instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_8933>?
The molecular formula for <BB_8933> (CC1(C(=O)O)CC12CCS(=O)(=O)CC2) is C9H14O4S.
Describe the ring structures in building block <BB_8933>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6.
List the primary functional groups present in <BB_8933>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_8933>.
**Token:** <BB_8933> **SMILES:** CC1(C(=O)O)CC12CCS(=O)(=O)CC2 **Molecular Formula:** C9H14O4S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_8934>.
Clc1ncnc2ncc(Br)cc12
What is the building block token for the following molecule?
Clc1ncnc2ncc(Br)cc12
<BB_8934>
What is the molecular formula for <BB_8934>?
The molecular formula for <BB_8934> (Clc1ncnc2ncc(Br)cc12) is C7H3BrClN3.
Describe the ring structures in building block <BB_8934>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_8934>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8934>.
**Token:** <BB_8934> **SMILES:** Clc1ncnc2ncc(Br)cc12 **Molecular Formula:** C7H3BrClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8935>.
O=C1COC(=O)[N-]1.[K+]
What is the building block token for the following molecule?
O=C1COC(=O)[N-]1.[K+]
<BB_8935>
What is the molecular formula for <BB_8935>?
The molecular formula for <BB_8935> (O=C1COC(=O)[N-]1.[K+]) is C3H2KNO3.
Describe the ring structures in building block <BB_8935>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_8935>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_8935>.
**Token:** <BB_8935> **SMILES:** O=C1COC(=O)[N-]1.[K+] **Molecular Formula:** C3H2KNO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_8936>.
O=C(O)c1ccc(Cl)c(Br)c1
What is the building block token for the following molecule?
O=C(O)c1ccc(Cl)c(Br)c1
<BB_8936>
What is the molecular formula for <BB_8936>?
The molecular formula for <BB_8936> (O=C(O)c1ccc(Cl)c(Br)c1) is C7H4BrClO2.
Describe the ring structures in building block <BB_8936>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8936>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8936>.
**Token:** <BB_8936> **SMILES:** O=C(O)c1ccc(Cl)c(Br)c1 **Molecular Formula:** C7H4BrClO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8937>.
COC(=O)c1ccc2cnc(C(=O)OC)cc2c1
What is the building block token for the following molecule?
COC(=O)c1ccc2cnc(C(=O)OC)cc2c1
<BB_8937>
What is the molecular formula for <BB_8937>?
The molecular formula for <BB_8937> (COC(=O)c1ccc2cnc(C(=O)OC)cc2c1) is C13H11NO4.
Describe the ring structures in building block <BB_8937>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_8937>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_8937>.
**Token:** <BB_8937> **SMILES:** COC(=O)c1ccc2cnc(C(=O)OC)cc2c1 **Molecular Formula:** C13H11NO4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_8938>.
O=C1C2CCC(O)C1Cc1ccccc12
What is the building block token for the following molecule?
O=C1C2CCC(O)C1Cc1ccccc12
<BB_8938>
What is the molecular formula for <BB_8938>?
The molecular formula for <BB_8938> (O=C1C2CCC(O)C1Cc1ccccc12) is C13H14O2.
Describe the ring structures in building block <BB_8938>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_8938>.
The molecule contains the following groups: Ketone, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_8938>.
**Token:** <BB_8938> **SMILES:** O=C1C2CCC(O)C1Cc1ccccc12 **Molecular Formula:** C13H14O2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone, Alcohol
Provide the SMILES representation for the building block token <BB_8939>.
O=C(O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1
What is the building block token for the following molecule?
O=C(O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1
<BB_8939>
What is the molecular formula for <BB_8939>?
The molecular formula for <BB_8939> (O=C(O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1) is C9H15NO2.
Describe the ring structures in building block <BB_8939>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_8939>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_8939>.
**Token:** <BB_8939> **SMILES:** O=C(O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1 **Molecular Formula:** C9H15NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine
Provide the SMILES representation for the building block token <BB_8940>.
CC(C)(C)OC(=O)NCCCC(O)CO
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCCCC(O)CO
<BB_8940>
What is the molecular formula for <BB_8940>?
The molecular formula for <BB_8940> (CC(C)(C)OC(=O)NCCCC(O)CO) is C10H21NO4.
Describe the ring structures in building block <BB_8940>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_8940>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_8940>.
**Token:** <BB_8940> **SMILES:** CC(C)(C)OC(=O)NCCCC(O)CO **Molecular Formula:** C10H21NO4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_8941>.
O=C(O)C12CC(c3ccc(C(F)(F)F)cc3)(C1)C2F
What is the building block token for the following molecule?
O=C(O)C12CC(c3ccc(C(F)(F)F)cc3)(C1)C2F
<BB_8941>
What is the molecular formula for <BB_8941>?
The molecular formula for <BB_8941> (O=C(O)C12CC(c3ccc(C(F)(F)F)cc3)(C1)C2F) is C13H10F4O2.
Describe the ring structures in building block <BB_8941>.
The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_8941>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8941>.
**Token:** <BB_8941> **SMILES:** O=C(O)C12CC(c3ccc(C(F)(F)F)cc3)(C1)C2F **Molecular Formula:** C13H10F4O2 **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8942>.
CC(C)(C#N)CBr
What is the building block token for the following molecule?
CC(C)(C#N)CBr
<BB_8942>
What is the molecular formula for <BB_8942>?
The molecular formula for <BB_8942> (CC(C)(C#N)CBr) is C5H8BrN.
Describe the ring structures in building block <BB_8942>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_8942>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_8942>.
**Token:** <BB_8942> **SMILES:** CC(C)(C#N)CBr **Molecular Formula:** C5H8BrN **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_8943>.
CCOC(=O)c1snnc1N
What is the building block token for the following molecule?
CCOC(=O)c1snnc1N
<BB_8943>
What is the molecular formula for <BB_8943>?
The molecular formula for <BB_8943> (CCOC(=O)c1snnc1N) is C5H7N3O2S.
Describe the ring structures in building block <BB_8943>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_8943>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_8943>.
**Token:** <BB_8943> **SMILES:** CCOC(=O)c1snnc1N **Molecular Formula:** C5H7N3O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_8944>.
Nc1cccc(Cn2ccnc2)c1
What is the building block token for the following molecule?
Nc1cccc(Cn2ccnc2)c1
<BB_8944>
What is the molecular formula for <BB_8944>?
The molecular formula for <BB_8944> (Nc1cccc(Cn2ccnc2)c1) is C10H11N3.
Describe the ring structures in building block <BB_8944>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_8944>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_8944>.
**Token:** <BB_8944> **SMILES:** Nc1cccc(Cn2ccnc2)c1 **Molecular Formula:** C10H11N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_8945>.
Nc1cccnc1Oc1cccnc1
What is the building block token for the following molecule?
Nc1cccnc1Oc1cccnc1
<BB_8945>
What is the molecular formula for <BB_8945>?
The molecular formula for <BB_8945> (Nc1cccnc1Oc1cccnc1) is C10H9N3O.
Describe the ring structures in building block <BB_8945>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_8945>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_8945>.
**Token:** <BB_8945> **SMILES:** Nc1cccnc1Oc1cccnc1 **Molecular Formula:** C10H9N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_8946>.
CCC(CC)C1CNC1.Cl
What is the building block token for the following molecule?
CCC(CC)C1CNC1.Cl
<BB_8946>
What is the molecular formula for <BB_8946>?
The molecular formula for <BB_8946> (CCC(CC)C1CNC1.Cl) is C8H18ClN.
Describe the ring structures in building block <BB_8946>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_8946>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8946>.
**Token:** <BB_8946> **SMILES:** CCC(CC)C1CNC1.Cl **Molecular Formula:** C8H18ClN **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8947>.
OCC(CNCc1ccccc1)C1CCC1
What is the building block token for the following molecule?
OCC(CNCc1ccccc1)C1CCC1
<BB_8947>
What is the molecular formula for <BB_8947>?
The molecular formula for <BB_8947> (OCC(CNCc1ccccc1)C1CCC1) is C14H21NO.
Describe the ring structures in building block <BB_8947>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_8947>.
The molecule contains the following groups: Secondary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_8947>.
**Token:** <BB_8947> **SMILES:** OCC(CNCc1ccccc1)C1CCC1 **Molecular Formula:** C14H21NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_8948>.
O=C(O)Cc1csc(-c2cc(Br)cs2)n1
What is the building block token for the following molecule?
O=C(O)Cc1csc(-c2cc(Br)cs2)n1
<BB_8948>
What is the molecular formula for <BB_8948>?
The molecular formula for <BB_8948> (O=C(O)Cc1csc(-c2cc(Br)cs2)n1) is C9H6BrNO2S2.
Describe the ring structures in building block <BB_8948>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_8948>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8948>.
**Token:** <BB_8948> **SMILES:** O=C(O)Cc1csc(-c2cc(Br)cs2)n1 **Molecular Formula:** C9H6BrNO2S2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8949>.
COc1ccc(OC)c(/C=C/C(=O)O)c1
What is the building block token for the following molecule?
COc1ccc(OC)c(/C=C/C(=O)O)c1
<BB_8949>
What is the molecular formula for <BB_8949>?
The molecular formula for <BB_8949> (COc1ccc(OC)c(/C=C/C(=O)O)c1) is C11H12O4.
Describe the ring structures in building block <BB_8949>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8949>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_8949>.
**Token:** <BB_8949> **SMILES:** COc1ccc(OC)c(/C=C/C(=O)O)c1 **Molecular Formula:** C11H12O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether