Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
7? True Is 30 a factor of 228697? False Does 19 divide 865946? False Is 883599 a multiple of 171? False Does 18 divide 100690? False Is 326 a factor of 1911979? False Is 244662 a multiple of 43? False Does 6 divide 222336? True Is 13374848 a multiple of 128? True Is 48 a factor of 653493? False Is 202 a factor of 1410162? True Does 30 divide 100915? False Does 52 divide 1155232? True Does 11 divide 1205413? True Is 113 a factor of 321163? False Is 44 a factor of 330241? False Does 10 divide 477870? True Is 933144 a multiple of 32? False Is 587657 a multiple of 11? False Does 60 divide 15720? True Is 11 a factor of 256383? False Does 100 divide 447177? False Is 90 a factor of 2390541? False Is 139920 a multiple of 424? True Does 6 divide 8670190? False Is 14 a factor of 895775? False Does 9 divide 58643? False Is 221581 a multiple of 42? False Is 1643085 a multiple of 5? True Is 14582106 a multiple of 10? False Is 343615 a multiple of 93? False Does 26 divide 1034098? True Does 418 divide 10664434? True Is 3228708 a multiple of 1292? True Does 6 divide 108038? False Is 237298 a multiple of 474? False Does 63 divide 8724681? True Does 3 divide 435804? True Is 715187 a multiple of 11? True Is 5 a factor of 322217? False Is 748800 a multiple of 100? True Does 57 divide 259577? False Does 14 divide 2688? True Is 3 a factor of 12914? False Is 748722 a multiple of 174? True Is 658432 a multiple of 512? True Is 2545061 a multiple of 1277? True Is 4949600 a multiple of 16? True Is 188230 a multiple of 16? False Does 27 divide 35080? False Does 18 divide 3262226? False Does 102 divide 44778? True Is 9 a factor of 23014703? False Is 21 a factor of 18165? True Does 3 divide 90297? True Is 101 a factor of 152391? False Is 267648 a multiple of 16? True Is 7 a factor of 97692? True Is 645540 a multiple of 5? True Does 285 divide 2265? False Does 4 divide 59048? True Does 36 divide 20059416? True Is 37 a factor of 221034? False Is 14 a factor of 322862? False Is 7433128 a multiple of 86? False Does 660 divide 453420? True Does 70 divide 1544041? False Does 7 divide 40626? False Is 28 a factor of 20154? False Is 78551 a multiple of 37? True Does 42 divide 22764? True Is 711256 a multiple of 13? True Does 152 divide 46056? True Is 111054 a multiple of 166? True Is 45843 a multiple of 111? True Does 42 divide 408837? False Is 11 a factor of 1988745? True Does 1102 divide 3151553? False Is 110 a factor of 3790355? False Is 277485 even? False Does 8 divide 1899432? True Does 99 divide 4632210? True Is 23 a factor of 23706? False Does 15 divide 5588385? True Does 15 divide 54285? True Is 3 a factor of 26635? False Is 42 a factor of 48510? True Does 6 divide 222041? False Is 34 a factor of 6357524? True Is 116 a factor of 3051264? True Does 847 divide 12880329? True Does 14 divide 791126? True Is 21231408 a multiple of 237? True Is 21840 a multiple of 3? True Is 223329 a multiple of 87? True Is 89 a factor of 8176? False Is 365646 a multiple of 818? True Is 6250 a multiple of 234? False Is 54 a factor of 64558? False Is 14932 a multiple of 116? False Is 11 a factor of 120868? True Does 57 divide 6965695? False Is 272 a factor of 6571060? False Does 211 divide 268645? False Does 10 divide 103462? False Is 34166887 a multiple of 160? False Is 10 a factor of 195630? True Is 507 a factor of 5841147? True Is 7 a factor of 855879? False Is 2224482 a multiple of 361? True Does 31 divide 556667? True Does 98 divide 305765? False Is 40 a factor of 35884? False Is 87285 a multiple of 162? False Is 341603 a multiple of 69? False Does 12 divide 3894096? True Does 120 divide 29520? True Is 16 a factor of 246797? False Is 432604 a multiple of 37? True Does 121 divide 172193? False Is 76835 a multiple of 41? False Is 76 a factor of 65208? True Is 476276 a multiple of 176? False Is 186648 a multiple of 28? True Is 33 a factor of 29861? False Does 6 divide 313002? True Is 1569720 a multiple of 824? True Does 123 divide 159241? False Is 2886429 a multiple of 327? True Is 18 a factor of 1681632? True Is 32 a factor of 6367968? True Does 221 divide 260780? True Does 124 divide 3499884? False Does 2 divide 26480? True Does 144 divide 2798453? False Is 15 a factor of 1794630? True Is 486657 a multiple of 3? True Is 332 a factor of 134283? False Is 319017 a multiple of 10? False Is 71208 a multiple of 72? True Is 1844190 a multiple of 45? True Does 58 divide 4073424? False Does 46 divide 154468? True Does 33 divide 895126? False Is 218 a factor of 676672? True Is 1092 a factor of 1512420? True Is 4648015 a multiple of 5? True Is 68430 a multiple of 15? True Does 25 divide 630375? True Is 52431 a multiple of 4? False Does 146 divide 88039? False Is 81 a factor of 14003642? False Is 9 a factor of 635211? True Is 1256869 a multiple of 178? False Is 61239 a multiple of 74? False Is 3418762 a multiple of 8? False Does 8 divide 63928? True Is 407 a factor of 95306? False Is 142 a factor of 76112? True Is 404181 a multiple of 60? False Does 641 divide 636513? True Does 414 divide 6047053? False Does 2456 divide 11941072? True Is 8 a factor of 7944? True Is 431756 a multiple of 23? True Does 18 divide 6474439? False Is 11532 a multiple of 12? True Is 235963 a multiple of 91? True Is 108 a factor of 13973501? False Does 97 divide 774216? False Is 6935 a multiple of 95? True Is 3007475 a multiple of 25? True Does 195 divide 2339147? False Does 36 divide 180572? False Is 3 a factor of 323300? False Is 17 a factor of 366326? False Is 65 a factor of 168476? False Does 51 divide 6982566? False Is 104 a factor of 12450844? False Is 16159178 a multiple of 21? False Is 8266478 a multiple of 2108? False Is 14 a factor of 5852? True Is 201213 a multiple of 12? False Is 28 a factor of 2021292? True Is 16 a factor of 1017712? True Does 137 divide 14389932? True Is 53 a factor of 785672? True Does 1373 divide 294201? False Is 57 a factor of 401518? False Does 190 divide 4554300? True Does 273 divide 433524? True Is 16 a factor of 5217238? False Is 10 a factor of 4304922? False Does 692 divide 1148720? True Is 14 a factor of 3486? True Is 8 a factor of 974045? False Is 3524020 a multiple of 5? True Is 11487801 a multiple of 13? True Is 31 a factor of 420217? False Is 189 a factor of 1656018? True Does 348 divide 3820097? False Is 138 a factor of 350106? True Does 643 divide 259931? False Is 44191 a multiple of 59? True Does 95 divide 122372? False Does 2 divide 34633? False Is 71 a factor of 659164? True Is 19 a factor of 832426? False Is 4215549 a multiple of 485? False Is 6 a factor of 184224? True Is 655605 a multiple of 94? False Is 15 a factor of 3976173? False Is 8902746 a multiple of 61? False Does 5 divide 130515? True Does 4 divide 355144? True Is 108441 a multiple of 45? False Is 1097068 a multiple of 25? False Does 83 divide 195880? True Is 13 a factor of 526929? True Does 11 divide 2202981? True Is 1802216 a multiple of 104? True Is 351696 a multiple of 102? True Does 3 divide 186042? True Is 260901 a multiple of 273? False Is 123 a factor of 26199? True Does 9 divide 2644545? False Is 9 a factor of 97200? True Is 17765057 a multiple of 25? False Is 473213 a multiple of 13? True Is 217399 a multiple of 13? True Is 145 a factor of 572177? False Is 195673 a multiple of 419? True Is 98 a factor of 423187? False Does 15 divide 298035? True Is 36 a factor of 791370? False Is 14 a factor of 3125934? True Is 198360 a multiple of 120? True Is 72 a factor of 58050? False Is 466 a factor of 895230? False Does 40 divide 298880? True Is 9951 a multiple of 93? True Is 417391 a multiple of 13? True Is 879 a factor of 13938303? True Is 13800481 a multiple of 1038? False Is 997920 a multiple of 330? True Does 350 divide 3677117? False Is 164 a factor of 90178? False Is 29 a factor of 24128? True Is 7471422 a multiple of 903? True Is 15755179 a multiple of 152? False Does 21 divide 295613? False Does 2 divide 542444? True Is 924833 a multiple of 13? True Is 9 a factor of 62025? False Is 6 a factor of 88? False Is 704844 a multiple of 18? True Does 12 divide 14663? False Is 433 a factor of 251140? True Does 121 divide 295072? False Does 20 divide 52140? True Is 54 a factor of 482868? True Does 719 divide 6035027	{ "pile_set_name": "DM Mathematics" }
st the prime factors of 106/k + 4/(-6). 17 Let m = -89 + 94. Suppose 5q + m = 5y + 30, 3q + 34 = -4y. List the prime factors of 2/y + 0 - 1480/(-35). 2, 3, 7 Let h be 16/4 + (-4)/1. Suppose -70 = -l - l + o, h = 4o. Let v = 12 + l. What are the prime factors of v? 47 Let a = -46 + 46. Suppose -2t + al = -l + 4, -2l + 2 = -t. What are the prime factors of 2535/18 + t/(-12)? 3, 47 Let u(l) = 206l - 11. Let a = 919 + -916. What are the prime factors of u(a)? 607 Let z(f) = f3 - 5f*2 + f - 13. Let t be z(6). Suppose -25 - t = -9a. Suppose av + 5b = 3v + 709, b = 5v - 1191. What are the prime factors of v? 2, 7, 17 Suppose -19m = -15m + 1860. Let s = m - -818. What are the prime factors of s? 353 Let a(b) = b3 + b2 + 2b - 2. Let h be a(-2). Let f be 5/h + (-1555)/(-10). Let k = 314 - f. List the prime factors of k. 3, 53 Let y(j) = 16j*3 - 19j*2 - 8j + 7. Let z be y(5). Suppose 5h + 0g - 1820 = -5g, -5g - z = -4h. What are the prime factors of h? 2, 23 Let w = 12 + -7. Suppose -12 = -3f, -3f + wf = q + 7. What are the prime factors of q/((-1 - 2)/(-321))? 107 Let x = 1 - 5. Let u(a) = -97a - 31. Let n be u(x). Suppose -121 = -w - 2z, -3w - 3z + n = -0w. What are the prime factors of w? 3, 13 Let h = -17 - -92. Let j = 42 - h. What are the prime factors of (-4)/14 - 67j/21? 3, 5, 7 Suppose -30 = -4x + 5t + 70, 5t = x - 40. Let v be 1504/10 + x/(-50). Suppose -c - c = 2g - v, 5g + 2c = 378. List the prime factors of g. 2, 19 Let s = -940 - -599. Let i = 151 - s. List the prime factors of i. 2, 3, 41 Let o = 2339 + -4138. Let m = o + 2593. List the prime factors of m. 2, 397 Suppose 0w = 3w - 4o - 2002, 3350 = 5w - 4o. Suppose w = 5b - 1306. List the prime factors of b. 2, 3, 11 Suppose -8 - 8 = -3y - 4v, y = -4v. Suppose -39o + 22o = 25o. Suppose yg + g - 378 = o. What are the prime factors of g? 2, 3, 7 Let u(b) be the first derivative of b4/6 + 35b*3/6 - 19b*2/2 - 12b - 11. Let o(t) be the first derivative of u(t). What are the prime factors of o(-20)? 3 Let q(d) = 50d2 + 8d + 3. Let o(i) = -i*2 - 2i - 1. Let p(n) = 3o(n) + q(n). Suppose 0 = -2b + 3 - 1. List the prime factors of p(b). 7 Suppose c = s - 280, -4s - 1095 = 3c - 248. Suppose -1838 = -6p + 562. Let w = p + c. List the prime factors of w. 7, 17 Let i(l) = -l3 + 53l*2 - 2l - 139. List the prime factors of i(52). 23, 107 Let w = -17 - -31. Suppose wl - 2964 = l. List the prime factors of l. 2, 3, 19 Let r be 7405/50 + 4 + 205/(-50). Suppose 30p - 30032 = r. List the prime factors of p. 2, 503 Suppose 0 = -8o + 10959 + 21017. What are the prime factors of o? 7, 571 List the prime factors of ((-158)/(-9))/(4/2886) - (-2)/(-6). 2, 3, 2111 What are the prime factors of ((-18198544)/(-65))/14 - 8/(-5)? 2, 5 Suppose 9b - 2 = 10b + 4k, -5b = -3k - 13. Suppose u = -bs + 1034 - 73, -5u + 4820 = -5s. What are the prime factors of u? 3, 107 Let n(c) = 2c + 420. Let w be n(0). Let z = w + 383. What are the prime factors of z? 11, 73 Suppose 93 = -4w - 323. What are the prime factors of (w/(-10))/(1/10)? 2, 13 Let c(o) = 6o*2 - 4o - 4. Let j be c(4). Let v = j + -46. List the prime factors of 102/v + (-2)/5. 3 Let a be (2 + 0)/((-10)/2285). Let u = a + 492. What are the prime factors of u? 5, 7 Let n(h) = 6h2 - 202h - 97. What are the prime factors of n(38)? 3, 11 Let g(a) = -7a + 4. Suppose 0v + 28 = 7v. Let u be g(v). What are the prime factors of -2(-4)/u - 103/(-3)? 2, 17 Let f be ((-724)/(-8))/(2/8-1). Suppose 3a + 4s = -101 - 441, -174 = a + 3s. Let n = a - f. List the prime factors of n. 2, 11 Let w(t) = -881t - 139. List the prime factors of w(-7). 2, 11, 137 Let h(r) = 6r*2 + 42r - 209. What are the prime factors of h(29)? 5, 7, 173 Let w = 78 + -59. Suppose -wj + 23j = 68. What are the prime factors of j? 17 List the prime factors of (11974/10)/(17/(-6 - -91)). 5987 Suppose 2v - 3v = 0. Suppose 3g + 963 = 6g - 5m, v = -m - 3. List the prime factors of g. 2, 79 Let b be (-70)/(-7)-1012/(-3). Suppose -j = j + 3r + b, -3j + 5r - 619 = 0. Let u = -106 - j. List the prime factors of u. 97 Let o(b) = -b*2 + 16b + 25. Let g(k) = 4k2 + 6 + 3 - 2 + 23k + 2. Let y be g(-6). List the prime factors of o(y). 2, 5 Let v be (4/(-14) + 125/70)10. Suppose -v = 3z, 3z - 665 = -2r + 6r. What are the prime factors of (-1)/4 + r/(-8)? 3, 7 Suppose 15s - 308184 = 126951. Suppose s - 4342 = 17y. What are the prime factors of y? 1451 Let r(x) = -53x + 7. Suppose 18m + 12 + 6 = 0. Let n be r(m). Let a = n - -104. List the prime factors of a. 2, 41 Let g(i) = 25i3 + i2 + 13i - 23. Let y be g(3). Suppose -6w + w + 5x + y = 0, 4w + 5x = 605. List the prime factors of w. 5, 29 Let i be -4(-1)/(-2)619/(-2). Let u = i + -324. Let k = u - 147. What are the prime factors of k? 2, 37 Let p be 1 + (42)/(-1). Let v(m) = -7m2 + 0m2 + 6 + m3 + 14m2 + m2. What are the prime factors of v(p)? 5, 11 Suppose f - 3l - 708 = -38, f - 622 = 11l. List the prime factors of f. 2, 43 Let c = 248 - 396. Let v = c + 58. Let i = v + 152. List the prime factors of i. 2, 31 Let b = 32 - 67. Let s = -32 - b. Suppose 2t + 7u - 3u - 370 = 0, su = 5t - 899. What are the prime factors of t? 181 Let u be (8 - 11)/(2/(-104)3). Let l be 28/13 - 8/u. What are the prime factors of 5/l + (-4)/(-8) + 90? 3, 31 Let t(z) = -19z*2 - 25z + 119. Let c be t(5). Let o = 420 - c. What are the prime factors of o? 17, 53 Let c(o) = 19o2 - 5o - 8. Let y = -161 - -157. What are the prime factors of c(y)? 2, 79 Suppose 0 = -121k + 123k - 15334. What are the prime factors of k? 11, 17, 41 Let b(d) be the first derivative of -5/4d4 + 0d - 8 + d2 + d3. List the prime factors of b(-3). 2, 3, 13 Let l(m) = -2m2 - 21m - 20. Let k be 476/(-70)10/(-4). Let b be l(k). What are the prime factors of b/(-10) + -2(-2)/8? 2, 3 Suppose -14g + 2295 + 6427 = 0. Let a = g - 244. Suppose -5u + a = 2w, 0w + w = 4u + 170. What are the prime factors of w? 2, 7, 13 Let b(h) = -4h*2 + 13h + 8324. List the prime factors of b(0). 2, 2081 Suppose 0 = -3u - 4a - 2, -u - 6 = -0a + 4a. Let h be 3 - (u + (4 - -173)). Let z = -104 - h. What are the prime factors of z? 2, 3 List the prime factors of ((-140)/(-9))/(12/3942). 2, 5, 7, 73 Let j be (-243)/68/(-12). Let n be (j/(-18))/((-1)/(-270)). What are the prime factors of (-668)/(-9) - 9/(n/(-10))? 2, 37 Suppose -7a + 2a = 0. Let p(s) be the third derivative of -s5/60 - s4/24 + 53s*3/6 + 57s*2. What are the prime factors of p(a)? 53 Let y be (-2350)/20 + 3/2. What are the prime factors of (6 + (6 - y))2? 2 Suppose 0 = 10v - 11058 + 48. Suppose -5p + u + v = 0, p + 3u = 2p - 223. What are the prime factors of p? 2, 5, 11 Let s(l) = -478l + 1250. List the prime factors of s(-42). 2, 10663 List the prime factors of 9406 + (-126)/18(-4)/84-6. 2, 2351 Let z(h) = 2 + 5h*2 + 1 + 2h + 277h2. What are the prime factors of z(-1)? 283 Let f = -6276 + 18856. What are the prime factors of f? 2, 5, 17, 37 Suppose 0 = 5g - 17949 + 4674. Let y = g + -1002. List the prime factors of y. 3, 19, 29 Suppose k + 364x - 361x = 52287, -3k + 156889 = 2x. List the prime factors of k. 3, 13, 149 Let v = 9 + -6. Suppose 0 = 7w - vw - 1008. Let n = 408 - w. List the prime factors of n. 2, 3, 13 Let p be 2 - (-3 + 6)(-768)/(-9). Let t = p + 71. Let o = t - -319. What are the prime factors of o? 2, 17 Suppose 4x = 449 + 191. Let n(o) = -o*3 + 27o*2 + o - 15. Let l be n(27). Suppose x = y + l. List the prime factors of y. 2, 37 Let r(g) = 3g + 3. Let f be r(-3). Let h(o) = -41o + 14 + 99o - 35o - 35o. List the prime factors of h(f). 2, 43 Suppose -v + 6v - 5r = 164695, -5v - r = -164677. What are the prime factors of v? 2, 23, 179 Suppose -3i - 4i = 35. Let s be (-4)/(-10) - 768/i. Suppose -s - 68 = -2f. What are the prime factors of f? 3, 37 Let v = 50645 + -35366. List the prime factors of v. 3, 11, 463 Suppose -15n = -30632 - 12238. What are the prime factors of n? 2, 1429 Let a(i) = 191i*2 + 47i - 45. List the prime factors of a(1). 193 Let j = -10670 - -20056. What are the prime factors of j? 2, 13, 19 Suppose	{ "pile_set_name": "DM Mathematics" }
nder when t is divided by 43? 40 Let n(s) = 2s3 - 37s*2 + 97s - 201. Let m = -49 + 74. What is the remainder when n(16) is divided by m? 21 Suppose -2015 = -5p - 5l, p - 283 = 5l + 102. Calculate the remainder when p is divided by 26. 10 Let b(t) = -t3 - 13t*2 + 4t + 96. Suppose -4g = -41g - 481. Calculate the remainder when 876 is divided by b(g). 40 Suppose p - 3z = 147, p + 5z + 41 = 156. Calculate the remainder when p is divided by 32. 7 Calculate the remainder when 1584 is divided by (-258)/1419 + 288/11. 24 What is the remainder when (687720/(-18))/(-10)(-21)/(-14) is divided by 21? 19 Let z(c) = -168c - 37. Let j be z(-4). Let r = -606 + j. What is the remainder when 103 is divided by r? 16 Let j(t) = 1177t + 2420. Calculate the remainder when 504 is divided by j(-2). 42 Suppose u - 6 = -3p + 44, 2p = -2u + 28. Calculate the remainder when (-6 + p/6)/(1/(-19)) is divided by 10. 7 Let g(y) = 4y2 + 3y + 152. Calculate the remainder when 287 is divided by g(0). 135 Let i(w) = -11 + 3w2 + 3w*2 - 4w*2 - 1 - 4w. Let z be i(-3). Suppose zk - 13k = 115. What is the remainder when 87 is divided by k? 18 Let q = -255 - -813. Let s = -551 + q. What is the remainder when 117 is divided by s? 5 Suppose -17h - 370 = -12h. Let r = h - -90. Calculate the remainder when 50 is divided by r. 2 Suppose 497w - 3j + 38 = 502w, -5w + 54 = -j. Let q(f) = -f*2 - 14f - 2. What is the remainder when q(-10) is divided by w? 8 Suppose 2422 = l + 15l - 2l. Suppose 2s + 0 - 26 = 0. Calculate the remainder when l is divided by s. 4 Let h(l) = 6l + 30. Let r be h(-3). Calculate the remainder when 60 is divided by 17/(612/560) + r/27. 12 Suppose 0h = -2h + 5j - 21, 2h = -j + 9. Suppose -ha + 162 = -5l, 4a - 15l = -14l + 342. Calculate the remainder when a is divided by 45. 41 Let p = 42 + -27. Suppose -3i + 2i = -p. Calculate the remainder when 1 - (-3 + 2) - -41 is divided by i. 13 Suppose 0 = -2j + 59 - 57. Let r(k) = 22k2 - k + 2k - 6k2 - 2. What is the remainder when r(j) is divided by 10? 5 Let u = 111 - 84. Let g = u - -6. What is the remainder when g is divided by 7? 5 Let z = -4318 - -7279. What is the remainder when z is divided by 18? 9 Suppose -3c - 5k + 400 = 0, -2c + 332 = -3k + 97. What is the remainder when 8245 is divided by c? 120 Let l = -11 - -23. Let h = 34 - l. Calculate the remainder when h is divided by ((2 - 3) + -2)/(2/(-10)). 7 Let v = -3085 - -3076. Let d = -7 - -4. What is the remainder when 68 - -1v/d is divided by 24? 23 What is the remainder when -52/(-55) + (2568/33 - -1) is divided by -1 - ((-35)/15)/(2/24)? 25 Let p(s) = -7s*2 - 104s + 913. Suppose 15 + 2 = -t. Let o = t - -35. What is the remainder when o is divided by p(-21)? 8 Let b(k) = -3k3 + 27k + 127. What is the remainder when 1687 is divided by b(-4)? 210 Suppose 0 = 3a - 4k - 369, 3k = 9a - 4a - 615. Suppose -3p + h = -a, 15p + 4h = 13p + 82. Calculate the remainder when p is divided by 15. 11 Calculate the remainder when 131 is divided by (-152)/10575/(-230). 17 Let m be 0(-4)/(-8)(-11)/(-11). Calculate the remainder when (16/(-2) - -5) + m - -289 is divided by 24. 22 Let v(y) = -65 - 1788y + 886y + 879y - y2. Calculate the remainder when 192 is divided by v(-15). 27 Suppose -52 = 5c + 2s - 3, 5s = 2c + 37. Let h = c + 57. Suppose -r = -l + 16, -3r - 24 + 8 = -l. Calculate the remainder when h is divided by l. 14 Let g(q) = 25q2 + 7q + 6. Let l be g(-1). What is the remainder when (-2)/(l/(-798))2 is divided by 27? 25 Let q(x) = x3 - 23x*2 + 34x - 252. Suppose t = 14 + 8. Calculate the remainder when t is divided by q(22). 10 Let g(z) be the first derivative of z*2/2 + 21z + 3. Suppose 3r = -19r - 198. Calculate the remainder when 42 is divided by g(r). 6 Let s be 88/(-6)((-38)/(-4) - -4). Let c = 282 + s. Calculate the remainder when c is divided by 5. 4 Let o(n) = -34n - 1. Let b be o(-2). Suppose -4g = -b - 57. Calculate the remainder when g is divided by 17. 14 Suppose 0 = -52g + 125g - 4526. What is the remainder when g is divided by (-134)/(-6) + 2/(-6)? 18 What is the remainder when 537 is divided by (-197 - (10 + -19))-1? 161 Suppose 17d + 1582 = 5r + 25d, 950 = 3r + 4d. Calculate the remainder when r is divided by 58. 28 Suppose 0 = 11l - 3333 + 1089. Let z = -151 + l. What is the remainder when z is divided by 9? 8 Suppose 4a + 11a = 18a - 939. What is the remainder when a is divided by 26? 1 Let l be -5 + 7 - (-12)/2 - 5. Suppose -2v - 5o + 87 = 0, -9 + 18 = -lo. Suppose 32 = k + 3k. Calculate the remainder when v is divided by k. 3 Suppose 0 = -3t + 1803 - 387. Suppose -5r - 51 = -3z + 297, 4z = 4r + t. What is the remainder when z is divided by 31? 28 Let p(m) = -177m + 4099. Calculate the remainder when 10329 is divided by p(23). 25 Let b(h) = -h3 + 32h*2 - 37h + 202. What is the remainder when 10893 is divided by b(31)? 13 Suppose 6942 = 194b - 168b. Calculate the remainder when 271 is divided by b. 4 Suppose -24n = 1306 - 1378. What is the remainder when 469 is divided by n? 1 Let s = 16182 - 16114. Suppose 0 = 5k + 4a - 141, 7a + 84 = 4k + 3a. Calculate the remainder when s is divided by k. 18 Suppose 5i = 5, 0 = v - 4i + 8i - 47. Suppose r = -vr + 4972. What is the remainder when r is divided by (-10)/15 - (-232)/6? 37 Let g = -4898 - -4916. Let f(y) = -y*3 + 9y*2 + 5y - 11. What is the remainder when f(9) is divided by g? 16 Suppose 2k = -2x - 16, -2k - 22 = -6x + 10x. What is the remainder when 295 is divided by 4 - 10(1 + 5)/x? 7 Let m(g) = g*3 + 11g*2 + 3g + 29. Let d be m(-10). Suppose 0 = -t + d + 12. Calculate the remainder when t is divided by (1/2)/((-1)/(-28)). 13 Let w(a) = -8a2 + 15a - 2. Let k(g) = -g*2 + 2g - 1. Let x(o) = 6k(o) - w(o). Calculate the remainder when 175 is divided by x(4). 15 Let y = -156 - -251. Suppose -3n = 23 - 56. Let o(h) = h + 22. What is the remainder when y is divided by o(n)? 29 Suppose 0 = -16l + 1354 + 3862. Calculate the remainder when 779 is divided by l. 127 Suppose 6743 = 47w - 4161. Calculate the remainder when w is divided by 121. 111 Suppose -5s + 3c + 475 = 0, -5s - c - 373 = -9s. Calculate the remainder when 2113 is divided by s. 89 Suppose n - 3q = -0q + 28, -2n = -4q - 48. Suppose 312 = 5g + 3w, -3w = -5w - 2. Calculate the remainder when g is divided by n. 15 Let b = 8318 + -7567. What is the remainder when b is divided by 42? 37 Suppose 63n + 51 - 1509 = 36n. Calculate the remainder when 597 is divided by n. 3 Let q(t) = -t*2 + 44t - 349. Calculate the remainder when 621 is divided by q(17). 71 Suppose -2g + 504 = 3b, 3g + 12b - 730 = 14b. What is the remainder when g is divided by 107? 32 Let o(r) = -274r + 849. What is the remainder when o(-5) is divided by 20? 19 Let w(p) = -33p - 33. Let l be w(-2). Suppose -ly = -1159 - 953. Calculate the remainder when y is divided by 1/(2/22 + 0). 9 Suppose 0 = p - 24a + 22a - 980, -2a = -5p + 4916. What is the remainder when p is divided by 30? 24 Let h be ((-51)/(-17))/(1/9). Let c = 89 - h. What is the remainder when c is divided by 17? 11 Let d = 163 + -101. Let g(b) = -4b - 1 - 2b + 7b + 3. What is the remainder when d is divided by g(14)? 14 Suppose -3s + 3 = 0, -5 = -v - s + 5. Suppose 4l - 105 = -17l. Suppose -lb = 4y - 57, 4b = y - 0b - 9. What is the remainder when y is divided by v? 4 Suppose -9h - 3 = -10h. Let z be h/(-5) + (-32968)/(-130). Suppose 3m = -z + 292. What is the remainder when 22 is divided by m? 9 Let p(q) = q3 - 6q*2 - 16q + 8. Suppose -4d + 178 = o, -8o + 7o = 2d - 90. What is the remainder when p(11) is divided by d? 41 Suppose 6v - 30v = -3v - 2352. Calculate the remainder when v is divided by 107. 5 Let a = -7114 - -8443. Calculate the remainder when a is divided by 148. 145 Let a(z) = -z3 - 4z*2 - 4z + 3. Suppose 11p + 21 = 4p. Let o be a(p). Suppose 15 = -3h + oh. What is the remainder when 15 is divided by h? 0 Let m = -119 - -121. Suppose -ms - 14 = -84. Calculate the remainder when 100 is divided by s. 30 Let s = -310 + 415. Let j = s - 78. Calculate the remainder when 0 - 1-159*	{ "pile_set_name": "DM Mathematics" }
d(q) = 9h(q) + 4t(q). Differentiate d(j) wrt j. -6 Let w(r) be the second derivative of -3r5/10 - 5r*4/12 - r. Find the third derivative of w(y) wrt y. -36 Let s = -3 - -5. What is the third derivative of 2 - 4ps - 2 + p5 + p*2 wrt p? 60p*2 Let n(t) be the third derivative of -31t*7/210 + 19t*4/24 - 20t*2. What is the second derivative of n(g) wrt g? -372g*2 Let y(v) = -31v*4 - 30v*2 - 5. Let r(a) = -15a*4 - 15a*2 - 2. Let u(c) = 5r(c) - 2y(c). What is the third derivative of u(h) wrt h? -312h Let b(k) be the second derivative of k*4/6 - 4k*2 + 8k. What is the derivative of b(a) wrt a? 4a Let q(m) = 41m*2 + 4m + 1. Let d(a) = 82a2 + 9a + 1. Let f(t) = -6d(t) + 13q(t). Find the second derivative of f(k) wrt k. 82 Suppose -31 = -4b + b + 4o, -5b - 4o + 9 = 0. Let j(n) be the first derivative of 3/5nb + 0n*3 - 3n + 0n2 + 0n*4 - 4. Differentiate j(h) wrt h. 12h*3 Let l be (-40)/(-6) + (-6)/9. Find the third derivative of -31q - q*2 + 31q + 3ql wrt q. 360q3 Let h(m) = m3 - 7m2 + 7m - 3. Suppose -2r = 5d + 4 - 11, -r = -3d - 9. Let f be h(r). What is the first derivative of 4y - y - f + 0 wrt y? 3 Let b(x) = -x*3 + 5x*2 - 4x + 2. Let t be b(2). Suppose k - 4 = -y - k, 3k - t = 4y. What is the first derivative of -h2 + y - h2 - 1 wrt h? -4h Find the third derivative of 4v*5 - 272v*3 + 10v*2 + 272v*3 wrt v. 240v*2 Differentiate -164 + 24p*2 + 62 + 30p*2 + 73 with respect to p. 108p Let p(h) = -h*2 - 6h - 3. Let u be p(-5). Find the first derivative of 3w3 - 3 + w2 - wu wrt w. 9w2 Let m(y) be the second derivative of y4/6 - y*3/3 + 2y. Find the second derivative of m(c) wrt c. 4 Let y(i) = -7i3 + 4i*2 + 3i - 3. Let w(c) = -8c3 + 5c*2 + 4c - 4. Let u(o) = 3w(o) - 4y(o). Find the third derivative of u(b) wrt b. 24 What is the third derivative of 2q6 - 146q*5 + 146q*5 - 38q*2 - 12q*4 wrt q? 240q*3 - 288q Let i(h) be the first derivative of -15h3 - 3h*2/2 + 4h - 18. Find the second derivative of i(y) wrt y. -90 Let k(n) be the second derivative of 0n5 + 1/2n*4 + 0n*2 + 2n - 4/15n6 + 0 + 0n*3. What is the third derivative of k(c) wrt c? -192c Let f(y) = y4 + y3 + y*2 + 1. Let c(k) = 40k*4 - 3k*3 - 3k*2 - 2k - 3. Let b(h) = -c(h) - 3f(h). Find the second derivative of b(i) wrt i. -516i*2 Let m(c) = -4c - 1 + 5c2 + 2 - 6c*2. Let g be m(-2). Find the second derivative of 5r*4 - gr - 4r4 + 3r wrt r. 12r2 Let i(s) = -s4 - s2 - s. Let u(a) = -a4 + 3a*3 + 2a*2 - 50a. Let z(t) = 2i(t) + u(t). Find the second derivative of z(f) wrt f. -36f*2 + 18f Suppose -3u = c - 3, -4c = 3u - 8u + 22. Find the second derivative of -4q + 0q - 2q2 - uq + 0q wrt q. -4 Let k(s) be the second derivative of 0s*5 + 3/56s*8 + 0s*7 + 0s*3 - 1/6s*4 - s + 0 + 0s*2 + 0s*6. Find the third derivative of k(q) wrt q. 360q*3 Find the second derivative of -3c*3 - 4c*3 + 13c - c*3 wrt c. -48c What is the third derivative of -4k2 + k3 + 12k*3 + 3k*2 - 8k*2 wrt k? 78 Let j(n) be the second derivative of 0n*2 - 3/10n*5 - 4n + 0 + 1/3n3 + 0n*4. Find the second derivative of j(i) wrt i. -36i Let j(u) be the first derivative of -u4/2 + u3 + 1. Find the third derivative of j(m) wrt m. -12 What is the third derivative of -k4 + k2 + 15k4 + 5k*4 wrt k? 456k Let j(v) = 11v2 + 5v + 3. Let s(b) = -33b2 - 14b - 8. Let d(m) = -8j(m) - 3s(m). Find the second derivative of d(h) wrt h. 22 Suppose -2p + i + 14 + 6 = 0, -4p + 40 = -i. What is the third derivative of -2h2 - 5h*2 + ph*2 + 3h*3 wrt h? 18 Let o(w) = 3w + 1. Let h(a) = 13a + 3. Let j(d) = 2h(d) - 9o(d). Let g be j(-9). Differentiate 0x - 5 - 2x + g with respect to x. -2 Let l(q) = -24q*2 - 7q - 7. Let s(b) = -24b2 - 8b - 6. Let w(d) = 6l(d) - 7s(d). Find the second derivative of w(z) wrt z. 48 Find the third derivative of w*2 + 4w*2 + 2w*2 + 8w*4 wrt w. 192w Suppose -2m = m - 6. Let r(b) = -b3 + 9b*2 + 10b + 6. Let q be r(10). Find the third derivative of z*2 - 2z*q - 2z*2 - 3z*2 + mz*2 wrt z. -240z*3 Let f(s) = -130s - 3. Let h be f(-1). Find the third derivative of -2v6 - hv*4 + 3v*2 + 127v*4 wrt v. -240v3 Let s(o) be the second derivative of o5/15 + o4/24 - o2/2 + 4o. Let g(p) be the first derivative of s(p). Find the second derivative of g(u) wrt u. 8 Let q(m) be the third derivative of -m9/63 + m7/105 - 23m*5/30 - 7m*2 - 2. What is the third derivative of q(n) wrt n? -960n*3 + 48n Differentiate -12o - 10o*4 - 18 + 12o - 2 wrt o. -40o3 Let h = 3 + -1. Suppose -h + 5 = z. Differentiate jz - 1 - 2 - 4j*3 with respect to j. -9j2 Let d(z) = -z2 + z. Suppose 0 = -2b - 2. Let a(w) = -5w*2 + w - 3. Let o(n) = bd(n) + a(n). What is the first derivative of o(f) wrt f? -8f Find the third derivative of -29g*2 + 113g*4 - 84g*4 - 16g*2 wrt g. 696g Let q(y) be the third derivative of y*7/30 + 7y*4/6 + 14y*2. What is the second derivative of q(w) wrt w? 84w*2 Let t be (-45)/(-18)(-1 - 33/(-15)). Suppose 6j - 10 = 2j - d, -5j + 23 = -4d. Find the third derivative of jc5 - 4c*5 - 2c*5 + tc*2 wrt c. -180c*2 Let b(l) = 33l*6 - 5l*5 + 19l*2 + 4l. Let q(r) = 32r6 - 6r*5 + 18r*2 + 5r. Let g(c) = -6b(c) + 5q(c). Find the third derivative of g(s) wrt s. -4560s3 Let u(p) be the second derivative of 11p*4/6 - 13p*2/2 - 21p. Find the first derivative of u(c) wrt c. 44c Let k(c) be the first derivative of -9c*4/4 + 4c + 4. Differentiate k(u) wrt u. -27u2 Let r = -1 - 1. Let c be ((-26)/(-10) + r)5. What is the first derivative of m*3 - cm3 - m3 + 2 wrt m? -9m2 Find the third derivative of m2 + 2 - 1 - 1 - 10m*4 wrt m. -240m Let t be 2/3 + 4/3. Find the third derivative of -4p3 + 3p2 - pt + 6p3 wrt p. 12 Let c(o) be the second derivative of -5o*7/21 + 19o*3/6 - 13o. What is the second derivative of c(w) wrt w? -200w3 Let l(o) = -10o + 8. Let r(a) = 10a - 8. Let i(t) = 7l(t) + 6r(t). Find the first derivative of i(c) wrt c. -10 Let p(f) = f3 + 9f*2 + 9f + 11. Let h = 13 + -21. Let x be p(h). Find the third derivative of 0r2 + 0r*2 + 2r*2 - xr*5 wrt r. -180r*2 Let b(w) = -w. Let f(a) = 0a*2 + 2a + a*3 + 3a*2 + 2a*3 - 4a*3. Let d(n) = 2b(n) + f(n). What is the third derivative of d(c) wrt c? -6 Let y be (5 + -13)1/(-2). Find the second derivative of yr*3 - 10r*3 - 5r + 8r wrt r. -36r Let v(q) be the first derivative of -q8/560 - q5/40 - 5q3/3 - 1. Let h(f) be the third derivative of v(f). Find the second derivative of h(y) wrt y. -36y2 Let d(x) be the first derivative of x6/3 - 13x3/3 + 4. Find the third derivative of d(o) wrt o. 120o*2 Let i(n) = 13n*2 - 14n. Let o(v) = 12v2 - 14v. Let c(z) = 4i(z) - 5o(z). Find the second derivative of c(y) wrt y. -16 Let q be (12 + -9)/(6/8). What is the derivative of -3p4 - p4 + 3p*q + 1 - 2 wrt p? -4p*3 Let s(b) = 6b - 12. Let u(t) = -4t + 8. Let o(z) = 5s(z) + 8u(z). Differentiate o(x) wrt x. -2 Let g = -7 + 22/3. Let i(v) be the first derivative of -v2 + 0v + 4 + gv3. What is the second derivative of i(b) wrt b? 2 What is the third derivative of 1 - 1 + 9g*3 + 30g*2 - 11g*3 wrt g? -12 Let p(s) be the first derivative of 5s*3/3 + 19s2/2 + 6. What is the second derivative of p(t) wrt t? 10 Let j(s) = -s2. Let v(p) = -8p2 + 3. Let u(o) = 4j(o) - v(o). Find the first derivative of u(k) wrt k. 8k Let x(f) be the second derivative of 19f*6/30 - 17f*4/12 - 20f. What is the third derivative of x(v) wrt v? 456v Let g(z) be the second derivative of -2z7/105 + z3 + z*2/2 + 3z. Let x(w) be the first derivative of g(w). Differentiate x(t) with respect to t. -16t3 Let u(g) be the first derivative of -g3 + 3g2 - 5. Find the second derivative of u(b) wrt b. -6 Let o(c) be the first derivative of c3 + 9c - 17. Differentiate o(z) with respect to z. 6z Let r(q) be the second derivative of -5q5/2 - 15q**2/2 + q. What is the first derivati	{ "pile_set_name": "DM Mathematics" }
t q be (-6)/((-81)/(-9)(-1)/(-6)). Let d = -0.01 + -0.01. Let k = d + -4.98. What is the third biggest value in q, 0.3, k? k Let f = 0.2 + 0. Let w = 2315 - 2316. Which is the smallest value? (a) -3/2 (b) w (c) f (d) 1 a Let p = -13 - -3. Let y = p + 9.64. Let k = y + 0.06. What is the third smallest value in -2, 0.5, k? 0.5 Suppose 0 = 5j - 4j - 9. Let f(g) = g3 - 8g*2 - 9g - 10. Let x be f(j). Let w be 3x/(-26) - 1. Which is the third biggest value? (a) 3 (b) 2/9 (c) w c Let h be (1 - (-16)/(-20))-3. Let m = 1 - 4. Which is the biggest value? (a) 2 (b) m (c) h a Let x(g) = -g*3 + 7g*2 - 10g + 7. Let k be x(5). Let b be 8/20(-5)/k. What is the biggest value in 1, -6, b? 1 Let a = -37825/12 - -3152. What is the second biggest value in 3/31, 0, 1, a? 3/31 Let p = 0.401 + -0.37. What is the biggest value in 0.5, p, 1/4? 0.5 Let q be (4/(-10))/(0 + -1). Let v be 685/(-1095) + 4/6. Let p = 52/511 + v. Which is the biggest value? (a) 3 (b) p (c) q a Suppose 5s - 3w = -14 - 98, 3w = 12. Let f = s + 15. Which is the second biggest value? (a) -4 (b) 4 (c) f a Let h = -1887 - -1874. Which is the fourth smallest value? (a) -4 (b) h (c) -5 (d) -0.3 d Let x = -211 - -310. Suppose -3z + x = -12z. Which is the second smallest value? (a) z (b) -0.3 (c) 0.1 b Let f = 14 - 14. Let u = -10.5 - -5.1. Let v = -5 - u. What is the second smallest value in v, 3, f? v Let z = 33.066 + -0.066. Let o = -22 + z. Let t = -6 + o. What is the second smallest value in 0.4, t, 0.2? 0.4 Let v = -213 - -215. What is the smallest value in -1/6, v, -1/5, 1/3? -1/5 Let r = 0.077 - -0.223. Let p = -0.1 + -0.9. Let w = p + 6. Which is the biggest value? (a) r (b) -0.2 (c) w c Let h = 8.8427 - -0.1573. Suppose o - 2o = -2. Let z = 34 - 33.9. Which is the third smallest value? (a) o (b) z (c) h c Let o = -72 - -65. Let m be (3 + (0 - -3) + o)/1. What is the second biggest value in 2/7, 9, m? 2/7 Let i = -520 + 520.4. Which is the second smallest value? (a) 0.3 (b) i (c) -4/5 a Let a = -23/2 + 12. Let i = 64 - 4033/63. Let m = 137/693 + i. What is the third biggest value in a, m, 0? 0 Let t be (-1875)/68/(-4130). Let y = 2/59 - t. What is the smallest value in 0.02, -3, y? -3 Let d = 1045 - 1044. What is the third biggest value in 6.3, 2, d? d Let g = 476 - 475.4. Which is the smallest value? (a) 1 (b) g (c) 0.5 c Let c be ((-3)/(-3))/(2/(-6)). Let a = 3 + c. Suppose 53 = -x + 44. What is the biggest value in a, x, 3? 3 Let t = -61 - -127. Let d = t - 64. Suppose -2s + 2 = 6. Which is the second smallest value? (a) d (b) -0.1 (c) s b Let l = 0.096 + -0.216. Which is the third biggest value? (a) l (b) 0 (c) 1 a Let z = 0.045 + 22.955. Let q = -23.11 + z. Let r = q - -0.51. Which is the second smallest value? (a) -4 (b) r (c) 3/2 b Let y = 177 - 181. Let q = 20 + -61/3. What is the fourth biggest value in 1, 0, q, y? y Let m = 320 + -2242/7. Which is the fourth smallest value? (a) -7 (b) 1 (c) 3 (d) m c Let u = 5342/5 - 1068. Which is the fourth smallest value? (a) u (b) -1/36 (c) 0.12 (d) -1 a Let d = 139/6 - 23. Let z = -0.25914 + 0.05914. Which is the second smallest value? (a) d (b) z (c) -0.33 b Let m be (-20)/18 + (-693)/(-891). Let k = -0.01 + -4.99. Which is the smallest value? (a) m (b) k (c) 6/13 b Suppose 16m - 595 = -m. Let i be ((-4)/m)/(-4 + (-44)/(-10)). Let y = 178/171 - 24/19. Which is the third smallest value? (a) y (b) 2/17 (c) i b Let n be ((-18)/736)/((-6)/(-4)). Let w = n - -751/920. Which is the second smallest value? (a) -5 (b) -4 (c) w b Let g = -4.9 - -1. Let f = -2.1 + g. Which is the smallest value? (a) -3 (b) 2 (c) f (d) -0.3 c Let g(i) = i*3 - 4i*2 - 18i + 4. Let v be g(-3). Which is the fourth biggest value? (a) v (b) 5 (c) -2 (d) -45 d Let s be (-11)/44 + 9/4. Suppose -sd - 3 = d. What is the smallest value in d, 1/6, -1/2? d Let m = -9 + 9.06. Let s = 28 - -2. Let o be 1/16/s. What is the third biggest value in m, -2, o? -2 Let u = 6.98 - 7. Let r = u + 0.12. Let v = -37/3 - -176/15. Which is the second biggest value? (a) v (b) r (c) -0.5 c Let s = 349/3 - 115. What is the third biggest value in -8, 2, s? -8 Let l be (4/6)/((-14)/(-14)). Let m = 28.2 - 23. Let g = m - 1.2. Which is the third smallest value? (a) 8 (b) l (c) g a Let w be ((-10)/(-45))/((-3)/(-1 - 1358)). Let v = 101 - w. Which is the second smallest value? (a) v (b) -1 (c) -0.07 (d) 2/9 c Let i = -568.8 - -569. Which is the smallest value? (a) -0.4 (b) i (c) 49 a Suppose 3t - 23 = -17. Let z = -14.2 + -5.8. What is the second biggest value in z, 4, -0.4, t? t Let b = -0.03 - -0.23. Suppose -5w - 2 = 2n, 2n - 16 = w + 3w. What is the biggest value in 3/7, b, 4/5, w? 4/5 Let l = 15070 - 15069. Let z = 0.51 + -0.15. Let p = -0.04 - z. What is the biggest value in p, -2, l? l Let t = 0.31 + -23.31. Let l = t + 23.36. Let k = -0.04 - l. Which is the biggest value? (a) k (b) -2/3 (c) 3 c Let u = -777.1 + 777. What is the second smallest value in 1, 4, u, 0.4? 0.4 Let p = 2/375 + -1133/1500. What is the smallest value in 3/4, -4, p? -4 Suppose -1111u = -1096u. What is the second smallest value in -2, -32, u? -2 Let x = -93 - -124. Let k = 28 - x. What is the smallest value in k, 4, 1/9? k Let h = 5/11442 - -5270933/34326. Let n = 154 - h. Let s = -2.92 + -0.08. What is the second smallest value in n, 2/13, s? 2/13 Let y be 2((-234)/(-10) - 3). Let l = y - 41. Let w = 0.04 - -0.26. Which is the biggest value? (a) w (b) l (c) -3/14 a Let s(w) = 0w2 - w2 + 2w*2 - 3w. Let j be s(3). Let f be (-3)/6 + j/(-3). What is the second biggest value in -3, f, 1? f Let l = 4 - 3.6. Let m be (6295/11331)/(2 + -1 + 0). Which is the smallest value? (a) -2/5 (b) l (c) m a Let w = 0.097 + -141.697. Let k = 159 + w. Let q = 17 - k. Which is the second biggest value? (a) -5 (b) -0.3 (c) q c Let r = -76 + 72. What is the third biggest value in -3/8, -4/15, r, -1? -1 Let u be 2/(-36)4 + 120/135. Which is the second biggest value? (a) 0.1 (b) u (c) -4 (d) 2.3 b Let n be 6/(-5) - 2 - 6/(-2). Let x = 37.7 - 38. Which is the third smallest value? (a) x (b) 4 (c) -1 (d) n d Let g = -0.23 + 0.34. Let i = g + 0.29. Which is the third smallest value? (a) i (b) -2/5 (c) -5 a Let k = 502 - 418. Which is the third biggest value? (a) 0 (b) -2 (c) k b Let r = -0.7 + 1.2. Let p = 25 + -5. Let x = p + -22. What is the second biggest value in x, 3, r? r Let b = -42.9 - -43. Suppose 2f + 5 = w, -14 = -4w - f + 6f. What is the smallest value in w, 3, b? b Let t = -0.4 + 0.7. Let g = 629 + -624. Which is the smallest value? (a) g (b) t (c) -3/5 (d) -3 d Let t = 135.3 - 135. Let z = -1/1303 - -2671/84695. Let k = z + -73/260. Which is the second smallest value? (a) k (b) t (c) -2 a Let q = 17 + -16. Let s = -659/12 + 213/4. Which is the biggest value? (a) q (b) 2/7 (c) 1/4 (d) s a Let o be (-11 + -1)/(-15). Let s = 956.3 - 956. Which is the third smallest value? (a) -2 (b) s (c) o b Let d = -1.8 - -1.62. Let x = 4.18 + d. Which is the biggest value? (a) 0.2 (b) x (c) -1/8 b Let u = -1198 - -1192. Which is the second biggest value? (a) u (b) 0.6 (c) -0.5 (d) 5/3 b Let t = -1 + 1. Let z = 118 + -142.2. Let h = z - -24. What is the second smallest value in -2/5, t, h? h Let x = -17 - -12. Let u = 0.2 - 3.2. Which is the second smallest value? (a) u (b) -9 (c) x c Suppose 2n = 6, 5n + 7 - 19 = 3k. Which is the biggest value? (a) -4/27 (b) k (c) 0.1 (d) 1/5 b Let v = 32.5 - 32. Suppose r + 5 - 8 = 0. Let y be (11/(-10) - -1)2. What is the second smallest value in y, r, v? v Suppose 6 - 16 = -2n. Suppose 0 = -nh + 17 + 143. Let r be -1 + -2(-4)/h. Which is the second smallest value? (a) -0.1 (b) 2/5 (c) r a Let a = 11 - 14. Let j be ((-4)/(-3) - 0)/a. What is the third smallest value in 9, j, -3? 9 Let b = 1684.4 - 1684. What is the third smallest value in -28, -3, b, -0.1? -0.1 Suppose 20 - 8 = -12*b. Let r = 6.9 - 7. Let n = -0.2 - r. What is the smallest value in n, b, -1/7? b Let f = 22 - 65/3. Let p = -2.7 + 2.8. Which is the fourth biggest value? (a) f (b) p (c) -3 (d) -0.5 c Let z = -14 + 12. Let f = -878/7 - -125. What is the secon	{ "pile_set_name": "DM Mathematics" }
- 4q3 + 20q*3 + 831 - 4q*3. 2q*3 + 831 Collect the terms in 180b*2 + 45b*2 - 73b*2. 152b*2 Collect the terms in -4i*2 - 2i*3 + 16i*2 - 22i*2. -2i*3 - 10i*2 Collect the terms in 10y*2 - 13y*2 + 3135y*3 + 3y*2. 3135y*3 Collect the terms in -38y*3 - 74y - 11y3 - 68y + 141y + 3y*3. -46y*3 - y Collect the terms in 173 + 3c + 175 + 181 - 529. 3c Collect the terms in 49h - 21h + 67h. 95h Collect the terms in -40q*3 - 13q*3 + 11q*3 - 22q*3 - 13q*3. -77q*3 Collect the terms in -355 - 3m - 2m + 3m + 5m. 3m - 355 Collect the terms in b*2 - 101b*3 + 165b*3 + 171b3 - b2. 235b3 Collect the terms in p2 + 4p*2 + 4p*2 - 5p*2. 4p*2 Collect the terms in 3522i + 3519i + 3567i - 10610i. -2i Collect the terms in 477q3 + 415q*3 - 816q*3 - 1004q*3 - 1261q*3. -2189q*3 Collect the terms in -56k*2 - 478k*2 + 10k + 12k. -534k*2 + 22k Collect the terms in 37 - 23 + 31 + 47 + l. l + 92 Collect the terms in -9z2 + 236z - 484z + 248z + 4z2. -5z*2 Collect the terms in 169b - 315b3 - 169b + 307b3. -8b*3 Collect the terms in 393i + 576i + 682i - 1190i. 461i Collect the terms in -8203 - 4i + 8203. -4i Collect the terms in -3 + 3 + 1104w2 - 391w*2. 713w*2 Collect the terms in 76r - 19r - 56r. r Collect the terms in -72r - 75r - 72r + 196r. -23r Collect the terms in 12808f + f*2 + 16f*2 + 16f*2 - 12805f + 3f2. 36f*2 + 3f Collect the terms in 8a3 + 419 - 133 - 136 - 150. 8a*3 Collect the terms in 0q*2 + 248q - 177q + 0q*2 - 89q*3 - 69q. -89q3 + 2q Collect the terms in -1176475j - 1176476j + 3529430j - 1176482j. -3j Collect the terms in -99p*3 + 1633p - 1633p. -99p3 Collect the terms in -z3 + 1688603z - 1688603z. -z*3 Collect the terms in 7a - 14a + 6a + 2a + 2663. a + 2663 Collect the terms in 92l - 27l - 34l + 109 - 34l. -3l + 109 Collect the terms in -i*2 + 8 + 6 + 47i - 7 - 317i. -i2 - 270i + 7 Collect the terms in -68g3 + 3g*3 - 26g*3. -91g*3 Collect the terms in 2 - 8u + 4 - 3 + 0u + 10u + u. 3u + 3 Collect the terms in 218z*2 - 18z*2 - 123z*2 - 27z*2 - 20z*2 - 27z*2. 3z*2 Collect the terms in -16r*2 + 13r*2 - 22r*2. -25r*2 Collect the terms in 73g*3 + 0g + 2g2 + 0g + 806g3. 879g*3 + 2g*2 Collect the terms in -47 - 5 + 1 + 51 + 5k. 5k Collect the terms in 7h*2 + 413h*2 + 41h*2 + 622h*2. 1083h*2 Collect the terms in -29d - 117d - 56d - 11d + 4. -213d + 4 Collect the terms in 110x2 - 2 - 222x*2 - 1 + 114x*2. 2x*2 - 3 Collect the terms in 2t - 8649t2 - 2t - 2990t2. -11639t2 Collect the terms in -6 - l3 - 578l2 + 16 - 11. -l3 - 578l*2 - 1 Collect the terms in -456 + 1734 - 447 - 384 - 447 - 9d. -9d Collect the terms in 34432878d - 65d2 - 2 - 34432878d. -65d2 - 2 Collect the terms in 53a*2 + 44a*2 - 94a*2. 3a*2 Collect the terms in 6w*3 - 36w*3 + 7w*3 + 12w*3. -11w*3 Collect the terms in -234a*2 + 1 - 150a*2 + 1. -384a*2 + 2 Collect the terms in 19q*2 - 1634 - 39q*2 + 1634 + 18q*2. -2q2 Collect the terms in -492758 + 246379 + 246379 - z2. -z*2 Collect the terms in 13360 - 13360 - 41t*3. -41t*3 Collect the terms in -9009d*3 - 409d*3 + 1018d*3. -8400d*3 Collect the terms in -35d*2 + 102d*2 - 34d*2 - 43d*2 - 9 + 12. -10d*2 + 3 Collect the terms in -38 + 315t + 32t + 64t - 27. 411t - 65 Collect the terms in 153 + 170 + 40x + 170 - 493. 40x Collect the terms in -791t*2 - 1266t*2 - 949t*2 + 892t*2. -2114t*2 Collect the terms in 5 - 2484591m + 2484570m - 5. -21m Collect the terms in -1 - 691i3 + 911806i + 1 - 911806i. -691i*3 Collect the terms in -312c - 133c + 142c - 8c. -311c Collect the terms in 16 + 1532f3 - 16. 1532f*3 Collect the terms in 2 - 2 - 195i*3 - 352i*3 + 545i*3. -2i*3 Collect the terms in -1232b*3 + 2 - 1 + 1442b*3 - 1 + 2b*2. 210b*3 + 2b*2 Collect the terms in -41964d - 3 + 3. -41964d Collect the terms in 13l - 39l + 81873l*2 + 12l - 81870l2 + 14l. 3l2 Collect the terms in -320j*2 + 79j*2 + 73j*2 + 91j*2 + 78j2. j2 Collect the terms in -47 + 95 + 1082x - 48. 1082x Collect the terms in -257j3 + 164j*3 + 85j*3. -8j*3 Collect the terms in 478r*2 - 2 + 1 + 141r - 475r2. 3r*2 + 141r - 1 Collect the terms in 3991v2 - 3993v*2 - 3 + 2 + 1. -2v*2 Collect the terms in -2c*2 - 3c*2 - 2c + 4c - 5 - 4c. -5c2 - 2c - 5 Collect the terms in 29z2 - 54z*2 + 12z*2 + 6z*2 + 7z*2 - 92z*3. -92z*3 Collect the terms in 2 + 71a - 116a + 1. -45a + 3 Collect the terms in 9192 - 15t3 - 9192 - 22t*3. -37t*3 Collect the terms in -25 + 2o + 25 - 1034o2. -1034o*2 + 2o Collect the terms in -3 - 11089600n + 5544799n + 3 + 5544800n. -n Collect the terms in -175x*3 - 14x*3 + 35x*3. -154x*3 Collect the terms in 655285109m*3 + 0m*2 - 655285111m*3 + 0m*2. -2m*3 Collect the terms in 329w*3 - 106w*3 - 110w*3 - 112w*3 - 112w2. w3 - 112w2 Collect the terms in -30v*3 + 1 - 2 - 30v*3. -60v*3 - 1 Collect the terms in -321380 + 35c + 321380 - c3. -c3 + 35c Collect the terms in -21q*3 - 181q*3 + 237q*3 - 29q*3. 6q*3 Collect the terms in -117n + 117n - 233n*3 + 435n*3. 202n3 Collect the terms in -x2 + 2x2 - 31 + 4 - 4. x2 - 31 Collect the terms in 300t*3 - 6t + 302t3 + 302t*3 - 908t*3. -4t*3 - 6t Collect the terms in 38h2 - 29h*2 - 24h*2 - 11h*2. -26h*2 Collect the terms in -31x + 11x - 64 + 11x + 64. -9x Collect the terms in 33n*2 - 58n*2 - 42n*2. -67n*2 Collect the terms in 42f + 40f + 39f + 43f - 155f. 9f Collect the terms in -82289c*2 + 18 + 82264c*2 + 3. -25c*2 + 21 Collect the terms in -247c - 385c - c2 + 2c2 - 33. c2 - 632c - 33 Collect the terms in 14a*2 + 10a*2 - 17a*2 + 9a*2. 16a*2 Collect the terms in 17963 - 18060 + 17v - 19v. -2v - 97 Collect the terms in -868h2 - 872h*2 + 2619h*2 - 877h*2. 2h*2 Collect the terms in 1126 + 83b - 1126 - 41b - 41b. b Collect the terms in -1013 + a + 1013 + 12a2 - a. 12a*2 Collect the terms in -5d*2 - 28d*3 - 26d*2 - 8d*2 + 39d*2. -28d*3 Collect the terms in 40 + 196a + 30 - 7 - 63. 196a Collect the terms in 6586 + 14r + 6585 + 6587 - 19758. 14r Collect the terms in 1699c + 76c2 - 848c - 851c. 76c*2 Collect the terms in -203d*2 + 470d*2 + d - 138d*2 - 136d*2. -7d*2 + d Collect the terms in 2z*2 + 321029z*3 + 321038z*3 + 2z*2 - 4z*2 - 642068z3. -z3 Collect the terms in -2i2 + 18i*2 - 26i*2 + 5i*2 + 3i*2. -2i*2 Collect the terms in -504h*3 + 505h*3 - 274h*2 + 274h2. h3 Collect the terms in 986l3 + 775l*3 + 1012l*3 - 562l*3. 2211l*3 Collect the terms in -840 + 2495 + 4d*3 - 3d3 - 827 - 828. d3 Collect the terms in -1976t + 2t*2 + 2t*2 - 1956t + 3969t. 4t*2 + 37t Collect the terms in 11515q - 5226q - 5355q. 934q Collect the terms in -3859i3 - 5914i*3 - 5173i*3 - 3845i*3 - 2i*2. -18791i*3 - 2i*2 Collect the terms in -3670c + 3667c - 1026c*2 + 145c*2. -881c*2 - 3c Collect the terms in -34 - 125t + 74t - 7 + 53t + 6. 2t - 35 Collect the terms in -49f + 9 - 40f - 9 - 64f + 155f. 2f Collect the terms in 1171 - 2r*2 + 3r*2 + 0r*2 + 2r*2. 3r*2 + 1171 Collect the terms in 228s*2 - 55s*2 - 58s*2 - 50s*2 - 56s*2. 9s*2 Collect the terms in -22k - 2k3 - 34k - 4 + 60k. -2k*3 + 4k - 4 Collect the terms in -3336 + s + 8946 + 4s2 - s. 4s*2 + 5610 Collect the terms in -21361i - 413i2 + 21361i. -413i2 Collect the terms in -109k + 107k - 31k. -33k Collect the terms in -2r - 767 + 1603 - 836. -2r Collect the terms in -2u*2 - 105 + 61 - 191. -2u*2 - 235 Collect the terms in -191 + 609 - 279 - 2b*3. -2b*3 + 139 Collect the terms in 958475879 - 2u*3 - 958475879. -2u*3 Collect the terms in 722p + 705p - 1453p + p2. p2 - 26p Collect the terms in -2i + 932i2 - 7i + 225i2 + 17i. 1157i2 + 8i	{ "pile_set_name": "DM Mathematics" }
. Let d(i) = 2i - 15. Let k be d(11). Let t = -5 + k. Let z(o) = -6o + 2o + o + to. Give z(a(g)). -3g Let y(p) = -19327p. Let c(l) = -17l2. Calculate c(y(h)). -6350059793h*2 Suppose 4y = 5f + 2y - 12, -f - 2y = 0. Let n(b) = 0b*2 + 4b*f - 6b*2 + 4b*2. Let m(a) = -4a*2 - 3. What is m(n(q))? -16q*4 - 3 Let u(n) be the first derivative of 18 + 0n - 5/2n2. Let c(s) = -2s. Determine c(u(k)). 10k Let p(s) = 137s. Let b(h) = -5h2 - 4h. Determine p(b(x)). -685x2 - 548x Let h(v) = -158v2. Let n(f) = -2f - 6. Let w(l) = 2l + 8. Let o(a) = 4n(a) + 3w(a). What is h(o(g))? -632g*2 Let h(z) = -2z*2. Let x be (4/6)/((-16)/(-72)). Let f(j) = 0 - xj*2 + 0 - 5. Give f(h(i)). -12i*4 - 5 Let h(q) = 10q. Suppose 13 + 35 = 12j. Let w(f) be the third derivative of -2f*2 + 0f - 1/30f5 + 0f*j + 0 + 0f*3. Calculate h(w(a)). -20a2 Let f(w) = -1. Let r(t) be the second derivative of -t3 - 3t2 - 14t. Let x(k) = -2f(k) + r(k). Let p(l) = -2l*2. What is x(p(h))? 12h2 - 4 Let d(b) = b2 - 6b + 3. Let k(h) = -h2 + 4h - 2. Let v(r) = 2d(r) + 3k(r). Let s(w) = -145w2. Determine v(s(a)). -21025a*4 Let m(g) = 177278g. Let k(x) = x*2. Calculate m(k(p)). 177278p*2 Suppose -16 + 0 = 4x. Let a be ((-2)/x)/(8/32). Let c(b) = -5ba - 4b*2 + 6b*2. Let t(w) = -2w*2. Give c(t(f)). -12f*4 Let t(s) = 44s. Let o(d) = 21d2 - 75d*2 + 8d*2 + 21d*2. What is t(o(r))? -1100r*2 Let z(f) = 2f*2. Let y(a) = -159a*2 - 10a - 5. Let p(t) = -80t2 - 4t - 2. Let w(c) = -5p(c) + 2y(c). What is z(w(s))? 13448s4 Let p(h) = h2 - 4h2 + h2. Let a(m) = -m - 23 + 2 - 2m + 21. Calculate p(a(w)). -18w*2 Let p(g) = -83g. Let z(r) = -279r2 - 286r*2 + 560r*2. Calculate z(p(s)). -34445s*2 Let l(f) = 64f*2. Let c(v) = -177v. Calculate l(c(d)). 2005056d2 Let i(c) = -199680c. Let t(b) = 6b2. Calculate t(i(q)). 239232614400q*2 Let k(g) = -2g*2. Let c(d) be the first derivative of 41 + d - d + 16d*2 - 37. Determine k(c(a)). -2048a*2 Let h(p) = -7p. Let q(u) = 5u2 - 9u - 6. Let l be q(6). Let i = l - 56. Let g(k) = k - i + 64. What is g(h(j))? -7j Let i(x) be the second derivative of x7/180 - 5x*4/6 - 13x. Let c(v) be the third derivative of i(v). Let g(b) = -b*2. Determine c(g(j)). 14j*4 Let d(y) = -2y*2 - 292y - 1. Let o(s) = 2s. What is o(d(t))? -4t*2 - 584t - 2 Let x(c) = 50c2 + 574c - 4. Let r(k) = -2k. Calculate r(x(g)). -100g*2 - 1148g + 8 Let a(l) = -34769l. Let r(z) = -2z. What is r(a(g))? 69538g Let t(m) = -15945m. Let r(f) = 44f2. What is r(t(l))? 11186693100l2 Let a(p) be the third derivative of p4/8 - p*2 + 19. Let h(c) = 6c*2 - 8c. Determine a(h(k)). 18k2 - 24k Let o(u) = 10u. Let m(c) = 17c + 6. Let a(r) = -15r - 5. Let t(p) = -6a(p) - 5m(p). What is t(o(h))? 50h Let n(o) = -29o. Let y(q) = -2q - 3. Let g(j) = -3j - 4. Let d(w) = -3g(w) + 4y(w). Determine d(n(f)). -29f Let z(v) = -2v2. Let s(o) be the second derivative of -o5/120 + 2o*3/3 - 5o. Let b(l) be the second derivative of s(l). What is b(z(g))? 2g2 Let c(y) = 9y. Let l(x) be the third derivative of x*4/6 + 83x*2. Calculate l(c(k)). 36k Let v(h) = -10h2. Let b(y) = -5y + 182 - 91 - 91. Calculate v(b(f)). -250f2 Let u(d) = 609d. Let k(h) = h*2 - 80h. Determine k(u(z)). 370881z2 - 48720z Let k(t) = -26t. Let p(n) be the second derivative of -n3/2 + n - 12. What is p(k(o))? 78o Let k(n) be the second derivative of -n4/8 - n2 - 2n. Let b(r) be the first derivative of k(r). Let d(t) = -70494 - 2t*2 + 70494. Determine b(d(x)). 6x*2 Let g(f) = -3347215f. Let d(p) = -p*2. What is g(d(s))? 3347215s*2 Let d(w) = w + 1. Let h(t) = -2t - 6. Let m(x) = -6d(x) - h(x). Let g(f) be the second derivative of f4/12 + 3f. Determine g(m(r)). 16r2 Let k(r) = 2r*2. Let w(x) be the second derivative of 11x*7/2520 + 19x*4/12 - 6x. Let m(z) be the third derivative of w(z). Determine m(k(t)). 44t4 Let g(d) = 5d*2 + 8d + 4. Let q(s) = -4s2 - 6s - 3. Let h(f) = -3g(f) - 4q(f). Let w(k) = -34k. Determine h(w(y)). 1156y*2 Let a(m) = -23m - 1 + 1. Let p(r) = -241r - 15. Let s(n) = -96n - 6. Let u(q) = 2p(q) - 5s(q). What is a(u(h))? 46h Let k = 8 - 2. Let y = 6 - k. Let m(r) = -14r + yr + 9r + 4r. Let x(q) = -2q*2. Determine m(x(p)). 2p*2 Let i(g) = -18041g. Let z(k) = -3k. Give i(z(b)). 54123b Let d(j) = -2j2. Let x = 0 - -3. Let p(y) be the first derivative of 1 + y3 - 2y*x + 2y*3 - 5. What is p(d(c))? 12c*4 Let m(h) = 2h - 2h + h2. Let u(f) = -11f*2 + 3f + 6. Let w(z) = -59z - 110 - 99z + 198z2 + 103z. Let o(s) = -55u(s) - 3w(s). What is o(m(x))? 11x4 Let x(r) = -1024r. Let z(u) = -u*2 + u + 3. Let q(p) = 5p*2 - 4p - 12. Let v(o) = -q(o) - 4z(o). What is x(v(h))? 1024h*2 Let r(b) = 5b*2. Let i(a) = 9a - 2. Suppose -6t + 59 - 185 = 0. Let g(j) = -91j + 21. Let f(k) = ti(k) - 2g(k). What is r(f(q))? 245q2 Let w(l) = -15l. Let b(f) be the first derivative of f*6/360 + 16f*3/3 + 12. Let p(c) be the third derivative of b(c). What is p(w(r))? 225r*2 Let j(y) = -3y + 10. Let g(l) = l - 4. Let n(c) = 5g(c) + 2j(c). Let t(d) = 11d2. Let p(k) = -4k*2. Let s(q) = 8p(q) + 3t(q). Give s(n(b)). b2 Let f(y) = 42334y*2. Let x(m) = 2m. Calculate x(f(t)). 84668t2 Let q(t) be the second derivative of t6/720 + 5t*4/2 - 6t. Let y(v) be the third derivative of q(v). Let o(c) = -15c2. Give y(o(i)). -15i*2 Let t(b) = 5b*2 - 4918b. Let a(y) = 11y. Give t(a(f)). 605f*2 - 54098f Let d(k) = k. Let j(v) = 4v - 2227. Determine d(j(a)). 4a - 2227 Let m(h) = 6h. Let a(t) = -2t*2 - 3t - 3. Let r be 4 + 1 - (12 - 11). Let j(f) = -2f2 - 4f - 4. Let z(y) = ra(y) - 3j(y). What is m(z(o))? -12o2 Let g(b) = 15b. Let n(x) = -4x - 12. Let h(v) = 9v + 22. Let s(d) = 6h(d) + 11n(d). What is g(s(f))? 150f Let a(w) = 297315w. Let t(l) = -3l. Determine t(a(z)). -891945z Let y(x) = 8368x. Let c(g) = -4g. What is y(c(h))? -33472h Let c be (12/(-14))/((-36)/168). Let v(s) = 0s + 4s - 2s - cs. Let t(u) = 72u. Calculate v(t(f)). -144f Let m(n) = -31n*2 - 8n + 14n2 + 19n*2 + n. Let o(c) = -3c*2. What is m(o(x))? 18x*4 + 21x*2 Let t(v) = -15v*2 + 7v*2 - 19v2. Let n(q) be the second derivative of q3/6 - 28q + 6. What is t(n(w))? -27w*2 Let q(z) = -5 + 9 + 2z*2 - 4. Let c be (-1)/(-4) + (-19)/(-4). Let d(m) = -c + 5 + 2m*2. Determine q(d(a)). 8a*4 Let l(v) = 40v*2. Let q(s) be the first derivative of 2s*3/3 + 76. Give q(l(g)). 3200g*4 Let n(t) = -127t*2 - t + 3. Let b(g) = 90g*2. Determine n(b(m)). -1028700m*4 - 90m*2 + 3 Let d(k) = -4575252k2. Let a(m) = -m2. Calculate d(a(o)). -4575252o4 Let p(c) be the third derivative of -13c4/24 - c2. Let z be 6/2 - (-5 + 8 + -4). Let s(v) = zv2 + 0v*2 - 2v2 - v2. Give s(p(n)). 169n2 Let t(l) = 11 + 30 - l - 158. Let r(n) = n2. What is t(r(w))? -w2 - 117 Let r(u) be the first derivative of -2u*3/3 + 420. Let t(f) = -149f. What is r(t(j))? -44402j2 Let z(i) = i. Let o(r) = 3r. Let a(b) = o(b) - 2z(b). Let k(d) = 698d*2. What is k(a(g))? 698g*2 Let o(d) = 32d. Let b(m) = -11m. Let g(y) = 17b(y) + 6o(y). Let k(t) = -6t. Let p(z) = z*2 + 4z. Let w(s) = -2k(s) - 3p(s). Determine g(w(a)). -15a2 Let b(p) = -10849p. Let g(s) = 32s2. What is b(g(h))? -347168h*2 Let d(k) = 2k. Let b be 5 - (-3)/6-2. Suppose b = -i + 5n - 16, -2i + 4n = 16. Let q(c) = ic + 2c - 6c + 2c. Give q(d(y)). -4y Let v(k) = 2k*2 + 56. Let h(c) = 108c*2. Calculate h(v(x)). 432x*4 + 24192x2 + 338688 Let h(k) be the second derivative of k4/6 + 2k. Let i(y) = 3y*2 - 4y*2 + 6y*2 - 4y*2. Give h(i(u)). 2u4 Let n(d) be the third derivative of d5/30 - 13d2. Let p(r) = -2r + 3. What is n(p(f))? 8f2 - 24f + 18 Let u(h) = -48h2 - 24h*2 + 78h*2. Let l(w) = -3w - 5. Let n(v) = 8v + 14. Let y(x) = -14l(x) - 5n(x). Calculate y(u(t)). 12t*2 Let t(z) be the second derivative of 0 - 6z - 2/3z4 + 0z*3 - 2z**2. Let j(w) be the first derivati	{ "pile_set_name": "DM Mathematics" }
191m2 + 349m*2 - 155m*2 + 2. Let h(q) = -2q + 3q - 1 - q2 - 2q. Determine zf(x) + 2h(x). x*2 Let u(p) = p + 19. Let f(h) = -4h + 343. Calculate f(v) + 3u(v). -v + 400 Let p(o) = -4o + 1. Let r(b) = -23b + 2. Let h(v) = -11v + 1. Let z(s) = -9h(s) + 4r(s). Let f = 297 + -291. Determine fz(d) + 11p(d). -2d + 5 Let d(h) = -168h*3 + 3h*2 + h - 19. Let w(f) = 41f3 - f2 + 4. Calculate -2d(j) - 9w(j). -33j3 + 3j*2 - 2j + 2 Let n(f) = 3f3 - 5f*2 + 4. Let k(u) = 2u - 6 - 2u - 5u*3 + 8u2. Let d(q) = q3 - 4q2 - 12q + 40. Let z be d(4). Calculate zn(p) - 5k(p). p*3 - 2 Let m(r) = 25r*2 + 4r - 1. Let p(n) = -24n2 - 3n. Suppose -102 = -14d - 60. Determine dp(s) + 2m(s). -22s*2 - s - 2 Let a(p) = -400p - 9. Let b(h) = 6800h + 150. What is -50a(y) - 3b(y)? -400y Let k(m) = -8m3 - 12m*2 - 2. Let a(j) = -11j*3 - 13j*2 - 3. What is -2a(n) + 3k(n)? -2n*3 - 10n*2 Let g be (24/(-20))/((-4)/(-20))-1. Suppose 2b = -g + 8. Let d be b/(2/10-1). Let t(a) = a*2 + 1. Let i(q) = -6q*2 - q - 4. Give dt(m) - i(m). m*2 + m - 1 Let f(l) = -2l*3 + 3l*2 + 6l + 1. Let c be -11 + (815/(-326))/(2 + (-5)/2). Let i(j) = 4j3 - 6j*2 - 11j - 2. Determine ci(w) - 11f(w). -2w3 + 3w*2 + 1 Let n(c) = -c - 6. Let v(q) = -87. Let m(s) = -427. Let o(y) = -10m(y) + 49v(y). Determine 2n(h) + 3o(h). -2h + 9 Let a(j) = -3j + 6. Let b(p) = 83p + 84p - 3 + 0 - 251p + 86p. What is 3a(h) + 5b(h)? h + 3 Let z(v) = 4 + 9v - 9v + 11v + 4. Let c be 12 - (-4 + 4 + -9 + 16). Let x(t) = -12 + 5 + 7t + 12. What is cz(y) - 8x(y)? -y Let g(f) = 2f*2 - 3f*2 + 5 + 0 - 4. Let w(p) = -14p*2 + 6p + 16. Let b(y) = -20y2 + 8y + 24. Let j(u) = 5b(u) - 7w(u). Give -6g(a) + j(a). 4a*2 - 2a + 2 Let h(d) = 1031d + 21. Let a(y) = 354664y + 7217. Calculate 3a(t) - 1031h(t). 1031t Let p(y) = 10y*3 - 5y*2 - 3097y + 12. Let w(m) = -28m3 + 14m*2 + 9291m - 33. Calculate -11p(u) - 4w(u). 2u3 - u2 - 3097u Let o(m) = -m + 1. Let w(q) be the first derivative of q*3/6 - 173q - 216. Let l(d) be the first derivative of w(d). What is -5l(t) - 4o(t)? -t - 4 Let s(j) = 6j - 6. Let w(m) = 11m - 11. Let h(d) = 2d2 - 8d - 125. Let q be h(10). Let n = -6 + 9. Calculate nw(o) + qs(o). 3o - 3 Let p(i) = 4i + 23. Let r(u) = -7u - 39. Let f(h) = 5p(h) + 3r(h). Let t be (0 - 21/(-12))4. Let y(l) = -l - 4. Calculate tf(v) - 4y(v). -3v + 2 Let z(l) = 259l*2 + 28l - 20. Let m(j) = 86j2 + 8j - 6. Determine -7m(w) + 2z(w). -84w2 + 2 Let d(n) be the second derivative of n2/2 + n. Let v(y) be the third derivative of -y5/60 - y3/6 + y2. Let r = 2417 + -2415. Give rd(i) + 2v(i). -2i*2 Let g(z) = -22z + 14. Let u(n) = -65n + 42. Let q(t) = -3g(t) + u(t). Let j = 2 - 1. Let a(k) = k*2 + 3k. Give ja(s) - 5q(s). s*2 - 2s Let b(z) = -1477z - 2. Let n(x) = 107814x + 147. What is -294b(t) - 4n(t)? 2982t Let f(m) = -12m - 16. Let k(q) = q + 1. Let h = 2 - -3. Suppose -hc + 4a - 260 = 0, -c + 2a + 182 = -5c. Determine ck(u) - 3f(u). -12u Let g(z) = 136z*2 + 153z. Suppose -5x + 7 = -p, p + 19 = 5x + 4p. Let l(h) = -h2 - h. Determine xg(k) + 306l(k). -34k*2 Suppose 3l - 26 = -2r, -l - 3r = -0l - 4. Let v(c) = lc + 22 - 53 + 16 + 15. Let a(m) = -m. Determine 6a(w) + v(w). 4w Let h(c) = -14c3 - 5c*2 + 8c + 4269. Let o(b) = -8b3 - 3b*2 + 5b + 2132. Calculate -3h(j) + 5o(j). 2j3 + j - 2147 Let y(r) = 7r - 1. Let f(i) = -18i + 84. Calculate -f(l) - 2y(l). 4l - 82 Let b(u) = 5u - 8. Suppose 6h - 2 = -2. Suppose h = 2j - 10j + 32. Let c be (-40)/(5 - 1) + j + 0. Let o(t) = t - 1. Determine co(q) + b(q). -q - 2 Let l(v) be the third derivative of -v6/120 + v3/6 + 359v2. Let b(a) = -27a*2 + 49a*2 - 3 + 3a*3 - 19a*2 + 0a*3. Give b(y) + 2l(y). y*3 + 3y*2 - 1 Suppose -16h = -7h + 5h + 84. Let m(g) = 5g2 - g - 7. Let n(s) = -4s*2 + s + 6. Calculate hn(i) - 5m(i). -i2 - i - 1 Let o(d) be the first derivative of -2d*3/3 - 3d*2/2 + 15d + 1982. Let w(i) = 2i2 + 2i - 14. Calculate 4o(h) + 5w(h). 2h2 - 2h - 10 Let y(t) = 434 + 350 - 14t2 - 2t - 786. Let p(a) = 113a2 + 17a + 17. Determine 6p(g) + 51y(g). -36g2 Let c(g) = g3 + g - 1. Let j = -54 - -95. Let u = j + -60. Let r = 21 + u. Let s(o) = -6o*3 - 9o + 9. What is rs(z) + 18c(z)? 6z3 Let l(s) = -s2 + 2s + 1. Let h(y) = 1021y2 - 6y - 3. Give h(k) + 3l(k). 1018k2 Let w(x) be the third derivative of x5/12 + x*4 - 888x*2. Let t(l) = -11l*2 - 48l. Calculate 4t(o) + 9w(o). o*2 + 24o Let k(n) = 12n + 2. Let z(u) = u. Let w(q) = -17q + 163. Let v be w(-17). Let r = v + -442. Calculate rz(s) - k(s). -2s - 2 Let p(r) = -2r3 - r2 - 1. Let j(f) = 108650f*3 - 108647f*3 - 4f*2 + 1 + 5f*2. Give -4j(l) - 3p(l). -6l3 - l2 - 1 Let p(o) = -3o + 3. Suppose -24 = -4n - 2n. Let x be n/36 + (-264)/(-54). Suppose 7 = w - 3s, 0 + 5 = -xs. Let u(i) = 2i - 2. What is wu(y) + 3p(y)? -y + 1 Let v = 3878 - 3873. Let n(u) = -7u2 + 4u - 5. Let k(a) = -1. Give vk(j) - n(j). 7j*2 - 4j Let a(k) = k*3 - 2k*2 - k + 2. Let f(c) = 2c*3 - 5c*2 - c + 4. Suppose 399z - 42z - 1785 = 0. Determine za(t) - 2f(t). t3 - 3t + 2 Let h(o) = -4o3 - 27o*2 + 5. Let w(s) be the first derivative of 5s*4/4 + 28s*3/3 - 6s + 4593. What is 6h(r) + 5w(r)? r*3 - 22r*2 Let g(l) = -6l*2 + 2l + 3. Let b(f) = -50f2 - 28f + 29. Let h(p) = -25p2 - 17p + 15. Let y(z) = 4b(z) - 7h(z). Give 22g(m) - 6y(m). 18m2 + 2m Let t(y) = -17y2 + y + 1. Let c be t(-1). Suppose 0 = -27i + 162. Let m(b) = 3b3 + 0 - 6 + 2. Let h(p) = 9p*3 - 11. Calculate cm(s) + ih(s). 3s*3 + 2 Let w(s) = -170s*3 - 41s*2 + 21s - 75. Let t(q) = 34q3 + 8q*2 - 4q + 14. Determine -11t(z) - 2w(z). -34z3 - 6z*2 + 2z - 4 Let x(a) be the third derivative of -a*5/30 + 17a4/24 - a3/3 - 2322a2. Let k(d) = d3 + 5d*2 - 34d + 4. Calculate -2k(p) - 5x(p). -2p3 - 17p + 2 Let m(o) = -7o - 165. Let p(k) = -109k - 2642. Determine -33m(q) + 2p(q). 13q + 161 Let p(y) = -11y - 6. Let i(c) = c - 1. Let r = 7757 + -7763. Give ri(m) + p(m). -17m Let g(j) = -42j - 135. Let a(p) = 38p + 124. Give 7a(n) + 6g(n). 14n + 58 Let m(a) = -5a*2 - a - 1. Let v(w) = -18w*2 - w - 10. Let x(r) = -4m(r) + v(r). Let s(z) = z*2 + 3z - 7. What is -4s(d) + 3x(d)? 2d2 - 3d + 10 Let g = 248 + -241. Let o(b) = -b - 3. Let v(a) = -a + 8. Let j be v(6). Let i(q) = 4q + 10. Calculate go(f) + ji(f). f - 1 Let i(k) = -k3 + 3k. Let g(y) = 354y3 + y2 + 17y. Calculate -g(u) + 5i(u). -359u3 - u2 - 2u Let x be -5209/95 - -15. Let z(l) = 19l - 2. Let g(i) = -19i + 2. Determine xz(a) + 3g(a). 19a - 2 Let m(g) = 3g*3 + 6041g*2 - 3g - 28. Let p(z) = -z*3 - 3021z*2 + z + 12. Give 3m(c) + 7p(c). 2c*3 - 3024c*2 - 2c Let y(l) = -2l2 + 5l - 8. Let x(g) = -2g2 + 6g - 7. Suppose 5f + 296 - 311 = 0, -4 = -4i + 4f. Determine iy(q) - 3x(q). -2q*2 + 2q - 11 Let y(g) be the second derivative of g4/24 + g3/6 + 75g2/2 + 51g. Let u(a) be the first derivative of y(a). Let x(s) = 1. Calculate 2u(j) - 3x(j). 2j - 1 Let w(h) = -4h*3 - 2h*2 + 1. Let g(p) = 255p*3 + 130p*2 - 20p - 65. Give 2g(f) + 130w(f). -10f3 - 40f Let x(p) = -554p2 + p - 4. Let z(v) = 1662v*2 - 3v + 10. Determine -11x(j) - 4z(j). -554j2 + j + 4 Let g(a) = 6a - 199. Let z(i) = 7i - 248. Give 5g(m) - 4z(m). 2m - 3 Let f(t) = 3t3 + 2t - 2. Let u(g) = 4 - 6 + 2g3 - 3g*3 + 3g*3 + g. Let l be (-3)/(1 - (3 - 3)). Give lf(h) + 4u(h). -h3 - 2h - 2 Let p(k) = -3201k2 - k - 77. Let j(c) = 12803c*2 + 4c + 346. What is 2j(q) + 9p(q)? -3203q2 - q - 1 Let i(v) = 38922v - 49. Let p(u) = 3244u - 4. Give 6i(c) - 74p(c). -6524c + 2 Let v(u) = -72u2 - 27u + 31. Let i(k) = 720k2 + 267k - 309. Let y(w) = -2i(w) - 21v(w). Let z(b) = 9b2 + 4b - 4. What is -4y(h) + 33z(h)? 9h2 Let l(b) = 182b*3 + 7b + 2. Let k(x) = -7x3 - x. What is 3k(s) + l(s)? 161s3 + 4s + 2 Sup	{ "pile_set_name": "DM Mathematics" }
iggest value in -2, 24, 20, 1? 20 What is the second smallest value in 8, -3.4, -1? -1 What is the second smallest value in -86, -23, -3, 0.1, 1/2? -23 Which is the third biggest value? (a) -0.7 (b) -9/8 (c) -0.1 b Which is the fourth biggest value? (a) -1/5 (b) 8 (c) 1/7 (d) 2 a Which is the fifth smallest value? (a) 115 (b) -5 (c) 2 (d) -3 (e) 0.3 a Which is the fifth smallest value? (a) 0.4 (b) 4 (c) -5 (d) 3/5 (e) 3537 e Which is the biggest value? (a) -0.4 (b) -2/3 (c) -4 a What is the third biggest value in 2/7, -1/646, -2? -2 Which is the fourth biggest value? (a) -2/3 (b) 0 (c) -3/7 (d) 101/5 a What is the biggest value in 0.3, -2, 278? 278 What is the second smallest value in -5, 4, 90? 4 Which is the smallest value? (a) -20 (b) -4 (c) 1 (d) -0.3 a What is the biggest value in 0.4, 5, 0.8, 3, 1/7? 5 Which is the fourth biggest value? (a) 2 (b) -0.5 (c) -10 (d) 11 c What is the smallest value in 3/191, 1, 0.1? 3/191 Which is the third smallest value? (a) -22 (b) -0.5 (c) 2/47 (d) -0.1 (e) -4 b What is the second smallest value in 0, 0.7, 2, 13? 0.7 Which is the biggest value? (a) 1.11 (b) -0.5 (c) 0 (d) 2 (e) -3 d Which is the biggest value? (a) 1/306 (b) -0.3 (c) -0.6 (d) 5 d Which is the smallest value? (a) -2/5 (b) 1 (c) 5 (d) -4/21 a Which is the fourth smallest value? (a) -1 (b) -0.3 (c) 1/9 (d) -0.2 c What is the third biggest value in 3/7, 2, 4, -8? 3/7 Which is the third biggest value? (a) 13 (b) -0.5 (c) 77 b What is the second biggest value in 3, -1/6, 2.69, -1? 2.69 What is the second smallest value in 17, -4, 0.01, 0.4? 0.01 Which is the third biggest value? (a) 2/3 (b) 6 (c) 4 (d) 1 (e) 4/9 d Which is the third biggest value? (a) 1/2 (b) -0.02 (c) -1/3 (d) -23 c Which is the fourth biggest value? (a) -2 (b) -1 (c) -2/141 (d) -5 d What is the third smallest value in 40, 4, 5? 40 What is the second biggest value in -2201, -1/2, -0.3, 0? -0.3 What is the smallest value in -0.03, -15, -1/18, 4? -15 Which is the third smallest value? (a) 2 (b) 4 (c) 0.4 (d) -341 a What is the smallest value in -3/10, -1/12, -3? -3 Which is the smallest value? (a) 0 (b) 100 (c) -1/4 c Which is the fourth biggest value? (a) 0.5 (b) 284 (c) 2/7 (d) 2 c What is the third biggest value in 1, -6, 4/7? -6 What is the fifth biggest value in 1, -1/6, -1/7, -0.3, 24? -0.3 Which is the fourth biggest value? (a) 5 (b) -2 (c) 67 (d) 0.5 b Which is the third smallest value? (a) 0.5 (b) -5 (c) 0 (d) -3 c What is the second biggest value in 3/5, -4, 0.05? 0.05 What is the smallest value in 9, 5/2, -1/5, 3? -1/5 What is the smallest value in 24, 55, -4? -4 Which is the second biggest value? (a) 0.1 (b) -5 (c) 4/7 (d) -4 a What is the second biggest value in 873, -0.4, 1/6? 1/6 Which is the fourth biggest value? (a) -5 (b) 4 (c) -3 (d) -1/3 a Which is the fifth smallest value? (a) 12/11 (b) -0.2 (c) 5 (d) -5 (e) 2 c What is the smallest value in -5, -10/7, -5.8, -1? -5.8 Which is the smallest value? (a) -0.7 (b) 1/3 (c) 0.5 (d) 5 (e) -1 e What is the third smallest value in -6, -2/27, 5? 5 What is the third smallest value in 31, 0.2, -4/3, -0.2? 0.2 Which is the third biggest value? (a) -1 (b) 5 (c) -0.4 (d) -16/9 a Which is the third smallest value? (a) 1 (b) -25 (c) -3 a Which is the biggest value? (a) 1/2 (b) 0.2 (c) 13 c Which is the smallest value? (a) 427 (b) -2 (c) -0.23 b What is the second smallest value in -4, -803, 14? -4 What is the second smallest value in 592, 1/3, -5? 1/3 What is the third biggest value in 9/17, -0.4, 1? -0.4 Which is the fourth smallest value? (a) 5 (b) -2/17 (c) -5 (d) -0.7 (e) 4/5 e Which is the third smallest value? (a) -2 (b) 5 (c) -4 (d) 1/10 d What is the second smallest value in 3/4, 1, 37, 0.2? 3/4 What is the smallest value in -3, 1.6, -0.026? -3 Which is the third biggest value? (a) -4 (b) 3 (c) 25 a What is the biggest value in -2/5, -2/3, 95, -0.06, 1? 95 What is the smallest value in -2/13, -11, 0.3, -2/3? -11 Which is the fourth smallest value? (a) 5/4 (b) 5/6 (c) -4 (d) 0.2 a What is the biggest value in 5, 0.11, -3/5, 3/7? 5 What is the third smallest value in 0.3, 0, 8/3? 8/3 What is the fourth smallest value in 1, 4/3, 1/2, 2, -0.1? 4/3 What is the smallest value in 1, -0.03, 0.04, -3/8? -3/8 Which is the smallest value? (a) -2/5 (b) -20 (c) -1/2 (d) -7 b What is the biggest value in 0.4, -0.3, 2233? 2233 What is the third biggest value in -4, 14/5, -8.8? -8.8 What is the third smallest value in -2, 20/7, 0.1? 20/7 What is the second biggest value in 1/132, -12, -2? -2 What is the second biggest value in -7/6, -0.6, -18? -7/6 What is the smallest value in 0, -3, 26? -3 Which is the biggest value? (a) -2/13 (b) -31/8 (c) -1/10 (d) -2 c Which is the biggest value? (a) -10 (b) 2/3 (c) -1/2 (d) -15 b Which is the third smallest value? (a) -1/5 (b) 8 (c) -0.08 b What is the biggest value in -1.4, 108, 3/5, 2/5? 108 Which is the second biggest value? (a) 2/19 (b) 1.4 (c) 8/7 c Which is the third smallest value? (a) -118/3 (b) -0.4 (c) 2 c Which is the biggest value? (a) -5 (b) 0 (c) 66 c What is the second smallest value in -0.2, 2, 1/6, 3, -6? -0.2 What is the second smallest value in 3.24, 5, 2/39? 3.24 Which is the fourth biggest value? (a) -1/8 (b) 1 (c) 1/4 (d) -2 d Which is the biggest value? (a) 2/5 (b) -0.32 (c) -1/3 a What is the third biggest value in -0.3, 29, 2, 0? 0 Which is the second biggest value? (a) 1 (b) 4 (c) -0.9 a What is the second smallest value in -11, -0.2, 3/2? -0.2 What is the second smallest value in -1, 4, 2, 1? 1 What is the second smallest value in -21, 0.02, -0.05? -0.05 Which is the biggest value? (a) -6 (b) 5 (c) -4/5 b Which is the third biggest value? (a) 3/7 (b) 1/16 (c) -1 (d) -5 c What is the second biggest value in -2, -4/7, 3? -4/7 What is the fourth biggest value in 3/7, 4, -4/9, -16, 0.2? -4/9 What is the fifth smallest value in -0.4, -0.06, 5, 4, 3? 5 Which is the third biggest value? (a) -0.12 (b) 2/21 (c) 0.4 (d) 23 b What is the fourth biggest value in 1/6, -1/11, 3, -5? -5 What is the biggest value in 8, 26, -0.4? 26 Which is the fourth biggest value? (a) -0.044 (b) -0.3 (c) 2/5 (d) -24 d What is the biggest value in 21, 2/7, -0.01? 21 What is the third smallest value in -4/5, -3, -31/6? -4/5 What is the second biggest value in -3, -4, 0.5, -19? -3 Which is the third smallest value? (a) 6 (b) -5 (c) 0.3 (d) 2 d What is the third biggest value in -2/21, -5, -80? -80 What is the fifth biggest value in 0.3, -6, -1, -0.7, 0.1? -6 Which is the biggest value? (a) -1 (b) -3/8 (c) 2 (d) 2/9 (e) 0.5 c What is the second smallest value in -4, -1.55, -2? -2 Which is the third smallest value? (a) -457 (b) -0.5 (c) -0.4 c What is the biggest value in 7, 57, 2.1? 57 Which is the smallest value? (a) -5 (b) -0.4 (c) -0.17 a What is the biggest value in 5, -3, 3, -563? 5 What is the fourth biggest value in -33, -2/23, 1/8, -2? -33 What is the second biggest value in 0.2, -0.06, -0.085, -2/5? -0.06 Which is the fourth biggest value? (a) 2 (b) 4 (c) -1/9 (d) -1.6 d What is the second biggest value in -2/7, -1/351, -4? -2/7 What is the second smallest value in -3, -1, 1/53? -1 What is the biggest value in 9/8, 2/7, 6/7? 9/8 What is the fourth biggest value in 0.91, 0.4, -5, -0.5? -5 Which is the third biggest value? (a) 0.045 (b) -0.5 (c) -3 c What is the second smallest value in -0.2, -30, 0.1? -0.2 Which is the third smallest value? (a) 7 (b) 4 (c) 1 (d) -5 (e) 6 b Which is the second biggest value? (a) -1 (b) -2 (c) -7 b Which is the third biggest value? (a) 0.2 (b) 2/5 (c) -120 c Which is the second biggest value? (a) 23 (b) -4/5 (c) -0.1 c What is the smallest value in 1, -6, -2/3, -1/2? -6 Which is the third smallest value? (a) -11 (b) 3 (c) -1/2 b Which is the fourth smallest value? (a) -2 (b) 0.4 (c) -373 (d) 3 d What is the fourth biggest value in -0.01, -2/13, -12, 0.03? -12 Which is the fifth smallest value? (a) 0.4 (b) -1/2 (c) -0.02 (d) 0.5 (e) -2.8 d What is the third smallest value in 0.4, -3/2, -3? 0.4 What is the fifth biggest value in -6/	{ "pile_set_name": "DM Mathematics" }
d) 2 c Let t(j) = 2j3 + 16j*2 + 4. Let o be t(-8). Suppose 7k = ok - 9. Which is the smallest value? (a) -0.4 (b) k (c) -1 b Let p = 16.24 + -16.04. What is the second biggest value in 3, -0.04, -2, p? p Let h = -436/3 + 146. Which is the fourth biggest value? (a) h (b) 149 (c) -0.4 (d) 4 c Let z be 10/6 + 11/(-54 - -21). Let m = 7 + -4. Which is the fourth biggest value? (a) m (b) 2 (c) z (d) -3 d Let u = 532.06 + -549. Let p = -0.06 + u. Which is the smallest value? (a) -2 (b) p (c) 4 b Let z = 422 - 427. Which is the biggest value? (a) -11 (b) 2/7 (c) 0.2 (d) z b Let z = -0.0948 - 3.9052. Which is the smallest value? (a) -126 (b) z (c) 3 a Let q = 601 - 596. Which is the second biggest value? (a) 0.3 (b) q (c) 2/21 a Suppose 2 = 2l + 2s, -1 = 2s + 1. Let w = 45 + -40. Which is the third smallest value? (a) l (b) 3 (c) 1 (d) w b Let z = 609 + -609.2. Let h be (-26)/8 - 2/(-8). What is the biggest value in -1/6, z, h? -1/6 Let d = -112 - -105. Let k = -0.2 + -0.1. What is the smallest value in d, 1, k? d Let w = -1140 - -1138. Which is the smallest value? (a) 0.05 (b) 2 (c) 23 (d) w d Let y be (-2)/(-6) - (-6)/(-45). Let l be -3 + 363/12 + (-1)/1. Let j = 25 - l. What is the third biggest value in 1/8, y, j? j Let d = -6 - -5.82. Let y = d - -0.18. Which is the biggest value? (a) 4 (b) y (c) 2/11 a Let i = 326 - 325.6. Which is the third biggest value? (a) -0.1 (b) i (c) 2 a Let l = 5 + -9. Let i = -1.08 - -0.77. Let m = i - 0.69. What is the biggest value in -3, l, m? m Let j = 32 + -28.6. Let n = -0.6 - j. Which is the smallest value? (a) n (b) -3 (c) 1/4 a Let x = 4103/4 - 1026. What is the second smallest value in x, 2, -9, 4? x Let h = 0.1 - 0.2. Let t = 1179 - 1176. What is the biggest value in -5, h, t? t Let i = -20.6 - -14.2. Which is the third smallest value? (a) 3/5 (b) i (c) 2 c Let r = -9 - -25/3. Let x = 17.35 + 0.05. Let m = x + -17. What is the second smallest value in m, -1/3, r? -1/3 Let z(w) = -w*3 - 6w*2 + w + 5. Let f be z(-6). Let y = 11.9 - 58.9. Let o = y + 43. Which is the second biggest value? (a) o (b) f (c) 0.07 b Let s = -3.4 - 0.6. Let z be 28/(-45) + (-4)/(-10). Which is the smallest value? (a) s (b) 0.2 (c) z a Let c = 5.78 - 6.78. What is the biggest value in 1/5, c, -1/14, 1? 1 Let j = 116 + -576/5. Which is the smallest value? (a) -0.187 (b) j (c) 1 a Let m = -12 - -12. Suppose m = -5x, 0 = 2i + x - 2x - 4. Let p = 0.29 + -0.09. What is the biggest value in p, i, 4? 4 Let m = -14.4 + 10.4. What is the fourth biggest value in 3/5, m, 1/3, -2? m Let y be (10/44)/(5 - 150/36). What is the smallest value in -2, y, -4? -4 Let k be (2/(-5))/(162/45 + -1). Which is the second smallest value? (a) k (b) -11 (c) 4 (d) -3 d Let k = 0.033 - 38.033. Let r = 38 + k. What is the second biggest value in 0.3, 2/13, -0.3, r? 2/13 Let v = -1.6 + -6.4. Let x = v - -8.7. Let c = x - 5.7. What is the biggest value in c, 1, -0.04? 1 Let y = 124 - 89. Suppose 3 = -k, -5g + 4k + 4 = -3g. What is the smallest value in y, 3, g? g Suppose 4z - 4g + 8 = 0, 2g - g - 8 = 4z. Let q be -3 + (z - 215/(-45)). Let c = 0 - -0.1. What is the biggest value in c, q, 4? 4 Let d = 4448/5 - 889. What is the third smallest value in d, 27, 6? 27 Let w = -0.397 - -1.397. Suppose 3k - 3 = -0m + 2m, 0 = 3m - 4k + 3. Let o = 0.2 + -1.2. What is the second smallest value in o, w, m? w Let g be 1/(-3) + 2/4. Let v = -100.7 + 101.2. Which is the second smallest value? (a) v (b) 2 (c) g a Let j = 0.47 + -25.47. Let m = 23 + j. Which is the smallest value? (a) 1 (b) -4/3 (c) m c Let a = -33 + 47. Let r = 0.07 + -0.16. Let i = r + -0.41. What is the second biggest value in a, -1/4, i? -1/4 Let b = -0.1 + 1.1. Let y = 401/685 - -2/137. What is the smallest value in -30, y, b? -30 Let n be (208/102 + -2)/((-3)/9). Which is the smallest value? (a) -0.9 (b) n (c) 0.1 a Suppose -2q = -4n - 18, 17 = 2q - 2n + 3. Which is the third smallest value? (a) 2 (b) q (c) 0.31 b Let o be (-121)/55 + (-2)/(-10). Which is the smallest value? (a) 2 (b) 0.7 (c) o (d) -1 c Let j(v) = 8v - 29. Let m(u) = -3u + 10. Let l(d) = 4j(d) + 11m(d). Let s be l(-6). Let b = 210 - 210.4. What is the biggest value in b, 2/13, s? 2/13 Let s = 1259.5 + -1259. Which is the third biggest value? (a) 11 (b) 0 (c) -7 (d) s b Let a be 871434/(-168) + 2/(-14). Let c = a - -5151. Let d = c + 35. What is the third smallest value in 0.2, d, 0.3? 0.3 Let n = -3 + 3.1. Let u be -1(4/2)/(-12). Let p = 0.072 - -1.928. What is the smallest value in n, u, p? n Let n = 2.97 + 0.03. Let v(u) = -3u + 4. Let d be v(3). Let z be (-34)/72 + (6/(-8) - -1). What is the third smallest value in d, z, n? n Let j be (4 - 19) + (-2)/(-2). Let y = j + 29. Let w be 1/(-5) + 23/y. Which is the third biggest value? (a) 3 (b) w (c) -1/5 c Let v = 1.3 + -0.7. Let t = 17841 + -17843. Let x = -2/325 - 632/2925. Which is the smallest value? (a) v (b) x (c) t c Suppose 78u = 72u - 24. What is the second smallest value in 2/19, u, -0.3? -0.3 Suppose 0 = 3f - 9, 7f - 3f = -5h + 32. Let d be (2 + -2)h/12. Let t be (-9)/(-3) - d - 5. What is the second biggest value in 5, t, 0? 0 Let y = 8.92 - 8.92. Which is the biggest value? (a) 0.35 (b) y (c) -1/5 a Let b = 1.04 - 62.04. Let w = b + 65. Let h be 0 - (9/4 - 2). What is the third biggest value in w, h, 2? h Let w = 2.21 + 61.79. What is the third smallest value in w, -3, -2, 2? 2 Let y = 2 - 2.4. Suppose 21h - 22h + 14 = -3r, -2r - 10 = -h. Which is the third biggest value? (a) y (b) -0.1 (c) h (d) -3/5 a Let n(u) = -2u*3 + 31u*2 + 16u + 3. Let l be n(16). Which is the fourth biggest value? (a) -3 (b) 0.1 (c) 1/4 (d) l a Let u = -20 + 12. Let h = -26 - -16. Let m = u - h. What is the smallest value in -0.3, -4/7, m? -4/7 Let n(v) = 5v - 6. Let o be n(-3). Let f be ((-4)/(-2))/(168/o). Which is the fourth biggest value? (a) f (b) 1/2 (c) -5 (d) 0 c Let r = 2.06 - 0.06. Let m be -7 - -396/(-81)(-114)/76. What is the third biggest value in r, 0, m? m Let z = 419.37 - 419. What is the third smallest value in 2, z, -1/6? 2 Suppose 0 = -s - 3u - 6, 0 = -4s + 3u - 75 + 66. Let t = 3 + -5. What is the second biggest value in s, t, -3/7? t Let n = -475 + 3326/7. What is the biggest value in n, -1, -4/3? n Let m = 9/32 - 13/160. What is the smallest value in -1/10, 4/7, m, 3/52? -1/10 Let t = -317 - -7293/23. Which is the second smallest value? (a) 0 (b) 11 (c) t c Let d be (-64)/(-36) - (80/(-45))/8. What is the fourth biggest value in -0.1, d, 0, -29? -29 Suppose -4a + 1 = -3m + 11, 4m - a = 9. What is the fourth smallest value in 1, 3, -1/4, m? 3 Let x be 10 - (-156)/(-15) - (-24)/35. Which is the fourth smallest value? (a) 0.3 (b) x (c) 2/5 (d) -49 c Let n be (-10)/(-4 - -2)(-8)/300. What is the fourth biggest value in n, -1/4, 6, -4? -4 Let x = 309 - 298. What is the third biggest value in -2/3, x, -0.3, 2/9? -0.3 Suppose -39 = -5p - 14. Which is the fourth smallest value? (a) p (b) 0.02 (c) -4 (d) 3 a Let n be (11 - -9)/(12/3). What is the biggest value in 1/5, -5, -3/19, n? n Let k be (2/(-30))/((-2)/(-5949)3). Let r = -66 - k. Let s be 12/(-26)1/3. Which is the biggest value? (a) -2/3 (b) s (c) r c Let q be 11 - ((2 - 3) + -2). Suppose 5k + 2o - 7 = 6, 0 = -5k - o + q. What is the second smallest value in 0.2, k, -4? 0.2 Let z = 948 - 948.2. Let x = 1 + -2. Which is the biggest value? (a) -2/9 (b) z (c) x b Let v(h) = h*3 - 27h*2 - 202h - 22. Let k be v(-6). Let c = -0.006 + 29.006. Let n = -21 + c. What is the biggest value in k, n, -2? n Let r be (-4)/(-16) + (-3)/12 + 1. Let z be 72/(-48)(r/6 - 0). What is the third biggest value in 5, 11, 0, z? 0 Let y be 1 + (-19)/(-10) + (-58)/145. What is the third biggest value in y, -3, -2/7, 6? -2/7 Let w = -731 + 750. Which is the second biggest value? (a) w (b) -3 (c) 4 c Let n = 1.53 + -1.7. Let h = -7.83 + n. Let j = 9 + h. What is the third biggest value in 3/2, j, 5? j Let m = -396 + 400. Which is the third biggest value? (a) -0.01 (b) -1.9 (c) 1 (d) m a Suppose -3z - 4 = -2p, -5p + 1 = -4*z - 2. Let v = 29.2 + -25.2. Which is the second b	{ "pile_set_name": "DM Mathematics" }
ve of a*3m*2 - 7a*3m - 69a2m - 88742am*3 + 3a + 4m2 + 1 wrt m. 2a*3 - 532452am + 8 What is the second derivative of -283116689m*2 + 194470858m wrt m? -566233378 Find the second derivative of -5674486i5 - 7139526i. -113489720i3 Find the first derivative of 7583673mv3 + 56m + v*3 + 5083916v - 57 wrt m. 7583673v3 + 56 Differentiate 27s*2 + 1832s - 3871228. 54s + 1832 What is the third derivative of 6j*5 - 352702j*4 + 2j*3 - 2j*2 + 3j - 107642? 360j2 - 8464848j + 12 What is the first derivative of -7095636d - 34724262 wrt d? -7095636 What is the second derivative of 105c*2v*3 - 9c*2 + 6cv3 + 174213cv + 10352v*3 + 6 wrt v? 630c*2v + 36cv + 62112v What is the third derivative of 5244311m*3u*4 - 2m*3u*2 + 7m*2 + 6mu2 - 2mu + 13156u*2 wrt u? 125863464m*3u Differentiate 181923j3 - 33j + 18018832. 545769j2 - 33 What is the second derivative of 62djsv2 - 4djs - djv + ds + 32779dv2 + 4dv + 1152d - 3jsv - 2js - 7jv2 wrt v? 124djs + 65558d - 14j What is the third derivative of 15a3j*3 + 2a*3j*2 - 83474a*3j - 2a2 + aj*3 + 2j*3 + 2609j*2 + j wrt a? 90j*3 + 12j*2 - 500844j What is the first derivative of -831403068bk - 876085465b wrt k? -831403068b What is the second derivative of 5299409w2 - 17167w + 220 wrt w? 10598818 What is the first derivative of 102257413a4 + 429903518? 409029652a*3 What is the first derivative of -675393115g*4 + 485262665? -2701572460g*3 What is the third derivative of -3832611g*3 + 45g*2 - 80042 wrt g? -22995666 Find the second derivative of 22381017y*3 - 2y + 88887 wrt y. 134286102y Find the second derivative of -10p5 + p3 - 155083p2 + 494247233p wrt p. -200p3 + 6p - 310166 What is the third derivative of 5y4 + 49993y*3 - 20870y*2 + 483y wrt y? 120y + 299958 Differentiate -71200948o*2 - 130902538. -142401896o Differentiate -512955j2 + 10j + 779057 with respect to j. -1025910j + 10 Find the second derivative of 855105c*3 + 10c*2 - 55149134c wrt c. 5130630c + 20 What is the third derivative of -70724b*5 - 237b*3 - 70049b*2 + b + 210? -4243440b*2 - 1422 What is the derivative of -90ou4 - 27414ou3 - ou + 322802o + 45 wrt u? -360ou3 - 82242ou2 - o Find the second derivative of 1536922uy3 - 4uy2 - 7u - 9y3 - 2y*2 - 16284y - 93 wrt y. 9221532uy - 8u - 54y - 4 Find the second derivative of -51u3 + 8495u*2 - 16606018u wrt u. -306u + 16990 Find the second derivative of 795876j*3u*3y*2 - 3j*3u*3y - 419j3u*3 + 56ju3y - 237u3y*2 wrt y. 1591752j*3u*3 - 474u*3 Find the second derivative of -464080736y*3 + 4y - 63997356 wrt y. -2784484416y What is the third derivative of -21n*3x*3 + 372976n*3x2 - n3x - 2n*2x*2 - 4n*2x - 1248nx*2 + 809x*3 wrt n? -126x*3 + 2237856x*2 - 6x Find the second derivative of -15362503u2 + 21871191u. -30725006 Differentiate 1056134nu + 285541299n + 35u*2 - 3u with respect to u. 1056134n + 70u - 3 Differentiate -1940510n + 13045731 with respect to n. -1940510 Find the third derivative of 755r*4t*2 + 4032r*3t*2 + 2r*2t*2 + 2r*2 + 84061rt - 2t*2 + 2t wrt r. 18120rt*2 + 24192t*2 Differentiate 4983600t*4v*2 + 5t*2v*2 + 41602v*2 - 40 with respect to t. 19934400t*3v*2 + 10tv2 Differentiate -191644297r - 108140563 with respect to r. -191644297 Find the first derivative of -526711g2i + 2g2 + 10gi + 4357g + 2i - 668 wrt i. -526711g*2 + 10g + 2 What is the third derivative of 11913928m5 - 848m*2 - 2424 wrt m? 714835680m*2 Find the third derivative of -43565354d*3 + 4715d*2 - 17449d wrt d. -261392124 What is the second derivative of -2p5 + 1643p*4 + 462p*3 + 88361113p? -40p3 + 19716p*2 + 2772p What is the first derivative of -5c4o - 3co*2 - 466946c - 2o2 - 12o - 1443 wrt c? -20c3o - 3o2 - 466946 Find the second derivative of -i3ry - 116i*3r + i*3y*2 + 664i*2ry2 - 4i*2ry - ir + 1197i - 15994ry2 wrt y. 2i*3 + 1328i*2r - 31988r Find the second derivative of -1690990k*5 + 4k*3 - 2k*2 - 63229017k. -33819800k3 + 24k - 4 What is the third derivative of -237b3w*4 + 2b*3w*2 + 3b*3 - 324b*2w - 4b2 + 283b + 2069w6 wrt w? -5688b*3w + 248280w3 What is the derivative of -1772w*2 + 29496w + 19963555? -3544w + 29496 Find the second derivative of -419562d*5 + 3d*3 - 252d*2 + 1958505d + 46 wrt d. -8391240d3 + 18d - 504 Differentiate -7984070k2n + 58k2 + 2k - 35092 with respect to n. -7984070k2 Find the second derivative of -36397925j*4 + 45980j + 25 wrt j. -436775100j2 What is the second derivative of 502830g*2p*2 - 3g*2p + 8g + 64024p*2 + 14p wrt g? 1005660p2 - 6p What is the second derivative of 12n3s*3 - 18762n*3s - 45518s5 - s2 - 23s + 1 wrt s? 72n3s - 910360s3 - 2 Find the first derivative of -1682f*4 + 41f - 4515351. -6728f3 + 41 What is the second derivative of 1288b5 + b4 - 474b3 - 26964720b wrt b? 25760b3 + 12b*2 - 2844b What is the first derivative of -635035747fv - 9v + 7853900 wrt f? -635035747v What is the second derivative of 3063ad*3f*3 - 2adf*3 + 2adf*2 - 2ad - af*2 + 32474d*3f + df3 - 22df + 350f wrt d? 18378adf3 + 194844df What is the third derivative of -2904g*3u*3 - 2g*3u*2 - 47010gu3 - 40915193u*2 wrt u? -17424g*3 - 282060g Find the second derivative of -2p3 - 5571717p*2 + p + 20668 wrt p. -12p - 11143434 What is the derivative of 2hp*2 + 596004923hp - 2h + 185069606 wrt p? 4hp + 596004923h Differentiate 4s*4 - 568363s*2 + 5811802 wrt s. 16s*3 - 1136726s Find the third derivative of -1420iy*3 - iy*2 + 14204209iy + 104687y*3 + y wrt y. -8520i + 628122 What is the third derivative of 392317530q3 + 45866381q*2 + q? 2353905180 What is the third derivative of 301567144o*6 + 4o*2 + 2o - 145217? 36188057280o3 Differentiate -4g*2q - 10009g2 - 396g + 74672547q4 - 5 wrt q. -4g*2 + 298690188q*3 What is the third derivative of -2d*2qv2 + 33d*2v*3 + 4d*2v + 8235dq*3v*2 + 2dqv*2 - 11234q*3v*4 + 4qv2 wrt v? 198d*2 - 269616q*3v What is the derivative of 615op*2 + 13698op - 14p*2 + 358646p + 2 wrt o? 615p2 + 13698p What is the third derivative of -9653220z4 - 31z*2 + 54583z + 3 wrt z? -231677280z What is the second derivative of 266q*4 - 58q*3 - 2216q*2 - 8087376q - 12? 3192q2 - 348q - 4432 What is the third derivative of 8192687o5 + 5343257o*2? 491561220o*2 What is the second derivative of 198550615t*2u*3 + 91119t*2u - t*2 + 16u - 10 wrt u? 1191303690t2u Find the first derivative of 32204836c - 42248019. 32204836 Find the third derivative of i4x - 19i4 - 36i*3x - 698i3 + 21995i*2x + 8ix - 10i - 2x wrt i. 24ix - 456i - 216x - 4188 What is the third derivative of 4735922b4 + 39214b*2 - b? 113662128b What is the first derivative of -43743758r2 - r - 1370519763 wrt r? -87487516r - 1 What is the first derivative of -5962913f - 26018505 wrt f? -5962913 What is the second derivative of 4f*2h*3i + 793301f2h*2i - 35fh*3 - 42fh2i + fhi + 12h3 + 15i wrt f? 8h3i + 1586602h2i What is the second derivative of -1671s4 + 864s*3 - 13833331s wrt s? -20052s2 + 5184s What is the derivative of -dy + 127816153d + 2y - 92053010 wrt d? -y + 127816153 What is the third derivative of -250400652s*3z*3 + 1600s*3 - sz*2 + 18z*2 + 87 wrt z? -1502403912s*3 Find the third derivative of 3a*3k*3 - 118a*3k*2 + 41789a*3 + 3020592a*2k*3 wrt k. 18a*3 + 18123552a*2 What is the third derivative of -45399i5 + i4 + 328i3 + 39139i*2 - 24i + 3? -2723940i2 + 24i + 1968 What is the second derivative of -1733114v5 + 4v*4 - 4394411v wrt v? -34662280v3 + 48v*2 What is the third derivative of 54826423g*2y*3 - 975g*2 - 28gy2 + 2 wrt y? 328958538g**2	{ "pile_set_name": "DM Mathematics" }
y + nw - 2 for y. 0 Suppose 0 = 18a + 20a - 190. Let j(y) = y2 - 8y + 6. Let q be j(8). Suppose 9w = qw. Solve w = 5u - 3f - 10, 4f = au - 0 - 10 for u. 2 Let t be (-7 - -1) + (27 - 41 - -20). Let a(s) = -s - 3. Let d be a(-3). Solve tu - i + 2 = u, d = i - 1 for u. 1 Let g(f) = -4f + 33. Let l be g(7). Suppose 0 = lj - 15j + 20. Solve -4t - 2u = t - 5, 0 = 4t - ju - 22 for t. 3 Suppose 11 = j + 7. Let y(x) = x*3 - 3x*2 + x - 16. Let k be y(j). Solve q = 3i - 9, 0q + 2q - ki = -10 for q. 3 Suppose 6b = 4b - 3c - 5, b - 5c + 22 = 0. Let r be (-1 - -4) + b/7. Solve -ru = 3u + 5, 0 = -5z - u - 16 for z. -3 Let k be -2-33/(-9) - 2. Let x(c) = -9c - 8. Let l be x(k). Suppose -3o - 22 + l = 0. Solve -3z - od + 11 = 0, 2z + 7d - 2d = 22 for z. 1 Suppose 0 = 4n + z - 2 - 3, -3z + 15 = -2n. Let f be (-9 + n)(-25)/75. Solve u - fx = 5u - 10, -5u + 13 = 4x for u. 1 Suppose 0 = 65i + 30i + 47i - 1562. Solve 3p - i = -2b, -225p + 220p = 2b - 17 for p. 3 Let o(x) = -x3 - x2 + 2x + 4. Let z be o(-2). Suppose zy = d + 7, d = -3y + 2 + 5. Solve yh - 4m = 2, 3h - 3m - 19 = 5h for h. -5 Let y = 3492 + -3486. Solve -2f = -5h + 12, h - yf = -8f for h. 2 Let b = -12704 - -12706. Solve -12 + 6 = -bw + 2z, w = -2z for w. 2 Let m = 28674 + -28655. Solve -4n + m = 3o, -13n = -9n + o - 17 for n. 4 Let y(d) = -d - 9. Suppose 5t - 12 = 2w + 13, 0 = w - t + 20. Let z be y(w). Let m = 8 + -5. Solve 4u - mu + 3v - z = 0, 5v = u + 16 for u. 4 Let y(v) = -v*3 + 4v*2 + 5v - 7. Let t be y(2). Suppose tq + 0q - 55 = 0. Solve 0 = 5x + 5o - 35, -3o + 6 = qx - 25 for x. 5 Let i = -28 - -31. Suppose 4t - 3 = 3u, 0u + u - i = 0. Solve 9 - 21 = -ta, 10 = 2p + a for p. 3 Suppose 3y + 3 = -2d, -5y - 1 = d + 11. Suppose 0s - m - 27 = -3s, m - 3 = 0. Let o = s - 6. Solve 1 = 5w - dq, oq = 2w + 3w + 2 for w. 2 Suppose -7q + 1123 = -207. Let o = 193 - q. Solve 0 = -b - 1, oa + 4 = -a - 4b for a. 0 Suppose 15 = 6g - 69. Suppose -b = 4p - 1, -2b - p + g = -5p. Solve 0 = bv + 2o + 28 - 6, -2v - 6 = -2o for v. -4 Let i(l) = 2l3 - 40l*2 + 35l + 62. Let g be i(19). Solve -4h = -24p + 27p + 25, -23 = 2h + gp for h. -4 Suppose -3q = 3, -2t + 26 = -10q + 4. Solve 3s - 10 = -4f, 2s - 13 = -3f - t for f. 1 Let y = -1545 + 1547. Solve 5m + 4c + y = -39, 3c + 27 = -3m for m. -5 Let s = 1985 - 1980. Solve sa - 3j + 8j = 30, -3j = 2a - 15 for a. 3 Suppose 0 = -d + 9 + 8. Suppose -g = t + 12, g + d = 2t + 5. Let x = -7 - g. Solve -n - 6 = -xr + 12, -2n + 5r - 21 = 0 for n. -3 Let s(m) = -2m*2 - 7m + 21. Let u be s(-7). Let n = 32 + u. Let j = 14 - n. Solve -b + y = -j, 4y + 32 = 12 for b. 5 Suppose 2z = 3r - z + 45, -2z = -10. Let g be r/(-65) - 192/(-104). Solve 0 = -gn + d - 1, 2n + 5d = 4 + 1 for n. 0 Let s be (-5 + 1)/20-15. Let g = 21 - -3. Solve -sn - 19 = -5y, -2y + g - 4 = 5n for n. 2 Let q be (-20)/14(-14 - 56/(-8)) + -4. Solve -3y = -qy - 2l, -l = -y for y. 0 Suppose 14 = 36m - 39m + 4v, 26 = 3m + 4v. Suppose 0 = j + ml - 9, 9l = 3j + 12l - 36. Solve 4p + 3s - 24 = s, 5p = 5s + j for p. 5 Let z = 4608 + -4604. Solve -2p + 3p + t = 1, 3p - zt = 31 for p. 5 Suppose -9w = 854 + 388. Let k = w - -140. Solve 5l - u - 5 = 0, ku - 1 = 9 for l. 2 Let w(j) = -j*2 + 17j - 16. Suppose 48z - 50z = -24. Let y be w(z). Let g = y + -41. Solve -5f = 2b - 7b + 10, -gb - 8 = 4f for f. -2 Let p be 28/(-6) + 3 - (-294)/63. Solve -2y = 4a - 5a + p, 5y + 4a = -1 for y. -1 Suppose -4j - 42 = -86. Solve -5l = 5v - 5, l + j = v + 4 for v. 4 Suppose -21r + 810 = -3r. Suppose r - 49 = p. Let m be (-18)/p - 0 - 29/(-58). Solve i = -5h - 1, 5i - h + 5h + m = 0 for i. -1 Suppose 3f - 126 = 131 - 245. Solve -3c - 7 + 2 = -fq, q = -2c - 7 for q. -1 Suppose 0 = 2u - u + 2w + 4, 0 = -u - 3w - 6. Suppose 2285k - 3663 = 2186k. Solve u = 3q - 5o - k, 0 = 5q + 2o + 3 - 13 for q. 4 Suppose 0 = 2x - 5x + 12. Let q be 1/((-3)/(-18)) - 10. Let t be 0 - ((-25)/x - q/16). Solve -4c + 3p - t = 0, 0 = 3c - 4p + 1 for c. -3 Let b = 3959 - 3944. Solve -2f = -2l - 3f + b, 5l - 50 = -5f for l. 5 Suppose h - 5h = 8h. Suppose 31m - 29m - 60 = h. Solve 2l = -5i - 19, -5l + 3i + m = -0l for l. 3 Let i(b) = -10b + 231. Let v be i(27). Let u(m) = 2m2 + 80m + 89. Let y be u(v). Solve 3k - 4r - 15 = 0, -5r - y = -2k + 6 for k. 1 Suppose 2k - 83 = -5j, j + 0k - 23 = -2k. Let g(m) = m*2 + m - 12. Let d be g(-4). Solve d = -2l - u + j, 4l - u - 12 = 3 for l. 5 Let w be 13 + -2 + 1 - (-150 - -154) - -4. Solve 1 = -g, 15u - wu - 9 = -3g for u. 4 Suppose 0 = 2g + 6n - 62, 4g + 20 = 139n - 135n. Let m(c) = -5c*2. Let w be m(3). Let b = w - -77. Solve -2f - y - g = -3y, 0 = -4f - 4y + b for f. 3 Let c be ((-33)/(-22))/38/1. Solve -cb = -d + 19, 5d - 8 = -5b - 38 for d. -1 Suppose -2j + 6v = -19 - 31, -49 = -4j - 5v. Suppose w - 3 - 2 = 0. Suppose -wl + j = 11. Solve -2g = z - 3, -l - 16 = -3g + z for g. 4 Let w be (0 + 9)/((-2)/(-2)). Let x be (-3)/w - 20/(-6). Let i = -125993 + 125999. Solve -3u + 3 = -g + i, 0 = -5u + xg - 9 for u. 0 Suppose 0 = v + 4w - 18, -5w = -5v - 10w + 30. Solve x - 5 = -vn, -13 = -n - 5x + 8x for n. 4 Let b(x) = -6x2 - 178x + 1373. Let v be b(-36). Let u be (-2 + 5)(-19)/(-3). Solve -1 = -i - vw - 16, u = 3i - w for i. 5 Let y(l) = 447l + 1791. Let n be y(-4). Solve 5d - 50 = -5f, -nd = f + 2d - 30 for f. 5 Let s(b) = -378b - 11335. Let w be s(-30). Solve 11 = 130z - 132z - g, 2z = -wg - 31 for z. -3 Let n be 8 - 92/28 - (-4)/14. Suppose u = 3w - 2, 2w - 3u = 7 - 1. Suppose 2f + 2c = 4, f + wc = -4c + 8. Solve -m = -nz - fm, 4z - 5m = 0 for z. 0 Let w be (57/76)/(1/4). Let b be 1 - (4 - w) - -10. Solve 3s = s - 2o + b, 0 = -2s + 3o + 10 for s. 5 Let u be 2232/1240 - 1/2(-2)/5. Solve um - 16 = -3l, 0 = -2m - 3l + 8l - 16 for m. 2 Let c(b) be the third derivative of -b*6/120 - 5b*4/12 - 11b*3/3 + 132b*2. Let s be c(-2). Solve 4o = 4f + 4, f = -5o + s + 11 for f. 2 Let g(c) = -c + 25. Let z be g(-2). Suppose -15 = -3l - 3f, -29l + 3f = -zl. Solve -3k + 18 = -lv, -k = -3v - 5k - 11 for v. -5 Suppose -7x + 8 = 1. Let w(p) = 2p2 + 12p - 7. Let u = 24 + -31. Let z be w(u). Solve 4h + z + x = -4g, 0 = 3g - 5h - 18 for g. 1 Let n(s) = s*3 - 4s*2 + 3s + 3. Let x be n(3). Suppose 0 = -xc + 24 - 18. Suppose -2p - 5 = -9. Solve -pa + c = b, -3b + 2 = 2a + 2b for a. 1 Suppose -122 = -2o - 0o. Suppose -4g - 5 = -o. Suppose 9d - 37d + 11d = 48d. Solve f + 3l + 12 = d, 2f + g - 5 = -l for f. -3 Suppose -17p - 732 = -13p. Let z = p + 185. Solve 2o - z = -5v, 1 + 0 = o for v. 0 Let y = -1768 - -1776. Solve -s = 5i, 13i = 5s + yi for s. 0 Let a(b) = b2 - 10b - 69. Let k be a(-7). Suppose 34 = 14c - k. Solve -z = 2u + c, 3z = 3u - 7 - 2 for z. -4 Suppose -a - 16 = a + 4v, -v = 5a + 31. Let b be -1 - 122/a - (-4)/(-12). Suppose -23d + bd = -76. Solve 0 = g - 5z + d, -2g - z + 6 = -0g for g. 1 Let v be (0 - 0)(-6)/12. Let f = 175 + -334. Let r = -159 - f. Solve r = -4x + 4, 3x - 8 = -5a - v for a. 1 Suppose t - 14 = -24. Let p be -2t((-63)/(-12) - 5). Solve pf - r - 22 = 0, -5r + 5 + 5 = -f for f. 5 Suppose -6n + 2n + 7 = -q, 3q - 2n - 19 = 0. Suppose 67 = qs + 31. Solve -8 = -sl - 2u, 4u = -l + 2u - 4 for l. 4 Let t(m) = 2m2 + 24m + 4. Let p(y) = -y*2 - 12y + 16. Let v be p(-14). Let a be t(v). Solve 0 = 2r + 2s - 4s + 16, s = -ar - 7 for r. -3 Let b = -13599 - -13614. Solve 11q - bq = -j - 23, -5q = 4j - 34 for j. 1 Let t = -70 - -64. Let h be ((-4)/(12/9))/(t/4). Solve 30 = ho + 5n + 5, 3n = -4o + 29 for o. 5 Let h = -8326 - -8342. Solve hz - 11z - 50 = -5o, 0 = -5z + 2o + 15 for z. 5 Let o be (1 + (-15)/6)/((-3)/(-8)). Let d be 3 - (o + 1)(-4)/(-3). Suppose -5 = -5b + 15. Solve 3u - du = -12, by = u + 1 for y. 1 Suppose -2x = -7 + 1. Suppose 3c = -2c - xu - 42, 2c + 24 = -3u. Let q(r) = r + 11. Let m be q(c). Solve l - 7 = -4y, -6 - 9 = -5y + ml for y. 2 Let q be (93 - 95)15/(-6). Solve -q*j = -n	{ "pile_set_name": "DM Mathematics" }
+ 10. Let b(k) = -26k3 + 6k*2 + 38k - 8. Let r(h) = 5b(h) + 6q(h). Let s(v) = v*3 - v + 1. Calculate r(i) - 20s(i). 12i3 Let f(b) = 13b*2 - 18b - 1. Let o(h) = 7h2. Determine -f(d) + o(d). -6d*2 + 18d + 1 Let j(q) = -2q3 - 4q. Let d(k) = -4k. Let y(s) = 3s. Let n(m) = -4d(m) - 5y(m). Determine -j(t) - 4n(t). 2t*3 Let a(c) = 5c - 248. Let v(t) = -6t + 250. What is 5a(l) + 4v(l)? l - 240 Let s(i) = -3i*2 + 2i - 57. Let y(d) = -3d2 + 2d - 57. What is 6s(p) - 5y(p)? -3p2 + 2p - 57 Let o(n) = 4n. Let a(k) = -21k. Let x(l) = l*2 - 11l + 3. Let q be x(11). Give qa(t) + 14o(t). -7t Let j(c) = -246c*2 + 242c*2 - 2c + 5c - c. Let q(z) = 3z*2 - z. Determine 2j(b) + 3q(b). b2 + b Let h(w) = -45w + 198. Let d(q) = 28q - 132. Determine 8d(f) + 5h(f). -f - 66 Let z(x) = 5x - 14. Let w(y) = 9y - 30. Calculate -6w(a) + 13z(a). 11a - 2 Let h(c) = -15c - 15. Let u(q) = 4q*2 + 37q + 34. Let w be u(-8). Let m(j) = -7j - 7. Determine wh(n) + 13m(n). -n - 1 Let u = 27 + -30. Let w(y) = 4y + 1. Let l(v) = 5v + 2. Suppose 5z = 3m + 24 - 120, z - 4m + 9 = 0. Let t = z + 25. Give tw(d) + ul(d). d - 2 Let y(c) = 32c - 2. Let b(i) = 16i - 1. Calculate 5b(a) - 2y(a). 16a - 1 Let p be (-3)/2 + (-119)/34 + 7. Let r(d) = -d2 - d - 1. Let j(u) = -3u*2 + u + 1. Give pr(h) + j(h). -5h2 - h - 1 Let f(u) = u2 - 2. Let z(x) = -5 + 1 + 3. Suppose 2k + 5w - 18 = 9, -4w = -20. Calculate kf(l) - 2z(l). l2 Let n(a) = -a2 - 128a. Let o(j) = -4j*2 - 382j. Give 7n(g) - 2o(g). g*2 - 132g Let a(d) = -5d + 11d - 10 - 3d. Let p(o) = 2o - 5. Let n(v) = -4a(v) + 7p(v). Let y(k) = -1. What is n(x) + 4y(x)? 2x + 1 Let y = 10 + -6. Suppose 2j + 6 = yj. Let h(v) = -3v - jv + 8v. Let t(n) = -n. Give -2h(f) - 2t(f). -2f Let o(n) = -n*2 + n + 1. Let m = -13 - -8. Let s(c) = 5c*2 - 8 + 5 - 7c - 6 + 2c3 + 4. Give mo(q) - s(q). -2q3 + 2q Let v(h) = 11h + 14. Let x be -2 - (-3 + 0 - 4). Suppose 4r + 3 = xr. Let y(q) = 4q + 5. Let d = 49 + -57. What is dy(c) + rv(c)? c + 2 Let v(g) = -g - g + 0g3 - 2 + g2 - g3. Suppose -5j = -10j + 10. Let h(q) = jq - 2q2 + 3q + 0 + 2q3 + 5 + 0q. Determine -2h(p) - 5v(p). p3 - p2 Let i(n) = -3n2 - 7n - 1. Let z(l) = -8l2 - 20l - 4. Determine -17i(v) + 6z(v). 3v2 - v - 7 Let c(y) = -16y + 2. Let v(b) = 43b - 49. Let o(g) = 14g - 18. Let l(a) = 8o(a) - 3v(a). Determine 3c(i) - 2l(i). -14i Let t(z) be the second derivative of z3/2 + 3z*2/2 + 2z + 13. Let l(g) = 5g + 6. What is 6l(y) - 11t(y)? -3y + 3 Let f be 4 + (-76)/(-4) + -1. Let z(j) = j - 1. Let u(a) = -10a + 10. Determine fz(c) + 2u(c). 2c - 2 Let c(g) = 4g3 + 7g2 - 7. Let o(a) be the second derivative of -a5/10 - a*4/4 + 2a*2 + 25a. What is 3c(q) + 7o(q)? -2q3 + 7 Let n(o) = -4o. Let f(p) = -11p - 1. Let g = -321 - -329. Determine gn(i) - 3f(i). i + 3 Let t(p) = 2p*2 - 5p. Let b be (0 - -5)12/15. Suppose 2m - 24 = -4w, -m + 10 = -3w + bw. Let x(r) = -3r*2 + 8r. Calculate mt(f) + 5x(f). f*2 Let g(h) = -2h + 4. Let b(t) = -91. Let z(k) = -18. Let j(q) = -b(q) + 5z(q). Calculate g(d) - 6j(d). -2d - 2 Let v(o) = 6o + 2. Suppose g + 375 = 6g. Suppose 3h + 81 - g = 0. Let a(q) = 24q + 9. Calculate ha(u) + 9v(u). 6u Let x(d) = -d + 1. Let k(v) = -4v + 1. Suppose -30 = -5p - 35. Let j(q) = q*3 + 2q*2 + q + 1. Let i be j(p). What is ix(s) - k(s)? 3s Let l(k) = -87k*3 - 5. Let m(v) = -260v*3 - 14. Calculate 17l(t) - 6m(t). 81t*3 - 1 Let q(s) = -3s*3 + 6s*2 + 4s. Let u(x) = x*3 - x. Suppose -4m + 2g + 24 = 0, 0g - 24 = -5m + g. Give mu(j) + q(j). j*3 + 6j*2 Let t(m) = 6m*3 + 5m*2 - 4m - 5. Let y(s) be the first derivative of -9s4/4 - 8s*3/3 + 3s*2 + 8s + 28. Determine -8t(q) - 5y(q). -3q3 + 2q Let f(o) = 3o2 + 15o - 4. Let m(d) = 4d2 + 14d - 5. Determine 6f(v) - 5m(v). -2v2 + 20v + 1 Let j(b) be the second derivative of -5b4/12 - b3/2 - 3b*2 - b + 22. Let g(l) = 4l*2 + 2l + 5. Give 3g(f) + 2j(f). 2f2 + 3 Let i(f) = 21f. Let h(j) be the third derivative of j*4/8 - 174j*2. Determine -15h(p) + 2i(p). -3p Let a(s) = -6s. Let j(y) = -68y - 1. Determine -10a(r) - 2j(r). 196r + 2 Let y(c) = c3 - 4c*2. Let q be 3/(-9) + (-14)/(-6). Let k(m) = 66m*3 - 18m*2 + 7m*q - 64m*3. Let p = 14 - 22. Give py(x) + 3k(x). -2x3 - x2 Let h(b) = 5b + 7. Let t(g) = g. Determine -2h(l) + 14t(l). 4l - 14 Let c(k) = -57k + 41. Let w(s) = -86s + 58. What is -7c(j) + 5w(j)? -31j + 3 Let y = 2314 - 2475. Let k(x) = 28x*2 - 5x. Let o(s) = -897s2 + 161s. Give yk(u) - 5o(u). -23u2 Let p be 2/9 + 32/18. Let b(x) be the first derivative of -x3/3 + 2x*2 - 4x + 366. Let h(g) = g*2 - g + 1. Give ph(d) + b(d). d*2 + 2d - 2 Let z(u) = -732 - 734 + 1466 - u. Let w(i) = 16i. Give 4w(x) + 56z(x). 8x Let m(f) = -299f3 + 4f*2 - 4f + 4. Let j(p) = -p3 - p2 + p - 1. What is 4j(w) + m(w)? -303w*3 Let a(s) = -391 + 9s + 7s2 + 766 - 2s*2 - 383. Let l(k) = -10k*2 - 17k + 15. Calculate 11a(j) + 6l(j). -5j2 - 3j + 2 Suppose 3c - 23 = 4o, 5o + 0c = -2c - 23. Let p(s) = -2s + 2. Let n(a) = -2a + 3. What is op(j) + 4n(j)? 2j + 2 Let s(y) = -7y3 - 10y*2 - 19y - 13. Let u(n) = 4n3 + 5n*2 + 10n + 7. Give -6s(m) - 11u(m). -2m3 + 5m*2 + 4m + 1 Let r(d) = -11d2 - 8d + 182. Let x(m) = 7m2 + 5m - 121. Give -5r(a) - 8x(a). -a*2 + 58 Let m(r) = 5r + 5. Let x(i) = 48 + 45 - 2i + 44 + 49 - 189. What is -3m(n) - 7x(n)? -n + 6 Let b(m) = -m2 + m. Let r(u) = -5u*2 - 10u - 4. Let z(a) = -3b(a) - r(a). Suppose -520 = -2n - 522. Let l(o) = -o*2 - o - 1. What is nz(g) - 6l(g)? -2g*2 - g + 2 Let j(z) = -4z*2 - z - 3. Let y = 6 + 1. Let g be (1 - 2)-3 + 2. Suppose -n = -2o - 1, 0o + gn + y = -2o. Let q(d) = d*2 + 1. Calculate oj(l) - 3q(l). l2 + l Let o(y) = -6y - 22. Let w(u) = u. Give -o(g) - 12w(g). -6g + 22 Let p(y) be the third derivative of -y*4/24 + 3y*3/2 + 7y*2. Let i(j) be the first derivative of -j - 1. Let o be (-2 - -5)/6-36. What is oi(h) - 2p(h)? 2h Let r be 35/3 + (-6)/9. Let n(w) = -11w - 6w + rw - 8. Let z(o) = 2o + 3. Calculate 3n(b) + 8z(b). -2b Let x(f) = -17875f2 + 165f. Let l(g) = 436g2 - 4g. Give -165l(z) - 4x(z). -440z2 Let h = -561 + 560. Let y(j) = -4j - 1. Let k(o) = o - 1. What is hk(w) + y(w)? -5w Let t(i) = i2 - 9. Let q be ((-18)/(-10))/((-84)/(-140)). Let x(a) = a2 - 4. Give qt(v) - 7x(v). -4v2 + 1 Let m(h) = -14h*2 + 9h + 13h2 - 8h + 1. Let k(g) = -5g2 + 5g + 5. Give -k(t) + 3m(t). 2t*2 - 2t - 2 Let s(c) = -5c + 4. Suppose 96j = 84j - 36. Suppose 2 + 2 = d. Let h(n) = -6n + 5. What is ds(g) + jh(g)? -2g + 1 Let f(c) = 10c - 4. Let u(p) = 45p - 201. Let l be u(4). Let q(b) = 49b - 21. Calculate lf(j) + 4q(j). -14j Let k = 65 + -66. Let m(a) = -3a - 1. Let b(c) = -c. Give kb(s) - m(s). 4s + 1 Let a(h) = -h*2 - h + 1. Let u be 18/(-30) + (-264)/(-40). Let s(i) be the first derivative of -u - 1/2i*2 - 1/3i*3 + 2i. Determine 3a(k) - s(k). -2k*2 - 2k + 1 Let x be (-147)/(-27) + (-10 - (-688)/72). Let l(h) = -h*3 - 3h*2 - 3h + 2. Let r(t) = t*3 + 5t*2 + 5t - 4. What is xl(n) + 3r(n)? -2n3 - 2 Let a(d) = 2d + 6. Let o(t) = 7t2 - t + 1. Determine a(k) + 2o(k). 14k2 + 8 Let d(x) = 7x - 78. Let v be d(12). Let h(q) = -2q3 + 3q*2 - 3q. Let w(c) = -25c3 + 35c*2 - 35c. Give vw(o) - 70h(o). -10o3 Let v(a) = -a3 + a2. Let m(k) = 36k*3 + 6k*2 + 2. Give -m(h) + 6v(h). -42h3 - 2 Let i(k) = -k - 1. Let n(z) = -z. Let r = 2077 + -2076. Suppose 2 = -0p - p. Calculate pn(u) + ri(u). u - 1 Let r(t) = 8t2 + t + 1. Let f(x) = 46x*2 + 6x + 37. What is -f(b) + 6r(b)? 2b*2 - 31 Let f(o) = -o + 4. Let c(q) = q - 2. What is 4c(m) + 9f(m)? -5m + 28 Let s(y) = 2y2 + y. Let t(x) = 8x*2 + 3x + 3. Let j(q) = 3s(q) - t(q). Let o(z) = -2z*2 - 4. What is 5j(v) - 4o(v)? -2v*2 + 1 Let k(u) = -4u*3 - 3u**2 + 3. Let h be (-250)/8 + 2/8. Let d = -34 - h. Le	{ "pile_set_name": "DM Mathematics" }
r) = r. Give t(c(k)). k*2 Let u(i) = 2i. Let q(t) = -8t2 + 103. What is u(q(f))? -16f*2 + 206 Let w(c) = -c. Let o(h) = 7 + 4h - 7 - 5h. Calculate w(o(l)). l Let k(l) be the second derivative of 2l + 0l2 - 1/6l3 + 0. Let g(p) be the second derivative of p3/6 + p. Calculate k(g(d)). -d Let z(b) = -2b2. Let o(u) = 2u*2 + 184. Calculate o(z(t)). 8t*4 + 184 Let q(m) = 3m2 + m2 - 5m2. Let x(l) be the second derivative of 0l*2 + 0 - 5/6l*3 - 2l. Calculate x(q(k)). 5k2 Let n(f) be the third derivative of -f5/15 + 2f*2. Let a(l) be the first derivative of 3l*2/2 - 3. Give n(a(k)). -36k*2 Let y(i) = i. Let p(m) = -246m*2. What is y(p(z))? -246z*2 Let v(a) be the second derivative of -8a*3/3 + 16a. Let h(o) = -o. Give v(h(n)). 16n Suppose 3m - 14 = 1. Let f(s) = 10s + 7s - ms - 3s. Let g(l) = -l. What is f(g(b))? -9b Suppose 0 = 3l + 2l - 15. Let n(k) be the second derivative of 0k*l + 0k*2 + 1/6k*4 - k + 0. Let q(w) = -2w. What is n(q(b))? 8b2 Let u(i) = 0 + 0 - i. Let z(c) = -7c. Let h(n) = -48n. Let w(p) = 4h(p) - 27z(p). Determine w(u(q)). 3q Let a(i) = -i2. Let s(g) = g2 + 6g - 113. Calculate s(a(f)). f4 - 6f*2 - 113 Let i(n) = -101n*2 - 6. Let r(m) = -3m. Give r(i(z)). 303z2 + 18 Let n(i) = -4i2. Let a(m) be the second derivative of m3/3 + 7m. What is a(n(t))? -8t*2 Let m(r) = 92r + 12. Let b(a) = 4a2. Give m(b(v)). 368v*2 + 12 Let y(m) = 2m. Suppose 0w - 8 = -4w. Let u(i) = -1 + 1 + 7i2 - wi*2. Give y(u(d)). 10d*2 Let v(g) = g + 2. Let r(j) = -4j - 11. Let n be 6/(2 - 8/2). Let a be 3/(27/6)n. Let y(d) = ar(d) - 11v(d). Let h(z) = -2z. What is y(h(l))? 6l Let x(z) = 25z*2 - 36z*2 + 15z*2. Let u(i) = 20i. Give x(u(f)). 1600f2 Let d(r) = -r. Let b(l) be the first derivative of 5l*3 - 14. Calculate d(b(m)). -15m*2 Let g(d) = -d. Let m(n) = 7n - 59. What is m(g(k))? -7k - 59 Let y(j) = -4j*2 - 3. Let p(x) = 16x. Calculate p(y(k)). -64k2 - 48 Let m(d) = -4366d*2. Let x(q) = -3q. Determine m(x(j)). -39294j2 Let l(h) = -h. Let i(q) = 43 - 22 + 3q*2 - 21. Calculate i(l(p)). 3p2 Let b(g) = g2. Let h(y) = -2813y. Give h(b(u)). -2813u*2 Let p(a) = -a. Let l(n) = 3122n. Give p(l(f)). -3122f Let h(j) = j2. Let r(n) = -19n*2. Let s(b) = 38h(b) + r(b). Let z(c) be the second derivative of -c*3/3 - 4c. Calculate z(s(y)). -38y2 Let c(o) = 2o*2 - 21. Let i(j) = -36j. Give i(c(n)). -72n2 + 756 Let v(z) = 2z. Let g(l) be the second derivative of 0 + 0l2 + 0l*3 + l - 5/12l*4. Calculate g(v(o)). -20o*2 Let m(j) = 22j. Let q(s) = 34s2. Calculate m(q(i)). 748i*2 Let d(o) be the third derivative of 0 - 1/24o*4 + 8o*2 + 0o + 0o3. Let m(w) = -2w. Determine m(d(u)). 2u Let h(y) = -5y + 7y + 6y + 12y. Let z(w) = -2w*2. What is z(h(m))? -800m*2 Let s(i) = 5i. Let x(w) = w*2 + 6w - 6. Let m be x(-5). Let q(z) = -4 + 4 - 3z. Let d(n) = mq(n) - 6s(n). Let h(f) = 2f*2. Determine d(h(r)). 6r*2 Let y(d) = 4d - 6 - 15d + 6. Let u(j) = 9j*2. Give y(u(t)). -99t2 Let q(h) be the third derivative of -h4/24 - 12h2. Let z(p) = -63p. Calculate q(z(u)). 63u Let r = 8 - 5. Let u(p) = -3 - p + r. Let a(g) be the third derivative of -g5/20 - 14g*2. Calculate u(a(k)). 3k*2 Let v = 8 - 5. Let g(x) = -2x*2 - 6x*2 + 2x*2 + vx*2. Let s(m) = 0 + 0 + 2m. Give s(g(j)). -6j2 Let d(k) = 7. Let r(b) = 20. Let f(x) = 17d(x) - 6r(x). Let q(v) = 3v*2 - 15. Let w(m) = -15f(m) + q(m). Let y(p) = -156 + 156 + 2p. Calculate w(y(i)). 12i*2 Let u(g) = -g. Suppose 0 = -5w + 3w - 8. Let t(z) be the first derivative of 15z*2/2 - 2. Let c(i) = 7i. Let x(v) = wt(v) + 9c(v). Calculate u(x(b)). -3b Let f(c) = 4c*2. Let r(a) = 7a + 6a - 16a. What is f(r(t))? 36t2 Let r(p) = -p2. Let j(u) = 5u*2 - 6. Suppose -4i - 19 - 1 = 0. Let w(v) = 4v2 - 5. Let s(t) = ij(t) + 6w(t). Give r(s(c)). -c4 Let m(k) = -25k. Let r(o) = 10o. Calculate r(m(b)). -250b Let b(h) = -911h. Let i(g) = 4g*2. Calculate i(b(k)). 3319684k*2 Let x(c) = 6 + 4c - 12 + 6. Let d(k) = 2k2. Let g(f) = -5f*2. Let n(z) = 11d(z) + 4g(z). What is x(n(t))? 8t*2 Let g(b) = -11b. Let v(w) = -39w - 3. Determine g(v(n)). 429n + 33 Let n = -167 - -167. Let f(v) be the second derivative of 0v2 - 5/12v*4 + 0v*3 + 4v + n. Let d(l) = -l. Give d(f(k)). 5k2 Let o(h) = 16h*2 + 19h*2 - 37h*2. Let z(p) = -25p*2. What is z(o(u))? -100u*4 Let y(b) = 7b - 5b + 0b. Let z(p) = -p*2. Calculate y(z(u)). -2u*2 Let w(k) = -k. Let o(b) = 105b*2 + 14b. Let j(u) = -35u2 - 5u. Let r(q) = -14j(q) - 5o(q). Calculate w(r(s)). 35s2 Let r(j) = -16j. Let x(s) = 870s. What is r(x(n))? -13920n Let n(r) = -5r2. Let i(h) = 7189h. Calculate n(i(a)). -258408605a2 Let j(k) = 2k*2. Let o(q) = 469q. Give o(j(p)). 938p2 Let g(i) = -2i*2. Let a = 2/17 + 13/34. Let p(y) be the first derivative of 2 + ay*2 + 0y. What is p(g(k))? -2k2 Let t(i) = 2i*2. Let y(g) = 12g - 5. Let f(l) = -l + 1. Let v(a) = f(a) - y(a). What is v(t(m))? -26m2 + 6 Suppose 0 = -3n + 2z + 8, 2z = 4n - 0 - 10. Let b(y) = 10y - 13y + 2y*n + 3y. Let u(q) = 2q. What is b(u(g))? 8g*2 Let g(y) = 1447y*2. Let x(h) = h. Give x(g(w)). 1447w*2 Let k(d) be the second derivative of 2d*4/3 - 19d. Let r(i) = 2i2. Determine k(r(n)). 32n*4 Let f(b) = -2377b*2. Let x(i) = 3i*2. Determine x(f(h)). 16950387h*4 Let j(a) = 6a. Let f(v) = 2v. Let u(t) = -8f(t) + 3j(t). Let q(d) = -d2 - 5d. What is q(u(l))? -4l2 - 10l Let x(y) = 4y - 5y + 86 - 86. Let s(j) = -6j. Give s(x(p)). 6p Let b(h) = -191h2 + 2h - 1. Let m(d) = d. What is b(m(v))? -191v2 + 2v - 1 Let v(n) = 214n2. Let w(t) = 9t*2. Give v(w(l)). 17334l*4 Let n(a) = 9a*2 - 5a. Let o(v) = 7v. Determine n(o(q)). 441q*2 - 35q Let t be 3/(-9) + 2/6. Let a(s) = -s + s - s + t. Let r(f) = 3f2 + 4f + 4. Let n(j) = -2j2 - 3j - 3. Let b(g) = -4n(g) - 3r(g). What is a(b(o))? o*2 Let o(j) = -5j. Let p(s) = -s3 + s - 2. Let k be p(-2). Let g(b) = -k - b2 + 3 + 1. Determine o(g(x)). 5x2 Let x(p) = -3p. Let k(i) = 43i2. Give x(k(r)). -129r*2 Let k(j) = 24j. Let v(h) = 2h2 - 29h. Calculate k(v(y)). 48y2 - 696y Let u(x) = -26x. Let t(z) = 4z*2 + 12z*2 - 17z*2. What is u(t(b))? 26b*2 Let u(g) = 7g - 3. Let d(h) = -76h + 32. Let v(f) = 3d(f) + 32u(f). Let i(q) = -2q. What is i(v(l))? 8l Let h(p) = 2p. Let n(z) = 3z2 - 19z + 19z. Let j(t) = t2. Let f(s) = 5j(s) - 2n(s). Calculate h(f(v)). -2v2 Let q(a) = a2. Let z(d) = 35d2. Determine q(z(m)). 1225m*4 Let b(l) = 2369l*2. Let m(i) = -4i*2. What is b(m(z))? 37904z*4 Let i(a) = -50a. Let j(b) = -2b. Give i(j(o)). 100o Let g(y) = 0 + y*2 + 0. Let q be (0(-2)/(-4))/(-3). Let t(n) = -n*2 + qn*2 - 2n*2. What is g(t(l))? 9l*4 Let z(t) be the third derivative of 0 + 0t - 1/8t4 - 3t*2 + 0t3. Let m(x) = x2. Calculate z(m(q)). -3q2 Let m(c) = -6c*2. Suppose 0 = v - 4i + 5, -2v - 3i + 12 = -0v. Let n(o) = 2o - 3. Let g(y) = -3y + 4. Let z(d) = vg(d) + 4n(d). Calculate m(z(p)). -6p*2 Let p(g) = -340g*2 - 119g. Let n(y) = 17y2 + 6y. Let j(o) = -119n(o) - 6p(o). Let f(l) = 2l. Give j(f(v)). 68v2 Let w(j) be the third derivative of j4/24 - 30j2. Let m(c) = -12c*2. Give w(m(b)). -12b2 Let n(y) = -y2 - 12y + 19. Let d be n(-13). Let x(q) = -dq + q + 5q - 2q. Let p(f) = -2f2. What is p(x(b))? -8b2 Let p(b) = -b2. Let m be 0/(-1 + 5 + -3). Let d(a) = 2a2 - a2 + ma2. What is d(p(h))? h4 Let r(w) be the third derivative of -w5/15 - w3 + 28w2. Let u(m) = -m2. Calculate r(u(s)). -4s*4 - 6 Let v(j) = 2j - 1. Let l(t) = -11t + 5. Let n(f) = l(f) + 5v(f). Let p(x) = 2x2. What is n(p(w))? -2w*2 Let c(g) = -171g*2. Let l(j) = -17j*2. Let n(r) = 2c(r) - 21l(r). Let v(o) = 2o*2. Give v(n(u)). 450u*4 Let z(x) = -3x. Let p(v) be the first derivative of -7v2/2 + 30. What is z(p(r))? 21r Let m(r) = 2r. Let v(g) = 14g - 5. Let n(a) = -69a + 24. Let t(z) = 5n(z) + 24*v(z	{ "pile_set_name": "DM Mathematics" }
third derivative of 8 + 0j7 + 1/2j*3 + 0j*5 + 0j*6 - 3/56j*8 + 1/12j*4 + 0j + 2j2. What is the second derivative of s(o) wrt o? -360o*3 Let y be (2 + 147/(-35))-5. Find the third derivative of t - t*6 - 11t*4 - yt*4 - 13t*2 + 0t + 46t4 wrt t. -120t*3 + 576t Let w(c) = -c*2 - 42c - 169. Let b be w(-5). What is the third derivative of -ba3 - 33a*2 - 4a - 24a3 + 4a + 3a4 wrt a? 72a - 240 What is the second derivative of -1029t + 2025t*3 - 1209t - 444t - 916t - 269t wrt t? 12150t Let j = 13 - 8. Suppose 7 - 52 = -5x. What is the second derivative of 2u + 138 - 138 + xuj wrt u? 180u*3 Let z be 4(-4 + 7) - (1 - -3). Find the third derivative of -zy2 - 2y*4 + 21y*4 - 9 + 10y2 + y2 - y*6 wrt y. -120y*3 + 456y Let j = 74 + -30. What is the derivative of 11 - 10o3 + 85o*2 - jo*2 - 24o*3 - 43o*2 wrt o? -102o*2 - 4o Find the third derivative of -893496j + 893496j + 88j2 - 1854j*5 + 4 - 3 wrt j. -111240j*2 Suppose 21 - 5 = -a. Let u be (1 + 52/(-4))12/a. Find the second derivative of -q*3 - uq + 15q3 + 0q - 2q wrt q. 84q What is the third derivative of -1975j + 994j - 935j4 - 114j*2 + 983j wrt j? -22440j Let g(t) be the first derivative of -55t*7/7 + 28t*5/5 + 16t*3 - 79t + 2562. Find the third derivative of g(j) wrt j. -6600j3 + 672j Let s(c) be the second derivative of -c*4/6 - 93c*3 - 889c*2/2 - 1724c. Find the first derivative of s(v) wrt v. -4v - 558 Let r = -11 - -21. Let x be (-366)/(-10) + r/25. What is the second derivative of 23b + 58b - 5b*4 - xb wrt b? -60b2 Let b(c) = -2c*3 - 2c*2 + c. Let u(i) = 19i*3 + 1221i*2 - 11i - 1493. Let o(x) = 8b(x) + u(x). What is the second derivative of o(r) wrt r? 18r + 2410 What is the third derivative of 3688q3 + 1136q*3 + 160363q*2 - 160364q*2 + 56q wrt q? 28944 Let i = 338 + -303. What is the derivative of 18 - 2 - 75b - 27 - i - 46 wrt b? -75 Let t = -68 + 72. What is the third derivative of -3 - 18n*2 - 4n*t + 4 + 15n*2 - 3 wrt n? -96n Let k(u) be the first derivative of -266u2 - 1265u - 253. Find the first derivative of k(c) wrt c. -532 What is the third derivative of 2828z3 + 58 + 93z*2 + 4944z*3 - 164z*2 + 62z*2 + 51z*2 wrt z? 46632 Let i(q) be the first derivative of -1601q*5/5 + 1027q + 274. What is the first derivative of i(k) wrt k? -6404k3 Let g(c) be the third derivative of 7c5/30 + c4/24 + 9c3 + 74c*2. Let b(m) be the first derivative of g(m). What is the derivative of b(y) wrt y? 28 Let i be -3 + 3 + -3 - (-200)/25. Let j(y) = -2y - 1. Let z be j(-3). Find the second derivative of 11kz + 8k - 276 + 276 + ik wrt k. 220k*3 Suppose 95v = 90v - 445. Let n = v + 91. Find the second derivative of 8d*n + 14d*2 - 20d + 2d2 - 7d*2 wrt d. 34 Suppose 8q + 38 - 334 = 0. Suppose -14i + 187 = -q. Differentiate -5 + 48u*2 + 2 + 20 + i with respect to u. 96u What is the second derivative of 9478r3 + 673r - 519r5 - 9478r*3 wrt r? -10380r*3 Let p(g) = -4301g - 6630. Let b(t) = -2867t - 4391. Let k(u) = -7b(u) + 5p(u). Differentiate k(o) with respect to o. -1436 Find the second derivative of -4019x*3 + 4926x - 1 - 2 - 2018x + 3 wrt x. -24114x Let q(n) = 1508n3 - 10n*2 + 6982n. Let k(x) = -755x3 + 4x*2 - 3491x. Let t(l) = -5k(l) - 2q(l). What is the second derivative of t(r) wrt r? 4554r Find the second derivative of -54627d*2 + 54627d*2 + 21 + 3375d*4 - 21 + 1979d wrt d. 40500d2 Find the second derivative of 496 - 239r - 221r + 461r + 2063r2 wrt r. 4126 Let u(m) be the third derivative of -137m*7/30 - 1033m*5/60 - 511m*2. What is the third derivative of u(g) wrt g? -23016g Let d be ((-6)/(-14))/1 - (-462)/294. What is the third derivative of -9n6 - n4 - 7n3 + n4 + 3n6 + 13n*2 - dn - 5n2 wrt n? -720n*3 - 42 Let d(r) = 78r - 48. Let o = 531 - 537. Let p(u) = 2. Let t(l) = op(l) + d(l). What is the first derivative of t(s) wrt s? 78 Suppose 0 = -h + 2 + 14. Suppose -2p - 6p = -h. What is the derivative of x2 + 5 - 2 + 16x*2 - p wrt x? 34x Suppose u - 1 = -3j - 4u, 4j - 5 = -3u. Find the third derivative of 167x4 + 198x*4 + 93x*j - 245x*4 + 2 wrt x. 2880x Suppose -g - 5 = 4p - 16, -g = -p - 1. Let s be 2/(4/(-30))-9. Find the third derivative of 11tp + 135 - s - 25t3 wrt t. -150 Let g(m) = m2 - 11m - 15. Suppose 0 = 5l - 87 + 22. Let p be g(l). Find the third derivative of -c*4 - 7c*2 - 2c*4 + 3c*4 + pc*6 wrt c. 1320c*3 Let x be -1(-168 - 2)56/70. What is the second derivative of -4 + 2 + 2i*3 + 177i*2 - xi*2 - 44i + 4 - 54i wrt i? 12i + 82 What is the third derivative of 0 + 0 - 576k2 + 564k*2 + 5 - 935k*3 wrt k? -5610 Let q(m) be the first derivative of 2544m*5/5 + 2m*2 - 984m - 6406. Find the second derivative of q(t) wrt t. 30528t2 Differentiate -281l*2 + 92l*2 - 1212l*2 + 783 with respect to l. -2802l What is the first derivative of 6848x3 + 5046 - 544509x*2 - 954x*3 + 544509x*2 wrt x? 17682x*2 Let o(s) be the second derivative of 145s4/3 - s3/3 - 68s2 + 14s + 37. Differentiate o(p) with respect to p. 1160p - 2 What is the derivative of -6428a - 1591 - 1292 - 1741 + 389 - 2728a wrt a? -9156 What is the second derivative of -207g + 753g2 + 1823g - 215g + 1045g*2 + 460g*2 wrt g? 4516 What is the first derivative of -2140d + 3336 + 552 + 1168 + 712 wrt d? -2140 What is the third derivative of 9k2 - 317 - 11k*2 - 1470k*4 + 79 + 907k - 907k wrt k? -35280k Let v(a) be the first derivative of 4/3a3 + 36a - a*2 + 59. Differentiate v(s) with respect to s. 8s - 2 Suppose 8s - 190 = 10. Suppose -59a - s = -64a. What is the first derivative of aw*3 - 60 - 5w*3 + 20 + 49w*4 wrt w? 196w*3 Let y = 267 - 163. Let w = 106 - y. Find the second derivative of 32o*3 + 97o*2 + 6o - 97ow wrt o. 192o Let d = 23 + -19. Find the second derivative of -5o + 4 - o4 - 20o*3 + 2o*d - 2 - 45o wrt o. 12o2 - 120o What is the third derivative of 10m2 - 6350m + 6338m + 5868m*6 + 620m*5 + 7 - 620m*5 wrt m? 704160m*3 Let a be (-16/6)/((-1)/3). Suppose 2v + v - 33 = 0. What is the derivative of a + v - 3 - 14t wrt t? -14 Let m(o) be the first derivative of 0o3 + 0o*4 - 119/5o*5 - 62 + 0o*2 - 16o. Differentiate m(d) wrt d. -476d3 What is the derivative of 413 - 3361t + 2813t - 5764t wrt t? -6312 Let m(j) be the third derivative of -2j2 + 0j*5 + 1/4j*4 - 7/24j*6 + 0j + 1/3j3 + 0. Find the second derivative of m(q) wrt q. -210q Let f(w) be the third derivative of -w*4/24 + 153w*2. Let g(h) = 209h + 196. Let o(d) = -2f(d) + g(d). What is the derivative of o(j) wrt j? 211 Let f(w) be the third derivative of -283w8/336 + w5/60 + 3w4/8 + 5w*3/3 - 5w*2 + 72. What is the second derivative of f(o) wrt o? -5660o*3 + 2 Let v(j) be the second derivative of 0j*4 + 0j*5 - 9/14j*7 + 0j*2 - 29/6j*3 - 155j + 2/15j6 + 0. What is the second derivative of v(y) wrt y? -540y*3 + 48y*2 Suppose 186 = 3v - 5c, -4v + c = -0c - 265. Find the third derivative of -39x*2 - x + 92x*3 + x - vx*2 - 6x*3 wrt x. 516 Let c(d) = -25d*5 - 5d*4 + 12d*3 - 1909d2. Let o(r) = r5 + r*4 - 2r*3. Let h(i) = c(i) + 6o(i). Find the third derivative of h(s) wrt s. -1140s2 + 24s Let t = -58 + 60. Find the third derivative of -l + l + 658lt - 634l*2 - 48l*5 wrt l. -2880l2 Let d(a) be the first derivative of a5/5 - 3a3 - 49a*2 + 2525a + 3087. What is the first derivative of d(q) wrt q? 4q3 - 18q - 98 Let f be 12/(-8)(-12)/9. Suppose -4v + k + 5 = fk, k + 13 = 5v. Find the third derivative of 23s3 - 541 - s3 + 541 + 25s*v wrt s. 132 Find the second derivative of 5838y*2 + 7013y*5 - 5838y*2 - 2815y wrt y. 140260y3 Let m(k) be the first derivative of -1517k*2/2 - 7002k - 3137. Differentiate m(h) with respect to h. -1517 What is the derivative of 0t2 + 2t*2 - 2083 - 225t*4 + 377t*4 + 236t*4 - 318 wrt t? 1552t*3 + 4t Let n(f) be the third derivative of -f*7/105 - f	{ "pile_set_name": "DM Mathematics" }
. -12x2 Suppose 0r = -7r + 42. Let l(q) be the first derivative of 2 + 0q + 1/6qr - q3 + 0q*4 + 0q*2 + 0q*5. What is the third derivative of l(c) wrt c? 60c*2 Find the second derivative of -1674s + 7s4 + 5s*4 + 1673s wrt s. 144s2 Let p(k) be the first derivative of k5/10 - 3k*2/2 - k - 1. Let x(h) be the first derivative of p(h). What is the derivative of x(n) wrt n? 6n2 Let m(g) be the first derivative of -g2/2 - 5g - 1. Let r be m(-6). Differentiate -2 - 2p*3 + 1 - r wrt p. -6p*2 Let q(y) be the second derivative of 3y + 0 + 0y5 + 0y*4 + 0y*3 + 1/30y*6 + 1/2y*2. What is the first derivative of q(m) wrt m? 4m*3 Suppose 2 + 4 = 3q. Find the second derivative of 2u - qu - 4u2 + 4u wrt u. -8 Let v(t) = 7t2 + 2t + 19. Let q(k) = -15k2 - 5k - 37. Let b(g) = -2q(g) - 5v(g). Differentiate b(s) wrt s. -10s Let m(v) = v2 - 7v + 9. Let x be m(6). Suppose -3p + xy = -3, 3p - 2y + 23 = 6p. What is the first derivative of 5l + 2l - pl - 2 wrt l? 2 Suppose -11 = -4o - 5c, 4o + 2c = 4c + 18. Suppose 0 = -x + ox. Find the third derivative of xy3 - 5y*2 + 2y*3 + 2y2 wrt y. 12 Let t(b) be the third derivative of -b6/40 + 13b3/6 - 16b*2. Find the first derivative of t(u) wrt u. -9u2 Let m(c) be the third derivative of c5/30 - 3c3 + 5c*2. What is the derivative of m(a) wrt a? 4a Let w(a) be the first derivative of a*6/15 - 5a*3/3 - 3a - 10. Let y(t) be the first derivative of w(t). Find the second derivative of y(d) wrt d. 24d2 Let m(i) be the third derivative of i6/24 + 7i*3/6 - 5i*2. What is the first derivative of m(o) wrt o? 15o*2 Let z(y) = 4y*4 - 6y*2 + 5y. Let b(c) = 4c4 - 7c*2 + 6c. Let h(a) = -5b(a) + 6z(a). Find the third derivative of h(q) wrt q. 96q Differentiate t2 + 21 - 43t*2 + 17 with respect to t. -84t Let a(q) = 20q3 + 12q2 - 1. Let k(x) = x3 - 1. Let u(j) = -a(j) + k(j). Find the third derivative of u(f) wrt f. -114 Let s = -19 - -28. What is the third derivative of 5g2 + sg*4 - 9g*4 + 2g*6 wrt g? 240g*3 Suppose -7 + 18 = l. What is the first derivative of -l - 2y + 2y + 2 - y wrt y? -1 Let s(m) be the first derivative of m6/40 - m4/8 + m2/2 + 3. Let j(q) be the second derivative of s(q). Find the second derivative of j(x) wrt x. 18x Let l(w) be the second derivative of -2w4/3 + w3/6 - 7w. What is the second derivative of l(i) wrt i? -16 What is the derivative of -4t - 13 - 5 + 2 + 1 wrt t? -4 Let y be (2/4 + -1)-14. What is the second derivative of 6g4 + 32 - 32 + yg + 0g wrt g? 72g2 Let q(g) be the first derivative of -g3 - 2 + g + 3g - 3g. Differentiate q(m) with respect to m. -6m Differentiate -7p*4 - p + 9 - 3p*4 + 42 - p wrt p. -40p*3 - 2 Let t(y) be the third derivative of 0y*6 + 0y*7 + 1/112y*8 + 0y*3 + 0y - 1/20y5 + 0y*4 + 2y*2 + 0. Find the third derivative of t(n) wrt n. 180n*2 Let l(b) = -6b*5 - 11b*2 + 5b + 5. Let j(p) = -5p5 - 11p*2 + 4p + 4. Let r(h) = 5j(h) - 4l(h). What is the third derivative of r(v) wrt v? -60v2 Let p(w) be the third derivative of 13w*7/105 + 9w*5/20 + 21w*2. Find the third derivative of p(r) wrt r. 624r Let a(q) be the first derivative of q*5/5 + 13q*3/3 - 5. Find the third derivative of a(f) wrt f. 24f Let i = 21 + -1. Suppose 3p - i = 28. Find the third derivative of -16o + po + o2 - 2o*5 wrt o. -120o*2 Differentiate -10x3 - 291 + x3 + 258 with respect to x. -27x2 What is the third derivative of -x4 - 2x*2 + 5x*4 - 13x*2 wrt x? 96x Suppose -5t = g - 25, -g - 2g = -3t + 15. Let d(n) be the second derivative of 5n + 0 + gn3 - 5/2n*2 + 1/6n*4. Differentiate d(v) with respect to v. 4v Let w be ((-16)/(-10))/((-4)/(-10)). Let n = w - 1. Find the second derivative of -s*3 + 6s*3 - 2s*n + s + 0s*3 wrt s. 18s Let w(x) = -x*2 - 4x. Let b be w(-2). Suppose 2z = -5 + 13. Find the first derivative of 1 + k4 + 0k*b + 0k*z wrt k. 4k3 Let r = 19 + -14. Differentiate -r + x + 6 - 8 wrt x. 1 Let m(d) be the second derivative of -d6/6 + 16d3/3 - 44d. What is the second derivative of m(u) wrt u? -60u2 Let u(k) be the third derivative of -k7/14 - k4/24 + 53k*3/6 - 11k*2. What is the derivative of u(v) wrt v? -60v3 - 1 Let y(x) be the second derivative of x5/10 + x*3/3 + 4x. What is the second derivative of y(v) wrt v? 12v Let l be (-3)/(4 - 1)(1 - 4). Let m(y) be the first derivative of -2y2 + 0y*l + 3 - 3/5y*5 + 0y + 0y4. Find the second derivative of m(z) wrt z. -36z*2 Suppose 3k - 196 = 7k. Let c be -7(-7)/(k/(-6)). Differentiate -2y2 - 4y*2 - 4 + cy*2 - 3y*2 with respect to y. -6y Let i(m) = -2m - 2. Let q be i(-2). Find the third derivative of -2f2 - f3 - 2f2 + qf*2 wrt f. -6 Suppose 3k + 4 - 13 = 0. What is the third derivative of 2m2 + km3 + m3 - 2m3 + 2m*2 wrt m? 12 Let i(v) = -4v*2 + 1. Let w(x) = 5x*2 - 2. Let a(h) = -2i(h) - 3w(h). Let p(o) = -o2. Let d(c) = -a(c) + 6p(c). Differentiate d(y) wrt y. 2y Suppose 0 = y - 4y + 15. Find the third derivative of 4t3 + 4t3 + t2 - yt2 - 3t*3 wrt t. 30 Differentiate z - 3 + 2z + 5z - 4z wrt z. 4 Suppose 0x = x - 2. Let r = 2 - x. Find the second derivative of rc*2 - 2c + 3c + 3c*4 + 0c*2 wrt c. 36c*2 What is the third derivative of 4r2 + r2 - r*2 + 5r*4 + 3r*2 wrt r? 120r What is the first derivative of 6 - 3 - 18r2 - 2 + 30r*2 wrt r? 24r Let l(n) be the first derivative of 7n - 3 + 0n*3 + 0n*4 - 9/5n*5 + 0n*2. What is the first derivative of l(s) wrt s? -36s3 Let w(l) be the second derivative of -l6/180 - l4/24 + l3/2 + 2l. Let u(s) be the second derivative of w(s). Differentiate u(c) with respect to c. -4c Let m(g) be the first derivative of -5g7/42 - 5g*3/6 + 2g + 3. Let h(q) be the first derivative of m(q). What is the second derivative of h(p) wrt p? -100p3 Let n be 0 - 2(-1)/2. Suppose 3k = -4d - 1, -4d - 2k + 4 = d. Differentiate 1 - d - n + v*2 wrt v. 2v What is the first derivative of -10 + 2 + 45w2 - 8 + 1 wrt w? 90w Let l(t) = -t - 4. Suppose -2 + 8 = -n. Let i be l(n). Differentiate -2 + 2 - id + 1 with respect to d. -2 Let v(s) be the second derivative of 7/6s*3 + 0s*4 + 0s*2 + 6s - 1/20s5 + 0. What is the second derivative of v(d) wrt d? -6d Let a(w) be the first derivative of -w8/1680 + w6/360 - 2w3/3 + 2. Let b(d) be the third derivative of a(d). What is the third derivative of b(k) wrt k? -24k What is the second derivative of -54 + 3i + 6i*4 + 54 wrt i? 72i2 Let g(x) be the third derivative of -x8/28 - x*4/4 + 13x*2. What is the second derivative of g(o) wrt o? -240o*3 Let v(t) = -5t + 24. Let y be v(4). Let q(n) be the third derivative of 0 - 2n2 - 1/2n*3 + 0n*y - 1/20n*5 + 0n. Differentiate q(d) with respect to d. -6d What is the derivative of -13f*3 + 12 + 15 - 5 + 6 wrt f? -39f2 Let l(t) = t3 + 4t2 + 2t + 26. Let n(q) = -2q3 - 5q*2 - 3q - 26. Let x(i) = -6l(i) - 4n(i). What is the derivative of x(y) wrt y? 6y2 - 8y Let v(n) = n + 4. Let b be 32/6 + 4. Let u(d) = d + 2. Let c(m) = bu(m) - 2v(m). What is the derivative of c(h) wrt h? 3 Suppose -4k - 5 = 5n, 0k + k = 4n - 17. Let p be 10/2 - (k + 4). What is the derivative of -2t*3 + 0 + 3 + 2 - p wrt t? -6t*2 Suppose 2f + 15 = 23. Find the first derivative of -c*3 - f + 3 - 5 wrt c. -3c*2 Differentiate -8z*2 + 0z*2 - 3z*2 - 4 + 0z*2 with respect to z. -22z Suppose 40 = 5c - 2j, -3 = 2c + 3j - 0. Find the third derivative of -3dc + d6 + d2 + d6 wrt d. -120d*3 What is the first derivative of -13 - 25 + 21b + 6 wrt b? 21 Find the second derivative of -13l3 + 5l*3 - 26l + 58l2 - 58l*2 wrt l. -48l Let k(f) = -10f4 - 2f + 2. Let u(s) = 11s4 + s2 + 3s - 3. Let l(m) = 3k(m) + 2u(m). Find the third derivative of l(i) wrt i. -192i Let m(a) be the first derivative of a3/2 - 2a*2 - 4a + 1. Let s(w) be the first derivative of m(w). Differentiate s(z) with respect to z. 3 Suppose 2p + 7 = 3p - 4*c, c =	{ "pile_set_name": "DM Mathematics" }
s in -20p3 + 10p*3 + 66p*3. 56p*3 Collect the terms in 68d*2 + 5 - 5 + 11648d - 11648d. 68d*2 Collect the terms in -9 + 8 - 2y + 20 - 4y. -6y + 19 Collect the terms in 32n2 + 33n*2 + 35n*2 - 100n*2 + 72n*3. 72n*3 Collect the terms in -2 + 747l*2 + 2l - 693l2 + 1362l*2 + 4. 1416l*2 + 2l + 2 Collect the terms in -165472 - 16n + 82723 + 82749. -16n Collect the terms in -38v3 + 40v*3 - 27v*3. -25v*3 Collect the terms in 57c*2 - 58c*2 + 29c*2 + 28c*2. 56c*2 Collect the terms in 325f - 166f + 1145 - 162f - 2280 + 1140. -3f + 5 Collect the terms in 3c + 632c3 + c - 626c*3. 6c*3 + 4c Collect the terms in -6966 + 6966 - 961d. -961d Collect the terms in 25u2 - 23u - 5u2 + 115u - 20u2 - u3. -u3 + 92u Collect the terms in 125476b3 - 125473b3 + b2 - b*2. 3b*3 Collect the terms in -34q*2 - 29q*2 + 102q*2 + 36 - 37q*2. 2q*2 + 36 Collect the terms in -100p*3 + 45p*3 - 75p*3 - 85p*3. -215p*3 Collect the terms in 8c*2 - 24c*2 + 30c*2 + 9c*2. 23c*2 Collect the terms in -3g + 0g + 7g - 4g - 2g. -2g Collect the terms in 20023y + 2359y - 4548y + 28109y. 45943y Collect the terms in 464o - 923o + 4 + 478o. 19o + 4 Collect the terms in -9756z - 11445z - 4152z + 2123z. -23230z Collect the terms in 1308z*2 - 78 + 78 - 1312z*2. -4z*2 Collect the terms in -654 - 652 - 53v*3 + 1306. -53v*3 Collect the terms in 96x + 3 - 4 - x*2 - 1 + 262x. -x*2 + 358x - 2 Collect the terms in -9144o + 40 - 40 + 9158o. 14o Collect the terms in 30 + 3j*2 - 33 - 48 - 47. 3j*2 - 98 Collect the terms in -5n*3 - 2700n*2 + 1832n*2 + 3n*3. -2n*3 - 868n*2 Collect the terms in 73g*2 + 56g*2 - 205g*2 + 68g*2. -8g*2 Collect the terms in -118t + 217 - 217 - 84t. -202t Collect the terms in 1089r2 - 13514r - 2r3 - 1089r*2 + 13514r. -2r3 Collect the terms in 24 - 49 + h + 25 - 960h*2. -960h*2 + h Collect the terms in -1 + 24k + 2 - 4. 24k - 3 Collect the terms in -648 - 20a + 648 - 30a + 13a. -37a Collect the terms in 15h + 3h - 24h - 11h3 + 3h*3. -8h*3 - 6h Collect the terms in 64k2 + 2k + 35k2 + 151k*2. 250k*2 + 2k Collect the terms in 2394 - 2394 + 1089g. 1089g Collect the terms in 119854q + 119855q - 359568q + 119858q. -q Collect the terms in 7 + 450 + 167 + 358 + 2v. 2v + 982 Collect the terms in 6694 - 3348 + 47i3 - 3346. 47i*3 Collect the terms in 297 - 726 + 429 - 2c*2. -2c*2 Collect the terms in -105781d*3 + 211565d*3 - 105773d*3. 11d*3 Collect the terms in -19i - 15i - 22i + 96i - 17i - 28i. -5i Collect the terms in 6516u - 3249u - 3255u. 12u Collect the terms in 2534k2 - 437k + 437k - 431k*2. 2103k*2 Collect the terms in 4f*3 - 27f + 16f3 - 6f*3 + 27f. 14f3 Collect the terms in -14t*2 - 12t*3 + 32t*2 - 35 - 14t*2. -12t*3 + 4t*2 - 35 Collect the terms in -82i - 120i + 92i - 188i. -298i Collect the terms in -3 - 31 + 34 + 5z. 5z Collect the terms in -22 - 2p2 - 24 + 9723p + 46 + 2p3. 2p*3 - 2p*2 + 9723p Collect the terms in 65j + 53 - 40j - 47. 25j + 6 Collect the terms in 4578k*2 - 2256k*2 - 2325k*2. -3k*2 Collect the terms in 843y*2 - 1738y*2 + 896y2. y2 Collect the terms in 251 - 15s3 - 95 - 53 - 52 - 51. -15s*3 Collect the terms in 2737 - 1 - 4t*3 - 1367 - 1369. -4t*3 Collect the terms in -2125g*2 - 2468g*2 + 125g*2. -4468g*2 Collect the terms in 223c + 231c + 37 + 33 - 464c - 70. -10c Collect the terms in -101l - 79 + 29 - 108l + 210l. l - 50 Collect the terms in 143m2 - 28m*2 - 19m*2 - 30m*2 - 31m*2 - 36m2. -m2 Collect the terms in -9242q2 + 30999q*2 + 11071q*2 + 27123q*2. 59951q*2 Collect the terms in -6345f*3 + 3191f*3 + 3152f*3. -2f*3 Collect the terms in 3201z + 1 - 2 + 735z. 3936z - 1 Collect the terms in 7s3 + 38s*3 + 147s*2 - 3s + 3s. 45s*3 + 147s2 Collect the terms in -278 - q3 - 407 - 2q + 156. -q3 - 2q - 529 Collect the terms in 66b + 95b - 240b - 152b - 250b. -481b Collect the terms in -17510 - 17510 - 2u3 + 35020. -2u*3 Collect the terms in 3553w*2 - 1183w*2 - 1184w*2 - 1187w2. -w2 Collect the terms in 4g2 - 2g*3 - 8g3 - g3 - 5g3 - 6g*2. -16g*3 - 2g*2 Collect the terms in 13m + 6769m2 + m3 + 6742m*2 - 13511m*2 - 13m. m*3 Collect the terms in 24951 + 12f*3 - 24951 - 13f3. -f3 Collect the terms in -37v3 - 29v*2 - 45v*2 + 97v*2 - 23v*2. -37v*3 Collect the terms in 684q + 228q3 - 684q. 228q3 Collect the terms in 121k + 26k - 56k + 55k + 102k. 248k Collect the terms in 2676b*2 + 1172b*2 - 795b*2. 3053b*2 Collect the terms in -32302f + 196f2 + 32302f. 196f2 Collect the terms in 231v + 2v3 + 165v + 161v + 163v - 720v. 2v*3 Collect the terms in 112 - 43b - 36 - 43 - 34. -43b - 1 Collect the terms in -192r*3 - 140r*3 + 378r*3. 46r*3 Collect the terms in -532h - 8 + 9 - 1. -532h Collect the terms in -11 + 2f + 8 - 8f + 3. -6f Collect the terms in -207l - 50999 + 50999. -207l Collect the terms in 77w2 + 63w*2 + 63w*2 - 169w*2 + 13w. 34w2 + 13w Collect the terms in 2q - 3q*3 + 2q*3 - 4q + 0q + 376q2. -q3 + 376q2 - 2q Collect the terms in -6037i - 6039i + 12037i - 2i*2. -2i*2 - 39i Collect the terms in 260 + 311 + 35h + 256 + 256 - 1083. 35h Collect the terms in 213j - 552j + 343j. 4j Collect the terms in -166 + 62 + 57 + 49 - 3x + 8x. 5x + 2 Collect the terms in 20 + 5 - 8m*3 - 25. -8m*3 Collect the terms in 56b - 455 + 225 + 230. 56b Collect the terms in 4j*2 - 48327 - 48331 + 96658. 4j*2 Collect the terms in -37 - 17 + 16i*2 + 10 - 17i2. -i2 - 44 Collect the terms in -4t2 + 5t*2 + 7t*2 + 3t*2 - 8t*2 - 2t2. t2 Collect the terms in -351 - 5y + 5y - 74 - y3 + 64. -y3 - 361 Collect the terms in 46153l2 - 46163l*2 + 32l + 44l. -10l*2 + 76l Collect the terms in -313b - 407b + 0 + 778b - 1. 58b - 1 Collect the terms in 6 - 19 + 3m2 - 11m*2 + 6. -8m*2 - 7 Collect the terms in 952r + 845r - 1684r. 113r Collect the terms in 300q*2 - 4789q*2 + 34455q*2. 29966q*2 Collect the terms in 8122g + 8107g - 16231g. -2g Collect the terms in -d3 - 9209d*2 + 4609d*2 + 4600d2. -d3 Collect the terms in 7p2 + 10p*2 - 44p*2 + 12p*2 + 12p*2. -3p*2 Collect the terms in -10 - 2m*2 - 743 - 186. -2m*2 - 939 Collect the terms in 5 - 20o + 16 + 13o - 2 + 2. -7o + 21 Collect the terms in -150c3 - 146c*3 - 134c*3 + 478c*3 - 105c*3. -57c*3 Collect the terms in 312s*2 - 945s*2 + 313s*2 + 309s*2. -11s*2 Collect the terms in 12u*2 + 119u*2 - 148u*2 + 21u*2. 4u*2 Collect the terms in 26 - 13 - 13 - 14676y. -14676y Collect the terms in 97s*2 - 115s*2 + 38s*2. 20s2 Collect the terms in -q3 - 350q - 256q + 606q. -q3 Collect the terms in -1050551z - 205z2 + 1050551z. -205z2 Collect the terms in -587 + 1155 - 11z*2 - 568. -11z*2 Collect the terms in 35b*2 + 489b*2 + 15b*2. 539b*2 Collect the terms in -11n - 2n - 5 + n - 6n + 1. -18n - 4 Collect the terms in -22c - 23c - 27c + 73c - 308c*2. -308c*2 + c Collect the terms in -12p + 243018 - 121510 - 121508. -12p Collect the terms in 1032 + 1033 - 2z*3 - 2065 + 0z*3. -2z*3 Collect the terms in -76d*2 + 0 + 1 + 52d*2. -24d*2 + 1 Collect the terms in -3k + 228k3 - 3k + 29k3 - 256k3. k3 - 6k Collect the terms in -15 - 4 + 3870j - 6 - 3862j + 25. 8j Collect the terms in -2352t2 + 4513t*2 - 2162t2. -t2 Collect the terms in -2x2 + 19879799 - 19879799. -2x*2 Collect the terms in 20v + 56248v2 + v3 - 56248v*2 - 20v + 5v3. 6v*3 Collect the terms in -36v + 194v - 35v - 38v - 37v - 41v. 7v Collect the terms in 6495m - 5m*3 - 6495m - 83m3 - 29m*3. -117m*3 Collect the terms in 18 + 17p + 106p - 18. 123p Collect the terms in 579 + 99d + 561 - 101d - 1140. -2d Collect the terms in -1596g + 1 + 1585g - 1 + 3g*3. 3g**3 - 1	{ "pile_set_name": "DM Mathematics" }
68. Put p, 1/7, -3, 0 in decreasing order. p, 1/7, 0, -3 Let q(f) = 34f + 5. Let b be q(0). Sort 34, b, 4. 4, b, 34 Suppose -92 = t - 5t. Let a = t - 19. Put a, 26, 1 in ascending order. 1, a, 26 Let s be (-3)/6 + 13/26. Let b(u) = u*3 - 3u*2 + 3. Let c be b(3). Suppose 4z + 4 = -0z. Sort c, z, s. z, s, c Let a = 0.3 + 0.7. Let f(d) be the second derivative of -d3/3 - 2d*2 - 6d. Let o be f(-2). Put o, a, 2/17 in decreasing order. a, 2/17, o Let o(j) = 14j - 1. Let m be o(-1). Let u = m + 10. Suppose -2v + y = 2, -y = -v - 0y - 1. Sort v, -3, u in descending order. v, -3, u Let q be ((-28)/(-20) - 1) + 0/1. Let d = 9 - 9.02. Let v = d + -1.98. Put 2, v, q in increasing order. v, q, 2 Let q = 0 - -1. Let k be 798/(-30) + 2/(-5). Let b = -107/4 - k. Put q, 0, b in increasing order. 0, b, q Suppose 6p + 149 - 119 = 0. Put 24, p, -2, 4 in decreasing order. 24, 4, -2, p Let r = 0.124 + -0.073. Let j = r - 0.551. Let x = 0.3 + -0.6. Sort 5, j, x in ascending order. j, x, 5 Let p = -302.6 + 303. Sort p, 2/21, 0.5 in decreasing order. 0.5, p, 2/21 Let h(s) = 1. Let j(x) = -2x - 5. Let b(g) = 10h(g) - 2j(g). Let m be b(-5). Put -18, 1/9, 2/3, m in descending order. 2/3, 1/9, m, -18 Let p(s) = -s2 - 5s + 5. Let m be p(-6). Let d(c) = c*3 - 2c*2 - 83c - 19. Let v be d(-8). Sort 0, m, v in ascending order. m, 0, v Let g = 5 - 2. Let i be (-3 + 0 + 1)g/(-2). Sort 1, i, 5. 1, i, 5 Let x = 0.05 + 0.05. Suppose -2h + 0 = 8. Let w be ((-2)/12)/(h/16). Put w, 9, x in descending order. 9, w, x Suppose 24g = 28g. Put g, 4, -3, 11 in decreasing order. 11, 4, g, -3 Suppose -12 = 4y - 4w, -5w - 3 - 3 = 2y. Let t(b) = -b - 1. Let j = -2 + -8. Let o be t(j). Sort y, o, 3 in increasing order. y, 3, o Let f(r) = -r*2 - 11r - 17. Let h be f(-7). Let s = 6 - h. Sort s, -1, -3 in increasing order. s, -3, -1 Let s = 295.72 - 301. Let h = -26.38 - s. Let m = h + 21. Put m, -0.3, -3/7 in descending order. m, -0.3, -3/7 Let q(c) = c - 1. Let h(x) = x - 4. Let z be h(5). Let a be q(z). Suppose l - 2d = -6 + 3, 5l - 3 = 4d. Put a, l, -1 in increasing order. -1, a, l Suppose -12 + 9 = -y + 4r, -10 = 5r. Sort y, -8, 6. -8, y, 6 Let i be 8 + (-16)/(-4) + -4. Suppose -ij = -9 + 1. Sort -4, j, 5. -4, j, 5 Let h be 45/86/(-5). Put h, 39, 0, 4 in decreasing order. 39, 4, 0, h Suppose -497f + 499f + 10 = 0. Sort f, 30, -2, 2. f, -2, 2, 30 Let r = 90 + -85.7. Let z = r - 4. Sort -0.2, -1/2, z in decreasing order. z, -0.2, -1/2 Let a = -240 - -236. Sort a, -2, 0 in decreasing order. 0, -2, a Let y = 548 - 550. Put -0.1, 1/2, y, -2/137 in descending order. 1/2, -2/137, -0.1, y Let s = 23898/126055 - 2/1483. Let r be 0 - (116/(-34) - -4). Let y = r + s. Sort 0.1, y, -5 in ascending order. -5, y, 0.1 Let r(k) = k + 20. Let b be r(-23). Put -6, -5, -4, b in descending order. b, -4, -5, -6 Let t(d) = 7d - 4. Let k be t(1). Let j be 3/k4/7. Let s = 95/63 + -9/7. Sort s, j, -2/3 in increasing order. -2/3, s, j Suppose 0 = -3f + 6, 5f - 2f - 36 = -2v. Let c(d) = 26d + 73. Let b be c(-3). Sort v, 1, b. b, 1, v Let i be 6/(-2) + (0 - 24). Let z = -27 - i. Sort -2, z, 25. -2, z, 25 Suppose -3o + 6 = -4u, -3u = -5u - o - 8. Let t = -93 + 88. Put t, -1.1, u in decreasing order. -1.1, u, t Suppose p + 16 = 5p. Suppose -pk - 13 = -21. Suppose -35 - 7 = 3w - 3a, -ka + 39 = -3w. Put -5, w, 5 in increasing order. w, -5, 5 Let w = -4.277 - -0.277. Put -0.7, -2/3, 3, w in ascending order. w, -0.7, -2/3, 3 Suppose 18l + 85 = 35l. Put l, 4, 33 in increasing order. 4, l, 33 Let h = 248 + -165. Let p = h + -245/3. Put p, -0.4, 4 in descending order. 4, p, -0.4 Let r(b) = 3b - 10. Let z be r(5). Let s be 1/(-5)z/(-6). Sort -2/7, s, 0.08 in ascending order. -2/7, 0.08, s Suppose -21c + 11c = -13c. Put c, -3, 9 in ascending order. -3, c, 9 Let d(b) = -b*3 + 4b*2 + b. Let x be d(4). Let c be (-1 - 5)12/(-8). Suppose 4r = -a - 27, -4a + 2a + c = -r. Sort r, x, -2. r, -2, x Let h be (-2)/(-27)9/(-3). Let q(a) = 32a + 8. Let l be q(2). Let g = l - 73. Sort g, -4, h. -4, g, h Let b = -46/9 - -211/36. Let l = 5.5 - 27. Let u = l - -22. Sort -1/8, u, b in decreasing order. b, u, -1/8 Let c = -39.7 - -34.7. Let d = -6 - -2. Sort d, 2, c, -2/7 in increasing order. c, d, -2/7, 2 Let c = 0.4 - 0.5. Let w = -5 - -10. Let f = w + -4.6. Sort c, f, -0.2 in increasing order. -0.2, c, f Suppose -276 = 11u - 9u. Let b = -967/7 - u. Sort 0, b, -2/69 in decreasing order. 0, -2/69, b Let o = -0.0606 + 0.1606. Put 36, -5/4, o in increasing order. -5/4, o, 36 Suppose 1 = -232p + 233p. Sort -9, -6, -4, p in decreasing order. p, -4, -6, -9 Let s = 0 + 2. Let a = s + -1. Let o(p) = -12p + 59. Let v be o(5). Sort v, 3, a. v, a, 3 Suppose 2 = -3u + 8. Let p = 1.236 + -1.336. Put p, u, 2/17 in descending order. u, 2/17, p Let y be ((-12)/2)/(-3 + 1). Suppose 5c - 8 = yc. Let a(n) = -n3 + 5n*2 - 3n - 3. Let d be a(2). Sort c, -2, d in ascending order. -2, d, c Let j = 251 + -250.5. Put j, 6, -5, -3 in descending order. 6, j, -3, -5 Let p = 1.86 - -0.14. Let j = -2.33 + 2.03. Sort p, j, -0.1 in decreasing order. p, -0.1, j Let a = -42 + 5. Let i = a + 41. Sort 2, -1, 3, i in descending order. i, 3, 2, -1 Let x = 1151 + -1151. Put -1.1, x, 1, -3/7 in ascending order. -1.1, -3/7, x, 1 Suppose -67 = -28h - 11. Sort h, -14, 1 in descending order. h, 1, -14 Suppose 3x = 7x. Suppose -72j + 71j = 5. Sort x, j, 5, -3 in descending order. 5, x, -3, j Suppose -8r + 10r + 6 = 2y, 0 = -4r + 5y - 13. Suppose 3p + 2c = 6c + 31, 5c = -5. Sort r, 1, p in increasing order. r, 1, p Let a = 91.7447 + 0.0553. Let i = a - 92. Sort -0.4, -6, 4, i in descending order. 4, i, -0.4, -6 Suppose 2w - 5g + 18 = 0, -3w + 3g + 1 - 19 = 0. Suppose 8 - 11 = x. Sort 3, -16, w, x in increasing order. -16, w, x, 3 Let q be 6/(-8)62/(-15). Let x = -2 + 1.9. Sort q, x, -0.3. -0.3, x, q Let g(x) = x*2 + 8x + 9. Let y be g(-7). Suppose 0 = 20o - 30o + 10. Sort y, -4, o in decreasing order. y, o, -4 Let l(h) = -15h + 81. Let c be l(6). Let d(q) = -q - 11. Let n be d(-7). Let k(p) = p3 - 11p*2 - 2. Let a be k(11). Sort a, c, n. c, n, a Let d = 1406 + -1405. Sort 12, 5, d in ascending order. d, 5, 12 Let c = -103 - -102. Sort 2, c, 0.01, 4. c, 0.01, 2, 4 Let p = 9 - 7. Let u be (2 - p) + -2 - (-6 - -8). Put -2, u, 3 in descending order. 3, -2, u Suppose -3r = 2r - 10. Suppose rp = -3p + 15. Let u(t) = -t - 1. Let y be u(-5). Put -5, p, y in decreasing order. y, p, -5 Let x(f) = -f2 + 4f - 2. Let p be x(4). Let l be p/5 - 154/(-35). Sort -0.5, l, -0.1 in decreasing order. l, -0.1, -0.5 Let k = 151 + -147. Suppose 0 = -5d - kv + 30, v + 6 = 2d - d. Let l(f) = 4f3 - f2 - 2f - 1. Let h be l(-1). Put h, d, -5 in decreasing order. d, h, -5 Suppose 0 = -2o + 3z - 0z - 5, 4o = 3z - 13. Put 2, -5, o, 7 in descending order. 7, 2, o, -5 Suppose -h = -89 + 95. Sort -3, 1, -2, h in descending order. 1, -2, -3, h Let j be 3/(-9) - (-5)/15. Suppose -45w + 44w + 2 = j. Sort w, 0.22, -0.1 in decreasing order. w, 0.22, -0.1 Let l = -6 + 0. Let t = l - -5.9. Put -2, 2/35, t in increasing order. -2, t, 2/35 Let z be 2/(((-6)/(-5))/3). Sort -4, -8, -5, z in descending order. z, -4, -5, -8 Let v = -4.7 + 5. Let j(t) = t*3 + 12t*2 + 14t + 28. Let a be j(-11). Put a, 1/2, v in decreasing order. 1/2, v, a Let j = 0.29 - -0.01. Let r = 176 + -178. Sort 3, r, -0.2, j in decreasing order. 3, j, -0.2, r Let c = 914 + -912. Sort -1.4, c, 4. -1.4, c, 4 Suppose 76r = 71r - 15. Sort r, 14, 0 in ascending order. r, 0, 14 Suppose -67g = -58g - 45. Put g, -11, 2, 4 in descending order. g, 4, 2, -11 Let a = -2.18 + 2.68. Put -2/5, 0.4, a in descending order. a, 0.4, -2/5 Let i = -42 + 41.7. Put i, -1, -2/39 in descending order. -2/39, i, -1 Let w be 2 + -3 + 56/52. Let z = 481 - 482. Put -0.2, z, w in descending order. w, -0.2, z Let i(n) = -15*n + 20. Let f be i(8). Let v = -296/3 - f. Put 0, -3, v in decreasing order. v, 0, -3 Let m be -2 - 0/(-1 - 0). Let i = 1749 - 1744. Put i, -3, 3, m in ascending order. -3, m, 3, i Let l = 0.14 + 2.86. Sort -0.6, 0.1, l in ascending order. -0.6, 0.1, l Let k = 8 - 7. Let y = 6.9 + -6.9. Sort y, -0.07, k in decreasing order. k, y,	{ "pile_set_name": "DM Mathematics" }
/3, -226.26? -226.26 What is the fourth biggest value in -1, 2, 0.0224, 5, -1/2, 8? 0.0224 What is the smallest value in 0, -0.5, 18, -60, 2/9? -60 Which is the biggest value? (a) -4/3 (b) 930 (c) 20 (d) 1/3 b What is the smallest value in -23.98, -1/12, 0.5? -23.98 Which is the third smallest value? (a) 27.9 (b) -53/4 (c) -6 a What is the second smallest value in -95, 1/3, 4/9, 2/15? 2/15 Which is the third biggest value? (a) 23.9 (b) -328.6 (c) 4 b What is the third biggest value in -2/3, 4, -23371? -23371 What is the sixth smallest value in 3, 0.2, -155, -5, -1, -0.4? 3 Which is the biggest value? (a) 2 (b) 19 (c) 69 (d) -2/7 (e) -1/7 c What is the third smallest value in -3/4, 3/2, 0.6, 1/3, -0.08, 0.4? 1/3 What is the smallest value in 3, 15, -2/81? -2/81 What is the fifth biggest value in 13, -1/3, -2, 0.3, -23/5, -0.5? -2 Which is the fifth smallest value? (a) 26 (b) 2 (c) -0.5 (d) 2/9 (e) -0.1 a Which is the biggest value? (a) 109 (b) 3 (c) 15/4 (d) -1 (e) 8 (f) 1/11 a What is the fourth biggest value in 5, -2, 2606, -3? -3 Which is the fifth biggest value? (a) -5 (b) 0.16 (c) -1/2 (d) -0.06 (e) -0.04 a What is the fourth smallest value in 28, 3, 4, -2, -0.54? 4 What is the third biggest value in 57, -1/5, 2, 1/2, -2? 1/2 Which is the biggest value? (a) -2 (b) 2/65 (c) 22.5 c Which is the second biggest value? (a) -2.67 (b) 0.01 (c) 5 b What is the second biggest value in -9.49, 0.2, -1? -1 Which is the sixth biggest value? (a) 1 (b) -79 (c) 17 (d) -2/9 (e) 4 (f) -1/6 b What is the biggest value in -1.6, 514/13, -2/17? 514/13 Which is the second smallest value? (a) 9 (b) -18.9 (c) 593 (d) -5 d What is the fourth biggest value in 0.4, 1/2, -1/3, 24, -3, 439? 0.4 What is the smallest value in -1003, 2/9, 6? -1003 What is the second smallest value in -1/2, 0.4, 0.9, -3, -9/7, 0.2? -9/7 Which is the fourth smallest value? (a) 2/9 (b) 21 (c) 6 (d) -6/23 b Which is the second smallest value? (a) -3 (b) 0.5 (c) -2 (d) 0.105 (e) 5 c Which is the third biggest value? (a) -148 (b) -4 (c) 15 a What is the second smallest value in 0, -5, 0.31, 3/4, -1007? -5 Which is the fifth smallest value? (a) -3/2 (b) -25/13 (c) -2/5 (d) -2 (e) 0.14 e What is the fourth smallest value in -5, -395, 3, 0.1, 1? 1 What is the second smallest value in -24, 107, -0.5? -0.5 Which is the fourth smallest value? (a) 12 (b) -2 (c) -3 (d) -5 (e) 0 (f) 75 e Which is the fourth smallest value? (a) -3/8 (b) 3 (c) 1 (d) -6 (e) -144 (f) 2/11 f What is the fifth biggest value in 2/9, -8/9, -2, -5, 18, 4/5? -2 Which is the second biggest value? (a) -493 (b) 2/5 (c) -21/8 (d) 0.1 (e) 5 (f) 3/2 f Which is the third smallest value? (a) 0.2 (b) -3/2 (c) 275/2 (d) 3/5 d Which is the third smallest value? (a) -2/11 (b) 3 (c) 18 (d) -10 (e) -0.1 (f) 5 e What is the fifth smallest value in -5/4, -0.4, 0, 3/2, 0.1, 1873? 3/2 What is the fifth smallest value in -3/7, -2, 5/7, 2, 0.2? 2 Which is the biggest value? (a) -3 (b) 1257 (c) -155 (d) -2/3 b Which is the third biggest value? (a) -4352 (b) -0.4 (c) -7 a Which is the second biggest value? (a) 1/4 (b) 4 (c) 2/3 (d) -0.063 (e) 45 (f) 0 b Which is the second biggest value? (a) 2/11 (b) -4 (c) -16/13 (d) -1/7 (e) 0.2 a What is the second smallest value in -54.5, 106, -2/21, -1, -1/2? -1 Which is the third biggest value? (a) -1/8 (b) 2/59 (c) -4 (d) 386 a What is the biggest value in -0.8, -5, -230? -0.8 What is the second biggest value in -1, -5/6, -4, -0.044, -1/6? -1/6 What is the second biggest value in 2/15, -25, -21? -21 What is the second smallest value in -39, 2, -2, -8? -8 Which is the second biggest value? (a) -723 (b) 2/3 (c) -0.7 c What is the fourth biggest value in -1087, 1/4, 0.7, 12? -1087 What is the third biggest value in 5, 5.9, 0.1, -0.1, 619, -0.4? 5 What is the fifth smallest value in -1/2, 18, -10, 8, 1? 18 What is the sixth biggest value in -3/5, 5/2, -97/4, 0.4, -0.4, 3? -97/4 What is the second smallest value in -3/16, -5, 4, -0.3, 0? -0.3 Which is the smallest value? (a) 0.5 (b) -2 (c) 1.18 (d) -2/21 (e) 0.2 b Which is the fifth smallest value? (a) -334 (b) 4 (c) 9 (d) 1/2 (e) 5 (f) -15 e What is the third biggest value in 4, 7/22, 3? 7/22 Which is the third smallest value? (a) -1 (b) -3 (c) -1/107 (d) -2/57 d Which is the fifth biggest value? (a) 16 (b) -2/11 (c) 18.4 (d) -5 (e) -2/3 d Which is the fourth smallest value? (a) 20 (b) 4 (c) -2 (d) 0.4 (e) 7 (f) -1/3 b Which is the smallest value? (a) -2/39 (b) 1 (c) 3/47 (d) 10/9 a Which is the third smallest value? (a) -365 (b) -0.4 (c) 1/4 (d) 1 (e) -27 (f) -4 f What is the third smallest value in 3/5, -10, 3, -12.7, -3/5? -3/5 Which is the second smallest value? (a) -0.486 (b) -1.2 (c) 1/6 a Which is the third biggest value? (a) 24 (b) 2.648 (c) -0.3 c Which is the third smallest value? (a) -26/19 (b) 0.25 (c) -0.05 b What is the biggest value in 2, 0.4, 0.9448? 2 Which is the third smallest value? (a) 3 (b) -1053 (c) 1.1 a Which is the fifth biggest value? (a) 0 (b) 3 (c) -980 (d) -0.1 (e) -1/2 (f) 7 e What is the biggest value in 8, -2, -0.3, 4/405? 8 What is the smallest value in 162037, -0.03, -1/2? -1/2 What is the smallest value in 2, -49, -217, 3? -217 What is the smallest value in -23, 1/2, -20331? -20331 What is the third smallest value in 3, -7, 24.49, 0? 3 What is the sixth smallest value in 0.2, 3/2, -4, 15, 3, -2/113? 15 Which is the biggest value? (a) -25 (b) 3 (c) -1/3 (d) 0.5 (e) -2/15 (f) -3 b Which is the third biggest value? (a) -7/3 (b) -1 (c) -17 (d) 1 (e) 2/27 b Which is the second biggest value? (a) -17244 (b) 1/5 (c) 2/5 b What is the fourth biggest value in 0.3, -0.112, 3, 125? -0.112 Which is the smallest value? (a) -2/5 (b) 971 (c) -0.006 a Which is the second biggest value? (a) -3 (b) 0.184 (c) -5.8 a What is the second biggest value in -9, 16/13, 3, -0.13, -4? 16/13 Which is the second smallest value? (a) -3/2 (b) 2/13 (c) -686 (d) 0.2 (e) -0.4 a Which is the smallest value? (a) 0.5 (b) -0.247 (c) -2/13 (d) -0.2 b What is the third smallest value in 1, -3/4, 16/427? 1 What is the fourth smallest value in -26/3, -3, -7, -152, -2/9, 0.5? -3 What is the smallest value in -382, -2, 0.78, -4/7? -382 Which is the second biggest value? (a) 0.5 (b) 35 (c) -0.07 (d) 3/4 (e) -4/5 (f) 3 f What is the third smallest value in 2/7, -1/7, 0.1, 2/13, 4? 2/13 Which is the second smallest value? (a) -3 (b) 1/3 (c) 0.271 (d) 1 c Which is the fifth smallest value? (a) 37 (b) -1/2 (c) -4/5 (d) 3/10 (e) 0.5 a What is the second biggest value in 4/95, 1, -2, 8, 4, -5? 4 What is the smallest value in -0.046, -0.165, 2/11? -0.165 What is the smallest value in 0.5, -1, -46, 3/4, 1/4? -46 Which is the fourth smallest value? (a) 0.4 (b) -0.3 (c) -1.94 (d) 703 d Which is the biggest value? (a) 3/8 (b) 70 (c) 1/31 (d) 35 b What is the smallest value in -7, 5, -8, 30? -8 What is the third biggest value in 2, -3/3083, -4, 0? -3/3083 Which is the second smallest value? (a) -0.8 (b) -2/61 (c) -3 a Which is the third smallest value? (a) -1171923 (b) 1/4 (c) 3 c What is the second biggest value in -54390, 0, 0.5? 0 Which is the fourth smallest value? (a) 0.7 (b) 4.82 (c) 1/3 (d) 190 d What is the smallest value in -1/13, 21/10, 0.4, 5, 2? -1/13 Which is the second smallest value? (a) 14650 (b) 2/15 (c) 4/7 (d) 4 c Which is the second smallest value? (a) -2.9 (b) 1.7 (c) -79 (d) -0.1 (e) -4 e What is the smallest value in 1.3, 18, 4861? 1.3 What is the second smallest value in -2/9, 76, 4, 78? 4 Which is the second smallest value? (a) 6/11 (b) 3/7 (c) 5 (d) -559 b What is the third biggest value in -6, -0.18, -1, 4? -1 What is the fourth smallest value in -0.3, 6/14657, 0.5, 0.2, 1/8, 2? 0.2 Which is the second biggest value? (a) -1 (b) 0.09 (c) 362 (d) 4 d What is the fifth biggest value in -0.1, 0.1, 1/9, -293, -22? -293 What is the second smallest value in 14, 0.01, 0.7, -1/7? 0.01 Which is the fourth smallest value? (a) 0.0536 (b) 5 (c) 0 (d) -1/4 b Which is the second biggest value? (a) 1/7 (b) 10 (c) -1.3	{ "pile_set_name": "DM Mathematics" }
d. 0 Solve 0 = 3b - z + 32, -5z + 2 = 7 for b. -11 Solve 5k + 9 = 3r, 90k - 3r - 18 = 94k for k. -3 Solve 3q - 30 = -l - 4, 4q = -3l + 33 for l. -1 Solve 7u - 4a + 18 = 0, 5u + 3u = a - 17 for u. -2 Solve l = -3a + 166 - 170, 5a + 30 = 3l for l. 5 Solve l - 4m = 27, -3l + 1134m - 1133m = -26 for l. 7 Solve 4h + 34w - 33w + 16 = 0, 5w - 85 = 13h for h. -5 Solve y - 4w - 11 = 0, 5w + 80 = -3y + 28 for y. -9 Solve 3n = -4l - 29, -2n - l = 208 - 202 for n. 1 Solve 0 = -3h + 543n - 556n - 32, 3h - 3n = 0 for h. -2 Solve 2p = 2, -z - p = 54 - 57 for z. 2 Solve -4j - 69 = -5b, j + 1036b + 36 = 1041b for j. -11 Solve -2z - 24 = -2w, 4w + 452z - 24 = 453z for w. 4 Solve 0 = -393a + 397a + 64, -4z - 5a - 64 = 0 for z. 4 Solve r + 17 = -a, 4r = 141a - 143a - 64 for r. -15 Solve -h - 333j = -332j + 5, h + 7 = -3j for h. -4 Solve -3y - 899 + 929 = -4x, 20 = -5y - 5x for y. 2 Solve 3n + 2a - 38 = 0, -n + 18 = 6a + 24 - 24 for n. 12 Solve -3t - 13 = -p, 5t + 9p + 66 = 17p for t. -2 Solve -73636f - 19 = -73637f + 3n, f = n + 7 for f. 1 Solve 0 = -4o + 4n - 16, -11o + 6n - 10n = -61 for o. 3 Solve 4y + 5 = u, 105u + 5 = 5y + 106u for y. 0 Solve 0 = -4k - 5b - 5, 4k - 5b + 16 = 21 for k. 0 Solve 0 = -3v - 5d + 33679 - 33674, -2v + 5d - 30 = 0 for v. -5 Solve 6837r - 4 = 6833r + 4v, -4r = -3v - 1 for r. -2 Solve -9u = 5c - 25, -111 + 132 = -4c + u for c. -4 Solve 4q + n + 11n - 99 = n, -6q = 5n - 91 for q. 11 Solve 2w - 416 = 20l - 386, 5w + 2l + 29 = 0 for w. -5 Solve g - 3m + 15 = 0, 3g = 66m - 61m - 29 for g. -3 Solve -5v + 0l = 4l - 56, -33 = -6v - l for v. 4 Solve -479s + 478s + 10 = -b, 15 = -s - 4b for s. 5 Solve 5j = 5q + 20, -j + 5q = 2024 - 2064 for j. -5 Solve 0 = 5u - 3s + 6 + 11, -u + 4s = 17 for u. -1 Solve -3l + v + 44 = 56, -5v = -15 for l. -3 Solve r = -4u - 1723 + 1705, 4u = -4r - 36 for r. -6 Solve -433j - 4a = -438j - 26, 6j - 5a + 32 = 0 for j. -2 Solve 75 + 79 = s + 3c + 147, 4s - 8 = 8c for s. 4 Solve -8i - 14 - 31 = -3g, -i - 4g = 10 for i. -6 Solve -2u - 2w = 4, 23 = -170u + 171u - 4w for u. 3 Solve 3b + 4g - 26 - 5 = 0, b = 4g - 11 for b. 5 Solve 4o - 3g = 15, -5o - 63 = -11o - 6g - 3g for o. 6 Solve 5f - 11 = -4c, -2c + 1 = 186f - 185f for f. 3 Solve 5u - 4n + 16 = 0, 6u = 2u - n + 4 for u. 0 Solve -99 = 5a - 4n, -10918n + 10921n - 79 = -a for a. 1 Solve 2u - 13d = -16d + 2, -2u - 34 = -6d for u. -5 Solve 10 = -5p, -132p + 129p = -5z - 19 for z. -5 Solve -8641s = -8645s + 4n, 2n = -2s + 4 for s. 1 Solve -2k - 5a + 51 = 0, 18k - 16k = 7a - 81 for k. -2 Solve -l - 8 = z, l - 3z - 5 = 7 for l. -3 Solve 1162w = 1167w - 5s, 3w + 15 = -2s for w. -3 Solve -3p = -2r - 41 + 34, 0 = 3r - 2p + 3 for r. 1 Solve a = 3z - 26, -4a + 5z = 156 - 87 for a. -11 Solve h + 3b = -7, -b = -5h - 257 + 254 for h. -1 Solve -12u - 5v - 416 = -261, -4u + 2v - 70 = 0 for u. -15 Solve 9 = 3c - 5z + 4 - 0, -c + 3z - 1 = 0 for c. 5 Solve -3s + 6 = -4y, -2322y = -2320y + 2s + 10 for y. -3 Solve 4 = -4b, 83k - 86k = 3b for k. 1 Solve 36n - 33n = -5u + 11, 3u + n = 5 for u. 1 Solve 3t = 3m + 3, -97 + 88 = 3t - 6m for t. 5 Solve b + 5g = -22, 3b - 8b = 2g + 432 - 437 for b. 3 Solve -p + 5r - 1 = 20, 6p - 2r + 14 = 0 for p. -1 Solve -3c - 5r = -6, 5c + 5r + 12473 = 12483 for c. 2 Solve 2o + 135t = 136t - 7, 8o + 73 = -5t for o. -6 Solve -4h = t - 24, -4h - 396 = -416 for t. 4 Solve -43p = -48p - 5f + 5, p - 19 = 5f for p. 4 Solve 15r + 266k = 263k + 6, 0 = -r - 5k - 14 for r. 1 Solve -219x + n - 31 = -215x, -20 = 2x + 4n for x. -8 Solve 6612n = u + 6610n + 2, -u - 5n - 9 = 0 for u. -4 Solve 188 = 5j + 2h + 204, 14j + 54 = -h for j. -4 Solve -4w = -4a - 490 + 502, 5w + 19 = 3a for w. -5 Solve -2x = u + 2012 - 2005, 5x + 40 = 5u for x. -5 Solve 5 = -165p + 168p - 2d, 0 = 3p + 4d + 1 for p. 1 Solve -71 = 5j - 69q - 7q, 2j - 4q + 2 = 0 for j. 1 Solve 3o = 3w + 6, 5w - 25o + 28o + 34 = 0 for w. -5 Solve -94v + 90v + b = -42, 2v - 4b = 28 for v. 10 Solve -14i = 2k + 6, 107k - 17 = 109k + 3i for k. -10 Solve 4p - s = 13, 2p + 90s - 48s - 10 = 46s for p. 3 Solve -r = 4p - 22, -47r + 48r - 8p + 50 = 0 for r. -2 Solve -3c + 4n + 15 = 0, 4c + 14103 = -3n + 14123 for c. 5 Solve 5y + 3z + 10 = 0, 1255 = -y - 5z + 1275 for y. -5 Solve 1660o + 4m - 11 = 1657o, 0 = 3o - 3m + 24 for o. -3 Solve 62p - 21 = -2y - 60p + 119p, 0 = y - 3p + 3 for y. 6 Solve 3a = -4k - 12, 0 = -334a + 337a + 2k for a. 4 Solve -203 = t - d - 197, -5t + 11d - 48 = 0 for t. -3 Solve 0 = -5s - 2t - 2, -1161 = 5s + 5t - 1156 for s. 0 Solve -3c - 4n + 23 = 0, 2c - 3n = -56 + 43 for c. 1 Solve 5z - 190y = -189y + 25, 25 = 5z + 2y for z. 5 Solve 0 = 4v - 12g + 7g + 6, -g = -3v + 1 for v. 1 Solve -x - 2t = 18, -t + 214 = -5x + 212 for x. -2 Solve -59 = -5c + 24x, 0c - x + 34 = 3c + 2c for c. 7 Solve -2x + 7b = 2b - 1, b = -4x + 35 for x. 8 Solve 0 = 4t - a - 16, -5t + 5a + 119 = 114 for t. 5 Solve -12o + 14o - 4 + 28 = -4t, 11o + 64 = -5t for o. -4 Solve 0 = -3i + 5o - 160 + 195, -5o - 35 = -2i for i. 0 Solve -5l - 40 = -4b + b, 15l + 4b = 12l + 5 for l. -5 Solve 3f - 15 = -3o, 1298o - f + 21 = 1303o for o. 4 Solve 6y - 16 = 5r, -28r + 27r = 3y - 1 for r. -2 Solve 69094l + 2p = 69089l + 30, 8l - p - 48 = 0 for l. 6 Solve -5n = -3a + 4, -88n + 1 = a - 90n for a. 3 Solve 4100j + s = 4099j - 8, 9 = -3s for j. -5 Solve -5w - 168 = -3r - 173, -2r - 15 = -w for w. -5 Solve 0 = 2c + 4w + 24, -5c - 4w + 9 = 39 for c. -2 Solve -4f - r = -19, -44f + 25 = -45f + 4r for f. 3 Solve -3v + 45 + 34 = 5s, -4s = -v - 53 for s. 14 Solve 10c - 15c = -7g + 41, 2c + 23 = 5g for g. 3 Solve 5c = -3f + 20684 - 20724, 0 = -c + f for c. -5 Solve -a + 1 = 0, -389t + a + 5 = -391t for t. -3 Solve 0 = -3x - 3n - 63, 3n = -159x + 160x - 47 for x. -4 Solve 0 = -n - 4t - 17, 2t + 416845 = n + 416844 for n. -5 Solve m + 6l = -11, 23m - 2l - 5 = 22m for m. 1 Solve -5i + 4q = 32, 0 = -3i + 38q - 34q - 16 for i. -8 Solve -6x - 2h = -3x - 37, -4x + h - 13 = 0 for x. 1 Solve -8z - 2h = -4z + z + 5, 10z + 10 = h for z. -1 Solve 20l + 52 = 4f + 24l, f + 5l - 77 = 0 for f. -3 Solve -2g - q = 9, 0 = 15q - 11q - 4 for g. -5 Solve 45 = 5g - 3m + 25, 5g - 5m = 40 for g. -2 Solve 2x - 4 = 2l, 1143x - 1144x = 2l - 17 for l. 5 Solve 0 = -13u - 2q - 76, -282u - 28 = -281u + 2q for u. -4 Solve -6z - 2u + 32 = 0, 0 = -5z - 4u - 193 + 222 for z. 5 Solve -13 = -3w + 4p, 45 = 16w + 30787p - 30784p for w. 3 Solve 4k - 4o = 12, 4o = 2k - 1907 + 1891 for k. -2 Solve -26 = -b + 3w, 26w = 68b - 65b - 163 for b. 11 Solve 0 = g + y + 1, 408g + 22 = 413g - 4y for g. 2 Solve 8 = 2z, -5x = -24z + 8z + 99 for x. -7 Solve -19g - 8 = -23g + 7d, 2g + d + 14 = -0g for g. -5 Solve 3c = 5v + 760 - 772, 11 = 2v + 5c for v. 3 Solve -3n = -3s - 9, 5 + 12 = -5s + 4n for s. -5 Solve 0 = -2q + 4u - 4, 0 = -3q - 4u - 1465 + 1479 for q. 2 Solve 6a = 3k + 11 + 13, 4k + 5a - 20 = 0 for k. 0 Solve -87 + 78 = -3s, -5w - 4s + 57 = 0 for w. 9 Solve -5d + 2123 = s + 2140, -s = 3d + 11 for s. -2 Solve 4h + 4 = -5l - 107, 49h + 145 = 44h for l. 1 Solve -23 = 5x - 213l + 217l, 0 = -4x - l - 14 for x. -3 Solve 0 = 5d - 5l + 43297 - 43257, 5d = 4l - 37 for d. -5 Solve -4u - k = 5, -3k + 1450 = 2u + 1455 for u. -1 Solve 0 = 11f - 44, 2f = 3c - 17401 + 17424 for c. -5 Solve 38829 - 38849 = s + 5k, 5s + 4 = -k for s. 0 Solve -2v = -4r - 6, -2v - 3r - r = -14 for v. 5 Solve -4h = -z + 16, -828z - 5h - 20 = -820z for z. 0 Solve -5q + 3p = -15, -61p - 15 = -q + 3q - 58p for q. 0 Solve 1 = -3t - j, -t + 35j - 30j + 21 = 0 for t. 1 Solve -38518k = -38516k + 2n, -6k + n - 28 = 0 for k. -4 Solve -u - 18 = 5s, 369u - 2 = s + 370u for s. -4 Solve -12496w = -2c - 12491w + 112, 3w + 70 = 4c for c. 1 Solve 15 = 3n - 11a, -1065a - 10 = -2n - 1061a for n. 5 Solve 5l + 2m -	{ "pile_set_name": "DM Mathematics" }
((-8)/(-84)). Suppose 4p + q = 7p. What is the highest common divisor of s and p? 14 Let u = -6734 - -6741. Calculate the greatest common divisor of 497 and u. 7 Let o be 1406 - ((3 - -3) + (-14)/2). Calculate the greatest common divisor of o and 63. 21 Suppose 4l + 253 = 4h - 491, 0 = -4l - 16. Calculate the greatest common factor of h and 819. 91 Let h be (-2 - 21/(-9)) + (-3542)/42. Let z(q) = -37q. Let n be z(-3). Let d = n + h. What is the highest common divisor of d and 36? 9 Let t be 6/8 + (-60)/16 + 3. Suppose 170v - 157v - 65 = t. Calculate the highest common factor of v and 17. 1 Suppose -15b = -29b - 98. Let m be b/(169/(-21) - -8). What is the greatest common factor of 3 and m? 3 Suppose f = 130 + 335. Suppose -7t + 9t = -3j + 390, 4t + 3j = 762. Calculate the greatest common divisor of f and t. 93 Let q be (-194)/824/(-3) - -1. Suppose 318 = 3u - q. Calculate the highest common divisor of 18 and u. 9 Let r = 3797 + -3149. What is the greatest common factor of 1188 and r? 108 Let f be (40 + -1)(-1)/(-1). Let v = -17 + f. Suppose 3a - v = m, -5a - 5m - 27 + 97 = 0. Calculate the highest common factor of 99 and a. 9 Suppose -3l + y = -253, 0 = 5y - 37 + 42. What is the highest common divisor of 966 and l? 42 Let n(t) = -3t*2 - 14t + 11. Suppose 5y + 2w + 29 = 0, -4w = -5y - 8 - 9. Let s be n(y). Calculate the highest common divisor of s and 30. 6 Suppose 5r = 356 + 294. Let l(h) = -h3 + 54h*2 + 109h + 171. Let q be l(56). Let m be (-24 - -18)(-13)/q. What is the greatest common factor of r and m? 26 Suppose -2p = 2, p + 105 - 14 = 3w. Let z(x) = -7x + 220. Let v be z(w). What is the highest common divisor of v and 85? 5 Let c be (-4563)/(-108) - (2 + (-14)/8). Let q be (-2)/12 - (-133)/c. Calculate the greatest common factor of q and 11. 1 Suppose 0 = -2w - 5 - 1. Let y be (0 + 1/w)-627. Suppose 21j - 234 = 165. What is the greatest common divisor of y and j? 19 Let n = -6850 - -2226. Let p = n - -6545. What is the greatest common factor of 17 and p? 17 Suppose 15f - 5680 + 370 = 0. Suppose 0 = -12l - f + 1794. Calculate the greatest common divisor of 5 and l. 5 Let o(t) = t2 - 14t - 45. Let n be o(25). Let f = 290 - n. What is the greatest common divisor of 30 and f? 30 Let h(r) = -323r + 22. Let y be h(1). Let m = -261 - y. What is the highest common divisor of 360 and m? 40 Let q be 9 + (6-1 - -2). Suppose -qg = 3d - 260, -148 = -2d + 2g + 4. Let z be ((-8)/10)/(2/5) + 62. Calculate the greatest common divisor of d and z. 20 Let w = 112 + -70. Suppose 0d + 2d = -3v + 6, 0 = -3d. Let n(j) = 8j2 + 3j - 10. Let t be n(v). What is the highest common divisor of w and t? 14 Let g be (-1298(-1)/(-3))/((-18)/(-2025)-5). What is the greatest common divisor of 15 and g? 15 Let i be 297/693 + ((-2)/(-6) - 59424/(-63)). What is the greatest common factor of 560 and i? 16 Suppose -g = 2t + 5, 2g - 3t + 10 - 35 = 0. Suppose 0u = -gu + 35. Let j be 8/10 + 1/5. Calculate the greatest common divisor of j and u. 1 Suppose 10w = 189 - 2159. Let r = -181 - w. Calculate the greatest common divisor of 12 and r. 4 Let w(d) = -d*3 - 3d*2 - 4d - 4. Let p be w(-4). Suppose 0 = -10a + 8a - 3a + 35. Calculate the highest common factor of p and a. 7 Let m(v) = -v3 + 11v*2 - 5v - 2. Let l be m(4). What is the greatest common factor of l and 108? 18 Let t(v) = 5v - 8 - 3v - v. Let o be (55/15 + -3)/((-4)/(-72)). Let i be t(o). What is the highest common factor of i and 44? 4 Suppose 0 = 3r + 3j - 15, 3r - 4r = -2j - 20. Calculate the highest common factor of r and 13570. 10 Suppose 0 = -o - 4t + 72, -14t + 52 = o - 15t. Let z(f) = 6f - 3. Let r be z(4). What is the greatest common factor of o and r? 7 Let j(r) = -2r*2 - 2r + 4. Let y be j(0). Suppose 0 = 5d - yh - 255 - 185, h = -5. What is the highest common factor of 21 and d? 21 Let a be 33147/5 - 168/(-280). Calculate the highest common factor of a and 30. 30 Let f = 42 + -38. Let a be f((-42)/(-8) - 4). Let n(l) = 41l + 4. Let o be n(1). What is the highest common divisor of a and o? 5 Suppose -3t = j - 13755, 6032 = 3t + 19j - 7723. Calculate the highest common divisor of t and 315. 35 Let r(t) = -t2 + 2t + 38. Let c be r(6). Suppose -5o - 90 = -5y, 14y = 11y + 2o + 57. Calculate the highest common factor of c and y. 7 Let x = -19210 - -29052. What is the highest common factor of 38 and x? 38 Suppose 3y = -36x + 38x + 96, -y = 2x - 16. Calculate the highest common factor of y and 525. 7 Let r = -184 + 228. Suppose -5w - r = -364. Calculate the highest common factor of 192 and w. 64 Let q(i) = -12i - 23. Let n be q(4). Let w = n + 100. Suppose 3b - 5o = w, 0b - b - 3o + 33 = 0. Calculate the greatest common divisor of 6 and b. 6 Suppose 135l - 1382 = 1588. Let k = 0 + 5. Suppose -ki + 6 = -49. Calculate the greatest common divisor of i and l. 11 Let p = -201 - -203. Suppose -c + 3 = -2h + h, 0 = pc + 4h - 30. What is the greatest common divisor of c and 49? 7 Let b(n) = 132n2 - 3n - 5. Let x be b(-2). Let u = x - 489. What is the highest common factor of u and 48? 8 Suppose 2b - 86 = 4v, 25v = 4b + 28v - 183. What is the highest common divisor of b and 345? 15 Let m be ((-2)/3)/((-3)/18). Suppose -my = 7 - 23. Suppose 0 = yz - 43 - 65. Calculate the greatest common factor of z and 27. 27 Let f be ((-9)/6)/((-3)/(-6)). Let t be -69(f + (-20)/(-6)). Let k = 49 + t. What is the highest common factor of 130 and k? 26 Suppose z - 6 = 0, 38r = 35r + 4z + 2760. What is the highest common divisor of r and 3944? 232 Suppose 5s + 16 + 57 = 4y, -4y + s + 53 = 0. Suppose -39x + 378 = -yx. Calculate the greatest common divisor of 182 and x. 14 Suppose 2s = 15s - 8424. Calculate the greatest common factor of s and 8. 8 Suppose y - 304 = -3k, -170 = -3y - 3k + 712. Suppose d + y = 2c, 5d = -5 - 10. Calculate the highest common factor of c and 26. 13 Let j be (1/((-21)/(-180)))/(3/315). What is the greatest common factor of 84 and j? 12 Let v be 21 + (-36)/9. Let b be (0/(1/1))/v. Let h(i) = -i*2 - 5i + 15. Let m be h(b). What is the greatest common divisor of m and 120? 15 Suppose 21979 = 3l + u, -12l + 15l = 4u + 22004. Calculate the highest common divisor of l and 32. 32 Suppose 0 = 3s + 132 + 60. Let i = s + 104. Let j be (18/(-15))/((-2)/i). What is the greatest common divisor of 60 and j? 12 Let p be 0/3 + (0 - (-1 - 2)). Suppose -pc - 19 = -187. Let o = c - 55. What is the highest common factor of 9 and o? 1 Let x = 3195 + -2760. What is the greatest common divisor of 1595 and x? 145 Let n(z) = 2z2 + 2z + 3. Let s be n(5). Let k(v) = v*2 - 147v - 2743. Let y be k(-17). What is the greatest common factor of y and s? 9 Let c be (-4)/(-14) - (-44272)/(-112). Let i = 563 + c. Calculate the greatest common factor of 84 and i. 84 Suppose -64g - 1671 = -2375. Calculate the highest common divisor of g and 23562. 11 Let p = 5478 + -5415. Let h(b) = -16b - 5. Let x be h(-2). Calculate the highest common divisor of x and p. 9 Let f = 152 + -147. Suppose -n = -5n + 3c + 503, fc - 399 = -3n. What is the highest common factor of n and 48? 16 Suppose 3p - 104700 = -3a, 283p - 282p + 3a - 34916 = 0. What is the highest common factor of 88 and p? 44 Let k be ((-16)/(-10))/(136/5780). What is the greatest common divisor of 8228 and k? 68 Let w(s) = -5s + 292s2 + 2s + 56 + 10s + 16s + 4s. Let a be w(-2). Calculate the greatest common divisor of a and 90. 90 Suppose -2y - 78 = 4y. Let t(h) = 21 + 241254h - 241266h - h2 + 13. Let k be t(y). Calculate the greatest common divisor of 3 and k. 3 Let w(a) = -11a. Let f be w(1). Let h be (2 + (-32)/6)/(f/132). Suppose h = 2l - g, -l = g + 2g - 13. What is the highest common divisor of l and 57? 19 Let y = -3823 - -3836. What is the highest common divisor of 8840 and y? 13 Let u be ((-34)/681)/((-2)/16). What is the greatest common factor of u and 4868? 4 Let w be (182/(-35))/(1/20). Let q = w - -126. Let h = 3 + -1. What is the greatest common factor of q and h? 2 Suppose -3u + 11 - 205 = -4p, 2u = p - 46. Suppose 15*w = -331 - 344. Let l = w + p. Calculate the greatest common divisor of l	{ "pile_set_name": "DM Mathematics" }
is 1662 take away 1? 1661 -9 - 20.3 -29.3 Add 66 and -7.7. 58.3 What is -1 - 43921? -43922 Subtract -0.005 from -41. -40.995 What is the difference between 4 and 4856? 4852 5+-0.75 4.25 What is -138151 - -4? -138147 What is 26 + -0.21? 25.79 What is the distance between 5 and 419881? 419876 27162.1 + 0.2 27162.3 What is the distance between 16 and -0.1058561? 16.1058561 66.73+-3 63.73 What is -0.09 - 17.7? -17.79 Add 1.431 and 1. 2.431 What is 927610 less than 0.5? -927609.5 Calculate 13868 - -40. 13908 What is 3446 take away 0.1? 3445.9 0.167 + 0.821 0.988 Calculate -77 - -16. -61 0.55 + 438 438.55 Total of 1.0929 and 6. 7.0929 What is the distance between 0.15285 and 11? 10.84715 Work out 2.2759 + -5. -2.7241 What is 39 - 0? 39 Sum 36528 and -111. 36417 Subtract 48 from -1.634. -49.634 Work out 0 - 0.185. -0.185 What is -2 take away -922.9? 920.9 Calculate -0.2 + 47.9. 47.7 0.4 - 3922.34 -3921.94 What is -18 plus -1.19338? -19.19338 What is the difference between 0.215 and -21? 21.215 What is 23404 less than 5? -23399 Calculate -512007 - -5. -512002 What is 0.1 - -1686.78? 1686.88 Put together -7791 and 0.3. -7790.7 -0.134+0.3173 0.1833 What is -9063 take away -0.04? -9062.96 17+-375 -358 Add together 0.02338 and 4. 4.02338 What is -44.31 + 0.4? -43.91 Add 4.6311 and -0.01. 4.6211 What is 3062 less than 15? -3047 -23 - -22 -1 Work out -0.2 - -265272. 265271.8 Total of 748 and -69. 679 Calculate 1 - -247. 248 Subtract 0.2 from -0.087. -0.287 What is 1.7 less than 0.43126? -1.26874 What is -0.206 minus -0.08? -0.126 What is the distance between 48 and -28? 76 Calculate -0.5 - -2055. 2054.5 What is the distance between 3 and -7.33? 10.33 What is -2218 minus -1? -2217 What is -4 - 22.1211? -26.1211 Work out -0.1472 - 1.4. -1.5472 What is 1 less than -1487.3? -1488.3 Put together 0.029563 and 0.2. 0.229563 -0.1 - 0.874 -0.974 Total of 0.5 and 2294. 2294.5 Calculate -2266 - -0.2. -2265.8 What is 366 plus 1.205? 367.205 What is -112543 - -35? -112508 Add -0.12 and -4319. -4319.12 What is -13037 - -0.4? -13036.6 Calculate 0.3 + -69.981. -69.681 What is the difference between 61.6 and 0.242? 61.358 Add together -270 and -0.008. -270.008 Sum -0.4 and 84. 83.6 Put together 0.03 and -23041. -23040.97 What is the difference between -0.01 and -151.2? 151.19 Work out -0.3 - 486. -486.3 Work out 0.8 - -760587. 760587.8 What is 0.607 less than -0.05987? -0.66687 Subtract 1577 from -3.5. -1580.5 Total of 0.21 and 157. 157.21 What is the distance between 32.177 and -2? 34.177 What is the distance between 28 and -0.4? 28.4 What is 0.03 - 46474? -46473.97 What is 0.066 plus -47? -46.934 Work out 4617918 + -2. 4617916 Total of -2657 and 0.0683. -2656.9317 What is -122 less than 89.2? 211.2 -0.1 - -138.8437 138.7437 Sum 3948 and 0.08. 3948.08 Calculate -0.2 - -1393. 1392.8 Calculate -1.71 - -0.04. -1.67 What is the difference between -2105 and -0.3? 2104.7 Add 0.5 and -11.37. -10.87 -2.96378 - 1 -3.96378 What is 3 take away 687? -684 What is the difference between 484 and -8? 492 What is -0.08 - -4384? 4383.92 What is 9 take away -268? 277 What is -4.3 plus 0.42? -3.88 What is -0.014 plus -263.93? -263.944 What is -787825 - 0.5? -787825.5 What is 6 - 4.571? 1.429 What is -186478 minus 4? -186482 Subtract 57 from -1.65. -58.65 Total of -9151 and -2. -9153 Calculate -97 - -0.0847. -96.9153 Put together 302 and 76. 378 Work out 5 - 83.92. -78.92 Total of -0.2602 and 9.3. 9.0398 -118.4 - 0.3 -118.7 Work out 1224 - -163.8. 1387.8 What is -0.03386 plus 0.3? 0.26614 Work out -0.3 - -173097. 173096.7 Calculate -0.3 - 976402. -976402.3 0.06 + -5725 -5724.94 Calculate -14993 + 0.98. -14992.02 What is -70 take away 2.2? -72.2 Add -648056 and -2. -648058 What is -743049 less than 6? 743055 Subtract 129 from 4. -125 Total of 453 and -88. 365 Work out -0.5547 + -3. -3.5547 344.6556 + -4 340.6556 Total of -1921 and -77. -1998 What is the distance between 24 and -80274? 80298 What is -2 - -2.6418? 0.6418 Calculate -14108.1 + -0.5. -14108.6 What is -0.336 take away 0.032? -0.368 Calculate -0.8 - -3153. 3152.2 Work out -0.192 - -0.078. -0.114 Work out 0.2 + 145971. 145971.2 What is -0.7 + 195? 194.3 What is -0.09 plus 0.01536? -0.07464 Total of -2 and -66.4631. -68.4631 410 - 2 408 What is 0.052 take away 2.2? -2.148 -64+-0.15 -64.15 What is 4990 take away 8? 4982 Work out -60691 + 50. -60641 Add -0.3 and 515. 514.7 Work out 0.1 - -597. 597.1 1357.7 + -4 1353.7 What is 32 less than 14? -18 41.82+-0.5 41.32 Calculate 0 + 4.411. 4.411 Add together 130 and -9. 121 Work out -85 - -13473. 13388 Put together -148.2382 and -3. -151.2382 Calculate -107 + -55. -162 Sum 0.4 and 0.604. 1.004 What is 294 minus 85.73? 208.27 Total of -0.3497 and 64. 63.6503 Calculate -0.2 + 2603. 2602.8 Add 0.28 and 2.43. 2.71 What is -182 less than -0.4? 181.6 Calculate -0.3 - 12681. -12681.3 -4 - -0.068271 -3.931729 What is -567 plus 3755? 3188 What is -73201 + 6? -73195 What is the difference between -153 and -0.8502? 152.1498 What is 241 plus -0.03? 240.97 2151 - 1.4 2149.6 What is -5.0994 plus -0.5? -5.5994 Calculate 1.64 - 1.1. 0.54 Calculate 0.6 - 2.262. -1.662 Work out -9 + 1041. 1032 Total of 1.44 and 101.5. 102.94 What is the distance between 0.2 and 7182.5? 7182.3 Add together 0.15 and -24. -23.85 -9 - 42882 -42891 Subtract -3 from -90.786. -87.786 Calculate 1.1234 + -0.7. 0.4234 What is 7231 take away 5? 7226 Total of -17 and -20834. -20851 0.2+462 462.2 -527479 - -0.5 -527478.5 What is -64 + -4.1364? -68.1364 Work out 2.6563307 - -0.2. 2.8563307 What is -0.598814 minus 4? -4.598814 Add together -0.845 and -5. -5.845 Calculate 11616782 - -0.2. 11616782.2 0.5+73.466 73.966 What is the distance between -245 and -8.5? 236.5 Add together -0.509 and 169. 168.491 Sum 4 and -2.946. 1.054 What is the distance between -0.19 and -234? 233.81 Add 6.4 and 135. 141.4 Put together -6617 and -0.489. -6617.489 Add together -4 and 34875. 34871 What is the difference between -1.2 and -2801? 2799.8 Calculate 947429 + 0.4. 947429.4 What is -2844 - 0.06? -2844.06 What is 65 less than -170? -235 -35 - -325 290 What is -0.109 plus -0.301? -0.41 -801+0.3 -800.7 Work out 0.2 - 342092. -342091.8 What is -0.5 less than 5.0271? 5.5271 Add -4.9 and -28014. -28018.9 Work out -432.4 - 0. -432.4 Work out 0.6 - -895. 895.6 What is -4.624 + 16? 11.376 Work out -15 - 30. -45 Work out -8.31 - 0.4. -8.71 What is the distance between 3218 and -62.8? 3280.8 Put together 133 and 129. 262 What is -18378 + 31.4? -18346.6 Work out 0.927 - -2861. 2861.927 What is 7732 less than -0.027? -7732.027 Sum 3.3 and -19232. -19228.7 What is -0.2 take away 0.510041? -0.710041 Total of 4862 and 2. 4864 What is 0.14 + 147070? 147070.14 Calculate 12254 - -3.2. 12257.2 What is the difference between 0.105 and -0.3? 0.405 Calculate -6033 - -1. -6032 What is 2 minus -7.21? 9.21 Work out -5 + 2044. 2039 Work out -3.61 + 24986. 24982.39 What is 0.54 minus 4.5? -3.96 0.81+0.5913 1.4013 Calculate -110129 - -12. -110117 -345 + -0.002 -345.002 What is the difference between -328.5 and -0.46? 328.04 What is -752.9 + -0.3? -753.2 Calculate 7.76 + 0.5. 8.26 Add together 3.152 and -6. -2.848 What is -0.3 plus 2260? 2259.7 What is 68961 less than 2.4? -68958.6 Subtract -0.2261 from -0.4. -0.1739 What is 1 plus -947? -946 What is -0.5 take away 0.03597? -0.53597 What is -0.13511 less than 6? 6.13511 Add 0.026 and 34. 34.026 What is 80 less than 0.4? -79.6 Work out -92.9728 - -0.1. -92.8728 What is -147360 plus 4? -147356 Add 3299.3 and 0.01. 3299.31 What is -197530 - -2? -197528 What is -113 plus -7? -120 Put together -18.482 and -0.06. -18.542 15+-2 13 0.923+18 18.923 -321832 - 0.3 -321832.3 What is the difference between -0.2 and -787? 786.8 Subtract -23 from 0.11. 23.11 What is -1482 minus 2567? -4049 -0.3 - 0.0432 -0.3432 3+258.5 261.5 -102185+-4 -102189 Add -0.1 and -1359. -1359.1 Add together 2365.162 and -3. 2362.162 What is 43 + -125? -82 Calculate -0.4 - 0.1075672. -0.5075672 What is -0.1 less than 2349? 2349.1 What is the difference between 41490 and 3? 41487 -4.0402+-19 -23.0402 Work out 0.52 - -3.53. 4.05 0.2617+2 2.2617 Add 0.1 and -100.499. -100.399 What is 3226 less than 0? -3226 What is the distance between -29.04 and 0.247? 29.287 Sum -897 and 7.	{ "pile_set_name": "DM Mathematics" }
four dps. -0.0074 What is 42.99061 rounded to two dps? 42.99 What is 0.0003374259 rounded to 4 decimal places? 0.0003 What is -1.479711 rounded to three dps? -1.48 Round -85.78305 to two dps. -85.78 Round 0.00028591066 to seven dps. 0.0002859 Round -2476.141 to the nearest 1000. -2000 Round -0.0211539 to 3 dps. -0.021 What is 0.000533822 rounded to six decimal places? 0.000534 Round 423.892 to the nearest 100. 400 What is -0.00004340113 rounded to 7 dps? -0.0000434 Round -0.001837784 to six dps. -0.001838 Round -11054858000 to the nearest 1000000. -11055000000 What is 56.3422 rounded to one dp? 56.3 Round -452.5704 to the nearest 100. -500 Round 142599200 to the nearest one million. 143000000 Round 0.0000104845 to four dps. 0 Round -7.186212 to zero dps. -7 What is -2820.619 rounded to the nearest 100? -2800 Round -6297.035 to the nearest 100. -6300 Round -1207381 to the nearest 10000. -1210000 Round 18044690 to the nearest one million. 18000000 What is -117830 rounded to the nearest 1000? -118000 Round -13.63964 to 1 dp. -13.6 What is 9.81452 rounded to the nearest integer? 10 What is 0.4932205 rounded to four dps? 0.4932 What is -0.000890121 rounded to 5 dps? -0.00089 What is 0.0002321286 rounded to 3 dps? 0 What is 0.985059 rounded to 3 dps? 0.985 What is -12.146898 rounded to one decimal place? -12.1 What is 47.6398 rounded to the nearest ten? 50 What is -212.132 rounded to zero decimal places? -212 What is -1.452059 rounded to two decimal places? -1.45 What is 0.3734153 rounded to 1 decimal place? 0.4 Round 0.2570731 to two dps. 0.26 Round 0.409348 to one dp. 0.4 What is 713.25 rounded to the nearest one hundred? 700 Round -0.00000408117 to seven dps. -0.0000041 What is 1123085.6 rounded to the nearest ten thousand? 1120000 Round -371560000 to the nearest 1000000. -372000000 Round -0.000875121 to four dps. -0.0009 What is 53146 rounded to the nearest 1000? 53000 What is 7551.38 rounded to the nearest one hundred? 7600 What is 11569.246 rounded to the nearest 10? 11570 What is 977324300 rounded to the nearest 100000? 977300000 Round 2059380000 to the nearest one million. 2059000000 Round -8891690 to the nearest ten thousand. -8890000 Round -527412400 to the nearest 1000000. -527000000 Round 2312609 to the nearest 100000. 2300000 Round -0.000004285469 to seven dps. -0.0000043 What is -14043.24 rounded to the nearest one hundred? -14000 What is 0.013347816 rounded to three decimal places? 0.013 What is 1.51922 rounded to 1 dp? 1.5 What is 0.0230611 rounded to 3 dps? 0.023 What is 0.2482928 rounded to 3 dps? 0.248 Round 643060.8 to the nearest 100000. 600000 Round 0.0180297 to three decimal places. 0.018 What is -13277800 rounded to the nearest one hundred thousand? -13300000 What is 4968.533 rounded to the nearest 100? 5000 Round -2352.39 to the nearest one hundred. -2400 Round -320053 to the nearest 100000. -300000 Round -0.0003202704 to 6 decimal places. -0.00032 Round -833.657 to 0 decimal places. -834 Round 226.30941 to the nearest ten. 230 Round 0.0000008991497 to 7 dps. 0.0000009 What is -53.006159 rounded to two dps? -53.01 What is -886640 rounded to the nearest ten thousand? -890000 Round 5442760 to the nearest ten thousand. 5440000 What is -0.000025639931 rounded to six dps? -0.000026 What is -0.000299377 rounded to five decimal places? -0.0003 Round -5698.31 to the nearest 100. -5700 What is -0.200059 rounded to two decimal places? -0.2 Round 0.0000227637 to 6 dps. 0.000023 What is 2091317.1 rounded to the nearest ten thousand? 2090000 What is 63637.9 rounded to the nearest 1000? 64000 What is 1.5496851 rounded to two decimal places? 1.55 Round 129240.4 to the nearest 100. 129200 What is 0.0000406751 rounded to 5 decimal places? 0.00004 What is -0.000016926349 rounded to seven decimal places? -0.0000169 What is -11169200 rounded to the nearest one million? -11000000 Round 0.008628222 to six decimal places. 0.008628 What is -711137.9 rounded to the nearest ten thousand? -710000 Round 107.585 to 1 dp. 107.6 What is 250545.7 rounded to the nearest 10000? 250000 What is -74.27 rounded to the nearest 100? -100 What is -3.49676 rounded to 0 dps? -3 Round 45881.454 to the nearest one hundred. 45900 What is -274067 rounded to the nearest 1000? -274000 Round 35557749 to the nearest one hundred thousand. 35600000 Round 20656.277 to the nearest 1000. 21000 Round -35912 to the nearest 10000. -40000 What is 1001.098 rounded to zero dps? 1001 Round 370.68 to the nearest 1000. 0 What is 3938689 rounded to the nearest 1000? 3939000 What is -0.892048 rounded to 2 decimal places? -0.89 Round 470.7875 to zero decimal places. 471 What is 0.00000702862 rounded to 7 dps? 0.000007 Round 46883200 to the nearest 100000. 46900000 Round -0.0376105 to four decimal places. -0.0376 Round 23807.56 to the nearest 100. 23800 Round -1.744407 to 2 dps. -1.74 Round -254698.3 to the nearest ten thousand. -250000 What is -364118.9 rounded to the nearest ten thousand? -360000 Round 0.0006792104 to 4 decimal places. 0.0007 Round 5528200 to the nearest 1000000. 6000000 What is -0.03174 rounded to 1 dp? 0 What is 0.00966829 rounded to 3 decimal places? 0.01 What is -238.9086 rounded to the nearest one hundred? -200 What is -2987915 rounded to the nearest 100000? -3000000 Round 0.164595 to two dps. 0.16 Round -91.561 to 0 decimal places. -92 What is 14768.258 rounded to the nearest 100? 14800 What is -946.2725 rounded to 0 dps? -946 What is -0.0000334053 rounded to seven dps? -0.0000334 Round 0.0001916779 to five decimal places. 0.00019 Round 2.4944711 to two dps. 2.49 What is 20.810027 rounded to two decimal places? 20.81 Round 0.09389688 to 3 dps. 0.094 Round 0.0884079 to two dps. 0.09 Round 0.00009910823 to six decimal places. 0.000099 Round -345.9275 to the nearest one hundred. -300 What is -0.0000414646 rounded to six decimal places? -0.000041 What is 447534900 rounded to the nearest one million? 448000000 Round -9101679 to the nearest 1000000. -9000000 What is 0.000004413413 rounded to 7 dps? 0.0000044 Round 4092230 to the nearest 100000. 4100000 What is 0.905252 rounded to 2 dps? 0.91 Round -0.0001409279 to 7 decimal places. -0.0001409 What is 42.26806 rounded to zero decimal places? 42 Round -0.00443269 to 5 decimal places. -0.00443 What is -45003.09 rounded to the nearest 10? -45000 What is 130.8784 rounded to 1 dp? 130.9 Round 0.00118652 to 4 decimal places. 0.0012 What is 0.640425 rounded to three dps? 0.64 What is 84.22 rounded to zero dps? 84 What is -4.028852 rounded to 2 decimal places? -4.03 What is 0.000005698714 rounded to 7 dps? 0.0000057 Round -25.706846 to two dps. -25.71 What is 3355.927 rounded to the nearest 100? 3400 What is -140572 rounded to the nearest ten thousand? -140000 What is 162563.1 rounded to the nearest 100? 162600 Round -0.0000025029693 to seven dps. -0.0000025 What is 64489.3 rounded to the nearest one thousand? 64000 Round 0.00002075698 to seven dps. 0.0000208 Round -8.651925 to 1 dp. -8.7 What is -0.0001247944 rounded to six decimal places? -0.000125 Round -0.00001076585 to six dps. -0.000011 Round 0.0461119 to two decimal places. 0.05 What is 0.1141403 rounded to 2 decimal places? 0.11 Round 11115.92 to the nearest ten. 11120 What is 4.19057 rounded to two dps? 4.19 Round -1931.0653 to the nearest ten. -1930 Round -115376.84 to the nearest one hundred. -115400 What is -0.0054013 rounded to 4 dps? -0.0054 What is 384.6692 rounded to the nearest integer? 385 What is -0.00576267 rounded to five dps? -0.00576 What is -5429.219 rounded to the nearest one hundred? -5400 What is 1776355 rounded to the nearest ten thousand? 1780000 What is -5720306 rounded to the nearest one million? -6000000 What is -71458.27 rounded to the nearest one hundred? -71500 What is -14416468 rounded to the nearest 1000000? -14000000 What is -859147 rounded to the nearest 10000? -860000 Round 134341900 to the nearest 100000. 134300000 What is 0.002717195 rounded to three decimal places? 0.003 Round 0.710955 to 1 dp. 0.7 What is 19.9446 rounded to two dps? 19.94 Round 3394.3 to the nearest 1000. 3000 What is -0.637999 rounded to 1 decimal place? -0.6 Round 1988245000 to the nearest one million. 1988000000 What is -0.1124429 rounded to three dps? -0.112 What	{ "pile_set_name": "DM Mathematics" }
t(176)). -sqrt(11) + 1585 Simplify (sqrt(99) + (sqrt(99) - (0 + sqrt(99))) + -5 + 1(sqrt(99) - sqrt(99)-2) + sqrt(99))*2. -150sqrt(11) + 2500 Simplify (sqrt(2) - sqrt(8)/sqrt(4))33. 0 Simplify -2 + (sqrt(13) + sqrt(52) + -4 + 2)1. -4 + 3sqrt(13) Simplify -5(sqrt(17) - 1(sqrt(17) + 1)). 5 Simplify 4 + sqrt(36)/((2sqrt(132))/sqrt(11)). sqrt(3)/2 + 4 Simplify (sqrt(343) + sqrt(343)24)2. 27783 Simplify (sqrt(3) - (1 + sqrt(243)))2 - (-3 + -4sqrt(3) - sqrt(3) - sqrt(3)). 22sqrt(3) + 196 Simplify 6(sqrt(2) - -3(sqrt(2) + 0)). 24sqrt(2) Simplify -4(3 + sqrt(17)) + sqrt(17) - (2 + sqrt(1088) + sqrt(1088) - sqrt(1088)). -11sqrt(17) - 14 Simplify (sqrt(13)36 + (4 + sqrt(13))5)2. 920sqrt(13) + 7277 Simplify ((sqrt(77) + 1sqrt(77) + sqrt(77))6)/((sqrt(110) + sqrt(110) + (sqrt(110)-2 - sqrt(110)))/sqrt(10)). -18sqrt(7) Simplify (sqrt(102) + (sqrt(102) - (sqrt(102) - (6sqrt(102)1 - sqrt(102)))) + sqrt(102))/(sqrt(192)/sqrt(8))-2. -7sqrt(17) Simplify (sqrt(1100) + (sqrt(1100) + -2sqrt(1100))2)6. 60sqrt(11) + 6600 Simplify ((sqrt(88)-4-3)/sqrt(11))2. 1152 Simplify (sqrt(1008) + (-22sqrt(1008))2)-5. -80640 - 60sqrt(7) Simplify ((1 + sqrt(396))6)*2. 432sqrt(11) + 14292 Simplify (sqrt(2450) + sqrt(2450)1)2. 9800 Simplify (sqrt(220)/sqrt(4))/sqrt(11) - -4(sqrt(5) + 2). 8 + 5sqrt(5) Simplify (sqrt(117) + (sqrt(117) - -5sqrt(117)) + sqrt(117))/sqrt(9) + 2(sqrt(13) + sqrt(13) + sqrt(52)). 16sqrt(13) Simplify (sqrt(17) - (-1 + sqrt(17)2))2 + (sqrt(153)1)/sqrt(9) + 4. -sqrt(17) + 22 Simplify -5 + -6(-1 + (2sqrt(833))*2). -19991 Simplify (sqrt(304) + sqrt(304) + 1)1 + (sqrt(304) - 4(0 + sqrt(304))2 - sqrt(304)). -1215 + 8sqrt(19) Simplify ((1sqrt(833) + -4)2)*2 + 0. -224sqrt(17) + 3396 Simplify -4(1 + 3 + sqrt(25)/sqrt(80))2. -261/4 - 8sqrt(5) Simplify 5 + (0 + (sqrt(8)/sqrt(4) - sqrt(2) - sqrt(2)) + sqrt(2))*2. 5 Simplify ((sqrt(13) + sqrt(1053)-1 + sqrt(13) + (sqrt(117)-1)/sqrt(9))1)*2. 832 Simplify 4(-3 + (sqrt(19) + 1)*2). 8sqrt(19) + 68 Simplify (sqrt(77) - (-1sqrt(77)1 + sqrt(77)) - sqrt(77))/(sqrt(70)/sqrt(250)). 0 Simplify sqrt(4)/(sqrt(6)/sqrt(3)) + -1 + -2. -3 + sqrt(2) Simplify 3 + sqrt(1539) + 4. 7 + 9sqrt(19) Simplify 0 + -1 + sqrt(5) + 0. -1 + sqrt(5) Simplify sqrt(40)/(sqrt(1152) + ((sqrt(1152) - (sqrt(1152) + sqrt(1152) + 1sqrt(1152))) + sqrt(1152) - sqrt(1152)) + sqrt(1152) - sqrt(1152)) + 5. -sqrt(5)/12 + 5 Simplify (2sqrt(272)-1 + (sqrt(272)2 + 5 - sqrt(272)))2. -40sqrt(17) + 297 Simplify sqrt(7)46 - (-2 + (sqrt(28))*2). -26 + 24sqrt(7) Simplify -4sqrt(126)/sqrt(2). -12sqrt(7) Simplify -4(4 + sqrt(51)/sqrt(3)). -4sqrt(17) - 16 Simplify (sqrt(16)/sqrt(2)-3)/(-3sqrt(196)). sqrt(2)/7 Simplify (-2 + (1 + sqrt(1900))*2 + -4)-3. -5685 - 60sqrt(19) Simplify 2 + (sqrt(117) - (sqrt(117) - -42sqrt(117)) - sqrt(117))/(sqrt(9) + -2sqrt(900) + sqrt(9)). sqrt(13)/2 + 2 Simplify (sqrt(84)1)/((-1sqrt(27))/sqrt(9)). -2sqrt(7) Simplify sqrt(24)/(sqrt(392)3). sqrt(3)/21 Simplify -3-6(1sqrt(19))2. 342 Simplify (5 + sqrt(704) + -1 + sqrt(1584)1 + 5)*2. 360sqrt(11) + 4481 Simplify ((sqrt(242) - -2sqrt(242))/sqrt(11))/(sqrt(22)/(sqrt(2)-1)). -3sqrt(2) Simplify ((sqrt(3) + sqrt(3)-2-6 + sqrt(3))-4)*2. 9408 Simplify ((sqrt(65) + sqrt(65) + (sqrt(65) - (sqrt(65) + -1(sqrt(65) - sqrt(65)1) + sqrt(65))))/((sqrt(120)/sqrt(6) + sqrt(20))/sqrt(4)))2. 13/4 Simplify 4-6(-2 + sqrt(18))2. -528 + 288sqrt(2) Simplify 2 + sqrt(3) + 4 + sqrt(6)/sqrt(2) + -3. 3 + 2sqrt(3) Simplify -6sqrt(38)/sqrt(2) - 4sqrt(38)/sqrt(2). -10sqrt(19) Simplify (((sqrt(66) - (sqrt(66)1 + sqrt(66))1) + sqrt(66))/(sqrt(6) - (sqrt(30)/sqrt(5)6 - sqrt(6))))2. 0 Simplify -4((sqrt(180) - (-1 + 1sqrt(180))2) + 0). -72sqrt(5) + 724 Simplify 6(-2 + 2sqrt(396)). -12 + 72sqrt(11) Simplify -5 + sqrt(1100) + 4 + 0. -1 + 10sqrt(11) Simplify -2 + (sqrt(95) - -3sqrt(95)4)/sqrt(5). -2 + 13sqrt(19) Simplify (1sqrt(720))*2 + -5. 715 Simplify (-1(sqrt(216)/sqrt(9) - sqrt(24)))/sqrt(8). 0 Simplify 5 + (sqrt(847) - (-1sqrt(847) - sqrt(847))2). -3383 + 11sqrt(7) Simplify -3 + (sqrt(125)6 + sqrt(5))2. 4802 Simplify ((-1sqrt(90))/sqrt(2))*2. 45 Simplify -3(sqrt(147) + (sqrt(147)-35)*2). -99225 - 21sqrt(3) Simplify (sqrt(76))*2-6 + (sqrt(38)/sqrt(2)-5)2. 19 Simplify (sqrt(3) - (5-1sqrt(3) - sqrt(3)))2 + -3sqrt(3)-5 + 1. 15sqrt(3) + 148 Simplify ((sqrt(2) + 2)-6 - 2sqrt(200))*2. 624sqrt(2) + 1496 Simplify sqrt(76)-3-4. 24sqrt(19) Simplify -5 + sqrt(2)-2 - (sqrt(22)1 + sqrt(22))/sqrt(11). -4sqrt(2) - 5 Simplify (sqrt(700) - (sqrt(700) - sqrt(700)-2)2)-5 + 0. -50sqrt(7) + 31500 Simplify sqrt(520)/sqrt(10) + 1 + sqrt(1053). 1 + 11sqrt(13) Simplify (4(sqrt(612) + -1(-1 + sqrt(612)) + sqrt(612) + sqrt(612)) + 3)*2. 672sqrt(17) + 39217 Simplify sqrt(1700) + sqrt(1700) + -1 + ((sqrt(17)-1 + sqrt(17))4)*2. -1 + 20sqrt(17) Simplify (-1 + sqrt(637) + sqrt(637)-4 + 4)2. -126sqrt(13) + 5742 Simplify sqrt(143)/(sqrt(11) + (sqrt(11) - (sqrt(11) + sqrt(11) + (sqrt(11) - sqrt(539))))) + 5. sqrt(13)/6 + 5 Simplify (-2 + 1 + sqrt(1452))*2. -44sqrt(3) + 1453 Simplify (sqrt(5) - ((sqrt(500) + 4 + sqrt(500) + sqrt(5))*2 + sqrt(5))) + (5 + sqrt(5)-4 - sqrt(5)). -2216 - 173sqrt(5) Simplify (sqrt(156)/(-1sqrt(12) - sqrt(12)) - sqrt(1573)-1) + -2. -2 + 21sqrt(13)/2 Simplify -1sqrt(18)/sqrt(6) + (0 + sqrt(48) - sqrt(48)). -sqrt(3) Simplify (1 + -1 + sqrt(35)/sqrt(5))-2. -2sqrt(7) Simplify (sqrt(1573) + 2 + sqrt(1573))5. 10 + 110sqrt(13) Simplify (sqrt(25) - 2sqrt(100))/(sqrt(20)4). -3sqrt(5)/8 Simplify 2 + (-5 + (sqrt(112))*2)45. 2142 Simplify 2 + (-4 + sqrt(98))2. -56sqrt(2) + 116 Simplify 1 + ((1 + sqrt(7))*2 + sqrt(7))6. 18sqrt(7) + 49 Simplify (1 + sqrt(91)/(-2sqrt(7)) + sqrt(13) + sqrt(26)/sqrt(2) + -3)*2. -6sqrt(13) + 133/4 Simplify (-4sqrt(12)/(3sqrt(24)))2. 8/9 Simplify (sqrt(88)/sqrt(288))2 - (1sqrt(11)-1)*2. -385/36 Simplify sqrt(33)/(sqrt(12)-3)-6. sqrt(11) Simplify -1(sqrt(5)-1-2 - sqrt(5)). -sqrt(5) Simplify sqrt(171)/(sqrt(900) + sqrt(900)2). sqrt(19)/30 Simplify (((-1 + sqrt(98))-1 - sqrt(98)) + 1)*2. -56sqrt(2) + 396 Simplify (-5sqrt(21)/sqrt(3))2 - sqrt(21)/sqrt(27). -sqrt(7)/3 + 175 Simplify 0 + 2 + sqrt(13) - (sqrt(52)/sqrt(4))2-2. sqrt(13) + 28 Simplify 5(sqrt(8) + 0 + 5). 10sqrt(2) + 25 Simplify -3(sqrt(228)26 - sqrt(228))/sqrt(12). -33sqrt(19) Simplify (sqrt(9) - -1sqrt(225))/(sqrt(3) - -6sqrt(3)-2). -6sqrt(3)/11 Simplify ((-3(1 + sqrt(162)) - sqrt(162))-3)*2. 1944sqrt(2) + 23409 Simplify 5(sqrt(405) + 2). 10 + 45sqrt(5) Simplify ((sqrt(88) - (sqrt(88) - (3((sqrt(88) - -1sqrt(88)) + sqrt(88) + sqrt(88)) + sqrt(88))) - sqrt(88)) + sqrt(88))/(sqrt(99)1). 26sqrt(2)/3 Simplify (sqrt(76) - (sqrt(76) + (sqrt(76) - 1-1sqrt(76))))/(sqrt(4) + ((sqrt(256) - (sqrt(256) - -2sqrt(256))) + sqrt(256) - sqrt(256)) - sqrt(4)). sqrt(19)/8 Simplify ((sqrt(70) + sqrt(70)-1)4 + sqrt(70))/sqrt(10). sqrt(7) Simplify (3(sqrt(252) + 4))*2. 432sqrt(7) + 2412 Simplify ((-5sqrt(65)-2)/(-1sqrt(605)))2. 1300/121 Simplify 1(1 + sqrt(468)). 1 + 6sqrt(13) Simplify (-5(sqrt(245) + 1 + sqrt(245) + sqrt(245) + -4 - (sqrt(245) + -1 + 2)))*2. -2800sqrt(5) + 24900 Simplify -5(0 + sqrt(288)). -60sqrt(2) Simplify -3((sqrt(52))2 + sqrt(13)) - (sqrt(325) + 1). -157 - 8sqrt(13) Simplify (sqrt(3) + 2 + 0 + sqrt(3) - (sqrt(3) + sqrt(108)-3))2. 76sqrt(3) + 1087 Simplify (sqrt(324)2)/(-61sqrt(2)). -3sqrt(2) Simplify sqrt(153)-3 - 4sqrt(68). -17sqrt(17) Simplify ((1sqrt(2240))/(4sqrt(7)-1))*2. 20 Simplify sqrt(77)/(2sqrt(275) + sqrt(275)). sqrt(7)/15 Simplify (sqrt(190) - ((1sqrt(190) - sqrt(190))-1 + sqrt(190)))/(sqrt(40)/(-2sqrt(4))). 0 Simplify ((2sqrt(156) + sqrt(156))-6)/((-1sqrt(12) - sqrt(12))-1). -9sqrt(13) Simplify 5(sqrt(11)-1)*2 + sqrt(11) + (4sqrt(1584))*2. sqrt(11) + 25399 Simplify 0 + (sqrt(1425)/sqrt(3) - (sqrt(228)-1 + sqrt(228) + sqrt(228))/sqrt(12)). 4sqrt(19) Simplify (2 + sqrt(75) + 5sqrt(3)-4)2. -60sqrt(3) + 679 Simplify sqrt(15)/(-6(sqrt(48) + sqrt(3))). -sqrt(5)/30 Simplify 1sqrt(5)*3 + sqrt(5) + sqrt(50)/sqrt	{ "pile_set_name": "DM Mathematics" }
- 0.11. Let q = -2.7 + y. What is the smallest value in q, -0.1, -5? -5 Let z be (3/((-24)/(-16)))/(7/(-2)). Let k = -0.3 + 4.3. What is the smallest value in k, z, -3/5? -3/5 Let v be (-1 + 3 + -2)/1. Suppose -t = -vt. Let p be (5 - (-234)/(-42))(-7)/6. What is the second biggest value in t, p, 4? p Let r = -0.1 - -0.1. Let q be 8/(-36) - (20/36)/5. Which is the biggest value? (a) q (b) -2/19 (c) r c Let z = 12 + -7.3. Let v = 4.95 - z. What is the biggest value in -2, -3, v? v Suppose 14g + 159 = -39g. Let w be (-4)/14 - 22/70. What is the second smallest value in w, 4, g? w Let f = 0.037 - -6.963. Let p = -5 + 4.99. Let o = p - 0.49. Which is the third smallest value? (a) o (b) -2/5 (c) f c Let o = -28/155 + 18/31. What is the second smallest value in -33/7, -0.1, -3/7, o? -3/7 Let q = -18 + 17. Let y be (2/18)/(20/24). Which is the third smallest value? (a) 5 (b) y (c) q a Let a = 671 + -670. What is the fourth smallest value in 4/3, 5/4, -0.3, a? 4/3 Let n(l) = -4l2 + 5l + 5. Let u be n(-1). Let m = 246 - 247. Suppose 0 = 2f + 2o - 2, 2f = 6f - o - 4. What is the third smallest value in u, f, m? f Let w = 17.922 - -0.078. Let n = w - 23. What is the fourth smallest value in -2/7, n, -1, 1? 1 Let g = 2 - 5.2. Let p = g - -3. Let z = 491 - 487. Which is the smallest value? (a) z (b) -3/5 (c) p b Let q = -572 + 574. Which is the smallest value? (a) 9/5 (b) q (c) 2.6 a Let o = 0 - -3. Let t = o + 0. Let k = 0.01 - -4.99. Which is the second biggest value? (a) t (b) k (c) -0.3 a Let u = 29/104 - 2/13. Let f = 20/3 + -58/9. What is the fourth smallest value in u, 1/9, 5, f? 5 Let w be (-11)/(33/(-420)) + (-4)/(-7). Let h = w - 141. What is the fourth biggest value in 2/7, h, -13, -4? -13 Let g = 73/10 - 39/5. Let f = 1 + -0.8. What is the second biggest value in 5, f, g? f Let y = -0.2 + 0. Let i = 179/255 - 3/85. What is the biggest value in 0.3, i, y, 1? 1 Let o = -43 + 40. Which is the third biggest value? (a) 8/3 (b) 3 (c) o c Let d = -7.61 + 7.91. Let z = 13 + -14.1. Let s = 0.15 + -0.55. Which is the third biggest value? (a) s (b) z (c) d b Let h = -4.935 + -1.065. What is the third biggest value in h, -4, 3? h Let o = -195 + 211. What is the second biggest value in o, 3, 4? 4 Let d = 0 - -30. Let x = d + -29.7. What is the third smallest value in x, -5, 8? 8 Let l be ((-3)/(-5))/(65/325). Which is the second smallest value? (a) -0.1 (b) l (c) 40 b Suppose 0 = 4r - 0r - 3t - 17, -5r + t = -13. Let i be (3/(-4))/(r/(-8)). Let l = 565 - 564.5. What is the third biggest value in i, -3/7, l? -3/7 Let j = -46.4 + -13.6. Let o = 65 + j. What is the second smallest value in 0.5, 2/9, o? 0.5 Let d = 36/11 + -158/55. What is the biggest value in 1, 3, d, -2/25? 3 Let n = 4045/4 + -1012. Which is the third smallest value? (a) n (b) -5 (c) 7 c Let o(l) = -5l2 + 2l - 1. Let b be o(1). Let a = -76 - -76.208. Let w = a + -0.108. What is the third biggest value in w, b, -5? -5 Let c be (((-396)/22)/(-36))/((-5)/2). Let n = 274/3 - 88. What is the second smallest value in -3, n, c? c Let d(k) = k*2 - 19k - 46. Let s be d(21). Which is the smallest value? (a) s (b) 2 (c) 252 a Let l = 191175 - 3640649/19. Let q = 438 + l. Let d = 0.1 - -0.9. What is the third smallest value in d, -0.2, q? d Let x = 265 + -793/3. What is the second biggest value in 9, 5, x, -4/5? 5 Suppose 3u = -4p + 17, -5u = -11p + 8p + 20. What is the second smallest value in -3, p, -0.2, -1/6? -0.2 Let y = -1.5 - -9.5. Let f = y - 12. Let z = -11 + 65/6. Which is the biggest value? (a) -3/7 (b) f (c) z c Let t be (-2)/(-3) - (-56)/6. Suppose -9o + 60 = -13o. Let j = t + o. Which is the second smallest value? (a) -0.1 (b) j (c) 0.1 a Let g = -0.3 + 0.5. Let n = -2372.7 - -2373. Which is the second biggest value? (a) g (b) n (c) 1/3 b Let f(x) = 4x + 1. Let u be f(1). Suppose -3o = -uo + 44. Suppose 0j = j + 3q - o, -2j - 1 = -3q. Which is the biggest value? (a) 5 (b) 1/2 (c) j c Let g = 0.125 - 0.225. Let c = 4.5 + -4. What is the second biggest value in g, c, -0.18? g Let k be -6(-4)/8 - 1. Let q be k/(-14) + 2/(-7). Let v = 20/39 - -2/13. Which is the third smallest value? (a) 1/4 (b) q (c) v c Let w = -4.244 + 0.044. Let a = -4 - w. Let g = -0.8 - a. What is the third smallest value in g, -2/13, 3? 3 Let r = 2/2775 + 2771/5550. Let k = 4 - 6. Let y = k - -1.8. What is the second smallest value in 0.2, y, r? 0.2 Let m = 52 - 52. Which is the smallest value? (a) m (b) 2/229 (c) 1/10 a Let p = -393 + 398. Which is the smallest value? (a) -10 (b) p (c) 6 a Let k be 2((-2)/(2/(-7)) + -5). What is the third biggest value in -2, -9, k, 5? -2 Let f = 2083 + -2104. Which is the second biggest value? (a) 1 (b) 4 (c) f a Let g = -82 - -151. Let s = 68 - g. What is the third smallest value in 9, 4, s? 9 Let f = -20 + 28. Let m = f - 7.7. Let j = 1.6 - 1.1. Which is the smallest value? (a) j (b) 7 (c) m c Let h = -28 + 17. Let y = h - -7. Which is the second biggest value? (a) 6 (b) y (c) 1/3 c Let t = -2106 + 2106.3. Let o = 5 + -2. Let a = o - 3. What is the third biggest value in t, 0.7, a? a Let n = 0.56 + -13.56. Let l = n - -13.2. Which is the biggest value? (a) 3 (b) l (c) 2/13 a Suppose 0q - 3v + 2 = q, 0 = q + 4v - 1. Suppose -qg - 6 = -1. Let s = -0.202 - -0.002. What is the biggest value in s, 4, g? 4 Let w = 28 - 25.9. Let l = w + -2.01. Let q = l + 0.41. Which is the second biggest value? (a) q (b) -7 (c) 1 a Let q = 519.1 - 519. What is the biggest value in q, 3, 2/11, -36? 3 Let t be -1(-10)/14 + (-784)/1372. Suppose -3q + 13 = 5h, -11 = -h - 3q - 6. Which is the second biggest value? (a) 5/4 (b) t (c) h a Let z = 1.51 + -4.51. Let l = -0.2 + 1.2. Let w = 0.26 + -0.16. Which is the third biggest value? (a) w (b) z (c) l b Let i = 2.31 - 0.21. Let q = i - 2.01. Let j = -0.69 - -1.09. What is the third biggest value in q, j, 0.3? q Let t = 254.99 - 254. Let w = t - 0.79. Let r = -29 + 44. Which is the smallest value? (a) w (b) 4 (c) r a Let t = 0.2 - 0.2. Let c = -1.901 + 1.401. What is the biggest value in t, c, 0.3, 2/43? 0.3 Let q = -5 + 5.1. Let i = -0.2 - q. Let m = -180 + 180.1. Which is the biggest value? (a) -0.1 (b) i (c) m c Let l be 2/(-4)5/(-10). Let a = 5.3 + 0.7. Let s = a - 5. What is the third smallest value in l, -2/9, s? s Let s = -225 + 207.3. Let y = -18 - s. Which is the smallest value? (a) y (b) 0.1 (c) -4 (d) -0.08 c Suppose 3z - 4z + 4 = 0. Suppose o - 12 = -o + 4p, 4p - 48 = -zo. Let h be 5/o(-8)/38. What is the smallest value in -2, h, 3? -2 Let x(r) = 3r*2 - r + 6. Let f be x(2). Let q = f - 17. What is the biggest value in -0.4, -1/3, q? -1/3 Let k = 1981 - 1981. What is the third smallest value in k, 1/13, -2/9, 4? 1/13 Let g be -4 + (-2)/(-22) - -4. Let z be -5 + ((-36)/(-16) - 6/24). Which is the second biggest value? (a) g (b) z (c) 0.5 a Let b = 0.014 + 0.386. What is the third biggest value in b, -2, -1? -2 Suppose -36 = 22p + 8. What is the third smallest value in -0.3, 0.08, p? 0.08 Let p = 31.4 + -33. Let k = p + 2.6. Let x = 1.3 + -1.1. What is the third biggest value in 4, k, x? x Let o = -0.0251 + 0.0551. Which is the third smallest value? (a) -1/2 (b) o (c) 1/8 c Let u = 0.21 + 0.79. Let y = 2 - 8. Let i = y + u. Which is the third smallest value? (a) 5 (b) i (c) 1 a Suppose -24d + 16 = -20d. What is the third biggest value in -4, d, 3/5? -4 Suppose -65 = -h + 22. Let i be (-5 + 1518/(-12))/(3/2). Let f = i + h. Which is the second smallest value? (a) f (b) -3 (c) 3 a Let v be (-1)/((-28)/56(-8 + 1)). Which is the third biggest value? (a) -117 (b) 1/3 (c) v a Let z = -311 + 310.73. Let q = 0.4 - 0.27. Let x = z - q. Which is the third biggest value? (a) -0.9 (b) x (c) 2 a Let f = 3 + -2. Let z = -7655 - -7657. Let d = -1 + 0.8. What is the biggest value in z, f, d? z Let t be 0/(4/(-14) - (-78)/(-21)). What is the biggest value in t, -8, -5? t Let i = -456 + 451. What is the second smallest value in -2/7, i, -2, 7/18? -2 Suppose -4k + 5*k - 1 = 0. Let j be (-48)/(-42) + k/(-7). Which is the second smallest value? (a) 2/3 (b) 3/7 (c) j a Let l = -9 + 11. Let o = l - 0. Suppos	{ "pile_set_name": "DM Mathematics" }
q = 3l + 10 for l. 5 Suppose -236 + 446 = -78u + 444. Solve o - 2y - 2 = 0, 3o - 6 = -uy + y for o. 2 Let t(r) = -70r - 3777. Let c be t(-54). Solve 4l + 13 = -cv - 5, -3l = 0 for v. -6 Suppose 0 = 2l - l - 2. Let q(i) = i*3 - 92i*2 + 894i - 243. Let x be q(81). Solve 4u + 8 = -4n + lu, x = n - u + 5 for n. -3 Let x = 1631 + -1629. Solve 0 = 2v - 3q + 3 - 5, -v - xq = 13 for v. -5 Suppose 208 - 46 = 6s. Suppose 0 = -5i - 7 + s. Let l(j) = -2j - 17. Let a be l(-10). Solve -af - g = 0, 0f + if + 8 = -4g for f. 1 Suppose 0 = 3w + 4q + 220, 0 = 4w - 5w - q - 75. Let z be w/(-32)4/5. Solve a - zj = -1 + 4, 3a + 2j = -15 for a. -3 Let s = -46 - -49. Suppose 35 + 1 = 3p. Let r be (-3)/18 - (-2)/p. Solve -5l + 2i + 8 = r, 5i - 11 = -sl - 0l for l. 2 Suppose -4u - 3 = 5t - 59, -t + 4u = 8. Solve -o + 1 = -tc, -4c - o + 5o - 4 = 0 for c. 0 Let u(a) = 1 + 26a - 4a2 + 3a*2 - 34a. Let n be u(-2). Solve x - 5 = 2k, -3k - 6x = -2x + n for k. -3 Let m be (-120 + -4 + 4)1. Let v = m - 1. Let t = -117 - v. Solve -9 - 8 = -to - 5c, -o + 3 = c for o. -2 Suppose 5s - 31 = g + g, g = -2s + 7. Suppose 0 = 4x - 3h - 344, 2x - h = -0h + 172. Let b = x - 86. Solve -5f + sn + 5 - 20 = b, 3n = 5f + 17 for f. -4 Suppose 3l = 4f + 12 - 0, -2f = 4l + 6. Let d(s) = 43 - s2 + ls - 46 - 2s + 6s. Let i be d(3). Solve c + 2x + 2 + 2 = i, -2x - 4 = 0 for c. 0 Let z(q) = -13q + 8. Let w be z(0). Solve -5a + 24 = d + w, -2d + 4 = 3a for a. 4 Let f = 99 + -74. Suppose -4s - 9 = 3m - 8m, 5m = f. Suppose 17 = 5z - 4o, z + 3o = sz - 9. Solve -40 = 4n - zp, -n - 21 = 2p - 6p for n. -5 Let q(s) be the first derivative of 2s2 + 90s + 111. Let r be q(-18). Solve -2w - 5o + 30 = 0, 2w + o + o - r = 0 for w. 5 Suppose 585 = 99m + 18m. Solve ma + 2s - 21 = 0, -5a + 17s - 13s + 3 = 0 for a. 3 Suppose 0j + 5j - 115 = 0. Suppose 21r - 1313 = -1250. Solve -3o + 4p - j = 0, 3o + 11 = -5p + rp for o. -5 Suppose 5i = b, -3b + 1 + 11 = -3i. Let q(x) = -13x - 152. Let y be q(-12). Solve -b - 8 = -5g + 3s, -yg - 5s = -3 for g. 2 Suppose -3f + 6 = 2j + 2f, -3j + 9 = -2f. Let c be (4 + -25)/7 + -2 + 7. Solve -10 = -r - 4o, r = -co + 1 + j for r. -2 Suppose 5q + 23b - 6 = 16b, -4q + 22 = -3b. Solve 2j - 5x + 1 = -23, j + qx - 14 = 0 for j. -2 Let b be 6 + 112/(-18) + 43/(-9). Let l be 1/((-3)/(-9)) - b. Let o be 17/4 - l/32. Solve 8 = -3p + 2k, -op + 4 - 15 = -3k for p. -2 Let w(h) = 2h*3 + 204h*2 - 209h - 309. Let q be w(-103). Solve -2m - 31k = -27k, -m + k - 3 = q for m. -2 Suppose -68h + 64h - q + 37 = 0, 4h - 2q - 22 = 0. Solve 4w + h = 2y, 21y + 7 = 25y - 5w for y. -2 Let g be (24/20)/315. Suppose -gw = -4w - 4. Suppose 0 = wi - 10 - 0. Solve y + 3y + 4n + 28 = 0, -y + 2n = -i for y. -3 Suppose 242u + 245 = 277u. Solve -3i + 29 = -5x + 19, -i = 2x - u for i. 5 Suppose 0 = -1155d + 1183d - 504. Solve -2a - d = 4b, 3b - 5a - 8 - 11 = 0 for b. -2 Let w(o) = 3o3 - 60o*2 + 9. Let a be w(20). Solve -5 = z - t, -5z = -11t + 10t + a for z. -1 Suppose -5w + 29 = 19. Let o = 4 - 0. Let t(d) = -2d + 9. Let q be t(o). Solve -11 = -2n - 3z + q, wz - 7 = -n for n. 3 Let v(k) = k3 + 32k*2 - 44k - 359. Let s be v(-33). Suppose -3g - 2x = -9 - 1, 0 = -3x - 12. Solve 2a - sj = 4a - g, -3a + 7 = 4j for a. 1 Suppose f + 3f - 48 = 0. Suppose 4y - 19m + 24m + f = 0, -y + m = -6. Solve q = -yu - 2u + 3, 5u = 5 for q. -1 Suppose -4z = 8g - 6g + 28, -68 = 4g - 4z. Let o = g + 21. Solve -2s + 21 = 5j, 6j - 2j + os = 27 for j. 3 Suppose 3n - g + 5 = 97, 0 = -5n + 5g + 160. Suppose 0 = 145w - 10w - 270. Suppose 4r - n = -10, y - r = -w. Solve a + yz - 1 = -9, 16 = 4a - 4z for a. 1 Let b(l) be the first derivative of 3l2/2 + 30l - 2. Let x = 2768 - 2777. Let k be b(x). Solve -4i - 18 = -a + 3a, -4i - 19 = ka for a. -1 Let y(x) = -2x + 25. Let v(d) = d2 + 2d - 1. Let h be v(-5). Let l be y(h). Let b be -1 - -2 - l - -3. Solve bm + r - 7 = 4m, -5r = m + 7 for m. 3 Let v(a) = a2 + 2a - 6. Let z be v(-4). Suppose -8 = zc - 16. Let t be 3/2(c + -3 + 1). Solve 3u + 5w - 4 + t = 0, -4w = -2u + 8 for u. 2 Suppose 0 = 109p - 115p + 24. Suppose -2x + 2k - pk + 6 = 0, -2x + 10 = -2k. Let t = 20 + -12. Solve 2 = -v - 4a, -2a = -xv + a - t for v. -2 Suppose 168f - 177f + 36 = 0. Suppose 6h = 9h - 3. Suppose x - d = -4d + 3, -d + h = -fx. Solve -4w = -4p + 24, 2w = -xw - p - 9 for w. -5 Suppose -30u + 25 = -25u. Let x be u/(100/15)4. Solve -2z + 4f = xz + 3, -2f = 4z - 8 for z. 1 Suppose 0 = 55x - 61x. Solve -4c - 7 = -5c + 3a, c + a + 5 = x for c. -2 Let v be 324/(-9)-1. Suppose 3q = -2z + v, 5q + 0q = z + 22. Solve 2g = -qs - 22, -5g - 7 = -3s - 4 for g. -3 Let t be (-9 - 110/(-11))/1. Solve 3z = 5z - 5r + 8, -r = -z - t for z. 1 Let d be (-3)/(-4)41. Let j(f) = f*3 + 6f*2 - 111f - 344. Let z be j(-3). Solve 2p + i + 22 = -dp, -5p - z = -2i for p. -4 Let a be ((-4)/6)/((-4)/30). Let k(n) = n*3 - 13n*2 + 27n - 9. Let c be k(11). Let d be a/20 - c/(-8). Solve 0 = -2f + 1 - 5, 3f + d = -2l for l. 0 Suppose 44 = 18i - 7i. Suppose -5c + 40 = -5n + 10, -20 = in. Let v(s) = 5s - 1. Let f be v(1). Solve -4h = fj + 24, j - 5h = 17 + c for j. -2 Suppose -4q - 3 = -39. Suppose 6j + 2d - q = 3j, 0 = 5j - 5d + 10. Solve -p + 23 = m + 4m, -m - 3p - j = 0 for m. 5 Let p(d) = d*3 + 51d*2 + 516d - 69. Let k be p(-37). Solve t = -kg - 13, 16 = 86g - 88g + 5t for g. -3 Suppose 3q = -10j + 9j + 14, 0 = -5q - 5j + 10. Suppose 23u = qu + 204. Solve -4k = -3n + 16, 3n = u - 0 for k. -1 Let a = 3183 + -3179. Solve t + 20 = ak, k + 10 = -4t + 3k for t. 0 Let i(y) = -y2 + 20y - 49. Let t be i(16). Suppose 3h - 5 = 2w, -15w + 16w + 2h = t. Solve 6o + 12 = 4u + 2o, -25 = 5u + wo for u. -1 Let b(z) = -5z2 - 22z + 8. Let g be -1 + -1 - (4 + 1 + -4). Let s be b(g). Solve s = -5m - 4y, -6y + 20 = -5m - y for m. -5 Suppose 0 = -j + 3w + 32, 3 = -2j - 3w + 31. Let f = j + -20. Let q be (-1)/((-2)/(-26))-1. Solve 2u = h - fu + 2, 3h + q = -u for h. -4 Let m be (120/380)/((-20)/(-190)). Solve mw = 4o + 5, 0 = -42w + 46w - 2o + 10 for w. -5 Let d(l) = l*3 - 10l*2 + 16l + 3. Let c(a) = 2a2 + 23a + 19. Let g be c(-11). Let v be d(g). Solve 1 = -u - 0u - vh, -h = 4u - 18 for u. 5 Suppose -5t + 3t + 26 = 0. Suppose 40 = 4u + 2y, -t = -u - 20y + 18y. Solve a = -0m + 4m - 13, a - 2m + u = 0 for a. -5 Let p = 8 - -6. Suppose z + 2f = p, 2z - 5z + 4f = -12. Suppose zm - 4m = 24. Solve -18 = -3h - 3i, -mh - 4i = -3h - 22 for h. 2 Suppose 18 = 5q - 2. Suppose 21a - 189 = -0a. Solve ah - qh - 4i = 45, -i = 3h - 10 for h. 5 Suppose -16k - k - 9828 + 9828 = 0. Solve 78n - 80n + 5y - 1 = k, -11 = 4n - y for n. -3 Let m = -25 - -28. Suppose 8s - 12s = -100. Suppose 16 = -3b + s. Solve -3f = mk + 9, -21 = -k + bf + 2f for k. 1 Suppose r + 3r - 399 = -5u, -3r + 3u + 333 = 0. Let y = r - 104. Solve x + 4z = y - 20, -4x - z + 3 = 0 for x. 2 Let h = 6 + -3. Suppose -d = hr - 104, 92 = r + 2r + 4d. Suppose -4w - r = -4c, 4c + 2w - 16 = w. Solve -13 = -cp + 2m - 6m, -p - 4m - 7 = 0 for p. 5 Suppose -6c + 27 - 9 = 0. Let x(u) = -63 + cu - u + 51. Let m be x(6). Solve 0w + 2w + 3 = -n, w + n + 1 = m for w. -2 Let z = -6527 + 6532. Solve -c - 2l = -z - 1, l - 3 = c for c. 0 Suppose 766w = 740w + 52. Solve 6 = -3n, -6q - wn = -2q - 8 for q. 3 Let m(y) = -12y - 1. Let n be m(11). Let q be 43/3 - 5 - n. Let i = q + -113. Solve -4c = -c - 4k + i, 0 = 4c - 2k + 12 for c. -1 Suppose 70k + 31k - 202 = 0. Solve 2z - 4s + 24 = 0, -kz + 6z - 2s + 24 = 0 for z. -4 Let f = -65 + 68. Suppose r + 4r - 14 = ft, 3r = -t + 14. Solve -2m = -rq + 14, 0 = -5q - 6m + 2m + 11 for q. 3 Let d(s) = 9s + 1. Let x(n) = 28n + 2. Let o(p) = 7d(p) - 2x(p). Let k be o(6). Let h = -42 + k. Solve 3t + 12 = h, -r + 5t = -17 for r. 2 Suppose 497 = 3a - 4u, 2a - 449 = -5u - 179. Solve -s - 3v = -11, -s - av + 1 = -154v for s. -4 Suppose	{ "pile_set_name": "DM Mathematics" }
n 408589, 408587, 408585, 408583? 408581 What is the next term in -6, -63, -144, -249, -378, -531, -708? -909 What is the next term in 69, -189, -875, -2199, -4371, -7601? -12099 What is the next term in -4461, -8922, -13383, -17844? -22305 What is the next term in -208, -871, -1980, -3535, -5536, -7983, -10876? -14215 What is next in -41255, -41251, -41239, -41213, -41167, -41095, -40991? -40849 What is the next term in 4453, 17829, 40123, 71335, 111465, 160513, 218479? 285363 What comes next: 24863, 24874, 24885, 24896, 24907, 24918? 24929 What is next in -165, -849, -1981, -3555, -5565? -8005 What comes next: 643, 573, 455, 289? 75 What is the next term in 1972, 1947, 1908, 1855, 1788? 1707 What is next in 2050, 8218, 18504, 32908, 51430, 74070? 100828 What comes next: -181, -388, -599, -814, -1033, -1256? -1483 What is next in 153, 350, 545, 738, 929? 1118 What comes next: -933612, -933613, -933614, -933615, -933616, -933617? -933618 What is next in -579, -551, -529, -519, -527, -559? -621 What comes next: -511899, -511900, -511901, -511902, -511903? -511904 What is the next term in 1487, 2959, 4431, 5903, 7375, 8847? 10319 What is the next term in -460463, -920923, -1381383, -1841843? -2302303 What is the next term in 66802, 133611, 200420? 267229 What comes next: -6047, -24199, -54469, -96869, -151411, -218107, -296969, -388009? -491239 What is the next term in 9237, 36917, 83029, 147573, 230549, 331957, 451797? 590069 What is next in 3953724, 3953723, 3953722, 3953721, 3953720, 3953719? 3953718 What comes next: -38, 185, 710, 1663, 3170, 5357, 8350, 12275? 17258 What is the next term in -18886, -18884, -18882, -18880? -18878 What comes next: -451, -2579, -8077, -18631, -35927, -61651, -97489, -145127? -206251 What is the next term in -170, 301, 1090, 2191, 3598, 5305, 7306, 9595? 12166 What comes next: 12996, 25993, 38990, 51987, 64984, 77981? 90978 What is next in -260, -292, -354, -452, -592, -780, -1022, -1324? -1692 What is the next term in 1833, 1810, 1785, 1758? 1729 What comes next: 3314, 3343, 3374, 3407, 3442? 3479 What comes next: 3600, 3567, 3532, 3495? 3456 What is next in 43324, 43394, 43510, 43672? 43880 What is next in -8090, -8160, -8244, -8348, -8478, -8640, -8840, -9084? -9378 What comes next: -10962, -87813, -296412, -702633, -1372350? -2371437 What comes next: 29174, 58273, 87372, 116471, 145570? 174669 What is next in -728, -1475, -2252, -3059? -3896 What is next in 549, 2183, 4911, 8733? 13649 What is next in -1, -107, -395, -949, -1853, -3191, -5047, -7505? -10649 What comes next: 758, 738, 706, 656, 582, 478, 338? 156 What is the next term in -2634, -2902, -3152, -3378, -3574, -3734, -3852? -3922 What is the next term in -604638, -604650, -604670, -604698, -604734? -604778 What comes next: -595, -1342, -2241, -3292, -4495, -5850? -7357 What is next in 815891, 815893, 815895, 815897? 815899 What is the next term in -23, -188, -463, -848, -1343, -1948, -2663? -3488 What is the next term in -2918, -9539, -20580, -36047, -55946, -80283? -109064 What is next in 83, -29, -221, -493, -845, -1277? -1789 What comes next: 38933, 77851, 116769, 155687, 194605, 233523? 272441 What comes next: -6, 8, 0, -42, -130? -276 What is the next term in -1583, -1578, -1567, -1550? -1527 What is next in 1200, 2372, 3544? 4716 What is the next term in -22070, -88260, -198572, -353006? -551562 What is next in -441, -1760, -3959, -7038, -10997? -15836 What is next in 2059, 2248, 2557, 2980, 3511, 4144, 4873? 5692 What is the next term in 12930513, 12930512, 12930511? 12930510 What comes next: 3700, 3678, 3662, 3664, 3696, 3770, 3898, 4092? 4364 What is next in 213, 1524, 5091, 12042, 23505, 40608? 64479 What is next in -25, -47, -91, -169, -293? -475 What is next in -80, -263, -442, -617, -788? -955 What comes next: -141, -424, -997, -2004, -3589, -5896, -9069, -13252? -18589 What comes next: 8969903, 8969899, 8969893, 8969885, 8969875, 8969863? 8969849 What is the next term in 6662, 6665, 6684, 6725, 6794, 6897, 7040, 7229? 7470 What is the next term in 284, 281, 278, 275? 272 What is the next term in 234, 472, 710, 948, 1186? 1424 What is next in 51, 704, 2441, 5802, 11327? 19556 What comes next: -558, -713, -868? -1023 What comes next: 430, 683, 936, 1189, 1442, 1695? 1948 What is the next term in -395, -1772, -4477, -8846, -15215, -23920, -35297? -49682 What comes next: -16360, -32719, -49078, -65437? -81796 What is the next term in 17686, 17692, 17702, 17716, 17734, 17756, 17782? 17812 What is next in 1633, 1646, 1659, 1672? 1685 What is the next term in -723988, -723991, -723994? -723997 What comes next: 9, 11, -29, -147, -379, -761, -1329, -2119? -3167 What comes next: -1071, -2163, -3255, -4347, -5439? -6531 What is next in -2288, -4592, -6896, -9200, -11504? -13808 What is next in -15, -118, -295, -558, -919, -1390, -1983? -2710 What is the next term in -42, -242, -608, -1152, -1886, -2822, -3972? -5348 What is next in -305, -521, -721, -899, -1049, -1165, -1241, -1271? -1249 What comes next: 197, 898, 2079, 3734, 5857, 8442, 11483, 14974? 18909 What comes next: 2964763, 5929529, 8894297, 11859067, 14823839, 17788613, 20753389? 23718167 What is next in 628, 1428, 2228, 3028, 3828, 4628? 5428 What is the next term in 2406, 4788, 7148, 9492, 11826? 14156 What is the next term in -1512, -3176, -4842, -6510, -8180, -9852? -11526 What is next in -2117, -4246, -6361, -8456, -10525, -12562, -14561? -16516 What is the next term in -16696, -16699, -16702? -16705 What is next in 102241, 408954, 920143, 1635808, 2555949, 3680566, 5009659? 6543228 What is the next term in 213361, 426714, 640069, 853426, 1066785, 1280146, 1493509? 1706874 What is next in 678, 1371, 2054, 2721, 3366, 3983, 4566, 5109? 5606 What is the next term in -58845, -58838, -58831, -58824? -58817 What comes next: -19072, -19086, -19100, -19114, -19128, -19142? -19156 What comes next: -133, -157, -259, -481, -865, -1453, -2287? -3409 What is next in 8385, 33562, 75533, 134298, 209857, 302210? 411357 What is next in 17057, 68102, 153171, 272258, 425357? 612462 What is next in -10302, -82736, -279336, -662184, -1293362, -2234952, -3549036, -5297696? -7543014 What comes next: -237, -271, -305? -339 What comes next: -465, -1930, -4365, -7770, -12145, -17490? -23805 What is next in -18377, -73515, -165411, -294065, -459477, -661647? -900575 What is next in 104, 794, 2682, 6368, 12452, 21534, 34214? 51092 What is the next term in 1262, 2537, 3822, 5111, 6398, 7677, 8942, 10187? 11406 What is next in 909047, 1818093, 2727139, 3636185? 4545231 What comes next: -12905, -25807, -38719, -51647, -64597, -77575, -90587, -103639? -116737 What is next in -4155, -4286, -4417, -4548? -4679 What is the next term in -232, -992, -2260, -4036, -6320, -9112, -12412? -16220 What is the next term in -15, -201, -519, -975, -1575, -2325, -3231? -4299 What comes next: -3668, -14667, -32998, -58661, -91656, -131983? -179642 What is the next term in -14, -107, -250, -431, -638, -859, -1082? -1295 What is next in -61525, -61485, -61445? -61405 What is the next term in -21758, -21746, -21734, -21722, -21710? -21698 What comes next: 705537, 705526, 705493, 705426, 705313? 705142 What comes next: 43, 26, -127, -500, -1177, -2242? -3779 What is the next term in -1453, -2946, -4441, -5938, -7437, -8938? -10441 What comes next: 63126, 63124, 63122, 63120, 63118? 63116 What comes next: -1489141, -1489146, -1489161, -1489192, -1489245, -1489326, -1489441? -1489596 What is the next term in -1733, -6919, -15561, -27659? -43213 What is next in -1180, -2397, -3614, -4831, -6048, -7265? -8482 What comes next: 12779, 12768, 12757? 12746 What comes next: 128, 665, 2104, 4889, 9464, 16273? 25760 What is next in 1985604, 1985600, 1985596, 1985592? 1985588 What is next in -943, -3785, -8523, -15163, -23711? -34173 What comes next: 97, 435, 1005, 1807? 2841 What is next in -60, -383, -1248, -2925, -5684, -9795, -15528? -23153 What is next in -73, -101, -151, -223? -317 What is next in -5983, -11984, -17985? -23986 What is next in -5905, -8625, -11331, -14017, -16677, -19305, -21895, -24441? -26937 What is next in 142788, 142773, 142732, 142653, 142524? 142333 What is the next term in -92737, -92735, -92733, -92731?	{ "pile_set_name": "DM Mathematics" }
w - 4v + 15 for w. 3 Solve -6z + 1 = -5z, 0 = v - 2z + 2 for v. 0 Solve -10 = 4l + l + 5u, -4 = l + 3u for l. -1 Solve -3s - 4i - 7 = -2, 3s = -5i - 10 for s. 5 Solve 0 = l - f, 4f - 10 = -l - 0 for l. 2 Solve 0 = 3v - 2h + 2, -657v + 4 = -660v + 4h for v. 0 Solve 40 = 4l - 12f + 16f, -5l = 2f - 35 for l. 5 Solve -3k - 3j = -4 + 19, -4j - 5 = k for k. -5 Solve -21 = 3r - 3m, 3r = m - 9 - 8 for r. -5 Solve 3d - 3z + 27 = 0, -204d + 207d = 2z - 22 for d. -4 Solve -7 = 2w + u, -w + 2w - 2u + 1 = 0 for w. -3 Solve -2y + 4k - 6k = 6, y = 2k + 12 for y. 2 Solve 3j - 19 + 0 = h, 2j - 10 = 0 for h. -4 Solve 2d = p + 4, 4d - 11 = -p - 3 for p. 0 Solve 3r - 2 = d - 5, -r = 5d - 15 for r. 0 Solve -3q - 5d = -43, -2d + 0 = -10 for q. 6 Solve -3f + 3u = 12, 3f - 3 = 4u - 20 for f. 1 Solve 0 = -2r + 10, -5r + 33 = 2c + 4 for c. 2 Solve 0 = -5q + 4n - 9, -2 = q + 2q + n for q. -1 Solve 2h = x - 10, 4x - 10 = 20h - 18h for h. -5 Solve -36q - 21 = -3j - 31q, -3j - q = -3 for j. 2 Solve 2 = 2r - 2y, 4r + 20 = -5y - 21 for r. -4 Solve 3v + d = 3, 0 = 4v - 5d - 13 - 10 for v. 2 Solve 0 = -5r + m - 6, 36r = 38r - m for r. -2 Solve 4d = 3n + 7, -4n - n - 3d - 31 = 0 for n. -5 Solve -5 = -5q - 3w, 1 + 3 = 4q + 4w for q. 1 Solve -5u + 14 = 4o, -5u - 5o + 13 = -2 for u. 2 Solve -2z - 10 = -3j, 0z - 5j - 15 = 3z for z. -5 Solve -5q + 2 = -i, 2i = 6i + 8 for q. 0 Solve 4p - 3 = -5k, -p + 21 = 4k - 4p for k. 3 Solve z + 3 = 4q, 2q + 3z = -z - 12 for q. 0 Solve 2c = -5w, -5c = -0c - 2w + 29 for c. -5 Solve -5p = -4l - 16, 10p - 7p - 12 = 3l for l. -4 Solve 7 = -h + 3n, -11n = 5h - 12n + 21 for h. -4 Solve 2y = 5z - 19, 2z + 4y - 16 = 9y for z. 3 Solve -3d - 4z = -24, 34d = 29d - z + 23 for d. 4 Solve -5x - 1 = s, 3s - 50x - 17 = -45x for s. 4 Solve 4p = -2c + 24, -2p - 2c + 28 = 3p for p. 4 Solve -2b + 4z + 8 = -z, -4 = -b - 2z for b. 4 Solve 0 = 2p + 12 - 20, 0 = 3h - 5p + 26 for h. -2 Solve -a + 2y - 7 = 0, -8 = -a - 2y - 3 for a. -1 Solve 4h + 5q - 4 = 0, -17 + 21 = q for h. -4 Solve 2v + 55l - 54l - 6 = 0, 0 = -5v + 3l - 7 for v. 1 Solve 17 = -p - 5z, 4p + 10z - 12z = 20 for p. 3 Solve 8q + 4 = p + 3q, -p + q = 0 for p. -1 Solve -10q - 5s = -15q - 5, -12 = 2q - 4s for q. 4 Solve -3t - p - 2 = 5, 4p = -t + 5 for t. -3 Solve -2p - 10 = 0, 26p + 30 = -4h + 24p for h. -5 Solve 5p = 5s + 30, 2p + 4 - 1 = -s for p. 1 Solve 4p = z + 16, 5z - 3p + 0 = 5 for z. 4 Solve -3g + 0 - 3 = -3z, 0 = -g + 2z - 2 for g. 0 Solve -g - 3d + 7 = 0, -g - 3g - 2 = 2d for g. -2 Solve 5d = 4f + f - 15, -4d = f - 3 for f. 3 Solve 0 = 5v - 2f - 28, -16v + 16 = -14v - 2f for v. 4 Solve 4i - 1 = -w - 0i, -4w - 5i - 7 = 0 for w. -3 Solve 0 = 5o + 5f - 5, 5o + 4f + 3 - 7 = 0 for o. 0 Solve 136z = 134z - s - 4, 8 = -4z + s for z. -2 Solve 0j - 4q = j - 7, 0 = 5q - 10 for j. -1 Solve -y = -4o - 1, -7o = -4o - 5y - 12 for o. -1 Solve 0 = -3u - o - 11, 0 = 3u - 2u + 2o + 2 for u. -4 Solve 5w - 3z = 16, -z - 10z - 26 = -2w for w. 2 Solve -s + 0g + 3g = 3, 5g - 5 = 0 for s. 0 Solve -u - g = 1 - 0, -1 = 4u + 5g for u. -4 Solve 2h - 6 = 4h - z, -3h - z - 19 = 0 for h. -5 Solve b = 3 - 5, -5b = -3d + 7 for d. -1 Solve -5z - 6 = -2n, 9 = n + 11 for z. -2 Solve -5o - 18 = 2j, -20 = 2j - 5o - 42 for j. 1 Solve -3q = -4q + 5m - 10, q + 4 = 2m for q. 0 Solve -2o + 7 = 3d - 4d, -5o - 3d = -23 for o. 4 Solve c + 3c = 3n + 8, -5n - 10 = -5c for n. 0 Solve 3k - 13w + 12w = 5, 0 = -2w - 4 for k. 1 Solve 4h - 14 = 3t, -2h - 3h = -5t - 20 for t. -2 Solve -28 = -3j + 5l, -3l = -j + 24 - 8 for j. 1 Solve 4z + 32 = -5a, -2a + 0a + 2z - 2 = 0 for a. -4 Solve 5y = 5j + 20, -2y + 4j + 12 + 0 = 0 for y. 2 Solve -4l + 7l - 3o + 3 = 0, -l + 4o + 2 = 0 for l. -2 Solve 0l = -3l + 2s - 17, 4s + 11 = -3l for l. -5 Solve 4a - 12 = 4q - 28, 4a + 1 = -q for q. 3 Solve -3z + 3 = 3k + 9, 3z + 30 = 5k for z. -5 Solve n + g - 3g + 10 = 0, n + g = 5 for n. 0 Solve 5b + 15 = i - 16, 3i + 3 = -b for i. 1 Solve -4a = 5c - 25, -5a + 8a + 3c - 18 = 0 for a. 5 Solve -2p = 5y - 20, -4p - y - 20 = -6y for p. 0 Solve 25 = 5t + u, -3u = -15 - 0 for t. 4 Solve -r + 5 + 2 = -2d, 4r - 20 = 0 for d. -1 Solve -3i + 20 = -2m, 3i - m = -3m + 4 for i. 4 Solve -4k - 8 = 4f, 11f = 7f + k + 17 for f. 3 Solve 4w + 5f = -16, -3w - 4f - 40 = -28 for w. -4 Solve -16o + 17o + 13 = -4s, -4o = -3s - 5 for o. -1 Solve -21s = -19s + i + 3, -6 = -2s + 2i for s. 0 Solve 3z + 2w = -6, 4z + 20w = 16w - 8 for z. -2 Solve -3 = n + l, 0l = 2n - 3l + 6 for n. -3 Solve -3t - 5m - 17 = 0, 10 = 2t - m + 4 for t. 1 Solve -5o + 2o - 4u = 20, 0 = -3u - 6 for o. -4 Solve 2b = 5t + 2, 0 = 4b - 4 for t. 0 Solve 1 = -3a - x, a = -4a + 3x - 25 for a. -2 Solve -3m = 3o - 18, 2o + m - 10 = -0o for o. 4 Solve 0 = -3w + 12, -4w = 2l - 1 - 7 for l. -4 Solve -2w + 3s + 7 = -3w, -3s - 1 = -5w for w. -1 Solve -12n - 2 = 2d - 14n, 0 = 2n + 8 for d. -5 Solve 0 = -o - 2q - 1, -33o + 2q = -28o - 19 for o. 3 Solve -3p - 3f + 12 = 0, 0 = -5p - 4f + 19 - 1 for p. 2 Solve -u = 4s + 2, 0 = -6u + 11u + 2s + 10 for u. -2 Solve -1 = 3s + 5z, 2z - 11 = 5s + 1 for s. -2 Solve 0 = v + 4f - 19, -20v = -23v + 3f - 18 for v. -1 Solve -5d + 2 = -u - 0d, -3d = 0 for u. -2 Solve 8 = 10q - 6q, 2n - 2 = 2q for n. 3 Solve 4v + 22 = -5n, 5v + 20 = -2n + 1 for n. -2 Solve 3u = -9, -3u - 12 = -2i - 1 for i. 1 Solve 3r - 1 = -5g - 9, 2r + 8 = -4g for r. 4 Solve 0o - 3 = -o, -o = 4b - 23 for b. 5 Solve 4a - 4 = 2m, 5a - m - 7 = 2m for a. -1 Solve -5f + 5b - 45 = 0, -3f = 4b - 9b + 35 for f. -5 Solve 3 + 11 = -3t + 5c, 4c - 10 = 3t for t. 2 Solve 5 = -5z - 5, b - 9 = 3z for b. 3 Solve 3s - 32 = -4h, 5s - 3h + 7 = 3s for s. 4 Solve 5t - r + 7 = -0, 1 = 4t - 3r for t. -2 Solve -10l + 5x + 1 = -12l, -2x + 8 = 5l for l. 2 Solve -2r + r - 3m = 13, 3r + m = -15 for r. -4 Solve 4i = 4l + 24, -4i + 15 = -3l - 7 for i. 4 Solve -2i - 106h + 101h + 25 = 0, -4i - h + 5 = 0 for i. 0 Solve -8 = -u - u, 4u = p + 21 for p. -5 Solve 0 = -0o + 5o + 15, 0 = 4q - 4o - 20 for q. 2 Solve -2 = -4k - s - 13, -4 = -4s for k. -3 Solve 4k + 14g - 17g = 6, 3k - 10 = 5g for k. 0 Solve -2r + 18 = r - 3n, 0 = -2r + 5n + 21 for r. 3 Solve -3z + 5 = -2l, 11z = -l + 8z - 7 for l. -4 Solve -4s + f = 6f + 21, s - f = -3 for s. -4 Solve -3f + 3w - 19 = -16, 5w = -3f - 35 for f. -5 Solve -2o = p - 4, -6o + 3o - p + 6 = 0 for o. 2 Solve 4r = 2d + 8, -2d = 2r - 7r + 11 for r. 3 Solve 28t = 29t + 10i - 32, -3t - i = -9 for t. 2 Solve -h + 4u - u - 17 = 0, -3u + 27 = -3h for h. -5 Solve b + 7 = 3b - 3v, -b + 16 = -4v for b. -4 Solve 2k + h - 4 = 0, 11h - 6h - 12 = -2k for k. 1 Solve 3p = 3q + 16 + 14, 2p + q - 5 = 0 for p. 5 Solve 4 = -3i - 0i - 2s, i - 5s = 10 for i. 0 Solve 7 = 4i + 3v, i - 67v - 2 = -68v for i. 1 Solve 0 = j, -16 = 41l - 37l + j for l. -4 Solve -13 = -5k + 4m, -2k - 11m = -8m + 27 for k. -3 Solve -n = -t, -5t + 23 = 5n + 3 for n. 2 Solve 0 = v + c + 2, v + 4c - 5 = -13 for v. 0 Solve 3c = 11d - 10d - 20, 12 = -2c + 2d for c. -7 Solve g = -5r - 9, r = -3g - 0r + 1 for g. 1 Solve -a + 17 = 3m, -37m + 30 = -32m for a. -1 Solve -4y + 6y + 17 = 5b, 4y + 10 = 2b for y. -1 Solve 4u = -s - 4 - 5, -u = -4s - 2 for u. -2 Solve 3t + 5z = -5, 4t + 5z + 15 = -t for t. -5 Solve -2g + 8 = -2z, 5g - 4z - 47 + 31 = 0 for g. 0 Solve 5o = 5a - 10, -3o = 4a - 5a for a. 3 Solve -4y - 4 = 0, -2y + 35 = -3s + 40 for s. 1 Solve 1 = n - 2d, -3d + 39 = 2n + 23 for n. 5 Solve 4h = 5v + 1, 3 = 3h + 4v + 10 for h. -1 Solve 0 = i + 3u + 20, -i + u + 10 = -2i for i. -5 Solve -15 = -5l + 2t, -38l + 33l - 3t - 10 = 0 for l. 1 Solve -26r + 29r + 4s = 20, -5r + 18 = -s for r. 4 Solve -6 = 13t - 14t + 5r, 0 = 3t + 2r + 16 for t. -4 Solve -2i - 2r + 7 + 11 = 0, -5i = -r - 15 for i. 4 Solve -7 = -3h - 4z, 4h - 9z - 6 = -16*z	{ "pile_set_name": "DM Mathematics" }
(4) a multiple of 11? False Suppose -2q + d + 36 = 8, 24 = q - 3d. Is 2 a factor of q? True Suppose 12 = 5v + 2x, -v + 6 = 4v - 4x. Suppose 2u + 50 = vp, p - 40 = 5u - 3. Does 7 divide p? False Suppose 0 = 3g + 4z + 7 + 5, 2g + 4z + 12 = 0. Suppose 2c - 68 - 7 = -5s, g = -4s + 12. Does 16 divide c? False Suppose 3o + 25 = -23. Let f = 17 + 0. Let w = f - o. Is 14 a factor of w? False Let v(r) = 3r + 3. Let p be v(3). Suppose -3f + 6f = p. Suppose x + 205 = fj, 2x - 153 - 100 = -5j. Is 13 a factor of j? False Let s(p) = -2p*2 - 12p - 5. Let z be s(-9). Let g = -34 - z. Is 10 a factor of g? False Suppose 5u = -4b + 120, -u + 3u = b + 61. Does 14 divide u? True Let l be (1 - -5)/((-1)/(-82)). Suppose -l = -5q + 4b + 55, -3q - 4b = -341. Is q a multiple of 37? True Is (8 - 2) + (0 - -3) a multiple of 3? True Suppose -2l - 5u - 34 = 0, 4l + 33 = -3u - 7. Let h be 1188/42 + 2/l. Suppose 0 = -5s + 3s + h. Does 13 divide s? False Let n be (-8)/20(0 - 5). Suppose -6 = -nf + 16. Is 4 a factor of f? False Let z = 6 + 0. Let g(x) = -9x - 8. Let p(i) = -17i - 16. Let u(h) = 11g(h) - 6p(h). Is 15 a factor of u(z)? False Let i(u) be the second derivative of u5/20 + 5u4/12 + u2/2 + u. Let n be i(-4). Let y = 3 + n. Does 10 divide y? True Let f be 2/3 + (-40)/6. Let z(q) be the second derivative of -q5/20 - q4/2 - q*3/3 + 3q2/2 + q. Is 8 a factor of z(f)? False Let r(d) be the second derivative of d5/60 - d*4/24 + 4d3/3 - d2 - 2d. Let k(q) be the first derivative of r(q). Is k(0) a multiple of 4? True Is (-4)/(-30) + 9258/90 a multiple of 19? False Let r(m) = -m3 - 7m*2 - 3m - 4. Let o be r(-8). Suppose 0 = -0t - 2t + o. Is t a multiple of 21? True Let g = 52 - -40. Is g a multiple of 20? False Let c = 160 - -8. Is 27 a factor of c? False Does 11 divide (-4)/(-14) + 7/(196/3688)? True Suppose -2g + 1 = -g. Is g/(4/128 + 0) a multiple of 10? False Suppose -9c + 942 = -930. Is 17 a factor of c? False Suppose 26 = i + 2r, 4r - 7r + 6 = 0. Is 11 a factor of i? True Does 13 divide 639/12 - (-12)/16? False Let b be ((-3)/(-4))/(-3)-20. Suppose 0 = -n - bf - 31, n - 6f + f = 19. Is (-2)/n + (-140)/(-12) a multiple of 12? True Let m(v) = v3 + v2 + v + 17. Let h(k) = k - 1. Let x be h(0). Let j be (-1 - x)/(2/(-1)). Does 17 divide m(j)? True Let a be ((-6)/(-5))/((-15)/350). Let o = a - -58. Is 10 a factor of o? True Let s(m) = -14m3 + 9m*2 - 9m - 8. Let z(p) = -5p3 + 3p*2 - 3p - 3. Let r(j) = -3s(j) + 8z(j). Suppose a + 1 - 3 = 0. Is 5 a factor of r(a)? True Suppose -4u + 4f = -0f + 12, -4u - 16 = -5f. Let g(d) = 13d*2 - 1. Is g(u) a multiple of 6? True Let i(x) = 124x*3 - 2x*2 + x. Does 33 divide i(1)? False Suppose k - 1 - 6 = 0. Does 4 divide k? False Suppose v = 2y - y + 21, -y + 79 = 3v. Is 6 a factor of v? False Suppose 0 = -3g - 1 + 7. Let w(m) = m*2 + 3m - 3. Let i be w(g). Let j(v) = 3v + 9. Does 8 divide j(i)? False Let v(r) = -r2 + 6r + 2. Let z(n) = n*2 - 6n - 1. Let f(i) = -3v(i) - 4z(i). Let b be f(6). Is 13 a factor of 75/2 - b/(-4)? False Let m(g) = g*2 + 4g - 12. Let j(l) = -l*2 + 10l + 14. Let x be j(12). Does 24 divide m(x)? True Suppose 0 = -9r + 6r + 24. Is r a multiple of 7? False Let y = -43 + 73. Does 9 divide y? False Let a = 113 - 68. Let n be (-2 + -85)1/3. Let m = a + n. Is m a multiple of 8? True Suppose 44 = 6w - 4w. Suppose -w = -3x - 7. Is x a multiple of 3? False Let i = 0 + 9. Is i even? False Suppose o - 2c = 4o - 15, -5o = 2c - 25. Is o even? False Suppose 0 = 2v - 5c + 31, -v + c - 14 = -3c. Let l = v - -40. Suppose 5s + 4n - 79 = 0, -l = -s - n - 7. Is 13 a factor of s? False Suppose 1 + 1 = c. Suppose cj = 3j - 2. Suppose -26 = -jo + 26. Is o a multiple of 13? True Does 5 divide (-4)/(-1) - (-14 - 13)? False Let h be (8 - 3) + (-1 - 0). Suppose hg + 0g - 80 = 0. Is g a multiple of 5? True Suppose 0 = 8t - 3t - 35. Let x(n) = n*3 - 6n*2 + 4n + 1. Let v be x(5). Let q = v + t. Does 2 divide q? False Let h = 44 + -2. Suppose 3o - 3z - h = 0, -5o + 3 = 3z - 43. Does 3 divide o? False Let p(l) = l3 + l2 + 2l. Let d be p(3). Is 11 a factor of -37/(d/(-88))? True Suppose 5 = -i - 10. Suppose -6u = -3u + 99. Let m = i - u. Is 7 a factor of m? False Let w(n) = -8n + 4. Let k be w(-3). Let h = 15 - k. Let a = -1 - h. Is a a multiple of 12? True Let j be -183/(-6) + 1. Suppose -2n - 3n - j = 0. Is 5 a factor of (3 + n)(4 - -1)? True Let l(g) = -g2 - 3g - 27. Let u(j) = j*2 + 4j + 28. Let b(o) = -4l(o) - 3u(o). Let s = -14 - -14. Does 12 divide b(s)? True Let g(s) = s*3 + 4s*2 + s + 2. Let x be g(-4). Let w(k) = 2k*2 + 4k + 2. Let a be w(x). Suppose -4j + c = -130, 4c = -j + 26 - a. Is 16 a factor of j? True Suppose t + 2 + 1 = 0. Let r be 3/t - (10 + -1). Let u = -6 - r. Does 3 divide u? False Does 19 divide 18/7(42 + -7)? False Let d = 23 + -3. Suppose -2t + 3t = 2. Suppose th + 0 = d. Is h a multiple of 10? True Let k = 4 - 9. Is 5 a factor of (k + -1)30/(-18)? True Let c be (-2022)/(-36) - 2/12. Suppose -12k = -11k - c. Does 14 divide k? True Let g = -90 + 132. Suppose 208 = 3c + 5j, c - 2j - 9 = g. Let y = 104 - c. Is 17 a factor of y? False Does 21 divide (51 - -2) + 1 + 4? False Let q = 936 - 588. Is q a multiple of 12? True Let s be (-1)/(-5) - 38/(-10). Let y be (-8)/2 + (4 - s). Is ((-13)/2)/(2/y) a multiple of 13? True Suppose 0z - 8 = -4z. Let q = z - -2. Does 2 divide q? True Let n(a) = -a - 2. Let x be n(-2). Suppose -6p = -8p + 4. Suppose x = 4l + 4, -4c + 4l + 22 = pl. Is c even? False Suppose 0 = -9o - 9o + 4320. Is o a multiple of 10? True Suppose -m = m + 10. Let i(a) = -2a - 6. Let j be i(m). Let d(k) = 2k2 - k - 3. Is d(j) a multiple of 10? False Let o(w) be the third derivative of -w4/24 - w3/6 + w2. Let s be o(-2). Suppose -10 = -m + s. Is 4 a factor of m? False Suppose -3p - p = -140. Let g = p + -17. Is 8 a factor of g? False Let u(l) = l2 - 9l + 11. Let v be u(8). Suppose 2p = -vp + 280. Is p a multiple of 14? True Let u(h) = -h*2 + 7h + 1. Is u(6) a multiple of 2? False Let x(t) = -t - 4. Let j be x(-6). Suppose 0 = jr - 0r - 114. Let v = r - 10. Is 17 a factor of v? False Suppose 2t - t = -72. Let f = -44 - t. Is f a multiple of 14? True Let z = 91 + -56. Is 5 a factor of z? True Suppose 3h + 34 = -194. Let c = 1 + -33. Let p = c - h. Is p a multiple of 13? False Let j(u) = u*3 + 7u*2 - 5. Let w be j(-7). Let h(v) = -357v + 42. Let y(l) = -42l + 5. Let p(g) = wh(g) + 42y(g). Is p(2) a multiple of 18? False Let i(f) = f3 + 7f*2 + 6f - 8. Is 8 a factor of i(-5)? False Suppose 5j = 127 + 178. Does 3 divide j? False Let l(c) = -c2 - 18c - 4. Let a be l(-7). Suppose -5d = -4d - a. Does 31 divide d? False Suppose -a + 36 = -3k, 2a + 0k = 4k + 70. Is a a multiple of 9? False Let h(s) = -s*3 + 8s*2 - 4s - 9. Let t be (-1)/((-1)/71). Is h(t) a multiple of 5? False Let k be (-69)/(-21) + 6/(-21). Let d(p) = -k + p + p - 7p. Does 12 divide d(-3)? True Does 10 divide 36/24(-146)/(-3)? False Suppose 3j + 5u - 40 - 21 = 0, -4j + 5u + 128 = 0. Suppose 22t - jt + 65 = 0. Is t a multiple of 7? False Let s = -14 - -14. Suppose z + 2l - 36 = s, -2l = -z - 2 + 26. Is 10 a factor of z? True Is 45 a factor of 370 + 10 - 1-4? False Let a(l) = -l*3 - 5l*2 + 6l + 5. Let g be a(-6). Suppose q - 4 = -p + 5, gq = -2p + 24. Is p a multiple of 7? True Suppose 3 = j - 0j. Suppose 0 = 3c - 9 + j. Suppose -3l - cl = -115. Is 23 a factor of l? True Let u(k) = 79k2 + 4k + 2. Suppose 0 = 7s - 3s + 8. Let v be u(s). Is 15 a factor of v/20 - 2/4? True Let s = 2 + 5. Does 12 divide (-568)/(-28) + (-2)/s? False Let y = -9 + 5. Let c be ((-20)/(-8))/((-2)/y). Suppose -21 - c = -v. Is 13 a factor of v? True Let u(x) = 4x3 - 2x*2 - 2x + 2. Suppose -p + 4 = v - 1, 2v - 2p + 2 = 0. Does 22 divide u(v)? True Suppose -5u + 3p = 5p - 248, -2u - 3p + 108 = 0. Does 18 divide u? False Suppose 2c + 7 + 5 = 0. Let n = 15 + c. Is n a multiple of 9? True Let p be 10/6 + (-2)/(-6). Let f(t) = -3t3 - pt - 3 + 1 + 4t3 + 10t**2. Is 8 a factor of f(-10)? False Suppose	{ "pile_set_name": "DM Mathematics" }
a - 7. Suppose -4f = -5o - 85, 4f - 2f - 3o = 41. Suppose -f = -4b - 3i - 2i, 3b - 4i - 11 = 0. Determine l(b). 8 Suppose -4v + 5 = v. Let h be (-1 - (0 + v)) + 0. Let u(f) = 0f2 + 3 - f3 - 2f - 6 - 4f2. Determine u(h). -7 Let x(o) = -12o + 7. Let c(y) = 11y - 6. Let a(h) = 6c(h) + 5x(h). Let u(k) be the first derivative of -k2 + 9k - 2. Let p be u(4). Calculate a(p). 5 Let n(y) = -4y. Let t(i) = -i2 + 1. Let b be t(2). Let z(c) = 11c. Let q(k) = bz(k) - 8n(k). Let a be 2/(-7) - 10/14. Calculate q(a). 1 Let q(u) = -3u2 + 6u + 7. Let n(y) = -7y2 + 13y + 15. Let h(o) = 4n(o) - 9q(o). What is h(-2)? -3 Let p = 2 - 2. Let k(c) = p + 2 + 1 - c. Calculate k(7). -4 Let z(y) = 11y. Let v(a) = 7a. Let c(g) = 8v(g) - 5z(g). Let s(k) = -4k - 1. Let p(h) = 5c(h) + s(h). Give p(-3). -4 Suppose 7 = -0f - 3f - 4t, -f - 3t + 1 = 0. Let a = 2 - f. Let l = -6 + a. Let w(s) = -11s2 + 1. What is w(l)? -10 Let u(t) = t2 - t + 1. Let c(w) = -w3 + 7w*2 - 3w - 3. Let g(z) = c(z) - 2u(z). Give g(5). -10 Let y(w) be the second derivative of -2w5/5 - w2/2 + w. Calculate y(-1). 7 Let m = 35 - 21. Suppose -6v - m = 2l - 2v, 5v + 13 = -4l. Let a(g) = 3g + 8. Let w(t) = 2t + 4. Let d(b) = -3a(b) + 5w(b). Give d(l). -1 Let n(m) = m2 - m - 1. Let l(v) = 6v*2 - 4. Let c(w) = l(w) - 5n(w). What is c(-6)? 7 Suppose 3 = 2l + 2s - 5, l + 20 = 5s. Suppose 4b + 5c = 11, lc = -3b - c. Let k(j) = j + 1. Calculate k(b). 0 Let j(l) be the second derivative of l5/20 - l4/2 + l3/2 - 3l*2 - 3l. Calculate j(6). 12 Suppose 3r + 6 = 4r. Let n(k) = k*2 - 7k + 2. Let l be n(r). Let j(t) = 6t - 1 + 2 + 1 - t2 - 10t. What is j(l)? 2 Let o(z) = z*3 - 4z2 - 3. Let t = -28 - -32. Calculate o(t). -3 Let h(d) = -d2 - 4d + 8. Let l be h(-5). Let v(c) = 2c + 4. What is v(l)? 10 Let s = -1 - -3. Let a(c) = -4c2 - 2c + 2. What is a(s)? -18 Let r(h) = -h*3 + h. Let t(z) = -6z*3 - 6z*2 + 5z. Let k(b) = 5r(b) - t(b). Let g be ((-1)/(-3))/(1/12). Let w be g/(-20) - (-58)/(-10). What is k(w)? 0 Let c(l) = -8l - 17 + 0l + l2 + 11 + 12. What is c(6)? -6 Let o(c) = 2c - 15. Let i be o(12). Let z(k) = 13k + 14. Let p(a) be the second derivative of -a3 - 7a*2/2 - a. Let n(s) = ip(s) + 4z(s). Give n(-5). 3 Suppose 0 = -2h - g - 0g + 9, -2g = 5h - 20. Let v(s) = -5s*2 + 2s*2 - 3s*h - 1 + 5s*2. Give v(-2). -5 Let n(m) be the second derivative of -13m3/3 - m2/2 - 8m. Give n(1). -27 Let r(s) be the third derivative of s4/4 + 8s2. Give r(-1). -6 Let i(n) be the second derivative of -n3/3 + n*2/2 + 3n. Calculate i(3). -5 Let l(a) = 4a2 - 5a + 6. Let w(u) = -9u2 + 10u - 12. Let k(p) = 7l(p) + 3w(p). Give k(5). 6 Suppose -5b - 29 = 4f, -3f = 11 - 8. Let j(m) = m2 + 3m - 7. Calculate j(b). 3 Let p(t) = -3 + 6 - t + 0 + 3. Calculate p(6). 0 Let u(g) = 9g3 + 12g*2 + 19g + 13. Let p(z) = 5z3 + 6z*2 + 10z + 7. Let a(k) = 7p(k) - 4u(k). Let c be 6/(-2) + (0 - 1). Determine a(c). -11 Let g(v) be the second derivative of v5/20 - v4/3 - v3/6 - v2/2 + 29v. Give g(4). -5 Let t(y) = 2y - 9. Let g be t(6). Let x(s) = -2s - 12. Let u be x(-9). Let c(v) = -uv*2 - 4vg - v3 - 5v + 4v*3. Determine c(-5). 0 Let j = 6 + -1. Let l be (-4)/(j/1 + -3). Let o(y) = 7y*3 - 2y*2 - 4y - 3. Let n(x) = 10x3 - 3x*2 - 6x - 4. Let u(f) = 5n(f) - 7o(f). What is u(l)? -7 Let x = -42 + 36. Let c(p) = -p*3 - 6p2 + p + 5. Determine c(x). -1 Let p(n) be the third derivative of n8/6720 + n7/420 - n6/720 + n*4/24 + 2n*2. Let k(o) be the second derivative of p(o). Give k(-6). 6 Let u(x) = -x. Let h = -39 - -42. Give u(h). -3 Let o(t) be the third derivative of -3t5/20 - t4/24 + t*3/6 + 7t*2. Calculate o(1). -9 Let u(c) = 5c*2 + 2c - 4. Let s(m) = -4m2 - m + 4. Let w(v) = -4s(v) - 3u(v). Calculate w(5). 11 Suppose -4 = -9f + 14. Let w(z) be the second derivative of -1/4z4 + 0 - fz + 1/2z2 + 0z*3. Calculate w(1). -2 Suppose 18 - 63 = -5t. Suppose 0 = 4u + 3l + t - 4, 11 = 2u - 3l. Let p(w) = 8w2 - 1. Determine p(u). 7 Let o(p) be the second derivative of p4/24 - p3/6 - p2/2 + p. Let x(b) be the first derivative of o(b). Suppose w - 3w + 10 = 0. Calculate x(w). 4 Let j(y) = 36y + 16. Suppose 46 + 9 = 5r. Let d(f) = -7f - 3. Let n(q) = rd(q) + 2j(q). Determine n(-1). 4 Let m(v) be the third derivative of -17v6/120 - v5/60 - v4/24 - v3/6 + 7v2. What is m(-1)? 16 Let k(h) be the third derivative of -h7/5040 - h6/80 + h5/60 + 3h*2. Let o(i) be the third derivative of k(i). Calculate o(-4). -5 Let y(u) = -3u + 10. Let r be y(3). Let j(p) = -p - 1. Let k(o) = -13o3 + 2o*2 - 5o - 2. Let f(v) = 3j(v) - k(v). What is f(r)? 12 Let v(w) = w3 - 4w*2 + 2w. Suppose q + 0 - 1 = 0. Let x be (-5)/(-1) + -2q. Calculate v(x). -3 Let i(l) = -l2 - 3l - 4. Let x(p) be the second derivative of 2p3/3 - 2p. Let m be x(-1). Calculate i(m). -8 Let d(k) be the third derivative of -k*5/60 - 5k*4/24 - 2k*3/3 + 13k*2. What is d(-4)? 0 Suppose -5m = -f - 12, -8m = -3m + 5f. Let s(n) = n3 + 5n*3 - 7n3 - nm + n. Suppose 4i - t - 5 = 0, 0 = 4i + 2t + 1 + 9. What is s(i)? 0 Let f(s) = -2s*2 - 3s - 1. Let g be 3 - (7 - 3) - 2. What is f(g)? -10 Let m(n) be the first derivative of -n*2/2 - 9n + 48. Give m(-4). -5 Let f(n) = -5n - 8. Let i(j) = j + 1. Let k(w) = -f(w) - 6i(w). Suppose 0 = -4m + 5u - 40, -3m - 4u + 5u = 30. Let a = -7 - m. Calculate k(a). -1 Let q(k) be the second derivative of -k3/3 - k2 - 2k. Calculate q(2). -6 Let w(j) = 7j3 - j. Let z be w(1). Suppose m - z = -m. Let v(y) be the first derivative of -y3/3 + 3y*2/2 + y + 6. Calculate v(m). 1 Let h(m) = 3m*3 + 4m*2 - 3m. Let f(o) be the first derivative of -o*4/4 + o - 3. Let j(y) = 4f(y) + h(y). Determine j(3). 4 Let n(v) = v - 1. Let a(t) = -4t + 7. Let s(l) = a(l) + 5n(l). Let i(o) = o*3 - 2o*2 - 11o + 5. Let r be i(4). Calculate s(r). -5 Suppose 0 = -5y + 1 + 9. Let l(v) = -v - 7 + yv - 3. Let b = 67 - 67. Calculate l(b). -10 Let i(n) = n + 1. Let s be i(2). Let r(d) be the second derivative of 1/2d3 + d - 1/20d*5 + 1/6d*4 - 2d2 + 0. Calculate r(s). -4 Let y(w) = -w3 + 3w2 + 3w. Let v be (-12)/36 + (-5)/(-6)4. Give y(v). 9 Let g(a) = a + 2a + 0 + 1 + 1 + 5a2. Determine g(-2). 16 Suppose -16 = -7l - l. Let b(f) = -6f + 3. What is b(l)? -9 Let c(p) = -p3 - 5p2 + p - 7. Let x be 10/(3 - 4 - 1). Let s = -10 - x. What is c(s)? -12 Let s(f) be the third derivative of f6/120 + f5/15 + f4/12 + f*3 - 2f2. Let p be s(-4). Let k(h) = -h3 - 5h2 + 0 + 1 + h2. What is k(p)? -7 Let p = -3 - -4. Suppose -2d + p = -9. Let k(f) be the third derivative of -f6/120 + f5/10 - f4/4 + f3 - f2. Determine k(d). 1 Let h(n) = n2 - 5n - 12. Let c(v) = 1. Let k(x) = 5c(x) + h(x). Suppose i - 32 = -4s, -4i = -5s - 56 + 12. Suppose 0 = 4d - 4 - i. Give k(d). -7 Let c(n) be the third derivative of n*5/60 - 5n4/24 + n3/3 - 5n2. Determine c(3). -4 Let z(n) = -3n*2 - 1. Let y(s) = -2s - 3. Let l be y(-3). Suppose -8 = -2v - 2r, -lv + 4v + 3r = 14. Calculate z(v). -4 Let v(o) = 0 + 4o*2 - 1 - 3o*2 + 5o. Suppose -y - 7 = 4b - 4y, -4y = -3b. What is v(b)? -5 Let k = -28 + 29. Let h = 3 - -2. Let r(y) = 11y + 4. Let t(s) = -12s - 5. Let p(l) = hr(l) + 4t(l). Give p(k). 7 Suppose y = -0y + 3. Let f(t) = -9t - 4 - t*3 + 8t*2 + yt - t2. What is f(6)? -4 Let n(g) = -g2 - 2 - 3g + 2g - g. Let x(m) = -m*2 + 6m + 14. Let y be x(8). What is n(y)? -2 Let x(b) = 5b3 - b2 - 5b - 4. Let i(c) = -c + 2c + 5 - c3 - 1 - 3. Let h(g) = 4i(g) + x(g). Give h(-1). -1 Let f(x) = -x*2 - 7x + 4. Let v be 15/(-2) + 1 - 2/4. What is f(v)? 4 Suppose -5x - 59 = -69. Let n(y) = y2 - y + 2. What is n(x)? 4 Let f(k) = -3k3 - k2 - 7k - 2. Let n(j) = 7j*3 + 3j*2 + 14j + 5. Let l(g) = 9f(g) + 4n(g). What is l(-5)? -13 Let x(p) = 4p - 2. Let y(l) = -2l - 1. Let c(v) = x(v) - y(v). Determine c(1). 5 Let y(r) = -2r + 3 + 0r3 + r2 + r*3 + 5r. Suppose 2l = 4w + 16, 0 = 2l + 12	{ "pile_set_name": "DM Mathematics" }
icked without replacement from votvvyvyyv. 1/15 Four letters picked without replacement from eeeneeeneeeeenennn. Give prob of sequence neee. 11/102 Two letters picked without replacement from {e: 1, c: 1, b: 1, z: 2}. What is prob of sequence eb? 1/20 Four letters picked without replacement from jjyjwyyyjzjyqyy. What is prob of sequence ywqy? 1/780 Calculate prob of sequence rvv when three letters picked without replacement from rrvrvr. 1/15 Two letters picked without replacement from bebbeubedsdsdyy. What is prob of sequence by? 4/105 Four letters picked without replacement from llaaaaaaaalaaaaaal. What is prob of sequence aaal? 91/765 Calculate prob of sequence pspp when four letters picked without replacement from {p: 10, s: 2}. 4/33 Calculate prob of sequence gggw when four letters picked without replacement from {w: 6, g: 4}. 1/35 Four letters picked without replacement from {q: 9, g: 11}. What is prob of sequence qggg? 99/1292 What is prob of sequence jcc when three letters picked without replacement from cccicmhcjccmcccmhcjc? 11/285 Two letters picked without replacement from {w: 1, p: 1, h: 10, f: 4, x: 3}. Give prob of sequence ff. 2/57 Three letters picked without replacement from {u: 3, p: 2, a: 1, v: 5, l: 1}. Give prob of sequence avv. 1/66 Two letters picked without replacement from hmnpjjppp. What is prob of sequence pn? 1/18 Calculate prob of sequence aa when two letters picked without replacement from aaggaaaaaaagaagqg. 55/136 Four letters picked without replacement from {j: 1, o: 3, u: 1}. What is prob of sequence uojo? 1/20 What is prob of sequence ne when two letters picked without replacement from nneooennoonnno? 1/13 Four letters picked without replacement from {r: 3, a: 15}. Give prob of sequence araa. 91/816 What is prob of sequence ac when two letters picked without replacement from ccaacacacc? 4/15 What is prob of sequence yyf when three letters picked without replacement from yyyyyfyyyyyy? 1/12 Three letters picked without replacement from {w: 5, p: 1, l: 1, t: 4, h: 5}. What is prob of sequence hth? 1/42 What is prob of sequence vs when two letters picked without replacement from {v: 2, u: 11, d: 1, s: 1, g: 3, i: 1}? 1/171 Four letters picked without replacement from xcccxccc. Give prob of sequence xcxc. 1/28 Calculate prob of sequence lz when two letters picked without replacement from {f: 1, z: 4, u: 3, l: 2}. 4/45 Four letters picked without replacement from orhhrhcocho. Give prob of sequence crcr. 1/1980 Two letters picked without replacement from wzzpzzzpzzppz. Give prob of sequence pp. 1/13 What is prob of sequence ep when two letters picked without replacement from empbbeeemmepeeb? 1/15 Three letters picked without replacement from ayaaaabaa. Give prob of sequence aab. 1/12 Calculate prob of sequence zof when three letters picked without replacement from {o: 4, t: 1, f: 2, u: 2, z: 2, i: 1}. 2/165 Two letters picked without replacement from {t: 5, s: 1, h: 2, x: 1}. What is prob of sequence tx? 5/72 Two letters picked without replacement from bbddaaabbaabaa. What is prob of sequence ab? 5/26 Four letters picked without replacement from mmazazzmm. Give prob of sequence ammz. 1/42 Calculate prob of sequence yvyc when four letters picked without replacement from lnccnvssycnsy. 1/2860 Calculate prob of sequence keee when four letters picked without replacement from {k: 3, j: 2, h: 7, e: 1, m: 1}. 0 Four letters picked without replacement from {d: 7, y: 2, c: 1, n: 7}. What is prob of sequence dnyy? 7/4080 Three letters picked without replacement from yvymyvvvyvvmy. What is prob of sequence mvm? 1/143 Two letters picked without replacement from ppsppppspsnssi. What is prob of sequence ss? 10/91 Two letters picked without replacement from {x: 5, w: 5, p: 3, f: 2}. What is prob of sequence fp? 1/35 Four letters picked without replacement from fttssttfffrsftt. Give prob of sequence rtfs. 1/364 Three letters picked without replacement from {g: 2, r: 3, q: 4, c: 1, z: 1, j: 1}. Give prob of sequence zcc. 0 Three letters picked without replacement from iaiiiwnwwikiwnaki. Give prob of sequence nni. 7/2040 What is prob of sequence zf when two letters picked without replacement from zffzffzfffzffzfzff? 4/17 What is prob of sequence xiw when three letters picked without replacement from vvvvxivvwvvxxixivwv? 4/969 What is prob of sequence dldl when four letters picked without replacement from {l: 9, d: 3}? 2/55 Calculate prob of sequence yf when two letters picked without replacement from {y: 2, h: 2, f: 2}. 2/15 Calculate prob of sequence gj when two letters picked without replacement from jjngjxgijjaxxxxgjgj. 14/171 Four letters picked without replacement from {x: 2, j: 1, y: 1, d: 2, z: 1}. What is prob of sequence jzdy? 1/420 Four letters picked without replacement from {l: 11, i: 3}. What is prob of sequence iili? 1/364 Calculate prob of sequence qhh when three letters picked without replacement from {j: 1, g: 1, n: 1, h: 6, q: 2, y: 4}. 2/91 Calculate prob of sequence uf when two letters picked without replacement from {u: 2, f: 1, j: 3, x: 1, h: 1, n: 4}. 1/66 Calculate prob of sequence sass when four letters picked without replacement from aasaaaaaasaasaaaaa. 1/816 Three letters picked without replacement from tuxoyuw. What is prob of sequence uty? 1/105 Three letters picked without replacement from {n: 4, x: 4, c: 2, v: 1}. Give prob of sequence xxx. 4/165 Calculate prob of sequence ee when two letters picked without replacement from {p: 1, e: 3, x: 1}. 3/10 What is prob of sequence ck when two letters picked without replacement from {c: 9, k: 3}? 9/44 Four letters picked without replacement from llcllclllllcclcllcct. Give prob of sequence ltcc. 7/1615 Calculate prob of sequence vui when three letters picked without replacement from vui. 1/6 What is prob of sequence zz when two letters picked without replacement from znkzekkknkckn? 1/78 Calculate prob of sequence wu when two letters picked without replacement from {k: 5, w: 2, u: 1, n: 6, t: 1}. 1/105 What is prob of sequence wtm when three letters picked without replacement from {w: 1, m: 1, v: 1, t: 2, g: 2}? 1/105 Calculate prob of sequence azsa when four letters picked without replacement from ssysasaz. 1/210 Four letters picked without replacement from {k: 1, r: 4, h: 1, g: 2}. What is prob of sequence rrkg? 1/70 Calculate prob of sequence mi when two letters picked without replacement from icqvmqc. 1/42 What is prob of sequence cwk when three letters picked without replacement from {k: 1, m: 1, c: 2, w: 1}? 1/30 Four letters picked without replacement from bbbhbbbbbbbbbhbhbbbh. Give prob of sequence hhhb. 16/4845 Two letters picked without replacement from lvllvl. Give prob of sequence lv. 4/15 Two letters picked without replacement from bbbbxxbbbx. What is prob of sequence xx? 1/15 Calculate prob of sequence hh when two letters picked without replacement from ehhhehe. 2/7 Calculate prob of sequence aaia when four letters picked without replacement from {i: 9, a: 7}. 9/208 Four letters picked without replacement from {z: 17, w: 3}. What is prob of sequence wwwz? 1/1140 Four letters picked without replacement from {r: 3, t: 2, g: 2, s: 2}. What is prob of sequence gtss? 1/378 What is prob of sequence ba when two letters picked without replacement from {g: 1, k: 7, a: 3, i: 6, b: 2}? 1/57 Two letters picked without replacement from nnqnnnannjqnnn. What is prob of sequence jq? 1/91 What is prob of sequence daa when three letters picked without replacement from babtbbadbbbbbb? 1/1092 Four letters picked without replacement from {p: 7, s: 2, l: 2}. What is prob of sequence sppp? 7/132 Two letters picked without replacement from {y: 3, m: 1, j: 5, r: 1, u: 2, e: 1}. What is prob of sequence ry? 1/52 Two letters picked without replacement from wwwmwmmwmmwwwkmwwww. Give prob of sequence ww. 22/57 Calculate prob of sequence ssss when four letters picked without replacement from jsssssss. 1/2 Calculate prob of sequence rj when two letters picked without replacement from jrjwjwwww. 1/24 Calculate prob of sequence qbqq when four letters picked without replacement from qbqppqbqxqpq. 2/99 Two letters picked without replacement from yut. What is prob of sequence yt? 1/	{ "pile_set_name": "DM Mathematics" }
f c? False Let x(w) = -2w - 1. Let i be x(4). Let l = i - -25. Suppose l = v + v. Is 4 a factor of v? True Suppose 3d = 5d - k - 10, 5d - 2k = 24. Suppose 2w - 16 = -db, -2b - w + 12 = w. Suppose -9 = -bs + 2p + 31, -5p = -s + 4. Is 8 a factor of s? True Let w be 8(-1 + (-1)/(-4)). Suppose 0 = 3x + 3n + 36, x + 0x = -2n - 8. Let u = w - x. Does 10 divide u? True Let j(q) = q*3 + 5q*2 + 4q + 5. Let u be j(-4). Suppose 0 = 3i - 5c - 31, -2i + ui - 55 = -c. Suppose -2t + i = -3. Does 4 divide t? False Let g = -38 + 116. Does 26 divide g? True Let f(x) = x - 12. Does 2 divide f(14)? True Let l = -639 - -923. Suppose -4r = 5q - 65 - 157, l = 5r + 3q. Is 29 a factor of r? True Suppose 0m + 1386 = 6m. Is 33 a factor of m? True Let y be (14/8)/((-7)/(-336)). Suppose -4w = -y - 20. Suppose -3b - w = -4b. Is 13 a factor of b? True Let p be 0 + -2 + (-12 - 0). Let f = -10 - p. Suppose 0 = 2c - c - f. Is 2 a factor of c? True Suppose -l + 11 = -7. Is l a multiple of 5? False Suppose -l + 3c + 26 + 7 = 0, l = 4c + 34. Does 3 divide l? True Let q = 9 - 8. Let l be (q - -2) + 1-39. Does 18 divide (-640)/l - (-4)/18? True Suppose 4h = h + 18. Let r(l) = -1 - l3 + 3l*2 + 2l*2 + h + l. Is r(4) a multiple of 13? False Suppose -n + 6n = 0. Suppose -2a - x + 10 = n, -4x - x + 25 = 5a. Suppose 5p - 3z - 75 = 0, -3z - 50 = -ap - 5z. Is 12 a factor of p? True Let j = -120 - -243. Suppose -2p + 4n - j = -5p, 33 = p + 4n. Is p a multiple of 18? False Suppose c + 7 = 2c. Is 7 a factor of c? True Let z be 3(-2 - -1) + 54. Suppose 3j = -4x + z, j + 0j - 1 = 0. Is 6 a factor of x? True Let p(f) = -f2 - f + 30. Let l be ((-8)/12)/(4/(-18)). Suppose -lj = j. Is p(j) a multiple of 15? True Suppose 2z + 2z + 4 = 0. Does 10 divide (z - -2)/(1/19)? False Let n(i) = -i*3 + 6i*2 - 3i - 2. Let u = 10 - 6. Is 6 a factor of n(u)? True Let b = -10 + 13. Suppose 4d = p + 5d - 24, bd = -2p + 52. Is 20 a factor of p? True Let m = -7 + 9. Suppose -5 = -ms + 1. Is s(14 - 3) + 1 a multiple of 17? True Let d(x) = x*2 - 7x + 28. Is d(11) a multiple of 24? True Suppose -885 = 7r - 10r. Suppose -k = -2x - 50, 5x = -9k + 4k + r. Is 28 a factor of k? True Suppose 3p + 7 + 8 = 0. Let t = p + 0. Let w = t + 12. Is 7 a factor of w? True Let m be 12/(-5)(-10)/4. Suppose mq = 2q. Let d = 15 - q. Is d a multiple of 8? False Suppose 10 = 5x - 5v, 4x = 2v - 0 + 14. Let z(p) = -p. Let y(i) = 4i - 4. Let a(h) = y(h) + 2z(h). Does 6 divide a(x)? True Let r(g) = -12g + 6. Is r(-2) a multiple of 10? True Let h(n) = 3 - 2 + 4 + n. Let c be h(-3). Suppose -ca - b + 22 = 0, 3a - 3b = -5 + 20. Does 8 divide a? False Let n be (-2)/(-2) + (4 - 2). Suppose 0 = -y - 0y + 13. Let u = n + y. Does 13 divide u? False Let b(v) = 2v*2 - 4v + 4. Is 10 a factor of b(3)? True Suppose -2d + 5d - 37 = -k, d + 109 = 4k. Is k a multiple of 6? False Suppose -86 + 220 = 2z. Let m = z - 45. Is m a multiple of 11? True Let s(g) = 17g3 + 4g*2 - 4g - 1. Is s(2) a multiple of 11? True Let g(r) be the third derivative of -r*5/60 + 7r*4/12 + 3r*3/2 - 7r2. Is 24 a factor of g(8)? False Let w(a) be the second derivative of a5/20 + 7a4/12 + a3/2 - 5a*2 + 6a. Is 4 a factor of w(-6)? True Suppose 5m - 25 = -2u, -4u + 5m = -3 - 32. Is u a multiple of 10? True Let o = 4 + -6. Is 3/6o + 22 a multiple of 8? False Suppose -3x - 35 = 2x. Let v(g) = g2 + 5g + 1. Is v(x) a multiple of 6? False Let n(j) = j + 6. Let l be n(-7). Let t = 2 - l. Does 2 divide t? False Suppose 0 = 3o - 2o - 5. Suppose of + 42 = 7f. Does 7 divide f? True Let a(f) = f + 1. Let v be a(5). Suppose 5k - 24 = -3x, vk - 8 = -x + 7k. Is x a multiple of 8? True Suppose 0 = -2k + 24 + 20. Suppose 4l = 22 + k. Does 8 divide l? False Suppose 5z - 4b + 14 = -b, 3b - 12 = 3z. Let f(p) = p + 1. Let m be f(z). Suppose 2o - 32 = -mo. Is o a multiple of 8? True Is (1 - 4 - -3) + 4 + 71 a multiple of 2? False Let f be (-30)/(-42) + 2/7. Is 8 a factor of (-1)/(3/(-27)) - f? True Suppose 3a - 120 = 3u, -a = -2a - 5u + 34. Is a a multiple of 13? True Suppose u = 4u. Suppose -j + uj = -12. Does 6 divide j? True Suppose -3v = -32 - 4. Is 53/2 - (-6)/v a multiple of 27? True Let l(a) = -a3 - 8a*2 - 4a + 4. Is 9 a factor of l(-8)? True Suppose y - 22 - 53 = 0. Does 25 divide y? True Let r(f) = 2f2 + 6f + 14. Is 14 a factor of r(-10)? True Suppose p - 6p + 20 = 0, -4f - 96 = 2p. Let l = f - -59. Does 12 divide l? False Suppose -4p + 83 + 45 = 0. Let t = -14 + p. Is 6 a factor of t? True Suppose 4i - 8i = -56. Is i a multiple of 7? True Suppose -6 = 3c - c, -s + 79 = -3c. Is s a multiple of 7? True Suppose -3o + 0o = -2y + 2, 14 = 3y + o. Suppose -3p - 2u = -1 - 2, -yp = -3u - 21. Is p even? False Suppose 2j - 18 = 4l, 2j + 4 = 14. Let v be 3/(0 - 3/l). Does 3 divide 16/v - (0 - -1)? False Does 18 divide 3((-15)/(-3) + 25)? True Does 20 divide 4/(-1) - (-168 + 4)? True Suppose 4z + r = -r + 584, r - 148 = -z. Suppose 2n = -2n + z. Does 12 divide n? True Let f = 3 + 0. Let s = f - 3. Suppose -o - 3u + u + 13 = s, 3u = 5o. Is o even? False Suppose 4f - 350 = -f. Let l = f - 42. Does 9 divide l? False Let a = 342 + -222. Is 24 a factor of a? True Suppose -2l = -7l, 3q - 3l = 150. Is 5 a factor of q? True Is 2 a factor of (-7 - -35)(-6)/(-8)? False Suppose 4r + 3y = y + 28, -34 = -5r - 3y. Let t = r - 4. Is -1 - ((3 - t) + -27) a multiple of 9? True Suppose h = 2h - 98. Does 14 divide h? True Let p(s) = s. Let o be p(6). Suppose -3z + 2r = -30, -z - r = -or + 3. Does 4 divide z? True Suppose 0 = -3t - 3, t - 17 = -2l. Is l even? False Suppose 3v = 1 - 10. Let b be 2/(v - -1 - -4). Let y(d) = 7d3 - d2 + d - 1. Is 2 a factor of y(b)? True Let m = 12 - 6. Suppose ma - 120 = a. Is 9 a factor of a? False Let p(f) be the second derivative of f7/2520 - f6/90 + f5/40 + f4/4 - 3f. Let k(o) be the third derivative of p(o). Is k(9) a multiple of 11? False Let v(h) = -2h2 + 49h - 21. Does 9 divide v(21)? True Let k = -3 - -5. Suppose -2n + k = -10. Does 4 divide n? False Suppose 0 = 3z + z. Suppose 3a + 3j + 18 = z, 3a + 2j - 6j = -25. Let u = -4 - a. Is 3 a factor of u? True Is (48 + 0)-2(-12)/18 a multiple of 16? True Let r = 442 - 147. Let i = -131 + r. Suppose -4d = 2t - 68, -5t + i = 5d - 16. Is 19 a factor of t? True Suppose -195 + 600 = -5y. Let b = y - -123. Does 13 divide b? False Suppose -148s + 56 = -147s. Does 8 divide s? True Suppose 20 = 4u - 0. Let i be -1 + (u - 0 - 0). Is 7 a factor of 159/15 + i/10? False Let c(d) = 21d*2 + 2d - 3. Let u be c(-3). Suppose -u = -n - 4n. Is 12 a factor of n? True Let r(i) = -i3 + 9i*2 - 8i + 5. Let k be r(8). Suppose 0f - 3f + 3w = -9, f - kw = 15. Suppose -4g - g + 50 = f. Is g a multiple of 7? False Let a(h) = h2 - 17h + 18. Let k be a(8). Let d = k + 124. Is d a multiple of 14? True Let r(d) = d*2 + 5d + 2. Let k(l) = -l*3 + 2l*2 + l - 1. Let p be k(3). Let i be r(p). Is i/(-6)(-9)/2 a multiple of 12? True Suppose 0 = -5v - 25, h + 6v + 10 = 3v. Suppose hp - 4q = 188, p - q = 59 - 22. Is p a multiple of 20? True Let r(o) = o - 8. Let p be -2 + 10 + 1 + -1. Let l be r(p). Suppose i + 1 - 11 = l. Does 10 divide i? True Let c(n) = n3 + 3n*2 - n. Let h be c(-2). Let p be (h(-3)/(-6))/1. Suppose -6o + po = -84. Is o a multiple of 14? True Let p(z) = -2z - 11z2 - z + z3 + 13z2. Is 9 a factor of p(2)? False Let g(z) = 2z - 4. Let v be g(8). Suppose c - v = -c. Is 13 a factor of (-4)/c - 164/(-12)? True Suppose -4v + 2k = -k - 248, -5k = -4v + 248. Suppose 0 = 5c + 22 - v. Is c a multiple of 4? True Suppose 5p + 430 = 4r, 212 = 3r - r - p. Is 35 a factor of r? True Let h be (5 - -2)/(-1)1. Let o(y) = -6 - 6y - 4y - y - y2. Does 17 divide o(h)? False Let o be (-3)/12 + (-191)/4. Let t = 68 + o. Suppose f - 3f + 20 = c, 4f - t = 0. Does 6 divide c? False Suppose -3s + 19 = -5q, 5s + 2q + 15 = -5. Does 9 divide -2 - (s - -2 - 37)? False Let v = -29 + 52. Suppose -3b + 15 = 0, 2p + 0b + b - v = 0. Is 14 a factor of (3/1)/(p/66)? False Suppose -4*b + b = 0.	{ "pile_set_name": "DM Mathematics" }
2, d: 1, i: 1, g: 1, h: 1}. What is prob of picking 1 d and 1 e? 1/14 Three letters picked without replacement from {i: 1, p: 5, o: 1, r: 2, e: 1}. What is prob of picking 1 p, 1 o, and 1 r? 1/12 What is prob of picking 2 b and 2 m when four letters picked without replacement from {m: 3, b: 3}? 3/5 What is prob of picking 1 y and 1 o when two letters picked without replacement from gycoycc? 2/21 Four letters picked without replacement from {u: 4, h: 2}. Give prob of picking 2 h and 2 u. 2/5 What is prob of picking 1 v and 1 h when two letters picked without replacement from hddhxdpvdhvvd? 3/26 Three letters picked without replacement from wzwza. What is prob of picking 1 z and 2 w? 1/5 Three letters picked without replacement from ueebbbuhuu. What is prob of picking 2 e and 1 h? 1/120 Four letters picked without replacement from {h: 9, s: 1, x: 5, m: 1}. Give prob of picking 1 s, 1 x, and 2 h. 9/91 Three letters picked without replacement from {y: 4, j: 1, h: 3, v: 3}. What is prob of picking 1 j, 1 h, and 1 y? 4/55 Three letters picked without replacement from {l: 3, p: 2, k: 1, d: 6, i: 4, y: 2}. Give prob of picking 1 i and 2 d. 5/68 What is prob of picking 1 e and 1 d when two letters picked without replacement from {l: 2, e: 3, d: 1, u: 2, m: 3, w: 9}? 3/190 What is prob of picking 1 u, 2 h, and 1 j when four letters picked without replacement from ghuglljuhhlghhhghl? 7/510 Four letters picked without replacement from {a: 4, f: 4, m: 1, o: 1}. Give prob of picking 1 m and 3 a. 2/105 Two letters picked without replacement from iiwwwbbiw. Give prob of picking 2 w. 1/6 Four letters picked without replacement from dbbdbdbbdbbdbbbbbbbb. What is prob of picking 4 d? 1/969 Calculate prob of picking 2 e and 1 r when three letters picked without replacement from llrlllelel. 1/120 What is prob of picking 3 i when three letters picked without replacement from {i: 3, o: 2, r: 4, g: 2}? 1/165 Two letters picked without replacement from aebxttxttnaettbtt. Give prob of picking 1 t and 1 a. 2/17 Calculate prob of picking 2 w when two letters picked without replacement from ryycyoyyccwhcywyoycw. 3/190 Four letters picked without replacement from {c: 3, m: 9, z: 1, g: 1}. What is prob of picking 3 m and 1 g? 12/143 Calculate prob of picking 1 k and 1 d when two letters picked without replacement from {k: 3, c: 2, q: 1, y: 6, d: 5, f: 2}. 5/57 Calculate prob of picking 3 x when three letters picked without replacement from {x: 3, p: 4}. 1/35 Two letters picked without replacement from jjijij. What is prob of picking 2 j? 2/5 Three letters picked without replacement from owwjqq. Give prob of picking 2 q and 1 o. 1/20 Two letters picked without replacement from {p: 2, x: 1, v: 1, d: 1}. What is prob of picking 1 d and 1 v? 1/10 Two letters picked without replacement from {n: 3, k: 6, f: 6}. Give prob of picking 2 n. 1/35 Three letters picked without replacement from {r: 4, o: 1, m: 7, z: 1}. What is prob of picking 3 m? 35/286 Four letters picked without replacement from lblrbbrbbybb. What is prob of picking 1 r and 3 b? 14/99 Calculate prob of picking 3 u when three letters picked without replacement from {u: 3, m: 3, z: 1}. 1/35 Three letters picked without replacement from {o: 7}. Give prob of picking 3 o. 1 Calculate prob of picking 3 h when three letters picked without replacement from {y: 6, h: 12}. 55/204 Four letters picked without replacement from {g: 2, q: 2, m: 6, s: 3, x: 1, z: 1}. Give prob of picking 2 g and 2 m. 1/91 What is prob of picking 1 o, 1 r, 1 m, and 1 g when four letters picked without replacement from {r: 1, m: 3, l: 1, q: 1, g: 5, o: 2}? 6/143 Three letters picked without replacement from zaaaizfiffaff. What is prob of picking 1 i and 2 f? 10/143 Calculate prob of picking 1 w, 1 m, and 1 e when three letters picked without replacement from {m: 1, j: 1, e: 5, l: 6, w: 1}. 5/364 What is prob of picking 1 e and 2 h when three letters picked without replacement from oeeeeeeeegeheeoehg? 1/68 What is prob of picking 2 o and 1 i when three letters picked without replacement from {g: 10, o: 4, i: 5}? 10/323 Two letters picked without replacement from {n: 1, l: 1, z: 1, w: 2, y: 1, m: 2}. What is prob of picking 2 w? 1/28 Four letters picked without replacement from {t: 1, x: 2, n: 4, w: 1, m: 2}. What is prob of picking 1 x, 1 t, and 2 m? 1/105 What is prob of picking 1 t and 3 s when four letters picked without replacement from ttssswtss? 5/21 Three letters picked without replacement from {x: 1, h: 3}. What is prob of picking 1 x and 2 h? 3/4 Calculate prob of picking 1 t, 1 a, and 2 m when four letters picked without replacement from {m: 5, a: 2, t: 7}. 20/143 Calculate prob of picking 1 p, 1 x, and 1 m when three letters picked without replacement from ppxamapvpap. 1/33 What is prob of picking 2 q when two letters picked without replacement from kbbbbqqoqqkqq? 5/26 Four letters picked without replacement from {c: 1, t: 3, z: 10, d: 4}. What is prob of picking 1 d and 3 z? 8/51 Calculate prob of picking 1 c and 3 z when four letters picked without replacement from {z: 3, c: 8, d: 4, b: 4}. 2/969 What is prob of picking 1 z and 2 p when three letters picked without replacement from zzzzzppzzzz? 3/55 Four letters picked without replacement from ndnsvsvtsnnsnsnnns. What is prob of picking 1 t, 2 n, and 1 d? 7/765 Two letters picked without replacement from {x: 1, z: 1, w: 3, v: 1, q: 1}. Give prob of picking 1 q and 1 v. 1/21 Four letters picked without replacement from {j: 1, l: 4, i: 9}. What is prob of picking 2 i, 1 j, and 1 l? 144/1001 Calculate prob of picking 1 r and 1 c when two letters picked without replacement from {c: 3, p: 5, d: 3, r: 1}. 1/22 What is prob of picking 1 y and 1 t when two letters picked without replacement from vjjqqvnvytj? 1/55 What is prob of picking 1 t, 1 q, and 1 z when three letters picked without replacement from zzzzotzbqybzzytozbbt? 2/95 Two letters picked without replacement from wmqqm. What is prob of picking 2 q? 1/10 What is prob of picking 1 q and 1 d when two letters picked without replacement from dccxq? 1/10 What is prob of picking 2 v and 1 x when three letters picked without replacement from vxvvvvvxvxxvvv? 45/91 What is prob of picking 3 z and 1 u when four letters picked without replacement from {z: 10, q: 1, m: 1, b: 1, g: 5, u: 1}? 10/323 Four letters picked without replacement from zmmkpyook. What is prob of picking 1 o, 1 y, 1 z, and 1 k? 2/63 Two letters picked without replacement from zzbkbzkzk. What is prob of picking 2 b? 1/36 Three letters picked without replacement from wwsxaicsc. Give prob of picking 2 a and 1 c. 0 Three letters picked without replacement from nxnxxxnkxnx. What is prob of picking 3 n? 4/165 Three letters picked without replacement from {d: 7, f: 3, y: 3, t: 1}. Give prob of picking 1 t, 1 f, and 1 d. 3/52 What is prob of picking 2 q when two letters picked without replacement from qbbbqbbbbq? 1/15 Three letters picked without replacement from llrrp. What is prob of picking 2 l and 1 p? 1/10 Two letters picked without replacement from {l: 7, m: 3, a: 4}. What is prob of picking 2 m? 3/91 What is prob of picking 2 f and 1 c when three letters picked without replacement from csffcsfffcfsfffs? 27/140 What is prob of picking 2 j when two letters picked without replacement from {x: 3, j: 2}? 1/10 Four letters picked without replacement from yyyyyzyyyzzy. What is prob of picking 1 y and 3 z? 1/55 Three letters picked without replacement from {j: 7, l: 7}. What is prob of picking 2 j and 1 l? 21/52 Three letters picked without replacement from kkcccck. Give prob of picking 2 k and 1 c. 12/35 What is prob of picking 2 h when two letters picked without replacement from {c: 4, h: 8, d: 2}? 4/13 Two letters picked without replacement from knqmmmknmkmnmmmmmk. What is prob of picking 1 k and 1 m? 40/153 Four letters picked without replacement from {e: 1, h: 6, z: 1, j: 2, u: 8}. What is prob of picking 1 z, 2 u, and 1 e? 7/765 Two letters picked without replacement from {b: 3, l: 17}. What is prob of picking 1 l and 1 b? 51/190 Calculate prob of picking 1 c and 2 d when three letters picked without replacement from dzdccdcddcccdddddc. 105/272 Three letters picked without re	{ "pile_set_name": "DM Mathematics" }
digit of f/4 + (0 - -8)? 1 Suppose 3v + 6v = 657. What is the tens digit of v? 7 Suppose -148 = -t + 6. What is the tens digit of t? 5 Let i be ((-27)/(-45))/((-2)/(-10)). Let b be (-3)/9-19. What is the units digit of i/9 - (-5)/b? 2 Suppose 1 = q - 2n + 3, 5q - 2n + 50 = 0. What is the tens digit of 7 - q/(-3) - -46? 4 Let u(v) = 0 + 4v - v*3 - v - 1 - 4v*2. What is the units digit of u(-5)? 9 Suppose 21n - 350 = 19n. What is the hundreds digit of n? 1 Let r = -158 + 302. What is the units digit of r? 4 Let l be (2/(-3))/((-1)/3). Suppose 4o - 8 - 15 = -3u, -lo + 3u = -25. What is the units digit of o? 8 Let m be 5/3 - 6/(-18). What is the units digit of m/(-1) + 4 - 1? 1 Let m(f) = -7f + 3. Let a be m(-6). Let q = -66 + a. Let z = -9 - q. What is the tens digit of z? 1 Let p(v) be the second derivative of 3v4/2 - v2/2 - v. What is the units digit of p(1)? 7 Let y(j) = j + 8. Let v be y(-8). Suppose 5b + 0b + 50 = v. What is the units digit of (-94)/b + 6/10? 0 Let y = -24 + 14. Let o = 16 + y. Let h = 1 + o. What is the units digit of h? 7 Let w(b) be the third derivative of 0b + 0 + 1/60b5 + 1/3b*3 + 7/24b*4 - 3b*2. What is the units digit of w(-7)? 2 Suppose -b + 0 = -10. Suppose 0 = 3z - z + b, 11 = c - 3z. What is the units digit of c/(-6)27/2? 9 Let j be ((-10)/(-3))/(8/(-12)). What is the tens digit of 790/25 + 3/j? 3 Let q = 56 + 23. What is the tens digit of q? 7 Let q = -2 + 3. Let x = 3 - q. What is the units digit of x? 2 Let v(p) = -p*2 - 2p + 3. Let x be v(-3). Suppose -34 = -2y - 4b, -3y - b = 3b - 61. Suppose xr + y = 3r. What is the units digit of r? 9 Let q(o) = o + 2. Let w = -3 + 5. What is the units digit of q(w)? 4 Let h = 8 - 7. What is the units digit of h - 1 - 3 - -28? 5 Suppose 0 = d - 2d + w + 30, 2d = 3w + 62. Suppose -3t + 42 = -5p, -2t + 0p + d = -2p. What is the units digit of t? 4 What is the units digit of (-8)/8 + 311? 2 Let u = -2 - -67. What is the tens digit of u? 6 Suppose 2q + 317 = 3h, 3q - 70 - 54 = -h. What is the hundreds digit of h? 1 Let p(n) = n*3 + 9n*2 + 7n. Let o be p(-8). Let b(x) = 5x - x3 + 3x + 0x2 + 7x*2 + 11. What is the tens digit of b(o)? 1 Let s be (1/4)/((-1)/(-8)). Suppose 3l + 5v = -s, -4l + 0v + 5v = 26. Let b = 2 - l. What is the units digit of b? 6 Suppose 0 = -2h - d + 573, 2d + 79 = -5h + 1511. What is the hundreds digit of h? 2 Suppose -3j + 5r - 14 = -j, j + 2r - 11 = 0. Let t = 1 - -1. Suppose -tx - 5 = jx, -5x + 1 = w. What is the units digit of w? 6 Let p(i) be the second derivative of -i4/12 - 8i*3/3 - 9i*2 - 5i. What is the tens digit of p(-14)? 1 Suppose j - 5 = 0, -4t - 2j = -9 - 1. Suppose -65 = -3m + a, t = -3m - 3a - 0a + 57. What is the units digit of m? 1 Let u = -2 - 5. What is the units digit of (-2 - u)/((-2)/(-10))? 5 Suppose 2y - 4j + 3 - 13 = 0, 21 = y + 2j. Suppose y = -a + 32. What is the units digit of a? 9 Suppose a + t - 70 = 0, 5t - 80 = -2a + 45. Suppose -q + 6q = -a. What is the units digit of (9/(-15))/(1/q)? 9 Suppose 3v - 5v + 640 = 0. What is the units digit of v? 0 Suppose 0 = 3g - 12, -2x = -6x + 2g - 48. Let s be ((-6)/3)/((-4)/x). Let n = 3 - s. What is the units digit of n? 8 Let a = 2 - -10. Suppose -u = 2u - a. Suppose us + 4h - 48 = 0, -2s + 5h - h + 12 = 0. What is the units digit of s? 0 Let f(z) = -z3 - 2z*2 + 8z + 6. What is the units digit of f(-5)? 1 Let j(u) = u*2 - 3u + 14. What is the units digit of j(0)? 4 Suppose 11 = -4z + 3. Let f(q) = -7q - 1. What is the tens digit of f(z)? 1 Suppose 2c - 7 = 1. Suppose -88 = cx - 8x. What is the tens digit of x? 2 Suppose -5s + 5o = -0s - 495, 5o - 15 = 0. Let a be s/(-30) + 4/10. What is the units digit of a/22/(-3)? 1 Let v(j) = 5j. Let y(m) = 3m - 1. Let a be y(1). What is the units digit of v(a)? 0 Let t(k) = k*2 - 3k - 7. Let o be t(6). Let b(r) = 4r + 14. What is the units digit of b(o)? 8 What is the units digit of 4 + (-1)/(3/(-87))? 3 Let k(u) = -u - 4. What is the units digit of k(-5)? 1 Let p(s) = s3 - 8s*2 + 8s + 1. Let g be p(7). Suppose a - 32 = g. What is the tens digit of a? 4 Suppose -6n + n = 690. What is the units digit of n/(-10) - (-2)/10? 4 Suppose -1 - 4 = 5s. Let q = 11 + s. What is the tens digit of q? 1 Let x = 3 + -5. Let z be (5 - 1)(-1)/x. Suppose -4y = zg - 18, -3g = -0g - 2y - 43. What is the units digit of g? 3 Suppose -3s - y + 3y + 39 = 0, 2s = y + 25. What is the units digit of s? 1 Suppose 0 + 8 = 4x. Let i(h) = 5h2 + 2h*2 - 3h*3 - 4h*2 + 2h + xh3. What is the units digit of i(3)? 6 Suppose 11 = -5d + 71. What is the units digit of d? 2 Suppose 0 = 2o + 3o + 25. Let l(g) = -2g2 - 19g + 13. Let q(a) = a*2 + 9a - 7. Let r(i) = oq(i) - 2l(i). What is the units digit of r(-7)? 9 Let a = 4 + 4. Suppose 5q + 1 = 4w, -5q - w + 11 = -a. What is the units digit of q? 3 Let z be (1211)/(-3) - 3. Let a = -33 - z. What is the tens digit of a? 1 Let g = -12 - -15. What is the units digit of g? 3 Suppose -4m + 3x = -22, x = -3x - 8. Suppose -4h + m = -12. Suppose 4i + 5u - 58 = 0, 7u - 18 = -i + hu. What is the units digit of i? 2 Let m be (-9)/(-15) - 12/(-5). Suppose -19 = -4a + 2a + md, -11 = 2a + 3d. Suppose -n + 48 = an. What is the units digit of n? 6 Suppose -2q - 3q = -15. Suppose -1 = -n + q. What is the units digit of n + 4/(-2) + 7? 9 Let f = 4 + -18. Let t be 4/(-6) + f/(-3). What is the units digit of (t - 2)/((-4)/(-2))? 1 Suppose -227 = -6a - 11. What is the tens digit of a? 3 Let b(i) = 5i*2 + 2i + 2. What is the units digit of b(-2)? 8 Suppose -5c - 11c = -5616. What is the units digit of c? 1 Suppose -62 = -4m + 38. Suppose -6c = -2c + 5r - 57, m = 5r. Suppose 2b + b = a - c, 0 = -4a + b + 10. What is the units digit of a? 2 Let r = -6 + 15. What is the units digit of r? 9 Let j(w) = w3 - 6w*2 + 8w + 12. What is the units digit of j(6)? 0 What is the tens digit of 5 + (4 - 11) - (-41 + 0)? 3 Let l = -2 + -20. What is the tens digit of (-1)/(0 + 2/l)? 1 Suppose 4p = -p + 15. Suppose j - v - 71 = -pj, -3v = -3. What is the tens digit of j? 1 Let u = -32 + 34. Suppose 2w - 8 = -0. What is the units digit of u/8 - (-23)/w? 6 Let z = 661 - 445. What is the hundreds digit of z? 2 Let i(u) = 51u2 - 3u + 1. What is the tens digit of i(1)? 4 Let b be (15/12)/(2/(-8)). Let q(o) = -o - 2. Let f be q(b). Suppose -3w + w = fk - 37, -4k + 40 = -2w. What is the tens digit of k? 1 Let q(l) = 4l2 - l - 7. What is the tens digit of q(-5)? 9 Let a(y) = -10y + 2. Let o be a(-3). Suppose -b + o = -0b. What is the tens digit of b? 3 Let z be -2(2/(-2) + -1). Suppose -zr = r. What is the units digit of 23 - (1 + 2 + r)? 0 Suppose f + r - 503 = -3f, -533 = -4f + 5r. What is the hundreds digit of f? 1 Let h = -276 - -494. What is the units digit of h? 8 Suppose 48 = -4w + 136. What is the tens digit of w? 2 Let g(j) = -8j - 4. Let a = 17 + -8. Suppose o + 2o = -a. What is the tens digit of g(o)? 2 Suppose -5q - 2x = -543, -q + 5x + 87 = -0q. Suppose 2k = -3z - 39 + q, -4k + 5z = -92. What is the units digit of k? 8 Let f be (12/10)/((-2)/(-10)). Suppose 19 = 5c - f. Suppose 37 = 3n - 2o, cn - 6 = 2o + 53. What is the units digit of n? 1 Let s(r) = -r + 1. Let t be s(-1). Suppose j = -tj + 57. What is the tens digit of j? 1 Suppose 673 = 4u - 5t, 0 = 3u - 5t - 401 - 110. Suppose -u - 78 = -5c. Suppose 5r - c = x - 3x, r = 4x + 14. What is the units digit of r? 0 Let f(u) be the third derivative of 11u*4/24 - 7u*3/6 - 3u*2. What is the units digit of f(4)? 7 Let q be 4(-6)/162. Let k = 0 - q. What is the units digit of 1k/610? 5 Suppose -k - 13k = -924. What is the units digit of k? 6 Let f(q) = -2q3 - 1 - 2q*2 + 7q - 4q2 + 2q*2 - 2q*2. Let v be f(-5). Suppose v = 5w - 21. What is the tens digit of w? 1 Suppose -3y = -39 + 6. Let a be (-2)/4 + 14/(-4). Let u = a + y. What is the units digit of u? 7 Let g(w) = -w3 + 8w*2 + 11w + 1. What is the units digit of g(9)? 9 Let p = 3 - -29. What is the units digit of p? 2 Suppose 0 = 2k - 6 - 0. Suppose 3d - 4*d = -3. Suppose -s + 33 = d	{ "pile_set_name": "DM Mathematics" }
d give y. -5014 Express (-m + 0m - m)(3 - 4 + 2)(-m - 2m - m) + (14m2 - 29m*2 - 13m*2)(2 + 2 - 2) as pm2 + v + fm and give p. -48 Rearrange 6 + 3s - 6 + ((3 - 2 + 0)(2s - 3s - 2s) - 13s + 8s + 2s - s - 3s + 9s)(-2 + 7 - 3) to the form ws + c and give w. 1 Express 0a + 2a*4 - 453a*3 + 451a*3 + 2a - 15 - 27a2 as ja*3 + z + ta*4 + ba*2 + ua and give b. -27 Rearrange -5t + 6t*2 + 3t*4 + 7t - 8492 + 8491 + 11t3 to k + qt*4 + nt + gt3 + pt*2 and give k. -1 Rearrange -458v - 4 + v*4 + 1374v - 160v3 - 455v - 461v to the form yv*4 + fv*3 + av + gv2 + l and give y. 1 Express (235y*2 - 164y*2 + 640y*2)(-12y + 14y - 8y) as ry + j + ay2 + ky*3 and give k. -4266 Express -4 - 14u*2 + 15u*3 + 20u*2 - 26u + 2u4 + 27u as h + su4 + fu*3 + ku + gu2 and give h. -4 Rearrange 3960i - 62043 + 124093 - 62050 to zi + l and give z. 3960 Express (0n - n + 0n)(65 + 63 - 168)(0n + 4910 - 4n - 4964) as cn*2 + tn + g and give c. -160 Express 2m + 2m*2 - 2 - 27 - 3m + 9 + 5m2 as qm*2 + pm + n and give n. -20 Rearrange (-11 - 5j + 11 + (-3j - j + 2j)(0 + 1 + 1))(-78j + 78j + 55j*2) to the form aj*2 + zj + l + sj3 and give s. -495 Express -269h*4 + 3 + 823h4 - h3 - 271h4 - 271h*4 - 4h*2 as qh + j + oh4 + ih*2 + yh3 and give i. -4 Express ((-o2 + o*2 - 2o*3)(-o + 5o - 3o) + 7o4 + 2o*4 - 3o*4)(-302 - 48 - 770) as co2 + ko*3 + n + ao*4 + mo and give a. -4480 Express -2185o - 2172 + 4346 - 2174 as vo + x and give v. -2185 Rearrange (-6b + 4b + 11b)(0 + 0 + 1)(154 + 73 - 823) to z + sb and give s. -5364 Rearrange (0h2 + h3 + 0h*2)(-389 + 176 - 199)(-5h - h - 2h) to the form sh*3 + th*2 + rh + x + ph4 and give p. 3296 Rearrange (-5 + 1 + 1)(316 - 15j2 + 324 + 75j*3 - 640) to the form kj*2 + uj*3 + sj + a and give k. 45 Express 43h2 - 45 + 97h*3 + 45 - h - 44h*2 in the form dh*3 + fh*2 + g + th and give d. 97 Express -2972v - 3928v + 2034v as jv + s and give s. 0 Express 90285h3 - 45141h*3 - h + 22 - 45145h3 + h2 as gh + d + zh*3 + ch*2 and give d. 22 Rearrange -2 + 2 - 3w + (2 - w - 2)(3174 - 1581 - 1345) to qw + o and give q. -251 Rearrange -27v2 + 7v*2 - 11v*2 + (-6v - 15v + v)(v - 2v + 2v) + 0v2 - v2 + 4v*2 to the form cv*2 + jv + o and give c. -48 Rearrange v - 19v3 - 19v*3 - 3v*3 + 79v*2 - 89v*2 to gv + kv2 + o + sv3 and give k. -10 Rearrange g3 + 13g - 148 + 331 - 3g - g*2 - 184 to lg*2 + v + kg + fg3 and give v. -1 Rearrange 2332293 - 2485y - 2332293 to the form m + uy and give u. -2485 Express 3n + 186n2 - 183n*2 - 105 - 74 + 49 in the form on*2 + j + xn and give j. -130 Rearrange (-22 - 7 - 13)(-2o + 3 - 3)(-6 - 163 + 331) to po + h and give h. 0 Express j3 - 1820 - j3 + 2927 - j3 - j2 + 0j2 as mj*2 + h + xj*3 + fj and give h. 1107 Express 8792h + 2h*4 + 24 - 26 - 2h*3 - 8910h in the form oh + ph*2 + ah*4 + r + bh*3 and give b. -2 Rearrange -2a + 7561 + 3719 + 2694 to ma + h and give m. -2 Express 37706 - 122n - 31352 + 120n as w + rn and give w. 6354 Express -628g3 + 241g + 75g2 - 239g - 78g2 in the form l + yg*3 + og*2 + zg and give y. -628 Express -2643n + 325 + 325 + 328 - 981 as ln + b and give b. -3 Rearrange -160m - 15m*3 - 5m - 18m3 + 37m*3 + 1 to tm*2 + jm + qm3 + a and give q. 4 Rearrange -2d*3 + 252 - 241 - 2d + 444d4 - 439d4 - d2 to the form md4 + qd*3 + vd*2 + od + u and give o. -2 Express -1673l4 + 2l*2 + 3l*3 - 590l + 2l2 - 5l*2 + 1676l*4 + 1 as xl + yl2 + cl*4 + p + jl*3 and give j. 3 Rearrange 354 - 945 - 1162t + 1163t to the form st + m and give m. -591 Rearrange -4u2 + 229 - u + 63 + 3u*3 - 236 to the form pu*2 + ru + w + du3 and give d. 3 Express -855724 - 117h + 855724 - 3h3 - 3h*3 in the form c + bh*3 + mh + dh2 and give b. -6 Rearrange (27v + 21v - 16v)(-3v + 4v - 5v)(-2v + 3v - 2v) to av3 + fv*2 + g + tv and give a. 128 Rearrange -2x2 + 3 + 0x + 222x + 457x - 1 to the form mx + sx*2 + c and give s. -2 Rearrange 5l*2 + 0l + 23249 + 6l - l3 - 23207 - 3l to the form y + tl + il*2 + dl*3 and give t. 3 Express 9i*3 + 5462i + 1 - i*2 + 5462i - 2i4 - 3 - 10929i - i*2 as yi*2 + zi*3 + ri*4 + x + mi and give r. -2 Express 415r2 + 414r*2 - 826r*2 - 19 - 3r + r*3 as jr*2 + lr + ir3 + s and give j. 3 Rearrange (2k*2 + 2k*2 - 2k*2)(0k + 7k + 4k)(-2k + 2 - 2)(1136 + 867 - 639 + 1462) to pk3 + ik*2 + d + mk*4 + zk and give i. 0 Express -2v + 1 - 1 + (-3 + 3 + 1)(3v - 3v - 2v) + 0v - 4v + 2v + (-3 + 6 - 1)(3v - 2v + v) - 1 + 44983017v + 1 - 44996421v as kv + g and give k. -13406 Express 6524z2 + 1713 - 3412 + 1699 in the form yz + fz2 + s and give y. 0 Rearrange (-138d*2 - 167d2 - d3 + 57d2)(-1 - d - d + 2) to the form md4 + wd + od2 + c + kd*3 and give m. 2 Express 1683v - 1 - 265v2 - 1686v - 50v2 as sv + qv2 + c and give q. -315 Rearrange (-2c + 3c - 5c)(-3 + 3 - 2c*3)(5 - 2 - 4)(-22 - 15 - 4) - 6c*4 - 12c*4 - 2c*4 to the form rc*4 + yc*3 + l + nc + sc2 and give r. 308 Express -39 + 40 + 23u + 14u2 + u + 20u + 40u2 as pu + lu2 + c and give c. 1 Rearrange ((1 + 2 - 5)(-2 - c + 2) - 6c + 3c + 2c)(2 - 2 - 2)(-684 + 255 + 153) + (-2c + 2c + 2c)(0 + 3 - 2) to the form g + pc and give p. 554 Rearrange 2 - 107a + 2563a*2 + 329a - 115a - 109a to the form va2 + i + ja and give v. 2563 Express f*2 - 17f*3 + 19f*3 + 9f*3 - f - 12f*3 - 2881 as lf*3 + m + xf + if2 and give x. -1 Rearrange -4o*4 + 22o2 + 1 - o3 + 127985o - 64000o - 63997o to the form mo*3 + so*4 + jo*2 + i + xo and give j. 22 Express (8v - v + 5v)(-111 + 491109v - 40 - 491112v) in the form ov + u + mv2 and give o. -1812 Express -44873 + 44873 + 2038g in the form k + cg and give c. 2038 Express -3f*2 - 176f*3 - 175f*3 - 175f*3 + 701f*3 - 176f*3 + 32f in the form of2 + a + uf + wf3 and give w. -1 Express -83j*2 - 3338j*2 + 17j*2 as qj + p + hj2 and give h. -3404 Express 3904d + 12464d + 7454d as j + zd and give z. 23822 Express -27c - 23c - 7c + 6 - 39c + 18c as jc + x and give x. 6 Rearrange 2r*2 + 41 + 4r - 237 + 32 + 81 - 8r to xr*2 + wr + v and give x. 2 Rearrange o*4 + 54o*3 + 3 + 1064298o*2 + 0o*4 - 1064300o*2 to zo*3 + ao*4 + s + vo + no2 and give a. 1 Rearrange (-2u*3 + 9 + 0u*3 - 12)(581u + 6u - 43u) to fu*4 + ou*3 + cu*2 + w + pu and give p. -1632 Express (2 + 3 - 3)(-u2 + 3u*2 + 0u*2)(-1160 + 2853 + 2291) in the form x + hu + bu*2 and give h. 0 Express (4d - 9d + 8d)(877d + 782d - 470d) in the form k + hd2 + ad and give h. 3567 Express 3p - p - 11 - 10p*4 - 968p*3 + 496p*3 + 465p*3 in the form ap*4 + op*2 + s + qp + bp3 and give q. 2 Rearrange ((0 - 2 + 1)(-3 + 5 + 0) + 1 + 3 - 3)(-p + p + 3p*2) + (3 - 1 - 3)(35 - 61 - 92)(4p2 + p2 - p*2) to the form z + kp*2 + gp and give k. 469 Express 20995 + 21012 - 42007 - 2193d in the form q + od and give o. -2193 Express 409 - 159 - 158d + 154d in the form yd + n and give n. 250 Rearrange 2r*3 + 11r*2 + 2027 + 10r*2 - 2019 to the form or*3 + tr*2 + gr + a and give o. 2 Express -4x2 - 4x*2 + 6x*2 + (0x + 2x + x)(26x + 63x - 186x) in the form yx*2 + dx + p and give y. -293 Express f + 18107f3 + 18098f*3 - 4f*2 + 5f*4 - 36469f*3 as xf*4 + h + af*2 + tf*3 + sf and give t. -264 Rearrange 3413 + 0v + v2 + 9v + 3413 - 6876 to the form tv + b + mv2 and give m. 1 Express (-c2 - c + c*2 - 2c*3)(11 - 11 + 18c) + (-8c - 5c + 2 - 5c)(10c*2 - 10c*2 + 5c*3) as bc*2 + hc*3 + pc*4 + k + ac and give h. 10 Rearrange 5d4 + 1 - 2d*2 - 11 - 4d*4 + 12 + 11d*2 to jd*2 + gd*4 + fd + w + ld3 and give w. 2 Express (2 - 3 - 1 + (-3 + 4 - 12)(-4 - 1 - 5) + 1	{ "pile_set_name": "DM Mathematics" }
rmine h so that x(h) = 0. -314, -1, 0 Factor -162/7 - 159/7g + 3/7g*2. 3(g - 54)(g + 1)/7 Let x(f) be the third derivative of f5/30 + 13f*4/4 - 82f*3/3 + 2f*2 - 35. Factor x(u). 2(u - 2)(u + 41) Let -142884/5 - 1512/5t - 4/5t2 = 0. What is t? -189 Suppose -3a = -4o - 1939, 4o = 5a - 3523 + 278. Suppose 654b*2 - ab*2 + 2b - 2 + 2 = 0. What is b? -2, 0 Let g(a) be the third derivative of -a*5/54 - 89a*4/12 - 160a*3/27 - 4795a*2. Solve g(s) = 0 for s. -160, -1/5 Let t(x) = 10x*2 - 2. Let l(f) = 23f*2 + 69f + 38. Let b(y) = -l(y) - t(y). Factor b(q). -3(q + 1)(11q + 12) Let f(h) be the third derivative of -2h*7/105 - 8h*6/15 - 83h*5/15 - 76h*4/3 - 56h*3 - 14h*2 + 8h - 2. Solve f(o) = 0. -7, -6, -2, -1 Let t be 9 + -5 + 3 + -9 + 5. Solve 99m2 + 77m*3 + 43m - m*4 + 46m*2 - 65 + 44 - tm*4 = 0 for m. -1, 1/4, 21 Let l be ((-3)/(-9))/((-4)/(-432)6). Let g be 24/(-18)(-1 - (-3)/l). Factor 1/3v*2 + v + g. (v + 1)(v + 2)/3 What is s in -1/11s4 + 20/11 + 48/11s + 6/11s3 + 35/11s*2 = 0? -2, -1, 10 Let p = -59/17 - -3785/1071. Let x(a) be the second derivative of pa*3 - 1/126a*4 + 0 + 0a*2 - 8a. Find n, given that x(n) = 0. 0, 4 Let z(l) be the first derivative of -l*6/3 - 82l*5/15 - 101l*4/3 - 272l*3/3 - 224l*2/3 + 256l/3 + 294. Solve z(s) = 0. -4, -2, 1/3 Let d(j) be the third derivative of j6/180 + j5/10 - 7j4/12 - 67j*3/6 - 6j*2. Let i(o) be the first derivative of d(o). Factor i(f). 2(f - 1)(f + 7) Suppose -o + b + 5 = 0, -337 + 328 = -3o + b. Factor -10n + 28/5n*o + 24/5 - 2/5n*3. -2(n - 12)(n - 1)2/5 Suppose 3f + 33 = 3y + 6f, 3y = 3f + 39. Find w such that 36 - 286w3 - 9w*2 + 0 + yw + 283w3 = 0. -3, -2, 2 Let q(i) be the third derivative of i6/600 - 17i*5/100 - 53i*4/60 + 521i*2. Factor q(m). m(m - 53)(m + 2)/5 Let v(r) be the third derivative of 0r + 0r4 + 0 + 1/105r*7 + 17/60r*6 + 0r*5 + 0r*3 + 100r*2. Factor v(p). 2p*3(p + 17) Let j(d) = -d*3 + 7d*2 + 10d + 17. Let w be j(8). Let r = w - 24. Factor -16o - 23o*3 - 14o*3 - 64o*2 + ro*3. -4o(o + 2)(7o + 2) Let i(s) = 3s*2 + 5s + 15. Let h be i(-20). Let m = -1113 + h. Let 2/7bm - 4/7b + 0 = 0. What is b? 0, 2 Let v be ((-19)/57)/((152/72)/19-1). Factor -2c*v + 2c + 5/2c2 - 9/4 - 1/4c4. -(c - 1)2(c + 1)(c + 9)/4 Let i(q) be the first derivative of -30 + 17/13q2 - 2/39q*3 + 76/13q. Factor i(b). -2(b - 19)(b + 2)/13 Let s(w) be the third derivative of 0w3 + 0w - 69w2 - 19/40w*4 - 1/100w*5 + 0. Factor s(p). -3p(p + 19)/5 Let x(c) be the third derivative of 4/3c*3 - 1/10c*6 + 1/2c*4 + 3c*2 - 3 - 1/15c*5 - 2/105c*7 + 0c. Let x(b) = 0. Calculate b. -2, -1, 1 Let g(w) be the first derivative of -25w4/4 - 545w*3/3 - 415w*2/2 + 105w + 94. Factor g(o). -5(o + 1)(o + 21)(5o - 1) Let d be (357/(-24) - -3) + 14/(-112). Let o(m) = -m*2 + 149. Let q be o(d). Factor 2/11w*3 + 0w + 0w2 - 2/11w*q + 0w*4 + 0. -2w*3(w - 1)(w + 1)/11 Let q be (-6)/(-27) - 7236/(-2430). Factor -12/5j*2 + 0j - 7/5j4 + qj*3 + 1/5j5 + 0. j2(j - 3)(j - 2)*2/5 Let f(p) be the first derivative of -10p*4 + 6p*2 - 26 - 8p + 29p4 + 16p*3 - 12p4. Let f(m) = 0. Calculate m. -1, 2/7 Let a(f) be the third derivative of f6/240 - 7f5/40 - 77f*4/24 - 18f*3 + 7210f*2. Let a(c) = 0. Calculate c. -4, -2, 27 Let b be (-50)/(-4)(-36)/(-45). Let z be b + 0 - (-6 - -7). Factor -7p + 3p*3 - zp*2 + 3p - 9p + p. 3p(p - 4)(p + 1) Let c = 1368676 - 4106026/3. Find n, given that 1/3n3 + n2 - 1/3n*4 - 5/3n + c = 0. -2, 1 Let c be 12/(-54) + (447/189 - ((-325)/(-91))/25). Factor 8/5 - 2/15jc + 2/15j. -2(j - 4)(j + 3)/15 Let p(u) be the first derivative of 5u7/42 + 5u*6/6 + 3u*5/4 - 15u*4/4 + 54u - 60. Let n(k) be the first derivative of p(k). Factor n(m). 5m2(m - 1)(m + 3)2 Factor -2s*2 + 166 - 11 - 140575s + 279 + 140143s. -2(s - 1)(s + 217) Let z(a) be the second derivative of 0a*2 - 14a + 0a3 + 0 + 3/20a*5 - 1/6a*4 - 1/42a*7 + 0a*6. What is n in z(n) = 0? -2, 0, 1 Factor 285726258 - 285726258 + 2u*2 - 22u. 2u(u - 11) Let s = -2083/600 - -87/25. Let x(o) be the third derivative of 18o2 - 1/240o*6 + 0o + 5/48o4 + so*5 + 0 + 1/4o*3. Factor x(d). -(d - 3)(d + 1)*2/2 Let r be (-2)/(40/(-3544092)) + (-12)/(-20). Let v = r - 176386. Factor 384/5l*2 - 32/5l*3 + 1/5l*4 + v - 2048/5l. (l - 8)*4/5 Let 266/11r*2 + 2/11r*4 - 324/11r - 72/11r3 + 128/11 = 0. What is r? 1, 2, 32 Let i be (0 - 2)/((-147)/24 + 6). Suppose 4k - 3y = 0, -4y + i = -0. Factor 1103 - s - ks3 + s4 - 1103 + 3s*2. s(s - 1)3 Let i(w) be the first derivative of -w8/13440 + w6/360 - w4/12 + 19w3 + 8. Let u(r) be the third derivative of i(r). Find g, given that u(g) = 0. -2, 2 Let t = -3473 - -3473. Let q(s) be the first derivative of 0s + 9 + ts2 - 2/15s3. Suppose q(a) = 0. Calculate a. 0 Let s(h) be the third derivative of -h7/1155 - 7h6/165 + 26h*5/55 + 112h*4/3 - 2816h*3/3 - 4h*2 + 934h. Factor s(d). -2(d - 8)2(d + 22)*2/11 Let v(q) = 41q*3 + 204q*2 - 9594q - 19994. Let n(s) = -130s3 - 613s*2 + 28781s + 59981. Let m(t) = 6n(t) + 19v(t). Factor m(f). -(f - 100)*2(f + 2) Let w(b) be the second derivative of 19b6/24 + 359b*5/16 - 4085b*4/48 + 2405b*3/24 - 105b*2/4 + 6b - 96. Let w(i) = 0. Calculate i. -21, 2/19, 1 Let j(l) be the second derivative of -l*5/5 - 13l*4/12 + 37l*3/6 + 5l*2 + 84l + 4. Factor j(v). -(v - 2)(v + 5)(4v + 1) Let p be (-166)/14 - 0 - (26214 + -26227). Factor -pg*2 - 2/7g*3 + 0 - 8/7g. -2g(g + 2)2/7 Let n(d) be the first derivative of -d5/40 - 5d4/32 + 23d*3/8 + 185d*2/16 - 175d + 1575. Solve n(j) = 0 for j. -8, -7, 5 Let m = 117 - 117. Suppose m = 4g - 2 - 14. Solve 3r*3 - 2r*3 + 4r*3 - gr*3 = 0 for r. 0 Let x(n) = -20n*2 - 547n - 1173. Let m be x(-25). Factor 14/13jm - 8/13j - 24/13 - 2/13j3. -2(j - 6)(j - 2)(j + 1)/13 Let v(o) be the third derivative of 0 + 1/12o5 + 2/3o*3 - 1/120o*6 + 0o - 1/3o4 + 51o2. Factor v(l). -(l - 2)2(l - 1) Let o(t) be the third derivative of 91t*2 + 1/120t*5 + 19/48t*4 + 0t - 2 + 0t3. Factor o(a). a(a + 19)/2 Let d(c) be the third derivative of 625/2c3 + 0 + 1/20c*5 + 0c - 16c2 - 25/4c*4. Find x, given that d(x) = 0. 25 Factor -123836576 - 1736h*4 - 1739h*4 + 3764h*3 + 3479h*4 + 122653424h + 1179384h2. 4(h - 1)(h + 314)3 Let -257m*3 + 40m*4 + 48m*4 + 184m*2 + 188m*5 - 14m*2 - 189m5 = 0. What is m? 0, 1, 2, 85 Let g(b) be the first derivative of b6/27 + 536b5/45 + 8842b*4/9 - 73436b*3/27 - 1965b*2 + 8100b - 13995. Suppose g(p) = 0. What is p? -135, -1, 1, 2 Find u, given that -8/5 + 116/5u2 + 108/5u = 0. -1, 2/29 Factor 22/5r2 + 1/10r*3 + 371/10r - 208/5. (r - 1)(r + 13)(r + 32)/10 Let v be 6/8 + 36/48 + 23. Let w = -39 - -43. Let -wx + vx*5 + 30x*2 - 61x*3 + 21/2x4 + 0 = 0. Calculate x. -2, 0, 2/7, 1 Let u(n) = n2 - 15n + 2. Let g(h) be the first derivative of -4h*3/3 + 45h*2/2 - 7h - 48. Let b(d) = -2g(d) - 7u(d). What is k in b(k) = 0? -15, 0 Suppose 3g - 11 = -2v + 5, -20 = -5g. Determine y so that 5y*v + 17 - 20y - 4 + 2 = 0. 1, 3 Let a(w) be the second derivative of 0w3 + 0w*2 - 30w + 0 + 0w4 + 3/5w*5 - 2/21w*7 - 4/15w*6. Find i, given that a(i) = 0. -3, 0, 1 Let x(m) be the second derivative of -44m*6/25 - 7m*5 - 13m*4/3 + 16m*3/3 - 8m*2/5 + 429m. Find h, given that x(h) = 0. -2, -1, 1/6, 2/11 Let x(i) be the first derivative of -i6/120 + i4/2 - 2i3/3 - 13i + 71. Let t(c) be the third derivative of x(c). Determine j so that t(j) = 0. -2, 2 Let i(d) = 22d2 - 1632d - 166425. Let x(q) = -24q2 + 1632q + 166422. Let b(f) = -14i(f) - 13x(f). Let b(p) = 0. What is p? -204 Let v(h) be the third derivative of 8 + 1/105h7 + 1/105h*5 - 1/42h*4 + 4h*2 + 1/588h*8 - 1/21h*3 + 2/105h*6 + 0h. Factor v(p). 2(p + 1)4(2p - 1)/7 Let u(v) = -2v*2 - 4v + 3. Let a(j) = -j	{ "pile_set_name": "DM Mathematics" }
5q)(1 - 2 + 3). 24q2 - 2q Expand (-4a - 13 + 0 + 3a)(-1 + 0 + 0 + (1 - 1 + 2)(-1 + 2 - 3)). 5a + 65 Expand 3x3 + x5 - 3x3 + (x3 - x3 + 2x*3)(0x2 + 2x*2 - 3x*2) + 2x*4 - 2x4 - x5 + (-5 + 2 - 1)(x - x - 3x*5). 10x*5 Expand -1 + 2v*3 + 1 + (0v*2 + 2v*3 + 0v*2)(1 - 2 - 1) - 3v3 + 3v*3 - 6v + v3. -v3 - 6v Expand (-2 - 5 + 4)(1 - 2x2 - 1). 6x*2 Expand (484b + 45b2 - 484b)(-b2 + b2 + 2b*2). 90b*4 Expand (3f*3 - 4f*3 - 4f*3)(0 + 1 - 8). 35f3 Expand (-2 - 3 + 3)(0 - 8 + 6)(m4 + 3m*3 - 3m*3). 4m*4 Expand -3x + 6x - 2x + (x + 1 - 1)(-3 + 0 + 2) - x + 3x + x. 3x Expand (13c + 14c - 28c)(c2 + c4 - c2). -c5 Expand -2g*3 + 3g*3 - 3g*3 + (g + 0g + 0g)(133 - 4g2 - 133). -6g3 Expand r2 + r*2 - 3r*2 + (4r*2 + 0r*2 - 2r*2)(3 + 3 - 2) - 2r2 - 3r*2 + 6r*2. 8r*2 Expand -2 + 2 + g + (2g - 2g - g)(1 - 2 + 0). 2g Expand (0 + 2 - 4)(-r - r + 4r) + (-r - 1 + 1)(2 + 0 - 4). -2r Expand c2 - 4c*2 + 2c*2 + (c + 3c - 2c)(-c - 4 + 4) + 12c - 4c*2 - 12c. -7c2 Expand (2 + 5g*2 - 2)(-5g + 0g + 2g)(-4 + 3 + 0). 15g3 Expand (0t*4 - 2t4 - t4)(0 - 1 + 3) + t4 - 4t*4 + 2t3 + t4. -8t4 + 2t*3 Expand (2x*3 + 0x*2 + 0x*2)(-10x + 4x - 41 + 8x). 4x*4 - 82x*3 Expand (4n - 6n - 5n)(3n + n*2 - 3n + (1 + 2 - 1)(-2n2 - n2 + 4n2) - 3n*2 + 3n*2 + 2n*2). -35n*3 Expand (-2g - g + 4g)(g - g + 2g) - 38g*2 - 27g*2 + 24g*2 - 1. -39g*2 - 1 Expand (-1 + 2l + 1)(-2l*2 + 4l*2 - 4l2) - l3 - 5l3 + 3l*3 - 18l*3 + 16l*3 - 14l*3. -23l*3 Expand (-5 + 1 + 2)(-4k - 5 + 5)(-k*3 - 3k*3 + 5k*3)(0 + k + 0). 8k5 Expand (2w + w*3 - 2w)(1 - 4 + 5) + 0w*3 + 4w*3 + 0w*3. 6w*3 Expand (2f - 2f + f)(25 + 4f - 25)(-f*3 - 4f*3 + 4f*3). -4f5 Expand (a3 + 22a - 22a)(-5a + 4a - 2a)(-4 + 2 + 3). -3a*4 Expand ((-3j + 0j + 0j)(-1 + 1 + 2) - j - 4j + 3j)(2j2 + 0j*2 + 2j*2). -32j*3 Expand (2t*2 + 2t*2 - 3t*2)(-3t3 + 0t*3 - 59 + 58). -3t5 - t2 Expand (2 + 0 + 1)(g - 4g + g)(-3 + 3 - 2). 12g Expand (2 + 0 - 1)(-b + 8b - b + (2 - 2b - 2)(6 - 2 - 2)). 2b Expand (-4 + 3 + 3)(-2m3 - m3 + 5m*3) + 2m*3 + 1 - 1 + 5m - 13m2 - 1 - m3 + 13m*2. 5m*3 + 5m - 1 Expand (4u4 + 0u*4 - 2u*4)((-3u + 1 - 1)(2 + 1 - 1) - 3u + 4u - 3u). -16u*5 Expand (4i + 2i - 7i)(11 + 16 - 42) + 3i - i - i. 16i Expand (-5 + 3 + 3)(3y - 2y + 3y) + 2y - 1 + 1. 6y Expand 3a*5 - 7a*5 + 2a*5 + ((0 + 4 - 1)(a*4 - 3 + 3) - 3a3 + a4 + 3a3)(4a - 3a + 0a). 2a*5 Expand -327j*2 - 26j*4 + 327j*2 + 3j*2 + 2j*4 - 3j*2 + 3j + j*4 - 3j + (0j + 0j + j)(3j3 - j3 - 4j3). -25j*4 Expand -3l*3 - 5 + 5 - 3l*3 + 2l*3 + 3l*3 + (-l - 3l + 2l)(-3l2 + 0l*2 + 5l*2) + 0l3 - l3 - l*3. -7l3 Expand (k4 - k*4 + 2k*4)(101 - 93 + 237 + 196). 882k4 Expand (1 - f + 3f + 2f)(-5 + 0 + 4). -4f - 1 Expand (13m - 2m + 4m)(2m + 2 - 2)(5 - 4 + 1). 60m*2 Expand 2v*2 - 2v*2 - 6v*3 + (-1 - 4 + 4)(v*3 + 2v*3 - 4v*3) - 4 + 4 - 3v*3. -8v*3 Expand (-11t*5 + 2t*5 - 7t*5)(-1 + 5 - 2). -32t5 Expand -y2 - 2y*2 + 2y*2 + (-3y + 2y - y)(-2 + y + 2) + 561y - 561y + 41y2. 38y*2 Expand (-12y + 5y - 13y)((y - 2 + 2)(1 - 2 + 0) - 2y + 2 - 2)(5 - 3y3 - 5). -180y*5 Expand (0h + 8h + h)(3 + 2 - 3 + (-4 + 1 + 2)(-1 - 2 + 1) - 2 + 0 + 0). 18h Expand (-6 - 1 + 1)(h - 17 + 17)(-h*2 - 4h*2 + 4h*2). 6h*3 Expand -5r*5 - 5r4 - r5 + 4r4 + (4r*2 - 4r*2 + 4r*3)(-3r2 - 3r*2 + 7r*2). -2r5 - r4 Expand (-u*2 - 2u*2 + 9u*2)(8 - 1 - 3) - 2 + 2 - u*2. 23u*2 Expand 0f + f + 4 - 2f + (0 + 0 + 2)(-2 + 2 - 2f) - 4f - 7f + 2f. -14f + 4 Expand -3f + 2f + 3f + 4f + f - 6f + (4f - 2f + 0f)(1 - 2 + 0). -f Expand (-4p2 + 2p*2 + 7p*2)(5p3 - 3p3 + p3). 15p5 Expand (4n*2 + 2n*4 - 4n*2)(-1 + 4 - 4) + 2n4 + n4 - 6n*4. -5n*4 Expand (-i + 5i - 2i + 3i + 0i - 4i - 4i + 4i + i + (4 - 2 - 4)(-4i + 5i - 3i))(2 - 1 - 5). -24i Expand (-11o3 - 3o*3 + 5o*3)(-o - 2o + o)(-3o - o + 3o). -18o5 Expand (0 + 2g + 0)(0 - 17 + 8). -18g Expand (-1 + 3v2 - v + 1)(2 - 2 + 2v)(2 - 2 - 2v). -12v*4 + 4v3 Expand -i2 - 27 + 27 + (1 - 1 - i)(-3i - i + 5i). -2i2 Expand (-p4 + 3p4 - p4)(-3p - 4p + 4p) - 2p*2 - 2p2 - p5 + 5p2. -4p5 + p2 Expand (12 - 12 - 17q)(2q2 - 2q*2 + 2q*2). -34q*3 Expand (-2 - 2 + 2)(-2t3 + 3t*3 - 7t*3). 12t*3 Expand (1 - 1 - 2)(23k2 + 11k*2 - 14k*2)(1 - 1 + 2k2). -80k*4 Expand -3z*2 + 0z*2 + 2z*2 + (-2z + 2z - z)(5 - 5 + z) + (2 + 2 - 2)(2 - 2 - 3z)(-6z - 4 + 4). 34z2 Expand ((-f2 + 2f2 + f2)(0f - 4f + 5f) + 2 + 2f3 - 2)(-2 + 2 - 2f). -8f*4 Expand -2 + 2 + 3o*2 + (-2o*2 + 4 - 4)(5 - 2 - 2) + (o - 5 + 5)(o + 5 - 5) - 4o + 4o + 2o*2. 4o*2 Expand (0j - 2j + 4j)((-2j*3 + 2j*2 - 2j*2)(3j + 2j - 3j) - 2j*4 - 2j*4 + 2j*4 + 0j*4 + 2j*4 - 7j*4). -22j*5 Expand (0 + 2 - 3)(8 + 5b - 8)(7b + 0b - 2b). -25b*2 Expand 3w*2 - 6w2 + w2 + (3 + w - 3)(0 + 6w + 0) + (2w2 + 0w + 0w)(-2 + 1 + 3). 8w2 Expand (g - 3g + 0g)(4 - 6 - 3 - 2g). 4g*2 + 10g Expand (-4d + 3d + 3d)(4d - 9 + 9)(-2d2 - 3d2 + d2). -32d4 Expand 4 - 4 + v + (-6 + 1 + 1)(v - 5v + 3v). 5v Expand -c + 0c - c + (2c - 4c + 0c)(0 + 2 - 1) + c + 0 + 0 + (-1 + 2 - 2)(0 + 0 - 5c). 2c Expand (-1 + 3s2 - s2 - 1)(-11s - 6s + 6s). -22s3 + 22s Expand (0 - 2 + 5)(7q - 5q - 6q)(5 - 3 - 3). 12q Expand (-4o2 + 4o*2 + 4o*3)(3 + 61o - 62o + 2). -4o4 + 20o*3 Expand (30 + 26 - 41)(0 + 3z + 0). 45z Expand (2z2 + 1 - 1)(2z3 - 5z + 5z) - 2z*2 - 2z*5 + 2z*2 + (-9z + 9z - 2z*3)(-3z2 + 7z*2 - 2z*2). -2z*5 Expand -3r + 8r - r + (1 + 3 + 5)(-3 - 3 + 5)(-r + r - 2r). 22r Expand (-1 - 1 + 3)(3h5 - 5h*4 + 12h*4 - 10h*4). 3h*5 - 3h4 Expand (-z3 + 2z3 + 0z*3)(-2 - 2z + 2)(0 + 2z + 0). -4z*5 Expand (-11 - 2 - 4)(-2r + 6r - r). -51r Expand (5o*2 + 0o*2 + 13o*2)(3 - 5o - 5 + 3o). -36o3 - 36o*2 Expand ((-4 - 3 + 5)(-2 + 2 - 2) + 3 + 3 - 4 + (0 - 1 - 3)(-5 - 4 + 5))(-2t - 4t + 4t). -44t Expand (-37q + 22q + 17q + 2 - 3q*2)(5 - 2 - 1). -6q2 + 4q + 4 Expand (-3 + 3 + x*2)(-4x - 2x + 2x)(-12 + 7x + 12). -28x*4 Expand (0 - 5 + 4)(3l - 3l + 3l3 - l3 - 2 + 2 + (0l*2 + 2l*2 - 4l*2)(0 + 0 + l) + 0l2 + 0l*2 - 2l*3) + 5 + 2l*3 - 5. 4l*3 Expand (-2m3 - m3 + m*3)(-2m + 2m - m) - 12m2 + 6m*4 + 12m*2. 8m4 Expand (-m2 + 2m2 + 4m*2)(-11m + 11m - 5m2). -25m*4 Expand 4c*4 + 11c*4 - 3c*4 + 3c*4 + 0c*4 - 5c*4 + (0c*3 + 3c*3 - 5c*3)(2c + 0 + 0). 6c*4 Expand (4 + 3 + 1)(-3y + 0y + 5y)(-y*3 + 2y3 + y3). 32y4 Expand -2z + 4z + 0z + (-2 - 2 + 3)(-z + z + z) + 1 + 60z - 34z - 3. 27z - 2 Expand (5q2 + q2 + q3 + 0q*3)(6q - 6q - 4q2). -4q*5 - 24q*4 Expand (c + 1 - 1)(3 + 0 - 5)(-1 + 2c*2 + 1 + (-5c + c + 3c)(-1 + 1 - 2c) - 6c*2 + 2c*2 + 3c*2). -6c*3 Expand (0k*4 - 2k + 5k3 - 4k*3 - 23k*4)(-4k + 0k + 2k). 46k*5 - 2k*4 + 4k*2 Expand (-12 + 13 - 8)(-5 - f + 5) - f + f + 2f. 9f Expand 0n2 + n3 + 0n*2 + (0 - 3 + 2)(-2n3 - n + n) - 1 + 1 + 5n*3. 8n*3 Expand (-3p + 0p + 5p)(200p - 96p - 100p). 8p2 Expand (-13y + 16 + 13 - 27)(0y*3 + 2y*3 - 4y*3). 26y*4 - 4y*3 Expand (4b*2 - 2b + 2b)(-4b3 + 7b*3 - 2b + 4b). 12b*5 + 8b*3 Expand (3n3 + n3 - 2n3)(-3 + 3 + 2)(-37 + 37 + 29n). 116n4 Expand (0 + 4 - 1)(s - 3s + 3s)(2s*2 - 6s*2 + 2s*2). -6s*3 Expand -9y3 + 7 - 7 + (y2 - 2 + 2)(3y - 5y - 3y). -14y3 Expand c + 5c + c + (-2c + 5c - 4c)(-3 + 7 - 3) + (3 - 3 - 2)(-3c + 5c - 4c). 10c Expand (3q - 4*q + 2 +	{ "pile_set_name": "DM Mathematics" }
/35 What is prob of picking 2 t and 2 i when four letters picked without replacement from mimitttmmimimmmiimt? 15/646 Three letters picked without replacement from rzzhhzrrzrhhzr. What is prob of picking 3 z? 5/182 What is prob of picking 4 a when four letters picked without replacement from {f: 4, v: 5, h: 1, a: 2, s: 2}? 0 Four letters picked without replacement from {t: 1, d: 2, r: 1, v: 1}. What is prob of picking 2 d and 2 v? 0 What is prob of picking 1 m and 1 h when two letters picked without replacement from {m: 7, h: 6}? 7/13 What is prob of picking 1 o and 2 v when three letters picked without replacement from {e: 2, v: 6, f: 1, z: 1, o: 3}? 45/286 Calculate prob of picking 1 y and 1 s when two letters picked without replacement from qqqqqqgqsqysq. 1/39 What is prob of picking 3 o when three letters picked without replacement from {o: 6, d: 2, b: 4}? 1/11 Calculate prob of picking 1 d, 2 m, and 1 e when four letters picked without replacement from {w: 1, d: 2, m: 8, e: 2, f: 1, n: 3}. 4/85 Two letters picked without replacement from {l: 2, b: 2, r: 4, v: 1}. What is prob of picking 1 l and 1 b? 1/9 Three letters picked without replacement from {t: 8, y: 1, p: 2, e: 6, z: 1}. What is prob of picking 3 t? 7/102 What is prob of picking 1 z and 1 x when two letters picked without replacement from {y: 1, x: 2, z: 1, o: 2, q: 2}? 1/14 Four letters picked without replacement from ppkllkllllpkjllllkjk. Give prob of picking 1 p, 2 k, and 1 l. 20/323 Three letters picked without replacement from cllclkcklklllk. What is prob of picking 3 c? 1/364 Calculate prob of picking 2 h when two letters picked without replacement from {u: 4, a: 3, h: 5}. 5/33 Calculate prob of picking 3 m when three letters picked without replacement from {t: 8, m: 3}. 1/165 Four letters picked without replacement from {f: 7}. What is prob of picking 4 f? 1 Four letters picked without replacement from {w: 1, k: 6, r: 3, j: 5, a: 3}. What is prob of picking 3 k and 1 r? 1/51 Three letters picked without replacement from {l: 2, q: 1, y: 2}. What is prob of picking 2 y and 1 q? 1/10 Three letters picked without replacement from {m: 9, n: 9}. What is prob of picking 2 n and 1 m? 27/68 Calculate prob of picking 2 g and 1 n when three letters picked without replacement from {g: 7, f: 2, r: 4, w: 2, n: 1}. 3/80 What is prob of picking 1 a and 1 e when two letters picked without replacement from {y: 7, a: 2, e: 1, q: 2}? 1/33 What is prob of picking 1 q and 2 p when three letters picked without replacement from dudpoqdpqdmu? 1/110 Four letters picked without replacement from ppppssnpnpssps. Give prob of picking 4 s. 5/1001 Three letters picked without replacement from beofbbe. Give prob of picking 2 b and 1 o. 3/35 What is prob of picking 4 z when four letters picked without replacement from {d: 3, z: 4}? 1/35 Four letters picked without replacement from qqqqqqqqqqqlq. Give prob of picking 4 q. 9/13 Three letters picked without replacement from tcnnnccnxxtcc. What is prob of picking 1 n and 2 c? 20/143 Calculate prob of picking 1 y and 1 v when two letters picked without replacement from {v: 6, g: 4, y: 7}. 21/68 What is prob of picking 2 o and 1 f when three letters picked without replacement from qofhorq? 1/35 What is prob of picking 2 d and 1 e when three letters picked without replacement from {d: 1, e: 4, p: 8}? 0 What is prob of picking 2 i and 1 z when three letters picked without replacement from zhrizhhhrizzzzhzhhjz? 2/285 Two letters picked without replacement from {t: 1, e: 2}. What is prob of picking 2 e? 1/3 Four letters picked without replacement from fffofofofff. What is prob of picking 4 f? 7/33 What is prob of picking 1 z and 1 r when two letters picked without replacement from rrrrrrssrsrrzrrr? 1/10 Four letters picked without replacement from cfhxcxacaacccxxchca. Give prob of picking 2 x and 2 h. 1/646 Two letters picked without replacement from {y: 1, t: 3, r: 2, q: 1}. What is prob of picking 2 r? 1/21 Three letters picked without replacement from {t: 3, n: 1, d: 1, a: 3, v: 2, e: 1}. Give prob of picking 2 v and 1 a. 1/55 Two letters picked without replacement from ggmccggmmmmmgxggxg. Give prob of picking 1 g and 1 c. 16/153 Three letters picked without replacement from jljlljfjjlljljjjjj. What is prob of picking 1 f and 2 l? 5/272 Three letters picked without replacement from {m: 1, o: 3, x: 3}. Give prob of picking 3 o. 1/35 Two letters picked without replacement from eee. Give prob of picking 2 e. 1 What is prob of picking 1 c and 1 n when two letters picked without replacement from nnnncnnccn? 7/15 Calculate prob of picking 3 r when three letters picked without replacement from bbiibiibbbvbiri. 0 Calculate prob of picking 1 g and 1 m when two letters picked without replacement from {z: 3, g: 3, s: 2, m: 10, h: 2}. 3/19 Three letters picked without replacement from {e: 1, g: 1, j: 3, k: 5}. What is prob of picking 1 k, 1 g, and 1 j? 1/8 Calculate prob of picking 1 n and 1 m when two letters picked without replacement from {m: 2, l: 4, h: 1, n: 2}. 1/9 What is prob of picking 1 p and 1 z when two letters picked without replacement from {p: 15, z: 5}? 15/38 What is prob of picking 1 h, 1 w, and 1 b when three letters picked without replacement from {b: 4, w: 2, h: 7}? 28/143 Two letters picked without replacement from {p: 7, v: 5}. Give prob of picking 2 p. 7/22 What is prob of picking 1 c, 1 i, and 1 s when three letters picked without replacement from {m: 7, c: 3, i: 4, s: 3, e: 2}? 12/323 Calculate prob of picking 1 y and 1 r when two letters picked without replacement from ccclrlcylcrllrrlrl. 5/153 Four letters picked without replacement from bggbbgb. Give prob of picking 1 g and 3 b. 12/35 Four letters picked without replacement from hhkhmamaad. What is prob of picking 3 h and 1 m? 1/105 What is prob of picking 1 x and 2 z when three letters picked without replacement from {z: 7, d: 6, x: 1, p: 1}? 3/65 What is prob of picking 1 r and 2 k when three letters picked without replacement from {k: 2, r: 4}? 1/5 Four letters picked without replacement from kbcxqoqk. What is prob of picking 1 c, 1 q, 1 x, and 1 k? 2/35 What is prob of picking 1 t and 1 i when two letters picked without replacement from {t: 1, o: 1, m: 1, j: 2, i: 2}? 2/21 What is prob of picking 2 x, 1 m, and 1 v when four letters picked without replacement from {v: 2, x: 5, t: 4, m: 4}? 16/273 Calculate prob of picking 2 m and 1 y when three letters picked without replacement from {m: 3, q: 2, y: 3, w: 1, a: 2, b: 3}. 9/364 Two letters picked without replacement from {l: 1, j: 3, v: 1}. Give prob of picking 1 v and 1 j. 3/10 Calculate prob of picking 1 x and 1 b when two letters picked without replacement from {b: 1, x: 3}. 1/2 Three letters picked without replacement from ulflllfutf. Give prob of picking 3 l. 1/30 Three letters picked without replacement from {r: 3, m: 3, w: 1, x: 6}. What is prob of picking 2 m and 1 r? 9/286 Two letters picked without replacement from {i: 3, k: 5, y: 1, d: 4, m: 4, h: 3}. Give prob of picking 1 m and 1 h. 6/95 Two letters picked without replacement from {h: 9, m: 11}. Give prob of picking 2 h. 18/95 What is prob of picking 1 b and 1 u when two letters picked without replacement from {c: 1, u: 2, w: 2, b: 6, d: 3}? 12/91 Calculate prob of picking 3 r and 1 j when four letters picked without replacement from jjeyrnyyjjrjrnen. 1/364 Two letters picked without replacement from srrrrrrrrrsrrrrrrrrr. What is prob of picking 2 s? 1/190 Four letters picked without replacement from {i: 7, d: 2, k: 4}. What is prob of picking 1 k and 3 i? 28/143 Calculate prob of picking 2 x when two letters picked without replacement from {r: 7, x: 6}. 5/26 Two letters picked without replacement from {h: 4, a: 1, n: 1, t: 1, o: 1}. What is prob of picking 1 o and 1 h? 1/7 Two letters picked without replacement from ookookooooo. What is prob of picking 2 k? 1/55 Calculate prob of picking 3 n and 1 p when four letters picked without replacement from npppnnnpppnnp. 28/143 What is prob of picking 2 e and 1 x when three letters picked without replacement from {x: 3, e: 2}? 3/10 What is prob of picking 4 j when four letters picked without replacement from jjbjjbbbbjbjjjjjbbb? 35/64	{ "pile_set_name": "DM Mathematics" }
cking 1 x and 1 c when two letters picked without replacement from {a: 3, c: 1, x: 1}. 1/10 What is prob of picking 2 b when two letters picked without replacement from {g: 6, x: 1, b: 4}? 6/55 What is prob of picking 1 i and 1 u when two letters picked without replacement from {i: 2, x: 3, u: 4, g: 6, o: 2, e: 1}? 8/153 Calculate prob of picking 2 y when two letters picked without replacement from {j: 2, z: 7, y: 3}. 1/22 Three letters picked without replacement from ptytdtttdtdtytpt. Give prob of picking 2 p and 1 y. 1/280 What is prob of picking 1 n and 1 g when two letters picked without replacement from nggnggnngggggggggngg? 15/38 Two letters picked without replacement from qqqqqqsqssqq. What is prob of picking 2 q? 6/11 Calculate prob of picking 3 z when three letters picked without replacement from bzlzzlzzzlff. 1/11 Three letters picked without replacement from yypcpcppyyypyy. What is prob of picking 1 p, 1 c, and 1 y? 5/26 Calculate prob of picking 1 f and 1 b when two letters picked without replacement from {j: 7, b: 1, f: 2}. 2/45 Three letters picked without replacement from {z: 2, e: 2, v: 1}. What is prob of picking 1 e and 2 z? 1/5 Four letters picked without replacement from {t: 4, w: 2, o: 5}. Give prob of picking 2 o and 2 w. 1/33 Calculate prob of picking 3 t and 1 u when four letters picked without replacement from {t: 3, m: 5, u: 1, w: 1}. 1/210 Two letters picked without replacement from {w: 1, t: 12, u: 1, p: 1, k: 2}. Give prob of picking 1 t and 1 u. 3/34 Four letters picked without replacement from mmmcmcc. What is prob of picking 1 m and 3 c? 4/35 Two letters picked without replacement from llxllxlxlxlx. Give prob of picking 1 l and 1 x. 35/66 What is prob of picking 1 z and 2 r when three letters picked without replacement from zzzzrzzzrzzzrrzzzrzz? 5/38 What is prob of picking 2 j when two letters picked without replacement from {j: 3, b: 11, c: 4}? 1/51 Four letters picked without replacement from {u: 2, c: 5, o: 12}. What is prob of picking 2 u and 2 c? 5/1938 What is prob of picking 1 j and 1 l when two letters picked without replacement from kmldjjkjddkldkdmdkdm? 3/95 Three letters picked without replacement from {v: 4, a: 5, d: 3}. Give prob of picking 3 v. 1/55 What is prob of picking 3 u when three letters picked without replacement from uuuuuuuquuuuqq? 165/364 Calculate prob of picking 1 k and 2 e when three letters picked without replacement from kgkauuksguskeseg. 1/140 What is prob of picking 2 p when two letters picked without replacement from ponp? 1/6 Calculate prob of picking 1 y and 1 d when two letters picked without replacement from dddqdddqqycd. 7/66 Two letters picked without replacement from {y: 1, q: 7}. What is prob of picking 2 q? 3/4 What is prob of picking 1 z, 1 j, and 2 b when four letters picked without replacement from bbddjdbzdbbbjzzjbddd? 63/1615 What is prob of picking 2 d when two letters picked without replacement from hhhhhhdhqdhdhqhhh? 3/136 What is prob of picking 3 s when three letters picked without replacement from {s: 6}? 1 Three letters picked without replacement from {d: 1, c: 1, w: 4, q: 6, g: 3}. Give prob of picking 1 d and 2 q. 3/91 Two letters picked without replacement from jjjozltzzojzkjt. Give prob of picking 1 l and 1 k. 1/105 Calculate prob of picking 4 v when four letters picked without replacement from {i: 4, v: 6}. 1/14 Three letters picked without replacement from {w: 4, s: 2, j: 3, e: 4, v: 3, o: 2}. What is prob of picking 1 v and 2 j? 3/272 What is prob of picking 1 b and 1 j when two letters picked without replacement from bkbj? 1/3 What is prob of picking 2 s and 2 f when four letters picked without replacement from {o: 5, s: 2, f: 3}? 1/70 Two letters picked without replacement from lllldppffflflflld. Give prob of picking 2 d. 1/136 Four letters picked without replacement from vtfebbteettefr. Give prob of picking 1 t, 2 v, and 1 f. 0 Three letters picked without replacement from llljj. Give prob of picking 2 j and 1 l. 3/10 Four letters picked without replacement from llvvllllvllllvlllll. Give prob of picking 3 l and 1 v. 455/969 Calculate prob of picking 1 o, 1 a, and 1 c when three letters picked without replacement from acjjo. 1/10 Two letters picked without replacement from {i: 9, c: 5}. Give prob of picking 2 c. 10/91 Calculate prob of picking 1 s and 1 f when two letters picked without replacement from ssdsesdvdgedfdss. 1/20 Three letters picked without replacement from mzabzzabbbybbzbyzeab. Give prob of picking 1 b, 1 z, and 1 m. 2/57 Four letters picked without replacement from ppqppppxtptjpttxpxxp. Give prob of picking 2 x, 1 p, and 1 t. 16/323 Four letters picked without replacement from {b: 5}. What is prob of picking 4 b? 1 Calculate prob of picking 2 r when two letters picked without replacement from {r: 4, g: 6}. 2/15 Two letters picked without replacement from coccgcg. Give prob of picking 1 c and 1 g. 8/21 What is prob of picking 1 m and 2 d when three letters picked without replacement from {p: 3, m: 4, d: 2, t: 3, q: 2, h: 4}? 1/204 Calculate prob of picking 2 l when two letters picked without replacement from {a: 10, i: 2, l: 2}. 1/91 Calculate prob of picking 1 w and 2 e when three letters picked without replacement from esesuewueeeseu. 3/52 Three letters picked without replacement from {y: 4, s: 10}. Give prob of picking 3 y. 1/91 What is prob of picking 3 y when three letters picked without replacement from {g: 3, p: 2, m: 3, y: 7}? 1/13 Two letters picked without replacement from {h: 14, z: 4}. Give prob of picking 2 z. 2/51 Three letters picked without replacement from lprlpplppppyrl. Give prob of picking 1 p, 1 l, and 1 y. 1/13 Calculate prob of picking 1 f, 1 w, and 1 y when three letters picked without replacement from {w: 4, b: 1, f: 2, m: 3, p: 4, y: 1}. 8/455 Two letters picked without replacement from {d: 4, f: 2, b: 2}. Give prob of picking 1 d and 1 b. 2/7 Two letters picked without replacement from nnnnonononnnnn. What is prob of picking 2 o? 3/91 Calculate prob of picking 1 w and 1 a when two letters picked without replacement from zwatzzizawa. 6/55 Two letters picked without replacement from skksnnovy. Give prob of picking 1 y and 1 o. 1/36 Two letters picked without replacement from wyyyyyyyw. What is prob of picking 2 y? 7/12 Four letters picked without replacement from {h: 5, d: 1, l: 3, n: 4}. What is prob of picking 2 h, 1 n, and 1 d? 8/143 Calculate prob of picking 1 w, 2 f, and 1 g when four letters picked without replacement from gqwffffwqwxwqwq. 2/91 What is prob of picking 1 s, 1 w, and 1 l when three letters picked without replacement from {v: 2, w: 1, x: 1, l: 1, s: 1, f: 1}? 1/35 Calculate prob of picking 2 q, 1 g, and 1 o when four letters picked without replacement from oiiqgqii. 1/70 Three letters picked without replacement from {y: 3, x: 2, m: 5}. Give prob of picking 1 m and 2 x. 1/24 What is prob of picking 3 c and 1 r when four letters picked without replacement from {c: 4, g: 3, r: 7}? 4/143 Four letters picked without replacement from {t: 7, w: 5}. What is prob of picking 4 w? 1/99 Four letters picked without replacement from {d: 3, i: 7}. What is prob of picking 2 d and 2 i? 3/10 Three letters picked without replacement from ennezeeneeznnneenqq. Give prob of picking 1 e and 2 z. 8/969 Two letters picked without replacement from {u: 6, d: 2}. What is prob of picking 2 d? 1/28 Three letters picked without replacement from {x: 2, z: 2, h: 6, f: 3}. What is prob of picking 2 f and 1 z? 3/143 Three letters picked without replacement from zzsfztsadszfzzss. What is prob of picking 1 t, 1 d, and 1 z? 3/280 What is prob of picking 1 z, 1 q, 1 i, and 1 n when four letters picked without replacement from {n: 2, q: 1, i: 2, s: 1, z: 1, a: 1}? 2/35 Four letters picked without replacement from {r: 2, c: 2, m: 2, e: 8}. Give prob of picking 2 c and 2 m. 1/1001 Three letters picked without replacement from {r: 2, x: 2}. What is prob of picking 1 x and 2 r? 1/2 What is prob of picking 1 j and 1 g when two letters picked without replacement from ljllgqc? 1/21 Three letters picked without replacement from welureg. What is prob of picking 1 r, 1 g, and 1 e? 2/35 Three letters picked without replacement from jj	{ "pile_set_name": "DM Mathematics" }
t z = 138 + b. Suppose -h + 100 = 4x, -x + zx + h - 75 = 0. Put x, -4, -2 in decreasing order. x, -2, -4 Let n be 1 + 31-18. Let p(z) = 19z - 263. Suppose -399y - 5c = -398y - 19, -5y = -c - 69. Let u be p(y). Sort n, 0, u in ascending order. n, 0, u Suppose 0 = -25d + 30d - 200. Suppose -30m + d = -26m. Let p be (16/(-18))/(2/(-3)). Put m, -2, p, 5/3 in ascending order. -2, p, 5/3, m Let r = -2337.95 + 2338. Let l = 97/9 + -11. Put l, r, -15 in decreasing order. r, l, -15 Suppose -3x - 154 = -d + 2d, x + 66 = -4d. Let z = 5939/9 - 660. Put -0.3, z, x in descending order. z, -0.3, x Let m = -210 - -212. Suppose ms - 65 = -71. Let q be 12/18(-1 + 16). Put s, q, -4 in descending order. q, s, -4 Let s(n) = 10n + 18. Let r be s(-2). Let c(i) = i - 8. Let d be c(0). Suppose 457 = 5k + 462. Sort d, k, r in increasing order. d, r, k Suppose -2o = -0o + n + 66, 5o - 5n + 150 = 0. Let f = o + 36. Suppose 5w = i + 13 + 4, -fi + 1 = 3w. Put i, -5, 8 in descending order. 8, i, -5 Let x(r) = r3 - 10r*2 - r + 15. Let u be x(10). Suppose -50n + 49n - 2 = 0. Suppose -2j = 7b - 5b + 16, -4j = -4b + 8. Sort n, b, u, 2. b, n, 2, u Let q = 17 - 17.3. Suppose 19z = -50z + 28 - 166. Sort z, 19, -0.2, q in decreasing order. 19, -0.2, q, z Let k(t) = t*3 + 51t - 51. Let o be k(1). Sort -2, o, -78 in decreasing order. o, -2, -78 Let g = 28518 + -28518.4. Let w = 1 - -1. Let a = -1/2 + 3/4. Sort 4, w, g, a. g, a, w, 4 Suppose 11y = -27y + 56 + 58. Let x = 6 - 2. Sort x, y, 0, 0.5 in decreasing order. x, y, 0.5, 0 Let c = 0.051 - -0.549. Let v = 46 - 51. Put v, -2, 3/8, c in ascending order. v, -2, 3/8, c Let q(w) = w - 1. Let j(l) = -l*2 + 10l - 9. Let b(h) = j(h) - q(h). Let n be b(8). Let r = 44 + -17. Put r, n, -2 in descending order. r, n, -2 Let l = 6 - 1. Suppose -5k + 2o = 31, -5k - 3o - 28 = -4o. Let c(x) = -12x - 63. Let v be c(k). Sort l, v, -0.04 in descending order. l, -0.04, v Let y = -318 + 322. Suppose 2t - 7 = ym - 13, -2t = 10. Put 22, m, 2 in descending order. 22, 2, m Let x = 30 - 2. Suppose 3w - 4n - x = n, 5w = n + 10. Let m = 82 + -79. Put w, -0.5, m in increasing order. -0.5, w, m Let x = 1122583/57 - 19693. Let p = x - 2659/1254. Let g = 2/11 + p. Sort -1/4, g, 2/7 in increasing order. g, -1/4, 2/7 Let q = -38.8 - -39.8. Sort q, -4/3, 446, -5 in decreasing order. 446, q, -4/3, -5 Let n be (-6 + 5)/(27/15 - (-94)/(-55)). Put 0, 26, n, 2 in ascending order. n, 0, 2, 26 Let f(n) = n*2 - 420n - 5564. Let s be f(-13). Suppose 16 = -3j + 4. Sort s, j, -2, 4 in descending order. s, 4, -2, j Let y(s) = -s2 - 11s + 18. Let i be y(-10). Let f = i + -17. Suppose 8 = 3l + 4x, 0l + 5l + x + 15 = 0. Put f, l, -1 in descending order. f, -1, l Let g be (-33)/(-22)2/152. Sort 5, g, 68, 1/6. 1/6, g, 5, 68 Let f = -38 - -37.05. Let g be 4(-20 - (-3606)/180). Sort g, f, 3. f, g, 3 Suppose 55j = 26j - 29. Let p = 3.75 - 0.75. Put j, p, 2, 2/3 in increasing order. j, 2/3, 2, p Let g be (2/3)/((-6)/45). Suppose -5r + 3l + 27 = 0, r + 3r - 5l - 32 = 0. Suppose -1640h = -1646h. Sort r, h, g in ascending order. g, h, r Suppose -40 = 2t + u - 3u, 5t - 3u = -90. Let k be (378/t)/2 - 30/(-50). Let d be ((-5)/15)/(14/k). Sort 0, d, 2, 2/13 in descending order. 2, d, 2/13, 0 Suppose -3w - w - 5 = -3x, 4x + 5w - 17 = 0. Let a(d) = d2 - 6d + 10. Let o be a(x). Let i be (0 - 1) + 23. Put 3, i, o in decreasing order. i, 3, o Suppose -40 = 4h + 16. Let a = 1946 - 5840/3. Put a, 4/3, h in ascending order. h, a, 4/3 Let j(a) = 1420a - 19868. Let n be j(14). Suppose 2k = -0k. Sort n, 1, k, 5 in descending order. n, 5, 1, k Suppose -a = v + 2v - 7, -v + 83 = 4a. Suppose 7 + 18 = -4u + h, -5h - a = u. Put u, 3, 0, 2 in decreasing order. 3, 2, 0, u Let y = 19901 + -19835. Sort -0.1, y, 0.4, 1, 2 in descending order. y, 2, 1, 0.4, -0.1 Let f = -47 - -49. Let s(t) = t3 - 5t + 6. Let c be s(f). Let u(v) = v*3 - 3v*2 - 2v - 5. Let q be u(c). Sort q, 12, -2 in decreasing order. 12, q, -2 Let s = -2.283 - -5.283. Sort -1/2, s, -0.3, 1/3, -5 in increasing order. -5, -1/2, -0.3, 1/3, s Let u be (-944)/(-304) - ((-56)/(-76))/7. Put u, -91, -4, -1 in descending order. u, -1, -4, -91 Let o = 9 - 18. Suppose 1129 + 804 = 329l + 288. Sort l, o, -5 in descending order. l, -5, o Let q be (-1 + 0)(-10)/2. Let o = -5255.3 + 5258. Sort o, q, 6. o, q, 6 Suppose 2z = -4y - 9 + 39, -4y = 4z - 48. Let v be (z/2)/((-2)/(-4)1). Suppose -vn = 6n - 75. Sort n, -3, -1 in decreasing order. n, -1, -3 Let q be ((-54)/135)/(2(-1)/(-856)). Let h = q - -3338/15. Let p = h - 51. Sort -48, 0.1, p. -48, 0.1, p Let s = -9906.6 + 9907. Sort s, 0.934, -2/3. -2/3, s, 0.934 Suppose 34l - 225 = -55. Sort -17, l, 1 in increasing order. -17, 1, l Let l = -51.01875 - -0.01875. Put -2, 1/5, l in increasing order. l, -2, 1/5 Suppose -2l - 6 = 0, -31 = 2t - 7l + 2l. Put t, -26, 5, 3, -3 in ascending order. -26, t, -3, 3, 5 Let u(p) = -6p2 - 1. Let s be u(-1). Let y = -0.0445 - 338.9555. Let a = 336 + y. Sort a, 4/3, s, 5 in descending order. 5, 4/3, a, s Let p be 27/4 + (5/4)/5. Let u(s) = s2 - 6s - 3. Let n be u(p). Suppose 3i + 4 = nl - 9, i = -3l + 13. Put l, 0, -1, 1 in descending order. l, 1, 0, -1 Suppose 0 = 2p + 4f + 75 + 7, 4p + 2f + 188 = 0. Let l(w) = 19w2 + 3w - 5. Let c be l(2). Let i be 14/p + 15/c. Put i, 3, 0.5 in decreasing order. 3, 0.5, i Let b = -1449/12172 + 1/716. Let a = 133.904 - 133. Let p = a + 0.096. Sort b, -3/8, -5, p. -5, -3/8, b, p Suppose 0 = -3o - 2k - 3, 3k = 130o - 135o - 7. Let d(a) = -a2 + a + 6. Let u be d(0). Sort -4, u, o. o, -4, u Let q = 1778 + -1778. Put -5, -17/471, q in descending order. q, -17/471, -5 Let s = -19198 - -19082. Put s, 3, 5, -4, 1 in descending order. 5, 3, 1, -4, s Let v(d) = -d3 - 5d*2 + 3d - 19. Let u be v(-6). Suppose -5r = 4y, 5y - 3r = 10y - 13. Put 1, u, y, -4 in increasing order. -4, u, 1, y Let n = 4.96 + 0.04. Suppose -2g = -4u - 70, 2u + 1365g - 1364g = -9. Sort u, n, 2 in descending order. n, 2, u Suppose 0 = -2i - 2r - 29 + 21, 3i = 3r - 18. Put -3, 3, -1, -6, i in ascending order. -6, i, -3, -1, 3 Let w be ((-18 + 17)-67)/((-1)/(4 + -3)). Put w, 5, 2 in ascending order. w, 2, 5 Let p = 506/3 - 337/2. Sort 0, -5, 10, p in increasing order. -5, 0, p, 10 Let i(f) = -16f*3 - 35f*2 - 108f + 24. Let w be i(-4). Sort -4, w, 5, -2, -3. -4, -3, -2, 5, w Suppose 181 = 12l + 145. Put 2, l, 0, -1 in descending order. l, 2, 0, -1 Let k = 382.3 + -382. Let i = 0.25 - 5.25. Put k, 23/4, i in increasing order. i, k, 23/4 Let m = 4 + 0. Suppose -8 - 10 = 3b, -z - 25 = 2b. Sort 2/7, m, z, 1. z, 2/7, 1, m Let x = 0 + -0.1. Let c = -1.1418 + -0.0582. Let s = -9.2 - c. Sort 0, s, 0.4, x. s, x, 0, 0.4 Let b = -7/734 - 713/2202. Let g = -4/23 + -3/115. Put 2, b, g in ascending order. b, g, 2 Suppose -5m = u - 482, -5m = -9m - 4. Let j = 484 - u. Put j, 0, -10 in ascending order. -10, j, 0 Let j = 395.3 + -394.9. Put -8, 1/3, j, -0.2 in increasing order. -8, -0.2, 1/3, j Let r be 1/224. Let n(h) = -2h3 - 43h*2 + 433h - 24. Let g be n(-29). Sort g, -2, r, -4. -4, -2, r, g Suppose 0 = -c + 5c + 20. Let g be (-6)/15 + (-22)/c. Suppose m + 4 = -y + gm, 0 = -4y + m + 17. Sort -2, -3, y in increasing order. -3, -2, y Let h = 38 + -61. Let k = h + 21. Let i = 843 - 71657/85. Put 0.5, k, i in increasing order. k, i, 0.5 Let z(c) = -184c*2 + 102c + 102. Let a be z(-1). Sort 1, -5, a, -3 in decreasing order. 1, -3, -5, a Let i(n) = n*3 + 12n*2 - 10n + 40. Let u be i(-13). Suppose -j - u = -5g - 29, -3 = 3g. Sort 5, j, -2/7, -3 in increasing order. -3, -2/7, 5, j Let x = -0.1 - 0.1. Let j = x - 0. Let b = 40121/3 - 13373. Sort j, 0.2, b in decreasing order. b, 0.2, j Let y(z) = 2z - 5. Let n be y(0). Let h be 1/n + 2/6. Let l be (114/95)/((-33)/15). Sort -4, h, l in increasing order. -4, l, h Let b(z) = -z3 + 3z*2 + 6z - 7. Let l be b(4). Let n be (1(-3)/9)/(l/(-165)). Suppose 2u = -9u + n. Sort -4, -1, 2, u. -4, -1, 2, u Let z = -0.2 - -0.7. Let l = -3226 + 3227. Sort -4, l, z, -3. -4, -3, z, l Suppose -85z = -81z + d + 153, 0 = -2z - 3*d - 69. Let s = 68 - 71. Sort 3, z, s in increasi	{ "pile_set_name": "DM Mathematics" }
s digit of 38057? 3 What is the hundreds digit of 551306? 3 What is the hundreds digit of 2025089? 0 What is the units digit of 41821? 1 What is the units digit of 2827886? 6 What is the hundreds digit of 1458279? 2 What is the tens digit of 254288? 8 What is the units digit of 5911969? 9 What is the ten millions digit of 18335691? 1 What is the thousands digit of 55631? 5 What is the ten thousands digit of 5705334? 0 What is the tens digit of 548709? 0 What is the hundred thousands digit of 236655? 2 What is the units digit of 65504? 4 What is the ten thousands digit of 836822? 3 What is the ten thousands digit of 50632? 5 What is the hundreds digit of 527167? 1 What is the hundreds digit of 229165? 1 What is the ten millions digit of 10210333? 1 What is the tens digit of 286432? 3 What is the hundred thousands digit of 1557008? 5 What is the millions digit of 1371151? 1 What is the thousands digit of 288094? 8 What is the tens digit of 18869571? 7 What is the hundred thousands digit of 905603? 9 What is the hundreds digit of 2268531? 5 What is the units digit of 4590112? 2 What is the tens digit of 85888? 8 What is the tens digit of 165787? 8 What is the hundred thousands digit of 289134? 2 What is the hundreds digit of 45617? 6 What is the ten thousands digit of 363607? 6 What is the hundred thousands digit of 3473601? 4 What is the tens digit of 2195341? 4 What is the thousands digit of 61373? 1 What is the thousands digit of 28447058? 7 What is the hundreds digit of 43904? 9 What is the ten thousands digit of 1483448? 8 What is the hundreds digit of 1571377? 3 What is the hundreds digit of 2626521? 5 What is the thousands digit of 1889553? 9 What is the units digit of 5456? 6 What is the thousands digit of 375807? 5 What is the hundreds digit of 363345? 3 What is the ten thousands digit of 128129? 2 What is the tens digit of 11718550? 5 What is the tens digit of 328073? 7 What is the hundreds digit of 393003? 0 What is the thousands digit of 6012006? 2 What is the tens digit of 5395683? 8 What is the hundreds digit of 76042? 0 What is the thousands digit of 5648318? 8 What is the hundreds digit of 1727001? 0 What is the units digit of 548989? 9 What is the hundreds digit of 177078? 0 What is the tens digit of 629920? 2 What is the ten thousands digit of 6834869? 3 What is the thousands digit of 240608? 0 What is the hundred thousands digit of 168499? 1 What is the tens digit of 435904? 0 What is the tens digit of 126868? 6 What is the millions digit of 1243369? 1 What is the units digit of 2567336? 6 What is the thousands digit of 254216? 4 What is the tens digit of 3936363? 6 What is the ten thousands digit of 638640? 3 What is the millions digit of 2714004? 2 What is the tens digit of 300064? 6 What is the ten thousands digit of 940418? 4 What is the ten thousands digit of 23507460? 0 What is the thousands digit of 254037? 4 What is the tens digit of 8356817? 1 What is the ten millions digit of 17202111? 1 What is the millions digit of 4672847? 4 What is the hundred thousands digit of 13563880? 5 What is the units digit of 1618113? 3 What is the tens digit of 114581? 8 What is the tens digit of 5384376? 7 What is the tens digit of 6948046? 4 What is the hundred thousands digit of 3365796? 3 What is the hundred thousands digit of 8257980? 2 What is the ten thousands digit of 1153812? 5 What is the hundreds digit of 5005665? 6 What is the ten thousands digit of 30071546? 7 What is the ten thousands digit of 4390732? 9 What is the thousands digit of 4979069? 9 What is the hundred thousands digit of 4738659? 7 What is the tens digit of 8180355? 5 What is the thousands digit of 20029047? 9 What is the hundreds digit of 505534? 5 What is the hundred thousands digit of 314180? 3 What is the hundred thousands digit of 481554? 4 What is the hundreds digit of 3551996? 9 What is the tens digit of 304144? 4 What is the units digit of 99623? 3 What is the tens digit of 11559387? 8 What is the tens digit of 138872? 7 What is the units digit of 18088175? 5 What is the thousands digit of 415701? 5 What is the hundred thousands digit of 368952? 3 What is the tens digit of 542896? 9 What is the hundred thousands digit of 205691? 2 What is the thousands digit of 2707230? 7 What is the thousands digit of 173838? 3 What is the hundred thousands digit of 389178? 3 What is the thousands digit of 5546683? 6 What is the hundreds digit of 15809544? 5 What is the thousands digit of 12393249? 3 What is the tens digit of 3579234? 3 What is the tens digit of 856325? 2 What is the ten millions digit of 16223236? 1 What is the hundreds digit of 1780185? 1 What is the thousands digit of 128228? 8 What is the hundred thousands digit of 294629? 2 What is the thousands digit of 478188? 8 What is the hundreds digit of 18710563? 5 What is the tens digit of 94949? 4 What is the thousands digit of 622990? 2 What is the thousands digit of 11266946? 6 What is the hundred thousands digit of 319961? 3 What is the tens digit of 28957799? 9 What is the millions digit of 4979545? 4 What is the units digit of 1492946? 6 What is the hundred thousands digit of 11844099? 8 What is the hundred thousands digit of 417664? 4 What is the units digit of 26548816? 6 What is the thousands digit of 178916? 8 What is the hundreds digit of 590141? 1 What is the hundreds digit of 11241647? 6 What is the tens digit of 7081968? 6 What is the thousands digit of 782876? 2 What is the hundreds digit of 1468059? 0 What is the thousands digit of 13996186? 6 What is the hundreds digit of 55972? 9 What is the ten millions digit of 14833492? 1 What is the units digit of 2040814? 4 What is the ten thousands digit of 524664? 2 What is the hundreds digit of 18453629? 6 What is the tens digit of 427409? 0 What is the units digit of 420930? 0 What is the units digit of 1805783? 3 What is the units digit of 2830825? 5 What is the thousands digit of 2234084? 4 What is the ten thousands digit of 1299089? 9 What is the hundreds digit of 315546? 5 What is the thousands digit of 2843601? 3 What is the tens digit of 269774? 7 What is the thousands digit of 24172? 4 What is the tens digit of 4980703? 0 What is the units digit of 7543455? 5 What is the units digit of 9634115? 5 What is the tens digit of 8298175? 7 What is the units digit of 1012327? 7 What is the hundreds digit of 162654? 6 What is the hundreds digit of 1754849? 8 What is the tens digit of 1616213? 1 What is the tens digit of 9266? 6 What is the hundred thousands digit of 423558? 4 What is the hundred thousands digit of 5514742? 5 What is the ten thousands digit of 55305? 5 What is the ten thousands digit of 324697? 2 What is the ten thousands digit of 77558? 7 What is the units digit of 82533? 3 What is the units digit of 5249712? 2 What is the ten thousands digit of 455411? 5 What is the hundreds digit of 303646? 6 What is the ten millions digit of 22102776? 2 What is the millions digit of 11424210? 1 What is the ten thousands digit of 170426? 7 What is the tens digit of 497636? 3 What is the hundreds digit of 14529745? 7 What is the hundred thousands digit of 681049? 6 What is the ten thousands digit of 32347251? 4 What is the tens digit of 1900526? 2 What is the tens digit of 3702620? 2 What is the hundred thousands digit of 116876? 1 What is the tens digit of 5476168? 6 What is the millions digit of 4550573? 4 What is the tens digit of 2937817? 1 What is the millions digit of 8098733? 8 What is the thousands digit of 1798499? 8 What is the ten thousands digit of 11031800? 3 What is the ten thousands digit of 418511? 1 What is the ten thousands digit of 2278486? 7 What is the hundred thousands digit of 106956? 1 What is the thousands digit of 2087813? 7 What is the units digit of 131398? 8 What is the hundreds digit of 1108311? 3 What is the hundreds digit of 565738? 7 What is the tens digit of 698071? 7 What is the ten thousands digit of 21302854? 0 What is the hundred thousands digit of 435152? 4 What is the tens digit of 2052055? 5 What is the hundred thousands digit of 835057? 8 What is the ten thousands digit of 1994147? 9 What is the thousands digit of 767307? 7 What is the hundreds digit of 8122470? 4 What is the units digit of 925686? 6 W	{ "pile_set_name": "DM Mathematics" }
)((r/(r(rrr*2rr)/rr))/r)(-43) assuming r is positive. r(1292/7) Simplify ((p/(p/(p*(3/4)/p)p)p5)/(p(1/4)((p/((pp(p/(p*(8/5)p))/pp)/p)p)/pp)/p))26 assuming p is positive. p(247/5) Simplify (g(-2)/((g(-1/4)/g)/g)g*(-6/5)/(gg*(3/7)g))/((g/g(1/3))(-6/23)g(-2/13)/(g/(g(-1/12)/g))) assuming g is positive. g(-30374/31395) Simplify h/(h/h(3/5)h)(hh/(hh19))/hh(-1/25)/(h(-2/67)/h) assuming h is positive. h*(-30837/1675) Simplify (ww*45w*(8/7)w)/(w/(ww/(w(3/28)/ww))w(-13/6)) assuming w is positive. w(4301/84) Simplify ((i/(i/i(9/4)))(-4)i*7/((((ii/i(2/9))/i)/i)/i))(-5/12) assuming i is positive. i(35/108) Simplify (((w/w(-1/13))/www)/ww(1/10)(w/(w/(www(-31))))/w7)(-13/3) assuming w is positive. w(1509/10) Simplify (((m*3m)/((m/(m*(-1/4)m))/m))/(((m/m4)/m)/(m4/m)))/((m(-2)/m1)/((m/((m*(-2/9)m)/m))/((m*(-3)mm)/m))) assuming m is positive. m(647/36) Simplify ((((cc*(2/11))/c)/c)/cc*(-10)cc(-2/3)cc(-15)/c)21 assuming c is positive. c(-6118/11) Simplify ((o19)(-49)/(o(-6)ooooo(-2/5)/o))12 assuming o is positive. o(-55656/5) Simplify ((l(-6/13))*(-17)(ll/l(-7/6))36)(23/4) assuming l is positive. l(9108/13) Simplify ((((i/i(-4))(-2))(-13))(-3/4))7 assuming i is positive. i(-1365/2) Simplify (aa/(a*4/a))/aa/(a/a*(1/5))a(a1)(-5/8)((a(-4))(10/7))(-1) assuming a is positive. a(1201/280) Simplify ((l1/l)8)2/((l(-1))(-3/34))(-12/13) assuming l is positive. l(18/221) Simplify ((w(-2/9))*(-7/5)(w*1w)/w(-1/3))25 assuming w is positive. w(595/9) Simplify (q(-1))*47(q/q*(1/9))/qqq/q(-2/9)(qq0q)*(-2)q(2/11)/(q/q5) assuming q is positive. q(-4426/99) Simplify ((h(1/11))*(1/21)h*(1/3)h(h/h(-2/31))/hh)(-9/8) assuming h is positive. h(-25803/9548) Simplify ((t16/t10)/(t(-3/14)/t19))(-6/23) assuming t is positive. t(-1059/161) Simplify (bbb(-2/3))(-15/4)/(b*(-9)bb(5/4)/b)(b(-1/6)/((b4/b)/b))/(b(1/13)/((b(-1/3)b)/b)) assuming b is positive. b(9/52) Simplify ((((tt*(-2/95)/ttt)/tt)/t)*(-1/34)t/(t*(-27)t)tt(2/119))(-12/7) assuming t is positive. t*(-3796854/79135) Simplify (l/((l(ll(-1)l)/l)/l))*(1/4)(l/(l2/l))(1/77)(l(-9)(l*(2/25)/l)/l)/(ll*(-4)l/l(-1/4)) assuming l is positive. l(-223/25) Simplify ((n/n1)(-49)/(n/(n/(n/n(-1/2))))36)/((n(2/3))(-23/4))(-45) assuming n is positive. n(-453/2) Simplify i*5i*(-1/3)i/(iii*(-2)i)i1i(i(2/5))(-1/9)/(i(3/7)ii6/i) assuming i is positive. i(61/315) Simplify (n(-2/5)(n/n*0)/n(nn/n0n)/nn/(n/(n(1/5)/n)))/((n(-2/7))40)(-2/79) assuming n is positive. n(1412/2765) Simplify a0a*(-3/4)/a(a/a1)(-40)(a(-1)/aaaa/(aa7/aa))(4/15) assuming a is positive. a(-217/60) Simplify (((n*(-1)n(-7))(3/4))(-15))(-1/30) assuming n is positive. n*(-3) Simplify (ii*(-3/7)i*3i)*(-2/101)((i*(2/5)/i)/ii(2/7))(-4) assuming i is positive. i(18264/3535) Simplify ((r(32/5))*29((r*(-3)r)/rr)/(r/(r(-2/37)/r)))(7/9) assuming r is positive. r(235102/1665) Simplify (((t/(t/t4))/t)/(tt(-6)/t))/(t/t0t2t)((t/(ttt10))/(ttt(-1/12)))(-1/15) assuming t is positive. t(211/36) Simplify ((b(2/15)bb(-3/11)(b(-2/3))36)(-15))(14/3) assuming b is positive. b(53452/33) Simplify ((o(1/5)/o)42)(1/15)/(o*(-1/4)ooo*6(o/((o/((o/o(1/2))/o))/o))18) assuming o is positive. o(-1899/100) Simplify ((h(1/4)h)(-28)/((h/((((h/(hh/h*(-2/9)hh))/h)/h)/h))/h(-3/8)))/((hhh/(hhh(-1/2))h)(-5/9))(-38) assuming h is positive. h*(-763/8) Simplify (((((w/(w/(w/(ww/(ww/w4w)))))/w)/w24)(-9))8)(-27) assuming w is positive. w(-52488) Simplify ((r(-8)/r)/(r/((rr(1/10)/r)/r)))(-22)(rr(-5)/r)/r(r*(-1)r)/rr(r(-2))(-22) assuming r is positive. r(1389/5) Simplify (i(4/3)/i(-8))(6/23)/(((i/(iiii(-4)ii))/ii(-1/8))/(i/(i/(i(-6/11)i))i/(iii/(i/(ii(-2/17)))i))) assuming i is positive. i(38949/34408) Simplify (p(-1)p(p/p*(1/3))/pp((p/p0)/p)(-19/2))/((p/(p3p))/p*6(p0)(-12)) assuming p is positive. p*(29/3) Simplify (mm(-2/103))/m(2/31)m46m33 assuming m is positive. m(255172/3193) Simplify ((((b/((b(b/b7)/b)/b))/b(b/(b/(b*3b)))/b)/(b(-3/4))(35/6))(-46))(-41) assuming b is positive. b(108445/4) Simplify (u/u(-1/3)uu*(-2/3)/uu)/(uuuu(-1)uu)16((u/u(-2/5))/u2)/((u0/u)/u(-2/3)) assuming u is positive. u(-313/5) Simplify ((r/(r/(r/((r/r(-1/2))/r))r))4rr/r1rr/r(1/7))/(((rr/(r(rr*(-6)r)/r)r)/(rr(-3/7)))/(r(2/7))(-1/55)) assuming r is positive. r(-2147/385) Simplify ((u/(uu/(u2u)))49)(-2/9)/((u(-1/2))41(uu/(u/u2))(-5)) assuming u is positive. u(247/18) Simplify ((h20hhhhh(-1/25)h)/(h*(2/27)h(-22)))(-2/111) assuming h is positive. h(-63296/74925) Simplify ((f0f)(-13/4))14/((ff(f/(ff*(-1/4)f)f)/f)(-17))(1/17) assuming f is positive. f(-177/4) Simplify ((d/(d/((dd*(-8))/d)))/(d/(dd*1d)))*(2/25)((d/(dd11))/dd((dd/(d/d*(3/5)d))/d)/d)38 assuming d is positive. d(-11792/25) Simplify ((((l/(ll/(ll*(-1/8)ll)))/ll)/l)/(ll4l)(lll(l*(-4/3)/l)/l)/(ll(4/7)))/((l(-1/3)/l)*16l/l*(3/2)l0/l) assuming l is positive. l(885/56) Simplify ((ff1)/ff(-1/3))(22/7)(((f/(ff*(-1)/f))/f)/ff)*(-11)/((f/((ff*(1/6))/ff))/f(2/13)) assuming f is positive. f(-4687/546) Simplify ((v*6v)*(-1/81)(v(-5))27)(-9) assuming v is positive. v(10942/9) Simplify (((((v/v(-1/4))/v)/v(2/7))/((vv6v)/vv(-9)))(-34))(2/37) assuming v is positive. v(-935/259) Simplify ((g(1/2)gg)(-1/35))11(g*(3/7)g(-5))7 assuming g is positive. g(-459/14) Simplify (r(-1)/(rrrr(-16)r)rr*(4/5)(rrr(-8/7))/r)26 assuming r is positive. r(11518/35) Simplify l(-3/4)/lll/(l/l*(1/3))ll(lll(-2/7))32(l/(lll/(ll/l*1lll)))*(9/5)/((l(l*3ll)/l)/(l/(ll/l*(-6))l)) assuming l is positive. l*(20597/420) Simplify ((((yy(1/5))/y)/y)/y(-7))/(y(-1/4)/(((y/((y(-1/9)y)/y))/y)/yy))(y(1/9)y7)(24/7) assuming y is positive. y(38987/1260) Simplify ((l(2/15))(-14))(-6/17)/(l/(l*(1/2)/l)l(ll(-2/11))/l)(-49) assuming l is positive. l*(213647/1870) Simplify ((hh(9/5))/h)(2/5)(h6/h)(-10) assuming h is positive. h(-1232/25) Simplify ((j0j5)/(j2/(jj(3/4))))/(j(3/10)j*2j*(1/2)/(jj/j(1/10))) assuming j is positive. j(77/20) Simplify ((y(-4/7)/(((y/(((y/y(-2/19))/yy)/y))/y)/y))/((yy(((y(-2/41)y)/y)/yy)/y)/y(-12)))(-47) assuming y is positive. y(3182464/5453) Simplify ((q(-4))(-12/13)/(q(-9)q/(qq(11/5))))(-11/2) assuming q is positive. q(-5324/65) Simplify ((x9/(xx*(-3/7))x/x*(2/3)xx5)(2/3))(-18) assuming x is positive. x(-1240/7) Simplify (((v(3/4)v)/vvv)(1/10))13/(vv(-8)v/((((v/v*(-9))/v)/v)/v)(vv/(vvv1v))(-30)) assuming v is positive. v(-1737/40) Simplify ((cc/c1)0(c*4c)/(c*(-3)c))/(((c/(c*(2/15)/cc)c)/(c(-2/7)/cc))/(c(3/8)/(c/c0cc))) assuming c is positive. c(1867/840) Simplify ((l(-1)l(-1/5))/(l(-1/7)/l(-1)))/(lll(-5)(ll/l6)/ll(4/5)/(l(2/5)l)) assuming l is positive. l(229/35) Simplify (b(5/3)b*6bb(-11)bb(1/4)/bb)(-1/7) assuming b is positive. b(13/84) Simplify ((g*(2/5)/ggg/(g/(g(-1/5)g))(g(-2/3))(-2/7))(43/5))(-4/19) assuming g is positive. g(-25112/9975) Simplify (((pp*(2/7)p)/p)(-34))37p(-5)/(pp*(1/6))(p/((p*2p)/p))/(p*(-4)p) assuming p is positive. p(-68107/42) Simplify b(-1)b/b(-2/5)b/((b*(1/2)/b)/b)bbb*(4/5)(((bb1/b)/b)/b(-4))(5/8) assuming b is positive. b(41/5) Simplify d3dd(-3/7)dddd4dd/d(-1/3)d((ddd/(dd*1)ddd)(9/7))(-9/5) assuming d is positive. d(488/105) Simplify ((((p/p(-7))/p)/p)*(-48)(p9)(-16))**50 assuming p is pos	{ "pile_set_name": "DM Mathematics" }
ase 8, what is -1 - 2127557? -2127560 In base 3, what is -2002000002 - 210? -2002000212 In base 10, what is 194211 + -8? 194203 In base 11, what is 4 + -358626? -358622 In base 10, what is 255 - 90? 165 In base 14, what is 1 - -1091? 1092 In base 5, what is 10 - 1043133? -1043123 In base 2, what is -100010001010 - -10? -100010001000 In base 15, what is -1 + -46ab4? -46ab5 In base 8, what is -2 - 236460? -236462 In base 4, what is 13301 + 2202? 22103 In base 12, what is -5a7125 + 1? -5a7124 In base 12, what is -56a0 - -45? -5657 In base 6, what is 10 - 13530523? -13530513 In base 13, what is 4 - -941? 945 In base 9, what is -357 - -217? -140 In base 16, what is -749 - 6? -74f In base 13, what is 17 - -c92? ca9 In base 10, what is -78781 + -3? -78784 In base 5, what is -102123 - 0? -102123 In base 3, what is -10011 - 1101200? -1111211 In base 3, what is -21 + 101202200? 101202102 In base 14, what is 3d - -a69? aa8 In base 13, what is 1c - 186? -167 In base 5, what is -1233 + -142231? -144014 In base 4, what is 0 + -23012012? -23012012 In base 3, what is -1202220022220 - -10? -1202220022210 In base 7, what is 253 + 23442? 24025 In base 13, what is -64417 - -5? -64412 In base 12, what is -6412 - 372? -6784 In base 13, what is -2167 - -511? -1956 In base 4, what is -1323312212 + 100? -1323312112 In base 3, what is -2210210 - -101100? -2102110 In base 10, what is 8 - -75778? 75786 In base 14, what is -136ab - 0? -136ab In base 7, what is -364455 - -5? -364450 In base 11, what is -4 - 2978a3? -2978a7 In base 14, what is 9 + -1618b? -16182 In base 10, what is 9 + 14878? 14887 In base 7, what is 2 - 50600? -50565 In base 11, what is 0 - 258608? -258608 In base 5, what is -11 + -23033? -23044 In base 4, what is 3 - -3231321210? 3231321213 In base 16, what is -62 + 13a1? 133f In base 7, what is -1 - -2533435? 2533434 In base 5, what is 31114 + -4? 31110 In base 2, what is -1111 - 11000001100101? -11000001110100 In base 4, what is -3 - 33130120? -33130123 In base 11, what is -1 - 924363? -924364 In base 12, what is -2 - -16263? 16261 In base 6, what is 43102421 - -4? 43102425 In base 11, what is 365971 + -1? 365970 In base 8, what is 3631 + -606? 3023 In base 4, what is -3123230 - 12? -3123302 In base 13, what is -3 + 10b92b? 10b928 In base 5, what is -314213 + 10? -314203 In base 3, what is -1 - -1022211221? 1022211220 In base 15, what is -5bc + 123? -499 In base 4, what is -11 + -213211022? -213211033 In base 8, what is -150667 - -1? -150666 In base 12, what is -3087 + -7? -3092 In base 7, what is 41 - -256215? 256256 In base 15, what is 3975 + -2a? 394a In base 12, what is 2641 - 82? 257b In base 8, what is 4500 + -27? 4451 In base 14, what is 83a + 3? 83d In base 14, what is -d1 - 68? -159 In base 7, what is -210 + 2024? 1514 In base 10, what is 2125 - -313? 2438 In base 7, what is -102140 + -2? -102142 In base 8, what is 36 - -3074? 3132 In base 5, what is 10304 + -32404? -22100 In base 4, what is 31003 - -3330? 100333 In base 12, what is -2 + 10b3a? 10b38 In base 12, what is 4 + -2b987? -2b983 In base 6, what is -3 + -30405412? -30405415 In base 15, what is 733b - -5? 7341 In base 2, what is 1011 + -1001100111101? -1001100110010 In base 5, what is 10 - 211402221? -211402211 In base 7, what is -235020223 - 0? -235020223 In base 5, what is 33042 - 104043? -21001 In base 15, what is 12332 - 23? 1230e In base 12, what is a4 - -8018? 8100 In base 6, what is 4 - 221444? -221440 In base 12, what is -1 - 2091b? -20920 In base 7, what is 4666633 - -5? 4666641 In base 5, what is -3421213 + 11? -3421202 In base 4, what is 220 + -213303? -213023 In base 11, what is 8869656 - -2? 8869658 In base 12, what is -985b + 2? -9859 In base 13, what is 25256 - -27? 25280 In base 7, what is 2214 - 145? 2036 In base 11, what is -2 + -9941? -9943 In base 16, what is 3 + c18? c1b In base 11, what is 0 + 3065? 3065 In base 9, what is -240350 - 3? -240353 In base 12, what is -2 - -2384? 2382 In base 12, what is -13 - -1875? 1862 In base 3, what is -10211 - 220120? -1001101 In base 13, what is -33 - 3c5? -428 In base 3, what is -111111210221 - -22? -111111210122 In base 6, what is -4523421 + 0? -4523421 In base 15, what is -46d + c06? 788 In base 10, what is -171 - 167? -338 In base 14, what is -56b + -2? -56d In base 15, what is a94 - -2b? ac0 In base 2, what is 10011 - 1011001101011110? -1011001101001011 In base 16, what is -11d - -869? 74c In base 11, what is 10a4370 - 3? 10a4368 In base 11, what is 21738 + -1? 21737 In base 5, what is -12324 + -231? -13110 In base 5, what is -314412 - -4? -314403 In base 12, what is -33b4 - -9? -33a7 In base 11, what is 70552 - 1? 70551 In base 10, what is 65 - -6? 71 In base 12, what is -9246b - 2? -92471 In base 10, what is -1 + 8245? 8244 In base 10, what is -79 + -2245? -2324 In base 2, what is -101 - 1001110100001001? -1001110100001110 In base 10, what is 205831 + -1? 205830 In base 8, what is -2 + 16613? 16611 In base 10, what is 65 - 3009? -2944 In base 7, what is -65 - 51664? -52062 In base 7, what is 201042 - -5? 201050 In base 9, what is -7580 - -50? -7530 In base 6, what is 22 - -133022? 133044 In base 16, what is caa0 - -6? caa6 In base 2, what is 101101011110110 - 1001010? 101101010101100 In base 6, what is -3141 - 4? -3145 In base 16, what is 2f098 - 5? 2f093 In base 2, what is 101 + 1011010001? 1011010110 In base 10, what is -3555673 - 2? -3555675 In base 2, what is -10111011010110100 - 10? -10111011010110110 In base 9, what is -52 - 101848? -102011 In base 6, what is 11252 + 4430? 20122 In base 9, what is 328 - 352? -23 In base 16, what is dc - be? 1e In base 10, what is 0 - 17889? -17889 In base 14, what is 6c9 + a86? 1371 In base 14, what is 49a0 + 12? 49b2 In base 5, what is 11 + 4101003? 4101014 In base 2, what is 11 - 1100110110111011011? -1100110110111011000 In base 8, what is -13624 - 14? -13640 In base 8, what is -5 - 42425? -42432 In base 6, what is -3012315 + 2? -3012313 In base 13, what is 0 + a0272? a0272 In base 16, what is -7c - -47? -35 In base 15, what is -53 + 757? 704 In base 16, what is 4 + -14fae? -14faa In base 14, what is 5 + -2d5? -2d0 In base 5, what is 44442002 + 3? 44442010 In base 5, what is -1 + -4032403? -4032404 In base 2, what is -111111000111000100110 + -1? -111111000111000100111 In base 7, what is -525265 - -5? -525260 In base 7, what is -13206 - 25? -13234 In base 10, what is -29423 + 11? -29412 In base 16, what is eebe + -2? eebc In base 16, what is 5f - da2? -d43 In base 13, what is -a1 - -65c1? 6520 In base 14, what is -6a83 + -2? -6a85 In base 12, what is 262 + 392a? 3b90 In base 5, what is -2413422 + 22? -2413400 In base 6, what is 305353 - 152? 305201 In base 13, what is 30 + -8c8? -898 In base 3, what is 1 + 100012121011? 100012121012 In base 7, what is -204433 + 2? -204431 In base 15, what is -99 + 66? -33 In base 16, what is 401e + 5? 4023 In base 2, what is -110011001001 + -100011010? -110111100011 In base 10, what is -11 + -20377? -20388 In base 5, what is -12 + -4402? -4414 In base 7, what is 442005 - 2? 442003 In base 16, what is -5 - 34156? -3415b In base 13, what is -4 + -5b753? -5b757 In base 11, what is 13 + -24752? -2473a In base 5, what is 433214 + 3? 433222 In base 11, what is 10 - 1328? -1318 In base 6, what is -121 + -20453? -21014 In base 12, what is -a361 + -2? -a363 In base 10, what is -46 - 10955? -11001 In base 3, what is -2100 - 200000111? -200002211 In base 11, what is -29a66 - -13? -29a53 In base 16, what is 5 + 18715? 1871a In base 6, what is 5211 + 333? 5544 In base 5, what is -1 + -134002110? -134002111 In base 2, what is -1011111100011010001100 + 11? -1011111100011010001001 In base 15, what is -14 - 3bda? -3bee In base 9, what is 1 - -125417? 125418 In base 13, what is -10584 + b? -10576 In base 4, what is -11 - 13030201? -13030212 In base 5, what is 11143132 - -30? 11143212 In base 2, what is -11 - -11010010010100100000? 11010010010100011101 In base 7, what is 354010 - -3? 354013 In base 14, what is -1 - 2ca82? -2ca83 In base 6, what is 125 - 13354? -13225 In base 13, what is -1 + -9469? -946a In base 11, what is -2014a2 - 5? -2014a7 In base 2, what is -1 + -10011001000010100000? -10011001000010100001 In base 7, what is 1 - 1205002? -1205001 In base 3,	{ "pile_set_name": "DM Mathematics" }
2f + f2 - 3f - 2f2 + pf*2 wrt f. 14 Suppose 5x - 8x = 0. What is the second derivative of 0v2 + v5 + v + 0v5 + xv*2 wrt v? 20v*3 Let y = -101/6 - -17. Let a(r) be the second derivative of -3r + 0 - 1/2r2 + 0r*3 + yr*4. Differentiate a(i) with respect to i. 4i Let r(i) be the second derivative of 0 + 9i + 0i*5 - 4/21i*7 + 0i*3 + 0i*2 + 2/3i*4 + 0i*6. Find the third derivative of r(t) wrt t. -480t2 Let m(c) be the third derivative of -c9/63 + 7c5/10 + 41c*2. Find the third derivative of m(s) wrt s. -960s*3 Let o(y) be the first derivative of -4y7/7 - y3/3 + 1. Find the third derivative of o(r) wrt r. -480r3 Find the third derivative of -z2 + 8z*2 - 124z*4 + 104z*4 + 6z*2 wrt z. -480z Let b(m) be the first derivative of -16m5/5 + m2/2 + 9. Find the second derivative of b(z) wrt z. -192z*2 Suppose 1 = -3v + 25. What is the first derivative of -vc2 + 2c2 + 2 - c2 wrt c? -14c Let g(k) = k + 2. Let a(y) = 2y + 3. Let c(n) = 2a(n) - 3g(n). Let t(d) = -9d - 1. Let p(u) = -6c(u) - t(u). What is the derivative of p(r) wrt r? 3 Differentiate -25 + 20 - 3k2 + 5k*2 wrt k. 4k Let o be (-63)/66/9. Let r(f) = -3f - 1. Let z(c) = c*2 + 7c + 2. Let i(v) = or(v) - 3z(v). What is the first derivative of i(q) wrt q? -6q Let x(s) be the third derivative of s4/12 - 7s3/6 + s2. What is the derivative of x(j) wrt j? 2 Suppose -4g + 2g = -10. What is the derivative of -c*3 + g + 2c*3 + 0 wrt c? 3c*2 Suppose 7 + 11 = 3s. Let y be 1 + -1 + (s - 4). Find the third derivative of -3u3 - 4u*3 - 6uy + u2 + 3u3 wrt u. -24 Let w(s) = -3s - 30. Let f(u) = -12u - 120. Let i(n) = -2f(n) + 9w(n). What is the first derivative of i(l) wrt l? -3 Let o(w) be the second derivative of w7/210 + w4/8 - w2 - 2w. Let z(s) be the first derivative of o(s). What is the second derivative of z(j) wrt j? 12j2 Suppose 0 = 6h - 14 + 2. Let c(f) be the first derivative of -3/4f4 - 1/2f*h + 0f + 0f3 + 1. What is the second derivative of c(z) wrt z? -18z Let y(n) be the second derivative of 0n5 + 0n*7 + 0 - 1/12n*4 + 3/56n*8 + 0n*2 + 0n*6 + 0n*3 + n. What is the third derivative of y(h) wrt h? 360h*3 Let i(v) = -19v*3 - 24v - 7. Let h(n) = 9n3 + 12n + 4. Let j(a) = -7h(a) - 4i(a). Find the second derivative of j(r) wrt r. 78r Let c = 1 - -1. What is the second derivative of -p2 + p5 + cp + p*2 wrt p? 20p*3 Let k(g) = -7g*3 + 17g*2 + 17g + 3. Let h(s) = -s3 + s2 + s. Let d(w) = -102h(w) + 6k(w). Differentiate d(x) with respect to x. 180x2 Let c(p) be the second derivative of -p4/3 - p3 - 3p*2 - 7p. Let h(o) be the first derivative of c(o). What is the derivative of h(s) wrt s? -8 Find the third derivative of -5h2 - 2h*5 + 2h*2 - 2h5 - h5 wrt h. -300h2 Find the third derivative of 8m*5 - 123m + 5m2 + 123m wrt m. 480m2 Suppose -j - 4w - 5 = 0, 3j + 5w + 2 - 1 = 0. What is the first derivative of -5m2 + 6 + 2m - jm + m wrt m? -10m Let u(k) be the first derivative of -k3/3 - k2/2 + k + 3. Let f(j) = -8j2 - 4j + 5. Let c(a) = -f(a) + 4u(a). Find the first derivative of c(o) wrt o. 8o Let u(p) = -36p2 + 15p - 21. Let s = -27 + 42. Let j(g) = -5g2 + 2g - 3. Let d(n) = sj(n) - 2u(n). Find the first derivative of d(m) wrt m. -6m Suppose -18 = 4n - 5n - 4v, 12 = -2n + 4v. Find the second derivative of -nh4 + 30h*2 - 30h*2 + 3h wrt h. -24h2 Let j = 0 - -2. What is the first derivative of 2n2 - 1 - 1 - n2 - 2nj wrt n? -2n Let a(n) be the first derivative of 2n6/3 + 5n*2/2 - 2. What is the second derivative of a(u) wrt u? 80u3 Let h(i) be the first derivative of -i6/30 - i*3/2 - 3i - 3. Let d(b) be the first derivative of h(b). Find the second derivative of d(u) wrt u. -12u2 Find the second derivative of 28z*4 + 17z - z - 10z4 wrt z. 216z2 Let c(d) be the third derivative of -d7/42 + 3d5/20 - 6d*2. Find the third derivative of c(k) wrt k. -120k Let u be 1 + 0 - (-4)/2. Let b = u + -1. Find the second derivative of 2f5 + bf - 4f4 + 4f*4 wrt f. 40f*3 Let q(y) be the first derivative of -4y3/3 - y2 - 2. What is the second derivative of q(j) wrt j? -8 Let m(p) = -p - 2. Let k be m(-2). Differentiate -1 - j - 3 + 0 + kj wrt j. -1 Let p(n) = -n3 + 7n - 3. Let o(h) = h - 1. Let t(i) = -21o(i) + 3p(i). What is the first derivative of t(d) wrt d? -9d2 Let h(l) = l2. Let x(y) = 3y*2 - 9. Let f(r) = 18h(r) - 2x(r). Find the first derivative of f(u) wrt u. 24u Let a(u) be the third derivative of u7/210 - u4/3 + 5u2. Find the second derivative of a(g) wrt g. 12g*2 Let l(h) = -2h*2 - 6h + 3. Let w(a) = a*2 + 7a - 4. Let v(i) = -4l(i) - 3w(i). Find the second derivative of v(m) wrt m. 10 What is the third derivative of 7k2 + k6 - 6k*6 - 3k*6 wrt k? -960k*3 Let m(o) be the third derivative of 0o*3 + 5/24o*4 + 0 + 5o*2 + 0o + 1/15o5. What is the second derivative of m(k) wrt k? 8 Suppose 5z + 22 = 2j + z, j + 3z = -14. Let u be j393/9. Differentiate u - 5 - 5 - 3a4 with respect to a. -12a3 Let v(m) be the second derivative of -m9/5040 - m6/360 - m4/12 + 3m. Let y(f) be the third derivative of v(f). Find the second derivative of y(j) wrt j. -36j*2 Let a = -8 - -11. Let t(i) be the third derivative of -1/60i*5 + 0i*4 + 0i + ai2 - 1/2i*3 + 0. Find the first derivative of t(m) wrt m. -2m Let s(r) be the first derivative of 9r6/2 + 31r*2/2 - 28. What is the second derivative of s(u) wrt u? 540u3 Let b(y) = y4 - y*2 + y - 1. Let w(f) = 16f*5 + 2f*4 + 31f*2 + 2f - 2. Let o(z) = 2b(z) - w(z). Find the third derivative of o(c) wrt c. -960c*2 Let y(o) = -6o*2 - 5o. Let l(u) = -7u2 - 5u. Let z(s) = -2l(s) + 3y(s). Find the second derivative of z(v) wrt v. -8 Let h(l) be the third derivative of 1/60l5 + 0l*4 + 0 - 2l*2 - 1/2l*3 + 0l. What is the derivative of h(k) wrt k? 2k Let z(d) = 38d*6 + 6d*3 - 7d*2 + 6d. Let a(r) = 38r6 + 5r*3 - 7r*2 + 5r. Let l(p) = 6a(p) - 5z(p). What is the third derivative of l(o) wrt o? 4560o3 Let g be (-1 + (-4)/(-3))9. Suppose -3x + 10 = -o, x + 2 = 6o - go. Find the second derivative of 0w4 + w4 + 0w - ow wrt w. 12w2 Let c = -38 - -38. Let g(x) be the third derivative of 0x*3 + 0 + 3x*2 + cx*5 + 1/120x*6 + 0x - 1/8x4. Find the second derivative of g(a) wrt a. 6a Find the third derivative of -14q5 - 2q*4 - 51q*2 - 22q*5 + 49q*5 wrt q. 780q*2 - 48q Let u(c) be the first derivative of 5c4 - 26c - 29. Find the first derivative of u(r) wrt r. 60r2 Let v(c) be the second derivative of c7/21 + 7c*4/12 + 16c. What is the third derivative of v(k) wrt k? 120k2 Suppose 0 = -4n + 3 - 19. Let a be ((-2)/n)/((-2)/(-16)). Find the second derivative of -2 + 3t + 2t*2 + 2 - at*2 wrt t. -4 Let t be (-2 + 1)-17. Differentiate -3c*3 + 4 - 5 - t + 4 wrt c. -9c*2 Suppose 5c - 4 - 6 = 0. Suppose 4g = -20, 17 + 7 = 2h + cg. What is the second derivative of -11n + hn - 10n + 3n3 wrt n? 18n Suppose g = -5, -l + 3g - 4g - 3 = 0. What is the second derivative of -2f2 + 0f2 - f + fl wrt f? -2 Let s(z) be the first derivative of 17z6/6 + 3z*3 + 18. What is the third derivative of s(n) wrt n? 1020n*2 Let r(b) be the first derivative of -6b*5/5 - 13b*3/3 - 12. Find the third derivative of r(c) wrt c. -144c Find the second derivative of 5t + 8t*3 - 8t + t - 3t wrt t. 48t Let u(s) be the first derivative of 13s6/6 + 25s*3/3 - 10. Find the third derivative of u(v) wrt v. 780v*2 Suppose -5f = -0f. Find the third derivative of -3t2 + t5 + 0t5 + ft*5 + 2t*2 wrt t. 60t*2 Differentiate 432y*2 + 15 - 432y*2 - 13y*3 with respect to y. -39y*2 Let k(m) be the first derivative of 5m*4/12 + 3m*2/2 + 4m + 5. Let h(z) be the first derivative of k(z). Differentiate h(p) with respect to p. 10p Let q(x) = x - 1. Let o be q(5). Find the first derivative of oi + 2 - 5 + 7 wrt i. 4 Let i be ((-8)/10)/((-3)/15). What is the second derivat	{ "pile_set_name": "DM Mathematics" }
ue Which is greater: 288745 or -0.2? 288745 Is 39/80827 at least as big as -1? True Which is smaller: 26716 or 133584/5? 26716 Is -1 greater than or equal to -24/147887? False Which is smaller: -29/93200 or 0? -29/93200 Is -784 >= -2353/3? True Is 3/8 greater than 0.33488? True Is 0.08055 at most as big as 2/17? True Is -163900 bigger than -163900? False Is -47109 bigger than -47103? False Is -22036 less than or equal to -21976? True Which is smaller: -202713 or -202712? -202713 Which is greater: 554 or -39? 554 Which is greater: 660 or -1/32? 660 Is -220288 less than -220288? False Are 48102 and 625336/13 equal? False Is 34626 >= 34624? True Which is bigger: -748/183 or -3? -3 Are -7/22705 and -17/4 non-equal? True Is -34864 greater than -34878? True Is -298425 at most as big as -298427? False Which is smaller: 185418 or 185434? 185418 Is -22.6 bigger than 1/2238? False Which is bigger: 0 or -2/18861? 0 Which is smaller: -2/10017287 or -1? -1 Which is greater: -7 or -13/51? -13/51 Do 22515 and 22514 have different values? True Are 0.04 and 1.13503 equal? False Which is smaller: -4/755029 or 0? -4/755029 Which is smaller: 0 or -111/824? -111/824 Which is smaller: 341527 or 341534? 341527 Is -8113 != -154134/19? True Is 3776330 bigger than 3776330? False Which is smaller: -19715 or -19714? -19715 Which is bigger: -13523 or 0.2? 0.2 Which is bigger: 1 or 40/348423? 1 Which is bigger: 1/2 or -1.757? 1/2 Is 0 equal to -2/3661853? False Is -167/265 not equal to 0? True Is 2018 greater than 1842? True Which is smaller: 1464.2 or -0.049? -0.049 Do -1 and 2134.4 have different values? True Which is greater: -1 or -3/630400? -3/630400 Is 0.4 greater than 62519? False Which is smaller: 149182 or 149183? 149182 Is -1786 at most 35? True Is -17888 bigger than -17887? False Is -3495/2521 > -0.1? False Do -1220 and 182 have the same value? False Which is greater: 752/241 or 3? 752/241 Which is smaller: 0.5 or 17282? 0.5 Is 0 <= 583/2045? True Is 8041 at most as big as 8041? True Is 1/4 <= -6417? False Is -104 less than -102/7? True Is -61254 less than -61254? False Which is smaller: 0 or 4/3141? 0 Which is bigger: 0.3 or -801.346? 0.3 Which is smaller: 6 or 10287? 6 Which is greater: -25.2 or -3.64? -3.64 Which is bigger: 36531/5 or 7306? 36531/5 Are 0 and -88/12869 nonequal? True Is -3562 at most 54/151? True Is 92191 smaller than 22? False Is 1230372/7 at most as big as 175766? False Is -857367 bigger than -857366? False Which is smaller: -0.3 or -207.359? -207.359 Is -1/4 >= 0.39337? False Is 58913 equal to 58915? False Which is smaller: 1/2 or -1670573? -1670573 Is -4/63281 greater than 1? False Do 451 and -791 have the same value? False Are -281791 and 2/3 nonequal? True Which is bigger: -1031 or -1054? -1031 Is 511/537 < 0? False Is 0 at least as big as 9/3677? False Is 4913 at least as big as 4832? True Is -453 <= -714? False Is -143 at least as big as -5824/41? False Which is greater: 1/295 or 1/2? 1/2 Do -4286 and -4106 have the same value? False Which is smaller: -2/3 or -652? -652 Which is smaller: -2/3 or 3553? -2/3 Which is smaller: -1/2 or -146899? -146899 Is 120985 bigger than 120956? True Which is bigger: 6328/239 or 25? 6328/239 Which is greater: -5 or -22968? -5 Is 2367989 smaller than 7103965/3? False Which is smaller: -3811 or -6? -3811 Is -778 at least -573? False Is 2616 smaller than 2616? False Is 17 smaller than 2/2117? False Are 49300/173 and -0.1 equal? False Which is greater: 108.22 or 0? 108.22 Do 1155084 and 1155084 have the same value? True Are -214/2731 and 1 nonequal? True Which is smaller: 0.3 or -3.446? -3.446 Is 167 less than -73? False Are 3295752 and 0 non-equal? True Is -1309/9 greater than or equal to 1? False Which is smaller: 1 or 181/13451? 181/13451 Do 0 and -10104.2 have different values? True Is -2868843 at most as big as -0.1? True Is 19445/8 greater than 2432? False Which is smaller: -94904/5 or -18981? -18981 Which is bigger: -40689/5 or -8139? -40689/5 Which is smaller: 2/1358967 or 0? 0 Is 43/70260 < 0? False Which is smaller: -41.7134 or 0? -41.7134 Is -222 greater than 164? False Is -720 >= 11.51? False Is 2 <= -7035? False Is -134307 not equal to -134309? True Which is greater: 57/619 or 1? 1 Is 149884 at least as big as 2/69? True Which is smaller: -12/135119 or 1? -12/135119 Which is greater: -1/113803 or -1? -1/113803 Is 3654859 greater than or equal to 3654860? False Do 1 and 3/60865 have the same value? False Does 66 = 11249/170? False Which is smaller: 2/679 or -501? -501 Which is greater: -1 or 506/2587? 506/2587 Is 3 greater than -4157? True Which is greater: -0.05 or -9074/9? -0.05 Is 164 at least 280? False Are 10759 and -9 nonequal? True Is -0.025 > -20870? True Are -1.14 and 0.2514 non-equal? True Which is bigger: -6 or -2796/439? -6 Is -2739 != 7/10? True Which is bigger: -15 or -4590? -15 Are 21998 and 21997 non-equal? True Which is greater: 1549400 or 1549401? 1549401 Is 237 bigger than 324? False Which is smaller: -0.6 or -4.277? -4.277 Which is smaller: -445 or -44860/101? -445 Is 3/328498 equal to -1? False Which is smaller: 14 or -17/315? -17/315 Is -124524 < -124523? True Are 6557 and 39347/6 equal? False Which is greater: -65694/25 or -2627? -2627 Is -0.21 >= 4496? False Which is bigger: -0.047 or 33491/6? 33491/6 Is 0.1 >= -8/88751? True Is -153866 equal to -153867? False Is -24026 > -24029? True Is -2 at least 1147246? False Which is greater: -0.11 or -1650/13? -0.11 Which is smaller: -8 or -20031? -20031 Which is bigger: 146048 or 146036? 146048 Is -46/73 > -1? True Which is smaller: -77453 or -77455? -77455 Is -369303 equal to -369302? False Which is smaller: 259065 or 1295322/5? 1295322/5 Is -171 <= -375? False Is 0 greater than 2/261623? False Which is bigger: 24281 or 315652/13? 24281 Do -24838/3 and -8278 have the same value? False Does 1421907 = 0? False Which is bigger: 0 or -90/64757? 0 Which is greater: -1110880 or -1110881? -1110880 Is -1 not equal to 8/72849? True Which is bigger: -7287 or -7295? -7287 Which is bigger: -440867 or 0.2? 0.2 Is -36009/43 greater than or equal to -836? False Is 746238/5 equal to 149247? False Is 11/5820 < 1? True Which is smaller: -47 or -143? -143 Is -139 at most as big as -35/6? True Are 12200766 and 12200765 nonequal? True Which is bigger: -5/626 or 1? 1 Is 1 greater than or equal to 119/1166? True Is -54986 less than -54988? False Which is smaller: 8 or 10131? 8 Are 6.6 and 18688 unequal? True Is -2 not equal to -249/137? True Is 6354 at least 57190/9? False Which is greater: -1 or -695.614? -1 Are 2/247961 and -1 unequal? True Is -3130 less than -34446/11? False Which is greater: 10.1 or 1674? 1674 Is 9118 greater than 8786? True Which is greater: 233/765 or -1? 233/765 Is 5724 >= 5718? True Which is bigger: 11115 or 1.26? 11115 Is 6/23 <= -61484? False Is -62 less than 196.83? True Is 743439 greater than or equal to 743439? True Which is bigger: -13/19536 or -1? -13/19536 Which is smaller: 607232 or 607241? 607232 Is -17315 at most as big as -17322? False Is 0.1 equal to -2944/7? False Is 25117 smaller than 25117? False Which is smaller: -0.05 or -0.0719? -0.0719 Is -1 at least -185/3432? False Is 20229 bigger than 7? True Is 5434/7 >= 776? True Are -145 and 0.0035 equal? False Which is smaller: -252036 or -252033? -252036 Is 310786 bigger than 0? True Is 120828 > 120828? False Which is smaller: 12586 or -0.7? -0.7 Which is smaller: 1349660 or 1349657? 1349657 Which is smaller: 20 or 76? 20 Which is greater: 18520 or -47? 18520 Is -2/19959 > -1? True Which is smaller: 0 or -34/3603? -34/3603 Is -349632/19 > -18402? True Which is smaller: -0.694 or 63.4? -0.694 Are -2281 and -330/23 non-equal? True Which is smaller: -2609 or -39142/15? -39142/15 Which is greater: 2 or 49/2? 49/2 Is 3/7 >= -509625? True Is 14804 at most as big as 14808? True Which is greater: 3685/2 or -11? 3685/2 Which is smaller: -4050/9599 or 1? -4050/9599 Which is smaller: 2517/1364 or 3? 2517/1364 Which is smaller: -75 or -5623/75? -75 Which is greater: 0.094 or -2066? 0.094 Is 633 at most as big as 238? False Is -3684 smaller than -3860? False Which is smaller: -1 or 18/13003? -1 Does 0.2346539 = 0.2? False Are -6484/1391 and -5 unequal? True Is -16.8 bigger t	{ "pile_set_name": "DM Mathematics" }
/(-12))/((-38)/(-18)))? 2, 19 Suppose -2q = -0q - v - 3, q - v = 3. Suppose -3b - k + 2k + 265 = q, -b - 4k + 110 = 0. What are the prime factors of b? 2, 3, 5 List the prime factors of 16/(-28)(-21)/(-6) + 700. 2, 349 Let w(t) = 8t2 + 1. Let s be 2/(-14) + (-242)/(-77). List the prime factors of w(s). 73 Let x(v) = -4v + v - 14 + 46v2 + 6 - v2. What are the prime factors of x(-2)? 2, 89 Suppose 3b + 5p - 1881 = 0, 6p - 10p + 1881 = 3b. What are the prime factors of b? 3, 11, 19 Suppose 2k = -16 - 42. Let w = -22 - k. Suppose -10 - 11 = -wl. What are the prime factors of l? 3 Let m = 2717 + -1320. List the prime factors of m. 11, 127 Let s be 2/6(-2 + -5 + 10). List the prime factors of 678/9(s/(-2) + 2). 113 Let b = -400 + 1434. List the prime factors of b. 2, 11, 47 Suppose -4 = -4u, -k + 0u + 131 = -2u. Suppose 22 = -3y + k. What are the prime factors of y? 37 Suppose -2r = -3r + 3. Suppose 450 = 5h + q - 220, rq + 555 = 4h. List the prime factors of h. 3, 5 Suppose 5y + 4u - 5908 = -1469, -3u + 4443 = 5y. What are the prime factors of y? 3, 11 Let v = -2 + -1. Let z be (v/(-1))/(12/512). Let h = z + -69. What are the prime factors of h? 59 Let w(z) be the third derivative of z6/120 + 2z*5/15 + 3z4/8 + z3/3 + 3z2. Let c be w(-6). Suppose c = 5p - 0p. List the prime factors of p. 2 Suppose 0j - 10 = -5j. Suppose -246 = -ji + 4l, i - 102 = -l + 21. List the prime factors of i. 3, 41 Let j = 10302 + -6221. List the prime factors of j. 7, 11, 53 Suppose 2y + 8 = -30. Let g(v) = v*3 + 21v*2 + 29v + 26. List the prime factors of g(y). 197 Let f be ((-10)/25)/(4/(-380)). Suppose fg - 40g = -12. What are the prime factors of g? 2, 3 Suppose -5g - 73 = -3t, 5t = 4t + 1. Let q be (-24)/g - (-8)/28. Let x = 5 + q. What are the prime factors of x? 7 Let p be ((-8)/(-24) + 4/(-6))-3. Suppose -2m - 6 = 3x, 0 = 3x - 3m + 4m + 6. List the prime factors of p1(18 + x). 2 Let t(j) = 15j - 19. What are the prime factors of t(29)? 2, 13 Suppose -2i + 4i = 352. Let n = i + -64. What are the prime factors of n? 2, 7 Let k be 9(-4 + (-76)/(-12)). Let w be ((-14)/k)/(4/6). Let r(a) = -46a - 1. List the prime factors of r(w). 3, 5 Let g(c) = -c2 - 12c - 8. Let s be g(-13). Let r = 12 + s. Let d = r + 45. List the prime factors of d. 2, 3 Suppose -7u + 12217 = -1797. What are the prime factors of u? 2, 7, 11, 13 Let i(s) = -s3 - 11s*2 + 7. Let w be i(-11). What are the prime factors of (-2)/4 - w/(42/(-267))? 2, 11 Suppose -9c - 1111 + 3604 = 0. What are the prime factors of c? 277 Let x(r) be the first derivative of r*3/3 - 7r*2 + 15r + 12. Let p be x(13). Suppose 0s = b - s - 55, 61 = b + ps. List the prime factors of b. 3, 19 Let i be (-26)/(-65) - (-96)/10. List the prime factors of -2(-3 + -5)i. 2, 5 Suppose -122742 = 37k - 64k. List the prime factors of k. 2, 2273 Let b = 113 + -175. List the prime factors of (b/(-3))/(5/15) + 2. 2 Let q = -63 - -123. Let n = 280 - q. List the prime factors of n. 2, 5, 11 Suppose -3 = -o + 2m - 4m, 0 = 5o + m - 24. Suppose 0 = -oh, -4w - 5h + 56 = -2h. Let y = w - 4. What are the prime factors of y? 2, 5 Let j(g) = -16g + 486. What are the prime factors of j(-28)? 2, 467 Let b be (-1)/((-2)/202). Let d = b - 3. Suppose -30 = -5z + z + dp, 0 = 2p + 6. What are the prime factors of z? 2, 3 Let x(b) be the first derivative of 31b3/3 + 3b*2/2 + 3b + 32. What are the prime factors of x(-2)? 11 Let a(d) = 13d2 - 3d - 1. Let v be a(-2). Suppose -vz = -55z - 530. List the prime factors of z. 5, 53 Let o(p) = 3p3 + 3p*2 + 12p + 16. What are the prime factors of o(6)? 2, 211 Suppose -5x = -9x + 12. Let o(f) = -x + 0f + f + 0f - 1. What are the prime factors of o(16)? 2, 3 Suppose 4x - 2576 = -4b, -4x - 323 = -b + 301. What are the prime factors of b? 2, 5 Let j(r) = r2 - 12r + 1. Let h be j(13). Let y = -39 + 24. Let v = h - y. What are the prime factors of v? 29 Let b = -141 + 49. Let x = 172 + b. What are the prime factors of x? 2, 5 Let h(r) = 6r - 3. Let o be h(4). Let s = -24 + o. What are the prime factors of s/(9/(-24)) - 1? 7 Suppose 4k - 9 + 3 = -o, -5o = -2k - 52. Suppose -5g + og = -45. What are the prime factors of 412/12 + 3/g? 2, 17 Let m = -19 + 21. Let r be (-8)/m + 6 - -3. Suppose rd - 96 = 34. What are the prime factors of d? 2, 13 Let r(x) = x3 + 9x2 - x - 1. Let h(k) = k3 - 2k2 - 7k - 5. Let t be h(-2). List the prime factors of r(t). 2, 13 List the prime factors of ((-4)/(-6))/((-8)/(-10606)). 2, 5, 53 Let d = -969 + 1430. List the prime factors of d. 461 Let u(l) = 2l - 8. Let y be u(6). Suppose -5r = yb + 25, 0 - 4 = -r + b. List the prime factors of 24 + 1 + (r - 0). 2, 3 Let n = 1301 + 744. What are the prime factors of n? 5, 409 Let p(v) be the second derivative of v4/3 - v3/2 - 4v2 + 7v - 1. Let c(w) = -2w - 7. Let d be c(-6). List the prime factors of p(d). 7, 11 Let k be 3 + ((-87)/4)/(2/72). List the prime factors of ((-48)/10)/(18/k). 2, 13 Suppose 62 = -b + 19. Let r = b + 108. List the prime factors of r. 5, 13 Suppose -3p + 5 = -7. List the prime factors of 262/p - (-2)/(-4). 5, 13 Suppose -6h + h + 392 = 4m, 0 = -5m + 5h + 490. Let n = -25 + m. List the prime factors of n. 73 Let c = -79 + 79. Suppose c = -3z - 3h + 4 - 1, -4h = -4z + 36. What are the prime factors of z? 5 Suppose -4f + 7f = 30. Suppose -4 = 3q - f. Suppose -qg = -5g + 69. What are the prime factors of g? 23 Let o(y) = 42y - 42. What are the prime factors of o(9)? 2, 3, 7 Suppose -3b - 3a = -0a - 15, 3a = 4b - 6. Suppose -73 - 107 = -bo. What are the prime factors of o? 2, 3, 5 Suppose -5t + 2t = -6. Suppose -b + 2b = t. Let i = b + 16. What are the prime factors of i? 2, 3 Suppose 0 = 9y - 4y - 5. Let h(l) = -3l*2 - 2l + 1. Let w be h(y). Let i(j) = 2j2 + 5j + 10. List the prime factors of i(w). 2, 11 Let u be 0/(-3)-1 + (0 - -66). Let l = 42 + u. List the prime factors of l. 2, 3 Let t = -999 + 1418. What are the prime factors of t? 419 Let c = -36 - 10. Let m = -114 + 211. Let w = m + c. What are the prime factors of w? 3, 17 Let r(j) = 15j - 29. Let m(x) = 14x - 29. Let p(b) = 7m(b) - 6r(b). List the prime factors of p(6). 19 Let x(u) = -u3 + 28u*2 + 29u + 11. What are the prime factors of x(29)? 11 Suppose 0 = 6a - 10a - p + 3112, 5p = 3a - 2311. What are the prime factors of a? 3, 7, 37 Let z be 6/(-1 - 6/(-9)). Let l be z/4234/27. Let g = -12 - l. List the prime factors of g. 3 Let w(h) = h2 - h + 12. Suppose -5l - b = -6b + 15, 1 = l - 3b. What are the prime factors of w(l)? 2, 3, 7 Let t = 3344 + -1215. List the prime factors of t. 2129 Let b = -11 - -19. Let o = 12 - b. Suppose 0 = -9u + ou + 80. What are the prime factors of u? 2 Let h be (3/(-3))/((-2)/6). Suppose 6t - 10 = t + 5o, 0 = ht + o - 26. Let x = t - 4. List the prime factors of x. 3 Let h = -14 - -12. List the prime factors of 2(-10)/(-1) + h. 2, 3 Let r(f) = -f*2 + 7f + 8. Suppose -7s = -9s + 14. What are the prime factors of r(s)? 2 Let j(w) = 17w2 - 2w - 1. Let b be j(2). Let g be b + 1 - 0/5. Suppose g = 2c - 3t - 2t, -3c + 96 = t. List the prime factors of c. 2 Suppose 3671 = 4d - 93. List the prime factors of d. 941 Let o(q) = q3 + 27q*2 + 51q + 45. List the prime factors of o(-24). 3, 61 Let j(t) be the first derivative of 8 + 1/2t2 + 19t. List the prime factors of j(-14). 5 Suppose 3p = p - 2q + 2732, -3q = -4p + 5471. List the prime factors of p. 1367 Let g(t) = 2t - 2. Let x be g(2). Suppose 3r - 51 = -5b + xb, -5b - 4r = -89. List the prime factors of b. 3, 7 Suppose 4 = 5g - 16. Let n be (1 - (0 + g)) + 11. Let m = n - -5. List the prime factors of m. 13 Suppose 3u = 4u + 2. What are the prime factors of (0 - (3 + u))-55? 5, 11 Suppose c - 3 = -2. What are the prime factors of (-1 + 2 - c) + (-1924)/(-26)? 2, 37 Let p = 96 - 92. Suppose 3s - 239 = -pr - 0r, -4s + 174 = 3r. List the prime factors of r. 2, 31 Let s be 7/(-21) - 1/((-9)/1146). Suppose 0a + m + s = a, -2a + m = -250. List the prime factors of a. 3, 41 Let q be (-1 + 1)2/(-3 - -7). List the prime factors of 0 + -1 + q	{ "pile_set_name": "DM Mathematics" }
positive. a(-466/11) Simplify i(10/9)/i(i(i*(11/2)i)/i)/ii(i(4/5))14 assuming i is positive. i(1603/90) Simplify (i/i13)*(-4/23)i(-11)/(i13/ii) assuming i is positive. i(-504/23) Simplify ((t(2/19)t(-2/11))(-49))(-34) assuming t is positive. t(-26656/209) Simplify (((x/(xx(2/67))x)/xxx)/(xx(5/2)/x))/(x(-4/3)x*(-6)x) assuming x is positive. x(2333/402) Simplify w(5/3)w(-22)(w/(ww(-1/29)))/w(-1/35) assuming w is positive. w(-61723/3045) Simplify ((yy(((y(-1/2)/y)/y)/y)/y)/yy/(y(y(-2/67)yy)/y))/(((y(-2/25)/y)/y)/yy/((y/(y*(-20)y))/y)) assuming y is positive. y(55643/3350) Simplify y/(((((y/y(3/2))/y)/y)/yyyy)/y)y*(2/45)y(yyy/(y/(((y/y21)/y)/y)))/(y/y(1/11)) assuming y is positive. y(-17191/990) Simplify (rrr((r/r6)/r)/r)32((r12/r)/r)35 assuming r is positive. r222 Simplify (p/(pp/((pp(-2/13))/p))p(-7))/((p(-9)p)/(((ppp/(p/(pp*(-1/3))p)pp)/p)/p)) assuming p is positive. p(59/39) Simplify (g/g(11/3))/(((ggg/g*(-16))/g)/g)((ggg*(-10/3)gg)/ggg)/g(1/10) assuming g is positive. g(-181/10) Simplify p(-2/21)p/((p*(-34)p)/p)p(-22)/(((pp*(-1/20))/pp)/p) assuming p is positive. p(5441/420) Simplify (h(2/11))*(6/11)h*(-11)/hh(h((hhh*(-2)hh)/hh)/h)/h assuming h is positive. h*(-1198/121) Simplify ((ss/s2)/(s(3/8)s))/(s15s(-6)) assuming s is positive. s(-83/8) Simplify ((r/r*6r)/(rr(-4/13)r))/(r*(13/5)r)7 assuming r is positive. r(-2008/65) Simplify (m(mm4)/m)29mm/((m*(2/21)/m)/m)mm/m16 assuming m is positive. m(2833/21) Simplify (((n/n(1/16))/n)/nnn)(-33)/(n18n/(nn(-1/4)n)) assuming n is positive. n*(-771/16) Simplify (jjjjj3j)(-19)/(j4/jj12) assuming j is positive. j(-167) Simplify (j/j(4/9))2((j/(j/(j*(9/4)j)))/jj)/j14 assuming j is positive. j(-347/36) Simplify v(-29)vv/(v/(vv*(-1/20)))(v(-14))(-1/4) assuming v is positive. v(-471/20) Simplify (c(-4/5))30/(c(2/19)/(c*18c)) assuming c is positive. c(-97/19) Simplify (k(4/9)/(kk(8/3)k))/((k/(kk/(((k(-4/7)/k)/kk)/k)kk)kkkk)/k(-3/5)) assuming k is positive. k(-1024/315) Simplify (l*1/llll(4/11))(-3/5) assuming l is positive. l(-78/55) Simplify (p21/(p/((p/p*(-1/3))/p)))/(ppp(2/31)p)(-49) assuming p is positive. p(15856/93) Simplify (s(-5/8)/s)36/(ss(-2)/ss/(s/s*(-1)s)s) assuming s is positive. s(-111/2) Simplify ((((a/(a/(a(a/(((a(((a(2/5)a)/a)/a)/a)/a)/a))/aa)a))/a)(-18))(-3/2))45 assuming a is positive. a3159 Simplify ((((gg/(g/(((g/(((gg*8)/g)/gg)g)/g)/g)g))/g)(8/5))(-35))(-6/13) assuming g is positive. g(-3024/13) Simplify (i*(-1/9)i)*(-37)(i/((ii0i)/i))/(i/(ii(2/73))) assuming i is positive. i(-21590/657) Simplify (z(-3))(5/3)(((z(zzz(2/23))/z)/z)/zz)/(z/z13) assuming z is positive. z(186/23) Simplify (n(-2)/(n/((n/(n/(n/(n(4/5)/nn)n)n))/nn))(nn(n(n/n*(-1)n)/nn)/nn)(-7/4))(30/7) assuming n is positive. n(-57) Simplify (b(-17)b)(5/6)/(b(2/13)b(12/5)) assuming b is positive. b(-3098/195) Simplify (((ww/(w(-2/17)w))/w*(-1/7))/(((ww(1/2))/w)/w)(-22))(-4/11) assuming w is positive. w(4636/1309) Simplify (y*(-4)y(2/3))/(y(2/7)/y13) assuming y is positive. y(197/21) Simplify ((m(-3))(20/7)/((m/(((m*7/m)/mmm)/mm))/(m/(m/(m*3m)))))(-2/27) assuming m is positive. m(-20/189) Simplify ((t/t(3/2))/((t/t31)/t))/(tt/t(-2/7)t)(2/11) assuming t is positive. t(4605/154) Simplify (w*(-24)www(1/8))/((w/w(-2/11))/ww)(-45) assuming w is positive. w(2755/88) Simplify ((m/m(-15)m)/mmm)(-1/5)/(m(-5/3)/(m/(m*9mm))) assuming m is positive. m(-179/15) Simplify (h/(h/(hh*(-1/5))))/((hh*9)/h)(h/(h/h*(-1/7))h)/hh(2/17)/h assuming h is positive. h(-5489/595) Simplify gg/g*4gggg(1/5)(g/g(-2/11))/g(3/4) assuming g is positive. g(359/220) Simplify (l(9/4))*(5/3)(lll*(3/11))/(ll(6/11)) assuming l is positive. l(197/44) Simplify (p/p19)(1/29)/(pp/(p/(p/p31))p34) assuming p is positive. p(-163/29) Simplify ((h*(1/3)/hh)*(-6)(h/(h*(2/29)h)h)/h9)(-1/22) assuming h is positive. h(146/319) Simplify ((u/(u/(u/u(3/14))))/u(2/11))/((u/((u(-3)u)/u))/u15) assuming u is positive. u(1787/154) Simplify ((g*10/g)/((g/(g/(gg(-6))))/g))(12/11) assuming g is positive. g*(180/11) Simplify k(k*13k)/kk(-2/5)(kkk(-3))(-13) assuming k is positive. k(133/5) Simplify (((q(-7)/q)/q)/qq/((q(5/3)q)/q)q(1/3)/(qq(1/8)))(8/13) assuming q is positive. q(-275/39) Simplify (k(-2)/(k*1/k)(k*(5/4)k)/k1)(-2/17) assuming k is positive. k*(3/34) Simplify ccc/(c/c(-9))cc30(c(-5))(-29) assuming c is positive. c169 Simplify (w(-16)/w(-16))/(w/(w(-5)w))37 assuming w is positive. w(-185) Simplify (c(-2))(-25)((c*(-1/18)c)/c)/(c/c(-9)) assuming c is positive. c(719/18) Simplify ((xx(2/7))(-42)x*(-5)/(xx((x4/x)/x)/x))(-29/2) assuming x is positive. x899 Simplify (v(-22)v*(2/11)v)/((v/(vv(-9/2)))/v(-9/4)) assuming v is positive. v(-1213/44) Simplify ((u/u(-18))/u)(8/3)(u*(-11/2)uu)29 assuming u is positive. u(-107/2) Simplify ((((n5/n)/n)/n)/n)/((n(-20)/n)/n)n*5(n/n(-3/5))/n assuming n is positive. n(143/5) Simplify (uu(-2/3)u)(-19)/(u(-9/8)u(-3/16)) assuming u is positive. u(-1153/48) Simplify ((n0)44/((n/(n/(n/n(-6)n)))/((n*(-3)n)/n)))(-30) assuming n is positive. n330 Simplify (nn(-11))(5/11)/(n(-6)/nn/(n*5n)) assuming n is positive. n(82/11) Simplify (((w/(w/w(2/25)))/w)/w(-45))(-1/8) assuming w is positive. w(-551/100) Simplify ((l3/l)(-36))(-35) assuming l is positive. l2520 Simplify ((a/(a(3/23)/a))/a(2/15))1 assuming a is positive. a(599/345) Simplify (b(-26)/b(-1/2))/(b(1/30)/(b/(b/(bb(2/13)bb)))) assuming b is positive. b(-4364/195) Simplify g/(gg*(-2/17))gg(gg/((g(2/29)/g)/g))/g(g/g*(-3))/((gg(3/8))/g) assuming g is positive. g(34209/3944) Simplify (gg(2/3))(-1/8)/((g/(g(-2/7)/g))/(g(-9)/g)) assuming g is positive. g(-2099/168) Simplify ((o13)(2/5))(-7) assuming o is positive. o(-182/5) Simplify ((l/((l/l(-7/6))/lll)l)/(l/(l((l/(l(-3/17)l))/l)/lll)))/(l(-15))(-34) assuming l is positive. l(-52121/102) Simplify (l(-2/9)/ll)(3/4)/(lll/((l/(l/(l/((l/l(2/5)l)/l))))/l))(-27) assuming l is positive. l(2911/30) Simplify (g/((gg(-19)gg)/g)g)/(gg(-1/2)g)g22gg20 assuming g is positive. g(121/2) Simplify (v(-10)/v(-7/2)v/((v/(vv(2/13))v)/vv)vvv/(v/(v/((vv0v)/v))))(-15) assuming v is positive. v(1695/26) Simplify (ddd*0d)*(-8/9)d*(4/11)d(-5) assuming d is positive. d(-241/33) Simplify (r/r6)/r(-9)r13/r(-13) assuming r is positive. r30 Simplify (g/(gg/(g/(((g/((gg/((g/g(-3))/g))/g))/g)/g))g))(-14/3)/(g/g(-4/19)g22) assuming g is positive. g(-791/57) Simplify (d(-12))(-2/75)/(d(15/8))12 assuming d is positive. d(-1109/50) Simplify (h/(hh/(h(-2/5)/h)))28/(h(-1/4))(-2/31) assuming h is positive. h(-20837/310) Simplify (b(2/49)/b)*(-5/4)(b/b*(-15))/(b/(b/(bb/(b*(-1/19)/b)))b) assuming b is positive. b*(48957/3724) Simplify (cc(-3/4))(1/3)(cc*(1/2))/(cc/c(-1/2)) assuming c is positive. c(-11/12) Simplify ((u/(u(4/7)/u))/u)/u(-1/3)u(-2/37)/u(-1/27) assuming u is positive. u(5209/6993) Simplify (m(m/(m/(m*(-2/5)/m)))/mm*(-8/5))/(mm*(-2/5)mm)26 assuming m is positive. m(-353/5) Simplify x(-18)x*(-25)((x/x(1/11))/x)(-29) assuming x is positive. x*(-444/11) Simplify (qq11)(-42/11)(qq(13/4))/(q(-24)q) assuming q is positive. q(-817/44) Simplify (c(2/5)/c)(-36)/(cc*26/cccc(-9)/c) assuming c is positive. c(18/5) Simplify ((b*(-1)b)/b*(1/14))/((bb(2/7)/b)/b)(-2) assuming b is positive. b(-3/2) Simplify ((i(-5/3)/i)/ii)(1/54)/(i8/(i/((i/(iii(2/33)iii)*i)/i)	{ "pile_set_name": "DM Mathematics" }
m - 2, 4m + 4 = 3n - 18. Suppose 5o - 5 = o - 5x, -nx + 9 = 3o. Suppose 4k - 3 + 11 = 4b, -ok - 6 = -4b. Does 4 divide b? True Suppose 5s = l - 63, 0l - 4s = -l + 62. Suppose 7g - l = -3p + 2g, 3g = -5p + 86. Does 8 divide p? True Let y(b) = 2b - 5. Let w be y(4). Suppose 0c - 195 = wc. Does 12 divide (2/5)/((-1)/c)? False Let f(y) = 7y - 9. Is f(7) a multiple of 8? True Let a(b) = 10b + 5. Does 25 divide a(7)? True Let f = -13 + 18. Let t = f + -1. Suppose 20 = tp - 4. Is 6 a factor of p? True Suppose -192 = -4v - 4v. Is 6 a factor of v? True Suppose q = 9q - 1232. Is 49 a factor of q? False Suppose 0 = c - 2c - 10. Is 9/(-15) - 246/c a multiple of 24? True Let g be 9(-2 + 46/6). Suppose 2c - g = -w, 3w = w - 2c + 108. Is w a multiple of 24? False Let c be 4 + 1 + 1 + -4. Suppose -cj = 5 - 19. Is 10/35 - (-19)/j a multiple of 2? False Suppose 5o + 4n = 30, 0 = -0o + 2o + 5n - 12. Does 13 divide 340/o - (-4)/12? False Suppose 0 = 5v + 25, -2h - 3h + 200 = v. Suppose 3y = 5a - 153, -2a - 2y = -a - h. Does 14 divide a? False Suppose 2t - 3r - 4 = 0, 2t + 2r - 4r - 4 = 0. Let z(k) = kt - k2 + 6 + 2k*2 + 6k - k*2. Is 10 a factor of z(-7)? False Suppose -4k - 10 = -3k + 3q, -4k + 4q + 24 = 0. Let n(d) = 2d2 - 2d + 1. Let b be n(k). Suppose 3 = 3w, bw = -3j - 0w + 53. Is 13 a factor of j? False Let k = -13 + 40. Is k a multiple of 8? False Let t = 134 + -69. Suppose -y - 39 = -5o, o + o - t = 3y. Let d = y - -31. Does 7 divide d? False Let n(x) = x*2 - 3x - 9. Does 4 divide n(7)? False Suppose -2w = -4i + 138 + 144, -5i + 352 = -3w. Does 37 divide i? False Let m be (-2082)/(-10) - (-1)/(-5). Let j be (-2)/4 + 3/6. Suppose j = -5g + m + 2. Does 20 divide g? False Let q(d) = 9d*2 + 3d. Let m be q(3). Suppose 3j - m = 5t, 0 = -j - 5t + 16 - 6. Is 13 a factor of j? False Suppose -4t = -5z + 6, 1 = -z + 4t - 1. Does 9 divide 1/((-1)/z) + 11? True Let s(a) = a*2 + 12a - 12. Let l be s(-13). Is l/(1/40) + -1 a multiple of 12? False Let s be 1/1 - (0 + -1). Suppose st + 3t + 4l = 591, l - 234 = -2t. Suppose -5n = -5y + t, 0 = -0y + 4y - 5n - 95. Does 10 divide y? True Suppose y - 1 = 2. Suppose 2z = -4k - 20 - 6, 5k + 16 = yz. Is 16 a factor of 80(z/5 - -1)? True Let g be ((-1)/(-2) - 2)-2. Suppose x - 2f = -4x + 52, gx + 2f = 44. Is 8 a factor of x? False Suppose 0 = -4j - u - u + 46, -3j = -u - 27. Is j a multiple of 2? True Suppose -n - 4 = -2z, -z + 23 = 5n - 1. Is 12 a factor of 1 + 1 - (-228)/n? False Let z(k) = -k2 + 11k + 13. Let t be z(12). Is t(24 - -1 - 3) a multiple of 15? False Suppose -2j + 28 = 3j - r, j = -2r - 1. Suppose 2g = -jb + 47, g + 5b + 1 - 22 = 0. Is g a multiple of 14? False Suppose -3s = -2x + 375, 4x + 195 = 5x + s. Is 32 a factor of x? True Suppose 16y = 14y + 440. Is 44 a factor of y? True Suppose -5v = 7v - 132. Is v a multiple of 2? False Let w(d) = d + 4. Let h be w(0). Let g = -3 - -7. Suppose -gz + hp + 71 = 11, 0 = -5p - 20. Is 11 a factor of z? True Let z = 10 - -2. Does 12 divide z? True Let t = 26 - 38. Is 12 a factor of (39/t)/((-1)/12)? False Suppose -5o + 4 = -1. Suppose -2v = 4p - v - 21, -v + o = 0. Suppose 4x - px + 22 = 0. Is x a multiple of 11? True Let g = -17 + 60. Suppose -z + g = -44. Is z a multiple of 29? True Let h = 8 - -6. Is 2 a factor of h? True Suppose 513 = 3b + 165. Suppose 0 = 4x - 21 + 1. Suppose h = xh - b. Does 16 divide h? False Is -9(-2 + 16/12) a multiple of 5? False Let i(s) = s3 - s - 1. Let v be i(2). Suppose 5d - 25 = vj, -3d - 3j = j - 22. Is d a multiple of 6? True Suppose 2p - 36 = 4f, -4p - 2f + f + 27 = 0. Is 4 a factor of p? True Does 5 divide 236/3 - (-28)/21? True Suppose 0 = 4p - 2k - 14, p - k + 0 = 1. Suppose 4n + h = 56, 0 = -2h - 2 - p. Is n a multiple of 7? False Let a = 24 - 12. Is 6 a factor of a? True Let g(a) = -a2 + 9a - 6. Let p(s) = s + 4. Let k be p(4). Let b be 0 - k/(-2)1. Is g(b) a multiple of 14? True Suppose 2s + 3 = 5c + 14, 5s + 4c = 11. Let h = 30 - s. Is 9 a factor of h? True Let d(n) = -5n*2 + 4n + 4. Let j be d(-8). Is ((-4)/6)/(8/j) a multiple of 14? False Let h(b) = -17b2 - 1. Let y be h(1). Let a = -9 - y. Is 7 a factor of a? False Let s = 6 - 30. Is (-750)/s + 2/(-8) a multiple of 9? False Let w = 192 - 48. Is w a multiple of 18? True Suppose t - 4 - 2 = 0. Let x(p) = -p - 10. Let n be x(-10). Let y = t + n. Does 3 divide y? True Suppose 5u + 3 = -3q, 4q - 4 = -0q - 4u. Suppose 3d - 10 = -q. Suppose -3y = 5n - 105, -3n = dn - 2y - 130. Is 20 a factor of n? False Let p(k) = -k. Let c(h) = -10h + 4. Let t(y) = -c(y) + 5p(y). Is 3 a factor of t(3)? False Suppose 11z - 294 = 4z. Is z a multiple of 9? False Suppose 0 = 5p - 2i - 472, -i = -5p - 0i + 471. Does 29 divide p? False Let w(p) = -5p3 + 3. Does 10 divide w(-2)? False Let s(y) = -y2 - 9y - 9. Let x be s(-7). Suppose 0j = -j + x. Suppose 2i - 68 = 4g, ji - 68 = -3g + 76. Is i a multiple of 15? True Let b(i) be the second derivative of -7i*3/6 - 11i*2/2 - i. Is b(-11) a multiple of 29? False Suppose -4b + a = -0b - 213, 20 = -4a. Is b a multiple of 24? False Let g(x) = 6x + 2. Let i(v) = -17v - 6. Let w(n) = n*2 + n + 3. Let r be w(0). Let z(c) = ri(c) + 8g(c). Is z(-3) a multiple of 7? True Let l be (0 - -14)/2 - 2. Suppose -lz + 0z = -190. Is z a multiple of 11? False Does 36 divide ((-822)/(-24))/((-2)/(-8))? False Let b(w) = 7w + 1. Let d(z) = -z - 1. Let h(a) = b(a) + 5d(a). Is h(7) a multiple of 8? False Let u = -21 - -28. Suppose 0 = 12m - um - 180. Is 6 a factor of m? True Suppose 0 = n + 4n - 135. Is n a multiple of 27? True Let a = 8 - 3. Does 5 divide a? True Let u be (6/(-4))/((-6)/(-40)). Is 7 a factor of (-84)/25/u? True Let g(x) = 6x - 8. Let a(w) = 6w - 8. Let q(r) = 6a(r) - 5g(r). Is 17 a factor of q(7)? True Does 7 divide (28/5)/(6/30)? True Let f = -2 + 17. Does 5 divide f? True Let h(d) = -d2 + 4d + 3. Let b be h(4). Suppose -bq + q = -76. Suppose 4y - 5c - 43 - q = 0, 52 = 3y + 5c. Does 15 divide y? False Suppose 63 = 3h - 90. Let q = h + 34. Suppose -3g + 8g = q. Is 11 a factor of g? False Let x = 121 - 85. Let n = 6 + x. Does 14 divide n? True Let q(x) = -52x + 4. Is q(-2) a multiple of 15? False Does 7 divide 252/(6 + -3 + 2)? False Let h(c) = -5c3 + 11c*2 - 4c - 10. Let f(n) = -n*3 + n - 1. Let i(d) = 6f(d) - h(d). Does 28 divide i(-12)? True Let s = -12 - -20. Is s - (3/(-1) - -1) a multiple of 3? False Let l be 2 - (-3)/(-1) - -1. Let t be -2 + 7/(l - -1). Suppose 25 = -ts + 100. Is s a multiple of 15? True Is 22 a factor of (6/3)/((-6)/(-99))? False Suppose -h + 3x - 216 = -6h, -2x + 46 = h. Is h a multiple of 41? False Let l = -148 - 1. Let a = -89 - l. Is a a multiple of 15? True Does 20 divide (-6)/4 + (-8)/(16/(-207))? False Suppose -5k + 6 = -4. Let i be 128/12 - k/3. Suppose -15 = -iw + 5w, -3u - 5w = -36. Does 3 divide u? False Suppose 3u + 123 = 378. Does 17 divide u? True Suppose 5u + 7h + 9 = 4h, -5u = 4h + 12. Let a = u + 21. Is 21 a factor of a? True Let m(b) = b3 + 7b*2 - b + 4. Let k = 39 - 56. Let i = k - -10. Does 6 divide m(i)? False Let j be 184/(-13) - 4/(-26). Let h = 8 - j. Suppose 2l + 3i - h = 0, -4l + 2i = l - 17. Is 5 a factor of l? True Suppose -4a + 538 = a + h, -4a + 422 = 5h. Is a a multiple of 11? False Let s(z) = -10 + 2z - z - 4z. Is 14 a factor of s(-13)? False Suppose -267 = -8s + 413. Does 15 divide s? False Let h be (0 + -4)(-27)/(-12). Let a = h - -19. Is 5 a factor of a? True Is 4/163622 a multiple of 14? False Let o be 3/((-3)/29) - 0. Let w = o + 65. Is 12 a factor of w? True Suppose 60 = -p + 3g, 0p + 4g - 110 = 2p. Let o = -31 - p. Suppose h - 3h = -o. Does 7 divide h? True Suppose -4n - 348 = -8n. Let z = n - 56. Does 21 divide z? False Let o(c) = c3 - 5c*2 - 3c - 1. Let j be o(4). Let g = -12 - j. Is 6 a factor of g - (2 - (-2 - -3))? False Suppose -5g - 6 = -2m, 8 = 2g - 4m + 4. Let v = 6 + g. Suppose -vt + 67 = -t + 5h, -2t + 2h = -18. Is t a multiple of 7? True Suppose 5q - 3 = -13. Let s = q + 2. Suppose s = 5o - u - 36, -	{ "pile_set_name": "DM Mathematics" }
11d2 + 30d + 26. Let p be s(-13). Is p smaller than -3? True Let d = 107212/77937 + -114/83. Which is smaller: 1 or d? d Let p = 96.03 + -96. Is 4 less than p? False Let l(f) = -f*3 - 34f*2 + 31f - 140. Let i be l(-35). Let c be 1/(-1010)-4-5. Which is smaller: i or c? c Suppose -4x + 91 - 643 = 0. Which is smaller: x or -137? x Let o = 194 + -193. Which is smaller: o or -2/157? -2/157 Suppose -5g = a - 17, 0a + 2g + 136 = 3a. Let v = 17 - a. Is v >= -24? False Suppose 4d = 12d. Let p be 2 + (78/(-40) - d). Which is bigger: p or 0? p Let n(j) = -j3 - 24j*2 - 66j + 21. Let y be n(-21). Which is bigger: y or 83? y Suppose 4w = -2f + 18, 0w = 5f - 3w + 20. Which is greater: 3/635 or f? 3/635 Suppose 2s - 4s + 10 = 0. Suppose 0 = -t + 2t - 1, -st = -5v + 55. Do v and 2/5 have the same value? False Let c be ((36/10)/1)/((-23)/(-460)). Are 72 and c nonequal? False Suppose 4 - 32 = 7a. Let c be (4/10)/(a/45). Let q(s) = s - 14. Let t be q(8). Which is greater: t or c? c Let h = 23 - 22. Let i be (-2)/5(2 + 3). Let y be i((-27)/(-6))/(-3). Which is bigger: h or y? y Let p = -18 + -54. Which is smaller: 2/7 or p? p Suppose 19s + 68 = 49. Let j be 1 - 3/((-12)/145). Let b = j + -37. Which is bigger: s or b? b Let j = -14 + 14.048. Let n = j - 4.048. Which is smaller: n or 0.8? n Let b = -710 - -708. Which is smaller: -399 or b? -399 Suppose 0 = -d + 5d - 200. Which is bigger: d or 51? 51 Suppose 0d - 10 = -5d. Suppose -2k = -5s - 0 - 3, -ds = -4k - 34. Let y be (-24)/(-11) - (-2)/k. Which is smaller: 2/5 or y? 2/5 Let d = 10031/11 - 913. Is d at most 2? True Let o = -9076/3 - -2983. Is -43 at most as big as o? True Suppose y - f = 7, -2f - 3f - 32 = -4y. Which is smaller: 72 or y? y Let m(w) = 3w + 2. Let g be m(-2). Let t be (12/(-10))/(g/20). Suppose 4 = h - 3h + 2p, -p + t = 3h. Is h smaller than 2? True Let j = -0.1 + 0.153. Let k = j - 0.053. Is 2 at most k? False Let p = 0.045 - 0.248. Which is smaller: p or -3? -3 Suppose 0 = -x + 1, -4m - 235x + 239x - 196 = 0. Do -287/6 and m have the same value? False Let g = 19.02 + -19.012. Which is bigger: 2/9 or g? 2/9 Let v(j) be the third derivative of j4/8 - 2j*3/3 - 6j*2. Let m be v(4). Let i be 12/m(-6)/(-9). Is i at most as big as 2/7? False Let m = -201 - -99. Let h = m + 507/5. Suppose -3t + 2i = 6, 3i - 8 = 58t - 54t. Which is smaller: t or h? t Let q be 0((-152)/24 - -6). Which is smaller: 4/69 or q? q Let c = -0.2 - 0. Let r = -0.2 - c. Let v = -116 - -115. Are r and v nonequal? True Let g = -543 - -921. Which is smaller: g or 1? 1 Let u = 137575/17 + -8089. Which is bigger: 5 or u? 5 Let z be 14/56 + (-6)/24. Let r be (-116)/5. Is z at least r? True Let n(y) = y*3 - 4y*2 + 9y - 10. Let q be n(2). Is 0.28 bigger than q? True Let o be 1182/(-78) + -1 + 6/39. Which is smaller: -21 or o? -21 Suppose 2g + k + 36 = 0, -3g - 3k = -5k + 68. Suppose 16f = -42 - 246. Are f and g non-equal? True Let k = 91 - 77. Let a be (-2 - 0)7/k82. Is a less than or equal to -82? True Let s be 3/(-1) + 547/176. Let i = 1/22 - s. Which is smaller: 0 or i? i Let m = -36 - -35.9. Let v = -24.013 - -0.013. Do v and m have different values? True Let g be (2/15)/(2/100). Let u = 1739 + -1733. Are u and g equal? False Let h(g) = g2 - 7g + 6. Let k be h(6). Let q(f) = -2f + 4. Let a be q(k). Suppose -y - 3p - 36 = 2y, 0 = 2y - ap. Is y >= -8? True Let k = -30 + 93. Let s = k - 76. Which is bigger: s or -1/6? -1/6 Let t be -1 + (3 - 1) + -2. Let z be (2t)/(-2)(-4 - -5). Is z bigger than -0.7? True Suppose -1 = o, 3o + 64 = x + 7o. Let l be -2 - 2/((-80)/x). Is 0 at least as big as l? True Let c(v) = -5v + 211. Let a be c(43). Do a and -170/31 have the same value? False Let o = -7 + 35. Do 142/5 and o have different values? True Let h(p) = -7p + 25. Let x be h(-4). Let s = 69 - x. Does 16 = s? True Let z be 6536/1940 + -4 - 18/(-30). Do z and 1 have the same value? False Suppose -4u + 82 = 2d, 3d + 2d = 5u + 220. Let s = d - 131/3. Let c(q) = 7q - 30. Let k be c(4). Are k and s equal? False Let a(y) = 3y - 105. Let b be a(38). Does b = 5? False Suppose -3z + 67 = 4w, 2z - 7 = 3w + 32. Suppose -z = 2p + 29. Is -26 <= p? True Let c be (-9)/52/6. Let t = 2.032 - 2.142. Which is smaller: c or t? c Let s = 52.4 - -8.6. Let q = -57 + s. Is q < -1/2? False Let n(i) be the third derivative of i4/24 + i3/6 - 3i2. Let y be n(4). Suppose 0 = 3c - 8c - 10, 2c = -2h - 2. Is h at most y? True Let v(p) = 2p*2 - 34p + 45. Let y be v(9). Does -100 = y? False Let m = 12.21 - 0.21. Let x = 0.1852 + -0.0852. Is x greater than m? False Let i be 2/520/8. Let q be 4/(-348)(i + 1 + 1). Is q less than or equal to 1? True Suppose -3j = 2r + 3r - 163, 3j + 12 = 0. Let o = r - 35. Are o and 15 nonequal? True Let f = -162 + 162.06. Is f less than 1/3? True Suppose 0l = l + 37. Let v = l - -38. Let n = 457 + -28789/63. Is v at most n? False Let s = 11 - 23. Let g be (45 - s/4) + -4. Suppose 0 = -2h + 7y - 3y - 32, 4h - 3y = -g. Is h <= -1? True Suppose -1705w = -1709w - 84. Suppose -21 = -2m + 3m. Is w bigger than m? False Suppose -5i + b + 3 = -2, 0 = 5i - 2b. Let u = 9313/30 - 925/3. Is u != i? True Let g be 18/4(-7332)/423. Is g < -155/2? True Suppose 0 = 4z + 4h - 16, 0z - 4h = -2z - 16. Let i be 106/(-360) + 98/392. Which is greater: z or i? z Suppose 3a - 5m + 5 = 0, m - 2 + 1 = 3a. Suppose 4g = 3g - 3y + 2, a = -4g + 3y - 7. Let n be (g/3)/((-6)/18). Is -1 equal to n? False Suppose -42 + 114 = q. Let w be 3/(-21) - q/280. Let g be 2/3 + 1/3. Which is bigger: g or w? g Let y = 30 + -33. Let h = 17 + -13. Let k = h + y. Is 1 greater than k? False Let t be (112/(-3))/(11374/(-66)). Let g = t - -24/47. Which is bigger: g or 2? 2 Let h = -1 + 6. Let g = 2186 + -2186.2. Is h equal to g? False Let k = -444 + 444. Is 3/434 greater than k? True Let o = 7607 + -1848493/243. Is o greater than 0? True Let c be -1(15 - (0 + -3)). Let k(q) = -9q + 45. Let w be k(7). Is c greater than or equal to w? True Let s = 67 + -58. Suppose 0 = -sj + 13j. Which is bigger: j or 1/59? 1/59 Let u(r) = -374r*2 - 8r - 20. Let b be u(-2). Is b equal to -1500? True Suppose -36 = 2g - 132. Let u(x) = 45 - g - 2x + 3x. Let v be u(0). Which is smaller: v or -4? -4 Suppose 3k - 15 = 0, 4k = -c + 4c - 19. Suppose cg + 30 = 11g. Which is smaller: g or -13? g Let k = 1 - -1. Suppose -4g - 12 = 0, g = ku - 3 - 0. Is u less than -1? False Let k = -3 - -3. Suppose -2o = -ko + 10. Suppose 0 = 3r + m + 2, 20 - 10 = 3r - 5m. Is o >= r? False Let f(y) = 2y*3 - 5y*2 + 4y - 3. Let z be f(3). Let l = 26 - z. Suppose l = t + 9. Is 0 smaller than t? False Let r = -0.028 - 0.072. Is 0.01 > r? True Let s = -752.7 - -753. Which is smaller: -81 or s? -81 Let x(w) = -11w - 171. Let a be x(-9). Is a > -77? True Let m be -2 + 0 + 4 - 0. Let g be 2/(m2/(-72)). Let t be 6/(-8)48/g. Which is greater: 4 or t? 4 Suppose s + 3s = 0. Suppose sn + n = 6. Is 5 at most as big as n? True Let y = 297.9 + -298. Which is greater: y or 43/2? 43/2 Let c(k) = -k + 3. Let d be c(3). Let q = -78827/55 + 8322/5. Let g = -231 + q. Is g greater than or equal to d? True Let l be -3(-6)/(-18) - 31. Is -34 > l? False Let o be ((-12)/4)/(-3) - -1. Suppose ow - 18 = 5z, -3 + 12 = w + 3z. Which is smaller: w or 11? w Let s be 2/6 - 48/(-18). Let n be (s/(-9))/(7/21). Which is smaller: n or -2? -2 Let z(n) = -n3 + 2n - 3. Let x be z(5). Are x and -119 nonequal? True Let z be -4 + (-1)/(8/(-34)). Suppose -3x = -2x. Suppose x = 2q - 0q. Do q and z have the same value? False Let l = 414 - 605. Is -191 greater than or equal to l? True Let u be (-14)/21 - 172/3. Let t = -984/17 - u. Is t greater than -1? True Let u(v) = -11v2 + 80v + 4. Let d be u(8). Is -0.01 bigger than d? True Let t be -36(1 - 2)/((-12)/8). Suppose 0 = -q + 4 - 0. Suppose 3z + qz = -168. Do t and z have the same value? True Let s = 0.83 + 7.07. Let z = s - 6.11. Let o = z - 1.9. Which is greater: 0 or o? 0 Suppose 5g - 21 = -4c, -5c + 6c + 16 = 3g. Do c and 21/55 have the same value? False Suppose 2r = 5j - 44, -4j + 4 = r - 26. Let x(d) = -d3 - 6d*2 - 5	{ "pile_set_name": "DM Mathematics" }
. -17 Let k(q) = -6q2 + 46q + 312. Calculate k(-8). -440 Let q(p) = -p*3 + 127p*2 + 2610p - 2. Determine q(-18). -2 Let r(t) = -52t + 879. Give r(16). 47 Let y(r) = r3 + 84r*2 - 355r + 13. Give y(4). 1 Let f(r) = -173r2 - 4824r + 561. Calculate f(-28). 1 Let a(m) = m*3 - 4m*2 + 8m - 27. Give a(4). 5 Let t(q) = 12q + 264. Determine t(-19). 36 Let g(t) = -3t*2 - 4t + 507. Calculate g(14). -137 Let i(g) = -2922g - 11619. Give i(-4). 69 Let a(g) = g2 + 191g + 2476. Give a(-14). -2 Let w(c) = -c*3 + 33c*2 - 112c - 2. What is w(4)? 14 Let d(z) = z*3 + 264z*2 + 15740z - 271. Determine d(-91). 2 Let b(f) = 10f3 + 29f*2 - 44f + 4. Calculate b(-4). 4 Let m(l) = 5l2 - 10214l - 20446. Calculate m(-2). 2 Let r(t) = 3t3 + 51t*2 - 64t - 181. Give r(-18). -1 Let b(l) = 65l - 1772. Calculate b(27). -17 Let h(q) = 27q + 388. What is h(-15)? -17 Let k(r) = -85r - 938. Calculate k(-11). -3 Let i(c) = 8c - 383. Give i(19). -231 Let i(y) = 4y3 - 5y*2 + 7y + 9. Determine i(4). 213 Let q(o) = 19o - 163. Determine q(9). 8 Let y(n) = -3n*2 - 272n + 37525. Determine y(-166). 9 Let a(g) = g*3 + 549g*2 + 1660g + 12013. Calculate a(-546). 1 Let q(t) = 142t - 104. Give q(4). 464 Let a(w) = w3 + w2 - 26w + 8. Give a(-6). -16 Let c(a) = -9a + 1014. Determine c(113). -3 Let y(v) = 46v*2 - 1483v + 340. Give y(32). -12 Let u(l) = l*2 - 579l - 5327. Give u(-9). -35 Let r(y) = y*2 + 94y - 3885. Calculate r(31). -10 Let s(t) = t*3 - 15t*2 + 17t + 111. Determine s(13). -6 Let m(v) = -v*2 - 53v - 602. Determine m(-17). 10 Let n(k) = k*2 - 5k - 17. Calculate n(19). 249 Let v(d) = -d*2 + 48d - 511. Calculate v(25). 64 Let f(k) = -k*3 - 2k*2 + 29k - 37. Calculate f(3). 5 Let j(s) = s*3 + 7s*2 - 8s + 34. Give j(-7). 90 Let c(h) = -2h2 + 8h - 18. What is c(8)? -82 Let w(d) = -179d + 681. Calculate w(4). -35 Let o(y) = -33y + 813. Determine o(24). 21 Let f(j) = 51j - 4798. Determine f(94). -4 Let u(t) = -2t*3 - 47t*2 - 12t + 245. What is u(-23)? -8 Let j(f) = 105f - 495. Give j(5). 30 Let d(w) = -1990w + 15916. Give d(8). -4 Let a(g) = -2g3 - 4g*2 + 427g + 1279. Calculate a(-3). 16 Let h(x) = -9x2 + 52x + 46. What is h(8)? -114 Let s(w) = -22w - 491. Determine s(-22). -7 Let a(w) = 5w - 328. Calculate a(50). -78 Let b(k) = -133k - 3730. Determine b(-28). -6 Let q(j) = 2j*3 + 39j*2 + 184j + 4. What is q(-9)? 49 Let s(p) = p*3 - 36p*2 - 11p + 390. Determine s(36). -6 Let o(d) = -15d + 345. What is o(25)? -30 Let o(h) = -2h*3 - 6h*2 + 33h + 71. Calculate o(-2). -3 Let q(l) = -3l2 + 262l + 733. Determine q(90). 13 Let k(a) = 2a3 + 65a*2 - 49a - 116. Give k(-33). 412 Let b(w) = 274w + 1632. Determine b(-6). -12 Let a(d) = -3d*3 - 52d*2 + 148d + 4. Determine a(3). -101 Let m(b) = 8b2 - 163b - 338. Determine m(-2). 20 Let a(c) = -563c + 1122. Determine a(2). -4 Let c(r) = -14r - 591. What is c(-43)? 11 Let g(m) = -126m - 639. Calculate g(-5). -9 Let u(r) = 6r*2 + 80r + 86. Give u(-12). -10 Let l(b) = -2b2 + 31b + 188. Determine l(-11). -395 Let s(m) = m3 + m2 - 11m - 4. Calculate s(-4). -8 Let h(z) = -2z + 218. Determine h(39). 140 Let r(v) = -19v - 269. Calculate r(-20). 111 Let i(u) = u3 - 75u*2 + 1323u + 476. What is i(46)? -30 Let x(z) = z*3 - 47z*2 - 152z + 103. Calculate x(50). 3 Let b(j) = -21j2 + 18j + 17. Determine b(-1). -22 Let v(m) = 62m - 2081. Determine v(34). 27 Let s(q) = 89q - 2667. Give s(30). 3 Let j(f) = 13f - 396. Calculate j(30). -6 Let y(j) = 65j - 298. Give y(4). -38 Let w(c) = -c*2 - 22c + 618. Calculate w(18). -102 Let g(p) = -9p - 27. Calculate g(17). -180 Let x(r) = r3 - 6r*2 - 10r + 65. Calculate x(5). -10 Let i(l) = -10l2 - 195l - 495. Calculate i(-3). 0 Let g(f) = -f*3 - 44f*2 - 461f + 33. What is g(-27)? 87 Let i(c) = 160c + 182. Calculate i(-1). 22 Let c(u) = 2u*3 - 10u*2 - 470u - 27. What is c(-13)? -1 Let p(s) = -16s3 - s2 - 21s - 28. Calculate p(-4). 1064 Let a(z) = 57z - 49. Give a(11). 578 Let a(g) = 20g + 4. Determine a(2). 44 Let v(x) = 90x - 3974. Determine v(44). -14 Let w(n) = 36n - 122. Calculate w(3). -14 Let j(o) = o*3 - 2o*2 - 54o + 53. What is j(8)? 5 Let g(o) = 28o + 424. What is g(-10)? 144 Let n(z) = 24z + 536. Calculate n(-25). -64 Let m(s) = 106s + 1481. Determine m(-14). -3 Let y(n) = 315n - 8190. What is y(26)? 0 Let c(q) = -2q3 - 7q*2 - 8q + 11. What is c(-4)? 59 Let c(l) = 5l3 - 316l*2 - 582l - 83. Calculate c(65). 112 Let g(u) = -358u + 2342. Give g(6). 194 Let u(k) = k3 - 16k*2 + 15k - 14. Give u(12). -410 Let g(p) = -p*3 - 33p*2 + 723p + 90. Calculate g(-48). -54 Let n(v) = -176v - 189. What is n(1)? -365 Let m(h) = 2h*2 + 46h - 102. Give m(-25). -2 Let j(g) = 1517g - 12134. What is j(8)? 2 Let t(g) = -58g - 263. Calculate t(-6). 85 Let a(o) = 830o + 15782. Give a(-19). 12 Let b(h) = h3 - h2 - 14h - 24. What is b(5)? 6 Let i(o) = -11o + 92. Determine i(9). -7 Let m(z) = -z2 - 52z - 495. What is m(-17)? 100 Let o(k) = -k*2 + 17k - 72. Give o(11). -6 Let a(v) = -39v2 + 239v + 8. Calculate a(6). 38 Let p(f) = -f*2 + 76f - 716. Calculate p(11). -1 Let z(h) = 195h + 1733. What is z(-9)? -22 Let f(n) = -27n - 105. Determine f(-6). 57 Let a(n) = 293n - 1187. Give a(4). -15 Let w(k) = 138k + 2077. Determine w(-15). 7 Let n(s) = -s*3 + 43s*2 + 47s - 151. Give n(44). -19 Let d(u) = 1617u + 4856. Calculate d(-3). 5 Let j(b) = -b3 + 26b*2 - 14b + 332. Determine j(26). -32 Let z(l) = 12l - 534. What is z(45)? 6 Let w(i) = -i3 + 6i*2 + 4i - 22. Calculate w(-3). 47 Let u(q) = -3q3 + 14q*2 + 66q - 2. What is u(-4)? 150 Let y(n) = n*3 + 25n*2 - 171n + 106. What is y(5)? 1 Let i(t) = 36t - 30. Give i(6). 186 Let i(l) = l2 + 158l - 1393. Give i(9). 110 Let i(m) = 2m2 - 57m - 4853. Calculate i(-37). -6 Let x(n) = 446n + 32995. Give x(-74). -9 Let b(a) = -a3 + 49a*2 - 52. What is b(49)? -52 Let z(p) = 3p*3 + 3p*2 + 7p + 8. Calculate z(-3). -67 Let g(n) = 323n + 123389. What is g(-382)? 3 Let t(k) = 242k + 4835. What is t(-20)? -5 Let v(a) = -7a2 + 257a + 52. What is v(37)? -22 Let k(s) = -3s3 + 40s*2 - 45s + 94. What is k(11)? 446 Let c(f) = -f*3 + 5f*2 - 12f + 18. Determine c(6). -90 Let l(k) = -35k - 356. What is l(-14)? 134 Let z(c) = -27c*2 + 4c - 4. Give z(-2). -120 Let s(o) = -122o2 - 4o - 2. Determine s(-1). -120 Let d(i) = 2i3 - 12i*2 - 3i + 54. Give d(9). 513 Let x(h) = -h*3 + 33h*2 + 14h - 95. Determine x(33). 367 Let c(m) = -m*2 + 219m + 6078. Calculate c(-25). -22 Let u(s) = -s*2 + 92s + 281. What is u(95)? -4 Let l(h) = -3h2 + 84h - 289. Determine l(24). -1 Let a(o) = 124o - 865. What is a(7)? 3 Let c(x) = -x3 + 16x*2 - 39x - 86. Determine c(13). -86 Let a(h) = 2h3 + 46h*2 + 26h - 127. Calculate a(-23). -725 Let b(k) = 568k - 17. Give b(0). -17 Let x(j) = -17j + 425. Determine x(11). 238 Let z(f) = -264f - 4772. What is z(-18)? -20 Let r(g) = -g2 + 313g + 2900. What is r(-9)? 2 Let q(n) = 6n3 + 4n*2 + 64n + 8. Calculate q(0). 8 Let x(t) = -2t3 - 11t*2 - 25t - 2. Determine x(-5). 98 Let x(o) = o*2 + 61o + 803. Calculate x(-39). -55 Let h(q) = 8q2 + 264q + 456. What is h(-31)? -40 Let s(c) = c*3 + 29c*2 - 223c - 4. Give s(7). 199 Let n(h) = -45h3 + 3h*2 - 2h - 10. Determine n(-2). 366 Let o(n) = -n*3 - 5n*2 + 19n + 50. Determine o(-5). -45 Let p(t) = -t*2 - 983t - 7769. Calculate p(-8). 31 Let z(o) = 180o2 + 2211o - 1678. What is z(-13)? -1 Let h(b) = 376b2 + 93b - 94. Calculate h(1). 375 Let q(i) = -26i - 442. Give q(-11). -156 Let h(b) = -b3 + 210b*2 - 1422b + 208. Give h(203). 5 Let z(k) = 2k2 + 97k - 941. Give z(-57). 28 Let d(y) = y*2 + 40y + 330. Determine d(-28). -6 Let d(y) = 43y - 225. Give d(6). 33 Let d(l) = -2l*2 + 47l + 210. Give d(-4). -10 Let v(a) = -547a + 548. Give v(1). 1 Let m(l) = 3l*2 - 161l + 260. What is m(52)? 0 Let w(d) = -2d2 - 22d + 68. Determine w(-13). 16 Let q(x) = 2x3 - 25x*2 + 2x - 619. Determine q(14). -3 Let p(x) = 2x2 - 8x - 37. Give p(11). 117 Le	{ "pile_set_name": "DM Mathematics" }
s in litres? 0.02976092 What is thirty-three fifths of a kilogram in grams? 6600 What is 1.041598 millilitres in litres? 0.001041598 Convert 9.962268l to millilitres. 9962.268 What is 4767.372mg in micrograms? 4767372 Convert 41760.39 days to nanoseconds. 3608097696000000000 What is 1185.691 millilitres in litres? 1.185691 How many meters are there in 1/10 of a kilometer? 100 What is 6/5 of a litre in millilitres? 1200 What is fourty-six fifths of a millimeter in micrometers? 9200 What is 5/4 of a microgram in nanograms? 1250 How many millilitres are there in 5.29785 litres? 5297.85 What is 79.891713 microseconds in hours? 0.0000000221921425 What is three fifths of a decade in years? 6 How many millimeters are there in 66.82418cm? 668.2418 Convert 3287.956t to kilograms. 3287956 How many millimeters are there in eleven halves of a centimeter? 55 How many grams are there in 935281.5 nanograms? 0.0009352815 How many nanometers are there in 864.1629 meters? 864162900000 What is 85.40876t in nanograms? 85408760000000000 What is twenty-nine fifths of a century in years? 580 What is 8.72679 months in millennia? 0.0007272325 How many months are there in 0.6035552 years? 7.2426624 What is thirty-seven halves of a decade in months? 2220 How many nanoseconds are there in 2.604401 milliseconds? 2604401 What is 4/7 of a week in days? 4 What is 420658.9ns in milliseconds? 0.4206589 How many litres are there in 316.9325ml? 0.3169325 What is 86.25098 tonnes in grams? 86250980 Convert 31208.57 minutes to milliseconds. 1872514200 How many months are there in 1/6 of a decade? 20 What is 0.3851707 weeks in nanoseconds? 232951239360000 How many micrometers are there in 55/4 of a millimeter? 13750 What is 782434.4ng in micrograms? 782.4344 What is 8.68732 centuries in years? 868.732 Convert 286961.5ug to grams. 0.2869615 What is 1/10 of a minute in seconds? 6 What is 59/4 of a milligram in micrograms? 14750 What is 0.6989899 millennia in years? 698.9899 What is 41.049001 days in weeks? 5.864143 How many days are there in 24042538.8ms? 0.278270125 How many minutes are there in 7/15 of a week? 4704 Convert 17606788.29 nanoseconds to weeks. 0.000000029111753125 What is 165.2525 nanoseconds in microseconds? 0.1652525 Convert 16.955034 months to decades. 0.14129195 Convert 0.0367649kg to micrograms. 36764900 What is five eighths of a litre in millilitres? 625 What is 0.3550853 nanometers in millimeters? 0.0000003550853 Convert 9.15616ml to litres. 0.00915616 What is 39424.99 nanograms in grams? 0.00003942499 What is 7/2 of a litre in millilitres? 3500 What is 55/4 of a kilometer in meters? 13750 What is 26/5 of a century in months? 6240 How many microseconds are there in 3/5 of a millisecond? 600 How many centimeters are there in three fifths of a kilometer? 60000 How many seconds are there in 1.561218 minutes? 93.67308 Convert 359.4475 meters to micrometers. 359447500 How many years are there in three fifths of a decade? 6 Convert 2923050.6 minutes to hours. 48717.51 What is 31/2 of a hour in minutes? 930 Convert 5.9963139s to days. 0.00006940178125 How many years are there in thirty-four fifths of a century? 680 How many hours are there in fifteen quarters of a week? 630 Convert 1051476.66ms to days. 0.01216986875 Convert 426695.3l to millilitres. 426695300 How many years are there in 9.253526 millennia? 9253.526 Convert 2259.11 micrograms to tonnes. 0.00000000225911 What is 2208.939 seconds in minutes? 36.81565 What is 8.9437797us in days? 0.00000000010351596875 How many decades are there in 11/2 of a millennium? 550 How many months are there in 21/8 of a century? 3150 What is 6.694279 millilitres in litres? 0.006694279 Convert 155.1657nm to millimeters. 0.0001551657 What is twenty-five halves of a kilometer in meters? 12500 Convert 76271.98kg to grams. 76271980 How many minutes are there in sixty-four thirds of a day? 30720 What is 7/2 of a litre in millilitres? 3500 Convert 60.11584nm to centimeters. 0.000006011584 How many litres are there in 2905.094 millilitres? 2.905094 Convert 9.808054 hours to milliseconds. 35308994.4 How many hours are there in thirteen quarters of a week? 546 What is eleven halves of a millimeter in micrometers? 5500 Convert 85052.42g to kilograms. 85.05242 How many millilitres are there in 307084.9 litres? 307084900 How many weeks are there in 14982292.71 seconds? 24.772309375 Convert 0.543505 millilitres to litres. 0.000543505 How many months are there in 5/4 of a year? 15 What is 64.171 micrometers in kilometers? 0.000000064171 Convert 54675.67 millimeters to centimeters. 5467.567 How many microseconds are there in 85471.52 minutes? 5128291200000 How many millilitres are there in 6/5 of a litre? 1200 Convert 3294.06 millilitres to litres. 3.29406 How many nanometers are there in 7/4 of a micrometer? 1750 How many hours are there in 8722887.3ns? 0.00000242302425 What is 17.01757g in tonnes? 0.00001701757 How many micrometers are there in 0.3034844 millimeters? 303.4844 What is 91049.91 nanograms in tonnes? 0.00000000009104991 What is seven quarters of a millisecond in microseconds? 1750 How many months are there in one fifth of a millennium? 2400 What is ten sevenths of a week in minutes? 14400 What is 6/5 of a meter in millimeters? 1200 What is one quarter of a kilometer in meters? 250 What is 9/10 of a hour in seconds? 3240 Convert 9577.143g to tonnes. 0.009577143 How many grams are there in 1/10 of a kilogram? 100 What is twenty-seven quarters of a microgram in nanograms? 6750 Convert 6.858398t to nanograms. 6858398000000000 How many years are there in 3/10 of a decade? 3 What is fifty-three fifths of a micrometer in nanometers? 10600 How many millilitres are there in 8/25 of a litre? 320 How many meters are there in 67/5 of a kilometer? 13400 How many nanograms are there in 8.8228 tonnes? 8822800000000000 What is 3/8 of a litre in millilitres? 375 What is 893148.6 millennia in decades? 89314860 What is 5/4 of a litre in millilitres? 1250 What is 897414.4 decades in centuries? 89741.44 What is 64/5 of a microsecond in nanoseconds? 12800 What is one twentieth of a litre in millilitres? 50 How many millilitres are there in 3/25 of a litre? 120 How many meters are there in 51/8 of a kilometer? 6375 How many nanometers are there in 5/4 of a micrometer? 1250 How many months are there in 0.3520712 years? 4.2248544 What is 2818.487 weeks in minutes? 28410348.96 What is one quarter of a litre in millilitres? 250 How many minutes are there in 7/8 of a day? 1260 How many milligrams are there in 791.5897 nanograms? 0.0007915897 What is 25/2 of a litre in millilitres? 12500 What is thirteen quarters of a millennium in months? 39000 How many meters are there in twenty-one quarters of a kilometer? 5250 How many millilitres are there in 18/5 of a litre? 3600 How many nanoseconds are there in five eighths of a microsecond? 625 How many weeks are there in 1010.05569 microseconds? 0.000000001670065625 How many micrometers are there in 14.30278 nanometers? 0.01430278 What is one fifth of a litre in millilitres? 200 What is 192662.1nm in kilometers? 0.0000001926621 Convert 317.426nm to meters. 0.000000317426 What is 12.9728 decades in months? 1556.736 How many seconds are there in 4/3 of a hour? 4800 What is 31/2 of a century in decades? 155 Convert 0.5217195 litres to millilitres. 521.7195 What is 17/10 of a hour in minutes? 102 What is fourty-five halves of a meter in centimeters? 2250 Convert 2.1774648 months to millennia. 0.0001814554 What is 0.9535352l in millilitres? 953.5352 How many centimeters are there in 0.0284767nm? 0.00000000284767 Convert 506285.8 decades to millennia. 5062.858 How many kilograms are there in 21/2 of a tonne? 10500 What is 3/32 of a milligram in nanograms? 93750 What is nineteen ninths of a hour in seconds? 7600 How many decades are there in fifty-seven fifths of a millennium? 1140 What is 2088.015 months in millennia? 0.17400125 What is 0.7051207um in kilometers? 0.0000000007051207 Convert 3.771028 seconds to milliseconds. 3771.028 How many micrometers are there in 8459.302 millimeters? 8459302 How many years are there in twenty-one halves of a millennium? 10500 How many months are there in nineteen quarters of a year	{ "pile_set_name": "DM Mathematics" }
Let n = 49 - 42. Let m = n - 6. What is the nearest to 2/5 in 4, m, 1/10? 1/10 Suppose 0 = 4t - 16, 0 = 2j + 26t - 28t + 6. What is the closest to 0.1 in 29/3, -0.4, j? -0.4 Let n = -4.17 + 12.17. What is the nearest to 0.1 in 2, n, -1/2? -1/2 Let l = 0.0331 - 0.1031. What is the nearest to l in 5, 3, 4, 1/7? 1/7 Suppose -5p - 36 = 4x, -2x - x - 16 = p. What is the closest to 0.1 in -5, p, 1/2? 1/2 Let c be (10/14)/((-110)/(-44)). What is the closest to c in -1/7, -1/12, -4, -3? -1/12 Let t = 11179 + -11131. Let k be 22/(-10) - -1 - -1. What is the nearest to -0.1 in -2, t, k? k Let a = -472 + 471.9. What is the closest to a in -0.3, 35, 1, -4? -0.3 Let h = 7079/3 + -2358. What is the closest to 5 in -2/7, h, 2? 2 Let w = 289.9 + -292. Which is the closest to 2/9? (a) w (b) 2 (c) -1 c Let w(h) = -3h*2 - 201h - 201. Let t be w(-66). What is the closest to -3 in 0, t, 0.1? t Suppose 621 = 8w + 645. Let o = 0.15 - 0.12. Which is the nearest to 0? (a) 3/2 (b) w (c) o c Let l = -0.471 + 0.971. What is the closest to -1 in -3/4, l, -13, 2/11? -3/4 Let t = -7 + 11. Let q = 17 - 17.4. Let y = 0.76 - 0.76. Which is the closest to y? (a) -0.1 (b) t (c) q a Let i be -2 + 4 - 44/10. Let l = -515 + 2586/5. Let p = i + l. Which is the closest to p? (a) -2 (b) -1/2 (c) -1 b Suppose -3l - 37 - 185 = 0. Let s = 71 + l. What is the closest to 2/7 in -2/15, s, 0.2? 0.2 Let h = 143 + -147. Which is the nearest to 1? (a) h (b) -3/5 (c) 2/83 c Let u = -32 + 34.8. Let h = -3 + u. Let f be 2/(-4)(-52 + 52). What is the nearest to 0 in h, 8, f? f Let u = -50 + 68.6. Let y = 14.6 - u. Which is the closest to -2/5? (a) 0 (b) 2.8 (c) y a Let o be 10/105 - (-8)/42. Let h be (-5 - -3)2/18. What is the nearest to h in -4, o, 0.2? 0.2 Let j be (6/28)/(1/2). Which is the closest to 0? (a) j (b) -0.5 (c) 3 (d) 9 a Let w = 65.2 + -65. Let g be ((-2)/(-6))/(4/48). Suppose 16 = 4s + 4k, -s = s + gk - 8. Which is the nearest to 1? (a) w (b) 1 (c) s b Let n = -111.7 + 112. Which is the nearest to 3? (a) 0.2 (b) -9 (c) n c Let p(i) = -i2 + 10i - 11. Let z be p(8). Let w = -192431/51 - -3773. Let k = w - 3/17. Which is the closest to 0? (a) z (b) 2 (c) k c Let u = -135/4 - -34. Let m be ((-1)/(-2 + 0))/((-10)/15). What is the closest to -2/5 in u, 1, m? m Let h = 4.042 + -0.042. Which is the nearest to -1/2? (a) 0 (b) 1 (c) h a Let p = -1.3 + 10.3. Let j = 5 - p. Let q = 0 - -0.2. Which is the closest to 0? (a) 1 (b) q (c) j b Let o = -46.1 - 16.4. Let i = o - -62. What is the closest to 1 in 0, i, -3? 0 Suppose -9 = 4g - v, 4v + 4 = -3g + 2. Let f = 8.3 - 6.3. Which is the nearest to -1/4? (a) g (b) 1/2 (c) f b Let q = -0.01 + 4.31. Let v = q + -4.5. What is the closest to 0 in 2, 7, v? v Let y = 0.1 - 0.3. Let t(g) = 7g. Let s be t(-2). Let i = 12 + s. Which is the nearest to i? (a) y (b) 0.3 (c) -3/7 c Let u = -3880/7 - -554. Which is the closest to 6? (a) u (b) -2 (c) 4 c Let w be (-6)/22 - 1/(-2). Let i = -17599/44 - -400. Let j = w + i. Which is the nearest to j? (a) 4 (b) 5 (c) -0.4 c Let m(y) = 37y + 53. Let u be m(-3). Which is the nearest to 0.1? (a) -2/3 (b) -0.2 (c) u b Let g = -2.1 - -2. Let t = 5379/4 + -1345. Which is the nearest to g? (a) 6 (b) -0.3 (c) t c Let c = 15 - 14. Let j be ((-3)/(-3) - c)8/16. What is the closest to 1 in j, -2, 0.5? 0.5 Let n = 40 - 39. Let z = -0.35 + -0.05. Let f = -0.18 - -0.38. Which is the nearest to n? (a) f (b) z (c) -3/5 a Suppose -3 = 3k, 15g = 10g + 2k + 17. Which is the closest to 0.4? (a) 58 (b) g (c) -0.5 (d) 1/2 d Let o = 15.071 - 15.6. Let f = 0.129 + o. What is the nearest to -1/4 in f, -2/7, 0.5? -2/7 Let x = 17 + -16.9. Let i = 1 - 0.8. Let h = x + i. Which is the closest to 0.1? (a) h (b) 1 (c) -0.2 a Let h = -7 - -4. Let x = -2.4 - -1.9. Let v = -2/231 - -472/1155. What is the closest to v in x, 0.3, h? 0.3 Let l = 100.9 + -101. What is the closest to l in 0.2, -1/2, -5/4? 0.2 Let w = 210 + -214. Which is the closest to 2? (a) w (b) -1 (c) -5 b Let f = -0.0394 - 4.9606. What is the nearest to f in 0, -0.1, -3? -3 Suppose -8 = -u - 2a - 11, -u = a + 4. What is the nearest to 3/7 in 0, u, 2? 0 Let x = -33/2 - -17. Let z = -17 + 10. Let f = -7 - z. What is the nearest to 0 in f, 0.1, x? f Let f = 16 - 19. Let g be 0 + 5/(1 + 24). What is the nearest to g in f, -1, 1/4? 1/4 Let c be (-84)/(-39) - (-1 - -3). Let o = -2692 + 2690. What is the nearest to o in 2, 4, c? c Let m = -0.7 - -0.3. Let p = 0 + -0.2. Let r = 19/349 - -273/1396. Which is the closest to 0? (a) p (b) r (c) m a Let c = -15 + 5. Let b = -10 + 22. Let y = b + c. What is the closest to 2/5 in 0.2, 4, y? 0.2 Let z = -0.7 - -0.2. Let v = 0.097 + 0.103. What is the nearest to 0 in z, v, 1/9? 1/9 Let s = -194 - -191. Let u = 1.1 + -0.3. Let f = 0.3 - u. Which is the closest to -2/5? (a) 0.4 (b) f (c) s b Let z = -304 + 1217/4. Which is the closest to -7? (a) -0.4 (b) z (c) -1 (d) 1 c Let r = -419 - -297. Let i = r + 120.18. Let l = -0.18 + i. What is the closest to 1 in l, -1/2, -5? -1/2 Let r = 55 - 43.9. Let i = r + -11. Let q = -0.3 - -0.2. Which is the closest to q? (a) 1 (b) 3 (c) i c Let z = -0.3 - -0.5. Let v = -563 - -607.3. Let y = 44 - v. Which is the closest to 1? (a) z (b) 0.5 (c) y b Let j be 4/(-5) + (-567)/(-540). Let a(b) = b3 - 4b*2 + 2b + 4. Let f be a(3). What is the nearest to f in -0.2, -0.3, j? j Let s = 314.1 - 314. Which is the closest to s? (a) 2/5 (b) -63 (c) -4 a Suppose 281 = 5g - 2d, 2d = 4g - 3d - 218. Let u = -59 + g. Which is the nearest to -0.1? (a) u (b) 3 (c) 0.2 c Let u = -3.449 + -0.551. Which is the closest to 1/15? (a) 2 (b) 2/17 (c) u (d) -5 b Let s(x) = 2x*2 - 3 + 4x + 0x2 + 6 - 1. Let q be s(-2). Let i = 11 + -6. Which is the closest to q? (a) -0.2 (b) i (c) 3 c Let q be (-32)/(-20) - (-1 + 2). Let i = -26 - -29. Which is the closest to -1? (a) 4 (b) i (c) q c Suppose 4r - 15 = 23f - 22f, 0 = 2r - 6. What is the closest to -1 in 2.9, f, 4? f Let a(b) = -2 - 4b*2 + 3b*2 + 0b*2 + b + 6b. Let g be a(7). Let u be (-60)/68 - 2/g. What is the nearest to -0.1 in -3, u, 0.3? u Let s = 3/727 - 5179/21810. Let m = -1/6 + s. What is the closest to m in 3, -5, 0.2? 0.2 Let t = -328 - -327.7. What is the closest to 1 in 5, 0.2, 2, t? 0.2 Let w = -229 - -239.7. Let n = w - 11. Let v = -29 - -117/4. What is the closest to v in 9, 2/5, n? 2/5 Let h = -29 - -143/5. Let s = -216 - -221. Which is the closest to -2? (a) -1/2 (b) s (c) h a Let u be 8/20 + (-4)/10. Let j = 16.32 + -16. Let n = j + -0.22. Which is the nearest to 0? (a) n (b) u (c) 5 b Let u = 0.54 - 0.14. Let o = -395 + 2377/6. Let h = -37/42 + o. Which is the closest to 0? (a) 2 (b) u (c) h c Let j = -1902 + 1895. Which is the closest to -1? (a) j (b) 0.06 (c) 3/4 (d) 0.2 b Let p = 0.9 + 0.1. Let k(a) = -a + 1. Let v be k(5). Let y be -30(-8)/(-64)(-2)/(-5). What is the closest to p in v, 0.2, y? 0.2 Let o be 2/3 - 16/24. Suppose -3i + 15 = -8i, 0 = d + 4i + 8. Which is the nearest to o? (a) 2 (b) d (c) 1/2 c Let o = -483 - -483.4. Let c = 12 - 82/7. What is the nearest to 0 in o, c, 9? c Let g = 0.005 - -0.195. Which is the closest to 0? (a) -0.117 (b) g (c) 1/2 (d) -4 a Let x = -63 + 22.5. Let n = -41 - x. Let q = 110/3 - 36. Which is the nearest to 0.2? (a) q (b) -2/11 (c) n b Let x = 3/200 - 427/1800. What is the nearest to 0.1 in -2/7, 0, 4, x? 0 Let v = 1.4 - -12.6. Let l = v - 16. Let m = 2 - 2.4. What is the closest to -2/9 in 0.1, m, l? m Let z be -4 - 16(2 + -3). Let n be 3(-1)/(z/16). What is the nearest to 0.1 in n, -1/7, 1? -1/7 Suppose -76 = 5s - 3m, 24 = -s - 4m + 9m. Let g = 0 - 5. What is the nearest to 1 in 2/11, g, s? 2/11 Let h be (-8)/(-10)(-15)/2. Let x = -385 + 383. What is the nearest to 0.1 in x, -0.1, h? -0.1 Suppose 10 = 2r + 4q, 3r + 20 = -0q + q. Let c(o) = 4*o - 68. Let s be c(17). What is the closest to s in 0.05, r, -4/9? 0.05 Let f = 628 - 629. Which is the nearest to 0.09? (a) 5 (b) f (c) -2/9 c Let v(w) = -w - 9. Let y be v(-4). Let o be (42/10 - 3) + (-343)/140. Which is the closest to 0.06? (a) o (b) -3 (c) y a Let v be (-3)/1 - (-122)/4	{ "pile_set_name": "DM Mathematics" }
by 12. 0 Calculate the remainder when 2718 is divided by 562. 470 What is the remainder when 29756 is divided by 2973? 26 What is the remainder when 73211 is divided by 71? 10 Calculate the remainder when 37547 is divided by 1126. 389 Calculate the remainder when 1321 is divided by 608. 105 Calculate the remainder when 412603 is divided by 24270. 13 Calculate the remainder when 76223 is divided by 38052. 119 What is the remainder when 1045720 is divided by 73? 68 What is the remainder when 1918 is divided by 13? 7 Calculate the remainder when 3404 is divided by 576. 524 What is the remainder when 78122 is divided by 19528? 10 What is the remainder when 22381 is divided by 36? 25 What is the remainder when 31026 is divided by 3102? 6 What is the remainder when 71971 is divided by 23981? 28 What is the remainder when 7409 is divided by 415? 354 Calculate the remainder when 89455 is divided by 105. 100 What is the remainder when 1197489 is divided by 399159? 12 What is the remainder when 20091 is divided by 5? 1 Calculate the remainder when 160702 is divided by 288. 286 What is the remainder when 46234 is divided by 282? 268 What is the remainder when 417987 is divided by 26124? 3 Calculate the remainder when 16152 is divided by 82. 80 What is the remainder when 86634 is divided by 285? 279 What is the remainder when 4123 is divided by 260? 223 What is the remainder when 36791 is divided by 36771? 20 What is the remainder when 3266 is divided by 482? 374 What is the remainder when 38191 is divided by 28? 27 Calculate the remainder when 13568 is divided by 75. 68 What is the remainder when 5190 is divided by 1037? 5 What is the remainder when 8975 is divided by 4438? 99 What is the remainder when 23166 is divided by 421? 11 What is the remainder when 24519 is divided by 481? 469 What is the remainder when 14079 is divided by 158? 17 What is the remainder when 51750 is divided by 227? 221 What is the remainder when 19482 is divided by 9? 6 What is the remainder when 17415369 is divided by 230? 229 Calculate the remainder when 1625 is divided by 449. 278 Calculate the remainder when 2402 is divided by 1125. 152 What is the remainder when 6301 is divided by 887? 92 Calculate the remainder when 4306 is divided by 34. 22 What is the remainder when 36963 is divided by 61? 58 What is the remainder when 578 is divided by 103? 63 What is the remainder when 1359 is divided by 667? 25 What is the remainder when 38951 is divided by 12? 11 What is the remainder when 527631 is divided by 271? 265 What is the remainder when 6834 is divided by 175? 9 Calculate the remainder when 12995 is divided by 1084. 1071 Calculate the remainder when 161966 is divided by 218. 210 What is the remainder when 24765 is divided by 1128? 1077 What is the remainder when 121305 is divided by 206? 177 What is the remainder when 191678 is divided by 69? 65 What is the remainder when 261273 is divided by 91? 12 Calculate the remainder when 944107 is divided by 190. 187 What is the remainder when 182416 is divided by 186? 136 What is the remainder when 109697 is divided by 19? 10 What is the remainder when 6161 is divided by 6155? 6 What is the remainder when 3820 is divided by 1026? 742 Calculate the remainder when 17276 is divided by 128. 124 Calculate the remainder when 18571 is divided by 278. 223 Calculate the remainder when 1821 is divided by 101. 3 What is the remainder when 5399 is divided by 1053? 134 Calculate the remainder when 145963 is divided by 14. 13 Calculate the remainder when 36211 is divided by 36. 31 Calculate the remainder when 323418 is divided by 2060. 2058 What is the remainder when 336716 is divided by 168354? 8 Calculate the remainder when 253297 is divided by 85. 82 What is the remainder when 554 is divided by 197? 160 Calculate the remainder when 3491 is divided by 313. 48 What is the remainder when 82726 is divided by 173? 32 Calculate the remainder when 260886 is divided by 100. 86 What is the remainder when 221 is divided by 17? 0 What is the remainder when 2549 is divided by 421? 23 What is the remainder when 1847 is divided by 546? 209 What is the remainder when 131053 is divided by 131052? 1 Calculate the remainder when 2481 is divided by 277. 265 What is the remainder when 66974 is divided by 279? 14 Calculate the remainder when 47543 is divided by 634. 627 What is the remainder when 1109700 is divided by 184? 180 Calculate the remainder when 3925 is divided by 48. 37 What is the remainder when 25800 is divided by 1702? 270 Calculate the remainder when 131830 is divided by 37. 36 Calculate the remainder when 83492 is divided by 1992. 1820 Calculate the remainder when 9923 is divided by 24. 11 What is the remainder when 18551 is divided by 94? 33 Calculate the remainder when 1891 is divided by 328. 251 What is the remainder when 1698773 is divided by 163? 150 What is the remainder when 55536 is divided by 67? 60 What is the remainder when 104423 is divided by 916? 915 Calculate the remainder when 19767 is divided by 238. 13 What is the remainder when 46557 is divided by 5173? 0 Calculate the remainder when 1959611 is divided by 653202. 5 Calculate the remainder when 66059 is divided by 66. 59 Calculate the remainder when 37766 is divided by 12569. 59 What is the remainder when 23742 is divided by 7619? 885 What is the remainder when 34160 is divided by 17062? 36 Calculate the remainder when 10402 is divided by 342. 142 Calculate the remainder when 23146 is divided by 830. 736 Calculate the remainder when 40872 is divided by 382. 380 Calculate the remainder when 42137 is divided by 555. 512 Calculate the remainder when 65560 is divided by 47. 42 Calculate the remainder when 19204 is divided by 206. 46 Calculate the remainder when 582771 is divided by 23. 20 Calculate the remainder when 36837 is divided by 120. 117 Calculate the remainder when 1165755 is divided by 61355. 10 Calculate the remainder when 114186 is divided by 270. 246 Calculate the remainder when 4375 is divided by 316. 267 What is the remainder when 137365 is divided by 28? 25 Calculate the remainder when 2058987 is divided by 6. 3 Calculate the remainder when 11034 is divided by 10919. 115 Calculate the remainder when 42161 is divided by 19. 0 Calculate the remainder when 8003 is divided by 26. 21 What is the remainder when 1431 is divided by 151? 72 Calculate the remainder when 1275989 is divided by 22. 11 Calculate the remainder when 33945 is divided by 293. 250 Calculate the remainder when 102507 is divided by 9. 6 What is the remainder when 14393 is divided by 14286? 107 Calculate the remainder when 255 is divided by 148. 107 What is the remainder when 535 is divided by 282? 253 What is the remainder when 2392 is divided by 1196? 0 Calculate the remainder when 6838 is divided by 3404. 30 Calculate the remainder when 717 is divided by 237. 6 What is the remainder when 3763 is divided by 410? 73 Calculate the remainder when 15729 is divided by 1310. 9 What is the remainder when 38878 is divided by 180? 178 Calculate the remainder when 58664 is divided by 85. 14 What is the remainder when 22744 is divided by 70? 64 What is the remainder when 752 is divided by 249? 5 Calculate the remainder when 9695 is divided by 8793. 902 What is the remainder when 8287 is divided by 2761? 4 What is the remainder when 243883 is divided by 28? 3 Calculate the remainder when 417634 is divided by 57. 52 What is the remainder when 960 is divided by 310? 30 Calculate the remainder when 497 is divided by 263. 234 What is the remainder when 1877 is divided by 583? 128 Calculate the remainder when 836 is divided by 701. 135 What is the remainder when 2885 is divided by 71? 45 What is the remainder when 1016 is divided by 336? 8 What is the remainder when 744 is divided by 466? 278 Calculate the remainder when 27679 is divided by 1384. 1383 What is the remainder when 9937 is divided by 9896? 41 Calculate the remainder when 7126 is divided by 1484. 1190 Calculate the remainder when 12832 is divided by 262. 256 What is the remainder when 2061 is divided by 685? 6 Calculate the remainder when 12715 is divided by 4229. 28 Calculate the remainder when 5195 is divided by 293. 214 Calculate the remainder when 365	{ "pile_set_name": "DM Mathematics" }
(c6/((c/c(-8))/c))/((c*(-1)cc)/c)(-3/31) assuming c is positive. c(-2) Simplify (yy/(y*(-5)/y)y*7/y)/((yyyyy5)/(yy*5y)) assuming y is positive. y*12 Simplify (vv*(1/25))/vvv(1/3) assuming v is positive. v(103/75) Simplify (v(-6)vv(-2))/((v(-1)/v)/(vv/(v/v(-2/5)))) assuming v is positive. v(-22/5) Simplify (z(z(1/4)z)/z)/z((z/z(-2/5))/z)/zz(-2/3)/z3 assuming z is positive. z(-241/60) Simplify ((j3/j)/jj(-8))(-21/2) assuming j is positive. j(147/2) Simplify (z(-7)/(z(z/z*7zz)/z))/(z(-1/3)z/(z/(z/z(-2)))) assuming z is positive. z(-17/3) Simplify ((f*(-3)f)/ff)/ff*(-4)/f(f(-1)/f)45 assuming f is positive. f*(-98) Simplify (mm*9mmm20)(2/29) assuming m is positive. m(64/29) Simplify (k/k(-7)k/(kk*(-1/4)/k))/(k(k*(2/7)k)/k)2 assuming k is positive. k(187/28) Simplify (pp(1/20))(-31) assuming p is positive. p(-651/20) Simplify ((b(2/3)b)(-1/7))(-1/36) assuming b is positive. b(5/756) Simplify (r/r3rr/r(-2/11))24 assuming r is positive. r*(48/11) Simplify (k(k/k16)/k)/k(-1/16) assuming k is positive. k*(-239/16) Simplify zz/((zz(2/37)zz)/z)z/(zz/z(-10))z assuming z is positive. z(-372/37) Simplify ((a(-5/4)a)/(aaa(-3/11)))/(a2)(-1/13) assuming a is positive. a(-1043/572) Simplify q(-1/7)q/(((q/q(-9))/q)/q) assuming q is positive. q(-50/7) Simplify (y/(y/(yy(-1/4))y))*(-31)(y(-1))(-2/45) assuming y is positive. y(1403/180) Simplify (v/(v(-15/2)v))/(v/(vv(-2))) assuming v is positive. v(11/2) Simplify (aaa/(((aa(2/9))/aa)/a))(-17) assuming a is positive. a(-425/9) Simplify (x(-36)/x)39 assuming x is positive. x(-1443) Simplify (f/f(-1/2)ff)/(f/f*(3/7))((f/f(-5))/f)/f2 assuming f is positive. f(83/14) Simplify (d(2/7))*44/(dd(dd/d*(-6))/dddd(2/3)) assuming d is positive. d(19/21) Simplify v*(-5)v(v/v(-1/8))/v assuming v is positive. v(-31/8) Simplify (y(-2/25)yy)/(y(-26)/yy) assuming y is positive. y(698/25) Simplify (w/w(-20))/w14 assuming w is positive. w7 Simplify (f/(f*9/f)f)/f*3(f(f/((f/(f(f/(f*(-2)f))/ff))/f))/ff)(-31) assuming f is positive. f(-164) Simplify v/(vvvv7v)vv*(-1/2)(v/v5)/((v5/v)/v) assuming v is positive. v(-33/2) Simplify (f/(f/(f(-2/5)/f)f)ff)(6/17) assuming f is positive. f(-12/85) Simplify (k(3/5))(-3/17) assuming k is positive. k(-9/85) Simplify ((m/(m(m*2/m)/mm)m)/((mm*(-2/13))/m))/(mm*(2/5)m)(7/5) assuming m is positive. m(-1042/325) Simplify (qq(1/5))(5/2) assuming q is positive. q3 Simplify (p(-3/5)p/((pp(-8))/p))(-41) assuming p is positive. p(-1722/5) Simplify (w/((ww*(-2/19))/w))/www/w(3/5) assuming w is positive. w(143/95) Simplify (x/x(-3/20))/(x(-6/7)/x) assuming x is positive. x(421/140) Simplify (m10m(2/31))(32/7) assuming m is positive. m*(9984/217) Simplify (c/(ccc/c(1/3)c))*(-27)(c(c/(cccc*1cc)c)/c)(9/5) assuming c is positive. c(324/5) Simplify ((q/(q(qqq(1/4))/qq))13)7 assuming q is positive. q*(-819/4) Simplify sss(-40)/sss(-23) assuming s is positive. s(-61) Simplify r(2/51)rr(-2/11) assuming r is positive. r(481/561) Simplify (y4/(y(-2/25)/yy))/(y*1(y/(yyyy(7/4)y)y)/y) assuming y is positive. y(783/100) Simplify (b(1/4)b(-6))(-2/5) assuming b is positive. b(23/10) Simplify (u2)*(-40)u(-3)/u8 assuming u is positive. u(-91) Simplify (a(1/15)a/(a/(a(1/2)/a)a))(5/7) assuming a is positive. a(-43/42) Simplify vv/((v/v(3/22))/v)vvv/(v(((v/(v4v))/v)/v)/v) assuming v is positive. v(245/22) Simplify (n(-4/5)/(nn4))/(nn*(-1/3)n)(-30) assuming n is positive. n(221/5) Simplify ((q/(qqq(1/2)))/q(-1))/(q*(-1/3)/(qq(-3))) assuming q is positive. q(-13/6) Simplify (ii15i(i(-1/13)/i)/i)(-1/20) assuming i is positive. i(-97/130) Simplify (uu6)(3/10) assuming u is positive. u(21/10) Simplify f(-1/22)f(-9/7) assuming f is positive. f(-205/154) Simplify ((((w/(ww*(-1/10)w))/w)/w)10)(-2/113) assuming w is positive. w(58/113) Simplify o16ooo(-4/11)o assuming o is positive. o*(205/11) Simplify ((ss*0s)/(ssss/(s(s/(s/(s*(-3/4)s)))/s)))43 assuming s is positive. s(-301/4) Simplify ((i/(i/(i*1ii))i)/i)*(-34)/(((((ii*(-7)i)/i)/i)/i)/(i/(i/i7))) assuming i is positive. i(-87) Simplify (r((r/(r/(rr28)))/r)/r)/r(-4) assuming r is positive. r*32 Simplify ((c(c/(cc/c(1/10)))/cc)/((c(c/(c/((cc(-2)/c)/c)))/c)/c))(-24) assuming c is positive. c(-492/5) Simplify ((d(-1/4))0)(1/24) assuming d is positive. 1 Simplify (o*10o/(oo(oo16)/oo)o)(-19) assuming o is positive. o133 Simplify ((p/p(-1/4))(-1))(9/4) assuming p is positive. p(-45/16) Simplify k/(((kk*(-2)kkk)/k)/k)(k/((k(k*(-4)/k)/k)/k)k)/k((kk(k/(k(-3)/k))/k)/kk)/kk(-2/13) assuming k is positive. k(167/13) Simplify ((j(j/(j/((jj/((j/(j(1/4)/j))/jjj))/j)))/j)(10/3))1 assuming j is positive. j(-35/6) Simplify g(-2/29)gg5g*(-5)/((g/(g/(ggg(3/4)gg)))/g) assuming g is positive. g(-327/116) Simplify (s/s(-13))(-22/3) assuming s is positive. s(-308/3) Simplify (r/(r/(((r(8/7)/r)/r)/r)))/((rr*(-22))/rr) assuming r is positive. r*(134/7) Simplify qq*(2/17)qqq*2q(q(5/2)q)/q(3/2) assuming q is positive. q(138/17) Simplify (tt/(tt*(-1/3)t))/t*(-3)(t/t(1/2))/t(-4) assuming t is positive. t(47/6) Simplify ((b(6/7)b)/b)/(b/((bbb(1/4)b)/b)) assuming b is positive. b(59/28) Simplify r(-13)/((r*(-4/9)r)/r) assuming r is positive. r*(-113/9) Simplify (p/(pp*(2/21)p))/((pp(-3))/pp)p(1/3)/(pp/((p*(-7)/p)/pp)p) assuming p is positive. p(-205/21) Simplify ((k(-2)kkk)/k)27/(k7k(-5/4)) assuming k is positive. k(-23/4) Simplify (y/((y/(y/y(-5/7)))/yy))/((y/((yyyy/(y/(yy*8/y))y)/y))/y) assuming y is positive. y(89/7) Simplify (z(-3)z)(3/14) assuming z is positive. z(-3/7) Simplify p/p21p(-6) assuming p is positive. p(-26) Simplify (w(-6)/w(-4/11))(-7/2) assuming w is positive. w(217/11) Simplify (o(-2/7)/o)/(o(-10)oo) assuming o is positive. o*(47/7) Simplify ((((p/(pp/p(1/13)))/p)/p)/((p(-4)/p)/p))(-3/20) assuming p is positive. p(-6/13) Simplify (i*(-1/5)/ii(-3/2))/(i(-1)/i)(-24) assuming i is positive. i(-507/10) Simplify ((m/m*(-2)mm)(5/3))(-1/8) assuming m is positive. m(-25/24) Simplify (g/(((g(2/43)/g)/gggg)/g))/g(-1/7) assuming g is positive. g(330/301) Simplify v*(-1)/((vvv(-8)vv)/v)(v1)(-30) assuming v is positive. v(-26) Simplify t21/t(4/7) assuming t is positive. t(143/7) Simplify j(-22)/((j/((j/(j(1/29)/j))/j))/j) assuming j is positive. j(-610/29) Simplify q(-1/24)/((q*28q)/qq) assuming q is positive. q(-697/24) Simplify (s(1/3))(-13/7)/(s(-1)s/s(-2)) assuming s is positive. s(-55/21) Simplify (o/(o/(o((o/o9)/o)/o))o(-4)/o)(1/10) assuming o is positive. o(-7/5) Simplify h(-1/9)(h(2/7)h)/h(h/(hhh(3/2)))(7/4) assuming h is positive. h(-2117/504) Simplify (((ff*(-3))/f)/(f/(f/(ff*7)f)))(7/5) assuming f is positive. f(-14) Simplify (www/w*2ww(-2/9)/w)(-20) assuming w is positive. w(-140/9) Simplify xx*1x*(-8)(x(x/(x/x(1/9)))/xx)/x(-2/21) assuming x is positive. x(-302/63) Simplify (l*(1/10)l4)(-1/7) assuming l is positive. l(-41/70) Simplify (y(-2/29)/yy)/y(-1/21) assuming y is positive. y(-13/609) Simplify (s(-2)/s)/ss/(s*(-1/5)/s)(ss/(ss*(2/9)/s))/(ss/(((ss0)/ss)/s)) assuming s is positive. s(-91/45) Simplify ((v(-2/3))(-31))27 assuming v is positive. v558 Simplify (c(-4/9)c)(1/23) assuming c is positive. c(5/207) Simplify (n(6/7)/n)/(n/(n/(n/(n(-2)/n)n)))(n/(n/n(-2/9)))30 assuming n is positive. n(-248/21) Simplify ((tt(t/(t/(tt*(7/3))))/ttt)/t)/(ttt(-25)t) assuming t is positive. t*(82/3) Simplify (l/(ll(2/3)))29/(l/(l/((l*(-1)l	{ "pile_set_name": "DM Mathematics" }
0 rounded to the nearest one million? -65000000 Round -0.0132266 to four decimal places. -0.0132 What is 9.567 rounded to 0 decimal places? 10 What is -37.7906 rounded to the nearest integer? -38 What is -0.0000133 rounded to six dps? -0.000013 Round 1.22 to one dp. 1.2 What is -55.82 rounded to the nearest ten? -60 Round -0.0000009435 to seven decimal places. -0.0000009 Round -0.00000129426 to seven dps. -0.0000013 What is 0.0001707 rounded to 5 decimal places? 0.00017 Round -2770 to the nearest one hundred. -2800 What is 0.9385 rounded to one dp? 0.9 Round 0.05917 to three decimal places. 0.059 What is 0.00057177 rounded to 4 dps? 0.0006 What is 6763000 rounded to the nearest 1000000? 7000000 Round 0.0562 to two dps. 0.06 Round -37.77 to the nearest 10. -40 What is -2095000 rounded to the nearest one hundred thousand? -2100000 Round 0.08 to one decimal place. 0.1 What is 0.00000088367 rounded to seven dps? 0.0000009 What is 0.0000098341 rounded to 6 decimal places? 0.00001 Round 0.0016934 to five dps. 0.00169 What is 0.0000565573 rounded to five dps? 0.00006 Round -81735000 to the nearest one million. -82000000 Round 1595000 to the nearest one hundred thousand. 1600000 Round -0.00022764 to five decimal places. -0.00023 Round 4.3883 to 2 dps. 4.39 Round -0.0013049 to 4 decimal places. -0.0013 What is -1.019 rounded to one dp? -1 Round -1362 to the nearest one hundred. -1400 What is -0.0012405 rounded to 4 dps? -0.0012 Round 0.000052421 to 7 decimal places. 0.0000524 What is 600.82 rounded to the nearest ten? 600 Round 13.75 to zero dps. 14 Round -0.000307078 to 5 decimal places. -0.00031 Round -472.3 to the nearest 100. -500 Round -146.203 to the nearest 10. -150 Round 0.000007574 to six decimal places. 0.000008 Round -56800 to the nearest ten thousand. -60000 What is -0.5929 rounded to two dps? -0.59 Round -0.000583 to 4 decimal places. -0.0006 Round -0.01158 to 3 decimal places. -0.012 What is -290850 rounded to the nearest ten thousand? -290000 Round -0.571 to two decimal places. -0.57 Round -0.00110231 to five dps. -0.0011 Round 0.01429 to three dps. 0.014 Round 87.5 to the nearest 10. 90 What is -10.624 rounded to zero decimal places? -11 Round 40900 to the nearest 100000. 0 What is -0.000019057 rounded to 6 decimal places? -0.000019 What is -591200 rounded to the nearest 100000? -600000 Round 604.73 to the nearest 100. 600 What is 2307900 rounded to the nearest 100000? 2300000 What is -0.00003028 rounded to 6 decimal places? -0.00003 Round -16757000 to the nearest 1000000. -17000000 What is -381110 rounded to the nearest ten thousand? -380000 Round -133.3 to the nearest 10. -130 What is 259100 rounded to the nearest 10000? 260000 Round -861400 to the nearest one hundred thousand. -900000 Round -0.000004767 to 7 dps. -0.0000048 What is 0.00000541 rounded to six dps? 0.000005 Round 2.9238 to two dps. 2.92 Round 3229000 to the nearest 1000000. 3000000 What is -47.158 rounded to the nearest integer? -47 Round -299100 to the nearest 10000. -300000 Round 1.439 to two decimal places. 1.44 What is -0.01741 rounded to 3 decimal places? -0.017 What is 202.1 rounded to the nearest 10? 200 Round 0.00134903 to five decimal places. 0.00135 Round -0.000008625 to 7 decimal places. -0.0000086 What is -621410 rounded to the nearest 10000? -620000 What is -0.0000000404 rounded to 7 decimal places? 0 What is -5114 rounded to the nearest one thousand? -5000 What is -14588 rounded to the nearest one thousand? -15000 Round -5.583 to 1 dp. -5.6 What is -2.086 rounded to two decimal places? -2.09 Round -2.2065 to 1 dp. -2.2 What is -358720 rounded to the nearest 10000? -360000 Round 0.0000006249 to 7 decimal places. 0.0000006 What is -40033 rounded to the nearest 1000? -40000 Round 235.3 to the nearest ten. 240 Round 0.00000368 to 6 decimal places. 0.000004 Round 22870000 to the nearest 1000000. 23000000 Round 0.0000046296 to 6 decimal places. 0.000005 What is -2.222 rounded to 1 dp? -2.2 Round -0.00120864 to five dps. -0.00121 What is 412700 rounded to the nearest ten thousand? 410000 Round -0.00649 to 3 decimal places. -0.006 Round 0.000108335 to five dps. 0.00011 Round 0.0000171539 to seven decimal places. 0.0000172 Round 14850000 to the nearest one million. 15000000 Round 146820 to the nearest ten thousand. 150000 What is -644500 rounded to the nearest ten thousand? -640000 Round 0.0765 to 2 decimal places. 0.08 What is -409.7 rounded to the nearest 10? -410 Round -7637000 to the nearest 100000. -7600000 What is -0.000209 rounded to 4 dps? -0.0002 What is 395.7 rounded to the nearest 100? 400 What is -20339000 rounded to the nearest one million? -20000000 What is -0.0000518 rounded to five decimal places? -0.00005 What is -27170 rounded to the nearest ten thousand? -30000 What is 8819 rounded to the nearest one thousand? 9000 What is -23489 rounded to the nearest 1000? -23000 Round 0.687 to one dp. 0.7 Round -0.00052259 to five dps. -0.00052 Round 0.1 to 3 dps. 0.1 What is 66030 rounded to the nearest 1000? 66000 Round -19820000 to the nearest one million. -20000000 Round -20950000 to the nearest 100000. -21000000 Round 0.0000027859 to 6 decimal places. 0.000003 What is -0.0011692 rounded to four dps? -0.0012 What is -29587 rounded to the nearest 1000? -30000 Round 44330 to the nearest 10000. 40000 Round 6477 to the nearest 100. 6500 What is 2508.7 rounded to the nearest 100? 2500 Round 33230000 to the nearest one hundred thousand. 33200000 Round 1613400 to the nearest 100000. 1600000 What is -0.002655 rounded to 4 dps? -0.0027 Round 0.000341 to three dps. 0 Round 1932400 to the nearest one hundred thousand. 1900000 Round 81300 to the nearest 10000. 80000 What is 1.2712 rounded to 1 decimal place? 1.3 Round -14611000 to the nearest one million. -15000000 Round 25315000 to the nearest 100000. 25300000 Round 0.9146 to 2 decimal places. 0.91 Round 0.0017822 to 3 decimal places. 0.002 What is -771.8 rounded to the nearest ten? -770 What is 0.17363 rounded to three decimal places? 0.174 Round -0.0039629 to four dps. -0.004 What is -19540 rounded to the nearest ten thousand? -20000 What is 200.5 rounded to the nearest ten? 200 Round -57.8533 to the nearest ten. -60 Round -645100 to the nearest 10000. -650000 What is 0.005522 rounded to three dps? 0.006 What is -8045 rounded to the nearest 1000? -8000 Round -25.95 to the nearest one hundred. 0 Round 485.66 to the nearest ten. 490 Round -247880000 to the nearest one million. -248000000 Round -3397 to the nearest 100. -3400 Round -1952000 to the nearest one hundred thousand. -2000000 What is 21.895 rounded to the nearest ten? 20 Round 0.00000093208 to 7 dps. 0.0000009 Round 151310 to the nearest 10000. 150000 Round 42140000 to the nearest one million. 42000000 What is 41.75 rounded to the nearest ten? 40 Round 1.356 to 1 dp. 1.4 What is 409.2 rounded to the nearest 100? 400 Round 230926 to the nearest one thousand. 231000 Round 6.67738 to one dp. 6.7 Round 640.5 to the nearest one hundred. 600 Round -0.000004582 to seven decimal places. -0.0000046 Round -1003000 to the nearest ten thousand. -1000000 What is -62350000 rounded to the nearest 1000000? -62000000 What is 149.9 rounded to the nearest ten? 150 What is 1565100 rounded to the nearest one million? 2000000 What is 0.0008555 rounded to five dps? 0.00086 Round 16715 to the nearest one thousand. 17000 Round 1150300 to the nearest ten thousand. 1150000 Round 0.000000147 to seven dps. 0.0000001 Round -55171700 to the nearest one million. -55000000 What is 1217200 rounded to the nearest one hundred thousand? 1200000 Round 0.00002972 to 5 dps. 0.00003 Round -114173 to the nearest ten thousand. -110000 Round -5961040 to the nearest 100000. -6000000 What is -0.000003281 rounded to seven decimal places? -0.0000033 Round 0.00004386 to 6 decimal places. 0.000044 What is -0.0000002189 rounded to 7 dps? -0.0000002 Round 0.2392 to 2 decimal places. 0.24 What is -0.396954 rounded to three dps? -0.397 What is -1363.2 rounded to the nearest 100? -1400 Round -8675.2 to the nearest one thousand. -9000 What is 0.0077402 rounded to 3 dps? 0.008 Round -8.312 to 0 dps. -8 What is 0.2562 rounded to 2 decimal places? 0.26 Round 18540 to the nearest 1000. 19000 Round 0.00001665 to	{ "pile_set_name": "DM Mathematics" }
ive of -2y2 + 0y*3 + 4y*n + 4y*2 + 2y*3 wrt y? 36 Let l(n) = 4n - 3. Let o(y) = -y*2 + 5y - 4. Let p(j) = -4l(j) + 3o(j). Find the second derivative of p(x) wrt x. -6 Find the first derivative of v - 2v + 1 + 7v wrt v. 6 Let l = 14 + -12. Find the third derivative of 3y6 - ly*6 + 0y*6 + 7y*2 wrt y. 120y*3 Find the second derivative of 511s + 0s5 - 500s - 2s5 wrt s. -40s*3 Find the first derivative of 2c - 17 - 15 + 29 wrt c. 2 Let f(j) be the second derivative of j6/30 + j4/8 - j*2 - 3j. Let s(o) be the first derivative of f(o). What is the second derivative of s(b) wrt b? 24b Let b(l) = -l - 2. Let p(d) = 20d*2 + 30d + 6. Let f(j) = -3b(j) - p(j). What is the second derivative of f(m) wrt m? -40 Suppose -g = -2g. Let a be (-2 - g)/1-2. What is the second derivative of -4l + 6l4 - al*4 + 5l wrt l? 24l2 Let k(m) be the second derivative of m10/7560 - m7/2520 - m4/4 + 3m. Let w(g) be the third derivative of k(g). Find the third derivative of w(x) wrt x. 240x2 Let q(g) = 20g*2 + 39g. Let u(t) = 21t2 + 38t. Let o(m) = 3q(m) - 4u(m). What is the second derivative of o(z) wrt z? -48 What is the first derivative of 7b - 56b - 31 + 79 wrt b? -49 Suppose 4v = 7 + 1. Suppose -1 = 2n - a, -n - 3a + 22 = a. What is the derivative of v + 2t2 - t2 + t*n wrt t? 4t Let x = 1 + 1. What is the second derivative of -j - 3j - j + xj - j*2 wrt j? -2 Suppose 3 = 2v + 1. Let q = 1 + v. What is the first derivative of -a*4 + q + 12a*2 - 12a*2 wrt a? -4a*3 Suppose 0w + 6 = w. Suppose 15 = -p + wp. Find the third derivative of 2i2 - i4 + 3ip - 3i*3 wrt i. -24i Let a be 6 - 1/((-2)/(-6)). Suppose 1 = 2h - h + b, ab = -4h + 3. Find the second derivative of 0g - 2g - 3g*2 + hg*2 wrt g. -6 Let r(a) be the first derivative of 5a*3 + 26a + 23. Find the first derivative of r(x) wrt x. 30x Let j(d) be the second derivative of 11d5/10 + d4/6 + 16d3/3 + 3d - 7. What is the second derivative of j(l) wrt l? 132l + 4 Let i(b) = b2 - 7b - 16. Let o be i(9). What is the second derivative of 0m - m2 + 7m*2 + om*2 + 2m wrt m? 16 Suppose -4o + 6 = -3p, -5o = -p - 5 - 8. What is the derivative of 1 - ox - 4 - 2 - 3 wrt x? -3 Let k(y) be the first derivative of 7y5/5 - 27y + 18. Differentiate k(m) wrt m. 28m3 Let k(n) be the second derivative of 5n*4/12 + 3n*2/2 + 3n. What is the derivative of k(b) wrt b? 10b Let t(y) = -y5 + 6y3 - y2 - 6y. Let m(c) = c5 + c3 - c2 - c. Let j(a) = 6m(a) - t(a). Find the third derivative of j(x) wrt x. 420x2 Suppose -2z + 0z - 3l + 12 = 0, -z - l = -5. Find the first derivative of -z - 2x2 - 3 + 6 + 4 wrt x. -4x Let n(c) = 21c3 - 3c*2 + 3c + 8. Let b(h) = -43h3 + 7h*2 - 7h - 17. Let q(t) = -3b(t) - 7n(t). What is the first derivative of q(p) wrt p? -54p2 Let r(n) be the second derivative of n9/1512 - n5/120 - n3/6 - n. Let y(w) be the second derivative of r(w). What is the second derivative of y(p) wrt p? 40p*3 Suppose c - 3 = 1. What is the derivative of -5 + 2 + 2y + c + 1 wrt y? 2 What is the second derivative of -13j5 + 5j*5 - 11j*5 + 24j wrt j? -380j3 Let u(b) be the third derivative of 7b*6/60 + 7b*3/2 + 19b*2. What is the derivative of u(d) wrt d? 42d*2 Let b(d) be the third derivative of -5d*9/252 + 13d*5/60 - 6d*2. Find the third derivative of b(w) wrt w. -1200w*3 Let k be (-2)/(-11) - 60/(-33). Suppose kq - 4g + 3 = -7g, 5g = 5q - 5. Find the second derivative of 5r + qr - 4r + r4 wrt r. 12r*2 Let r = 13 + -13. Find the third derivative of rk*6 - 4k*2 + 0k*6 - 2k*6 wrt k. -240k*3 Let h be (-20)/6(-3)/2. Find the third derivative of 0d2 - d2 - 3d*2 + 3dh + d5 wrt d. 240d2 Let w(a) be the third derivative of -a7/210 + a6/360 - a3/2 + 7a*2. Let q(s) be the first derivative of w(s). Find the third derivative of q(m) wrt m. -24 Let k(x) = 1. Let h(r) = 3r + 3. Let f(w) = h(w) + 4k(w). What is the derivative of f(a) wrt a? 3 Let g(n) = -16n*4 - 5n*2 + n - 5. Let o(a) = -16a*4 - 4a*2 + a - 4. Let t(j) = -4g(j) + 5o(j). Find the second derivative of t(x) wrt x. -192x*2 Suppose -d + 6d = 25. Let u = d + -1. Differentiate up2 + 2 - 4p*2 + 2p*2 - 5 with respect to p. 4p Let m(n) be the first derivative of -2/3n3 + n - 1 + 0n*2. Differentiate m(p) wrt p. -4p Differentiate -1 - 4d4 - 4d + 4d - 2d*4 wrt d. -24d*3 Let j(g) = -2g + 1. Let l be j(-1). Find the first derivative of l - 3x4 + 0x*2 - 7x*2 + 7x*2 wrt x. -12x*3 Suppose 5 = 4k - 3. What is the second derivative of 3z + kz*5 + 3z*5 - 2z*5 wrt z? 60z3 Let r(c) be the second derivative of -c3/6 - 3c2 - 10c. What is the derivative of r(s) wrt s? -1 Suppose 0g = 4g - 28. What is the third derivative of 5p4 - gp*4 + 0p*4 + 2p*2 wrt p? -48p Let c(u) be the first derivative of -9u2/2 - 8u + 17. Differentiate c(z) with respect to z. -9 Let u(t) = -4t3 - 3t*2 - 4t - 3. Let c be u(-2). Suppose 6l = 11l - c. Find the third derivative of 0x2 - lx*2 + 4x*4 + 4x*2 + 4x*2 wrt x. 96x Let m(p) = -2p2 - 3. Let u(y) = 4 + 5y2 - y5 + 1 + 9y - 9y. Let d(z) = 5m(z) + 3u(z). What is the third derivative of d(g) wrt g? -180g2 Let c(n) be the first derivative of n10/2520 + n6/180 - 8n*3/3 + 4. Let m(y) be the third derivative of c(y). Find the third derivative of m(j) wrt j. 240j*3 Suppose 2a = -4g - 2, 5g - 7 = 4a + 23. What is the second derivative of -3u - u*4 + 6u - gu4 wrt u? -36u2 Let i(q) be the first derivative of -q3/2 - 3q2 - 3q - 5. Let y(l) be the first derivative of i(l). Differentiate y(h) wrt h. -3 Let q(j) = -16 + 37 + j - 21. Let t(s) be the third derivative of -s6/40 - s4/12 + s3/3 - s2. Let p(r) = -2q(r) - t(r). Differentiate p(x) wrt x. 9x*2 Let k(t) be the second derivative of -3t + 0 + 2/3t3 - t2. What is the first derivative of k(x) wrt x? 4 Let y(g) = g3 - 7g*2 + g - 5. Let z be y(7). Suppose 2o = z + 4. Find the second derivative of -r + 2r5 + 6r - or wrt r. 40r3 Let o(l) = -l5 + 5l4 + 5l2 + l. Let i(b) = b4 + b*2. Let n be (-15)/(-2)6/9. Let m(c) = ni(c) - o(c). Find the second derivative of m(a) wrt a. 20a*3 Let x be -4 - -3(-2)/6. Let z = 8 + x. What is the third derivative of 4p2 - 2p*3 - 2p*2 + 3p*z - 2p*3 wrt p? -6 Let l be 4/18 - 468/(-81). Find the third derivative of -4o*2 + 0o*l + 4o*6 + 0o*2 wrt o. 480o*3 Let a(z) be the third derivative of -7z*5/30 + 5z*3/3 - 6z*2. Find the first derivative of a(l) wrt l. -28l Let j(r) be the second derivative of 5r7/21 - 5r*4/4 + 8r. What is the third derivative of j(n) wrt n? 600n2 Let l be (((-2)/9)/((-2)/3))/10. Let m(n) be the third derivative of -2/3n*3 + ln*5 + 0n*4 + 0 + 0n - 3n2. Differentiate m(b) with respect to b. 4b Let y(v) be the first derivative of -v*3/3 - v - 9. What is the derivative of y(j) wrt j? -2j Suppose -3f + 4f - 3 = 0. Differentiate k*4 - fk*4 - 4 + 0 with respect to k. -8k*3 Let u(l) = -7l + 3. Let k(x) = -8x + 4. Let r(w) = -6k(w) + 5u(w). What is the derivative of r(s) wrt s? 13 Let f be ((-42)/5)/(-3)5. Suppose -f + 4 = -2y. Find the third derivative of g2 + g5 + 3g*y - 6g*5 wrt g. -120g*2 Find the second derivative of 0i3 + i3 - i*3 - 5i - i*4 wrt i. -12i2 Let z(m) be the second derivative of -m7/280 + m5/40 + m3/2 - 2m. Let d(t) be the second derivative of z(t). Find the second derivative of d(a) wrt a. -18a Suppose 8 = 2l - 4i, 2l + i - 53 = -3l. What is the first derivative of ls - 3 - 12s - 1 wrt s? -2 Let o(s) = s + 1. Let d be o(-1). Let j(f) be the third derivative of 0f3 + 1/20f*5 + df + 1/12f4 - f2 + 0. Find the second derivative of j(v) wrt v. 6 Let y be (-5)/7 + (-4)/14. Let j be (-2 + 0)/(1/y). Find the third derivative of p6 + 0p6 + p6 - 2pj wrt p. 240p*3 What is the derivative of -15f*4 - 52 + 11f*4 + 2f*3 + 0f*3 wrt f? -16f*3 + 6f*2 Let q(m) be the first derivative of -10m*7/7 + 2m**3 - 4. Find the t	{ "pile_set_name": "DM Mathematics" }
-84) - -27) 9 (-4 - 104/(-32))/((-54)/24 + 1) 3/5 Calculate (-10)/77 - 213/(-781). 1/7 Evaluate (100/700)/(2/63). 9/2 Evaluate (18 - 2676/144)32/(-42). 4/9 Evaluate 9/12 - 210/(-252)996/(-40). -20 What is (2/7)/(-5 - 256/(-112))? -2/19 Evaluate 1/(-10)2 + 16/(-20). -1 Calculate (1258/(-185) + 10)/(-6). -8/15 5(-16)/(-80) + (-2 + 1 - 25) -25 Evaluate (30/(-8) + 3)960/(-1800). 2/5 0 - ((-9)/12)/((-63)/168) -2 -3(-2 + 11/6) 1/2 Evaluate 3/(-2)(-47 - 55496/(-1176)). -2/7 Calculate 5(-3)/(-10 + 108/12). 15 What is 5/150-54? -2/3 (-7 - -3)9/(-192) 3/16 Evaluate (-22)/110 - ((-3)/5)/((-126)/(-3612)). 17 Calculate 2080/(-7176)3/(-10). 2/23 Calculate (-7 - 2 - (-285)/10) + 3/(-6). 19 (10/(52 + -22))/(26/138) + -2 -3/13 What is the value of ((-60)/(-10) - (3 + (-145)/30)) + -7? 5/6 Evaluate (-178)/(-144) + (123/(-600) - 46/(-575)). 10/9 What is the value of -11(2/33)/((-4)/6)? 1 Calculate 71(-1)/(-14) - (-47 + 27 + 25). 1/14 What is the value of ((-28)/(-372))/(175/75)? 1/31 What is 129/86(-56)/(-54)? 14/9 What is the value of 0/(48/(-27 - -3))? 0 What is the value of 36/(-6) - 1485/(-264)? -3/8 What is the value of ((-144)/(-18) - (1 - -12))4/(-6)? 10/3 Calculate 63/(-336)(-130)/15 + 6 + -8. -3/8 What is the value of 288/576(6/5)/(3/45)? 9 What is (240/(-18))/(45/54)? -16 Calculate (((-580)/261)/((-12)/45) - 12) + 3. -2/3 (-20)/2340309/5-1 6/13 Calculate 13/(1521/12)(9 - 12). -4/13 270/(-81)5 + 20 10/3 (1 + (-28)/16)48/120 -3/10 Calculate ((-4)/(-46))/(31(-46)/(-2139)). 3/23 (-472)/59 + 200/28 -6/7 Evaluate (36/(-3))/(110/55). -6 ((-777)/(-185))/(((-135)/(-50))/(-9)) -14 Evaluate 240/100100/280. 6/7 (-1)/(19/(-6) + (-77)/33 + 5) 2 Calculate ((-2921)/759 - -4)(-18)/(-5). 6/11 What is the value of (6 + (605/(-11))/11)/((-2)/52)? -26 Evaluate 2/(6/(-3 + -9)). -4 Calculate 99/(-528) - (-2639)/208. 25/2 Calculate 1(-56)/7 + 144/(-9) + 7. -17 110/(-66) - (-1)/1 -2/3 What is the value of (0 - 2 - -1)(-3 + (-357)/(-77))? -18/11 What is 25/(-10) + ((-6)/(-112))/(6/264)? -1/7 What is 1209/1561/(-2 - (-36)/16)? 31 (6 + -1)/(111 + -110) - (-92)/(-18) -1/9 What is the value of (-34)/7 - 953/6671? -5 Evaluate (27(-2)/(-270))/(22/10). 1/11 Evaluate 8/(-2)((-168)/336)/(1/2). 4 What is the value of ((952/(-221))/28)/((-4)/(-26))? -1 Calculate 30(-21 + 2472/120). -12 What is the value of ((-1 + -3)/(-16))/(209/132 - 2)? -3/5 What is the value of (-23)/(-46)(-4 + 62/16)-6? 3/8 What is (70/(-180))/((-28)/(-16))? -2/9 56/(-18) + ((-244)/(-9) - 27) -3 Calculate 25 + 1160/((-319)/11). -15 Evaluate ((-8)/(48/(-42)))/(((-7)/2)/7). -14 Calculate (-134 + 1)/(7889/1127). -19 Calculate (-3)/(-90) - (-35571)/15030. 12/5 What is the value of (-6)/24 - (-5 - (-66)/(-8) - 10)? 23 Evaluate (-17969)/(-1208) + (-11)/(-24) + 2/(-6). 15 What is ((-72 + 79)1/7)/(-15)? -1/15 (2/(-2))/(15827/(-441) - -36) -9 What is the value of (455328/442)/(-31) - -34? 10/13 Evaluate 6/8(342/486 + -1). -2/9 Calculate (3952/2090 + 3/(-33))(-10)/3. -6 Evaluate (132/605)/((-4)/10). -6/11 Calculate (-61)/((-122)/(-24)) + 11 + -2. -3 What is the value of 29 - (-19140)/(-377) - -21? -10/13 (-17)/(-34)(-100)/(-5) 10 Evaluate 468/405 - 54/45. -2/45 What is the value of ((-6)/(-5))/(((-18)/120 - -6) + -6)? -8 Calculate (-122)/(-4941)54(-9)/606. -2/101 What is the value of (8/24)/(((-238)/6)/(-7))? 1/17 Calculate (-4)/34 + (-2440)/2380. -8/7 Calculate -10 + 744/78 + 996/(-39). -26 ((-78)/(-3))/2 + (-2 - -2 - 2) 11 What is the value of (-10 - 230/(-15))/((-10)/(-15))? 8 Calculate (-495)/182 + 12 + 8. -35 (-7)/143 + ((-180)/55)/18 -3/13 Calculate 60/330 + (-1608)/132. -12 Evaluate (4/20 - (3 - 2))(-705)/282. 2 Calculate 35/9 - (-17)/153. 4 (6/(-4))/((-144)/(-768)) -8 Evaluate 40/(150/(-15))3/258. -2/43 3/((-6)/196)26/(-468) + -5 4/9 Evaluate 26/(-2) + (-782)/(-69). -5/3 Calculate ((-18)/264)/1 - (-12)/48. 2/11 Evaluate (-2169)/2410(-12 + 2). 9 Calculate ((-12 - -10)15 + 14)/1. -16 Calculate (-19)/(-7) + -9 + 242/14 + -8. 3 14 - 198/(72/8) - 8 -16 (-32 - 1) + (-1604505)/(-48675) -2/55 Calculate (-3)/(75/(-6)32/(-20)). -3/20 ((-88)/20)/(3432/(-24960)) 32 Evaluate ((-2076)/3287)/(0 + (-6)/57). 6 What is the value of ((-44)/231)/((-95)/(-15) - 3)? -2/35 9/(816/1120 + (-3)/7) 30 (-83 - (-11254)/136)(-256)/2 32 What is the value of (-901)/2703(1/(-2))/((-2)/(-12))? 1 ((-15)/3783)/((-45)/(-36)) -2/21 Evaluate 20 - (16 + 3) - 14/12. -1/6 Calculate 7 - (-16)/(96/(-47)). -5/6 What is (-3)/3(0 - -27 - (30 - 42))? -39 Evaluate (4/(-45))/(168/420). -2/9 -44 - -13 - 17/(-20 - -3) -30 Evaluate (-68)/(-20) - (-17 + 1232/80). 5 Calculate 214/3531 + (388/40)/(1056/(-10)). -1/32 What is (-211)/85 + (-296)/2516? -13/5 Evaluate ((1100/(-8))/5)/((-810)/(-648)). -22 Evaluate (-10)/(-88)(-168)/(-21)22. 20 What is the value of (-12)/26 + (-22015)/(-30940)? 1/4 Calculate (-11 - (18 - 34)) + -21. -16 What is (-296)/(-80) + (-966)/276? 1/5 Evaluate 117 - (-1730)/(-173). 7 (24284/351 - 69)/((-4)/18) -5/6 Evaluate (1 - 1 - -6)(-7)/(5 + -40). 6/5 296/(-37) - (-176)/8 14 What is the value of ((-1)/(-2)-1)/(32/4025637)? -17 ((-110)/(-28 + 6))/(1 + 0) 5 Evaluate ((-3)/2)/(19/((-570)/45)). 1 (46 + 6532/(-138))6/8 -1 What is the value of (-6)/7126/288? -3/8 What is (-116)/56 + 0 - ((-590)/(-70) - 8)? -5/2 ((-3)/(-9)3)/(22(-47)/14476) -14 What is the value of (53/212)/((270/120)/(15/(-2)))? -5/6 What is (1/(-4))/(2375/190 + (-42)/6)? -1/22 What is ((-66)/(-2))/3 + 432/(-42)? 5/7 2/(-5)((-148)/(-5) - 8/(-20)) -12 ((-3)/5((-220)/(-30))/11)/(-1) 2/5 What is (-3435)/750 - (-6)/75? -9/2 16 - (35 - 16) - 17 -20 What is the value of 6(17/((-459)/342) + 14)? 8 (80/(-24))/((-2)/9) 15 Calculate (166/5 + -34)(-5)/3. 4/3 Evaluate (20 - 17)(4-1)/(-5 - -2). 4 Evaluate (-2 + (8 - -1))(-20 + -9 + 28). -7 Calculate (-1)/(-2)(29946/8372 + 7/(-2)). 1/26 (-98)/91 + 47/(-65) -9/5 Evaluate (3/(-9) - 1)/((-3584)/(-96) - 6). -2/47 Calculate 232/126 - (-2250)/(-1750). 5/9 What is the value of (31/(-12))/(((-30)/(-36))/5)? -3/2 4/(-48)(11 - 17)/((-4)/2) -1/4 Evaluate 77(-14)/(-392) - (-3)/(-4). 2 17159 - 17158 - ((-15)/(-2)2 - 0) -14 Calculate 360/(-32)352/220. -18 What is the value of 4/(((-2)/34)/((-490)/56 + 9))? -17 What is 217/(-34)4/(-68)? 1/17 Evaluate 0 + (-11)/2 + (373 - 375). -15/2 Calculate 9/(-324)1276 + 37. 14/9 What is (1 - -1)/(20/135) - (-455)/(-65)? 13/2 What is (2/17 - (-472)/34)/2? 7 Evaluate 72/(-168) - (2640/(-378))/8. 4/9 What is 712/504 + 12/9? 3/2 (48/(-6))/(-2) - 3 1 (4/10)/((-2367)/(-1315)) 2/9 Evaluate (180/(-21))/(10/(-28)). 24 Calculate ((-884)/(-51) - 17)-24. -8 What is the value of 22 - (-1 - (-4575)/195)? -6/13 Calculate 5 + -4 - (3 - -2). -4 -12 + -5(-132)/60 -1 Evaluate -22 - 14/56-94. 3/2 31/558-45 + (-30)/4 -10 What is the value of (-12)/(-66) - (1521/(-165) - (-10)/25)? 9 What is (-1 - 0)((-6)/22 + (-2970)/1089)? 3 Evaluate (-4)/(-14) + (-1958)/2492. -1/2 What is the value of ((-392)/(-245))/((-6)/(-20) - (-38)/(-95))? -16 2457/(-4095)35/(-6) 7/2 ((-15)/(-35))/((-9)/6) -2/7 Evaluate ((7/6)/7)/(2 - 56/27). -9/4 12/(-8)300/(-45) 10 Calculate 16/39 + (1467/(-27) - -54). 1/13 Calculate 64/504 + 2/21 + (-151)/(-9). 17 Evaluate (42/(-49))/(8/(-168)). 18 Calculate ((-14)/12)/(-36(-66)/14256). -7 What is -14 + 1853/136 + 0/5? -3/8 What is the value of 12324/869 + (-4)/22? 14 What is the value of ((-8)/(-24))/(2 + 39/(-18))? -2 (-42 - (-4736)/111)/((-1)/33) -22 11 + 12/(-21)(-1071)/102 17 (-28)/(-24) + (-763)/1684 -17 Evaluate 2/42(18 - 5) - 7/21. 2/7 Evaluate (1075/1125 - 1)/(2/(-20)). 4/9 What is ((-40)/60(-18)/(-10))/((-27)/(-180))? -8 What is ((-615)/(-328))/(3/4)? 5/2 What is 588/952 + (-8)/16? 2/17 Calculate -15 - 1 - (-25351)/1506. 5/6 -2((-10)/4 + (-252)/(-104)) 2/13 What is (-40 - -36) + (-12)/16-5? -1/4 Calculate 22 - 11 - 11 - (-45)/210. 3/14 ((2835/198)/9 - 2)(-6)/9 3/11 What is the value of (30 + 2546/(-95))5? 16 What is ((-868)/(-112) - (10 + 0))/((-6)/(-16))? -6 Calculate -4 + ((-169)/26 - -3)10/(-8). 3/8 What is 14/84 + 418/(-204) - (-2 - 0)? 2/17 Calculate (-21)/(6006/(-1298)) + (-4 - -1) + -2. -6/13 Calculate 3 + 20/(-16) - 33465/13580. -5/7 Evaluate (-5 + (-65)/15 - -7)/(-8 - -7). 7/3 What is 4 - -31 - (-30733)/(-876)? -1/12 What is (2	{ "pile_set_name": "DM Mathematics" }
2 + 2b + 4 What is the s'th term of -48631, -48633, -48637, -48643, -48651, -48661, -48673? -s*2 + s - 48631 What is the k'th term of 16479, 16507, 16535, 16563? 28k + 16451 What is the l'th term of -5382, -10745, -16070, -21339, -26534, -31637, -36630? 3l3 + l2 - 5387l + 1 What is the g'th term of 64, 26, -24, -86, -160, -246, -344? -6g2 - 20g + 90 What is the b'th term of 42483, 42485, 42487? 2b + 42481 What is the h'th term of -651, -2565, -5741, -10179, -15879, -22841, -31065? -631h*2 - 21h + 1 What is the u'th term of 274, 316, 376, 448, 526, 604, 676? -u*3 + 15u*2 + 4u + 256 What is the b'th term of 2093850, 2093849, 2093848? -b + 2093851 What is the g'th term of 38722, 38723, 38724, 38725? g + 38721 What is the s'th term of 22, 440, 1570, 3766, 7382, 12772, 20290, 30290? 59s3 + 2s*2 - s - 38 What is the u'th term of 1576848, 3153696, 4730544, 6307392, 7884240? 1576848u What is the p'th term of -7334, -14679, -22036, -29405, -36786, -44179? -6p2 - 7327p - 1 What is the o'th term of 4935, 9918, 14901, 19884, 24867? 4983o - 48 What is the d'th term of 53451, 53449, 53447? -2d + 53453 What is the a'th term of 24574, 24580, 24584, 24586? -a*2 + 9a + 24566 What is the k'th term of -214909, -214981, -215039, -215077, -215089? k3 + k2 - 82k - 214829 What is the u'th term of 117927, 235853, 353779? 117926u + 1 What is the s'th term of 47916, 47895, 47854, 47787, 47688, 47551? -s*3 - 4s*2 - 2s + 47923 What is the d'th term of -1996, -2038, -2080? -42d - 1954 What is the h'th term of -422, -1668, -3756, -6692, -10482, -15132? -h3 - 415h*2 + 6h - 12 What is the o'th term of 4001, 8002, 12015, 16046, 20101, 24186, 28307? o*3 + 3994o + 6 What is the u'th term of -1516, -5927, -13224, -23407? -1443u2 - 82u + 9 What is the r'th term of -43, -52, -45, -16, 41, 132, 263? r*3 + 2r*2 - 22r - 24 What is the n'th term of -351055, -351049, -351043? 6n - 351061 What is the g'th term of -397, -347, -267, -157? 15g*2 + 5g - 417 What is the h'th term of 2535, 2538, 2541, 2544? 3h + 2532 What is the x'th term of 2009, 4116, 6223, 8330, 10437? 2107x - 98 What is the f'th term of -97209, -194444, -291679, -388914, -486149, -583384? -97235f + 26 What is the l'th term of -169, 514, 1197? 683l - 852 What is the u'th term of -608768, -608766, -608762, -608756, -608748, -608738? u*2 - u - 608768 What is the c'th term of -2438, -4857, -7276? -2419c - 19 What is the t'th term of 4215, 4185, 4159, 4137, 4119, 4105, 4095? 2t2 - 36t + 4249 What is the c'th term of 185, 649, 1411, 2465, 3805, 5425, 7319, 9481? -c*3 + 155c*2 + 6c + 25 What is the i'th term of 249919, 249922, 249925, 249928, 249931? 3i + 249916 What is the k'th term of 25, 109, 189, 217, 145, -75, -491, -1151? -8k*3 + 46k*2 + 2k - 15 What is the c'th term of 2684, 2654, 2594, 2498, 2360, 2174, 1934? -c*3 - 9c*2 + 4c + 2690 What is the h'th term of -7189, -6958, -6727, -6496? 231h - 7420 What is the o'th term of 12120, 48568, 109316, 194364, 303712? 12150o*2 - 2o - 28 What is the j'th term of -19, -78, -137? -59j + 40 What is the b'th term of 7836861, 7836862, 7836863, 7836864, 7836865, 7836866? b + 7836860 What is the d'th term of 222764, 222767, 222770, 222773? 3d + 222761 What is the g'th term of -937, -3792, -8637, -15544, -24585, -35832, -49357? -12g3 - 923g*2 - 2g What is the w'th term of 825, 625, 423, 219, 13, -195? -w*2 - 197w + 1023 What is the g'th term of 132, 253, 456, 741, 1108, 1557, 2088? 41g2 - 2g + 93 What is the x'th term of 608, 606, 604, 602? -2x + 610 What is the v'th term of -3760, -7582, -11418, -15274, -19156? -v3 - v2 - 3812v + 54 What is the v'th term of -3449, -6862, -10203, -13436, -16525, -19434, -22127? 6v3 - 3455v What is the s'th term of 578, 2321, 5254, 9401, 14786, 21433, 29366, 38609? 4s3 + 571s*2 + 2s + 1 What is the w'th term of -5067, -10127, -15189, -20253? -w*2 - 5057w - 9 What is the h'th term of 40615, 162480, 365589, 649942? 40622h2 - h - 6 What is the s'th term of -11134, -22268, -33402, -44536, -55670? -11134s What is the q'th term of -60967, -60962, -60955, -60946? q*2 + 2q - 60970 What is the n'th term of -46, -142, -232, -316, -394, -466? 3n2 - 105n + 56 What is the l'th term of -4028, -4006, -3970, -3920, -3856, -3778, -3686? 7l2 + l - 4036 What is the t'th term of 4669, 4708, 4773, 4864? 13t2 + 4656 What is the p'th term of -11440, -10879, -9950, -8659, -7012? -p3 + 190p2 - 2p - 11627 What is the v'th term of 52798, 52790, 52780, 52768? -v*2 - 5v + 52804 What is the g'th term of -1740, -1744, -1750, -1758, -1768, -1780, -1794? -g2 - g - 1738 What is the n'th term of -8835, -35332, -79503, -141354, -220891, -318120, -433047, -565678? -n3 - 8831n2 + 3n - 6 What is the g'th term of -2326, -1456, 914, 5534, 13154, 24524, 40394? 125g3 - 5g - 2446 What is the t'th term of 10124, 40484, 91084, 161924, 253004, 364324? 10120t2 + 4 What is the x'th term of -11206, -11445, -11836, -12373, -13050, -13861? x3 - 82x*2 - 11125 What is the d'th term of 343, 505, 719, 985, 1303? 26d*2 + 84d + 233 What is the s'th term of 30, 562, 1094? 532s - 502 What is the g'th term of 1139, 1175, 1235, 1313, 1403, 1499, 1595, 1685? -g3 + 18g*2 - 11g + 1133 What is the b'th term of 252, 1970, 6636, 15726, 30716, 53082, 84300, 125846? 246b3 - 2b*2 + 2b + 6 What is the v'th term of 217520, 435041, 652562? 217521v - 1 What is the m'th term of -2364, -4720, -7076, -9432, -11788, -14144? -2356m - 8 What is the w'th term of 215250, 430495, 645740? 215245w + 5 What is the j'th term of -5585, -11167, -16749, -22331? -5582j - 3 What is the c'th term of 363, 747, 1169, 1635, 2151, 2723, 3357? c*3 + 13c*2 + 338c + 11 What is the l'th term of -596, -606, -622, -644? -3l2 - l - 592 What is the o'th term of 803, 841, 879, 917, 955, 993? 38o + 765 What is the q'th term of -410, -380, -342, -296, -242, -180? 4q2 + 18q - 432 What is the o'th term of 4597, 18254, 40971, 72754, 113609, 163542, 222559? o*3 + 4524o*2 + 78o - 6 What is the z'th term of -2456, -4914, -7372, -9830, -12288, -14746? -2458z + 2 What is the g'th term of 1654, 1681, 1768, 1945, 2242, 2689, 3316, 4153? 5g*3 - 8g + 1657 What is the d'th term of 153, 1219, 4103, 9711, 18949, 32723, 51939? 151d3 + 3d*2 - 1 What is the b'th term of 49485, 49479, 49473, 49467, 49461, 49455? -6b + 49491 What is the h'th term of 1287, 1286, 1291, 1308, 1343? h*3 - 3h*2 + h + 1288 What is the s'th term of 294904, 294902, 294900, 294898? -2s + 294906 What is the p'th term of 3764, 3713, 3660, 3605, 3548, 3489? -p*2 - 48p + 3813 What is the f'th term of -613, -1302, -1991, -2680, -3369? -689f + 76 What is the v'th term of -385, -1172, -2443, -4204, -6461, -9220? -v3 - 236v*2 - 72v - 76 What is the g'th term of -517, -995, -1385, -1645, -1733? 7g3 + 2g*2 - 533g + 7 What is the g'th term of 331, 2244, 7433, 17536, 34191, 59036, 93709? 273g3 + 2g + 56 What is the f'th term of 9968, 10028, 10088, 10148, 10208, 10268? 60f + 9908 What is the h'th term of -1130, -2290, -3450, -4610? -1160h + 30 What is the z'th term of 47825, 47832, 47841, 47852, 47865? z*2 + 4z + 47820 What is the s'th term of 798, 1612, 2426, 3240? 814s - 16 What is the v'th term of 3764, 3776, 3798, 3836, 3896? v3 - v2 + 8v + 3756 What is the t'th term of 83, 176, 289, 434, 623? 2t3 - 2t*2 + 85t - 2 What is the b'th term of 42199, 42237, 42275? 38b + 42161 What is the u'th term of 23, 60, 101, 146, 195, 248, 305? 2u*2 + 31u - 10 What is the z'th term of 370, 744, 1108, 1456, 1782, 2080? -z3 + z2 + 378z - 8 What is the c'th term of 96, 174, 238, 288, 324, 346? -7c*2 + 99c + 4 What is the t'th term of 3443, 3410, 3381, 3356? 2t2 - 39t + 3480 What is the z'th term of -648, -2557, -5740, -10197, -15928, -22933? -637z2 + 2z - 13 What is the h'th term of 1724, 1778, 1930, 2228, 2720, 3454, 4478, 5840? 8h3 + h2 - 5h + 1720 What is the b'th term of -103, -125, -131, -115, -71, 7, 125, 289? b*3 + 2b*2 - 35b - 71 What is the h'th term of 217, 416, 593, 748, 881, 992, 1081? -11h2 + 232h - 4 What is the w'th term of 3913, 4443, 49	{ "pile_set_name": "DM Mathematics" }
0 - 840, 2p = 5p - 2n - 26 for p. 2 Solve l - l - 11 = 25z + 48 + 41, 0 = -8l - 2z for l. 1 Solve -m + z + 15 = 3z, -5z + 20 = 2m - 16 for m. 3 Solve 2135p - 2136p + 3o = 115, -3o + 105 = -6p for p. 2 Solve 5a + 0n + 2910 = 4n + 2902, 0 = -a + 5n - 4 - 6 for a. 0 Solve -5w + 286 + 208 = -3i + 424, 441i + 11028 = -3w for i. -25 Solve -4a - 1 = -b, -1103a + 1045a + 2b + 248 = 0 for a. 5 Solve 98h - 94h = 5w - 25, 1 = 34w - 4h - 53 for w. 1 Solve 332z + 62 = 2j + 322z, 4j - 49 = 5z for j. 6 Solve 77244r - 77249r + 25 = 0, i - 2r + 10 = -18 for i. -18 Solve 0 = 3u - 3, u - 1 + 12 = z + 6 + 6 for z. 0 Solve -75t + 38 = -73t - 7w, -5t + 41t - 192 = 3w for t. 5 Solve 3l = 4n + 5l + 8l + 12 + 38, 0 = n - l - 5 for n. 0 Solve 3b + 0h + 2h + 297 = -h, -35933b + 35930b = -2h - 183 for b. -3 Solve -2069 = 8g - 1533, g + 39 + 57 = 29u for u. 1 Solve 68 = j + 322c - 635c + 310c, -3c - 58 = 4j for j. 2 Solve z - 5x - 36 + 52 = -56, 171 = -z + 3x + 129 for z. 3 Solve -3x = -4u - 22, u - 80 = -3x + 85 - 163 for x. 2 Solve -g + 3 = 4h, -3g + 7h = 536 - 583 for g. 11 Solve -4j - 27352g + 27348g = 32, 3j = 7g - 64 for j. -12 Solve -2l - 9 - 2 = -16d + 3 - 0, 4d = 25l - 217 for d. 2 Solve 28c + 178 = 18l - 25c + 57c, -77 = 2l - c for l. -5 Solve -3q = 5d + 66 - 25, 24514d = 24519d + q - 3 for d. 5 Solve 20 = -3d + 2m, -3d - 5m + 2076 = 2089 for d. -6 Solve 6f + 2p + 2803 = 2459, -f - 2p - 64 = 0 for f. -56 Solve 5p + 42 = 2t + 19 - 27, 0 = 8p - 9p + 8t - 48 for p. -8 Solve 2f - 50 = 18x - 8x, -16x - 98 = -5f for f. 10 Solve -5f = 5g + 65, -18g - 4f - 82 = 91 - 135 for g. 1 Solve 3q + 31 + 10 = 7v, 21q - 17q = 10q + 54 for v. 2 Solve d + 7t - 9t - 3t = 13, -7d = 16t + 62 for d. -2 Solve 26f = 17j + 169, -3f + 57j - 62j = 71 for f. -2 Solve 0 = 31t - 7a + 92, -a + 17 = -3a - 1 for t. -5 Solve 0 = 11u + v + 33, -3v + 6 = -3u - 3v - 2v - 3 for u. -3 Solve 2164h - 2168h + b = 19, -22 = 4h - 2b for h. -4 Solve -3w = -1035a - 5127, 4w - a + 4a = 30 - 109 for w. -16 Solve 11x - 3r - 8 = 14x + 73, -67r + 299 = x - 2x for x. -31 Solve 109 = -12c + 4964m - 4965m, 5m + 41 = -4c for c. -9 Solve -19l + 3m + 79 + 90 - 252 = 5m, 0 = -2l + 5m - 40 for l. -5 Solve 4i - 178 = 21n - 177, -3i = -n - 45 for i. 16 Solve -7v + 461 = 419, -6m + 2v - 6 = 0 for m. 1 Solve -4v - 15v = 2u - 295, 5v - 2v + 3593u - 35 = 3595u for v. 15 Solve 2k + 2q + 5178 - 5248 = 0, -k + 3q - 85 = 0 for k. 5 Solve -5b + 23g = -228, -g + 184 = 4b - b + 210 for b. -5 Solve -416551 = 4u - 5v - 416590, -5u - 4v + 100 = 0 for u. 16 Solve -3p - 2823i = -2827i + 143, i = -2p + 22 for p. -5 Solve -303h = -2b + 2b - 2b - 265h - 188, -12b = -h - 7 for b. 1 Solve 10v + 39 = -3t + 13v - 10v - 18, -4t - 44 = 4v for t. -5 Solve 0 = 6x - 2k - 28, k - 161 = -160 for x. 5 Solve 2c + 3j + 17 = 4j, -1124457c + 1124461c - j = -27 for c. -5 Solve 3n + 703884c - 703889c - 37 = 0, -9n - 2c = -26 for n. 4 Solve 0 = -5d + 4g + 269, -168 - 162 = -5d + 5g for d. 5 Solve -5t + 5 = -2g, -3t + 1027g - 1023g = 11 for t. 3 Solve 24z - 21z + 105 = -19p, -z + 64p - 19 = 65p for z. -16 Solve -2s = 3i - 11, 32s + 56 = -6i + 34s for i. -5 Solve -5z + 2x - 27 = 0, -132z - x - 14 = -129z for z. -5 Solve 4u + 309885s = 309881s - 88, -s + 20 = -u for u. -21 Solve 3h + 63 = 8z, -z - 5z - h + 5 = -0 for z. 3 Solve -7g + 0g + 33d = -7g - 13d + 506, 0 = -g + 5d - 52 for g. 3 Solve -3u + 74 = 2h, 3u - 203h = -199h - 184 for u. -4 Solve 7g - 194u - 115 = 2g - 199u, -14u = 4g - 292 for g. 3 Solve -1 = -h - 5w + 2 + 3, -h - 6w = -2 for h. 26 Solve 0 = -2p + 30z - 25z - 151, p - 4z + 122 = 0 for p. 2 Solve 24602r = 3y + 24600r - 61, 3y = 6r + 45 for y. 23 Solve 2u + 14 = -2z, -2z - 188579 = -u - 188580 for z. -2 Solve 352 = -1588j + 1584j - 101o, 2j - 1 = -2o + 17 for j. 13 Solve -9y + u + 1 = 11y - 23y, 0 = -3y - 23u - 23 for y. 0 Solve -9u + 7u + 0 = 16v + 64, 30u + 2v - v = -4 for u. 0 Solve 2c = -159 + 126 + 69, 3c - 90 = -9f for f. 4 Solve 2a + 135w + 11 = 136w, -20a + 3w = 103 for a. -5 Solve 5y - l + 380 = 443, 0 = -10y + 5l + 120 for y. 13 Solve 3c = -49y + 46y + 84, 7c = 168 for y. 4 Solve -d + 100 = -3c + 213, 2d + 10c = 2c + 278 for d. -5 Solve 0o - 41 = 24j - o, 2j + o + 5 - 5 = 15 for j. -1 Solve 41 = -8w + 3s, -65w + 68w = -2s - 6 for w. -4 Solve -21 + 15 = j + 5n - 107, 2n = -28j + 68 for j. 1 Solve -19c = -10c - n - 42, 11c - 7 = 9c + 3n - 2n for c. 5 Solve -3i + 4 = 11b, 4i + 104 = 4b + 16 for i. -17 Solve -z - 1746 = -4q - 2005, -57z = 4q + 85 for q. -64 Solve -3j - 156 + 12 = 2g, 3g - 4g - 3j = 37 + 110 for g. 3 Solve 11o = 5o + 5o + 2z - 5, -5o = -2z - 7 for o. 3 Solve -13 - 11 - 15 = -4s + 5m, 2s + m = -5 for s. 1 Solve 18 = -6h - 14v - 65 + 37, -17 = 3v - 2 for h. 4 Solve 6m - 42 = -11m + 26m - 10m + 16t, 0 = 5m - 5t + 15 for m. -6 Solve -3f - m = 7428 - 7277, 0 = 5f - 5m + 285 for f. -52 Solve 5w + 57 = -5a + 122, 2a + 10a - 156 = -w for w. 0 Solve 195k - 266k + 2g - 12 = 0, g = k + 6 for k. 0 Solve 2i + 10 = 0, 0 = -p + 2549i - 2547i + 7 for p. -3 Solve -2p = -r - 1, -37 - 141 = -26p - 30p + 238r - 240r for p. 3 Solve -99 = -4c + 3c - 4528d + 4522d - 380, 3c - d = 50 for c. 1 Solve -993r - 21q - 75 = -996r, 0 = -4r + 4q + 4 for r. -3 Solve -399y + 400y - n + 9 = 0, -5y = -n + 45 for y. -9 Solve 5687j - 6 = 5691j - 3x, -18 = -4j - x for j. 3 Solve 6p - 13p + 4p - 27 = 3n, -16n = -26p + 278 - 8 for n. -12 Solve -5p = -g + 203 - 119, 11 = 2g - p - 13 for g. 4 Solve -2s + 0s - 622 = -0s + 14n, -3s - 7n = -5s + 323 for s. 4 Solve -2p - 69w - 36 = -76w, -w + 3 = -9p + 4w for p. 3 Solve -10 = u - 6k, 297 - 282 = u + 19k for u. -4 Solve -3698u = 4w + w - 3688u + 75, 0 = 3w + 2u + 9 for w. 3 Solve 1212 = 2t - 5i + 1116, -28t - 3i + 30 = 0 for t. 3 Solve -6u - 4o - 38 = -u, 10u - 2o + 48 - 42 = 0 for u. -2 Solve 0 = -538p + 534p - 4a + 60, -3p = -10a + 124 for p. 2 Solve -3j + 31 = -j + 3d, -59 = -3j - 2d for j. 23 Solve -7q + 41 = o, -14o + 21o = 6q + 12o - 60 for q. 5 Solve 92 = -5d - 2240b + 2286b, -10 = 5d - 5b for d. 0 Solve 5r + 1282408 = -4y + 1282423, -3r = 10y - 85 for r. -5 Solve 9u + 72t - 1638 - 1209 = 10u - 754, 0 = -u - t + 24 for u. -5 Solve -m + 2l = 3m + 17 + 103, 5m - 8l + 151 = -5l for m. -29 Solve 89t = 39t + 47t + 80f + 6, 5t - 10 = -4f for t. 2 Solve -38 = -173n + 177n + 6j, -5n = 4j + 23 for n. 1 Solve 104 - 287 = 9s - 3u, -10s - 2u + 101 = -15s for s. -21 Solve 56357y - 2g = 56353y - 32, y = -2g + 12 for y. -4 Solve -3w + 3p = -7w - 83345 + 83396, -p = -9w + 76 for w. 9 Solve -h - 110i = 507i - 3702, 7 = h + 3i - 8 - 3 for h. 0 Solve 3z - 2o + 184657 = o + 184690, -o - 11 = -7z for z. 0 Solve i + 7r = 9, 21i + 6i - 26i + 8i + 4r = -37 for i. -5 Solve 0 = -3025z + 3030z + 2a - 14, 0 = -4z + 3a + 2a - a for z. 2 Solve -16u = 3w - 21u - 79, -28w + 23 + 19 = 3u for w. 3 Solve 6w + 8 - 19 + 58 = -5h + 3w - 42, 115w + 361 = -h for h. -16 Solve -2d = 10a - 102, -144d + 149d + 639a - 24 = 635a for d. -4 Solve 4m - 2b = 191 + 177 - 352, 9 = 3m - 3b for m. 5 Solve 8322i + h - 243 = 8324i - 248, 0 = -5i - 5h + 5 for i. 2 Solve 3j = -2g - 57, 12011j + 3g + 76 = 12007j for j. -19 Solve -2782q + 2785q = -5i - 21, 4q = 2i - 2 for q. -2 Solve -16x - 2j + 75 = -9, 2j - 209 = -205 for x. 5 Solve 5c + r + 203 = 28c, c - 6r = -2r - 7 for c. 9 Solve 3n - 1779s = -1781s - 5, 3n + 3s = -6 for n. -1 Solve -2c - 7o + 65 + 95 = -2c + 17o - 8o, 18 = -16c + 5o for c. 2 Solve 14v + 96s = 9v + 40s - 66, 0v + s = -v - 4v - 11 for v. -2 Solve -2f + 7 = -14g - 51, 5f = 16g - 18g + 34 for g. -3 Solve 0 = 5s - 6s - 2r + r - 8, -1309 = 4s + 475r + 1078 for s. -3 Solve -3s - 47b + 8b + 36b = -4s - 18, 9b = s + 6 for s. -24 Solve 56d - 41 + 20 = 51d - 7l, -3d + l = 3 for d. 0 Solve -16 = -4*i +	{ "pile_set_name": "DM Mathematics" }
+ 23m + 106. Let f be j(-4). Is (-47)/f + 121/2 a multiple of 6? True Let f be (-3)/4 - 6964/16. Let d = -376 - f. Does 12 divide d? True Let c be ((-3)/(-12) - 0)/((-2)/(-40)). Suppose cw = -8 + 8. Suppose 16a - 20a + 60 = w. Is a a multiple of 3? True Suppose -4v + 12194 = 5d + 1065, -2d + 2786 = v. Is 208 a factor of v? False Suppose -7s + 82s - 253680 = -65s. Does 12 divide s? True Let t(i) = i*3 + 2i*2 - 11i + 9. Let o be t(2). Suppose p = 2p - 2u - 257, -5p + 1285 = ou. Is 30 a factor of p? False Let u(r) = 181r2 + 136r - 1921. Does 179 divide u(13)? False Let z(l) = 2006l + 5. Let p be z(-1). Let a = -1272 - p. Is a a multiple of 26? False Let l = -223 - -241. Let w(i) = i3 + 10i*2 + 10i + 12. Let r be w(-9). Suppose 5n - y = -5y + 45, ry = -2n + l. Does 9 divide n? True Let z(w) = 1218w + 13292. Is z(13) a multiple of 36? False Let n be 20/(-6)(8 - 184/20). Is (n - -46)(-2)/(-4) a multiple of 25? True Let n = -13721 - -18591. Does 10 divide n? True Suppose -4s + 7s - 5n = 24, 4s = 3n + 21. Suppose 2j + 4h = 4j - 826, sj - h = 1234. Is j a multiple of 49? False Is (24770/15)/((-18)/(-27)) a multiple of 14? False Let s be (4/(-5))/((-2)/180). Suppose 2x = 5m + 48, 0 = -4x + x + m + s. Suppose xw - 26w + 194 = 0. Does 20 divide w? False Suppose 2p + 58p - 540 = 0. Let c(q) = -q3 - 10q*2 + 8q - 6. Let a(w) = w*3 + 1. Let v(i) = -2a(i) - c(i). Is 5 a factor of v(p)? False Let d(n) = -n*3 - 7n*2 - n + 12. Let a be d(-5). Let t(y) = -2y*2 - 9y + 3. Let p be t(-9). Let o = a - p. Does 9 divide o? True Suppose -2p - 38 = -4a, 5a - 48 = 2p + 2. Let c(w) = 29w - 130. Is c(a) a multiple of 49? False Does 14 divide ((-56028)/(-464))/((-6)/(-496))? True Suppose 13a - 19859 = 6154. Does 69 divide a? True Let m = 3498 - -7158. Is 211 a factor of m? False Let h(c) = 5c2 - 6c + 41. Let x be h(-8). Let t = x + -274. Is 13 a factor of t? False Suppose -7582z + 7579z + 2976 = 0. Is 3 a factor of z? False Suppose -b + 20239 = 5o, -6246 = -o - 7b - 2171. Is 71 a factor of o? True Suppose 139r - 152r = -3965. Is r a multiple of 3? False Suppose -36w + 1124 + 32572 = 0. Does 36 divide w? True Let i be (6 - (-108)/(-16)) + (-1119)/(-4). Suppose -i = -3u - 24. Is 17 a factor of u? True Let t(x) be the third derivative of -x*5/30 - 2x*4 + 19x*3/3 + 15x*2 + 1. Is 7 a factor of t(-23)? True Let t(a) = -9a*3 - 48a*2 - 13a + 4. Is t(-9) a multiple of 23? False Let o be (-6 + 5)/(-3 + 428/142). Let s = 71 + o. Suppose s = -u - m + 29, 4u + 3m - 137 = 6m. Does 16 divide u? True Suppose 38x = -25547 + 333119. Is x a multiple of 238? False Suppose -2j + 5 = 2v - j, -4v - 4j = 0. Let n be (-2 - (-5)/v)/((-2)/8). Suppose nt = -5g + 269, g - 34 = 3t + 16. Does 26 divide g? False Let k(o) = o3 - 9o*2 - 7o + 62. Let r be k(9). Is 9 a factor of 232(26/104 + r/(-4))? False Let a = -587 - -51. Let x = 598 + a. Is 13 a factor of x? False Let g be (0 + 0)(26 + -25). Suppose -6x + 2k = -3x - 856, -4x + k + 1148 = g. Is x a multiple of 16? True Let u(a) = 78a3 + 3a - 2. Let f be u(1). Suppose 0 = 9w + 1159 - f. Let r = -86 - w. Is r a multiple of 13? False Suppose -6c + 3c = -3i - 9, 2c - 13 = -5i. Suppose 2b - 420 = -cw + 314, -w + 188 = 2b. Is 26 a factor of w? True Is ((-3 + 2)-84)/(194/1067) a multiple of 6? True Let j(p) = 4p. Let a be j(12). Does 20 divide (-35)/((-246)/a - -5)? True Let d = 712 - -41. Suppose -5y - 3w + d = -5952, -w = 3y - 4019. Does 15 divide y? False Let f(o) = o*2 + 4o + 3. Let x be f(-3). Let t be (-16)/104 + 314/13. Suppose x = -tr + 30r - 216. Is 11 a factor of r? False Suppose t + 3 = -0y - 3y, y + 1 = -2t. Let p = -664 + 667. Suppose a + ta + pm = 160, -4a = m - 684. Does 30 divide a? False Suppose 3y = 3p - 258, 2p + 0y = y + 177. Is p a multiple of 2? False Let i(k) = -k. Let x be i(-5). Suppose -2p = -xp + 6. Suppose pb + 48 = 10b. Does 3 divide b? True Let t = 52 - 134. Let a = t + 148. Is 22 a factor of a? True Suppose -1618668 = 8868o - 8904o. Is 39 a factor of o? False Suppose u = -45z + 52z - 362200, -5z - 5u = -258760. Is 264 a factor of z? True Suppose -2s = 5s - 21. Suppose 5f + 5g - 40 = 0, sg = 2f + g + 4. Suppose 0r - fr + 59 = -5w, 0 = -3w - 3. Is 4 a factor of r? False Let x = -2313 - -4553. Is 160 a factor of x? True Let c = -76 + 48. Let i = -22 - c. Does 9 divide ((-45)/i)/(-3 + 85/30)? True Let m(k) = 12k2 - 612k + 195. Does 121 divide m(58)? False Let r(b) = -29548b - 20. Does 50 divide r(-1)? False Let x = -64 - -150. Suppose 81c - xc + 1305 = 0. Is c a multiple of 29? True Let b be 21/15 + 2/(-5). Let y(t) = 1 + 3t + 7 + 0 + 134t2 - 6 - 4. Is 31 a factor of y(b)? False Let d(k) be the second derivative of k5/20 - 7k*4/6 + 11k*3/3 + 13k*2/2 + 46k. Let p be d(11). Is p/8(-5 - 3/1) a multiple of 36? True Let s be (-15)/((105/(-20))/7). Let n be (19 - -3)/((-5)/s). Let j = n + 160. Is 25 a factor of j? False Let x = -250 - -259. Let q(z) = -z2 - 5z - 3. Let v(g) = -2g2 - 11g - 7. Let l(d) = -13q(d) + 6v(d). Is l(x) a multiple of 23? True Suppose -2r + 19039 = -3j - 21341, -3r + 3j + 60579 = 0. Is r a multiple of 78? False Suppose 0 = 2j - 4t - 0t - 12, j - 2 = t. Does 2 divide (-66)/(-11)(3/2 - j)? False Suppose -5o + 0j + j = 3, 0 = -3o - 5j + 15. Suppose r + 142 = 3p, -2p + op + 92 = -2r. Is p even? True Let m(h) = -14h2 - 34h + 118. Let c(i) = 5i2 + 11i - 40. Let k(r) = -8c(r) - 3m(r). Is 9 a factor of k(10)? True Let c = -926 + 409. Let a = c + 316. Let b = -80 - a. Does 19 divide b? False Suppose -i + 263 = -3d - 247, 3i + 180 = -d. Let y(q) = -12q2 + 2q - 5. Let o be y(3). Let r = o - d. Is 15 a factor of r? False Suppose 441 = d + 3h, 0d - h = 2d - 892. Let b = d + -239. Is 9 a factor of b? False Let a(o) = -11o + 9. Let n(q) = -44q + 47. Let g(r) = -11r + 12. Let v(f) = -22g(f) + 6n(f). Let l(s) = 5a(s) - 3v(s). Is 5 a factor of l(2)? False Let h(p) = p*2 - 7p - 15. Let d be h(9). Suppose -4m + 8 = 0, dx = 4m - 90 - 152. Does 32 divide (-12)/x + 6648/52? True Let r = -100 - 206. Let t = r - -592. Does 6 divide t? False Suppose 3285 - 14865 = -10k. Suppose 0 = -c - 0c + 3y + 225, 5c - 4y - k = 0. Is 18 a factor of c? True Let g = 87 + -83. Let y be ((-20)/g - -4)-3. Suppose -yj - 3h + 63 = 0, -2h = j + 2h - 30. Is 3 a factor of j? True Suppose -28g = 97g - 798875. Is g a multiple of 77? True Let u(r) = 5r*2 - 15r - 16. Let s be u(-1). Suppose 3g + 3i - 178 = 1475, si = 2g - 1120. Is 12 a factor of g? False Let s(g) = 6g - 16. Let y(h) = 6h - 32. Let x(m) = 5s(m) - 3y(m). Let t(k) = -k*3 - 6k*2 - 6k - 2. Let f be t(-5). Is x(f) a multiple of 13? True Let o = -14542 + 20128. Is o a multiple of 7? True Is 46 a factor of (-7)/2 + (-24)/288-5562? True Let f(d) be the first derivative of 17d*2/2 - 5d - 35. Let y be f(6). Suppose 0 = 2s - 3r - y, 2s = -r - 2r + 67. Does 28 divide s? False Suppose -404w + 397w = -22764. Suppose -26304 - w = -36q. Is 52 a factor of q? False Suppose -4m + 8m + 2g - 13976 = 0, 3483 = m - 5g. Is m a multiple of 101? False Suppose -55z + 73z = 64170. Suppose z = -305m + 310m. Does 32 divide m? False Suppose -z + 376 + 294 = 0. Let w = -502 + z. Is 55 a factor of w? False Let f(q) = 7q + 72. Let p be f(0). Suppose -p = -4z - 0z. Suppose 21d - zd - 6 = 0. Is d a multiple of 2? True Suppose -1192 - 1269 = -5f + h, -5f = -4h - 2464. Is 17 a factor of f? False Suppose 14132 = 4c + 4g, 4c - 8896 = -2g + 5236. Is c a multiple of 83? False Suppose -7f + 2c = -6f - 224, 0 = 2f + 3c - 476. Is f a multiple of 11? False Suppose -26b + 167674 = -26b + 26b. Is 16 a factor of b? False Suppose -73710 = -47p + 8p. Does 21 divide p? True Suppose -m = -3a + 68, -2m - 188 = m - 5a. Let g be m/(-24) - (-4)/6. Suppose -2z + gr + 150 = 35, 3r - 150 = -3z. Is 18 a factor of z? False Suppose 14g = 9g + 5f + 3885, -2g = f - 1545. Does 19 divide g? False Suppose -6i - 18481 = -24i + 6323. Is i a multiple of 107? False Is 15 a factor of (-1260)/1512 + ((-345)/54)/(2/(-4674))? False Is ((4615/2)/5)/(11/(112	{ "pile_set_name": "DM Mathematics" }
+ 4y2 - 2y*2. What is z(k(r))? -5r*4 Let z(o) = -o. Let i(h) = h - 157. What is z(i(d))? -d + 157 Let j(w) = 3w*2. Let t(q) = -309q*2. Determine t(j(a)). -2781a4 Let a(d) be the second derivative of -d4/12 - 4d. Let k = 4 + -3. Let p(b) = -k + 1 - 2b. Give a(p(r)). -4r2 Let f(j) = 8j + j - 2j - 3j. Let y(i) = -8i2. Calculate y(f(g)). -128g*2 Let n(q) = 401q. Let l(b) = 2b2. Determine n(l(d)). 802d*2 Let o(m) = -3m*2. Let w be 1032/(-40) - (-2)/(-10). Let n(c) = -8c*2 + 13c. Let l(z) = -2z2 + 3z. Let d(x) = wl(x) + 6n(x). Calculate o(d(a)). -48a4 Let q(h) = h - 1. Suppose 2y = -2i, -y - 1 + 5 = 2i. Let x(u) = -7u + 4. Let p(t) = iq(t) + x(t). Let g(z) = z. What is g(p(d))? -3d Let b(x) = -x + 6. Let n(m) = -14m + 91. Let p(l) = -91b(l) + 6n(l). Let q(c) = -5c2. Determine q(p(v)). -245v*2 Let n(j) = 2j*2. Let m = -4 + 4. Let d(f) be the second derivative of 2f - 1/3f3 + 0 + mf*2. Calculate d(n(t)). -4t*2 Let c(y) be the third derivative of 7y*2 + 0y + 1/12y4 + 0y*3 + 0. Let t(q) = 4q. Give t(c(n)). 8n Suppose -4 = 2n - 4n. Let j(m) = -3m2 + m2 + 4mn. Let r(f) = 5f + 0f + 0f. Give r(j(w)). 10w2 Let r(k) = k2. Suppose 2t - 4s = -7s + 21, 26 = 2t + 4s. Let a(x) = 0x2 - tx*2 - 4x*2 + 0x*2. What is r(a(z))? 49z4 Let u(j) = -j2 + 2. Let q(v) = 3v2 - 5. Let z = 1 + -11. Let m(x) = zu(x) - 4q(x). Let c(o) be the second derivative of -o4/4 + 4o. Determine c(m(r)). -12r4 Let y(n) = -10n. Let g(a) = -3a2. Calculate y(g(x)). 30x*2 Let y(o) = o. Let f(h) = 91h*2. Determine f(y(m)). 91m*2 Let o(n) = 3n - 4n - 2n. Let g(r) be the second derivative of -r*4/24 + 2r*2 + r. Let s(k) be the first derivative of g(k). Give s(o(f)). 3f Let o(i) be the second derivative of i*3/3 - 17i. Let j(x) = -11x2. Calculate j(o(t)). -44t*2 Let j(z) = 28z*2. Let b(o) = -2o - 5. Let i(c) = -3c - 8. Let k(f) = 8b(f) - 5i(f). Calculate j(k(l)). 28l*2 Let t(x) = 4x2. Let y(q) = -q2 - 2q. Give y(t(j)). -16j*4 - 8j*2 Let q(n) be the third derivative of 3n*4/4 + 14n*2. Let x(j) = 2j. Calculate q(x(l)). 36l Let v(d) = 33d - 2. Let s(g) = g*2. Calculate v(s(j)). 33j*2 - 2 Let s(y) = 1297y. Let z(m) = 2m2. Determine s(z(t)). 2594t2 Let z(g) = g2 - g. Let n(m) = -5m2 + 3m. Let u(s) = n(s) + 3z(s). Let i(a) = -6a*2. Determine i(u(f)). -24f*4 Let c(l) = 3l*2 - 2l2 + l2 - l*2. Let b(h) = 2h*2. Determine b(c(p)). 2p*4 Let c(m) = 5m. Let z(o) = 58o2 - 2o. Determine c(z(f)). 290f2 - 10f Let q(j) = 3j. Let b(u) = -78u*2 - 22u. Calculate q(b(c)). -234c2 - 66c Let t be 0 - ((-2)/1)/2. Suppose 23 = 3a + 4n, 15 + 7 = 2a + 4n. Let l(v) = a - t + v2. Let c(y) = y2. Calculate l(c(w)). w*4 Let x(z) be the first derivative of 5z*2/2 + 4z + 2. Let w(v) = v + 1. Let a(b) = -4w(b) + x(b). Let d(s) = -7s*2. Calculate d(a(n)). -7n*2 Let f(j) = 3j. Let k(u) be the first derivative of -3u2/2 + 2. Determine f(k(w)). -9w Let r(n) = -8n - 3. Let z(u) = 19u*2 - 25u*2 + 7u*2. What is r(z(x))? -8x2 - 3 Let p(o) = o2 - 156. Let i(n) = -16n2. What is i(p(s))? -16s*4 + 4992s*2 - 389376 Let t(q) = 2q*2. Let s(y) = -19y. Let f(r) = -9r. Let v(h) = -9f(h) + 4s(h). Give t(v(c)). 50c*2 Let s(t) = -4t*2 - 18. Let m(l) = 62l*2. Calculate s(m(j)). -15376j*4 - 18 Let r(d) = -10 - 3d*2 + 10 + 0d*2. Let z(q) = 3q*2. Give r(z(t)). -27t*4 Let m(t) be the second derivative of 0t*2 - 4t - 11/6t3 + 0. Let n(z) = -2z. What is m(n(s))? 22s Suppose 0o - 3o = -9. Suppose od = -4g + 5, 10 = 3d - 3g - 2. Let n(y) = -d + 4y + 3. Let b(p) = -2p2. What is b(n(h))? -32h*2 Let c(k) = -k - 1. Let y(f) = -2f + 7f - 2f + 4. Let z(r) = 4c(r) + y(r). Let n(x) = 3x. Give n(z(v)). -3v Let l(k) = -k2 - 5k - 4. Let g be l(-3). Let i(b) = -g + 2 - 3b2. Let z(t) = t2. Calculate z(i(c)). 9c*4 Let q(a) = a. Let k(g) be the second derivative of 2g3 + g2 + 5g + 6. What is k(q(m))? 12m + 2 Let o be (-1 + 1)/(-10 - -8). Let b(g) = -2 + g + 2 + o. Let m(c) = -c*2 - 2c. Let d(s) = -s. Let q(k) = -2d(k) + m(k). What is b(q(h))? -h2 Let q(w) = -2w*2 + 9. Let a(x) = 10x*2. Calculate a(q(i)). 40i*4 - 360i*2 + 810 Let r(c) = -8c - 5. Let f(z) = 33z + 21. Let t(s) = -5f(s) - 21r(s). Let n(g) = -3g. Give n(t(p)). -9p Suppose 7b + 30 = 2b. Let h be (-14)/b - 3/9. Let g(f) = f2 + 4f2 - fh - 3f2. Let s(x) = x. Give s(g(m)). m2 Let o(y) = y2. Suppose -25 = -j - 4j + 3i, -j = -5i - 5. Suppose 2r + 6 = -0d - 4d, d - 15 = jr. Let v(s) = ds + 0s + s. Calculate o(v(z)). z*2 Let t(r) = -2r*2. Let y(k) be the first derivative of -14k*3/3 - 23. Give t(y(l)). -392l4 Let y(j) = -j2. Suppose -5m = 0, 2s + 3s = -3m + 10. Let o(z) = 14 + sz2 - 14 - 3z2. Calculate y(o(a)). -a4 Let y(c) = 6c - 7c + 8c. Let q(o) = o2. Give q(y(x)). 49x*2 Let k(b) = 6b*2. Suppose 2l = 5l - 96. Let v(y) = -32 - 2y*2 + l. Calculate k(v(i)). 24i*4 Suppose 4q - c + 5 = 0, 4 = 4q + 2c - 6c. Let x(n) = 8n - 9. Let o(a) = -2a + 2. Let i(s) = qx(s) - 9o(s). Let k(z) = -4z*2. Give i(k(b)). -8b*2 Let l(k) = 2k. Let f(z) = 17z2 - 5. Let q(s) = -18s*2 + 6. Let i(c) = -6f(c) - 5q(c). Determine i(l(m)). -48m*2 Let y(s) = 83s*2. Let b(p) = -4p. Determine y(b(j)). 1328j2 Let l(w) be the second derivative of -w4/24 - w2/2 + w. Let m(q) be the first derivative of l(q). Let r(n) = -103 + 103 + n2 + 5n*2. Determine r(m(g)). 6g*2 Let l(d) = d. Let v(x) = -6871x*2. Give v(l(r)). -6871r*2 Let t(l) = -4l - l - 5l. Let b(f) be the first derivative of f5/60 + 11f*3/3 + 10. Let v(m) be the third derivative of b(m). What is t(v(s))? -20s Let y(i) = 10i2 - 12i. Let q(d) = d*2 - d. Let z(v) = -12q(v) + y(v). Let w(s) = -5s. Give z(w(c)). -50c*2 Let d(h) = -225h - 2h2 + 225h. Let i(w) = 2w2. Determine d(i(s)). -8s*4 Let g(f) = f. Let v(c) = 5280c - 1. Give g(v(p)). 5280p - 1 Let h(c) = -c. Let w(b) = -2 + 3 + 8b*2 - 1. Calculate w(h(u)). 8u2 Let s(m) be the third derivative of m6/720 + m*4/8 + 3m*2. Let z(l) be the second derivative of s(l). Let j(h) = 2h. What is j(z(u))? 2u Let r(v) = -v2 + 1. Let p(z) = 6z*2 - 7. Let n(u) = -2p(u) - 14r(u). Let o(g) = g2. Determine n(o(c)). 2c*4 Let s(x) = -16x*2. Let i(n) = 3n - 4. Let y(c) = 4c - 5. Let q(t) = -5i(t) + 4y(t). Give q(s(m)). -16m2 Let i(q) = -q2. Suppose 2j = 3j - 3, 2b = 2j. Let k(d) be the first derivative of -2 + 0d2 - 2/3d*b + 0d. Give k(i(a)). -2a4 Let r(i) = -7i. Let n(d) be the second derivative of -d*3/3 + 6d. Determine r(n(v)). 14v Let n(x) = 9x + 3. Let u(a) = -a. Let t(w) = 6w. Let z(b) = -t(b) - 4u(b). Determine n(z(l)). -18l + 3 Let p(x) = 4x - 6. Let u(d) = -5d2. Give u(p(n)). -80n*2 + 240n - 180 Let h(z) = -20z. Let k(p) = 28p. Calculate h(k(q)). -560q Let m = 26 + -15. Suppose 2p - m = -w - 0w, 3p - 14 = -w. Let u(o) = 3o + po - 5o. Let y(b) = 2b. Give u(y(r)). 2r Let v(q) = 16q. Let m(f) = f. Let c(y) = -36m(y) + 2v(y). Let o(r) be the second derivative of 0r2 + 0 + 1/3r*3 - 2r. Give o(c(i)). -8i Let c(g) = g - 1. Let t(f) = -4f - 6f + 4 + 4. Let x(a) = 8c(a) + t(a). Let v(r) = -3r2. What is v(x(y))? -12y*2 Suppose -i - 20 = -5h - 0h, 15 = h + 2i. Let v(l) be the third derivative of 0l4 + 1/60l*h + 0 + 0l + 0l3 + l2. Let z(r) = 2r. What is z(v(s))? 2s2 Let x(c) = 59c + 2. Let v(s) = -17s. Give x(v(g)). -1003g + 2 Let y(j) = -4j2. Suppose 0 = -2a - 5p - 20 - 0, 0 = -4a - 4p - 16. Let o(d) = -6d + 4d + ad. What is y(o(x))? -16x2 Let s(f) = -12f + 12f + 6f2. Let d(i) = i2. Determine d(s(h)). 36h4 Let s(m) = -2m. Let n(z) be the second derivative of -43z4/12 - 36z. Calculate s(n(b)). 86b2 Let y(g) be the second derivative of -g4/4 + 5g. Let r(q) be the second derivative of -q*4/12 + 2q. Determine y(r(w)). -3w4 Let p(d) = -4d2. Let y(t) be the second derivative of -t4/12 - 7t. Give p(y(j)). -4j**4 Let l(f) = -f. Let m(n) be the second deriva	{ "pile_set_name": "DM Mathematics" }
is (-310/285)/((-316)/129086)? 43 Evaluate 10/36182490/(-27650). -11/6 What is 4/(12-2)1664/(-128)? 13/6 Calculate (5/(-8))/(((-75)/45)/((-30)/(-60))). 3/16 What is the value of (365700/(-207))/21266/10? -55 Evaluate ((-2024)/(-660))/((-421314)/(-1290)). 2/213 (237/(-790))/(5/(-150)) 9 What is the value of -56310/217-1(-6)/(-15)? 32 Calculate (-3255/(-54))/(19290/138888). 102 ((-182658)/(-21745))/(((-6)/(-9))/((-5)/3)) -21 Evaluate 14/18(-456)/266066. -44/5 What is the value of (-372467)/18939(-1)/(-2)? -59/6 What is ((-51)/((-1530)/(-1400)))/(54/(-81))? 70 Calculate ((-434)/(-2604))/((-2)/(-18)). 3/2 Evaluate ((-12)/8(-292)/4599)/((-2)/9). -3/7 Calculate 49/(-294)36300/(-110). 55 What is the value of (187/(-110))/((160/(-8))/400)? 34 What is (75/(-110))/(((-2)/(-5))/(212/(-265))-6)? -5/22 (-12)/10-3(-4650)/3720 -9/2 Evaluate ((247/39)/19)/(-5(-12)/396). 11/5 Evaluate ((-12)/9)/(104/13-126/3900). 25 Evaluate (-10)/(-380)20/6(-14)/((-770)/(-33)). -1/19 Calculate (-3)/3242(-1044)/(5394/62). 2/9 (((-135)/8)/(-45))/(((-81)/9)/216) -9 Evaluate ((-10)/(-11))/(2/22265/(-265)). -10 Calculate ((-111)/(-1517))/(((-150)/(-10))/60). 12/41 (8/(-14)((-50)/325)/(108/39))/2 1/63 Evaluate (27184/(-3398))/((24/21)/4). -28 ((30240/(-100))/(-72))/((-7)/70) -42 Evaluate ((-14)/(-3990)-3)/((-72)/(-60))-9. 3/38 Calculate 32/(-17760)30-1369. 74 (1326/517/(-168))/(12/64) -52/9 Calculate -129/(-162)7/((-784)/42). -1/4 Evaluate (4060/245)/(4(-18)/252). -58 What is the value of (((540/102)/9)/(424/901))/((-4)/(-18))? 45/8 What is ((-35)/6)/(-10(-25)/(750/(-5)))? 7/2 What is 12/(-126)3/4(-4)/42-3? -1/49 What is the value of (8/130)/((-18)/(-90)-3)? -4/39 Evaluate (15/(-50))/(3612/(-215)). 1/56 What is the value of (833/(-343))/((-248)/434)? 17/4 What is the value of ((-456)/(-12))/(-19)((-12)/(-10))/(42/(-80))? 32/7 Evaluate 154(-77)/((-38115)/135). 42 683/((-129087)/34020)(-2)/(-4) -90 Evaluate ((-783)/(-6525))/((-20)/375). -9/4 Evaluate (((3026/136)/(-89))/((-2)/(-6)))/(3/(-232)). 58 Calculate (-16/((-108)/(-78)))/((-556)/5004). 39 Evaluate ((-32)/2556)/1(-16)/(7936/(-372)). -2/213 What is 1/(-12)-10(-105)/35(-1166)/55? 53 (-37)/((-9916)/(-268))166 -66 Calculate (480/144)/(1235/342). 12/13 Evaluate (8/1)/(((-47160)/(-225))/(-131)). -5 Calculate 4875/(-260)(-18)/7266/285. 45 Evaluate 47/((-16544)/64)484/(-8624). 1/98 What is the value of ((-3)/(6/10))/((6/190)/((-222)/(-1406)))? -25 Evaluate (-16)/(-24120/2340). 13 (352/(-1320))/(28/(-30))(-21)/(-30) 1/5 ((-575)/92)/(15/(-24))(-1643)/(-265) 62 What is 10/(-15)(-580)/696? 5/9 What is the value of ((64/(-3))/4)/(15/1575(-430)/43)? 56 What is the value of ((-666)/1776)/(12/256)? -8 -46(-21)/(-147)14(-10)/(-40) -23 What is the value of (72/154)/(4826/(-4368))? -18/11 What is (-3)/(-18)-5220/(-416)? 5/12 What is (-2)/6-15/((-5)/1)? -1/3 What is the value of (-144)/1260(-15)/(-2)(-49)/45? 14/15 What is ((780/(-792))/13)/(455/273)? -1/22 What is the value of -54/20188/374-1? 4/17 Evaluate -4(-60)/(-48)108/15930. -2/59 Evaluate (-2)/(16/24)28/8412/(-102). 2/17 Evaluate (918/153)/((-216)/423). -47/4 Calculate ((-726)/234135)/(4/(-5))2(-30)/(-10). 1/43 Calculate ((-18)/484)/(5514/(-9190)). 5/2 Calculate (((-286)/4290)/(4/(-35)))/((-42)/(-80)). 10/9 23/(-12)6(-232)/4350 4/25 What is the value of ((-21)/70(-55)/(-2475))/(7/(-42))? 1/25 4368/(-312)(-774)/126 86 Evaluate ((-210)/630)/((-11)/(-2772)). -84 What is the value of (161/2806)/(1/(24/(-9)))? -46/5 What is the value of 210/(-1071)-34(-16)/1400-21? 8/5 What is (1-1)/(1647/(-8235)(-20)/(-408))? 102 Calculate (((-658)/(-1833))/(-14))/(12/(-26)). 1/18 What is (((-180)/(-15))/(-6))/((128/220)/16)? -55 Calculate (-46)/(16100/42)15. -9/5 Calculate (-259)/555(-78)/(-14). -13/5 What is -1265/((-19890)/(-272))? -32/3 9/6(-1092)/56304/171 -52 Evaluate (6412/(-1145))/((-112)/(-1280)). -64 Calculate (-3952)/1235(-1880)/(-64). -94 (3876/(-133))/(-51)-126 -72 Evaluate ((-7)/4)/(2(-3)/(-72)(-46)/(-92)). -42 Calculate 12(-1284)/192((-2)/6)/((-13)/(-52)). 107 ((16/1)/8)/((17/(136/(-16)))/16) -16 What is (53088/(-54747))/((-1)/(-11))? -32/3 What is the value of (2/(-6))/((-345)/5175)? 5 Calculate 8946/5112(-2)/28-16. 2 What is (4284/24)/51(-4)/32? -7/16 Calculate ((-1536)/(-48)10/(-4)(-1)/5)/(-1). -16 What is the value of (306/(-4590))/((-8)/300)46(-6)/5? -138 (4/101(-750)/60)/(7/(-161)) 115 Calculate (-1736)/2170(-195)/(-3). -52 What is the value of (2/(-4))/1470188132/(-470330)? 94 (3/368)/((-4)/20(-10)/(-44)) -44/3 Calculate 6-414542/(-10576). 33 What is (2/(-16))/((-6)/(-32))152/(-22)? 10/11 Calculate 14/(1/(((-160)/(-8))/20)). 14 What is ((-5)/((-855)/18))/((1/5)/(78/65))? 12/19 Calculate ((4/10)/((-1176)/735))/((-3)/(-696)). -58 1223/(-2208)(-100)/(-2)4 -25 What is the value of (118/462)/((-21)/(1911/(-598)))? 2/69 What is the value of (((-44)/(-99))/(16/33614))/(10/(-2))? -2/15 What is (5/(-10))/(44/2728)? -31 What is the value of (-53/(18/(-2)))/((43710/(-5499))/(-62))? 13 What is (-18)/(-1296)-610/5257? -1/90 Evaluate -44((-2162)/23)/(-94). -44 Evaluate (-38)/101956/37164. -1/5 1207/142-4(-25)/(-10) -85 Calculate (-153)/6(-78)/(-1872)16. -17 What is ((-2)/(-28)(-59)/((-3245)/(-6600)))/((-1)/(-7))? -60 What is 1/(-10)9(-6415)/69282? 1/12 (-30)/848232/3920 -3/4 Evaluate 128622/(-388)10/(-65). 51 Evaluate ((-170)/(-15))/((-30)/180)(-2)/8. 17 What is the value of 539/331740/(-203)(-6)/6? 140 What is (5/(40/(-4)))/(-9)40/(-200)-15? 1/6 Evaluate (-4)/6-19536/(-3528)49. -65 Calculate 156906/22745/((-30)/(-4)). 46 What is (425/1360)/(85/2652)? 39/4 What is (97/(26190/(-54)))/((-2)/(-230))? -23 Calculate 045/12(-52)/(-390). 0 Calculate ((28/49)/((-10)/(-105)))/(6/(-22)). -22 Calculate (-1)/(14(1421/116)/49). -2/7 (-2)/(-54)(-49)/(980/440)(-96)/16 44/9 Calculate (-2)/38(24/20)/(453/(-1510)). 4/19 What is (587/60)/(229/(-1832))? -58 Calculate ((305/300)/(-1))/(1/(-26)). 13 (-5576)/(-1476)(-198)/(-77)7 68 What is the value of ((3/45)/(-1))/(15(-1)/(-1305))? -29/5 What is the value of ((-2)/(-1))/(-2)(5/(-3))/((-96300)/(-1080))? 2/107 Calculate ((-1360)/(-31450))/(28/7)2/2-1. -2/185 What is the value of ((-1)/4)/(29/15022147/(-42))? 37 Evaluate 51513/(-6244)(-48)/4. 99 What is the value of 10/(-15)(-32274)/489? 44 What is (-9)/(18/(-28))-1475(-25)/4375? 118 Calculate ((563805/33150)/737)/((-6)/(-10)). 1/26 What is the value of ((-1)/(-7))/(4400/(-184800))? -6 Calculate 205/11344/14024/384. 123 What is (207/(-2)(-2)/18)/((-80)/(-480))? 69 What is the value of (-223705/(-715))/(6/21)? 38 546/156(-92)/14 -23 5746/(-10608)(-2)/(-26) -1/24 Calculate ((-1)/354/(-6))/((-14)/210). -45 (8/(-1314))/((-384)/(-1728)) -2/73 What is the value of (60/56)/((23760/308)/45)? 5/8 What is -3((-207)/45)/((-87)/(-145))3? 69 Calculate (-10)/(760/133)(-32)/(-196). -2/7 Calculate 15(-77)/(-924)(6/(-315))/1. -1/42 Evaluate ((-17)/(1224/(-176)))/(48/(-216)). -11 What is the value of (3/(9/7))/(((-714)/12)/(-17))? 2/3 (4/(-36))/(131/47160) -40 What is (-15)/(-3)465/46500? 1/20 Calculate (3/1(-2)/(-3))/(2415/345). 2/7 97592/(-26616)108/(-11) 36 What is the value of (-5)/(-10)((-36)/(-3))/(((-308)/3)/22)? -9/7 Evaluate (4/(-365))/((-4062)/(-10155)). -2/73 What is ((-12)/14)/((-5778)/(-8988))? -4/3 (-5)/((-15)/132)10644/(-9757) -48 Evaluate (-9)/217/(3213/(-252)). 6 What is the value of 99/630(-59)/(-885)? 33 What is the value of ((-116)/3915081)/(-6)? 1/25 What is ((1536/(-4440))/64)/(1/10)? -2/37 What is (-21(-3)/(-33))/(17(-213)/1207)? 7/11 Calculate 186/(-5)-520200/(-41600). -93 Evaluate (((-2)/6-1)/((-4)/(-76)))/((-191)/(-1719)). 57 Calculate (50/15)/(-2)(-22594)/(-1430). -79/3 What is (-60)/(6480/54)(-46)/1? 23 What is (1/((-306)/(-24)))/(164/123)? 1/17 Evaluate ((-3)/(-54))/(2/(-8))621450/(-13810). 10 Evaluate (-1(-8)/(-18))/((-27430)/(-9495)). -2/13 What is ((-2)/1511/(440/(-15)))/((-60)/144)? -3/25 (8/(-6))/(106876/6246)(-1)/328 8/11 Evaluate 6(-235)/(-3055)(-39)/(-108). 1/6 What is the value of (-984)/(-3)(-167)/(-1336)? 41 (-2)/8(-231)/(-33)(-60)/14 15/2 What is the value of (-103/(-126))/((-780)/(-13650))? 25/6	{ "pile_set_name": "DM Mathematics" }
84 - 63/36)? -28/5 (-1533)/(-3)((-4)/12)/(420/360) -146 What is 2328/(-111) - (35 - (-38 - -94))? 1/37 What is the value of (6798/(-1815)-11)/((-996)/60 - -17)? 103 Calculate 26(3 - 5)/616/(16896/288). -26/11 What is (204/(-90) - 180/(-108))/(((-8)/5)/4)? 3/2 2((-855)/18 - (-41 + 3)) -19 Calculate (320 - 284)15/(-306). -30/17 Calculate (-656)/(-2173)(-15)/(-40). 6/53 What is the value of 27 + -21(-28594)/(-22134)? -4/31 What is (160/140)/((-48)/28) + (-235)/(-15)? 15 (4752/(-360) + -10 + -2)-5 126 What is ((-113072)/573 - -199)/((2 + 0)/30)? 25 What is the value of 0/((4945/344)/238)? 0 (35 - (-215358)/(-6149)) + 2/86 0 Calculate ((-1615)/4845)/(38/12). -2/19 Calculate (11/11)/(-29 - -6). -1/23 ((-2574)/(-1872))/(2/(-64)) -44 What is the value of 9720/810 + (3 - (-138)/(-8))? -9/4 Calculate 29 + (-930)/(-217)620/(-93). 3/7 Evaluate (-1729)/(-665) - (-2 + (-606)/15). 45 Evaluate 302/(-78) + 13225/3450. -1/26 375875/(-60140)(198/(-105) + 2) -5/7 Evaluate ((-1008)/60)/(2947/2105). -12 (-8)/(-184)-1309 - (-550)/(-6325) -57 Calculate (-1)/6(-49 + 43)25. 25 What is the value of (927/1236)/(9/(-348))? -29 822/2745/(-210)4 -2/7 What is the value of (303/6 + -4)(-53 + 7)(-4)/92? 93 What is 2/(31/(-5642)-84)? 13/3 Calculate (-6)/4130(-160)/6567600. 2/421 (-238221)/(-47124) - (17 - (-3339)/(-196)) 56/11 Evaluate (2/66)/((-34357)/218268 + 4/54). -4/11 What is (106/9)/(2054/(-9243))? -53 Calculate 52 + -88 + (36/3 - 26). -50 What is the value of (-6)/(-20) + 35 + 22190/700? 67 Calculate -24/(-172) + ((-4285050)/4515)/(-106). 9 728/224 + (-5 - (3 + 5(2 - 3))) 1/4 What is 3/(-9)((-611)/(-1131) - (-27)/(-891)11)? -2/29 Evaluate 17466/(-78597)(0 - 72). 16 What is the value of (-182)/(-19)(-270028)/49742? -52 What is 6645/(-10632)(-544)/(-4)? -85 What is the value of (7 + (-7791)/1029)/((-30)/(-7))? -2/15 -7(-44)/(-231) + 434/24 + -6 43/4 What is (2 - -6) + (8 + -4)45/(-30)? 2 ((-108275)/(-3479) + -31)/((-4)/7) -3/14 Evaluate -279(-200)/(-102300) - 1/((-11)/(-797)). -73 What is 1/(-2) - (8178/203 + (-4)/(336/(-18)))? -41 What is the value of -15 + (-86)/((-16856)/1428)? -54/7 Evaluate -35(-47)/(-1974)(-5)/(-15)(-3)/(-10). -1/12 630/102 + 6 + 0 + (-288)/24 3/17 9 + ((-8)/32)/(1/(-8)) + -131 -120 What is 8610/(-1989) + (-13728)/66020/(-96)? 1/221 (0 - 4 - (-94 + 93)(-3 - -2)) + 59 54 Evaluate ((-22)/(-88))/(3/8 - (-15)/5). 2/27 What is (7 + 19773/(-2826))(102 - 98)? 2/157 Evaluate 137 + 7557/(-55) - ((-256)/(-10) - 0). -26 Calculate -51 + (52/18)/((-92)/(-414)). -38 What is (-7 + -2 + 203/35)/((-54)/(-135))? -8 Calculate 1(-108)/189 + 7/((-147)/1479). -71 What is 5040/1225 + 5/1 + (215 - 224)? 4/35 Calculate (-6860)/(-105) + -42 + (-13 - 0) - 9. 4/3 Calculate (-1056)/37510 - ((-6660)/(-558) + -12). 2/55 What is (-11)/((-132)/(-16))((-2000)/(-640))/(1/(-12))? 50 What is -14 + (-44)/(-27)2(-210)/(-56)? -16/9 What is the value of (-1628/294)/((-28)/12 - -3)? -16/7 What is the value of 655/((-1933560)/(-17056)) + (-1)/((-9)/2)? 6 Calculate (3/5 + 228/(-480))4. 1/2 Evaluate (16/(-666))/(175/1225 + 93/(-63)). 2/111 Evaluate (55/(-360) - 0) + (-280)/1260. -3/8 What is -48 + 32 + 20 - (-15651)/(-3901)? -1/83 What is the value of 2851632/(-46494) + 5/(-3)? -63 Calculate (-128)/34 + -2 + 19252/798. 4/17 What is the value of (1890/(-162)-2)/14? 5/3 -8 + (-8 - -5 - (2 - 0))/((-430)/344) -4 What is 1395/558 + 1(-6 - -3)? -1/2 What is the value of (-28)/9 - (-12121890)/3867075? 2/85 14144/(-1404) + 1258/119 + 12/(-21) -2/27 Evaluate 2((-14)/(-924)33 + (-75)/154). 2/77 What is the value of (-4)/(-30)2 - 4987694/(-571110)? 9 What is 3 - (-22)/(-10) - (8694/105 - 52)? -30 Evaluate -2 + -1 + (-3242)/(-260981) + (-10306)/161. -67 -10 + (28 - -19) + -1 36 What is -14(-285)/(-38)((-16)/(-21) + 15/(-35))? -35 What is -5 + ((-759)/77 - (-30)/(-14))? -17 (-3)/26543/543-2 3/13 Calculate ((-6)/70)/(12150/(-8100)). 2/35 What is (16/10)/((-1)/(0 - -90)(-6582)/(-4388))? -96 Calculate (-24124)/(-16137) - 2/9. 14/11 ((-335)/(-105))/((-1533)/10731) -67/3 What is the value of (-2 + (-32)/(-10))/(336/7200)? 80 What is (-20)/((-4)/2) - -216(-88)/2112 - -15? 16 Evaluate 170/627198/(-113325). -34/5 (-12)/(-51)-391 + (34 - 0) -58 Calculate (24/(-5))/((-148)/(16280/165)). 16/5 What is -4((-10 - 1) + (-6390)/(-576))? -3/8 What is (142/(-10) + 1)/(72/10980244)? -33/4 (22/6 - (-11)/(-44)28) + (-4495)/186 -55/2 What is ((-107114)/1372 - -78)/(2/4)? -1/7 What is the value of -22 - 15/((-555)/407) - 476/(-43)? 3/43 Evaluate 182/(-518)-37 + 193/(-5) + (-8)/20. -26 (5/(-4))/((-2418)/(-279)) + (-24)/(-64) 3/13 (-27)/27056/63 + (-1900)/(-4620) 4/11 What is (23 - -39 - 65) + -43 + 0 - 7? -53 ((-3)/(-5) - (-18)/(-45))(-27 - -3 - -9) -3 Calculate 6 - (((-18032)/(-126))/(-7))/(-4). 8/9 Evaluate 806/279-9 - -64. 38 Evaluate -32 - (-79 + (3 - -42)). 2 Evaluate ((-56)/3 + 6)/(235/2115) - -43. -102 Evaluate 172/2924 - (24654/(-51))/(-7). -69 Calculate ((-1533)/(-3920) + (-3)/7)/(-43 + 49). -1/160 (483/621)/(294/(-180)) -10/21 Evaluate ((-38)/6 - -8)/(42/105125/60). 2 Calculate 112 - (-130)/11727 - 31. 111 -21 + (0(-21)/462)/4 -21 Calculate 15 - (-1 - 198/(-1116))/((-1)/18). 6/31 What is the value of 1/(-39) - (-1810900)/(-201786)? -9 What is the value of (-197)/(-13790) + 9117/1260? 29/4 (-390)/(-6) - (-5520020)/(-84700) -6/35 Calculate 49 - ((-6627)/(-47) + -19). -73 Evaluate (-218 + 1)/(-10 - 308/(-14)) - -18. -1/12 (-111760)/(-25400) + 2034/(-460) -1/46 Evaluate ((-17)/68 + (-118)/(-456))/(244/732). 1/38 Evaluate (-1545)/(-575)1395/341 + (-8 - 3). -2/253 Evaluate ((-38)/(-4))/(50 - 804/16). -38 What is the value of (-470400)/11466 + (-3)/(-117)? -41 What is (-56)/5040342 - (-2 - 1)? -4/5 What is (188630/(-10478) - -18)/(35/(-1365))? 3/31 Calculate 21/(1269/282(-1)/(-9)). 42 What is ((-2)/2 + -59)/(18/14 - (-112)/(-392))? -60 Evaluate (-756840)/(-107100) - (-44)/(-6). -4/15 (-4)/(-1) - (-1 - 14 - -14)(-183 - -72) -107 Evaluate (6/(-20)8)/(2(-9)/(-360)). -48 Evaluate (1404/90 - (-9 + 27))(-24 - (-4)/1). 48 What is (-7273)/(-1106) - 29172/4488? 6/79 What is (-9)/(-180)-9230/2763/45? -1/40 What is 303799/112484 - (-88)/(-32)? -3/61 Evaluate (-6 - -8 - -72)/(12/(-300)-25). 74 Evaluate (12 - (-2451)/(-114))6. -57 Calculate (-9)/((-288)/344) - 21519/3188. 4 Calculate (-624)/(-26) + (-2 + 3)6/147. 27 What is the value of (-392)/243 + -26 + 22 + 6? -47 What is -16 + (-260)/(-728)42? -1 What is (-10528)/(-65800)1/(-4)? -1/25 Calculate (-33 - 672)/(-15) - 53. -6 What is the value of 6 + ((-29463)/(-610) - 48 - 34/(-20))? 8 9-2 - 88010/406254/15 -96 What is 6533/(-17719) + 915/3965? -4/29 What is the value of ((-4)/18)/(9/(140616/56))? -62 (((-19)/(-57))/(2/406))/((-42)/(-18)) 29 What is 8/684-38(-141)/(-5358)? -2/171 What is 252/21 - (-17 - 1800/(-62))? -1/31 What is the value of 24/((2 - 3/(-1)) + 10/(-40)16)? 24 (42/5)/(-34(-138)/5865) 21/2 Evaluate ((-60)/9 + 7)424/24 + -3. 26/9 ((-45)/(-700)-2)/((-33)/130917) 3/10 What is the value of 80/950(-31 - (-114)/4)/(-20)? 1/95 2188842/40062 - (-30)/22 56 What is (1/108)/((-55440)/(-540) - 104)? -1/144 What is the value of (-1)/71(-25 + -2 + (-19 - -126) + -82)? 2/71 Evaluate -1(-19 + 19 - -54). -54 Evaluate (-378)/(-135)(-22 - (-702)/36). -7 Evaluate (-42)/22057 - 196/60. -17/5 What is the value of (6 + (-216)/10)/(0 - 30/75)? 39 What is ((-21)/9 + 2)387(-10)/30? 43 What is (-723)/(-6) + ((-34)/4 - (51 + -26 + -32))? 119 What is 899/(-203) - 6935/(-1596)? -1/12 What is 6(-56007)/10668(0 + (3/9)/1)? -21/2 What is the value of (-6 - 2)(-1028)/(-7196)? -8/7 Evaluate 34534/961 - -11 - ((-1848)/(-186) + -6 + -4). 47 2/(-6)((-25)/100 - (-55)/44) -1/3 What is the value of (-11492)/(-136)(-1080)/780? -117 What is the value of 385/6750 + (17 - (-460)/(-27))? 1/50 What is 1 - -107 - (-144 + 353 - 181)? 80 What is the value of (-16 - (-86952)/5112) + (-5 - 2) + 6? 2/213 Calculate -9 + -7 + 2124/132 + 30/10560. 3/32 What is ((-22140)/(-47970))/(1/(-104))? -48 What is (222/(-15) - -15)(226 + 39)? 53 ((-1302)/112)/(-31)-8 - 50/(-16) 1/8 Evaluate ((1184/128)/(-37))/((-1)/(-1))260/(-45). 13/9 ((-24)/3)/(((-74120)/327)/(-170)) -6 What is 170316/(-4980) + (-24)/5? -39 ((4/(-5))/((-34	{ "pile_set_name": "DM Mathematics" }
replacement from {z: 4, x: 7, s: 1, v: 1, i: 4}. 3/340 Two letters picked without replacement from {e: 2, u: 2, c: 6, i: 2, d: 3}. Give prob of picking 1 e and 1 c. 4/35 Calculate prob of picking 1 x and 1 l when two letters picked without replacement from {l: 1, s: 1, x: 1, t: 2, h: 1, d: 1}. 1/21 Four letters picked without replacement from {d: 1, o: 1, g: 1, f: 1, c: 1}. Give prob of picking 1 o and 3 g. 0 Four letters picked without replacement from {i: 1, b: 6, r: 5, s: 1, a: 2, x: 5}. Give prob of picking 2 r, 1 a, and 1 b. 8/323 Two letters picked without replacement from bbbdrrrrdce. Give prob of picking 1 r and 1 b. 12/55 What is prob of picking 1 p and 1 e when two letters picked without replacement from gwegpegggwpww? 2/39 What is prob of picking 1 u, 1 b, and 1 v when three letters picked without replacement from kkubukukvbubk? 6/143 Four letters picked without replacement from {d: 1, h: 1, y: 2, k: 1, l: 1, q: 2}. Give prob of picking 1 h, 2 q, and 1 l. 1/70 What is prob of picking 3 x and 1 z when four letters picked without replacement from xxxxxxxxxxzxz? 6/13 What is prob of picking 1 z, 2 a, and 1 f when four letters picked without replacement from {x: 4, a: 2, c: 3, f: 1, z: 1}? 1/330 Four letters picked without replacement from bbllll. Give prob of picking 3 l and 1 b. 8/15 Calculate prob of picking 2 e when two letters picked without replacement from {e: 5, x: 1, l: 4, c: 1}. 2/11 Calculate prob of picking 1 t, 1 q, and 1 p when three letters picked without replacement from jbbqntqptbbt. 3/110 Two letters picked without replacement from obdbdowj. Give prob of picking 2 d. 1/28 Calculate prob of picking 2 f, 1 t, and 1 n when four letters picked without replacement from ffffefefftfenffeefnn. 11/323 Two letters picked without replacement from ovvvapfv. What is prob of picking 1 a and 1 o? 1/28 What is prob of picking 1 h and 3 k when four letters picked without replacement from hkkkkhkk? 4/7 Four letters picked without replacement from qrqzrgwgrr. Give prob of picking 3 r and 1 w. 2/105 Three letters picked without replacement from zbbz. What is prob of picking 2 b and 1 z? 1/2 Calculate prob of picking 2 e and 1 r when three letters picked without replacement from kvkevekekkerveeer. 21/340 Two letters picked without replacement from {b: 4, w: 2, y: 1}. Give prob of picking 2 w. 1/21 Two letters picked without replacement from enmneeefff. What is prob of picking 1 f and 1 m? 1/15 What is prob of picking 1 k and 1 w when two letters picked without replacement from wsiwisiiisiiks? 2/91 What is prob of picking 1 l and 1 d when two letters picked without replacement from {h: 3, l: 1, q: 1, d: 1, a: 3, f: 2}? 1/55 Calculate prob of picking 1 d, 1 u, 1 f, and 1 y when four letters picked without replacement from {d: 1, h: 1, u: 4, y: 3, e: 2, f: 1}. 4/165 Calculate prob of picking 2 c when two letters picked without replacement from {c: 3, b: 11}. 3/91 Four letters picked without replacement from {k: 1, f: 1, x: 2, a: 3}. Give prob of picking 1 a, 1 k, and 2 x. 3/35 Calculate prob of picking 2 f and 1 h when three letters picked without replacement from fffhffffffhff. 5/13 Two letters picked without replacement from {j: 3, s: 3, x: 1}. What is prob of picking 2 s? 1/7 What is prob of picking 1 l and 1 q when two letters picked without replacement from {l: 3, q: 3, x: 6, i: 1, v: 1, m: 3}? 9/136 What is prob of picking 1 c and 2 m when three letters picked without replacement from mmcmccmccmmmpcccm? 28/85 Two letters picked without replacement from {q: 2, l: 2, d: 1}. Give prob of picking 1 d and 1 l. 1/5 What is prob of picking 1 r and 2 l when three letters picked without replacement from {l: 3, r: 8}? 8/55 Three letters picked without replacement from sppnppnpspptppsp. Give prob of picking 1 t and 2 n. 1/560 Two letters picked without replacement from rrxrrxrrr. Give prob of picking 2 x. 1/36 Four letters picked without replacement from bssrerrdbbmr. Give prob of picking 1 m, 1 r, 1 b, and 1 e. 4/165 Three letters picked without replacement from kggyyms. Give prob of picking 2 g and 1 k. 1/35 Calculate prob of picking 1 x and 1 v when two letters picked without replacement from {x: 1, v: 2, k: 1, g: 1}. 1/5 Four letters picked without replacement from vvkgvvvvvvvkgvvkgvv. Give prob of picking 3 v and 1 g. 143/646 Two letters picked without replacement from swswwllglmw. Give prob of picking 2 l. 3/55 Three letters picked without replacement from {c: 9}. What is prob of picking 3 c? 1 Two letters picked without replacement from {c: 2, p: 17}. Give prob of picking 2 c. 1/171 Two letters picked without replacement from {a: 1, o: 2, b: 1, v: 2}. Give prob of picking 1 b and 1 v. 2/15 What is prob of picking 2 i and 1 h when three letters picked without replacement from hlkillhl? 0 Calculate prob of picking 2 a and 1 g when three letters picked without replacement from bbabjbgaaa. 1/20 Calculate prob of picking 1 g and 1 a when two letters picked without replacement from nggugagnuuiuggguug. 8/153 Calculate prob of picking 1 q and 2 p when three letters picked without replacement from qppqwqqwq. 5/84 Calculate prob of picking 2 z and 1 k when three letters picked without replacement from zkckkkczkkzkzz. 5/26 Four letters picked without replacement from gaasgkagekske. Give prob of picking 3 g and 1 a. 3/715 Two letters picked without replacement from pwwpwwwww. What is prob of picking 1 p and 1 w? 7/18 Calculate prob of picking 3 y when three letters picked without replacement from {y: 9, m: 3}. 21/55 Three letters picked without replacement from iciiiccccicccccc. Give prob of picking 3 c. 33/112 What is prob of picking 1 t and 1 o when two letters picked without replacement from tntstaoootnogsnssn? 16/153 Calculate prob of picking 2 j and 1 c when three letters picked without replacement from gcgjgggjcjjcgi. 9/182 Two letters picked without replacement from xfmeveqfqxxxmfqfeffx. What is prob of picking 1 e and 1 f? 9/95 Three letters picked without replacement from {z: 8, s: 7, l: 5}. What is prob of picking 1 s and 2 l? 7/114 Calculate prob of picking 1 g and 3 w when four letters picked without replacement from {w: 5, g: 3}. 3/7 Calculate prob of picking 1 n and 2 c when three letters picked without replacement from csggnci. 1/35 What is prob of picking 2 o when two letters picked without replacement from {s: 1, o: 14}? 13/15 Calculate prob of picking 3 x and 1 h when four letters picked without replacement from xobbxhbhxxob. 8/495 Calculate prob of picking 1 m and 2 b when three letters picked without replacement from {u: 6, m: 11, b: 2}. 11/969 Two letters picked without replacement from yoceiiyiciyieic. Give prob of picking 2 y. 1/35 What is prob of picking 3 u when three letters picked without replacement from {u: 4, p: 14}? 1/204 Calculate prob of picking 1 s and 3 z when four letters picked without replacement from zssszz. 1/5 Three letters picked without replacement from ggvggvvvggggvg. What is prob of picking 3 g? 3/13 Three letters picked without replacement from {s: 2, t: 2, v: 2, o: 3, l: 5, z: 2}. What is prob of picking 3 l? 1/56 Three letters picked without replacement from rmjmjumjvmmr. Give prob of picking 1 m and 2 j. 3/44 Four letters picked without replacement from qjjuuuquuuuuub. What is prob of picking 2 j, 1 b, and 1 u? 9/1001 What is prob of picking 1 v and 1 o when two letters picked without replacement from vfddjoodvovrdo? 12/91 Three letters picked without replacement from {w: 2, h: 3, m: 3}. What is prob of picking 1 w and 2 h? 3/28 Four letters picked without replacement from llpyypfypfpp. What is prob of picking 2 p and 2 f? 2/99 What is prob of picking 1 z, 1 r, and 2 b when four letters picked without replacement from zrbzmvbbbzvyzzm? 2/91 Calculate prob of picking 1 o and 1 c when two letters picked without replacement from ncxncoiv. 1/14 What is prob of picking 1 r, 1 y, and 1 j when three letters picked without replacement from {j: 8, w: 2, y: 1, r: 9}? 6/95 Three letters picked without replacement from {o: 1, a: 1, e: 1, n: 1, f: 1, k: 2}. Give prob of picking 1 f and 2 k. 1/35 What is prob of picking 1 i, 1 q, and 2 m when four letters picked without replacement from {i: 3, m: 2, g: 1, s: 1, p:	{ "pile_set_name": "DM Mathematics" }
3 What is the tens digit of 5347? 4 What is the hundreds digit of 22145? 1 What is the tens digit of 1037? 3 What is the tens digit of 2218? 1 What is the hundreds digit of 40397? 3 What is the tens digit of 5014? 1 What is the tens digit of 1037? 3 What is the tens digit of 4001? 0 What is the units digit of 83767? 7 What is the hundreds digit of 1188? 1 What is the hundreds digit of 14888? 8 What is the hundreds digit of 430? 4 What is the thousands digit of 1708? 1 What is the ten thousands digit of 27360? 2 What is the tens digit of 145? 4 What is the units digit of 2229? 9 What is the thousands digit of 7131? 7 What is the thousands digit of 2037? 2 What is the thousands digit of 37507? 7 What is the hundreds digit of 27616? 6 What is the ten thousands digit of 15346? 1 What is the hundreds digit of 440? 4 What is the hundreds digit of 28533? 5 What is the hundreds digit of 13268? 2 What is the hundreds digit of 1125? 1 What is the tens digit of 3331? 3 What is the hundreds digit of 41216? 2 What is the thousands digit of 64038? 4 What is the tens digit of 8646? 4 What is the units digit of 3012? 2 What is the hundreds digit of 1631? 6 What is the hundreds digit of 5875? 8 What is the thousands digit of 3793? 3 What is the thousands digit of 71903? 1 What is the tens digit of 1532? 3 What is the hundreds digit of 3396? 3 What is the units digit of 123738? 8 What is the tens digit of 136? 3 What is the units digit of 2005? 5 What is the tens digit of 2581? 8 What is the hundreds digit of 565? 5 What is the ten thousands digit of 35235? 3 What is the hundreds digit of 874? 8 What is the hundreds digit of 2391? 3 What is the hundreds digit of 9125? 1 What is the tens digit of 1103? 0 What is the units digit of 3547? 7 What is the thousands digit of 173065? 3 What is the hundreds digit of 1182? 1 What is the thousands digit of 3904? 3 What is the ten thousands digit of 27204? 2 What is the tens digit of 1099? 9 What is the units digit of 1236? 6 What is the thousands digit of 9457? 9 What is the hundreds digit of 1313? 3 What is the ten thousands digit of 76657? 7 What is the thousands digit of 2509? 2 What is the tens digit of 33485? 8 What is the tens digit of 748? 4 What is the units digit of 4364? 4 What is the ten thousands digit of 14208? 1 What is the thousands digit of 32363? 2 What is the units digit of 3379? 9 What is the tens digit of 1416? 1 What is the ten thousands digit of 26762? 2 What is the tens digit of 38809? 0 What is the hundreds digit of 20058? 0 What is the tens digit of 1131? 3 What is the tens digit of 561? 6 What is the thousands digit of 59265? 9 What is the thousands digit of 17181? 7 What is the tens digit of 2897? 9 What is the hundreds digit of 1834? 8 What is the hundreds digit of 93975? 9 What is the units digit of 24615? 5 What is the units digit of 5768? 8 What is the tens digit of 9836? 3 What is the thousands digit of 3102? 3 What is the thousands digit of 7327? 7 What is the hundreds digit of 1039? 0 What is the tens digit of 11318? 1 What is the units digit of 89603? 3 What is the thousands digit of 4771? 4 What is the units digit of 1193? 3 What is the tens digit of 5061? 6 What is the thousands digit of 5269? 5 What is the units digit of 16193? 3 What is the thousands digit of 1074? 1 What is the units digit of 26305? 5 What is the tens digit of 54120? 2 What is the thousands digit of 40021? 0 What is the thousands digit of 28818? 8 What is the tens digit of 14280? 8 What is the thousands digit of 12259? 2 What is the tens digit of 46331? 3 What is the thousands digit of 1248? 1 What is the units digit of 177? 7 What is the units digit of 10332? 2 What is the ten thousands digit of 60843? 6 What is the hundreds digit of 74882? 8 What is the thousands digit of 2239? 2 What is the units digit of 2023? 3 What is the hundreds digit of 42437? 4 What is the units digit of 635? 5 What is the hundreds digit of 3955? 9 What is the units digit of 691? 1 What is the hundreds digit of 985? 9 What is the units digit of 605? 5 What is the units digit of 2357? 7 What is the units digit of 4530? 0 What is the tens digit of 2816? 1 What is the units digit of 174654? 4 What is the units digit of 421? 1 What is the hundreds digit of 38240? 2 What is the hundreds digit of 2182? 1 What is the units digit of 394? 4 What is the ten thousands digit of 33304? 3 What is the hundreds digit of 433? 4 What is the units digit of 63? 3 What is the tens digit of 3611? 1 What is the thousands digit of 40044? 0 What is the hundreds digit of 4117? 1 What is the hundreds digit of 17326? 3 What is the thousands digit of 77032? 7 What is the hundreds digit of 2031? 0 What is the ten thousands digit of 11127? 1 What is the thousands digit of 1281? 1 What is the hundreds digit of 10780? 7 What is the ten thousands digit of 10292? 1 What is the hundreds digit of 173? 1 What is the tens digit of 6535? 3 What is the tens digit of 2834? 3 What is the hundreds digit of 3633? 6 What is the tens digit of 976? 7 What is the tens digit of 1112? 1 What is the units digit of 33890? 0 What is the units digit of 1044? 4 What is the units digit of 15701? 1 What is the thousands digit of 1208? 1 What is the thousands digit of 9012? 9 What is the tens digit of 12111? 1 What is the ten thousands digit of 38610? 3 What is the units digit of 1? 1 What is the hundreds digit of 7707? 7 What is the thousands digit of 18537? 8 What is the thousands digit of 19295? 9 What is the units digit of 10520? 0 What is the tens digit of 1574? 7 What is the tens digit of 97997? 9 What is the hundreds digit of 1130? 1 What is the units digit of 38088? 8 What is the tens digit of 750? 5 What is the units digit of 136298? 8 What is the thousands digit of 15937? 5 What is the hundreds digit of 607? 6 What is the units digit of 419? 9 What is the tens digit of 1360? 6 What is the hundreds digit of 41115? 1 What is the tens digit of 31254? 5 What is the hundreds digit of 24041? 0 What is the hundred thousands digit of 163451? 1 What is the hundreds digit of 906? 9 What is the ten thousands digit of 20483? 2 What is the tens digit of 938? 3 What is the units digit of 2552? 2 What is the thousands digit of 2169? 2 What is the hundreds digit of 6736? 7 What is the units digit of 1149? 9 What is the tens digit of 18589? 8 What is the hundreds digit of 10126? 1 What is the hundreds digit of 831? 8 What is the tens digit of 49? 4 What is the units digit of 439? 9 What is the hundreds digit of 3614? 6 What is the units digit of 8471? 1 What is the units digit of 50423? 3 What is the hundreds digit of 23220? 2 What is the units digit of 3093? 3 What is the tens digit of 45808? 0 What is the tens digit of 9906? 0 What is the units digit of 78024? 4 What is the hundreds digit of 22973? 9 What is the tens digit of 37697? 9 What is the units digit of 132? 2 What is the units digit of 3205? 5 What is the hundreds digit of 2892? 8 What is the units digit of 9? 9 What is the units digit of 28196? 6 What is the tens digit of 10996? 9 What is the tens digit of 91211? 1 What is the units digit of 2625? 5 What is the units digit of 1260? 0 What is the hundreds digit of 13653? 6 What is the thousands digit of 1227? 1 What is the units digit of 529? 9 What is the tens digit of 10428? 2 What is the units digit of 1181? 1 What is the hundreds digit of 2519? 5 What is the ten thousands digit of 10287? 1 What is the units digit of 80387? 7 What is the tens digit of 430? 3 What is the hundreds digit of 42316? 3 What is the units digit of 7967? 7 What is the tens digit of 26514? 1 What is the units digit of 50755? 5 What is the tens digit of 27528? 2 What is the hundreds digit of 2660? 6 What is the ten thousands digit of 32550? 3 What is the thousands digit of 1568? 1 What is the hundreds digit of 1239? 2 What is the units digit of 50029? 9 What is the tens digit of 26387? 8 What is the tens digit of 1192? 9 What is the hundreds digit of 48872? 8 What is the thousands digit of 24488? 4 What is the hundreds digit of 1285? 2 What is the units digit of 602? 2 What is the tens digit of 835? 3 What is the tens digit of 125408? 0 What is the units digit of 1260? 0 What is the thousands digit of 3462? 3 Wha	{ "pile_set_name": "DM Mathematics" }
. What are the prime factors of v? 3, 17, 103 Suppose -5g + 8g = -3y + 35751, 5y - 59621 = 4g. List the prime factors of y. 7, 13, 131 Suppose 35i - 33i - 1464 = 0. Suppose 63b = 57b + i. List the prime factors of b. 2, 61 Let j = -189 - -191. What are the prime factors of j/6 - (-18456)/36? 3, 19 Let r be 13 - 17 - (-2 + (1901 - -2)). What are the prime factors of (-83/15)/(6/r)? 2, 127 What are the prime factors of (9/6)/((-14)/((-1568840)/30))? 13, 431 Let b(n) = -160n2 + 11n - 10. Let a be b(1). Let k = a + 972. What are the prime factors of k? 3, 271 Let c(q) = -12q - 14q + 22q + 3 + 131q2. Let d be (3 - 22/6)/(18/(-27)). What are the prime factors of c(d)? 2, 5, 13 Let l(m) = m2 + m. Let n(c) = 3c2 - 13c + 3 - 19c + 20c. Let j(w) = 4l(w) + n(w). List the prime factors of j(6). 3, 23 Suppose -34r + 2338 = -27r. Let d = -229 + r. What are the prime factors of d? 3, 5, 7 Suppose -2n = -5g - n + 476, -284 = -3g + n. Let i = -88 + g. Suppose -145 = 7u - iu. What are the prime factors of u? 5, 29 What are the prime factors of (328398/490)/(2/70)? 3, 7, 1117 Let j = -1248 + 1902. Let a = j - 374. What are the prime factors of a? 2, 5, 7 Let x be (-4)/1 - -262675/10. Suppose x = 4t - 7b + 2b, -3473 = -2t + 3b. List the prime factors of t. 2, 109 Let d(g) = 1419g + 107. What are the prime factors of d(2)? 5, 19, 31 Suppose -105 = 40t - 45t. Suppose -tu + 3878 = -14u. What are the prime factors of u? 2, 277 Suppose -10s + 6s - 2m - 100 = 0, s + 25 = -2m. Let o = s + 132. List the prime factors of o. 107 Let n(i) = 4i*3 - 97i*2 + 8i - 7. What are the prime factors of n(29)? 2, 4051 Suppose 13092 = 5l + y, 13374 - 2904 = 4l - y. Suppose -5z = -12z + l. List the prime factors of z. 2, 11, 17 Let g(x) = 11x2 + 36x - 44. What are the prime factors of g(15)? 2971 Let b be (0 - -6)8/(-12) - 2. Let d be 1/(b/(-4)) - 21/(-9). Suppose 0 = 2a, -3k = -da + 2a - 438. What are the prime factors of k? 2, 73 Suppose -4x - 9 = -605. Let w = 6084 - 6019. Let f = x - w. List the prime factors of f. 2, 3, 7 Let h = 71576 - 41903. List the prime factors of h. 3, 7, 157 Suppose -4f + f + 363 = 0. Let h(b) = -b3 - 20b*2 + 2b - 3. Let y be h(-20). Let x = y + f. List the prime factors of x. 2, 3, 13 Let t(j) = 2j2 - 5. Let q be t(2). Suppose -qi + 8i + 10 = 0, 4i = 2c - 192. What are the prime factors of c? 2, 23 Let j(f) = -1433f - 858. What are the prime factors of j(-15)? 3, 2293 Let f be 9 + (2 - 9)1. Suppose 4h = 4z - 2484, -z + 5h = fh - 611. What are the prime factors of z? 2, 313 Let i = 368 + -337. Suppose ia + 2a - 56199 = 0. What are the prime factors of a? 13, 131 Let j be 2/11 - (-19)/(836/432). Let s(z) = -2z*3 + 19 + 12z*2 - 8z + z3 - 14. What are the prime factors of s(j)? 5 Let d(w) = w3 + 9w2 + 68w + 27. List the prime factors of d(12). 3, 1289 Let q(l) = 23267l + 432. List the prime factors of q(1). 13, 1823 Let d = -65 - -67. Suppose q - 2c = 6q - 968, -q + 184 = -dc. Suppose 2k - q = 5j, -4j - 450 = -5k + j. What are the prime factors of k? 2, 43 Suppose 7j = 6j - 6. Let o(z) = 60z - 39. Let x(k) = 15k - 10. Let n(l) = jo(l) + 22x(l). What are the prime factors of n(-5)? 2, 41 Let r = 123 + -114. Suppose 21 = -3y + 2y - 3d, -4y - r = -3d. Let a = 224 + y. What are the prime factors of a? 2, 109 Suppose 0 = 35x + 5x - 55040. List the prime factors of x. 2, 43 Let d(b) = 87b*2 - 22b + 74. Let c = 85 - 82. What are the prime factors of d(c)? 7, 113 Suppose 628 - 1668 = -5p. Suppose -1071 = -4m + 3s, 3s = -2m + p + 341. Let b = -180 + m. List the prime factors of b. 2, 3, 5 List the prime factors of (54/5)/((-38408)/(-7680) + 2 + -7). 2, 3 Suppose 7y - 322 = -0y. Suppose -3w = -t - y, w - 13 = 5t + 7. What are the prime factors of (5/w)/(2/(-334))-3? 167 Suppose -5266 = -19p + 4196. Suppose -5w = 4a - 412, -28a + 23a = 2w - p. List the prime factors of a. 2, 7 Let y(u) = 2u3 - 3u*2 + 2u - 3. Let r be y(2). Suppose 91 = -4t + ra, t = 2t - 4a + 20. What are the prime factors of t/(-16)(149/3 - 1)? 73 Let g(i) = -54i - 403. Let y(t) = -2t2 + 73t. Let n be y(37). What are the prime factors of g(n)? 5, 11, 29 Let h = 10706 + -5731. List the prime factors of h. 5, 199 Suppose -7t - 4246 = -38028. Suppose -t = -9q - 884. Let o = 653 - q. List the prime factors of o. 5, 43 Let x(d) = d - 2. Let m be x(3). Let s be m - (-2 - (-166)/((-4)/2)). Suppose -5l = -8 - 2, -4f = -3l - s. List the prime factors of f. 23 Let q = -8 + -31. Let w be 2(4 + (-71)/(-2)). Let r = w + q. List the prime factors of r. 2, 5 Let p(u) = -23872u3 - u2 + 34u + 34. List the prime factors of p(-1). 3, 73, 109 List the prime factors of ((-165)/(-1155) - (-50)/(-56))(-56936)/2. 3, 11, 647 Suppose -12g = -3370 - 5222. List the prime factors of g. 2, 179 What are the prime factors of (-6)/9(-1717914)/44 + -11? 2, 13009 Let t = -39 - -49. Let k be ((-52)/t)/(-4 + (-54)/(-15)). Suppose 0 = 3n + b - 593, 2b + k + 377 = 2n. List the prime factors of n. 197 Let a(x) = 3x2 - 62x - 87. What are the prime factors of a(-17)? 2, 7, 131 Let s = 194 + -190. Suppose -5m = -10, -st + 1138 = -3m + 52. What are the prime factors of t? 3, 7, 13 Suppose 0 = -q - 7, 0q + q - 21469 = -2s. What are the prime factors of s? 2, 7, 13, 59 Let i be (-2 - 3)/(9 + -10). Suppose -4d - 3c + 18 = 0, 0d + 2c = id - 34. Let u = d - -48. List the prime factors of u. 2, 3 Suppose 0 = 2p + 5m - 682, 2m + 1069 = 3p - 2m. Suppose c = -3o + 806 + 254, 0 = o - 2c - p. List the prime factors of o. 353 Let p(y) = 428y + 56. List the prime factors of p(4). 2, 13, 17 Let z = -5677 + 5882. What are the prime factors of z? 5, 41 Let n = 1542 - -404. Suppose 11a + 65 = n. What are the prime factors of a? 3, 19 Suppose -130824 = 39y - 118y. What are the prime factors of y? 2, 3, 23 Let l(x) = -15x + 17. Let s be l(-12). Let p = 354 + s. List the prime factors of p. 19, 29 Let g(k) = -k*3 + 10k*2 + 7. List the prime factors of g(0). 7 Suppose 4b = 13 + 3. Suppose y - bq + 7 = -11, 10 = 2q. What are the prime factors of ((-488)/y)/(0 + -6 + 4)? 2, 61 Let q = -558 - -880. Let x = 553 - q. List the prime factors of x. 3, 7, 11 Suppose -10 = 3j + r, -2 = -r + 3r. Let d(t) = -2t2 - 6t + 3. Let g be d(j). Suppose -341 = -gb - n, 2n + 559 = 5b - n. List the prime factors of b. 113 Let k be (1 + -17)7/28. What are the prime factors of -3(-785)/(-30)k? 2, 157 Let m(x) = -9x3 - 41x*2 + 18x - 5. Let o(l) = -5l3 - 21l*2 + 9l - 3. Let w(b) = -6m(b) + 11o(b). What are the prime factors of w(11)? 2, 191 Let h(q) = 180q2 + 3q - 2. Let b be h(1). Suppose -179f = -bf + 104. What are the prime factors of f? 2, 13 Suppose -26341 - 125373 = -16q + 13022. What are the prime factors of q? 2, 3, 11, 13 Let t(p) = -p3 - 34p*2 - 117p - 192. List the prime factors of t(-41). 2, 4093 Let l = 91221 - 56042. List the prime factors of l. 127, 277 Suppose -5z = -8z + 54. Let c(w) = -w*3 + 19w*2 - 19w + 23. Let m be c(z). Suppose u - 80 = -ms, 5u + 2s - 354 = -0u. List the prime factors of u. 2, 5, 7 Suppose -5r + 110 = -s, -6s + 4s - 31 = -r. Suppose -w = -47 - 50. Let o = w - r. List the prime factors of o. 2, 19 Let c be (-32)/80 - (-1054)/10. Suppose 17 = j - 63. Let r = c + j. What are the prime factors of r? 5, 37 Let o(d) = -d2 - 8d + 20. Let r be o(-8). Suppose 2w = -2w + r. List the prime factors of ((-194)/w)/(108/(-20) + 5). 97 Let x be (-4)/(-26) + ((-2036)/52 - 4). Let l = 94 + x. Suppose -5s + l = -4. List the prime factors of s. 11 Suppose 9a + 392 = 356. List the prime factors of (8 - 7)-2750a/10. 2, 5, 11 Let j(g) = -65g - 167. Let c(o) = -64o - 167. Let v(s) = -5c(s) + 6j(s). What are the prime factors of v(-6)? 11, 23 Suppose 705703 = 49x + 128583 - 592412. List the prime factors of x. 2, 3, 13, 17 Let o(f) = -f3 - 4f*2 - 49f - 56. Let x(n) = -n*2 - 10n - 11. Let b(t) = 2o(t) - 11x(t). Suppose 69 - 41 = -7z. What are the prime factors of b(z)? 137 List the prime factors of (1/(-3))/((-38)/((-963984)/(-4))). 2, 7, 151 Let g = -93 + 121. Let m(f) = 11f + 42. What are the	{ "pile_set_name": "DM Mathematics" }
tens digit of p? 0 Suppose a - n = -a + 19, 0 = 4a + 2n - 26. Let q(w) = -aw2 - 1 + 2 + w3 + 6 + 7w. What is the units digit of q(7)? 7 Let l(q) = -189q3 - 2q - 1. Let a be l(-1). Suppose 5x - 760 + a = 0. Suppose -w - 4g = -34, -w - 5g = 3w - x. What is the units digit of w? 6 Let r be 1/2(1 + -1). Let n(w) = w + 16. Let t be n(-14). Suppose -tf - 4q + 28 = r, 1 = 2f - 4q - 3. What is the units digit of f? 8 Let s(o) = -7 - 7o - 4o + 5o*2 - 2o. Let q be s(11). What is the tens digit of 1/3 + q/21? 2 Suppose -w - 5l + 6 = -l, -4w = 2l + 18. Let z(i) = -i2 - 6i. Let o be z(w). Suppose -6j + 7j - 21 = o. What is the units digit of j? 1 Suppose -5t + 3t = -5v + 91, t + 63 = -v. Let s = -10 - t. What is the tens digit of s? 4 Let k(z) = 15z + 2. Let u be k(-1). Let i(p) = p*3 + 13p*2 - 7p - 11. What is the units digit of i(u)? 0 Let r(c) = 5c - 20. Let o be r(14). Let v = 18 - o. What is the tens digit of (-8)/v - (-43)/4? 1 Suppose -2y = p - 79, 3y + 0p - p - 111 = 0. Suppose 18 = -yu + 41u. What is the tens digit of 681/(-4 + u)? 3 Suppose 5j - 2y - 7254 = 1863, 5j = 5y + 9120. What is the tens digit of j? 2 Let f = 1095 - 759. What is the hundreds digit of f? 3 Let u(p) = -17p + 26. Let f(z) = 4z - 3z - 9 + 6z - z. Let x(v) = -11f(v) - 4u(v). What is the tens digit of x(9)? 1 Suppose -2844 = -3f - 717. What is the hundreds digit of f? 7 Let k = 29 - 48. Let b be k/(-7) + 28/98. Suppose -u - bd - 34 = -3u, -3u + 4d = -49. What is the tens digit of u? 1 What is the hundreds digit of (9192/(-36))/(3/(-9))? 7 Suppose q - 25 + 2 = -w, 5q = -2w + 130. Let g(x) = -7x + 235. Let y be g(33). Suppose q = yl - 3l. What is the units digit of l? 8 Let v(h) = 10h + 10. Let z be 22/3 + (-1)/3. What is the units digit of v(z)? 0 Let a(l) = 7l2 - 16l - 98. What is the units digit of a(-6)? 0 Let a(n) = 1 + 3 + n*3 - 10n*2 - 2n3. Let p be 1 + (-5 + 1 - 7). What is the units digit of a(p)? 4 What is the hundreds digit of (-326240)/(-125) - (-30)/375? 6 Let z(h) = h3 - 7h2 - 17h - 41. What is the units digit of z(10)? 9 Suppose 13f = 5639 + 55. What is the hundreds digit of f? 4 What is the tens digit of 374/11(-12)/(-1)? 0 Let f(z) = -z*3 + 6z - 6. Let x = 28 + -34. Let y be f(x). Suppose -i + 90 = 5r - y, i = r - 54. What is the units digit of r? 3 Suppose 21f + 0f = 8757. What is the units digit of f? 7 Suppose 5m = 2w - 7w + 20, 5w + 2m = 11. Let f = w - 1. Suppose f = -2b + 5k - 8, -32 = 4b - 8b - 2k. What is the units digit of b? 6 Let h = 92 + -88. Suppose 276 = hn - 436. What is the hundreds digit of n? 1 Suppose -90i - 228 = -89i. Let v = i + 395. What is the tens digit of v? 6 Let p be ((-8)/(-3))/((-10)/(-15)). Suppose -g - p = -5. What is the units digit of ((-12)/14)/(g/(-7))? 6 Suppose 1369 = 7x - 227. What is the units digit of x/(-8)2/(-3)? 9 Let z be 4/(-10) - 6/10. Let g be (9 + 1)z/(-2). Suppose -4l + 4c + 56 = -36, -5l - gc + 155 = 0. What is the tens digit of l? 2 Suppose 2h = -0h - 8. Let u be 2 - (3 + h) - 2. What is the tens digit of u - -1 - 72/(-4)? 2 What is the thousands digit of (-627522)/(-231) - 24/44? 2 Let p(i) = i2 + 2i + 1. Let s be p(-2). Let k(m) = -3m3 - 2m + 1. Let d be k(s). What is the units digit of ((-540)/d)/5 + -3? 4 Let h = -31 + 13. Let u = h - -25. Let j(x) = 2x - 5. What is the units digit of j(u)? 9 Let w(n) = 34n*2 - 146n - 1. What is the tens digit of w(15)? 5 Let t = -58 - -83. Suppose -4g + 83 = -t. What is the units digit of g? 7 Suppose 0 = -2r + 7r - 10. Let l(u) = 3u*2 - 2u - 1. Let d be l(r). Suppose 108 = dk - 3k. What is the units digit of k? 7 Let t(b) = -b2 - b3 - 9b - 3b*2 + 4b*2 - 7b*2. Let x be t(-4). What is the units digit of (221)/(x/(-6))? 1 Suppose 4p - 36 = -12. Let t(l) = 2l + 19 - pl + 3l. What is the tens digit of t(7)? 1 Let d be (-2)/(-16) + 21399/(-56) + 4. Let x(t) = t*2 - 9t. Let k be x(8). What is the units digit of d/k + 2/(-8)? 7 Let d(s) = -22s - 4. Let h be d(-8). Suppose -2k + h = 10. What is the tens digit of k? 8 Let z(p) = p*2 - 2p + 3. Let m be z(4). Let j = 12 - m. What is the units digit of j? 1 Let x be 7(-1)/(-3)(51 - -6). Let q = 256 - x. What is the units digit of q? 3 Let x(f) be the first derivative of 8f2 - 4f - 6. Let v be (2/(-8))/((-4)/32). What is the units digit of x(v)? 8 Let s(v) be the first derivative of 4v3/3 + 3v*2/2 - 4v - 129. Suppose p = -p - 6. What is the units digit of s(p)? 3 Let i(p) = p*2 - p + 98. Let k be i(0). Let c = -1104 - -1104. Suppose co - k = -2o. What is the units digit of o? 9 What is the hundreds digit of (548 - -3) + -1 + 0? 5 Suppose 0 = -14f + 23798 - 7348. What is the units digit of f? 5 Let p(k) be the second derivative of -k5/20 - k4/3 + 2k3/3 + 9k*2/2 + k. Let n be p(-6). Let j = n + -33. What is the tens digit of j? 2 Suppose -26q = -15209 - 3381. What is the tens digit of q? 1 Let s be (-2 + 1 - 7) + -1. Let x = 87 + -62. Let d = x + s. What is the units digit of d? 6 Let g(c) = c*3 + 3c*2 - 4c - 1. Let w(q) = -6q - 2. Let h be w(-2). Let v(j) = j - 13. Let r be v(h). What is the tens digit of g(r)? 1 Let m be 2/(-8) - (-46)/(-8). Let x = 0 - m. What is the tens digit of ((-34)/x)/((-8)/24)? 1 Suppose 8q - 10q + 22 = z, 0 = -2z + 2q + 74. Let m(i) = -i2 + 3i - 1. Let r be m(-4). Let s = z + r. What is the units digit of s? 3 Let y = 38 + -28. Suppose -12g = -yg - 458. What is the units digit of g? 9 What is the units digit of (8 - (1 + -753)) + 8? 8 Let i be 5/2 - (-3)/2. Suppose -io = 3w - 86, 119 = 2w + 2w + o. Let a = w - -7. What is the tens digit of a? 3 Let t = -235 - -568. What is the hundreds digit of t? 3 What is the thousands digit of ((-210)/25)/(18/(-8145))? 3 Suppose -192 = -2l - 2a, -4a + 186 = 3l - l. Let g = l + -30. Suppose 0y - g = -y. What is the tens digit of y? 6 Suppose 4968 = 452y - 446y. What is the tens digit of y? 2 Suppose 0r - 10 = -5r. Suppose -48 = rd - 5d. What is the tens digit of d? 1 Let l(w) = w2 + 16w + 17. Let a be l(-15). Let f(b) = -11b3 - 29b*3 + a + b - 19b*3 + 17b*3. What is the tens digit of f(-1)? 4 Suppose 4m - 172 = 3h, 0m + 5h = 3m - 129. What is the units digit of m + (-2 - (2 + -4))? 3 Let b be 39/(-4) + 1/(-4). Let l be (-8)/(-10) + 28/b. What is the units digit of (0 + -2)/l45? 5 Let z be 101/4 - (-12)/24. Suppose 3c + 237 = zi, 0c + 75 = i + c. What is the tens digit of i? 7 Let n be (-14)/42(-21 + 0). Let x = n - -5. What is the tens digit of x? 1 Suppose n = -3m + 53, -4n - 2m + 173 = -n. Let i = 10 + -6. Suppose n + 21 = il. What is the units digit of l? 0 What is the hundreds digit of (-5 - -9) + -11 - -334? 3 Suppose 5295 = 3v + 996. What is the thousands digit of v? 1 What is the hundreds digit of (-392)/(-112)5384/14? 3 Let b(f) = f*2 + 6f + 24. Let g(c) = -8c2 + c + 1. Let z be g(-1). What is the units digit of b(z)? 0 Suppose 37 = -8i + 741. Suppose i = 7m - 3m. Suppose -7j - m = -9j. What is the units digit of j? 1 Let g(m) = -m*2 - 7m + 2. Suppose 3t + 2w = 3w - 13, -2t + 4w = -8. What is the units digit of g(t)? 8 Suppose 54a + 562005 = 189a. What is the tens digit of a? 6 Suppose -454 = -2n + 4k, n + 0k = -3k + 212. What is the units digit of n? 1 Let s(v) = 2v*2 + 3v + 20. Suppose 16 = -10q + 8q. Let h be s(q). Suppose 4k - h = -0k. What is the units digit of k? 1 Suppose 16f = 15f + 5. Suppose -285 = -fi + 5n, i + 2i + 2n = 156. What is the units digit of i? 4 Let d(a) = 6a2 - 24a - 48. What is the units digit of d(-7)? 4 Suppose d = -4d + 3345. What is the units digit of d/6 - 3/(-6)? 2 Suppose -p + 2 = -1. Suppose 0 = -pf + 4 + 2. What is the units digit of (32/(-10))/(f/(-5))? 8 Let x = -64 - -123. Suppose 0 = -5g - x + 94. What is the units digit of g? 7 Suppose 5v - 5522 = -4c, 7v + c - 4422 = 3v. What is the tens digit of v? 0 Suppose 0 = -6a + 4302 + 4884. What is the units digit of a? 1 What is the units digit of (18/8)/3 + (-335064)/(-96)? 1 Let r be -2 + 0(-1 - -2). Let x be -4(21/(-6) + r). Let v = x + 10. What is the units digit of v? 2 Let q = 29 - 27. What	{ "pile_set_name": "DM Mathematics" }
1 54 (base 12) to base 10 64 Convert -34 (base 8) to base 5. -103 5 (base 8) to base 14 5 Convert -1 (base 12) to base 10. -1 Convert -3 (base 5) to base 9. -3 What is -23 (base 7) in base 11? -16 -78 (base 10) to base 6 -210 71 (base 10) to base 12 5b -3 (base 4) to base 11 -3 -7 (base 11) to base 13 -7 What is -16 (base 9) in base 14? -11 What is -2 (base 6) in base 7? -2 What is -4 (base 16) in base 13? -4 Convert 13 (base 8) to base 9. 12 What is -11 (base 3) in base 4? -10 Convert 114 (base 8) to base 16. 4c Convert -112 (base 12) to base 15. -a8 Convert -a0 (base 11) to base 13. -86 What is 44 (base 9) in base 10? 40 Convert -152 (base 8) to base 10. -106 -e (base 16) to base 5 -24 What is 1 (base 8) in base 4? 1 What is 111 (base 3) in base 16? d Convert 346 (base 8) to base 5. 1410 What is -3 (base 13) in base 6? -3 Convert 103 (base 6) to base 2. 100111 Convert -1a (base 13) to base 11. -21 Convert 0 (base 7) to base 2. 0 -123 (base 8) to base 5 -313 Convert 2 (base 13) to base 10. 2 -102 (base 3) to base 10 -11 1d (base 15) to base 16 1c What is -45 (base 12) in base 4? -311 -3 (base 12) to base 5 -3 Convert -10 (base 3) to base 7. -3 What is 13 (base 7) in base 13? a Convert -36 (base 13) to base 16. -2d 13 (base 14) to base 12 15 What is -ab (base 13) in base 14? -a1 24 (base 7) to base 5 33 Convert -12 (base 7) to base 3. -100 What is 1 (base 10) in base 4? 1 2 (base 15) to base 6 2 Convert 11 (base 3) to base 13. 4 -241 (base 5) to base 7 -131 3 (base 16) to base 7 3 Convert 6 (base 10) to base 8. 6 Convert -11 (base 15) to base 16. -10 What is -2 (base 14) in base 7? -2 -42 (base 8) to base 5 -114 -1110 (base 2) to base 6 -22 Convert -11 (base 6) to base 11. -7 What is -1 (base 11) in base 7? -1 1 (base 14) to base 4 1 Convert -66 (base 9) to base 5. -220 -103 (base 4) to base 10 -19 What is -20021 (base 3) in base 13? -100 Convert 1 (base 8) to base 11. 1 -8 (base 16) to base 5 -13 Convert -10 (base 4) to base 8. -4 What is -a (base 12) in base 7? -13 241 (base 5) to base 14 51 -1010110 (base 2) to base 7 -152 Convert -30 (base 9) to base 6. -43 -7 (base 10) to base 4 -13 What is -3 (base 5) in base 2? -11 15a (base 16) to base 15 181 Convert -21 (base 3) to base 4. -13 11 (base 4) to base 16 5 What is 10 (base 15) in base 4? 33 Convert 1 (base 7) to base 13. 1 Convert -15 (base 8) to base 2. -1101 -3 (base 11) to base 8 -3 Convert -12 (base 8) to base 6. -14 What is 91 (base 13) in base 11? a8 Convert -111200 (base 3) to base 9. -450 -57 (base 12) to base 10 -67 What is -23 (base 4) in base 6? -15 What is -5 (base 10) in base 2? -101 1 (base 10) to base 4 1 -c (base 14) to base 6 -20 Convert 23 (base 13) to base 16. 1d What is a7 (base 12) in base 10? 127 Convert -3 (base 5) to base 2. -11 Convert -2 (base 12) to base 13. -2 -10101100 (base 2) to base 11 -147 What is -1324 (base 6) in base 13? -202 Convert c1 (base 13) to base 10. 157 -2 (base 12) to base 9 -2 Convert 12 (base 3) to base 7. 5 Convert -7 (base 12) to base 10. -7 Convert -2 (base 4) to base 2. -10 What is 11 (base 2) in base 4? 3 What is -10 (base 4) in base 15? -4 What is 311 (base 4) in base 9? 58 Convert -1011111 (base 2) to base 15. -65 What is -1010 (base 2) in base 4? -22 What is -14 (base 13) in base 2? -10001 -10 (base 7) to base 15 -7 -3 (base 4) to base 16 -3 What is -1 (base 12) in base 6? -1 c4 (base 13) to base 8 240 1 (base 5) to base 7 1 4 (base 16) to base 14 4 What is 30 (base 11) in base 15? 23 What is -122 (base 4) in base 14? -1c 3 (base 15) to base 5 3 6c (base 13) to base 3 10100 Convert -1 (base 12) to base 9. -1 Convert -1210 (base 3) to base 9. -53 What is 18 (base 11) in base 2? 10011 Convert 6 (base 10) to base 16. 6 -33 (base 15) to base 8 -60 Convert -303 (base 6) to base 10. -111 What is 0 (base 6) in base 10? 0 What is 12 (base 12) in base 10? 14 Convert -5 (base 12) to base 5. -10 Convert -6 (base 9) to base 10. -6 Convert 101001 (base 2) to base 8. 51 What is 1122 (base 5) in base 11? 138 Convert 3 (base 7) to base 13. 3 Convert 126 (base 8) to base 5. 321 Convert -2 (base 3) to base 11. -2 Convert -2 (base 8) to base 16. -2 -2200 (base 4) to base 14 -b6 2210 (base 3) to base 7 135 -11101 (base 2) to base 13 -23 Convert 4f (base 16) to base 9. 87 -1 (base 11) to base 9 -1 What is -23 (base 12) in base 11? -25 What is 1200 (base 4) in base 10? 96 -24 (base 6) to base 16 -10 5 (base 9) to base 5 10 1 (base 3) to base 7 1 Convert 2 (base 5) to base 16. 2 Convert -240 (base 5) to base 14. -50 Convert 201 (base 3) to base 9. 21 Convert -10001011 (base 2) to base 3. -12011 15 (base 16) to base 12 19 What is 1100 (base 4) in base 5? 310 Convert -113 (base 8) to base 6. -203 Convert 2a (base 15) to base 13. 31 -1 (base 15) to base 13 -1 Convert 1111110 (base 2) to base 16. 7e 6 (base 14) to base 4 12 What is -43 (base 15) in base 11? -58 -1120 (base 3) to base 13 -33 What is -12 (base 10) in base 13? -c Convert 3 (base 11) to base 15. 3 121 (base 5) to base 4 210 Convert 1 (base 14) to base 8. 1 -2 (base 15) to base 8 -2 What is -14 (base 6) in base 11? -a 0 (base 12) to base 9 0 18 (base 13) to base 5 41 1d (base 15) to base 6 44 Convert 6 (base 8) to base 16. 6 What is -23 (base 9) in base 4? -111 Convert 0 (base 2) to base 9. 0 Convert 3 (base 15) to base 14. 3 What is -7 (base 15) in base 8? -7 Convert -3d (base 16) to base 7. -115 What is -36 (base 12) in base 10? -42 What is 205 (base 8) in base 13? a3 87 (base 11) to base 8 137 Convert -1 (base 13) to base 7. -1 51 (base 8) to base 5 131 Convert 66 (base 7) to base 5. 143 What is 3 (base 8) in base 6? 3 Convert -231 (base 7) to base 15. -80 c (base 16) to base 4 30 What is 101 (base 3) in base 5? 20 What is -220 (base 3) in base 14? -1a What is -9e (base 15) in base 16? -95 Convert 11c (base 15) to base 7. 510 314 (base 8) to base 5 1304 What is -46 (base 9) in base 10? -42 What is -2 (base 16) in base 4? -2 Convert 123 (base 5) to base 14. 2a What is -101101 (base 2) in base 10? -45 What is 0 (base 8) in base 5? 0 Convert 3 (base 12) to base 11. 3 What is 1 (base 16) in base 4? 1 What is 131 (base 4) in base 16? 1d What is -3 (base 11) in base 3? -10 What is -103 (base 5) in base 11? -26 Convert 170 (base 13) to base 8. 404 Convert -123 (base 4) to base 11. -25 10010 (base 2) to base 11 17 -51 (base 13) to base 11 -60 What is 6 (base 13) in base 9? 6 Convert 0 (base 9) to base 8. 0 Convert -c7 (base 13) to base 4. -2203 Convert 13 (base 4) to base 3. 21 What is 30 (base 13) in base 5? 124 What is 2 (base 4) in base 15? 2 What is -15 (base 6) in base 16? -b Convert -9 (base 14) to base 16. -9 -7 (base 11) to base 9 -7 -40 (base 5) to base 16 -14 Convert -140 (base 5) to base 7. -63 -4 (base 6) to base 5 -4 What is 5 (base 10) in base 16? 5 3 (base 5) to base 15 3 -46 (base 9) to base 2 -101010 What is 58 (base 15) in base 3? 10002 -22 (base 3) to base 8 -10 What is 14 (base 5) in base 11? 9 What is -5e (base 15) in base 8? -131 What is -3 (base 9) in base 12? -3 Convert -2 (base 8) to base 4. -2 Convert -13 (base 4) to base 9. -7 Convert -110000 (base 2) to base 15. -33 Convert -20 (base 6) to base 14. -c What is -40 (base 13) in base 12? -44 Convert -40 (base 9) to base 14. -28 Convert 1 (base 11) to base 12. 1 -23 (base 8) to base 15 -14 Convert -221 (base 4) to base 14. -2d Convert -6 (base 13) to base 6. -10 Convert -160 (base 13) to base 14. -139 1 (base 3) to base 12 1 Convert -4 (base 13) to base 2. -100 Convert 114 (base 7) to base 9. 66 260 (base 9) to base 11 187 a1 (base 11) to base 12 93 Convert -10010 (base 2) to base 15. -13 Convert 1100101 (base 2) to base 8. 145 Convert -36 (base 8) to base 11. -28 What is 2 (base 6) in base 11? 2 47 (base 11) to base 14 39 4c (base 14) to base 13 53 58 (base 10) to base 15 3d What is -5 (base 14) in base 4? -11 -2 (base 4) to base 10 -2 126 (base 12) to base 11 149 22 (base 4) to base 16 a 39 (base 16) to base 13 45 Convert 1000 (base 3) to base 16. 1b What is -30 (base 15) in base 3? -1200 What is 18 (base 15) in base 3? 212 Convert -1 (base 9) to base 14. -1 130 (base 8) to base 5 323 -95 (base 11) to base 9 -125 12 (base 6) to base 8 10 Convert -1 (base 15) to base 3. -1 -1012 (base 3) to base 7 -44 Convert 51 (base 16) to	{ "pile_set_name": "DM Mathematics" }
c. 2 Solve -22t = 1 - 23 for t. 1 Solve 6u = 61 - 79 for u. -3 Solve -50m - 12 = -62 for m. 1 Solve -1905m - 120 = -1890m for m. -8 Solve -6j + 49 = 31 for j. 3 Solve -33p = 118 - 19 for p. -3 Solve -24h = -27h - 6 for h. -2 Solve -28 = 78r - 184 for r. 2 Solve -12r = 12r + 48 for r. -2 Solve 0 = 1442i - 1456i + 112 for i. 8 Solve 62u - 28 = 96 for u. 2 Solve 7i - 25 = 10 for i. 5 Solve -5u - 55 + 45 = 0 for u. -2 Solve -8 = -9s + 17s for s. -1 Solve -h + 5 = 2 for h. 3 Solve 33 + 11 = -11h for h. -4 Solve 45 = -11g + 78 for g. 3 Solve 10m = -6 - 4 for m. -1 Solve 38s = 42s - 12 for s. 3 Solve 3u - 62 = -77 for u. -5 Solve 2c + 213 = 203 for c. -5 Solve 17 = 31k - 14 for k. 1 Solve -7d + 141 = 113 for d. 4 Solve -2235u + 3 = -2236u for u. -3 Solve 15c + 19c + 204 = 0 for c. -6 Solve 25n = -17 - 133 for n. -6 Solve -6h = 1332 - 1308 for h. -4 Solve 34 = -66d + 83d for d. 2 Solve 0 = 4p - 3 - 17 for p. 5 Solve 24f - 13 + 85 = 0 for f. -3 Solve -77 = -16g + 51 for g. 8 Solve 8j + 36 = 84 for j. 6 Solve -44t + 60 = -56t for t. -5 Solve -5y = -y for y. 0 Solve 8 = -15p + 53 for p. 3 Solve 28j - 12 = 34j for j. -2 Solve 11q - 2q = -9 for q. -1 Solve 2a = 19 - 27 for a. -4 Solve o + 91 = 91 for o. 0 Solve -16x - 21 = -101 for x. 5 Solve -4z + 2z + 12 = 0 for z. 6 Solve -9f = -7f - 10 for f. 5 Solve -101 = 11j - 35 for j. -6 Solve 51y = 15y + 72 for y. 2 Solve 214l - 8 = 213l for l. 8 Solve -u + 52 = 12u for u. 4 Solve 28l - 41l + 117 = 0 for l. 9 Solve -190d + 198d = 32 for d. 4 Solve -12 = -7i - 33 for i. -3 Solve 0 = 16u + 6 - 22 for u. 1 Solve 0 = -5x + 2 - 7 for x. -1 Solve -6n + 14 = -8n for n. -7 Solve 0 = 5m + 675 - 650 for m. -5 Solve 42 + 8 = 10a for a. 5 Solve -12 = -3j - 27 for j. -5 Solve 36 = 862x - 871x for x. -4 Solve -12w - 3w = 15 for w. -1 Solve -5z - 2 - 18 = 0 for z. -4 Solve -686 + 674 = -2p for p. 6 Solve -4o + 0 = 8 for o. -2 Solve 579 - 3 = 72o for o. 8 Solve 22f - 21f + 5 = 0 for f. -5 Solve 218 = 11z + 273 for z. -5 Solve -4x = -5x for x. 0 Solve 0 = -523p + 525p + 2 for p. -1 Solve -19s = -15s + 16 for s. -4 Solve 0 = -5l - 54l + 472 for l. 8 Solve 5a + 4 + 16 = 0 for a. -4 Solve 3t + 10 = -2t for t. -2 Solve 6y + 15y = 0 for y. 0 Solve 7a + 20 + 1 = 0 for a. -3 Solve 9z - 240 = -195 for z. 5 Solve -55 = -28z + 1 for z. 2 Solve -34o + 106o = 72 for o. 1 Solve -10j - 10 - 10 = 0 for j. -2 Solve 0r + 4r = r for r. 0 Solve 171p = 153p + 144 for p. 8 Solve -4w = 3w for w. 0 Solve -9 = -6b + 3 for b. 2 Solve -2x - 13799 + 13805 = 0 for x. 3 Solve -25o - 54 - 71 = 0 for o. -5 Solve -44 + 128 = -14d for d. -6 Solve 70x - 79x = 0 for x. 0 Solve 0 = 49w - 51w - 12 for w. -6 Solve 4v = 43 - 39 for v. 1 Solve 81 = 6u + 69 for u. 2 Solve -19i = -7i - 12 for i. 1 Solve -12j = -13j + 1 for j. 1 Solve -9y + 9 = 45 for y. -4 Solve 52 = -6h - 7h for h. -4 Solve 3 = -3a + 12 for a. 3 Solve -20q + 102 - 42 = 0 for q. 3 Solve -31 = 9b + 14 for b. -5 Solve 0 = -g - 2 - 1 for g. -3 Solve 98 = -6n + 86 for n. -2 Solve 9f = 60 - 6 for f. 6 Solve 0 = 44d - 41d + 6 for d. -2 Solve 59x - 57x + 8 = 0 for x. -4 Solve -y + 4y - 9 = 0 for y. 3 Solve 0 = 2s - 1237 + 1225 for s. 6 Solve 88p = 81p - 35 for p. -5 Solve -5l + 16 = -l for l. 4 Solve 9n + 29 + 7 = 0 for n. -4 Solve -6n - 37 = -1 for n. -6 Solve -27 = 15k + 3 for k. -2 Solve 0 = -25b + 3b + 66 for b. 3 Solve -40 = -110h - 260 for h. -2 Solve -3q - 3q = -30 for q. 5 Solve -2g + 14 = 5g for g. 2 Solve -60o - 190 = 410 for o. -10 Solve -3o = 4o - 3o for o. 0 Solve 7b = 39b for b. 0 Solve -3n = 3n for n. 0 Solve 0 = 38l - 42l + 20 for l. 5 Solve 180 = -49y + 67y for y. 10 Solve 3y - 15 = -3 for y. 4 Solve -6p = -7p + 2 for p. 2 Solve -15f + 18f = 6 for f. 2 Solve 3f - 7 = -19 for f. -4 Solve 0 = r - 26 + 23 for r. 3 Solve 20 = -g + 15 for g. -5 Solve -84o + 18 = -90o for o. -3 Solve -69i + 186 = -100i for i. -6 Solve 0 = 5w - 19w - 28 for w. -2 Solve 0 = 2d + 37 - 43 for d. 3 Solve 4 = 10f - 12f for f. -2 Solve -8j = 121 - 145 for j. 3 Solve -25l + 68 = -59l for l. -2 Solve 47i - 28 = 19 for i. 1 Solve -1 = -7g - 36 for g. -5 Solve -6 = 7b - 13b for b. 1 Solve 4v + 44 = -7v for v. -4 Solve -5s - 25 = -55 for s. 6 Solve 0b + b = 0 for b. 0 Solve 14v + 77 - 21 = 0 for v. -4 Solve -15l = 9l - 24 for l. 1 Solve 0 = 79u - 44 - 35 for u. 1 Solve -2h + 4h = 10 for h. 5 Solve 0 = 3q + 62 - 77 for q. 5 Solve -293s = -284s - 9 for s. 1 Solve -25s = -8s - 85 for s. 5 Solve -8o - 30 = -6 for o. -3 Solve 20 = -12i + 8i for i. -5 Solve 46g + 215 = 3g for g. -5 Solve -21 = g - 20 for g. -1 Solve 0t - 6t = -12 for t. 2 Solve -4m = 291 - 299 for m. 2 Solve -6v + 6 = -24 for v. 5 Solve 5 = 2s + 15 for s. -5 Solve 25 = -7x + 11 for x. -2 Solve -6r + 300 = 24r for r. 10 Solve -131 = -5p - 111 for p. 4 Solve -42s - 24s = 330 for s. -5 Solve 4h + 96 - 88 = 0 for h. -2 Solve -7t = 5t - 24 for t. 2 Solve 0 = -263m + 261m + 18 for m. 9 Solve -14b - 44 + 100 = 0 for b. 4 Solve 0 = 3t - 23 + 29 for t. -2 Solve 56 = 844b - 858b for b. -4 Solve -5n = -19n + 12n for n. 0 Solve 0 = -2w - 3 - 7 for w. -5 Solve -3r = 20 - 14 for r. -2 Solve 0 = -4o - 332 + 320 for o. -3 Solve 0 = 125g - 147g + 198 for g. 9 Solve 4s - 101 = -121 for s. -5 Solve 0 = 6h - 16 + 22 for h. -1 Solve 13l = -11l - 72 for l. -3 Solve 8g + 47g = 495 for g. 9 Solve l + 297 = 34l for l. 9 Solve 3p = 16 - 4 for p. 4 Solve 12z + 2z = 56 for z. 4 Solve -67 = 24x + 5 for x. -3 Solve 0 = -18i - 0i - 18 for i. -1 Solve 139 = -k + 136 for k. -3 Solve 11b = -45 + 1 for b. -4 Solve -10s + 20 = -15s for s. -4 Solve -6x = 4x + 40 for x. -4 Solve 0 = 264m - 255m + 45 for m. -5 Solve -17k + 51 = 17 for k. 2 Solve 0 = 9r + 3 - 39 for r. 4 Solve -b + 20 = 24 for b. -4 Solve 25o = -4 - 21 for o. -1 Solve -10 = -14x + 9x for x. 2 Solve -7g = 2 + 19 for g. -3 Solve -d + 7 = 2 for d. 5 Solve 0 = 20x - 62 - 58 for x. 6 Solve -6 = -18t + 21t for t. -2 Solve -45 = 14n - 59 for n. 1 Solve -2h + 142 - 132 = 0 for h. 5 Solve 0 = 94j - 81j - 78 for j. 6 Solve 26x = 37x - 44 for x. 4 Solve -72b = -64b + 24 for b. -3 Solve 3w - 9w - 6 = 0 for w. -1 Solve 0 = 18v - 5v - 65 for v. 5 Solve 5d - 5 = 4d for d. 5 Solve 0 = -7h + 6h - 1 for h. -1 Solve 31 = -c + 32 for c. 1 Solve 5l + 10 = -5 for l. -3 Solve 0 = 5i + 55 - 40 for i. -3 Solve -7u - 15 = -8 for u. -1 Solve -22q = -56q - 170 for q. -5 Solve -6z - 168 = -62z for z. 3 Solve 0 = 3x - 68 + 50 for x. 6 Solve -21b - 18 = -102 for b. 4 Solve -h = -13h for h. 0 Solve -6l = 29 - 35 for l. 1 Solve -7p + 12 = -19p for p. -1 Solve -15c - 1 = 59 for c. -4 Solve -5u - 24 = -11u for u. 4 Solve -43r + 35r = -32 for r. 4 Solve 9y = -1 + 28 for y. 3 Solve 70 = -2m + 74 for m. 2 Solve 4h - 103 = -103 for h. 0 Solve 16d = 15d for d. 0 Solve 7m - 5 + 33 = 0 for m. -4 Solve 1 - 9 = -2b for b. 4 Solve 369 = 5h + 354 for h. 3 Solve 43w + 27 = 16w for w. -1 Solve 0g + 7g = 0 for g. 0 Solve 107q + 20 = 117q for q. 2 Solve 8x + 50 = 2 for x. -6 Solve 1 = 19p - 37 for p. 2 Solve -57 = -70x + 83 for x. 2 Solve 0 = -3q + 16 - 40 for q. -8 Solve -53 + 40 = 13k for k. -1 Solve -6 = -10b + 12b for b. -3 Solve 10p = -8p + 36 for p. 2 Solve 43r = 165r + 244 for r. -2 Solve 23f - 105 = -13 for f. 4 Solve -16d - 65 = -3d for d. -5 Solve -17q = -13q - 12 for q. 3 Solve 4w + 12 = 10w for w. 2 Solve -11w = w - 0w for w. 0 Solve q = -5q + 24 for q. 4 Solve 0 = -15y + 19y + 8 for y. -2 Solve 6l - 18 = -0l for l. 3 Solve 23 = -21u - 40 for u. -3 Solve -8x - 25 = 39 for x. -8 Solve 3699a + 12 = 3687a for a. -1 Solve -24 = 12f - 0f for f. -2 Solve 39z = -24z + 126 for z. 2 Solve -2b = -11b + 36 for b. 4 Solve -1738w = -1714w + 216 for w. -9 Solve 38q + 139 + 127 = 0 for q. -7 Solve -27s - 8 = -25s for s. -4 Solve 4v = -96v - 800 for v. -8 Solve 0 = -q - 9q + 3q for q. 0 Solve 182g = 179g for g. 0 Solve 0 = -20q - 6 + 6 for q. 0 Solve 0 = -10f - 93 + 33 for f. -6 Solve 0 = -11v + 33v - 44 for v. 2 Solve -12*g - 100 + 112	{ "pile_set_name": "DM Mathematics" }
6 = 2j + 2j, 0 = 4u + 5j - 32. What is the remainder when 26 is divided by b(u)? 6 Let j(r) = r*2 - 5r - 9. What is the remainder when 106 is divided by j(9)? 25 Let y = -294 + 569. Calculate the remainder when y is divided by 46. 45 Suppose 3z = -z - 240. Let k = -28 - z. What is the remainder when k is divided by 11? 10 Let p(k) = 11k. Suppose -10 = -3t + 14. What is the remainder when p(1) is divided by ((-6)/t)/(2/(-8))? 2 Let n = 100 - 95. What is the remainder when (-4)/(-14) - 248/(-14) is divided by n? 3 Suppose -t + 3t = 3n + 23, -3t - n = -18. Calculate the remainder when 27 is divided by t. 6 Suppose -3m = d, 5m = 4d - 10 - 7. Calculate the remainder when (-10)/(-4)(-294)/(-105) is divided by d. 1 Let z = 19 + -23. Calculate the remainder when 48 is divided by (2/z)/(6/(-204)). 14 Suppose -4d = 3b - 220, -5d - 309 = -4b - 57. Calculate the remainder when b is divided by 14. 12 Let f(u) = -3u + 1. Let h be f(-2). Let p(x) = -x2 + 9x - 7. What is the remainder when 34 is divided by p(h)? 6 Let n(t) = -t*2 + 12t + 16. Calculate the remainder when 46 is divided by n(12). 14 Suppose 0 = t - 4. Calculate the remainder when 18 is divided by t. 2 Let h(y) = -y*2 - y + 5. Let r be h(0). Suppose -rk + 39 = -11. What is the remainder when 38 is divided by k? 8 Suppose 0 = 19k - 14k - 60. Calculate the remainder when 357 is divided by k. 9 Suppose 5s + 45 = -5o, -o + 1 = s - 2s. Let b = 19 + s. What is the remainder when 26 is divided by b? 12 Let x = 6 - 4. Suppose -xv + 27 = 9. Calculate the remainder when 33 is divided by v. 6 Suppose 304 = 4z + 4q, -182 = -3z + z + 4q. Suppose 4s + 2n = 570, s + 3n - 112 = 28. Let t = s - z. What is the remainder when t is divided by 16? 14 Suppose -3i - 4m + 234 = 0, 2i - 3m + 2m - 167 = 0. What is the remainder when i is divided by 17? 14 Suppose -4 = -3a - 5c + 14, -4a - 4c = -16. What is the remainder when 37/(0 + a) - 3 is divided by 9? 7 Let a = -9 - -17. Calculate the remainder when 14 is divided by a. 6 Suppose 4n + 16 = 2p, -3p - n = 2n - 33. Let s = 22 - p. Calculate the remainder when s is divided by 7. 5 What is the remainder when 266/42 - (-2)/3 is divided by 4? 3 Let t = 79 + -61. What is the remainder when 71 is divided by t? 17 Let y(h) = -h*2 - 8h + 2. Suppose 4w - 62 = 2j, -5w = 2j - 66 - 16. Calculate the remainder when w is divided by y(-7). 7 Suppose -37 - 59 = -4s. Let y(x) = x. Calculate the remainder when s is divided by y(13). 11 Let s(n) be the first derivative of 5n4/2 + n2/2 - n + 3. What is the remainder when 29 is divided by s(1)? 9 Let s be 3/2 - (-3)/6. Suppose 0 = -m + 5y + 25, -7m + sm = 2y - 71. Calculate the remainder when 27 is divided by m. 12 Suppose -1 = a - 3. What is the remainder when 28/6 - 2/(-6) is divided by a? 1 Suppose -4y + 3y = 4. Let b(x) = -3x + 1. Calculate the remainder when b(y) is divided by 7. 6 Let s(q) = q3 + 5q*2 + 3q + 1. Let l = 12 - 7. Suppose -2b = 5d + 13, lb + 0b + 10 = -5d. What is the remainder when s(d) is divided by 6? 4 Suppose -3q = q + 4i - 16, -2q = 3i - 3. Calculate the remainder when 12 is divided by 520/72 - 2/q. 5 Suppose -4i = -4b, -i = -b + 3b. Suppose i = 4h - h. Suppose ht = -4t + 100. What is the remainder when t is divided by 13? 12 Let d = 10 - 7. Calculate the remainder when 10 is divided by d. 1 What is the remainder when (536/6 - 0)/(4/6) is divided by 17? 15 Let n(i) = -i2 - i + 12. Let f be n(0). Suppose q = f + 1. What is the remainder when 23 is divided by q? 10 Let i = 8 + 10. Suppose 2z - 4z = -i. Calculate the remainder when 33 is divided by z. 6 Let v be (-14)/(-4)213. Let t = v - 38. Calculate the remainder when t is divided by 27. 26 Let x(z) = -5z - 3. Let o be 2/(-1)6/4. Let a = 20 - -14. What is the remainder when a is divided by x(o)? 10 Suppose 5b - 188 = b. Let x(z) = z*2 - 6z + 9. Let g(c) = c*3 - 16c2 + c - 9. Let u be g(16). Calculate the remainder when b is divided by x(u). 15 Let h(r) = r3 - r*2 - 3r - 5. Calculate the remainder when h(4) is divided by 11. 9 Let v(q) = q*2 - 10q - 15. Let t be v(11). Let a = t + 26. Calculate the remainder when a is divided by 12. 10 Let u(c) = 9c - 17. What is the remainder when 79 is divided by u(3)? 9 Let n(v) = 2v - 5. Let m = 8 + -3. Suppose -ml - 1 = -21. What is the remainder when l is divided by n(4)? 1 Let h(v) be the first derivative of v2/2 - 4v + 6. Suppose -4r + 9r - 5 = 0. Calculate the remainder when r is divided by h(5). 0 Calculate the remainder when 4/1 + 6 + -3 is divided by 4. 3 Suppose -3v = 4y - 0v - 552, -y = 3v - 147. Let i = y - 66. What is the remainder when i is divided by 18? 15 Let k = 50 - 29. Suppose 0 = -r + 4r - k. What is the remainder when r is divided by 4? 3 Let k = -3 - -9. Suppose -k - 35 = -q. What is the remainder when q is divided by -128/16-8? 13 Suppose -5q + 27 = -4q. Calculate the remainder when q is divided by 7. 6 Let o = -37 - -51. Calculate the remainder when o is divided by 8. 6 Suppose 3s - 2s - 3 = 4w, w + 9 = 3s. Calculate the remainder when 11 is divided by s. 2 Suppose 39 = -4q + 7q. Let p = -28 + 91. Calculate the remainder when p is divided by q. 11 Suppose 3k - 137 = -l + 2l, 2k + 4l - 96 = 0. Let w = 13 - -3. What is the remainder when k is divided by w? 14 Suppose -2k - 40 = -4m, -2k + 37 = 5m + 2k. Let j be (3/(-2))/((-1)/22). Let a = j - 17. Calculate the remainder when a is divided by m. 7 Let y = -9 - -17. Suppose 0g + 4g - 56 = 0. What is the remainder when g is divided by y? 6 Let h = 33 + -10. What is the remainder when 90 is divided by h? 21 Suppose 160 = 4x - 0x. Calculate the remainder when x is divided by 11. 7 Suppose k + 0k + 4u = 30, 3k = u + 51. Suppose -k = -2q - 0q. Calculate the remainder when 26 is divided by q. 8 Let c(a) = -5a + 1. What is the remainder when 78 is divided by c(-3)? 14 Let s = 94 + -54. Calculate the remainder when s is divided by 14. 12 Suppose 0 = c + 2k - 11 - 8, 4c - 2k = 76. Calculate the remainder when 36 is divided by c. 17 Let i be 52/(-9) + (-4)/18. Let a(o) = 3o - 46. What is the remainder when (-248)/i + 1/(-3) is divided by a(20)? 13 Let r(p) = p*2 - 16p - 8. Suppose 3i - i - 56 = -4q, -q = -3i - 21. What is the remainder when r(18) is divided by q? 13 Let n = -2 + 3. Let u(f) = -n + 1 - 8f - f2 + 4 + 0. Calculate the remainder when 47 is divided by u(-6). 15 Let l = 61 - 37. What is the remainder when 71 is divided by l? 23 Let k(r) = -r3 - 7r2 - 4r - 1. Calculate the remainder when 871/11 - (-16)/(-88) is divided by k(-7). 25 Let h = 26 - 17. Suppose -41 = -2y + h. What is the remainder when y is divided by 7? 4 Let h = -19 - -43. Suppose -3m = m - h. Suppose -3a - 2o = -10, -3o + 11 = 4a - 2. Calculate the remainder when m is divided by a. 2 Suppose -o = 2o - 6. Suppose -2 = -2i + o. What is the remainder when i is divided by 2? 0 Suppose -2k = -0k - 16. Let z = 50 + -29. What is the remainder when z is divided by k? 5 Suppose 5o = t + 4o - 29, 5o - 195 = -5t. What is the remainder when t is divided by 10? 4 Suppose 3t + 3 = 0, 17 = b + 2t - 111. Suppose 8s - b = 3s. Calculate the remainder when s is divided by 2/7 + 366/42. 8 Let h(r) be the first derivative of 19r2/2 + r + 1. What is the remainder when h(3) is divided by 15? 13 What is the remainder when 75 is divided by (11 + 2)(-18)/(-4 + -2)? 36 Suppose 0 = -2x + 5o + 8 + 12, -2x - o + 32 = 0. Let b = x + 4. Calculate the remainder when b is divided by 10. 9 Suppose -462 = -11i - 3i. What is the remainder when i is divided by 9? 6 Calculate the remainder when (-4)/6 - -1(-419)/(-3) is divided by 36. 31 Suppose l = 2f + 51, -1 = -3f - 7. Calculate the remainder when l is divided by 12. 11 Suppose 0o = -o + 5g - 9, 2g - 10 = 0. Suppose 5z + 163 = 3f, 2f - 6f + 209 = -5z. What is the remainder when f is divided by o? 14 Calculate the remainder when 34/(-4 - (-26)/6) is divided by 21. 18 Let b(d) = 8d + 8. What is the remainder when 77 is divided by b(4)? 37 Suppose -x = 4d - 49, 2x - 25 = -d + 6x. Calculate the remainder when d is divided by 2/8 + (-54)/(-8). 6 Let n(s) = -s*2 + 7s +	{ "pile_set_name": "DM Mathematics" }
= -163j. Let k(b) = 1286b - 9. Determine k(g(r)). -209618r - 9 Let b(d) = 0d*2 - 5 - 5d - d + 3 - d*2. Let g be b(-4). Let h(j) = -gj + 11j + 2j. Let u(m) = -m*2. Calculate h(u(v)). -7v*2 Let r(b) = -4b*2 - 140. Let i(o) = -1070o. Calculate i(r(w)). 4280w2 + 149800 Let h(r) = 2r*2. Let p(g) = -15323071g. Give h(p(x)). 469593009742082x2 Let j(u) = -2u*2. Let v = -160 + 162. Let f(h) = -352 + 0h - vh + 507. Determine j(f(g)). -8g*2 + 1240g - 48050 Let u(v) be the second derivative of v*4/4 + 12v - 38. Let q(k) = 206k2 - 14. Let l(j) = 41j*2 - 3. Let o(p) = 14l(p) - 3q(p). Give o(u(f)). -396f*4 Let y(h) = 110h. Let z(u) = -15u - 4. Let i(q) = -6q - 1. Let m(t) = 10i(t) - 2z(t). Calculate m(y(c)). -3300c - 2 Let t(y) = -1775y2. Let r(i) be the second derivative of -i4/6 + 2317i. Determine r(t(j)). -6301250j*4 Let y = 132 - 124. Let s(f) = yf - 7f + 0f + 11f. Let a(j) = -j2. Calculate s(a(u)). -12u*2 Let r(u) = -138319u*2. Let m(i) = 4i - 29. What is m(r(g))? -553276g2 - 29 Let l(j) = 39j - 2. Let o(u) be the third derivative of 11u4/24 + 48u*2 - 13u. What is l(o(a))? 429a - 2 Let f(d) = -d. Let l(t) = -5t*2 - 145273t. Calculate l(f(w)). -5w2 + 145273w Let g(p) = -87p + 276. Let d(f) = 1908f. Determine d(g(z)). -165996z + 526608 Let v(n) = -6n*2. Let q(y) = y - 27. Let a be q(25). Let w be (-1 - (-66)/42)/(a/(-7)). Let p(d) = 0d*w + 2d2 + d2 - d*2. Calculate v(p(s)). -24s*4 Let g(w) = -w + 7. Let x(j) be the second derivative of 3j*4 + 503j - 1. Give x(g(q)). 36q2 - 504q + 1764 Let d(l) = 3l2 + 5885l + 1. Let r(y) = 19y + 3. Give r(d(j)). 57j*2 + 111815j + 22 Let q(n) = 8n2 - 7n*2 - n + n. Suppose -v - 1 + 8 = 0. Let b(r) = 28 - vr + 16r - 28. Determine q(b(g)). 81g*2 Let x(s) = -17s*2. Suppose 26p - 15p - 67298 = 0. Let l(k) = -6118 + 6k + 6k + p. Calculate l(x(u)). -204u*2 Let i(m) = -790m*2. Let w(k) = -k - 163k*2 - 202k*2 + k + 358k*2. Determine i(w(d)). -38710d*4 Let a(l) = 59l. Let p(r) = -165446r. Calculate a(p(u)). -9761314u Let i(x) = 27160x. Let u(g) = 9g. Let z(y) = 2y. Let a(s) = -4u(s) + 19z(s). Determine a(i(q)). 54320q Let l(t) = 10t. Suppose -4q + 44 = 2g - 6g, 0 = 5q - g - 35. Suppose qj + j - 210 = 0. Let x(y) = y - 30 + j. Give l(x(b)). 10b Let u(a) = -39a*2. Let r(t) be the third derivative of 26t*2 + 0t + 0t3 + 0 - 1/12t*4. Determine r(u(p)). 78p*2 Let n(r) = 6r. Let i(v) be the third derivative of 26v5/15 + v2 + 22v. Give n(i(z)). 624z2 Let a(w) be the first derivative of 1085w*2/2 - 6000. Let f(l) = 4l. Give a(f(q)). 4340q Let u(a) = -a + 3a - 4a. Let y(l) = -222l - 25 - 25 + 21l + 77 - 27. Give y(u(o)). 402o Let x(h) = -13h + 6. Let c(u) = -19u + 8. Let r(j) = 3c(j) - 4x(j). Let t(w) = w*2 - 148. Calculate r(t(v)). -5v*2 + 740 Let b(d) = -10d*2 + 48d*2 + 55d*2 - 55d*2 + 45d*2. Let t(g) = -217g*2. Determine t(b(l)). -1494913l*4 Let c(x) = -2x. Let l(w) be the third derivative of 31w4/6 + 7w*3/3 - 1671w*2. Calculate c(l(g)). -248g - 28 Let r(c) be the third derivative of c*5/10 - 2c*2 + 9599. Let i(s) = 94s*2. What is r(i(a))? 53016a*4 Let m(j) = -j. Let u(i) be the third derivative of -5i*5/6 - 13i*3/2 - 85i*2. Let s(z) be the first derivative of u(z). What is s(m(l))? 100l Let v(t) = -t*3 - 12t*2 + 17t + 54. Let d be v(-13). Let p(q) = 50qd - 59 + 17 + 42. Let z(l) = 3l*2. Give z(p(u)). 7500u*4 Let k(f) = 412f - 5. Let u(x) = -27x2 - 12x. Give u(k(w)). -4583088w2 + 106296w - 615 Let u(h) = 36h2. Let i(l) = 135l*2 + 13382l. What is i(u(t))? 174960t4 + 481752t*2 Let y(g) = 19094g*2. Let f(a) = -23a. What is y(f(v))? 10100726v2 Let d(f) = 3f. Let y(h) = -81625h + 86. Give d(y(a)). -244875a + 258 Let c(u) = -u*2 - 297u. Let a(n) = -2985n. What is c(a(r))? -8910225r*2 + 886545r Let c(d) = 8d. Let k(f) = 2600895f. Give c(k(l)). 20807160l Let k be ((-12)/(-7))/(14/49). Let s(h) = 24h - k + 8 - 2. Let v(p) be the first derivative of p*3/3 - 4. Calculate s(v(x)). 24x*2 Let k(l) be the first derivative of -3l*2 + 3893. Let y(o) = -192o. Calculate k(y(i)). 1152i Let i(w) = 332284w*2. Let p(o) = 80o*2. What is p(i(b))? 8833012532480b*4 Suppose -y - 4k + 2 = 0, 3y = -4k + 5 + 1. Let s(t) = 153t2 - 73t*y - 78t*2. Let l(f) = 50f. What is l(s(x))? 100x2 Let b(z) = -21z. Let q(k) be the third derivative of -k*4/24 - 31k*3/6 + 2k*2 + 4. Calculate b(q(m)). 21m + 651 Let l(m) = 146m2 + 140m*2 + 7m - 282m2 - 8m. Let d(n) = 8n + 6. Let c(i) = -i - 1. Let h(z) = 6c(z) + d(z). Determine l(h(y)). 16y2 - 2y Let l(i) = i*2. Let o(r) = 287r + 780. Let p(q) = 72325q + 196625. Let b(k) = -3025o(k) + 12p(k). What is l(b(m))? 75625m*2 Let g(y) = -2y*2. Let i be (1 + -1)/((0 - -4)/2). Suppose 0c = -3c - 9, -r - c + 99 = i. Let z(x) = -1 + rx*2 - 33x*2 - 52x*2. Give g(z(f)). -578f*4 + 68f*2 - 2 Let s(m) = 3m. Let t(a) = -2a2 + 57791a + 8. Calculate t(s(x)). -18x2 + 173373x + 8 Let g(w) = 18w2. Let m = 64 + -58. Suppose 7 = mn - 5. Let x(l) = 32 - 2ln + 34 - 66. Calculate x(g(q)). -648q*4 Let z(m) = -570m + 1. Let l(p) be the second derivative of -p*4/4 + 1093p + 1. Determine l(z(u)). -974700u2 + 3420u - 3 Let s(o) = o*2. Let j(m) = -6m*2. Let h be (-8532)/252 + ((-4)/(-14))/(-2). Let z(k) = hs(k) - 6j(k). Let d(f) = -24f*2 + f - f. What is d(z(q))? -96q*4 Let t(x) = 409123550x. Let r(w) = 2w2. Determine t(r(g)). 818247100g2 Let a(o) = o2 - o - 1. Let u(g) = 99g2 - 55g - 55. Let k(y) = -55a(y) + u(y). Let j(t) = 29201 - 14600 - 14601 - t2. Give j(k(l)). -1936l*4 Let c(l) = -4l. Let i = -1 + 1. Let b(z) = 259z + iz2 - z2 - 259z. Give c(b(d)). 4d*2 Let p(l) = -796106l - 12. Let h(n) = n*2. Determine p(h(t)). -796106t2 - 12 Let l(s) be the second derivative of s4/4 + s*3 + s. Let w(m) be the first derivative of -3m*2 - 1007. Determine w(l(h)). -18h*2 - 36h Let j(d) be the second derivative of 67d3/6 + 1647d. Let y(o) = 10o2. Calculate y(j(l)). 44890l*2 Let y(u) = -16u*2 + 8u + 10. Let v(a) = 16a2 - 7a - 9. Let j(i) = -8v(i) - 7y(i). Let h(q) = 2q2. Calculate j(h(o)). -64o4 + 2 Let k(a) be the second derivative of a4/4 + 52a - 2. Let v(t) be the third derivative of -91t*4/24 - 21t*2. What is k(v(r))? 24843r*2 Let t(o) be the first derivative of 0o - 1 - 1/2o2. Let n(j) = 33j*2 - 163386j + 163386j. Calculate t(n(a)). -33a*2 Let q(f) = -19f. Let v(b) = -580256b. Calculate q(v(t)). 11024864t Let m(s) = -4s2. Let r(g) = 2g + 21 - 3g - 22. Let d(q) = -6 - 2 - 4q + 3 + 2. Let o(h) = d(h) - 3r(h). What is m(o(j))? -4j*2 Let c(b) = -3b + 4. Suppose 0 = 3s - 12, s - 15857 = 3u - s. Let a be 4/(-54)3 - u/81. Let g(x) = ax*2 + 1 - 64x*2 - 1. What is c(g(p))? -3p*2 + 4 Let o(p) = p. Let n(u) = -12u + 15. Let y(g) = 3g - 4. Let z(l) = l3 + 6l*2 + 11l + 16. Let t be z(-4). Let v(k) = tn(k) + 15y(k). What is v(o(b))? -3b Let s(v) be the third derivative of -10769v*4/24 - 2v*2 + 3v + 44. Let m(j) = 2j2. Calculate s(m(h)). -21538h*2 Let x(v) = -48v*2. Let w(f) = -102421f*2. Determine w(x(r)). -235977984r*4 Let v(x) = -489x - 536. Let o(n) = 8n + 8. Calculate v(o(g)). -3912g - 4448 Let i(m) = -2m2 + 7m. Let c = -1 + 4. Let h(j) = -j + 5 + 5j + cj. Let b(z) = -8z - 6. Let v(q) = -5b(q) - 6h(q). What is i(v(r))? -8r*2 - 14r Let w(t) = 3815t. Let b(f) = -3595f*2. Determine b(w(r)). -52322438875r*2 Let u(b) = -38b. Let m(y) = -7y2 - 5y + 12. Let x(f) = -f*2 - 8f + 6. Let g(k) = -m(k) + 2x(k). Give g(u(o)). 7220o*2 + 418o Let q be ((-72)/(-360))/(1/10). Let f(v) = -193 - 2vq - 195 + 388. Let h(o) = 37o*2. Calculate f(h(p)). -2738p*4 Let p(s) = s + 4. Let g(d) = -77d*2 - 24d + 24. Let v(t) = 25t2 + 9t - 9. Let x(j) = -3g(j) - 8v(j). Give p(x(q)). 31q2 + 4 Let l(p) = p - 5. Let q(g) = 3. Let j(d) = -6l(d) - 10q(d). Let x = 1301 - 1305. Let m(f) = -5f. Let z(w) = xj(w) + 5m(w). Let u(a) = 8a. Give z(u(b)). -8b Let y(	{ "pile_set_name": "DM Mathematics" }
alculate lr(q) - 4g(q). q*3 - 5q*2 Let x(a) = -5a*2 - 3a - 2. Let m(h) = -h. Determine -5m(d) + x(d). -5d*2 + 2d - 2 Let x be (-1 - 0) + (-84)/(-3). Suppose 3g - x = 3j, 4g - 2g - 26 = 4j. Let m(z) = z2 - 9z. Let n(b) = 4b. What is gn(i) + 2m(i)? 2i*2 + 2i Let z(x) = 6x3 + 3x*2 + 4. Let r(v) = -5v*2 + 30 + 7v*2 + 5v*3 - 27. Determine -4r(h) + 3z(h). -2h3 + h2 Let v(f) = f3 - f2 + f. Let a(s) be the third derivative of s*6/30 - 7s5/60 + s4/4 - 3s2. Give a(u) - 6v(u). -2u3 - u2 Let f(r) = r - 3. Let j(w) = 6 + 12 + 5 - 7 - 5w. Give -11f(l) - 2j(l). -l + 1 Let q(d) be the third derivative of -d4/12 - d3 - d*2. Let h(y) = 20y - 1 + 1 - 22y - 7. Let f = -14 + 8. What is fq(c) + 5h(c)? 2c + 1 Let k(z) = 3z3 - 9z*2 - 4z + 5. Let v(q) = -q*3 + 4q*2 + 2q - 2. Suppose -2y + 7l = 6l - 7, 2y = 3l + 1. What is yv(o) + 2k(o)? o3 + 2o*2 + 2o Let r(g) = 4 - 354g + 355g - 3. Let b(m) = m*2 + 5m + 5. Calculate 3b(w) - 15r(w). 3w2 Let c(m) = -8m + 5. Let k(b) = 3b - 2. Let x(g) = 4c(g) + 11k(g). Let t(s) = -5. Let y(q) = q + 1. Let r(n) = -t(n) - 2y(n). Determine -3r(p) - 4x(p). 2p - 1 Let d(z) = -2z + z*3 - 11 - 9z - 14z2 + 3z*2. Let i be 10 - -1(2 + -1). Let x(a) = 2a2 + 2a + 2. Give ix(t) + 2d(t). 2t3 Let f(k) = 2k - 2. Let l(r) = -7r - 3. Let n(g) = -3g - 1. Let y(a) = -2l(a) + 5n(a). What is 6f(p) + 11y(p)? p - 1 Let m(s) = -16s + 5. Let j(v) = -8v + 2. Let x be j(3). Let k be 2/(-8) - (-136)/32. Suppose -kd - 6 = 10. Let o(l) = 3l - 1. Determine dm(u) + xo(u). -2u + 2 Let x(m) = 2m + 7. Let z(v) = v - 1. What is -x(c) + 5z(c)? 3c - 12 Let x(g) be the third derivative of -g*4/24 - 4g*2. Let w(d) = d. Calculate 3w(r) + 2x(r). r Let c(z) = -5z*3 - 4z*2 - 7z + 7. Let s(w) = 2w3 + 2w*2 + 3w - 3. Determine -3c(k) - 7s(k). k*3 - 2k*2 Let v(g) = 4g*2 + 3g + 8. Let a(k) = -9k2 - 6k - 17. What is 3a(s) + 7v(s)? s*2 + 3s + 5 Let z(n) be the first derivative of 2n2 - 7n + 1. Let v(x) = -2x + 3. Let t = -11 - -15. Let f be t + (-3 - 4/(-1)). What is fv(i) + 2z(i)? -2i + 1 Let y(f) = -5f3 + 7f*2 + 7f - 13. Let u(w) = -2w3 + 3w*2 + 3w - 6. What is -7u(l) + 3y(l)? -l3 + 3 Let w(c) = c3 + c*2 - c + 1. Let n(m) = -18m*3 + 3m*2 - 3m + 3. Give n(t) - 3w(t). -21t*3 Let g(j) = -10j - 13j + 21 + 30j*2 + 2j. Suppose 3q + 3 = -3. Let f(y) = -3y*2 + 2y - 2. What is qg(k) - 21f(k)? 3k2 Let a(u) = -u + 4. Let q(t) = -t - 3. Let h be q(-6). Let z(c) = h - 3 + 4 + 1. Let m(b) = 2. Let p(r) = 8m(r) - 3z(r). What is -a(l) + 5p(l)? l + 1 Let y = -4 + 7. Let x(c) = 6c2 + 6c - 3. Let r(g) = -6g2 - 7g + 4. Let p(l) = yr(l) + 4x(l). Let z(u) = u*2 + u. What is p(j) - 4z(j)? 2j2 - j Let s(g) = 2g*3 - 5g*2 - 2g - 3. Let k(y) = -12y - 67. Let n be k(-5). Let u(j) = 5j*3 - 10j*2 - 4j - 7. Determine ns(r) + 3u(r). r*3 + 5r*2 + 2r Let v(p) = p*2 + 2p. Let q be ((-6)/15)/(1/(-10)). Let o(u) = u - u - 2u2 - qu. Suppose 4 = -4d - 4n, -2n + 2 = 12. What is do(y) + 7v(y)? -y2 - 2y Let b(d) = -3d. Let y be b(2). Let r(n) = -1. Let v(o) = o2 - 7o + 5. Let x be v(6). Let m(a) = -a*2 - 2a + 6. Calculate xm(f) + yr(f). f*2 + 2f Let f(r) = 8r3 - 10r - 10. Let u be (30/9)/(1/(-3)). Let g(d) = d*3 - d - 1. What is ug(x) + f(x)? -2x3 Let x(d) = d2 + 1. Let f(i) = -i3 + 4i2 - 3. Give f(v) - x(v). -v3 + 3v2 - 4 Let j be (2 - 2/2) + 0. Let t(i) = -165i*2 - 6 - 162i*2 - 3i + 334i2 + 4i. Let b(r) = r*2 - 1. Determine jt(h) - 5b(h). 2h*2 + h - 1 Let c(b) = -9b - 5. Let m(r) = -25r - 14. Give -8c(u) + 3m(u). -3u - 2 Let p(i) = i - 1. Let a(r) = 2r2 - 8r + 8. Suppose -h + 2h - 1 = 0. What is ha(k) + 8p(k)? 2k*2 Suppose -3g - 3 = 2d + 1, -4d = g + 18. Let n(q) be the third derivative of -q*4/4 - 7q*3/6 + 2q*2. Let j(m) = 2m + 2. What is gn(c) + 7j(c)? 2c Let q(k) = -1. Let a(i) = 5i + 2. Let t(x) = -a(x) + 5q(x). Let h(u) = 3 + 0 - 3u + 4u + u. Suppose 0 = -0s + 3s + 42. Determine sh(m) - 6t(m). 2m Let j(p) = 5p3 - 4p. Let u(k) = -5k3 + 5k. Determine 5j(f) + 4u(f). 5f3 Let c(a) = -a3 - a2 + 1. Suppose 0 = -5v + 9 + 6. Let w(u) be the second derivative of -u5/4 - u4/4 + 3u2/2 + 3u. Determine vc(o) - w(o). 2o*3 Let m be 8/(-5) + 6/(-15). Let c(k) = 4k + 1. Let s(q) be the third derivative of q*5/60 - 17q*4/24 - 2q*3/3 - 10q*2. Give ms(p) - 9c(p). -2p*2 - 2p - 1 Let i(k) = -9k. Let c(a) = -8a. Suppose -10o + 48 - 8 = 0. Determine oi(r) - 5c(r). 4r Let c(h) be the second derivative of 7h5/20 + h4/2 + 4h*3/3 + h. Let i(l) = -20l*3 - 17l*2 - 23l. What is 17c(t) + 6i(t)? -t*3 - 2t Let z(d) = -80d - d3 - 1 + 160d - 81d. Let s(l) = l3 + 6l*2 + 6l + 4. Let h be s(-5). Let w(f) = -5f + 0 - 5 - 4f*3 + 0. Give hw(q) + 5z(q). -q3 Let r(g) be the third derivative of g4/12 - g3/2 + 7g*2. Let x(m) = -m + 1. Calculate -2r(d) - 5x(d). d + 1 Let a = -99 - -88. Let w(o) = -3o*2 - 3o*2 - 4o + 3o2. Let p(b) = -8b*2 - 11b. What is aw(k) + 4p(k)? k*2 Let f(l) = 5l*2 - l. Suppose -4s + 22 = -5y, 7y + 11 = s + 3y. Let b(o) = 14o*2 - so - 27 + 27. What is 3b(n) - 8f(n)? 2n2 - n Let o(u) = -3 + 2 + 2. Let y be -22 - (0/3 - 0). Let f = y - -19. Let x(j) = 2j - 3. Determine fo(s) - x(s). -2s Let w(h) = 3h. Let v be w(-1). Let o(u) = 4u + 3 - 5 + 2 + 2. Let t(b) = -b - 1. Determine vt(x) - o(x). -x + 1 Let l(m) = -7m - 1. Suppose 0 = 4b + 3h + 35, 0b - h = -b. Let x(z) = z. Give bx(s) - l(s). 2s + 1 Let h(w) = w3. Let j(f) = 3f*3 - 79f*2 + 1. Determine -5h(z) + j(z). -2z3 - 79z*2 + 1 Let g = 16 + -8. Let v = -3 + g. Let a(c) = -44c - 32. Let k(x) = 15x + 11. Let u(l) = -6a(l) - 17k(l). Let z(n) = 14n + 8. Determine vz(d) - 8u(d). -2d Let l(c) = 3c*2 - 4c. Let a(u) = -11u2 + 17u + 1. Let m(o) = -2a(o) - 9l(o). Let f(h) = -3h2 + h - 1. Determine 7f(r) - 4m(r). -r2 - r + 1 Let r(n) = 4n - 6. Let k(c) = c - 2. Let x(d) = -2d3 + 10d*2 - 3d - 12. Let y be x(4). Determine yk(l) - 3r(l). -4l + 2 Let p(x) = -13x*2 + 9x + 9. Suppose -2o = 2, -3f - 10 = -5o + 12. Let q(b) = 6b*2 - 4b - 4. Calculate fq(k) - 4p(k). -2k2 Let i(l) = -3. Let g(y) = y - 8. Calculate -3g(z) + 8i(z). -3z Let t(b) = -3b2 + 3b. Let i(p) = p - 1. Let d(w) = 5i(w) - t(w). Let j = -5 + 1. Let r(u) = 4u*2 + 3u - 6. Calculate jr(f) + 5d(f). -f*2 - 2f - 1 Let w be 13/(-6)-6. Let b(h) = -3h + 4h*2 - 4h*3 + wh - 3h. Let v(f) = f3 - f2 + f. Suppose -n - 3 = -4. Determine nb(l) + 5v(l). l3 - l2 + 2l Let r(n) = 4n2 - 4n - 4. Let p(a) = 3a2 + a - 3. Let v(d) = -1 + 3d*2 - 5d*2 + d + 3d*2 + 0d*2. Let i(f) = -p(f) + 2v(f). Give 6i(z) + 2r(z). 2z2 - 2z - 2 Let r(b) = 4b + 1. Let y(a) be the first derivative of 7a*2/2 + a - 3. Suppose -n - n + 6 = 0. Determine ny(l) - 5r(l). l - 2 Let q be (9/6)/((-18)/(-12)). Let j(x) = x2 - x - 1. Let z(c) = -c3 - 5c*2 + 8c + 5. What is qz(u) + 5j(u)? -u*3 + 3u Let p(y) = 5y2 + y + 1. Let x be p(-1). Let d(f) = x + 0 + f - 4. Let g = 67 + -68. Let u(r) = -r - 1. Calculate gu(l) - 2d(l). -l - 1 Let n(h) = -h2 + h. Let y = 3 - 4. Let o(w) = -3w*3 - 6w*2 + 6w. Determine yo(t) + 6n(t). 3t3 Let u(t) = 3t*3 + 4t*2 + 4t. Let m = -29 - -32. Suppose 4g + 0 = 12. Let q(r) = -r2 + r3 + 3r*3 - 2r*2 - 6r*g - 3r. What is mu(d) + 4q(d)? d*3 Suppose -5c + 5 = 0, -20 = h - 6h + 5c. Let a(r) = -6r2 + 5r - 5. Let g(x) = 9x2 - 7x + 7. Determine hg(z) + 7a(z). 3z2 Let u(s) = 17s*2 - 50s. Let b(j) = -6j2 + 17j. What is -11b(o) - 4u(o)? -2o2 + 13o Let p(o) = 12o2 + 2o - 1. Let l(u) = u - 1. Determine -2l(d) + p(d). 12d*2 + 1 Let k(n) = 9n - 5. Let o(v) = 10v - 6. Determine 7k(u) - 6o(u). 3u + 1 Let d be (-10)/1523/2. Let w(v) = 15v2 - 33v. Let o(b) = -b*2 + 2b. Let t(u) = -3u2 - 3u + 3. Let a be t(3). Give ao(k) + dw(k). 3k2 Let o(y) = y3 + 4y*2 + 7y - 7. Let p(z) = z*2 + 2z -	{ "pile_set_name": "DM Mathematics" }
r? True Suppose -9j = -4o - 5j - 14876, -3j = 3. Let p = 7085 + o. Is p a prime number? False Suppose -1736 = -206x + 199x. Let y = 135 + -52. Let h = x + y. Is h a composite number? False Let i = 42160 - 25907. Is i composite? False Let s be 2/(1 + 1) + (-8703)/9. Let i = -637 - s. Is i a prime number? False Let q(p) = 8p2 + 5p + 6. Let s be q(-4). Suppose -s = -4w + 10. Is w prime? True Let i(p) = -99p - 8. Let x(m) = -m*3 + 15m2 + 5. Let y be x(15). Let h(j) = -j2 + 5j - 7. Let k be h(y). Is i(k) a prime number? False Let y be 451/(2 - 4/4). Let c = y + -201. Let x = -123 + c. Is x a composite number? False Let f = -27458 + 38859. Is f prime? False Let b be 7/(28/(-3))1532/(-1). Suppose 2z - 3307 = -3d - b, 2z + 4d - 2158 = 0. Is z composite? True Let j(k) = 8k - 14. Let m be j(8). Suppose -4w = -d - 6w + m, -140 = -3d - w. Is d prime? False Suppose 5q + 0q - 5i - 35 = 0, q = 3i - 3. Suppose -w + q = 2w. Suppose -t + 921 = wt - 2d, -d - 3 = 0. Is t a prime number? False Suppose 12q - 8q + 2y - 96102 = 0, -5q + 120132 = y. Is q composite? True Let s(w) be the second derivative of -w3/6 - 5w*2 + 6w. Let o be s(-13). Is (-2 + o)/1631 a prime number? True Let w be (15/(-10))/((-6)/712). Suppose 3i - 130 = -2a, -4a = -4i - 2a + w. Let r = i + -5. Is r prime? False Suppose 2w - 3w = -4s + 4200, -2s + 2w + 2100 = 0. Suppose 5i = 2a - 435, -2a - 5i = -7a + s. Is a a composite number? True Let w(f) = -49f + 80. Is w(-37) a composite number? True Suppose l + v + 3 = 0, 5l = -3v - 4 - 3. Is 102132/(-18)l/(-2) prime? True Let k be -1 + (4 + 26)/5. Suppose 3n + 180 = 4m + 1365, -m + 1952 = kn. Is n composite? True Let q = 17033 - -22260. Is q composite? False Suppose 2u + 2u + 20 = 0, -u = -4i + 17. Is ((-120)/45)/((-2)/i) composite? True Let x(f) = -f*3 - 4f*2 + 6f + 6. Let s = 33 + -66. Let d = s - -26. Is x(d) a prime number? False Suppose 2148 = 2w + 2p, -4w + 1205 = -3p - 3056. Is w a composite number? False Let z be (-8)/12 + (-148)/3. Let v be z/(-8)(12 - 0). Let x = -28 + v. Is x a prime number? True Let h = 4873 - -2448. Is h a composite number? False Suppose x - 7 = -0x. Let j(d) = -d*3 + 7d*2 + 4. Let h be j(x). Suppose -k + 93 = -h. Is k a composite number? False Suppose 0g + g = 0. Suppose 4y = i - 38, y - 4i + 2 + 0 = g. Let p = 24 + y. Is p a composite number? True Let h(j) = -j*2 + 3j. Let l be h(3). Suppose 1 = -2b - 1, 4p - 5b - 17 = l. Suppose po - 633 = -2d, -5o + 1055 = -2d + 4d. Is o a prime number? True Let a be 5 + 0 + 4 + 4. Suppose 0 = am + m - 8722. Is m prime? False Suppose 5t = -3m - 16, -2t + t + 7 = 4m. Suppose -3 + 15 = mb. Suppose 4u = bg + 308, -7u = -2u - g - 405. Is u composite? True Is 35248/(-24)(-9)/2 prime? False Suppose 2j - 2m - 6462 = -0m, 5m - 16135 = -5j. Is j prime? True Let v = -11 - -21. Suppose -1203 = -vp + 13p. Let z = p - -727. Is z a prime number? False Suppose 191p + 414015 = 206p. Is p a prime number? False Is (-1)/(-3) + (-80)/(-30) + 1210 composite? False Let j(f) = -6f + 7. Suppose 4p = -16, t - 5t - 16 = -2p. Let y be 21/t(-2)/(-1). Is j(y) a prime number? False Let p = -5980 - -9967. Suppose -5z = -2z - p. Is z a prime number? False Suppose k + 2k = -f + 1, -4f + 18 = -2k. Let r(q) = -15q2 - 4q - 6. Let s be r(f). Let i = s - -449. Is i a prime number? False Suppose -25g - 720 = -35g. Let m(c) = 23c3 - 3c + 1. Let u be m(2). Let k = u + g. Is k prime? True Let y be -1(-4)/(-4) - 8. Let m = -7 - y. Is (m/(-4))/(1/(-46)) prime? True Let w(n) = 190n + 1. Suppose 16 + 14 = 5a. Let j be (21/a)/72. Is w(j) composite? False Suppose 2p - 4c - 20 = 0, -4p - 3c = -3p + 15. Let w be p3/6 + 4. Suppose -3m + 2n + 0n + 437 = 0, 0 = 2m - wn - 278. Is m a prime number? True Suppose 10g + 2155 = 15g. Let a = g + -12. Is a a prime number? True Let a = 29 + -29. Suppose a = 107r - 111r + 184. Is r a composite number? True Is ((-55885)/(-5))/(0/(-7) - -1) a prime number? True Let z(p) = -71 + 61 + 36 - 81p. Is z(-9) a prime number? False Let b(v) = v*2 + 4v + 4. Let a be b(-4). Let m = -12 + 20. Is a/16 + 3270/m composite? False Let n(q) = -q + 2. Let u be n(3). Let b(z) = -152z + 5. Is b(u) composite? False Let c(k) = 38k*3 + 7k*2 + 11k - 35. Is c(6) a prime number? False Let o be (5 + -8)/(1/(-97)). Let z = o + -142. Is z composite? False Let p(z) = 3z2 - 10z - 7. Let o be p(-6). Suppose m = w - 2 + 6, -2m + 8 = w. Suppose wd + 4h + o = d, 3d = -4h + 435. Is d a composite number? False Let a(b) = -b2 + 6b - 3. Let t be a(5). Suppose -ts - 3h + 16 = -4, -2h = -4s + 8. Let w(k) = 18k2 - 5k - 1. Is w(s) composite? True Suppose 40q - 25q = 20775. Is q prime? False Suppose 8q + 24768 = 66776. Is q a composite number? True Let r be (3/(-2))/((-2)/(-8)). Let g be (148/r)/((-2)/(-3)). Let x = g - -60. Is x prime? True Let b be 33/2252/6. Suppose -4p + b - 1 = 0. Is (3 + -6)/(p/(-38)) a prime number? False Is (-28)/(-224) - (-21285)/24 a prime number? True Suppose -4i - 5m = -72467, 36235 = 2i - 0i + 3m. Is i a prime number? False Suppose 2850372 = -41f + 77f. Is f a composite number? True Suppose 142 = 2j - c, -2j + 3j - 81 = 3c. Is j a composite number? True Let t(l) = 187l + 7. Let h be t(-5). Let a be h/(-22) + (-2)/11. Suppose 5j - 2j = 2g - a, -4g + 68 = -2j. Is g prime? False Suppose f = -3p + 7, 0f - f - 8 = -2p. Suppose r - 28 = -3n, 0 = -5n + pn. Suppose -2m = r - 138. Is m prime? False Suppose -4q - 9 = -3v - 39, -v + 2q - 12 = 0. Let o be (-3)/v - (-6)/(-4). Is 2 + (o + 203 - 1) a prime number? False Let m = 4656 - 2503. Is (1 - 0)-3m/(-3) a prime number? True Let p(c) = 3c2 + 3c - 2. Let l be p(1). Suppose -3t + 703 = -2b, -2t + b - 478 = -lt. Is t a prime number? False Let g = -103 + 5165. Suppose 5y = 693 + g. Is y a composite number? False Let o(v) = -14v + 18 - v*3 + 2v*2 - 2v2 - 26. Is o(-5) composite? True Let l(t) = -t2 + 14t - 2. Let b be l(14). Is (-1)/b(17 + 821) prime? True Suppose 2u - 38 = -14. Suppose -5715 = -ux + 2889. Is x composite? True Suppose 5w = h - 0h + 8, 3w = 5h - 4. Let t(b) = -b*3 + 8b*2 - 10. Let a be t(7). Suppose wp - 173 = -a. Is p a composite number? False Suppose d = 4o + 13411, 5d + 10041 = o - 4o. Is o/(-4)1/2 prime? True Suppose -2p + 1146 = 3u, 8p - 5p = 2u + 1693. Suppose -5w = -c + 4c - 558, -3c = 2w - p. Is c prime? True Suppose 2q = -8, -2q - 16 = -4b - 0q. Suppose -bh + 0j + 5j + 8 = 0, 0 = 3h + j - 29. Is ((-151)/(-2))/(h/90) a composite number? True Let x(h) = -h3 - h2. Let y be x(0). Suppose y = -2z + 6z + 168. Is (-6)/(-1 + z/(-46)) composite? True Let v be 1/(-4) + (-16917)/(-4). Suppose v = 4i - 5p, -3663 - 584 = -4i - p. Is i a prime number? True Let p = 15 + -15. Suppose -3l + p = 5m - 44, -5l = m. Suppose 13r - mr = 354. Is r composite? True Suppose -448 = 4s - 6s + o, -230 = -s - o. Is ((s + 0)/2)/(20/580) a prime number? False Suppose 3m = -c + 7, 4m = c + 5 + 9. Suppose -7 = -mv + 5. Suppose -q - vt = -4q + 355, 2q - 246 = 5t. Is q prime? True Suppose 13 = -8h + 61. Suppose ht = -3665 + 10835. Is t prime? False Suppose -3q - 3s + 27 = -0q, 2 = -s. Let v be ((-15)/2)/(9/(-12)). Is v - q - (-112 + 0) a prime number? False Let d(p) = 54p*2 - 15p + 11. Is d(10) prime? True Let j(r) = -5 + 2 + 4 - 8r - 15r. Let g be (-2)/(((-14)/4)/(-7)). Is j(g) a composite number? True Suppose -12z + 37 = 13. Suppose -r = 4g - 129, 4g + g - 273 = -zr. Is r a composite number? False Suppose -224507 = -5j - 46312. Is j prime? False Suppose -2h = -3p - 4429, -4p + 2653 + 1755 = 2h. Suppose -a - y = -1096, -h = -0a - 2a + 4y. Is a prime? False Let s(z) = z*2 - 19z + 21. Let w be s(18). Suppose -1174 = -wh + h. Is h prime? True Let z = -24 - -32. Suppose -36981 = -i - zi. Is i a prime number? False Let c = 16 - 11. Suppose cm - 1242 = -m. Let n = -128 + m. Is n composite? False Suppose 14m - 6m = -10896. Let b = -775 - m. Is b a composite number? False Suppose -30c - 149195 = -35*c. Is c a prime number? False Is (27/36)/((-3)/(-18028)) a prime number? True I	{ "pile_set_name": "DM Mathematics" }
True Which is greater: 1 or -132/1035871? 1 Are -2924762 and -2924743 nonequal? True Is 0 > 109/8070525? False Which is bigger: -94056 or -10063996/107? -94056 Which is smaller: -3/138995069 or -1? -1 Is 866.5585 greater than or equal to -1/5? True Is 1174309291 at least as big as 1174309290? True Which is smaller: -1/3 or 6331842? -1/3 Is -3259 greater than 41044? False Which is smaller: 1 or -2/283427? -2/283427 Is 8649211 equal to 8649211? True Is -2/62680057 at most -1? False Is 2589 > 42713? False Which is greater: -3482 or 2711? 2711 Which is bigger: 1760/15823 or -1? 1760/15823 Is 1495842 smaller than 1495886? True Is 2805918 not equal to 2805916? True Is 71685 <= -120? False Which is smaller: 107/5445 or 0? 0 Which is bigger: -18530 or -18427? -18427 Is 1515898 greater than or equal to 1515774? True Which is smaller: -43 or -2864253? -2864253 Is -46166/16883 > -2? False Which is smaller: -5145 or -3382? -5145 Are 2446 and 604527/247 unequal? True Is -65474 at least as big as 2? False Which is smaller: 3 or -18271922.5? -18271922.5 Is 20948994/7 less than 2992712? False Is -94481 bigger than 1886/7? False Is -2 bigger than 320/10841? False Which is smaller: 442531 or -8/11? -8/11 Which is bigger: -12183012/5 or -2436602? -2436602 Which is greater: 18271/45271 or 1? 1 Which is bigger: 895563 or 895741? 895741 Does 1 = -185/11180669? False Which is greater: 25992352 or 25992364? 25992364 Is 20409495 bigger than 20409495? False Is -4/447 >= 1231366? False Is -94636 < -94997? False Is -16465/11931 < 0? True Which is smaller: 13631820 or 13631818? 13631818 Which is bigger: -9196621 or -9196616? -9196616 Does -2235754 = -2235754? True Which is smaller: -1 or -6/6226231? -1 Which is smaller: -3386426 or -3386483? -3386483 Is -1 at least as big as 4789/162279? False Is -22629559 >= -22629560? True Which is greater: 20800087/2 or 10400044? 10400044 Which is greater: 16422 or -83825? 16422 Do -1413195/107 and -13206 have the same value? False Is 140459 at least as big as 1190? True Is -4327770 >= -4327784? True Which is bigger: -1492435 or -44? -44 Are 1790293 and 1790295 equal? False Which is bigger: -957.86 or 139? 139 Is -280319 bigger than -280116? False Is 0 at least -2/1836907465? True Which is smaller: -524529 or -524300? -524529 Is -8 <= -10069/1140? False Is 1530826 > 1530825? True Which is bigger: 132483743 or -0.1? 132483743 Which is smaller: -54208888/5 or -10841779? -10841779 Is -3612965 less than or equal to -3612972? False Are -1/3 and 1043301534 unequal? True Which is bigger: -124079 or -124636? -124079 Which is greater: -76236237/5 or 1? 1 Which is smaller: -1153443 or -27682663/24? -27682663/24 Which is smaller: 53195 or -869? -869 Is -1/9 less than -173934/97? False Is 1342714 equal to -0.32? False Which is smaller: 124517 or 1245183/10? 124517 Which is smaller: 166008113 or 166008112? 166008112 Which is greater: 0 or 0.341982? 0.341982 Which is bigger: -452933 or -452932? -452932 Is 96118 at most 96087? False Is 1 less than or equal to -1240/1324337? False Which is smaller: -5535 or -702772/127? -5535 Which is smaller: 0 or 1152/125491? 0 Which is smaller: -82194 or -85951? -85951 Which is smaller: -39136 or -38391? -39136 Is -827368778 at least as big as -827368778? True Which is smaller: 790/100787 or 1? 790/100787 Which is bigger: -20464541 or 1/15? 1/15 Is -19515 < -67? True Is 0 smaller than -6/474831163? False Is -142 greater than 0.0487? False Which is greater: -3 or -11651651? -3 Which is smaller: -23492 or -67171? -67171 Which is smaller: -159353 or -159292? -159353 Are -1616 and -4514 non-equal? True Is -41940 <= -35752? True Are 2545390 and 2545392 nonequal? True Is -49757034 at least as big as -49757033? False Which is greater: -0.04424 or 4/161? 4/161 Which is smaller: -28018 or -28052? -28052 Is -43964 at least as big as -7869310/179? False Does 10 = 16623438? False Is -813/32626 > 7? False Which is smaller: -646845 or -5821594/9? -646845 Is -125 less than or equal to -372856/2957? False Is 40703 less than 22255? False Are -22593843 and -90375367/4 nonequal? True Is -7322183 < -51255280/7? True Which is greater: 1/572156687 or -1? 1/572156687 Is -70/88661 bigger than 1? False Is 9174142 less than 9174151? True Which is smaller: -628280/11 or -57117? -57117 Which is bigger: -2 or 87/18190? 87/18190 Which is smaller: 809665 or 809660? 809660 Which is smaller: -596060/4201 or -143? -143 Which is smaller: -516219 or -516407? -516407 Which is greater: 971539853/5 or 194307971? 194307971 Do 83466 and 3/56 have different values? True Is 227951 smaller than 58? False Which is smaller: 761294652 or 761294654? 761294652 Which is bigger: -159020 or -159096? -159020 Is -1.115 at most 2761? True Is -18799255 > -18799255? False Which is smaller: 0 or 1/283116326? 0 Which is greater: 1/923661 or 0? 1/923661 Which is smaller: -572/1904755 or 1? -572/1904755 Is 8133 <= -0.577? False Is 107/1035971 != -1/3? True Which is bigger: -774019 or -773968? -773968 Is -24193032 at least as big as -24193032? True Which is greater: 218520681 or 437041359/2? 218520681 Is -2/4320181 at least as big as 9/50? False Which is smaller: -1750/11223 or 0.3? -1750/11223 Is -0.01 at least as big as -429776? True Which is greater: 0 or 1124/12703? 1124/12703 Which is greater: 55749 or -1038? 55749 Which is smaller: -350/3 or -6/29951? -350/3 Which is smaller: -461943 or -461941? -461943 Is 187564637/4 at most 46891158? False Which is greater: 5902397 or -5/4? 5902397 Is 76115772/5 less than or equal to 15223154? False Which is greater: -42755196 or -42755193? -42755193 Which is greater: 7490810 or 7490822? 7490822 Is -25681 greater than -2311393/90? True Does 3392665 = 3392772? False Do -89090080 and 0 have the same value? False Which is bigger: 0 or -16431/13858? 0 Which is bigger: -2/49 or -255455? -2/49 Is 0 less than or equal to -14/181241491? False Is 0 less than -2/12812417? False Which is smaller: 119022528 or 119022526? 119022526 Which is greater: -8/7134663 or 1? 1 Which is smaller: -790.78567 or -2/7? -790.78567 Is -0.01 at least -9062.59? True Are -4/5 and -4274036 non-equal? True Which is smaller: 0.287697325 or 0? 0 Is 250263293 greater than 250263294? False Which is greater: -21/843134 or 0? 0 Is -53216 >= -31? False Which is smaller: 23476057 or 23476058? 23476057 Which is greater: 93135838 or 93135839? 93135839 Does -1 = 121936973? False Which is smaller: 10.3 or -2835? -2835 Do 31830624 and 31830606 have the same value? False Which is greater: -6.5 or -8168? -6.5 Which is bigger: 16/360451 or -1? 16/360451 Which is smaller: -1 or 7697616? -1 Is 110983202 at least as big as 110983202? True Do 9.36 and -7/89 have the same value? False Is 305837399 != 305837399? False Is 19.9492821 at most as big as 1/3? False Which is smaller: -11444230/71 or -161186? -11444230/71 Are -1/24922059 and 1 non-equal? True Which is smaller: -95293/18 or 0.3? -95293/18 Is -0.1 <= -34311379? False Which is smaller: 637433/802 or 796? 637433/802 Which is smaller: -1601951 or -1601947? -1601951 Is 281 < 235620? True Is 2 less than or equal to 3550/1299? True Which is greater: -79064 or -79378? -79064 Which is greater: -1 or -2787/4643? -2787/4643 Does 354420 = 13? False Which is smaller: -53136621 or 2/3? -53136621 Which is bigger: 30580/1091 or 27? 30580/1091 Is 44510 at least as big as 43932? True Is 266898 > 266892? True Are 0.44 and -1500.94 equal? False Is 5201 greater than 0.051433? True Which is greater: 25467515 or 50935027/2? 25467515 Which is greater: 13810480/127 or 108743? 13810480/127 Is -185716 > -184588? False Which is smaller: 6112 or 3050370/499? 6112 Is -2213/108562 equal to 0? False Which is bigger: 870294/107 or 8133? 870294/107 Which is bigger: 13/3514383 or -1? 13/3514383 Which is bigger: -0.1 or 107478195? 107478195 Is 103808636 less than 103808647? True Which is smaller: 35875511 or 0? 0 Which is bigger: -2 or -876429.9? -2 Which is greater: -2987745/11 or -271612? -271612 Is -400993858 >= -400993859? True Is 4 <= 15123101? True Which is bigger: -184/92619 or 16? 16 Is -138886 greater than -138889? True Is 4760923 equal to 4760923? True Which is smaller: 11/72487 or 0? 0 Is -3890537 at most as big as -19452692/5? False Which is smaller	{ "pile_set_name": "DM Mathematics" }
is divided by t. 8 Suppose 128 = 5d - n, -59 = -2d + 7n - 4n. Let f(b) = 277b - 783. Calculate the remainder when f(3) is divided by d. 23 Let b(g) = g2 - 4g*2 + 6g2 - g2 + 29 + 0g2 - 21g. What is the remainder when b(14) is divided by 32? 31 Suppose -2b - 2 = -3m + 6, 4b = m - 6. Let r(j) = 11j*2 + 4j - 5j2 - 3j*m. What is the remainder when r(-5) is divided by 15? 10 Let i(w) = -2w*3 - 2w*2 + 2w + 2. Let q(t) = 4t2 + 57t + 195. What is the remainder when i(-4) is divided by q(-4)? 28 Suppose 5 = -h + 15. Let z(i) = -12i + 234. Calculate the remainder when h is divided by z(19). 4 Let s(y) = -110y - 3028. What is the remainder when 5831 is divided by s(-29)? 161 Suppose -568 = 18c + 1394. Let y = -80 - c. Calculate the remainder when y is divided by 17. 12 Let c(q) = 3q - 83. Let h be c(27). What is the remainder when 44/11 + h/(-2) + 117 is divided by 25? 22 Suppose 6 - 31 = 5b, 4k = -2b + 2. Suppose 0 = -kv + 19v - 480. Calculate the remainder when 111 is divided by v. 21 Let u(f) = f3 - 6f*2 + 2f + 9. Let m be (1/(-4))/((-6)/(-8))-15. Let z be u(m). What is the remainder when 13 is divided by -3(-2)/z + 8? 6 Suppose 594 = 16z - 638. Calculate the remainder when 150 is divided by z. 73 Suppose 0m = -m + 3o - 6, -o + 2 = -3m. Let w = -16 - -52. What is the remainder when 3 - (4/(-4) - (102 + m)) is divided by w? 34 Let o(u) = u*2 - 5u - 14. Suppose 0 = -n - 1, 21m + n = 19m + 73. What is the remainder when m is divided by o(-3)? 7 Suppose -1240 = -34j + 24j. Let v = 141 - j. What is the remainder when 47 is divided by v? 13 Let q(s) = -s - 1. Let h be q(-12). Suppose -h = 5a - 31. Suppose -18 = -an + 3n. What is the remainder when n is divided by 6? 0 Calculate the remainder when 722 is divided by 180/70 + 534/21. 22 Suppose 7z - 202 = -13. Let u = z + -24. Suppose -24 = ul - 36. What is the remainder when 11 is divided by l? 3 Let h(l) be the second derivative of l4/3 + l3/3 - 9l*2 + 5l. Calculate the remainder when ((-414)/12)/((-6)/16) is divided by h(3). 20 Let r(g) = g*3 - 2g - 1. Let y be r(-2). Let v(l) = 4l + 20. Let p be v(y). Suppose p = 8w - 238 - 2. What is the remainder when 118 is divided by w? 28 Calculate the remainder when 804 is divided by 6/(-4) + 240/32. 0 Suppose -373 = -n + 85. What is the remainder when n is divided by 2(546/28 - -6)? 50 Let v be 268 - (-3)/(-6)8 - -1. Let h = 335 + v. What is the remainder when h is divided by 86? 84 Let y = 200 - 166. Suppose 0 = 24s - 634 + y. What is the remainder when 92 is divided by s? 17 Suppose 3c - 23212 = 17q - 80240, 16756 = 5q + c. Calculate the remainder when q is divided by 11. 9 Let i(d) = 605d - 3447. What is the remainder when i(9) is divided by 10? 8 Let v = 128 + -73. Suppose j - 143 = v. Suppose 3t + 100 = 5t. What is the remainder when j is divided by t? 48 Let k be 1449/12 + 2/8. Let v(x) = 24x*2 - 448x - 38. Let h be v(19). Let i = k - h. Calculate the remainder when 34 is divided by i. 6 Let v = 3428 - 3373. Calculate the remainder when 108 is divided by v. 53 Suppose 1032 = 8l - 720. Let g = 282 - l. Calculate the remainder when g is divided by (-1)/2 + (-105)/(-6). 12 Let d be (-3 + -6)/(-1 - -2). Let v = d + 16. Calculate the remainder when 30(205/30 + -6) is divided by v. 4 Let u(r) = 21r - 3. Let c(b) = b3 - 41b*2 - 32b - 402. Calculate the remainder when u(6) is divided by c(42). 15 Suppose 322 - 280 = 4h - h. Calculate the remainder when 2883 is divided by h. 13 Suppose 0 = 4v - 0v - 76. Suppose -116l + 281 = -48l - 3323. What is the remainder when l is divided by v? 15 Let z(j) = -218j - 29. Let c be z(-3). What is the remainder when 52 is divided by (4/5)/(25/c)? 12 Suppose -2d = 4l - 770, 5l - 969 = -2d + 6d. Let w = l + -188. Calculate the remainder when 23/1 + (-8)/(-2) is divided by w. 2 Suppose 59 + 1 = 10q. Let m(b) = 5b2 - 9b - 31. Calculate the remainder when m(q) is divided by 20. 15 Suppose 39m - 530 = 289. What is the remainder when 1070 is divided by m? 20 Calculate the remainder when 1171 is divided by -6314/(-126) - (-2)/((-6)/9). 3 Let g = 1896 + -1869. What is the remainder when 174 is divided by g? 12 What is the remainder when 117/(-3)(-15 - (11 - 20)) is divided by 31? 17 Let j(z) = -z3 + 17z. Let p be j(4). Suppose 5m - 7m + 8 = 0, w - pm = -3. Calculate the remainder when 102 is divided by w. 11 Let g = -58 - -63. Let n = -182 + 261. Suppose 4j = n - 3. Calculate the remainder when j is divided by g. 4 What is the remainder when 66 is divided by 12/(-294) + 8260/686? 6 Let d(v) = -v*3 - 18v*2 - 8v + 412. What is the remainder when 268 is divided by d(-16)? 16 Suppose 0 = 2z - 2 - 4. Suppose 6g + 54 = zg. Calculate the remainder when 53 is divided by (-328)/g + ((-208)/(-36) - 6). 17 Suppose 360 = 14a - 9a. Let j = -66 + a. Suppose 43 + 117 = 4t. Calculate the remainder when t is divided by j. 4 Suppose 3x + 5c + 141 = 7x, -204 = -5x - 3c. Let t be x-1(-350)/15. Suppose 3a + 4a = t. What is the remainder when a is divided by 33? 31 Let v(n) = -10n + 16n2 - 6n - 17n2 - 3. Calculate the remainder when 7(-12)/168 - (-43)/2 is divided by v(-15). 9 Suppose -266b + 325b - 429756 = 0. What is the remainder when b is divided by 24? 12 Let t(j) = 7j2 + 76j + 785. What is the remainder when t(-10) is divided by 10? 5 Suppose -3k + 58 = 37. Let d(h) = -2h. Let w be d(-2). Suppose -3m - o + 50 = -0o, 2m + wo - 20 = 0. What is the remainder when m is divided by k? 4 What is the remainder when (-1 - (-14)/6)/((-2146)/(-286491)) is divided by 170? 8 Suppose -251a = -173a - 5946 - 1776. Let w = 707 - 319. What is the remainder when w is divided by a? 91 Suppose 33 = 2s - 345. Let q(v) = -v3 + 6v*2 + 108v - 637. Calculate the remainder when s is divided by q(10). 17 What is the remainder when 774 is divided by (-120)/20(-6)/(-198) - (-1852)/22? 18 Let m(c) = -348c3 + c2 + 19c + 16. What is the remainder when m(-1) is divided by 22? 16 Let k(z) = 3z*2 - z - 2. Suppose 0 = -2j + 6j - 4p - 340, p + 409 = 5j. Let u = -11 + j. Calculate the remainder when u is divided by k(-2). 10 Let n(f) = 12f - 40. Let c be n(10). Suppose -77a - 48 = -ca. What is the remainder when 31 is divided by a? 15 Let x(o) be the second derivative of o*5/20 + 11o*4/12 + 10o*3/3 + 7o*2/2 - 3o - 20. Calculate the remainder when 153 is divided by x(-8). 36 Let w be (-5)/(-1) + (-6 - -2). Let f be w/(-6) - 186/(-36). What is the remainder when -3 - (0 + -4 - f) is divided by 2? 0 Let h(z) = -5z3 + z2 + 8z + 13. Let s = -40 + 56. What is the remainder when h(-2) is divided by s? 9 Suppose 4u + 4r - 56 = 0, -28u + 2r + 16 = -26u. Let l = u - -15. Suppose 0f - 150 = -2f. What is the remainder when f is divided by l? 23 Let a(u) = 2u3 - u2 + u - 2. Suppose 8d = 3d + 2d. Suppose -8 = -4q, d = x + 9q - 4q - 27. What is the remainder when a(3) is divided by x? 12 Let d(l) be the third derivative of 0l + 1/20l*5 + 4/3l*3 - 1/8l*4 + 16l2 + 0. What is the remainder when d(3) is divided by 9? 8 Let i(t) = t2 + 2t - 3. Let d be i(2). Suppose -dh = 2c - 53, -24h - 5c + 6 = -23h. Let g = -74 + 105. Calculate the remainder when g is divided by h. 9 Let n(z) = 5z2 + 31z - 63. Let s(l) = 8l2 + 59l - 125. Let f(b) = -5n(b) + 3s(b). What is the remainder when f(9) is divided by 20? 17 Suppose -3u = -3s + 6s - 219, 4 = u. Let l = 135 - s. Calculate the remainder when l is divided by 24. 18 Suppose 3y + 237 - 2286 = -d, 4d - 2049 = -3y. What is the remainder when y is divided by 115? 108 Suppose -26r + 25r + 3 = 0, 4o - 1793 = 5r. Calculate the remainder when o is divided by 7. 4 Suppose 0m - 214 = -2m. Suppose 5o - 164 = 3q, 2q + 524 = 5o + 353. Calculate the remainder when m is divided by o. 33 Let z be (-1107)/(-45) - -6 - 3/5. What is the remainder when (-2 - (-132)/30)z is divided by 25? 22 Suppose 0 = -c - c - 5q + 10, 0 = 3q. Let k = -387 + 405. What is the remainder when k is divided by c? 3 Let r(x) = -4x*2 + 0x*2 - 5 + x + 9x2 + x2. What is the remainder when r(-2) is divided by 7? 3 Let i = -13621 + 13701. What i	{ "pile_set_name": "DM Mathematics" }
:20 PM What is 485 minutes after 12:52 PM? 8:57 PM How many minutes are there between 4:27 AM and 2:50 PM? 623 What is 376 minutes after 5:56 PM? 12:12 AM What is 126 minutes after 12:41 AM? 2:47 AM How many minutes are there between 12:33 PM and 5:28 PM? 295 How many minutes are there between 4:29 AM and 8:12 AM? 223 How many minutes are there between 5:22 PM and 3:03 AM? 581 How many minutes are there between 5:27 PM and 1:10 AM? 463 How many minutes are there between 9:56 PM and 7:29 AM? 573 What is 341 minutes before 2:48 PM? 9:07 AM How many minutes are there between 9:58 PM and 12:31 AM? 153 What is 589 minutes before 1:14 PM? 3:25 AM How many minutes are there between 12:05 AM and 5:32 AM? 327 How many minutes are there between 6:00 PM and 5:45 AM? 705 What is 424 minutes after 6:19 AM? 1:23 PM What is 265 minutes before 4:14 PM? 11:49 AM What is 135 minutes after 8:10 PM? 10:25 PM What is 371 minutes after 7:00 AM? 1:11 PM What is 490 minutes after 12:39 AM? 8:49 AM How many minutes are there between 6:33 PM and 1:11 AM? 398 What is 587 minutes after 5:06 AM? 2:53 PM How many minutes are there between 6:19 PM and 4:26 AM? 607 How many minutes are there between 1:14 PM and 5:20 PM? 246 What is 305 minutes after 9:32 AM? 2:37 PM What is 110 minutes after 4:26 PM? 6:16 PM How many minutes are there between 3:32 PM and 9:45 PM? 373 What is 77 minutes after 9:11 AM? 10:28 AM What is 279 minutes before 11:53 PM? 7:14 PM What is 399 minutes before 12:39 PM? 6:00 AM How many minutes are there between 2:00 AM and 2:38 AM? 38 What is 67 minutes before 9:05 PM? 7:58 PM What is 166 minutes before 9:30 PM? 6:44 PM How many minutes are there between 1:13 PM and 3:03 PM? 110 What is 63 minutes after 4:30 PM? 5:33 PM How many minutes are there between 4:06 AM and 8:02 AM? 236 What is 132 minutes after 1:45 AM? 3:57 AM What is 472 minutes after 3:12 AM? 11:04 AM What is 103 minutes after 2:57 AM? 4:40 AM What is 454 minutes before 10:09 AM? 2:35 AM What is 345 minutes before 3:03 AM? 9:18 PM How many minutes are there between 11:06 AM and 7:28 PM? 502 How many minutes are there between 11:29 AM and 10:59 PM? 690 What is 681 minutes after 5:08 AM? 4:29 PM How many minutes are there between 10:41 AM and 2:24 PM? 223 How many minutes are there between 10:59 PM and 1:55 AM? 176 How many minutes are there between 5:17 AM and 10:10 AM? 293 How many minutes are there between 6:59 AM and 4:05 PM? 546 How many minutes are there between 8:15 AM and 12:40 PM? 265 How many minutes are there between 4:55 AM and 5:09 AM? 14 How many minutes are there between 12:27 PM and 10:45 PM? 618 What is 628 minutes after 1:03 PM? 11:31 PM How many minutes are there between 2:49 AM and 2:10 PM? 681 What is 400 minutes before 2:24 PM? 7:44 AM What is 625 minutes after 3:03 PM? 1:28 AM How many minutes are there between 1:56 PM and 6:10 PM? 254 What is 10 minutes after 1:04 AM? 1:14 AM What is 104 minutes after 6:08 AM? 7:52 AM How many minutes are there between 12:53 AM and 7:37 AM? 404 How many minutes are there between 7:21 AM and 8:03 AM? 42 What is 585 minutes after 10:51 AM? 8:36 PM What is 123 minutes before 1:27 AM? 11:24 PM What is 295 minutes after 10:59 AM? 3:54 PM What is 170 minutes after 8:04 PM? 10:54 PM What is 623 minutes before 7:04 PM? 8:41 AM What is 366 minutes after 3:37 AM? 9:43 AM How many minutes are there between 4:43 PM and 4:20 AM? 697 What is 59 minutes before 3:14 AM? 2:15 AM How many minutes are there between 11:00 AM and 9:34 PM? 634 What is 493 minutes before 5:19 PM? 9:06 AM What is 154 minutes after 5:13 AM? 7:47 AM How many minutes are there between 4:34 AM and 10:29 AM? 355 How many minutes are there between 7:27 AM and 1:27 PM? 360 How many minutes are there between 9:18 AM and 12:42 PM? 204 How many minutes are there between 12:42 AM and 10:58 AM? 616 What is 289 minutes after 4:38 AM? 9:27 AM What is 584 minutes after 10:49 AM? 8:33 PM How many minutes are there between 8:20 PM and 4:03 AM? 463 How many minutes are there between 9:54 AM and 12:04 PM? 130 How many minutes are there between 3:31 PM and 5:28 PM? 117 What is 591 minutes after 3:05 PM? 12:56 AM How many minutes are there between 10:56 AM and 2:54 PM? 238 How many minutes are there between 4:13 AM and 12:21 PM? 488 What is 439 minutes before 10:49 AM? 3:30 AM How many minutes are there between 12:56 AM and 6:41 AM? 345 How many minutes are there between 6:29 PM and 1:54 AM? 445 How many minutes are there between 5:12 AM and 1:17 PM? 485 What is 557 minutes before 5:07 PM? 7:50 AM What is 543 minutes before 1:58 PM? 4:55 AM What is 209 minutes before 6:16 PM? 2:47 PM How many minutes are there between 8:07 PM and 12:22 AM? 255 How many minutes are there between 1:22 AM and 12:25 PM? 663 How many minutes are there between 1:02 AM and 11:25 AM? 623 How many minutes are there between 8:09 PM and 6:56 AM? 647 What is 472 minutes after 6:48 AM? 2:40 PM How many minutes are there between 1:07 AM and 4:11 AM? 184 What is 462 minutes before 7:01 AM? 11:19 PM What is 54 minutes before 9:48 AM? 8:54 AM How many minutes are there between 3:58 AM and 9:19 AM? 321 How many minutes are there between 7:28 PM and 3:18 AM? 470 How many minutes are there between 10:33 PM and 11:36 PM? 63 What is 644 minutes before 11:14 PM? 12:30 PM How many minutes are there between 8:50 PM and 10:12 PM? 82 What is 236 minutes before 8:13 PM? 4:17 PM How many minutes are there between 3:19 AM and 11:20 AM? 481 How many minutes are there between 12:23 AM and 1:03 AM? 40 How many minutes are there between 7:38 PM and 6:55 AM? 677 What is 573 minutes before 6:34 AM? 9:01 PM How many minutes are there between 5:51 PM and 10:44 PM? 293 How many minutes are there between 3:20 AM and 5:41 AM? 141 How many minutes are there between 2:58 PM and 5:14 PM? 136 How many minutes are there between 12:05 AM and 10:46 AM? 641 How many minutes are there between 5:09 PM and 2:56 AM? 587 How many minutes are there between 5:11 AM and 3:23 PM? 612 How many minutes are there between 2:11 AM and 5:01 AM? 170 How many minutes are there between 1:21 PM and 5:21 PM? 240 What is 679 minutes before 3:37 AM? 4:18 PM How many minutes are there between 2:21 PM and 11:05 PM? 524 How many minutes are there between 3:16 PM and 11:32 PM? 496 What is 423 minutes after 1:15 PM? 8:18 PM How many minutes are there between 7:20 PM and 8:02 PM? 42 How many minutes are there between 10:34 AM and 10:14 PM? 700 What is 491 minutes before 3:28 PM? 7:17 AM What is 470 minutes before 11:23 PM? 3:33 PM How many minutes are there between 6:32 PM and 11:56 PM? 324 How many minutes are there between 9:20 AM and 6:36 PM? 556 What is 616 minutes before 8:25 AM? 10:09 PM How many minutes are there between 5:58 PM and 2:32 AM? 514 What is 443 minutes before 1:22 PM? 5:59 AM How many minutes are there between 8:11 AM and 4:33 PM? 502 How many minutes are there between 10:47 PM and 1:21 AM? 154 How many minutes are there between 1:42 AM and 12:28 PM? 646 How many minutes are there between 8:54 PM and 12:21 AM? 207 What is 56 minutes after 2:27 PM? 3:23 PM What is 54 minutes after 2:12 AM? 3:06 AM What is 682 minutes after 11:21 PM? 10:43 AM What is 672 minutes after 5:18 AM? 4:30 PM How many minutes are there between 8:57 AM and 9:11 AM? 14 What is 342 minutes before 2:13 PM? 8:31 AM What is 243 minutes after 10:29 PM? 2:32 AM How many minutes are there between 7:03 PM and 3:05 AM? 482 How many minutes are there between 8:19 PM and 7:20 AM? 661 How many minutes are there between 4:30 AM and 5:09 AM? 39 How many minutes are there between 9:43 AM and 12:12 PM? 149 How many minutes are there between 8:59 AM and 5:24 PM? 505 What is 530 minutes after 3:27 PM? 12:17 AM How many minutes are there between 7:45 AM and 11:54 AM? 249 How many minutes are there between 12:53 PM and 6:34 PM? 341 What is 401 minutes before 2:44 AM? 8:03 PM What is 526 minutes after 4:47 AM? 1:33 PM How many minutes are there between 4:50 PM and 6:12 PM? 82 How many minutes are there between 9:37 AM and 10:59 AM? 82 How many minutes are there between 2:51 AM and 1:07 PM? 616 What is 48 minutes after 3:40 AM? 4:28 AM How many minutes are there between 1:01 PM and 7:07 PM? 366 What is 517 minutes	{ "pile_set_name": "DM Mathematics" }
placement from {q: 4, j: 6, o: 7, z: 1, h: 2}. Give prob of sequence jz. 3/190 Three letters picked without replacement from ymymwwfmydwdfd. Give prob of sequence wym. 9/728 Two letters picked without replacement from miimippprpiiii. What is prob of sequence pi? 2/13 Three letters picked without replacement from oodboboqowoowoowbdo. Give prob of sequence qbd. 1/969 Calculate prob of sequence nnv when three letters picked without replacement from {v: 6, n: 12}. 11/68 What is prob of sequence yf when two letters picked without replacement from ufufufyf? 1/14 Two letters picked without replacement from ddddtzdzzzzezddtdet. Give prob of sequence ez. 2/57 What is prob of sequence qg when two letters picked without replacement from {q: 1, g: 8, j: 8}? 1/34 Calculate prob of sequence usf when three letters picked without replacement from {u: 3, i: 7, f: 2, h: 3, s: 3}. 1/272 Calculate prob of sequence ccc when three letters picked without replacement from {z: 2, c: 4}. 1/5 Two letters picked without replacement from {m: 1, z: 2, n: 3, x: 4, r: 2}. What is prob of sequence nr? 1/22 Four letters picked without replacement from nahbbhaabbaaaae. What is prob of sequence hbhb? 1/1365 Three letters picked without replacement from hbb. What is prob of sequence bhh? 0 Three letters picked without replacement from gjjjjjjj. What is prob of sequence gjj? 1/8 Three letters picked without replacement from {q: 4, w: 1, t: 2}. Give prob of sequence wqq. 2/35 Two letters picked without replacement from kkkdkkdkkkk. What is prob of sequence kk? 36/55 Calculate prob of sequence nnf when three letters picked without replacement from {f: 10, n: 2}. 1/66 Four letters picked without replacement from {f: 5, i: 9}. What is prob of sequence fiii? 15/143 Calculate prob of sequence jjo when three letters picked without replacement from {j: 11, y: 1, o: 1, l: 3, d: 2}. 55/2448 Four letters picked without replacement from {y: 11, t: 2}. What is prob of sequence tyty? 1/78 Four letters picked without replacement from {f: 1, y: 3, i: 1}. Give prob of sequence yiyf. 1/20 Four letters picked without replacement from fjwwfffffjf. Give prob of sequence ffjw. 7/330 Calculate prob of sequence xsit when four letters picked without replacement from tisspdx. 1/420 Calculate prob of sequence sz when two letters picked without replacement from {s: 4, z: 2, c: 1}. 4/21 Calculate prob of sequence jjjy when four letters picked without replacement from {j: 3, y: 11}. 1/364 Two letters picked without replacement from bbzt. Give prob of sequence tb. 1/6 Calculate prob of sequence fvjj when four letters picked without replacement from {v: 1, s: 1, f: 2, j: 2}. 1/90 Calculate prob of sequence oo when two letters picked without replacement from {k: 3, y: 1, o: 5}. 5/18 Calculate prob of sequence aaaa when four letters picked without replacement from aaaaa. 1 What is prob of sequence aa when two letters picked without replacement from {o: 1, w: 1, n: 1, b: 1, a: 2, y: 1}? 1/21 Calculate prob of sequence oqww when four letters picked without replacement from qwwosqsss. 1/756 Calculate prob of sequence nn when two letters picked without replacement from {n: 2, c: 4, f: 1, w: 2}. 1/36 Four letters picked without replacement from rrqrrrrrrrqrr. What is prob of sequence rqrq? 1/78 What is prob of sequence sa when two letters picked without replacement from rpttksapptr? 1/110 What is prob of sequence kkz when three letters picked without replacement from {z: 1, k: 2, u: 4, m: 3}? 1/360 Three letters picked without replacement from ilvilaaaailaa. Give prob of sequence aia. 15/286 What is prob of sequence lwl when three letters picked without replacement from tltltllwllltttl? 4/195 Three letters picked without replacement from ymyxwdmwwm. What is prob of sequence mdm? 1/120 Four letters picked without replacement from {z: 4, d: 3, t: 5, k: 7}. What is prob of sequence tzzd? 5/2584 Three letters picked without replacement from rxxxrxr. Give prob of sequence rrr. 1/35 Calculate prob of sequence lgly when four letters picked without replacement from {g: 2, e: 1, y: 2, l: 4}. 1/63 What is prob of sequence th when two letters picked without replacement from ztqnthnl? 1/28 Three letters picked without replacement from mchwqpw. Give prob of sequence whc. 1/105 What is prob of sequence gkrg when four letters picked without replacement from {h: 1, k: 1, r: 1, v: 3, g: 6, j: 3}? 1/1092 Three letters picked without replacement from {c: 8, p: 5}. What is prob of sequence ccc? 28/143 What is prob of sequence oo when two letters picked without replacement from {w: 3, o: 3}? 1/5 What is prob of sequence mmm when three letters picked without replacement from {m: 7, b: 6}? 35/286 Two letters picked without replacement from {z: 1, m: 1, f: 2, t: 2, u: 1, g: 1}. Give prob of sequence fg. 1/28 What is prob of sequence qixb when four letters picked without replacement from {f: 2, q: 1, b: 1, x: 1, i: 2, m: 1}? 1/840 Three letters picked without replacement from ffjjahffjhfjhfafah. Give prob of sequence aaa. 1/816 Three letters picked without replacement from {s: 1, g: 1, m: 3, q: 1, t: 5}. Give prob of sequence gtt. 2/99 What is prob of sequence bmz when three letters picked without replacement from zzzmzabzbzzmzrzmuz? 5/408 Four letters picked without replacement from udubuuddudebbudubdb. Give prob of sequence ebud. 35/15504 What is prob of sequence mfhm when four letters picked without replacement from mhhhhffffmwfwfhwfff? 5/5168 Calculate prob of sequence mmmm when four letters picked without replacement from mmmmmmmmm. 1 Calculate prob of sequence sws when three letters picked without replacement from ssws. 1/4 Four letters picked without replacement from {m: 7, a: 9}. What is prob of sequence mmaa? 9/130 Calculate prob of sequence bvgx when four letters picked without replacement from {b: 4, x: 4, v: 4, g: 6}. 4/765 What is prob of sequence cp when two letters picked without replacement from psahpheheshehpc? 1/70 What is prob of sequence rrf when three letters picked without replacement from {r: 2, f: 4, j: 2}? 1/42 Two letters picked without replacement from ywfwfrffwrrrwfyy. What is prob of sequence rf? 1/12 Calculate prob of sequence jmjj when four letters picked without replacement from {m: 2, j: 2, w: 2, h: 2}. 0 Four letters picked without replacement from {q: 2, x: 1, a: 2, d: 1, f: 2}. Give prob of sequence fdfa. 1/420 Calculate prob of sequence bw when two letters picked without replacement from bbbw. 1/4 Four letters picked without replacement from {u: 3, h: 1, s: 1, n: 2}. What is prob of sequence hnsn? 1/420 Three letters picked without replacement from ooqktttqokkomootok. What is prob of sequence tqm? 1/612 Three letters picked without replacement from {j: 7, m: 4}. What is prob of sequence jmm? 14/165 Three letters picked without replacement from ssssgssssgssssssss. What is prob of sequence sgg? 1/153 Three letters picked without replacement from eee. Give prob of sequence eee. 1 Two letters picked without replacement from {y: 3, e: 1, u: 1, c: 2}. Give prob of sequence ey. 1/14 What is prob of sequence jjsu when four letters picked without replacement from jjjsjjsjejeuususjsj? 15/1292 Three letters picked without replacement from omlooqlulozlo. Give prob of sequence muz. 1/1716 What is prob of sequence na when two letters picked without replacement from {n: 2, w: 2, a: 1, d: 1}? 1/15 Calculate prob of sequence cyxh when four letters picked without replacement from {h: 3, y: 1, c: 3, l: 2, x: 2, m: 4}. 1/1820 Calculate prob of sequence ffff when four letters picked without replacement from ffffffffff. 1 Three letters picked without replacement from ttottotolttolotot. Give prob of sequence ttl. 3/85 What is prob of sequence aaaa when four letters picked without replacement from asaaaasasassa? 14/143 Four letters picked without replacement from eolqqeolpqlpoqqoqqp. Give prob of sequence lqlo. 7/3876 Three letters picked without replacement from {a: 9, g: 5}. Give prob of sequence aga. 15/91 Four letters picked without replacement from {z: 1, i: 1, y: 1, g: 2, n: 4}. What is prob of sequence yzni? 1/756 Calculate prob of sequence zz when two letters picked without replacement from tzzz. 1/2 Two letters picke	{ "pile_set_name": "DM Mathematics" }
8 + 26746 for x. 28 Solve -2701f + 14008 = 43719 for f. -11 Solve 5278y + 53213 - 269573 = 1672y for y. 60 Solve -12m - 3m + m = 43m - 2508 for m. 44 Solve 137 + 829 = 133b - 50b - 196 for b. 14 Solve 53c = 326c - 2890 + 16267 for c. -49 Solve 146c - 5184 = -10148 for c. -34 Solve -132o + 626o + 74760 = -129o for o. -120 Solve 1826x - 3886 = 6432 + 7942 for x. 10 Solve 17460z = 17584z - 4588 for z. 37 Solve -1124y - 1787y = 273y - 281y + 226434 for y. -78 Solve -5b + 234b + 9743 = b - 3025 for b. -56 Solve -124f + 762 = 4978 for f. -34 Solve 268u + 301u + 27835 + 1568 = 206u for u. -81 Solve 119z + 6835 = -1823z - 933 for z. -4 Solve -3376i - 3408i + 957 = -6697i for i. 11 Solve -1452g - 1403952 = -1798g - 5852g - 4438g for g. 132 Solve 1094w + 72861 = -7001 for w. -73 Solve -52f + 6986 = 4386 for f. 50 Solve 1279x + 31680 + 60305 - 7797 - 2332 = 0 for x. -64 Solve -2x + 37 = -8x - 11 - 78 for x. -21 Solve 85680 = -1346f - 4366f for f. -15 Solve 95u + 27u - 443 = -43u - 1103 for u. -4 Solve -3779o + 235354 + 129220 - 77370 = 0 for o. 76 Solve 1858o = 6380o + 280364 for o. -62 Solve -501c - 539c + 48880 = 0 for c. 47 Solve -31005 = 534m + 27766 - 20323 for m. -72 Solve -11949773d + 31875 = -11950198d for d. -75 Solve -468f - 8232 = 94f - 3294 + 5178 for f. -18 Solve 6585v = 2749v - 364420 for v. -95 Solve -219j - 2486 = -77 for j. -11 Solve 265s - 546s + 3626s = 469680 - 168630 for s. 90 Solve 65n + 4423 = -9n - 2n - 2037 for n. -85 Solve 1839m + 61193 = 109007 for m. 26 Solve 3083x + 15878 + 5410 = -11787 - 3921 for x. -12 Solve 0 = -76v + 18v + 964 + 428 for v. 24 Solve 150q - 3763 = -151q + 248q for q. 71 Solve -1922o + 524o = 1649o + 146256 for o. -48 Solve 185k - 10556 = 549k for k. -29 Solve -2455 - 3622 = -1202r + 1305r for r. -59 Solve 780x - 1925 = -737x + 2626 for x. 3 Solve 5987r + 5979r - 17986r + 1760 = -5988r for r. 55 Solve 2102z + 977z + 1833z - 15191 = 127257 for z. 29 Solve -442z = -954z + 483z - 841 for z. -29 Solve -116s = -305s + 6s - 281s + 9280 for s. 20 Solve -5376i - 468167 = -54215 for i. -77 Solve -1257g - 3447g - 331539 = 1280g + 350637 for g. -114 Solve 144x + 7391 + 8179 = 126x + 537x for x. 30 Solve 10920 = -6541a - 80654 for a. -14 Solve -40t + 964 = -218 - 98 for t. 32 Solve 0 = 382255q - 382165q - 5220 for q. 58 Solve -67v + 159v + 15351 = 200v + 249v for v. 43 Solve 28q = -1607q - 2071q - 2583q - 421363 for q. -67 Solve 9672 = 651c - 41757 for c. 79 Solve 0 = 513b + 1487 + 8773 for b. -20 Solve 68887 = 35356i - 34599i for i. 91 Solve 12472b - 152717 = 46835 for b. 16 Solve -14520t + 4609t = 140406 + 1048914 for t. -120 Solve 131n + 83 = -81 - 98 for n. -2 Solve 654y = 815y + 2093 for y. -13 Solve -233c + 5058 = -135c + 183c for c. 18 Solve -2419j + 563j + 111904 = 296j for j. 52 Solve -975 = 126l + 8553 + 174 for l. -77 Solve -11447r - 922 = -5809r - 5749r + 521 for r. 13 Solve -8c - 1017 = 86c - 735 for c. -3 Solve -1967p + 123876 = -6555p for p. -27 Solve -25137 = -2569000v + 2569189v for v. -133 Solve 1327q + 3 = 1340q + 55 for q. -4 Solve 7035a = 6596a - 8939 - 5987 for a. -34 Solve 1945a + 57858 + 37447 = 0 for a. -49 Solve -7683b = -7871b - 16168 for b. -86 Solve -1065z = -2130z + 1061z + 132 for z. 33 Solve 5017 = -129q + 115 for q. -38 Solve 31047 = -1812j + 105339 for j. 41 Solve 0 = -4181a + 6281a + 86100 for a. -41 Solve -8290 = 1105b - 69b + 9322 for b. -17 Solve 54m - 360 = -133m + 54m - 47m for m. 2 Solve 25451 - 8389 = -449d for d. -38 Solve 1250z + 1085z - 52737 - 35993 = 0 for z. 38 Solve -8j = -766 - 812 + 1506 for j. 9 Solve 3383y - 3650y + 7743 = 0 for y. 29 Solve 0 = 45h - 2973 + 2703 for h. 6 Solve 356v - 427v + 291 = 1498 for v. -17 Solve 0 = -4170k - 43929 - 423111 for k. -112 Solve -981 = -658k + 265k + 3157 + 6866 for k. 28 Solve 13590s - 765 = 6866s + 6809s for s. -9 Solve -5845 - 55083 = -523m - 233m + 308 for m. 81 Solve -1710o = -45o + 3023o - 221636 - 36204 for o. 55 Solve 0 = 1281f - 1195f + 2666 for f. -31 Solve -1696u + 3331u + 2450 = 1705u for u. 35 Solve 735170c + 5130 = 735341c for c. 30 Solve 691w + 4181 = -156w - 10346 + 2669 for w. -14 Solve -7437w + 3809w + 3621 = -3699w for w. -51 Solve -6812 = -87u + 265u + 7912 - 5468 for u. -52 Solve 542u - 2475 = -7894 - 4879 for u. -19 Solve -312o - 6506 - 3385 - 9742 = -601 for o. -61 Solve 11070 = 469d + 1371d + 86510 for d. -41 Solve 1569y = 53y - 38y - 21756 for y. -14 Solve 35y + 23y = 2940 - 2997 + 1275 for y. 21 Solve -268r + 1044r = -540r + 31584 for r. 24 Solve -9q + 560 = -8q - 12q + 582 for q. 2 Solve -4j - 9 + 114 + 147 = 5j for j. 28 Solve 1843p - 8993p = 729300 for p. -102 Solve 9703o + 56753 - 353153 = 1106o - 1283o for o. 30 Solve 0 = -570g - 8520 + 5767 - 17197 for g. -35 Solve -1615v + 698v - 4254 = -721v + 842 for v. -26 Solve -32q = 145641 - 72466 - 72727 for q. -14 Solve -356s + 30480 = 1461s + 5042 for s. 14 Solve 371a - 3897665 = -3921780 for a. -65 Solve -420 = -60921b + 60981b for b. -7 Solve 6926q = 6823q + 4326 for q. 42 Solve -24189j = 964j + 1383j + 1202877 + 601571 for j. -68 Solve -20550u + 25 = -20490u - 635 for u. 11 Solve 18303 = -1953v - 153214 - 133793 + 41655 for v. -135 Solve -284o + 1114 + 8826 = 0 for o. 35 Solve 4012 = -48p - 140p + 12766 + 4218 for p. 69 Solve -1161o + 2823 = 10365 + 2907 for o. -9 Solve -1650b + 5454 = -1751b for b. -54 Solve 65c - 120c + 65c = 250 for c. 25 Solve 44c - 28586 = -32546 for c. -90 Solve 32551 = 1731i - 11066 - 13506 for i. 33 Solve 313y - 215y - 544 - 5042 = 0 for y. 57 Solve -37126 = 340j - 44266 for j. 21 Solve 3197y = -1874y + 381y - 51590 for y. -11 Solve -43v = -44v + 25v + 528 for v. -22 Solve 110h - 30h + 86 = -634 for h. -9 Solve -57w - 465w + 36608 = 182w for w. 52 Solve 25p - 196p - 169p = 298p - 7656 for p. 12 Solve 3630b + 437663 = 45623 for b. -108 Solve 89i + 754 + 1201 = 86 for i. -21 Solve 38562z + 23415 = 39231z for z. 35 Solve -46663c + 46625c = -612 - 72 for c. 18 Solve -187a - 1113a = 580a - 52640 for a. 28 Solve 781j - 12090 = 316j for j. 26 Solve -577d - 281d + 81445 = 231d - 194d for d. 91 Solve -88n + 4667 = 2819 for n. 21 Solve -155w + 12691 - 11938 = 14858 for w. -91 Solve 121p + 721p + 311p - 13836 = 0 for p. 12 Solve -2761j + 8013j = 2694j + 2709j - 6493 for j. 43 Solve 13304v - 13484v = -5580 for v. 31 Solve -940n + 1823 + 8517 = 0 for n. 11 Solve -27466 = 14307048u - 14307934u for u. 31 Solve 357739 = -8143n + 239n - 4625n - 168479 for n. -42 Solve -63665 = 9606k - 9071k for k. -119 Solve 662b + 76b - 12012 = -186b for b. 13 Solve -75l + 1521 = 5l + 5l - 859 for l. 28 Solve -4022 - 15206 = -733v + 315v for v. 46 Solve 76r = 242r - 70r + 251r - 40252 for r. 116 Solve 0 = -2726715w + 2726677w + 1710 for w. 45 Solve -138n + 1858 = 2410 for n. -4 Solve 33541i - 33549i + 424 = 0 for i. 53 Solve 1222f + 4821 - 185 = -1474 for f. -5 Solve 212g + 4g + 4390 + 4685 = -389g for g. -15 Solve -1498m = 1227m - 2975m + 5750 for m. 23 Solve 0 = 2767w + 170w + 337755 for w. -115 Solve 323k + 210702 = 202950 for k. -24 Solve -677a - 2994 = -776a - 222 for a. 28 Solve -30o - 188o - 7464 - 3436 = 0 for o. -50 Solve 121u - 7018 - 809 = -2987 for u. 40 Solve -5117 = -405u + 104u + 11137 for u. 54 Solve -304q = 1084267 - 1062683 for q. -71 Solve -18619 = -59c - 9511 - 12353 for c. -55 Solve 0 = 32x - 611 - 366 + 177 for x. 25 Solve 47129908i - 6480 = 47130016i for i. -60 Solve -2483x + 63592 - 213544 = 175610 - 64847 for x. -105 Solve -1291u - 863008 = 2216u - 1449u + 3734u for u. -149 Solve -116481 + 134007 = 762n for n. 23 Solve 35a + 81a = 524a - 13872 for a. 34 Solve 1095 = -8x + 599 + 661 + 443 for x. 76 Solve 164t - 28t - 68t = -142t - 19740 for t. -94 Solve -11317 = 115y - 967 for y. -90 Solve 703a - 5203 = 824a for a. -43 Solve 182067t = 182012t + 2090 for t. 38 Solve -2782q + 325 = -2795q for q. -25 Solve -765x + 1666x + 4284 = 782x for x. -36 Solve -11424 = -92v - 622v for v. 16 S	{ "pile_set_name": "DM Mathematics" }
1153g. 5748g*3 Collect the terms in 1418 + 106i + 67i - 174i - 857 + 1370. -i + 1931 Collect the terms in 8194s2 + 114s*3 + 5101s*2 - 13295s*2. 114s*3 Collect the terms in -2 + 3 + 23 - 22 - 30k. -30k + 2 Collect the terms in -1188 - 725 + 2107 - o2 - 1630 + 2o2. o2 - 1436 Collect the terms in -1877h - 325h + 978h - 2452h - 1533h. -5209h Collect the terms in -69p2 + 570p - 12 - 570p + 15p*2. -54p*2 - 12 Collect the terms in 104x*2 + x - 375x*2 - 19x*3 + 1 - 942x*2. -19x*3 - 1213x*2 + x + 1 Collect the terms in -125w + 89w + 67w - 1848 + 1843. 31w - 5 Collect the terms in -20 - 8447f - 8 + 549f - 3451f. -11349f - 28 Collect the terms in -39 + 41h + h*2 + 63 - 163h + 122h + 75. h2 + 99 Collect the terms in -2 - 1850212q*2 + 3 + 1850206q*2 + 293q. -6q2 + 293q + 1 Collect the terms in 98 - 89 - 38x - 72x - 3x + 28x. -85x + 9 Collect the terms in -117 + 224 + 2m*2 - 30m*2 - 148 - 3m + 0m. -28m*2 - 3m - 41 Collect the terms in 60l2 - 12l*2 + 257l*2 - 88. 305l*2 - 88 Collect the terms in -2759 - 179934n*3 - 2772 + 5531 + 179933n3. -n3 Collect the terms in 7h - 73h*2 + 2h + 503 - 56 - 10h. -73h*2 - h + 447 Collect the terms in -344z + 666 + 667 - 2005 + 670 + 3z2. 3z*2 - 344z - 2 Collect the terms in 3 - 1044022327t2 + 1044021292t*2 - 3. -1035t*2 Collect the terms in -46 - 47 - 14g + 146 - 54 + 16g. 2g - 1 Collect the terms in -2j + j + 9j - 69 - 58 + 151. 8j + 24 Collect the terms in -r3 - 59537r + 54292r + 0 + 1 - 244959r. -r*3 - 250204r + 1 Collect the terms in -2x + 3750x*2 - 9931x*2 + 6166x*2 + 2x. -15x2 Collect the terms in -900g + 14059g - 9 + 18 - 9. 13159g Collect the terms in 7234x - 17446x + 10212x - 472x*2. -472x*2 Collect the terms in -33969l*2 - 6790l*3 + 159515l*2 + 6789l3. -l3 + 125546l2 Collect the terms in 271f*3 + 275f*3 - 1628f*3 + 281f*3 + 269f*3 + 276f*3 + 274f*3. 18f*3 Collect the terms in -11 - 15 - 72 + 0u*2 + 6 + 13u*2 + 86. 13u*2 - 6 Collect the terms in -15803s*3 + 26825s + 1 - 1 - 26825s. -15803s*3 Collect the terms in 97h*2 + 39984422h - 79968829h + 39984407h. 97h2 Collect the terms in -19847m*3 + 100663m*3 + 83069m*3. 163885m*3 Collect the terms in -8021t*2 + 12555 + 8005t*2 - 12555. -16t*2 Collect the terms in 13471k*2 + 18218k*3 - 18205k*3 - 13471k*2. 13k*3 Collect the terms in 30k - 87k - 4878 + 28k + 31k. 2k - 4878 Collect the terms in -34 + 1774r + 10 + 13 + 11. 1774r Collect the terms in -131j3 + 75 - 75 - 93j*3 + 448j*3. 224j*3 Collect the terms in 112k - 31k - 1122k*2 - 52k - 29k. -1122k*2 Collect the terms in -2k - 13k2 - k + 5k*2 + 14k*2 - 44k*2 + 26k*2. -12k*2 - 3k Collect the terms in 229691164148 - 229691164148 + 9g3. 9g*3 Collect the terms in 991v*3 + 1072v*3 - 14v*2 - 1571v*3 + 14v*2. 492v*3 Collect the terms in -85 + 85 - 284o*3 - 22o*2 + 22o*2. -284o*3 Collect the terms in 707s + 186s + 1521s + 701s. 3115s Collect the terms in 6593805338 - 6593805338 + 68094z2 - 68091z*2. 3z*2 Collect the terms in -214833 + 31q + 13q + 214833 - 9q + 29q. 64q Collect the terms in 23121434y3 - 23121437y*3 + 32729 - 32729. -3y*3 Collect the terms in -542l - 823l + 717l - 873l - 743l. -2264l Collect the terms in -2 + 6309089k + 1 + 1. 6309089k Collect the terms in -364245a*2 - 364403a*2 + 0 + 0 + 728517a*2. -131a*2 Collect the terms in 126660b*2 + 24114b*2 + 78504b*2. 229278b*2 Collect the terms in -425369 - 425366 + 487z + 850735 - 139z. 348z Collect the terms in 52m - 8 + 36m + 59m - 137m + 8. 10m Collect the terms in 209j*3 + 143j*3 + 173j*3 - 185j*3 + 190j*3. 530j*3 Collect the terms in 457o*3 - 13267o*3 - 5830o*3 - 280o*3. -18920o*3 Collect the terms in -538n*3 - 25n*3 + 542n*3. -21n*3 Collect the terms in -109365l*3 + 5l + 0l2 + 0l*2 - 109327l*3 + 218700l*3 - 5l. 8l3 Collect the terms in 29 + 52402p*3 + 52430p*3 - 104831p3. p3 + 29 Collect the terms in 1585530 - 1585530 - 20797b2. -20797b*2 Collect the terms in 775153n - 102687n + 1137963n. 1810429n Collect the terms in -179688a*2 + 73476a*2 - 135707a*2. -241919a*2 Collect the terms in 117i*2 - 117i*2 - 65 + 17 + 51 - 69i*3. -69i*3 + 3 Collect the terms in 2988302u*2 - 1494151u*2 - 1494150u2. u2 Collect the terms in 2018o + 8 - 3 - 52o*2 - 5. -52o*2 + 2018o Collect the terms in -38r2 - 18r*2 + 88r*2 - 8 + 68r - 68r. 32r*2 - 8 Collect the terms in -1141w*2 - 1728w*2 + 432w*2. -2437w*2 Collect the terms in -5960t*2 + 23289t*2 - 5960t*2 - 6065t*2 - 5803t*2. -499t*2 Collect the terms in -156k - 158k - 153k - 151k - 318k + 936k - k3. -k3 Collect the terms in 4 + 0 - 4 - 1105p*2 + 2437p*2 - 852p*2. 480p*2 Collect the terms in 257 + 246 + 265 - 230 + 173 - 18d. -18d + 711 Collect the terms in -31f*3 + 6f*3 + 11f*3 + 13f3. -f3 Collect the terms in 683d - 2006d*3 + 410d - 1093d + 52 - 52. -2006d*3 Collect the terms in -3v2 + v2 - 3711730990165 + 3711730990165. -2v2 Collect the terms in -2463 + 985 + 763 + 715 + 4p*2. 4p*2 Collect the terms in 236j*2 + 43j*3 - 8j*2 + 8j*2. 43j*3 + 236j2 Collect the terms in -r3 + 0r3 - 87694r - 3r3. -4r*3 - 87694r Collect the terms in 6 + 4a - 116a*2 - 23a*2 - 85a*2 - 87a*2. -311a*2 + 4a + 6 Collect the terms in 219b3 - 11b - 8b - 2 + 23b - 3b. 219b*3 + b - 2 Collect the terms in 3 + 102z + 122z - 260z. -36z + 3 Collect the terms in 168 + 2j - 509 + 0j + 167 + 174. 2j Collect the terms in 39 - 667716d2 + 1199911d*2 + 1151418d*2 - 39. 1683613d*2 Collect the terms in -14h + 171h - 64h - 647h - 776h - 384h. -1714h Collect the terms in 98629119m + 98629111m - 197258213m. 17m Collect the terms in -923540463q + 1847080930q - 923540462q. 5q Collect the terms in -5389 + 13g + 11g + 11g + 5389 + g - 34g. 2g Collect the terms in -11 - 193o*2 + 582o*2 - 68 - 188o*2 - 189o*2. 12o*2 - 79 Collect the terms in 1667 - 1846 + 18i*3 + 179. 18i*3 Collect the terms in -26 - 1633w + 28 + 1022w + 609w. -2w + 2 Collect the terms in 15859h - 26h2 - 31459h + 15600h. -26h*2 Collect the terms in 6585j - 1682j - 1546j - 1607j - 1606j. 144j Collect the terms in 828223 - 1653883 + 825660 - 23b*2. -23b*2 Collect the terms in -18f*2 + 47f*2 + 141f*2 + 130f*2 + 32f*2 - 61f*2. 271f*2 Collect the terms in -102208t*2 - 34 + 201682t*2 - 99476t*2. -2t*2 - 34 Collect the terms in 11 + j + 66j*2 + 0 - 10j + 0j2. 66j*2 - 9j + 11 Collect the terms in 390g - 390g + 53 + 13 + 2g3 + 1 + g2. 2g3 + g2 + 67 Collect the terms in -7 + 4 + 1455n2 - 113 + 117. 1455n*2 + 1 Collect the terms in -288 - 3s + 678s2 - 17s + 20s. 678s*2 - 288 Collect the terms in 8r + 36r - 14r + 12r - 4r + 49r. 87r Collect the terms in -1884v + 512v + 502v + 439v + 448v. 17v Collect the terms in 72 + 75 + 1793t - 147 + 3t*2 - 1793t. 3t2 Collect the terms in -194522w*2 - 14223w*2 - 3766w + 3766w. -208745w*2 Collect the terms in -128g + 7 - 57g2 + 117g + 7g. -57g*2 - 4g + 7 Collect the terms in -208o2 - 77o*2 + 65o*2 + 26o*2 - 113o*2. -307o*2 Collect the terms in -8311w*3 - 8w2 - w2 + 11w2 - 2w*2. -8311w*3 Collect the terms in -34p*2 - 144p*3 + 9p*2 - 28p*3 - 2p*2 + 27p*2. -172p*3 Collect the terms in -2112j + 4207j - 2098j - 1 + 13 + 5. -3j + 17 Collect the terms in -3221x - 3247x - 3241x + 8x3 + 9709x. 8x3 Collect the terms in -6646h*2 + 3305h*2 + 528h - 528h + 3338h*2. -3h*2 Collect the terms in -5j*2 + 0j*2 + 4j*2 + 79 - 12j*3 + 3j*2. -12j*3 + 2j2 + 79 Collect the terms in k2 - 157k3 - 141k*3 - 183k*3 + 461k3 - k2. -20k3 Collect the terms in 4389m*2 - 8769m*2 + 4381m2 - 98. m2 - 98 Collect the terms in 8z + 90 + 87 + 95 - 375 + 91. 8z - 12 Collect the terms in 36h + 7h + 8*h	{ "pile_set_name": "DM Mathematics" }
c be (2 - 4) + 81. Let p = c - 4. Suppose py = 7y - 15. What is the greatest common factor of y and 6? 3 Suppose 3l + 2 = 5v, 5v - 6 = -3l + 2l. Let j = -1 - -2. What is the highest common divisor of v and j? 1 Suppose -4r = -r - 6. Suppose 0 = 5t - t + ra - 34, 4a = -5t + 35. Calculate the greatest common factor of 11 and t. 11 Suppose 5f = d - 50, -3d + 0f + f = -178. Calculate the highest common divisor of 12 and d. 12 Suppose -25 = 5p - 200. Suppose 2i - 1 = 7. Suppose 68 = 4j + iw, -j + 0w - 3w + 23 = 0. What is the greatest common divisor of p and j? 7 Suppose -2p = -0p - 242. What is the greatest common factor of p and 11? 11 Let b be (-1)/(13/2) - 504/(-234). What is the highest common divisor of b and 2? 2 Let w(m) = -m - m + 4 + 3m. Let t be w(4). What is the greatest common factor of t and 64? 8 Suppose 0 = 3a - 26 - 43. Calculate the greatest common factor of a and 69. 23 Let v be 236/20 - (-2)/10. What is the greatest common factor of v and 132? 12 Let a(u) = u*2 - 5u + 6. Let s be a(5). Calculate the highest common factor of s and 18. 6 Suppose 3p - 7p = -44. Let w = p - 5. Suppose -h - 100 = -wh. Calculate the highest common factor of h and 5. 5 Suppose 3g = 5 - 2. Suppose 6 = w + g. Calculate the highest common factor of w and 55. 5 Let h(c) = -c + 33. Let s be h(21). What is the greatest common factor of 12 and s? 12 Suppose f - 6m + m = 129, 0 = -3f - 4m + 463. Let t = f + -93. Let b be 4/((-2)/8-2). Calculate the highest common divisor of t and b. 8 Suppose -5z + 5o - o = -19, 5z - 51 = -4o. What is the highest common divisor of z and 56? 7 Let w = 16 + 38. Let g = w - 36. What is the highest common divisor of g and 12? 6 Suppose -m + 0 = -6. Let n be (-1 - 0)/((-8)/16). Suppose 4z - nz - 136 = -3d, 2z = 5d - 200. Calculate the greatest common factor of d and m. 6 Suppose q + 88 = -3q. Let p be 3/(-16)q. Calculate the greatest common divisor of 1 and p. 1 Let s be 20/1 + 0/4. Let h be (-1)/(1/(-8) + 0). Calculate the greatest common divisor of h and s. 4 Let o(b) = b*2 + 2b + 24. Let k be o(0). What is the greatest common factor of 120 and k? 24 Let j = -7 + 41. Calculate the greatest common divisor of j and 17. 17 Suppose j + 4j = 0. Suppose -f - f + 144 = j. Calculate the greatest common divisor of f and 9. 9 Let b(u) = 1 + 0u + u - 7. Let v be b(8). Calculate the greatest common factor of v and 6. 2 Suppose -p + 40 = 5q - 5p, -p - 17 = -3q. Let w be ((-53)/4)/((-1)/q). Let f = w + 27. Calculate the highest common divisor of 32 and f. 16 Suppose 4q - 12 = q. Suppose qt - 2t - 8 = 0. Suppose -6r + 80 = -2r. Calculate the highest common factor of t and r. 4 Let x = -3 - 1. Let u be 15 - x/(-6)3. Suppose -3w + 41 = 4c + u, 28 = 5c + 2w. Calculate the greatest common divisor of c and 36. 4 Suppose 0 = 2c + 6, d = 4d - 5c - 21. Suppose -g = -dg + 4. Calculate the greatest common factor of 8 and g. 4 Let c(j) = -2j*2 + 32j + 21. Let l be c(14). Calculate the highest common factor of 33 and l. 11 Let x = 57 + -38. Let d = 4 + -2. Suppose dg - 282 = 60. What is the highest common divisor of x and g? 19 Suppose 3c + 2r - 2 + 5 = 0, 4c + 3r + 3 = 0. Let s be (-12 - -3)/(1/c). Calculate the highest common divisor of s and 27. 27 Suppose 5i - 25 = -0i, 0 = 2x - 5i - 143. Let r = 106 + x. What is the greatest common factor of 19 and r? 19 Let a = -92 - -261. Let i = -121 + a. Let r be (0 - -1)/(4/24). Calculate the greatest common factor of r and i. 6 Let c = 5 - -1. Let w(y) = -54y*3. Let x be ((-1)/2)/((-1)/(-2)). Let q be w(x). Calculate the greatest common factor of q and c. 6 Let z = 5 - 5. Suppose 2n + 3q - 9 = 0, zn + 3n = 2q - 6. Suppose n = -3l + l + 6. What is the greatest common factor of l and 21? 3 Suppose 5j - 88 = 2d - 17, 5j + 2d = 59. Let o = 23 - j. What is the highest common factor of o and 25? 5 Let h be (-8)/14 + (-128)/(-28) - -2. Calculate the highest common divisor of h and 78. 6 Let s be -6((-11)/2)/1. Let r(c) = -c*3 + 13c*2 + 2c - 15. Let v be r(13). Calculate the greatest common divisor of v and s. 11 Suppose -3x = -0x + 3, -2q + 56 = -2x. Calculate the highest common divisor of 18 and q. 9 Let m = 111 - 59. What is the highest common factor of m and 78? 26 Let x be 6/9 + (-4)/6. Suppose -3r - 4 + 22 = x. Suppose -rv + 4v = -3q - 123, 2q = v - 64. Calculate the greatest common divisor of 6 and v. 6 Let p be 0 + 1/((-3)/(-84)). Suppose p = 2v + 8. Calculate the greatest common factor of v and 15. 5 Let r = 13 - 2. Suppose -2x - r = -5q, 3q - 3x + 1 = 13. Let g be (q14)/(1/8). What is the highest common factor of g and 16? 16 Let o be 6 - 66/9. Calculate the greatest common divisor of 14 and o. 2 Let f be (-1)/2 - (-201)/2. Suppose 56 + f = 3h. What is the highest common factor of h and 13? 13 Suppose 26 = -8v + 122. What is the greatest common factor of v and 6? 6 Let i(h) = h*3 - 8h*2 - 9h - 6. Let j be i(9). Let g = j - -14. What is the highest common factor of 16 and g? 8 Suppose m - 5m + 9 = -z, 5z - m - 31 = 0. Suppose 0 = 2n - 6, -2o = 2o + n - 59. What is the highest common divisor of o and z? 7 Let p = 4 + -4. Suppose 6a - a - 85 = p. Calculate the greatest common divisor of 187 and a. 17 Let v be (1 - (2 - -9))-1. Calculate the greatest common factor of v and 5. 5 Suppose 33o - 110 = 32o. What is the greatest common factor of 10 and o? 10 Suppose 2h - 332 = -2h + 4x, -4h = -5x - 327. Suppose 2o - 4 = -2o. Let i be o/(-2) - 68/(-8). What is the greatest common divisor of i and h? 8 Let k(u) = -u*2 + 9u + 8. Let y be k(9). Calculate the greatest common factor of y and 16. 8 Suppose 3t + 3 = 9. Let a be ((-155)/t - -1)-2. Calculate the greatest common factor of 17 and a. 17 Let g(y) = -y*3 + 2 + 8y + 0y2 - 3y - 4y2. Let k be g(-5). Let q be -14(-6)/8k. Calculate the greatest common factor of q and 105. 21 Let d(j) = -28j - 2. Let f be d(-4). Let h(w) = w - 16. Let y be h(0). Let m = -6 - y. Calculate the highest common factor of m and f. 10 Suppose -3v + 0v - 11 = -2j, -2j - 4v = -32. Let x = -6 + j. Suppose xc - 344 = -6b + 2b, -c + 66 = -3b. What is the highest common divisor of 9 and c? 9 Let y = 14 - -1. Suppose 5d = -4f + 845, -2d = 3f - 564 + 219. Calculate the highest common factor of y and d. 15 Let l be 36708/1083 - (17/19 + -1). Let t = -47 + 132. What is the greatest common factor of t and l? 17 Let l = 245 - 74. Calculate the greatest common factor of 19 and l. 19 Let g(q) = 21q*2 - 6q - 5. Let j(x) = 20x2 - 5x - 4. Let a(i) = -4g(i) + 5j(i). Let o be a(-1). Calculate the greatest common factor of 34 and o. 17 Suppose -6 - 18 = -2a. Suppose 0 = -3j + 5j - a. Calculate the greatest common divisor of j and 12. 6 Suppose -67 = -4l + 93. What is the highest common factor of l and 60? 20 Let q = -6 + -4. Let i be q/(-3) + 1/(-3). Suppose k + 4o - 2o - 9 = 0, -5o + 30 = 5k. What is the greatest common factor of k and i? 3 Suppose 3w = 2d - 23 - 1, -49 = -5d + 2w. Calculate the greatest common factor of d and 3. 3 Let h be 2(3/(-2) - -4). Calculate the greatest common factor of 45 and h. 5 Let u = -3 - -5. Let c be (1/u)/((-1)/(-34)). Suppose x - c = -2. Calculate the highest common factor of 6 and x. 3 Suppose 15 = 5t, 0 = -3f + t + 21 + 15. Let c(r) = 6r*2 - 6r - 3. Let m be c(5). What is the greatest common divisor of m and f? 13 Let m(k) = -11k - 20k - 2 + 0. Let u be m(-3). Calculate the highest common divisor of u and 13. 13 Let v be 8/3 - 2/3. Suppose -i - 9 = -4i, vi = s - 300. Calculate the greatest common divisor of s and 34. 34 Suppose -u + 482 = 4i + u, 5i - 5u - 595 = 0. Calculate the greatest common divisor of i and 12. 12 Suppose -6u + 9u = 120. Calculate the highest common divisor of 8 and u. 8 Let t = 1 + 0. Let k be (-3)/t(-5 - 2). What is the highest common divisor of 14 and k? 7 Let q be 9 + -2 + -3 + 5. What is the highest common factor of q and 45? 9 Let i(k) = -k*2 + 7k - 4. Let f be i(6). Let w = 7 - 5. Calculate the highest common factor of w and f. 2 Let b = 3 + 9. Calculate the greatest common divisor of 84 and b. 12 Let f(q) = -q - 4. Let y be f(-5). What is the hi	{ "pile_set_name": "DM Mathematics" }
27 PM? 5:41 AM What is 481 minutes before 3:10 PM? 7:09 AM How many minutes are there between 1:30 AM and 3:46 AM? 136 How many minutes are there between 11:05 AM and 5:49 PM? 404 How many minutes are there between 1:19 PM and 6:15 PM? 296 What is 171 minutes before 6:52 PM? 4:01 PM How many minutes are there between 10:26 PM and 8:53 AM? 627 How many minutes are there between 1:09 PM and 8:12 PM? 423 How many minutes are there between 5:28 AM and 11:13 AM? 345 How many minutes are there between 3:02 AM and 9:52 AM? 410 What is 472 minutes after 5:36 AM? 1:28 PM How many minutes are there between 3:03 PM and 7:09 PM? 246 How many minutes are there between 10:07 AM and 8:14 PM? 607 What is 309 minutes after 12:15 AM? 5:24 AM How many minutes are there between 5:54 PM and 10:43 PM? 289 What is 710 minutes before 1:02 AM? 1:12 PM How many minutes are there between 1:44 AM and 6:08 AM? 264 What is 429 minutes before 5:19 PM? 10:10 AM How many minutes are there between 9:44 AM and 8:30 PM? 646 How many minutes are there between 10:31 AM and 12:38 PM? 127 What is 408 minutes after 3:30 AM? 10:18 AM How many minutes are there between 5:33 PM and 10:36 PM? 303 What is 556 minutes after 6:23 PM? 3:39 AM How many minutes are there between 1:45 AM and 4:49 AM? 184 What is 166 minutes after 10:59 AM? 1:45 PM How many minutes are there between 3:43 AM and 3:03 PM? 680 What is 217 minutes before 2:25 AM? 10:48 PM What is 714 minutes before 3:11 AM? 3:17 PM How many minutes are there between 9:06 PM and 5:33 AM? 507 What is 680 minutes before 4:10 AM? 4:50 PM What is 89 minutes after 5:29 AM? 6:58 AM How many minutes are there between 7:38 PM and 4:22 AM? 524 How many minutes are there between 10:57 AM and 11:56 AM? 59 How many minutes are there between 11:48 PM and 6:02 AM? 374 What is 254 minutes after 12:29 PM? 4:43 PM What is 576 minutes before 4:49 AM? 7:13 PM How many minutes are there between 4:07 AM and 8:20 AM? 253 What is 669 minutes after 8:37 PM? 7:46 AM How many minutes are there between 12:06 PM and 11:37 PM? 691 How many minutes are there between 5:27 AM and 4:56 PM? 689 How many minutes are there between 10:51 PM and 3:53 AM? 302 What is 572 minutes after 1:30 PM? 11:02 PM What is 678 minutes before 11:33 PM? 12:15 PM How many minutes are there between 4:36 AM and 8:56 AM? 260 How many minutes are there between 4:47 PM and 11:21 PM? 394 How many minutes are there between 4:21 AM and 3:00 PM? 639 What is 647 minutes after 12:10 PM? 10:57 PM What is 607 minutes after 9:47 AM? 7:54 PM How many minutes are there between 9:51 AM and 2:03 PM? 252 How many minutes are there between 4:17 AM and 11:07 AM? 410 How many minutes are there between 9:19 AM and 6:36 PM? 557 How many minutes are there between 4:57 PM and 3:36 AM? 639 What is 191 minutes before 8:47 PM? 5:36 PM How many minutes are there between 11:59 PM and 4:11 AM? 252 How many minutes are there between 10:18 PM and 9:15 AM? 657 How many minutes are there between 11:55 PM and 7:05 AM? 430 What is 468 minutes before 8:21 PM? 12:33 PM How many minutes are there between 9:34 PM and 11:42 PM? 128 How many minutes are there between 11:19 PM and 10:39 AM? 680 What is 328 minutes before 6:24 AM? 12:56 AM What is 77 minutes before 8:53 PM? 7:36 PM How many minutes are there between 6:52 AM and 4:44 PM? 592 What is 504 minutes after 3:08 PM? 11:32 PM How many minutes are there between 11:51 AM and 11:57 AM? 6 How many minutes are there between 1:40 AM and 7:56 AM? 376 What is 337 minutes before 12:48 AM? 7:11 PM How many minutes are there between 7:18 PM and 9:58 PM? 160 What is 295 minutes after 10:32 PM? 3:27 AM How many minutes are there between 9:40 PM and 12:31 AM? 171 What is 89 minutes before 1:15 AM? 11:46 PM How many minutes are there between 4:39 AM and 1:51 PM? 552 How many minutes are there between 9:46 PM and 5:57 AM? 491 How many minutes are there between 2:06 AM and 1:49 PM? 703 What is 556 minutes after 6:20 AM? 3:36 PM How many minutes are there between 10:55 PM and 11:01 PM? 6 What is 428 minutes before 9:53 PM? 2:45 PM What is 101 minutes after 9:10 PM? 10:51 PM How many minutes are there between 2:37 PM and 7:41 PM? 304 What is 141 minutes before 3:47 AM? 1:26 AM What is 387 minutes before 9:57 PM? 3:30 PM How many minutes are there between 9:36 AM and 7:53 PM? 617 How many minutes are there between 11:53 AM and 11:02 PM? 669 What is 661 minutes after 11:47 AM? 10:48 PM What is 473 minutes after 9:35 AM? 5:28 PM How many minutes are there between 5:41 AM and 8:55 AM? 194 How many minutes are there between 10:13 PM and 1:50 AM? 217 How many minutes are there between 1:58 AM and 9:07 AM? 429 How many minutes are there between 4:30 PM and 1:47 AM? 557 How many minutes are there between 10:09 PM and 9:36 AM? 687 What is 578 minutes after 1:26 AM? 11:04 AM How many minutes are there between 10:52 AM and 6:29 PM? 457 How many minutes are there between 12:51 AM and 5:42 AM? 291 How many minutes are there between 10:12 AM and 1:05 PM? 173 What is 135 minutes before 12:18 AM? 10:03 PM What is 236 minutes after 12:22 AM? 4:18 AM How many minutes are there between 2:57 AM and 4:54 AM? 117 What is 51 minutes after 6:10 AM? 7:01 AM What is 573 minutes after 7:18 PM? 4:51 AM How many minutes are there between 3:00 PM and 8:31 PM? 331 How many minutes are there between 4:52 AM and 10:33 AM? 341 What is 107 minutes before 4:31 PM? 2:44 PM How many minutes are there between 5:34 PM and 10:08 PM? 274 What is 103 minutes before 11:24 AM? 9:41 AM What is 136 minutes before 1:42 PM? 11:26 AM What is 631 minutes after 1:07 PM? 11:38 PM What is 404 minutes after 11:48 PM? 6:32 AM How many minutes are there between 4:36 PM and 5:27 PM? 51 How many minutes are there between 4:52 AM and 2:12 PM? 560 What is 110 minutes before 11:59 PM? 10:09 PM How many minutes are there between 11:45 PM and 9:17 AM? 572 What is 669 minutes after 6:07 PM? 5:16 AM What is 123 minutes after 2:24 AM? 4:27 AM How many minutes are there between 5:39 AM and 6:39 AM? 60 How many minutes are there between 8:53 PM and 5:06 AM? 493 What is 359 minutes after 8:40 AM? 2:39 PM How many minutes are there between 8:24 AM and 10:34 AM? 130 How many minutes are there between 8:57 PM and 11:33 PM? 156 How many minutes are there between 11:16 AM and 3:28 PM? 252 What is 40 minutes before 8:57 PM? 8:17 PM How many minutes are there between 9:01 PM and 4:09 AM? 428 What is 439 minutes after 3:46 PM? 11:05 PM How many minutes are there between 10:15 PM and 8:06 AM? 591 How many minutes are there between 7:09 AM and 10:01 AM? 172 What is 680 minutes before 2:47 AM? 3:27 PM How many minutes are there between 10:24 AM and 10:04 PM? 700 What is 410 minutes before 8:04 PM? 1:14 PM How many minutes are there between 11:40 AM and 6:34 PM? 414 What is 293 minutes after 11:43 PM? 4:36 AM How many minutes are there between 11:07 AM and 3:13 PM? 246 How many minutes are there between 10:35 AM and 9:27 PM? 652 What is 173 minutes before 9:58 PM? 7:05 PM What is 624 minutes after 2:15 PM? 12:39 AM How many minutes are there between 12:16 PM and 12:11 AM? 715 How many minutes are there between 3:54 AM and 2:55 PM? 661 How many minutes are there between 9:43 AM and 12:21 PM? 158 How many minutes are there between 11:38 PM and 5:06 AM? 328 How many minutes are there between 1:41 PM and 7:47 PM? 366 How many minutes are there between 3:26 AM and 10:04 AM? 398 How many minutes are there between 7:05 AM and 11:29 AM? 264 How many minutes are there between 2:39 PM and 10:31 PM? 472 How many minutes are there between 2:24 AM and 5:16 AM? 172 How many minutes are there between 2:55 PM and 5:41 PM? 166 How many minutes are there between 4:17 PM and 10:55 PM? 398 How many minutes are there between 12:34 AM and 5:00 AM? 266 What is 387 minutes before 6:57 PM? 12:30 PM What is 291 minutes before 3:17 PM? 10:26 AM How many minutes are there between 12:06 AM and 1:34 AM? 88 What is 279 minutes before 10:46 PM? 6:07 PM How many minutes are there between 7:56 AM and 6:26 PM? 630 What is 414 minutes after 12:14 PM? 7:08 PM What is 291 minutes before 11:38 AM? 6:47 AM How many minutes are there between 9:10 PM and 11:45 PM? 155 How many minutes are there between 3:31 AM	{ "pile_set_name": "DM Mathematics" }
1 = 5a, -ux - 4a + 2 = -6. What is the second derivative of -2i + 11ix - 8i + 17i4 - 5i*4 wrt i? 276i*2 Let k(t) be the second derivative of -2947t*5/20 - 1017t*3/2 + 2701t. What is the second derivative of k(a) wrt a? -17682a Let t(g) = g4 - 3g*2 - g - 2. Let x(j) = 5j*4 - 936j*2 - 5j - 3790. Let h(l) = -4t(l) + x(l). What is the second derivative of h(z) wrt z? 12z*2 - 1848 Let g(u) be the third derivative of 35/6u*3 + 0u*6 - 2 + 0u + 1/105u7 + 25u*2 + 0u*5 + 5/24u*4. Find the first derivative of g(r) wrt r. 8r*3 + 5 Let d(t) be the first derivative of 25t*4/4 - 53t*2/2 + 3706t - 3870. Differentiate d(u) with respect to u. 75u2 - 53 Let u be (-74)/(-26) + (-80)/(-520). Find the second derivative of j2 - 64j5 - j2 + uj - 5j - 12 wrt j. -1280j3 Let r(u) be the second derivative of -11u*4 + 419u*3/6 + 905u - 1. Find the second derivative of r(a) wrt a. -264 Suppose 7f - 3f + 48 = 0. Let c = f - -18. What is the second derivative of y - cy4 + 7y*4 + 18y + 3y wrt y? 12y*2 Let b(y) be the third derivative of -1813y*6/120 - 953y*5/60 + 6862y*2. Find the third derivative of b(j) wrt j. -10878 What is the third derivative of 2q*2 + 1911q*3 - 28q - 6q2 - 2726q*3 wrt q? -4890 Let n = -191 + 396. What is the second derivative of 3j*5 + 6j*2 + nj*4 - 205j*4 + 28j wrt j? 60j3 + 12 Find the third derivative of 2609y*3 - 1513y*2 + 553y*2 + 3576y*2 wrt y. 15654 Let z be (-5)/30 + (-230)/(-12). Find the third derivative of -25865 - zv*3 - 66v*2 + 25865 wrt v. -114 Let p(m) be the second derivative of -617m*4/6 + 614m*3/3 - 3m - 38. What is the second derivative of p(s) wrt s? -2468 Let s(v) = -4v + 40. Let u be s(10). Suppose -c = 2b - ub - 25, 4c = 5b - 56. What is the second derivative of 7j*5 - bj*5 - 16j + 4j5 wrt j? -20j*3 What is the derivative of -11 + 2331 - 679p - 155p - 57 wrt p? -834 Let r(f) be the second derivative of 442f7/21 + f4/12 + 13f3/2 + 604f. What is the third derivative of r(x) wrt x? 53040x2 Let d(c) be the third derivative of -18c*8/7 - 3155c*4/24 - 997c*2 - 2. Find the second derivative of d(p) wrt p. -17280p*3 Let l = 67067/6 + -11177. Let f(t) be the second derivative of -lt*4 + 0t*2 + 0t*3 + 0 - 31/20t*5 + 36t. What is the third derivative of f(i) wrt i? -186 Let b(n) be the third derivative of -n*6/4 - 17n*5/15 + 5569n*3/6 + 5n*2 + 361. What is the first derivative of b(k) wrt k? -90k*2 - 136k Let r(q) = 3599q2 + 1249q - 2. Let m(x) = -10793x2 - 3746x + 7. Let n(o) = 2m(o) + 7r(o). Find the second derivative of n(t) wrt t. 7214 Find the second derivative of 418r + 48r + 161r - 17r + 258r + 1637r*3 wrt r. 9822r Find the third derivative of 288c3 - 781c*3 + 1509c*2 - 243c*2 wrt c. -2958 Let d(s) be the first derivative of -71 + 1/2s*4 - 2s + 32/3s3 - 1/2s*2. What is the second derivative of d(f) wrt f? 12f + 64 Let d(q) be the first derivative of 8q5/5 - 187q*4/4 + 3707q*2/2 - 197. Find the second derivative of d(m) wrt m. 96m*2 - 1122m What is the third derivative of -53s3 + 46s*3 + 5035s*2 + 35s*4 + 4s*4 + 114s*2 + 47s*4 wrt s? 2064s - 42 Let z(a) be the second derivative of -1/20a5 + 0a*4 + 51a - 69/2a2 + 0 - 13/3a*3. What is the first derivative of z(o) wrt o? -3o*2 - 26 What is the third derivative of -1 + 1 - 95d*2 - 722d*2 + 0 - 147d*4 wrt d? -3528d Let d(h) be the third derivative of 31h2 + 0h*6 + 0h - 31/6h3 + 0 + 0h*4 + 0h*5 - 29/210h*7. Differentiate d(y) wrt y. -116y*3 Suppose -7a = 40 - 54. Let z = -6 + 12. What is the third derivative of 19pa - 8p*z - 5p*6 - 32p*2 wrt p? -1560p*3 Suppose 2f + 8f - 360 = 0. Let n be (22/(-3))/((-24)/f). Differentiate n + 9 - 25 - 2s*4 with respect to s. -8s*3 Let d(h) be the third derivative of -4/105h*7 - 16h*2 + 0h*5 + 0 - 1/120h*6 - 1/6h*3 - 2h + 5/24h4. What is the second derivative of d(s) wrt s? -96s*2 - 6s Let s be (3/6)/(1/(-2)). Let i(y) = 3y2 + 3y + 2. Let o be i(s). What is the third derivative of -10zo + 7z*5 + 15z*2 - 8z*2 wrt z? 420z*2 Let c be (-2)/14 - 50/(-7). Suppose ch - 40 = 2h. What is the second derivative of 23y - hy - y2 - 4y + 5y2 wrt y? 8 Let g = -31 + 36. Find the second derivative of 11d*g - 137d - 136d + 276d wrt d. 220d3 Let q(u) be the first derivative of 276u*7 + 649u*3 - 188. Find the third derivative of q(s) wrt s. 231840s*3 Let u(v) = -2v*2 - 536v - 6832. Let a(z) = z*3 - 5z*2 - 1071z - 13667. Let n(q) = -2a(q) + 5u(q). What is the derivative of n(c) wrt c? -6c2 - 538 What is the second derivative of 343j*3 + 927j*3 - 1087 + 311j*3 + j + 1724j*3 wrt j? 19830j Suppose 0 = 5l - 4i - 56 + 6, 0 = -3i - 15. Let w(j) = -j3 + 5j*2 + 8j + 12. Let y be w(l). Differentiate 18f - 18f - yf4 + 10 wrt f. -96f*3 Differentiate 3v*4 + 2v*2 + 48v*3 + 1979 - 3581 + 1364 + 1284 + 704 wrt v. 12v*3 + 144v*2 + 4v Let f be -4 - (-11)/(11/42). Differentiate 2y - f + 14y*4 - 37y*4 - 28 with respect to y. -92y*3 + 2 Let y(f) = 2. Let b(l) = -128l*3 + 3l - 603. Let w(u) = b(u) - 5y(u). Differentiate w(z) wrt z. -384z*2 + 3 Let y(t) = -10t - 102. Let b be y(-13). Find the second derivative of -35w2 - 94w + bw + 138w*2 - 57w wrt w. 206 Let a(s) = s*2 + 2s - 3. Let k(w) = 112w4 - 8w*2 - 3655w + 12. Let t(d) = -4a(d) - k(d). What is the second derivative of t(i) wrt i? -1344i*2 + 8 Let z be -5(-1 - (-33)/(-5)). Let f = z - 16. What is the second derivative of 3k2 - fk + k2 + k2 - 11k2 wrt k? -12 Let x = 164 + -126. Differentiate 132p + 2p3 - 137p - 3p3 + 3p*3 + x wrt p. 6p*2 - 5 Suppose i + 2l - 80 = 4i, 24 = -i + 2l. Let b be (-78)/(-14) + 16/i. What is the third derivative of r*b + 15r*2 + 12r*2 - 16r6 - r5 wrt r? -1920r3 Let l(z) = -451z*3 - 7z*2 - 9z - 59. Let j(y) = -447y3 - 8y*2 - 9y - 60. Let i(n) = 6j(n) - 7l(n). Find the second derivative of i(d) wrt d. 2850d + 2 Let q be (-9)/21 - (-19458)/126. What is the derivative of 292 - 183 - 253 - qr*3 wrt r? -462r*2 Let x(s) = -6s*2 - s + 1. Let d(z) = 919z*2 - 5z - 2278. Let a(q) = -d(q) + 5x(q). What is the first derivative of a(n) wrt n? -1898n Find the first derivative of -535 - 1585 - 1169 - 1266t4 wrt t. -5064t*3 Let h(d) = -875d - 420. Let n = 29 + -26. Let i(s) = -73s - 35. Let w(a) = nh(a) - 35i(a). Differentiate w(o) wrt o. -70 Let m(c) be the second derivative of -438c*6/5 - 2571c*2/2 + 3296c. What is the first derivative of m(j) wrt j? -10512j3 Find the third derivative of 445z*3 + 641z*3 - 2285 - 69z*3 + 2285 + 4z*2 + 24z wrt z. 6102 Find the third derivative of -15287i2 - 16145i*2 + 29627i*2 + 3901i*3 wrt i. 23406 Let j(n) be the third derivative of 0n*3 + 169/120n*6 - 1/30n*5 + 0 + 2n*2 - 8n + 0n4. What is the third derivative of j(y) wrt y? 1014 Let w(u) be the second derivative of 377u*8/28 - 589u*4/12 + 2u + 51. Find the third derivative of w(v) wrt v. 90480v3 Let t(j) = -j3 + 8j*2 - 2j + 8. Let a be t(8). Let i = 24 + a. What is the first derivative of 19o2 - io + 16o - 5o*2 + 2 wrt o? 28o Let y(r) be the second derivative of -5r4 - 91/2r*2 + 0r*3 + 0 - 174r. What is the first derivative of y(x) wrt x? -120x Let c(l) be the second derivative of -97l8/56 - l7/21 + 11l5/20 - l4/12 + 2827l*3/6 + 96l + 13. Find the third derivative of c(j) wrt j. -11640j3 - 120j*2 + 66 Suppose 5y - 14 = 6. Suppose 396p - 376p = 140. What is the third derivative of -337k3 + 9k*y + 337k*3 + pk*2 - 28k*2 wrt k? 216k What is the second derivative of 8z5 - 6z*3 + 5638z + 141z2 - 142z*2 + 6362z - 3730z + z5 wrt z? 180z*3 - 36z - 2 Let s(w) be the first derivative of 1171w4/2 + 997w*3/3 + 1796. What is the third derivative of s(y) wrt y? 14052 What is the third derivative of -39l*3 + 6565l*4 + 39l*3 - 12456l*4 - 5073l*2 wrt l? -141384l Let b be 2/7 + 24/14. Let k be 280/(-72) + 8 - 1/9. What is the t	{ "pile_set_name": "DM Mathematics" }
d 11322? 222 Calculate the highest common divisor of 2419 and 348867. 59 What is the greatest common factor of 30 and 9450? 30 What is the highest common factor of 13 and 297804? 13 Calculate the highest common factor of 13343 and 11. 11 Calculate the highest common factor of 27731 and 10835. 11 What is the greatest common divisor of 159 and 1393582? 53 What is the greatest common factor of 90 and 107883? 9 What is the greatest common divisor of 68784 and 48? 48 Calculate the greatest common factor of 32 and 5308. 4 What is the highest common divisor of 588 and 296184? 84 What is the greatest common factor of 70974 and 117? 9 Calculate the greatest common divisor of 80400 and 21600. 1200 Calculate the highest common divisor of 4182 and 8262. 102 What is the greatest common divisor of 7379 and 37523? 157 Calculate the highest common divisor of 490517 and 3493. 499 What is the highest common divisor of 62 and 22909? 31 What is the greatest common factor of 285936 and 56? 56 Calculate the greatest common factor of 514524 and 6996. 636 What is the highest common factor of 1220 and 221880? 20 Calculate the greatest common factor of 526 and 6418778. 526 Calculate the greatest common divisor of 20440 and 3745. 35 Calculate the greatest common factor of 45629 and 1751. 103 Calculate the highest common factor of 867 and 13. 1 Calculate the highest common factor of 285581 and 22555. 347 Calculate the highest common factor of 80995 and 7760. 485 What is the greatest common factor of 4 and 67316? 4 What is the greatest common divisor of 54306 and 252? 126 Calculate the highest common divisor of 5313 and 1061841. 759 What is the greatest common factor of 3869502 and 2964? 1482 What is the greatest common divisor of 414 and 3590415? 207 Calculate the greatest common divisor of 164709 and 9. 9 Calculate the greatest common divisor of 837902 and 10582. 962 Calculate the highest common factor of 64 and 61. 1 What is the highest common divisor of 190 and 90782? 38 Calculate the greatest common divisor of 13310 and 170. 10 Calculate the greatest common divisor of 6168 and 8328. 24 What is the highest common factor of 45 and 822? 3 Calculate the highest common divisor of 1620 and 9450. 270 Calculate the greatest common divisor of 144 and 6852. 12 What is the highest common divisor of 165 and 2420? 55 What is the highest common divisor of 5 and 107370? 5 What is the highest common factor of 1309 and 6188? 119 Calculate the highest common factor of 42 and 399. 21 What is the greatest common factor of 16 and 210572? 4 Calculate the highest common factor of 1176 and 5496. 24 What is the greatest common divisor of 896120 and 20? 20 Calculate the highest common factor of 690376 and 16. 8 Calculate the highest common divisor of 2040 and 330. 30 What is the greatest common divisor of 27 and 81369? 9 What is the greatest common divisor of 8836 and 129203? 47 Calculate the highest common factor of 60957 and 4329. 117 Calculate the greatest common divisor of 29137 and 28. 1 What is the greatest common factor of 183668 and 481? 37 Calculate the highest common divisor of 135 and 15285. 15 Calculate the highest common factor of 882 and 2548. 98 Calculate the greatest common divisor of 456548 and 4404. 1468 Calculate the highest common factor of 8783 and 2. 1 Calculate the highest common divisor of 3233 and 583. 53 Calculate the greatest common factor of 51564 and 24. 12 Calculate the greatest common divisor of 23058 and 244. 122 What is the highest common factor of 516 and 494586? 258 Calculate the highest common divisor of 98672 and 238. 14 Calculate the greatest common factor of 344592 and 2016. 144 What is the greatest common divisor of 60732 and 56? 28 What is the greatest common divisor of 6 and 56412? 6 What is the highest common factor of 135313 and 141? 47 Calculate the highest common factor of 375 and 4948050. 75 What is the greatest common factor of 111372 and 48? 12 Calculate the highest common divisor of 20456187 and 93. 93 Calculate the greatest common divisor of 3667 and 3743. 19 What is the greatest common divisor of 32 and 18621408? 32 What is the greatest common factor of 3590 and 3665? 5 Calculate the greatest common factor of 88 and 1969. 11 Calculate the greatest common divisor of 139 and 139834. 139 What is the highest common divisor of 1494 and 136618? 166 What is the highest common factor of 2506 and 25074? 14 Calculate the highest common divisor of 534252 and 36. 12 What is the highest common divisor of 666 and 135420? 222 What is the greatest common divisor of 772 and 351839? 193 Calculate the highest common factor of 37012 and 532. 76 Calculate the greatest common divisor of 31453 and 7531. 443 What is the greatest common divisor of 12 and 93820? 4 Calculate the highest common factor of 17 and 2997372. 17 Calculate the greatest common divisor of 190014 and 165. 33 Calculate the greatest common divisor of 47790 and 5040. 90 Calculate the greatest common factor of 2000425 and 575. 575 Calculate the greatest common factor of 3608 and 9416. 88 What is the greatest common divisor of 18894 and 1608? 402 What is the greatest common factor of 36905 and 44? 11 What is the greatest common divisor of 48867 and 4833? 537 Calculate the greatest common divisor of 117515 and 5795. 95 What is the highest common factor of 8 and 681576? 8 Calculate the highest common factor of 92818 and 44. 22 What is the greatest common divisor of 2158 and 10458? 166 Calculate the highest common factor of 7404 and 1400590. 1234 Calculate the greatest common factor of 590007 and 1254. 627 Calculate the greatest common divisor of 421554 and 210. 42 What is the highest common divisor of 19251 and 54? 27 Calculate the greatest common divisor of 102618 and 36. 18 What is the highest common divisor of 1938 and 9180? 102 What is the greatest common factor of 95256 and 90? 18 What is the greatest common divisor of 6390 and 468387? 639 What is the greatest common factor of 384 and 17664? 384 What is the greatest common factor of 340673 and 202? 101 Calculate the highest common divisor of 26522 and 596. 298 Calculate the highest common divisor of 1740 and 513242. 58 Calculate the highest common divisor of 732028 and 2096. 524 Calculate the highest common factor of 274035 and 15. 15 Calculate the highest common divisor of 11674 and 2743. 13 Calculate the highest common divisor of 817 and 23865. 43 Calculate the greatest common divisor of 242 and 2981. 11 Calculate the highest common divisor of 109622 and 6. 2 Calculate the highest common factor of 130 and 29263. 13 What is the highest common divisor of 2552 and 7424? 232 What is the greatest common factor of 1812118 and 490? 98 Calculate the highest common factor of 418247 and 19. 19 Calculate the greatest common divisor of 56109 and 1585. 317 What is the highest common divisor of 2816 and 242? 22 Calculate the highest common factor of 192 and 67. 1 Calculate the highest common divisor of 60 and 14655. 15 What is the greatest common factor of 311984 and 185? 37 What is the highest common factor of 17888 and 180128? 416 Calculate the highest common divisor of 64 and 124456. 8 What is the highest common factor of 374805 and 90? 45 What is the greatest common factor of 2950 and 22184? 118 Calculate the highest common factor of 34 and 1146. 2 Calculate the greatest common divisor of 10164 and 1518. 66 Calculate the greatest common factor of 290 and 2528510. 290 What is the highest common factor of 3208099 and 2305? 461 What is the highest common factor of 412595 and 20? 5 What is the greatest common factor of 44 and 10252? 44 Calculate the highest common divisor of 201936 and 6048. 336 What is the highest common divisor of 182 and 146237? 91 What is the greatest common factor of 9869 and 923? 71 What is the greatest common factor of 2596945 and 195? 65 Calculate the greatest common divisor of 6588054 and 4455. 891 What is the highest common factor of 330 and 205? 5 Calculate the greatest common factor of 132 and 17028. 132 What is the highest common factor of 128 and 1526? 2 Calculate the highest common divisor of 4352 and 62. 2 Calculate the greatest common divisor of 814 and 43758. 22 Calculate the highest common factor of 1166 and 17702. 106	{ "pile_set_name": "DM Mathematics" }
om {f: 1, w: 3, i: 1, d: 1, c: 1}. Give prob of picking 2 c and 1 f. 0 Three letters picked without replacement from {u: 3, v: 2, y: 7}. What is prob of picking 2 y and 1 v? 21/110 Three letters picked without replacement from kkkktkuiitikeii. What is prob of picking 1 i, 1 u, and 1 k? 6/91 Three letters picked without replacement from juuuju. What is prob of picking 2 j and 1 u? 1/5 Three letters picked without replacement from {z: 3, i: 6, c: 1, n: 2, f: 4}. What is prob of picking 1 f, 1 i, and 1 c? 3/70 Four letters picked without replacement from pbbpbbbxxbpbxpbb. Give prob of picking 1 p, 1 b, and 2 x. 27/455 Four letters picked without replacement from {r: 5, e: 4, l: 8}. What is prob of picking 1 l and 3 r? 4/119 Calculate prob of picking 2 e when two letters picked without replacement from {j: 16, e: 4}. 3/95 What is prob of picking 4 g when four letters picked without replacement from xxgggggggg? 1/3 Three letters picked without replacement from {p: 2, m: 7, c: 1}. What is prob of picking 2 m and 1 c? 7/40 Calculate prob of picking 2 o when two letters picked without replacement from oafaaffoaafaoaoaf. 3/68 Three letters picked without replacement from dteteyittttetvet. What is prob of picking 1 v, 1 y, and 1 t? 1/70 Calculate prob of picking 3 f when three letters picked without replacement from {u: 1, j: 1, f: 7}. 5/12 Calculate prob of picking 1 h and 2 v when three letters picked without replacement from jjhvv. 1/10 Three letters picked without replacement from {r: 1, f: 2, c: 6, n: 3, e: 3}. Give prob of picking 1 c, 1 r, and 1 n. 18/455 Calculate prob of picking 1 w, 1 s, and 1 p when three letters picked without replacement from {w: 2, e: 4, t: 3, p: 1, s: 6, m: 3}. 4/323 Two letters picked without replacement from bxeenegxxlg. Give prob of picking 1 l and 1 b. 1/55 What is prob of picking 2 c and 2 s when four letters picked without replacement from {c: 11, s: 5, y: 1}? 55/238 Calculate prob of picking 1 i and 1 a when two letters picked without replacement from mdari. 1/10 Two letters picked without replacement from {z: 1, x: 1, o: 1, u: 2, i: 1, n: 1}. Give prob of picking 1 u and 1 n. 2/21 Three letters picked without replacement from iciiiciwww. What is prob of picking 1 w and 2 c? 1/40 Four letters picked without replacement from {d: 7, i: 9}. What is prob of picking 2 d and 2 i? 27/65 Four letters picked without replacement from ssssyyzwsyss. Give prob of picking 4 s. 7/99 Two letters picked without replacement from {k: 5, u: 2, t: 2, d: 3, y: 6}. What is prob of picking 1 d and 1 t? 2/51 Two letters picked without replacement from vddggddvvdg. Give prob of picking 2 v. 3/55 Calculate prob of picking 1 p and 2 n when three letters picked without replacement from pnnpnnpnnn. 21/40 Four letters picked without replacement from {d: 1, g: 6, s: 10}. What is prob of picking 3 g and 1 d? 1/119 Two letters picked without replacement from fffaffaffaafffffaa. What is prob of picking 1 f and 1 a? 8/17 Calculate prob of picking 1 x and 1 y when two letters picked without replacement from {p: 6, y: 4, f: 1, x: 4}. 16/105 Calculate prob of picking 2 x and 1 c when three letters picked without replacement from {x: 7, c: 2}. 1/2 Calculate prob of picking 1 d and 1 l when two letters picked without replacement from {d: 2, e: 4, j: 1, g: 1, l: 1}. 1/18 What is prob of picking 2 w when two letters picked without replacement from {w: 4}? 1 Four letters picked without replacement from grfrfrrrfrfrrrrffr. Give prob of picking 4 f. 1/204 Two letters picked without replacement from foooffffooof. Give prob of picking 2 o. 5/22 Calculate prob of picking 4 y when four letters picked without replacement from ydyyyyyyydyydydyyyyy. 364/969 What is prob of picking 2 r when two letters picked without replacement from {t: 2, h: 1, r: 4}? 2/7 Calculate prob of picking 1 a and 1 w when two letters picked without replacement from wzzawnszzzwsaswww. 3/34 Calculate prob of picking 3 t when three letters picked without replacement from ttttttttt. 1 Calculate prob of picking 1 m and 1 q when two letters picked without replacement from mqqqqmzrhqzrzhm. 1/7 Two letters picked without replacement from {m: 2, s: 1, w: 1, t: 1, q: 1, g: 1}. What is prob of picking 1 w and 1 t? 1/21 Calculate prob of picking 1 j, 1 p, and 1 v when three letters picked without replacement from vvjvvagvavvpvvavvp. 11/408 Two letters picked without replacement from pkbjppkbtjwp. Give prob of picking 1 b and 1 w. 1/33 What is prob of picking 1 s and 1 z when two letters picked without replacement from {y: 5, o: 2, s: 3, z: 3, g: 2}? 3/35 Four letters picked without replacement from {z: 2, x: 2, h: 9, b: 2, r: 5}. Give prob of picking 2 h and 2 x. 12/1615 Three letters picked without replacement from hhrhhhrrhrrhrr. What is prob of picking 3 r? 5/52 Calculate prob of picking 1 q, 1 w, and 2 l when four letters picked without replacement from {w: 1, l: 1, q: 2, x: 1, a: 1, i: 1}. 0 Two letters picked without replacement from {g: 4, r: 3}. Give prob of picking 2 g. 2/7 Calculate prob of picking 1 g and 2 z when three letters picked without replacement from {i: 7, y: 2, c: 1, z: 4, g: 4}. 1/34 What is prob of picking 1 y and 2 j when three letters picked without replacement from jyiiyjyyjjj? 8/33 Four letters picked without replacement from {p: 2, g: 1, t: 2, z: 7, q: 4, e: 4}. What is prob of picking 2 e and 2 q? 12/1615 Calculate prob of picking 2 u when two letters picked without replacement from tuutu. 3/10 Two letters picked without replacement from {u: 1, f: 1, v: 4, d: 2, j: 1}. Give prob of picking 1 f and 1 d. 1/18 Calculate prob of picking 4 u when four letters picked without replacement from uuuuupupppuupuuu. 33/182 What is prob of picking 1 n and 1 s when two letters picked without replacement from {n: 3, i: 1, v: 3, k: 1, c: 3, s: 2}? 1/13 What is prob of picking 3 r when three letters picked without replacement from {j: 2, r: 7, q: 3}? 7/44 What is prob of picking 2 k, 1 t, and 1 a when four letters picked without replacement from kkaktotkkkktkkakt? 18/119 Two letters picked without replacement from xououoouxoxouxoo. Give prob of picking 1 x and 1 u. 2/15 Four letters picked without replacement from {m: 7, x: 4}. What is prob of picking 3 x and 1 m? 14/165 What is prob of picking 1 s and 1 u when two letters picked without replacement from {u: 5, s: 4, o: 5}? 20/91 What is prob of picking 2 w and 1 m when three letters picked without replacement from wmmmwwmmwmwwmmmw? 27/80 Two letters picked without replacement from {o: 2, u: 1, z: 1, g: 2, c: 1, n: 1}. Give prob of picking 1 n and 1 u. 1/28 Calculate prob of picking 1 u, 1 c, and 1 t when three letters picked without replacement from {c: 2, u: 1, t: 1, z: 2, x: 1}. 2/35 Four letters picked without replacement from vaarannnnra. What is prob of picking 2 a and 2 r? 1/55 Two letters picked without replacement from yplpllnnnn. What is prob of picking 2 l? 1/15 Three letters picked without replacement from {y: 1, m: 2, h: 6, x: 5, z: 2}. Give prob of picking 1 h, 1 x, and 1 m. 3/28 Four letters picked without replacement from zithige. Give prob of picking 1 e, 1 g, and 2 i. 1/35 Three letters picked without replacement from hmarmjarrmhhmhhhaash. What is prob of picking 2 h and 1 j? 7/380 Three letters picked without replacement from {x: 5, e: 3, q: 6, g: 2, u: 1}. Give prob of picking 3 e. 1/680 Calculate prob of picking 1 c and 2 d when three letters picked without replacement from {c: 2, r: 11, d: 7}. 7/190 Calculate prob of picking 1 z and 1 m when two letters picked without replacement from mhhmhhhmmlzmmmmhm. 9/136 What is prob of picking 3 p and 1 w when four letters picked without replacement from {c: 2, j: 3, f: 1, p: 4, w: 2}? 8/495 Four letters picked without replacement from {v: 1, o: 11, h: 8}. What is prob of picking 2 h, 1 v, and 1 o? 308/4845 Calculate prob of picking 1 d and 1 b when two letters picked without replacement from gbd. 1/3 Calculate prob of picking 1 i, 2 g, and 1 a when four letters picked without replacement from tyybaiyggiyyig. 9/1001 Calculate prob of picking 1 q, 2 z, and 1 o when four letters picked without replacement from zssssasazsqdoszsszaa. 2/1615 What is prob of picking 3 q when three	{ "pile_set_name": "DM Mathematics" }
? -901540 What comes next: -1164, -2337, -3512, -4689, -5868, -7049, -8232? -9417 What is the next term in 15381, 15382, 15391, 15414, 15457? 15526 What is next in -110, -270, -498, -812, -1230, -1770? -2450 What comes next: 567, 590, 635, 708, 815, 962, 1155, 1400? 1703 What comes next: 106, -76, -378, -800, -1342, -2004? -2786 What is the next term in -998, -4599, -10600, -19001, -29802, -43003, -58604? -76605 What is the next term in -388, -782, -1146, -1480, -1784, -2058, -2302? -2516 What is the next term in -127, -115, -103, -97, -103, -127? -175 What is next in -203192, -203211, -203266, -203375, -203556, -203827, -204206, -204711? -205360 What is the next term in -359901, -359900, -359899, -359898, -359897? -359896 What is the next term in -6, -71, -200, -399, -674? -1031 What is the next term in -4338, -7972, -11606, -15240? -18874 What is the next term in -7447, -14829, -22221, -29629, -37059, -44517, -52009? -59541 What is the next term in 11448, 11430, 11400, 11358? 11304 What is next in -10823, -10813, -10803? -10793 What comes next: -1342, -1335, -1328, -1321? -1314 What is the next term in -252, -215, -128, 33, 292, 673? 1200 What is the next term in 3759, 30108, 101625, 240894, 470499? 813024 What comes next: -30471, -60946, -91423, -121902, -152383, -182866? -213351 What is the next term in -112, -366, -1010, -2224, -4188, -7082, -11086? -16380 What comes next: -483831, -967664, -1451499, -1935336, -2419175? -2903016 What is next in -581, -2299, -5163, -9173? -14329 What is next in 482181, 482182, 482183, 482184, 482185? 482186 What comes next: 4649, 4647, 4647, 4649, 4653, 4659? 4667 What is next in 7476, 7446, 7376, 7248, 7044, 6746? 6336 What is the next term in -312, -642, -878, -1014, -1044, -962, -762? -438 What comes next: 210050, 420106, 630164, 840224, 1050286? 1260350 What comes next: 71, 40, 35, 68, 151, 296, 515? 820 What is next in -36, 439, 914, 1389, 1864, 2339? 2814 What is next in 3407, 6872, 10335, 13796, 17255, 20712, 24167? 27620 What is next in 61, 242, 537, 940, 1445, 2046? 2737 What is next in -12725, -25411, -38099, -50789, -63481? -76175 What comes next: -2944264, -2944265, -2944266? -2944267 What is next in -9630, -9631, -9636, -9645, -9658, -9675? -9696 What is next in 1834497, 1834499, 1834503, 1834509, 1834517, 1834527, 1834539? 1834553 What is the next term in 217, 925, 2097, 3727, 5809? 8337 What is the next term in 2364, 2412, 2534, 2766, 3144, 3704, 4482, 5514? 6836 What is next in 273, 1061, 2361, 4173? 6497 What comes next: 627, 610, 603, 612, 643, 702, 795? 928 What is next in -200645, -200640, -200635? -200630 What comes next: -1412, -1405, -1408, -1427, -1468? -1537 What comes next: 382, 783, 1164, 1519, 1842? 2127 What comes next: 132783, 132795, 132807, 132819, 132831? 132843 What comes next: -172, -466, -948, -1618, -2476, -3522, -4756? -6178 What comes next: -28, 152, 308, 428, 500? 512 What is the next term in -85, -281, -603, -1051, -1625? -2325 What is next in -21, -48, -77, -108, -141, -176? -213 What is next in -5592, -5573, -5542, -5499, -5444, -5377, -5298? -5207 What is the next term in -638, -2527, -5676, -10085, -15754? -22683 What comes next: 1713, 1731, 1749, 1767, 1785? 1803 What is next in -33, -79, -137, -207, -289, -383, -489? -607 What is the next term in 3605, 15537, 35415, 63233, 98985? 142665 What is the next term in 582, 1280, 1978, 2676, 3374? 4072 What is next in 9, 3, 1, 3? 9 What is the next term in -6616, -13237, -19864, -26497, -33136? -39781 What is next in -213, -546, -1439, -3174, -6033, -10298? -16251 What is the next term in -1491, -897, -303, 291? 885 What is next in -114, -298, -606, -1038, -1594, -2274? -3078 What is next in -5154, -10328, -15514, -20718, -25946? -31204 What is next in 14739, 14726, 14699, 14652, 14579? 14474 What is next in -1742, -3298, -4854, -6410? -7966 What is the next term in 12, -141, -424, -843, -1404? -2113 What comes next: 3230306, 3230307, 3230308? 3230309 What is next in 717, 1452, 2187, 2922, 3657? 4392 What comes next: 1450, 2893, 4330, 5761, 7186, 8605, 10018? 11425 What is next in -4472, -8792, -13110, -17426, -21740, -26052, -30362? -34670 What is the next term in 393, 531, 915, 1665, 2901? 4743 What is next in -128425, -128434, -128457, -128500, -128569? -128670 What is next in 3089, 3071, 3053, 3035? 3017 What comes next: 3018, 6048, 9094, 12162, 15258, 18388, 21558? 24774 What comes next: -33, -150, -337, -588, -897, -1258? -1665 What comes next: -9, -117, -225, -333? -441 What is the next term in -452372, -452378, -452382, -452384, -452384, -452382, -452378? -452372 What is the next term in -65, -501, -1247, -2309, -3693, -5405? -7451 What is next in -127, -157, 29, 539, 1481, 2963? 5093 What is the next term in -50912, -101895, -152880, -203867? -254856 What is the next term in -38733, -38734, -38735? -38736 What is the next term in 10162, 10169, 10188, 10225, 10286, 10377, 10504? 10673 What is the next term in -4230, -8157, -12084, -16011, -19938? -23865 What is next in -396, -795, -1194, -1593, -1992, -2391? -2790 What is next in -2101, -2254, -2409, -2566, -2725? -2886 What is next in -10399, -20789, -31179? -41569 What is the next term in 96457, 96458, 96451, 96430, 96389, 96322, 96223? 96086 What is next in 47, -102, -251, -400, -549, -698? -847 What comes next: -179, -358, -657, -1076, -1615, -2274, -3053? -3952 What comes next: 184, 247, 434, 811, 1444, 2399, 3742, 5539? 7856 What comes next: 711, 659, 511, 219, -265, -989, -2001, -3349? -5081 What is the next term in 141, 97, 51, 27, 49, 141, 327? 631 What comes next: 224731, 224732, 224733? 224734 What comes next: -1573, -3153, -4737, -6325? -7917 What is the next term in 30, 141, 368, 747, 1314, 2105, 3156? 4503 What comes next: -4482, -4383, -4228, -4017, -3750, -3427? -3048 What is next in 2256, 2985, 3714, 4443, 5172? 5901 What comes next: 982103, 982105, 982109, 982115, 982123, 982133, 982145? 982159 What is next in -1970, -1985, -2026, -2105, -2234, -2425, -2690, -3041? -3490 What is next in -42963, -85927, -128891, -171855, -214819? -257783 What comes next: 67085, 134163, 201239, 268313? 335385 What comes next: 789, 1585, 2381, 3177, 3973? 4769 What comes next: -1579, -3193, -4807? -6421 What is next in -8, -13, -10, 7, 44? 107 What is the next term in -69218, -69196, -69160, -69110, -69046, -68968, -68876? -68770 What comes next: 64, 373, 1152, 2635, 5056, 8649, 13648? 20287 What is next in -49425, -49371, -49231, -48963, -48525, -47875, -46971, -45771? -44233 What is the next term in 8041, 16085, 24129, 32173, 40217? 48261 What is the next term in -1735279, -1735280, -1735281, -1735282? -1735283 What is the next term in 783120, 783119, 783118? 783117 What is next in -457, -693, -927, -1159, -1389, -1617? -1843 What is the next term in 4864, 19406, 43642, 77572? 121196 What is the next term in 88945, 177889, 266833? 355777 What is next in -450, -759, -1068? -1377 What is the next term in -367, -1125, -1883, -2641? -3399 What is the next term in -6291, -12567, -18827, -25071, -31299, -37511? -43707 What comes next: -4169, -8334, -12499? -16664 What is the next term in 4163, 16624, 37385, 66446, 103807, 149468? 203429 What is the next term in -1425, -2770, -4031, -5166, -6133, -6890? -7395 What is the next term in 1076, 1147, 1220, 1295? 1372 What comes next: -23102, -23104, -23098, -23078, -23038? -22972 What is next in -52998, -52999, -53000? -53001 What is next in 0, -76, -202, -378? -604 What is next in 516, 1756, 3824, 6720, 10444, 14996, 20376? 26584 What is next in 76706, 76697, 76676, 76637, 76574, 76481? 76352 What is the next term in 83, -1813, -4979, -9421, -15145, -22157, -30463? -40069 What is next in 766, 294, -494, -1598, -3018, -4754, -6806? -9174 What comes next: 163, 200, 257, 322, 383, 428, 445, 422? 347 What is next in 384, 728, 1050, 1344, 1604, 1824, 1998, 2120? 2184 What comes next: -475, -946, -1425, -1924, -2455, -3030, -3661? -4360 What comes next: 2648, 3374, 4096, 4814? 5528 What comes next: 1157, 994, 829, 662, 493, 322? 149 What is next in 758, 2549, 5376, 9239, 14138, 20073? 27044 What is next in 125396, 250794, 376192, 501590, 626988, 752386? 877784 What comes next: 166393, 166394, 166395, 166396, 166397? 16639	{ "pile_set_name": "DM Mathematics" }
+ lp2 + up and give l. 143 Rearrange (3c - 3c - 2c)(-1 + 1 - 1 + (3 - 1 - 3)(1 + 1 + 0) + 23 - 9 + 24 + 5 - 1 - 3) to the form h + wc and give w. -72 Rearrange -40k2 + 154k*2 - 60k*2 to the form hk*2 + s + wk and give h. 54 Express (5f - 4f - 3f)(-1 + 3 - 4)(-4f + f - f) as k + nf + sf*2 and give s. -16 Express 0w + 33w + 5w as m + tw and give t. 38 Express -5n*2 - 6n*2 - 3n*2 in the form jn + tn2 + g and give t. -14 Express -4i + 2i + 3i + (2 - 1 + 1)(1 - i - 1) + (-5 + 4 - 1)(0i - i + 2i) - 3i - i + 2i as z + vi and give v. -5 Rearrange -2 + 2 + 67n + 32n to the form g + in and give i. 99 Express -20o - 15 + 8o - 3o2 + 11o as io + co*2 + a and give a. -15 Rearrange -1 + 12 - 7 + 6k to the form z + gk and give g. 6 Express -r - 9r - 3r in the form i + xr and give x. -13 Express 10q - 20 - 3q - 4q - 4q in the form uq + b and give b. -20 Express 18z*2 + 20z*2 + 57z*2 in the form az + vz2 + w and give v. 95 Rearrange 27m*2 + 27m*2 + 36m*2 to the form hm*2 + nm + w and give h. 90 Express 12c - 4c - 9c + 64c in the form o + gc and give g. 63 Express ((-1 + 2 - 2)(-5 + 5 - 8w) + (-3w - 4 + 4)(1 + 2 - 4))(-3w2 + 2w*2 + 2w*2) in the form jw + lw2 + yw*3 + z and give y. 11 Express 5c*2 + 2c - 2c + (-2c + 2c + c2)(3 + 0 - 1) + 12c + 6c*2 - 12c as bc + y + ic*2 and give i. 13 Rearrange (3 + 0 - 4)(-4d + 6d - 1 + 2) to the form n + ad and give a. -2 Express -b - 2b - 4b + 41 + 8b in the form f + qb and give f. 41 Rearrange 263b + 2b2 - 261b + 2 + 0 - 2b4 + 2b*3 to ab*4 + z + jb*2 + xb + qb3 and give x. 2 Express (5 + 1 - 5)(3x - 3x - 2x + (-1 + 1 - 2x)(-30 - 4 - 31)) as qx + i and give q. 128 Rearrange -7a3 - 5a*2 + 6a*3 + 0a*2 + 0a*3 to the form j + sa*3 + na + ya2 and give y. -5 Express (11 - g4 - 11)(1 + 0 + 1)(-1 + 1 - 1) in the form zg*4 + kg*2 + yg*3 + mg + d and give d. 0 Rearrange 149z + 2698 - 2698 to iz + w and give i. 149 Rearrange -g + 4g + 2g*2 + 21 - 17 to the form s + xg + zg2 and give s. 4 Express 2 - 2 - 2k4 + k + k4 - k + (3 + 3 - 5)(-5k + 2k4 + 5k) - 32k3 + 9k*4 + 32k*3 as lk*3 + mk*2 + xk + yk4 + p and give l. 0 Express (3f - f + 0f)(0f2 + 2f*2 + 0f*2)(6 - 2 - 1)(-11f + 25f - 9f) in the form if2 + kf + j + zf3 + vf*4 and give v. 60 Rearrange -15s*3 + 7s*3 + 6s*3 - 5s*2 to the form os*2 + rs + gs3 + b and give g. -2 Rearrange (-3s*2 + 496 - 496 + 4s)(-2 + 0s*2 - 2s*2 + 0s*2) to rs*4 + cs*2 + ns*3 + hs + x and give x. 0 Rearrange 7 - 4 - 15 - f to xf + p and give p. -12 Rearrange (-2a*3 + 0a*2 + 0a*2)(-2a + 1 - 1) - 25a*4 - 4a*4 - 6a*4 to ra + xa3 + o + ga*4 + sa*2 and give g. -31 Rearrange 3v*2 + 3 - 2 + 6 - 6 - 4v to fv + i + tv*2 and give i. 1 Rearrange -m + 11m*3 + 3m*3 - 15m*3 - m - 13 to the form jm + fm2 + b + nm*3 and give j. -2 Express -8b*2 - 6b*2 + 10b*2 - 5 in the form db + r + yb2 and give y. -4 Express 3 + 9n + 8n - 3 in the form vn + j and give v. 17 Express -g - 1 + 2g2 + 4 - 28g*3 + 27g*3 - 5g*2 in the form w + kg*3 + jg + tg2 and give k. -1 Express (2c - 2c + 2c*3)(0c + 2c - c) + (0c3 + 2c3 + c3)(c - 5c + 3c) + c4 - c4 + 2c*4 as g + xc*2 + oc*3 + ic*4 + kc and give i. 1 Rearrange 7n2 - 46 - 47 + 92 to the form fn + in2 + w and give f. 0 Rearrange 2c*3 - 7c*3 - 4c3 - c4 + 2 - 2c2 + 0c*2 to jc*2 + nc + mc3 + a + bc*4 and give b. -1 Express (-2d + 4d + 0d)(5 - 2 + 6 - 4 - 2 + 4 - 1 - 2 + 4 + (3 - 4 - 1)(3 - 3 + 1) - 1 + 5 - 2) as w + od and give o. 16 Rearrange (-120k - 35k2 + 120k)(-1 + 2 + 0)(0 + 0 - 1) to the form jk2 + qk + b and give j. 35 Rearrange 2k3 + 3 - k4 + 4 - 6 to mk*3 + wk + tk2 + xk*4 + a and give m. 2 Rearrange -2c3 - 3 + c4 + 2 + 4 - c*2 to the form pc*3 + tc*4 + f + bc*2 + uc and give u. 0 Rearrange 0 - 36y2 + 35y*2 - 4 to the form oy + ty2 + g and give t. -1 Express 62i - 3 - 63i - 7 as k + ri and give k. -10 Rearrange 9k4 - 4k - 7k3 - 5k*4 - 5k*4 + 3k to the form ak2 + sk*4 + g + pk*3 + fk and give f. -1 Rearrange -941u + 941u - u*4 + 4u*3 - 1 + 2u*2 to pu + nu4 + ou*3 + i + du*2 and give d. 2 Express (2 - 3 - 2)(3t2 - 6t2 + t2 + (3 - 3 + t)(-8t + 3t - 3t)) as x + it + mt*2 and give x. 0 Express (1 + z - 1)(4 + 16 + 1)(1 + 1 - 3) as nz + g and give n. -21 Express 16u3 + 2 - 2u*3 - 6u*3 - 2u*3 as hu*2 + d + cu*3 + lu and give l. 0 Express -4n2 - 6 - n3 + 11 - n2 + 2n*2 as on*2 + sn + p + zn3 and give o. -3 Express (-1 + 2 - g - 10g)(2g*3 + 4g*2 - 4g*2) in the form cg + hg3 + yg*4 + sg*2 + b and give y. -22 Rearrange 63 + 3p*2 - 15 - 19 - 24 to the form c + bp + ap2 and give c. 5 Rearrange (2i - 2i + i2)((i + i - i)(2 - i - 2) - 5i*2 + 18i*2 + 14i*2) to bi*2 + ni*4 + qi + ci3 + r and give b. 0 Express 12o*2 + 476o + o*3 - 476o as ko + no*2 + jo3 + x and give n. 12 Express -a + a2 - 5a4 + a3 + 0a + 0a + 2a*4 as wa*3 + na*4 + ta*2 + ya + z and give y. -1 Express 11s4 + 2s2 + s4 + s + 2s3 - 8s*4 in the form cs*4 + ls + ws3 + bs*2 + g and give w. 2 Express (73 + 14t - 73)(-t - 3 + 3) + 3t*2 + 0t2 - t2 in the form zt2 + gt + w and give z. -12 Express ((-1 + z + 1)(-1 - 2 + 2) - z - 2z + 7z)(0z + 0z - 2z) as o + sz + fz2 and give f. -6 Rearrange (-3j - j + 2j)(-j - 3j + 0j) to the form dj2 + vj + m and give d. 8 Rearrange (-1 + 2i + 1)(0 - 3i + 0)(-2i - 2i + 3i) + 0i3 - i3 + 3i3 to m + xi*3 + gi*2 + di and give g. 0 Rearrange -1 - 2 - 2z2 + 4 - z2 to vz + f + iz2 and give f. 1 Express w - 28w*3 - 20w*4 + 0w*4 - 2 + 29w*3 as yw*3 + sw*2 + kw*4 + z + fw and give z. -2 Express 0n4 - 5n*4 + 4n*4 + (-n + 3n - 5n)(2n3 - n3 + 3n*3) as dn*4 + y + kn*3 + hn + rn2 and give k. 0 Express 75d*2 + 3d*4 - 2d + 3d - 73d*2 in the form jd*2 + ld + xd4 + z + sd*3 and give l. 1 Express (-4a - 1 + 1)(-a2 + 5a*2 - 2a*2) in the form ra*3 + ka + na2 + t and give k. 0 Rearrange (-2g - g + 4g)(-19g + 20g - 11g) to the form sg*2 + ag + b and give s. -10 Rearrange 2t - 6t + 3t - 4 - 10 to the form qt + j and give q. -1 Rearrange 2u + 2 - u4 - u2 - 5 + 0 + 1 to iu + ku4 + nu*3 + lu*2 + p and give i. 2 Express 110a - 53a - 91a in the form w + ca and give c. -34 Rearrange 11n + 36 - 62 + 26 to the form qn + r and give q. 11 Express (-3v + 3v + v + (-1 + 0 + 4)(5v - 2v - 4v))(-5v + 2v + 0v)(0 + 2 + 0) as kv + hv*2 + y and give h. 12 Express 7m - 3m - 3m in the form cm + i and give c. 1 Rearrange -4 - 7 - 67w + 11 to v + kw and give v. 0 Rearrange (4 + 0 - 2)(-3h + 2h + 0h) + (-104 + 20 + 43)(0h + 3h - h) to the form vh + z and give v. -84 Rearrange -4x*3 + 2x*3 + 4 - 4 - 2x to bx3 + n + vx*2 + ax and give a. -2 Express -33 + 66 - 34 + 2r as a + lr and give a. -1 Express ((-3y + 3y + y)(-1 + 1 - y) - y2 + 0y + 0y + 14y*2 - 3y*2 - 8y*2)(0 - 1 + 0) as x + ky2 + jy and give k. -1 Rearrange -4h + 21h*2 + 3h + 3h to the form ah + dh2 + g and give a. 2 Rearrange -5x*4 + 3x4 - x4 + (2x2 - 2x*2 - 2x*2)(3x2 + 5x*2 - 2x*2) to vx + j + nx2 + px*4 + ox*3 and give p. -15 Express -7n3 + n2 - 3 + n + n*3 + 3 in the form vn*2 + g + rn + wn3 and give r. 1 Rearrange 0r2 - r2 + 10 - 4 - 3 to wr + b + tr*2 and give t. -1 Rearrange (-3l - 3l + 4l)(-5 + 1 + 0 - 5 + 4 + 0 + (0 - 4 + 3)(2 - 5 + 0)) to al + o and give a. 4 Rearrange -13j - 15 + 15 + 0j to the form ij + y and give i. -13 Rearrange (-5w - w + 4w)(3 + 4 - 5)(2w3 + 4w*3 - 4w*3) to the form j + dw*2 + uw + xw3 + qw*4 and give q. -8 Express (1 - 2 + 0)(-f - 2f + 0f)(-4 + 1 + 7)(-3 + 2 + 3) in the form hf + m and give h. 24 Express -3m*2 + 0m2 + m2 + 4*m	{ "pile_set_name": "DM Mathematics" }
= p - 6, -p + 2c = -11. Let m = -9 + p. Suppose 0i + 2 = -j + 2i, m = 2j - i. What is the units digit of j? 2 What is the units digit of -26174/2442/(-7)? 7 Let v(w) = 80w - 18. Let k be v(2). Let t = -38 + k. What is the units digit of t? 4 Let k = -5 - -5. Let f = k + 5. Suppose -2h = 3v - 34, f - 1 = -2v. What is the tens digit of h? 2 Let z(g) be the third derivative of g6/120 + g5/10 - g3/6 + g2. Let y(n) = -9n - 5. Let q be y(0). What is the units digit of z(q)? 4 Let r = 101 + -83. Suppose 850 = rc - 50. What is the tens digit of c? 5 Suppose -4x + 66 = -x. Let r be x + -5 - 4/2. Suppose r = y - 0y. What is the units digit of y? 5 Let r = 3 + 4. Let x be (-16)/56 + 58/r. Suppose 144 = xs - 4s. What is the tens digit of s? 3 Let o = 23 + -10. Suppose p - 27 - o = 0. Suppose -4u = -p - 36. What is the tens digit of u? 1 Let w(v) = -5v - 3v3 - 6 + 2 - 7. What is the tens digit of w(-3)? 8 Let y(q) = -q3 - 3q*2 - 2q. Let r be y(-2). Let f(w) = -w*2 - w + 33. What is the units digit of f(r)? 3 Suppose 5u - 4j - 14 = 0, -3u + 0j + j = -7. Let v(a) = u - 1 - 7a - 3. What is the units digit of v(-6)? 0 What is the thousands digit of ((-15738)/(-15))/(24/60)? 2 Suppose -72m = -78m + 1356. What is the tens digit of m? 2 Suppose 48a - 43a = 22155. What is the units digit of a? 1 What is the tens digit of 10/12 + (-11693)/(-66) - 0? 7 Let c be (40/4 - 0)/2 + 2. Suppose 3j - 19 + c = 0. What is the units digit of j? 4 Let p(u) = u2 + 14u + 3. Let s be p(-14). Suppose 4z - d - 1030 = -2d, sz + 2d = 775. What is the hundreds digit of z? 2 Let g(m) = 2m2 - 8m + 9. Let p(d) = -d*3 + 7d*2 + 2d - 4. Let c be p(7). Let y = 16 - c. What is the units digit of g(y)? 3 Let f = -644 - -1960. What is the thousands digit of f? 1 Let t = 122 - -291. What is the tens digit of t? 1 Suppose -2x - 8 = 0, 0j - 3x - 87 = -j. Let z be ((-34)/(-3))/(5/j). Let m = z + -95. What is the tens digit of m? 7 Let h be ((-2)/(-4))/(5/30). Suppose 0 = -9s + hs + 6. What is the units digit of s? 1 Suppose 0 = -3t - 2t + 230. Let c(k) = 4k + t - 51 - 10k. What is the units digit of c(-5)? 5 Let c(u) = 3u*2 - 2u. Let t be c(2). Let z(a) = 0a - 6 + 4a - t. What is the tens digit of z(15)? 4 Let t(i) = 4i + 1. Let b(y) = -y + 7. Let c be b(6). Let d be t(c). Suppose -5z = -dx - 65, 3x + 73 = 5z - 0. What is the units digit of z? 7 Let o be 69/21 - 6/21. Suppose -7d = -od + 124. Let p = d - -47. What is the tens digit of p? 1 Let g(q) = 2q*2 - 23q - 12. Let h be g(12). Suppose -w - 2m + 259 = h, 391 = 2w - 2m - 115. What is the hundreds digit of w? 2 Suppose 2a + 4s = s + 3911, 0 = 4a - 2s - 7830. What is the tens digit of a? 5 Let f(z) = -6z + 1. Let b(p) = 12p - 2. Let k(t) = 4b(t) + 7f(t). Let w be (70/25)/(-1 + 49/35). What is the tens digit of k(w)? 4 Let t = 0 + 4. Suppose tf = -375 + 99. Let a = f - -112. What is the tens digit of a? 4 Suppose z - 2a + 4 = -7, 5z = -a. Let r(q) = -5q3 + q. Let f be r(z). Suppose -5m - 13 + 1 = j, 4j + fm = 32. What is the tens digit of j? 1 Let f be ((-1)/2)/((-2)/92). Let t = f - -2. What is the units digit of t? 5 Suppose -18l + 23l = 105. Let y = 24 - l. Suppose 4z + 4n = 3n + 17, 0 = yn + 9. What is the units digit of z? 5 Let c be (1 + 27/(-7))/((-2)/7). Suppose -cq + 320 = -0q. What is the tens digit of q? 3 Suppose -6t + 21 - 3 = 0. Suppose 248 = -to + o. Let y = -84 - o. What is the tens digit of y? 4 Suppose 7 = j - 34. Let n = j + -35. What is the tens digit of (20/n)/((-18)/(-297))? 5 Let b = -1454 + 2588. What is the units digit of b? 4 Suppose 3d = 2t + 211, 5d - 330 = 2t - 3t. What is the units digit of d? 7 Suppose 30014 = 46b - 46208. What is the thousands digit of b? 1 Let l = 146 + -98. Let r = l - 47. What is the units digit of r? 1 Suppose 25m - 5m - 4700 = 0. What is the hundreds digit of m? 2 Let l be (14 - 5)(3 + -22). Let m = 246 + l. What is the tens digit of m? 7 Suppose -5r - 700 = -9r. What is the units digit of r? 5 Suppose 4u - 10 = -u. Suppose -uj = 2j - 8. Suppose 3p - 3c - 34 = p, 3c = -jp + 46. What is the tens digit of p? 2 Suppose g - 7 = -0g + 3m, -4g = -4m + 4. Let a = g - -15. What is the tens digit of a? 1 Suppose 0 = 10a - 1 + 71. Let i(j) = 6j*2 + 13j - 4. Let b(t) = 5t2 + 13t - 3. Let k(c) = -5b(c) + 4i(c). What is the units digit of k(a)? 1 Let h = -4 + 6. Suppose -c = -hc - 9. Let y = c + 25. What is the units digit of y? 6 Let p = 3 - -3. Suppose 16 = -2a + pa. Suppose al = 0, -366 + 111 = -5c + 5l. What is the units digit of c? 1 Let w = 37 - 32. Suppose 4p + t + 12 = -t, 0 = -wt - 10. What is the tens digit of (-51)/p + 4/(-8)? 2 Let d = 13 + -8. Suppose -4t + 96 = -5w, -4t - dw = -4w - 96. What is the units digit of t? 4 Let z be (3/6 + 0)/((-2)/(-36)). Suppose zk = 801 + 1422. What is the hundreds digit of k? 2 Suppose 5i + 4z + 6 = 0, -5i - 3z + 26 = -7z. Suppose a + y = -2y + 69, -3a = iy - 242. What is the units digit of a? 4 Suppose 0 = -3w + 8w - 45. Let i(t) = 5 + 5t + 7t*2 - w + 9. What is the tens digit of i(-2)? 2 Suppose 3w = 2z - 19 - 3, -w + z = 8. Let v be (7 + w)(1 - -2). Suppose -5o = -vo - 18. What is the units digit of o? 9 Let i(a) = -2a + 18. Let m be i(8). Suppose 17 = -3h + 2, 0 = 3v - mh - 43. What is the units digit of v? 1 Suppose 3j - 12 = -0. Suppose -x = -jx + 87. What is the units digit of x? 9 Suppose 5k = 6k - 2. Let a(i) = 13i2 + 5i - 6. What is the units digit of a(k)? 6 Let h = -11 + 8. Let t be -3 + 3 + h + 8. Suppose -4b + 148 = -4c, -4b + 0c = -tc - 152. What is the units digit of b? 3 Suppose 2 = c - 2. Suppose -ci + 123 + 73 = 0. What is the tens digit of i? 4 Suppose 0z - 2z = 174. Let n = 68 + -104. Let x = n - z. What is the units digit of x? 1 Let o(z) be the first derivative of z*4/2 - 2z*3 + 3z*2/2 + 3z + 9. What is the tens digit of o(4)? 4 Let q = -129 + 3954. What is the thousands digit of q? 3 What is the units digit of -9 + 11 + -2 - (-5028 - -1)? 7 What is the hundreds digit of ((-4225)/(-20))/((-5)/(-20))? 8 Let h be (-568 - 2)/(-3) - 4. Let o = h - 117. What is the units digit of o? 9 What is the units digit of (24/(-45)3)/((-14)/665)? 6 Let j(d) = -4d + 15. Let k be j(-8). Suppose -2l + 3y + 49 = 0, -2l + k = -0y - y. What is the units digit of l? 3 Let s be 865 + 3 + -1. What is the units digit of (-1 - (-13)/(-2))s/(-60)? 4 Let n = 481 + 83. What is the units digit of n? 4 Suppose 3r + 2r + 35 = -4m, -2r = m + 11. Let i = -9 + r. Let l(o) = o*3 + 13o*2 + 7o - 15. What is the tens digit of l(i)? 4 Suppose 5o - q + 5q = -18, -2o - 4q = 0. Suppose 2n + 3n = -x + 9, -128 = -4x + 3n. Let p = x + o. What is the units digit of p? 3 Let k be 6186/12 - 3/2 - 1. Suppose 10p - k - 877 = 0. What is the hundreds digit of p? 1 Let q = -5 + 8. Let l = q - 3. Suppose -36 + l = -4b. What is the units digit of b? 9 Suppose 0 = 3s - 1279 - 4196. What is the tens digit of (-1 + (-1)/5)/((-10)/s)? 1 Suppose -4p + 2k - 6k = 4, 2p - 2k - 18 = 0. Suppose -pc + 4y = -28, -3y + 0 = -2c + 10. What is the units digit of c? 1 Let h = 1 - -2. Suppose -hn + n = -44. Suppose -20s + ns = 102. What is the tens digit of s? 5 Suppose -35r = -25r - 19300. What is the tens digit of r? 3 Suppose 2h - o - 31 = 0, -4h - 13 + 78 = -3o. Suppose 13l = hl - 12. What is the tens digit of l? 1 Let z be 6/16 - 17186/(-208). Let y = 115 - z. What is the units digit of y? 2 Let a be -485(-3 - (-2 + (-6)/10)). Suppose -781 = -3m - k - 263, -a = -m + 5k. What is the tens digit of m? 7 Suppose 3q + 3q + 18 = 0. What is the tens digit of -6q/(45/40)? 1 Suppose 0 = -2u + 3i - 57, 84 = -0u - 3u + 5i. Let m be (-2)/1u/6. What is the tens digit of ((-6)/4)/(m/(-308))? 4 Let k = -991 + 1630. What is the tens digit of k? 3 Suppose 9c - 7c + 2 = 0, f + 5c = 135. What is the units digit of f? 0 What is the tens digit of (-210 + -41)(-2 - -1)? 5 Let w = -23 + 29. Suppose -2s - 4a = w, -7s - 3 = -2s + 4a. Suppose 0 = -4r + 43 + s. What is the tens digit of r? 1 Suppose t + r - 127 = 0, t = -4r - 0r + 112. Suppose tv = 135v - 93.	{ "pile_set_name": "DM Mathematics" }
ent from wqqpvwvvpwqwppqi. What is prob of sequence vv? 1/40 Calculate prob of sequence pwww when four letters picked without replacement from kpwrfww. 1/140 Calculate prob of sequence qu when two letters picked without replacement from uuqqqqqqqqqqquq. 6/35 Calculate prob of sequence vb when two letters picked without replacement from {b: 1, p: 1, i: 2, v: 2, w: 1}. 1/21 Calculate prob of sequence betk when four letters picked without replacement from {b: 1, t: 1, e: 1, d: 2, k: 1, s: 2}. 1/1680 Four letters picked without replacement from {j: 1, k: 4, v: 2, s: 7}. Give prob of sequence sjsk. 1/143 Calculate prob of sequence aaa when three letters picked without replacement from aaa. 1 What is prob of sequence zxz when three letters picked without replacement from {z: 2, x: 5}? 1/21 What is prob of sequence ys when two letters picked without replacement from zdayskadayay? 1/44 Calculate prob of sequence ooo when three letters picked without replacement from hohohhhhhhoooooh. 1/16 What is prob of sequence wx when two letters picked without replacement from fxw? 1/6 Three letters picked without replacement from iixiiiiiiiiib. Give prob of sequence bix. 1/156 Calculate prob of sequence ee when two letters picked without replacement from {e: 11, c: 5}. 11/24 Two letters picked without replacement from oejddbojwbjjdw. What is prob of sequence dj? 6/91 Three letters picked without replacement from {v: 1, k: 7, d: 2}. What is prob of sequence kkk? 7/24 Calculate prob of sequence eeev when four letters picked without replacement from eeeevevvvvve. 2/33 Four letters picked without replacement from cpiapiuj. Give prob of sequence uicp. 1/420 What is prob of sequence so when two letters picked without replacement from {s: 1, e: 2, o: 4}? 2/21 What is prob of sequence gc when two letters picked without replacement from ncgssgs? 1/21 What is prob of sequence qc when two letters picked without replacement from qccccqcq? 15/56 Three letters picked without replacement from nddddnynnd. What is prob of sequence ydn? 1/36 Three letters picked without replacement from djwrjrjjllnd. Give prob of sequence nrd. 1/330 Two letters picked without replacement from cnnncncccn. What is prob of sequence cn? 5/18 Calculate prob of sequence ym when two letters picked without replacement from zmmzyzf. 1/21 Two letters picked without replacement from yyyytyytyyyyyt. Give prob of sequence tt. 3/91 Three letters picked without replacement from {c: 1, g: 1, n: 2, l: 4, v: 4, f: 2}. What is prob of sequence vnc? 1/273 Calculate prob of sequence rh when two letters picked without replacement from nnnnnhhnnnrnk. 1/78 Two letters picked without replacement from {m: 13, p: 5}. Give prob of sequence mp. 65/306 Three letters picked without replacement from vkkkv. What is prob of sequence kkv? 1/5 Calculate prob of sequence yyfn when four letters picked without replacement from snnyysfssyy. 1/330 Three letters picked without replacement from {c: 12, k: 7}. Give prob of sequence ckc. 154/969 What is prob of sequence nnb when three letters picked without replacement from nbibbbddnnbbd? 3/143 Calculate prob of sequence zuu when three letters picked without replacement from {z: 7, e: 4, b: 2, u: 5}. 35/1224 What is prob of sequence dfv when three letters picked without replacement from {f: 1, i: 2, b: 2, g: 1, v: 10, d: 3}? 5/969 What is prob of sequence ff when two letters picked without replacement from sffssssssss? 1/55 Four letters picked without replacement from siissiiissis. Give prob of sequence sssi. 2/33 Two letters picked without replacement from oorrorrt. Give prob of sequence to. 3/56 Calculate prob of sequence fm when two letters picked without replacement from fffffmfmfmffmm. 45/182 Two letters picked without replacement from pttafpppf. Give prob of sequence pp. 1/6 What is prob of sequence iqxq when four letters picked without replacement from iiiiqqiiiiiixiiiqiii? 4/4845 Two letters picked without replacement from {p: 7, x: 6}. What is prob of sequence xx? 5/26 Two letters picked without replacement from {x: 1, j: 7}. Give prob of sequence jj. 3/4 Two letters picked without replacement from ccrccccccccccccccc. What is prob of sequence cc? 8/9 Four letters picked without replacement from {f: 4, x: 3, w: 6}. What is prob of sequence xfxw? 6/715 What is prob of sequence ckk when three letters picked without replacement from {c: 3, k: 5}? 5/28 Calculate prob of sequence aaj when three letters picked without replacement from ayawwjyyjwyydy. 1/546 Three letters picked without replacement from {v: 2, l: 6, k: 4}. Give prob of sequence llv. 1/22 Calculate prob of sequence ii when two letters picked without replacement from vivvivvssvvvsvvsvvxi. 3/190 Four letters picked without replacement from {a: 3, s: 2, x: 3}. Give prob of sequence aaxx. 3/140 Calculate prob of sequence jjd when three letters picked without replacement from wjwwwjjddwjwd. 3/143 Three letters picked without replacement from vhssvvssvvhvs. Give prob of sequence vsh. 5/143 Calculate prob of sequence ffj when three letters picked without replacement from {j: 1, k: 3, f: 2, e: 13}. 1/2907 What is prob of sequence gwag when four letters picked without replacement from {c: 1, w: 2, h: 6, g: 2, a: 1}? 1/2970 Four letters picked without replacement from puqpupqqtqqu. What is prob of sequence tppq? 1/396 Two letters picked without replacement from xxuxvxxxxupppxxp. Give prob of sequence xu. 3/40 Calculate prob of sequence lq when two letters picked without replacement from {q: 2, l: 7}. 7/36 What is prob of sequence zzzk when four letters picked without replacement from zzzzzkzzkzz? 7/55 Three letters picked without replacement from vtlyvug. Give prob of sequence uvg. 1/105 Two letters picked without replacement from {e: 3, m: 3, q: 1}. Give prob of sequence ee. 1/7 Four letters picked without replacement from {e: 1, o: 2, d: 2, v: 2, w: 4, b: 1}. What is prob of sequence vwoe? 2/1485 What is prob of sequence xh when two letters picked without replacement from {h: 1, x: 3, r: 1}? 3/20 Two letters picked without replacement from {o: 6, j: 2}. What is prob of sequence oo? 15/28 What is prob of sequence xxxx when four letters picked without replacement from {r: 2, x: 5}? 1/7 Two letters picked without replacement from {h: 3, p: 3}. Give prob of sequence hp. 3/10 Calculate prob of sequence rf when two letters picked without replacement from grf. 1/6 What is prob of sequence cd when two letters picked without replacement from {d: 6, c: 4, r: 3}? 2/13 Two letters picked without replacement from {s: 3, l: 4}. What is prob of sequence sl? 2/7 Calculate prob of sequence tts when three letters picked without replacement from ftafdsttaf. 1/120 Four letters picked without replacement from ggogofoggvgg. What is prob of sequence oovg? 7/1980 Four letters picked without replacement from yxyxyjryymxyvyry. Give prob of sequence rjmr. 1/21840 Three letters picked without replacement from mmnmznzdnmzmmnnz. Give prob of sequence nzn. 1/42 Calculate prob of sequence vllv when four letters picked without replacement from llvlvlvvlvlvvvlllv. 6/85 Two letters picked without replacement from rsninni. What is prob of sequence nn? 1/7 Three letters picked without replacement from qkkqqqkkkqkk. Give prob of sequence qkq. 7/66 Calculate prob of sequence amfl when four letters picked without replacement from {f: 4, m: 7, l: 1, a: 2, g: 3}. 1/1020 Calculate prob of sequence bfq when three letters picked without replacement from bpfqqccbqb. 1/80 Three letters picked without replacement from {e: 5, g: 2, d: 1, c: 6, h: 2}. Give prob of sequence cce. 5/112 What is prob of sequence lmqs when four letters picked without replacement from {s: 3, g: 2, m: 1, n: 1, q: 3, l: 2}? 1/660 Four letters picked without replacement from {k: 4, d: 1, h: 1, f: 1, l: 4}. Give prob of sequence hldl. 1/660 What is prob of sequence us when two letters picked without replacement from {k: 1, b: 6, u: 3, s: 1, e: 1}? 1/44 Two letters picked without replacement from {k: 2, e: 1}. What is prob of sequence ek? 1/3 What is prob of sequence fflg when four letters picked without replacement from {u: 4, g: 3, l: 4, p: 4, f: 4}? 1/646 Four letters picked without replacement from wk	{ "pile_set_name": "DM Mathematics" }
7. Let c(h) = -41h2 + 4h - 16. Give -2c(i) - 5n(i). -18i2 + 2i - 3 Suppose 5k = -3i - 7, 4k + 1 = i - 8. Let s(f) = -f - 3. Let l(u) = -u - 1. Let g(n) = 2l(n) - s(n). Let h(c) = -3 + 14 - c - 11. What is ig(p) - 2h(p)? p + 1 Let j(o) = 4o2 - 2o - 4. Let c(m) = 21m2 + 1 + 25m*2 + 21m*2 + 22m*2 - 88m*2. Determine -4c(u) - j(u). -8u2 + 2u Let c(a) = -a*3 - 2a - 2. Let s(b) = 2b3 + 5b + 5. Let v = -167 - -172. Determine vc(z) + 2s(z). -z*3 Suppose -4g + 58 = 2k, 2g - 5g - k + 44 = 0. Let c(d) = -35 + 6d*2 + 33 - 3d - gd2. Let l(z) = 4z*2 + z + 1. Give 3c(i) + 7l(i). i2 - 2i + 1 Let a(x) = 48x3 - 2x*2 + 6x + 1. Let p(m) = 32m3 - m2 + 4m + 1. Calculate 5a(h) - 8p(h). -16h3 - 2h*2 - 2h - 3 Let d be 18/(-6)28/(-42). Let a(p) = 1. Let s = -2 - -2. Let h(k) = 1 - 2k + s + 0. Give da(b) - h(b). 2b + 1 Let g(c) = -62c3 + 5c*2 + 5c + 2. Let l(y) = 60y3 - 6y*2 - 6y - 2. Calculate 6g(v) + 5l(v). -72v3 + 2 Let a(l) = 7l*2 - 12l + 3. Let g(j) = -9j2 + 13j - 4. What is 6a(c) + 5g(c)? -3c2 - 7c - 2 Let h(w) = -5w - 4. Let j(r) = -14r - 9. Let l(d) = -70d - 44. Let u(t) = 11j(t) - 2l(t). Determine 11h(a) - 4u(a). a Let j(v) = v3 - v. Let x(p) = -166p*3 + 8p. Give -4j(n) - x(n). 162n*3 - 4n Let m(t) = -t - 1. Let q(g) = 4g + 2. Suppose 3r + 12 = -2h - 2r, 5r + 8 = -3h. Suppose -2s + 2 - h = 0. Calculate sq(f) - 2m(f). -2f Let f(y) = 443y3 - 3y*2 - 2. Let p(v) = -884v*3 + 7v*2 + 5. What is 7f(s) + 3p(s)? 449s*3 + 1 Let v(o) = -7o - 132. Let i(p) = 9p + 133. Give 4i(r) + 5v(r). r - 128 Let d(a) = -7a*3 + 5a*2 + 17. Let j(s) = 2s3 + s2 + 3. Let f(v) = -9v3 + 9v*2 + 28. Let w(u) = f(u) - j(u). What is 8d(m) - 5w(m)? -m3 + 11 Let t = -8 - -12. Suppose 0 = -9u + 7u - t. Let m(p) = p - 1. Let g be ((-9)/(-12))/(2/48). Let r(w) = 8w - 8. Determine gm(s) + ur(s). 2s - 2 Let r(f) = 24717f - 642. Let q(s) = 309s - 8. Determine -321q(j) + 4r(j). -321j Let u(o) = -3o2 + 8 - 9 + o2 - o2 + o. Let r(q) be the third derivative of q5/30 - q4/24 + q3/6 - 34q*2. What is 5r(d) + 3u(d)? d2 - 2d + 2 Let i(y) = -730 + 1470 + 3y - 733. Let o(t) = -t - 1. Give i(v) + 2o(v). v + 5 Let v(b) = -6b2 - 9b + 8. Let z(t) = -t + 2. Determine -v(f) + 4z(f). 6f*2 + 5f Let p(x) = 2 - 2 + x. Let f(o) = -21o + 108. Let m(k) = 6k - 30. Let s(h) = -5f(h) - 18m(h). What is 10p(u) + 4s(u)? -2u Suppose 0 = 5t + 6 + 4. Let f(u) = 2u3 - 5u*2 + 2u + 2. Let n(v) = -2v3 + 6v*2 - 2v - 3. Calculate tn(w) - 3f(w). -2w3 + 3w*2 - 2w Let r(p) = -9p2 - 5p + 5. Let b = 151 - 146. Let y(w) = 20 - 23 + 7w + bw*2 - 4w. Give 3r(k) + 5y(k). -2k2 Let b(j) = j3 - 15j*2 - 9j - 9. Let r(w) = 3w2 + 36 + w - 27 - 3w - 11 - 7w2. Give 2b(t) - 9r(t). 2t*3 + 6t*2 Let n(r) = -4r - 7. Let w(k) = 4k - 5. Let p be w(3). Let x(l) = -3l - 5. Calculate px(d) - 5n(d). -d Let b(g) = -4g2 + 3g + 3. Let u(p) = -4p2 + 4p + 4. Let x(l) = l*3 - 8l*2 + 16l - 2. Let i be x(5). Give iu(h) - 4b(h). 4h2 Let k(z) = 6z*2 + z - 2. Let n be 10/(-4)28/(-35). Let i(s) = -3s2 - s + 1. Determine nk(t) + 5i(t). -3t*2 - 3t + 1 Let t be ((-68)/(-238))/(2/14). Let w(f) = -3. Let d(l) = -l - 4. Give td(x) - 3w(x). -2x + 1 Let m(v) = 3v - 31. Let w(o) = 8o - 62. Calculate 7m(r) - 3w(r). -3r - 31 Let q(i) = i + 7. Let f(h) be the first derivative of -h*2/2 - 16h - 24. Let o(n) = 2f(n) + 5q(n). Let d(a) = a + 1. Give -14d(w) + 4o(w). -2w - 2 Let s(d) = -48d - 83. Let a(h) = -57h - 82. Calculate -5a(w) + 6s(w). -3w - 88 Let p(i) = 22i3 - 2i*2 - 2i + 5. Let x(k) = -1. Give p(q) + 6x(q). 22q*3 - 2q*2 - 2q - 1 Let z(g) be the first derivative of -g*3/3 - 7g + 2. Let r(j) = 1. Let h be 3/6 - 35/10. Give hr(w) - z(w). w2 + 4 Let n(q) = 1 - 2q + q + 2q. Let m be ((-14)/63)/(20/(-1080)). Let p(z) = -14z - 12. What is mn(t) + p(t)? -2t Suppose -4x - 2 = -5x + 3m, -2x + 4 = -2m. Let q(l) = l - 6l + xl. Let c(b) = 2b. Suppose -3 = -3p, -5p + 8p = -2t - 5. Give tc(r) - 3q(r). r Let h(l) = 42l3 - 3l*2 - l. Let p(i) = -125i*3 + 10i*2 + 3i. What is 7h(n) + 2p(n)? 44n3 - n2 - n Let u(x) = x2 - 1. Let t(d) = 73d*3 - 2d*2 + 4. What is -t(v) - 2u(v)? -73v3 - 2 Let n(t) = -515t*2. Let d(k) = -2k*2. What is -6d(h) - n(h)? 527h2 Let h(v) = -15v2 + 11. Let s(x) be the first derivative of x3 - 2x + 164. What is 2h(r) + 11s(r)? 3r*2 Let j(m) be the second derivative of -2m*3 - 3m*2 - 4m + 51. Let g(l) = -13l - 5. Give 6g(n) - 5j(n). -18n Let g(n) = 8n3 - 374n*2 + 3n - 3. Let v(b) = -13b3 + 747b*2 - 5b + 5. What is 5g(c) + 3v(c)? c*3 + 371c*2 Let a(y) = -5y*2 - 18. Let b(i) = 6i*2 + 19. Determine 3a(q) + 4b(q). 9q2 + 22 Let n(x) = -x2 - 2x + 27. Let k(s) = -s2 - s + 14. Determine -5k(v) + 3n(v). 2v*2 - v + 11 Let i(q) = 7q*2 + q - 8. Let a(p) = 6p*2 - 7p + 7. Let j(n) = 10n2 - 13n + 14. Let t(f) = 11a(f) - 6j(f). Give -5i(z) + 6t(z). z2 + z - 2 Let d(a) = a2. Let k(f) = -208f2 - 130. Let q(c) = 19c*2 + 12. Let v(j) = 6k(j) + 65q(j). What is 6d(o) + v(o)? -7o2 Let c(d) = 38d + 13. Let i(z) = -12z - 4. Calculate -2c(y) - 7i(y). 8y + 2 Let o(j) = 9j2 - 2j - 2. Let k(g) = -g*3 - 2g + 1. Let s be k(1). Let f(u) = 36u2 - 9u - 9. Give sf(x) + 9o(x). 9x2 Let b(l) = -44l*2 - 43l - 2. Let d(w) = -36w2 - 45w - 2. Calculate -5b(a) + 6d(a). 4a2 - 55a - 2 Let g(z) = z - 71. Let u(w) = -2w. Calculate g(f) + 2u(f). -3f - 71 Let s(i) = 3i*2 - 8i. Let q(z) = -z*2 + 9z. What is 5q(j) + 6s(j)? 13j2 - 3j Let g(p) = 5p - 1. Let j(t) = -14t + 3. What is -8g(q) - 3j(q)? 2q - 1 Let p(d) = -121d*2 - 6d - 6. Let n(a) = -364a2 - 17a - 17. Determine 6n(s) - 17p(s). -127s2 Let l(w) = -w - 1. Let q(y) = -18y*2 - 4. What is l(u) - q(u)? 18u2 - u + 3 Let z(d) be the second derivative of -d3/6 + d*2/2 + d. Let p(g) be the second derivative of 2g3/3 - g2/2 + 312g - 2. Determine p(l) + 2z(l). 2l + 1 Let n(q) = 18q - 5q - q2 + 1 - 14q. Let f(r) = 4r - 1. Let s(g) = -g. Let z(y) = -f(y) - s(y). Calculate 3n(k) - z(k). -3k2 + 2 Let p(m) = 12m + 117. Let s(d) = -3d - 30. What is 4p(f) + 15s(f)? 3f + 18 Let t(v) = -245v. Let i(f) = 1716f. Determine -5i(n) - 36t(n). 240n Let g(i) = -3i*2 - 14i + 2. Let h(c) = c3 + c2 + c - 1. What is -g(d) - 2h(d)? -2d3 + d2 + 12d Let t(v) = v3 + 1. Let o(g) be the second derivative of g5/10 - g2/2 + g + 10. What is -3o(s) - 3t(s)? -9s*3 Let a(r) = 159r*2 - 474r - 1. Let o be a(3). Let j(k) = 4k + 3k + 4k + 11. Let p(y) = -4y - 4. Determine op(c) + 3j(c). c + 1 Let z(m) = -14m - 89. Let p(n) = -17n - 89. Give 4p(v) - 5z(v). 2v + 89 Let v(c) = 317c - 2. Let f(u) = 16799u - 107. Calculate -2f(n) + 107v(n). 321n Let f(w) = -19w + 10. Let t be (-39)/26(-44)/6. Let j(l) = -4l + 2. What is tj(o) - 2f(o)? -6o + 2 Let g(p) = -4p2 + 5p + 1. Let s(t) = 4t + 11. Let v be s(-4). Let k(d) = -6d*2 + 8d + 2. Let q = 1 - -7. Determine qg(c) + vk(c). -2c2 - 2 Suppose -4h + 12 = -h, -2x = 5h - 18. Let s(m) = m3 + m2 + 2m - 1. Let w(u) = -u2 + u + 1. Give xs(n) - w(n). -n*3 - 3n Let r(s) be the second derivative of s*3/6 - 3s*2 + 59s. Let o(j) = -j + 7. Determine 4o(h) + 5r(h). h - 2 Let w(o) = 1656o - 56. Let c(s) = 184s - 6. What is 28c(g) - 3w(g)? 184g Let u(b) = -18b*2 - 12b + 12. Let q be 5/((-5)/(-2 + -3)). Let m(l) = -5 + 4l - 7l*2 + 20l*2 + l - 6l*2. Give qu(o) + 12m(o). -6o*2 Let t(n) = -26 + 2n + 42 - 17. Let m(z) = z*3 - 5z*2 - 3z - 5. Let l be m(6). Let g = l - 4. Let k(h) = -5h + 2. Determine gt(f) + 4k(f). -2f - 1 Let o(c) = 8c + 8. Let m(l) = -23l + 7 - 10 - 20. Let p(f) = -621f - 621. Let i(a) = 161m(a) - 6p(a). Determine 6i(d) - 17o(d). 2d + 2 Let i(m) = 6m3 + 9m*2 - 3m - 33. Let f(p) = -p3 - p2 + p + 2. Give -5f(x) - i(x). -x3 - 4x*2 - 2x + 23 Let j(a) = -a - 1. Let m be ((-2)/8 - -2) + 2/8. Le	{ "pile_set_name": "DM Mathematics" }
the highest common factor of v and r? 10 Let q(l) = 3l - 5. Let g be q(7). Let w be 40/70 - 2232/(-14). Calculate the highest common factor of g and w. 16 Suppose 19m - 23m = -88. What is the greatest common factor of m and 33? 11 Let x(f) = 3f + 26. Let z be x(10). Suppose i + i = z. Calculate the highest common divisor of i and 168. 28 Let w(k) = -3k + 7 + 19k + 6k - 12k*2 + 10k*3 - 9k*3. Let p be w(10). What is the greatest common divisor of p and 6? 3 Let d(k) = -7k*2 - 14k + 27. Let m(s) = -s*2 - s + 1. Let a(w) = d(w) - 6m(w). Let h be a(-9). What is the greatest common factor of 60 and h? 12 Let d(g) = -g + 11. Let y be d(4). Let s be (-5y)/(-4 + 3). What is the highest common divisor of s and 105? 35 Let v = -101 - -59. Let u be 28/v - 434/(-3). Let x = u + -89. Calculate the greatest common divisor of 11 and x. 11 Suppose 2616 = 83y - 24691. What is the greatest common factor of 188 and y? 47 Let y(t) = 2t2 - 3 - 2 + 0t*2 - 4t*2 - 3t. Let k be y(4). Let o = -35 - k. What is the highest common factor of 98 and o? 14 Let u be (65/(-3))/((-12)/36). Calculate the greatest common factor of u and 5. 5 Suppose -9 = -w - 6. Let l = w + -11. Let b(s) = s + 16. Let d be b(l). Calculate the highest common divisor of d and 64. 8 Suppose -82 + 18 = -3r - 2m, 0 = -3r + 2m + 44. Suppose -8s = -6s - 24. Calculate the highest common divisor of r and s. 6 Let a(b) = b*2 - b. Let q be a(4). Suppose 0 = 5s + 164m - 160m - 28, -2s - 4m + 16 = 0. What is the highest common divisor of q and s? 4 Let z be (-18)/81 - 168/(-27). Calculate the greatest common divisor of 534 and z. 6 Suppose 2d - 2f + 11 - 105 = 0, d = 4f + 56. Suppose b - 356 = -3i - 27, -4i + 439 = b. Calculate the greatest common factor of i and d. 22 Suppose 236 = 5x + 6. What is the highest common factor of x and 460? 46 Suppose 2o + 5396 = 3r - 1650, -4r = 2o - 9404. What is the greatest common divisor of 50 and r? 50 Let x = -19 - -27. Let l(o) = -o*2 + 9o - 11. Let a be l(x). Let r be -1 + (a + 92 - 0). Calculate the greatest common factor of r and 11. 11 Let b(q) = 27q2 + 1. Let l be b(-1). Let s(h) = 1 + 6 - 2 - 32h - 1. Let f be s(-6). Calculate the highest common factor of f and l. 28 Let g(t) = -2t2 + 23t - 9. Let h be g(11). Let z(u) = u*3 - 5u + 8u + 4 - 9u*2 + hu2. Let c be z(7). What is the highest common divisor of 10 and c? 5 Let o = 223 + -113. Let x(l) = l3 + 6l - 2l*2 + 2l - 2l2 - 3l - 6. Let d be x(5). Calculate the highest common factor of d and o. 22 Let d(w) = -w*3 + 5w*2 + 6w - 3. Let m = 0 - -5. Let y be d(m). Let a(b) = -51b - 42. Let u be a(-1). Calculate the greatest common factor of y and u. 9 Suppose -3a + 10 = -4g - 66, -5a - 5g = -150. What is the greatest common divisor of a and 119? 7 Let d(z) = 4z*2 - 9z + 6. Let i be d(3). Let x = 563 + -398. What is the greatest common factor of x and i? 15 Suppose 2i = 80 + 10. Let c = 89 - i. What is the greatest common divisor of 66 and c? 22 Suppose -4k - 85 - 11 = 0. Let u = -14 - k. What is the greatest common divisor of u and 4? 2 Let c = -475 - -699. Calculate the highest common divisor of c and 64. 32 Suppose 0 = l + h - 2h - 95, 3l = -4h + 306. Let o be (-2)/4(0 - 84/3). Calculate the greatest common divisor of l and o. 14 Suppose 15 = 120x - 117x, 0 = -3a + 4x + 5164. Calculate the greatest common divisor of a and 64. 64 Let g(p) = 5p2 - 8p - 9. Let o(l) = -26l2 + 40l + 44. Let d(h) = 11g(h) + 2o(h). Let z be d(5). What is the highest common divisor of 6 and z? 6 Let f be -4 + (-4548)/(-54) + 4/(-18). Let d = f + -20. Suppose 53 = 3g - 4i, -4g + 0i + 52 = 4i. Calculate the highest common divisor of g and d. 15 Let j = -189 - -299. Let k = 2 + 1. Let a = k - -7. What is the highest common factor of j and a? 10 Let x = -1834 + 1852. What is the highest common factor of x and 1602? 18 Let o(b) be the second derivative of -b2 + 7/6b*3 + 0 - 9b - 1/12b4. Let k be o(5). What is the highest common factor of k and 32? 8 Let j = -233 + 285. Let u be (-38)/(-8) + 2/8. Suppose -202 = -uv - j. What is the highest common divisor of 180 and v? 30 Suppose 4o - 2p + 14 = 0, 0o + 2p + 21 = -3o. Let b be 16(-5)/(-20)-6. Let z be (135/12)/ob. Calculate the highest common factor of 6 and z. 6 Let g = -7 - -21. Let w be g - 11 - -11. Let l(o) = 3o*3 - 5o*2 + 4o. Let t be l(w). Calculate the greatest common factor of t and 16. 16 Suppose -5 = g, a - 141 = -5g + 120. Calculate the highest common factor of a and 22. 22 Suppose -x = -0x - 8. Let r = -44 + x. Let z be (1680/r)/((-2)/6). Calculate the greatest common divisor of z and 28. 28 Let l = -782 - -834. What is the greatest common divisor of 8 and l? 4 Let a(v) = 15v + 114. Let m(f) = -3f - 23. Let h(p) = -2a(p) - 11m(p). Let z be h(-3). What is the greatest common divisor of z and 128? 16 Suppose 16h - 12 = -156. Let j be 22(h - -5 - -5). What is the highest common divisor of j and 11? 11 Let m be -1 - 3(36 - 0). Let a be ((1/(-1) - -3) + -136)/2. Let v = a - m. Calculate the greatest common factor of v and 6. 6 Let q be 31(-20)/(-30). Suppose 0 = -qr + 67 + 73. Calculate the greatest common divisor of r and 10. 10 Let a(x) = 3x2 - 8x - 5. Let v be a(-7). Let d(j) = 45j - 2. Let u be d(2). Suppose 0h = -4h + u. What is the greatest common divisor of h and v? 22 Let l(u) = 59u - 181. Let w be l(11). What is the greatest common factor of w and 54? 18 Suppose 5m - 6m = -6. Suppose 5p - a = 39, mp - 44 = 2p + 4a. Suppose 1 = f, p = -5o + 5f + 17. What is the greatest common factor of o and 3? 3 Let h = 21 + -10. Suppose -7 = -j + h. What is the greatest common factor of j and 18? 18 Let l(s) be the second derivative of -s*5/20 + 3s4/4 - s3 + 9s2/2 - 3s. Let d be l(6). What is the greatest common divisor of d and 9? 9 Let z = 6 + -1. Suppose o - 6 = 4y, zo - 8 - 1 = -y. Suppose -183 = -oh + 41. What is the highest common factor of h and 14? 14 Let m be ((-4 - -6) + 44)/((-1)/(-10)). Calculate the highest common factor of 276 and m. 92 Let k(x) = -x3 - 4x*2 - 2x - 1. Let o be k(-2). Let c be (1/3)/(o/(-135)) - 0. Calculate the greatest common divisor of 18 and c. 9 Let t be (0 - -9)(-32 + -4). Let o = -144 - t. What is the highest common divisor of 20 and o? 20 Let w be (-84)/(-2) + (-12 - -11). Suppose 2b - w - 179 = 0. Calculate the highest common divisor of 10 and b. 10 Suppose -2394 = 12g - 26g. Calculate the highest common factor of 228 and g. 57 Let a be 5(-4)/(-60) + 70/6. Suppose -2g = a - 16. Suppose -4l + l + 20 = m, 4m - 3l - 5 = 0. What is the greatest common factor of g and m? 1 Let r be 1 + 2 - (5 - 4). Let s(b) = 14b*2 + 0b - 13br - b - 3 + 9b. Let i be s(-11). Calculate the highest common divisor of 6 and i. 6 Suppose -5f = f - 72. Suppose fv + 0v - 2484 = 0. Calculate the greatest common divisor of v and 23. 23 Suppose 15 = 3n + l, -3l - l - 42 = -5n. Let t be (2 - (-206)/n) + 10/(-30). Let q = 6 + -2. Calculate the highest common factor of t and q. 4 Let n(i) = 15i - 25. Let w be n(17). What is the highest common factor of 23 and w? 23 Let a be (42/9)/((-4)/6). Let n(o) = -10o + 18. Let x be n(a). What is the greatest common factor of x and 8? 8 Let y(x) be the second derivative of x*5/20 - 5x*4/4 - 7x*3/3 + 15x*2/2 - 25x. Let t be y(16). What is the greatest common divisor of 517 and t? 47 Let m(i) = -207i3 + 3i*2 + 2i + 1. Let k be m(-2). Calculate the highest common factor of k and 37. 37 Let c(v) = 3v3 - 5v*2 + 4v + 7. Suppose 5w - 4h = h, 3w - h - 8 = 0. Let r be c(w). Calculate the highest common factor of 54 and r. 27 Suppose 5f + 2 - 4 = 2i, -f - 1 = i. Let q = 0 - i. Let u be 14 - (-2 + 2)/q. What is the greatest common divisor of u and 21? 7 Suppose 549 = 2g + 123. Calculate the highest common divisor of 142 and g. 71 Suppose -3m - 20 = 2m. Let z be 0 - 0 - m - -7. Suppose 2p = -8, 27 + z = o + 4p. Calculate the highest common divisor of o and 36. 18 Suppose -2k + 828 = -6k - 5v, v = 0. Let y = 350 + k. Let x(l) = l + 7. Let b be x(6). Calculate the greatest common factor of b and y. 13 Let l(i) = i2 - 8i + 7. Su	{ "pile_set_name": "DM Mathematics" }
(g) = -2g2 - 1. Give -s(l) + 4x(l). 70l2 + 6l Let o(g) be the third derivative of -7g5/60 - g2. Let p(q) be the first derivative of -12q*3 + 5. What is 11o(f) - 2p(f)? -5f*2 Let s(r) = r - 3. Let w(i) = -5i - 6 + 2 + i + 5i. Let a be ((1 - 1)-1)/2. Let l = -4 + a. Determine ls(n) + 3w(n). -n Let q(w) = 861122w + 7798. Let o(k) = 1104k + 10. What is 3899o(u) - 5q(u)? -1114u Let t(s) = -s2. Let n(d) = 2d*2 - 9d*2 - 3d*3 + 2d*3. Suppose -11j + 134 = 79. Determine jt(u) - n(u). u3 + 2u*2 Let k(q) = -3q + 2. Let a(i) = -2. Determine a(b) + 3k(b). -9b + 4 Suppose -63p + 60p - 9 = 0. Let h(j) be the third derivative of j6/60 - j5/60 + j*2. Let f(u) = -2u3 + u2. Calculate pf(v) - 4h(v). -2v3 + v2 Let x(u) = 57u - 40u + 12u*2 + 0u*2. Let j = -37 - -71. Let f(g) = -2g*2 - 3g. What is jf(w) + 6x(w)? 4w2 Let x(z) = 1310z*3 + 655z*2 - 1310z - 655. Let p(g) = -g3 - g2 + 2g + 1. Give 655p(w) + x(w). 655w3 Let g(k) = 7k + 9. Let x(n) = 10n + 12. Let j(t) = -11t - 13. Let w(i) = -2j(i) - 3x(i). Suppose 4l - 14l - 60 = 0. Determine lw(a) - 7g(a). -a - 3 Let y(x) = x*3 - x. Let f be 7/2882/(-4). Let i(s) = 4s*3 - 5s + 1. Let p be 2/(-4)01. Suppose -j + 5 + 0 = p. What is fi(c) + jy(c)? c3 - 1 Let q(l) = -l3 - 5l. Let p(c) be the second derivative of -c3/3 - c - 414. Let x(r) = -r3 - 2r*2 - 4. Let a be x(-3). Determine ap(w) - 2q(w). 2w*3 Let f(d) = 2d - 193. Let l(y) = -3y + 289. What is -7f(m) - 5l(m)? m - 94 Let q(d) = -65d*2. Let o(b) = 13b*2. Suppose 182v - 197v = -30. What is vq(a) + 11o(a)? 13a*2 Let q(h) = 2h*2 + 4h + 4. Let k(l) = -3l2 + 80l - 85l + 1 - 5. Determine -4k(r) - 5q(r). 2r*2 - 4 Let y(i) = -6i*2 + 11i - 8. Let f(l) = -l*2 + l. What is -5f(o) + y(o)? -o*2 + 6o - 8 Let x(p) = 5p - 1. Let v(f) = -6f + 1. Let s(g) be the third derivative of -g*5/60 - 7g*4/12 - 2g*3/3 - 11g*2. Let y be s(-14). Give yv(t) - 5x(t). -t + 1 Let c(l) be the second derivative of -l4/3 - l3/3 + l2/2 - 49l. Let m = -6 - -17. Let b(k) = -11k + 4 - 28k*2 + 2 + 7k*2. What is mc(t) - 2b(t)? -2t2 - 1 Let a(p) = p2 - 9p + 19. Let z be a(3). Let h(g) = -3g - 1. Let r(q) = q. Determine zh(t) + 4r(t). t - 1 Let f(u) = -56 - u - 6u3 - 58 + 114. Let k(l) = -11l*3 - 2l. Give -5f(m) + 3k(m). -3m3 - m Let x(a) = 1 + a2 - a - 7a*2 + 10a*2. Let j(s) = 5s*2 - s + 1. Give 3j(i) - 4x(i). -i2 + i - 1 Let u(z) = -z3 + 18z*2 - 2z + 4. Let a(q) = 2q3 - 17q*2 + 3q - 6. Determine -2a(b) - 3u(b). -b*3 - 20b2 Let g(h) = -h2. Let j(z) = 5z2 + z - 11. Let p(f) = 5f*2 + 2f - 14. Let u(w) = 4j(w) - 3p(w). Determine 6g(o) + u(o). -o2 - 2o - 2 Let v(q) = q + 1. Let j(t) = -t + 5. Let g be j(6). Let m(f) = -3f - 7. Let x = 42 - 26. Suppose 3s + k = 5s + x, 0 = -4k + 16. Calculate gm(y) + sv(y). -3y + 1 Let s(g) = 105g*3 - 13g*2 + 9g + 13. Let b(z) = 53z3 - 6z*2 + 4z + 6. Calculate -13b(r) + 6s(r). -59r3 + 2r Let x(n) = -11n2 - 16n*2 + 28n2 + n3. Let z(k) = 3k3 + 2k*2. What is -2x(b) + z(b)? b*3 Let l(z) = -17z*2 + 8z. Let k(m) = m*2 - m. Let r(c) be the first derivative of 4c*3/3 - 3c*2 + 9. Let y(q) = -8k(q) + r(q). Give 2l(g) - 9y(g). 2g2 - 2g Let x(w) = -39. Let j(h) = -h*2 + 1. Give 39j(a) + x(a). -39a2 Let f(g) = 403g*3 - 78g*2 + 78g. Let d(a) = -2a3 + 5a - 5a2 + 21a*3 - 37a*3 + 26a*3 + 18a*3. Determine 78d(k) - 5f(k). 13k*3 Let k(g) = -15g + 5. Let m(h) = 14h - 4. Give 3k(x) + 4m(x). 11x - 1 Let o(m) = -4m2 - 3m + 5. Let i be ((-4)/18 - -1)33/11. Let w(u) be the first derivative of -iu*3 + 9u - 5/2u2 + 4. What is -5o(s) + 3w(s)? -s2 + 2 Let u(y) = y3 + 5y*2 + 3y + 2. Let o(a) be the first derivative of -a*4/4 - 4a3/3 - a2 - 2a - 332. Let q = -9 - -5. Give qu(i) - 5o(i). i3 - 2i + 2 Let x(i) = -2i2 + 3. Let w(u) be the third derivative of u5/30 - u3/3 + 16u*2. Let a be 2/3(-9)/(-2). Determine aw(j) + 2x(j). 2j2 Let z be (1 + 1)(0 - 1). Let j(m) = 3m2 + m - 2. Let c(f) = -f2 - f. Suppose 0 = 3y + y + 4. What is yj(t) + zc(t)? -t*2 + t + 2 Let y(g) = -5g + 3. Let q(d) = -6 + 9d - 3d - 2d + 0 + 7d. What is -6q(u) - 13y(u)? -u - 3 Let o(d) = -4 + 1 - d + 0. Let u(g) = 91 - 3g + 89 - 264 + 76. Give -11o(l) + 4u(l). -l + 1 Let j(x) = -4 + 18 - 12x + 11x. Let z be j(11). Let i(w) = -w + 1. Let b(o) = 2o*2 - 4o + 4. Let r = 2 - 3. Calculate rb(d) + zi(d). -2d2 + d - 1 Let h(u) = 8u*2 + 7u + 8. Let x(k) = 32k - 13k - k*2 - 1 - 20k. Calculate 2h(v) + 14x(v). 2v2 + 2 Let j = -705 - -694. Suppose 12 = 4c + b, 0c - 2b + 3 = c. Let k(t) = 3 - 3t2 - 2 - c. Let g(i) = i3 + 16i*2 + 10. What is jk(r) - 2g(r)? -2r3 + r2 + 2 Let l(x) = 4061x - 8139x + 4079x. Let z = 31 - 56. Let i(d) = 5d. Calculate zl(s) + 4i(s). -5s Let d(u) = 10u + 15. Let n(r) = -11r + 25. Let q(g) = -5g + 11. Let l(z) = -4n(z) + 9q(z). Determine 2d(i) + 30l(i). -10i Let m(h) = -5h*2 + 24h - 12. Let r(a) = 4a2 - 23a + 10. Give 5m(z) + 6r(z). -z*2 - 18z Let g(q) = -5q - 6. Let x be (-6)/2 + (27 - 20). Let c(h) = -11h - 13. Give xc(d) - 9g(d). d + 2 Let t(u) = u3 + u + 1. Let l(i) = -i + 0 + 2 - i3 - i*3 - 1. Suppose -w = -4n - 11, -3w - 9n + 5n = 15. Determine wl(c) - t(c). c*3 - 2 Let f(m) = -m. Let y be 11 + 5 - 2/2. Let t = y - 14. Let x(o) = 2o - 8o + 3o - 3o. Give tx(g) - 4f(g). -2g Let r(b) = b - 3. Let n(t) = 69. Determine n(g) - 4r(g). -4g + 81 Let p(a) = -4a3 - 106a*2 + 5a + 5. Let m(o) = -5o3 - 107o*2 + 6o + 6. Calculate -5m(j) + 6p(j). j*3 - 101j*2 Let l be 2/(-3) + 1/(-3). Let k(q) be the first derivative of -5q*2/2 + 6q - 282. Let y(n) = n - 1. Suppose 5d = 2d - 12. Give dy(h) + lk(h). h - 2 Let s(g) = 2g + 2. Let r = 15 + -11. Suppose -2q - rt = 4, -5q - 4t = 3 + 7. Let n(l) = -2l - 3. Suppose -64z = -67z - 9. What is qn(m) + zs(m)? -2m Let p(g) = -2g*3 - 88g. Let w(r) = r. Determine p(c) + 3w(c). -2c*3 - 85c Let b(m) = -11m - 2. Let g be (-7 + 22/3)/((-3)/45). Let w(d) = -21d - 5. Give gb(p) + 2w(p). 13p Let u(n) = n2 - 2n - 10. Let z(g) = 2g2 - 3g - 20. Suppose -6 = -2k - 3i, 0k - 3 = -k - 3i. Calculate kz(f) - 5u(f). f*2 + f - 10 Let x(m) = -35m + 39. Let j(p) = -18p + 23. Calculate 10j(y) - 6x(y). 30y - 4 Let w(g) be the first derivative of g + 2. Let r be (1 - 1)/(-2) - -1. Let d(q) = -3q2 + 2. Give rd(t) - 2w(t). -3t*2 Let h(k) = -20k*3 - 28k + 26k + 3k*2 + 22k3. Let o(q) be the third derivative of q6/30 + q5/10 - q4/6 - 2q2. What is -7h(j) + 4o(j)? 2j*3 + 3j*2 - 2j Let h(u) = -5u + 5. Let l = 12 + -4. Suppose -2n - 14 = l. Let v(d) = 14d - 14. Calculate nh(q) - 4v(q). -q + 1 Let t(r) = 562 - 5r*2 - 5r + 559 - 1116 + 34r3. Let g(x) = -17x*3 + 2x*2 + 2x - 2. Determine 5g(c) + 2t(c). -17c3 Let a be (25/(-35) + (-8)/28)7. Let z(n) = 5n - 1. Let s be (-3)/(-6)(4 - 0). Let m(w) = 16w - 4. Determine az(k) + sm(k). -3k - 1 Let f(u) = -8u + 59. Let l(x) = -6x + 60. Calculate 4f(q) - 5l(q). -2q - 64 Let l(n) = 7n + 19. Let s(m) = 3m + 9. Let d(b) = 2l(b) - 5s(b). Let h(q) = 6. What is -4d(i) - 5h(i)? 4i - 2 Let b(n) = 4n3 + 5n + 3. Let f(l) be the third derivative of -l6/24 - l5/60 - l*4/4 - 2l*3/3 + 19l*2 + 3. Calculate 4b(w) + 3f(w). w3 - 3w*2 + 2w Let z(v) = -2v3 - 3. Let g = -54 + 63. Let j be (g/(-3) + 1)2. Let d(u) = -2u3 - 2. Determine jz(t) + 6d(t). -4t*3 Let t = 32475 + -32470. Let w(g) = 2g*2 + 6g + 8. Let q = -3 - -9. Let u(a) = -2a2 - 5a - 7. Determine qu(k) + tw(k). -2k2 - 2 Let l(y) = y - 1 - 7 + 8. Suppose 6w = 2w + 12. Let q(b) = -4b. Give wq(k) + 16l(k). 4k Let x be 7/((-11)/((-66)/12) + -3). Let i(p) = -7p*3 - 3p*2 + 7p + 6. Let u(c) = -8c3 - 3c*2 + 8c + 7. Calculate xi(q) + 6u(q). q*3 + 3q*2 - q Let q(y) = 8 + 2y - 8. Suppose -3n = 2v - 1, -n = 10v - 9v - 2. Let b(o) = o*3 - 5o. Determine vq(g) + 2b(g). 2g*3 Let p(r) =	{ "pile_set_name": "DM Mathematics" }
What is the value of (-14)/77 - 272/(-44)? 6 Calculate -1(-8)/(-4)3/36. -1/6 Calculate (-2 + 1)/((-5)/(-10)). -2 152/(-28) - (1 - 3 - 4) 4/7 Evaluate 6/7 + (-12)/14. 0 What is (-5)/(-10)6 + (-14)/5? 1/5 What is the value of (0 + (-2)/(-5))/(1364/620)? 2/11 Calculate (4/(-6))/(-9 + (-175)/(-15)). -1/4 -9-1(-5)/(-15) - -1 4 Evaluate 13 - 12/((-72)/(-66)). 2 What is (-456)/252 - (-30)/18? -1/7 Calculate 21/(-35)10/9. -2/3 Evaluate (-40)/18 + -10 + (-368)/(-36). -2 Calculate 5376/(-14700) - (-2)/7. -2/25 What is the value of ((-5)/10)/((-1)/6)? 3 6/(-9)(2 + 70/(-38)) -2/19 What is 4 + (3/7510 - 5)? -3/5 What is (-13)/110 + 43/(430/3)? 2/11 What is -3(2 + 1 + -2)? -3 What is the value of (-68)/85 + (-51)/(-70)? -1/14 Evaluate 4/55/10. 2/5 -3 - (-4 - 20/363) 8/3 ((-36)/(-24))/((-3)/8) -4 Calculate (-11)/(-10) - (-75)/(-50). -2/5 5 + 494/133 - 2/(-7) 9 Calculate ((-48)/132)/((-8)/44). 2 What is ((-10)/3)/(155/(-93))? 2 What is (-8)/(-6)(35 - 38)? -4 What is (0 + -1 - -8) + (-38)/5? -3/5 What is the value of -3(-5)/((-45)/12)? -4 What is the value of (3/(-4))/((-12)/32)? 2 Calculate (2 - (-1)/(-1)) + -1. 0 What is 5/((-35)/(-2)) + 253/(-77)? -3 What is the value of -1 + -3 + (-1750)/(-455)? -2/13 What is (-4)/(-176)104/5? 2/11 What is the value of 8/(-6)(-21)/(-7)? -4 What is the value of -1 - (756/(-77))/12? -2/11 (-2 + 2)/(23 + -21) 0 What is 1/3 - 632/474? -1 Evaluate 82/(-60) - (-14)/(-105). -3/2 Evaluate (-1)/3 - (-8)/96. -1/4 Calculate (1/(5/(-2)))/((-114)/(-570)). -2 What is (3/7)/(-1(-6)/(-4))? -2/7 Calculate ((-36)/(-24))/(-1 + (-1 - -5)). 1/2 ((-4)/16)/((-3)/(-4)) -1/3 What is (-2 - (-120)/70) + 144/14? 10 What is (24/132)/(-1)-44? 8 (-3)/2 - -5(-4)/(-16) -1/4 What is the value of (0 - 0)(17/(-3) + 6)? 0 Evaluate (-3 + (-114)/(-30))(-7)/28. -1/5 What is the value of -1 - 1 - (9 + -1 + -6)? -4 (-9 - (-112)/12)-9 -3 What is ((108/60)/((-4)/10))/(-6)? 3/4 What is (0 + 1)/((-8)/(14 + -6))? -1 Calculate (-18(5 + 96/(-18)))/(-2). -3 What is the value of 104/78(-42)/(-8)? 7 Evaluate ((-114)/48 + 3)(-6)/(-15). 1/4 Evaluate 3 - 216/36. -1/2 Calculate ((-204)/(-45))/4 + -1. 2/15 Evaluate ((-77)/15 - -5)/((-3)/15). 2/3 Calculate -18 + (-2165)/(-130) + (-2)/13. -3/2 Calculate (-12)/9(-324)/(-144). -3 What is the value of 24/(-36) - (-20)/84? -3/7 Evaluate (0 + 3 - -2)/(-1). -5 Evaluate (10/(-12))/((-1)/12). 10 Evaluate ((-159)/(-106))/(15/(-4)). -2/5 ((-3)/(12/8))/(-36)-3 -1/6 Evaluate 12/(-9) + 2/3. -2/3 2 + 4/6 + 6/(-6) 5/3 Evaluate (1 + (-4)/16)4. 3 What is ((-18)/24)/((-1)/(-2))? -3/2 What is (18/(-4) + (-84)/(-56))/1? -3 What is -42(-49)/196? 2 What is the value of 1/45 - 24/108? -1/5 ((-1)/4-2)/((-2)/16) -4 What is -10413/130 + 6/15? -10 Calculate (9/2)/(1(2 + -5)). -3/2 444/336 + (-32)/56 3/4 Calculate (-5)/7 - 156/(-42). 3 Calculate 175/665(16/10 - 2). -2/19 ((-3)/1 - 1)1 -4 50/33 - (-28)/(-21) 2/11 Calculate (5/(-2))/((-145)/58). 1 (-1 - 2) + (-2 - 0) + 6 1 What is the value of 2/(-4)8/38? -2/19 ((-3)/42)/((-6)/(-8)) -2 Evaluate (-2)/17 - -30(-4)/136. -1 Calculate 15((-133)/21 + 6). -5 (10 + -1 - -1) + -5 5 What is the value of (-28)/(-7)6/40? 3/5 What is the value of (4/5)/((-28)/70)? -2 What is the value of (-45)/(-10) - (2 + 10/(-4))? 5 Calculate (-1 - (2 + -4))(1 - -4). 5 (54/63 + -1)14/(-6) 1/3 What is ((-36)/(-48))/(5 + (-123)/24)? -6 Calculate 1 - 7/(-2) - (-156)/(-104). 3 What is the value of (4 - -1) + -12? 3 Calculate ((-104)/(-208))/(2/42). 1/2 ((-15)/(-55))/(-1 + (-15)/(-6)) 2/11 What is ((-20)/12 - -2)35? 5 Evaluate 180/(-24)2/(-3). 5 Evaluate (-26)/2 + 264/44. -7 Calculate (-3)/(-11) - 884/1144. -1/2 What is (40/(-480))/((-2)/(-6))? -1/4 What is (-2)/9 - 4/(-18)? 0 Evaluate (-110)/20(5 + -3) - -4. -7 What is (6/8)/1 - 18/24? 0 What is (304/(-133))/((-10)/(-14) - 1)? 8 What is 11 + 3 + 456/(-33)? 2/11 Evaluate 0/((-2)/(-4 - -3)). 0 63 - 65 - (0 - 24/9) 2/3 What is the value of 60/(-24) + 2/(-4)? -3 What is the value of -3 - ((-2)/(-1) - 10)? 5 (-1836)/4760 + 2 + 12/(-7) -1/10 Evaluate (3/(-15))/(-1)(7 - 6). 1/5 Calculate (-12)/(-2) - (-1)/(3/(-21)). -1 What is the value of -4 - (7 + 2) - -6? -7 0 + (8(-6)/60)/(-4) 1/5 What is the value of 4 - (-56)/(-7) - (-2 - -1)? -3 Calculate -3 - ((-21)/6)/7-2. -4 What is the value of 7 - (7 + 11) - -8? -3 What is (-14)/(-24)81/126? 3/8 Evaluate (-6)/2 + 279/27 + -8. -2/3 Evaluate 38/266 + (-148)/644. -2/23 (-1)/3 - 110/(-231) 1/7 (2/(-5))/((-192)/(-40) - 5) 2 Calculate ((-81)/108 - (-2)/(-8))/9. -1/9 What is the value of 2 - (-12)/82? 5 Evaluate ((-2)/4)/1-8. 4 Calculate (1 + (-27)/15)(-65)/(-13). -4 What is -12((-56)/(-21) - 3)? 4 What is (5/(-3) - -1)/(150/675)? -3 What is the value of 8/(-7)(35/1)/(-5)? 8 46/(-12) - 3 -5 What is (-6)/(-5)7/21-15? -6 Calculate (-1740)/(-165) + 2 - 12. 6/11 What is the value of (0/(-3) - 9/6)2? -3 Calculate (-100)/3756/4. -2/5 28/126 + 40/(-18) -2 (-16)/60(-11 - -8) 4/5 3 - (-6 + 9 + -1) 1 Calculate (0 + 1)/((-2)/(-6)). 3 What is the value of (-6)/135(-20)/(-4)? -2/9 Calculate ((-1)/2)/(8/80). -5 Evaluate (10/(-75))/(72/(-45)). 1/12 ((-5)/(-8) + (-9)/72)0 0 (-1)/(-4) - (6 + (-92)/16) 0 (-13)/(-10) + -1 + (-21)/(-105) 1/2 Evaluate -4 + (3 + -3 - (-4 - -5)). -5 What is the value of ((-45)/(-4))/(-5) - 1/(-4)? -2 Calculate -2(-1)/10 + (-3)/(-135). 2/9 Calculate (-2)/8 - 84/(-16). 5 What is the value of 61/(-30) - ((-715)/(-78))/(-11)? -6/5 What is the value of 4 + 1248/(-252) + 2/3? -2/7 Evaluate 2/5(-75)/(-120). 1/4 Evaluate (-9 + 78/10)(-15)/(-9). -2 Calculate (4 + (-54)/15)(-12)/24. -1/5 What is the value of 10/(-195) + (-8)/13? -2/3 What is (-2035)/(-740) + (-23)/4? -3 Evaluate -2 + 8(-2)/(-12). -2/3 What is 4(-45)/(-72)(3 - 1)? 5 What is 53/(-8) + (54 - 47)? 3/8 Calculate 1-281/(-135)5. 6 (-3)/(36/10)2/(-5) 1/3 (-1102)/232 - (-5 - -1) -3/4 Evaluate (-12)/32 + 14/112. -1/4 Calculate 58/(-78) + (-74)/(-111). -1/13 Calculate (-1)/(3/(-18)1) + 2. 8 Evaluate (-15 + 13/1)/7. -2/7 Evaluate 660/(-105) - 6/(-21). -6 Calculate (-10)/1233/(-110). 1/4 What is (-12)/21 + (-1)/((-7)/2)? -2/7 What is (2/9)/((-18)/(-54))? 2/3 Evaluate (8/11)/4 - (-40)/(-704). 1/8 Calculate (-1 - 0)/(3/27-3). 3 What is ((-3 - -15) + 6)/(-2)? -9 Calculate (-15)/102(-7)/(-147). -1/7 (-96/(-63))/(15/(-105)) -6 Calculate 8 + 4/(3(-1)/3). 4 Calculate 27/(-63) - 676/(-91). 7 Calculate (0 + (-2)/8)/((-27)/(-72)). -2/3 Evaluate -2 - (-4 + -5 + 0). 7 What is ((-22)/10 - -1)91/(-819)? 2/15 What is the value of (112/40)/(2(-3)/15)? -7 Evaluate ((-12)/(-33))/(-2) + (-9)/132. -1/4 What is the value of (88/66)/((-28)/6)? -2/7 (-12)/(-60) + (-54)/45 -1 Calculate 8/448-6 - 2/14. -1/4 What is 2/(-8 - 2 - -3 - 4)? -2/11 Evaluate (-52)/(-4) + 3 - (-13 + 21). 8 Calculate 8/(-52) - 500/130. -4 Evaluate (-1 + -3)((-3)/6)/(-1). -2 What is (-140)/14(-8)/10? 8 What is the value of (-37)/28 + (-6)/(-8)? -4/7 What is 312/(-32) + (-3)/8? -3/2 Evaluate (-3 - 81/(-15)) + (-44)/110. 2 What is the value of ((-2)/114-6)/1? 2/19 Evaluate (-234)/130 + 62/40. -1/4 Evaluate (36/(-8))/(12/16). -6 What is the value of (-3)/(-18) - (-19)/57? 1/2 Calculate (-2)/10 - (-1 + 20/25). 0 Evaluate ((-24)/5 - (-4)/5) + 1. -3 Calculate 6/(-147) + (-8115)/(-735). 11 What is (-120)/(-10) + -15 - 2? -5 (-1)/(-5) - 1(-15)/25 4/5 ((-2)/5)/((-2)/(40/28)) 2/7 Calculate 55/33(-1 + (-8)/(-14)). -5/7 -3 - 6/60-34 2/5 Evaluate (2/6)/((-11)/(-22)). 2/3 What is the value of (-225)/(-54) - (-126)/(-28)? -1/3 Evaluate 0(-6 + (-26)/(-4)). 0 Calculate (3 + (-160)/56)(0 - -3). 3/7 Calculate ((-44)/7 + (-2)/(-7))/(-2). 3 Evaluate 13 + 1 + -1 + -8. 5 What is the value of (-11 - -12 - 0)(-6)/11? -6/11 What is the value of 6/39(67 - 93)? -4 What is the value of 1/(((-12)/(-3) - 3)/5)? 5 What is 9 - ((-2010)/(-100) - 11)? -1/10 Evaluate (3/(-18))/((-7)/4 - -2). -2/3 Evaluate (3/(-6))/((-3)/(-12)). -2 Calculate (-328)/(-123)(-3)/2. -4 Calculate ((-1)/(-10))/((-132)/220)2. -1/3 What is the value of (-1 - -6)51/(-170)? -3/2 (1 - 1)(13 - 12) 0 ((-1)/3)/((-11 + 6)/(-5)) -1/3 What is 4(-6)/(-24) + 1? 2 (6 - (-68)/(-8))/(1/(-2)) 5 (9/(-30)2)/((-5)/(-25)) -3 Evaluate ((-5)/15)/(6/54). -3 What is (24/(-20) - 0)*(-55)/99? 2/3 (-2)/(-11) - (-72)/(-154) -2/7 Calculat	{ "pile_set_name": "DM Mathematics" }
7, 20125? 5028v + 13 What is the o'th term of 5513, 11121, 16719, 22301, 27861, 33393, 38891? -o3 + o2 + 5612o - 99 What is the q'th term of 2362, 2338, 2314, 2290, 2266, 2242? -24q + 2386 What is the t'th term of 42, 66, 96, 132, 174, 222, 276? 3t*2 + 15t + 24 What is the q'th term of 395, 612, 829, 1046, 1263, 1480? 217q + 178 What is the i'th term of -9727, -9728, -9729, -9730, -9731, -9732? -i - 9726 What is the q'th term of -104, -256, -458, -704, -988, -1304, -1646? q3 - 31q*2 - 66q - 8 What is the b'th term of 715685, 1431371, 2147059, 2862749, 3578441, 4294135? b*2 + 715683b + 1 What is the c'th term of 1699, 1701, 1677, 1615, 1503, 1329? -2c3 - c2 + 19c + 1683 What is the i'th term of -1705, -3380, -5055? -1675i - 30 What is the g'th term of -17186, -34351, -51516, -68681? -17165g - 21 What is the f'th term of 1260408, 1260407, 1260406, 1260405, 1260404? -f + 1260409 What is the r'th term of 36, 131, 290, 513, 800, 1151, 1566? 32r2 - r + 5 What is the w'th term of 53067, 106162, 159263, 212370, 265483? 3w*2 + 53086w - 22 What is the g'th term of 3642, 7290, 10938, 14586? 3648g - 6 What is the x'th term of -2482, -2472, -2458, -2440? 2x*2 + 4x - 2488 What is the m'th term of 1626, 4130, 6634, 9138? 2504m - 878 What is the n'th term of -230, -1043, -2414, -4337, -6806? n3 - 285n*2 + 35n + 19 What is the a'th term of -234, -989, -2262, -4053, -6362? -259a2 + 22a + 3 What is the o'th term of -294, -733, -1172, -1611, -2050, -2489? -439o + 145 What is the o'th term of 3523, 7079, 10633, 14185, 17735, 21283, 24829? -o2 + 3559o - 35 What is the l'th term of -1201204, -1201203, -1201202, -1201201, -1201200? l - 1201205 What is the n'th term of -933, -1240, -1751, -2466? -102n2 - n - 830 What is the j'th term of -546946, -546943, -546938, -546931, -546922, -546911, -546898? j2 - 546947 What is the c'th term of 737, 738, 739, 740? c + 736 What is the j'th term of 6805, 6855, 6947, 7087, 7281? j3 + 15j*2 - 2j + 6791 What is the k'th term of -181, -478, -829, -1234, -1693, -2206, -2773? -27k2 - 216k + 62 What is the f'th term of 353, 697, 1031, 1349, 1645, 1913, 2147? -f3 + f2 + 348f + 5 What is the z'th term of 77, 470, 1131, 2060, 3257, 4722, 6455? 134z*2 - 9z - 48 What is the k'th term of -20185, -40379, -60569, -80755, -100937, -121115? 2k2 - 20200k + 13 What is the g'th term of -1860, -7405, -16636, -29547, -46132, -66385? g*3 - 1849g*2 - 5g - 7 What is the u'th term of 14013, 56105, 126257, 224469, 350741, 505073? 14030u2 + 2u - 19 What is the m'th term of -1936, -777, 382, 1541, 2700, 3859? 1159m - 3095 What is the m'th term of -15097, -15129, -15161? -32m - 15065 What is the q'th term of -7773, -7766, -7755, -7740, -7721, -7698, -7671? 2q2 + q - 7776 What is the w'th term of 26194, 52370, 78546, 104722, 130898? 26176w + 18 What is the i'th term of -418, -166, 86, 338, 590? 252i - 670 What is the n'th term of 576, -784, -2144? -1360n + 1936 What is the i'th term of -99, -159, -219, -279, -339? -60i - 39 What is the g'th term of 1017, 4279, 9701, 17277, 27001? -g3 + 1086g*2 + 11g - 79 What is the j'th term of 1293, 2560, 3835, 5118, 6409? 4j2 + 1255j + 34 What is the d'th term of -7, -46, -85? -39d + 32 What is the k'th term of -450, -875, -1280, -1665, -2030? 10k*2 - 455k - 5 What is the j'th term of 6633, 13277, 19921, 26565, 33209? 6644j - 11 What is the g'th term of -18195, -18192, -18189, -18186, -18183, -18180? 3g - 18198 What is the p'th term of 8344, 8331, 8308, 8275, 8232, 8179? -5p2 + 2p + 8347 What is the c'th term of 848, 6819, 23026, 54587, 106620, 184243? 853c3 - 5 What is the x'th term of -736, -725, -704, -673, -632, -581? 5x*2 - 4x - 737 What is the z'th term of 53465, 106974, 160485, 214004, 267537, 321090, 374669, 428280? z*3 - 5z*2 + 53517z - 48 What is the j'th term of 178113, 356220, 534327, 712434, 890541, 1068648? 178107j + 6 What is the l'th term of 228, 239, 250, 261, 272, 283? 11l + 217 What is the k'th term of 1700, 1544, 1388, 1232, 1076, 920? -156k + 1856 What is the v'th term of -576, -1160, -1740, -2310, -2864, -3396, -3900, -4370? v3 - 4v*2 - 579v + 6 What is the h'th term of 275, 1077, 2411, 4277, 6675, 9605, 13067? 266h2 + 4h + 5 What is the g'th term of -52, -72, -92? -20g - 32 What is the m'th term of -4031, -8063, -12095, -16127, -20159? -4032m + 1 What is the x'th term of 1380, 2758, 4136, 5514, 6892? 1378x + 2 What is the s'th term of 168, 151, 120, 69, -8? -s3 - s2 - 7s + 177 What is the f'th term of 75, 179, 347, 603, 971? 4f3 + 8f*2 + 52f + 11 What is the g'th term of -14, -183, -346, -503, -654? 3g2 - 178g + 161 What is the x'th term of 3424, 13677, 30770, 54703, 85476? 3420x2 - 7x + 11 What is the b'th term of 448593, 448604, 448619, 448638, 448661? 2b2 + 5b + 448586 What is the r'th term of 24, -75, -234, -483, -852, -1371, -2070? -5r3 - 64r + 93 What is the w'th term of 2400, 2397, 2392, 2385, 2376? -w*2 + 2401 What is the h'th term of -172, -25, 122? 147h - 319 What is the v'th term of 668, 1506, 2694, 4406, 6816? 29v3 + v2 + 632v + 6 What is the k'th term of -5183, -10404, -15627, -20852, -26079? -k*2 - 5218k + 36 What is the r'th term of 79832, 79828, 79824, 79820, 79816? -4r + 79836 What is the j'th term of 7216, 7240, 7266, 7294, 7324, 7356? j2 + 21j + 7194 What is the c'th term of 2261, 2008, 1755? -253c + 2514 What is the u'th term of -3872, -7728, -11588, -15452? -2u*2 - 3850u - 20 What is the s'th term of 9799, 39154, 88079, 156574? 9785s2 + 14 What is the o'th term of 5029, 20104, 45227, 80398? 5024o*2 + 3o + 2 What is the q'th term of 42871, 42800, 42729, 42658, 42587, 42516? -71q + 42942 What is the f'th term of -11, -113, -431, -1073, -2147, -3761, -6023? -18f*3 + 24f - 17 What is the i'th term of -470, -1919, -4348, -7763, -12170, -17575? -i*3 - 484i*2 + 10i + 5 What is the s'th term of -23, -101, -181, -263, -347, -433? -s*2 - 75s + 53 What is the h'th term of -20442, -20469, -20514, -20577, -20658, -20757, -20874? -9h2 - 20433 What is the d'th term of 102, 28, -46, -126, -218, -328, -462? -d3 + 6d*2 - 85d + 182 What is the s'th term of 12088, 12047, 12006? -41s + 12129 What is the g'th term of -23404, -23400, -23388, -23362, -23316? g3 - 2g*2 + 3g - 23406 What is the c'th term of -12, -55, -132, -255, -436, -687? -2c3 - 5c*2 - 14c + 9 What is the g'th term of 27907, 27905, 27903? -2g + 27909 What is the h'th term of 60570, 60574, 60588, 60618, 60670, 60750? h3 - h2 + 60570 What is the z'th term of 4112, 7676, 11242, 14810? z2 + 3561z + 550 What is the d'th term of 227, 260, 285, 302, 311, 312? -4d2 + 45d + 186 What is the u'th term of -31286, -125140, -281564, -500558, -782122, -1126256, -1532960? -31285u2 + u - 2 What is the d'th term of 5, 43, 161, 401, 805, 1415? 7d*3 - 2d*2 - 5d + 5 What is the g'th term of 136318, 272630, 408942, 545254, 681566? 136312g + 6 What is the r'th term of 2660, 10643, 23948, 42575, 66524, 95795? 2661r2 - 1 What is the p'th term of 1526, 3038, 4548, 6056, 7562? -p2 + 1515p + 12 What is the o'th term of 654, 1274, 1908, 2562, 3242? o3 + o2 + 610o + 42 What is the o'th term of 893811, 1787625, 2681439? 893814o - 3 What is the p'th term of 1883, 1870, 1857, 1844? -13p + 1896 What is the q'th term of 2426, 9436, 21118, 37472, 58498, 84196, 114566? 2336q2 + 2q + 88 What is the v'th term of 98, 133, 200, 305, 454, 653, 908, 1225? v*3 + 10v*2 - 2v + 89 What is the i'th term of 68848, 137699, 206552, 275407, 344264, 413123, 481984? i*2 + 68848i - 1 What is the v'th term of 487, 122, -243, -608, -973, -1338? -365v + 852 What is the y'th term of -993, -1005, -1017, -1029, -1041? -12y - 981 What is the t'th term of -3223, -3222, -3221, -3220? t - 3224 What is the k'th term of -95291, -95304, -95317, -95330, -95343, -95356? -13k - 95278 What is the x'th term of -95000, -190006, -285012, -380018, -475024, -570030? -95006x + 6 What is the a'th term of 8081, 14245, 20423, 26621, 32845, 39101? a3 + a2 + 6154a + 1925 What is the n'th term of 7, 28, 49? 21n - 14 What is the i'th term of -196, -	{ "pile_set_name": "DM Mathematics" }
Solve -3h + t - 2 = 0, -491t = h - 486t + 54 for h. -4 Solve 112n - 117n = -f + 22, 3f - 11 = 4n for f. -3 Solve 6y - j + 17 = 33, -2j = 4y - 16 for y. 3 Solve -3 + 8 = k - 4b, -4k = 5b + 22 for k. -3 Solve -p + 6 = 4v, -3v - 4543p + 4544p + 1 = 0 for v. 1 Solve -3b + g + 771 = 756, 25 = 5b - g for b. 5 Solve -6l + 3f - 27 = 0, -5l + 8223f - 30 = 8219f for l. -2 Solve 0 = -3o - 2r + 1, -o - 4r + 402 - 395 = 0 for o. -1 Solve 0 = -3u - 3j - 12, 4j - 9 = 165u - 164u for u. -5 Solve -33 = m - 4q, -5m - 8q + 8q = -3q + 12 for m. 3 Solve 34 = -4d - 5y, 0 = -3d + 501y - 506y - 28 for d. -6 Solve -5t = -3c - 47, 4c = 3t - 45 - 3 for c. -9 Solve -4x + 31 = -4g + 9g, 5 = x + 4g for x. 9 Solve -26j = -31j - 2o + 11, 0 = -4j - 4o + 16 for j. 1 Solve 5p = -3a - 226 + 222, 0 = -p + 4a - 10 for p. -2 Solve 0 = -3n + 4k + 78, -4n - 11k = 439 - 249 for n. 2 Solve 14 = 10z - 4r, -5z - 4r - 1128 = -1159 for z. 3 Solve -9r - 3s - 30 = -9, -5r + 122s - 121s - 25 = 0 for r. -4 Solve 5p + 71u = 70u + 8, -3p = -4u + 9 for p. 1 Solve -3m - 5 = -4o - 2, -m + 2o - 3 = 0 for m. 3 Solve 15o + 0g = -g - 62, 10o - 8o + 2g = -12 for o. -4 Solve 4j = 5y - 130 + 108, 8 = -2y - 4j for y. 2 Solve -8 = -4w - 4a, w - a - 6 = 6 for w. 7 Solve 66 - 87 = 3x - y, x - 2y + 27 = 0 for x. -3 Solve 0 = 3q - 5y + 13, 0 = -q - 692y + 696y - 9 for q. -1 Solve x - 9 = -5a, -10x + 5a = 739 - 774 for x. 4 Solve -2l - 10 = 0, -5s = 1073l - 1075l - 20 for s. 2 Solve -3b + 16 - 37 = -4f, -3b = -3f + 18 for f. 3 Solve -2q - 349y = -354y + 11, -2q - 2y + 10 = 0 for q. 2 Solve 136m - 3s + 16 = 140m, -4m + 3s = 8 for m. 1 Solve -154z = -152z + u - 13, 0 = -5z - 3u + 33 for z. 6 Solve -6 = -2q - 4f, -10 = 2q - 2f + 2 for q. -3 Solve 135c - 113c - 2j - 114 = 0, -5j = -c + 69 for c. 4 Solve 0 = m - g - 5 - 0, -5m - 2g + 25 = 0 for m. 5 Solve -3d = 5v - 23, -5d + 412 = -5v + 427 for v. 4 Solve -5u + 4r - 19 = 0, -5u - 3r + 2r = -11 for u. 1 Solve 11t + 3v = -34, 0 = -5t - 438v + 443v + 10 for t. -2 Solve 0 = -2y + g - 87 + 52, -3g - 300 = 21y for y. -15 Solve m = -5288 + 5286, -5m - 7 = -3n for n. -1 Solve 6o = 3k + 3o, -35o + 33o = -12k for k. 0 Solve 5t + 5b + 15 = 0, 5t - b - 4001 = -4028 for t. -5 Solve 3g - 5k - 1 = 12, -83 = -g - 12k - 106 for g. 1 Solve 1907y = -2t + 1902y + 52, -t = 2y - 20 for t. -4 Solve 178s - 174s - 3j + 18 = 0, 0 = -2j + 4 for s. -3 Solve -9z + 56 = -5f, -2z + 149 = -5f + 156 for f. 5 Solve -4i = -107311t + 107296t + 10, 0 = i - 5t for i. -10 Solve -2z + 3c - 21 = 0, z - 1411c + 1406c = -35 for z. 0 Solve x = -15h + 17h - 18, 0 = 4h + 7x + 54 for h. 4 Solve 5u - 22 = -2n, -7n - 211 = 5u - 238 for u. 4 Solve -4l + 12 = 4d, -4d - 13 = 3l - 21 for d. -1 Solve -14i - 40 = 4b, 11 - 24 = -i + 5b for i. -2 Solve 4u + 2s + 12 = 0, -1724s + 18 = u - 1734s for u. -2 Solve -5 = -5x + 2v, -36x + 34x + 4v + 18 = 0 for x. -1 Solve -h = 5b - 22, -2h - 2748 = -2762 for b. 3 Solve -4k - 8 = -2m, 13m - 12m = -2k + 4 for k. 0 Solve 3s + 1 = 2m, 3m - 8 + 2 = 0 for s. 1 Solve -2s + 7h = -21, 125s = 124s + 2h + 6 for s. 0 Solve 20 - 4 = 2i - 4g, 0 = 3g + 15 for i. -2 Solve 6v = 9v - 3n, 5v - 2n = 15 for v. 5 Solve -2i - 23 = 5s, 6s - 2i + 4 = 2s for s. -3 Solve 0 = -2n + 4j + 34, -44n + 46n + 2j + 8 = 0 for n. 3 Solve -5k + 5c + 55 = 0, -35c + 30c = 2k + 20 for k. 5 Solve 15 = k - 2s, -2s = -3k + 1442 - 1417 for k. 5 Solve 12a - 18a - 15 = -62y + 59y, 0 = -y + 3 for a. -1 Solve 0 = t - 16, -3s - 8 - 17 = -4t + 42 for s. -1 Solve 2z + 2l = -4, 4l + 2 = 1069z - 1071z for z. -3 Solve 40 = f + 3b - 22, 0 = f - 4b + 71 for f. 5 Solve -4u = 5a - 56, 2a + 52 = 3u + 7a for u. 4 Solve -24i + 20i - 2c = 4, -3i + 7c = 20 for i. -2 Solve 4n + 47u + 156 + 7 = -5, -13 = -n + 2u for n. 5 Solve -3t + 2s = -8, 6t + 3s + 5 = 7t for t. 2 Solve 15r - 17r + 22 = 5n, -4n = r - 17 for n. 4 Solve -25 = -4w + 3d, 5w - 26d - 23 = -25d for w. 4 Solve -2z + 18 = 3c, -18c = 4z - 58 - 2 for z. 6 Solve -293f + 3p + 8 = -291f, 0 = 4f - 2p - 16 for f. 4 Solve 5c = -2b - 17, 9b = 12b + c + 6 for b. -1 Solve 162o - 126o - 27 = -5t, -o - 4t = 34 for o. 2 Solve -a - 29 = 5u + 3a, 3459u - 3454u + 5a + 30 = 0 for u. -5 Solve 3c - 4d = 7, 18c - 20c - 3d = 1 for c. 1 Solve 31 = y + 4w, 4y = 29w - 33w + 88 for y. 19 Solve -r = -4x + 20, -25x = -24x - 5 for r. 0 Solve -s - 155i = -152i + 12, i = -4 for s. 0 Solve -3j - 6j - 5g - 63 = -13j, 2g = -22 for j. 2 Solve 4d = 5b + 33, -2d + 21 = -19b + 18b for d. 12 Solve -2i = 60n - 58n + 10, -3i = 4n + 19 for i. -1 Solve r - 5p - 1 - 6 = 0, 0 = r - 3p - 3 for r. -3 Solve 0 = -2p + 2, f - 6f - 91p - 18 = -89p for f. -4 Solve 5z = h - 6h + 15, 2h - 782 + 784 = 0 for z. 4 Solve 3p - 25 = -4l, 2p + 5l - 1 = 18 for p. 7 Solve 4r - 1 = h + 2r, -5h + 1431r = 1436r + 20 for h. -3 Solve -34 = -3s - 5z, 12 = -2s + 6z - 5z for s. -2 Solve 4g = 3u + 37, 4g = 262u - 261u + 23 for g. 4 Solve 6w - 16 = -5r + 72, 0 = 3w + 4r - 47 for w. 13 Solve 4g + 3x + 3 = 0, 12041g - 12043g - 3 = 3x for g. 0 Solve 3v = -7p + 764 - 760, -4v = -3p - 30 for p. -2 Solve 5w - 5 = 5f, 3w - 54 + 39 = -3f for f. 2 Solve -2 = f + 3h, 4f - 304 = 2h - 242 for f. 13 Solve 5u = -3o - 32, 0 = 20o - 35 + 15 for u. -7 Solve 19 = 3r - 4g, 2r - 3g - 21 + 8 = 0 for r. 5 Solve c - 2k = -7, 5c + 29 = 150k - 146k for c. -5 Solve 0 = -f + 2z - 112 + 120, 3z - 27 = -5f for f. 6 Solve -4i = 2d + 18, 0 = -2i - 413d + 410d - 35 for i. 2 Solve g + 66r = 65r + 5, -5r = 2g - 16 for g. 3 Solve 4y - 2y + 5g = -7, 8y + 2g + 13 = -3g for y. -1 Solve 39d = 43d + 5o + 47, 0 = 4d + 9o + 59 for d. -8 Solve -17 = l + 3w, 230l - 5w - 23 = 229l for l. -2 Solve 271x - 253x = 2o + 98, -x + 1 = o for x. 5 Solve 0 = 3w + n - 494 + 506, 4n = 4w + 32 for w. -5 Solve -2l + 11y - 15y = -22, 0 = -l + 5y - 10 for l. 5 Solve -4q + 5x - 16 = 0, 3q = 2x - 579 + 567 for q. -4 Solve -21j + 5g = -23j + 40, -j = 3g - 25 for j. -5 Solve -m + 5w - 60 = 0, -107 = 4m - 4w - 59 for m. 0 Solve -5 = -d + 3s, 2d + 20s - 10 = 18s for d. 5 Solve 0 = a - 5r - 22, 219a - r = 218a + 6 for a. 2 Solve 2l + 4d - 26 = 0, 0 = 2726d - 2728d + 8 for l. 5 Solve -6f = w - 30, 181f - 8 = -2w + 182f for w. 6 Solve 4v - 16 = 47b - 43b, -5v - 50 = 5b for b. -7 Solve -4h - 14 = 123i - 121i, -16 = 4i - 4h for i. -5 Solve -2691s + 5n + 28 = -2690s, 2s + 3n = -9 for s. 3 Solve -k + 35 = 5a + 14, -4k + 8 = a for k. 1 Solve -9n = -19n + 5g + 165, -4n + 63 = -g for n. 15 Solve 2z = -2f + 14, -3f + 29z + 29 = 36z for f. 5 Solve -5 = 3v - g, 85v - 10 = 90v - 2g for v. 0 Solve 4v - 12 = -2078o + 2083o, 3o + 22 = -5v for o. -4 Solve 4s + 5g + 3 = -37, 3s = 5g + 5 for s. -5 Solve 4r - 3q = -19, 1274r = 1269r + 2q - 22 for r. -4 Solve 0 = d + 8b - 254, 14884d - 14881d + 70 = 2b for d. -2 Solve 3w + 14 = -j, -210j + 213j + 22 = -5w for j. 1 Solve 0 = -s + k - 1, -s - 2k = -15 + 25 for s. -4 Solve 0 = -w - 4 + 1, -3w - 58 + 67 = -2i for i. -9 Solve -s + 2y = -17, 0 = -4480y + 4483y + 12 for s. 9 Solve -q + 8824 = -3n + 8756, -2n - 42 = 0 for q. 5 Solve 0 = -2j + 8, 2j = -4y - 9 + 1 - 0 for y. -4 Solve -4v - 3p = -6, 0 = 5v + 4p - 22 + 15 for v. 3 Solve -3o = -2p - 34, -5o + 2p = -19 - 35 for o. 10 Solve l = 3v - 32, 150l - 42 = -5v + 146l for v. 10 Solve 0 = 5v - 4a - 32, -929v - 1 = -924v + 7a for v. 4 Solve -3y = 5q + 12, -2y + 7 + 10 = -5q for q. -3 Solve 377p - 4r = 374p + 13, -19 = -5p + 4r for p. 3 Solve -6n - 7n = -9n + 92, -2f = -4n - 86 for f. -3 Solve 2h = i - 13, 70i - 75i = -3h - 37 for h. -4 Solve 4s + k = -19, s + 46 = -3203k + 3200k for s. -1 Solve -3 = 3n - g - 5g - 24, -g + 1 = 0 for n. 9 Solve -44n - 4j = -48n + 8, -3n + 10 = -5j for n. 0 Solve -10 = -5p + 2v, 2v + 49 = 4p + 41 for p. 2 Solve 151y + 63 = 9f + 156y, 5f - 35 = 5*y fo	{ "pile_set_name": "DM Mathematics" }
e Let v be (0 - -2) + 6/(-2). Let o be 66/55 - v/(-5). Is o less than 7/6? True Let t = -11.4 + 11. Is 3 <= t? False Let b be (3/(-46))/(-3)-4. Let q = 21 - 16. Suppose qj = 10 - 15. Which is smaller: b or j? j Let g be ((-2)/(-10)-53)/(132/(-660)). Is 51 greater than or equal to g? False Let t(o) = -o3 + 95o*2 - 2 - 6o + 0 + 8 - 89o2. Let g be t(5). Which is smaller: -2 or g? -2 Suppose 42w = 47w + 5. Suppose 4n - 3x = 7, 5x = -n - 3 - 24. Which is bigger: w or n? w Let i be 14/4 - (2 + -1). Suppose 0 = -5m - 5m - 70. Let f be (m/(-14))/(-1(-2)/12). Which is smaller: i or f? i Suppose 16l + 904 = 216. Is -42 less than or equal to l? False Let z = -1 - -1. Let c(w) = w + 3 + 4w2 - 5w*2 + 3w. Let l be c(0). Which is smaller: l or z? z Let d be (150/(-35))/(1/(-7)). Suppose -2z - 6y + 2y - d = 0, -4y = 20. Let w(b) = -b - 10. Let k be w(-7). Which is greater: z or k? k Let r = 102 + -80. Let x = -11 + r. Do x and 11 have different values? False Let w = -10 + 11. Let r(s) = 10s - 13. Let i be r(4). Let f be (-51)/3428/i. Which is smaller: w or f? f Let o(z) = -z*3 + 10z2 + z - 9. Let l be o(10). Let h = -46 - -1792/39. Which is greater: l or h? l Let f = 1 - 1.4. Let r = 0.2 + f. Let o(t) = -t2 - 7t - 10. Let m be o(-3). Which is bigger: r or m? m Let f = 0.4854 + 0.0546. Which is smaller: f or 1/15? 1/15 Let x = 108.1 - 107.6. Which is smaller: -194 or x? -194 Let f be (-10)/498/(-35). Let o(m) = m*3 - 8m*2 + 7m - 3. Let x be o(f). Which is smaller: -5/3 or x? x Let y = 1/87 - 34/435. Suppose 5q + 2o + 3o + 25 = 0, o - 7 = 2q. Let f = -5 - q. Which is bigger: y or f? y Let q(f) = 7f + 4 + f2 + 0f + 4f - 4f. Let y be q(-7). Let k be (-1 - -8) + (4 - y). Are k and 6 unequal? True Let h = 6913/10 - 691. Let l = -1 - 0. Is h smaller than l? False Let y = -151 - -154. Is y less than or equal to 56/13? True Suppose 602 = 2d + 5a, -a - 2a = 2d - 602. Which is bigger: 299 or d? d Let c be 2 - (0 - (1 - 58)). Let k = -56 - c. Is k at most -16? False Let x = 2345281/858 - 8201/3. Let n = x - -4/39. Which is smaller: 0 or n? n Let m(k) = -k*3 + 15k*2 - 14k + 21. Let p be m(14). Suppose -2i + 0i - p = -5h, 0 = h - 3. Let x be 18/27 + (-16)/i. Do x and 6 have the same value? True Suppose 0 = 5o + 5s + 1300, -3s + 589 = -4o - 451. Is o greater than or equal to 1? False Suppose 8 = 4i - 4. Let w be ((-3 - -4)3)/i. Let j be -1 + w/(-4)1. Does j = 0? False Let y = 2.729 + -0.329. Do 0.4 and y have the same value? False Let b(t) = -t*2 - 8t + 12. Let q be b(-9). Suppose 2r = -qr. Let c = 397 + -5957/15. Is r less than c? False Suppose n = -6 + 11. Let u be (-22)/(-12) + n/(-45)3. Is u less than 2/17? False Let z = -3 + 3. Let n = -13591527/26 - -522688. Let s = -63 - n. Which is bigger: s or z? s Let v(w) = -2w*3 + 3w*2 + 6w - 23. Let h be v(3). Suppose -f = -3f - 66. Is h at least f? True Suppose -50 = 5v + 235. Which is smaller: v or -55? v Let y = 8.4 - -1.5. Let s = 5.9 - y. Let a = -0.04 + -1.96. Which is greater: a or s? a Let u = 468123/749 + -625. Which is bigger: u or 1? 1 Let m = 10.8 + -20.7. Let k = 9.7 + m. Is -17 at most as big as k? True Let w be -3 - -3 - (-4)/54. Let b = 69 + -142. Let j = -72 - b. Is w equal to j? False Let w = 9.92 + 0.08. Let r = -0.0226 + 0.2226. Do w and r have different values? True Let d = 1312 - 1236.9. Let p = -75 + d. Which is smaller: 1/2 or p? p Let v be (-16)/(-4)3/8. Let n be -1 - 30 - 0 - -2. Let x = n - -30. Do x and v have different values? True Let o = 1539 + -1588. Is o at most as big as 5? True Let j = 22 - -6. Let y = j + -28. Let b = 1/47 + 87/329. Are y and b equal? False Suppose 3b + 32 = 47. Let u be (-2 - -1)/1 - -5. Let q = 2 + u. Which is smaller: q or b? b Let p = 18.9 - 19. Let a be (-4)/(-126)(-6 - -165). Let w = a + -16/3. Is w equal to p? False Let j be 2/8 - (-1195)/20. Let z be (-6)/(-4) + j/(-80). Which is smaller: 1/8 or z? 1/8 Let t = -11917.9 - -12484. Let l = 601 - t. Let d = 35 - l. Which is smaller: d or 0.06? 0.06 Let z = 7/2 - 3. Suppose a + 4i = -0i - 18, 60 = -4a - 4i. Let w be -5(-3 + a/(-5)). Which is smaller: z or w? z Let m = 92.95 - 93.4. Which is bigger: m or -0.1? -0.1 Suppose -3b - 15 = 2b. Let w(n) = -n*3 + 51n*2 - 100n + 94. Let l be w(49). Which is smaller: l or b? l Let p = -1801/7 + 256. Let n be 9 + (17 - 3 - 24). Is p less than n? True Let v(n) = n*2 + 5n - 204. Let h be v(12). Which is smaller: h or -18? -18 Let r(z) = z*2 + 5z - 4. Let d be r(-8). Which is smaller: -5 or d? -5 Let k = 46 - 30. Let l be k/44/(-14). Suppose 2d = 1 - 3. Is l at most d? True Let m(b) = -6b - 12. Let l be m(-4). Let k be (l/(-18))/(1(-2)/3). Is -42 greater than k? False Suppose -4n + 19 = 3u, 2n + u - 9 = -0u. Let h = n + -4. Let f be (-3)/(-4)6/(-9). Which is smaller: h or f? f Let k = 58 + 519. Which is smaller: 578 or k? k Let x = -2.4 - -1.4. Let s = -89 - -88.99. Are s and x equal? False Let f be 210/150 - 6/(-10). Let y = 292 + -2040/7. Is f bigger than y? True Let b = -6 + 7. Let z be -3((-4)/6 + -2). Let l = -14 + z. Is b at least l? True Let z be -5 - (2/(-4) - (-102)/(-10)). Which is greater: 5 or z? z Let f be ((-4)/(-5))/((-4)/(-10)). Let j = -118 - -124. Let i be ((-30)/70)/(j/(-4))14. Which is greater: f or i? i Let j = -174 - -95. Let x = -82 - j. Which is greater: x or -0.02? -0.02 Let j be (-12)/3510/(-4). Suppose 0 = 3c + 3s, c = 2c + 2s + 4. Suppose 0 = 3i - h - 2, -2i + 2h = -5i - c. Do j and i have the same value? False Let b = 1/3840 + 6971/2722560. Is b at least as big as 1? False Let a = -352 + 353. Does 2/199 = a? False Let b be (-92)/6 - 1/(-3). Let q(w) = w*2 - 3w - 8. Let n be q(4). Let t = n - 10. Is t != b? True Let g be 1 + (54/(-10))/3. Let n = -78.845 + -0.155. Let x = 79 + n. Is g greater than x? False Let u = 232418/9 - 25855. Let d = u - -31. Let b = -2.7 + 2.9. Is d greater than b? True Suppose -7470 + 7668 = 6y. Which is bigger: y or 7? y Suppose -4m + b + 22 = 4b, 24 = 4m + 4b. Suppose c = 4y - 0y + 42, -3y - 22 = mc. Let n be 9/(81/y)3. Which is smaller: -2 or n? n Let n = -627/119 - -126/17. Which is greater: n or 1? n Let v = 0.2849 - 0.1849. Is 223 bigger than v? True Let r(z) be the third derivative of -7z4/24 + 4z*3 + 14z2. Let o be r(5). Let f(n) = n3 - 5n2 + 2n - 3. Let s be f(4). Is o bigger than s? False Suppose 12n - 7n - r = -5, 0 = -5n - 3r + 15. Are 9/7 and n non-equal? True Let q be 4/(-14) + (-348)/(-42). Suppose 0 = -5g + q + 12. Let y be 6(g + (-5)/2). Which is bigger: 8 or y? y Let z be (-80)/15(-20)/(-16). Let m = z + 50/9. Is -1 > m? True Let w be (-1 + 43)/(6/4). Let y be -1085/(-30) - (-12)/(-9). Is y != w? True Suppose 3b + t - 2 = 0, 2t = 5b - 2t - 9. Let g = 8 - 7. Let r be 7 + -3 + -1 - g. Which is greater: b or r? r Let y = -18.12 + 16.12. Do 8.6 and y have different values? True Let k be ((-8)/1)/(11/(-2)). Let s(g) = g*2 + 45g + 267. Let x be s(-7). Is x > k? False Let v = -289 - -866/3. Is 4 greater than or equal to v? True Let j = 6.93 + -7.3. Let t = -5/12 - -1/12. Is j at most t? True Let v = 11394/19 - 600. Suppose 13q - 16q - 28 = -5x, -23 = 3q - 4x. Do q and v have the same value? False Let c = -547/9116 + -7/212. Does c = -1? False Let n = -514 + 4600/9. Is -0.2 < n? False Let u = 213.35 + 5.65. Do 2 and u have different values? True Let s = -1 - 0. Let w be (3 - -4) + s - -1. Which is bigger: w or 1? w Let b(m) = m2 + 10m - 14. Let v be b(-11). Let g be ((-36)/(-54))/(50/v). Which is smaller: g or 0? g Let h = -181 + 103. Let q be 24/h(-3)/3. Let j = 4 - 5. Is j < q? True Let b be (14/4)/((15/(-2))/5). Which is greater: 2 or b? 2 Suppose -3b - 15 - 12 = 0. Let g be (-2 - -1)(b + 14). Let k = -4 - g. Is k smaller than -8? False Let w be (-1)/1(11 + -16). Let l be -9 + 6 - 1/(2/(-18)). Which is greater: w or l? l Let p = 55.4 + 1.6. Let j = 46 - p. Is 0.1 equal to j? False Let f = -0.1 - -1.9. Let n = -6.2 - f. Let p = n - -1. Is p greater than -0.1? False Let q = -449 - -426. Is q < -23? False Let s be 1/7 + (-1)/7. Let x = 775/8 - 97. Let c = x + -1/8. Is s at most c? False Let z be ((-780660)/(-368))/(-9) - 2/8. Let x = -236 - z. Which	{ "pile_set_name": "DM Mathematics" }
20 - p. Is 3 a factor of h? False Let d(x) be the second derivative of -x*4/12 + 5x3/3 - x2/2 + 150x. Let q = 12 - 3. Is 2 a factor of d(q)? True Suppose -33k = -29k - 152. Let y be 0/(3/(3/(-2))). Suppose y = -w - w + k. Is w a multiple of 13? False Let f(r) be the first derivative of r2 + 22r + 12. Is f(7) a multiple of 7? False Suppose 4n + b - 422 = -0b, 5b + 200 = 2n. Suppose 0 = 4d + 2d - 360. Let h = n - d. Does 15 divide h? True Let v be (36/54)/(2/36). Suppose -5b + 117 - v = 0. Is 3 a factor of b? True Let a(r) = 0 - 5r + 18 + 4r. Let h be a(0). Is 22 a factor of ((-6)/h)/(1/(-69))? False Is 3 a factor of (-8 + (-1380)/(-10))24/10? True Let h(y) = 45y - 77. Is 23 a factor of h(15)? True Let o(p) = 3p*2 + 95p + 3. Is 29 a factor of o(16)? True Suppose 2n - 14 = -5h + 28, 0 = h - 4n - 4. Let d be (h + 16)/(3/(-2)). Let f = d + 40. Is f a multiple of 7? False Let l = 878 - 249. Is 17 a factor of l? True Suppose 7 = -3a - 5, 82 = -5z + 2a. Is 10 a factor of (-57)/224/z? False Let d be (14-2 - -1)/((-6)/40). Suppose 7i - d = 6i. Is i a multiple of 19? False Let i(v) = 224v - 209. Does 39 divide i(12)? False Suppose -938 = 5p - 8p - u, -4p - 3u + 1244 = 0. Does 37 divide p? False Let h = -4416 + 6409. Is h a multiple of 26? False Let i = -2590 - -3310. Is 24 a factor of i? True Let x(p) = 27p*2 - 10p - 63. Is x(-4) a multiple of 13? False Suppose 3z - 1498 = -t + 265, -4t - 1753 = -3z. Suppose 5c + 147 = z. Does 11 divide c? True Let o = 48 + -82. Let q = o - -84. Does 25 divide q? True Let t(f) = f*3 + 6f*2 - 5f - 8. Let y = 23 - 13. Let i = y - 16. Does 11 divide t(i)? True Let p = -10 + 11. Suppose 2g + 1 = -p. Is 12 + g - 1/1 a multiple of 3? False Let f = -6 - -2. Let j = f - 2. Let k(q) = q3 + 5q*2 - 8q - 3. Is k(j) a multiple of 3? True Does 45 divide ((-2)/(-3))/(-77/(-40131))? False Suppose -40o + 16 = -36o. Is 3 a factor of o? False Let p = -11 + 8. Let b = p + 160. Is 14 a factor of b? False Let d be -1(-3)/(-6)10. Let a be (2/(-4))/(d/(-60)). Let l(v) = -5v - 8. Is 11 a factor of l(a)? True Let d(w) = -13w + 8w - 16w + 2. Is d(-2) a multiple of 11? True Suppose 139 = -2i + 387. Is 15 a factor of i? False Suppose -2s - 8496 = -6s + 4b, s - 3b = 2128. Is 13 a factor of s? False Let k(u) = -220u2 - 2u - 2. Let z be k(-1). Let r = z + 317. Let v = r + -67. Is v a multiple of 15? True Let b(v) = 2v - 5v + 3v2 - 3v*3 + 2v - 2v2. Is b(-2) a multiple of 9? False Let y = -79 + 75. Is 41 a factor of (-11)/((-11)/y) - -291? True Let k(v) = -2v + 11. Let u be k(5). Is 11 a factor of (330/(-75))/(u/(-30))? True Let k(c) = -c*2 + 4c + 5. Let i = 2 + 4. Let x be k(i). Let t(y) = 2y2 + 9y + 1. Does 12 divide t(x)? True Suppose 0 = -2u - 3m + 7m + 1604, 1597 = 2u + 3m. Is 10 a factor of u? True Let q be (-27 - -27)(2 - 3/2). Suppose 0 = 2b - 2g + 28, -2b - 4g + 9g - 43 = 0. Is (-3 + (q - -2))b a multiple of 7? False Let m(f) = -2f2 - 45f + 34. Let v be m(-23). Let t(h) = 13 - 11h - 2 + h2 - 2. Is t(v) a multiple of 4? False Suppose 6804 = 37m - 10m. Is 36 a factor of m? True Let m(b) = b3 + 9b*2 + 7b + 10. Let q be m(-8). Let t be (60/q)/((-4)/6). Let a(c) = -c + 3. Does 5 divide a(t)? False Let t = 2245 - 813. Does 89 divide t? False Suppose -26r + 19383 + 1547 = 0. Is 23 a factor of r? True Let o be 2 + (-4 - (-15 + 1)). Is 8 a factor of 784/20 - (o/10 + -1)? False Suppose z - 95 - 321 = 0. Does 3 divide z? False Let v = 47 - 49. Let u = v + 23. Does 7 divide u? True Let p(d) = -d2 + 3d - 2. Let x be p(2). Suppose -2y - q - 1 = x, 3q + 1 + 0 = -5y. Is ((y - 208)/3)/(-1) a multiple of 35? True Let z = -741 + 1281. Does 27 divide z? True Is 14 a factor of (3 - 1)/(-2) - (-274 - 49)? True Let w(g) = -g2 - 3g + 6. Let p be w(3). Let u = 80 + p. Is 17 a factor of u? True Let z(j) = 50j2 + 3j - 4. Let x(b) = -b + 1. Let t(s) = -4x(s) + z(s). Is 16 a factor of t(2)? False Let a(v) = -v3 - 6v*2 + 7. Let q be a(-6). Let r = 1 - q. Let o(s) = -10s - 12. Is 16 a factor of o(r)? True Let v be (-57/1 + 0)-6. Suppose v = y + y. Is y a multiple of 15? True Let g(f) = f*3 + 18f*2 + 26f - 12. Let s be g(-17). Let h(d) = -d*3 + 4d*2 - 4d - 7. Let q be h(6). Let t = q - s. Does 17 divide t? False Let j = 786 + -397. Is j a multiple of 14? False Suppose -92q = -110q + 6372. Is 4 a factor of q? False Let a = -59 - -61. Suppose 103 = 4b + 5t, -5t + 105 = 4b - at. Is 3 a factor of b? True Let a = 52 + -92. Is 10 a factor of 50/4(-32)/a? True Let s be (251 - 0)/(3 + -4). Let m = s - -372. Does 33 divide m? False Suppose -5826 = -12k + 2310. Let q = -457 + k. Does 19 divide q? False Suppose -4r + 8r = -12, 3m + 4r = 1056. Is m a multiple of 18? False Let j = -1047 - -1496. Is 32 a factor of j? False Let u(i) = 17i*2 - 19i + 98. Is 38 a factor of u(7)? True Suppose 4u = 46 - 2. Let l(i) = i2 - 4i - 26. Is 17 a factor of l(u)? True Let y = 1621 - 443. Does 38 divide y? True Suppose 0 = -y + 16y - 1500. Does 12 divide y? False Suppose -8b - 575 + 3055 = 0. Is 4 a factor of b? False Suppose 16 = 2b + 4g, -3g + 2g + 6 = b. Suppose -i - bi + q + 234 = 0, 3q = -12. Suppose 0 = 3a - i - 44. Is a a multiple of 17? False Suppose -1249c = -1255c + 1596. Does 17 divide c? False Let c(j) = -j2 - 10j - 6. Let v be c(-9). Is 318 - (-1 - v) a multiple of 7? False Suppose -2o + 96 = 2q + 14, -3o - 2q + 123 = 0. Suppose -h = -4x + 171, o + 28 = x + 5h. Is x a multiple of 22? True Suppose 0 = -4a + a. Let p be a(-4 - 14/(-4)). Suppose -5f + 230 = -pf. Does 23 divide f? True Suppose -27y = -68y + 6396. Does 8 divide y? False Let x(m) = 7m - 64. Suppose 32c = 31c + 10. Is 3 a factor of x(c)? True Suppose 0 = -17c - 23519 + 88442. Does 19 divide c? True Suppose 2u = -3c + 486, -c + 9u = 4u - 179. Is 41 a factor of c? True Suppose -57k - 12760 = -62k. Does 88 divide k? True Let x(y) = -12y - 6. Let a be x(-11). Suppose 5q - 4 = 41. Is 7 a factor of 1/2a/q? True Let i(s) = -2s3 - 9s*2 - s. Let f = -6 - 1. Let n be i(f). Does 19 divide (2 - 4) + n/4? False Suppose -p = -0u - u + 546, -2p = 2u - 1092. Does 26 divide u? True Suppose -6a = -8a + 990. Does 9 divide a? True Suppose -s + y + 131 = -3s, 2 = 2y. Let u = -16 - s. Is 10 a factor of u? True Let n be 14/63 + 2/(-9). Let f be -4 + 2 + n + 3. Is 9 a factor of (11 + -12)/(f/(-44))? False Let f = -223 - -542. Let p = f - 210. Does 12 divide p? False Let p(m) = m*3 - 8m*2 + 7m. Let w be p(7). Suppose w = -42a + 38a + 112. Does 28 divide a? True Let q = -27 - -48. Suppose -3d + q = -42. Does 4 divide d? False Let h be -1 + 33/27 - 382/18. Suppose -7 = -5q + 3. Is (287/h)/(q/(-6)) a multiple of 18? False Let q = 8 - 43. Let s = q - -49. Is 5 a factor of s? False Is ((-192)/(-80))/(1/65) a multiple of 26? True Suppose 4x - c = -6c + 24, -3c - 12 = -2x. Let w(t) = -t*3 + 5t*2 + 15t + 2. Is 14 a factor of w(x)? True Let j(c) = -46c - 16. Let r = -43 - -38. Is 37 a factor of j(r)? False Let x(j) = j2 - 4j - 7. Let z(o) = -o*2 + 5o + 6. Let y(i) = 2x(i) + 3z(i). Does 11 divide y(5)? False Suppose 0 = -3k - 2k + 6000. Suppose -3q + k = 3d, 2d = -0d + 3q + 820. Suppose 370 = 9x - d. Does 11 divide x? False Let s(j) = 19j2 + 13j + 2. Does 3 divide s(2)? False Let i be (-97)/(-4) - (-9)/(-36). Let m = -92 + i. Let w = m + 97. Is 20 a factor of w? False Let o(b) = 45b2 + 31b + 65. Is o(-2) a multiple of 2? False Let o be (1/3)/(2/(-24)). Let z = 20 + o. Suppose -14h + zh - 24 = 0. Is 6 a factor of h? True Suppose -45p + 8465 = -7600. Is p a multiple of 28? False Let g(t) = 16t - 10. Let p be (-6)/12 + (-11)/(-2). Is g(p) a multiple of 10? True Suppose 5 = 4z - 3, 3s - 4z - 763 = 0. Let f = s + -57. Is f a multiple of 10? True Suppose 3r = -r - 8. Does 5 divide 12(8/18)/(r/(-3))? False Let n(s) = 8s - 32. Suppose -2b + 2m + 50 = 3b, 5b = -3m + 25. Is 7 a factor of n(b)? False Suppose 0 = 5h - 10h + 20. Suppose -6 = hp - 22. Let w(q) = 5q + 8. Is 11 a factor of w(p)? False Is 180/(-25)(-405)/9 a multiple of 18? True Let x(d) = 3d - 13. Let n be x(6). Let f be 63/(-28)(n	{ "pile_set_name": "DM Mathematics" }
91d + 40d*2 + 42 - 74d*2 + 39d*2 - 1511d. 5d2 - 20d + 42 Collect the terms in 239 - 237 - 344y3 + 191y*3. -153y*3 + 2 Collect the terms in -1076y*2 + 1815y*2 + 1 + 156y*2 + 1 - 2. 895y*2 Collect the terms in -9738 - 161x - 9734 + 19470. -161x - 2 Collect the terms in -3501 - 12667o*2 + 12667o*2 + 3o*3. 3o*3 - 3501 Collect the terms in 327483731 - 109161243 - 4x + 2x - 109161244 - 109161244. -2x Collect the terms in 7d + 248358 + 7d + 0d - 9d. 5d + 248358 Collect the terms in -166l - 159l - 159l + 629l - 16 - 146l. -l - 16 Collect the terms in -821d - 552d + 1372d - 15. -d - 15 Collect the terms in -337 - 81 + 10 - 22a - 5a - 403. -27a - 811 Collect the terms in 1086y3 - 590y + 19437y3 + 590y + 7057y3. 27580y*3 Collect the terms in -40259k*2 + 6956k*2 - 1387k*2. -34690k*2 Collect the terms in -30t + 17t - 1763 + 16t - 4t + 7t. 6t - 1763 Collect the terms in -504v*2 + 542 + 33 + 832 - 390v*2. -894v*2 + 1407 Collect the terms in -475a*3 + 331a*2 + 913a*3 + 3a - 441a3. -3a*3 + 331a*2 + 3a Collect the terms in 8391459m - 11 + 11 - 8391469m. -10m Collect the terms in -4811 + 0p*3 + 2p*3 + 5804 - 3p3. -p3 + 993 Collect the terms in 601b + 420b + 5b2 + 4b*2 - 1021b - 2b3. -2b*3 + 9b*2 Collect the terms in 118 - 4795x*2 + 4416x*2 - 118. -379x*2 Collect the terms in -53w - 9123 + 106w - 50w. 3w - 9123 Collect the terms in -263492667151477 - p2 + 263492667151477. -p2 Collect the terms in 1274 - 508i*2 - 634 - 2535i*2 - 640. -3043i*2 Collect the terms in 97999 - 48682 - 49317 - 2f - 16f. -18f Collect the terms in 469 + 468 + 480 - 1883 + 466 - 383z2. -383z*2 Collect the terms in 23w + 28w + 16w - 104w + 21w + 18w + 1769w*3. 1769w*3 + 2w Collect the terms in -154 + 138 - 406f3 + 16. -406f*3 Collect the terms in 19t*2 + 514482t + 19t2 - 514482t - 37t2 - 2142 + 2142. t2 Collect the terms in -51290710066n*2 - n - 3n + 51290710067n2 + 4n. n*2 Collect the terms in -303v - 3 + 3 - 702v + 1302v - 301v. -4v Collect the terms in -2009058856o2 + 2009058856o*2 - 4o*3. -4o*3 Collect the terms in -24m + 165m2 + 746m*2 - 12996m*2 + 24m. -12085m2 Collect the terms in -126y*3 - 91y*3 - 103y*3 + 231y*3. -89y*3 Collect the terms in 3831c*2 - 767638880c + 767638880c + 538c*2. 4369c*2 Collect the terms in -51 + 18v - 12 - 58 + 18. 18v - 103 Collect the terms in -7520 - 13932n + 7520 + 35529n. 21597n Collect the terms in -1824 + 607 + 4q3 + 1214. 4q*3 - 3 Collect the terms in -15a*3 + 6 + 729a + 8 + 723a - 1452a + 4a3. -11a*3 + 14 Collect the terms in -33 - 327k + 661k + 151 + 2 - 336k. -2k + 120 Collect the terms in 4k - 1123k3 + 1579k*3 - 1326k*3. -870k*3 + 4k Collect the terms in -5d3 + 0d*3 + 13d*3 - 5d*3 - 8d*3 + 10d*3. 5d*3 Collect the terms in 3787a*2 - 1698a*2 - 1906a*2. 183a*2 Collect the terms in 627n - 46178n2 - 627n + 9262n2. -36916n*2 Collect the terms in 58x - 488 + 245 + 243 + 2442x - 582x. 1918x Collect the terms in -340925x - 340895x + 681811x. -9x Collect the terms in -2s*2 - 7 - 204 + 1495 - 6s*2. -8s*2 + 1284 Collect the terms in 0 + 9208385p + 0 + 4720865p. 13929250p Collect the terms in -6511a2 - 6501a*2 - 6551a*2 + 19560a*2. -3a*2 Collect the terms in -1040d*2 + 2 - 269d*2 - 74d*2 - 748d*2 + 3694d*2. 1563d*2 + 2 Collect the terms in 999z - 114134z3 + 228264z*3 - 114131z*3 - 1000z. -z*3 - z Collect the terms in -37278h + 79097h - 38681h. 3138h Collect the terms in -91a - 116a + 2a + 183a. -22a Collect the terms in -668 - 3r + 15r - 3r - 3r - 100. 6r - 768 Collect the terms in -2366o*2 - 972o*2 - 1115o*2 + 736o2 + o3. o*3 - 3717o*2 Collect the terms in 23919 - 23919 + 2497o. 2497o Collect the terms in 474 - 474 + 114697k. 114697k Collect the terms in 294 - 698 + 3n + 45n3 + 404 - 3n. 45n3 Collect the terms in -878b*3 + 43b*2 - 2275b*3 + 1037b*3 - 43b*2. -2116b*3 Collect the terms in -6751g - 5085g + 3988g - 9799g. -17647g Collect the terms in -3v2 - 8601v*3 + 4v2 - v2 + 4286v3 + 4330v*3. 15v*3 Collect the terms in -2 + 215r - 602r2 + 2 - 392r + 581r2 + 216r. -21r2 + 39r Collect the terms in 150981 - 150981 - 5603i. -5603i Collect the terms in h*3 - 1010405h2 + h3 + 203983h2. 2h*3 - 806422h*2 Collect the terms in -239 - 1808y - 1792y + 3578y. -22y - 239 Collect the terms in 235 + 4b*2 + 220 - 711 + 256. 4b*2 Collect the terms in 875l + 1 - 1119l - 2158l. -2402l + 1 Collect the terms in 392l + 7973 + 7776 - 15749. 392l Collect the terms in 1937h*2 - 2884h*2 + 1636h*2 + 9811h*2 + 12410h*2. 22910h*2 Collect the terms in -7a + 26a - 37a + 7a. -11a Collect the terms in -3 + 1 + 1652114g2 - 3g + 2. 1652114g2 - 3g Collect the terms in 5r2 - 115 - 6r*2 + 2r - 5r2 - 53 - 20r*2. -26r*2 + 2r - 168 Collect the terms in 65u - 66u + 12114 - 12200. -u - 86 Collect the terms in -43380j2 + 21729j*2 - 5j*3 + 21651j*2. -5j*3 Collect the terms in 7592 + 7600 - 22757 + 7587 - 20l. -20l + 22 Collect the terms in 30819c + 20660c - 17661c. 33818c Collect the terms in 301n*2 - 225 - 297n*2 + 208n - 422n + 214n. 4n2 - 225 Collect the terms in -1063o*3 - 1036o*3 - 1065o*3 + 4217o*3 - 1056o*3. -3o*3 Collect the terms in -3s + 76091374s2 + 3s - 76091214s2. 160s*2 Collect the terms in 5 - 82 + 15 + 153i + 16 + 18. 153i - 28 Collect the terms in -1381 - 1380 - 140m*2 + 2764. -140m*2 + 3 Collect the terms in -70n*3 - 73n*3 - 96n - 89n + 323n - 138n. -143n*3 Collect the terms in -10906h*3 + 14h*2 + 21818h*3 - 10908h*3. 4h*3 + 14h*2 Collect the terms in 127a - 473 + 1918 - 490 - 473 - 482. 127a Collect the terms in -38836 + 38836 + 1714l*3. 1714l*3 Collect the terms in -230618m + 76861m - 19 + 76879m + 76880m. 2m - 19 Collect the terms in 540c - 183c - 189c + 9c - 182c. -5c Collect the terms in -15436y - 24436y + 3967y. -35905y Collect the terms in -219c + 236c*2 - 147c + 478c2 + 366c - 46c2. 668c*2 Collect the terms in -11 + 26 - 4 + 46328y - 46322y - 11. 6y Collect the terms in 29 + 4b - 6b - 25b2 + 3b*2 - 29 + 3b. -22b2 + b Collect the terms in 254296020 - 254296020 - 3x*2. -3x*2 Collect the terms in -26071o + o*3 + 2962o*2 + 24795o - 2962o2. o3 - 1276o Collect the terms in -149y + 584y*3 - 41y + 224y - 34y. 584y3 Collect the terms in -3262u*2 + 1 - 377u*2 - 1 - 886u*2. -4525u*2 Collect the terms in 14i*3 - 3284i - 45i3 + 15i*3 + 11i*3. -5i*3 - 3284i Collect the terms in -1879905f - 23 + 1879909f + 1 - 3. 4f - 25 Collect the terms in -587m*2 + 583m*2 - 81872 + 81873. -4m*2 + 1 Collect the terms in 2641m*3 + 4275m*3 + 190m*3. 7106m*3 Collect the terms in 833256n*3 - 123n + 123n. 833256n*3 Collect the terms in -836777r*2 + 1673593r*2 - 836859r*2. -43r*2 Collect the terms in 1081914 + 2634o - 1081914. 2634o Collect the terms in -10365r - 10377r + 30715r - 10360r. -387r Collect the terms in 27t2 - 5t*2 + 30t*2 + 880t - 443t - 437t. 52t2 Collect the terms in x - 537x*3 + 2x + 186x3 - 12x + 171x3 + 182x*3 + 2x. 2x3 - 7x Collect the terms in -h*3 - 10h*3 + 27h*3 - 4h*3 + 67h - 13h3. -h3 + 67h Collect the terms in u*3 + 4u*3 - 1036273551u*2 + 1036273551u*2. 5u*3 Collect the terms in 3275h*3 + 33214h*3 - 2h*2 + 2h*2. 36489h*3 Collect the terms in 196 - 50h*2 + 227 - 122h*2 - 423. -172h*2 Collect the terms in -1717d*3 - 1741d*3 + 3461d*3 + 270d*2. 3d*3 + 270d*2 Collect the terms in -9u + 7u - 183u*3 - 12 + 34 + 90u*3 + 50. -93u*3 - 2u + 72 Collect the terms in 2 - 92h + 54h - 1360h2 + 36h. -1360h2 - 2h + 2 Collect the terms in 497a2 + a + 24 - 11 + 18a*3 - 9. 18a*3 + 497a*2 + a + 4 Collect the terms in 0z + z + z + 4z + z + 2z. 9z Collect the terms in -928d + 821d + 115d	{ "pile_set_name": "DM Mathematics" }
0, 3r - 6j + 5j = 59. Which is greater: 20 or r? r Let x(d) = -d3 - 4d*2 + 5d + 15. Let o be x(-4). Is 4 at most as big as o? False Let b be 3 + (-1 + 6/9)94. Is -27 equal to b? False Let y be 18/(-40)60/36. Let g = 4 + -10. Let s = g + 6. Is y equal to s? False Let w be (4 + -5)(4 + -5). Which is smaller: w or -2/49? -2/49 Suppose 2v = 42 - 12. Let p(q) = q - 2. Let z be p(-2). Let n be (-20)/v(-6)/z. Which is bigger: n or -3/5? -3/5 Let w = 0 - 2. Let g(a) = 3a - 15. Suppose 5x - 33 = -2j, -22 = -2j - j - 2x. Let z be g(j). Are z and w equal? False Let v be (10586/3685)/((-2)/10). Which is bigger: v or -14? -14 Let t be ((-38)/(-6))/((-16)/48). Let v be (10/105)/((-2)/(-6)). Which is smaller: v or t? t Let m = 0.168 + 68.832. Are m and 0.2 unequal? True Let s = 0.0378 - 2.7378. Which is smaller: s or -5? -5 Let j = -45 + 32. Let f = j - -13.02. Are 0.2 and f nonequal? True Let d(x) = x3 - x2 - 2x - 1. Let o be d(-1). Does o = -1/115? False Let x = 239 + -260. Which is greater: 4 or x? 4 Let z = -11.79 - 0.21. Let p = 6.1 - -1.9. Let w = z + p. Which is smaller: -1/3 or w? w Let f = -23 - -20. Let p = 5 - 9. Which is bigger: p or f? f Let b be -9 + 5 - (-22)/2. Let k(a) = -a3 - 3a*2 + 2a - 4. Let y be k(-4). Which is greater: y or b? b Let d(w) = -17w + 25. Let q be d(3). Let p be q/(-39)3/2. Which is smaller: -2/7 or p? -2/7 Let u be (10 - 13) + -2(-2)/8. Is 2/15 equal to u? False Let s be (3996/63)/((-5)/35). Which is bigger: -446 or s? s Let x = -28 + -120. Which is smaller: -147 or x? x Suppose 2d - 13 = -5. Suppose -da + s + 1 = 0, 3a - 5a + 4s = 10. Are a and 3/8 unequal? True Let s = -140 + -132. Which is bigger: -275 or s? s Let i be (-12)/(-8) + 10/(-8). Let q(k) = k + 13. Suppose 20 + 4 = -2m. Let p be q(m). Is i at least as big as p? False Let d be (12/(-90))/((-1)/3). Let c = 47 - 32. Let h be 12/(-20) + 6/c + 0. Which is bigger: h or d? d Let w = 457 - 452. Which is smaller: 24 or w? w Suppose 22a + 19a + 5863 = 0. Which is greater: -144 or a? a Let q = 3526001/141 - 25007. Which is bigger: -1 or q? q Let l(b) = -b3 - 6b*2 - 10b - 2. Let w be l(-4). Let m = w + -7. Are -1 and m non-equal? False Let d = 849 + -849.2. Which is smaller: 8/35 or d? d Let b = -5/191 + 54/9359. Let y be (25/(-10))/(1/2). Let t(j) = j*3 + 6j*2 + 6j + 4. Let k be t(y). Is k >= b? False Let l = -150 - -559. Do l and -0.1 have different values? True Let j(q) = 3q2 - 1. Let s be j(-1). Suppose -4u - 1 = 7, 4u + 104 = 4f. Let m = 27 - f. Which is smaller: m or s? s Let d(z) = -7z - 5. Let m be d(-3). Suppose 0 = -5o + 14 + m. Let s be 211/o + 3. Is 8 greater than or equal to s? True Let t be (-20)/(-15) - (-364)/(-138). Are -1 and t non-equal? True Let n be 6410/(-18) - 1/(-9). Let a be (4 + -2)/(3 - n/(-124)). Do a and 16 have the same value? False Suppose -5 = -5x, j + 20 = x + 4x. Let p = j + 20. Suppose 0d = 3d. Is p less than d? False Let v be 1/42/(-3). Let i(n) = -3n3 - 2n + 2. Let g be i(0). Suppose 14w - w = gw. Which is smaller: v or w? v Suppose 3k - 3g - 11 = 2k, -5g - 25 = 0. Let b be (4 + -2)((-110)/k - 2). Is 51 greater than b? False Let b(k) = -2k*3 + 5k + 6. Let z be b(-1). Let l = 6 - 4. Are l and z equal? False Suppose -22o = -3 - 19. Which is smaller: o or 18/35? 18/35 Let p = 324/589 + -4/31. Are p and 0 unequal? True Let j(z) = z2 + 7z. Let b be j(-14). Which is greater: 97 or b? b Let u = 25 - 34. Let z = u - -7. Let o = 0.03 - 0.03. Which is greater: o or z? o Let a(p) = -7p - 15. Let c be a(-5). Let i be (-4)/(-2)-1 - (-39)/c. Which is smaller: i or 2? i Suppose 156y - 82y = 78y + 8. Let x be 2/(-12)(-42)/(-8). Is y bigger than x? False Let q = -225.22 + -5.78. Is q smaller than 1/4? True Let q = 8 - 6. Let w = -14.5 + 14. Let l = w + 0.45. Which is smaller: l or q? l Let k be (-20)/(-2)(-130)/(-3575). Which is smaller: k or 2? k Let w(u) = -15u + 39. Let j be w(6). Which is greater: j or -53? j Let c(z) = -3z + 37. Let u be c(9). Suppose 90 = -7l + 2l. Let y = l + u. Which is smaller: y or 1? y Let u(q) = q3 - 5q*2 + 2q - 6. Let f be u(5). Let l be f/(-26) + 82/26. Let y be (4/l)/(16/(-72)). Which is greater: y or -14/3? -14/3 Let r(d) = -5d - 2. Let y be r(2). Suppose -3n = 0, -2n = -4p - n - 52. Are p and y equal? False Let y(w) = 6w3 - 3w*2 + 2w - 3. Let a be y(2). Let f = a - 31. Is f less than 3? False Let l = -1.24 + -5.36. Let c = 4.4 - l. Which is greater: c or -2? c Let d = 9.6 - -58.4. Let c = d - 73. Is c less than or equal to 2/35? True Let l(f) = f + 6. Let a be l(-6). Let c be (a - 1)(-11)/1. Suppose -5r + 49 = -2p, 2p + p = -r + 3. Is c not equal to r? True Suppose -3u - 18 = -15. Which is greater: 2/221 or u? 2/221 Let n = 7/6 + -3/2. Is n at most as big as -39? False Let r be (-34)/72 + 4/18. Suppose a + t + 3t = -37, 5a + 5t + 110 = 0. Let y = a - -16. Which is bigger: y or r? r Let m be 23730/(-490) - (-6)/14. Is m < -49? False Let w = 72.99 - 73. Let m = w - 0.49. Which is bigger: -3 or m? m Let r(d) = d*2 - 15d + 13. Let i be r(14). Let n(g) = 9g - 1. Let x be n(i). Is x >= -2? False Let n be (4/(-48)-6)/(50/(-60)). Which is bigger: n or -27? n Suppose 25n = 8n - 2159. Is 2/9 less than n? False Let y be ((-3)/9)/(6/(-54)). Suppose 4 = f + yf. Suppose 0 = 3r + 20 + f. Which is greater: r or -5? -5 Let y = -86 - -77. Let m be -3(-8)/42y. Which is smaller: m or 1? m Suppose -4o + 170 - 166 = 0. Which is bigger: o or -2/401? o Let x be (4/(-46))/((-20)/130). Let r = x + -397/621. Is r at least 0? False Let q = -10 + 5. Let w(v) = v - 13. Let l = -17 + 26. Let r be w(l). Is r not equal to q? True Let f = 145.34 + -144. Let r = 0.34 - f. Do -3 and r have the same value? False Let f = 328.6 + -384. Let c = 39 + f. Let n = -3.4 - c. Are n and 0.1 unequal? True Let x = 411 - 414. Let v(z) = z3 + 6z*2 + z + 8. Let k be v(-6). Which is smaller: k or x? x Let q = 146 - 145.2. Which is greater: -6 or q? q Let d = 3 + -1. Let v(c) = -14c*2 + 6c*2 + 7c*2 - 11c - 9. Let q be v(-10). Which is smaller: q or d? q Let i = 557/8 + -687/8. Which is smaller: i or -0.1? i Let i(a) = a - 3. Let r be i(11). Let x = 18 - r. Suppose 2l - k + 5k - x = 0, 20 = 4l - 5k. Which is smaller: 1 or l? 1 Suppose 35 = -v - i - 0i, -3i = 4v + 141. Let a = 38 + v. Which is smaller: 3 or a? a Let i be (-6)/(-4) + 9755/(-80)-5. Let a = i - 611. Which is bigger: a or 1? 1 Let q be (1/3)/((-2)/(-6)). Let c = 0.86 - 1.1. Let p = -0.06 + c. Which is bigger: p or q? q Let d be (-674)/12 + 0 - (-41)/246. Which is greater: d or -57? d Suppose z + 43u = 38u + 1, 2z = 4u + 2. Is z bigger than -115? True Let u(h) = -h*3 - 14h*2 + 16h + 15. Let f be u(-15). Suppose f = 2y - 2 - 6. Let x be (4/(-10))/(y/20). Is x at most -2? True Let v = -650 + 651. Is -5/38 != v? True Let p be (28/(-70))/((-1)/(-5)). Suppose -5n + 9n + 12 = 0. Let m be p/n(-225)/30. Is 0.1 less than m? False Suppose -5z = -2v + 9, 0 = -0z + 2z + 5v - 8. Let h be 6/(z/(-4) + 2). Is h smaller than 2? False Let h = -2.511 + 0.511. Is h != -8.8? True Suppose 7y - 9287 - 1675 = 0. Let z = -70474/45 + y. Does z = 1? False Let w = 2.5 + -2.36. Let h = -0.35 + w. Let j = h - -0.01. Is -3/2 at most as big as j? True Suppose 3u = -i + 191, -5u + 10u + 679 = 4i. Is i < 177? True Let f be 188/10 + 45/225. Is 11 > f? False Let h be 940/40 - (0 + 2). Is 23 less than or equal to h? False Let r = -123.3 + 106. Let l = r + 1.3. Let y = l - -12. Is 0.1 less than or equal to y? False Suppose -t = -6t. Suppose 5x + 0d - 8 = 4d, t = 4x + 5d + 10. Suppose -4l - n = -6l + 2, -4n = 5l + 21. Which is smaller: l or x? l Let s be (-2)/(-4) + (-21)/4. Suppose -4n - 8 = 8. Do s and n have different values? True Let a = 1 + -7. Let p be -5a/15 - 22. Let k = -16 - p. Which is greater: k or 3? k Let k be 1((-3)/12 + 21/4). Suppose kv + 10 + 0 = 0. Suppose -2y - 9 = -t, -y - 2 = 5t - 3. Is v at least as big as y? True Let r = -5256 - -21145/4. Which is bigger: r or 30? r Suppose p + 17 = -4q, 3q + 11 = -p - 2. Let d be 7p(2 - -1). Let r be 6/30 - d/(-5). Is -4 >= r? True Let o(a) = 69*a + 18. Let u be o(1). Which is greater: -2 or u? u Let b =	{ "pile_set_name": "DM Mathematics" }
2g - 90. Suppose 2i = -i + g. What are the prime factors of i? 2, 5 Let o = -2 - -4. Let u be (-1 + -1 + o)/1. Suppose b - 13 + 5 = u. List the prime factors of b. 2 Let f(d) = d*3 - 10d*2 + 16d + 13. What are the prime factors of f(10)? 173 Suppose m + 1 - 5 = 0. Let s(a) = -2a2 + a3 - m - 2a*3 + 2. What are the prime factors of s(-3)? 7 Let j be -3(-1)/(-2)-2. Suppose jo - 78 = 75. List the prime factors of o. 3, 17 Let d = 56 + -37. What are the prime factors of d? 19 Let g = 67 - 44. Suppose -2v = -d + g, d - v = -0d + 26. Suppose -3u - a = -5u + 6, -a + d = 5u. What are the prime factors of u? 5 Let c(g) = 0g + 5g2 + 4 - g3 + 2g - 8. Let n be c(5). Suppose -2w + n + 10 = 0. List the prime factors of w. 2 Let v = 114 - 44. Suppose -5f = -5b + v, -b - 56 = -5b - f. What are the prime factors of b? 2, 7 Let k(r) = -4r - 1. Let c be k(-6). Let n = c + -11. List the prime factors of n. 2, 3 Let o = 34 - 7. What are the prime factors of o? 3 List the prime factors of (34 - -2)(-20)/(-16). 3, 5 Suppose -z + 4u + 47 = -13, 0 = 3z - 5u - 215. List the prime factors of z. 2, 5 Let d(z) = -23z - 1. Let x be d(-1). Let t = 4 - 0. Suppose 5n + tb - x - 20 = 0, 0 = -2b - 4. What are the prime factors of n? 2, 5 Let y = -6 - -5. Let u(i) = 35i*2 - i - 1. Let b be u(y). Suppose -a + 5s = 3a - b, -2a = 4s - 50. List the prime factors of a. 3, 5 Suppose 5f - 8 - 2 = 0. Suppose 0 = -fy + 2k + 40, -2y + 4k + 11 = -y. List the prime factors of y. 23 Suppose 3r - 2r = 4s - 24, 2s - 12 = 4r. List the prime factors of s. 2, 3 Suppose -4i = 8, 3i - 42 = 2b - 292. List the prime factors of b. 2, 61 Let d be (2/(-2))/(1/(-2)). Suppose -v = du - 13, 2u - 52 = -4v + u. List the prime factors of v. 13 Suppose -3t - 3q = -162, 3t = -4q + 101 + 65. What are the prime factors of t? 2, 5 Let b(i) = -i3 + 6i*2 + 9i - 8. List the prime factors of b(6). 2, 23 Suppose -3l + 2l = -2. Suppose -li + 11 = 3. What are the prime factors of i? 2 Let q(a) = 4a*2 + a - 2. What are the prime factors of q(4)? 2, 3, 11 Suppose 0 = -2i + 5y + 65, 2y - 11 + 101 = 4i. List the prime factors of i. 2, 5 Suppose -s - 4n - 17 = 0, 3s - n - 20 = -2s. Suppose 75 = -sx + 8x. What are the prime factors of x? 3, 5 List the prime factors of -3 + 0 + 11 - 1. 7 Suppose 3c - 2o + 16 = -7o, 5o = -25. Let x(l) = -l*2 + 5l - 1. What are the prime factors of x(c)? 5 Let k(g) = -14 + 0g3 - 6 + 12g*2 + 2g2 - g3 + 5g. List the prime factors of k(14). 2, 5 Let r = -77 + 145. List the prime factors of r. 2, 17 Suppose 2y = -y. Suppose 3t + 1 = 2c - 19, y = 4c + 4t - 80. List the prime factors of c. 2 Let t = 143 - 77. What are the prime factors of t? 2, 3, 11 Suppose 0 = -0r - r - 5d - 16, 48 = -3r + 3d. Let a be (18/24)/((-6)/r). What are the prime factors of a/(-2)10/(-2)? 5 Let g be (-2)/(-11) + 40/22. Suppose -2v - 2u = gu - 32, -2u = 0. List the prime factors of v. 2 Suppose 0a = -5a + 275. List the prime factors of a. 5, 11 Let s = 11 - 0. What are the prime factors of s? 11 Let k(d) = -d3 - 5d*2 - 3d - 2. Let n be k(-4). Let l(i) be the first derivative of -i*2/2 + i + 1. List the prime factors of l(n). 7 Let u = -11 - -42. What are the prime factors of u? 31 Let m(l) be the first derivative of 0l - 7/2l2 - 1. List the prime factors of m(-1). 7 Let l = -13 + 83. What are the prime factors of l? 2, 5, 7 Let m(a) = a3 - 8a*2 + 3a - 3. List the prime factors of m(8). 3, 7 Let q(u) = u*2 - 2u + 3. Let v be 52(-3)/6. List the prime factors of q(v). 2, 19 What are the prime factors of 71 + (-4 + 5)-2 + 2? 71 Let s = -3 - -10. Let b(k) = k3 - 5k*2 - 11k + 6. What are the prime factors of b(s)? 3 Suppose 2u - 3r - 183 = -2u, -3u = r - 147. What are the prime factors of u/21 + 6/(-21)? 2 Suppose -5q + 34 = -51. Let o = q + -6. What are the prime factors of o? 11 Let n = -164 - -385. List the prime factors of n. 13, 17 Let x be ((-19)/(-5) - 3)5. Let a = -2 + x. List the prime factors of a. 2 Let c = -3 + 5. Let r be -2 - (c - 5) - 3. List the prime factors of r/(-2 + (-36)/(-21)). 7 Let l(o) = o*3 - 9o*2 + 7o + 10. Let p be l(8). Suppose -pt - 25 = 3t. Let a = t - -8. List the prime factors of a. 3 Suppose -f = 5f - 198. List the prime factors of f. 3, 11 Suppose -3a = 2a - 30. List the prime factors of a. 2, 3 Suppose -2u + 14 = 3c, -5c + 4u + 22 = 7u. Suppose -4t + 52 = cw - w, -4w - 4t + 148 = 0. What are the prime factors of w? 2 Let f be (-12)/(-20)15/3. Suppose 3l - 6y = -fy + 51, 5 = -5y. What are the prime factors of l? 2 Let u(j) = 4j + 5. Let b(s) = s + 1. Let m(d) = -3b(d) + u(d). What are the prime factors of m(6)? 2 Let q(t) = -19t + 4. List the prime factors of q(-5). 3, 11 Let h be 3 - (-23 - (-8)/4). Suppose 4i = -0i + h. List the prime factors of i. 2, 3 Let b(c) = 2c + 11. Let m be b(6). Suppose 5f - 63 = -m. What are the prime factors of f? 2 Let z(v) = -20v - 34. List the prime factors of z(-8). 2, 3, 7 Let w = 41 + -18. List the prime factors of w. 23 Let t(m) = 11m2 + m + 1. Suppose 0 = q - 3 + 4. List the prime factors of t(q). 11 What are the prime factors of 14/56 - 158/(-8)? 2, 5 Let n be 8 + 5/(5/(-3)). Let h = 7 - n. What are the prime factors of (h/(-4))/(1/(-4))? 2 Let g(h) = h2 - 2h - 4. Let m be g(4). Suppose -4a - 16 = 8. What are the prime factors of 3/a - (-26)/m? 2, 3 Let m = 8 - 5. Suppose -v + m = -0v - 3s, 3v - 9 = s. Suppose vg = g + 36. What are the prime factors of g? 2, 3 What are the prime factors of (-1776)/(-10) - 2/(-5)? 2, 89 Let u(b) be the second derivative of 0 - 2b2 + 2b + 1/6b3. What are the prime factors of u(9)? 5 Let v be (0/(-2 + 3))/(-1). Suppose 2l - 2h - 26 = v, h + 3 + 20 = 2l. What are the prime factors of l? 2, 5 Suppose -3r + 163 = -2w, -2r = 2r - 2w - 218. Suppose -5u = -o + r, 3o - u = 138 - 1. List the prime factors of o. 3, 5 Let f(s) = -s - 1. Let i be f(-5). Let d(b) = b - 6. Let m be d(i). Let u(l) = l3 + 3l*2 - l - 2. What are the prime factors of u(m)? 2 Suppose -4f + 10 = 2. What are the prime factors of f? 2 Let b(u) = u + 2. Let c be b(-1). Let n be -2(c + 0)37. List the prime factors of 3/(-12) + n/(-8). 3 Let r be -2(-228)/(-8)2/6. Suppose -w - 7 = 2w + 2s, -2s = -8. Let i = w - r. List the prime factors of i. 2, 7 Let b(y) = -4y - 37. What are the prime factors of b(-20)? 43 Let k be 1/(-4) + 966/24. Let g = k - 28. What are the prime factors of g? 2, 3 Let g(w) = w*3 - 18w*2 - 37w + 5. What are the prime factors of g(20)? 5, 13 Let o(r) be the third derivative of -r4/2 + r2. Suppose 4k + 5i - 22 = k, -2k - 7 = -i. List the prime factors of o(k). 2, 3 Suppose w - 9 = 33. Suppose 4c - w = 2b, 37 + 26 = -3b - 5c. List the prime factors of (-4)/(-14) - 57/b. 3 Suppose -4i + 6 = -l + 3l, -5i = 3l - 8. Let c(t) = 6t*2 - t + 1. List the prime factors of c(i). 2, 3 Let h be (-22)/(-12) + 2/12. Suppose -3l = 3j - 129, 0 = 3j + hj + l - 199. What are the prime factors of j? 3, 13 Let u = 15 - 9. Suppose -uk + 2k = -244. List the prime factors of k. 61 List the prime factors of 454/(-32/(-3)). 227 Let v = 16 + -4. Suppose -b = 3b - v. What are the prime factors of (11/b)/(2/6)? 11 Let y = 6 + -4. Let z be 18 + (-1)/1y. Suppose 4t = z + 16. List the prime factors of t. 2 Suppose 3u = -3b, -b - 2b = -2u - 20. Suppose -3w = -5l + 167, 0 = bl + w - 57 - 80. List the prime factors of l. 2, 17 Suppose -9t + 8t + 70 = 0. List the prime factors of t. 2, 5, 7 Let j(o) = o*2 - 4o + 3. What are the prime factors of j(8)? 5, 7 Let z(h) = h*2 + 7h + 2. Let p be z(-4). Let v(c) = -5c - 3. What are the prime factors of v(p)? 47 Let t(u) = 8u*2 + 4u + 4. What are the prime factors of t(-3)? 2 Let j(z) = -z + 7. Suppose -1 = -5a - 4d + 4, -4d = -4a + 40. Let f(r) = -r*3 + 5r*2 - 5. Let i be f(a). What are the prime factors of j(i)? 2, 3 Suppose -3j = -j. Suppose 54 = -3c - jc. List the prime factors of 5/(15/c)-1. 2, 3 Let h = 104 - -46. List the prime factors of h. 2, 3, 5 Suppose -4b + 30 = 5i, 0 = 2i + 4b - 41 + 17. Let l(c) = 2c3 + c2 - 1. Let n be l(i). Let r = n - 8.	{ "pile_set_name": "DM Mathematics" }
th smallest value in h, -0.3, y, 0.07? y Let i = 2106 - 35740/17. What is the third smallest value in 0.5, 0.2, 3, i? 3 Let j be (9/5 - 1)(-19)/38. What is the third biggest value in -4/7, -0.5, j, 5/2? -0.5 Let i = -0.52 - -0.67. Let q = -2291 + 2287. Which is the biggest value? (a) i (b) q (c) 2 c Let t be (12/16)/(6/(-128)-4). Suppose -tw - 1219 = -1235. Which is the smallest value? (a) 3 (b) 12/7 (c) w (d) -4 d Let o = -19955/313 - -40623983/633512. Let t = o - -1/253. Let r = -0.3 + -0.2. What is the third biggest value in 0.5, r, t? r Let k = 2.966 - 3.966. Which is the third biggest value? (a) -3 (b) -50 (c) k b Let s(k) = -k3 - k2 + 2k - 1. Let g be s(1). Let i be g/(-2) - 6/4. Let l = -241.8 - -247.8. Which is the smallest value? (a) -1/9 (b) 0 (c) l (d) i d Let q = 73 - 22997/315. Which is the third biggest value? (a) q (b) -4 (c) 0.5 b Let y = -49 + 75. Suppose -306 = -4x - y. Let n = -283/4 + x. Which is the biggest value? (a) 5/6 (b) n (c) -3/7 (d) -5 a Suppose 0 = 70z + 189 - 49. What is the smallest value in -2367, 2/3, z? -2367 Let g = 7161 - 7160.5. Let f = 17 - 48. Let t = 58 + f. Which is the smallest value? (a) -0.4 (b) g (c) t a Let h be (5 + (-161)/28)/(-59/(-150)). What is the smallest value in h, -10, -4, 0.1, -0.3? -10 Let l be (-5 - -15 - (11 - 6)) + -5. Let j = -1.3 + 4.3. Which is the fourth biggest value? (a) l (b) -3/7 (c) j (d) -12 d Let x = 3 + -3. Let n = -4 + x. Let k be (-1)/((-64)/144)64/360. What is the smallest value in k, n, -2/5? n Let j = -108775/6 + 18056. Let h = j + 218/3. What is the smallest value in h, -0.2, -6? -6 Let r = 7.5 + 2.5. Let z(b) = -67b2 + 2955b - 304. Let q be z(44). What is the fourth smallest value in r, -1/2, q, 4/3? r Let f = -1908 + 1907.942. What is the fourth smallest value in -4, f, -1/3, 15? 15 Let o = -2318.43 + 2318.63. Let y = -0.09 - -0.2. Which is the biggest value? (a) 1/4 (b) y (c) o a Let v = -0.0518 - -1.7518. Let j = -2.3 + 0.1. Let h = v + j. Which is the third smallest value? (a) -0.2 (b) h (c) 1 c Let i = -2980.8 + 2981. Which is the third smallest value? (a) i (b) 3/2 (c) -7 (d) 0.5 (e) 5 d Let d(m) = 16m + 93. Let o be d(-17). Let c = -179 - o. Let v = 5 + -9. What is the fourth smallest value in 4, -5, c, v? 4 Let v(q) = q3 - 62q*2 - 62q - 61. Let h be v(63). Which is the biggest value? (a) h (b) 30 (c) 5/8 b Let z = 5446 + -5444. What is the smallest value in 2/67, z, 3? 2/67 Let r = -19097/7 - -2727. What is the biggest value in 3, r, -1/46? 3 Let w = 11.781 - 11.49. What is the smallest value in w, -1, 4/3? -1 Suppose -331 = -5r + 2x + x, -2r + 4x + 124 = 0. Let m be 1r/(-60) - -1. Which is the second smallest value? (a) m (b) 15 (c) -0.3 a Let p = 209 - 208.8. Let b be 21/(-10) - (-3)/2. What is the third smallest value in b, 3/2, p? 3/2 Let x = 0.5642 + -0.639. Let t = x - -0.0748. What is the biggest value in t, 1/7, -1? 1/7 Let l = -1014 - -1935. Let w = l + -917. Which is the third smallest value? (a) w (b) -0.5 (c) 0.8 (d) 9/8 d Let l be -50 + 1529/33 + (-52)/(-24). Let u = 0.06 + -0.46. Which is the smallest value? (a) u (b) l (c) 3/5 b Let f = 0.421 - 36.221. Let y = 44.8 + f. Which is the third smallest value? (a) y (b) -3 (c) -0.2 a Let i = -351 + 361. Suppose 0 = 5j + g - 69, j - 5 + 0 = 2g. Let p = -9 + j. What is the second biggest value in p, -2/9, i? p Let z = -260934 + 260933.9. Let t = 0.4 - 1.8. Let k = 0.6 - t. What is the smallest value in z, 1/5, k? z Let n(u) = -u3 + 5u*2 - 27. Let r be n(6). Let z = 569/9 + r. What is the third biggest value in -3/2, z, 114? -3/2 Let h = -0.294 - -21.894. What is the biggest value in 5, -1/2, -0.3, h? h Let i = 927.9973 - 928. Let s = -0.1027 - i. What is the third smallest value in 0.4, s, -11? 0.4 Let d = -3.8 + 4. Let w = -52537 + 52536.9. Which is the third smallest value? (a) d (b) w (c) 3 c Let h = -32 + 45.9. Let o = 1.1 + h. Let g = o + -15.1. What is the biggest value in 0.2, 4, g? 4 Let o = -4.0365 + 0.0365. Let x = -77.7 + 78. Which is the fourth biggest value? (a) o (b) x (c) -3 (d) 23 a Let p = -732 - -732.5. Let x = 7 + -7. Which is the second smallest value? (a) 4 (b) -4 (c) p (d) x d Let b = 0.23 + -0.13. Let q = b - 0.6. Let l = -1.08 + 9.08. What is the third smallest value in l, -2, q, 0.1? 0.1 Suppose r = 9 - 5 - 9. Let i be -2 + 1 - 1 - -7. Suppose -1 = iu - 16. Which is the third smallest value? (a) r (b) u (c) 1/4 b Let m = -14 + -21. Let n = -35 - m. Let v = -2 - -3. What is the third biggest value in v, -0.4, n? -0.4 Let m = 4502.8 + -4503. Let u = -0.2 + 0.5. Which is the biggest value? (a) 7 (b) m (c) u a Let t = 1112 + -1109.972. Let w = 0.028 - t. Let h = -0.43 + -0.07. What is the biggest value in w, -0.3, h? -0.3 Let r(z) = -1877z + 5627. Let w be r(3). Let n = 0.44 - 0.5. Let o = -0.46 - n. Which is the third biggest value? (a) w (b) 2/9 (c) o (d) 1/2 c Let o = -2703 + 2703.5. What is the smallest value in o, 716, 5? o Let d = -172.87 - -186.87. What is the smallest value in 0.2, 11, d, 5? 0.2 Let m = 1.34 + -1.64. Let g be 6/10 - (56/(-15))/(-8). Which is the second biggest value? (a) -2/21 (b) g (c) m a Let w = 591.8 - 595.8. Let i = -3 - -3.5. Which is the second smallest value? (a) w (b) i (c) -8 a Let r(t) = -t - 6. Let h be r(-4). Suppose -118w - 348 - 242 = 0. Which is the third biggest value? (a) w (b) h (c) 4 (d) 1 b Let g be (-62)/(-228) - 2/12. Let l = 4865 - 4864. Which is the fourth smallest value? (a) g (b) l (c) 1/2 (d) -1 b Let m = -0.7 - -1. Let z = 0.1 + m. Let s = 2687 + -2690. What is the second biggest value in s, 0, z, -0.5? 0 Let f = 765.366 + -766. Let d = f - -0.334. What is the second smallest value in d, 3, 10? 3 Let n = -3540 + 3564. Which is the second biggest value? (a) n (b) -0.06 (c) 2 c Let j = 19 + -18.5. Let m = -20.75 + 22.75. What is the second biggest value in 5, m, -2/3, j? m Let h be ((-20)/3)/(-10) - (0/(-4))/(-4). What is the biggest value in 0.3, -0.16, 0.21, h? h Let h = 7.28 + -484.28. Let o = -475 - h. Which is the second biggest value? (a) o (b) -0.13 (c) -1/11 c Let p = 36485 + -36448.8. What is the second biggest value in p, -1, 0.2, -4? 0.2 Let w be (2884/(-20))/7 - (-5 - 4 - -5). What is the smallest value in -5, w, 1.6? w Let r(g) = -2g + 17. Suppose -61t = -59t - 26. Let s be r(t). Which is the smallest value? (a) 4 (b) 2/11 (c) 0 (d) s d Let t = -16333 + 16329. Which is the smallest value? (a) 0.1 (b) -934 (c) t b Let t = 4 - 9. Let u(z) = z2 - 1461z - 4387. Let q be u(-3). Let f = 3.96 - -0.04. What is the second biggest value in f, 2/15, q, t? f Let s = 1911/10 + -13397/70. Let w = 14 + -10. What is the second biggest value in 0, -6/7, w, s? 0 Let a be 250/48 + -5 - 3/9. What is the fourth biggest value in 2/5, -3/7, a, 4, 0.64? a Suppose a + 4a - g - 95 = 0, -3a + 2g = -50. Let s be a/159/(-6). Let q = 1231/11 - 112. What is the third biggest value in q, -1/7, s? s Suppose 7 = 5b - 8. Let z be ((-54)/(-137619))/(2/(-6)). Let k = z - 1677/18689. What is the third biggest value in b, -24, k? -24 Let h = 922 + -925. What is the second smallest value in -0.608, 1/5, h? -0.608 Let g = 14802 - 547676/37. Let s = 1 - 1.1. Which is the biggest value? (a) s (b) -44 (c) g c Let w be 3/(-7)37765/(-1245). Which is the second biggest value? (a) w (b) 20/9 (c) 4 c Let l = 7290329/35 - 208281. Let h = l + -72/5. Let m = 0.1 + 0.2. Which is the fourth smallest value? (a) -0.5 (b) -3 (c) m (d) h c Let v be (1 - 0)/(19 - 24). What is the third smallest value in -2/19, 4, v, 0.01, -4/7? -2/19 Suppose 28s + 90s = 35s + 747. What is the smallest value in -5, s, 0.33, 0.4, -0.1? -5 Let y = -12.963 + 10.463. Which is the second biggest value? (a) y (b) -0.21 (c) 4 (d) -1 b Let y = 4 - 0. Let q(w) = -w + 3. Let m be q(0). Suppose -2x - 18 = 2b, 2x - b = 34 - 40. What is the fourth biggest value in x, -4, y, m? x Let r = -110.19 + 108. Let y = r + 1.89. Let v = -55 + 82. What is the second biggest value in -0.5, y, v? y Let g = 498 + -500. What is the third smallest value in 70, 3/5, -2/3, g? 3/5 Let n = -2.1 + 94.1. Let m = n - 99. Let t = -4.7 - -4.2. Which is th	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.