Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
96729 What is next in -3896, -3230, -2592, -1994, -1448, -966, -560? -242 What is next in -153343, -153349, -153343, -153313, -153247, -153133, -152959? -152713 What is the next term in -294, -4601, -16310, -39123, -76742, -132869, -211206? -315455 What comes next: -14554, -29261, -43926, -58549? -73130 What is the next term in -1896823, -3793646, -5690469, -7587292? -9484115 What is next in -3437688, -6875370, -10313052, -13750734, -17188416, -20626098? -24063780 What is next in -2842136, -5684275, -8526414, -11368553? -14210692 What is next in -8537, -34581, -78127, -139175? -217725 What comes next: -10661, -10983, -11869, -13607, -16485, -20791? -26813 What comes next: -3510, -502, 2506? 5514 What is next in -3886, -3877, -3866, -3853, -3838? -3821 What is the next term in -15266, -16740, -18198, -19628, -21018, -22356? -23630 What is next in -2877, -13796, -32029, -57576? -90437 What comes next: -78521, -156980, -235377, -313712, -391985, -470196? -548345 What comes next: 351109, 702160, 1053211, 1404262, 1755313, 2106364? 2457415 What comes next: 1031, 2077, 3099, 4091, 5047, 5961? 6827 What is next in -692, -59, 654, 1447, 2320, 3273? 4306 What is next in -4392, -8596, -12820, -17070, -21352, -25672? -30036 What comes next: 654981, 2619669, 5894065, 10478169, 16371981? 23575501 What is the next term in -5134867, -20539464, -46213793, -82157854, -128371647, -184855172, -251608429? -328631418 What comes next: -6364, -6473, -6654, -6907, -7232, -7629, -8098? -8639 What comes next: -5664, -11166, -16586, -21882, -27012? -31934 What comes next: 10353, 20245, 29679, 38655? 47173 What comes next: 600, -4419, -12782, -24489? -39540 What is next in -599, -1281, -2475, -4427, -7383, -11589, -17291? -24735 What is next in -12461, -20164, -27867, -35570, -43273, -50976? -58679 What comes next: -2939, -6191, -9467, -12785, -16163? -19619 What comes next: 52313, 52457, 52635, 52865, 53165? 53553 What comes next: -10818449, -10818448, -10818447? -10818446 What is the next term in -972, -1014, -1046, -1050, -1008, -902, -714, -426? -20 What comes next: 42780, 84570, 126346, 168102, 209832, 251530, 293190? 334806 What is next in 2970, 10381, 22230, 38517, 59242? 84405 What is the next term in -13065, -52483, -118181, -210159, -328417, -472955, -643773? -840871 What is the next term in 1105, -10151, -21405, -32657? -43907 What comes next: -2235624, -4471241, -6706850, -8942451, -11178044? -13413629 What is next in -16371517, -16371515, -16371513, -16371511? -16371509 What is next in 12440, 12328, 12216, 12104, 11992? 11880 What is next in -1016340, -1016342, -1016344, -1016346, -1016348, -1016350? -1016352 What comes next: -6095380, -6095361, -6095316, -6095233, -6095100, -6094905, -6094636? -6094281 What comes next: 26886, 54025, 81420, 109071, 136978? 165141 What is the next term in 63125, 253363, 570711, 1015169, 1586737, 2285415, 3111203? 4064101 What comes next: -11388, -11409, -11370, -11241, -10992, -10593, -10014, -9225? -8196 What is next in -4944, -40017, -135590, -322035, -629724, -1089029, -1730322? -2583975 What comes next: -17435, -69782, -157029, -279176, -436223, -628170? -855017 What comes next: 245450, 490652, 735854, 981056, 1226258? 1471460 What is the next term in -3384, -7310, -13854, -23022, -34820? -49254 What is the next term in 182290536, 364581075, 546871614? 729162153 What comes next: -803979, -803967, -803955, -803943, -803931? -803919 What comes next: -1114, -5741, -10368, -14995, -19622? -24249 What is the next term in -238, 1835, 6218, 12911, 21914? 33227 What is next in 6052, 13336, 20620, 27904, 35188, 42472? 49756 What is the next term in -8061, -16333, -24773, -33465, -42493, -51941, -61893, -72433? -83645 What comes next: -258, -548, -992, -1662, -2630, -3968? -5748 What is next in -400262, -400756, -401580, -402734, -404218? -406032 What comes next: 1714007, 1714008, 1714007, 1714004, 1713999, 1713992? 1713983 What comes next: -36207, -72456, -108717, -144990, -181275, -217572, -253881? -290202 What comes next: -5793598, -11587191, -17380784, -23174377? -28967970 What comes next: -7984, -63889, -215640, -511159, -998368? -1725189 What is the next term in 329, 1263, 3795, 8723, 16845, 28959, 45863, 68355? 97233 What is next in 22343514, 22343515, 22343516, 22343517? 22343518 What is the next term in -571195, -570835, -570241, -569413? -568351 What is the next term in -3940410, -7880738, -11821066, -15761394, -19701722? -23642050 What is next in -359, -195, 55, 433, 981, 1741? 2755 What is next in -13080, -104531, -352736, -836067, -1632896, -2821595, -4480536, -6688091? -9522632 What is next in 710213, 1420505, 2130797, 2841089? 3551381 What comes next: -1048, -4052, -9018, -15940, -24812, -35628, -48382? -63068 What is the next term in -31446588, -31446588, -31446586, -31446582, -31446576, -31446568, -31446558? -31446546 What comes next: -3247, -3436, -4151, -5656, -8215, -12092, -17551, -24856? -34271 What is next in -35, 391, 1203, 2443, 4153, 6375? 9151 What comes next: -42931, -42890, -42825, -42730, -42599, -42426, -42205, -41930? -41595 What is next in -663, -193, 547, 1557, 2837, 4387, 6207? 8297 What is next in 7061, 56374, 190137, 450542, 879781, 1520046, 2413529? 3602422 What is next in -5764024, -5764037, -5764060, -5764099, -5764160, -5764249, -5764372, -5764535? -5764744 What is next in -8254727, -16509455, -24764183, -33018911, -41273639, -49528367? -57783095 What is next in -144025, -577099, -1299219, -2310379, -3610573? -5199795 What comes next: -2368030, -2368019, -2368006, -2367991, -2367974? -2367955 What is next in 63947, 63877, 63761, 63599, 63391, 63137? 62837 What is next in 1098, 1878, 2352, 2520, 2382? 1938 What is the next term in -302113576, -302113577, -302113578, -302113579, -302113580? -302113581 What is the next term in 2435, 4918, 7447, 10022, 12643, 15310, 18023? 20782 What is the next term in 31191, 32450, 33697, 34926, 36131, 37306, 38445? 39542 What is next in 84, 3735, 13640, 32925, 64716, 112139, 178320, 266385? 379460 What is next in -3487, -7014, -10543, -14080, -17631? -21202 What is the next term in 3748519, 7497045, 11245571, 14994097, 18742623, 22491149? 26239675 What is next in -31550992, -31551020, -31551048, -31551076? -31551104 What is next in -7130, -29016, -65500, -116582, -182262? -262540 What is next in -31765, -63644, -95583, -127612, -159761? -192060 What is next in -21951, -9211, 3525, 16257? 28985 What is the next term in 199442, 1595699, 5385538, 12765749, 24933122, 43084447, 68416514, 102126113? 145410034 What comes next: 4185, 10210, 20257, 34332, 52441, 74590, 100785, 131032? 165337 What comes next: 175135, 175083, 175017, 174931, 174819, 174675, 174493? 174267 What is the next term in -402, -573, -922, -1497, -2346, -3517, -5058? -7017 What is the next term in -166, 115, 600, 1283, 2158, 3219, 4460? 5875 What comes next: 19819, 40321, 60823, 81325, 101827? 122329 What is next in -11302191, -22604404, -33906631, -45208866, -56511103, -67813336, -79115559? -90417766 What is the next term in 5849558, 5849563, 5849570, 5849579? 5849590 What comes next: 2033, 8126, 18287, 32522, 50837, 73238, 99731, 130322? 165017 What is the next term in 950, 3473, 10388, 23915, 46274, 79685? 126368 What is next in -96814, -193695, -290592, -387511, -484458? -581439 What is the next term in 62333, 62326, 62295, 62228, 62113? 61938 What is next in -755, 61, 1431, 3355? 5833 What is the next term in 1286, 1516, 1842, 2252, 2734, 3276, 3866, 4492? 5142 What is next in 132057795, 132057796, 132057797, 132057798, 132057799, 132057800? 132057801 What is the next term in -279478, -558811, -838144? -1117477 What is the next term in -339863, -1358541, -3056337, -5433251, -8489283, -12224433? -16638701 What is the next term in 1612, 12018, 29366, 53656, 84888, 123062, 168178? 220236 What comes next: 12745517, 25491066, 38236615, 50982164? 63727713 What comes next: 1435, 1589, 1837, 2179, 2615, 3145? 3769 What comes next: -711, -1269, -2121, -3189, -4395, -5661? -6909 What is the next term in 55171, 55630, 56891, 59356, 63427? 69506 What comes next: 1108972, 4435901, 9980782, 17743615? 27724400 What is the next term in -2248, -2040, -1850, -1684, -1548, -1448? -1390 What is next in 38	{ "pile_set_name": "DM Mathematics" }
of 136 and 11. 1496 Calculate the smallest common multiple of 2 and 8. 8 Calculate the smallest common multiple of 170 and 476. 2380 Calculate the least common multiple of 6 and 38. 114 Calculate the least common multiple of 420 and 126. 1260 Find the common denominator of 17/108 and -73/56. 1512 Calculate the common denominator of -61/22 and -23/258. 2838 Calculate the lowest common multiple of 41 and 684. 28044 Calculate the least common multiple of 1270 and 2540. 2540 Calculate the least common multiple of 102 and 10. 510 Calculate the lowest common multiple of 584 and 64. 4672 What is the smallest common multiple of 116 and 10? 580 What is the least common multiple of 66 and 114? 1254 Calculate the common denominator of 97/88 and -1/6. 264 Calculate the smallest common multiple of 292 and 2. 292 Find the common denominator of 3/49 and -23/70. 490 Find the common denominator of 31/18 and -55/2014. 18126 Calculate the lowest common multiple of 40 and 28. 280 Calculate the common denominator of -13/504 and -109/48. 1008 What is the least common multiple of 2348 and 32? 18784 Calculate the common denominator of -67/168 and -61/141. 7896 Calculate the common denominator of -53/7 and -41/4162. 29134 Calculate the common denominator of -41/117 and -17/702. 702 Find the common denominator of 59/4 and 181/30. 60 Calculate the common denominator of -76/945 and 121/36. 3780 What is the common denominator of 1/784 and -49/68? 13328 What is the lowest common multiple of 130 and 156? 780 What is the common denominator of -101/2026 and 61/4? 4052 Find the common denominator of -145/108 and -23/10. 540 What is the least common multiple of 10 and 488? 2440 What is the lowest common multiple of 986 and 696? 11832 Calculate the least common multiple of 88 and 8. 88 What is the common denominator of -83/68 and -8/17? 68 Calculate the common denominator of -137/162 and 59/594. 1782 Calculate the common denominator of 81/10 and -57/568. 2840 Find the common denominator of 43/45 and -23/18. 90 Calculate the smallest common multiple of 36 and 132. 396 What is the least common multiple of 124 and 108? 3348 Calculate the common denominator of 33/35 and 74/6265. 6265 Find the common denominator of 36/3845 and -106/105. 80745 Calculate the smallest common multiple of 8 and 2326. 9304 What is the lowest common multiple of 10 and 684? 3420 What is the least common multiple of 2015 and 50? 20150 What is the least common multiple of 5 and 25? 25 Calculate the smallest common multiple of 11817 and 808. 94536 Calculate the common denominator of -103/144 and -73/96. 288 Calculate the smallest common multiple of 299 and 4324. 56212 Calculate the least common multiple of 64 and 128. 128 What is the least common multiple of 1547 and 1547? 1547 What is the common denominator of 115/594 and -43/198? 594 What is the common denominator of 107/240 and -173/120? 240 What is the least common multiple of 24 and 14? 168 What is the common denominator of 89/996 and 35/156? 12948 What is the least common multiple of 16 and 82? 656 Calculate the lowest common multiple of 360 and 240. 720 What is the smallest common multiple of 379 and 1? 379 Find the common denominator of -67/549 and -19/3. 549 What is the least common multiple of 6 and 78? 78 Calculate the common denominator of -163/30 and -46/10407. 104070 Calculate the smallest common multiple of 52 and 12. 156 What is the least common multiple of 4158 and 2268? 24948 Calculate the smallest common multiple of 56 and 48. 336 Calculate the smallest common multiple of 945 and 35. 945 Calculate the smallest common multiple of 2980 and 1788. 8940 What is the lowest common multiple of 56 and 91? 728 What is the common denominator of 115/16366 and 61/16? 130928 Calculate the common denominator of -59/3605 and -11/1545. 10815 What is the least common multiple of 8 and 8412? 16824 Calculate the smallest common multiple of 32 and 12. 96 What is the common denominator of 11/93 and -18/217? 651 Calculate the common denominator of 31/40 and -19/90. 360 What is the common denominator of 85/224 and 25/112? 224 What is the common denominator of -13/30 and -31/282? 1410 What is the common denominator of -70/57 and -35/38? 114 What is the common denominator of -40/177 and 119/36? 2124 What is the smallest common multiple of 1859 and 154? 26026 What is the least common multiple of 1395 and 7? 9765 Calculate the common denominator of -97/140 and 71/70. 140 Calculate the lowest common multiple of 24 and 436. 2616 What is the smallest common multiple of 33 and 8418? 92598 Find the common denominator of -48/395 and -61/35. 2765 What is the common denominator of 23/4 and -10/3551? 14204 Calculate the common denominator of 67/6772 and -77/2. 6772 Calculate the least common multiple of 2 and 14. 14 Calculate the smallest common multiple of 3072 and 448. 21504 Calculate the lowest common multiple of 100 and 530. 5300 Calculate the least common multiple of 1425 and 133. 9975 What is the smallest common multiple of 39 and 78? 78 What is the common denominator of 85/166 and 13/7? 1162 What is the smallest common multiple of 110 and 4? 220 Calculate the smallest common multiple of 14 and 35. 70 What is the lowest common multiple of 650 and 104? 2600 Calculate the common denominator of 7/6 and 7/194. 582 Calculate the common denominator of 113/8344 and -27/10. 41720 Calculate the common denominator of 37/60 and -71/420. 420 What is the least common multiple of 18 and 10218? 30654 What is the smallest common multiple of 33 and 447? 4917 Calculate the lowest common multiple of 116 and 116. 116 What is the smallest common multiple of 6 and 14? 42 What is the smallest common multiple of 213 and 18? 1278 What is the lowest common multiple of 1221 and 22? 2442 What is the smallest common multiple of 1068 and 1157? 13884 Calculate the smallest common multiple of 44 and 44. 44 Find the common denominator of 145/126 and -61/42. 126 What is the common denominator of -27/2497 and -5/2043? 22473 Calculate the smallest common multiple of 1 and 589. 589 What is the smallest common multiple of 1160 and 1860? 107880 Find the common denominator of 13/45 and 26/1167. 17505 Calculate the least common multiple of 35 and 405. 2835 Calculate the smallest common multiple of 232 and 32. 928 What is the smallest common multiple of 6454 and 10? 32270 Calculate the common denominator of -71/100 and -119/36. 900 What is the smallest common multiple of 25 and 24? 600 What is the common denominator of 7/2264 and -1/4528? 4528 What is the lowest common multiple of 114 and 2? 114 What is the common denominator of 28 and -45/107? 107 Find the common denominator of -41/579 and 50/579. 579 Calculate the common denominator of -139/162 and 31/8. 648 What is the common denominator of 75/56 and 52/35? 280 Calculate the common denominator of 37/458 and -71/2. 458 Find the common denominator of -64/45 and -5/171. 855 Calculate the lowest common multiple of 292 and 1022. 2044 Calculate the lowest common multiple of 28 and 316. 2212 What is the common denominator of 77/2110 and 117/40? 8440 Find the common denominator of -79/624 and -41/60. 3120 Calculate the lowest common multiple of 274 and 14. 1918 What is the common denominator of -101/24 and -151/186? 744 Calculate the least common multiple of 384 and 1152. 1152 Calculate the least common multiple of 2 and 3. 6 Find the common denominator of -43/154 and 88/63. 1386 Calculate the lowest common multiple of 6 and 1046. 3138 What is the common denominator of -111/644 and -97/2? 644 Find the common denominator of 93/2 and 35/158. 158 What is the common denominator of -23/36 and 173/630? 1260 Calculate the common denominator of 25/2712 and -83/3390. 13560 What is the lowest common multiple of 66 and 198? 198 Calculate the common denominator of 25/27 and -121/120. 1080 Find the common denominator of -49/7010 and 43/12. 42060 Calculate the common denominator of 8/1119 and 50/33. 12309 What is the smallest common multiple of 2 and 264? 264 What is the least common multiple of 2194 and 5? 10970 What is the common denominator of -41/22 and 61/132? 132 Find the common denominator of -181/9690 and 19/45. 29070 Find the common denominator of -59/351 and -71/78.	{ "pile_set_name": "DM Mathematics" }
d by n? 21 Let i(x) = 7x - 3. What is the remainder when 138/(9/6 - (4 + 1)/(-10)) is divided by i(4)? 19 Suppose -3c = 3x - 348, 2c = -2x + 5x + 232. Let a(k) = 3k2 + 167k - 36. Calculate the remainder when c is divided by a(-56). 16 Suppose 423 = h - u, 7h + 5u - 7u - 2991 = 0. What is the remainder when h is divided by 60? 9 Let r(q) = -19q - 32. Let j be ((-6)/4)/(27/72). Calculate the remainder when r(j) is divided by 16. 12 Let l = 8670 + -8000. Calculate the remainder when l is divided by 61. 60 Suppose 3a + 10 = 5y - 3y, -5y + 2a = -25. Suppose 0 = q + y, u - 3u - 18 = 2q. Calculate the remainder when 63 is divided by u/12 - 43/(-3) - 1. 11 Let m = 737 - 426. What is the remainder when m is divided by (3 - 8/3) + 564/9? 59 Let g(w) = 3w*2 - 22w + 35. Let n be g(5). Suppose n = 22k - 1554 - 3858. What is the remainder when k is divided by 13? 12 Suppose -4f = -16f + 24. Suppose fi + 8i - 450 = 0. What is the remainder when i is divided by 24? 21 Let d = -115 + 121. Let g be (-5 - (-2 + -1)) + -3. Let a(j) = -j3 - 4j*2 - j - 1. Calculate the remainder when a(g) is divided by d. 5 Suppose 0 = -y + 2, -52d = -48d - 3y - 282. Let k = -443 - -799. Calculate the remainder when k is divided by d. 68 Suppose -80k = -90k + 3700. Let r = 378 - k. Calculate the remainder when 98 is divided by r. 2 Suppose -4g = -5k + 320, 3g + 192 = 3k - g. Suppose -354a + 351a + r + 113 = 0, -a + 2r + 31 = 0. Calculate the remainder when k is divided by a. 25 Let i = -9658 + 9678. What is the remainder when 3377 is divided by i? 17 Suppose 0 = -81q + 76q - o + 87, 42 = 2q + 4o. Suppose 5a - 749 = -c + 1101, -757 = -2a + 3c. Calculate the remainder when a is divided by q. 14 Suppose 32h = 31h + c + 32, 0 = 3h + c - 72. Calculate the remainder when 779 is divided by h. 25 Let z(o) = -16o*3 - 36o*2 + 30o + 300. What is the remainder when z(-8) is divided by 96? 92 Suppose 11l - 30l + 57 = 0. Suppose 2y - 202 = -lg - 2y, -3y = 3g - 207. Let k = -67 + g. What is the remainder when 7 is divided by k? 0 Let m(q) = 10 - 12q - 14 + 12 - 37 - 25. Calculate the remainder when 22 is divided by m(-5). 4 Let m = -15 - -11. Let s be 6400/26 - m/(-26). Suppose 0 = 2o + 5i - 245, -s = -4o - 5i + 239. Calculate the remainder when o is divided by 41. 38 Let o(p) be the first derivative of -p*3/3 + 4p*2 + 12p + 136. Calculate the remainder when 63 is divided by o(0). 3 Let x = -3908 - -5580. Calculate the remainder when x is divided by 31. 29 Let f(a) = -68 - 129 + 101 + 36a - a2. Let s = 33 + -21. What is the remainder when s is divided by f(33)? 0 Let r(q) be the second derivative of q5/20 - 7q*4/12 + 5q*3/6 - 6q*2 + 15q. What is the remainder when 320 is divided by r(7)? 21 Let h be -14 + 17 + (-655 - 2). Calculate the remainder when 73 is divided by h/(-14) - (8/14)/(-2). 26 Let j be 433/15 + (-4 - (-62)/15). Suppose -27u - 78 = -ju. What is the remainder when u is divided by 14? 11 Let z be 12 + (7 - (17 + -10)). Suppose r - 2r = -4m + 282, -4r = -zm + 134. What is the remainder when m is divided by 3? 2 Suppose 19 + 15 = l. Suppose 5g - l = 4o, -2g + 17o + 15 = 14o. What is the remainder when 44 is divided by g? 2 Let u be (-14)/21(0 - 6). Suppose 0 = -5f + 4z + 188, -106 = -3f + 3z - uz. What is the remainder when 286 is divided by f? 34 Suppose 5b + 2 + 13 = 0. Calculate the remainder when 5(198/(-5))/b is divided by 8 - (-382)/14 - (-54)/(-189). 31 Let f = 9573 + -8697. What is the remainder when f is divided by 8? 4 Let r = 0 - -8. Calculate the remainder when 261 - 196/(4 + 10) is divided by r. 7 Let n be -6 - 1305/(2 - 7). Suppose 24l + n = 29l + 4c, 4c = -l + 51. Calculate the remainder when 191 is divided by l. 38 Let t be 171/(-1)(-28)/42. Calculate the remainder when 1520/t(-18)/(-8) is divided by 7. 2 Suppose -2f = f - 381. Let g(s) = 735s + 18415. Calculate the remainder when f is divided by g(-25). 7 Let s = 17540 - 16949. Calculate the remainder when s is divided by 13. 6 Suppose 0 = 7b - 38 - 46. Let n(a) = a2 - 18a + 62. Calculate the remainder when n(19) is divided by b. 9 Suppose -8m - 7m = 3m. Let h(k) = k3 + 8k*2 - 3k + 16. Suppose -3c = -q + 55 + 68, 2q + 5c = 191. What is the remainder when q is divided by h(m)? 12 Let o = 146 - 130. Suppose 0 = -a + 2b + o, -5a + 7b = 2b - 80. What is the remainder when 205 is divided by a? 13 Let o(d) = d2 + 27d - 10. Let l be o(-27). What is the remainder when 129 is divided by 16/l(-4)/16110? 41 Let r(k) = -3k - 8. Let c be r(-6). Let f = 5 + c. Calculate the remainder when (-11360)/(-210) - (1892/(-462))/(-43) is divided by f. 9 Suppose 62 - 7 = 5w. Suppose 223l = -3515 + 18010. What is the remainder when l is divided by w? 10 Let r(j) = -11j*2 - 5j - 2. Let z(u) = 0u2 + 8u + 2u - 9u + u*2. Let t(k) = -r(k) - 5z(k). Calculate the remainder when t(2) is divided by 7. 5 Let x = -20730 - -20914. Calculate the remainder when 212 is divided by x. 28 Let d(g) = 67g2 + 637g + 86. Calculate the remainder when d(-11) is divided by 593. 0 Let w(c) = 23c + 52 - 28c - c*3 - 89 + 33c*2 + 2c*3 + 2c*3. What is the remainder when 141 is divided by w(-11)? 15 Let z(a) = 2a*2 - 12a + 7. Let d = 192 - 178. Suppose -7r = -dr + 791. Calculate the remainder when r is divided by z(8). 35 Let g be 14/(-4)(-20)/14. Suppose 33 = -gc - 32. Let b(t) = -t*3 - 13t*2 + 29. Calculate the remainder when b(c) is divided by 16. 13 Let l = 67 + -68. Let d(g) = 89g*2 + 4g + 5. Calculate the remainder when d(l) is divided by 24. 18 What is the remainder when 282 is divided by 8 + (-5 - (-1 + -2)) + 4? 2 Let l = 4161 + -4020. What is the remainder when 843 is divided by l? 138 Let n be (0/3)/((-12)/4). Suppose n = -j + 5b + 7, -3j + 3b - 5b + 89 = 0. Suppose u - j = -6. Calculate the remainder when 62 is divided by u. 20 Let x = -8 + 12. Suppose x - 44 = -8j. Suppose 188 = 3l - jd, -2l + 5d = 3l - 320. Calculate the remainder when l is divided by 10. 6 Let g(m) = 4m2 + 2m + 27. Let f = -368 + 365. What is the remainder when 134 is divided by g(f)? 20 Let y = -10 + 3. Let t(z) = 5z2 - 3z - 3. Calculate the remainder when t(5) is divided by -55(y + (5 - -1)). 52 Let k = 57 + 14. Suppose -17d = -19d + 4. What is the remainder when k is divided by 5 - d52/(-8)? 17 Let y(w) = -w*2 + 19w - 9. Suppose 14 = 3i - 52. Let j be y(i). What is the remainder when 74 is divided by (j/10)/((-2)/4)? 14 Let u(s) = 23s + 70. Let w be u(-14). Let z = w - -335. What is the remainder when 159 is divided by z? 76 Let t = 6 + 7. Let x = -28008 - -28081. Calculate the remainder when x is divided by t. 8 Suppose 369q - 520 = 364q. Suppose -12c + q = -4c. What is the remainder when 896 is divided by c? 12 Suppose w = -2b + 2121, -3w - 1 = 14. What is the remainder when b is divided by 175? 13 Calculate the remainder when -2 - (-894)/2 - 0 is divided by (3 + 0 + 11)610/30. 25 Suppose -6x + 620 = -2x. Suppose -2y + 6y = 0. Suppose 3a = 2c - 303, c + 2a + ya = x. Calculate the remainder when c is divided by 22. 21 Let t = 54 - -1. What is the remainder when 53(-12 - (-486)/42)-7 is divided by t? 49 Let a = -93 - -97. Suppose 0u + 133 = 3u - 2z, -3u + az + 125 = 0. What is the remainder when u is divided by ((-1)/(-2))/(86/768)? 7 Let l(j) = 14j + 10. Let y be l(-3). Let f = 1 - y. Let c(d) = -d2 + 5d + 3. What is the remainder when f is divided by c(4)? 5 Let h(r) = r*2 - 13r - 22. Let b be h(17). Let a be 2 + b - (-1 - -5). Let x = a + -32. What is the remainder when 59 is divided by x? 11 Let z(m) = -m*2 - 15m + 37. Let r be z(-17). Suppose -7y + 11y = t - r, y = t - 6. Calculate the remainder when 230 is divided by t. 6 Let u be -39 + (4 - 2/2). Let j = 38 + u. Suppose 0 = -4g - 3n + 309, 3g + jn = 7g - 294. Calculate the remainder when g is divided by 19. 18 Let z = 1762 - 910. Calculate the remainder when z is divided by 95. 92 Let i = 305 + -297. Suppose 3o = -5c + 266, -io = -9o + c + 86. Calculate the remainder when 257 is divided by o. 83 Suppose 4z = 3j - 208 + 1558, z = 3j + 324. What is the remainder when z is divided by	{ "pile_set_name": "DM Mathematics" }
ppose -5k + 892 = 3z, 3k - d = -z - 155. What is the units digit of k? 9 Suppose 30 = 5y + 3r - 1217, -4y + 997 = 3r. Suppose 4f + y = -f. What is the tens digit of f/((-4)/2) - 2? 2 Let i(k) = -k*3 + 4k*2 - 2k + 6. Let h be i(4). Let n be -4 - (h - 5)-1. Let c = n - -23. What is the tens digit of c? 1 Let p = -7 - -13. Let h(n) = n2 - 6n + 6. Let t be h(p). Suppose u = 4u - 4w - 17, u = w + t. What is the units digit of u? 7 Let j be (-8)/(-20) - 6326/(-10). What is the tens digit of j(-1)/(-3) + -3? 0 Let s(a) = a - 4 + 0a - 4a + a. Let y be s(-4). Let x = 25 + y. What is the tens digit of x? 2 Let i(d) = -d3 + 9d*2 + 17d - 4. What is the tens digit of i(10)? 6 Let p = 110 - -1203. What is the thousands digit of p? 1 Let z(x) be the first derivative of x*4/4 - 16x*3/3 + 8x*2 - 6x + 17. What is the units digit of z(15)? 9 Let l(v) be the second derivative of 29v4/6 - v2/2 - 2v. Let s(z) = -z*2 + 9z + 1. Let x be s(9). What is the units digit of l(x)? 7 Let x(i) = 35i - 414. What is the hundreds digit of x(29)? 6 Let y = 472 + 22. What is the tens digit of y? 9 Suppose -5u = 4y - 12213, 3 = -u + 8. What is the thousands digit of y? 3 Suppose -3f + q = 3q - 2, f - 3q + 3 = 0. What is the units digit of ((-3 - -1)-1 - f)31? 2 Suppose 4l = 4, -8l - 7641 = -4x - 9l. What is the units digit of x? 0 Let y(f) = f*2 + 7f - 18. Let p(z) = z*3 - 4z*2. Let d be p(3). Let n be y(d). Suppose 3h + nj = j + 56, -60 = -4h + 5j. What is the tens digit of h? 2 Suppose -2l = -4l. Suppose x - 3 - 39 = l. Suppose -24 = -3s + x. What is the units digit of s? 2 Let j(q) = 3q3 - 5q + 11. Let m(n) = n3 + n2 - n. Let l(s) = j(s) - 4m(s). What is the units digit of l(-5)? 1 Suppose -u = 2u + 6, -3r + 4u = -251. Let n = 129 - r. What is the tens digit of n? 4 Suppose 2u = -2u + 12. Let c be (-2)/(-5) - (-2)/(-5) - -28. Suppose c = -uy + 4y. What is the tens digit of y? 2 Let c = 3031 - 922. What is the thousands digit of c? 2 Let r be 153/21 + (-10)/35. Suppose 4t + 333 = rt. What is the hundreds digit of t? 1 Let z(w) = 119 + 2w3 + w2 - 2w*2 - 11w + 13w. What is the hundreds digit of z(0)? 1 Suppose 5y - 5355 = -3c, -1091 - 1082 = -2y + 5c. What is the thousands digit of y? 1 Let i = 55 - 51. Let y(m) = 2m*3 - 4m*2 + 5m - 2. What is the units digit of y(i)? 2 Let t(z) = 366z2 + 27z + 2. What is the thousands digit of t(3)? 3 Let u be ((-7)/21)/(1/177). Let y = -6 - u. What is the tens digit of y? 5 Let p(q) = 16q2 + 30q + 26. What is the tens digit of p(-6)? 2 Let i(g) = 11g3 - 2g*2 - 4g + 4. Suppose 7 = 3o + 1. What is the units digit of i(o)? 6 Suppose 4d + 2011 - 6539 = 0. What is the tens digit of d? 3 Suppose 12u - 14u = -912. What is the tens digit of u? 5 Let l(w) = -w*2 + 6w + 11. Let v be l(13). Let g = v - -193. What is the hundreds digit of g? 1 Let i(u) = -u*2 - 13u + 18. Let v be i(-15). What is the tens digit of ((-6)/v)/((-2)/(-292))? 7 Suppose -10p + 1076 = -2264. Suppose -2x + 3f + p = -f, -3x + 496 = -f. What is the tens digit of x? 6 Suppose -5o = -45 + 5. Suppose -2f - of + 450 = 0. What is the units digit of f? 5 Let j = 104 - 45. Suppose -5y = -3l + 171, -4l + 2 = y + 50. Let w = j + y. What is the units digit of w? 3 Let w(f) = f3 + f2 + 2f. Let n = 0 + -2. Let r be w(n). What is the units digit of -1 - (-4 + 3) - r? 8 Let f = 1452 - 886. What is the hundreds digit of f? 5 Suppose 9i + 30 = 4i. Let m = -3 - i. Suppose -mw + 36 + 6 = 0. What is the tens digit of w? 1 Suppose 50 = 11b - b. Suppose -c = 1 + 3, -f = 3c + 10. Suppose 0 = -ft + 5k + 16, -2t + bt + 5k = -1. What is the units digit of t? 3 Let k be 0 - -1(-6)/(-2). Let h(p) = 11p - 4. Let m be h(k). Suppose -5 = 2n - m. What is the tens digit of n? 1 Let w = 51 + 124. What is the hundreds digit of w? 1 Suppose -13h - 138 = -4116. What is the hundreds digit of h? 3 Suppose z + 2z = h + 412, 2z + 5h = 252. What is the units digit of z? 6 Let y(g) = g*3 - 6g*2 + 2. Let z be ((-6)/8)/(1/(-8)). Let a be y(z). Suppose 3j - 36 = -3p, -2j - 36 = -p - ap. What is the units digit of p? 2 Let n = -424 - -997. What is the tens digit of 3/(-6) - (n/(-6) + -3)? 9 Let i be (-28)/5(-2635)/34. Suppose 9m - 2414 = -i. What is the tens digit of m? 2 Let q = 33 + 7. What is the tens digit of (-100)/(-2)-1q/(-25)? 8 Let i(j) = 118j - 310. What is the hundreds digit of i(6)? 3 Suppose 3m = 3k + 2054 + 172, 6m + 5k = 4419. What is the tens digit of m? 3 Suppose 5v + 4d = -0v + 387, -3d = 6. Let w = -49 + v. What is the tens digit of w? 3 Let a be ((-12)/(-5))/((-18)/(-2340)). Let l = a - 208. What is the units digit of l? 4 Let d = -11 - -19. Let z be d/129/2. Suppose -h - zh = -84. What is the tens digit of h? 2 Suppose -1 = -m + w - 14, 3w - 3 = -m. Let y = -1 - m. Suppose -104 = -12g + yg. What is the units digit of g? 6 Let y(g) = -4g + 12. Let w be 3/1(-28)/(-6). Suppose -4r + 2r - 18 = 4o, -4r + w = -2o. What is the tens digit of y(o)? 3 Let j = 269 - 139. What is the tens digit of j? 3 What is the units digit of 700((-7)/4 + 4)? 5 Suppose 2y - 3593 = -195. What is the tens digit of y? 9 What is the tens digit of 1/((6/(-13374))/(2/(-6)))? 4 Let t(k) = 231k - 5. Let q be t(1). What is the units digit of (-7)/((-28)/(-16)) - (-3 - q)? 5 Suppose 2k - 3h - 207 - 2546 = 0, 5h + 4129 = 3k. What is the hundreds digit of k? 3 Let p = 25 - 69. What is the tens digit of (-4741)/p - (-2)/8? 0 Suppose 0 = -d + 50 - 46. Suppose -2k - dg = -72, -g + 86 = 3k - 12. What is the units digit of k? 2 Let y(f) = -f*2 - 7f - 2. Let p be y(-5). Let c be -8 + p - (-2 + -28). What is the units digit of ((-1)/3)/((-2)/c)? 5 Let h(i) = 5i - 5. Let b(m) = -9m + 10. Let f(l) = -6b(l) - 11h(l). Let v be f(-7). What is the tens digit of v/1(0 + 6)? 1 Let k(z) be the first derivative of z3/3 - 6z*2 + 7z - 5. Let p be k(16). Suppose 0 = 2d - 5o - p, 2d - 28 = d + 4o. What is the tens digit of d? 4 Suppose 0 = 2b + 2a - 57 - 153, b - 5a - 99 = 0. Let o = 0 + b. What is the units digit of o? 4 Let g be (0 + 2/4)4. Let j(u) = 2 + 5u - 2u*2 - 2u*2 - gu + 5u2. What is the tens digit of j(4)? 3 Suppose -59q + 39297 = -16399. What is the hundreds digit of q? 9 Suppose 5l - 5u + 100 = 0, 5l = 4u - 24 - 75. Let y = -15 - l. Suppose 3t + yg = 14 + 9, 9 = -t + 2g. What is the units digit of t? 1 Let a = 514 + -206. Suppose 2j - 2c - a = 0, 0 = -4j - 5c - 0c + 580. What is the hundreds digit of j? 1 Suppose -3 = 20l - 3. Suppose 30s - 27s - 165 = l. What is the tens digit of s? 5 Suppose 19f - 187 = 7109. What is the hundreds digit of f? 3 Let q = -3 + 6. Let a be (1 + 1/3)471/314. Suppose n - 3h = 29, ah + 51 = 2n + qh. What is the units digit of n? 6 Let d be (-9)/(-3) + (-46)/2. Let a = d + 56. Suppose 0i = -i + a. What is the tens digit of i? 3 Suppose 0f - 18 = 2n - 2f, 5n - 3f + 37 = 0. What is the units digit of -86(n/10 + -1)? 9 Let h be 2/((-10)/(-6) - 1). Let c be 8/h - (-14)/(-21). Suppose -6d - cq = -3d - 42, -4q = -2d + 44. What is the tens digit of d? 1 What is the tens digit of -4 + 9 - (-1533 + 17)? 2 Let d = -630 - -972. What is the hundreds digit of d? 3 Suppose x - 8 + 5 = 0. Suppose 0 = xb + 221 - 725. What is the tens digit of b? 6 Let f(j) = -j*2 + 12j + 7. Let o be f(13). Let i(h) = -2h - 12. Let d be i(o). Suppose 2a - 6a + 92 = d. What is the units digit of a? 3 Let v(f) = -15f + 3f - 8f + 1. What is the units digit of v(-4)? 1 Suppose -x = -5u - 480, -2638 = -4x + u - 756. What is the tens digit of x? 7 Suppose 8m - 16m + 3672 = 0. What is the tens digit of m? 5 Let d(y) = 5y - 4. Let h be d(-6). Suppose 245 = 2q + 3q. Let x = h + q. What is the tens digit of x? 1 Let z(g) = 7g*3 - 13g*2 + 8g - 6. Let k(p) = -p3 + p2 - 1. Let r(f) = 6k(f) + z(f). Let u be r(6). What is the tens digit of (u - -18)48/18? 4 What is the units digit of ((-132)/7)/((-8)/280)? 0 Suppose 1317 + 135 = 3r. What is the hundreds digit of r? 4 Suppose -25c + 23c = 0. Suppose ca + 117 = 3a. What is the units digit of a? 9 Suppose 6 = 10d - 13d. Let x(y) = 38y*	{ "pile_set_name": "DM Mathematics" }
icked without replacement from {k: 1, y: 4, t: 5, h: 5}. What is prob of sequence yhyt? 5/546 Calculate prob of sequence fzj when three letters picked without replacement from {v: 3, f: 9, j: 1, z: 1}. 3/728 Four letters picked without replacement from {v: 5, q: 3, m: 4, o: 4}. What is prob of sequence qvvo? 1/182 Calculate prob of sequence dpdp when four letters picked without replacement from pddpdddpdd. 1/20 What is prob of sequence la when two letters picked without replacement from alaaaaaalaaaa? 11/78 Two letters picked without replacement from ddddiididd. Give prob of sequence dd. 7/15 Two letters picked without replacement from vvt. What is prob of sequence tv? 1/3 Two letters picked without replacement from {w: 4, u: 1, i: 2}. What is prob of sequence uu? 0 Two letters picked without replacement from ssffsfsfgssfgsf. What is prob of sequence sg? 1/15 Four letters picked without replacement from obboobo. What is prob of sequence ooob? 3/35 What is prob of sequence bp when two letters picked without replacement from bfpfm? 1/20 What is prob of sequence aad when three letters picked without replacement from qdcadqacqqqqdrca? 3/560 Two letters picked without replacement from ebeeebeeeeeeehbbheb. Give prob of sequence hh. 1/171 What is prob of sequence sz when two letters picked without replacement from {k: 2, x: 2, z: 1, s: 6}? 3/55 Calculate prob of sequence kk when two letters picked without replacement from {i: 3, b: 1, q: 3, k: 5}. 5/33 What is prob of sequence jj when two letters picked without replacement from {x: 1, j: 3, s: 6, e: 7}? 3/136 Two letters picked without replacement from etstvdeetms. What is prob of sequence td? 3/110 Three letters picked without replacement from xyyyxxxx. What is prob of sequence xxx? 5/28 Two letters picked without replacement from hhocjo. Give prob of sequence hh. 1/15 Calculate prob of sequence wf when two letters picked without replacement from fkpwm. 1/20 Four letters picked without replacement from thftkxkxkhhkkxhktk. Give prob of sequence khtf. 7/6120 Two letters picked without replacement from {g: 1, f: 1, l: 3, s: 2, k: 1, b: 3}. Give prob of sequence bs. 3/55 Calculate prob of sequence eeee when four letters picked without replacement from edede. 0 Four letters picked without replacement from ycaaeyceayyaaaaayay. What is prob of sequence yyec? 5/3876 What is prob of sequence mf when two letters picked without replacement from ddfdddmfm? 1/18 Two letters picked without replacement from {o: 2, g: 4, s: 7, p: 1, j: 2, q: 1}. Give prob of sequence js. 7/136 What is prob of sequence oj when two letters picked without replacement from ajxjoaaxoasaasxasos? 1/57 What is prob of sequence li when two letters picked without replacement from iicccciolccolclcclco? 3/95 What is prob of sequence wfpb when four letters picked without replacement from {l: 2, f: 1, b: 2, w: 1, o: 1, p: 1}? 1/840 Three letters picked without replacement from {i: 3, f: 4, g: 3, y: 4}. Give prob of sequence yig. 3/182 What is prob of sequence qtl when three letters picked without replacement from {z: 9, i: 1, t: 5, l: 1, q: 1}? 1/816 Four letters picked without replacement from {y: 6, x: 1, z: 2, h: 3, l: 2, k: 1}. Give prob of sequence kyll. 1/2730 Three letters picked without replacement from dbd. Give prob of sequence dbd. 1/3 Four letters picked without replacement from gvcgcllcvcglcgggggg. Give prob of sequence clvg. 15/5168 What is prob of sequence st when two letters picked without replacement from csycyyvccsctcs? 3/182 Calculate prob of sequence bf when two letters picked without replacement from ftfbtbbbxff. 8/55 Two letters picked without replacement from {i: 4, l: 2, n: 1, t: 5, f: 4}. Give prob of sequence ft. 1/12 Calculate prob of sequence hl when two letters picked without replacement from {i: 3, l: 4, q: 2, h: 2, n: 2, c: 1}. 4/91 Two letters picked without replacement from {d: 3, t: 4, w: 2, p: 1, q: 1}. Give prob of sequence wp. 1/55 What is prob of sequence joj when three letters picked without replacement from ujoouuuoj? 1/84 Two letters picked without replacement from llllzzlllllz. What is prob of sequence zz? 1/22 What is prob of sequence cbb when three letters picked without replacement from {c: 4, b: 10, j: 1, w: 2}? 3/34 Two letters picked without replacement from {c: 3, v: 2}. Give prob of sequence vc. 3/10 Calculate prob of sequence drrl when four letters picked without replacement from {l: 2, d: 1, r: 7}. 1/60 What is prob of sequence ejj when three letters picked without replacement from zeeajjeeqqjooj? 2/91 Three letters picked without replacement from jjfffjfffj. What is prob of sequence ffj? 1/6 What is prob of sequence lv when two letters picked without replacement from {s: 1, d: 6, j: 1, v: 1, l: 4}? 1/39 Calculate prob of sequence iiaa when four letters picked without replacement from iiaaiaa. 3/35 Two letters picked without replacement from {i: 13, x: 3}. Give prob of sequence xi. 13/80 Three letters picked without replacement from mrmrrmmfmrmf. Give prob of sequence rrr. 1/55 What is prob of sequence mg when two letters picked without replacement from ypmbbbmdmgyp? 1/44 Calculate prob of sequence fyy when three letters picked without replacement from {f: 5, c: 2, u: 5, y: 5}. 5/204 Three letters picked without replacement from {l: 8, k: 4, r: 4}. What is prob of sequence krk? 1/70 Two letters picked without replacement from {c: 1, o: 1, m: 1, h: 1, u: 1}. What is prob of sequence uo? 1/20 What is prob of sequence bz when two letters picked without replacement from {f: 4, q: 4, z: 2, b: 2, a: 2, l: 1}? 2/105 What is prob of sequence usi when three letters picked without replacement from {s: 2, u: 2, v: 5, c: 1, i: 5, w: 2}? 1/204 What is prob of sequence pi when two letters picked without replacement from pippppiipi? 4/15 Four letters picked without replacement from {j: 3, k: 7, e: 3}. Give prob of sequence eeej. 3/2860 Two letters picked without replacement from fefffe. Give prob of sequence ee. 1/15 Four letters picked without replacement from hebabe. What is prob of sequence ebea? 1/90 What is prob of sequence zx when two letters picked without replacement from {i: 3, x: 1, z: 1, b: 2}? 1/42 Calculate prob of sequence kzt when three letters picked without replacement from qztuzktzz. 1/63 Calculate prob of sequence jjjj when four letters picked without replacement from {j: 7}. 1 Two letters picked without replacement from {w: 5, y: 4, v: 5, q: 1}. What is prob of sequence yy? 2/35 Four letters picked without replacement from {p: 3, h: 17}. Give prob of sequence phhp. 4/285 Three letters picked without replacement from {x: 4}. What is prob of sequence xxx? 1 Two letters picked without replacement from vutlwwvt. What is prob of sequence lv? 1/28 Four letters picked without replacement from ottjjoqk. Give prob of sequence ttqo. 1/420 Two letters picked without replacement from eniihlzh. Give prob of sequence in. 1/28 Two letters picked without replacement from vvcpsvvc. What is prob of sequence cc? 1/28 Three letters picked without replacement from {r: 2, d: 2, w: 2, p: 1, g: 1, h: 1}. Give prob of sequence hwp. 1/252 What is prob of sequence fee when three letters picked without replacement from {f: 1, z: 4, u: 1, e: 2, p: 2}? 1/360 Calculate prob of sequence ht when two letters picked without replacement from {x: 2, t: 1, k: 1, h: 1, s: 1, c: 2}. 1/56 Calculate prob of sequence hhfc when four letters picked without replacement from {h: 6, c: 4, f: 1}. 1/66 Four letters picked without replacement from {v: 1, i: 2, b: 14}. Give prob of sequence ibbv. 13/2040 Calculate prob of sequence yt when two letters picked without replacement from {y: 2, i: 1, t: 4}. 4/21 Three letters picked without replacement from xxxbxbbbbxxxx. What is prob of sequence bbx? 40/429 Two letters picked without replacement from {n: 1, r: 1, m: 1, h: 1, b: 1, o: 2}. Give prob of sequence mn. 1/42 Two letters picked without replacement from {c: 1, h: 2}. Give prob of sequence hh. 1/3 What is prob of sequence glgl when four letters picked without replacement from llllgllllllllgllgl? 7/408 Four letters picked without replacement from {c: 1, w: 11, s: 2}. Give prob of sequence wwss. 5/546 Calculate prob of sequence bdn whe	{ "pile_set_name": "DM Mathematics" }
5 = 0. Suppose rh + 9 = -4g + 234, -375 = -5h - 2g. Let j = h - 40. What is the units digit of j? 5 Let x = 27960 + -17441. What is the units digit of x? 9 Let x(q) = 103q2. Suppose 3o + 5f - 9 = 6f, 3o - 5f + 3 = 0. What is the tens digit of x(o)? 4 Suppose 4b = j + 163168, j + 16 - 12 = 0. What is the units digit of b? 1 Suppose -8g - 89 = 47. Let j be g + 15 - (19 - 0). What is the hundreds digit of 3 - 4590/j - 9/(-21)? 2 Suppose 32m = 35m - 9, 3u + 4m = 8490. What is the thousands digit of u? 2 What is the thousands digit of 3 + -1 + (5705 + -6)/1? 5 Suppose 18 = 3g - 21. Suppose -2y + 84 = 2z, -g + 91 = 2z - 4y. Let v = z - 17. What is the units digit of v? 4 Suppose -15r - 105695 = -19r - 3t, 3t = 3. What is the tens digit of r? 2 Let x(r) = -151r - 4. Let g be x(-9). Suppose l - g = 6l. Let q = -183 - l. What is the units digit of q? 8 Let c(m) = -3m + 6. Let g be c(2). Suppose g = -3o - 4 + 4. Suppose -d - 4u + 2u = -14, -5u = o. What is the tens digit of d? 1 What is the hundreds digit of -9 - (-51956 + 524/(-10))? 9 Let n = -1411 + 2408. What is the tens digit of n? 9 Let o = -26 - -24. Let r be (-6)/o + (11 - -4) + 6. Suppose -5u = t - 430, -469 + r = -5u + 2t. What is the tens digit of u? 8 Let i = -127 - -131. Let p(k) = 47k + 16. What is the hundreds digit of p(i)? 2 Let i(p) = -7p - 288. What is the hundreds digit of i(-71)? 2 Suppose -3364p + 3362p - 3750 = -k, p + 7521 = 2k. What is the thousands digit of k? 3 Let b = -1672 + 4365. What is the units digit of b? 3 What is the units digit of (-2606)/(-10) - (-78)/195? 1 Suppose 171 = -10n - 9. Let y = -25 - n. Let i(u) = -14u - 18. What is the tens digit of i(y)? 8 Suppose 0 = 334q - 355q + 297192. What is the units digit of q? 2 Let h(b) = -b2 + 25b - 15. Suppose -3t + 6t - 9 = 0. Suppose -56 = -td - 2. What is the units digit of h(d)? 1 What is the thousands digit of ((-123)/(-861))/(1/20783)? 2 Suppose f - 34 = -4i, -3f - 4 = -5i - 21. Let j(k) = -k*2 + 21k - 33. What is the tens digit of j(f)? 6 Let o(w) = -53w2 - 29w - 28. Let l(j) = -27j2 - 13j - 15. Let g(b) = -7l(b) + 3o(b). What is the tens digit of g(4)? 1 Let b = -103 - -103. Suppose 4w - w = p + 4, -3p - w + 8 = b. What is the units digit of 1 + 84 - (1 + p)? 2 Suppose 14943 = 4c + m - 21716, -2c - m = -18327. What is the thousands digit of c? 9 Suppose 5b - 349 = -2w, 3w + 13b - 506 = 9b. What is the units digit of w? 2 Suppose 0 = -s - v + 5, -5s - 2v + 18 = 2. Suppose sh + 4100 = 12h. What is the tens digit of h? 1 Suppose -2i = -5u - 943, -4u - 1151 - 741 = -4i. Let b = -30 + i. What is the tens digit of b? 4 Suppose -f + 4f = 12. Let u be (-777)/(-84) - 1/f. Suppose -4g + 231 = 3i, ui + 2g - 399 = 4i. What is the tens digit of i? 8 Let d = -81 + 38. Let h = 70 + d. What is the tens digit of h? 2 Let y = 11739 - -14247. What is the tens digit of y? 8 Suppose 2m = 9m - 2338. Let x = -69 + m. What is the hundreds digit of x? 2 Suppose 1262l = 1310l - 566910 - 469746. What is the hundreds digit of l? 5 Let l be ((-15968)/(-128))/((-2)/8). Let o = -289 - l. What is the tens digit of o? 1 Suppose -a - 15667 = -3p, 0 = -4p + 4a + 18292 + 2592. What is the thousands digit of p? 5 Let b(c) = 56c2 - 11c + 9. Let x be b(1). Suppose x = g - 295. What is the hundreds digit of g? 3 Let y(h) be the third derivative of 0 + 1/6h5 - 7/8h*4 + 6h*2 - 1/2h*3 + 0h + 1/120h6. What is the hundreds digit of y(-10)? 2 Suppose 132m - 309744 = -12m. What is the hundreds digit of m? 1 What is the tens digit of 8 + 0 + 7989 + 7? 0 Let y be (-20)/(-25) + 62/10. What is the tens digit of ((y + -594)-1)/1? 8 Let x = 572 + -572. Suppose 5p + 3q - 5070 = x, -3p - q = -4p + 1022. What is the units digit of p? 7 Let g(d) = 23d2 + 7d - 3. Let q be g(-8). Suppose -17b = -q + 87. What is the tens digit of b? 7 Suppose j = -4j + 140. Let r = j - 28. Suppose y = 4o - ry - 25, -2o = 2y. What is the units digit of o? 5 Suppose -2z + 5 = 3w, -3z - 10 = -2w + 3w. Suppose -2r + wr + 186 = 0. Let j = 128 + r. What is the units digit of j? 6 What is the hundreds digit of 1 + 0 + 49/(-7) - -964? 9 What is the units digit of (6232/(-12))/((-18)/27)? 9 Suppose -3b - 1076 = -b. Let t = b - -1296. What is the hundreds digit of t? 7 Let d = 98 + -76. Let l(z) = 9 - 6 + dz + 13 + 15. What is the units digit of l(8)? 7 Let x be (30/20)/(3/28). What is the units digit of (39/(-9))/(x/(-1218))? 7 Let w(o) = 74776o*2 - 44o + 39. What is the units digit of w(1)? 1 Let h = 37819 + -15179. Suppose h = -127n + 147n. What is the hundreds digit of n? 1 Suppose 2m - c = 19 + 38, -4m - 3c + 129 = 0. Suppose -31k + 280 = -mk. What is the units digit of k? 0 Let r be ((-4)/(-6))/(2 + (-16)/9). Suppose 0 = -4h + 17 + r, 3z - 200 = 2h. What is the tens digit of z? 7 Let b be 3/(4/(24836/(-21))). Let v = -562 - b. What is the units digit of v? 5 Suppose 3q = -n - 4n + 52, 2q + 24 = 4n. Suppose 25 = 3l - nl, -l + 547 = -2g. Let w = 457 + g. What is the units digit of w? 1 Let j be 3/4 - (221/(-4) - 6). Suppose j = 4q + 2c, 3c = 5q + 2c - 88. Suppose -13h + qh = 16. What is the units digit of h? 4 Suppose 2r + a = 14287, 5r + 14a - 11a - 35715 = 0. What is the hundreds digit of r? 1 Let g be (3/((-6)/8) + -4)1. What is the units digit of (-13)/(52/g) - -94? 6 Let b(g) = 52g - 360. Let f be b(7). Suppose -t = -2t - j + 1076, fj = -3t + 3227. What is the thousands digit of t? 1 Let s be ((-8)/(-14) - 204/210)-10. Suppose -y = -t - 392, st = -5y + 6y - 380. What is the tens digit of y? 9 Suppose 1 = -q + i - 2, 21 = q + 5i. Let x be (q/(6/16))/(6/9). Let a = 21 + x. What is the tens digit of a? 2 Let m(s) = s*2 + 2s - 20. Let c be m(-6). Suppose ct + 5166 = 18t. What is the units digit of t? 9 Let i be (1 - (3 - 0)) + 6. Suppose -ih = 14h - 378. What is the tens digit of h? 2 Let w(k) = -79k + 10. Let n(m) = m3 - 8m*2 - 8. Let q be n(8). Let v be w(q). Suppose -5f = -v - 208. What is the units digit of f? 0 Let f = -2674 - -9693. What is the hundreds digit of f? 0 Suppose 0 = -10x + 46085 + 228475. What is the thousands digit of x? 7 Let n = -1066 + 413. Let r = n - -1898. What is the hundreds digit of r? 2 Suppose -4i = -14746 - 15570. What is the units digit of i? 9 Suppose 0 = -363s + 378s - 295635. What is the hundreds digit of s? 7 Suppose -4r = 2p + r + 13, -4p + 34 = -2r. Suppose 0 = pf - 7 - 5. Suppose -2s + 204 = fc - 0c, -4s + 399 = -5c. What is the hundreds digit of s? 1 What is the thousands digit of (18101 - (-2 - -1 - -2)) + -299 + 295? 8 Suppose -2h - 5z = h - 10764, -5z - 14317 = -4h. What is the hundreds digit of h? 5 Suppose 53l = 33l - 216l + 3844440. What is the hundreds digit of l? 2 Let n(h) = -h3 + 5h2 - h - 6. Let j(l) = -l3 + 10l2 + 11l + 4. Let k be j(11). Let y be n(k). Let u = y + 10. What is the units digit of u? 6 Let h(d) = 6d3 - d2 + 3d + 2. Suppose -c + 10 = -2p - 0c, -5p + 2c - 23 = 0. Let z be (p/(-9))/(3/27). What is the hundreds digit of h(z)? 1 Suppose -2l = 0, 5l - 7704 - 9177 = -2h + 3059. What is the hundreds digit of h? 9 Suppose -65r + 0r = 61r - 958986. What is the hundreds digit of r? 6 Let r = -165 + 167. Suppose -5z = -5y - rz + 1683, -2 = 2z. What is the units digit of y? 6 Let a be 248/93 - (1 + (-8)/6). Suppose 0 = 4w + 4, -2b + ab = -2w. What is the units digit of b/(-5)(-1)/(2/640)? 8 Let p(z) = -1096z + 526. What is the thousands digit of p(-2)? 2 Let v = 6271 - -2821. What is the hundreds digit of v? 0 Suppose 8u + l - 437 = 3u, u = 3l + 81. Suppose -2c + 14 = a - 24, -4a + 5c + u = 0. What is the units digit of a? 8 Let t = 95262 + -67274. What is the units digit of t? 8 Let t(v) be the second derivative of v*4/12 + 7v*3/6 - 7v*2/2 + 11v. Let j be t(-9). Suppose 15l - 288 = jl. What is the units digit of l? 2 Suppose 3o + 485 = -5c, 732 = -5o + 4c - 64. Let i be (o/6)/(22/(-132)). Let r = i - 58. What is the hundreds digit of r? 1 Let k(u) = -u*2 + 1. Let f(v) = 4v*3 - 2v*2 - 9v + 3. Let p(s) = -f(s) + 3*k(s). What is the hundreds digit of p(-4)? 2 Suppose -	{ "pile_set_name": "DM Mathematics" }
0m - 3m - 5 = 0, -5m + 4 = 4d. Which is the closest to 0.14? (a) -2 (b) d (c) n b Let f = 3.179 + -0.079. Let g = f + -6.1. Which is the nearest to -2? (a) -1/4 (b) g (c) 0.07 b Let a = -7 + -2. Let w = -9.4 - a. Let v = 232 - 224. What is the nearest to -2/7 in v, w, -0.2? -0.2 Let y = -29/2 + 15. Let t = 0 - 0.4. Let m = -329 + 326. Which is the closest to 1/3? (a) t (b) y (c) m b Let s = -783.055 + 786. Let j = s - -0.055. What is the nearest to -9 in 1/4, 0, j? 0 Let d = 176 - 175.6. What is the closest to 2/9 in 0.5, d, 7? d Let g be ((-3)/((-9)/6))/6. Let k = 19.6 - 20.3. Which is the nearest to k? (a) 2/7 (b) -2/7 (c) g b Let g = -9 - -12. Let f be ((-4)/44-4)/2. Let i = -0.68 + -1.32. Which is the closest to 0? (a) g (b) f (c) i b Let p = -0.83 - -0.8. Let j = 0.216 - -0.814. Let d = p + j. Which is the nearest to 0? (a) 5/4 (b) 3 (c) d c Let g be (-2)/(2/(-5) - 0). Let t be (-38)/(-14) - ((-4 - 1) + 99/21). Let h = -3/5 - -14/15. What is the nearest to 0.1 in g, t, h? h Let j be (-7 - (-99)/18)/(5 - -1). Which is the nearest to 0.2? (a) 0.2 (b) -0.5 (c) 0.3 (d) j a Let f = 27.8 - 27.6. What is the closest to -3 in 2, -5, -0.04, f? -5 Let m be 2/11 + (-2045)/55. Let f = m + 113/3. Which is the closest to f? (a) 3 (b) -1/3 (c) 5 b Let g = -716 - -715. Which is the nearest to g? (a) -3 (b) -0.5 (c) 0.9 (d) 6 b Let s = -1.11 + 4.11. Which is the closest to 3? (a) -0.2 (b) s (c) -4/5 b Let q = 0.25 - -0.05. Let i = 16 - 17.4. Let t = i + 0.4. Which is the nearest to t? (a) q (b) 1/4 (c) -4 b Let l be 2/166 + 979/12. Let p = l + -83. Which is the closest to -3? (a) 0.1 (b) p (c) -1/9 b Suppose 108 = -h - 35h. Let j = -88/123 + 2/41. Which is the nearest to j? (a) h (b) -4 (c) -5 a Let l be (308/104 - (0 + 3))4. What is the closest to 2/53 in 1/2, 4, l? l Let q = -62 + 64. Let k = 116/265 + -2/53. Let l(d) = -d*2 - 12d + 9. Let m be l(-13). Which is the closest to k? (a) -1 (b) q (c) m a Let x = -2.77 + -0.13. Let t = -4.9 - x. Let q = -2/3 - -1/3. Which is the closest to 2/7? (a) t (b) 0.3 (c) q b Let p be (-4)/(7 + 1) + 1/(-10). Which is the closest to -7/8? (a) -0.2 (b) p (c) -1/8 b Let r = 18.741 + -18.741. Let g = 450.07 - 463. Let k = 13 + g. Which is the nearest to r? (a) -1/5 (b) -4 (c) k c Let o = -3 + 4. Let c(t) = -t*3 + 30t*2 - 55t - 28. Let g be c(28). What is the nearest to o in 0.3, -2, g? 0.3 Let m = 14 + -34.5. Let x = 49 - 70. Let c = x - m. What is the nearest to 1/2 in 1, 1/3, c? 1/3 Suppose 971 = -19g + 952. Which is the nearest to -3/2? (a) 7 (b) g (c) -0.3 (d) 5 b Let b = -4 - -3.6. Let a = -1 + -1. Let l = -15 + 14.7. What is the closest to b in 1/9, a, l? l Let h = 2.5 + -2.6. What is the nearest to h in 2, -4.1, -3? 2 Let n = 6.7 - 7.1. Let f = -3 - -2. Which is the nearest to f? (a) n (b) -2 (c) -5 a Let u = -0.1 - -0.1. Let w be -1 - -5 - (-120)/5. Let o = -24 + w. What is the nearest to u in -5/4, o, -2? -5/4 Let y = -0.8 - -3.8. Let v = -594 - -6536/11. What is the nearest to -1 in -4, v, y? v Let m = -115 + 113. Let i be (9/(-6))/((-9)/12). Which is the nearest to m? (a) 5 (b) 2/11 (c) i b Let n = 418.9 + -419. What is the nearest to -1 in 4, n, -3, -2? n Let w = -8.8 - -9. Let u = 188 + -188.05. What is the closest to 2/5 in u, 5, w? w Let g be (-6)/33 - (-9)/(495/(-265)). What is the nearest to -0.3 in 4, -2, 3, g? -2 Let p = 2682 - 2677. What is the closest to -0.1 in 0, 1.5, p? 0 Let z = -0.63 + 0.69. Let p(u) = -3u + 3. Let r(j) = -7j + 6. Let l(t) = -13p(t) + 6r(t). Let d be l(-2). Which is the closest to z? (a) -5 (b) 4 (c) d c Suppose -3g = -0r + r - 15, -5g + 29 = 3r. Let w = -0.91 + 1. Which is the closest to 0? (a) g (b) w (c) 4/3 b Let j(y) = y3 + 7y*2 - y - 6. Let m be j(-7). Let s = -317/3 + 106. What is the closest to -0.1 in 1/6, m, s? 1/6 Let f = 0.4 + -0.2. Let a = 571.1 + -571. What is the closest to 6 in -3/2, a, f? f Let f = -97 + 97.068. Let s = 4.932 + f. Let q = 9/17 + -96/85. What is the nearest to 1/2 in -0.1, s, q? -0.1 Suppose 0 = -3v - 45 - 81. Let b be (-1 - 0)/(v/24). What is the closest to 2 in b, -0.3, 4? b Let k = -11.15 - -12.15. Let p(n) = -n - 1. Let h be -11/(-2)-10. Let v be p(h). What is the nearest to k in v, -3, 3? 3 Let g be (-54)/81 - ((-232)/(-3) - 0). Let b be ((-3)/g)/((-6)/24). Suppose -7q = -3q - 12, -w + 5q = 15. What is the nearest to w in b, 0.1, 2? 0.1 Let g = 34 + 34. Let y = -66 + g. Let c = 0.43 + -0.03. What is the closest to y in 3, c, -0.2? 3 Let u = -260/553 - 8/79. Let j = -1144.5 - -1144. Which is the nearest to 0? (a) j (b) 11 (c) u a Let i = 122 - 121.8. Which is the nearest to -8? (a) i (b) -0.1 (c) 1/3 b Let z = 783/5 - 3127/20. What is the closest to 0 in z, -5, -2/9? -2/9 Let r = -125 + 130. Let k(u) = 2u*3 + 2u*2 - 2. Let q be k(1). Which is the closest to 1? (a) q (b) 0.4 (c) r b Let t = 1016 - 1014. Suppose 5n = -0n + 15. Let k = -3 - -4. What is the nearest to k in 0.1, n, t? 0.1 Suppose 66 = 9s - 6. Which is the nearest to 2? (a) 0.02 (b) s (c) 0.2 c Let z(h) = -h + 1. Let f be z(5). Let c = -0.078 + 0.478. What is the nearest to 4 in f, c, 0? c Let z = 195.3 - 200.3. Which is the nearest to z? (a) 0 (b) 4 (c) -5 (d) -0.2 c Let j = 2.5 + -7.5. Which is the closest to 0.1? (a) -2/9 (b) 1/6 (c) j b Let o = 33.1 - 33. What is the closest to -2 in -0.5, -2/5, -2, o? -2 Let j = -0.262 + -0.738. What is the nearest to j in 2/7, -18, -1/5? -1/5 Let k = 2498 + -2500. Which is the nearest to 0? (a) 0.04 (b) k (c) 24 a Let u = -9 - -10. Let q = 58/3 + -19. What is the nearest to u in q, 5, 1/7? q Let h be 297/220 + 2/8. Which is the closest to h? (a) 0.4 (b) 0.1 (c) 4 a Let d be ((13 - 0) + -14)2/(-10). What is the closest to 0 in -4, -3.4, d, 1? d Let j = -51.53 - 0.47. Let u = 38 + j. What is the closest to u in -4, -4/9, -1? -4 Let q = 14.2 - 11. Let t = q - 3.7. Which is the nearest to 1/4? (a) t (b) 4 (c) -3/5 a Let f(y) = y + 8. Let u be f(-9). Let w be u/((-12)/(-3) + -3). Which is the nearest to w? (a) 0.4 (b) -3/5 (c) 0.06 b Let u = -361 - -360.6. Which is the nearest to -12? (a) u (b) 0.2 (c) -2/9 a Let v = 3051 + -3047. What is the nearest to 10 in v, 0, -2/7, 2/5? v Let l = -36033 + 35817.21. Let k = l + 218. Let g = k + -0.21. Which is the closest to 0.1? (a) 3 (b) 1/3 (c) g b Let g = 601/3124 + -3/284. What is the nearest to 12 in 2/7, -1, g? 2/7 Let k = -8207/728 + 144/13. Let q = 1/14 + k. Which is the closest to -11? (a) -2/3 (b) q (c) 0 a Let v = 511/6 + -85. Let x = 36339/14 + -2592. Let p = x + -7/2. What is the closest to 1 in v, p, 6? v Let o = -277 - -277. Which is the closest to -1? (a) 1 (b) -11 (c) o c Let j(n) = -n3 + 6n*2 + 10n - 11. Let l be j(7). Suppose 15o = 20o + l. Which is the nearest to -2/3? (a) -6 (b) -5/4 (c) o b Let q = -65/56 - -11/14. Which is the nearest to -1? (a) q (b) 0.3 (c) 2 a Let l = -0.02 + 0.22. Let t be 5/10(-6)/(-8). Let f be ((-1)/5)/(((-6)/(-15))/1). Which is the closest to f? (a) l (b) -1/11 (c) t b Let q = 47 + -44. Let z = 2.2 + -1.7. Which is the nearest to q? (a) -4 (b) z (c) -5 b Let q = -26.36 - -21.5. Let k = q - 0.14. What is the nearest to -1 in -0.4, -1/7, k? -0.4 Let o be 3(-3)/(-3) + -4. Which is the closest to 0.7? (a) -3 (b) o (c) -0.3 c Let v = -9 + 8. Let i = 21 - 29. Let y be -2 - 14/i1. Which is the nearest to y? (a) 2/17 (b) v (c) 0 c Suppose 0 = 6u + 34u + 160. Which is the nearest to -2? (a) 149 (b) 1 (c) 2/7 (d) u d Let p be (-24)/(-9) + 2 - (-6)/(-9). What is the nearest to -0.08 in -0.2, 1/4, p? -0.2 Let o(r) = 3r + 33. Let n(s) = s + 16. Let z(m) = 5n(m) - 2o(m). Let f be z(6). Which is the closest to 1? (a) -5 (b) f (c) 2 c Let q = 11 - 3. Let n = -11 + q. Let p = -41.77 + 44.77. What is the nearest to 2/15 in 1, n, p? 1 Let k(j) = 44j - 1579. Let i be k(36). Let y = -14 + 9. Which is the nearest to -0.1? (a) y (b) 2 (c) i b Let u = 133.47 - 134. Let n = u + 0.33. Which is the nearest to 0.02? (a) -1 (b) -0.1 (c) n b Let q = -1245.1 - -1245.6. Suppose 5v - v + 20 = 0. What is the closest to -2 in -3/5, q, v? -3/5 Let a = 0.01 + 0.09. Let t = 1542.9 - 1543. Let s = 3	{ "pile_set_name": "DM Mathematics" }
f be -273 + (12/2 - 3). Let n be (16/10)/((-12)/f). Let b be 4/n6/(-4). Sort 1/10, b, 0.3 in ascending order. b, 1/10, 0.3 Let g = 3 - 5. Let i = 4.92 - -0.08. Let q = -10 + i. Sort g, q, -0.1. q, g, -0.1 Suppose -2m = 2c + 12, -4m - c - 3 = -4c. Let i be 2/m + 50/(-15). Sort -2, -5, i in descending order. -2, i, -5 Suppose 0 = -6q - q + 21. Put 4, q, -5, -1 in ascending order. -5, -1, q, 4 Suppose -t = 6m - 4m - 10, 2t + 8 = 3m. Sort 3/4, 1, t, -5 in ascending order. -5, 3/4, 1, t Let b = 3.6 - 3.5. Put 1/9, b, 0.3 in ascending order. b, 1/9, 0.3 Let p(d) = -d*2 + 3d - 1. Let t be p(3). Let s = -10 - -13. Let f be 0/(8/((-12)/s)). Sort f, t, -3 in increasing order. -3, t, f Let n = 2 - 1.6. Let y = 0.002 + -28.002. Let o = -28.3 - y. Put -1, o, n in ascending order. -1, o, n Let j = 5.166 - 0.166. Let f(u) = u + 7. Let q be f(-5). Put 1/12, q, j in descending order. j, q, 1/12 Suppose 5x - 7 = 2z, -x - 3z = 1 + 1. Let g be (7 - 2)/(14 - 13). Sort x, g, 3 in descending order. g, 3, x Let i(v) = -6v - 6. Let o(u) = u + 1. Let f(d) = -2i(d) - 14o(d). Let k be f(-3). Let w = k - 6. Sort 4, 3, w in decreasing order. 4, 3, w Let n be 2(2 + 1/(-1)). Suppose -nq + 4q = -4. Suppose 5y = -a + 4 + 1, -5 = -a + 5y. Sort -0.2, q, a. q, -0.2, a Let q(o) = -o2 + 4o + 8. Let x be q(6). Suppose -2v + 7v + y - 30 = 0, 5v - 5 = 4y. Sort v, x, 0 in decreasing order. v, 0, x Let a = -215/2 - -110. Sort 1, a, -1/8. -1/8, 1, a Let r = -45 - -41. Sort 3/2, -1, r. r, -1, 3/2 Let i = 0.234 + 0.066. Put 1/5, i, -3 in increasing order. -3, 1/5, i Let t = -0.02 - 0.38. Let s = 0.04 + 2.96. Let r = 1 - s. Sort t, r, -2/19 in ascending order. r, t, -2/19 Suppose -l - 3 = -4l. Let c = -0.1 + 1.1. Let o = -0.5 + c. Sort -2/13, l, o. -2/13, o, l Let u be 36/81(-15)/12. Put -1/10, u, 0.2 in ascending order. u, -1/10, 0.2 Let m = -1 + 1. Suppose 3y = 2c - y - 14, 3y = 3c - 15. Let a be 1/(-3) - (-10)/c. Put a, -4, m in increasing order. -4, m, a Let m = -41.01 - -41. Sort -2, -5, m, -2/5 in descending order. m, -2/5, -2, -5 Let b = -83 - -77. Sort b, -3, -4 in increasing order. b, -4, -3 Let x = 1 + -4. Sort -5, x, -0.5 in decreasing order. -0.5, x, -5 Let y = -0.6 - -0.4. Let o = 0.427 + -0.017. Let i = o - -0.09. Put 0.4, i, y in decreasing order. i, 0.4, y Let d(p) = -p*2 - 7p - 4. Let f be d(-7). Let s(t) = -t + 1. Let r be s(f). Sort 4, 0, r. 0, 4, r Let u = 0.03 + -0.13. Let x = u - -4.1. Put x, 0, 5 in increasing order. 0, x, 5 Suppose -2n + 3d + 1 - 4 = 0, -5n - 1 = -d. Let u = 17 + -15. Let w be (-8 + 3)/(1 - u). Sort n, w, -2 in descending order. w, n, -2 Let q(z) = -z2 - 9z - 11. Let c be q(-8). Suppose -5r + 2a = 7a - 10, 0 = 4r - 4a - 24. Put c, -2, r in increasing order. c, -2, r Let n be (-4)/5 + 8/10. Put -2, -4, -7, n in increasing order. -7, -4, -2, n Let o(y) = -y - 1. Let k be 4(-1 + (-9)/(-6)). Let h be o(k). Sort 1, h, -8 in descending order. 1, h, -8 Let i be (-13)/(-15) - (-2)/(-3). Let x be (1 - 0) + -1 + 2. Sort -4, i, x in ascending order. -4, i, x Suppose 2u - 6 = -f, 0 = u - 2f + 9 - 2. Suppose -2r - r = -9. Suppose -z = -u, -4z + r = -5y - z. Sort -3, 2, y in decreasing order. 2, y, -3 Let i(n) = 4n*2 + 4n + 2. Let t be i(-1). Suppose 0 = -f - 1 - 4. Sort t, 5, f in descending order. 5, t, f Let o = 247/4 - 62. Let l = -3203 - -15828/5. Let u = l + 38. Sort -5, u, o in decreasing order. u, o, -5 Let t be (-2)/((-79)/81 - -1). Let v be (-2)/(-5) + t/15. Sort v, 5, -1. v, -1, 5 Let o be (-2)/(3/(3/2)). Suppose 4z = -l - 2l + 20, -3z - l = -10. Suppose 0 + 6 = zr. Sort r, -5, o in ascending order. -5, o, r Let z = -4.898 + -0.102. Sort z, -3, -4/3, -1/6 in decreasing order. -1/6, -4/3, -3, z Suppose -13 = -p + 4z, p - 3z = -8z - 23. Put 5, -1, p, 0 in descending order. 5, 0, -1, p Let s = 1 + -1.1. Let k = s - -2.1. Let a = -55/7 + 59/7. Sort 0.1, k, a in ascending order. 0.1, a, k Let u(s) = 2s*2 + 35s + 18. Let v be u(-17). Suppose -13 = 5n + 4j, 4n + 0j = -3j - 11. Sort v, n, 2. n, v, 2 Let v = 1 - 1. Suppose -3 = -f - v. Suppose -13 = 2o - f. Sort o, -2, 2. o, -2, 2 Suppose 33 - 1 = 4d. Suppose 0 = -4g + 12 + d. Put g, -5, -3 in descending order. g, -3, -5 Let k(x) = x*2 + 4x. Let y be k(-3). Let m(w) = 11w + 88. Let t be m(-8). Sort y, t, 2/5 in increasing order. y, t, 2/5 Let d be ((-12)/15)/((-2)/15). Let h be 4/d6/12. Put 0.3, h, 0.2 in increasing order. 0.2, 0.3, h Suppose -3d - 15 = -0d. Let x be (6 - (-10)/25) + -6. Put d, x, 2 in increasing order. d, x, 2 Let m = -136 - -139. Sort -19, -1, 4, m. -19, -1, m, 4 Let i = -16 - -29. Let g(b) = 7b3 + 14b*2 - b - 12. Let l(c) = -15c*3 - 29c*2 + 2c + 25. Let o(m) = ig(m) + 6l(m). Let w be o(-8). Sort w, -5, -4. -5, -4, w Let n = 2.77 - -0.23. Sort -3, n, 5. -3, n, 5 Suppose 3u + 36 = -u - 4n, 5u = -n - 49. Let w = u - -12. Put 5, w, 0 in ascending order. 0, w, 5 Let v(m) = m2 - 2m - 4. Let d be v(3). Let q = 4 + d. Put 2, 0, q in increasing order. 0, 2, q Let f = -2 + 2. Let j(p) = -p*3 - 14p*2 - 13p + 2. Let s be j(-13). Sort f, -4, s in ascending order. -4, f, s Let d(h) = -h*3 - 5h*2 - 4h + 1. Let f be d(-3). Suppose -6q + 2q - 5i + 13 = 0, 4q + 7 = -i. Sort f, 4, q. f, q, 4 Let r = 8 - 0. Put -0.2, -1/7, r in descending order. r, -1/7, -0.2 Suppose -5v + 4l = -2v - 35, -4v + 4l = -40. Let t be v/(5/(-3)) - -2. Sort t, -3, 5 in descending order. 5, t, -3 Let g(i) be the third derivative of -i5/30 - i4/24 + i3/3 - 5i*2. Let p be g(-2). Sort 6, -1, p in ascending order. p, -1, 6 Suppose 0 = x + 3x - 4k - 36, 0 = -3x + 4k + 32. Let m(u) = u2 + 12u. Let r be m(-12). Sort x, -5, r in decreasing order. x, r, -5 Suppose 10u = 4u + 12. Sort 3, u, -3 in decreasing order. 3, u, -3 Let h = -2966435/68588 + 1/17147. Let f = -43 - h. Sort 2/3, 1, f in decreasing order. 1, 2/3, f Let h be ((-10)/(-6))/(4/12). Put 3, -1, h in decreasing order. h, 3, -1 Let r = -15.4 - -15. Put -4/7, 2, r in descending order. 2, r, -4/7 Let l = 0 + -0.04. Suppose -r = 3r - 16. Sort 0, l, r in ascending order. l, 0, r Let r = -23 + 21. Let v be -1-1(-2 - -5). Put v, 1, r in descending order. v, 1, r Let p be (-12)/93(-1)/(-2). Sort p, 2, 3/2, -0.5 in descending order. 2, 3/2, -0.5, p Let r = 1 - -2. Sort -1, 0.04, r in increasing order. -1, 0.04, r Let f be (-8)/(-60) + (1/5)/1. Put 2, 1, f, -4/3 in decreasing order. 2, 1, f, -4/3 Let g(d) = d2 - 5d + 3. Let c be g(5). Let t(r) = -r*2 + 3r - 2. Let l be t(c). Sort 5, 4, l in decreasing order. 5, 4, l Suppose -5j - 41 = -4q, 10 + 6 = 4q. Sort 5, j, 1 in descending order. 5, 1, j Let k(p) = 2p*2 + 7p + 4. Let w be k(-4). Let z be 58/(-18) + w/36. Put z, 4, 1 in decreasing order. 4, 1, z Suppose 2i - 11 = 9. Suppose 0p + 55 = 5p. Suppose -v = 5r - i, -4r - p = -v - 2v. Sort -3, -4, v in decreasing order. v, -3, -4 Let b(y) = y - 3. Let p be b(3). Suppose -3j - 2j = p. Suppose -4q + 14 = q - 2w, 0 = 5q + 5w - 35. Sort j, -5, q in descending order. q, j, -5 Suppose p - 5 = 4. Suppose -5a = -129 + p. Suppose 6k = 3k + 5h - a, -3h = 4k + 3. Sort 3, 1, k. k, 1, 3 Let k = -0.3 + -0.2. Let i = 1/2090 + -474433/6270. Let g = -75 - i. Sort k, -1, g in ascending order. -1, k, g Let k be (-32)/6 - 2/3. Put -1, k, -3 in ascending order. k, -3, -1 Let p(r) = -r*3 + 6r*2 + 9r - 7. Let c be p(7). Suppose c = t - 1. Suppose -4q + t + 0 = 0. Sort q, 3, 1 in ascending order. 1, q, 3 Let k = 1.4 - 4.4. Let q = -8 + 13. Let a be 2/(1/((-3)/(-6))). Sort q, a, k. k, a, q Let p = -5/2 - -29/14. Sort p, -0.5, -2/9. -0.5, p, -2/9 Let r = 112 - 121. Sort -6, r, 2 in decreasing order. 2, -6, r Suppose -3j + 2 = -7. Suppose -4k = -b + 14, -jk - k - 16 = -2b. Let z be (-1 - 0)/((-1)/3). Put 0, k, z in increasing order. k, 0, z Let p = -0.12 + 5.62. Let w = p + -5. Sort -5, w, -0.2 in decreasing order. w, -0.2, -5 Let f be -1 - (-2 - -3)2. Let y be 21/141/f. Sort -6, 1/8, y in descending order. 1/8, y, -6 Suppose j = 9 + 15. Let r be -14(-10)/(-4). Let t be (r/(-8))/((-6)/j). Sort t, -5/6, -3/7. t, -5/6, -3/7 Suppose -3p + 8p + 2g = 8, -2p = 4g. Suppose b - pb = 2. Suppose 5y - 18 = 2. Put y, b, -1 in descending order. y	{ "pile_set_name": "DM Mathematics" }
letters picked without replacement from {h: 14, c: 5}. What is prob of picking 2 h and 1 c? 455/969 What is prob of picking 1 y, 1 p, 1 j, and 1 z when four letters picked without replacement from {z: 2, p: 1, d: 2, j: 7, u: 1, y: 1}? 2/143 What is prob of picking 2 l and 1 d when three letters picked without replacement from {l: 5, r: 2, y: 2, d: 3, h: 1, k: 6}? 10/323 Calculate prob of picking 1 e and 1 q when two letters picked without replacement from {o: 3, q: 3, v: 2, y: 3, z: 1, e: 7}. 7/57 Calculate prob of picking 2 p when two letters picked without replacement from {j: 6, p: 7}. 7/26 Calculate prob of picking 2 c and 2 k when four letters picked without replacement from {k: 11, c: 5}. 55/182 What is prob of picking 1 x and 3 n when four letters picked without replacement from {x: 1, c: 8, n: 4}? 4/715 Four letters picked without replacement from {d: 3, w: 1, o: 3, u: 2, h: 1, b: 2}. What is prob of picking 2 o and 2 b? 1/165 Three letters picked without replacement from rhrfhrrhr. Give prob of picking 1 f and 2 r. 5/42 What is prob of picking 1 e and 2 l when three letters picked without replacement from {o: 2, e: 4, l: 7}? 42/143 What is prob of picking 2 y, 1 k, and 1 s when four letters picked without replacement from {k: 1, n: 1, y: 2, s: 3}? 3/35 Two letters picked without replacement from {h: 3, e: 5, t: 1}. What is prob of picking 1 h and 1 e? 5/12 Two letters picked without replacement from ubvvlbubmmbuubx. What is prob of picking 1 u and 1 x? 4/105 Two letters picked without replacement from nnbjnzknjnjnjnn. What is prob of picking 2 j? 2/35 Calculate prob of picking 1 q, 2 d, and 1 y when four letters picked without replacement from {q: 6, y: 3, h: 3, d: 3, f: 2}. 27/1190 What is prob of picking 1 c and 2 n when three letters picked without replacement from {n: 2, c: 3, h: 4}? 1/28 Two letters picked without replacement from {k: 3, b: 4}. What is prob of picking 2 k? 1/7 Four letters picked without replacement from obfhbbh. Give prob of picking 1 b and 3 f. 0 Three letters picked without replacement from {s: 2, a: 2, g: 1}. What is prob of picking 1 g, 1 s, and 1 a? 2/5 Two letters picked without replacement from {n: 2, l: 4, p: 3}. Give prob of picking 2 n. 1/36 Calculate prob of picking 1 t and 1 u when two letters picked without replacement from {u: 2, q: 7, g: 1, t: 2}. 2/33 Two letters picked without replacement from {e: 3, u: 4, t: 3, h: 3}. Give prob of picking 1 u and 1 e. 2/13 Three letters picked without replacement from eeeetkkl. Give prob of picking 1 k and 2 e. 3/14 Calculate prob of picking 2 z when two letters picked without replacement from {z: 7, w: 9}. 7/40 What is prob of picking 2 u when two letters picked without replacement from uuuuvvvuuvuvuuuu? 11/24 Three letters picked without replacement from {c: 6, h: 11, v: 2}. What is prob of picking 3 h? 55/323 Three letters picked without replacement from {s: 7, d: 7, x: 2}. Give prob of picking 2 d and 1 s. 21/80 What is prob of picking 2 h when two letters picked without replacement from hjkhsshjjh? 2/15 Calculate prob of picking 1 w and 1 i when two letters picked without replacement from wupiupiiwip. 8/55 Four letters picked without replacement from nnttnsnasnkskn. What is prob of picking 3 n and 1 a? 20/1001 Two letters picked without replacement from {h: 2, w: 1, v: 1, n: 1, u: 2}. What is prob of picking 2 h? 1/21 Three letters picked without replacement from {c: 1, v: 1, a: 3, h: 2}. What is prob of picking 1 v, 1 c, and 1 h? 2/35 Four letters picked without replacement from lldzzoko. Give prob of picking 1 k, 2 z, and 1 o. 1/35 Four letters picked without replacement from pppysppsyyup. Give prob of picking 2 p and 2 y. 1/11 Calculate prob of picking 2 c, 1 x, and 1 k when four letters picked without replacement from {e: 3, k: 2, c: 4, s: 2, x: 1}. 4/165 Calculate prob of picking 1 t, 1 w, and 1 h when three letters picked without replacement from {t: 2, h: 6, w: 7}. 12/65 Two letters picked without replacement from fnodnnnnnaddnnndnfdn. What is prob of picking 1 n and 1 o? 11/190 What is prob of picking 1 q and 1 v when two letters picked without replacement from {o: 2, v: 1, q: 2, k: 1, y: 4}? 2/45 Two letters picked without replacement from efejpeepme. Give prob of picking 1 p and 1 m. 2/45 What is prob of picking 1 o and 2 u when three letters picked without replacement from {u: 13, o: 3}? 117/280 What is prob of picking 1 c and 2 d when three letters picked without replacement from {c: 2, d: 5}? 4/7 Calculate prob of picking 3 u when three letters picked without replacement from {u: 17, f: 1}. 5/6 Three letters picked without replacement from {u: 5, p: 5, x: 2, s: 1, j: 3, t: 4}. What is prob of picking 1 x, 1 s, and 1 t? 2/285 Three letters picked without replacement from {d: 5, o: 3, s: 9, q: 1}. What is prob of picking 2 o and 1 d? 5/272 Calculate prob of picking 1 l and 1 a when two letters picked without replacement from lvlovavlll. 1/9 What is prob of picking 2 s when two letters picked without replacement from {k: 6, l: 1, s: 6, h: 1, o: 1}? 1/7 Calculate prob of picking 1 a and 1 l when two letters picked without replacement from lalaoolla. 1/3 Three letters picked without replacement from ymymayyyyyymmiym. Give prob of picking 2 y and 1 m. 9/28 Two letters picked without replacement from {q: 1, e: 1, w: 2}. What is prob of picking 1 w and 1 q? 1/3 Two letters picked without replacement from {l: 2, t: 1, u: 3, v: 3, d: 1}. What is prob of picking 1 u and 1 l? 2/15 Three letters picked without replacement from {n: 3, h: 1}. What is prob of picking 2 n and 1 h? 3/4 Two letters picked without replacement from csnycim. Give prob of picking 1 y and 1 m. 1/21 Three letters picked without replacement from {e: 5, k: 3, l: 1, p: 1, w: 2, b: 1}. Give prob of picking 2 e and 1 l. 5/143 Four letters picked without replacement from iiixxyccxxuixxxi. What is prob of picking 2 x, 1 i, and 1 u? 3/52 Three letters picked without replacement from vbxsxavvxssbf. Give prob of picking 1 f, 1 b, and 1 x. 3/143 Two letters picked without replacement from taiztiicctitcicicccc. What is prob of picking 1 a and 1 z? 1/190 Calculate prob of picking 1 y, 1 i, and 2 f when four letters picked without replacement from ifffyyyff. 5/21 Four letters picked without replacement from qyyhrhhhhlryhrlhqq. What is prob of picking 1 h and 3 r? 7/3060 Two letters picked without replacement from ootoooroo. Give prob of picking 1 t and 1 o. 7/36 What is prob of picking 1 o and 1 a when two letters picked without replacement from aoaaaaaoaaaaaoaaao? 56/153 Four letters picked without replacement from {h: 3, k: 5, f: 5}. What is prob of picking 1 k and 3 h? 1/143 Three letters picked without replacement from {e: 5, p: 3, t: 2, x: 2, a: 2, n: 2}. Give prob of picking 1 a and 2 x. 1/280 Four letters picked without replacement from hchci. Give prob of picking 1 i, 2 c, and 1 h. 2/5 Three letters picked without replacement from {m: 1, o: 3, a: 4, j: 1, z: 4}. What is prob of picking 2 o and 1 a? 6/143 Three letters picked without replacement from {b: 2, u: 11, x: 5, y: 2}. What is prob of picking 1 b and 2 y? 1/570 Three letters picked without replacement from frfffrrfrfrfufrffuf. Give prob of picking 3 r. 20/969 Calculate prob of picking 3 q and 1 p when four letters picked without replacement from pqpqqqpqpqq. 14/33 Calculate prob of picking 1 r, 1 j, and 1 h when three letters picked without replacement from {j: 1, f: 1, h: 2, r: 3}. 6/35 Calculate prob of picking 1 h and 1 y when two letters picked without replacement from hykhklz. 2/21 Calculate prob of picking 3 c when three letters picked without replacement from cccccccf. 5/8 What is prob of picking 1 g, 1 h, and 1 d when three letters picked without replacement from dgdkhdl? 3/35 Calculate prob of picking 1 a and 1 s when two letters picked without replacement from xxsssac. 1/7 Three letters picked without replacement from {e: 16, d: 4}. Give prob of picking 1 e and 2 d. 8/95 Two letters picked without replacement from {k: 2, j: 1, p: 1, w: 2}. Give prob of picking 1 w and 1 j. 2/15 What is prob of picking 2 w when two letters picked without replacement from {i: 2, w: 8}? 28/45 What is prob of picking 1 o, 1 i, 1 h, and 1	{ "pile_set_name": "DM Mathematics" }
y. 1 Solve 16 - 32 = -4a for a. 4 Solve 4p = -5p - 27 for p. -3 Solve -5y + 240 = 225 for y. 3 Solve 503g = 512g - 18 for g. 2 Solve -20d - 728 = -111d for d. 8 Solve -12 = -48j + 52j for j. -3 Solve 32 = -19g + 11g for g. -4 Solve 8d - 10d = 0 for d. 0 Solve 9 = m + 14 for m. -5 Solve 33f + 156 = -108 for f. -8 Solve -1980y + 6 = -1982y for y. -3 Solve 0 = 8v - 13v + 10 for v. 2 Solve 0 = -w - 33 + 39 for w. 6 Solve -89k + 77k = 12 for k. -1 Solve 0 = 2b - b + 3 for b. -3 Solve 0 = 5m - 6m - 2 for m. -2 Solve -57n + 282 + 60 = 0 for n. 6 Solve -7t - t = 0 for t. 0 Solve -15d + 69 + 36 = 0 for d. 7 Solve 24 = 12t - 18t for t. -4 Solve -4q = 6 + 22 for q. -7 Solve -30 = -69x + 54x for x. 2 Solve 10a = 15a - 25 for a. 5 Solve -27h = -31h for h. 0 Solve 0 = 13q + 21q - 34 for q. 1 Solve 7 = 6m - 13m for m. -1 Solve 0 = 3c - 6 for c. 2 Solve -113 + 107 = 6i for i. -1 Solve -1126 = 13y - 1178 for y. 4 Solve 0 = -11q + 3 - 47 for q. -4 Solve -5x = -4x + 2 for x. -2 Solve -45q + 28 = -107 for q. 3 Solve 20 = 7z - 2z for z. 4 Solve 547 = 22t + 613 for t. -3 Solve 9w - 23 = 4 for w. 3 Solve -5u = -826 + 861 for u. -7 Solve 5j + 18 - 18 = 0 for j. 0 Solve 0 = -3y - 16y for y. 0 Solve 27q + 272 = 56 for q. -8 Solve 124b - 150 = 154b for b. -5 Solve -23a + 17a = 18 for a. -3 Solve -29 + 9 = 4q for q. -5 Solve 38i + 14 = 36i for i. -7 Solve 25 + 6 = -31o for o. -1 Solve -5 = 7r + 23 for r. -4 Solve -11b - 10 = -6b for b. -2 Solve 5o = 6o + 1 for o. -1 Solve 0 = 8q - 10q + 10 for q. 5 Solve -55 = -21z - 13 for z. 2 Solve -240v - 11 = -251v for v. 1 Solve -15m - 1 = -14m for m. -1 Solve -27q + 20 = -37q for q. -2 Solve 6v + 104 = 68 for v. -6 Solve 29q - 14 - 247 = 0 for q. 9 Solve -7k - 23k = -270 for k. 9 Solve -5 = 7l + 23 for l. -4 Solve -36 + 96 = -10l for l. -6 Solve -544 = 25r + 43r for r. -8 Solve 21 - 3 = -18s for s. -1 Solve -3 = 94v - 91v for v. -1 Solve -84k + 14 = -91k for k. -2 Solve 101j - 105j - 12 = 0 for j. -3 Solve 0 = 7y + 5 + 30 for y. -5 Solve 9v + 25 = 25 for v. 0 Solve 30d = 52d + 44 for d. -2 Solve 0 = -51z + 53z - 10 for z. 5 Solve -4p + 72 = 72 for p. 0 Solve 0 = 10t + 239 - 219 for t. -2 Solve -5q + 684 = 659 for q. 5 Solve 5h = h + 20 for h. 5 Solve -36 = -21h + 3h for h. 2 Solve 0 = 3u + 1076 - 1058 for u. -6 Solve -33 = -3p - 24 for p. 3 Solve 4g - 23 = -3 for g. 5 Solve -3104u + 3097u = -49 for u. 7 Solve 2r + 12r + 28 = 0 for r. -2 Solve n + 4 - 2 = 0 for n. -2 Solve 2s + 16 - 4 = 0 for s. -6 Solve -5w - 50 = -75 for w. 5 Solve 117c - 3 = 114c for c. 1 Solve -70 + 15 = -11i for i. 5 Solve 9p = -26 - 1 for p. -3 Solve 6c + 45 = 15c for c. 5 Solve -30 = 39n - 33n for n. -5 Solve 0 = -5k - 26k - 310 for k. -10 Solve -468j = -453j for j. 0 Solve 0 = -89u + 88u - 2 for u. -2 Solve 3z = -86 + 68 for z. -6 Solve 12z = 176 - 116 for z. 5 Solve -43 + 87 = 11i for i. 4 Solve -40z = -36z - 20 for z. 5 Solve 0 = 5g - 1150 + 1125 for g. 5 Solve -18 = 1333i - 1330i for i. -6 Solve -5m = -0 - 10 for m. 2 Solve 24g + 39g - 315 = 0 for g. 5 Solve 19b + 101 = 6 for b. -5 Solve 23 = 7x - 12 for x. 5 Solve 2021 = 11w + 2076 for w. -5 Solve -112u = -124u - 84 for u. -7 Solve -40u = -30u - 40 for u. 4 Solve -183 - 233 = -52b for b. 8 Solve 5s + 49s = -162 for s. -3 Solve 14 = -8j + 6 for j. -1 Solve 12d + 36 + 12 = 0 for d. -4 Solve 0 = -91a - 47a - 1104 for a. -8 Solve -11d + 0d - 22 = 0 for d. -2 Solve -26t = -13 - 91 for t. 4 Solve -11c + 7c + 12 = 0 for c. 3 Solve -9q - 44 = -35 for q. -1 Solve -5x = -7x + 8 for x. 4 Solve -352 + 44 = -44q for q. 7 Solve 0 = 41x - 25 - 16 for x. 1 Solve 2b + 14 = 9b for b. 2 Solve -34p = -10p - 96 for p. 4 Solve 0 = -27p + 41p - 42 for p. 3 Solve h - 51 = -53 for h. -2 Solve -49i = -39i + 80 for i. -8 Solve 20 = -5x - 15 for x. -7 Solve 0 = 3n - 15 + 27 for n. -4 Solve 20g - 13g + 21 = 0 for g. -3 Solve 13 = 29a + 187 for a. -6 Solve 6t + 2t - 32 = 0 for t. 4 Solve -3g = -32 + 17 for g. 5 Solve 5s + 137 = 162 for s. 5 Solve 68 = -27r - 67 for r. -5 Solve -6n + 9 = -3 for n. 2 Solve 131 - 68 = 9a for a. 7 Solve 21b - 20 = 16b for b. 4 Solve 28 + 28 = -14a for a. -4 Solve 1543 = 10z + 1493 for z. 5 Solve 0 = -66v + 60v + 12 for v. 2 Solve -19f + 15f = -16 for f. 4 Solve 9p + 15 + 48 = 0 for p. -7 Solve -19m = -2m + 51 for m. -3 Solve 2t + 863 = 845 for t. -9 Solve 589 = 5s + 619 for s. -6 Solve -428 = -4p - 452 for p. -6 Solve -19h = -18h - 5 for h. 5 Solve 0 + 6 = 2h for h. 3 Solve -658 = 12z - 778 for z. 10 Solve 75u - 81u = -42 for u. 7 Solve 32a = 11a - 84 for a. -4 Solve 416s - 424s = 0 for s. 0 Solve -7 = 34j - 35j for j. 7 Solve 8a + 7 = 7 for a. 0 Solve 88s = 104s + 48 for s. -3 Solve -6b + 49 - 7 = 0 for b. 7 Solve 0 = 10l - 6l - 4 for l. 1 Solve -9d + 12d = -15 for d. -5 Solve -6 = 4c - 18 for c. 3 Solve -2g + 150 - 154 = 0 for g. -2 Solve -16a - 16 = -0 for a. -1 Solve 461q = 462q + 7 for q. -7 Solve -79k + 10 = -81k for k. -5 Solve -46 = 10g - 86 for g. 4 Solve -65d + 28d + 37 = 0 for d. 1 Solve 0 = -8o + 14 - 46 for o. -4 Solve 7h + 56 = 28 for h. -4 Solve -2z - 5z + 0z = 0 for z. 0 Solve -4i - 108 = -104 for i. -1 Solve -239u + 44u = -1755 for u. 9 Solve 13l - 15l = 10 for l. -5 Solve -30p = 106 + 104 for p. -7 Solve -q + 30 - 32 = 0 for q. -2 Solve -5y + 0 = -20 for y. 4 Solve 3 = k + 8 for k. -5 Solve 22i - 322 = -168 for i. 7 Solve 21i - 27i = 42 for i. -7 Solve 31i - 23 = -178 for i. -5 Solve -12g - 141 = -153 for g. 1 Solve 5x - 621 = -591 for x. 6 Solve -22 = -7q - 1 for q. 3 Solve 80 = 6o + 26 for o. 9 Solve -5h = -23h - 54 for h. -3 Solve -65n - 237 + 42 = 0 for n. -3 Solve -13r + 4 = -48 for r. 4 Solve -7h + 0h = -56 for h. 8 Solve -3l - 8 = -l for l. -4 Solve 0 = -80t - 137 + 457 for t. 4 Solve -58x + 66 = -47x for x. 6 Solve 4u - 5u = 1 for u. -1 Solve 8w - 24 = 2w for w. 4 Solve 0 = 271j - 251j + 80 for j. -4 Solve -6 = -12z - 30 for z. -2 Solve 2n = 9n + 7n for n. 0 Solve -4s + 77 - 85 = 0 for s. -2 Solve 138 = -18u + 48 for u. -5 Solve 0a = 28a - 28 for a. 1 Solve o - 40 = -19o for o. 2 Solve 20 = -17g + 71 for g. 3 Solve 27 = -3v - 6v for v. -3 Solve -16r - 927 = 87r for r. -9 Solve 0 = 4f - 8f + 8 for f. 2 Solve -22 - 12 = -17w for w. 2 Solve 4m + 26 = 30 for m. 1 Solve 7m - 12 = 4m for m. 4 Solve 76g + 11g = -783 for g. -9 Solve 7x + 336 = 350 for x. 2 Solve 99 + 93 = 24m for m. 8 Solve -2w - 15 = -17w for w. 1 Solve 432 - 112 = -32d for d. -10 Solve 0 = 18x - 17x - 3 for x. 3 Solve 16 = -2m - 14m for m. -1 Solve 0 = 8v - 17v + 54 for v. 6 Solve 7 + 59 = -11t for t. -6 Solve -20h + 34h = 112 for h. 8 Solve 0 = -5u + 16 - 1 for u. 3 Solve 72j + 34j = -530 for j. -5 Solve -52 = 29d - 168 for d. 4 Solve 14s - 8 = 10s for s. 2 Solve 4 = 4r - 0 for r. 1 Solve 3287w = 3290w - 12 for w. 4 Solve -15l + 11l = 20 for l. -5 Solve -4y = -10y + 12 for y. 2 Solve -665b + 659b = 12 for b. -2 Solve -15s - 21 = -8s for s. -3 Solve 0 = 111s - 128s + 102 for s. 6 Solve -502h = -498h + 20 for h. -5 Solve x = -0x - 1 for x. -1 Solve -6z + 21z = -15 for z. -1 Solve -74h - 7 = -81h for h. 1 Solve 476a - 478a = -18 for a. 9 Solve 1 = -160l + 161l for l. 1 Solve 20m = 21m for m. 0 Solve -13 = 16i + 51 for i. -4 Solve 17p - 110 = -42 for p. 4 Solve -5f - 2 + 7 = 0 for f. 1 Solve -28b - 110b + 1518 = 0 for b. 11 Solve -354f - 36 = -360f for f. 6 Solve 27q - 5 = 28q for q. -5 Solve -15g + 52 = -8 for g. 4 Solve 0 = i + 48 - 42 for i. -6 Solve 0 = 6f + 531 - 567 for f. 6 Solve -42 = 14h - 21h for h. 6 Solve 0 = -2c - 75 + 81 for c. 3 Solve -5u + 456 = 446 for u. 2 Solve -47 - 43 = -15k for k. 6 Solve -31k + 185 = 61 for k. 4 Solve -b + 7b - 4b = 0 for b. 0 Solve -5c - 24 = 1 for c. -5 Solve 0 = -4r - 7 - 5 for r. -3 Solve -55 = 22i - 33i for i. 5 Solve 46 = -5g + 31 for g. -3 Solve -48 = -179p + 185p for p. -8 Solve 0 = 27q - 10 - 125 for q. 5 Solve -3v + 591 - 612 = 0 for v. -7 Solve 0 = y - 2 for y. 2 Solve -21 = -10f + 7f for f. 7 Solve 14z = 10*	{ "pile_set_name": "DM Mathematics" }
ed to the nearest 100000? -200000 What is -0.8709 rounded to 2 decimal places? -0.87 Round -0.00022599 to 5 dps. -0.00023 What is 9433000 rounded to the nearest one million? 9000000 What is 1712300 rounded to the nearest 1000000? 2000000 What is -989.4 rounded to the nearest ten? -990 What is 0.00000236 rounded to six dps? 0.000002 What is -34.63 rounded to 0 decimal places? -35 Round 328740 to the nearest one thousand. 329000 Round 0.6128 to 1 dp. 0.6 What is 47690 rounded to the nearest one hundred thousand? 0 Round -73210 to the nearest 10000. -70000 What is -3.28 rounded to 1 decimal place? -3.3 What is -88500000 rounded to the nearest 1000000? -89000000 What is -3662900 rounded to the nearest 10000? -3660000 Round 934 to the nearest one hundred. 900 What is -0.001757 rounded to 5 dps? -0.00176 Round 0.0000073074 to 6 dps. 0.000007 Round 122500 to the nearest one thousand. 123000 Round -0.0000023199 to 7 dps. -0.0000023 Round -0.0283313 to four dps. -0.0283 Round 0.0000013318 to seven decimal places. 0.0000013 What is 0.053749 rounded to four decimal places? 0.0537 What is 1.762 rounded to 0 decimal places? 2 Round 0.0065197 to 3 decimal places. 0.007 What is 0.003801 rounded to four decimal places? 0.0038 What is -4360 rounded to the nearest one hundred? -4400 What is -347 rounded to the nearest 100? -300 What is 0.0005612 rounded to five decimal places? 0.00056 What is -0.00113 rounded to three dps? -0.001 Round 0.00000559 to 6 decimal places. 0.000006 Round 4707.9 to the nearest 1000. 5000 What is -0.000879 rounded to 4 dps? -0.0009 Round 0.0022182 to four dps. 0.0022 What is 0.006947 rounded to 4 dps? 0.0069 What is 0.000987 rounded to three dps? 0.001 Round -6818100 to the nearest one hundred thousand. -6800000 What is 115640 rounded to the nearest one thousand? 116000 What is -0.00019003 rounded to five decimal places? -0.00019 Round -0.071764 to 2 decimal places. -0.07 What is -0.001673 rounded to 4 dps? -0.0017 Round 34.015 to the nearest integer. 34 What is -0.00688 rounded to four decimal places? -0.0069 Round 0.00016475 to six decimal places. 0.000165 Round 52250 to the nearest one thousand. 52000 What is -0.000032289 rounded to 7 dps? -0.0000323 What is -329635000 rounded to the nearest 1000000? -330000000 Round 51900 to the nearest ten thousand. 50000 What is -0.061629 rounded to two decimal places? -0.06 What is 0.0000011653 rounded to seven decimal places? 0.0000012 Round -0.947 to 1 decimal place. -0.9 What is -0.3833 rounded to three decimal places? -0.383 What is 0.00000377581 rounded to seven dps? 0.0000038 Round -5226 to the nearest 1000. -5000 Round 178612 to the nearest ten thousand. 180000 What is 14.975 rounded to one dp? 15 What is 94844 rounded to the nearest 100? 94800 Round 0.23738 to two dps. 0.24 What is -8716 rounded to the nearest one thousand? -9000 What is -75287 rounded to the nearest 1000? -75000 Round 18.1319 to 2 dps. 18.13 What is 3930300 rounded to the nearest ten thousand? 3930000 What is 162.749 rounded to the nearest integer? 163 What is -0.09351 rounded to three decimal places? -0.094 Round -113774000 to the nearest one million. -114000000 Round 0.000716 to 4 dps. 0.0007 What is 0.000121982 rounded to 5 dps? 0.00012 Round -99190000 to the nearest one million. -99000000 Round 66198.4 to the nearest 100. 66200 What is -2904.8 rounded to the nearest 10? -2900 Round 0.000043952 to six decimal places. 0.000044 Round 2230.9 to the nearest 10. 2230 What is -7420000 rounded to the nearest one million? -7000000 What is -117380000 rounded to the nearest one million? -117000000 Round -146.85 to 0 dps. -147 What is 0.0001673 rounded to five dps? 0.00017 Round -1.9323 to 2 decimal places. -1.93 Round -0.0000129004 to seven decimal places. -0.0000129 Round 76300 to the nearest 1000. 76000 What is -0.0009337 rounded to four dps? -0.0009 What is -1.028 rounded to the nearest 10? 0 Round -8592000 to the nearest one hundred thousand. -8600000 Round -166490000 to the nearest one million. -166000000 Round -637000 to the nearest one million. -1000000 Round 0.333 to 2 dps. 0.33 What is -24.491 rounded to 1 decimal place? -24.5 What is -72064 rounded to the nearest one hundred? -72100 Round 0.0030463 to four decimal places. 0.003 Round -1196.65 to the nearest 10. -1200 What is 680000 rounded to the nearest 100000? 700000 What is 0.0000074337 rounded to six decimal places? 0.000007 What is 5447600 rounded to the nearest one million? 5000000 What is 0.709 rounded to 1 dp? 0.7 What is 0.00061428 rounded to 5 dps? 0.00061 What is -927.11 rounded to the nearest ten? -930 What is -0.0613 rounded to 3 dps? -0.061 Round 13.759 to 0 dps. 14 Round -1130000 to the nearest one hundred thousand. -1100000 What is -162246 rounded to the nearest 1000? -162000 What is 0.058316 rounded to two dps? 0.06 What is -4.8602 rounded to 2 decimal places? -4.86 Round 0.000011587 to seven dps. 0.0000116 What is -0.0862 rounded to three dps? -0.086 Round -0.0000050664 to 7 decimal places. -0.0000051 Round 101630 to the nearest ten thousand. 100000 What is -1293700 rounded to the nearest 100000? -1300000 What is -0.007232 rounded to three dps? -0.007 Round -0.00032347 to five decimal places. -0.00032 What is 0.02994 rounded to two dps? 0.03 Round 98.634 to the nearest ten. 100 What is 0.000025 rounded to four dps? 0 What is 5626 rounded to the nearest 1000? 6000 Round 79007 to the nearest one hundred. 79000 Round -0.000008616 to seven dps. -0.0000086 Round 0.07005 to two decimal places. 0.07 Round 0.0000925 to four dps. 0.0001 What is 29.43 rounded to zero dps? 29 What is -46.19 rounded to the nearest 10? -50 What is 4708 rounded to the nearest 100? 4700 Round -0.00004795 to 6 decimal places. -0.000048 What is -1300.36 rounded to the nearest 10? -1300 What is 0.3941 rounded to one dp? 0.4 What is 8363000 rounded to the nearest one million? 8000000 What is 16176000 rounded to the nearest 1000000? 16000000 What is -276.36 rounded to the nearest ten? -280 Round 0.00001378 to 6 decimal places. 0.000014 What is 0.0002093 rounded to five decimal places? 0.00021 Round 0.000014012 to 6 dps. 0.000014 What is 0.13444 rounded to 2 dps? 0.13 Round 12258200 to the nearest one hundred thousand. 12300000 Round -1836 to the nearest ten. -1840 Round 5.0629 to 2 dps. 5.06 What is 0.05278 rounded to two decimal places? 0.05 What is -10330000 rounded to the nearest 1000000? -10000000 Round -0.000000326921 to seven decimal places. -0.0000003 What is -12063.3 rounded to the nearest 100? -12100 What is 0.000100415 rounded to six decimal places? 0.0001 What is 0.0005093 rounded to 4 dps? 0.0005 Round 0.2213 to two decimal places. 0.22 Round 0.004916 to 5 decimal places. 0.00492 What is -0.0006654 rounded to 5 dps? -0.00067 Round 0.00000904 to 5 dps. 0.00001 What is 0.0000006486 rounded to 7 decimal places? 0.0000006 Round 13.24 to 0 decimal places. 13 What is 9450000 rounded to the nearest 1000000? 9000000 What is 0.0000016621 rounded to 7 dps? 0.0000017 What is 0.000000272 rounded to six dps? 0 What is -1.1197 rounded to 1 dp? -1.1 Round -9940 to the nearest 1000. -10000 What is 350500 rounded to the nearest 10000? 350000 What is 0.4699 rounded to 1 decimal place? 0.5 What is 96210 rounded to the nearest one thousand? 96000 What is 0.000948 rounded to 4 dps? 0.0009 Round 0.00001578 to six decimal places. 0.000016 Round 0.000048763 to 6 dps. 0.000049 What is -4160400 rounded to the nearest one hundred thousand? -4200000 What is 5.97 rounded to the nearest integer? 6 Round -0.046382 to four decimal places. -0.0464 Round 0.497 to 2 decimal places. 0.5 What is -11090000 rounded to the nearest one million? -11000000 What is -69000 rounded to the nearest 10000? -70000 What is 0.00001353 rounded to six decimal places? 0.000014 Round 43958 to the nearest 10000. 40000 Round -45.2 to the nearest one hundred. 0 What is -0.00131168 rounded to four dps? -0.0013 What is -0.118746 rounded to 2 dps? -0.12 What is -0.012071 rounded to four decimal places? -0.0121 What is 14072 rounded to the nearest one hundred? 14100 What is -3607000 rounded to the nearest 1000000? -4000000 What is 10620 rounded to the nearest ten thousand? 10000 Round -4790.8 to the nearest 100. -4800 What is 0.00	{ "pile_set_name": "DM Mathematics" }
6/5 + 17827/210. Find the common denominator of j and -55/27. 378 Let v(r) = r*2 + 8r + 4. Suppose k + 5g = 4k - 40, 0 = -4k - 4g + 32. Calculate the smallest common multiple of k and v(-8). 20 Suppose 2q + 10 = 3z, 5z - 8 = 4q + 10. Suppose -t = 3m + 20, -5t - 3m + 3 = 43. What is the lowest common multiple of (-1)/(-5) - 34/t and z? 14 Calculate the common denominator of (-329)/35 + 9 + (-401)/(-390) and -97/52. 156 Suppose -1835 - 1674 = -29r. Calculate the lowest common multiple of 55 and r. 605 Suppose 6c - 8c = -14. Let o = c + -1. Suppose 0 = 4b - 3j - o - 11, -5j = 5b - 65. What is the lowest common multiple of 11 and b? 88 Let g = -34 + 38. Suppose gy = 5y - 46. Calculate the lowest common multiple of 12 and y. 276 Suppose -4p = -7p + 18. Find the common denominator of -37/7 and (-2424)/(-462) + p/(-14). 77 Let w(q) = -3q - 24. Suppose 5 = 5y, 5o + 40 = -5y - 15. Let c(u) = 11u2 - 2u + 1. Calculate the lowest common multiple of w(o) and c(1). 60 Suppose 18o - 160 - 164 = 0. What is the lowest common multiple of o and 33? 198 Suppose 4z = -41 - 19. Let h be 216/8(-4)/(-18). What is the least common multiple of 2 and 1h(-10)/z? 4 Let n(v) = 4v*2. Let a be n(-5). Suppose 5f = 2g + 96, -a = -3f - 4g - 32. Suppose 5u - 37 = 63. What is the lowest common multiple of u and f? 20 What is the common denominator of ((-5)/(-45))/((-10)/165) and -115/816? 816 Let h = 63 + -39. What is the least common multiple of (-2)/(-11) - (-3406)/143 and h? 24 Calculate the common denominator of -58/3 and 879/126 + (-51)/17. 42 Suppose -41i + 39i = 3p - 50, -32 = -2p - 2i. Suppose 0t + 4t - 48 = 0. What is the smallest common multiple of t and p? 36 Let p = 47 - 27. Suppose -2n = -7n - 65. Let k = n + 25. Calculate the smallest common multiple of k and p. 60 What is the lowest common multiple of 6 and 9/15 + 588/20? 30 Let i = 54 + -52. Let r(z) = -3z - 6. What is the least common multiple of r(-6) and i? 12 Let s = -30 + 34. Calculate the common denominator of (3/s)/(1/(260/(-12))) and 113/6. 12 Suppose 3s - 13 = -5c, 2c + 7 = 2s - 7. Calculate the smallest common multiple of s and 6. 6 Let i be ((-8)/65862)/(12/18). Let n = 5323837/43908 - i. Let s = n - 122. Calculate the common denominator of s and -77/2. 4 Let m(s) = 6s - 16. Let y be m(11). Let l be -2 - -3 - (-1 + 2). Suppose l = 4t - 30 - y. Calculate the smallest common multiple of t and 14. 140 Let t(v) = v*3 - 31v*2 + 40v - 273. What is the smallest common multiple of 54 and t(30)? 54 Let o(y) be the second derivative of y*3/3 + 6y*2 - 20y. Calculate the least common multiple of 8 and o(-4). 8 Suppose -4f + 2 = -6. Let b be (-32)/(-4) + 3 + -1. Suppose 13j - 33 = bj. Calculate the least common multiple of f and j. 22 Suppose 2a - 248 = -3p, -4a + 453 - 37 = 5p. Let c = 43381/66 - 1975/3. What is the common denominator of c and 42((-6)/20)/(p/25)? 176 Suppose 0 = -14b + 944 - 174. What is the smallest common multiple of b and 35? 385 Let m(q) = 6q + 12. Let k be m(-7). Calculate the lowest common multiple of -14(k/(-21) - 2) and 13. 104 Let i be 126/(-4)(-26)/39. Suppose -2b + i = b. What is the lowest common multiple of 18 and 12/4 + -2 + b? 72 Let w = -137/28 + 15/7. Suppose -3p = 2b - 2p + 61, 59 = -3b + 5p. What is the common denominator of 5/b-63 and w? 28 Let u be ((-8)/10)/(18/(-45)). Suppose 56 = 2g + ug. What is the least common multiple of 20 and g? 140 Let j = -1105045689/200 + 5525217. Let y = 5961/9575 + 22/383. Let v = j - y. Calculate the common denominator of -76/9 and v. 72 Suppose -31v - 5q = -36v + 40, 14 = 2v - 4q. Suppose -3o + 11 = 5u - o, -3u - 3o = -3. What is the lowest common multiple of v and u? 9 Let q be (-2)/(-11) - (-3 - (-191955)/(-33)). Let p = 128125/22 - q. Find the common denominator of p and 0 + (-183)/60 + 0. 220 Suppose l - 2l - 5k + 41 = 0, -5k + 97 = 2l. Calculate the lowest common multiple of 42 and l. 168 Suppose -5s - 4s + 117 = 0. Find the common denominator of (48/(-160))/((-3)/s) and 52/9. 90 Let k = 9281/1130 - 41/5. Let d = 1817/678 - k. What is the common denominator of -56/5 and d? 15 What is the common denominator of -77/50 and ((55/250)/(-11))/(36/6390)? 100 Let g(h) = h2 - 20h + 36. Let z be g(18). Suppose z = -k - 4r + 6 + 18, -2k - 7 = -3r. What is the least common multiple of 20 and k? 20 Let i = 739/76 + -75/38. What is the common denominator of 59/3 and i? 12 Let y(o) = -o3 + 7o*2 - 5o - 2. Let i be y(6). Suppose -3n + in = 10. What is the lowest common multiple of 2 and n? 10 Let l(w) = w*2 + w + 6. Suppose -5h - 473 = -513. Suppose 120 = hb + 4b. What is the lowest common multiple of l(0) and b? 30 Suppose 11451 = -i + 2052. Let w = -19417/2 - i. Let f = w + 354. Find the common denominator of 25/2 and f. 2 Calculate the common denominator of -17/6 and (-20)/(-90)(-65)/54. 486 Let f = -108 + 148. Suppose j - 5q = 5 - 0, 0 = -2j - 5q + 55. Calculate the least common multiple of j and f. 40 Calculate the least common multiple of ((-10)/(-7))/(47/329) and 40. 40 What is the least common multiple of -2 - ((10/5)/2 - 10) and 43? 301 Suppose -9l = 127 - 1423. Calculate the smallest common multiple of l and 22. 1584 Find the common denominator of 87/28 and 18/27-2 - 410/84. 28 Suppose -m + 3f = -6m, -f - 8 = -m. Let y = 0 + m. Find the common denominator of 29/16 and -3 + 225/42 + y. 112 Let p be (25/20 + -2)/((-1)/364). Let v = 461 + -989/2. What is the common denominator of v and p/120 + (-6)/(-16)? 20 Calculate the common denominator of (-1267)/315 - 16/(-72) and (-14)/(-10) - (0 - 0). 5 Let d be 7 - -5 - 5/1. Suppose 4f + d = 11. Calculate the lowest common multiple of f and 11. 11 What is the common denominator of (-331)/90 - (-1300)/390 and 29/210? 630 Let c = 33 - 29. Suppose -33 = -7u + cu. Calculate the lowest common multiple of 2 and u. 22 Suppose -2m + 6m + 3t = 41, -9 = -3t. What is the smallest common multiple of 9 and m? 72 Let w be -1669(0 - 1/(-76)). Let v = -49/38 + w. Calculate the common denominator of v and 13/8. 8 Let t be (-2)/(-1)(-69)/(-6). Let x = t - 15. What is the lowest common multiple of x/6 + (-6)/(-9) and 3? 6 Suppose 3x - 135 = -6x. Let i(g) = 3g - 37. What is the least common multiple of 8 and i(x)? 8 Let w(d) = 29d - 249. What is the smallest common multiple of 84 and w(12)? 2772 What is the least common multiple of (-14 + 42/7)1796/(-16) and 22? 9878 Let o(g) = g*3 - 13g*2 - 10g - 40. Calculate the smallest common multiple of o(14) and 52. 208 Suppose -s - 4k + 12 = k, -2s + 24 = -3k. Let d(u) = 6u + 38. What is the lowest common multiple of s and d(-6)? 12 What is the smallest common multiple of 18 and ((-65880)/(-1708))/(4/14)? 270 Let j(c) = 2c2 + 4c + 4. Let t be ((-1)/(-3) + 1)-3. Let b(y) = -y3 - 4y*2 + 4y - 3. Calculate the lowest common multiple of j(t) and b(-5). 20 Let c(j) = -110 - j + 43 + 50. Calculate the smallest common multiple of 2/(-8) - 82/(-8) and c(-25). 40 Let j(h) = 3h + 2. Suppose 196d - 76 = 177d. Calculate the lowest common multiple of d and j(3). 44 Let v be (4/(-6))/(1/954). Let s = 49339/10 - 4929. Find the common denominator of s and (v/(-126))/((-8)/6). 70 Let q = 154/109 + -14255/1526. Let z(y) = -2y*2 + 15y + 8. Let x be z(8). Find the common denominator of -2(-265)/(-110) - x and q. 154 Let k be 5 - 1 - 287/(-7). Let f = k + -25. What is the least common multiple of 40 and f? 40 Let s = 219 + -214. Calculate the least common multiple of s and 8. 40 Calculate the common denominator of -29/26 and 1/(10/4)(-444)/(-48). 130 Let k = 6469 + -51671/8. What is the common denominator of k and -101/170? 680 Calculate the common denominator of 1804/40 + -3 + 34/10 and 77/34. 34 Let d = 40 - 22. Calculate the least common multiple of d and 8/(-24) + 50/6. 72 Find the common denominator of 53/21 and ((-2064)/1053 + 2)/((-48)/180). 1638 Let u = 3 - 12. What is the common denominator of 55/9 and u/15 + (-222)/(-120)? 36 Find the common denominator of (-131 - -125) + 2/(-8)52/10 and (-151(-1)/6)/8. 240 Let f = 410 - 1077. Let g = -12017/18 - f. Let x = 495945/22 + -22547. Find the common denominator of x and g. 198 What	{ "pile_set_name": "DM Mathematics" }
2u + 4f - 230 = 0. Suppose 3g + u = -0t + t, -3g = 3t - 363. Let h = t + 1. What is the hundreds digit of h? 1 Suppose -216 = 5b + 669. Let r be -45/(-4) - b. Let t = -107 + r. What is the tens digit of t? 7 Suppose -45 = -27t + 90. Let w(f) = 2f*3 - 3f*2. Let k be w(2). Suppose 3y = 3v - 339, -kv + 0y + 454 = -ty. What is the units digit of v? 1 Suppose 0 = 641t - 521t - 80400. What is the units digit of t? 0 Let h = 729 + -855. Let u = 605 + -351. Let x = h + u. What is the hundreds digit of x? 1 What is the thousands digit of 7310 - (144/(-648) + 166/18)? 7 Suppose 2080 - 1031 = c - 3560. What is the units digit of c? 9 Let s be (-50)/250 + 56/5. Let z(c) = c*3 - 9c*2 - 5c - 5. What is the tens digit of z(s)? 8 Let z(r) = -5r + 20r + 1765 - r*2 + 13r*2 - 1844. What is the units digit of z(8)? 9 Let p(w) = 344w*2 - 21w + 71. Let h be p(3). Suppose 2d - 1159 = -2c + 403, -4d + c = -h. What is the units digit of d? 7 Suppose -3q + 2i = -67530, 712i = 5q + 717i - 112550. What is the thousands digit of q? 2 Suppose 0 = -76j + 74j + 4u + 4558, 3j = -u + 6823. What is the units digit of j? 5 Suppose 0 = 2h + 5v + 60, 0 = 3h + 5v + 17 + 63. What is the units digit of (-25)/h + 2894/8? 3 Let y be ((-12)/(-9))/(28/63). What is the hundreds digit of (156/10)/((4 - y)/30)? 4 Let j = 9954 + -9413. Suppose 3p = 19 + 5. Suppose -pi = -j - 395. What is the units digit of i? 7 Let s = -702 - -478. Let f = 234 + s. What is the tens digit of f? 1 Let t be (-11 - -13)22/4. Suppose 4p - t - 1 = 0. Suppose -a = -20 - p. What is the tens digit of a? 2 Suppose -5j - y + 429129 = 0, 429121 = 7j - 2j - y. What is the thousands digit of j? 5 Let f(h) = 3h*2 + 65h + 340. What is the units digit of f(-75)? 0 Let d be 0 + -70(-18)/(-12). Let g = -112 - d. What is the tens digit of 8660/70 - 2/g? 2 Suppose 11d + 2120 = 3d. Let y = -166 - d. Suppose 167 = 3k - 5c, 0 = -3k + 2c + y + 83. What is the tens digit of k? 6 Let g(t) = 50 + 5103t + 26 - 5089t. Let u be g(21). Suppose -4i + 442 = -u. What is the hundreds digit of i? 2 Let i = 13537 - 7697. What is the units digit of i? 0 Let p be ((96/20)/(9/60))/2. Let w = p - -20. What is the units digit of w? 6 Let c(v) = -v + 8. Let b be c(16). Let x = -8 - b. Suppose -2l + 2i + 188 = x, -2l + 67 = 3i - 136. What is the units digit of l? 7 Let i = -2288 - -3383. Suppose 4f - 4362 = -2t, -i = -f - 54t + 55t. What is the tens digit of f? 9 Let q = 10368 + -7250. Let a = -1279 + q. What is the thousands digit of a? 1 Let p(t) = t*2 + 41t + 282. What is the hundreds digit of p(-47)? 5 Suppose -3z + 5z = 5t - 7, -3z - 3 = -5t. Suppose za + 76 = 8a. Let h = a + 42. What is the units digit of h? 1 Let o = -3 + 5. Suppose -f + 4r = 4 - 6, -r = -of + 4. Suppose fn = -n + 315. What is the hundreds digit of n? 1 Suppose 20 = -31d - 11. What is the hundreds digit of (44/(-154) - (-8874)/(-7))d? 2 Suppose 1549p - 41478 = -2v + 1545p, -v - 3p = -20732. What is the ten thousands digit of v? 2 Suppose -92x = 2c - 90x - 18748, 4c = 2x + 37520. What is the hundreds digit of c? 3 Suppose 0 = 3o + q + 191, -5o = -0o - 4q + 341. Let a = 67 + o. Suppose 3z + 3 = av + 73, 5z - 4v = 118. What is the units digit of z? 2 Suppose 0 = -c - 4p + 8 - 1, -2c - 2p + 14 = 0. Suppose -2k - 285 = -ck. What is the tens digit of k? 5 Suppose 3f = -5x - 203 + 1842, 3f + 317 = x. Suppose 2r - x = -g, -g + 11r = 9r - 310. What is the units digit of g? 8 Let a(t) = 47t3 + 4t*2 - 6t + 24. Let v be a(7). What is the tens digit of v/24 + 6/(-48)? 7 What is the tens digit of (-117766)/(-132) + (-10)/(-12)? 9 Suppose 3w + 3i = -30, 10w + 4i + 45 = 5w. What is the tens digit of w/(-15) + (-1691)/(-3)? 6 Let c(y) = 227y + 2. Let o(h) = -228h - 2. Let t(r) = r3 - 6r*2 - r + 27. Let b be t(5). Let m(f) = bc(f) - 2o(f). What is the tens digit of m(-1)? 2 Let y be 3/2(-8)/6 + 6. Let z = 31 - 29. Suppose 0 = -0s + ys - 20, 125 = 5r + zs. What is the tens digit of r? 2 Suppose 4769 = -o - 5k + 16138, 5k = -15. What is the ten thousands digit of o? 1 Suppose -g - 5r = -7, -4r = -4 - 0. Suppose 4b - g = 3b. Suppose -1 = bl - 23. What is the units digit of l? 1 Let d(w) = 289w - 77. Let z(n) = n - 1. Let j(p) = d(p) + 2z(p). What is the units digit of j(4)? 5 Let n be (3 - 834/(-18))9/6. Suppose -4154 = -8m - n. What is the tens digit of m? 1 What is the ten thousands digit of (-1789677)/(-48) + 179/2864? 3 Suppose -2a - 1630 = -3w + 1206, -2w + 3a + 1899 = 0. Suppose 4i - 1892 = -5u + 3u, -2i + u = -w. What is the hundreds digit of i? 4 What is the ten thousands digit of (62325/18)/(5/20)? 1 Let f be ((-8)/6 - 13/6)22. Let a = f + 72. Let k = 55 + a. What is the tens digit of k? 5 What is the tens digit of ((-86198)/(-35))/(12/132011)? 2 Suppose 0 = 8r - 13r + 3130. Let s be r/8 - (5/4 + -1). Suppose 3o + s = p, -3p + 0p + 4o + 224 = 0. What is the tens digit of p? 7 Let o(r) = r2 - 8r + 16. Let g be o(2). What is the tens digit of 6 + 208 + g - 3? 1 Suppose -4i = -3i - 15. Suppose -il + 6l = -2898. What is the units digit of l? 2 Let d(r) = r*3 + 14r*2 - 17r + 14. Let j = 32 - 29. Suppose l = -0l + jg - 27, 2l + g = -26. What is the tens digit of d(l)? 4 Let d(k) = -5k + 14. Let m be d(3). Let z(h) = -473h3 - 2h*2 - 2h. What is the tens digit of z(m)? 7 Suppose -2q - 2s - 4408 = -6q, 5q - 5504 = s. Suppose -5m = -2y - 1120, 5m - y - q = -3y. Let t = m - 81. What is the units digit of t? 1 Let x = 41 - 58. Let y = x + 21. What is the units digit of (0 - 72)/y(-21)/6? 3 Suppose 40698 = -11u + 4u + 128142. What is the units digit of u? 2 Let n(d) = 36d*3 + 6d*2 + 3d + 2. Let c(v) = -36v3 - 6v*2 - 3v - 2. Let r(j) = 5c(j) + 4n(j). What is the tens digit of r(-3)? 2 Suppose 413i - 102159 = 170i + 2316906. What is the units digit of i? 5 Suppose -q = -5q + 40. Let z(w) = w3 - 11w*2 + 12w - 19. Let v be z(q). What is the hundreds digit of -3 + 0 - v(-106 + 0)? 1 Let j = -1467 + 7629. What is the hundreds digit of j? 1 Let i = 19 - 26. Let n be i + 5 + -3 - -3. What is the tens digit of 53(-1 + n)-1? 5 Let a = -101 + 163. Suppose -z = -a + 50. Suppose -zo + 19o - 119 = 0. What is the units digit of o? 7 Let q = -33 + 52. Let z = 24 - q. What is the units digit of 2/z - (-516)/10? 2 Suppose 17u - 18u + 7184 = 1706. What is the thousands digit of u? 5 Let l(f) = -148f*3 + 3f + 4. Let o be l(-1). Let d = o - -339. What is the hundreds digit of d? 4 What is the tens digit of 5852 - (21 - 12) - (-2 + -3)? 4 Let c = -11245 - -29287. What is the hundreds digit of c? 0 Let o = 7874 + 17068. What is the ten thousands digit of o? 2 Let a = 24650 - 16577. Suppose -51b = -64b + a. What is the tens digit of b? 2 Suppose -42r = 3z - 39r - 21552, 0 = 2z - 3r - 14378. What is the units digit of z? 6 Let s = 6 - 3. Suppose sn + 2p - 206 = -0p, -4p = -n + 78. What is the tens digit of n/14 + (1 - -130)? 3 Let f = -5749 + 16383. What is the tens digit of f? 3 Let s = 602 + -202. Let y = -1327 + 1409. Suppose y - s = -3p. What is the tens digit of p? 0 Let p = -2425 + 3617. Suppose 0 = 4y + 4h - p, -26 = y - 5h - 354. What is the hundreds digit of y? 3 Suppose 0 = -7t + 14t - 4200. Let g = t - 344. What is the tens digit of g? 5 Let m = 204 + -620. Let v = -381 - m. What is the tens digit of v? 3 Suppose 0 = -4m - 3q + 22, -m - 3 = q + 4q. Suppose 0t = -4j - t - m, -5t + 1 = 2j. What is the units digit of (-2 - -3)/(j/4) + 164? 2 Suppose 0 = f + 4k - 33, 2f - k = 47 + 37. Let z(v) = 7v + 5. Let w be z(-4). Let j = f + w. What is the tens digit of j? 1 Suppose 4c = -4f + 55492, 170c - 173c + 41640 = -4f. What is the tens digit of c? 7 Suppose -4m + 3l + 424 = 0, -l + 6l + 432 = 4m. Let a = -206 + m. What is the hundreds digit of (4 - 3)-2 - a? 1 Let q be (6 - 0)(3 + 10/(-4)). Suppose qh + 15 = 5v, 2h = -5v + 6 - 16. What is the units digit of (-6 - -17)(3 + v)? 3 Suppose -25i + 17 = -408. Suppose -4533 = -ir + 1995. What is the tens digit of r? 8 Suppose 0 = -249a + 2497233 - 533370. What is the thousands digit of a? 7 Let q(l) = -	{ "pile_set_name": "DM Mathematics" }
Let k be c(-12). Let g(n) = 7n2 + 3n + 4. Let t(z) = 9z2 + z + 3. Let a(d) = -4g(d) + 3t(d). Give a(k). 7 Let s(w) = w3 - 74w*2 + 66w + 517. Let z be s(73). Let h(q) = q2 - 2. Give h(z). 34 Let u(m) = m3 + 40m2 - 42m - 52. Let g = -19536 + 19495. What is u(g)? -11 Let o(p) = p3 + p2 - 23p + 21. Let w be o(1). Let s(x) = x + 6. Determine s(w). 6 Let d(u) = 4u + 47. Let n be d(23). Suppose -k + n = 42. Let t(i) = 61i - ki + 58i. Give t(1). 22 Let w(q) = q2 - 24q - 80. Suppose -3y = 3x - 69, -3y = 65 - 53. Give w(x). 1 Let v(n) = n + 12. Let c be -38 + (-8 - -11) - (0 + -4 - 3). What is v(c)? -16 Let s(w) = -w3 + 9w*2 - 7w - 1. Let y be ((-56)/77)/((-9)/99). Give s(y). 7 Let f(a) = a + 10. Suppose -19i = -21i + 4. Suppose -i + 101 = -9y. Calculate f(y). -1 Suppose j - 6j = -140. Suppose 4a - j = -2h, 2h - 7h + 10 = -2a. Suppose 4c + k = 3, 4c + a - 13 = 4k. Let m(i) = 9i + 1. What is m(c)? 10 Let i(s) = -2s*3 + 6s*2 - 14s. Let r(v) = -v*3 + 7v*2 - 13v - 1. Let c(x) = 2i(x) - 3r(x). Let a = -12 + 2. Give c(a). -7 Let d(z) = 39z - 5. Let n = 15131 + -15130. Calculate d(n). 34 Let r = -16 - -17. Let h be r - (3 + (-16)/4). Let p(c) = -c. Let b(f) = 11f - 3. Let t(o) = -b(o) - 6p(o). Determine t(h). -7 Let o(q) be the second derivative of 2 + 1/12q*4 + 3/2q*3 + 14q - 5q2. What is o(-10)? 0 Let a(i) = i + 2. Let d be 576/80 + 4/5. Suppose -3o = -do - 10. Let c(m) = -5m*2 - 7m - 4. Let p be c(o). Determine a(p). -8 Let l(v) be the second derivative of v*3/6 + 3v*2/2 + 367v. Let p be 10/(-4)(-14)/35. Suppose p - 19 = -6i. Give l(i). 6 Let w(d) be the second derivative of -d4/12 + d3/6 + 13d2/2 - 4322d. Calculate w(3). 7 Let t(q) be the first derivative of -q*4/4 + 3q - 1. Suppose 3s = 3m, -15s = -11s - 8s + m. Calculate t(s). 3 Let k be (2/(-6))/((-7)/21). Let f(g) = -k - 11 + g - 5 + 23. Determine f(-10). -4 Let m(x) = -3x*2 - 7x - 9. Let b(h) = -4h2 - 6h - 8. Let p(v) = 4b(v) - 5m(v). Suppose -2222k + 2271k = 490. What is p(k)? 23 Let x(j) = j + 6. Let r(v) = v*3 + 28v*2 - 4v - 107. Let p be r(-28). Suppose 25 = -pt - 10. Calculate x(t). -1 Let t be -9 + (126 + -127)/(2/(-20)). Let l(a) = -8a*2 + a + 1. What is l(t)? -6 Suppose 7m - p = 57, 5p + 0 = -4m + 27. Let j(k) = -35k + 281. What is j(m)? 1 Let s(g) = g + 689. Let u(p) = -111. Let d(j) = -s(j) - 6u(j). Calculate d(-11). -12 Let g be 1 + 24/8 + 7. Suppose i + i = 3v, 0 = -v - 3i + g. Let u(b) = -b*2 + 2b + 1. Calculate u(v). 1 Let f(n) be the second derivative of -n5/20 - n4/6 + n3/3 + n2 + n. Suppose b = 3h + 213, -3b + 0b = 2h - 606. Let s = b + -202. What is f(s)? -10 Let a(t) = 17 - 243t2 - 113t*2 + 361t2 - t. Give a(5). 137 Let r(i) = -i2 + 7i - 6. Let v be ((-392)/(-84))/((-1)/(-30)). Suppose 16f - v = -28. Determine r(f). -6 Suppose -g = 4 - 2. Let m = -2 - g. Let z(t) = -38t3 + t2 + 26t + 20. Let w(s) = 41s3 - s2 - 28s - 22. Let o(q) = 13w(q) + 14z(q). Determine o(m). -6 Let g(l) = 3l - 10. Let z(k) = 5k - 15. Suppose 10u - 62 = -552. Let s be (-1 - u/14)/(1/2). Let w(p) = sz(p) - 8g(p). What is w(0)? 5 Let d(q) = -3q*2 - 8q - 5. Suppose -5r = -5w - 90, 3r + 3w - 44 = w. Suppose 44 + 36 = -ru. What is d(u)? -40 Let f(g) = -49 + 94 - 44. Let c(d) = d2 - 6d - 2. Let h(l) = c(l) - 3f(l). Let u be 54/8 - 3/(-12). Give h(u). 2 Let x(l) = l3 - 26l*2 + 24l + 23. Let y = -453 - -478. Determine x(y). -2 Let h be (-11 + 13)/(4/10) - 1. Let k(c) = 2 + 4 - 8 + h + c. What is k(1)? 3 Let g(y) be the second derivative of -y*2/2 + 7y. Let t(d) be the third derivative of d*4/12 - 5d*3/6 - 7d*2. Let c(f) = -4g(f) + t(f). Give c(-4). -9 Let n(v) be the first derivative of -v2 + v2 + 132 - v*2 + 11v + 8v + 0v. Give n(7). 5 Let v(o) = -o - 12. Suppose -2x + 5b = -5, -3x = 2x + 3b + 3. Suppose 4s - 12 = x, -3l - 5s + 5 = 8. Determine v(l). -6 Let z(o) = -o*2 - 7o - 6. Let k = 185 + -123. Suppose kx + 45 = 53x. Give z(x). 4 Let n(f) be the second derivative of -f*5/20 + 5f4/12 - f3/2 + 6f2 - 559f. What is n(5)? -3 Suppose 72r - 12 = 71r. Let u be (3/r)/((-8)/(-32)). Let m(q) = -1. Let p(x) = -2x2 + 4. Let j(w) = -3m(w) - p(w). What is j(u)? 1 Let d(z) = 27z3 - 37z*2 + 40z - 4. Let l(b) = -11b3 + 20b*2 - 21b. Let n(w) = -2d(w) - 5l(w). Give n(25). 8 Suppose -40 = 5a + 5y, -144 + 154 = -2a - 5y. Let f(z) = z*3 + 9z*2 - 11z - 4. Give f(a). 6 Let c(b) = b + 115. Let h(x) = -36x - 690. Let o(q) = -6c(q) - h(q). Suppose v = -v + 2. Give o(v). 30 Let z(s) be the first derivative of -3s2 - 134 - 1/3s*3 + 0s. What is z(-4)? 8 Let w(s) be the third derivative of s*6/120 + 7s*5/30 + 5s*4/12 - 8s*3/3 + 28s*2 + 24s. Determine w(-13). 23 Suppose 3y + 22 = 52. Let x(t) = -53t + 23t + 31t + 7. What is x(y)? 17 Let r = 984 + -980. Let w(n) be the third derivative of 0n3 + 12n*2 + 0 - 1/24n*r + 0n. What is w(5)? -5 Let d(f) = -7f3 - 5f - 5. Let y(v) = 0 - 1 - 2v + 10v - v*3 - 9v. Let n(b) = d(b) - 6y(b). Suppose 8s - 3s = 5r + 10, 3 = -2r + s. What is n(r)? 1 Let y(w) = -8357 + 3w - 8367 + 16735. Calculate y(-5). -4 Let k(i) = -22i3 + 26i*2 - 23i - 103. Let f(x) = 3x3 - x2 + 4x + 1. Let d(v) = -7f(v) - k(v). Calculate d(19). 1 Let c(i) = -20i + 53. Let w(k) = -384k + 1011. Let v(q) = 39c(q) - 2w(q). What is v(3)? 9 Let f be (-3)/(-6) + (-5)/(50/(-5035)). Let n = 513 - f. Let i(x) = -x2 + 6x + 7. Determine i(n). -20 Let p(k) = -4k + k + 1 - k2 - k. Suppose -21 = 159s - 156s. What is p(s)? -20 Let v be 4/((-28)/(-91)) - (41 - 16). Let x(b) = b3 + 13b*2 + 6b - 75. What is x(v)? -3 Let n(z) = -5z2 + 47z + 3. Let w(b) = 2b2 - 26b - 2. Let x(s) = -3n(s) - 7w(s). Give x(-41). 5 Let f(r) = -1518r2 + 6r - 7r + 764r*2 + 753r*2 - 1. Calculate f(2). -7 Let u be (-684)/117 - 2/(-39)-3. Let w be 2 - (2/(-1) + 2 - u). Let z(y) = y + 2. Let s(p) = -2p - 4. Let v(q) = 2s(q) + 5z(q). Give v(w). -2 Let h(m) be the third derivative of -3m5/40 + m4/4 + 175m3/6 - 58m*2. Let j(t) be the first derivative of h(t). What is j(5)? -39 Let l = 18 - 8. Let t(i) = 11i*2 - 88i + 92. Let y(m) = 5m2 - 40m + 41. Let f(v) = -9t(v) + 20y(v). What is f(l)? 12 Suppose -21o + 24o + 75 = 0. Let x be ((-2)/5)/2 + (-55)/o. Let m(d) = 7d - 5d + 3d - 1 + xd - 2d2. Determine m(5). -16 Let r(p) = 287p*2 - 278p - 286p2 + 276p - 5. Calculate r(8). 43 Suppose 0 = -23u + 30 + 108. Let s(n) = 4n - n - 2735 - un2 + 2732 + n3 - n. What is s(6)? 9 Let l be 0 - (-14 + 2 + -4). Let b = -20 + l. Let w(h) be the second derivative of -h5/20 - h4/3 - h3/2 - 5h*2/2 + 3h - 13. Give w(b). 7 Let f(u) = 7u3 - 2u - 1. Suppose -8w = -5w + w. Suppose -c + l = w, -c - 4l + 18 = 4c. Let s = c - 3. Give f(s). -6 Let y(g) = 2g - g - 4 - 8g + g + 5g. Determine y(2). -6 Let l(r) = -3r2 + 6 + 21 - r3 - r*2 + 11 - 68. Determine l(-6). 42 Suppose -4x - 33 = -k, 33x - 5k + 60 = 28x. Let z(c) = -c - 3. What is z(x)? 4 Let k = -88 + 95. Let v(i) = 6i + 6. Let a(h) = 5h + 5. Let q(o) = -7a(o) + 6v(o). Let z(s) = 3s - 6. Let l(f) = 2q(f) - z(f). Determine l(k). 1 Let n(v) be the second derivative of v5/60 - v4/12 - 67v*2/2 - 39v - 2. Let m(r) be the first derivative of n(r). Determine m(2). 0 Let s(q) = -q*3 - 7q*2 - q - 4. Let c = -80 - -80. Suppose 5d - 15 = c, -3d = -2j - j - 30. What is s(j)? 3 Let p(x) = -6x2 + 4x*3 - 3x3 + 0 - x2 + 1. Let g be p(7). Let l(u) = 13u2 + 27u*2 - u - 41u*2 + 23u*2. Determine l(g). 21 Suppose 2v + 432 = -6v. Let d = 55 + v. Let a = d - 2. Let s(w) = -6w*2. Calculate s(a). -6 Let u(n) = 8n + 121. Suppose 0 = p + 3z - 33 + 59, 184 = -12p - 4z. Determine u(p). 9 Let b(g) = -7g - 25. Suppose -5a + w = 39, 0 = -73a + 76a - 4w + 20. Calculate b(a). 31 Let k be 42/2 + 612/(-51). Let l(p) = p*2 - 6p - 1. Give l(k). 26 Let a(w) = -w2 - w - 1. Let u(b) = -b3 + 4b2 + 3b + 5. Let f(o) = a(o) + u(o). Let i(t) = -t*2 - 10t - 20. Let v be i(-4). Determine f(v). -4 Let v(c) = -c*3 + 9c*2 - 9c - 4. Let z	{ "pile_set_name": "DM Mathematics" }
41. Let d(o) = o. Calculate u(d(n)). -108n2 + 6n + 41 Let u(q) = 34q + 2. Let s(w) = -508w. What is u(s(o))? -17272o + 2 Let q(k) = -k. Let x(t) = -208t*2 - 8t. Let i(b) = -625b2 - 22b. Let m(z) = -4i(z) + 11x(z). Calculate q(m(n)). -212n2 Let v(k) = 7k - 1597. Let p(x) = x*2. Calculate v(p(t)). 7t*2 - 1597 Let o(s) = -38s. Let x(u) = -44688u. Determine o(x(v)). 1698144v Let d(z) = z*2. Let o(y) = -18y - 12y2 - 19y*2 + 38y - 19y. What is d(o(x))? 961x*4 - 62x3 + x2 Let a(b) = b*2 - 7b - 7. Let m(k) = -2k - 2. Let d(x) = 2a(x) - 7m(x). Suppose 5l = -2l. Let z(h) = -2h + 9h + lh - 3h. What is d(z(f))? 32f*2 Let l(b) = 7b. Let x(a) be the second derivative of -a*6/360 + 2a*4/3 - 8a. Let n(s) be the third derivative of x(s). Determine l(n(m)). -14m Let v(g) = 53 + 55 - 171 - 7g + 63. Let u(s) = 2s. Give u(v(o)). -14o Let j be 1/(-8) - (-4)/32. Let h(o) be the third derivative of 0o + 0 - 1/12o*4 + jo3 + o2. Let t(x) = x*2. Determine t(h(m)). 4m*2 Let t(c) = -15c - 2. Let o(y) = 30y + 5. Let b(s) = 2o(s) + 5t(s). Let x(z) = 9z - 6z - 2z. Give b(x(f)). -15f Let q(v) = v. Suppose n + 0 - 4 = 0, -y - n + 6 = 0. Suppose -12 = 4z + 4f, f + 18 = -z - 3f. Let u(t) = 4ty + 4t*2 - 4t*z. Determine q(u(k)). 4k*2 Let a(h) = -101h*2 - 22h - 1. Let j(z) = z. Give a(j(q)). -101q2 - 22q - 1 Let o(b) = -10b. Let a(m) = 159 + m - 159. Let x(s) = -15a(s) - 3o(s). Let c(n) = 2n*2. Give x(c(q)). 30q*2 Let x(h) = -26h. Let i(j) be the third derivative of j4/24 + j2 - j. What is x(i(r))? -26r Let t(m) = 7m. Let a(i) = -i*2 + 15i - 2. Determine t(a(x)). -7x2 + 105x - 14 Let f(c) = 2c2. Suppose -2j + 4q = 26, 1 + 0 = 3j + 4q. Let d(x) = x + 7. Let z be d(j). Let n(o) = -oz + o2 + 5o*2 - 6o*2. Determine n(f(u)). -4u*4 Let m(h) = -8h*2 - 48. Let v(d) = 38d*2. Calculate m(v(y)). -11552y*4 - 48 Let o(j) = 2j*2. Suppose 0 = 4v - 4 - 4. Suppose v = -l + 4. Let g(h) = 2 + 0 - 7h2 - l. Give o(g(q)). 98q4 Let n(w) = -w2 + 12w2 + 19w2. Let l(z) = z2 + z - 1. Let p(x) = 7x2 + 6x - 6. Let q(g) = 6l(g) - p(g). Determine n(q(c)). 30c*4 Let p = 45 + -42. Let m(l) = pl + 6l - 5l. Let b(a) = -3a2 + 0a*2 + 4a*2. Calculate b(m(n)). 16n*2 Let x(q) = -2q*2 - 69497. Let s(l) = -80l. Calculate x(s(k)). -12800k2 - 69497 Let g(s) = -4s*2 + 3s - 3. Let u(w) = w*2 - w + 1. Let y(i) = g(i) + 3u(i). Let f(r) be the second derivative of 5r4/12 + 7r. Calculate y(f(l)). -25l4 Let x(q) = 5q + 4. Let f(z) = 11z + 9. Let a(m) = -4f(m) + 9x(m). Let b(j) = -4 - 27j + 3 + 0. What is a(b(c))? -27c - 1 Let v(d) = -30d*2. Let y(r) = 3r*2 - 55r + 3. Determine y(v(q)). 2700q4 + 1650q*2 + 3 Let j(n) = -8n*2 - 8n*2 + 28n*2. Let b(z) = 17z. Let w(s) = -2s. Let q(g) = 2b(g) + 18w(g). What is j(q(t))? 48t*2 Let v(w) = 375659w*2. Let r(p) = -4p. Give v(r(y)). 6010544y2 Let t(w) = 2w. Let p(q) be the third derivative of 13q8/20160 + 13q*5/60 - 4q*2. Let u(r) be the third derivative of p(r). Give t(u(x)). 26x*2 Let k(a) = a. Let o be ((-2 - 4) + -3)1/(-3). Let v(m) be the third derivative of 2m2 + 0 + 0m*o - 1/4m*4 + 0m. Give v(k(s)). -6s Let v(s) = s - 1. Let b be v(3). Let h be (16/(-40))/(b/(-40)). Let q(n) = -4n + 11 - 11 + hn. Let y(m) = 3m. Determine q(y(i)). 12i Let o(v) be the third derivative of -v5/20 - 19v*2. Let q(m) = -3m + 8m - 3m. Calculate q(o(h)). -6h2 Let m(l) = 8l*2 + 12l + 6. Let r(i) = -2i2 - 2i - 1. Let n(q) = -m(q) - 6r(q). Let t(d) = -10d - 1. Give t(n(z)). -40z2 - 1 Let p(k) be the first derivative of k2/2 + 1737. Let h(n) = -5n + 11n + 12n. Give h(p(l)). 18l Let y(l) = 704l*2. Let j(c) = -268c + 2. Give j(y(p)). -188672p2 + 2 Let h(p) = -6p. Suppose 28 = 16u - 12u. Let z(w) = 3w. Let j(n) = 2n. Let t(o) = uj(o) - 5z(o). Calculate h(t(d)). 6d Let j(m) be the first derivative of m2/2 + 276m + 279. Let x(l) = 2l2. What is j(x(s))? 2s*2 + 276 Let t(p) = 6p*2. Let a be (2/4)/((8 - 14) + 21). Let x(s) be the third derivative of 0s + 4s2 + 0 + 0s*3 + as*5 + 0s*4. Determine x(t(z)). 72z*4 Let s(n) = -2n*2. Let l(g) = -5g - 114 + 230 - 116. What is l(s(p))? 10p2 Let b(z) = 2z. Let y(l) be the first derivative of -11l2/2 - 3l + 309. What is y(b(k))? -22k - 3 Let i(m) be the second derivative of -59m*4/12 + 32m. Let g(l) = -l. Calculate g(i(z)). 59z2 Let q(o) = 4o + 2o + 7o + 9o + 16o. Let p(w) = -7w2. What is q(p(d))? -266d*2 Let q(x) = 6x. Let t be 3/(-4) - (-19 - (-1290)/72). Let b(s) be the second derivative of ts3 + 0s*2 + 0 - s. Give q(b(o)). 12o Let b(g) = 57g2. Let a(m) = -3m + 25. Let w(j) = 4j - 30. Let c(q) = 6a(q) + 5w(q). Determine c(b(n)). 114n2 Let m(d) = -d2. Let y(l) = l*3 + 10l*2 - 14l - 1. Let u be y(-11). Let v(k) = u - 17 - 3k - 15. What is m(v(f))? -9f2 Let k(b) = b2. Let z(t) = -21t. Let d(i) = 12i. Let s(r) = 5d(r) + 3z(r). Determine k(s(u)). 9u2 Let m(k) = 515k*2. Let w(u) = 344u*2. Let g(c) = -5m(c) + 7w(c). Let s(o) = -2o*2. Determine g(s(d)). -668d*4 Let o(f) be the first derivative of 0f + 4/3f3 - 7 + 0f2. Let u(r) be the second derivative of r3/3 + 5r. Give o(u(c)). 16c*2 Let g(v) = -43v. Let p(m) = 3m - 6. Let j(h) = 12h - 27. Let s(l) = 2j(l) - 9p(l). Give g(s(r)). 129r Let m(g) be the second derivative of g4/12 - g + 7. Let k(y) = 19y*2 - 2. Let n(r) = -189r*2 + 21. Let l(w) = -21k(w) - 2n(w). Give l(m(p)). -21p*4 Let b(r) = 3r*2 + 2r + 1. Let z be b(-2). Let o(m) = -zm + 11m + 3m. Let c(x) be the second derivative of x4/6 + 2x. Determine o(c(w)). 10w2 Let k(t) be the third derivative of -t5/60 + 54t*2. Let a(b) = -8b. Give a(k(j)). 8j2 Let q(n) = 103n - 97n + 1 + 38. Let u(s) = s2. Give q(u(v)). 6v*2 + 39 Let y(p) = 175p. Let o(w) = w*2 + 2w + 2. Let q(x) = -3x2 - 5x - 5. Let c(j) = 5o(j) + 2q(j). Determine c(y(t)). -30625t2 Let n(f) = -214f. Let s(x) = -2x + 29 - 29 + 0x. What is s(n(r))? 428r Let g(h) = 2h. Let p(s) = 267s2 + 176s*2 - 333s*2. What is g(p(j))? 220j*2 Let v(a) = 2a - 10. Let w(k) = k*3 - 9k*2 - 3k + 7. Let i be w(9). Let u(j) = -j + 3. Let y(m) = iu(m) - 6v(m). Let b(n) = 4n2. Calculate y(b(c)). 32c2 Let p(h) = h. Let g(s) be the third derivative of -s6/240 - 19s4/24 - 2s*2. Let w(n) be the second derivative of g(n). What is p(w(j))? -3j Let w(z) be the second derivative of z*4/6 - 22z. Let g(y) = -14y2 - 2y. Let s(r) = -140r2 - 21r. Let o(k) = 21g(k) - 2s(k). What is o(w(x))? -56x4 Suppose -4o = -0o. Let v(h) = -h + oh + 6h - 3h. Let w(q) = 11q2. What is w(v(z))? 44z*2 Let t(n) be the second derivative of -5n*3/2 + 2n*2 + 764n. Let a(s) = 2s2. Determine a(t(p)). 450p*2 - 240p + 32 Let v(s) = 2s2. Let p(u) = 89307u. What is p(v(l))? 178614l2 Let b(p) = -p2. Let r(k) = -95k - 1302. Determine r(b(y)). 95y2 - 1302 Let c(p) = 18p2. Let x(t) = t2 + 88173. Give x(c(d)). 324d4 + 88173 Let c(w) = w3 - w2 + 2w. Let g be c(1). Let h(k) = -4kg + 5k2 - k2 + 2k2. Let p(q) = -35q. What is p(h(l))? -70l2 Let a be 191/7 + (-18)/63. Let x = 33 - a. Let m(l) = 4l*2 + 3l*2 - xl*2. Let k(j) = -2j. Calculate k(m(t)). -2t2 Let h(b) = -361221b*2. Let x(p) = -3p. What is x(h(s))? 1083663s2 Let f = -23 - -68. Let d(t) = 47t - 95t + ft. Let p(b) = -10b. Determine p(d(g)). 30g Let v(z) = 377z2. Let l(j) = 89j. Determine v(l(n)). 2986217n2 Let m(t) = -3t*2 + 0t*2 + 4t*2 - 2t*2. Suppose d = -2z, 2z + 4d = z - 14. Let s(j) = 6jz - j2 - 11j*2 + 7j2. Determine s(m(v)). v4 Let h(l) = 14l2. Let y(v) = 4v. Let x be (-10)/25-5 + 3. Let w(p) = -7p. Let r(i) = xy(i) + 3w(i). Determine r(h(s)). -14s2 Let v(a) = 56a*2. Let q(t) = -13t - 4. Calculate q(v(c)). -728c2 - 4 Let u(c) = 3c*2 - 6c + 30. Let q(y) = -y + 5. Let o(j) = 6q(j) - u(j). Let n(m) = 17m*2 + m. Give n(o(r)). 153r*4 - 3r*2 Let x(s) = -2s*2 + 137s*2 - 11s*2 - 36s*2. Let z(r) = r	{ "pile_set_name": "DM Mathematics" }
6u + 11. List the prime factors of c(5). 881 List the prime factors of (19 - -5365) + (-2 - -1). 7, 769 Let f(s) = -s. Let l(w) = -w2 - 16w - 2w - 14 - 8 + 5. Let o(u) = 6f(u) - l(u). What are the prime factors of o(-12)? 17 Let k be (-1 - (-1 - -3))/1. Let u(a) = -36a2 - a. Let l(j) = -36j*2 - j. Let x(v) = ku(v) + 2l(v). What are the prime factors of x(-1)? 5, 7 What are the prime factors of ((-81)/154)/((-4)/30)? 2, 3 Let g be (-1 - (-1 + -1))-6. Suppose -2r - 6 = -f - 0, 22 = -3f - 2r. Let j = f - g. What are the prime factors of j? 2 Suppose -21w - 40 = -16w. Let k(g) = 4g2 + 14g + 29. What are the prime factors of k(w)? 173 Suppose -65 - 65 = -4u + 2j, -2u + 5j = -53. Let y = 4 + u. What are the prime factors of y? 2, 19 Suppose -2z = -2f - 3f + 2, -f + 6 = z. Suppose 4 + z = 4m. Suppose -mt - 17 = -3t. List the prime factors of t. 17 Let h(w) = 2w2 - 5w + 3. Let n be h(3). Suppose 4u - 1138 = 5d, 4u - 1134 = -3d + nd. List the prime factors of u. 2, 3, 47 Suppose -3p - 3x - 7330 = -5p, -18304 = -5p - 3x. List the prime factors of p. 2, 1831 Let n(q) = -q*2 - 102q - 3. List the prime factors of n(-31). 2, 7, 157 Let j(v) = -2 + 108v + 0 + 1. Let q be j(2). What are the prime factors of 4/6 - q/(-15)? 3, 5 Let f(t) = 3t - 8. Let l be f(5). Suppose -4m = -lm. Suppose z = m, -3z = -2j + 34 + 60. List the prime factors of j. 47 Suppose -z + t - 1 = -12, 0 = -4z - 4t + 12. List the prime factors of 181/7 + 1/z. 2, 13 Suppose -i = -4y - 15, 4y - 13 = 2i - 31. Let p(v) be the first derivative of v3 - v2/2 + 4v + 57. What are the prime factors of p(i)? 2, 7 Suppose -3113 = -14a + 27183. List the prime factors of a. 2, 541 Let g(r) = -2r*3 - 37r*2 + 3r + 130. List the prime factors of g(-20). 2, 5, 127 Suppose 2t - 1813 = -0y - 3y, t = -2y + 1208. List the prime factors of y. 3, 67 Let j = 678 + -251. List the prime factors of j. 7, 61 Let k be -1 - (1 - 3) - -4. Suppose 4l - t - 305 = 0, -kt + t = l - 55. List the prime factors of l. 3, 5 List the prime factors of (-1)/((-4)/12 + 1058/3192). 2, 7, 19 Suppose 0c - 51 = 2t + 3c, -3t = -2c + 96. Let q be (28/(-5))/(12/t). Suppose q = 3l - 37. What are the prime factors of l? 17 What are the prime factors of ((-2)/93)/((-12)/4050)? 3, 5 Let y(m) = -m3 + 23m*2 + 4m + 25. List the prime factors of y(22). 3, 199 Let p = -23 - -44. Let t = p + -5. What are the prime factors of t? 2 Let i(h) = -57h + 80. What are the prime factors of i(-15)? 5, 11, 17 Suppose -3p + 8 + 3 = -v, 5v - 21 = -4p. Suppose -4s - 283 = -h - ph, -2h + 103 = -5s. What are the prime factors of h? 59 Let w(t) = 15 + 3t + 21 + 11 + 9. What are the prime factors of w(0)? 2, 7 Let l(m) = -m2 - 17m - 11. Let v = 5 + -7. Let j be -10 - ((-2 - v) + 2). What are the prime factors of l(j)? 7 Let k = -2027 - -3218. What are the prime factors of k? 3, 397 Let l(g) = -g*3 + 14g*2 - 8g + 10. Let b be 9((-15)/9 - -2). Suppose 0 = bt - 50 + 11. What are the prime factors of l(t)? 3, 5 Let b = -1760 - -2230. What are the prime factors of b? 2, 5, 47 Let u(l) = 3l2 - 7. Let j = 38 + -33. What are the prime factors of u(j)? 2, 17 Let y = -2093 + 3464. What are the prime factors of y? 3, 457 Suppose 0 = -5c - 2t + 1161, -4c + t + 3t = -940. What are the prime factors of c? 233 Let m(x) = 6x*2 + 31x + 33. List the prime factors of m(-26). 7, 67 Let d(c) = c*2 + 3c - 7. Let l be d(-5). Suppose -2w + 4t = 12 + 36, lw - 4t + 62 = 0. Let a = -9 - w. List the prime factors of a. 5 What are the prime factors of 7682/18 + (-98)/(-441)? 7, 61 Let g be 2 - (-2 + 2 - 2). Let d(w) = w*3 - w + 79. Let k be d(0). Suppose 4b - k + 3 = -2z, 0 = -gb - 4z + 68. List the prime factors of b. 3, 7 Suppose 752 = 4h - 4k, 572 = 4h - k - 180. What are the prime factors of h? 2, 47 Let f(x) be the third derivative of x5/60 + x4/24 - 17x3/6 + 9x*2. List the prime factors of f(11). 5, 23 Suppose -h + 5s + 40 = -0s, 0 = 5h - s - 176. Let g = 87 - -50. Suppose -4q = -g - h. List the prime factors of q. 43 Suppose 0 = -2v - 2o + o + 584, -874 = -3v - 2o. Suppose 3b - 167 = -5j + 3j, -4j + v = -2b. What are the prime factors of j? 2, 19 Let f(b) = 33b - 251. List the prime factors of f(26). 607 Let f be (1 - -5)(6 + -5). Suppose -f = -3m, -m = 2u - 3m. Suppose 5 = z + 3n, -un - n + 9 = 3z. What are the prime factors of z? 2 Let m(l) be the first derivative of l*3/3 + 4l*2 - 2l - 1. Suppose 0 = 9u - 4u + 45. List the prime factors of m(u). 7 Let u(o) = o*3 - 15o*2 + 4o + 1. Suppose 40 + 50 = 5n + 5a, -3a + 69 = 4n. What are the prime factors of u(n)? 61 Suppose 3r - 1961 = -t, 3r - 8r + 3271 = t. List the prime factors of r. 5, 131 Let i = 102 - -220. List the prime factors of i. 2, 7, 23 Let n = 0 - 18. Let k(p) = -p2 - 21p - 24. List the prime factors of k(n). 2, 3, 5 Suppose 0 = -2c + 158 + 156. What are the prime factors of c? 157 Suppose 2v + 15 - 61 = 0. Suppose -z - z = 5m + 3, 0 = 2z - 4m - 6. Suppose -a = -v - z. What are the prime factors of a? 2, 3 Suppose q - 7 + 2 = 0. Suppose 0 = -qi - 2l + 297, -5l = -3i + 4i - 64. List the prime factors of i. 59 Let j = 1108 + -62. List the prime factors of j. 2, 523 Suppose -3f = -11 - 1, 0 = 4r + 5f - 3692. What are the prime factors of r? 2, 3, 17 Suppose 5b - 10 = x, 5x - b = 2b + 16. Suppose xw - 84 = -o, 4w - 44 = -0o + 5o. List the prime factors of w. 2 Suppose h - 3w = -4h + 746, -h - 5w = -138. Suppose k - 4y = 87, 181 = 4k + 3y - h. What are the prime factors of k? 83 List the prime factors of ((-526054)/249)/((-4)/6). 3169 Let i = 438 + -259. Suppose 5r - i = 166. What are the prime factors of r? 3, 23 Let q = 82 + -80. Suppose 0 = -5t + qx + 1584, 3x - 4x - 950 = -3t. What are the prime factors of t? 2, 79 Let w = -59 + 162. What are the prime factors of w? 103 Let f(k) = -14k3 + 9k*2 - 14k + 5. Let t(j) = -5j3 + 3j*2 - 5j + 2. Let w = 10 + -16. Let d(c) = wf(c) + 17t(c). List the prime factors of d(-3). 7 Suppose -2u + 3u - 4k = 38, -7 = u + 5k. Suppose -g = -4g + u. Let p = -1 + g. What are the prime factors of p? 5 Let r = 1784 + -1138. What are the prime factors of r? 2, 17, 19 Suppose 5z - 21 = 49. Let h = -12 + z. What are the prime factors of (11 - -5) + (-6)/h? 13 Let z(j) = 3j3 - 3j*2 - 2j - 3. Let a(h) = h*3. Let y(w) = -5a(w) + z(w). List the prime factors of y(-3). 2, 3, 5 Let f(x) = 5x2 + 2x + 1. Let m be (2/6)/((-3)/9). Let t be f(m). Suppose -v + tv - 120 = 0. List the prime factors of v. 2, 5 Let g(c) = 3c + 17. Let n be g(-8). Let y(s) = s*3 + 9s*2 + 3s - 3. What are the prime factors of y(n)? 2, 37 Let m be (4/(-14))/(18/252). What are the prime factors of (-3)/(-6)m(-3 + -123)? 2, 3, 7 What are the prime factors of ((-87)/6)/((-3)/714)? 7, 17, 29 Suppose w - 2 = 3. Suppose wl - 265 = 6v - 4v, -2v = -3l + 155. List the prime factors of l. 5, 11 Let m(n) = 15n*2 + n - 1. Let v be m(2). Let z = v + -19. What are the prime factors of z? 2, 3, 7 Let j(t) = 7t*2 + 0 - 7t*3 + 3 + 5 - 13t + 8t3. List the prime factors of j(-7). 3, 11 Let l(v) = 14v - 80. What are the prime factors of l(17)? 2, 79 Let o(g) = g*3 + 5g*2 + 4. Let f be o(-4). Suppose 3d = -2d - f, -2d - 60 = 2y. Let v = y - -54. What are the prime factors of v? 2, 7 Suppose 0 = -2i - 20 + 100. Suppose i = h - s - 3s, 0 = -2h - 3s + 25. What are the prime factors of h? 2, 5 Suppose -148 = -p + 5k, 2k = -2p + 133 + 175. Suppose -6 = -2s, -4f = -s - 766 + p. What are the prime factors of f? 2, 7, 11 Suppose -2l + 52 - 30 = 0. Suppose -410 = -16y + ly. List the prime factors of y. 2, 41 Let g = 427 + 164. List the prime factors of g. 3, 197 Suppose -2 + 6 = -4d. Let v be d + (2 - -1) + -15. Let r = v + 43. List the prime factors of r. 2, 3, 5 What are the prime factors of (-103851)/(-55) + (-6)/5? 3, 17, 37 Let u(i) = -i*2 - 11i + 6. Suppose d - 5d - 44 = 0. Let w be u(d). What are the prime factors of w/((-5)/(60/(-8)))? 3 Let l be (-28)/(-3 - 28/(-12)). Suppose 20g - 18g = l. List the prime factors of g. 3, 7 Let q be 351/9 + (-2 + 5 - 4). Suppose -3n +	{ "pile_set_name": "DM Mathematics" }
, 2715? 4187 What is the next term in -594, -6007, -20708, -49341, -96550, -166979? -265272 What is next in 456, 590, 722, 852, 980, 1106, 1230? 1352 What is the next term in -42330, -42328, -42326, -42324, -42322? -42320 What comes next: 130936, 130935, 130934, 130933, 130932? 130931 What is the next term in 685, 648, 585, 496? 381 What is next in -184798, -184822, -184862, -184924, -185014, -185138, -185302? -185512 What is the next term in 196, 184, 172, 160, 148, 136? 124 What comes next: -211938, -423875, -635812? -847749 What is next in -3852100, -3852098, -3852096, -3852094, -3852092? -3852090 What comes next: -119744, -119749, -119754, -119759? -119764 What is next in -128, -284, -462, -662, -884? -1128 What is next in -564, -2267, -5096, -9045, -14108, -20279, -27552? -35921 What is next in -1581, -6259, -13969, -24639, -38197, -54571, -73689? -95479 What is next in 24, -72, -238, -492, -852, -1336? -1962 What is the next term in -186, -149, -44, 165, 514? 1039 What is the next term in -431, -376, -321, -266? -211 What is next in 1299, 5207, 11725, 20853, 32591, 46939, 63897? 83465 What is the next term in 25656, 25654, 25652, 25650? 25648 What is the next term in 9, -23, -99, -237, -455, -771, -1203, -1769? -2487 What is next in 1033, 2476, 3919, 5362, 6805, 8248? 9691 What is the next term in 4081, 8245, 12411, 16579? 20749 What comes next: -190, -310, -478, -688, -934? -1210 What is the next term in 817463, 817462, 817461, 817460, 817459, 817458? 817457 What is next in -12225, -24455, -36687, -48921, -61157, -73395? -85635 What comes next: -340, -332, -306, -256, -176? -60 What is the next term in -219, -161, -73, 45, 193? 371 What is the next term in 590, 2345, 5270, 9365? 14630 What is the next term in -1709, -6585, -14631, -25847, -40233? -57789 What is the next term in 263374, 526747, 790118, 1053487, 1316854, 1580219? 1843582 What is next in 5633497, 5633492, 5633485, 5633476, 5633465, 5633452? 5633437 What is the next term in 37558, 75118, 112678, 150238, 187798, 225358? 262918 What is next in 968, 1001, 1050, 1109, 1172, 1233? 1286 What is the next term in 7, -14, -27, -32, -29, -18? 1 What is next in 246, 1862, 6244, 14772, 28826? 49786 What is the next term in 854, 1618, 2364, 3086, 3778, 4434, 5048, 5614? 6126 What comes next: -92, -269, -714, -1559, -2936? -4977 What comes next: 422, 834, 1222, 1574, 1878, 2122? 2294 What comes next: 1074111, 2148223, 3222335, 4296447, 5370559? 6444671 What comes next: 240, -9, -754, -1995, -3732? -5965 What is the next term in 291, 987, 2149, 3777? 5871 What comes next: 1253141, 2506287, 3759435, 5012585, 6265737, 7518891, 8772047? 10025205 What is the next term in 1268, 2527, 3784, 5039, 6292, 7543, 8792? 10039 What is the next term in -2045187, -2045186, -2045185, -2045184, -2045183, -2045182? -2045181 What comes next: 502, 526, 564, 622, 706? 822 What is next in 1360010, 1360011, 1360012, 1360013, 1360014? 1360015 What is the next term in -30588, -61176, -91764, -122352, -152940? -183528 What is next in -507, -753, -999? -1245 What is the next term in 102296, 102278, 102248, 102206, 102152, 102086, 102008? 101918 What is next in -49324, -49291, -49258, -49225, -49192, -49159? -49126 What comes next: 3205, 3018, 2707, 2272, 1713, 1030? 223 What comes next: -151155, -302336, -453515, -604692, -755867? -907040 What is next in 231, 278, 119, -252, -841, -1654, -2697, -3976? -5497 What is the next term in 2034, 8117, 18254, 32445, 50690? 72989 What is the next term in -311, -987, -2123, -3725, -5799, -8351, -11387, -14913? -18935 What is the next term in -57778, -57780, -57782? -57784 What is next in -8702, -8686, -8692, -8732, -8818, -8962? -9176 What is next in 611, 2443, 5501, 9785, 15295, 22031, 29993? 39181 What comes next: -3397, -3465, -3569, -3709, -3885, -4097, -4345? -4629 What comes next: 30184, 60387, 90608, 120847, 151104? 181379 What is next in -237, -397, -557? -717 What is next in 13022, 13020, 13000, 12950, 12858, 12712, 12500, 12210? 11830 What is the next term in 74, 276, 816, 1862, 3582, 6144, 9716, 14466? 20562 What is next in 114900, 114899, 114898, 114897, 114896? 114895 What is the next term in 44293, 44302, 44317, 44338? 44365 What is next in -3273, -13247, -29869, -53139, -83057, -119623, -162837? -212699 What is next in 129, 38, -111, -318, -583, -906? -1287 What is next in 1087, 2162, 3227, 4282, 5327, 6362, 7387? 8402 What is the next term in 19123, 38250, 57377, 76504, 95631, 114758? 133885 What comes next: -296, -912, -1940, -3380, -5232, -7496? -10172 What comes next: 344, 395, 496, 671, 944, 1339, 1880, 2591? 3496 What is the next term in 368, 368, 378, 398, 428, 468? 518 What comes next: 2770, 5553, 8342, 11137? 13938 What is the next term in -16663, -16667, -16673, -16681, -16691? -16703 What comes next: 2008, 3992, 5976? 7960 What comes next: 3383, 3459, 3537, 3617, 3699? 3783 What is next in 386, 807, 1244, 1703, 2190, 2711? 3272 What is the next term in -152, -1279, -4338, -10295, -20116, -34767, -55214, -82423? -117360 What is next in 10618276, 10618275, 10618274, 10618273? 10618272 What comes next: -1298, -1556, -1814? -2072 What comes next: 929, 577, -17, -859, -1955? -3311 What is the next term in -43, -1, 59, 131, 209, 287, 359, 419? 461 What is next in 613498, 613505, 613512, 613519, 613526? 613533 What is the next term in -992, -1112, -1232? -1352 What is next in 281, 232, -491, -2224, -5303, -10064, -16843? -25976 What is next in 825, 908, 991, 1074, 1157, 1240? 1323 What is the next term in 1694, 1636, 1578, 1520, 1462, 1404? 1346 What comes next: -1154, -1105, -1008, -851, -622, -309, 100? 617 What comes next: -3136, -6284, -9432, -12580, -15728, -18876? -22024 What comes next: -5867, -11748, -17631, -23516? -29403 What is the next term in 4504762, 4504773, 4504798, 4504843, 4504914? 4505017 What is next in -541924, -541929, -541934, -541939? -541944 What comes next: 811, 1665, 2577, 3553, 4599, 5721? 6925 What is the next term in -1718, -1764, -1840, -1952, -2106? -2308 What comes next: -23104, -23112, -23126, -23146? -23172 What comes next: 99, 191, 293, 411, 551, 719, 921? 1163 What is the next term in -2353, -4706, -7059, -9412, -11765? -14118 What comes next: 46, -65, -174, -281, -386, -489, -590? -689 What is next in -3420, -7131, -10842? -14553 What is next in -3, -135, -303, -495, -699? -903 What is the next term in 1080862, 1080851, 1080826, 1080781, 1080710, 1080607? 1080466 What is the next term in 384, 393, 414, 453, 516, 609? 738 What comes next: -6, -89, -252, -501, -842, -1281? -1824 What is next in 223, 901, 2031, 3613, 5647? 8133 What is next in 199, 587, 1637, 3679, 7043, 12059, 19057, 28367? 40319 What comes next: -32702, -32706, -32710, -32714? -32718 What comes next: 4963, 4931, 4905, 4885, 4871, 4863, 4861? 4865 What is the next term in -2824, -5649, -8476, -11305, -14136? -16969 What is the next term in 1553, 1783, 2167, 2705, 3397, 4243, 5243? 6397 What is next in 2442568, 2442567, 2442566, 2442565, 2442564, 2442563? 2442562 What comes next: -3194, -6342, -9488, -12632? -15774 What comes next: -314, -617, -920, -1223? -1526 What comes next: -1805, -3545, -5219, -6827, -8369, -9845? -11255 What is the next term in -790, -1148, -1506, -1864, -2222? -2580 What comes next: 295, 369, 591, 1033, 1767, 2865, 4399, 6441? 9063 What is the next term in 504, 542, 594, 666, 764, 894, 1062, 1274? 1536 What is next in -799, -765, -743, -739, -759? -809 What comes next: -118, -52, 110, 416, 914? 1652 What is next in 1199, 1488, 1777, 2066, 2355, 2644? 2933 What is the next term in -1086, -1863, -2628, -3375, -4098, -4791? -5448 What comes next: -513, -822, -1133, -1446, -1761, -2078, -2397? -2718 What is next in 6161, 6169, 6183, 6203, 6229, 6261? 6299 What comes next: 8271, 8251, 8231, 8211, 8191? 8171 What is next in 75557, 75539, 75517, 75491, 75461? 75427 What is next in 813, 849, 905, 975, 1053? 1133 What is next in 7640, 30578, 68816, 122360, 191216, 275390, 374888? 489716 What comes next: 4159, 4168, 4191, 4234, 4303, 4404, 4543? 4726 What comes next: -254, -507, -768, -1037, -1314, -1599? -1892 What is next in 4781, 9556, 14331, 19106? 23881 What is next in 36, 295, 734, 1359, 2176, 3191, 4410? 5839 What is the next ter	{ "pile_set_name": "DM Mathematics" }
40). 4/5 What is ((-18)/(-3))/(1((-191 - -2) + 6))? -2/61 -422 - -464 - 330/8 - (54/16 + -2) -5/8 Calculate ((-9)/(-24))/(36/(-1248)). -13 (121/((-59895)/5995))/(3/27) -109 What is (-1)/((((-391)/92)/17)/(-6))? -24 Calculate 264/54390/40 + 18/54. 48 Evaluate (-4)/31(-19747)/182 + 1628/(-116). -1/29 Evaluate 121542/(-329)2/20 - 24/420. -37 What is (11 - (-1989)/(-255))45/(-2)? -72 What is 2400/(-192) + 6/4? -11 What is (2352/63 + -6)/((-100)/(-15) - 6)? 47 Evaluate -23(-7)/63 + 1500/(-2375). 2/57 Calculate (117/351)/((-4)/(-36)). 3 What is 39245/(-319638) + 16/(-88) + (-1)/(-6)? -4/29 What is 1734/(-153) + -10 + 40/(-15)? -24 What is (13257/22095)/((-3)/305)? -61 What is the value of (-4)/55 - 542133/981640? -5/8 What is the value of (-216)/264(2-10 - (-276 - -255))? -9/11 ((-6)/(-14))/(393/19257) 21 Calculate ((-60)/(-80))/(((-135)/(-8))/5)27/36. 1/6 What is the value of (2/15)/(17666/(-8030))? -2/33 -21(-520)/(-728) + -55 -70 What is the value of 10 - (167 + -166)/(3/((-3666)/(-122)))? -1/61 Evaluate (1624/(-84))/(-58)(-265 - -1). -88 What is -9 - (10 + (-16 - 24) - -34)? -13 Evaluate 4/(-110) - 228/13150280121. -1/26 ((-8)/(-2) + (3 - 123/18))/(3100/400) 2/93 (12/22)/((90139/424941)/(182/12)) 39 What is the value of 45/(-60)1328/2241? -4/9 (2/(-16))/((-365)/(-90) - 4)-40 90 What is (-56)/(-6)(115(-37)/(-851) - (0 - 1))? 56 Calculate (13/78)/(((-2588)/144 + 18)/(5/(-4))). -15/2 Evaluate (451/(-176))/(162/2592). -41 What is (-11 - -1)-1 + 8567 + -8617? -40 Calculate (144/(-1260))/(32/336). -6/5 What is the value of ((-87680)/2112 + 42)-3? -16/11 What is the value of 76(-23 - (-7395)/323) + 538/67? 2/67 Evaluate 1 + (((-6)/(-2))/(3/7) - (-5 + 0)). 13 What is 208/(-988) + 9891/(-399) + 0/1? -25 What is the value of (-7 - 4970/(-714)) + (4944/153)/8? 4 Calculate ((-2 - -3) + (-406)/408)/(-332 + 373625/1125). 3/68 Evaluate (688/(-112) + 6)/((-78)/(-84)). -2/13 What is the value of (-24486)/28567(167/(-2) - -3)/(3/2)? 46 What is the value of 4 + -2 - (-726)/(-484)? 1/2 What is -9 + 2 + 162/(-27) - -141? 1 Evaluate 3040/70(-1204)/1032(-6)/(-8). -38 What is 56((-105)/(-4) + -26)-3? -42 What is the value of -2((-310)/3100)/(14/(-5) + 2)? -1/4 ((-1)/1)/(660758/5144040 + 4/(-270)) -44/5 What is the value of (-2613)/(-11154) - (-132)/(-484)? -1/26 What is the value of (255 + -160 - 289) + 156? -38 Evaluate -30((-24)/(-5) + (-1)/((-26)/(-156))). 36 Calculate (-122)/(-13) - (39/(-78))/((-362)/36 - -10). 5/13 Evaluate (30/50)/((-2250)/172500). -46 -107 - (-60 + (-65 - -85)) -67 Calculate (34510/959 - 8) + (-1960)/70. -2/137 What is the value of (414 + -411)/(18/(-12))? -2 (28/27)/(5 + (-12257)/3399 + (-2)/33) 7/9 Evaluate 826931/(-20847) + (-6830)/(-174). -12/29 Calculate 82/68 - (-2960/4176)/(5/(-14)). 2/51 Calculate -57 + (3 - (-167 + 45)). 68 Evaluate ((19090/138)/(-83))/((70/72)/(-1)). 12/7 Evaluate -256 + 315 - 11295/195. 14/13 Evaluate (113 + 64790/(-570))/(-1 + -1). 1/3 What is the value of 34/221 + (1 - (-23)/(-13))/((-129)/(-473))? -8/3 What is (10 - 207/21) + 75/(-525)? 0 What is (12502/4606)/(42/30 - (6/(-5))/(-3))? 19/7 What is 12432/(-560)4/6 - -15? 1/5 What is the value of 672/(1848/11)((-94)/32 + (-6)/(-3))? -15/4 What is the value of (54472/142989)/(4/(-30))? -20/7 Evaluate -1 - ((-477)/728 + 192/(-12)). 68 Evaluate (1924/407)/((-2)/(-4)(-32)/(-264)3). 26 Evaluate ((-42)/(-609))/((-837)/(-2697)). 2/9 Evaluate (-25)/175 + 3/60 + 278176/4480. 62 Evaluate -3(-2)/571 - (-3823578)/308484. 25/2 Calculate (4/(2-6))/(14 - 1684/120). 10 Evaluate 11 + 0 + -5618/1440(-1 + 7). 34/5 Calculate (-390)/(-3) - (-1106880)/(-5765). -62 What is the value of (95 + (-457209)/4773)/(-17)? 2/43 Evaluate 1542/11822 + (-6)/(-92)(-3899)/(-63). 25/6 (-1 - 5)((-20)/(-3) - 15/45) -38 What is (-248)/806(-910)/(-28)? -10 What is -9 - ((-2680)/220 + 15 + (-6)/(-33))? -12 Calculate (((-4300)/(-75))/43)/(8/252). 42 Evaluate 50 - 0/(-72 - 3). 50 What is ((-299)/(-42) - (-4)/(-14)) + (-1159 - -1151)? -7/6 What is the value of -10883/(-9960) + (-4 - -2)? -11/10 153/(-357)12/(72/(-10)) 5/7 What is the value of ((-184)/3)/(38652/86967)? -138 What is the value of (-42)/1385/(-35)? 1/23 ((-6)/3)/((-6)/42) + ((-19411)/28)/47 -3/4 What is the value of ((-1224)/(-11067)31)/((-16)/(-28))? 6 (80/8 + (-29)/(435/120))19 38 Evaluate 1232/154 + (45/(-10) - -3)/((-45)/(-420)). -6 Calculate (-23 - (-3460)/150) + (-357)/(-45). 8 What is the value of 132/(-151536)-82 + (-827)/141? -59 What is the value of 1280/(-2240)(-7)/(-10)? -2/5 Calculate (144/(-30) - -7) + (-18 + 8/4 - -15). 6/5 72/(-22) - (-136)/(-187) - (-291)/73 -1/73 What is the value of 31/589((-10)/(-12) - 1)/(112/(-672))? 1/19 (21476/182546)/((-1)/10) -20/17 What is (108/(-99))/(24/396)? -18 Evaluate (-8)/(360/25) - (-51120)/16200. 13/5 Calculate 11 + (-1323)/(-882)574/(-78). -1/26 Calculate (-40 + (-4699)/(-111))/((-2)/5 - (-55)/75). 7 Evaluate (-21 - (-30 + -123) - 14) + 3 + -17. 104 What is 1275/120 + (-2 - 32/4)1? 5/8 What is the value of (-5656)/18382 - 72/(-65)? 4/5 Evaluate 322530/(-96390) - ((-94)/14 - -6). 2/153 Evaluate ((70/(-20))/(-7)1)/(10/(-15)-45). 1/60 Evaluate 4 + (-8)/(-108)-48 - ((-120950)/2250 + 66). -59/5 Evaluate 10819/698 - 212/8. -11 What is the value of ((-846)/423)/((-13)/273)? 42 0/(-17 - -6) + -21 -21 Evaluate 24/(-2) + (-1044)/63 + 8/14. -28 Calculate (-9027)/(-2655) - (2 - 12/(-15)). 3/5 What is the value of (-2 + 1)/((-3)/(-42)) + -4007 + 3941? -80 Calculate (-186)/(-1 + -2) - (12177/(-4428) + 25/(-4)). 71 Evaluate ((-266)/(-28) + -21 + 8)1/((-7)/110). 55 -1675 - -1700 - 256/4 -39 Calculate -46 - -71 - (-10 - (-37)/(259/700)). -65 What is the value of (342/(-228))/(((-30)/(-3))/620)? -93 Calculate ((-4)/9 - (-120764)/(-684))((-22)/(-6) + -4). 59 Evaluate 36/(-66)4/30-110. 8 What is ((-21 - 623)/28 - 37)/4? -15 Calculate 14 + 31/(-3) + (110 - 115). -4/3 What is the value of (1 - 0)137/((-28085)/9635)? -47 Calculate ((-2075)/830(-1)/32)/((-65)/273). -7 What is the value of (578 - 535)/(5 - (114/12 + -4))? -86 What is the value of ((-74)/(-20))/(451866/5461 - 83) - (-4)/(-110)? -29/2 What is (2 - (19221/13559 + 3/7)) + 1474/(-15158)? 3/53 What is 2 + (-30)/(-9) - ((-6)/14 + (-3387)/(-7903))? 16/3 What is ((-504)/9)/(41/90244)? -28 623(-72)/1512 - -117 -38/3 Evaluate 504/336 + (-1014)/660. -2/55 What is the value of -19 - ((-7777)/231 + 13)? 5/3 What is (220 + -230)12(-3)/(-10)? -36 Evaluate 6/(-18) - (526/24)/((-233)/(-932)). -88 Evaluate (-682)/(-330)((-29)/174 + (-86)/12 + 4). -62/9 (3/(-18))/(56/(-6300)) + 8-1 43/4 What is 516/(-14) - (208 - 246)? 8/7 What is (-675)/17820132/(-300)? 1/60 Evaluate (1(-2)/7)/((-8349)/(-10626)). -4/11 Calculate 1 + -176 - -170 - (-1 + 2 + 0). -6 Evaluate (-3540)/413(-26 - 1180/(-40)). -30 What is the value of (2010/(-60) - -32)12/(-210)-55? -33/7 What is the value of ((-5)/2206)/((-890)/979)? 3/20 Evaluate 13 + -6 + -129 + (-2 + -8)/(480/(-672)). -108 What is the value of 9456174/920920 + (-51)/5? 3/44 What is the value of -1 - (209/(-9) - (15680/882 + 9-2))? 22 Calculate 1-9 + (-19 + 29 - (-42 - -62)). -19 What is the value of (-54)/(-15)((-18)/(-84) + 488/336)? 6 (-26 - -20) + (4 - (4 + -3)/1) -3 What is (((-25)/250)/(5/110) - (-6)/10)5? -8 12393/(-2430)4/61 -17/5 What is (35/45)/(-7) - (-753)/(-27)? -28 What is (1/5)/(1 + 964/(-20))(-61704)/(-38565)? -2/295 What is the value of 6 + 117/(-21) - (-22 + 8/(-84)741)? 93 Calculate 364/195(8/(-18) + (-3116)/2952). -14/5 ((-118552)/6570 + (-16)/(-36))/(4/(-25)) 110 What is (23/(4025/210))/((-99)/30)? -4/11 Evaluate 5/4((-131)/(-1310))/((-5)/(-24)). 3/5 205685/(-26540) + (-1538)/(-184) 14/23 What is the value of ((-589)/95 - (-4 + -1))/((-142)/(-1775))? -15 Calculate 6(-342)/3240 - 2/10. -5/6 What is the value of ((-35)/(-175) + (-126)/30)/(16/28)? -7 Evaluate (2/9 - (-1099)/(-6594)22/30)-36. -18/5 What is the value of -13 + (75200/560)/10? 3/7 Calculate (-4)/(-14) - 563/(358631/(-38038)). 60 What is ((-61172)/(-7460))/(2/10)? 41 What is the value of -3 + 264/9 + (12/(-25))/((-4599)/25550)? 29 What is the value of (-22)/(-2) + 19 + (-9)/((-10989)/(-36482))? 4/33 Evaluate (-291)/57 - (-30 + ((-4550)/(-13))/14). -2/19 What is (40 + (61	{ "pile_set_name": "DM Mathematics" }
- 1016 = 112t + 115. Let f(w) = 4w + 5. Let h(u) = -9u - 10. Determine tf(p) - 6h(p). 2p - 5 Let n(g) = 96g3 + 14g*2 - 8g + 2. Let v(c) = -c*3 + 2c*2 - c + 1. What is -n(k) + 8v(k)? -104k3 + 2k*2 + 6 Let g(h) = -8h*3 - 14h*2 + 9h + 13. Let r(w) = 3w3 + 7w*2 - 5w - 7. Calculate -5g(d) - 9r(d). 13d3 + 7d*2 - 2 Let f be (-5 - -3)5/(-2). Suppose 5 = -2o - ft, 3o + t = 5o + 11. Let u(m) = -14 + 4m + 13 - 2m - 2m - m. Let l(d) = 2d + 7. What is ou(i) - l(i)? 3i - 2 Let l = -15310 - -15299. Let w(m) = 14m3 + m2 - 4m - 4. Let u(t) = -41t3 - 2t*2 + 11t + 11. What is lw(i) - 4u(i)? 10i3 - 3i*2 Let y(h) = 15h - 5. Let q(c) be the third derivative of 2c4/3 - c3 - 2c*2 + 499c. Give 5q(z) - 6y(z). -10z Let s(x) = -x2 + 5x - 3. Let p(t) = -1730t2 - 15t + 9. Calculate -p(b) - 3s(b). 1733b*2 Suppose 3x - 36 = -5i - 66, -x = -4i - 41. Let g(u) = 17u3 + 19u. Let o(w) = -33w - 31w + 4w3 + 135w - 35w - 31w. What is io(q) + 2g(q)? -2q3 - 7q Let b(k) = -325k3 - 4k*2 + 10. Let q(j) = 325j*3 + 5j*2 - 12. Give 6b(i) + 5q(i). -325i3 + i2 Let m(t) = -4t2 + 4t - 4. Suppose -51o + 191 - 38 = 0. Let j(i) = -2 + 1 + 6 + oi*2 + 0i - 4i - i. Calculate -4j(x) - 5m(x). 8x2 Let k(r) = -r2 - 5r + 5. Let w = 0 + -37. Let x = -27 - w. Let o(a) = 11 - 20 + x - a. Calculate k(z) - 5o(z). -z*2 Let n(k) = -8412 + 8412 + 0k + 30k2 - 29k*2 - k. Let o(f) = 30f*2 - 33f. Calculate 66n(w) - 2o(w). 6w2 Let i(u) = 13294u*2 + 51u - 153. Let l(r) = 1328r2 + 5r - 15. Determine 5i(o) - 51l(o). -1258o2 Let b(d) = -2d + 2. Let o(l) = l + 1. Let x(i) = i*3 - 10i*2 - 4i - 35. Let m be x(10). Let z = m + 73. What is zb(k) + 4o(k)? 8k Let x(z) = 15z*2 + 5z - 5. Let n(p) = -6p + 0p - 7p2 + 6 - 9p*2. Let r(y) = -8y*2 - 257y - 1549. Let q be r(-8). Give qn(b) - 6x(b). -10b2 Let v(f) = -4f*3 + 7f*2 + f + 1. Let b = -4546 - -4539. Let k(i) = 4i*3 - 6i*2 - i - 1. Give bk(c) - 6v(c). -4c*3 + c + 1 Let b(z) = -3z*2 - 21z - 1. Let s(w) = -3w2 - 18w - 1. What is -6b(f) + 7s(f)? -3f2 - 1 Let w be (32/40)/((108/(-180))/(3/2)). Let v(y) = y3 - 2y*2 - 2y - 24. Let j(t) = 6t3 - 11t*2 - 11t - 120. Calculate wj(s) + 11v(s). -s*3 - 24 Let y(d) = -284d + 207. Let n(p) = p - 71. Calculate 3n(c) + y(c). -281c - 6 Let i(n) = -4698n3 - 203n*2. Let r(o) = 88o*3 - 47o*3 - 157o*3 - 5o*2. What is -5i(g) + 203r(g)? -58g*3 Let n(k) = -8k - 9. Let u(h) = 16h + 17. Let p be (15/6)/((-4)/(-10) - (-48)/2880). Give pu(w) + 11n(w). 8w + 3 Let h(z) = 5z2 - 62z + 4. Let v(f) = 4f2 - 59f + 3. What is -2h(s) + 3v(s)? 2s2 - 53s + 1 Let t(y) = -14y + 16. Let o = -39 - -127. Let l = o - 85. Let w(r) = -3r + 3. Give lt(n) - 16w(n). 6n Let m(v) = 91 - 8v*3 - 5v - 11v2 + v3 + 8v*3 + 5v3. Let s(z) = z3 - 2z2 - z + 18. Calculate -2m(q) + 11s(q). -q3 - q + 16 Let j(n) be the first derivative of -n2 + 7n + 12. Let x(h) = -6h + 80. Let v(f) = 6f - 110. Let r(o) = 2v(o) + 3x(o). Calculate -8j(i) + 3r(i). -2i + 4 Suppose 58h + 19h = 14h + 189. Let t(a) = 6a2 + 2a - 4. Let f(o) = -11o2 - 4o + 9. Give hf(d) + 7t(d). 9d2 + 2d - 1 Suppose 8r - 50r + 630 = 0. Suppose 5m = 0, 10q + 4m + r = 13q. Let d(y) = y + 5. Let v(h) = -3h - 12. Determine qv(g) + 12d(g). -3g Let s(a) be the second derivative of a*4/2 - 17a*3/6 - 3a. Suppose -73k + 62k = -143. Let q(g) = 2g2 + kg - 20g + g. Calculate -17q(n) + 6s(n). 2n2 Let c(y) = y3 + y*2 + y - 1. Let m(p) = 4p*3 - 3 - 7p*3 - 8p*2 - 22107p - 10p3 + 22101p + 8. Give 6c(w) + m(w). -7w*3 - 2w*2 - 1 Let q(s) = 2549s - 2. Let h(g) = -5101g + 4. Determine 3h(j) + 5q(j). -2558j + 2 Suppose -32 = -4g + 4d, -4g + 4d + 17 = -3g. Let m(x) = 0 + g - 1 - 5. Let l be ((-51)/(-34))/((-12)/(-16)). Let a(v) = 3v + 2. What is lm(k) + a(k)? 3k Let f(b) = 25b. Let n(j) = 2j. Let l(w) = -w*3 + 3w*2 + 7w - 10. Let y be l(4). Suppose ya = -10 + 2, 5a = -4g - 32. Give gf(c) + 35n(c). -5c Let g(z) = -619z3 + z2 + 61z + 5. Let k(b) = 310b3 - 25b - 2. Determine -2g(j) - 5k(j). -312j3 - 2j*2 + 3j Let q(w) = -899w3 + 6w + 12. Let m(p) = 7191p3 - 47p - 94. What is -6m(t) - 47q(t)? -893t3 Let p(d) = -3d*2 - 2d + 13. Let k(u) = -20u2 - 4u + 450. What is k(o) - 6p(o)? -2o*2 + 8o + 372 Let t(p) = -31p + 5 - 4 - 4 + 59p + 2 - 29p. Let d be (1 - (1 - 1)) + -4. Let s(u) = 2u*2 + 3u + 3. Give dt(j) - s(j). -2j*2 Let w(b) = 7b - 643. Let n(i) = -8i + 608. Give -5n(r) - 6w(r). -2r + 818 Let c(v) = 6683v. Let j(w) = 5406549w. Calculate 2428c(f) - 3j(f). 6677f Let b(o) = 103o*2 - 6o - 6. Let u(q) = 105q2 - 7q - 7. What is -5b(f) + 4u(f)? -95f2 + 2f + 2 Let u(p) = -p*3 - 3p*2 - 20p + 16. Let y(w) = -w*2 + 3. Give -u(s) + 5y(s). s*3 - 2s*2 + 20s - 1 Let s(p) = 5851p + 6. Let x(j) = -17557j - 17. Determine 11s(b) + 4x(b). -5867b - 2 Let v(f) = 5 - 3f - 2f + 2f. Let i be (-1 - 431)(-3)/(0 - -6). Suppose i = -11p + 47p. Let u(h) = -3h + 4. Determine pu(o) - 5v(o). -3o - 1 Let l(i) = i + 1. Let f = -2 + 5. Suppose -1894v - 864 = 1030. Let z(g) = 7g + 3. Give fl(q) + vz(q). -4q Let y(r) = -82r + 492. Let t(q) = 5q - 2. Calculate -1230t(f) - 5y(f). -5740f Let v(p) = p + 1. Let a(o) = 3o + 2. Let u(l) = 2a(l) - 5v(l). Let d(b) = -b + 2 - 1 + 1. Let h be (193/772)/(3/48). Determine hu(z) + d(z). 3z - 2 Let z(s) = 8156 + 8155 - 37s2 - 16311. Let q(r) = r2. Determine 4q(p) + 2z(p). -70p2 Let x(z) = z2 - z - 1. Suppose -2k = -5c - 11, -5c + 2 = -4k + 19. Let q(v) = -8v2 - 6v - 6. Give cq(m) + 6x(m). 14m2 Let d(a) = -16a + 16. Suppose 0 = n - 6 + 3. Suppose 5o - 9 = 3v + 7, 0 = -nv - 4o + 29. Let z(j) = -8j - v + 10j + j. What is 2d(h) + 11z(h)? h - 1 Let p(x) = -6x3 + 16x*2 + 144x - 91. Let c(j) = -2j3 + 4j*2 + 36j - 21. Calculate 13c(w) - 3p(w). -8w3 + 4w*2 + 36w Let w(r) = 618r + 65. Let c(q) = -308q - 37. Determine -5c(v) - 3w(v). -314v - 10 Let h(l) = -36l + 11. Let u(r) = -144r + 44. Let b(q) = 9h(q) - 2u(q). Let v(k) = -3k + 2 - 7k + k + 2k. Determine -2b(c) + 11v(c). -5c Let z(a) = -61303819a + 132876. Let j(b) = -3691b + 8. Determine 33219j(w) - 2z(w). -3691w Let k(o) = 4139o + 2 + 0 - 4163o. Let a(y) = 25y - 3. What is -2a(b) - 3k(b)? 22b Let q(x) = x*3 - 4x*2 + 33x - 7. Let v be (-8559)/(-317) - (1 - -21). Let j(b) = -2b2 + 16b - 3. What is vj(l) - 2q(l)? -2l3 - 2l*2 + 14l - 1 Let a(l) = -l*2 - l - 1. Let h(s) = -719 + 728 + 105s - 96s. What is 9a(z) + h(z)? -9z2 Let m(u) = -19u + 8. Let n(j) = -6j + 3. Let q(p) = m(p) - 3n(p). Suppose -14 = 2f - 4g, 2f + 0f + 18 = 5g. Let h(x) = -13x - 4. Give fh(t) - 4q(t). -9t Let i(u) = -724u - 2898. Let p(j) = -395j - 1449. What is 6i(k) - 11p(k)? k - 1449 Let m(b) = 5b + 7. Let h(o) be the first derivative of -9o2/2 - 13o - 4926. Determine -6h(t) - 11m(t). -t + 1 Let z(d) = -1287 - 6d - 6d*3 + 3d*2 + 24d + 2d2 - 1271 + 2563. Let y(v) = 9v*3 - 7v*2 - 27v - 7. Determine 5y(i) + 7z(i). 3i3 - 9i Suppose 5v + 0v - 145 = -5f, 19 = v - f. Suppose vk = -11k + 175. Let s(q) = -3q - 5. Let g(h) = -h - 2. Give kg(p) - 2s(p). p Let c(z) = z*2 - 15. Let u(i) = -3i*2 + 29. Suppose -107m + 120m - 65 = 0. Give mc(t) + 2u(t). -t2 - 17 Let j(x) = -19x + 452. Let w(n) = -3n. Give j(r) - 7w(r). 2r + 452 Let b(n) = 1329517n*2 - 2107n. Let l(r) = 6311r2 - 10r. Give -10b(u) + 2107l(u). 2107u2 Let c(n) = 40n*3 + 11n*2 + 6n - 11. Let a(g) be the second derivative of -2g5/5 - g4/6 - g3/6 + g2 - 72g + 12. What is -11a(r) - 2c(r)? 8r3 - r Let l(t) = 11t*3 - 6t + 6. Let b = 14 + -8. Let y(c) = -132 + 45c3 + 633 - 476 - 25c. Give by(d) - 25l(d). -5d3 Let t(k) = k3 - 1 + 9241k*2 - 3k - 4582k2 - 4661k*2. Let o(b) = -2b*2 - 1 - 3b2 + b3 - 7b - 2. What is 2o(s) - 5t(s)? -3s*3 + s - 1 Let x(y) = -393y - 414. Let g(b) = -95	{ "pile_set_name": "DM Mathematics" }
and 1 v when four letters picked without replacement from pbbpypbqvbbb? 4/99 Calculate prob of picking 2 b when two letters picked without replacement from {f: 2, h: 4, b: 4}. 2/15 Calculate prob of picking 2 p, 1 a, and 1 m when four letters picked without replacement from {m: 2, p: 3, g: 1, a: 5, v: 5}. 3/182 Two letters picked without replacement from {b: 1, k: 9, p: 1, f: 6, q: 2}. Give prob of picking 2 k. 4/19 What is prob of picking 1 x and 3 d when four letters picked without replacement from ddxdxdxddd? 1/2 What is prob of picking 3 z and 1 e when four letters picked without replacement from zezzoozzs? 5/63 Three letters picked without replacement from {y: 1, n: 4, o: 6, b: 4, l: 2}. Give prob of picking 3 o. 1/34 What is prob of picking 1 n, 1 d, and 2 v when four letters picked without replacement from {d: 3, b: 4, v: 4, i: 1, a: 1, n: 5}? 1/34 Four letters picked without replacement from {p: 10, q: 3, h: 2, u: 4}. What is prob of picking 1 u and 3 p? 40/323 Calculate prob of picking 2 n when two letters picked without replacement from nnn. 1 Two letters picked without replacement from {f: 7, p: 4}. What is prob of picking 2 p? 6/55 Two letters picked without replacement from laallliaiai. What is prob of picking 2 a? 6/55 Three letters picked without replacement from qqjqqqqqjjqjqqqqqqq. What is prob of picking 1 j and 2 q? 140/323 Two letters picked without replacement from {e: 4, c: 1, h: 5}. Give prob of picking 2 e. 2/15 Four letters picked without replacement from rddvt. What is prob of picking 1 r, 2 d, and 1 t? 1/5 Two letters picked without replacement from {n: 2, x: 4, k: 1, b: 3, o: 3, w: 2}. Give prob of picking 1 n and 1 o. 2/35 Two letters picked without replacement from suauasaa. Give prob of picking 2 u. 1/28 What is prob of picking 2 v when two letters picked without replacement from vgvvvgggvggvovvvsvg? 5/19 Four letters picked without replacement from {o: 1, s: 2, p: 2, h: 6, m: 3}. Give prob of picking 1 s and 3 m. 2/1001 Three letters picked without replacement from ffuuxssruhs. What is prob of picking 2 f and 1 s? 1/55 What is prob of picking 2 m when two letters picked without replacement from fgmmii? 1/15 Calculate prob of picking 1 t and 1 q when two letters picked without replacement from {t: 1, c: 6, z: 1, q: 3, e: 2, g: 2}. 1/35 Calculate prob of picking 3 k when three letters picked without replacement from {k: 1, u: 3, e: 1, d: 2, w: 3}. 0 Two letters picked without replacement from llpelpppll. Give prob of picking 1 l and 1 p. 4/9 Calculate prob of picking 1 f and 1 h when two letters picked without replacement from hhyfywu. 2/21 Calculate prob of picking 1 o and 3 a when four letters picked without replacement from {o: 1, d: 1, x: 2, a: 5, j: 1}. 1/21 Two letters picked without replacement from uuiuiuuuuiuiiiiuiiu. Give prob of picking 1 i and 1 u. 10/19 Calculate prob of picking 1 d and 1 z when two letters picked without replacement from ddddzmdddmmmddzddzdz. 24/95 What is prob of picking 1 o, 2 p, and 1 z when four letters picked without replacement from wwoowwzwpppoooop? 9/455 Two letters picked without replacement from xqylpygypqpy. What is prob of picking 1 y and 1 l? 2/33 Four letters picked without replacement from ppppppp. Give prob of picking 4 p. 1 Calculate prob of picking 3 w and 1 f when four letters picked without replacement from awmwaafafafaafawwf. 1/153 Four letters picked without replacement from {j: 6, l: 3, y: 2, r: 2}. Give prob of picking 2 r, 1 y, and 1 j. 12/715 Two letters picked without replacement from ttoaotatgtnt. What is prob of picking 1 t and 1 o? 2/11 Two letters picked without replacement from ohhhhmcmhtototmh. Give prob of picking 1 t and 1 c. 1/40 What is prob of picking 1 k, 1 m, and 1 u when three letters picked without replacement from mokun? 1/10 Three letters picked without replacement from {f: 1, j: 1, s: 1, m: 2, e: 2, x: 2}. Give prob of picking 1 j and 2 x. 1/84 Three letters picked without replacement from {t: 4, h: 3}. Give prob of picking 3 h. 1/35 Three letters picked without replacement from lnaraaarsaaasnaar. What is prob of picking 1 l and 2 s? 1/680 Three letters picked without replacement from eneweffeppeeneefpep. Give prob of picking 1 p, 1 e, and 1 w. 12/323 Two letters picked without replacement from zxxdxzdoededzzhde. Give prob of picking 1 x and 1 o. 3/136 Four letters picked without replacement from {a: 2, r: 3, o: 2, j: 6, q: 3, u: 2}. What is prob of picking 1 u, 1 r, 1 j, and 1 q? 3/85 Three letters picked without replacement from {z: 7, l: 2, t: 8, b: 3}. Give prob of picking 1 z and 2 t. 49/285 Calculate prob of picking 2 v and 2 i when four letters picked without replacement from {d: 2, s: 3, i: 5, v: 2}. 2/99 Calculate prob of picking 2 p and 1 e when three letters picked without replacement from dprepd. 1/20 Two letters picked without replacement from {b: 1, e: 8, q: 4, k: 1, c: 1}. What is prob of picking 1 e and 1 b? 8/105 Four letters picked without replacement from ppqttppptqtttqptqqtp. What is prob of picking 2 t and 2 p? 196/1615 Two letters picked without replacement from bwbwwbobbwbbwbbbw. Give prob of picking 2 w. 15/136 Calculate prob of picking 2 a and 1 q when three letters picked without replacement from aliqqima. 1/28 What is prob of picking 1 o and 1 w when two letters picked without replacement from {d: 2, w: 2, o: 4}? 2/7 Three letters picked without replacement from tqtsftttfqfq. Give prob of picking 2 f and 1 s. 3/220 Two letters picked without replacement from {c: 4, s: 10}. Give prob of picking 2 c. 6/91 What is prob of picking 2 o and 1 x when three letters picked without replacement from {x: 11, o: 2, q: 4, t: 2}? 11/969 Three letters picked without replacement from jwoarou. Give prob of picking 1 o, 1 w, and 1 a. 2/35 Three letters picked without replacement from {n: 4, x: 5, j: 10, w: 1}. What is prob of picking 3 j? 2/19 Calculate prob of picking 2 j when two letters picked without replacement from jjyjyjjjrryyrjjj. 3/10 Four letters picked without replacement from {x: 1, d: 1, e: 1, r: 2, k: 2, g: 2}. What is prob of picking 1 d, 1 g, 1 k, and 1 r? 4/63 Calculate prob of picking 2 b when two letters picked without replacement from {b: 2, d: 1, z: 2, h: 2, i: 7, x: 2}. 1/120 Two letters picked without replacement from oofofoooofooooo. What is prob of picking 2 f? 1/35 What is prob of picking 1 s and 2 a when three letters picked without replacement from ajsa? 1/4 Calculate prob of picking 1 m, 1 a, and 1 b when three letters picked without replacement from hmhbiba. 2/35 What is prob of picking 1 s and 2 q when three letters picked without replacement from {s: 8, q: 2}? 1/15 Two letters picked without replacement from viiniiwiniw. Give prob of picking 1 i and 1 w. 12/55 What is prob of picking 2 i and 1 w when three letters picked without replacement from {i: 3, t: 6, p: 2, w: 1}? 3/220 Three letters picked without replacement from {a: 1, v: 3, r: 1, z: 5, n: 1}. Give prob of picking 1 a and 2 z. 2/33 Three letters picked without replacement from nvnvn. What is prob of picking 3 n? 1/10 Two letters picked without replacement from gvoaovvoaoavvovv. Give prob of picking 2 a. 1/40 Four letters picked without replacement from {i: 5, t: 2, l: 1, u: 1, o: 1}. Give prob of picking 4 t. 0 Four letters picked without replacement from oouufnntonutnfwt. What is prob of picking 2 f, 1 w, and 1 o? 3/1820 What is prob of picking 3 h and 1 b when four letters picked without replacement from bbvvbhhhbhhh? 16/99 Two letters picked without replacement from uutotuyuylolyuyyyou. Give prob of picking 2 l. 1/171 Calculate prob of picking 1 p and 1 f when two letters picked without replacement from {p: 3, d: 3, f: 3, y: 1, c: 4, b: 2}. 3/40 Four letters picked without replacement from {e: 1, z: 2, p: 2, l: 1}. Give prob of picking 2 p, 1 z, and 1 e. 2/15 Calculate prob of picking 2 k when two letters picked without replacement from kkk. 1 Three letters picked without replacement from {e: 11, v: 5}. Give prob of picking 3 e. 33/112 What is prob of picking 1 m and 1 r when two letters picked without replacement from {g: 1, z: 1, s: 1, r: 1, m: 1, a: 2}? 1/21 Four letters picked without replacement from {l: 1, b: 5, w: 4, h: 1}.	{ "pile_set_name": "DM Mathematics" }
? c*2 + 75981c + 80 What is the w'th term of -634252, -634170, -634088? 82w - 634334 What is the z'th term of 118815, 237659, 356529, 475425, 594347, 713295, 832269? 13z*2 + 118805z - 3 What is the x'th term of 447772, 1791053, 4029854, 7164175, 11194016, 16119377, 21940258? 447760x2 + x + 11 What is the p'th term of 7764965, 7764968, 7764973, 7764980, 7764989, 7765000, 7765013? p2 + 7764964 What is the u'th term of 969, 3819, 8495, 14937, 23085, 32879, 44259? -10u*3 + 973u2 + u + 5 What is the f'th term of 73788, 295173, 664146, 1180701, 1844832, 2656533, 3615798? -f3 + 73800f2 - 8f - 3 What is the i'th term of 3106, 8926, 14742, 20554? -2i2 + 5826i - 2718 What is the k'th term of 5428, 21466, 48206, 85654, 133816, 192698? k*3 + 5345k*2 - 4k + 86 What is the h'th term of -44347387, -44347389, -44347391, -44347393, -44347395, -44347397? -2h - 44347385 What is the n'th term of -12309, -24643, -36963, -49257, -61513, -73719, -85863? 2n*3 - 5n*2 - 12333n + 27 What is the j'th term of 844626, 3378489, 7601594, 13513941, 21115530, 30406361, 41386434? 844621j2 + 5 What is the w'th term of 275952, 276142, 276458, 276900, 277468? 63w*2 + w + 275888 What is the p'th term of 56638, 226619, 509946, 906619, 1416638, 2040003, 2776714? 56673p*2 - 38p + 3 What is the g'th term of -2134911, -4269872, -6404833, -8539794, -10674755? -2134961g + 50 What is the g'th term of -46, -164, -636, -1738, -3746? -46g*3 + 99g*2 - 93g - 6 What is the u'th term of -842026, -841945, -841730, -841315, -840634, -839621? 11u3 + u2 + u - 842039 What is the q'th term of -128, 763, 1636, 2485, 3304? -q3 - 3q*2 + 907q - 1031 What is the i'th term of -171414, -172550, -174444, -177096, -180506, -184674, -189600? -379i2 + i - 171036 What is the n'th term of 4401, 1696, -1009, -3714, -6419? -2705n + 7106 What is the c'th term of 558025, 559170, 561079, 563752, 567189, 571390, 576355? 382c2 - c + 557644 What is the t'th term of 368, 791, 1114, 1331, 1436, 1423? -t3 - 44t*2 + 562t - 149 What is the s'th term of -144639, -144655, -144665, -144669, -144667? 3s2 - 25s - 144617 What is the a'th term of 168406, 337322, 506238, 675154? 168916a - 510 What is the w'th term of 5966, 10811, 15656? 4845w + 1121 What is the s'th term of 14069897, 28139796, 42209695, 56279594, 70349493? 14069899s - 2 What is the p'th term of -119, -751, -1399, -2063, -2743, -3439? -8p*2 - 608p + 497 What is the n'th term of -7831, -10465, -13099, -15733, -18367, -21001? -2634n - 5197 What is the i'th term of 426163657, 426163658, 426163659, 426163660, 426163661, 426163662? i + 426163656 What is the f'th term of 276106479, 276106475, 276106469, 276106461, 276106451, 276106439? -f2 - f + 276106481 What is the l'th term of -1920, -4137, -6408, -8733? -27l*2 - 2136l + 243 What is the a'th term of 254819169, 509638341, 764457513, 1019276685, 1274095857, 1528915029? 254819172a - 3 What is the y'th term of -1065281, -1065388, -1065495, -1065602, -1065709, -1065816? -107y - 1065174 What is the z'th term of -3083, -6388, -9909, -13646, -17599? -108z2 - 2981z + 6 What is the z'th term of -897240, -1794160, -2691080, -3588000? -896920z - 320 What is the y'th term of -16681672, -16681638, -16681596, -16681546? 4y*2 + 22y - 16681698 What is the f'th term of -2245, -3888, -5055, -5746, -5961, -5700, -4963? 238f2 - 2357f - 126 What is the b'th term of 81013, 161943, 242791, 323551, 404217, 484783, 565243? -b*3 - 35b*2 + 81042b + 7 What is the w'th term of -7339, -7458, -7595, -7750, -7923, -8114, -8323? -9w2 - 92w - 7238 What is the u'th term of -5600, -5463, -5326, -5189, -5052, -4915? 137u - 5737 What is the n'th term of -92001, -92042, -92143, -92334, -92645, -93106, -93747? -5n*3 - 6n - 91990 What is the u'th term of -49231, -393749, -1328835, -3149773, -6151847? -49214u3 - 20u + 3 What is the z'th term of -7434, -6267, -4322, -1599, 1902, 6181, 11238? 389z2 - 7823 What is the k'th term of 59485, 236438, 531349, 944212, 1475021, 2123770? -k3 + 58985k*2 + 5k + 496 What is the v'th term of -107758954, -107758955, -107758956? -v - 107758953 What is the n'th term of -32244, -32674, -33122, -33594, -34096? -n*3 - 3n*2 - 414n - 31826 What is the p'th term of -10668921, -10668976, -10669067, -10669194, -10669357? -18p2 - p - 10668902 What is the o'th term of 28468, 113490, 255054, 453154, 707784, 1018938, 1386610, 1810794? -o3 + 28277o*2 + 198o - 6 What is the s'th term of -4585, -8948, -13147, -17182? 82s2 - 4609s - 58 What is the h'th term of 64739, 258955, 582645, 1035809, 1618447, 2330559, 3172145? 64737h2 + 5h - 3 What is the y'th term of -622631, -622664, -622713, -622778, -622859? -8y2 - 9y - 622614 What is the g'th term of -1707, -3657, -6915, -11475, -17331, -24477, -32907? g*3 - 660g*2 + 23g - 1071 What is the y'th term of -14985, -32016, -49047, -66078, -83109? -17031y + 2046 What is the s'th term of -4246866, -8493525, -12740184? -4246659s - 207 What is the c'th term of -11732, -13662, -16864, -21326, -27036, -33982, -42152? 2c3 - 648c*2 - 11086 What is the q'th term of -706005, -706041, -706083, -706131, -706185, -706245? -3q*2 - 27q - 705975 What is the s'th term of -13387, -25884, -38381? -12497s - 890 What is the b'th term of 33621, 68498, 103389, 138300, 173237, 208206? b3 + b2 + 34867b - 1248 What is the o'th term of 6619897, 6619913, 6619929, 6619945? 16o + 6619881 What is the p'th term of -229520, -459045, -688632, -918311, -1148112, -1378065, -1608200? -5p3 - p2 - 229487p - 27 What is the m'th term of 107836, 212884, 317932, 422980, 528028, 633076? 105048m + 2788 What is the p'th term of 49127, 98190, 147219, 196196, 245103, 293922, 342635? -3p3 + p2 + 49081p + 48 What is the v'th term of -11120119, -11120123, -11120129, -11120137? -v2 - v - 11120117 What is the v'th term of 73380, 293509, 660382, 1173993, 1834336? -v3 + 73378v2 + 2v + 1 What is the l'th term of 179, 395, 605, 809? -3l2 + 225l - 43 What is the t'th term of -4778033, -4777996, -4777959? 37t - 4778070 What is the w'th term of 109750, 109657, 109564, 109471, 109378, 109285? -93w + 109843 What is the y'th term of 85431, 170851, 256271, 341691? 85420y + 11 What is the s'th term of 546037, 1092001, 1637965, 2183929? 545964s + 73 What is the n'th term of 4064203, 4064243, 4064283, 4064323, 4064363, 4064403? 40n + 4064163 What is the g'th term of 4522, 6488, 9764, 14350, 20246, 27452, 35968? 655g2 + g + 3866 What is the g'th term of -9421139, -18842245, -28263353, -37684463, -47105575, -56526689? -g2 - 9421103g - 35 What is the k'th term of -1527383, -1527316, -1527249? 67k - 1527450 What is the c'th term of -124206, -124229, -124252, -124275, -124298? -23c - 124183 What is the r'th term of -13873, -10081, 215, 20267, 53327, 102647, 171479? 542r*3 - 2r - 14413 What is the p'th term of 128, -266, -910, -1792, -2900, -4222, -5746, -7460? 2p3 - 137p*2 + 3p + 260 What is the a'th term of -477, -1116, -1867, -2730? -56a2 - 471a + 50 What is the k'th term of 82204, 82197, 82200, 82219, 82260, 82329? k3 - k2 - 11k + 82215 What is the x'th term of -1020735, -2041408, -3062077, -4082742, -5103403? 2x*2 - 1020679x - 58 What is the z'th term of -7975, -19239, -37089, -64819, -105723, -163095? -549z3 + z2 - 7424z - 3 What is the t'th term of -437415, -1749679, -3936791, -6998751, -10935559? -437424t2 + 8t + 1 What is the i'th term of 877, 941, 981, 997, 989? -12i2 + 100i + 789 What is the k'th term of 17186972, 17186970, 17186968, 17186966? -2k + 17186974 What is the s'th term of -804, -3015, -6236, -10089, -14196, -18179? 63s*3 - 883s*2 - 3s + 19 What is the h'th term of -32269, -64561, -96879, -129223, -161593? -13h2 - 32253h - 3 What is the i'th term of -1054, -2721, -5006, -7909, -11430, -15569, -20326? -309i2 - 740i - 5 What is the w'th term of -6828, -14287, -21746, -29205? -7459w + 631 What is the d'th term of -20496821, -20496822, -20496823, -20496824, -20496825? -d - 20496820 What is the w'th term of -14674, -58426, -131348, -233440? -14585w*2 + 3w - 92 What is the q'th term of 177835, 178711, 1	{ "pile_set_name": "DM Mathematics" }
is prob of picking 1 l and 3 z when four letters picked without replacement from {l: 2, z: 7}? 5/9 Calculate prob of picking 1 k and 1 h when two letters picked without replacement from {h: 2, w: 4, f: 2, t: 6, k: 1}. 2/105 Four letters picked without replacement from {u: 8, t: 4, l: 2}. Give prob of picking 4 t. 1/1001 Calculate prob of picking 1 a and 1 n when two letters picked without replacement from qqqtqqfan. 1/36 Calculate prob of picking 2 o when two letters picked without replacement from ggpmitgimigmotggmpgi. 0 What is prob of picking 2 l when two letters picked without replacement from {l: 2, x: 11}? 1/78 Three letters picked without replacement from {t: 2, f: 8, w: 8}. What is prob of picking 3 f? 7/102 What is prob of picking 1 k and 2 i when three letters picked without replacement from {i: 15, k: 3}? 105/272 Three letters picked without replacement from iccc. What is prob of picking 3 c? 1/4 Two letters picked without replacement from yvmyoonmyvmyme. Give prob of picking 2 y. 6/91 Calculate prob of picking 2 b when two letters picked without replacement from {b: 3, v: 1, x: 1}. 3/10 What is prob of picking 1 s, 2 y, and 1 m when four letters picked without replacement from {s: 1, z: 4, y: 2, m: 1, d: 1}? 1/126 Two letters picked without replacement from {k: 6, h: 12}. Give prob of picking 1 k and 1 h. 8/17 Three letters picked without replacement from {l: 3, c: 9}. What is prob of picking 3 c? 21/55 What is prob of picking 4 r when four letters picked without replacement from errrvrrrrrerreereer? 165/1292 Four letters picked without replacement from fkfeqqxxvfqfqfv. What is prob of picking 2 v, 1 k, and 1 e? 1/1365 What is prob of picking 2 o and 1 c when three letters picked without replacement from {s: 2, k: 1, v: 1, c: 1, o: 2, e: 2}? 1/84 Calculate prob of picking 2 y when two letters picked without replacement from zyyyvmzbevz. 3/55 Calculate prob of picking 1 o and 1 n when two letters picked without replacement from {e: 1, o: 3, n: 2, w: 6, x: 1}. 1/13 Two letters picked without replacement from {o: 9, a: 9}. What is prob of picking 1 a and 1 o? 9/17 What is prob of picking 2 u when two letters picked without replacement from {m: 2, y: 9, r: 4, u: 3}? 1/51 Two letters picked without replacement from {l: 2, x: 9}. What is prob of picking 1 l and 1 x? 18/55 What is prob of picking 2 v when two letters picked without replacement from kkkkvkkkkzkkkkvkk? 1/136 What is prob of picking 2 m and 1 a when three letters picked without replacement from mmmammmmmaam? 27/55 Two letters picked without replacement from vvvjjzvvzzzjvjzejjv. What is prob of picking 1 v and 1 e? 7/171 Calculate prob of picking 2 g when two letters picked without replacement from gcgggcggg. 7/12 What is prob of picking 3 z when three letters picked without replacement from zhzhzhhzzhhhzzzhhzhz? 2/19 Four letters picked without replacement from hkhp. What is prob of picking 4 k? 0 Four letters picked without replacement from hdezze. What is prob of picking 3 h and 1 d? 0 Two letters picked without replacement from cyvvxcwa. What is prob of picking 1 y and 1 c? 1/14 What is prob of picking 1 b and 1 c when two letters picked without replacement from {n: 1, e: 1, k: 2, v: 1, c: 1, b: 2}? 1/14 Calculate prob of picking 1 f and 2 j when three letters picked without replacement from wjjfwf. 1/10 Two letters picked without replacement from gccgggjbbgjjgccjjbob. What is prob of picking 1 b and 1 j? 2/19 Calculate prob of picking 2 c when two letters picked without replacement from ccccc. 1 Calculate prob of picking 3 w and 1 x when four letters picked without replacement from {w: 4, x: 1, f: 3}. 2/35 Two letters picked without replacement from xfjnfnlennxl. What is prob of picking 1 e and 1 l? 1/33 Two letters picked without replacement from {l: 3, b: 4, m: 1, z: 2, t: 6, v: 3}. Give prob of picking 1 v and 1 z. 2/57 Three letters picked without replacement from {e: 2, o: 1, m: 3, v: 1, y: 5, b: 1}. What is prob of picking 2 e and 1 m? 3/286 Two letters picked without replacement from {e: 8, m: 5}. Give prob of picking 2 m. 5/39 Two letters picked without replacement from {o: 11, r: 5}. Give prob of picking 1 r and 1 o. 11/24 Three letters picked without replacement from zzzzyyz. Give prob of picking 2 z and 1 y. 4/7 Two letters picked without replacement from {f: 1, o: 1, d: 1, z: 1, e: 1}. Give prob of picking 1 e and 1 o. 1/10 Four letters picked without replacement from utnnunfnntntt. What is prob of picking 3 n and 1 u? 8/143 Three letters picked without replacement from hhsoohsshhhosshh. What is prob of picking 1 s and 2 o? 3/112 What is prob of picking 2 t when two letters picked without replacement from {t: 11, f: 3}? 55/91 Two letters picked without replacement from {y: 7, p: 7}. What is prob of picking 2 y? 3/13 What is prob of picking 2 f when two letters picked without replacement from ffyjjffyfjjyjjjfjjy? 5/57 Calculate prob of picking 1 y and 1 m when two letters picked without replacement from {v: 1, m: 1, n: 2, y: 5, u: 2, e: 5}. 1/24 Two letters picked without replacement from iyxiiyyyyiiitiyyixi. What is prob of picking 1 y and 1 i? 7/19 Two letters picked without replacement from {m: 1, z: 9, o: 4, e: 1}. What is prob of picking 1 o and 1 z? 12/35 What is prob of picking 1 z and 1 x when two letters picked without replacement from xxqxqqxxqqzxqx? 1/13 Two letters picked without replacement from {b: 5, s: 1, d: 4}. Give prob of picking 2 d. 2/15 What is prob of picking 3 h when three letters picked without replacement from heqhheeeeeeqeeeee? 1/680 Two letters picked without replacement from cuqwh. Give prob of picking 1 w and 1 c. 1/10 Calculate prob of picking 1 v and 2 c when three letters picked without replacement from {z: 4, c: 8, e: 2, i: 1, v: 1}. 1/20 Two letters picked without replacement from {t: 10}. Give prob of picking 2 t. 1 What is prob of picking 1 b, 2 e, and 1 s when four letters picked without replacement from hsbekskbkkgeses? 8/455 What is prob of picking 1 s and 1 v when two letters picked without replacement from vsvssvssvtvvavvvs? 27/68 Calculate prob of picking 1 w, 1 k, and 2 p when four letters picked without replacement from kkppzkkwk. 5/126 Three letters picked without replacement from qxwwbqtwtwbt. What is prob of picking 1 q, 1 x, and 1 t? 3/110 Three letters picked without replacement from {q: 5, f: 3}. Give prob of picking 1 q and 2 f. 15/56 Two letters picked without replacement from {d: 1, x: 3, c: 1, t: 2, l: 3, e: 1}. Give prob of picking 2 x. 3/55 Three letters picked without replacement from hppppppppphp. Give prob of picking 2 p and 1 h. 9/22 What is prob of picking 1 n and 1 k when two letters picked without replacement from knnpnnppnanpkkanak? 28/153 Calculate prob of picking 2 c and 1 z when three letters picked without replacement from cqvvqvvqvzpccv. 3/364 Two letters picked without replacement from cbboevb. What is prob of picking 1 o and 1 c? 1/21 What is prob of picking 1 p and 3 c when four letters picked without replacement from uucccipciuuuu? 4/715 Four letters picked without replacement from {k: 13, a: 6}. Give prob of picking 1 k and 3 a. 65/969 What is prob of picking 2 u and 1 c when three letters picked without replacement from utcuuucttuuutccc? 3/16 What is prob of picking 1 s and 1 f when two letters picked without replacement from shzukkfu? 1/28 Two letters picked without replacement from ttggtttgggtgtgggggg. Give prob of picking 2 g. 22/57 Two letters picked without replacement from {g: 2, d: 1, m: 1, e: 4, x: 3, w: 4}. What is prob of picking 1 w and 1 m? 4/105 Four letters picked without replacement from {r: 2, t: 2, f: 5, v: 3}. What is prob of picking 2 t, 1 r, and 1 v? 2/165 What is prob of picking 2 b and 1 k when three letters picked without replacement from {k: 11, b: 9}? 33/95 Calculate prob of picking 2 w when two letters picked without replacement from wkkkww. 1/5 Four letters picked without replacement from {g: 6, k: 12}. Give prob of picking 4 k. 11/68 Two letters picked without replacement from {a: 1, b: 2, w: 1}. What is prob of picking 1 b and 1 w? 1/3 Calculate prob of picking 2 a, 1 g, and 1 o when four letters picked without replacement from ggllogolaloaa. 27/715 W	{ "pile_set_name": "DM Mathematics" }
+ w*2 + 3w*3)(-2w + 3w*2 + 4 - 2 - 3). 9w*5 - 6w*4 - 3w3 Expand (-p2 - 2p2 + 2p*2 + (0p*2 - 2p*2 + 3p*2)(-6 + 1 + 3) - 3p + 3p + 2p2)((0 + 0 + 2p)(-2p - 2p + 2p) + 7p*2 - 11 + 11). -3p*4 Expand (-2z + 2z4 + 2z)(z - 7z - 2z). -16z*5 Expand -12v*3 + 12v*3 - 5v*4 + (7 + 3v*3 - 7)(0v - v - 3v) + v*3 + 2v4 - v3 + (v + 4v - 4v)(v3 - 5 + 5). -14v*4 Expand (4 - 6 + 0)(0o2 - o2 - 2o*2 + (3 - 4 - 1)(-4o2 + 4o2 + o2) + 0o2 + 0o2 + o2). 8o2 Expand (-2 - 2 + 5)(2 - 4 + 9)(h - h + 2h). 14h Expand (-2v*2 - 2v*2 - 2v*2)(-v*2 + 5v*2 - 5v*2). 6v*4 Expand (-3 + 4 + 0)(2 - 8 - 4f + 4). -4f - 2 Expand a5 + a5 + a*5 + (0a*3 + 2a3 - a3)(-3a + 3a + a2) + (a4 + a - a)(a - 7a - a). -3a5 Expand 4 + c3 - 4 + (-2c + 0c + 3c)(-4c2 + 6c*2 - 4c2). -c3 Expand (4j5 + 0j5 + j5)(0 + 1 - 2) + (-4j*4 + 2j*4 + 3j*4)(4j + j - 2j). -2j5 Expand 2u*2 - 2u*2 + 3u*2 + (-u + 4u - u)(-u + 0u - u). -u2 Expand (6 - 6 + x3)(-5x*2 + 4x*2 + 2x2 + x2 + x*2 - 4x*2 + (-2x - 4x + 7x)(-5x + 0x + 3x) + 6x2 + x - x). 3x*5 Expand 1 - s - 1 + (-s - 7 + 7)(-3 + 6 - 2). -2s Expand -f3 - 2f*3 + 0f*3 + (2f*2 - 1 + 1)(0f + 0f + f) + (-7f + 7f - f*2)((-4 - 1 + 3)(-1 + 1 - 2f) - 6f - 2f + 5f). -2f*3 Expand 3o - 7o + 18o + (-2 + 1 + 2)(3o - 4o - o) + 2o + o - 5o - 2o - 2 + 2. 8o Expand (-4y + 3 - 3)(-3y*4 - 2y4 + y4) + (5y4 - 3y*4 - 4y*4)(-5y + 2y + 2y). 18y*5 Expand (3t2 - t2 - 3t2)(t + t*2 - t) - 3t*4 - 8t + 8t + 3t*4 + 0t*4 - 6t*4. -7t*4 Expand 19t2 - 46 + 46 + (-t2 + 2 - 2 + (-3t + 2t + 2t)(4t - t - t))(-1 + 1 + 2). 21t2 Expand (0l - 3l + 2l)(-3l3 + l3 + l3) - l4 - 2l4 + 4l*4 - 1. 2l*4 - 1 Expand ((-3 + 2 + 0)(-3 + 2 + 4) + 0 - 3 - 1)(3n2 + n3 - 3n2). -7n*3 Expand (2y3 + y3 - 2y3)(5y + 2y - 5y) - 4y*2 + 4y2 - y4. y*4 Expand (2a*4 + 2a*4 - 5a*4)((0a - 3a + 2a)(-1 + 2 + 0) + 14 + 2a - 14). -a5 Expand (-66l - 13l - 9l)(l - 3l + 4l). -176l*2 Expand (s - 3s + 0s)(0s3 + 3s*3 - 4s*3 + (4 - 1 - 4)(s*3 - 2 + 2) + 3s*3 - 6s*3 + 2s*3) - 381s*2 + 23s*4 + 2 + 381s*2. 29s*4 + 2 Expand (g - 2g + 3g + (-4g + 4g + 2g)(0 + 0 - 2))(-4 + 0 + 5)(-g3 + 4g*3 - 6g*3). 6g*4 Expand 2g*3 - 2 + 2 + (5g - 3g - 3g)(3g*2 - 6g2 + g2) + 4g2 + 2g*3 - 4g*2. 6g*3 Expand (1 - 2 + 3)(4k5 - 6k5 + k5 - 4k5 + 4k5 - k5 - 5k5 + 2k*5 + 0k5 + (-1 + k2 + 1)(-k3 - 1 + 1) + k5 + 2k*5 - 5k*5). -16k*5 Expand (6 - 2 - 6)(2r + r - 2r). -2r Expand 0v*2 + 0v*2 - 2v*3 + (-1 + 1 + 2v)(v2 + v2 - v2) + 3 + v3 - 3 - 3v + v*3 + 3v. 2v3 Expand (2 - 3f*2 - 2)(5 - 5 + f*2) + (5 - 3 - 1)(2f4 + 2f - 2f) - 2f*4 - 2f + 2f. -3f*4 Expand (-2 - 4 + 5 + (2 - 3 - 1)(-4 + 6 - 4) - 3 - 1 + 3 + 0 + 2 - 4 + (-4 + 5 - 3)(3 - 2 - 3) - 2 + 0 + 1 + 4 - 1 - 2 - 1 + 2 + 1)(3i - 2i - 4i). -18i Expand (0 + x + 0)(3x*2 - 5x*2 + 4x*2) - 3x + x*3 + 3x + 0x3 - 3x*3 - 4x3 - 6 + x3 + 6 + x*2. -3x3 + x2 Expand (-1 + 2 + 0)(-i3 - 22i*2 + 22i2). -i3 Expand (-j*3 + 4j3 - j3)(3 + 3 - 5)(-j*2 + 0j*2 + 2j*2). 2j*5 Expand (2x*3 + 2x*3 + 0x*3)(-1 + 1 + x*2) + (2x*3 - 5x3 + x3)(2x*2 - 4x*2 + 3x*2). 2x*5 Expand (10y*3 - 28y*3 + 0y*3)((4y - 6y + 0y)(0y + 0y + 2y) + 3y2 + y2 - 2y2). 36y*5 Expand -7u*3 + 3u*3 + 2u*3 + (-3 + 3 - 4u)(-2u*2 + 4u2 - u2). -6u3 Expand (-3 + 3 - h)(-3h - h - 3h). 7h2 Expand 4q - q + 0q + (0 + 3 - 4)(-2q + 3q + 0q) - 2q - 5q + 3q + (-3 + 1 + 4)(-1 - 2q + 1). -6q Expand (1 - 4 + 0)(-2c + 0c + 4c - 4c + 2c + 4c + (-1 + 2 + 0)(c + 0c + 0c)). -15c Expand (2z - 2z + 2z2)(z*3 - 24 + 11z + 24) + (0z2 + 4z*2 - 6z*2)(-2z3 + 2z3 - z3) + z*5 + 0z + 0z. 5z*5 + 22z*3 Expand (2q + 0q - q)(2q - 6q - 2q + (2q + 0q - 3q)(-2 - 2 + 5)). -7q*2 Expand -18l*5 - 21l*5 + 30l*5 + (2l - l + 0l)(2l4 + 0l*3 + 0l*3) - 2l*4 + 2l*5 + 2l*4. -5l*5 Expand 3 - 3 + u + (-5 + 5 - 1)(0u - u - u). 3u Expand (3x - x2 - 3x)(-9x + 6x - 35x)(2x - 4x + 3x). 38x4 Expand 2o - o - 3o + (3 - 2o - 3)(-3 - 2 + 2) + 5o - 4o - 2o. 3o Expand (2r + 0 + 0)(2 + 2 - 2) + r + 7r + r. 13r Expand -5v*2 + 3v*2 + 4v*2 + (6v - 3v + v)(-v - 3v + 5v) - 2v2 + 0v*2 + 0v*2. 4v*2 Expand (3s - 1 + 1 - s - 4s + 4s + (0 + 1 + 0)(0s + 2s + 0s))(4s + 3s - 3s) + 3s2 + 3s*2 - 4s*2. 18s*2 Expand (-2k + 3 - 2 + 0)(-16k + 13k - 10k). 26k2 - 13k Expand (4s - 4s + 7s)(1 - 1 + 1 - 3s2) + 2s*3 - 3s*3 + 3s*3. -19s*3 + 7s Expand (1 + 2 - 1)(2y - 2 + 2) - 2y + y + 3y + (7 - 4 - 2)(-4y + 2y + y) - 35y + 13y - 17y. -34y Expand (-r2 - 2r5 + r2 + (0r - r + 3r)(-3r*4 + 5r*4 - 3r*4) - 4r5 - r5 + 3r5)(-1 + 2 + 0 + (-2 - 1 + 4)(3 - 3 - 2)). 6r*5 Expand ((5 + 0 - 4)(0 + 4 - 5) - 2 - 1 - 1 + (-1 - 2 + 1)(0 - 2 - 1))(-5q - q + 4q). -2q Expand (0t*2 + 2t*4 + 0t*2)(2 - 3 + 3) + (-2t2 - 3 + 3)(t*2 - 2t*2 + 2t*2). 2t*4 Expand (y + 0y + y)(-5y*2 + 4y - 4y) + 2y*3 - 11y*3 - 5y*3. -24y*3 Expand (13y + y - 36y)(-3 - y*3 + 3). 22y*4 Expand -g + 0g + 2g + (-17 + 102 + 6)(2 - 2 + 2g). 183g Expand 0n2 - 7n*2 + 4n*2 + (-2n*2 + 0n2 + n2)(-3 + 0 + 1) + 5n*2 - 2n*2 + 0n*2. 2n*2 Expand (-j + 4j - j)(3 + 4 - 2)(6 - 4 - 1). 10j Expand (-11c + 0c - 5c)(-3c2 + c2 + c*2). 16c*3 Expand (0a + a - 5a + (0 - 2a + 0)(1 + 1 - 3) - a - 2a + a)(-2 + 2 + a). -4a*2 Expand (29 - 11 - 11)(1 + 5 - 4)(-2 + 2p + 2) - 5p + p + 2p. 26p Expand (7g*2 - 9g*2 + 0g*2)(4g - 2g + g)(2g - 5g + 5g + 1). -12g4 - 6g*3 Expand (11 + 24 + 3)(4d2 - 4d2 - d3). -38d3 Expand (-2 - 2 + 2)(128r3 - 17r*5 - 128r*3). 34r*5 Expand ((-3d - 3d + 4d)(4d - 4d + 2d) + 5d2 - 3d2 - d2 + 0d2 - 2d2 - d2)(2d - 3d - d). 12d*3 Expand (-2 + 3 - 2)(6 - 6 - 2b2)(b*3 + 5b*3 - 2b*3). 8b*5 Expand (-v - v + 0v)(3v + 0v - 4v)((-5 + 4 + 3)(4v - v - v) + v + v + 2v). 16v3 Expand -2m*3 + 4m*3 - 3m*3 + (0m2 + m2 + 0m2)(3m - 5m - 3m) + 0m*3 + 0m*3 - 5m*3. -11m*3 Expand (2 + 2v - 2)((-2v + 5v - v)(4v - 2v + 0v) + 11v + 6v2 - 11v). 20v3 Expand (4 - 6 + 0)(-5d5 + 2d*5 + 4d5) + (2 + d2 - 2)(0 - d3 + 0) - d4 + d4 - 3d*5. -6d*5 Expand (0 - 2 - 2)(-3p - p + 2p)(6 + 0 - 3). 24p Expand 0f5 + 271f*4 - 274f*4 - 4f5 + (-f3 + 0f3 + 3f*3)(2f + 2f*2 - 2f) - 5f5 + 0f*5 + 2f*5. -3f*5 - 3f*4 Expand (-1 + 0 - 76s + 62s)(s*3 - 5s3 + s3). 42s4 + 3s*3 Expand (0u2 + u2 + 3u2)(u + u - 3u) + (-3u*2 - 2u*2 + 3u*2)(1 + 2u - 1) + u3 - u3 + 2u*3 - 3u*3 + 0 + 0. -9u*3 Expand (-11 + 1 - 9)(-4z2 + 0z*2 + 2z*2)(-3 + 2 + 0). -38z2 Expand (1 - 1 - 3o*2)(3 + 1 + 2) + (o + 2o - o)(5 - 2o - 5). -22o2 Expand (r2 - r + r)(2 + 2r*2 + 11r*2 - 3). 13r4 - r2 Expand (2k - 2k + 3k3)(2k2 + k2 - 2k*2) - 4k5 - k5 + 4k5 - 3k5 - k2 + k2. -k5 Expand (4 + 1 - 6)(-3l - 2l + 4l)(5l*2 + 11 - 11). 5l*3 Expand (0 + 0 + 2)(4j - j - 2j) + 3j - j + 9j + j - 2 + 2 + j + j - j + (4 + 3 - 5)(0 + 0 + 2j). 19j Expand (2t3 - 1 + t4 - 2t3)(-4 + 2 + 1). -t*4 + 1 Expand 4r*4 - 3r*4 - 2r*4 + (-2r*3 - 4r*3 + 3r*3)(3r + r - 3r + (r + 0r + r)(1 + 2 - 1)). -16r4 Expand -31w*2 - 5421 + 5421 + 4w + (-2 - 3 + 3)(1 - 2w*2 - 1). -27w*2 + 4w Expand (0s + 8s - 2 - 5s)(3s2 - s2 - 5s*2). -9s*3 + 6s*2 Expand (3p + p - 5p)((-5p + 4p + 0p)(-4 - 1 + 3) + p - 2p + 2p + 0p - p + 0p). -2p2 Expand (0 + h + 0 - 3h*2 - 2)(3 - 2h2 - 3). 6h*4 - 2h*3 + 4h*2 Expand (8h*3 + 5h*3 + 5h*3)(1 -	{ "pile_set_name": "DM Mathematics" }
u(-773/77) Simplify (s(1/2)s/(s/(s(s*(1/4)/ss)/s)s))/(((s(-1)s)/s)/sss/(ss(1/4)/s)) assuming s is positive. 1 Simplify (v(-1/2)/vv)(-16/7)/(v/(v(-1/5)v)v(-1)) assuming v is positive. v(68/35) Simplify t*6/ttt(-1)tt(t1)20 assuming t is positive. t*27 Simplify (jj(-16))(2/33) assuming j is positive. j*(-10/11) Simplify (s/(ss(-4/13)/s))39 assuming s is positive. s51 Simplify (t(-1/4)/t)*(-1/2)/(ttt(-1/2))(-31) assuming t is positive. t(377/8) Simplify (s/s20)(1/8) assuming s is positive. s(-19/8) Simplify nn*(-1/4)/nn*(3/4)/nn(-5/4)/n(2/9) assuming n is positive. n(-71/36) Simplify (m(2/7)m)(-37)(m(-1/4))(-13/5) assuming m is positive. m(-6569/140) Simplify (q/((q/q1)/q))40/(((q(-2/5)q)/q)/(qqq/(q(-2/17)/qq))) assuming q is positive. q(7099/85) Simplify (n/n(1/34))33 assuming n is positive. n(1089/34) Simplify (g(2/5))(-2/7)/((g/(g/(gg/(g/(((g5/g)/gg)/gg)))))/(gg(-2/7))) assuming g is positive. g(-22/5) Simplify t10/t27 assuming t is positive. t(-17) Simplify f(-8/7)f(3/8)(f((f(2/7)f)/f)/ff)(-3/13) assuming f is positive. f(-775/728) Simplify c/(c((c/(cccc(4/5)))/c)/cccc)c(9/5)(c*(2/3)c)(1/15) assuming c is positive. c(167/45) Simplify (k*(1/7)/(kkk/(kk*(2/3))))/(kk*(-1/6)kk(-6)/k) assuming k is positive. k(167/42) Simplify (fff(-8)/f)/((f/f(-1))/f)f*(-9/5)f4 assuming f is positive. f(-29/5) Simplify (p(1/2)/p(-5/6))/(p*(3/7)pp/(p/p5)p) assuming p is positive. p*(-128/21) Simplify (nn*(1/4)nn3)(-2) assuming n is positive. n(-21/2) Simplify (aaa(-2))/(a(-1)/aa)(a(2/3)a)(5/6) assuming a is positive. a(43/18) Simplify (((u*10u)/u)/(uu4))/(u/(u(-1)u))39 assuming u is positive. u(-34) Simplify (ttt*16ttt)23 assuming t is positive. t483 Simplify (zz(-1))(10/13)/((zz1)/z(-3/7)) assuming z is positive. z(-17/7) Simplify (l0)*(27/4)(l(-1/3))50 assuming l is positive. l*(-50/3) Simplify (w/(ww*(-5)/w)w)/(w*(-2/3)/w)w*9w(-10)/w assuming w is positive. w(20/3) Simplify (y*(-3)y(-3/4))/(y(-1/4))17 assuming y is positive. sqrt(y) Simplify n(-3/2)/(n/(n*(-2/23)n)) assuming n is positive. n(-73/46) Simplify (w(1/2)w)(-1/10)(ww/(ww/(w*(-2)w))ww)(2/65) assuming w is positive. w(-31/260) Simplify o*(-1/2)o(o/(o(-2/5)o))/o(ooo(-3/5))/(o(-1/2)/oo) assuming o is positive. o(9/5) Simplify m/m(-1/4)m24 assuming m is positive. m(101/4) Simplify (c1c)*49(c/(c/c*(-2/13)))/(cc3) assuming c is positive. c(1220/13) Simplify (((mm4)/m)/(mm(2/11)))/(m(4/5)m/(mm3)) assuming m is positive. m(276/55) Simplify xx/((x/x(-39))/x)xx(-14/3) assuming x is positive. x(-122/3) Simplify (z/((((z(2/21)z)/z)/z)/z))/z(-1/5) assuming z is positive. z(326/105) Simplify o/(o/o*0)o/(o*(3/7)o)(o(-2/3))(-11) assuming o is positive. o(145/21) Simplify (jjjjj(2/3)j(-7))(-48) assuming j is positive. j*112 Simplify ((tt(-1/3))/(t/t1))/(t*(-2/7)/tt(-2)) assuming t is positive. t(83/21) Simplify (p(p/(p6pp))/pp/((p*(-2/5)/p)/p))/((pp/p1)/p)(-3/16) assuming p is positive. p*(-18/5) Simplify (oo(-2/9))/(o(5/9)o) assuming o is positive. o(-7/9) Simplify (qq/(q*(-4/5)q)qq/(qqq*(1/6)/qq))/(qq/q(-2/27)qq/(q/((q(q/(((q*4q)/q)/q))/q)/q))) assuming q is positive. q(421/270) Simplify s/s6ss(-8/17) assuming s is positive. s(-76/17) Simplify (((t*(2/3)t)/t)/t13)(2/153) assuming t is positive. t*(-74/459) Simplify (y/((yy/(y*(-1/7)y)y)/yy)yy/(y*(-8)y))/(y/(y/y(-1/2)))(-2/13) assuming y is positive. y*(708/91) Simplify ((z/(zzz/z(-1)z))/(zz3/z))/(((z7z)/zz)/(z/z0)) assuming z is positive. z(-14) Simplify (zz(zz(-18))/z)/(z/(z/z23)) assuming z is positive. z(-39) Simplify (k(-2)/k)31 assuming k is positive. k(-93) Simplify (i(-11))4 assuming i is positive. i*(-44) Simplify ((s/(ss/(s/(s(s(s/s*3)/sss)/s))))/(s(ss(-1/4)s)/s))/(s*(-6)(ss0)/s) assuming s is positive. s(17/4) Simplify (v(6/19)v)/(vv/v(-2/17)v) assuming v is positive. v(-582/323) Simplify o6o(2/5)(o(2/9))(-3/13) assuming o is positive. o*(1238/195) Simplify (cccc(7/6))/c(-1/5) assuming c is positive. c*(131/30) Simplify ((dd0)/d)(-18)/((d/((((dd(-1/3)d)/d)/d)/d))/(((dd/(d/d(1/5))d)/dd)/d)) assuming d is positive. d(-17/15) Simplify (n(-1/3)/(n/(n/n1)))/((nn/(n/(n*(-1/9)/n)nnn)n)/(n/n(2/5))) assuming n is positive. n(62/45) Simplify i12/(i(3/13)/i) assuming i is positive. i(166/13) Simplify (w(-1/3))(-21)(((ww(-3/4))/ww)/w)/(w1/w) assuming w is positive. w(25/4) Simplify (h(-1/4))(6/11) assuming h is positive. h(-3/22) Simplify (w(-3/4))(2/31) assuming w is positive. w(-3/62) Simplify bb/b(-18)((b(-1/40)/b)/b)/b assuming b is positive. b(679/40) Simplify u*(-25)/(uu(-14)) assuming u is positive. u(-12) Simplify g*(-1/19)gg/((gg(-3/14))/g) assuming g is positive. g(575/266) Simplify ((n/(nn(1/14)/n))/nnn/n(2/9)n)/(n3/(n6/n)) assuming n is positive. n(593/126) Simplify (o(-2/3)/o*7)/(oo*1o)(-1/5) assuming o is positive. o(-106/15) Simplify (b*3bb9/b)(11/5) assuming b is positive. b(132/5) Simplify (u(-7)u*2)/((uu(1/9))/u(7/2)) assuming u is positive. u(-47/18) Simplify (j(-1))*(-37)(jjj0)(-15/7) assuming j is positive. j(229/7) Simplify ((((u(-1/3)uu)/u)/u)/u)3 assuming u is positive. u(-4) Simplify ttt/t*(-7)tt(-4)(t(-1/3))(4/11) assuming t is positive. t*(227/33) Simplify ((dd/(dd/(d/(dd/(d*(-2/9)/d))))d)/dd)(-5)/(d(-7)((dd/(dd*(-2)dd))/d)/d) assuming d is positive. d(127/9) Simplify ii*6iii/(i/(i/((ii(3/2))/i))) assuming i is positive. i(17/2) Simplify (d(1/2))(2/9) assuming d is positive. d(1/9) Simplify v/v(-8/13)v/v(-41) assuming v is positive. v(567/13) Simplify (x*(-3/5)(((x/((xx(-1/3))/x))/x)/xx)/xxx)/(x(-2/15)/x3) assuming x is positive. x*(58/15) Simplify zz/(zz/(z/((z/(z((z/(z*(-3/7)/z)z)/zzz)/z))/z))z)zz/z(-2) assuming z is positive. z(59/7) Simplify ((g((gg/g(-37)ggg)/gg)/g)/g)/((g/(g8/g))/g) assuming g is positive. g48 Simplify f0/(f8/f)f*(-2/3)f(1/6) assuming f is positive. f(-15/2) Simplify (tt(2/9)ttt/t*8ttt)(-26) assuming t is positive. t(182/9) Simplify (c/(c1/c))(-15)((c(c/c*(-1/2))/cc)/c)(-22) assuming c is positive. c(-48) Simplify ((j(-21)/j)/j)(-29) assuming j is positive. j667 Simplify ((k(-8)k)/(k/(kk(-2/5))))30 assuming k is positive. k(-222) Simplify (c/c(-2/3))/c*5(c/c(3/2))/c0 assuming c is positive. c(-23/6) Simplify (l/l(2/5))42/((l3l)/(l/(ll/(ll/(l2/l))ll))) assuming l is positive. l(96/5) Simplify (mm1/m)/((((m5/m)/m)/m)/m) assuming m is positive. 1 Simplify ((m/(((mm/m4)/mm)/m))/mm)/(((mm(-1))/m)/m) assuming m is positive. m6 Simplify gg(1/11)ggg*(12/11)g assuming g is positive. g(57/11) Simplify k28/(k/(k/(k*(2/11)k))) assuming k is positive. k(295/11) Simplify z/z19z11 assuming z is positive. z(-7) Simplify ((n(1/31)/n)/n)/n(-7) assuming n is positive. n(156/31) Simplify (((k1/k)/k)(-4))(-19) assuming k is positive. k(-76) Simplify gg*(2/3)gg(9/5) assuming g is positive. g(67/15) Simplify (g0)(-1/65)((g*(-5/6)g)/g)/g(ggg8ggg)/g assuming g is positive. g(61/6) Simplify ((g/g(-4))/g)(-13/4) assuming g is positive. g(-13) Simplify (((hh10)/h)/hh(-2/9))(11/2) assuming h is positive. h(869/18) Simplify ((a(-1/3))23)(-19/4) assuming a is positive. a(437/12) Simplify (j6j/(j/(j/j(3/5))))/(j(-9)j(-3/4)/j) assuming j is positive. j(343/20) Simplify (g(1/2))20 assuming g is positive. g10 Simplify (g35/g)/gg/g(9/10) assuming g is positive. g(331/10) Simplify (xxx(-3/16)/x)/(xx*(7/4)x) assuming x is positive. x**(-47/16) Simplify (r	{ "pile_set_name": "DM Mathematics" }
be p(1). Suppose -12l + 465 = -y. Does 5 divide l? False Is (-905 - 1(1 - 0))98454/(-3228) a multiple of 61? True Let v(s) = -s2 - 51s + 78. Let m = 206 + -232. Is v(m) a multiple of 14? True Let l(j) = -37j + 118j - 57j + 2. Let n be l(1). Suppose v - 16 = n. Is v a multiple of 7? True Is (-124)/558 - (-43908)/27 a multiple of 37? False Suppose 0 = 94c - 106c + 60. Suppose -u = 2h - 1241, 0 = -5u + ch + 4645 + 1515. Is 19 a factor of u? True Let s(v) = -2v - 375 - 9v + 355 - v*2. Let t be s(-8). Is 65 - (-1 - t/4) a multiple of 29? False Suppose -1931n + 1933n = 12862. Is n a multiple of 73? False Suppose 7c = 18c - 22. Does 43 divide (c/(-1) - -1)/((-70)/4900)? False Is 13 a factor of ((-237)/395)/((-3)/34740)? False Is 173 a factor of (694/(-8) + (-175)/(-700))/((-1)/430)? True Let l = 1023 + -110. Suppose 0 = 4d + 2h - 1214, 0 = 3d - 0d + h - l. Is 9 a factor of d? True Let b = -514 + 2493. Suppose -b = -20l + 1341. Does 89 divide l? False Does 54 divide (-13)/(-52)(92177 - 13)? False Let m(y) = -4y*3 - 70y*2 - 40y + 78. Is m(-26) a multiple of 26? True Let a(c) = 10c - 154. Let f be a(15). Let h(o) = -92o - 113. Does 5 divide h(f)? True Let p = 112 - 82. Suppose 4h + p = 9h. Suppose c = 2a + hc - 40, 4a + 2c - 64 = 0. Is 3 a factor of a? True Let h(y) = y*2 + 81y + 1135. Is 15 a factor of h(-72)? False Let s(z) = z*2 + 34z - 70. Let g be s(-36). Is -201(-3 + g) - 3 a multiple of 33? True Let h(c) = 5c*2 - 3c + 22. Let j be h(-9). Let o = j + 646. Does 22 divide ((-6)/(-15))/(1105/o - 1)? True Suppose -4s - 3d = 64, 4s + 77 = d - 3. Let v = -38 - s. Let p(z) = 2z*2 + 25z - 2. Does 31 divide p(v)? False Is 71 a factor of 105207/6 - (-4 + (-15)/(-50)5)? True Let v be (-1)/(-1) - (0 - -3). Let j be (-621)/(-9) - (-8)/v. Let x = 73 + j. Is 46 a factor of x? True Suppose -5d - 780 = -180. Let k = 120 + d. Suppose k = -18n + 2831 - 41. Is 19 a factor of n? False Let d(o) = 692o*2 - 195o - 2. Is d(2) a multiple of 11? True Let n(i) = -i*3 + 4i*2 - 9i + 11. Let a be n(5). Let x = a + 62. Suppose v - 2g = -v + 6, -xv + 2g = -11. Is v a multiple of 2? False Let v(u) = -5u + 40. Let i be v(8). Suppose i = 9q - 152 - 415. Is q a multiple of 9? True Let c = -78 - -96. Let z(u) = -10u*2 + 13u*2 + 20 - cu - 6. Is 29 a factor of z(8)? False Let o = -22407 - -26567. Is o a multiple of 13? True Let f(c) = c*2 - 8c - 22. Let k be f(-10). Suppose 3v + 260 = 5s - 2v, k = 3s - v. Does 20 divide s? False Let r = 1506 - 678. Suppose 13n - 11n = r. Is 18 a factor of n? True Let a = 201 - 198. Suppose c + 4m - 151 = 0, ac + 5m = m + 493. Does 23 divide c? False Let u = 829 - -3036. Is u a multiple of 156? False Let i(n) = 1640n*2 - 2n + 28. Does 20 divide i(-3)? False Let u be (-3092)/(-5) - (16/(-10) + 2). Suppose -6n - u = -1518. Suppose -n = -95t + 94t. Is 13 a factor of t? False Suppose 3g + 3g = 2g. Let m(d) = 7d - 13. Let l be m(3). Suppose g = -lo + 142 + 10. Does 2 divide o? False Suppose -2b = -3l + 5 - 0, -4l + 10 = -b. Let g(m) = -54 + b + 5 + 6m. Does 6 divide g(19)? False Let q = 529 + -704. Is 25 a factor of (-3 + 1)5q? True Suppose -175a + 90246 = -340a + 171a. Is a a multiple of 7? False Suppose -3o = -2f + 756, -23f + 1959 = -18f + 4o. Is f even? False Let z(c) = -c*2 + 12c + 6. Suppose 0 = -3d + 4d - 6. Let s = 13 - d. Is z(s) a multiple of 7? False Suppose -m - 9 = 2m. Let d be 10/824/(-18)m. Let b = 29 - d. Does 20 divide b? False Let w = -55 + 55. Suppose w = 2o - 130 - 118. Suppose 81 = 5s - o. Is s a multiple of 4? False Suppose 0 = -4w, 7k - w - 1665 = 4k + 8w. Is k a multiple of 14? False Let u(d) = -3d + 29. Let o be u(-18). Let c = -116 + o. Let j = -8 - c. Is 2 a factor of j? False Let l(r) = -r*2 + 6. Let p be l(3). Let i(u) = 4u2 - u + 9. Let d be i(p). Is 13 a factor of ((d/9)/8)/((-4)/(-78))? True Let j(a) = a2 - 22a + 11. Let k be j(-11). Suppose 2i = -f + 374, -i - k = -3i - 3f. Is 12 a factor of i? False Let k = 88090 - 48868. Is 29 a factor of k? False Let b = -408 + 736. Let r = 645 - 451. Let o = b - r. Is 38 a factor of o? False Let f = -787 + 1793. Suppose 4w - f = -y, 4y - 2w = w + 4024. Is 56 a factor of y? False Let o = 35944 + -7200. Does 9 divide o? False Let w(g) = 2g + 5. Let m be w(5). Let d = -283 - -238. Is 11 a factor of (-2)/m - 5451/d? True Let b(f) = 37f2 - 21f + 74. Does 10 divide b(11)? True Let y(h) = h*2 - 55h - 125. Is 11 a factor of y(76)? False Let f = -8 - -24. Let m = f + -49. Let c = m + 52. Is c a multiple of 3? False Let l(z) = -6z3 - 2z*2 - 3z. Let p be l(-1). Let c(r) = r3 + r2 + 59r - 8. Is c(p) a multiple of 23? False Let r = 395 + -371. Suppose -6112 - 2288 = -rx. Is x a multiple of 10? True Suppose -17r + 15r = 0. Suppose -2o + 7 - 7 = r. Suppose o = 69d - 66d - 63. Does 9 divide d? False Does 3 divide 1160/(-84)-7144/10? True Let r(u) = -150u*3 - 14u*2 - 2u - 6. Is r(-2) even? True Suppose 3y = 5q + 9482, 3172 = -124y + 125y + 4q. Does 6 divide y? False Suppose 4k - 20179 = -5i + 26717, 3k + 18 = 0. Does 24 divide i? True Is 17 a factor of 676 - ((2/(-4))/((-7)/14) + -5)? True Let x = 12 - 7. Suppose xm - 180 - 313 = 4t, 190 = 2m + 2t. Is m a multiple of 31? False Does 5 divide 4/(17110/8545 + -2)? False Let z(j) = -93 + 86 - 3j + 17j. Let q be z(6). Let i = -32 + q. Is i a multiple of 4? False Let u(i) = i*3 + 21i*2 + 19i - 26. Let p be u(-20). Is 63 a factor of (p1)/((-5)/95)? False Suppose -5n + 21 = -2v - 37, -4n - 2v = -32. Suppose 15m + 50 = -n. Is 24 a factor of (m/6 - 596/(-12)) + -1? True Let x = 2546 + 9214. Is x a multiple of 14? True Let c = 72 + -69. Suppose 4u - 1648 = -u - o, -cu + o = -992. Does 11 divide u? True Let j be -1523 - -2. Suppose 16 = -d + 2l, -l - 3 = -0. Let n = d - j. Is 13 a factor of n? True Suppose -2l = -2a + 63090, 7l + 31509 = -33a + 34a. Is 15 a factor of a? False Suppose 2j + 3j - 70 = -5d, -j - 82 = -5d. Suppose 3i - 22 = -d. Is (-2)/(i/(-4) - 729/(-1482)) a multiple of 27? False Suppose 3w - 4w + 11 = 3x, -3w = -2x - 11. Suppose 2j = xg + 3j - 179, -3 = -j. Does 11 divide g? True Let i = -28013 - -30499. Does 22 divide i? True Let f be (-6)/(-7) + (990/42)/(-3). Let t(s) = 10s*2 - s + 59. Is 9 a factor of t(f)? False Let n(i) = 9i3 + i2 + 8i + 42. Let j be n(7). Suppose j = -20k + 42k. Is 13 a factor of k? False Let y(d) = -d3 - 32d*2 + 117d + 87. Let o be y(-35). Let q = o - -861. Is q a multiple of 66? True Let l(v) = -v*3 - 5v*2 + v - 4. Let i be 66/(-8) - (-1)/4. Let y be l(i). Let j = y + -69. Is j a multiple of 32? False Let n(z) = 19z - 110. Let v be n(11). Suppose 5j + 159 = 4w - 264, j - v = -w. Is w a multiple of 9? False Let n be (1/(10/4))/(2/20). Suppose -y + 3d + 230 = 0, ny + 4d = 5y - 235. Is y a multiple of 16? False Suppose -69g = -71g + 1958. Let d = g - 898. Does 2 divide d? False Let k = -14516 - -29364. Suppose 170 = 4n - 2u, 486n + 5u = 481n + 205. Does 2 divide (-4)/n + k/672? True Let p = 9 - 27. Let q = p + 20. Suppose -5j = -0r - 3r - 394, qr + 316 = 4j. Is j a multiple of 17? False Let d(b) = -6b2 + b + 1. Let p be d(-1). Let z = -52 - p. Let y = z - -133. Does 12 divide y? False Let s = -2734 - -10734. Is 5 a factor of s? True Let c be (-2)/14 - -2(-224)/(-49). Let n(u) = -9 + 2u2 - 3u - 2u + 0u + 13. Is n(c) a multiple of 24? False Let t(p) = 3p3 + 7p*2 + 11p - 17. Let o be t(-6). Let q = -13 - o. Is 26 a factor of q? False Let o(g) = -g*3 + 2g*2 + 10g - 1. Let l be o(4). Suppose 8w - 420 = -lw. Is w a multiple of 14? True Is -6((-189794)/44 - -1) a multiple of 241? False Let o(z) = z3 - 2z + 7. Let u be o(5). Suppose -32s + 31s = -u. Is s a multiple of 7? False Let b(o) = -197o3 - 5o*2 - 26o - 47. Is b(-2) a multiple of 40? False Let i(t) = t*3 + 23t*2 - 81t - 221. Is i(-20) a multiple of 113? True Let f(d) = -3d3 + 17d*2 - 5d - 24. Let j be f(7). Let m = j + 520. Is m a multiple of 53? True Let r be 6/918/4. Suppose -7283 = -3i + d, -i = rd - 1455 - 966. Suppose -i + 472 = -17u. Is 23 a factor of u? True Let c(x) = -x**2 -	{ "pile_set_name": "DM Mathematics" }
qrt(2) + 130 Simplify 2(sqrt(1900)-1 + 0)*2. 3800 Simplify (sqrt(15)/sqrt(3) + 2 - -4sqrt(10)/sqrt(2))*2. 20sqrt(5) + 129 Simplify (4(sqrt(4500) - (sqrt(4500) + 1)) + -6(sqrt(4500) + -1 - sqrt(4500)))*2. 4 Simplify (-3 + sqrt(2)-3)*2 + 3. 18sqrt(2) + 30 Simplify (sqrt(1053)4 + -2 + -5)2. -504sqrt(13) + 16897 Simplify (-4(((sqrt(78) - 1sqrt(78)) + sqrt(78))/sqrt(6) + -2 + sqrt(13)2))2. -192sqrt(13) + 1936 Simplify 1 + sqrt(12)3. 1 + 6sqrt(3) Simplify (sqrt(3240) - (sqrt(3240) + sqrt(3240)3 + sqrt(3240)))/sqrt(8). -36sqrt(5) Simplify -5 + -2 + sqrt(95)/(sqrt(45) + sqrt(5)) + sqrt(19) + sqrt(133)/sqrt(112). -7 + 3sqrt(19)/2 Simplify ((sqrt(240)/sqrt(4)-5)/(sqrt(1200)2))2. 5/16 Simplify sqrt(425) + (sqrt(425) - ((sqrt(425) - (-1 + sqrt(425))) + sqrt(425))2) + -1. -427 Simplify -5(sqrt(4)/sqrt(2))2 - (0 + (sqrt(16)/sqrt(8))2). -12 Simplify (sqrt(1617)-1 - sqrt(1617))/sqrt(3). -14sqrt(11) Simplify 6(sqrt(96)/sqrt(2))2. 288 Simplify (((sqrt(171)2 - sqrt(171)) + sqrt(171) + sqrt(171))1)/sqrt(9). 3sqrt(19) Simplify (sqrt(22) - (1sqrt(176))/sqrt(8))/(sqrt(88)/sqrt(2)). 0 Simplify (sqrt(95)/sqrt(5) - sqrt(19)) + -4 + -2. -6 Simplify -3sqrt(1008)-2. 72sqrt(7) Simplify 4((sqrt(1700) - (sqrt(1700)2)*2) + -3). -27212 + 40sqrt(17) Simplify (sqrt(15)/sqrt(3) - sqrt(5)) + 5 + (sqrt(5) - (sqrt(80) + 0)*2). -75 + sqrt(5) Simplify -5(sqrt(180) + 1 + -1). -30sqrt(5) Simplify (-4sqrt(4)/(sqrt(72)/sqrt(9)))*2. 8 Simplify -2sqrt(175)2-4. 80sqrt(7) Simplify (((sqrt(95) + sqrt(95) + sqrt(95)2 - sqrt(95)) + sqrt(95))2)/(sqrt(5) - (sqrt(5) - (sqrt(120)/sqrt(4))/sqrt(6))). 8sqrt(19) Simplify 5-3sqrt(175). -75sqrt(7) Simplify (-5 + (-1 + sqrt(832) - sqrt(65)/(sqrt(15)/sqrt(3))))-6. -42sqrt(13) + 36 Simplify 1 + (sqrt(11) - (sqrt(891) + 1)2). -891 - 17sqrt(11) Simplify 6(sqrt(76) + 2) + 4. 16 + 12sqrt(19) Simplify (sqrt(704) - (0 + sqrt(704) - sqrt(704)) - (2sqrt(66) - sqrt(66))/sqrt(6))2. 539 Simplify (sqrt(99) - (sqrt(99) - (2 + sqrt(99))))2-1. -103 - 12sqrt(11) Simplify -6sqrt(60)/(sqrt(12) - sqrt(96)/sqrt(8) - sqrt(12)). 6sqrt(5) Simplify sqrt(143)/(sqrt(11) + 2sqrt(396))-3. -3sqrt(13)/13 Simplify sqrt(2736)1 + -5. -5 + 12sqrt(19) Simplify sqrt(99)/((sqrt(9) + sqrt(90)/sqrt(10))4 + sqrt(9)) + 4. sqrt(11)/9 + 4 Simplify -4 + sqrt(7)3 - (5 + sqrt(7)2). -9 + sqrt(7) Simplify -5 + (sqrt(304) + 0)2 + sqrt(2299)-26. -132sqrt(19) + 299 Simplify (sqrt(190) + (sqrt(190) - sqrt(190)1-6) - sqrt(190))/sqrt(10). 7sqrt(19) Simplify -3 + (sqrt(112))2 + -4. 105 Simplify sqrt(8)/(sqrt(32)/sqrt(8)) - (sqrt(66)/sqrt(3))/sqrt(11). 0 Simplify sqrt(153)/(sqrt(9) + (sqrt(9)-2-4 - sqrt(9)))3. 3sqrt(17)/8 Simplify (sqrt(1539) + -2 + -4)2. -108sqrt(19) + 1575 Simplify (-1 + (sqrt(70) - -1sqrt(70)-1)/sqrt(10))*2. 1 Simplify ((sqrt(110) + 2sqrt(110))/sqrt(10)-4)2. 1584 Simplify sqrt(500) + (-4 + sqrt(500) + 2sqrt(500) + sqrt(500))2 + sqrt(500) + ((0 + sqrt(500))2 - sqrt(500))6 + 2. -360sqrt(5) + 11018 Simplify 2sqrt(9)/sqrt(3)5. 10sqrt(3) Simplify sqrt(150)/sqrt(3)2. 10sqrt(2) Simplify -1sqrt(968) - (sqrt(128) + sqrt(128)-1)2. -22sqrt(2) Simplify 3(0 + sqrt(52)2). 12sqrt(13) Simplify -3(-4 + sqrt(42)/sqrt(6))*2-4. -96sqrt(7) + 276 Simplify (-3 + sqrt(6)/sqrt(3) - 3(sqrt(2) + 3))*2. 48sqrt(2) + 152 Simplify 3 + (sqrt(1053) + -1 + sqrt(351)/sqrt(3))*2. -24sqrt(13) + 1876 Simplify (-1 + (sqrt(300) - (sqrt(300) - (-1 + sqrt(300)))-6))2. 100sqrt(3) + 325 Simplify (3 + -5 + -1sqrt(76))2. 8sqrt(19) + 80 Simplify (((sqrt(19) - sqrt(76)/sqrt(4)-5) + 2 + sqrt(2736))5)*2. 1800sqrt(19) + 154000 Simplify (sqrt(48) - sqrt(48)-3)25. 3840 Simplify (1sqrt(204)-6 - sqrt(204) - sqrt(204))/sqrt(12). -8sqrt(17) Simplify (3(sqrt(162) + sqrt(162) + -1 + sqrt(162) + 1 + sqrt(162)))*2. 23328 Simplify (-1(2sqrt(1872) + (-2sqrt(91))/sqrt(7)))*2. 6292 Simplify (sqrt(72) + (-2(sqrt(72) + sqrt(72)1 - sqrt(72)) - sqrt(72)))2. 288 Simplify sqrt(8) + 3 + -2sqrt(8). -2sqrt(2) + 3 Simplify -5(-3 + sqrt(13)1). -5sqrt(13) + 15 Simplify ((1sqrt(684)-2 + 5)-6)2. -4320sqrt(19) + 99396 Simplify ((sqrt(27) + 4)1 + 5)2. 54sqrt(3) + 108 Simplify (sqrt(42)/(sqrt(6)21))*2. 7/4 Simplify (-2sqrt(7) + -1 - ((sqrt(70) - (sqrt(70) - (sqrt(70) - (sqrt(70)3 + sqrt(70)))))/sqrt(10) + sqrt(7))) + 3. 2 Simplify (-2 + sqrt(13))24-4. -272 + 64sqrt(13) Simplify ((sqrt(110)/(sqrt(11)-1) - sqrt(10))/(sqrt(720)-2))*2 + 2. 145/72 Simplify (1sqrt(200) - (-1 + sqrt(98)))*2. 6sqrt(2) + 19 Simplify -1 + -3(sqrt(5) + 1). -3sqrt(5) - 4 Simplify 3 + (sqrt(77)/(sqrt(28)/(sqrt(16)/sqrt(4) + sqrt(4)) + sqrt(7)))*2. 71/9 Simplify (5(sqrt(56) + (sqrt(56) - sqrt(1400))))/sqrt(8). -15sqrt(7) Simplify sqrt(21)/(-1sqrt(252)). -sqrt(3)/6 Simplify (sqrt(2) - (sqrt(2)-4 + sqrt(2))-4) + 0. -11sqrt(2) Simplify (sqrt(980) - (sqrt(980) - sqrt(980)-2) - sqrt(980))/sqrt(4). -21sqrt(5) Simplify (sqrt(68) - (-4sqrt(68) + sqrt(68) + sqrt(68))5)2-6. -49368 Simplify sqrt(156)/(sqrt(12) - 2sqrt(12)-2). sqrt(13)/5 Simplify sqrt(63) + -2 + (sqrt(7) + 2)-2. -6 + sqrt(7) Simplify 5(6(sqrt(7) - sqrt(14)/sqrt(2))2 + sqrt(7) + sqrt(7)). 10sqrt(7) Simplify 3 + ((sqrt(19) - (1 + sqrt(19)))1 + sqrt(19) - 1sqrt(1539)). -8sqrt(19) + 2 Simplify 1 + -2 + sqrt(833) + (sqrt(612) + sqrt(612) + -1)2 + sqrt(612). -11sqrt(17) + 2448 Simplify (sqrt(153) + 2 - sqrt(153) - sqrt(153))*2 + sqrt(153) + 2. -9sqrt(17) + 159 Simplify 6(-3(sqrt(176)-1 + sqrt(176)))2. 0 Simplify (-3sqrt(10)/sqrt(2))*2 + sqrt(320) + 1 + sqrt(320). 16sqrt(5) + 46 Simplify sqrt(24)/(-1sqrt(1200) - sqrt(12)). -sqrt(2)/11 Simplify -6(sqrt(200) + 0 - sqrt(200))*2 + (-2sqrt(200) + sqrt(200))*22. 400 Simplify sqrt(84)/((sqrt(12) - 2sqrt(12))5). -sqrt(7)/5 Simplify sqrt(1573)-2 - -2sqrt(637) - (2 + (-1sqrt(637) - sqrt(637))). -2 + 6sqrt(13) Simplify (sqrt(1700) + 1)2 + (1 + sqrt(17) + -3 - sqrt(17))2. 20sqrt(17) + 1705 Simplify 6(1(-1sqrt(325) - sqrt(325)))*22. 15600 Simplify (sqrt(5) + sqrt(5) + sqrt(40)/sqrt(8) + 2 - sqrt(55)/sqrt(275))*2. 56sqrt(5)/5 + 216/5 Simplify sqrt(425) + (sqrt(425) - (2sqrt(425))2) + 3 - sqrt(425). -1697 + 5sqrt(17) Simplify (5(5 + sqrt(144)/sqrt(8)))2. 750sqrt(2) + 1075 Simplify -5(0 + sqrt(288)). -60sqrt(2) Simplify (6(sqrt(684) + 0))2-4-1. 98496 Simplify ((sqrt(1300) + 2)-2)*2 + 2. 160sqrt(13) + 5218 Simplify 4 + 6((sqrt(76)/sqrt(4) - sqrt(19)) + sqrt(19))2. 118 Simplify (-4(sqrt(3) + sqrt(27)/sqrt(225))2)2. 6912/25 Simplify -2(4 + -2sqrt(405)). -8 + 36sqrt(5) Simplify ((sqrt(153) + sqrt(153)1 + 2 + sqrt(153) - sqrt(153))-3)*2. 216sqrt(17) + 5544 Simplify (sqrt(165)/sqrt(5))/sqrt(11) + (2 + sqrt(108))*2. 25sqrt(3) + 112 Simplify (sqrt(6897)2)/(sqrt(9)/sqrt(12)). 44sqrt(19) Simplify sqrt(6)/(sqrt(72)/sqrt(4)). sqrt(3)/3 Simplify (sqrt(3) - sqrt(18)/sqrt(24)) + 3. sqrt(3)/2 + 3 Simplify 5 + -2 + sqrt(7)-1. -sqrt(7) + 3 Simplify -5 + 5(sqrt(17) - sqrt(1700)). -45sqrt(17) - 5 Simplify 6((-1sqrt(98) - sqrt(98) - sqrt(98)) + -3)2. 756sqrt(2) + 5346 Simplify (sqrt(152)/(sqrt(4) + sqrt(24)/sqrt(6)))/(sqrt(162)-3). -sqrt(19)/54 Simplify (-2sqrt(504) - sqrt(504))/sqrt(7). -18sqrt(2) Simplify -5 + sqrt(112) + sqrt(7)1 + 4. -1 + 5sqrt(7) Simplify 5 + (sqrt(252)/(-3sqrt(4)) - sqrt(63)). -4sqrt(7) + 5 Simplify (6(sqrt(88) - (sqrt(88) + 3sqrt(88)) - sqrt(88)) + sqrt(88))/sqrt(8). -23sqrt(11) Simplify -4(sqrt(1539)4)*2-4. 393984 Simplify -5 + sqrt(171) + 5. 3sqrt(19) Simplify (sqrt(112) + sqrt(112) + sqrt(112)-1 + 3 - (sqrt(112) + 3((sqrt(112)2)*2 + sqrt(112))))-2. 24sqrt(7) + 2682 Simplify ((sqrt(119) + (sqrt(119) + sqrt(119)1)-2)/(6sqrt(21)/sqrt(3)))*2. 17/4 Simplify 2(0 + sqrt(68)). 4sqrt(17) Simplify sqrt(5) + (sqrt(5) - (sqrt(500) - (1 + sqrt(500))))2 + (sqrt(100)/sqrt(2))/sqrt(10). 6 + 4sqrt(5) Simplify (sqrt(125) + -2sqrt(125))6 + 1. -30sqrt(5) + 1 Simplify sqrt(21)/(sqrt(300)1 + sqrt(3)). sqrt(7)/11 Simplify ((1sqrt(432) - sqrt(432))1 + (-1 + sqrt(432) + sqrt(432))6)2. -1728sqrt(3) + 62244 Simplify 1 + sqrt(68) + -5 + sqrt(153). -4 + 5sqrt(17) Simplify ((5(sqrt(171) + s	{ "pile_set_name": "DM Mathematics" }
Let g = -68 - -67. Let t = q + g. What is the nearest to 0 in 0, t, -2/5? 0 Let j(n) be the first derivative of n*3/3 - 2n*2 + 3n - 1. Let i be j(2). What is the closest to i in -0.5, 2/11, 5? -0.5 Let a = 158 - 156. What is the nearest to 2 in 3, a, -2? a Suppose 0 + 12 = -3i. Let x = 9.1 + -9. What is the closest to -0.2 in x, i, 1? x Let t = -41 - -41. Let k = 3 - 7. Let l be 1/(-2)(0 + 0). Which is the nearest to t? (a) k (b) 1/4 (c) l c Let i(x) = -x*2 - 9x - 6. Let c be i(-8). What is the nearest to 1 in -1, c, 0.5? 0.5 Let g be (-6)/(-9) - 4/(-12). What is the closest to g in 1, 1/4, 0.3? 1 Let g = -0.9 + -0.1. Let r = -1 + 2.5. Let m = r + -0.5. Which is the nearest to g? (a) 0 (b) 0.4 (c) m a Suppose 5 + 3 = -4m. Let s = 6 - 5.6. Which is the closest to 0.1? (a) s (b) 5 (c) m a Let z = 0.3 - 5.3. Let i = z + 4. Let c = 4 - 3. What is the nearest to i in c, -5, -1? -1 Suppose -3x - 9 = -0. Let q = 6 - 6.2. What is the closest to -1 in x, q, -2/5? -2/5 Let j = 5/16 + -1/16. Let h = 2.6 + 0.4. Which is the closest to 0.1? (a) 0.1 (b) j (c) h a Let n = -37 + 36. Let j(o) = -o*3 + 4o*2 - 1. Let i be j(4). Which is the closest to n? (a) i (b) -4 (c) -0.1 a Suppose 0m = -x + 5m + 6, 0 = -5x + 3m - 14. What is the nearest to 1/4 in -1, 0.1, x? 0.1 Let m = -0.3 - 0.1. Let o = m - -0.9. Let u = -0.4 + o. What is the nearest to u in -2, 2/3, -5? 2/3 Let m = -96 - -95. Which is the closest to -2/9? (a) 0.3 (b) -0.4 (c) m b Let d = 24 + -23. Which is the closest to 1? (a) -0.5 (b) 2 (c) d c Let b = -7.4 + 7.1. What is the nearest to 1 in -2/9, b, -5? -2/9 Let s be 10/40 - 6/56. Which is the nearest to -0.2? (a) -1 (b) s (c) -2/5 c Let y = 1 + 5. Let n = 1 - y. Which is the closest to -2/5? (a) n (b) 4 (c) 2/9 c Let d = 2.2 + -1.8. What is the nearest to -1/5 in 0.3, 1/7, d? 1/7 Let s be 3/21(-4 - -1). Which is the nearest to -2/7? (a) 0.2 (b) -2 (c) s c Let u = -1.2 + 1. Let s = 0 + -1. Let g = 5 - 4. What is the nearest to s in u, g, -2? u Suppose -4h = 7 - 3. Let l = h + 4. Suppose g - 2v + 9 = -1, 0 = -2g + lv - 15. What is the nearest to g in -2, -0.3, -5? -0.3 Let z = 0.052 - 9.252. Let o = z + 9. Which is the nearest to o? (a) -0.1 (b) 1 (c) -5 a Let y = -34.9 - -35. Which is the nearest to y? (a) 4/3 (b) -4/5 (c) 1/6 c Suppose 5 = 5s, 3m - 2s - 14 = -m. Suppose mg - 21 = 5k, -4k - 8 = -3g + 2g. Which is the nearest to k? (a) -3/5 (b) 0.1 (c) -0.1 a Suppose -3n + 3 - 9 = 0. Which is the nearest to n? (a) 3/2 (b) 0 (c) 0.2 b Let c be 29/(-6)1. Let a = -5 + 10. What is the nearest to 0.1 in c, 1, a? 1 Let w be 121/2. Let c = -0.27 + 0.07. Let a = 0.05 - 0.05. What is the closest to a in c, 4, w? c Let v = -61.9 + 62. What is the nearest to -5 in -1, 0.4, v? -1 Let v = 0.01 + -2.01. Let j = 5/76 - -87/988. What is the nearest to -0.1 in j, 0.4, v? j Let x = 0 - 8. Let a = x + 6.4. Let l = -0.4 + a. What is the nearest to 0 in -0.5, 2/19, l? 2/19 Let f = 187.5 + -187. Which is the nearest to 4? (a) f (b) -3 (c) -0.2 a Let t be (2 - 1)/(2/(-3)). Let p(l) = 5l + 10. Let f be p(-9). Let y = 106/3 + f. Which is the nearest to y? (a) 1/2 (b) t (c) 1 a Let z = 16805/86796 - -2/2411. Let m = z + 1/36. What is the nearest to 2/5 in 2, -4, m? m Let b be (-325)/546 + (-2)/(-12). What is the nearest to -0.1 in -0.2, 4, b? -0.2 Let j = 0.038 + -26.038. Let l = j + 26.2. Which is the nearest to -3? (a) -2/15 (b) l (c) 2/5 a Let t be 3/(-9)(-2916)/(-20). Let v = t + 49. Suppose 3j + 5 + 4 = 0. What is the closest to -2/9 in j, -0.1, v? -0.1 Suppose 7c = 2c. Let x = 3 - c. Let h be 4x/(2 - 44). What is the nearest to h in -3/4, -1/2, -4? -1/2 Let k be (-5)/94/(-10). Let y = -0.04 - -13.04. Let n = y + -8. Which is the closest to k? (a) n (b) 0.2 (c) -5 b Let z = -20 - -26. Let i = -7 + z. What is the closest to i in -0.5, 1/8, -0.07? -0.5 Let h = -0.5 + 1. Let o = 102 + -100. Which is the nearest to 2/11? (a) o (b) 3 (c) h c Let m = -160 - -160.1. Let r = 6 + -1. Let i = 5 - 9. Which is the nearest to m? (a) r (b) i (c) 0.4 c Let u(j) = -j. Let l be u(5). Let f = -0.53 - 0.07. Let d = -0.5 - f. Which is the closest to -1/4? (a) d (b) l (c) -0.2 c Let y be 32/(-72) + (-22)/(-9). What is the nearest to y in 1/4, -5, -3? 1/4 Let t = 1 + 0. Suppose 2s + 2n = 30, -3 = -2n + 3n. Let p be (-4)/s - (-128)/252. What is the closest to 1 in 2, t, p? t Let z = -2 + 1. Let f = -53.2 + 53. What is the nearest to z in 3/4, f, 0? f Let k = 43 - 47.3. Let x = k + -0.7. Which is the nearest to 2/5? (a) 4 (b) 0 (c) x b Suppose -3j - 41 + 7 = -5u, 0 = 5j - 3u + 30. Let h = -86 - -84.01. Let a = 0.01 - h. What is the nearest to a in -5, j, -1/2? -1/2 Let i be (-1)/10(-20)/(-8). Let s = 0.7 + 1.3. Which is the nearest to -1/2? (a) s (b) 0.1 (c) i c Let w = -0.6 + 0.35. Let z = 0.05 - w. What is the closest to -1 in 4, 1, z? z Let n = -3.07 - -0.07. What is the closest to -2/3 in n, 0, 7? 0 Let q be 16/14 + -4 + 2. Which is the closest to 1? (a) -0.2 (b) -0.5 (c) q a Let g be 0 + (64/(-20))/4. What is the nearest to -1 in -1/10, g, 0.1? g Let w = -0.02 + -0.28. What is the closest to -1 in 1, w, -5? w Suppose 2c - 3 = -4p - 19, 3p = -c - 10. Let x = 4.7 - 0.7. What is the nearest to -1 in -1, c, x? -1 Let z = -1.32 - -0.12. Let n = z - -1.75. Let m = n - 0.05. What is the nearest to -0.1 in m, 2/9, 1? 2/9 Let h = -0.8 + 0.3. Let l = 0.4 + 0. Which is the nearest to -1/3? (a) 2/7 (b) h (c) l b Let f = 39 - 38. What is the nearest to 0 in -2/3, 0, f? 0 Suppose 4i - 5 = -5j, -5j = 5i - j - 4. Let k = -1 + 3. Suppose i - k = -n. Which is the closest to -2/5? (a) -1 (b) n (c) -2 a Let t = -7 + 7.4. Let u = 0.6 + t. What is the nearest to -1 in u, 2/3, -0.5? -0.5 Let p = -117 - -1757/15. Let x be (-16)/6 - 11/33. Let s be (x/51)/((-4)/(-8)). What is the nearest to -1 in p, s, -3? s Let m = -12 - -7. Let u = -15 - -14. Which is the closest to u? (a) m (b) -1/5 (c) -0.5 c Suppose -5q = -0q - 2y - 10, 2y = -4q + 26. Which is the nearest to -2? (a) 1/6 (b) -2/7 (c) q b Suppose 0 = -3i + 2x - 0x + 20, -3x = 3i. Which is the closest to -3/2? (a) 1/8 (b) i (c) 0.3 a Let x = -83 - -81. Which is the nearest to x? (a) -2 (b) 2 (c) -1/3 a Let s = -29 - -26. Let j = 1.2 - 1. What is the closest to j in s, -0.4, -0.2? -0.2 Suppose 0 = 5g - 5, 2t - 6t + 6 = 2g. Let w = 2 - 1. Let d be w/2 + (-27)/42. Which is the closest to -0.1? (a) 3/4 (b) d (c) t b Let g = 3 + -3.4. Let v be 42/4 + 2. Let r = -12 + 12. What is the nearest to 0 in r, g, v? r Let n = 391 + -390. Let f be 1 + -1 + 1 + -4. Let m be 4/(2 + 10/2). What is the closest to n in f, -0.1, m? m Let l be 2/(-4)(-1 - -5). Suppose -5p - 2q - 26 = 0, -2p + 4p = 4q + 4. Which is the nearest to 1/3? (a) l (b) 1 (c) p b Let i be 4(-5)/2190-3. What is the nearest to 0.1 in 5, i, 2? i Let p = -6 + 5.9. Let u = -9 + 9.2. Let r be (-4)/10(0 - -2). Which is the nearest to p? (a) r (b) 1 (c) u c Let w = 16 + -15.8. What is the closest to -1 in w, 3, 0.5? w Let h = -5.11 + 0.11. Let x = 10 - 10.2. Which is the nearest to -1? (a) x (b) h (c) -0.4 c Let p = 8 - 6.4. Suppose -2 = 2s, 6 = -f - 0s - 5s. Which is the nearest to 0? (a) f (b) 0.5 (c) p b Let a = -3.97 - 0.03. Let x = -0.173 + 0.073. What is the closest to x in 4, a, -2/15? -2/15 Let x = 25/2 + -53/4. Let g = -0.1 + -0.2. What is the closest to -0.1 in x, g, -2/17? -2/17 Let d = 0 - -0.1. Let l = 1.94 - -0.06. Let m be (-8)/(-2) + (-34)/8. What is the nearest to m in -4, l, d? d Let y = 0 + 1. Let f = -23 + 22. Let a = f - y. What is the nearest to a in 1, 1/3, 1/8? 1/8 Let o be ((-4)/46)/1. Let x be (-7)/o9/(-14). What is the closest to 1 in x, 2/3, 0.4? 2/3 Let c = -4794/2821 - -52/31. Let g = 83/364 - c. What is the closest to -0.1 in 1/2, g, -2? g Let p = -5.12 + 0.12. What is the closest to 0.1 in 8, p, 2/5? 2/5 Let v = -0.89 - -4.89. Which is the closest to 2/7? (a) 0.3 (b) -14 (c) v a Let p = 1.5 + -2. Let s = -0.2 - -0.3. What is the closest to s in 1/6, 0.4, p? 1/6 Let i be 1/123-2. Let x(m) = -4m - 4. Let s be x(7). Let g be 2/(s/6 - -2). Which is the nearest to 2/5? (a) g (b) -1 (c) i c	{ "pile_set_name": "DM Mathematics" }
372, 299, 194? -m3 - m2 - 3m + 464 What is the i'th term of 33, 70, 109, 150, 193, 238, 285? i2 + 34i - 2 What is the k'th term of -264, -250, -218, -162, -76, 46, 210? k*3 + 3k*2 - 2k - 266 What is the r'th term of -26, -34, -40, -44, -46? r*2 - 11r - 16 What is the z'th term of -856, -1712, -2568? -856z What is the z'th term of -22, -61, -124, -211, -322? -12z*2 - 3z - 7 What is the r'th term of -47, -90, -129, -164, -195? 2r2 - 49r What is the l'th term of -13, 17, 97, 251, 503, 877? 4l3 + l2 - l - 17 What is the t'th term of -11, -20, -17, 4, 49, 124, 235? t3 - 16t + 4 What is the s'th term of 254, 510, 766, 1022, 1278, 1534? 256s - 2 What is the o'th term of 65, 55, 33, -7, -71, -165, -295, -467? -o3 - 3o + 69 What is the c'th term of 681, 683, 687, 693? c2 - c + 681 What is the i'th term of 26, 49, 60, 53, 22, -39? -i3 + 30i - 3 What is the k'th term of -16, -70, -210, -478, -916, -1566, -2470? -7k3 - k2 - 2k - 6 What is the g'th term of -5, -24, -43, -62, -81? -19g + 14 What is the u'th term of -1256, -2515, -3778, -5045, -6316? -2u2 - 1253u - 1 What is the v'th term of 45, 130, 263, 438, 649, 890? -v*3 + 30v*2 + 2v + 14 What is the j'th term of 196, 195, 194? -j + 197 What is the h'th term of -603, -604, -605, -606? -h - 602 What is the a'th term of -483, -946, -1409? -463a - 20 What is the d'th term of -667, -1333, -2001, -2671, -3343, -4017? -d2 - 663d - 3 What is the w'th term of 141, 173, 207, 243, 281, 321, 363? w*2 + 29w + 111 What is the h'th term of -27, -56, -85, -114, -143? -29h + 2 What is the b'th term of -230, -233, -242, -257, -278, -305, -338? -3b*2 + 6b - 233 What is the a'th term of 8, 9, 8, 5, 0, -7? -a*2 + 4a + 5 What is the h'th term of -275, -315, -369, -431, -495? h*3 - 13h*2 - 8h - 255 What is the r'th term of -170, -286, -402, -518? -116r - 54 What is the z'th term of 11, 9, 3, -13, -45? -z3 + 4z*2 - 7z + 15 What is the u'th term of -2379, -2389, -2411, -2451, -2515, -2609, -2739, -2911? -u*3 - 3u - 2375 What is the z'th term of -15, -21, -9, 27, 93, 195, 339? z*3 + 3z*2 - 22z + 3 What is the v'th term of 17, -1, -65, -199, -427? -4v3 + v2 + 7v + 13 What is the u'th term of -41, -42, -45, -50, -57, -66? -u*2 + 2u - 42 What is the l'th term of 1272, 2543, 3814, 5085? 1271l + 1 What is the r'th term of 6, 70, 250, 606, 1198? 10r*3 - 2r*2 - 2 What is the o'th term of -3709, -3710, -3711, -3712? -o - 3708 What is the s'th term of 3, -4, -11? -7s + 10 What is the t'th term of 25, 52, 79, 106? 27t - 2 What is the z'th term of 617, 618, 619? z + 616 What is the k'th term of 11, 45, 79? 34k - 23 What is the t'th term of -97, -159, -177, -145, -57, 93? t*3 + 16t*2 - 117t + 3 What is the f'th term of -6744, -6751, -6762, -6777? -2f2 - f - 6741 What is the c'th term of -142, -171, -200? -29c - 113 What is the u'th term of -238, -481, -724, -967, -1210, -1453? -243u + 5 What is the r'th term of 3603, 7203, 10803, 14403, 18003, 21603? 3600r + 3 What is the c'th term of -53, -130, -229, -350, -493, -658? -11c2 - 44c + 2 What is the b'th term of 458, 1837, 4134, 7349, 11482? 459b2 + 2b - 3 What is the k'th term of -679, -675, -671, -667, -663, -659? 4k - 683 What is the n'th term of -106, -158, -306, -598, -1082, -1806, -2818? -8n*3 + 4n - 102 What is the p'th term of 81, 68, 51, 30, 5? -2p2 - 7p + 90 What is the s'th term of -52, -40, -14, 32, 104, 208, 350, 536? s3 + s2 + 2s - 56 What is the s'th term of 17, 18, 21, 26? s2 - 2s + 18 What is the d'th term of -17, -16, -15? d - 18 What is the n'th term of -569, -2261, -5091, -9065, -14189, -20469, -27911? -n*3 - 563n*2 + 4n - 9 What is the p'th term of -334, -332, -330, -328? 2p - 336 What is the c'th term of 217, 347, 503, 697, 941? 2c3 + c2 + 113c + 101 What is the z'th term of 128, 256, 384, 512? 128z What is the l'th term of 16, 7, -16, -59, -128, -229, -368, -551? -l3 - l2 + l + 17 What is the k'th term of -238, -248, -258? -10k - 228 What is the h'th term of -180, -740, -1678, -2988, -4664, -6700? h3 - 195h*2 + 18h - 4 What is the m'th term of -189, -198, -209, -222, -237, -254? -m*2 - 6m - 182 What is the i'th term of -119, -81, -43? 38i - 157 What is the k'th term of 196, 194, 192, 190, 188? -2k + 198 What is the k'th term of 0, -22, -58, -108, -172, -250? -7k2 - k + 8 What is the r'th term of 1065, 1064, 1061, 1056, 1049, 1040? -r2 + 2r + 1064 What is the a'th term of 293, 1162, 2611, 4640, 7249? 290a2 - a + 4 What is the i'th term of 102, 105, 108, 111? 3i + 99 What is the h'th term of -1025, -1023, -1021? 2h - 1027 What is the i'th term of 7, -3, -37, -107, -225, -403, -653? -2i*3 + 4i + 5 What is the v'th term of -357, -359, -361? -2v - 355 What is the d'th term of 91, 151, 209, 265, 319? -d2 + 63d + 29 What is the k'th term of -98, -194, -292, -398, -518, -658, -824? -k*3 + 5k*2 - 104k + 2 What is the l'th term of -15, -52, -113, -198? -12l2 - l - 2 What is the p'th term of -125, -129, -135, -143, -153, -165? -p2 - p - 123 What is the s'th term of 535, 537, 539, 541? 2s + 533 What is the k'th term of -345, -1381, -3115, -5553, -8701, -12565, -17151, -22465? -k*3 - 343k*2 - 1 What is the g'th term of -2, -2, 4, 16? 3g*2 - 9g + 4 What is the j'th term of 19, 16, -3, -50, -137, -276? -2j3 + 4j2 - j + 18 What is the y'th term of -55, -70, -101, -154, -235, -350? -y3 - 2y2 - 2y - 50 What is the h'th term of -51, -33, -17, -3, 9, 19? -h*2 + 21h - 71 What is the m'th term of 102, 203, 310, 423, 542, 667, 798? 3m2 + 92m + 7 What is the n'th term of -1, 31, 97, 197, 331, 499? 17n2 - 19n + 1 What is the m'th term of -17, -69, -163, -305, -501? -m*3 - 15m2 - 1 What is the o'th term of -109, -436, -987, -1768, -2785? -o3 - 106o2 - 2o What is the y'th term of 624, 631, 632, 621, 592, 539? -y*3 + 3y*2 + 5y + 617 What is the t'th term of -483, -966, -1451, -1938? -t*2 - 480t - 2 What is the b'th term of 6, 10, 14, 18, 22, 26? 4b + 2 What is the b'th term of -181, -704, -1579, -2812, -4409, -6376, -8719? -b3 - 170b*2 - 6b - 4 What is the i'th term of 10, 8, 4, -2? -i2 + i + 10 What is the g'th term of 1305, 2569, 3831, 5091, 6349, 7605? -g2 + 1267g + 39 What is the g'th term of -22, -35, -44, -49, -50, -47, -40? 2g*2 - 19g - 5 What is the x'th term of 92, 188, 284? 96x - 4 What is the p'th term of 28, 97, 214, 385, 616, 913, 1282, 1729? p3 + 18p*2 + 8p + 1 What is the y'th term of -518, -513, -508? 5y - 523 What is the y'th term of -83, -74, -77, -98, -143, -218, -329, -482? -y3 + 16y - 98 What is the x'th term of 76, 100, 162, 280, 472, 756, 1150? 3x3 + x2 + 72 What is the b'th term of -11724, -23452, -35180, -46908, -58636, -70364? -11728b + 4 What is the o'th term of 10699, 10700, 10701? o + 10698 What is the f'th term of 172, 389, 606, 823? 217f - 45 What is the u'th term of -887, -892, -899, -908, -919? -u2 - 2u - 884 What is the d'th term of 439, 876, 1313, 1750, 2187? 437d + 2 What is the f'th term of -4, -60, -122, -190, -264, -344, -430? -3f*2 - 47f + 46 What is the j'th term of 113, 236, 361, 488? j*2 + 120j - 8 What is the z'th term of 342, 686, 1030, 1374? 344z - 2 What is the a'th term of 659, 656, 653? -3a + 662 What is the x'th term of 150, 144, 138? -6x + 156 What is the r'th term of -125, -271, -429, -605, -805, -1035? -r3 - 139r + 15 What is the x'th term of 97, 178, 259, 340, 421? 81x + 16 What is the a'th term of 360, 637, 916, 1197, 1480, 1765? a2 + 274a + 85 What is the u'th term of 36, 25, -6, -69, -176, -339, -570? -2u3 + 2u*2 - 3u + 39 What is the b'th term of 426, 819, 1212, 1605, 1998, 2391? 393b + 33 What is the c'th term of 450, 924, 1398, 1872, 2346? 474c - 24 What is the s'th term of 195, 203, 225, 267, 335? s3 + s2 - 2s + 195 What is the u'th term of 213, 427, 641? 214u - 1 What is the z'th term of -27, -58, -89, -120, -151? -31z + 4 What is the f'th term of 107, 426, 959, 1706, 2667, 3842? 107f*2 - 2f + 2 What is the p'th term of -14239, -28477, -42715, -56953, -71191? -14238p - 1 What is the o'th term of 39, 85, 131? 46o - 7 What is the m'th term	{ "pile_set_name": "DM Mathematics" }
+ 921. Let f be w(6). What is fn(v) - 6s(v)? 15v3 Let t(p) = p2 + 6p - 10. Let b(u) = 3u2 + 5u - 9. Calculate -6b(v) + 5t(v). -13v2 + 4 Let d(b) = -13b - 3. Let a(y) = -13y - 4. Give -5a(s) + 4d(s). 13s + 8 Let l be 2/4 - 552/(-48). Let x(s) = 11s - s2 + 0s*2 - ls. Let r = 26 + -8. Let d(m) = 15m2 + 18m. Calculate rx(f) + d(f). -3f*2 Let k(j) = 2j*2 + 61j - 5. Let v(o) = o*2 + 65o - 6. Calculate -6k(s) + 5v(s). -7s2 - 41s Suppose 2c - 335 = 2m - 347, 3m = 2c + 16. Let u(f) = -3f - 3 + 1 + f. Let z(x) = x2 - 7x - 7. What is cz(o) + 7u(o)? -2o2 Let w(a) = a2 - 1. Let m(q) = 7q*2 - 4. Let z be (((-4)/(-6))/1)/(75/450). Calculate zw(g) - m(g). -3g2 Let q(u) = -2u*3 + 3u - 147. Let f(x) = -2x3 + 4x - 148. Give 3f(z) - 4q(z). 2z3 + 144 Let y(a) be the first derivative of -5a*4/2 - 2a*3 - 3a*2 - 109. Let w(b) = -10b*3 - 5b*2 - 5b. What is -6w(t) + 5y(t)? 10t3 Let i(q) = 2 - 25q + 5q - 3 + 0. Let a(p) = 61p + 4. Calculate -2a(t) - 7i(t). 18t - 1 Let i(t) be the third derivative of -t4/24 + t2 + 6t. Let s(r) = 3r2 + 15r - 3. What is 15i(n) + s(n)? 3n*2 - 3 Let b(j) = 1395j*2 - 45j + 45. Let f(w) = -127w2 + 4w - 4. Calculate -4b(t) - 45f(t). 135t2 Suppose 5 + 9 = 7j. Let t(l) = -25l + 55. Let p(x) = -8x + 18. Let g(b) = jt(b) - 7p(b). Let i(h) = -h + 3. Calculate -3g(v) - 16i(v). -2v Let s(r) = r + 2. Let w(z) = -9z + 15. What is -6s(k) - w(k)? 3k - 27 Let z(x) = -2x + 4. Let c(j) = -16j + 13. Determine 2c(u) - 7z(u). -18u - 2 Let l(s) = -15s + 63. Let j(n) = 8n - 35. Let a(i) = 7j(i) + 4l(i). Let y(g) = g - 2. Calculate 2a(k) + 7y(k). -k Let i(z) = z + 2. Let k(r) = 3 + 3 + 0 - 4 - 3. Calculate i(p) + 5k(p). p - 3 Let n(h) = -8h2 + 5h. Let i(p) = 5p2 - 3p*2 + 8p - 9p2 - 4p. Give 6i(q) - 5n(q). -2q2 - q Let a(h) = 6h*3 + 2h*2 + 3h. Let b(k) = k3 - k2 - k. What is -a(y) - 4b(y)? -10y*3 + 2y*2 + y Let q(i) = -13i*2 + 15i - 3. Let z(b) = -12b2 + 13b + 1. What is -5q(l) + 6z(l)? -7l2 + 3l + 21 Let y(q) be the third derivative of 5q4/8 + 11q3/6 + q2 + 143. Let f(j) = 5j + 4. Determine 17f(z) - 6y(z). -5z + 2 Let o(u) be the first derivative of 2u2 - u - 39. Let p(l) = 8l - 3. Determine 5o(h) - 2p(h). 4h + 1 Let n(t) = -7t*2 + 2t + 5. Let d = -10 - -14. Let y(z) = 4 - 2z + 0z + dz + 0z - 6z2. Let b = 119 + -125. Determine by(h) + 5n(h). h2 - 2h + 1 Let l(w) = -15w + 198. Let z(r) = -8r + 98. Determine 6l(x) - 11z(x). -2x + 110 Let t(x) = 1. Suppose 9 = 3w - 9. Let b(z) = -5z - 3. What is wt(m) + 2b(m)? -10m Let x(b) be the first derivative of b*2/2 + 6b - 145. Let c(h) = -h - 5. What is 2c(i) + 3x(i)? i + 8 Let a(m) = -21m - 10. Let u(q) = 8q + 3. What is -2a(y) - 7u(y)? -14y - 1 Let h(j) = 1. Let v(t) = 266t - 6. What is 4h(b) + v(b)? 266b - 2 Let i(s) = -s*2 - 3s. Let g = 500 - 504. Suppose -4a = 3 - 15. Let d(z) = -z2 - 4z. Calculate ad(x) + gi(x). x2 Let h(i) = i2 - 10i - 43. Let x be h(-3). Let d(z) = 6z*3 + 4z*2 - 4z. Let m(v) = -6v3 - 3v*2 + 3v. What is xm(n) - 3d(n)? 6n3 Let l(b) = 21b*2 + 25b. Let t(u) = -14u2 - 17u. Give -5l(h) - 7t(h). -7h2 - 6h Let c be (0 - 1)(8 - 11). Let u be 4 + ((-3)/(-1))/3. Let y(w) = 3 - u - 1 + w. Let r(q) = -2q + 4. What is cr(s) + 4y(s)? -2s Let h(m) = -7m*3 + 15m*2 + 11m + 23. Let p(b) = -b3 - b2 + b + 3. Let g(w) = h(w) - 6p(w). Let v(k) = k3 - 11k*2 - 3k - 3. Give -3g(j) - 5v(j). -2j3 - 8j*2 Let a(y) = -y. Let h(t) = 5t + 9. Let n be h(-5). Let d = 18 + n. Let c(w) = -d - 4 + 4 + 20w - 8w. Determine 10a(j) + c(j). 2j - 2 Let w(c) = 2c - 1. Suppose -11 - 17 = 4z. Let u = z - -10. Let d(h) = -3h + 1. Let x be (-2)/(-3)90/12. Determine ud(r) + xw(r). r - 2 Let r(u) = u*2 - 2u - 2. Let i(n) = -n*3 + 9n*2 - 19n + 2. Let x be i(6). Let t(h) = h*2. Give xt(v) + r(v). -3v2 - 2v - 2 Let q(m) = -7m2 + 65m + 1. Let i(j) = 6j2 - 51j. Give 5i(y) + 4q(y). 2y2 + 5y + 4 Let m(s) = -8s2 + s + 7. Let b(u) = -u2 + 1. Let f(j) = 22j*2 - 3j - 19. Let k(l) = b(l) - f(l). Determine -6k(x) + 17m(x). 2x2 - x - 1 Let c(j) = 12j*2 - 8j - 6. Let m(s) = 11s2 - 6s - 5. Calculate 2c(o) - 3m(o). -9o2 + 2o + 3 Let o(k) = -5k3 + 4k*2 + 4k. Let u(c) = 0c - 68c*3 + 58c*3 + 9c3 + c2 + 0c. Determine o(g) - 4u(g). -g*3 + 4g Let r(j) = -4j3 - 3j*2 - 4j + 3. Let d(h) = 320 + 7h2 - 171 - 156 + 9h*3 + 7h. Give 3d(n) + 7r(n). -n*3 - 7n Let n(j) = -9j3 - 13j*2 + 11j - 13. Let l(i) = 4i3 + 6i*2 - 6i + 6. Determine -13l(v) - 6n(v). 2v3 + 12v Let r(z) = -2 + 35z3 + 2z*2 + z - 44z*3 + 10z3. Let p(o) = -o3 - 3o2 - 2o + 3. What is -4p(m) - 6r(m)? -2m3 + 2m Let l(i) = 3i - 4i*2 - 3i - 1 - 7i. Let u(t) = -t2 - 2t. Suppose -5d + 4d = -5a + 3, -a + 30 = 4d. Determine du(w) - 2l(w). w*2 + 2 Let x(c) = -c + 2 - 6 + 9 - 5. Suppose 3i = -i + 8. Let u(g) = -6g2 - 5g - 1. Let n(p) = p*2 + p. Let l(m) = -14n(m) - 2u(m). What is ix(f) - l(f)? 2f2 + 2f - 2 Let p(f) = -29f - 57. Let s(j) = 44j + 87. Give -7p(v) - 5s(v). -17v - 36 Let u(a) = 6a - 3. Let c(w) = -2w + 1. Let q(d) = 7c(d) + 2u(d). Let l(j) = -4j + 1. Determine -2l(k) + 5q(k). -2k + 3 Let v(f) = -6f - 29. Let t(g) = -2g - 1. What is 4t(x) - v(x)? -2x + 25 Let l(t) = -109t*2 - 16t - 3. Let v(g) = -35g2 - 5g - 1. Calculate 2l(h) - 7v(h). 27h2 + 3h + 1 Let d(y) = 5y + 29. Let h(q) = 17q + 294. Let x be h(-17). Let g(n) = -3n - 19. Determine xd(t) + 8g(t). t - 7 Let x(l) = -11l*2 - 96l + 2. Let u(t) = -4t2 + t + 1. What is -2u(q) + x(q)? -3q2 - 98q Let r(h) = 3h2 + 3h + 3. Let o(v) = -5v2 - 7v - 7. Let g = 775 - 779. Determine go(p) - 9r(p). -7p2 + p + 1 Let o(f) = -53156f*3 + 2329f*2 - 2329. Let g(t) = 137t*3 - 6t*2 + 6. What is -2329g(y) - 6o(y)? -137y3 Let q(z) = z + 7. Let n(m) = -m3 + 3m2 + 39m + 9. Let w be n(8). Let k(v) = -v + 1. Determine wq(h) - 6k(h). 7h + 1 Let b(w) = -14w - 13. Let m(j) = -7j - 35. Let k(q) = 4q + 16. Let x(c) = 7k(c) + 3m(c). Determine -6b(f) - 11x(f). 7f + 1 Let h(j) = -j2 - j - 1. Let u(t) = -4t*2 - 3t - 3. Let i = -36 + 37. Let g be (i/(-2))/(4/8). Let y be 2 - 1 - (-3 + 1). Give gu(s) + yh(s). s2 Let c(o) = -o2 + o. Let m be (6/4)/((-325)/50 - -5). Let d(t) = 2t3 - 4t*2 + 6t - 4. What is md(f) + 4c(f)? -2f3 - 2f + 4 Let m(b) = -b*2 - b + 1. Let u(g) = 5g*2 + 2g - 3. Let y(v) = -4m(v) - u(v). Let p(f) = -2f*2 + 2f - 1. What is 2p(z) - 3y(z)? -z*2 - 2z + 1 Let u(k) = 1. Let i = -609 + 627. Let m(a) = 5a + 9. What is iu(g) - 2m(g)? -10g Suppose -3 = a - 4t, 0 = -a - a + 5t + 9. Let h(n) = 11n - 11n + an + 15n. Let c(k) = -13k. Calculate 12c(s) + 5h(s). 4s Let y(c) be the third derivative of 0c + 6c*2 + 0 + 5/24c*4 - 1/3c*3. Let b(q) = -6q + 3q + 2q. Give -3b(o) - y(o). -2o + 2 Let r(z) = -5z3 + 5z*2 + 5z. Let p(j) = 6j3 - 6j*2 - 7j. Determine -2p(y) - 3r(y). 3y3 - 3y*2 - y Let z(s) = 5s + 1. Let v(b) = -2b. Let h(i) = 3v(i) + z(i). Let f(m) = 4m + 3. Give f(q) - h(q). 5q + 2 Let g(r) = 2r - 2. Let x(z) = z + 1. Let q(h) = -6h - 4. Let b(o) = -3q(o) - 15x(o). Let j(y) = 3b(y) - 5g(y). Let a(p) = 9p - 4. Give -a(v) - 5j(v). -4v - 1 Let f(q) = -21q - 5. Let m be -3 - 4/((-28)/21) - 4. Let u(h) = 10h + 2. Calculate mf(w) - 10u(w). -16w Let p(t) = 33t3 + 17t + 17. Let s(f) be the third derivative of -f6/30 - f4/12 - f*3/3 + 112f*2 - 2f. Determine 6p(x) + 51s(x). -6x3 Let y(q) = 43q*2 - 4q. Let v(c) = -c*2 + c. Determine 3v(b) + y(b). 40b2 - b Let l(v) = v - 10. Let g be l(12). Let m(n) = -4n + n - gn + 2n. Let r(f) = f*2 + f. Suppose w + 6 + 8 = 4t, 2w + 4t - 20 = 0. Calculate wr(y) + m(y). 2y2 - y Let z(d) be the first derivative of -d2/2 + 78. Let n(a) = a*2 + 5a. Let g be n(-2). Let w(c) = 2c + 1 - 3 + 3. What is gz(i) - 2w(i)? 2i - 2 Let v(k) = k*2 + k - 1. Let t(s) = 60s*2 + 55s	{ "pile_set_name": "DM Mathematics" }
a. Let w(x) = x - 3. Let i be w(5). Let b be s(i). Calculate the remainder when ((-2)/(-4))/((-1)/b) is divided by 5. 3 Suppose 4b - 3r - 86 = 2r, -5b - 5r = -85. Calculate the remainder when b is divided by 16. 3 Suppose -4s = -3k + 197, -6k + 5k = -5s - 62. Suppose -4y = -r - 2r + 29, -2y = -5r + k. What is the remainder when 44 is divided by r? 14 Let o(b) = 5b3 + b2 - b + 1. Let a be o(1). Let v(w) = 2w. What is the remainder when 22 is divided by v(a)? 10 Suppose 2d - 3d = -12. Let j = 9 + -6. Suppose -jh + 35 = 2h. What is the remainder when d is divided by h? 5 Let w = 23 - -8. Calculate the remainder when w is divided by 7. 3 Suppose 2c = -10, -7l + 180 = -2l - 4c. Let k = -30 + 48. What is the remainder when l is divided by k? 14 Let y be 22/(-18) + 4/18. Let u be ((-42)/2)/3y. Calculate the remainder when 50 is divided by (-121)/(-7) + (-2)/u. 16 Let w(b) = -7b - 6. Let m(n) = 8n + 7. Let u(a) = -4m(a) - 5w(a). Let t = 2 - -1. What is the remainder when 31 is divided by u(t)? 9 Suppose l = 10 + 4. Suppose -12 + 3 = -3f. Suppose 0 = -0h - fh + 15. Calculate the remainder when l is divided by h. 4 Suppose 3z = 5h - 0z - 70, 4h + 2z = 56. Let f(u) = u2 - 3u + 8. What is the remainder when f(6) is divided by h? 12 Let y = 34 - 22. Suppose 66 = 5b - 2b. Calculate the remainder when b is divided by y. 10 Let t(f) = 8f - 3. Suppose 5m = 6 + 4. Suppose -mr - 15 = -5r. What is the remainder when t(r) is divided by 13? 11 Let u = -17 - -22. What is the remainder when 7 is divided by u? 2 Let c = -2 + 3. Suppose -c = n + 4v + 2, 4v = -4n. Let y(o) = -o3 + 13o*2 + 12o + 30. What is the remainder when y(14) is divided by n? 0 Let t = 115 - -15. What is the remainder when t is divided by 33? 31 Suppose 70 = 5l - 15. Calculate the remainder when l is divided by 7. 3 Suppose 2r - 70 = -5r. What is the remainder when 17 is divided by r? 7 What is the remainder when 2 + (-3)/(-6)106 is divided by (-1)/(-1(-3)/(-42))? 13 Let m(i) be the third derivative of 7i4/12 - i3/6 + 2i2. Let l be ((-3)/(-2))/((-6)/(-16)). Calculate the remainder when m(l) is divided by 19. 17 Let a = -5 + 46. What is the remainder when a is divided by 24/614/4? 13 Suppose 8f - 4f - 12 = 0. What is the remainder when f is divided by 1? 0 Let s = -29 + 43. Suppose 0 = -3g + 9 + 9. Calculate the remainder when g is divided by (-20)/(-35)s/4. 0 Let r = -7 - -32. What is the remainder when r is divided by 9? 7 Let m be 2/(-2) + -1 + -12. Let t = m + 20. Suppose -4f + 28 = 3f. What is the remainder when t is divided by f? 2 Let d(v) = -v*2 - 24v + 8. Let w be d(-14). Suppose 3x + w = 7x. Calculate the remainder when x is divided by -12(-13)/2. 11 Suppose 4u - 4 - 156 = 0. Calculate the remainder when 116 is divided by u. 36 Let z = -93 + 108. Calculate the remainder when z is divided by (-16)/(-2 - 0)1. 7 Let m = 28 + -14. Suppose -70 = 3r - 4r. What is the remainder when m is divided by (-18)/24 + r/8? 6 Let m(j) = -j*2 + 3j + 4. Let y be m(5). Calculate the remainder when (-2)/y + 16/24 is divided by 1. 0 Let t = 1 + 1. Suppose -3a + 2a - 20 = tn, -5a - 40 = -5n. What is the remainder when (4/a)/((-2)/90) is divided by 8? 7 Let b be ((-10)/3)/((-2)/66). Suppose -g = 4g - b. What is the remainder when g is divided by 240/84/10? 10 Let n = 344 + -312. Let x = 10 + 1. Calculate the remainder when n is divided by x. 10 Let w = 27 + -13. What is the remainder when 41 is divided by w? 13 Let v be (3/(-6))/((-2)/20). Suppose 0 = 5u + v - 0. What is the remainder when u/(-5) - (-78)/10 is divided by 3? 2 Let x(p) = 7p2 - 4p + 9. What is the remainder when x(2) is divided by 5? 4 Suppose -5z - m + 110 = 0, 0 = -z + m - 0m + 28. Suppose 0 = 3g - 31 - 8. Calculate the remainder when z is divided by g. 10 Let g = 9 - 3. Suppose -5h + 12 = -h. Suppose hk - 2k - 16 = 0. Calculate the remainder when k is divided by g. 4 Suppose -5h + 5s + 95 = 0, 2h + s - 44 = -3s. What is the remainder when 55 is divided by h? 15 Suppose -12y + 9y + 147 = 0. Calculate the remainder when y is divided by 10. 9 Calculate the remainder when 61 is divided by ((-48)/(-9))/((-7)/(-42)). 29 Suppose 0x + 5x - 115 = 0. What is the remainder when 89 is divided by x? 20 Let t be (1/(-1))/(-1) + 5. Suppose -2s = 2x - s - 21, 2x - 15 = 5s. Calculate the remainder when x is divided by t + (1 + 3)/(-2). 2 Calculate the remainder when 11 is divided by (2/(-1))/(2/(-7)). 4 Let z(s) = -s*3 - 3s*2 + 9s + 4. What is the remainder when z(-6) is divided by 20? 18 Suppose 13 = -4v + 3r, -4v - 3r + 3 = -2. Calculate the remainder when 8 - 9 - 42/v is divided by 22. 19 Suppose -5n + 80 = -n. Suppose 0 = m - n - 11. What is the remainder when m is divided by 16? 15 Suppose -131p = -126p - 115. Calculate the remainder when 108 is divided by p. 16 Let a = 61 - 40. What is the remainder when 60 is divided by a? 18 Let s = 26 + -43. Let y = 12 + s. Let u = y - -16. Calculate the remainder when 32 is divided by u. 10 Let o(y) be the second derivative of y5/10 - y4/4 - y3/3 + 2y*2 + 2y. Let x = 10 + -1. What is the remainder when o(3) is divided by x? 7 Let b = 2388 + -1410. Calculate the remainder when (-2)/(-5) - b/(-30) is divided by 9. 6 Let v = 41 - 19. Calculate the remainder when v is divided by 7. 1 Let v = 2 - -4. Let d(y) = -y*3 + 8y*2 - 6y - 7. Suppose -3 + 19 = 2w. What is the remainder when d(v) is divided by w? 5 Let z be 3(-4)/(-12) - -12. Let m = -1 + z. What is the remainder when 34 is divided by m? 10 Suppose v + 3j = -3v + 134, 4v - 3j - 122 = 0. Let c = -16 + v. Let p(d) = d*2 + 2d - 1. Calculate the remainder when p(6) is divided by c. 15 Let i(r) = -12r - 5. What is the remainder when i(-2) is divided by 12? 7 Suppose 0 = 5v - 4a - 76 - 36, 8 = 4a. Calculate the remainder when 47 is divided by v. 23 Suppose h + h - 68 = 0. Suppose 166 = 4f + h. Let c(m) = 3m - 13. What is the remainder when f is divided by c(10)? 16 Let d be -1(-1 + 0)-3. Calculate the remainder when 19 is divided by -22((-21)/6 - d). 8 Let m = 38 + -17. Let u = -11 + 15. Let h = u + m. What is the remainder when h is divided by 7? 4 Suppose 0 = 3o - 8o. Suppose 5k = -2w + 12 + 10, -4k = o. Calculate the remainder when ((-19)/3 + 1)-6 is divided by w. 10 Suppose 4f - 20 = -4t, -4t + 20 = 2f + 2. Suppose m = -tm. Suppose -x + g + 23 = m, -x - 5g + 30 = 7. What is the remainder when 68 is divided by x? 22 Let x(z) = 2z*2 + 5z + 18. Let u(v) = -v*2 - 3v - 9. Let j(a) = -9u(a) - 4x(a). Calculate the remainder when j(-8) is divided by 2/5 - 129/(-15). 8 Let c(n) = n*3 - 9n*2 - 9n - 8. Let u be c(10). Suppose 34 = -2r + ug + 108, -3r = -5g - 101. What is the remainder when r is divided by 11? 9 Let x(m) = m*3 - 2m*2 - 3m + 3. Let y = -9 - -12. Let f be x(y). Suppose -15 = -3i, -34 = -fa + 3i + i. What is the remainder when 53 is divided by a? 17 Let n(i) = -i2 + 12i + 12. What is the remainder when n(9) is divided by 21? 18 Let o(z) = -1. Let u(d) = -5d + 2. Let g(c) = 6o(c) - u(c). What is the remainder when g(6) is divided by 12? 10 What is the remainder when 1/(-6) + 875/30 is divided by 8? 5 Suppose -604 + 44 = -35j. What is the remainder when ((-78)/(-7))/((-2)/(-14)) is divided by j? 14 Suppose 4j - 9 = 23. Let k(o) = -13o - 6. Let r be k(-7). Suppose 3f - 18 + 3 = 0, -5f - r = -5z. Calculate the remainder when z is divided by j. 6 Let b(j) = -j*3 - 6j*2 - 6j - 7. Calculate the remainder when 84 is divided by b(-6). 26 Let w = 29 + -20. Calculate the remainder when 34/((2 + -3)-2) is divided by w. 8 Let a(q) = 2q3 + q2 - q + 1. Suppose 2p + 3l = -33, 8 = 5l + 33. Let x be (-2)/p - (-32)/18. Calculate the remainder when a(x) is divided by 7. 5 What is the remainder when ((-54)/4)/((-18)/120) is divided by (-92)/(-10)(-10)/(-4)? 21 Let b = 19 + -13. Suppose bt - 2t = 16. What is the remainder when 10/(-25) + 114/10 is divided by t? 3 Let f(r) = -r*3 - 16r*2 + 37r + 22. Suppose -5k + k = -260. Suppose -5m = 5b - k, 4m - 2b = -b + 62. What is the remainder when m is divided by f(-18)? 3 Suppose -4l + 204 = 4n, n + 3l - 6 - 37 =	{ "pile_set_name": "DM Mathematics" }
the form sk + uk*3 + v + tk*2 + wk*4 and give v. -4 Express (2t*3 - 5t*3 + 2t*3)(0t + 0t - 2t) + 11t*3 - 235t*4 + 16t*4 - 11t*3 in the form n + wt*2 + it*4 + ht*3 + ut and give w. 0 Rearrange -4a3 + 5a*3 + 3a*3 + (-5 + 3 + 4)(0a3 - a3 + 3a*3) + 7a3 - a3 - 7a3 to the form ya + na3 + oa*2 + b and give o. 0 Express 3n + 2 - 1 - 2 + (0 + 7 - 1)(6n + 0n - 5n) in the form in + z and give i. 9 Express ((-4 - 3 + 6)(-8n - 9n + 23n) - 4n + n + 4n)(-5n + 0n + 4n) in the form tn + q + ln2 and give l. 5 Express 2v*3 + 13 - 29v - 3v3 + 31v + 2v3 as rv*3 + hv*2 + gv + k and give r. 1 Express (-a + 3a + a)(2a + 3a - 2a)(-2 + a*2 + 2) as wa + pa2 + ma*3 + k + ra*4 and give m. 0 Express 0 - 3j4 + 0 - j3 + 2j4 + 6j as rj2 + lj*3 + fj + o + pj4 and give f. 6 Express -15s + 9s + 6s - 41s + 1 as d + ws and give w. -41 Rearrange -2o + 5o - 3o + 8o to the form po + t and give p. 8 Express -2t*2 - 15 - 3t3 + t3 - 2t + 8t*4 + 14 + 4t*2 as it*2 + st*3 + yt*4 + b + gt and give g. -2 Rearrange -9 + 3m - m3 + 0m*2 + 4 - 2m*2 + 4m*2 to b + zm*3 + cm*2 + nm and give n. 3 Rearrange r - 2r2 - 5r + 3r to the form vr*2 + sr + h and give v. -2 Rearrange -5m2 + 23m*2 + 7m - 7m to dm + s + am2 and give a. 18 Rearrange (6 - 8 + 2g + 4g)(-2g - 2g + 2g) to the form l + tg*2 + vg and give v. 4 Express (0x - x - 2x)(2x - 2x + 4x3) + x2 + 4x4 - 15x*4 + 29x*4 in the form hx*3 + wx + gx2 + kx*4 + v and give k. 6 Express 5i - 3i3 - 6i + 7i2 - 2i*3 + 2i*3 as ni*2 + fi + bi3 + o and give f. -1 Express 6n*2 + 3n*3 - 6n2 - 2 - n2 - 3n2 in the form bn*3 + sn + vn2 + t and give b. 3 Rearrange (0k4 + k4 + k*4)(33 - 11 - 10) to the form sk3 + c + ak + hk4 + pk*2 and give p. 0 Rearrange (-12 + 17 + 18)(-2 + 2 + 3g) to the form kg + n and give k. 69 Express -7i3 + 30 - 3i*3 - 33 in the form z + hi*2 + li + di3 and give z. -3 Express -b4 - 4b*4 + 12b*4 + (2b*4 + 4b - 4b)(-1 + 6 - 2) as ub + gb*3 + tb*4 + fb*2 + c and give t. 13 Express -2y*2 + 12 - 14y*2 - 2y*3 - 12 as py*3 + q + ny + dy2 and give p. -2 Rearrange -2u4 + u2 - 1 + 0u2 + 5u*4 + 0 to yu*3 + mu*4 + zu + ru2 + d and give r. 1 Express ((1 + 2 + 0)(-2 + 2 - 1) + 2 - 3 + 0)(23l - 23l - 6l*4) in the form ul*2 + zl*3 + dl*4 + h + rl and give d. 24 Rearrange -12r - 2r*2 + 9r + 7r to mr + w + xr2 and give x. -2 Express 2 + 7t2 - t2 - 3 - 2t2 in the form nt*2 + b + pt and give n. 4 Rearrange 4c2 - 2c2 - c2 + c*2 + 0c*2 - 6c*2 + (0c - 5c + 3c)(23 - 23 - 27c) to xc + dc*2 + u and give u. 0 Express (0h*2 + 0h*2 - 3h*2)(25h + 15h - 8h) in the form zh*3 + qh + fh2 + j and give q. 0 Rearrange (3z + 2z - 3z)(1 - 3 + 3)(1 + 1 + 0)(7 - 11 - 3) to az + w and give a. -28 Express 0a2 + 7a*2 - 2a - 3a2 + 8a*2 in the form ta + d + na2 and give d. 0 Express -20 - 109i + 56i + 52i as q + yi and give y. -1 Express (-2b*2 + 3b*2 - 2b*2)(17b + 25b - 7b) as ab + k + mb3 + db2 and give m. -35 Express (-2 + t3 + 2)(6 + 14 + 2t - 16) in the form ht3 + vt*2 + bt*4 + jt + m and give b. 2 Rearrange -k*2 - 3 - 2 + 3 + 6k*2 to the form g + lk*2 + dk and give g. -2 Rearrange 3 + 52r2 - 36r*2 - 3 to pr + br2 + c and give b. 16 Rearrange 4h*2 - 2h*3 + 2 - 172h - 9h4 + 172h to the form yh + jh*4 + u + ch*2 + mh*3 and give j. -9 Rearrange (0 + 5 + 1)(-k + 3k - k)(3 - 3 + 1)(-3k*2 + 2k*2 + 4k*2) to xk + h + zk3 + yk*2 and give y. 0 Express (9 + 38 - 13)(2z - 5z + z) in the form m + wz and give w. -68 Express -3h + 17h - 15h + 3h2 + 9h*3 in the form oh*3 + xh + q + wh2 and give x. -1 Express (2l - l + 11l)(2 - 2l - 2 - l + 0 + 0 - 3l + 5l - 4l + (1 - 1 + l)(-2 + 2 + 1) - l - 1 + 1) as ol + dl2 + w and give d. -60 Express -20d*3 + 1 - 1 + (-4d*3 - 4 + 4)(-2 + 1 + 0) as xd3 + zd + m + wd2 and give x. -16 Rearrange 5b*2 - 2b*2 - 2b*2 + (8 + 7 - 4)(-3b2 + 2b*2 + 0b*2) to k + db + sb2 and give k. 0 Express 43m*2 - 12m*2 + 18m*2 + 6m*2 in the form nm*2 + c + xm and give n. 55 Rearrange -9i3 + 11i3 - i2 + 2i - 3i to qi2 + oi*3 + fi + b and give f. -1 Rearrange -13w3 + 6w*4 + 6 - w + 15w*3 - 3w*4 to b + lw*3 + fw*4 + cw + nw2 and give c. -1 Express -7 + 6 + 1 + 4j in the form b + wj and give w. 4 Express 4h2 + h4 - 3 + 7 - 6 + 2h3 as dh*4 + th + ch2 + y + rh*3 and give d. 1 Rearrange -2t*2 + 4t*2 - 2t - 3t2 to ut*2 + a + kt and give u. -1 Rearrange (3f + 5f - 4f)(19f - 19f + 4f2) + (0 + 4 - 2)(-2f3 - f3 + f3) to o + pf*2 + yf*3 + cf and give o. 0 Express -s - 2s2 - 57 + 8s + 30 + 30 in the form ts2 + y + gs and give g. 7 Express 5 - 29u - 5 - u2 + 10u as n + mu + gu*2 and give m. -19 Express 4259b - 4259b + 19b*2 in the form qb*2 + mb + v and give q. 19 Rearrange -198 + 10p2 + 198 to up + w + yp2 and give y. 10 Rearrange 3o*2 + 155o*2 + 101o*2 - 52o*2 to the form u + wo + po2 and give p. 207 Express -48 + 48 - 6h*2 as ch + q + yh2 and give y. -6 Rearrange 1 - k - 1 + 35k to the form q + vk and give v. 34 Rearrange -9a - 8a + a3 - 2a*2 + 13a to ta2 + sa + d + xa3 and give s. -4 Express 3802l + 2 - 3802l - 4l*4 + 9l*2 + 3l*2 in the form fl + al3 + h + cl*2 + yl*4 and give c. 12 Express -265a*2 + 1 + 265a*2 - 2a*3 + 6a as la3 + na*2 + va + t and give l. -2 Rearrange 20c - 49c - 52c + 14c to vc + z and give v. -67 Express o2 - 15o*2 - 3o*2 - 10o*2 as uo*2 + z + co and give z. 0 Rearrange 7h3 + 8h*2 - 10h*2 + 2h - 4h3 to dh + lh3 + rh*2 + m and give r. -2 Rearrange 0b*4 + 0b4 - b4 + (3b3 - 3b*3 + 2b*3)(-6b + b + 0b) to v + tb + ub*3 + pb*2 + cb4 and give c. -11 Express 812 - i3 + 2i3 - 810 + 12i in the form ri2 + ci + y + hi3 and give y. 2 Rearrange (0 + 0 + b)(b - 5b + 3b) - 74b + 0 + 6b*2 + 1 + 75b to pb + mb*2 + k and give p. 1 Express -4n*4 - 2n*3 - 15n*2 + 3 + 17n*2 - 4 as f + zn*4 + gn + bn3 + cn*2 and give f. -1 Express 18p + 9p - 24p as q + yp and give y. 3 Rearrange -3d*2 - 22d*2 + 38 - 40 to id*2 + od + z and give z. -2 Rearrange (-6n - 8n*2 + 6n)(n - 12n + 0n) to yn*2 + g + dn + wn3 and give g. 0 Express 10o - 13o + 29o + 78o in the form xo + t and give x. 104 Rearrange (1 - 4 - 1)(7 - 4 - 4)(-7y + 8y - 22y) to r + gy and give g. -84 Express 9p + 18p - 5p in the form y + ip and give y. 0 Express 6i2 - 23 + 25 - 2i + 2i2 - i3 in the form ki*2 + s + zi*3 + yi and give y. -2 Rearrange 483 - 133g2 - 483 to mg + bg2 + l and give b. -133 Rearrange 1 + 15h - 16h - 1 to u + dh and give d. -1 Rearrange -24b2 - 2b - 2 - 22b2 + 54b*2 + (b - 2b - b)(-b + 2b - 3b) to j + kb + lb2 and give l. 12 Express (-2a + 2a + a)(-4a + 4a - 4a) + 10a*2 + 8a*2 - 19a*2 - a + 2 as u + qa*2 + ya and give y. -1 Rearrange -17 + 17 + 9i2 + (i2 + i2 + i2)(-2 + 5 - 2) - i + i - 2i2 to mi*2 + j + zi and give m. 10 Rearrange -39c2 + 27c*2 + 24c*2 to the form x + rc + uc2 and give u. 12 Express (12z + 1 + 17z - 32z)(5z - 4z - 3z) in the form tz + f + iz*2 and give t. -2 Express -4r*3 + 0r*3 + 4r*3 + 2r*2 + 5r*3 as sr + y + ar2 + cr*3 and give a. 2 Express -10m*3 + 4m*4 - 1 - 3m4 - m2 + 11m3 in the form wm*2 + pm + o + rm3 + cm*4 and give w. -1 Express (7 - 2 + 2)(2 + 3p - 2) in the form z + vp and give v. 21 Express ((-m + 0m + 0m)(m + 5m - 4m) + (-3m + 2m + 2m)(3m - 3m - m))(-3m + 3m + 3m)(-3 + 1 + 7) as zm + i + dm*2 + sm*3 and give s. -45 Rearrange 33d - 2d3 + 6d*3 - 24d*3 - 35d to md + h + ud*2 + sd*3 and give m. -2 Express -c - 2c - 8c in the form sc + x and give s.	{ "pile_set_name": "DM Mathematics" }
-20 Let i(g) = -11g3 - 978g*2 + 1087g - 185. Calculate i(-90). -815 Let t(a) = 16878a - 50152. Calculate t(3). 482 Let h(t) = -12t*2 - 13t + 1397. Calculate h(-10). 327 Let y(u) = 4925u - 9891. Calculate y(2). -41 Let m(y) = 3y*2 + 418y - 169144. Give m(-317). -183 Let s(c) = 7c2 + 1032c - 2090. What is s(2)? 2 Let c(f) = -2f2 + 340f + 2077. Calculate c(173). 1039 Let f(w) = 2w3 + 517w*2 - 2372w - 1250. Give f(-263). 65 Let k(h) = -1479h - 20729. Determine k(-14). -23 Let b(h) = 3h*2 + 2024h + 15999. Give b(-8). -1 Let x(j) = -1344j - 12093. What is x(-9)? 3 Let m(c) = c2 - 80c - 1091. Calculate m(87). -482 Let h(b) = -b*2 + 103b + 11628. What is h(-68)? 0 Let b(z) = -71z2 + 2474z - 14876. Calculate b(6). -2588 Let d(u) = u*3 - 2387u*2 - 21751u - 1683. Determine d(-9). 0 Let q(h) = -9926h2 + 387081h + 1283. Determine q(39). -4 Let l(v) = -6282v + 62714. Give l(10). -106 Let n(z) = z3 - 39z*2 - 496z - 1365. Give n(-6). -9 Let c(u) = -u*2 - 425u + 2587. Give c(6). 1 Let z(w) = 15w2 + 2650w - 93007. Give z(30). -7 Let o(y) = 41982y + 2267023. Calculate o(-54). -5 Let t(d) = 718d - 10525. Give t(15). 245 Let p(l) = l*2 + 11l - 468. What is p(31)? 834 Let o(a) = 6521a - 41450. Give o(6). -2324 Let g(k) = 76k - 6310. Determine g(73). -762 Let p(a) = -75a - 6609. What is p(-84)? -309 Let h(s) = 15876s + 32382. Calculate h(-2). 630 Let p(z) = -3z2 - 44z + 56. What is p(17)? -1559 Let p(s) = 2s3 + 20s*2 - 4s + 3467. What is p(0)? 3467 Let g(q) = -q*2 + 171q - 6743. What is g(61)? -33 Let v(j) = j*2 - 182j - 2831. Calculate v(-16). 337 Let s(c) = -182c2 + 12349c - 37039. Give s(3). -1630 Let q(s) = -3s3 + 180s*2 - 7s + 915. Calculate q(60). 495 Let q(d) = 1153d + 82842. What is q(-72)? -174 Let x(n) = -34n*2 + 3893n + 9936. What is x(117)? -9 Let v(l) = 234l + 19998. Determine v(-95). -2232 Let k(p) = p3 + 11p*2 + p - 322. What is k(0)? -322 Let b(v) = -17923v + 179220. Determine b(10). -10 Let v(o) = o*3 - 63o*2 + 703o - 127. Determine v(49). 706 Let i(r) = r*2 - 28980r + 86927. Give i(3). -4 Let w(l) = -1333l + 75844. Calculate w(57). -137 Let y(n) = -108n*2 + 156n - 9. Determine y(1). 39 Let o(v) = 20v3 + 115v*2 + 12v + 35. What is o(-6)? -217 Let r(f) = -12f3 - 12f*2 + 44f + 45. Determine r(-2). 5 Let x(m) = 14m2 + 564m + 5028. Calculate x(-27). 6 Let f(y) = -357059y - 2142348. Determine f(-6). 6 Let p(k) = -41k*2 - 4k + 343. Determine p(6). -1157 Let b(f) = 4389f - 100857. Determine b(23). 90 Let x(c) = c3 + 350c*2 - 24595c + 2044. Calculate x(-410). -6 Let n(y) = 106y + 4964. Determine n(-58). -1184 Let v(z) = 5878z + 1496. Calculate v(0). 1496 Let o(v) = 2318v - 21079. What is o(9)? -217 Let a(i) = 21i*2 + 1875i + 7522. Calculate a(-85). -128 Let t(c) = -c*3 - 13c*2 + 724c + 12866. Give t(-18). 1454 Let b(f) = -7679f - 1512744. Determine b(-197). 19 Let c(w) = w3 - 69w*2 - 977w + 404. What is c(81)? -1 Let j(k) = -4031k - 64724. Determine j(-16). -228 Let s(y) = -y3 - 237y*2 - 528y - 13638. Give s(-235). -8 Let n(p) = 123p + 11696. Give n(-91). 503 Let h(y) = 6y*2 - 7658y + 187696. Give h(25). -4 Let h(j) = -44387j - 1154091. Give h(-26). -29 Let q(m) = -4m*3 + 26m*2 + 116m - 802. Give q(8). -258 Let s(i) = 4062i + 1112972. Determine s(-274). -16 Let y(n) = 2425n + 657177. Calculate y(-271). 2 Let p(l) = 26l3 - 95l*2 + 249l - 1151. Determine p(4). -11 Let v(y) = -163y2 - 17440y + 348. What is v(-107)? 241 Let j(t) = -23t - 7574. Calculate j(-332). 62 Let r(q) = q2 + 86q - 43. What is r(18)? 1829 Let p(i) = 74i + 11006. Give p(-130). 1386 Let y(r) = 358r - 32824. What is y(92)? 112 Let z(h) = h*3 - 9h*2 - 106h - 58. Calculate z(16). 38 Let f(x) = 3x2 - 74x - 3594. Calculate f(49). -17 Let k(y) = 6177y + 49410. Calculate k(-8). -6 Let f(x) = 491x*2 + 23564x - 177. Determine f(-48). 15 Let h(r) = -5r2 - 655r + 7002. Give h(10). -48 Let m(z) = -5z2 - 1719z + 22135. Calculate m(13). -1057 Let a(t) = -1718t2 + 6840t + 6841. What is a(-1)? -1717 Let d(g) = 1739g - 12392. Give d(7). -219 Let j(s) = 31s*2 + 1327s - 1593. Calculate j(-44). 35 Let n(t) = -42544t - 85091. Determine n(-2). -3 Let r(t) = -2t*3 + 56t*2 + 475t + 70. Determine r(34). 2348 Let u(w) = -w*2 + 172w + 851. Determine u(-5). -34 Let f(u) = 3u2 + 591u - 3268. Determine f(5). -238 Let h(s) = -2s3 + 303s*2 - 148s - 2568. What is h(151)? -2115 Let w(m) = -2m2 - 26m + 3095. Determine w(27). 935 Let a(p) = -622p + 27343. Determine a(45). -647 Let u(f) = -516f + 23. Give u(0). 23 Let v(k) = 6k3 + 2311k*2 + 382k - 1348. Calculate v(-385). -193 Let r(j) = 2j3 + 48j*2 + 111j - 2323. What is r(-16)? -3 Let u(d) = -6d2 + 67d + 224. What is u(16)? -240 Let k(q) = 219q + 56245. Calculate k(-251). 1276 Let a(p) = -p3 + 98p*2 - 190p - 437. Give a(96). -245 Let y(k) = -16k3 - 9k*2 + 243k + 728. Give y(-3). 350 Let z(k) = -9787k - 48938. What is z(-5)? -3 Let a(i) = i2 + 128i + 3805. Determine a(-99). 934 Let s(r) = 38595r - 617544. Calculate s(16). -24 Let c(h) = 4h*3 + 310h*2 - 10762h + 1. Determine c(26). 53 Let g(t) = 25t2 - 3550t + 7112. Determine g(2). 112 Let x(o) = -8o3 - o2 - 22o - 69. What is x(-3)? 204 Let l(d) = -111d3 - 316d*2 + 9d + 78. What is l(-3)? 204 Let l(r) = -r*3 - 46r*2 + 8r - 1904. What is l(-47)? -71 Let k(g) = g*2 + 45g - 1019. Determine k(21). 367 Let c(p) = -2p3 + 104p*2 - 305p + 16081. Determine c(52). 221 Let x(k) = -4k3 - 148k*2 - 1055k + 284. Calculate x(-10). 34 Let b(i) = -3i2 - 358i - 1468. Determine b(-116). -308 Let b(j) = -j*3 + 35j*2 - 77j - 1048. Give b(32). -440 Let p(s) = 12s2 + 975s + 23795. Determine p(-25). 6920 Let p(v) = v*3 + 69v*2 - 716v - 22879. Calculate p(-15). 11 Let w(k) = -47k - 1587. What is w(-6)? -1305 Let d(l) = 369l*2 + 4987l + 4986. What is d(-1)? 368 Let t(g) = 2g2 - 52g + 166. Calculate t(34). 710 Let r(t) = 113209t - 5094404. Give r(45). 1 Let v(o) = -o3 - 254o*2 - 248o + 1100. Calculate v(-253). -165 Let g(x) = -428x - 1433. Give g(0). -1433 Let n(z) = -z2 - 21230z - 5. Give n(0). -5 Let v(d) = -1608d - 5312. Calculate v(-4). 1120 Let a(i) = 268i + 6605. Calculate a(-26). -363 Let j(a) = -21a2 - 1743a + 3558. Give j(2). -12 Let u(r) = -2r2 + 3r - 277. Calculate u(-16). -837 Let k(a) = a*3 + 15a*2 - 322a - 5528. Give k(-16). -632 Let y(p) = 592p - 5423. Determine y(10). 497 Let y(l) = 23l*2 - 19411l - 19410. Determine y(-1). 24 Let t(d) = 107612d + 3228262. Give t(-30). -98 Let l(g) = 49564g + 4510315. What is l(-91)? -9 Let v(p) = -4p2 - 584p - 18522. What is v(-51)? 858 Let c(m) = m*3 + 224m*2 + 874m - 1819. What is c(-220)? -499 Let d(g) = -2g3 - 87g*2 - 113g + 322. Calculate d(-42). -224 Let f(x) = 2x3 + 316x*2 - 3880x + 20. Determine f(11). -1762 Let q(v) = -27875v - 250885. Give q(-9). -10 Let i(w) = w3 - 244w*2 + 268w - 6073. Calculate i(243). 2 Let s(y) = y*3 + 147y*2 + 2418y - 280. Give s(-19). -14 Let c(h) = 2h3 - 80h*2 + 268h + 2833. Give c(35). -37 Let n(m) = -488m - 36584. Determine n(-75). 16 Let l(c) = 2251c + 20497. Determine l(-9). 238 Let o(x) = 299x2 + 138x - 135. Calculate o(1). 302 Let f(w) = -388w - 2709. What is f(-4)? -1157 Let y(z) = z3 + 166z*2 + 625z - 29. Give y(-4). 63 Let v(w) = -2w3 - 33w*2 + 5229w + 473. Calculate v(-60). -67 Let s(n) = -n*2 - 171n - 1872. Determine s(-12). 36 Let q(y) = 51425y - 308533. Determine q(6). 17 Let f(v) = 49v + 6465. What is f(-127)? 242 Let p(q) = -403q2 - 41q + 40. Give p(1). -404 Let i(s) = -s*3 + 29s*2 + 3095s + 82. What is i(72)? 10 Let r(q) = -91q3 - 18836q*2 + 193q - 2928. What is r(-207)? -30 Let z(s) = 2s2 + 72s - 1942. Determine z(-52). -278 Let b(z) = 311z - 5054. Give b(19). 855 Let o(d) = -2d*3 + 65d*2 - 337d - 1758. What is o(24)? -54 Let m(h) = -h*2 + 2653h - 81169. Determine m(31). 113 Let q(s) = 3918s2 + 58769s - 15. Give q(-15). 0 Let f(k) = k*3 + 4k*2 - 156k + 873. What is f(6)? 297 Let a(f) = 3f3 - 699	{ "pile_set_name": "DM Mathematics" }
2k = -d + 2 for d. -1 Let p be (5/(-30)-6)/((-2)/(-72)). Solve -4r + 27 = 5u, -p = -5u - 5r - 6 for u. 3 Let b(r) be the second derivative of 0 - 6r + 1/3r*3 - 3r*2. Let i be b(4). Solve 5m - 6 = -o + 7m, 3o + 6 = -im for o. 0 Let x(b) = -2b*2 + b + 1. Let y be x(-1). Let l be (-13)/1y/1. Suppose -l - 19 = -3j. Solve -o - 3u + j = -7u, 0 = 2o - 5u - 15 for o. -5 Let m(w) = -w2 - 6w. Let t be m(-6). Let c be 8/204-3 + 6/51. Let i be (-1 - -2 - c)/((-29)/(-145)). Solve t = -iu + 5, -u = -3p + u - 5 for p. -1 Suppose -5o = -l - 5, o - 5l + 33 = 5o. Suppose 4i - s - 8 = 0, 0 = -i - os - 3 - 4. Solve 2f - f = -3z - i, -21 = 4f - 5z for f. -4 Let l(n) = n*2 - 5n + 2. Let b be l(5). Suppose bm - 5m = 12. Let q be m/14 - 44/(-7). Solve a + 2t - 8 = qt, 0 = -5t - 10 for a. 0 Let p = 95 + -74. Suppose p = 12b - 27. Solve -r + h = -br - 9, 4r - 2h = -12 for r. -3 Let m(s) = 13 - 7s + 6s + s2 + 4s + 7s. Let h be m(-9). Solve hf + 2 + 11 = 5r, 2r - 10 = 4f for f. -2 Suppose -4t + 5y = -9, -3y = t - y + 1. Solve -20 = -4l, 4l = -5a + t + 9 for a. -2 Suppose 32 = 43x - 39x. Let n be 1/(-4) + 0 - (-34)/x. Solve 2y + 4w = -2y + 4, 0 = -3y + nw - 25 for y. -3 Let l = -3 - -3. Let t be 6 - ((-16)/(-4) + l). Solve o - 7 = -2u, 4o = o + tu - 19 for o. -3 Suppose 5z - 3t + 36 = -3, 2z = 3t - 21. Let r = 7 - z. Suppose 5u + i = 6i + 45, -3i + r = 2u. Solve -g + 7 = -2s - 3, -4s - u = g for g. 4 Suppose -16 = -9p + 7p. Let d be 1859/52 - (-2)/p. Suppose -4c + d = 8. Solve 5l = 5, l = 4i - 4l - c for i. 3 Suppose 6i - 37 - 173 = 0. Solve 5y - i = -3d, -4y + 0y - 4 = -4d for y. 4 Let v = 5 - 2. Let n(m) = -12 - m + vm - 6. Let s be n(10). Solve -q - 9 = 2k - 0, -21 = 5q - sk for q. -5 Let q = -90 - -85. Let b(x) = 8x + 44. Let a be b(q). Solve -az + 3 + 2 = 3n, 2z = -n + 3 for n. -1 Let l be 8/60 - 986/(-255). Solve 0 = -3c + lh - 15, -3h + 5 = -0c + 4c for c. -1 Let z be (146 + -10)/8 + 1-5. Solve -z = -3f, 0f = -2w - 5f + 22 for w. 1 Let d(s) = 23s + 119. Let m be d(-5). Solve -y - 2 = -0, -y = g + m for g. -2 Let k = 216 - 214. Solve 3a + 2s = -ka, 1 = 3a + s for a. 2 Suppose -5d = 5r - 25, -5d = r - d + 4. Suppose -3i = -x + 9 + 3, r = x - 2i. Solve -y = 2f - 2y - 2, x = -5f + 2y + 6 for f. 2 Let v(s) = -11s - 4. Suppose 3q - 9 = 6q. Let g be v(q). Let y = g + -27. Solve yk - 2m + 8 = 0, 3k + 2m - 4 = k for k. -1 Suppose 71f = 72f - 2. Solve fh + 5 = n, -2 = 3h + 1 for n. 3 Let r(n) = -n. Let y(f) = -f*2 - 36f - 47. Let q(o) = -2r(o) + y(o). Let m be q(-32). Solve -3d = k - m, -d + 27 = k + 4d for k. 2 Suppose 40 = 4x + x. Suppose 0 = -b + 4y + x + 4, -2y = 4. Solve -4w - 5p = w - 40, 0 = -4w + bp + 8 for w. 5 Suppose -14k - 975 = -9k. Let x be 8/5 + 1 - 78/k. Solve -4t - 15 = -5b, -xt + 2b - 7 = -1 for t. 0 Suppose -3 - 5 = -4h. Suppose -5s - h + 17 = 0. Solve -3 = -3w + sx, -10 = -3w + 2x - 3 for w. 5 Let k be 1/(-2) + (-21)/(-6). Suppose -8z = -4z. Suppose -g - 4g + 25 = z. Solve -gw = -kj - 17, 0 = -w - 0w + 4j for w. 4 Let a be 12 + (-28)/2 + 4. Solve l = -2, 4t + 2l = -al - 24 for t. -4 Suppose 8o + 2387 = 2475. Solve -13 = -3m - 4k, -4m + 4k - 3k + o = 0 for m. 3 Let f(z) be the first derivative of z*4/4 - 14z*3/3 + 7z*2 + 2z + 12. Let o be f(13). Solve -2p + x - o = 0, 2p + 12 + 8 = 2x for p. -5 Let t = -18 - -6. Let f = t + 16. Suppose 0 = 5o - fa - 84, -4o + 93 = -4a + 29. Solve -2c + o - 8 = -2y, 3y = -4c + 3 for y. -3 Let x(g) = 3g*2 + 12g + 14. Let s be x(-3). Solve 2k = -3n - 18, -sk + k = -4n - 4 for n. -4 Suppose 0 = -0m - 3m + 6, 2m = -4h + 104. Let x = h + -21. Solve 3o - 12 = -xu, -3o - o - 6 = -2u for u. 3 Suppose 4 = 3a + 1, -5i + a + 34 = 0. Let c = 4 - -1. Suppose cd + 15 = -b - 3b, 3d + 22 = -5b. Solve p - d = 4r - 2p, 0 = 3r - p + i for r. -4 Let r be ((-1232)/30)/(-8) - (-6)/(-45). Solve j = -rq + 4, 4q = -q for j. 4 Let p be 27/3 + (5 - 2). Let a = -11 + p. Let h be ((-1)/(-1))/(1/2). Solve -t + 4 = -hi, -4i - 7 = 4t + a for t. 0 Suppose 9v - 55 = 4v. Suppose b + 4k = 5k + 17, -5k = -4b + 69. Let d = b - v. Solve 0 = 2f + dn, -2f - 4n + 2 = 4 for f. -5 Let o(s) = -11 + 16 + 4 + 2s + 15. Let d be o(-12). Let j be (-2)/5 + (-44)/(-10). Solve -2m + 0m - 18 = 4z, d = -2z - j for m. -5 Let q = -15 + 9. Let t = -4 - q. Let u = 314 + -302. Solve 3f - 2r = -3r - 13, tf - r = -u for f. -5 Suppose -2g = -g. Suppose 3w - 4o + 1 = 0, 0 = -gw + 2w - 4o + 6. Solve 2c = 2u - 2, 0c - 4c = 5u - w for u. 1 Let i be (14/1)/(-1 - -3). Solve -3n + 4w - i = -19, 4n + w = -3 for n. 0 Let q = -201 + 209. Solve -s = -2s + 5d - 20, 5s = 2d - q for s. 0 Let k(d) = -d + 11. Let f be k(6). Suppose 0 = 8c - f - 11. Solve 2s - t + c = -0s, 0 = 2s - 5t + 10 for s. 0 Let c = 168 + -49. Let a = c - 115. Solve -3o - 2y = -a, 7o - 3o + y - 2 = 0 for o. 0 Let a(w) = -47w + 25w + 26w + 3. Let b(x) = x2 - x - 2. Let l be b(-1). Let z be a(l). Solve -zg = -2t - 7g, -t - 5g = 0 for t. 0 Let k(w) = 4w*2 + 3w - 6. Let c be k(-2). Solve 4l - i = -l + 26, -21 = -5l - ci for l. 5 Let t(o) = -o2 - 16 + 5o + 15o - 32o. Let r be t(-12). Let k = -13 - r. Solve -g + 5 = 3n + 3, kg = -4n + 6 for g. 2 Let i = 365 - 338. Solve -14 = 2y - 5o + 3o, 5y - 3o + i = 0 for y. -3 Let m be 0/(-6)(1 - 2/4). Solve -10 = 4n + 5g - mg, 0 = -3g + 6 for n. -5 Suppose -36 = -0n - 3n. Let z = n + -7. Solve -q - 2c = -7 + 5, zq + 4c = 4 for q. 0 Let x = -136 + 137. Solve 5b - 2t - 11 = -4t, -2b - x = -t for b. 1 Suppose 47b = 37b + 30. Solve -bq - 15 = -0u + 5u, -q + 6 = -2u for q. 0 Let q(g) = -44g - 156. Let r be q(-4). Solve 2d - 8 = 0, 0f - 3f = 5d - r for f. 0 Suppose -15m + 2396 = 251. Suppose 102 = 2x + 3n, -5x + 2x - 2n + m = 0. Solve -4y = -3t - 2t - x, -y + 5 = 0 for t. -5 Let t be ((-9)/(-6))/((-2)/(-4)). Suppose a - 39 = -2a. Solve -4n = -3g + a, -4g = -g - tn - 9 for g. -1 Let u(j) = -j2 + 4j + 3. Let l be u(6). Let i = l - -11. Solve 2v + 12 = -iv, 10 = r - 5v for r. -5 Let g be (0 + (-1)/2)-6. Let z = 7 + -2. Let i = 12 + z. Solve -gq - 48 = -5a - i, 4a = -4q + 12 for q. -2 Let w be (5 - 4)/(22/60). Suppose 4k + 2h - 26 = -0h, -w = -5h. Solve -3s - 2c = -s - 16, -ks + 19 = -2c for s. 5 Let w be ((-8)/6)/((8 + -6)/(-18)). Solve -4v + 6v = r - 7, -3v + r = w for v. -5 Suppose -94 = 2m - 298. Suppose 5y = -20, -m = -5h - 3y - 24. Let i be 7/4 - (-1)/4. Solve 22 = -5r + iz, 0z = -4r + 2z - h for r. -4 Let m = -5 + 7. Suppose 0 = -v + 2v - 16. Let h = 50 - 42. Solve -u - h = mu + 4i, 5u = -4i - v for u. -4 Let t be (-16)/(-28)84/24. Solve 0 = -s - a + ta - 1, 0 = -4s - 5a - 31 for s. -4 Suppose -21i + 400 = 4i. Solve o - 3q + 7q + 5 = 0, 2o - 5q = i for o. 3 Suppose 0 = 4y - 8 - 8. Suppose -5d = -11 + 1. Suppose -16 = -5p - 2u + u, du + 7 = 3p. Solve -y + 2 = m, -4 = -5t - pm for t. 2 Let h(j) = j*2 + 12j + 3. Let u be h(-13). Suppose u = 4v - 8v. Let q be (v - -2)/((-2)/4). Solve 4g = -c + 5, 2c + qg - g = 10 for c. 5 Suppose -33 = -4j - 13. Suppose 0 = 10s - js + 75. Let k be (-2)/(-1 - 9/s). Solve 20 = 4r, -5i + 4r = kr - 10 for i. 1 Let i = -5 + -3. Let j = i + 11. Let t be (-20)/15 - (-31)/j. Solve -2o - t = 3x, -x + 4o - 12 = 3x for x. -3 Let v be 16/56 + (-2)/7 + 2. Solve -vt + 20 = 4c, 0t + t = -3c + 13 for t. 4 Let o = 3 + 0. Suppose 5k - y + 3 = 26, -10 = -5y. Solve -c = kj - oj + 6, 12 = -j - 5c for j. -2 Let z = -57 + 61. Suppose -l - 4c = -7, 6l = l - c + 16. Solve -p = lr, -p = -zp + r for p. 0 Let s = -1864 - -1873. Solve 5u - s = -0o - 2o, -4u = -2o for o. 2 Let j be 90/(-36)12/(-15). Solve 0 = jy - 5y + 4t - 10, -4t + 12 = -2y for y. 2 Let t be (-41)/(-3)(1 + -4). Let k = t + 44. Solve 2m + 2v - 2 = -20, -5 = -km + 5v for m. -5 Let a = -21 + 15. Let s be 0(4 + 21/a). Solve s = -v + 2j - 2 - 3, -2v - j + 5 = 0 for v. 1 Suppose -704 + 644 = -10t. Solve 0 = 5y + d - 1, -ty - 2d = -9y - 2 for y. 0 Let a(c) = 6c*3 + 2c*2 + 2c - 3. Let q	{ "pile_set_name": "DM Mathematics" }
r? False Is 115631 a prime number? True Is 2705 a prime number? False Is 804821 a prime number? False Is 366677 prime? True Is 1147767 a composite number? True Is 34433 prime? False Is 33361 prime? False Is 1876439 composite? True Is 1367 a prime number? True Is 277157 composite? False Is 45587 prime? True Is 9793 composite? True Is 15937 a composite number? False Is 111859 a composite number? True Is 120643 a prime number? False Is 1735 prime? False Is 11654 prime? False Is 31463 composite? True Is 74177 a composite number? False Is 10057 a prime number? False Is 68219 a prime number? True Is 72337 prime? True Is 32537 a prime number? True Is 952097 a composite number? False Is 21461 a prime number? False Is 911357 a composite number? False Is 636655 a prime number? False Is 4327 prime? True Is 55973 prime? False Is 33043 prime? False Is 1176281 prime? False Is 124511 a prime number? False Is 31853 composite? True Is 45273 prime? False Is 1346737 prime? False Is 42203 a prime number? False Is 314851 composite? False Is 1447707 prime? False Is 68755 composite? True Is 26899 a composite number? True Is 79939 a prime number? True Is 1495183 composite? True Is 1651 a composite number? True Is 1759 a composite number? False Is 865 a prime number? False Is 42373 a prime number? True Is 695 prime? False Is 41879 prime? True Is 110009 composite? True Is 131129 composite? False Is 175737 prime? False Is 106637 composite? False Is 87 prime? False Is 202558 a composite number? True Is 59887 prime? True Is 557 prime? True Is 427213 a prime number? True Is 1382487 a prime number? False Is 25378 prime? False Is 648833 a composite number? True Is 22513 prime? False Is 39659 prime? True Is 9227 a prime number? True Is 285751 prime? False Is 397 a composite number? False Is 225229 a prime number? False Is 1454 a prime number? False Is 47599 a composite number? False Is 243797 a composite number? True Is 42061 prime? True Is 19417 a prime number? True Is 27179 a prime number? True Is 217043 prime? False Is 77081 a composite number? False Is 31741 prime? True Is 16183 a prime number? True Is 33505 prime? False Is 23401 composite? True Is 80221 prime? True Is 5779 a composite number? False Is 104245 a composite number? True Is 1194707 prime? True Is 27233 composite? True Is 2285 prime? False Is 12149 prime? True Is 39661 prime? False Is 14689 prime? False Is 24317 prime? True Is 143669 a prime number? True Is 374909 a composite number? False Is 57517 a composite number? True Is 25765 composite? True Is 28453 a prime number? False Is 3821 a composite number? False Is 405799 a composite number? False Is 6503 composite? True Is 7807 a composite number? True Is 22679 composite? False Is 16519 prime? True Is 114035 a prime number? False Is 25859 a prime number? False Is 62941 composite? True Is 610913 a prime number? True Is 42589 a prime number? True Is 7897 a prime number? False Is 8147 prime? True Is 124789 a prime number? False Is 10937 composite? False Is 403357 prime? False Is 171793 a composite number? False Is 497879 a composite number? True Is 907 a prime number? True Is 23899 a composite number? False Is 17583 prime? False Is 152921 a composite number? True Is 104231 composite? False Is 11351 a prime number? True Is 450514 prime? False Is 29409 composite? True Is 1867 prime? True Is 7583 a composite number? False Is 206699 composite? False Is 72026 a prime number? False Is 5414 composite? True Is 374639 composite? False Is 466703 prime? False Is 40099 a composite number? False Is 13291 prime? True Is 76231 a composite number? False Is 410003 a composite number? True Is 42707 a composite number? True Is 28151 composite? False Is 1158161 prime? True Is 601127 composite? False Is 49721 composite? True Is 563573 a prime number? False Is 74537 prime? False Is 398407 composite? False Is 11549 a prime number? True Is 3309 a composite number? True Is 204805 a prime number? False Is 3989 a composite number? False Is 1285265 a prime number? False Is 1310191 composite? True Is 3491 a composite number? False Is 2759 a composite number? True Is 3153187 a prime number? False Is 260941 composite? False Is 223781 composite? False Is 13577 composite? False Is 76631 a prime number? True Is 2819 a prime number? True Is 3522157 a prime number? True Is 105283 a prime number? False Is 695613 a prime number? False Is 15391 a prime number? True Is 272759 a prime number? True Is 127901 a prime number? False Is 2857247 a composite number? False Is 19534 composite? True Is 1576283 composite? False Is 784481 a prime number? True Is 3779 prime? True Is 240997 prime? True Is 229263 a prime number? False Is 2616071 prime? True Is 26747 a composite number? True Is 4423 a composite number? False Is 1386551 a prime number? True Is 45777 prime? False Is 60701 composite? True Is 252277 composite? False Is 100249 a prime number? False Is 63991 composite? True Is 767573 prime? False Is 288647 a prime number? True Is 57643 a composite number? True Is 67327 composite? True Is 4487 prime? False Is 12695 a composite number? True Is 205507 a prime number? True Is 967 composite? False Is 65167 composite? False Is 82849 a composite number? True Is 62759 a prime number? False Is 6623 a composite number? True Is 229351 composite? False Is 162119 composite? False Is 196763 a prime number? False Is 54391 a composite number? True Is 123271 a composite number? True Is 3137 a composite number? False Is 866971 prime? False Is 26233 composite? True Is 308119 prime? False Is 194569 prime? True Is 1685381 a composite number? False Is 43447 a composite number? True Is 31637 composite? True Is 10771 composite? False Is 12473 a composite number? False Is 241907 composite? False Is 9413 a composite number? False Is 70249 prime? True Is 77911 a composite number? True Is 2429 prime? False Is 120521 prime? False Is 52621 prime? False Is 594421 a prime number? True Is 157 a prime number? True Is 922021 a prime number? True Is 400823 composite? False Is 485587 a composite number? False Is 213713 composite? False Is 1966 prime? False Is 1478 prime? False Is 534187 composite? True Is 2533 composite? True Is 112061 prime? True Is 75133 a composite number? False Is 1272421 a composite number? False Is 30017 a composite number? True Is 10061 a prime number? True Is 911 prime? True Is 2503 prime? True Is 2210723 a composite number? False Is 278899 prime? False Is 73274 composite? True Is 5189 composite? False Is 3613 a composite number? False Is 131203 composite? False Is 56299 a composite number? False Is 153886 prime? False Is 12333 composite? True Is 43201 prime? True Is 415693 a prime number? False Is 262433 a composite number? False Is 192563 composite? True Is 15371 a composite number? True Is 6343 a composite number? False Is 2777 a prime number? True Is 6053 composite? False Is 5747 a composite number? True Is 365437 a prime number? False Is 332201 a composite number? False Is 38519 prime? False Is 3163 a prime number? True Is 1317 a composite number? True Is 506573 a prime number? True Is 1133 a prime number? False Is 341305 composite? True Is 256378 composite? True Is 4595 a composite number? True Is 15935 composite? True Is 21833 composite? True Is 747139 a prime number? True Is 256279 prime? True Is 3691 prime? True Is 80351 a prime number? False Is 37129 a composite number? True Is 886409 a composite number? True Is 38113 composite? False Is 23189 a prime number? True Is 40483 composite? False Is 37099 a prime number? False Is 15905 composite? True Is 147073 a prime number? True Is 4711 a composite number? True Is 3802073 a composite number? True Is 52223 prime? True Is 2518 composite? True Is 1399291 a composite number? True Is 505231 a prime number? True Is 20507 a composite number? False Is 1229219 a prime number? False Is 245785 a prime number? False Is 10147 a prime number? False Is 115293 composite? True Is 51451 a composite number? True Is 136057 a composite number? False Is 14431 a composite number? False Is 685 composite? True Is 159977 a prime number? True Is 10427 prime? True Is 35023 a composite number? False Is 550569 a composite number? True Is 5513 prime? False Is 17651 prime? False Is 102397 a	{ "pile_set_name": "DM Mathematics" }
- (9 + -5)) - 0. 42 Calculate 39 + -10 + -41 - (13 + -4 + (9 - 2)). -28 (0 - -2) + 47 - (-8 - 19 - -17) 59 What is the value of 3 + (10 - 7) + -13 - (-203 + 179)? 17 Evaluate 3 + 0 + (-36 - (4 - -42)) + (13 - 0). -66 Evaluate 5 - 40 - 27 - 16. -78 Evaluate -136 + 35 + 58 + 24 + -4. -23 What is (2 - -115) + -30 + (9 - -36) - (-11 + 6)? 137 18 + (-66 - (5 + (-18 - -3))) + -16 -54 What is -2 + -4 + 34 - (29 + (-8 - 9))? 16 Calculate 1 + -28 + (62 + 6 - 2). 39 Evaluate (-12 + 16 + (-5 - -9 - 46) - 5) + 5. -38 4 - (1 + 2 + -3) - 3 - (-1980 + 1910) 71 (47 - (-1 + 1)) + (-4 - (-3 + -5) - 5) 46 (-22 + (82 - 28) - -39) + -15 56 Evaluate 47 - 44 - -5 - (-2 + -40 - -3). 47 What is the value of 3 + (-19 + 2 + -7 - ((-27 - -11) + 15))? -20 ((-14 - 7) + 6 - -14) + 66 65 -457 + 453 - (1 + -48) - 18 25 What is the value of 0 + 0 + -12 - (-4139 + 4130) - -34? 31 Evaluate -13 + (-2 + 4 - 6) + -163 + 217. 37 40 - 31 - (-1 - -8) - ((12 - -108) + -12) -106 Evaluate (-208 - -106) + 124 + -1 + 0 + 9. 30 Calculate (-93 - (-9 + 2)) + 22 + 3. -61 Evaluate -14 - -8 - (25 + (-1 - -11) - 1 - -12). -52 What is (23 + -50 + 18 - (-18 + 4)) + 59 + 0? 64 Calculate -11 + (121 - -4 - (16 + -2 - (45 + -41))). 104 (63 + -5 - 22) + -24 12 (-35 - -51) + (0 - -3) + -24 + 15 10 Evaluate 4 + -12 + (49 + -85 - (2 + -15)). -31 11 - (26 + 8 - 29 - (-3 - -3)) 6 What is the value of (2 - (-12 - -59)) + 87? 42 Evaluate -44 - (-36 + (-85 - 16)). 93 Calculate -111 + 71 + 124 - 17. 67 Evaluate (-1 - -16) + (65 - 67) + (-48 - -36). 1 What is the value of (4 + -7 - (78 + -2)) + (-193 + 101 - -82)? -89 What is -30 - (-33 + 75 + -43)? -29 What is the value of (-14 + 9 - (40 - 2) - -1) + -3? -45 What is (-338 - -341) + (-7 - -1) - (3 + -2 + 26)? -30 Evaluate 47 - -21 - 145 - (-6 + -3). -68 Evaluate 201 - (1 + -123 + 194). 129 What is the value of (4 + 45 - 7) + 7 + 12 + (-10 - 6)? 45 What is 150 - (161 - -7) - (-2 - 77)? 61 Calculate (-4 - (-4 + 17 + (-5 - 2))) + 12. 2 What is -31 + (2 - -75) + (-168 - -198)? 76 What is the value of (-1 - -23) + -38 + (-12 - -3)? -25 -17 + (-26 - (-1 - 78)) 36 -23 + (20 - -130 - -18) + -16 129 -11 + 24 + -6 - (-73 - 6) - 17 69 Evaluate (40 - (25 + 31 + 24)) + -15. -55 Calculate (106 - 133) + 80 - 93. -40 Calculate (33 - 45) + 3 - 38. -47 Calculate 68 + -72 + -8 - 14. -26 Evaluate (52 - 46 - (4 - 2)) + (-81 - -179). 102 Calculate -117 + (18 - (37 + -54)). -82 Evaluate 8 + (-13 + (20 - 10) - (20 + -12)). -3 Evaluate 37 + -20 + -19 + (2 - 1) - 10. -11 Calculate -184 - (73 + -147) - -194. 84 What is the value of -26 - (7 + -5 + 2 - (3 + -3 - -2))? -28 What is the value of (46 - (47 - 34)) + -68? -35 (0 - 6) + (-89 + 7 + -3 - (87 + -114)) -64 Evaluate (40 + -86 - 199) + 124. -121 14 - (1 + 124 + (-21 - 19 - -31)) -102 -63 + 82 + (-3 - (-6 - -4)) 18 What is the value of -71 + (-145 + 278 - -16)? 78 What is 28 - (140 - (108 - -70))? 66 37 - (4 - (-12 + -31 + 33 + (15 - 2))) 36 -1 - (-17 - (-8 + 14 + -10)) - (2 - -28) -18 What is -181 + 106 + 53 + 0? -22 What is the value of (95 + -96 - (1 - (4 + -5) - -6)) + 48? 39 (87 + -91 - (-12 + -2)) + 17 27 What is -14 - -10 - (-17 + 7 + 10 - -7)? -11 What is the value of 71 - 156 - (-36 + -11)? -38 What is the value of (25 - 57) + -61 - -106? 13 What is 66 - (35 - (-18 - -21 - 3))? 31 -117 + 128 - (1 + 29 + -2) - -89 72 (146 - 106) + -111 - -68 -3 Evaluate -2 + (-57 + 40 - ((1 - -4) + -32)). 8 Calculate -14 - ((-5 - -15) + 4 - 2) - -12. -14 Evaluate (-12 + -4 - -5) + -8 + -3 + 46. 24 Evaluate (-79 + 31 - 7) + 92. 37 Calculate -80 + 1 - (486 + -557). -8 What is the value of (-4 - 7 - -22) + -21 + 37? 27 Calculate (7 - 4) + -12 - ((2 - -13 - 5) + 1). -20 (13 - 3) + -29 + (-8 - (-19 - 4)) -4 What is the value of (-30 - 15 - -42) + 50? 47 3 - (45 + -9 + -4 - -9) -38 Calculate 56 - (-25 + 23 + (-26 - -17)). 67 Evaluate (1 - 7) + 0 + 75 + (97 - 140). 26 What is the value of 1 + 38 + (713 - 790)? -38 What is 0 + -28 + 13 - -78? 63 Evaluate 104 + 10 + (-84 - -51). 81 -30 + (-14 - (67 - 17)) - 10 -104 -14 + (-59 - (-25 + 20 + 12)) -80 Evaluate 23 - (4 + 71 + (-66 - -29)). -15 What is the value of -6 + (-9 - -1) + 4 + 2 + -30? -38 What is the value of (52 - (11 + (-10 - 25))) + -1 - (1 - -1)? 73 Calculate 5 + 14 - (-25 + -5 + -5 + 11). 43 What is -21 + 26 + -13 + (-1 - 6) - 9? -24 What is 6 + 5 + 3 + -15 + (3 - -34) + -9? 27 72 - (-58 + 192 + -47) -15 What is (-43 - (46 - 81)) + 0 + -34? -42 What is 22 - 29 - (13 + -11 - 0 - 5)? -4 Calculate (-1 - -97) + (3386 - 3359). 123 Evaluate -79 + (47 + 62 - 36). -6 What is the value of (8 - 1 - (72 + -70)) + 0 + 0 - -22? 27 -102 + -6 + (-2427 - -2546) 11 -49 - 25 - (-36 + 3) - (-7 + (1 - 1)) -34 What is (-3 - -15) + -1 - ((45 - 15) + -67)? 48 (-359 - -334 - (-23 + 0)) + 12 + -61 -51 Calculate -74 + (30 - (1 + 42)) - -42. -45 Evaluate -23 + -4 + 25 + -14 - -22. 6 79 + 1 - (5 + 37) 38 What is 7 - ((1 - 17) + -53 + 63)? 13 What is the value of 81 + (-42 - 6) - -21? 54 What is the value of 66 + (-8 - 5) - ((19 - 11) + -6)? 51 What is 64 - 0 - (45 + -10 + -14 + -42)? 85 4 - 1 - (-38 - -12 - (-13 + -1)) 15 What is (-37 - (-34 - -10)) + (-2 - -3) - -50? 38 Calculate 5 - (3 + -12 + (9 - 0)). 5 Evaluate -53 - (1 - (13 - 1) - (12 - 48 - -27)). -51 What is -37 + 22 + 24 - (4 + -5 + 4)? 6 Calculate (12 + -15 - -24) + -4 + 8 + -12. 13 Evaluate -3 - (-12 - (5 + -26)) - 19. -31 Evaluate -18 - (-36 - -19) - -10 - (-4 + 2) - -30. 41 Calculate 8 - (1 + 0 + -2 - (-3353 + 3345) - 24). 25 Evaluate -5 - (-8 + 11 + 0 + 3 + 5 + 4). -20 -33 + (35 - 12) + 9 -1 What is 11 - (50 - (75 - 84 - (0 + -17)))? -31 -211 + 72 + (-83 - -145) -77 Calculate 47 + (-1 - -5 - ((-38 - 20) + 63)) + -12. 34 Calculate 7 - (-16 + 12) - 111 - (-4 - -3). -99 -15 - ((-71 - -16) + (16 - 4)) 28 Calculate -113 + 132 + (3 - 9) + 1 - 64. -50 What is 10 - ((-26 - -15) + 14 - -8)? -1 What is the value of (-6 - -108) + 9 + -18? 93 Calculate (-1 - -70) + (-132 - -133). 70 What is (-17 - 3) + (-17 + 14 - -15)? -8 Evaluate (1 - (17 + -17)) + -5 - (1 - 9). 4 What is the value of -5 + 49 - 123 - -41? -38 2739 + -2725 + 1 + (6 - -2) 23 (-46 - (56 + -20)) + 35 -47 Evaluate -1 + 1 + 32 - (-41 + -16 + 30 + 27). 32 Calculate 38 - 15 - -33 - 129. -73 What is the value of 3662 + -3651 - (-2 - 5)? 18 Calculate 6 + -2 + -273 + 276 + (-1 - -1 - -4). 11 What is the value of 61 - (51 - (8 + 7))? 25 Evaluate -3 - -18 - 40 - -28 - -38. 41 What is 773 + -666 + -86 + 5? 26 (-1 - 41) + (-125 - (-188 + 87)) -66 What is -7 + 4 + -4 + 400 + -391? 2 -17 + 23 + -9 + 11 + (46 - 53) 1 Calculate -140 - (99 + (-144 - 79)). -16 -3 + (-32 - 0) + (-14 - ((-26 - -10) + 14)) -47 Calculate 32 + (-51 - (-25 - -24)) - (-1 + 0). -17 What is (5 - (8 + 1)) + -233 + 245? 8 What is the value of -83 + 6 + 43 + -2 - (1 + (1 - 12))? -26 Evaluate -39 + 35 + (11 - 1) + -7 - (-152 - -187). -36 (-5 - -11) + (35 - 115) + 1 -73 18 + (-6 - (-11 + 7 + -9 + 17)) 8 Evaluate (6 - -4) + -18 - ((-17 - -23) + 62). -76 What is the value of 1 + -4 + 3 + 35 - (584 + -579)? 30 Evaluate -51 - -93 - (-3 + -8 + -66). 119 What is -18 - (-17 + 16 - (-12 + 21)) - (2 + 29)? -39 142 + -199 + 9 - (-9 - (2 + 0)) -37 What is 32 + 5 - 65 - -10 - -95? 77 What is -121 + (-19 - (46 + -43)) + 19? -124 What is the value of -21 + 30 + 4 + (8 - 32)? -11 Evaluate -14 - 1 - (4 - 9) - (-64 + 117). -63 63 - (-37 - -89) - 117 -106 Calculate -129 + 63 + 65 - (62 + -1). -62 Calculate (145 - 154) + (6 + 74 - 8) + (1 - -1). 65 24 - (-26 + 25 + 56) - 27 -58 (3 - 94 - -42) + 88 39 Evaluate 95 - (785 - 776 - (-1 - (4 + -13 + 3))). 91 Evaluate -2 - 82 - ((-26 - 0) + -7 + -36 + 55). -70 What is the value of 0 + (-22 - -10) + 19? 7 Calculate 36 + 2 - (28 - (6 - (-20 - -2))). 34 Evaluate 4 + 4 + -26 - (-5 + 3 + 8). -24 -1 + 0 + 15 - -14 - 22 6 Evaluate -17 - (31 + -121 - -90). -17 What is 531 + -514 - (28 - 1) - 30? -40 What is the value of (-11 + 8 - 4 - (39 + -102)) + 6? 62 What is the value of (21 - (-4 - (-19 + (9 - 7)))) + (0 - -44)? 52 Evaluate -39 + (-20 + -13 - -11) - (-1 + -17). -43 Evaluate 195 + -207 - (0 + 36 + -5). -43 What is the value of -4 + -6 - (1 - (-14 - (-43 + 2)))? 16 Evaluate (-99 - -59) + 69 + -113. -84 What is 17 - (-12 - (-38 - -18))? 9 What is 9 - (14 + -22) - 56? -39 Evaluate -14 + (19 - (2 + 1)) - (7 - -18). -23 What is t	{ "pile_set_name": "DM Mathematics" }
e nearest to 4 in -0.3, -0.2, 1/4, k? 1/4 Let s = 16588 + -99527/6. Which is the closest to -2.6? (a) -3 (b) s (c) -0.1 a Let l = 7/401 - -725/4411. What is the nearest to 0.2 in -0.5, -3/2, -0.12, l? l Let y = -1.9 + 0.6. Let z = 26942 - 26941. Which is the nearest to z? (a) -5 (b) -1 (c) -1/6 (d) y c Let i(n) = -16n + 13. Suppose 3k + 5z - 13 = 0, -3z + 5 = -3k + 2. Let v be i(k). Which is the closest to 1/3? (a) v (b) -0.051 (c) 1/2 c Let i = 30 + -29. Let j = -102.67 - -103.1. Which is the nearest to j? (a) -2 (b) i (c) 3 b Let y = -11.395 + -5.605. Which is the closest to 6? (a) y (b) 0.4 (c) 5 c Suppose 5n = 5x + 560, -x = 3n - 0x - 324. Let s = n - 322/3. Let g = -1/145 - -61/435. What is the nearest to 7 in 0.1, s, g? s Let y be (6/15)/((-28)/(-35)). Let k = -0.015 + 1.725. Let t = k + 0.29. Which is the nearest to y? (a) t (b) -0.4 (c) 3 b Let p = 2845.6 + -2846. Which is the nearest to 2? (a) -60 (b) p (c) 1/3 c Let c = -2.36 - -3.337. Let u = -0.077 + c. Let z be (-5)/21 + 1/(-3). What is the nearest to 0 in -0.5, u, z? -0.5 Let g = -514 + 503.15. Let j = g - -10.8. Let v = 0.11 + j. Which is the closest to 2/7? (a) -1 (b) v (c) 4/5 b Suppose -49u + 201 = -250u. Let r be (-6)/4190/(-15). Let y = -37/2 + r. What is the nearest to u in y, 4, 1/21? 1/21 Let f = -0.024 + -8.976. Let x = f - -10. Let r = x + -0.8. Which is the closest to r? (a) -1/4 (b) -2 (c) 1 a Suppose 15 - 67 = -t. Let j = 51 - t. What is the closest to -1/5 in j, -2/7, 3? -2/7 Let g = -0.07 + 0.17. Let m = 3.323 - 3.823. Let k = -0.8 - 0.2. What is the closest to g in -0.1, k, m? -0.1 Let t be ((-660)/(-264))/((-1)/10). Which is the closest to -1/4? (a) 5 (b) -7 (c) 1 (d) t c Let s = -347/5 + 69. Let t = 13 + -12. Let b = -3/16 + -11/112. What is the closest to 0 in t, b, s? b Let q = 1.1 - 0.1. Let s = 0.206008 + -3.206008. Which is the closest to 1/5? (a) -0.4 (b) s (c) q (d) -5 a Let u = 7252 - 7249. What is the nearest to -1/15 in 0.5, -3, u, -0.5? -0.5 Let v = 16/2037 - 10/97. Let m = -2592 - -2593. What is the closest to m in 0, v, -1/11? 0 Suppose 0k - 2k = y - 11, 5y = k. Let q = -2822 - -2821. Which is the nearest to y? (a) q (b) -7 (c) -4/7 c Suppose 0 = 10j - 4j - 558. Let u = j - 75. Let g be (0 - u/40) + 9/45. What is the closest to 1 in 2/7, 0.3, g? 0.3 Let m = -5.4 + 5. Let j = -1113 - -1113.15. Which is the nearest to j? (a) 0.3 (b) m (c) -5 a Let b = 0.6 - 0.52. Let z = -0.03 + 0.64. Let q = z - 0.71. What is the nearest to b in q, 6/5, -2/17? q Suppose -3g + 4y + 188 = g, -4g - y = -208. Let n be (9/16)/(g/34). Let h be 6/243/((-3)/4). Which is the nearest to 0? (a) n (b) -3 (c) h a Let p = 13 - 77. Let k = 64 + p. Let n = 0.22 - 0.12. Which is the nearest to n? (a) 4/3 (b) 1 (c) k c Let w = 69.652 - 0.152. Let y = w + -74.5. Which is the nearest to 0.2? (a) y (b) 0.5 (c) 0.6 b Let f = 27435 - 27434.7. Which is the nearest to 2? (a) f (b) 0.1 (c) -200/3 a Let o be (-88)/(-9) + 4/18. Let u be (-4)/o + ((-1836)/(-30))/3. Suppose i = -4i - u. Which is the nearest to -6/13? (a) -4/5 (b) i (c) 2 a Let y = -0.2 + -0.3. Let n be (-32)/(-40) + 42/(-60). What is the nearest to n in y, 3/4, 1/6? 3/4 Let v be ((-2)/(-15))/(304/(-380)). Which is the nearest to v? (a) -3/5 (b) -0.4 (c) -2 b Let r = 95 - 14. Let c = r + -80.97. Suppose 15 = -9x + 6. What is the closest to c in x, -2, 4? x Let i be 5/602 + (-16)/(-12). What is the closest to 6/11 in 3, i, -10? i Let h = 123.65 + 0.35. Let s = -122 + h. What is the nearest to 38 in -1/3, s, 5? 5 Let n = -945/8 - -118. Let r = 18589 + -18588. Which is the closest to r? (a) 1/10 (b) n (c) 4 a Let f be (-30)/12(159/55 + 4/(-44)). What is the closest to 1/33 in -2/7, f, 2, -4? -2/7 Let x = -279.3 + 279.2409. What is the closest to x in 0.2, -0.5, 3? 0.2 Let o = 5.7 - 0.7. Let m = -72.772 - -72.772. Which is the nearest to 0.1? (a) m (b) 0.4 (c) o a Let d = -0.0948 - 1.3052. Let p = 3 - 5.6. Let m = d + p. Which is the nearest to 0? (a) 3/4 (b) m (c) 2 a Let o be 20/3 - (-672)/(-96). Let q = -13 + 11. What is the nearest to q in -5, 2, o? o Let k = 0.06 + -0.36. Let g = -0.3 - k. Let a be 285/152 + 3-34/18. What is the nearest to g in -6, a, 1/3? a Let l be ((-2)/142)/(-19 + 6 - -14). What is the nearest to -0.1 in l, -7/30, 1/10, -10? -7/30 Let w(z) = -2z*3 + 102z2 + z - 61. Let g be w(51). Let p be (12/135)/(g/(-45)). What is the closest to 0.6 in 1, p, -2, -0.2? p Let d(a) = a3 - 6a2 + 5a + 3. Let r be d(4). Let t = -8080/6039 - -28/6039. What is the nearest to -1/3 in -3, r, t? t Let h be (3 - (-45)/(-10))10/(-3). Let d = 229/2 + -112. What is the nearest to h in 2, d, -3/4? d Let j be (-3)/44/(-3). Let l = -255.4 - -255. Which is the nearest to 2/3? (a) j (b) 0 (c) -0.6 (d) l a Let m = -1493 - -1492.9103. Let q = m + 2.0897. Which is the nearest to 2/3? (a) q (b) 4 (c) 0.3 c Let g = -175/4 - -43. Let u = -138 + 138.013. Let q = u - -3.987. Which is the closest to 0.2? (a) q (b) g (c) 5 b Let x = -171.4 + 11.4. Let o = 160 + x. Which is the nearest to -2? (a) 4 (b) o (c) -0.6 c Let c(m) = 194m - 8535. Let p be c(44). What is the closest to p in 3/8, 12, -2? 3/8 Let q = 19505.69 + -19506. Which is the nearest to 29? (a) 2 (b) -0.1 (c) 1 (d) q a Let v = 0.0277 - 0.4287. Let h = v + -0.099. Which is the closest to -2/5? (a) h (b) 5 (c) -0.2 a Let t = 7.7 + 0.3. Let i(y) = -845y + 92948. Let v be i(110). Which is the closest to -7? (a) v (b) t (c) -4 c Let s(o) = o*3 + 14o*2 + 12o + 3. Let j be s(-13). Let m = -13 + j. Let l = -1.2579 + 1.0579. What is the nearest to l in 2/23, 5, m? 2/23 Let t = 83988/5 + -16798. What is the closest to -4 in -62, 0.3, t? t Let j be 1714/249954/(-12). Which is the nearest to 2? (a) 4 (b) -12 (c) j a Let t = 3 - 4. Let l be 3 + 5 - -3 - ((24 - 13) + -1). Which is the closest to l? (a) -1/6 (b) 0.34 (c) t b Let z = -34 + 36. Let k(u) = 2u3 + 25u*2 + 12u + 18. Let l be k(-12). Suppose -26q + l = -32q. Which is the closest to -2/3? (a) z (b) -0.1 (c) q b Let t = 27889/2 - 13945. What is the closest to -0.059 in -2/45, -0.4, t? -2/45 Let k = 6/5 + -4/5. Let m = 147 - 284. Let i = m - -138. Which is the nearest to k? (a) i (b) 1/3 (c) -7/5 b Let t = -9 - -8.7. Suppose -11 - 9 = 4x. Let m be (-297)/(-55) + 2/x. Which is the closest to t? (a) -2 (b) 3 (c) m a Let s = 0.05 - 0. Let i = 3.1 - 3. Let g be -23 + (11 - 4) + 12. What is the nearest to s in -2, i, g? i Let k(m) = 9m*2 - 909m - 5. Let o be k(101). Let l = 80 - 79.93. What is the nearest to -0.1 in -0.4, o, l? l Let z = 11/7 + -10/7. Let g be (-1610)/43473/5-2. Which is the nearest to z? (a) -1 (b) g (c) 5 b Let m = -17.62 - -26.62. Let s = 79/5 + -563/35. What is the closest to m in s, 0.2, 2/5? 2/5 Let t = -23 - -45/2. Let v = 32 + 11. Let i = 43.2 - v. Which is the closest to t? (a) 4 (b) i (c) 0.09 c Let p be -3 + -5 + 5 + 4. Let z be (p/11)/(1/(-2)). Let f(h) = 2h2 - 13h - 5. Let r be f(7). Which is the closest to -2/5? (a) -0.5 (b) r (c) z a Let s = -2545 + 2543. What is the closest to -3 in s, -0.3, 5, -0.06? s Let f = 0 - 0.1. Let h = -4583.2 - -4581.9. Which is the nearest to h? (a) 2 (b) 1/6 (c) f c Let o = 5.7 - 3.7. Let q = -0.43 + 0.63. Let t = 4 + -2. Which is the closest to o? (a) q (b) t (c) -1/4 b Suppose 18r - 6 = 20r + 2t, -23 = -4r + t. Which is the closest to 4? (a) 24 (b) r (c) 26 b Let r(c) = -c*2 + 8c + 9. Let j be r(9). Suppose -91 = -q - jq + s, 5q + 2s = 434. Let l be (q/(-110))/(5 + 1). What is the nearest to 0 in 2/7, 4, l? l Let k(n) = 21 + 67n + 61n - 129n. Let g be k(10). Let m = g + -58/5. What is the closest to 1 in m, -0.5, -0.07? -0.07 Let g = 1.097 - 1.117. Which is the nearest to g? (a) 0.5 (b) -17 (c) 1 (d) 2 a Let h be ((-632)/(-44))/(-2)*1 + 7. What is the closest to 0.1 in -14/5, h, -2/13? -2/13 Let d = -636 - -637.37. Let b = d + -5.37. What is the nearest to 2/33 in 1, b, 1/2? 1/2 Let f = 147.433 + 28.567. What is the closest to -2 in -1, 0.1, f? -1 Let m = 0.0516 - -214.9484. Let b = 219 - m. What is the nearest to -0.2 in b, -2, 2/9? 2/9 Let o = 957.7 - 958. Which is the closest t	{ "pile_set_name": "DM Mathematics" }
ve -2p + 28 = -4d, 3587d - 1815d - 1776d - 3p = -2 for d. -4 Solve 2i + 45 = -442z + 439z - 7, -i = -6z - 94 for i. -2 Solve -45w + 203w - 87 = 4g + 151w, -3g + 4w = 49 for g. 1 Solve 64 = -z + 3z - 2x, 3z + 1048280x - 112 = 1048279x for z. 36 Solve -5c = -36i - 61, -i + 2212c - 2210c = 11 for i. -1 Solve 0 = -16o + 18o - 4j + 28, -3 + 5 = -j for o. -18 Solve w - 138 = -2z - 100, z + 2w = 19 for z. 19 Solve 0 = x + 3y + 3, -3 = 266x - 265x - 60y for x. -3 Solve 2x - 9j = -18j + 3j + 5j + 11, -2x = -x - 4j + 35 for x. 1 Solve -2u + 16 = -15o + 5o + 13o, -5u = -10u + 2o - 17 for u. -1 Solve -9076b = -9078b + 33u - 175, 5b = -3u - 10 for b. -5 Solve 2t - 757 = -5b - 712, 17 = 5t - 3b + 75 for t. -5 Solve -7v + 5m + 7m - 17 = 7m, -9m = -3v + 1 + 26 for v. -6 Solve 90794p = -2j + 90792p + 14, -25 = -2j - 3p for j. -4 Solve -874w + 867w = -y - 18, 4y = -w - 14 for y. -4 Solve 2q = 2o - 20, 5q + 16 + 10 = -10o + 22o - 10o for o. 8 Solve 5z + 22 = 3u - 4, 2u + 67z - 8z = 11z - 34 for u. 7 Solve 3z - 4i + 11 - 3 = 0, 4i + 99 - 20 = 16z + 35 for z. 4 Solve 3h - 3 - 5 = x, -3x + 10h + 32243 = 3h + 32259 for x. 4 Solve o - 15 = 0, 3x - x + 17 = 2o - o for x. -1 Solve 24 = -0y + 3y - 28c + 31c, 0 = 5y + 2c - 1 for y. -5 Solve -3z + 2s = 44, 76s + 98s = 5z + 156s + 44 for z. -16 Solve -1124f + 1120f - 3r = -26, 0 = -14f + 2r + 66 for f. 5 Solve -o = -15j + 237, 3o + 26 = -0j + 2j + 4 - 1 for o. 3 Solve -3q - 1434350o = -1434351o - 19, 0 = 7q - o - 35 for q. 4 Solve 5i - 15f - 1385 + 1381 = 546, 115 = 2i - 3f for i. 5 Solve g = -3s + 5, -478s - 5g = -486s + 44 for s. 3 Solve 257 + 269 = -16b + 32t - 30t, -6b - 5t = 203 for b. -33 Solve 2065463a - 2065468a = 2w + 8, 5a - 4w = -14 for a. -2 Solve c - 46 = -10g, 636g + 30 = 638g - 5c for g. 5 Solve -3v + 3g = -111, -4g - 8g - 1 = 4g - 17g for v. 38 Solve 14f = -42, f - 541 = -n - 538 for n. 6 Solve 12y + 11 = 67 + 64, -4 = -3l - y for l. -2 Solve 35s - 87i + 1365 = 37s - 628, -3s - 127 = -5i for s. -4 Solve 3i + 5v + 43 = 0, 2i + 0i = -0i - 5v + 65789 - 65831 for i. -1 Solve 4m - 2l = -4m + 4m + 10, 5m + 18l + 298 = -14l for m. -2 Solve -3a - 9 = -4i, 69 = -5610a + 5598a + 5i for a. -7 Solve 5270 - 5245 = -2n + 3w, 0 = -3n + 2w - 25 for n. -5 Solve 75 = -9n + 4n + 5y, -12n - 5y = -15n - 75 for n. 0 Solve l + 33156 = -20n + 33072, 0 = l - 3n - 8 for l. -4 Solve 2711f - 8 = -4o + 2710f, -6f - 68 = -15o + 10o for o. 4 Solve 7i = 704j - 702j - 177, -1 = -j for i. -25 Solve -4w - 198 = -7c, 5w - 9w - 4c + 3c = -42 for w. 3 Solve 2l = 38c + 72811 - 73187, 0 = 3c + 4l - 38 for c. 10 Solve -10958 = 4l - 2l - o - 10945, -3o = -4l - 33 for l. -3 Solve 5k + 90 = -4f, 5k - 284f + 285f = -30 for k. -2 Solve -2l + 92 = -6j + 2j, 2l - j = -380962 + 380988 for l. 2 Solve -6w - 30x - 76 = -6w - 2w, 11x - 15x + 16 = -4w for w. -7 Solve 0 = a + 4a + 2x + 127, a + 4 = a + x for a. -27 Solve 0 = -m - 3a - 20, 4m - 240 - 191 = -7a - 698 + 217 for m. -2 Solve t + 13x + 9 = 14x, 0 = -2t - x + 6 for t. -1 Solve 5j = -d - 23 + 135, 3j - 2d + 26 - 88 = 0 for j. 22 Solve 21 - 53 = 7g - 4b, -5g - 7b + 125 = 0 for g. 4 Solve 20o + 31 - 59 = -3n + 59, -58 = -2n - 2113o + 2115o for n. 29 Solve k = b + 2k + 6, -b + 12 = -k - 0 for b. 3 Solve 10q + 45 = -5m, 0q - 14m = -3q - 13m - 6 for q. -3 Solve 4538263t - 2 = 4538261t + s, -14 = -5t - 2s for t. 2 Solve 2q = -z + 18, 2z - 3q - 676615 = -676642 for z. 0 Solve u - 2s + 29 = 0, 6366u - 6369u + 20s = 87 for u. -29 Solve 0 = 303j - 302j, j - 42 = -10y + 18 for y. 6 Solve -2m = -2t + 92 - 49 + 23 - 52, 5t - 23 = m for m. -3 Solve 0 = 2f + 4c + 38, 0 = 159f - 161f - 5c - 43 for f. -9 Solve 3z + 9 = -2w - w, -z + 193w - 349w = -192w - 293 for z. 5 Solve -2y = 3f - 15, -20y + 74f + 958 = 86y + 70f for y. 9 Solve 4f = 2l - 2, l - 12l - 90f - 85 = -19l + 3l for l. -1 Solve 32 = 5l - p, -l - 89 + 93 = p for l. 6 Solve 16 = 3f - u + 34, f - 25 + 7 = 13u + 14 for f. -7 Solve v = -2z + 164, -412 = 1658v - 1661v - 5z for v. 4 Solve -y + 11945n = 11942n + 31, 3n = 7n - 4 for y. -28 Solve 80 = 2r + 3m + 135, -3r - 5m - 18 - 73 = 0 for r. -2 Solve -5p + 74 = -4l + 79, 8p - 22 - 2 = 0 for l. 5 Solve -3y = -b + 13, -70444b + 70441b = 4y + 26 for b. -2 Solve 0 = -o - 3q - 13, -3q - 23 = -9129o + 9125o for o. 2 Solve 5w + 130 = -18k - 10k + 4w, -75 = -35k + 36k - 7w for k. -5 Solve 105 = 4647259f - 4647260f + 2p, -4f - 108 = -2p for f. -1 Solve -45 = -3m - 12g, -m + 527364g = 527361g + 20 for m. -5 Solve 0 = -3r - 5b - 2, 282r + 2b + 8 = 280r for r. -9 Solve 1215o + 13d - 2 - 5 = 1220o + 3 - 4, o - 3d = -d for o. 4 Solve -10y - 3h + 79 = -y - 4y, 5y = -2h + 76 for y. 14 Solve 3i + u - 44 = -1, -56i + 57i + 4u = -4 for i. 16 Solve 154o + 149 = -131v + 130v, 0 = 3v + 2o - 13 for v. 5 Solve 5t - 11f + 7f = -98, -8 = -4f for t. -18 Solve -14 = -10y - 4l, -257464y - 16l + 236 = -257460y for y. -5 Solve -5p + 48f + 0 = 52f + 90, 0 = -4p - 5f - 108 for p. -2 Solve 3u + 412 = 4o, 74 = -25u - 11u + 38u + o - 29 for u. 0 Solve -s + 5 - 27 + 18 = 0, 0 = -4c - 4s - 32 for c. -4 Solve -5s + 3v = v + 17, -171v + 279 = 3s + 978 for s. -5 Solve 3r + 3c = -27, -32 = -5r + 75c - 73c for r. 2 Solve 0 = -4z + 42w + 42334 - 42098, -w = -40z - 154 for z. -4 Solve 4v - 2469 + 2461 = -5w, 9w = -v - 0v - 29 for w. -4 Solve 10o + 935 = 13t + 11o, -375t + 5o + 365 = -370t for t. 72 Solve 4h = -c - c + 22, -4h - 7c - 160 + 207 = 0 for h. 3 Solve 0 = -v + v - 4t - 36, -3t = -13v + 41 + 38 for v. 4 Solve -w - 23 = -j, 5w + 397j - 197j = 203j - 109 for w. -20 Solve 0 = 2t + 4k + 34, 5k = t - 13138 + 13085 for t. 3 Solve -5j = -41o + 60o + 124, o + 8 = -6j + 5j for j. -2 Solve 4i + 8497d - 23 = 4247d + 4249d, 0 = -4i + 2d - 10 for i. 3 Solve -9 = -2i - 481c + 482c, -2i = 8c for i. 4 Solve -360q + 71k + 15 = -363q + 76k, -6q + k + 2k - 30 = 0 for q. -5 Solve 24f - 29f = -62d + 166, -3f = 4d + 182 for d. -2 Solve -90p + 187p + 10 = 98p + 2n, -10 = -p + n for p. 10 Solve -2514302m + 2514301m = 2i - 71, 5i = m + 181 for m. -1 Solve 2u - 4b = 233 - 289, -3b + 20 = 4u for u. -4 Solve -218g - 227g - 5s = -447g + 14, 0 = s for g. 7 Solve 5q - 24159n = -24155n - 57, q + 4n + 21 = 0 for q. -13 Solve 3y = 70a - 72a - 58, -4y - 4a - 84 = 0 for y. -16 Solve -16b = -2b + j + 157, -3j - 2196 = -b - 2198 for b. -11 Solve -2c + 9f + 1 = 6f - 8, -716f = -2c - 720f - 26 for c. -3 Solve -3c + 3h = 54, 7890c - 7891c = 12h - 43h + 48 for c. -17 Solve -5y - 112 = 2h, -104y + 3h = -109y - 108 for y. -24 Solve n - 4n + 80 - 147 = 6f - 100, 0 = 2n - 2 for f. 5 Solve 0r + r + 2 = 1, 2153x = 2149x - 14r + 10 for x. 6 Solve -11v = -2q + 19, -10v + 8 - 3 = -5q for q. -7 Solve -4f - 148 = 7v, 279v - 104 = 284v + 2f for v. -20 Solve 2d - 9 = -d, 4a - 3d = 7a + 103 + 68 for a. -60 Solve -34h + 13h + 8 = 3j + 188, -222 = -4h + 6j for h. -3 Solve -3z + 23 = 2h, 1208h - 1213h + 85 = -20z for z. -1 Solve -131 - 55 = 4p + 6d, -19p + 2d - 99 - 74 = 6d for p. -3 Solve 3z - 918p + 916p + 15 = 0, 135 = -27z - 4p for z. -5 Solve -12c = -m - 760, -87m - 307 = -5c - 89m for c. 63 Solve 0 = -2w + 5r + 135, 0 = -188w + 189w - 3r - 82 for w. -5 Solve 4i + 32 - 25 = 401f - 406f, 2f - 50 = -28i for f. -3 Solve 0 = 4a + 5u - 15, -3a + 37u - 32u - 53 = -73 for a. 5 Solve -22x = -4x - 234, -40t + 3x = -23t - 19t + 41 for t. 1 Solve -h = h + 54f + 158, -2f = 56 - 50 for h. 2 Solve -y + 2258 = v + 2263, 2v + 4 = -y for y. -6 Solve 4y + 2k = 202, -2y - 193 + 1294 = 45k - 431 - 3013 for y. 0 Solve 5n - 10x + 176 - 16 = -35, 2x - 2 = 0 for n. -37 Solve 4s - 2192 = -3y + 3y - y - 2227, -4s + 3 = 6y + 33 for s. -9 Solve 2i - 3k - 64 = -i + 2k, 8k + 2 = 3k - 68 for i. -2 Solve 18c - 12c - 5c - 70 = 13c - 2o, 139o - 28 = -c + 144o for c.	{ "pile_set_name": "DM Mathematics" }
ms in -1 + 150877b2 + 1 - 150863b*2. 14b*2 Collect the terms in 13s3 + 540 - 542 - s3 + 59s3. 71s*3 - 2 Collect the terms in 63n*2 - 25n*2 - 28n*2 - 30n*2. -20n2 Collect the terms in j2 - j2 - j2 + 89j + 14. -j2 + 89j + 14 Collect the terms in 566w3 - 634w*3 + 462w*3. 394w*3 Collect the terms in -51u + 51u - 108u*2 - 3u*3. -3u*3 - 108u*2 Collect the terms in -304 - 947v*2 + 304. -947v2 Collect the terms in -a2 - 4298a3 + 2261a*3 + 2164a3 + a2. 127a3 Collect the terms in -48l + 186l - 46l - 42l + 4 - 48l. 2l + 4 Collect the terms in 960r - 64 + 64. 960r Collect the terms in 452f*3 + 348f*3 - 806f*3. -6f*3 Collect the terms in -2x*2 + 241739 - 483422 + 241683. -2x*2 Collect the terms in 14357w - 34809w - 18384w. -38836w Collect the terms in 52b + 0b2 + b2 - 26b - 159b - 400b. b*2 - 533b Collect the terms in -33232 - 2d - 37598 + 23287 + 3d. d - 47543 Collect the terms in 216z + 1203z*2 - 1207z*2 - 447z + 231z. -4z*2 Collect the terms in 43 + 3q*2 + 46 + 44 - 182 + 49. 3q*2 Collect the terms in -9 + 9 + 547l*2 - 3l3 + l3 - 548l2. -2l3 - l2 Collect the terms in 4b3 + 8b*3 - 5b*3 - 6b*3 + 5b*3. 6b*3 Collect the terms in 84h*2 - 132h - 157h + 289h. 84h2 Collect the terms in h - 2h + h + 3024h2 + 3034h*2 - 6048h*2. 10h*2 Collect the terms in -2 + 143308j*2 - 143388j*2 + 0 + 2. -80j*2 Collect the terms in 126166w - 63082w - 389w*3 + 111w*3 - 63084w. -278w3 Collect the terms in 8m + m - 6 - 11m. -2m - 6 Collect the terms in -2 + 23045u + 2 - 23052u. -7u Collect the terms in 48g*2 - 147g*2 + 64g*2 + 61g*2. 26g*2 Collect the terms in 1791167g - 1791167g - 104g*2. -104g*2 Collect the terms in 3 + 234w - 221w - 215w. -202w + 3 Collect the terms in -119j*2 - 4j + 119j2 + 1352j*3 + 4j. 1352j3 Collect the terms in -1527x*3 + 510x*3 + 506x*3 + 499x*3. -12x*3 Collect the terms in 7167551 - 13v2 - 7167551 + v2. -12v2 Collect the terms in -5k + 65 + 99 + 63 - 227. -5k Collect the terms in -22i + 54i - i - 6i - 3i + 5i*2. 5i*2 + 22i Collect the terms in 220787h2 + 23h*3 - 220787h*2. 23h*3 Collect the terms in 1227a + 19328a2 - 1227a - 6685a2. 12643a*2 Collect the terms in 96z + 13 - 59z - 13 - 36z. z Collect the terms in -324025c2 - c + 324064c*2 - c. 39c*2 - 2c Collect the terms in -2121 - 404 + v*2 + 0v2. v2 - 2525 Collect the terms in 205i2 - 394i*2 - 49i*3 + 189i*2 - 20i*3. -69i*3 Collect the terms in 169l3 + l2 + 4l2 - 5l*2. 169l*3 Collect the terms in -130x + 179x - 143x - 89x - 54x. -237x Collect the terms in -550a - 499a + 743a. -306a Collect the terms in 6520 - 3991 + 13f*2 - 2529. 13f*2 Collect the terms in 3n + n*2 - 2n*2 - 5n*2 - 2n*3 + 6n*2 + 140. -2n*3 + 3n + 140 Collect the terms in 715 + 2q3 + 2659q - 2659q. 2q*3 + 715 Collect the terms in -7b*2 + 4b + 9b2 - 9b*2 - 13b*2 - 6b. -20b2 - 2b Collect the terms in -a*2 + 4a*2 - 2a*2 - 298a + 2. a*2 - 298a + 2 Collect the terms in 59j + 8j*2 - 275j + 216j. 8j*2 Collect the terms in -31 + 14133a*2 + 31. 14133a*2 Collect the terms in -377j*2 - 5 + 194j*2 + 178j*2 + 5. -5j*2 Collect the terms in 16y*3 + 46y + 44y - 136y - 12y3 + 46y. 4y3 Collect the terms in 1830954 - o - 1830954. -o Collect the terms in -144v - v*3 - 81v + v*3 - 2v*3. -2v*3 - 225v Collect the terms in -320t - 262 + 262. -320t Collect the terms in 3108q + 3172q - 6281q. -q Collect the terms in 67c - 12c - 19c - 5 - 23c. 13c - 5 Collect the terms in q*3 + 72q*2 - 113q*2 - 89 - 3q*3. -2q*3 - 41q*2 - 89 Collect the terms in 5871o - 2322o + 22149o. 25698o Collect the terms in -3423p*2 - 3414p*2 + 10220p*2 - 3413p*2. -30p*2 Collect the terms in -159h*2 + 3875h*2 + 6886h*2. 10602h*2 Collect the terms in -3 - 11u + 14u - 12u. -9u - 3 Collect the terms in 357228 + 18d*3 - 714452 + 357224. 18d*3 Collect the terms in -19f*3 - 26f*2 + 64f*2 + 18f3. -f3 + 38f2 Collect the terms in -7l + 33l + 27l - 54l. -l Collect the terms in -40t*3 + 68t*3 + 101t*3. 129t*3 Collect the terms in -15g + g + 281g. 267g Collect the terms in 843t2 - 425t*2 - 414t*2. 4t2 Collect the terms in -i2 - 869i - 864i + 25i3 + 2601i - 868i. 25i3 - i2 Collect the terms in 14x2 + 7x*3 - 10x*2 - 5x*3. 2x*3 + 4x*2 Collect the terms in 9639k*2 - 4806k*2 - 4847k*2. -14k*2 Collect the terms in 62g - 63g + 83240 - 83240. -g Collect the terms in -63647u*2 - 63682u*2 + 127345u*2. 16u*2 Collect the terms in 108 + 190u - 36 - 191u. -u + 72 Collect the terms in -2o*2 - 9599034o*3 + 9599029o*3 + 2o*2. -5o*3 Collect the terms in 358p*3 - 398p*2 + 398p*2 + 601p*3. 959p*3 Collect the terms in 453y + 624y + 0 + 244y + 2. 1321y + 2 Collect the terms in -4q*3 + 4472q*2 + 12q*3 + 4477q*2 - 8949q*2. 8q*3 Collect the terms in -123753k + 247515k - 123765k. -3k Collect the terms in -685d - 681d - 242d - 391d. -1999d Collect the terms in c*3 - 3c*3 + 2673c - 29 - 2673c + 29. -2c*3 Collect the terms in -2g + 13 + 110 - 123. -2g Collect the terms in 10y*2 - 246y + 382y - 19y*2. -9y*2 + 136y Collect the terms in 194 - 194 + 68t3 - 61t*3. 7t*3 Collect the terms in 816 + 5y - 418 - 398. 5y Collect the terms in -23 + 26 + 3d - 3 - 80d. -77d Collect the terms in 295w3 + 2908w + 6w3 + 143w*3 - 2908w. 444w3 Collect the terms in 8 + 10r*2 - 8 + 3 + 0 + 3. 10r*2 + 6 Collect the terms in -69w*3 - 78w*3 + 119w*3. -28w*3 Collect the terms in 4r*2 - 6r + 15r2 - 15r*2 - 2r. 4r2 - 8r Collect the terms in 1781k + 4499k + 2639k. 8919k Collect the terms in -43 - 65963i + 32981i + 32979i. -3i - 43 Collect the terms in -2378b2 - 2365b*2 + 4737b*2. -6b*2 Collect the terms in 745 + 751 + 0f*2 - 3f*2 + 3f - 1496. -3f2 + 3f Collect the terms in -7s3 - s3 - 5s*3 + 112 - 6 + 3s*3. -10s*3 + 106 Collect the terms in -2465 - 6n*3 - 2472 - 2465 + 7402. -6n3 Collect the terms in p3 - 10499p2 + 10516p2 + p3. 2p3 + 17p*2 Collect the terms in 445t*3 + 345t*3 - 795t*3. -5t*3 Collect the terms in 11 + 5d*2 - 26 - 77d - 26d2 + 13. -21d*2 - 77d - 2 Collect the terms in -16t + 116 - 6 + 29t - 7. 13t + 103 Collect the terms in 0 + 0 - 1034f*3 + 0. -1034f*3 Collect the terms in 57b*2 + 22b + 2 - 55b2 - 2. 2b*2 + 22b Collect the terms in 269x - 470x + 15x. -186x Collect the terms in -62 - 59 + 151 - 30 + 4h3. 4h*3 Collect the terms in 1744p*3 - 1131p*2 + 1131p*2. 1744p*3 Collect the terms in -76s - 1114s3 + 1126s*3 + 76s. 12s3 Collect the terms in -19694u + 1 + 17558u - 2 + 1. -2136u Collect the terms in 68146l + 53 + 30621l - 53. 98767l Collect the terms in 26y*2 - 627314 + 627314. 26y*2 Collect the terms in 40 + 53h*2 - 40h*2 - 21 - 19. 13h*2 Collect the terms in 9o*3 - 519289 + 519289. 9o*3 Collect the terms in -87i + 51i - 277i - 43i. -356i Collect the terms in -4i2 + 24 + 19 + 2i*2. -2i*2 + 43 Collect the terms in 3420h - 2 - 11h2 + 11h*2 - 4h*3. -4h*3 + 3420h - 2 Collect the terms in -87087i - 489791i - 2564274i. -3141152i Collect the terms in 162479m2 - 81229m*2 - 81248m*2. 2m*2 Collect the terms in -320 - 225 - 6n*3 + 545. -6n*3 Collect the terms in -14g + g + 13g - 6019g*2. -6019g*2 Collect the terms in s + 753s*2 - 720s*2 + 0s. 33s2 + s Collect the terms in -21h - 30312 - 30389 + 60701. -21h Collect the terms in 37k*3 + 20k*3 - 68k*3. -11k*3 Collect the terms in 6017n*2 + 6032n*2 - 12153n*2. -104n*2 Collect the terms in 138w - 13 + 6 + 5. 138w - 2 Collect the terms in h + 35973h*3 - h - 36061h*3. -88h*3 Collect the terms in -11360y*2 - 1281y*2 - 547y*2 - 11886y*2. -25074y*2 Collect the terms in -2k + 12k - 7 + 0k - 5k - 3k. 2k - 7 Collect the terms in 9t -	{ "pile_set_name": "DM Mathematics" }
te prob of picking 1 a and 1 d when two letters picked without replacement from {d: 6, a: 13}. 26/57 Two letters picked without replacement from {m: 1, r: 2, i: 5, u: 1, b: 8}. What is prob of picking 2 b? 7/34 Calculate prob of picking 1 q and 2 y when three letters picked without replacement from yqyqqqqq. 3/28 Three letters picked without replacement from {t: 2, s: 4}. Give prob of picking 1 t and 2 s. 3/5 Calculate prob of picking 3 j when three letters picked without replacement from jjjjjjvjjjjjjjj. 4/5 What is prob of picking 1 o and 3 y when four letters picked without replacement from yyyoyyoooo? 5/21 What is prob of picking 1 n, 1 a, 1 q, and 1 j when four letters picked without replacement from {e: 2, j: 1, a: 2, q: 2, n: 7, b: 1}? 4/195 Four letters picked without replacement from ehhehhhhjejhjd. Give prob of picking 2 h and 2 e. 9/143 What is prob of picking 4 k when four letters picked without replacement from akkkkkkkakkkakkkakkk? 364/969 Calculate prob of picking 2 f when two letters picked without replacement from ejieifieiieejeiiefe. 1/171 Two letters picked without replacement from ecuceneesncl. What is prob of picking 1 c and 1 e? 2/11 What is prob of picking 1 h and 1 v when two letters picked without replacement from {s: 7, h: 4, v: 2}? 4/39 Calculate prob of picking 2 d when two letters picked without replacement from dddddddzizi. 21/55 Calculate prob of picking 1 b and 1 z when two letters picked without replacement from zbbzzbzzzzzzzzz. 12/35 Two letters picked without replacement from {g: 12, y: 7}. What is prob of picking 1 y and 1 g? 28/57 Calculate prob of picking 2 d, 1 w, and 1 j when four letters picked without replacement from {e: 2, d: 4, w: 8, j: 2}. 24/455 Two letters picked without replacement from mofmfb. Give prob of picking 1 m and 1 o. 2/15 Three letters picked without replacement from myvxxixxaaxam. Give prob of picking 1 x and 2 y. 0 Calculate prob of picking 1 o and 1 l when two letters picked without replacement from {z: 1, a: 2, l: 6, h: 3, r: 2, o: 4}. 8/51 Two letters picked without replacement from {i: 1, m: 1, c: 1}. What is prob of picking 1 c and 1 m? 1/3 Four letters picked without replacement from {s: 4, e: 16}. Give prob of picking 4 e. 364/969 Two letters picked without replacement from ycyyccctyty. Give prob of picking 1 t and 1 c. 8/55 Three letters picked without replacement from hmmgmnmmndimhmm. What is prob of picking 1 h, 1 d, and 1 n? 4/455 What is prob of picking 3 e and 1 d when four letters picked without replacement from eedded? 1/5 What is prob of picking 1 d and 1 k when two letters picked without replacement from ddcykkcyccywwyl? 4/105 What is prob of picking 1 u, 1 h, and 1 m when three letters picked without replacement from {h: 7, p: 1, m: 3, u: 5}? 3/16 Three letters picked without replacement from ssdsstsdpstspptdtd. Give prob of picking 3 p. 1/816 Three letters picked without replacement from {n: 3, h: 4, i: 4}. What is prob of picking 2 h and 1 n? 6/55 What is prob of picking 1 k and 1 q when two letters picked without replacement from {m: 1, p: 2, q: 2, t: 4, k: 3}? 1/11 Four letters picked without replacement from jvsvljvvs. What is prob of picking 1 j, 1 s, and 2 v? 4/21 Calculate prob of picking 1 k and 1 e when two letters picked without replacement from {e: 7, r: 1, k: 2, u: 1, d: 3}. 2/13 Four letters picked without replacement from kkiipisikpkkkpikkki. Give prob of picking 2 i, 1 p, and 1 k. 135/1292 Three letters picked without replacement from ennnnoeeeeeonne. Give prob of picking 1 n and 2 e. 18/65 Two letters picked without replacement from {g: 6, l: 4, o: 1}. Give prob of picking 1 o and 1 l. 4/55 What is prob of picking 2 h when two letters picked without replacement from aahhh? 3/10 What is prob of picking 2 f when two letters picked without replacement from {l: 2, f: 2, m: 3, n: 8}? 1/105 Three letters picked without replacement from {x: 1, g: 3, a: 3}. Give prob of picking 1 x and 2 a. 3/35 Three letters picked without replacement from {q: 2, z: 1, i: 1, f: 2}. Give prob of picking 1 i, 1 z, and 1 q. 1/10 Two letters picked without replacement from {p: 7, g: 7}. Give prob of picking 2 p. 3/13 Two letters picked without replacement from {r: 1, n: 1, s: 2, h: 1, g: 2, w: 1}. Give prob of picking 2 s. 1/28 Two letters picked without replacement from kzzzkzzzz. What is prob of picking 2 z? 7/12 Two letters picked without replacement from {o: 1, h: 1, c: 2, r: 2, l: 2, b: 1}. Give prob of picking 2 l. 1/36 Four letters picked without replacement from ngyyymmygn. Give prob of picking 1 g and 3 y. 4/105 Two letters picked without replacement from ueeeepuneuewouwun. What is prob of picking 1 w and 1 n? 1/34 Three letters picked without replacement from {t: 5, h: 4, x: 4, u: 2, v: 4, n: 1}. What is prob of picking 1 u and 2 h? 1/95 What is prob of picking 2 t and 1 a when three letters picked without replacement from ttttaltlll? 1/12 Two letters picked without replacement from mvsvpmppmrvmrsx. Give prob of picking 1 x and 1 r. 2/105 Two letters picked without replacement from ssnisinsnsinisiii. What is prob of picking 1 i and 1 n? 7/34 Four letters picked without replacement from {i: 3, f: 9, a: 4}. Give prob of picking 1 f, 1 a, and 2 i. 27/455 What is prob of picking 2 g when two letters picked without replacement from {j: 4, w: 2, g: 3, a: 1}? 1/15 What is prob of picking 4 x when four letters picked without replacement from xxxkkkxxxxxxxxx? 33/91 What is prob of picking 2 q, 1 m, and 1 t when four letters picked without replacement from qqmqqmqtmqmqq? 112/715 What is prob of picking 1 r and 1 i when two letters picked without replacement from {r: 3, i: 9}? 9/22 Three letters picked without replacement from whwwhhzw. Give prob of picking 1 h, 1 z, and 1 w. 3/14 Calculate prob of picking 2 k when two letters picked without replacement from {w: 2, l: 1, k: 2, d: 1}. 1/15 What is prob of picking 1 b, 1 h, 1 i, and 1 r when four letters picked without replacement from {h: 2, v: 1, m: 1, r: 1, b: 1, i: 1}? 2/35 Two letters picked without replacement from ayydibibbbdi. Give prob of picking 1 b and 1 y. 4/33 Two letters picked without replacement from dqqddyuddydqqfqfyd. Give prob of picking 2 q. 10/153 Calculate prob of picking 2 c when two letters picked without replacement from ccccccccsccccccccc. 8/9 Two letters picked without replacement from vvvvnudkavkkd. Give prob of picking 1 n and 1 d. 1/39 Four letters picked without replacement from {q: 4, a: 6}. Give prob of picking 3 a and 1 q. 8/21 Calculate prob of picking 1 x and 3 c when four letters picked without replacement from xccjxgxrxcxgxxxxcxcl. 20/969 Four letters picked without replacement from sggrdkdj. What is prob of picking 2 d, 1 g, and 1 s? 1/35 Calculate prob of picking 4 i when four letters picked without replacement from {i: 10, p: 2}. 14/33 Two letters picked without replacement from {v: 1, s: 3, j: 1, h: 3, m: 2, u: 7}. Give prob of picking 1 s and 1 v. 3/136 Three letters picked without replacement from {z: 6, o: 7}. Give prob of picking 3 o. 35/286 Calculate prob of picking 2 l and 1 n when three letters picked without replacement from nnliiinnllnnln. 3/26 Calculate prob of picking 2 o when two letters picked without replacement from ioloioiiol. 2/15 What is prob of picking 1 x and 1 d when two letters picked without replacement from {y: 4, d: 10, x: 5}? 50/171 Calculate prob of picking 3 f and 1 x when four letters picked without replacement from {f: 7, x: 5}. 35/99 Calculate prob of picking 2 j when two letters picked without replacement from {q: 8, f: 1, y: 3, r: 2, d: 1, j: 5}. 1/19 What is prob of picking 2 t and 1 a when three letters picked without replacement from qitiaiiiqqtaaiaiiiqi? 1/285 What is prob of picking 2 u and 2 y when four letters picked without replacement from uguyyguug? 1/21 What is prob of picking 2 q when two letters picked without replacement from eqeeeeeeeeeeqweee? 1/136 Calculate prob of picking 2 x, 1 j, and 1 h when four letters picked without replacement from tcxtfctttjfhxtt. 1/1365 Four letters picked without replacement from tttttttttttftttfft. Give prob of picking 3 t and 1 f. 91/204 Calculate prob of picking 1 u and 1 q when two letters picked witho	{ "pile_set_name": "DM Mathematics" }
*2 + 10z - 28. Calculate a(-12). -4 Let s(m) = m*2 + 3m - 19. What is s(5)? 21 Let w(z) = -z*3 + 5z - 2. Calculate w(2). 0 Let l(h) = h + 13. Give l(-11). 2 Let v(n) = -n*2 + n - 1. Give v(4). -13 Let i(u) = -2u*2 - 16u + 24. Give i(-11). -42 Let b(a) = -a*3 - 7a*2 + 9a - 3. Give b(-8). -11 Let n(i) = -i*3 + 2i*2 + 2i - 8. Determine n(3). -11 Let n(m) = -m*2 + 7m - 5. Determine n(9). -23 Let m(o) = -o*3 + 19o*2 - 21o + 48. Determine m(18). -6 Let a(i) = 6i2 + 32i + 3. Give a(-6). 27 Let a(u) = -u*3 + 4u*2 + 12u - 9. Determine a(5). 26 Let y(t) = -t3 + t2 - t + 37. Determine y(0). 37 Let x(a) = -6a3 - 4a2 + a + 1. Calculate x(1). -8 Let s(j) = -j3 - 6j2 + 2j + 22. Calculate s(-7). 57 Let q(v) = v + 1. Determine q(14). 15 Let h(u) = 18u - 105. Calculate h(5). -15 Let u(j) = 16j - 54. Give u(3). -6 Let r(j) = j*3 - 12j*2 + 11j + 7. What is r(11)? 7 Let b(q) = q*3 + 6q*2 + 9q + 48. Give b(-6). -6 Let l(u) = -u + 1. Determine l(2). -1 Let a(s) = s*3 - 13s*2 - 13s - 20. Give a(14). -6 Let o(q) = 22q - 62. What is o(3)? 4 Let w(c) = 2c - 1. Determine w(-6). -13 Let q(v) = -v*3 + 5v2 - v + 5. Calculate q(4). 17 Let l(v) = -v3 - 13v2 + 17v + 38. Calculate l(-14). -4 Let m(q) = 3q - 20. Calculate m(7). 1 Let z(l) = l3 + 23l*2 + 23l + 22. Give z(-22). 0 Let n(f) = f*3 - 16f*2 - 17f + 6. What is n(17)? 6 Let u(g) = g*3 - 5g*2 + 4g - 41. Determine u(5). -21 Let z(s) = s*2 + 8s - 7. Calculate z(-8). -7 Let r(n) = n*2 - 5n - 1. Give r(3). -7 Let l(m) = 9m + 1. Calculate l(-1). -8 Let l(k) = k2 + 2k - 8. What is l(6)? 40 Let u(p) = 3p3 + 40p*2 + 13p + 2. Give u(-13). 2 Let n(y) = 6y - 22. Give n(4). 2 Let x(w) = w3 + w2 + w - 6. Determine x(0). -6 Let t(r) = 4r3 + r2 - 2. Calculate t(-2). -30 Let u(x) = -2x2 - 11x - 28. Calculate u(-3). -13 Let d(b) = 4b2 + 38b - 118. What is d(-12)? 2 Let p(g) = g*3 + 4g*2 - 9g + 5. Calculate p(-6). -13 Let m(c) = c*2 - 2c + 2. Give m(12). 122 Let b(q) = q*3 + 12q*2 + 12q + 10. What is b(-11)? -1 Let u(g) = 2g - 15. What is u(7)? -1 Let c(l) = -47l - 39. Give c(-1). 8 Let u(j) = -j*3 + 12j*2 + 7j - 70. Determine u(12). 14 Let v(l) = 32l + 1. Calculate v(1). 33 Let b(r) = -45r + 176. Determine b(4). -4 Let x(w) = -2w + 3. Determine x(-5). 13 Let d(m) = -2m*2 - 6m + 1. Give d(-5). -19 Let k(g) = -203g2 - g + 2. Calculate k(1). -202 Let a(g) = -g2 + 2g + 2. Give a(-7). -61 Let i(a) = 2a3 - 3a*2 - 4a - 8. What is i(-2)? -28 Let r(m) = -4m3 + 2m*2 + 2m. Calculate r(2). -20 Let x(j) = -j. What is x(-1)? 1 Let t(p) = 4p - 16. What is t(3)? -4 Let l(w) = -w3 + 4w*2 - 3w - 2. Determine l(3). -2 Let h(f) = 3f - 18. Give h(8). 6 Let p(z) = -z3 + 7z*2 - 4. Calculate p(5). 46 Let r(l) = -2l*2 + 4l + 7. Give r(4). -9 Let v(o) = -o*2 - 3o + 7. What is v(-7)? -21 Let f(v) = 3v - 5. Give f(-3). -14 Let r(p) = 6p + 162. Determine r(-12). 90 Let j(i) = -i*2 + 2i + 191. Determine j(15). -4 Let r(b) = 25b + 316. Calculate r(-13). -9 Let f(h) = -h + 5. Give f(2). 3 Let y(a) = -a3 + 3a*2 + a + 1. Calculate y(3). 4 Let k(v) = -7v - 1. Determine k(5). -36 Let k(t) = t*3 - 26t*2 + 24t + 31. Calculate k(25). 6 Let q(a) = 4a2 - 2a + 1. Determine q(3). 31 Let v(u) = -3u - 3. What is v(-4)? 9 Let o(g) = -g3 + 7g*2 + 48g - 321. Calculate o(8). -1 Let n(x) = 2x2 + 3x + 1. What is n(0)? 1 Let y(c) = 13c - 130. Give y(11). 13 Let l(d) = -20d + 8. What is l(8)? -152 Let x(k) = 11k - 5. Calculate x(3). 28 Let g(z) = -z3 + 7z*2 + 2z + 50. Give g(8). 2 Let v(a) = 85a - 4. Calculate v(1). 81 Let r(g) = g2 + 26g + 136. Determine r(-19). 3 Let l(z) = -z*3 - z + 10. Determine l(2). 0 Let w(l) = -28l - 8. What is w(-1)? 20 Let k(y) = -2y - 4. Calculate k(-6). 8 Let r(b) = -b3 - 3b*2 + 2b - 2. Give r(-4). 6 Let m(k) = k*3 - 7k*2 + k - 13. Calculate m(6). -43 Let r(y) = 5y + 2. Calculate r(-5). -23 Let d(z) = -z*3 - 11z*2 + 11z - 12. Determine d(-12). 0 Let y(m) = -4m - 36. Determine y(-8). -4 Let w(j) = 2j*2 - 5j - 12. Calculate w(4). 0 Let y(k) = 18k + 92. What is y(-5)? 2 Let k(z) = -z3 + 3z*2 + 2z - 4. What is k(4)? -12 Let t(x) = 2x2 - 62x + 13. What is t(31)? 13 Let a(g) = -19g + 37. Give a(7). -96 Let z(r) = 21r - 2. Calculate z(3). 61 Let s(x) = -x*2 - 6x + 1. Calculate s(-5). 6 Let j(h) = 3h - 7. Calculate j(7). 14 Let i(k) = 4k*2 + 9k + 4. Determine i(-4). 32 Let r(f) = 2f - 34. Determine r(10). -14 Let z(j) = -j2 - 12j + 2. Calculate z(-12). 2 Let k(s) = -19s - 10. What is k(-3)? 47 Let m(v) = v3 - v2 - 13v + 7. What is m(6)? 109 Let t(z) = -z*3 - 20z*2 + 18z - 47. Determine t(-21). 16 Let l(n) = 10n + 57. Determine l(-5). 7 Let i(h) = 7h + 6. What is i(-4)? -22 Let m(d) = d*2 + 2d - 29. What is m(5)? 6 Let i(h) = h*3 - 17h*2 - 22h + 81. Calculate i(18). 9 Let m(x) = 3x2 - 9x + 13. Give m(6). 67 Let q(f) = f*3 + 5f*2 + 3f - 1. Determine q(-3). 8 Let v(w) = -w*3 + 3w*2 + 12w - 3. Determine v(-3). 15 Let o(l) = l*2 - 7l + 17. Determine o(6). 11 Let h(y) = -2y + 16. Give h(9). -2 Let g(j) = -9j + 4. What is g(8)? -68 Let d(o) = -o*3 + 21o*2 + 24o - 11. Determine d(22). 33 Let c(r) = r*3 + 4r*2 - 4r. Give c(-5). -5 Let t(m) = m*2 + 7m + 11. What is t(-5)? 1 Let l(a) = a*3 - 3a*2 - 6a + 1. What is l(4)? -7 Let d(v) = -2v2 + 33v + 23. Give d(17). 6 Let d(k) = 2k2 + 113k - 57. Give d(-57). 0 Let s(l) = l3 + l2 + 3l + 3. Determine s(-2). -7 Let q(h) = -h3 - 2h*2 - 3h + 3. Calculate q(3). -51 Let m(g) = g*3 + 9g*2 + 15g - 6. Determine m(-5). 19 Let s(d) = -2d2 - 22d + 298. Give s(8). -6 Let k(y) = y*2 - 7y - 26. Give k(11). 18 Let d(i) = 5i + 79. Calculate d(-16). -1 Let m(b) = 39b*3 - 4b*2 - 4b - 1. Determine m(-1). -40 Let r(l) = l*3 + 13l*2 - 18l - 67. Determine r(-14). -11 Let o(c) = 6c3 + 2c*2 - 2c + 1. Give o(1). 7 Let u(c) = 2c2 + 2c - 113. Give u(7). -1 Let z(i) = 2i2 + 19i + 23. Give z(-7). -12 Let t(j) = -2j2 - 5j - 9. Give t(-3). -12 Let h(u) = u*3 + 11u*2 + 10u - 8. Give h(-10). -8 Let w(q) = -2q + 29. Determine w(15). -1 Let x(j) = 8j - 25. Calculate x(8). 39 Let t(d) = -d*3 + 13d*2 - 5d + 28. Calculate t(13). -37 Let s(i) = -i*2 - 3i + 213. What is s(12)? 33 Let p(u) = u*3 - 5u2 + u - 5. Give p(4). -17 Let m(t) = -t2 - t + 35. What is m(0)? 35 Let c(a) = -3a3 - 4a + 6. What is c(-3)? 99 Let a(s) = s*3 + 9s*2 + 9. Determine a(-9). 9 Let y(r) = 5r - 10. What is y(-6)? -40 Let z(r) = -r + 19. Determine z(10). 9 Let c(v) = -12v3 - 4v2 - v + 2. Determine c(-2). 84 Let v(d) = -d - 4. Give v(0). -4 Let v(j) = -j3 + 11j2 - 39j + 284. Calculate v(10). -6 Let u(t) = -t*2 + 9t - 37. Give u(8). -29 Let f(o) = -57o3 + 3o + 4. Give f(-1). 58 Let z(a) = a*3 - 3a*2 + a - 11. Give z(3). -8 Let h(f) = 2f*2 + 3f - 8. What is h(4)? 36 Let d(g) = 20g + 1. Give d(-1). -19 Let v(h) = 2h - 28. What is v(14)? 0 Let z(i) = i*2 - 15i + 4. Calculate z(10). -46 Let x(a) = a*3 + 4a*2 - 6a - 10. Calculate x(-5). -5 Let l(z) = -z*3 - 9z*2 - 11z - 1. Give l(-8). 23 Let n(g) = g*3 + 9g*2 + 3g - 13. What is n(-8)? 27 Let r(p) = 2p2 + 13p + 1. Calculate r(-6). -5 Let o(y) = -4y3 + 12y*2 + y - 1. Give o(2). 17 Let a(u) = 160u*2 - 3u - 2. Calculate a(-1). 161 Let m(k) = k*3 + 7k*2 + 7k - 8. Determine m(-5). 7 Let p(r) = r*2 + 12r + 44. Give p(-6). 8 Let u(g) = 2g2 + 4g - 100. Calculate u(6). -4 Let o(b) = b3 - b2 - 3b + 4. What is o(4)? 40 Let f(l) = l2 + 17l + 8. What is f(-12)? -52 Let m(t) = -2t2 - 21t - 13. What is m(-10)? -3 Let f(l) = -l*3 + 28l*2 - 53l + 19. Calculate f(26). -7 Let i(z) = -2z2 + 9z - 6. Determine i(6). -24 Let l(z) = -z*3 + 4z*2 + 5z + 6. Calculate l(5). 6 Let q(r) = 13r + 4. Determine q(-11). -139 Let n(r) = -r3 + 7r*2 - 4r - 4. Give n(5). 26 Let d(p) = -32p3 + 3p*2 + 3p + 1. Determine d(-1). 33 Let d(a) = a*3 - 10a*2 + 6a - 1. Calculate d(4). -73 Let j(c) = -2c2 + 40c - 2. Give j(20). -2 Let f(u) = u*3 - 7u2 + u + 6. Give f(5). -39 Let g(c) = -c2 - 2*c + 5. Determine g(	{ "pile_set_name": "DM Mathematics" }
prime factors of h(21). 2, 11, 41 Suppose -4u = 3j, -2j + 3u - 1 = -18. Let r(m) be the second derivative of -m5/20 + m4/2 - 3m2/2 + 4m. List the prime factors of r(j). 29 Let l = 11 - 16. What are the prime factors of (l - -4)(-15)/1? 3, 5 Let n = -144 - -62. Let h = n + 120. What are the prime factors of h? 2, 19 Suppose -70 - 10 = -q. Suppose -2w = 4g - q, 3g - g = w + 36. Let j = 12 + g. What are the prime factors of j? 31 Let o(d) = d + 12. Let y be o(-12). Let g be ((-3)/2 - -2)y. Suppose 3m - 2x = -4x + 56, 2x + 4 = g. List the prime factors of m. 2, 5 Let d(i) = -2i*2 - 27i + 17. Let a be d(-14). List the prime factors of a - ((-141 - 0/(-2)) + -2). 2, 73 Let n = 600 - 135. List the prime factors of n. 3, 5, 31 Let x(f) = 11f2 + 2f - 1. Suppose m - 22 + 1 = -4a, -m = -3a + 7. Suppose 7r = ar + 3. List the prime factors of x(r). 2, 3 Suppose 0k - 5k = 1100. What are the prime factors of k/306/(-4)? 11 Let k = 1198 - 544. What are the prime factors of k? 2, 3, 109 Let m = 16 - 10. Let z(i) = 6i + 9. Let d(c) = 7c + 8. Let n(f) = mz(f) - 5d(f). What are the prime factors of n(5)? 19 List the prime factors of -330568/(-112) - (-4)/(-28). 3, 787 Suppose 0 = -42c + 39c + 15. Suppose cp = 1743 - 248. List the prime factors of p. 13, 23 Suppose 456 = -891n + 897n. What are the prime factors of n? 2, 19 Let o = 791 + -203. What are the prime factors of o? 2, 3, 7 Let r(i) = i2 - 7i + 9. Let s be r(6). Suppose -3o - 4a = -7, 5o - sa = 25 + 6. Suppose 0 = 2b - ob + 6. What are the prime factors of b? 2 Let n be 1/(-2)(6 + -16). Let w(p) = 2p*3 - 5p*2 - 5p - 6. List the prime factors of w(n). 2, 47 Suppose -i - 2 = -3. Let w be (-2)/(i + (-44)/46). Let z = -13 - w. List the prime factors of z. 3, 11 Suppose -3f - 2m = -1289, -f = 2f + m - 1291. List the prime factors of f. 431 Suppose -58 - 22 = -5f. Let p(g) = 18g - 40. What are the prime factors of p(f)? 2, 31 List the prime factors of (2/2 - 2)/((-1)/61). 61 Let x(o) = -o + 6. Let u = -7 - -13. Let d be x(u). Suppose 106 = -dt + 3t + 5n, 4t + 2n = 146. List the prime factors of t. 37 Let i = 2563 + -535. What are the prime factors of i? 2, 3, 13 Suppose 0 = -22n + 19n + 57. Let k(v) = -v*3 + 19v*2 + 14v - 14. List the prime factors of k(n). 2, 3, 7 Let p = 247 - 39. What are the prime factors of p? 2, 13 Let w = -73 - -76. List the prime factors of (3 - -1 - w)/((-2)/(-356)). 2, 89 Suppose -s = -0s - 170. Suppose -2w = -4n - s - 246, 631 = 3w + n. What are the prime factors of w? 2, 3, 5, 7 Let s be 19 + -22 - (1 + (-14)/2). Suppose -4f + 2b = 0, -3f = -5f - b. Suppose f = sc + g + g - 53, -c + 19 = 2g. What are the prime factors of c? 17 Suppose 4k - k + 639 = 3g, -2k - 4 = 0. Suppose 5i + 0u - 251 = 2u, 4i = 5u + g. What are the prime factors of i? 7 Let r = 6 - 10. Let a(k) = 3k2 - 3k - 6. Let q be a(r). Suppose -2g + 7u - 3u + q = 0, -4g + 2u + 96 = 0. List the prime factors of g. 23 Let b = -95 + 380. Let r = -173 + b. List the prime factors of r. 2, 7 Suppose -202x + 204x - 154 = 0. What are the prime factors of x? 7, 11 List the prime factors of ((-26)/(-6))/((11/213)/11). 13, 71 Suppose -x = -4s + 24, 13 = -0x - 2x + s. What are the prime factors of x - -12 - (4 + -1)? 5 Let i be 5 - ((-8)/(-6) + 2/(-6)). Let l be ((-6)/9)/((-2)/21). Suppose -3c = -ij - 25, 0 = -4c - j + 1 + l. List the prime factors of c. 3 Suppose -2g = -5f + 3629, -6g - 1454 = -2f - 4g. What are the prime factors of f? 5, 29 Suppose 0 = f + 3 - 43. Suppose 2t + 169 = 3a, -5a + 281 = -0a - 4t. Let z = a - f. List the prime factors of z. 17 Suppose 18o - 20o + 608 = 0. List the prime factors of o. 2, 19 Suppose i + 3h - 250 = 6i, i + 50 = -5h. Let y = i - -113. List the prime factors of y. 3, 7 Let r be (-6)/9(7 + -4). List the prime factors of r - 67(-4 - -3). 5, 13 Suppose 0 = -2o - 2o + 3m + 531, m - 527 = -4o. List the prime factors of o - (-5 + 0 + 2). 3, 5 Suppose 0 = 9s - 8s - 6. Suppose -so - 270 = -9o. What are the prime factors of o? 2, 3, 5 Let s = 11 + -8. Suppose 0 - 3 = -sn. List the prime factors of 55/102n. 11 Let x be 4/8 + 7/(-2) - -2. List the prime factors of (x/(-3))/(11/660). 2, 5 Let w(g) = g3 - 17g*2 + 4g - 18. Let r be w(17). Suppose 0 = -7x + 12x - r. What are the prime factors of x? 2, 5 Suppose 98 = -5y - 42. List the prime factors of (-8)/y - (-122)/14. 3 Let c(j) = 2j - 7. Let t(k) = k - 1. Let h(y) = -c(y) + 5t(y). Let d(n) = n2 - 7n - 1. Let r be d(8). What are the prime factors of h(r)? 23 Let a(f) = 2f + 2f - 10 + 15 + f*3 - 14f*2 + 0f*3. What are the prime factors of a(14)? 61 Suppose -3u = -14u + 1815. What are the prime factors of u? 3, 5, 11 Suppose t + 4p + 0p + 6 = 0, 0 = t + 5p + 9. Suppose 0 = -tb + 19b - 468. What are the prime factors of b? 2, 3 Let u(q) = 7 - 6 + 12q + 58q. List the prime factors of u(1). 71 Suppose 0 = -8x + 110 - 22. Let g = x - 7. Suppose h + gd + 102 = 3h, 4d + 212 = 4h. What are the prime factors of h? 5, 11 List the prime factors of ((-32)/(-20))/((-76)/(-181735)). 2, 1913 Let p be (-405)/(-10) + 2/(-4). Let d be (2/9)/(7/63). Suppose p = dr - 56. What are the prime factors of r? 2, 3 Suppose -14z + 47171 - 12367 = 0. List the prime factors of z. 2, 11, 113 Let p be 136/(-6)3 + 1. Let o be p(0 - 1) + 3. Let r = o - 39. What are the prime factors of r? 31 Suppose -3d + 4d + 144 = o, -606 = -4o - 2d. What are the prime factors of o? 149 Suppose 8g + 683 - 1867 = 0. List the prime factors of (1870/8)/1 - (-37)/g. 2, 3, 13 Let x be (-86)/(-18) + (-2)/(-9). Let q(u) be the second derivative of u5/20 - u4/3 + u*3/6 + 5u*2/2 + u - 8. List the prime factors of q(x). 5, 7 Let m(x) = 3x*2 + 5x - 4. Let h = -30 - -33. Suppose o + 4p + 0 = -5, -ho + 5p + 19 = 0. What are the prime factors of m(o)? 2, 19 Let x(y) = y2 - 15y - 6. What are the prime factors of x(-18)? 2, 3, 7 Suppose -m = -2w, 1 = -2w - 1. Let q(d) = 29d2 - 3d - 8. List the prime factors of q(m). 2, 3, 19 Let f = 1 + -1. Suppose f = 8x - 10x + 182. List the prime factors of x. 7, 13 Let b(w) = 6w - 16. Let n be b(7). Let k = n + -26. Suppose 2a - 4p = -kp + 28, 0 = 5a + 2p - 94. What are the prime factors of a? 2, 3 Let i(h) = 9h2. Let f be i(-1). Suppose -5t = 2s + 5, -4s = 5t - t + 16. Let k = s + f. List the prime factors of k. 2 Suppose 2s - 8 = 0, 0 = -k - 5s + 926 + 498. List the prime factors of k. 2, 3, 13 Let g(l) = -194l - 360. What are the prime factors of g(-4)? 2, 13 Suppose 2q - 95 = -3k, -2q - k - 13 + 110 = 0. Let h = 70 - q. What are the prime factors of h? 3, 7 Suppose -12 = -3t, -3t - 500 = 5n - 6662. List the prime factors of n. 2, 3, 5, 41 What are the prime factors of ((-627)/132)/(3/(-168))? 2, 7, 19 Let t(p) = -8p + 7. Let b be t(-15). Let j = b + -66. List the prime factors of j. 61 Let c(t) = t2 - 12t + 31. Let x be c(-7). Suppose 6p - 2024 = -x. What are the prime factors of p? 2, 5, 31 Let y = -99 + 230. List the prime factors of y. 131 Let h = 79 + -99. Let b = 29 + h. What are the prime factors of b? 3 What are the prime factors of (-36)/63 - ((-7836)/14)/3? 2, 3, 31 Suppose 3l + s = 1855, 5l - 2719 = 4s + 401. What are the prime factors of l? 2, 5, 31 Suppose 2p + 0o - o = 19, 0 = -3o + 3. Suppose -37 = -3l - 4z + 13, p = 3l - 4z. Let j = l + 5. List the prime factors of j. 3, 5 Suppose -w + 0w - 11943 = -5v, -v = -5w - 2379. List the prime factors of v. 2389 Let t(a) be the second derivative of -29a5/5 - a4/6 - a3/3 - a2/2 - 15a. List the prime factors of t(-1). 5, 23 Let u = 3378 + -1781. What are the prime factors of u? 1597 Let g(m) = m + 4. Let r be g(6). Let z = 8 - r. What are the prime factors of (12 + 12)/((-3)/z)? 2 Let g(j) = -j*2 - 21j - 8. Suppose 3r - 5w = -1, -r - 4w = 15 + 8. What are the prime factors of g(r)? 2, 3, 5 Suppose 0s - 2066 = -2s - 4m, 0 = 5s + 4m - 5165. What are the prime factors of s? 1033 Let x = -12 + 17. Let v be (-2)/x - 187/(-5). Let i = v + -21. List the prime factors of i. 2 Let s(r) = r - 12. Let z be s(9). What are the prime factors of ((-108)/16)/3*8/z? 2, 3 Sup	{ "pile_set_name": "DM Mathematics" }
is greater: v or 1624? 1624 Suppose 33q + 240 = 90q + 1209. Which is bigger: q or 22? 22 Let p = 3962 - 3826.45. Let f = p - 135. Which is smaller: f or 0? 0 Let i be 0 - (0 + 2) - -2. Let l be -8 + 11 - 1/(-2 - -1). Let n be l/(-6) - 22/(-21). Are i and n nonequal? True Let y be (-43 + 1)(-5)/15. Let g be (-4)/y + 264/826. Which is greater: 1 or g? 1 Let y = -3113 + 3107. Do y and 273 have the same value? False Let u = 0.0801 - 38.4801. Let f = 2 - 42. Let p = u - f. Which is smaller: p or 0? 0 Suppose 40p - 57 = 41p. Let j = p + 57. Suppose -v + 7 + 10 = 0. Which is greater: v or j? v Let y(z) = 8z*3. Let c be y(-1). Let o = 39 + -39. Suppose 0 = -2f + 4m + 8, 4f + o = -5m - 36. Which is greater: f or c? f Suppose 598q - 623q = -7700. Which is bigger: 7086/23 or q? 7086/23 Let j be (-256)/(-1998) + 134/(-2479) - 58/54. Is j <= 4/1255? True Suppose -7g = -13g. Suppose g = 8y - 59 + 3. Which is smaller: y or 3? 3 Let p = -4193.1 + 4193. Does -8/55 = p? False Let p = 15248 - 4559162/299. Are p and 1 non-equal? True Let c = -5546 + 5509. Which is bigger: -0.9 or c? -0.9 Suppose -77 = 2y - 3y - 3c, 0 = -3y + 4c + 257. Let b(h) = 4h*2 - 197h - 67. Let f be b(50). Let d = y - f. Is d <= 1? True Let u be 0 + 4/(4/525). Let f = 3139/6 - u. Let a be (-154)/1001 + (-120)/(-273). Which is greater: f or a? a Suppose 3w + 2i = 3, -w - 7 - 9 = -5i. Suppose -48n - 12169 = 123n - 541. Which is smaller: n or w? n Suppose 9 = -2t + 29. Let y(o) = 8o3 - 105o*2 + 19o - 65. Let a be y(13). Which is smaller: a or t? t Suppose -3k = 4s + 8651, 5k + 278s + 14500 = 283s. Is 0.2 less than k? False Let s = -6213/2987 - -438/103. Let k = -2036 - -2038. Is k < s? True Let j(x) = -12 - 14x*2 + 3x - x*3 + 2x*3 + 15 - 2. Let g be j(14). Is 46 greater than g? True Suppose -56 = 30q - 2q. Let i(f) = -2f*3 + 3f*2 + 2f - 2. Let n be i(q). Which is greater: n or 27? 27 Let v = 39523/2481394 + -10/661. Which is greater: 0 or v? v Let k(o) = o*3 + 10o*2 - o - 10. Let s = 38 - 48. Let l be k(s). Suppose -5c + lc + 3j - 4 = 0, -4c - 2j - 12 = 0. Which is smaller: c or -7/9? c Suppose -3q - 3h + 12 = 0, -4h = -2q - 5h + 5. Which is bigger: q or -62/363? q Let j = 49048 + -48606574/991. Do 0 and j have the same value? False Let i = -73.81 - -73.81. Is 3/64 less than or equal to i? False Suppose -171 = 2o - 1399. Let l = -601 + o. Suppose 3n - 6n = 5u - 42, 3u = -4n + 23. Is l bigger than u? True Let j = 11 + -10. Let l be 3/(12/80)j. Suppose -5x = 5g - 50, -6g + 4g - 3x = -l. Is g at least as big as 0.2? True Let r = -40328036064/43 - -30196628691653/32207. Let p = 281626 + r. Let a = -3/107 - p. Which is bigger: -0.048 or a? -0.048 Let y = 1227.8 - 1228. Let m = -21 - -19.6. Which is greater: y or m? y Let v(x) = -2x + 10. Let q be v(7). Let g = q - -3. Let a be -1 - (15/(-30))/(7/4). Which is bigger: a or g? a Suppose 4937b - 2142 = 5063b. Let k(x) = -23x + 1. Let y be k(1). Which is smaller: b or y? y Let h(q) = q2 - q. Let g be h(-2). Suppose -2o + f + 3f + 412 = 0, o + 3f = 221. Let c be o/2438 + (-188)/46. Which is smaller: g or c? c Let s = 90.9455 - -0.0545. Let p = s + -90.973. Which is smaller: 2/7 or p? p Suppose 2 = -20o + 82. Suppose -4 = og, 5a + 53 + 79 = -2g. Let w(p) = 5p + 3. Let n be w(-6). Are a and n equal? False Let h(w) = w2 + 39w - 1183. Let x be h(-59). Let g be (2 + (-16)/3)(-6)/(-4). Is g bigger than x? False Suppose -5215a - 25080 = -5203a. Is -2083 equal to a? False Suppose 0 = 2d + z - 0 + 243, -2d = -4z + 268. Which is smaller: -117 or d? d Suppose 0 = 3o - 10o + 1932. Let z = o + -276. Is z greater than -30/49? True Let c be 5600/(-650) + 6/9. Do -8 and c have the same value? False Let m = 19.552 - 19.3. Let h = -3.252 + m. Which is smaller: h or -8/5? h Suppose -2g + i - 1 = 0, 0 = -26g + 24g + 2i - 4. Which is bigger: 1/2197 or g? g Suppose -5h + 4p = 254, 56 + 48 = -2h + 4p. Let x be (-3)/((-81)/h)1518/(-92). Is x at most 30? False Let r = 1621828/494475 + 2/19779. Let a = -17908/5475 + r. Which is smaller: a or 1? a Let a = 215 + -3271. Is -21384/7 at most a? False Let i = -227 - -366. Let t = i - 139.1. Do -101 and t have the same value? False Suppose 0 = 5k - 9 - 56. Suppose 0 = 5g + i - 1, 0 = 6g - g + 5i - 5. Suppose 0 = -2v - 3d + 19, -4d + 6d + 6 = g. Is k at least v? False Let r be 4/(-8)6 - (28848/45)/8. Is -83 bigger than r? True Let c(v) = 4v - 70. Let b be c(18). Let n be -2b/(-4)-1. Which is smaller: 2/299 or n? n Let r be (-48)/(-3 - -11) + (-18 - -18). Which is smaller: -1648 or r? -1648 Let p = 114779/3 - 39409. Is p at most as big as -1150? False Let g be -1 + ((-50)/(-5))/(32/(-500)). Which is greater: g or 1? 1 Suppose -3g + z - 275 = 0, 0 = -0g + g + 3z + 105. Let t be (-1 + g/(-90))(-840)/(-96). Do t and -1 have the same value? False Let v = 72.1021 + 0.0979. Let n = 80.2 - v. Which is smaller: n or 14/5? 14/5 Let j = 36 - 26. Let u(z) = 11z*2 - 10z + 5z + 4 - 3z + 14 - z*3 - 30. Let f be u(j). Which is bigger: 0.5 or f? f Let r = 237.5 + -322.5. Is -0.1 at least r? True Let h be 10(-2)/(-4). Let f = -416.6 - -81.6. Let k = 356 + f. Is k bigger than h? True Let d = -14449/6 + 2401. Let k = d + 20/3. Which is bigger: k or 90? 90 Let n be -3(-1)/6(-1800)/(-4950). Let q(l) = -l2 - 9l - 8. Let i be q(-6). Suppose -2j = -y + i, 3y = y + 3j + 15. Do n and y have the same value? False Let r be ((-11478)/(-21))/(180/(-252)). Which is smaller: -766 or r? -766 Let d(l) = l3 + 8l*2 + 12l - 1. Let i be d(-6). Let x be (-3 - (-282)/92)/((-96)/64)4. Which is smaller: i or x? i Let v be (31886/(-1070))/(3/(-45)). Is 455 != v? True Suppose -43h + 42h - 7 = -5c, -3c + 3 = -h. Let s(b) = 3b*3 - 4b*2 + b. Let d be s(2). Which is smaller: h or d? h Suppose 0 = -21s + 30s - 36. Let q be (-10 + (-556)/(-56))/((-22)/s). Which is smaller: 0 or q? 0 Let i(z) = -4z - 57. Let h be i(-28). Let s be (-4)/(-5 + h/15). Let d be (-1)/2s(-153)/(-81). Which is smaller: d or -2? d Suppose -4 = -h + 1. Suppose 0 = -hc + y - 15, c + 3 = -0y - 5y. Let l be (0 - 3/(-162)c)4. Which is greater: l or 1? 1 Let s(i) = 3i*2 - 32i + 47. Let o be s(9). Let t(v) = 24v2 - 2v - 1. Let u be t(-1). Suppose y - 58 = 4x, -y = ox - 71 + u. Which is smaller: 49 or y? 49 Let c(l) = -l*3 + 14l*2 + 12l + 47. Let s be c(15). Let m be (-1 + s)/(-111/(-2)). Which is bigger: m or 5? 5 Suppose 4g + 5j + 33 = 0, 5g + 43 = -5j + 8. Let s be (g - 12/(-9))/(12/(-54)). Is 36/13 smaller than s? True Suppose 7x - 119 = 343. Let w be x/18 - (-1 + 4). Which is smaller: w or 3/44? 3/44 Let r be 17/(-170) + (17913/(-390))/(-7). Which is smaller: -3/4 or r? -3/4 Suppose 3x = -17x - 4327 + 91707. Is 4368 not equal to x? True Let w = 13.1893 - 0.1893. Is 111 smaller than w? False Let a = 0 + -2. Let f = -20181 - -20235. Which is smaller: f or a? a Let j(p) = p*2 - 7p + 18. Let i be j(4). Suppose -341 - 145 = ir. Is r at least as big as -81? True Let d be (-2)/(-5) + (-63)/(-5). Suppose 640q - 636q = 712. Suppose -24r + q = -182. Is r equal to d? False Let h = 53 - -38. Let f = 111 - h. Let q(n) = -n*2 + 19n + 19. Let k be q(f). Which is smaller: k or -2/147? k Suppose 2 - 22 = 2y. Let c = 24 + 16. Let q = c + y. Do q and 31 have the same value? False Let r be -1311/(-9)-423. Which is greater: -3665/6 or r? -3665/6 Let j = -4127 - -4126.293. Is -2/9 < j? False Let o = -16 + 1. Let q be 10 + -5 - (-6 - -1). Let w be ((-2)/q + (-9)/180)1. Which is smaller: o or w? o Suppose 243u = 248u - 1805. Let r = u + -532. Is -172 at most r? True Let w = -1227 + 94477/77. Let b be (-345)/20-1 + (-1)/4. Let z be ((4/(-6))/(b/51))/2. Which is smaller: z or w? z Let y(r) = -26r2 + 14r + 15. Let b be y(-1). Let s be ((-45)/b)/92. Is s at least -24/19? True Let n be (-3 - -4)(0 - 6). Let d be 1/(n/(-4068)-3). Which is greater: d or -225? -225 Let m = 14 - -2. Suppose -c - mc + 34 = 0. Is 2 smaller than c? False Suppose -25y - 7890 = -8y + 5387. Are -773 and y nonequal? True Let j be 1-4(-58)/8. Let a = -1/409 + 22497/818. Is a greater than j? False Let a be (-85)/(-25) + (-4)/10. Suppose -3h + 14 = 2, 4h	{ "pile_set_name": "DM Mathematics" }
e power of 1/2, to the nearest integer? 2318 What is 13350161 to the power of 1/2, to the nearest integer? 3654 What is the third root of 31073141 to the nearest integer? 314 What is the fifth root of 12115857 to the nearest integer? 26 What is the sixth root of 1334668 to the nearest integer? 10 What is the third root of 11215685 to the nearest integer? 224 What is the cube root of 366247 to the nearest integer? 72 What is the square root of 1506424 to the nearest integer? 1227 What is the third root of 1697755 to the nearest integer? 119 What is the eighth root of 1803389 to the nearest integer? 6 What is the third root of 11012525 to the nearest integer? 222 What is the cube root of 3235778 to the nearest integer? 148 What is the third root of 945185 to the nearest integer? 98 What is the square root of 3190252 to the nearest integer? 1786 What is the fourth root of 26581 to the nearest integer? 13 What is the ninth root of 1577127 to the nearest integer? 5 What is 68995 to the power of 1/4, to the nearest integer? 16 What is 3534426 to the power of 1/2, to the nearest integer? 1880 What is the seventh root of 108951 to the nearest integer? 5 What is the square root of 245795 to the nearest integer? 496 What is 146090 to the power of 1/9, to the nearest integer? 4 What is 106725 to the power of 1/8, to the nearest integer? 4 What is the cube root of 156715 to the nearest integer? 54 What is 19218689 to the power of 1/2, to the nearest integer? 4384 What is the square root of 64857 to the nearest integer? 255 What is 650334 to the power of 1/2, to the nearest integer? 806 What is the cube root of 1070762 to the nearest integer? 102 What is the seventh root of 108893 to the nearest integer? 5 What is the square root of 515792 to the nearest integer? 718 What is 160196 to the power of 1/2, to the nearest integer? 400 What is 241609 to the power of 1/2, to the nearest integer? 492 What is 7893 to the power of 1/5, to the nearest integer? 6 What is 423991 to the power of 1/2, to the nearest integer? 651 What is the third root of 2022881 to the nearest integer? 126 What is 4524446 to the power of 1/2, to the nearest integer? 2127 What is the fourth root of 327296 to the nearest integer? 24 What is 424815 to the power of 1/10, to the nearest integer? 4 What is 3252596 to the power of 1/2, to the nearest integer? 1803 What is the square root of 5373582 to the nearest integer? 2318 What is 1392955 to the power of 1/3, to the nearest integer? 112 What is 2073226 to the power of 1/2, to the nearest integer? 1440 What is the third root of 27651885 to the nearest integer? 302 What is the cube root of 56314 to the nearest integer? 38 What is 669426 to the power of 1/2, to the nearest integer? 818 What is 46372 to the power of 1/3, to the nearest integer? 36 What is the eighth root of 5050030 to the nearest integer? 7 What is the square root of 787718 to the nearest integer? 888 What is 540275 to the power of 1/3, to the nearest integer? 81 What is the cube root of 9715899 to the nearest integer? 213 What is the seventh root of 155518 to the nearest integer? 6 What is 7229258 to the power of 1/3, to the nearest integer? 193 What is 5284846 to the power of 1/2, to the nearest integer? 2299 What is the seventh root of 1394215 to the nearest integer? 8 What is the fifth root of 994119 to the nearest integer? 16 What is the third root of 375329 to the nearest integer? 72 What is the square root of 5965130 to the nearest integer? 2442 What is 555276 to the power of 1/3, to the nearest integer? 82 What is the cube root of 293898 to the nearest integer? 66 What is the fourth root of 321725 to the nearest integer? 24 What is the third root of 8531236 to the nearest integer? 204 What is 14696552 to the power of 1/2, to the nearest integer? 3834 What is 544834 to the power of 1/2, to the nearest integer? 738 What is the square root of 9136395 to the nearest integer? 3023 What is 11001960 to the power of 1/3, to the nearest integer? 222 What is 765816 to the power of 1/5, to the nearest integer? 15 What is the cube root of 237084 to the nearest integer? 62 What is the third root of 27837733 to the nearest integer? 303 What is the tenth root of 214818 to the nearest integer? 3 What is 5173030 to the power of 1/8, to the nearest integer? 7 What is the cube root of 3367001 to the nearest integer? 150 What is the cube root of 33153 to the nearest integer? 32 What is the square root of 4234187 to the nearest integer? 2058 What is the fifth root of 33740 to the nearest integer? 8 What is 4995302 to the power of 1/6, to the nearest integer? 13 What is the square root of 121681 to the nearest integer? 349 What is the fourth root of 1633219 to the nearest integer? 36 What is 585739 to the power of 1/2, to the nearest integer? 765 What is 1065809 to the power of 1/5, to the nearest integer? 16 What is 11396355 to the power of 1/2, to the nearest integer? 3376 What is the fifth root of 1923375 to the nearest integer? 18 What is 802327 to the power of 1/3, to the nearest integer? 93 What is 635890 to the power of 1/4, to the nearest integer? 28 What is the cube root of 87165 to the nearest integer? 44 What is the square root of 723130 to the nearest integer? 850 What is the square root of 11036159 to the nearest integer? 3322 What is the square root of 2470322 to the nearest integer? 1572 What is the fourth root of 259033 to the nearest integer? 23 What is 1582864 to the power of 1/2, to the nearest integer? 1258 What is 10523682 to the power of 1/2, to the nearest integer? 3244 What is the ninth root of 414825 to the nearest integer? 4 What is 111294 to the power of 1/3, to the nearest integer? 48 What is 236193 to the power of 1/5, to the nearest integer? 12 What is the square root of 1884630 to the nearest integer? 1373 What is 2175570 to the power of 1/2, to the nearest integer? 1475 What is the third root of 211079 to the nearest integer? 60 What is the cube root of 1870068 to the nearest integer? 123 What is the fifth root of 154165 to the nearest integer? 11 What is 104937 to the power of 1/3, to the nearest integer? 47 What is the square root of 1601031 to the nearest integer? 1265 What is the ninth root of 1598837 to the nearest integer? 5 What is the cube root of 252002 to the nearest integer? 63 What is the third root of 672621 to the nearest integer? 88 What is the eighth root of 46764 to the nearest integer? 4 What is 8984201 to the power of 1/3, to the nearest integer? 208 What is the square root of 478652 to the nearest integer? 692 What is the third root of 8934223 to the nearest integer? 208 What is the square root of 854098 to the nearest integer? 924 What is 7119079 to the power of 1/3, to the nearest integer? 192 What is the cube root of 694803 to the nearest integer? 89 What is 797189 to the power of 1/3, to the nearest integer? 93 What is 269733 to the power of 1/5, to the nearest integer? 12 What is 3285532 to the power of 1/3, to the nearest integer? 149 What is the square root of 396337 to the nearest integer? 630 What is 3684020 to the power of 1/5, to the nearest integer? 21 What is 142763 to the power of 1/3, to the nearest integer? 52 What is 44242552 to the power of 1/3, to the nearest integer? 354 What is the third root of 112468 to the nearest integer? 48 What is 1908292 to the power of 1/2, to the nearest integer? 1381 What is the cube root of 6864561 to the nearest integer? 190 What is the square root of 842891 to the nearest integer? 918 What is the third root of 4550041 to the nearest integer? 166 What is the fifth root of 628018 to the nearest integer? 14 What is 32117 to the power of 1/2, to the nearest integer? 179 What is the cube root of 2782476 to the nearest integer? 141 What is the cube root of 3659258 to the nearest integer? 154 What is 7889285 to the power of 1/2, to the nearest integer? 2809 What is 1383678 to the power of 1/5, to the nearest integer? 17 What is the square root of 863978 to the nearest integer? 930 What is the third root of 196633 to the nearest integer? 58 What is the cube root of 3775905 to the nearest integer? 156 What is 2062017 to the power of 1/7, to the nearest integer? 8 What is the seventh root of 560	{ "pile_set_name": "DM Mathematics" }
= l - 3l, 3l - 136 = -xw. Solve 0 = 4h - 11 + w for h. -5 Suppose 4n + 3n - 140 = 0. Suppose 6b = 2b + 3g - 12, 5b - 5g + n = 0. Solve 2x - 4 = -b for x. 2 Let s = 40 - 13. Suppose 4n - s = n. Suppose -n = -4o + 23. Solve og - 15 = 3g for g. 3 Let b be (-75)/(-100)(4 - 76/(-3)). Solve -b = 4z - 30 for z. 2 Let r(j) = -j*2 + 12j + 72. Let z be r(16). Solve 0 = -11h - h + zh for h. 0 Let u = -2 - -11. Let v(b) = -b*3 + 9b*2 - b + 12. Let z be v(u). Let p(c) = -4c*3 - 2c*2 + 2c. Let q be p(-2). Solve -s - zs = q for s. -5 Suppose -6b = -15 - 15. Solve -v + 8 = -bv for v. -2 Let n = 162 + -158. Solve 2 = -ni + 2i for i. -1 Let p(x) = x3 - x2 + x + 12. Let j be p(0). Suppose -3t + j = 6. Solve -n + tn = -4 for n. -4 Let u(b) = -b2 - 18b - 17. Let g be u(-17). Suppose g = -12a + 9a + 6. Suppose -2s + r = -r + 2, 45 = 5s + 5r. Solve -2y = ay - s for y. 1 Suppose -3y + 19 = 1. Solve -yu + u = 0 for u. 0 Suppose 3 + 1 = u. Let n(g) = -6g + 8. Let k(a) = a + 1. Let x(b) = 5k(b) + n(b). Let i be x(7). Solve -uq + 7q + i = 0 for q. -2 Suppose j = -5x + 4j + 27, 4j = -x - 13. Suppose -3s = -5b + 39, -b - 4s + s + 15 = 0. Solve -xc - b = 6 for c. -5 Suppose z = -6z - 14. Let q(f) = -11f - 5. Let s be q(z). Solve -3 = 5m + s for m. -4 Let n be (-1 - -2)(4 + -2). Let x be (5/(-4))/(n/8). Let q be (8/(-20))/(1/x). Solve 2h + qh = -20 for h. -5 Let a(t) = -3t - 24. Let s be a(7). Let z = 48 + s. Solve -10 = zg + 2g for g. -2 Suppose -2w = 3d + 3, -2w = -4w + 5d - 27. Let v be (-260)/(-22) - w/33. Suppose -3o = g - v, 2o + 2o = 2g + 16. Solve -2f + o = -0 for f. 2 Suppose -9j = -12j + 78. Let v = j - 25. Solve -v + 2 = z for z. 1 Suppose 0 = -4b + 4j + 64, 2b + 2j - 23 = j. Let w(l) be the first derivative of -l2/2 + 15l + 112. Let z be w(b). Solve -zf = -7f for f. 0 Suppose -4j + 4n + 23 + 1 = 0, 3j = 4n + 22. Let y be (0/(-2))/(-94 - -95). Solve y = -f - f - j for f. -1 Let d(u) = -u + 8. Let k be d(2). Suppose 8j - 16 = kj. Solve -v + 5v = -j for v. -2 Let c(k) be the first derivative of -k3/3 - 9k*2/2 - 9k - 10. Let n be c(-7). Solve -nq + 20 + 0 = 0 for q. 4 Suppose -3v - v + 4 = 0. Let n be 14/4((-12)/(-14))/(300/400). Solve -t + v + n = 0 for t. 5 Let x = -11 - -16. Suppose -15n + 7n = 0. Solve xa - 4a + 5 = n for a. -5 Let i = 28 - 21. Suppose -4g = -ig. Suppose g = 4h - 4y + 8, -2h - 4y = h - 8. Solve h = 2r + 4 + 4 for r. -4 Let v(s) be the third derivative of s4/24 - s3/2 - 2s2. Let t be v(3). Let z be 102/5 + 18/30. Solve 4y - 1 + z = t for y. -5 Let x = 653 - 358. Solve xh - 296h = 0 for h. 0 Let j(y) = 5y - 73. Let s be 873/51 + (4 - (-280)/(-68)). Let l be j(s). Solve l = -g - 2g for g. -4 Suppose 0 = -17r + 218 - 184. Solve -37 + 31 = -rx for x. 3 Let j(f) = 3f + 4. Let a(l) = -4l - 3. Let c(k) = -2a(k) - 3j(k). Suppose -4m - 2g = 38, 27 = -2m - 4g - 1. Let v be c(m). Solve vn = -4 - 4 for n. -4 Suppose 2d + 0d = 600. Suppose -5s + d = -0s. Suppose 2g + s = 2l + 2l, 60 = 4l + 5g. Solve u - 6u = l for u. -3 Suppose 2m - 8f - 49 = -9f, -29 = -2m + 3f. Solve 26q = mq + 8 for q. 2 Suppose 0 = -3k + 9 - 0. Suppose -3y + 4 = -y. Solve -yb + k = -3 for b. 3 Let b = 18 + -17. Solve -c - b = 3 for c. -4 Suppose 0 = 4y - 9y + 10. Let r = 32 + -26. Solve 4 + r = -yo for o. -5 Suppose -3m - 5c = 4, 5c - 2c = 3. Let n(i) = -i + 9. Let l be n(8). Let j be m/6-4 - l. Solve 4a - 3 - j = 0 for a. 1 Let j = -37 - -33. Let t be (-155)/(-10) - 3 - (-6)/j. Solve 5l = -t - 4 for l. -3 Suppose -4s + 13 = n, n - 2n - 23 = -5s. Suppose -2c - 2 = -s. Let y be c/(1 - (-3)/(-6)). Solve -ym + 3 = -3m for m. -3 Let c(w) = -w2 - 11w - 5. Let n be c(-9). Let t(g) = g*3 - 14g*2 + 13g + 3. Let f be t(n). Solve -f = -0h + 3h for h. -1 Let c be -6((-24)/(-16) - (-1 - -1)). Let p be ((-28)/(-3))/((6/c)/(-1)). Solve -2q + p = 6 for q. 4 Suppose -4b + 2h + 3h = -28, -8 = -2h. Let n = b - 9. Let o be 0 + 3/(-3) + n. Solve -4 = 6k - ok for k. -1 Let h(m) = -m - 3. Suppose -4j - 89 = -41. Let u be h(j). Solve -5v + uv = 8 for v. 2 Suppose z = -2, 1 = k + 5z + 10. Let s be (k - 4)(-5 + 2 + 2). Solve -12 = -3c + s for c. 5 Let w = -290 - -293. Solve -wr = 2r + 20 for r. -4 Suppose 52 - 22 = 6l. Suppose ly + 10 = 0, 2p - 4y + 4 = 5p. Solve 0 = pv + 11 + 1 for v. -3 Let n(g) = 15g + 65. Let i(u) = 5u + 21. Let d(o) = 17i(o) - 6n(o). Let j be d(-9). Solve t + 17 - j = 0 for t. -5 Suppose 0 = 3w + 5q - 5, -q + 4 = -4w + 26. Let f = -141 + 147. Suppose 8o = wo + f. Solve o = 3z - 4 for z. 2 Let w be ((-2)/(-5))/((-4)/(-20)). Let t be (10/(-4) + w)-4. Solve tg + 3g = -10 for g. -2 Suppose 4o = -3g + 43, -4o + g = 21 - 60. Solve or - 25 = 5r for r. 5 Let u(a) = a*3 - 12a*2 - 14a + 20. Let j be u(13). Solve ji + 3 = 17 for i. 2 Suppose -z = -4s + 12 + 1, -6 = 2z - 3s. Solve 9b - 8b - z = 0 for b. 3 Let u = 26 - 23. Suppose -ut + 8 = -t. Suppose tn = -v - 0v + 18, 5v + 20 = 2n. Solve -3h = -nh + 2 for h. 1 Let x(t) = -t2 + 10t - 6. Let k be x(7). Let v = -6 + k. Suppose 0 = -3u + v + 9. Solve b = -b + u for b. 3 Suppose q = 5k + 22, 2 - 5 = -4q + 3k. Let f(i) = i + 7. Let a be f(q). Suppose 0p = 4u - ap - 4, -2p = -4u + 10. Solve -uh + h = 3 for h. -1 Suppose 1 = 10c + 1. Solve p + 0p = c for p. 0 Let z = 0 - 0. Let a be 14 + 69 + -70 + 0. Solve -an + n - 8 = z for n. -4 Suppose -m - 80 = -4p + m, 2p - 56 = -3m. Let h = -19 + p. Suppose -f + 17 = -4x, -6x + hx + 1 = 2f. Solve -4g = g + f for g. -1 Let g = 71 + -53. Solve 4t - g = 10t for t. -3 Suppose -w + 6w - 28 = -u, u + w = 8. Suppose 14 = s - us. Let n = s + 9. Solve 5t = -n + 27 for t. 5 Let x be (-3 - -1 - -5) + 14 + -10. Solve x = 5s - 3 for s. 2 Let u(i) = i3 - i2 + 1. Let v be u(2). Suppose -4h + 5s + 16 = 0, -h + 15s + 4 = 13s. Solve -hw + 17 = v for w. 3 Let p be 0 + (-3 - (-1)/(-1)). Let q(x) = -3x - 11. Let k be q(p). Let w be (-12 - 5)/(k/(-1)). Solve -3 = -5f + w for f. 4 Let z = -40 - -42. Let m be -1 - 6z/(-4). Solve mj - 3 = 5 for j. 4 Let f be 0 + -1 + (12/2)/1. Solve -2a - f - 5 = 0 for a. -5 Let r be 1/((-1)/243). Let u be r/24 + (-1)/(-3). Solve -4v + 1 + 3 = u for v. 1 Let m(q) = 13q + 75. Let t(l) = -39l - 226. Let x(p) = -7m(p) - 2t(p). Let d be x(-6). Solve -n + 0n + d = 0 for n. 5 Suppose -2q - 2q = -120. Solve h + 5h + q = 0 for h. -5 Suppose 63 = -b - 0b + 3p, -2p - 8 = 0. Let h = b - -76. Solve g + 3 = -h for g. -4 Let u be 3/2 + (-98)/(-196). Solve ut + 164 = 166 for t. 1 Let c(f) = -f*2 + f + 2. Let o be c(2). Let b = 2197 - 2195. Solve o = -5r + 3 + b for r. 1 Suppose 2v = 3j - 44 + 1, 3v = 4j - 59. Solve -1 - j = 3f for f. -4 Let t be (1 - (0 - 0))/((-1)/(-4)). Suppose g + tg - 100 = 0. Solve 5x - g = x for x. 5 Suppose -4z + 2g - 16 = -3g, 0 = 3z - g + 1. Solve -3v = 2 + z for v. -1 Let p(o) = -o*2 - 8o + 14. Let a be p(-9). Suppose 2i + i - d = 31, -ad + 25 = 0. Let g = 0 - -5. Solve -r + gr - i = 0 for r. 3 Let q = -16 + 6. Let z be q5/((-100)/8). Solve -15 = -zi - i for i. 3 Suppose 0 = 3c - 41 + 5. Suppose m = -25 + 30. Suppose -o - 24 = -4d + 3o, -12 = d + mo. Solve -dt + c = t for t. 3 Let r(w) = -w*3 + 59w + 7. Let j be r(7). Solve j - 68 = -3s for s. -3 Let k be (23/7 - 0) + 20/(-70). Solve -km - 1 = -16 for m. 5 Let b(t) = -t*2 + 2t - 3. Let j be b(3). Let c be (2 + (-20)/15)/(j/(-27)). Solve -v = cv for v. 0 Suppose 236 = 5v - 169. Suppose 3j - 33 = -4h - 144, 4h + v = 3j. Let u be (6/(-5))/(h/60). Solve 0k = -uk for k. 0 Suppose -s - 4d - 17 = 0, 3s + 59 = d + 8. Suppose 3u + 105 = -2u. Let p = s - u. Solve -o - p = o for o. -2 Let c be (-3)/212/9. Let y(n) = -n. Let m be y(c). Suppose -3s + i = -6s + 34, -5i - 30 = -5s. Solve 0 = -mw + s for w. 5 Let z be 8 - -614/21. Solve -22 = zs + 38 for s. -5 Let d be 0(4/(-14) - (-85)/175). Solve w + 49 - 47 = d for w. -2 Let b be 26/8 + (-18)/(-24). Let w be 4/(0 - 8)b. Let u be 9w(-4)/6. Solve 0c - 4c = u for c. -3 Let a be (-2 + -2 - -3)/((-3)/9). Solve -a = -13r + 14r for r. -3 Let v(l) = -8*l +	{ "pile_set_name": "DM Mathematics" }
12014 = yf - 17f. Is f composite? False Suppose -3p + 27880 = -p + r, -5p = 4r - 69703. Is p composite? True Suppose 5g + 2x - 91977 = 0, g + 5x = 14919 + 3458. Is g a composite number? False Let m = 31840 + -12251. Is m composite? True Let z(v) = -v*3 + v + 2. Let u be z(0). Suppose 0 = -3t - 3o + 33, -o - 5 = -ut + 26. Is t/(-63) + (-3874)/(-18) a prime number? False Suppose 0 = 5p - 15, -5 + 17 = -5x + 4p. Suppose x = -10o - 38754 + 106444. Is o prime? False Let h = 142 + -142. Let g = 11 + -7. Suppose j + gj - 1675 = h. Is j composite? True Let r(y) = -1463y + 7. Let u be r(-3). Suppose a = 5a - u. Is a a composite number? True Let a be (6/412)/2. Is 3679/a + 8/36 composite? False Suppose y = 2q + 546, 368 = -q + y + 94. Let j = q + 1543. Is j composite? True Let j be 8 + 4 + 3 + 1. Suppose -5g + 0f = 2f, 2g = -4f + j. Is (1036/(-5 + 3))/g a composite number? True Let d = 102968 - 65979. Is d composite? True Let u(i) = -i*2 + 4i + 11. Let c(t) = t*3 - 9t*2 + 7t + 14. Let k be c(8). Let b be u(k). Let x(q) = -249q + 2. Is x(b) composite? False Suppose -4 = -0v + 4v. Let c = 4 + v. Suppose 618 = cl + 5o, -3l = 2l - o - 1058. Is l a composite number? False Let w(b) = 16608b + 11. Is w(1) a prime number? True Suppose -4j - 22 = -2r + 4r, 5r - 4j = 1. Let g be (1 + r/4)12. Suppose -2u = -gh + 1397, u - 506 = -5h + 1831. Is h a prime number? True Let p be (-21)/(-1)(-4)/6. Let q = -11 - p. Suppose 0 = -qk + 6k - 186. Is k a prime number? False Suppose 2v + h = 17879, 2h = -8v + 7v + 8941. Is v composite? True Suppose 6u = -3q + 3u + 83454, 4u - 27827 = -q. Is q composite? True Let w = -6969 - -11925. Let c be w/36 - (-1)/3. Suppose -5i + 4a = 2a - c, -i = 2a - 18. Is i prime? False Let x be (-139)/(-3 - 366/(-123)). Suppose 2o - 4 = 0, 2a = 5a - 2o - x. Is a composite? False Is (4561/3)/((-12)/(-36)) a composite number? False Let j = -3 + 11. Let y = j + -41. Is (-5)/(5/2) - y a composite number? False Let u be 108/(-10)55/(-22). Let q = u - 21. Suppose 1016 = qp + 2p. Is p composite? False Let c be 463/((-1)/((-3)/3)). Suppose 0 = 3l - c - 263. Suppose 4j - 6j = -l. Is j prime? False Suppose 6o = 785172 + 40626. Is o composite? False Suppose d - 2o - o = 2519, 3o = -3d + 7605. Is d prime? True Let o = -49 - -51. Suppose 3h - 139 = -2a, 40 = 2a + oh - 104. Is a prime? False Let z = -1 - -3. Suppose 706 - 2088 = -zl. Is l a composite number? False Let v be (9/(-2))/(21/(-19768)). Let o = v + -2855. Is o composite? False Suppose -2p + 4p + 34 = 0. Is 0/p + 1764 + -1 composite? True Let y = -51900 + 125809. Is y a prime number? False Let r = 5 + -1. Suppose rz = 3z. Suppose -3c + 5a - 135 = -694, z = 3c + 3a - 519. Is c composite? True Let r(f) be the second derivative of -f3/6 + 9f*2/2 + 6f. Suppose p = 2p. Is r(p) prime? False Let n be (35/1)/(-6 - (-938)/156). Suppose -n = -12x + 714. Is x a composite number? True Let v(x) = -11x + 18. Let z be v(6). Let o be (z/10)/((-21)/70). Is 1608/o2/3 a prime number? True Let t(c) be the second derivative of 0 - 5c2 - 13/6c*3 - 4c + 5/6c4. Is t(8) a prime number? False Let z(i) be the third derivative of 0i + 3i2 + 7/12i*4 - 3/2i3 + 0. Is z(11) a prime number? False Let i(m) = m3 + 3m2 - 6m - 2. Let k be i(-4). Is ((-3)/k)/((-6405)/6402 + 1) a composite number? True Let s be (-5)/5 + 5 - -1. Suppose v + 4i - 8691 = 0, sv + 2i - 69052 + 25525 = 0. Is v prime? True Suppose -29v - 12345 = -26v. Let q = v + 8308. Is q a composite number? True Suppose -5o = -d + 133 + 913, -3d + o = -3096. Is d composite? False Let s(d) = 10d*2 + 23d + 6. Let y(x) = 31x2 + 70x + 17. Let o(p) = 7s(p) - 2y(p). Is o(7) a prime number? True Suppose 26b = 5x + 23b - 74012, x = -b + 14804. Is x a composite number? True Let o(f) = 3f*3 - 2f*2 - 69f - 33. Is o(20) a composite number? False Let y be (-4 - (-7 + 4))/(-1). Is 7/((1/433)/y) a prime number? False Let j(c) = -747c + 110. Is j(-19) a composite number? False Suppose -2545 = 5o - 210. Let s = -262 - o. Is s a prime number? False Let g(u) = 188u2 + u. Suppose -4q - 33 = 7. Let z = q - -9. Is g(z) composite? True Let g = -71 + 74. Is 5587/g + (80/15)/(-4) composite? False Let n(o) = o*3 + 31o*2 + 4o + 67. Is n(-21) a prime number? False Suppose -233c = -238c + 19895. Is c prime? False Let f(t) = t - 2. Let j be f(2). Suppose -12 = -5b + 4b + 2u, 3b - 2u - 16 = j. Suppose -3l = -3k + bl + 337, 3l - 12 = 0. Is k prime? False Let i(m) = m3 + 8m*2 + 8m + 4. Suppose -3w + 1 = -4l, 2l - l = 3w + 11. Let o be i(w). Suppose -607 = -2v + o. Is v composite? True Suppose 2b + 2o = -2o + 30, 4b - 20 = 2o. Suppose 2w = bw + 15. Is (w - -617)/(3 + -1) a composite number? False Suppose -468575 = -26l + l. Is l composite? False Let m = -3590 - -6525. Is m prime? False Suppose 0 = 18c - 14c - 134764. Is c a composite number? True Suppose -5g - 34017 = -4i + 174561, -3i - 3g + 156447 = 0. Is i prime? True Suppose 0 = -5s + 9s - 20. Suppose so - 1117 = 4o. Is o prime? True Let x = 122 + 249. Is x a composite number? True Suppose q = r + 1480, -q + 2q - 2r - 1479 = 0. Let z = -952 + q. Is z a composite number? True Suppose 0 = -4b + p + 117936, -6p + 5p - 58970 = -2b. Is b composite? False Suppose 3n - 4n = 5c - 19, 2n + 3c = 38. Let b = -22 + n. Is (201(b - -2))/(-1) a prime number? False Suppose -306 = x + j, 0x - 5j + 605 = -2x. Let z = -164 - x. Is z prime? False Is (-9)/(-18) + (34689/6 - 3) a prime number? True Is (1(-2396)/8)/((-17)/1462) composite? True Suppose 3p + 3873 = -p + 3g, 3g + 957 = -p. Let b = p - -1385. Is b a composite number? False Suppose -2q = 3q - 40. Let f(v) = 48v3 + 18v - 49v3 + 3v*2 - 5 + 3v*2. Is f(q) prime? True Suppose 0 = -2g - m + 25578, 0 = 15g - 11g + 4m - 51148. Is g prime? True Let r = 5356 + 607. Is r a prime number? False Let j be 2/(33/15 - 2). Is (1868/(-10))/((-4)/j) prime? True Let o = 14151 - 9568. Is o a prime number? True Let m(g) = -11g*3 + 3g*2 - 8g - 11. Suppose 11 = 2h + 17. Is m(h) a prime number? True Suppose 671 = -r - l + 3364, -2l - 4 = 0. Suppose 4s - 2793 - r = 2z, -4z = -5s + 6854. Suppose -3j + s = -j - d, 1350 = 2j + 5d. Is j a prime number? False Let w be -2 - (106/(-34) + (-2)/(-17)). Suppose w + 0 = -x, 3s - 6162 = 3x. Is s a prime number? True Let d = 20 - 17. Let c = 158 - d. Is c prime? False Suppose -3p - 18 = -0p. Let w = p + 1. Is (w + -6)/(1/(-5)) a prime number? False Suppose -x + 5 = 0, 0 = -5y - x + 5x - 10. Suppose 199 + 27 = i + 3k, 0 = -3i - yk + 643. Is i prime? True Suppose 96g = 106g - 159370. Is g composite? False Suppose -r = 2 + 2. Let c be r(-2 + 4/8). Suppose 4s + u - 136 = -49, c = 2u. Is s a prime number? False Let j(i) = 2i*2 + 3i - 8. Is j(-9) composite? False Let m(w) = -3w3 - 16w*2 + 10w - 19. Is m(-8) a prime number? False Suppose 2j + 4088 = 5j - 5x, 5443 = 4j + x. Is j a composite number? False Let j = 25578 + 39359. Is j a prime number? True Suppose h + 443 = 5790. Is h composite? False Let a = 20 - 16. Suppose ag - 5g = 2. Is g(-1)/((-8)/(-1628)) composite? True Let s = -1621 + 2451. Suppose 0 = 12r - 334 - s. Is r a composite number? False Let b be 4/(-20) + 80/25. Suppose -155 + 488 = bs. Is s a prime number? False Let j(w) = -75w + 2. Suppose 3u + 18 - 9 = 0. Let m be j(u). Suppose -5i + 488 = -m. Is i prime? False Let f = -20 + 22. Suppose 103 + 189 = c + 3h, fh - 604 = -2c. Is c composite? False Let p = -1512 + 3118. Suppose 5d - 836 = 3x, 3d - 341 = d - x. Suppose -p = -3r - d. Is r prime? True Let y(q) = -5643q - 356. Is y(-3) a prime number? True Suppose 2x + 3i - 976 = 0, 0x - i - 1966 = -4x. Is x prime? True Let l = -208 + 310. Suppose y - l + 13 = 0. Is y composite? False Suppose 0i - 2i + k = -7, -i - k + 2 = 0. Let n(r) = 6r + 8. Is n(i) a composite number? True Let s(d) = 1842d*3 - 4d*2 + d. Let y be s(1). Let z = -3308 + 2260. Let v = y + z. Is v composite? True Let i(r) = 5r*2. Let f be i(1). Suppose fd + 24 = 2c, -c - 14 = -6c + d. Suppose 4w - 119 = 3t + 323, c*w - t = 220. Is w p	{ "pile_set_name": "DM Mathematics" }
of 1/4, to the nearest integer? 5 What is 3325 to the power of 1/2, to the nearest integer? 58 What is the sixth root of 11609 to the nearest integer? 5 What is 31936 to the power of 1/8, to the nearest integer? 4 What is the square root of 34263 to the nearest integer? 185 What is 9930 to the power of 1/2, to the nearest integer? 100 What is the square root of 2482 to the nearest integer? 50 What is 77995 to the power of 1/2, to the nearest integer? 279 What is the eighth root of 23815 to the nearest integer? 4 What is 118502 to the power of 1/2, to the nearest integer? 344 What is the third root of 1671 to the nearest integer? 12 What is 8605 to the power of 1/2, to the nearest integer? 93 What is the cube root of 12159 to the nearest integer? 23 What is 60929 to the power of 1/2, to the nearest integer? 247 What is 76210 to the power of 1/3, to the nearest integer? 42 What is the cube root of 5242 to the nearest integer? 17 What is the third root of 9918 to the nearest integer? 21 What is the seventh root of 29676 to the nearest integer? 4 What is the fourth root of 4577 to the nearest integer? 8 What is 30521 to the power of 1/2, to the nearest integer? 175 What is 3202 to the power of 1/2, to the nearest integer? 57 What is the square root of 32081 to the nearest integer? 179 What is 9659 to the power of 1/2, to the nearest integer? 98 What is 942 to the power of 1/2, to the nearest integer? 31 What is the cube root of 1545 to the nearest integer? 12 What is 68712 to the power of 1/2, to the nearest integer? 262 What is the seventh root of 41489 to the nearest integer? 5 What is the fourth root of 2229 to the nearest integer? 7 What is the square root of 17021 to the nearest integer? 130 What is the square root of 2905 to the nearest integer? 54 What is 6550 to the power of 1/2, to the nearest integer? 81 What is the square root of 1132 to the nearest integer? 34 What is 866 to the power of 1/2, to the nearest integer? 29 What is the third root of 11648 to the nearest integer? 23 What is 58 to the power of 1/6, to the nearest integer? 2 What is 106267 to the power of 1/4, to the nearest integer? 18 What is 10697 to the power of 1/3, to the nearest integer? 22 What is 72130 to the power of 1/5, to the nearest integer? 9 What is 1057 to the power of 1/2, to the nearest integer? 33 What is 676 to the power of 1/2, to the nearest integer? 26 What is the third root of 12897 to the nearest integer? 23 What is the tenth root of 20309 to the nearest integer? 3 What is the square root of 41142 to the nearest integer? 203 What is 9407 to the power of 1/8, to the nearest integer? 3 What is 577 to the power of 1/8, to the nearest integer? 2 What is the third root of 779 to the nearest integer? 9 What is 225 to the power of 1/2, to the nearest integer? 15 What is the square root of 21990 to the nearest integer? 148 What is 10028 to the power of 1/3, to the nearest integer? 22 What is the third root of 2762 to the nearest integer? 14 What is 7 to the power of 1/10, to the nearest integer? 1 What is 11752 to the power of 1/2, to the nearest integer? 108 What is the eighth root of 4065 to the nearest integer? 3 What is the sixth root of 1066 to the nearest integer? 3 What is the third root of 60000 to the nearest integer? 39 What is the cube root of 5525 to the nearest integer? 18 What is the seventh root of 35861 to the nearest integer? 4 What is the tenth root of 291 to the nearest integer? 2 What is 3707 to the power of 1/2, to the nearest integer? 61 What is 1148 to the power of 1/2, to the nearest integer? 34 What is 1116 to the power of 1/2, to the nearest integer? 33 What is the third root of 107 to the nearest integer? 5 What is the tenth root of 15260 to the nearest integer? 3 What is 51860 to the power of 1/6, to the nearest integer? 6 What is 2179 to the power of 1/6, to the nearest integer? 4 What is 59262 to the power of 1/9, to the nearest integer? 3 What is the eighth root of 183 to the nearest integer? 2 What is the sixth root of 137 to the nearest integer? 2 What is 1387 to the power of 1/2, to the nearest integer? 37 What is the third root of 224 to the nearest integer? 6 What is 6072 to the power of 1/4, to the nearest integer? 9 What is 5862 to the power of 1/3, to the nearest integer? 18 What is the square root of 533 to the nearest integer? 23 What is 35361 to the power of 1/2, to the nearest integer? 188 What is 598 to the power of 1/5, to the nearest integer? 4 What is 4624 to the power of 1/3, to the nearest integer? 17 What is 5523 to the power of 1/8, to the nearest integer? 3 What is 137865 to the power of 1/2, to the nearest integer? 371 What is the tenth root of 119313 to the nearest integer? 3 What is the sixth root of 1662 to the nearest integer? 3 What is 34728 to the power of 1/2, to the nearest integer? 186 What is the square root of 722 to the nearest integer? 27 What is 3343 to the power of 1/9, to the nearest integer? 2 What is 112 to the power of 1/2, to the nearest integer? 11 What is the square root of 1352 to the nearest integer? 37 What is 178 to the power of 1/7, to the nearest integer? 2 What is the fourth root of 709 to the nearest integer? 5 What is 234 to the power of 1/2, to the nearest integer? 15 What is the third root of 28850 to the nearest integer? 31 What is the third root of 7980 to the nearest integer? 20 What is the seventh root of 692 to the nearest integer? 3 What is the fifth root of 22882 to the nearest integer? 7 What is the cube root of 27403 to the nearest integer? 30 What is 9347 to the power of 1/3, to the nearest integer? 21 What is 1575 to the power of 1/8, to the nearest integer? 3 What is 1557 to the power of 1/2, to the nearest integer? 39 What is the square root of 911 to the nearest integer? 30 What is the fourth root of 167909 to the nearest integer? 20 What is the square root of 3764 to the nearest integer? 61 What is the seventh root of 474 to the nearest integer? 2 What is the square root of 7045 to the nearest integer? 84 What is the square root of 43472 to the nearest integer? 208 What is the square root of 1097 to the nearest integer? 33 What is the square root of 1469 to the nearest integer? 38 What is the cube root of 1390 to the nearest integer? 11 What is the eighth root of 1404 to the nearest integer? 2 What is 77694 to the power of 1/2, to the nearest integer? 279 What is 6502 to the power of 1/2, to the nearest integer? 81 What is the third root of 51943 to the nearest integer? 37 What is the cube root of 42053 to the nearest integer? 35 What is the square root of 18714 to the nearest integer? 137 What is the cube root of 5008 to the nearest integer? 17 What is the third root of 1261 to the nearest integer? 11 What is the eighth root of 75734 to the nearest integer? 4 What is the fourth root of 8550 to the nearest integer? 10 What is the fifth root of 5013 to the nearest integer? 5 What is the square root of 12699 to the nearest integer? 113 What is 16713 to the power of 1/2, to the nearest integer? 129 What is the cube root of 12750 to the nearest integer? 23 What is the cube root of 12966 to the nearest integer? 23 What is 1606 to the power of 1/2, to the nearest integer? 40 What is 7664 to the power of 1/9, to the nearest integer? 3 What is 996 to the power of 1/8, to the nearest integer? 2 What is 19641 to the power of 1/2, to the nearest integer? 140 What is 124698 to the power of 1/3, to the nearest integer? 50 What is 821 to the power of 1/4, to the nearest integer? 5 What is the fifth root of 8932 to the nearest integer? 6 What is the third root of 8648 to the nearest integer? 21 What is the cube root of 2353 to the nearest integer? 13 What is the cube root of 49143 to the nearest integer? 37 What is the cube root of 1488 to the nearest integer? 11 What is the fourth root of 2563 to the nearest integer? 7 What is 941 to the power of 1/3, to the nearest integer? 10 What is the ninth root of 4162 to the nearest integer? 3 What is 3814 to the power of 1/3, to the nearest integer? 16 What is the seventh root of 16293 to the nearest integer? 4 What is 1042 to the power of 1/7, to the nearest integer? 3 What is the ninth root of 1083 to the nearest integer? 2	{ "pile_set_name": "DM Mathematics" }
z2 - 3612370z - 652460850845. -5(z + 361237)2 Determine c so that 4c*2 - 2452060c + 14712216 = 0. 6, 613009 Suppose 3l5 + 89l*4/2 - 2347l*3/2 - 5042l*2 + 1398l + 12960 = 0. What is l? -27, -10/3, -2, 3/2, 16 Solve 3h5/2 + 2198h*4 - 21355h*3 + 47950h*2 + 36875h/2 = 0 for h. -1475, -1/3, 0, 5 Factor 2y2 - 194122y + 970560. 2(y - 97056)(y - 5) Suppose 2r4/9 + 6155128r*3/3 - 2051710r*2 - 36930772r/9 = 0. What is r? -9232693, -1, 0, 2 Suppose -6g3 + 79292g*2 - 9064736g - 6078400 = 0. What is g? -2/3, 116, 13100 Solve -2w2/5 + 112404w/5 - 10212202/5 = 0. 91, 56111 Factor x*2/3 + 3750950x/3 + 3517406475625/3. (x + 1875475)*2/3 What is z in -5z*3/2 + 93450z*2 + 5236745z/2 + 7014000 = 0? -25, -3, 37408 Suppose 4k2 + 270064k + 2430252 = 0. What is k? -67507, -9 Let -2p4/7 - 22580p*3/7 - 675816p*2/7 - 2432368p/7 - 2342080/7 = 0. Calculate p. -11260, -26, -2 Solve -3y4 - 89274y*3 - 1159968y*2 + 2587770y - 1338525 = 0 for y. -29745, -15, 1 Determine y, given that -y*5/2 - 227y*4/2 + 3943y*3/2 + 13403y*2/2 + 4617y = 0. -243, -2, -1, 0, 19 Find n such that -3n4/4 + 5655n*3/4 + 843183n*2/4 + 1669389n/4 + 207966 = 0. -137, -1, 2024 Suppose -3u4 + 6909u*3 - 454623u*2 - 2942385u - 2480850 = 0. Calculate u. -5, -1, 74, 2235 Factor -t*2/6 - 30031934t/3 - 450958529890178/3. -(t + 30031934)*2/6 Determine n so that -768n*5 - 197703840n*4 - 12723261509091n*3 + 39762048027879n*2 - 4821155089605n + 149107961025 = 0. -128715, 1/16, 3 Find n, given that n*3 + 5459788n*2 - n - 5459788 = 0. -5459788, -1, 1 Suppose 2d*3/13 - 2353040d*2/13 + 692111420250d/13 - 6920878900500/13 = 0. What is d? 10, 588255 Solve 16g4/5 - 18296g*3/5 + 2225969g*2/5 + 1116416g/5 + 27939 = 0. -1/4, 139, 1005 Suppose -15w4/2 - 386w*3/3 + 781w*2/6 + 880w/3 + 42 = 0. What is w? -18, -1, -7/45, 2 Let -2m3/17 + 59818m*2/17 - 119622m/17 - 179442/17 = 0. Calculate m. -1, 3, 29907 Determine b so that b*2 + 7105b - 106800 = 0. -7120, 15 Find n, given that -n*2/2 + 36748n + 147000 = 0. -4, 73500 Let -3b3 + 6213291b*2 - 186396705b + 1397970225 = 0. What is b? 15, 2071067 Let -5q4 + 70735q*3 + 921440q*2 - 14725300q - 15576000 = 0. Calculate q. -22, -1, 10, 14160 Factor v*3/4 - 1508v*2 + 127795v + 261624. (v - 5946)(v - 88)(v + 2)/4 Solve 3c2/2 - 10489041c + 20978079/2 = 0 for c. 1, 6992693 Solve 51p5 + 1532p*4/3 - 94075p*3/3 + 141370p*2 - 327368p/3 - 4352/3 = 0 for p. -32, -2/153, 1, 4, 17 Determine p so that 7p5 - 117042p*4 + 492059513p*3 - 23522341982p*2 + 146283695808p - 39886626304 = 0. 2/7, 7, 41, 8336 Solve 5i2/3 - 268435750i/3 + 3602887593903125/3 = 0 for i. 26843575 Factor 2p2 - 94710p - 1705428. 2(p - 47373)(p + 18) Suppose -6w5 - 5091w*4 - 37872w*3 - 22494w*2 + 178998w - 113535 = 0. What is w? -841, -5, -9/2, 1 Factor 2f3/3 + 210f*2 - 110484f. 2f(f - 279)(f + 594)/3 Factor 3u*2 + 21645u - 1640250. 3(u - 75)(u + 7290) Find l, given that l*4 - 199l*3/3 - 504l*2 + 1212l + 11680/3 = 0. -8, -2, 10/3, 73 Find v such that v*5 - 145v*4 - 8704v*3 + 28780v*2 + 91200v = 0. -48, -2, 0, 5, 190 Factor n*2 + 730n + 78469. (n + 131)(n + 599) What is o in -o2/2 - 72278420o - 2612084998848200 = 0? -72278420 What is o in o*4/2 + 18964o*3 + 2498757o*2/2 - 2555651o + 1287308 = 0? -37862, -68, 1 Factor 4b3 + 21276b*2 + 11835032b + 11813760. 4(b + 1)(b + 630)(b + 4688) Factor -2o*3/11 + 1856966o*2/11 - 59421376o/11 + 475366912/11. -2(o - 928451)(o - 16)2/11 Find g such that -g4/6 + 115g3/2 + 3508g*2 + 9310g/3 - 20696 = 0. -52, -3, 2, 398 Suppose 2k4/5 + 4182k*3/5 - 320582k*2/5 - 69966k + 389700 = 0. Calculate k. -2165, -3, 2, 75 Suppose s*2/4 - 29017494s - 116069977/4 = 0. Calculate s. -1, 116069977 Find h such that -2h4/15 - 81946h*3/15 + 81964h*2/5 + 491712h/5 = 0. -40976, -3, 0, 6 Factor 732c2 - 4872200c + 53248. 4(c - 6656)(183c - 2) Factor -5k*2/3 + 242680k/3 - 1374705. -5(k - 48519)(k - 17)/3 Let 5o2/2 + 1278500460o + 163456342622021160 = 0. What is o? -255700092 Determine l, given that -5l4/4 - 3865l*3/4 + 175935l*2/2 - 720440l + 633440 = 0. -856, 1, 8, 74 Solve 6v2/11 - 560286v/11 - 144953172/11 = 0 for v. -258, 93639 What is f in -2f2 - 52384f + 471618 = 0? -26201, 9 Factor -2n4/5 + 162n*3/5 + 31832n*2/5. -2n*2(n - 173)(n + 92)/5 Find d such that -151726d*2/3 - 354026d + 28/3 = 0. -7, 2/75863 Determine p so that -2p4 + 3717p*3 - 20396p*2 + 24093p - 7412 = 0. 1/2, 1, 4, 1853 Solve -d*5/5 + 169d*4/5 - 741d*3 + 2923d*2 + 72346d/5 + 53856/5 = 0. -2, -1, 11, 17, 144 Factor -605w3 + 458370w*2 + 1085955w + 642200. -5(w - 760)(11w + 13)2 Factor t3/4 - 98875t*2/4 - 296639t/2 - 197762. (t - 98881)(t + 2)(t + 4)/4 Determine h, given that -2h3/7 + 2152202h*2/7 + 6456644h/7 - 21522080/7 = 0. -5, 2, 1076104 Determine u, given that 2u2/7 - 266972u/7 + 266970/7 = 0. 1, 133485 What is v in -5v5 + 2575v*4 - 227865v*3 + 883265v*2 - 1093210v + 435240 = 0? 1, 2, 108, 403 Factor 2p3 - 98554p*2 - 394272p + 1182744. 2(p - 49281)(p - 2)(p + 6) Let -12j*3/5 - 1419j*2/5 + 3680862j/5 + 920304/5 = 0. Calculate j. -616, -1/4, 498 Factor -n*3/3 + 39n*2 - 3479n/3 + 1121. -(n - 59)(n - 57)(n - 1)/3 Factor -p*2 + 11088118p - 11088117. -(p - 11088117)(p - 1) Find c such that -440c*3 + 643950c*2 + 3392315c + 807825 = 0. -5, -1/4, 32313/22 Factor p*2 + 8181153p + 8181152. (p + 1)(p + 8181152) Factor 5h*3 - 70645h*2 - 4968970h - 9655320. 5(h - 14199)(h + 2)(h + 68) Find v, given that -v4/4 + 8757v*3/4 - 2250903v*2/4 + 4440527v/4 + 1675047 = 0. -1, 3, 263, 8492 Factor -3p2 - 108228p + 17284095. -3(p - 159)(p + 36235) Factor -3c4/5 + 7770c*3 - 125114691c*2/5 - 857528280c - 36540637488/5. -3(c - 6492)2(c + 17)*2/5 Factor 2c*3 - 6160c*2 - 2521016c - 5017376. 2(c - 3446)(c + 2)(c + 364) Factor -5s*4 + 805s*3 + 3300s*2. -5s*2(s - 165)(s + 4) Factor -529702v*2/11 + 283920276v/11 - 2144/11. -2(v - 536)(264851v - 2)/11 Suppose -3f*2 + 1704f + 9837699 = 0. Calculate f. -1549, 2117 Factor x*5/9 - 5650x*4/9 - 804388x*3 - 234076536x2. x2(x - 6766)(x + 558)2/9 Find z such that -z3 + 86z2 + 157192z - 630080 = 0. -358, 4, 440 Suppose 4q2 - 52932472q + 175115412001924 = 0. What is q? 6616559 Determine k, given that 3k4/7 + 1257k*3/7 - 2433k*2 - 2337801k/7 + 2353572/7 = 0. -428, -39, 1, 47 Determine u, given that 4u3 - 3627964u*2 - 116098596u - 315644004 = 0. -29, -3, 907023 Solve -3r5 + 1173r*4 - 25788r*3 + 145728r*2 = 0 for r. 0, 11, 12, 368 Factor 9d*3/2 - 4544791d*2/2 - 504977d. d(d - 504977)(9d + 2)/2 Factor 2y*3/5 + 14486y*2/5 + 4733750y - 9493986278/5. 2(y - 331)(y + 3787)*2/5 What is f in -5f*5 + 28120f*4 - 40809080f*3 + 3577876320f*2 - 80944998480f = 0? 0, 46, 2766 Factor a*3 - 81542a*2 + 1662519040a - 9972178944. (a - 40768)*2(a - 6) Factor -9m3 - 419007m*2 + 158783645m - 14982186925. -(m + 46933)(3m - 565)*2 Let 4j*5 + 1753844j*4 + 192243663848j*3 - 961256904152j*2 + 576773084244j + 1730271898404 = 0. Calculate j. -219233, -1, 3 Let 2m4/11 + 1120m*3 + 49250m*2/11 + 12300m/11 - 73872/11 = 0. What is m? -6156, -3, -2, 1 Suppose 3g4/5 - 128073g*3/5 + 1367083206g*2/5 - 4100353152g/5 + 2733398016/5 = 0. What is g? 1, 2, 21344 Factor 2s3/5 - 11978s*2/5 + 4073398s - 1403663310. 2(s - 2765)2(s - 459)/5 Find p, given that 2p3/9 - 454358206p*2/9 + 8601724064254400p/3 + 2867241405235712 = 0. -1, 113589552 Suppose g*2 + 11766324g + 34611595118244 = 0. Calculate g. -5883162 Determine j so that 2j4/5 + 77464j*3/5 - 108476j*2 - 1317144j/5 - 697302/5 = 0. -38739, -1, 9 Determine s, given that 5s5/3 - 3617s*4/3 + 37156s*3/3 - 56704s*2/3 - 79904s + 34224 = 0. -2, 2/5, 6, 713 Determine q, given that -4q4 + 1864q*3 - 5456q*2 - 46600q + 138900 = 0. -5, 3, 5, 463 What is b in -223847405b2 + 1693358280b - 3202474320 = 0? 25308/6691 Solve	{ "pile_set_name": "DM Mathematics" }
litre? 17750 How many years are there in 786.4809 millennia? 786480.9 How many millilitres are there in 5/4 of a litre? 1250 How many minutes are there in 51/4 of a hour? 765 What is 423.25317 microseconds in hours? 0.000000117570325 What is 185423.5 years in centuries? 1854.235 What is 9.942582 litres in millilitres? 9942.582 How many milligrams are there in five quarters of a gram? 1250 How many months are there in 5/24 of a millennium? 2500 How many litres are there in 786523.4 millilitres? 786.5234 Convert 7352.634 litres to millilitres. 7352634 Convert 7.353887ug to grams. 0.000007353887 What is three fifths of a tonne in kilograms? 600 Convert 14.29855 millennia to years. 14298.55 What is three fifths of a litre in millilitres? 600 How many grams are there in 7203.516mg? 7.203516 What is thirty-three fifths of a millimeter in micrometers? 6600 Convert 3.378224ml to litres. 0.003378224 What is 11/2 of a kilometer in meters? 5500 What is 170.5997 meters in nanometers? 170599700000 Convert 3.36387 millilitres to litres. 0.00336387 How many nanoseconds are there in one tenth of a millisecond? 100000 What is 0.7817296 centimeters in micrometers? 7817.296 What is 166105.3 tonnes in kilograms? 166105300 Convert 0.1453786 litres to millilitres. 145.3786 How many millilitres are there in 11/4 of a litre? 2750 How many micrograms are there in 3/40 of a milligram? 75 How many millilitres are there in 127.801l? 127801 How many millennia are there in 65.87646 decades? 0.6587646 How many nanograms are there in 389732.4t? 389732400000000000000 How many kilometers are there in 9324.048um? 0.000009324048 What is 3/25 of a meter in millimeters? 120 Convert 0.2708893 minutes to microseconds. 16253358 What is three fifths of a meter in millimeters? 600 What is 68184.27ml in litres? 68.18427 How many millilitres are there in thirteen quarters of a litre? 3250 Convert 242.655 decades to centuries. 24.2655 What is 6/5 of a gram in milligrams? 1200 How many millennia are there in 1.851075 decades? 0.01851075 How many millilitres are there in 2.153499 litres? 2153.499 How many litres are there in 9033.17ml? 9.03317 What is 659.3004 nanograms in micrograms? 0.6593004 How many meters are there in 15/4 of a kilometer? 3750 What is 3/25 of a litre in millilitres? 120 How many years are there in 0.7550463 months? 0.062920525 Convert 49095.06ng to tonnes. 0.00000000004909506 What is 3/25 of a centimeter in micrometers? 1200 How many days are there in 7732.738 weeks? 54129.166 What is thirty-seven halves of a litre in millilitres? 18500 How many millilitres are there in 34/5 of a litre? 6800 Convert 88046.88 nanograms to tonnes. 0.00000000008804688 How many grams are there in 1/10 of a kilogram? 100 How many months are there in seven thirds of a decade? 280 Convert 4.362744 months to decades. 0.0363562 What is seven halves of a meter in centimeters? 350 How many meters are there in 3/40 of a kilometer? 75 How many millilitres are there in 400.4903l? 400490.3 Convert 45.94626 days to seconds. 3969756.864 How many litres are there in 48.0673ml? 0.0480673 What is 0.0283861l in millilitres? 28.3861 How many milligrams are there in 45/4 of a gram? 11250 Convert 232518.6 days to microseconds. 20089607040000000 What is 5.999534 millilitres in litres? 0.005999534 What is twenty-eight thirds of a decade in months? 1120 How many centimeters are there in 7/4 of a meter? 175 How many years are there in 5646.723 centuries? 564672.3 Convert 97.30632cm to millimeters. 973.0632 What is 5294.655l in millilitres? 5294655 How many weeks are there in 26472814.2 milliseconds? 0.0437711875 What is seventy-four fifths of a meter in centimeters? 1480 Convert 34.01442 tonnes to grams. 34014420 How many micrometers are there in 96458.65km? 96458650000000 What is 3/8 of a milligram in micrograms? 375 What is 9041.948nm in kilometers? 0.000000009041948 How many nanometers are there in 7.832191km? 7832191000000 What is 41.79752 millennia in decades? 4179.752 Convert 7.585573ml to litres. 0.007585573 What is three fifths of a hour in minutes? 36 What is 7599.865 micrometers in kilometers? 0.000007599865 What is 21/8 of a litre in millilitres? 2625 What is 15186.696 months in centuries? 12.65558 How many seconds are there in fifty-two fifths of a hour? 37440 How many micrograms are there in 6.285757ng? 0.006285757 How many years are there in 91.81617 decades? 918.1617 What is 1/80 of a century in months? 15 What is 9.04412 kilograms in micrograms? 9044120000 How many grams are there in 3/10 of a kilogram? 300 How many kilograms are there in 3/25 of a tonne? 120 What is 0.4814895g in milligrams? 481.4895 Convert 384.1516 years to millennia. 0.3841516 How many grams are there in 3/10 of a kilogram? 300 What is 66.44823 litres in millilitres? 66448.23 What is fourty-nine quarters of a litre in millilitres? 12250 How many millimeters are there in one fifth of a centimeter? 2 Convert 2.311365 days to minutes. 3328.3656 What is 19/4 of a centimeter in micrometers? 47500 What is 0.1362075 millilitres in litres? 0.0001362075 What is 6465.602 milligrams in nanograms? 6465602000 Convert 879.8489 years to months. 10558.1868 What is 5/6 of a week in minutes? 8400 How many tonnes are there in 396847.3 kilograms? 396.8473 How many milliseconds are there in 5/8 of a second? 625 How many kilograms are there in eleven quarters of a tonne? 2750 How many weeks are there in 90896.904 seconds? 0.1502925 How many months are there in twenty-seven quarters of a millennium? 81000 How many months are there in 216.9702 decades? 26036.424 What is thirty-two fifths of a litre in millilitres? 6400 What is 6/5 of a litre in millilitres? 1200 What is 0.8786343us in nanoseconds? 878.6343 How many seconds are there in five quarters of a hour? 4500 How many months are there in 6/25 of a century? 288 What is 1/20 of a gram in micrograms? 50000 What is 86803.08ml in litres? 86.80308 How many milligrams are there in 11/2 of a gram? 5500 What is 6.186291 minutes in seconds? 371.17746 What is six fifths of a tonne in kilograms? 1200 What is thirteen fifths of a hour in seconds? 9360 What is 3/40 of a centimeter in micrometers? 750 How many millimeters are there in fifty-four fifths of a meter? 10800 What is 35.31637 microseconds in nanoseconds? 35316.37 How many centimeters are there in five quarters of a meter? 125 What is 1/20 of a week in minutes? 504 What is twenty-five eighths of a microsecond in nanoseconds? 3125 What is 6/25 of a litre in millilitres? 240 How many micrograms are there in 26/5 of a milligram? 5200 How many centuries are there in 20564.6 decades? 2056.46 How many millilitres are there in fifty-three quarters of a litre? 13250 What is 3750.51um in meters? 0.00375051 What is 124.9375 nanometers in kilometers? 0.0000000001249375 What is 759619.4 litres in millilitres? 759619400 Convert 30.74908 milliseconds to microseconds. 30749.08 How many milliseconds are there in six fifths of a second? 1200 How many kilograms are there in one fifth of a tonne? 200 How many meters are there in 0.3139214 millimeters? 0.0003139214 How many millennia are there in 7431.268 years? 7.431268 How many centimeters are there in 7.643411 nanometers? 0.0000007643411 How many seconds are there in 232.605 hours? 837378 How many litres are there in 52.58972ml? 0.05258972 What is 8873.112 millilitres in litres? 8.873112 What is 3/25 of a millimeter in micrometers? 120 What is 8/25 of a centimeter in micrometers? 3200 How many millilitres are there in 538357.5l? 538357500 What is seven quarters of a litre in millilitres? 1750 How many months are there in 564157.2 decades? 67698864 Convert 821.8763l to millilitres. 821876.3 How many millilitres are there in 6.796439 litres? 6796.439 Convert 242251.56 months to centuries. 201.8763 How many years are there in 39.69797 decades? 396.9797 How many milligrams are there in 64425.29g? 64425290 Convert 607446.5 millennia to centuries. 6074465 How many decades are there in 27/2 of a century? 135 What is eleven eighths of a microgram in nanograms? 1375 How many years are there in 11/4 of a century? 275 How many seconds are there in 7/6 of a hour? 4200 What is 742.7612mg in tonnes? 0.0000007427612 How many	{ "pile_set_name": "DM Mathematics" }
is -64 - 137? -19b In base 7, what is -62423 + 13? -62410 In base 4, what is 1 + 21301030? 21301031 In base 7, what is 1246 + 65? 1344 In base 4, what is 101 - -2221? 2322 In base 9, what is 4721282 + 5? 4721287 In base 11, what is -1080 + -730? -1800 In base 9, what is 5405 + -2487? 2807 In base 4, what is -21 + -1111312? -1111333 In base 7, what is -225445 - -1? -225444 In base 11, what is 3 - 6613? -6610 In base 3, what is -100102 - -21111001? 21010122 In base 15, what is -334e - 16? -3365 In base 11, what is 17083 - 59? 17025 In base 14, what is 4 + -3301? -32db In base 13, what is -120 + -a8b? -bab In base 5, what is 2123113 + 2? 2123120 In base 7, what is -44 + 2025? 1651 In base 7, what is -16 + -641215? -641234 In base 9, what is 7 - 642364? -642356 In base 13, what is 5c042 - -5? 5c047 In base 13, what is -1337 + c3? -1244 In base 2, what is 110101111000 + 110001? 110110101001 In base 13, what is 7 - 21877? -21870 In base 13, what is -31a7c + 5? -31a77 In base 9, what is -120505 - 6? -120512 In base 10, what is -7 - 8476? -8483 In base 6, what is 12 + -33015? -33003 In base 6, what is -225 - -215? -10 In base 5, what is 232143 - -204? 232402 In base 16, what is 26a61 - 1? 26a60 In base 13, what is -2466 + -29a? -2733 In base 2, what is -100111111000111 + -1000000? -101000000000111 In base 7, what is -21523 - -5? -21515 In base 8, what is 252 - 23664? -23412 In base 6, what is 15 + -13555? -13540 In base 9, what is 84088 + -10? 84078 In base 11, what is -2523 - -13? -2510 In base 11, what is 8 + -609997? -60998a In base 2, what is 100000010011100100 + 10? 100000010011100110 In base 5, what is 3 + -3243422? -3243414 In base 10, what is -1347 - -24? -1323 In base 13, what is 4b2 + -22? 490 In base 4, what is 1032 + 233030? 300122 In base 10, what is -2762 - 22? -2784 In base 2, what is -100 - -1000001011010? 1000001010110 In base 14, what is 17 + -cc3? -caa In base 7, what is -1 + 1226521? 1226520 In base 15, what is -15b04 - 1? -15b05 In base 5, what is -33040233 - 0? -33040233 In base 6, what is 12234430 + 23? 12234453 In base 13, what is 1 + 356? 357 In base 10, what is 513722 + 5? 513727 In base 10, what is -47 + -1070? -1117 In base 13, what is -143 - 452? -595 In base 9, what is -41 - 7156? -7207 In base 15, what is 94a5c - 5? 94a57 In base 16, what is d7 + 2b0d? 2be4 In base 8, what is -6 + 4272540? 4272532 In base 4, what is -11010 - 1000? -12010 In base 6, what is -2 + 312120? 312114 In base 11, what is -44914a1 + 4? -4491498 In base 12, what is 4b - 37297? -37248 In base 4, what is -3300 + -13013? -22313 In base 3, what is 100 - -12221? 20021 In base 16, what is -11 + 4574? 4563 In base 16, what is 2104f + 2? 21051 In base 11, what is -28824 + -4? -28828 In base 5, what is -2131 - 2122? -4303 In base 7, what is 5552 + 4? 5556 In base 9, what is -8302553 + 4? -8302548 In base 2, what is 1100011 + -1010010011100111? -1010010010000100 In base 12, what is -1 - 1467? -1468 In base 9, what is 12 - 24100? -24077 In base 16, what is -4 + -8e17? -8e1b In base 13, what is 2a - -10a77? 10aa4 In base 14, what is -cc + -1792? -1880 In base 15, what is -93 - -2b08? 2a65 In base 7, what is -6351444 - 0? -6351444 In base 5, what is -10 - -3433? 3423 In base 8, what is -5 + -4104? -4111 In base 2, what is 111101010 - 1011011? 110001111 In base 5, what is 411 - -404023? 404434 In base 10, what is -5267 + -75? -5342 In base 12, what is -63b51b + -2? -63b521 In base 2, what is 10011100111110011 + 100? 10011100111110111 In base 13, what is 257 + -1370? -1116 In base 13, what is 5c51 + 23? 5c74 In base 13, what is a - -1cc8a? 1cc97 In base 16, what is -19cd45 - -4? -19cd41 In base 14, what is -ad1 + 6? -ac9 In base 12, what is -40 + a95? a55 In base 8, what is 2244737 + 1? 2244740 In base 2, what is -100 + -10100001011010010? -10100001011010110 In base 4, what is 112220221302 - 3? 112220221233 In base 12, what is -7 - 64a4? -64ab In base 6, what is 5122 - -220? 5342 In base 16, what is -1c - -26be? 26a2 In base 6, what is 441 + -1313? -432 In base 8, what is -4 + -14056? -14062 In base 13, what is 13069 + -5? 13064 In base 16, what is -1 + 98fc? 98fb In base 13, what is -1c4 + -4c1? -6b5 In base 11, what is -28a - -670? 391 In base 13, what is -4387 - -4? -4383 In base 7, what is -10526 + -5? -10534 In base 3, what is -12 - -1221021? 1221002 In base 7, what is 3 + -1146326? -1146323 In base 8, what is 165 - 61073? -60706 In base 10, what is 2936 + 76? 3012 In base 3, what is 111100120020 - -12? 111100120102 In base 10, what is 4430 + 234? 4664 In base 12, what is -139 - -2b2? 175 In base 3, what is -20012022112 - 11? -20012022200 In base 4, what is -3 - -1112033002? 1112032333 In base 4, what is -102 - -301122? 301020 In base 9, what is -75 + 2446? 2361 In base 4, what is -1131023 + 1002? -1130021 In base 6, what is -1055000 + 0? -1055000 In base 14, what is 6b3d + 5? 6b44 In base 14, what is -6a5 + -82? -747 In base 13, what is 5489 - -10? 5499 In base 15, what is 1e7d - -42? 1ec0 In base 3, what is -20000200100021 - -10? -20000200100011 In base 14, what is -2 - -4681? 467d In base 10, what is -168872 - 0? -168872 In base 15, what is -4 - 3b9e? -3ba3 In base 3, what is 100 + -12110020? -12102220 In base 2, what is 110110110011011101 - 1? 110110110011011100 In base 11, what is -3 - 1143a4? -1143a7 In base 13, what is 0 + 15791? 15791 In base 11, what is 34 - 2a5? -271 In base 15, what is -416 - 107? -51d In base 13, what is 4 - 481b37? -481b33 In base 3, what is 1201011 + 1122202? 10100220 In base 5, what is 10010124 + -4? 10010120 In base 3, what is -120200 - 212? -121112 In base 4, what is 331 + -30212320? -30211323 In base 8, what is 37 - -3073? 3132 In base 11, what is 1246 + -95? 1161 In base 13, what is -1 - -a83a? a839 In base 13, what is 6378 - -7? 6382 In base 11, what is 486 - -11? 497 In base 12, what is -39098 - 2? -3909a In base 4, what is -32032 - -2? -32030 In base 11, what is 941 + 109? a4a In base 4, what is 3 - -123113120? 123113123 In base 9, what is 0 + -2664? -2664 In base 15, what is 523 - -8c? 5b0 In base 16, what is -1198 + 13? -1185 In base 5, what is 4 + -42200? -42141 In base 9, what is 351 - -2888? 3350 In base 10, what is 5778 + -16? 5762 In base 15, what is d - 1549? -153b In base 2, what is 1000101001001011 - 1101? 1000101000111110 In base 10, what is 301 + 4684? 4985 In base 9, what is -2 + 10025? 10023 In base 8, what is -5 - 1315414? -1315421 In base 5, what is -322132 + -221? -322403 In base 3, what is 22102211020 + -11? 22102211002 In base 5, what is -113110 - 11? -113121 In base 6, what is 544 - -24233? 25221 In base 3, what is -2120 + 202020? 122200 In base 12, what is -b3 - -857? 764 In base 10, what is 230 + -60? 170 In base 10, what is -9208 + 25? -9183 In base 3, what is -110 + -10020222101? -10020222211 In base 3, what is 1120 - 1120101112? -1120022222 In base 14, what is 67c + -290? 3cc In base 4, what is 0 + 3301333? 3301333 In base 7, what is 1232503 - -5? 1232511 In base 4, what is -13212103 - -1? -13212102 In base 6, what is -21155234 - 4? -21155242 In base 8, what is 4 + 7064? 7070 In base 3, what is -121201 - -2002? -112122 In base 5, what is -2143031 + 20? -2143011 In base 8, what is 370075 + 3? 370100 In base 9, what is -486 - 637? -1234 In base 12, what is 5099b - 7? 50994 In base 13, what is -2c - -562? 533 In base 15, what is -10c - 867? -974 In base 3, what is 200201202 - 21? 200201111 In base 12, what is -284188 - -2? -284186 In base 16, what is 32 + 6e00? 6e32 In base 16, what is -15cf + -6? -15d5 In base 7, what is -333136 - 10? -333146 In base 16, what is -15177 - -c? -1516b In base 5, what is 24332 - -2? 24334 In base 10, what is -2 - 1183916? -1183918 In base 3, what is -10000 - -1021? -1202 In base 10, what is 124 - -148? 272 In base 16, what is -1 - -cd141? cd140 In base 16, what is 1 + -114e? -114d In base 12, what is 33041a - 0? 33041a In base 6, what is -25014 - -102? -24512 In base 8, what is 3 - 650434? -650431 In base 14, what is 15a + -65? d5 In base 15, what is 4 - -210b? 2110 In base 6, what is -112135 + 52? -112043 In base 2, what is -1100111110 - 111? -1101000101 In base 4, what is 1301233 + -1133? 1300100 In base 7, what is -251 + -12154? -12435 In base 8, what is 34031	{ "pile_set_name": "DM Mathematics" }
3g2 - 17g. Let z(d) = -d*2 - 9d. Let c(a) = -a*3 + 7a*2 + 11a - 86. Let x be c(4). Give xv(o) - 11z(o). -7o2 - 3o Let z(p) = -p*3 + 4p*2 + 2p + 15. Let d(g) = g*3 - 3g*2 - 2g - 20. Determine 5d(u) + 6z(u). -u*3 + 9u*2 + 2u - 10 Let r(x) = x - 1. Let g(m) = 17m - 6. Let w be -16 + (-32)/((-128)/84). What is wr(l) - g(l)? -12l + 1 Let i(o) = -2o*2 - 63o - 26. Let d(y) = 6y2 + 177y + 77. Determine -4d(q) - 11i(q). -2q2 - 15q - 22 Let j(u) = 77u2 + 3u + 5. Let v(f) = 2 + 116f2 + 5f - 5 + 14 + 0 - 3. Determine 8j(w) - 5v(w). 36w2 - w Let t(u) = -u2 - 2u - 1. Let f = -9 + 14. Suppose 14r - fv + 9 = 10r, 3 = 2r - v. Let g(y) = -y*2 - 2y - 1. What is rt(m) - 3g(m)? -m*2 - 2m - 1 Let x(s) = 22s + 1. Let b(c) = -c. Let o = 10443 + -10438. What is ob(z) + x(z)? 17z + 1 Let g(d) = -20d + 27. Let o(r) be the second derivative of 9/2r2 + 0 - 7/6r*3 + 48r. Determine -6g(q) + 17o(q). q - 9 Let o(z) = -24z2 - 24. Let k(n) be the second derivative of -3n*2/2 - 1484n - 2. Give 24k(f) - 3o(f). 72f2 Let o(c) = -193c3 + c2 - 283c + 4. Let j(n) = 241n3 - n2 + 282n - 5. What is -4j(g) - 5o(g)? g3 - g2 + 287g Let q(i) = 7i2 - i + 267. Let n(y) = 5y - 140. Let l(t) = -2n(t) - q(t). Suppose 3z + 44 = 7z. Let g(o) = -4o*2 - 5o + 7. Give zg(r) - 6l(r). -2r2 - r - 1 Let n(q) = -15q*2 - 3094. Let m(g) = 8g*2 + 1553. What is -11m(d) - 6n(d)? 2d*2 + 1481 Let x(m) be the second derivative of 11m - 1/2m3 + 7/2m*2 + 0. Let n(g) = 2g - 6. Give 6n(r) + 5x(r). -3r - 1 Let r(u) = 3u*2 - 2u - 2. Let n be (4 - 5)22(-2)/2. Suppose -c - b = n + 29, 0 = -4b + 16. Let w(a) = -80a*2 + 55a + 55. Determine cr(l) - 2w(l). -5l2 Let s(x) = 255x + 84. Let g(f) = 84f + 30. Give -17g(c) + 6s(c). 102c - 6 Let g(s) = 20s2 - 2s + 42. Let a(x) = -7x2 + x - 21. What is -13a(d) - 6g(d)? -29d*2 - d + 21 Let j(g) = 1454g*2 + 6g + 21. Let f(k) = 4361k2 + 16k + 56. Calculate 3f(i) - 8j(i). 1451i2 Let k(u) be the third derivative of u5/30 - u4/6 + u3 - 3019u*2. Let x(z) = 3z*2 - 7z + 11. Suppose 0 = p - 3 - 4. Calculate pk(m) - 4x(m). 2m2 - 2 Let f(c) be the third derivative of c5/20 - 3c4/8 + c3 - 5c2 - 83c. Let b(i) = 1. Calculate 6b(j) - f(j). -3j*2 + 9j Let p(f) = -3f + 20. Let r(o) = -o2 - 19o - 13. Let l be r(11). Let d = l + 349. Let j(v) = -v + 7. Let z = -35 - -18. Calculate dp(h) + zj(h). -h + 1 Let q(f) = -56f2 - 7f - 7. Let s(b) = -3b2 - 35b - 77. Let n be s(-9). Let j(l) = -37l2 - 5l - 5. Give nq(u) + 7j(u). 21u2 Suppose -2y + 5m = 22, -3y - 11m + 9m = -5. Let p(n) = -n + 1. Let g(d) = -4d + 4. Determine yg(c) + 5p(c). -c + 1 Let q = -3379 + 3778. Let i(m) = 19m*3 - 133m*2 - 133m + 133. Let b(h) = -h*2 - h + 1. Calculate qb(r) - 3i(r). -57r*3 Let c(j) = 3j*3 + 3. Suppose -4v = -4a + 16, -4v + 0a - 7 = -a. Let s(y) be the second derivative of -13y + 1/2y2 + 0. Determine vc(z) + 3s(z). -3z*3 Suppose x = -8x + 423. Let s = x - 47. Let r(g) = s + g + 5 + 2 - 1. Let a(z) = -z - 5. Determine -4a(q) - 3r(q). q + 2 Let j(o) = 2o2 - o - 2. Let g(p) = 0p + 2p2 - p - 24633 + 24632. Determine 5g(b) - 4j(b). 2b*2 - b + 3 Let d(z) = -2z*3 + 689z*2 - 6z + 174. Let m(c) = -7c3 + 2066c*2 - 19c + 551. Give -19d(b) + 6m(b). -4b3 - 695b*2 Let x(s) = 40s + 51. Let u(d) = -84d - 100. What is -3u(k) - 5x(k)? 52k + 45 Let s(o) = -2o + 7. Let d be s(0). Let u(a) = -5a - 38a2 - 7 - 2 - 40a*2 + 81a*2 + 2a. Let l(c) = 2c2 - 2c - 5. Determine dl(b) - 4u(b). 2b2 - 2b + 1 Suppose -12r - 13 = -37. Let q be (15/12)/((-1)/4). Let b(u) = u3 + 2u*2. Let i(l) = 2l*3 + 5l*2 + l. Determine qb(o) + ri(o). -o3 + 2o Let c(l) be the first derivative of -l3 - l2 - 1872. Let z(m) be the third derivative of 7m5/60 + m4/6 - m3/6 + 34m*2. Determine -5c(g) - 2z(g). g2 + 2g + 2 Let o(q) = 24q - 52. Let i(c) = -c + 6. What is -2i(m) + o(m)? 26m - 64 Suppose -8u = -6u - 8. Suppose 3g - 13 = -u. Let d(n) = 3 - 3 + g - 2 - 2n. Let c(w) = 5w - 2. Determine 3c(p) + 7d(p). p + 1 Let v(o) = -1014o3 + 3042o - 3042. Let y(g) = g*3 - g + 1. What is v(u) + 3042y(u)? 2028u3 Suppose 11x + 4897 = 4930. Let c(u) = 20u - 5. Let v(o) = -19o + 4. Give xv(j) + 2c(j). -17j + 2 Let g(a) = -a2 - 11a - 20. Let y be g(-8). Let u(v) = -v. Let n(r) = 5r - 5. Let l(j) = yu(j) - n(j). Let z(b) = -4b + 2. Determine -2l(p) + 5z(p). -2p Let k(m) = -180m - 139. Let g(o) = 238o + 185. Calculate 7g(z) + 9k(z). 46z + 44 Let c(t) = -43t + 4481. Let i(k) = 77k - 8966. Give 9c(n) + 5i(n). -2n - 4501 Let m(c) = -4c3 + 9c*2 - 143c + 9. Let j(z) = z*3 - 2z*2 + 36z - 2. Let v = 19097 + -19106. Give vj(t) - 2m(t). -t*3 - 38t Let c(s) = s + 3 - 3 + s*2 - 2191s*3 + 2190s*3. Let h(a) = 11a*3 - 3a*2 - 4a - 1. Determine 3c(x) + h(x). 8x*3 - x - 1 Let a(c) = 8 + 22904c - 4 - 22882c - 6. Let x(n) = -1. Give a(i) - 4x(i). 22i + 2 Let s(v) = -8v*3 - 4v - 4. Let i(m) be the third derivative of m4/24 + m3/6 - 1835m2. Calculate 24i(b) + 6s(b). -48b*3 Let j(s) = -3s*2 - 9. Let q(n) = -749n - n*2 - 4 + 749n. Let x be 2/(48/(-27) + 2). What is xq(w) - 4j(w)? 3w2 Let q(n) = -n2 + 4n. Let l(h) = 100h2 + 400h. Give 5l(w) - 500q(w). 1000w2 Let u(y) be the third derivative of -y5/12 + y4/12 + y3 - 2y*2. Suppose -640k = 2203 + 1637. Let n(i) = 5i2 - 2i - 5. What is kn(q) - 5u(q)? -5q2 + 2q Let u(i) = 26i - 1795. Let o(z) = 11z - 896. Determine 7o(v) - 3u(v). -v - 887 Let j(r) = -7r2 - 3r + 6. Let f(q) = -13q2 + 1. Let z(c) = 15c*2 - c + 1. Let p(a) = -4f(a) - 3z(a). Determine -7j(h) - 6p(h). 7h*2 + 3h Let z(g) = g*3 - 13g*2 + 44g - 14. Let r(n) = -5n2 + 23n - 6. Give -7r(t) + 3z(t). 3t3 - 4t*2 - 29t Let f(t) = 96986205t - 15255. Let c(h) = -25429h + 4. Give 15255c(j) + 4f(j). 25425j Let g(c) = c + 4. Let u(k) be the second derivative of 10 + 5/2k*2 + 1/6k*3 + 2k. Determine 4g(a) - 3u(a). a + 1 Let u(x) = 5937 - 2959 + 2x2 - 2973 + 2x3. Let b(c) = c3 + 2c2 + 6. Calculate -3b(z) + 4u(z). 5z*3 + 2z*2 + 2 Let z(p) be the second derivative of -9p + 1 - 3/2p2 + 7/6p*3. Let m = 5 - 2. Let a(o) = 15o - 7. What is ma(f) - 7z(f)? -4f Let q(i) = 3528i - 145. Let v(k) = 3529k - 181. Calculate 5q(b) - 4v(b). 3524b - 1 Let h(s) = 29s - 6. Let o(p) be the third derivative of 5p4/24 - p3/6 - 6p2 - 8. Calculate -6h(y) + 34o(y). -4y + 2 Let o(n) = 13 + 20 + 17 - 56 + 7. Let s = -14 - -13. Let x(h) = 27h - 27. Let c(d) = -7d + 7. Let p(u) = 15c(u) + 4x(u). Determine sp(m) - 3o(m). -3m Suppose 3u = 1 - 13. Let x(n) = n3 - n2 + n - 1. Let t(f) = 5502f3 - 1840f*3 - 1839f*3 + 4 - 1820f*3 - 2f + 4f2. What is ux(m) - t(m)? -7m3 - 2m Let i(j) = -4j3 - 3j*2 - 3j*2 - 6 + 0j + 0j. Let y(q) be the first derivative of -3q*4/4 - 7q*3/3 - 7q + 5387. What is 7i(l) - 6y(l)? -10l3 Let b(g) = 12g*2 + 4209g + 21. Let j(t) = -19t2 - 6313t - 33. What is 22b(m) + 14j(m)? -2m2 + 4216m Let k(b) = 6b + 3. Suppose -5 = 2r - 9. Let a be (r/(-2))/(96/(-30) + 3). Let v(w) = -25w + 72w + a - 21w - 15w. Give -5k(j) + 3v(j). 3j Let a = 5 - 7. Let z be 6/(-3)2 - (2 - 5). Let c(r) = -3r - 2. Let d(b) = -30 + 13 + 6 + 12. Determine ad(q) + zc(q). 3q Let j(f) = -1044f - 32. Let h(c) = -3534985c - 108368. What is 6h(z) - 20319j(z)? 3126z Let j(g) = 60g*3 - 172g*2 + 7g - 98. Let c(m) = -20m3 + 58m*2 - 2m + 28. What is -7c(b) - 2j(b)? 20b3 - 62b*2 Let l(p) = 801 - 2403 + 5p + 812 + 809. Let u(r) = 9r + 39. Determine -11l(q) + 6u(q). -q + 25 Let s(b) = -46 - 51 - 32 + 129 + 280b. Let j(a) = 33a. Calculate -42j(h) + 5s(h). 14h Suppose -3x - 130 = -5x. Let o be x/(-9) - (-2)/9. Let c = 2783 + -2779. Let f(k) = -2k2 - 2k - 11. Let p(r) = -r*2 - r - 6. Give cf(i) + op(i). -i2 - i - 2 Let q(p) = 2p + 27. Let n = -10561 + 10565. Let r(j) = 3j + 28. Calculate nq(t) - 3*r(t)	{ "pile_set_name": "DM Mathematics" }
assuming x is positive. x(107/42) Simplify u(3/8)uu(u/u(-2/21)u)/u(((uu*(-2/3)uuu)/u)/u)(4/17) assuming u is positive. u(10807/2856) Simplify ((s2)(14/3)/((s/s(3/5))/s(1/14)))31 assuming s is positive. s(58621/210) Simplify (d/(dd(11/3))(d/(d/(d*(1/4)d)))/d)32 assuming d is positive. d(-328/3) Simplify (v/((v*(1/4)/vv)/v))*(-2/149)v*(1/4)v(1/8) assuming v is positive. v(419/1192) Simplify (b*(-22)b/(b((b/b(-18))/b)/bb))(4/5) assuming b is positive. b(-32) Simplify (((i(-25)/i)/i)/(i(-32)/i))/((i/((i/((ii/(ii*14)i)/i)i)/i))/((i/(ii/(ii34i)i))/i)) assuming i is positive. i52 Simplify s12s*(15/2)ss(1/22)/ss*10/ss assuming s is positive. s(325/11) Simplify a(1/3)/(aa(3/13))aa7aa24 assuming a is positive. a(1252/39) Simplify (vv*(2/27)v)*(-22)v(3/7)/v(-8/11) assuming v is positive. v(-92461/2079) Simplify ((q14/q)/q(-7/4))/(q10(q/q(2/7))/q) assuming q is positive. q(141/28) Simplify ((a/(a/((aa*13/a)/aa)))/(a(-2/19)/a))/(a(-3/5)/a(1/3)) assuming a is positive. a(4286/285) Simplify ((q/(q/(q/(q/(qq(q*(-5/6)/qq)/q))))q/(qq/q*(4/3)q)qqq)/(((qq/q(-4))/q)/q7))12 assuming q is positive. q54 Simplify (iii*11i)/(ii(-27))(i*(2/61)i)(-2/79) assuming i is positive. i(192634/4819) Simplify (x0)(-2/141)/((xx(2/3))/xxx(1/5)) assuming x is positive. x(-28/15) Simplify (b(2/9))(5/2)/(((bb(-9))/b)/b(-1/20)) assuming b is positive. b(1711/180) Simplify ((q2/q*(-1/5))/((((qq*0)/q)/q)/(qqq/(qq*0)qq)))45 assuming q is positive. q324 Simplify (s(2/3)/(((((s/s(3/10))/s)/s)/s)/s))/((s/s31)/(s/(s/((((ss(-23))/s)/s)/s)))) assuming s is positive. s(269/30) Simplify ((x*22/xxx)/x12)/(xx*(-2/11)(x(-15)/x)/x) assuming x is positive. x(299/11) Simplify ((n/(n*17n))/(nn/(nn((n(2/61)/n)/nn)/nn)))(-18/7) assuming n is positive. n(19728/427) Simplify ((z/(zz/(z*(-1/15)z))(z/z13)/z)(2/21))(-22/7) assuming z is positive. z(176/45) Simplify q(-1/5)q*(-1/9)q(qq(1/5)/q)(8/9) assuming q is positive. q*(13/15) Simplify (ww(-2/7))46/(w(2/5))(12/19) assuming w is positive. w(21682/665) Simplify ((w/(w(3/5)w)w(-4/9))(-49))(1/8) assuming w is positive. w(2303/360) Simplify (s*(-15)s)*0/(s/((s/(s/(s(s/(s/(s/s*(2/27))))/s)s))/s)(s(-5/17)/s)/s) assuming s is positive. s(101/459) Simplify (((ll/(l/(((ll(l/((l/(lll/(l/l*6)l))/l))/l)/ll)/l))l)/l(2/7))(2/33))40 assuming l is positive. l(6560/231) Simplify l*0/(ll*(2/7))l*(-2)lll(((l(2/5)/l)/l)/l)/l assuming l is positive. l(-136/35) Simplify (q(1/4)q)/q((q(2/13)q)/q)/q((q(-14)/q)/q)/((((qq/(q/q(-9)))/q)/q)/q) assuming q is positive. q(-291/52) Simplify (s*34ss8)(2/53) assuming s is positive. s(86/53) Simplify (o(-5))27/(o4)(-1/5) assuming o is positive. o(-671/5) Simplify p/(pp*(1/4))p*(-11/4)p/p*22p*22pp assuming p is positive. 1 Simplify (nn/(n/n(-12)))(2/17)/(n(-9))(1/4) assuming n is positive. n*(65/68) Simplify (((o(o/(o/((o*(-5)o)/o)))/o)/o3)(-46))(2/17) assuming o is positive. o(736/17) Simplify ((k(-13))(2/49))(19/2) assuming k is positive. k(-247/49) Simplify ((h/h0)(29/5)(h3/h)/(hhh(-1/2)h))11 assuming h is positive. h(583/10) Simplify q*(2/19)qq(q/(q/(q/(q/q*13))))/q(q(-3))(-16) assuming q is positive. q(1180/19) Simplify (t13t(-7/4))/(t/t(-2/23)t(-2/57)/t) assuming t is positive. t(58723/5244) Simplify (((ss(2/3))/(s/(s(-4/7)/s)))44)(-5) assuming s is positive. s(4180/21) Simplify (i(-28)/(i23ii))(2/15) assuming i is positive. i(-106/15) Simplify (r(-4)r*7)/(r/(rrr/(rrr(-2/7)r)))(-3) assuming r is positive. r(36/7) Simplify (uuu*(-1/4)u)/((uuu*(-8/5))/u)(u/((u/u*(2/9))/u))/(uu(-8)) assuming u is positive. u(2083/180) Simplify ((s12/s)/s(-4))/(s/s(-6))44 assuming s is positive. s(-293) Simplify z(-1/4)z(1/8)z*(-2/9)zz/z(-6/11)z assuming z is positive. z(2533/792) Simplify (y(2/3)/(y*(-1/2)/yy))/((y/(y(-2/15)/y))/y)31 assuming y is positive. y(-1019/30) Simplify ((p(-1))*(2/31)p*(-3/4)p(-3/7))(-1/13) assuming p is positive. p*(83/868) Simplify (w/(ww*(-9)ww))/(w6/w)w*(7/4)w5 assuming w is positive. w(35/4) Simplify (b/(b/(b(2/5)/b)))(1/21)/((b8/b)/b(1/6)) assuming b is positive. b(-1441/210) Simplify (((s/s(-12)s)/(ss*14s))(-38/5))(-3/10) assuming s is positive. s*(-114/25) Simplify ((r(r/r*(-1/6))/rr)/r(9/7))(-1/4) assuming r is positive. r(-37/168) Simplify (l(-11)l(-6))/(l(1/20)l(-7)) assuming l is positive. l(-201/20) Simplify ((r(13/3)/r)/(r/r(4/9)))/(r(6/7))(8/7) assuming r is positive. r(793/441) Simplify ((b(-17)/b)/(b/(b/(b*(-25)b))))(30/7) assuming b is positive. b(180/7) Simplify ((oo4/o)/o)(-23)/(o8o/o(3/4)) assuming o is positive. o(-309/4) Simplify (w/w(-25))/w(-3/11)(ww/(w/(ww/(ww(ww/(w/w*27w))/w)w)))(-3) assuming w is positive. w(1081/11) Simplify (((y24/y)/yy)/yy18)/(y/y(-3/2)y)(3/5) assuming y is positive. y(379/10) Simplify ((xx(-19)/x)(-2/17))(2/9) assuming x is positive. x(76/153) Simplify (b1/b)/b(-1/9)(b*3b)(-1/3) assuming b is positive. b(-11/9) Simplify ((tt(-1/14)t)/(t*(1/8)t))/(t*(-1/10)t26/t) assuming t is positive. t(-6747/280) Simplify ((h*(-13)h(-1/3))(-49))(1/22) assuming h is positive. h(980/33) Simplify ((v*(-2)/vvvv(1/2))/(v/v8v2))(-5/7) assuming v is positive. v(-45/14) Simplify (k(-3/2)k/((k*(3/17)k)/k))(9/8) assuming k is positive. k(-207/272) Simplify (n(-7)/n)/n(-12)(n/(((n/(n(-2/7)n))/n)/nn))/n(2/7) assuming n is positive. n(38/7) Simplify ((pp(p2/p)/pppp)/pp)/(p/(p12/p))(p*(-8)/ppp)/(pp(5/4)) assuming p is positive. p(23/4) Simplify (a*(-1/16)/aa/a(-1))/(a(-6)/(((a*(-12)aaa)/a)/a)) assuming a is positive. a(-65/16) Simplify ((y4y(-1/20))/(y2/yy(-6)))(-17/4) assuming y is positive. y(-3043/80) Simplify ((l(-5)l)/(l/(l0l))(l/l(-1))(3/8))(-2/35) assuming l is positive. l(13/70) Simplify ((h/(h/(h(-4)/hh)hh))/(h*(-10)h))/(h/(h*13hhhh)hh(-2/9)h) assuming h is positive. h*(155/9) Simplify (j/(jj*30))/(jj*(-7))(j/j(-2/55))(-23) assuming j is positive. j(-2631/55) Simplify (p7/p)*(6/5)pp25pp28p assuming p is positive. p*(316/5) Simplify ((((u/((uu/u*4u)/u))/u)/u)/u*(1/6)(uu/u(-5/4))/u(-5))(6/17) assuming u is positive. u(109/34) Simplify y(1/30)yyy*(18/11)(y/(yy13))/(y(-1)y) assuming y is positive. y*(-3079/330) Simplify (nn(-10)/n)(-4)(n(-36)/n)/n(5/3) assuming n is positive. n(4/3) Simplify ((s/(s(-1/2)/ss)s/s(-3)s)(-21/4))(-1/3) assuming s is positive. s(91/8) Simplify ((d(-5)d)/d(-3)d*(-4)/(dd(-1/4)))(-8) assuming d is positive. d46 Simplify (q(-14)/qq/(q/q(3/7)))/(q(-2/25))(-1/64) assuming q is positive. q(-81607/5600) Simplify (q7/(qq(q/q12)/q))/(((q/(q(2/27)q))/qq)/((q/(q/(qqq/(q(q(q(-2)qq)/q)/qq)q)))/q)) assuming q is positive. q(515/27) Simplify k(-3/7)/k2k*21/kk/k*(-5/4)k assuming k is positive. k*(583/28) Simplify ((b(bb(-3/11))/b)/(b(-11)/b))/(b(-2/17)/(bbbbb(-12)/b)) assuming b is positive. b(719/187) Simplify (yy/((y/y*(-6)y)/y)y(-1)(y(-2/5))9)(-2/153) assuming y is positive. y(32/255) Simplify ((c(1/3))2/(cc(-1/4))(-2/5))(-2/61) assuming c is positive. c(-29/915) Simplify (c37ccc(2/51)/c)(-20) assuming c is positive. c(-38800/51) Simplify (o(-1/3))*(-12/17)/((o(o/o(-1/4))/o)/o)41 assuming o is positive. o(-681/68) Simplify (y(1/3))41/(y(1/7)/y(-6/11)) assuming y is positive. y(2998/231) Simplify ((cc(11/2)/c)/(cc/(c*13ccc)))/(cc(cc(-9))/ccccc(-1/13)) assuming c is positive. c(613/26) Simplify o(4/5)/oo/(oo/(o(o*(1/11)o)/o))(o(-6))*12 assuming o is p	{ "pile_set_name": "DM Mathematics" }
5640 to the nearest integer? 9 What is 79197 to the power of 1/2, to the nearest integer? 281 What is the square root of 2018 to the nearest integer? 45 What is 24296 to the power of 1/9, to the nearest integer? 3 What is the third root of 4082 to the nearest integer? 16 What is 2845 to the power of 1/3, to the nearest integer? 14 What is the square root of 664 to the nearest integer? 26 What is the square root of 6508 to the nearest integer? 81 What is the fifth root of 1100 to the nearest integer? 4 What is the seventh root of 40595 to the nearest integer? 5 What is 10998 to the power of 1/9, to the nearest integer? 3 What is 32748 to the power of 1/7, to the nearest integer? 4 What is 4338 to the power of 1/2, to the nearest integer? 66 What is the tenth root of 9380 to the nearest integer? 2 What is the third root of 1512 to the nearest integer? 11 What is the square root of 30177 to the nearest integer? 174 What is the seventh root of 16806 to the nearest integer? 4 What is the square root of 1945 to the nearest integer? 44 What is 2477 to the power of 1/2, to the nearest integer? 50 What is the sixth root of 818 to the nearest integer? 3 What is the square root of 601 to the nearest integer? 25 What is the square root of 26188 to the nearest integer? 162 What is 17234 to the power of 1/2, to the nearest integer? 131 What is the square root of 10 to the nearest integer? 3 What is 62 to the power of 1/10, to the nearest integer? 2 What is the third root of 1234 to the nearest integer? 11 What is the square root of 2760 to the nearest integer? 53 What is 22857 to the power of 1/4, to the nearest integer? 12 What is the sixth root of 3264 to the nearest integer? 4 What is 391 to the power of 1/2, to the nearest integer? 20 What is 36728 to the power of 1/2, to the nearest integer? 192 What is 576 to the power of 1/3, to the nearest integer? 8 What is 10093 to the power of 1/3, to the nearest integer? 22 What is the third root of 9277 to the nearest integer? 21 What is 5718 to the power of 1/2, to the nearest integer? 76 What is 167659 to the power of 1/7, to the nearest integer? 6 What is 4195 to the power of 1/2, to the nearest integer? 65 What is the sixth root of 6276 to the nearest integer? 4 What is the cube root of 565 to the nearest integer? 8 What is the cube root of 38396 to the nearest integer? 34 What is 150834 to the power of 1/3, to the nearest integer? 53 What is 131079 to the power of 1/3, to the nearest integer? 51 What is the cube root of 93502 to the nearest integer? 45 What is 6163 to the power of 1/5, to the nearest integer? 6 What is the square root of 39346 to the nearest integer? 198 What is the eighth root of 83202 to the nearest integer? 4 What is the third root of 586 to the nearest integer? 8 What is 1323 to the power of 1/2, to the nearest integer? 36 What is 1985 to the power of 1/6, to the nearest integer? 4 What is 3031 to the power of 1/8, to the nearest integer? 3 What is 17192 to the power of 1/2, to the nearest integer? 131 What is 9684 to the power of 1/2, to the nearest integer? 98 What is the cube root of 91871 to the nearest integer? 45 What is the cube root of 55194 to the nearest integer? 38 What is the cube root of 361 to the nearest integer? 7 What is the square root of 11467 to the nearest integer? 107 What is the cube root of 4595 to the nearest integer? 17 What is the square root of 84130 to the nearest integer? 290 What is 6989 to the power of 1/8, to the nearest integer? 3 What is 1009 to the power of 1/2, to the nearest integer? 32 What is 1121 to the power of 1/8, to the nearest integer? 2 What is 2689 to the power of 1/2, to the nearest integer? 52 What is 2568 to the power of 1/3, to the nearest integer? 14 What is 137020 to the power of 1/10, to the nearest integer? 3 What is the tenth root of 516 to the nearest integer? 2 What is 70805 to the power of 1/8, to the nearest integer? 4 What is 6551 to the power of 1/10, to the nearest integer? 2 What is the square root of 55127 to the nearest integer? 235 What is the cube root of 13288 to the nearest integer? 24 What is 205 to the power of 1/8, to the nearest integer? 2 What is the square root of 915 to the nearest integer? 30 What is 22458 to the power of 1/3, to the nearest integer? 28 What is the square root of 33907 to the nearest integer? 184 What is the third root of 4028 to the nearest integer? 16 What is 6066 to the power of 1/10, to the nearest integer? 2 What is 1980 to the power of 1/8, to the nearest integer? 3 What is the fourth root of 143058 to the nearest integer? 19 What is the seventh root of 988 to the nearest integer? 3 What is the cube root of 1123 to the nearest integer? 10 What is the seventh root of 71737 to the nearest integer? 5 What is 86231 to the power of 1/4, to the nearest integer? 17 What is the cube root of 1857 to the nearest integer? 12 What is the fifth root of 8935 to the nearest integer? 6 What is 3248 to the power of 1/6, to the nearest integer? 4 What is 109 to the power of 1/3, to the nearest integer? 5 What is 13567 to the power of 1/2, to the nearest integer? 116 What is the cube root of 37201 to the nearest integer? 33 What is the eighth root of 389 to the nearest integer? 2 What is 6077 to the power of 1/10, to the nearest integer? 2 What is the cube root of 22836 to the nearest integer? 28 What is 1174 to the power of 1/3, to the nearest integer? 11 What is 152 to the power of 1/4, to the nearest integer? 4 What is 63226 to the power of 1/10, to the nearest integer? 3 What is 3748 to the power of 1/3, to the nearest integer? 16 What is the cube root of 15769 to the nearest integer? 25 What is the cube root of 46921 to the nearest integer? 36 What is the fifth root of 62124 to the nearest integer? 9 What is the cube root of 37356 to the nearest integer? 33 What is the cube root of 329 to the nearest integer? 7 What is the fourth root of 5173 to the nearest integer? 8 What is the eighth root of 783 to the nearest integer? 2 What is 149140 to the power of 1/2, to the nearest integer? 386 What is 162 to the power of 1/7, to the nearest integer? 2 What is 9044 to the power of 1/2, to the nearest integer? 95 What is the square root of 10353 to the nearest integer? 102 What is 12216 to the power of 1/6, to the nearest integer? 5 What is the square root of 197618 to the nearest integer? 445 What is 102707 to the power of 1/3, to the nearest integer? 47 What is 11263 to the power of 1/10, to the nearest integer? 3 What is the third root of 11914 to the nearest integer? 23 What is 4353 to the power of 1/5, to the nearest integer? 5 What is the square root of 1184 to the nearest integer? 34 What is the tenth root of 16566 to the nearest integer? 3 What is the fifth root of 9717 to the nearest integer? 6 What is 748 to the power of 1/2, to the nearest integer? 27 What is the third root of 3013 to the nearest integer? 14 What is the square root of 15088 to the nearest integer? 123 What is the cube root of 158 to the nearest integer? 5 What is the eighth root of 24826 to the nearest integer? 4 What is 66524 to the power of 1/3, to the nearest integer? 41 What is the square root of 129528 to the nearest integer? 360 What is the square root of 263 to the nearest integer? 16 What is the ninth root of 7517 to the nearest integer? 3 What is 464 to the power of 1/6, to the nearest integer? 3 What is the sixth root of 1478 to the nearest integer? 3 What is the ninth root of 25112 to the nearest integer? 3 What is 27532 to the power of 1/2, to the nearest integer? 166 What is the tenth root of 25280 to the nearest integer? 3 What is the seventh root of 14601 to the nearest integer? 4 What is 26099 to the power of 1/4, to the nearest integer? 13 What is 59761 to the power of 1/7, to the nearest integer? 5 What is the seventh root of 5495 to the nearest integer? 3 What is the cube root of 2456 to the nearest integer? 13 What is the square root of 5287 to the nearest integer? 73 What is 14624 to the power of 1/2, to the nearest integer? 121 What is the square root of 131619 to the nearest integer? 363 What is 66863 to the power of 1/5, to the nearest integer? 9 What is the square root of 6518 to the nearest integer?	{ "pile_set_name": "DM Mathematics" }
of 9465 and 18930? 18930 What is the common denominator of 24/65 and 7/76? 4940 What is the smallest common multiple of 28410 and 6? 28410 What is the common denominator of 49/45838 and 77/3526? 45838 Calculate the least common multiple of 6273 and 4182. 12546 Calculate the common denominator of -42/1025 and 51/39565. 197825 Find the common denominator of -99/12064 and -91/2. 12064 What is the common denominator of 44/68439 and -10/9? 205317 Find the common denominator of 7/98580 and -15/2. 98580 Calculate the smallest common multiple of 59 and 245263. 245263 Find the common denominator of -61/1852449 and -137/6. 3704898 What is the common denominator of -29/95 and 43/1610? 30590 What is the smallest common multiple of 115 and 18920? 435160 What is the common denominator of 131/60 and 19/2320110? 4640220 Calculate the common denominator of -45/115628 and -23/274. 115628 Calculate the smallest common multiple of 129954 and 35442. 389862 What is the least common multiple of 23529 and 33? 23529 Calculate the least common multiple of 2100 and 1050. 2100 Find the common denominator of 49/12969 and -52/12969. 12969 What is the common denominator of 81/664 and -63/64? 5312 Calculate the least common multiple of 46933 and 422397. 422397 What is the least common multiple of 3633 and 315? 54495 Find the common denominator of 1/55584 and -15/176. 611424 Find the common denominator of -55/4282 and -23/2. 4282 Find the common denominator of -89/2464 and -87/1552. 239008 Calculate the common denominator of 71/54597 and 55/9. 163791 What is the smallest common multiple of 6501 and 21276? 234036 Calculate the common denominator of -17/6125 and -36/1225. 6125 Calculate the common denominator of 43/23332 and 77/164. 956612 What is the lowest common multiple of 4200 and 3000? 21000 What is the smallest common multiple of 84 and 27366? 383124 Calculate the common denominator of 30/8159 and -24/287. 57113 Find the common denominator of -59/15116 and 33. 15116 What is the common denominator of 11/32 and 33/41864? 167456 What is the least common multiple of 9192 and 492? 376872 What is the common denominator of -117/14480 and 19/724? 14480 Calculate the least common multiple of 276274 and 1070. 1381370 Calculate the least common multiple of 15 and 47180. 141540 Find the common denominator of 1/6 and -119/16146. 16146 Calculate the common denominator of -61/7032 and -77/548496. 548496 Calculate the lowest common multiple of 465 and 21828. 3383340 What is the common denominator of 29/14 and 95/853342? 853342 Calculate the common denominator of -109/4842 and -67/150. 121050 What is the lowest common multiple of 11060 and 140? 11060 Find the common denominator of 105/67796 and 67/22. 745756 What is the common denominator of 97/584 and -57/365? 2920 What is the common denominator of 87/202312 and 51/119548? 2630056 Calculate the common denominator of -2/16707 and 85/112. 1871184 Calculate the common denominator of 107/12810 and 131/6. 12810 What is the least common multiple of 171492 and 20745? 2572380 Find the common denominator of 51/10205 and -56/1495. 234715 Calculate the common denominator of -67/172 and 85/30232. 1299976 Calculate the common denominator of 67/807432 and 59/2422296. 2422296 Calculate the common denominator of 9/901241 and -8/9. 8111169 Calculate the lowest common multiple of 20 and 180296. 901480 Calculate the common denominator of -37/14 and -29/9008. 63056 Calculate the lowest common multiple of 3795819 and 10. 37958190 What is the smallest common multiple of 20677 and 870? 620310 What is the common denominator of -167/1092 and 57/4186? 25116 Find the common denominator of -88/4977 and -41/1505. 1070055 What is the least common multiple of 8080 and 42016? 210080 Calculate the least common multiple of 36 and 28900. 260100 Calculate the least common multiple of 70 and 38913. 389130 What is the least common multiple of 338 and 13? 338 Find the common denominator of -83/587664 and -83/587664. 587664 Find the common denominator of 107/11952 and -93/932. 2784816 What is the common denominator of -161/4020 and 125/48? 16080 Calculate the lowest common multiple of 363 and 291. 35211 What is the smallest common multiple of 48 and 23784? 47568 What is the common denominator of -85/1781692 and 59/18? 16035228 Calculate the common denominator of 163/1380 and -181/120. 2760 What is the common denominator of 51/560 and -107/2464? 12320 Find the common denominator of 137/3900 and 79/2. 3900 What is the common denominator of -25/125111 and -27/2684? 5504884 Calculate the least common multiple of 5 and 32359. 161795 Calculate the least common multiple of 2908380 and 2423650. 14541900 What is the smallest common multiple of 2730 and 612? 278460 Calculate the lowest common multiple of 1118 and 416. 17888 Calculate the common denominator of 57/794360 and 59/280. 794360 What is the common denominator of 13/30 and 155/51072? 255360 Calculate the common denominator of -25/13566 and -8/51. 13566 Find the common denominator of 57/3130 and 73/28170. 28170 Calculate the common denominator of -37/89559 and 91/1070. 895590 Calculate the lowest common multiple of 630 and 8316. 41580 Calculate the common denominator of 71/585543 and -19/147. 4098801 Calculate the smallest common multiple of 42294 and 451136. 1353408 Calculate the smallest common multiple of 198474 and 798. 1389318 Calculate the least common multiple of 52800 and 240. 52800 What is the common denominator of -37/6324 and -17/1333? 271932 Find the common denominator of 47/3386 and -121/42. 71106 Find the common denominator of 41/10 and -17/36590. 36590 Calculate the least common multiple of 6736 and 4631. 74096 Calculate the common denominator of -23/157674 and -199/660. 1576740 Calculate the smallest common multiple of 2376 and 5346. 21384 What is the common denominator of -129/460 and -52/54763? 1095260 What is the common denominator of -8/59823 and 1/84? 1675044 Find the common denominator of 65/34443 and 67/48. 551088 What is the smallest common multiple of 208549 and 113754? 1251294 Calculate the common denominator of -61/144 and -77/1688. 30384 Calculate the least common multiple of 4644 and 54. 4644 Find the common denominator of -101/16992 and 29/42480. 84960 Calculate the lowest common multiple of 90 and 4. 180 What is the lowest common multiple of 1403745 and 35? 1403745 Calculate the least common multiple of 192170 and 192170. 192170 Find the common denominator of -131/25680 and 67/3210. 25680 What is the smallest common multiple of 384 and 38400? 38400 What is the common denominator of -91/15720 and 89/10480? 31440 Calculate the common denominator of -5/365344 and -82/14679. 3288096 Calculate the lowest common multiple of 3843 and 4270. 38430 Calculate the common denominator of -24/443675 and -48/88735. 443675 What is the lowest common multiple of 138 and 127? 17526 What is the lowest common multiple of 971 and 21? 20391 Calculate the smallest common multiple of 1384 and 15224. 15224 Find the common denominator of 37/419 and -71/22626. 22626 What is the common denominator of 79/13232 and -133/768? 635136 Calculate the common denominator of 51/10 and -25/83166. 415830 What is the common denominator of -15/5488 and 59/14? 5488 Calculate the least common multiple of 432 and 288792. 577584 Calculate the common denominator of 169/9996 and 83/192. 159936 Find the common denominator of 29/272 and 53/21216. 21216 What is the least common multiple of 12 and 2577? 10308 Calculate the smallest common multiple of 4488 and 83028. 166056 What is the least common multiple of 28480 and 85440? 85440 Calculate the common denominator of 47/5928 and -37/51168. 972192 Find the common denominator of 57/28 and 60/26677. 106708 What is the lowest common multiple of 13932 and 4? 13932 What is the common denominator of 23/38044 and 69/400? 3804400 Calculate the smallest common multiple of 108 and 102618. 615708 What is the lowest common multiple of 328458 and 109486? 328458 What is the least common multiple of 69470 and 30? 208410 Calculate the lowest common multiple of 311670 and 90. 311670 Calculate the smallest common multiple of 24703 and 70. 247030 Calculate the lowest common multiple of 241818 and 886666. 2659998 Ca	{ "pile_set_name": "DM Mathematics" }
(-15)/(-6)(-319)/228/(-5). Solve -28 + b = 10c for c. 3 Suppose y - 55 = -53. Suppose -yn + 16 = f + n, 0 = n - 2. Solve f = -10q + 5q for q. -2 Suppose 11z - 6z = -360. Let k = z - -107. Suppose -k - 49 = -7f. Solve -2m - f = 2m for m. -3 Suppose 2b - 108 = -5n + 82, 4n = 4b + 124. Suppose 5p - 55 = -5a, 2p + 1380a - 1385a - 36 = 0. Solve -29 = py + n for y. -5 Let u(f) = 10 - 25 + 3f - 4f2 + 10. Let r be u(6). Let b = 134 + r. Solve -3y - 6 = -b for y. -1 Suppose -303 = -29p - 71. Let o = -18 + 23. Solve pm = om - 3 for m. -1 Let d be 7(1 + 3 + -2). Let n be ((-71)/(-2))/((35/d)/5). Let a = n + -69. Solve a = -0v - 2v for v. -1 Let q(u) = -12u2 + 57u - 13. Let y be q(4). Solve -12g = 11g + y for g. -1 Suppose 5y - t - 16 = 0, -5y + y - 5t = -36. Suppose 5w - 504 = -4w. Suppose wj + 11 = 4r + 55j, -4j = -2r - 12. Solve 0 = -yv - 0 - r for v. -1 Let k(g) = 73g - 6. Let a be k(-10). Let i = a - -739. Solve -i = 12q - 13q for q. 3 Suppose 7c - 5 = 2c. Let u be ((-6)/4)/((-9)/12). Suppose 3w = 2a - 12, a - 2w + 19 = 26. Solve c + u = -ap for p. -1 Let s = 1905 + -1322. Let m = s + -583. Solve 4r - 7 + 3 = m for r. 1 Let j(q) = -6q + 37. Let c be j(-9). Suppose s - c = -6s. Solve 8 = -17k + sk for k. -2 Let j = 559 + -540. Let z = -20 + 28. Suppose u + z = j. Solve 1 - u = -2r for r. 5 Let t be 16/(-240)-1810(5 + -2). Solve 43p - t = -18 for p. 8 Suppose -2m - m + 3i + 9 = 0, -m - 2i = -12. Suppose 95 = 4x + 11. Suppose 1690 = 87a + 67a + 184a. Solve m - x = -as for s. 3 Let a(m) = -18m + 3. Let u be a(-3). Let w be ((-5)/4)/(-5)-8. Let f be (-3)/w38/u. Solve -4l - f - 3 = 0 for l. -1 Let p = 60 + -32. Suppose 2z - 28 = -4x - 6, 4x = -4z + p. Suppose 4 = -xn, -2s + 3n + 2n + 17 = 0. Solve 3k = 5k + s for k. -3 Let q(t) = -t3 + 11t*2 + 12t. Suppose -k - 3k + 52 = 4y, 4y = -2k + 28. Let c be q(k). Solve -l + 2 = -c for l. 2 Let v(z) = 2z3 + 108z*2 + 103z - 146. Let r be v(-53). Solve -32 = -3l - rl for l. 2 Suppose 5 + 7 = 12y. Suppose 2h - y = 1. Let f be (-456)/(-30) + -3 + h/(-5). Solve -3p + f = -0p for p. 4 Let j be ((-24)/15)/((-4)/20). Suppose 73 = -ju + 289. Solve -6z - 3z = -u for z. 3 Suppose 35t = -10t + 1347 + 1488. Solve 2b + t = 67 for b. 2 Suppose 0 = -q - 6p + 2p + 8, -p = -4q + 15. Let n(b) = b3 - 5b*2 + 2b + 13. Let w be n(q). Solve 0 = wj - 15 + 5 for j. 2 Let p = -9518 + 9538. Solve 240 - 260 = -py for y. 1 Let t(i) = i*2 - 11i + 1 + 12 + 11 - 5 + 1. Suppose -4b = -0b - 36. Let q be t(b). Solve qc - 3c = 3 for c. -3 Let j be -10((-143)/22 + 5). Solve 25g - 22g - j = 0 for g. 5 Suppose -42s + 210 + 294 = 0. Solve -253a = -256a - s for a. -4 Let w(d) = 111d + 777. Let b be w(-7). Solve -4x - 2 - 10 = b for x. -3 Suppose -2i + 52 = -25p + 29p, -3p - 3i + 51 = 0. Solve -59 = -pc - 5 for c. 6 Suppose -15 = 5s, -8s + 4s = 4v - 0v. Solve 8j - v = -51 for j. -6 Let c be 1/(((-6)/4)/(-3)). Let u be (c/3)/(8/(-516)). Let x = 44 + u. Solve 4o + 9 = x for o. -2 Let v be -1 + 2 - (7 - 8). Suppose 0u - 9 = -5u - 2y, -2y + v = -2u. Let c be -2 - (-5 - -2) - u. Solve 5w = -cw for w. 0 Let a be -24((-10)/(-3) + -4). Suppose 0f = -2f + a. Suppose f = -b + 9b. Solve 3 = -x - b for x. -4 Suppose -806p - 2 = -801p - 3q, -3p + q + 2 = 0. Solve 0 = pu + 125 - 129 for u. 2 Let z be 15/3 - 161. Let g be 2z/((-22)/4). Solve 4 = -gd - 4 for d. -2 Suppose 3l + 2t - 8464 = 3t, 5l = -5t + 14160. Solve -2m = 2816 - l for m. 4 Let m be (4 + -1)/((-2)/((-128)/12)). Solve 22p - 6 = mp for p. 1 Suppose -9 = -0j - j. Let s = 399 + -396. Suppose -24d = -3 + s. Solve d - j = -3y for y. 3 Let g = 18110 + -17370. Solve gu - 15 = 755u for u. -1 Suppose -3q - 105 = -5z, 2z + 2q + 22 = 48. Solve -4n + z - 22 = 0 for n. -1 Let r be 4 + (-20)/6 - (-46)/3. Suppose r - 4 = -3s, 0 = -5u - 3s + 133. Suppose -2y - u = -37. Solve yg + 0g - 16 = 0 for g. 4 Let a(g) = 4g3 - 82g*2 + 43g - 39. Let l be a(20). Solve -li - 67 = 17 for i. -4 Suppose -14k = 26k - 9640. Solve ko + 10 = 243o for o. 5 Suppose -54 = -23h - 4h. Solve 2 = -10o + h for o. 0 Let o(u) be the third derivative of -u6/15 - u3/3 - 23u2. Let t be o(1). Let s be t(4 - (-9)/(-2)). Solve -4i - i - s = 0 for i. -1 Let z be (-6)/10 - (-66)/110. Solve -21o + 23o - 12 = z for o. 6 Let a = -412 - -416. Solve 13 = -ai - 15 for i. -7 Let g(j) = 2j3 - 24j*2 - 58j + 32. Let s be g(14). Suppose -16 = 5q + 4. Let r be (-30)/q - (-7)/(-14). Solve rc = sc - 12 for c. -4 Suppose 16 + 18 - 6 = 14j. Suppose 2m = 3p - 40, -3p + 4m + m + 55 = 0. Let d be 1/(-3)-33. Solve -p = db + j for b. -4 Let f be 7 - (-6)/((-1)/(-4)2). Solve fm - 29 + 29 = 0 for m. 0 Suppose -4r - 4z + 52 = 0, -4r = -5r - 5z + 25. Suppose -rd + 44 = d. Solve du = -2 + 6 for u. 1 Let p(t) = 5t3 + 3t*2 + 4t + 2. Let r be p(-2). Let z = r - -30. Let h be -3 - -1 - (-9 - z). Solve -ha = -7a for a. 0 Let i = -223 - -244. Suppose -iq - 38 = -206. Solve -2k + 2 = q for k. -3 Let j = 9858 + -9796. Solve js - 51s = -11 for s. -1 Let l(d) = 2d3 + 5d*2 + 7d - 23. Let m be l(2). Suppose 28 = mk + k. Solve -4a = -5a - k for a. -1 Let o(f) = 10f - 2. Suppose u - 3l - l = -3, 0 = 4u + 3l - 7. Let g be o(u). Suppose -9q = -11q + g. Solve qa - 3a = 3 for a. 3 Let x(a) = -4 + 28a + 10 - 1 - 1. Let w be x(1). Let h = w - 26. Solve 3i = i + h for i. 3 Suppose 57q - 52q = -5x + 60, 0 = q + 4x - 21. Solve -qf - 1012 = -931 for f. -9 Suppose -3q - 210 = 3q. Let w be ((98/q)/(-7))/(3/90). Solve 6j = -w + 18 for j. 1 Let s(a) = a2 - 6a - 12. Let b be s(-2). Suppose 6i - 2i + 5k - 23 = 0, -bk + 10 = -i. Solve 34o = 35o + i for o. -2 Let n(v) = 3v + 19. Let b be n(-6). Let w be (143/(-26))/(b/(-2)) - -5. Solve 0 = -2k + 6k - w for k. 4 Let w(j) = 20j*2 - 25j + 10. Let r be w(1). Let d be (-6)/9 + (-2)/(-3). Solve 0f - rf - 20 = d for f. -4 Let x = 12 + -4. Suppose 0 + 0 = -14b. Suppose b = -xa + 23 + 73. Solve 2q + a = -q for q. -4 Suppose 0 = -18t + 648 + 36. Solve -32b - 36 = -tb for b. 6 Suppose 66t = 53t - 3601. Let r = t + 290. Solve -3j - 16 = rj for j. -1 Let h(t) = -12t - 42. Let l be h(14). Let k = l - -212. Suppose 4z - 30 = -s, -4z + 1 + 19 = 0. Solve 4p = s - k for p. 2 Suppose y - 33 = -2z, 2y - 4z - 8 = 26. Solve -66v - 287 = -yv for v. -7 Suppose 0 = 2r - 6, 10r - 9r = 2n - 57. Solve n - 23 = -7p for p. -1 Suppose -2z = -2v + 41 - 3, -7z = -v + 19. Solve 0 = 12o - v + 43 for o. -2 Let b = -21 + 23. Suppose 0 = 4y - by - 8. Let n be (8/(-3))/(y/3 - 2). Solve 0 = -4c - 0 - n for c. -1 Let g = 5442 + -5428. Let n(s) = -s3 + 5s*2 + 8s + 4. Let z be n(6). Solve -10i - z = -gi for i. 4 Let i = -14110 - -14152. Solve 40 - 418 = -it for t. 9 Suppose p = 2u - 449, -494 = 4u - 5p - 1395. Solve -uj + 212j + 48 = 0 for j. 4 Let y be 690/24 - 7/(-28). Solve 34r = y + 73 for r. 3 Let i be (16/120(2 - 86))/((-16)/40). Solve -36 = 8a - i for a. -1 Suppose -27 = -3b - 3n, -b = b - 3n - 8. Let s be (7 - -7)2/b. Let z be 8/((6/s)/(18/24)). Solve z = d + d for d. 2 Suppose -10y + 12464 = 3504. Solve 5l + y = 871 for l. -5 Let p = -1062 + 549. Let j = p - -516. Solve -3m + j = -3 for m. 2 Suppose -o - 3z + 121 = 0, 4o + 4z - 31 = 453. Let b = o + -115. Solve 0 - b = -3f for f. 2 Suppose 3n - 159 = -3k, -287n + 291n = 12. Solve 13h - 15 - k = 0 for h. 5 Suppose -4n - 23q - 4 = -27q, q + 11 = -n. Let k be ((-9)/n)/(1/12). Solve kb - 13b + 20 = 0 for b. -4 Let x(o) = -4o2 + 257 - 3o*3 + 2o*2 + 256 - 511 + o. Let w be x(-1). Solve 0 = wk - 4 - 4 for k. 4 Let w = -31 - -196. Let x be 22/w - 264/(-45). Solve 20 = xk - k for k. 4 Let c = 184 - 180. Let t be (5/(-2))/(39/(-78)). Solve -tn = -6n - c for n. -4 Suppose 6w = -0y + 4y - 8, -5y = -25. Suppose -n + m + 8 = 0, -m = wm + 3. Solve -nc + 12c - 5 = 0 for c. 1 Let v(c) = c*3 + 11c*2 + 22c + 46. Let g be v(-9). Solve 9z - 1 = -g for z. -1 Let p = 81186 + -81184. Let u be (0 - -3) + 0/1. Solve -pa + ua = -4 for a. -4 Let j be 2/4 + 1468/405. Let d = 193 - j.	{ "pile_set_name": "DM Mathematics" }
q*3 + 17q*2 - 50q*2 + 16q*2 + 8q - 1. Let a(k) = -4k3 - 6k*2 + 3k. Let o(x) = -8a(x) + 3u(x). What is o(-3)? -3 Suppose 0z - 1 = z. Let g(y) = -47y + 52y - 2y + 1. What is g(z)? -2 Let m(k) = 9 - k + k*3 + 8 - 1333k*2 - 3k + 1328k2. Determine m(5). -3 Let b(o) = -2o*2 + 16o + 5. Suppose 0 = 28m - 26m - 5x - 23, 5x = -5. Give b(m). -13 Let a(j) be the first derivative of -j*4/4 + 5j - 5. Suppose 0b - 5 = b, -f = -2b - 3. Let n(i) = i*2 + 6i - 7. Let d be n(f). What is a(d)? 5 Let b(i) = -4i - 3. Let v be b(-2). Let r(a) be the first derivative of -a4/4 + 5a3/3 - a2 - a - 22825. Determine r(v). -11 Let i(z) = -3z2 - 169z - 1444. Let v(l) = 2l2 + 112l + 964. Let h(o) = -5i(o) - 8v(o). Determine h(-13). 2 Let m(t) = -2t - 19. Suppose 0 = 3y + 4s + 29, -y = 5s + 829 - 823. Calculate m(y). 3 Let g be 52/65(-10)/4. Let v be ((-3)/(-6))/((-1)/g). Let w(i) = 1 - i2 + 1 + 0i*2 - v. Determine w(3). -8 Let q(l) = 62l + 36. Let s(m) = 113m + 73. Let r(g) = 9q(g) - 5s(g). Determine r(-5). -6 Suppose 88u + 103 + 161 = 0. Let t(q) = q3 + q2 - q - 4. Give t(u). -19 Let v = -1381 - -1379. Let g(l) = -14l + 17l - 2 + 3 + 4l2. Calculate g(v). 11 Let v(i) = 28 - 6i*2 + 11227i + 5i2 - 11209i. Calculate v(19). 9 Let f be 4 + 5 + 0 + 0/(-2). Suppose 2h + 5 = v, -f = 4v + h - 2. Let p(m) = -6 - m + 6m3 + 1 - m2 + 4 + 0. What is p(v)? -7 Let x(m) = 4m*2 + 20m + 53. Let r(a) = -13a2 - 63a - 160. Let n(s) = -6r(s) - 19x(s). Give n(0). -47 Suppose 0 = -5k - 5i, 4k - 8k + 2i = -30. Suppose 0 = -kq + 3y + 14, -3q - 9y + 18 = -14y. Let n(u) = 14u2 + u - 1. What is n(q)? 14 Let k be 244/(-28) + 1 + 102/(-357). Let u(b) = -b2 - 2b + 5. Determine u(k). -43 Let d be (-4)/((13 - 5)/(-16)) - 24. Let r(u) = -u - 19. What is r(d)? -3 Let c(v) = -22607v + 22604v + 0v3 - 9v*2 - 2v*3. What is c(-5)? 40 Let m(u) = 5u*2 - 1. Suppose -12h + 0h - 36 = 0. Let n be 2/(-3)(h/(-2) + 0). Calculate m(n). 4 Suppose -2v + 19 = -5u, 4 = -v + 3u + 11. Suppose -5p + v = -3. Let q(b) = -9b + 7. Let g(i) = i. Let a(m) = 4g(m) + q(m). Calculate a(p). -18 Let d be 315/91. Suppose 2u = -d - 7. Let p(x) = -2x - 160. Let m(k) = 9k + 693. Let c(n) = -3m(n) - 13p(n). Give c(u). 7 Let m(j) = 2 - 40j*2 + 3j*3 + 0 + 24j*2 + 13j. Let l(z) = -2z3 + 11z*2 - 9z - 1. Let r(k) = -8l(k) - 5m(k). Let b = 7 - 0. Give r(b). -2 Let b(k) = 491k3 + 56k*2 - 23k + 18. Let y(t) = 344t3 + 38t*2 - 15t + 12. Let m(j) = -7b(j) + 10y(j). Calculate m(4). 38 Let y(d) = -d*3 + 6d*2 - 4d - 2. Suppose 0 = -5f + w + 29, 212f = 211f + 4w + 21. What is y(f)? 3 Let p(h) = -59h + 38. Let c(q) = 101q - 64. Let d(x) = -7c(x) - 12p(x). Give d(14). 6 Let j = -39 - -39. Let z(f) be the third derivative of f5/60 - f4/24 - 2f3/3 - 5f*2 - 3. Calculate z(j). -4 Let o(y) = -17y + 4y + 12y - 9. Suppose -23 = -55i - 408. Calculate o(i). -2 Let z(w) be the second derivative of -13w5/20 + w4/12 + w*3/6 + 3w. Let b = -4588 + 4587. What is z(b)? 13 Let t(x) = -x. Let z(h) = 4h - 8. Let g(j) = 5t(j) + z(j). Let q(v) = 27v3 + 174 - 28v*3 - 5v*2 - 13v*2 + 10v. Let a be q(-18). What is g(a)? -2 Let b(s) = 7s + 104. Let r be -65(51/(-45) - 16/(-12)). What is b(r)? 13 Let z(n) be the first derivative of 2n2 + 3n + 281. Let y(m) = m*3 - 5m*2 - 6m - 5. Let u be y(6). What is z(u)? -17 Let j(l) = l*2 + 30l - 1077. Let n be j(21). Let c(d) be the third derivative of 0 + 1/60d5 + 1/4d*4 - 1/6d*3 + 0d - d*2. What is c(n)? -1 Let b(g) = 7g*3 - 22g*2 + 27g - 30. Let h(w) = 3w3 - 11w*2 + 13w - 15. Suppose 0 = -12i - 88 + 64. Let p(j) = ib(j) + 5h(j). Determine p(10). -5 Let d be (-1 - (-49)/(-3))21/(-14). Let h(p) = p*3 - 27p*2 + 26p - 3. Determine h(d). -3 Let o(l) be the second derivative of 1/6l3 - l + l2 + 2. What is o(3)? 5 Let n(y) = -26y + 9y + 25y + 41. Determine n(-5). 1 Let n = 127544 - 127538. Let l(o) be the first derivative of o*3/3 - 3o*2 + 4o - 4. Give l(n). 4 Let w(p) = -17p - 1. Suppose 4z = -2z + 18. Suppose -4h + 3 + 13 = n, 0 = -zn - 5h + 83. Let j = -37 + n. Give w(j). 16 Suppose -287 = -29g + 70g. Let c(w) = -w*2 - 6w + 1. Determine c(g). -6 Suppose -5z - 1 = -26. Suppose 5j + 4b = 29, 2j - 34 = -b + zb. Let y(m) = jm2 - 23 - 24 + 37 - m3 - 5m. Calculate y(8). 14 Let m be (((29 - 9)/(-5))/(-4))/((-3)/15). Let h(p) = 8p - 12. Give h(m). -52 Let w(j) = -8j + 8. Let r = -84 - -120. Let d be ((-160)/96)/((-10)/r). Determine w(d). -40 Let o(s) = -2s*3 + 22 + 1 - 20s*2 + 30 + 2s - 98 + 3s3. Calculate o(20). -5 Let j(u) = 26u + 91. Let c = 4934 + -4937. Determine j(c). 13 Let y(j) be the second derivative of j*4/12 - 5j*3/2 - 17j2 + j - 25. Determine y(17). 0 Let g(t) = -t2 + 6t. Let c = 2827 + -2823. Calculate g(c). 8 Let b(m) = -4m*2 - 3m - 8. Let x = -5595 - -5593. What is b(x)? -18 Let m(a) = -a + 12. Let s(j) = 6j - 73. Let c(q) = -11m(q) - 2s(q). Determine c(5). 9 Let y(l) = l3 + 10l*2 - 10l + 1. Let j be -7 + (-2 + -30)/(-4). Let q be ((-9)/2 - j)(-16)/(-8). Calculate y(q). -10 Suppose 0 = 2z - 4j - 170, -3z + 13j - 9j = -257. Let t(v) = 35v + 30v - zv. Give t(-2). 44 Let o(z) = 3z + 2. Let y(i) = -i*3 + 12i*2 - i + 15. Suppose -5r = -18 - 42. Let l be y(r). Let p = l - 5. Give o(p). -4 Let t be 10/(-8)432/(-90). Let n(o) = o3 - 7o*2 + 8o - 16. Give n(t). -4 Let p = -4270 + 4266. Let w(h) = 4h2 + 14h - 8. What is w(p)? 0 Let z(o) be the first derivative of 24 + 0o3 - 1/12o*4 + 7o*2 + 0o. Let q(b) be the second derivative of z(b). Calculate q(4). -8 Suppose -4h + 5v + 534 = 0, h - 32 = -3v + 93. Let o = -132 + h. Let g(l) = 3l3 + l2 - 2l - 2. Calculate g(o). -2 Let k(d) be the third derivative of d5/60 - d4/4 - 8d*3 + 3029d*2 + 3. Give k(-4). -8 Let s(x) = -5x - 7. Suppose t - 4g = -280, 256 = -2t - 2g - 344. Let f = 290 + t. Give s(f). 23 Suppose v + 3n - 15 = 0, -11v = -16v + 3n + 3. Suppose -4p - 5 = vk - 6k, 0 = 3p - 5k - 10. Let j(o) = -o - 2 - 3 - 4. Give j(p). -4 Let k(o) = 15o + 7. Let g(u) = -10u + 80. Let a(j) = g(j) + 3k(j). Calculate a(-3). -4 Let t(p) = p3 + 39p*2 + 41p + 75. Let b = -505 + 467. Give t(b). -39 Let a(u) = 96u - 108u + 13u - 4. Let z(c) = -2c - 1. Let s be z(-3). Let t = -9 + s. Determine a(t). -8 Let k(w) = w - 8. Let o = 22514 - 22501. Give k(o). 5 Let q(l) = -l*2 + 7l - 6. Let m be q(5). Let n(y) = -910y + 284y + 313y + 314y + 1. Determine n(m). 5 Let c(k) = -6 + 5k2 - 5k - k*3 + 2k*3 - 4k + 7k2 - 20k*2. Suppose -23a + 25a = 18. Give c(a). -6 Let g = 11033 + -11036. Let t(p) = -32p - 97. Give t(g). -1 Let q(s) = -s*3 + 9s*2 + 3s + 8. Let t be ((-2)/(-3))/(1154/15579). Determine q(t). 35 Let i(t) = 3t + t2 + 5t + 5 + 0. Suppose -18s = -u - 23s - 12, 0 = -4u - 2s - 30. Give i(u). -2 Let v(o) = 30o + 1251. Let i be v(-42). Let f(l) = l + 1. Determine f(i). -8 Let f be ((-6)/10 - 489/(-15))/4. Let v(x) = -x3 + 9x*2 - 7x. Give v(f). 8 Let d(k) = k + 4. Let v(w) = -8 + 7 - 6 - w - 20. Let u be v(-19). Calculate d(u). -4 Suppose 0v = v - 6. Let f(t) = 1 - 3t + 15t + vt. Suppose -836 = 919y - 132 + 215. Calculate f(y). -17 Let g(r) = -r3 - 11r*2 - 4r - 6. Suppose -81u + 77u = -44. Suppose uz = 4z - 77. Give g(z). 38 Let j(d) = d*2 + 10d + 1. Let p(w) = -2w. Let t(o) = 2j(o) + 11p(o). Let k be t(2). Suppose -i = -ki - 25. Let x(u) = u*2 + 4u - 5. What is x(i)? 0 Let b(z) = -z3 - z2 + 6z + 2. Let r be b(-3). Let q(t) = 23 - 5t - 2tr - 7 + t2 - 11. Give q(-6). -1 Let y(x) be the third derivative of x5/30 - 7x4/24 + x3 + 2457x2. Give y(6). 36 Let v(w) = -w3 - 5w*2 + 7w + 8. Let o be v(-6). Suppose 6d + 12 = -om + d, 0 = 3d + 12. Let l(x) = -1 - 292x + 150x + 144x. Calculate l(m). 7 Suppose -10 = -2s + 22. Let z(y) be the first derivative of y4/4 - 17y*3/3 + 8y*2 + 2y + 146. Determine z(s). 2 Let d(s) = -6s - 12 - 11 - 72s*2 + 73s2 + 33. Calculate d(3). 1 Let u(n) be the third derivative of n7/2520 - n6/90 - n5/24 - 5n*4/24 -	{ "pile_set_name": "DM Mathematics" }
ommon divisor of o and r. 5 Let d(b) = 4b2 - 3b + 15. Let t(j) = -3j2 + 2j - 15. Let g(a) = -2d(a) - 3t(a). Let n be g(0). Calculate the highest common divisor of 165 and n. 15 Let y(t) = -5t - 10. Suppose 3l + 26 = -0v + v, 0 = l + 5v - 2. Let d be y(l). What is the highest common divisor of d and 45? 15 Let f(b) = 9b3 - b2 + b. Let r be f(1). What is the greatest common divisor of 6 and r? 3 Let i = -135 + 243. Suppose 5t - 135 = -4d - 0, -4t + 3d = -i. Calculate the highest common factor of t and 27. 27 Let f(p) = -12p. Let o be f(-4). Suppose -50 = -5n + 4d, -3 = -4n + d + o. What is the highest common factor of 28 and n? 14 Let f(o) = -3o - 2. Let d be f(-6). Suppose 960 = -0q + 15q. Calculate the highest common divisor of q and d. 16 Suppose 95 = 5v - 4w, -4v + 21 = 3w - 24. What is the highest common divisor of 15 and v? 15 Let t = 15 - 9. Let v = 18 + t. What is the highest common divisor of 12 and v? 12 Let o be (-6)/(-18) + (-41)/(-3). Suppose -2h + o = 6. What is the highest common divisor of h and 28? 4 Let w = 2 - 0. Let t(u) = -u3 + 25u*2 - 24u + 22. Let f be t(24). What is the highest common factor of f and w? 2 Suppose h + 3 = 0, 0 = -2q + 3q + 4h - 69. What is the highest common divisor of 9 and q? 9 Let n = 15 + -28. Let j = -8 - n. Suppose 4l - 4 = 2i, 1 = 3i - j. What is the greatest common divisor of l and 10? 2 Let s be (-9)/6 + (-364)/(-8). Let f = -31 + s. Calculate the greatest common divisor of 13 and f. 13 Let r be (-1 - 3)/(-2) - (-44 + -29). Calculate the greatest common factor of r and 15. 15 Suppose -2k + 37 = -201. Let r be 6/(-9) + (-106)/(-6). What is the greatest common divisor of r and k? 17 Let l(m) = -m2 - 19m + 4. Let d be l(-17). What is the greatest common factor of d and 266? 38 Let m = 2 + 9. Let a = m + 9. Calculate the highest common divisor of a and 4. 4 Let f = 53 + -26. Let k(t) = 12t - 9. Let s be k(3). Calculate the highest common divisor of s and f. 27 Let p be (80/(-3))/((-6)/36). Let q be (-4)/(-18) - p/(-9). Suppose -36 - 131 = -3b - g, -g - 103 = -2b. Calculate the greatest common divisor of q and b. 18 Let p = 19 + -10. Let h(j) = -34j3 - j2. Let t be h(-1). Let g = 51 - t. Calculate the greatest common factor of g and p. 9 Let q be -4-1(-25)/(-10). What is the highest common divisor of 10 and q? 10 Let l(a) = -11a + 5. Let f be l(-2). Calculate the greatest common divisor of f and 9. 9 Suppose 0 = 5f - 0f - 10. Suppose -x + fx = 0. Let q = x - -26. What is the highest common divisor of q and 39? 13 Suppose -17 = -2o - 0o + m, 37 = 4o - 5m. Let w = -19 + 7. Let z(v) = -v*3 - 12v*2 + 12. Let a be z(w). Calculate the highest common divisor of o and a. 4 Let f(l) = 3l*2 - 2l - 5. Let j be f(-5). Calculate the greatest common factor of j and 32. 16 Let n = -186 - -321. Suppose z - 21 = 5v, 7z + 4v = 4z + 158. Let b = z - 31. What is the greatest common factor of n and b? 15 Let u = 9 - 6. Suppose u = -j + 2. Let s(g) = -49g - 1. Let l be s(j). What is the greatest common factor of l and 32? 16 Suppose 0 = 6v - 123 + 15. Calculate the highest common factor of 6 and v. 6 Let m be ((-42)/5)/(36/(-240)). What is the greatest common factor of m and 28? 28 Let c = -23 + 33. Suppose 4g - 38 = -u, 0 = 7u - 4u + 6. Calculate the greatest common divisor of c and g. 10 Let g(i) = -9i*3 - 2i*2 + 1. Let b be g(-1). Suppose 40 = 5p + 4n, 5p - n - 8 = 4p. What is the highest common divisor of p and b? 8 Let u(z) = -2z + 50. Let r be u(21). Calculate the highest common factor of 8 and r. 8 Let j be ((-4)/(-10))/(3/(-15)). Let s = 7 - j. What is the greatest common factor of s and 99? 9 Let p(z) = z + 1. Let m = 20 - 12. Let f be p(m). Suppose -3s + 3a + 60 = -s, 75 = 3s + 3a. Calculate the greatest common divisor of f and s. 9 Let w(n) = 3n + 7. Let p be w(-5). Let o be 24 - -212/p. What is the greatest common factor of o and 147? 21 Let w = 87 + -51. Calculate the greatest common divisor of 90 and w. 18 Suppose 0r = -3m + 2r + 1, m = 3r + 12. Let x = 33 + m. Let a = 44 - x. What is the highest common factor of a and 14? 14 Let l = 145 - 97. What is the highest common divisor of 12 and l? 12 Let c be (-2)/3(-6 + 3). Suppose 0 = -3a + 37 - 7. Calculate the greatest common divisor of c and a. 2 Let y = 114 - 100. What is the highest common divisor of y and 56? 14 Let t(s) = 18s2 + 2s - 1. Let u be t(-1). Suppose i = -4i + 75. What is the greatest common factor of u and i? 15 Let o be 337/4 + (-5)/20. What is the greatest common divisor of 14 and o? 14 Suppose 7b + 250 - 964 = 0. What is the highest common divisor of 68 and b? 34 Let v(f) = 21f2 - 3f - 6. Let b be v(-3). Suppose -b = -5s - 17. Calculate the highest common factor of s and 5. 5 Let z be -3 - (1 + -2)2. Let r = z - -3. Let x = r + 18. Calculate the greatest common factor of 4 and x. 4 Let t(z) = 14z + 1. Suppose 4s - 20 = 0, -2j + 7j - 5s = -20. Let p be t(j). What is the greatest common factor of 75 and p? 15 Suppose 0 = -4l + 2k + 110 + 200, 210 = 3l + 3k. Let v = -86 + 125. Let u = v + -9. Calculate the highest common factor of l and u. 15 Let l = 107 + -67. What is the highest common factor of l and 10? 10 Let m be 15 + (26 - 22). What is the highest common divisor of m and 3? 3 Let a = -19 - -36. What is the highest common divisor of a and 17? 17 Suppose b - 1 - 16 = 0. What is the highest common factor of b and 17? 17 Let n be (-6)/(-2)(-60)/(-18). Suppose -k + 1 + n = 0. What is the highest common divisor of 121 and k? 11 Suppose -3i = 3n - 3, -3i = -i + 4n. Let x be (-1)/(2/(-12)1). Let y = x + i. Calculate the highest common divisor of y and 16. 8 Let o(k) = -14k - 2. Let l be o(-4). Let z be (3/1 - -2) + 1. What is the greatest common factor of z and l? 6 Let s(b) = b + 1. Let p be s(2). Suppose 7g = pg + 8. Let o(a) = 2a*3 - 2a*2 + a - 2. Let w be o(g). Calculate the greatest common factor of w and 8. 8 Let p = 4 - -6. Suppose 3 = 5o + 2q - p, -o - 19 = -5q. Calculate the greatest common factor of 8 and o. 1 Let g be 4/14 + (-5592)/(-28). Let m be ((-6)/(-4))/(12/g). Suppose -t - 4t + m = 0. What is the highest common divisor of 5 and t? 5 Suppose -3g + 4g - 3 = 0. Let o = 3 - g. Let a be 165 - (0 - o)/(-3). Calculate the greatest common divisor of 15 and a. 15 Suppose -4h = -5g + 421, -18 = 5h + 2. Suppose 48 = -3r - 4v, -3r - 74 + 11 = -v. Let l = r - -29. What is the greatest common divisor of l and g? 9 Let s(f) = -f3 - 16f*2 - 1. Let z be s(-16). Let r be 4(-1 + z + 8). What is the greatest common factor of 264 and r? 24 Let y(q) = 20q + 10. Let o be y(-8). Let p be (-2)/(-6) - o/9. Let w = -9 + p. Calculate the greatest common divisor of w and 1. 1 Suppose 5a - 5 - 10 = 0. Let c be 1 + 0 - (-5 + a). Suppose -2y + y = -2z - 13, 0 = -cz + 6. Calculate the greatest common divisor of 68 and y. 17 Suppose -7u + 36 = -3u. Suppose d = -2d + u. Calculate the highest common factor of 6 and d. 3 Suppose -4v + f = -28 - 21, v + 2f = 19. What is the highest common factor of v and 13? 13 Let f(t) = 39t + 1. Let r be f(1). Calculate the highest common divisor of r and 5. 5 Let g = 97 - -113. Let h = 24 - -6. Calculate the greatest common factor of g and h. 30 Let f be 3/(-24) + 774/48. Calculate the highest common factor of 40 and f. 8 Let c be (-21)/(-6)80/14. What is the greatest common divisor of c and 5? 5 Let d = -181 + 198. What is the greatest common divisor of d and 136? 17 Suppose u - 49 = -13. Calculate the greatest common factor of u and 4. 4 Let j(t) = t + 9. Let w be j(-8). What is the greatest common factor of w and 4? 1 Let o be (-1 - 19/(-2)) + 8/(-16). Suppose 3p + 2 = 4p. Suppose u - 4j + 6 = 0, 0 = -4u + ou - pj - 18. Calculate the highest common divisor of 6 and u. 6 Suppose 2a = -a + 5p + 156, -5a + 5p = -260. What is the greatest common divisor of a and 13? 13 Let u = -117 + 197. Suppose -10 = 5o - 6o. What is the greatest common divisor of o and u? 10 Suppose 0 = -10d + 13d - 48. Calculate the greatest common divisor of 72 and d. 8 Suppose -4t = -4n + 1176, -5t + 2n = -0*t + 1461. Let r = 567 + t. Let c be 2/(-5) - r/(-15). What is th	{ "pile_set_name": "DM Mathematics" }
. Suppose -3u = -8714 + 2150. Let v(p) = -up*2 - 2 + 2179p*2 + 2. Give v(g(q)). -144q*2 Let s(p) = 135p*2. Let x(g) be the first derivative of -1/2g*2 + 0g + 6. Calculate s(x(f)). 135f2 Let m(p) = 6p*2 + 7. Let k(l) = 5 - 5 + 8 - 9. Let h(i) = i + 6. Let s(w) = h(w) + 6k(w). Calculate m(s(n)). 6n2 + 7 Let x(y) = 2y*2. Let t(w) be the second derivative of 0w*2 + 35/3w*3 - 163w + 0. Determine t(x(m)). 140m2 Let x(s) = 1396966s*2 + 230s. Let q(m) = -3m2. Give x(q(a)). 12572694a*4 - 690a*2 Let z = 10018 + -5454. Let v(k) = zk*2 + 3 - 3 - 4561k*2. Let s(a) = 0 - 6a + 0. What is s(v(x))? -18x2 Let y(b) = -b3 + 6b*2 - b + 8. Let g be y(6). Let n(w) = -22w*g + 8w*2 + 44w2. Let v(t) be the second derivative of t3/3 - 6t. Calculate v(n(c)). 60c*2 Let k(c) = -319c - 220c - 227c + 768c. Let s(v) = -1092v. Calculate s(k(p)). -2184p Let p(m) = m2 + 14. Let w(f) = -7f + 125577. Calculate w(p(t)). -7t2 + 125479 Let m(l) = -l. Let u(o) = o. Let v(x) = -4m(x) - 2u(x). Suppose 2f - 9 = -g - f, 5f + 5 = 0. Let n(c) = 3c - gc - 5c. Give v(n(j)). -28j Let o(j) be the second derivative of 0 + 23/3j*3 - 12j + 0j2. Let i(s) = -3s + 2s + 2s*2 + s. Determine i(o(h)). 4232h*2 Let j(w) = 17w. Let c(m) = 13m. Let z(s) = 391s. Let v(r) = -119c(r) + 4z(r). Let k(n) = 6j(n) - 7v(n). Let x(g) = -8g. Give k(x(p)). 136p Let b(d) = -5d. Let t(a) = -1649a - 20699. What is t(b(m))? 8245m - 20699 Let d(f) = 6f*2 + 1. Let b(y) = -49y - 127y + 176y - 15y2. Give d(b(z)). 1350z*4 + 1 Let t(q) = 45q - 4 + 0 + 2. Let g(a) = -a - 7. Let j(f) = -f*2 - 2f - 14. Let l(y) = 2g(y) - j(y). What is l(t(b))? 2025b*2 - 180b + 4 Let y(b) = -6b2. Let q(l) = -3412157l*2. Determine y(q(w)). -69856892355894w*4 Let v(n) = 3n*2. Suppose 5t - 10 = 5x - 35, 0 = -5x + 4t + 22. Let w(m) = mx + 113 - 54 - 57. Give w(v(d)). 9d*4 + 2 Let z(k) = -2516k*2 + 5161k*2 + 3824k*2. Let h(x) = 2x. Determine h(z(d)). 12938d2 Let g(i) = -6i - 5. Suppose -4t + 3r = -2, -r - 1 = t + 2. Let f(l) = 2 + 3 - 4. Let d(o) = tg(o) - 5f(o). Let u(m) = 3m2. Calculate d(u(p)). 18p*2 Let j(b) = -8b - 254. Let n(u) = -u + 117. What is j(n(v))? 8v - 1190 Let t(h) be the first derivative of 121h*3/3 - 3h + 598. Let m(i) = -i*2. Determine t(m(c)). 121c*4 - 3 Let j(k) = 49k2. Let t(r) = -r2 - r + 7. Let q(i) = -9i + 63. Let o(h) = 4q(h) - 36t(h). What is j(o(a))? 63504a*4 Let j(c) = -8c*2. Suppose -3n - 51n = 0. Let x(t) be the second derivative of 0t*2 - 2/3t*3 + n + 4t. Give x(j(w)). 32w2 Let g(s) = 8s. Let z(d) = 24073836d - 111d*2 - 24073836d. Give z(g(m)). -7104m2 Let q(l) be the first derivative of l6/72 - 4l*3 + 3l + 96. Let c(u) be the third derivative of q(u). Let x(s) = -10s2 + s. What is x(c(d))? -250d*4 + 5d*2 Let x(b) be the second derivative of -7b4 + b2/2 + 138b - 1. Let l(d) = -d2 - 8d + 6. Let y be l(-8). Let w(z) = -12z + 8z + yz. What is x(w(r))? -336r*2 + 1 Let z(a) = -4a*2. Let w(i) be the third derivative of -1169i*4/24 - 1076i*2 - 1. Give w(z(y)). 4676y*2 Let v(l) = -2l*2 + 10799l. Let s(j) = 84j. Determine v(s(u)). -14112u*2 + 907116u Suppose -6a + 10 = -a. Let h(p) be the first derivative of 3p*a - 7p*2 + 9 + 3p*2. Let f(t) = 6t. Determine f(h(x)). -12x Let u(g) = -g. Let s(j) be the first derivative of 400j*3 + 516. Determine u(s(l)). -1200l*2 Let r(i) = 56 - 162 + 106 + 3i. Let p(d) = 35d + 2. Let h(s) = -139s - 9. Let z(u) = 2h(u) + 9p(u). Give r(z(f)). 111f Let m(w) be the second derivative of -93w*4/2 - 8w - 31. Let v(n) = -n*2. What is m(v(l))? -558l*4 Let n(o) = -5o*2 - 5o. Let l(i) = -16i + 20. Let j(z) = -49z + 70. Let c(k) = -2j(k) + 7l(k). Calculate n(c(a)). -980a2 + 70a Let q = -4440 - -4442. Let w(m) be the first derivative of -13 + 0mq + 1/3m*3 + 0m. Let c(b) = -b. Give c(w(d)). -d*2 Let b(w) = -4w - 2. Let r(z) be the second derivative of 5z3/6 - 3z*2 - 88z + 34. Determine r(b(d)). -20d - 16 Let p(y) = -3y. Let d(b) = 41b2 - 576b + 2. What is p(d(o))? -123o2 + 1728o - 6 Let b(f) = 0f2 + f2 - 3f2. Let j(r) be the first derivative of -r3/3 - 2r + 291. What is j(b(c))? -4c*4 - 2 Suppose 9y - 14y - x = -1747, x = -y + 347. Let j(u) = -350 + 2u*2 + 9u*2 + y. Let i(w) = -19w*2. Determine j(i(l)). 3971l*4 Let v(d) be the first derivative of -1/2d*2 + 76 + 0d. Let i(o) = 12o2. Give i(v(l)). 12l*2 Let x(r) = 4r*2. Let w(v) be the third derivative of -55v*4/12 + 60v*2. Let b(o) = 7o. Let g(q) = 33b(q) + 2w(q). Determine x(g(k)). 484k2 Let q be (-18)/(-16)-2-8. Let u = -443 + 465. Let f(s) = -us + qs + 7s. Let n(l) = -42l. Determine f(n(m)). -126m Let q(p) = -160p. Let s(c) be the second derivative of c3/3 + 2c + 128. Determine s(q(w)). -320w Let f(m) = -15 - 2m - 11 + 98 - 14 - 58. Let t(x) = 896x + 28. Let k(g) = 163g + 5. Let b(z) = -28k(z) + 5t(z). Calculate f(b(h)). 168h Let m(c) = 2704c + 56. Let t(g) = -14g - 14. Let v(w) = -m(w) - 4t(w). Let i(a) = a. Determine v(i(f)). -2648f Let g(m) = -7m*2. Let z be (-300 + -3)/((-3)/(3/1)). Suppose -l + z = -244. Let v(j) = 547j - j*2 - lj. Determine g(v(c)). -7c4 Let t(g) be the third derivative of 0g - 7g2 + 0g*3 - 11/24g4 + 0. Let u(f) be the third derivative of -f5/30 + 3f2. Calculate t(u(n)). 22n2 Let w(b) be the second derivative of -b4/6 - 174b. Let c(i) = -i. Let z(h) = -h - 1. Let l(m) = -6c(m) + 2z(m). Calculate w(l(u)). -32u*2 + 32u - 8 Let l(d) be the first derivative of d*6/180 + 27d*4/2 - 30d*3 - 89. Let s(b) be the third derivative of l(b). Let i(y) = -2y. What is s(i(g))? 8g2 + 324 Let s(v) = -v. Let h(y) be the second derivative of 7y*5/30 + 49y*2/2 + 101y. Let f(a) be the first derivative of h(a). Give s(f(l)). -14l2 Let m(c) = -204c + 19. Let s(a) = -67a + 6. Let o(q) = 3m(q) - 8s(q). Let z(h) = -75h + 6. Let v(w) = -3o(w) + 4z(w). Let i(k) = 2k. What is v(i(x))? -144x - 3 Let v(i) = 3i - 15. Let j(m) = m. Let p(a) = -2a. Let d = -409 - -407. Let f(l) = dj(l) - 2p(l). What is v(f(s))? 6s - 15 Let o(u) = -2u2. Let p(q) = -q2 - 19q - 33. Let x be p(-17). Let a be (x/2)/((-2)/(-8)). Let f(c) = -ac*2 - 137 - 139 + 276. Calculate f(o(l)). -8l4 Let l(k) = k2 + 5035k + 2. Let u(m) = 3m*2 - 4466. What is l(u(x))? 9x*4 - 11691x*2 - 2541152 Let y(i) = 23972i*2 + 5 - 5 - 23970i*2. Let g(t) = 14158t. Determine y(g(u)). 400897928u2 Let o(q) = 7q2. Let m(a) be the third derivative of a6/180 + 13a3/2 + 2a*2 - 38a. Let d(f) be the first derivative of m(f). Determine d(o(t)). 98t4 Let v(r) = -r2 + 8r + 44. Let j(h) = h*2 - 10h - 55. Let u(a) = -4j(a) - 5v(a). Let s(b) = -511b2. What is s(u(p))? -511p*4 Let q(k) = 9k. Let o(i) = i. Suppose 10 = 4m + 18. Let s(l) = -3l. Let n(f) = mo(f) - s(f). What is n(q(z))? 9z Let m(f) = 43f. Let j(y) = -18591683y. Determine j(m(c)). -799442369c Let b(h) = 2h. Let v(l) = -l*2. Suppose 3f = 104 - 392. Let n be 110/90 + (-4)/18. Let m(a) = -112a2. Let s(y) = fv(y) + nm(y). Calculate s(b(q)). -64q*2 Let i(z) = -2z*2 - 49z. Let p(w) = -30w + 4157. Give p(i(x)). 60x*2 + 1470x + 4157 Let x(g) be the third derivative of -g4/24 + g3/6 + 3g2 + 4. Let i(a) = 146. Let l(f) = i(f) - 146x(f). Let u(b) = b*2. Give u(l(h)). 21316h*2 Let r(y) = 87y*2. Let c(w) = -w - 6. Let g(d) = -20d - 110. Let k(f) = -110c(f) + 6g(f). What is r(k(o))? 8700o2 Let r(j) = 197j + 74. Let b(a) = 16a + 6. Let x(k) = 74b(k) - 6r(k). Let d(o) = 382o. Calculate x(d(f)). 764f Let k(u) be the second derivative of u4/6 + 28u. Let a(s) = s - 4. Let b(t) = -28t + 24. Let g(c) = -6a(c) - b(c). What is g(k(h))? 44h2 Let q(v) = -53v*2. Suppose p + 3a = 7, a = -2p + 5a - 16. Let n(w) = 13090w2. Let k(f) = pn(f) - 495q(f). Let d(z) = -3z. Give k(d(c)). 495c2 Let y(c) be the first derivative of -c5/60 + 7c3 - c2 - 12. Let k(b) be the third derivative of y(b). Let s(j) = 4j + 1. Give k(s(l)). -8l - 2 Let r(b) = -5b*2	{ "pile_set_name": "DM Mathematics" }
76 for q. -79 Solve 4547h = 541h - 64096 for h. -16 Solve -9157v = -8784v - 373 for v. 1 Solve -33s - 17s + 724 = -3302 + 776 for s. 65 Solve -1314h - 108h = -90h - 11088 + 432 for h. 8 Solve -616k + 134k + 209k - 4700 = -173k for k. -47 Solve 22463 = -2429l - 220437 for l. -100 Solve 6270 = 1347f - 1589 - 8305 for f. 12 Solve 1696w - 27234 + 37375 = -45827 for w. -33 Solve 72a = -89a - 416 + 94 for a. -2 Solve 3968q + 804q = -130q - 2030q + 596152 for q. 86 Solve -13245q + 187 - 32410 = 34002 for q. -5 Solve -9504t = -1386273 + 350337 for t. 109 Solve 5460 = -46l + 11836 - 5410 for l. 21 Solve -4302 - 1384 = -195g + 749 for g. 33 Solve -2641z - 61494 - 54717 - 2727 + 21221 = 0 for z. -37 Solve 610 - 1007 = -337w + 818 + 2829 for w. 12 Solve -329y - 3747 = 253y + 2754 + 2811 for y. -16 Solve 74b + 1504 = -28b - 3290 for b. -47 Solve 0 = 51y + 1676929 - 1675603 for y. -26 Solve -98n + 3237 = -243 - 244 for n. 38 Solve 10797m - 566m - 1002638 = 0 for m. 98 Solve -237x - 221x + 654x - 3915 = 341x for x. -27 Solve 1287i + 1070i - 9708i - 509920 = 254584 for i. -104 Solve 2290 - 737 - 751 = -10l + 692 for l. -11 Solve 87p = 1738 - 899 - 5019 - 3041 for p. -83 Solve -77f = 81154707 - 81150703 for f. -52 Solve 19z - 33z - 3z + z - 816 = 0 for z. -51 Solve -17f + 142f - 5f - 7248 = 552 for f. 65 Solve -82y = -470y + 162y - 365y - 26004 for y. -44 Solve -16508z = -1426z - 306051 + 626024 + 1504949 for z. -121 Solve 443a - 69a = 117a + 112a + 10295 for a. 71 Solve -385v + 859 = 2937 + 2157 for v. -11 Solve 47368 = -4936l - 332l + 125835 + 148057 for l. 43 Solve -23275 = -231v - 449v + 15v for v. 35 Solve -26600 = 654z - 1718z for z. 25 Solve 333r = 122r + 752r - 144r - 44464 for r. 112 Solve -46t - 6t = -2549 + 6085 for t. -68 Solve -210j = 257j + 10277 - 937 for j. -20 Solve -757a + 743a = -546 for a. 39 Solve -176s = 360174 - 335182 for s. -142 Solve 7193w + 346116 = 44010 for w. -42 Solve 8x + 741 - 7033 = -278x for x. 22 Solve -233u = -889u + 13331 + 5693 for u. 29 Solve 15x - 924 = -130x - 163x for x. 3 Solve 0 = -212v - 13v - 134v + 17591 for v. 49 Solve 2200k + 81767 = 20167 for k. -28 Solve 1950 = -429545c + 429480c for c. -30 Solve 48q - 8264 + 8840 = 0 for q. -12 Solve 39b + 57b = 47b + 58b - 189 for b. 21 Solve 12485z - 2391z = 82914 + 547981 + 287659 for z. 91 Solve 984y - 1026 + 1719 = 6 - 2265 for y. -3 Solve 5291v + 5442v = 3079v + 658244 for v. 86 Solve -810 + 1207 = -46u - 707 for u. -24 Solve 989 = 96c + 2387 + 2058 for c. -36 Solve 21998 - 10187 = -78d - 15d for d. -127 Solve 64f + 32044 - 27116 = 0 for f. -77 Solve -828b + 4914b + 49005 + 159381 = 0 for b. -51 Solve 0 = 146p - 330441 + 331609 for p. -8 Solve 31p + 7826 - 5891 = -12p for p. -45 Solve -43a + 59 - 2923 + 5315 = 0 for a. 57 Solve 0 = 122s + 41s + 316s + 36404 for s. -76 Solve 31q + 203 = -1161 for q. -44 Solve -24597 = -1485t + 67885 - 1897 for t. 61 Solve 108f + 494f + 37312 = 178f for f. -88 Solve 0 = -395l + 156704 - 142089 for l. 37 Solve -4m - 956 + 965 = -3m - 0m for m. 9 Solve 75s + 107s + 22593 = -182s - 79s for s. -51 Solve 3779k = -72146 - 70756 - 114464 - 86523 for k. -91 Solve 9607 + 6875 = 606k - 18666 for k. 58 Solve 10015b = 2019b + 135932 for b. 17 Solve -28r + 14551 = 17519 for r. -106 Solve 0 = 248p - 751 + 2487 for p. -7 Solve -13j - 38j - 58795 = 27j - 49357 for j. -121 Solve 3530l - 40961 = 336749 for l. 107 Solve -4773k + 150388 = -1105k for k. 41 Solve 0 = 352h - 332h + 200 for h. -10 Solve -85b = 124b + 231b - 17600 for b. 40 Solve 36443 = 180m + 22943 for m. 75 Solve 8529 = -536i - 3496 - 10788 - 14171 for i. -69 Solve 145a + 53960 = -40a - 575a for a. -71 Solve -9182 = -1756w + 137102 - 33900 for w. 64 Solve 116p - 15p - 6052 + 2214 = 0 for p. 38 Solve 1547s + 44461 = -28424 - 9508 + 12778 for s. -45 Solve 1070n + 881 - 610 + 799 = 0 for n. -1 Solve 436x - 49x + 1764 = -19195 - 713 for x. -56 Solve 198n - 141n = -585 - 441 for n. -18 Solve 5161x - 2246x = 2424x + 73159 for x. 149 Solve 48x = -75x - 931650 + 949854 for x. 148 Solve -5868o - 5401 = -430929 - 38044 for o. 79 Solve 176k + 218k = -10638 for k. -27 Solve -11717903 = 307k - 11675230 for k. -139 Solve 227877x - 31 + 451 = 227947x for x. 6 Solve 313i - 6175 - 11410 = 1619i + 24207 for i. -32 Solve -27x - 17x - 18x = -1054 for x. 17 Solve 47o + 101 = 148 for o. 1 Solve 590j = 3086j + 97344 for j. -39 Solve 104482 - 116767 = 117j for j. -105 Solve 161m + 94m - 22547 = -4187 for m. 72 Solve 1661d + 5310 = -301 - 4355 for d. -6 Solve -3487y - 3470y = -6922y - 2345 for y. 67 Solve 0 = -784m - 4925 - 361 - 2382 - 6444 for m. -18 Solve -2172w - 19273 = 263w + 85432 for w. -43 Solve 1035m + 18522 + 6331 = -6134 + 5112 for m. -25 Solve 11480k - 66659 - 242822 = -68401 for k. 21 Solve -78480 = 1661j + 83j for j. -45 Solve -25075m = -23346m + 185003 for m. -107 Solve 4549 = 1429r - 29747 for r. 24 Solve -2345a = -450a - 2229 - 12931 for a. 8 Solve 1778r + 1758r + 1815 = 3569r for r. 55 Solve -86o - 885 - 24252 = -485o for o. 63 Solve 1474 - 295 = 2437b - 2385b - 2305 for b. 67 Solve 1209u - 2297 - 869 = 2587 + 292 for u. 5 Solve -4907 + 111076 = -1522l + 10879 - 11250 for l. -70 Solve -1170s + 525 + 7431 = 52416 for s. -38 Solve -5500 = 33r - 12137 + 5647 for r. 30 Solve 245714r = 245735r - 1176 for r. 56 Solve 2825 = -183d + 629 for d. -12 Solve -7875 = 75w + 47w - 297w for w. 45 Solve 646381x - 15045 = 646558x for x. -85 Solve 4808 + 29570 = 1616t - 33494 for t. 42 Solve 379b + 624b = 27068 + 17064 for b. 44 Solve -197 + 66 = -41j + 361 for j. 12 Solve -62140 = 473o + 593o - 15236 for o. -44 Solve 28j = -24j - 146j + 21978 for j. 111 Solve 0 = -32v + 677158 - 673926 for v. 101 Solve -498b - 3655 - 320 = -924 + 1431 for b. -9 Solve 8332 + 17671 = 1291k - 8854 for k. 27 Solve -1466 + 1095 - 1194 = -223i + 3341 for i. 22 Solve 22p + 58 = -p + 12 for p. -2 Solve -123c = -392c - 379c + 43416 for c. 67 Solve -367w + 49494 = 944w - 133 - 2813 for w. 40 Solve 728p + 547p = 418p - 46278 for p. -54 Solve -11p - 342p + 16302 = 76p for p. 38 Solve 202a - 1819a = 103488 for a. -64 Solve -201g + 26509 = 325g + 15g for g. 49 Solve -64 = -27m - 38m + 2 + 194 for m. 4 Solve -174p - 2994 - 13746 = 486 for p. -99 Solve 8312u - 439403 = 533101 for u. 117 Solve -55b - 27b - 4340 = 8b - 28b for b. -70 Solve 4319 - 6778 = -97h - 6727 for h. -44 Solve -100415 - 18303 = -5324m + 115538 for m. 44 Solve -30y - 111608 + 111248 = 0 for y. -12 Solve 75i - 103i - 321i = 698 for i. -2 Solve -3993 = -482b + 361b for b. 33 Solve -64c + 1384 + 2248 = 558 - 1150 for c. 66 Solve 5514 = -173w + 25w - 4140 + 2698 for w. -47 Solve 1292w + 25224 = -1291w + 1984w - 2929 for w. -47 Solve -1687f + 15f - 533763 = 9007f - 608f for f. -53 Solve -603m - 1531m = 73096 - 4808 for m. -32 Solve 1173k - 986k - 1086k = -8091 for k. 9 Solve 13677d + 13679d - 27357d = 24 for d. -24 Solve 4o + 13o + 377 = -642 + 271 for o. -44 Solve 317w - 2087 + 15401 = 0 for w. -42 Solve 21 = -11c - 108 - 25 for c. -14 Solve 0 = -4368p + 4820p + 15820 for p. -35 Solve -2400v = -24043 - 71957 for v. 40 Solve -1162g + 187045 = 513g + 911g + 73261 for g. 44 Solve 292q + 53 - 36 + 575 = -868 for q. -5 Solve 566 + 109 = -0k - 15k for k. -45 Solve 0 = -38v - 19557257 + 19557827 for v. 15 Solve 92366l = 92156l - 13020 for l. -62 Solve 2149f = 24646 - 261036 for f. -110 Solve 12955r - 4966r + 9328r = 2493648 for r. 144 Solve 166880 = -285d + 173435 for d. 23 Solve 30207 - 62463 + 28384 = 121t for t. -32 Solve -1842v + 6371v = -511777 for v. -113 Solve -3463i - 2218 - 887 = -3328i for i. -23 Solve 21a + 12116 = -236a + 24a for a. -52 Solve -55256 + 3693 = -1173n - 482n + 11327 for n. 38 Solve -47935n + 47415n = -5200 for n. 10 Solve 627i + 67452 = -131i - 118i for i. -77 Solve 54t = 2079t + 58725 for t. -29 Solve -66a - 1792a + 158554 + 107140 = 0 for a. 143 Solve 1276v + 1246v + 1222v - 4295v + 10469 = 0 for v. 19 Solve -1724g - 323 + 983 = -1704	{ "pile_set_name": "DM Mathematics" }
{k: 1, u: 1, w: 1}. 1/6 Calculate prob of sequence ff when two letters picked without replacement from fffffvfvf. 7/12 Four letters picked without replacement from {p: 3, y: 17}. What is prob of sequence ypyp? 4/285 Three letters picked without replacement from {i: 1, u: 1, c: 1, r: 1, p: 1}. Give prob of sequence uir. 1/60 What is prob of sequence gxe when three letters picked without replacement from {x: 3, g: 15, e: 2}? 1/76 Calculate prob of sequence zk when two letters picked without replacement from {o: 1, z: 1, t: 2, x: 8, k: 2}. 1/91 Two letters picked without replacement from {c: 1, r: 1, b: 2, y: 2, t: 1, n: 7}. What is prob of sequence nt? 1/26 Calculate prob of sequence puuo when four letters picked without replacement from {a: 4, o: 4, u: 4, p: 1, d: 7}. 2/4845 Three letters picked without replacement from {j: 1, x: 1, f: 1, c: 1, u: 1}. Give prob of sequence xuc. 1/60 What is prob of sequence aav when three letters picked without replacement from {k: 2, q: 2, w: 1, v: 2, a: 5, d: 1}? 10/429 Two letters picked without replacement from bbpppkpuuppppkbbkbp. What is prob of sequence pb? 5/38 Two letters picked without replacement from {t: 1, q: 1, h: 9, m: 5, y: 1}. Give prob of sequence qh. 9/272 Three letters picked without replacement from {t: 9, q: 7}. What is prob of sequence ttq? 3/20 What is prob of sequence cg when two letters picked without replacement from ufufczgggfzcczgfu? 3/68 What is prob of sequence tu when two letters picked without replacement from utabwbj? 1/42 Three letters picked without replacement from {r: 2, f: 1, t: 2}. Give prob of sequence frt. 1/15 Calculate prob of sequence dxqx when four letters picked without replacement from ccddqbxddbdccdxdcd. 1/4590 Calculate prob of sequence stw when three letters picked without replacement from {t: 2, w: 1, s: 11, g: 1, i: 3}. 11/2448 Three letters picked without replacement from {u: 5, r: 2}. What is prob of sequence uur? 4/21 Calculate prob of sequence kjjk when four letters picked without replacement from kjjjkk. 1/10 Two letters picked without replacement from ssspsmmsrsspizsm. Give prob of sequence sz. 1/30 Calculate prob of sequence mwk when three letters picked without replacement from {m: 1, k: 5, w: 1, z: 3}. 1/144 Two letters picked without replacement from {d: 5, r: 3, m: 5, s: 2}. What is prob of sequence md? 5/42 Calculate prob of sequence ii when two letters picked without replacement from xmmiihmgmhmhimhhxmx. 1/57 Calculate prob of sequence jjrr when four letters picked without replacement from {r: 5, j: 2, v: 3}. 1/126 Three letters picked without replacement from uzqdduzuuduu. What is prob of sequence uzu? 1/22 Two letters picked without replacement from {n: 4, m: 1, p: 5, d: 2, h: 2}. Give prob of sequence ph. 5/91 Three letters picked without replacement from oiiiiooioooioiii. Give prob of sequence ioo. 9/80 Calculate prob of sequence lt when two letters picked without replacement from lto. 1/6 What is prob of sequence igg when three letters picked without replacement from {i: 13, g: 6}? 65/969 What is prob of sequence gggg when four letters picked without replacement from {g: 5}? 1 Four letters picked without replacement from ddddd. Give prob of sequence dddd. 1 Three letters picked without replacement from {p: 3, u: 7}. What is prob of sequence uuu? 7/24 Calculate prob of sequence sz when two letters picked without replacement from {z: 2, s: 3}. 3/10 What is prob of sequence zuzu when four letters picked without replacement from {z: 7, u: 7}? 21/286 Two letters picked without replacement from kekkkkkkkkkkkkekkkk. What is prob of sequence ek? 17/171 Three letters picked without replacement from {i: 1, d: 1, w: 1, y: 3, n: 1}. What is prob of sequence dyw? 1/70 What is prob of sequence yep when three letters picked without replacement from {e: 1, y: 10, p: 1, f: 7}? 5/2907 Two letters picked without replacement from {p: 18, r: 1}. What is prob of sequence pr? 1/19 What is prob of sequence xtx when three letters picked without replacement from mxxtt? 1/15 Four letters picked without replacement from {n: 3, z: 1, i: 6, e: 1, g: 6}. Give prob of sequence nnez. 1/9520 Three letters picked without replacement from {q: 2, n: 1, o: 2, r: 1, s: 1, e: 1}. What is prob of sequence nqo? 1/84 Calculate prob of sequence tyb when three letters picked without replacement from bybbbbkbxktyyb. 1/104 Calculate prob of sequence mv when two letters picked without replacement from {c: 1, m: 3, u: 2, t: 1, v: 6}. 3/26 Two letters picked without replacement from ududuuuduuuu. What is prob of sequence dd? 1/22 Two letters picked without replacement from {c: 1, n: 1, y: 3}. What is prob of sequence ny? 3/20 Two letters picked without replacement from {a: 1, y: 4, o: 6, h: 3}. Give prob of sequence oo. 15/91 Two letters picked without replacement from {s: 2, m: 4, i: 4, n: 5}. What is prob of sequence ns? 1/21 Three letters picked without replacement from eeeeceeeeeece. Give prob of sequence eec. 5/39 What is prob of sequence eg when two letters picked without replacement from egjls? 1/20 What is prob of sequence cc when two letters picked without replacement from {o: 3, c: 13}? 13/20 What is prob of sequence qsgs when four letters picked without replacement from gsgssqggsggqsqgqqgqq? 28/2907 What is prob of sequence tpte when four letters picked without replacement from {p: 8, t: 2, e: 5, l: 1}? 1/546 What is prob of sequence ccc when three letters picked without replacement from {l: 2, c: 8, g: 8}? 7/102 Three letters picked without replacement from {r: 3, x: 1, c: 2, a: 1, j: 4}. Give prob of sequence raj. 2/165 Two letters picked without replacement from {c: 1, b: 2}. Give prob of sequence bc. 1/3 What is prob of sequence tzmj when four letters picked without replacement from jzmmt? 1/60 What is prob of sequence pzp when three letters picked without replacement from {z: 9, p: 7}? 9/80 Four letters picked without replacement from mpmmlykbylmlly. What is prob of sequence ymbm? 3/2002 Three letters picked without replacement from {e: 9, p: 3}. What is prob of sequence epp? 9/220 Two letters picked without replacement from wwccccwcwcww. What is prob of sequence cw? 3/11 Calculate prob of sequence mjk when three letters picked without replacement from {j: 4, c: 1, k: 1, m: 1, a: 2}. 1/126 Two letters picked without replacement from {m: 5, r: 5, y: 4, b: 1}. What is prob of sequence yb? 2/105 Calculate prob of sequence gv when two letters picked without replacement from {g: 3, v: 6, o: 8}. 9/136 Calculate prob of sequence fli when three letters picked without replacement from {l: 1, k: 2, g: 2, m: 5, i: 5, f: 2}. 1/408 Two letters picked without replacement from vevhejbbbjejjheeeev. What is prob of sequence vj? 2/57 Three letters picked without replacement from yycrkfkyycyccfyfcc. Give prob of sequence kkr. 1/2448 Calculate prob of sequence gbb when three letters picked without replacement from nnmnbmbnmnngnbnmnmnb. 1/570 Two letters picked without replacement from {g: 1, j: 1, y: 1, w: 1, b: 1}. What is prob of sequence wg? 1/20 Calculate prob of sequence nbbt when four letters picked without replacement from tnbebetnbaaba. 2/715 What is prob of sequence yz when two letters picked without replacement from udzym? 1/20 Two letters picked without replacement from {f: 3, g: 3}. What is prob of sequence gg? 1/5 Three letters picked without replacement from wssytt. What is prob of sequence yyw? 0 What is prob of sequence bzvv when four letters picked without replacement from bnvnvkkkkzkvuvbvvvvk? 14/14535 What is prob of sequence vvvv when four letters picked without replacement from bvbbbbbvvbvv? 1/99 Two letters picked without replacement from zwlwnfw. What is prob of sequence wz? 1/14 What is prob of sequence sahs when four letters picked without replacement from {s: 4, k: 5, a: 1, h: 1, g: 3}? 1/2002 What is prob of sequence bjku when four letters picked without replacement from uqiuujjqbjbqjqbjuk? 1/1224 What is prob of sequence ur when two letters picked without replacement from ruuuuruuu? 7/36 Three letters picked without replacement from qdjzb. Give prob of sequence jdz. 1/60 What is prob of sequence zll when three letters picked without replacement from {z: 3, g: 5	{ "pile_set_name": "DM Mathematics" }
- 3, -5c + 8c + 16 = 2h. Let m(q) = 3q + 4. What is hm(p) - 5w(p)? -3p + 1 Let t(d) be the second derivative of d4/8 - 2d*3/3 - 4d*2 - 15d. Let p(z) be the first derivative of t(z). Let f(v) = 6v - 9. Give 6f(m) - 13p(m). -3m - 2 Let m(v) = 22v + 2v*2 - 18v - v2 + 4 - v. Let b(h) = -h2 - h - 1. Let g = 3 + 0. Give gb(k) + m(k). -2k*2 + 1 Let t(f) = -163f*3 + 3f*2 + 6f - 2. Let m(d) = 325d3 - 7d*2 - 14d + 5. Give -3m(y) - 7t(y). 166y3 - 1 Let n(j) = 4j*3 + 5j*2 - 4j. Let w(l) = 3l3 + 4l*2 - 3l. Suppose 3i = 6i - 54. Suppose -16m = -7m + i. Calculate mn(k) + 3w(k). k*3 + 2k*2 - k Let b = -5 - -8. Let j = 6 + -14. Let p(c) = -13c + 9. Let y(s) = -11s + 10. Let u(m) = -4p(m) + 5y(m). Let q(n) = -n + 5. Calculate bu(t) + jq(t). -t + 2 Let w(t) = 4t*3 - 9t*2 + 7t + 6. Let k(m) = 5m3 - 10m*2 + 8m + 7. Let j be 130/18 + 22/(-99). Give jw(a) - 6k(a). -2a3 - 3a*2 + a Let s(o) = 58o*3. Let z(i) = 4756i*3. What is 493s(u) - 6z(u)? 58u3 Let n(g) be the second derivative of -g4/12 + g3/6 - g2/2 - 2g + 32. Let w(m) = -4m*2 - 10 + 6m + 5 - 3. Give -6n(v) + w(v). 2v*2 - 2 Let b(s) = -38s + 63. Let q(i) = 12i - 22. Determine -3b(z) - 8q(z). 18z - 13 Let j(o) = 20o - 70. Let r(h) = -9h + 35. Determine 2j(p) + 5r(p). -5p + 35 Suppose -3l = -4 + 1. Let i(c) = c*2 + 1. Let o(a) = -5a - 2. What is lo(z) + 2i(z)? 2z2 - 5z Let c = -2465 + 2459. Let p(o) = 7o2 - 20. Let n(y) = 13y*2 - 39. Calculate cn(b) + 11p(b). -b2 + 14 Let j(l) be the second derivative of -l4/4 - 5l*3/6 + 13l*2 + 225l. Let g(w) = 2w2 + 3w - 17. Give -8g(i) - 5j(i). -i*2 + i + 6 Let m(y) = -y. Let o(i) = -11i. Let d be 9(20/80)/(3/(-4)). Determine do(q) + 24m(q). 9q Let d(m) = -m3 - m2 + 5m - 7. Let r(y) = 2y3 + y2 - 6y + 8. Determine 6d(h) + 5r(h). 4h3 - h2 - 2 Let c(n) = n3 + n2 + 5n. Let u(b) = -22b*2 - 2b - 7. Let t(y) = -13y2 - y - 4. Let q(v) = 5t(v) - 3u(v). What is -c(d) + q(d)? -d3 - 4d + 1 Let y(z) = -2z2 + 3z + 4. Let k(p) = -2p2 + 4p + 3. Let d(q) = -q*2 + 3q. Let a(l) = 2d(l) - 3k(l). Determine 2a(x) + 5y(x). -2x2 + 3x + 2 Let d(m) = -55m3 + 8m*2 + 2m + 2. Let i(u) = -111u3 + 20u*2 + 5u + 5. Calculate -5d(y) + 2i(y). 53y3 Let l(u) = 14u - 22. Let a(x) = -41x + 59. Give -4a(o) - 11l(o). 10o + 6 Let t(s) = 0 + 15 + 19s - 5 + 5. Let d(v) = -9v - 7. Let u be 2/((8/(-52))/1 + 0). Give ud(q) - 6t(q). 3q + 1 Let i(k) = -4. Let q(g) = g - 5. Let m be ((-80)/(-140))/(2/21). Calculate mi(p) - 5q(p). -5p + 1 Let b(w) = 6w3 - 22w*2 + 13w + 13. Let i(n) = -3n3 + 10n*2 - 6n - 6. Determine 6b(h) + 13i(h). -3h3 - 2h*2 Let a(n) = -13n - 2. Let i be (-5)/(((-45)/(-30))/((-6)/4)). Let y(c) = 13c + 2. Calculate iy(r) + 4a(r). 13r + 2 Let m(q) = 13q + 16. Let f(d) = -4d. What is 3f(z) + m(z)? z + 16 Let y(a) = -2a + 41. Let m(n) = -n + 41. What is -5m(s) + 4y(s)? -3s - 41 Let s(c) = 2c*2 - 2c - 2 - c*3 + 2c*3 + 0 - 4c*3. Let g(f) = -13f*3 + 9f*2 - 9f - 8. Calculate -2g(d) + 9s(d). -d*3 - 2 Let k(a) = -7a*2 + 3a. Let f(w) = 24w2 - 10w. Let i(x) = -2f(x) - 7k(x). Let p(n) = -n*2 + n. Give 3i(h) + 5p(h). -2h*2 + 2h Let q(a) = -8a3 + 2a*2 + a - 2. Let l(p) = -16p*3 + 5p*2 + 3p - 5. Let y(r) = -r*2 + 16r + 15. Let c be y(17). What is cl(k) + 5q(k)? -8k3 - k Let l(b) = -2b + 4. Let i(v) be the first derivative of 2v2 - 9v + 474. Suppose 0a + 6 = 3a. Determine ai(s) + 5l(s). -2s + 2 Let l(v) = -v2. Let y(x) = 4x*2 + 2x + 8. Let c(m) = -4l(m) + y(m). Let p(z) = -7z*2 - 2z - 7. Suppose 22s - 62 - 70 = 0. What is sp(i) + 5c(i)? -2i*2 - 2i - 2 Let j(y) = -2y3 + 106y*2 + 3y - 154. Let n be j(53). Let i(k) = -5k3 + 5k*2 + 5k. Let t(f) = -f*2 - f. What is nt(w) + i(w)? -5w3 Let h(y) = y2. Let p(g) = -18g*2 + 11g + 20. Let w(x) = -9x2 + 6x + 11. Let f(n) = 6p(n) - 11w(n). Calculate -f(v) - 5h(v). 4v*2 + 1 Let s(w) = -507w - 8. Let j(b) = -169b - 3. Determine 11j(m) - 4s(m). 169m - 1 Let u(q) = -24q - 7. Let v(l) = 72l + 19. What is 8u(r) + 3v(r)? 24r + 1 Let k(s) = -16s*3 + 10s + 1. Let g(u) = 18u3 + u2 - 12u - 1. What is 4g(f) + 5k(f)? -8f3 + 4f*2 + 2f + 1 Let o(x) = 11x2 + 5. Let t(v) = 11v*2 + 5. What is 2o(q) - 3t(q)? -11q*2 - 5 Let q(r) = 5r + 3. Let c = -131 - -127. Let u(v) = 1. Determine cu(o) + q(o). 5o - 1 Let j(v) = -18v2 + 2v + 1. Let r(t) = 92t2 - 11t - 4. What is 11j(h) + 2r(h)? -14h2 + 3 Let f(j) = 9j*3 - 7j*2 - 5j. Let m(u) = -u3 + u2. Calculate 2f(t) + 14m(t). 4t3 - 10t Let n(q) = -11q2 + 32q - 10. Let c(r) = -20r2 + 64r - 19. Give -6c(o) + 11n(o). -o*2 - 32o + 4 Let a(k) = 10k - 4. Let f(v) = -13v + 5. Let u(w) = -4a(w) - 3f(w). Let b(l) = -21l + 14. Determine b(x) - 14u(x). -7x Let x(a) = -5a*2 + 6a + 114. Let o(h) = -h*2 + h. Give 4o(k) - x(k). k*2 - 2k - 114 Let a(z) = -4z - 3. Let x be (1/(-2))/(5/20). Let d(p) = 5p + 2. Determine xd(j) - 3a(j). 2j + 5 Let x = 8 + -30. Let b(a) = 17a + 2. Let s(t) = 8t + 1. Let c(g) = -6b(g) + 13s(g). Let m(f) = -4 + 8 + 7f + 0. Give xc(h) + 6m(h). -2h + 2 Let w(u) = -17u*2 + 6u - 6. Let h(l) = 220l2 - 77l + 77. Suppose -4k = 2c - 2k - 164, -c = 5k - 102. Give cw(t) + 6h(t). 11t2 Let i(q) = 7q*2 - 9q. Let b(p) = 4p2 - 5p. Calculate 5b(d) - 3i(d). -d*2 + 2d Let x(b) = -26b2 - b + 68b*2 - 41b2 + 1. Let w(v) = -v2 + 0v - 4v + 4v2 + 2. Calculate w(d) - 2x(d). d*2 - 2d Let h(k) = k*3 - 4k - 4. Let x(o) = -o*3 + 5o + 5. Let u be (-8 - (-105)/10)/((-2)/4). What is uh(c) - 4x(c)? -c*3 Let d(y) = -4y*3 - 2y*2 - y - 10. Let b(g) = 5g*3 + 3g*2 + g + 9. What is 2b(o) + 3d(o)? -2o*3 - o - 12 Let z(q) = 10q*3 - 3q*2 + q + 3. Let j(l) = 29l*3 - 8l*2 + 3l + 9. Give 3j(k) - 8z(k). 7k3 + k + 3 Let g(n) = 3n*3 + 8n*2 + n. Let i(k) = 2k*3 + 5k*2 + k. Determine 4g(j) - 7i(j). -2j*3 - 3j*2 - 3j Let b(r) be the third derivative of -18r2 + 0r - 5/24r4 - 7/6r*3 + 0. Let h(y) = 6y + 8. Let i = 3 - 10. Calculate ib(m) - 6h(m). -m + 1 Let g(p) = -2p3 + 4p*2 + 4p + 10. Let s(v) = v*2 + v - 1. Calculate -g(b) + 2s(b). 2b3 - 2b*2 - 2b - 12 Let t(q) = q - 2. Let z(i) = -4i - 14. Give 4t(x) - z(x). 8x + 6 Let h(b) = -18231b*3 - 413b*2. Let m(i) = -177i*3 - 4i*2. What is -4h(w) + 413m(w)? -177w*3 Let z(u) = 7u*3 - 4u*2 - 4u. Suppose -96p + 82p = 42. Let f(m) be the first derivative of 3m4/2 - m3 - 3m*2/2 - 2. Calculate pz(s) + 4f(s). 3s3 Let g(p) = -p3 - p*2 - 1. Let b(w) = 11w*3 - 2w*2 - 17. Determine -b(d) + 2g(d). -13d3 + 15 Let m(x) = 3x*2 - 6x + 12. Let w(s) = s*2 - s. What is m(a) - 4w(a)? -a*2 - 2a + 12 Let b(j) = -72j - 1589. Let w be b(-22). Let o(n) = -3n + 4 + n + 2. Let c(s) = 2 + 3s - 5s + 3. Give wc(q) + 4o(q). 2q - 1 Let a(h) = -12h*2 + 11h + 2. Let n(s) = -2s2 - 2s + 1. Determine a(o) - 4n(o). -4o*2 + 19o - 2 Let a = 8 + -9. Let l be ((-44)/(-10))/(1/(-5)). Let h = -18 - l. Let y(d) = d*3 - 1. Let f(q) = 2q*3 - 4. Calculate af(u) + hy(u). 2u*3 Let r(k) = 16k. Suppose -5 = -5b + l + 4l, 3 = 4b - 5l. Let p(j) = 8j. Determine br(m) - 5p(m). -8m Let v(k) = -8k2 + 7k + 16. Let j(r) = 15r2 - 12r - 31. Let x(l) = -5j(l) - 9v(l). Let u(b) = 2b2 + 2b - 7. What is 8u(s) + 5x(s)? s*2 + s - 1 Let i be (45 - (-5 + 4))/2. Suppose 3v = 34 + i. Suppose -4b - 1 = v. Let g(h) = -2h*2 - 2h + 1. Let k(a) = 4a2 + 4a - 3. Give bg(y) - 2k(y). 2y2 + 2y + 1 Let f(p) = 3p3 - 4p - 5. Let j(d) = d*3 - 2d - 2. Let l(c) = -2c3 + 4c*2 - 2c - 1. Let b be l(2). Determine bj(o) + 2f(o). o*3 + 2o Let s = -31 + 36. Let f(h) be the second derivative of 0h2 + 1/3h*3 + 0 + sh. Let j(a) = a. Give 2f(z) - 2j(z). 2z Let x(i) = 13i*3 + 3i*2 - 48i - 15. Let j(y) = -20y3 - 5y*2 + 72y + 24. Give -5j(o) - 8x(o). -4o3 + o2 + 24o Let h(r) = 5r3 + 7r*2 - 7. Let k(x) = 5x**2	{ "pile_set_name": "DM Mathematics" }
(-260)/(-325)(-30)/4. -6 Calculate 2(1/4)/(28/224). 4 What is (-45)/153/(6/2)? -3 Calculate (-2)/1087/29. -3/5 What is (-5)/(-20)3/(-6)? -1/8 ((-56)/(-42))/(1(-8)/(-30)) 5 Evaluate 6/10(-115)/(-23). 3 (3/((-6)/4))/17 -2/17 What is (8/56)/((-3)/(-28))? 4/3 Calculate (-9)/(-16)(-1)/(12/(-8)). 3/8 Calculate 2/50145/18. 1/10 Calculate ((-3)/12)/(4/6). -3/8 What is ((-2)/(-9))/((2/3)/(-1))? -1/3 What is ((-2)/6)/((-3)/183)? 2/3 Evaluate 2/((-12)/(-15)(-35)/14). -1 What is the value of ((-21)/196)/(27/(-72))? 2/7 Calculate ((-8)/(-32))/(15/(-12)). -1/5 Evaluate (-3)/(-9)(-5)/((-10)/(-1)). -1/6 ((-1)/(-2))/(2/6) 3/2 Calculate (3/105-6)/(2/(-5)). 3/7 Calculate 540/(-162)6/4. -5 Evaluate ((-6)/(-22))/(96/(-32)). -1/11 (127/(-210))/((-8)/(-10)) -1/2 Evaluate (-6)/82485/8730. -1/12 Calculate (-6)/(-10)100/120. 1/2 What is the value of ((-2)/(-3))/(2/(-12))? -4 Evaluate (((-231)/22)/21)/((-2)/(-8)). -2 Calculate ((-12)/16(-2)/3)/2. 1/4 What is (-2)/((-9)/(-6)-2)? 2/3 What is the value of (-22)/165250/16? -5/6 What is ((-2)/6)/((-9)/135)? 5 (-68)/(-238)(-28)/16 -1/2 What is (-172)/43(-1)/(-1)? -4 3/4324/(-243) -1 What is the value of (-12)/(-36)(-1)/(-3)? 1/9 What is the value of (-6)/(-3)3/((-24)/4)? -1 Calculate ((-8)/12486)/(3/6). -1/13 -5-1-42/(-8) 5 Evaluate (-6)/418/9. -3 What is (36/(-63))/((-1)/7)? 4 (6/2)/(18/3)4 2 Calculate ((-2)/(-4))/(2/(-4)). -1 Calculate 4/(-3)(-7)/(56/6). 1 What is ((-23)/(-2))/(-23)14? -7 Calculate (24/(-8)(-4)/(-15))/(-2). 2/5 Calculate (31/(-217))/(21/4). -2/7 What is the value of (-4)/(-11)51/34? 6/11 Evaluate (15/125-2)/((-4)/10). 3/5 Calculate (5/(-3))/(45/(-54)). 2 Calculate 37/744(-2)/2. -2 What is the value of (-2)/(-28)1263/(-9)? -6 What is (11/(-55))/((-12)/(-15))? -1/4 (4(-5)/50)/(2/20) -4 (9/(-3))/(-5(-12)/(-4)) 1/5 Calculate ((-15)/(-20))/((-4)/((-32)/15)). 2/5 Evaluate (12/9)/(510/(-45)). -2/17 0/((54/6)/9) 0 ((-2)/3)/((-7)/21-13) -2/13 Calculate (8/(-32))/((70/7)/5). -1/8 Calculate (84/(-165))/(-7)(-5)/1. -4/11 What is the value of (-5)/(-5)(-11)/55? -1/5 Evaluate (-1)/4((-660)/(-11))/(-5). 3 (-5(-8)/60)/(1/9) 6 Evaluate (-18)/(-63)(-28)/12. -2/3 What is the value of ((-6)/(-9))/(2/(-15))? -5 Calculate (6/(-15))/(5/((-5)/(-2))). -1/5 What is the value of ((-45)/(-36))/(5/60-3)? -5 What is the value of ((-13)/(-39))/((-4)/72)? -6 What is the value of 0/(-3)(-3)/(-6)? 0 (7(-4)/(-224))/(1/6) 3/4 ((-27)/(-18))/(7/(-42)) -9 Calculate ((-4)/(-70))/(3/(-15)). -2/7 What is the value of (-1)/(-6)05/35? 0 Evaluate (-9)/(27/2)9/33. -2/11 What is the value of (-44/(-208))/((-2)/(-4))? 2/13 What is the value of 2/((-15)/((-90)/4))? 3 What is (((-78)/(-20))/(-13))/((-6)/4)? 1/5 What is the value of (181/63)/((-2)/(-2))? 2/7 (-49)/(-147)0/(-2) 0 What is -3(-3)/(-36)4/(-7)? 1/7 -1320/(-130)(-2)/4 -1 Calculate (-936)/702(-2)/8. 1/3 Evaluate 3/(-2)2(-84)/(-36). -7 Calculate ((-5)/(210/4))/(165/(-495)). 2/7 What is (6/2)/(-12)40/35? -2/7 What is the value of ((-21)/4)/(-3)210/(-735)? -1/2 Calculate (-3)/((-16)/((-48)/(-15))). 3/5 Calculate 10/((-110)/(-121))1. 11 (((-12)/(-27))/13)/(-2) -2/3 What is the value of (-94)/(-47)(-10)/4? -5 What is 10/(-12)564/94? -5 What is the value of (-30)/27012/10? -2/15 (-22)/(-165)203 8 ((57/(-2))/19)/9 -1/6 What is (-136)/(-68)3/1? 6 Calculate (84/105)/((-28)/20). -4/7 ((-2)/(-4))/(((-14)/(-4))/7) 1 What is 12/4(-4)/12? -1 What is (8/(192/8))/(-1)? -1/3 Evaluate (-4)/((-64)/(-24))-2. 3 Calculate 98/2117/34. 7/3 Calculate (2/(-3))/(2213/(-78)). 2/11 Evaluate (1/(-2))/((-6)/(216/6)). 3 Calculate 12/(-8)1/(-3). 1/2 Calculate (((-12)/(-30))/(-2))/(2/10). -1 Evaluate (-2)/7(-3)/18-14. -2/3 What is (9/((-108)/(-32)))/((-4)/6)? -4 Evaluate 12/(432/(-18))-21. 1 (6/(-16))/((-57)/228)6 9 Calculate (-16)/124/(16/(-6)). 2 (-32)/(-48)-12(-3)/6 4 What is ((-1)/3)/(69/(-46))? 2/9 What is the value of (5(-12)/(-10))/2? 3 ((-2)/36)/(((-15)/(-12))/5) -2/9 Calculate -1(0/5)/1. 0 Evaluate 5/216/(-8). -5 Calculate (-24)/96/(-4). 4 Evaluate 10/(-6)(-12)/16-4. -5 Calculate (3/(-25))/((4/20)/(-1)). 3/5 (-1688)/(-633)2/(4/6) 8 Evaluate ((-2)/(-28))/((-6)/12). -1/7 Calculate (-1)/((5/35)/((-2)/(-14))). -1 What is the value of (189/(-54))/(1/1)? -7/2 (-36)/(-15)65/(-26) -6 What is the value of (4/2)/(6/(156/13))? 4 (-142)/(-71)1/(-14) -1/7 Evaluate 4((-90)/(-160))/(-3). -3/4 What is the value of 10((10/(-4))/5)/1? -5 Calculate (18/96)/((-3)/4). -1/4 What is the value of 13(18/(-9))/2? -3 716/(-1512)-61 4/9 Evaluate 0/47/14-2. 0 What is the value of (-1)/((-18)/(-6)5/(-60))? 4 (20/15)/(6/18) 4 Calculate -1(-4)/(-24)3. -1/2 Evaluate (-56)/(-98)7(-4)/(-152). 2/19 What is the value of 9/(5/103)? 6 Calculate 13/268/(-6). -2/3 (2/(-1))/((-8)/(-2)) -1/2 Calculate ((-15)/(-6))/((-225)/(-15)). 1/6 Evaluate 2/2-2(-10)/(-4). -5 Calculate -65/30-1. 1 What is (30/8)/((-186)/(-248))? 5 (-6)/(-24)(-8)/(-44)-4 -2/11 Evaluate (-4)/(-2)(-23)/299. -2/13 Calculate -45/(30/3). -2 (-13)/133/((-174)/(-4)) -2/29 Calculate (12/15)/(42/(-21)). -2/5 What is -65/(-225)-1? -2/15 What is the value of (5/(-10))/((-20)/(-24))? -3/5 ((-6)/4)/((-6)/201) 5 Calculate 0/(((-2)/10)/((-3)/15)). 0 Evaluate (6/(-6))/((-4)/16). 4 What is (3/6)/(4/24)? 3 Evaluate (-3)/910/4. 0 Evaluate -10(-2)/15-1. -4/3 What is the value of (3/(-1))/((-3)/(-9))? -9 ((-126)/12)/(45/6) -7/5 Calculate ((-20)/(-45))/((-5)/(15/(-6))). 2/9 Evaluate (-70)/(-168)3/(-15). -1/12 What is the value of (6/8)/((-2691)/552)? -2/13 What is the value of ((-1)/4)/(20/160)? -2 (-6)/(-12)-9(-8)/(-6) -6 What is ((-12)/14)/((-18)/(-9))? -3/7 (378/504)/(((-15)/12)/(-5)) 3 (-9)/(-12)(-5)/(60/(-8)) 1/2 -1812/(-81)6/(-4) -4 Calculate (3/7)/((-3)/((-2)/(-2))). -1/7 (-1)/((-3)/(-1))(-30)/(-5) -2 What is (((-12)/4)/1)/(-2)? 3/2 Evaluate 5/(-1(-4)/(-8)2). -5 What is (03/6)/((-4)/2)? 0 What is the value of (-1)/(1/2)309/(-1545)? 2/5 What is the value of ((-2)/18)/((52/24)/13)? -2/3 Evaluate 1/((-72)/(-6)3/12). 1/3 What is the value of (9/(-2))/128/42? -3 Evaluate 10/(-4)8/20. -1 -33/95 -5 What is 6/(-10)(-3)/7210? 1/4 Evaluate ((-5)/(-2))/(235/376). 4 Evaluate (-10)/149/15. -3/7 Evaluate 2/2((-12)/6)/2. -1 Calculate (-2)/65/(-15). 1/9 (65/234)/((-5)/(-4)) 2/9 What is (-3)/616/88? -8 What is the value of 8/205/3? 2/3 Calculate (-5)/2(30/(-25))/(-1). -3 Evaluate (-110)/176(-32)/(-4). -5 What is the value of ((-6)/161)/(6/(-2))? 1/8 (-3)/((36/15)/4) -5 Evaluate (-18)/(-12)(-16)/12. -2 8/(-100)220/4 -4/5 Evaluate ((36/15)/4)/(189/70). 2/9 Calculate 6/(-7)((-560)/(-15))/(-8). 4 Calculate 5(-48)/40-1. 6 Calculate (45/(-2))/154/(-14). 3/7 30/(-15)4/64-2 1/4 Calculate (-4)/(-4)(24/90)/(-2). -2/15 Evaluate (-84)/105(70/4)/7. -2 Evaluate (4/(-20))/((-2)/20)1. 2 (-1)/(-151/(-3)) -1/5 Evaluate (-3)/42210/(-5). 2/7 Evaluate 2/((32/(-56))/(8/(-4))). 7 What is (-35/(-15))/(-3)? -1/3 What is ((-6)/9)/(7/(-42)4)? 1 Evaluate (-1)/(9/(-24)(-24)/(-18)). 2 What is ((24/(-14))/2)/(6/(-2))? 2/7 What is -3(-28)/2730-15? -6/13 What is (6/(-45))/((-2)/6)? 2/5 Calculate (12/14)/(126/63). 3/7 (-18)/(-12)(-28)/(-6) 7 What is ((-12)/15)/((-24)/(-20))? -2/3 What is 14/(-3)198/132? -7 Evaluate (2-2)/((-60)/(-60)). -4 Evaluate (2/36)/(((-2)/(-1))/8). 2/9 What is -21(-5)/10? 1 What is the value of ((-48)/40)/((-21)/(-35))? -2 Calculate ((-33)/11)/(((-3)/(-1))/3). -3 Evaluate (-6)/411/((-33)/(-8)). -4 What is (-15)/420-148/(-10)? -2/5 Calculate (-24)/25236/4. -3/7 What is (-2)/(-2)-2(-73)/(-146)? -1 (-14)/(-28)(-24)/(-6) 2 (-260)/9368/10 -2/9 Evaluate (-4)/((-40)/(-10))-2. 2 (45/20)/(30/(-4))2 -3/5 Calculate 0/(16/2). 0 Evaluate (99/(-18))/110/4. 0 Evaluate ((-30)/15)/(-171/(-1)). -2/17 Evaluate ((-76)/(-95))/(-1(-3)/(-30)). -8 3/15-3(-16)/(-12) -4/5 ((-25)/10)/(30/(-36)) 3 8/41(-1)/5 -2/5 Calculate ((-17)/(-85))/((-6)/5). -1/6 Calculate ((-4)/3)/(34/3). -2/17 Calculate 6(-235)/94(-2)/10. 3 4/(-8)0/3 0 Calculate ((-24)/18)/((-15)/(-9)). -4/5 What is ((-6)/(-45)9)/(-3)? -2/5 What is (6/(-4))/((-10)/(-20))? -3 What is (-2)/((-1)/((-4)/(-24)))? 1/3 Evaluate 1/316/((-256)/60). -5/4 1/(-1)12/2 -1 Calculate 413/(-177)*(-8)/(-42). -4/9 C	{ "pile_set_name": "DM Mathematics" }
- 223v + 27856 = 0. What are the prime factors of v? 2, 1741 Let o = 48 + 175. Suppose 0 = -5p - 3 + o. What are the prime factors of p? 2, 11 Suppose 36 = 10x - 114. Let h(d) = 13d + 56. What are the prime factors of h(x)? 251 Suppose 0 = -8z + 9 + 7. List the prime factors of z + -4 + -1 + 48. 3, 5 Let f be (-3)/(0 + (1 - (-135)/(-138))). Let q = -14 - f. List the prime factors of q. 2, 31 Let r(t) = t2 - 3t - 14. Suppose -2w = 4i + 14, -3i - i = -w - 13. What are the prime factors of r(w)? 2, 47 Suppose -122 = 3s - s. Let w be (1 - s)15/30. Let x = 3 + w. What are the prime factors of x? 2, 17 Suppose 2043 = 3r - 3h, 4h + h = 3r - 2039. Let m = -485 + r. List the prime factors of m. 2, 3, 11 Let g = -3625 - -6403. What are the prime factors of g? 2, 3, 463 Suppose 3028 = 13g - 16849. List the prime factors of g. 11, 139 Suppose 41 = 2l + 117. Let s = 82 + l. What are the prime factors of s? 2, 11 Let s be 4 - (-3 + 0 - -2)/(-1). Suppose -a - 166 = -sa. What are the prime factors of a? 83 Let p(a) = 477a - 45. What are the prime factors of p(3)? 2, 3, 7, 11 Suppose 3t = -5q + 1399 + 237, t = q + 540. List the prime factors of t. 2, 271 Let p(c) = -c2 + 16c + 1. Let j be 2/5 + (-56)/(-10). Let g(y) = -y*3 + 7y*2 - 3y - 4. Let f be g(j). What are the prime factors of p(f)? 29 Let q be (1 + -1)/(3 - 2). Suppose q = 3w - 12. Suppose 0 = -wj - 4v + 124, 0 = -3j - 3v + 5v + 83. List the prime factors of j. 29 Suppose 0 = g + 4v - 1070, 5g - 61v = -60v + 5308. List the prime factors of g. 2, 3, 59 Suppose 2i + 26 = -2j, -2i + 3i + 22 = -2j. List the prime factors of (81/j)/(1 - (-14)/(-13)). 3, 13 Let f(m) = -m3 + m2 + 1. Let o be f(0). Let j(w) = -2w*2 + w - 1. Let d be j(o). List the prime factors of (d/4)/(9/(-558)). 31 Suppose -44c - 2808 = -46c. What are the prime factors of c? 2, 3, 13 What are the prime factors of (-8)/(-4(-1)/(-148))? 2, 37 Let y = 465 + -105. What are the prime factors of y? 2, 3, 5 Let b(i) = i*3 + 5i*2 - 17i - 14. Let m be b(6). Let d = -134 + m. What are the prime factors of d? 2, 73 Let w = 1007 + -408. What are the prime factors of w? 599 Let k(m) = m*2 - m + 349. Let r be k(0). Suppose 81 = -4d + r. What are the prime factors of d? 67 Let s(h) = -h*3 + 8h*2 - 9h + 16. Let q be s(7). Suppose qz - 210 = -z. List the prime factors of z. 2, 5, 7 Let f be 0 + 0(2 + -3 + 2). Suppose -3y + 191 = -8y + 4w, 2w = -y - 27. Let p = f - y. List the prime factors of p. 5, 7 Let d = 6840 + -4738. What are the prime factors of d? 2, 1051 Let q = -179 - -1012. List the prime factors of q. 7, 17 Let c be 52/12 - (-1)/(-3). Suppose -286 = cs - 1046. List the prime factors of s. 2, 5, 19 What are the prime factors of 3 + 3 + -1 + 1563? 2, 7 Let b be 100/(-6)3/(-2). Suppose 2x - 77 = -5a, x + 4a - 68 + b = 0. Let f = x - 22. List the prime factors of f. 3 What are the prime factors of (-143 + -1)/(13/5 - 3)? 2, 3, 5 Suppose 0 = q - 6q - 5. Let x(l) = -l + 4. Let f be x(4). What are the prime factors of (-3 + -6)(q + f)? 3 Let y(x) = -x2 - 2x - 2. Let a = -26 - -22. Let t be y(a). What are the prime factors of 3 + t/5 - -25? 2, 13 Suppose -2m = m + 51. Let c = 27 + m. Suppose -4f + c = f. What are the prime factors of f? 2 Suppose 0 = 31f - 20627 - 3925. What are the prime factors of f? 2, 3, 11 Let w(v) = 4v - 4. Let h = -15 + 17. Let q be w(h). Let g(l) = 3l + 6. List the prime factors of g(q). 2, 3 Let p be 4 - ((-3 - 0) + 3). Suppose -2b = -pc + 148, -148 = -0c - 4c - 3b. List the prime factors of c. 37 Let p be (28/49)/((-6)/(-63)). Let z(y) = 3 - 2y + 10y + py. List the prime factors of z(3). 3, 5 Let u(a) = -56a + 621. What are the prime factors of u(-57)? 3, 31, 41 Suppose -j - 5c = -24, -5j + 3c + 5 = -3. Suppose 5t = 2d - 162, -2d + 182 = jt + t. List the prime factors of d. 2, 43 Let u be (-328)/28 + 4/(-14). Let i = -13 - u. What are the prime factors of (18 - i) + -12 + 15? 2, 11 Suppose 5l = 8l + 4o - 1222, -3o + 1227 = 3l. List the prime factors of l. 2, 3, 23 Let t(z) = 18z + 8. Let k(s) = -18s - 8. Let w(j) = 4k(j) + 3t(j). List the prime factors of w(-2). 2, 7 Suppose 3h + 2d = 22, 4d - 16 = 2h - h. Suppose ht - 213 - 127 = 0. List the prime factors of t. 5, 17 What are the prime factors of (-2)/3(3/(-1) - 1332)? 2, 5, 89 Let f be (-87)/(-6) - 6/4. Let i = -14 + f. List the prime factors of 9(3 - 0) - i. 2, 7 What are the prime factors of (-102050)/(-250) - (-4)/5? 409 Let x(l) = 36l - 1. Suppose 0 = a + 5i + 14, 3a + i = -i + 10. Suppose 2 = -ab + 8b. List the prime factors of x(b). 5, 7 Suppose b - 142 = -3d, 4d - 132 = -b + 7. List the prime factors of b. 151 Suppose -3r = -9 - 0. Suppose rm - 4m + 39 = 0. Let p = 85 - m. List the prime factors of p. 2, 23 Let i(m) = -320m - 49. List the prime factors of i(-5). 3, 11, 47 Let g be 1/(-3) - (-80)/15. Suppose 12 + 3 = 3c - gi, -4c + 5i + 15 = 0. Suppose -2d + 4m = 7m - 29, c = -4d - 4m + 60. List the prime factors of d. 2 Suppose 59c = 62c - 471. Suppose 0 = -5z + 5, w - c = -z + 5z. What are the prime factors of w? 7, 23 Suppose -152 = -3y - n, 27 + 37 = y - 3n. Suppose 3c - y - 305 = 0. List the prime factors of c. 7, 17 Suppose 2u = 5m + 4505, 2294 = u + 4m + 74. Suppose -v + u = 9v. What are the prime factors of v? 2, 7 Let b(f) be the second derivative of -f*3/3 - 5f*2/2 + 17f. What are the prime factors of b(-4)? 3 Suppose -3b - 115 = -541. List the prime factors of b. 2, 71 Let f be 49/(42/6) - 31. What are the prime factors of f/12 + (-284)/(-3) + 4? 3, 11 Let c(k) = 271k3 + 8k + 2 - 7k2 - 272k*3 - 2k. Let m = -2 + -6. List the prime factors of c(m). 2, 3 Suppose -12f + 45 + 399 = 0. List the prime factors of f. 37 Let r(m) = m3 + 8m*2 + 10m + 15. Let j be r(-7). What are the prime factors of -36(9/j + -1)? 2, 3, 5 Let q be 1/4 - 831/(-4). Let x = q - 88. Suppose -a + 5a = x. What are the prime factors of a? 2, 3, 5 Let z = -813 + 1456. List the prime factors of z. 643 Suppose -4z = 2a - 104 + 30, -4z + 132 = 4a. What are the prime factors of a? 29 Let t(n) = -n*3 - 6n*2 + 13n + 17. List the prime factors of t(-11). 479 Suppose b - 4 + 25 = v, -102 = -5v + 2b. List the prime factors of v. 2, 5 Let m(b) = 156b3 + b2 - 1. Let j be m(1). Suppose -w - 2n + j = n, 5n + 290 = 2w. Suppose -5p + w = -2p. List the prime factors of p. 2, 5 Let y = 2359 - 892. What are the prime factors of y? 3, 163 List the prime factors of 5/((-20)/(-6222)) - (-3)/2. 3, 173 Suppose 5u = -3b + 9946, -b - 39 = 2u - 3356. List the prime factors of b. 3307 Suppose g - 2 = -4n - 0, -3n = -g + 37. Suppose 2 = -4t + g. Suppose -2m - h = -101 + 12, -4m + 175 = th. List the prime factors of m. 3, 5 Suppose 3f - 1320 - 99 = 0. What are the prime factors of f? 11, 43 Let h(r) = r*3 - 17r*2 + 23r + 13. What are the prime factors of h(17)? 2, 101 Let c be (-9)/(2(-6)/(-200)). Let q = c - -39. Let g = -79 - q. What are the prime factors of g? 2 Suppose -5v + 3264 = -4f, 3f = 5v - 3174 - 94. List the prime factors of v. 2, 41 Suppose -3t - 505 + 5749 = 2v, 0 = 2v - 6. What are the prime factors of t? 2, 3, 97 Suppose -2a + 16 + 60 = 0. Let z = 24 - a. What are the prime factors of z/(-3) + 5/15? 5 Let k(f) = -f2 - 2f - 34. Let u = 12 - 12. Let b be k(u). Let x = b - -64. List the prime factors of x. 2, 3, 5 Let g = -11 + 13. Suppose -gc = -4c - 2. Let y = 4 - c. List the prime factors of y. 5 Suppose -16s + 30124 - 268 = 0. List the prime factors of s. 2, 3, 311 Suppose 0d - 1971 = -9d. What are the prime factors of 4/(-6) + d/1810? 11 Let o = 311 - 140. List the prime factors of o. 3, 19 Let q(n) = n*3 - 5n*2 + 3n + 6. Suppose -5h - 5c + 53 - 3 = 0, -4c = 5h - 46. What are the prime factors of q(h)? 2, 3, 5 Let o = -12 - -9. Let q(j) = j2 - j + 1. Let s(h) = h2 - h. Let r(w) = q(w) + 2s(w). What are the prime factors of r(o)? 37 Suppose -3a - 4b + 186 = 0, -4b = -3a - 3b + 201. Suppose -2o + 4q = -80 - a, -5o - 3q = -313. What are the prime factors of o? 5, 13 Let f(w) = -3w3 + 7w*2 - 15w + 71. List the prime factors of f(-10). 3, 1307 Suppose 7*d +	{ "pile_set_name": "DM Mathematics" }
descending order. v, 3, -34 Let r = 201/19 - 2249/209. Put r, 5, -0.6 in ascending order. -0.6, r, 5 Suppose p - 15 = -2p. Let u be (1 - 7/5)/((-209)/(-359480)). Let f = u + 679. Put -4, p, f in ascending order. f, -4, p Let v = 2 + -2. Let z be -3((-664)/72)/(4/120). Let d = 825 - z. Put 5, d, -4, v in decreasing order. 5, v, -4, d Let i = 35 + -72. Suppose 26q - 540 = -20. Let l = q + i. Sort 0.5, l, 0. l, 0, 0.5 Suppose 2l - 1 = -9. Let z = 99 + -97. Let j(a) = a*3 - 3a*2 + 7a - 9. Let s be j(z). Put l, s, 2 in increasing order. l, s, 2 Let h be 1 + (4 - 3)/(-3). Let z = 3.1321 - -0.0379. Let y = 0.17 - z. Put y, h, 0.3, -1/4 in increasing order. y, -1/4, 0.3, h Let r be (12/10)/(1 - 3). Let x = 14 + -2. Let d = -0.64446 - -0.14446. Put -1/9, x, d, r in descending order. x, -1/9, d, r Let x = -0.1 - -0.4. Let u = 175.9 + -176.2. Put u, x, -18 in decreasing order. x, u, -18 Let b be 14/66 - 7. Let a be 1(277 + -2)/1. Suppose bh = -4h + a. Sort -2/7, 2/13, h, 0.5 in ascending order. -2/7, 2/13, 0.5, h Let h(i) = -i*2 + 11i - 15. Let m = 3 + 7. Let r be h(m). Sort r, -4, 9 in increasing order. r, -4, 9 Let c = -7391 + 7386. Sort 1, 5, c, 2, -6 in increasing order. -6, c, 1, 2, 5 Let p = -1441 + 885. Let t = p - -556.1. Sort t, -3, 60, -3/8. -3, -3/8, t, 60 Let h = 432 - 477. Let o = -47 + 88. Let d = h + o. Put -0.2, -5/4, d, 0.1 in descending order. 0.1, -0.2, -5/4, d Let m = -5599/16806 - 1/5602. Sort -2, 5, m, 2/5, 3/71 in decreasing order. 5, 2/5, 3/71, m, -2 Let v = 2.1 + -0.97. Let y = 1.43 - v. Sort y, -0.5, -15, -2 in descending order. y, -0.5, -2, -15 Let w = 52 + -37. Suppose 151o = 23o - 512. Sort 3, w, 1, o in increasing order. o, 1, 3, w Let o = 7549 + -7547.49. Sort o, -0.07, -2/11 in increasing order. -2/11, -0.07, o Let h = -0.03474 + 6.03474. Put -1, 2/3, h, -0.4, -2 in descending order. h, 2/3, -0.4, -1, -2 Suppose -29l = 11l - 40. Let k = 4.9 + -4.4. Sort k, l, 1/3. 1/3, k, l Let b = -140836/1445 - -1462/15. Let t = b - -1712/9537. Sort -2/3, 4, -41, t in descending order. 4, t, -2/3, -41 Let w = -1571.4 - -1571. Let z be ((-24)/32)/(6/2). Sort 2, w, -19, z in ascending order. -19, w, z, 2 Let k = -13.534 + 14.034. Let q = -8 + 11. Put k, q, -1 in decreasing order. q, k, -1 Suppose -5j = -4v - 56, -5v = -6j + 9j + 107. Sort -4, v, -1. v, -4, -1 Let c = 3.059 + -0.059. Suppose 3z = 6z - 138. Let p = 51 - z. Put 0.4, p, c, 0.5 in ascending order. 0.4, 0.5, c, p Let l = -3 + 2. Suppose 4p + 133 - 222 = 5r, 4p = -23r - 163. Suppose 5q + 15 = -0q, 2c - 4q = 8. Sort l, c, p in increasing order. c, l, p Let f = 29903 + -29907. Put 97, f, 21 in increasing order. f, 21, 97 Let b = 39949/199770 + 1/39954. Put 1, 2, 3, b, 2/7 in ascending order. b, 2/7, 1, 2, 3 Let o be (-6120)/(-544)4/(-18)6. Let v = 4 + -3. Sort o, v, -2/15 in descending order. v, -2/15, o Suppose 5 = 3h - 2v, -3137h = -3136h + 3v - 20. Put h, -2, -104, -4 in descending order. h, -2, -4, -104 Let i(x) = 14x2 + 304x + 1442. Let j be i(-7). Let o = -2 + 23. Suppose 2s = 3t - 4t + 9, -t + 4s = o. Sort j, -6, t in decreasing order. j, t, -6 Let y = 1465/10206 - 1/1458. Sort -1/3, -0.2, -0.036, 2/19, y. -1/3, -0.2, -0.036, 2/19, y Let s(i) = 5i - 59. Let k be s(11). Suppose -f - 2f - h - 9 = 0, 0 = 2f - h + 11. Let r be 3f/(-24)-2. Sort k, r, -2 in ascending order. k, -2, r Let k be ((-2)/(-7))/(26/455). Put -0.2, 2/11, 1/3, k in ascending order. -0.2, 2/11, 1/3, k Let r(h) = -10h + 145. Let n be r(14). Let j be 0 + -4 - -4 - n. Put 4, -128, j in ascending order. -128, j, 4 Let b = -75 + 77. Suppose 12 - b = l - 5f, 3l - 2f - 17 = 0. Let c = -171 + 173. Sort c, 4, l in ascending order. c, 4, l Let t = -1502 + 1499. Sort t, -55, -0.6 in increasing order. -55, t, -0.6 Let o = -22779 + 20442. Put -3, 4, -1, o in descending order. 4, -1, -3, o Let y = 658 + -656.555. Let l = -0.445 + y. Suppose 0 = -0t + 4t - 12. Sort l, t, 4, 0 in descending order. 4, t, l, 0 Let p = -77614 + 77610. Suppose 4 = -2c + 8. Let m = 15 - 24. Put c, p, m in increasing order. m, p, c Suppose -20 = 19s - 24s. Let t(y) = -y + 10. Let h be t(0). Suppose -7a = -ha + 21. Sort -2, 5, a, s in decreasing order. a, 5, s, -2 Let p = 103 + -75. Suppose -4z - 3k = z + 3, 0 = 4z - 4k + p. Suppose l + 5m + 30 = 5, -3m = 4l + 32. Sort z, 1, l in descending order. 1, z, l Let a(j) = 57 + 10j*2 - 5j*2 - 4j*2 - 16j. Let y be a(11). Sort y, -1, 4 in descending order. 4, y, -1 Let n = 1007259799/4057 - 248277. Put -1, n, -0.3 in ascending order. -1, -0.3, n Suppose 8 = -o + 5o. Suppose -2d + 10 = 5l - 10, od + 12 = 3l. Put 1, l, -19 in descending order. l, 1, -19 Let r = -0.138793 - -0.338793. Let a = 5 + -5.3. Let x = -3 + 3.1. Put r, a, x in decreasing order. r, x, a Suppose -346 = 5k - 2c, -3k - c = -4k - 68. Let v = k - -1886/27. Sort -0.2, 5, v, -0.5. -0.5, -0.2, v, 5 Let m be (-6)/96/(-2). Let y be (20/15)/(-4) - (5/3 - -4). Put y, 1, -5, m in descending order. m, 1, -5, y Let g = -276 + 126. Sort g, 0.3, 0.5, -0.1. g, -0.1, 0.3, 0.5 Let t = -2087 + 2086.5. Put t, 2/7, 1, -2, 19 in increasing order. -2, t, 2/7, 1, 19 Let i = 3930 + -3930.2. Let c = 2/111 - -101/555. Let v be ((-2)/5)/(6/(-10)). Put i, 4/3, c, v in decreasing order. 4/3, v, c, i Let a(b) = 77b - 9431. Let n be a(122). Sort 1, 119, n in descending order. 119, 1, n Suppose -5i = 4n - 57 - 5, 2i - 4n - 36 = 0. Suppose 2c + i = -0x + 3x, 2x + 4c - 4 = 0. Sort x, 15, 0 in decreasing order. 15, x, 0 Let d(l) = -12l + 74. Let h be d(4). Let u be (-1)/(2/18-3). Put -5, u, h in decreasing order. h, u, -5 Let z(l) = 350l - 2104. Let x be z(6). Suppose -2c - h + 1 = 10, 0 = -3c - 4h - 26. Sort -2/21, x, c in descending order. -2/21, c, x Suppose -y = -4s - 11, 4s - y = -4y - 15. Suppose 626 + 154 = -l - 155l. Sort 40, 2, l, s. l, s, 2, 40 Let z = -229 - -356. Let x = z + -130. Let b be ((-2)/3)/((-125)/(-75)). Sort b, 5, x, -0.02. x, b, -0.02, 5 Suppose 2j + 5v + 33 = 0, -4j + 5v + 2 = -7. Suppose 0 = -4s - q + 4, -3q = 4s - 17 + 21. Put s, j, -2, 0 in increasing order. j, -2, 0, s Let l = 116 - 43. Let a = l - 75. Sort a, 0.13, 0.4 in increasing order. a, 0.13, 0.4 Let i = -126.3 - -126. Let f = 23 - 18. Suppose fz - 9 = 1. Sort z, 0.02, i in increasing order. i, 0.02, z Let r = 1/3193 - -261823/9579. Sort 3, 0.2, r in ascending order. 0.2, 3, r Let z = 243 + -256. Let s = z - -10. Let h be (-2)/4 - 1/(-2). Put h, 5, s, -5 in increasing order. -5, s, h, 5 Let g = -46 + 12. Let r(l) = -2l2 - 6l + 7. Let w be r(-6). Let s = w - g. Put s, 1, -5 in ascending order. -5, 1, s Let m = 2450 - 2445. Put -2/25, -6, m in decreasing order. m, -2/25, -6 Let f(n) = -n*2 - 258n - 6837. Let u be f(-30). Let j be -6 + (1 - 0)1. Sort 1, 5, u, j in descending order. 5, u, 1, j Let a be ((-1)/(-28))/((2/(-7))/((-528)/(-462))). Put -0.3, -2, -6, 1, a in decreasing order. 1, a, -0.3, -2, -6 Let y = 41 + -37. Let v = -0.04 - 0.02. Let q = 1618/5173 + -20/739. Put -1/8, q, v, y in increasing order. -1/8, v, q, y Let n be -81 - -79 - (0 - 4). Let w(i) = -i2 - 2i - 3. Let d be w(-2). Put n, d, -5, -4 in decreasing order. n, d, -4, -5 Let h be (-4 + 90/27)/((-16)/(-6)). Sort h, -15.7, -0.3, 1. -15.7, -0.3, h, 1 Suppose 37 = -5l + 2i + 185, 0 = 5l - i - 154. Sort -2, -1, l in increasing order. -2, -1, l Let b = 87398 - 87399. Let r(v) = -2v - 5. Let g be r(-9). Sort g, b, -2 in decreasing order. g, b, -2 Let b(f) = -2f3 - 11f*2 + 9f + 85. Let r be b(-4). Let i be -24 + 1 + -1. Let g = i + 39/5. Sort g, -2, r in ascending order. -2, g, r Let i = 16956.95 + -16957. Sort -3, -5/3, i, 1/3, 3/2 in increasing order. -3, -5/3, i, 1/3, 3/2 Suppose -u + 1 = -2. Suppose -3c = -uk + 12, -4k + 15 = -4c + k. Let o = -23839 + 23837. Put -3, -1, c, o in increasing order. c, -3, o, -1 Suppose i - 5f = 26, 0 = 2i + 2f + f - 52. Let w be 78/(-12)-8(-1)/2. Let p = w + i. Sort p, 5, 1 in increasing order. p, 1, 5 Suppose 0 = -d + q - 3, 7 = 3d - q + 10. Sort -12, d, 115. -12, d, 115 Suppose 18f - 46 - 42 = -16. Suppose 2a + 4b - 4 = 2, -2a + 5b = 3. Put 6, a, 5, f in descending order. 6, 5, f, a Let b(s) be the third derivative of -s*6/30 - 13s**5	{ "pile_set_name": "DM Mathematics" }
y(l) = ac(l) - 2w(l). Factor y(f). -2f(3f + 1) Let g(s) = -7s*3 - 12s*2 - 21s - 7. Let z(v) = -3v3 - 6v*2 - 11v - 4. Let j(x) = -4g(x) + 9z(x). Factor j(d). (d - 8)(d + 1)2 Factor -1/2j5 - j2 + 0j4 + 2j*3 - 3/2j + 1. -(j - 1)*3(j + 1)(j + 2)/2 Let b be (((-9)/252)/((-1)/(-12)))/(-2 - -1). Solve b + 4/7d + 1/7d2 = 0. -3, -1 Let i(j) be the third derivative of -j7/140 + j6/80 + 3j5/20 + j2 + 10. Determine r so that i(r) = 0. -2, 0, 3 Let c(o) be the first derivative of -9o6/2 - 6o*5/5 - 24. Factor c(j). -3j*4(9j + 2) Let l(z) be the third derivative of z8/21 + 2z*7/7 - 4z6/15 - z5 + 2z4/3 + z2 + 180z. Let l(y) = 0. What is y? -4, -1, 0, 1/4, 1 Let r(s) be the third derivative of s8/336 + s7/105 - s*6/15 - 4s*5/15 + 2s*4/3 + 16s*3/3 - 37s*2. Find y, given that r(y) = 0. -2, 2 Let w = -102698/25 + 4108. Factor -2/25s*2 + 2/25s + w - 2/25s3. -2(s - 1)(s + 1)2/25 Let z be (8/(-35))/(620/(-1550)). Factor z + 22/7n*2 + 26/7n. 2(n + 1)(11n + 2)/7 Suppose 6j - 3l + 6 = 9j, j = -3l. Let q be (-9)/(-5) + (-5)/(-25). Factor 1/4t*5 - 1/2t*j - 1/4 + 1/2t*q + 1/4t - 1/4t4. (t - 1)3(t + 1)*2/4 Factor -1225/2y*2 + 0 + 1085/4y*3 + 1/4y*5 + 17y*4 + 0y. y*2(y - 2)(y + 35)2/4 Let x(h) = -h2 + 2. Let p(w) = -1. Let j(s) = 4p(s) - x(s). Let m be j(3). Let 6a - 27a*2 - 2a3 - am + 6 + 21a2 - 3a = 0. What is a? -2, -1, 1 Let k(m) = -m - 9. Let b be k(9). Let d be (-1)/2 + (-9153)/b. What is h in dh - 508h + 2h2 - 8 = 0? -2, 2 Suppose -57x - 10 = -59x. Let h(s) be the third derivative of 0s + 0 - 1/120sx + 1/24s*4 + 3s*2 - 1/12s*3. Solve h(y) = 0. 1 Let a(c) be the first derivative of 0c*3 + 4c + 2 + 1/6c2 + 0c*5 - 1/18c*4 + 1/90c6. Let q(y) be the first derivative of a(y). Factor q(i). (i - 1)2(i + 1)2/3 Let i(z) be the third derivative of z6/24 + 2z*5/3 - 25z*4/6 + 99z*2 - 2. Find q, given that i(q) = 0. -10, 0, 2 Let q(j) = -7j*3 - 17j*2 + 55j - 31. Let z(n) = -10n3 - 26n*2 + 82n - 46. Let b(s) = 7q(s) - 5z(s). Factor b(v). (v - 1)*2(v + 13) Suppose 4f + 14r - 5 = 17r, 3 = -f + 5r. Let d(q) be the second derivative of 0 + 1/3qf - 7q + 1/27q3 - 1/90q*5 - 1/18q*4. Solve d(a) = 0. -3, -1, 1 Suppose -17/2l + 1/2l4 + 3 + 17/2l*2 - 7/2l3 = 0. Calculate l. 1, 2, 3 Let u(b) be the third derivative of -b8/3864 + b*7/483 - 7b6/1380 + b5/230 - b*2 + 78b. Factor u(g). -2g2(g - 3)(g - 1)2/23 Let a be ((3 - 3) + 5)/1. Suppose -as - 3h = 5, -3h - 7 = -5s + 18. Factor 9b + 4b2 - bs + 0b + 6. 3(b + 1)(b + 2) Let o be 26/6 + 6/9. Find x, given that 15x2 + x - 6x + o - 5x3 - 10x = 0. 1 Let w(z) be the third derivative of z6/960 - z5/480 - 45z2. Factor w(b). b2(b - 1)/8 Suppose -t + 6t - 7 = -f, t = -2f + 5. Suppose 12gf + 0g*2 - 7g - 21g - 24 = 0. Calculate g. -2/3, 3 Let n(o) be the first derivative of 2o*4/11 - 64o*3/11 - 9o*2 - 50o/11 + 373. Solve n(h) = 0 for h. -1/2, 25 Factor -2m5 + 6m - 4m3 - 120444m*2 + 120428m*2 + 16m*3. -2m(m - 1)3(m + 3) Let n(r) be the third derivative of r*5/90 - 25r*3/9 - 63r*2 + r. Let n(l) = 0. What is l? -5, 5 Suppose 4d - 14 = 3o, -5o - 2d = 2d - 30. Factor 7k2 + 10k*3 - 3k*o + 0k*2. 2k*2(5k + 2) Let r(v) be the third derivative of 3v7/2240 - v6/960 - v*5/160 - 19v*3/3 + 35v*2. Let y(j) be the first derivative of r(j). Let y(c) = 0. What is c? -2/3, 0, 1 Determine a so that 36/5a*2 - 123/5a - 3/5a3 + 126/5 = 0. 2, 3, 7 Factor 0 + 9 - 10 - 4q*2 + 30 + 23 + 48q. -4(q - 13)(q + 1) Factor -36/7n2 - 24/7n*3 + 0n - 4/7n4 + 0. -4n*2(n + 3)*2/7 Let w(q) be the third derivative of 7q*5/160 + 41q*4/32 + 75q*3/16 - 825q2. Let w(p) = 0. What is p? -75/7, -1 Let z(y) = y3 - y*2 + y. Let i(r) = -6r*3 - 52r*2 - 61r. Let h(b) = -i(b) - 5z(b). What is g in h(g) = 0? -56, -1, 0 Suppose 4k - 9k + 20 = 0. Let w(m) = -m3 - 13m*2 - 12m + 6. Let q be w(-12). Factor kf2 + 2f + 4f3 - 16f*2 + qf. 4f(f - 2)(f - 1) Suppose 24a - 213 = -47a. Let 2/3r*a + 0r + 0 - 2/3r2 = 0. What is r? 0, 1 Factor -104u*2 - 265u - 23 + 364u2 + 5u*3 + 23. 5u(u - 1)(u + 53) Solve 77b + 0 + 12 + 10b*2 - 7b + 12b2 = 0. -3, -2/11 Let k be (((-5)/(-1) - 3) + -2)/(-1). Let j(a) be the third derivative of 1/12a*3 - 1/60a*5 + 3a*2 - 1/48a*4 + 0a + k. Factor j(x). -(x + 1)(2x - 1)/2 Let g = -10184/3955 + 2/565. Let n = g + 68/21. Find x, given that 2x2 + 4/3 - 10/3x - 2/3x4 + nx3 = 0. -2, 1 Let n(k) be the third derivative of -k6/30 + 19k4/6 - 20k*3 - 2k*2 + 307k. Find o such that n(o) = 0. -5, 2, 3 Let x(g) be the first derivative of 14 - 3/8g2 + 0g - 1/4g3. Factor x(s). -3s(s + 1)/4 Factor -15n - 25n + 143 - 98 - 5n*2. -5(n - 1)(n + 9) Let p(f) = 5f*2 + 32f - 229. Let z(u) = -40u2 - 255u + 1835. Let c(h) = 25p(h) + 3z(h). Factor c(m). 5(m - 4)(m + 11) Let k(p) be the first derivative of -2p6/3 + 16p*5/15 + 2p*4/3 - 16p*3/9 + 2p2/3 - 48. Solve k(m) = 0. -1, 0, 1/3, 1 Let i(m) = -m3 + m*2 - 6m - 6. Let d be i(-3). Let r be d/(-36)6/(-4). Factor -1/6o*r + 1/6 + 0o. -(o - 1)(o + 1)/6 Let x = -554 - -1684/3. Solve 20/3v*2 - 2v + xv4 - 2v*5 - 92/9v3 + 2/9 = 0 for v. 1/3, 1 Let p = 31 + -17. Let x be (p/(-8))/(2/(-8)). Factor -l2 - 6l5 + 5l*2 - 8l*4 + 9l*3 - xl*3. -2l*2(l + 1)*2(3l - 2) Let g(r) = r3 + 4r*2 + 10r + 21. Let b be g(-3). What is o in bo2 + 0 + 0o - 2/11o4 + 0o*3 + 2/11o*5 = 0? 0, 1 Let y(s) be the first derivative of 28s*6/3 + 92s*5 + 113s*4 - 1988s*3/3 + 610s*2 - 200s + 21. Let y(z) = 0. Calculate z. -5, 2/7, 1/2, 1 Suppose 5i - 6 = 2m, 3m = 5i - i + 5. What is c in 55c4 + 24 + 12c - 30c2 - 8c*3 - mc*3 + 3c*5 - 49c*4 = 0? -2, -1, 1, 2 Determine m, given that 800/3m + 268/3 + 256/3m3 + 264m*2 - 4/3m4 = 0. -1, 67 Let r(u) be the first derivative of u6/3 - 2u5/5 - 3u*4/2 + 2u*3/3 + 2u*2 - 35. Factor r(q). 2q(q - 2)(q - 1)(q + 1)2 Let u = 47 + -45. Let g be ((-6)/(-3) - -4)/u. Solve -1/3o + 1/3og + 1/3o*2 - 1/3o*4 + 0 = 0 for o. -1, 0, 1 Let d be 2 + (-6)/4 + 1. Suppose 0 = -4a - 5v - 2 - 0, -3a - 3v = 0. Suppose -dp*2 - ap*3 - 1/3p - 5/6p4 + 0 = 0. Calculate p. -1, -2/5, 0 Suppose 0 = g - 2l + 5l - 11, 4g - 16 = 2l. Suppose -10t + gt = -20. Suppose 4/3b*t - 2b - 2/9b5 + 4/9 + 32/9b*2 - 28/9b3 = 0. Calculate b. 1, 2 Let u(c) be the third derivative of -c6/320 + 11c5/160 - 35c*4/64 + 25c*3/16 + 46c*2. Suppose u(i) = 0. What is i? 1, 5 Let g(m) be the second derivative of 3m*5/160 - 3m4/32 - m3/4 + 199m. Find i, given that g(i) = 0. -1, 0, 4 Let y be (0/(-12))/((4 + 0)-1). Suppose y + 0m2 - 1/11m*3 + 1/11m = 0. What is m? -1, 0, 1 Let 126z - 21927z*3 - 210 + 21932z*3 - 120z*2 + 199z = 0. Calculate z. 1, 2, 21 Let h(n) be the third derivative of 13n2 + 0 + 1/30n*5 + 0n*3 + 0n + 1/3n4. Find r, given that h(r) = 0. -4, 0 Suppose 3o = 8o - 20. Let a be (2/4)/((-4)/(-16)). Suppose -4g*4 - 2 + ago + g2 + 3g2 = 0. What is g? -1, 1 Let n = 104452/3 + -34817. Factor 1/6q - 1/6q3 - 1/3q*2 + n. -(q - 1)(q + 1)(q + 2)/6 Let i = -19 - -23. Suppose -4d = d - 15. Solve -6ud - 10u*3 + 25u*5 + iu*2 - 2u*4 + 2u*4 + 5u*4 = 0 for u. -1, 0, 2/5 Let k(w) be the first derivative of 9 + 3/16w*2 - 3/4w + 1/8w3. Determine b so that k(b) = 0. -2, 1 Factor 35z*4 + 2747z - 1810z3 + 17036z*2 + 718z + 4586z + 6104z*2 - 1291z. 5z(z - 26)*2(7z + 2) Suppose 22 = 19y - 16. Let h = -9 + 13. Factor -h + 25a2 - 24a*y - 2a + 4. a(a - 2) Let u = 78 - 50. Let r be (0(u/(-8) + 3))/(-2). What is n in r + 2/7n2 + 4/7n = 0? -2, 0 Let r(g) be the second derivative of -7g - 1/80g*5 - 1/4g*3 + 0 + 3/32g4 - g2. Let l(j) be the first derivative of r(j). Factor l(i). -3(i - 2)(i - 1)/4 Let l(u) be the second derivative of -2u + 2744/3u*3 - 98u*4 - 4802u*2 + 0 + 28/5u**5 - 2/15	{ "pile_set_name": "DM Mathematics" }
g and q. 13 Let j = 47 + -5. Let c = j - 22. Let q be c - (-3 - (1 - 3)). What is the highest common divisor of 14 and q? 7 Let a be 21/9 + 708/9. What is the highest common factor of a and 513? 27 Let a be (6/(-4))/((-1)/(-20)). Let i be 1/(((-9)/a)/3). Calculate the greatest common divisor of 25 and i. 5 Let o = -229 + 242. What is the greatest common factor of o and 52? 13 Let u(y) = -2y2 + 8y + 5. Let o be u(-5). Let q = -25 - o. What is the greatest common divisor of 40 and q? 20 Suppose 0u + u - 27 = 0. Let r = 881 + -665. Calculate the greatest common factor of u and r. 27 Suppose -102 = 2a + 4z, a - 3z = -18 - 58. Let t be a/(-7) - (-6)/21. Suppose ti = 12i - 336. What is the highest common factor of i and 14? 14 Let q be 0 + -3 - (-11 - -10). Let t be -45/q + 2. Let n be 2/t + (-2514)/(-36). What is the greatest common factor of 7 and n? 7 Let l = -5 - -9. Let x be l - (5 - (-2 + 5)). Suppose 0 = q + xq - 54. What is the greatest common divisor of q and 45? 9 Let z be -35(26/(-14) + -1). What is the greatest common divisor of 90 and z? 10 Let o = -1 + 4. What is the highest common factor of 33 and o? 3 Let f be 23/(-12)-10. Suppose z - 26 = -2. Suppose -k = -31 - z. What is the greatest common divisor of k and f? 5 Suppose -3t = z - 3507, 3t + 6z - 10z - 3492 = 0. Calculate the greatest common divisor of 73 and t. 73 Let l = 776 + -753. What is the highest common factor of 253 and l? 23 Let p = 824 + -822. Suppose -5k + 85 = -3x + 8x, 2k - 4x - 28 = 0. What is the greatest common factor of p and k? 2 Let v = -250 + 327. What is the highest common factor of v and 7? 7 Suppose 0 = -5p + 4d - 39, p + 0d = 4d - 11. Let m(c) = -c - 6. Let n be m(p). What is the highest common factor of n and 8? 1 Suppose -6a + 294 = a. Let l = 94 - 53. Suppose -3s + 43 = -l. Calculate the greatest common divisor of s and a. 14 Let a(f) = -6f3 + 48f*2 + 4f - 20. Let h be a(8). Suppose 126 = 4t - 18. Let q be (t/(-10))/((-2)/10). Calculate the highest common divisor of h and q. 6 Suppose -4y + 187 + 13 = 0. Calculate the highest common divisor of y and 50. 50 Let y be ((-280)/3)/5-3. Suppose 0k - 4 = 2k - 2j, -4k + 27 = 3j. Let u be ((-6)/(-3) - k) + 15. Calculate the highest common divisor of u and y. 14 Let r = -54 - -98. Suppose 2n + 3g = 2, 38n - 41n + 3g = -18. What is the greatest common divisor of n and r? 4 Let g = -193 + 214. Let d(r) = 5r*2 + 9r - 3. Let t = -16 + 22. Let o be d(t). Calculate the highest common factor of o and g. 21 Suppose -3n = -4n + 3. Suppose m - 1154 = -3m + 5g, -862 = -nm + 2g. What is the highest common divisor of 26 and m? 26 Let o(t) = 7t2 + 3t + 5. Let q be o(-4). Let p(h) = 5h2 - 2h - 3. Let g be p(-2). Calculate the greatest common divisor of g and q. 21 Suppose -6m + 22 + 2 = 0. Let p be 4 + (-13 - -1)/(-4)-1. What is the greatest common factor of p and m? 1 Suppose 66 = -0u + 3u. Let a(n) = -2n3 - 45n*2 - 31n + 44. Let s be a(-22). Calculate the greatest common divisor of s and u. 22 Let b = -90 + 45. Let n = b + 54. What is the greatest common divisor of 9 and n? 9 Suppose 0 = 11y - y - 190. Calculate the greatest common factor of y and 76. 19 Let o be ((-378)/70)/(3/(-10)). Let f(a) = a3 + 3a*2 - 3a - 3. Let w be f(-3). Calculate the greatest common divisor of w and o. 6 Let s(l) = l3 - l2 + 2l + 65. Let p be s(0). Let y = 101 - p. What is the greatest common divisor of 90 and y? 18 Suppose 234 = 14y + 4y. Suppose -9z + 12z - 273 = 0. Calculate the greatest common divisor of z and y. 13 Suppose -32 = -3g - g. Let u = -9 + g. Let b be 90/10 - (-3)/u. What is the highest common divisor of 54 and b? 6 Let w(l) = l*2 + 28l - 85. Let y be w(8). What is the highest common factor of 7 and y? 7 Let p(a) = a - 6. Let v be (5 - -1)6/12. Suppose 0 = 4r + vh - 20, -r + 3r + 4h = 0. Let w be p(r). Calculate the greatest common divisor of 6 and w. 2 Let b be (-6)/9-15 - 2. Let z be (7 + -5)14/4. Suppose z - 3 = q. What is the greatest common factor of q and b? 4 Let p = 207 + -187. Let h = 46 - -4. Calculate the highest common factor of p and h. 10 Let s = -532 + 551. Let g(z) = z - 46 - z3 - 2z2 + 236 + z2. Let y be g(0). Calculate the highest common divisor of y and s. 19 Let n be 2/(-7) - (-174)/21. Suppose -3g - 30 = -2m, 3g - n = -3m + 22. Let p be ((-432)/(-84))/(3/56). Calculate the greatest common divisor of p and m. 12 Let x(w) = -5w + 14. Let u be x(-10). Let g = -34 + u. Calculate the greatest common divisor of 10 and g. 10 Let n = -19 - -49. Suppose -4b + n = -2b. Let x = -5 - -20. What is the highest common factor of x and b? 15 Let p = -117 - -261. Calculate the greatest common factor of 9 and p. 9 Suppose -41n = -40n - 8. Suppose -6h = -nh + 28. What is the highest common factor of 14 and h? 14 Suppose 965d = 950d + 3780. Calculate the highest common factor of 27 and d. 9 Let s(l) = -2l - 30. Let a be s(0). Let h be (a/(-21))/(4/28). Let p = h + -4. Calculate the highest common factor of p and 3. 3 Suppose 0 = 2m - 4j - 1184, 1421 + 1569 = 5m - 4j. Calculate the greatest common divisor of 172 and m. 86 Suppose 2585 = 7b + 170k - 167k, -1457 = -4b + 5k. Calculate the highest common factor of 207 and b. 23 Suppose 7n = 2n + 65. Suppose -9 + 129 = 2g - 2c, 4c - 75 = -g. Let y be 4928/g - 6/27. What is the highest common divisor of n and y? 13 Let v(x) be the first derivative of 7x2/2 + 3x + 6. Let t be v(3). Let r be (-352)/2t/(-32). Calculate the highest common divisor of 12 and r. 12 Let x be 90/70 + -1 + 782/7. Calculate the greatest common factor of 32 and x. 16 Suppose -2769 = -46g - 1113. What is the greatest common factor of g and 1422? 18 Suppose -18 = -6x - 0. Suppose -5m + j = 150 - 657, -j - 406 = -4m. Suppose 2h + a - m = -2h, 2a - 10 = 0. What is the highest common divisor of h and x? 3 Suppose -5a + 0a - 2k + 324 = 0, 0 = -2a - k + 129. Let s = -348 + 248. Let w = s - -122. Calculate the greatest common factor of w and a. 22 Let y = 423 - 358. Calculate the highest common divisor of y and 10. 5 Let c be ((-28)/(-4))/1108/14. Suppose 4s - c = 74. Calculate the greatest common factor of 24 and s. 8 Let m = -34 + 111. Let g = -44 + m. Let h = g + -26. What is the greatest common divisor of 14 and h? 7 Let p = -540 + 586. Let s(o) = -o*2 - 4o - 2. Let a be s(-2). Suppose at + 0t - 46 = 0. Calculate the highest common divisor of t and p. 23 Suppose -3g - 8 = -2, 0 = 2s + g + 14. Let b(n) = -5n - 23. Let t be b(s). Suppose -4q + 28 = -2q. What is the highest common factor of q and t? 7 Let d be ((-162)/(-12))/9(-224)/(-3). What is the greatest common divisor of d and 80? 16 Let r(x) = 35x. Let z be r(3). Let b(l) be the second derivative of 11l*3/6 + 9l*2/2 + 8l. Let n be b(3). What is the highest common factor of n and z? 21 Let q be (2 + (-2)/4)-6. Let d(h) = 1. Let w(r) = -2r + 16. Let a(b) = -6d(b) + w(b). Let k be a(q). What is the highest common divisor of k and 70? 14 Let t = -49 + 1224. What is the highest common divisor of 25 and t? 25 Let f be ((-523)/2 - 4) + (-3)/(-6). Let w = f - -427. What is the highest common factor of 18 and w? 18 Let b(p) be the first derivative of 21p*2/2 + 2p - 2. Let h be b(3). Let i be 0 + 1 + -2 + h. Calculate the greatest common divisor of 16 and i. 16 Let h(w) = -14w. Let k be h(-2). Let x be ((-16)/k)/(2/(-7)). What is the highest common divisor of 4 and x? 2 Suppose -5y + 4v = 18, 11 + 3 = -4y + 3v. Let o be 20 - (y - -3)(0 + -1). What is the highest common factor of 147 and o? 21 Let h(f) = f*3 + 4f*2 - f - 6. Let t be h(4). Let p = t + -82. What is the highest common factor of p and 36? 36 Let u = 21 - -5. Let j(v) = 21v + 2. Let y be j(3). Suppose 2d - d = y. Calculate the highest common divisor of d and u. 13 Suppose 0 = -2r - 1 + 61. Calculate the highest common divisor of 18 and r. 6 Suppose -3n + 24 = -18. Let u be (n/(-4))/(1/(-4)). Suppose 2307o - 2256o = 2856. What is the greatest common factor of o and u? 14 Let b(o) = -o3 - 4o + 132. Let d be b(0). Let k be d/(-48)(23-2 + 2). Calculate the highest common divisor of k and 11. 11 Let w = -75 + 124. Suppose 5*t	{ "pile_set_name": "DM Mathematics" }
rt(1700) - (sqrt(612) + sqrt(612) + -2 + sqrt(612) + -1))*2. 492sqrt(17) + 114317 Simplify -1(0 + sqrt(11))24 - (sqrt(11) - (sqrt(11) - (sqrt(11) + sqrt(33)/sqrt(3) + 1)) - (1sqrt(1100) + sqrt(1100))). -45 + 18sqrt(11) Simplify 4 + ((sqrt(228)-2-1 + sqrt(228))/(4sqrt(588)))2. 3307/784 Simplify (-4 + ((-1sqrt(54) + sqrt(54))/sqrt(9))/(sqrt(3) - sqrt(6)/sqrt(2)6))2. 16 Simplify (3 + (sqrt(2) - (sqrt(2) + 4)))2 + (sqrt(2) + -2 + -2sqrt(2) - (sqrt(64)/sqrt(2) + sqrt(2))2). -54 - sqrt(2) Simplify ((2 + (sqrt(99)/(sqrt(9)-3) - (sqrt(11) - (sqrt(11) - sqrt(121)/sqrt(539)))))2)2. -160sqrt(11)/21 + 11456/441 Simplify (4(sqrt(22)/sqrt(2))2 - (sqrt(66)/sqrt(2))/sqrt(3)) + 3sqrt(99)/sqrt(225). -2sqrt(11)/5 + 44 Simplify ((sqrt(240)1 - sqrt(240))/sqrt(10) - sqrt(24) - (sqrt(96)/sqrt(4) + sqrt(24))-6)/(-3sqrt(128) - sqrt(32)/sqrt(4)4) + -2. -2 - 11sqrt(3)/16 Simplify ((sqrt(126) + -2sqrt(126) + sqrt(126) + sqrt(126) - sqrt(126))4)/(sqrt(42)/(sqrt(6) + sqrt(216)-2 + sqrt(6) + sqrt(6))). 0 Simplify (-3(sqrt(1300)1 - sqrt(1300)) + 0)-4 + -1. -1 Simplify ((-1(sqrt(228)1 - sqrt(228) - sqrt(228))-4)/(-1sqrt(108) + sqrt(768) + sqrt(768)1)4)*2. 4864/169 Simplify 1((sqrt(1300) + 4(sqrt(1300) + 1) - sqrt(1300)) + sqrt(1300)-2 + 4). 8 + 20sqrt(13) Simplify (-5 + 4 + sqrt(175) + (sqrt(175) - -2sqrt(175)-6) + -2)2. 300sqrt(7) + 17509 Simplify (1sqrt(100)4 - (1sqrt(100)-5 - sqrt(100)))/(sqrt(605) + (sqrt(605) - (sqrt(605) + sqrt(605) + 6sqrt(605)-2 + sqrt(605)))). 20sqrt(5)/121 Simplify ((3(sqrt(144)-2 + sqrt(144)))/sqrt(6))/(sqrt(128) + 31sqrt(128)). -3sqrt(3)/16 Simplify 1((sqrt(288) + 5 + sqrt(288))2 - (sqrt(2) - sqrt(288))1)2. 502sqrt(2) + 2354 Simplify ((sqrt(133)-2-3)/sqrt(7))2 + (sqrt(209)/(sqrt(55)/sqrt(5)))2 + ((-1sqrt(133) + sqrt(133))/sqrt(7))2. 703 Simplify (5(3 + (4 + sqrt(567)-2 - (1 + sqrt(567)2)) + 0))*2. -10800sqrt(7) + 227700 Simplify (4(0 + sqrt(243) + -1 + -5)-5)*2. -43200sqrt(3) + 111600 Simplify ((sqrt(117) - 6(sqrt(117) - (sqrt(117) + 6sqrt(117))))/(-6sqrt(81)/sqrt(9)))2. 17797/36 Simplify (5 + -1sqrt(500))2 + -2sqrt(5)2 + (sqrt(15)/sqrt(3))2 + -2. -24sqrt(5) + 13 Simplify sqrt(15)/(2(sqrt(405) + sqrt(5))) - (sqrt(3267)/sqrt(9)-6)*2. -13068 + sqrt(3)/20 Simplify -2((5 + sqrt(968)-2)2 - (sqrt(968) + sqrt(968) + 62sqrt(968) + sqrt(968)))-1. -1540sqrt(2) + 7794 Simplify ((2sqrt(50))*2 + 2 - sqrt(50))-5-5. -125sqrt(2) + 5050 Simplify (-6-1sqrt(500) + 0 + sqrt(320) + 4 + sqrt(320))*2. 608sqrt(5) + 28896 Simplify (3 + sqrt(2) + sqrt(8) - ((sqrt(2) + -1 + sqrt(2) - sqrt(2))-3)2) + sqrt(8)-5-2 + 2. -22 + 41sqrt(2) Simplify ((sqrt(112)2 - sqrt(112))/sqrt(7))/(sqrt(72)/sqrt(324)) + -1. -1 + 6sqrt(2) Simplify (-5-2(sqrt(1216) + -1 + sqrt(1216)) - (2 + (sqrt(38) - sqrt(152))/sqrt(2)-2))2. -3792sqrt(19) + 474460 Simplify -4 + (3 + (0 + sqrt(17))2 - (sqrt(1377) + 2 + sqrt(1377) - sqrt(1377))2). -1365 - 36sqrt(17) Simplify (sqrt(72)/((sqrt(4) + sqrt(16))6))/((sqrt(294)-1 + sqrt(294))-6 - sqrt(294)). -sqrt(3)/126 Simplify (sqrt(22)/sqrt(275) + -2 + 32sqrt(2)5)2. -604sqrt(2)/5 + 45702/25 Simplify ((-5sqrt(20)2)/(sqrt(4) + (sqrt(256) - -1sqrt(256)) + sqrt(256)))2 + -1. -1/5 Simplify 4 + -1sqrt(567) - (sqrt(77)/sqrt(176) + (sqrt(7) + -1)5)2. -3423/16 + 87sqrt(7)/2 Simplify (4(4 + -5 + (sqrt(2057) - (1 + sqrt(2057) - sqrt(2057))) + 5))2. 1056sqrt(17) + 33056 Simplify ((-11sqrt(153) + 1 + -3 + sqrt(153) + sqrt(153))3)2. -108sqrt(17) + 1413 Simplify (-1 + sqrt(2448) + -1 - (-1 + (sqrt(2448) - (1 + sqrt(2448))))*2) + (-1sqrt(85)4)/(-4(sqrt(5)2 + sqrt(5))). -6 + 37sqrt(17)/3 Simplify (-2sqrt(99) + -5)2 - (sqrt(99) + -3)2-4. -12sqrt(11) + 853 Simplify 6((3 + sqrt(363))*2 + -3 - sqrt(27)/(sqrt(90)/(sqrt(60)/sqrt(6)))). 390sqrt(3) + 2214 Simplify ((sqrt(75)-1)/sqrt(5) + 6sqrt(60)/sqrt(4))/(sqrt(15)/(sqrt(192)/sqrt(4))). 20sqrt(3) Simplify (5 + (sqrt(539)3 + -3 - (2 + 3sqrt(539))))2. 0 Simplify (6-51sqrt(162)-3)2 + 2 + 2. 1312204 Simplify (-4 + 4 + -3-2-1sqrt(147) + -3)*2. 252sqrt(3) + 5301 Simplify (sqrt(153)111)/(sqrt(1296)1-3 - sqrt(1296) - sqrt(1296)). -sqrt(17)/60 Simplify (6((sqrt(300) - (sqrt(300) + sqrt(300) + (1 + sqrt(300) - sqrt(300)))) + sqrt(300))-4)26. 3456 Simplify (3 + ((sqrt(350) + (sqrt(350) - ((sqrt(350) - sqrt(350)-1) + sqrt(350) + sqrt(350)) - sqrt(350)) - sqrt(350) - sqrt(350))-4)/(4-1sqrt(162)))*2. -50sqrt(7)/3 + 5104/81 Simplify -3 + sqrt(3) + sqrt(192)1 + (-41sqrt(6))/sqrt(2). -3 + 5sqrt(3) Simplify 1(sqrt(49) - (sqrt(49) + sqrt(4900)2) - sqrt(343)/sqrt(63))/(((sqrt(70) + 2sqrt(70))-5)/sqrt(10)). 61sqrt(7)/45 Simplify (sqrt(119)2)/sqrt(7) + (sqrt(1700) + 0)*2 + -4 + ((0 + sqrt(68))4 + -1 + -2sqrt(68))2. -6sqrt(17) + 1969 Simplify ((3(sqrt(600) - (sqrt(600) - (sqrt(600) - sqrt(600)2))))/(-6(1sqrt(108) - sqrt(108) - sqrt(108))))*2. 25/18 Simplify (sqrt(120)/sqrt(3)1 - (sqrt(160) - 1sqrt(160)))/(-5(-2sqrt(72) - sqrt(72))). sqrt(5)/45 Simplify (2 + -5 + -1-1((sqrt(112) - (sqrt(112) + -1)) + 2))2. 0 Simplify (sqrt(429)/(sqrt(44)/sqrt(4)))/(4sqrt(432) - sqrt(3))4-2. -8sqrt(13)/47 Simplify ((sqrt(119)1 + sqrt(119) - sqrt(119))/sqrt(7) - sqrt(17) - (sqrt(51)/sqrt(3) + -5))*2 + ((sqrt(34) - sqrt(136)/sqrt(4))1)/sqrt(2). -10sqrt(17) + 42 Simplify (4sqrt(4400)2 + sqrt(4400))/((sqrt(12) - sqrt(108))/sqrt(3) + (sqrt(4) - sqrt(16)/sqrt(4))2). -45sqrt(11) Simplify 5 + -2-2sqrt(432) + -5(-4 + (sqrt(432) + sqrt(432) + 0)*2). -8615 + 48sqrt(3) Simplify (sqrt(17)-1 + 5)2 + sqrt(85)/(sqrt(5)3) - ((sqrt(1700)1 + sqrt(1700))2 - (sqrt(102)/sqrt(6)-3 - sqrt(17))). -6758 - 41sqrt(17)/3 Simplify (sqrt(60)/((sqrt(864) + 2sqrt(864) - sqrt(864)) + sqrt(6) - sqrt(6)))/((sqrt(2560)-2)/sqrt(8)). -sqrt(2)/384 Simplify (-2 + 4 + (3-1sqrt(156))/(sqrt(24)/(sqrt(4)/sqrt(2))))2. -12sqrt(13) + 121 Simplify -1(sqrt(325) + 0 + 3(sqrt(13) + 0))3. -24sqrt(13) Simplify (-5((2sqrt(75))/sqrt(3))/(sqrt(30)/(sqrt(6)-2))-5)*2. 50000 Simplify 0 + ((sqrt(1331) + sqrt(1331)1 + -3 + (sqrt(1331) - (sqrt(1331) + 0 + ((sqrt(1331) - 1sqrt(1331)) + sqrt(1331) - sqrt(1331)))))2)*2. -528sqrt(11) + 21332 Simplify ((1((sqrt(70) - (sqrt(70) - (sqrt(70) - ((sqrt(70) - sqrt(70)-1) + sqrt(70))-5))) + sqrt(70) + sqrt(70)))/(sqrt(30)/sqrt(3)4 + sqrt(40)6))2. 567/64 Simplify ((sqrt(85) + -5sqrt(85)2 + sqrt(85))/(sqrt(245) + 2sqrt(245)))*2. 1088/441 Simplify (sqrt(2) + (-3 + sqrt(2))6 - (0 + (sqrt(14)/sqrt(7))*2)) + -1 + 0. -21 + 7sqrt(2) Simplify 13(5(sqrt(2057) + 0 - sqrt(2057))-3 + 1). 3 Simplify (sqrt(190) + (-13sqrt(190) - sqrt(190)))/(sqrt(80)/(sqrt(8)1)). -3sqrt(19) Simplify ((sqrt(204) + 1sqrt(204)-2)2)/(sqrt(120)/sqrt(160) + (sqrt(12) - (-1sqrt(192) + sqrt(192) + sqrt(12)))) + 0. -8sqrt(17) Simplify 3(-3(sqrt(637) + 0)2 + sqrt(637) + -2). -5739 + 21sqrt(13) Simplify (-4 + -2 + -3 + sqrt(11) + 3 + sqrt(22)/sqrt(2) + -1)*26. -168sqrt(11) + 558 Simplify (((sqrt(50) + sqrt(250)/sqrt(5))-5)/(sqrt(10) + (sqrt(640) - (sqrt(640) - sqrt(640)-1)) - sqrt(10))4 + 1)*2. 10sqrt(5) + 126 Simplify (-2 + -5-1sqrt(153) + sqrt(153))*2 + -5. -72sqrt(17) + 5507 Simplify (sqrt(12) + 3sqrt(1452) + sqrt(1452))/((sqrt(96)/sqrt(2))/sqrt(12)). 45sqrt(3) Simplify ((sqrt(2448) - (sqrt(2448) - sqrt(2448)1-3 - sqrt(2448)))*2 - sqrt(2448) - (sqrt(2448) - (sqrt(2448) - (1 + sqrt(2448)))4)*2) + -5. -108sqrt(17) + 7323 Simplify ((sqrt(700) - (sqrt(700) + (sqrt(700)-2 + -1 - sqrt(700))) - (2 + sqrt(700)1))-2)2. -160sqrt(7) + 11204 Simplify (sqrt(100) + 2(sqrt(100) + (1sqrt(100) - sqrt(100)) + sqrt(100)))/(sqrt(640)/sqrt(8) - 1sqrt(125)). -10sqrt(5) Simplify (((sqrt(637) - -2sqrt(637)1) + (sqrt(637) - (sqrt(637) + sqrt(637)1)-4) + sqrt(637) + sqrt(637))4-1)*2. 1997632 Simplify (sqrt(144)/(sqrt(8) - sqrt(800)-2))/(sqrt(99)/(2sqrt(176))). 8sqrt(2)/21 Simplify (-2 + ((5 + -1 + sqrt(3))*2 - sqrt(15)/(sqrt(15)/sqrt(3))) + 1)-5. -90 - 35sqrt(3) Simplify ((sqrt(24) + (sqrt(600)-3 - sqrt(24)) + sqrt(24))-4)/(2sqrt(128)3 - sqrt(128)). 14sqrt(3)/5 Simplify ((0 + sqrt(80))**2 + 5)	{ "pile_set_name": "DM Mathematics" }
value of 4 - (4 - (-9 + 6 + 3))? 0 Calculate 0 - ((1 - 0) + 2). -3 What is the value of -5 + 4 + -4 + 11 - 7? -1 Calculate -8 + 13 + -8 + (-2 - -1). -4 Evaluate 6 - (1 - (-5 - -11) - -6). 5 What is the value of -9 + 1 - (23 + -27)? -4 What is the value of -8 + 3 + 2 + 5? 2 Calculate -1 + (-3 - -2) - -2 - -2. 2 What is the value of (4 - 3 - -1) + -6 + 7? 3 1 + (4 - -3 - 10) -2 What is -6 - (4 - 10) - 2? -2 What is the value of -2 - (-2 + 0) - -1 - 6? -5 Calculate (3 - (5 - 2 - 7)) + -3. 4 Evaluate (1 - (3 - 3 - -3)) + 2. 0 -12 + (8 - 9 - -9) -4 Evaluate -3 - (-9 + 2 + 2). 2 Evaluate -5 + (0 - -12) + -8. -1 (-3 - -1) + 1 + -7 + 3 -5 What is 4 - 2 - (6 + -4 + -3)? 3 What is 3 + -5 + (-1 - 0) + -1? -4 Evaluate -5 + 4 - 2 - 1. -4 What is 0 + 3 + -2 + -6? -5 What is 0 - -3 - 8 - -3 - 2? -4 Calculate 3 + -3 + -6 + 5. -1 Evaluate -1 + 3 - (5 - (1 - 1)). -3 -6 - (-6 - (5 + -3)) 2 Evaluate -8 + 13 - ((7 - 4) + 2). 0 Calculate 1 + 8 + -10 + -6. -7 Calculate -14 - -17 - (1 - 1). 3 -7 + -1 + 1 + 5 -2 Calculate 21 + -23 - (2 + -7). 3 Evaluate (3 - 3) + -2 + 19 + -25. -8 Calculate 4 - (2 - (4 + -1) - -3). 2 -15 + 19 + 4 + -4 4 What is the value of (7 + -2 - 4) + 9 + -3? 7 What is the value of 0 + -2 + 9 + -4? 3 What is 8 + (9 - 5) + -17? -5 Calculate 7 - (6 - 0) - 5. -4 What is the value of 2 + (0 + -4 - (-17 - -21))? -6 What is the value of -6 + (4 - 0) - (0 + 0)? -2 Calculate (-3 - (3 + -5)) + -3 + 2. -2 Calculate 4 + -7 - (-5 + 3). -1 Evaluate 6 - (0 + 2 + -7 - -12). -1 0 + (4 - (9 - -5)) -10 Calculate -2 - (-7 - -2) - -2. 5 19 + -24 - (-15 + 0) 10 Evaluate (2 - 3) + 6 - (3 - 2). 4 What is the value of -7 - (-17 + 4) - (7 - -1)? -2 What is (-9 - 1) + 24 + -19 + 5? 0 Calculate 1 - (2 - 0) - 2. -3 Calculate (-1 - 5 - -4) + -3 - -3. -2 What is the value of 9 + -11 - -13 - 7? 4 What is -7 + (1 - 5) + 3 + 1? -7 Calculate -41 - -39 - ((-2 - -1) + -6). 5 Calculate 7 + (7 - 12) + -6. -4 Evaluate 3 + 0 + (10 - 8). 5 Calculate 0 - -7 - (22 - 19). 4 What is the value of 0 + 0 - (-6 + 10 + -3)? -1 What is -3 - -5 - (-1 + 1 + 1)? 1 Calculate 5 - (4 - 2) - 3 - 8. -8 What is the value of -3 - (-2 + (-2 - -4) + 0)? -3 Calculate 2 + -2 + 3 - (-97 + 110). -10 What is 4 + -2 + -2 - (-9 + 12)? -3 Evaluate -3 + 0 - (43 + -51). 5 Evaluate 0 + -4 - (-1 - 1). -2 What is (2 - 9) + (-3 - -8)? -2 What is the value of 3 - (0 - (1 - 4))? 0 What is (-3 + 8 - -5) + -7? 3 1 + -3 + 14 + -10 2 What is -14 + -5 + 18 - (-9 - -1)? 7 What is the value of 3 - 0 - (1 - 3)? 5 Evaluate 2 + 1 - (84 - 73). -8 (-3 - 3) + -1 + (0 - -2) -5 What is the value of 9 - (2 + (-6 - -8))? 5 What is -7 + 12 + (-2 - -1 - 5)? -1 What is (-16 + 13 - (1 + -8)) + -3? 1 What is the value of (-3 - -5) + -2 + -1 - 0? -1 Evaluate 1 - 8 - (-3 + (4 - 7)). -1 Evaluate (2 - 0) + -25 + 26. 3 What is 4 - 5 - (5 + 1 + -2)? -5 6 + -9 - (6 + -6) -3 (-4 + 3 - -1) + (-3 - 2) -5 What is the value of -3 + 7 + 0 - -1? 5 6 + (2 - -1 - 6) 3 Evaluate 6 + (14 - 6) - 9. 5 What is -10 + 9 - (4 - (-3 + 12))? 4 What is 2 + (7 - (13 - 9))? 5 (-44 - -47) + (-9 - -1) -5 What is 2 + -1 + 0 - (-3 + 3)? 1 Evaluate (-6 - -5) + -3 - (-2 - 0). -2 (-3 - 15 - -3) + 10 -5 -2 + -1 + 2 + 2 1 Evaluate -7 + 6 - (-5 - -1). 3 What is 1 + -5 - (-4 - 4)? 4 Evaluate 4 + 2 + 42 + -51. -3 Calculate (0 - 0) + (5 - (5 - 1)). 1 What is the value of -1 + 6 + 4 + -14? -5 What is -7 - (-4 + -5) - 3? -1 What is the value of -2 + -1 + (5 - (1 - -2))? -1 (-4 - (4 - 4)) + 4 0 What is -1 + -2 - (-4 + 2 + -4)? 3 What is -1 - (9 + -7 - -1)? -4 Evaluate 1 - (-1 + -1) - (8 + -4). -1 Calculate 3 + (-3 - -1 - -5) - 6. 0 Calculate 3 + (3 - 9) - -9. 6 Evaluate -7 + -6 + 5 + 14. 6 -3 + 1 + -3 + 4 -1 What is the value of 5 - (-2 - -1 - -2)? 4 What is the value of 6 + 0 - (0 + 3 - 3)? 6 What is 8 + (-12 - -8) + -4? 0 What is the value of -3 + 7 + 3 + -12? -5 Evaluate (0 - 5) + 2 - (-24 - -25). -4 Evaluate 2 + -2 + 2 - (-1 + 3). 0 What is 4 + (-4 - (8 + -4))? -4 What is the value of 6 - (14 - 5) - -7? 4 -11 + 0 + (6 - 8) - -6 -7 What is (3 - -1) + -12 + 5 - -4? 1 What is 0 + 3 + (-1 - -1) + 2? 5 0 - 1 - (-8 + 5) 2 What is -2 + (-4 - -1 - -6)? 1 Calculate -1 + 13 + (6 - 9). 9 2 - 1 - (8 - 10) 3 What is 16 + -20 + 2 + 0? -2 What is the value of -14 + 5 + 1 - (-2 - 11)? 5 -2 + 9 + (-5 - -2 - -5) 9 What is the value of (-5 - -12) + 0 - 2? 5 (35 - 14) + -26 - (-8 - 1) 4 Evaluate -4 + (7 + -3 - 3 - -2). -1 What is the value of (-2 - 1) + 9 + -1 + -1? 4 Calculate 8 + (4 - 6) + (-10 - -15). 11 Calculate 6 + 1 + 0 - 8. -1 What is the value of 3 + 8 + 4 + -6 - 8? 1 Calculate -6 + -1 + (2 - -5). 0 What is the value of 5 + (2 - (0 - -3))? 4 What is (2 - 3) + -2 + (213 - 203)? 7 -7 + (3 - 7) + 14 3 Evaluate -3 + (3 - (-6 + 2)). 4 Calculate 1 - (10 + -6 - 4). 1 Calculate 3 - (-5 - -2 - -2). 4 What is -1 + -1 - (-7 + (7 - 4))? 2 What is -2 + (2 + (1 - 2) - -2)? 1 Calculate (5 - 5 - -3) + 1 + -1. 3 What is the value of 0 + 0 + (15 - 16) + -4? -5 Calculate 1 - (8 - (-4 + 12 + 3)). 4 What is the value of 1 - (1 + (-4 + 2 - 0))? 2 Calculate 2 - (5 + -2 + -2). 1 Evaluate (-51 - -51) + -1 + 2 - 5. -4 What is the value of -11 + 7 - (4 - -3 - 3)? -8 What is the value of 4 + (-4 - (-3 - 5)) + -10? -2 What is 2 + 1 + -1 + -3 + 4? 3 What is (4 - 7) + 1 - -4? 2 115 - 127 - (1 + -6) -7 What is -4 + -14 + 7 - -4? -7 (7 - 2) + -7 + -1 - -6 3 Evaluate -6 - -4 - -1 - -2. 1 What is the value of -1 + 7 + (4 - (7 - 2))? 5 What is the value of 2 - (2 + 8) - -4? -4 What is 0 - (-11 - -12) - (5 - 0)? -6 -5 + 1 - (0 + -11 + 6) 1 What is -19 + 14 + (1 - 1)? -5 Calculate -3 - (4 - 14) - 2. 5 Evaluate -6 - (-23 + 11 - 1). 7 Evaluate (-3 - 1) + (8 - (4 - -1)). -1 9 + (6 + -14 - 1) 0 What is the value of -13 - -7 - (-3 - (1 + -3))? -5 Calculate 2 - -4 - ((-7 - -7) + 4). 2 -1 + (-5 - -7) + -6 -5 What is 2 - (3 + 0 + -2 - -2)? -1 Evaluate 7 + -3 + 0 + 1. 5 10 + -5 + (2 - 2) 5 Calculate 6 - -1 - (9 + -6). 4 What is the value of -2 + 0 + (0 - -6)? 4 Calculate 4 + -4 + (2 - 13 - -6). -5 Calculate 2 - 3 - (-3 - (2 - 2)). 2 Calculate (-53 - -49) + (8 - -1). 5 Evaluate -19 + -5 + 13 + 6. -5 Evaluate -30 - -33 - (-1 - (-1 - -4)). 7 0 - (-9 + 1) - (75 - 74) 7 Calculate 23 - 21 - (1 + 7). -6 Evaluate (3 - 1) + (-14 - -9) + 9. 6 Calculate (2 - 2) + 0 + -1. -1 -1 - 2 - (-2 + 2 + -1) -2 (-5 - (4 - 4)) + (-2 - -3) -4 Evaluate -7 - (-5 + (3 - (-1 + 1))). -5 What is -5 + 12 + -8 - -2? 1 What is -8 - (-9 - 3) - 0? 4 What is 2 + 0 + 2 + -2? 2 Evaluate -1 - -6 - (33 - 23). -5 What is 2 - (-5 + 5 + 1)? 1 What is the value of 3 + -8 + 5 + 0? 0 Evaluate -13 + -6 + 7 - -7 - 0. -5 What is 3 - (-2 + 6 + -14 - -5)? 8 What is -2 + 1 + (3 - (7 - 3))? -2 Calculate 1 + 14 + -5 + -9. 1 (4 - 0) + -3 + 3 4 Calculate (1 - (-2 + 4 - 2)) + -3. -2 8 - 16 - -5 - 0 -3 Calculate (1 + -3 - -6) + -4. 0 Calculate 1 + (-4 - -4 - (-1 - 4)). 6 What is the value of (1 - -1) + -5 + -4 + 7? 0 Evaluate 5 + -1 + (-4 - -5 - 2). 3 What is 6 - 0 - (2 + 1)? 3 (-27 - -24) + 0 + 8 5 Calculate (4 - 2 - -1) + -3 + 2. 2 What is (-10 - (3 + -2)) + (17 - 13)? -7 Calculate 1 + -3 + 1 + -1 + 0. -2 What is 3 + 2 + (-11 + 10 - -4)? 8 What is (3 - (-1 - (-5 + 7))) + -6? 0 Evaluate (17 - 12) + (6 - 19). -8 What is -2 + (-4 - -5) + -1 + 2? 0 What is the value of 11 + 0 + -5 - 5? 1 What is (1 + -11 - (-3 - 1)) + 3? -3 What is the value of 1 - (3 - (-1 - -5) - -1)? 1 Calculate (-4 + -7 + 5 - 7) + 7. -6 What is the value of 1 + 9 + -3 + -10 + 8? 5 3 - (4 - (1 + -1 - -4)) 3 -3 - ((-1 - -3) + -3 + 2) -4 What is the value of 2 + -13 - (27 - 38)? 0 0 + (3 - (-3 + 0 + 3)) 3 7 - (3 - (-1 + (1 - -1))) 5 Calculate 28 + -26 - (8 + 1 + -3). -4 What is 8 + -2 + (0 - 2)? 4 Evaluate 2 + (0 + -14 - -7). -5 Calculate -7 - (5 + -17 + 8). -3 What is the value of (-4 - 0) + (-8 + 5 - -2)? -5 -2 - (1 - 8) - (14 + -12) 3 What is 4 - (0 + (4 - 4)) - 0? 4 What is 6 + -1 + 2 + -3 + -4? 0 What is the value of (-7 - -2 - -12) + -5? 2 -7 - (2 + 3 + -12) - 7 -7 Evaluate -2 - 4 - (10 - 8). -8 What is -14 + (-12 - -12) - -20? 6 What is the value of 8 + -1 + -6 + 0 + -1? 0 What is the value of 1 + 1 + 4 + -7 - -3? 2 Evaluate -5 + -1 + -5 + 4 - -3. -4 Evaluate (3 - 7) + (-4 - -3). -5 -6 + 3 + -1 + 2 + -2 -4 Calculate -1 - (-6 - -1) - (-1 - -2). 3 Evaluate (-4 - (4 - 4)) + 2. -2 -11 - -14 - (3 - 6) 6 What is 1 - (-7 - -4) - 4	{ "pile_set_name": "DM Mathematics" }
Put -3/7, -17/6, x, 2/11 in descending order. x, 2/11, -3/7, -17/6 Suppose -14v = 17 - 65 - 8. Sort -2, -4, -1, v, -223. -223, -4, -2, -1, v Let p be 36/(-14094)-29 + ((-24)/(-81))/(-4). Put 3, -97, p, 13 in decreasing order. 13, 3, p, -97 Suppose 3z + 2k + 30 = 0, -2k = -0z - z - 2. Let m(p) be the third derivative of p*5/60 + 17p*4/24 + 5p*3/3 + 6p*2. Let t be m(z). Sort 4, 3, t. t, 3, 4 Let k be 425/150 - ((-55)/(-30) + -2). Sort -3, 30/97, k. -3, 30/97, k Let a = -5518 - -5520. Sort 9, a, 10. a, 9, 10 Let o be ((-6)/4)/((-1)/2). Suppose -4k = t - 0k - 2, -3t - 4k = 26. Put t, o, -1 in decreasing order. o, -1, t Let b(m) = -5m*3 + 11m2 - 11. Let i be b(-1). Sort 6, i, 3 in increasing order. 3, i, 6 Let j = 0.47 + -0.07. Let l = 20.3 - -103. Let f = 123 - l. Sort f, -2/17, 1, j in descending order. 1, j, -2/17, f Let k(y) = y2 + 13y - 33. Let q be k(-15). Let t = -0.444 + 0.244. Sort -0.02, q, t in increasing order. q, t, -0.02 Let v = -1238018/35 + 35372. Put 3, -18/11, 0, v, 2/3 in increasing order. -18/11, 0, v, 2/3, 3 Suppose -3d + 12 - 3 = 0. Let m = -6 + d. Let q = 125 + -125.5. Sort m, 2, q in decreasing order. 2, q, m Let b = -7.5 + 20.5. Let c = 13.4 - b. Let p = -50 + 49. Sort 0.3, p, c in increasing order. p, 0.3, c Let x(d) = -194d2 - 80d - 3. Let i be x(-3). Put 0.3, -2/9, i in descending order. 0.3, -2/9, i Let q(j) = 4j3 - 5j*3 + 1 + 5j*2 + 5j + 2j3. Let p be q(-4). Let h(f) = -f3 - 12f*2 - 37f - 20. Let o be h(-4). Sort 3, o, p. p, o, 3 Let a = 3 + -5. Let l be (69/92)/(a/(-104)). Sort l, 0, 3. 0, 3, l Let i = 155 - 155. Let x = -12/65 - -89/130. Sort x, i, 0.46 in decreasing order. x, 0.46, i Let z be (-150)/(-550) - (-6)/(-22). Suppose z = 3d - 4d + 1. Let a = -4 - -2. Put 0, 2/9, d, a in descending order. d, 2/9, 0, a Let x = 11.1 + -19.3. Let k = x + 8.2. Sort -5, k, 1.2 in increasing order. -5, k, 1.2 Let c = -511.41045 - -0.01045. Let p = c + 511. Put -0.09, -0.02, p in ascending order. p, -0.09, -0.02 Suppose -r + 20 = 3r. Suppose -4a = -2k - 2k - 4, 3k + ra = -19. Let c(f) = -f*3 + 12f*2 - 2f + 26. Let i be c(12). Put k, i, -4 in descending order. i, k, -4 Suppose 0 = -27a + 978 - 897. Let r be (-9)/(-3) + -2 + 1. Suppose 3p = -l + 8, -10 = -4l - 4p - r. Put a, l, 2 in decreasing order. a, 2, l Suppose -6v + 58 = -5f - 3v, -2f - 3v - 19 = 0. Let i = -1 + 1. Put i, -4, f in descending order. i, -4, f Let w(u) = -2u + 77. Let n be w(12). Suppose -nc = -49c - 16. Sort -3, c, 1, 0 in descending order. c, 1, 0, -3 Let q = 148 + -139. Suppose 4b = qb - 10. Put b, 8, -2 in descending order. 8, b, -2 Let k(w) = 37w + 178. Let j be k(-2). Sort j, 2, -1, -3 in ascending order. -3, -1, 2, j Let j be 5(84/(-10))/(-3). Let n(y) = -2y3 - 28y*2 - 22y - 307. Let h be n(-14). Sort j, 0, h, 4. 0, h, 4, j Let b = 1.317 + -0.417. Let c = 1.9 + b. Put -3, 0.1, c in descending order. c, 0.1, -3 Let s = -495.76 - -495.7. Put -0.3, s, 0 in decreasing order. 0, s, -0.3 Suppose 2u = -z + 43, 3z = -u - 2 + 131. Suppose 48w - zw - 115 = 0. Put 3, w, 0 in decreasing order. w, 3, 0 Let s be (-464)/812 + (-78)/105/(-7). Sort 2, s, 4, 141. 2, 4, s, 141 Let u = -0.07253 + 1.07253. Put -5, 12.7, -1, u in increasing order. -5, -1, u, 12.7 Let z(l) = 20l - 670. Let o be z(30). Sort o, 0, 5 in descending order. 5, 0, o Let z(q) = q*3 + 48q*2 - q - 50. Let u be z(-48). Sort 4/7, u, 1.2 in increasing order. u, 4/7, 1.2 Let i = 4448 - 4452. Sort i, 4, -51 in increasing order. -51, i, 4 Let f = 0.2 + -0.7. Let z = 4637/18524 + -3/9262. Sort z, 1, -1/5, f in descending order. 1, z, -1/5, f Let g = 208/757 + -75/3028. Let n = 3 + 0. Sort 4, -1.9, n, g in decreasing order. 4, n, g, -1.9 Suppose -108 = -9r - 27. Suppose 3j + 1 = 3v - 2, -5j - 2v + r = 0. Let g be 3/((2 - 3)/8). Sort -5, g, 4, j in descending order. 4, j, -5, g Let c(j) = -217j - 4463. Let r be c(-20). Sort -2, r, 0.1 in descending order. 0.1, -2, r Let c = 9200 - 9203. Sort 0.5, -0.85, -2, 0.1, c in descending order. 0.5, 0.1, -0.85, -2, c Let u be (0(2/4)/((-57)/38))/(-2). Sort -76, -1, 3, -2, u in increasing order. -76, -2, -1, u, 3 Let d be (-3)/(-6)26(-11 - -12). Suppose 0 = w + 4b + 6, -w + 3b + d = -6w. Let p(y) = -11y - 26. Let l be p(w). Put l, -2, 5, 21 in decreasing order. 21, 5, -2, l Let l = 0.166367 + -0.066367. Let h(b) = 2b - 3. Let f be h(6). Sort f, -0.4, l, -3 in decreasing order. f, l, -0.4, -3 Let k be 19/(-35) + 6/15. Suppose -j - 52 = c - 45, -5c - 26 = 2j. Sort -1, c, 0.09, k. c, -1, k, 0.09 Let v = 5283 - 5281. Let c = -17 - -17. Sort 210, v, c in ascending order. c, v, 210 Suppose 3 = y + 4u, 0 = -4u - 0 + 4. Suppose -o + 4x = 25, o - 5x + 4 = -32. Put 2, y, o in increasing order. y, 2, o Let p = 0.6 - 1. Suppose -3i = 5g - 31, -2g = -g - 3i + 1. Suppose -b + c + 8 = 0, 0 = -4b + c + 11 + 9. Put b, -10, g, p in ascending order. -10, p, b, g Let b be -2 - 48/(-22) - 3072/(-528). Let p be (2/(-21))/(2/b). Sort p, 2/7, 3. p, 2/7, 3 Let x = 4472 + -4470. Sort -163, x, -1 in decreasing order. x, -1, -163 Let l = -2020 + 6071/3. Sort l, 25/2, -2, -0.2 in decreasing order. 25/2, l, -0.2, -2 Let y be (1 + -7)/2 - (-9 - -150). Let k = y - -166. Suppose -17n + kn + 20 = 0. Sort -2, 0, n in increasing order. n, -2, 0 Let w be -1(2 - -1)(-5588)/(-33). Let g = 3554/7 + w. Let b be 80/(-38) + 0 + 2. Sort -3, g, b, -0.4. -3, -0.4, g, b Let q = 316.5 + -316.3. Put 2, -160, q in decreasing order. 2, q, -160 Let h = -18 - -18. Let x be (-9)/(-7) + 2/(-7). Let u(l) = l*3 + 10l*2 - 3l - 33. Let g be u(-10). Sort x, g, h, 5 in descending order. 5, x, h, g Let y = 17 - 12. Suppose -5 = -yq + 5. Suppose 10 = 5u, 0n + 3u = qn - 6. Sort -2, -4, n in decreasing order. n, -2, -4 Let t = -2406 - -2406.4. Put -0.3, 0.3, t, -2.2, 5/6 in decreasing order. 5/6, t, 0.3, -0.3, -2.2 Let p = 180.74 - 180.212. Put -1/3, p, 0.6 in increasing order. -1/3, p, 0.6 Let p = 246 + -250. Suppose 93 = 3b - 5h, h = -3b - 4h + 93. Suppose -3q + 6 = 5f, 4q + 18 = f + f. Sort b, p, f. p, f, b Let a be 29798/(-84) - 6/(144/20). Let g = 356 + a. Sort g, 29, -0.4 in decreasing order. 29, g, -0.4 Let z = 0.0759 - -0.0641. Sort -1/31, z, -4. -4, -1/31, z Suppose -5a = 4p + 32, -18p - 27 = -13p + 3a. Sort -2, -4, -98, p, -5 in ascending order. -98, -5, -4, p, -2 Let q be -3(-115)/15 - (2 + 2). Let c(f) = f + 3. Let o be c(0). Let h(g) = -2g2 + 47g - 19. Let j be h(23). Sort q, o, j in ascending order. o, j, q Let b = 6347.72 + -6347.8. Suppose -4h = -5c + 37, 6c + 5h = c + 10. Sort b, -2, 3, c. -2, b, 3, c Let n(i) = i*3 - 9i*2 - 5i - 375. Let w be n(12). Sort 5, -11, w, 2 in descending order. 5, 2, w, -11 Let l(q) = -q*2 + 8q - 5. Let k be l(1). Suppose 0 = 2r - 7r + 5. Let w be 0 - (-12)/r - 3. Sort k, 1, w in descending order. w, k, 1 Let b = -241/2 + 2653/22. Let l be (-9)/(-12)12(-6)/(-378). Sort 1/6, -4, b, l. -4, b, l, 1/6 Let a = 1772 - 1777. Sort -1, a, 0, -12, -4 in decreasing order. 0, -1, -4, a, -12 Let c be ((-96)/(-40))/(4/6). Let j = c + -31/10. Let g be 51 - 1476/288. Sort j, -5, g in increasing order. -5, g, j Let w be (5 - 215/45) + 734/18. Let n = 41 - w. Suppose 3y - 5b - 2 = n, 2b + 8 = 3y - 0b. Sort -8, 5, y in increasing order. -8, y, 5 Let g(p) = p*3 + 4p*2 + 5p + 7. Let r = 399 + -402. Let u be g(r). Put u, 11, -1 in descending order. 11, u, -1 Let j be (-6594)/36 - 1/(-24)4. Sort -2, j, 0 in decreasing order. 0, -2, j Let d(x) = -2x*3 + 16x*2 - x + 10. Let t = -3 + 11. Let l be d(t). Sort -4, -0.4, l. -4, -0.4, l Let g = -4515 + 4427. Sort -2, 2, g in decreasing order. 2, -2, g Let m(p) = 33p + 165. Let x be m(-5). Suppose -12g + 27 + 9 = x. Sort g, -8, -5. -8, -5, g Let d = -91 + 64. Let u = d + 80/3. Let b = 95/112 + -9/16. Put 11, b, u in decreasing order. 11, b, u Let u be (9/366)/(-4 - (-1367)/342). Put 0, u, -3, -2 in decreasing order. 0, -2, -3, u Let y = -1/10 + 13/10. Let a = -69629/4 - -17406. Put y, -2, -0.1, a in decreasing order. y, -0.1, a, -2 Let f = -350 + 347. Sort 1, f, -1/4, -0.033, -4 in increasing order. -4, f, -1/4, -0.033, 1 Let r be (6/4)/(1/(-24)). Let h be -3 + (4 - r/(-30)). Suppose 3 + 2 = o. Pu	{ "pile_set_name": "DM Mathematics" }
picking 2 w and 1 o? 5/13 What is prob of picking 2 a and 1 m when three letters picked without replacement from {a: 4, m: 1, w: 3}? 3/28 Two letters picked without replacement from qrtrrqark. What is prob of picking 1 r and 1 q? 2/9 Two letters picked without replacement from {u: 3, f: 3, k: 1, c: 2, n: 3, j: 3}. Give prob of picking 1 k and 1 c. 2/105 What is prob of picking 1 h, 1 a, and 1 s when three letters picked without replacement from fahsy? 1/10 Three letters picked without replacement from {t: 5, f: 9}. Give prob of picking 3 t. 5/182 What is prob of picking 2 q when two letters picked without replacement from {d: 2, q: 2}? 1/6 Two letters picked without replacement from hllhohl. Give prob of picking 1 o and 1 l. 1/7 Two letters picked without replacement from drodowowrocdrrrdr. Give prob of picking 1 c and 1 w. 1/68 Four letters picked without replacement from {t: 2, a: 2, h: 1}. Give prob of picking 1 a and 3 t. 0 Two letters picked without replacement from {r: 4, n: 3, t: 7, q: 1, p: 1}. What is prob of picking 1 n and 1 t? 7/40 Two letters picked without replacement from zzzfffzzff. What is prob of picking 2 f? 2/9 What is prob of picking 1 u, 1 j, and 1 l when three letters picked without replacement from jjuullzquzlzqzqluzj? 16/323 Two letters picked without replacement from xnhthmp. Give prob of picking 1 h and 1 x. 2/21 Calculate prob of picking 3 p when three letters picked without replacement from {b: 2, p: 4, j: 1}. 4/35 Three letters picked without replacement from pjjpjjjhhjjh. What is prob of picking 1 p and 2 h? 3/110 What is prob of picking 3 i and 1 z when four letters picked without replacement from iiiiiiiziiiiiiiiii? 2/9 Three letters picked without replacement from {x: 1, y: 2, a: 2, o: 1, i: 1}. What is prob of picking 1 i and 2 y? 1/35 Two letters picked without replacement from {x: 1, z: 2, h: 2, r: 1, u: 8, q: 1}. What is prob of picking 1 r and 1 h? 2/105 Three letters picked without replacement from {z: 2, k: 1, m: 1}. Give prob of picking 2 m and 1 k. 0 Calculate prob of picking 3 h and 1 g when four letters picked without replacement from hhhhhhhhhhhhg. 4/13 Calculate prob of picking 2 d when two letters picked without replacement from dggggdvvdododrdga. 15/136 What is prob of picking 4 k when four letters picked without replacement from {k: 6, b: 6}? 1/33 Three letters picked without replacement from {r: 1, h: 1, s: 2, k: 1, g: 1, n: 1}. Give prob of picking 1 h and 2 s. 1/35 What is prob of picking 1 b and 2 x when three letters picked without replacement from {s: 1, z: 8, x: 2, b: 9}? 3/380 Two letters picked without replacement from kmvah. Give prob of picking 1 m and 1 k. 1/10 What is prob of picking 1 o and 2 y when three letters picked without replacement from {o: 1, v: 2, y: 2}? 1/10 What is prob of picking 1 u and 1 w when two letters picked without replacement from {u: 10, w: 1, p: 7}? 10/153 What is prob of picking 3 k when three letters picked without replacement from hkkhhkhkhhhhkh? 5/182 Calculate prob of picking 2 v and 1 w when three letters picked without replacement from wyqvppv. 1/35 What is prob of picking 1 l, 1 a, and 1 u when three letters picked without replacement from {g: 1, u: 6, l: 4, a: 7}? 7/34 Calculate prob of picking 1 g and 3 m when four letters picked without replacement from {m: 3, t: 1, g: 3, f: 1, n: 2}. 1/70 Calculate prob of picking 2 a when two letters picked without replacement from {s: 2, a: 11, k: 2}. 11/21 Four letters picked without replacement from {j: 5}. Give prob of picking 4 j. 1 Three letters picked without replacement from hwakwhpkj. What is prob of picking 2 w and 1 k? 1/42 What is prob of picking 1 x and 1 p when two letters picked without replacement from kxkyepxxpkxxpyeexe? 2/17 Calculate prob of picking 1 y, 1 a, and 1 e when three letters picked without replacement from ayyeyye. 8/35 Four letters picked without replacement from dofdocdooooodcccdo. What is prob of picking 2 d and 2 c? 1/51 What is prob of picking 1 a and 1 w when two letters picked without replacement from {j: 1, a: 4, w: 3, y: 2}? 4/15 Calculate prob of picking 1 u, 1 j, and 2 p when four letters picked without replacement from xppjxjppxrjxuuuupu. 5/102 Three letters picked without replacement from truttrirrjrtutirm. What is prob of picking 2 u and 1 r? 3/340 Calculate prob of picking 2 i when two letters picked without replacement from vivivvi. 1/7 Calculate prob of picking 1 c and 1 r when two letters picked without replacement from {l: 3, r: 2, v: 1, c: 3, u: 3, f: 1}. 1/13 Two letters picked without replacement from mmzrzmw. What is prob of picking 1 m and 1 r? 1/7 Calculate prob of picking 1 r and 2 y when three letters picked without replacement from {r: 8, y: 5}. 40/143 Calculate prob of picking 1 l and 1 h when two letters picked without replacement from {l: 2, i: 1, h: 10, e: 3}. 1/6 What is prob of picking 2 y when two letters picked without replacement from {t: 3, y: 2, q: 1, z: 1}? 1/21 Four letters picked without replacement from tteeettt. What is prob of picking 1 t and 3 e? 1/14 Calculate prob of picking 3 f and 1 g when four letters picked without replacement from mfllqqfgqqlfqq. 1/1001 What is prob of picking 2 j when two letters picked without replacement from {y: 1, e: 1, j: 2, q: 1}? 1/10 Two letters picked without replacement from xdiiiiixydiiyiy. Give prob of picking 2 i. 4/15 Two letters picked without replacement from mmjnn. What is prob of picking 2 n? 1/10 Calculate prob of picking 2 m when two letters picked without replacement from mmmmm. 1 What is prob of picking 1 p and 2 i when three letters picked without replacement from ppriiriiir? 1/6 Two letters picked without replacement from qootkqoqoqqqbkkoqb. What is prob of picking 2 o? 10/153 Calculate prob of picking 1 d, 1 r, and 1 o when three letters picked without replacement from ddtrido. 3/35 What is prob of picking 4 k when four letters picked without replacement from kkkcckkkkkk? 21/55 What is prob of picking 2 g when two letters picked without replacement from {g: 10}? 1 What is prob of picking 1 o and 2 e when three letters picked without replacement from xhhexhxhuxveoxvvve? 1/272 Calculate prob of picking 2 f when two letters picked without replacement from {w: 1, f: 3, k: 1}. 3/10 What is prob of picking 2 f, 1 s, and 1 d when four letters picked without replacement from pffshdhfdsrh? 4/165 Two letters picked without replacement from aiauaikauifauuu. What is prob of picking 1 f and 1 i? 1/35 Four letters picked without replacement from {m: 2, i: 5}. Give prob of picking 2 i and 2 m. 2/7 Three letters picked without replacement from {f: 2, d: 4, y: 3, k: 1, x: 4, l: 1}. What is prob of picking 1 f, 1 l, and 1 k? 2/455 Three letters picked without replacement from ufudufwdoduddfu. Give prob of picking 3 u. 2/91 Calculate prob of picking 1 c and 1 v when two letters picked without replacement from {v: 2, c: 1}. 2/3 Two letters picked without replacement from {v: 1, a: 5, s: 3, i: 6, e: 3}. Give prob of picking 1 e and 1 s. 1/17 Four letters picked without replacement from juhmhkr. What is prob of picking 2 h, 1 j, and 1 u? 1/35 Two letters picked without replacement from {d: 2, z: 1, g: 2, e: 1}. Give prob of picking 2 d. 1/15 Four letters picked without replacement from {w: 1, y: 1, t: 4, c: 1, q: 2}. What is prob of picking 1 y, 1 c, and 2 q? 1/126 Calculate prob of picking 1 y and 1 l when two letters picked without replacement from {d: 3, l: 2, y: 5, q: 1, s: 1}. 5/33 Calculate prob of picking 1 r and 1 b when two letters picked without replacement from bbbbbpybbybbbbrbb. 13/136 Calculate prob of picking 4 r when four letters picked without replacement from rprrrpprpprrpprpppr. 21/646 Four letters picked without replacement from rrfrskrkrkp. What is prob of picking 4 s? 0 Calculate prob of picking 2 z and 2 c when four letters picked without replacement from cczczcccccccc. 1/13 Two letters picked without replacement from jycjcjjjycycyyojcj. What is prob of picking 1 o and 1 c? 5/153 Two letters picked without replacement from aswtwtiwiitwiwaw. What is prob of picking 1 a and 1 t? 1/20 What is prob of picking 1 n and 2 b when three letters picked without replacement from bnbbbbbb? 3/8	{ "pile_set_name": "DM Mathematics" }
ve of -10t + 4t - t*2 + 6t - dt5 wrt t. -360t*2 Let q(g) = -2g*2 - 3g + 2. Let n be q(-4). Let x = 25 + n. What is the third derivative of -p*2 + xp*3 + 3p*2 - 9p*2 wrt p? 42 Let s be 50/(-2)(-4)/(-12)-3. What is the third derivative of sg*2 + 31g*4 - 65g*2 + 10g*2 wrt g? 744g Let n be ((-10)/5)/(4/(-4)). Suppose -n = 3g - 11. Find the first derivative of -9 - 5m*g + 0m*3 - 3m*3 wrt m. -24m*2 Find the second derivative of 4m*5 - 2429 + 2471 + 17m*4 + 3m - 5m wrt m. 80m*3 + 204m*2 Let w = 4 - 1. What is the third derivative of 14k*2 + 10k*2 - 8k*6 - wk*6 - 3k*6 wrt k? -1680k*3 Let q(w) be the third derivative of -23w*7/42 - 163w*3/6 - 2w*2 + 3. Find the first derivative of q(d) wrt d. -460d*3 Let a(s) be the second derivative of 83s*3/3 + 565s*2/2 - 788s. What is the derivative of a(l) wrt l? 166 Let v(c) be the first derivative of 7c2 - 1 + 0c - 13/3c3. Find the second derivative of v(f) wrt f. -26 Let k(b) be the second derivative of 6b - 5b2 - 5/6b*4 + 0 + 0b*3. Find the first derivative of k(l) wrt l. -20l Let k(w) be the third derivative of -w6/30 + w5/20 - 77w3/3 + 4w*2 + 1. What is the derivative of k(z) wrt z? -12z*2 + 6z What is the derivative of 93 - 10 + 7d4 - 81d*4 - 44 wrt d? -296d*3 Find the third derivative of 8o + 524o3 + 151o*2 - 8o - 225o3 wrt o. 1794 Find the second derivative of 7i + i*4 - 3i*4 - 7i*3 - 3i*3 + 13i*3 wrt i. -24i*2 + 18i Let c be (52(-34)/(-4))/((-10)/(-15)). What is the third derivative of 662a*2 + a - 2a*5 + 7a - ca2 wrt a? -120a*2 Suppose 3o - r + 0r = 12, -o + 12 = -3r. Let n be (-50)/(-15) + (-1)/o. What is the second derivative of -4p2 + 23 - 23 - np wrt p? -8 Let w(b) = -7b4 + 6b*3 - 23b*2 + 8b + 8. Let m(a) = -a4 + a3 - a*2 + 1. Let g(r) = -6m(r) + w(r). What is the second derivative of g(l) wrt l? -12l2 - 34 Let n(x) be the second derivative of 26x*3/3 - 12x*2 + 32x - 1. Differentiate n(s) with respect to s. 52 Let g(b) = -5b4 + 3b*3 + 10b2 - 4. Let m(n) = -n4 - n3 - n2 - 1. Let a(z) = g(z) - 4m(z). What is the third derivative of a(w) wrt w? -24w + 42 Let w(j) be the first derivative of 236j5/5 - 92j*2 - 24. Find the second derivative of w(p) wrt p. 2832p*2 Let x(p) = -2p + 1. Let m be x(-1). Let v be (m - 4 - 2)/(-1). Find the third derivative of 10j2 - j - 13j*3 - vj*2 + j wrt j. -78 Let y = 76 - 455/6. Let z(c) be the second derivative of yc*3 - 1/5c*6 + 0c*5 + 0c*2 + 0 + 0c*4 - 5c. Find the second derivative of z(p) wrt p. -72p2 Suppose 0 = -x - 4x + 15. Find the second derivative of 13c3 - 3c*3 + 20c - 10cx + 20c*5 wrt c. 400c*3 Suppose s - 4f + 10 = 2s, -5f = 5s - 20. Suppose -10 = -6i + i. What is the second derivative of 4v3 + v + iv - 7v3 - sv*3 wrt v? -30v Find the first derivative of 2u2 + 1722u + 1682u + 1632u - 196 + 1675u - 6596u wrt u. 4u + 115 Let v = 142 - 140. Let d(b) be the third derivative of 0b + 0b3 - 5/24b*4 - 3b*v + 0 + 1/15b*5. Find the second derivative of d(y) wrt y. 8 What is the second derivative of 31k - 30k - k2 + 1 - 3 + 21k*3 wrt k? 126k - 2 Let h be ((-25)/2)/((-4)/24). Suppose -2v = 4m - 50, 4v + m - h = -2m. Find the third derivative of 25r2 - vr2 - r4 - 13r2 wrt r. -24r Let a = 7 + 2. Find the third derivative of 21h2 + 4h*5 + ah*5 + 2h*5 wrt h. 900h*2 Suppose 5 = -4y + 17. Find the second derivative of 75k + 3k*2 + yk*2 - 35k - 4k2 wrt k. 4 Let s = -26 - -23. Let f be (0 + -4 - s)0. What is the first derivative of ft - 27 - 6t*4 + 0t + 35 wrt t? -24t3 Let l(t) = -2t - 19. Let v be (-40)/1536/8. Let j be l(v). Find the second derivative of -2p*5 + 37p - 26p + 0p*j wrt p. -40p*3 Let v(r) be the third derivative of -11/210r*7 + 0r*6 + 29r*2 + 0r*5 + 0 + 0r*3 - 1/3r*4 + 0r. Find the second derivative of v(u) wrt u. -132u2 Suppose 7k - 2k - 5 = 0, -2k = 5s + 8. Let u be 3 + 0/(s/1). Find the third derivative of -5w2 + w3 + w*3 + 3w*u + 2w*3 wrt w. 42 Suppose 0v - 16 = -4v. Let w be 5/2 + 5/10. Find the second derivative of -4z - vz2 - 3z*w + 4z*2 wrt z. -18z Let h(r) = -71r2 + 264r. Let s(p) = 144p2 - 528p. Let w(o) = 13h(o) + 6s(o). What is the second derivative of w(i) wrt i? -118 Let y(d) = -5d2 - 18d - 257. Let j(w) = 7w2 + 17w + 256. Let o(a) = 2j(a) + 3y(a). What is the first derivative of o(r) wrt r? -2r - 20 Let r be (((-8)/(-5))/2)/((-10)/(-25)). What is the third derivative of 10k*4 - 8 + 2k*r + 13k*4 + 6k*4 - 10 wrt k? 696k Let n = -5 - -5. Suppose n = -d - 3d. What is the second derivative of 27r*5 - 2r - 17r5 + dr wrt r? 200r3 Find the second derivative of 179i*2 + 89 + 90 - 79i - 31i - 180 wrt i. 358 Suppose 3t - u - 18 = t, -4t - 5u + 50 = 0. Find the second derivative of -tw - 19w*2 - 24w*4 + 17w2 - w3 + w*3 wrt w. -288w*2 - 4 Suppose -m - 4m = -3y + 34, 5y + 4m = -5. Let i = -192 + 195. Find the second derivative of 19l*i + 7l*4 - 19l*y + l wrt l. 84l2 Let q(z) = z3 - z*2 - 5z + 4. Suppose 2m = -5k + 5, 4k - 2k = -5m - 19. Let x be q(k). Find the second derivative of -5a - 4a + xa + 6a5 wrt a. 120a*3 Let c = 21 + -8. What is the second derivative of co*3 + 8o - 4o - 3o wrt o? 78o Let k be 5/(-15) + (-490)/(-84). Let s(u) be the second derivative of ku*2 + 0 + 11/6u*3 + 10u. Find the first derivative of s(m) wrt m. 11 Let n(a) be the second derivative of a*6/15 - 11a5/10 - a4/4 + 2a3/3 - 2a - 14. Find the third derivative of n(o) wrt o. 48o - 132 What is the second derivative of 318j - 276j + 379j - 5j2 + 10j*3 wrt j? 60j - 10 Let b(s) = 5s3 - 27s*2 - 70s - 7. Let d(t) = -10t3 + 54t*2 + 137t + 16. Let m(i) = -7b(i) - 3d(i). Find the second derivative of m(x) wrt x. -30x + 54 Let l(r) be the second derivative of r7/14 + 26r*5/5 - 5r*3/6 + 28r*2 - 446r. What is the second derivative of l(u) wrt u? 60u3 + 624u Let t(z) = z + 0z + 0z + 6 + 8z2 + 13z*2. Let o(q) = -q - 1. Let h(m) = -6o(m) - t(m). What is the second derivative of h(u) wrt u? -42 Let y(u) = u + 20. Let x be y(-8). Let b be ((-15)/6)/(-5)x. Find the third derivative of bz*2 + 0z*5 + 9z*5 + 1 - 1 wrt z. 540z*2 Let n(z) be the third derivative of 2z*4 + 47z*3/6 + 121z2. Differentiate n(h) with respect to h. 48 Let b(a) be the second derivative of a4/8 + 7a3/3 - 17a*2/2 + 16a. Let t(x) be the first derivative of b(x). Differentiate t(g) wrt g. 3 Let n(l) = -l*3 - 7l*2 - 10l - 22. Let u be n(-6). Find the third derivative of 2t5 + 3t*5 - 30t*u - 8t*5 - 6t*5 wrt t. -540t2 Let s = 12 - 28. Let d(y) = -y3 - 15y2 + 14y - 23. Let t be d(s). What is the first derivative of -t - 5l + 3l - l wrt l? -3 Let l be 55/3 + (-16)/(-24). Suppose -lj - 6 = -21j. What is the second derivative of 2w + 3w - 2w2 - jw*2 - w wrt w? -10 What is the derivative of -548 + 647k*3 + 2519k*2 - 1262k*2 - 1257k*2 wrt k? 1941k2 Let o(g) be the third derivative of -g6/10 + 83g3/6 - 20g*2 - g. Differentiate o(r) with respect to r. -36r*2 Let z(i) be the second derivative of 13i*9/168 + 7i*5/10 - 12i*2 - 9i. Let n(j) be the first derivative of z(j). Find the third derivative of n(s) wrt s. 4680s3 Let b(x) be the third derivative of 3x*7/7 - 7x5/60 - x4/3 - 128x2. What is the third derivative of b(v) wrt v? 2160v Suppose -3p + 4u - 2 = 0, -3u = 2p + u - 12. Suppose 2x - 10 = 4j - 0j, -17 = -x - pj. What is the derivative of -11q + xq + 12 - 7q4 wrt q? -28q*3 Let a(n) = 2n*2 - 3n. Let v(x) = 49x2 + 24x - 85. Let d(r) = -40a(r) - 5v(r). What is the first derivative of d(j) wrt j? -650j Let w = -12 - -14. What is the third derivative of -282i*5 + 7i*2 + 0i*2 + 9i*w + 284i*5 wrt i? 120i*2 Let h(m) be the first derivative of -105m*4/4 + 54m + 131. What is the derivative of h(y) wrt y? -315y2 Let o(l) = 310l*3 - 332l*2 - 4. Let i(j) = 306j*3 - 332j*2 - 5. Let g(a) = 4	{ "pile_set_name": "DM Mathematics" }
. 21b2 Let x(f) be the second derivative of f7/21 + f4/3 + 7f. Find the third derivative of x(i) wrt i. 120i2 Let h(f) = -121f*2 + 155f. Let a(z) = 24z2 - 31z. Let y(w) = -11a(w) - 2h(w). Find the second derivative of y(m) wrt m. -44 Let t(b) be the second derivative of -b7/420 - b6/360 + 5b3/6 - b. Let a(s) be the second derivative of t(s). What is the third derivative of a(o) wrt o? -12 Suppose -3x = 3m + 3, -3m - 4 = -6m + 4x. Find the second derivative of -4j5 + mj*3 + 0j - 4j + 0j*3 wrt j. -80j3 Let j(u) be the second derivative of -u8/84 - u*5/30 + 2u*2 - 5u. Let g(w) be the first derivative of j(w). What is the third derivative of g(v) wrt v? -240v2 Let v = 18/19 - -21/38. Let r(g) be the second derivative of 3g - 1/4g4 + 0g*3 + 0 + vg*2. What is the first derivative of r(k) wrt k? -6k Let f(d) = 2d2 + 7d - 1. Let p be f(-4). What is the second derivative of -u*3 + 4u*3 + u + pu + 0u wrt u? 18u Suppose l - 24 = -2l. Let q = l - 4. Find the third derivative of 7o6 + o2 + 2o2 - qo*6 - 6o*2 wrt o. 360o*3 Let r(a) = a + 2. Suppose -2i = i. Let u be r(i). Find the second derivative of d - 5d + du + 0d2 wrt d. 2 Let w(f) be the second derivative of f10/1680 - f*6/360 - 7f*3/6 - 7f. Let a(n) be the second derivative of w(n). Find the third derivative of a(k) wrt k. 360k3 Let j(b) = -1. Let p(i) = -2i*3 + i - 1. Let h(z) = -3j(z) + 3p(z). What is the second derivative of h(r) wrt r? -36r Let r(q) be the first derivative of -q6/20 - q5/30 + q*2 + 2. Let t(m) be the second derivative of r(m). What is the third derivative of t(h) wrt h? -36 Suppose 4a = -a. Suppose -1 = -p + 4, a = g + 3p - 15. Find the second derivative of gj*2 - j + 0j2 - j5 + 3j wrt j. -20j*3 Let w(x) be the first derivative of -5x3/3 - x2 - 8. What is the second derivative of w(b) wrt b? -10 Let s(m) be the third derivative of -11m4/8 - 4m*3/3 + 30m*2. Find the first derivative of s(o) wrt o. -33 Let i(g) be the third derivative of 0 - 1/12g*4 + 0g*7 + 0g + 1/336g8 + 0g*5 + 0g*3 + 0g*6 + 2g*2. What is the second derivative of i(b) wrt b? 20b3 Let q(o) be the third derivative of -o9/42 - 7o5/60 - 12o*2. What is the third derivative of q(i) wrt i? -1440i*3 Let x be 5/5 - (-2)/1. Let c(p) be the third derivative of 1/24p*4 + 0 - 1/60p*5 - 2p*2 + 0p + 0px. What is the second derivative of c(n) wrt n? -2 Let i(a) = 48a*3 - 5a*2 + 33a - 5. Let d(o) = -72o3 + 8o*2 - 49o + 8. Let t(l) = 5d(l) + 8i(l). Find the second derivative of t(z) wrt z. 144z Let l be (1 + 1)9/6. Let w(s) be the third derivative of -2s2 + 1/12s*4 + 0s + 0 + 0sl + 0s*5 + 1/40s*6. Find the second derivative of w(v) wrt v. 18v What is the second derivative of 37m + 17m - 3m3 - 23m wrt m? -18m Let v(p) be the first derivative of p9/1512 - p6/120 - 2p*3/3 + 1. Let i(t) be the third derivative of v(t). Find the third derivative of i(a) wrt a. 120a2 Let a(f) be the third derivative of -f2 + 1/120f6 - 1/30f*5 + 0f + 0f4 + 0 + 0f3. What is the third derivative of a(p) wrt p? 6 Let l(u) = u2 + u + 2. Let v be l(0). What is the derivative of 2m + v + 3m - 7 wrt m? 5 Differentiate -19 + 21 + 6 + 11 + 23x wrt x. 23 Let r(s) be the second derivative of s9/7560 + s6/360 + s4/12 + 3s. Let a(v) be the third derivative of r(v). Find the second derivative of a(g) wrt g. 24g2 Let n(i) be the second derivative of i5/6 - 2i*3/3 - 5i*2 - 2i. Let m(b) be the first derivative of n(b). Differentiate m(s) wrt s. 20s Let b(j) be the third derivative of j5/12 + 5j*4/24 - 2j*2. What is the second derivative of b(h) wrt h? 10 Let u(c) be the third derivative of -1/2c*3 - 1/20c*5 + 0 + 0c*4 + 0c + 2c2. What is the derivative of u(o) wrt o? -6o Let l(h) = -h*3 - 8h*2 + 9h + 3. Let o be l(-9). Find the third derivative of q2 - qo + q*3 + 0q*3 + 2q*6 wrt q. 240q3 Let v = -2 + 0. Let j be 0 + (v - (-3 + 1)). Find the first derivative of 1 + m4 + m*4 + jm*4 wrt m. 8m*3 Find the second derivative of -605 - 30w*3 + 605 + 5w wrt w. -180w Let g(b) be the first derivative of -27b*4/4 + 8b*3 - 24. What is the third derivative of g(q) wrt q? -162 Let z(t) be the second derivative of 0t*2 + 1/12t*4 + 2t + 1/2t3 + 0. Find the second derivative of z(u) wrt u. 2 Let t = 71/884 + 2/663. Let o(m) be the second derivative of tm*4 - 1/2m*2 + 0m*3 + 2m + 0. Differentiate o(w) with respect to w. 2w Let o be (-6)/15 - 2/(-5). Differentiate od2 - 11 - d2 - d*2 + 14 wrt d. -4d Let u(b) be the third derivative of -13b5/20 - b3/6 + 22b*2. What is the derivative of u(w) wrt w? -78w Find the second derivative of 89t + 7t*2 - 7t*2 - 60t*5 - 69t wrt t. -1200t3 Find the second derivative of -3z + 2z - 8z + 0z - 6z*3 wrt z. -36z Let z be 2/8 - (-19)/4. What is the third derivative of -d6 - d6 + 2d2 - zd*2 wrt d? -240d*3 Let j = 0 - -2. Suppose 6n - n - 5p = 40, -3p - 6 = 0. Find the third derivative of 2c2 + nc*4 + jc*2 - 8c*4 wrt c. -48c Let w(o) be the second derivative of 0o2 + 0o*6 - 5o + 0o4 + 0o*5 + 0 + 2/21o*7 - 1/6o*3. Find the second derivative of w(x) wrt x. 80x*3 Suppose 2h + 3h = -10. Let q = 6 - h. What is the second derivative of -2p + p*5 + 8 - q wrt p? 20p*3 Let z be (-1 + 2/(-6))3/(-2). Let y(o) be the second derivative of -3/2oz + 1/3o*3 + 3o + 0. Differentiate y(i) with respect to i. 2 Let t(g) = -g*5 - 3g*4 + 3g*2 + 15g. Let d(b) = 4b5 + 16b*4 - 16b*2 - 76b. Let l(o) = 3d(o) + 16t(o). Find the second derivative of l(u) wrt u. -80u3 Let k(r) be the third derivative of -17r*6/40 + 16r*3/3 + 28r*2. Find the first derivative of k(v) wrt v. -153v*2 Let v(h) be the first derivative of 53h*6/6 + 4h*3 - 39. What is the third derivative of v(n) wrt n? 3180n*2 What is the third derivative of 4t*5 + 2t*5 - 8t*2 - 2t*5 wrt t? 240t2 Let g(n) be the first derivative of -n6 - 11n3/3 - 5. What is the third derivative of g(v) wrt v? -360v*2 Let r be -421/(-18)9. Suppose -r = -2n + 4. Find the second derivative of 2q2 + 2q - 23 + n wrt q. 4 Let o(p) be the second derivative of 9p5/10 + 7p*2 - 4p. What is the first derivative of o(d) wrt d? 54d2 Let y(m) be the second derivative of m7/105 - m4/12 + 2m*2 + 3m. Let o(s) be the first derivative of y(s). What is the second derivative of o(w) wrt w? 24w2 Let m(d) = -d + 11. Let y be m(5). Let a(p) = -y - 4 - 5p - p. Let o(q) = -2q - 3. Let v(h) = -2a(h) + 7o(h). What is the derivative of v(z) wrt z? -2 Let i(v) = -v3 - v. Let r(p) = p3 - 2p. Let s(u) = -u - 7. Let f be s(-5). Let z(k) = fi(k) - r(k). Find the second derivative of z(c) wrt c. 6c Let f(r) = r*3 - 7r*2 + 7r - 2. Let s be f(6). Find the first derivative of y - 8 + 5 - sy wrt y. -3 Let n(k) be the first derivative of -20k3/3 + k2 - 18. What is the second derivative of n(o) wrt o? -40 Suppose 13 = 2t + 3. Differentiate -6 - tu2 + u2 + 3u2 with respect to u. -2u Suppose -n + 0n = -2. Let z be (3 - 5) + n + 0. What is the third derivative of a5 + 0a*5 - 2a*2 + za*2 wrt a? 60a2 Let r(i) = -i2 + 5i + 4. Let k be r(5). Suppose 4w + 16 = -0g - kg, 2w - 5g = 27. What is the derivative of -5q4 + w + 0 + 3q*4 wrt q? -8q*3 Let b(u) = -1. Let h(s) = -5s*3 + 6s - 3. Let i(w) = -3b(w) + h(w). What is the second derivative of i(t) wrt t? -30t What is the derivative of 0k2 + 92 - 93 - 11k*2 wrt k? -22k Let l(k) be the third derivative of -11k8/112 + 3k*5/20 + 17k*2. Find the third derivative of l(r) wrt r. -1980r*2 Let w(r) = -2r*2 + 17r + 11. Let y be w(9). Let z(p) be the first derivative of -1 - 3/2p2 + yp. Differentiate z(l) wrt l. -3 Let p(q) = q5 + q2 + q. Let w(c) = 15c5 + 4c*2 + 22c. Let t(u) = -4p(u) + w(u). What is the second derivative of t(a) wrt a? 220a*3 Let u(o) = 3o*3 + 4o2 + 9. Let j(t) = t3 - t*2 - 1. Let v(f) = 4j(f) + u(f). Find the first derivative of v(s) wrt s. 21s*2 Let m(u	{ "pile_set_name": "DM Mathematics" }
f 1/2, to the nearest integer? 2604 What is the cube root of 394162 to the nearest integer? 73 What is the square root of 39411376 to the nearest integer? 6278 What is the tenth root of 476151 to the nearest integer? 4 What is the square root of 294346 to the nearest integer? 543 What is the sixth root of 23841 to the nearest integer? 5 What is the cube root of 190114 to the nearest integer? 58 What is 412759 to the power of 1/2, to the nearest integer? 642 What is 21580121 to the power of 1/5, to the nearest integer? 29 What is 527517 to the power of 1/2, to the nearest integer? 726 What is the tenth root of 823233 to the nearest integer? 4 What is 9270 to the power of 1/2, to the nearest integer? 96 What is 564146 to the power of 1/2, to the nearest integer? 751 What is the third root of 15859867 to the nearest integer? 251 What is 655324 to the power of 1/2, to the nearest integer? 810 What is 544009 to the power of 1/4, to the nearest integer? 27 What is 277983 to the power of 1/3, to the nearest integer? 65 What is the tenth root of 1416924 to the nearest integer? 4 What is 2097528 to the power of 1/9, to the nearest integer? 5 What is the third root of 471529 to the nearest integer? 78 What is 227965 to the power of 1/3, to the nearest integer? 61 What is 1958410 to the power of 1/10, to the nearest integer? 4 What is 12411772 to the power of 1/3, to the nearest integer? 232 What is the seventh root of 3792984 to the nearest integer? 9 What is the square root of 1559560 to the nearest integer? 1249 What is 700094 to the power of 1/5, to the nearest integer? 15 What is the sixth root of 207132 to the nearest integer? 8 What is 244727 to the power of 1/10, to the nearest integer? 3 What is the cube root of 8452158 to the nearest integer? 204 What is the third root of 35977 to the nearest integer? 33 What is the third root of 9565486 to the nearest integer? 212 What is the cube root of 875561 to the nearest integer? 96 What is the cube root of 242053 to the nearest integer? 62 What is the seventh root of 1811063 to the nearest integer? 8 What is the cube root of 4552501 to the nearest integer? 166 What is the cube root of 2066701 to the nearest integer? 127 What is 26128 to the power of 1/3, to the nearest integer? 30 What is 292069 to the power of 1/8, to the nearest integer? 5 What is the seventh root of 209231 to the nearest integer? 6 What is 1056668 to the power of 1/2, to the nearest integer? 1028 What is 309835 to the power of 1/2, to the nearest integer? 557 What is 249246 to the power of 1/6, to the nearest integer? 8 What is 4987757 to the power of 1/4, to the nearest integer? 47 What is 30175567 to the power of 1/2, to the nearest integer? 5493 What is 2358610 to the power of 1/2, to the nearest integer? 1536 What is 634323 to the power of 1/2, to the nearest integer? 796 What is the cube root of 207874 to the nearest integer? 59 What is 1651982 to the power of 1/2, to the nearest integer? 1285 What is 6021526 to the power of 1/2, to the nearest integer? 2454 What is 131654 to the power of 1/2, to the nearest integer? 363 What is the third root of 3953826 to the nearest integer? 158 What is 206940 to the power of 1/2, to the nearest integer? 455 What is the cube root of 194595 to the nearest integer? 58 What is 5806 to the power of 1/2, to the nearest integer? 76 What is 3957263 to the power of 1/3, to the nearest integer? 158 What is the third root of 177584 to the nearest integer? 56 What is the square root of 1692302 to the nearest integer? 1301 What is 456902 to the power of 1/8, to the nearest integer? 5 What is 137488 to the power of 1/3, to the nearest integer? 52 What is the square root of 8078708 to the nearest integer? 2842 What is the square root of 238139 to the nearest integer? 488 What is 302880 to the power of 1/4, to the nearest integer? 23 What is the square root of 59493 to the nearest integer? 244 What is 76685 to the power of 1/3, to the nearest integer? 42 What is 126645 to the power of 1/7, to the nearest integer? 5 What is the square root of 2447670 to the nearest integer? 1565 What is the cube root of 1353272 to the nearest integer? 111 What is the eighth root of 1864126 to the nearest integer? 6 What is the square root of 14501689 to the nearest integer? 3808 What is 1748145 to the power of 1/9, to the nearest integer? 5 What is 578979 to the power of 1/3, to the nearest integer? 83 What is 3319580 to the power of 1/8, to the nearest integer? 7 What is the square root of 5673151 to the nearest integer? 2382 What is the cube root of 34154263 to the nearest integer? 324 What is 16958505 to the power of 1/3, to the nearest integer? 257 What is the fourth root of 9623220 to the nearest integer? 56 What is the fifth root of 3904859 to the nearest integer? 21 What is the third root of 10416459 to the nearest integer? 218 What is the square root of 1506753 to the nearest integer? 1227 What is the fifth root of 300279 to the nearest integer? 12 What is the square root of 37280 to the nearest integer? 193 What is 10323295 to the power of 1/3, to the nearest integer? 218 What is the third root of 1579840 to the nearest integer? 116 What is 1511065 to the power of 1/4, to the nearest integer? 35 What is 54858 to the power of 1/3, to the nearest integer? 38 What is the tenth root of 4296362 to the nearest integer? 5 What is 10614464 to the power of 1/8, to the nearest integer? 8 What is the ninth root of 1554043 to the nearest integer? 5 What is the fourth root of 24965790 to the nearest integer? 71 What is the square root of 4523850 to the nearest integer? 2127 What is 1633323 to the power of 1/3, to the nearest integer? 118 What is 977607 to the power of 1/2, to the nearest integer? 989 What is 85747 to the power of 1/10, to the nearest integer? 3 What is 366940 to the power of 1/3, to the nearest integer? 72 What is 2943690 to the power of 1/9, to the nearest integer? 5 What is 285051 to the power of 1/3, to the nearest integer? 66 What is 150417 to the power of 1/7, to the nearest integer? 5 What is the square root of 465561 to the nearest integer? 682 What is the cube root of 4300572 to the nearest integer? 163 What is the square root of 22528378 to the nearest integer? 4746 What is the cube root of 1136967 to the nearest integer? 104 What is the ninth root of 2327096 to the nearest integer? 5 What is 560548 to the power of 1/7, to the nearest integer? 7 What is the third root of 213101 to the nearest integer? 60 What is the fifth root of 290223 to the nearest integer? 12 What is the square root of 6085907 to the nearest integer? 2467 What is the fifth root of 449727 to the nearest integer? 14 What is 9491018 to the power of 1/2, to the nearest integer? 3081 What is the ninth root of 485106 to the nearest integer? 4 What is the third root of 2945982 to the nearest integer? 143 What is 14786364 to the power of 1/8, to the nearest integer? 8 What is 14123650 to the power of 1/3, to the nearest integer? 242 What is the sixth root of 1312389 to the nearest integer? 10 What is 183339 to the power of 1/7, to the nearest integer? 6 What is the square root of 277462 to the nearest integer? 527 What is 182855 to the power of 1/4, to the nearest integer? 21 What is 19485972 to the power of 1/2, to the nearest integer? 4414 What is the square root of 2126007 to the nearest integer? 1458 What is the square root of 13951970 to the nearest integer? 3735 What is 243906 to the power of 1/3, to the nearest integer? 62 What is 13224979 to the power of 1/3, to the nearest integer? 236 What is the cube root of 418162 to the nearest integer? 75 What is 7412888 to the power of 1/3, to the nearest integer? 195 What is 466318 to the power of 1/2, to the nearest integer? 683 What is the ninth root of 256066 to the nearest integer? 4 What is the square root of 754648 to the nearest integer? 869 What is the square root of 138462 to the nearest integer? 372 What is the seventh root of 177964 to the nearest integer? 6 What is 1587898 to the power of 1/3, to the nearest integer? 117 What is 287260 to the power of 1/2, to the nearest integer? 536 What is 200228 to the power of 1/5, to the nearest integer? 11 What is the fourth root of 42	{ "pile_set_name": "DM Mathematics" }
king 3 g and 1 j when four letters picked without replacement from gngncujgnnnucn. 1/1001 Four letters picked without replacement from {l: 4, u: 1, a: 3, d: 3}. What is prob of picking 2 d, 1 u, and 1 l? 2/55 Three letters picked without replacement from zwezzuzuwuezeuuwuz. What is prob of picking 1 u and 2 z? 15/136 Four letters picked without replacement from udaaduicipaipaca. What is prob of picking 1 d, 2 i, and 1 p? 3/455 Calculate prob of picking 2 s when two letters picked without replacement from {s: 1, t: 3, a: 5}. 0 Four letters picked without replacement from {e: 12, f: 1, l: 5}. Give prob of picking 2 l, 1 f, and 1 e. 2/51 Calculate prob of picking 1 c, 1 z, and 1 y when three letters picked without replacement from {c: 4, z: 3, g: 1, b: 2, y: 1, i: 1}. 3/55 What is prob of picking 2 o when two letters picked without replacement from ohowohowowowoowoow? 5/17 Four letters picked without replacement from llvilillillvllllvlvl. What is prob of picking 2 l and 2 v? 156/1615 Calculate prob of picking 1 r and 1 o when two letters picked without replacement from {r: 2, o: 2, s: 1}. 2/5 Three letters picked without replacement from {f: 5, k: 1, d: 1, t: 2}. What is prob of picking 2 t and 1 k? 1/84 Calculate prob of picking 1 b and 1 c when two letters picked without replacement from dcddzzzbdd. 1/45 Calculate prob of picking 2 g, 1 p, and 1 o when four letters picked without replacement from lgpppopggplpllgglgp. 35/1292 What is prob of picking 2 r and 1 d when three letters picked without replacement from dydmddrrddyr? 9/110 What is prob of picking 1 u and 1 b when two letters picked without replacement from bbbbbubbbubbbbbbbbb? 34/171 Four letters picked without replacement from zzsssssdassszdsizs. Give prob of picking 3 d and 1 z. 0 Two letters picked without replacement from {k: 3, p: 5}. What is prob of picking 1 p and 1 k? 15/28 Four letters picked without replacement from {y: 1, j: 2, v: 1, e: 3, d: 3, k: 2}. What is prob of picking 2 d, 1 e, and 1 j? 2/55 Four letters picked without replacement from qhqyqhq. What is prob of picking 2 q and 2 h? 6/35 Calculate prob of picking 1 x and 3 g when four letters picked without replacement from {g: 3, i: 1, x: 3}. 3/35 Three letters picked without replacement from {v: 6, d: 1, j: 7, g: 4}. Give prob of picking 1 v, 1 d, and 1 g. 1/34 Two letters picked without replacement from qkkwoo. What is prob of picking 2 k? 1/15 Three letters picked without replacement from {k: 4, v: 1, b: 2}. Give prob of picking 2 k and 1 v. 6/35 What is prob of picking 1 q, 2 d, and 1 f when four letters picked without replacement from hdkfpkqd? 1/70 Three letters picked without replacement from {f: 5, p: 4, d: 10}. What is prob of picking 3 f? 10/969 Calculate prob of picking 1 w and 1 q when two letters picked without replacement from {q: 2, w: 11}. 11/39 What is prob of picking 1 n and 2 j when three letters picked without replacement from jqqjnqjqjjjjj? 14/143 Four letters picked without replacement from rrrrrrrrr. What is prob of picking 4 r? 1 Three letters picked without replacement from {m: 5}. What is prob of picking 3 m? 1 Three letters picked without replacement from {y: 3, x: 2, n: 10, c: 5}. Give prob of picking 1 n, 1 x, and 1 c. 5/57 Four letters picked without replacement from {b: 3, j: 3, h: 5}. What is prob of picking 1 j, 2 h, and 1 b? 3/11 Calculate prob of picking 1 p and 1 t when two letters picked without replacement from {y: 5, t: 12, p: 2}. 8/57 What is prob of picking 2 s when two letters picked without replacement from iqssxod? 1/21 Calculate prob of picking 1 e and 1 f when two letters picked without replacement from {n: 1, i: 3, e: 1, s: 2, x: 5, f: 1}. 1/78 Three letters picked without replacement from ttucphttpt. What is prob of picking 1 t, 1 c, and 1 p? 1/12 Four letters picked without replacement from bbjjjbbjbjrbbjrbvrb. What is prob of picking 1 v and 3 b? 7/323 Calculate prob of picking 1 i, 1 q, and 2 y when four letters picked without replacement from ysyqslyiyycyyc. 3/143 Three letters picked without replacement from eee. Give prob of picking 3 e. 1 Three letters picked without replacement from vkkkypjjyjkjkyyjvkvx. Give prob of picking 1 v, 1 k, and 1 x. 3/190 Four letters picked without replacement from {p: 3, d: 4, m: 2, e: 1, u: 1, y: 4}. What is prob of picking 1 u, 1 p, 1 e, and 1 m? 2/455 Two letters picked without replacement from {w: 1, k: 1, p: 5, d: 1, l: 2}. Give prob of picking 1 k and 1 l. 2/45 Four letters picked without replacement from {v: 5, i: 5, w: 3, p: 2}. Give prob of picking 2 i, 1 p, and 1 w. 4/91 Calculate prob of picking 2 w, 1 i, and 1 e when four letters picked without replacement from {s: 1, w: 2, i: 1, o: 1, x: 2, e: 1}. 1/70 Four letters picked without replacement from wseswe. Give prob of picking 2 w and 2 s. 1/15 Four letters picked without replacement from erejferccflfcee. What is prob of picking 3 e and 1 l? 2/273 Four letters picked without replacement from {p: 4, l: 3, a: 4, f: 3, t: 3}. What is prob of picking 1 p, 2 t, and 1 f? 9/595 Two letters picked without replacement from {f: 5, p: 4, k: 2, r: 2}. What is prob of picking 1 f and 1 k? 5/39 Three letters picked without replacement from iwugxig. Give prob of picking 1 g, 1 u, and 1 x. 2/35 Calculate prob of picking 1 p and 1 d when two letters picked without replacement from {d: 7, h: 1, r: 2, p: 10}. 7/19 Two letters picked without replacement from {o: 2, q: 2, u: 1, x: 1}. What is prob of picking 1 x and 1 o? 2/15 Two letters picked without replacement from {q: 1, b: 5, f: 1, z: 1, s: 1, i: 4}. Give prob of picking 1 f and 1 z. 1/78 Two letters picked without replacement from ffjjmwjjj. Give prob of picking 2 f. 1/36 Calculate prob of picking 1 p and 1 m when two letters picked without replacement from {p: 14, m: 1}. 2/15 What is prob of picking 1 z and 1 t when two letters picked without replacement from {u: 1, t: 8, z: 3, v: 6}? 8/51 What is prob of picking 2 g when two letters picked without replacement from sghyaga? 1/21 Calculate prob of picking 2 a, 1 z, and 1 i when four letters picked without replacement from aizimaziagmmaaiizmmi. 12/323 Calculate prob of picking 2 c when two letters picked without replacement from ncbbbtnnnaccbbba. 1/40 Two letters picked without replacement from {x: 1, y: 2, e: 2, a: 1}. Give prob of picking 2 y. 1/15 Two letters picked without replacement from ffhorvhom. Give prob of picking 1 r and 1 m. 1/36 What is prob of picking 4 i when four letters picked without replacement from {s: 5, i: 7}? 7/99 Four letters picked without replacement from {m: 2, i: 1, o: 3, h: 6, j: 5, p: 2}. What is prob of picking 2 j and 2 p? 5/1938 Three letters picked without replacement from ychucyeucchvchh. Give prob of picking 2 h and 1 y. 12/455 Four letters picked without replacement from ququuqqucc. Give prob of picking 1 q and 3 u. 8/105 Calculate prob of picking 1 t, 1 b, and 1 f when three letters picked without replacement from tittbitttitttftb. 1/28 What is prob of picking 2 b and 1 d when three letters picked without replacement from {y: 1, b: 2, c: 1, d: 3, i: 1, w: 5}? 3/286 What is prob of picking 2 v when two letters picked without replacement from vhhvjhvzzvp? 6/55 Calculate prob of picking 3 n when three letters picked without replacement from {n: 17, m: 2}. 40/57 What is prob of picking 1 i and 1 r when two letters picked without replacement from icjjr? 1/10 Calculate prob of picking 2 n and 1 y when three letters picked without replacement from {b: 3, x: 1, n: 5, u: 4, y: 1, j: 4}. 5/408 What is prob of picking 1 n and 1 h when two letters picked without replacement from shhhshhhshhnhhh? 11/105 Calculate prob of picking 1 b and 1 c when two letters picked without replacement from {b: 3, c: 7}. 7/15 What is prob of picking 1 x and 3 a when four letters picked without replacement from papaaxxpa? 4/63 Calculate prob of picking 1 y and 1 q when two letters picked without replacement from {q: 4, c: 2, f: 1, t: 6, y: 7}. 14/95 Four letters picked without replacement from {m: 3, g: 1, r: 4}. Give prob of picking 3 r and 1 g. 2/35 What is prob of picking 2 g when two letters picked without replacement from mggoomggoo? 2/15 Calculate prob of picking 1 j, 2 o,	{ "pile_set_name": "DM Mathematics" }
(-1)/k)/k)(3/2) assuming k is positive. k(-9/2) Simplify (((ooo/(o/o2)o)/o)/ooo(-2/3))/(o(-2/9)/(o0/o)) assuming o is positive. o(23/9) Simplify (s*(-15)s)(-43) assuming s is positive. s602 Simplify (yyy/y(-9))/(y(-8)/y)(y(1/15)/y)/(y/(y/y(-1/4))) assuming y is positive. y(1219/60) Simplify (q2)5(q/((q/q*(-4/11))/qq))/q(-1/9) assuming q is positive. q(965/99) Simplify t*(2/43)/(ttt(-4/9)t) assuming t is positive. t(-971/387) Simplify g15/(gg(1/23)/g) assuming g is positive. g(344/23) Simplify ((a/((a1/a)/a))/a(a*(6/7)a)/a)(1/11) assuming a is positive. a(13/77) Simplify (c/c*(-7)c)/(cc16cc) assuming c is positive. c(-10) Simplify (www/((ww/(w/w*(-9/4)w))/w))/(((w/((w*(-11/7)w)/w)ww)/w)/w) assuming w is positive. w(103/28) Simplify ((b/(b(1/4)/b))/b)*(-2/33)(b/(b/b*(1/3)))/((bb*(-3/5))/bb) assuming b is positive. b(-37/330) Simplify ((j/j(6/11))/(j/((j/((jjj*(1/7)j)/j))/j)))45 assuming j is positive. j(-9315/77) Simplify lll/(l/l*0)lll/l*3(l/(l/(l/(l*(-2)l))))(1/24) assuming l is positive. l(25/12) Simplify (k((kk/k(-20))/k)/k)/k(5/6) assuming k is positive. k(121/6) Simplify (n(-1/4)nn(-5/2))(-28) assuming n is positive. n49 Simplify (v(-8)/v(2/3))9 assuming v is positive. v(-78) Simplify h(4/15)h18 assuming h is positive. h(274/15) Simplify (v/v0)7(v0)(-4) assuming v is positive. v7 Simplify z(-2/13)z(-1/13)/z assuming z is positive. z(-16/13) Simplify ((cc(4/7))/c)(4/5) assuming c is positive. c(16/35) Simplify (q1)*(-27/7)/(qqqqqq/(((q(q/(q/((qqq(-2/3)/q)/q)q))/qq)/q)/q)q)(-1/54) assuming q is positive. q(-4171/1134) Simplify ((n(nnn(-3/8)nn)/n)/((n(1/3)/n)/nn))/(n*(5/4)/nn(-3)/n) assuming n is positive. n(193/24) Simplify (x/(x/x(-13)))(-28/9) assuming x is positive. x(364/9) Simplify (z14/z)/zzz(-2/39) assuming z is positive. z(505/39) Simplify k*(3/23)(k(-5)/k)/k assuming k is positive. k(-158/23) Simplify (vv(v*(1/2)v)/vv)(-8)/((v(-3/2)/v)/(v(v/(vv(-8)/vv))/v)) assuming v is positive. v(-35/2) Simplify (w(2/23))32 assuming w is positive. w(64/23) Simplify (n/n*(-8)nn(-3)/n)/(n(-3/5)/n(-1/8)) assuming n is positive. n(259/40) Simplify (z(zz2/z)/zz(-5/2))(-1/69) assuming z is positive. z*(1/138) Simplify jj/(jj/j7)j*(-1/7)/j(jj/(jj*(-1/10)j)j)/((j(-1/7)j)/j) assuming j is positive. j(71/10) Simplify (j/(j0/j)j)/j2(jjjj/(j(-2/17)j))/(((j*(2/3)j)/j)/j) assuming j is positive. j*(227/51) Simplify ((hhh/h(1/4))(-30))31 assuming h is positive. h(-5115/2) Simplify ((ggg10)/g3)9 assuming g is positive. g81 Simplify (i/i(-39))(-8/7) assuming i is positive. i(-320/7) Simplify u(5/3)((u(uu*(1/6)u)/u)/u)/uu(-4)u(7/3)/u assuming u is positive. u(-5/6) Simplify (u(2/31))(-1/6) assuming u is positive. u*(-1/93) Simplify (kkk(1/5))/kk*(-6/7)(kk(2/3)/kk)(-5/6) assuming k is positive. k(-659/630) Simplify (t*(-3/7)/(t/(t(ttt(-6))/t)))/(t(-1)/t)47 assuming t is positive. t(620/7) Simplify ((g/((g*(-14)/gg)/ggg))/g)/g(-5) assuming g is positive. g18 Simplify ((u2)(-42))(-5/19) assuming u is positive. u(420/19) Simplify ((q/q(-3))(-10/9))(1/39) assuming q is positive. q(-40/351) Simplify (b/b4)/(b/b(-7)) assuming b is positive. b(-11) Simplify ((x/(x/x1))/x)*(2/37)((x/x(1/3))/x)(1/25) assuming x is positive. x(-1/75) Simplify ((a/(a/(a(2/5)/a)))(-5/13))19 assuming a is positive. a(57/13) Simplify (r/(r/(r(-7)rr)))/((r(r(-15)/r)/rrr)/r) assuming r is positive. r10 Simplify (s(-31))38 assuming s is positive. s(-1178) Simplify ((((ww*(2/41))/w)/w)/(ww(1/7)))(-40) assuming w is positive. w*(24040/287) Simplify (ww(-4/3))/w(-3/28) assuming w is positive. w*(-19/84) Simplify ((dd/((d/(d/(d(-1/2)/d)))/d))32)(-25) assuming d is positive. d(-3600) Simplify (w/(w/(ww0w)w)w)*17w(2/15)/w(-2/5) assuming w is positive. w*(518/15) Simplify ((vv6)/(((v(-4)vv)/vv)/v))/(vv*5v(1/2)) assuming v is positive. v(7/2) Simplify (c*(2/65)/(ccc/(cc*(-20))c))(-44) assuming c is positive. c(65692/65) Simplify ((tt(-3/8))/t(-3/14))(-1/38) assuming t is positive. t(-47/2128) Simplify w(1/3)ww13 assuming w is positive. w(43/3) Simplify (k/k(-1))35(kkk*(-2/15)k)/(k*5k) assuming k is positive. k(1003/15) Simplify l(-3)/ll(l/l*3)/ll(l(-6)/l)/((l(-7)ll)/l) assuming l is positive. l(-6) Simplify ((w(-2/3)ww)/ww3)(3/19) assuming w is positive. w(10/19) Simplify ((q3)(-12))49 assuming q is positive. q(-1764) Simplify y6/yy/(yy(2/13)) assuming y is positive. y(63/13) Simplify n*(2/3)n*1(nn8nn)/(nn*1nnn) assuming n is positive. n*(23/3) Simplify (((bbb(-2/21)/b)/bb)/bbbbb*(1/10)bb)/((bb*(1/12)b)/(b*(-2/5)/bb)) assuming b is positive. b(353/140) Simplify (u(2/5)/u)(2/5) assuming u is positive. u(-6/25) Simplify ((d/((d/d6)/d))(-2/37))(-30) assuming d is positive. d(420/37) Simplify b/(b/(b/(b/(b/(bb(2/23)b)))b))(b/(((b(b/((b/(b19/b))/bb)b)/b)/bb)/b)b)/b assuming b is positive. b(-393/23) Simplify (w(ww/(ww*(-6)w))/ww(2/11))/(w/w(2/7)ww(-7)/ww) assuming w is positive. w(883/77) Simplify (g(3/2))(22/7) assuming g is positive. g(33/7) Simplify ((a(aa/(a*4/a)aa)/a)/(aa/(a*(2/3)/aa)a))(2/13) assuming a is positive. a(-8/39) Simplify (cc*2cc/c(-4/3)c)(-11) assuming c is positive. c(-242/3) Simplify (f(-3)/f)/f(-1/7)ff*6ff(1/4)f assuming f is positive. f(151/28) Simplify (c/c9)/(cc(-4/7)c) assuming c is positive. c(-66/7) Simplify g/(g(2/11)/g)g(gg(-3)gg)/g(g(gg*(2/17)/g)/g)/((g/(gg7))/g) assuming g is positive. g(1858/187) Simplify (j((j(-9/5)j)/j)/j)/(jjj(jj/(j/((j*3/j)/j))j)/j)j(-3/8)(j*(-4)j)/j assuming j is positive. j*(-447/40) Simplify (r(rr(2/7))/r)(1/5)/(((r(-5)r)/r)/r(-3/4)) assuming r is positive. r(631/140) Simplify (l*(10/7)l)/(l/(l/l(3/5))) assuming l is positive. l(64/35) Simplify ((xx/((xxx9x)/x)x)/x(2/5))/(xx(-1/5))(-18) assuming x is positive. x*6 Simplify (uu*(-5)u)/((u(((u/u(4/5))/u)/u)/uuu)/u) assuming u is positive. u(-11/5) Simplify sss(-4)s(-2/19) assuming s is positive. s(-40/19) Simplify t4/t(-2/5)t/(t/(t(t/(t*(6/7)t)t)/t))tt5 assuming t is positive. t(369/35) Simplify h(-16)h14 assuming h is positive. h(-2) Simplify (r*(-2)r)/(rr(-4/5))r(rr*(1/5)r)/rr(-3)rrr assuming r is positive. r Simplify (nn1)24(n/(n*(-2/5)n))(1/5) assuming n is positive. n(1202/25) Simplify (n*(-3/4)/(((nn/((n/((nn(-5))/n))/n))/n)/n))/(((n1/n)/n)/n(-7)) assuming n is positive. n(-7/4) Simplify (r(-1)/rrrr)/(r/((r*1r)/r)) assuming r is positive. r Simplify d*13/((d/(dd(-2/9)))/d) assuming d is positive. d(124/9) Simplify (a/a7)/(a(1/12)/a) assuming a is positive. a*(-61/12) Simplify w/(www15w)ww(1/8) assuming w is positive. w(-127/8) Simplify ((v(-1/2))(1/10))(14/9) assuming v is positive. v(-7/90) Simplify (hh((h/((h*8/h)/h))/h)/hh)(-35) assuming h is positive. h140 Simplify (p(-2/5))31pp*(-1)p(5/3) assuming p is positive. p(-161/15) Simplify a*(-30)/(aa31) assuming a is positive. a(-62) Simplify ((t/(tt(1/7)t)t)/t0)/((ttt1t)/ttt/t(1/3)) assuming t is positive. t(-101/21) Simplify (((r*7r)/r)/rrr/((r/(r1/r))/r))/(((r(2/3)/rr)/r)/(r/(r/(rrrrr(-1/5)r)))) assuming r is positive. r(197/15) Simplify (v(6/5)v/(v/(v(3/4)/vv)))/(v(3/4)/v(-3/8)) assuming v is positive. v*(33/40) Simplify (qq*(-8))/(qq/q*(-1))(q/q(-4))/q(-3) assuming q is positive. q(-2) Simplify ((n/((n4n)/nnn))/n7)2 assuming n is positive. n(-24) Simplify (o(-1)/(oo*(-7)o))(-41) assuming o is positive. o(-164) Simplify ((v*(1/4)/vv)/v(v/v2)/v)/(v*	{ "pile_set_name": "DM Mathematics" }
/19(-15)/(-10) -5 What is 8385/5031(-3)/(-15)201? 67 Evaluate (((-28)/350)/(7/(-315)3))/(9/(-420)). -56 Calculate (-104)/512-16-16. -52 (20/42)/((-7735)/21658) -4/3 ((96/(-9))/(-8))/(((-770)/(-15))/(-7))-5 10/11 Calculate ((-4125)/550)/(115/(-4)). 6/23 Calculate ((-7)/(28/18))/((18/165)/(172/(-215))). 33 ((-14)/(-3))/((-1)/(-27)(-315)/(-30)) 12 Calculate ((-13)/(-65))/((-1(-36)/50)/((-92)/(-2530))). 1/99 Evaluate ((-1449)/(-1127))/(6/28)122/(-4). -33 Calculate ((-18)/8)/((-720)/84035/80). 6 What is the value of ((-9)/140)/(3678/25746)? -9/20 Calculate ((-136)/4046)/((-103)/(-2163)). -12/17 What is ((-144)/(-3780))/(((-76)/(-5))/19)? 1/21 What is (((-60)/126)/(495/1782))/((-20)/(-154))? -66/5 Evaluate 16/5(-419650)/(-12320). 109 6/(-33)-33(-26)/(-18876) 1/121 What is ((-38415)/1970)/(15/(-2))? 13/5 Calculate (-399)/(1527372/(-264))1841. 58 Evaluate (25/(-30))/(((-260)/13)/(-600)). -25 ((-44)/((-11220)/1377))/((-63)/(-350)) 30 What is the value of (((91200/(-325))/16)/((-20)/390))/3? 114 What is the value of (4/(-24))/((-14289)/866)? 1/99 What is (-1056)/(-56)721/3090? 22/5 Calculate (3/84)/((-333)/23754). -107 What is the value of (77959/(-58867))/((-5)/370)? 98 What is (-230)/(-4)29212/15370? 23 Evaluate (26/60)/((1806/(-56))/129)(-5)/(-4). -13/6 Evaluate -26/(-2)(66/264)/(44/32). 12/11 What is (-6)/(-4)((-210112)/(-12))/(-49)1/(-8)? 67 (42/(-9)-18(-4)/(-196))/((-4800)/(-224000)) 80 Evaluate (-6(-6)/(-420))/((960/100)/12). -3/28 What is 275100/25004/(-242)? -2/11 Calculate (-51)/(-34)9320/(-240). -18 What is (10206/(-105))/27(-1260)/(-162)? -28 What is the value of -72/273(-403)/2? 31/3 (((-5)/9)/5)/(17619/11746) -2/27 (-8)/13342093/(-182) 2/29 What is the value of (144631/(-7113))/((-122)/12)? 2 Calculate ((-133)/532(-246)/18)/((-1)/(-24)). 82 9/((-243)/(-6))(-3)/((-108)/(-18)) -1/9 Calculate (((-1)/30)/1)/(15(-127)/5715). 1/10 Evaluate ((-86)/(-946))/((-2)/(-40))-11. -20 Evaluate (-9)/((-17)/136((-98)/7)/7). -36 (2/725)/((-53)/530)2805/(-374) 6/29 Evaluate ((-1)/((-3)/92))/((-200)/(-180)24/20). 23 What is the value of ((-13)/(-26)14/15)/(826/708)? 2/5 Evaluate (-5)/((-20)/(-6))(126/81)/((-2821)/(-78)). -2/31 Calculate ((-7)/15)/(8/61989/7956). -7/5 (-1246200)/(-726950)(18/(-8))/((-2)/28) 54 Calculate (138/3(-2)/(-28)1)/((-2552)/(-4466)). 23/4 Evaluate (-1)/((-5)/6)2322/3483370/(-4). -74 Calculate (2187/54)/(-27)1/(-27)-3. -1/6 What is (-21)/1537(-6)/(-147)? -2/51 (((-3)/(-33))/((-1785)/11781))/((-6)/485) 97/2 Evaluate (54/3312-23)/(9/(-15)). 5/8 Evaluate (((-3)/(-108))/(496/(-19840)))/((-2)/(-4)). -20/9 What is the value of (-34)/14(-1874)/15929-434? -124 Evaluate 1352040/(-9488)6/9. -95 Evaluate (22/(-66)15/(-5))/(7/(-91)). -13 Calculate (-5)/(136/(381888/520)). -27 What is the value of (42/3)/((25/(-70))/(55/(-11))-2)? -98 What is the value of (-175)/100(8/(-6))/(132/99)? 7/4 What is (17/(-2210))/((-60)/(-20)(-4)/(-24))? -1/65 Evaluate 85288/(-1201647)6/56. -2/263 What is the value of (-5)/(-35)-57280/120? -19 What is the value of ((-3)/2)/((-4)/208384/(-64))? -13 Calculate ((-47424)/(-20520)(-10)/(-48))/((-2)/12). -26/9 What is the value of ((-213)/(-9940)-35)/((-2)/(-106)(-24)/64)? 106 Evaluate -2484/(1344/32). -48 What is the value of ((-48)/208)/(14(-11)/18018)? 27 What is ((-8)/96)/(117/351)? -1/4 Evaluate 21014/(-553)-7(-3)/(-63)-3. -38 What is (-75)/(-975)663(-2)/2? -51 Calculate (-10(-80)/140)/(4/28). 40 ((-5)/10(-1850)/333)/(6/27) 25/2 What is the value of 72/14134/(-3082)? -1/23 What is 48/828(-84)/56? -2/23 What is the value of 688/(-10)245/(-196)(-1)/1? -86 ((-10919)/1113738)/(1/(-2)) 1/51 What is the value of (70/50-4)/(25/(-125))? 28 What is 35(-47)/(6110/234)? -63 Calculate (6/(-20)1064/(-6384))/(-2). -1/40 What is the value of 9/(117/(-2236))(-104)/(-208)? -86 What is the value of (12/(-5))/(165/(-1362900)-177)? -112 Evaluate -71(-27169)/381982/(-1). -101 What is the value of (4/(-3))/(2284/46251)? -27 What is the value of 9/30-12265/1272445? -135 What is the value of 5((-33633)/1414(-14)/(-60))/(840/(-224))? 37/5 ((-14155)/(-65113))/((-5)/(-4)) 4/23 ((152/(-19))/32)/(13100/975) -3/16 (-16)/232821/14 -1/97 Calculate ((-470)/(-55))/(1212/(-19998)). -141 Calculate (3/(-7))/(21875/(-18375)-21/(-10)). 9/5 What is the value of (54/(-360))/((-3)/(-140)(-1235)/(-247))? -7/5 What is the value of 37/((-1246)/267)? -9/2 Calculate 12167/(-15870)(-2)/23. 1/15 Calculate ((-136)/(-10))/((-3488)/12208(56/10)/(-4)). 34 What is the value of (8/(-33))/(10/30(-141)/517)? 8/3 1528/(-31324)287/(-77) 2/11 What is ((-83984)/99731)/((-4)/(-114))? -24 What is (-2)/(((42705/(-1022))/(-117))/(15/(-6)-4))? -56 Calculate ((-2)/(-30))/((-5)/6((-2646)/405)/(-49)). -3/5 ((-12)/(-108)-3)/((14/(-63))/((-356)/(-6))) 89 What is the value of ((6/(-62))/(-3))/(1007/(-4028))? -4/31 Evaluate 4/(-2)4/1075/150. -2/5 What is 3012/(-2510)1300/120? -13 What is the value of (-486)/270(-261)/(-81)? -29/5 What is the value of (35/60)/((-1617)/(-99))36? 9/7 (-4560)/3876306/225 -8/5 (-7)/((4/130)/((-2046)/71610)) 13/2 What is ((-1590)/59784)/((-3)/(90/75))? 1/94 Calculate (-6688)/(-132)88/2816. 19/12 What is the value of (117/153)/(-5076/(-16150))? 13/4 What is (-4)/(-2)(-31)/(-193161)93? 2/67 What is the value of ((-16)/960-20)/((-7)/6(-10)/(-30))? -6/7 What is the value of ((-637)/(-1365))/((-2)/(180/(-35)))? 6/5 Calculate (-36)/(-336)28/2136/((-96)/8). -3/7 Calculate (-2)/(161/(177100/160)). -55/4 ((2/(-15))/((-1210)/5445))/((-8)/30)28 -63 What is the value of (-2)/(-2)(-12789)/205814? -87 Evaluate (-3)/(33/44)(-690)/(-1196). -30/13 (344/473)/((-24)/4818) -146 What is the value of (((-440)/100)/(-11))/(-10(-2)/420)? 42/5 What is ((-67)/((-3685)/(-242)))/((-3)/(-15))? -22 Evaluate (21/33)/((-3040)/(-66880)). 14 What is the value of ((9/6)/(-1))/((242/22)/176)? -24 What is the value of (((-413)/3)/(-7))/((6600/(-75))/264)? -59 1736/4((-7)/(-28))/((-2)/(-2)) 46 (-14(-80)/224(-8)/210)/((-1358)/291) 2/49 What is the value of (-237)/210866/16299? -79 Calculate (190/399)/(((6/20)/(-1))/((-168)/120)). 20/9 Evaluate (-6)/196-133(-300)/19950. -3/49 What is (1516/(-758))/(6/918/2)? -1/3 What is ((-6)/2)/18(-8)/2800-2521? -1/4 What is the value of (-1872)/104(-195)/270? 13 Calculate -2347/1081-4(-2)/584. -1/73 What is the value of 18(-408)/2525/7049? -102 What is the value of (((-1575)/(-56))/(-15))/((-81)/864)? 20 What is the value of (73870/249)/(-178)(32/(-12))/463? 70 Calculate -88(-7)/2321/2247. 44 21/1059/(63/(-14))(-15)/(-39) -2/13 (-5)/7(-44)/264(-8)/(-10) 2/21 ((1/9)/(255/(-29835)))/((-1)/((-4)/2)) -26 Evaluate (4/32104/73788-88)/(2/6). -2/43 Evaluate -3(-16)/248/(-12)-3. 4 What is the value of 35/(5516/(-528))? -21 Calculate 1/(11(-850)/(-2200)). 4/17 Evaluate (610/244)/(99/(-18)). -5/11 What is ((-5)/(75/(-1)))/((-208)/78)? -1/40 Calculate ((-163)/(-652))/((-5)/(-48)). 12/5 ((-13728)/(-2912))/(55/105) 9 ((-19)/(-3))/(1413315/70470) 6/19 ((-20944)/32)/773/32 -17 What is the value of ((-8)/4(-14)/(-84))/(74/(-12))? 2/37 Calculate ((-4)/18)/(((-6)/1728-24)/(-9)). 24 (-72)/2(-3)/((-2)/(-24)4-9) -36 What is ((-24)/(-16))/((-3)/(-4))(-384)/((-144)/9)? 48 What is the value of 67/(-80)(-23360)/292? 67 Evaluate ((-40)/9)/(9/(-1944)24). 40 What is the value of 2/((-44)/5)535248/(-95580)? 14/11 What is ((1520/(-36))/10)/((-49)/(-441))? -38 What is (10/((-26980)/(-38)))/(7/(7/1))? 1/71 What is (55/(2750/60))/(15678/335)? 1/39 Calculate (216/(-112))/(213/142). -9/7 Evaluate -442((-34)/(-51))/((-5)/((-45)/(-12))). 44 Evaluate ((-45)/(-54)21/(-10))/(7/(168/30)). -7/5 Evaluate (4/(-12)3)/(((-10)/62)/51). 31 What is 5710/6852(-24)/1? -20 Calculate (-24)/3031(3395/28)/(-97). 31 Calculate ((8/(-108))/(344/6192))/((-44)/42). 14/11 What is ((-366)/3843)/(143/77)? -2/39 What is (477/((-231822)/2268))/((-2)/98)? 21/8 What is the value of (-176)/(-132)246/3232/(-8)? -41 Evaluate (3802/11406)/(-21/52). -26/3 Calculate (-386)/579(-435)/638. 5/11 What is (-9((-16)/(-198))/((-92)/(-69)))/((-4)/22)? 3 What is (-52)/3(-2115)/9870? 26/7 Evaluate ((-58)/(25056/360))/(33/(-18)). 5/11 (-18)/6741((-12)/(504/21))/(	{ "pile_set_name": "DM Mathematics" }
t is prob of sequence ieqs when four letters picked without replacement from {s: 1, i: 9, o: 1, e: 7, q: 2}? 7/6460 Calculate prob of sequence hne when three letters picked without replacement from nsnsnshshsessnnsenh. 2/323 Calculate prob of sequence ug when two letters picked without replacement from {u: 1, j: 7, e: 2, g: 1, f: 1, m: 2}. 1/182 Calculate prob of sequence dwxu when four letters picked without replacement from kwuuzdwwxzxzwww. 1/1365 What is prob of sequence epz when three letters picked without replacement from pwzzepwwwezeez? 4/273 Calculate prob of sequence rder when four letters picked without replacement from pdrwepr. 1/420 What is prob of sequence wrz when three letters picked without replacement from {w: 1, z: 1, r: 2, v: 1, o: 1, p: 2}? 1/168 Four letters picked without replacement from {q: 9}. Give prob of sequence qqqq. 1 What is prob of sequence fp when two letters picked without replacement from {f: 4, y: 6, m: 2, p: 4, k: 1}? 1/17 What is prob of sequence pnn when three letters picked without replacement from {a: 2, n: 6, p: 4}? 1/11 Calculate prob of sequence bbb when three letters picked without replacement from {g: 7, b: 3}. 1/120 Three letters picked without replacement from {y: 4, d: 3, p: 1}. What is prob of sequence dpd? 1/56 What is prob of sequence jj when two letters picked without replacement from jpppjfpfjj? 2/15 What is prob of sequence yy when two letters picked without replacement from ryyryryryyyryy? 36/91 Three letters picked without replacement from {c: 2, e: 1, k: 1}. What is prob of sequence cke? 1/12 Two letters picked without replacement from {h: 3, j: 17}. What is prob of sequence hj? 51/380 Three letters picked without replacement from {o: 3, v: 2, y: 8, z: 1, u: 1, x: 1}. What is prob of sequence ooo? 1/560 Three letters picked without replacement from {d: 2, k: 1, x: 2, l: 1, u: 1, j: 2}. Give prob of sequence xdl. 1/126 What is prob of sequence momm when four letters picked without replacement from omomzmmmomommm? 12/143 What is prob of sequence ow when two letters picked without replacement from {w: 6, m: 3, z: 3, o: 4, q: 2, h: 1}? 4/57 What is prob of sequence yyyb when four letters picked without replacement from yybyybyybbbyyyyy? 165/1456 What is prob of sequence hhc when three letters picked without replacement from {c: 1, h: 2, q: 4, x: 2}? 1/252 Four letters picked without replacement from rnaybynnyay. Give prob of sequence anba. 1/1320 Four letters picked without replacement from {w: 1, j: 14, i: 1, d: 2, z: 2}. Give prob of sequence jjjj. 1001/4845 What is prob of sequence ut when two letters picked without replacement from {y: 4, u: 1, t: 1, b: 1, q: 2}? 1/72 Two letters picked without replacement from {l: 6, q: 1, w: 3, m: 2, s: 5}. What is prob of sequence sm? 5/136 Three letters picked without replacement from {o: 2, d: 1, p: 2, k: 8}. What is prob of sequence ppo? 1/429 Three letters picked without replacement from ipippppipipiippppip. What is prob of sequence ppp? 220/969 Two letters picked without replacement from hqwzovwwhhwhhw. Give prob of sequence vh. 5/182 Two letters picked without replacement from {l: 1, h: 1, j: 1, p: 1, r: 1}. Give prob of sequence rp. 1/20 Calculate prob of sequence jj when two letters picked without replacement from jrbjcmcbmcjj. 1/11 Calculate prob of sequence frc when three letters picked without replacement from ysyssskcsskcrskkfskf. 1/1710 What is prob of sequence gee when three letters picked without replacement from eqgqqdqqggqeqe? 3/364 Two letters picked without replacement from tttttttjtjj. Give prob of sequence tj. 12/55 What is prob of sequence xiim when four letters picked without replacement from iiibmbxxmixiiiimi? 27/2380 What is prob of sequence oy when two letters picked without replacement from {b: 1, o: 5, a: 1, y: 1, k: 3}? 1/22 What is prob of sequence lb when two letters picked without replacement from {f: 4, p: 1, l: 1, w: 1, b: 3, t: 4}? 3/182 What is prob of sequence ych when three letters picked without replacement from bhybhycyyhbjb? 1/143 Calculate prob of sequence md when two letters picked without replacement from {v: 1, m: 2, c: 2, d: 1, w: 1}. 1/21 Three letters picked without replacement from {d: 11, i: 2}. What is prob of sequence ddi? 5/39 What is prob of sequence bbb when three letters picked without replacement from bbrrbbb? 2/7 Two letters picked without replacement from {y: 5, x: 2, u: 4, a: 7}. Give prob of sequence ua. 14/153 Calculate prob of sequence kz when two letters picked without replacement from kzzkzzkkzz. 4/15 Two letters picked without replacement from {s: 2, g: 1, v: 1, e: 1, d: 1, u: 1}. Give prob of sequence ve. 1/42 Four letters picked without replacement from {y: 2, q: 4}. Give prob of sequence qqyy. 1/15 Three letters picked without replacement from {j: 3, o: 4, e: 11}. What is prob of sequence oee? 55/612 Three letters picked without replacement from {i: 2, t: 3, y: 7, m: 1, e: 3, z: 2}. What is prob of sequence zyt? 7/816 Calculate prob of sequence uuxm when four letters picked without replacement from {m: 3, u: 5, x: 4}. 2/99 Four letters picked without replacement from kbyvkrbkrrrfkv. Give prob of sequence brvk. 8/3003 Three letters picked without replacement from {k: 7, c: 4, f: 2, s: 1}. What is prob of sequence csc? 1/182 Calculate prob of sequence iii when three letters picked without replacement from yiydiydiydd. 1/165 Four letters picked without replacement from jjjujjjuujjjuujjjj. Give prob of sequence jjuj. 143/1224 What is prob of sequence od when two letters picked without replacement from oqbnd? 1/20 What is prob of sequence ye when two letters picked without replacement from eeeeyeeeyee? 9/55 Two letters picked without replacement from {f: 3, s: 1, p: 1, l: 1, m: 1}. What is prob of sequence fm? 1/14 Two letters picked without replacement from jjusj. Give prob of sequence sj. 3/20 Two letters picked without replacement from eara. Give prob of sequence er. 1/12 Two letters picked without replacement from {q: 2, a: 2, u: 1, n: 1, h: 3, g: 3}. Give prob of sequence ha. 1/22 Four letters picked without replacement from mzmzzzzzzz. What is prob of sequence zmmz? 1/45 Four letters picked without replacement from {q: 1, p: 3, v: 11, r: 1, m: 2, a: 1}. What is prob of sequence vmpr? 11/15504 Two letters picked without replacement from sclgsza. What is prob of sequence gl? 1/42 What is prob of sequence aa when two letters picked without replacement from aaaaaagaaaaagaaaaaa? 136/171 What is prob of sequence ii when two letters picked without replacement from ajadadaaaajdiadv? 0 Four letters picked without replacement from {o: 2, i: 2}. Give prob of sequence iioo. 1/6 Two letters picked without replacement from lbyfbfbyblbblfyfl. What is prob of sequence yy? 3/136 What is prob of sequence pzpz when four letters picked without replacement from {p: 7, z: 4}? 7/110 Four letters picked without replacement from {r: 2, o: 2, u: 4, q: 1, x: 1}. What is prob of sequence uxqu? 1/420 Three letters picked without replacement from xoonzmmnononnx. What is prob of sequence mmo? 1/273 Calculate prob of sequence eem when three letters picked without replacement from {m: 4, v: 9, e: 3}. 1/140 Three letters picked without replacement from {q: 2, b: 5}. Give prob of sequence qbq. 1/21 Two letters picked without replacement from {h: 2, p: 7, z: 2}. Give prob of sequence zz. 1/55 Calculate prob of sequence voro when four letters picked without replacement from ooooovovooooovooooor. 2/323 Calculate prob of sequence mdc when three letters picked without replacement from {c: 4, m: 3, f: 2, d: 1, a: 2, h: 3}. 2/455 Calculate prob of sequence qeq when three letters picked without replacement from bbzqqeb. 1/105 What is prob of sequence qjgq when four letters picked without replacement from ggkgjsqjqjkjjj? 3/2002 What is prob of sequence vl when two letters picked without replacement from ccvl? 1/12 Four letters picked without replacement from sgaakoa. Give prob of sequence akao. 1/140 What is prob of sequence iii when three letters picked without replacement from {i: 16, n: 4}? 28/57 Two letters picked without replacement from eydee. What is prob of sequence ee? 3/10 Calculate prob of sequence kn when tw	{ "pile_set_name": "DM Mathematics" }
*2 + j + 21. Determine 2t(a) + 11y(a). -a2 + 2a - 2 Let l(t) = -17t + 9. Let d(w) = w + 1. Calculate -5d(x) + l(x). -22x + 4 Let o(c) = -2 - 4c - c - 3 - 1. Suppose -d = -f - 6d - 7, 5f = 3d + 21. Let n = -7 + f. Let q(h) = h + 1. Give no(y) - 22q(y). -2y + 2 Let f(n) = -752n + 5. Let d(c) = -2246c + 14. What is 6d(l) - 17f(l)? -692l - 1 Let q(d) = 8d*2 + 9 - 9d*3 - 3d*3 - 3 + 7d + 3 + d*2. Let k(y) = -11y*3 + 8y*2 + 6y + 8. What is -7k(c) + 6q(c)? 5c3 - 2c*2 - 2 Let d(b) = -1. Let i(z) be the third derivative of -5z4/12 - z3/3 - 9z2. Let k be i(2). Let t(j) = -j + 12. Give kd(u) - 2t(u). 2u - 2 Let d(v) = v*3 + 13v*2 + 9v - 37. Let a be d(-12). Let c(z) = -1. Let n(q) = 6q + 5. What is an(l) - 6c(l)? -6l + 1 Let g(d) = 6d3 - 6d + 3. Let y(r) = 7r3 - 7r + 3. Determine -4g(p) + 3y(p). -3p3 + 3p - 3 Let d(r) = 4r + 2. Suppose -71 + 16 = -11m. Let b(k) = 10 - 6 - 2k - m. Let q be 0 + 0 + -1 + -4. What is qb(n) - 2d(n)? 2n + 1 Let f(d) = 3d3 - d2. Suppose 4p + 18 = -z, 4p = 4z - 2z - 12. Let t be 2/(-3) + z/6-11. Let k(c) = -3c3 + c2 - 1. Determine tf(h) + 2k(h). 3h3 - h2 - 2 Let y(r) = -r - 2. Let i(c) = -457c + 12. Give i(t) + 6y(t). -463t Let w(g) = 7g*2 + 9g - 21. Let o(d) = 8d2 + 10d - 24. Give 5o(k) - 6w(k). -2k2 - 4k + 6 Let k = 104 - 95. Let h(y) = -y + 4. Let u(o) be the first derivative of 3 + 3/2o2 - 9o. Calculate kh(g) + 4u(g). 3g Let g(o) = -3o - 16. Let t(b) = b - 1. Give -g(k) - 2t(k). k + 18 Let o(v) = -v3 + v + 1. Let h(r) = 22r2 + r + 1. What is -h(u) + o(u)? -u3 - 22u2 Let v(z) = -10z - 5 + 6 + 3. Let a(b) = -2b + 1. Determine 14a(k) - 3v(k). 2k + 2 Let d(q) = 4q + 90 - 277 + 100 + 91 - 6q2. Let h(o) = o2 - o. Let m(y) = 10y2 - 8y - 3. Let c(z) = -5h(z) + m(z). Determine -4c(p) - 3d(p). -2p*2 Let j(p) = 2 + p + 0 + p. Let q(m) = 14m + 2. Let b(r) = 83r + 13. Let v(u) = b(u) - 6q(u). Give j(c) - 3v(c). 5c - 1 Let k(d) = 2d3 - 15d*2 - 5d + 14. Let c(a) = a*3 - 8a*2 - 3a + 8. What is -11c(m) + 6k(m)? m*3 - 2m*2 + 3m - 4 Let g(c) = -4c3 + 4c + 4. Let s be (-73 - -91)/(2/1). Let x(i) = -8i3 + 9i + 9. Determine sg(q) - 4x(q). -4q3 Let v(x) = x2 + x - 1. Suppose -r + 16 = 3y + 36, 2y = -4r - 30. Let k be 20/2-1 - r. Let w(f) = 8f*2 + 7f - 7. Calculate kv(j) + w(j). 3j*2 + 2j - 2 Let b(v) = v3 - v2 + v + 1. Let y(o) = 2o3 - 2o*2 + 4o + 3. Give -3b(z) + y(z). -z3 + z2 + z Let w = -150 - -154. Let f(z) = -z3 - 5z2 - 2. Let n(t) = t3 + 4t2 + 1. Determine wf(q) + 5n(q). q3 - 3 Let v be (-18)/21(3 + (4 - 14)). Let k(y) = -2y2 + 5y + 4. Let a(n) = 2n2 - 4n - 3. Give va(g) + 5k(g). 2g2 + g + 2 Let q(i) = -5i*2 + 3i + 2. Let b(k) = 12k + 14. Let h be b(-4). Let v = -32 - h. Let t(u) = -4u*2 + 2u + 1. Calculate vq(d) - 3t(d). 2d2 + 1 Let z(i) = -3i*2 - 4i + 2. Let u(n) = -3n3 - 5n*2 - 7n + 4. Give -4u(r) + 7z(r). 12r3 - r2 - 2 Let n(d) = -3d*3 - 2d*2 - 2d - 2. Let t(p) = -8p3 - 6p*2 - 5p - 6. Calculate -17n(x) + 6t(x). 3x3 - 2x*2 + 4x - 2 Let r(s) = s - 1. Let a(t) = 4t - 110. Calculate a(u) - 2r(u). 2u - 108 Let l(w) = -1089w*2 + 9w + 21. Let a(n) = -109n2 + n + 2. Calculate -21a(z) + 2l(z). 111z*2 - 3z Let o(p) be the third derivative of -p4/6 - p3/2 + 6p2. Suppose -31c + 26c + 5k + 30 = 0, 0 = -c + 2k + 5. Let n(g) = 3g + 2. Give cn(s) + 5o(s). s - 1 Let b(g) = -4g3 - 3g*2 + 3. Let v(n) = 4n*3 + 2n*2 - 2. Let u(j) = -9 - 4j*2 + 8j*2 + 12j - 5j2. Let s be u(11). Give sb(r) + 3v(r). 4r*3 Let l(w) = -13w*2 + 13w. Let x(v) = 3v2 - 3v. Suppose g - 5g - 88 = 0. Let c = -40 - g. Let u be (1 + 3/(-9))-6. Give cx(z) + ul(z). -2z2 + 2z Let n(d) = -d2 + d. Let r(k) = k2 - k - 1. Let x(c) = 5c. Let f(h) = 2r(h) + x(h). What is -f(m) + n(m)? -3m2 - 2m + 2 Let l(g) = -2g2 + 42g - 11. Let p(x) = -3x2 + 85x - 19. Calculate 7l(m) - 4p(m). -2m2 - 46m - 1 Let k = 2 - 4. Suppose -6x + 5x = -4. Let o(u) = 0u - 2u + xu - u. Let c(m) = -m2 + m. What is kc(z) + 2o(z)? 2z*2 Let j(u) = -3u. Let c(i) = i. Let t(l) = -l - 20. Let r be t(-10). Let f = -2 + r. What is fc(h) - 3j(h)? -3h Let z(b) = -b + 14. Let m(j) = -1. Give 3m(s) + z(s). -s + 11 Let f(c) = 4c3 - 3c*2 - 3c - 151. Let m(h) = 13h3 - 10h*2 - 10h - 452. What is -10f(w) + 3m(w)? -w*3 + 154 Let a(h) = 9h*2 + 6h + 6. Let f(m) = 19m2 + 13m + 13. Let c be ((-11)/(-33))/(1/51) - 4. What is ca(i) - 6f(i)? 3i2 Suppose -72 - 12 = 14s. Let t(m) = -3m2 - 2m + 5. Let c(k) = -3k2 - 2k + 6. Give sc(r) + 7t(r). -3r2 - 2r - 1 Let k(b) = -40b + 10b - 87 - 12b2 + 204 - 87. Let w(f) = f - 1. Determine k(t) + 30w(t). -12t2 Let v(p) = -678p*3 + 2p. Let a(r) = -678r3 + 3r. Calculate -2a(f) + 3v(f). -678f3 Let u(c) = c3 - 123. Let r(f) = 4f*3 - 493. Calculate -2r(v) + 9u(v). v3 - 121 Let q(n) = 6n*2 - 3n. Let t(d) = d*2 - d. Suppose -3g + 4 = -w + 12, 2g = -4. What is wq(b) - 6t(b)? 6b*2 Let c(b) = -7b*3 - 5b*2 - 10b - 26. Let r(p) = 6p3 + 4p*2 + 8p + 25. What is -4c(g) - 5r(g)? -2g3 - 21 Let s(w) = 9w*3 - 4w*2 + 2w + 22. Let v(h) = h*3 - 2h*2 + h - 1. Determine -s(q) + 2v(q). -7q3 - 24 Let d(f) = -23f + 11. Suppose 38 = -5p - 2z, 5p + z + 24 = -15. Let w(q) = 8q - 4. Give pw(x) - 3d(x). 5x - 1 Let p(l) = -1 + 0 + 2. Let i(w) = -w. Suppose -6j + 4j - 2 = 4v, 5v = 0. Determine ji(z) + 2p(z). z + 2 Let a(i) = -i3 + i2 + 8i - 8. Let r be a(3). Let f(l) = l. Let y(k) = -4k - 2. Determine rf(q) - y(q). 2q + 2 Let p(n) = 1. Let j(v) = -3v*2 + v + 1. Let f be -9 - (3 - 8) - (-5 + 0). Give fp(r) - j(r). 3r2 - r Let n(w) = 124w*2 + 10w + 11. Let u(b) = -31b2 - 3b - 3. Give -6n(g) - 22u(g). -62g2 + 6g Let a(m) = 13m - 6. Let g(d) be the third derivative of d4/2 - 5d*3/6 - 6d*2 - d. What is 5a(n) - 6g(n)? -7n Let q(g) = -28g - 2g*2 + 3 + 13g + 9g + 7g. Let x(n) = 3n2 - 4. Give -4q(s) - 3x(s). -s2 - 4s Let n(j) = 3j + 5. Let a(c) = -5c + 98. Let t be a(21). Let k(q) = -4q - 6. Calculate tn(s) - 6k(s). 3s + 1 Let b(m) = 34 + 13 - 46. Let z(s) = 7s3 + 35. Determine 35b(g) - z(g). -7g3 Let b(i) = 7i + 6. Let w(t) = -1. What is 2b(d) + 10w(d)? 14d + 2 Suppose 0k = -3k - 3, 2i - 3 = k. Let c(o) = o - i + 0o + 1. Let y be -38/15 + (-6)/15. Let u(h) = -h*3 + 2h*2 + 2h. Determine yc(p) + u(p). -p3 + 2p*2 Let w(o) = -o - 1. Let z(c) = 187c*2 - 187c - 187. Calculate 374w(k) - 2z(k). -374k2 Let i(f) be the first derivative of 2f*3/3 - 7f*2/2 + 5f - 66. Let z(x) = -4x2 + 15x - 11. What is -13i(b) - 6z(b)? -2b2 + b + 1 Let f(y) = -6y*2 - 45. Let r(j) = -12j*2 - 91. What is 7f(s) - 4r(s)? 6s*2 + 49 Let s(g) = 3g*3 + 3g2 + g2 - 8 + 0. Let l(b) = 22b3 + 0b*2 - 4b*3 - 10b*3 - 23 + 11b*2. Determine 6l(u) - 17s(u). -3u*3 - 2u*2 - 2 Let i(h) = 3h - 6. Suppose 13 + 64 = -11w. Let y(z) = -2z + 4. What is wy(u) - 5i(u)? -u + 2 Suppose -4p = -3o + 35, 5p = -21 - 4. Suppose -u - 1 = -a, -ou = 5a - 3u - 26. Let s(f) = f - 3. Let c(l) = l - 2. Give ac(r) - 3s(r). r + 1 Let v(r) = -r2 - r - 28. Let z(i) = -i2 - 27. Give -3v(b) + 4z(b). -b*2 + 3b - 24 Let k(n) = 2n2 + 2n + 2. Let o(h) = 13h2 + 9h - 5. What is -4k(c) + o(c)? 5c2 + c - 13 Let d(h) = h3 + 7h2 - 5h. Suppose 3a - 12 = 3j, -5a = -j + 5j - 38. Let u(x) = -3x3 - ax + 8x2 + 120 - 120 + 4x*3. Give 6d(k) - 5u(k). k3 + 2k*2 Let l(p) = -9p*2 - p + 10. Let t(a) = -17a*2 - 2a + 21. Calculate 11l(c) - 6t(c). 3c2 + c - 16 Let z(f) = 3f*3 + 2f*2 + 25f. Let d(a) = 7a3 + 5a*2 + 49a + 1. Calculate -2d(o) + 5z(o). o*3 + 27o - 2 Let f(g) = -32g2 - 3g + 2. Let s(d) = -97d2 - 8d + 6. Calculate 11f(o) - 4s(o). 36o2 - o - 2 Let y(a) = -64a - 35. Let q(g) = -22g - 12. Determine 11q(p) - 4y(p). 14p + 8 Let p(n) = -19n2 - 12n + 3. Let s(a) = -10a2 - 7a + 2. What is 6p(t) - 10	{ "pile_set_name": "DM Mathematics" }
4/13 - 152w*3/13 - 524w*2/13 + 154w/13 + 484/13 = 0. -2, -1, 1, 11 Determine i so that i*4 - 33i*3 + 193i*2 - 291i + 130 = 0. 1, 5, 26 What is l in -25l5 + 205l*4 - 155l*3 - 205l*2 + 180l = 0? -1, 0, 1, 36/5 Factor f*4 - 15f*3 - 225f*2 + 3375f. f(f - 15)2(f + 15) Factor -4f3 - 716f*2 + 4f + 716. -4(f - 1)(f + 1)(f + 179) Let 5h*4/4 - 15h*3/4 - 165h*2/4 - 265h/4 - 30 = 0. Calculate h. -3, -1, 8 Factor -3k5 + 690k*4 - 38271k*3 - 161460k*2 - 164268k. -3k(k - 117)*2(k + 2)2 Find c, given that -c5/4 + c*4 - 5c3/4 + c2/2 = 0. 0, 1, 2 Find c, given that 2c5/5 + 24c*4/5 + 34c*3/5 - 68c*2/5 - 72c/5 + 16 = 0. -10, -2, 1 Let -2h2 + 844h - 89042 = 0. What is h? 211 What is h in h*4 + 5h*3 - 14h2 = 0? -7, 0, 2 Factor -q3/6 - 26q2/3 - 101q/6 - 25/3. -(q + 1)*2(q + 50)/6 Factor d*2 + 165d + 486. (d + 3)(d + 162) Factor h4 + 61h*3 + 119h*2 + 59h. h(h + 1)2(h + 59) Let 4z5/3 - 32z*4/3 + 20z*3 = 0. Calculate z. 0, 3, 5 Factor -2g*5/9 - 122g*4/9 - 2396g*3/9 - 1484g*2 + 3822g - 2058. -2(g - 1)2(g + 21)3/9 Determine p so that -p2/2 + 47p/2 - 23 = 0. 1, 46 Suppose -3r*2/5 + 6r + 33/5 = 0. Calculate r. -1, 11 Factor 3h3 - 54h*2 + 195h + 252. 3(h - 12)(h - 7)(h + 1) What is b in 2b*5/13 + 6b*4/13 - 20b*3/13 + 4b*2/13 + 18b/13 - 10/13 = 0? -5, -1, 1 Factor -2z3 - 124z*2. -2z*2(z + 62) Factor -r*2 - 101r - 198. -(r + 2)(r + 99) Determine m so that 4m*5/3 + 2m*4/3 - 32m*3/3 - 16m*2/3 + 64m/3 + 32/3 = 0. -2, -1/2, 2 Solve -f*4 + 39f*3/4 - 49f*2/2 + 45f/4 + 9/2 = 0. -1/4, 1, 3, 6 Determine s so that 2s4/3 - 8s*3/3 + 2s*2/3 + 4s = 0. -1, 0, 2, 3 Factor 3m5 + 33m*4 + 57m*3 - 345m*2 - 600m + 1500. 3(m - 2)2(m + 5)*3 Let -594f*2/7 + 1002f/7 - 20/7 = 0. What is f? 2/99, 5/3 Factor -5g3/6 + 5g*2/6. -5g*2(g - 1)/6 Solve 6t2/7 + 678t/7 + 636 = 0. -106, -7 Find g, given that 4g4 + 32g*3 - 488g*2 - 1056g - 540 = 0. -15, -1, 9 Determine n, given that n*2/7 + 12n/7 + 11/7 = 0. -11, -1 Factor q*3 + 25q*2 + 123q + 171. (q + 3)*2(q + 19) Factor -2m2 - 11648m - 16959488. -2(m + 2912)2 Factor h3/7 + 17h*2/7 + 30h/7. h(h + 2)(h + 15)/7 Find b such that 2b5/5 - 26b*4/5 + 78b*3/5 - 46b*2/5 - 16b + 72/5 = 0. -1, 1, 2, 9 Find w, given that -3w2 - 1638w = 0. -546, 0 Determine u so that -15u2 - 69u/4 - 9/4 = 0. -1, -3/20 Let -5n3 - 585n*2 - 2280n - 2260 = 0. What is n? -113, -2 Find d, given that -4d3 + 100d*2 - 456d = 0. 0, 6, 19 Factor 3f3/2 - 15f*2/2 - 9f. 3f(f - 6)(f + 1)/2 Factor 5x*3/3 - 26x*2 - 32x/3. x(x - 16)(5x + 2)/3 Find r, given that 2r*5 + 6r*4 - 2r*3 - 14r*2 + 8 = 0. -2, -1, 1 Factor 4r*3 + 136r*2 + 496r + 480. 4(r + 2)2(r + 30) Factor -5h2 - 620h + 7425. -5(h - 11)(h + 135) Factor -4z2/3 - 202z/3 - 100/3. -2(z + 50)(2z + 1)/3 Factor 93l*2/5 + 36l - 12/5. 3(l + 2)(31l - 2)/5 Find s, given that s2/3 - 10s + 75 = 0. 15 What is d in -5d5 - 20d*4 + 5d*3 + 20d*2 = 0? -4, -1, 0, 1 Suppose -2p*2 - 19p/3 + 25/3 = 0. Calculate p. -25/6, 1 Solve -196q4 + 672q*3 + 1412q*2 + 624q + 80 = 0. -1, -2/7, 5 Factor w*5 - 14w4 + w3 + 156w2. w2(w - 13)(w - 4)(w + 3) Let 2c2/5 + 3596c/5 + 1616402/5 = 0. What is c? -899 Find m such that -5m5 - 15m*4 + 5m*3 + 35m*2 - 20 = 0. -2, -1, 1 Factor -3r*5/5 + 3r*4/5 + 3r*3/5 - 3r*2/5. -3r*2(r - 1)*2(r + 1)/5 Suppose -2i4/7 + 66i*3/7 - 380i*2/7 + 384i/7 + 832/7 = 0. Calculate i. -1, 4, 26 Factor -o*4/3 - 2o*3 + 3o*2 + 14o/3. -o(o - 2)(o + 1)(o + 7)/3 Factor -5g*4 - 20g*3 + 30g*2 + 20g - 25. -5(g - 1)2(g + 1)(g + 5) Factor q2/3 + 29q/3. q(q + 29)/3 Factor g4 - 3g*3 - 60g*2 + 368g - 576. (g - 4)*3(g + 9) Suppose 12v5 - 64v*4 - 1140v*3 - 728v*2 = 0. Calculate v. -7, -2/3, 0, 13 Solve -10n*2/11 - 104n/11 - 40/11 = 0. -10, -2/5 Factor -6h3/13 - 20h*2/13 - 6h/13. -2h(h + 3)(3h + 1)/13 Solve 3y3 - 468y*2/7 + 2673y/7 - 726/7 = 0. 2/7, 11 Determine n, given that -2n3 + 24n*2 - 18n - 44 = 0. -1, 2, 11 Factor 6m4 - 9m*3 - 24m*2 - 9m. 3m(m - 3)(m + 1)(2m + 1) Suppose 21632h*3/15 - 4576h*2/3 + 422h/5 - 6/5 = 0. What is h? 3/104, 1 Suppose 5p2 - 610p + 18605 = 0. Calculate p. 61 Solve 3c5 - 42c*4 - 348c*3 + 1266c*2 - 1335c + 456 = 0 for c. -8, 1, 19 Let -o*4 + 43o*3 - 206o*2 - 592o = 0. What is o? -2, 0, 8, 37 Factor -2z4/7 - 334z*3/7 - 14110z*2/7 - 13778z/7. -2z(z + 1)(z + 83)2/7 Suppose -x2/9 + 16x/9 - 64/9 = 0. What is x? 8 Solve -2q5 + 266q*4/3 + 562q*3/9 - 982q*2/9 - 368q/9 + 40 = 0. -1, 2/3, 45 Find g such that g*4/6 - 17g*3/6 + 19g*2/2 + 63g/2 - 81 = 0. -3, 2, 9 Solve 28z5 - 620z*4 + 1236z*3 - 724z*2 + 80z = 0. 0, 1/7, 1, 20 Factor i*3 - 25i*2 - i + 25. (i - 25)(i - 1)(i + 1) Factor 2d*3/17 + 90d*2 + 22950d + 1950750. 2(d + 255)3/17 Let 2t*2 + 748t + 746 = 0. Calculate t. -373, -1 Let -2a2/11 + 38a/11 + 184/11 = 0. What is a? -4, 23 Let -57f2/7 + 7131f/7 - 750/7 = 0. What is f? 2/19, 125 Let 5n4 + 5n*3 - 15n*2 - 25n - 10 = 0. Calculate n. -1, 2 Factor 2r2/17 - 108r/17 + 1216/17. 2(r - 38)(r - 16)/17 Factor -5u4 + 20u*3 + 50u*2 - 140u + 75. -5(u - 5)(u - 1)*2(u + 3) Factor -2x2 - 196x + 198. -2(x - 1)(x + 99) Factor l*2/7 - 3l/7 - 10/7. (l - 5)(l + 2)/7 What is o in -4o*2/7 + 1840o/7 + 528 = 0? -2, 462 Determine w, given that 2w4 - 8w*3 + 12w*2 - 8w + 2 = 0. 1 Factor m*2/6 - 941m/6 - 943/3. (m - 943)(m + 2)/6 Find a, given that 3a*2 - 243 = 0. -9, 9 Determine f, given that 2f*5 + 190f*4 - 194f*3 - 190f*2 + 192f = 0. -96, -1, 0, 1 Factor -5z4 + 3405z*3 - 13560z*2 + 13540z. -5z(z - 677)(z - 2)2 Solve 4p*2 - 104p - 1088 = 0. -8, 34 Find b such that -2b5/15 - 2b*4 - 124b*3/15 - 68b*2/15 + 42b/5 + 98/15 = 0. -7, -1, 1 Factor -3t4 + 15t*3 + 63t*2 + 69t + 24. -3(t - 8)(t + 1)3 Factor -g5/9 + 14g4/9 + 8g*3/9 - 368g*2/9 - 1040g/9 - 800/9. -(g - 10)*2(g + 2)*3/9 Suppose -2k*4/9 + 4k*2/9 - 2/9 = 0. Calculate k. -1, 1 Let -2h*3/3 - 134h*2 - 6386h + 106090/3 = 0. Calculate h. -103, 5 Let 2w4/5 + 22w*3/5 + 46w*2/5 - 14w = 0. What is w? -7, -5, 0, 1 Let p*4/9 - 5p*3/3 + 19p*2/3 - 17p/9 - 10 = 0. Calculate p. -1, 2, 5, 9 Suppose 3g4/4 - 33g*3/4 + 93g*2/4 - 63g/4 = 0. Calculate g. 0, 1, 3, 7 Factor 5f4/6 - 70f*3/3 + 200f*2 - 2080f/3 + 2560/3. 5(f - 16)(f - 4)*3/6 Determine b so that 4b*2 + 2244b + 15512 = 0. -554, -7 Find k such that k*4/2 + 5k*3 + 33k*2/2 + 20k + 8 = 0. -4, -1 Factor 16g5 + 8g*4 - 15g*3 - 8g*2 - g. g(g - 1)(g + 1)(4g + 1)2 Find z such that -6z*4/5 + 142z*3 - 212z*2/5 - 568z + 944/5 = 0. -2, 1/3, 2, 118 Find j, given that 14j3/15 - 1112j*2/15 + 4352j/3 + 2560/3 = 0. -4/7, 40 What is p in -5p2/2 + 15p - 20 = 0? 2, 4 What is f in 2f2/23 - 842f/23 = 0? 0, 421 Factor 39s3/4 - 21s*2 + 51s/4 - 3/2. 3(s - 1)2(13s - 2)/4 Factor q2/3 - 172q/3 - 175. (q - 175)(q + 3)/3 Find k such that -k2/2 + 129k/2 - 649 = 0. 11, 118 Factor p*3/2 - 42p*2 - 547p/2 + 315. (p - 90)(p - 1)(p + 7)/2 Factor 2v5 - 328v*4 - 2022v*3 - 3060v*2. 2v*2(v - 170)(v + 3)2 Factor -2m*3 - 92m*2 + 392m - 400. -2(m - 2)2(m + 50) What is m in 4m3 + 244m*2 + 1356m + 1980 = 0? -55, -3 Factor 3w3 + 18w*2 - 45w - 300. 3(w - 4)(w + 5)*2 Determine a, given that 33a*3/2 + 105a*2/2 + 42a + 6 = 0. -2, -1, -2/11 Factor 2y3/3 - 2y*2/3 - 13y/2 - 6. (y - 4)(2y + 3)2/6 Determine h, given that -h4 - 3h3 - 2h*2 = 0. -2, -1, 0 Factor 3j*4/4 - 75j*3/4 + 225j*2/2. 3j*2(j - 15)(j - 10)/4 Find y, given that -5y*4 + 70y*3 - 225y*2 - 280y + 980 = 0. -2, 2, 7 Factor -2x2/15 + 34x/15 - 32/15. -2(x - 16)(x - 1)/15 Factor 3p3/5 - 951p*2 - 19056p/5 - 19068/5. 3(p - 1589)(p + 2)*2/5 Factor 3q*2 + 534q + 23763. 3(q + 89)2 Solve -2l*2/7 + 14l = 0 for l. 0	{ "pile_set_name": "DM Mathematics" }
17 - 1095m to the form um + q + rm3 + bm*2 and give b. 0 Rearrange -61l*2 + 10 + 49l*2 - 124l + 121l - 4 to the form g + sl + ql2 and give q. -12 Rearrange -12 + 31482z - 13 + 24 - 2831z to the form mz + u and give m. 28651 Express 598 + 593 - 7313k + 590 - 1781 in the form f + hk and give h. -7313 Express -25w - 13w + 28w - 127w + 31w2 as zw*2 + i + ow and give o. -137 Rearrange (2j - 2j - j*3)(0 - 2 - 1) + (-3j - 5j + 3j)(483530 - 1678j2 - 483530) to the form sj + xj2 + d + lj*3 and give l. 8393 Express 19 - 34 - 1084l + 1032l as ql + n and give q. -52 Express 13w2 - 81w*2 + 34w*2 + 34w*2 - 35456w*3 - 2 as iw*3 + jw + o + sw2 and give i. -35456 Express -9363z - 48 + 33 + 15 as qz + c and give q. -9363 Rearrange -2x*4 + 0x + 42 - 93 + 36 + 2x2 - 11x*3 + 32 + x to jx*4 + hx*3 + rx*2 + u + wx and give h. -11 Express (-109p - 95p - 95p)(15 - 15 + 7p) + 5p2 - p2 - 2p2 in the form b + yp + cp2 and give c. -2091 Express 37q*2 - 37q*2 - 8q*3 + (2q*2 - 5q + 5q + 2)(-q - 6q + 4q) + 16251q - 16251q + 119q3 in the form hq + oq2 + k + fq*3 and give h. -6 Express (96 - 17 + 42)((-1 + 4 - 4)(1 + 1 + 0) + 1 + 0 + 0 + 1 + 1 - 4 + (-3 + 5 - 3)(-1 + 1 + 1))(2l*2 + 2 - 2) as sl*2 + c + gl and give s. -968 Rearrange 3301555j + 7j*4 - 2 + 4j*4 - 4j*3 - 3301552j + 12j2 to i + gj*3 + dj + vj2 + zj*4 and give z. 11 Express -4l*2 + 108l*2 - 5l*3 - 9l*2 - 35l*2 + 8l*2 as il*2 + p + bl*3 + wl and give i. 68 Express -695c2 + 1338c*2 - 1 + 17c*3 - 640c*2 as oc*2 + ac + fc3 + p and give p. -1 Express (-2 - 1 + 2)(l + 0l + 0l + (0l - l - l)(-5 + 1 + 3) + 0l + 6l - 4l + l - 6l + 3l)(3 - 7 - 1)(108 + 34 + 27) as ul + p and give u. 2535 Express 79945b2 - 196b - 79963b2 - 350b as fb + o + gb*2 and give f. -546 Rearrange 6i - 5i4 + 10i - 42i + 5i4 + i4 + 47i3 to the form ri + fi4 + ui*2 + oi*3 + q and give f. 1 Express -1240f - 3714564 + 3714564 + 4f2 in the form nf*2 + wf + q and give n. 4 Rearrange (-536p - 528p - 233 + 1066p)(0p + 4p + 3p)(3 + 2 - 3) to bp + i + dp*2 and give b. -3262 Rearrange (69j*3 - 51j*3 - 59j*3)(2 - 2 + j + j + j - 5j + (2 + 1 - 4)(4 - 4 + j)) to the form hj3 + sj + tj2 + wj*4 + m and give w. 123 Express 637y - 2 - 5y4 + 29y*3 + 2y*2 - 401y - 2y4 - 233y in the form xy + zy*3 + fy*4 + vy*2 + o and give f. -7 Express ((3 - 2 - 2)(s + 0s + 0s) - 2s + 0s + s)(-2 + 2 - 3)(732s - 400s - 2048s) as os*2 + js + n and give o. -10296 Express -63h + 3455h*4 - 2h*2 + 1 + 189h - 71h - 54h as oh + nh*4 + th*2 + g + zh*3 and give t. -2 Express 10584c - 13310c + 3 - 1 as b + tc and give b. 2 Express 2i2 + i2 - 2i*2 + (-56 - 26 - 55)(-436i + 436i + i*2) as r + li + hi2 and give r. 0 Rearrange (5 - 3 - 4 + (-3 - 5 + 1)(0 + 2 - 4))(-1859 + 1859 + 488y) to the form zy + g and give z. 5856 Express 225b*3 + 17b*2 + 23b*2 + 18b*2 - 31b*2 + 2 - 25b*2 as db*2 + tb*3 + k + pb and give d. 2 Express 320z4 + 322z*4 + 323z*4 - 69z*3 - 4 - z - 2z*2 - 966z*4 as mz*3 + gz*4 + iz + nz2 + s and give s. -4 Rearrange (0g - 3g + 4g)(-2g*2 + 2g*2 + 3g*2) - 3327g*3 - 55547g*2 - 167g*3 + 55549g*2 to rg*2 + k + xg*3 + bg and give r. 2 Express ((1 + 5 + 7)(3 - 2 - 2) - 3 + 1 + 4 - 2 + 2 - 4)(-43f + 74 + 83f - 41f) as b + hf and give h. 15 Rearrange (-14276u - 235u*2 + 14276u)(0u + 6u - 5u)(-4u + 6u + u) to xu*2 + ru*4 + hu*3 + g + wu and give r. -705 Rearrange -14684g2 + 7183g*2 - 8635g*2 to the form yg*2 + ng + i and give y. -16136 Express (270x3 + 87x*3 + 10x*3)(2 + 3 - 1)(5x - 2x - x) + 4x*3 - 4x*3 - 2x*4 in the form r + ix*3 + gx + zx4 + hx*2 and give z. 2934 Rearrange -88i + 26i2 - 12i*2 - 38i - 342i + 81i to the form xi2 + c + fi and give x. 14 Express (3 - 1 + 0)(2w*2 - 5w*2 + 4w*2)(-8563w - 10082w - 16582w + 6464w) in the form cw2 + a + dw*3 + rw and give d. -57526 Express 3i + 22i*3 + 26i*3 + 34i*2 + 9i - 3 - 4i - 49i*3 in the form bi*3 + yi + di2 + n and give b. -1 Express (-2g - g + 6g)(1434 - 770 - 8578) as rg + n and give n. 0 Express -201 - 8w - 831 - 714 + 9w as nw + l and give n. 1 Rearrange -1346s + 669s + 678s + 147 to as + t and give t. 147 Rearrange 9 + 1758w - 3699w + 2242w + (-w + 5w - 5w)(-1 + 4 + 1) + (-1 + 1 - 1)(2 - 2 + 2w) to the form iw + f and give f. 9 Express 79g - 6g2 - 75g - 43g2 + (5g + 0g - 4g)(-3g + 2g + 0g) as a + bg2 + qg and give q. 4 Rearrange -278z2 - 23z - 24z - 23z + 87z - 18z to i + gz + nz*2 and give n. -278 Express ((-3o + 4o - 3o)(-1 + 5 - 1) - o + 4o + 7o)(-4o + 3o + 3o + (2 + 0 + 0)(0o - 3o - o)) in the form l + so + io*2 and give i. -24 Express (0 + 2 - 4)(3f + 0f - f) - 6 - 6497f - 6498f + 12992f as uf + w and give w. -6 Rearrange 38612h - 3287h*2 - 38614h + 770h2 to c + yh + lh2 and give l. -2517 Express -3y + 164 - 7y3 + 76 + 3y3 + y3 as uy3 + hy*2 + oy + n and give u. -3 Express (571g - 325g + 155g)(2 - 3 - 1)(-4g3 + g3 + g*3) in the form ag*3 + h + xg*4 + dg + tg2 and give x. 1604 Express (5 - 3x - 5)(-6962 - 1349 + 2119x - 2117x) in the form ix + tx2 + w and give t. -6 Rearrange (-1 + 1 + 2l)(-3 + 4 + 1) + 352l + 239 - 349l + 453 to s + rl and give s. 692 Express 89r - 62r - 130r in the form m + pr and give p. -103 Express (5h2 + 2 - 2)(294h + 260h + 89h) in the form vh*2 + x + fh*3 + zh and give f. 3215 Rearrange -2s + 9s*3 - 3134s*2 + 3179s*2 + 8s*3 + 2s to n + vs + rs*3 + xs*2 and give x. 45 Rearrange 784 - 1583 + 799 + 2985u*2 to the form qu + y + wu2 and give w. 2985 Express 302 - 11y*2 + 18y*4 + 13y*2 + 2y - 304 + 12y3 in the form ky + m + cy2 + hy*3 + sy*4 and give c. 2 Rearrange (66867m*2 - 4 - 66155m*2 + 3)(32m - 2m*2 - 32m) to the form um3 + lm*2 + ym + d + fm4 and give f. -1424 Express -2 + a2 - a - 2a*2 + 35278a*4 - 35696a*4 + 0a*2 as na*2 + v + ya + ua4 + ga*3 and give g. 0 Rearrange -1957j*2 + 980j*2 + 980j*2 - 6010 to cj*2 + zj + d and give d. -6010 Express -5 + 8 + 1693m2 - 41m + 1691m2 - 3388m*2 as om*2 + vm + l and give v. -41 Rearrange (169b + 37b + 95b)(-19b - 386 + 386) to the form f + gb*2 + kb and give g. -5719 Rearrange -169 + 4b2 - 53b + 93 + 84 - 3b2 to xb*2 + db + c and give x. 1 Rearrange -8t - 15t*2 + t - 1393 - 51t + 1390 to zt + u + nt2 and give n. -15 Express -988 + i3 + 335 + 6i2 + 344 + 347 as gi + o + li3 + si*2 and give l. 1 Express 0a4 - a4 + 66a3 - 13a - 65a3 + 0a - 2a - 1 as wa*2 + y + na + za3 + ma*4 and give y. -1 Rearrange 7f*3 + 27f*2 - 10f*3 + 2f - 122 - 3f3 - 23f*2 + 5f*3 to the form qf + vf3 + wf*2 + p and give p. -122 Express 10g + g*3 + 185338g*2 - 185338g*2 - 2 as wg*2 + qg + hg3 + y and give h. 1 Express -s2 + 7s + 33s3 - 7s*3 + 2s*2 - 2s*4 - 7s*3 - 13s*3 in the form gs*2 + t + cs*3 + hs*4 + os and give c. 6 Rearrange (2y + 5y - 9y)(-50 + 50 + 894y2 + 3248y*2) to the form sy + qy3 + iy*2 + m and give q. -8284 Express 259092 + 37q*3 - 259092 - 3q + 2q4 as aq*3 + u + gq + sq4 + bq*2 and give g. -3 Rearrange 1 + 12u + 166u3 - 35u + 239u3 + 22u to nu + r + ju*2 + mu*3 and give m. 405 Rearrange -103w + 3 + 13w2 - 43w*2 + 13w*2 + 15w*2 - 5w to the form tw2 + m + iw and give i. -108 Express (-5x2 + 9x*2 + 2x*2)(-2218 - 3229 + 6524) in the form jx2 + tx + b and give j. 6462 Rearrange -492 + 248 + 241 - 53x - 86x to the form z + lx and give z. -3 Express (-32 - 10 + 45 - 39f)(-66f - 74f - 5f) as vf2 + x + hf and give h. -435 Rearrange -601 + 1222 + q*2 - 612 - q + 2q*3 - 13q to the form kq + c + nq*2 + pq*3 and give n. 1 Rearrange -50968a*2 + 27864a**2 + 2	{ "pile_set_name": "DM Mathematics" }
4 What is the greatest common factor of 1131700 and 1940? 20 Calculate the greatest common divisor of 626131 and 3883. 11 Calculate the highest common factor of 528 and 1206204. 12 Calculate the greatest common factor of 185890790 and 183. 61 Calculate the highest common divisor of 444540 and 384. 12 Calculate the greatest common divisor of 12064 and 30695717. 377 Calculate the greatest common factor of 568742894 and 32330. 6466 Calculate the highest common divisor of 4 and 4245382. 2 What is the highest common factor of 24037182 and 468? 234 What is the greatest common factor of 1 and 14567459? 1 Calculate the highest common divisor of 36 and 6075116. 4 What is the highest common divisor of 480 and 7783500? 60 Calculate the greatest common factor of 7565152 and 35. 7 What is the greatest common factor of 228 and 2275860? 12 What is the greatest common divisor of 37404392 and 1688? 1688 Calculate the highest common divisor of 53379253 and 64737. 7193 Calculate the greatest common factor of 2982 and 30974531. 497 Calculate the highest common factor of 76 and 10443255. 19 What is the greatest common divisor of 21932534 and 39? 13 Calculate the greatest common factor of 154 and 58438590. 14 What is the highest common factor of 1845070 and 224110? 3070 What is the greatest common divisor of 51324164 and 267? 89 What is the highest common divisor of 5936 and 6251896? 56 What is the highest common factor of 8379713 and 5? 1 What is the highest common factor of 23066826 and 5118? 5118 What is the greatest common divisor of 7122157 and 11416? 1427 Calculate the highest common factor of 312 and 3879499. 13 What is the highest common divisor of 16 and 7647192? 8 Calculate the greatest common factor of 1795 and 73237795. 1795 Calculate the highest common factor of 251345 and 646. 17 Calculate the highest common factor of 50533847 and 26. 13 Calculate the highest common factor of 10 and 53418710. 10 What is the greatest common divisor of 196705167 and 123? 123 What is the greatest common divisor of 111 and 11449354? 37 What is the highest common factor of 11008 and 2097152? 256 Calculate the highest common divisor of 235942026 and 178. 178 What is the highest common factor of 77486 and 37672? 34 What is the greatest common divisor of 1100 and 3766708? 44 Calculate the highest common divisor of 4800052 and 68. 68 Calculate the greatest common factor of 687995640 and 2547. 2547 What is the highest common divisor of 8733584 and 32? 16 What is the highest common divisor of 940 and 1272280? 20 Calculate the highest common divisor of 81184 and 1816. 8 Calculate the highest common factor of 1394 and 8974736. 82 What is the highest common factor of 422 and 4594103? 211 What is the greatest common divisor of 8507348 and 1484? 212 What is the highest common divisor of 195 and 301857673? 13 What is the greatest common factor of 1170 and 17167358? 26 Calculate the greatest common divisor of 328 and 15538180. 164 What is the greatest common divisor of 13 and 998608? 13 What is the greatest common divisor of 20 and 23375930? 10 What is the greatest common divisor of 12984 and 2590818704? 4328 Calculate the highest common factor of 35160054 and 276. 138 Calculate the greatest common divisor of 12456 and 306920. 8 What is the highest common divisor of 11361 and 25459? 7 Calculate the greatest common divisor of 23528 and 240767906. 5882 Calculate the greatest common factor of 861 and 2304204. 21 Calculate the greatest common divisor of 2065 and 13028435. 35 What is the highest common divisor of 19722 and 5328746? 346 What is the greatest common divisor of 48234197 and 11? 11 Calculate the highest common factor of 15616 and 15173872. 976 Calculate the greatest common divisor of 401098 and 9287. 251 Calculate the greatest common factor of 1064990 and 188270. 2810 Calculate the highest common factor of 14171980 and 188. 4 What is the highest common divisor of 6612931 and 1066? 533 What is the greatest common divisor of 21664556 and 846? 94 What is the greatest common divisor of 2219 and 5500267? 317 Calculate the highest common divisor of 48670714 and 46. 46 Calculate the greatest common divisor of 60 and 95612870. 10 What is the highest common divisor of 777 and 24773091? 777 Calculate the greatest common factor of 4360 and 1551833. 109 Calculate the highest common factor of 439671 and 1717. 17 What is the highest common factor of 45703 and 36901908? 6529 Calculate the greatest common factor of 102 and 136870383. 51 What is the greatest common factor of 329 and 77469583? 47 What is the greatest common divisor of 1776 and 10525808? 16 What is the highest common factor of 42480060 and 11760? 2940 Calculate the highest common factor of 62959542 and 659. 659 Calculate the greatest common divisor of 1483 and 155324971. 1483 Calculate the greatest common divisor of 37441820 and 272. 68 Calculate the greatest common factor of 12720 and 35760. 240 What is the greatest common divisor of 1042259865 and 1335? 1335 Calculate the greatest common factor of 4059244 and 6860. 28 What is the highest common divisor of 4725320 and 187000? 680 What is the highest common divisor of 916827432 and 36? 12 Calculate the highest common factor of 26677043 and 14237. 619 Calculate the highest common divisor of 5659980 and 383955. 2685 Calculate the highest common factor of 188043201 and 108. 27 Calculate the highest common divisor of 7463338 and 2752. 86 What is the greatest common factor of 40289374 and 74? 74 Calculate the highest common divisor of 28576 and 1881692. 188 Calculate the highest common divisor of 3045530 and 20. 10 What is the greatest common factor of 6485808 and 686469? 2037 What is the highest common divisor of 11833757 and 31707? 3523 Calculate the greatest common divisor of 281321360 and 592. 592 What is the greatest common divisor of 4278540 and 1540? 140 Calculate the greatest common factor of 28350396 and 2988. 36 What is the greatest common divisor of 3365 and 769239? 673 Calculate the greatest common factor of 29706331 and 445. 89 Calculate the highest common divisor of 2826 and 8635. 157 Calculate the highest common divisor of 380851 and 91572523. 8857 What is the highest common factor of 163994032 and 24? 8 Calculate the greatest common factor of 2122054 and 1826. 22 What is the greatest common divisor of 663 and 5960747? 13 Calculate the greatest common divisor of 330179 and 9125. 73 Calculate the greatest common factor of 145722158 and 313. 313 What is the greatest common factor of 11568 and 1401? 3 Calculate the highest common divisor of 44291 and 13052217. 3407 Calculate the highest common divisor of 125492 and 185261. 229 Calculate the highest common factor of 1400385 and 35560. 35 What is the greatest common divisor of 9584868 and 5517? 1839 What is the greatest common divisor of 315 and 1281890505? 105 What is the greatest common divisor of 808007229 and 4626? 2313 What is the highest common divisor of 186231 and 21965? 23 What is the greatest common factor of 80410056 and 1704? 1704 What is the highest common divisor of 3472120 and 5560? 40 What is the greatest common factor of 152978 and 1503026? 686 What is the highest common factor of 55606270 and 4566? 1522 Calculate the greatest common divisor of 11895348 and 2064. 516 Calculate the greatest common divisor of 81174 and 514428. 978 Calculate the highest common factor of 4344 and 682152. 24 Calculate the highest common divisor of 18 and 530798274. 18 What is the greatest common divisor of 133648 and 52? 4 Calculate the highest common factor of 141645267 and 6. 3 Calculate the highest common divisor of 80181490 and 3815. 545 What is the greatest common divisor of 5337 and 17058831? 1779 What is the greatest common divisor of 359 and 236042141? 359 Calculate the greatest common divisor of 9167 and 11369661. 89 Calculate the highest common factor of 319509502 and 121914. 13546 Calculate the greatest common factor of 265 and 266330. 5 What is the highest common factor of 1007 and 114969? 19 Calculate the greatest common factor of 182649099 and 3954. 1977 Calculate the greatest common divisor of 541904 and 40304. 176 Calculate the highest common factor of 2234542 and 57753. 713 What is the greatest common divisor	{ "pile_set_name": "DM Mathematics" }
uch that 96 - 2b3 - b3 - 34b*5 - 768b + 0b3 + 1146b*2 - zb*2 - 228b*4 - 5b*5 = 0. -4, 2/13, 1 Let g(u) be the second derivative of 9u*5/40 - 8u*4/3 + 19u*3/36 + 7u*2/6 - 394u + 3. Factor g(j). (j - 7)(3j - 1)(9j + 2)/6 Suppose 0 = l - 98y + 100y - 21, y + 3 = 4l. Let v(g) be the third derivative of 0g - 37/12g4 + 0 - 10/3g*l - 40g*2 - 7/30g*5. Factor v(w). -2(w + 5)(7w + 2) Let l be 6/(-84)-710. Suppose -20p2 + 130p - 35p2 - 75 + 12p*3 - l - 7p*3 = 0. What is p? 1, 2, 8 Solve 4996r - 9360006 - 2/3r2 = 0 for r. 3747 Let w be (20 - 0)(-137 + 117741/858). Factor -26/11 - 2/11d3 + wd - 2d2. -2(d - 1)*2(d + 13)/11 Let l(q) be the second derivative of -q*6/135 + 8q*5/45 - 5q*4/18 + 2q + 450. Factor l(j). -2j2(j - 15)(j - 1)/9 Let s(f) = -f2 + 4f. Let v(i) = -4i4 - 16i*3 + 2i*2 + 24i. Let h(k) = 2s(k) - v(k). Let h(j) = 0. Calculate j. -4, -1, 0, 1 Factor 110m - 182m2 - 49/2m*3 - 16. -(m + 8)(7m - 2)2/2 Let r = -572 + 574. Suppose 11v + rv = 52. Solve -vt*3 + 8t*2 - 4/3t*4 + 112/3t + 32 = 0. -2, 3 Let m(w) be the first derivative of w4/4 - w3/3 - 21w2/2 + 45w + 5058. What is f in m(f) = 0? -5, 3 Let c(y) be the third derivative of y*5/60 - 7y*4/24 - 49y*3/3 - 15y*2 + 16y. Find z such that c(z) = 0. -7, 14 Suppose -4q + 53795 = -3h, 3q + 11h - 40349 = 16h. Let 272i - 187i - 2i*2 + 243i - q = 0. What is i? 82 Suppose -5b = -1 - 14. Let y = 109 + -107. Factor yv - 9vb + 3v*3 + 2v*5 + 2v*3. 2v(v - 1)2(v + 1)*2 Let r(x) be the third derivative of -1922x*3 + 0x - 1/20x5 + 31/2x*4 + 0 + 153x*2. Factor r(c). -3(c - 62)*2 Let g be (2104/1578)/(15/36). Factor 72/5o*3 + 6/5 - 58/5o*4 + go*5 - 28/5o*2 - 8/5o. 2(o - 1)4(8o + 3)/5 Let j(a) be the third derivative of a7/2240 + 3a*6/160 + 3a*5/16 + 7a*4/8 + 41a*3/3 - 94a*2. Let m(i) be the first derivative of j(i). Factor m(v). 3(v + 2)*2(v + 14)/8 Let w(x) = -x*3 + 18x*2 - 69x + 595. Let p be w(16). Let i(q) be the second derivative of 0q2 - 1/9q*p + 38q + 0 - 1/90q4. Factor i(l). -2l(l + 5)/15 Let a(u) = -u2 + u - 1. Let j be (-86)/(-129) + (-5)/3. Let m(n) = 3n*2 + 8n + 11. Let s(k) = jm(k) - 2a(k). Determine g, given that s(g) = 0. -9, -1 Suppose 981603l + l4 + 516l*2 - 982619l + 672 + 0l4 - 90l*3 = 0. What is l? 2, 84 Let o(c) be the first derivative of -2c*3/57 - 15c*2/19 + 2852c/19 - 3218. Factor o(n). -2(n - 31)(n + 46)/19 Let p(l) be the second derivative of l*5/4 - 25l*4/12 - 35l*3/3 - 1070l. Factor p(m). 5m(m - 7)(m + 2) Let c = 6760636081/11549115655 - -6/7673831. Let q = c + -3/215. Find b such that -4/7b + 24/7b3 - qb*2 + 0 = 0. -1/3, 0, 1/2 Let v(r) be the first derivative of 0r + r*2 - 70 - 2/3r*3. Factor v(z). -2z(z - 1) Let k(t) be the first derivative of -14t*2 + 52t + 1/3t3 + 259. Factor k(y). (y - 26)(y - 2) Let j(d) be the second derivative of d*7/126 + 13d*6/360 - 37d*5/240 - 53d4/72 - d3/3 + 7926d. Solve j(m) = 0 for m. -4, -2, -1/4, 0, 3 Let x = 1537411/7 - 219613. What is m in x + 4/7m*2 + 52/7m = 0? -10, -3 Let g be 0(6 + -7)/1. Suppose g = 3o + 2k - 13, -37k + 35k = -5o + 27. Find h such that 0 + 6/7h3 - 6/7h*4 - 2/7h*2 + 0h + 2/7ho = 0. 0, 1 Let w(i) be the first derivative of 5i*2 + 6i - 39 - 1/2i4 + 2/3i*3. Factor w(k). -2(k - 3)(k + 1)2 Let y(d) be the first derivative of -d6/84 - d5/420 + d4/42 - 50d*3/3 - 93. Let m(x) be the third derivative of y(x). What is u in m(u) = 0? -2/5, 1/3 Let p = 54 + -46. Suppose 0 = i + 5n - p, 3i - 4 = 5n - 0. Factor -17gi - g5 + 3g*4 + 7g - 3g2 - 5g + 16g3. -g(g - 2)(g - 1)2(g + 1) Let i(h) be the third derivative of -10h2 - 1/60h*5 + 0h + 4 - 1/6h4 + 0h*3. Factor i(n). -n(n + 4) Let z be -1 + 3 - 20448/10240. Let p(q) be the third derivative of -1/560q7 + 0q*4 + 0 - 4q*2 + 0q*3 + zq*6 + 0q + 1/80q5. Factor p(b). -3b*2(b - 2)(b + 1)/8 Let s(y) be the second derivative of -y6/135 - 34y*5/3 - 14450y*4/3 + 3621y. Let s(j) = 0. Calculate j. -510, 0 Let k(l) = l*2 - 182l + 3255. Let j be k(20). Solve 5/3i3 + 0 - 50/3i + ji2 = 0. -10, 0, 1 Suppose 0 = -99q + 240q. Let c(h) be the third derivative of -1/330h*5 + 13h*2 + 0h + 0h4 + q + 4/33h*3. Factor c(d). -2(d - 2)(d + 2)/11 Let t(d) = d3 + 5d*2 + 5d + 7. Suppose -2v + 0 - 8 = 0. Let k be t(v). Factor 0w*3 - 5w5 + wk + 4w5. -w3(w - 1)(w + 1) Let u(y) be the first derivative of -6y*2 + 8y - 3/8y4 - 70 + 13/6y*3 + 1/40y*5. Suppose u(p) = 0. Calculate p. 2, 4 Let s(r) be the first derivative of 0r - 200 - 1/14r4 + 4/7r*3 - 8/7r*2. Determine f so that s(f) = 0. 0, 2, 4 Suppose 2s = 4j + 146, s + 200 = -10j + 5j. Let o be 6/j + 7/((-364)/(-424)). Factor 4t*3 + 3t5 + t5 - 6t3 + ot*4 + 6t*3. 4t*3(t + 1)*2 Suppose -12b = -13b + 2. Suppose 17 = bn - n - 5r, -2n + r = -7. Find d such that -4dn - d3 + d3 - 3d3 + d3 = 0. -2, 0 Let w(q) = -193q3 - 2206q*2 - 43524q - 18262. Let x(m) = 80m3 + 1102m*2 + 21762m + 9130. Let d(t) = 2w(t) + 5x(t). Factor d(c). 2(c + 39)2(7c + 3) Suppose 15x*2 - 27/2x - 3/2x4 - 3/2x*5 + 15x*3 - 27/2 = 0. What is x? -3, -1, 1, 3 Let r be (48/308)/(234/286). Let g(l) be the second derivative of 0l*2 - 7l + 0 + 4/21l3 + 1/105l*6 + 1/14l*5 + rl*4. Factor g(k). 2k(k + 1)(k + 2)*2/7 Let v(h) be the first derivative of 3h*5/5 - 33h*4/4 + 39h*3 - 135h*2/2 - 461. Factor v(o). 3o(o - 5)(o - 3)*2 Let a(o) be the second derivative of -10/3o*3 + 1/6o*4 - 84 + 2o + 24o2. Factor a(p). 2(p - 6)(p - 4) Let y(x) = 8x*3 + 1826x*2 + 1226x + 10. Let s(w) = -9w3 - 1826w*2 - 1228w - 12. Let f(b) = 5s(b) + 6y(b). Determine p so that f(p) = 0. -608, -2/3, 0 Let x(m) be the first derivative of 0m5 + 16m*2 + 0m - 4m4 + 0m*3 + 43 + 1/3m*6. Factor x(k). 2k(k - 2)2(k + 2)*2 Let b(t) be the first derivative of -7/6t*4 - 11t + 6/5t2 + 11/15t*3 + 4. Let n(u) be the first derivative of b(u). Determine i, given that n(i) = 0. -2/7, 3/5 Let q(m) be the second derivative of 10m*3 - 2/21m*7 - 14/5m*5 - 9m - 13 + 50m2 - 34/3m*4 + 6/5m*6. Determine u, given that q(u) = 0. -1, 1, 5 Let s = 32337 - 64673/2. Find v, given that 3/8 + sv*2 - 13/8v = 0. 1/4, 3 Suppose -1449s + 1443s + 120 = 0. Let d = -39 - -70. Factor -50r2 + dr + s - 11r + 55r*2. 5(r + 2)2 Let f(g) be the first derivative of -g4/2 + 670g3/3 - 28223g*2 + 55778g + 1772. What is k in f(k) = 0? 1, 167 Let m(o) = o*2 - 3o. Let c(i) = 17i + 104. Let g be c(-6). Let r(v) = -4v*2 + 10v - 2. Let b(p) = gm(p) + r(p). Factor b(d). -2(d - 1)*2 Let y be ((-44)/18 + 2)2358/(-524). Let j = 39 - 23. Factor -20t + 21t*3 - 42t*3 + 20t*y + jt*3. -5t(t - 2)2 Let f(w) = -1934w + 3868. Let u be f(2). Suppose 5p - 15 - 5 = 0. Find a, given that -18a*2 + 6a*3 - 2/3a*p + u + 18a = 0. 0, 3 Let w(u) be the second derivative of -2u6/195 + 31u*5/130 - 46u*4/39 + 33u*3/13 - 36u*2/13 + 4677u. Solve w(t) = 0. 1, 3/2, 12 Suppose -53 - 1046 = -3i - 5s, 2s - 1484 = -4i. Factor 269 + 197 + 34 - 327l - il + 245l2. 5(7l - 10)2 Let v(c) = 3c*2 - 2c + 1. Let q be v(1). Let i = 495668/743529 + 6/247843. Let -4/3 - 2b - ib*q = 0. Calculate b. -2, -1 Suppose 29l - 16l - 91 = 0. Suppose 3t + l - 1 = -2s, 3s + 6 = -3t. Factor 2/11h*2 + s - 2/11h. 2h(h - 1)/11 Suppose -9 = -3u, -21 = -y + 3u - 10. Determine i, given that 24i + yi*2 - 29i*2 + 13i*2 + 3i*3 + 23i*2 = 0. -8, -1, 0 Let i = -29/133 - -124/133. Let h(c) be the first derivative of -9/14c*2 - 3/28c*4 + 0c + 3/35c5 - ic*3 + 21. Suppose h(u) = 0. What is u? -1, 0, 3 Let -156/5v*3 - 16/5v*4 + 1164/5v - 136/5v2 - 56 = 0. Calculate v. -7, -5, 1/4, 2 Let g(x) be the third derivative of x5/12 - 25x*4/4 - 340x*3/3 - 84x*2 - 6. Suppose g(d) = 0. What is d? -4, 34 Determine o, given that 1/2o*2 + 37/2o + 18 = 0. -36, -1 Let u(i) = 153*	{ "pile_set_name": "DM Mathematics" }
-0.2 (b) 4/23 (c) 0 (d) 50 (e) 2 a What is the closest to -127 in 0, -3/203, 2/3, 5, -1? -1 Which is the closest to 1? (a) 1.7 (b) -9439 (c) 17 (d) -3/5 a What is the nearest to 1.6 in 1/6, 1/186, 3, -4/9, 7/2? 3 Which is the closest to 2? (a) -0.3 (b) -0.0985 (c) -2 (d) -6.6 (e) -0.2 b Which is the nearest to -0.2? (a) 33/2 (b) 3/7 (c) 5 (d) -1.3 (e) -79 (f) -3 b What is the closest to 0.1 in 6, -1, 117, 3, 2? -1 Which is the closest to 282635? (a) 3/5 (b) -8/7 (c) 3 c What is the closest to -0.2 in -1/15, -3/4, 3/7, 50, 0.1742? -1/15 Which is the nearest to 1? (a) 1/8 (b) -2/3 (c) -6 (d) -5/10072 a What is the closest to -0.1 in -79, -1, -89, 1, -1.9? -1 Which is the closest to -4225? (a) 2/1385 (b) 8 (c) -2/11 c Which is the nearest to -3.5? (a) -60 (b) -18 (c) 3/2 (d) 0.05 (e) -0.1 e What is the nearest to -3 in 2/5, 0.1259, -21/8, 0? -21/8 Which is the nearest to -1.72326? (a) 4 (b) 2/23 (c) 4/5 (d) 2 b Which is the nearest to 4.5? (a) -304 (b) -4781 (c) -5 c Which is the nearest to 1? (a) -3 (b) 129 (c) 837/8 (d) 0.5 d What is the closest to 3 in 69301, 252, 5, 2/9? 5 Which is the closest to 0.1? (a) 231 (b) -139 (c) 1 (d) 0.7 (e) -5 d Which is the nearest to -2/9? (a) -12 (b) -0.047 (c) 3/2 (d) 4 (e) 5/8 b What is the closest to -202 in 65, 3, -0.4, 5/3, -0.1? -0.4 What is the nearest to 0 in -3, 192/89, 0, -0.2, -4, 41? 0 Which is the nearest to 0? (a) 6742 (b) 1/4 (c) -3/2 (d) 0 d What is the nearest to -307 in -85, 3, 9/4? -85 Which is the closest to -1? (a) -5 (b) -2919 (c) 0.08 (d) -1/2 d Which is the closest to -1/53? (a) 498 (b) 0 (c) -4 (d) -5/4 b What is the closest to 3 in 0.04, -2, 1/12, -1/4, 2182? 1/12 What is the closest to -1/2 in 1/4, 6/11, 12667/47? 1/4 Which is the nearest to 2/7? (a) 1 (b) 3 (c) -9.24 (d) -1.87 a Which is the nearest to -1.81872? (a) 3 (b) -5 (c) -0.1 c What is the nearest to -7 in 3, 0.2, 169, -30? 0.2 What is the nearest to 4 in 0, 6, -40/3, 5/3, 5/43? 6 Which is the nearest to -17? (a) -4/3 (b) 15.15 (c) 1/4 (d) -0.1 a Which is the closest to 0? (a) -0.09 (b) 0 (c) 3 (d) 227/8 (e) 2/5 (f) 0.031 b Which is the closest to -5/48? (a) -0.3 (b) 5 (c) -6 (d) 0.1 (e) 0.01 e What is the closest to 0.1 in 0, 690, -4.5, -0.3, 4? 0 Which is the nearest to -7/3? (a) -0.1 (b) -2 (c) -4 (d) 10 (e) -0.2 (f) 487 b Which is the nearest to 2/507? (a) 7 (b) 0 (c) -663 b What is the closest to 0.0294458 in 2/31, 0.5, 2, -4/7? 2/31 What is the closest to -1/32 in 2/15, 5, -1, -5? 2/15 What is the closest to 1 in -133, -4, 3274? -4 What is the closest to 1 in 2675, -1/6, -5, 0.19? 0.19 Which is the closest to 1? (a) -3 (b) -3/7 (c) -0.4 (d) 0.0952 (e) -34.7 d Which is the nearest to -21? (a) -0.4 (b) 1/10024 (c) -0.05 (d) -1 d Which is the nearest to -2958? (a) 3/5 (b) 0.1 (c) -5 (d) 0.4 (e) -12/5 (f) 5 c Which is the nearest to 2? (a) 2 (b) -3 (c) 0.1 (d) 9.01738 (e) 1/9 (f) -2 a Which is the nearest to 2/49? (a) -2/3 (b) 665/2 (c) 2 (d) 3 a Which is the closest to -3? (a) 2 (b) -7 (c) -2/2885 (d) 0.5 (e) 0.4 c What is the closest to -7 in 219, -18/5, 0.0556? -18/5 Which is the nearest to 4152? (a) 0.7 (b) -1/25 (c) 3 (d) 0 (e) -3 (f) -2/11 c What is the closest to -25 in -3/79, -5, -13/20, -1/2, -4, 12? -5 Which is the closest to 0.62? (a) 0.09 (b) 2/15 (c) -0.207978 b What is the nearest to 1/339 in -7, -2, 5, -1/5, 1/5? 1/5 What is the nearest to -0.43 in -8.577, -5/13, -3/2? -5/13 Which is the nearest to -7? (a) -16/3 (b) 0.6 (c) 12/13 (d) 2 a What is the nearest to 4/7 in 3/2, 1/2, 568/57, 2, -0.2? 1/2 Which is the nearest to 1/3? (a) -0.2 (b) 5 (c) -0.06 (d) -0.5 (e) -0.3 c Which is the nearest to 2? (a) -0.4 (b) 0.2 (c) 1/7 (d) 26/7 (e) 3696 (f) -2/7 d Which is the closest to -37? (a) -3/5 (b) -0.5 (c) -353 (d) 3.4 (e) 0 a Which is the closest to -3/2? (a) -74 (b) -2/13 (c) -2 (d) -2564 c What is the nearest to 0.1 in 1, -2/5, 4064229? -2/5 What is the nearest to -3/17 in -2/9, 1/4, 5, -712.21, 12? -2/9 What is the closest to -8.77 in 0.5, -8, -208? -8 Which is the closest to -0.114? (a) 0 (b) -2 (c) 1 (d) -26 (e) 0.2 (f) 37 a What is the nearest to 5.9069 in 18, 0, 3? 3 What is the nearest to -1295.85 in 3, 3/2, 2/3? 2/3 Which is the closest to -0.1? (a) 11 (b) 4/11 (c) 1/57 (d) 22 c What is the nearest to 2 in -1/3, -555, -8, 8, -3/5, 13? -1/3 What is the nearest to 0.04 in -1/8, -1, -5.6, -7/5? -1/8 What is the nearest to 0.056 in -3/4, 0.4, -1/6, -88? -1/6 Which is the nearest to 0.6? (a) 59/51 (b) 3 (c) 1/2 (d) -1 (e) 0 c Which is the nearest to 0.12? (a) -6 (b) 14 (c) -1/2 (d) 12.7 (e) 2 c Which is the closest to 0.06? (a) -55.9 (b) 10 (c) 3 (d) -0.4 (e) -2/7 e What is the nearest to 0.1 in -1865, -15, 11/4, 4, -2/19? -2/19 Which is the nearest to 29.56? (a) -205 (b) 1/7 (c) -8/3 (d) 1 d What is the closest to 74 in 0.3, -2, -0.34, -16? 0.3 Which is the nearest to 13869? (a) 10 (b) 148 (c) -3 b What is the closest to -8 in 110, 10/3, 0.5? 0.5 What is the nearest to -7 in 7, 2, -52.28, 0.3? 0.3 Which is the nearest to 0? (a) 1/13 (b) 8/6437 (c) 0.13 b Which is the closest to 2/7? (a) 36 (b) 0.5 (c) 28 (d) -5 b What is the closest to -1 in 2/9, 0.05, -1, 0.26584? -1 Which is the nearest to -0.3? (a) -1/38 (b) 341 (c) 2 (d) 0.3 a What is the nearest to 0.25761 in -2/7, -4, -0.12, -1/2, 1/6? 1/6 Which is the closest to 1.6? (a) 0.4 (b) 7 (c) -4 (d) 56 a What is the nearest to 24 in 1, -3/4, 5, -0.024, -62? 5 What is the nearest to -1/5 in -6.109, 57, -4? -4 Which is the closest to -3? (a) -232.423 (b) 0.5 (c) -0.1 c What is the nearest to -1 in 2873, -3, 513, -0.5? -0.5 Which is the closest to -13151? (a) 141 (b) -0.5 (c) -0.1 (d) -1 d What is the nearest to -4/9 in 9/34, 31/5, -0.4? -0.4 What is the closest to -2/133 in -40, 3, 209, 0.3? 0.3 What is the nearest to 0 in -0.4, -2/29, -1/2, 661? -2/29 What is the nearest to 2 in 0.3, 1/13, -5, 185, 50/7? 0.3 Which is the closest to 2/3? (a) -4 (b) 1.27 (c) 12 (d) 0.2 (e) -261 d What is the closest to -1 in -1/6, 1, 2, -5, -9621934? -1/6 What is the nearest to 2/5 in -2189, 5/4, 1, 5? 1 Which is the closest to -1? (a) -6 (b) 2/3 (c) 6/5 (d) 44 (e) -0.4 e What is the closest to -11/5 in 4.1, -306, -5, -4, 0.3? -4 Which is the closest to 2? (a) 2/7 (b) -0.27 (c) 1/18 (d) 0.3 (e) -124 d What is the nearest to 984 in 180, 3, 2/5, -4, -5? 180 What is the closest to 72847 in -38, -5, -1/29? -1/29 What is the nearest to -2 in 0, -124617, -0.2, 5? -0.2 Which is the closest to -1? (a) 5 (b) -0.5 (c) 656 (d) 4/7 (e) -1/25 (f) -340 b Which is the closest to -0.1? (a) 303 (b) -159 (c) 5 (d) 0.4 (e) -227 d What is the closest to 0 in 0.1, 3, -6, -0.037, 0.87? -0.037 Which is the nearest to 251? (a) -10/49 (b) 0.02 (c) 2/5 c What is the nearest to -8 in 7462, -2, 4? -2 Which is the nearest to 10? (a) 123 (b) 16 (c) 2/9 (d) -2/21 (e) 0.2 (f) -1/3 b Which is the closest to 0.47? (a) 17/4 (b) 2/9 (c) -20 (d) 0.6 d Which is the closest to -9? (a) 1/33 (b) 1.1 (c) 3 (d) -4 (e) -81/2 d Which is the closest to -1? (a) -1/134 (b) -1/18 (c) 2/21 (d) 9 (e) -3 b What is the nearest to -2 in -2/591, 0.4, -2197? -2/591 Which is the closest to 4? (a) 3/19 (b) -69737 (c) 3 c What is the closest to -1608 in -5, -1, -3, 0.4, -354/13, 3? -354/13 Which is the nearest to 6? (a) 20156 (b) -6/13 (c) 2/21 c Which is the closest to -1.3? (a) -1 (b) 16/5 (c) -1.2044 c What is the nearest to -2 in -7, 2/11, 2/83, 2/781? 2/781 Which is the nearest to 2562289? (a) -3 (b) 2/13 (c) 1/13 b What is the closest to 75 in 319, -7, -2/7, -5? -2/7 What is the nearest to 1697 in -0.5, 0.13, 35/121? 35/121 What is the nearest to -15 in -88, 5, 1? 1 What is the closest to 3 in 1031, -1, -2, -3/5, 4? 4 Which is the nearest to -39? (a) 1 (b) -3019 (c) -5 (d) 2/5 (e) -1/8 (f) 2 c Which is the nearest to -0.67? (a) 46732 (b) -5/3 (c) -2 b Which is the closest to 0.5? (a) -39 (b) 8 (c) -208 (d) 0.3 d Which is the nearest to 0.01? (a) 1/7 (b) -130 (c) -3/10 (d) -5/6 (e) 0.08 e Which is the nearest to 18/67? (a) -4 (b) 17 (c)	{ "pile_set_name": "DM Mathematics" }
Round d to zero dps. 4 Let z = -1.3 - -1.34. Let u = 0.19 - z. Let o = 0.15055 - u. What is o rounded to 4 dps? 0.0006 Suppose 7a - 106 + 43 = 0. Suppose -aw = -w + 25600. Round w to the nearest one thousand. -3000 Let a = -0.0638 + 47.3638. What is a rounded to the nearest integer? 47 Let g = -59 - -39. Let b be 12/(-30)g/2. Suppose bi - 11100 = j, 3j = -5i - 13674 - 19626. What is j rounded to the nearest 1000? -11000 Let x = 2.218002617 + -2.218. What is x rounded to seven decimal places? 0.0000026 Let r = 4300 + -1570. Suppose r = c + 5n, 0c + 2c = 5n + 5400. What is c rounded to the nearest 100? 2700 Let s = 1.295 - 1.297146. What is s rounded to four dps? -0.0021 Let x = -167 - -270. Let l = -101.66 + x. What is l rounded to one decimal place? 1.3 Let t = 1046 + -1062.56. What is t rounded to one decimal place? -16.6 Suppose 122 = 4q - 22. Suppose -qd + 350000 = -37d. Round d to the nearest one hundred thousand. -400000 Let g = 53.063 + -0.063. Let y = -52.9988 + g. Round y to 3 decimal places. 0.001 Let u = 637.999262 - 638. Round u to 4 decimal places. -0.0007 Suppose -z + 4n + 3850020 = 0, 7700010 = 2z - n - n. Round z to the nearest one hundred thousand. 3900000 Let u(k) = -k3 - 7k*2 + 6k - 16. Let h be u(-8). Let w be h/1 + (-802900)/(-7). Round w to the nearest ten thousand. 110000 Let c = -0.073 - -0.263. Let p = -0.149 + c. What is p rounded to 2 decimal places? 0.04 Let r = 70.000000082 + -70. Round r to 6 dps. 0 Suppose -r = -4 + 2. Suppose -i - 58399988 = -3c, -rc - 58400016 = i + 2c. Round i to the nearest one million. -58000000 Let v = 128.999946 - 129. What is v rounded to four dps? -0.0001 Let f = -767 - -767.0593. Round f to 2 decimal places. 0.06 Let r be (-5759776)/(-36) - (-4)/18. Suppose -r = -2p + 3q, 3q = 2p - 5p + 240006. What is p rounded to the nearest one hundred thousand? 100000 Let i = -0.012875 - -0.03887376. Let w = i + -0.026. What is w rounded to seven dps? -0.0000012 Let h be 6/(-10) + (-8 - (-260073)/55). Round h to the nearest one thousand. 5000 Let m = -348908 + 349238.407. Let x = m - 330. Round x to 1 decimal place. 0.4 Let f = -37.2 - 112.7. Round f to the nearest integer. -150 Suppose -5x - 699985 = 4l, -12 = x - 5x. Round l to the nearest 10000. -180000 Let y = -0.18387 - -76.51387. Let q = y + -76. Round q to 1 dp. 0.3 Suppose 46d - 632984 = b + 42d, 4b + 2531984 = 4d. Round b to the nearest ten thousand. -630000 Suppose -2m + 11242 = -4374. Suppose -10509 = -3w + 1167. Suppose w = -3z - m. Round z to the nearest 1000. -4000 Let f(a) = -a*2 - 4a + 6. Let h be f(-7). Let j = h + 15. Suppose -6300000 = 3k - jk. What is k rounded to the nearest one million? -2000000 Let y = -1.422 + 1.4220002064. Round y to seven dps. 0.0000002 Let c(w) = w - 3w - w - 2 - 2w - 245002w2. Let b be c(-2). What is b rounded to the nearest 100000? -1000000 Let i = 0.771232 + -0.82623139. Let t = i + 0.055. What is t rounded to seven dps? 0.0000006 Let o(w) = -5w + 7. Let x be o(4). Let t = x - -16. Suppose -4d = ty - 87, 5d = 3d - 4y + 56. What is d rounded to the nearest 10? 20 Suppose p = r - 70073 - 71648, -p - 283447 = -2r. Suppose -6d - 641167 = -96811. Let s = r + d. What is s rounded to the nearest 10000? 50000 Let x = 286 + -144. Let b = 142.0000095 - x. What is b rounded to six decimal places? 0.00001 Let i = 24.74 + -65.43. What is i rounded to the nearest ten? -40 Let b be (-1544 + -4 + 2)10/(-20). What is b rounded to the nearest 10? 770 Let x = -11354 - -7258. Let a = x - -7156. Suppose 0 = j - 0c + 3c - a, -3c - 15300 = -5j. What is j rounded to the nearest 100? 3100 Suppose 698345 = 5x - 5j, x + 4j - 2j = 139663. Let k be x/(-11) - 3/1. Let w be k(-9)/((-9)/(-10)). Round w to the nearest ten thousand. 130000 Let i = 0.695 - 0.6948226. Round i to 5 dps. 0.00018 Let u = -33.6 - -0.6. Let n = u - -31.975. Let v = n - -1.1. What is v rounded to 2 decimal places? 0.08 Let g = 2139.173 - 2138.2030284. Let k = -0.97 + g. What is k rounded to 5 decimal places? -0.00003 Let l = -20 - -25. Suppose 4w = 2w + 5z, 0 = lw - 5z. Let d be 3 - w - (-2 + 5). What is d rounded to two decimal places? 0 Let v = -15662.92999952 + 15662.77. Let d = -0.16 - v. Round d to 7 dps. -0.0000005 Suppose 2m + 2w - 13820 = 0, 2m - 27645 = -2m - 5w. Let i = m - 3855. Round i to the nearest one hundred. 3100 Let v = -31.74 - -32. Let l = v + -0.11. Let h = l + -0.14999992. What is h rounded to seven dps? 0.0000001 Let n = -246 + 387. Suppose 2b + n = -b. Round b to the nearest ten. -50 Let r = 919.53958869 + 20.84419241. Let y = -930.38378 + r. Let k = -10 + y. Round k to seven decimal places. 0.0000011 Let c = -3929141 + 1473891. Let d = c - -2455115.9933. Let q = -134 - d. Round q to 3 decimal places. 0.007 Let q = -93320 - -92882.89. Let c = -439 - q. Round c to one dp. -1.9 Let n = -222.3 - -239. Let w = 15.83 - n. What is w rounded to one decimal place? -0.9 Let i = -1.3 + 2.8. Let f = 1.533 - i. What is f rounded to 2 dps? 0.03 Let s = 49 - 71. Let p = -26546765 + 26546743.000042. Let d = s - p. Round d to five decimal places. -0.00004 Suppose -4y + 197 = -3. Let m be (-4)/10 - 730/y. Let c be 176/3m/(-2). Round c to the nearest one hundred. 400 Let m(i) = 466135i2 - i - 2. Let v be m(-1). Let p = 278134 - v. Round p to the nearest 10000. -190000 Let k = -3.176 - -3.1. Let f = k + -33.924. Let s = f - -34.0000002. Round s to seven decimal places. 0.0000002 Suppose -2y + 21 = 3z + 2y, 0 = z - 5y - 7. Let i(c) = c2 - 23c - 1. Let l be i(z). Round l to the nearest 10. -110 Let s = -87800151 - -87800128.9999956. Let d = s + 22. Round d to 6 dps. -0.000004 Suppose -3m = -s + 3960000, 2m = -9s + 5s - 2640000. Round m to the nearest one million. -1000000 Let s = -4 + 9. Let i = 1343 - 1305. Suppose i = 3x + s. Round x to the nearest ten. 10 Let d = -0.0122773 - -0.01265. What is d rounded to five dps? 0.00037 Let u = 9.319 + -0.159. Let l = 9 - u. Let t = l - -0.160119. What is t rounded to 5 decimal places? 0.00012 Let m = -51 + 53.7. Let t = m - 2.699924. Round t to five decimal places. 0.00008 Let o = -23 + 42. Let l = -18.924 + o. What is l rounded to two decimal places? 0.08 Let f be 133/21 + (-1)/3. Suppose 5s - fs - 102994 = 0. Let o be s - (-6)/(-3) - 4. What is o rounded to the nearest ten thousand? -100000 Let w = 121.05 - 120. Round w to 1 decimal place. 1.1 Suppose -327800010 = 5r - 0r + 2t, -262240015 = 4r + 3t. What is r rounded to the nearest one million? -66000000 Let z = 0.421 - 7.369. Let q = z + 6.7. What is q rounded to two decimal places? -0.25 Let n = 11204 - 27104. What is n rounded to the nearest one thousand? -16000 Suppose 5c = t - 79547, 49c - 48c = 4t - 15898. What is c rounded to the nearest one thousand? -16000 Let g = 456.1995899 + -456.2. What is g rounded to four dps? -0.0004 Let t = 1 + 0. Let v = -812.24 - -813.23982. Let w = t - v. What is w rounded to four dps? 0.0002 Let v = -4.41 - -357.41. Let w = -353.00151 + v. Round w to 3 dps. -0.002 Let q(h) be the second derivative of 6436h3 + 8h*2 + 8h + 3. Let w be q(-26). Round w to the nearest one hundred thousand. -1000000 Let m = 9328 - 34571. Let h = 25251.0014 + m. Let c = h + -8. Round c to 4 decimal places. 0.0014 Let r = -11490.88014 + 11491. Let p = -1.12 - -1. Let c = r + p. Round c to four decimal places. -0.0001 Let r be (-2)/(-8) - 109044039/156. Round r to the nearest one hundred thousand. -700000 Let m = -825.000081 + 825. Round m to five dps. -0.00008 Suppose -35 = 5b + 5p, -9 = -b + p + 2p. Let u = b + 3. Suppose -2j - 145 - 15 = u. Round j to the nearest one hundred. -100 Suppose -8s - 4 = -3j - 4s, -4s = 16. Let z be 1(40/(-2))/(j/22). Round z to the nearest 10. 110 Suppose -5s = -0s. Suppose 4z + 1186019 + 813973 = -4a, s = -4z - 2*a - 1999996. Round z to the nearest one hundred thousand. -500000 Let i = -270338 + 270337.883041. Let k = -0.117 - i. What is k rounded to five decimal places? -0.00004 Let v = 14051.53 - 13995. What is v rounded to zero decimal places? 57 Let m = 1732 - 976. Let r = 756.00000591 - m. Round r to six decimal places. 0.000006 Let h = 2.5 + 0.3. Let i = 2739 + -2741.7949. Let v = h + i. W	{ "pile_set_name": "DM Mathematics" }
y(9). Let x = c + -66. Let f = x + 1774. Is f a composite number? True Suppose -4h = 2p - 1434, -2h + 705 = 5p - 0p. Is 9/(h/277892) - (-3)/(-10) prime? True Let j = 17904 + -6553. Is j a prime number? True Suppose 0w + 2w + 250 = 5j, 4w = -3j - 526. Let n be -1 + w/(-12) - (-4)/24. Suppose 6a - b + 2591 = na, -a + 650 = b. Is a prime? True Is -2578083(5 - 16/3) a prime number? True Let j(p) = 2p - 6. Let i be j(5). Suppose 37 = 5q - iq. Suppose 4s - 1097 + q = 0. Is s a composite number? True Suppose -4671291 = -13d + 9133109 + 1237887. Is d a composite number? False Let k be (2 + 0)(-29950)/(-100). Suppose -r + 50795 = 2l, 24791 = l + 3r - k. Is l prime? False Let u(j) = -6j + 106. Let v be u(0). Let b = v + -720. Is (b/4)/(6 + (-266)/44) composite? True Let j = -161845 + 112514. Let q = -28030 - j. Suppose -3z = -20z + q. Is z a composite number? True Suppose 45h - 39h - 12 = 0. Suppose 2t = -5z + 5565, -2z - 2t = ht - 2210. Is z a prime number? False Suppose 2 = -29a + 30a. Suppose -aj + 3 = -0j - c, 2j + 5c - 9 = 0. Is (-706)/(-4)1j a composite number? False Let w(i) = 24i*2 + 57i + 467. Is w(-38) composite? False Let o(k) = -2152k - 7393. Is o(-90) prime? False Let v = -45 - -330. Suppose -5y + 482 = -h, 3y + 18h - 20h - v = 0. Is y a composite number? False Let q(g) = 17g - 33. Let v be q(3). Suppose 4y + 4a + 1000 = 0, -y - 209 = -2a + 32. Let l = v - y. Is l a composite number? True Suppose -24t + 4572836 = 111t - 19t. Is t a composite number? True Let f be (-4854)/(-15) - (-18)/(-30). Suppose -3u + 148 = -f. Is u composite? False Let r = -160 - -160. Suppose 3k + 3u = 45621, r = 3k - k - 5u - 30400. Is k prime? False Let b(q) = 30725q + 5486. Is b(7) a composite number? True Let j(h) = 188h3 + h2 + 4h + 2. Let o(l) = -l*2 + 19l + 21. Let k be o(20). Suppose 5i + 12 = 4s, -2i - k = -s + 2. Is j(s) a prime number? True Let n(g) = -2g*3 - 7g*2 - 3g + 7. Suppose 2s - 7 = 3. Suppose 2p - 30 = sf, 4p + 9 = -2f - 3. Is n(f) prime? False Let d(q) = q3 - 4q*2 - 4q + 7. Let n be d(9). Let s = 244 - n. Is (39/6)/((-6)/s) composite? True Let j be (-44)/55 + 111/(-5). Let p = 19 + j. Let u(t) = -157t + 3. Is u(p) prime? True Suppose s - 701 = 1454. Let y(v) = 180v + 44 - 46 + sv. Is y(1) a prime number? True Suppose z + 166 = 3v + 561, 0 = -5v - 2z - 640. Let b = -246 - v. Let j = -47 - b. Is j a prime number? False Let x(d) = 2414d + 1358. Is x(36) prime? False Let u(i) = 3748i - 2601. Is u(16) prime? True Let v(l) = l*2 - 2l - 18. Let f be v(6). Suppose fh = -4449 + 18489. Suppose -h + 789 = -3p. Is p prime? False Let s be (-249)/(16 - 874/146). Let z = -12196 - s. Is z composite? False Suppose -2x + 2u = -1015628, -5x + 3481999 = -4u + 942932. Is x a prime number? False Suppose 87384 = -379c + 467c. Is c a prime number? False Let i be (3 + -2 + 1317)12/8. Let y = i - -5882. Is y prime? False Let i(x) be the first derivative of -2x2 + 1. Let h be i(-3). Is -1 + 51050/h + 1/(-6) a composite number? False Suppose -6 = -6x - 0x. Is ((-10)/6 + x)/((-14)/16863) a composite number? True Suppose -r - 2d + 16 = 3r, 5d - 24 = -2r. Suppose -3t + 6 = -5z + rz, 5t - 8 = 3z. Is 3(z + 2) + 6 + 332 composite? True Suppose 5d - 29561 + 10670 = -3g, -3g = 3d - 11331. Suppose 2h + d = -r + 137, -h = 5r + 1817. Let p = -1071 - h. Is p prime? True Let n be 8 - (8 + 1) - (1 + 1). Is (-3)/2 - -5450n/(-12) a prime number? True Let y be (573/(-2))/(14/((-784)/21)). Let p = y + -457. Is p prime? True Suppose 10t = f - 76057, -647f - 4t - 76093 = -648f. Is f a prime number? False Let j(c) = 508c - 305. Let n(l) = -1018l + 611. Let x(m) = -13j(m) - 6n(m). Is x(-11) composite? True Let f be -1 - (2/20 - 762498/180). Let x = f - 262. Is x prime? False Let x be ((-258230)/(-45))/(-7) - (-2)/(-9). Let z = 1734 - x. Is z a prime number? False Let a(o) = 269o + 224. Is a(33) a composite number? True Let f be -3 - (-6300)/(-52) - 4/(-26). Let n = -39 - f. Is n composite? True Let k(i) = -19i + 2. Let j be k(9). Suppose -3p + 1581 = 5h, -2h + 2p = -0h - 642. Let m = h - j. Is m a composite number? False Let m = 3051092 - 1823181. Is m prime? True Suppose -2h = -191 + 181. Suppose 2q = hi + 3976, -4q + 8i - 7i = -7934. Is q prime? False Suppose 152a = 137a + 4664805. Is a a prime number? True Is 43433 + 1(-1 + -2) + 99/(-33) prime? True Let b be ((-126)/5)/(-3) - (-8)/(-20). Let x(k) = 137k + 13. Is x(b) prime? True Let s(q) = 14q*3 - 3q*2 + 11q + 5. Let u(f) = -4f - 36. Let m be u(-11). Is s(m) composite? False Suppose -183473 = -14t + 821013. Is t a composite number? True Let v be 1/(7/(-2)) - (-6279248)/(-112). Is (0 - -2)/((-10)/v) composite? False Let l = 4338 + -1657. Suppose 3n - l = -s, -5n + 1374 = s - 1307. Is s prime? False Let z(v) = -64148v + 515. Is z(-3) a composite number? True Let n(r) = 0r - 3r + 0r + 14 + 4r. Let b be n(7). Is (-788)/(-3) + 7/b composite? False Suppose -2v - 61 = -57. Let h = v + 305. Is h a composite number? True Suppose -41q + 244274 = -467887 - 59828. Is q a composite number? True Suppose 200q = 152q + 3957936. Is q composite? False Let o(s) = 45s*3 - 13s*2 + 8s + 15. Let a(b) = 23b3 - 7b*2 + 4b + 8. Let h(f) = 7a(f) - 3o(f). Is h(7) composite? False Let t(k) = 7k3 - 58k*2 + 27k + 125. Is t(34) composite? False Let g = -1183 + 2856. Let p = g + -1122. Is p a prime number? False Let r(h) = -28h2 - 21h + 1. Let a be r(10). Let g = a - -1536. Let t = g - -2624. Is t a composite number? False Let d = -104 - -204. Suppose d = 5a + 25. Suppose 0 = 19r - ar - 1304. Is r composite? True Let x(k) = k3 + k2 - k - 1. Let p(t) = -591t*3 + 11t*2 - t - 7. Let v(r) = p(r) - 6x(r). Let b be v(-3). Is (-3)/(-8) - b/(-32) a prime number? False Let x = -265228 - -511667. Is x a prime number? True Let a = 729820 - 331727. Is a a composite number? True Suppose -63m - 90m + 27784035 = 0. Is m prime? False Suppose 29z - 22497862 + 8276736 = -33z. Is z a composite number? False Let h be ((-4076)/(-18))/((-44)/(-396)). Is h/((0 + 3)38/399) a composite number? True Let o = 1974353 + -572292. Is o composite? False Suppose -11 + 29 = -3h. Let t be h/(9/(27/2)). Let o(q) = -20q + 5. Is o(t) prime? False Let r(v) = 97v*2 - 26v - 4. Let s(k) = -97k2 + 24k + 5. Let n(i) = -6r(i) - 7s(i). Is n(10) composite? True Let q(m) = -15m - 179. Let o be q(-12). Let u(t) = 27383t*2 + 4t - 2. Is u(o) a prime number? False Let o(n) = 73n2 + 139n - 735. Is o(34) prime? True Let t(p) = 86p2 - 17p - 20. Let h be (-41)/(-123) - 114/(-9). Is t(h) composite? False Suppose -4c = -5x - 214, -2c + 81 = -x - 29. Suppose 5p + 21 = c. Let f = p + 1616. Is f a prime number? False Let z be 720/(-100) + (-8)/10. Let j(l) = 72l2 - 2l - 3. Is j(z) prime? True Let u(j) = 4j2 + j - 1. Let d be u(-1). Let x(h) = 4h + 106 - h*2 + 4h*2 - 105 + 3h*d. Is x(-5) composite? False Suppose 6a + 19 = 11a - 2j, 0 = -3a - 5j - 1. Suppose al - 27544 = p, l + 4p - 9184 = 7p. Is l composite? False Is -3 + 72/16 - (-18062705)/46 a composite number? False Let x(c) = 4c*2 - 3c*2 + c + 5c*2 - 5c*2 - 37. Let o be x(-7). Let z(y) = 392y - 11. Is z(o) a prime number? True Suppose -2h = 5y - 495087, -7y - 4h = -9y + 198054. Is y composite? True Let p = 4499 - 6350. Let w = 1352 - p. Is w a prime number? True Let f(j) = 167172j*2 + 327j + 3. Is f(-2) composite? True Let r be -5(-1)/(-5)-1. Let x(a) = 3a3 + a + 1. Let o be x(-1). Is r + o/12 - (-52230)/24 a prime number? False Let i = 1527 - -886. Is i composite? True Let v = 1423323 + -637190. Is v composite? True Let b(u) = -89u + 196. Let h be 54/(-36)(116/(-6))/(-1). Is b(h) composite? False Let o = 70802 + -22602. Suppose 9y = 6y + 2l + 36155, -4y + o = -4l. Is y prime? False Suppose 2c - 2w = 12, 5c = 3c - 3w - 8. Suppose -5r + cq = -8, 5q = -4r + q - 16. Suppose -262 = -2x - rx. Is x a composite number? False Let j = 162 + -162. Suppose j = -9i - 4i + 10387. Is i composite? True Suppose 4o - 88 = 4n, 8o + 2n - 82 = 3o. Suppose -12887 = -op + 11p. Let r = p - 1063.	{ "pile_set_name": "DM Mathematics" }
2 + 5f + 6. Suppose 9z + 8 = 10z. Suppose s + 16 = -5l, -4s = -2s - z. Give b(l). 2 Let q(h) = -13h + 13. Let g(a) = -2a2 + 30a + 110. Let z be g(18). Determine q(z). -13 Let u(l) be the second derivative of -6l + 1/2l*2 + 1/2l*3 + 0. What is u(-3)? -8 Let s(y) = 7y*2 - 4y + 10. Let p(l) = 13l2 - 8l + 19. Let a(o) = -6p(o) + 11s(o). What is a(5)? -9 Suppose -4l - 143 = 9. Let u = -36 - l. Suppose 0p + up = -8. Let x(n) = -n3 - 3n*2 + 4n + 3. Give x(p). 3 Suppose -3n - q = 1, 0q + 2q + 2 = 4n. Let a(y) = -174y - 3. Let r be a(-1). Let p(b) = -172b*2 - 2 + rb*2 - 4b + 3b. Give p(n). -2 Let o(t) = -t - 7. Let z be o(-7). Let d(h) = 0 + 5h - 6h + z. Determine d(0). 0 Suppose -v + 5h - 29 = 0, -v - 16h - 23 = -19h. Let x(k) = k + 7. Calculate x(v). -7 Let z be (-40)/6 - 7/422. Let t(h) be the second derivative of 0 - 3/2h*2 - 1/12h*4 - 2h - 4/3h3. Give t(z). 4 Let k(g) = -3g*2 + 4g - 1. Let f be (04/(-16))/3. Let u = 7 - 3. Suppose 12 = up - fp. Calculate k(p). -16 Let v(c) = 0c2 + c2 - 2014 + 3c + 2011. Calculate v(-3). -3 Let j(o) be the third derivative of -o7/5040 + o6/180 - o5/60 + o2. Let t(c) be the third derivative of j(c). Suppose 262n = -276 + 1848. What is t(n)? -2 Let j be (1 - (-1 - 1))3. Let c be j/7 + (-8)/28. Let i(s) = -5s2 + s - 1. Give i(c). -5 Let c(n) be the third derivative of n5/30 + 5n4/24 - 2n*3/3 + 313n2. Determine c(3). 29 Let f(c) = -c3 - 6c2 - c + 3. Suppose 2i - 2b + 2 = 0, 3i + 4 = b - 7. What is f(i)? -17 Let i(w) = -7w - 11. Let m be i(-2). Let r be (1/m)/(1/(-3)). Let k(a) = 16a3 - a2 - 2a - 1. Give k(r). -16 Let f = -208 + 217. Let o(z) = 2z - 23. Give o(f). -5 Let w(b) = 2b2 - 4b - 1. Let x(s) = 2s2 - 4s - 1. Let p = 22 + -15. Let c(u) = pw(u) - 6x(u). Let z be 18(32/(-12))/8 + 9. Calculate c(z). 5 Let u = 466 + -464. Let a(i) = -3i*2 - i + 1. Give a(u). -13 Suppose 17 - 62 = 4n - 7v, 5n = -3v - 21. Let f(j) = j. Let y(z) = -z3 - 5z*2 + 4z + 1. Let g(r) = -4f(r) - y(r). Determine g(n). 11 Let h(y) be the second derivative of -y4/12 - y3/6 + 2y*2 - 14y. Suppose -4i + 32 = -5r, -3 = 2i + 2r - 1. Calculate h(i). -8 Let l(v) = 22v - 24v + 14 + 7 + 0. Determine l(6). 9 Let u(x) be the first derivative of -x7/210 - x5/120 - x*4/24 - 11x*3 - 30. Let i(j) be the third derivative of u(j). Determine i(-1). 4 Let p be 3(-6)/(-63) - (-32)/(-14). Let z(f) = -f2 + f - 1. Let n(m) = m2 + 3m - 3. Let k(l) = pz(l) + n(l). Determine k(-2). 9 Let r(o) = o. Let s(q) = 3q. Let a(c) = 17r(c) - 6s(c). Let g(p) = -p2 + 3p - 2. Suppose -2 = t - 1. Let n(j) = tg(j) + 2a(j). What is n(4)? -2 Let o(j) = j*3 + 4j*2 - 5j + 7. Let y be 3/18 - 1/6. Let p(i) = -2 + y + 5 + 3 - i. Let d be p(11). What is o(d)? 7 Let m = 16 - 8. Suppose 0 = -8j + 10j + m. Let p(z) = -4z - 6. Give p(j). 10 Let n(s) be the first derivative of -s3/3 + s2/2 - 5. Suppose -7k = -0k - 14. What is n(k)? -2 Let v(y) be the third derivative of -y5/60 - 3y*4/8 - 2y*3/3 + 100y*2. Let m = -8 - 0. What is v(m)? 4 Let u(z) = z + 6. Let v(q) = -4q - 10. Let g(i) = 7u(i) + 3v(i). Calculate g(4). -8 Let z(d) = -57d + 1 + 3d3 - d2 - 52d + 110d. What is z(-2)? -29 Let i(l) = -l*2 - 5l - 9. Suppose 0q = -a + 5q + 44, 77 = 2a + q. Suppose -h - 9 = -r, -2h + 2r - a = 3h. Determine i(h). -23 Suppose -3r - 32 = -3g - 7r, -3r - 5 = -5g. Let d(x) = 2x*3 - 5x2 - 4. Determine d(g). 44 Let g(i) = i2 - 5i + 1. Let t(p) be the first derivative of p4/4 + 8p*3/3 - 3p + 5. Let h be t(-8). Let w = 9 + h. Calculate g(w). 7 Let f be (-56)/20 - -1 - (-12)/15. Let g(t) = -2t3 + 2t + 1. Determine g(f). 1 Let c = -1644 - -1643. Let d(h) = 4h2 + 0 + 3h*2 - 1. Calculate d(c). 6 Let i(h) = -4h. Let m(f) = -3f. Let n(c) = 5i(c) - 7m(c). Let j(y) = -15y - 34. Let l be j(-2). What is n(l)? -4 Let u(l) be the first derivative of -l*3/2 + 13l*2/2 - 32l + 32. Let y(a) be the first derivative of u(a). Determine y(9). -14 Let o(y) be the first derivative of -17 + 3y2 - 2y + 0y2 - 3y - 2y. What is o(5)? 23 Let j(l) be the first derivative of -l5/60 - l4/6 + l3 - 9. Let x(m) be the third derivative of j(m). What is x(3)? -10 Let p(k) = -k + 5. Let n(d) = 2d + 4d + 77 - 97 + d2. Let i be n(-9). What is p(i)? -2 Let z be (5/5-5)/(-1). Suppose 6 = 3x + t, 3t = zx - 10 - 14. Let a(j) = j + 2. What is a(x)? 5 Let l be 3(-8)/(-16)2/(-3). Let i(x) = -x2 + 1. Calculate i(l). 0 Let m(t) = 4t*2 - 12t. Let h(x) = 3x2 - 12x + 2. Let b(r) = -5h(r) + 4m(r). What is b(-13)? 3 Let v(a) = a + 1. Let f(s) = -3s - 2. Let c(r) = f(r) + 4v(r). Suppose 12 = 2w - 6w. Let z = 1 + w. What is c(z)? 0 Let j(n) = 1 + 2 - 4 - n*2 - 7n*2. Let i = -16 + 18. Suppose -4h = -iz, 0h + h + 4z = -9. Calculate j(h). -9 Let q(j) = -j2 - 15. Let w = -16 + 16. Suppose -4i - 4 + 16 = w, 4i = -2d + 32. Suppose d = 2b, l - 4b + 28 = 8. Determine q(l). -15 Let l(p) = 4p2 + 2p + 1. Let u(y) = -9y2 - 5y - 1. Let w(d) = 7l(d) + 3u(d). Let o(g) = 1. Let b(h) = 6o(h) - w(h). What is b(-2)? -4 Suppose -105 = -7o - 91. Let i(a) be the third derivative of 0a - 1/6a*3 - 1/60a*5 + 0 - 9a*o + 1/24a*4. Determine i(2). -3 Let x be (30/416/24)/(-1). Let g(y) = -7y - 7. Give g(x). 28 Let l(m) = m2 + 6m + 4. Let v(d) = 4d + 5d - 3d - 5 - 5d. Let s(w) = -w*2 - 6w + 2. Let b be s(-6). Let i be v(b). Give l(i). -5 Let j(h) = -4h3 + 8h*2 + 7h - 10. Suppose -73 - 75 = -4v. Let y(d) = -32d - 9 - 3d3 + 2 + 5d*2 + vd. Let l(r) = -5j(r) + 7y(r). Determine l(-4). -15 Let p(b) = b3 - 15. Let y be (0/(-16))/(-5 + 7). Calculate p(y). -15 Let z(c) be the second derivative of c5/20 + c4/12 - c3/6 - 9c2/2 - 2c + 36. What is z(0)? -9 Let b(w) = w + 19. Let u be b(-20). Suppose -5a + 72 = 2c, -c - 1 = 3. Let x(g) = -17 + 2g - 8g + a. Calculate x(u). 5 Let p(b) = -534 - 531 - 534 + 1603 - 3b. Let w = 13 - 8. Give p(w). -11 Let m(d) = -d + d3 + 7d*2 + 0d*2 - 5 + 8d. Let p = 465 - 471. Determine m(p). -11 Let r(j) = 2j - 12. Let z(b) = -10b3 - b2. Suppose 2i + 0 = -4m - 2, 2m + 5 = -5i. Let u be z(i). What is r(u)? 6 Let u(a) = -a*2 + 4. Suppose -5z = -3j + 8j + 5, -4j - 3z = 0. Give u(j). -5 Let b(y) = y*2 + 10y + 3. Let a be b(-10). Suppose -14 - 52 = -ai. Let m be 68/11 - 4/i. Let d(k) = k - 1. What is d(m)? 5 Let f(r) = r3 - 3r*2 - 18r. Let o be f(-3). Let m(n) = -n + 29. Determine m(o). 29 Let v(g) = -g*2 + 12g - 1. Let t = -130 + 138. What is v(t)? 31 Let m(j) = -6 - 7j + 10 + j2 - 3 - 2j*2. Let u be m(-7). Let s(p) = 2p*3 + 1. Determine s(u). 3 Let k(l) be the third derivative of 0l + 7/12l4 - 10l*2 + 29/6l*3 + 0. Let z(j) = -5j - 10. Let v(a) = -4k(a) - 11z(a). What is v(-5)? -1 Let q(y) = -3y2 - 42y - 38. Let m(o) = -5o2 - 63o - 55. Let v(t) = 5m(t) - 8q(t). Give v(22). 7 Let g be 3/(-9) - 10/15. Let r(j) = -9j3 - 2j*2 - 3j - 2. Determine r(g). 8 Let h(u) = -u*3 - 5u*2 + 6u + 9. Let o be (0 - (-18)/8) + 3/(-12). Let r be o/3-3(-6 - -9). Determine h(r). 9 Suppose -7a - 3 = -4a. Let q(s) = 0s + 3s*2 + 5s + 3 + s*2. Let p(n) = -6n*2 - 8n - 5. Let b(v) = -5p(v) - 8q(v). Give b(a). -1 Let y(q) = 3q2 - 23q - 32. Let p(x) = -x*2 + 8x + 11. Let i(z) = -8p(z) - 3y(z). Let o(w) = -24w + 367. Let h be o(15). Calculate i(h). -6 Let c(f) be the second derivative of f5/20 - f4/6 - f3/2 + f2 + 3f - 2. Determine c(3). 2 Let h(g) be the third derivative of -g5/60 + g4/24 + g*3/3 + 9g2. Let t = -17 - -9. Let y(a) = -a3 - 9a2 - 8a + 2. Let k be y(t). Determine h(k). 0 Let m(v) = 2 - 5 + 7v2 + v3 - 3v*2 + v. Let g(r) = 9r*3 - 1. Let n be g(1). Let s = n + -11. What is m(s)? 3 Suppose 0 = 4b + d - 8, -3d - 4 = 5b - 7b. Let u(i) be the second derivative of 1/3i3 + ib - i + 0. Determine u(3). 8 Let i(k) = 2 + k*3 - 24k - 17k + 4k*2 + 35k + 0k3. Calculate i(-5). 7 Let x = -18 + 21. Suppose -xq + 6q + 0q = 0. Let m(r) = -r*2 - 6. Determine m(q). -6 Let q(g) = g + 1. Let a(b) = 3b + 12. Let r(o) = -a(o) + 4*	{ "pile_set_name": "DM Mathematics" }
he fourth smallest value? (a) -1/51 (b) -4 (c) 0.2 (d) 47 d What is the fourth smallest value in 2/31, -0.4, -0.3, 3? 3 What is the biggest value in -1/17, 2/3, 2/23, 1/4, -2/7? 2/3 Which is the smallest value? (a) 0.1 (b) 5 (c) 6 (d) -8 (e) 1 d What is the third smallest value in 0.2, 217, 0.07? 217 Which is the third biggest value? (a) 0.5 (b) -4/7 (c) 4 (d) -4.57 b What is the fourth smallest value in -0.2, 0.06, -64, -1? 0.06 What is the fourth biggest value in -1/6, 2/9, -4691, -3/5? -4691 What is the third smallest value in 3, -0.03, 1/7, 5/21? 5/21 Which is the second biggest value? (a) 0.2 (b) -25 (c) 0.02 (d) -3 c What is the fourth smallest value in -4, 0, -4/5, -2/31, -5? -2/31 What is the third smallest value in 454, -0.5, -3/5, 1? 1 Which is the fourth smallest value? (a) 10 (b) 0.4 (c) -1/10 (d) 4/7 a What is the biggest value in 0.3, -9, -4, -1/4, -3/5? 0.3 What is the third smallest value in -4, -2, -6857? -2 Which is the third smallest value? (a) 3 (b) -16777 (c) -2 a Which is the fourth biggest value? (a) 2 (b) -5 (c) -2/7 (d) -19 d What is the smallest value in 0.3, -0.3, -1/4, -77? -77 What is the fourth smallest value in 6, 9, -0.1, -0.4, 4? 6 Which is the second biggest value? (a) 2/11 (b) -1.4 (c) 3/5 a Which is the fourth biggest value? (a) 130 (b) 4 (c) -0.4 (d) 0.5 c What is the smallest value in 0.4, 1, 210, -0.1? -0.1 Which is the second biggest value? (a) 30 (b) 4 (c) 15 c Which is the second smallest value? (a) 0.514 (b) 3/4 (c) 4.4 b What is the smallest value in -2, 2/15, -12, -4, 7? -12 What is the third smallest value in -5, 4, -44, 1/2? 1/2 Which is the smallest value? (a) -14 (b) 3/4 (c) 1/3 (d) 1/5 a Which is the fourth smallest value? (a) 1/2 (b) -2/9 (c) -0.15 (d) -3 a Which is the third smallest value? (a) -2/17 (b) -8 (c) 0 c Which is the biggest value? (a) 0.4 (b) -1 (c) 3.45 c What is the fifth biggest value in -23, -1/3, -6, -2, -4? -23 Which is the biggest value? (a) 6/5 (b) 10 (c) 3/11 b What is the third smallest value in 4, -5, 2, 3/4, -1/6? 3/4 What is the smallest value in -2/11, -4, 110/3, -3? -4 What is the third biggest value in 12, -1.3, 5? -1.3 Which is the fourth biggest value? (a) 2/11 (b) -0.1 (c) 14 (d) 3 b What is the third biggest value in 3, -1/4, -2/9, -0.07? -2/9 What is the third biggest value in 63/2, -20, 1/3, 2/3? 1/3 What is the third biggest value in 0.003, 2/3, -1? -1 What is the third biggest value in -0.04, -0.068, -0.5? -0.5 Which is the third biggest value? (a) -0.2 (b) 167 (c) 3/16 a Which is the biggest value? (a) -1 (b) 5 (c) -4 (d) 0 b Which is the second smallest value? (a) -2 (b) -16 (c) -17 b Which is the biggest value? (a) 4 (b) -2/23 (c) -20 (d) -5 a Which is the smallest value? (a) -106 (b) -1/3 (c) 0 a What is the biggest value in -0.6, 3, 15? 15 Which is the smallest value? (a) -9.4 (b) -0.4 (c) 0.3 a Which is the smallest value? (a) 0 (b) 3 (c) 197 a Which is the smallest value? (a) 0.09 (b) 2/7 (c) 0 c What is the fourth smallest value in -2/5, 1/10, 8, -0.09? 8 What is the third biggest value in -0.5, -165/47, 5/3? -165/47 What is the fifth smallest value in -2/13, 1/2, -0.04, -3/2, -0.2? 1/2 Which is the third biggest value? (a) -5 (b) -3 (c) -1 (d) 186 (e) 4 c Which is the second smallest value? (a) 1/2 (b) -0.5 (c) 21/4 a What is the second biggest value in -2/9, -51, 0, 1.3? 0 Which is the second smallest value? (a) 5 (b) 0.3 (c) 13/4 (d) -5 b What is the smallest value in -2/245, -1/18, 1/4? -1/18 What is the second smallest value in 2/9, -2/5, -116? -2/5 What is the biggest value in 24, 2/5, 3? 24 Which is the second smallest value? (a) -1/9 (b) 5 (c) -0.1 c Which is the biggest value? (a) 0.5 (b) -8 (c) 140 c What is the biggest value in 2/5, -2/9, -31? 2/5 What is the second biggest value in 3, 5, -1.9? 3 Which is the third smallest value? (a) -12/7 (b) 5 (c) -0.5 (d) 0.4 d Which is the second biggest value? (a) 0.4 (b) 5 (c) 1/24 a What is the second smallest value in 5, 30, -223? 5 What is the biggest value in 4, -5/3, 3/10? 4 Which is the biggest value? (a) 0.22 (b) 0.2 (c) 4 (d) -3 c What is the second biggest value in -2, -5, 0, -19? -2 Which is the fourth smallest value? (a) 0 (b) -5 (c) 3/5 (d) 3 (e) -1.5 c What is the biggest value in -3, -82/5, 0.5, 3? 3 What is the fourth smallest value in 5, 0, 52, -4? 52 Which is the second smallest value? (a) -1.55 (b) -0.04 (c) 2/5 b Which is the second smallest value? (a) -2/3 (b) 19 (c) 0.03 (d) -1 a Which is the biggest value? (a) 3/8 (b) -4 (c) 0 (d) 2/7 (e) 4/5 e What is the second smallest value in 244, 0.1, -2/7, -3? -2/7 What is the smallest value in 0.2, 0, -3, 62? -3 What is the biggest value in -0.1, 7/9, -1? 7/9 What is the third smallest value in 27/100, 0.1, 0.3, 0? 27/100 What is the third biggest value in -1/125, -1/17, -2/15? -2/15 What is the second biggest value in 0.7, 3, 4/7, 0.1? 0.7 Which is the biggest value? (a) -3/5 (b) 0 (c) -0.105 (d) -0.1 b Which is the fifth biggest value? (a) -0.4 (b) -47 (c) 2 (d) 0.5 (e) -1 b Which is the third smallest value? (a) 26 (b) -1/8 (c) 1/4 (d) 3 d Which is the fifth biggest value? (a) 0.2 (b) 1 (c) 250 (d) 3 (e) 1/6 e Which is the fifth smallest value? (a) -3 (b) 0.1 (c) -0.3 (d) -2/5 (e) -1/125 b Which is the smallest value? (a) 2 (b) -7 (c) 11 b What is the third smallest value in 3/5, -38, 18? 18 Which is the second smallest value? (a) 0.5 (b) -0.5 (c) -8 (d) 1 b What is the smallest value in 6, 10/11, 2/5, -0.2? -0.2 Which is the biggest value? (a) -0.06 (b) -0.1 (c) -1 (d) 4 d Which is the third biggest value? (a) 8 (b) 8/5 (c) 5 b What is the third biggest value in -470, 1/16, -5/3? -470 Which is the fifth biggest value? (a) 5 (b) -24 (c) -4 (d) -7 (e) -2 b Which is the biggest value? (a) -5 (b) -1/3 (c) -4 (d) 7 d Which is the second smallest value? (a) -4/7 (b) 11 (c) -0.24 (d) -0.3 d Which is the smallest value? (a) -2 (b) -0.01 (c) 29 a Which is the smallest value? (a) -0.2 (b) 4 (c) 15 a What is the second biggest value in 45/14, 4/7, -1/4? 4/7 Which is the smallest value? (a) 10 (b) -2/11 (c) 5 b Which is the biggest value? (a) 2/17 (b) 2/13 (c) 1/6 (d) 3 d What is the third biggest value in -63, -3, 9/5? -63 What is the third biggest value in -1/8, 1/8, 0.4? -1/8 Which is the biggest value? (a) -343 (b) -0.2 (c) 2/5 (d) -5 c What is the third smallest value in -2, -8/19, 2/11? 2/11 Which is the second smallest value? (a) 1/18 (b) 2 (c) 2/7 c Which is the second biggest value? (a) -114 (b) -5 (c) -1/2 (d) 2 (e) -3/2 c What is the biggest value in -7, -2, 0.4, 8, -0.11? 8 Which is the third smallest value? (a) -0.11 (b) -1/7 (c) -1/22 (d) -4 a What is the third biggest value in 5, 0.06, -0.22, -2? -0.22 Which is the fourth smallest value? (a) 0 (b) -0.1 (c) -0.5 (d) 88 d Which is the fifth smallest value? (a) -191 (b) -3 (c) -0.1 (d) -1 (e) 2/7 e What is the biggest value in -5/3, -4, -1, -1.67? -1 Which is the third biggest value? (a) 30 (b) 0.4 (c) -1 (d) 0.1 d Which is the smallest value? (a) -0.5 (b) 16 (c) 0.06 (d) -5/3 d What is the third smallest value in -2/13, 74, 3/17? 74 What is the second biggest value in -2, 2/11, 0.65, -4? 2/11 Which is the fourth biggest value? (a) 2/7 (b) 0.4 (c) -8 (d) 1/5 c What is the third biggest value in 1.07, 2, 0.5? 0.5 Which is the smallest value? (a) 6 (b) 3 (c) -0.4 (d) 0.3 c What is the second biggest value in 1, 3/200, -0.5? 3/200 What is the fifth biggest value in 4, 4.6, 4/7, 8, 0.5? 0.5 What is the third smallest value in -4, 0.1, 6, -1? 0.1 What is the biggest value in 1, -5, 15? 15 What is the fourth biggest value in -8/19, 2, 0.2, 1/4, 4? 0.2 Which is the smallest value? (a) 0.5 (b) -1/6 (c) 0.1 (d) 2/17 b What is the third smallest value in -1/11, 276, 0.4? 276 Which is the fourth smallest value? (a) 6 (b) 2/3 (c) 0.2 (d) 166 d Which is the biggest value? (a) 3/5 (b) -8/7 (c) 0.2 (d) -0.1 a Which is the third smallest value? (a) 0.04 (b) 1/4 (c) -1 (d) 0.4 b Which is the third smallest value? (a) -92.1 (b) 5 (c) -0.1 b W	{ "pile_set_name": "DM Mathematics" }
and 1 s when two letters picked without replacement from {s: 1, b: 3, q: 3, l: 1, w: 1, z: 2}. 2/55 Calculate prob of picking 1 h and 2 t when three letters picked without replacement from {b: 5, a: 2, t: 5, h: 5}. 5/68 Calculate prob of picking 4 s when four letters picked without replacement from {s: 9}. 1 Calculate prob of picking 1 l, 1 i, and 2 z when four letters picked without replacement from {z: 2, s: 1, i: 1, l: 3, b: 6}. 3/715 Calculate prob of picking 2 d and 1 o when three letters picked without replacement from awaktdtoadktkwtw. 1/560 What is prob of picking 3 c when three letters picked without replacement from clllcclclcll? 1/22 What is prob of picking 1 f, 1 t, and 1 g when three letters picked without replacement from {g: 2, f: 1, i: 1, t: 4}? 1/7 Three letters picked without replacement from {o: 1, a: 1, b: 1, z: 1, j: 2, x: 1}. Give prob of picking 1 x, 1 a, and 1 z. 1/35 Three letters picked without replacement from rttmrrrtbrrr. Give prob of picking 1 m and 2 r. 21/220 Two letters picked without replacement from {a: 2, n: 2, r: 2}. What is prob of picking 1 r and 1 a? 4/15 What is prob of picking 1 h and 1 v when two letters picked without replacement from {w: 1, v: 3, f: 4, h: 3}? 9/55 What is prob of picking 1 w and 1 v when two letters picked without replacement from {m: 1, w: 1, i: 5, o: 1, v: 10, y: 2}? 1/19 Calculate prob of picking 1 r, 1 t, 1 h, and 1 q when four letters picked without replacement from wnqwrht. 1/35 Calculate prob of picking 3 i when three letters picked without replacement from lllllillillilllliil. 10/969 Calculate prob of picking 1 v and 1 b when two letters picked without replacement from {g: 2, v: 1, o: 1, b: 1}. 1/10 What is prob of picking 2 q and 1 y when three letters picked without replacement from {i: 2, q: 3, y: 4, s: 1}? 1/10 Four letters picked without replacement from pvdpfffmfpvfvdffff. What is prob of picking 1 v, 2 d, and 1 f? 3/340 What is prob of picking 1 a and 1 b when two letters picked without replacement from {b: 1, o: 5, a: 7}? 7/78 Three letters picked without replacement from {n: 3, k: 3}. What is prob of picking 3 n? 1/20 Three letters picked without replacement from ddddddcdddddd. Give prob of picking 3 d. 10/13 What is prob of picking 3 p when three letters picked without replacement from {d: 3, p: 12, g: 3}? 55/204 Three letters picked without replacement from agagaggaggggaggagag. Give prob of picking 3 g. 220/969 What is prob of picking 1 g and 3 z when four letters picked without replacement from ogvoggogzzoooozozogo? 4/969 Two letters picked without replacement from ynn. Give prob of picking 2 n. 1/3 Calculate prob of picking 1 j and 1 w when two letters picked without replacement from jjjocojcjjwj. 7/66 Calculate prob of picking 2 y when two letters picked without replacement from {y: 9, q: 7, k: 3}. 4/19 Three letters picked without replacement from {t: 3, o: 5}. Give prob of picking 3 o. 5/28 Three letters picked without replacement from {i: 1, p: 2, x: 2}. What is prob of picking 2 p and 1 i? 1/10 Calculate prob of picking 2 u when two letters picked without replacement from uuuuuu. 1 Three letters picked without replacement from bgufdbbbufhgbuhhbd. What is prob of picking 2 h and 1 g? 1/136 Calculate prob of picking 2 q when two letters picked without replacement from {c: 1, i: 1, q: 2, e: 1}. 1/10 What is prob of picking 1 o, 1 p, and 1 z when three letters picked without replacement from zaoppppz? 1/7 Two letters picked without replacement from {f: 7, x: 7, t: 2, s: 2, u: 1}. What is prob of picking 1 u and 1 t? 2/171 Three letters picked without replacement from {z: 4, l: 2, q: 6}. What is prob of picking 2 q and 1 l? 3/22 Three letters picked without replacement from {a: 1, n: 1, r: 1, b: 1, s: 1}. Give prob of picking 1 n, 1 a, and 1 s. 1/10 What is prob of picking 2 a when two letters picked without replacement from ahaammaamhhmaha? 1/5 Calculate prob of picking 2 f when two letters picked without replacement from {d: 2, f: 2}. 1/6 Three letters picked without replacement from igigoiewi. What is prob of picking 1 w, 1 g, and 1 i? 2/21 What is prob of picking 2 j when two letters picked without replacement from {p: 3, m: 4, j: 4, a: 3, s: 2, k: 1}? 3/68 What is prob of picking 1 r and 1 j when two letters picked without replacement from rjrrjjrrrjrjrr? 45/91 Four letters picked without replacement from {i: 1, a: 3, v: 13}. Give prob of picking 3 v and 1 a. 429/1190 Three letters picked without replacement from aadsdyduduya. What is prob of picking 2 u and 1 y? 1/110 Calculate prob of picking 2 m, 1 p, and 1 u when four letters picked without replacement from {p: 1, u: 1, m: 2, q: 2}. 1/15 What is prob of picking 2 d and 1 u when three letters picked without replacement from {o: 2, c: 1, u: 6, d: 4}? 18/143 What is prob of picking 1 h, 2 s, and 1 u when four letters picked without replacement from {s: 4, u: 7, h: 6}? 9/85 Three letters picked without replacement from {l: 1, f: 4, b: 1, i: 1, t: 1, y: 4}. What is prob of picking 1 y, 1 f, and 1 l? 4/55 Calculate prob of picking 1 p, 1 n, and 1 b when three letters picked without replacement from {b: 1, s: 2, n: 1, p: 1}. 1/10 What is prob of picking 1 t and 1 u when two letters picked without replacement from {u: 1, f: 9, b: 1, t: 2}? 1/39 Three letters picked without replacement from {e: 2, g: 1, q: 1, l: 1}. Give prob of picking 1 l and 2 e. 1/10 Two letters picked without replacement from ddooooooodododdd. Give prob of picking 2 o. 3/10 What is prob of picking 2 o and 1 j when three letters picked without replacement from qojjo? 1/5 Three letters picked without replacement from {g: 4, m: 3}. Give prob of picking 3 g. 4/35 Four letters picked without replacement from {i: 11, q: 3, v: 3, d: 3}. Give prob of picking 2 d, 1 q, and 1 v. 9/1615 What is prob of picking 2 m, 1 c, and 1 n when four letters picked without replacement from {n: 2, c: 1, r: 4, m: 2}? 1/63 Four letters picked without replacement from {k: 1, u: 7}. What is prob of picking 4 u? 1/2 What is prob of picking 1 n and 1 e when two letters picked without replacement from neeeeeeeeenn? 9/22 Three letters picked without replacement from {g: 8, t: 2}. Give prob of picking 1 g and 2 t. 1/15 What is prob of picking 2 j when two letters picked without replacement from {j: 3, f: 1}? 1/2 Four letters picked without replacement from bbbbbbbbbbbbbbsbbbbb. Give prob of picking 4 s. 0 What is prob of picking 1 v, 1 p, and 1 w when three letters picked without replacement from cvwfovp? 2/35 Two letters picked without replacement from svsvuvsvsv. Give prob of picking 1 u and 1 s. 4/45 What is prob of picking 4 l when four letters picked without replacement from {l: 11, o: 5}? 33/182 What is prob of picking 1 o and 1 i when two letters picked without replacement from rdiiniodii? 1/9 Four letters picked without replacement from {a: 9, u: 9}. Give prob of picking 2 a and 2 u. 36/85 Calculate prob of picking 1 l, 1 k, and 1 d when three letters picked without replacement from kdllldkwoloj. 4/55 What is prob of picking 1 h, 1 e, and 1 f when three letters picked without replacement from {o: 2, e: 3, h: 5, m: 3, b: 1, f: 1}? 3/91 What is prob of picking 1 u and 1 s when two letters picked without replacement from {u: 2, c: 2, s: 1, f: 6, g: 4}? 2/105 Two letters picked without replacement from kkkkkkxkkkkkkkkxkkxk. Give prob of picking 2 k. 68/95 Four letters picked without replacement from oioooooooooiii. What is prob of picking 4 i? 1/1001 Three letters picked without replacement from {v: 1, y: 1, f: 1, c: 1, p: 2, x: 2}. Give prob of picking 1 v, 1 y, and 1 c. 1/56 What is prob of picking 1 e and 2 d when three letters picked without replacement from edde? 1/2 Three letters picked without replacement from jjjooojojjjjo. What is prob of picking 1 o and 2 j? 70/143 Four letters picked without replacement from pbpppbpbpbbppppbpp. Give prob of picking 4 p. 11/68 Four letters picked without replacement from {y: 4, o: 1, h: 2, z: 1, p: 1, x: 3}. Give prob of picking 1 o, 1 p, and 2 h. 1/495 What is prob of picking 1 f, 1 p, and 1 g when three letters picked without replacement from fppgf? 2/5 Four letters picked without replacement from iyiiyaeaixxiiaa. Give	{ "pile_set_name": "DM Mathematics" }
m be w/g - 1/(-3). Give y(m). -11 Let x(a) = -a*3 - 9a*2 - 4a. Let o be 76/57 - (-1)/((-3)/28). Determine x(o). -32 Suppose -g - 4g = 0. Let u(r) be the second derivative of r4/12 - 3r*2/2 - 224r. Give u(g). -3 Let y(f) = -f*3 + f - 1. Let a(w) = -2w*3 + 17w*2 + 3w + 2. Let p(r) = -a(r) + 3y(r). Let z be p(-17). Let x(j) = j2 + 7j + 6. Determine x(z). -4 Suppose 5o - 35 = 5x - 0o, 0 = 4x + 5o + 73. Let l be (0 + 0)/(12/x). Suppose -s - 3 + 6 = l. Let j(u) = -2u + 4. Calculate j(s). -2 Suppose 0 = -q + 2h, -3h + 1 - 6 = q. Let m(a) = 1298a + 1298a - 2 - 2597a. Give m(q). 0 Suppose n = -1 + 4. Let y be (n/(-6))/((-3)/6). Let a(x) = -1 - 6 + x + x2 + x3 + y. What is a(0)? -6 Let b(n) be the third derivative of -n7/840 + n6/60 - n5/60 - 7n*4/24 - 5n*3/3 - 15n*2. Let k(p) be the first derivative of b(p). Determine k(5). 8 Let t(x) be the third derivative of 2/3x*3 + 0x + 0 - 7x2 - 1/6x*4. Let h(b) = -9b + 7. Let m(i) = 4h(i) - 7t(i). What is m(-1)? 8 Let x(g) = -9g - 1. Let z = 28 - 64. Let b = 34 + z. What is x(b)? 17 Let o(j) = j2 - 2. Suppose -62w = -63w + 115. Let d = 115 - w. Give o(d). -2 Let v(w) = -29w*2 - 11w - 8. Let g(c) = -10c2 - 4c - 3. Let j(b) = 8g(b) - 3v(b). Let t = 68 - 66. Suppose -61n - t = -59n. Calculate j(n). 6 Let t(v) be the second derivative of v5/20 + v4/3 + v*2 + 12v. Calculate t(-3). 11 Let h = 3783 + -2186. Let k(f) = -1 + 1598f2 + 6 - 9f - hf2. What is k(7)? -9 Let w be (0 - -2) + -6 + -1. Let v(u) be the first derivative of -u5/120 + u4/4 + 17u3/3 + 14. Let f(q) be the third derivative of v(q). Determine f(w). 11 Let w(a) be the third derivative of a5/60 - 5a4/24 + a3/6 + 123a*2. Give w(5). 1 Let y be (-1)/(-1) + -11. Suppose y = -4n - 7 + 19. Let h(g) = 2g*2 - 3g + 2. Give h(n). 11 Let s = 91 + -86. Suppose -s + 1 = -u. Let v(r) = r*3 - 4r*2 + r + 3. Give v(u). 7 Suppose 5i - 19 = 31. Let x be (-8)/(3/((-15)/i)). Let g(n) = -n*3 + 5n*2 - 5n + 2. Determine g(x). -2 Let r(t) = 7t3 - 4t*2 + 2t*2 - 4t - 5t3 - 1. Let d be (-1)/(-3) + 2016/756. Give r(d). 23 Let i(y) = -5y*2 + 10y + 14. Let h(m) = -10m2 + 18m + 25. Let j(q) = -4h(q) + 7i(q). Give j(2). 14 Suppose -120 = 4k - 116. Let l(i) = 7i*2 + 2i. Give l(k). 5 Let f(s) = 2s2 - 4s + 3. Let d(o) = -o*3 + 9o*2 - 7o - 4. Let v be d(8). Suppose -8l = -vl - 16. Determine f(l). 19 Let j(y) = -3y - 17. Let p = -278 + 273. Determine j(p). -2 Let i(h) = -8h*2 + 29h + 20. Let l(s) = s*2 - s - 3. Let j(v) = -i(v) - 5l(v). What is j(8)? -5 Let w(u) = -u*3 - 10u*2 - 10u - 9. Suppose -2v - 88 = 4h, -2v + v + 2h = 32. Let b = v + 29. Give w(b). 0 Let q(k) be the third derivative of -k*6/120 - 2k*5/15 - 13k*4/24 - 3k*3/2 + 936k*2. What is q(-6)? -3 Suppose -6w - 44 = -74. Let f(h) = 2h2 - 11h + 1. What is f(w)? -4 Suppose 8c - 21 + 69 = 0. Let l(x) = -2x - 2. What is l(c)? 10 Let m be (9 - 10)(1 + -3 - -1). Let n be m/(-7) + (-609)/(-147). Let l(s) = -s2 + 2s + 5. What is l(n)? -3 Let z = 2682 - 2689. Let l(i) = -i*2 - 11i - 38. Give l(z). -10 Let b(q) = 2q2 - q2 + 0q*2 + 6q - 2q2 - 4. Suppose -2x + 25 = -5r, 3r + 24 = 3x - 0x. Suppose -3j + 2 = -xl, 3 = -2j + 2l + 7. Give b(j). 4 Suppose 3i = 31 + 17. Suppose 4q - 2h = 3q - 6, 0 = 2q - 5h + i. Let d(t) = 3t + 2 - 6t - 3t. Determine d(q). -10 Let h(v) = 2v*3 - 11v*2 + 2v + 21. Let r be h(5). Let j(u) = -u*2 + 3u - 2. Calculate j(r). -20 Let b = 18 + -12. Let y be (-30)/(-20)4/b. Let a(o) be the first derivative of o4 - o3/3 - o2/2 + o - 3. Calculate a(y). 3 Let x(u) = -u2 - 9u - 4. Let t be (-7)/((-28)/8) - 28. Let j = t - -20. What is x(j)? 14 Let x(u) be the second derivative of -u5/4 - u4/6 + u*3/6 + 2u. Suppose -215w + 2 = -213w. Determine x(w). -6 Let o = -17 + 20. Suppose 3f = -15, j - 9 = oj + 3f. Let d(r) = -2r + r + r*3 + 3r - j + 4r2 + 9. What is d(-4)? -2 Let a(n) = 5n - 2n - 4n + 1. Let r be 2(4/(-3) - 30/180). Give a(r). 4 Let u(r) = -409 - 411 + 1243 - 410 + 2r. Determine u(-6). 1 Let b(l) = 4l - 3. Let q(y) = -y + 1. Let c be (-7 - (1 + 3)) + 4. Let a(o) = cq(o) - 2b(o). Determine a(-8). 7 Let s = -24 + 26. Let g(m) be the first derivative of 1/4m*4 - 5/3m*3 + 3 + 2m + 3/2ms. Give g(3). -7 Let b(u) = -4 + 4u*2 + 3 + 3 - 1. Let v(x) = 84x - 419. Let j be v(5). Calculate b(j). 5 Let n = -97 - -97. Let y(v) = -v3 - v2 + 33. Give y(n). 33 Let t = 7 - 1. Let s = 8 - t. Let l(b) = -53b - 1 + 42b + s. What is l(1)? -10 Let w(p) = -p*2 + 7p + 2. Suppose -216i = -211i - 25. Give w(i). 12 Let c(o) be the first derivative of 1/3o3 + 3o - 3/2o2 + 1. Calculate c(2). 1 Let x(o) = -168o - 5 + 153o + 0 + 2 + 4. Suppose -2g - 2g + 4 = 0. Give x(g). -14 Let f(l) = 28l + 10. Let s(g) = -7g - 2. Let j(p) = -2f(p) - 9s(p). Let d(u) = u + 4. Let o be d(-6). What is j(o)? -16 Suppose -10n + 12n + 2a = 8, -3n = -2a - 2. Let s(l) be the third derivative of 0 + 0l + 5/24l*4 - 5l*n + 2/3l*3 - 1/60l*5. Give s(6). -2 Suppose 21b + 99 + 69 = 0. Let y(z) = z*3 + 10z*2 + 5z - 6. Give y(b). 82 Let x(s) = 33s + 14. Let p be x(0). Let u(n) = -n2 + 14n - 7. Determine u(p). -7 Let k(q) be the second derivative of q*5/20 - 5q*4/12 - 3q*3/2 + 5q*2/2 + 557q. Determine k(6). -13 Suppose 13z - 30 = -2z. Let i(s) = -7s2 + 73 - 2s - s*3 - zs - 66 - 2s. Determine i(-5). -13 Let w(n) be the third derivative of 0n - 5/24n4 + 1/2n*3 + 0 + 14n2. Determine w(3). -12 Let j(y) = -y2 + 7y - 1. Let o(a) = a3 + 4a*2 - 6a. Let w be o(-5). Suppose -2s + 4 = 3z, -wz - s + 10 = 1. Let h be 3z/((-6)/(-5)). Give j(h). 9 Let k(s) = -s3 - s2 - s - 5. Let u(i) = -4i2 - i - 13. Let m(n) = -2k(n) + u(n). Give m(2). 7 Suppose 0o + o - 5 = 0. Let k(b) be the second derivative of b4/12 - 5b*3/6 + 3b2 + b. Calculate k(o). 6 Let i(a) be the second derivative of -a5/20 - a*4/6 + 12a + 4. Suppose 0 = p - 4p - 6. Determine i(p). 0 Let d = -67 - -66. Suppose o = 2 - 0. Let k(p) = 2p - 4p2 + 0 - po + 1. Calculate k(d). -6 Suppose -11q - 10q = 0. Let z(c) be the third derivative of 0 + 1/60c*5 + 0c*4 + 0c + c*2 + 4/3c3. Calculate z(q). 8 Let c(t) be the second derivative of t4/12 + t3/2 - t2/2 - 4t - 70. Give c(-6). 17 Let q(s) = -5s - 37. Suppose -b - 3r - 25 = 0, 5b = -107r + 105r - 60. What is q(b)? 13 Suppose 23l - 21 = 20l. Let g(w) = w*3 - 7w*2. Give g(l). 0 Let n(u) = 107 - 2u + 104 - 219. Determine n(-7). 6 Let u(a) = a*3 + 11a*2 + 4a + 2. Let r(g) = -2g3 - 22g*2 - 7g - 6. Let q(v) = 4r(v) + 9u(v). Give q(-10). 14 Let a be (-77 - -2)(-2)/(36/6). Suppose -a = -2b - 3b. Let z(g) = g + 3g - g*2 + 2g. Determine z(b). 5 Let o(k) = -k*2 - 12k + 7. Suppose 3p + 56 = 4q, -p + 0p = -q + 17. Determine o(p). 7 Let f = 48 - 42. Let i = -3 + 5. Let j(r) = 5r*2 - 5r*2 + 2r*i - 6r - 4 - r2. Calculate j(f). -4 Let q(v) = -v2 + 5v + 6. Let i be q(7). Let r(f) be the third derivative of f5/60 + f4/3 + f3 + 11f*2. Determine r(i). 6 Suppose 0t + 6t = 108. Let p = -14 + t. Suppose -p + 22 = 3h. Let l(v) = 2v - 9. Calculate l(h). 3 Let k(j) = 19j*2 + 7 + 29j*2 - 5 - 11j - 47j2 + 2. Give k(10). -6 Let r(o) = 0o - o - 2o. Let t be (-66)/(-176)(-4)/3-2. What is r(t)? -3 Let d be (-1 + 0)/((-2)/10). Let f(z) = 4z*2 - dz*3 + 2z - 1 + 0z2 - 5z*2. Let b be -61/(-4) + 2/(-4). What is f(b)? -5 Let t(g) = g*3 - 5g*2 - 4g - 7. Let b be t(6). Suppose 5u = -4k + 5, 5u = 2k - k + b. Let x(l) = -2l3 + 1. Calculate x(u). -1 Let g(m) be the third derivative of m4/8 - 35m*3/6 - 2m*2 + 32m. Give g(13). 4 Let v(f) = -f + 1. Let g be 3 + (-1 - -1 - 4). Let s(w) = 5w3 - 2w*2 - 2w - 1. Let d be s(g). Determine v(d). 7 Suppose 2l + l = 3. Let d(z) = 9z*2 - 2z + 1. Let p be d(l). Let t(v) = -2v + v - p + 2v + 0v. Determine t(4). -4 Let m(s) = 3s*2 + 4s + 2. Let j(w) = 8w2 + 11w + 7. Suppose -11 = -0l - l. Let z(n) = lm(n) - 4j(n). Calculate z(-5). 19 Suppose 9r = 4r + 2x - 31, 3x = -2r - 20. Let d be 4/(-2) - r/(	{ "pile_set_name": "DM Mathematics" }
se 36 = 5u - 14. Solve h + h - u = 0, 3f = -sh + 9 for f. -2 Let a(b) = b3 + 32b*2 - b - 29. Let m be a(-32). Solve s + 2g = -s, -5s - mg - 2 = 0 for s. -1 Let i be -1 + 6/3 + -1. Solve 7w - 5 = 5q + 2w, 2q + 3w - 3 = i for q. 0 Let g(k) = -k3 + k2 + 2k + 5. Let s be g(0). Solve 0l - l + 11 = -3v, 10 = sv + 4l for v. -2 Let w = -8 - -15. Suppose -3x = -v - 3, 5v + w = -8. Suppose -3n + xn = -9. Solve 3u - 5 = -2y, u - ny + 10 + 3 = 0 for u. -1 Suppose -7q - 5b + 20 = -2q, 0 = 2q - 2b. Solve 0 = -2f - 4r + q, -f - 5 = -4r - 0r for f. -1 Suppose b - 3 = 1. Suppose -15 - 10 = -3d + bs, -4s - 1 = 5d. Solve 2h = -c - 0 + 9, c = dh - 16 for c. -1 Let y be ((-3)/4)/(7/(-196)). Solve -2a + 5l - 2 - 5 = 0, 3a + 3l - y = 0 for a. 4 Let b(l) = l*3 - 6l*2 - 5l - 9. Let q be b(7). Let n be -2 + 3 + -3 + q. Solve -2x - 2s + 24 = 3x, -2x - ns = -14 for x. 4 Let j(h) = -h + 6. Let r be j(4). Solve -2d + 3k = 13, -4d - 3k - rk + 29 = 0 for d. 1 Let h = 7 - 7. Suppose 4b - 4 = -5x, h = -4b + x - 2x + 20. Suppose 0i + b = 3v - 3i, 4v = -3i + 8. Solve -l = -3z - 2, vl + z = -z - 12 for l. -4 Let q(r) = r + 24. Let o be q(-20). Let d = 1 - -7. Let x = d - 6. Solve 2s + 22 = ot, -s - t = -x + 4 for s. -5 Let k = -10 + 7. Let v = k + 9. Solve -4g + 10 = -5b, 4b - 2g - 28 = -vg for b. 2 Let l(i) = -i*3 + 2i*2 + i + 2. Let k be l(2). Solve 6c - 2o = 2c - 6, -kc = -4o + 8 for c. -1 Let u be ((-10)/(-25))/((-3)/(-15)). Solve 3s - 12 = 0, 3s = ug + 4s - 14 for g. 5 Let b be -4 + (6 - -3) + 1. Solve -4q + 16 = -s, -4s - b = -3q + 6 for q. 4 Let s be 3(-4)/(-48)4. Solve 3a = -t - s, -t + 4 = -3t - 4a for t. -4 Suppose 3s = 2k + 3k + 34, 2s = 2k + 16. Let f(g) = -9g3 + g2. Let m be f(1). Let c = -6 - m. Solve 28 = 4n + 4b, -cn + s = -n - b for n. 5 Suppose -3b = 3j + 72, -j - 9 - 15 = -b. Let k be (-51)/(-4) - j/(-32). Solve -r - k = -5x, -r - r = -3x + 3 for r. 3 Let l(i) = -9i - 3. Let o be l(-2). Let c be -2(3/(-2) - 0). Let x be (-70)/(-15) - (-1)/c. Solve -3z = o, 2z = -2n - x - 7 for n. -1 Let d = 29 + -21. Solve -2b = 2, -1 = k + 4b + d for k. -5 Suppose -t + 2n - 6 = 0, -t + 3t - 3n + 9 = 0. Solve y + a - 5 = 0, 5a - 15 = -3y - ta for y. 5 Let k = -22 - -14. Let h be (-9 - k)(-1 + -4). Solve -3n + c - 4 = -h, -3c = -4n - 7 for n. 2 Let n(g) = 5g2 - 1. Let b be n(1). Solve bq + 3x = x + 4, -3q + x = 2 for q. 0 Suppose -28 = 5b + 27. Let f = 0 - b. Let k(n) = -n3 - 6n*2 + 5. Let t be k(-6). Solve -3u - 3z - f = -2u, tu - 35 = 3z for u. 4 Let q(s) = -7s2 + 3s*2 + 3s - 6 - s*3 + 1. Let x be q(-5). Let i = -2 + x. Solve 0 = 4f - 3c + 3, -17 = 3f + ic + 1 for f. -3 Suppose -16 = 2v - 3v - 5u, 5v - 3u = 24. Suppose -15 = vd - 9d. Suppose 0 = dt - 19 - 11. Solve 2w - 2y + 0 - t = 0, 4w - 12 = -2y for w. 3 Let l be -31 + 7/(35/75). Solve -o + 4k - l = -0o, -k - 2 = o for o. -4 Suppose 0 = -3d - 3 - 6. Let u be (-390)/(-18) + (-1)/d. Suppose 5c + 4s - s = u, -4 = 4c - 3s. Solve 6 = -cp + 4n, -2p + 4n = p + 3 for p. 3 Suppose -a = 5a. Solve ak - 3f = 2k - 16, 5k - 5f = 15 for k. 5 Let l = 5 - 1. Suppose 4m + 8q = 3q + 80, m - 35 = -5q. Solve -d = 3n - 10 + 30, n = ld + m for n. -5 Let p be (-20)/(-6)(-3)/(-2). Suppose 2r + pg = r - 8, -5r + 3g + 16 = 0. Solve -j - 2m - 5 = 0, -rm = -2j - 9 - 1 for j. -5 Let z = -35 + 38. Solve 3o = 3b + z, -6b - 5 = -3o - 2b for o. -1 Let c be ((-21)/(-12) + -1)/(2/8). Solve cd + 7 = -5f, -4d + 4 = -0 for f. -2 Let s(w) = 2w - 3. Let n be s(5). Let p = n - -7. Solve -p + 1 = 3d + 5u, -d + 4u = -7 for d. -1 Let x(y) = -2y*2 - 5y - 9. Let b be x(5). Let d be (-2)/(-7) - b/49. Solve -dm = -2p + 12, 0 = m + 1 + 3 for p. 2 Suppose -o - s = -20, o - 3s = 34 - 2. Solve -2g = -4d - 0d - 20, 5d + o = 2g for d. -3 Let g = 9 - 6. Let r(o) = o*3 - 6o*2 + 7o - 6. Let d be r(5). Let s(z) = 7z2 + z. Let l be s(1). Solve -l = dq, -13 = -gm + 4q - 2 for m. 1 Suppose -m - 5l = -13, m - l - 15 = -m. Solve q = -5n - q + 27, m = 2n - 2q for n. 5 Let h = 8 - 5. Suppose 0f + 15 = hf. Suppose -2s + 5 = y, -5s - 3 = y - f. Solve 0 = c, yl - 3l - 5c - 12 = 0 for l. 3 Suppose -25 = -23d + 18d. Solve 5h - 21 - 1 = -j, 0 = dj + 2h + 5 for j. -3 Let g(q) = -2q - 4. Let p = 15 - 25. Let v be (p/4)/((-2)/(-4)). Let o be g(v). Solve -4b + 2n + 16 = 0, 3b - 2n - o = 6 for b. 4 Suppose -2r = 4r. Solve -5 = s, -2s + 10 = -4t - rs for t. -5 Suppose -u + 18 = -o + 6o, -9 = -o - 2u. Suppose ol = 3v + 21, -3l - 2v + 0 + 1 = 0. Solve -ld - 21 = 4q + q, -3q = d + 11 for q. -3 Let c(j) = j3 + 11j*2 + 8j - 17. Let p be c(-10). Solve -d - pz + 4 = 0, -d = -3z + z + 1 for d. 1 Suppose 0 = 4z - 18 + 6. Let h(m) = m3 - 4m*2 + 3m + 3. Let j be h(3). Solve jd = b - z, -3b = -3d - 4 + 1 for b. 0 Suppose -6j = -128 - 16. Solve -4m = 4a + j, -2a - 8 = a - 2m for a. -4 Let y = -6 - -8. Let k be (0 + -3)30/9. Let z = k + 22. Solve -2d + 2r + z = -0d, -2r + 4 = yd for d. 4 Suppose -2 = -y - 0y. Solve -4 = 6r - 2r, -8 = -yf - 2r for f. 5 Suppose -2t = -4t - 16. Let f(m) = -2m. Let g be f(t). Solve 4o = -5p + 26, p - g = -3p - 2o for p. 2 Suppose -68 = 3d - 7d. Solve -3g = -7g + 5b + 10, d = 3g + b for g. 5 Suppose -4t + 3t = 5, -p - t - 4 = 0. Let a = 4 - p. Solve al + 3m + 27 = 0, 2l + 3l - 3m + 5 = 0 for l. -4 Let x(d) = d + 14. Let l be x(-6). Suppose -v = a - 2, 4v = 4a + a + l. Solve 0 = -4w - 2g - 8, 0 = 2w - 3g - v + 6 for w. -2 Let c(t) = t3 + 4t*2 - 3t + 4. Let a be ((-12)/8)/(3/8). Let d be c(a). Suppose 2w = 3w - d. Solve -i + 4s + w = 0, -18 = 2i - s + 3s for i. -4 Suppose -23 = -3z + 4h, 2z + 2z + 3h = 39. Suppose 3a - 2a = 6. Solve -u = -2f + a, -u = 3f - 3u - z for f. 3 Let z be (49/3)/((-8)/(-24)). Suppose 4q + 5c - z = 0, -4q - 50 = -9q - 4c. Suppose -d = d - q. Solve -5s - 2m - 6 = -27, dm + 21 = 3s for s. 5 Suppose -5z + z = -68. Solve 2t = 5u + z, -4t - t = 5u + 10 for u. -3 Suppose 0 = 2y + b, -b = -2y - 0y. Let a = 52 + -48. Solve y = 4f - f - 4m + 3, -3m = -4f - a for f. -1 Let y(l) = -l - 11. Suppose 8k - 3k - h + 44 = 0, 0 = k + h + 4. Let w be y(k). Let b be 0/(w2/(-3)). Solve -2r - 22 = -4x, -2r + bx = 4x - 2 for r. -5 Let h(z) = -z*2 - 5z + 2. Let j(q) = 2q2 + 9q - 3. Let k(a) = 5h(a) + 2j(a). Let l be k(-7). Solve -s - 4r = -7 + 2, -s + 5r - l = 0 for s. 1 Let y(n) be the third derivative of n5/60 - n4/6 - 5n3/6 + 3n*2. Let b be y(5). Solve ba - 2o = 2a - 6, 0 = -3a - 4o + 9 for a. 3 Let n be ((-2)/(-4))/((-4)/(-8)). Let v = n - -1. Solve 4 + v = -3k, -3k - 2 = 4g for g. 1 Let d = 46 + -46. Solve 3i - 3 = d, -5i = -j + 5j - 17 for j. 3 Suppose -2n + 2 = 4j, 2j = -3n + n + 4. Solve -3q = 2z - 2, 2q + 4z - 6 = -nq for q. -2 Suppose -5i = 5x - 30, 0 = 2x - 0x - 4i. Solve 2m + 2g - 10 = 0, 4m - xg + 0g = -4 for m. 2 Suppose 27 = 5l - f, -2l - 5 = -4f - 23. Let t = 0 + l. Suppose 0 = 2p - 5p + 87. Solve 2n = -x + 12, tn + 2x + 0 = p for n. 5 Let o = 30 - 28. Solve b + 2a = 3, ob = a + 4a - 30 for b. -5 Suppose 4w + b - 21 = 0, 10b - 2 = -w + 13b. Solve 2i + o = i + 1, wi = -4o + 3 for i. -1 Let r(z) be the third derivative of -z5/60 + z4/4 - z*3/3 + 3z*2. Let l = 5 + 0. Let a be r(l). Solve 11 = -ah - k - 6, 2h = 4k + 12 for h. -4 Let v(d) = d*3 - 10d*2 + 8d + 11. Let z be v(9). Let x = 6 - z. Suppose 0 = 2h + 4n - 4, h - 4n - 14 = -6. Solve 16 = xp, 16 + h = -4k + 5p for k. 0 Let i = 66 + -64. Solve -h - 2w = -0h - i, 9 = 3w for h. -4 Let v be 5 - ((-8)/4 + 2 + 2). Solve 0 = -3t - 3s, vt + 2s - 15 = 4s for t. 3 Let s(n) = n*3 - 18n*2 - 2n + 41. Let r be s(18). Solve -15 = -2f - 0z + rz, -4f + z = 15 for f. -5 Let o = -31 - -51. Solve 0 = -4r + 2u + o - 4, -7 = -r + 2u for r. 3 Let o be 02/(-4) + 3. Suppose 2y - 11 = 5. Let p = y - 4. Solve pw + 8 = 2d, od - 3 = -0d - 3w for d. 2 Let c = -39 + 28. Let t = 31 + c. Suppose y + 4y = t. Solve -3n + 3f - 2 = y, -2f = 2 for n. -3 Let x be	{ "pile_set_name": "DM Mathematics" }
). -8 (-1977)/659(-13)/3 13 What is ((225/9)/550)/(((-4)/2)/(-12))? 3/11 Evaluate (7/28)/((-28)/32). -2/7 Calculate (-30)/((-42)/7)31/155. 1 Calculate ((-32)/(-48))/((-52)/1248). -16 (8/(-30))/((-1)/(4/(24/(-15)))) -2/3 What is ((-15)/(-24)(-120)/(-150))/((-3)/54)? -9 Evaluate 16/10(-15)/(-10)-5. -12 What is 6/((-2)/(36/27)4/(-30))? 30 Calculate 3/(-2)180/3510. -1/13 Calculate (-1692)/5640((-10)/18)/(-1). -1/6 What is 6264/(-696)(-10)/6? 15 What is the value of ((-3)/213/((-6006)/(-44)))/2? -1/14 What is the value of ((-4)/6)/(((-243)/27)/(-54))? -4 Evaluate ((-9(-28)/2268)/(4/2))/(-1). -1/18 What is (4/(-2))/10295/(-354)? 1/6 What is (28/14054/32)/(-1)? -1/8 ((-3)/(-3))/(12/(-14))684/(-3192) 1/4 What is the value of -281(-7)/140? 7/5 (9/(-648)-9)/((-11)/((-198)/15)) 3/20 Calculate (270/(-756))/(5/132)14/(-6). 22 Evaluate (163/18)/14. 1/4 (4416/(-72))/233 -8 What is ((-448)/128)/((-21)/12)? 2 What is (-1192)/(-447)36/(-4)? -24 What is the value of (4/(-9))/2((-1067)/291)/(-11)? -2/27 What is (-5)/5025/(-22)? 1/22 Evaluate -335/42(-64)/520. 4/13 Evaluate -19/63-76. 6 Evaluate ((-10)/(-8))/(870/522). 3/4 Evaluate ((-60755)/(-2514))/(5/6). 29 Calculate 5/225(-18)/(-9)3. 2/15 Calculate ((-481)/5772)/((-3)/(-36)). -1 What is ((-3)/((-117)/4))/((-4)/(-6))? 2/13 8/(240/5)(-101)/101 -1/6 (-6)/5(-290)/464 3/4 Calculate ((-6405)/3660)/(77/24). -6/11 Evaluate ((-5)/15)/(17/459). -9 Calculate (-176)/(-48)4/220. 1/15 (4/(-4))/(45/10) -2/9 What is the value of 826/177(81/(-6))/9? -7 1/11(162/1620)/((-1)/4) -2/55 Evaluate (19/(76/30))/12. 5/8 What is the value of ((-22)/44)/(3/(9/(-21)))? 1/14 ((-1820)/(-2600))/(2/4) 7/5 What is (-19)/((-2128)/96)(-42)/12? -3 What is the value of ((-545)/4796)/((-1)/4)? 5/11 ((-2)/(-2))/((-238)/102) -3/7 48/(-33)(-22)/77444 2/121 Calculate (-4(-12)/56)/((-5)/(-35)). 6 What is the value of 12((-1)/(10/(-2)))/(52/13)? 3/5 Evaluate (1(-4)/14)/((-56)/2352). 12 ((-4)/6)/((-108)/81)(-40)/110 -2/11 What is the value of (-3)/(((-40)/60)/((-64)/(-36)))? 8 What is the value of ((-1328)/166)/(-6(-12)/(-189))? 21 What is the value of 4(-15)/30-4? 8 ((-1)/(-68))/(424/3604) 1/8 What is the value of 1814/1512-8? -4/3 What is the value of (10/(-4))/((-700)/23527/(-10))? -12 What is the value of (18/(-14))/(120/40)? -3/7 4/11028/((-448)/(-80)) 2/11 (((-36)/(-54))/((-7)/(-6)))/(4/(-56)) -8 4/(-66)37884/4592 -1/2 What is (-35)/(-21)(-450)/(-13125)? 2/35 Calculate (-333/(-18)-1)/((-1)/(-2)). -11 Evaluate ((-48)/(-20))/((-8)/((-800)/30)). 8 1/(-3)-3116/493 4/17 What is (384/(-16)-1)/((-2)/(-1))? 12 What is (((-2)/(-4))/((-1)/(-2)))/((-484)/(-14520))? 30 What is ((-4)/5)/((1224/(-270))/(-34))? -6 What is the value of (-8)/(-3)(-36)/(-80)-5? -6 Calculate 11/(3(-16)/48). -11 ((-26)/(-156))/(1/(-12)) -2 Evaluate (42(-39)/(-8190))/((-6)/(-80)). 8/3 19593/(-311)4/(-14) 18 What is the value of (-18)/60(-10)/1228/(-1)? -7 Evaluate ((-5)/4)/((396/(-72))/11). 5/2 6/66/18-30 -10 Evaluate 0/(((-294)/7)/14). 0 (-18)/100(55/(-33))/(-1) -3/10 What is the value of (-1)/380/((-4560)/171)? 1 What is the value of (648/516)/(-18)(-4)/(-18)3? -2/43 Calculate (645/1505)/(4/7). 3/4 What is ((-1)/(-2))/((-77)/110-1)? 5/7 Calculate 44/(-1650)(-45)/(-9). -2/15 What is the value of (3(-4)/126)/((-6)/(-72))? -8/7 What is the value of ((-12)/(-9)-3)/((-4)/14)? 14 Calculate (216/(-36))/(-36/(-48)). -16 Calculate (3(-6)/(-48))/(9/3). 1/8 9/1(-25)/((-375)/(-10)) -6 Calculate (18/(-105))/((-24)/((-64)/(-8))). 2/35 What is (36/(-3465)-5)/(2(-3)/(-66))? 4/7 What is (-10)/(9/(-9)-14)? -5/7 ((-15)/21)/((-3250)/29575) 13/2 Evaluate (1604/2807)/(2/63). 18 What is ((-222)/(-148))/((5/6)/(-5))? -9 (8/(-12))/(-18(-5)/405) -3 What is the value of 6/(11/((-99)/6))? -9 Evaluate 1/(((-4)/201)/1-5). 1 ((-10)/(-42)(-6)/2)/((-7230)/(-8435)) -5/6 What is the value of -7(-9)/(-1134)((-120)/8)/(-5)? -1/6 What is the value of (3/132)/((-46)/184)? -1/11 Evaluate 14/(-20)2352/(-2058). 4/5 Calculate -2-3(-36)/40(-5)/3. 9 55/(-15)(-1224)/(-561) -8 Evaluate (-41/9)/((-86)/(-6579)-51). 2/3 (36/(-40))/(633/(-21100)) 30 What is 20/(-20)(-4)/(-44)-1-6? -6/11 What is ((-52)/858)/(3(-6)/27)? 1/11 24/(-144)(-4)/(-6) -1/9 Calculate (17/17)/((-1)/(-3))-3. -9 (((-4)/(-2))/(-2))/((-860)/(-215)) -1/4 (-5)/(-15)(-3852)/(-214) 6 Evaluate 15/(-108)51/8552. -5/6 (0/2)/(((-72)/(-96))/(4/(-16))) 0 Evaluate ((-6)/2)/(-24(-315)/(-1120)). 4/9 -8(-17)/(-34)(-9)/78 6/13 What is (12/8)/((-833)/(-1190))? 15/7 Evaluate 163/(((-9)/6)/((-17)/(-34))). -16 Calculate (10/((-600)/36))/(-2). 3/10 What is (-3)/(-2)848/1272? 1 (-2)/(3/(-33)((-8)/(-1))/4) 11 What is 0/(-31)(-6)/(90/(-5))? 0 ((-6)/190)/(27/(-90)) 2/19 What is the value of 1/(-191/39)? -3/7 Evaluate ((-17)/6126)/(15/36). -2/5 Calculate ((-9)/6)/(35/(-175)30/16). 4 What is ((-48)/(-45))/8(-3)/(18/30)? -2/3 Calculate 16/2183/1098. 4/3 Calculate 32/((-29)/((-1334)/12)). 23 Evaluate (3948/(-94))/(-84)64/(2-1). -16 1(-2)/3(-12)/1405 2/7 Calculate (6/(-54))/((-10)/(-15)(-3)/20). 10/9 Calculate (70/(-49))/(75/42). -4/5 Calculate (-10)/15(-24)/(-136). -2/17 What is the value of (-27)/(-1134)2118? 9 What is the value of ((-24)/128)/(-221/56)? 1/4 What is ((-36)/(-21))/(38/(-57)(-3)/(-28))? -24 -6(-5)/15(-476)/(-112) 17/2 What is (212/(-231))/(8/11)? -1/4 Calculate (18/108)/(116/(-4)). -1/24 (-9)/((108/(-3))/(-72)) -18 What is (28/35)/(92/2990)? 26 Calculate (4/(-30))/(-4((-49)/(-7))/140). 2/3 What is the value of 2/((-35)/((-175)/(-10)))? -1 What is 115/138(-54)/(-3)? 15 What is ((-39)/585)/(((-25)/(-5))/90)? -6/5 What is the value of 434/9513/(-228)? -34 ((-48)/28)/((-22)/(-11)5/(-35)) 6 ((-1645)/(-1316))/((-5)/(-104)) 26 Calculate 75/(-2)(-10)/1004128/860. 18 ((2/(-8))/(-1))/((117/(-162))/13) -9/2 What is the value of ((-351)/78)/((-6)/(-12))? -9 Calculate (-675)/(-90)8/6. 10 What is the value of (-12)/(-4)4/(-8)4/3? -2 (-50)/2076/(-1235) 2/13 What is the value of 6/8(-11484)/783? -11 Evaluate (1/(-9))/((-1060)/(-1060)). -1/9 Evaluate (15/((-180)/(-8)))/(98/(-4557)). -31 What is 25/(1250/20)30? 12 ((-67)/((-89311)/124))/(-2) -2/43 Calculate ((-408)/19380)/(244/80). -1/19 What is ((-513)/(-342))/((-2)/(-1)(-1)/(-2))? 3/2 Calculate ((6/(-10))/3)/(29(-40)/(-5800)). -1 Evaluate ((184/(-138))/(172/6))/(-2). 1/43 (2367/(-34716))/(6/(-16)) 2/11 ((-36)/48)/(5/80-1) 12 ((-433)/5196)/(2/(-42)) 7/4 27(-4)/(72/(-6)) 9 Evaluate 18/4(9248/102)/68. 6 What is the value of (308/(-35))/(24/(-60))? 22 Evaluate (-2)/(-12)(-65)/(-13)27/30. 3/4 What is the value of ((-28)/231)/(18/27)? -2/11 2(-1)/((-20)/110) 11 Calculate (23/((-5175)/(-240)))/(1/(-3)). -16/5 3/(21/35)((-120)/25)/12 -2 Evaluate (-3)/120(-660)/88. 3/16 Evaluate (520/(-624))/(-2(-15)/24)-21. 14 Evaluate ((-65)/(-26))/(((-210)/(-72))/(-7)). -6 What is the value of ((16/18)/(115/(-345)))/4? -2/3 Calculate (15/3)/((-40)/(-56)). 7 (((-5)/(-4))/(-1))/((-809)/9708) 15 What is 100/250(-135)/6? -9 What is the value of ((-15)/40)/((1050/40)/(-7))? 1/10 (33)/((-2)/3(-126)/112) 12 Evaluate (8/(-2))/((-212)/(-212)). -4 What is the value of 0/(1/(2/4))? 0 3157/(-8118)(-12)/(-21) -2/9 Calculate 1/3357/(-102)6. -7 What is (1/(-12))/((-180)/480)-9? -2 (-4)/2-33(-3)/144 -3/8 99/2(-121)/(-363)-2 -33 Evaluate (115/((-940)/(-188)))/((-5)/((-1)/(-1))). -23/5 What is (92/(-322))/((-9)/(-504))? -16 Evaluate (4/((-304)/(-19)))/((-3)/51). -17/4 Calculate ((-326)/978)/(2/(-132)2). 11 (-18)/48(-160)/(-180) -1/3 What is ((-20)/(-22))/((-492)/(-13530))? 25 9/216-2810/(700/45) -3/4 Calculate (-56)/145/900-3. 1/15 What is the value of 4/(((-51)/(5049/22))/((-2)/342))? 2/19 Calculate ((-4)/((-36)/3))/(2/(-54)). -9 Evaluate ((-8)/(-39))/((-2364)/1773). -2/13 Calculate ((-22)/33)/((-9)/(567/(-154))). -3/11 Calculate 7775/93318/(-5). -30 Evaluate ((-498)/4316)/(3/4). -2/13 (((-2)/(-7))/(5/(-20)))/(2176/(-448)) 4/17 2((20/25)/4)/((-34)/(-5)) 1/17 Evaluate 5/(-3)-9(-68)/(-255). 4 (351/5148)/(30/(-20)) -1/22 (-8)/68119/7 -2 What is the value of -120/(-30)-3? -2 Evaluate (-3)/(-1(-18)/60). -10 -40((-132)/48)/11 10 Calculate (-4(-40)/(-288))/(84/189). -5/4 Evaluate (-140)/49(-7)/2. 10 5	{ "pile_set_name": "DM Mathematics" }
, i = 5b + 49. Let y = i - 39. Is 32 a factor of ((-1335)/(-25))/(-3)y? False Suppose -2t = -3v + 628 - 2320, 5t - 4v - 4216 = 0. Is 21 a factor of t? True Suppose -6 = -r - 2t, -4t + 3t = -3. Suppose r = -3q + q + 146. Does 15 divide q? False Let k be ((-6)/4)/((-1)/2). Suppose -5n + 28 = k. Suppose -96 = u - nu. Is 12 a factor of u? True Let a(q) = -q*3 + 15q*2 - 11q - 3. Does 34 divide a(6)? False Is (-5331)/(-9) + (-2)/6 + -6 a multiple of 17? False Suppose -8 = 2o - 6o. Suppose -4v - o = -6. Is (-2 - 1) + v + 9 even? False Suppose 37o + 227 - 10032 = 0. Is o a multiple of 14? False Suppose 34p = 487 + 193. Does 10 divide p? True Let p = 29 + -39. Let j = p - -2. Does 9 divide (36/j + 4)-36? True Let l(c) = -14c3 + 4c*2 + 2c*3 + 7c + c*3 + 5. Does 11 divide l(-2)? False Suppose 4w - 27 = -i, i = -2i - 15. Suppose -4k = -w, -3k - k = 4q - 204. Is 16 a factor of q? False Let x be 2(-4 + (-218)/4). Let r = -48 - x. Is r a multiple of 16? False Suppose 6k + k = 63. Suppose -74 = -a + 3f, k = 4f - f. Does 30 divide a? False Let c(y) = 48y3 - 11y*2 - 13y - 6. Let k(b) = -16b3 + 4b*2 + 4b + 2. Let r(i) = -3c(i) - 8k(i). Does 8 divide r(-2)? True Let d be ((-8)/((-64)/198))/(15/40). Let f = -4 + 25. Suppose 4c - 46 = -2p, 4c - f = 5p - d. Does 13 divide p? True Suppose -f + 48 = 25. Let b = f + -15. Is 2 a factor of b? True Let a = 71 - 145. Let i = a + 5. Is -1(-3 + -3 + i) a multiple of 15? True Suppose 16 = -3q + 5v - 272, -5q = 2v + 449. Let d = q + 166. Suppose -4u + 9u - d = 0. Does 5 divide u? True Let s(b) = -2b*3 - 9b*2 + 13b - 5. Let k be s(-8). Let f = -159 + k. Is f a multiple of 12? True Suppose 4g - 472 = -2s, 3s = -3g + 7g + 718. Is s a multiple of 12? False Let f(z) = 11. Let a(j) = j + 11. Let q(i) = 3a(i) - 2f(i). Is q(3) a multiple of 12? False Let w(a) = 2a*2 + 12a - 304. Is 13 a factor of w(-25)? False Let o(s) = -9s - 1. Suppose 2k + 4 = -2k. Let q be o(k). Suppose 11l - ql = 18. Is l a multiple of 6? True Let n(y) be the third derivative of y4/8 - y3/2 + 3y*2. Is 3 a factor of n(4)? True Suppose -2j + j - 3 = c, -4c - 3j = 9. Suppose a + ca + 4z - 170 = 0, -2z - 170 = -a. Is 22 a factor of a? False Is ((-66)/(-4))/((-3)/(-200)1) a multiple of 70? False Let y(i) = i*3 + 18i*2 + 19. Let m be y(-18). Suppose -m = -4q + 117. Is 17 a factor of q? True Let h = 928 + -400. Is h a multiple of 16? True Let v be 2/2 + (-268)/(-12)3. Suppose -12i = -16i + v. Does 17 divide i? True Suppose 5a - 36 = a. Suppose -ax - 105 = -14x. Is 11 a factor of x? False Let y(m) = -44m - 276. Does 72 divide y(-35)? False Suppose 39 = o + 2o. Suppose -g = g + 4c - 18, -5g - 2c = -o. Does 29 divide g/4 + (-230)/(-8)? True Let x(d) = -d2 + 6d - 7. Let f be x(3). Suppose 0 = -a - 2a - 4n + 1298, fa = 3n + 854. Is 21 a factor of ((-24)/30)/((-4)/a)? False Is 13 a factor of (3198/2)/(69/46) + 0? True Let y = -202 + 363. Does 23 divide y? True Let v(r) = 2r2 - 22r - 10. Is v(16) a multiple of 15? True Suppose 3g - 1495 = 5y, -5y = 95g - 100g + 2485. Does 5 divide g? True Suppose -p - 3 = -2p. Suppose 2s + 2s = pg, 0 = 5g - 2s + 14. Let u = 3 - g. Is 4 a factor of u? False Let h be (-88)/(-6)(-90)/(-20). Let y = h - 21. Suppose -3n = -f - 2n + y, -2n = -5f + 228. Is 13 a factor of f? False Suppose 5p + 3 = -2, -2p = -3d + 29. Is 318/d + 16/24 a multiple of 15? False Suppose -2y - 3y + 3i + 3 = 0, y + 2 = -2i. Suppose -2h + 1 + 13 = y. Is h a multiple of 2? False Let y(x) = x*3 + 2x*2 - 7x - 8. Is 4 a factor of y(4)? True Suppose 10 = -5l - 3f, -25 = l + l - 3f. Is 9 a factor of (-16)/(-80) - 64/l? False Let w = -14 - -19. Let k = -6 - w. Let z = 25 + k. Does 9 divide z? False Suppose -n = -94c + 99c - 2141, -n + 2171 = -5c. Does 28 divide n? True Suppose 2z - 12 = -z. Suppose v - 24 = -0j - zj, 3j - 23 = -2v. Is 4/(-7)(-14)/v a multiple of 2? True Suppose -2y + 4y = 4u + 54, 4y - 132 = 2u. Suppose 155 = 4x + y. Is 5 a factor of x? True Let p be 3 + 6(-20)/6. Let c = -12 - p. Suppose 0 = cd + 6z - 3z - 52, d + 12 = 5z. Is d a multiple of 7? False Let q(v) = -v + 7. Let p(n) = -n + 13. Let c be p(0). Suppose 2m + 3 = -c. Does 7 divide q(m)? False Let q be -11 - 31/(-3). Is 273 + (-8 - q) a multiple of 25? False Let b = -175 + 201. Suppose 0 = 4p - 65 + 13. Suppose -p = -r + b. Does 13 divide r? True Suppose -3a + 5b = 64 - 260, 0 = -4a - 3b + 300. Is a even? True Suppose 4x - 3 = -271. Let i = 100 + x. Let j = i - -24. Is j a multiple of 19? True Suppose -3h + 12 = 0, q - 3h - 124 - 62 = 0. Is q a multiple of 12? False Let x(n) = -2n - 20. Let u(h) = -12h*2 + 2h - 1. Let a be u(1). Let k be x(a). Suppose 4 = -kd + 82. Does 13 divide d? True Let n = 34 - 44. Let w = 20 - n. Does 15 divide w? True Let g = -59 - -61. Suppose gi = -5s + 137, i = 3s - s - 62. Is 5 a factor of s? False Let n(t) be the first derivative of t*3/3 + 3t*2/2 + 2t + 6. Let g be n(-2). Suppose g = 4s - s - 90. Does 15 divide s? True Let l = 139 + -122. Let v(h) = h3 - 19h*2 + 40h - 19. Is 15 a factor of v(l)? False Let a = -13 - -14. Is 12 a factor of (-4)/(3/(-18)a)? True Let y(b) = -7b - 10. Let j(w) = -7w - 9. Let h(o) = 5j(o) - 4y(o). Is 2 a factor of h(-3)? True Let b = -85 - -93. Is 10 a factor of (-1 + -3)(-4)/b14? False Let q = -39 + 43. Is -10((-164)/20 + q) a multiple of 14? True Suppose -3d = 5c - 125, 0 = d + 3c - 28 - 7. Let f = 81 - d. Does 14 divide f? False Let z(s) = -s3 + 13s*2 - 10s - 24. Let y be z(6). Suppose -6x = -y - 648. Does 10 divide x? False Is 4 a factor of (44/10)/(153/30 + -5)? True Suppose 13f + 838 = 2242. Does 49 divide f? False Suppose -1377 = -3x + 3w, -2w = -5x + 1207 + 1088. Does 12 divide x? False Is 4 a factor of -4(-9)/(45/325)? True Let q = 804 + 246. Is q a multiple of 71? False Let o(k) = 5k*2 - 146k + 21. Is o(36) a multiple of 83? True Let x(m) = -3m + 2 + 10 + 4m - 6. Let v be x(-6). Suppose g + 2g - 93 = v. Is g a multiple of 31? True Let p be -53 - 5 - (1 + -1). Let k = 61 - p. Does 17 divide k? True Suppose m + 1 = 6. Suppose -5t = -mj + 10 + 10, -3t - 5j + 4 = 0. Is 4 a factor of (-2)/(2 + 5/t)? True Suppose 2l + 0l + 5 = 5f, -2f + 2 = 2l. Suppose -8 = -li + i. Is (2 - 1) + (-1 - i) a multiple of 8? True Suppose -j + 16 = 4j - 3v, 0 = -4j + 4v + 16. Let g = j - -20. Is 4 a factor of g? False Suppose -2o = -4o + 4l + 216, 5o - 5l - 520 = 0. Suppose 7x = -2 + o. Does 3 divide x? False Is 10 a factor of (1 - -3)65 - 5? False Let p(x) = -5x + 19. Let b(r) = -r + 4. Let l(j) = 22b(j) - 4p(j). Let a be l(9). Is 16 a factor of -3 - (a + 3) - -16? True Suppose -2624 = -4g + 256. Is 8 a factor of g? True Suppose -44r = -11r - 37092. Is 36 a factor of r? False Let a(g) = -35g + 23. Is a(-2) a multiple of 6? False Let g(d) = -3d - 2. Let m = -12 + 10. Let c be g(m). Is (-4)/(-6)(c - -26) a multiple of 7? False Let d(p) = 9p*2 + 3p - 18. Is d(-3) a multiple of 18? True Suppose 5g = -5h - 10, 0 = 3h + g - 3g - 4. Let s(p) = 4p2 - p + p2 - 4 + hp + 0p. Does 8 divide s(2)? False Let c = 29 + 90. Let z = c + 121. Is 8 a factor of z? True Let m(n) be the first derivative of n3/3 + 5n*2 - 14n + 7. Let s be m(-11). Let d(o) = -2o3 - 4o*2 + 1. Is 4 a factor of d(s)? False Suppose 20 = 5y, 0 = -2a + 4a - 5y - 274. Is 44 a factor of a? False Let b(x) = 17x*2 + 3x + 2. Suppose 7m + 17 = -25. Let c be 2 - m/2-1. Is b(c) a multiple of 4? True Suppose -2086 = -15z + 8z. Does 3 divide z? False Let t = 11 - 18. Let w(x) = -7x2 + 5x + 78. Let r(v) = -10v2 + 7v + 117. Let n(f) = tw(f) + 5r(f). Is 16 a factor of n(0)? False Does 22 divide ((-21)/6)/((-9)/18) - -1357? True Suppose -5n - 18n = -20700. Is 22 a factor of n? False Let d(l) = -l*2 + l + 16. Suppose h - 2 = -3m, -2m + 5h = 2m + 10. Is 4 a factor of d(m)? True Suppose 0 = z - 2z. Let x be (z + -2 - -3) + 2. Suppose -3h = -3a - 96, -xa = -2h + 3h - 12. Is 7 a factor of h? False Suppose 0 = -85a + 71a + 26656. Is 24 a factor of a? False Let l(b) = 9b*2 - 83b - 11. Does 11 divide l(12)? False	{ "pile_set_name": "DM Mathematics" }
- 13. Suppose 0 = -3k - 4j + 845, -5k - 2j - 542 = -s. What is k rounded to the nearest ten? 290 Let a = -603750.621 - -603405. Let r = a - -345. Round r to one decimal place. -0.6 Let k = 778 - 634.7. What is k rounded to the nearest integer? 143 Let n = -0.496999681 - -0.497. What is n rounded to 7 decimal places? 0.0000003 Suppose -3v = 4z - 1494, v + 3z - 163 - 340 = 0. Round v to the nearest 10. 490 Let s = -12.7 + 4.2. Let z = s + 10. Let v = z + -1.5096. Round v to 3 dps. -0.01 Let n = 11243751.500021 - 11243799.5. Let y = n - -48. What is y rounded to five dps? 0.00002 Suppose 2n = q - 3q - 1094592, -n + 4q = 547316. What is n rounded to the nearest 100000? -500000 Let r = -0.50355779 - -0.5036. Round r to six dps. 0.000042 Let o = 142146 + -78786. Let d be (o/22)/(3/2). Round d to the nearest 100. 1900 Let a = 217 + -428. Let f = a + 210.618. Round f to 2 decimal places. -0.38 Suppose 4y + 113861 = -91535. Let r = y + -132651. Round r to the nearest ten thousand. -180000 Let f(m) be the first derivative of -2m3/3 + m2 + 31m - 20. Let w be f(8). Round w to the nearest 10. -80 Suppose 25340020 = -2t - 4o, 10o = 2t + 9o + 25339995. What is t rounded to the nearest 1000000? -13000000 Let b = 205 - 192.28. Let x = 0.08 + b. Round x to the nearest integer. 13 Let s = -348714 + 28814. What is s rounded to the nearest 10000? -320000 Suppose 17p + 5a + 6160 = 12p, 3p + 2a + 3691 = 0. Round p to the nearest one hundred. -1200 Suppose 0n = -n + 3. Suppose 5 = nx - 1. Let w be 120005 - 4 - x/2. Round w to the nearest ten thousand. 120000 Suppose 2v - f = 4v + 31, -4v - 61 = f. Let n = v - -15. Let g(c) = c*2 - 53000. Let w be g(n). Round w to the nearest ten thousand. -50000 Let d = -1637381095351260764.00000063 + 1637381085848977622. Let h = 9502283220 + d. Let a = h + -78. Round a to seven dps. -0.0000006 Let i = 11.5 - 7.92. What is i rounded to one dp? 3.6 Let h = 19444507 - 19444650.00169. Let c = h + 143. Round c to 3 dps. -0.002 Let d = -3494 - -3494.000004758. Round d to seven dps. 0.0000048 Let v = 661 + -661.0000575. What is v rounded to six dps? -0.000058 Let b = 23721902 + -23721889.600233. Let h = 0.146 - -12.254. Let f = b - h. What is f rounded to five dps? -0.00023 Let h = -0.11046 + 413.23046. Let n = -416.4286 + h. Let s = n + 3.3. Round s to three dps. -0.009 Suppose 0z + 2z = 0. Suppose u + 3 - 5 = z. Suppose -267000 = -b - ub. Round b to the nearest 10000. 90000 Let q = -5.85 - -5.8506675. What is q rounded to 4 decimal places? 0.0007 Let a = -1.88 - -1.896. What is a rounded to two dps? 0.02 Let o be 1 + 1 + -2 + 4. Suppose 4v = oj - 5j + 24627, v + 73907 = 3j. Suppose 31165 = -2x - j. What is x rounded to the nearest one thousand? -28000 Suppose -4q = -2v + 2, q - 2v - 2 = v. Let h be 76000/(-12)(q + 31). Round h to the nearest one hundred thousand. -200000 Let s = 118 - 167. Let b = s + 45.47. Let n = b + 3.3. Round n to one dp. -0.2 Suppose o - 30854 = -154254. Round o to the nearest ten thousand. -120000 Let w be (-16000)/(-6)(-342285)/(-38). What is w rounded to the nearest one million? 24000000 Let r = -0.1 - -19.1. Let y = r - 18.902. Let w = -0.1 + y. Round w to two dps. 0 Let v = 452.97 - 456. Let b = v + 3.1. What is b rounded to 2 dps? 0.07 Let t = -46.87 - -46. Let i = -9.7 + 1.63. Let a = t - i. What is a rounded to the nearest integer? 7 Let k = -166191820.98451 + 200288347.984354. Let d = -34096471 + k. Let m = 56 - d. What is m rounded to 5 decimal places? 0.00016 Let n = 0.05693 - 24.92693. Round n to 0 dps. -25 Let c = 24.153 + -24. Let w = -0.15 + c. Round w to two dps. 0 Suppose -6t + 10t = -5o - 75150, 0 = 3o - 6. What is t rounded to the nearest one thousand? -19000 Let n = 13 - 11.3. Let r = -20.965 + 22.66404. Let u = n - r. What is u rounded to 4 decimal places? 0.001 Let o = 11.41 + -127.21. Round o to the nearest integer. -116 Let a = -0.0843 + 12.1443. Let j = a + -12. Let l = 0.0599784 - j. Round l to six dps. -0.000022 Let z = -6.8 - 102.2. Let a = 109.0000208 + z. Round a to 6 dps. 0.000021 Let a = -91 - 38. Let n = a + 165.1. Let k = 33 - n. Round k to the nearest integer. -3 Let l = -0.1862855 - -0.146286. Let j = l + 0.04. Round j to six dps. 0.000001 Let t = -27.53035 - 3.49545. Let y = t + -0.0242. Let m = y + 31. Round m to 2 dps. -0.05 Suppose -3n + 4n - 6550008 = 0. Suppose d - 318884 = v + 991118, 4v = 5d - n. What is d rounded to the nearest one hundred thousand? 1300000 Let j = 27.4 - 27.399624. Round j to four dps. 0.0004 Let t = -6 - -1. Let r = -22 - t. Let k = r + 16.99974. What is k rounded to four decimal places? -0.0003 Let o(f) = -9f2 - 2f + 7. Let y be o(4). Let r = 79 + y. What is r rounded to the nearest 100? -100 Let h(y) = -7924y + 7. Let j be h(13). Let z = j - -303005. What is z rounded to the nearest 100000? 200000 Let q = -25.1248 + 25.3. What is q rounded to two decimal places? 0.18 Let b = 30.648 + 32.326. Let i = b - 63. What is i rounded to 1 dp? 0 Let q = 3.199866 + -3.2. What is q rounded to four dps? -0.0001 Let k(y) = -y3 - y2 + 599988. Let i be k(0). Let o = 54 + -51. Suppose 3f + 5c - 359985 = 0, 2f + 4c - i = -of. Round f to the nearest ten thousand. 120000 Let r = -346.3854 - -346.7. Round r to 2 decimal places. 0.31 Let y = -221.0000492 + 221. Round y to five decimal places. -0.00005 Let s be (-4)/(-18) - (-14)/18-1214. What is s rounded to the nearest one hundred? -900 Let v = -6260946 - -10620946. What is v rounded to the nearest one hundred thousand? 4400000 Let j(a) = 15a - 3871. Let t be j(0). What is t rounded to the nearest one hundred? -3900 Let g = 1.72 + -2. Let q = g + -0.12. Let u = -0.409 - q. Round u to two dps. -0.01 Let m = -0.202824 + 31.203864. Let i = -31 + m. What is i rounded to four decimal places? 0.001 Let m be 3 + (-334 + -3)3. Let j = -2508 - m. Let z be ((-1832)/6)/(2/j). What is z rounded to the nearest 10000? 230000 Let c = -1.93 - 15.77. Let u = 1705 - 1723.79. Let a = c - u. What is a rounded to one decimal place? 1.1 Let q = 0.37 + -0.26. Let u = q - 0.24. Let b = -0.1264 - u. Round b to three decimal places. 0.004 Let r = 6.881 - 7.61. Round r to two dps. -0.73 Let g be 64(-4)/(-48). Suppose 2k - g = 10. Let r be (-1 - 3494/k)-24. What is r rounded to the nearest 10000? 10000 Let r(v) = -v3 + v2 - 15v + 383. Let s be r(0). What is s rounded to the nearest one hundred? 400 Let j(a) = 13499a2 + 9a + 10. Suppose -6z + z + 50 = 0. Let k be j(z). Round k to the nearest 100000. 1400000 Let d(c) = 186914c*2 - 12c + 74. Let w be d(9). What is w rounded to the nearest one million? 15000000 Let m = -2.1 + 4. Let b = m - 1.8994. What is b rounded to 3 dps? 0.001 Let n = 1.3 + -1.47. Let p = 0.16999942 + n. What is p rounded to 7 decimal places? -0.0000006 Let l be -1194410/1 - 0. Let r = -23108 - 6332. Let d = r - l. Round d to the nearest 10000. 90000 Let p be ((-8)/(-10))/(2/(-18415)). Let j = -3593 + 2427. Let u = j - p. What is u rounded to the nearest one thousand? 6000 Suppose 6 = -s + 3. Let a be ((s + -106)1)/(-1). Suppose -a = 6j - 25. Round j to the nearest ten. -10 Suppose -2g - 12 = -4u, 0u - u - g = 0. Let y be -5u4/(-5). Suppose i - n - n = -y, -4i + 2n - 8 = 0. Round i to five decimal places. 0 Let p = -0.168245 + 0.168. Round p to 4 decimal places. -0.0002 Let z = 94 + -92. Suppose -4a - 3o + 27163 = 0, 2a + zo = -2o + 13584. What is a rounded to the nearest one thousand? 7000 Let j = -14504618.899826 + 14504602. Let h = 0.79 + -17.69. Let s = h - j. What is s rounded to 5 decimal places? -0.00017 Let t = 11114 + -11112.8659. Let w = t + -1.14. What is w rounded to three dps? -0.006 Suppose 0y = 2b + 4y + 43000000, -3y = -3b - 64500009. Let v be (-2)/5 + b/(-5). What is v rounded to the nearest one million? 4000000 Let c = 5315895846.649061 + -5315893357. Let w = 2276.6492 - c. Let y = 213 + w. What is y rounded to five dps? 0.00014 Let i = -78 + 62.4. Let q = 15.6000302 + i. Round q to six dps. 0.00003 Let v = 300 - 299.8. Let g = -57375.200046 + 57375. Let f = v + g. Round f to 5 decimal places. -0.00005 Suppose 644 = m - 405. Let h = 532 - m. What is h rounded to the nearest one hundred? -500 Let b = -0	{ "pile_set_name": "DM Mathematics" }
- 3. Let c be j(7). Suppose -o + 259 = 2m, -co + 274 = -3o - 3m. Is o a prime number? False Let r be (-5)/10 + (-22)/(-4). Suppose -5s - 2k + 285 = 0, 0s = -rs - k + 285. Is s prime? False Suppose z = -3z + 5276. Is z a composite number? False Suppose 3548 = r + 3r. Is r a prime number? True Let t(o) = -o + 402. Let z be t(0). Is -3 + -1z/(-3) a prime number? True Suppose -t + 8 = t. Let r = t + 19. Is r prime? True Let w be (-5055)/(-9) - (-6)/(-9). Suppose -q + w = 2q. Is q a prime number? False Suppose -d + 5s + 198 = 0, 3d + 4s = 6d - 605. Suppose -d = 4n - 3m, n = 3n + 3m + 115. Let g = 32 - n. Is g a prime number? False Suppose -t + 570 = 4t. Let f = t - 61. Is f a composite number? False Let b(u) = 43u*3 - 2u*2 - 9u + 7. Is b(3) prime? True Suppose l + 35 = -x + 3x, 2x + 3l = 15. Suppose -2b = 3b - x. Suppose -2z + 39 = -by + 12, -4z + 9 = 3y. Is z a prime number? False Let b be (1 - 1) + 570/(-6). Let m = b - 232. Is 4/6 + m/(-9) a prime number? True Let w(z) be the first derivative of -z5/60 + 3z*4/8 - 7z3/6 + z2 - 1. Let b(c) be the second derivative of w(c). Is b(7) prime? True Suppose -3a - 2v + 235 = -2a, 5a - 5v = 1250. Suppose -2o + 242 = 4w, -2o + 0w + a = 3w. Is o composite? False Let h(c) = 13 + 3c + 13 - 4. Is h(15) a composite number? False Is 7/(14/8) + (198 - 1) a composite number? True Suppose -5f = -21 + 6. Suppose 0 = fu - 2a - 3a - 43, -9 = -u + 3a. Is u a prime number? False Suppose 0 = 6o - 2o. Suppose 4 = 4c, on + 386 = 4n - 2c. Is n a composite number? False Let l(s) = 14s + 1. Let d be l(1). Let t be (20/d)/((-4)/(-6)). Suppose -5b - 250 = -3o - 2o, 4o + tb = 230. Is o a prime number? False Let x(b) = 11b3 + b2. Let m be x(-1). Let s(g) = -3g + 7. Is s(m) composite? False Let z be 12/5 + 4/(-10). Suppose -4n + 8 = -4j, zj + n = -j - 2. Is (-3 - 4)/(j/3) a prime number? False Let u(q) = -q3 + 7q*2 - 5q + 4. Let d be u(6). Let t = -3 + d. Is t prime? True Suppose -2k - 29 = -99. Is k composite? True Let i(z) = 2z + 1. Let k be i(1). Let r be (k - 2)(-3 + 2). Let c = r + 8. Is c composite? False Let o(w) be the second derivative of 13w4/6 - w3/2 - w*2/2 + 5w. Is o(-2) a prime number? True Let o = -18 + 39. Is o composite? True Suppose 0 = -3h - 2j + 5, h - 3j - 21 = -4h. Suppose w + 500 = 4l + 3w, -5w + 361 = hl. Is l a composite number? False Suppose -r + 9 = 2r. Suppose -u - 90 = -2u + c, -286 = -ru - 5c. Let x = u + 29. Is x prime? False Suppose -4r - 4 = 0, 2j + 3j + 5r - 20 = 0. Suppose -3l + x = -125, -jl + 3x + 2x = -195. Let p = l + -8. Is p a composite number? True Is (-10 - -7)/((-9)/11091) a composite number? False Let w = 1965 - 1352. Is w composite? False Suppose -f + 4 + 1 = 0. Let u(z) = 5z3 - 4z*2 + 6z - 2. Let v(h) = -11h3 + 8h*2 - 13h + 4. Let k(t) = 9u(t) + 4v(t). Is k(f) a composite number? True Let i(j) = 2 + 3 + 0j - j. Is i(3) composite? False Let j(b) = -8b*3 - 2b*2 + b - 1. Suppose -f = 2f + 6. Is j(f) prime? True Let n(p) = -3p + 10. Let g be n(-7). Let f = -10 + g. Is f composite? True Suppose -3v = 3v + 780. Let r = v + 575. Is r composite? True Suppose 3x - 1 = 14. Suppose -9 = xp - 3q, -q + 4 = -3p - 3. Let w(u) = -3u3 + u2 + u - 2. Is w(p) a prime number? False Suppose 4n = n - o + 1078, 5n - 1797 = -2o. Is n a composite number? False Let u = 12 + -8. Suppose 8k - uw = 4k + 484, -k - w + 117 = 0. Is k a prime number? False Let g(u) = -u*2 + 34u + 25. Is g(20) a composite number? True Let p(y) = y3 + y2 - 3y. Let b be p(3). Let i = 30 + b. Is i a composite number? True Let s = 10 + -6. Suppose -s = -3z + z. Suppose -30 = -za + 32. Is a a composite number? False Suppose 4s - 4 = 4. Suppose 0 = -sd - 43 + 185. Suppose 3i + 7 = -2c, -5i + 26 = -5c + d. Is c a composite number? True Suppose 5w - 20 = -0. Let l(g) = -16g + 3. Let u be l(2). Let a = w - u. Is a a composite number? True Suppose 15t - 1174 = 13t. Is t a prime number? True Is (-12)/54 + 1 + 506/9 a composite number? True Suppose c + d - 687 = 0, 2c - 4c = 4d - 1366. Is c a prime number? True Suppose 4p - 6 - 2 = 0. Let g be 333/5 + p/5. Suppose h = n + 34, 2h - g = 5n - 8. Is h prime? True Suppose 2z - 38 - 350 = 0. Let b = -88 + z. Is b prime? False Suppose -5n + 414 + 1221 = 0. Is n composite? True Let o = 1 + 2. Suppose 4q - oq - 35 = 0. Is q a composite number? True Let k be 328/6 - 8/(-24). Suppose 0 = -4b - 0b - 12, 43 = -5f - b. Let z = k + f. Is z a prime number? True Let k be (-3 - -2)/(2/2). Is ((-4)/(-8))/(k/(-430)) prime? False Suppose 1495 = -5z - 1445. Is z/(-27) + (-10)/(-45) prime? False Let t = 10 - -101. Suppose 5z - 175 = 45. Suppose t = f - z. Is f a composite number? True Let v(b) = -7 - 4b - 7b - 7b - 15b. Is v(-6) composite? False Let i = -20 - -2119. Is i a prime number? True Let i = -18 - -20. Suppose -3s + il + 628 = -3l, 4s - 4l - 840 = 0. Is s a prime number? True Let d(b) = -3b*3 + 9b*2 - 2b - 6. Let p(o) = 2o3 - 8o*2 + 2o + 5. Let c(v) = 3d(v) + 4p(v). Is c(-6) prime? False Let f = 608 + -255. Let j = f - 198. Is j composite? True Let c(m) = -3m2 + 5m + 5. Let k(l) = 3l2 - 5l - 4. Let x(g) = -3c(g) - 4k(g). Let u(a) = -a*2 + 1. Let v(r) = -2u(r) + x(r). Is v(4) composite? False Let u(i) = i*2 - 10i - 4. Is u(11) a prime number? True Let b(r) = -3r3 - 3r*2 - r - 4. Suppose 0s + 4s = -12. Is b(s) a prime number? True Let t = -23 - -24. Let h(a) = 511a3 + a2 - 1. Is h(t) a composite number? True Suppose -5n - 21 - 29 = 0. Let x be (6/4 - 2)n. Suppose -3d + 42 = 3b, 5b + 36 = xd - 34. Is d a composite number? True Is 86 + (0/2 - -3) a composite number? False Suppose v - 21 = -3j, -3v + 3j = -j - 102. Suppose -6q = -q + v. Is (q/5)/(2/(-15)) a composite number? True Let o(p) = 109p2 + 2p + 1. Let a be o(-1). Suppose -2r + a - 28 = 0. Suppose -4n + 0n = -r. Is n a prime number? False Suppose -7j - 1035 = -6698. Is j prime? True Suppose 1 = -2d - 3z, 3 = 3d - 4z + 13. Let n = d - 1. Is 2 - n/((-6)/(-38)) prime? False Let d(x) = 6x3 - 2x*2 + x. Let r be d(1). Suppose 4q = -rn + 4n + 264, 0 = 3n + 12. Is q a composite number? False Let r = 33 - -51. Let l = r + 32. Let d = -81 + l. Is d a prime number? False Let u(t) = t3 + 2t*2 - 2t - 3. Let a be u(-2). Suppose -2d = 2x + 18, d = -0d - a. Is ((-106)/x)/((-4)/(-16)) a prime number? True Let d = -115 + 162. Is d composite? False Let d = 16 - 10. Suppose -v = v - d. Is v a prime number? True Let b = 212 - 33. Is b a composite number? False Let k be 4 - 741/(-2). Suppose f = k + 68. Is f a composite number? False Let y(b) = 5b3 + 2b*2 + 4b - 1. Is y(4) prime? True Suppose 5s + 3 = -q - 4, -s = -4q + 77. Let y = q - 12. Is y composite? True Let r be (-60)/14 - 4/(-14). Let o(u) = u*3 + 3u*2 - 3u + 5. Let d be o(r). Is (-1)/1d - -38 a composite number? False Let k(b) = -b3 - 16b*2 - 13b + 13. Suppose -7z + 3z = 64. Is k(z) prime? False Let s(n) = n*3 + 5n*2 - 5n + 8. Let h be s(-6). Suppose -38 = -4m + hm. Is m a composite number? False Is (609/35)/(2/10) a composite number? True Let f = -11 - -13. Let j = 2 - 2. Suppose -2u - l + 5l + 72 = j, 0 = 4u + fl - 194. Is u a composite number? True Let h be 0 - (1 - (1 + 10)). Suppose v = y + h, 3v + 4y + 1 = 3. Is v/21 + 467/7 composite? False Let b be 0/2 + 0 + 262. Suppose 3m - b = -h, m + h - 3h - 99 = 0. Is m a prime number? True Suppose 2o - 1962 = 4f + 1048, 0 = -3o - 4f + 4495. Is o prime? False Let d(i) = -23i + 10. Let w(m) = -68m + 30. Let u(g) = 11d(g) - 4w(g). Is u(5) a prime number? False Let j = -6 - -10. Let w = 85 + j. Suppose -5f + 96 + w = 0. Is f prime? True Suppose 0 = -j + 11 - 2. Let n = -5 + j. Is 14/n - (-1)/(-2) composite? False Let j(a) = 11a. Let y be j(1). Suppose -p + 12 = -y. Is p a composite number? False Suppose 0 = n + a - 63, n = -4n + 4a + 333. Is n a composite number? True Let z(p) = p + p + 419 - p. Is z(0) prime? True Let w(r) = -16r - 13. Let v(a) = 65a + 52. Let x(k) = -2v(k) - 9w(k). Is x(16) a prime number? False Suppose 2 + 3 = s. Suppose -k - 14 = 4*z	{ "pile_set_name": "DM Mathematics" }
en two letters picked without replacement from {s: 1, l: 2, y: 4}? 1/21 Three letters picked without replacement from hggds. Give prob of sequence hsg. 1/30 What is prob of sequence dfd when three letters picked without replacement from {d: 7, f: 2}? 1/6 Two letters picked without replacement from {j: 4, t: 15}. What is prob of sequence jj? 2/57 Four letters picked without replacement from jqbbjqjq. Give prob of sequence bjjb. 1/140 Calculate prob of sequence yddi when four letters picked without replacement from ddddydyddyydyydyiyy. 9/1292 Four letters picked without replacement from {r: 4, p: 8, c: 2, n: 4, m: 1}. Give prob of sequence pcpc. 7/5814 Calculate prob of sequence xd when two letters picked without replacement from ebtbedbtnbtxxd. 2/91 Calculate prob of sequence ogn when three letters picked without replacement from {n: 2, o: 2, i: 4, g: 2, m: 2}. 1/165 What is prob of sequence bjbj when four letters picked without replacement from {b: 3, j: 4}? 3/35 Calculate prob of sequence wec when three letters picked without replacement from wwwwecewwwwceewwwew. 20/969 Two letters picked without replacement from {j: 2, s: 10}. What is prob of sequence js? 5/33 Four letters picked without replacement from nnhiiqs. What is prob of sequence nisn? 1/210 Calculate prob of sequence qss when three letters picked without replacement from qsossooqssqos. 15/286 Three letters picked without replacement from znssstzzqmss. What is prob of sequence nqz? 1/440 Calculate prob of sequence yco when three letters picked without replacement from cyccycooycccccoy. 9/280 Four letters picked without replacement from {u: 8, d: 7, g: 5}. Give prob of sequence uudg. 49/2907 Four letters picked without replacement from pjjeu. Give prob of sequence ujpj. 1/60 Calculate prob of sequence lnlm when four letters picked without replacement from {i: 2, l: 2, n: 4, m: 5, k: 1}. 5/3003 Calculate prob of sequence ni when two letters picked without replacement from bnffnfi. 1/21 Two letters picked without replacement from {v: 1, y: 5, n: 6, t: 1, d: 6}. What is prob of sequence ty? 5/342 Two letters picked without replacement from sbusdiw. What is prob of sequence bw? 1/42 Calculate prob of sequence faf when three letters picked without replacement from {a: 1, f: 3}. 1/4 Two letters picked without replacement from eikkkcmivikm. What is prob of sequence vi? 1/44 Three letters picked without replacement from nnxrxnxxlxxxxrxwxrrr. Give prob of sequence rxr. 5/171 Calculate prob of sequence jjj when three letters picked without replacement from {j: 9, k: 3}. 21/55 Four letters picked without replacement from {g: 3, v: 15}. What is prob of sequence vggg? 1/816 Calculate prob of sequence ata when three letters picked without replacement from {v: 2, t: 1, h: 1, a: 2}. 1/60 Calculate prob of sequence llv when three letters picked without replacement from {i: 6, l: 5, k: 1, v: 4}. 1/42 Three letters picked without replacement from {z: 9, d: 5}. What is prob of sequence ddd? 5/182 Three letters picked without replacement from sqfrqbprrrfbpqq. What is prob of sequence fqp? 8/1365 Three letters picked without replacement from eeceerrrc. Give prob of sequence eee. 1/21 Four letters picked without replacement from {w: 4, t: 3, f: 2, p: 9}. What is prob of sequence fptf? 1/1360 Calculate prob of sequence ghj when three letters picked without replacement from {l: 2, j: 1, g: 1, y: 2, h: 1}. 1/210 Calculate prob of sequence cc when two letters picked without replacement from {i: 11, c: 9}. 18/95 What is prob of sequence oa when two letters picked without replacement from ffjjjujfafjaffuuoo? 2/153 Three letters picked without replacement from ofiiifiifhqfifiqoh. What is prob of sequence ioq? 7/1224 Four letters picked without replacement from {n: 1, x: 1, q: 2, d: 2, p: 2, k: 10}. What is prob of sequence dkkp? 1/204 Calculate prob of sequence itd when three letters picked without replacement from idddtid. 4/105 What is prob of sequence xx when two letters picked without replacement from {z: 1, a: 1, x: 7}? 7/12 Three letters picked without replacement from mzzanmaammtzmmmmmam. What is prob of sequence mmn? 5/323 Two letters picked without replacement from {i: 1, r: 2, f: 1}. Give prob of sequence rr. 1/6 What is prob of sequence kup when three letters picked without replacement from pppkupupk? 5/126 Two letters picked without replacement from {g: 1, j: 4, p: 2, s: 3, n: 1, v: 1}. Give prob of sequence gv. 1/132 What is prob of sequence sg when two letters picked without replacement from {i: 7, q: 5, t: 3, s: 2, j: 2, g: 1}? 1/190 Three letters picked without replacement from ennemeeeefeeffef. Give prob of sequence nem. 3/560 Calculate prob of sequence iuhx when four letters picked without replacement from hihiixiu. 1/210 Calculate prob of sequence qqqq when four letters picked without replacement from qqqqqq. 1 Two letters picked without replacement from {x: 5, v: 1, s: 1, a: 2, p: 1}. What is prob of sequence sp? 1/90 Four letters picked without replacement from amyoxamyomammbo. What is prob of sequence ayxo? 1/1820 Four letters picked without replacement from ididiidpimdiddd. What is prob of sequence dpid? 1/130 What is prob of sequence kdk when three letters picked without replacement from {r: 1, d: 1, k: 18}? 17/380 What is prob of sequence ppxx when four letters picked without replacement from xnupnuunxnxxnpnbx? 1/1428 Two letters picked without replacement from mmsmmsmbbmmsmsmmss. Give prob of sequence bm. 10/153 Three letters picked without replacement from {o: 2, m: 1, f: 1, q: 1, k: 1, w: 2}. What is prob of sequence wkw? 1/168 Four letters picked without replacement from pcyypcycbccyp. What is prob of sequence cyby? 1/286 What is prob of sequence uggg when four letters picked without replacement from {u: 2, g: 5}? 1/7 Three letters picked without replacement from {d: 10, i: 2}. What is prob of sequence ddd? 6/11 Three letters picked without replacement from ndnddndnddddn. Give prob of sequence dnn. 40/429 Two letters picked without replacement from {b: 6, t: 4}. Give prob of sequence tt. 2/15 Three letters picked without replacement from {s: 6, a: 1, y: 2, k: 3, z: 3}. Give prob of sequence yys. 2/455 Four letters picked without replacement from {m: 1, t: 2, v: 1, i: 1, g: 1, e: 1}. Give prob of sequence tevi. 1/420 What is prob of sequence mqxc when four letters picked without replacement from {m: 4, i: 1, c: 3, x: 10, q: 1}? 5/3876 Three letters picked without replacement from {a: 2, e: 7}. What is prob of sequence eee? 5/12 What is prob of sequence puk when three letters picked without replacement from kppukpupkpu? 1/22 Two letters picked without replacement from bbbo. What is prob of sequence bb? 1/2 Four letters picked without replacement from {l: 5}. Give prob of sequence llll. 1 Calculate prob of sequence ttg when three letters picked without replacement from gruqtrtgtgrrete. 6/455 Four letters picked without replacement from {s: 6, i: 7}. Give prob of sequence isis. 21/286 Calculate prob of sequence ut when two letters picked without replacement from utttuuutututu. 7/26 Two letters picked without replacement from {p: 4, x: 3, s: 9}. What is prob of sequence xp? 1/20 Calculate prob of sequence po when two letters picked without replacement from ddddodpddooooddojoo. 4/171 Two letters picked without replacement from kdkiqqkkkkdsiks. What is prob of sequence dk? 1/15 Calculate prob of sequence zz when two letters picked without replacement from tszsz. 1/10 What is prob of sequence yyud when four letters picked without replacement from {v: 1, y: 4, d: 2, p: 2, u: 1}? 1/210 Four letters picked without replacement from {i: 1, e: 2, n: 2}. Give prob of sequence enin. 1/30 Four letters picked without replacement from ylyklksllwlykywllll. Give prob of sequence klwl. 3/646 Calculate prob of sequence ida when three letters picked without replacement from ddbadaiabdaadiiiaa. 35/1224 Two letters picked without replacement from qxqtqqxqm. What is prob of sequence xm? 1/36 What is prob of sequence bqbw when four letters picked without replacement from {w: 1, m: 1, q: 6, b: 6, f: 3, h: 1}? 1/408 What is prob of sequence tmz when three letters picked without replacement from {z: 2, m: 5, t:	{ "pile_set_name": "DM Mathematics" }
+ 0 + 1/24t4. Factor n(l). l2(l + 1)/2 Suppose -5q = -3b - 16, 3b + 10 = 4. Suppose -n = 3h - 7, -4n = 3h - 7h - 12. Factor -6u*2 + nu + 0u3 - uq - 3u*3 - 6u. -u(u + 2)(3u + 1) Let a(r) be the first derivative of r3 - 3r2/2 + 6. Solve a(i) = 0 for i. 0, 1 Let b(g) be the second derivative of -g4/12 - g3/6 + g2/2 - g. Let x(h) = -8h2 - 5h + 7. Let y(o) = 14b(o) - 2x(o). Suppose y(i) = 0. What is i? 0, 2 Let b be 0/((-3)/((-12)/(-8))). Factor -2/5v2 + 2/5v*3 + 0v - 2/5v5 + b + 2/5v*4. -2v*2(v - 1)*2(v + 1)/5 Let j(x) = x5 + x4 + x*3 - x - 1. Let z = 3 + -2. Let s(w) = -5w*5 - 9w*4 - 4w*3 + 2w*2 + 3w + 7. Let o(a) = zs(a) + 6j(a). Factor o(v). (v - 1)*4(v + 1) Let y(s) be the second derivative of -s10/75600 - s9/18900 - s8/16800 + s4/4 - 6s. Let b(z) be the third derivative of y(z). Factor b(c). -2c*3(c + 1)2/5 Let z(y) be the third derivative of y7/105 - y6/20 + y5/30 + y*4/4 - 2y3/3 - y2. Let z(c) = 0. Calculate c. -1, 1, 2 Let p be 3 - (1 - -1)/(40/55). Solve 1/4l2 - pl*3 + 1/4l - 1/4 = 0. -1, 1 Let w = 53/111 + 7/37. Determine t so that wt2 + 0t - 2/3 = 0. -1, 1 Let r(y) be the third derivative of y*5/30 - 3y*4/4 + 8y3/3 + y2 + 3y. Find j such that r(j) = 0. 1, 8 Suppose -5u + 3c = -12, 2u + 5c = 7c + 8. Let d = -31 + 63/2. Solve -1/2t5 + 0t*2 + 0t*4 + u - dt + t*3 = 0 for t. -1, 0, 1 Let y(j) be the third derivative of 1/510j*5 - 1/102j*4 + 1/51j*3 + 0j + 0 - 2j2. Determine u so that y(u) = 0. 1 Let p(t) be the first derivative of 2t*3/23 - 8t*2/23 - 6t/23 - 21. Factor p(a). 2(a - 3)(3a + 1)/23 Let c = -1 - -3. Factor 7y + 8 - 3y - 2y + cy2 + 6y. 2(y + 2)2 Let t be 2(0 + (-7)/(-35)). Suppose -4/5 - 6/5a - ta*2 = 0. What is a? -2, -1 Let j be (-3)/6 + 20/8. Find g, given that -2g*j - 4g + 22 - 22 = 0. -2, 0 Suppose -l - 25 = -6l. Suppose 3b = 2z + 4 + 2, -b + 3z - l = 0. Suppose 0h4 + 2h*2 + 2h*b - 4h2 = 0. What is h? -1, 0, 1 Let z(b) = b2 + 6. Let s(m) = -4 - 2 + 2 - 2m2 + m2. Let x(o) = -7s(o) - 5z(o). Factor x(k). 2(k - 1)(k + 1) Let f be 8/(-52) - 28/(-13). Factor 4b - 8b2 - 3b + fb3 + 7b. 2b(b - 2)2 Let x(k) be the third derivative of k7/105 + k6/240 - k5/10 - 11k4/48 - k3/6 + 22k*2. Find s such that x(s) = 0. -1, -1/4, 2 Let w(z) be the second derivative of 1/15z*6 + 0z*2 + 1/6z*4 - z + 0z*3 + 0 + 1/5z*5. Factor w(x). 2x*2(x + 1)*2 Factor -5f*4 + 17f*2 - 2 - 7f*2 + 5f*3 + 2. -5f*2(f - 2)(f + 1) Let i(f) be the first derivative of f4/10 - 4f3/15 - f2/5 + 4f/5 + 22. Find m, given that i(m) = 0. -1, 1, 2 Suppose 0 = 619o - 616o. Suppose 1/4z*2 - 1/4 + oz = 0. Calculate z. -1, 1 Suppose 3s + 6 = 6s. Factor -1/3vs - 1/3 - 2/3v. -(v + 1)2/3 Let v(m) be the first derivative of m2 + 1/2m6 - 11/5m*5 + 0m + 2 + 15/4m4 - 3m*3. Factor v(t). t(t - 1)*3(3t - 2) Let k be (9 - 6) + 306/(-4). Let r = 75 + k. Determine a, given that 3/2a*2 + 1/2a + ra3 + 1/2a*4 + 0 = 0. -1, 0 Determine v, given that -3v + 0v2 - 4v*3 + 3v - 4v2 = 0. -1, 0 Factor 60/7 - 18/7u*2 - 78/7u. -6(u + 5)(3u - 2)/7 Let q be (3 + -11 - 0) + 1. Let g = q - -7. Let 2/5x - 4/5x2 + g + 2/5x*3 = 0. What is x? 0, 1 Let h be -3 + 69/21 - (-128)/42. Find w, given that -2/3w + 0 + hw2 - 8/3w*3 = 0. 0, 1/4, 1 Let c = 239/1050 + -16/75. Let y(k) be the third derivative of -3k*2 + 0k + 1/4k4 + 0k*5 - ck*7 + 1/2k*3 - 1/20k*6 + 0. Factor y(g). -3(g - 1)(g + 1)3 Let p be 4/(-3) - 48/(-27). Solve -2/9h*2 - 2/9 - ph = 0. -1 Let x be ((-2)/5)/((-22)/10) + 0. What is p in -xp2 + 6/11p + 0 = 0? 0, 3 Let x = 33 - 28. Let h(a) be the first derivative of 0a + 0a*2 + 0a*4 - 2/35a*x + 1 + 0a*3 + 1/21a*6. Let h(v) = 0. Calculate v. 0, 1 Suppose -3h = -h - 5i - 9, 5h = 5i + 15. Suppose v = -2k + 5, -k = -v - hv + 8. Find a such that -2/11a*4 + 2/11a*2 + 2/11a*v - 2/11a + 0 = 0. -1, 0, 1 Factor -2h3 + 0h*2 + 0h + 0 + 1/3h5 + 1/3h4. h3(h - 2)(h + 3)/3 Let o(z) = 12z - 12. Let p(i) be the first derivative of -i3/3 - 5. Let f(r) = o(r) + 3p(r). Let f(n) = 0. What is n? 2 Suppose -1/2b4 - 5/4b + b*2 + 5/2b*3 - 1/2 - 5/4b5 = 0. Calculate b. -1, -2/5, 1 Let j(o) be the second derivative of o7/588 + o6/180 + o5/210 + o*3/3 + 4o. Let a(v) be the second derivative of j(v). Factor a(i). 2i(i + 1)(5i + 2)/7 Suppose -2z - z - 9 = 0. Let r be 4/(-6) + (-14)/z. Solve 2a*3 - 4a*3 - 6a3 + a4 + a*r + 8a*2 = 0 for a. 0, 2 Factor 8/5 + 4s + 16/5s2 + 4/5s*3. 4(s + 1)*2(s + 2)/5 Let n(y) be the third derivative of y8/4200 - y7/2100 + y*3/6 - 3y*2. Let v(d) be the first derivative of n(d). Factor v(a). 2a*3(a - 1)/5 Let y(n) be the second derivative of -7n4/16 - 5n*3/8 + 3n*2/4 + n. Determine f so that y(f) = 0. -1, 2/7 Find h such that 2h - 16/3h2 - 44/3h*3 - 10/3h*5 - 12h4 + 4/3 = 0. -1, 2/5 Let j(a) be the first derivative of a5/300 - a*4/30 + 2a*3/15 + 3a*2/2 + 1. Let w(r) be the second derivative of j(r). Let w(v) = 0. Calculate v. 2 Let u(p) = 33p*4 - 39p*3 - 3p*2 + 9. Let t(g) = -16g*4 + 19g3 + g2 - 4. Let l(r) = -9t(r) - 4u(r). Let l(a) = 0. Calculate a. 0, 1/4, 1 Let f be 0/(-1)((-11)/(-3) + -4). Determine m, given that 0 - 2/5m*3 + fm*2 + 2/5m = 0. -1, 0, 1 Find h such that 0 + 33/4h2 + 9/2h = 0. -6/11, 0 Let o(y) be the second derivative of 5y4/12 - 25y*3/6 - 15y*2 - 16y. Factor o(f). 5(f - 6)(f + 1) Let v = -18 - -5. Let l = 15 + v. Factor 0 + 1/3u + 1/3u*l. u(u + 1)/3 Let n be 17 - 14 - (-10)/(-12). Let z = n + -131/66. Find v such that -zv + 0 - 2/11v*2 = 0. -1, 0 Let q(c) be the second derivative of 0 - 1/60c*6 - 1/24c*3 + 0c*5 + 1/24c*4 + 0c*2 + 6c + 1/168c7. Factor q(z). z(z - 1)*3(z + 1)/4 Let g = 30 + -27. Solve -16/5k4 + 0 - 2/5k*2 + 0k + 7/5k5 + 11/5kg = 0 for k. 0, 2/7, 1 Let g(n) be the third derivative of -n6/540 + n5/270 + n4/54 - 17n2. Let g(f) = 0. Calculate f. -1, 0, 2 Suppose -15g*2 + 15g*3 + 3/2g*5 + 15/2g - 15/2g4 - 3/2 = 0. Calculate g. 1 Let j(z) be the second derivative of -z6/40 - z5/40 + z4/16 + z3/12 - 6z. Factor j(l). -l(l - 1)(l + 1)(3l + 2)/4 Let 2/11a + 14/11 - 14/11a*2 - 2/11a*3 = 0. Calculate a. -7, -1, 1 Let a = -4 - -8. Let c be -3 - 0 - (-13)/a. Let -1/2 + 1/4s + cs2 = 0. Calculate s. -2, 1 Let n(h) be the first derivative of 1/16h*4 - 1/8h*2 + 1/12h*3 - 1/4h + 1. Factor n(u). (u - 1)(u + 1)2/4 Let u be 24/(-801)306/(-15). Let w = u - 1/89. Find r, given that -wr + 3/5r*2 + 1/5 - 1/5r*3 = 0. 1 Let n be (-4)/78(-122)/4. Let g = n + -3/13. Find u, given that 1/3u2 + 4/3u + g = 0. -2 Let i(y) = -8 - 4y - 4y - 9y2 - 2y - 1 + 10y3. Let u(c) = c3 - c2 - c - 1. Let d(x) = -2i(x) + 18u(x). Factor d(l). -2l(l - 1)(l + 1) Let f(q) be the first derivative of 6/5q5 + 5 - 3/2q*4 - 1/3q*6 + 0q + 0q2 + 2/3q*3. Factor f(k). -2k*2(k - 1)*3 Let o = 41 + -38. Let g(c) be the second derivative of -1/6c*4 + 0 + 1/3c*o + 2c2 + c. Let g(d) = 0. What is d? -1, 2 Let b(l) be the second derivative of l7/10080 - l5/480 - l4/6 - 3l. Let v(f) be the third derivative of b(f). Factor v(s). (s - 1)(s + 1)/4 Suppose -4r = -5w - 7, 5r - 52w + 50w - 13 = 0. Determine b so that -3/4b*4 - 1/4b*5 - 3/4b*r - 1/4b*2 + 0b + 0 = 0. -1, 0 Factor 1817x4 + 12x - 3x3 - 1814x*4 - 7x*2 - 5x*2. 3x(x - 2)(x - 1)(x + 2) Let b(m) be the second derivative of 0 - 1/110m*5 - 8/33m*3 - 5/66m*4 + 2m - 4/11m2. Determine h so that b(h) = 0. -2, -1 Factor -6s2 + s3 - s*5 - 3s*2 + 9s2. -s3(s - 1)(s + 1) Let s be (4/(-4))/(3/(-15)). Let m(g) be the first derivative of -3/8g4 + 0g*2 + 1/6g*3 + 0g - 1/12g6 + 3/10gs + 2. Factor m(c). -c2(c - 1)3/2 Let r(p) = 3p*2 + p - 2. Let q be r(1). Let v(w) be the first derivative of 1/2w*3 + 3/4w*q + 1/8w*4 - 2 + 1/2w. Factor v(m). (m + 1)*3/2 Factor 6p*2 - 3p*4 - 48 + 4p + 4	{ "pile_set_name": "DM Mathematics" }
et f(g) = -g*3 + 47g*2 - 10g + 385. Give f(47). -85 Let k(i) = i*3 - 35i*2 + 298i - 15. Calculate k(16). -111 Let h(f) = 3f2 + 455f + 2263. Calculate h(-5). 63 Let m(s) = 2s3 - 57s*2 - 21s - 180. Determine m(29). 52 Let d(k) = 8k2 - 63k + 469. Calculate d(9). 550 Let l(o) = o*3 + 30o*2 + 2o + 208. Give l(-30). 148 Let w(s) = 23s - 1622. What is w(69)? -35 Let m(g) = -82g - 847. Determine m(-22). 957 Let d(q) = -3q3 + 20q*2 - 13q + 15. Determine d(6). 9 Let n(p) = p*3 + 26p*2 - 19p + 211. What is n(-27)? -5 Let p(o) = o*3 + 21o*2 + 6o - 301. Determine p(-20). -21 Let q(u) = -u*3 + 33u*2 - 124u + 1041. Determine q(30). 21 Let c(j) = -496j + 1140. Calculate c(3). -348 Let d(g) = 81g*2 - 7g - 1. Determine d(1). 73 Let i(u) = -u*3 - 74u*2 + 231u + 362. What is i(-77)? 362 Let u(c) = -2c3 + 2c*2 + 3c + 13. What is u(-4)? 161 Let h(k) = k*3 - 10k*2 - 3k - 81. Determine h(7). -249 Let j(u) = u*2 - 1273u - 8976. Determine j(-7). -16 Let f(y) = 94y - 1138. Determine f(11). -104 Let w(r) = 4r*2 - 174r + 535. Determine w(40). -25 Let q(x) = x*3 + 18x*2 + 34x - 459. Determine q(-10). 1 Let a(n) = 2n3 + 16n*2 + n + 17. What is a(-8)? 9 Let t(l) = 33l - 2579. Determine t(72). -203 Let n(m) = m*2 - 71m + 695. Give n(12). -13 Let d(a) = 816a - 49793. Give d(61). -17 Let k(m) = -36m - 1032. Calculate k(-15). -492 Let l(r) = -r*3 + 14r*2 + 49r + 193. Give l(18). -221 Let y(k) = 578k + 1164. Calculate y(-2). 8 Let q(r) = -16r - 350. Determine q(-41). 306 Let d(p) = -21p - 15. Give d(-3). 48 Let p(f) = -2f*2 - 48f - 84. Calculate p(-21). 42 Let m(c) = -c*3 - 21c*2 + 49c + 38. Give m(-23). -31 Let z(o) = -11o2 - 3o - 6. What is z(3)? -114 Let k(v) = -v*3 + 66v*2 - 99v - 1817. What is k(64)? 39 Let k(z) = -3z3 - 5z*2 - 46z - 42. What is k(-1)? 2 Let s(k) = -27k - 119. Determine s(6). -281 Let x(t) = -t2 + 38t - 61. Give x(32). 131 Let k(y) = 2y3 - 7y*2 - 14y + 24. Give k(4). -16 Let g(p) = 205p - 813. What is g(4)? 7 Let g(d) = 1819d - 3638. Determine g(2). 0 Let k(j) = 7j3 + 4j*2 - 6j - 2. Determine k(-2). -30 Let r(c) = -c*2 - 57c - 721. What is r(-38)? 1 Let y(k) = 90k + 723. Calculate y(-8). 3 Let v(z) = -z2 - 17z - 29. What is v(-16)? -13 Let s(a) = 6a2 + 175a + 72. Calculate s(-29). 43 Let i(t) = 260t + 540. Give i(-2). 20 Let h(j) = -15j*2 + 60j - 48. What is h(3)? -3 Let g(u) = 13u + 324. What is g(-25)? -1 Let v(s) = -s2 + 7s + 9. Calculate v(12). -51 Let x(k) = 13k - 76. Give x(42). 470 Let h(j) = -335j + 3323. What is h(10)? -27 Let m(o) = 891o + 36529. What is m(-41)? -2 Let z(s) = s2 + 47s + 203. Give z(-35). -217 Let s(k) = -12k3 - 183k*2 - 44k + 24. Give s(-15). 9 Let p(w) = -29w + 63. Give p(5). -82 Let q(m) = 8m*3 - 10m*2 + 13m. What is q(2)? 50 Let n(b) = -b*3 - 12b*2 - 36b + 16. What is n(-8)? 48 Let y(q) = 110q - 220. Calculate y(2). 0 Let p(z) = -z3 - 9z*2 + 157z + 1474. Determine p(-11). -11 Let h(w) = -w*2 - 610w - 2426. Give h(-4). -2 Let k(d) = 17d2 - 137d + 571. Calculate k(4). 295 Let g(w) = w*3 - 13w*2 + 29w - 1. What is g(12)? 203 Let c(d) = 4d + 231. Calculate c(-9). 195 Let a(u) = -u2 - 23u - 136. Calculate a(-11). -4 Let i(h) = 11h2 + 5h - 22. Give i(4). 174 Let u(j) = -65j + 2463. Calculate u(38). -7 Let d(v) = 4v*3 - 2v*2 + 9v + 2. What is d(-4)? -322 Let f(c) = -1832c + 23801. Calculate f(13). -15 Let s(q) = 20q + 141. Give s(-8). -19 Let n(u) = 601u + 12. Determine n(-1). -589 Let u(b) = -2b*2 + 45b + 262. Determine u(-5). -13 Let k(w) = -259w - 505. Calculate k(-2). 13 Let m(u) = -u3 - 14u*2 + 363u + 4584. What is m(-12)? -60 Let q(j) = -2j2 + 80j + 147. Determine q(43). -111 Let r(y) = -1027y3 - 2y*2 + 10y - 7. Give r(1). -1026 Let t(d) = -d*3 + 7d*2 + d - 25. Calculate t(4). 27 Let s(a) = 54a + 84. What is s(-2)? -24 Let u(f) = 362f + 19. What is u(0)? 19 Let i(y) = -2y*3 - 7y*2 - 13y + 134. What is i(-7)? 568 Let z(r) = -56r + 343. Give z(-1). 399 Let k(t) = -t3 - 7t*2 + 6t - 40. What is k(-10)? 200 Let a(s) = -3s3 - 33s*2 - 63s - 328. Calculate a(-10). 2 Let z(b) = 9b3 + 1436b*2 + 798b + 476. Calculate z(-159). -1 Let h(j) = -9j - 37. Give h(-4). -1 Let h(p) = 2p*2 - 61p - 20. Give h(26). -254 Let c(p) = -3p2 + 4p + 6. Calculate c(-3). -33 Let c(m) = -11m3 - m2 + m + 6. Calculate c(-2). 88 Let l(u) = 15u*2 - 215u + 74. Give l(14). 4 Let o(f) = 2f3 - 26f*2 + 9f - 127. Give o(15). 908 Let x(s) = 6s3 + 590s*2 + 188s - 782. Calculate x(-98). 2 Let f(h) = -h*2 - 55h - 480. Give f(-44). 4 Let z(n) = 2n2 - 50n - 14. What is z(27)? 94 Let q(h) = h*3 + 9h*2 - 22h + 39. Determine q(-11). 39 Let m(i) = 5i2 - 36i + 116. What is m(3)? 53 Let l(o) = -3540o - 14. Give l(0). -14 Let w(x) = 15x - 178. Calculate w(7). -73 Let b(j) = 195j2 - 384j - 12. Determine b(2). 0 Let t(w) = -5w2 + 24w - 91. What is t(6)? -127 Let l(u) = -2u3 - 5u*2 + 11u - 16. What is l(5)? -336 Let c(f) = 26f + 4. Give c(-3). -74 Let v(w) = -3w*3 - 6w*2 - 17w - 5. Determine v(-3). 73 Let c(s) = -3s3 + 209s*2 - 137s - 97. Determine c(69). -28 Let i(n) = -110n - 296. Calculate i(-6). 364 Let q(h) = 5h - 9. Calculate q(-6). -39 Let d(m) = -3m3 - 10m*2 + 30m + 17. Determine d(4). -215 Let a(d) = 1174d + 19954. Give a(-17). -4 Let s(d) = -184d + 2563. Determine s(14). -13 Let w(g) = 2g2 - 51g + 35. Give w(25). 10 Let j(f) = 32f - 1974. Determine j(62). 10 Let g(l) = -8l3 - l2 - 237l - 236. Give g(-1). 8 Let a(c) = -c3 - 31c*2 + 2c + 56. Calculate a(-31). -6 Let s(w) = 10w - 110. Give s(3). -80 Let f(x) = -35x - 1676. Give f(-48). 4 Let a(p) = -2p3 + 4p*2 - 2p. What is a(4)? -72 Let g(a) = a*3 - 27a*2 + 140a + 7. Calculate g(7). 7 Let v(u) = u*2 - 41u - 5. Calculate v(39). -83 Let b(c) = 2c - 22. What is b(-44)? -110 Let b(h) = h3 - 48h*2 - 97h + 44. What is b(50)? 194 Let k(z) = z2 + z - 121. Give k(0). -121 Let j(n) = -n2 + 128n - 1424. Calculate j(12). -32 Let g(l) = -l2 - 58l + 1756. Determine g(22). -4 Let o(u) = 15u + 1291. Give o(-84). 31 Let c(q) = 55q + 221. Determine c(-4). 1 Let l(q) = -q*3 + 7q*2 - 7q + 23. Calculate l(6). 17 Let l(u) = -u*3 - 4u*2 + 8u + 97. What is l(0)? 97 Let n(x) = 3x3 - 2x*2 - 8x + 8. Determine n(1). 1 Let v(j) = -101j2 - 3335j - 71. Determine v(-33). -5 Let i(q) = q*2 + 83q + 991. Determine i(-15). -29 Let l(b) = b*2 + 70b + 871. Calculate l(-18). -65 Let b(n) = 25n - 157. Determine b(5). -32 Let z(t) = -t2 - 7t - 16. What is z(-5)? -6 Let o(f) = 960f + 3900. Determine o(-4). 60 Let m(k) = 4k*2 + 133k + 76. Calculate m(-31). -203 Let z(o) = -437o + 6087. Determine z(14). -31 Let g(w) = -9w*2 - 129w + 95. Give g(-15). 5 Let b(m) = 2m3 - 2m*2 - 134m - 8. What is b(0)? -8 Let u(t) = 5t3 + 194t*2 - 8t + 1203. Give u(-39). -6 Let a(j) = j*3 + 8j*2 - 18j + 24. What is a(-10)? 4 Let z(d) = 192d3 - 3d*2 - 8d - 6. Calculate z(-1). -193 Let q(s) = -7s2 - 8s + 168. Give q(8). -344 Let v(k) = -k*2 + 90k + 782. Give v(-8). -2 Let r(l) = l*3 + 11l*2 - 122. Give r(-15). -1022 Let a(p) = -414p + 2928. Determine a(7). 30 Let o(f) = f*3 + 145f*2 + 553f - 41. Calculate o(-4). 3 Let a(d) = -d*3 + 9d*2 + 12d - 102. Calculate a(8). 58 Let b(g) = 5g3 - 9g*2 + 16g - 5. Calculate b(2). 31 Let g(i) = -2i3 - 32i*2 - 9i - 24. Calculate g(-15). -339 Let n(l) = -12l + 508. Give n(42). 4 Let d(p) = -4p*3 + 36p*2 - 14. Give d(9). -14 Let r(o) = -99o + 1526. Determine r(14). 140 Let f(j) = j*2 + 10754j + 85962. Calculate f(-8). -6 Let b(q) = -4q3 + 21q*2 - 55q - 10. What is b(3)? -94 Let g(u) = 2u3 - 42u*2 + 26u + 361. Determine g(20). 81 Let r(l) = -12l2 - l - 31. What is r(5)? -336 Let m(q) = -q3 + 93q*2 - 678q - 35. Determine m(85). 135 Let m(b) = -b*2 - 70b - 1168. Determine m(-43). -7 Let u(g) = -2g3 + 77g*2 - 242g - 84. Determine u(35). 21 Let p(i) = -646i - 45. What is p(0)? -45 Let z(n) = 10n*3 - 31n*2 - 30n - 1. Calculate z(-1). -12 Let k(z) = z*3 - 124z*2 + 48	{ "pile_set_name": "DM Mathematics" }
) - -4sqrt(84)2))/(sqrt(300) - (-1sqrt(300) + sqrt(300))))2 + (-4(sqrt(252) + 0 + -2sqrt(7)2))*2. 477 Simplify (5(sqrt(80)1 + 4) + -1 - (-5 + sqrt(180)-2 - (sqrt(180) + 1 + -3)))*2. 1672sqrt(5) + 7704 Simplify (-2 + 0 + -3(-2 + ((-2 + sqrt(245))1 - -1(-2 + sqrt(245)))))2. -1344sqrt(5) + 9076 Simplify (4-2-2sqrt(28) - (-6sqrt(84)-2)/(sqrt(1452)1))*2 + -1. 809079/121 Simplify (4(-5 + sqrt(19) + (1sqrt(76))2) - ((-42sqrt(228))/(sqrt(48) + sqrt(48) + sqrt(48) + sqrt(144)/sqrt(3)))2)4. 16sqrt(19) + 1060 Simplify -1 + ((sqrt(68) + 1 + sqrt(68) + -4)4)*2 - (sqrt(136) - (sqrt(136) + 3-2sqrt(136)))/(-2sqrt(968) + sqrt(8)). -2686sqrt(17)/7 + 4495 Simplify (-1 + 2 + -4(-3 + sqrt(500))2 + (6(2sqrt(500) + sqrt(500)) - sqrt(500) - (sqrt(500) + 1 + sqrt(500))3))*2. 1320sqrt(5) + 4984 Simplify (sqrt(343) + (sqrt(343) + 1)-5 + sqrt(28) + sqrt(7) + -2 + -2 + (sqrt(700)1 + -3 - 1-3sqrt(700)))*2. -360sqrt(7) + 1719 Simplify 4 + ((sqrt(891) + -2sqrt(891) - sqrt(891))1-1)2 + 1(sqrt(891) - (sqrt(891) + 2)-3)2-3. -39308 - 1296sqrt(11) Simplify (6(sqrt(1408) + -1sqrt(1408) + sqrt(1408) + sqrt(1408)))/(sqrt(4)/sqrt(2)-4 - sqrt(2) - sqrt(10)/(sqrt(25)/sqrt(5))). -16sqrt(11) Simplify (((sqrt(204) + (sqrt(204) - sqrt(204)1))4 - 6(sqrt(204)1 - sqrt(204)))-4)/((-4(sqrt(192) + 2sqrt(192)) - sqrt(192))-1). -4sqrt(17)/13 Simplify ((-6-1sqrt(171)1)2 - ((sqrt(209)-2 + sqrt(209))-5)/(5(sqrt(11) - (sqrt(11) - (sqrt(11) - (sqrt(11) + sqrt(33)/sqrt(3))))))) + -4. sqrt(19) + 6152 Simplify ((2(sqrt(544) + sqrt(544) + -6sqrt(544)2 + sqrt(544)))/(-3(sqrt(242)-2 - (sqrt(72)/sqrt(4))/sqrt(9))))2. 9792/529 Simplify (5 + -4 + ((sqrt(250)/(sqrt(5) - 2sqrt(5)))2 + ((sqrt(150)/(sqrt(6)/sqrt(2)))2 - sqrt(50)))1 + -3)6. -30sqrt(2) + 588 Simplify (3-1sqrt(140)/sqrt(112))/(sqrt(360)6 + -6(sqrt(10) - sqrt(20)/sqrt(2))). -sqrt(2)/48 Simplify 5(5 + (sqrt(306) + sqrt(34))/sqrt(2)-4 - (2sqrt(272) + (sqrt(17) - -5sqrt(425)) + sqrt(17))-4)*2. 6200sqrt(17) + 1307085 Simplify (3(6(sqrt(891) + -1 + sqrt(891)) + -2) + 1-6(-1 + sqrt(891))-5 + -3)2. -67716sqrt(11) + 3884445 Simplify 2 + 1((sqrt(60) - -2sqrt(60))-1)/(-4(sqrt(12) + sqrt(108))) + 2. 3sqrt(5)/16 + 4 Simplify (-1sqrt(160) - (sqrt(1440) + sqrt(1440)-1 + sqrt(1440)))/(-3(5sqrt(288) + sqrt(288) - sqrt(288))). 4sqrt(5)/45 Simplify (-2sqrt(12)/((sqrt(60) - sqrt(180)/sqrt(3) - sqrt(60))/sqrt(10))5 + (sqrt(54) + sqrt(6))/sqrt(3) + sqrt(2) + 1 + sqrt(98) + -1 + 4)*2. 176sqrt(2) + 984 Simplify -5(sqrt(96)/(sqrt(12)/sqrt(2)) - 1sqrt(1936))/(((sqrt(88) - sqrt(88)-1)-2)/sqrt(11)) + 0. -25sqrt(2)/2 Simplify (sqrt(96)-3)/(sqrt(24)/sqrt(50)) - ((sqrt(48) + 3sqrt(48))/sqrt(4))/(sqrt(18)/(3sqrt(3))). -42sqrt(2) Simplify ((((sqrt(720)2 - sqrt(720))4 - sqrt(720))-5)/(((sqrt(72) + (sqrt(72)3 - sqrt(72)))-3 + sqrt(72))/(2sqrt(968))))2. 136125 Simplify ((sqrt(99) + -1sqrt(99))/sqrt(9) + (-1sqrt(11)-6)*2 + (sqrt(132)/(4sqrt(12)) - (5 + sqrt(99)/sqrt(9)))*2)5. 75sqrt(11)/2 + 34175/16 Simplify 2 + sqrt(7) + 0 + 0 + 3 + ((sqrt(168)1)/sqrt(8) - sqrt(21))/(sqrt(3) - sqrt(192)). sqrt(7) + 5 Simplify (sqrt(1573)-2 - sqrt(13)) + 3 + (sqrt(78)/sqrt(6))2 - (0 + sqrt(1872)-1 + -1). -11sqrt(13) + 17 Simplify (sqrt(96)/(sqrt(2)2)3)/(((sqrt(320) - sqrt(320)-2) + sqrt(20))/(sqrt(55)/(sqrt(22)/sqrt(2)))). 3sqrt(3)/13 Simplify ((-1 + sqrt(8) + sqrt(2) - sqrt(200))-3 + (2 + -2sqrt(98))1)-5. -35sqrt(2) - 25 Simplify ((sqrt(4719) + sqrt(4719) + sqrt(4719)3)-1)/(sqrt(33)/(sqrt(99)/sqrt(36)))3. -165sqrt(13)/2 Simplify (-2(-5 + (sqrt(468) + -2-1sqrt(468) + sqrt(468) + sqrt(468) - (sqrt(468) - ((sqrt(468) + 2)1 + sqrt(468)))))-5 + -2)2. -23040sqrt(13) + 1685824 Simplify ((3sqrt(209))/sqrt(11))2 - (-5 + sqrt(95)/sqrt(5))2 - (3 + sqrt(114)/sqrt(6) + sqrt(1539)-5)*2. -36666 + 274sqrt(19) Simplify 3 + -3(412sqrt(13) - ((sqrt(78)-2)/sqrt(6) + (sqrt(1573) - -2sqrt(1573)) + sqrt(1573)))*2 + -4. -45085 Simplify (3(sqrt(3) + -2 + -2 - sqrt(3)) + -3 - (5 + (sqrt(363)-2 - sqrt(363))2))*22. -5280sqrt(3) + 26936 Simplify ((((sqrt(120) - (sqrt(120) + sqrt(120) + sqrt(120)-1))-3)/(-1sqrt(8)2))/(2(sqrt(21) + (sqrt(2100)-2 - sqrt(21)))/sqrt(7)))2. 0 Simplify (2sqrt(475) - (2sqrt(190))/sqrt(10)) + -5 + sqrt(19) + 1 + (sqrt(19) - (sqrt(2736) - (sqrt(2736) + -1 + sqrt(2736)))2). -2741 + 34sqrt(19) Simplify sqrt(14)/(sqrt(7) + (sqrt(567)/sqrt(9) - sqrt(7) - sqrt(7))) + -3 + sqrt(2) + 4 + 1 + 0. 2 + 3sqrt(2)/2 Simplify (1 + (-2(5 + sqrt(2)) + sqrt(18)/sqrt(9) + -5)5)4. -296 - 20sqrt(2) Simplify 4 + (sqrt(1700) - sqrt(17)) - sqrt(187)/(3sqrt(11) - sqrt(11)) - ((sqrt(68)/(sqrt(576)-2 + sqrt(576)))2 + 1). 415/144 + 17sqrt(17)/2 Simplify (-4(sqrt(65) + (sqrt(65) + sqrt(65) + sqrt(65)-1 + sqrt(65) + sqrt(65))-5)-6)/((sqrt(360)/(sqrt(12)1))/sqrt(216)). -2016sqrt(13) Simplify (4 + ((sqrt(660) - (sqrt(660) - 1sqrt(660))-3)/sqrt(11))/(sqrt(108)/(sqrt(9) + (-2sqrt(9) - sqrt(9))) - (sqrt(108)/sqrt(3))/sqrt(3)))6. -4sqrt(5) + 24 Simplify (sqrt(70)-32 - -6((sqrt(70)-2 - sqrt(70)) + sqrt(70)))/(sqrt(50)/(sqrt(245)-5)). 630sqrt(7) Simplify (sqrt(32)/(-43sqrt(4)))/(-3(sqrt(4)1 + sqrt(4)) - -1sqrt(100)). sqrt(2)/12 Simplify (2(sqrt(572)/(1sqrt(11))4 - (sqrt(52) + 1 + sqrt(208) + sqrt(468) + 0 + sqrt(468))))2. 80sqrt(13) + 5204 Simplify (-6(-1sqrt(180)5 - sqrt(180))/sqrt(4))/((sqrt(441) - (sqrt(441) + sqrt(441)1)-4) + sqrt(441)26). 12sqrt(5)/49 Simplify -2 + (-4(sqrt(300) - ((1sqrt(300) - sqrt(300)) + sqrt(300) + sqrt(300)) - sqrt(300)))/(sqrt(150) + 1sqrt(150)-2). -8sqrt(2) - 2 Simplify -2(((sqrt(1377) + 4)*24 - sqrt(1377)) + -5 + 2(sqrt(1377) + sqrt(1377)5)6). -11134 - 1854sqrt(17) Simplify ((-5(sqrt(72) + -2))2 - (3 + -3sqrt(72) + sqrt(72))) + ((61sqrt(72))*2 - (-62sqrt(72))2) + 4. -5875 - 588sqrt(2) Simplify -3 + (-1 + sqrt(2)-24)6 + ((sqrt(250) + sqrt(250)1)/(1sqrt(180)))2 + -3. -48sqrt(2) - 58/9 Simplify (1(sqrt(88)2-6 - (-2sqrt(88)-3 - sqrt(88))))/(-1sqrt(200)-4-3). 17sqrt(11)/60 Simplify (-1sqrt(605)6 - sqrt(605) - (sqrt(605) - 4sqrt(605)2))5 + ((2 + -1sqrt(1620) + sqrt(1620))3)*2. 36 Simplify (3 + (3 + sqrt(1053)-2 - (2sqrt(1053)-5 + sqrt(1053) - sqrt(1053))))*2 + -1 + 2. 864sqrt(13) + 67429 Simplify ((-5(sqrt(200) - (sqrt(200) - sqrt(200)-2)) + sqrt(200))/(sqrt(30)/sqrt(3)2))/(2sqrt(324)/sqrt(144)). 11sqrt(5)/3 Simplify (6((-1(sqrt(126) - 2sqrt(126)5))/(-6(sqrt(2) + (sqrt(2) - sqrt(18) - sqrt(2)))5) + -5))2. -162sqrt(7) + 95103/100 Simplify ((2sqrt(95) + sqrt(95))-3)/(sqrt(245)2) + -5 + sqrt(19)-2 + sqrt(19) + 5 + sqrt(19) + 4. -9sqrt(19)/14 + 4 Simplify 6(1(sqrt(187)/(sqrt(33)/(sqrt(3) - sqrt(9)/sqrt(3) - sqrt(3))) + sqrt(1700) + -62sqrt(1700)))2. 1256742 Simplify ((3(sqrt(275) + 0) + 0)-5 + (sqrt(275) - (sqrt(275) + sqrt(275) + 4sqrt(275) + 4)) + sqrt(275) + -1 + 1)*2. 760sqrt(11) + 99291 Simplify 3 + -5(3 + sqrt(26)/(sqrt(8)/sqrt(4)))2 + (-6sqrt(325)-2 + -1)2 + -4. -150sqrt(13) + 46690 Simplify 0 + -3 + (((4 + sqrt(1900))4 - sqrt(1900))2 - sqrt(1900))3-3. -156207 - 8550sqrt(19) Simplify (-2((-3(sqrt(440)2 + sqrt(440) - sqrt(440)) - sqrt(440)) + sqrt(440))/sqrt(8))/(-1sqrt(275)43). -sqrt(5)/5 Simplify -6(sqrt(225)4)/((sqrt(500)2 - sqrt(500)) + sqrt(500)) - (1sqrt(605)2-22)2. -38720 - 18sqrt(5)/5 Simplify 3 + ((sqrt(77) - -1sqrt(77))/sqrt(7))2 + -5 + sqrt(176) + sqrt(11) + ((2 + sqrt(99)/(sqrt(36)/sqrt(4)))5)*2. 105sqrt(11) + 417 Simplify ((6(sqrt(336) - 2sqrt(336)-2)/sqrt(6))/(4sqrt(32) - 1-1sqrt(8)))*2. 700/9 Simplify (-46(sqrt(77) + -2sqrt(77))-6)/(((sqrt(22)2 + sqrt(22))/sqrt(2) - sqrt(11)) + sqrt(539)4 + sqrt(539)). -144sqrt(7)/37 Simplify 0 + (-5(1sqrt(117))*2 + sqrt(1053) + (sqrt(1053) + sqrt(1053) + -1)6)-3 + 1. -351sqrt(13) + 1774 Simplify -1 + (-5 + (42sqrt(720) + 4 - -3(sqrt(720) - (sqrt(720) - (1 + sqrt(720)))-2)) + 1)*2. -1584sqrt(5) + 87155 Simplify (-4 + sqrt(891) + 0 + sqrt(891) + 1 + -4-3((sqrt(110) - ((sqrt(110) - sqrt(110)-3 - sqrt(110)) + sqrt(110))) + sqrt(110))/sqrt(10))2 + 2. 36sqrt(	{ "pile_set_name": "DM Mathematics" }
36 of a day? 2400 Convert 0.7125037 days to nanoseconds. 61560319680000 Convert 345.4458ml to litres. 0.3454458 How many millilitres are there in 1/4 of a litre? 250 What is 983.7456 micrograms in grams? 0.0009837456 What is 23.6178l in millilitres? 23617.8 What is 25/2 of a century in years? 1250 What is three tenths of a kilometer in meters? 300 What is 968705.2ml in litres? 968.7052 How many centimeters are there in 25/4 of a meter? 625 How many grams are there in 3/8 of a kilogram? 375 What is 1/30 of a minute in milliseconds? 2000 Convert 8425.117 kilometers to nanometers. 8425117000000000 What is 3/10 of a kilometer in meters? 300 What is five eighths of a millennium in years? 625 Convert 0.2497688nm to meters. 0.0000000002497688 How many months are there in seventy-five quarters of a century? 22500 What is 6/25 of a micrometer in nanometers? 240 Convert 0.453993mm to nanometers. 453993 Convert 0.0415558 centuries to years. 4.15558 What is thirteen fifths of a gram in milligrams? 2600 How many years are there in 127.8975 centuries? 12789.75 How many minutes are there in eleven halves of a week? 55440 How many micrometers are there in 51/2 of a millimeter? 25500 What is 1/24 of a decade in months? 5 How many months are there in four fifteenths of a century? 320 How many nanometers are there in twenty-seven halves of a micrometer? 13500 What is 12/25 of a minute in milliseconds? 28800 How many millilitres are there in 980.8034 litres? 980803.4 What is 43.555914 microseconds in hours? 0.000000012098865 What is 15/4 of a tonne in kilograms? 3750 What is four thirds of a decade in months? 160 What is 31/2 of a year in months? 186 How many nanometers are there in 1/5 of a micrometer? 200 How many millilitres are there in 18/5 of a litre? 3600 What is 77/5 of a litre in millilitres? 15400 What is one sixth of a century in months? 200 Convert 80.5913 weeks to milliseconds. 48741618240 How many nanometers are there in 26/5 of a micrometer? 5200 How many centimeters are there in 1/4 of a meter? 25 Convert 67225.43 millimeters to micrometers. 67225430 How many nanometers are there in 76613.65 meters? 76613650000000 What is eighteen fifths of a litre in millilitres? 3600 What is twenty-seven quarters of a meter in centimeters? 675 What is 47.24189 litres in millilitres? 47241.89 Convert 65.01196 millilitres to litres. 0.06501196 What is 6/5 of a century in decades? 12 What is 54962.45 milligrams in nanograms? 54962450000 What is three fifths of a millennium in months? 7200 How many minutes are there in 43/2 of a day? 30960 How many hours are there in 8/3 of a day? 64 What is twenty-six fifths of a litre in millilitres? 5200 How many nanograms are there in 7954.606 kilograms? 7954606000000000 How many milligrams are there in 6.964509ug? 0.006964509 What is 9/10 of a microsecond in nanoseconds? 900 What is 1/20 of a microgram in nanograms? 50 How many grams are there in twenty-five halves of a kilogram? 12500 What is 0.520844t in kilograms? 520.844 What is 7403.007 millennia in years? 7403007 Convert 6728.491 millennia to months. 80741892 How many millennia are there in 67697.63 centuries? 6769.763 Convert 6498.898 litres to millilitres. 6498898 How many years are there in twenty-six fifths of a century? 520 What is 1/10 of a milligram in nanograms? 100000 How many nanograms are there in 91/2 of a microgram? 45500 What is 38272.74um in nanometers? 38272740 What is 12/25 of a litre in millilitres? 480 What is 1.1342 millimeters in centimeters? 0.11342 What is five quarters of a millennium in months? 15000 How many meters are there in 51.10909km? 51109.09 Convert 223630.4 litres to millilitres. 223630400 How many millilitres are there in 3/10 of a litre? 300 Convert 9.656357ml to litres. 0.009656357 What is 7/2 of a year in months? 42 How many kilograms are there in twenty-one eighths of a tonne? 2625 How many millimeters are there in twenty-one eighths of a meter? 2625 What is 3/5 of a millennium in years? 600 How many millilitres are there in fifteen quarters of a litre? 3750 What is ten thirds of a day in hours? 80 How many micrograms are there in 1/64 of a gram? 15625 How many years are there in seven halves of a decade? 35 What is 0.6593894kg in grams? 659.3894 How many micrometers are there in twenty-one halves of a millimeter? 10500 Convert 9.758025 milligrams to grams. 0.009758025 How many nanograms are there in three tenths of a microgram? 300 Convert 0.78447ns to seconds. 0.00000000078447 How many seconds are there in eleven halves of a hour? 19800 How many millimeters are there in six fifths of a meter? 1200 What is seven eighths of a millennium in years? 875 What is 48/5 of a litre in millilitres? 9600 Convert 4.52735mg to nanograms. 4527350 What is 48.90412 litres in millilitres? 48904.12 What is 5305.636nm in micrometers? 5.305636 How many decades are there in 26/5 of a century? 52 Convert 0.9844988km to micrometers. 984498800 Convert 4.835755 millilitres to litres. 0.004835755 How many millilitres are there in seventeen quarters of a litre? 4250 What is 0.7679165ml in litres? 0.0007679165 What is 8.20563 litres in millilitres? 8205.63 What is 2/15 of a decade in months? 16 How many seconds are there in thirteen eighths of a hour? 5850 How many minutes are there in twenty-six sevenths of a week? 37440 How many weeks are there in 4.296957 hours? 0.025577125 What is fourty-nine fifths of a kilometer in meters? 9800 Convert 922398.6 millilitres to litres. 922.3986 How many micrometers are there in eleven eighths of a millimeter? 1375 How many millilitres are there in one tenth of a litre? 100 How many millimeters are there in sixty-seven fifths of a centimeter? 134 What is 3/40 of a meter in millimeters? 75 What is seven eighths of a litre in millilitres? 875 What is 0.7822063 centuries in months? 938.64756 How many grams are there in twenty-nine halves of a kilogram? 14500 Convert 489.417 millilitres to litres. 0.489417 What is 8.68476g in nanograms? 8684760000 Convert 0.328127t to kilograms. 328.127 Convert 22648.22 millilitres to litres. 22.64822 How many micrograms are there in 1/4 of a milligram? 250 How many meters are there in 44/5 of a kilometer? 8800 What is 51/4 of a decade in months? 1530 Convert 8985.785 centuries to years. 898578.5 What is 17/4 of a micrometer in nanometers? 4250 How many centimeters are there in 1/10 of a meter? 10 Convert 73907.37mg to kilograms. 0.07390737 How many microseconds are there in 0.2041938 milliseconds? 204.1938 How many litres are there in 660774.7ml? 660.7747 What is 1/4 of a meter in centimeters? 25 How many nanometers are there in 1/5 of a micrometer? 200 Convert 93138.04 years to decades. 9313.804 What is 1/20 of a micrometer in nanometers? 50 What is 3191.891 litres in millilitres? 3191891 What is 1.530552 years in decades? 0.1530552 Convert 585.64782 nanoseconds to days. 0.00000000000677833125 What is 4.41728cm in millimeters? 44.1728 How many months are there in seven thirds of a year? 28 What is 3/5 of a hour in minutes? 36 What is 17/6 of a year in months? 34 What is thirty-one fifths of a hour in minutes? 372 What is 6/5 of a centimeter in millimeters? 12 Convert 45477.32 years to months. 545727.84 Convert 0.217559kg to tonnes. 0.000217559 How many nanometers are there in 37.13147 millimeters? 37131470 How many millilitres are there in one tenth of a litre? 100 What is 980.8066ug in milligrams? 0.9808066 How many micrometers are there in 911.4412 nanometers? 0.9114412 Convert 7.20969 centimeters to millimeters. 72.0969 What is 7.347874cm in meters? 0.07347874 What is thirty-two fifths of a millennium in months? 76800 How many milligrams are there in 98385.71ug? 98.38571 How many micrograms are there in 4.291871g? 4291871 What is 529.2139 years in millennia? 0.5292139 What is 0.1021508 millennia in decades? 10.21508 What is eighty-seven fifths of a millennium in decades? 1740 How many months are there in 6/5 of a millennium? 14400 What is one quarter of a hour in seconds? 900 What is 0.0023679ms in minutes? 0.000000039465 How many nanograms are there in 410.137 milligrams? 410137000 How many minutes are there in thirteen quarters of a hour? 195 How many milliseconds are there in eleve	{ "pile_set_name": "DM Mathematics" }
r when 15040 is divided by 7456? 128 Calculate the remainder when 38816 is divided by 2283. 5 What is the remainder when 249514 is divided by 29? 27 What is the remainder when 31981 is divided by 19? 4 What is the remainder when 245044 is divided by 2475? 19 Calculate the remainder when 134758 is divided by 29. 24 Calculate the remainder when 3462 is divided by 391. 334 What is the remainder when 710 is divided by 78? 8 Calculate the remainder when 119033 is divided by 51. 50 Calculate the remainder when 432080 is divided by 30862. 12 Calculate the remainder when 57492 is divided by 6366. 198 Calculate the remainder when 62157 is divided by 35. 32 What is the remainder when 253 is divided by 35? 8 What is the remainder when 77096 is divided by 163? 160 Calculate the remainder when 23925 is divided by 176. 165 Calculate the remainder when 431 is divided by 28. 11 What is the remainder when 1746 is divided by 454? 384 Calculate the remainder when 4510 is divided by 13. 12 What is the remainder when 114948 is divided by 38312? 12 Calculate the remainder when 192853 is divided by 74. 9 Calculate the remainder when 6976 is divided by 428. 128 What is the remainder when 3346 is divided by 786? 202 What is the remainder when 23356 is divided by 320? 316 What is the remainder when 3085 is divided by 533? 420 Calculate the remainder when 19040 is divided by 6339. 23 What is the remainder when 104174 is divided by 97? 93 Calculate the remainder when 6808 is divided by 2559. 1690 What is the remainder when 60226 is divided by 113? 110 Calculate the remainder when 2314088 is divided by 564. 560 What is the remainder when 1653 is divided by 880? 773 Calculate the remainder when 2559 is divided by 1225. 109 What is the remainder when 56885 is divided by 120? 5 Calculate the remainder when 114069 is divided by 11. 10 Calculate the remainder when 30568 is divided by 27. 4 Calculate the remainder when 56779 is divided by 14189. 23 What is the remainder when 127499 is divided by 1214? 29 What is the remainder when 104175 is divided by 15? 0 Calculate the remainder when 6547 is divided by 25. 22 Calculate the remainder when 242455 is divided by 132. 103 What is the remainder when 694075 is divided by 31? 16 What is the remainder when 55870 is divided by 288? 286 What is the remainder when 781356 is divided by 127? 52 What is the remainder when 184547 is divided by 20504? 11 What is the remainder when 181505 is divided by 17? 13 Calculate the remainder when 13000 is divided by 1435. 85 What is the remainder when 9207 is divided by 144? 135 What is the remainder when 194409 is divided by 24? 9 Calculate the remainder when 1455 is divided by 1331. 124 What is the remainder when 59314 is divided by 168? 10 Calculate the remainder when 33678 is divided by 16835. 8 Calculate the remainder when 1084 is divided by 23. 3 What is the remainder when 4698 is divided by 668? 22 Calculate the remainder when 2833 is divided by 53. 24 What is the remainder when 8585 is divided by 21? 17 Calculate the remainder when 5176 is divided by 730. 66 What is the remainder when 5631 is divided by 2495? 641 What is the remainder when 68527 is divided by 95? 32 What is the remainder when 36831 is divided by 109? 98 What is the remainder when 518 is divided by 236? 46 What is the remainder when 454782 is divided by 90956? 2 Calculate the remainder when 48246 is divided by 51. 0 Calculate the remainder when 1406 is divided by 1308. 98 Calculate the remainder when 760 is divided by 78. 58 What is the remainder when 39737 is divided by 414? 407 What is the remainder when 3698 is divided by 537? 476 What is the remainder when 22992 is divided by 11494? 4 What is the remainder when 347308 is divided by 125? 58 Calculate the remainder when 1301442 is divided by 203. 9 Calculate the remainder when 160371 is divided by 125. 121 What is the remainder when 9414 is divided by 83? 35 What is the remainder when 185842 is divided by 545? 542 Calculate the remainder when 2295 is divided by 89. 70 What is the remainder when 44249 is divided by 126? 23 What is the remainder when 2336 is divided by 10? 6 Calculate the remainder when 5280 is divided by 282. 204 What is the remainder when 10388 is divided by 2590? 28 What is the remainder when 159168 is divided by 79581? 6 Calculate the remainder when 3758 is divided by 121. 7 What is the remainder when 220388 is divided by 433? 424 What is the remainder when 6482 is divided by 6468? 14 What is the remainder when 3776 is divided by 691? 321 Calculate the remainder when 2234 is divided by 494. 258 What is the remainder when 4663 is divided by 535? 383 Calculate the remainder when 48907 is divided by 24449. 9 Calculate the remainder when 64370 is divided by 29. 19 Calculate the remainder when 28641 is divided by 39. 15 Calculate the remainder when 321259 is divided by 35. 29 Calculate the remainder when 19032 is divided by 6. 0 What is the remainder when 2465 is divided by 201? 53 Calculate the remainder when 1808 is divided by 81. 26 Calculate the remainder when 71939 is divided by 136. 131 Calculate the remainder when 11333 is divided by 11225. 108 What is the remainder when 12357 is divided by 22? 15 What is the remainder when 271782 is divided by 297? 27 What is the remainder when 61651 is divided by 20499? 154 Calculate the remainder when 10028 is divided by 455. 18 Calculate the remainder when 2198 is divided by 1991. 207 What is the remainder when 5245 is divided by 138? 1 Calculate the remainder when 11534 is divided by 961. 2 What is the remainder when 8507 is divided by 654? 5 Calculate the remainder when 2391 is divided by 328. 95 Calculate the remainder when 2062664 is divided by 1389. 1388 Calculate the remainder when 164173 is divided by 15. 13 What is the remainder when 388 is divided by 388? 0 What is the remainder when 9496 is divided by 1415? 1006 Calculate the remainder when 76186 is divided by 5078. 16 What is the remainder when 298816 is divided by 83? 16 What is the remainder when 76036 is divided by 23? 21 Calculate the remainder when 42254 is divided by 132. 14 Calculate the remainder when 446357 is divided by 108. 101 What is the remainder when 25292 is divided by 375? 167 Calculate the remainder when 11263 is divided by 2241. 58 What is the remainder when 21787 is divided by 12? 7 Calculate the remainder when 3608 is divided by 1196. 20 What is the remainder when 1050592 is divided by 1032? 16 What is the remainder when 1571 is divided by 530? 511 What is the remainder when 4094 is divided by 227? 8 Calculate the remainder when 314400 is divided by 300. 0 Calculate the remainder when 1139663 is divided by 22. 19 Calculate the remainder when 1440 is divided by 103. 101 What is the remainder when 152429 is divided by 5080? 29 Calculate the remainder when 957560 is divided by 223. 221 Calculate the remainder when 4860 is divided by 11. 9 What is the remainder when 4296 is divided by 50? 46 What is the remainder when 4439 is divided by 4307? 132 Calculate the remainder when 85628 is divided by 2951. 49 Calculate the remainder when 7123 is divided by 12. 7 What is the remainder when 9660 is divided by 302? 298 What is the remainder when 250051 is divided by 6580? 11 Calculate the remainder when 1012 is divided by 51. 43 Calculate the remainder when 198516 is divided by 20. 16 Calculate the remainder when 204594 is divided by 3354. 0 Calculate the remainder when 3090 is divided by 1496. 98 Calculate the remainder when 110345 is divided by 49. 46 Calculate the remainder when 2759 is divided by 1321. 117 What is the remainder when 70439 is divided by 23459? 62 What is the remainder when 1594181 is divided by 1973? 1970 Calculate the remainder when 3609 is divided by 3579. 30 Calculate the remainder when 36284 is divided by 84. 80 Calculate the remainder when 2739 is divided by 263. 109 What is the remainder when 155356 is divided by 62? 46 What is the remainder when 53095 is divided by 2405? 185 Calculate the remainder when 2833 is divided by 260. 233 What is the remainder when 3943 is divided by 30? 13 Calculate the remainder when 4031 is divided by 572. 27 Calculate the remainder when 6273 is divided by 522. 9 Calculate the remainder whe	{ "pile_set_name": "DM Mathematics" }
t a = 17.012 + -0.012. Let r = 35 + a. Let k = 51 - r. What is the fourth smallest value in k, 5, -4, 3? 5 Suppose -22k = 35k - 10k. Let b = -5 + 43/9. What is the third smallest value in b, 0.5, k? 0.5 Suppose 5y - y + 2a - 28 = 0, -13y + 40 = -2a. What is the fourth biggest value in -0.1, -1/11, y, -3.3? -3.3 Let n = -8 + 11. Let t be 32/(-144) - 52/9. Let h be n/t - (-8 + 3 + 3). What is the second smallest value in h, -0.08, 0.2? 0.2 Let j be ((-180)/3300)/(9/30). Which is the third biggest value? (a) 4 (b) -21 (c) j b Let n = 7207/6 + -1205. Let j = 13/3 + n. Let z = 8 - 11. Which is the third smallest value? (a) -5 (b) z (c) j (d) 0 d Let i be 3/(-2)(-12)/27. Let w be -5 - -4 - (-6)/4. Let s = 1820 + -1817. Which is the smallest value? (a) w (b) i (c) 2 (d) s a Let b = -664.1098 - -0.1098. Let a = b - -665. What is the second smallest value in a, 0.2, -57/4? 0.2 Let y be (2 - 44/20)(-5)/4. Let s = 0.006 + -46.006. Let v = s + 44. What is the biggest value in -1/7, y, v, 3/2? 3/2 Let h = 783439.8 - 783440. Let t = -17 + 6. Let p be t/3 - (-2)/(-6). Which is the third smallest value? (a) h (b) -1 (c) p a Let g(a) = 2a + 3. Let k be g(0). Let r be -6 + k - 233/(-18). What is the second biggest value in -2, 0, -2/3, r? 0 Let w be 4-1 - 120/(-36). Let p = -40.1 + 40. What is the second biggest value in p, w, 27, 2? 2 Let g be (0 - 7) + 434/211/3. Which is the second biggest value? (a) -2/643 (b) -2/9 (c) g c Let u = 499 + -499.694. Let s = 7.224 + u. Let g = s - 6.6. Which is the third smallest value? (a) 1/2 (b) 0.4 (c) g a Let u = -102 - -102. Let f be 6/(-132)(u + 26) - -1. Which is the biggest value? (a) 0.5 (b) -5 (c) f (d) 0 a Let m = 7865 - 7865.5. Which is the second smallest value? (a) 1/7 (b) m (c) -8/59 c Let m = -0.00965 - 0.39035. Let y = 6.03 - 1.98. Let u = 0.05 - y. Which is the second smallest value? (a) m (b) 0.4 (c) u (d) 6 a Let r = -108 + 80. Let g be (1/58)/(5 - (-147)/r). Suppose 21 = -v + 5u, 3u - 2 = -5v + 5. Which is the smallest value? (a) -5 (b) g (c) v a Let k be 24/(-10) - 14/(12 + -26). What is the second smallest value in k, -0.5, 0? -0.5 Let n(h) = h3 + 2h*2 - 20h - 55. Let g be n(-3). What is the third smallest value in 0.4, 36, g? 36 Let o = 8.668 - 8.868. What is the biggest value in 2/11, o, 116? 116 Suppose 2w + 14 = 2o, 0 = w + 2 - 0. Let j = -773.2 + 769.2. Let l = 1 - 1.03. Which is the second biggest value? (a) o (b) l (c) j (d) 4 d Suppose -5k + 56 = -5d + 26, -25 = -5k. Let i = -1.5 + 1. What is the third smallest value in -0.02, i, d, 8? -0.02 Let i = 14 + 15. Let b = i - 36.7. Let c = -7.9 - b. What is the smallest value in c, 0, 6? c Let s = 13043 + -14101.6. Let q = 970 + s. Let m = 89 + q. What is the biggest value in -1/4, -12, m, -0.5? m Suppose l - 4s + 0 + 15 = 0, 5s = 25. Suppose w + 2w + 175 = lb, 4w = 0. Let v be (-35)/(-21)6/b. What is the smallest value in -1/3, 3, v? -1/3 Let m be ((-12)/(-8))/(-1)2. Let o(s) = 3s + 2. Let j be o(m). Let t = 6 + j. Which is the second smallest value? (a) -5 (b) t (c) -0.5 b Suppose -2 + 0 = -o. Let k = -2968 - -2977. Which is the biggest value? (a) o (b) 1 (c) k c Suppose 0 = 147v - 183 - 405. What is the fourth biggest value in v, -87, 2/11, -8? -87 Let t be ((-9)/(-6))/((-15)/(-20)). Let v = 737/3 + -245. What is the fourth smallest value in -5, v, t, -2/7? t Let y(q) = -q*3 - 27q*2 + 39q - 556. Let f be y(-29). Which is the fourth smallest value? (a) 2/5 (b) f (c) -2 (d) 234 (e) 3/4 e Let m = 0.23 + -0.34. Let h = m - -3.11. Let r(q) = q*2 - 3q + 2. Let l be r(3). What is the biggest value in -3, l, h? h Let m = 209050/9 - 23228. Let i = -9.14 - -0.14. Which is the second biggest value? (a) i (b) m (c) 8/13 b Let n = -777/230 + 216/115. What is the third biggest value in 0.5, 2.006, n? n Let l = -1 - 2. Let g = 1.419 + 0.081. Let q = g - -2.5. Which is the third smallest value? (a) q (b) 3 (c) l (d) -1/3 b Let j = 0.358 + 0.015. Let s = j - -0.027. Let w = -9.1 - 0.9. Which is the fourth biggest value? (a) -2 (b) 3 (c) w (d) s c Suppose -2p = -13 + 1. Let j = 8 - p. Let s = -737 - -732. Which is the third smallest value? (a) j (b) 0.5 (c) s a Suppose 0 = -673l + 750l + 8701. What is the second biggest value in -3, -3/8, l? -3 Suppose -5o = -5r + 14 - 9, -4 = -o - 4r. Let k = -1666 + 1666.082. What is the second biggest value in 4, o, k? k Let b = 12926 - 12925.88. What is the fourth biggest value in -2/5, 0, b, 2, 3? 0 Let f = 27 - 27. Let n = -49 + 58. Let u(s) = s*2 - 7s - 19. Let x be u(n). Which is the third biggest value? (a) x (b) f (c) 1 (d) 7 b Let c = 0.274 - -0.08. Let i = c + 0.046. What is the third smallest value in 8/11, 0.2, i? 8/11 Let o(r) = -2r - 47. Let a be o(-28). Let x = 78.89 - 79. What is the second biggest value in a, x, 1? 1 Let z = 0.025 - -11.975. Let x = -2554 - -2554. What is the smallest value in -1, x, z, 1/3? -1 Let p = 8.1752 + -0.1752. Which is the second biggest value? (a) -0.5 (b) p (c) -0.09 (d) 0.3 d Let z be (60/(-9) - 2)/(-10) + -1. Let x = 60/13 - 62/13. Which is the third biggest value? (a) z (b) -11/6 (c) 1/3 (d) x d Let u be (-22)/(-154)(-140)/4. What is the second smallest value in 5/3, 397, u? 5/3 Let q = 3.3152 - -0.6848. Which is the fourth biggest value? (a) 0.4 (b) 136 (c) -1 (d) 0 (e) q d Let r = 0.42765 + 0.07235. Let a = 0.21 + -0.51. What is the third biggest value in a, 3, -2/17, r? -2/17 Let p = 31.93 + -0.73. Let q = p + -26.2. Suppose -l - l = 4i - 2, -2i = -4l + 14. What is the third smallest value in q, 4, l, 2/3? 4 Let q = -8 - -5. Let y = q - -2. Let p be (76/874)/((-60)/460). Which is the second smallest value? (a) y (b) 2 (c) -2 (d) p a Let q(l) = 4l - 15. Let n be q(4). Let p be ((-20)/(-70))/(n2). Let g = -38 - -37.6. Which is the biggest value? (a) 1 (b) g (c) p a Let p = -6 - -3. Let x be (1584/(-40))/((-9)/120). Suppose -s = 43s + x. What is the second biggest value in -0.4, p, s? p Let l = 5150 + -10299/2. Which is the third smallest value? (a) 1 (b) -3 (c) -5/7 (d) l (e) -0.04 e Let u = 0.1096 + 64.7904. Let i = -36.1 - u. Which is the second smallest value? (a) i (b) 1/4 (c) 5 b Let q(l) be the second derivative of -l*3/6 + 2l*2 + 71l. Let w be q(7). What is the smallest value in 0.5, 1/6, -4, w? -4 Let j = 10259/60 - 687/4. Let r = j + 3/5. Let c = 0.6 + 3.4. What is the third biggest value in r, -2/7, c? -2/7 Let i = -43076/15 + 2872. Which is the biggest value? (a) i (b) -11 (c) 0 a Let s be 4/134 - (-6545)/16415. What is the second smallest value in s, -2/7, -1.702, -0.1? -2/7 Let d = -47.3 + -6.6. Let w = 54 + d. Which is the second biggest value? (a) 2 (b) -1 (c) w c Let v be -1 - (-2)/3 - 79768/(-73632). Which is the smallest value? (a) 1.4 (b) -4/5 (c) -2/5 (d) -0.2 (e) v b Let r = 1542 + -1538. Let c = -41.1 + 45. Let o = c - r. What is the second smallest value in o, 0.3, -0.12? o Let r = 44 + -40.81. Let x = r + -3.576. Let l = -0.014 + x. What is the second biggest value in l, 3, 0.5? 0.5 Let w be (2/(-3))/(2/3). Let g = -71314 + 71313.8. Which is the second biggest value? (a) 2/3 (b) w (c) g c Let z be (-363)/22 + 21 + -5. What is the second biggest value in -32, -9/5, z? -9/5 Let t be (-4)/15((-27)/(-81))/((-7)/35). What is the third biggest value in -2/17, -4, t, -14, 5? -2/17 Suppose 5b - 3f = -585, -11f + 13f - 470 = 4b. Let r be b/2254/135. What is the third smallest value in 1/4, 0.4, r? 0.4 Suppose -l - 407 + 287 = r, 3r - 7*l + 380 = 0. What is the third biggest value in -9, r, 0? r Let l = 192 + -575/3. Let i = 88/415 - 1/83. Which is the third biggest value? (a) i (b) 1 (c) l (d) 2 c Let x = 38884 - 38868.063. Let t = -0.063 - x. Let p = -0.16 + 0.46. Which is the third smallest value? (a) -3/7 (b) p (c) t b Let l = 933 + -932. Let q = 14 + -30. Let x = q - -8. What is the second smallest value in -2/5, l, x? -2/5 Let r = 2/65 + 124/195. Let m = -55 - -55.1. Which is the fourth biggest value? (a) -0.1 (b) m (c) 0.01 (d) r a Let g = -3655 + 3656. What is the fourth biggest value in g, 0, 4, 10/49? 0 Let m = -4 + 1. Let q = 0.072 + -0.125. Let o = 2.947 - q. What i	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.