instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_8900>.
CO[C@H]1C[C@H](CCS(=O)(=O)Cl)C1
What is the building block token for the following molecule?
CO[C@H]1C[C@H](CCS(=O)(=O)Cl)C1
<BB_8900>
What is the molecular formula for <BB_8900>?
The molecular formula for <BB_8900> (CO[C@H]1C[C@H](CCS(=O)(=O)Cl)C1) is C7H13ClO3S.
Describe the ring structures in building block <BB_8900>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_8900>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8900>.
**Token:** <BB_8900> **SMILES:** CO[C@H]1C[C@H](CCS(=O)(=O)Cl)C1 **Molecular Formula:** C7H13ClO3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8901>.
Cc1cc(Cl)ncc1C#N
What is the building block token for the following molecule?
Cc1cc(Cl)ncc1C#N
<BB_8901>
What is the molecular formula for <BB_8901>?
The molecular formula for <BB_8901> (Cc1cc(Cl)ncc1C#N) is C7H5ClN2.
Describe the ring structures in building block <BB_8901>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8901>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_8901>.
**Token:** <BB_8901> **SMILES:** Cc1cc(Cl)ncc1C#N **Molecular Formula:** C7H5ClN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_8902>.
CCC(C)c1ccc(S(=O)(=O)Cl)cc1
What is the building block token for the following molecule?
CCC(C)c1ccc(S(=O)(=O)Cl)cc1
<BB_8902>
What is the molecular formula for <BB_8902>?
The molecular formula for <BB_8902> (CCC(C)c1ccc(S(=O)(=O)Cl)cc1) is C10H13ClO2S.
Describe the ring structures in building block <BB_8902>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8902>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8902>.
**Token:** <BB_8902> **SMILES:** CCC(C)c1ccc(S(=O)(=O)Cl)cc1 **Molecular Formula:** C10H13ClO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8903>.
O=[N+]([O-])c1cc(Cl)c(Cl)c(Cl)c1
What is the building block token for the following molecule?
O=[N+]([O-])c1cc(Cl)c(Cl)c(Cl)c1
<BB_8903>
What is the molecular formula for <BB_8903>?
The molecular formula for <BB_8903> (O=[N+]([O-])c1cc(Cl)c(Cl)c(Cl)c1) is C6H2Cl3NO2.
Describe the ring structures in building block <BB_8903>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8903>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_8903>.
**Token:** <BB_8903> **SMILES:** O=[N+]([O-])c1cc(Cl)c(Cl)c(Cl)c1 **Molecular Formula:** C6H2Cl3NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_8904>.
COCC1(C(=O)O)CCOCC1
What is the building block token for the following molecule?
COCC1(C(=O)O)CCOCC1
<BB_8904>
What is the molecular formula for <BB_8904>?
The molecular formula for <BB_8904> (COCC1(C(=O)O)CCOCC1) is C8H14O4.
Describe the ring structures in building block <BB_8904>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_8904>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_8904>.
**Token:** <BB_8904> **SMILES:** COCC1(C(=O)O)CCOCC1 **Molecular Formula:** C8H14O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_8905>.
Cl.Cl.NC1CCC(C(F)(F)F)NC1
What is the building block token for the following molecule?
Cl.Cl.NC1CCC(C(F)(F)F)NC1
<BB_8905>
What is the molecular formula for <BB_8905>?
The molecular formula for <BB_8905> (Cl.Cl.NC1CCC(C(F)(F)F)NC1) is C6H13Cl2F3N2.
Describe the ring structures in building block <BB_8905>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_8905>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8905>.
**Token:** <BB_8905> **SMILES:** Cl.Cl.NC1CCC(C(F)(F)F)NC1 **Molecular Formula:** C6H13Cl2F3N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8906>.
CC(C)(O)c1cnc(Cl)nc1
What is the building block token for the following molecule?
CC(C)(O)c1cnc(Cl)nc1
<BB_8906>
What is the molecular formula for <BB_8906>?
The molecular formula for <BB_8906> (CC(C)(O)c1cnc(Cl)nc1) is C7H9ClN2O.
Describe the ring structures in building block <BB_8906>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8906>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8906>.
**Token:** <BB_8906> **SMILES:** CC(C)(O)c1cnc(Cl)nc1 **Molecular Formula:** C7H9ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8907>.
C[S+](C)CCC(O)C(=O)O.O=S(=O)([O-])O
What is the building block token for the following molecule?
C[S+](C)CCC(O)C(=O)O.O=S(=O)([O-])O
<BB_8907>
What is the molecular formula for <BB_8907>?
The molecular formula for <BB_8907> (C[S+](C)CCC(O)C(=O)O.O=S(=O)([O-])O) is C6H14O7S2.
Describe the ring structures in building block <BB_8907>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_8907>.
The molecule contains the following groups: Carboxylic Acid, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_8907>.
**Token:** <BB_8907> **SMILES:** C[S+](C)CCC(O)C(=O)O.O=S(=O)([O-])O **Molecular Formula:** C6H14O7S2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Alcohol
Provide the SMILES representation for the building block token <BB_8908>.
CCOC(=O)c1c(N)sc2c1CCN(C)C2
What is the building block token for the following molecule?
CCOC(=O)c1c(N)sc2c1CCN(C)C2
<BB_8908>
What is the molecular formula for <BB_8908>?
The molecular formula for <BB_8908> (CCOC(=O)c1c(N)sc2c1CCN(C)C2) is C11H16N2O2S.
Describe the ring structures in building block <BB_8908>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_8908>.
The molecule contains the following groups: Amine, Tertiary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_8908>.
**Token:** <BB_8908> **SMILES:** CCOC(=O)c1c(N)sc2c1CCN(C)C2 **Molecular Formula:** C11H16N2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_8909>.
O=Cc1cc2c(nc1Cl)CCOC2
What is the building block token for the following molecule?
O=Cc1cc2c(nc1Cl)CCOC2
<BB_8909>
What is the molecular formula for <BB_8909>?
The molecular formula for <BB_8909> (O=Cc1cc2c(nc1Cl)CCOC2) is C9H8ClNO2.
Describe the ring structures in building block <BB_8909>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_8909>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8909>.
**Token:** <BB_8909> **SMILES:** O=Cc1cc2c(nc1Cl)CCOC2 **Molecular Formula:** C9H8ClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8910>.
COC(=O)C1(C2=CCNCC2)CCC1.Cl
What is the building block token for the following molecule?
COC(=O)C1(C2=CCNCC2)CCC1.Cl
<BB_8910>
What is the molecular formula for <BB_8910>?
The molecular formula for <BB_8910> (COC(=O)C1(C2=CCNCC2)CCC1.Cl) is C11H18ClNO2.
Describe the ring structures in building block <BB_8910>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_8910>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8910>.
**Token:** <BB_8910> **SMILES:** COC(=O)C1(C2=CCNCC2)CCC1.Cl **Molecular Formula:** C11H18ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8911>.
COc1ccc(Cl)c(Cl)c1C=O
What is the building block token for the following molecule?
COc1ccc(Cl)c(Cl)c1C=O
<BB_8911>
What is the molecular formula for <BB_8911>?
The molecular formula for <BB_8911> (COc1ccc(Cl)c(Cl)c1C=O) is C8H6Cl2O2.
Describe the ring structures in building block <BB_8911>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8911>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8911>.
**Token:** <BB_8911> **SMILES:** COc1ccc(Cl)c(Cl)c1C=O **Molecular Formula:** C8H6Cl2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8912>.
NCC1CCN(CCc2ccccc2)CC1
What is the building block token for the following molecule?
NCC1CCN(CCc2ccccc2)CC1
<BB_8912>
What is the molecular formula for <BB_8912>?
The molecular formula for <BB_8912> (NCC1CCN(CCc2ccccc2)CC1) is C14H22N2.
Describe the ring structures in building block <BB_8912>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_8912>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_8912>.
**Token:** <BB_8912> **SMILES:** NCC1CCN(CCc2ccccc2)CC1 **Molecular Formula:** C14H22N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_8913>.
COc1cc(OC)sn1
What is the building block token for the following molecule?
COc1cc(OC)sn1
<BB_8913>
What is the molecular formula for <BB_8913>?
The molecular formula for <BB_8913> (COc1cc(OC)sn1) is C5H7NO2S.
Describe the ring structures in building block <BB_8913>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_8913>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_8913>.
**Token:** <BB_8913> **SMILES:** COc1cc(OC)sn1 **Molecular Formula:** C5H7NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_8914>.
O=C(O)C1CCN(C(=O)C=Cc2ccccc2)CC1
What is the building block token for the following molecule?
O=C(O)C1CCN(C(=O)C=Cc2ccccc2)CC1
<BB_8914>
What is the molecular formula for <BB_8914>?
The molecular formula for <BB_8914> (O=C(O)C1CCN(C(=O)C=Cc2ccccc2)CC1) is C15H17NO3.
Describe the ring structures in building block <BB_8914>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_8914>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_8914>.
**Token:** <BB_8914> **SMILES:** O=C(O)C1CCN(C(=O)C=Cc2ccccc2)CC1 **Molecular Formula:** C15H17NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_8915>.
CCOC(=O)Cc1nc(C(C)C)c(C)s1
What is the building block token for the following molecule?
CCOC(=O)Cc1nc(C(C)C)c(C)s1
<BB_8915>
What is the molecular formula for <BB_8915>?
The molecular formula for <BB_8915> (CCOC(=O)Cc1nc(C(C)C)c(C)s1) is C11H17NO2S.
Describe the ring structures in building block <BB_8915>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_8915>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_8915>.
**Token:** <BB_8915> **SMILES:** CCOC(=O)Cc1nc(C(C)C)c(C)s1 **Molecular Formula:** C11H17NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_8916>.
CC(C)(C)OC(=O)N1CC2CCC1(C=O)CC2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC2CCC1(C=O)CC2
<BB_8916>
What is the molecular formula for <BB_8916>?
The molecular formula for <BB_8916> (CC(C)(C)OC(=O)N1CC2CCC1(C=O)CC2) is C13H21NO3.
Describe the ring structures in building block <BB_8916>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.