prompt stringlengths 189 761 | answer stringclasses 2 values |
|---|---|
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)c1cc(C)ccc1CC(Cc1cccc(C)c1)C(=O)OC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)OC12CCCCCC1C1(O)C(O)CCCC21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=c1[nH]c(=O)n(C2CC(O)C(CO)O2)c2nc3ccc4ccccc4c3nc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)C(=Cc1cccc(C#N)c1)C(=O)OCC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(C=Cc2ccc3ccccc3n2)c(OC)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Br.CCN(CC)CCN(C)CCc1ccc(Br)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(O)CCCC[PH](c1ccccc1)(c1ccccc1)c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1cc2c(c(OC)c1OC)C(=O)C(O)C2N.Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)c1nc2c(C)c(O)c(O)c(C(C)CCC=C(C)C)c2o1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cl.Cn1cc(NC(=O)c2cc(NC(=O)C3CCC(=N)N3)c[nH]2)cc1C(=O)NCCC(=N)N
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(C=C2N=C(NN=CC(O)C(O)C(O)CO)NC2=O)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)NNc1nc(C)c(C(=O)NNC(=O)C(=O)Nc2c(C)cccc2C(C)C)s1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(N)=[N+](C)[O-].Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1(C)c2ccccc2C(=O)C1(Br)Cc1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)C1C(=O)C(=O)N2CCc3c([nH]c4ccccc34)C12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)C1=C2SCCN2C(=O)CC1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)C(=Cc1ccc(C(=O)OC)cc1)N(CC)CC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)=CCCC(C)C1=C(O)C(=O)C(C)=C(Nc2ccccc2Cl)C1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1(C)CC(C2=NCCO2)CC(C)(C)N1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC12CCC3C(CCC4CC(OC(=O)Cc5ccc(N(CCCl)CCCl)cc5)CCC43C)C1CCC(=O)N2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)c1ccc(COC(=O)N2C=CCC2C(=O)O)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1c(N)c(C#N)c2n(C)c3ncccc3n2c1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=NNC(=S)Nc1ccc([N+](=O)[O-])cc1)c1cccc(C(C)=NNC(=S)Nc2ccc([N+](=O)[O-])cc2)n1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cc(NC(=O)c2ccc(NC(=O)c3ccccc3)cc2)ccc1N=Nc1ccc(N=Nc2ccc3c(O)cc(S(=O)(=O)O)cc3c2)c2cc(S(=O)(=O)O)ccc12
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(O)c1n[nH]c(O)c1N=Nc1ccc(C=Cc2ccc(N=Nc3c(C(=O)O)n[nH]c3O)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1.[NaH]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1(C)OC(CP(c2ccc3ccccc3c2)c2ccc3ccccc3c2)C(CP(c2ccc3ccccc3c2)c2ccc3ccccc3c2)O1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOP(=O)(CC(=O)C1CC1)OCC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C=O)=Cc1ccc(F)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(NCCCl)c1cc(C(F)(F)F)cc(C(F)(F)F)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1cc2ccc(C(=O)O)cc2cc1OC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: NC(=S)NN=C1CCCCc2ccccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1csc(C2CCC3C4CC=C5CC(OC(C)=O)CCC5(C)C4CCC23C)n1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)C1OCC(CO)CO1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCCn1[nH]c(=O)ccc1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1C=C(CCC2=CC(=O)c3ccccc3C2=O)C(=O)c2ccccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#Cc1c(-c2ccc(Cl)cc2Cl)nc2[nH][nH]c(=S)n2c1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Nc1c(-c2ccccc2)oc2ccccc2c1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cc(C(=O)O)c(C)cc1SSc1cc(C)c(C(=O)O)cc1C
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cc(NS(=O)(=O)c2ccc(Nc3c4ccccc4nc4c(C(=O)Nc5ccc(S(=O)(=O)NC(=N)N)cc5)cccc34)cc2)no1
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)C(C(=O)N(C)C(Cc1ccccc1)C(=O)N(C)C(C(=O)N(C)C(C(=O)N1CCCC1C(=O)OC(C)(C)C)C(C)C)C(C)C)N(C)C
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(C=C2SC(c3ccc(OC)cc3)N(NC(=O)Cc3ccccc3)C2=O)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(CCC(=O)O)C1CCC2C3C(=O)CC4CC(O)CCC4(C)C3CCC12C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(CCc1cccc(O)c1)NCCCNC(=O)CCc1cccc(O)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(C(C(N)=O)N(C)C)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cc(C)nc(NC(P(=O)(O)O)P(=O)(O)O)n1.[NaH]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: S=c1nnn(C2CCCN2)[nH]1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCCCCCCCC1(N=[N+]=[N-])C(=O)c2ccccc2N(C)C1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1(O)CC2C(CC1SCc1ccccc1)C2(C)C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1nc(OC)nc(Sc2ccc(Sc3ccc(Sc4nc(OC)nc(OC)n4)cc3)cc2)n1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)CNC(=O)C(C)NC(=O)C(NC(=O)OCc1ccccc1)C(C)C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCN(CCC)C(=O)COc1cc2c(O)c3c(O)c(C)c4c(c13)C(=O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(=O)N2)O4
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1CCC(=Cc2ccc(F)cc2)C2=C1C(c1ccc(F)cc1)n1c(sc(=Cc3ccc(Cl)cc3)c1=O)=N2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(Cc2nnc3nc(OC)c(-c4ccc(OC)cc4)n3n2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N[Pt-2](N)([n+]1ccsc1)[n+]1ccsc1.O=[N+]([O-])[O-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cl.NC(=O)c1cc2ccc(O)c(O)c2cn1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccccc1NC(=O)C(=Cn1c(=S)[nH]c2ccccc21)C(C)=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Nc1ccc(Sc2c3ccccc3nc3ccccc23)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)c1cc(O)ccc1NC(=O)c1ccc(O)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc2c(c1)[n+]([O-])c(C(C)=NNC(=O)c1ccccc1O)c(C)[n+]2[O-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COCC12CCC(OC)C34C5CC6(O)C(OC)C=C(C5C6OC(=O)c5ccccc5)C(C(OC)C13)C4N(C)C2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: c1ccc2nc3c(nc2c1)[nH]c1ccccc13
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#CC(C#N)=C1NC(=O)CC(=O)N1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cc(NS(=O)(=O)c2ccc(Nc3c4ccccc4nc4ccc(C(=O)Nc5ccc(S(N)(=O)=O)cc5)cc34)cc2)no1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cccc(N2C(=O)C=C(NC(CC(C)C)c3nc4ccccc4[nH]3)C2c2ccccc2)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cc(CO)c(O)c(C(=O)CC2CC(=O)NC(=O)C2)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(NNC(=S)Nc1ccc(Cl)cc1)c1cc(-c2ccccc2)nc2ccccc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Nc1cc2c3c(cccc3c1)C(=O)N(CCN1CCCC1)C2=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1cccc(N2C(=O)C3C4C=C5c6ccccc6N(c6ccccc6)C5(C3C2=O)C2C(=O)N(c3cccc(OC)c3)C(=O)C42)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C(C#N)=C1CCc2ccccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C=C(C(=O)OC)c1c(C)c(C)c2c(C)cc(C)cc(C)c1-2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C1Cc2c([nH]c3ccccc23)C(c2ccccc2O)N1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(Cn1c2ccc(Br)cc2c2nc3ccccc3nc21)Nc1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1CCC2(C(=O)O)CCC3(COC(=O)C=Cc4ccc(O)cc4)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)CC(=O)C(=O)NNC1=NCCCN1.I
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCCCCCCCCCCCP(=O)(OC)OC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=C=CC(C)(O)c1ccc(-c2ccccc2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=C1C(=O)C23CC1C(O)C(OC(C)=O)C2C1(C)C(OC(C)=O)CC(OC(C)=O)C(C)(C)C1CC3OC(C)=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#CC1CC12c1ccccc1C(=O)c1ccccc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C(Cc1cn(C(C)=O)c2ccccc12)P(=O)(OC)OC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cn1c(=O)c2nc3c(nc2n(C)c1=O)oc1ccccc13
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=c1[nH]c(=O)n(COC(CO)CO)cc1-c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C1C2CC3c4[nH]c5cc(OC)ccc5c4CCN3CC2CC(OC)C1OC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Clc1ccc2c(c1)[nH]c1c2nc2sccn21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: c1ccc2c(c1)SCCCSCCCS2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(C(=O)C[PH](c2ccccc2)(c2ccccc2)c2ccccc2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)(C)OC(=O)N(CCCCNCc1ccc2ccccc2c1)CCCNCc1ccc2ccccc2c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1(C)CN=C(Nc2ccc(Cl)cc2)S1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cc(N(CCC#N)CCC#N)ccc1C=CC(=O)Nc1cccc(Cl)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1nc(-n2nc(-c3ccccc3)cc2-c2ccccc2)sc1C(C=Cc1ccc([N+](=O)[O-])cc1)=NNC(=S)NN
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)On1c(-c2ccccc2-c2nc3ccccc3n2OC(C)=O)nc2ccccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)C(=O)Nc1nc2ccc(C)cc2s1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccccc1C1(C)SCc2nc3ccccc3n21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(O)C1CCCN1C(=O)c1ccccn1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cccc(C=NC23CC4CC(CC(C4)C2)C3)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(Br)c(C(=O)N2CCc3ccccc32)c1N
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(C=NNc2nnc3c4ccccc4n(C)c3n2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)c1ccc(NCC2=CC(=O)C=CC2=O)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1cc(NC(C)=O)c(OC)cc1Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cn1c(=O)n(CC2CS2)c2ccccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1SS(=O)c2ccccc21
| Yes |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.