instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_3216>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3216>.
**Token:** <BB_3216> **SMILES:** C[N+](C)(C)CC=O.O.[Cl-] **Molecular Formula:** C5H14ClNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3217>.
Nc1nc(-c2ccc3c(c2)OCO3)cs1
What is the building block token for the following molecule?
Nc1nc(-c2ccc3c(c2)OCO3)cs1
<BB_3217>
What is the molecular formula for <BB_3217>?
The molecular formula for <BB_3217> (Nc1nc(-c2ccc3c(c2)OCO3)cs1) is C10H8N2O2S.
Describe the ring structures in building block <BB_3217>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_3217>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_3217>.
**Token:** <BB_3217> **SMILES:** Nc1nc(-c2ccc3c(c2)OCO3)cs1 **Molecular Formula:** C10H8N2O2S **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_3218>.
COC(=O)c1ccc(N)c(OC)c1
What is the building block token for the following molecule?
COC(=O)c1ccc(N)c(OC)c1
<BB_3218>
What is the molecular formula for <BB_3218>?
The molecular formula for <BB_3218> (COC(=O)c1ccc(N)c(OC)c1) is C9H11NO3.
Describe the ring structures in building block <BB_3218>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3218>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3218>.
**Token:** <BB_3218> **SMILES:** COC(=O)c1ccc(N)c(OC)c1 **Molecular Formula:** C9H11NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_3219>.
Cc1cccc2[nH]c(=O)oc(=O)c12
What is the building block token for the following molecule?
Cc1cccc2[nH]c(=O)oc(=O)c12
<BB_3219>
What is the molecular formula for <BB_3219>?
The molecular formula for <BB_3219> (Cc1cccc2[nH]c(=O)oc(=O)c12) is C9H7NO3.
Describe the ring structures in building block <BB_3219>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3219>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_3219>.
**Token:** <BB_3219> **SMILES:** Cc1cccc2[nH]c(=O)oc(=O)c12 **Molecular Formula:** C9H7NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_3220>.
NC1CCC(O)(C2CCCCC2)CC1
What is the building block token for the following molecule?
NC1CCC(O)(C2CCCCC2)CC1
<BB_3220>
What is the molecular formula for <BB_3220>?
The molecular formula for <BB_3220> (NC1CCC(O)(C2CCCCC2)CC1) is C12H23NO.
Describe the ring structures in building block <BB_3220>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3220>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_3220>.
**Token:** <BB_3220> **SMILES:** NC1CCC(O)(C2CCCCC2)CC1 **Molecular Formula:** C12H23NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Alcohol
Provide the SMILES representation for the building block token <BB_3221>.
Cc1cc(Br)cc2nc(Cl)oc12
What is the building block token for the following molecule?
Cc1cc(Br)cc2nc(Cl)oc12
<BB_3221>
What is the molecular formula for <BB_3221>?
The molecular formula for <BB_3221> (Cc1cc(Br)cc2nc(Cl)oc12) is C8H5BrClNO.
Describe the ring structures in building block <BB_3221>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_3221>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3221>.
**Token:** <BB_3221> **SMILES:** Cc1cc(Br)cc2nc(Cl)oc12 **Molecular Formula:** C8H5BrClNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3222>.
Oc1nc(/C=C/c2ccccc2)cc(C(F)(F)F)n1
What is the building block token for the following molecule?
Oc1nc(/C=C/c2ccccc2)cc(C(F)(F)F)n1
<BB_3222>
What is the molecular formula for <BB_3222>?
The molecular formula for <BB_3222> (Oc1nc(/C=C/c2ccccc2)cc(C(F)(F)F)n1) is C13H9F3N2O.
Describe the ring structures in building block <BB_3222>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3222>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3222>.
**Token:** <BB_3222> **SMILES:** Oc1nc(/C=C/c2ccccc2)cc(C(F)(F)F)n1 **Molecular Formula:** C13H9F3N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3223>.
OCc1cnon1
What is the building block token for the following molecule?
OCc1cnon1
<BB_3223>
What is the molecular formula for <BB_3223>?
The molecular formula for <BB_3223> (OCc1cnon1) is C3H4N2O2.
Describe the ring structures in building block <BB_3223>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3223>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_3223>.
**Token:** <BB_3223> **SMILES:** OCc1cnon1 **Molecular Formula:** C3H4N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_3224>.
CC(C)N(C)c1ccccc1[N+](=O)[O-]
What is the building block token for the following molecule?
CC(C)N(C)c1ccccc1[N+](=O)[O-]
<BB_3224>
What is the molecular formula for <BB_3224>?
The molecular formula for <BB_3224> (CC(C)N(C)c1ccccc1[N+](=O)[O-]) is C10H14N2O2.
Describe the ring structures in building block <BB_3224>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3224>.
The molecule contains the following groups: Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_3224>.
**Token:** <BB_3224> **SMILES:** CC(C)N(C)c1ccccc1[N+](=O)[O-] **Molecular Formula:** C10H14N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_3225>.
CC(C)(C)OC(=O)NC(CC(Cl)Cl)C(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC(CC(Cl)Cl)C(=O)O
<BB_3225>
What is the molecular formula for <BB_3225>?
The molecular formula for <BB_3225> (CC(C)(C)OC(=O)NC(CC(Cl)Cl)C(=O)O) is C9H15Cl2NO4.
Describe the ring structures in building block <BB_3225>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3225>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3225>.
**Token:** <BB_3225> **SMILES:** CC(C)(C)OC(=O)NC(CC(Cl)Cl)C(=O)O **Molecular Formula:** C9H15Cl2NO4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3226>.
Cl.Cl.Fc1cc(Br)ccc1CNCc1ccccn1
What is the building block token for the following molecule?
Cl.Cl.Fc1cc(Br)ccc1CNCc1ccccn1
<BB_3226>
What is the molecular formula for <BB_3226>?
The molecular formula for <BB_3226> (Cl.Cl.Fc1cc(Br)ccc1CNCc1ccccn1) is C13H14BrCl2FN2.
Describe the ring structures in building block <BB_3226>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3226>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3226>.
**Token:** <BB_3226> **SMILES:** Cl.Cl.Fc1cc(Br)ccc1CNCc1ccccn1 **Molecular Formula:** C13H14BrCl2FN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3227>.
COC(=O)c1nccc2c1NCCC2
What is the building block token for the following molecule?
COC(=O)c1nccc2c1NCCC2
<BB_3227>
What is the molecular formula for <BB_3227>?
The molecular formula for <BB_3227> (COC(=O)c1nccc2c1NCCC2) is C10H12N2O2.
Describe the ring structures in building block <BB_3227>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3227>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3227>.
**Token:** <BB_3227> **SMILES:** COC(=O)c1nccc2c1NCCC2 **Molecular Formula:** C10H12N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_3228>.
Cc1ccc(S(=O)(=O)Cl)nc1
What is the building block token for the following molecule?
Cc1ccc(S(=O)(=O)Cl)nc1
<BB_3228>
What is the molecular formula for <BB_3228>?
The molecular formula for <BB_3228> (Cc1ccc(S(=O)(=O)Cl)nc1) is C6H6ClNO2S.
Describe the ring structures in building block <BB_3228>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3228>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3228>.
**Token:** <BB_3228> **SMILES:** Cc1ccc(S(=O)(=O)Cl)nc1 **Molecular Formula:** C6H6ClNO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3229>.
NCCCCCc1ccco1
What is the building block token for the following molecule?
NCCCCCc1ccco1
<BB_3229>
What is the molecular formula for <BB_3229>?
The molecular formula for <BB_3229> (NCCCCCc1ccco1) is C9H15NO.
Describe the ring structures in building block <BB_3229>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3229>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_3229>.
**Token:** <BB_3229> **SMILES:** NCCCCCc1ccco1 **Molecular Formula:** C9H15NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_3230>.
COc1ccc(NCc2ccccc2)cc1
What is the building block token for the following molecule?
COc1ccc(NCc2ccccc2)cc1
<BB_3230>
What is the molecular formula for <BB_3230>?
The molecular formula for <BB_3230> (COc1ccc(NCc2ccccc2)cc1) is C14H15NO.
Describe the ring structures in building block <BB_3230>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3230>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_3230>.
**Token:** <BB_3230> **SMILES:** COc1ccc(NCc2ccccc2)cc1 **Molecular Formula:** C14H15NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_3231>.
O=C(CCl)c1cc(Cl)ccc1O
What is the building block token for the following molecule?
O=C(CCl)c1cc(Cl)ccc1O
<BB_3231>
What is the molecular formula for <BB_3231>?
The molecular formula for <BB_3231> (O=C(CCl)c1cc(Cl)ccc1O) is C8H6Cl2O2.
Describe the ring structures in building block <BB_3231>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3231>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3231>.
**Token:** <BB_3231> **SMILES:** O=C(CCl)c1cc(Cl)ccc1O **Molecular Formula:** C8H6Cl2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3232>.
O=S(=O)(C1CCCNC1)N1CCOCC1
What is the building block token for the following molecule?
O=S(=O)(C1CCCNC1)N1CCOCC1
<BB_3232>
What is the molecular formula for <BB_3232>?
The molecular formula for <BB_3232> (O=S(=O)(C1CCCNC1)N1CCOCC1) is C9H18N2O3S.
Describe the ring structures in building block <BB_3232>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3232>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Ether, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_3232>.
**Token:** <BB_3232> **SMILES:** O=S(=O)(C1CCCNC1)N1CCOCC1 **Molecular Formula:** C9H18N2O3S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Ether, Sulfonamide
Provide the SMILES representation for the building block token <BB_3233>.
C#CCCc1c[nH]c2ccccc12
What is the building block token for the following molecule?
C#CCCc1c[nH]c2ccccc12
<BB_3233>