instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_3250>.
NNC(=S)Nc1ccccc1Cl
What is the building block token for the following molecule?
NNC(=S)Nc1ccccc1Cl
<BB_3250>
What is the molecular formula for <BB_3250>?
The molecular formula for <BB_3250> (NNC(=S)Nc1ccccc1Cl) is C7H8ClN3S.
Describe the ring structures in building block <BB_3250>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3250>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3250>.
**Token:** <BB_3250> **SMILES:** NNC(=S)Nc1ccccc1Cl **Molecular Formula:** C7H8ClN3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3251>.
CC(CCl)CN(C)C.Cl
What is the building block token for the following molecule?
CC(CCl)CN(C)C.Cl
<BB_3251>
What is the molecular formula for <BB_3251>?
The molecular formula for <BB_3251> (CC(CCl)CN(C)C.Cl) is C6H15Cl2N.
Describe the ring structures in building block <BB_3251>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3251>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3251>.
**Token:** <BB_3251> **SMILES:** CC(CCl)CN(C)C.Cl **Molecular Formula:** C6H15Cl2N **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3252>.
N#CCc1cc(Cl)cc(Br)c1
What is the building block token for the following molecule?
N#CCc1cc(Cl)cc(Br)c1
<BB_3252>
What is the molecular formula for <BB_3252>?
The molecular formula for <BB_3252> (N#CCc1cc(Cl)cc(Br)c1) is C8H5BrClN.
Describe the ring structures in building block <BB_3252>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3252>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_3252>.
**Token:** <BB_3252> **SMILES:** N#CCc1cc(Cl)cc(Br)c1 **Molecular Formula:** C8H5BrClN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_3253>.
CC(C)(C)OC(=O)N1CCC(CCCO)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(CCCO)C1
<BB_3253>
What is the molecular formula for <BB_3253>?
The molecular formula for <BB_3253> (CC(C)(C)OC(=O)N1CCC(CCCO)C1) is C12H23NO3.
Describe the ring structures in building block <BB_3253>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_3253>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_3253>.
**Token:** <BB_3253> **SMILES:** CC(C)(C)OC(=O)N1CCC(CCCO)C1 **Molecular Formula:** C12H23NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_3254>.
Cc1cc(F)c(N)c(I)c1
What is the building block token for the following molecule?
Cc1cc(F)c(N)c(I)c1
<BB_3254>
What is the molecular formula for <BB_3254>?
The molecular formula for <BB_3254> (Cc1cc(F)c(N)c(I)c1) is C7H7FIN.
Describe the ring structures in building block <BB_3254>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3254>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3254>.
**Token:** <BB_3254> **SMILES:** Cc1cc(F)c(N)c(I)c1 **Molecular Formula:** C7H7FIN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3255>.
CCC1(C(C)=O)CN(C(=O)OC(C)(C)C)C1
What is the building block token for the following molecule?
CCC1(C(C)=O)CN(C(=O)OC(C)(C)C)C1
<BB_3255>
What is the molecular formula for <BB_3255>?
The molecular formula for <BB_3255> (CCC1(C(C)=O)CN(C(=O)OC(C)(C)C)C1) is C12H21NO3.
Describe the ring structures in building block <BB_3255>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_3255>.
The molecule contains the following groups: Amide, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_3255>.
**Token:** <BB_3255> **SMILES:** CCC1(C(C)=O)CN(C(=O)OC(C)(C)C)C1 **Molecular Formula:** C12H21NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Ketone, Ether
Provide the SMILES representation for the building block token <BB_3256>.
Clc1nnc(Cl)s1
What is the building block token for the following molecule?
Clc1nnc(Cl)s1
<BB_3256>
What is the molecular formula for <BB_3256>?
The molecular formula for <BB_3256> (Clc1nnc(Cl)s1) is C2Cl2N2S.
Describe the ring structures in building block <BB_3256>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3256>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3256>.
**Token:** <BB_3256> **SMILES:** Clc1nnc(Cl)s1 **Molecular Formula:** C2Cl2N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3257>.
CC1(C)OB(c2ccccc2S(N)(=O)=O)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(c2ccccc2S(N)(=O)=O)OC1(C)C
<BB_3257>
What is the molecular formula for <BB_3257>?
The molecular formula for <BB_3257> (CC1(C)OB(c2ccccc2S(N)(=O)=O)OC1(C)C) is C12H18BNO4S.
Describe the ring structures in building block <BB_3257>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_3257>.
The molecule contains the following groups: Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_3257>.
**Token:** <BB_3257> **SMILES:** CC1(C)OB(c2ccccc2S(N)(=O)=O)OC1(C)C **Molecular Formula:** C12H18BNO4S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_3258>.
NC1CCCc2[nH]ncc21
What is the building block token for the following molecule?
NC1CCCc2[nH]ncc21
<BB_3258>
What is the molecular formula for <BB_3258>?
The molecular formula for <BB_3258> (NC1CCCc2[nH]ncc21) is C7H11N3.
Describe the ring structures in building block <BB_3258>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_3258>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_3258>.
**Token:** <BB_3258> **SMILES:** NC1CCCc2[nH]ncc21 **Molecular Formula:** C7H11N3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_3259>.
C#Cc1cc(I)cc(C(=O)O)c1
What is the building block token for the following molecule?
C#Cc1cc(I)cc(C(=O)O)c1
<BB_3259>
What is the molecular formula for <BB_3259>?
The molecular formula for <BB_3259> (C#Cc1cc(I)cc(C(=O)O)c1) is C9H5IO2.
Describe the ring structures in building block <BB_3259>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3259>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3259>.
**Token:** <BB_3259> **SMILES:** C#Cc1cc(I)cc(C(=O)O)c1 **Molecular Formula:** C9H5IO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3260>.
COC(=O)C12CC(C(=O)O)(C1)C2(Cl)Cl
What is the building block token for the following molecule?
COC(=O)C12CC(C(=O)O)(C1)C2(Cl)Cl
<BB_3260>
What is the molecular formula for <BB_3260>?
The molecular formula for <BB_3260> (COC(=O)C12CC(C(=O)O)(C1)C2(Cl)Cl) is C8H8Cl2O4.
Describe the ring structures in building block <BB_3260>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_3260>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3260>.
**Token:** <BB_3260> **SMILES:** COC(=O)C12CC(C(=O)O)(C1)C2(Cl)Cl **Molecular Formula:** C8H8Cl2O4 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3261>.
Cn1nc(NC(=O)C(F)(F)F)cc1C(F)(F)F
What is the building block token for the following molecule?
Cn1nc(NC(=O)C(F)(F)F)cc1C(F)(F)F
<BB_3261>
What is the molecular formula for <BB_3261>?
The molecular formula for <BB_3261> (Cn1nc(NC(=O)C(F)(F)F)cc1C(F)(F)F) is C7H5F6N3O.
Describe the ring structures in building block <BB_3261>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3261>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3261>.
**Token:** <BB_3261> **SMILES:** Cn1nc(NC(=O)C(F)(F)F)cc1C(F)(F)F **Molecular Formula:** C7H5F6N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3262>.
CC(C)(C)C1(CN)CC1
What is the building block token for the following molecule?
CC(C)(C)C1(CN)CC1
<BB_3262>
What is the molecular formula for <BB_3262>?
The molecular formula for <BB_3262> (CC(C)(C)C1(CN)CC1) is C8H17N.
Describe the ring structures in building block <BB_3262>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_3262>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_3262>.
**Token:** <BB_3262> **SMILES:** CC(C)(C)C1(CN)CC1 **Molecular Formula:** C8H17N **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_3263>.
COC(=O)C1CC(OC)(c2ccc(O)cc2)C1
What is the building block token for the following molecule?
COC(=O)C1CC(OC)(c2ccc(O)cc2)C1
<BB_3263>
What is the molecular formula for <BB_3263>?
The molecular formula for <BB_3263> (COC(=O)C1CC(OC)(c2ccc(O)cc2)C1) is C13H16O4.
Describe the ring structures in building block <BB_3263>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6.
List the primary functional groups present in <BB_3263>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3263>.
**Token:** <BB_3263> **SMILES:** COC(=O)C1CC(OC)(c2ccc(O)cc2)C1 **Molecular Formula:** C13H16O4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_3264>.
O=[N+]([O-])c1ccn(C2CCCC2)n1
What is the building block token for the following molecule?
O=[N+]([O-])c1ccn(C2CCCC2)n1
<BB_3264>
What is the molecular formula for <BB_3264>?
The molecular formula for <BB_3264> (O=[N+]([O-])c1ccn(C2CCCC2)n1) is C8H11N3O2.
Describe the ring structures in building block <BB_3264>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_3264>.
The molecule contains the following groups: Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_3264>.
**Token:** <BB_3264> **SMILES:** O=[N+]([O-])c1ccn(C2CCCC2)n1 **Molecular Formula:** C8H11N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_3265>.
COC(=O)c1ccc2nc(C(F)(F)F)cn2c1
What is the building block token for the following molecule?
COC(=O)c1ccc2nc(C(F)(F)F)cn2c1
<BB_3265>
What is the molecular formula for <BB_3265>?
The molecular formula for <BB_3265> (COC(=O)c1ccc2nc(C(F)(F)F)cn2c1) is C10H7F3N2O2.
Describe the ring structures in building block <BB_3265>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_3265>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3265>.
**Token:** <BB_3265> **SMILES:** COC(=O)c1ccc2nc(C(F)(F)F)cn2c1 **Molecular Formula:** C10H7F3N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3266>.
Cc1cccc(NC(=O)CO)c1
What is the building block token for the following molecule?
Cc1cccc(NC(=O)CO)c1
<BB_3266>
What is the molecular formula for <BB_3266>?
The molecular formula for <BB_3266> (Cc1cccc(NC(=O)CO)c1) is C9H11NO2.
Describe the ring structures in building block <BB_3266>.
The molecule contains 1 ring(s): an aromatic ring of size 6.