hexsha string | size int64 | ext string | lang string | max_stars_repo_path string | max_stars_repo_name string | max_stars_repo_head_hexsha string | max_stars_repo_licenses list | max_stars_count int64 | max_stars_repo_stars_event_min_datetime string | max_stars_repo_stars_event_max_datetime string | max_issues_repo_path string | max_issues_repo_name string | max_issues_repo_head_hexsha string | max_issues_repo_licenses list | max_issues_count int64 | max_issues_repo_issues_event_min_datetime string | max_issues_repo_issues_event_max_datetime string | max_forks_repo_path string | max_forks_repo_name string | max_forks_repo_head_hexsha string | max_forks_repo_licenses list | max_forks_count int64 | max_forks_repo_forks_event_min_datetime string | max_forks_repo_forks_event_max_datetime string | content string | avg_line_length float64 | max_line_length int64 | alphanum_fraction float64 | qsc_code_num_words_quality_signal int64 | qsc_code_num_chars_quality_signal float64 | qsc_code_mean_word_length_quality_signal float64 | qsc_code_frac_words_unique_quality_signal float64 | qsc_code_frac_chars_top_2grams_quality_signal float64 | qsc_code_frac_chars_top_3grams_quality_signal float64 | qsc_code_frac_chars_top_4grams_quality_signal float64 | qsc_code_frac_chars_dupe_5grams_quality_signal float64 | qsc_code_frac_chars_dupe_6grams_quality_signal float64 | qsc_code_frac_chars_dupe_7grams_quality_signal float64 | qsc_code_frac_chars_dupe_8grams_quality_signal float64 | qsc_code_frac_chars_dupe_9grams_quality_signal float64 | qsc_code_frac_chars_dupe_10grams_quality_signal float64 | qsc_code_frac_chars_replacement_symbols_quality_signal float64 | qsc_code_frac_chars_digital_quality_signal float64 | qsc_code_frac_chars_whitespace_quality_signal float64 | qsc_code_size_file_byte_quality_signal float64 | qsc_code_num_lines_quality_signal float64 | qsc_code_num_chars_line_max_quality_signal float64 | qsc_code_num_chars_line_mean_quality_signal float64 | qsc_code_frac_chars_alphabet_quality_signal float64 | qsc_code_frac_chars_comments_quality_signal float64 | qsc_code_cate_xml_start_quality_signal float64 | qsc_code_frac_lines_dupe_lines_quality_signal float64 | qsc_code_cate_autogen_quality_signal float64 | qsc_code_frac_lines_long_string_quality_signal float64 | qsc_code_frac_chars_string_length_quality_signal float64 | qsc_code_frac_chars_long_word_length_quality_signal float64 | qsc_code_frac_lines_string_concat_quality_signal float64 | qsc_code_cate_encoded_data_quality_signal float64 | qsc_code_frac_chars_hex_words_quality_signal float64 | qsc_code_frac_lines_prompt_comments_quality_signal float64 | qsc_code_frac_lines_assert_quality_signal float64 | qsc_codepython_cate_ast_quality_signal float64 | qsc_codepython_frac_lines_func_ratio_quality_signal float64 | qsc_codepython_cate_var_zero_quality_signal bool | qsc_codepython_frac_lines_pass_quality_signal float64 | qsc_codepython_frac_lines_import_quality_signal float64 | qsc_codepython_frac_lines_simplefunc_quality_signal float64 | qsc_codepython_score_lines_no_logic_quality_signal float64 | qsc_codepython_frac_lines_print_quality_signal float64 | qsc_code_num_words int64 | qsc_code_num_chars int64 | qsc_code_mean_word_length int64 | qsc_code_frac_words_unique null | qsc_code_frac_chars_top_2grams int64 | qsc_code_frac_chars_top_3grams int64 | qsc_code_frac_chars_top_4grams int64 | qsc_code_frac_chars_dupe_5grams int64 | qsc_code_frac_chars_dupe_6grams int64 | qsc_code_frac_chars_dupe_7grams int64 | qsc_code_frac_chars_dupe_8grams int64 | qsc_code_frac_chars_dupe_9grams int64 | qsc_code_frac_chars_dupe_10grams int64 | qsc_code_frac_chars_replacement_symbols int64 | qsc_code_frac_chars_digital int64 | qsc_code_frac_chars_whitespace int64 | qsc_code_size_file_byte int64 | qsc_code_num_lines int64 | qsc_code_num_chars_line_max int64 | qsc_code_num_chars_line_mean int64 | qsc_code_frac_chars_alphabet int64 | qsc_code_frac_chars_comments int64 | qsc_code_cate_xml_start int64 | qsc_code_frac_lines_dupe_lines int64 | qsc_code_cate_autogen int64 | qsc_code_frac_lines_long_string int64 | qsc_code_frac_chars_string_length int64 | qsc_code_frac_chars_long_word_length int64 | qsc_code_frac_lines_string_concat null | qsc_code_cate_encoded_data int64 | qsc_code_frac_chars_hex_words int64 | qsc_code_frac_lines_prompt_comments int64 | qsc_code_frac_lines_assert int64 | qsc_codepython_cate_ast int64 | qsc_codepython_frac_lines_func_ratio int64 | qsc_codepython_cate_var_zero int64 | qsc_codepython_frac_lines_pass int64 | qsc_codepython_frac_lines_import int64 | qsc_codepython_frac_lines_simplefunc int64 | qsc_codepython_score_lines_no_logic int64 | qsc_codepython_frac_lines_print int64 | effective string | hits int64 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
635453b6d41cf038663bf558cac583aa6e1b1819 | 783 | py | Python | graphTraversal/test_traversal.py | yujhenchen/AlgorithmsAndDataStructures | 73283eea4ace8bd76ae6c63b30cd55da400ac373 | [
"MIT"
] | null | null | null | graphTraversal/test_traversal.py | yujhenchen/AlgorithmsAndDataStructures | 73283eea4ace8bd76ae6c63b30cd55da400ac373 | [
"MIT"
] | null | null | null | graphTraversal/test_traversal.py | yujhenchen/AlgorithmsAndDataStructures | 73283eea4ace8bd76ae6c63b30cd55da400ac373 | [
"MIT"
] | null | null | null | from graphTraversal import GraphTraversal
def printGraph(graph):
print(graph.adjancencyList)
print()
def addVertexEdges():
graph = GraphTraversal()
graph.addVertex("A")
graph.addVertex("B")
graph.addVertex("C")
graph.addVertex("D")
graph.addVertex("E")
graph.addEdge("A", "B")
... | 19.575 | 41 | 0.59387 | 94 | 783 | 4.925532 | 0.212766 | 0.311015 | 0.084233 | 0.060475 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.212005 | 783 | 39 | 42 | 20.076923 | 0.750405 | 0.021711 | 0 | 0.068966 | 0 | 0 | 0.037958 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.137931 | false | 0 | 0.034483 | 0 | 0.206897 | 0.137931 | 0 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
63561ed015c539405b8f177ae3efea054b87783d | 5,665 | py | Python | modules/scraper.py | Nikhil-Kulkarni/instagram-scraper | 20d009c6f1c747529399be6e47cc1a11f02d30e2 | [
"MIT"
] | null | null | null | modules/scraper.py | Nikhil-Kulkarni/instagram-scraper | 20d009c6f1c747529399be6e47cc1a11f02d30e2 | [
"MIT"
] | null | null | null | modules/scraper.py | Nikhil-Kulkarni/instagram-scraper | 20d009c6f1c747529399be6e47cc1a11f02d30e2 | [
"MIT"
] | null | null | null | import re
import time
from selenium import webdriver
from selenium.webdriver.common.keys import Keys
from selenium.webdriver.common.by import By
from selenium.webdriver.support.ui import WebDriverWait
from selenium.webdriver.support import expected_conditions as EC
from random import seed
from random import random
fro... | 31.472222 | 92 | 0.556222 | 645 | 5,665 | 4.711628 | 0.255814 | 0.039487 | 0.025666 | 0.043435 | 0.287266 | 0.287266 | 0.260941 | 0.217506 | 0.217506 | 0.189865 | 0 | 0.008984 | 0.351633 | 5,665 | 179 | 93 | 31.648045 | 0.815137 | 0.100618 | 0 | 0.222222 | 0 | 0 | 0.074774 | 0.031156 | 0 | 0 | 0 | 0 | 0 | 1 | 0.071429 | false | 0.055556 | 0.079365 | 0 | 0.246032 | 0.047619 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 1 |
635d1e8ff8b745d6b3576cf9ce63bce558e2ba4a | 1,256 | py | Python | Add Selected Glyphs To CSS.py | benhami1ton/iconfont-build-update | 6006e28c358903be4f776783a3139e69d5a83326 | [
"MIT"
] | null | null | null | Add Selected Glyphs To CSS.py | benhami1ton/iconfont-build-update | 6006e28c358903be4f776783a3139e69d5a83326 | [
"MIT"
] | null | null | null | Add Selected Glyphs To CSS.py | benhami1ton/iconfont-build-update | 6006e28c358903be4f776783a3139e69d5a83326 | [
"MIT"
] | null | null | null |
#MenuTitle: AddSelectedGlyphsToCSS
# -*- coding: utf-8 -*-
__doc__="""
Takes selected glyphs and outputs code for custom CSS classes to insert the new icons
Instructions: Select Icons in Glyphs application, run code in Macro window, then paste into CSS file.
"""
lineBreak = '\n'
glyphname = 'b'
thisFont = Glyphs.font
... | 33.052632 | 145 | 0.75 | 137 | 1,256 | 6.817518 | 0.664234 | 0.029979 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.000935 | 0.148885 | 1,256 | 37 | 146 | 33.945946 | 0.872778 | 0.04379 | 0 | 0 | 0 | 0 | 0.240147 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0 | null | null | 0.076923 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
636669d7a6db6da7b3091e9ae064c8be768c69b5 | 1,752 | py | Python | src/avd/plugins/generic/OutOfBounds.py | Traxes/zeno | 48e72e8884838a171a217336923beec2983853b5 | [
"BSD-3-Clause"
] | 35 | 2019-03-21T08:56:16.000Z | 2022-03-24T07:55:44.000Z | src/avd/plugins/generic/OutOfBounds.py | bkerler/zeno | d1e51e0226474a81d96de26f36ffc2d39065ba87 | [
"BSD-3-Clause"
] | 5 | 2019-02-27T17:15:35.000Z | 2019-03-21T16:32:32.000Z | src/avd/plugins/generic/OutOfBounds.py | bkerler/zeno | d1e51e0226474a81d96de26f36ffc2d39065ba87 | [
"BSD-3-Clause"
] | 5 | 2019-03-21T13:31:33.000Z | 2019-08-17T01:32:24.000Z | from src.avd.plugins import Plugin
#from ..reporter.vulnerability import Vulnerability
#from ..helper import binjaWrapper, sources
#import re
#import collections
#import traceback
#from src.avd.core.sliceEngine import slice
from src.avd.core.sliceEngine.loopDetection import loop_analysis
#from binaryninja import Medium... | 35.04 | 98 | 0.638128 | 213 | 1,752 | 5.046948 | 0.497653 | 0.03907 | 0.027907 | 0.026047 | 0.139535 | 0.074419 | 0.074419 | 0 | 0 | 0 | 0 | 0.00318 | 0.281963 | 1,752 | 49 | 99 | 35.755102 | 0.851351 | 0.357306 | 0 | 0.166667 | 0 | 0 | 0.098982 | 0 | 0 | 0 | 0 | 0.020408 | 0 | 1 | 0.166667 | false | 0.041667 | 0.083333 | 0 | 0.5 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
6369af8aa4d1d81d1acc5b49c4a5fe7efb073edf | 3,710 | py | Python | accelbyte_py_sdk/api/platform/models/category_create.py | encyphered/accelbyte-python-sdk | 09c1e989d7251de308150fdcd3119d662ca2d205 | [
"MIT"
] | null | null | null | accelbyte_py_sdk/api/platform/models/category_create.py | encyphered/accelbyte-python-sdk | 09c1e989d7251de308150fdcd3119d662ca2d205 | [
"MIT"
] | null | null | null | accelbyte_py_sdk/api/platform/models/category_create.py | encyphered/accelbyte-python-sdk | 09c1e989d7251de308150fdcd3119d662ca2d205 | [
"MIT"
] | null | null | null | # Auto-generated at 2021-09-27T17:12:36.201014+08:00
# from: Justice Platform Service (3.24.0)
# Copyright (c) 2018 - 2021 AccelByte Inc. All Rights Reserved.
# This is licensed software from AccelByte Inc, for limitations
# and restrictions contact your company contract manager.
# pylint: disable=duplicate-code
# py... | 34.351852 | 124 | 0.663342 | 405 | 3,710 | 5.91358 | 0.303704 | 0.070564 | 0.130271 | 0.066806 | 0.075992 | 0.044259 | 0.015866 | 0.015866 | 0 | 0 | 0 | 0.015765 | 0.247709 | 3,710 | 107 | 125 | 34.672897 | 0.84235 | 0.3 | 0 | 0.245283 | 1 | 0 | 0.11543 | 0.076953 | 0 | 0 | 0 | 0 | 0 | 1 | 0.113208 | false | 0 | 0.056604 | 0.018868 | 0.358491 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
636e00a959b212f262ac012cb926737093403373 | 8,291 | py | Python | app/utils.py | Tevinthuku/Questioner-API-V2 | 4ebe1a5a811635af5580c02c3fccb52c57fc862c | [
"MIT"
] | 1 | 2019-01-17T16:35:34.000Z | 2019-01-17T16:35:34.000Z | app/utils.py | Tevinthuku/Questioner-API-V2 | 4ebe1a5a811635af5580c02c3fccb52c57fc862c | [
"MIT"
] | 1 | 2019-01-22T07:30:46.000Z | 2019-01-22T07:30:46.000Z | app/utils.py | Tevinthuku/Questioner-API-V2 | 4ebe1a5a811635af5580c02c3fccb52c57fc862c | [
"MIT"
] | 1 | 2019-02-11T06:25:37.000Z | 2019-02-11T06:25:37.000Z | # This module contains the functions that will validate users data
# some imports
import os
import re
from functools import wraps
import jwt
from flask import jsonify, request, abort, make_response
from werkzeug.security import generate_password_hash
from datetime import datetime
import jwt
# local imports
from app.... | 32.513725 | 122 | 0.595706 | 1,069 | 8,291 | 4.52666 | 0.210477 | 0.046497 | 0.087828 | 0.119033 | 0.421781 | 0.355239 | 0.342426 | 0.312048 | 0.253978 | 0.233726 | 0 | 0.034191 | 0.273308 | 8,291 | 255 | 123 | 32.513725 | 0.768963 | 0.105416 | 0 | 0.311258 | 0 | 0.006623 | 0.207623 | 0.009142 | 0 | 0 | 0 | 0 | 0 | 1 | 0.07947 | false | 0.092715 | 0.072848 | 0 | 0.238411 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 1 |
636f01e3ee57a3d5a058d1e1c8dfdab1d8fd8ba4 | 1,249 | py | Python | MovieRec.py | JDReutt/siraj | 99316153c836824e7fcce61419d9ff625b0e8387 | [
"MIT"
] | null | null | null | MovieRec.py | JDReutt/siraj | 99316153c836824e7fcce61419d9ff625b0e8387 | [
"MIT"
] | null | null | null | MovieRec.py | JDReutt/siraj | 99316153c836824e7fcce61419d9ff625b0e8387 | [
"MIT"
] | null | null | null | import numpy as np
import lightfm.datasets import fetch_movielens
import lightfm import LightFM
# fetch data and format it
data = fetch_movielens(min_rating=4.0)
# print training and testing data
print(repr(data['train']))
print(repr(data['test']))
# create model
# warp = weighted approximate-rank pairwise (uses gra... | 26.574468 | 90 | 0.705364 | 185 | 1,249 | 4.648649 | 0.481081 | 0.04186 | 0.030233 | 0.067442 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.011685 | 0.177742 | 1,249 | 46 | 91 | 27.152174 | 0.825706 | 0.297838 | 0 | 0.090909 | 0 | 0 | 0.141204 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.136364 | null | null | 0.318182 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
6370d11a22071d0bc0aa587a06bea8fe2422b984 | 5,936 | py | Python | src/parser/landmarks_csv_parser.py | youlu860612/IDAR | 30e711fafb17731905febc8e86cb51306456d023 | [
"Unlicense"
] | null | null | null | src/parser/landmarks_csv_parser.py | youlu860612/IDAR | 30e711fafb17731905febc8e86cb51306456d023 | [
"Unlicense"
] | null | null | null | src/parser/landmarks_csv_parser.py | youlu860612/IDAR | 30e711fafb17731905febc8e86cb51306456d023 | [
"Unlicense"
] | null | null | null | # landmarks_csv_parser.py
# Parse the landmarks csv file into a collection object. It also provides the
# functionality to save a collection object into a csv file.
#
# Steven Lu 4/23/2018
from collection.raw_collection import RawCollection
import csv_mapping as m
import csv
import json
import sys
import os
import er... | 37.808917 | 84 | 0.602089 | 683 | 5,936 | 5.01757 | 0.229868 | 0.028013 | 0.02918 | 0.02918 | 0.233732 | 0.171579 | 0.120805 | 0.120805 | 0.120805 | 0.120805 | 0 | 0.009766 | 0.309973 | 5,936 | 156 | 85 | 38.051282 | 0.826904 | 0.155492 | 0 | 0.209524 | 0 | 0 | 0.153106 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0.009524 | 0.066667 | null | null | 0.12381 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
6374d9eb8ae6e7f6799c0803b8ed546bc07a2803 | 25,571 | py | Python | pxr/usd/lib/usd/testenv/testUsdStageLoadUnload.py | octarrow/USD | 1845291a9701ab0a3a7d591bc243a1a80fdcba8a | [
"Unlicense"
] | 6 | 2018-08-26T13:27:22.000Z | 2021-08-14T23:57:38.000Z | pxr/usd/lib/usd/testenv/testUsdStageLoadUnload.py | octarrow/USD | 1845291a9701ab0a3a7d591bc243a1a80fdcba8a | [
"Unlicense"
] | 1 | 2021-08-14T23:57:51.000Z | 2021-08-14T23:57:51.000Z | pxr/usd/lib/usd/testenv/testUsdStageLoadUnload.py | octarrow/USD | 1845291a9701ab0a3a7d591bc243a1a80fdcba8a | [
"Unlicense"
] | 4 | 2018-06-14T18:14:59.000Z | 2021-09-13T22:20:50.000Z | #!/pxrpythonsubst
#
# Copyright 2017 Pixar
#
# Licensed under the Apache License, Version 2.0 (the "Apache License")
# with the following modification; you may not use this file except in
# compliance with the Apache License and the following modification to it:
# Section 6. Trademarks. is deleted and replaced with:
#
... | 41.044944 | 84 | 0.547534 | 2,834 | 25,571 | 4.912491 | 0.141143 | 0.061198 | 0.075061 | 0.029881 | 0.619451 | 0.568094 | 0.537135 | 0.489872 | 0.47249 | 0.434708 | 0 | 0.005901 | 0.337257 | 25,571 | 622 | 85 | 41.110932 | 0.815602 | 0.201517 | 0 | 0.578667 | 0 | 0 | 0.093412 | 0 | 0 | 0 | 0 | 0.001608 | 0.349333 | 0 | null | null | 0 | 0.013333 | null | null | 0.024 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
6378e1149a9370332e6b81cc1d7dd37ee4089470 | 4,003 | py | Python | src/test/testcases/testPutGetScom.py | wak-google/sbe | c9fea2e9662bdef548ea4742106b721386240ffe | [
"Apache-2.0"
] | null | null | null | src/test/testcases/testPutGetScom.py | wak-google/sbe | c9fea2e9662bdef548ea4742106b721386240ffe | [
"Apache-2.0"
] | null | null | null | src/test/testcases/testPutGetScom.py | wak-google/sbe | c9fea2e9662bdef548ea4742106b721386240ffe | [
"Apache-2.0"
] | null | null | null | # IBM_PROLOG_BEGIN_TAG
# This is an automatically generated prolog.
#
# $Source: src/test/testcases/testPutGetScom.py $
#
# OpenPOWER sbe Project
#
# Contributors Listed Below - COPYRIGHT 2015,2016
# [+] International Business Machines Corp.
#
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you ma... | 33.358333 | 79 | 0.580315 | 460 | 4,003 | 4.982609 | 0.382609 | 0.013962 | 0.036649 | 0.015707 | 0.528796 | 0.448517 | 0.250436 | 0.250436 | 0.213787 | 0.179756 | 0 | 0.10046 | 0.29378 | 4,003 | 119 | 80 | 33.638655 | 0.710294 | 0.337247 | 0 | 0.447761 | 1 | 0 | 0.078957 | 0.009582 | 0 | 0 | 0.134918 | 0.008403 | 0 | 1 | 0.014925 | false | 0 | 0.029851 | 0 | 0.044776 | 0.089552 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
638157542c8be3a0e65d58045a301a96297ea0ef | 4,606 | py | Python | _handsfree_weather_search.py | konsan1101/pycv4nict | 490c6cc664f4d96d07d795346cfd5ef447c64415 | [
"MIT"
] | null | null | null | _handsfree_weather_search.py | konsan1101/pycv4nict | 490c6cc664f4d96d07d795346cfd5ef447c64415 | [
"MIT"
] | null | null | null | _handsfree_weather_search.py | konsan1101/pycv4nict | 490c6cc664f4d96d07d795346cfd5ef447c64415 | [
"MIT"
] | null | null | null | #!/usr/bin/env python
# -*- coding: utf-8 -*-
import sys
import os
import queue
import threading
import subprocess
import datetime
import time
import codecs
# weather 天気予報
import speech_api_weather as weather_api
import speech_api_weather_key as weather_key
qPathTTS = 'temp/a3_5tts_txt/'
qPathWork = 'temp... | 27.094118 | 111 | 0.55558 | 523 | 4,606 | 4.760994 | 0.305927 | 0.047791 | 0.027309 | 0.020482 | 0.073092 | 0.019277 | 0.011245 | 0 | 0 | 0 | 0 | 0.015035 | 0.292445 | 4,606 | 169 | 112 | 27.254438 | 0.747469 | 0.025836 | 0 | 0.107438 | 0 | 0 | 0.125307 | 0.010945 | 0.008264 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.082645 | null | null | 0.016529 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
6388e70bd23db5ae39aedc61f0a3aa8a633f2fa7 | 4,972 | py | Python | code-challenges/cf401/linked_list/linked_list.py | chrisba11/data-structures-and-algorithms | 3111ff813ba54e307d36422c04252d51e4f5cc0b | [
"MIT"
] | null | null | null | code-challenges/cf401/linked_list/linked_list.py | chrisba11/data-structures-and-algorithms | 3111ff813ba54e307d36422c04252d51e4f5cc0b | [
"MIT"
] | 11 | 2019-02-19T01:25:41.000Z | 2019-04-10T05:09:23.000Z | code-challenges/cf401/linked_list/linked_list.py | chrisba11/data-structures-and-algorithms | 3111ff813ba54e307d36422c04252d51e4f5cc0b | [
"MIT"
] | null | null | null | """
Module containing LinkedList class and Node class.
"""
class LinkedList():
"""
Class to generate and modify linked list.
"""
def __init__(self, arg=None):
self.head = None
if arg is not None:
if hasattr(arg, '__iter__') and not isinstance(arg, str):
for ... | 27.469613 | 69 | 0.499195 | 575 | 4,972 | 4.215652 | 0.142609 | 0.062706 | 0.068069 | 0.034653 | 0.567657 | 0.454208 | 0.433581 | 0.413366 | 0.413366 | 0.413366 | 0 | 0.00173 | 0.418544 | 4,972 | 180 | 70 | 27.622222 | 0.836735 | 0.171762 | 0 | 0.57377 | 1 | 0 | 0.035686 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.106557 | false | 0 | 0 | 0 | 0.188525 | 0.04918 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
639322e635ec79f9f00fbfd7dcf42c091d00007c | 6,789 | py | Python | srllib/qtgui/models.py | craneworks/srl-python-lib | 83b24b9dc406f4481d2b5fad814e2eff932cb04f | [
"MIT"
] | null | null | null | srllib/qtgui/models.py | craneworks/srl-python-lib | 83b24b9dc406f4481d2b5fad814e2eff932cb04f | [
"MIT"
] | null | null | null | srllib/qtgui/models.py | craneworks/srl-python-lib | 83b24b9dc406f4481d2b5fad814e2eff932cb04f | [
"MIT"
] | null | null | null | """ Collection of Qt model classes.
"""
from PyQt4 import QtGui, QtCore
from PyQt4.QtCore import Qt
class _AppendRowCommand(QtGui.QUndoCommand):
__super = QtGui.QUndoCommand
def __init__(self, model, items, text, parent=None):
if text is None:
text = "append row"
self.__super.__ini... | 35.731579 | 81 | 0.649286 | 815 | 6,789 | 5.136196 | 0.217178 | 0.070951 | 0.031056 | 0.024367 | 0.195891 | 0.125179 | 0.100334 | 0.064979 | 0.064979 | 0.064979 | 0 | 0.002168 | 0.252762 | 6,789 | 189 | 82 | 35.920635 | 0.822984 | 0.194727 | 0 | 0.137931 | 0 | 0 | 0.008116 | 0 | 0 | 0 | 0 | 0 | 0.008621 | 1 | 0.224138 | false | 0 | 0.017241 | 0.025862 | 0.353448 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
6398f0360d58bede91f2a7b5ccfb570cf644eeca | 11,041 | py | Python | wlister/wlconfig.py | etombini/wlister | e517aea028080eef175f4284c9c8b194685e3449 | [
"0BSD"
] | 3 | 2016-12-21T13:39:36.000Z | 2020-10-20T01:12:17.000Z | wlister/wlconfig.py | etombini/wlister | e517aea028080eef175f4284c9c8b194685e3449 | [
"0BSD"
] | null | null | null | wlister/wlconfig.py | etombini/wlister | e517aea028080eef175f4284c9c8b194685e3449 | [
"0BSD"
] | 3 | 2015-10-27T13:29:05.000Z | 2021-05-19T07:01:50.000Z | # -*- coding: utf-8 -*-
# Copyright (c) 2014, Elvis Tombini <elvis@mapom.me>
#
# Permission to use, copy, modify, and distribute this software for any
# purpose with or without fee is hereby granted, provided that the above
# copyright notice and this permission notice appear in all copies.
#
# THE SOFTWARE IS PROVIDE... | 35.16242 | 76 | 0.283761 | 596 | 11,041 | 5.147651 | 0.268456 | 0.11734 | 0.123207 | 0.158409 | 0.482725 | 0.432855 | 0.354628 | 0.289439 | 0.276076 | 0.246741 | 0 | 0.005346 | 0.610361 | 11,041 | 313 | 77 | 35.27476 | 0.70781 | 0.069287 | 0 | 0.5 | 0 | 0 | 0.198129 | 0.018809 | 0 | 0 | 0 | 0 | 0 | 1 | 0.003448 | false | 0.003448 | 0 | 0 | 0.006897 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
63990fa7d0cfec9f976097d322d1cb7ebed39051 | 693 | py | Python | oops_fhir/r4/value_set/v3_role_link_status.py | Mikuana/oops_fhir | 77963315d123756b7d21ae881f433778096a1d25 | [
"MIT"
] | null | null | null | oops_fhir/r4/value_set/v3_role_link_status.py | Mikuana/oops_fhir | 77963315d123756b7d21ae881f433778096a1d25 | [
"MIT"
] | null | null | null | oops_fhir/r4/value_set/v3_role_link_status.py | Mikuana/oops_fhir | 77963315d123756b7d21ae881f433778096a1d25 | [
"MIT"
] | null | null | null | from pathlib import Path
from fhir.resources.valueset import ValueSet as _ValueSet
from oops_fhir.utils import ValueSet
from oops_fhir.r4.code_system.v3_role_link_status import (
v3RoleLinkStatus as v3RoleLinkStatus_,
)
__all__ = ["v3RoleLinkStatus"]
_resource = _ValueSet.parse_file(Path(__file__).with_suffi... | 21.65625 | 72 | 0.751804 | 83 | 693 | 6.012048 | 0.60241 | 0.056112 | 0.064128 | 0.08016 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.031359 | 0.171717 | 693 | 31 | 73 | 22.354839 | 0.837979 | 0.359307 | 0 | 0 | 0 | 0 | 0.049065 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.363636 | 0 | 0.545455 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 |
639a81b1015fff633dbac1dc86d6aff46144c6fd | 4,094 | py | Python | lizard/client/lizard_client.py | Magical-Chicken/lizard-slayer | 2768f6027b88687088e6672d8d8f41599599eb29 | [
"Apache-2.0"
] | null | null | null | lizard/client/lizard_client.py | Magical-Chicken/lizard-slayer | 2768f6027b88687088e6672d8d8f41599599eb29 | [
"Apache-2.0"
] | 17 | 2018-04-10T08:43:20.000Z | 2018-05-02T04:02:04.000Z | lizard/client/lizard_client.py | Magical-Chicken/lizard-slayer | 2768f6027b88687088e6672d8d8f41599599eb29 | [
"Apache-2.0"
] | null | null | null | <<<<<<< HEAD
from lizard import util
=======
import os
from lizard import util
>>>>>>> ef9b13b186c1a356f50a36e78ad91a3ccff76392
class LizardClient(object):
"""Main client object"""
def __init__(self, args, tmpdir, hardware):
"""
Client init
:args: parsed cmdline args
:tmpdi... | 34.116667 | 76 | 0.609428 | 501 | 4,094 | 4.840319 | 0.173653 | 0.070103 | 0.036289 | 0.035052 | 0.628041 | 0.597938 | 0.597938 | 0.586804 | 0.565773 | 0.565773 | 0 | 0.032787 | 0.284807 | 4,094 | 119 | 77 | 34.403361 | 0.795424 | 0 | 0 | 0.45 | 0 | 0 | 0.042656 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.05 | null | null | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
639b9330c5986023810caba345f272947187a2d4 | 370 | py | Python | Python/AutomateTheBoringStuff/lesson3.py | Cryptoniac/Challenge | fcb2f685c21bd84c1ef0924e5f0026bd2961c772 | [
"MIT"
] | null | null | null | Python/AutomateTheBoringStuff/lesson3.py | Cryptoniac/Challenge | fcb2f685c21bd84c1ef0924e5f0026bd2961c772 | [
"MIT"
] | null | null | null | Python/AutomateTheBoringStuff/lesson3.py | Cryptoniac/Challenge | fcb2f685c21bd84c1ef0924e5f0026bd2961c772 | [
"MIT"
] | null | null | null | # This programs aasks for your name and says hello
print('Hello world!')
print('What is your name?') #Ask for their name
myName = input()
print('It is good to meet you, ' + myName)
print('The lenght of your name is : ')
print(len(myName))
print('What is your age?') #Ask for their age
yourAge = input()
print('You wil... | 24.666667 | 62 | 0.667568 | 63 | 370 | 3.920635 | 0.571429 | 0.097166 | 0.089069 | 0.121457 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.003333 | 0.189189 | 370 | 14 | 63 | 26.428571 | 0.82 | 0.224324 | 0 | 0 | 0 | 0 | 0.43617 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0.777778 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 |
639bda46a4f37eda630ea25fc3e0e8a5db773327 | 5,697 | py | Python | python/ably_craft.py | tomczoink/ably-craft | b91402376b928e825be9f93b6dcbedcf70e44cb8 | [
"Apache-2.0"
] | null | null | null | python/ably_craft.py | tomczoink/ably-craft | b91402376b928e825be9f93b6dcbedcf70e44cb8 | [
"Apache-2.0"
] | null | null | null | python/ably_craft.py | tomczoink/ably-craft | b91402376b928e825be9f93b6dcbedcf70e44cb8 | [
"Apache-2.0"
] | null | null | null | import json
import asyncio
import math
from math import sin, cos
from ably import AblyRest
import logging
import msgpack
import faust
from faust import Record
from aiokafka.helpers import create_ssl_context
from datetime import datetime
from typing import Optional, Union, Any, List, Dict
from orjson import orjson
fr... | 28.064039 | 118 | 0.631385 | 700 | 5,697 | 4.987143 | 0.285714 | 0.044113 | 0.038098 | 0.008594 | 0.062446 | 0.037812 | 0 | 0 | 0 | 0 | 0 | 0.022383 | 0.247148 | 5,697 | 202 | 119 | 28.20297 | 0.79156 | 0.058452 | 0 | 0.092715 | 0 | 0 | 0.105981 | 0.037757 | 0 | 0 | 0 | 0 | 0 | 1 | 0.039735 | false | 0.066225 | 0.112583 | 0 | 0.364238 | 0.059603 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 1 |
639cacb192f156ab41a1403e52c4ff654b0976e3 | 8,461 | py | Python | app/views.py | Panthere/coinstream | 4ed7e1eef03f29bf9b9da15f7e3c4930520bad72 | [
"MIT"
] | 2 | 2019-08-26T08:51:27.000Z | 2021-07-03T15:33:38.000Z | app/views.py | Panthere/coinstream | 4ed7e1eef03f29bf9b9da15f7e3c4930520bad72 | [
"MIT"
] | null | null | null | app/views.py | Panthere/coinstream | 4ed7e1eef03f29bf9b9da15f7e3c4930520bad72 | [
"MIT"
] | 1 | 2018-03-17T23:03:21.000Z | 2018-03-17T23:03:21.000Z | #!flask/bin/python
from flask import render_template, flash, redirect, session, url_for, \
request, g, send_file, abort, jsonify
from flask_login import current_user
from flask_qrcode import QRcode
from app import app, db, lm
from datetime import datetime, timedelta
from config import STREAMLABS_CLIENT_ID, S... | 32.171103 | 75 | 0.614348 | 962 | 8,461 | 5.179834 | 0.237006 | 0.043347 | 0.018262 | 0.017058 | 0.271122 | 0.195866 | 0.143287 | 0.116396 | 0.066225 | 0.043347 | 0 | 0.00674 | 0.281054 | 8,461 | 262 | 76 | 32.293893 | 0.812428 | 0.013828 | 0 | 0.176744 | 0 | 0 | 0.136774 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.074419 | null | null | 0.037209 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
63bd8d6978c110b5c5db8dd8177c95c20e159139 | 510 | py | Python | product/migrations/0014_auto_20210113_1803.py | rodkiewicz/pola-backend | e26df1cea07b43c8b4272739234b7e78e2ce08c9 | [
"BSD-3-Clause"
] | 30 | 2015-08-13T01:05:36.000Z | 2022-01-22T03:02:50.000Z | product/migrations/0014_auto_20210113_1803.py | rodkiewicz/pola-backend | e26df1cea07b43c8b4272739234b7e78e2ce08c9 | [
"BSD-3-Clause"
] | 1,428 | 2015-10-08T07:38:26.000Z | 2022-03-31T08:36:08.000Z | product/migrations/0014_auto_20210113_1803.py | rodkiewicz/pola-backend | e26df1cea07b43c8b4272739234b7e78e2ce08c9 | [
"BSD-3-Clause"
] | 13 | 2015-12-27T22:35:25.000Z | 2022-02-01T15:55:58.000Z | # Generated by Django 3.1.2 on 2021-01-13 17:03
from django.db import migrations
SQL_STATEMENT = """
INSERT INTO product_product_companies(product_id, company_id)
SELECT product_product.id AS product_id,
product_product.company_id AS company_id
FROM product_product
WHERE product_product.company_id IS NOT NULL;... | 22.173913 | 61 | 0.733333 | 68 | 510 | 5.25 | 0.573529 | 0.196078 | 0.117647 | 0.128852 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.074163 | 0.180392 | 510 | 22 | 62 | 23.181818 | 0.779904 | 0.088235 | 0 | 0 | 1 | 0 | 0.537797 | 0.241901 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.066667 | 0 | 0.266667 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
63c2550fd56b5d7301c4698dfbd27c8ce0a17131 | 2,418 | py | Python | mpf/tests/test_ModesConfigValidation.py | pmansukhani/mpf | 0979965d24bcaba9423b43581c6a18b847b1b900 | [
"MIT"
] | null | null | null | mpf/tests/test_ModesConfigValidation.py | pmansukhani/mpf | 0979965d24bcaba9423b43581c6a18b847b1b900 | [
"MIT"
] | null | null | null | mpf/tests/test_ModesConfigValidation.py | pmansukhani/mpf | 0979965d24bcaba9423b43581c6a18b847b1b900 | [
"MIT"
] | null | null | null | from mpf.tests.MpfTestCase import MpfTestCase
from mpf._version import log_url
class TestModesConfigValidation(MpfTestCase):
def getConfigFile(self):
return self.config
def getMachinePath(self):
return 'tests/machine_files/mode_tests/'
def setUp(self):
self.save_and_prepare_sys_... | 35.043478 | 119 | 0.648056 | 268 | 2,418 | 5.634328 | 0.33209 | 0.037086 | 0.046358 | 0.059603 | 0.370199 | 0.268212 | 0.201987 | 0.201987 | 0.201987 | 0.201987 | 0 | 0.001676 | 0.259719 | 2,418 | 68 | 120 | 35.558824 | 0.841899 | 0 | 0 | 0.3125 | 0 | 0.020833 | 0.228701 | 0.090984 | 0 | 0 | 0 | 0 | 0.145833 | 1 | 0.208333 | false | 0 | 0.041667 | 0.041667 | 0.3125 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
63c4bcc28d377d65fb38aa78be9b81532f57b140 | 1,398 | py | Python | stats-and-probs/rolling_dice.py | MarkMoretto/python-examples-main | 37b8c41d2f175029f4536ca970f037ff19b4e951 | [
"MIT"
] | 1 | 2020-07-21T23:24:25.000Z | 2020-07-21T23:24:25.000Z | stats-and-probs/rolling_dice.py | MarkMoretto/python-examples-main | 37b8c41d2f175029f4536ca970f037ff19b4e951 | [
"MIT"
] | 4 | 2021-06-29T00:38:57.000Z | 2022-01-15T00:22:15.000Z | stats-and-probs/rolling_dice.py | MarkMoretto/python-examples-main | 37b8c41d2f175029f4536ca970f037ff19b4e951 | [
"MIT"
] | null | null | null | from fractions import Fraction
print_dict = lambda d: print("\n".join([f"{k}: {v}" for k, v in d.items()]))
def dice_sample(number_of_sides: int = 6) ->:
"""Prints basic sample space and value frequency for the roll
of two unbiased dice with N sides.
Parameters
----------
number_of_sides : in... | 26.884615 | 86 | 0.587983 | 204 | 1,398 | 3.823529 | 0.367647 | 0.155128 | 0.083333 | 0.017949 | 0.133333 | 0.082051 | 0.082051 | 0.082051 | 0 | 0 | 0 | 0.015275 | 0.297568 | 1,398 | 51 | 87 | 27.411765 | 0.779022 | 0.004292 | 0 | 0.074074 | 0 | 0 | 0.143396 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.037037 | null | null | 0.222222 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
63cb10faa8d6f7970c16e1e137c36a1e4bb5d1c7 | 2,486 | py | Python | nautobot/utilities/fields.py | steffann/nautobot | f5cf4a294861e69fa10ac445f7fc89f432d5b3df | [
"Apache-2.0"
] | 1 | 2021-03-16T15:14:55.000Z | 2021-03-16T15:14:55.000Z | nautobot/utilities/fields.py | steffann/nautobot | f5cf4a294861e69fa10ac445f7fc89f432d5b3df | [
"Apache-2.0"
] | null | null | null | nautobot/utilities/fields.py | steffann/nautobot | f5cf4a294861e69fa10ac445f7fc89f432d5b3df | [
"Apache-2.0"
] | 1 | 2021-10-14T01:54:24.000Z | 2021-10-14T01:54:24.000Z | from django.core.validators import RegexValidator
from django.db import models
from nautobot.utilities.ordering import naturalize
from .forms import ColorSelect
ColorValidator = RegexValidator(
regex="^[0-9a-f]{6}$",
message="Enter a valid hexadecimal RGB color code.",
code="invalid",
)
# Deprecated: Re... | 33.146667 | 116 | 0.692679 | 285 | 2,486 | 5.884211 | 0.37193 | 0.059034 | 0.035778 | 0.02743 | 0.062016 | 0 | 0 | 0 | 0 | 0 | 0 | 0.00258 | 0.220434 | 2,486 | 74 | 117 | 33.594595 | 0.862745 | 0.19107 | 0 | 0.043478 | 0 | 0 | 0.140673 | 0.018858 | 0 | 0 | 0 | 0 | 0 | 1 | 0.152174 | false | 0 | 0.086957 | 0.021739 | 0.521739 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 |
63ce671a9936af4e670883cbf7906a730524a8c9 | 25,902 | py | Python | fonticon_fa5/fa5s.py | tlambert03/fonticon-fontawesome5 | f84e4692b9c8f3e6d57eed243fa94b3a5b071573 | [
"CC-BY-4.0",
"MIT"
] | null | null | null | fonticon_fa5/fa5s.py | tlambert03/fonticon-fontawesome5 | f84e4692b9c8f3e6d57eed243fa94b3a5b071573 | [
"CC-BY-4.0",
"MIT"
] | null | null | null | fonticon_fa5/fa5s.py | tlambert03/fonticon-fontawesome5 | f84e4692b9c8f3e6d57eed243fa94b3a5b071573 | [
"CC-BY-4.0",
"MIT"
] | null | null | null | from pathlib import Path
from ._iconfont import IconFont
FONTS = Path(__file__).parent / "fonts"
class FA5S(IconFont):
__font_file__ = str(FONTS / "Font Awesome 5 Free-Solid-900.otf")
ad = '\uf641'
address_book = '\uf2b9'
address_card = '\uf2bb'
adjust = '\uf042'
air_freshener = '\uf5d0'
... | 25.569595 | 68 | 0.572465 | 2,732 | 25,902 | 5.167277 | 0.673865 | 0.004534 | 0.003967 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.123833 | 0.272025 | 25,902 | 1,012 | 69 | 25.594862 | 0.624841 | 0 | 0 | 0 | 0 | 0 | 0.233573 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0.002979 | 0.002979 | 0 | 1 | 0.002979 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 |
63d1a70e561a14a5be100b95332ac90ce8299dc3 | 1,313 | py | Python | my_drawing/draw_line.py | steven3614/MystanCodeprojects | 97bfc8c6f36517ac8aa4a64981a5ec1f530b111b | [
"MIT"
] | null | null | null | my_drawing/draw_line.py | steven3614/MystanCodeprojects | 97bfc8c6f36517ac8aa4a64981a5ec1f530b111b | [
"MIT"
] | null | null | null | my_drawing/draw_line.py | steven3614/MystanCodeprojects | 97bfc8c6f36517ac8aa4a64981a5ec1f530b111b | [
"MIT"
] | null | null | null | """
File: draw_line
Name: 張文銓
-------------------------
TODO: this function draw lines every two clicks while the first click will create a circle and the second click will
make a line with the circle.
"""
from campy.graphics.gobjects import GOval, GLine
from campy.graphics.gwindow import GWindow
from campy... | 28.543478 | 117 | 0.629855 | 191 | 1,313 | 4.282723 | 0.465969 | 0.02445 | 0.041565 | 0.03912 | 0.0489 | 0 | 0 | 0 | 0 | 0 | 0 | 0.013598 | 0.271896 | 1,313 | 45 | 118 | 29.177778 | 0.84205 | 0.41965 | 0 | 0.090909 | 0 | 0 | 0.011747 | 0 | 0 | 0 | 0 | 0.022222 | 0 | 1 | 0.090909 | false | 0 | 0.136364 | 0 | 0.227273 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
63d73d6f936650d63cf4878822b3888bd905a7bf | 1,250 | py | Python | nelfurion/public/models/contacts.py | nelfurion/nelfurion | dd4623fa2f04629231b25092fa8f4bb284cbe879 | [
"MIT"
] | null | null | null | nelfurion/public/models/contacts.py | nelfurion/nelfurion | dd4623fa2f04629231b25092fa8f4bb284cbe879 | [
"MIT"
] | null | null | null | nelfurion/public/models/contacts.py | nelfurion/nelfurion | dd4623fa2f04629231b25092fa8f4bb284cbe879 | [
"MIT"
] | null | null | null | from public.models import helpers
contacts = [{
'src': '{scheme}://{host}/static/public/img/cv3.png',
'content': 'resume',
'url': 'https://www.visualcv.com/arcbze7iaos/pdf',
'col': 'col-lg-4'
}, {
'src': '{scheme}://{host}/static/public/img/phone.png',
'content': '+3... | 32.051282 | 73 | 0.5272 | 134 | 1,250 | 4.902985 | 0.343284 | 0.082192 | 0.118721 | 0.173516 | 0.351598 | 0.333333 | 0.290715 | 0.290715 | 0.290715 | 0.290715 | 0 | 0.030462 | 0.2384 | 1,250 | 38 | 74 | 32.894737 | 0.659664 | 0.0216 | 0 | 0.314286 | 0 | 0 | 0.544856 | 0.269136 | 0 | 0 | 0 | 0 | 0 | 1 | 0.028571 | false | 0 | 0.028571 | 0 | 0.085714 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
892296a77e36fb0f813a7eede1e5b79300cc9299 | 567 | py | Python | argparse_utils/json.py | madman-bob/python-argparse-utils | e3a816596d1b374825a4b8d45b56fbce4758a4f4 | [
"MIT"
] | 7 | 2019-07-05T20:17:08.000Z | 2021-09-27T04:56:40.000Z | argparse_utils/json.py | madman-bob/python-argparse-utils | e3a816596d1b374825a4b8d45b56fbce4758a4f4 | [
"MIT"
] | 2 | 2019-04-03T09:43:40.000Z | 2020-05-05T17:47:22.000Z | argparse_utils/json.py | madman-bob/python-argparse-utils | e3a816596d1b374825a4b8d45b56fbce4758a4f4 | [
"MIT"
] | 1 | 2020-12-11T10:47:49.000Z | 2020-12-11T10:47:49.000Z | from argparse import ArgumentTypeError
from json import loads as json_loads
from argparse_utils.store_mapped_action import StoreMappedAction
__all__ = ["json_action"]
def json_action(**kwargs):
class JSONAction(StoreMappedAction):
def mapping_function(self, value):
try:
retur... | 25.772727 | 75 | 0.663139 | 58 | 567 | 6.258621 | 0.568966 | 0.066116 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.261023 | 567 | 21 | 76 | 27 | 0.866348 | 0 | 0 | 0 | 0 | 0 | 0.07231 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.2 | false | 0 | 0.2 | 0.066667 | 0.666667 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 |
8923389a2b8e594029aef38bf75ec8de216e61b9 | 7,158 | py | Python | omnisync/transports/file.py | skorokithakis/omnisync | b015f56ae7dd72bbb3714a3e061cb3cfeb5c3567 | [
"BSD-2-Clause"
] | 36 | 2015-01-17T10:11:44.000Z | 2020-08-06T20:45:38.000Z | omnisync/transports/file.py | skorokithakis/omnisync | b015f56ae7dd72bbb3714a3e061cb3cfeb5c3567 | [
"BSD-2-Clause"
] | null | null | null | omnisync/transports/file.py | skorokithakis/omnisync | b015f56ae7dd72bbb3714a3e061cb3cfeb5c3567 | [
"BSD-2-Clause"
] | 5 | 2015-01-18T11:56:17.000Z | 2021-04-04T04:05:56.000Z | """Plain file access module."""
from omnisync.transportmount import TransportInterface
from omnisync.fileobject import FileObject
from omnisync import urlfunctions
import platform
import os
import time
import errno
if platform.system() == "Windows":
OSERROR = WindowsError
else:
OSERROR = OSErro... | 37.47644 | 99 | 0.584521 | 846 | 7,158 | 4.858156 | 0.274232 | 0.020438 | 0.032847 | 0.039416 | 0.173479 | 0.13382 | 0.116788 | 0.107786 | 0.082968 | 0.047202 | 0 | 0.00102 | 0.314892 | 7,158 | 190 | 100 | 37.673684 | 0.837072 | 0.110645 | 0 | 0.289474 | 0 | 0 | 0.093105 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.061404 | null | null | 0.026316 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
89274d60bfc7fc8017c1f101a05a0ecc7184d736 | 5,570 | py | Python | scripts/make-biblio.py | astrocatalogs/tidaldisruptions | 87558308b09c4d08a20dec141e438ccbcddb491b | [
"MIT"
] | 2 | 2018-11-18T21:17:29.000Z | 2022-01-25T18:29:10.000Z | scripts/make-biblio.py | astrocatalogs/tidaldisruptions | 87558308b09c4d08a20dec141e438ccbcddb491b | [
"MIT"
] | 5 | 2016-11-01T13:31:06.000Z | 2022-03-28T18:35:21.000Z | scripts/make-biblio.py | astrocatalogs/tidaldisruptions | 87558308b09c4d08a20dec141e438ccbcddb491b | [
"MIT"
] | 1 | 2022-03-17T23:26:36.000Z | 2022-03-17T23:26:36.000Z |
import gzip
import json
import os
from collections import OrderedDict
from glob import glob
from astropy.time import Time as astrotime
from utils.tq_funcs import tqdm
import ads
biblio = OrderedDict()
def get_event_filename(name):
return(name.replace('/', '_'))
with open('rep-folders.txt', 'r') as f:
rep... | 36.405229 | 95 | 0.454758 | 534 | 5,570 | 4.726592 | 0.314607 | 0.044374 | 0.035658 | 0.028526 | 0.1771 | 0.156101 | 0.104596 | 0.104596 | 0.064184 | 0.026941 | 0 | 0.01626 | 0.40377 | 5,570 | 152 | 96 | 36.644737 | 0.743752 | 0 | 0 | 0.181818 | 0 | 0 | 0.125185 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.066116 | null | null | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
8928eb745d3cd4f0af3a3e3eff9c91c835fa02c6 | 439 | py | Python | augment_images.py | SimkinTheWizard/SDC_P12-CarND-Semantic-Segmentation | 1a24c5f01688d8efb7955b55d4a689e692aedf37 | [
"MIT"
] | null | null | null | augment_images.py | SimkinTheWizard/SDC_P12-CarND-Semantic-Segmentation | 1a24c5f01688d8efb7955b55d4a689e692aedf37 | [
"MIT"
] | null | null | null | augment_images.py | SimkinTheWizard/SDC_P12-CarND-Semantic-Segmentation | 1a24c5f01688d8efb7955b55d4a689e692aedf37 | [
"MIT"
] | null | null | null | import Augmentor
p = Augmentor.Pipeline('./data/data_road/training/image_2/')
p.ground_truth('./data/data_road/training/road/')
p.ground_truth('./data/data_road/training/lane/')
p.rotate(probability=0.5, max_left_rotation=10, max_right_rotation=10)
p.zoom(probability=0.5, min_factor=1.1, max_factor=1.6)
p.shear(proba... | 39.909091 | 70 | 0.794989 | 79 | 439 | 4.177215 | 0.417722 | 0.145455 | 0.157576 | 0.181818 | 0.193939 | 0.193939 | 0.193939 | 0 | 0 | 0 | 0 | 0.059242 | 0.038724 | 439 | 11 | 71 | 39.909091 | 0.722749 | 0 | 0 | 0 | 0 | 0 | 0.218182 | 0.218182 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.111111 | 0 | 0.111111 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
8935bd12ed4c5ecc363f8109b0c7b14ce695cef8 | 233 | py | Python | kite-python/kite_pkgexploration/kite/pkgexploration/importhooks/django_algoliasearchsettings.py | kiteco/kiteco-public | 74aaf5b9b0592153b92f7ed982d65e15eea885e3 | [
"BSD-3-Clause"
] | 17 | 2022-01-10T11:01:50.000Z | 2022-03-25T03:21:08.000Z | kite-python/kite_pkgexploration/kite/pkgexploration/importhooks/django_algoliasearchsettings.py | kiteco/kiteco-public | 74aaf5b9b0592153b92f7ed982d65e15eea885e3 | [
"BSD-3-Clause"
] | 1 | 2022-01-13T14:28:47.000Z | 2022-01-13T14:28:47.000Z | kite-python/kite_pkgexploration/kite/pkgexploration/importhooks/django_algoliasearchsettings.py | kiteco/kiteco-public | 74aaf5b9b0592153b92f7ed982d65e15eea885e3 | [
"BSD-3-Clause"
] | 7 | 2022-01-07T03:58:10.000Z | 2022-03-24T07:38:20.000Z | from django.conf.global_settings import *
from .djangosettings import INSTALLED_APPS as _DEFAULT
INSTALLED_APPS = _DEFAULT + [
"algoliasearch_django",
]
ALGOLIA = {
'APPLICATION_ID': 'MyAppID',
'API_KEY': 'MyApiKey',
}
| 19.416667 | 54 | 0.72103 | 25 | 233 | 6.4 | 0.76 | 0.1625 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.167382 | 233 | 11 | 55 | 21.181818 | 0.824742 | 0 | 0 | 0 | 0 | 0 | 0.240343 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.222222 | 0 | 0.222222 | 0 | 1 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
894148315947ee607acb9cd1a1b68dcbbfc92df4 | 3,605 | py | Python | code/use_parameters.py | mkmasukawa/bead_tracking | 672edd21cad8bf9239dca117f5e045332ba568ab | [
"MIT"
] | null | null | null | code/use_parameters.py | mkmasukawa/bead_tracking | 672edd21cad8bf9239dca117f5e045332ba568ab | [
"MIT"
] | null | null | null | code/use_parameters.py | mkmasukawa/bead_tracking | 672edd21cad8bf9239dca117f5e045332ba568ab | [
"MIT"
] | null | null | null | import cv2.cv as cv
import numpy as np
import cv2
import os
ellipse_morph_x = 50
ellipse_morph_y = 50
threshold_binary = 0.2
crop = [100,558, 0,1916]
border_size = 150
gap = 100
radius = 30
#experiment code
code = '5611'
#input: two images, one of the experiment and one of the average with erased beads
#outputs expe... | 29.308943 | 101 | 0.709847 | 564 | 3,605 | 4.381206 | 0.306738 | 0.016997 | 0.033994 | 0.017807 | 0.198705 | 0.114124 | 0.075273 | 0.046945 | 0.046945 | 0.028329 | 0 | 0.056333 | 0.148128 | 3,605 | 122 | 102 | 29.54918 | 0.74829 | 0.204716 | 0 | 0.067797 | 0 | 0 | 0.065401 | 0.041491 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.067797 | null | null | 0.016949 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
8944ca412e9126f2305b44ca7bc257c035af6d60 | 443 | py | Python | src/pure_pursuit/src/view_lidar.py | chardorn/unc-racecar | 45d8f2b6a134422f9cdbb6b1ac0531b3257f6e44 | [
"MIT"
] | 1 | 2020-11-03T07:23:48.000Z | 2020-11-03T07:23:48.000Z | src/pure_pursuit/src/view_lidar.py | chardorn/unc-racecar | 45d8f2b6a134422f9cdbb6b1ac0531b3257f6e44 | [
"MIT"
] | null | null | null | src/pure_pursuit/src/view_lidar.py | chardorn/unc-racecar | 45d8f2b6a134422f9cdbb6b1ac0531b3257f6e44 | [
"MIT"
] | 2 | 2020-11-03T07:23:53.000Z | 2022-03-09T19:44:09.000Z | import rospy
import numpy as np
from sensor_msgs.msg import LaserScan
rospy.init_node('lidar_reader', anonymous=True)
np.set_printoptions(precision=2)
while not rospy.core.is_shutdown_requested():
laser_data = rospy.client.wait_for_message('scan', LaserScan)
distances = laser_data.ranges
center_index = len... | 34.076923 | 69 | 0.774266 | 65 | 443 | 5.015385 | 0.661538 | 0.101227 | 0.08589 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.020888 | 0.13544 | 443 | 12 | 70 | 36.916667 | 0.830287 | 0 | 0 | 0 | 0 | 0 | 0.036117 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.272727 | null | null | 0.181818 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
894e1caa1e05f1f48a2ba904fc2cdfc0b44225f3 | 2,442 | py | Python | python/myprofiler_test.py | magehost/myprofiler | c3b45eeda86cf1ed5988d56ec5591e6f826829f0 | [
"MIT"
] | 44 | 2015-01-07T04:26:14.000Z | 2021-08-20T08:50:55.000Z | python/myprofiler_test.py | magehost/myprofiler | c3b45eeda86cf1ed5988d56ec5591e6f826829f0 | [
"MIT"
] | 3 | 2018-04-24T08:55:24.000Z | 2019-11-25T10:56:27.000Z | python/myprofiler_test.py | magehost/myprofiler | c3b45eeda86cf1ed5988d56ec5591e6f826829f0 | [
"MIT"
] | 8 | 2016-01-25T10:46:32.000Z | 2021-05-26T19:06:17.000Z | import myprofiler
import pytest
def test_SummingCollector():
collector = myprofiler.SummingCollector()
assert collector.summary() == []
collector.append("foo")
collector.append("bar")
collector.append("foo")
assert collector.summary() == [("foo", 2), ("bar", 1)]
collector.turn()
def te... | 25.978723 | 70 | 0.595004 | 270 | 2,442 | 5.296296 | 0.207407 | 0.08951 | 0.092308 | 0.022378 | 0.741958 | 0.731469 | 0.602797 | 0.602797 | 0.602797 | 0.542657 | 0 | 0.021624 | 0.223587 | 2,442 | 93 | 71 | 26.258065 | 0.732595 | 0 | 0 | 0.567164 | 0 | 0 | 0.097871 | 0 | 0 | 0 | 0 | 0 | 0.268657 | 1 | 0.134328 | false | 0.029851 | 0.029851 | 0.014925 | 0.208955 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
89526f000559f1b47a0f32abc5798c8b46f8320a | 2,838 | py | Python | utility.py | arthurgof/ADM-HW4 | ad188f59bb257ff0f2506d174a7bb23208c8eb45 | [
"MIT"
] | null | null | null | utility.py | arthurgof/ADM-HW4 | ad188f59bb257ff0f2506d174a7bb23208c8eb45 | [
"MIT"
] | null | null | null | utility.py | arthurgof/ADM-HW4 | ad188f59bb257ff0f2506d174a7bb23208c8eb45 | [
"MIT"
] | null | null | null | #!/usr/bin/env python
# coding: utf-8
import numpy as np
import matplotlib.pyplot as plt
import scipy.io.wavfile
import subprocess
import librosa
import librosa.display
import IPython.display as ipd
from pathlib import Path, PurePath
from tqdm.notebook import tqdm
import random
import pickle
N_TRACKS = 14... | 32.25 | 124 | 0.642354 | 411 | 2,838 | 4.3382 | 0.381995 | 0.040381 | 0.021312 | 0.019069 | 0.067302 | 0.067302 | 0 | 0 | 0 | 0 | 0 | 0.020056 | 0.244538 | 2,838 | 88 | 125 | 32.25 | 0.811567 | 0.313953 | 0 | 0 | 0 | 0 | 0.056849 | 0 | 0 | 0 | 0 | 0.011364 | 0 | 1 | 0.061224 | false | 0 | 0.22449 | 0 | 0.346939 | 0.040816 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
8955f9075e449a4987bd1e4e4fef682a3a66b112 | 1,155 | py | Python | v6_summary_omop/utils.py | pedro-cmat/v6-summary-omop-py | 2d4b72adf3e3602b43aa986d12db0f722377841a | [
"MIT"
] | null | null | null | v6_summary_omop/utils.py | pedro-cmat/v6-summary-omop-py | 2d4b72adf3e3602b43aa986d12db0f722377841a | [
"MIT"
] | null | null | null | v6_summary_omop/utils.py | pedro-cmat/v6-summary-omop-py | 2d4b72adf3e3602b43aa986d12db0f722377841a | [
"MIT"
] | null | null | null | """ Utility functions.
"""
import os
from v6_summary_omop.constants import *
def run_sql(db_client, sql_statement, parameters=None, fetch_all=False):
""" Execute the sql query and retrieve the results
"""
db_client.execute(sql_statement, parameters)
if fetch_all:
return db_client.fetchall()
... | 28.875 | 78 | 0.681385 | 159 | 1,155 | 4.748428 | 0.408805 | 0.07947 | 0.058278 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.001105 | 0.21645 | 1,155 | 39 | 79 | 29.615385 | 0.833149 | 0.234632 | 0 | 0 | 0 | 0 | 0.088652 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.238095 | false | 0 | 0.095238 | 0 | 0.619048 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
895aa04b113bf67dfdd352a896f2e1a9d05af9cb | 9,341 | py | Python | testapi.py | windlessStorm/allspeak | 712e13f91b4a9d89c37c4da1dbe4e704625ce24f | [
"Unlicense"
] | 1 | 2018-04-26T15:15:24.000Z | 2018-04-26T15:15:24.000Z | testapi.py | windlessStorm/allspeak | 712e13f91b4a9d89c37c4da1dbe4e704625ce24f | [
"Unlicense"
] | 1 | 2018-04-25T17:32:23.000Z | 2018-04-26T15:12:32.000Z | testapi.py | windlessStorm/allspeak | 712e13f91b4a9d89c37c4da1dbe4e704625ce24f | [
"Unlicense"
] | null | null | null | #!/usr/bin/env python
# Copyright 2017 Google Inc. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless require... | 33.007067 | 119 | 0.667487 | 1,189 | 9,341 | 5.136249 | 0.342304 | 0.00786 | 0.012281 | 0.010316 | 0.025544 | 0.007532 | 0 | 0 | 0 | 0 | 0 | 0.008528 | 0.246762 | 9,341 | 282 | 120 | 33.124113 | 0.859437 | 0.258966 | 0 | 0.1 | 0 | 0 | 0.087651 | 0.010468 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.092857 | null | null | 0.092857 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
895bb3ea3c4fe0d652c352e4e32b4b5760e7aec6 | 1,076 | py | Python | tests/benchmarks/bench.py | etano/whiplash | ba7d28ce5642eac69cd514f6450f9bd4cd5a2c4b | [
"MIT"
] | null | null | null | tests/benchmarks/bench.py | etano/whiplash | ba7d28ce5642eac69cd514f6450f9bd4cd5a2c4b | [
"MIT"
] | null | null | null | tests/benchmarks/bench.py | etano/whiplash | ba7d28ce5642eac69cd514f6450f9bd4cd5a2c4b | [
"MIT"
] | null | null | null | #!/usr/bin/env python3
import sys, os, random
import whiplash
import whipbench as bench
print("Login")
db = whiplash.db(sys.argv[1], int(sys.argv[2]), username=sys.argv[3], password=sys.argv[4])
print("Reset database")
bench.reset_db(db)
print("Benchmarking collections")
sizes = [2]
numbers = [10, 100, 1000]
print("... | 30.742857 | 95 | 0.713755 | 136 | 1,076 | 5.595588 | 0.397059 | 0.12615 | 0.134034 | 0.189225 | 0.248357 | 0.172142 | 0.172142 | 0.172142 | 0.172142 | 0.172142 | 0 | 0.016026 | 0.130112 | 1,076 | 34 | 96 | 31.647059 | 0.797009 | 0.019517 | 0 | 0.071429 | 0 | 0 | 0.158444 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0.035714 | 0.107143 | 0 | 0.107143 | 0.25 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
895c55650383e245ed55f42a892421f81f140054 | 565 | py | Python | clusterdata/database.py | burgerdev/googleclusterdata | f1c443b72754082f41c927e83160627e79f5c74e | [
"MIT"
] | null | null | null | clusterdata/database.py | burgerdev/googleclusterdata | f1c443b72754082f41c927e83160627e79f5c74e | [
"MIT"
] | null | null | null | clusterdata/database.py | burgerdev/googleclusterdata | f1c443b72754082f41c927e83160627e79f5c74e | [
"MIT"
] | null | null | null | # -*- coding: utf-8 -*-
import psycopg2
from config import config
params = " ".join(["dbname='{}'",
"user='{}'",
"host='localhost'",
"password='{}'"])
user = config.get("database", "user")
pw = config.get("database", "pass")
db = config.get("database", "db")... | 19.482759 | 67 | 0.578761 | 56 | 565 | 5.821429 | 0.571429 | 0.082822 | 0.156442 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.007126 | 0.254867 | 565 | 28 | 68 | 20.178571 | 0.767221 | 0.037168 | 0 | 0 | 0 | 0 | 0.202952 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.058824 | false | 0.176471 | 0.117647 | 0 | 0.294118 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 1 |
895d1c28288999cd2b438363af7dc7f6ff965fc1 | 3,137 | py | Python | google/cloud/recommendationengine_v1beta1/types/__init__.py | renovate-bot/python-recommendations-ai | e4aebdeb0afa1bc2e871736508c4f49897f6bce3 | [
"Apache-2.0"
] | 18 | 2020-03-14T23:10:56.000Z | 2021-12-30T02:20:27.000Z | google/cloud/recommendationengine_v1beta1/types/__init__.py | renovate-bot/python-recommendations-ai | e4aebdeb0afa1bc2e871736508c4f49897f6bce3 | [
"Apache-2.0"
] | 39 | 2020-03-25T21:16:55.000Z | 2022-03-07T16:59:57.000Z | google/cloud/recommendationengine_v1beta1/types/__init__.py | renovate-bot/python-recommendations-ai | e4aebdeb0afa1bc2e871736508c4f49897f6bce3 | [
"Apache-2.0"
] | 5 | 2020-03-13T23:24:42.000Z | 2022-01-29T08:13:16.000Z | # -*- coding: utf-8 -*-
# Copyright 2020 Google LLC
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or... | 27.278261 | 74 | 0.748486 | 208 | 3,137 | 11.225962 | 0.567308 | 0.025696 | 0.011135 | 0.013705 | 0.664668 | 0.501071 | 0.314347 | 0.181585 | 0.181585 | 0.181585 | 0 | 0.003484 | 0.176602 | 3,137 | 114 | 75 | 27.517544 | 0.900503 | 0.181383 | 0 | 0 | 0 | 0 | 0.33268 | 0.24569 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.22449 | 0 | 0.22449 | 0 | 0 | 0 | 1 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
895f2261a0550b4a723b2f506b8f365d8b7edfd5 | 309 | py | Python | test_s3uri.py | nonjosh/minio-dev | 45fc16bf07ba7def3e4619cb72e07ad5364ef96e | [
"MIT"
] | null | null | null | test_s3uri.py | nonjosh/minio-dev | 45fc16bf07ba7def3e4619cb72e07ad5364ef96e | [
"MIT"
] | null | null | null | test_s3uri.py | nonjosh/minio-dev | 45fc16bf07ba7def3e4619cb72e07ad5364ef96e | [
"MIT"
] | null | null | null | # %%
import pandas as pd
# %%
storage_options = {
"anon": False,
"key": "minio",
"secret": "minio123",
"client_kwargs": {
"endpoint_url": "http://localhost:9000",
},
}
# %%
# Require s3fs
df = pd.read_csv(
"s3://test/people.csv",
storage_options=storage_options,
)
df
# %%
| 15.45 | 48 | 0.563107 | 34 | 309 | 4.941176 | 0.794118 | 0.25 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.038136 | 0.236246 | 309 | 19 | 49 | 16.263158 | 0.673729 | 0.07767 | 0 | 0 | 0 | 0 | 0.329749 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.071429 | 0 | 0.071429 | 0 | 0 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
8962569f44111fe33c388000c0af876b2d00193c | 590 | py | Python | vendor/plugit-development-client/app/urls.py | ebu/test-engine-ondemand | 31d5ef4e2ddb6d80f22f166aa25cd6e883181c66 | [
"BSD-3-Clause"
] | 4 | 2017-03-22T02:31:11.000Z | 2020-09-16T20:47:16.000Z | vendor/plugit-development-client/app/urls.py | ebu/test-engine-ondemand | 31d5ef4e2ddb6d80f22f166aa25cd6e883181c66 | [
"BSD-3-Clause"
] | 1 | 2015-01-08T03:44:52.000Z | 2015-01-08T03:44:52.000Z | vendor/plugit-development-client/app/urls.py | ebu/test-engine-ondemand | 31d5ef4e2ddb6d80f22f166aa25cd6e883181c66 | [
"BSD-3-Clause"
] | 2 | 2015-04-24T01:52:22.000Z | 2020-09-16T20:47:24.000Z | # -*- coding: utf-8 -*-
from django.conf.urls import patterns, include, url
from django.conf import settings
from django.views.generic import RedirectView
# Uncomment the next two lines to enable the admin:
from django.contrib import admin
admin.autodiscover()
urlpatterns = patterns('',
url(r'^admin/', include(ad... | 28.095238 | 151 | 0.684746 | 80 | 590 | 5 | 0.55 | 0.1 | 0.07 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.003922 | 0.135593 | 590 | 20 | 152 | 29.5 | 0.780392 | 0.162712 | 0 | 0 | 0 | 0 | 0.179592 | 0.05102 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.363636 | 0 | 0.363636 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 |
8971e6957a503f787157dbe3ab59064105e1f0ab | 1,084 | py | Python | csrv/model/cards/runner/card01043.py | mrroach/CentralServer | e377c65d8f3adf5a2d3273acd4f459be697aea56 | [
"Apache-2.0"
] | null | null | null | csrv/model/cards/runner/card01043.py | mrroach/CentralServer | e377c65d8f3adf5a2d3273acd4f459be697aea56 | [
"Apache-2.0"
] | null | null | null | csrv/model/cards/runner/card01043.py | mrroach/CentralServer | e377c65d8f3adf5a2d3273acd4f459be697aea56 | [
"Apache-2.0"
] | 1 | 2020-09-20T11:26:20.000Z | 2020-09-20T11:26:20.000Z | from csrv.model import actions
from csrv.model import events
from csrv.model import timing_phases
from csrv.model.cards import card_info
from csrv.model.cards import program
class Card01043(program.Program):
NAME = u'Card01043'
SET = card_info.CORE
NUMBER = 43
SIDE = card_info.RUNNER
FACTION = card_info.SH... | 26.439024 | 66 | 0.71679 | 143 | 1,084 | 5.223776 | 0.475524 | 0.064257 | 0.087015 | 0.076305 | 0.203481 | 0 | 0 | 0 | 0 | 0 | 0 | 0.029748 | 0.193727 | 1,084 | 40 | 67 | 27.1 | 0.824943 | 0 | 0 | 0 | 0 | 0 | 0.039668 | 0.023063 | 0 | 0 | 0 | 0 | 0 | 1 | 0.058824 | false | 0 | 0.147059 | 0.029412 | 0.647059 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 |
897c51d66a416d1dcdbe31d1cd363650d75e0e37 | 522 | py | Python | src/web/crockpi/powersupply.py | friedm/crockpi | 36e0502f32dc45676ed8a5da895f9b0d47bc5b74 | [
"MIT"
] | 1 | 2017-01-25T14:41:39.000Z | 2017-01-25T14:41:39.000Z | src/web/crockpi/powersupply.py | friedm/crockpi | 36e0502f32dc45676ed8a5da895f9b0d47bc5b74 | [
"MIT"
] | null | null | null | src/web/crockpi/powersupply.py | friedm/crockpi | 36e0502f32dc45676ed8a5da895f9b0d47bc5b74 | [
"MIT"
] | null | null | null | import RPi.GPIO as GPIO
class PowerSupply:
__pin = 11 # board pin 11, wiringpi pin 0
def set(self, value):
if value:
self.__write(1)
else:
self.__write(0)
def __write(self, value):
GPIO.output(PowerSupply.__pin,value)
def __enter__(self):
GPIO.... | 21.75 | 55 | 0.603448 | 66 | 522 | 4.439394 | 0.469697 | 0.143345 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.019126 | 0.298851 | 522 | 23 | 56 | 22.695652 | 0.781421 | 0.05364 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.235294 | false | 0 | 0.058824 | 0 | 0.470588 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
897d4298c2dbf832f3b90db12568d6977f1746e4 | 600 | py | Python | InvenTree/stock/migrations/0013_auto_20190908_0916.py | ArakniD/InvenTree | 0ebf2ebd832b2d736e895abe054ca56bfd1cc477 | [
"MIT"
] | 656 | 2017-03-29T22:06:14.000Z | 2022-03-30T11:23:52.000Z | InvenTree/stock/migrations/0013_auto_20190908_0916.py | ArakniD/InvenTree | 0ebf2ebd832b2d736e895abe054ca56bfd1cc477 | [
"MIT"
] | 1,545 | 2017-04-10T23:26:04.000Z | 2022-03-31T18:32:10.000Z | InvenTree/stock/migrations/0013_auto_20190908_0916.py | fablabbcn/InvenTree | 1d7ea7716cc96c6ffd151c822b01cd1fb5dcfecd | [
"MIT"
] | 196 | 2017-03-28T03:06:21.000Z | 2022-03-28T11:53:29.000Z | # Generated by Django 2.2.5 on 2019-09-08 09:16
from django.db import migrations
import django.db.models.deletion
import mptt.fields
class Migration(migrations.Migration):
dependencies = [
('stock', '0012_auto_20190908_0405'),
]
operations = [
migrations.AlterField(
model_na... | 28.571429 | 217 | 0.676667 | 74 | 600 | 5.364865 | 0.689189 | 0.060453 | 0.070529 | 0.110831 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.065126 | 0.206667 | 600 | 20 | 218 | 30 | 0.768908 | 0.075 | 0 | 0 | 1 | 0 | 0.195298 | 0.041591 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.214286 | 0 | 0.428571 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
897f45020254bbea3f4e3126f5d308a1476f0235 | 388 | py | Python | calculator/migrations/0010_auto_20210407_1729.py | Andromed-World/CarbonFC | 3582368ec00bd3fd4aae1d544fa8ce6b1c339be0 | [
"MIT"
] | 2 | 2021-04-03T12:38:28.000Z | 2022-03-05T19:57:04.000Z | calculator/migrations/0010_auto_20210407_1729.py | Andromed-World/CarbonFC | 3582368ec00bd3fd4aae1d544fa8ce6b1c339be0 | [
"MIT"
] | 2 | 2021-06-09T18:45:21.000Z | 2021-06-10T20:40:09.000Z | calculator/migrations/0010_auto_20210407_1729.py | Andromed-World/CarbonFC | 3582368ec00bd3fd4aae1d544fa8ce6b1c339be0 | [
"MIT"
] | null | null | null | # Generated by Django 3.1.7 on 2021-04-07 17:29
from django.db import migrations, models
class Migration(migrations.Migration):
dependencies = [
('calculator', '0009_auto_20210407_1729'),
]
operations = [
migrations.AlterField(
model_name='address',
name='name',
... | 20.421053 | 50 | 0.600515 | 42 | 388 | 5.428571 | 0.833333 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.119134 | 0.286082 | 388 | 18 | 51 | 21.555556 | 0.703971 | 0.115979 | 0 | 0 | 1 | 0 | 0.129032 | 0.067449 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.083333 | 0 | 0.333333 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
89815d101fd7b6435ce0564e7621d6688f72a347 | 2,397 | py | Python | src/227-basic_calculator.py | dennislblog/coding | cae25eef18e97224831b70ce5b187ba9e2c266d5 | [
"MIT"
] | null | null | null | src/227-basic_calculator.py | dennislblog/coding | cae25eef18e97224831b70ce5b187ba9e2c266d5 | [
"MIT"
] | 45 | 2019-12-06T20:20:23.000Z | 2021-01-04T13:12:01.000Z | src/227-basic_calculator.py | dennislblog/coding | cae25eef18e97224831b70ce5b187ba9e2c266d5 | [
"MIT"
] | null | null | null | class Solution:
"""
问题一: 计算 "(1+(4+5+2)-3)+(6+8)" 只有 加减法 和 括号
问题二: 计算 "- 3+5 / 2 " 只有 加减法 和 乘除法
问题三: 计算 "- 3+5 / 2 " 既有加减乘除法又有括号
问题四: 计算 "e + 8 - a + 5" with {e: 1} 要替换 e = 5, 得到多项式 14 - a 即 ["-1*a","14"]
"""
def calculate(self, s: str) -> int:
"""
第... | 35.25 | 81 | 0.306216 | 280 | 2,397 | 2.621429 | 0.217857 | 0.073569 | 0.047684 | 0.054496 | 0.355586 | 0.29564 | 0.148501 | 0.148501 | 0.076294 | 0.076294 | 0 | 0.0776 | 0.478515 | 2,397 | 68 | 82 | 35.25 | 0.5096 | 0 | 0 | 0.285714 | 0 | 0 | 0.010682 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0 | null | null | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
898631fe2149476b41b54f1fe917f0ee5a6dd523 | 349 | py | Python | cypherpunkpay/db/migrations/20200805_04_hdebK-create-dummy-store-orders.py | RandyMcMillan/CypherpunkPay | 997fc1e06865d6be75c46b719e673b2f50546f44 | [
"MIT",
"Unlicense"
] | 44 | 2021-06-25T16:40:52.000Z | 2022-03-24T08:17:49.000Z | cypherpunkpay/db/migrations/20200805_04_hdebK-create-dummy-store-orders.py | RandyMcMillan/CypherpunkPay | 997fc1e06865d6be75c46b719e673b2f50546f44 | [
"MIT",
"Unlicense"
] | 25 | 2021-07-20T04:36:08.000Z | 2022-03-10T14:00:53.000Z | cypherpunkpay/db/migrations/20200805_04_hdebK-create-dummy-store-orders.py | RandyMcMillan/CypherpunkPay | 997fc1e06865d6be75c46b719e673b2f50546f44 | [
"MIT",
"Unlicense"
] | 5 | 2021-06-29T23:17:06.000Z | 2022-01-25T22:55:43.000Z | """
Create dummy_store_orders
"""
from yoyo import step
__depends__ = {}
steps = [
step("""
CREATE TABLE dummy_store_orders (
uid text primary key not null,
item_id integer not null,
total integer not null,
currency text not null,
cc_total integer,
cc_curr... | 14.541667 | 39 | 0.584527 | 41 | 349 | 4.707317 | 0.560976 | 0.145078 | 0.165803 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.338109 | 349 | 23 | 40 | 15.173913 | 0.835498 | 0.071633 | 0 | 0 | 0 | 0 | 0.772152 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.071429 | 0 | 0.071429 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
89865a579c1dd9a528ef500aed9fa95e14f9fefb | 7,386 | py | Python | encryption/techniques/aes.py | TheDigitalPhoenixX/Encryption-Techniques | e41714ba50c9ec77c40d6acd12eebabc95ea0012 | [
"MIT"
] | null | null | null | encryption/techniques/aes.py | TheDigitalPhoenixX/Encryption-Techniques | e41714ba50c9ec77c40d6acd12eebabc95ea0012 | [
"MIT"
] | null | null | null | encryption/techniques/aes.py | TheDigitalPhoenixX/Encryption-Techniques | e41714ba50c9ec77c40d6acd12eebabc95ea0012 | [
"MIT"
] | null | null | null | AESEncryptParam = "Key (32 Hex characters)"
S_BOX = (
0x63, 0x7C, 0x77, 0x7B, 0xF2, 0x6B, 0x6F, 0xC5, 0x30, 0x01, 0x67, 0x2B, 0xFE, 0xD7, 0xAB, 0x76,
0xCA, 0x82, 0xC9, 0x7D, 0xFA, 0x59, 0x47, 0xF0, 0xAD, 0xD4, 0xA2, 0xAF, 0x9C, 0xA4, 0x72, 0xC0,
0xB7, 0xFD, 0x93, 0x26, 0x36, 0x3F, 0xF7, 0xCC, 0x34, 0xA5, 0... | 36.564356 | 99 | 0.606959 | 1,142 | 7,386 | 3.909807 | 0.294221 | 0.007167 | 0.012094 | 0.022172 | 0.144009 | 0.111086 | 0.103471 | 0.102576 | 0.101904 | 0.089586 | 0 | 0.243459 | 0.218657 | 7,386 | 201 | 100 | 36.746269 | 0.530237 | 0 | 0 | 0.211268 | 0 | 0 | 0.003114 | 0 | 0 | 0 | 0.296236 | 0 | 0 | 1 | 0.133803 | false | 0 | 0 | 0.042254 | 0.204225 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
89876655a18cff97ea7b15b8586085f1d5db4a8d | 2,941 | py | Python | spider_demo/SpiderPro/day07/day07/spiders/meiju_spider.py | bestwishfang/fang | a4c48e242f6b46f1557ba92ce9ca5728c9381fed | [
"MIT"
] | 1 | 2021-01-13T13:22:03.000Z | 2021-01-13T13:22:03.000Z | spider_demo/SpiderPro/day07/day07/spiders/meiju_spider.py | bestwishfang/PerDemo | a4c48e242f6b46f1557ba92ce9ca5728c9381fed | [
"MIT"
] | null | null | null | spider_demo/SpiderPro/day07/day07/spiders/meiju_spider.py | bestwishfang/PerDemo | a4c48e242f6b46f1557ba92ce9ca5728c9381fed | [
"MIT"
] | 1 | 2019-08-22T06:12:19.000Z | 2019-08-22T06:12:19.000Z | # -*- coding: utf-8 -*-
import json
import scrapy
from urllib.parse import urljoin
from day07.items import MeijuItem
class MeijuSpiderSpider(scrapy.Spider):
name = 'meiju_spider'
custom_settings = {
'ITEM_PIPELINES': {'day07.pipelines.MeijuPipeline': 300,}
}
allowed_domains = ['meijutt.com']
... | 37.227848 | 111 | 0.537232 | 345 | 2,941 | 4.382609 | 0.307246 | 0.047619 | 0.060185 | 0.027778 | 0.138228 | 0.070106 | 0.070106 | 0.042328 | 0 | 0 | 0 | 0.01079 | 0.306698 | 2,941 | 79 | 112 | 37.227848 | 0.73075 | 0.50255 | 0 | 0 | 0 | 0 | 0.133489 | 0.074161 | 0 | 0 | 0 | 0 | 0 | 1 | 0.1 | false | 0 | 0.2 | 0 | 0.55 | 0.1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 |
898c7720a42bc5eca9b2667318f5236b10159abb | 306 | py | Python | CVhome/migrations/0008_delete_socialaccountposts.py | siavashMehran/Portfolio | a592ec51122d96e8e336365fd3cd039a7f223221 | [
"MIT"
] | null | null | null | CVhome/migrations/0008_delete_socialaccountposts.py | siavashMehran/Portfolio | a592ec51122d96e8e336365fd3cd039a7f223221 | [
"MIT"
] | null | null | null | CVhome/migrations/0008_delete_socialaccountposts.py | siavashMehran/Portfolio | a592ec51122d96e8e336365fd3cd039a7f223221 | [
"MIT"
] | null | null | null | # Generated by Django 3.1.5 on 2021-05-11 13:54
from django.db import migrations
class Migration(migrations.Migration):
dependencies = [
('CVhome', '0007_auto_20210511_1815'),
]
operations = [
migrations.DeleteModel(
name='SocialAccountPosts',
),
]
| 18 | 47 | 0.617647 | 32 | 306 | 5.8125 | 0.875 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.13964 | 0.27451 | 306 | 16 | 48 | 19.125 | 0.698198 | 0.147059 | 0 | 0 | 1 | 0 | 0.181467 | 0.088803 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.1 | 0 | 0.4 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
898f3552ab9006c26084d504f72bffd868b80c6f | 798 | py | Python | src/Python.Cef/PythonCef.Vue.Vuetify2/src/ServerApp/Controllers/HomeController.py | grbd/GBD.NetCore.WebTemplates | 19dee03ecc98279c10999fe6c32c61e17357d4c9 | [
"MIT"
] | null | null | null | src/Python.Cef/PythonCef.Vue.Vuetify2/src/ServerApp/Controllers/HomeController.py | grbd/GBD.NetCore.WebTemplates | 19dee03ecc98279c10999fe6c32c61e17357d4c9 | [
"MIT"
] | null | null | null | src/Python.Cef/PythonCef.Vue.Vuetify2/src/ServerApp/Controllers/HomeController.py | grbd/GBD.NetCore.WebTemplates | 19dee03ecc98279c10999fe6c32c61e17357d4c9 | [
"MIT"
] | null | null | null | from flask import Blueprint, render_template, abort
HomeController = Blueprint('HomeController', __name__)
@HomeController.route('/')
def home():
return render_template(
'home.html',
title='PythonFlask.Vue.Vuetify1 Template'
)
#using System;
#using System.Collections.Generic;
#using System.... | 21.567568 | 89 | 0.641604 | 71 | 798 | 7.126761 | 0.633803 | 0.108696 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.003279 | 0.235589 | 798 | 36 | 90 | 22.166667 | 0.82623 | 0.62406 | 0 | 0 | 0 | 0 | 0.204301 | 0.086022 | 0 | 0 | 0 | 0 | 0 | 1 | 0.125 | false | 0 | 0.125 | 0.125 | 0.375 | 0.25 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 |
89a0ac38e8195bcf7a8efa3ba7c2a4975509217d | 944 | py | Python | SciComputing with Python/lesson_05-06/ballisiticDrag.py | evtodorov/aerospace | 54a1b58c3c0b02c0eaa3aef14d0e732d7f867566 | [
"MIT"
] | null | null | null | SciComputing with Python/lesson_05-06/ballisiticDrag.py | evtodorov/aerospace | 54a1b58c3c0b02c0eaa3aef14d0e732d7f867566 | [
"MIT"
] | null | null | null | SciComputing with Python/lesson_05-06/ballisiticDrag.py | evtodorov/aerospace | 54a1b58c3c0b02c0eaa3aef14d0e732d7f867566 | [
"MIT"
] | null | null | null | # -*- coding: utf-8 -*-
"""
Created on Tue May 06 09:47:05 2014
Ballistic trajectories Case 2 Drag
@author: etodorov
"""
import math
import matplotlib.pyplot as plt
v0 = 50. #m/s
x0 = 0.
y0 = 0.
deg = math.pi/180.
g = -9.81
dt = .01 #time step
cD = .47 #drag c
A = 0.8 # m^2
m =... | 21.454545 | 40 | 0.494703 | 160 | 944 | 2.91875 | 0.525 | 0.034261 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.082671 | 0.333686 | 944 | 44 | 41 | 21.454545 | 0.659777 | 0.143008 | 0 | 0 | 0 | 0 | 0.06399 | 0 | 0 | 0 | 0 | 0.022727 | 0 | 1 | 0 | false | 0 | 0.054054 | 0 | 0.054054 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
89a1d92ecf3d1ee62167eeaf114b5e177ae8716c | 350 | py | Python | tools/_shared/inc/helpers/config_helpers.py | openTdataCH/OJP-Showcase | 0c36eae8ef3d539bc4ead7737735b522b0978c1e | [
"Apache-2.0"
] | 3 | 2020-12-11T13:21:15.000Z | 2022-01-27T06:38:44.000Z | tools/_shared/inc/helpers/config_helpers.py | openTdataCH/OJP-Showcase | 0c36eae8ef3d539bc4ead7737735b522b0978c1e | [
"Apache-2.0"
] | 22 | 2020-12-09T16:24:41.000Z | 2022-03-07T15:53:44.000Z | tools/_shared/inc/helpers/config_helpers.py | openTdataCH/OJP-Showcase | 0c36eae8ef3d539bc4ead7737735b522b0978c1e | [
"Apache-2.0"
] | 1 | 2021-03-19T10:44:32.000Z | 2021-03-19T10:44:32.000Z | import os
import yaml
from pathlib import Path
def load_yaml_config(config_path: Path, app_path: Path):
config_file_handler = open(f'{config_path}')
config_s = config_file_handler.read()
config_s = config_s.replace('[APP_PATH]', f'{app_path}')
config = yaml.safe_load(config_s)
config_file_hand... | 23.333333 | 60 | 0.725714 | 53 | 350 | 4.45283 | 0.377358 | 0.118644 | 0.216102 | 0.144068 | 0.20339 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.168571 | 350 | 15 | 61 | 23.333333 | 0.810997 | 0 | 0 | 0 | 0 | 0 | 0.094017 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.1 | false | 0 | 0.3 | 0 | 0.5 | 0 | 0 | 0 | 0 | null | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
89a5467b2460e819333eb658d04d55ff7bdc58f0 | 2,338 | py | Python | book/views.py | fbreversg/django_playing | ebeb9fb35350a65d970e950e99088fa5741ae09c | [
"MIT"
] | null | null | null | book/views.py | fbreversg/django_playing | ebeb9fb35350a65d970e950e99088fa5741ae09c | [
"MIT"
] | null | null | null | book/views.py | fbreversg/django_playing | ebeb9fb35350a65d970e950e99088fa5741ae09c | [
"MIT"
] | null | null | null | from django.shortcuts import render
from django.template.loader import get_template
from django.template import Context
from django.http import Http404, HttpResponse, HttpResponseRedirect
import datetime
def hello(request):
return HttpResponse("Hello world")
def current_datetime(request):
now = datetime.dat... | 28.168675 | 88 | 0.693328 | 287 | 2,338 | 5.501742 | 0.271777 | 0.049398 | 0.060165 | 0.053198 | 0.271058 | 0.21026 | 0.162128 | 0.162128 | 0.162128 | 0.162128 | 0 | 0.006332 | 0.189478 | 2,338 | 82 | 89 | 28.512195 | 0.826913 | 0.094525 | 0 | 0.150943 | 0 | 0 | 0.098244 | 0.019934 | 0 | 0 | 0 | 0 | 0.037736 | 1 | 0.207547 | false | 0 | 0.09434 | 0.018868 | 0.566038 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
89a8ab469344773b9024b7f54a63436e8da580c8 | 593 | py | Python | import.py | BusherBridi/Book-Review-Website | eb835cf23e41218f6a992fad65af2822aafe7f75 | [
"MIT"
] | 1 | 2020-06-24T03:28:25.000Z | 2020-06-24T03:28:25.000Z | import.py | BusherBridi/Book-Review-Website | eb835cf23e41218f6a992fad65af2822aafe7f75 | [
"MIT"
] | null | null | null | import.py | BusherBridi/Book-Review-Website | eb835cf23e41218f6a992fad65af2822aafe7f75 | [
"MIT"
] | null | null | null | import os
from flask import Flask, session, render_template, request
from flask_session import Session
from sqlalchemy import create_engine, exc
from sqlalchemy.orm import scoped_session, sessionmaker
import traceback
import csv
# Set up database
engine = create_engine("dbURL")
db = scoped_session(sessionmaker(bind=... | 26.954545 | 162 | 0.748735 | 84 | 593 | 5.214286 | 0.452381 | 0.082192 | 0.10274 | 0.130137 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.129848 | 593 | 22 | 163 | 26.954545 | 0.848837 | 0.025295 | 0 | 0 | 0 | 0.071429 | 0.202773 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.5 | 0 | 0.5 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 |
89a98f44ac130005d600e9a4220694f01ea0d4b6 | 351 | py | Python | gallery/migrations/0002_rename_name_image_img_name.py | Koech-code/My-gallery | 9ca6a4bee94528628202df6f96d15d347e62773b | [
"MIT"
] | null | null | null | gallery/migrations/0002_rename_name_image_img_name.py | Koech-code/My-gallery | 9ca6a4bee94528628202df6f96d15d347e62773b | [
"MIT"
] | null | null | null | gallery/migrations/0002_rename_name_image_img_name.py | Koech-code/My-gallery | 9ca6a4bee94528628202df6f96d15d347e62773b | [
"MIT"
] | null | null | null | # Generated by Django 3.2.7 on 2021-09-03 21:30
from django.db import migrations
class Migration(migrations.Migration):
dependencies = [
('gallery', '0001_initial'),
]
operations = [
migrations.RenameField(
model_name='image',
old_name='name',
new_nam... | 18.473684 | 47 | 0.569801 | 38 | 351 | 5.131579 | 0.789474 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.078838 | 0.31339 | 351 | 18 | 48 | 19.5 | 0.73029 | 0.128205 | 0 | 0 | 1 | 0 | 0.118421 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.083333 | 0 | 0.333333 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
89b2263b9935f8f866e10d6eed582d577f0563bc | 640 | py | Python | elasticapm/instrumentation/packages/pymssql.py | lyrixderaven/apm-agent-python | e21b306da70995ca1582666378b7059495ff1bee | [
"BSD-3-Clause"
] | 2 | 2019-02-15T20:23:39.000Z | 2019-02-15T20:26:06.000Z | elasticapm/instrumentation/packages/pymssql.py | lyrixderaven/apm-agent-python | e21b306da70995ca1582666378b7059495ff1bee | [
"BSD-3-Clause"
] | null | null | null | elasticapm/instrumentation/packages/pymssql.py | lyrixderaven/apm-agent-python | e21b306da70995ca1582666378b7059495ff1bee | [
"BSD-3-Clause"
] | null | null | null | from elasticapm.instrumentation.packages.dbapi2 import (
ConnectionProxy,
CursorProxy,
DbApi2Instrumentation,
extract_signature,
)
class PyMSSQLCursorProxy(CursorProxy):
provider_name = "pymssql"
def extract_signature(self, sql):
return extract_signature(sql)
class PyMSSQLConnection... | 23.703704 | 68 | 0.739063 | 55 | 640 | 8.490909 | 0.618182 | 0.102784 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.00565 | 0.170313 | 640 | 26 | 69 | 24.615385 | 0.873823 | 0 | 0 | 0 | 0 | 0 | 0.04375 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.117647 | false | 0 | 0.058824 | 0.117647 | 0.705882 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 1 |
89b2be0bd971399e7711319e325dfed9dfa51a52 | 2,086 | py | Python | src/z3c/form/browser/image.py | pretaweb/z3c.form | 757300d6e15a5ca8427946dbdc3952ba8978f132 | [
"ZPL-2.1"
] | null | null | null | src/z3c/form/browser/image.py | pretaweb/z3c.form | 757300d6e15a5ca8427946dbdc3952ba8978f132 | [
"ZPL-2.1"
] | null | null | null | src/z3c/form/browser/image.py | pretaweb/z3c.form | 757300d6e15a5ca8427946dbdc3952ba8978f132 | [
"ZPL-2.1"
] | null | null | null | ##############################################################################
#
# Copyright (c) 2007 Zope Foundation and Contributors.
# All Rights Reserved.
#
# This software is subject to the provisions of the Zope Public License,
# Version 2.1 (ZPL). A copy of the ZPL should accompany this distribution.
# THIS SOF... | 34.766667 | 78 | 0.667306 | 243 | 2,086 | 5.703704 | 0.469136 | 0.025253 | 0.031746 | 0.041126 | 0.031746 | 0 | 0 | 0 | 0 | 0 | 0 | 0.006279 | 0.160115 | 2,086 | 59 | 79 | 35.355932 | 0.784817 | 0.283317 | 0 | 0 | 0 | 0 | 0.046529 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.064516 | false | 0 | 0.290323 | 0 | 0.580645 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 |
89b372631f8c41e6984bedb16ca21f7aa34439ec | 2,202 | py | Python | Libraries/Python/CommonEnvironment/v1.0/CommonEnvironment/CodeCoverageValidatorImpl/__init__.py | davidbrownell/v3-Common_Environment | 8f42f256e573cbd83cbf9813db9958025ddf12f2 | [
"BSL-1.0"
] | null | null | null | Libraries/Python/CommonEnvironment/v1.0/CommonEnvironment/CodeCoverageValidatorImpl/__init__.py | davidbrownell/v3-Common_Environment | 8f42f256e573cbd83cbf9813db9958025ddf12f2 | [
"BSL-1.0"
] | 1 | 2018-06-08T06:45:16.000Z | 2018-06-08T06:45:16.000Z | Libraries/Python/CommonEnvironment/v1.0/CommonEnvironment/CodeCoverageValidatorImpl/__init__.py | davidbrownell/v3-Common_Environment | 8f42f256e573cbd83cbf9813db9958025ddf12f2 | [
"BSL-1.0"
] | 1 | 2018-06-08T04:15:17.000Z | 2018-06-08T04:15:17.000Z | # ----------------------------------------------------------------------
# |
# | __init__.py
# |
# | David Brownell <db@DavidBrownell.com>
# | 2018-05-22 22:27:15
# |
# ----------------------------------------------------------------------
# |
# | Copyright David Brownell 2018-22.
# | Distrib... | 37.965517 | 93 | 0.411444 | 139 | 2,202 | 6.359712 | 0.57554 | 0.067873 | 0.074661 | 0.027149 | 0.126697 | 0.126697 | 0.126697 | 0.126697 | 0.126697 | 0 | 0 | 0.01484 | 0.20436 | 2,202 | 57 | 94 | 38.631579 | 0.489726 | 0.591281 | 0 | 0.222222 | 0 | 0 | 0.061947 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.166667 | false | 0 | 0.166667 | 0 | 0.388889 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
89b92d42d6b18ae723aa872cb68cdb54f02d11be | 334 | py | Python | agc/019/b.py | wotsushi/competitive-programming | 17ec8fd5e1c23aee626aee70b1c0da8d7f8b8c86 | [
"MIT"
] | 3 | 2019-06-25T06:17:38.000Z | 2019-07-13T15:18:51.000Z | agc/019/b.py | wotsushi/competitive-programming | 17ec8fd5e1c23aee626aee70b1c0da8d7f8b8c86 | [
"MIT"
] | null | null | null | agc/019/b.py | wotsushi/competitive-programming | 17ec8fd5e1c23aee626aee70b1c0da8d7f8b8c86 | [
"MIT"
] | null | null | null | from collections import Counter
from string import ascii_lowercase
A = input()
# 英小文字xについて、Aに含まれるxの個数をc[x]で表す。
# 解は、1 + c['a'](c['b'] + ... + c['z']) +
# c['b'](c['c'] + ... + c['z']) + c['y']['z'] である。
c = Counter(A)
ans = 1 + sum(
c[x] * sum(c[y] for y in ascii_lowercase if x < y)
for x in ascii_lowercase
... | 19.647059 | 54 | 0.562874 | 59 | 334 | 3.135593 | 0.440678 | 0.227027 | 0.032432 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.007519 | 0.203593 | 334 | 16 | 55 | 20.875 | 0.68797 | 0.350299 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.222222 | 0 | 0.222222 | 0.111111 | 0 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
89bad99681d5ec475958ab5ee3fa7e905b49759c | 486 | py | Python | slides/car_methods.py | adwas/oop_basics | 09fa44faf25212b2c6a6cc27de7f5b170fc5b601 | [
"MIT"
] | null | null | null | slides/car_methods.py | adwas/oop_basics | 09fa44faf25212b2c6a6cc27de7f5b170fc5b601 | [
"MIT"
] | null | null | null | slides/car_methods.py | adwas/oop_basics | 09fa44faf25212b2c6a6cc27de7f5b170fc5b601 | [
"MIT"
] | null | null | null | #!/bin/env python3
class Car:
''' A car description '''
NUMBER_OF_WHEELS = 4 # Class variable.
def __init__(self, name):
self.name = name
self.distance = 0
def drive(self, distance):
''' incrises distance '''
self.distance += distance
def reverse(distance):
... | 18.692308 | 43 | 0.598765 | 58 | 486 | 4.775862 | 0.517241 | 0.129964 | 0.101083 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.022346 | 0.263374 | 486 | 25 | 44 | 19.44 | 0.751397 | 0.174897 | 0 | 0.142857 | 0 | 0 | 0.052632 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.214286 | false | 0 | 0 | 0 | 0.357143 | 0.214286 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
89bb2b3e059ef6937550795e36452a7e00f0ba63 | 15,524 | py | Python | test_cases/geo_quiz.py | edupylearn/simplegui | 1f781d849b26fd15b949c0a7740d29b5628308a8 | [
"BSD-3-Clause"
] | 413 | 2015-01-18T01:56:41.000Z | 2022-03-29T05:29:12.000Z | test_cases/geo_quiz.py | zadacka/easygui | 6652d526468a98d3b5720df39dd395cf911d7015 | [
"BSD-3-Clause"
] | 148 | 2015-01-05T00:42:22.000Z | 2022-03-18T12:06:46.000Z | test_cases/geo_quiz.py | zadacka/easygui | 6652d526468a98d3b5720df39dd395cf911d7015 | [
"BSD-3-Clause"
] | 136 | 2015-01-03T11:57:19.000Z | 2022-02-11T04:49:56.000Z | __author__ = 'Mays D'
# Ref:
# http://stackoverflow.com/questions/29767777/gui-quiz-using-easygui-and-pygame-issue-with-quieting-the-game-and-playing-sound
#We start by importing a few libraries.
#Easygui provides our GUI for the game.
import sys
sys.path.append('..') ;# This is only needed in Robert Lugg's develop... | 33.747826 | 141 | 0.528408 | 1,959 | 15,524 | 4.172537 | 0.199592 | 0.022755 | 0.060313 | 0.01884 | 0.497431 | 0.363225 | 0.363225 | 0.351236 | 0.346097 | 0.326645 | 0 | 0.032637 | 0.364468 | 15,524 | 460 | 142 | 33.747826 | 0.795865 | 0.147707 | 0 | 0.719677 | 0 | 0 | 0.244182 | 0.001668 | 0 | 0 | 0 | 0 | 0 | 1 | 0.008086 | false | 0 | 0.010782 | 0 | 0.018868 | 0.005391 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
89bcce712126a4f5de2cd23b0e9bf0fe4e5e4523 | 1,008 | py | Python | setup.py | eddbrown/coodinate_country_lookup | 6e2f34c3d43c35e46319561682205d3eebb652f3 | [
"MIT"
] | null | null | null | setup.py | eddbrown/coodinate_country_lookup | 6e2f34c3d43c35e46319561682205d3eebb652f3 | [
"MIT"
] | null | null | null | setup.py | eddbrown/coodinate_country_lookup | 6e2f34c3d43c35e46319561682205d3eebb652f3 | [
"MIT"
] | null | null | null | from distutils.core import setup
setup(
name = 'coordinate_country_lookup', # How you named your package folder (MyLib)
packages = ['coordinate_country_lookup'], # Chose the same as "name"
version = '0.1.5', # Start with a small number and increase it with every change you make
license='MIT', ... | 63 | 126 | 0.699405 | 135 | 1,008 | 5.140741 | 0.651852 | 0.073487 | 0.066282 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.003686 | 0.19246 | 1,008 | 15 | 127 | 67.2 | 0.848894 | 0.393849 | 0 | 0 | 0 | 0 | 0.429285 | 0.126456 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 0.066667 | 0 | 0.066667 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
89bd675247ec6ec779dfad946417c03dfd6a454a | 570 | py | Python | setup.py | deeso/splunk-connector | 16510d46fbd294bf77c527b8505d418f7ad13df1 | [
"Apache-2.0"
] | null | null | null | setup.py | deeso/splunk-connector | 16510d46fbd294bf77c527b8505d418f7ad13df1 | [
"Apache-2.0"
] | null | null | null | setup.py | deeso/splunk-connector | 16510d46fbd294bf77c527b8505d418f7ad13df1 | [
"Apache-2.0"
] | null | null | null | #!/usr/bin/env python
from setuptools import setup, find_packages
import os
data_files = [(d, [os.path.join(d, f) for f in files])
for d, folders, files in os.walk(os.path.join('src', 'config'))]
setup(name='splunk-connector',
version='1.0',
description='execute splunk queries and format d... | 30 | 91 | 0.642105 | 76 | 570 | 4.736842 | 0.684211 | 0.066667 | 0.055556 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.004329 | 0.189474 | 570 | 18 | 92 | 31.666667 | 0.774892 | 0.035088 | 0 | 0 | 0 | 0 | 0.285975 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0.076923 | 0.153846 | 0 | 0.153846 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 1 |
98265a391ba6e679689f6e1b4e30dc2c1dd6e654 | 3,185 | py | Python | tests/test_superconductor_losses.py | tamasorosz/TrafoCalc | f7b6d5dbd8b144cfbc4f7f86467a5a3fa3c32f9d | [
"Apache-2.0"
] | null | null | null | tests/test_superconductor_losses.py | tamasorosz/TrafoCalc | f7b6d5dbd8b144cfbc4f7f86467a5a3fa3c32f9d | [
"Apache-2.0"
] | 2 | 2022-03-29T07:45:37.000Z | 2022-03-30T15:49:08.000Z | tests/test_superconductor_losses.py | tamasorosz/TrafoCalc | f7b6d5dbd8b144cfbc4f7f86467a5a3fa3c32f9d | [
"Apache-2.0"
] | null | null | null | from unittest import TestCase
from src.superconductor_losses import parallel_loss, perp_loss, norris_equation, cryostat_losses, cryo_surface, \
thermal_incomes, cooler_cost, sc_load_loss, magnusson_ac_loss
from math import pi
class TestLosses(TestCase):
def test_losses(self):
# BSCCO cable from Magn... | 30.92233 | 113 | 0.583046 | 474 | 3,185 | 3.763713 | 0.335443 | 0.200112 | 0.049327 | 0.055493 | 0.240471 | 0.200673 | 0.200673 | 0.133408 | 0.065022 | 0.065022 | 0 | 0.160433 | 0.303297 | 3,185 | 102 | 114 | 31.22549 | 0.643533 | 0.232653 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.306122 | 1 | 0.122449 | false | 0 | 0.061224 | 0 | 0.204082 | 0 | 0 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
982ceab1b7e87477124d35ceb27890b9b8325339 | 75,843 | py | Python | src/pyhees/section7_1.py | jjj-design/pyhees | d63e7cd84abfc2f509bc1cd1256598a10aac1825 | [
"MIT"
] | null | null | null | src/pyhees/section7_1.py | jjj-design/pyhees | d63e7cd84abfc2f509bc1cd1256598a10aac1825 | [
"MIT"
] | 3 | 2022-01-04T07:29:52.000Z | 2022-03-19T08:02:51.000Z | src/pyhees/section7_1.py | jjj-design/pyhees | d63e7cd84abfc2f509bc1cd1256598a10aac1825 | [
"MIT"
] | 2 | 2022-01-19T07:57:10.000Z | 2022-03-07T00:25:54.000Z | # ============================================================================
# 第七章 給湯設備
# 第一節 給湯設備
# Ver.18(エネルギー消費性能計算プログラム(住宅版)Ver.02.05~)
# ============================================================================
import numpy as np
from functools import lru_cache
import pyhees.section7_1_b as default
import... | 34.025572 | 150 | 0.625463 | 12,478 | 75,843 | 3.313271 | 0.043356 | 0.049295 | 0.026413 | 0.049754 | 0.79762 | 0.739303 | 0.692403 | 0.667199 | 0.61459 | 0.585226 | 0 | 0.032837 | 0.235486 | 75,843 | 2,228 | 151 | 34.040844 | 0.677957 | 0.296283 | 0 | 0.531041 | 0 | 0 | 0.105226 | 0.032408 | 0 | 0 | 0 | 0 | 0 | 1 | 0.056351 | false | 0 | 0.017192 | 0 | 0.187202 | 0.025788 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
982eab1083a177d99db2fb41bd058c1ad5726e22 | 460 | py | Python | doughnuts/webshell_plugins/extension.py | MorouU/Doughnuts | ca4777551b27e6dbe9015827ecf091b1dafcd064 | [
"MIT"
] | 5 | 2020-10-09T05:01:34.000Z | 2020-11-15T08:38:06.000Z | doughnuts/webshell_plugins/extension.py | SkyBlueEternal/Doughnuts | 8d82cffd3e4867f5e87ce35bdcf53678049c579c | [
"MIT"
] | 1 | 2020-11-10T03:44:57.000Z | 2020-11-10T03:44:57.000Z | doughnuts/webshell_plugins/extension.py | SkyBlueEternal/Doughnuts | 8d82cffd3e4867f5e87ce35bdcf53678049c579c | [
"MIT"
] | null | null | null | from libs.config import alias, gget, color
@alias(func_alias="ext", _type="COMMON",)
def run():
"""
extension
Lists installed extensions.
"""
loaded_ext = gget("webshell.loaded_ext",namespace="webshell")
print()
if isinstance(loaded_ext,list):
print(color.magenta("Extension ---> \n... | 23 | 65 | 0.597826 | 53 | 460 | 5.075472 | 0.622642 | 0.133829 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.23913 | 460 | 19 | 66 | 24.210526 | 0.768571 | 0.082609 | 0 | 0.166667 | 0 | 0 | 0.164589 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.083333 | false | 0 | 0.083333 | 0 | 0.166667 | 0.416667 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 1 |
9835d97f02fb560c2dfa7686e8d7235cdd834f88 | 489 | py | Python | LeetCode/09/lc953.py | Ad147/LeetCode-Solutions | 2ddbaef7387887f030825616cafde87db7d2022e | [
"MIT"
] | null | null | null | LeetCode/09/lc953.py | Ad147/LeetCode-Solutions | 2ddbaef7387887f030825616cafde87db7d2022e | [
"MIT"
] | null | null | null | LeetCode/09/lc953.py | Ad147/LeetCode-Solutions | 2ddbaef7387887f030825616cafde87db7d2022e | [
"MIT"
] | null | null | null | # LeetCode 953. Verifying an Alien Dictionary `E`
# 1sk | 97% | 22'
# A~0v21
class Solution:
def isAlienSorted(self, words: List[str], order: str) -> bool:
dic = {c: i for i, c in enumerate(order)}
def cmp(s1, s2):
for i in range(min(len(s1), len(s2))):
if s1[i] != s2[i... | 30.5625 | 74 | 0.519427 | 77 | 489 | 3.298701 | 0.493506 | 0.047244 | 0.047244 | 0.086614 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.068452 | 0.312883 | 489 | 15 | 75 | 32.6 | 0.6875 | 0.143149 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.222222 | false | 0 | 0 | 0 | 0.666667 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
98364b3609f6613642458c25472e10552e3a22f0 | 6,814 | py | Python | jaccard.py | derursm/troll-identification | ab5dda3520e31706e761fdd5bf231b308f449cf7 | [
"MIT"
] | 1 | 2016-07-12T10:27:35.000Z | 2016-07-12T10:27:35.000Z | jaccard.py | derursm/troll-identification | ab5dda3520e31706e761fdd5bf231b308f449cf7 | [
"MIT"
] | null | null | null | jaccard.py | derursm/troll-identification | ab5dda3520e31706e761fdd5bf231b308f449cf7 | [
"MIT"
] | null | null | null | from __future__ import division
import itertools
import re
import numpy as np
import sqlite3 as lite
class Jaccard:
#k: word-grams
#t: threshold
#m: minimum tokens
def __init__(self,k,t,m,db):
self.k=k
self.t=t
self.m=m
self.shingleLength=[]
self.db=db
def makeASetOfTokens(self,co... | 41.048193 | 272 | 0.634723 | 753 | 6,814 | 5.664011 | 0.223108 | 0.082532 | 0.061899 | 0.076905 | 0.379836 | 0.291208 | 0.275733 | 0.26354 | 0.187573 | 0.132239 | 0 | 0.017756 | 0.247872 | 6,814 | 165 | 273 | 41.29697 | 0.814439 | 0.041826 | 0 | 0.217391 | 0 | 0.007246 | 0.121045 | 0.045333 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.036232 | null | null | 0.021739 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
983e7a979f6b56c9208eca0d2ed03d5fea5b077d | 1,796 | py | Python | backend/model/upload.py | jrborbars/Icarus | f0195d54f52831449acf822801a5ee8f951450b1 | [
"Zlib"
] | null | null | null | backend/model/upload.py | jrborbars/Icarus | f0195d54f52831449acf822801a5ee8f951450b1 | [
"Zlib"
] | null | null | null | backend/model/upload.py | jrborbars/Icarus | f0195d54f52831449acf822801a5ee8f951450b1 | [
"Zlib"
] | null | null | null | import time
import peewee
from peewee import BlobField, BigIntegerField, TextField
from playhouse.postgres_ext import BinaryJSONField
from slim.utils import StateObject, to_hex
import config
from model import BaseModel, MyTimestampField
from model._post import LongIdPostModel, POST_TYPES
class UPLOAD_SOURCE(StateOb... | 30.440678 | 108 | 0.666481 | 218 | 1,796 | 5.353211 | 0.353211 | 0.030848 | 0.058269 | 0.032562 | 0.075407 | 0.030848 | 0 | 0 | 0 | 0 | 0 | 0 | 0.23441 | 1,796 | 58 | 109 | 30.965517 | 0.848727 | 0.053452 | 0 | 0.088889 | 0 | 0 | 0.027139 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.088889 | false | 0.022222 | 0.177778 | 0.044444 | 0.644444 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 |
983fadd8838306cc9aa9bacd881ecae83aee5532 | 2,844 | py | Python | cyder/cydns/sshfp/models.py | ngokevin/chili | 36c354ac567471d5e36dccf9eea5096c6b02d4b9 | [
"BSD-3-Clause"
] | 2 | 2019-03-16T00:47:09.000Z | 2022-03-04T14:39:08.000Z | cyder/cydns/sshfp/models.py | ngokevin/chili | 36c354ac567471d5e36dccf9eea5096c6b02d4b9 | [
"BSD-3-Clause"
] | 1 | 2020-04-24T08:24:55.000Z | 2020-04-24T08:24:55.000Z | cyder/cydns/sshfp/models.py | ngokevin/chili | 36c354ac567471d5e36dccf9eea5096c6b02d4b9 | [
"BSD-3-Clause"
] | null | null | null | import re
from gettext import gettext as _
from django.db import models
from django.core.exceptions import ValidationError
from cyder.cydns.models import CydnsRecord, LabelDomainMixin
def validate_algorithm(number):
if number not in (1, 2):
raise ValidationError(
"Algorithm number must be wi... | 32.689655 | 79 | 0.608298 | 312 | 2,844 | 5.394231 | 0.36859 | 0.089127 | 0.028521 | 0.020202 | 0.207962 | 0.171123 | 0.147356 | 0.116459 | 0.041592 | 0.041592 | 0 | 0.01322 | 0.255274 | 2,844 | 86 | 80 | 33.069767 | 0.781398 | 0.117089 | 0 | 0 | 0 | 0 | 0.239403 | 0.026241 | 0 | 0 | 0 | 0.011628 | 0 | 1 | 0.127273 | false | 0 | 0.090909 | 0.036364 | 0.436364 | 0.163636 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
98417935d2ca21ade1d3f299809c60ac68909668 | 631 | py | Python | aristo/zip.py | AristodamusAdairs/Aristo-Framework | c3e67eca4452e690319883802e85f25d3300287c | [
"MIT"
] | 1 | 2021-12-22T11:15:13.000Z | 2021-12-22T11:15:13.000Z | aristo/zip.py | AristodamusAdairs/Aristo-Framework | c3e67eca4452e690319883802e85f25d3300287c | [
"MIT"
] | 4 | 2021-12-12T18:39:31.000Z | 2022-02-13T05:42:56.000Z | aristo/zip.py | AristodamusAdairs/Aristo-Framework | c3e67eca4452e690319883802e85f25d3300287c | [
"MIT"
] | 1 | 2021-12-12T18:53:09.000Z | 2021-12-12T18:53:09.000Z | import zipfile
import color
from color import *
def zipfile():
print(""+C+"Files have to be in the same directory - Include .zip or .txt")
zipfilename = input(''+T+'' + color.UNDERLINE + 'Zip file>' + color.END)
dictionary = input(''+T+'' + color.UNDERLINE + 'Dictionary file>' + color.END)
print(""+G+"[*] "+W+"Cra... | 30.047619 | 79 | 0.640254 | 84 | 631 | 4.785714 | 0.571429 | 0.052239 | 0.054726 | 0.099502 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.177496 | 631 | 20 | 80 | 31.55 | 0.774566 | 0 | 0 | 0 | 0 | 0 | 0.22504 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.052632 | false | 0.315789 | 0.157895 | 0 | 0.210526 | 0.157895 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 1 |
9847fb2cca001c2c454e6fab672b078d00e7a9cb | 1,414 | py | Python | setup.py | nghung270192/colorama | 0ced6edbf6c93cca628195f5e22940d736c4c66a | [
"BSD-3-Clause"
] | null | null | null | setup.py | nghung270192/colorama | 0ced6edbf6c93cca628195f5e22940d736c4c66a | [
"BSD-3-Clause"
] | null | null | null | setup.py | nghung270192/colorama | 0ced6edbf6c93cca628195f5e22940d736c4c66a | [
"BSD-3-Clause"
] | null | null | null | #!/usr/bin/env python
# Copyright Jonathan Hartley 2013. BSD 3-Clause license, see LICENSE file.
from os.path import dirname, join
from distutils.core import setup
from colorama import VERSION
NAME = 'colorama'
def get_long_description(filename):
readme = join(dirname(__file__), filename)
return open(readm... | 30.73913 | 79 | 0.652758 | 156 | 1,414 | 5.846154 | 0.551282 | 0.145833 | 0.191886 | 0.114035 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.017179 | 0.217822 | 1,414 | 45 | 80 | 31.422222 | 0.807414 | 0.115983 | 0 | 0 | 0 | 0 | 0.495987 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.029412 | false | 0 | 0.088235 | 0 | 0.147059 | 0 | 0 | 0 | 0 | null | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
984c49f5b020f448256ca7c437afd73b2d9facd1 | 284 | py | Python | 0/1/1978/1978.py | chr0m3/boj-codes | d71d0a22d0a3ae62c225f382442461275f56fe8f | [
"MIT"
] | 3 | 2017-07-08T16:29:06.000Z | 2020-07-20T00:17:45.000Z | 0/1/1978/1978.py | chr0m3/boj-codes | d71d0a22d0a3ae62c225f382442461275f56fe8f | [
"MIT"
] | null | null | null | 0/1/1978/1978.py | chr0m3/boj-codes | d71d0a22d0a3ae62c225f382442461275f56fe8f | [
"MIT"
] | 2 | 2017-11-20T14:06:06.000Z | 2020-07-20T00:17:47.000Z | prime_numbers = [True for x in range(1001)]
prime_numbers[1] = False
for i in range(2, 1001):
for j in range(2*i, 1001, i):
prime_numbers[j] = False
input()
count = 0
for i in map(int, input().split()):
if prime_numbers[i] is True:
count += 1
print(count)
| 17.75 | 43 | 0.616197 | 50 | 284 | 3.42 | 0.44 | 0.280702 | 0.070175 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.07907 | 0.242958 | 284 | 15 | 44 | 18.933333 | 0.716279 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0 | 0 | 0 | 0.090909 | 0 | 0 | 0 | null | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
98509ad5558c8bd722ac106d4959be2c5d4cd6b2 | 6,333 | py | Python | indicatorlibrary/quickstart/migrations/0001_initial.py | andrewtpham/Indicator-Library | d8fb434b467775ab8e2dae2190c36a93ada242a0 | [
"Apache-2.0"
] | 2 | 2020-12-07T10:49:30.000Z | 2022-03-12T18:52:24.000Z | indicatorlibrary/quickstart/migrations/0001_initial.py | andrewtpham/Indicator-Library | d8fb434b467775ab8e2dae2190c36a93ada242a0 | [
"Apache-2.0"
] | 3 | 2019-11-15T09:55:29.000Z | 2019-11-15T09:55:37.000Z | indicatorlibrary/quickstart/migrations/0001_initial.py | andrewtpham/Indicator-Library | d8fb434b467775ab8e2dae2190c36a93ada242a0 | [
"Apache-2.0"
] | null | null | null | # Generated by Django 2.0.5 on 2018-06-21 16:10
import django.contrib.postgres.fields
import django.contrib.postgres.fields.jsonb
from django.db import migrations, models
import django.db.models.deletion
import uuid
class Migration(migrations.Migration):
initial = True
dependencies = [
]
operation... | 68.836957 | 247 | 0.652297 | 714 | 6,333 | 5.634454 | 0.170868 | 0.082774 | 0.071588 | 0.107383 | 0.666915 | 0.640318 | 0.587621 | 0.522496 | 0.522496 | 0.445936 | 0 | 0.022759 | 0.209064 | 6,333 | 91 | 248 | 69.593407 | 0.780395 | 0.007106 | 0 | 0.333333 | 1 | 0 | 0.176265 | 0.026567 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.059524 | 0 | 0.107143 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
98515e44cb3fcfe690b89637b19d261f38460da5 | 2,888 | py | Python | biosteam/compounds/_chemical.py | lilanyu/biosteam | b025bbe138bfd0b016af58583792fb4f3ff9186e | [
"MIT"
] | 1 | 2019-11-17T13:14:19.000Z | 2019-11-17T13:14:19.000Z | build/lib/biosteam/compounds/_chemical.py | lilanyu/biosteam | b025bbe138bfd0b016af58583792fb4f3ff9186e | [
"MIT"
] | null | null | null | build/lib/biosteam/compounds/_chemical.py | lilanyu/biosteam | b025bbe138bfd0b016af58583792fb4f3ff9186e | [
"MIT"
] | null | null | null | # -*- coding: utf-8 -*-
"""
Created on Sat Aug 18 13:50:03 2018
@author: yoelr
"""
from ..thermo.chemical import Chemical as TChem
from ._compound import Compound
import numpy as np
import re
__all__ = ('Chemical', 'Solid', 'Liquid', 'Gas')
class Chemical(Compound, TChem):
"""An extension of the ChEDL thermo Che... | 29.773196 | 287 | 0.605956 | 407 | 2,888 | 4.164619 | 0.390663 | 0.047788 | 0.042478 | 0.030678 | 0.39646 | 0.350442 | 0.331563 | 0.312684 | 0.269027 | 0.253687 | 0 | 0.044719 | 0.272161 | 2,888 | 96 | 288 | 30.083333 | 0.761656 | 0.32964 | 0 | 0.35 | 0 | 0 | 0.074017 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.2 | false | 0.066667 | 0.066667 | 0.05 | 0.45 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 1 |
9851a44fd8f1c1134120e88b6cbd40f82be96153 | 1,040 | py | Python | app/factories/event_invoice.py | akashtalole/python-flask-restful-api | 475d8fd7be1724183716a197aac4257f8fbbeac4 | [
"MIT"
] | 3 | 2019-09-05T05:28:49.000Z | 2020-06-10T09:03:37.000Z | app/factories/event_invoice.py | akashtalole/python-flask-restful-api | 475d8fd7be1724183716a197aac4257f8fbbeac4 | [
"MIT"
] | null | null | null | app/factories/event_invoice.py | akashtalole/python-flask-restful-api | 475d8fd7be1724183716a197aac4257f8fbbeac4 | [
"MIT"
] | null | null | null | import factory
import app.factories.common as common
from app.factories.discount_code import DiscountCodeFactory
from app.factories.event import EventFactoryBasic
from app.factories.user import UserFactory
from app.models.event_invoice import db, EventInvoice
class EventInvoiceFactory(factory.alchemy.SQLAlchemyModel... | 28.888889 | 66 | 0.735577 | 117 | 1,040 | 6.333333 | 0.478632 | 0.129555 | 0.064777 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.022727 | 0.196154 | 1,040 | 35 | 67 | 29.714286 | 0.863636 | 0 | 0 | 0 | 0 | 0 | 0.022115 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.193548 | 0 | 0.935484 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 |
985a4f1c560e4bd3590d2dc04f90cfb151a23500 | 1,963 | py | Python | cloudify_rest_client/evaluate.py | aleixsanchis/cloudify-rest-client | 6acaadee8286ab647465824d3c8e13d4c43ca9ba | [
"Apache-2.0"
] | 7 | 2015-09-30T09:27:00.000Z | 2016-10-24T17:27:41.000Z | cloudify_rest_client/evaluate.py | aleixsanchis/cloudify-rest-client | 6acaadee8286ab647465824d3c8e13d4c43ca9ba | [
"Apache-2.0"
] | 97 | 2018-05-25T12:10:19.000Z | 2022-03-30T10:16:40.000Z | cloudify_rest_client/evaluate.py | aleixsanchis/cloudify-rest-client | 6acaadee8286ab647465824d3c8e13d4c43ca9ba | [
"Apache-2.0"
] | 21 | 2015-01-21T17:13:26.000Z | 2019-11-14T11:57:09.000Z | ########
# Copyright (c) 2014 GigaSpaces Technologies Ltd. All rights reserved
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless... | 30.671875 | 79 | 0.641365 | 224 | 1,963 | 5.544643 | 0.482143 | 0.077295 | 0.020934 | 0.025765 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.005602 | 0.272542 | 1,963 | 63 | 80 | 31.15873 | 0.864146 | 0.556291 | 0 | 0.1 | 0 | 0 | 0.092827 | 0 | 0 | 0 | 0 | 0 | 0.05 | 1 | 0.25 | false | 0 | 0 | 0 | 0.5 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
9861fed30616875e7f29ab06b6fdfd398fbe1bbc | 1,033 | gyp | Python | test/binding.gyp | pavelnikitiuk/nan-marshal | 84984def9d773d9adb06dab371305341e55aef38 | [
"MIT"
] | 8 | 2015-10-11T15:39:02.000Z | 2018-04-20T17:53:38.000Z | test/binding.gyp | pavelnikitiuk/nan-marshal | 84984def9d773d9adb06dab371305341e55aef38 | [
"MIT"
] | 2 | 2019-11-20T09:22:13.000Z | 2019-12-08T19:15:19.000Z | test/binding.gyp | pavelnikitiuk/nan-marshal | 84984def9d773d9adb06dab371305341e55aef38 | [
"MIT"
] | 3 | 2016-07-25T20:38:22.000Z | 2019-11-20T19:38:36.000Z | {
"target_defaults":
{
"cflags" : ["-Wall", "-Wextra", "-Wno-unused-parameter"],
"include_dirs": ["<!(node -e \"require('..')\")", "<!(node -e \"require('nan')\")",]
},
"targets": [
{
"target_name" : "primeNumbers",
"sources" : [ "cpp/primeNumbers.cpp" ],
"target_conditions": [
... | 30.382353 | 105 | 0.449177 | 94 | 1,033 | 4.776596 | 0.585106 | 0.026726 | 0.040089 | 0.080178 | 0.164811 | 0.164811 | 0.164811 | 0.164811 | 0.164811 | 0.164811 | 0 | 0.016736 | 0.305905 | 1,033 | 33 | 106 | 31.30303 | 0.609484 | 0 | 0 | 0 | 0 | 0 | 0.525653 | 0.092933 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | true | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
9865bb50a4182daed1f55c9534ca9dba00d264e0 | 2,515 | py | Python | apps/beatitud_annotate/models/vatican.py | beatitud/beatitud-back | 32de6c33ec5d70e35bf76c38bedc73c5b2c3e719 | [
"MIT"
] | null | null | null | apps/beatitud_annotate/models/vatican.py | beatitud/beatitud-back | 32de6c33ec5d70e35bf76c38bedc73c5b2c3e719 | [
"MIT"
] | null | null | null | apps/beatitud_annotate/models/vatican.py | beatitud/beatitud-back | 32de6c33ec5d70e35bf76c38bedc73c5b2c3e719 | [
"MIT"
] | null | null | null | from django.db import models
from django.contrib.postgres.fields import ArrayField
from apps.beatitud_corpus.models import Language
from utils.scraping.beautiful_soup import get_text_from_bs, BeautifulSoup
from django.db.models.signals import post_save
from django.dispatch import receiver
class Pope(models.Model):
... | 36.449275 | 80 | 0.689463 | 314 | 2,515 | 5.378981 | 0.296178 | 0.063943 | 0.106572 | 0.142096 | 0.367081 | 0.164594 | 0.164594 | 0.124334 | 0.061575 | 0.061575 | 0 | 0.019095 | 0.208748 | 2,515 | 68 | 81 | 36.985294 | 0.829648 | 0 | 0 | 0.101695 | 0 | 0 | 0.014712 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.033898 | false | 0 | 0.118644 | 0 | 0.59322 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 |
9866b10cc7254c65134b6dd8b4b726a793b04e29 | 52,765 | py | Python | codewof/style/style_checkers/python3_data.py | uccser-admin/programming-practice-prototype | 3af4c7d85308ac5bb35bb13be3ec18cac4eb8308 | [
"MIT"
] | 3 | 2019-08-29T04:11:22.000Z | 2021-06-22T16:05:51.000Z | codewof/style/style_checkers/python3_data.py | uccser-admin/programming-practice-prototype | 3af4c7d85308ac5bb35bb13be3ec18cac4eb8308 | [
"MIT"
] | 265 | 2019-05-30T03:51:46.000Z | 2022-03-31T01:05:12.000Z | codewof/style/style_checkers/python3_data.py | samuelsandri/codewof | c9b8b378c06b15a0c42ae863b8f46581de04fdfc | [
"MIT"
] | 7 | 2019-06-29T12:13:37.000Z | 2021-09-06T06:49:14.000Z | """Data for Python 3 style errors.
The following fields are rendered as HTML.
- solution
- explanation
"""
DATA = {
"E101": {
"original_message": "indentation contains mixed spaces and tabs",
"title_templated": False,
"title": "Line is indented using a mixture of spaces and tabs.",
... | 46.285088 | 317 | 0.623709 | 6,217 | 52,765 | 5.24047 | 0.109217 | 0.067219 | 0.082812 | 0.104604 | 0.652241 | 0.56194 | 0.491375 | 0.441713 | 0.411572 | 0.361633 | 0 | 0.01356 | 0.257879 | 52,765 | 1,139 | 318 | 46.325724 | 0.818453 | 0.015503 | 0 | 0.355106 | 0 | 0.034039 | 0.710838 | 0.003583 | 0 | 0 | 0 | 0.000878 | 0 | 1 | 0 | false | 0.00092 | 0.019319 | 0 | 0.019319 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
987492a81b7e959332405c021d8c73816040b50c | 2,414 | py | Python | apps/material/migrations/0002_auto_20211024_1816.py | yhkl-dev/JAutoOps | e42342fc6d814813dcac2e0154cd5dfdc1adf4c1 | [
"MIT"
] | null | null | null | apps/material/migrations/0002_auto_20211024_1816.py | yhkl-dev/JAutoOps | e42342fc6d814813dcac2e0154cd5dfdc1adf4c1 | [
"MIT"
] | null | null | null | apps/material/migrations/0002_auto_20211024_1816.py | yhkl-dev/JAutoOps | e42342fc6d814813dcac2e0154cd5dfdc1adf4c1 | [
"MIT"
] | null | null | null | # Generated by Django 3.2.6 on 2021-10-24 10:16
from django.db import migrations, models
class Migration(migrations.Migration):
dependencies = [
('material', '0001_initial'),
]
operations = [
migrations.CreateModel(
name='GICategoryModel',
fields=[
... | 42.350877 | 138 | 0.609362 | 263 | 2,414 | 5.34981 | 0.254753 | 0.070362 | 0.125089 | 0.147832 | 0.703625 | 0.697939 | 0.594883 | 0.554371 | 0.502488 | 0.440654 | 0 | 0.024063 | 0.259735 | 2,414 | 56 | 139 | 43.107143 | 0.76329 | 0.018641 | 0 | 0.46 | 1 | 0 | 0.17068 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.02 | 0 | 0.08 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
9880b4215ab310633b77e5aecbe3e92892c92ae5 | 243 | py | Python | Solutions/ProjectEuler_09.py | Yassate/ProjectEuler | dd2a8402535f48d9ca5b45c6fbbe7f5359e088de | [
"MIT"
] | null | null | null | Solutions/ProjectEuler_09.py | Yassate/ProjectEuler | dd2a8402535f48d9ca5b45c6fbbe7f5359e088de | [
"MIT"
] | null | null | null | Solutions/ProjectEuler_09.py | Yassate/ProjectEuler | dd2a8402535f48d9ca5b45c6fbbe7f5359e088de | [
"MIT"
] | null | null | null | import math
for a in range(1,1000):
for b in range(1,1000):
c = math.sqrt(a**2 + b**2)
if a+b+c == 1000:
print(f"a = {a}, b = {b}, c = {c}")
print(f"Product = {a*b*c}")
break
| 18.692308 | 47 | 0.399177 | 41 | 243 | 2.365854 | 0.414634 | 0.061856 | 0.164948 | 0.247423 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.111888 | 0.411523 | 243 | 12 | 48 | 20.25 | 0.566434 | 0 | 0 | 0 | 0 | 0 | 0.17284 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.125 | 0 | 0.125 | 0.25 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
9884ae84f1bd7e4d35477bdce9fa8d2fe4d17e8a | 404 | py | Python | app_handlers/thread_invitations_handler.py | kskarbinski/threads-api | c144c1cb51422095922310d278f80e4996c10ea0 | [
"MIT"
] | null | null | null | app_handlers/thread_invitations_handler.py | kskarbinski/threads-api | c144c1cb51422095922310d278f80e4996c10ea0 | [
"MIT"
] | null | null | null | app_handlers/thread_invitations_handler.py | kskarbinski/threads-api | c144c1cb51422095922310d278f80e4996c10ea0 | [
"MIT"
] | null | null | null | from app_data.threads import threads_invitations
from app_utils.helpers.pagination import Paginate
class ThreadInvitationsHandler(object):
def get(self, thread_id, start, limit):
paginated_thread_invitation_models = Paginate(
start=start,
limit=limit,
resource=threads_i... | 28.857143 | 54 | 0.717822 | 43 | 404 | 6.465116 | 0.581395 | 0.05036 | 0.179856 | 0.223022 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.225248 | 404 | 13 | 55 | 31.076923 | 0.888179 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.1 | false | 0 | 0.2 | 0 | 0.5 | 0 | 0 | 0 | 0 | null | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
98906359d194fe7f0e5215eea64f8da538c6f81e | 3,247 | py | Python | incomepropertyevaluatorkit/pdf/pdfdocgen.py | MikaSoftware/py-incomepropertyevaluatorkit | f1a05effc80d328c90f7f27ed9b1a6d82492f9d2 | [
"BSD-2-Clause"
] | null | null | null | incomepropertyevaluatorkit/pdf/pdfdocgen.py | MikaSoftware/py-incomepropertyevaluatorkit | f1a05effc80d328c90f7f27ed9b1a6d82492f9d2 | [
"BSD-2-Clause"
] | null | null | null | incomepropertyevaluatorkit/pdf/pdfdocgen.py | MikaSoftware/py-incomepropertyevaluatorkit | f1a05effc80d328c90f7f27ed9b1a6d82492f9d2 | [
"BSD-2-Clause"
] | null | null | null | # -*- coding: utf-8 -*-
import os, sys
from xhtml2pdf import pisa
from incomepropertyevaluatorkit.foundation.constants import *
from incomepropertyevaluatorkit.foundation.utils import *
from incomepropertyevaluatorkit.pdf.evaluatorfileformat import *
class PDFDocGen:
"""
Class will take financial information ... | 37.755814 | 93 | 0.568217 | 366 | 3,247 | 4.852459 | 0.39071 | 0.030968 | 0.025338 | 0.035473 | 0.160473 | 0.118243 | 0.118243 | 0.096847 | 0.096847 | 0.096847 | 0 | 0.002106 | 0.268864 | 3,247 | 85 | 94 | 38.2 | 0.745998 | 0.406221 | 0 | 0.058824 | 0 | 0 | 0.080681 | 0 | 0 | 0 | 0 | 0 | 0.058824 | 1 | 0.205882 | false | 0 | 0.147059 | 0 | 0.411765 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
98931061087615c4677fbd7e3e2ae092060d7010 | 3,320 | py | Python | Picturedom/Picturedom/photo/migrations/0001_initial.py | Azzarox/Picturedom | 69d1b77dcdd89d63b12c7c56e25d43955d906b98 | [
"MIT"
] | null | null | null | Picturedom/Picturedom/photo/migrations/0001_initial.py | Azzarox/Picturedom | 69d1b77dcdd89d63b12c7c56e25d43955d906b98 | [
"MIT"
] | null | null | null | Picturedom/Picturedom/photo/migrations/0001_initial.py | Azzarox/Picturedom | 69d1b77dcdd89d63b12c7c56e25d43955d906b98 | [
"MIT"
] | null | null | null | # Generated by Django 3.2.6 on 2021-08-02 07:39
import Picturedom.core.validators
from django.conf import settings
import django.core.validators
from django.db import migrations, models
import django.db.models.deletion
import django.utils.timezone
class Migration(migrations.Migration):
initial = True
depen... | 44.266667 | 185 | 0.621386 | 341 | 3,320 | 5.885631 | 0.255132 | 0.03986 | 0.06278 | 0.098655 | 0.62282 | 0.561036 | 0.528151 | 0.528151 | 0.528151 | 0.528151 | 0 | 0.008032 | 0.25 | 3,320 | 74 | 186 | 44.864865 | 0.797992 | 0.013554 | 0 | 0.522388 | 1 | 0 | 0.078216 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.089552 | 0 | 0.149254 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
989822480776b93a7028bfeea05c29dbff951804 | 361 | py | Python | gcp/modules/locust/tasks/preferences.py | JavierJF/gpii-infra | 3a8c29e954af6b25f9eec27372a54f536d5661a1 | [
"BSD-3-Clause"
] | 2 | 2018-04-05T10:12:31.000Z | 2019-03-18T21:16:23.000Z | gcp/modules/locust/tasks/preferences.py | JavierJF/gpii-infra | 3a8c29e954af6b25f9eec27372a54f536d5661a1 | [
"BSD-3-Clause"
] | 4 | 2018-09-13T19:32:35.000Z | 2018-09-30T19:11:03.000Z | gcp/modules/locust/tasks/preferences.py | mrtyler/gpii-infra | f156cd463e2e5d55bcea6d0577ab4f61a7eea6d5 | [
"BSD-3-Clause"
] | null | null | null | from locust import HttpLocust, TaskSet, task
import random
class PreferencesTasks(TaskSet):
_keys = ["carla", "vladimir", "wayne", "omar", "nvda"]
@task
def get_pref_by_key(self):
self.client.get("/preferences/" + random.choice(self._keys))
class PreferencesWarmer(HttpLocust):
task_set = PreferencesT... | 21.235294 | 66 | 0.717452 | 44 | 361 | 5.704545 | 0.704545 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.026316 | 0.157895 | 361 | 16 | 67 | 22.5625 | 0.799342 | 0 | 0 | 0 | 0 | 0 | 0.108033 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.090909 | false | 0 | 0.181818 | 0 | 0.818182 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 |
989924b172396e77d3d72035f6c68bc4ab3d5431 | 317 | py | Python | tests/main.py | statmlben/tab-data | 2c669c67a7cf2f35f5383084a387453bbf996567 | [
"MIT"
] | null | null | null | tests/main.py | statmlben/tab-data | 2c669c67a7cf2f35f5383084a387453bbf996567 | [
"MIT"
] | null | null | null | tests/main.py | statmlben/tab-data | 2c669c67a7cf2f35f5383084a387453bbf996567 | [
"MIT"
] | null | null | null | import numpy as np
import pandas as pd
from sklearn import preprocessing
raw_data = {'patient': [1, 1, 1, 2, 2],
'obs': [1, 2, 3, 1, 2],
'treatment': [0, 1, 0, 1, 0],
'score': ['strong', 'weak', 'normal', 'weak', 'strong']}
df = pd.DataFrame(raw_data, columns = ['patient', 'obs', 'treatment', 'score'])
| 26.416667 | 79 | 0.586751 | 48 | 317 | 3.833333 | 0.520833 | 0.032609 | 0.032609 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.058366 | 0.189274 | 317 | 11 | 80 | 28.818182 | 0.657588 | 0 | 0 | 0 | 0 | 0 | 0.233438 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.375 | 0 | 0.375 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 |
98a039796d33001c0906edfd533b8d0c91b0d7fc | 995 | py | Python | tests/test_utils.py | lparolari/weakvtg | e5d5f738ff0d916da8b31e967aa21f01fb74a906 | [
"RSA-MD",
"Info-ZIP"
] | null | null | null | tests/test_utils.py | lparolari/weakvtg | e5d5f738ff0d916da8b31e967aa21f01fb74a906 | [
"RSA-MD",
"Info-ZIP"
] | null | null | null | tests/test_utils.py | lparolari/weakvtg | e5d5f738ff0d916da8b31e967aa21f01fb74a906 | [
"RSA-MD",
"Info-ZIP"
] | null | null | null | from weakvtg.utils import get_batch_size, percent, pivot, identity, map_dict, expand
def test_get_batch_size():
assert get_batch_size({"id": range(10), "foo": range(100), "bar": "hello"}) == 10
def test_percent():
assert percent(0) == 0
assert percent(54) == 5400
def test_pivot():
out = pivot([{"a... | 23.690476 | 93 | 0.6 | 166 | 995 | 3.445783 | 0.343373 | 0.073427 | 0.062937 | 0.045455 | 0.08042 | 0.08042 | 0.08042 | 0 | 0 | 0 | 0 | 0.064103 | 0.21608 | 995 | 41 | 94 | 24.268293 | 0.669231 | 0 | 0 | 0 | 0 | 0 | 0.118593 | 0 | 0 | 0 | 0 | 0 | 0.4 | 1 | 0.32 | false | 0 | 0.08 | 0.08 | 0.4 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
98a140c602f509d8f647fb003b42f1763c7d081a | 5,600 | py | Python | flog/plugins/projects/__init__.py | jedahu/flog | cf2606e31fcf354f900f57fe37b81655e46b86e8 | [
"0BSD"
] | null | null | null | flog/plugins/projects/__init__.py | jedahu/flog | cf2606e31fcf354f900f57fe37b81655e46b86e8 | [
"0BSD"
] | null | null | null | flog/plugins/projects/__init__.py | jedahu/flog | cf2606e31fcf354f900f57fe37b81655e46b86e8 | [
"0BSD"
] | null | null | null | import asciicode
import asciidoc
import flask
import mimetypes
import os
import urlparse
from StringIO import StringIO
from flog.mime import mimetype
TEXT_MIMES = set([
'application/javascript'
])
class Plugin:
def __init__(self, app, conf):
self.app = app
self.root = conf['root']
self.text_mimes = ... | 35.897436 | 98 | 0.633214 | 753 | 5,600 | 4.548473 | 0.196547 | 0.028613 | 0.032117 | 0.011387 | 0.235328 | 0.232409 | 0.219562 | 0.14073 | 0.14073 | 0.115037 | 0 | 0.005955 | 0.220357 | 5,600 | 155 | 99 | 36.129032 | 0.778516 | 0 | 0 | 0.098592 | 0 | 0 | 0.101429 | 0.007679 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.056338 | null | null | 0.007042 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
98a41c7fc9df412ca9c239a00b4f3be7da84317a | 6,596 | py | Python | code/drf_template/settings/base.py | ChouBaoDxs/django-rest-framework-template | d17a884ca8ae921a67abda1e35c41e84614f24e2 | [
"MIT"
] | 2 | 2021-04-02T15:29:13.000Z | 2021-05-31T11:31:09.000Z | code/drf_template/settings/base.py | ChouBaoDxs/django-rest-framework-template | d17a884ca8ae921a67abda1e35c41e84614f24e2 | [
"MIT"
] | 1 | 2021-08-03T06:07:17.000Z | 2021-08-03T07:20:40.000Z | code/drf_template/settings/base.py | ChouBaoDxs/django-rest-framework-template | d17a884ca8ae921a67abda1e35c41e84614f24e2 | [
"MIT"
] | null | null | null | """
Django settings for drf_template project.
Generated by 'django-admin startproject' using Django 2.2.7.
For more information on this file, see
https://docs.djangoproject.com/en/2.2/topics/settings/
For the full list of settings and their values, see
https://docs.djangoproject.com/en/2.2/ref/settings/
"""
import ... | 27.949153 | 113 | 0.605822 | 685 | 6,596 | 5.708029 | 0.350365 | 0.026087 | 0.030691 | 0.032225 | 0.29821 | 0.277494 | 0.213043 | 0.190026 | 0.140921 | 0.05601 | 0 | 0.020635 | 0.235901 | 6,596 | 235 | 114 | 28.068085 | 0.755159 | 0.169345 | 0 | 0.202381 | 1 | 0.005952 | 0.457615 | 0.261101 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0.035714 | 0.011905 | 0 | 0.011905 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
98a7291a8bb62cc4a06e00958352a1fdfdae9fd2 | 443 | py | Python | code/NLPCode/TISP/utils/__init__.py | andrewsu/RTX | dd1de262d0817f7e6d2f64e5bec7d5009a3a2740 | [
"MIT"
] | 31 | 2018-03-05T20:01:10.000Z | 2022-02-01T03:31:22.000Z | code/NLPCode/TISP/utils/__init__.py | andrewsu/RTX | dd1de262d0817f7e6d2f64e5bec7d5009a3a2740 | [
"MIT"
] | 1,774 | 2018-03-06T01:55:03.000Z | 2022-03-31T03:09:04.000Z | code/NLPCode/TISP/utils/__init__.py | andrewsu/RTX | dd1de262d0817f7e6d2f64e5bec7d5009a3a2740 | [
"MIT"
] | 19 | 2018-05-10T00:43:19.000Z | 2022-03-08T19:26:16.000Z | """Utility functions/classes for Type-driven Incremental Semantic Parser
This module only contains:
Singleton: the base class for singleton pattern
timeout: function used as a decorator that forces the decorated function to terminate
after given time.
Timeout: a class used for error passing
"""
__author_... | 22.15 | 85 | 0.774266 | 57 | 443 | 5.877193 | 0.701754 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.1693 | 443 | 19 | 86 | 23.315789 | 0.910326 | 0.679458 | 0 | 0 | 0 | 0 | 0.156716 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.5 | 0 | 0.5 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 |
98a9cd9e3cdcc0c538ea63d1ade304c8a921a9ad | 3,092 | py | Python | experimental/scratch/mmp_testing.py | Arun-Niranjan/pymdp | 2f7ca7e90254f0ea26f6ceb947f3b45280d18307 | [
"MIT"
] | null | null | null | experimental/scratch/mmp_testing.py | Arun-Niranjan/pymdp | 2f7ca7e90254f0ea26f6ceb947f3b45280d18307 | [
"MIT"
] | null | null | null | experimental/scratch/mmp_testing.py | Arun-Niranjan/pymdp | 2f7ca7e90254f0ea26f6ceb947f3b45280d18307 | [
"MIT"
] | 1 | 2021-08-16T08:25:55.000Z | 2021-08-16T08:25:55.000Z | # %%
import sys
import pathlib
import numpy as np
import copy
from scipy.io import loadmat
import os
sys.path.append(str(pathlib.Path(__file__).parent.parent.parent))
from pymdp.distributions import Categorical, Dirichlet
from pymdp import core
# %% define some auxiliary functions that help generate likelihoods and o... | 28.109091 | 183 | 0.637128 | 497 | 3,092 | 3.812877 | 0.261569 | 0.034829 | 0.02533 | 0.021108 | 0.107124 | 0.073879 | 0.073879 | 0.073879 | 0.034829 | 0 | 0 | 0.024979 | 0.223157 | 3,092 | 109 | 184 | 28.366972 | 0.763947 | 0.111578 | 0 | 0.095238 | 0 | 0.015873 | 0.047228 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.126984 | null | null | 0.047619 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
98acecbdef3142c8153553f950bf1c1d29e295e6 | 6,550 | py | Python | plots/plots.py | Peniac/NSE-CSC | 7bb313b59f3b92c1349b03bc11e8fb17512e1518 | [
"Apache-2.0"
] | null | null | null | plots/plots.py | Peniac/NSE-CSC | 7bb313b59f3b92c1349b03bc11e8fb17512e1518 | [
"Apache-2.0"
] | null | null | null | plots/plots.py | Peniac/NSE-CSC | 7bb313b59f3b92c1349b03bc11e8fb17512e1518 | [
"Apache-2.0"
] | null | null | null | import pickle
import numpy as np
import pandas as pd
import matplotlib
import matplotlib.pyplot as plt
from pylab import *
import seaborn as sns
sns.set()
sns.set_style("whitegrid")
flatui = ['#009ADE','#FF1F5B']
sns.set_palette(flatui)
# black edges around all figures
rc('axes', linewidth=1, edgecolor=... | 43.959732 | 125 | 0.692366 | 1,137 | 6,550 | 3.933157 | 0.151275 | 0.04025 | 0.044275 | 0.072451 | 0.706843 | 0.677326 | 0.661673 | 0.624553 | 0.620975 | 0.620975 | 0 | 0.04725 | 0.114656 | 6,550 | 148 | 126 | 44.256757 | 0.723918 | 0.067328 | 0 | 0.316667 | 0 | 0.15 | 0.350715 | 0.21783 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.058333 | 0 | 0.058333 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
98adb572ba7ebcb055fb94ef3b3ff5423e6b685d | 937 | py | Python | apps/crawling/models.py | rangertaha/newslytics | 204561507816c5daf3b8c5b89afd56d487b23311 | [
"MIT"
] | null | null | null | apps/crawling/models.py | rangertaha/newslytics | 204561507816c5daf3b8c5b89afd56d487b23311 | [
"MIT"
] | null | null | null | apps/crawling/models.py | rangertaha/newslytics | 204561507816c5daf3b8c5b89afd56d487b23311 | [
"MIT"
] | null | null | null | # -*- coding: utf-8 -*-
from __future__ import unicode_literals
from django.db import models
from ..domains.models import Domain
class Crawl(models.Model):
TYPE_CHOICES = (
('article', 'Article'),
('feed:urls', 'Feed URLs'),
('feed:entries', 'Feed Entries'),
)
otype = models.Char... | 29.28125 | 67 | 0.667022 | 113 | 937 | 5.362832 | 0.460177 | 0.089109 | 0.085809 | 0.112211 | 0.09571 | 0.09571 | 0.09571 | 0 | 0 | 0 | 0 | 0.007968 | 0.196371 | 937 | 32 | 68 | 29.28125 | 0.796813 | 0.022412 | 0 | 0.086957 | 0 | 0 | 0.065574 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.086957 | false | 0 | 0.130435 | 0.086957 | 0.782609 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 1 |
98b39457bca2e5ed9d47d5a479049a54dd8cbbe5 | 995 | py | Python | app/routers/auth.py | AKASHCS50/FastAPI | 2adf498c4b024a5b23710d509700128bafa36941 | [
"MIT"
] | 1 | 2021-11-12T11:42:52.000Z | 2021-11-12T11:42:52.000Z | app/routers/auth.py | AKASHCS50/FastAPI | 2adf498c4b024a5b23710d509700128bafa36941 | [
"MIT"
] | null | null | null | app/routers/auth.py | AKASHCS50/FastAPI | 2adf498c4b024a5b23710d509700128bafa36941 | [
"MIT"
] | null | null | null | from fastapi import status, HTTPException, Depends, APIRouter
from fastapi.security.oauth2 import OAuth2PasswordRequestForm
from .. import schemas, models, utils, oauth2
from sqlalchemy.orm.session import Session
from ..database import get_db
router = APIRouter(tags=["Authentication"])
@ router.post("/login", respo... | 39.8 | 86 | 0.732663 | 122 | 995 | 5.836066 | 0.467213 | 0.061798 | 0.067416 | 0.078652 | 0.210674 | 0.210674 | 0.210674 | 0.210674 | 0.210674 | 0.210674 | 0 | 0.013158 | 0.159799 | 995 | 24 | 87 | 41.458333 | 0.838517 | 0.01809 | 0 | 0.235294 | 0 | 0 | 0.095385 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0.058824 | false | 0.176471 | 0.294118 | 0 | 0.411765 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 1 |
98b7f304ac5bec6fc0952eb773a40e50bcbcd250 | 486 | py | Python | web-app/manage.py | sandbernar/corona-prod | c296af4934c9e70ce56ccdb23c5998e2d8418cab | [
"MIT"
] | null | null | null | web-app/manage.py | sandbernar/corona-prod | c296af4934c9e70ce56ccdb23c5998e2d8418cab | [
"MIT"
] | null | null | null | web-app/manage.py | sandbernar/corona-prod | c296af4934c9e70ce56ccdb23c5998e2d8418cab | [
"MIT"
] | null | null | null | import os
from flask_script import Manager
from flask_migrate import Migrate, MigrateCommand
from config import config_dict
from run import app, db
from dotenv import load_dotenv
load_dotenv()
get_config_mode = os.environ.get('CONFIG_MODE', 'Debug')
config_mode = config_dict[get_config_mode.capitalize()]
app.config... | 21.130435 | 56 | 0.788066 | 70 | 486 | 5.142857 | 0.371429 | 0.138889 | 0.108333 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0.119342 | 486 | 22 | 57 | 22.090909 | 0.841122 | 0 | 0 | 0 | 0 | 0 | 0.053498 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | false | 0 | 0.4 | 0 | 0.4 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 1 |
98b82b394ec37008b35ef6c10e4fba54b1516edd | 2,303 | py | Python | examples/double_it_lowlevel/double_it_lowlevel.py | 01org/pyMIC | f775239a208dc1daaf89451af06e0138b80099e9 | [
"BSD-3-Clause"
] | 38 | 2015-01-15T05:24:20.000Z | 2017-07-12T08:03:44.000Z | examples/double_it_lowlevel/double_it_lowlevel.py | 01org/pyMIC | f775239a208dc1daaf89451af06e0138b80099e9 | [
"BSD-3-Clause"
] | 15 | 2015-02-17T12:04:50.000Z | 2017-01-13T06:26:17.000Z | examples/double_it_lowlevel/double_it_lowlevel.py | 01org/pyMIC | f775239a208dc1daaf89451af06e0138b80099e9 | [
"BSD-3-Clause"
] | 16 | 2015-02-17T01:00:30.000Z | 2017-09-23T03:52:40.000Z | #!/usr/bin/python
# Copyright (c) 2014-2016, Intel Corporation All rights reserved.
#
# Redistribution and use in source and binary forms, with or without
# modification, are permitted provided that the following conditions are
# met:
#
# 1. Redistributions of source code must retain the above copyright
# notice, this... | 39.033898 | 74 | 0.785497 | 348 | 2,303 | 5.163793 | 0.502874 | 0.020033 | 0.01892 | 0.025598 | 0.102393 | 0.075682 | 0.075682 | 0.075682 | 0.075682 | 0.075682 | 0 | 0.009734 | 0.15241 | 2,303 | 58 | 75 | 39.706897 | 0.910861 | 0.758576 | 0 | 0.2 | 0 | 0 | 0.045977 | 0.045977 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0 | 0.133333 | null | null | 0.066667 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
98b8788661368a40c6912e08d6bf82d4714a56d9 | 15,320 | py | Python | isip/packet.py | TheRipperJhon/Isip | fad1f10b02f9e075451588cc6a18a46cc5fbd66b | [
"MIT"
] | 60 | 2017-12-01T14:46:01.000Z | 2022-02-22T19:17:42.000Z | isip/packet.py | TheRipperJhon/Isip | fad1f10b02f9e075451588cc6a18a46cc5fbd66b | [
"MIT"
] | null | null | null | isip/packet.py | TheRipperJhon/Isip | fad1f10b02f9e075451588cc6a18a46cc5fbd66b | [
"MIT"
] | 16 | 2018-11-05T13:21:30.000Z | 2021-04-26T17:36:30.000Z | # The MIT License (MIT)
# Copyright (c) 2014 Halit Alptekin
#
# Permission is hereby granted, free of charge, to any person obtaining a copy
# of this software and associated documentation files (the "Software"), to deal
# in the Software without restriction, including without limitation the rights
# to use, copy, modi... | 42.793296 | 109 | 0.574021 | 1,843 | 15,320 | 4.59414 | 0.129137 | 0.052085 | 0.044171 | 0.024094 | 0.626904 | 0.598559 | 0.514704 | 0.466163 | 0.409354 | 0.409354 | 0 | 0.004572 | 0.314752 | 15,320 | 357 | 110 | 42.913165 | 0.801962 | 0.070235 | 0 | 0.585551 | 0 | 0 | 0.149337 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | null | 0.038023 | 0.015209 | null | null | 0.060837 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | null | 0 | 0 | 0 | 0 | 1 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.