 10 Evaluate -6 - (-12 - (2 + -7)). 1 What is 1 - 0 - (-7 - -7)? 1 (-8 - -1) + (-4 - -3) + 4 -4 -2 + 8 + 0 + -6 0 -1 + -1 - ((-6 - -5) + 0) -1 7 - ((-1 - 5) + 7) - 4 2 Calculate -1 + (4 + -10 - -3) + 0. -4 What is 1 + (7 - 3) + 1 + -4? 2 -3 + (1 - 1) - (15 + -17) -1 What is the value of -2 + (1 - 0) - (4 - 3)? -2 Calculate 4 + -6 - (-6 + 4 - 3). 3 1 + -1 + -1 + 14 + -18 -5 Calculate -7 + (-2 - -5) + 3. -1 Evaluate -10 - -7 - 4 - -6. -	{ "pile_set_name": "DM Mathematics" }
e 2b - 6 = -2u, -2b + 3b = fu + 8. Suppose 0s - s - 2 = 0. Which is smaller: u or s? s Let a be (6 + 280/(-15))6/2. Let f be (-2)/6(-18)/a. Is 0 at most f? False Suppose -1058m - 15768 = -1067m. Is m at most as big as 1751? False Let q = 335 + -336. Which is greater: q or 3/394? 3/394 Let u(i) = 15i + 225. Let b be u(-15). Let y be ((-14)/6)/((-1)/3). Suppose w = -y - b. Is 1 >= w? True Let z(y) = -y3 - 2y*2 + 4y. Let i be z(-4). Let c = 37 - i. Let w be ((-14)/c)/((-6)/(-9)). Is 4/11 less than w? False Let h = 1013/168 - 35/24. Let g = 6 - 0. Which is smaller: g or h? h Let w = 3 + -1. Suppose wl - 5 = -31. Is l at least -12? False Let h(x) = x + 23. Let m be h(-31). Let c = -1 + 3. Let s be (1 + c)32/(-12). Is m at most as big as s? True Let y(r) = -r*3 - 14r*2 - 14r - 1. Let n be y(-15). Suppose -238 - n = 7k. Which is bigger: k or -95? -95 Suppose 0 = -2d + x, -4x - 6 = 4d - 9x. Let y = -2/1221819 - 153134066/355549329. Let c = -4/291 + y. Is d at most as big as c? False Let c = -10 + 6. Let h = -659/180 + -1/180. Is h > c? True Let v be 9/5 + 2 + -3. Let o be 16/(-40) - 12/(-5). Suppose -2z + o = -0z. Is z at most v? False Let v(t) = 3t*2 + 24t + 51. Let s be v(-6). Is s > 33? False Let l = 294/25 - -987/50. Which is smaller: 32 or l? l Let g be (-10)/24 - (-18)/24. Let i = 0 + 2. Let o = 2 - i. Which is smaller: o or g? o Let l = 2164 + -2165. Which is smaller: -13/7 or l? -13/7 Let w = 1331 - 1358. Which is bigger: -129/5 or w? -129/5 Let p be (-6)/(-63)(-6)/(-8)-6. Is p bigger than 3? False Suppose 39s - 66 = 45s. Does 10 = s? False Suppose -3q + 175 = 592. Let s = -738 + 599. Is s < q? False Let b = -26 - -23.5. Let j = -0.6 - b. Let s = 19.1 + j. Is -1/4 >= s? False Let s be -48 - (0 - 0/(-3)). Let w = 37 + s. Is w less than -10? True Let b(o) = -2o*3 + 29o*2 - 39o + 44. Let w be b(13). Which is smaller: 0 or w? 0 Let f = 13 - 41. Let m be (40/f)/(-5) + 29/(-77). Suppose g + 7 = -3d, -5g = -0d + d + 7. Is m > g? True Let v(n) = n2 + n - 6. Let d(p) = -2p*2 - 3p + 13. Let g(a) = 3d(a) + 7v(a). Let x be g(3). Is -2 bigger than x? False Let l be -4 - ((-1 - -2) + -1). Let f be (-135)/140 + l/14. Let m(h) = 4h + 4. Let g be m(-1). Which is greater: f or g? g Let b = 23.051 - 0.051. Let w = b - 24. Do w and -6 have the same value? False Suppose 106l - 2 = 107l. Is 137 less than l? False Let k = 26.1 + -5.1. Let u = -22 + k. Let n = 4.4 - 1.4. Are n and u non-equal? True Suppose 0 = 4g + 4b - 356, 7b - 356 = -4g + 11b. Which is smaller: 93 or g? g Let j = 158.1 - 159. Is -23 greater than j? False Let t = -20 - -11. Let x be t-2(-5)/(-15). Is x != 4? True Let y be (-199)/(-2) + 65/26 + 2. Which is smaller: y or 0.2? 0.2 Let o = 6011/235 + -128/5. Which is smaller: o or 0.2? o Let l be (6/4)/((-54)/(-72)). Suppose 0 = 6t - 9t - lt. Is -3/5 at most as big as t? True Suppose -4x = -w + 5 - 6, 0 = -5x + w. Let p = 2364/13 - 182. Which is bigger: x or p? p Let u be 3 + 0 + 11 + -18. Which is smaller: u or -7? -7 Let c = -11 + 13. Let m = -2 + c. Let q = 0.98 + -1. Is q at most as big as m? True Let c = 14 - 10. Suppose -3y - 5 = -cy. Suppose -5 = yn + 5a, -2n = -0n + 3a + 4. Is n not equal to 1/19? True Let x = 0 + -6. Let i = x - -6. Let d = -17.96 + 18. Which is smaller: i or d? i Let x = 0.0065 - 26.9835. Let v = 0.023 - x. Do v and 1/2 have the same value? False Let b be 17/34 + (-213)/(-2). Which is bigger: 109 or b? 109 Let c = -43685/7 - -6368. Let o = c + -127. Let i = 0.3 + -0.4. Is i equal to o? False Suppose 8z + 1470 + 306 = 0. Is z at most -221? True Suppose -21 = 18t - 75. Suppose -3c = -c + 4. Let o be (c + 1)0 + 2. Are o and t non-equal? True Let y(z) = 19z2 - z - 1. Let v be y(2). Let i = -23/93 + 34153/465. Let f = v - i. Is 3 bigger than f? True Let d be -3 + (1 - -1) - -2. Let r be -6(2 - -2 - d). Let o = r + 86/5. Is o >= 0? False Let l = -0.9 - -0.6. Let d be (6/(-10))/(2802/2810 - 1). Let o = d + -210. Which is smaller: l or o? l Let s be 2/(-12) - 25/(-6). Suppose 2w + 6 = 0, 8u = 6u - 2w - s. Is -2/21 at most u? True Let m be 10/(-65) - 244/(-234). Which is greater: m or 2? 2 Let a be 123/1(-6)/(-9). Suppose 889 + 311 = 15o. Does o = a? False Suppose 4t = -5x - 2, -7 = 4t + 5. Suppose -13f + 11f - 4 = 0. Which is greater: x or f? x Let f(k) = k3 - 7k*2 - 6k + 9. Let b be f(7). Let h be b/22(-16)/6. Suppose 4j = -4, -ha + j + 6 = a. Which is smaller: a or 15? a Let j = -1283/3 + 9383/21. Let p = 19 - j. Which is greater: p or -1? p Let c = -199 - -199.1. Which is greater: -2/19 or c? c Suppose 2p + 3j = 6j + 7, -2j = p - 7. Suppose -6s - 3s + 495 = 0. Suppose 5d + 4r - s = 0, -d - pr = 2d - 46. Are 7 and d unequal? False Suppose 2d - 2 = 2o - 0, 5o - 2d = 4. Suppose 4r = ox + 16, 2x + 3x + 32 = 2r. Suppose -5v + 25 = -10v. Is v > x? True Let n(v) = 4v - 10. Let c be n(7). Suppose -c = -l - 20. Let f = l - -6. Is 3 greater than f? False Let j be 14/10 - (45/25 - 2). Which is bigger: 1 or j? j Let m = 7.51 - -523.49. Which is smaller: 1 or m? 1 Let t = -20 + 20.3. Let l = -2.7 - t. Is l greater than -7? True Let w(t) = 3t*3 - 16t*2 - 9t - 19. Let r be w(6). Which is smaller: r or 86? r Let d = 729/2 - 365. Are -9.2 and d unequal? True Suppose -4y - 74 = a, -75 = 4a + y + 191. Let o = 67 + a. Which is bigger: -2/75 or o? o Let y = -2/425473 + 136577281/95305952. Let w = -9/32 - y. Suppose -14m + 5m - 9 = 0. Which is smaller: w or m? w Let y = -0.6 + -0.4. Let g = y + 3. Are g and -0.1 equal? False Let x = -233927/120720 - -2/7545. Which is smaller: 0.1 or x? x Let d = 90015846/2641 - 34084. Is d > -1? True Let t = -23 + 39. Let u = 22 - t. Which is bigger: u or 2/7? u Let r be (1635/(-45) - -37)/((-3)/(54/4)). Let b be (1/(-2))/(52/288). Which is smaller: b or r? r Let w be 2379/13871 + 4/(-22). Which is smaller: w or 1? w Suppose 0 = -4g + 8g - 8. Suppose 54 = gu - 5u. Is u not equal to -18? False Let u = 46 - 43. Which is smaller: 7 or u? u Let i be (227/36)/(3/9). Let s = i + -91/4. Is -4 less than s? True Suppose 0 = 66t - 19019 + 101849. Is -1256 at least as big as t? False Suppose -4r + 3r + 8 = 4p, -18 = -2p - 4r. Let b be ((-1)/(-2))/(p/(-2)). Let y be b/3 - 0/(-1). Which is smaller: 4/9 or y? y Let s = -1/32039 + 65421/43028377. Which is smaller: -1 or s? -1 Let d(q) be the third derivative of -5q4/24 - 41q*3/6 - 8q*2. Let b be d(-16). Which is greater: b or 0.1? b Suppose -5j = -j - 5c + 129, 4c = 20. Let b be (j/(-4))/(1/(-2)). Let k = b - -8. Is k < -5? False Let k = 21 - 44. Let g = -9 - k. Let n = 3/8 + -1/8. Which is greater: g or n? g Suppose -5l + 1109 = 3w, -3w - 599 - 52 = -3l. Is 221 smaller than l? False Let h = -3.2 + 3.02. Which is bigger: h or 0.2? 0.2 Let x(w) = 7w3 - 2w*2 + w. Let q be x(1). Let d be 12/(5/10 + 1). Suppose 0v + 17 = v + 4n, -4v = -4n - d. Is v > q? False Let w be 2/(-6) - 150/(-18). Suppose 0 = 6r - 80 + w. Is 12 > r? False Suppose -38 = -x + 2b, -x - 3x - 4b = -116. Suppose 6w - x = 2w. Is w at most as big as 9? True Let n be 68(-5)/(-60)15. Is n <= 89? True Suppose 8o = 3o. Let d be (3 - 3)(o + -1). Let n be (-1 - -5)6/(-84). Is n at most d? True Let y(m) = 7m*2 + 2m. Suppose -5v - 3w + 11 = 0, -3w + 0w = 9. Suppose o + 3p = -o - v, -5p = -5o + 15. Let c be y(o). Is c smaller than 1? False Let d be 1/((13/26)/((-6)/4)). Let r be -1(-7)/(-14) - d/10. Suppose 2x + 5 = -3x. Which is smaller: r or x? x Suppose 0 = -5j - l + 36, -4j + 5l = -2j - 36. Let c(m) = 3m - 2 - 3 - 2 - 2m. Let i be c(j). Which is smaller: i or 1/13? 1/13 Suppose 4s + 3h = s + 66, -s + 14 = -h. Suppose 5 = 3q - f - 3, 4q - 5f - s = 0. Are q and 1/2 equal? False Let d = 47257 - 853093/18. Let r = -137 - d. Let i(u) = -u2 + 5u + 1. Let y be i(5). Is y >= r? True Let g be 1/(-4) - (-246)/24. Suppose -2v + g = -7v, 3o = -5v - 382. Let u = o - -239/2. Is -4 != u? True Let s be (-1)/(-1 + 1435)-8. Which is smaller: s or -1? -1 Let q = -11 + 14. Suppose 5u - 36 = -qh, 3h - 5 = 4u + 4. Suppose -11 + h = 4l. Which is smaller: -28 or l? -28 Suppose 0 = -4a + 9 - 5. Let i be 2/(-4)(-1 + a). Suppose i = x -	{ "pile_set_name": "DM Mathematics" }
ed by u. 14 Suppose -8i + 193 - 49 = 0. Suppose y + 12 = p + 2p, -3y = -p + 4. Calculate the remainder when i is divided by p. 2 Let v = 349 - 345. Suppose 2n = -4l + 4, l - 10 = -5n - 4l. Suppose ny - 25 = -3y. Calculate the remainder when y is divided by v. 1 Let t = 6546 + -6470. Let u = 92 - 148. Let l = u + t. What is the remainder when 97 is divided by l? 17 Suppose 2o + j + 22 = 0, 4o + 4j + 0j = -40. Let z(b) = 13b*2 + 138b + 14. What is the remainder when z(o) is divided by 8? 6 Let i(g) = g*3 + 9g*2 - 10g + 7. Let k be i(-10). Suppose -5d - kd = -204. Calculate the remainder when 60 is divided by d. 9 Let t = 10972 - 10895. Calculate the remainder when 268 is divided by t. 37 Let l(t) = -t*2 + 10t + 20. Let p be l(10). Let f = p + -93. Let n = 163 + f. What is the remainder when n is divided by 23? 21 Suppose 5i - 2 = 4i. Suppose -x - 11 = -ix. What is the remainder when 86 is divided by x? 9 Suppose -5m = -2b - 0b + 864, 164 = -m - 4b. Let f = m - -62. Let p = f - -156. Calculate the remainder when p is divided by 12. 10 Let r be (-3)/9((1 - 70) + 0). Let o = r + -20. Suppose -op + 4j = -p - 64, j + 70 = 2p. Calculate the remainder when p is divided by 8. 4 Let d(s) = 12s + 5. Let n be (12/15)/(2/303). Let m = n + 7. What is the remainder when d(5) is divided by m? 10 Suppose 241b + 346b - 10075 = -188b. Let o(q) = 674q2 + q. Calculate the remainder when o(-1) is divided by b. 10 Suppose -47h - 585 = -52h. Let a = -107 + h. Let s(d) = 6d. What is the remainder when s(9) is divided by a? 4 Suppose 0 = -2n - 2r + 53 - 163, 2n + 5r = -98. Let z = 84 + n. Let o(u) = -u*2 - 19u - 41. Calculate the remainder when z is divided by o(-16). 4 Let s = -3 - -6. Suppose 3a - 90 = 9y, -11y + 9y + 65 = 5a. Calculate the remainder when s/(2/(-76)-2) is divided by a. 12 Let g = 5123 - 5111. Calculate the remainder when 4739 is divided by g. 11 Suppose -63 - 408 = -3j. Suppose -31h + 1795 = 152. What is the remainder when j is divided by h? 51 Let b = 15258 - 14689. What is the remainder when b is divided by 184? 17 Suppose 0 = -27s + 706 - 166. Calculate the remainder when 74 is divided by s. 14 Let n = -58 + 94. Let y = n + 20. What is the remainder when y is divided by 21? 14 Let g = 67 + -70. Let y be (18 - 21)(-1)/((-1)/g). Suppose -4i = -yi + 370. What is the remainder when i is divided by 38? 36 Suppose 3w - 18 = -l + 879, 1177 = 4w - 5l. Calculate the remainder when w is divided by 146. 6 Let r(n) = 2n*2 - 543n + 4293. Calculate the remainder when 435 is divided by r(8). 50 Let q(x) = x*2 + x - 76. Let w be q(0). Let v = 604 + -625. Let f = v - w. Calculate the remainder when f is divided by 29. 26 Let q = 59 + -145. Suppose 4i = -2s + 66, -3s + 16 = 4i - 81. What is the remainder when q/(-3)(-345)/(-46) is divided by s? 29 Let z(h) = -22h - 588. Calculate the remainder when 513 is divided by z(-29). 13 Let d = -1635 - -1780. Let n be (-21)/(-4) + (-2)/8. Let p(v) = v2 + v + 7. What is the remainder when d is divided by p(n)? 34 Suppose -248t - 6846 = -411t. What is the remainder when t is divided by 15? 12 Suppose w + 4 = -1. Let i(p) be the third derivative of -p4/8 + 65p*3/6 + 34p*2 - 39p. What is the remainder when i(w) is divided by 18? 8 Suppose 321h + 12 = 324h. Suppose hx + 52 = 4b - 124, 0 = 3b - x - 138. What is the remainder when 421 is divided by b? 45 What is the remainder when 2/(-19) - (-42880)/152 is divided by 27? 12 Let k(r) = -3r*2 - 111r + 139. Calculate the remainder when 1849 is divided by k(-38). 24 Let c(s) = -s*3 - 17s*2 - 8s + 116. Calculate the remainder when 514 is divided by c(-17). 10 Let w(o) = -15o + 83. Let v be ((-2)/(-6))/(4 + (-423)/108). Let k(y) = -y + 89. Calculate the remainder when k(0) is divided by w(v). 20 Let i(p) be the second derivative of p5/20 - 4p*4/3 + 13p*3/3 + 53p*2/2 + p + 7. Calculate the remainder when 89 is divided by i(14). 14 Suppose -w = r - 33, -5r - w = 2w - 173. Suppose 0 = -g - 4p + 169, p = -2g - 0p + 338. Let t = 179 - g. What is the remainder when r is divided by t? 7 Calculate the remainder when 0 + -4 - (1475/(-5) - -6) is divided by 33. 21 Suppose -8t + 4223 = 3x - 12t, -7t - 4220 = -3x. Calculate the remainder when x is divided by 290. 249 Let j = -1097 + 3135. Calculate the remainder when j is divided by 102. 100 Let l(m) = -7m*2 + 7 - 8m + 19m2 - 4m*2 + 24m*2. What is the remainder when l(1) is divided by 12? 7 Let z = -3125 - -3588. Calculate the remainder when z is divided by 147. 22 Calculate the remainder when (-1259 - (-2)/1)/2150/(-225) is divided by 106. 101 Let h(r) = 152r2 - 3r + 2. Suppose -35v + 13v + 836 = 0. Calculate the remainder when h(1) is divided by v. 37 Let b = -1754 + 1994. Calculate the remainder when 821 is divided by b. 101 Let m(d) be the second derivative of d4/6 + d3 - 4d2 - 12d. Let w be m(5). Suppose w = -f + 4f. What is the remainder when f is divided by 13? 11 Suppose -17g = -4g - 2002. What is the remainder when (-13)/39 - g/(-3) is divided by 18? 15 Let k = -157 + 276. Let j = 923 - 836. Suppose 5n - 3x - j = -7x, -n - 5x = -30. Calculate the remainder when k is divided by n. 14 Suppose 5k - 49 = -2k. Suppose -14v + kv = -420. What is the remainder when v is divided by 16? 12 What is the remainder when (-1988)/(-5) - (-687)/(-1145) is divided by 85? 57 What is the remainder when (328 - 311)/((-2)/(-2054)) is divided by 5? 4 Suppose -2w + 698 = -4q, -20q = -5w - 22q + 1721. Let k = 375 - w. Calculate the remainder when 182 is divided by k. 2 Let y be 2/(-1) + 0 + 12. Suppose -ym + 6m = -388. Suppose -4z + 5r = -m, -z - 85 = -6z - r. What is the remainder when z is divided by 10? 8 Let p = -11598 + 13927. Calculate the remainder when p is divided by 213. 199 Let w = 212 + -35. Suppose -6l + 3l + w = -3g, 4g = -20. What is the remainder when l is divided by 15? 9 Suppose 5v - 30 + 14 = 4s, -4s + 48 = 3v. Suppose 3i - 48 = -0. Calculate the remainder when i is divided by v. 0 Let q be (4 - -1) + (-2 - -4). Suppose p - 11 - q = 0. Calculate the remainder when p is divided by (-61)/(-6) + (4380/360)/(-73). 8 Suppose -3i + 2 = -p, -6p + 11p + 3i - 44 = 0. Suppose -po + 120 = 13o. Suppose -4z + 2z = -44. What is the remainder when z is divided by o? 4 Let w = 821 - 465. Let j = 367 - w. Calculate the remainder when 0 + 2 + 255/5 is divided by j. 9 What is the remainder when 8/60 - 8139/(-45) is divided by 38? 29 Suppose 88w - 293w = -2255. Suppose 0m + 2 = m. What is the remainder when -106(2 - 5/m) is divided by w? 9 Let v be (-16)/(-24) + (-4)/(-3). Suppose -vh - 8 = 3i, 2i - 5 = 2h + 3. Let z = h - -10. Calculate the remainder when 23 is divided by z. 5 What is the remainder when 5190648/456 - -111 is divided by 74? 72 Let c = 1187 - 1135. What is the remainder when c is divided by 10? 2 Suppose 0 = 4r - 4c - 8376, 2r + 6257 = 5r + 2c. What is the remainder when r is divided by 51? 49 Let t(u) = -u*2 + 11u + 33. Suppose 3n + 2o = 138, 4n - 5o = -25 + 209. What is the remainder when n is divided by t(13)? 4 Let f(v) = 3v2 + 36v + 194. What is the remainder when f(-15) is divided by 5? 4 What is the remainder when (15 + -4 - -40) + 6 is divided by 15? 12 Let d = 6054 + -6001. Calculate the remainder when 745 is divided by d. 3 Suppose -3n = 3t - 273, 46n = -3t + 42n + 267. Calculate the remainder when 99 is divided by t. 2 Let c(z) = 173z + 2120. What is the remainder when 350 is divided by c(-12)? 42 Suppose 5u - u + 3c + 50 = 0, 0 = c - 2. Let t(z) = 6z3 + z2 - 2z + 1. Let p be t(1). What is the remainder when 11 is divided by (-4 - -1)u/p? 4 Let k(s) = 6s + 280. Let a be k(48). Let t = a + -560. Suppose 369 = 5i - l - 12, l - 312 = -4i. What is the remainder when i is divided by t? 5 Let q(r) = -r - 21. Let h be q(-15). Let k be ((-2)/h)/((-1)/(-81)). Suppose 4w + k = 5m, 2m = -3m + 2w + 21. What is the remainder when m is divided by 3? 0 Let k = -279 + 302. Suppose 0 = -5q - kq + 3584. Calculate the remainder when q is divided by 25. 3 Suppose -4w - h - 5 = 0, -18 = 5w + 3h - 3. Suppose 5u + 4t - 7 - 778	{ "pile_set_name": "DM Mathematics" }
) assuming g is positive. 1 Simplify ((a/(aa(1/2)))/a)(3/13)/((((a/(a/a(2/7)))/a)/a)/aa)(1/30) assuming a is positive. a(-263/910) Simplify (o(oo/((((ooo*(1/3))/ooo)/o)/o))/oo)/(o/(o*(-14)/o)o)o(2/29)o8 assuming o is positive. o(-632/87) Simplify (((q/(q(-1/3)/q))/q)(-4/5))*0 assuming q is positive. 1 Simplify ((q/(qqq(2/7)q)q)/(q(-4/15)q))/((q/(qqq*(1/2)q))/q(-5)) assuming q is positive. q(-949/210) Simplify ((yy/(y(-3/7)/y))/y(-17))/((y/(y(y/(y/(yyy/(y/(y/(y*(-19)/y))y)y))y)/y))/(yy(1/4))) assuming y is positive. y(1251/28) Simplify ((u(-1/4))42/(u3uu6))(9/4) assuming u is positive. u(-369/8) Simplify (((q/(qq*(-2/5)qqq))/q)*(-13/8)q*(-5/6)(q/q*(4/3)q)/q)(2/15) assuming q is positive. q(281/450) Simplify (t*(9/5)/t(t/t*(-9/5)t)/t)/(((t/(t/((t*(-5)t)/t)))/t)/t7) assuming t is positive. t(83/5) Simplify (((i*(-2/5)i)(-18/5))46)(-14) assuming i is positive. i(34776/25) Simplify ((m0/m)/m)(-3/2)mm/m*(3/4)m/(m/(mm/m5m)) assuming m is positive. m(9/4) Simplify ((g(-2/3)/g)*(-5)gg(-1/3)gggg(gg(ggg*(-2/7))/gg)/gg)(-10/7) assuming g is positive. g(-1170/49) Simplify (b(1/2)bb/b(-1)bb5/(b(-3)b))(4/9) assuming b is positive. b(46/9) Simplify (((d(dd(dd(-7/5))/d)/d)/d)/d9)/((d/(dd16))/(d/(d/(dd/(d*(2/21)/d)d)))) assuming d is positive. d(1103/105) Simplify ((u/u(-6))/(uu/(u/(uu/u*(-7))))uu(1/6)/uuuu/(u/u(3/7)))(-1/32) assuming u is positive. u(17/1344) Simplify (o/(o/((o/(o/o(-3)))/o)))*(-19/3)(o4)(5/13) assuming o is positive. o(1048/39) Simplify (f(-2/7))*(-47)f*(-5)/ff/f0 assuming f is positive. f(59/7) Simplify (p(2/7))30(p(-2/35)/p)/(p5/p) assuming p is positive. p(123/35) Simplify (k/k0)(17/6)k*1/kk/k(-1/14) assuming k is positive. k(82/21) Simplify (l*(2/59)((l/(l*18/lll))/ll)/l)/((l*(1/2)/ll)/l)(3/23) assuming l is positive. l(-51297/2714) Simplify j*26/j(jj/j(-31)j)/jj(-4)/j(-1/5) assuming j is positive. j(271/5) Simplify ((m/(m/(((mm(-2/57))/m)/m)))/m(-26))28 assuming m is positive. m(39844/57) Simplify (((t(-2/7))47)(-1))21 assuming t is positive. t282 Simplify (p2)*(-32)/(pp(-1)/p)48 assuming p is positive. p(-16) Simplify ((g/g2g)/g(-2))/(g(1/2))(2/15) assuming g is positive. g(29/15) Simplify ((u/(u(-1/7)u))/(u*2u)(uu(-6))/((u0/u)/u))10 assuming u is positive. u(-410/7) Simplify (s4/s)(3/11)s(-3)s/s(-2/7) assuming s is positive. s(-69/77) Simplify (s/s*22(sss*15)/s)/((s/(ss/s(-1/9)))/(s/(s/s(-3/20)))) assuming s is positive. s(-727/180) Simplify (z(-8)z5zz((z2/z)/z)18)(-34) assuming z is positive. z34 Simplify x/x*(-21)xx(-20)(xx(-4/11))(3/11) assuming x is positive. x(384/121) Simplify (x(2/67)x(5/6)/x)32 assuming x is positive. x*(-880/201) Simplify (xx11/x)(-10)x(8/5)/(x/(x(-1/8)x)) assuming x is positive. x*(-4341/40) Simplify (aa*(-1)aa/a(-1/3)a*(-3/7)a(a/(a5/a))/a)(28/5) assuming a is positive. a(-92/15) Simplify (vv/(v/v1))(-3/5)/(((vvv*0vv)/v)/v(vv/v(-18)v)/v) assuming v is positive. v(-116/5) Simplify (d/((d(-2/5)/d)/d))(36/7)/((d(-1/32)d)/d)(-44) assuming d is positive. d(4511/280) Simplify (gg*5)/(g/(ggg(3/2)/gg))g/(gg(gg*9g)/gg)g/g(-2/7) assuming g is positive. g(-31/14) Simplify (vvvv(-4)vv)14v17/(v10/v) assuming v is positive. v22 Simplify (j(-4))*(-11)j*(-15/2)/(jj(20/3)) assuming j is positive. j(173/6) Simplify (l(2/7))(-1/5)l(2/3)/ll/(l/(l((((ll(3/7)/l)/l)/l)/l)/l)) assuming l is positive. l(-311/105) Simplify ((bb/(b/b(-2/53)))/(bb*(4/5)b))/((b*(-1/9)b)/(b/(((b(b(-2/31)/b)/b)/b)/b))) assuming b is positive. b(98917/73935) Simplify (p10)(-15)/(p19p((p/p(2/43)p)/p)/p) assuming p is positive. p(-7308/43) Simplify n(-1/9)nnn(-8/5)nnn(n(-4/7)n)/n(-19) assuming n is positive. n(7156/315) Simplify (((o(-7/4)/o)12)(-15))(2/35) assuming o is positive. o*(198/7) Simplify ((n/(nnn/(n/(nn/(((n/(n(nn*1nn)/nn)n)/n)/n)))n))(-1/8))(2/7) assuming n is positive. n*(9/28) Simplify (pp/(p/p*(-23))p)/p*(-28)(pp(15/4))(-37) assuming p is positive. p(-675/4) Simplify (((d(-1/10)d)/d(-3/8))(-27))(-25/2) assuming d is positive. d(6885/16) Simplify ((n0)(-28))(-14/13) assuming n is positive. 1 Simplify (g9g(-2/3))/(g5gg/(((g/(g/g(2/11)))/g)/g)) assuming g is positive. g(-16/33) Simplify ((bbb((bb(2/9))/b)/b)/(bb*5b)(b0/b)(-4/9))12 assuming b is positive. b(-52) Simplify (q(2/3))(1/10)(q/(qq(-2/27))q)(3/14) assuming q is positive. q(187/630) Simplify (uu1)/(uu/u*(-12)u)(uu/(u(-19)/u))(-18) assuming u is positive. u(-409) Simplify a(9/4)aa/(aaa(a(a/a*(2/31))/a)/a)a(a/a20a)(2/9) assuming a is positive. a(-209/124) Simplify (h(-2/13))(2/7)h13/h(-13) assuming h is positive. h(2362/91) Simplify ((mm18)(6/23))(3/2) assuming m is positive. m(171/23) Simplify y/(y*0/y)y(y/((yyy(-7))/yyy))/yy*(-2/35)yyy*(-2/17)y assuming y is positive. y(5846/595) Simplify (((y/y(3/7)y)/y)/(y/(y/(y/y(-1/5)))))/(((y/(y(yy((y*7yy)/yy)/yy)/y))/y)/y)(-26) assuming y is positive. y(-10942/35) Simplify ((q/q(-4/9)qq(q/q*(1/4))/qq)21)(5/2) assuming q is positive. q(5285/24) Simplify ((v/v(2/33))/vv)(-2/105)/((v(14/5)vv)/(vv*(4/23)v)) assuming v is positive. v(-210712/79695) Simplify (a/a(2/21))/(a*(-6)/a)a(1/17)/(a(2/29)/a) assuming a is positive. a(92086/10353) Simplify (((m(1/4))(-4/11))11)(-1/10) assuming m is positive. m(1/10) Simplify (h(2/15))(-47)((((h/((h(-1/3)hhhh)/h)hh)/h)/hh)/h)(2/143) assuming h is positive. h(-13492/2145) Simplify (((m5)(-21/4))(-16))7 assuming m is positive. m2940 Simplify (o(-2/17))*(7/3)((o/(o(o(oo(-4))/oo)/o))/o)31 assuming o is positive. o(3148/51) Simplify (rrr/r*(-3)r)*17/((rr(-12)/r)/(r7r)) assuming r is positive. r139 Simplify (z/(zz/(zz/z(-1/4)))((z/z*30)/z)/zz)(-18/13) assuming z is positive. z(1035/26) Simplify (l(6/7)/((l8/l)/l))/((ll(11/4))/(l/((l(-3/5)/l)/l))) assuming l is positive. l(-741/140) Simplify (b/b8)(1/29)(b(-6)/b)23 assuming b is positive. b(-4676/29) Simplify (j(-3/7)j)(-20)/(j/j(2/9))(13/8) assuming j is positive. j(-6397/504) Simplify (k3k*(-2/13)k(k/(k(-5)/k))/(kk/((k/(k*(-6/5)k))/k)kk))(-2/41) assuming k is positive. k(-916/2665) Simplify (j/(j*(1/5)j)j(-3))/((jj/j*(-16))/(j/((jj/(jj/(j(jj(-1/35))/j)))/j))) assuming j is positive. j(-706/35) Simplify (((g/(ggg(1/3)/g))(-29))(19/2))(-2/17) assuming g is positive. g(-551/51) Simplify x(-7)xx(-5)xx((((x/(x/((x(1/5)/x)/x)))/x)/x)/x)(-9/10) assuming x is positive. x(-117/25) Simplify (((x/(x/x20)x)/xxx)/x)(1/60)(x/(xx(-17)/x)x)/(x/(x/(x/x(-9)))) assuming x is positive. x(187/20) Simplify ((d*22d)/(((d/d*(-2/37))/d)/d))/(((((d/(dd*(2/33)))/d)/d)/d)/(dd10)) assuming d is positive. d(46406/1221) Simplify (jj12)/(j/j(5/6))(jj(2/33))/(j14/j) assuming j is positive. j(59/66) Simplify (aa*12a)*49(a/(a*(-16)/a))/aaa(-16)/a assuming a is positive. a687 Simplify ((zz*(-6/19)zz)(6/7))(-18) assuming z is positive. z(-5508/133) Simplify (((p/(pp*(1/7))p)/ppp(-2/13))12)9 assuming p is positive. p(6912/91) Simplify (ww3w*(2/5)(ww/(ww*(-4)))/(ww/w(-4)))(-5/7) assuming w is positive. w*(-17/7) Simplify ff*(-13)/ff*(-24)(ff/((f/(fff11)f)/f))(-29) assuming f is positive. f(-443) Simplify (((b/(b/(bb(-12))))/b)/b)(1/5)b(11/4)/((b22/b)/b) assuming b is positive. b(-397/20) Simplify (v20v)/((v/(v(4/11)/v))/v)(vvv*4vv)/(v(-14)v) assuming v is positive. v(455/11) Simplify (((a(-1))(-1/2))(-2/11))(-1/59) assuming a is positive. a(1/64	{ "pile_set_name": "DM Mathematics" }
in -276149, -1104664, -2485531, -4418750, -6904321? -9942244 What comes next: 31399175, 31399174, 31399173, 31399172? 31399171 What comes next: 1379, 4936, 10869, 19178? 29863 What is the next term in 522040, 1043710, 1565380, 2087050, 2608720, 3130390? 3652060 What is next in -19600, -78437, -176572, -314065, -490976, -707365, -963292? -1258817 What is next in 197, 2165, 7361, 17399, 33893, 58457? 92705 What is the next term in -5652150, -11304293, -16956436, -22608579, -28260722, -33912865? -39565008 What comes next: -383240, -1534441, -3453110, -6139247, -9592852, -13813925? -18802466 What is the next term in 2084254, 2084069, 2083884, 2083699, 2083514? 2083329 What comes next: -220433, -220456, -220493, -220544, -220609, -220688, -220781? -220888 What is next in -1214678, -1214694, -1214718, -1214750, -1214790? -1214838 What comes next: 123705863, 247411721, 371117579, 494823437, 618529295? 742235153 What is the next term in 8806757, 8806756, 8806755, 8806754, 8806753? 8806752 What is the next term in 5170, 7118, 9066, 11014, 12962? 14910 What comes next: 13514, 13528, 13548, 13574, 13606, 13644, 13688? 13738 What is next in 3832400, 3832402, 3832404? 3832406 What comes next: 1041108, 4164366, 9369792, 16657386, 26027148? 37479078 What is the next term in -1464, -2178, -3322, -4896, -6900, -9334, -12198? -15492 What comes next: 4925, 10030, 15135, 20240? 25345 What is next in -589142, -589130, -589136, -589166, -589226, -589322? -589460 What comes next: 14810453, 29620923, 44431393? 59241863 What is next in 5637, 45092, 152209, 360828, 704789, 1217932? 1934097 What is the next term in -9192, -15553, -19074, -19755, -17596, -12597, -4758? 5921 What is next in 1924, 2796, 2570, 1246? -1176 What is the next term in -4947176, -4947166, -4947156, -4947146, -4947136? -4947126 What is next in -13346, -22107, -30868, -39629, -48390, -57151? -65912 What is next in 7371, 8975, 11649, 15393, 20207, 26091? 33045 What is the next term in -1906, -4309, -7210, -10603, -14482, -18841, -23674? -28975 What comes next: 253, 172, 103, 64, 73, 148, 307, 568? 949 What is next in 19605, 38048, 56487, 74922, 93353, 111780? 130203 What comes next: 3396, 3439, 3444, 3411, 3340, 3231? 3084 What comes next: -1796059, -1796057, -1796055, -1796053, -1796051? -1796049 What is next in 118396, 473623, 1065684, 1894585, 2960332, 4262931, 5802388, 7578709? 9591900 What comes next: -731463, -1463033, -2194603, -2926173, -3657743, -4389313? -5120883 What is next in 252346, 507466, 762586, 1017706, 1272826? 1527946 What is next in 716, 1658, 3010, 4976, 7760, 11566? 16598 What is the next term in -946034, -946033, -946032, -946031, -946030, -946029? -946028 What is the next term in -723419, -723406, -723395, -723386, -723379? -723374 What comes next: -941, -3794, -8569, -15272, -23909? -34486 What is the next term in 69, 229, 459, 753, 1105, 1509? 1959 What comes next: -52804, -52632, -52432, -52198, -51924? -51604 What is the next term in -10849, -41745, -93229, -165295, -257937, -371149, -504925? -659259 What comes next: -40166500, -40166603, -40166782, -40167043, -40167392? -40167835 What comes next: 1416365159, 2832730317, 4249095475, 5665460633? 7081825791 What is the next term in 78469, 157182, 235897, 314614, 393333, 472054, 550777? 629502 What comes next: 146447, 150444, 154441, 158438, 162435? 166432 What is next in -1104, -9646, -23884, -43818? -69448 What comes next: 1233611, 2467248, 3700901, 4934576, 6168279, 7402016? 8635793 What is next in 8385, 26819, 45253, 63687? 82121 What is the next term in 5467, 10668, 15871, 21076, 26283, 31492, 36703? 41916 What comes next: 153, -2050, -4253, -6456, -8659? -10862 What is the next term in -2715932, -5431853, -8147774, -10863695, -13579616, -16295537? -19011458 What is next in 90020, 90041, 90062, 90083, 90104, 90125? 90146 What is the next term in -5354, -21704, -49062, -87428? -136802 What is next in -1764, -1295, -38, 2397, 6400, 12361, 20670? 31717 What is next in -5092, -17621, -37590, -64999? -99848 What is next in -4920195, -19680784, -44281767, -78723144, -123004915? -177127080 What comes next: -6367, -24871, -55721, -98923, -154483, -222407, -302701? -395371 What is the next term in 183903, 367787, 551671? 735555 What comes next: -40, -1, 66, 173, 332, 555, 854? 1241 What is next in 547, -334, -1231, -2138, -3049, -3958, -4859? -5746 What comes next: 75331, 75215, 75099, 74983? 74867 What comes next: 360453, 720892, 1081317, 1441722, 1802101, 2162448? 2522757 What is next in 229974, 229904, 229832, 229758? 229682 What comes next: 79671, 79646, 79609, 79560, 79499, 79426, 79341? 79244 What is the next term in -10211, -40052, -89787, -159416, -248939? -358356 What is the next term in 5162, 6296, 8188, 10838, 14246? 18412 What comes next: 2716311, 5432788, 8149265? 10865742 What is the next term in -30747, -61517, -92309, -123123? -153959 What is the next term in -3103109, -3102963, -3102817? -3102671 What is next in 24302, 25001, 25592, 26021, 26234, 26177, 25796, 25037? 23846 What comes next: -123264, -123252, -123218, -123150, -123036, -122864, -122622, -122298? -121880 What comes next: -391554, -391549, -391544, -391539, -391534? -391529 What is next in -11319, -44346, -99051, -175428, -273471, -393174, -534531, -697536? -882183 What comes next: 28740, 55796, 82852, 109908, 136964? 164020 What is the next term in 6826266, 27305064, 61436390, 109220244, 170656626, 245745536, 334486974? 436880940 What is next in 1425025, 2850201, 4275525, 5700997? 7126617 What is the next term in -84025, -167852, -251679? -335506 What comes next: 572, 2040, 4160, 6686, 9372, 11972, 14240, 15930? 16796 What is the next term in 492330, 495402, 498484, 501582, 504702, 507850, 511032? 514254 What is the next term in -556, -1784, -3632, -5938, -8540, -11276? -13984 What is next in -22177, -22522, -22867, -23212? -23557 What is next in 459291, 918593, 1377895, 1837197, 2296499, 2755801? 3215103 What is the next term in 11905720, 11905711, 11905690, 11905651, 11905588, 11905495? 11905366 What is the next term in 2300, 3810, 5284, 6704, 8052? 9310 What is next in -10, 132, 406, 818, 1374? 2080 What comes next: -5519, -5477, -5459, -5477, -5543, -5669, -5867? -6149 What is the next term in 52809608, 105619215, 158428822? 211238429 What comes next: 1145, 3831, 11169, 25499, 49161, 84495, 133841? 199539 What is the next term in -164009, -328048, -492087, -656126, -820165? -984204 What is the next term in -183, -804, -1859, -3348? -5271 What comes next: 11829, 23671, 35533, 47415, 59317? 71239 What is the next term in -6215403, -12430805, -18646203, -24861597, -31076987? -37292373 What is next in 6788, 54438, 183842, 435902, 851520, 1471598? 2337038 What is the next term in 192549, 192558, 192567, 192576, 192585? 192594 What comes next: 5133, 21709, 51419, 95967, 157057, 236393, 335679, 456619? 600917 What is the next term in 865813, 1731626, 2597439, 3463252, 4329065? 5194878 What comes next: 90127, 90618, 91109, 91600, 92091, 92582? 93073 What is next in -1021310, -1021292, -1021240, -1021136, -1020962? -1020700 What is next in -6125, -12141, -18189, -24287, -30453? -36705 What comes next: -1960, -6359, -13692, -23959? -37160 What comes next: 12696, 17945, 23194? 28443 What is the next term in 1603, -4419, -10441, -16463? -22485 What is next in 13665, 23424, 33181, 42936, 52689, 62440? 72189 What is next in 6749, 3525, 301, -2923, -6147? -9371 What is the next term in -31750, -253938, -856994, -2031340, -3967398? -6855590 What is the next term in 213078, 426387, 639696, 853005, 1066314? 1279623 What is next in -5350, -21340, -47798, -84568, -131494, -188420, -255190? -331648 What comes next: -428, -1133, -2758, -5765, -10616, -17773, -27698? -40853 What is next in -92474, -184964, -277454, -369944, -462434, -554924? -647414 What is the next term in 750, 3500, 8136, 14676, 23138? 33540 What is the next term in 73892, 73715, 73538? 73361 What comes next: 613181, 613521, 613861, 614201, 614541? 614881 What is the next term in -1482, -6016, -13564, -24120, -37678, -54232, -73776? -96304 What is the next term in -10822, -69093, -166202, -302143, -476910, -690497? -942898 What is next in 22141, 40631, 51753, 51823, 37157? 4071 What is the ne	{ "pile_set_name": "DM Mathematics" }
i*6. Find the third derivative of b(s) wrt s. -360s*2 What is the second derivative of -15h*2 - 12h*4 + 16h*2 - 13h + 27h wrt h? -144h*2 + 2 What is the second derivative of -3o*3 - 15o + 0o3 + 8o wrt o? -18o Let q(a) be the second derivative of -11a4/12 - a3/6 - 9a2 + a + 8. Find the second derivative of q(u) wrt u. -22 Let g(v) be the first derivative of 6v*5/5 - 14v + 18. What is the first derivative of g(f) wrt f? 24f3 Find the first derivative of -119w*2 + 119w*2 - 6 - 19w*4 wrt w. -76w*3 Suppose 3n - 16 = -n. Suppose -3b + 5 = 5x, -nb - 2x + 3x - 1 = 0. What is the derivative of bf - 1 - 2f + 2 wrt f? -2 Let r(p) be the first derivative of p7/105 - p4/8 + 2p*2 + 1. Let h(a) be the second derivative of r(a). Find the second derivative of h(c) wrt c. 24c2 Let c(f) be the second derivative of -f4/12 + f*3/3 + 8f. Find the second derivative of c(g) wrt g. -2 What is the first derivative of -53 + 34 + 31 - 7g2 wrt g? -14g Let p(j) = -4j + 0 + 2j2 - 3 + 3. Let m(b) = b2 + b. Let k(f) = -2m(f) - p(f). What is the second derivative of k(u) wrt u? -8 Let r(c) be the first derivative of -17c*7/7 - 4c*3/3 + 10c - 22. What is the third derivative of r(g) wrt g? -2040g3 Let a(y) be the second derivative of 1/4y*5 - 3y*2 + 0 + 6y + 0y4 + 0y*3. Differentiate a(m) wrt m. 15m*2 What is the derivative of 9l - 3l - 1 - 8 wrt l? 6 Let x(w) = 7w*2 - 1. Let n be x(1). What is the second derivative of -3h + nh + 3h + 5h2 - 4h wrt h? 10 Suppose -3j = 2j - 10. Suppose 4t = -4c + 8, -jc = t - 1 - 1. Find the first derivative of 2 + d2 + dt - 3 wrt d. 4d Let n(z) = 7z2 - 4z + 9. Let q(m) = 0 + 2 + m2 + m2 + 0m2 - m. Let v(s) = 2n(s) - 9q(s). What is the second derivative of v(c) wrt c? -8 Let y(t) be the third derivative of -t7/70 - 13t*6/120 - 11t*4/12 + 42t*2. Find the second derivative of y(b) wrt b. -36b*2 - 78b Let d(z) be the first derivative of -20z6/3 + 22z*2 + 27. Find the second derivative of d(p) wrt p. -800p*3 Find the second derivative of n + 3n + 6n4 - 7n wrt n. 72n2 Let b(f) = 12f*5 - 44f*3 + 32f*2 + 44f + 44. Let h(m) = -m3 + m2 + m + 1. Let i(a) = -2b(a) + 88h(a). Find the third derivative of i(d) wrt d. -1440d2 Suppose -5r = -2t - 1, r + 0 - 1 = 0. What is the third derivative of 11b*2 - 3b*2 - 5b6 + bt wrt b? -600b3 What is the third derivative of 170 + 162 - 332 - 37k*4 + 11k*2 wrt k? -888k Let d = 11 - 7. Differentiate -10 + 6 - da3 + 5a*3 with respect to a. 3a2 Let y(k) be the third derivative of k6/720 + k5/20 + k4/12 + k*2. Let z(p) be the second derivative of y(p). Differentiate z(s) with respect to s. 1 Let d(i) = -8i*2 - 4i - 46. Let r(m) = -m*2 + 1. Let z(q) = d(q) - 2r(q). What is the derivative of z(k) wrt k? -12k - 4 Let w be 0 + (3 - -1) - -2. Find the first derivative of -11d + 2 + 5 - w + 19d wrt d. 8 Suppose -8 = -2x - 2. What is the derivative of -5u + 5u + 3 - 5ux + 3 wrt u? -15u2 Let w(o) be the second derivative of o6/30 + 7o5/10 - o4/6 - o3/3 + 49o. Find the third derivative of w(d) wrt d. 24d + 84 Let d(i) be the first derivative of 7i*6 + 23i*2/2 - 11. What is the second derivative of d(t) wrt t? 840t*3 Suppose 0 = -4u + 6 + 10. Let n be (-4)/612/(-8). Differentiate -n - i + i - iu wrt i. -4i3 Let o(r) be the third derivative of r6/120 - r*5/10 - 4r2. Find the third derivative of o(d) wrt d. 6 Let y(v) be the third derivative of -v7/21 + v*5/20 - 5v*2. What is the third derivative of y(j) wrt j? -240j Let l(y) = 3y + 7. Let j(v) = 7v + 14. Let m(g) = 4j(g) - 9l(g). Let z be m(9). Find the third derivative of -3u2 - zu*2 + 2u*3 + 6u*2 wrt u. 12 Find the third derivative of 2d*5 - 4d*5 + 17d*2 + 0d*5 wrt d. -120d*2 Let u(h) = -5h*2 + 4h. Let w(z) = -3z + 11z*2 - 5z - 1 + 1. Let g(o) = -5u(o) - 2w(o). Find the second derivative of g(f) wrt f. 6 Find the third derivative of -4a6 + 2a*6 + 2a*2 - 5a2 - a6 wrt a. -360a3 Let s(w) be the second derivative of -3w*6/10 - 2w*4/3 - 2w. Find the third derivative of s(p) wrt p. -216p Suppose -4u = -u - 15. Find the third derivative of 4ou + 2o2 - o5 - 8o2 wrt o. 180o*2 Let t(g) = g + 15. Let w be t(-10). What is the third derivative of -9 - 2u*2 - wu*3 + 9 + 2u*3 wrt u? -18 Let f(t) = 6t*6 + 5t*4 + 13t2 - 5. Let o(m) = m4 + m*2 - 1. Let b(r) = -f(r) + 5o(r). What is the third derivative of b(l) wrt l? -720l3 Let m(n) be the first derivative of 9n*4 - 11n - 30. Find the first derivative of m(f) wrt f. 108f2 What is the second derivative of -3a*4 + a - 8 - 5a*4 + 2a - 4a4 wrt a? -144a2 Let t(u) = u3 + 1. Let a(x) = 3x3 + x2 - 2x + 5. Let n(l) = a(l) - 5t(l). What is the third derivative of n(r) wrt r? -12 Let p(z) = -15z*4 + 4z*2 - 4z - 5. Let k(n) = 30n4 - 7n*2 + 7n + 9. Let j(m) = 4k(m) + 7p(m). Differentiate j(b) with respect to b. 60b3 Let l(d) = -18d*3 + 3d*2 + 14d + 3. Let u(k) = 19k3 - 2k*2 - 15k - 2. Let i(r) = 2l(r) + 3u(r). What is the second derivative of i(m) wrt m? 126m Let t(x) = x3 - x2 + 1. Let j(d) = 9d*3 - 2d*2 + 1. Let u(b) = j(b) - t(b). What is the third derivative of u(s) wrt s? 48 Let c(g) be the third derivative of -2g8/21 + g4/12 - 7g2. What is the second derivative of c(j) wrt j? -640j*3 Suppose -5n + n = -116. What is the first derivative of 29y2 - 7 + 0y*4 + 6y*4 - ny*2 wrt y? 24y*3 Let h(i) = -4i*2 + 24i + 14. Let a(m) = m*2 - 5m - 3. Let r(g) = -14a(g) - 3h(g). Find the second derivative of r(n) wrt n. -4 Let k(z) = -2z3 - 3z*2. Let w be k(-2). Find the second derivative of 2x + wx - x5 - 4x*5 wrt x. -100x*3 Find the first derivative of 6 + 0 - 4 + 21k*2 wrt k. 42k Let v(z) be the third derivative of 0z5 - 1/210z7 + 0 + z2 + 0z + 0z*6 - 1/2z*3 + 0z*4. Find the first derivative of v(h) wrt h. -4h3 Let z(h) be the first derivative of h4 + 0h4 + 4 + 0 + h2. What is the second derivative of z(d) wrt d? 24d Let j = 20 - 18. Let g(u) be the second derivative of -u - u*j + 1/6u*3 + 0. What is the derivative of g(w) wrt w? 1 Let a be (2 - 4) + (-27)/(-3). Differentiate -10k*4 - a + 5 + 4 wrt k. -40k*3 Let m(i) = 7i + 7. Suppose 11 = 5v + 1. Let y(u) = u + 1. Let n(t) = vy(t) - m(t). What is the derivative of n(j) wrt j? -5 Suppose -10 = -5q + 5g, 30 = -q + 6q + 5g. Find the second derivative of 3l + l + 180l*q - 4l*5 - 180l*4 wrt l. -80l*3 Differentiate 1 + 11 - 8 + 8 + 9g with respect to g. 9 Let c(r) = -r*3 + 2r*2 - 3r. Let z(b) = 4b3 - 8b*2 + 13b. Let t(l) = -26c(l) - 6z(l). Find the third derivative of t(v) wrt v. 12 Find the third derivative of 5 - 95g + g4 + 2g*2 + 34g*5 - 86g + 181g wrt g. 2040g*2 + 24g Let w(x) = 3x5 - 2x*3 - 7x*2 - 2x. Let a(z) = -6z5 + 5z*3 + 14z*2 + 5z. Let g(h) = 2a(h) + 5w(h). What is the third derivative of g(c) wrt c? 180c2 Let n(y) = 3y*3 - 4y*2 - 4y - 3. Let v(d) = -d*2 - d - 1. Let j = 9 - 5. Let i(g) = jv(g) - n(g). Differentiate i(l) wrt l. -9l2 Find the second derivative of 4a - 5a2 - a2 + 2a*2 + 0a*2 wrt a. -8 Suppose -25 = 2p - 7p. Let j = p + -3. What is the second derivative of -jn + 2n3 + n3 - 2n*3 wrt n? 6n Let x(u) = 3u3 + u2 + 5u + 5. Let q(a) = -2a3 - a2 - 4a - 4. Let b(p) = 5q(p) + 4x(p). Find the third derivative of b(z) wrt z. 12 Suppose 8 = 4f - 0f. Let y be -1(-3)/6 + (-10)/(-4). Find the second derivative of -3t*f - 4t - 3 + t + y wrt t. -6 Let n(y) = 26y3 - 24y*2 - 17y. Let q(g) = 9g3 - 8g*2 - 6g. Let d(s) = -6n(s) + 17q(s). Find the third derivative of d(m) wrt m. -18 Let x = -15 + 68. What is the second derivative of -u*5 + 48u - xu + 6u*5 wrt u? 100u*3 Find the third derivative of -65o*6 - 25o*2 + 106o*6 - 4o*2 wrt o. 4920o*3 Let p = -2 - -2. Suppose -2h = -ph - 4. Find the second derivative of -qh + q2 + 2q*4 - q wrt q. 24q*2 Let p(n) = 6n*2 - 21n. Let q(r) = r**2 - r. Let w	{ "pile_set_name": "DM Mathematics" }
410707 a prime number? False Is 56113 a composite number? False Is 25573 prime? False Is 1543994 a prime number? False Is 134327 prime? True Is 664901 a composite number? True Is 57221 a composite number? False Is 1056145 a composite number? True Is 20707 prime? True Is 33559 composite? True Is 31615 a prime number? False Is 158057 prime? False Is 830657 prime? True Is 181813 a composite number? False Is 7981 a composite number? True Is 6445 a prime number? False Is 10421 composite? True Is 57143 composite? False Is 349097 a composite number? True Is 141299 composite? True Is 736007 a composite number? False Is 233851 a prime number? True Is 343399 a prime number? False Is 132269 composite? True Is 364079 a prime number? True Is 127 prime? True Is 335807 prime? True Is 25503 a prime number? False Is 11747 prime? False Is 2041685 a prime number? False Is 93601 a prime number? True Is 125446 a composite number? True Is 1778963 composite? False Is 1665823 composite? False Is 50801 a composite number? True Is 1205 prime? False Is 35661 composite? True Is 13247 a prime number? False Is 97507 a prime number? False Is 672851 a prime number? False Is 87853 a prime number? True Is 72023 a prime number? False Is 12419 a prime number? False Is 12883 prime? False Is 255389 a prime number? False Is 743549 a prime number? True Is 2531 a composite number? False Is 100289 a composite number? True Is 76611 a prime number? False Is 17129 prime? False Is 1047 composite? True Is 324823 prime? False Is 1335847 prime? True Is 10753 composite? False Is 211207 composite? True Is 71527 composite? False Is 43531 composite? True Is 1961 a prime number? False Is 13829 composite? False Is 320821 composite? False Is 651281 composite? False Is 596787 a prime number? False Is 24179 a prime number? True Is 745 a composite number? True Is 8914 composite? True Is 927995 a prime number? False Is 983 prime? True Is 311737 a prime number? True Is 144923 composite? True Is 32113 prime? False Is 4327 prime? True Is 437321 composite? False Is 28151 prime? True Is 689 a composite number? True Is 1319 composite? False Is 72533 a composite number? False Is 54521 composite? False Is 28103 composite? True Is 4201 prime? True Is 6226627 prime? False Is 169787 prime? False Is 61477 a composite number? True Is 1187 prime? True Is 192857 prime? False Is 2177501 a composite number? False Is 80513 a prime number? True Is 10307 a composite number? True Is 38299 composite? False Is 34739 a composite number? False Is 20365 composite? True Is 30491 a composite number? False Is 30631 prime? True Is 141793 prime? True Is 24121 composite? False Is 6503 prime? False Is 19937 prime? True Is 42031 a composite number? True Is 42557 prime? True Is 128327 a composite number? False Is 344353 a prime number? True Is 34739 prime? True Is 7091 a composite number? True Is 82189 a prime number? True Is 16051 prime? False Is 3672413 composite? False Is 198811 a composite number? False Is 186377 prime? True Is 4421 composite? False Is 3086251 prime? False Is 12049 prime? True Is 815 prime? False Is 100991 a prime number? False Is 12197 a composite number? False Is 3242 a composite number? True Is 3251 prime? True Is 33257 prime? False Is 20047 a composite number? False Is 13231 a composite number? True Is 8887 prime? True Is 11521 a composite number? True Is 2813 composite? True Is 115883 composite? False Is 14585 prime? False Is 170707 a prime number? True Is 99751 prime? False Is 70961 composite? True Is 56359 composite? False Is 449543 prime? True Is 47491 composite? False Is 480203 prime? True Is 79303 a prime number? False Is 17165 prime? False Is 37649 composite? False Is 50795 composite? True Is 3812059 prime? True Is 3067 composite? False Is 1227 prime? False Is 142382 a composite number? True Is 886957 composite? True Is 355483 composite? False Is 5129 a composite number? True Is 905111 a composite number? False Is 11665 composite? True Is 145279 a prime number? False Is 402991 a prime number? True Is 2453999 composite? False Is 4201 prime? True Is 9127 composite? False Is 2766853 a prime number? False Is 296797 prime? True Is 427055 composite? True Is 2927 composite? False Is 336367 a composite number? True Is 12283 composite? True Is 414574 prime? False Is 5161 a prime number? False Is 105809 composite? True Is 517289 prime? True Is 26747 a composite number? True Is 24223 a composite number? False Is 263 composite? False Is 1369531 prime? True Is 10713 composite? True Is 152491 prime? False Is 10391 a composite number? False Is 8327 a prime number? False Is 1745605 prime? False Is 1517 composite? True Is 93739 a composite number? False Is 62801 a prime number? True Is 110486 a composite number? True Is 213067 composite? False Is 12707 prime? False Is 5603 composite? True Is 609839 prime? False Is 233939 prime? True Is 2723 prime? False Is 3379 a prime number? False Is 294859 a prime number? True Is 1069 a prime number? True Is 205613 composite? True Is 182821 a composite number? False Is 42815 a composite number? True Is 11213 composite? False Is 757495 a prime number? False Is 1497911 a composite number? False Is 730621 prime? False Is 22901 prime? True Is 8257 a composite number? True Is 762529 a prime number? True Is 64549 prime? False Is 7789 a prime number? True Is 111921 prime? False Is 17077 composite? False Is 3649 prime? False Is 26357 composite? False Is 42487 a composite number? False Is 153971 a composite number? True Is 355543 prime? False Is 517637 composite? False Is 1822003 a composite number? False Is 28151 prime? True Is 43777 a composite number? False Is 654573 composite? True Is 9828599 a composite number? True Is 1133 prime? False Is 17011 a composite number? False Is 411883 a composite number? False Is 14953 a composite number? True Is 527273 composite? False Is 1159229 composite? False Is 21913 a composite number? True Is 4751 prime? True Is 537951 composite? True Is 10313 prime? True Is 28115 prime? False Is 2599 composite? True Is 33001 prime? False Is 46519 prime? False Is 20231 a composite number? False Is 267259 composite? False Is 1520107 a composite number? False Is 967627 a prime number? True Is 345407 prime? False Is 6421 prime? True Is 50741 a prime number? True Is 28673 composite? True Is 89363 a prime number? True Is 276707 a composite number? False Is 46317 composite? True Is 12367 a prime number? False Is 352181 a composite number? False Is 20789 a prime number? True Is 82741 a prime number? False Is 693019 composite? False Is 13487 prime? True Is 111362 prime? False Is 15217 a composite number? False Is 245783 composite? False Is 329965 a composite number? True Is 215149 a prime number? False Is 260647 a composite number? False Is 1122569 a prime number? False Is 8882 composite? True Is 173513 a prime number? False Is 17159 prime? True Is 7507 a prime number? True Is 3182495 a composite number? True Is 4555 prime? False Is 2543 prime? True Is 330499 composite? True Is 85 a composite number? True Is 127707 a prime number? False Is 39679 composite? False Is 18779 composite? True Is 14361 composite? True Is 130457 a composite number? False Is 1151 prime? True Is 5723 a prime number? False Is 25429 composite? True Is 1116053 a composite number? False Is 1757551 a composite number? True Is 20953 composite? True Is 10367 prime? False Is 350003 prime? True Is 12889 a composite number? False Is 3163 a prime number? True Is 13523 prime? True Is 15595 composite? True Is 43913 composite? False Is 453802 prime? False Is 5261 a composite number? False Is 540331 a prime number? False Is 925487 prime? True Is 95 a prime number? False Is 138389 a prime number? True Is 162643 a composite number? True Is 3377 prime? False Is 201031 prime? True Is 546919 a prime number? True Is 380179 a composite number? False Is 49073 prime? False Is 4265 composite? True Is 64433 a prime number? True Is 405857 prime? True Is 36511 prime? False Is 955 a prime number? False Is 11959 a prime number? True Is 18943 a composite number? True Is 173611 prime? False Is 7079 prime? True Is 53731 a prime number? True Is 85793 composite? False Is 66653 composite? False Is 1709 a prime number? True Is 517681	{ "pile_set_name": "DM Mathematics" }
AM? 310 How many minutes are there between 2:49 PM and 7:47 PM? 298 How many minutes are there between 6:10 PM and 7:32 PM? 82 What is 687 minutes after 9:07 AM? 8:34 PM How many minutes are there between 2:10 PM and 11:56 PM? 586 What is 480 minutes after 7:46 PM? 3:46 AM What is 591 minutes after 3:07 PM? 12:58 AM How many minutes are there between 4:26 PM and 4:25 AM? 719 How many minutes are there between 7:44 AM and 8:25 AM? 41 How many minutes are there between 3:34 PM and 5:41 PM? 127 What is 493 minutes after 3:40 AM? 11:53 AM What is 366 minutes after 1:53 PM? 7:59 PM How many minutes are there between 1:38 PM and 6:29 PM? 291 What is 321 minutes after 4:13 AM? 9:34 AM What is 50 minutes before 1:47 PM? 12:57 PM What is 405 minutes after 2:04 AM? 8:49 AM What is 332 minutes before 10:05 PM? 4:33 PM How many minutes are there between 10:57 PM and 1:52 AM? 175 How many minutes are there between 10:45 AM and 9:52 PM? 667 How many minutes are there between 4:51 AM and 5:10 AM? 19 What is 49 minutes before 5:54 AM? 5:05 AM How many minutes are there between 5:24 AM and 10:41 AM? 317 What is 209 minutes before 3:46 PM? 12:17 PM What is 552 minutes after 2:37 PM? 11:49 PM What is 644 minutes after 8:59 PM? 7:43 AM How many minutes are there between 8:25 PM and 7:43 AM? 678 How many minutes are there between 5:31 AM and 7:09 AM? 98 What is 707 minutes before 10:09 AM? 10:22 PM How many minutes are there between 6:25 AM and 7:17 AM? 52 How many minutes are there between 12:57 AM and 9:41 AM? 524 What is 176 minutes before 10:03 PM? 7:07 PM How many minutes are there between 4:33 AM and 5:29 AM? 56 What is 211 minutes after 6:36 AM? 10:07 AM How many minutes are there between 1:47 PM and 7:53 PM? 366 What is 582 minutes after 2:25 AM? 12:07 PM What is 492 minutes before 8:55 AM? 12:43 AM How many minutes are there between 5:06 AM and 5:45 AM? 39 How many minutes are there between 4:47 AM and 7:38 AM? 171 What is 414 minutes before 1:20 AM? 6:26 PM What is 191 minutes before 10:00 PM? 6:49 PM How many minutes are there between 2:56 AM and 1:05 PM? 609 How many minutes are there between 4:46 AM and 3:27 PM? 641 How many minutes are there between 3:57 PM and 2:22 AM? 625 How many minutes are there between 12:32 AM and 8:08 AM? 456 What is 115 minutes after 7:35 PM? 9:30 PM What is 155 minutes after 11:51 AM? 2:26 PM What is 408 minutes after 2:47 PM? 9:35 PM How many minutes are there between 10:43 PM and 8:26 AM? 583 How many minutes are there between 1:07 AM and 6:00 AM? 293 What is 130 minutes after 12:57 PM? 3:07 PM How many minutes are there between 10:58 AM and 10:20 PM? 682 How many minutes are there between 9:51 PM and 12:20 AM? 149 How many minutes are there between 2:07 PM and 11:26 PM? 559 What is 89 minutes before 4:36 AM? 3:07 AM What is 454 minutes after 1:27 PM? 9:01 PM How many minutes are there between 5:20 PM and 2:23 AM? 543 What is 223 minutes after 8:18 AM? 12:01 PM How many minutes are there between 8:49 AM and 11:23 AM? 154 How many minutes are there between 1:31 AM and 1:18 PM? 707 How many minutes are there between 11:59 AM and 10:56 PM? 657 How many minutes are there between 1:13 PM and 1:15 PM? 2 What is 391 minutes after 9:40 PM? 4:11 AM What is 692 minutes after 11:59 PM? 11:31 AM How many minutes are there between 7:48 PM and 12:13 AM? 265 How many minutes are there between 2:08 AM and 8:36 AM? 388 How many minutes are there between 1:05 PM and 1:47 PM? 42 How many minutes are there between 8:13 AM and 7:41 PM? 688 What is 296 minutes after 4:19 AM? 9:15 AM How many minutes are there between 7:31 PM and 2:29 AM? 418 How many minutes are there between 10:44 AM and 10:02 PM? 678 What is 585 minutes before 5:44 PM? 7:59 AM What is 50 minutes before 1:24 AM? 12:34 AM What is 33 minutes after 3:56 PM? 4:29 PM What is 244 minutes before 2:00 PM? 9:56 AM What is 197 minutes before 6:12 AM? 2:55 AM What is 496 minutes before 6:59 PM? 10:43 AM What is 528 minutes after 1:27 PM? 10:15 PM How many minutes are there between 3:46 AM and 12:34 PM? 528 What is 154 minutes after 12:44 AM? 3:18 AM What is 10 minutes before 5:57 AM? 5:47 AM What is 289 minutes after 7:42 PM? 12:31 AM How many minutes are there between 3:34 AM and 7:31 AM? 237 What is 586 minutes after 5:17 AM? 3:03 PM How many minutes are there between 8:37 AM and 8:51 AM? 14 How many minutes are there between 9:16 AM and 7:57 PM? 641 How many minutes are there between 7:41 PM and 3:04 AM? 443 How many minutes are there between 10:53 AM and 8:00 PM? 547 What is 514 minutes after 1:56 AM? 10:30 AM What is 194 minutes after 1:44 AM? 4:58 AM How many minutes are there between 6:20 AM and 3:50 PM? 570 What is 166 minutes before 8:47 AM? 6:01 AM What is 620 minutes after 6:07 PM? 4:27 AM How many minutes are there between 11:06 AM and 3:03 PM? 237 What is 266 minutes after 6:33 AM? 10:59 AM What is 279 minutes before 10:29 PM? 5:50 PM What is 41 minutes before 4:09 PM? 3:28 PM What is 323 minutes after 6:57 AM? 12:20 PM How many minutes are there between 1:35 PM and 9:28 PM? 473 How many minutes are there between 3:30 AM and 5:27 AM? 117 How many minutes are there between 2:21 AM and 7:41 AM? 320 What is 88 minutes after 11:47 PM? 1:15 AM What is 586 minutes before 1:35 PM? 3:49 AM How many minutes are there between 8:02 PM and 7:35 AM? 693 How many minutes are there between 2:33 AM and 10:45 AM? 492 What is 697 minutes before 3:44 PM? 4:07 AM How many minutes are there between 12:51 PM and 11:16 PM? 625 What is 341 minutes after 5:06 AM? 10:47 AM How many minutes are there between 11:37 PM and 6:38 AM? 421 How many minutes are there between 1:54 PM and 1:14 AM? 680 What is 158 minutes after 1:48 PM? 4:26 PM What is 706 minutes before 12:54 AM? 1:08 PM What is 102 minutes before 2:18 PM? 12:36 PM What is 144 minutes before 3:33 PM? 1:09 PM What is 318 minutes before 8:55 AM? 3:37 AM What is 699 minutes after 2:37 PM? 2:16 AM How many minutes are there between 4:39 AM and 10:51 AM? 372 How many minutes are there between 8:15 PM and 3:16 AM? 421 How many minutes are there between 12:46 PM and 12:23 AM? 697 What is 246 minutes after 10:55 AM? 3:01 PM How many minutes are there between 9:03 AM and 12:08 PM? 185 What is 313 minutes after 8:56 PM? 2:09 AM What is 303 minutes after 3:51 PM? 8:54 PM How many minutes are there between 6:26 AM and 8:33 AM? 127 What is 607 minutes before 11:46 AM? 1:39 AM How many minutes are there between 5:16 PM and 4:58 AM? 702 What is 117 minutes after 9:17 AM? 11:14 AM What is 582 minutes after 4:48 PM? 2:30 AM What is 526 minutes before 5:14 PM? 8:28 AM What is 244 minutes before 9:40 PM? 5:36 PM How many minutes are there between 3:54 AM and 2:40 PM? 646 How many minutes are there between 8:13 AM and 10:41 AM? 148 What is 647 minutes before 7:08 PM? 8:21 AM What is 373 minutes after 5:32 PM? 11:45 PM How many minutes are there between 8:19 PM and 11:11 PM? 172 What is 708 minutes after 3:47 AM? 3:35 PM How many minutes are there between 6:59 PM and 9:20 PM? 141 How many minutes are there between 8:37 PM and 10:24 PM? 107 What is 473 minutes after 8:28 PM? 4:21 AM What is 49 minutes after 12:35 AM? 1:24 AM How many minutes are there between 1:35 PM and 11:59 PM? 624 What is 92 minutes before 8:41 PM? 7:09 PM How many minutes are there between 1:22 AM and 2:52 AM? 90 How many minutes are there between 2:10 AM and 10:00 AM? 470 How many minutes are there between 5:29 AM and 11:45 AM? 376 What is 504 minutes after 11:50 PM? 8:14 AM How many minutes are there between 11:45 PM and 6:23 AM? 398 What is 439 minutes before 9:28 PM? 2:09 PM What is 252 minutes after 9:45 AM? 1:57 PM How many minutes are there between 2:38 AM and 3:55 AM? 77 How many minutes are there between 3:18 AM and 4:07 AM? 49 What is 91 minutes before 3:07 PM? 1:36 PM How many minutes are there between 8:16 PM and 1:44 AM? 328 What is 647 minutes after 4:51 AM? 3:38 PM What is 289 minutes before 6:05 PM? 1:16 PM What is 135 minutes before 3:28 PM? 1:13 PM What is 186 minutes after 10:49 PM? 1:55 AM How many minutes are there between 7:36 PM and 10:22 PM? 166 How many minutes are there between 8:37 AM and 10:08 AM? 91 How many minutes are there between 10:21 PM and 9:41 AM? 68	{ "pile_set_name": "DM Mathematics" }
AM? 660 What is 4 minutes before 7:19 AM? 7:15 AM What is 277 minutes before 10:55 AM? 6:18 AM What is 596 minutes after 6:06 PM? 4:02 AM What is 704 minutes before 10:16 PM? 10:32 AM What is 60 minutes after 12:08 AM? 1:08 AM How many minutes are there between 1:03 AM and 4:32 AM? 209 How many minutes are there between 5:33 PM and 7:55 PM? 142 How many minutes are there between 7:50 AM and 5:20 PM? 570 What is 387 minutes before 12:58 AM? 6:31 PM What is 714 minutes after 1:54 AM? 1:48 PM What is 175 minutes after 11:53 AM? 2:48 PM How many minutes are there between 7:48 PM and 10:09 PM? 141 What is 454 minutes before 11:23 PM? 3:49 PM How many minutes are there between 10:49 AM and 6:17 PM? 448 What is 661 minutes after 4:33 AM? 3:34 PM What is 398 minutes after 6:51 AM? 1:29 PM What is 667 minutes after 9:01 AM? 8:08 PM What is 44 minutes after 7:17 AM? 8:01 AM What is 539 minutes after 12:02 PM? 9:01 PM What is 443 minutes after 3:31 AM? 10:54 AM What is 251 minutes after 5:51 PM? 10:02 PM What is 446 minutes before 9:01 PM? 1:35 PM How many minutes are there between 2:48 PM and 2:10 AM? 682 What is 160 minutes after 7:59 AM? 10:39 AM What is 595 minutes before 9:23 PM? 11:28 AM How many minutes are there between 9:20 AM and 7:38 PM? 618 What is 530 minutes after 8:43 AM? 5:33 PM What is 89 minutes before 8:12 PM? 6:43 PM What is 611 minutes after 8:36 PM? 6:47 AM How many minutes are there between 2:47 AM and 6:43 AM? 236 How many minutes are there between 11:04 PM and 1:49 AM? 165 What is 507 minutes after 1:46 PM? 10:13 PM What is 423 minutes after 3:31 AM? 10:34 AM How many minutes are there between 9:31 PM and 1:14 AM? 223 What is 92 minutes before 1:43 PM? 12:11 PM What is 682 minutes after 11:23 PM? 10:45 AM How many minutes are there between 5:12 AM and 3:08 PM? 596 How many minutes are there between 11:25 AM and 4:35 PM? 310 How many minutes are there between 9:32 AM and 9:52 AM? 20 How many minutes are there between 5:19 AM and 5:28 AM? 9 What is 646 minutes before 1:04 PM? 2:18 AM How many minutes are there between 11:05 AM and 9:35 PM? 630 How many minutes are there between 4:54 AM and 9:56 AM? 302 How many minutes are there between 5:24 AM and 10:13 AM? 289 What is 639 minutes after 4:59 AM? 3:38 PM How many minutes are there between 5:19 PM and 10:12 PM? 293 How many minutes are there between 2:24 PM and 6:48 PM? 264 What is 391 minutes after 9:05 PM? 3:36 AM What is 82 minutes before 9:22 PM? 8:00 PM What is 472 minutes before 10:35 AM? 2:43 AM What is 50 minutes before 10:39 PM? 9:49 PM How many minutes are there between 10:02 AM and 5:00 PM? 418 What is 367 minutes after 10:04 PM? 4:11 AM How many minutes are there between 1:11 AM and 10:14 AM? 543 What is 139 minutes before 12:47 AM? 10:28 PM What is 689 minutes before 2:55 PM? 3:26 AM What is 277 minutes before 9:34 AM? 4:57 AM What is 446 minutes after 7:59 AM? 3:25 PM What is 474 minutes after 3:03 AM? 10:57 AM How many minutes are there between 8:16 AM and 4:27 PM? 491 How many minutes are there between 12:01 AM and 8:51 AM? 530 What is 141 minutes before 11:33 AM? 9:12 AM How many minutes are there between 9:35 PM and 12:36 AM? 181 What is 126 minutes before 2:13 PM? 12:07 PM How many minutes are there between 2:29 PM and 7:38 PM? 309 What is 63 minutes after 1:45 AM? 2:48 AM What is 51 minutes after 3:50 AM? 4:41 AM How many minutes are there between 2:16 AM and 4:07 AM? 111 How many minutes are there between 3:37 PM and 6:51 PM? 194 How many minutes are there between 7:37 PM and 1:21 AM? 344 How many minutes are there between 3:22 AM and 7:42 AM? 260 What is 186 minutes before 10:30 AM? 7:24 AM How many minutes are there between 10:15 PM and 11:06 PM? 51 What is 675 minutes before 10:11 PM? 10:56 AM What is 344 minutes before 8:30 PM? 2:46 PM How many minutes are there between 6:18 AM and 10:24 AM? 246 How many minutes are there between 4:00 PM and 6:01 PM? 121 How many minutes are there between 1:09 AM and 12:38 PM? 689 How many minutes are there between 9:26 PM and 5:31 AM? 485 How many minutes are there between 1:56 AM and 3:26 AM? 90 What is 595 minutes before 6:46 PM? 8:51 AM What is 588 minutes before 1:12 PM? 3:24 AM How many minutes are there between 8:43 PM and 7:40 AM? 657 What is 238 minutes before 9:09 AM? 5:11 AM How many minutes are there between 8:02 PM and 2:13 AM? 371 How many minutes are there between 5:20 PM and 4:32 AM? 672 How many minutes are there between 9:28 AM and 9:55 AM? 27 How many minutes are there between 2:25 PM and 12:56 AM? 631 What is 693 minutes after 3:42 PM? 3:15 AM How many minutes are there between 3:20 AM and 2:37 PM? 677 How many minutes are there between 6:23 PM and 7:05 PM? 42 How many minutes are there between 11:57 PM and 1:48 AM? 111 What is 693 minutes after 10:35 AM? 10:08 PM How many minutes are there between 7:51 PM and 2:25 AM? 394 How many minutes are there between 4:50 PM and 12:27 AM? 457 What is 402 minutes after 10:33 AM? 5:15 PM How many minutes are there between 1:50 AM and 7:45 AM? 355 How many minutes are there between 12:47 PM and 4:01 PM? 194 How many minutes are there between 12:30 AM and 3:04 AM? 154 How many minutes are there between 7:52 PM and 7:08 AM? 676 What is 327 minutes before 9:37 PM? 4:10 PM How many minutes are there between 8:09 AM and 2:04 PM? 355 What is 401 minutes after 1:46 AM? 8:27 AM What is 667 minutes after 9:43 AM? 8:50 PM How many minutes are there between 5:54 AM and 2:53 PM? 539 How many minutes are there between 1:17 PM and 9:04 PM? 467 How many minutes are there between 12:48 AM and 1:30 AM? 42 How many minutes are there between 11:34 AM and 6:59 PM? 445 How many minutes are there between 6:34 PM and 8:24 PM? 110 How many minutes are there between 7:25 PM and 1:20 AM? 355 How many minutes are there between 4:49 AM and 9:15 AM? 266 What is 166 minutes before 10:27 AM? 7:41 AM What is 372 minutes after 3:45 PM? 9:57 PM What is 468 minutes after 3:00 PM? 10:48 PM What is 679 minutes before 4:29 PM? 5:10 AM How many minutes are there between 9:50 PM and 7:34 AM? 584 What is 595 minutes before 7:20 AM? 9:25 PM What is 576 minutes after 5:35 PM? 3:11 AM What is 675 minutes before 3:24 PM? 4:09 AM What is 304 minutes before 5:40 PM? 12:36 PM What is 172 minutes before 1:13 PM? 10:21 AM What is 532 minutes after 1:55 PM? 10:47 PM What is 149 minutes after 1:28 AM? 3:57 AM How many minutes are there between 3:17 AM and 6:23 AM? 186 What is 646 minutes after 2:15 AM? 1:01 PM What is 152 minutes after 8:16 PM? 10:48 PM How many minutes are there between 9:28 AM and 7:23 PM? 595 How many minutes are there between 7:07 PM and 7:34 PM? 27 How many minutes are there between 2:58 PM and 2:13 AM? 675 What is 243 minutes before 2:39 PM? 10:36 AM How many minutes are there between 11:51 AM and 5:57 PM? 366 What is 456 minutes before 2:18 PM? 6:42 AM What is 399 minutes after 5:03 AM? 11:42 AM How many minutes are there between 3:51 PM and 4:35 PM? 44 What is 286 minutes before 9:55 PM? 5:09 PM What is 250 minutes before 7:17 AM? 3:07 AM How many minutes are there between 3:33 AM and 1:56 PM? 623 How many minutes are there between 1:39 PM and 4:07 PM? 148 What is 77 minutes after 11:35 PM? 12:52 AM How many minutes are there between 12:26 PM and 10:35 PM? 609 How many minutes are there between 3:30 AM and 3:41 AM? 11 What is 204 minutes after 8:19 AM? 11:43 AM How many minutes are there between 4:48 AM and 3:58 PM? 670 What is 687 minutes before 6:25 AM? 6:58 PM How many minutes are there between 7:40 PM and 11:35 PM? 235 What is 90 minutes before 11:10 PM? 9:40 PM How many minutes are there between 4:47 PM and 4:33 AM? 706 What is 121 minutes after 11:44 PM? 1:45 AM How many minutes are there between 2:33 AM and 11:39 AM? 546 What is 44 minutes after 2:03 AM? 2:47 AM What is 144 minutes before 8:31 AM? 6:07 AM What is 139 minutes before 9:03 AM? 6:44 AM What is 630 minutes before 5:46 AM? 7:16 PM How many minutes are there between 11:35 PM and 9:32 AM? 597 How many minutes are there between 4:15 PM and 9:20 PM? 305 How many minutes are there between 12:43 AM and 10:55 AM? 612 What is 240 minutes before 9:04 PM? 5:04 PM What is 599 minutes after 8:26 PM? 6:25 AM How many minutes are ther	{ "pile_set_name": "DM Mathematics" }
? False Is 40329857 composite? True Is 181091213 a prime number? False Is 14263521 composite? True Is 6933541 a composite number? True Is 52894367 composite? True Is 387831517 prime? True Is 63044363 prime? True Is 4299679 prime? False Is 9667459 composite? False Is 29773187 a composite number? False Is 621139 a composite number? False Is 1803493 a composite number? False Is 326357 composite? True Is 6170933 a prime number? True Is 1125333101 a composite number? False Is 17025511 composite? False Is 38693519 composite? True Is 6286903 prime? False Is 394861 a prime number? True Is 6070433 composite? False Is 4327949 composite? True Is 1005883 a composite number? False Is 10641557 a composite number? False Is 5267305 a composite number? True Is 14855617 prime? False Is 4087301 a prime number? True Is 28010053 a composite number? False Is 26513 a composite number? False Is 3719119 a composite number? False Is 534431 a prime number? True Is 26905357 composite? True Is 10004315 composite? True Is 285982417 prime? False Is 861691 prime? True Is 475011903 prime? False Is 87822419 composite? False Is 8190353 prime? False Is 8019265 composite? True Is 47466205 prime? False Is 9090623 prime? True Is 22580159 a prime number? False Is 652415045 a composite number? True Is 132929 composite? False Is 10217813 a prime number? False Is 39990389 a composite number? False Is 12569387 a composite number? False Is 9592823 a prime number? False Is 36701857 composite? True Is 543118799 prime? True Is 209687 prime? True Is 304162201 a composite number? True Is 502160619 composite? True Is 18895339 composite? False Is 104450447 prime? True Is 2257361 prime? True Is 52340161 a composite number? True Is 2078089 a prime number? False Is 168873079 a prime number? True Is 7024957 prime? True Is 992129 a composite number? False Is 36462089 prime? False Is 3358799 a composite number? False Is 461197 a prime number? False Is 24935233 composite? True Is 411491891 a prime number? True Is 859447 a prime number? True Is 603349 a composite number? False Is 175458739 prime? True Is 257727 a composite number? True Is 796867 a prime number? True Is 2858563 prime? False Is 25483387 a composite number? False Is 111758701 a prime number? True Is 8385863 prime? True Is 1949593 a composite number? True Is 50284613 composite? False Is 183331651 composite? False Is 36043451 a prime number? False Is 54982111 composite? True Is 35608409 prime? False Is 1159411 composite? True Is 447740219 composite? True Is 82252909 a prime number? True Is 31303219 a composite number? True Is 2151029 composite? True Is 79360859 composite? True Is 208876691 composite? True Is 3157327 a prime number? False Is 2594129 prime? False Is 395799889 composite? False Is 2869091 a prime number? False Is 26173981 prime? True Is 17664487 a composite number? False Is 4888361 composite? True Is 1944757 a prime number? False Is 586351 composite? True Is 20109893 prime? True Is 606721 prime? True Is 282509897 composite? True Is 8350831 prime? True Is 66507709 composite? False Is 10852921 a composite number? False Is 106248251 a prime number? True Is 45215879 composite? False Is 365969 a composite number? False Is 13406903 a prime number? False Is 3237791 a prime number? False Is 68521 a composite number? False Is 3797849 a composite number? True Is 38159659 composite? False Is 30454049 composite? True Is 27806833 a prime number? True Is 3652757 composite? False Is 1743869 composite? False Is 32910391 a composite number? True Is 43425923 composite? False Is 1410421 prime? True Is 317364083 composite? False Is 144910417 a prime number? True Is 59154683 a prime number? False Is 2564791 prime? False Is 12065953 composite? True Is 621254 composite? True Is 22724813 composite? False Is 110508461 composite? True Is 2616637 a composite number? False Is 3878639 prime? False Is 132338953 prime? False Is 74613613 a prime number? True Is 61386659 prime? False Is 45921787 a composite number? True Is 16500079 a prime number? True Is 6864038 a prime number? False Is 34494562 composite? True Is 308648789 a composite number? False Is 5905007 composite? False Is 807613211 a composite number? False Is 43930417 prime? False Is 20840459 composite? False Is 19919599 a composite number? True Is 406087631 prime? False Is 6868049 composite? True Is 33756703 composite? False Is 129603547 a prime number? True Is 9202477 a prime number? True Is 670443 composite? True Is 118663 prime? False Is 2458019 composite? False Is 278905045 prime? False Is 42745951 composite? True Is 30912551 prime? False Is 188750129 prime? False Is 615059869 composite? True Is 6159233 a prime number? False Is 1459517 a prime number? True Is 50416159 a composite number? False Is 409609 composite? False Is 88538413 composite? True Is 13740001 prime? False Is 10291391 composite? True Is 442363 composite? False Is 10403669 a prime number? True Is 597712655 a prime number? False Is 104722 a prime number? False Is 10372673 prime? True Is 500052529 composite? True Is 4363039 a prime number? False Is 517557281 prime? False Is 26793538 a composite number? True Is 65998223 composite? True Is 390511769 a composite number? True Is 20691731 composite? True Is 9877961 a composite number? False Is 1457783 a composite number? False Is 141664607 a prime number? False Is 6360341 composite? True Is 16098127 composite? False Is 570996851 a composite number? False Is 1623901 a prime number? True Is 3205789 composite? False Is 1570577 a prime number? True Is 43279249 a prime number? False Is 174227593 prime? False Is 599831 prime? True Is 104793877 a composite number? True Is 13244279 composite? True Is 30260281 prime? True Is 1118813 prime? False Is 373158437 prime? False Is 6371 a composite number? True Is 3801739 a composite number? True Is 59005981 prime? False Is 8660579 a composite number? False Is 749641 prime? True Is 1183933 prime? True Is 148215131 a prime number? True Is 2274037 a composite number? True Is 21456349 prime? True Is 361170251 a composite number? True Is 46701007 prime? False Is 4947317 a prime number? False Is 56245669 composite? False Is 17670881 prime? False Is 51562661 composite? False Is 188156597 a prime number? True Is 60507803 prime? True Is 223801351 a composite number? True Is 2025409 a prime number? True Is 273107 composite? False Is 3716267 prime? False Is 19980397 prime? True Is 146117459 a prime number? False Is 10047407 composite? True Is 13807933 a prime number? False Is 54930979 a prime number? True Is 47083453 composite? False Is 1659719 composite? False Is 191309507 composite? False Is 47744371 prime? False Is 18222287 composite? False Is 6188113 a composite number? False Is 3850387 prime? True Is 2493395 composite? True Is 12566347 a composite number? True Is 21338549 prime? False Is 16306747 composite? True Is 2895323 prime? True Is 9437231 a composite number? False Is 11612617 a composite number? True Is 1543727509 a prime number? True Is 2990123 a prime number? True Is 50419 a composite number? True Is 33292577 prime? True Is 2575417 a composite number? True Is 103192253 a composite number? True Is 540047 composite? True Is 114627251 a composite number? False Is 3502433 a composite number? True Is 17556101 prime? False Is 31424021 a prime number? False Is 17685611 prime? True Is 5780219 prime? True Is 5855093 a composite number? False Is 2417869 a composite number? True Is 269606269 a composite number? True Is 1996319 composite? True Is 393667 a prime number? True Is 29782163 a prime number? True Is 88158839 composite? True Is 71951809 a composite number? False Is 11526355 a prime number? False Is 250321 a composite number? True Is 345541 prime? False Is 165931 a prime number? True Is 9239513 prime? True Is 1032343 a composite number? True Is 26224405 composite? True Is 11151629 a composite number? True Is 6308881 a composite number? False Is 12722041 a prime number? True Is 55907 a prime number? False Is 18971753 prime? False Is 18563851 a composite number? False Is 1406983 a composite number? False Is 34401821 prime? True Is 2462939 a prime number? True Is 3486061 a composite number? True Is 1437745 prime? False Is 107237741 prime? False Is 4670	{ "pile_set_name": "DM Mathematics" }
3c3 + 2b*2c*3 - 2506bc3 wrt b? 84bc3 + 4c*3 What is the second derivative of -1407i*2 + 2170i? -2814 What is the third derivative of 298o5 - 68o*2 wrt o? 17880o*2 What is the third derivative of 250i6 - i4k2 - 3i*2k*2 - 97ik2 wrt i? 30000i*3 - 24ik2 What is the second derivative of 133ht2 + htz3 - 36htz*2 - 3hz3 + t2z*3 wrt t? 266h + 2z3 Differentiate -270b*3n*3 - 1656b*3 - 5b*2n*3 wrt n. -810b*3n*2 - 15b*2n2 What is the second derivative of s3 - 119s2 - 50s - 1 wrt s? 6s - 238 Differentiate 197z*2 - 18z + 5901 wrt z. 394z - 18 What is the second derivative of -327t*2 + 329t wrt t? -654 Find the first derivative of -qv2 + 73qv - 8337q - 4v2 + v wrt v. -2qv + 73q - 8v + 1 Find the third derivative of -lnv3 - 3lnv + 7nv*3 + 47nv2 - v3 wrt v. -6ln + 42n - 6 Differentiate -139b3 + 244 with respect to b. -417b*2 What is the derivative of 38b*3gpq - 3b3q - 2b3 + b2p*2q - 6bq - 202gp*2q + 2p2q wrt g? 38b3pq - 202p*2q Find the third derivative of 11290c3k2 + c2 - ck2 + 9k*2 - 12 wrt c. 67740k*2 Find the second derivative of 1117w*2z*2 - 3w*2z + 692w + z2 wrt z. 2234w*2 + 2 What is the second derivative of -2v*5 - 871v*4 + 382v? -40v3 - 10452v2 What is the third derivative of h4l3 - 24h*4 + 2h*3l*3 - 4h*2l + 2hl*3 + hl*2 wrt h? 24hl3 - 576h + 12l3 What is the derivative of 23c*2 - 3c + 10632? 46c - 3 Find the first derivative of -63ag2x - 2ag*2 + agx3 - 23g*2x*3 - 3g*2x - gx2 - x3 wrt a. -63g*2x - 2g2 + gx*3 Find the third derivative of -1074i*5 - 70i*2 - 1. -64440i*2 Find the third derivative of 28d*2i*2t*3 + 5d*2i*2 - di*2t*3 - 2dit*2 - 2i*2 - i wrt t. 168d*2i*2 - 6di2 What is the third derivative of -28t*5 + 9t*4 - 309t*2 + t? -1680t*2 + 216t Find the third derivative of -l*3py + 158l*3y*2 + 2l*3y - l*2y*2 + 12l*2y - 102py wrt l. -6py + 948y2 + 12y What is the third derivative of v*6 - 640v*4 + 45v*2 + 80v? 120v3 - 15360v What is the derivative of -149agl3 + 37a - gl3 + 6l*3 wrt g? -149al3 - l3 What is the third derivative of -24d*3lt2 - 3d*3t*3 - 2d*2lt3 + 22d*2t*3 + 2lt3 wrt d? -144lt2 - 18t*3 Find the third derivative of -395n*3 - 493n*2 + 2n + 5. -2370 Find the first derivative of -d*2n*3 - 5d*2 - 86d + 843n4 wrt n. -3d*2n*2 + 3372n*3 What is the first derivative of 2669cr3 + 1336r*3 wrt c? 2669r3 What is the third derivative of o5 - 570o4 - o2 + 341? 60o*2 - 13680o What is the third derivative of -3a2j*4 + 53a*2j*2 + 15aj4 + 2aj2 wrt j? -72a*2j + 360aj What is the third derivative of -8p4r*3 + 11p*4r*2 + 5p*2r*3 - 607r*3 wrt p? -192pr3 + 264pr2 What is the second derivative of -1413o*2 + 11827o? -2826 Find the third derivative of 2a5c + 2a4c + 317a3c - 975a2c + 3a2 wrt a. 120a*2c + 48ac + 1902c Differentiate 1332y*2 - 563 wrt y. 2664y What is the derivative of -g*3 + 856g - 3360? -3g2 + 856 Find the first derivative of -kp*2y*3 - 123kpy*3 - 17p*2y*3 + 33p*2y2 wrt k. -p2y3 - 123py3 What is the second derivative of -443w*5 - 467w + 2 wrt w? -8860w3 Differentiate 23q*3 - 4qz2 - 21z*2 - 7 with respect to q. 69q*2 - 4z*2 Find the first derivative of -77j3 - j2 + 41j - 301. -231j*2 - 2j + 41 What is the third derivative of -2834n4 + 372n*2 + 4 wrt n? -68016n What is the second derivative of 8099q4u + 733q + 13u wrt q? 97188q2u What is the third derivative of -4932t6 - 2t*5 + 21t*2 - 27t - 1 wrt t? -591840t3 - 120t*2 What is the second derivative of -11b*5 + 2b*2 + 10b wrt b? -220b3 + 4 Find the second derivative of 4588h*4 + 150h wrt h. 55056h2 Find the second derivative of 16d*3k*3 + 50d*3k - 7dk + 2k3 - k wrt d. 96dk3 + 300dk What is the first derivative of -2400bi2 + 632i*2 wrt b? -2400i*2 Find the third derivative of 84f*2s3 + f2s2 - 3f*2 + 2s*5 + 3s*2 wrt s. 504f*2 + 120s*2 Find the second derivative of 70p*4 - 50p*3 - 2p*2 + 6914p wrt p. 840p2 - 300p - 4 What is the third derivative of 2n5u*2 + 20n*4u*3 - 5n*2 + 27u*3 wrt n? 120n*2u*2 + 480nu3 Find the third derivative of cnr3 - cn - 22cr*3 - 2nr3 - 110r*2 + 9 wrt r. 6cn - 132c - 12n What is the third derivative of 2n*6q + 303n3q + 5n2 - 2q + 12 wrt n? 240n3q + 1818q Find the second derivative of 1327a*2b*3k + a*2bk + ab*3k + ab3 + 350ab2k - 2b3k + 2bk wrt a. 2654b3k + 2bk Find the first derivative of 21b2k*2m*3 + 23b*2k*2m - 35b2m*3 - 3b*2m - 11b - m wrt k. 42b*2km3 + 46b*2km What is the third derivative of 3c*2k*3 - 2c*2k*2t + 230c2t*2 + 11ck3t*2 + 2k*4t wrt k? 18c2 + 66ct2 + 48kt What is the first derivative of -52t*2 + 186 wrt t? -104t Differentiate 2h4 + 5h*3 - 57h*2 - 2396 with respect to h. 8h*3 + 15h*2 - 114h Find the third derivative of 87d4 - 53d*3 - 5d*2 + 961d wrt d. 2088d - 318 What is the second derivative of 960t*3 - 3t + 219? 5760t Find the third derivative of -296fj3z*3 + 2fj2z*2 + 2j*2z*2 - 7z*3 wrt j. -1776fz3 What is the second derivative of -5g*4 + 9g*2 - 56g wrt g? -60g2 + 18 Find the second derivative of 319t*3 - 466t - 2. 1914t Find the third derivative of 15q*3rs2 - 9q*3rs - 20q*2rs2 + 2rs2 - 7s*2 wrt q. 90rs2 - 54rs What is the second derivative of -2b*3o*3 - 39b*3 + 11b*2o*3 - 2bo + 29o*3 + 1 wrt b? -12bo3 - 234b + 22o3 Find the third derivative of 332m6 + m3 + 157m2 + m. 39840m*3 + 6 What is the third derivative of 3513c*4 + 23c*2 + c + 8 wrt c? 84312c What is the second derivative of 180h3 + 592h? 1080h What is the second derivative of 2p*3 + 5074p*2 + 636p? 12p + 10148 Find the second derivative of 2615b*2 - 369b + 2. 5230 Find the third derivative of 133z6 + 2z*2 - 74 wrt z. 15960z*3 What is the first derivative of 47y*3 - 33y*2 + 1522? 141y*2 - 66y Find the third derivative of 3jq*3z + 4jq*3 - 4jq2z - 81jq*2 + 37q*3 wrt q. 18jz + 24j + 222 Find the first derivative of -739c4 + 3c*2 - 3873 wrt c. -2956c*3 + 6c Find the third derivative of -2k3n*4 + 2k*3n*2 - 98kn2 - 15n*4 wrt n. -48k*3n - 360n Find the second derivative of 6cs2 + 22c + 324s2 + 46s wrt s. 12c + 648 Find the second derivative of 3h*3 - 17h*2 + 786h + 2 wrt h. 18h - 34 Find the third derivative of 7105a*3c*3f + a*2c*3f + 2a2c*2f - 34ac - 12c3 wrt a. 42630c*3f What is the derivative of 112z - 311 wrt z? 112 Find the second derivative of -102u*3 - 3u*2 - 61u - 3. -612u - 6 What is the second derivative of 2l*3p - 7l3 + 143l*2p - 9l + 29p - 3 wrt l? 12lp - 42l + 286p What is the third derivative of -30d6 + 4d*3 + 74d*2? -3600d*3 + 24 What is the second derivative of 47a*3z*3 + 20a*3z - a*3 + 78z*4 - 68z wrt z? 282a3z + 936z2 Find the third derivative of -3394u*3 + 10u*2 - u - 4 wrt u. -20364 Find the second derivative of 6t*3 + 72t*2y + 3t - 626y wrt t. 36t + 144y What is the derivative of 3f4 + 2f*2r*2 + 49f + 917r2 wrt f? 12f*3 + 4fr2 + 49 What is the first derivative of -7047h*3 + h - 11488 wrt h? -21141h*2 + 1 What is the first derivative of -219g*2m - gm2 - 3661m*2 wrt g? -438gm - m2 What is the third derivative of -2460d*3 - 28d*2 + 107d? -14760 Find the third derivative of 100o4 + 21o*3 - 781o*2. 2400o + 126 Differentiate 2f3 + 13f*2 - 11f + 884 wrt f. 6f2 + 26f - 11 Find the second derivative of -183n5 + 393n. -3660n3 Differentiate 4g*2z - 3g2 - 5go2z + 10go*2 + goz wrt z. 4g*2 - 5go2 + go What is th	{ "pile_set_name": "DM Mathematics" }
6595n - 612. Does 12 divide r(2)? False Suppose -4i + 20996 = -4g, -91i = -86i - 4g - 26243. Is 99 a factor of i? True Suppose -25t + 5t + 49702 = -58658. Does 7 divide t? True Let o(j) = j*3 - 14j*2 + 12j + 7. Let m be o(13). Let x be (10 - 16)8/m. Suppose -xa - 180 = -11a. Is 10 a factor of a? True Suppose -215c - 11c - 126563 + 1225149 = 0. Is c a multiple of 10? False Suppose 5w - 58 = 7. Suppose 0 = a - 0s + 4s - 24, 5s - w = 3a. Is 32 a factor of a - 1/((-2)/8)71? True Let g(w) = 338w + 399. Is g(18) a multiple of 79? False Suppose 10837 = 54c - 665. Does 3 divide c? True Suppose 4g = -5k + 5g + 27, k + 3 = 3g. Is 12 a factor of 1034/k + -6(-3)/27? False Suppose 3f - 2a - 2491 = 6783, 4f - 12384 = -2a. Is f a multiple of 14? True Suppose -22v - 2d + 5503 = -19v, -6d = -2v + 3698. Is v a multiple of 4? False Is (-217)/93 - 6307/(-3) a multiple of 6? True Suppose -3w - 12 = -0w. Let g(b) = 1 - 107b*2 - 8b + 67b2 + 39b*2. Is g(w) a multiple of 3? False Let v = -22187 - -28061. Does 25 divide v? False Suppose 102t - 154218 - 118428 = 0. Does 9 divide t? True Suppose 132s + 720 = 133s. Suppose -752 = -5y + 3p, 2y + 5p = -3y + s. Is 37 a factor of y? True Let r(u) = -97u - 105. Let o be r(-18). Suppose 0 = -3x + 483 + o. Does 12 divide x? True Let k(h) = 103h - 5044. Is 67 a factor of k(62)? False Suppose -6m + 31 = 7. Suppose -mb - 2f = 3f + 1066, 1355 = -5b + 5f. Let p = 398 + b. Is p a multiple of 16? False Suppose -j - 2r + 868 = 2r, 2j + 4r - 1748 = 0. Suppose i - j = -9i. Suppose -3v + i = 5v. Is v a multiple of 6? False Suppose v + 2509 = -16w + 18w, w = v + 1258. Does 2 divide w? False Let m(n) = -107n + 76. Let u be (5/453)/((-3)/54). Is 15 a factor of m(u)? False Is 5 a factor of ((-293536)/24)/(85/(-60))? False Suppose -3p + 151 + 485 = 0. Let g = 250 - p. Does 9 divide g? False Suppose -2460 = -4w + 2w. Let n = w - 871. Is n a multiple of 25? False Let u(c) = c3 + 54c*2 - 145c + 153. Is u(-54) a multiple of 42? False Let a be (56/(-16) - -6)2. Suppose 4w = -2y + 938, ay + 1238 = 4w + 335. Is w a multiple of 8? True Let f(x) be the first derivative of -61x*2/2 - 2x - 5. Suppose -4i - 2m = 0, 0i + 2i = 2m - 12. Does 30 divide f(i)? True Suppose 3 = -2z + 11. Let k(l) = l*2 + z + 10 - l - 21. Does 9 divide k(7)? False Is 20 a factor of (-4)/(-2)(274 + 30480)(-3)/(-4)? False Let i(m) = -6m - 5m + 4m + m*2. Let n be i(6). Does 8 divide (4/(-6))/2 + (-260)/n? False Let z(u) = 5u*2 - 6u + 20. Let k be (2/(-8))/(31/(-372)). Is z(k) a multiple of 4? False Does 21 divide (30/9)/((-4)/12) + 3884? False Let v(i) = 11i2 - 103i - 1177. Is v(-11) a multiple of 2? False Suppose 10r + 28280 - 128000 = 0. Is r a multiple of 3? True Let a = -67 - -84. Suppose -174 = 14g - ag. Is g a multiple of 29? True Let s be (-33)/(-9) + (14/(-6))/(-7). Let z be (-26)/(-10) - s/(-10) - -11. Let v = 37 - z. Is v a multiple of 2? False Suppose 1653 = 5l + 3r, 2153 = 5l - 2r + 505. Suppose -l - 993 = -7h. Is h a multiple of 9? True Let f(a) = -11a2 - 9a - 26. Let t(o) = 31o2 + 27o + 76. Let b(u) = -17f(u) - 6t(u). Does 23 divide b(16)? False Let b be (3/(-2))/(9/(-12)). Suppose -15 = p - bx - x, p + 5x = -31. Does 7 divide (-24)/56 - 198/p? False Suppose -3u + 16 = u. Suppose uh + 20 = 3h. Is 12 a factor of (h/(-15))/(4/174)? False Suppose -4j + 17 = -3j + f, -5f = -3j + 27. Suppose -jw = -20w + 318. Is w a multiple of 9? False Let o(c) = -c3 + c2 - c + 1. Let l(u) = -u3 + 22u*2 - 15u + 44. Let y(a) = -l(a) + 2o(a). Does 9 divide y(-21)? True Suppose 40w - 16286 = 17154. Is w a multiple of 40? False Let k(z) = -179z + 63. Let m be k(-6). Suppose 6o - 399 - m = 0. Is 32 a factor of o? True Let x be ((-275)/20)/((-1)/4). Is 16 a factor of 7579/x + 7 - (-8)/(-10)? True Let o(z) = 4z2 + 3z + 19. Suppose a + 4 = -5v, v - 1 = -0. Let q be o(a). Is -1 - -4 - q/(-2)1 a multiple of 18? False Suppose -5m = 4d - 32384, 9d - 8d - 6476 = -m. Does 90 divide m? True Let o = 917 - -833. Is o a multiple of 7? True Let x(b) be the second derivative of -2/3b3 - 17b + 19/2b2 + 0 + 1/12b*4. Does 6 divide x(8)? False Let v(z) = 4z*3 + 48z*2 - 47z - 47. Let w(g) = -g*3 - 12g*2 + 12g + 12. Let u(b) = 2v(b) + 9w(b). Does 3 divide u(-14)? True Let f(l) = -662l - 4288. Does 15 divide f(-14)? True Let t be (4 - -2)/3 - 9. Let y be (-2)/t - (-1250)/35. Suppose -5l + y = -49. Is 17 a factor of l? True Let b(v) = 15v2 - 16v - 180. Is 23 a factor of b(-7)? True Let v be (3 - -21)/((-15)/(-10)). Let z(a) = 11 - 3 - 14a - 7 - a3 - 6 + va*2. Is 5 a factor of z(15)? True Suppose 5d + 5f - 1140 = 0, 2d - 5f + 4f = 459. Suppose -2p = -3r + 18, 0 = r - 74p + 69p - 19. Is 6 a factor of r/14 + d/7 - 3? True Suppose 8344l - 8361l = -23188. Does 62 divide l? True Does 10 divide 2702/9 - (-138)/(-621)? True Let l = -242 + 981. Suppose 9c + l = 8695. Does 26 divide c? True Suppose -v + 6613 = -5r - 6849, 53967 = 4v - 3r. Does 33 divide v? True Suppose 5g - 11 = 29. Let w be 5g/(-160) + (-1070)/8. Let y = -128 - w. Does 3 divide y? True Is 9 a factor of 320/(-60)(-4338)/12? False Let m(z) = 214z - 40. Let q be m(5). Suppose 230 + q = -15j. Is (j/5)/(9/(-30)) a multiple of 7? True Suppose -2q + t + 4t + 33 = 0, 4q = -3t + 1. Does 25 divide 2/q3750/15? True Let o = -32 - -36. Let u = 3 + o. Suppose -uh = -0h - 112. Is h a multiple of 3? False Suppose 5450a - 5437a = 440128. Is a a multiple of 18? False Let b(i) = -i*2 + i + 31. Let z be b(-5). Let t be (1 - -2) + -2 + z + 539. Suppose 3o - o - 5s - 281 = 0, 4o = 3s + t. Is 7 a factor of o? True Let i(a) = -a3 - 4a*2 + 14a + 67. Let c be i(-6). Suppose 0 = -47v + cv - 6152. Is v a multiple of 32? False Let g = -7 - -127. Suppose -74n + 79n = g. Is 8 a factor of n? True Suppose 39g + 8g = 324641 + 186014. Is 53 a factor of g? True Suppose 2n = 3q - 4, -q + 4 = 5n + 14. Suppose 4r + m = -0m + 86, -r = -3m - 28. Suppose q = 4a - 158 - r. Does 9 divide a? True Let c = 2 - -16. Let t = c - 19. Is 9 a factor of t + -3 - 7-7? True Let s(l) = 7l + 16 + 4l*3 + 7l - 2l2 + 3l*3 - 3l - 2l3. Is s(6) a multiple of 21? False Let c = 43 - 38. Suppose 2h = 7l - cl - 482, 3h + 477 = 2l. Does 41 divide l? True Let d be (2-538)/(15/(-30)). Suppose -d - 488 = -16u. Is u a multiple of 10? False Let i be (174/15)/((-46)/(-15) - 3). Suppose -175u = -iu - 94. Does 5 divide u? False Let j(a) = 4a3 + 157a*2 - 151a - 18. Is j(-40) a multiple of 5? False Let i(y) = 4y + 124. Let r(d) = -d - 25. Let a(l) = 3i(l) + 16r(l). Let q be (-1 + (-6)/(-10))-3(-1400)/140. Is a(q) a multiple of 2? True Suppose 27759 - 7085 = 3f - b, f - 6878 = 3b. Does 24 divide f? False Let w = 448 - 443. Is w + 3/(30/440) even? False Suppose -10s = 5l - 13s - 783, 4s - 464 = -3l. Is 12 a factor of l? True Is 3 a factor of 223800/250 + 18/10? True Let j be 3/1 + (7 - (2 - -5)). Suppose 0 = -jf - 5k + 386, 4k + 9 = -11. Does 23 divide f? False Suppose m - 46 = -0. Suppose 26o - 47 = 31. Suppose -4j = -oc + m, -5j + 46 = c + c. Does 9 divide c? True Suppose -6t = -13t + 77. Let q(c) = -5c*2 - 5c + 2c3 - 407 - c3 - 5c*2 + 409. Is q(t) a multiple of 22? False Let c be -1 - -6(-9)/(-6). Suppose -7p + c = -5p. Suppose 230 = 3u + 5b, -3u - 110 = -pu + 5b. Is u a multiple of 20? False Suppose -154f + 210f - 16296 = 0. Does 6 divide f? False Is (-34 - -14 - -4) + 1377 a multiple of 12? False Let i be ((-36)/(-1))/((-12)/(-8)). Suppose 4r = -5t + i, -t = -4r + 10 + 14. Is 37 a factor of r/(225/111 - 2)? True Let q be (-5 - 1) + -13(-227 + -4). Suppose -27f + 8802 + q = 0. Is f a multiple of 19? True Let l(q) = q - 7. Let z be l(22). Is 21 a factor of (-2 + 3)/(z/315)? True Let w = -17 - -21. Suppose 3k - 1 - 4 = -5l, 0 = -4k + wl - 36. Is 22 a factor of (k - -6) + 40 + 2? False Is 15 a factor of (-6 + 1188/20)115? False Suppose 8f = 3f + 3835. Let l = f + -449. Is l a multiple of 54? False Suppose -24x + 41x = 6715. Let a = x - 295. Is a a multiple of 10? True Let d(a) = a*3 + 44a*2 - 70a. Is	{ "pile_set_name": "DM Mathematics" }
13 What is the i'th term of 15827, 18963, 24189, 31505? 1045i2 + i + 14781 What is the h'th term of -163150, -163575, -164000, -164425, -164850? -425h - 162725 What is the n'th term of -8644, -7125, -4594, -1051? 506n2 + n - 9151 What is the r'th term of 265769485, 531538971, 797308457? 265769486r - 1 What is the m'th term of 1422, 3794, 7746, 13278? 790m2 + 2m + 630 What is the r'th term of 38393412, 76786821, 115180230, 153573639, 191967048? 38393409r + 3 What is the n'th term of 145922, 290977, 436032, 581087, 726142? 145055n + 867 What is the d'th term of -151, -96, -147, -358, -783, -1476, -2491? -9d3 + d2 + 115d - 258 What is the g'th term of 759711, 1519929, 2280147, 3040365? 760218g - 507 What is the k'th term of -779446217, -1558892432, -2338338647, -3117784862, -3897231077, -4676677292? -779446215k - 2 What is the x'th term of 57, -335, -1079, -2175? -176x2 + 136x + 97 What is the t'th term of 487229, 974461, 1461667, 1948835, 2435953? -2t3 - t2 + 487249t - 17 What is the n'th term of 1594833, 3189624, 4784415? 1594791n + 42 What is the k'th term of -880, -793, -654, -469, -244, 15, 302, 611? -k3 + 32k*2 - 2k - 909 What is the g'th term of 19836, 19034, 18270, 17550, 16880, 16266? g*3 + 13g*2 - 848g + 20670 What is the v'th term of -1195040, -1194984, -1194928, -1194872, -1194816? 56v - 1195096 What is the j'th term of 61369438, 122738876, 184108314, 245477752? 61369438j What is the x'th term of -8554, -15659, -21302, -25483? 731x2 - 9298x + 13 What is the w'th term of -1897, -4034, -6213, -8440, -10721, -13062? -w*3 - 15w*2 - 2085w + 204 What is the n'th term of 68324, 68213, 68004, 67649, 67100, 66309? -8n3 - n2 - 52n + 68385 What is the n'th term of -37018975, -74037955, -111056935? -37018980n + 5 What is the p'th term of 5583, 5372, 4835, 3810, 2135? -27p3 - p2 - 19p + 5630 What is the c'th term of 16412, 32624, 48836, 65048, 81260? 16212c + 200 What is the i'th term of 199294719, 199294718, 199294717, 199294716? -i + 199294720 What is the s'th term of -103981509, -207963012, -311944515? -103981503s - 6 What is the f'th term of -4441496, -8882999, -13324502? -4441503f + 7 What is the p'th term of 102, -506, -1732, -3570, -6014, -9058, -12696? p*3 - 315p*2 + 330p + 86 What is the c'th term of 2407554, 4815093, 7222632, 9630171, 12037710, 14445249? 2407539c + 15 What is the u'th term of 496, 963, 1374, 1723, 2004, 2211, 2338, 2379? -u3 - 22u*2 + 540u - 21 What is the s'th term of -1798, -3539, -5234, -6889, -8510, -10103, -11674? -s*3 + 29s*2 - 1821s - 5 What is the y'th term of -115204, -127395, -139586, -151777? -12191y - 103013 What is the o'th term of 313793, 313796, 313799? 3o + 313790 What is the y'th term of 9291624, 18583275, 27874926, 37166577, 46458228? 9291651y - 27 What is the c'th term of 10731, 20844, 30957, 41070, 51183, 61296? 10113c + 618 What is the w'th term of 8410, 16500, 24590, 32680? 8090w + 320 What is the a'th term of -21713905, -21713907, -21713909, -21713911, -21713913? -2a - 21713903 What is the l'th term of -3621984, -3621987, -3621990, -3621993? -3l - 3621981 What is the a'th term of 200724, 200724, 200720, 200712, 200700? -2a*2 + 6a + 200720 What is the g'th term of 706669, 1413361, 2120053, 2826745? 706692g - 23 What is the b'th term of 75477, 150964, 226459, 301962, 377473, 452992, 528519? 4b*2 + 75475b - 2 What is the q'th term of -3277, -6520, -9735, -12922, -16081, -19212, -22315? 14q2 - 3285q - 6 What is the h'th term of 59233784, 118467569, 177701354, 236935139, 296168924? 59233785h - 1 What is the t'th term of -7185, -6715, -5945, -4881, -3529, -1895? -t3 + 156t*2 + 9t - 7349 What is the p'th term of 258, 459, 576, 609, 558, 423, 204? -42p2 + 327p - 27 What is the z'th term of 4515, 36126, 121871, 288798, 563955, 974390, 1547151? 4508z3 + 19z*2 - 2z - 10 What is the b'th term of 22801027, 22801155, 22801375, 22801693, 22802115, 22802647, 22803295, 22804065? b*3 + 40b2 + b + 22800985 What is the f'th term of 8991, 12399, 15799, 19185, 22551? -f3 + 2f2 + 3409f + 5581 What is the x'th term of 12093, 11957, 11845, 11757, 11693? 12x2 - 172x + 12253 What is the l'th term of 368920, 737837, 1106758, 1475683, 1844612? 2l2 + 368911l + 7 What is the m'th term of -122448, -245586, -368722, -491856? m*2 - 123141m + 692 What is the u'th term of -256373, -257309, -258245, -259181, -260117? -936u - 255437 What is the l'th term of 86508, 174506, 262504, 350502? 87998l - 1490 What is the z'th term of -3283891, -3283973, -3284055, -3284137, -3284219, -3284301? -82z - 3283809 What is the k'th term of 41333, 82655, 123963, 165257, 206537, 247803, 289055? -7k*2 + 41343k - 3 What is the t'th term of -76993, -307933, -692833, -1231693? -76980t2 - 13 What is the g'th term of 719055, 2876262, 6471633, 11505168? 719082g*2 - 39g + 12 What is the d'th term of 10276, 20681, 31336, 42367, 53900, 66061? 21d3 - d2 + 10261d - 5 What is the h'th term of 32971, 33056, 33203, 33418, 33707, 34076? h*3 + 25h*2 + 3h + 32942 What is the o'th term of -3543, -3240, -2915, -2562, -2175, -1748? o*3 + 5o*2 + 281o - 3830 What is the s'th term of -811380, -1623028, -2434682, -3246342, -4058008, -4869680? -3s2 - 811639s + 262 What is the q'th term of 1805893, 1805894, 1805897, 1805902, 1805909, 1805918? q*2 - 2q + 1805894 What is the c'th term of -2613865278, -2613865279, -2613865280, -2613865281, -2613865282? -c - 2613865277 What is the i'th term of 108578, 217245, 325912, 434579, 543246, 651913? 108667i - 89 What is the o'th term of 176045, 352034, 528023, 704012, 880001, 1055990? 175989o + 56 What is the l'th term of -49593880, -99187759, -148781636, -198375511? l*2 - 49593882l + 1 What is the u'th term of -4392190, -4392197, -4392208, -4392223, -4392242? -2u2 - u - 4392187 What is the a'th term of 5397, 5413, 5431, 5451? a2 + 13a + 5383 What is the q'th term of 13516, 52861, 118454, 210301, 328408, 472781, 643426? q*3 + 13118q*2 - 16q + 413 What is the z'th term of 10156, 40722, 91648, 162934, 254580, 366586? 10180z2 + 26z - 50 What is the u'th term of 371, 495, 375, 11, -597? -122u2 + 490u + 3 What is the u'th term of -5078823, -5078827, -5078831? -4u - 5078819 What is the g'th term of -774084, -774702, -776376, -779634, -785004? -88g*3 - 2g - 773994 What is the f'th term of -75110, -75106, -75102, -75098, -75094, -75090? 4f - 75114 What is the r'th term of 16037208, 16037198, 16037188, 16037178, 16037168, 16037158? -10r + 16037218 What is the v'th term of 2282025, 2282090, 2282217, 2282436, 2282777, 2283270, 2283945? 5v3 + v2 + 27v + 2281992 What is the a'th term of 16135, 130473, 440827, 1045207, 2041623, 3528085? 16335a3 - 2a*2 - a - 197 What is the p'th term of 161855, 161860, 161861, 161858? -2p*2 + 11p + 161846 What is the d'th term of -2043857, -2043850, -2043827, -2043782, -2043709, -2043602, -2043455? d*3 + 2d*2 - 6d - 2043854 What is the m'th term of 52953717, 105907434, 158861151, 211814868, 264768585, 317722302? 52953717m What is the b'th term of 2996, 3886, 4776, 5666, 6556? 890b + 2106 What is the m'th term of -199, -177, 315, 1517, 3669? 40m3 - 5m*2 - 243m + 9 What is the q'th term of -46641, -46879, -47117? -238q - 46403 What is the o'th term of 19582895, 19582894, 19582893, 19582892, 19582891, 19582890? -o + 19582896 What is the w'th term of 37987, 73515, 109043? 35528w + 2459 What is the b'th term of -935846, -1871691, -2807534, -3743375, -4679214, -5615051, -6550886? b*2 - 935848b + 1 What is the a'th term of -6605, -8888, -15081, -27140, -47021? -326a3 + a2 - 4a - 6276 What is the v'th term of 5604, 4376, 3148? -1228v + 6832 What is the u'th term of -1359989, -2720034, -4080079, -5440124, -6800169? -1360045u + 56 What is the j'th term of -18337, -36614, -54891, -73168, -91445? -18277j - 60 What is the k'th term of 5572737, 5572723, 5572707, 5572695, 5572693? k3 - 7k*2 + 5572743 What is the j'th term of -457, -3202, -10629, -25072, -48865, -84342, -133837, -199684? -389j*3 - 7j2 - j - 60 What is the v'th term of -2721, -1076, 1683, 5562, 10567, 16704, 23979, 32398? v3 +	{ "pile_set_name": "DM Mathematics" }
igit of 3650572328? 2 What is the units digit of 202655842? 2 What is the hundred thousands digit of 1021957961? 9 What is the hundreds digit of 602342648? 6 What is the thousands digit of 345828060? 8 What is the units digit of 61006450? 0 What is the ten millions digit of 81762054? 8 What is the units digit of 96742891? 1 What is the tens digit of 4186473? 7 What is the ten millions digit of 780436207? 8 What is the ten millions digit of 196153696? 9 What is the hundred thousands digit of 204712377? 7 What is the ten millions digit of 66866048? 6 What is the hundred thousands digit of 8441712? 4 What is the hundred millions digit of 2198131522? 1 What is the ten thousands digit of 149488640? 8 What is the ten millions digit of 3899799292? 9 What is the ten thousands digit of 578419800? 1 What is the ten millions digit of 347857305? 4 What is the hundred millions digit of 758177876? 7 What is the hundred thousands digit of 48295378? 2 What is the ten thousands digit of 6278308964? 0 What is the units digit of 753814278? 8 What is the hundreds digit of 96316841? 8 What is the billions digit of 1868711416? 1 What is the hundreds digit of 2293945021? 0 What is the tens digit of 68849650? 5 What is the hundred thousands digit of 393570098? 5 What is the thousands digit of 33531682? 1 What is the units digit of 7535308? 8 What is the ten thousands digit of 547742042? 4 What is the ten millions digit of 630701095? 3 What is the millions digit of 142994832? 2 What is the millions digit of 185347163? 5 What is the tens digit of 23870267? 6 What is the ten thousands digit of 6771408? 7 What is the millions digit of 212232863? 2 What is the hundreds digit of 553930205? 2 What is the ten millions digit of 836438828? 3 What is the hundreds digit of 741607072? 0 What is the hundreds digit of 296200653? 6 What is the billions digit of 2164183781? 2 What is the thousands digit of 1170903738? 3 What is the tens digit of 12635588? 8 What is the ten millions digit of 23150290? 2 What is the ten millions digit of 3242958738? 4 What is the hundreds digit of 138445372? 3 What is the hundreds digit of 732029166? 1 What is the ten thousands digit of 67783552? 8 What is the tens digit of 241445278? 7 What is the ten millions digit of 340207408? 4 What is the hundred thousands digit of 651258503? 2 What is the billions digit of 4801420482? 4 What is the ten millions digit of 738004741? 3 What is the hundred millions digit of 419044150? 4 What is the units digit of 57898238? 8 What is the ten thousands digit of 19898579? 9 What is the millions digit of 16825482? 6 What is the hundred millions digit of 592724939? 5 What is the thousands digit of 302366928? 6 What is the hundreds digit of 12960355? 3 What is the thousands digit of 55302116? 2 What is the billions digit of 2135090309? 2 What is the millions digit of 2364519412? 4 What is the tens digit of 191818626? 2 What is the thousands digit of 103967650? 7 What is the millions digit of 72609950? 2 What is the millions digit of 1081143920? 1 What is the units digit of 269299419? 9 What is the tens digit of 2507607363? 6 What is the hundred millions digit of 198150527? 1 What is the hundreds digit of 145244813? 8 What is the hundred thousands digit of 1344299871? 2 What is the ten thousands digit of 202210736? 1 What is the hundreds digit of 177693? 6 What is the thousands digit of 116292? 6 What is the ten millions digit of 11517940? 1 What is the hundred thousands digit of 2127845653? 8 What is the units digit of 945223960? 0 What is the tens digit of 1079555379? 7 What is the hundreds digit of 1329057383? 3 What is the ten millions digit of 28152413? 2 What is the tens digit of 70916098? 9 What is the thousands digit of 84025857? 5 What is the ten thousands digit of 1829358892? 5 What is the thousands digit of 4769843285? 3 What is the hundreds digit of 359328392? 3 What is the ten millions digit of 633308038? 3 What is the hundred thousands digit of 2130804266? 8 What is the millions digit of 600179494? 0 What is the hundreds digit of 5688613632? 6 What is the ten millions digit of 4926610293? 2 What is the hundred millions digit of 120436090? 1 What is the tens digit of 3707809? 0 What is the ten millions digit of 569456138? 6 What is the units digit of 603030273? 3 What is the tens digit of 337161716? 1 What is the units digit of 70394064? 4 What is the millions digit of 104045686? 4 What is the units digit of 286092819? 9 What is the tens digit of 465541408? 0 What is the hundreds digit of 302714847? 8 What is the tens digit of 1415609602? 0 What is the ten thousands digit of 759568434? 6 What is the units digit of 61884135? 5 What is the hundred millions digit of 2098048654? 0 What is the hundreds digit of 136069095? 0 What is the ten millions digit of 42146861? 4 What is the hundreds digit of 886020? 0 What is the units digit of 17031724? 4 What is the millions digit of 145876839? 5 What is the thousands digit of 10667142? 7 What is the ten thousands digit of 1050965? 5 What is the units digit of 1852425343? 3 What is the ten thousands digit of 839992611? 9 What is the ten millions digit of 2432474964? 3 What is the billions digit of 2203765076? 2 What is the thousands digit of 16023412? 3 What is the units digit of 189384595? 5 What is the ten millions digit of 61089523? 6 What is the thousands digit of 99432117? 2 What is the hundreds digit of 33144126? 1 What is the tens digit of 68950174? 7 What is the ten millions digit of 2215872276? 1 What is the millions digit of 14405145? 4 What is the thousands digit of 30372750? 2 What is the hundred millions digit of 1252695868? 2 What is the hundred thousands digit of 38208085? 2 What is the tens digit of 47480469? 6 What is the millions digit of 26065580? 6 What is the hundred thousands digit of 4019285866? 2 What is the tens digit of 304713716? 1 What is the ten thousands digit of 312877574? 7 What is the hundred thousands digit of 945378337? 3 What is the ten thousands digit of 570936036? 3 What is the ten thousands digit of 47664424? 6 What is the thousands digit of 7071321? 1 What is the ten thousands digit of 225927436? 2 What is the tens digit of 216441193? 9 What is the tens digit of 35284259? 5 What is the ten thousands digit of 4844842205? 4 What is the ten thousands digit of 3103098263? 9 What is the thousands digit of 943387397? 7 What is the ten thousands digit of 107325763? 2 What is the units digit of 95921055? 5 What is the ten millions digit of 83094594? 8 What is the hundred millions digit of 416048965? 4 What is the thousands digit of 21546073? 6 What is the hundred thousands digit of 18606362? 6 What is the tens digit of 9223093? 9 What is the hundred thousands digit of 5622196? 6 What is the ten thousands digit of 167433631? 3 What is the units digit of 2641053612? 2 What is the units digit of 6126262373? 3 What is the billions digit of 4567447681? 4 What is the ten thousands digit of 258595334? 9 What is the tens digit of 1831718? 1 What is the thousands digit of 1109792681? 2 What is the tens digit of 397030517? 1 What is the millions digit of 122455476? 2 What is the hundred millions digit of 349912110? 3 What is the hundreds digit of 100834742? 7 What is the hundreds digit of 1294183591? 5 What is the ten millions digit of 176537421? 7 What is the hundred millions digit of 684921394? 6 What is the ten millions digit of 225674524? 2 What is the millions digit of 4257130? 4 What is the billions digit of 1901479018? 1 What is the ten millions digit of 98597828? 9 What is the millions digit of 31366443? 1 What is the ten millions digit of 354643314? 5 What is the hundreds digit of 100328643? 6 What is the millions digit of 137858941? 7 What is the millions digit of 72969782? 2 What is the millions digit of 9508480? 9 What is the hundred thousands digit of 786347295? 3 What is the ten millions digit of 672104684? 7 What is the hundreds digit of 37852051? 0 What is the hundreds digit of 48290174? 1 What is the millions digit of 56992715? 6 What is the ten thousands digit of 22115503? 1 What is the units digit of 472313566? 6 What is the thousands digit of 985584211? 4 What is the tens digit of 3446504696? 9 What is the ten thousands digit	{ "pile_set_name": "DM Mathematics" }
4 + 3w2 - 8w2 + wq wrt w. 72w Let b(c) be the first derivative of -5c*8/56 + 5c*4/12 - 4c - 6. Let s(y) be the first derivative of b(y). Find the third derivative of s(t) wrt t. -600t3 Let r(l) be the third derivative of -l8/20160 - l6/720 + l5/30 + 4l*2. Let p(d) be the third derivative of r(d). Differentiate p(s) wrt s. -2s Let c(n) be the third derivative of n7/280 - n4/4 - 5n3/6 - 2n*2. Let i(o) be the first derivative of c(o). Differentiate i(j) wrt j. 9j*2 Let i(s) = -9s*3 + 5s*2 + 6. Let c(b) = -4b*3 + 3b*2 + 3. Let w(z) = -5c(z) + 3i(z). Find the first derivative of w(h) wrt h. -21h*2 Let t(k) = 2k - 6. Let n be t(5). Suppose -5 - n = -x. Find the third derivative of -9 - w2 + x + w5 wrt w. 60w2 Let i = 1 + 24. Suppose 0 = 5n + 5 - i. What is the second derivative of 2d + 3d*n - 2d + 2d wrt d? 36d*2 Let y be ((-30)/(-4))/((-1)/2). Let w be (-1)/(-3 + y/(-6)). Find the second derivative of -3t*5 - 2t + 7t - 3t + wt wrt t. -60t*3 Let h(o) = 11o*4 + 9o*3 - 9o + 41. Let q(y) = 3y4 + 2y*3 - 2y + 10. Let d(b) = -2h(b) + 9q(b). Differentiate d(m) with respect to m. 20m3 Let n(u) = -u2 + 4u. Let o be n(3). Suppose -op + 1 = -11. What is the second derivative of r5 - r + 0r*4 + 0r*p wrt r? 20r*3 What is the third derivative of -40q*4 + 16q*5 + 8q*2 + 84q*4 - 44q*4 wrt q? 960q*2 Let r be (1 - 4) + -6 + 13. What is the second derivative of 5c - 2cr - 5c - c - 4c wrt c? -24c*2 Let p(b) be the second derivative of -3b4/2 + b2 + 5b. What is the first derivative of p(v) wrt v? -36v Let p(g) = g4 - g2 + g. Let o(r) = r*2 + 3r. Let a be 3 - 1 - (1 + 0). Let f(k) = ap(k) + o(k). What is the second derivative of f(q) wrt q? 12q2 Let d = 8 + -3. Let z be (-1 - d)/((-9)/6). Find the second derivative of -f2 + 2f - 3f*2 + zf*2 - 2f*4 wrt f. -24f*2 Let c = -4 - -8. Suppose -18 = -3x + 3a, -ca + 5 + 3 = 4x. Find the first derivative of -1 - 5m*2 + 5m*2 - xm*3 + 3 wrt m. -12m*2 Suppose -6o + 2o = 0. Let y be 2/(-1 + o - -2). What is the third derivative of yk*4 - 2k4 + k2 + k*5 wrt k? 60k*2 Let n(d) = 4d - 3. Let c be n(2). Find the third derivative of 4h5 + 0h*5 - 3h*2 - 6hc - h2 wrt h. -120h2 Let t(y) be the first derivative of y3/3 + 8y + 7. Find the first derivative of t(x) wrt x. 2x Suppose -3 = -r - r + f, -3r + 2f = -4. Find the third derivative of 19s*3 - 15s*3 + rs*2 - 8s*2 wrt s. 24 Let y(w) be the first derivative of 0w*3 - 7/2w*2 + 0w*4 + 4 - 8/5w*5 + 0w. Find the second derivative of y(h) wrt h. -96h2 Let k(p) = -p2 + 5p. Let u be k(4). What is the first derivative of 4s3 - us3 - s3 + 1 wrt s? -3s2 Let l(t) be the second derivative of -t7/2520 - t5/40 + t4/6 - t. Let d(r) be the third derivative of l(r). Find the first derivative of d(y) wrt y. -2y Let y(n) be the first derivative of 0n2 + 3 - n + 0n*3 + 1/2n*4. What is the first derivative of y(s) wrt s? 6s2 Let g(y) be the second derivative of y6/15 - y*3/3 - 9y. What is the second derivative of g(q) wrt q? 24q2 Let r(l) be the third derivative of 3l9/56 + l5/6 - l*3/6 - 3l*2 - 18l. What is the third derivative of r(t) wrt t? 3240t3 Let j(i) = -i3 - i2 + i. Let u(p) = 12p*3 - 2p*2 + 2p + 27. Let w(n) = -2j(n) + u(n). What is the first derivative of w(c) wrt c? 42c*2 Let w(o) be the second derivative of -9o*5/20 - 5o*4/4 + 12o. What is the third derivative of w(z) wrt z? -54 Let q(h) = 13h2 + 4h. Let t(g) = -14g2 - 3g. Let y(x) = -2q(x) - 3t(x). Find the second derivative of y(l) wrt l. 32 Suppose -f = -2f. Let p be f/(3/(-1 - 2)). What is the first derivative of 0h + 5h + 4 - h + ph wrt h? 4 Let q be 7/2 + (-3)/6. What is the derivative of 13n - 13n - n*q - 1 wrt n? -3n2 Let u(y) be the first derivative of y8/14 - y*4/4 + 3y + 3. Let a(t) be the first derivative of u(t). Find the third derivative of a(m) wrt m. 480m3 Let y be -2 - (-2 - -1)/((-4)/(-20)). Let i(h) be the first derivative of 1 + 0h - 1/4h4 + hy + 0h*2. What is the third derivative of i(r) wrt r? -6 Suppose -5j + 2n + 21 = -9, 0 = -3j + 2n + 22. Find the second derivative of -r - r3 + jr + r - r*3 wrt r. -12r Let c(b) be the first derivative of -2/3b6 + 0b*4 + 0b + 0b5 + 0b*3 + 2 - 2b*2. What is the second derivative of c(l) wrt l? -80l*3 Find the second derivative of -5o + 4o3 - o3 + 2o*3 + 2o*3 wrt o. 42o What is the second derivative of 7l5 + 3l*5 - 5l - 2l5 wrt l? 160l*3 Find the first derivative of -22r*4 + 11r*4 - 12 + 9r*4 wrt r. -8r*3 Let o(g) be the third derivative of -37g*6/120 + 13g5/60 - g3/3 - 37g2. Find the third derivative of o(c) wrt c. -222 Find the third derivative of s - 3s*4 + 2s - 3s2 - 3s wrt s. -72s What is the third derivative of 10j2 - j3 - 107j4 + 96j4 + j3 wrt j? -264j Let z be -2 - (-15)/(-3) - -3. Let c be (-1 - 0)(2 + z). Find the third derivative of -2o4 + 5o*c - 4o2 + o5 + 2o4 wrt o. 60o*2 Let f(y) = 2y*2 - 2y - 2. Let v be f(2). What is the third derivative of 3o + vo + 5o2 - 5o + 3o3 wrt o? 18 Suppose 3s - 5u - 11 = 0, 11 = s - 2u + 4u. Let p = -5 + s. Find the third derivative of 1 + 3f*6 - 2f*2 - 1 + 0f*p wrt f. 360f*3 Let w(y) be the third derivative of -23y9/504 + y5/30 - 30y2. Find the third derivative of w(b) wrt b. -2760b*3 What is the third derivative of -4h*6 - 2h2 + h2 + 8h2 - 5h*2 wrt h? -480h*3 Find the first derivative of -17g*4 + 7g - 12g + 5g - 16 wrt g. -68g3 Let o(x) be the second derivative of -1/12x*4 + 0x*6 + 3x + 0x2 + 1/42x*7 + 0x*3 + 0 + 0x*5. What is the third derivative of o(f) wrt f? 60f*2 Differentiate 6 + 3 + 10n + 1 wrt n. 10 Let a = -6 - -4. Let h = 0 - a. What is the first derivative of -hx3 + 4 + 0x*3 - 6 wrt x? -6x*2 Let u = -7 + 10. Find the second derivative of 3z - 8z3 + 2z*u + 4z*3 wrt z. -12z Let s(j) = -24j2 - 23j. Let p(q) = -47q2 - 47q. Let c(d) = 2p(d) - 5s(d). What is the second derivative of c(k) wrt k? 52 What is the third derivative of 0w2 - 2w*2 + 2w + 7w5 + 6w*2 - 3w*2 wrt w? 420w*2 Let c(g) = -5g4 + g4 - 3g2 - 3g + 5g - 4g*2. Let s(h) = -2h*4 - 4h*2 + h. Let z(k) = -4c(k) + 7s(k). Find the second derivative of z(u) wrt u. 24u*2 Let f(n) = n - 5. Let c be f(9). Let z(r) = -2r - 2. Let b be z(-2). Find the second derivative of 0x - x2 + 3x + cxb wrt x. 6 Let k = -3 - -5. Differentiate kf*3 + 2 - 3f*3 + 0 wrt f. -3f*2 Find the third derivative of 40 + 4v*2 + 7v*3 + 40 - 80 wrt v. 42 Find the first derivative of -2 - 5 + u - 2u wrt u. -1 Let m(v) = 133v3 + 9v*2 + 177v + 9. Let r(p) = 33p3 + 2p*2 + 44p + 2. Let s(y) = -2m(y) + 9r(y). What is the second derivative of s(z) wrt z? 186z Suppose z + 2 = 4. Let u = -7 - -9. What is the third derivative of -h5 + hz + hu + 2h*5 wrt h? 60h*2 Suppose -1 = -3q + 5. Suppose qp = 3r + 19, -17 = -p - 2r + 5r. Find the third derivative of a*p + 2 - 2 - 4a*6 + 3a*2 wrt a. -480a*3 Let m(j) = 3j*2 + 6j + 4. Let r(x) = 3x2 + 7x + 5. Let w(o) = 5m(o) - 4r(o). What is the second derivative of w(d) wrt d? 6 Differentiate -5z3 - 3 + 0 + 10z*3 + 1 wrt z. 15z2 Let s(t) be the second derivative of t5/15 + t*3/6 + 3t*2/2 - 3t. Let d(m) be the first derivative of s(m). Find the first derivative of d(f) wrt f. 8f Let k(b) = b2 - 3b - 4. Suppose -3p - 2p = -30. Let n(f) = -f*2 + 7f + 9. Let y(a) = pn(a) + 14k(a). Differentiate y(s) with respect to s. 16s Let k(p) = 6p*3 - 4. Let f(s) = -1 + 0s*3 + 2s3 - s3. Let t(l) = 3f(l) - k(l). Find the first derivative of t(i) wrt i. -9i*2 Let n(i) = 6i*2 + 3i - 1. Let w(d) = 23d2 + 11d - 5. Let j(z) = 22n(z) - 6w(z). Differentiate j(h) wrt h. -12h Let d(k) be the first derivative of -6k5/5 - k2 + 7. What is the second derivative of d(v) wrt v? -72v2 Let a(l) be the second derivative of 0l*4 + l + 0l*5 + 2l*2 + 1/30l**6 + 0	{ "pile_set_name": "DM Mathematics" }
36606201? 6 What is the thousands digit of 685523? 5 What is the tens digit of 533084? 8 What is the tens digit of 322710? 1 What is the thousands digit of 4395419? 5 What is the thousands digit of 8667? 8 What is the hundred thousands digit of 1178603? 1 What is the hundreds digit of 24065954? 9 What is the tens digit of 121707? 0 What is the ten thousands digit of 215403? 1 What is the ten thousands digit of 2009309? 0 What is the tens digit of 17611245? 4 What is the millions digit of 5177022? 5 What is the thousands digit of 9292? 9 What is the millions digit of 3177026? 3 What is the units digit of 1524499? 9 What is the hundred thousands digit of 1347655? 3 What is the thousands digit of 2641947? 1 What is the hundred thousands digit of 3496661? 4 What is the hundreds digit of 2248533? 5 What is the hundreds digit of 4362825? 8 What is the thousands digit of 6187469? 7 What is the ten thousands digit of 278174? 7 What is the tens digit of 5936323? 2 What is the thousands digit of 849566? 9 What is the units digit of 1586251? 1 What is the thousands digit of 1319024? 9 What is the units digit of 9233288? 8 What is the hundreds digit of 4184612? 6 What is the tens digit of 5800257? 5 What is the thousands digit of 6378757? 8 What is the hundred thousands digit of 246201? 2 What is the tens digit of 457168? 6 What is the millions digit of 4164469? 4 What is the hundred thousands digit of 4670569? 6 What is the units digit of 16484? 4 What is the ten thousands digit of 293361? 9 What is the tens digit of 205453? 5 What is the thousands digit of 2812196? 2 What is the hundreds digit of 110621? 6 What is the tens digit of 2450482? 8 What is the millions digit of 1526062? 1 What is the hundreds digit of 4970837? 8 What is the tens digit of 143865? 6 What is the hundreds digit of 283459? 4 What is the tens digit of 4576061? 6 What is the ten thousands digit of 311939? 1 What is the hundreds digit of 585635? 6 What is the tens digit of 452946? 4 What is the ten thousands digit of 191532? 9 What is the hundreds digit of 729170? 1 What is the hundreds digit of 641927? 9 What is the hundreds digit of 25230732? 7 What is the units digit of 77107? 7 What is the hundreds digit of 468881? 8 What is the units digit of 12251540? 0 What is the units digit of 456970? 0 What is the tens digit of 190162? 6 What is the hundreds digit of 81869? 8 What is the units digit of 3602460? 0 What is the millions digit of 1937307? 1 What is the thousands digit of 39201348? 1 What is the millions digit of 7904058? 7 What is the units digit of 602640? 0 What is the tens digit of 11039180? 8 What is the tens digit of 521436? 3 What is the hundreds digit of 1041494? 4 What is the ten thousands digit of 1356537? 5 What is the hundred thousands digit of 34351536? 3 What is the units digit of 440638? 8 What is the units digit of 279512? 2 What is the thousands digit of 90793? 0 What is the hundred thousands digit of 123339? 1 What is the thousands digit of 2966? 2 What is the tens digit of 52776? 7 What is the units digit of 2011477? 7 What is the hundreds digit of 3545180? 1 What is the tens digit of 2574188? 8 What is the units digit of 179546? 6 What is the units digit of 464014? 4 What is the hundreds digit of 4355579? 5 What is the millions digit of 19402620? 9 What is the ten thousands digit of 103356? 0 What is the hundred thousands digit of 3813330? 8 What is the hundred thousands digit of 113676? 1 What is the thousands digit of 93052? 3 What is the thousands digit of 1247244? 7 What is the thousands digit of 208207? 8 What is the hundred thousands digit of 575644? 5 What is the hundred thousands digit of 2680033? 6 What is the units digit of 9180877? 7 What is the thousands digit of 7141809? 1 What is the hundreds digit of 5066259? 2 What is the hundred thousands digit of 185333? 1 What is the hundreds digit of 8987433? 4 What is the hundred thousands digit of 1233657? 2 What is the ten thousands digit of 7397364? 9 What is the ten thousands digit of 5360309? 6 What is the millions digit of 1104436? 1 What is the hundred thousands digit of 353466? 3 What is the tens digit of 763336? 3 What is the hundred thousands digit of 14709612? 7 What is the hundred thousands digit of 3541569? 5 What is the tens digit of 170336? 3 What is the ten thousands digit of 8703989? 0 What is the tens digit of 17278? 7 What is the hundreds digit of 806344? 3 What is the thousands digit of 3763648? 3 What is the thousands digit of 726266? 6 What is the millions digit of 2859149? 2 What is the hundreds digit of 1144272? 2 What is the ten thousands digit of 3068701? 6 What is the tens digit of 513243? 4 What is the hundreds digit of 1449320? 3 What is the thousands digit of 65868? 5 What is the hundred thousands digit of 3146626? 1 What is the millions digit of 1436741? 1 What is the ten thousands digit of 1235172? 3 What is the tens digit of 166165? 6 What is the units digit of 10514833? 3 What is the hundred thousands digit of 102587? 1 What is the thousands digit of 489455? 9 What is the hundreds digit of 7255117? 1 What is the hundred thousands digit of 33169845? 1 What is the ten thousands digit of 1061390? 6 What is the ten thousands digit of 21270620? 7 What is the units digit of 520669? 9 What is the ten thousands digit of 1074229? 7 What is the units digit of 803832? 2 What is the thousands digit of 324093? 4 What is the hundred thousands digit of 386182? 3 What is the hundreds digit of 25268945? 9 What is the hundred thousands digit of 2867247? 8 What is the ten thousands digit of 9255351? 5 What is the thousands digit of 1088461? 8 What is the hundred thousands digit of 6311329? 3 What is the tens digit of 36214? 1 What is the units digit of 1554819? 9 What is the thousands digit of 9573913? 3 What is the hundred thousands digit of 483143? 4 What is the ten thousands digit of 15550362? 5 What is the hundred thousands digit of 7082613? 0 What is the hundreds digit of 491287? 2 What is the ten thousands digit of 3736539? 3 What is the tens digit of 321380? 8 What is the hundred thousands digit of 427497? 4 What is the hundred thousands digit of 455374? 4 What is the tens digit of 541727? 2 What is the hundred thousands digit of 4341166? 3 What is the thousands digit of 9953433? 3 What is the hundreds digit of 518841? 8 What is the units digit of 265369? 9 What is the tens digit of 17929732? 3 What is the ten thousands digit of 13659804? 5 What is the hundreds digit of 1286300? 3 What is the hundred thousands digit of 945834? 9 What is the ten thousands digit of 50722? 5 What is the hundreds digit of 29935? 9 What is the hundreds digit of 7008513? 5 What is the units digit of 7197182? 2 What is the hundred thousands digit of 12434362? 4 What is the thousands digit of 87916? 7 What is the hundreds digit of 6186451? 4 What is the hundred thousands digit of 200038? 2 What is the hundred thousands digit of 772049? 7 What is the hundreds digit of 4973728? 7 What is the thousands digit of 23696? 3 What is the tens digit of 4659245? 4 What is the thousands digit of 94190? 4 What is the units digit of 335172? 2 What is the hundreds digit of 1187994? 9 What is the tens digit of 444797? 9 What is the hundred thousands digit of 123876? 1 What is the units digit of 90014? 4 What is the tens digit of 5934375? 7 What is the ten thousands digit of 290252? 9 What is the hundreds digit of 306888? 8 What is the tens digit of 310268? 6 What is the tens digit of 292133? 3 What is the hundreds digit of 147103? 1 What is the hundred thousands digit of 6777599? 7 What is the hundred thousands digit of 405124? 4 What is the thousands digit of 154529? 4 What is the ten thousands digit of 762070? 6 What is the units digit of 5612798? 8 What is the units digit of 1205414? 4 What is the hundred thousands digit of 9958170? 9 What is the hundred thousands digit of 527016? 5 What is the tens digit of 311360? 6 What is the tens digit of 15538289? 8 What is the millions digit of 1585953? 1 What is the millions digit of 1715710? 1 What is the hundred thousands digit of 520368? 5 What is the tens digit of 1374011? 1 What is the ten thousands digit of 558160? 5 What is the units digit of 28870? 0 What is the hund	{ "pile_set_name": "DM Mathematics" }
k = -2.2 + -16.8. Let z = k + 15. Which is the second biggest value? (a) -1/3 (b) z (c) 3/4 a Let j = -20.5 - -21. What is the biggest value in j, -3, -2/19? j Let k(v) = -3v + 2. Let u(l) = 2l - 3. Let f(b) = -3k(b) - 4u(b). Let d be f(-9). Let a be (0 + 0 + -2)-2. What is the biggest value in a, -2/5, d? a Let m(y) = -2 + 0 + 4y - 1. Let l be m(4). Suppose -5o - 12 = l. What is the biggest value in -2, -0.4, o? -0.4 Suppose -3 = -3r - 0r. Let v be 0 - (r + (-6)/4). Which is the smallest value? (a) v (b) -1/4 (c) -2 c Let t = 0.3 - 1. Let s = -11/2 + 7. Which is the second biggest value? (a) 4 (b) s (c) t b Suppose -i + 2 = i. Let v(f) = f2 - 2. Let z be v(-2). Let k = -0.6 - -0.1. Which is the third smallest value? (a) k (b) z (c) i b Let y = 0.04 + 0.06. Which is the third biggest value? (a) y (b) -0.5 (c) -1 c Let d = -3.3 + 3. Let o be (-6)/(-8)2/(-3). Which is the biggest value? (a) 1/2 (b) o (c) d a Let w = 1.5 + -1.2. Which is the second biggest value? (a) -2 (b) w (c) -4 a Let q = -0.2 - -0.3. Let y be (4/2 - 2)/1. Let b = 61/30 - 8/15. What is the second biggest value in q, y, b? q Let k = -0.042 - -0.042. Let p = 5 - 8. Let t = p + 2.6. What is the third smallest value in t, k, 1? 1 Let c(z) = -z*3 - 12z*2 + 4. Let m be c(-12). Let q = 948/8347 + 2/491. What is the second biggest value in m, 3/2, q? 3/2 Let z = -563/35 - -79/5. Let i = -1.96 - 0.04. Let y be -8 - -8 - 22/(-16). Which is the third smallest value? (a) i (b) z (c) y c Let y = 5/2 - 19/8. Let p = 1 - -5. Let g = 4 - p. Which is the third biggest value? (a) -5 (b) y (c) g a Suppose 3g + 2g = 0. Suppose 0 = -gp + p + 5. Let m = 4 + -5. What is the third smallest value in -0.4, p, m? -0.4 Let o = 20 + -15. Let l = -1.7 - -1.2. Which is the third biggest value? (a) o (b) l (c) 2/5 b Let s be (-15)/(-60) - 2/(-8). Which is the second smallest value? (a) 17 (b) s (c) -4 b Let i = 1 - 122. Let n = i + 607/5. What is the second smallest value in n, -1/3, 5? n Let j = -0.21 + 5.21. Which is the second smallest value? (a) -2/7 (b) j (c) -2 a Let r = 14 - 11. What is the biggest value in 0.2, r, -0.1? r Let i = -13.7 - -13.6. What is the biggest value in i, -5/3, 3, -3/7? 3 Suppose -20 = 5d - d, 5m = 2d + 5. Let u be ((-22)/(-385))/(1/5). Which is the biggest value? (a) -0.4 (b) m (c) u c Let n be (-2)/2 - (-46)/42. Which is the biggest value? (a) n (b) -0.9 (c) -0.2 a Let q be -33/(-45)(2 - 4). What is the smallest value in q, -5, 3, -2/9? -5 Let s be 1/4 + 27/12. Which is the third biggest value? (a) s (b) 0.2 (c) 3/4 b Let k = -4.4 - -0.4. What is the fourth biggest value in 0.4, -0.5, k, 0.5? k Suppose -33 = 5d - k, -4d - 11 = -4k + 25. Let y be d/(6(-14)/(-8)). What is the biggest value in 2/7, 0, y? 2/7 Suppose 14d - 9d = 15. What is the smallest value in -8, -4, d? -8 Let p be -33/((-9)/4). Let h(t) = t3 + 3t*2 - t + 3. Let z be h(-3). Let d be (z/8)/((-6)/(-20)). Which is the smallest value? (a) d (b) p (c) -3 c Let d = 0.37 + -0.07. What is the third biggest value in d, -1/8, -1? -1 Suppose 0 = -2g + g + 3. Let r = 84 + -82. What is the second biggest value in g, r, 0.4? r Let l be 30/4(-16)/24. Let x = -16 - -13. Which is the third biggest value? (a) l (b) x (c) 2/9 a Let a be 11/(-35)-5. What is the smallest value in a, 0.1, -0.4? -0.4 Let z = 5 + -28. What is the second biggest value in z, -3, -4/5? -3 Let j = 1.4 + -1.5. Which is the smallest value? (a) j (b) -0.4 (c) 1/7 b Let k = 0 - 0.2. Let h be 3 + (-2 - 0 - 4). What is the biggest value in -2, k, h? k Let u be 26/(-6) + 2/6. Suppose 2l - o = -2l - 9, -5o = -25. Let b be l + 3 - (-15)/(-8). What is the smallest value in b, 4, u? u Suppose -4f - 1 = -5f. Let u be (3936/210)/(18/5). Let d = 52/9 - u. Which is the smallest value? (a) d (b) 5 (c) f a Let o = 0.7 + 11.3. Let j = o - 8. Let u = j - 1. What is the third biggest value in 0.4, 3/8, u? 3/8 Let m = -2 + 4. Let t(k) = -k*3 + 5k*2 + 8k - 2. Let i be t(6). Let x be (2/i)/(4/(-5)). Which is the third smallest value? (a) -3/5 (b) x (c) m c Suppose 2 + 0 = -2a. Let r be -3 + 5 + 3/a. What is the third biggest value in r, 0, 0.1? r Let x = 57366 - 109713/2. Let y = -2570 + x. Let s = y - -1577/26. Which is the smallest value? (a) -4/5 (b) s (c) -5 c Let l = 4 - 5. Let j = l + 6. Let p be (-10)/(-6)(-6)/(-15). Which is the third biggest value? (a) p (b) j (c) 3/7 c Let q = -0.7 - -3.7. Let h = -2 + q. Let i = -0.8 - -0.5. What is the third biggest value in h, i, -1/3? -1/3 Let n = 0.7 + -1. Which is the third smallest value? (a) -0.7 (b) -2/5 (c) n c Let z = -68 + 63. Which is the biggest value? (a) -2/11 (b) z (c) -2 a Let o(m) = -m - 3. Let q be o(-6). Let r = 9.3 - 13. Let h = 4 + r. What is the smallest value in h, q, -3/4? -3/4 Let d = 29 + -57/2. Suppose -2o = -o + 3. Let u = -4 - o. What is the second smallest value in d, 5, u? d Let n = 49 + -22. Let b = n - 188/7. Let f = -0.4 - -0.3. What is the third smallest value in b, f, -0.5? b Let c = 3 + -2. Let y = 5 - 5.5. Let r = y - -3.5. What is the second smallest value in r, c, 0.3? c Let w = 5 + -4.6. Let z = -1.2 - -1. What is the second biggest value in w, -2/19, z? -2/19 Let m = -14 + 10. Which is the second biggest value? (a) -6 (b) m (c) -3 b Let o = 1271/9 - 141. Let h = 32 + -30. Which is the third smallest value? (a) h (b) o (c) 0.5 a Suppose 5o + r + 6 - 2 = 0, -2o + 5r - 7 = 0. Let l be (1 - o)/(2/5). Which is the smallest value? (a) 2/3 (b) 0.5 (c) l b Let k = 8.89 - -0.11. Let n = k - 8. What is the smallest value in -0.1, 0.5, n? -0.1 Let z = 270.98 + -268. Let s = z + -3. Let f = 4.98 - s. Which is the second biggest value? (a) f (b) -0.2 (c) -2/9 b Let k = 9 + -9. Let l = -0.4 - k. Let o = 2 - 4. What is the third biggest value in l, o, 5? o Let h = 2 + -1.98. Let k = h + -2.02. Let i = 12 - 17. Which is the biggest value? (a) i (b) -5/2 (c) k c Let l = -0.08 + -0.52. What is the second biggest value in l, 2/7, 3? 2/7 Let g = 5.5 + -6.5. Which is the second biggest value? (a) -0.4 (b) 0.05 (c) g a Let o = -0.035 + 4.035. Let q = 1.7 + 0.3. Which is the third biggest value? (a) q (b) o (c) 0.1 c Let k = -286/201 - -6/67. Let t be 2/(-42) + 6/18. What is the biggest value in 0.4, k, t? 0.4 Suppose 0 = f + 4f - m + 23, 2f + 2m + 14 = 0. Which is the smallest value? (a) -4 (b) f (c) -4/3 (d) -1 b Let w be 5 - (3 - 1 - 0). Suppose wr = 4 + 8. What is the biggest value in 0, 5, r? 5 Suppose 2s - 2 = 3s. What is the third biggest value in -4, s, 5? -4 Let h = -0.07 + 0.07. What is the third biggest value in 9, h, 0.5? h Let x = -7/13 + 61/65. What is the third smallest value in -2/7, x, 0.5? 0.5 Let z(q) = q*2 + 2q + 1. Let g be z(-1). Let d = -9 + 8.9. Let p = d - -3.1. Which is the second smallest value? (a) g (b) p (c) -3 a Let h be (1 + -1)/((-6)/3). Let i be (10/(-6) - -1) + h. Let w be (-30)/(-24)2/5. What is the second smallest value in -1, w, i? i Let n = 301 - 14449/48. Let t = n - -103/336. What is the smallest value in t, 3, 3/4? t Let v = 717/56 - 36299/3080. Let h = v - 9/11. Let p be (-1)/22/4. Which is the second biggest value? (a) -3 (b) h (c) p c Let f = -8 + 6. Let t = f + 1.7. What is the second biggest value in -1/3, 3, t? t Let x = 2.99 - -0.01. Let o = 11 - 9. Which is the second smallest value? (a) -3 (b) x (c) o c Let x = -5/6 + 19/30. What is the biggest value in x, 1/2, 0.4? 1/2 Let z = 3 - 2. Let o = z + -0.7. Let w = 6 + -3. What is the second smallest value in o, w, -0.4? o Let f = -0.9 + 0.8. Which is the biggest value? (a) 0.2 (b) f (c) -2/21 a Let a = -2 - 4. Let i = 11 + a. What is the third smallest value in -1/3, i, 3/4? i Let y = -0.26 + 0.3. Let v = 1.941 + 0.019. Let m = y + v. What is the biggest value in -4, 5, m? 5 Let d = -9.3 - -9. Which is the third biggest value? (a) 0.4 (b) 2/7 (c) d c Let i = 0 - 0. Let d = -1.2 - -10.7. Let v = 10 - d. Which is the second smallest value? (a) v (b) i (c) -2/11 b Let t = 9.2 + 2.8. Let v = 12.9 - t. Let x = v + 0.1. What is the third biggest value in 3, -2, x? -2 Let h = -67/112 + 5/16. Let s = -6.4 + 4.1. Let x = 2 + s. Which is the bigge	{ "pile_set_name": "DM Mathematics" }
0, a, 2 Suppose -5i = -2 + 17. Let c(h) = -h2 - 3h + 4. Let o be c(-4). Sort 3, o, i in decreasing order. 3, o, i Suppose -x + 1 - 4 = 0. Let c = 2/19 - 56/171. Sort 2, x, c in decreasing order. 2, c, x Suppose -75 - 10 = 17v. Sort 0, -3, v in decreasing order. 0, -3, v Let j = -1 - -2. Let r be j/2 + (-18)/(-4). Suppose 3u + u = -20, 2q + ru + 17 = 0. Put q, -5, 2 in ascending order. -5, 2, q Suppose 9c - 3 = 10c. Sort -0.2, 5, c in ascending order. c, -0.2, 5 Let y = 84 + -84. Let p be 10/(-45) - (-86)/306. Put y, p, -2 in decreasing order. p, y, -2 Let r be 4/((-32)/(-21)) - 3. Let j = -1.1 + 1.1. Put 1, j, r in decreasing order. 1, j, r Let s = 19.9 + -20. Put s, 17, -1/3 in descending order. 17, s, -1/3 Let p = -4 + 7. Let t be ((-2)/(-1 + p))/(-3). Let f = 0 - 4. Sort 1/4, t, f. f, 1/4, t Let c = 8 - -12. Suppose -2a + 7a = -c. Put 3/5, a, 3/4 in ascending order. a, 3/5, 3/4 Let b be (-26)/(-52)18/(-5). Let z = -4 - -7. Put 1/3, b, z in ascending order. b, 1/3, z Suppose -5i = -x - 14, 0 = 4x + x + 2i - 11. Let p be (-1 + -1)(x - 2). Put p, 1, -3 in decreasing order. p, 1, -3 Suppose 3c = -c + 8. Let u be 0/(2 - 1 - 3). Put u, 4, c in descending order. 4, c, u Let h(y) = 3y + 10. Let w be h(-4). Sort w, -5, -0.1 in increasing order. -5, w, -0.1 Let h = 2/11 - -38/33. Suppose -p - 20 = -0x + 4x, -2p - 3x - 15 = 0. Put 1/2, p, h in descending order. h, 1/2, p Let q = -22 + 25. Let a = -3 + 0. Let w(f) = -3f + 24. Let k be w(8). Sort a, q, k in ascending order. a, k, q Let q = -4 - -4.05. Let w = q - -4.95. Put 2/9, w, -0.3 in increasing order. -0.3, 2/9, w Let g be (-2)/((-6)/3)2. Let j(m) = m2 - 5m - 3. Let l be j(6). Let k = l - -1. Sort g, k, -5 in ascending order. -5, g, k Suppose 0t = 4t - 20. Suppose -t - 10 = -5c. Sort 2, 0, c in descending order. c, 2, 0 Let h = 12.56 + -1.16. Let z = -11 + h. Put 2, -5, z in ascending order. -5, z, 2 Let k = 12 + -10. Let h(v) = -v + 1. Let f be h(2). Put k, f, -5 in decreasing order. k, f, -5 Let l = -0.5 + 0.4. Let f = l + 0.2. Let a = -4.9 - f. Sort -3, 0.5, a in decreasing order. 0.5, -3, a Let c(a) = a + 4. Let s be c(-3). Suppose 4 + 2 = -2u. Let p be -9(u + (-30)/(-9)). Sort s, p, -5 in decreasing order. s, p, -5 Let d(w) = -w3 - w. Let q be d(-1). Let m be (-4 + 3)(-4)/28. Put 4, q, m in descending order. 4, q, m Let k(t) = 5t + 56. Let f be k(-11). Put -24, -2, f in decreasing order. f, -2, -24 Suppose 2c = 6c + 2f + 2, -4f = -2c - 26. Let d be (32/(-4))/2(-2)/8. Sort c, -5, d. -5, c, d Suppose -2d + 5 = -7. Suppose -4 = 2k, 2k = 4h + 3k - 2. Sort h, 0, d in ascending order. 0, h, d Suppose u + 2o = 5 + 7, 0 = 4u + 5o - 33. Suppose -i - u = -2k, 2k - i - 1 = -k. Put -2, k, 4 in decreasing order. 4, k, -2 Let i = 1 + -1. Let a be 2 - (1 + (-10)/(-6)). Sort i, 7, a in descending order. 7, i, a Suppose -n + 6 - 2 = -2t, -3t + 5n = -1. Let c be (4/(-5))/(t/(-15)). Put -5, 5, c in descending order. 5, c, -5 Let f be ((-80)/88 - -1)/(0 + 1). Sort f, 2/7, -1/6, -0.2 in decreasing order. 2/7, f, -1/6, -0.2 Suppose -3a + 121 = 10. Let k = 184/5 - a. Let j be 9/128/36. Sort k, j, 4 in decreasing order. 4, j, k Let v be ((-10)/4 - -2)2. Let l = -12 + 12. Suppose l = q + 2d - 5, 16 = 2q - 4d + 6. Sort v, 4, q in decreasing order. q, 4, v Let z = 1 - 4. Let c = 0.2 + 0. Sort 2/7, c, z in increasing order. z, c, 2/7 Let z(m) be the first derivative of m*4/4 + 2m3/3 - m2/2 + m + 3. Let g be z(-2). Sort 5, -3, g in descending order. 5, g, -3 Let j be ((-16)/40)/(13/5). Sort 0.1, 2, j. j, 0.1, 2 Suppose -3r + 2i - 4i - 10 = 0, r = -i - 5. Put r, 4, -2 in decreasing order. 4, r, -2 Let n(b) = -5b - 8. Let i be n(-2). Put 0, -2, i in increasing order. -2, 0, i Let c = -32 - -33.95. Let n = c - 1.9. Put 2/11, n, -5 in increasing order. -5, n, 2/11 Let p = 3 + 1. Suppose -pi + 2i + 10 = -h, -2i = -8. Let f be (h/(-4))/(10/40). Put f, 0, 5 in increasing order. 0, f, 5 Let g = 0.2 + -0.2. Suppose 3 = 2z + r, -5 + 2 = -z - 2r. Let c = 0.5 + -2.5. Put c, z, g in decreasing order. z, g, c Suppose -5x = -r - 4 - 4, -2x = -2r - 8. Suppose 0y - n - 6 = -2y, 4n - 36 = -4y. Let g = y + -9. Sort g, r, -1 in ascending order. g, r, -1 Let s = 0.289 - 0.289. Let r = -7 + 2. Let g = -2 + 0. Put s, g, r in ascending order. r, g, s Let n = 112 - -37. Suppose -5x - r = -n, x + 2r + 0r - 28 = 0. Suppose 11 = v - 2c, x = 5v - 2v - 5c. Put 3, v, 1 in descending order. v, 3, 1 Suppose 3a = -10a. Put a, 1, 2, -1 in ascending order. -1, a, 1, 2 Suppose b - 3 = -8. Sort b, 0, -2 in ascending order. b, -2, 0 Suppose 0 = -16w - 0w. Put w, 20, 2 in descending order. 20, 2, w Suppose 0j = 2j - 10. Let n = -2 + 4. Suppose nr = -3 + j. Put -4, r, 0 in descending order. r, 0, -4 Let v = -451 - -455.03. Let w = v + -0.03. Let g = -3.03 + 1.03. Put -0.2, g, w in descending order. w, -0.2, g Suppose 0 = -4c + t + 13, -2t = 2c + 3t - 23. Suppose -y - cy - z = 11, -3y + 2z = 4. Let u = -0.3 - -0.3. Sort u, -5, y in descending order. u, y, -5 Let k = -13 - -18. Suppose 5n = 12n + 28. Put k, -2, n in decreasing order. k, -2, n Let m be (0/(-8))/((-2)/(-1)). Put -2, -4, m in descending order. m, -2, -4 Let n = 43 + -44. Sort -4/7, n, 0. n, -4/7, 0 Let d be (24/9)/4-3. Let z = d - -7. Let i(x) = x*2 + 3x - 3. Let g be i(-4). Put z, g, 3 in increasing order. g, 3, z Let r(a) = -2a3 - 3a*2 + 3a - 1. Let x be r(2). Let m = x + 26. Suppose 10 = 4q + 2y, 5 = -2q - 2y - y. Put m, q, -3 in descending order. q, m, -3 Let c = -4.061 + 0.061. Sort -1, c, -16, 5 in descending order. 5, -1, c, -16 Let r(y) = 2y + 29. Let t be r(-12). Sort t, 4, -5. -5, 4, t Let n = -19 + 23. Sort 0, n, -3. -3, 0, n Let l(r) be the third derivative of -r6/120 + r5/12 + 5r4/24 + r3/6 + 2r2. Let s be l(6). Let z = s + 7. Put -2, -0.4, z in ascending order. -2, -0.4, z Let m = 0.17 + -8.17. Let k = -7.8 - m. Let w(x) = -2x - 3. Let s be w(-3). Sort s, k, 2 in decreasing order. s, 2, k Let x(v) = v - 3. Let q be x(7). Let j be 20/15(-1)/q. Sort -1, j, 3 in increasing order. -1, j, 3 Let q be (15/(-9))/(1/(-3)). Put 4, q, -2 in ascending order. -2, 4, q Let q(z) = 3z*2 - 2z + 4. Let n(l) = -5l2 + 5l - 8. Let a(s) = 4n(s) + 7q(s). Let j be a(-7). Suppose 0 = -0m + 3m - 12. Sort j, -3, m. -3, j, m Let x = -35 - -31. Sort -2, 5, x. x, -2, 5 Let p be (2/10)/((-10)/25). Suppose 1 = 3c + 2v, -4c + v - 3 - 3 = 0. Put p, c, 1 in decreasing order. 1, p, c Suppose -z = -k - 4, 0k + 2k - 6 = -5z. Let b be (-8 + 4)k/4. Put b, -2, -4 in decreasing order. b, -2, -4 Let o be 7 - (-2 + 8 - 3). Suppose -2z = -z + 4. Sort 5, z, o in ascending order. z, o, 5 Let f be (-4 - -3 - -5) + 0. Put 4/7, f, -0.2 in increasing order. -0.2, 4/7, f Suppose 3y = -4i - y - 20, i = y + 3. Let r = i - -3. Suppose r = j - 2. Put 1, -1, j in decreasing order. j, 1, -1 Suppose -5n - 35 = 4f, n + 6 = -n. Put -4, f, 0 in decreasing order. 0, -4, f Let j = 0.2 - 0.16. Let c = j + 0.26. Let h be (-5)/(-9) - 4/18. Sort h, 2, c in increasing order. c, h, 2 Let z(u) = -u - 11. Suppose 0 = 3t - 4t - 7. Let b = t + -2. Let w be z(b). Sort w, -1, -3 in ascending order. -3, w, -1 Let b = -0.42 - 0.08. Sort 0.1, -2/11, b in decreasing order. 0.1, -2/11, b Let m(x) = x*3 + 3x*2 + x + 5. Let h be m(-4). Put 0.1, -5, h in decreasing order. 0.1, -5, h Suppose 0 = -5n - 4 - 21. Let r(w) = -w*3 - 11w*2 - 9w + 10. Let t be r(-10). Put t, 4, n in descending order. 4, t, n Let i be (-6)/1(-1)/2. Suppose 7g = 40 - 5. Sort i, g, 4 in increasing order. i, 4, g Let m = 5.6 - 3.6. Sort 3, m, 22. m, 3, 22 Let x(i) = -3i2 + i2 - 3i + 3i2 - 3 + 9i. Let t be x(-7). Sort -4, t, 5 in decreasing order. 5, t, -4 Let q = -100 + 98. Sort 1, 4, -2/3, q in ascending order. q, -2/3, 1, 4 Let n be -110 - 0. Suppose 14 = -f - 2w, w - 6 = 3f + 1. Let r = -2 - f. Put -4, r, n in descending order. r, n, -4 Let d = -20 - -16. Sort d, -2/13, -5 in ascending order. -5, d, -2/13 Suppose 4h - 4 = 12. Suppose 0 = -3k + 1 + 8. Let y = k - h. Sort y, 3, -5 in increasing order. -5, y, 3 Let g(x) = 5x2 - x. Let c be g(1). Suppose -2s - 8 = -0. Let h = -39 - -36. Sort h, s, c in decr	{ "pile_set_name": "DM Mathematics" }
d derivative of 4g5h - 174510g4h*2 + 2gh2 - 25gh + 84g - 5h2 wrt g. 80g*3h - 2094120g2h*2 Find the third derivative of 2s*5 - 6s*4 + 4779s*3 + 49s*2 + 3s + 663. 120s2 - 144s + 28674 What is the second derivative of -70366osx2 + 134o + 4sx - 75s wrt x? -140732os What is the second derivative of -400072v*5 - 2v*3 + 2v*2 - 1710978v? -8001440v3 - 12v + 4 What is the third derivative of -579027k3 - 593k*2 + k - 9? -3474162 Find the second derivative of -3m*2n*3 + 30m*2n*2 + 200m*2n - m*2 + 3881mn3 + 2mn - 3m + n*3 wrt m. -6n*3 + 60n*2 + 400n - 2 What is the second derivative of 142l3 + 8l*2 - 51781l wrt l? 852l + 16 What is the first derivative of -2209x4 + x3 - 26x2 + 928893? -8836x*3 + 3x*2 - 52x Find the third derivative of -70m3q*3 + 2m*2q*3 + 3m*2q - 15mq*3 + 1 wrt m. -420q*3 What is the third derivative of 11v*3y*2z + 91446v3yz - 2v*2z - 4025263vy*2z wrt v? 66y2z + 548676yz Find the third derivative of 11hlo3 - ho*3 - 2h + 606lo*3 + 3lo2 + 20652l - o*2 wrt o. 66hl - 6h + 3636l Find the second derivative of 24c*2n*3 - 160c*2n + 3c2 + 53cn3 + 2cn2 + 2c - 132n3 wrt c. 48n*3 - 320n + 6 Find the second derivative of -4724m3q*2t + m*3qt2 + 5m*3q - m*3t*2 - 3m*2q*2t*2 - 402m*2q wrt q. -9448m3t - 6m2t*2 What is the third derivative of -7m*3w*2 - 395m*3w - 33m3 - 123228m*2w*2 - 3w*2 wrt m? -42w*2 - 2370w - 198 What is the third derivative of 100h2i*3 + 5h*2 - 11hi3 + i3 - 1198i*2 wrt i? 600h*2 - 66h + 6 What is the first derivative of -4607m4 + 12m + 49825? -18428m3 + 12 What is the first derivative of 2jl + 58840j - 1612l wrt l? 2j - 1612 Find the first derivative of 108825r2 - 124231. 217650r Differentiate 151w2 - 9611w + 2668661. 302w - 9611 Differentiate -50i*3w + 14334i3 + 3iw + 39w with respect to w. -50i3 + 3i + 39 What is the third derivative of -471lv*4 + 82lv3 + 2lv2 - 4627450l - 9v4 wrt v? -11304lv + 492l - 216v Differentiate 32310q + 23199. 32310 Find the third derivative of 9d5 - 29507d*4 - 453654d*2 wrt d. 540d*2 - 708168d Find the first derivative of -17g4 - g3 + 442g*2 - 6g + 603046. -68g3 - 3g*2 + 884g - 6 What is the first derivative of 1791864h - 2674395 wrt h? 1791864 Find the first derivative of 107tu + 19t - 5u - 922 wrt u. 107t - 5 What is the third derivative of -557jp*2s*3 + 4jp2s*2 + 143p*2s*2 + 1057s*3 + 1107s*2 wrt s? -3342jp2 + 6342 What is the third derivative of 222752l*3 - 222790l*2? 1336512 Find the second derivative of -10ac2g*2 - 257ac - 730c*2g*2 + 4c*2g - 2c2 + 4g + 3 wrt g. -20ac*2 - 1460c*2 What is the first derivative of 41182o4 - o3 - o*2 - 2o - 2641446? 164728o3 - 3o*2 - 2o - 2 What is the second derivative of -w*5 - 36269w4 - w2 + 678w + 190? -20w*3 - 435228w*2 - 2 Find the third derivative of -2p*4 - 750536p*3 - 3p*2 + 458761. -48p - 4503216 Differentiate 17879l2 + 54585 wrt l. 35758l What is the derivative of 12gr + 6041103g - 44509r wrt r? 12g - 44509 Find the third derivative of -35898h*4 - 191h*2 + 4h - 13 wrt h. -861552h Differentiate 2gn2 - 31gn + 653g - 146881n2 with respect to g. 2n*2 - 31n + 653 Differentiate at4 - 18at2 - 298160a + 705t4 with respect to t. 4at3 - 36at + 2820t*3 What is the third derivative of 748487d*3m + 8073d2 + 3dm + 1 wrt d? 4490922m What is the second derivative of -2b2w*3 + 539094b*2 + 3b + 12730w3 wrt b? -4w*3 + 1078188 Find the third derivative of 37339f*6 - 9f*2 - 9f wrt f. 4480680f3 Find the second derivative of -1473t*3 - 134t*2 - 1170147t. -8838t - 268 What is the second derivative of 1310842n*2 + 1901020n? 2621684 Find the third derivative of -57d4u*2 + 252d*4 - 2d*2u*2 - 19002d*2u wrt d. -1368du*2 + 6048d What is the third derivative of d*4q + 26d4 + 2d*3q - 35d3 - 37d*2q + d*2 - 12dq - 5q - 1 wrt d? 24dq + 624d + 12q - 210 What is the second derivative of -112059o2q*2 + 4oq + 3o + 374q2 - 59 wrt o? -224118q*2 Find the second derivative of 41272i*2 + 21829i. 82544 Find the second derivative of -281f4u*3 + 344f*3u*3 + 165f - u*3 + 9u*2 + 2 wrt f. -3372f*2u*3 + 2064fu3 What is the third derivative of 168069j*3 - 2j*2 - 124j - 131? 1008414 Find the second derivative of -3677p5 + 25p4 - p2 - 622219p. -73540p*3 + 300p*2 - 2 What is the third derivative of -43815h*3q - 20h2q + h*2 - 3hq + 2 wrt h? -262890q What is the first derivative of -l*2t + 233375l2 + 329641t wrt t? -l*2 + 329641 Find the second derivative of -68025jy4 + 79754jy + y wrt y. -816300jy2 Differentiate -bv + 171793b + 514v - 543 with respect to b. -v + 171793 Find the third derivative of -3063g3h*3 - 6g*3h*2 + 8gh3 - 6h*3 - 56981h*2 wrt h. -18378g*3 + 48g - 36 Differentiate -376068l - 1431731 wrt l. -376068 Find the second derivative of -40177k*3 + 7135k + 3. -241062k Find the third derivative of o3y - 19444o3 - 403863o*2y wrt o. 6y - 116664 What is the first derivative of 656884s*2 + 1873892? 1313768s What is the second derivative of 3825833p3 + 3502p + 32 wrt p? 22954998p Differentiate -11n*3r + 101746n3 + 5n*2r + 502nr - r wrt r. -11n3 + 5n*2 + 502n - 1 Find the third derivative of -599555u4 + 132257u*2 + 3u. -14389320u What is the first derivative of -94706h*2 - 75464? -189412h Find the third derivative of 401715p6 - 3p*4 + 965004p*2. 48205800p*3 - 72p What is the first derivative of 749h4 - 28h*3 - 2h*2 - 368476 wrt h? 2996h*3 - 84h*2 - 4h What is the third derivative of -87d5 + 61d4 + d3 + 28807d2? -5220d*2 + 1464d + 6 What is the second derivative of -260f3x*3 - 15f*3x + 4f2x*2 + 63379fx3 wrt f? -1560fx3 - 90fx + 8x*2 Differentiate -953391s + 158090 wrt s. -953391 What is the third derivative of -49136t6 - 569t*2 - 218t wrt t? -5896320t3 What is the first derivative of 105318m*2r - 85143m2 wrt r? 105318m2 Differentiate -d2t2 + 290d*2 + 12187t*3 + 38 wrt t. -2d*2t + 36561t2 Find the third derivative of h3o*3x - 9780h3ox + 9h*2o*3x + h*2ox + 15ho3x - 21hox + 2o*3 wrt h. 6o*3x - 58680ox Find the second derivative of -326k4 + 80k*3 - 2k - 153962 wrt k. -3912k2 + 480k What is the second derivative of -os5 - 1762530os2 + 2os - 4230o - 5s - 3 wrt s? -20os3 - 3525060o What is the second derivative of -2y5 + 252y*4 + 4y*3 - 926y + 8 wrt y? -40y3 + 3024y*2 + 24y What is the second derivative of 14279g4y - 5g2y + 71339gy wrt g? 171348g2y - 10y Find the second derivative of 117486m*2 - 2354181m wrt m. 234972 What is the derivative of -o*4 - 296o*2 + 1007o + 393890? -4o3 - 592o + 1007 What is the third derivative of -3004819j5 + 191j*2 + 170j - 5? -180289140j2 Find the first derivative of -49062h - 94972. -49062 Find the second derivative of -106711r3 - 1278r - 9 wrt r. -640266r Differentiate 628083k - 720036 with respect to k. 628083 What is the second derivative of 2d3np + d3p*3 - 185dn - 257np3 - 14np wrt p? 6d*3p - 1542np What is the third derivative of -14637h3i - 2h3q + 2h2iq + 2hi - 4855hq wrt h? -87822i - 12q Find the second derivative of l3 + 12229l*2 + 33l - 122. 6l + 24458 What is the second derivative of -157318a2 + a + 14046? -314636 What is the third derivative of m3u3 + 2m*3u + 57mou3 + 6mou + 6mu*3 + 2639mu2 + 3ou3 wrt u? 6m*3 + 342mo + 36m + 18o What is the second derivative of -523q*5 - 1124q*4 - 1777189q wrt q? -10460q3 - 13488q*2 Differentiate -2x*2y + 8407x2 + 2xy - 79962y wrt x. -4xy + 16814x + 2y Differentiate 842jn*3 - 65090j + 4n3 - 5n**2 with respect to n. 2526	{ "pile_set_name": "DM Mathematics" }
? 0 Suppose -48x - 44 = -52x. Suppose 3j + 2j - 220 = 0. Suppose -x = -w + j. What is the remainder when w is divided by 19? 17 Suppose w - 4i - 60 = 0, -i + 129 = -5w + 353. What is the remainder when w is divided by 16? 12 Calculate the remainder when 265 is divided by (-26)/(-156) + (-166)/(-12). 13 Suppose -3l + 33 = -108. What is the remainder when l is divided by (105/(-4 + -3))/((-5)/6)? 11 Let j(i) = i2 + 7i + 16. What is the remainder when j(-9) is divided by (-2)/13 + 3486/182? 15 Let t = -199 + 109. Let n = -51 - t. What is the remainder when 193 is divided by n? 37 Suppose -4o + 72 + 56 = 0. Suppose 0 = -i - 6 + o. What is the remainder when 76 is divided by i? 24 Suppose 11w - 332 = 7w. Calculate the remainder when w is divided by 24. 11 Let m = 247 - 175. What is the remainder when m is divided by 8? 0 What is the remainder when -1 + 245 - (12 + -5) is divided by 8? 5 Calculate the remainder when 182 is divided by 47230/280 + 8/(-14). 32 Let g(a) = a*3 - 27a*2 + a - 30. Let n be g(27). Calculate the remainder when 271(1 + 0) is divided by (2/(-6))/(n/90). 7 Let s = 42 + -29. Let t be (-4)/(-14) + 24/14. Suppose w - a = 33, 0 = -tw - a + 2a + 71. Calculate the remainder when w is divided by s. 12 What is the remainder when 6/11 - 9950/(-110) is divided by (-2)/6 + (-94)/(-3)? 29 Suppose -8j + 9j = 5. Suppose 5t - 65 = -5f, -59 = -jt - 6f + 4f. Let l(s) = -s*3 - 5s*2 - 4. Calculate the remainder when l(-6) is divided by t. 10 Suppose -5z - a + 29 = 0, 4z - 2a = 3 + 23. What is the remainder when 94 is divided by z? 4 Calculate the remainder when (4/2)/((-52)/(-3718)) is divided by 4. 3 Suppose 32 = 2d + 2. Suppose -2p - d = -29. What is the remainder when p is divided by 5? 2 Let x(f) = -13f + 10f - 12f - 5. Calculate the remainder when x(-4) is divided by 28. 27 Let h = 13 + -7. Let c(f) = 9 - 3 - 3f*2 + 5f*2 - 9f + 9f2 - f3. What is the remainder when c(10) is divided by h? 4 Let d = 32 + 9. Let t = -18 + -49. Let m = t - -89. What is the remainder when d is divided by m? 19 Let v(g) = 2g*2 + 22g - 10. Calculate the remainder when 81 is divided by v(-12). 11 What is the remainder when (-15035)/(-85) + -2 - 20/(-170) is divided by 11? 10 Let a(k) = -4k - 101. What is the remainder when 178 is divided by a(-29)? 13 Suppose -q - 36k = -32k - 8, 0 = q - 5k - 44. What is the remainder when 49 is divided by q? 1 Let w be (-192)/(-80)5/2. Suppose -3j - w = -4j - 2u, -j = -4u + 6. Suppose -jm + 40 + 36 = 0. What is the remainder when m is divided by 10? 8 Suppose -4m + 107 = r, 3r = -4m + r + 106. What is the remainder when m is divided by 8? 3 Suppose 23q - 941 - 2210 = 0. What is the remainder when q is divided by 58? 21 Suppose 13q + 75 - 1050 = 0. Suppose 55 = -2k + q. Calculate the remainder when k is divided by 5. 0 Suppose -n = -35n + 612. Suppose 0 = 5l - 0 - 5, 2f - 67 = -l. Calculate the remainder when f is divided by n. 15 Let l(c) = -3c - 9. Let i be l(-6). Let r = 12 - i. Suppose -r = -n + 5. Calculate the remainder when 23 is divided by n. 7 Let h(r) = -r*2 - 10r + 15. Let k be h(-11). Suppose -11i + 91 = -ki. Let w = 23 - -1. Calculate the remainder when w is divided by i. 11 Suppose -6 = 2l - 54. Let u(v) = -9v*3 - 2v2 - v + 5. Calculate the remainder when u(-2) is divided by l. 23 Let q = 11 - 15. Let a(g) = -g2 - 5g - 2. Let s be a(q). Suppose sd = 7d - 125. Calculate the remainder when 97 is divided by d. 22 Suppose -2q + 115 = 3q + 5o, 0 = q - o - 25. Suppose -5c = 5n - 225, -5 = 2n + 1. Suppose c = f + 2. Calculate the remainder when f is divided by q. 22 Let o = 12 - 10. Let y be -3 + 1 + (-32)/(-16). Suppose m + 4h = y, 2m - 2 = -4h + 2. Calculate the remainder when m is divided by o. 0 Let u = 4 + -53. Let a be 28/u - (-32)/7. Suppose a = o, 2n - n - 23 = 4o. What is the remainder when n is divided by 14? 11 Let n = 246 - 212. Calculate the remainder when 56 is divided by n. 22 Suppose 80m = 9m + 1065. Suppose -27 = -3f + 102. What is the remainder when f is divided by m? 13 Let l = -79 - -147. Calculate the remainder when l is divided by 7. 5 Let a(b) = -b3 - 5b*2 + 4b + 6. Let q be a(-6). Suppose 80 = qh - 13h. Calculate the remainder when 23 is divided by h. 7 Let i(y) = -2y3 - 4y*2 + 3y + 3. Let j be i(-3). Suppose -jk + 29 = -11k. What is the remainder when k is divided by 64/6 - (-2)/6? 7 Let m be 6((-34)/(-4) + 0). Let b be -2 - 8/(-12)m. Suppose 4t - 40 = b. Calculate the remainder when 52 is divided by t. 16 Suppose -5p + 2z = -140, -z = -2p - 0 + 56. What is the remainder when 107 is divided by p? 23 Suppose -80 = -7f + 368. Calculate the remainder when f is divided by 22. 20 Suppose -22 = -5r + t + 13, 0 = 2t. Calculate the remainder when r is divided by 5. 2 Let j = 219 + -105. Calculate the remainder when j is divided by 58. 56 Suppose -8 = 3p - 14. Suppose -2h = ph - 40. Let j = h + -1. Calculate the remainder when 17 is divided by j. 8 Suppose 3x - 37 = 3k - 187, 3k - 160 = x. Calculate the remainder when 121 is divided by k. 11 Let q(w) = 15w + 353. What is the remainder when q(-13) is divided by 15? 8 Let q be 18/5 + (-4)/(80/12). Let t(o) = 14o - 12. Calculate the remainder when 89 is divided by t(q). 29 Suppose -3n - n + 92 = 0. Suppose 5x = -t + 68, 5x - x - 40 = 4t. What is the remainder when n is divided by x? 10 Suppose 0m = 2m - 8. Suppose mr = -0r + 120. Let c(l) = l3 - 13l*2 - 7l - 9. Calculate the remainder when c(14) is divided by r. 29 Let n = -12 - -12. Suppose 2r - 22 = -n. What is the remainder when 74 is divided by r? 8 Let y(p) = p3 - 3p*2 + 6. Calculate the remainder when 107 is divided by y(2). 1 Let j be 1(0 - (4 + -4)) + 3. Suppose -4a + 2b = -160, -186 = -5a + 4b + 14. What is the remainder when a is divided by (j + 11/(-2))28/(-5)? 12 Suppose 0 = -4b + z + 315, -4b + 3z - 7z = -340. What is the remainder when b is divided by 28? 24 Let m(l) = -l3 + 8l*2 - 4l - 2. Suppose 2v = 5v - 48. Suppose -5x + 14 = -v. What is the remainder when m(x) is divided by 16? 14 Let o(b) = -3b + 7. Let w(s) = -7s + 15. Let p(x) = 13o(x) - 6w(x). What is the remainder when 29 is divided by p(3)? 9 Suppose 0 = -45h + 37h + 9768. What is the remainder when h is divided by 51? 48 Calculate the remainder when 294 is divided by ((-450)/(-135))/((-1)/(-18)). 54 Suppose -2y - 21 = -23. Calculate the remainder when 23 is divided by ((-2)/42)/y - -6. 3 Let q = -11 + 11. Suppose q = 2a - 42 + 4. Let m = a - 10. Calculate the remainder when m is divided by 5. 4 Let o = -741 - -858. What is the remainder when 245 is divided by o? 11 Let t be (-1)/((-2)/10(7 - 6)). Suppose -v + tv - 304 = -r, -379 = -5v - r. What is the remainder when v is divided by 19? 18 Let w(y) = 8y + 5y2 - 12y*2 + 0y*2 + 6y*2. Calculate the remainder when 77 is divided by w(4). 13 Let j = -27 - -37. Suppose jc - 4c - 288 = 0. What is the remainder when c is divided by 25? 23 Suppose -2g + 10 = 3o, 6 = -0o + 2o + g. Suppose -2d - 4t = -36, -t = -3d - ot + 74. What is the remainder when d is divided by 9? 8 Let h = -13 - -233. What is the remainder when h is divided by 13? 12 Let b = 1116 - 1054. What is the remainder when b is divided by 35? 27 Let h = 310 + -171. Suppose -5x - 112 = -232. What is the remainder when h is divided by x? 19 Suppose v = -3, w - 1346 = -0w + v. What is the remainder when w is divided by 96? 95 Suppose -y - 4a - 10 = 0, a = 2y - a - 30. Let n(q) = -q3 + 10q*2 - 3q + 41. What is the remainder when 29 is divided by n(y)? 7 Calculate the remainder when 1318 is divided by (1 - (-5 + 4))/(14/77). 9 Let j(u) = 78u3 - u2 + 14u - 15. What is the remainder when 137 is divided by j(1)? 61 Calculate the remainder when 118 is divided by (48/9)/(4/24). 22 Suppose 2y - 64 = q, -4y - 24 = 3q + 118. Let g = q - -68. Calculate the remainder when 55 is divided by g. 13 Suppose -30g + 59g - 203 = 0. What is the remainder when 67 is divided by g? 4 What is the remainder when 116 is divided by 13/(7 + 30/(-5))? 12 Suppose -69l + 144 = -57l. Suppose -2x + 25 - 5 = 0. Suppose -u = u - x. Calculate the remai	{ "pile_set_name": "DM Mathematics" }
et t be (-6)/27 + (-316)/c. Let h = t - -11. Solve 4a - 3p - 26 = 0, ha - 2p = -0a + 14 for a. 5 Let o be -2(-8)/(-72) - 20/(-9). Solve oy + y = -2d + 2, 0 = -2d - y + 2 for d. 1 Let m be (1 + 6 + -5)2. Solve 0 = 4c + 4 + 8, 0 = -j - mc - 15 for j. -3 Let h = -33 - -46. Solve q + 3 = -3m - h, 0 = -3m + q - 14 for m. -5 Suppose -5w + 3j + 55 = 0, -3w + 26 = -w - 2j. Solve x = p - 4, -p + 0x = 3x + w for p. 1 Let v = -113 - -136. Solve 6c - 3c = 4j + v, 0 = c - j - 6 for c. 1 Let w = -19 - -9. Let k(o) = 10 + 9o + 0 - 3o3 - o3 + 3o*3 - 9o*2. Let g be k(w). Solve -4y + 16 = 2n, 5y = -0y + 5n + g for y. 4 Let w be (-32)/(-80) - 72/(-20). Solve -wi - g = 4g - 10, 0 = -i - 2g + 1 for i. 5 Let y = 308 - 303. Solve g + 3g + 5u = 4, 4 = -yg - 4u for g. -4 Let g = 5 + -17. Let i(v) = -2v*3 - 2v*2 - 3v - 4. Let x be i(-2). Let d be g/30 + 4/x. Solve d = l + 2f - 1, 3f + 1 = l - 0 for l. 1 Suppose r = 4m + 8, -m + 2 - 5 = 0. Let j = -2 - r. Let w be (5/4)/((-1)/(-7 + 3)). Solve -wl - 4 = 2v, 3v - 3 = jv for l. -2 Suppose -82x + 124 + 122 = 0. Solve -xb + 6 = 0, -2 + 11 = -i + 3b for i. -3 Let d = -393 - -395. Solve 3t + 2t + dv = 9, 2t - 4v + 6 = 0 for t. 1 Suppose 16i - 360 = -20i. Solve -n + 4 = 0, -16 = -5y - 4n + i for y. 2 Let y(v) = -v2 + 6v - 6. Let j be 5 + -2 + (-36)/(-12). Let f be y(j). Let d be f(-2 - (-16)/12). Solve -3w + 5 + 4 = 3t, -dw = -t + 3 for w. 0 Suppose -40 = -10m + 5m. Suppose 9 = d + m. Let f be 2/d(-21)/(-14). Solve fx + 4t = -10 - 9, -x - 4t - 17 = 0 for x. -1 Suppose -4 = -m - 0. Suppose -3h - 15 = 0, h - 5 = -2n - mh. Suppose 6g - g = 0. Solve 3s - j = -gj + 17, 0 = s - 5j - n for s. 5 Let s be (-5 + 364/77)-11. Solve 3t = -3c + s, -t - 11 = 4c - 0t for c. -4 Let n(a) = -a - 27. Let x be n(3). Let w be 4/((-4)/x(-8 + 13)). Solve 0y + 3o = 3y - w, 4y - 11 = o for y. 3 Suppose u + 9 = 4l, 2l = 5u - 6 - 3. Solve -4n + 5c + 17 = 0, 2n = -3c + l - 0 for n. 3 Suppose 2k = 98 - 94. Solve -5n = 25, -2n = ka + a + 13 for a. -1 Let c be 17 + -10 - (2 + -1). Solve 0 = -2o - 2d + c, d + 0d + 1 = o for o. 2 Let a = 64 + -25. Suppose 0 = -x + 2, -5z + x - a = 13. Let g be (48/(-15))/(4/z). Solve -n + 4n + g = h, -2n - 10 = 4h for n. -3 Let y = 479 - 479. Solve 3u - 5o - 22 = y, 0 = 3u - 3o - 15 - 3 for u. 4 Let d be (3/(-9))/(-4 - 115/(-30)). Solve -2b = -df, 3b - 3f = 4b - 16 for b. 4 Let o be 9 - (-1 + -3 + 4). Let s(b) = b*2 - 10b + 11. Let j be s(o). Suppose -h + n = h - 4, jn - 8 = 0. Solve 0t - hu = -2t + 2, -u = 3t + 11 for t. -3 Let l be (21/12)/((-1)/28). Let g be (-278)/(-7) - 14/l. Suppose -12 = -0f - 3f. Solve h + 4h + fy = -g, -h = -y - 1 for h. -4 Let l be -2 - 15/(-9) - 4/(-12). Suppose 3p + 5a = 1, la - 8 = -5p - 2a. Solve -14 = 5b - pg, -7 = 2b + 2b - 3g for b. -4 Let l(k) = 4k*2 - 2k - 7. Let q be l(2). Solve y - 3y = -qo - 4, o = -5y + 10 for o. 0 Let o be ((-5)/3)/(40/(-144)). Solve ow + 4n - 5 = w, 3w - 2n = 3 for w. 1 Suppose -37m + 39m = 78. Let f = 1 + 0. Suppose 3d - m = -4y + f, 0 = -4d - 4y + 48. Solve 4x + 4v - d = 0, x - 6 = -2x + 5v for x. 2 Suppose 0 = -2f + 24. Let w = f + -12. Let u be -3 + -3 + 10 - w. Solve 5q - 4 = -2s, us + 4q + 7 = 3 for s. -3 Let p = -1152 + 1156. Solve -5o - 10 = -b, 0 = -po - 2 - 6 for b. 0 Suppose -w + 4 = 0, 3h - 9 = -2w + 53. Let n be (44/33)/(4/h). Suppose -16 = -np + 2. Solve 17 = pd + 4u, -4d + 3u - 29 = -2u for d. -1 Suppose 4f - 19 = -5x, -f + 6 + 10 = 5x. Solve -xq - 4k = -k - 3, 4k = -3q for q. 4 Let a be -7 + (4 - 0) + 20. Suppose -6u = -7 - a. Suppose ug + m - 47 = 0, 2m - 17 = -g - 0m. Solve 0 = w + 3q - g, -w - 10 = -3q - 3 for w. 2 Let s be (-1 + 2)-4 + 9. Suppose -2b - 2b - 12 = sg, -2b = -4g - 20. Solve -4j + 3 - 11 = bh, 0 = -3h + j + 16 for h. 4 Let k be (-1)/2 - 13/2. Let s = k + 9. Suppose f = -1 + 23. Solve 7 = -d + z, -5d + sz = -d + f for d. -4 Suppose 5z - z - 3b = -7, -4b = 4z - 28. Solve -3 = -w + z, -2g + w = 5 for g. 0 Let d be -7 + 2 + -18 + 42. Solve -3r = 2v - v + d, 5r - 3v + 13 = 0 for r. -5 Let c(z) = -6z + 45. Let j be c(7). Solve -2r = -2p - 18, jp - 5r + 5 = 6p for p. -5 Let y = 91 - 91. Suppose y = 2i - 4, -5i = 4v - 0v - 10. Solve 3w - 4f - 3 + 10 = 0, 3w + 4f - 25 = v for w. 3 Suppose 2a = 4a + 68. Let m be 4/((-8)/a) + -1 + 4. Solve -2o - 14 = 2o - 2g, -4g = -4o - m for o. -2 Let m be (-320)/(-152) + (-8)/(-228)-3. Solve 0q + 26 = 5q - 2a, 14 = 2q - ma for q. 4 Suppose 3 = -g - 2t, 4g - 5t + 3 = -10t. Let i be (-69)/(-12) + g/12. Solve 5j + 5s + 19 = 2j, i = -2j - 2s for j. 2 Suppose -5k - 5w - 96 = -3k, 5k = -4w - 206. Let b = k + 69. Suppose -4m = -33 - b. Solve i - m = -4h, -i + 0 = -h + 4 for i. 0 Suppose 2s - 1 - 1 = m, 0 = -5s + 3m + 5. Solve 0 = -t - 0t + 4z - 7, 0 = t - z + s for t. 1 Suppose -2x + 5 = -x. Solve -2d - 4 = -d - s, 2d = -xs - 15 for d. -5 Let b be (2/(-6))/(1/(-9)). Suppose -u = -1 - b. Let n(t) = -4t + 23. Let z be n(-3). Solve z = s - 4s + uc, 5c = 5s + 50 for s. -5 Let t = 16 + -1. Suppose 5k = 6k - t. Suppose 2g - 3r = 2r - k, -r = -3. Solve -i - z + 1 - 8 = g, 5z = -15 for i. -4 Let p(k) = -k*2 + 19k + 46. Let q be p(21). Solve 0 = qi - 4f - 24, 5 - 2 = -3f for i. 5 Let z = 16 - 13. Suppose -2m = -4m + zw - 7, 5m + w = 25. Suppose -1 = -mh + 31. Solve r = -o - h, -r - 3 + 0 = 0 for o. -5 Let w be 2/(-4)(-48)/(-72)-9. Let r(h) = -h*3 - 5h*2 - h + 4. Let q be r(-5). Suppose -q = -4o + 7. Solve 0c + 4 = oj - c, wc = 0 for j. 1 Let p be 48/121/1. Suppose -r + 2r - 11 = -2f, 27 = 3r + pf. Let i(l) = -l - 15. Let j be i(-20). Solve -4u + 0z - 20 = 4z, 5u - jz = r for u. -2 Let u(f) = 3f - 5. Let h be u(-3). Let c = h - -14. Suppose -5a + 120 = 4y, -4a - y = -6y - 96. Solve cq = -2q + 5p - a, 0 = -q + 4p - 18 for q. -2 Let g be 5/2(54/30 + -1). Suppose -gw - 2w + 11 = u, -2u = 2w - 10. Solve 5z + 0c + 5c - 15 = 0, 0 = -wz + 3c + 1 for z. 2 Let u(s) = -s*2 - 2s + 5. Let h be u(-4). Let i be 0/((h + 1)/2). Let m = 10 + i. Solve -3v + 3w + 15 = 0, -5v = -v + w - m for v. 3 Let z be (-1 - (3 - 0)) + -4. Let b be ((-86)/(-4) + 12/z)1. Solve -2w - b = -5l - w, 4l = -2w + 30 for l. 5 Suppose 3l = -4l + 112. Let s be 0 + 3 - (-3 + 1). Solve -sr = -h - 25, -4r + 4 + l = h for r. 5 Suppose q - 5l - 1 = -q, 4q - 26 = 2l. Let r(b) = -2b + 21. Let v be r(q). Solve 16 = c - 4s, s - 5s = vc - 8 for c. 4 Suppose 0 = 22m - 12m - 30. Solve z + b + 9 = 0, 3z + 2z = -mb - 37 for z. -5 Let m = 125 - 118. Suppose -2x + 5t = m, 4x - 36 + 11 = -3t. Solve 2a - 6 = -3f, 2f + 2a + 0 - x = 0 for f. 2 Let k be 10/240(-8)/(-200). Solve -4p - y = -16, -2p + 3y + k = y for p. 4 Suppose 5 = -c - 4p - 3, -3p - 25 = -4c. Solve cj + 25 = -5f, j - 15 = -2j + 3f for j. 0 Let k be 28/(-56)(6 - 0). Let v be k/(9/(-4)) + (-38)/(-57). Solve 3g - 9 = m - 1, 1 = g - vm for g. 3 Let t be 35 + -16 + 5/((-5)/(-3)). Solve -15 = 5m, 5s - m + t = -0 for s. -5 Suppose h + 2h = 3o - 15, 5h - 15 = -3o. Suppose -3i - o = -3n + 13, 13 = 3n + 2i. Solve -ns - 5j + 10 = 0, -s - 2s - 2j + 5 = 0 for s. 1 Let d = 20 + 3. Let r = d - 23. Suppose 3m - 3j = -rj + 9, -4j = m - 18. Solve 0 = 4s - w + m, 2s + 11 = -2w + 3 for s. -2 Let a(s) = -3s + 51. Let u be a(17). Solve 4i + o - 16 = u, -4o = -7o for i. 4 Suppose -5d = -0d + 5m - 65, d + 5m - 29 = 0. Suppose -27 - d = -9u. Solve 0 = uh - 5h + b + 1, b = -3h + 19 for h. 5 Let v(d) = d*3 - 3d*2 - d + 3. Let q(r) = r - 1. Let p be q(4). Let l be v(p). Let z = 5 - l. Solve -2g + 31 = zs, -g = s - 0g - 8 for s. 5 Let t be 5 + 32/(-2) - 0/(-2). Suppose 4n - d - 68 = 2d, -d - 4 = 0. Let z = t + n. Solve -2x - 4 = -5l, 2x - 7 = 4l - zx for l. 2 Let c(w) = w + 22. Let q be c(11). Suppose 9 = -4b + q. Solve -2n - 2y + b = -y, -3n - 5y + 9 = 0 for n. 3 Let f(s) = s - 2. Let y(c) = c + 3. Let j be y(2). Let l be f(j). Solve 5m - l = -4o, 1 = -4m + 3m for o. 2 Suppose 3l + 12 + 12 = 3d, -3d - 4l = -3. Suppose 10 =	{ "pile_set_name": "DM Mathematics" }
e the first derivative of x5/25 + x4/10 - 7x3/15 + 2x*2/5 + 134. Factor z(g). g(g - 1)*2(g + 4)/5 Let x(n) = n3 - n2 + 3n + 1. Let r = 169 + -170. Let u(h) = -2h*2 + 5h*2 - 2h*2. Let k(s) = rx(s) - 4u(s). Suppose k(m) = 0. Calculate m. -1 Let x(o) = -3o - 70. Let q be x(-24). Suppose -d - qd + 20 = 5c, -16 = 4d - 4c. Factor -2/7s5 + 0s - 2/7s4 + d + 2/7s*3 + 2/7s*2. -2s*2(s - 1)(s + 1)2/7 What is k in 6k*2 - 3k*2 + 174 - 1413k + 1590k = 0? -58, -1 Let u(a) be the second derivative of -a7/336 + 17a*6/60 - 611a*5/80 + 187a*4/8 - 363a*3/16 + 2a - 421. Find x, given that u(x) = 0. 0, 1, 33 Let k = 911/3676 - -2/919. Let l(i) be the second derivative of -5i - ki*3 + 0 + 1/4i*2 + 1/8i*4 - 1/40i*5. Determine z so that l(z) = 0. 1 Let y(c) be the second derivative of -3c5/20 + c4 - 2c3 - 32c + 1. Find o, given that y(o) = 0. 0, 2 Let b(w) be the second derivative of -1/10w5 + 4w - 4/3w3 + 0w*2 + 0 + 2/3w*4. What is l in b(l) = 0? 0, 2 Let x(c) be the third derivative of -5c6/24 - c5/3 + 25c4/24 + 10c*3/3 - 105c*2. Factor x(g). -5(g - 1)(g + 1)(5g + 4) Suppose -17 = 2s + 4h - 57, 4s + 4h - 68 = 0. Suppose 8q - s = 10. What is m in -10/11mq + 4/11m*2 - 4/11 + 10/11m = 0? -1, 2/5, 1 Let l = -27 - -30. Solve 22 - 22 - 8pl - 4p + 5p2 + 7p3 = 0 for p. 0, 1, 4 Let a(u) be the second derivative of -u5/120 + 5u4/8 + 4u*3/3 - 23u*2/3 - 396u. Suppose a(z) = 0. Calculate z. -2, 1, 46 Let i(b) be the third derivative of -b9/80640 - b8/3360 - b7/420 + b5/15 - 6b2. Let h(f) be the third derivative of i(f). Factor h(m). -3m(m + 4)2/4 Suppose -32m + 6163 = -1965. Let o = -501/2 + m. Solve -ot - 1 + 5/8t*4 - 9/4t*2 + 7/8t*3 = 0 for t. -2, -1, -2/5, 2 Let g(s) be the first derivative of 3s*5 - 5s*4/2 - 5s*3 + 5s*2 - 133. Find n, given that g(n) = 0. -1, 0, 2/3, 1 Let k(b) = -11b*2 - 52b - 71. Let u(d) = -4d2 - 18d - 22. Let w(i) = -2k(i) + 7u(i). Suppose w(f) = 0. Calculate f. -3, -2/3 Determine p so that 68/3p + 0 + 4/3p*2 = 0. -17, 0 Let r = 22327 - 111632/5. Factor ri*3 + 3/5i*2 + 0 - 6/5i. 3i(i - 1)(i + 2)/5 Let k(x) be the third derivative of x8/336 - 3x7/70 + x6/4 - 23x5/30 + 11x*4/8 - 3x*3/2 - 7x*2 - 11x. Factor k(z). (z - 3)*2(z - 1)*3 Let r(t) be the second derivative of 5t*7/14 - 10t*6/3 + 51t*5/4 - 155t*4/6 + 30t*3 - 20t*2 - 4t + 2. Let r(d) = 0. What is d? 2/3, 1, 2 Let g(t) be the third derivative of t6/840 - t5/70 + t*4/21 - 2t*2 + 71t. Factor g(v). v(v - 4)(v - 2)/7 Let q(v) = v*2 + 28v + 55. Let z be q(-26). Let a(c) be the first derivative of -1/14c2 + 1/21c*z + 0c + 3. Factor a(u). u(u - 1)/7 Suppose 24 = 420u - 408u. Factor 4/5s - 3/5 - 1/5su. -(s - 3)(s - 1)/5 Factor -3w2 + 0 + 1/4w*3 - 13/4w. w(w - 13)(w + 1)/4 Let o(q) be the first derivative of q7/168 - q6/72 - q*5/3 + 5q*4/2 - 19q*3/3 + 20. Let w(g) be the third derivative of o(g). Factor w(i). 5(i - 2)*2(i + 3) Let r be ((-5)/6)/5(-357 - -354). Suppose t4 + 0t*2 + 0t + rt5 + 1/2t*3 + 0 = 0. Calculate t. -1, 0 Factor -45m - 3m3 - 9m*2 - 43m + 152m + 0m*3 - 52m. -3m(m - 1)(m + 4) Let l(n) be the first derivative of -n5/40 + 5n4/24 - n3/2 - 5n + 11. Let q(i) be the first derivative of l(i). Factor q(v). -v(v - 3)(v - 2)/2 Let f = -7 + 9. Let k be (-3)/f8/(-21). Factor -2/7u5 + ku*4 + 6/7u*3 - 8/7u + 0 - 8/7u2. -2u(u - 2)2(u + 1)*2/7 Suppose -7496h = -7502h. What is n in 0 + hn*3 + 2/7n*4 + 4/7n - 6/7n2 = 0? -2, 0, 1 Let v be (1216/80 - 16)/(-1 + -1). Let u(i) be the first derivative of 0i*2 - 1/10i*4 + vi*3 + 3 - 8/5i. What is p in u(p) = 0? -1, 2 Let y = 437/339 + 507617/8136. Let h = -536/9 + y. Let -15/8b3 - 3/4b + 0 + hb2 = 0. Calculate b. 0, 1/5, 2 Let k = -1 - -3. Determine t so that -13t + 4t2 + 16 + 5t - 3tk = 0. 4 Let i(o) = 10o*4 + 330o*3 + 90o*2 - 1255o - 65. Let n(x) = x*4 + 30x*3 + 8x*2 - 114x - 6. Let g(u) = 6i(u) - 65n(u). Factor g(r). -5r(r - 6)(r - 2)(r + 2) Let h(o) be the third derivative of 10o2 + 1/105o*6 + 0o*3 + 0o + 0o4 - 2/105o*5 + 0 - 1/735o*7. Suppose h(s) = 0. What is s? 0, 2 Let y be 200/(-8)4/(-20). Let z(a) be the third derivative of 0 + 1/120a6 + 2/45a*y + 0a - a*2 - 1/24a*4 + 0a*3. Find w such that z(w) = 0. -3, 0, 1/3 Let -22/3i*2 + 20/3 + 2i*3 - 2i + 2/3i4 = 0. What is i? -5, -1, 1, 2 Let m = 52 - 49. Suppose -8 - 1 = -mi. Determine o, given that -6/7o2 - 4/7o + 2/7o4 + 0o*i + 0 = 0. -1, 0, 2 Let y(b) be the first derivative of 4b*3 - 26 - 3/4b*4 - 18b - 3/2b2. Factor y(t). -3(t - 3)(t - 2)(t + 1) What is d in 180/7 - 564/7d3 + 9d*4 + 1437/7d*2 - 996/7d = 0? 2/7, 2/3, 3, 5 Suppose -4i = 3v - 8, -i = -52v + 50v - 2. Factor 0 - 1/9ui + 0u. -u*2/9 Suppose -4h = -229 + 93. Factor 0o3 - 15o - 5o3 - h + 2o*3 - 12o*2 + 28. -3(o + 1)*2(o + 2) Factor 46n + 160/3 - 2/3n*3 - 8n*2. -2(n - 5)(n + 1)(n + 16)/3 Let n be 4/(-12) - (-3)/9. Let c = -5 + 10. Factor np4 + pc - 2p5 + p2 + 3p4 - 3p3. -p2(p - 1)3 Let h(v) be the first derivative of v4/72 - v2/12 - 3v - 12. Let g(p) be the first derivative of h(p). Factor g(n). (n - 1)(n + 1)/6 Let b(h) = -h2 - 2h + 2. Let k be b(1). Let y be (3 - 3) + 4 + k. Factor yl2 - 6l - 1/2l3 + 4. -(l - 2)3/2 Let l(y) = y3 + 5y*2 + 3. Let b be l(-5). Suppose -bj = 2x, -5x = -x - j. Solve 2/9g - 2/9g2 + x = 0 for g. 0, 1 Let l(g) be the second derivative of g4/16 + 45g3/8 - 323g. Factor l(d). 3d(d + 45)/4 Let w(b) be the second derivative of b*5/20 + 9b*4/8 + 4b*3 - 8b*2 - 13b. Let g(o) be the first derivative of w(o). Factor g(r). 3(r + 1)(r + 8) Let b(x) be the third derivative of -x5/270 - x4/12 - 20x3/27 + 316x*2. Factor b(d). -2(d + 4)(d + 5)/9 Let q = 964 - 961. Let b(p) be the second derivative of 0 - 1/48p*4 - 1/6p*q + 10p - 1/2p2. Suppose b(j) = 0. What is j? -2 Let n(v) be the first derivative of 15/2v*4 - 6/5v*5 + 4v*3 - 6v - 5/2v6 + 10 - 15/2v2. Determine u, given that n(u) = 0. -1, -2/5, 1 Let j(c) be the second derivative of -c6/30 - 61c5/20 - 119c*4/12 - 59c*3/6 + 8c + 12. Let j(x) = 0. Calculate x. -59, -1, 0 Let w(b) be the first derivative of -b*3/12 + 3b2/4 - 70. Solve w(j) = 0 for j. 0, 6 Let o(t) be the second derivative of -t6/480 - t5/48 - t4/32 + 7t3/6 + 20t. Let b(l) be the second derivative of o(l). Factor b(f). -(f + 3)(3f + 1)/4 Let h be 418/225 - (-414)/(-5175). Suppose -16/9 - hd4 + 4/9d + 4/9d5 + 32/9d*2 - 8/9d*3 = 0. What is d? -1, 1, 4 Let i(m) be the first derivative of 1/270m*6 + 0m - 1/45m5 + 2 - 2/3m*3 + 0m*2 + 0m*4. Let h(n) be the third derivative of i(n). Factor h(z). 4z(z - 2)/3 Let g(u) = 2u*2 + 11u - 25. Let o be g(3). Let p(i) = -5i + 135. Let v be p(o). Factor -1/5t*3 + 0t*4 + 0t + 0 + 0t2 + 1/5tv. t3(t - 1)(t + 1)/5 Suppose 0t + 44 = 11t. Let q be (t - (-50)/(-20)) + 2/4. Solve -6/5 - 2/5d3 - 14/5d - qd2 = 0. -3, -1 Let x(m) be the first derivative of -5m*6/24 + 17m*5 - 335m*4/16 - 211. Factor x(c). -5c*3(c - 67)(c - 1)/4 What is u in 14u*2 - 152u - 31023u4 + 31019u*4 + 84 + 34u*2 + 24u*3 = 0? -3, 1, 7 Let k(y) be the second derivative of -3/40y*5 + 0 - 18y - 1/24y4 + 1/2y*2 - 1/60y*6 + 1/4y3. Suppose k(f) = 0. Calculate f. -2, -1, 1 Let j(i) = i3 - 2i2 - i + 2. Let o be j(1). Suppose 0 - 1 = l - z, -4l + 3z - 1 = o. Solve 0 + 2/3f*l - 2f = 0. 0, 3 Solve 18/13l + 0 - 12/13l*2 + 2/13l*3 = 0 for l. 0, 3 Let q be 2 + 16/9-3. Let u(z) be the second derivative of q - 1/3z*3 - 1/2z*2 - 4z - 1/12z4. Factor u(w). -(w + 1)2 Let k(m) be the second derivative of -m6/30 - 3m*5/5 - 35m*4/12 + 2m*3 + 18m*2 - 19m - 2. Factor k(g). -(g - 1)(g + 1)(g + 6)*2 Let l(f) = 2f3 + f2 + f + 1. Let v(w) = 4w4 - 20w*3 + 82w*2 - 42w + 6. Let i(a) = 6*l(a) - v(a). Find d such that i(d) = 0. 0, 1, 3, 4 L	{ "pile_set_name": "DM Mathematics" }
et y = 221 - 220. Let p = 65.93 + -66. Which is the second biggest value? (a) 5 (b) p (c) y c Let y = 1 - 0.3. Let g = 277.2 - 282.2. Which is the fourth smallest value? (a) y (b) g (c) 6 (d) 2 c Let g = -110 + 181. Let q = 114 - g. Let v = q - 45. Which is the third biggest value? (a) v (b) 6 (c) 0.2 a Let l = -3.48 - -2.48. Let h = -0.107 + 0.137. What is the second biggest value in h, l, 3, -0.1? h Suppose 130 + 341 = -48a + 205a. What is the third smallest value in 545, 1/7, a? 545 Let z = 12675 + -15679. Which is the third smallest value? (a) 0 (b) -1 (c) z a Let s = -15526 + 15541. What is the second biggest value in s, 11, -3, 0? 11 Let g = 712 - 713.03. Let j = 0.97 + g. Let y = -3.2 - -3. Which is the third smallest value? (a) -3 (b) y (c) j (d) -1/4 b Let k be (-11)/66117/(-2652). Which is the second smallest value? (a) k (b) -0.5 (c) 0 (d) -6/7 (e) -5/4 d Let k = -1.2186 - -35.2186. Which is the second biggest value? (a) 0.1 (b) 4/7 (c) k (d) 1/5 b Let p be 33 - 1259/135. What is the smallest value in p, 0, -1, 14, -4/7? -1 Let d be ((-17655)/682 + 26)((-2)/7)/(-1). Which is the biggest value? (a) 6 (b) -11 (c) d a Let w = 521.44 + -521.44. Let z(k) = 2k. Let t be z(-4). Which is the third biggest value? (a) 0.8 (b) w (c) t c Let x = 41429 - 41429.2. Which is the biggest value? (a) 0.2 (b) x (c) -437/5 a Suppose 0 = 3l + 2w - 54, -102 = l - 5w - 137. What is the third smallest value in -4, -11, l? l Let g = -11 - -7. Let t = 25/849 + 1423/9339. What is the biggest value in 1/3, g, 3, t? 3 Let i = 4408 - 30850/7. What is the third smallest value in i, 43, -4/7? 43 Let d = -0.529 - 20.871. Let v = d + 15.4. Let m = -38 - -149/4. Which is the second biggest value? (a) v (b) m (c) 3 b Let j(u) = 7u3 + 71u*2 + 9u - 4. Let r be j(-10). What is the smallest value in -1/28, 0.4, r? -1/28 Let u = 0.48 - 0.58. Let y = 59 + 28. Let q = y + -84. Which is the second smallest value? (a) u (b) -6 (c) q a Let i = -95.412 + 90.412. Let f = 0.4 + -2.4. Which is the smallest value? (a) i (b) 14 (c) f a Let h = -576.9 - -580.9. Let w = 6 - 10. What is the third smallest value in w, -12, h, -0.1? -0.1 Let n = 1382 - 1382.7. What is the second biggest value in -4, n, 1/11, -20? n Let g = 11754 - 11751. Which is the third biggest value? (a) -865 (b) 0 (c) g a Let i = -0.18 - -0.08. Let d = 6.5 - 33.5. Let p = d - -30. What is the fourth biggest value in -5, i, p, -2/3? -5 Let j = -1 - -1. Let k be (-720)/900(148/(-32) + 4). Which is the fourth smallest value? (a) -1/4 (b) k (c) -3.3 (d) j b Let u = 152 - 146. Let y be (6 - (-18485)/(-105)) + (-4)/u. Let z = -171 - y. What is the second smallest value in -3, 5, z? z Let r = 3958.4569 + -3958. Let k = r - 0.0569. What is the fourth smallest value in 0, -0.2, 4, k? 4 Let h = 11.2 - -152. Let u = -163 + h. Which is the second biggest value? (a) 3/8 (b) 2 (c) u a Let f = 11.019 + -16.019. Which is the third smallest value? (a) -0.4 (b) -53 (c) f (d) -0.03 (e) -3 e Let c = 4923 - 4923.2. What is the second smallest value in -624, c, -3? -3 Let x(v) = -3v*2 - 28v - 65. Let u be x(-5). What is the second smallest value in u, 65, -13? u Let u = 39 + -27. Let m be 18/(-90) - 2/10. What is the smallest value in u, 1/3, -4, m? -4 Let p be 5/(-25) - (-72)/(-15). Let v = -155 + 464/3. What is the smallest value in -4, 0.1, v, p? p Let o = -6 - -9. Let q = -54 - -76.6. Let s = q - 23. Which is the smallest value? (a) s (b) -1/4 (c) o a Let s = 3720 + -3716. Let y = -3 + 4. Let r(x) = 4x3 + 2x*2 - x. Let t be r(1). Which is the third biggest value? (a) t (b) y (c) s b Let h = 0 - -5. Let d = -0.108 - 308.892. Let g = 308.5 + d. What is the biggest value in 2, h, g, 2/7? h Let q = 7.156 - 7.456. Let x = 56 + -44. Which is the second biggest value? (a) x (b) 2/9 (c) q (d) -1/11 b Let u = -368.47 + 6.47. Let t = -361.502 - u. Let g = 0.002 + t. What is the third biggest value in g, -2, -5? -5 Let p = 6.7 + -7. Let l = 1438946/141 - 30616/3. Let r be 8/(-110)(-45)/18. Which is the second biggest value? (a) r (b) l (c) p b Suppose -314y + 428 = -660 - 482. Which is the biggest value? (a) -22 (b) y (c) -33 b Let g = 1134 + -1137. Let q = -153 - -153.1. What is the second smallest value in q, 0.5, 5, g? q Let w = 88 + -87.6. Let p = 350 + -350. Which is the smallest value? (a) w (b) p (c) 3/10 b Let r be (((-1)/(-6))/(4690/4020))/((-3)/(-7)). Let v = -0.8 + -0.2. Which is the fourth smallest value? (a) 7 (b) r (c) v (d) 0.01 a Let y be 44/(-32) + (-175)/50(-6)/56. Suppose 0 = 2m - 1 + 15. Which is the fourth biggest value? (a) -0.4 (b) 0.03 (c) m (d) y c Let n = 0.2 - 1.2. Let w be (-360)/25 - (-714)/51. Which is the second biggest value? (a) -2 (b) n (c) w (d) -1/8 c Let r = -282 + 280.89. Let t = -0.61 - r. Let c = -1.3 - -1. What is the smallest value in t, c, 5, 1/4? c Let t = 1605 + -1605.5. Which is the fifth biggest value? (a) -3/2 (b) -0.1 (c) -4 (d) -1/55 (e) t c Let d be (-34)/(2/10 - -1). Let b = d - -343/12. Let u(o) = o - 8. Let s be u(8). What is the biggest value in 1/5, b, s? b Let g = -0.772 - -2.872. What is the biggest value in -3, g, -4/5, 3/5? g Let c = -12073 + 12073.5. What is the third smallest value in -1/8, 0.1, 2.2, c, -0.12? 0.1 Let v = -4.91 + -0.09. Let x = -472019/5733 + 2/5733. Let j = -82 - x. What is the smallest value in v, -2/3, j? v Let r = 6.441 - 6.75. Let w = r + 0.109. Let a be (-1)/(-2) - (-22)/(-28). What is the third biggest value in a, w, -0.05? a Let j(x) = 3x*2 - 73x - 52. Let a be j(25). Let d be a + 6 - (-36)/(-9). What is the third biggest value in d, 4, 83? d Let h(f) = -f + 2. Let t = -274 + 272. Let u be h(t). Which is the biggest value? (a) u (b) 3/8 (c) -46 a Suppose 2c + 424 = 2i, 138c = 140c + 4i + 436. What is the biggest value in c, -2/9, 1/4, 4? 4 Let r = -2 + 7. Let g = -271643 + 271580. What is the second biggest value in g, -0.5, r? -0.5 Let n be (-1645)/13818 + (-2)/12. Let r = 0 - 4. Which is the second smallest value? (a) 3 (b) n (c) -6 (d) r d Let j = 7781 + -7781.06. What is the fifth smallest value in 1, -0.1, j, -4, 11? 11 Let k = -150.22 - -149.22. What is the fourth biggest value in 6/11, 0.2, 0.5, -0.01, k? -0.01 Let s = -1452.6 - -1453. Let g be (-12)/(-18) - 4/3. Let h = -1 + 4. Which is the biggest value? (a) g (b) s (c) h c Let k = -929.55 - -931. Let o = 2.55 + k. Let s = -37/2 + 18. Which is the smallest value? (a) o (b) -0.1 (c) s (d) 4/3 c Let v(b) = 2b*2 - 15b - 79. Let i be 1516/40 - (-5 - 0). Let r be v(i). Let t = -2 + 5. What is the second biggest value in r, 1/3, 2/5, t? 2/5 Let h = 111.79631 - -0.05369. Let y = 112 - h. What is the biggest value in y, -5, 0.3? 0.3 Let g be 34/14 + 9(10 + (-1104)/108). Which is the third biggest value? (a) g (b) 0 (c) 2 b Let l = 392 + -353. Let a = 128 - 87. Let o = l - a. What is the second smallest value in o, 4/7, -14? o Let m = -0.0164 + -303.9836. Let p = -307 - m. Let k = 2.726 - 0.026. Which is the second biggest value? (a) p (b) 2/11 (c) k b Let k = -7510058 + 4138039850/551. Let t = 74/19 + k. What is the biggest value in 0.2, t, 4, -4? 4 Let d(n) = -n*2 - 25n + 26. Let x be d(-14). Suppose 20q = -16q + x. What is the third smallest value in q, 0.4, -3, -20? 0.4 Let b = 86 + 91. Let q = b - 228.8. Let l = 52 + q. What is the biggest value in l, 0.1, 1/3? 1/3 Let l = -12361 - -49441/4. What is the biggest value in 2, -13, l, 2/13? 2 Let q = 3250.4 - 3250. Which is the smallest value? (a) -5 (b) -1 (c) q (d) 24 a Let w = -10/7 + 9/7. Let j = -331.5 + 332. Which is the smallest value? (a) j (b) 1 (c) w (d) -0.1 c Let p = -13.3 + 14. Let k = p + 0.3. Suppose -17f - 2f = -5f. What is the second smallest value in -2/9, k, f? f Let p = 128.66 - 128.6. Which is the fourth smallest value? (a) 0.2 (b) -1 (c) -2 (d) p a Let n = 3745 + -14983/4. Which is the third smallest value? (a) 1/39 (b) n (c) -2 (d) 4/7 a Let q = -4034.899 - -4033. Let l = -0.101 + q. Which is the third biggest value? (a) l (b) -3/2 (c) 6 a Suppose 583s - 3a = 588s - 498, a = -3*s + 302. What is the smallest value in -2/17, 1/4, s, 3? -2/17 Let v = 14	{ "pile_set_name": "DM Mathematics" }
8582s - 1 What is the third derivative of -265y5 - y2 + 7 wrt y? -15900y2 What is the third derivative of -5m*2q3 + m2q2 + 16m*2q - 2mq*3 - mq*2 wrt q? -30m*2 - 12m Differentiate 2ad*3o - 2ao - 350a + 9d*3o + 3d2o + do + o wrt a. 2d*3o - 2o - 350 Find the second derivative of -33c*2o2 - c2 - 2co*5 + 2co2 + 2co wrt o. -66c*2 - 40co3 + 4c Find the second derivative of -1758w2 - 48w wrt w. -3516 What is the third derivative of 81tw*3 - 3tw2 + 5tw + 7w*3 - 27w wrt w? 486t + 42 What is the second derivative of 3kn2 - 2417kn - 3477n*2 + 2n wrt n? 6k - 6954 Find the third derivative of 4d*2o*3q - 14d2o*3 + 2d*2o*2q + d*2q - doq + 4o2q wrt o. 24d2q - 84d2 What is the second derivative of -561r*5 + 16r - 69? -11220r3 What is the first derivative of 896bz + 5z + 147 wrt b? 896z Find the third derivative of -10q*3r5 - q3r3 + 3q*3r*2 + 2q3 + q2r2 wrt r. -600q*3r*2 - 6q*3 Find the third derivative of 2q*3x + 226q3 + 397q*2x wrt q. 12x + 1356 Find the third derivative of 1355w*3 + 20w*2 - 3w wrt w. 8130 What is the first derivative of -8684h - 1300? -8684 Differentiate 200p*4 + 77 with respect to p. 800p*3 What is the third derivative of -2b*3o*3 - 4b*3o2 - b3o - 284b*2o*3 - 2b*2 wrt o? -12b*3 - 1704b*2 What is the derivative of 2ms3 - 2ms - 78m + 13s2 - 2 wrt s? 6ms2 - 2m + 26s Find the second derivative of -935y*2 + 154y wrt y. -1870 Differentiate 2o4 - 1038o*3 + o - 20777. 8o*3 - 3114o*2 + 1 What is the first derivative of -6q*2x + 3q2 - qx - 2x - 4 wrt q? -12qx + 6q - x Find the first derivative of y*3 - 291y*2 + 1268 wrt y. 3y*2 - 582y What is the derivative of -2127z - 926 wrt z? -2127 Find the third derivative of 8u*5 - 519u*4 + 23u*2 - 5u - 1 wrt u. 480u2 - 12456u Find the second derivative of -303x3 - 15x + 10 wrt x. -1818x Find the second derivative of 8a*3d*3 - 11a*3d + 4a2d + 9ad3 - d3 - 4d wrt d. 48a*3d + 54ad - 6d Find the first derivative of 2114t + 1507. 2114 Find the second derivative of 17233j3 + 3923j + 4. 103398j Differentiate -20p*2 + 13p + 729 wrt p. -40p + 13 What is the third derivative of -21i*5t*2 - 5i*5 + 2i*2 - 47t*2 wrt i? -1260i*2t*2 - 300i*2 Differentiate 184o*2w3 + o2w2 - 178w*3 + w with respect to o. 368ow3 + 2ow2 What is the third derivative of 21g*3q*4 - 3g*3q*2 + 3g*3q + 87g2q*2 + 35gq6 wrt q? 504g*3q + 4200gq*3 Find the first derivative of 4c*3 + 34c*2 + 271 wrt c. 12c*2 + 68c Find the second derivative of -10m2n + m*2 + 169mn wrt m. -20n + 2 What is the second derivative of 24f4 - 2f*2n*3 + 5fn + 19n*3 wrt f? 288f*2 - 4n*3 What is the first derivative of -12q - 8013? -12 Find the second derivative of -7949x2 - 12840x. -15898 Differentiate -11220o3 + 325 wrt o. -33660o*2 What is the second derivative of -3429z*2 - 19z - 3? -6858 What is the first derivative of -226jr*2 - 2j + 3r2 - 7 wrt j? -226r*2 - 2 What is the second derivative of -49iv5 - 2iv2 + iv + 15v wrt v? -980iv3 - 4i What is the first derivative of 3074x2 - 1564? 6148x Find the second derivative of 35m3y3 - m3y + 446my3 + my*2 wrt m. 210my3 - 6my Find the third derivative of -11a*3b*3 + 9a*3b - 2a2 + 2a + 32b3 wrt a. -66b*3 + 54b What is the third derivative of -y*6 + 7y*5 + 174y*3 + 6y*2 - 41? -120y*3 + 420y*2 + 1044 What is the third derivative of 4546a*3i*3 - 39a*3i2 - a2i2 + 2ai wrt i? 27276a*3 Find the third derivative of -1526c*2t*6 + 4c*2 + 2ct6 + 27ct2 - 5t*2 wrt t. -183120c*2t*3 + 240ct3 Differentiate -i4 - 146i*2 + 461. -4i*3 - 292i Differentiate 16h3q*2 + 456hq3 + 9332q*3 wrt h. 48h*2q*2 + 456q*3 What is the third derivative of 5gq5 - 5gq3 - 2gq2 - 95g + 2q wrt q? 300gq2 - 30g What is the third derivative of -2f2k*2n*2q - f*2k*2n + 6013f2n*3q + f*2n*2q + fk2n*3q - fk2q - 19fkq + 2k*2n*2 wrt n? 36078f*2q + 6fk*2q What is the first derivative of 4u2w*2 + 7u*2wx + 2uw3x + 5w3x + w*3 wrt u? 8uw2 + 14uwx + 2w3x What is the second derivative of 633m3 - m + 43? 3798m What is the derivative of 2b2n*2 + 4491b*2 + 2bn2 + n2 + 28n wrt n? 4b2n + 4bn + 2n + 28 Find the first derivative of 19k*3nu + 215k*3 - 4knu + 2kn wrt u. 19k3n - 4kn What is the second derivative of -1368w4 - 1238w? -16416w2 Find the second derivative of 151g*2 + 2g + 130 wrt g. 302 Find the second derivative of 25p5 + 6p*4 + p - 32. 500p*3 + 72p*2 Find the second derivative of -12434k*4 + 4418k. -149208k2 Find the first derivative of -81x*2 + x + 351. -162x + 1 Find the second derivative of 7dk*2 + 2dko + 94do*2 + 5do + 3k*2o*2 + 2k*2o - 2o2 - 1 wrt o. 188d + 6k2 - 4 Find the first derivative of 26742w*2 + 26087. 53484w Find the second derivative of -2933s4 + 3s + 320. -35196s2 What is the first derivative of -1648n - 1312? -1648 What is the second derivative of 19l5 + 9l*3 - 41l - 3 wrt l? 380l3 + 54l What is the third derivative of 728s5 + 11s*2 + 5s? 43680s2 Find the third derivative of -39gq2 - 4gqt*3 - gqt2 + 4g + 4q2t*3 + 4qt3 wrt t. -24gq + 24q*2 + 24q Find the third derivative of 68m3w*3x2 + m3w2x2 - m2w3x - 3m2wx2 + 5m*2w wrt m. 408w3x*2 + 6w*2x2 Find the third derivative of -q2z5 + q2z*2 + 2q*2 + 912qz5 - 26z*2 wrt z. -60q*2z*2 + 54720qz2 Find the second derivative of -2q*5 - 3q*4z*2 - 8q*2z - 125qz*2 wrt q. -40q*3 - 36q*2z*2 - 16z Find the third derivative of -21839a4 - 2679a*2 + 4 wrt a. -524136a Differentiate -2d2j + 2dj - 19d - 1007j with respect to d. -4dj + 2j - 19 What is the derivative of 875w*2 - 140? 1750w What is the second derivative of 2527n2 + 2844n wrt n? 5054 What is the first derivative of -7156m - 3518 wrt m? -7156 Find the third derivative of -1799b*4v + 2b2v + 176v wrt b. -43176bv What is the second derivative of -p5 + 4p*3t*2 - 18p*2t*2 + 92pt2 wrt p? -20p*3 + 24pt2 - 36t*2 What is the third derivative of 28994a*5 - 960a*2 - a - 1? 1739640a*2 What is the second derivative of 3703ku2w*2 - 42ku2w - 8kuw - 2u*2w wrt w? 7406ku*2 What is the second derivative of 737b*3m*2 + 27b*3 - 2bm + 2 wrt m? 1474b*3 Find the first derivative of 14m*3 - 11m*2 + 1089 wrt m. 42m*2 - 22m Find the second derivative of 651m2w*3 - 36mw2 + 2m + 2w3 wrt m. 1302w*3 What is the derivative of 17j*3n*2 - 111j*3 + 62j*2n*4 + 2j wrt n? 34j3n + 248j2n*3 Find the third derivative of -3p*6 + 160p*5 - 978p*2 wrt p. -360p*3 + 9600p*2 Differentiate -3n*4 - 121nr3 + 15r*3 + 7r*2 - 4 with respect to n. -12n*3 - 121r*3 What is the second derivative of 5i*3v*3 + 4i*3 - 8i*2v*3 + 2iv3 - 77iv wrt i? 30iv3 + 24i - 16v3 Find the first derivative of -3287o*2 + 2680. -6574o Find the third derivative of 19q5 - 4q*4 + 48q3 - q2 + 415. 1140q2 - 96q + 288 What is the first derivative of 32t2x*2 + 500t*2 - 4x*2 wrt x? 64t*2x - 8x Differentiate 65b*3j*3z - b*3j*3 - 73b*3j*2 + 2bj2z*2 - 4j*3 wrt z. 65b*3j*3 + 4bj2z Find the second derivative of -5d3s*5 - 6d*3 + 16d*2s*5 - 2ds wrt s. -100d*3s*3 + 320d*2s*3 What is the first derivative of -642u*2 - 557 wrt u? -1284u What is the second derivative of 3v5 - 11v*2 + 12v - 3 wrt v? 60v3 - 22 Differentiate 3771c*3h + 1146c3 with respect to h. 3771c*3 What is the third derivative of -5324u*3x*3 - 58u*3 - 23u*2x*2 wrt x? -31944u*3 Find the third derivative of -2648y*3 + 855y**2 wrt y. -15888 Find the second	{ "pile_set_name": "DM Mathematics" }
*2 + 0y*2). -74y4 Expand (-m2 - 2m2 + 4m*2)(-m + m - 2m) + 175m*3 + 27369m*2 - 27369m*2. 173m*3 Expand 2w*2 - 2w*2 + 2w*3 + (-11w*2 - 48w*2 + 10w*2)(-2w - w - w) - 3w*3 - 2w*3 + 3w*3. 196w*3 Expand (258 + 30 - 57)(2 - 2 + 2)(b2 - b2 - b3). -462b*3 Expand (0w2 + w2 + 0w2)(-4 + 2 + 0) - 24w2 + 80w*2 - 36w*2. 18w*2 Expand (-21v - 38v + 31v - 8v)(0v + 0v + 6v). -216v*2 Expand -3093t*4 - 405t*4 - 179t*4 + (4t - t - 4t)(0 + 0 - 1)(-4t*3 + 3t*3 + 2t*3). -3676t*4 Expand (2o*2 - 5o*2 + 4o*2)(-2 + 25o - 5o + 3)(-15 + o + 15)(1 + o - 1). 20o5 + o4 Expand (l3 + l3 + 0l*3 + (0l*2 + 3l*2 - 2l*2)(0l - 5l + 3l) + l3 - 2l*2 + 2l*2)(-l + 0 + 0)(-75 - 55 + 81). 49l*4 Expand (7h*3 - 2h*3 - 3h*3)(h*2 + 0h2 + h2 + (-62 + 62 - 2h)(-4h + 13h + 7h) - 4h*2 + 2h2 + h2). -62h5 Expand (1 + 1 - 8)(-3p - 4 + 4p + 9p). -60p + 24 Expand (25 + 38 - 7)(1 - 5 + 2)(3c4 - c4 - c4) + (-2c*3 + 4c - 4c)(1 + c - 1). -114c4 Expand (0s + 6s - s)(-109 - 92 + 41). -800s Expand (2 + 0 + 0)(-103k - 129k + 201k)(4 - 3 + 1)(k2 - k2 - k2). 124k*3 Expand (430 - 430 - 182l)(4 - 3l + 0l - 3)(7 - 3 - 3). 546l2 - 182l Expand (-73 + 25 - 65)(c - c + c3 + (0c*2 + 4c*2 - 5c*2)(c - 3c + 4c)). 113c3 Expand (-1 - 2 + 1)(15z + 8z - z) + 2z - 2z + 3z. -41z Expand (-5w2 + 3w*2 + 6w*2)(-11w - 2257 + 2257). -44w*3 Expand (33d - 47d + 27d)(2 - 2 + 6d + (4 - 3 + 0)(4d - 2d - 3d) + 0d - 2d + 0d). 39d*2 Expand (-5l - 3l + 6l)(3l*4 - 2l4 + l4) - 483l2 - 23l*5 + 483l*2. -27l*5 Expand (4 + 1 + 3)(-7a - 2a + 10a). 8a Expand (1 - 4 + 2)(8i - 20i - 7i). 19i Expand (2 + 1 - 1)(-126m5 - 2m*2 + 59m*5 + 68m*5). 2m*5 - 4m*2 Expand (4b*4 + 0b*4 - 3b*4)(-2 - 4 + 4) - 3b4 + 2b4 - b4 - 2 + 0b4 - 3b*4 - 2 - 14b*4 + 18b*4 + 14b*4. 11b4 - 4 Expand z2 - 471 + 237 + z + 232 + (1 - 2 - 1)(-z2 - z2 + 0z*2). 5z*2 + z - 2 Expand (-2h3 + h3 - 2h3 + (2 - 2 + 2h*3)(-1 + 3 + 2))(-5h + 4h + 4h). 15h4 Expand (-4 + 1 + 0)(4a2 - 109a + 109a)(-6a3 + 11a*3 + 2a*3). -84a*5 Expand (-2 + 6 - 2)(-3g + 3g - g)(17 - 36 + 6)(-4g + 3g + 2g). 26g*2 Expand (37 - 37 + 5z)(3 + 1 + 0 + 2 + 3 - 4 + (-1 + 3 - 4)(0 + 3 - 4)). 35z Expand (-1 - 11 + 110)(-6 - 6 + 1)(3g + 0g - g). -2156g Expand (c + c - 4c)(51 - 24 - 22) + (c - 4c + 5c)(2 - 5 - 1). -18c Expand ((u2 + u2 - 8u2)(0u + u + 2u) + 10u2 - 6u*3 - 10u*2)(7u2 - 2u*2 - 2u*2). -72u*5 Expand (-31 + 10 - 3)(0g2 - 2g*2 + 6g*2). -96g*2 Expand ((-2 + 6 - 3)(o - 7o + o) - 10o - 15o - 3o)(-o3 + 4o*3 - 2o*3). -33o*4 Expand -120x*2 + 120x*2 + 38x*4 + (1 + 2 + 0)(-2x4 + 0x*4 + 3x4) - x4 + x*4 + 2x*4. 43x4 Expand -x3 - 3x4 + x3 + (1 - 1 - 2x*3)(-2x - x + 2x) + 56x4 + 64x*4 - 49x4 + x4 - 3x3 + 3x*3. 71x*4 Expand (14d + 11 - 34 + 18)(-d2 + 3d*2 - 4d*2). -28d*3 + 10d*2 Expand (-5m*2 + 3m*2 + 3m*2)(19m + 115m - 235m) + m2 - m3 - m2. -102m*3 Expand 3o*4 - 387o*2 - 3o5 + o5 + 411o2 + (0o + 4o - 3o)(2 + 3 - 3)(2o4 + 0o*4 - 3o*4). -4o*5 + 3o*4 + 24o*2 Expand ((2 - 2 - 2y)(3 + y - 3) + 0y*2 + 3y*2 - 5y*2 - 2y*2 + 2y2 + y2 + 2y2 + 32 - 32)(-y - y + 0y). 2y*3 Expand (3 - 4 + 2)(-z5 + z5 - 2z5) + 9z5 + z5 - 5z5 + (4z - z - 2z)(z*4 - 3z4 - z4) - 8z5 + z4 - z4. -8z*5 Expand (-17b - 80b + 7b)(1 - 6 + 3). 180b Expand (-2f4 + 9f4 - f4)(26 - 34 + 30). 132f*4 Expand 51v*3 + 8v*2 - 2v*4 + 53v*3 - 102v*3 + (-4 - 2 + 0)(-3v4 + 3v*4 + 3v*4). -20v*4 + 2v*3 + 8v*2 Expand (-2c - 3 + 3c + 0c)(-2 + 2 + 2)(0 + 36 - 6)(-2c4 + c4 + 2c4). 60c*5 - 180c*4 Expand 4l*5 - 46l*5 - 39l*5 + (-3l3 - l3 + 2l3)(-l + l*2 + l). -83l*5 Expand (228 - 125 + 235)(g*3 + 6g*3 - 4g*3). 1014g*3 Expand ((0l + l - 2l)(34 + 19 - 16) + 0l + 2l + 0l)(2 + l - 2). -35l2 Expand (4c - c - c)(-26c + 198 - 198) - 1 + 1 + 3c2. -49c*2 Expand 50m*2 + 38m*2 - 87m*2 + 151 + (0 + m + 0 + (5m - 2m - m)(0 + 6 - 4))(-4m - m + 3m). -9m*2 + 151 Expand -3r*4 + 0r*4 + 2r*4 + (-3 - 2r*2 + 3)(3r2 + 0r2 - r2) + 2r4 - r4 + 0r*4 + (1 + 2r + 3 - 1)(3r3 - r3 - 3r3). -6r*4 - 3r*3 Expand (-2 - 3 + 6)(p*4 - 3p*4 + 3p*4) + (-2 - 4 + 4)(18p4 - p4 + 46p*4). -125p*4 Expand (-56 + 164b + 56)(-5b*3 + 2b*3 + 2b*3) + (-b + 3b + 2b)(-b3 + b3 - b*3). -168b*4 Expand (-2m + 5m - 2m)(-m3 + 0m*3 + 0m*3)(-2 + 16 - 4)(13m + 0m + m). -140m*5 Expand 2d2 + d2 - 4d2 + (1 - 2 + 0)(0d2 + 4d*2 - 2d*2) + 0d2 - d2 + 0d2 + 0d + 0d - 2d*2 + 28d*2 + 14d*2 + 4d*2. 40d2 Expand (-a2 + 7a2 + 5a*2)(6 - 2 - 3)(7 - 3 - 2). 22a*2 Expand (-4 + 6 - 4)((4r2 - 4r2 - r2)(-r3 + 3r*3 + 0r*3) - 6r5 + r5 + 4r5 + (-5r*2 - 2r*5 + 5r*2)(-22 + 67 - 31)). 62r5 Expand (2t*3 + 5t*2 - 5t*2)(-3t - 3t + 14t) + 3t*4 + 0t*4 - 5t*4. 14t*4 Expand ((0 - 2 + 0)(2 - 2 + 1) - 1 + 2 + 0 - 2 + 2 + 2 + (3 - 4 + 0)(1 - 3 + 1))(-2l - l + 4l) - 1279 + 67l + 1279. 69l Expand -3u5 + 4u*5 + 0u*5 + (5u*2 - 4u*2 - 3u*2)(7006u3 + 6700u*3 - 12797u*3). -1817u*5 Expand -u + 4u - u + (-2 - 1 + 1)(1007u + 4 - 1008u - 16). 4u + 24 Expand -4l5 + l5 + 5l*5 + (0l + 0l - 2l*4)(0 + 2l + 0) - 2l5 - l5 + l5 + l2 + 44l5 + 42l*4 - 74l*5 + 25l*5. -9l*5 + 42l4 + l2 Expand (4f - 140267 + 140267 + 186f*2)(-4 - f + 4). -186f3 - 4f*2 Expand 0g*4 + 4g + g*4 - 5g + (0 + 0 - g)(0g*2 - 2g*3 + 0g*2) + 3g3 - g4 - 3g3 + (-18g - 136g - 4g)(0 - g3 + 0). 160g4 - g Expand (0 + 0 - p4)(0p - 2p - p) - 4p*5 + 0p*5 + 3p*5 + (0p*2 - 2p*2 + 0p*2)(3p3 + 3p*3 - 4p*3). -2p*5 Expand (0o + 4o - 3o)(2 + 0 - 4 + 2 - 4 + 4 + (-2 + 0 + 0)(2 - 2 + 1)) + 2o + 3o - 2o. o Expand (0f*2 + 0f*2 - 5f*2)(5 - 4 + 1) + 0f2 + 0f2 + f2 + f*2 + f - f + (-f + 1 - 1)(0f - f + 0f) + f*2 - 4f*2 + 0f*2. -10f*2 Expand (0 + 0 - 1)(-2m + 2m - m) + (-1 + 1 + 3)(6m + 2m - 3m) - 5m - m + 5m + (1 + 0 + 1)(m - 4m + m). 11m Expand (-1303 - 2197 - 339 - 1155 + 1217)(5w - 2w - w). -7554w Expand (-3 + 3 - r)(-107r - 373 + 373). 107r*2 Expand ((-6f2 - f2 + 4f2)(-3 - 2f + 3) + 4f*3 + 4f*3 - 6f3 - f3 - 1 + 1)(-4f + 3f + 4f). 21f4 Expand (-730f - 727f - 6f*4 + 1451f)(3f - 2f - 2f). 6f5 + 6f*2 Expand 3d + 2d - 4d + (-6d + d - d)(-1 + 1 - 1) + 6d + d - 3d. 11d Expand (0 - 2c*2 + 0)(-1 + 6 - 3) - 41c2 - 35c2 + c2. -79c2 Expand (-2z4 + z4 - 2z4)(-30 - 23 + 7). 138z4 Expand (-18d + 12 - 12)(-2 + 6 - 5)(-1 + 1 - 2d3). -36d*4 Expand (3k3 + k3 + 2k3)(1 + 0 - 3)(2 - 1 + 1)(-2 + 2 + 3)(-3 + 10 + 15k*2 - 14k*2). -72k*5 - 504k*3 Expand (7k*2 - 4k*2 + 4k*2)(1346 + 38k - 1346). 266k*3 Expand (3 - 3 - y)(61y2 - 6 - 58y*2 + 100y*3 - 102y*3). 2y*4 - 3y*3 + 6y Expand (4u - 4u - u*2)(0u3 + 2u*3 + 0u*3) - 8u*5 + 9 - 9 + 4u*5 - 77u - 2u4 + 77u. -6u5 - 2u*4 Expand (-1 + 1 + w)(2332w2 + 2303w*2 - 4591w*2) + (0 - 2w + 0)(-1 + 1 + 2w*2). 40w*3 Expand (-5 - 9 - 22)(3 + 0 - 1)((-6b + 4b + 6b)(0 + 2 - 4) + 4b + 2b - 4b). 432b Expand -b2 - 33b5 + b2 + (b + 2b - b)(b*2 - 3b2 + b2)(-3b*2 - 4b*2 + 2b*2). -23b*5 Expand (-2r - 5r + 4r)(-5 + 0 - 1) + r - r + 4r. 22r Expand (-3q + 0q + q)(-3 + 3 + 4q) - 12q*2 + 22q*2 + 7q*2. 9q*2 Expand (5m*4 - 4m*4 + 3m*4)(4m - 3m + m) + (5m5 + 0m*5 + 5m*5 + (-1 + m + 1)(m - 3m4 - m))(0 + 0 - 1). m*5 Expand (-3x*5 + 11x*3 - 11x*3)(-2 + 4 - 6) - 3x5 + 4x*5 - 5x*5. 8x*5 Expand 4a*3 + 6a*3 + 3 - 4a**	{ "pile_set_name": "DM Mathematics" }
+ 0 - 2 + 1 - 3 + 1). 10p Expand (0 - 1 + 3)(-2s3 + 2s - 2s) + (-1 + 1 + 2s*2)(s - 4s + s). -8s*3 Expand -7d*5 - 2d*2 + 2d*2 - 2d*5 + 0d5 - d5 + (-4 + 2 + 4)(0d*2 + 2d*5 + 0d*2). -6d*5 Expand 0l*2 + 4l*2 - 5l*2 + (0l*2 - 2l*2 + 0l*2)(-4 + 3 + 2) + l2 + l2 - l*2. -2l*2 Expand (0j*2 + 0 + 2j*2 + 1)(-5j3 + 2j*3 + 4j*3). 2j5 + j3 Expand (-q*3 + 3q*3 + 3q*3)(5q2 + 3q*2 - 3q*2) + (0q - 2q4 + 0q)(q - 2q + 2q). 23q*5 Expand (-5d + d + 3d)(11 - 11 + 4d4) + (0d + d*2 + 0d)(d - d + d3). -3d*5 Expand (3w + w - 2w)(-2w + 3w + w) + 4w2 + 5w*2 + 2w*2. 15w*2 Expand 3u + 0u + 4u + (2u + 0u + 0u)(3 - 2 + 1). 11u Expand (0i + 2i + i)(-i4 + i4 - 2i4) + 6i*5 + 3i*4 - 3i*4 + (-3i4 + i4 + 3i4)(-4i + 0i + 2i). -2i*5 Expand (-2g*2 + 4g2 - g2)(3 - 2g - 3) + (-2g2 + 3g*2 - 2g*2)(2g - 2 + 2) + 4 - 8 - g3 + 1. -5g*3 - 3 Expand (-200 + 200 + k)(2k + 0k - 3k). -k2 Expand (35p*2 - 35p*2 - 9p*3)((1 - 2 + 2)(3 - 3 + 2p2) - p2 + 2p2 - 2p*2 - 4p*2 + 2p*2 + 0p*2). 9p*5 Expand (-2c*2 + c - c)(1 - c - 1) + 3c3 + 4c*2 - 6c*3 - 2 + 6c*3. 5c*3 + 4c*2 - 2 Expand -2q*5 + 0q*5 + 0q5 + (-q4 - 2q4 + 6q*4)(-2q + 4 - 4) + 14q*5 + 46q - 46q. 6q*5 Expand (-7z + 2z + 2z)(-4z*2 - 2z*2 - 2z*2). 24z*3 Expand (2x*4 - 4x4 - x4)(0 + 0 - x) - 5x5 - x5 + 4x5 - 2x*5 - 4x*4 + 4x4. -x5 Expand -13w4 + 9 - 9 + (-5w*2 + 5w*2 - 2w*2)(-2w2 + 3 - 3) + 2w*4 + 2w*3 - 2w*3. -7w*4 Expand 0a3 - a3 + 6a3 + (2a + 0 + 0 - a - 2a + 5a + (a - a - a)(-4 + 4 + 1) + a + 2a - 5a)(-a*2 + 4a2 - a2). 7a3 Expand (-z2 + z2 - z2)(5z - 2z - z) + (0z + 0z + z*2)(17z + 24z - 5z). 34z*3 Expand -2u*4 + 4u*4 - 4u*4 + (u + u - 4u)(0u*3 + 6u*3 - 4u3) + u4 + 3u4 - u4. -3u*4 Expand (2p + 2p + 12 - 10)(-4 + 0 + 2). -8p - 4 Expand (j + j + 0j)(55j*4 - 81j*4 + 46j*4). 40j*5 Expand -3 + 3 - q + (0 - 2q + 0)(4 - 3 + 1) + 1 + 2q - q + 0q. -4q + 1 Expand (-2v2 + 2 - 2)(3 - 3 + 2)(5 - 1 - 1). -12v*2 Expand (2b + b + 0b)(b + 7b - 5b). 9b2 Expand (3z - 3z + z - 4 + 4 + z + 5z - 2z - 2z - 3 + 3 + z + (-z - 3z + 3z)(0 + 0 - 1) - 3z + z + 3z + z - 3z + z)(-z - 1 - 4z + 2z). -15z*2 - 5z Expand (-6l2 + 2l*2 + 2l*2)(-24l + 40l - 19l). 6l*3 Expand -2u*2 - 1 - 2u*2 + 0 + (-4 + 2u + 4)(-3 + 2u + 3) + 4u2 - 6u2 + u2. -u*2 - 1 Expand (2x + 2x + 3x)(1 + x - x - x) - 5x - 2x2 + 5x. -9x2 + 7x Expand 2w2 + 0w + 0w + 2w*2 - 1 + 1 + (w + 2w + 0w)(-w - 2 + 2). w*2 Expand (-3y*4 - 2y*4 + 6y*4 - 2y)(-3y - 2y + 3y). -2y5 + 4y*2 Expand (-3n*2 - 3n*2 + 3n*2)(2n - 2n - 2n)(0 - 1 + 3). 12n3 Expand (-t4 - 2t5 + t4)((1 - 1 - 3)(-1 + 3 - 1) + 0 + 0 - 3). 12t5 Expand -6p*3 - p - 36p*3 + 72p*3 + (0 + 1 - 2)(p - p - 2p3). 32p*3 - p Expand 2a*4 + a + a - 5a4 + (a3 - 2a3 + 0a*3)(0a - a + 0a). -2a4 + 2a Expand (j + j + 0j)(3 - 2 - 2)(2 + 0 + 0). -4j Expand (6f3 + 7f*3 - 3f*3)(-2 + 0 + 1). -10f3 Expand (-f + 2f - 2f)(-5f2 + 0f2 + f2)(1 + 3 - 2). 8f*3 Expand (2s + s - 2s)(3s - 4s + 0s) + s2 + 0s*2 - 3s*2 + 4s*2 - 13s*2 - 4s*2. -16s*2 Expand (1 - 4 + 1)(0l - 3l + 2l)(3 - 3 - 2l). -4l*2 Expand (0w - 4w + 2w)(2 + 1 + 4w*3 - 2w*3). -4w*4 - 6w Expand (-2f - 3f - 2f2 + 2f)(3f + 1 - 1). -6f3 - 9f*2 Expand (4w*3 - 2w*3 + 0w*3)(w - w + 2w) + 2w4 + w3 - w*3 - 2w2 - w4 + 2w2 - 2w + 2w + w4. 6w*4 Expand -5c*2 + 5c*2 + 3c*2 + 4c*2 + 4c*2 - 5c*2 + (-2 + 1 + 0)(-c*2 - 4c + 4c) - 2c + 2c + c2 - c2 - 4c*2 + 2c*2. 5c*2 Expand (0 + 0 + 2d)((-1 - 1 + 0)(2 - 2 - 1) + 1 - 7 + 2) - 2d - 1 + 1. -6d Expand (2i4 + 3i*3 - 3i*3)(-4i + 5i - 3i)(-3 + 6 + 6). -36i5 Expand (3 + 0 - 4)(-1 + 1 - k) + (3 - k - k - 1)(1 - 1 - 9). 19k - 18 Expand (-13 - 2y4 + 13)((0 - 2 + 1)(0 + 1 + 1) - 4 + 1 + 2 - 3 - 2 + 6 - 1 + 1 + 1 + 6 + 3 + 13). -42y4 Expand l5 - 4l5 - 5l*5 + (-3l2 + l2 + 0l2)(4l2 + 2l*3 - 4l2) + l5 + l3 - l3 + (-l + l - l*2)(-l*3 - 2l*3 + 2l*3). -10l*5 Expand ((4u - 2u + 0u)(3u*2 - 2u*2 - 3u*2) + 3 - 3 - 2u*3)(4u2 + 2u*2 - 4u*2). -12u*5 Expand (-37l*3 + 73l*3 - 12l*3)(l + 1 - 1) - l4 + 9 + l2 - 11 - 2l2. 23l4 - l2 - 2 Expand (2k2 - 2k*4 - 2k2 + (k3 + 0k3 + k3)(2 - 2k - 2))(4k + 0k - 6k + 4k - 3k - 5k + (-2 + 1 + 0)(0k + 0k - 2k)). 24k5 Expand 5s*4 - 13s*2 + 13s*2 + 3s*4 + 3s*4 - 4s*4 + 0s4 + s4 + s4 + (1 - s3 - 1)(3s - 4s + 0s) + (-2s - s + s)(s2 + s3 - s*2). 8s4 Expand c - c + c4 + 1 - c*4 - 1 + 5c*4 + 0c*4 - 3c*4 + (-2c*2 + 2c*2 + 2c*3)(-1 + 2c + 1) + 3c*4 - 2c4 + c4. 8c4 Expand (0 + 2 + 6)(y + 3y + 4y)(-2 + y + 2). 64y2 Expand a5 + 0a5 + a5 - 3a*5 + 4a*5 - 2a*5 + (3a*2 - 3a2 + a2)(a - a + 2a*3) - 4a5 + a5 + a*5 - 3a*5 + 0a + 0a. -2a*5 Expand -7 - 6t*4 + 7 + (-5t2 + t3 + 5t2)(-t - 2t + t) - t4 - 3t + 3t. -9t*4 Expand (-3r*3 + 2r*3 + 11r*3)(-2r2 - 3r + 3r) + r2 - r2 - r5. -21r*5 Expand 2w4 + w4 - 4w4 + (-3w*3 - 4w*3 + 0w*3)(0w - 2w - w) + (-3w2 - w2 + 2w*2)(-w*2 + 0w*2 + 0w*2). 22w*4 Expand ((2 + 2 - 2)(-1 + 0 + 2) + 2 + 1 - 2 + 4 - 3 + 0)(-4v + 3 - 3). -16v Expand (15r - 35r - 9r)(4r - 2r - r). -29r*2 Expand -2p2 - p4 + 2p2 - 2p*4 + 4p*4 - 4p4 - p4 + 4p4 - 2p*4 + (-4 + 3 + 3)(0p4 - 3p*4 + 4p*4) + 5p*4 - 4p*4 - 3p*4. -2p*4 Expand 4v*3 - 3v*2 + 3v*2 + (2 - 5 + 5)(-4v3 + 5v*3 + 0v*3). 6v*3 Expand (-3o2 - o3 + 3o2)(14o + 27o + 23o). -64o*4 Expand (1 - 9 + 0)(-3d + 4d + 0d + (1 - 2 + 3)(0d - 4d + 2d)). 24d Expand -k*2 - 2k3 + k2 + (-2k3 - 5k + 5k)(-3 + 1 + 4) + 5 + 0 - 4k3 - 7. -10k*3 - 2 Expand (-1 + 8 - 2)(3b - 2b - 3b + 4 - 4 + 2b + (0b - b + 3b)(3 - 2 + 1) - 1 - b + 1 + 0 + b + 0). 20b Expand (-n + 3n - 3n)(n2 + n2 - n2) + 3n*3 - 4n*3 + 3n*3 + (2n*2 + 4n*2 - 4n*2 + (-n - n + 0n)(-4n - n + 3n))(1 - 1 + 4n). 25n*3 Expand (3 - 3 + 2 + 1 - 2 + 0 + (5 + 2 - 5)(1 - 6 + 3))(0v*2 + 3v*2 + 0v*2). -9v*2 Expand ((-2q - 2q + 3q)(2 - 1 + 0) - 1 + 1 - q)(144 + 2q + 2q*4 - 144). -4q*5 - 4q*2 Expand (-4a - a + 3a)(-4a - 11a*4 + 4a). 22a5 Expand (-2 - 2 + 6)((3 + 1 - 3)(-4b*2 + 0b*2 + 6b*2) - 148b + 6b2 + 148b)(-2 + 3 + 1). 32b*2 Expand (-2 + 6 - 2)(-43 - 26v + 43) + (0 - 3 + 1)(3 - 3 - v). -50v Expand (-2k + 2k - k2 + (-2k - 2 + 2)(k - 3 + 3) + (0k*2 + 0k2 - k2)(4 - 5 + 2))(0 + 1 + 4). -20k2 Expand (-7 + 1 - 3)(4z5 - 6z5 + z5). 9z5 Expand (-2n3 - n3 + 4n3)(0n + 3n + 0n) - n2 + n2 - n4 - n3. 2n4 - n3 Expand (-4n + 2n + n)(-2 + 7 - 2) - n - 2n + n + n - 3n + 5n. -2n Expand (2p + 3p - 2p)(7p + p + 0p). 24p*2 Expand (2q - 7q - q)(0q2 - 2q2 + q2) + 2q2 - 2q2 + q3 + 2 - 2 - q*3 + (0q3 - q3 + 0q3)(-3 + 5 - 1). 5q3 Expand (-1 + 1 - 1)(-5 - 8q + 11 + 6q). 2q - 6 Expand (-3 - 2 + 4)(n*2 - 2n + 2n) + 2n*2 + 0n + 0n + (-3n + 7n + 0n)(-n + 7n + 2n). 33n*2 Expand -2p*3 + 2p*4 + 2p*3 + (p - 3p - p)(3p*2 - 3p*2 - 3p*2)(4p + 4p - 6p). 20p4 Expand (g4 + g*4 - 3g*4)(-5g + 10 - 10). 5g*5 Expand (-3 + 4 - 3)(-19o + 14o + 117o). -224o Expand (-q - 6q + 5q)(1 - 17 + 6 - 15). 50q Expand (-d - 2 + 2)(-46d*3 + 10d3 - d3). 37d4 Expand (-3 + 3 - 2)(-3v + v + 3v) - 12v + 5v + 8v - 1. -v - 1 Expand (-n - 3n + 2n)(-3n3 + 3n*3 - 2n*3) + (5n*2 + 7 - 7)(49n - 49n - 8n2) + 2n*4 - 3n*2 + 3n*2. -34n*4 Expand -5w*3 + 13 - 13 + 0w*3 + 3w*3 - 9w*3 + (2w2 + w2 - 2w2)(	{ "pile_set_name": "DM Mathematics" }
om {p: 2, i: 12, h: 4, o: 2}? 8/95 Two letters picked without replacement from wcjwjwjwwwgjhjgwjjfj. What is prob of picking 1 h and 1 w? 7/190 Four letters picked without replacement from uhphgkkughpgk. What is prob of picking 1 h, 1 u, 1 g, and 1 p? 36/715 Calculate prob of picking 2 a when two letters picked without replacement from wdywwaaaaayyydwwaw. 5/51 Three letters picked without replacement from orbhhnbanban. Give prob of picking 2 h and 1 a. 1/110 Calculate prob of picking 2 u and 1 g when three letters picked without replacement from {u: 16, g: 4}. 8/19 Two letters picked without replacement from kkffkkf. Give prob of picking 2 k. 2/7 What is prob of picking 4 i when four letters picked without replacement from {i: 7, g: 2}? 5/18 Three letters picked without replacement from {g: 6, m: 1, u: 4, j: 4, r: 1}. Give prob of picking 1 g, 1 j, and 1 u. 6/35 Calculate prob of picking 2 c when two letters picked without replacement from {x: 7, c: 2}. 1/36 Calculate prob of picking 2 r, 1 m, and 1 w when four letters picked without replacement from {n: 1, a: 1, r: 2, w: 2, m: 1}. 2/35 What is prob of picking 3 j when three letters picked without replacement from {y: 5, j: 13}? 143/408 Calculate prob of picking 1 m and 1 g when two letters picked without replacement from {m: 1, s: 2, g: 1}. 1/6 Three letters picked without replacement from mlmmlmm. Give prob of picking 2 m and 1 l. 4/7 Two letters picked without replacement from {o: 10, q: 1, h: 7}. Give prob of picking 1 o and 1 q. 10/153 What is prob of picking 2 p, 1 i, and 1 k when four letters picked without replacement from fpppizckcpcccpicz? 1/119 Two letters picked without replacement from {q: 3, x: 3}. Give prob of picking 2 x. 1/5 Four letters picked without replacement from {k: 10, x: 4, e: 3, s: 2}. Give prob of picking 2 s, 1 k, and 1 e. 5/646 Four letters picked without replacement from pggggggpg. What is prob of picking 4 g? 5/18 Three letters picked without replacement from zqttkttzzfkw. What is prob of picking 1 f, 1 t, and 1 z? 3/55 Calculate prob of picking 1 u and 1 e when two letters picked without replacement from zueeheuzzhuki. 3/26 Two letters picked without replacement from hjjjyyhlyjjihhy. What is prob of picking 1 y and 1 l? 4/105 Three letters picked without replacement from hvnohhvvzhno. Give prob of picking 2 n and 1 v. 3/220 Four letters picked without replacement from jcjocccjmj. Give prob of picking 1 o, 2 c, and 1 m. 1/35 Calculate prob of picking 1 u and 1 g when two letters picked without replacement from {u: 1, n: 1, m: 1, g: 1, y: 3}. 1/21 Three letters picked without replacement from {s: 1, h: 2, x: 1, y: 2, z: 1, r: 2}. What is prob of picking 1 z, 1 y, and 1 s? 1/42 What is prob of picking 2 m and 1 z when three letters picked without replacement from ssjzmjmmsjsmmss? 2/91 What is prob of picking 3 t when three letters picked without replacement from {t: 6}? 1 Four letters picked without replacement from aanaaaaaaaaaa. What is prob of picking 3 a and 1 n? 4/13 What is prob of picking 1 v and 1 x when two letters picked without replacement from {a: 1, p: 1, s: 1, x: 1, y: 2, v: 1}? 1/21 Calculate prob of picking 1 f and 1 v when two letters picked without replacement from yggfvfc. 2/21 What is prob of picking 3 e when three letters picked without replacement from eeeeeeeee? 1 What is prob of picking 2 z when two letters picked without replacement from {n: 6, z: 2, v: 10}? 1/153 Calculate prob of picking 1 i, 2 d, and 1 l when four letters picked without replacement from pprliddi. 1/35 Calculate prob of picking 1 w and 2 x when three letters picked without replacement from uwfwwwfxuwuuuxuxuwu. 6/323 Three letters picked without replacement from pppppbapppp. What is prob of picking 2 p and 1 b? 12/55 Three letters picked without replacement from ygrrrmrc. Give prob of picking 1 m, 1 y, and 1 c. 1/56 Four letters picked without replacement from dyeeeygdduy. What is prob of picking 1 e, 1 g, 1 d, and 1 u? 3/110 Four letters picked without replacement from {y: 8, n: 5, j: 4}. What is prob of picking 2 y and 2 j? 6/85 What is prob of picking 1 o and 2 b when three letters picked without replacement from koccbb? 1/20 What is prob of picking 1 k and 1 o when two letters picked without replacement from wlkco? 1/10 Calculate prob of picking 2 k when two letters picked without replacement from pkkpookkk. 5/18 Calculate prob of picking 1 v and 1 u when two letters picked without replacement from gggvvvvvugvuj. 2/13 Four letters picked without replacement from {w: 13, i: 5}. Give prob of picking 4 w. 143/612 Calculate prob of picking 1 l and 1 o when two letters picked without replacement from {p: 1, o: 2, u: 5, k: 1, h: 6, l: 2}. 1/34 Four letters picked without replacement from zrrzzzrrzr. Give prob of picking 4 z. 1/42 Three letters picked without replacement from {l: 2, w: 3, s: 1, q: 4}. Give prob of picking 1 w and 2 l. 1/40 Calculate prob of picking 2 o and 2 f when four letters picked without replacement from {o: 3, f: 3, e: 9, q: 1, w: 1, r: 2}. 3/1292 What is prob of picking 2 r when two letters picked without replacement from {x: 1, n: 1, y: 1, r: 2, o: 2}? 1/21 Calculate prob of picking 1 j and 1 z when two letters picked without replacement from jkkjkzjrkk. 1/15 Three letters picked without replacement from {w: 6, h: 1, v: 2, s: 1, x: 8}. Give prob of picking 2 v and 1 x. 1/102 Two letters picked without replacement from cccccceecc. What is prob of picking 1 e and 1 c? 16/45 Four letters picked without replacement from {c: 2, w: 1, r: 3, j: 4, a: 4, h: 1}. What is prob of picking 1 c, 2 r, and 1 j? 8/455 What is prob of picking 2 x when two letters picked without replacement from {b: 9, x: 2}? 1/55 Calculate prob of picking 3 z when three letters picked without replacement from {h: 2, z: 5, f: 2}. 5/42 Calculate prob of picking 1 b and 2 g when three letters picked without replacement from {v: 2, b: 7, f: 5, g: 4}. 7/136 Calculate prob of picking 1 l, 1 m, 1 b, and 1 w when four letters picked without replacement from wblmmlwmb. 4/21 Three letters picked without replacement from {m: 1, v: 3, y: 2, k: 3, w: 1, n: 1}. Give prob of picking 1 v and 2 y. 1/55 Two letters picked without replacement from dddssd. Give prob of picking 2 d. 2/5 Three letters picked without replacement from {c: 1, l: 11, y: 1}. What is prob of picking 2 l and 1 c? 5/26 Three letters picked without replacement from {y: 2, n: 4, h: 2}. What is prob of picking 2 n and 1 h? 3/14 What is prob of picking 2 i when two letters picked without replacement from lliiliillilili? 3/13 Two letters picked without replacement from tmttmttmttttttttttm. What is prob of picking 1 m and 1 t? 20/57 Two letters picked without replacement from nnnnnsns. Give prob of picking 1 n and 1 s. 3/7 Three letters picked without replacement from {u: 1, d: 7, q: 2, y: 3, h: 1}. Give prob of picking 1 y, 1 d, and 1 h. 3/52 Two letters picked without replacement from {f: 2, h: 2, e: 2, a: 2}. What is prob of picking 1 e and 1 a? 1/7 Calculate prob of picking 4 f when four letters picked without replacement from {s: 2, n: 2, f: 9, a: 1}. 18/143 Two letters picked without replacement from {p: 3, q: 5, y: 3, x: 1, o: 3}. What is prob of picking 1 y and 1 p? 3/35 Four letters picked without replacement from {o: 2, b: 7, x: 5, j: 3, p: 1}. Give prob of picking 1 b and 3 j. 7/3060 Calculate prob of picking 1 i, 1 e, and 2 l when four letters picked without replacement from delilueuulellldlele. 35/969 Two letters picked without replacement from {g: 4, b: 10, r: 1, t: 3}. Give prob of picking 2 t. 1/51 Two letters picked without replacement from cciggganagaz. Give prob of picking 1 c and 1 a. 1/11 Calculate prob of picking 1 g and 1 e when two letters picked without replacement from egeegeeeggegeegeege. 28/57 Three letters picked without replacement from bbbbbbbbb. What is prob of picking 3 b? 1 Three letters picked without replacement from {c: 11, b: 3}. What is prob of picking 3 c? 165/364 Calculate prob of picking 2 j when two letters picked without replacement from {j: 2, g: 2, d: 2}. 1/15 Two letters picked without replacement from {z: 4, x: 4, a: 1, f: 1}. What is prob of picking 1 z and 1 a? 4/45 Calculate prob o	{ "pile_set_name": "DM Mathematics" }
506. -7002.0506 Subtract -0.101 from 4142727.5. 4142727.601 Put together -30789 and -214.5. -31003.5 What is 851.5 minus -609723? 610574.5 Sum -10.1772012 and -0.044. -10.2212012 What is 0.4 less than -8433804? -8433804.4 Sum 1.69 and -18225675. -18225673.31 Work out -0.412830603 - 1.3. -1.712830603 What is 83.29 take away -0.20512? 83.49512 What is 2 plus 468.6966? 470.6966 What is -181822 + -600? -182422 What is -4302 less than 133602? 137904 What is -18754 + -583.2? -19337.2 Total of -6.136475871 and -2. -8.136475871 Sum -587286277 and -0.4. -587286277.4 Subtract -3 from -388677936. -388677933 What is 3844915 less than -258.57? -3845173.57 Work out -4.509 - 91487. -91491.509 What is the difference between 399717 and 107? 399610 What is the difference between -2337537 and -0.5? 2337536.5 What is -0.2 + -1622749? -1622749.2 Calculate 4106597 - -26. 4106623 Work out 8 - -7382342. 7382350 What is -0.2473993 - 0.0312? -0.2785993 What is 24400181 plus -23? 24400158 Subtract 0.27 from 0.92881284. 0.65881284 What is -1268 - -60843? 59575 What is 19213 + -936095? -916882 Work out -80.3364 + 0.1805. -80.1559 Put together 1068468 and 142. 1068610 Total of 2.31725 and 69.258. 71.57525 -1029 - 0.001189437 -1029.001189437 Work out -6840.8986921 - 2. -6842.8986921 What is the distance between 3 and 7010226? 7010223 1230+719796 721026 Work out -17.254328 - -0.01. -17.244328 What is 94726034705 plus 2? 94726034707 What is -519623 take away 0.000809? -519623.000809 What is the distance between -6 and 0.6011? 6.6011 Subtract 11488 from -9333. -20821 0.3 + -1223431631 -1223431630.7 Put together 72 and -1252650. -1252578 Work out -46.1 + -206952. -206998.1 What is 14.134 less than 12838? 12823.866 Total of -3 and -28890.368. -28893.368 What is the difference between 0.3330262 and -51145? 51145.3330262 What is 36 - -33938322? 33938358 Sum -4 and -1131.74165. -1135.74165 What is -695302468 less than -0.4? 695302467.6 Sum -0.2635 and 135415. 135414.7365 What is -0.05 + -932.1769? -932.2269 What is -654.9496 minus 102? -756.9496 What is -0.0288 take away -31327914? 31327913.9712 Subtract 105 from -20134.3. -20239.3 Work out 2.216819271 - 4. -1.783180729 What is -4 + -796766173? -796766177 Sum -68.164 and 205. 136.836 9.021981+-9118 -9108.978019 8268.6957 + 323 8591.6957 What is the difference between 15789.64 and 0.01? 15789.63 Work out 5 + 0.07297149723. 5.07297149723 What is 0.1 - -185162066? 185162066.1 Add together 620803.4 and 342. 621145.4 What is -51 plus -19.9811843? -70.9811843 Put together 1 and 24142310. 24142311 Put together 1816382334 and -1. 1816382333 What is 1800.556 take away -18.67? 1819.226 What is -2831570912 plus -0.4? -2831570912.4 Add -0.409533 and -0.5. -0.909533 Calculate -5293.326 - 10105. -15398.326 Work out -2216 + -18749. -20965 Add -92.95 and 68.89. -24.06 What is 0.0877929 plus -4234? -4233.9122071 What is the distance between 0.38787757 and -3.3? 3.68787757 What is the distance between 0.51718437 and 1.37? 0.85281563 Add 33240473 and -11. 33240462 Put together 30 and 208804404. 208804434 Subtract 0.3733445 from 0.31. -0.0633445 Work out 10.6 + -3117368. -3117357.4 -0.1+6371809011 6371809010.9 What is -9965463 less than -54.7? 9965408.3 Work out -0.26 - 668581. -668581.26 What is 0.4 + -46.487475? -46.087475 -2.121306+-136 -138.121306 Add -0.0498 and -948.6. -948.6498 Calculate -0.912 - -573804. 573803.088 What is -8 minus -6372912? 6372904 Work out -0.08 - -0.20775876. 0.12775876 336526 + -0.0273 336525.9727 Total of 951897 and 73. 951970 Total of 394326 and -1929.7. 392396.3 Subtract -46.2 from -4437039. -4436992.8 What is 0.37863 less than 82881? 82880.62137 What is 25102 less than 0.0363? -25101.9637 Calculate 0.006 + -4344813. -4344812.994 What is -1419332 take away 62? -1419394 Put together -0.2 and -15035461. -15035461.2 Work out 0.2 + -127938735. -127938734.8 Work out 191 + 4632.56. 4823.56 What is 0.26727 - -1.111? 1.37827 Calculate -1028156107 - -57. -1028156050 Calculate 153 + 102.89606. 255.89606 Calculate -175227726 - 0.29. -175227726.29 What is 338 plus -7200.36? -6862.36 Put together -0.177 and 21182730. 21182729.823 -4900503 - -2 -4900501 Subtract -3.319567611 from 11. 14.319567611 -71660122 + 2 -71660120 Work out -0.622 - -1889867. 1889866.378 What is 8459407244 plus 0.16? 8459407244.16 What is 287610740 minus 0.2? 287610739.8 Work out 202255 - -666. 202921 Add 349 and 12660510. 12660859 What is -1 less than -1.9064833? -0.9064833 What is -96380 less than 458528? 554908 What is -16 plus -0.009571268? -16.009571268 What is 100945.47 take away -0.1? 100945.57 What is 16 less than -46.3148129? -62.3148129 What is -2 take away 244569.44? -244571.44 What is 217381 minus 0.42351? 217380.57649 Work out -0.177501 + -0.37. -0.547501 What is 0.16 take away 169412437? -169412436.84 What is -41309.3 - 2.54? -41311.84 134963 - -1.9422 134964.9422 -21 + 155468 155447 Add 107666.05 and 4836. 112502.05 What is -0.15 + -30345.84? -30345.99 Add together -91903 and -53. -91956 Put together 1202510.4 and 2. 1202512.4 19 - 180837551 -180837532 What is 0.2 minus -24619.2281? 24619.4281 -3234248 - 125.6 -3234373.6 Subtract 0 from 12187.48853. 12187.48853 Subtract 73.241 from 142.2. 68.959 6269652 + 9 6269661 Add together -0.040583 and 5.88. 5.839417 What is the distance between -5753223974 and 0.3? 5753223974.3 59832 - -0.075 59832.075 9 - -2858601.414 2858610.414 -5119.9638 + -0.1 -5120.0638 Put together -0.44 and -119549.3. -119549.74 Sum 0.03204294 and 0.048. 0.08004294 -0.91 - 2472007 -2472007.91 Calculate -463 + -891678. -892141 What is -0.4055 take away -86561.9? 86561.4945 Sum -512450 and 1608. -510842 What is the distance between -1.4 and -743826? 743824.6 What is the distance between 133897593 and -0.1? 133897593.1 Work out 1253 + 1275.85. 2528.85 What is 41 take away -7.030941? 48.030941 Add together -693442 and -7.28. -693449.28 Put together 0.984 and -84582051. -84582050.016 What is the difference between -5 and 3650664? 3650669 What is -365492.513 - -0.12? -365492.393 0.3 + 289535.405 289535.705 What is -14 minus 0.314306735? -14.314306735 Calculate 313 + 898951. 899264 Put together 1310.343 and -25. 1285.343 What is -5374.27 take away 0.5? -5374.77 What is the distance between 0.095 and -5972.867? 5972.962 Calculate 943412742 + 5. 943412747 Work out -201.170867 + 0.2. -200.970867 -0.3 + -5545.827 -5546.127 What is the distance between 31737 and -0.027119? 31737.027119 -31575037 - 0.3 -31575037.3 What is -2 + -222150162.01? -222150164.01 Work out 2.863 + 2.0485. 4.9115 412 - 82042.2 -81630.2 Calculate -5 - -10179683289. 10179683284 What is the distance between 1.24783 and -2526? 2527.24783 What is the distance between 21295269 and -293? 21295562 Calculate 186986879 - -277. 186987156 What is the distance between 1.59 and 436735? 436733.41 What is -771.432 + -55? -826.432 What is 5 take away 42354904? -42354899 Put together -5431401 and -3529. -5434930 What is -3 minus -362.2912? 359.2912 Put together -0.02 and 1816007.284. 1816007.264 Add -1.981 and -318609. -318610.981 What is -9 plus -0.0014866905? -9.0014866905 What is -33624 take away -617? -33007 Subtract -0.97 from -115.3334. -114.3634 Work out 0.01 - 20329379. -20329378.99 What is 109360986290 + 3? 109360986293 Put together -1128716627 and 0.1. -1128716626.9 Work out -19.85 + 0.2516846. -19.5983154 116.543317 + 0.2 116.743317 What is -1.48 minus 23427627? -23427628.48 What is the difference between 314925 and 13232? 301693 Work out 7 + -45972111. -45972104 -2.47728359+-1 -3.47728359 What is the distance between -5.3752 and 0.322? 5.6972 Work out 260094531 + 1. 260094532 Calculate -1940 - 2531812. -2533752 -1.72028555 - -12.6 10.87971445 What is 0.053376 take away -34255.6? 34255.653376 2+-4574946 -4574944 Calculate -400685 - -15.7. -400669.3 What is -0.04923081 take away -0.144? 0.09476919 Calculate 507480 + 107235. 614715 What is the difference between -199771401 and -0.2? 199771400.8 What is -394.262016 take away -2.5? -391.762016 Calculate 0.0212596 + 0.36409. 0.3853496 Add 0.2 and -17961887121. -17961887120.8 What is the distance between -73 and 717745? 717818 Subtract 12 from 190856. 190844 Total of 0 and -16286152. -16286152 Subtract 0.3 from 35949843.177. 3594	{ "pile_set_name": "DM Mathematics" }
)))*2. -56sqrt(2)/11 + 2034/121 Simplify (4-1sqrt(132) + sqrt(132) + 4sqrt(132)2)/(-4(sqrt(12) + -1sqrt(1200) + sqrt(1200) + sqrt(12))). -5sqrt(11)/8 Simplify 3 + 3 + ((-1 + sqrt(99)1 + -5)1)2. -36sqrt(11) + 141 Simplify ((-2sqrt(520))/sqrt(10)6)/(-5(sqrt(4) - (sqrt(4) - sqrt(8)/sqrt(2))) + sqrt(4) + (-1sqrt(196) - sqrt(196) - sqrt(196)))4. 48sqrt(13)/25 Simplify (5 + -2 + sqrt(13) + sqrt(13) - (sqrt(13) + 6(sqrt(13) + -2)))2 + 4(2 + (sqrt(13) - (sqrt(39)/sqrt(3) + 3)) + sqrt(13)). -146sqrt(13) + 546 Simplify 5 + 2(-5 + sqrt(72)/sqrt(6))-33. -36sqrt(3) + 95 Simplify -6(-5 + ((3sqrt(208))/(sqrt(8)/(sqrt(2)2) + sqrt(4)))*2). -1218 Simplify ((sqrt(135) - (sqrt(135) - (sqrt(135) + -43sqrt(135) - sqrt(135)) - sqrt(135)))/((sqrt(3) + -3sqrt(108))1))2. 5445/289 Simplify ((-5 + 2 + sqrt(11))4)*2 + -2(sqrt(11) + 2)*21. -104sqrt(11) + 290 Simplify -4(sqrt(153) + (1 + sqrt(153))*2 + sqrt(153) + -2 + sqrt(153)) + sqrt(272)3 + ((sqrt(2448) + 1)*2 - sqrt(2448)). -36sqrt(17) + 1841 Simplify 3((sqrt(539) - -2(1 + sqrt(539) + sqrt(539))) + -6(1sqrt(539))*2). -9696 + 105sqrt(11) Simplify (-1(2(0 + sqrt(2299) + sqrt(2299)) + (sqrt(2299)1 + 0 - sqrt(2299))))2-2. -73568 Simplify ((1 + sqrt(272) + sqrt(272) + 0 + sqrt(272))4 - (-1 + 3sqrt(272) + -1))*2. 432sqrt(17) + 22068 Simplify ((sqrt(33) + (3sqrt(297))/sqrt(9))/((sqrt(132)3)/sqrt(12)))*2. 16/3 Simplify 3(-5 + (sqrt(13) - sqrt(156)/(sqrt(12)-1) - (1 + sqrt(1573))))2. 324sqrt(13) + 3267 Simplify (sqrt(180)11 - (-6(2 + sqrt(180)))2)-5. 4290sqrt(5) + 33120 Simplify (2(sqrt(21)/sqrt(3)4 + 5)3)*2. 1440sqrt(7) + 4932 Simplify ((2sqrt(270) - sqrt(270))/sqrt(10) + sqrt(27) + (sqrt(27) + sqrt(27)2 + sqrt(27) - sqrt(27)) + -2)*25. -300sqrt(3) + 3395 Simplify 3(-1(sqrt(396) + 3) + sqrt(99)/(52sqrt(9) - sqrt(9))). -53sqrt(11)/3 - 9 Simplify ((4 + 6(sqrt(13) + 0 + 2 + (sqrt(104) + sqrt(104) + sqrt(104)-4 + sqrt(104))/sqrt(8) + sqrt(13)))-2)2. 768sqrt(13) + 2896 Simplify -1 + -1 + 2 + 4(sqrt(112) + 1)2. 8 + 32sqrt(7) Simplify -4((sqrt(176) + 1)6 + 5(sqrt(176) - sqrt(176)-2))2. -310608 - 4032sqrt(11) Simplify (((sqrt(117) + (sqrt(117) - sqrt(117)1) + sqrt(117))5 - sqrt(117))/sqrt(9)1 + 5)-1. -9sqrt(13) - 5 Simplify ((sqrt(112)5)/sqrt(4) + (sqrt(847) + 4 + -2sqrt(847) + sqrt(847))2)5. 80 + 50sqrt(7) Simplify -2((1 + sqrt(700))-4)2 + 4. -22428 - 640sqrt(7) Simplify (-5(sqrt(51)/sqrt(3)-4 - -3sqrt(17)4)4)2. 435200 Simplify 6(-3-2sqrt(684)6)2 + 1. 5318785 Simplify -4(5 + sqrt(243)2 + ((0 + sqrt(3) + -1)2 + sqrt(3))3). -60sqrt(3) - 68 Simplify 3-6(4 + (sqrt(1900) + -1 + 2)2). -34290 - 360sqrt(19) Simplify (5(3 + (sqrt(6050) - 5((-1sqrt(6050) + sqrt(6050) - sqrt(6050)) + sqrt(6050))) + 3))2. 16500sqrt(2) + 152150 Simplify (5 + -1sqrt(7))4 - ((sqrt(70)-5 - sqrt(70))/sqrt(10) - sqrt(7))5. 20 + 31sqrt(7) Simplify ((sqrt(80) + 3 + (sqrt(80) + (sqrt(80) + sqrt(80)2 + sqrt(80) + sqrt(80) - sqrt(80)) + sqrt(80) + sqrt(80) - sqrt(80)))2-3 + 2)*2. 5376sqrt(5) + 141376 Simplify ((sqrt(567)4)/(sqrt(9) - (sqrt(90)-1)/sqrt(10)))*2 - 35sqrt(252). -90sqrt(7) + 252 Simplify (sqrt(84) + (sqrt(84) - (sqrt(84) - (sqrt(84) + sqrt(84) + sqrt(84)4)6)))/(sqrt(48)/sqrt(4)5)4. 148sqrt(7)/5 Simplify (4sqrt(2448) + -4 + -5)*26. -5184sqrt(17) + 235494 Simplify (-3sqrt(3136)-3)/(sqrt(175) + (sqrt(175) - (sqrt(175) + sqrt(175) + (sqrt(175)-31 + sqrt(175) - sqrt(175)) + sqrt(175)))). 36sqrt(7)/5 Simplify (64((sqrt(156) + -4sqrt(156) + sqrt(156) - sqrt(156))4)/(sqrt(24)/(sqrt(2) - (sqrt(16)/sqrt(8) + sqrt(2)))))*2. 1078272 Simplify ((sqrt(1539) - (sqrt(1539) + -1)) + 2 - ((sqrt(190)-2-5)/sqrt(10))2)-1. 1897 Simplify -1 + (sqrt(84)/sqrt(4))/sqrt(3)3-1. -3sqrt(7) - 1 Simplify ((5sqrt(204)/sqrt(4)4)/(4(sqrt(3) + -5sqrt(6)/sqrt(2))))2. 425/16 Simplify ((sqrt(153)2 + sqrt(153))-2 + sqrt(153) + (sqrt(153) - (-2sqrt(153)-1 + sqrt(153) - sqrt(153)) - sqrt(153)))/((sqrt(729)-2 - sqrt(729))-2). -7sqrt(17)/54 Simplify 3 + sqrt(147) + ((sqrt(147) - (sqrt(147) - (sqrt(147) + 1))) + -2 + sqrt(147))*2 + 4 + sqrt(147)-1 + sqrt(147). -21sqrt(3) + 596 Simplify (-3 + (sqrt(28) + sqrt(112) + -1sqrt(112) + sqrt(112))/(2sqrt(196) - sqrt(196)))2. -18sqrt(7)/7 + 72/7 Simplify (sqrt(5040) - (sqrt(5040) - (sqrt(5040)-2 - sqrt(5040))))/(sqrt(28)/(sqrt(4)-3)). 108sqrt(5) Simplify ((sqrt(14)-1-5)/sqrt(2) - (-1 + (sqrt(7) - (sqrt(14)1)/sqrt(2))))*2-1. -176 - 10sqrt(7) Simplify (sqrt(2299)-1 + sqrt(2299) + 5 + sqrt(2299) - (-4sqrt(38)/sqrt(2) - (1sqrt(19) + 2)))-2. -32sqrt(19) - 14 Simplify -3 + (sqrt(12) + -5)2 - (-4 + (sqrt(192) - (sqrt(192) + (1 + sqrt(192))2))). -4sqrt(3) + 231 Simplify -3((sqrt(112)-3)/sqrt(2))/(sqrt(140)/sqrt(5)). 9sqrt(2) Simplify ((sqrt(112) + 2 - sqrt(7))*2 - (-3 + sqrt(21)/sqrt(3))) + (-3sqrt(1400))/sqrt(8). -4sqrt(7) + 70 Simplify (-1sqrt(1216)-6 + -1)2 + (1sqrt(1216) + sqrt(1216))*2-45. -53503 - 96sqrt(19) Simplify 5 + (sqrt(880)6)/(-2sqrt(180) - sqrt(180)). -4sqrt(11)/3 + 5 Simplify 6(5 + ((sqrt(832)1)2 + 5)-46). -120498 Simplify -6(-2 + -1 + (sqrt(208) - sqrt(13))) - (-6sqrt(143)-1)/(sqrt(121)/(sqrt(22)/sqrt(2))). -24sqrt(13) + 18 Simplify (((4-1sqrt(396) - (4sqrt(396) + 0 - sqrt(396))) + 0)6)2. 698544 Simplify ((sqrt(66)1-63)/((sqrt(726) - (sqrt(726)1 - sqrt(726) - sqrt(726) - sqrt(726))) + sqrt(72)/sqrt(3)))2. 3564/1225 Simplify (sqrt(304) + -1 + sqrt(304) + -4)2 + -2 + (5 + sqrt(304)1 - sqrt(304) - sqrt(304) - 4((1 + sqrt(304))2 - sqrt(304))). -100sqrt(19) + 24 Simplify 6(2 + ((sqrt(102)1)/sqrt(6))*2 + 3). 132 Simplify -3 + (1(4(sqrt(13) + -3 + sqrt(13)) + sqrt(13) + sqrt(13) + sqrt(637)2 + sqrt(637)))*2. -744sqrt(13) + 12634 Simplify ((sqrt(108) + 0)6 + (sqrt(108) - (sqrt(108) + 1))4)*2. -288sqrt(3) + 3904 Simplify (-5-2(sqrt(343) + -2sqrt(343))6)*24. 4939200 Simplify (-2 + sqrt(432) + -2 + -4 + sqrt(432) - (4 + 4sqrt(432)1))*2. 576sqrt(3) + 1872 Simplify (sqrt(99) - 5sqrt(99)2 - (sqrt(1100) - (sqrt(1100) + sqrt(1100) + sqrt(1100) + 2sqrt(1100) + sqrt(1100)))6)1. 273sqrt(11) Simplify 6(-4(sqrt(162) + 1) - -3(sqrt(162) + -2))2. 1080sqrt(2) + 1572 Simplify (sqrt(360)/(sqrt(48)/(2sqrt(4))))/(-3sqrt(1000)-1 + sqrt(1000) - sqrt(1000))5. sqrt(3)/3 Simplify ((sqrt(288)/sqrt(6))*2 - sqrt(12)/sqrt(64)) + 0. -sqrt(3)/4 + 48 Simplify (((sqrt(77) + sqrt(77)-1)-6 + 1sqrt(77)-1)/(sqrt(22)/(-5sqrt(288))))*2. 25200 Simplify 1 + (sqrt(85)/sqrt(5)6)*2 - (sqrt(85) - (sqrt(85) - -1sqrt(85)1))/sqrt(5). sqrt(17) + 613 Simplify (4 + -5((sqrt(468) + -2 - sqrt(468)) + -4 + 0 + 5))*2. 81 Simplify 5(-4 + -2 + 1(sqrt(704) - (-1 + sqrt(704))) + -1)2. 180 Simplify (2sqrt(21)1 + (sqrt(21) - 2sqrt(21))-3)/(sqrt(567)-21). -5sqrt(3)/18 Simplify (2 + sqrt(405))-4 + sqrt(15)/(sqrt(147) - sqrt(147)-4). -1259sqrt(5)/35 - 8 Simplify 2 + (3 + -6(sqrt(567) + 2) + sqrt(567) + -1)*2. 900sqrt(7) + 14277 Simplify -2 + sqrt(72)1 + sqrt(72) + sqrt(162) + -1 + sqrt(4)/sqrt(2)-3 + 2. -1 + 18sqrt(2) Simplify (5 + (3 + 2 + sqrt(343)-2 - (-1sqrt(343)-5 - sqrt(343) - sqrt(343))-3))2. 980sqrt(7) + 16907 Simplify (sqrt(360)/sqrt(36))/sqrt(8) - ((sqrt(315) + (sqrt(315) + (sqrt(315) - (sqrt(315) + sqrt(315)1) - sqrt(315)) - sqrt(315)))/sqrt(9))/sqrt(7). 3sqrt(5)/2 Simplify (2 + (sqrt(147)2)2 + 0)-11. -590 Simplify -4(-6(2sqrt(475))*2 + sqrt(475)) - (sqrt(475)3 + 5)1. -35sqrt(19) + 45595 Simplify (sqrt(34)/sqrt(72) + (sqrt(68) + -2 - sqrt(68)) + 4)*2. 2sqrt(17)/3 + 161/36 Simplify 1 + ((-1sqrt(150))/sqrt(3))/(-2sqrt(250) + sqrt(250)). sqrt(5)/5 + 1 Simplify ((-5 + 0 + 0 + (sqrt(832) - sqrt(832)-5))-5)*2. -12000sqrt(13) + 749425 Simplify (sqrt(3564) - (62sqrt(3564) - sqrt(3564)))/(sqrt(20)/sqrt(80) - (sqrt(4) + -2sqrt(144) + sqrt(144))). -120sqrt(11)/7 Simplify (-3sqrt(3645)4)/(sqrt(18)/sqrt(2)64). -9sqrt(5)/2 Simplify (2 + sqrt(65)/(sqrt(20)1))1. sqrt(13)/2 + 2 Simplify -3((sqrt(7)-4 + sqrt(7) - sqrt(7))6 - ((sqrt(7) + 1)6)2). 288sqrt(7) + 864 Simplify 1 + (sqrt(95)2-2 + sqrt(95) + sqrt(95) + sqrt(95))/(sqrt(5)	{ "pile_set_name": "DM Mathematics" }
cking 1 d and 1 h? 1/18 Calculate prob of picking 2 n and 1 g when three letters picked without replacement from {g: 1, n: 2, a: 1}. 1/4 Calculate prob of picking 2 h, 1 t, and 1 l when four letters picked without replacement from {h: 3, l: 1, s: 1, i: 1, t: 1}. 3/35 Three letters picked without replacement from {x: 3, a: 4, d: 3, b: 1, t: 5, z: 4}. What is prob of picking 1 d and 2 x? 3/380 Three letters picked without replacement from llpppphoophlllppopl. What is prob of picking 2 l and 1 p? 40/323 Calculate prob of picking 1 f and 3 v when four letters picked without replacement from vfvvx. 1/5 Three letters picked without replacement from mmhmmwhhwhowm. Give prob of picking 1 w and 2 m. 15/143 What is prob of picking 2 k, 1 g, and 1 w when four letters picked without replacement from rkwgwk? 2/15 Two letters picked without replacement from ovlok. What is prob of picking 1 o and 1 l? 1/5 Two letters picked without replacement from ooaffjjdddadj. Give prob of picking 2 d. 1/13 Four letters picked without replacement from ppssllspssslppppsss. What is prob of picking 2 l and 2 p? 21/1292 What is prob of picking 2 k and 2 l when four letters picked without replacement from {k: 3, m: 4, d: 1, l: 2}? 1/70 Four letters picked without replacement from wwqqowqoqw. Give prob of picking 3 q and 1 w. 8/105 Three letters picked without replacement from attuu. Give prob of picking 1 t, 1 u, and 1 a. 2/5 Three letters picked without replacement from yjnyynnuydhjdhdjyyd. What is prob of picking 1 y, 1 n, and 1 d? 24/323 Two letters picked without replacement from {b: 2, g: 3, e: 4, d: 8}. What is prob of picking 2 d? 7/34 Calculate prob of picking 2 s and 1 m when three letters picked without replacement from msmsss. 3/5 Two letters picked without replacement from rbyvrynyorv. What is prob of picking 2 r? 3/55 Calculate prob of picking 3 l when three letters picked without replacement from mlmlmll. 4/35 What is prob of picking 1 p, 2 c, and 1 r when four letters picked without replacement from {r: 4, q: 1, m: 2, c: 4, p: 3, s: 3}? 18/595 Calculate prob of picking 2 m when two letters picked without replacement from {x: 5, m: 2}. 1/21 What is prob of picking 1 t, 1 b, and 1 k when three letters picked without replacement from {r: 4, q: 2, b: 1, t: 1, k: 1}? 1/84 What is prob of picking 1 v, 1 f, and 1 s when three letters picked without replacement from {f: 2, s: 1, c: 9, v: 2}? 1/91 Two letters picked without replacement from {a: 1, u: 2, h: 1, t: 1, c: 1, z: 1}. What is prob of picking 1 c and 1 t? 1/21 Four letters picked without replacement from uvuujtvvtvtjttvjt. Give prob of picking 2 j, 1 t, and 1 v. 9/238 Two letters picked without replacement from llllll. Give prob of picking 2 l. 1 Calculate prob of picking 1 f, 2 a, and 1 x when four letters picked without replacement from xfoaaxx. 3/35 Four letters picked without replacement from ylyylryyfjfyyylytyf. Give prob of picking 3 f and 1 t. 1/3876 Two letters picked without replacement from {m: 4, l: 3, w: 4, j: 4}. Give prob of picking 2 w. 2/35 Four letters picked without replacement from {n: 4, s: 2}. Give prob of picking 4 n. 1/15 Calculate prob of picking 1 p and 3 z when four letters picked without replacement from bbzzbllpbzplzbplbbb. 1/323 Three letters picked without replacement from {u: 1, o: 4, n: 1, v: 1, w: 2}. What is prob of picking 2 w and 1 n? 1/84 Two letters picked without replacement from mmajjnmmjm. Give prob of picking 1 n and 1 j. 1/15 Calculate prob of picking 2 y and 1 k when three letters picked without replacement from acyckykkkcykkay. 36/455 Four letters picked without replacement from zoozooozozzooo. What is prob of picking 4 o? 18/143 Four letters picked without replacement from {x: 10}. What is prob of picking 4 x? 1 What is prob of picking 1 d and 3 b when four letters picked without replacement from hbbbhdddddbhhdbddh? 4/153 Three letters picked without replacement from {b: 1, r: 1, p: 5, q: 4, x: 3, a: 1}. What is prob of picking 1 x, 1 p, and 1 b? 3/91 What is prob of picking 4 p when four letters picked without replacement from ppppp? 1 Calculate prob of picking 2 f when two letters picked without replacement from kggftf. 1/15 Three letters picked without replacement from tjcjccajjjtztjczt. Give prob of picking 1 a and 2 c. 3/340 Calculate prob of picking 2 p when two letters picked without replacement from {y: 1, p: 2, n: 1}. 1/6 Calculate prob of picking 2 z when two letters picked without replacement from zoyocyozcycyzooyzyy. 2/57 What is prob of picking 1 r and 2 w when three letters picked without replacement from {x: 9, w: 3, r: 4}? 3/140 Four letters picked without replacement from zzzzaazzzzzzzzzzzz. What is prob of picking 4 z? 91/153 Calculate prob of picking 1 r, 1 b, and 2 w when four letters picked without replacement from beeewweeeewewrweww. 7/1020 Calculate prob of picking 1 v and 2 d when three letters picked without replacement from aavvdvaadvaaava. 1/91 Two letters picked without replacement from {i: 2, d: 7, a: 4, c: 3, j: 1}. What is prob of picking 2 a? 3/68 Two letters picked without replacement from lugukkn. What is prob of picking 2 u? 1/21 What is prob of picking 1 b and 1 i when two letters picked without replacement from qkrkrqkaikkqbr? 1/91 Two letters picked without replacement from qql. What is prob of picking 2 q? 1/3 Calculate prob of picking 2 r when two letters picked without replacement from riirirriii. 2/15 Two letters picked without replacement from tlsiissltlsst. Give prob of picking 1 t and 1 s. 5/26 Calculate prob of picking 1 x and 1 o when two letters picked without replacement from ttmootxttq. 2/45 What is prob of picking 1 k, 2 o, and 1 f when four letters picked without replacement from {l: 4, o: 2, f: 1, w: 1, k: 1}? 1/126 Two letters picked without replacement from nvnvnvzsvnvn. What is prob of picking 1 s and 1 z? 1/66 Three letters picked without replacement from {w: 7, l: 5}. What is prob of picking 2 l and 1 w? 7/22 What is prob of picking 2 q and 1 l when three letters picked without replacement from {l: 3, q: 4}? 18/35 Calculate prob of picking 1 q, 1 o, and 1 x when three letters picked without replacement from {s: 4, o: 1, q: 4, a: 1, x: 1, k: 1}. 1/55 Three letters picked without replacement from mymm. What is prob of picking 1 y and 2 m? 3/4 Three letters picked without replacement from {b: 1, n: 1, u: 2, l: 1, r: 2, c: 2}. Give prob of picking 1 b and 2 c. 1/84 What is prob of picking 4 r when four letters picked without replacement from {u: 1, w: 4, r: 7, m: 1}? 7/143 Two letters picked without replacement from gxuff. What is prob of picking 1 x and 1 g? 1/10 Three letters picked without replacement from {c: 5}. What is prob of picking 3 c? 1 Calculate prob of picking 1 c and 2 a when three letters picked without replacement from axrrarscaxcrrrx. 6/455 Two letters picked without replacement from ggssssgggsgggggggg. What is prob of picking 2 g? 26/51 Calculate prob of picking 2 z when two letters picked without replacement from ddzdvzddvdddddkd. 1/120 What is prob of picking 1 x, 1 a, and 1 i when three letters picked without replacement from xiaodadoooiooaa? 8/455 Three letters picked without replacement from aiaiiaiiijaiii. Give prob of picking 2 a and 1 i. 27/182 What is prob of picking 1 k and 1 m when two letters picked without replacement from {u: 3, q: 2, f: 2, k: 1, m: 3, n: 1}? 1/22 Calculate prob of picking 1 l and 1 a when two letters picked without replacement from olmaiimoamti. 1/33 Three letters picked without replacement from bzbzzzbzzzzzzzzzzz. Give prob of picking 3 b. 1/816 Four letters picked without replacement from flttptbbpcfbfttccccf. What is prob of picking 2 t, 1 f, and 1 l? 8/969 What is prob of picking 1 t and 1 k when two letters picked without replacement from kkvvttkvvkvvt? 2/13 What is prob of picking 2 c when two letters picked without replacement from ccccccncnc? 28/45 What is prob of picking 2 p, 1 l, and 1 h when four letters picked without replacement from polollleelllllhllpl? 1/323 Calculate prob of picking 2 c when two letters picked without replacement from ffzffcczzfff. 1/66 Calculate prob of picking 2 c, 1 l, and 1 n when four letters picked without replacement fro	{ "pile_set_name": "DM Mathematics" }
z(-6). Suppose -w = -3p + 828. Is p a prime number? False Let c(a) be the first derivative of 60a*2 + a + 97. Suppose 2b = 2t, 0 = 3b - 0b - t - 8. Is c(b) composite? True Let z be (129 + 4)/(1 + 0). Let c = 189 - z. Let b = 357 + c. Is b a prime number? False Let m = 42 + -36. Suppose 328 = h + m. Suppose h = -4d + 1226. Is d composite? True Let i = 310 + -176. Is i composite? True Is 5 + (-9 + -13)/((-2)/72) a prime number? True Suppose -113 + 5 = -2j. Suppose -h + 5n = -18, 0h - 3n = -3h + j. Is (-27)/h - 1498/(-4) a composite number? False Let l(j) be the second derivative of -j5/20 - 2j4/3 + j3/3 + j*2 + 2j. Let m be l(-8). Is -211337/m prime? True Let m(i) = -i*3 + 21i*2 - 28i + 1. Let j be -4 - (-3 + -3) - -17. Is m(j) a prime number? True Let s be (17 + 4)(-21)/(-9). Let o be (-16)/(-7) - 14/s. Is (o/6)/((-2)/(-1074)) prime? True Let w(h) = 523h - 36. Is w(5) composite? False Suppose 0 = 3h - 5i - 29164, 4h + 2i - 19464 = 2h. Suppose -5p - 4y = 237 - 12370, 4p - 4y - h = 0. Is p prime? False Let y(t) = 18t + 5. Let f be y(5). Let l = f - -107. Is l a prime number? False Suppose 15k - 6 = 12k. Is (-1)/(1/k - 898/1788) a prime number? False Let v(f) = 5f2 + 6f - 41. Let s(r) = -4r2 - 6r + 40. Let m(l) = 6s(l) + 5v(l). Is m(18) a composite number? False Suppose -5t + 3h + 3053 = -4t, -2t + 6126 = -h. Is t a composite number? True Suppose -3j + 436 = -2m, -2m + 730 = 5j + 14. Let t = j + 163. Is t a prime number? True Let q = 10 - 18. Let n be 1980/q(0 - 2). Suppose 4b - 253 - n = 0. Is b prime? False Suppose 6g - 11 - 13 = 0. Suppose b = -1 - 0. Is 0 + (b - -196 - g) a prime number? True Suppose -x + 18 = -1. Let l(n) = 3n + 28. Is l(x) prime? False Let u(y) = 12y - 6. Let o be u(-13). Let t = 167 - o. Is t a composite number? True Let y be 9/(-6)-2 - 1. Suppose -h + m + 2m = -83, h - 63 = -ym. Is h prime? True Suppose 3y = 4i - 25, -4y = -i + 3 - 0. Suppose -10t + it + 801 = 0. Is t a composite number? True Let z = 78 - 76. Suppose 2m = -4d + 4562, m - zd - 1203 = 1074. Is m prime? False Let j(v) = -5v - 1. Let d be j(-1). Let r(w) = w3 - w2 - 4w + 3. Let t be r(d). Is 594/10 + (-14)/t prime? True Let i(w) = -59w + 5. Let f(p) = 2p + 16. Let s be f(-12). Let m = 6 + s. Is i(m) prime? False Suppose -r - r = -y - 5, -r = 5y - 30. Suppose -3h = rd + 72 - 334, 321 = 4h + d. Is h composite? False Let n(k) be the first derivative of -57k2/2 + 7k + 17. Is n(-4) prime? False Suppose -9v = -4v - 32525. Is v prime? False Let a be (1 - 4) + 1975 + 5. Suppose 0 = -v + 4j + 1975, -v + a = -2j - 0j. Is v a prime number? True Let l(c) = 3c*3 - 5c*2 + 3c - 3. Let w be l(3). Let j = w + -7. Is j a prime number? False Let m(g) = g*3 - 3g*2 - 4g + 2. Let o be m(4). Let n(x) = -3x - x + 30 + 9x*o - 28. Is n(3) a prime number? True Let w(n) = 380n*2 - 2n + 3. Let q be w(2). Suppose 0 = -7o + 14o - q. Is o prime? False Let l = -19 + 23. Suppose -5m = -f + lf - 926, -1538 = -5f - 3m. Is f a prime number? True Suppose -t - 5f = -13, 2t - 4f + 4 = f. Suppose ts + 2s - 153 = -m, 5s = 20. Is m a prime number? False Let l(a) = 3a3 + 3a*2 + 2a + 1. Let x be l(-2). Let v = -13 - x. Let u = 6 - v. Is u composite? True Let h = 59092 - 11303. Is h a prime number? False Let h(p) be the second derivative of -p*5/20 - 7p*4/6 - 3p3 - p2 - 13p. Is h(-15) a composite number? True Let x(u) = -155u + 5. Let r be x(-6). Suppose r = -18o + 23o. Is o prime? False Let l = -4380 + 12049. Is l composite? False Suppose 33 = -0j - 3j - 3l, -3l - 49 = 4j. Let q = -12 - j. Suppose -138 - 170 = -qf. Is f a prime number? False Suppose -2x + 2666 = 2d, -d = -5d + x + 5352. Is d a composite number? True Let i(h) = 44h + 2. Let d(n) = n*3 - 11n*2 + 12n - 12. Let m be d(10). Suppose -7u + mu = 3. Is i(u) a composite number? True Let h be (-4)/5 - 3612/(-15). Suppose 0 = 2a - 444 - h. Let z = a + -53. Is z composite? True Suppose 2v - 4m = 7426, -53v - 3m - 3716 = -54v. Is v composite? True Let m be 18/(-15)70/(-3). Suppose -l - 2l + 5q = m, 4l = -q - 22. Is (-260)/l + 2/(-6) a prime number? True Let z = 2 + 0. Let g = 58 - 72. Is gz/(-4)127 a composite number? True Is ((-30)/20)/((-6)/4)10417 a prime number? False Let a(g) = -2. Let h(j) = -j2 - 2j - 8. Let f(q) = 4a(q) - h(q). Let z(m) = -m3 + 4m*2 - m + 1. Let i be z(4). Is f(i) a composite number? False Suppose 0 = -5a + 5z - 6355, -5a + 2z - 1275 = 5077. Let u = -777 - a. Is u composite? True Let d = 644 + -1758. Let i = 2178 + d. Let x = i + -267. Is x a composite number? False Let i be (-3 - 0/4)/(-1). Is (i + -4 + 38)5 prime? False Suppose -3v - 3 = -51. Is (-2)/v + (-3257)/(-8) a composite number? True Is (12-11249)/(-3) - 9 prime? True Let l be 3/(9/2258)6/(-4). Let x = l - -1596. Is x prime? True Let s(g) = -76g*2 - 2g - 1. Let h be s(-2). Let z = 450 + h. Is z prime? True Suppose -3r + 0r + 1863 = 3z, z = 2r + 612. Let g = z - -483. Let x = -754 + g. Is x a prime number? True Suppose 3g - 45 = -3t, -6g - 2t = -5g - 19. Suppose 5j - g = 9. Suppose -jr + 51 = -41. Is r a prime number? True Suppose 0y - k = 2y - 9, -k = -1. Suppose -yo = -6o + 74. Is o a composite number? False Let w = -8425 + 12368. Is w composite? False Let q = 11 + -8. Let b = q - 1. Suppose -202 = -p + c + 248, bc = -p + 447. Is p composite? False Suppose -6x + 9140 + 592 = 0. Is 2/4x - -4 a prime number? False Suppose -2w - 2q = 16, w + 3q = -0q - 16. Let u be w/(-14) + (-66)/(-14). Is (185/u)/(2/14) composite? True Is -30 - -5149 - 6/1 composite? False Suppose -d - 2w + 10 = -w, 15 = 3w. Suppose 2542 = y - dl, 3y - 2l - 10078 = -y. Is y composite? True Let u(y) = 12 + 50y - 37 - 30 - 12. Is u(15) a prime number? True Let l = -128 - -462. Suppose 54a - 58a = -560. Let r = l - a. Is r prime? False Let k be (2 + 3)/((-2)/(-2)). Let f(l) be the third derivative of l*5/15 - 5l4/24 + l3/3 - 3l2. Is f(k) a composite number? True Suppose -3o - 7511 = -4v + 3v, -2o = 5v - 37487. Is v a composite number? False Suppose -9v + 10653 = -50889. Suppose 6o - v = -544. Is o a composite number? False Let p = 3091 + 12402. Is p a composite number? False Suppose -5t + 2w = -3320, t = -4w + 2w + 652. Is t a composite number? True Let s(n) = -31n3 + 3n*2 - 3. Suppose j + 6 = 4t, 5j + 12 - 2 = 0. Let o(f) = f3 - f2 + 1. Let r(i) = ts(i) + 2o(i). Is r(-2) a composite number? True Let g(b) = b2 - b + 2. Let x be g(2). Let m be (0 + 4)(-5)/(-10). Suppose 0 = xi - 4 + 24, -2c - mi = -84. Is c composite? False Let w(g) = 2891g - 894. Is w(5) composite? True Suppose -17l + 37542 = -11l. Is l prime? True Let o = -11699 + 18696. Is o prime? True Is 201/(21/(-455)-5) a composite number? True Suppose 0 = -4l + l - c - 28, -2l - c = 18. Is 993/5 - 4/l composite? False Suppose -12c + 8c = -28. Let p(o) = 6o*2 - 4o + 6. Let k be p(c). Suppose 134 = 2y - k. Is y prime? False Let w(m) = 25m*2 + 55m - 601. Is w(21) composite? False Let a be -31 + -5 + 4 + -3. Let t = 90 + a. Is t a prime number? False Suppose 5a - 36988 = 28u - 27u, a + 2u - 7391 = 0. Is a a composite number? True Let r = -7331 + 16918. Is r prime? True Let a = -372 - -549. Is a composite? True Let s = 32 - -1. Let y = 42 + -31. Is 6/s + 2264/y prime? False Let d(j) = 2j + 8. Let i be d(-6). Let z be 230(-2)/i-1. Let b = z - -824. Is b prime? True Let s(q) = 3445q - 202. Is s(5) composite? True Let b(h) = h*3 - 2 + 53h*2 - 60h*2 + 7h - h + 5. Let c be b(6). Suppose 0 = 2u + u - ct - 255, -u = -4t - 85. Is u composite? True Let o(r) be the first derivative of r3/3 + 15r*2/2 + 3r - 3. Let y be o(-15). Is 3/((-42)/15 + y) composite? True Suppose -11 - 9 = -4l, k = -3l + 17. Is (29 - 6/(-2)) + (-2)/k prime? True Suppose 5r - 18448 = -3w + 33490, -17311 = -w - 2r. Is w composite? False Let l be (-1)/4 + 0 + 1229/4. Let i(y) = -8y*3 + 3y*2 - y - 2. Let g be i(2). Let o = l + g. Is o a prime number? True Suppose -f - 3f = 8. Let x(j) be the first derivative of 32j3/3 + 3j*2/2 + 5j - 10. Is x(f) composite? False Let c(q) = 17*q - 2	{ "pile_set_name": "DM Mathematics" }
n when two letters picked without replacement from nnnnnnn. 1 Three letters picked without replacement from ooioaoaiao. Give prob of picking 3 o. 1/12 Four letters picked without replacement from {x: 2, s: 6, b: 2, h: 1, f: 1}. Give prob of picking 2 s and 2 x. 1/33 What is prob of picking 1 y and 1 b when two letters picked without replacement from {b: 6, y: 5, l: 1, r: 5}? 15/68 Calculate prob of picking 2 s and 2 o when four letters picked without replacement from ssosoosssossosoosss. 231/646 Three letters picked without replacement from gggggggkggggggggggkg. What is prob of picking 3 g? 68/95 Two letters picked without replacement from {k: 6, d: 1, e: 4, x: 5}. Give prob of picking 1 x and 1 e. 1/6 Three letters picked without replacement from {a: 14, k: 5}. Give prob of picking 2 a and 1 k. 455/969 Three letters picked without replacement from {k: 2, d: 3, u: 3, w: 7, z: 1, j: 2}. Give prob of picking 3 u. 1/816 Calculate prob of picking 2 q and 2 k when four letters picked without replacement from {k: 2, q: 6}. 3/14 Calculate prob of picking 1 a, 1 w, and 2 y when four letters picked without replacement from wyyfaiywwyzy. 2/33 Calculate prob of picking 3 w and 1 p when four letters picked without replacement from ppwwwwpppppppppwpp. 13/306 Three letters picked without replacement from {v: 7, i: 3, j: 7, d: 3}. Give prob of picking 2 d and 1 i. 3/380 Four letters picked without replacement from mkmkmkkk. What is prob of picking 4 k? 1/14 Three letters picked without replacement from {x: 5, w: 5}. Give prob of picking 3 w. 1/12 Calculate prob of picking 3 o and 1 s when four letters picked without replacement from {e: 1, o: 3, s: 1, t: 2}. 1/35 Three letters picked without replacement from {w: 3, l: 2, g: 1, s: 3, h: 1, i: 1}. What is prob of picking 2 l and 1 s? 1/55 What is prob of picking 1 d and 1 n when two letters picked without replacement from qqnnddncqcctt? 1/13 Three letters picked without replacement from {l: 5, r: 3}. What is prob of picking 3 r? 1/56 What is prob of picking 1 x and 1 f when two letters picked without replacement from {u: 2, f: 2, x: 2, t: 3, j: 1, z: 2}? 2/33 Three letters picked without replacement from cbcycbcybbbbbchbcb. What is prob of picking 2 b and 1 h? 3/68 Three letters picked without replacement from {o: 5, h: 7}. What is prob of picking 1 o and 2 h? 21/44 Four letters picked without replacement from {f: 2, t: 10, w: 6}. Give prob of picking 4 w. 1/204 Two letters picked without replacement from mqvvuqnz. Give prob of picking 1 u and 1 q. 1/14 Calculate prob of picking 1 t and 1 n when two letters picked without replacement from {j: 2, r: 1, o: 1, t: 5, n: 3}. 5/22 What is prob of picking 2 t when two letters picked without replacement from ccctxxccctxc? 1/66 Calculate prob of picking 1 w, 1 q, and 1 t when three letters picked without replacement from {q: 3, p: 2, m: 1, t: 3, i: 2, w: 1}. 9/220 Calculate prob of picking 1 m and 1 k when two letters picked without replacement from {y: 1, m: 1, k: 1}. 1/3 Three letters picked without replacement from dzwzwwgwwdwz. What is prob of picking 3 w? 1/11 Three letters picked without replacement from lllllllx. What is prob of picking 3 l? 5/8 Four letters picked without replacement from {m: 2, u: 5, a: 5}. What is prob of picking 1 u and 3 a? 10/99 Four letters picked without replacement from {h: 6, u: 2, w: 1, i: 3}. What is prob of picking 2 h and 2 u? 1/33 Three letters picked without replacement from tzzccyzzzzezcyceye. Give prob of picking 2 c and 1 e. 3/136 Three letters picked without replacement from hhhhh. Give prob of picking 3 h. 1 Two letters picked without replacement from ppppappppppp. Give prob of picking 1 p and 1 a. 1/6 Calculate prob of picking 3 s and 1 g when four letters picked without replacement from {s: 4, g: 8, z: 4}. 8/455 Four letters picked without replacement from {r: 10, o: 3, v: 1, m: 5, b: 1}. What is prob of picking 1 m, 2 r, and 1 o? 45/323 What is prob of picking 1 s and 1 l when two letters picked without replacement from ysdoyysoolyy? 1/33 Two letters picked without replacement from xxdc. What is prob of picking 2 x? 1/6 Two letters picked without replacement from {p: 1, z: 1, l: 3, h: 4, q: 1, i: 2}. What is prob of picking 2 p? 0 Three letters picked without replacement from rgrgg. Give prob of picking 2 g and 1 r. 3/5 Two letters picked without replacement from yjyreeejeeryeyejee. Give prob of picking 2 j. 1/51 What is prob of picking 2 l when two letters picked without replacement from {l: 7, u: 5}? 7/22 What is prob of picking 1 s and 1 y when two letters picked without replacement from {s: 2, y: 10}? 10/33 Three letters picked without replacement from iiivnnnnvpgnpginn. Give prob of picking 1 p, 1 i, and 1 g. 2/85 Four letters picked without replacement from sssjjjjjsssujojuso. Give prob of picking 4 s. 7/612 Calculate prob of picking 2 s and 1 k when three letters picked without replacement from {s: 13, k: 3, z: 3}. 78/323 Three letters picked without replacement from {e: 4, k: 2, n: 1, p: 1}. What is prob of picking 2 k and 1 p? 1/56 Three letters picked without replacement from qqqq. Give prob of picking 3 q. 1 Calculate prob of picking 2 k and 2 w when four letters picked without replacement from {h: 4, b: 1, w: 3, k: 2}. 1/70 What is prob of picking 4 q when four letters picked without replacement from {g: 4, t: 8, q: 4}? 1/1820 Calculate prob of picking 1 g and 1 b when two letters picked without replacement from xbgbqbgbbxqbnxq. 4/35 What is prob of picking 2 k and 1 g when three letters picked without replacement from {d: 1, t: 6, c: 2, g: 1, o: 7, k: 2}? 1/969 Calculate prob of picking 1 q and 1 f when two letters picked without replacement from {q: 1, b: 6, f: 1, i: 1, d: 5}. 1/91 Four letters picked without replacement from vkmiaavkaa. Give prob of picking 2 i and 2 a. 0 Calculate prob of picking 1 w and 2 c when three letters picked without replacement from {h: 2, q: 1, t: 2, w: 7, r: 2, c: 1}. 0 Four letters picked without replacement from {q: 3, n: 1, s: 11}. Give prob of picking 2 q and 2 s. 11/91 What is prob of picking 3 x and 1 s when four letters picked without replacement from {x: 5, s: 7, v: 1}? 14/143 What is prob of picking 3 h when three letters picked without replacement from {h: 9, q: 2, n: 8}? 28/323 Calculate prob of picking 2 s and 1 t when three letters picked without replacement from ttsslsstststtsssst. 105/272 Two letters picked without replacement from {z: 1, l: 2, u: 1, b: 1}. What is prob of picking 1 u and 1 z? 1/10 Two letters picked without replacement from {x: 2, u: 2, a: 4, j: 1}. What is prob of picking 1 a and 1 j? 1/9 Two letters picked without replacement from zzookpzzklzzzk. Give prob of picking 1 o and 1 k. 6/91 Three letters picked without replacement from zxggdggddxxdeeggzegz. What is prob of picking 2 d and 1 e? 3/190 What is prob of picking 1 l and 1 g when two letters picked without replacement from glvgggzxlvvz? 4/33 Calculate prob of picking 1 f and 1 y when two letters picked without replacement from byfbbybby. 1/12 Three letters picked without replacement from qqjvsjuqjsuj. Give prob of picking 1 q and 2 u. 3/220 What is prob of picking 1 h, 2 m, and 1 p when four letters picked without replacement from {t: 1, h: 5, p: 8, m: 2, c: 3}? 10/969 Three letters picked without replacement from nasyvca. Give prob of picking 1 c, 1 s, and 1 v. 1/35 Calculate prob of picking 1 i and 3 x when four letters picked without replacement from {x: 7, u: 5, i: 1}. 7/143 What is prob of picking 1 i and 1 z when two letters picked without replacement from ttvlzdi? 1/21 Three letters picked without replacement from {p: 1, e: 1, a: 4, t: 4, h: 1, b: 3}. Give prob of picking 2 t and 1 h. 3/182 Two letters picked without replacement from {w: 2, k: 2, h: 6, v: 3, s: 2}. Give prob of picking 1 w and 1 v. 2/35 What is prob of picking 1 c and 1 x when two letters picked without replacement from xcwvwv? 1/15 Four letters picked without replacement from {t: 4, d: 2, x: 1}. What is prob of picking 4 t? 1/35 Three letters picked without replacement from bpuzxixpbxxzuxzbuuzb. What is prob of picking 2 z and 1 p? 1/95 Calculate prob of picking 2 z when two letters picked without replacement f	{ "pile_set_name": "DM Mathematics" }
30 = -80. Solve -9d + y = -23 for d. 5 Let r(y) be the second derivative of 7/6y*3 + 1/12y*4 + 6y + 0 + 2y2. Let i be r(-7). Solve -k = -3 + i for k. -1 Let c be (-11 + -1)(-6)/8. Suppose 5u + 2l - 3 = 0, 5l + 41 = -2u + 17. Solve ug - c = -0g for g. 3 Suppose 4p - 2p + 54 = 0. Let z be (p/(-6))/(1/(-2)). Let o = 9 + z. Solve -c = -oc + 5 for c. -5 Suppose -2z - 15 = -6z + 5y, 4y = 4. Suppose 0 = -4t - n + 35, 5t = 5n + 45 + z. Suppose -2l - t = -19. Solve 0 = lv - 0v for v. 0 Suppose 45b = 1177 + 398. Solve 36y = 29y + b for y. 5 Let w = -64 - -84. Suppose 5h - w + 0 = 0. Solve -hx = -x for x. 0 Suppose 38i = 106 + 312. Solve -14 = k - i for k. -3 Let v(n) = n3 - 10n*2 + 9n + 4. Let m be v(9). Suppose 0 = 2c - m. Suppose -p - cw + w + 2 = 0, -w + 2 = 2p. Solve -y - y - 2 = p for y. -1 Suppose -4o + v + 50 = 0, -o = -6v - 14 - 10. Solve -of = -22 - 38 for f. 5 Let x be -48/3(-18)/12. Solve 0 = xi - 11i for i. 0 Suppose 3i - 3t = 78, -23 = -i + 3t + 13. Solve 0 = iw - 16w + 10 for w. -2 Suppose 0p + 3s - 18 = -3p, 0 = -2p - 3s + 15. Suppose -2 = -2i + i. Suppose 3z = z + io, z = -po + 4. Solve -z - 2 = -l for l. 3 Let r(s) = -5s - 3. Let o be r(3). Let l = -18 - o. Solve 0 = -lj - j - 2 for j. -2 Let d(v) = v*3 + 5v*2 - v - 1. Let c be d(-5). Solve -2z + 6 - c = 0 for z. 1 Suppose 3w + 2w - 25 = 0. Let x be w/(-20) - 18/(-8). Let v(g) = -12g - 108. Let n be v(-9). Solve xu - 10 = -nu for u. 5 Let g be (-25)/5 + (-2 - -2). Let n = g + 10. Solve -3c - 4 = n for c. -3 Suppose 6 = 5z - 14. Let q(w) = -24w*2 - 169w + 8. Let t be q(-7). Solve -zu + u = -t for u. 5 Suppose 6 = -3s - 0s, 58 = 2b + 4s. Let i = b + -30. Solve 5d - 28 = -i for d. 5 Suppose -8c + 11c - 9 = 0. Suppose 2t + 5 = 3t. Solve -4w - c = t for w. -2 Let k(b) = 2b*3 + 9b*2 - 13b + 1. Let w be k(2). Suppose 0 = 23d - wd. Solve dl = 2l + 6 for l. -3 Let l(s) = -s*3 - 8s*2 - 11s - 3. Let k be l(-3). Let b be (-6)/(-45)3 - 219/k. Solve 0n - 5n + b = 0 for n. 3 Let n be -3 - 24/(-20)(-100)/(-15). Solve -5o + 4o = n for o. -5 Let h be ((-10)/4)/((-60)/48). Suppose -hz + 5 = -z. Solve -zr + 1 = 6 for r. -1 Suppose 10 = -5i, 3i = 5p - 121 - 55. Solve 10 = 8d + p for d. -3 Suppose 0 = -3g - 5f + 9, -2 = g - 3f - 5. Let x be (-3)/(-4) + (-35)/(-28). Let d be (7 - 4) + 0 + x. Solve -di + g = 23 for i. -4 Let l be 3010/40 + 1/(-4). Suppose 3j - 29 + 98 = 2n, 2n = 5j + l. Let r be n - -2(-4)/(-8). Solve 6 - r = -5t for t. 5 Let f be (-18)/(-15)(-805)/(-46). Solve 10u - 1 = -f for u. -2 Suppose -t - 6t - 133 = 0. Let v = t + 31. Solve 3i = v - 0 for i. 4 Let q be (6/9)/((-8)/276). Let h = -16 - q. Suppose 0 = -3i + h + 14. Solve 4t - i = 9 for t. 4 Let c(b) = -b*3 - 8b*2 - 7b + 3. Let d be c(-7). Let r = 0 + d. Solve -rn + 6 = 18 for n. -4 Suppose -22k + 26k = 76. Suppose 3o - k = 4y + 20, 5o - 3y = 65. Let q be 7/4 - 2/(-8). Solve 3s = -q - o for s. -5 Let h = -13 - -43. Let j = -21 + h. Let z(c) = c*3 + 3c*2 - c + 2. Let g be z(-3). Solve gb - j = 16 for b. 5 Let h = 4 - -52. Suppose -2g + 38 = -2c + g, -4c - h = -g. Let w = 17 + c. Solve -t = -wt + 9 for t. 3 Suppose -4a + 4 = -4g, -4g + a + 4 + 1 = 0. Suppose 15 = -5m - 5s, 3m + 2s = -5 - 2. Let u be (m/g)/(4/(-48)). Solve -3t + u = -3 for t. 3 Suppose 3x - 22 = -2o, -2x - o - 3o + 28 = 0. Suppose 5s = 3v - 1 + 17, 4v + 8 = xs. Suppose -6 = -4f + vj + 3, -5j = -5. Solve 2y - y = -f for y. -3 Let x(a) = a*3 + 8a*2 + 8a + 5. Let y be x(-7). Let t(u) = 2u2 + 3u + 1. Let b be t(y). Solve 0 = -bo + o + 10 for o. 5 Let r(o) = -4 - 21 + 6 - 13 + 5o. Let p be r(7). Solve -10 = -2m - pm for m. 2 Let q(b) = -b*3 + 2b*2 + 4b. Let f be q(3). Suppose 42 = 193z - 192z. Suppose -m = -2a + 25, -z = -3a + 3m + f. Solve 0 - a = 2j for j. -5 Let v be (-2)/1 + 15. Suppose -2k - 5c = -vk + 12, 2k + c = 2. Suppose 2b = 2x + 6, -2x - 2b + 12 = -x. Solve -xm = km - 16 for m. 4 Let r = 3 + -4. Let j be 0/(r/((-3)/3)). Suppose -c + 5b = j, -4b + 2b = 2c - 24. Solve -o = -6o - c for o. -2 Suppose h - 2o - 1 = 47, -h = -4o - 40. Let g = -40 + h. Suppose -5d + g + 4 = 0. Solve -6 = 2l + d for l. -5 Let a be (-360)/(-144)36/5. Solve -14h - 12 = -ah for h. 3 Let j be 194/12 + 9/(-54). Let g = 1 - -3. Solve 0 = -gt - j - 0 for t. -4 Let s be (-13)/((-16)/(-12) + -1). Let h = -59 - s. Let a be 84/(-24)h/7. Solve -t + a = t for t. 5 Suppose -10n + 11n - 21 = 0. Let s be (-58)/(-7) + (-6)/n. Solve 5c - 7 = s for c. 3 Let x(c) = -c + 1. Let j be x(-5). Let a be 2(-1 + 0) + j. Let q(n) = -2n*3 + 17n*2 + 12n - 21. Let m be q(9). Solve mw = 2w - a for w. -1 Let y(c) = c*2 + c + 1. Let g(w) = -3w*3 - 5w*2 - 6w - 7. Let s(r) = g(r) + 5y(r). Let d be s(-1). Solve j = dj for j. 0 Suppose 288 = -5v - z, -4z + 240 = -v - 3v. Let k = v + 68. Solve 10c - 5c = -k for c. -2 Suppose x - 4r + 16 = 1, 12 = 3r. Suppose 5u + x + 9 = i, 0 = 2i + 2u + 4. Solve i = -n + 3 - 0 for n. 3 Let x be (-11)/3 - (-3)/(-9). Let t(u) = -u*2 - 5u - 2. Let i be t(x). Solve f + i = -2 for f. -4 Let u(k) = -k*3 + 18k*2 - 54k + 140. Let l be u(15). Solve -lq + 3 = 28 for q. -5 Let o be (-3 + 0)(-3 + 2). Suppose 4z - 3j + 33 = -6j, oz + 61 = 5j. Let h = 14 + z. Solve -hg = -0g for g. 0 Suppose 2c = 4i - 12, -3c + 4c + i = 3. Suppose 0 = -3g - 4m - 3 - 13, -2g - 3m - 10 = c. Let a = 13 + g. Solve 0 = -d - 0d + a for d. 5 Let r be (-4)/(-2 + 0) - (20 + -20). Let n be 1/((-1)/(-13) + 0). Suppose -5l - 2m = -l - 58, n = l + m. Solve rf + 2f + l = 0 for f. -4 Suppose 80 = 5o + 5o. Solve -oh - 5 = -7h for h. -5 Suppose -5w = 1 + 4. Let d(g) = -g3 - 1. Let j be d(w). Suppose -2t - 2 = v - jt, 4v - 2 = -3t. Solve -vk + 6 + 0 = 0 for k. 3 Suppose b - 4j = 3 + 4, 13 = -b - j. Let u(m) = m2 + 9m + 4. Let a be u(b). Suppose -an + 11 = -5. Solve -2i + 6i = n for i. 1 Suppose -27p + 758 = -187. Solve 0 = -pu + 22u + 52 for u. 4 Let a be (-154)/(-8) + (-126)/(-168). Solve -4i - a = i for i. -4 Let b(q) be the first derivative of -q2/2 - 16q - 10. Let x be b(-17). Solve -u = 3 - x for u. -2 Let a be 5 + (3 - 6) - (3 - 5). Solve -b - 12 = -ab for b. 4 Let q(w) = -w3 + 4w*2 + 34w - 10. Let u be q(8). Solve -u = 11t - 14t for t. 2 Let h be ((-644)/(-69))/(4/6). Solve hi = 10i + 8 for i. 2 Suppose 0 = -9m - 606 + 246. Let q be m/(-60) - (-1)/((-6)/(-8)). Solve 3w - 20 = -qw for w. 4 Suppose 5 = -2q - w, 0 = -4w - 29 + 9. Suppose -4b + 14 = 2. Suppose qy - 6 = -by. Solve -yx = 2x + 16 for x. -4 Let w(n) = n*3 + 3n*2 + 2n + 3. Suppose 5y + 25 = 3g, -2g = -y - y - 14. Let a be w(y). Solve -3 = 3i + a for i. -2 Let z = 1317 - 1284. Solve 6 = -13h - z for h. -3 Suppose -a + 2a = 12. Let x be ((-1)/3)/((-2)/a). Suppose -3t = 2k - 10, 2t + xt = -2k + 14. Solve tf - 6 = 6 for f. 3 Let x(f) be the first derivative of f*2/2 + 11f + 1. Let i be x(-6). Let c(v) = v*3 + 14v*2 + 20. Let h be c(-14). Solve 0y + iy = -h for y. -4 Let o(u) = -u - 4. Let t be o(-6). Let k be (-105)/(-24) - (-15)/(-40). Suppose r - 4n + 5 = 0, kn - 3n = -5r + 17. Solve -rb = -b - t for b. 1 Suppose 2h + 2h = -4n - 8, -3h = -n + 6. Let r be (-1)/(-2)((-16)/(-2) - n). Solve -rf - 2 = -14 for f. 3 Let x be 2 + (4 - (3 + -2)). Suppose -xv + 24 = -2v. Solve -v = -i + 5i for i. -2 Let s(a) = -a2 + 3a - 2. Let g be s(3). Let x = 4 + g. Suppose 6r - 7r = -x. Solve 0 = rh - 1 + 9 for h. -4 Suppose z - 19 = -j, -3z + 4z - 43 = 5j. Suppose 4c + 3 = z. Suppose 23 = p + cn, -16 = 2n - 6n. Solve -5v - 2 = p for v. -1 Let f = -344 - -346. Solve 15 = -l - fl for l. -5 Suppose 5x - 2y = -5y + 2, -x - 2y - 1 = 0. Let r = 1 + x. Let m(s) = s*3 + 7s*2 + 5s - 3. Let k be m(-6). Solve -rp + 15 = kp for p. 3 Let b(h) = -h*2 - 25h + 28. Let n be b(-26). Solve 6q - 4q = -n for q. -1 Let r = 100 + -93. Suppose -10x + rx = -9. Solve 0w = -xw for w. 0 Suppose -124 = 3i - 25. Let g = -13 - i. Suppose -6r = -r - g. Solve rs + s = 0 for s. 0 Suppose 0 = -5a - 4 - 1, -2a + 28 = 5v. Suppose -8k = -vk. Sol	{ "pile_set_name": "DM Mathematics" }
True Suppose 92 = 3n - 2n. Is 4 a factor of n? True Suppose -1064 = -3z - 98. Suppose 3t - 3p = 11 + z, 0 = 2t + p - 228. Is t a multiple of 34? False Let q(f) = -f*2 - 8f - 16. Let u = 9 + -20. Let o be q(u). Let j = -22 - o. Is 9 a factor of j? True Let h be 13 - 4/(12/9). Let o = h + 10. Let l = 82 - o. Does 31 divide l? True Let b(v) = 41v2 + 2v - 1. Is b(1) a multiple of 14? True Suppose -17b = -6393 - 220. Is b a multiple of 32? False Suppose 6v = 22v - 9488. Does 35 divide v? False Suppose 0x + 5d + 10 = -2x, 0 = -3x - 2d - 26. Let c = 37 - x. Is 7 a factor of c? False Suppose 3o - 152 = -5d, 0 = 2o - 7d + 3d - 116. Let t(s) = -s2 + 147. Let q be t(0). Suppose 2i + o = 3i - 5p, 2i + 3p = q. Does 28 divide i? False Let x(n) = 3n - 194. Let z be x(20). Let h be -54 + 2 + 1-3. Let v = h - z. Is 16 a factor of v? False Let q = 104 - 100. Let g be (1 + 22/(-10))-120. Suppose ql = l + g. Is 15 a factor of l? False Suppose -1389 + 17979 = 15t. Suppose 8b + 114 = t. Is b a multiple of 13? False Let z(v) = 3v2 + 17v - 17. Let p be z(7). Is p - (0 + 3 + -1) - -1 a multiple of 28? False Suppose -400 = -7c + 111. Is 6 a factor of c? False Suppose -3x + 53b = 58b - 13, 2b = 5x - 63. Is x a multiple of 5? False Let j be 0 + -3 - (-96 + -4). Does 13 divide -21 + j + -17? True Let n(x) = x3 + 5x*2 - 15. Let l be n(-4). Is l + -3 - (-442)/1 a multiple of 43? False Suppose 20y - 17y = 3p - 1515, 2p + 5y - 1003 = 0. Is p a multiple of 84? True Let l = 44 - 42. Suppose -p - 2k + 190 = 3p, -4p + lk = -210. Is p a multiple of 11? False Suppose 694 = 3b - h - 0h, -2b + 456 = h. Let z = 188 - 184. Suppose zn - b = -n. Is 13 a factor of n? False Is (8/(-18))/((-13)/(-78))-576 a multiple of 16? True Suppose 7l - 900 = -200. Does 6 divide l? False Let o = 7 + 261. Suppose 0 = 3f - 5c - 233, 0 = 5f - f + 4c - o. Is f a multiple of 7? False Suppose 2l = 5b - 4b + 32, -2b = -3l + 49. Is 6 a factor of l? False Let o = 265 - 209. Does 14 divide o? True Suppose 2h - 8 = 4j, -4j - 5h = -3h - 8. Suppose 4q = 3o - 1, 4o + 0o - 5q - 2 = j. Is o even? False Suppose 0 = -4i - 6i + 1650. Suppose i = -w + 193. Is w a multiple of 14? True Let w(d) = 2d*2 + 24d - 22. Let t be w(17). Suppose 5v - t + 59 = k, -700 = -4v - 4k. Is v a multiple of 36? True Let o(z) = z - 1. Let i(m) = 5m + 7. Let x(k) = i(k) - 4o(k). Is x(0) even? False Suppose 0n = n + 4. Let h(x) be the first derivative of -x*4/4 - 2x*3/3 + 5x*2/2 - 2x - 27. Is 6 a factor of h(n)? False Suppose -2t - r + 973 = 0, -4t + 457 + 1483 = 4r. Does 5 divide t? False Is 65 a factor of ((-38)/(-4))/(1 + (-744)/752)? False Suppose -2t + 125d - 124d = -7915, 0 = -2t + 5d + 7927. Does 86 divide t? True Suppose 0 = 99t + 163842 - 439854. Is 17 a factor of t? True Let d(a) = -4a*3 - 10a*2 + 7a + 41. Does 26 divide d(-7)? False Suppose 0 = 12h - 18h + 24. Suppose -2g + 84 = hg. Does 5 divide g? False Let p = 31 + -33. Is 22 a factor of ((-1)/p)/(((-2)/(-288))/1)? False Suppose 0 = -3c + c - 8, -5b + c = -1399. Does 31 divide b? True Suppose 4j = 207 + 197. Suppose a = -p - 2p + j, -4p - 4a = -148. Is 6 a factor of p? False Let b = -32 + 36. Suppose bw - 142 - 626 = 2g, 4g + 206 = w. Does 34 divide w? False Let f = -1 - -2. Let b(w) = -50w + 3. Let x(k) = -51k + 2. Let p(v) = 3b(v) - 4x(v). Does 22 divide p(f)? False Suppose -4941 = -22p - 1795. Does 11 divide p? True Let q(z) = -24z - 49. Is 18 a factor of q(-7)? False Let d be ((-2)/(-6))/(1/(-6)). Let z = d + 5. Suppose 0 = zm - m - 102. Is 13 a factor of m? False Suppose -z + 6 = -1. Let c(x) = x + 9. Is c(z) a multiple of 8? True Suppose 9m + 427 - 1606 = 0. Suppose 4q - 489 = m. Is 19 a factor of q? False Suppose -5r = -0r. Suppose r = g + 3g - 24. Suppose 0 = 5t - 2u + g - 76, 0 = 2t + u - 19. Does 10 divide t? False Let w(k) = k*2 - k - 1. Let y be w(-2). Suppose -66 = 8v - yv. Let g = v + 34. Is 3 a factor of g? True Suppose 0 = 4y + 3u - 483 - 21, -3y - 5u + 378 = 0. Is 5 a factor of y? False Let b be -24((-8)/3)/(-4). Let l = 32 + b. Let i = -6 + l. Is 4 a factor of i? False Let k = 1606 - 778. Is k a multiple of 43? False Suppose -2o - 780 = -17o. Is o a multiple of 52? True Let u(a) = -4a3 + a2 + a - 1. Let t be 2/(5(-8)/(-20)). Let r be u(t). Does 2 divide r + 86/4? False Does 16 divide 232 + (2 - (-8)/(-2))? False Let m(u) = 11u - 39. Suppose s + s + y = 31, -5s - 2y = -77. Is m(s) a multiple of 7? True Let r(h) = 3h2 - 5h + 15. Let l be r(-6). Suppose -70 = -q + 5s + l, 2q = 2s + 430. Is 26 a factor of q? False Is (-5)/((-5)/184) + -4 a multiple of 30? True Let o be 7/2(-3 - -1). Let k be o/14 + 26/4. Suppose 5m = -2b + 118, 2b - 70 = 3m - km. Does 9 divide m? False Let s = 607 - 336. Is 10 a factor of s? False Let s(i) = i2 + 2i + 11. Does 7 divide s(-6)? True Let t be (-6)/(-18)(-57)/1. Let x = -7 - t. Does 6 divide x? True Let z = 19 - 17. Suppose 0 = p + zp - 120. Is 16 a factor of p? False Suppose 916j = 922j - 1512. Is j a multiple of 12? True Suppose -o = -6o - o. Let g(h) = -h2 + 2h + 45. Is 22 a factor of g(o)? False Let h = -2650 + 2669. Does 19 divide h? True Suppose 6u = 2u + 16. Suppose -2l = um - 5l - 250, -m = -4l - 56. Is m a multiple of 16? True Let u = 12 + -20. Let j = -4 - u. Suppose jh = 75 - 27. Does 4 divide h? True Let x(q) = q + 1. Let a be x(7). Let t = a - -13. Does 3 divide t? True Does 11 divide ((-10752)/(-60))/((-4)/(-20))? False Let p(f) = 294f + 26. Does 5 divide p(1)? True Let b = 158 + 110. Is 6 a factor of b? False Let y = 14 - 12. Suppose -yb - 3b = -10. Suppose b + 3 = 2u + 3l, 3u = l + 35. Does 2 divide u? True Suppose -3t = 0, -4m + 41 = -2t - 519. Is m a multiple of 70? True Is (-25/(-10))/((-1)/(-90)) a multiple of 11? False Suppose -73j = -21j - 33280. Is j a multiple of 9? False Suppose 3g - v - 35 = 0, -7v + 2v = -5. Let s be (-3)/(4/g - 0). Let u(d) = -4d - 5. Is u(s) a multiple of 13? False Suppose 0 = -2w + 8, o - 4o + 3w = 6. Suppose -ou = -u + 84. Is 7 a factor of (u/15)/(4/(-10))? True Let k(t) = t3 - 4t*2 - t + 7. Let i be k(4). Suppose d + id = -2p + 202, -2p = -10. Is 12 a factor of d? True Let y = 211 - 91. Let d = y - 103. Is 7 a factor of d? False Suppose 2q + x = 14, 3q = -0q + 3x + 3. Suppose -y = -qs + 15, -5y = -3s - 6 + 191. Let v = 62 + y. Does 11 divide v? True Suppose -41a + 45a - 208 = 0. Let s(z) = z + 3. Let f be s(0). Suppose 2w = 3t + t - a, -fw = -5t + 67. Does 11 divide t? True Does 29 divide 1481/3 - (-14)/(-21)? True Let t be (-4 + 0)(-35)/20. Suppose tw - w = 534. Is 10 a factor of w? False Suppose 0 = -3u + 2l + 3, -4l - 3 + 1 = -2u. Let j be u - 2 - (-1)/(-1). Does 11 divide j/6 + 308/6? False Let d be (-39)/264/6. Let u(m) = -10m3 + 3m*2 - 1. Let r be u(-2). Is d - r/(4/(-4)) a multiple of 30? True Suppose 6u - 32 - 34 = 0. Suppose 3t - 218 + 11 = 0. Let d = t - u. Is 29 a factor of d? True Let j(v) = 116v + 8. Let b be j(-16). Let w be (1/(-3))/(14/b). Suppose -4g + w = 2f - 6f, 3f = 4g - 42. Is 2 a factor of g? False Let i(a) = 59a + 167. Does 25 divide i(6)? False Suppose 2683 = 4b - w, -b + 2w = -625 - 51. Is 16 a factor of b? False Let b(x) = -19x + 70. Is 23 a factor of b(-6)? True Let k = 1121 + -671. Is k a multiple of 15? True Let x be (1 - 4)(-10)/15. Suppose q - 4b - x = 51, 0 = 3q + 3b - 99. Suppose -4h + q = -63. Does 11 divide h? False Let t be (66/44)/(2(-3)/(-244)). Let u = t - 53. Does 4 divide u? True Let o(p) be the third derivative of 13p*4/12 + 7p*3/3 + 7p2. Let i be o(5). Let u = 224 - i. Does 15 divide u? False Let f(i) = -i3 - 5i2 - i - 5. Let w be f(-5). Suppose 2j - 18 = -wj. Suppose -j = -u + 6. Does 15 divide u? True Suppose 5d - 3288 = j + 2449, 0 = 5d - 5j - 5745. Does 37 divide d? True Let h(a) = -24a2 - 4a + 1. Let s be h(-3). Is 29 a factor of (s/(-35))/(1/25)? True Suppose -368 = -6s - 10s. Is s a multiple of 23? True Suppose 0n = -2n - 710. Let l = -1018 - n. Is 11 a factor of l/(-15) - (-1)/(-5)? True Let i be (-3)/(-18) - (2 - (-563)/(-6)). Let d = i + -72. Is d	{ "pile_set_name": "DM Mathematics" }
ert -10201 (base 3) to base 6. -244 What is 31 (base 5) in base 9? 17 b (base 12) to base 13 b What is -21102 (base 3) in base 12? -148 Convert -11001 (base 2) to base 13. -1c What is -156 (base 7) in base 12? -76 What is 120 (base 4) in base 11? 22 Convert 42 (base 8) to base 4. 202 Convert -11010 (base 2) to base 3. -222 What is 24 (base 9) in base 2? 10110 What is 110 (base 3) in base 6? 20 Convert 12 (base 5) to base 13. 7 Convert -25 (base 9) to base 11. -21 Convert -105 (base 11) to base 13. -99 Convert 1 (base 12) to base 15. 1 What is 15 (base 6) in base 4? 23 Convert -e (base 16) to base 8. -16 What is -12 (base 6) in base 12? -8 2b (base 15) to base 2 101001 What is -15 (base 6) in base 7? -14 7 (base 14) to base 9 7 6 (base 12) to base 9 6 Convert -1 (base 6) to base 7. -1 6 (base 11) to base 14 6 What is -13 (base 5) in base 10? -8 Convert 4 (base 5) to base 3. 11 What is -9 (base 13) in base 8? -11 What is 101 (base 2) in base 4? 11 Convert 0 (base 16) to base 5. 0 Convert -7 (base 12) to base 13. -7 Convert 10 (base 5) to base 4. 11 45 (base 11) to base 5 144 -29 (base 14) to base 16 -25 7 (base 15) to base 9 7 0 (base 5) to base 3 0 Convert -10 (base 2) to base 16. -2 What is 1 (base 5) in base 14? 1 Convert -5 (base 13) to base 12. -5 -424 (base 10) to base 8 -650 What is 41 (base 5) in base 3? 210 0 (base 3) to base 16 0 Convert c9 (base 15) to base 4. 2331 Convert 7 (base 15) to base 6. 11 22 (base 3) to base 2 1000 What is 4 (base 15) in base 14? 4 1000 (base 2) to base 5 13 -7 (base 15) to base 4 -13 2 (base 12) to base 9 2 Convert 10 (base 3) to base 4. 3 Convert 1 (base 2) to base 12. 1 What is 4c (base 16) in base 3? 2211 What is 6 (base 11) in base 13? 6 What is -14 (base 9) in base 8? -15 -27 (base 9) to base 5 -100 Convert -34 (base 11) to base 6. -101 What is 14 (base 10) in base 8? 16 What is -8 (base 13) in base 10? -8 Convert -72 (base 16) to base 4. -1302 Convert b (base 15) to base 2. 1011 Convert 21 (base 4) to base 14. 9 -11 (base 5) to base 8 -6 Convert 11 (base 5) to base 15. 6 -25 (base 6) to base 11 -16 4 (base 16) to base 9 4 Convert 12 (base 15) to base 10. 17 -32 (base 9) to base 8 -35 Convert 12 (base 11) to base 6. 21 What is 30 (base 4) in base 16? c Convert -ab (base 12) to base 16. -83 Convert -4 (base 9) to base 10. -4 Convert 1000100 (base 2) to base 4. 1010 154 (base 7) to base 4 1120 Convert -34 (base 14) to base 4. -232 Convert 11001 (base 3) to base 13. 85 What is 0 (base 16) in base 12? 0 Convert -10 (base 16) to base 10. -16 What is 5 (base 6) in base 12? 5 What is -3 (base 13) in base 15? -3 Convert 152 (base 12) to base 6. 542 Convert 85 (base 13) to base 15. 74 What is 4 (base 13) in base 10? 4 Convert -13 (base 11) to base 4. -32 -3 (base 4) to base 12 -3 -35 (base 15) to base 13 -3b What is -12 (base 5) in base 12? -7 What is 31 (base 12) in base 15? 27 What is 3 (base 15) in base 10? 3 Convert -71 (base 8) to base 15. -3c Convert -31 (base 8) to base 5. -100 -209 (base 12) to base 15 -14c 564 (base 8) to base 14 1c8 Convert -404 (base 7) to base 9. -242 Convert -54 (base 7) to base 14. -2b 210 (base 8) to base 9 161 -111011 (base 2) to base 4 -323 What is -12 (base 12) in base 7? -20 Convert f (base 16) to base 3. 120 Convert -1 (base 4) to base 13. -1 -37 (base 10) to base 7 -52 What is 22 (base 14) in base 12? 26 Convert -67 (base 15) to base 8. -141 -1c (base 16) to base 3 -1001 Convert 6 (base 12) to base 11. 6 Convert 6 (base 14) to base 15. 6 Convert 58 (base 11) to base 2. 111111 Convert 2 (base 9) to base 6. 2 What is 0 (base 16) in base 9? 0 Convert 49 (base 13) to base 8. 75 -5 (base 7) to base 3 -12 Convert 1a8 (base 11) to base 10. 239 What is 322 (base 4) in base 16? 3a Convert 4 (base 11) to base 8. 4 -11 (base 11) to base 6 -20 Convert -10101 (base 2) to base 10. -21 What is 0 (base 11) in base 16? 0 What is 1 (base 2) in base 3? 1 What is -10221 (base 3) in base 16? -6a -7 (base 15) to base 8 -7 1331 (base 5) to base 10 216 -237 (base 9) to base 6 -524 What is 2a (base 15) in base 16? 28 a5 (base 12) to base 2 1111101 What is 1 (base 14) in base 3? 1 Convert -50 (base 10) to base 8. -62 -1 (base 13) to base 12 -1 Convert -24 (base 10) to base 14. -1a -33 (base 14) to base 7 -63 Convert 2 (base 13) to base 12. 2 What is -8 (base 15) in base 10? -8 Convert -4 (base 7) to base 16. -4 Convert 2 (base 14) to base 2. 10 Convert 111 (base 4) to base 11. 1a 31 (base 5) to base 15 11 Convert -1 (base 9) to base 5. -1 Convert -4 (base 15) to base 3. -11 What is -1 (base 14) in base 10? -1 What is -10020 (base 3) in base 5? -322 -1000 (base 4) to base 7 -121 Convert 32 (base 4) to base 9. 15 Convert 13 (base 7) to base 14. a Convert a (base 11) to base 14. a -40 (base 9) to base 2 -100100 -48 (base 15) to base 5 -233 What is 2 (base 16) in base 13? 2 Convert 11 (base 2) to base 10. 3 -2 (base 7) to base 10 -2 13 (base 6) to base 9 10 Convert -151 (base 6) to base 3. -2111 Convert -2122 (base 3) to base 9. -78 What is 6 (base 8) in base 10? 6 -1 (base 7) to base 5 -1 Convert -104 (base 7) to base 9. -58 1 (base 2) to base 9 1 Convert -16 (base 7) to base 2. -1101 Convert -1 (base 12) to base 9. -1 What is -a (base 12) in base 9? -11 Convert -64 (base 7) to base 6. -114 Convert 416 (base 7) to base 16. d1 Convert 7a (base 15) to base 9. 137 8 (base 13) to base 11 8 What is -1010 (base 2) in base 3? -101 What is -4 (base 5) in base 2? -100 10 (base 8) to base 13 8 What is 133 (base 16) in base 11? 25a -42 (base 12) to base 15 -35 Convert -10 (base 9) to base 11. -9 What is -13 (base 8) in base 14? -b 16 (base 7) to base 3 111 Convert 89 (base 16) to base 8. 211 What is 10000011 (base 2) in base 13? a1 Convert b6 (base 15) to base 7. 333 What is -343 (base 6) in base 12? -b3 What is -135 (base 9) in base 5? -423 Convert 5 (base 8) to base 6. 5 What is -21 (base 16) in base 2? -100001 Convert -2 (base 9) to base 14. -2 What is -63 (base 14) in base 4? -1113 What is 25 (base 15) in base 2? 100011 What is 11 (base 8) in base 12? 9 Convert 15 (base 6) to base 11. 10 What is 114 (base 6) in base 4? 232 What is 1 (base 11) in base 16? 1 1 (base 6) to base 15 1 -11 (base 2) to base 3 -10 11101 (base 2) to base 12 25 What is 142 (base 5) in base 4? 233 Convert 56 (base 16) to base 4. 1112 36 (base 16) to base 7 105 What is -46 (base 8) in base 6? -102 What is -5 (base 13) in base 3? -12 -45 (base 15) to base 4 -1001 -192 (base 15) to base 11 -2aa 3 (base 7) to base 15 3 What is 120 (base 3) in base 6? 23 Convert 5 (base 8) to base 13. 5 Convert 24 (base 9) to base 10. 22 What is 2222 (base 3) in base 9? 88 320 (base 4) to base 5 211 -47 (base 15) to base 10 -67 Convert 1 (base 2) to base 15. 1 What is -32 (base 16) in base 12? -42 9 (base 10) to base 3 100 What is -22 (base 4) in base 11? -a 3 (base 10) to base 15 3 1e (base 16) to base 3 1010 -7 (base 10) to base 7 -10 What is 1c (base 15) in base 7? 36 Convert 110 (base 5) to base 16. 1e 10 (base 5) to base 12 5 Convert -3 (base 14) to base 15. -3 What is -250 (base 7) in base 8? -205 Convert 3 (base 7) to base 12. 3 Convert -223 (base 11) to base 12. -1a3 Convert -4 (base 9) to base 16. -4 What is -6 (base 7) in base 2? -110 Convert -3 (base 13) to base 12. -3 Convert -101022 (base 3) to base 4. -10112 What is 120 (base 3) in base 13? 12 Convert 5 (base 7) to base 13. 5 Convert 37 (base 10) to base 12. 31 What is -1 (base 13) in base 7? -1 33 (base 11) to base 13 2a What is 5 (base 7) in base 10? 5 What is -504 (base 7) in base 3? -100020 Convert -21 (base 15) to base 2. -11111 What is -1 (base 6) in base 15? -1 What is -3 (base 8) in base 13? -3 Convert -9 (base 15) to base 2. -1001 15 (base 6) to base 5 21 -21 (base 16) to base 9 -36 Convert -11 (base 6) to base 3. -21 Convert -230 (base 4) to base 13. -35 What is -3 (base 15) in base 8? -3 -cc (base 16) to base 5 -1304 26 (base 13) to base 2 100000 What is -1 (base 3) in base 13? -1 Convert -b (base 16) to base 15. -b What is 31 (base 7) in base 6? 34 What is 42 (base 8) in base 12? 2a What is 1303 (base 4) in base 8? 163 What is -2222 (base 3) in base 7? -143 103 (base 6) to base 5 124 -34 (base 14) to base 7 -64 What is -4 (base 15) in base 7? -4 Convert 3 (base 10) to base 6. 3	{ "pile_set_name": "DM Mathematics" }
Let w(h) = 25h + 6. Give w(0). 6 Let p(f) = 3f - 11. Calculate p(2). -5 Let x(j) = -j*2 - 64j - 352. What is x(-58)? -4 Let s(m) = -2m3 + 3m*2 + 4m - 1. What is s(3)? -16 Let t(o) = o*2 + 11o - 22. Determine t(2). 4 Let h(b) = -6b2 - b. Determine h(-1). -5 Let t(a) = -12a - 39. Give t(-3). -3 Let x(l) = -2l + 11. Calculate x(6). -1 Let r(i) = i2 - 3i - 6. What is r(11)? 82 Let k(j) = j*2 - 28j + 41. What is k(26)? -11 Let w(l) = -l*2 - 10l - 10. What is w(-8)? 6 Let b(c) = c + 6. Determine b(4). 10 Let c(y) = -y*3 - 8y*2 - 2y - 12. Give c(-8). 4 Let d(k) = 2k + 33. Give d(-9). 15 Let p(u) = 26u - 5. Give p(2). 47 Let g(c) = -c*2 + 11c + 4. Calculate g(8). 28 Let b(w) = w*2 + 13w - 15. Calculate b(-15). 15 Let y(h) = 5h2 - 111h + 29. What is y(22)? 7 Let m(n) = -n*3 + 3n*2 + 4n - 4. Give m(4). -4 Let o(z) = -z*2 + 4z - 4. Give o(5). -9 Let x(a) = -a*2 - 20a - 37. What is x(-15)? 38 Let o(t) = t*2 - 2t - 2. What is o(-5)? 33 Let t(g) = -g*2 - 3g + 45. Calculate t(-8). 5 Let p(i) = -2i + 15. Give p(7). 1 Let q(v) = -v3 - 15v*2 + 16v + 7. Give q(-16). 7 Let h(z) = -4z + 61. Give h(14). 5 Let d(y) = -y + 20. Give d(-6). 26 Let t(w) = 2w*2 + 8w - 11. Calculate t(-7). 31 Let x(q) = -22q - 1. Give x(1). -23 Let x(v) = v3 + 9v*2 + v + 9. What is x(-9)? 0 Let t(h) = -25h - 51. Calculate t(-2). -1 Let u(j) = 5j + 2. Determine u(-2). -8 Let u(d) = 3d*3 - 22d*2 + d + 23. Calculate u(7). -19 Let x(w) = -w - 24. What is x(-6)? -18 Let p(a) = -23a - 2. Determine p(2). -48 Let k(b) = 13b2 - 9. What is k(2)? 43 Let c(j) = 4j3 - j2 - 2j - 3. Determine c(-1). -6 Let q(g) = -5g + 21. What is q(3)? 6 Let o(h) = 6h2 + h + 6. Determine o(0). 6 Let n(x) = 8x - 11. Calculate n(1). -3 Let l(a) = -39a2 + a + 1. Determine l(-1). -39 Let m(k) = -3k + 9. Give m(7). -12 Let w(i) = i*3 - 4i*2 - 6i + 6. Give w(4). -18 Let a(l) = l*3 + 11l*2 + 8l - 20. What is a(-10)? 0 Let k(s) = -12s + 352. Calculate k(29). 4 Let t(x) = -x2 + 2x + 10. Determine t(-3). -5 Let l(f) = 15f + 11. Calculate l(-1). -4 Let f(z) = 14z - 98. What is f(7)? 0 Let b(z) = -2z - 29. Give b(-12). -5 Let r(u) = 2u + 104. What is r(-36)? 32 Let h(f) = 16f - 8. What is h(-1)? -24 Let h(q) = -5q3 + q2 + 5q + 5. Give h(-1). 6 Let r(z) = -z3 + 2z2 + z - 1. Give r(2). 1 Let r(b) = -b3 - b*2 + 5b - 3. Determine r(3). -24 Let a(d) = 3d + 13. Determine a(-2). 7 Let a(v) = -v2 - 5v + 8. Calculate a(-8). -16 Let h(w) = -w*2 + 2w + 6. What is h(-4)? -18 Let f(h) = 2h - 8. Give f(-5). -18 Let y(w) = -w3 + 5w*2 + 35w + 16. Determine y(9). 7 Let h(l) = l - 49. Give h(26). -23 Let z(g) = 8g - 281. Determine z(40). 39 Let f(b) = b3 + b2 + b + 12. What is f(-5)? -93 Let b(a) = a2 - 4a - 4. Determine b(6). 8 Let q(l) = l*2 - 59l + 455. Determine q(50). 5 Let w(g) = g*3 - 2g*2 + g - 1. Determine w(2). 1 Let w(u) = 9u + 308. What is w(-37)? -25 Let j(u) = -2u2 - 8u - 5. Calculate j(-5). -15 Let q(y) = 4y2 + 86y + 44. Give q(-21). 2 Let l(s) = 2s2 - 35s - 101. Calculate l(20). -1 Let a(j) = j - 2. Determine a(-6). -8 Let z(d) = d*2 - 18d + 71. Give z(11). -6 Let f(w) = w + 109. Determine f(32). 141 Let h(i) = 6i2 - 6i - 4. Give h(2). 8 Let s(z) = z*3 - 13z*2 + 12z - 3. Determine s(12). -3 Let g(l) = l*3 + 6l*2 + 16. Give g(-6). 16 Let u(p) = 3p*2 + 94p - 56. Calculate u(-32). 8 Let w(b) = b*3 + 17b*2 + b + 22. Determine w(-17). 5 Let q(y) = 5y*2 - 6y + 7. Give q(3). 34 Let z(u) = 4u2 + 7u - 35. Determine z(-6). 67 Let h(u) = 44u - 78. Calculate h(2). 10 Let m(v) = -3v - 1. What is m(-5)? 14 Let m(d) = 36d + 1. Calculate m(1). 37 Let h(g) = g2 + 13g + 22. Give h(-11). 0 Let m(y) = -y*3 + 22y*2 + 22y + 22. Calculate m(23). -1 Let w(k) = 2k2 + 16k + 20. What is w(-6)? -4 Let x(r) = -r*3 + 24r*2 + 55r - 76. Determine x(26). 2 Let m(g) = -g*3 - 6g2 + 5. Give m(-5). -20 Let o(x) = -x2 + 25x - 9. Determine o(14). 145 Let f(p) = -13p - 167. Give f(-12). -11 Let o(d) = -15d - 79. Calculate o(-9). 56 Let p(b) = b3 + 3b*2 - 3b - 10. What is p(-4)? -14 Let t(w) = -w*2 - 9w - 13. Give t(-7). 1 Let b(d) = d*3 - 6d2 - d + 2. Calculate b(6). -4 Let x(i) = -i3 + 2i2 + 63i + 6. What is x(-7)? 6 Let s(y) = -y*2 + 17y - 33. What is s(9)? 39 Let b(u) = -u - 19. Determine b(-17). -2 Let c(r) = r*3 - 9r*2 + 6r - 2. Give c(8). -18 Let k(r) = -2r3 - 12r*2 - 2r + 9. Calculate k(-6). 21 Let t(w) = 3w2 + 13w - 6. Give t(-5). 4 Let b(g) = -27g2 + 4g + 3. Give b(-1). -28 Let a(r) = r*3 + 5r*2 - 12r - 27. What is a(-6)? 9 Let k(z) = -6z3 - 2z*2 + 6z - 3. Give k(3). -165 Let b(a) = -31a + 279. What is b(9)? 0 Let g(t) = -25t*2 - t - 1. Calculate g(1). -27 Let i(w) = -12w*2 - 4w + 5. Calculate i(1). -11 Let l(d) = 2d - 4. Give l(3). 2 Let n(r) = -15r + 13. What is n(1)? -2 Let j(z) = -7z - 56. Determine j(-9). 7 Let p(s) = -s3 - s2 + 2s - 70. Determine p(0). -70 Let y(r) = -r*2 - 2r. Give y(-3). -3 Let l(z) = -2z2 + 21z - 21. Give l(9). 6 Let z(a) = -a*3 - 6a*2 + 7a + 14. What is z(-5)? -46 Let d(a) = -a*3 - 7a*2 + 6a + 3. What is d(-8)? 19 Let i(y) = 3y2 + 41y + 24. Calculate i(-13). -2 Let w(g) = g*2 - 10g - 41. Give w(11). -30 Let q(i) = -i*3 + 14i*2 - 57i + 24. What is q(7)? -32 Let i(p) = p*3 - 12p*2 + 9p + 4. Give i(11). -18 Let v(w) = 2w2 - 30w - 27. Give v(14). -55 Let f(s) = s*3 + 8s*2 + 6s - 10. Determine f(-7). -3 Let g(c) = 18c3 - 5c*2 + 6c - 3. Calculate g(1). 16 Let m(p) = p*3 + 5p*2 + 2p - 1. Give m(-3). 11 Let i(s) = -s*3 + 2s*2 - 4s + 2. Give i(2). -6 Let k(l) = -l*2 + 3l + 2. What is k(5)? -8 Let c(l) = -94l + 98. Determine c(1). 4 Let l(h) = h2 - 42h - 80. Determine l(44). 8 Let f(i) = -i*2 - 3i + 13. Give f(-5). 3 Let u(k) = -k*3 + 11k*2 - 2k + 18. Give u(11). -4 Let w(r) = r*3 + 3r*2 - 7r - 1. Calculate w(-4). 11 Let s(l) = -6l - 13. Give s(-2). -1 Let x(n) = -n2 + 2. Give x(-4). -14 Let p(g) = 2g*2 - 20g - 6. What is p(11)? 16 Let c(p) = p*2 + 24p - 23. Determine c(-18). -131 Let k(q) = 7q + 58. Calculate k(-10). -12 Let l(r) = -5r - 122. Determine l(-23). -7 Let v(u) = -u + 2. Calculate v(-5). 7 Let n(i) = i*3 - 11i*2 - 82i + 22. What is n(16)? -10 Let o(b) = -2b3 - 3b*2 + 6. Determine o(-3). 33 Let l(g) = 2g*3 + 16g*2 + 6g + 26. Give l(-8). -22 Let m(y) = -y*2 - 6y + 34. Give m(-10). -6 Let d(p) = 2p2 - 13p + 12. What is d(6)? 6 Let p(h) = -h*2 + 5h + 7. Give p(-5). -43 Let y(v) = 7v - 13. Give y(4). 15 Let g(l) = 17l*3 - 4l + 4. Calculate g(1). 17 Let b(y) = 2y2 + 51y - 47. What is b(-26)? -21 Let u(w) = w*3 - 20w*2 + 16w - 46. Calculate u(19). -103 Let f(n) = -3n2 - 4n + 6. Calculate f(-3). -9 Let u(o) = -o*3 - 3o*2 - o - 2. What is u(-2)? -4 Let l(x) = -4x*2 - x - 2. Calculate l(4). -70 Let j(p) = 3p + 89. What is j(-23)? 20 Let c(w) = -w*3 - 5w*2 + 2w - 3. What is c(-6)? 21 Let x(s) = -s - 21. Give x(-23). 2 Let h(t) = t*2 - 6t + 9. Determine h(2). 1 Let w(x) = 3x2 - 4x + 3. What is w(3)? 18 Let y(k) = -2k3 - 15k*2 - 6k + 5. Determine y(-7). -2 Let c(t) = -t + 50. Give c(28). 22 Let j(l) = l*2 - 7l - 16. Give j(-2). 2 Let o(k) = k*2 + 47k - 318. What is o(-53)? 0 Let v(w) = 25w2 + w - 2. What is v(-2)? 96 Let p(k) = 4k - 41. Determine p(13). 11 Let z(o) = -2o2 - 6o - 4. Calculate z(-3). -4 Let c(u) = -u - 43. What is c(-3)? -40 Let s(d) = -4d - 19. Determine s(-13). 33 Let n(q) = -3q*3 - 26q*2 + 11q + 3. Determine n(-9). -15 Let k(r) = 2r + 60. Calculate k(-23). 14 Let z(t) = 15t*3 - 1. Give z(1). 14 Let v(g) = -32g + 86. Determine v(6). -106 Let w(j) = j*2 - 13j - 54. Give w(-4). 14 Let q(x) = -43x. Give q(-1). 43 Let z(f) = -3f - 35. Calculate z(7). -56 Let z(b) = -37b - 3. What is z(-1)? 34 Let c(r) = -2r*2 + 10r - 6. Give c(3). 6 Let q(x) = -3x + 2. What is q(1)? -1 Let d(n) = 5n*2 + 4n - 1. Calculate d(-3). 32 Let q(u) = -2u2 + 23u - 4. Determine q(11). 7 Let y(g) = 10g + 99. Give y(-12). -21 Let d(x) = x - 26. Calculate d(0). -26 Let c(i) = -5i*2 - 2i + 4. Calculate c(2). -20 Let	{ "pile_set_name": "DM Mathematics" }
the least common multiple of 18 and m? 36 Calculate the lowest common multiple of 3 and 6/(-5)105/(-14). 9 Let h be 1(43 + 0 + 0). Let f(y) = -12y - 72. Let p be f(-6). Calculate the common denominator of -67/16 and p/(-3) - h/(-14). 112 What is the common denominator of 76/(-10) - 4/(-8) and (548/48)/(-1 - -2)? 60 Suppose 4x - 4 + 0 = 0. What is the least common multiple of 5 and (0 + x/(-2))-2? 5 Suppose 3o = 18 + 150. Suppose -j + o = 1. Find the common denominator of (-5)/j27-1 and -87/2. 22 Let p(j) = -4j - 2. Let t = -32 + 46. What is the smallest common multiple of p(-2) and t? 42 Let k = 4 - 1. Let g(m) = -m2 + 6m + 2. Let p(t) = -3t2 + 19t + 7. Let s(j) = 7g(j) - 2p(j). Calculate the lowest common multiple of 1 and s(k). 3 Suppose -3h = 2h - 450. What is the common denominator of (-21)/h170/6 and 25/6? 18 Let n = 20287/319 + -706/11. Let g = -33/290 + n. Calculate the common denominator of 2/78/1 and g. 70 Let i be (3 - (0 - -6)) + 221. Suppose -5t + 2 = -i. Let l = t - 26. Calculate the smallest common multiple of l and 22. 198 Let z(a) = a3 + 8a*2 + a + 18. Suppose 1 = -i + 6. What is the least common multiple of i and z(-8)? 10 Let z = 5365/7098 + 335/169. Calculate the common denominator of z and 57/10. 210 Let r be (3/2)/(9/(-12)). Let j be (r - (1 - 2))460. What is the least common multiple of 1 and j/(-110) + (-2)/11? 4 Suppose 156 = 5x + 8x. Calculate the least common multiple of 56 and x. 168 Let w be -10(-3)/(-12)-2. Let z = w + -3. What is the least common multiple of (-10)/(-2 - (2 + -2)) and z? 10 Let d = -947/44 + -30/11. What is the common denominator of 85/2 and d? 4 Let t = -31492/11 + 2859. What is the common denominator of t and 117/40? 440 Suppose 0 = 20q - 19q - 14. What is the smallest common multiple of q and (-3)/((-3)/19) - 1? 126 Let j(k) = -k*2 + 9k - 4. Calculate the least common multiple of j(6) and 12. 84 Let a be 1/(-1(-1)/(-18)). Let q = 3/986 + -19974/2465. Find the common denominator of q and 4/a - (-4326)/(-216). 20 Calculate the least common multiple of 5 and 4/(60/25) - (-1)/3. 10 Let s(y) = y3 + 7y*2 - 7y + 6. Let j be s(-6). Let t(d) = 2d - 4. Let z be t(6). Calculate the common denominator of ((-15)/z)/(39/j) and -1/16. 208 Suppose -6w + 8w = 2. What is the least common multiple of w and 8? 8 What is the common denominator of ((-306)/(-24) + 4)(-2)/31 and 63/10? 310 Suppose -5 = -3q - 2. What is the smallest common multiple of 171/27 - q/3 and 10? 30 Suppose -2a = a - 30. What is the smallest common multiple of 3 and a? 30 Let s(w) = -w*2 - 2w + 16. What is the lowest common multiple of 7 and s(0)? 112 Suppose 6j = 4j + 80. What is the smallest common multiple of 3 and (-6)/5j/(-6)? 24 Let b = 22 + -15. What is the smallest common multiple of 2 and b? 14 Let s = -25224 - -555021/22. Calculate the common denominator of s and -55/52. 572 Let t be 15/108/(-6). Let m = t + 3. Calculate the lowest common multiple of m and 3. 3 Let q be 11/33(0 - -3). Find the common denominator of 4/112-82q and -93/20. 140 Let g be (-7)/(0 - (-33)/39). Let z = g + 1233/44. Find the common denominator of 0 + (-146)/(-16) + 2 and z. 8 Let i = 9 - 8. What is the least common multiple of -7(30/(-21))/i and 2? 10 Let c(b) = b*3 - 2b*2 + 2b - 4. Calculate the smallest common multiple of 136/10 + 1(-16)/(-40) and c(3). 154 Let r be ((-1)/(-1))/(3/(-9)). Let w = -10 - r. Find the common denominator of w/111/18 and -67/8. 72 Let i be (1/(-6))/(4/347192). Let l = i + 15112. Let q = l + -637. What is the common denominator of q and -61/2? 6 Suppose 10 = 2l - 0l. Suppose -3a = -2u + 29, 0u - 2u + a + 19 = 0. What is the least common multiple of u and l? 35 Suppose s + 157 = -g, -31 - 130 = g - 3s. Find the common denominator of (-3)/(-22)g/(-6) and -73/16. 176 Let y(k) = k2 + 8. Let w(f) = -f2 - 10f - 9. Let n be w(-9). What is the lowest common multiple of y(n) and (-17)/(-2) - (-2)/(-4)? 8 Suppose -26 + 116 = 3v. Suppose 2w = 3u + 7, 3w + 5u = -2w + v. Let y(s) = -4s + 1. Calculate the smallest common multiple of y(-2) and w. 45 Let w(d) = -d*3 + 6d*2 - 5d + 2. Suppose -25 = -4u + x - 0x, 0 = 5u - 5x - 20. Calculate the smallest common multiple of w(5) and 13 + (-7)/(u/3). 10 Let n(f) = -2f2 - 13f - 19. Let j be n(-8). Let c = 65 + j. Calculate the lowest common multiple of c and 2. 22 Let x = -5 - 0. Let m be ((-6)/(-6))/((-1)/x). Calculate the lowest common multiple of 16 and m - (2 - 0)/2. 16 Let k(z) = -z*2 + 9z - 5. Let i be k(10). What is the common denominator of 1/(-8)(-438)/i and 39/16? 80 Let g(w) = -7w + 25. Let p be g(-13). Find the common denominator of (p/6)/(-4 - 2) and -34/5. 45 Let u = 7132 + -99767/14. What is the common denominator of u and 71/62? 434 Find the common denominator of -1(-3 - 64/66-4) and -139/12. 132 What is the smallest common multiple of (-1)/(-2) + (-188)/(-8) and 18? 72 Let p = -5797/282 - 60/47. Let f = 6/47 - 559/329. Find the common denominator of p and f. 42 Suppose 0 = -5l - 2 - 8. Let j be 1 - 1/(l/(-10)). Calculate the common denominator of (3/(-30))/(j/890) and -9/16. 16 Calculate the least common multiple of ((-8)/(-12))/(44/(-15) - -3) and 22. 110 Suppose 5r + 4o - 7204 = 34332, 0 = 4r - 5o - 33196. Let i = r - 149575/18. What is the common denominator of (-255)/(-10) - (0/(-6))/(-7) and i? 18 Let y be ((-456)/(-99))/(0 - -14). Let k = -5/21 + y. What is the common denominator of 31/2 and k? 22 Suppose -6 = -2u - u. Suppose 0 = z - 0r - 5r - 12, uz = -r + 13. What is the lowest common multiple of 4 and z? 28 Suppose 4r + 0r + 12 = 0, 2w + r + 5 = 0. Let z = 13 + w. Calculate the lowest common multiple of 4 and z. 12 Suppose 2m - 6 = 0, -4i + 9i - 5m - 45 = 0. What is the lowest common multiple of i and 6? 12 Let o = -10 + 6. Let d = -10 + 21. Let m = o + d. Calculate the smallest common multiple of m and 4. 28 Let h = -4103/48 + 505/6. Calculate the common denominator of (-138)/(-20) - (-6 + 4) and h. 80 Suppose -192 = -7d + 32. Calculate the common denominator of 15/14 and d. 14 Let b = 4/1417 - 99226/12753. What is the common denominator of -99/4 and b? 36 Let w = -3163/4 + 786. Calculate the common denominator of 35/22 and w. 44 Let m be (-612/54)/(4/78). Suppose 4j = 2j + 88. Let g = m + j. What is the least common multiple of 16 and g? 144 Suppose q = -0q + 3h + 28, 3h = -q + 16. Calculate the lowest common multiple of 12 and q. 132 Let s = 9762/7 + -1397. Calculate the common denominator of (142/(-50) + 3)-40 and s. 35 Let f = -7 + 16. What is the smallest common multiple of f and 11? 99 Let w(x) = x*2 + 7x - 7. Let j be w(-11). Suppose 0 - j = -4a - 3k, a - 19 = -4k. Calculate the lowest common multiple of a and 10. 70 Let n = -2631/10 - -1351/5. Find the common denominator of 107/12 and n. 60 Let i = -4 + 1. Calculate the common denominator of 79/8 and (i - -3) + (-39)/2. 8 Let q = -8 + 5. Let b be (-2)/((q/(-758))/3). Find the common denominator of 23/20 and b/440 - 4/(-10). 220 Let x = 114 + -796/7. Let j = 6452/9 - 714. Find the common denominator of j and x. 63 Let d = 11715/8 + -1462. Calculate the common denominator of (1 - 9/10) + 1 and d. 40 Let f = 2851/12 + -230. Calculate the common denominator of 83/4 and f. 12 What is the common denominator of -53/27 and -4 + 4 + 2 + 29/9? 27 Let a = 9 - 5. Let y = -580 - -586. Calculate the smallest common multiple of a and y. 12 Suppose 2g - 4b - 3482 = 0, -4g + 294 = -b - 6684. Let r = 19180/11 - g. What is the common denominator of r and 50/9? 99 Let i = -5641/88 + 653471/264. Let y = i + -2429. What is the common denominator of 29/18 and y? 18 Suppose -2n = 55 - 1. Let o be 872(-2 - 152/(-77)). Let h = 163/7 + o. Calculate the common denominator of h and n. 11 Let h(c) be the second derivative of c4/6 - c3/3 - c*2 + 9c. Calculate the smallest common multiple of 18 and h(-3). 198 Let g = -1 + 3. Calculate the least common multiple of 11 and g(-6)/(-4) - -1. 44 Let m be (-3 - -6)-1 - -32. Suppose 5o + 2h = m, 3h - 31 = -0o - 5o. Suppose -9 = -2z + 11. What is the least common multiple of z and o? 10 Calculate the common denominator of (-38)/6*(-36)/(-24) and -93/2. 2 Le	{ "pile_set_name": "DM Mathematics" }
, 5z = -2u + 69. Suppose -12 = uy - 40y. Solve y = 2h + 2h for h. 1 Let x be (-40)/4 + 399 + -4 - -8. Solve 0 = 391c - xc for c. 0 Suppose 576 = 30x - 14x. Let f be (4 - 2) + (-15)/((-135)/x). Solve 4m = 2m - f for m. -3 Let c be (-4 + (-135)/(-35))/(((-8)/(-952))/(-1)). Solve 17f - 68 = -c for f. 3 Let x be -2 - (-4 - 425/20)-12. Let q = -294 - x. Solve -3 = 2a - q for a. 4 Suppose 0 = -2r + 6p - 3p + 72, -3r + 32 = 5p. Solve -r = 43q + 191 for q. -5 Let z(l) = 7 - 26 - 4l*2 + 31l + 7 + 7. Let v be z(7). Suppose -f + 2s + 9 = s, 0 = 4f - 2s - 28. Solve q = fq + v for q. -4 Let l = -7 + 13. Suppose -5j - l = -o - 5, 0 = 4o + 4j - 28. Solve 15 = -ot + 3 for t. -2 Suppose 42c + 80 = 23c + 29c. Solve -18d = -62 + c for d. 3 Let p(j) = -2j2 + 15j. Let i be p(11). Let q = i + 81. Let h be 1(0 - -3)/1. Solve d - h = qd for d. -1 Suppose -196b + 198b = 0. Solve b = 46v - 93 - 229 for v. 7 Suppose 14 + 28 = 2s. Let u be 9/1 - (s + -16). Solve 0 - 20 = -ug for g. 5 Let u = -117 - -102. Let l(w) = -w3 - 13w*2 + 29w + 13. Let v be l(u). Suppose 3g - v = -19. Solve g = -q - 0 for q. -3 Let p = 148 + -153. Let x be (8/36)/(p/(-45)). Solve 5 = -xg + 7 for g. 1 Let g(w) = -w*2 + 4w - 85. Let r be g(0). Let s = -81 - r. Let a be ((-1)/s)/((-17)/136). Solve -a = -3v - 14 for v. -4 Suppose 8h - 6 = 6h. Suppose hj - 5j + 4x + 6 = 0, -5j + 2x = -15. Suppose 4f - 3f - j = 0. Solve -fz = z - 16 for z. 4 Let o(t) = 38t - 108. Let f be o(3). Solve fz = -360 + 390 for z. 5 Suppose -22 = -5c + y - 1, -y - 6 = 0. Solve 23h - c = 26h for h. -1 Suppose 234d - 1060 - 344 = 0. Solve -dn + 202 = 202 for n. 0 Suppose -3m + 103 = 4q, -3q = -3m + 66 + 9. Solve 21 = -mp + 36p for p. 3 Let p = 428 - 672. Let o = p + 244. Solve -3x - 9 - 3 = o for x. -4 Let c be -25/(40/12)-1. Let o = 2106 - 2104. Solve -ou + c = u for u. 1 Let s = 43 - 31. Let b be 0 + -1 + ((-90)/(-9) - 7). Let y be -5(-8)/20 + 0/b. Solve 5j = yj - s for j. -4 Let s(t) = 69t3 + t2 - t + 1. Let w be s(1). Suppose 12g + w = 322. Suppose -2r - 5r = -g. Solve r = -3k - 0 for k. -1 Suppose -25 = -5f - 5k, -5f - k + 25 = -0f. Suppose -4y + 13 = f. Solve yz - z = 0 for z. 0 Let x(o) = -o*2 + 20o + 56. Let q be x(22). Let n be (q/11)/(8/44). Solve 4w = n + 6 for w. 3 Suppose 237r = 310r - 1679. Solve -d = r - 24 for d. 1 Let c be 1502/(-12) - 19/(-114). Let g = c - -142. Solve -2 = 5k - g for k. 3 Suppose -u = -25 + 25. Solve -18p + 4 - 22 = u for p. -1 Let r be (-10)/(90 + -95 - (-5)/2). Solve rv = -7v - 22 for v. -2 Let h be -4(-1)/(-4) - -33. Suppose 30a + 30 = ha. Solve -am = -11m - 12 for m. 3 Let d be 4/(-8)2(-1 + -6). Solve -dw = 11w + 36 for w. -2 Suppose 0 = -60w + 61w. Suppose 51k - 140 - 13 = w. Let d be 0(2 - 0)/4. Solve 0 = -kh - d - 3 for h. -1 Suppose 14r - 223 = 169. Solve -53f + rf - 50 = 0 for f. -2 Let g(w) = -2w2 + 57w - 193. Let d(o) = o*2 - 29o + 96. Let h(i) = -9d(i) - 4g(i). Let z be h(29). Solve -9u - z = -u for u. -3 Let r(j) = 3j + 472. Let s be r(-153). Solve sd = 51 - 155 for d. -8 Suppose 3l - 134 = -5a, 26 = a + 43l - 42l. Solve a = -44c + 28 for c. 0 Let o be (2/3)/(10/75). Let x(l) be the third derivative of l*5/30 - 3l*4/8 + 13l*3/6 - 53l*2. Let b be x(o). Solve -5s - b = 2 for s. -4 Suppose -153p - 128 = -169p. Let d(b) = 30b - 226. Let h be d(p). Solve hw - 6w = -40 for w. -5 Let h be ((-12)/(-41))/(1316/26978). Suppose -4 = r + 5j + 4, 2r - 5j = 14. Solve -r = 2b - h for b. 2 Let c = -408 - -470. Let v = 74 - c. Solve 0 = 4f - 16 + v for f. 1 Let p be ((-91)/(-35) - -1)/((-1)/10). Let o = p - -43. Solve 0 = -ox + 31 - 3 for x. 4 Suppose 6v - 4v - 14 = u, -4u + 7 = v. Let r(o) = -o*2 + 11o - 17. Let d be r(v). Suppose 4i - d - 1 = 0. Solve -2 = -m + im for m. -1 Let m(r) = -12r + 7. Let a be m(-3). Let b = a - 39. Solve 10 = 6l - bl for l. 5 Let b(t) = -22t - 155. Let n be b(-9). Suppose 89 = 33c - n. Solve c - 19 = 5q for q. -3 Let r(y) = -y*2 + 613y + 2471. Let u be r(-4). Solve 0 = -un + 4976 - 4958 for n. 6 Let w be 29(-1)/(-9) + 86/(-387). Suppose 0 = -p - h + 9, -2 = 2h - wh. Solve p = -2r - 1 for r. -4 Suppose 9 = -16n + 19n. Suppose -3v + v + 27 = -ny, y - 1 = 4v. Let b(o) = -2o - 20. Let f be b(y). Solve fa = -a + 3 for a. 1 Suppose -2k + 0 = 3n - 7, -3k - 4n + 10 = 0. Suppose -2o - 2 = 3p, -5o + 3p = -kp - 20. Solve -ob = -8b - 0b for b. 0 Let k = -9 - -4. Let f = k - -8. Suppose 39r + 32 = 43r + 4o, -12 = r - 3o. Solve r = fj + 6 for j. -1 Suppose 0t = 2d + 11t - 134, 4d - t = 130. Solve 0 = -dp + 27p for p. 0 Suppose 615 - 41 = 7a. Solve 22k - a = 28 for k. 5 Let b be (-6)/(-6)(142 + 2). Solve -bi + 444 = -33i for i. 4 Let t(n) = -n*3 + 6n*2 + 4n - 22. Let y be t(6). Suppose -3 = x + yr, -3x + 2r = r + 16. Let z be (4 + x)/(-3)(-1 + 10). Solve -5a = -za for a. 0 Suppose 0l = l + 4, 2n + 4l = -12. Let z be 0 - (-5 + 0 - -3 - 0). Suppose -q + 6 = y + 3, 4y - z = q. Solve qv + 20 = -nv for v. -5 Suppose -12s - 13s + 5350 = 0. Suppose 6r = s - 118. Solve r = 11d - 7d for d. 4 Let x(n) = 4n - 93. Let g be x(-10). Let l = g + 149. Solve -4r = -8r - l for r. -4 Suppose 4k - 12 = 3g - 4, -2g = 3k - 6. Let x(q) = -q*2 + 24q + 13. Let v be x(20). Let p = v + -91. Solve pd + k = -0d for d. -1 Let r be 17/85-265(-1)/22. Solve r - 75 = -11u for u. 2 Let o(j) = -j*2 - 5j + 15. Let f be o(2). Suppose a = -f - 2, -5k = a + 3. Solve -4t + k = 4 for t. -1 Let n = 1136 + -1081. Solve -6b + 43 - n = 0 for b. -2 Let l(c) = 2c*3 + 39c*2 + 13c - 35. Let d be l(-18). Let y = d + -701. Solve -7 = yj - 3 for j. -2 Let t be 133/38 + (-422)/(-92) + 6/(-69). Solve -tw + 2224 = 2240 for w. -2 Suppose -5x = -4i + 561, 8i = 13i + 3x - 655. Solve in - 122n - 60 = 0 for n. 5 Suppose 0 = -82y + 85y - 45. Let h be (-7)/(-231)11y. Suppose 2u + p = 14, 0p + 28 = 4u - 4p. Solve -ho - 32 = -u for o. -5 Let r(p) = p*2 + 10p + 2. Let d be r(2). Suppose 3t + 27j = 22j + d, j + 62 = 5t. Solve 0 = tf - 9f - 3 for f. 1 Suppose 6l = 88 - 88. Suppose 9 = -3n - 3k, l = -n + 2n - k - 5. Solve 0 = 5h + n + 19 for h. -4 Suppose 0 = -4g + 21 + 15. Let j = 5 - g. Let o be 3/(78/4) - j/(-26). Solve os - 8 = 2s for s. -4 Let t = -3483 + 3487. Let c = 42 - 39. Solve c - t = y for y. -1 Suppose -3y + t = -576, 81t + 358 = 2y + 76t. Solve 210 = 4v + y for v. 4 Let j be (-9)/(-54) + (-51)/(-18). Suppose -jw + 78 = 14b - 12b, 62 = 2b - 5w. Solve 4g - b = -5g for g. 4 Let d be (20/(-14))/((-24)/168). Suppose 9i + di - 285 = 0. Let z be 0/((0 + 1)/((-15)/i)). Solve -2b - b = z for b. 0 Let j = 140 + -131. Let z(r) = -r3 + 9r*2 + 2r - 14. Let n be z(j). Let a = n + 4. Solve 4k + 8 = -a for k. -4 Let q(x) = 22x - 119. Let c be q(6). Suppose 0 = -cs + 29s - 128. Solve -6 = -su + 2 for u. 1 Let s = 4056 - 4054. Solve -2a - 2 = s for a. -2 Let k = 10875 - 10867. Solve -kh - 242 + 290 = 0 for h. 6 Suppose -o - 11r - 18 = -7r, -5r = -5o + 35. Suppose -z + 9 = 2z. Suppose 5 = -t - oy, -zt - 2y = t - 4. Solve -6l + tl - 15 = 0 for l. -5 Let m(a) = a2 - 9a + 7. Let q = 66 - 57. Let d be m(q). Suppose -5u + d = -8. Solve -n - 8 = -un for n. 4 Let v(t) = t*3 + 4t*2 - t + 39. Suppose 4x + 11 = 3m, -1 = 2x - 4m - 3. Let i be v(x). Solve i - 4 = 5c for c. 3 Let k(o) = 120o - 663. Let t be k(6). Solve 9h = t - 39 for h. 2 Suppose -55534 = -104t + 26002. Solve -766 = -3l - t for l. -6 Let p(w) = -43w - 4. Let m be p(-1). Suppose 129 = 6t + m. Solve -9v - t = -14v for v. 3 Suppose -72p + 134 = -154. Solve pb = 239 - 239 for b. 0 Let q be (46/(-92))/(4/(-152)). Solve -q = 5z - 14 for z. -1 Let u be ((-1120)/98)/((-12)/126). Solve -14g + 64 = u for g. -4 Let d(l) = -18l - 18. Let q be d(-1). Solve q = 19m - 21m + 8 for m. 4 Let n be 1 + 65 + (-2)/((-26)/117) - -2. Solve ng = 63g - 28 for g. -2 Let j(b) = b3 + 18b*2 - 21b - 23. Let y be j(-19). Solve 0 = -yu + 2u - 52 for u. -4 Let f = 25459 - 25439. Solve -fi = -541 + 581 for i. -2 Let i be ((5 - -10) + -15)/1. Solve -4b - 33*b + 11	{ "pile_set_name": "DM Mathematics" }
= -2l - dl. Calculate the remainder when l is divided by a(8). 6 Let g(x) be the second derivative of 4x3 - 77x*2/2 - 56x. What is the remainder when g(12) is divided by 71? 69 Let k = -8978 + 8990. Let y = -3 - -6. Calculate the remainder when k is divided by y. 0 Let k = -529 + 299. What is the remainder when k/922844/(-10) is divided by 24? 20 Suppose 2g - 14 = -2. Let f = 198 - 179. Calculate the remainder when -22(-3)/g(f - 3) is divided by 45. 41 Let d be 20/(4/(2 + -6)). Let a = 3 + d. Let q = a - -38. What is the remainder when 83 is divided by q? 20 Suppose 2a = -24u + 26u + 8, 2a - 6 = 0. Calculate the remainder when 11 + 8/(-8) + u + 0 is divided by 3. 0 Let s be (-39)/(-12) - (-2)/(-8). Suppose 2l - 140 = -sl. Let w(h) = -h2 - 3h + 165. Calculate the remainder when l is divided by w(11). 6 Suppose -x + 35 = -20. Let d be (167 + -163)(1 + 103/4). Suppose -9p + 1 = -d. Calculate the remainder when x is divided by p. 7 Let j(q) = 3q2 + 19q + 84. Calculate the remainder when 774 is divided by j(-6). 72 Suppose -3f = -3o + 447, 427 = 3o + 2f - f. Let s = 178 - o. Calculate the remainder when 203 is divided by s. 33 Suppose -53t + 12t + 1476 = 0. Let h(a) = 4a2 + 9 - 3a*3 + 5a3 - a3 - a. What is the remainder when t is divided by h(-4)? 10 Let m(k) = -10k + 2. Suppose -35v + 5i = -31v - 89, i + 75 = 3v. Calculate the remainder when v is divided by m(-2). 4 Suppose -22k - w + 187 = -10k, 3w + 15 = 0. What is the remainder when 198 is divided by k? 6 Let n(s) = s*3 - 3s*2 - 7s + 5. Suppose -3z = -38 - 298. What is the remainder when (-8 - -7)/((-2)/z) is divided by n(5)? 16 Let g = 4586 - 4558. What is the remainder when 574 is divided by g? 14 Let x be 8/10 - 5577/65. Let c = 85 + x. What is the remainder when 7 is divided by -3 + 28/(4 - c)? 3 Suppose 3l = -y + 4699, 4l - 5802 = 5y + 419. Calculate the remainder when l is divided by 32. 28 Let j(d) = -d - 1. Let b(n) = -11n - 24. Let i(l) = -b(l) + 5j(l). Let t be i(-12). Let g = 158 + t. Calculate the remainder when g is divided by 27. 24 Suppose 7y - 8y = -23. Calculate the remainder when 735 is divided by y. 22 Suppose -4o + 142 = -58. Let h = o - 12. What is the remainder when h is divided by 91/4 - 6/8? 16 Let p(v) = -411v + 323. Let w be p(-5). Suppose -29g = 12g - w. Calculate the remainder when 283 is divided by g. 51 Suppose -29z = -33z - x + 430, 0 = z - x - 110. What is the remainder when 119 is divided by z? 11 Suppose -5z + 40 = 20. Suppose 5 + 13 = 5p + zs, -3s = 5p - 21. Calculate the remainder when 13 is divided by p. 1 Suppose -13207m + 13250m = 48719. What is the remainder when m is divided by 23? 6 Suppose -4f + 18 = 5f. Suppose -fu + 13 = 3. Suppose 5c - 404 = 4y, -18 = -2c - uy + 137. Calculate the remainder when c is divided by 28. 24 Suppose -85418 + 2365 = -62i - 12745. Calculate the remainder when i is divided by 225. 9 Let j = 7604 + -6967. What is the remainder when j is divided by 59? 47 Let j(b) = 9b + 49. Let y(q) = 20q - 9. Let z be y(1). Calculate the remainder when j(z) is divided by 51. 46 Let q(b) = b3 - 39b*2 + 239b - 65. What is the remainder when q(32) is divided by 108? 91 Let o = 7650 - 7551. What is the remainder when 3263 is divided by o? 95 Suppose t - 38 = -1. Let a = -7490 - -7578. What is the remainder when a is divided by t? 14 Let q = 217 + -220. Calculate the remainder when (451/(-33))/(q/9) is divided by 16. 9 Let m = -82 - -101. Calculate the remainder when (-4 - (2 - 96)) + 3 is divided by m. 17 Let j(i) = -i*2 - 6i + 41. Let u(z) = -2z3 + 15z*2 - 8z + 7. Let l be u(7). What is the remainder when 84 is divided by j(l)? 2 Let a = 5028 + -4971. What is the remainder when 4556 is divided by a? 53 Let v = -422 + 172. Let h = v + 270. Calculate the remainder when h is divided by 8. 4 Suppose -4z = 21p - 20p - 64, -3z = 3p - 174. Suppose -50 = -b + 5h + 12, -4h - 200 = -4b. Calculate the remainder when p is divided by b. 9 Let q(h) = 138h - 1678. Calculate the remainder when q(20) is divided by 107. 12 Let p(c) = 4c*2 - 3c. Suppose -35h + 37h - 8 = 5i, 0 = -4i + 4h - 4. Calculate the remainder when 80 is divided by p(i). 14 Suppose 4p = -5g + 56, -g + 4p + 51 - 59 = 0. Suppose gt - 141 = -109. Calculate the remainder when 171 is divided by t. 3 Let n(a) = -2a*3 - 7a*2 + 3a + 7. Suppose -2k = -4k + 240. Suppose -28y = -31y + k. What is the remainder when y is divided by n(-4)? 7 Let c = 32653 + -32394. What is the remainder when c is divided by 26? 25 Suppose 2l + 18a - 22a = 1496, 3734 = 5l - 4a. Let s = l + -671. What is the remainder when 173 is divided by s? 23 Let k = 248 - 147. Let y = 339 + -280. Calculate the remainder when k is divided by y. 42 Let b = -30 - -35. Calculate the remainder when (b + -10 - -15) + 1 + -3 is divided by (6/(-30) - 12/(-10)) + 1. 0 Let f(u) = 14u*2 + 83u + 749. What is the remainder when f(-9) is divided by 273? 44 Suppose -541 = -159c + 3997 + 14224. What is the remainder when 458 is divided by c? 104 Let b = 56 + -53. Suppose 14o = bo + 176. What is the remainder when -2 + 1722/27 + 14/63 is divided by o? 14 Let o be (-4 - (6 - 11)) + (0 - 2). Let n = 5 + 6. Calculate the remainder when ((-11)/33)/(o/57) is divided by n. 8 Let k = -30 + 15. Let s = k - -56. What is the remainder when s is divided by (1/(-3))/(2/(-90) - 0)? 11 Suppose -4z - 3d + 83 = 0, 5d + 241 - 206 = 0. What is the remainder when 259 is divided by z? 25 Let k be -2 + -1 + 9 + -1. Let b(i) = 8i + 12. Let v(f) = 37f*2 - 15f + 34. What is the remainder when v(2) is divided by b(k)? 48 Suppose 0 = -4r - 75 - 97. Let g be -1 + (-7 + 4 - r). Suppose 0 = -38z + 41z - g. Calculate the remainder when 24 is divided by z. 11 Let u(o) = 148o - 1305. Calculate the remainder when 156 is divided by u(9). 21 Suppose 0 = b - f + 17, f - 5f = b - 8. Let r = -3 - b. Suppose 4j + 7 = 2h - 11, -3j + r = 0. What is the remainder when 118 is divided by h? 13 Suppose -218 = 5n - 5d + 102, -3n = -2d + 191. Calculate the remainder when (-177 - -3)(n/14 + 4) is divided by 22. 21 Let h = 2239 - 2144. What is the remainder when 472 is divided by h? 92 Let q = 25 - 10. Suppose 5o - 30 = -10. Suppose t = o + 55. Calculate the remainder when t is divided by q. 14 Let g = -106 + 111. Suppose -gs + 380 = -2i, -2i = 3s - 176 - 36. Let j = 101 - s. What is the remainder when 48 is divided by j? 21 Let t be (-2(-3)/(-10))/(4/(-780)). Let m = -13 + t. Let u = -91 + m. What is the remainder when 103 is divided by u? 12 Suppose -146q + 345 = -4619. Calculate the remainder when 7173 is divided by q. 33 What is the remainder when (1-37)/(((-4)/6)/(17304/63)) is divided by 21? 19 Let g = 300 + -183. Let d = 87 + -70. What is the remainder when g is divided by d? 15 Let q(h) = h3 + 10h*2 + 2h + 13. Calculate the remainder when (384 - 0)/(1/(10/15)) is divided by q(-9). 28 Suppose -476c = -466c + 1160. Let t = c - -132. What is the remainder when 157 is divided by t? 13 Let h = 25 - 6. Suppose -68y + 90y - 9424 = 8506. Calculate the remainder when y is divided by h. 17 Calculate the remainder when 8133 is divided by (36/7)/(31/217). 33 Let l be 7(12/(-42) - 0). What is the remainder when 151 is divided by (35/21 - -2)(-6)/l? 8 Let x be 1 - 4 - 10/(-5). Calculate the remainder when 99 is divided by ((-290)/203)/(x/7). 9 Let x(b) = -8b + 206. Let g be x(24). Suppose -gd - 84 = -938. What is the remainder when 238 is divided by d? 55 Suppose 3i - 32h = -37h + 1754, 3h = i - 580. Calculate the remainder when i is divided by 14. 9 Let o = 9 - 4. Suppose ob + 106 = -319. What is the remainder when 12 is divided by (-1)/4 - b/20? 0 Suppose 0 = -2b + 218 - 208. Suppose o = s - 33, -bs - 3o - o = -165. Calculate the remainder when 161 is divided by s. 29 Let n(k) = 6k2 - k + 8. Let r be ((-39)/1)/((-2 - 0) + 1). Let h = r + -42. What is the remainder when n(h) is divided by 24? 17 Let d = 59 - -15. Calculate the remainder when d is divided by -12 - (4 + (9 + -38 - 7)). 14 Suppose 4x = -z + 456, -217 = -2x - z + 9. What is the remainder when x is divided by 2((-261)/6)/(-3)? 28 Let s = 1002 + -	{ "pile_set_name": "DM Mathematics" }
j*3 - 1845j*3 + 911j*3. 5j*3 Collect the terms in -29a*3 + 102a - 102a + 12a*3 + 8a*3. -9a3 Collect the terms in 8776 + q3 + 8770 - 2q2 - 17546 + 2q2. q3 Collect the terms in 1023 + 11z + 17z - 1023 - 34z. -6z Collect the terms in 42h + 194h - 1244h. -1008h Collect the terms in 5642z - 2712z*2 - 5642z. -2712z2 Collect the terms in -1356 - 16757 + 2298 - 5378 - j3. -j3 - 21193 Collect the terms in 20y*3 - 9y*3 - 52y*3 + 64y*3. 23y*3 Collect the terms in 171v*2 - 178v*2 + 37v*2. 30v*2 Collect the terms in -16y - 8y - 11y - 11y + 52y - 7y. -y Collect the terms in 778n - 2n2 + 256n - 3n2 - 88n. -5n2 + 946n Collect the terms in -33s + 14s + 11s + 9s + 4s2. 4s*2 + s Collect the terms in -317592191846 - 3q + 317592191846. -3q Collect the terms in 35q*2 + 27q*2 + 34q*2 - 93q*2. 3q*2 Collect the terms in -83w + 77w - 243w. -249w Collect the terms in 6r + 5r - 23r + 157 + 102 + 11r. -r + 259 Collect the terms in 1 + 15352m + 3140m + 0. 18492m + 1 Collect the terms in -1139k + 2275k + 25 - 1138k. -2k + 25 Collect the terms in -98n - 45 + 103n + 2. 5n - 43 Collect the terms in -5 + 25p*2 + 2 - 161p*2 + 1. -136p*2 - 2 Collect the terms in -221h + 281h - 54h. 6h Collect the terms in -74p - 37p + 125p - 47p. -33p Collect the terms in -203096505d3 + 4 - 3 + 1 - 2 + 203096501d*3. -4d*3 Collect the terms in 217y - 422y + 205y + 84y2. 84y*2 Collect the terms in 192c*2 + 820c - 820c - 196c*2. -4c*2 Collect the terms in -31b*3 - 15322b*2 + 37b*3 + 15322b*2 - 5b3. b3 Collect the terms in -2541w3 - 2470w*3 + 7488w*3 - 2473w*3. 4w*3 Collect the terms in 0n + 114n2 - 3n + 100n2 + 3n. 214n2 Collect the terms in -339y*3 + 42y*3 - 202y*3. -499y*3 Collect the terms in 30p*2 - 6p*2 - 3p*2 - 17p*2. 4p*2 Collect the terms in 1400n*3 - 13312n*3 - 16641n*3 + 6969n*3. -21584n*3 Collect the terms in -54h*3 + 56h*3 + 6h - 17h2 - 8h*2 + 25h*2. 2h*3 + 6h Collect the terms in -33d + 15d + 9d + 13d + 76 - 74. 4d + 2 Collect the terms in 0 - 154q*2 + 298q*2 + 0 - 147q*2. -3q*2 Collect the terms in -48w*2 + 471w*2 - 1278w*2 - 1475w*2. -2330w*2 Collect the terms in -133u*2 + 212u*2 - 91u*2. -12u*2 Collect the terms in -1 + 1 - 3603m*3 + 1095m*3. -2508m*3 Collect the terms in -1078v + 4v2 + v2 - 1091v + 2169v. 5v*2 Collect the terms in -44969g - 2 + 149288g + 2. 104319g Collect the terms in -37203k + 18658k + 18593k. 48k Collect the terms in -11b - 5b - 17b - 58b. -91b Collect the terms in 103f*3 - 32f*3 - 101f*3. -30f*3 Collect the terms in -68c - 76c - 2538 + 143c + 2538. -c Collect the terms in 11a - 260a*3 + 63a*3 + 60a*3 + 68a*3 + 72a*3. 3a*3 + 11a Collect the terms in -44b + 2734b + 3279b. 5969b Collect the terms in -m*3 + 0m*3 + 0m3 + 244. -m3 + 244 Collect the terms in -8784q - 8790q + 20q3 + 17574q. 20q3 Collect the terms in -171 + 171 + 36c*3. 36c*3 Collect the terms in 1 + 20 - 20 - 1 - 1503k. -1503k Collect the terms in 1276 - 1276 + 48p*3 + 40p*3 - 16p*3. 72p*3 Collect the terms in 4 - 7l + 2 + 2. -7l + 8 Collect the terms in -46569v - 35v2 + 46569v. -35v2 Collect the terms in 95740v*2 - 191473v*2 + 95737v*2 + 31v. 4v2 + 31v Collect the terms in 16120n + 2393n + 9294n + 98479n. 126286n Collect the terms in -10d + d*3 + 42d + d*3 - 9d. 2d3 + 23d Collect the terms in -245j2 + 67j*2 + 119j*2 + 4j. -59j2 + 4j Collect the terms in 33 + 2v2 + 33 + 63v - 63v. 2v*2 + 66 Collect the terms in 20m*3 + 2m*2 - 6m*2 + 6m*2 - 11m*2. 20m*3 - 9m*2 Collect the terms in 160382d + 160375d - 320754d. 3d Collect the terms in 382q - 933q + 5814q - 2 + 7462q. 12725q - 2 Collect the terms in 4 + 1522m2 + 4 - 1599m*2 - 7. -77m*2 + 1 Collect the terms in -48m + 39m - 236m. -245m Collect the terms in -259i*3 + 16 + 6i + 29 + 264i3 - 6i. 5i3 + 45 Collect the terms in -28516m*3 - m + 28511m*3 + 11m. -5m3 + 10m Collect the terms in 1207l - 475l - 541l. 191l Collect the terms in 1140k2 - 542k2 - k3 - 533k2. -k3 + 65k*2 Collect the terms in -138y*2 + y + 71y*2 - 157y*2 - y. -224y*2 Collect the terms in 42y*3 - 92y*3 - 97y*3 - 78y*3 + 48y*3. -177y*3 Collect the terms in -940d + 1851d - 913d. -2d Collect the terms in 398 - 14o*3 + 391 - 36o*3 + 392 - 1181. -50o*3 Collect the terms in 35h + 7h3 - 7h + 35h. 7h*3 + 63h Collect the terms in -3 - 2c - 4c + 29571c2 + 6c. 29571c2 - 3 Collect the terms in 3 - 18143x*2 - 18146x*2 + 54436x*2 - 18151x*2. -4x*2 + 3 Collect the terms in -9381m + 3087m + 3195m + 3097m. -2m Collect the terms in -68w3 - 49w*3 - 37w*3 - 3w*3. -157w*3 Collect the terms in 14081 + 29j - 28168 + 14086. 29j - 1 Collect the terms in -101f*3 + 8f*2 - 2f*2 - 4f*2. -101f*3 + 2f*2 Collect the terms in 189i*3 - 147i*3 - 2i*2 + 1164i*3. 1206i*3 - 2i*2 Collect the terms in 5j + 13 - 34j + 32j. 3j + 13 Collect the terms in -5a + 138a2 - 141a*2 + 6a - 37a3. -37a*3 - 3a*2 + a Collect the terms in -118487d - 18d2 + 118487d. -18d2 Collect the terms in 1538h - 6 + 3 + 3. 1538h Collect the terms in 98830h + 68574h + 649h - 13123h. 154930h Collect the terms in -4703y2 + 2324y*2 - y + y + 2353y*2. -26y*2 Collect the terms in 23306r*2 - 11680r*2 - 11629r*2. -3r*2 Collect the terms in -126u*2 - 28u*2 + 143u*2. -11u*2 Collect the terms in 281c*3 - 75c*3 - 71c*3 - 74c*3 - 71c*3. -10c*3 Collect the terms in -3c*3 - 1915c*2 - 1932c*2 + 3847c*2 - 8c*3. -11c*3 Collect the terms in 0 + 0 - 10269q*2 + 5107q*2 + 5104q*2. -58q*2 Collect the terms in -6 - 13r*2 + 6 + 17 - 14r*2. -27r*2 + 17 Collect the terms in 0 - 12314p + 0. -12314p Collect the terms in -66c - 57c + 296c - 59c - 47c - 48c. 19c Collect the terms in -25p + 10p*2 + 71p - 37p. 10p*2 + 9p Collect the terms in 0m + 0m - 667835m3 + 0m + 0m + 667838m*3. 3m*3 Collect the terms in 53v*2 + 17v*2 + 43v*2 + 11v*3 + 5v*3 - 14v*3. 2v*3 + 113v*2 Collect the terms in -4 + 29r - 4 - 1 - 7 + 12. 29r - 4 Collect the terms in -1888y*3 - 1873y*3 + 4y*2 + 5537y*3 - 1853y*3. -77y*3 + 4y*2 Collect the terms in -1406s - 39s3 + 1403s + 12s3. -27s*3 - 3s Collect the terms in 2p + 48p*3 - 5p2 - p3 - 5p3. 42p*3 - 5p*2 + 2p Collect the terms in -277k - 278k - 272k - 275k + 1094k. -8k Collect the terms in 683z3 - 157z*3 - 5172z*3. -4646z*3 Collect the terms in -425 + 38u + 845 - 420. 38u Collect the terms in 1 - 325g*2 + 451g*2 - 1 + 189g*2. 315g*2 Collect the terms in 723k + 600k + 781k - 49k. 2055k Collect the terms in -7z2 - 151327045 - 2z + 151327045. -7z2 - 2z Collect the terms in -48x - 26x - 934x2 + 936x*2. 2x*2 - 74x Collect the terms in -2009u - 2199u + 4429u. 221u Collect the terms in 27d3 - 723d + 0 + 0 + 724d. 27d*3 + d Collect the terms in 11m - 6m - 28m - 19m + 2m. -40m Collect the terms in 471s - 181s + 272s + 141s. 703s Collect the terms in 547u - 137u - 136u - u2 - 158u - 145u. -u2 - 29u Collect the terms in 50c2 + 47c*2 - 52c*2 - 14c*2 + 42c*2. 73c*2 Collect the terms in 11v - 13v + 343 + 650 + 357. -2v + 1350 Collect the terms in 1112u2 - 7 + 16 - 1108u*2 - 9. 4u*2 Collect the terms in -8 + 8 + 1733p - 6452p. -4719p Collect the terms in 21o2 + 268o - 542o + 274o - 89o2 + 73o*2. 5o*2 Collect the terms in 467142116o + 5o2 - 467142116o. 5o2 Collect the terms in -252 + 2d - 266 + 285 - d. d - 233 Collect the terms in 3606612m - 1803298m - 1803314m + 5m*2. 5m*2 Collect the terms in -18i*3 - 51i*3 - 44i*3 - 198i*2 + 198i*2. -113i*3 Collect the terms in -8v - 28 - 18 + 57 - 36 + 0v. -8v - 25 Collect the terms in 607 - 300 - 307 - 16b3 - 27b*3. -43b**3 Collect the te	{ "pile_set_name": "DM Mathematics" }
s -236 + -36572? -36818 In base 2, what is 10011 - -10011100000001111001010? 10011100000001111011101 In base 8, what is 226201345 - -4? 226201351 In base 7, what is 1344 - 4250656? -4246312 In base 7, what is 1 + -550104366? -550104365 In base 7, what is -120150253 + 23? -120150230 In base 4, what is -2330 - 22312322? -22321312 In base 8, what is -34 - -225723? 225667 In base 5, what is 2320130 + 2134? 2322314 In base 7, what is -1 - -2552533402? 2552533401 In base 6, what is -244223520 + -1? -244223521 In base 15, what is -4 - -2a048c1? 2a048bc In base 9, what is 7 - 3114655? -3114647 In base 2, what is 10 - -111000101100000111011? 111000101100000111101 In base 11, what is 1a + 68817? 68836 In base 15, what is 16d164c - -4? 16d1651 In base 8, what is 21627150 + 114? 21627264 In base 12, what is -433 + 4a599? 4a166 In base 8, what is -205 + -44542? -44747 In base 15, what is 3e + 1429964? 14299a3 In base 2, what is -100101000010111011110100 - -100? -100101000010111011110000 In base 2, what is 111111011000100011101100 - 11? 111111011000100011101001 In base 5, what is 1420103 + -13420? 1401133 In base 15, what is -2b85c - -1? -2b85b In base 2, what is -111110110011001 + -10111101010111? -1010110011110000 In base 5, what is 1010340033 - 4? 1010340024 In base 11, what is -2 + 4192a46? 4192a44 In base 6, what is -1555 - 5345? -11344 In base 11, what is 41 + -284481? -284440 In base 3, what is -2 + 11201100220010102? 11201100220010100 In base 8, what is 5311641 - -114? 5311755 In base 11, what is -1a988 - -61? -1a927 In base 10, what is -25 + 217580? 217555 In base 12, what is -421227 + -5? -421230 In base 13, what is -104b + -71b9? -8237 In base 12, what is 997 + -14b203? -14a428 In base 9, what is -32348322 + -1? -32348323 In base 16, what is -1 - -48877f? 48877e In base 10, what is 14201 - -335? 14536 In base 16, what is 12dc03f - 2? 12dc03d In base 5, what is -1010142 - 102132? -1112324 In base 4, what is -3122101 - 223220? -10011321 In base 15, what is 255e8b5 + -12? 255e8a3 In base 10, what is 0 + -4380759? -4380759 In base 10, what is 14 + 17320133? 17320147 In base 8, what is -652 + 25464? 24612 In base 5, what is -2112 + -101233043? -101240210 In base 14, what is 4690 + -508? 4186 In base 2, what is 1001011000100111000001100 + 100? 1001011000100111000010000 In base 7, what is 2010 - -136314? 141324 In base 4, what is 1012222233233 + 13? 1012222233312 In base 7, what is 1611521233 + 0? 1611521233 In base 6, what is 15232115 - 12? 15232103 In base 2, what is 11 - -1010101111011100110001? 1010101111011100110100 In base 5, what is 134 - -120212212? 120212401 In base 14, what is 36c4 - 9c7? 2adb In base 5, what is -213330 - -1134132? 420302 In base 14, what is -43b9196 + 2? -43b9194 In base 12, what is 9896aa64 + -5? 9896aa5b In base 11, what is 7095a0 - 31? 70956a In base 10, what is 28 - -626989? 627017 In base 12, what is -2665940 + 3? -2665939 In base 16, what is 4 - 92ae8d? -92ae89 In base 6, what is -123322121 + -421? -123322542 In base 12, what is 3 - -132946a? 1329471 In base 11, what is -14861 - 34959? -4970a In base 8, what is 6 + -62277? -62271 In base 16, what is 1224 + -10e04? -fbe0 In base 8, what is -4 + -6436525? -6436531 In base 3, what is 20200 + 2222102211201? 2222110002101 In base 8, what is 3034 - 674700? -671644 In base 13, what is 23a - a3b6? -a179 In base 11, what is 217a65 - 211? 217854 In base 6, what is 0 + 200455532? 200455532 In base 2, what is -11010111111101 - 10111000111001? -110010000110110 In base 3, what is 0 - -101111220021010? 101111220021010 In base 16, what is -31f15 - -a8? -31e6d In base 4, what is 210302 + -302101110? -301230202 In base 16, what is 303f + -df? 2f60 In base 7, what is 54131204 + -14? 54131160 In base 10, what is -10 - 171484? -171494 In base 14, what is 428 - 27812? -273c8 In base 14, what is 1bb7 + -1b5d? 58 In base 11, what is -544 - a537? -aa80 In base 11, what is 23a5608 + -9a? 23a5519 In base 16, what is -a2 + 5392? 52f0 In base 10, what is 4 + 176701? 176705 In base 15, what is -3 - a3b01eb? -a3b01ee In base 2, what is 101111110100 + -11110111010? 10000111010 In base 12, what is 53303 - b5a? 52365 In base 6, what is 22 + -133524543? -133524521 In base 9, what is -1110483 - 3073? -1113566 In base 2, what is -1111101110001110000 + -10111001000? -1111110001000111000 In base 2, what is 100 + 1000011101100100011101000? 1000011101100100011101100 In base 11, what is -8326743 - -5? -8326739 In base 16, what is -2 + 64125d7? 64125d5 In base 4, what is -11 - 202030301331? -202030302002 In base 5, what is 0 - 10032041221? -10032041221 In base 15, what is -3ee - 8a3d2? -8a7d1 In base 9, what is -48345 + 412? -47833 In base 6, what is 150 - 110510204? -110510014 In base 3, what is 12020112101 + 22? 12020112200 In base 15, what is -2c3b70 + -4? -2c3b74 In base 16, what is -450 - 8715? -8b65 In base 15, what is 37dac6 - -2? 37dac8 In base 11, what is -1319 + -46a3? -5a11 In base 8, what is -3541 + 1625? -1714 In base 15, what is -ae3e - -2ce? -ab60 In base 8, what is 2 - -46422127? 46422131 In base 13, what is 42 - 48b44? -48b02 In base 13, what is -cc - 21263? -21362 In base 9, what is -6580 + -7727? -15417 In base 14, what is 1012c2 + 5a1? 101883 In base 9, what is 367 + -31831? -31453 In base 10, what is -25 - 79214? -79239 In base 10, what is -95766081 - -8? -95766073 In base 6, what is -11 - -1203133340? 1203133325 In base 16, what is -13b - 29393? -294ce In base 6, what is -132 + 4220332? 4220200 In base 14, what is 242310 - b? 242303 In base 7, what is -3421 + 143446? 140025 In base 15, what is -175 + ce6a? cce5 In base 9, what is 12350133 + -5? 12350127 In base 8, what is -4671062 + -373? -4671455 In base 5, what is 0 + 1312333214003? 1312333214003 In base 12, what is 1 + b001b92? b001b93 In base 9, what is 204 + -656581? -656376 In base 2, what is 1000 - -11110011111101? 11110100000101 In base 4, what is -202120202 + -3001? -202123203 In base 8, what is -3 + 1130252251? 1130252246 In base 10, what is 6340168 - -1? 6340169 In base 16, what is 3 + -c52f19? -c52f16 In base 8, what is -7302773 + 1? -7302772 In base 4, what is 1032322230113 - 0? 1032322230113 In base 7, what is 16006 + -22116? -3110 In base 14, what is -7 + -2b36c19? -2b36c22 In base 13, what is 1565687 - -3? 156568a In base 14, what is -21a + 32b6d? 32953 In base 4, what is -101121222032 - -20? -101121222012 In base 10, what is -79 - 4702027? -4702106 In base 4, what is 221 + -331110201330? -331110201103 In base 2, what is 1101011011100001010110 + 0? 1101011011100001010110 In base 9, what is -5138 + -48522? -54661 In base 8, what is 1151163451 - 4? 1151163445 In base 11, what is 3 + -8220721? -8220719 In base 13, what is -a9576 - -176? -a9400 In base 6, what is -140433 + 242? -140151 In base 4, what is 2113 + -2111211012? -2111202233 In base 7, what is -2 - 156115636? -156115641 In base 6, what is -1014411 - -12431? -1001540 In base 7, what is 15330355 - 43? 15330312 In base 9, what is 1240485 + -75? 1240410 In base 16, what is -1a - 8bba5? -8bbbf In base 12, what is 21 - -1b4974? 1b4995 In base 9, what is 0 + 4776854? 4776854 In base 12, what is -3 - -180b0b? 180b08 In base 10, what is 4 - -76379481? 76379485 In base 8, what is 5 - -23322142? 23322147 In base 5, what is -133 - -213003133? 213003000 In base 7, what is -4 - 556043102? -556043106 In base 15, what is 33 + -15574dc? -15574a9 In base 3, what is -2100110012 + -2220000? -2110100012 In base 7, what is -44614 + 63523? 15606 In base 4, what is 11 + -2203031310211? -2203031310200 In base 14, what is 4 + b51849? b5184d In base 13, what is -1a935 - -1a5? -1a760 In base 16, what is -4b0a1cc + 4? -4b0a1c8 In base 7, what is 123112 + -2245? 120534 In base 14, what is 1b4d - dcd2? -c183 In base 3, what is -2 + -20111122202121112? -20111122202121121 In base 14, what is 406c + -13b? 3d31 In base 12, what is -1139 - 213a? -3277 In base 5, what is -210432 + -2022? -213004 In base 8, what is 751136 + -530? 750406 In base 8, what is 45035 + -375? 44440 In base 13, what is -6 + 105338? 105332 In base 3, what is -121121 - -1001112120? 1000220222 In base 13, what is 657b32 - -94? 657bc6 In base 6, what is -14 + -50242022? -50242040 In base 6, what is 122 + -22500? -22334 In base 6	{ "pile_set_name": "DM Mathematics" }
is the second biggest value? (a) w (b) l (c) m b Let h = 8 + -3. Let m be (-2)/6(-4 + 7). Let y be -4 - 1 - (m - 1). Which is the third biggest value? (a) -0.5 (b) h (c) y c Let x = 104.5 - 105. What is the smallest value in 0.2, x, -0.6? -0.6 Let n = 188 - 188.3. What is the fourth biggest value in -5, 1/3, 0.1, n? -5 Let c = -140.9 - -145.9. What is the second biggest value in 20/7, 0.04, c? 20/7 Let h be (-45)/35 - (0 + -1). Suppose -3f = p + 17, -15 = 3p - 0. What is the smallest value in h, f, -9/2? -9/2 Let j = -101 - -82. Let i = 18.5 + j. Which is the smallest value? (a) -1/8 (b) -4/5 (c) i b Let y = -0.089 - -0.289. Suppose 16 = -p - 5f + 1, -2p - 15 = 5f. Which is the third smallest value? (a) 2/3 (b) y (c) p (d) 0.1 b Suppose -2y + 7 - 1 = 0, 3m + 4y = 2565. Let q = -1665/2 + m. Let h = 20 - q. Which is the second smallest value? (a) h (b) 5 (c) -2 a Let k = 1.29 + -1.39. Which is the second smallest value? (a) k (b) 5 (c) 33 (d) -4 a Let g = 0.05 + -0.35. Let o = -546 - -549. Let s = 0.3 + -0.3. What is the second smallest value in o, s, g? s Let h be (-2)/(-2) + (-7)/(-21)6. Which is the fourth biggest value? (a) -13 (b) h (c) -4 (d) -2/3 a Let i = 2.668 - -0.332. Which is the third biggest value? (a) -2/11 (b) -3 (c) i (d) 2/3 a Let u = -608/7 - -87. Let m = -72 + 71.7. What is the third smallest value in u, 0.11, m? u Let d = 80 - 127. Let i = 46.8 + d. What is the smallest value in -4, -23, i? -23 Let b be 6/4 + (-13)/6. What is the fourth smallest value in 4/3, b, -0.4, -1? 4/3 Let b = -5.94 - 0.06. Let h = b + 4.9. Let j = h - -0.7. What is the third biggest value in j, -1, 1? -1 Let v be 12293/(-114) + 4 + 1. Let i = v + 103. Which is the fourth biggest value? (a) -2.2 (b) -0.1 (c) 3/8 (d) i a Let s be 0 + 1 + (-9)/7. Let d = 0.2 + -1.2. Let v = -24.467 + 24.267. Which is the smallest value? (a) s (b) v (c) d c Let r = 0.22 + 37.78. Let v = 37.7 - r. Let y = 1.6 - 1.7. What is the smallest value in 0.1, v, y? v Let l = 60 + -62.7. Let f = l + 2.4. Let z = -2 - -1.8. Which is the second smallest value? (a) z (b) f (c) -2/7 c Let u = 0.054 + -6.084. Let f = -0.03 - u. Let z = -5.7 + f. Which is the third smallest value? (a) 0.1 (b) z (c) -0.2 b Let a = -102.18 + 2.18. Let n = 100 + a. What is the fourth biggest value in n, 4/5, 8, 2/3? n Let g = -94.8 + 94.4. Which is the biggest value? (a) g (b) -4 (c) -8 (d) 5 d Let k = 2.52 - 6.52. Which is the third biggest value? (a) 20 (b) k (c) 3 (d) 2 d Let q = -36 - -39. Which is the third smallest value? (a) -5 (b) -0.81 (c) -0.2 (d) q c Let n = 142 + -137.83. Let w = n + -1.17. Let p = -2/31 + -27/62. Which is the second smallest value? (a) w (b) p (c) -1 b Let h = 199 + -199.5. What is the smallest value in -4, -3/2, h, -1? -4 Let d = -0.0642 - 0.0358. Let y be 35/6(-2)/(-20). Let g = y + -71/60. What is the second biggest value in d, g, -0.4? -0.4 Let w = 112/793 + -18/61. Which is the smallest value? (a) w (b) -2 (c) -33 c Let q = 33.7 + -36.7. Which is the second biggest value? (a) 2/15 (b) 2 (c) 1 (d) q c Let v = 0.0015 + 55.0785. Let l = v + -55. Which is the smallest value? (a) l (b) 0.1 (c) 5 a Let l = -39/28 - -8/7. Let p = 1 + -0.96. Let o = p + -0.04. Which is the biggest value? (a) o (b) l (c) 1/5 c Let p = -0.09 + -0.21. Let z = 226 - 231. What is the fourth biggest value in -1, -3, p, z? z Let h = 2/21 - -5/21. Which is the biggest value? (a) 3 (b) h (c) -0.5 (d) 3/4 a Let t = 29.7 - 30. Let x be (30/8)/(-3) - -1. What is the third smallest value in -0.5, t, x? x Suppose -4g - 201 + 317 = 0. What is the third biggest value in g, -3, 0.5? -3 Suppose 0 = -152o + 165o + 52. What is the third smallest value in 2/29, 3, o, -3/8? 2/29 Let r be -2 + (-1)/(-2)22. Let n(d) = -d2 - 11d + 8. Let l be n(-12). Let x = r + l. What is the third biggest value in -5, -3, x? -5 Let j = 9185 - 9180. Let q = -1.07 + -0.03. Let l = -2.9 + q. What is the second biggest value in l, j, -3? -3 Let m be 437/(-1012) - (-1)/4. What is the second biggest value in -1, 0.3, 0.2, m? 0.2 Let g be (-19)/955/(-2). What is the second biggest value in -46, 4, g? g Suppose 4b = -5u + 17, -3u - 5b = -7u - 11. Let d = -10.22 + 0.22. Let w = 9.8 + d. What is the second biggest value in u, -3, w? w Let n = 1.48 + 125.52. Let w = 125 - n. What is the smallest value in w, -0.2, 1/6? w Let q = 114.4 - 114. What is the third biggest value in q, -6/5, 1? -6/5 Let n(h) = -h + 1. Let j = 5 + -2. Let d be n(j). Let l be 75/(-140) + d/(-8). What is the third smallest value in l, 1/2, -5? 1/2 Suppose -2j = n + 13, -4j + 2n + 137 = 143. Let w = 3.7 + -4. Which is the second biggest value? (a) -2/21 (b) w (c) j b Let i be ((-147)/(-33) - 2) + -3. Let j = 62 - 440/7. Which is the second smallest value? (a) -4 (b) i (c) j c Let g = -29.261 - 1.539. Which is the biggest value? (a) g (b) -0.1 (c) 2/13 c Let h = -19 + 35. Let s be (4/h)/(28/32). Which is the third biggest value? (a) -4 (b) 1/2 (c) s a Let n = -2.127 + -0.073. Let s = n - -2.6. Which is the third smallest value? (a) s (b) 2/7 (c) 1 c Let l = -6.65 + 3.05. Which is the third smallest value? (a) -4 (b) 0 (c) l b Let u = -0.28 + -0.02. Let d = -41 - -34. Let s = 9 + d. Which is the biggest value? (a) -0.2 (b) u (c) s c Suppose -205 = -i + 911. Suppose -144 = 2z + 2z. Let x be (-8)/z + (-176)/i. What is the third smallest value in x, -0.4, -5? x Let f = -0.3 + 1.3. Which is the biggest value? (a) -2/173 (b) 3/5 (c) 5 (d) f c Let f = 1.42 + -6.78. Let i = f + 0.36. Let w = -0.07 + 4.07. What is the smallest value in i, w, 1/5? i Let q = 20.28 - 20.38. Let i = 19 - 15.6. Let w = 0.6 + i. Which is the second biggest value? (a) w (b) 0.5 (c) q b Let m = 11485/21 + -547. Let x = -1.3 + 1. Let o be (-182)/140 - 2/10. Which is the third biggest value? (a) x (b) o (c) m b Let j = 40 + -28. Let c = -30 + j. What is the third biggest value in 3, c, -0.1? c Let h = -4 - -4.6. Let d = 1.1 + -1. Which is the third smallest value? (a) -0.3 (b) d (c) h c Let t(z) = -z3 - 2z*2 + 29z + 57. Let v be t(-2). Suppose 2 + 2 = c. Let o = -10 + c. What is the second biggest value in -4, o, v? -4 Let l be (-1)/(-4)(-152)/57. Which is the biggest value? (a) l (b) -1 (c) -1/3 (d) -0.05 d Let l = -0.34 + -0.96. Let s = 0.3 + l. Let j = -397 + 397.3. Which is the second smallest value? (a) s (b) j (c) -2/19 c Suppose 401 = 50m + 1. Which is the third biggest value? (a) m (b) -2/5 (c) 4/5 (d) -3 b Let f = 1.1 - 0.7. Let q = 0.04 + -0.54. Let s = f + q. What is the third biggest value in -0.2, s, 1/2? -0.2 Let g = 0.13 + -8.13. Let w = 20.8 - 24.8. Let q = w - g. Which is the third biggest value? (a) -2/5 (b) q (c) 5 a Let x = 1 + 13. Let s = x - 14.3. What is the biggest value in s, 5, 4/5? 5 Let d = -104.5 + 104. Which is the second smallest value? (a) -6 (b) 4 (c) d c Let l be -1 + ((-10)/(-14) - 0). Let o = 0.2779 - 0.0779. What is the second smallest value in 9, l, o? o Let p = -0.29 - -0.3. Let m = p + -0.81. Let k = m + -1.2. What is the third biggest value in k, 1/3, -3? -3 Let n = 12.8 + -12.5. Let r = -2.1 - -2. Which is the biggest value? (a) r (b) n (c) -1 b Let y(n) = 3n + 2. Suppose 3l + 3t - 2 = -5, 3t = 4l + 11. Let h be y(l). Which is the second biggest value? (a) h (b) 3/2 (c) 2 b Let o = 0.024 + 0.176. Let j = 16.3 - 2.3. Which is the third biggest value? (a) o (b) 3 (c) j a Suppose -42m = -39m - 15. Suppose -md = -d - 8, -4d = -4a - 64. What is the third biggest value in a, -1/4, -5? a Let g = -0.0356 - 3.9644. Let v = -2 + 3.5. Let t = v - 1. Which is the second biggest value? (a) g (b) -1 (c) t b Let q = -33.9 - -32. Let g = -1.1 + q. Let h = -3.4 + 3. What is the third biggest value in 2/11, h, g? g Let m be ((-2)/5)/(520/(-50) - -8). Which is the biggest value? (a) 3 (b) m (c) 0 a Let z be (-9)/(-10) - 1 - (-6)/10. Which is the fourth biggest value? (a) 1 (b) 1/4 (c) -0.2 (d) z c Suppose 3*z + 14 = 2. Let x be 1/(-6) + (4 - 4). Let s = 5 - 7. What is the third smallest value in s, z, x? x Let d = -1.77 + -74.23. Let t = -75.9 - d. What is the second smallest value in t, -2, 0.4? t	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.