prompt stringlengths 189 761 | answer stringclasses 2
values |
|---|---|
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1C2(O)CC34CC(=O)OC3(CC(O)C4C)C1(C)CO2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1N=C(Nc2ccccc2)C(=Nc2ccccc2)N1c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)Oc1c2occc2cc2ccc(=O)oc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Nc1c(Cl)cccc1-c1c[nH]cc1Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#Cc1c2c(c(N)oc1=O)C(c1ccccc1)CC(=O)N2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(CC2NCCc3cc(OC)c(OC)cc32)cc1Br
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1cc2c(c(OC)c1OC)-c1ccc(SC)c(=O)cc1C(NC=O)CC2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1cccc(C=NN=Cc2cccc(OC)c2O)c1O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=Nc1c(N=O)c(N=O)c(N=O)c(N=O)c1N=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCC(=O)OC(C)CC1SCCCS1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C[PH](C)(C)[Ir-3]1([PH](C)(C)C)([PH](C)(C)C)NC(c2c[nH]c3ccccc23)C(=O)[OH+]1.[Cl-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC1OC(CO[Si](C)(C)C(C)(C)C)C(O)CC1n1ccc(=O)[nH]c1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)(Cc1ccccc1)NC1=NCCO1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=S1(=O)C2C=CCC1C(c1ccccc1)CC2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CN1CCC23c4c5ccc(O)c4OC2C(=NN=C2CCC4(O)C6Cc7ccc(O)c8c7C4(CCN6C)C2O8)CCC3(O)C1C5
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=NNC(=O)C[N+](C)(C)C)C(CN(C)C)C(=O)Nc1ccccc1.[Cl-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCN1C(=O)C(C)SC1=NNC(=O)CSc1nc2ccccc2c(=O)n1CC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C(=NOCc1ccccc1)c1ncccc1C1OCCO1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(CC(=O)N(C)C(CC(C)C(Cl)(Cl)Cl)c1nccs1)C(Cl)Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCC1(O)CC2CN(CCc3c([nH]c4ccccc34)C(C(=O)OC)(c3cc4c(cc3OC)N(C)C3C5(OCOC5=O)C(O)C5(CC)C=CCN6CCC43C65)C2)C1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cccc2c1CC(Cc1ccccc1C(=O)O)C2=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Fc1ccc(Oc2nc3ccccc3nc2-c2ccccc2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N=C1N(c2ccccc2)C(=S)C(=Nc2ccccc2)N1c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)c1ccc2c(c1)CC1(C2)Cc2ccc3c(c2C1)CCC3
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=C1C(=O)OC2CC(C)C3(O)C=C(C(C)=O)C4(OC3CC12)C(=O)OC1CC(C)C(C=CC(C)=O)=CCC14
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)OCC1OC(c2nc3ccccc3s2)=CC(OC(C)=O)C1OC(C)=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CN(C)CCS
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: S=C1NC(c2ccc(Cl)cc2)N2C(=S)NC(c3ccc(Cl)cc3)N12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: OC(Cc1ccc2ccccc2n1)(C(F)(F)Cl)C(F)(F)Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)c1cccc(C)c1C1CN=NC12Cc1cc(C)cc(C)c1C2=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(OCCN=C1c2ccccc2CCc2ccccc21)c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C1=C(C(=O)OC)C2(C3C(SC)=CC(C)(C)CC3S1)N(Cc1ccccc1)CCN2Cc1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C(CCC[Te][Te]CCCCCCOC1CCCCO1)CCOC1CCCCO1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=c1[nH][nH]c(=O)n1CCCCCCn1c(=O)[nH][nH]c1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=CCCCCCCCCCP(=O)(c1ccccc1)c1ccc2c(c1)OCCOCCOCCOCCO2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=S(=O)(c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1(C)SC2C(NC(=O)C3(N)CCCCC3)C(=O)N2C1C(=O)O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(O)CNC(=O)Cn1[se]c2ccccc2c1=O
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#Cc1cc2c(n(C3OC(CO)C(O)C(O)C3O)c1=S)CCCC2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCC(c1nc2ccccc2c(=O)n1NC(=O)C(C)(C)C)C1(O)CCCCC1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC1=NC(C(F)(F)F)(C(F)(F)F)N=C(N2CCCCC2)O1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(C=Cc2cc(OC)c(OC)c(OC)c2)cc1OC(=O)CCC(=O)O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1N=NC([S-])=NC1=O.[Cl-].[Pt]
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCN(CC)Cc1cc(O)c(CN(CC)CC)cc1O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)(C)N1C(=O)N[N+]2(CCCCC2)C1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccccc1C1c2cc3c(cc2OC(N2CCOCC2)C1C)OCO3
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: NCCCNCCSSCCNCCCN.O=P(O)(O)O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cn1c2ccccc2c(=O)c2c(O)cc3c(c21)C=CC1(CCCC1)O3
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)N(c1ccccc1)N(CC)C(=O)C(C)=NNc1ccc([N+](=O)[O-])cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cc(NS(=O)(=O)c2ccc(N=Nc3cc(S(=O)(=O)O)c4ccccc4c3O)cc2)ccc1N=Nc1ccc2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2c1
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)C(=CNC(N)=S)C(=O)Nc1ccc(Cl)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C1=CC2CCC1C1CN(CCCN3CCOCC3)CC21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)c1c(SCc2cc(O)nc(O)n2)n(-c2ccccc2)c(=S)n(-c2ccccc2)c1=O
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCc1cc(=O)oc2c3c(cc(OS(=O)(=O)c4ccc(C)cc4)c12)OC(C)C(C)C3=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc2nc3ccccc3c(NCCCN(C)CCCl)c2c1.Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#CC(NC12CC3CC(CC(C3)C1)C2)c1ccccc1C(F)(F)F
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CN(C(=O)C12C3C4C5C3C1(C(=O)C13C6C7C8C6C1C8C73)C5C42)C(C)(C)C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOP(=O)(OCC)C(=Cc1ccccc1)P(=O)(OCC)OCC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cl.O=C1Oc2ccccc2C(=O)C1=CNc1nc(-c2ccccc2)cs1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Nc1onc2c1Cc1c(noc1N)-c1ccccc1-2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCCCCCCCCCCCCCCOP(=O)(O)OP(=O)(O)OCC1OC(n2ccc(=N)[nH]c2=O)C(O)C1O.[NaH]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)NCCCCNCCCNC(C)=O.Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1=C(C)C2(OC1=O)C(O)C(C)C1(O)CCC3C4CC=C5CC=CC(=O)C5(C)C4CC2(O)C31C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)(C)[Si](C)(C)OC1C(C=NO)OC(n2ccc(=O)[nH]c2=O)C1O[Si](C)(C)C(C)(C)C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCCc1ccc(N2C(=O)c3cc(C)cnc3S2(=O)=O)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(OCC(F)([N+](=O)[O-])[N+](=O)[O-])OCC(F)([N+](=O)[O-])[N+](=O)[O-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: c1ccc2c(c1)oc1cc3c(cc12)nnc1cccn13
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCN(C(=O)c1ccccc1C)C(c1ccccc1)P(=O)(c1ccccc1)c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: NC1CCCC2CCC(N)C12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)NC(C)(C)C1CCC(C)=C(c2ccccc2)C1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=c1[nH]n2c(=O)cc[nH]c2c1-c1nnns1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)CC1(CNC(=O)OCc2ccccc2)OCCO1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CSc1nc(SC)c2nc(Nc3ccccc3)sc2n1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1C(c2ccccc2)OCN1CC=C(c1ccsc1)c1ccsc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC12OCCN(CCO)C1=CC(=O)C1(C)N=NC(C)C12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)=CCCC(C)C1=C(O)C(O)C(C)=C2N=C(c3ccccc3)C(=O)OC21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC[P+]1(c2ccccc2)C(C)CCC1C.[I-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C(=C(C)c1ccco1)P(=O)(OC)OC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#CC(=Cc1ccc(O)c(O)c1)C(=O)OCc1ccccc1COC(=O)C(C#N)=Cc1ccc(O)c(O)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)Nc1cc(N=Nc2ccc(N=Nc3ccc(NC(=O)c4ccc(N)cc4)cc3C)cc2C)c(S(=O)(=O)O)cc1N=Nc1cccc(C(=O)O)c1
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=CCC(C)(O)CCC(O)(CC=C)CC=C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccccc1N=NC1=C2Nc3ccccc3N=C1N(c1ccccc1OC)C(=S)N2c1ccccc1C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1cc2c(c(OC)c1OC)C(c1ccc3c(c1)OCO3)C1COC(=O)C1C2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCN1c2ccccc2-n2c(C)nnc2-c2c(-c3ccccc3)n[nH]c21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1nc2c(=O)[nH]c(=O)nc-2n(CCO)c1C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOP(=O)(OCC)C(C)(C)OC(=O)NC(F)(F)F
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C[N+]12CC3C4CC(C3C1)C2C4
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#CC12C(=O)NC(=N)C1(C#N)C(c1ccco1)NC1=C2CCCC1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CSC(SC)=C1CC(=O)Nc2ccccc2C1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)CC(CC(=O)C(=O)OC)C(=O)OC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1C(=Cc2cccc(Oc3ccccc3)c2)SC(c2ccccc2)N1c1cccc([N+](=O)[O-])c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)OCC1(C)C(N(C)C)CCC23CC24CCC2(C)C(C(C)N(C)C)C(O)CC2(C)C4C=CC13
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: FC(F)(F)C1(C(F)(F)F)OC(Cl)(Cl)C(Cl)(Cl)O1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=CCOCc1cc2c(cc1Br)OCO2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Br.CCN1CCC(O)(c2ccccc2)C(C(=O)c2ccccc2)C1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1c(Cc2ccccc2)n(COCCCN2C(=O)c3ccccc3C2=O)c(=O)[nH]c1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOc1ccccc1NC(=O)C(=NNC(C)(C)C)C1C(=O)Nc2ccccc2S1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1CCC(C(=O)N2CSCC2C(=O)O)N1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: NNC(=O)c1nn[nH]c1C(=O)NN
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=[N+]([O-])C(F)(CCNCC(F)([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-]
| Yes |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.