prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)CCc1ccccc1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)CC(C)(C)c1ccccc1)C2 | Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)CCc1ccccc1)C2 | Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)CC(C)(C)c1ccccc1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)CC7"
} |
Can you make molecule Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)CCc1ccccc1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)CCC(C)(C)c1ccccc1)C2 | Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)CCc1ccccc1)C2 | Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)CCC(C)(C)c1ccccc1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)CC7"
} |
Can you make molecule Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)CCc1ccccc1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)C[C@H](C)c1ccccc1)C2 | Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)CCc1ccccc1)C2 | Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)C[C@H](C)c1ccccc1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H]&C",
"old_substring": "C4(=O)CC7"
} |
Can you make molecule Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)CCc1ccccc1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)C[C@@H](Br)c1ccccc1)C2 | Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)CCc1ccccc1)C2 | Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)C[C@@H](Br)c1ccccc1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C4(=O)CC7"
} |
Can you make molecule Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)CCc1ccccc1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(SC(=O)[C@@H](C)c1ccccc1)C2 | Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(C(=O)CCc1ccccc1)C2 | Cc1nc2c(c(Nc3ncc(C)s3)n1)CCN(SC(=O)[C@@H](C)c1ccccc1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C4(=O)CC7"
} |
Can you make molecule O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1ccccc1 | O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1cccnc1 | O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c18cccnc1"
} |
Can you make molecule O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1ccc(I)nc1 | O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1cccnc1 | O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1ccc(I)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)nc1",
"old_substring": "c18cccnc1"
} |
Can you make molecule O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1cc2cnsc2s1 | O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1cccnc1 | O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1cc2cnsc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cnsc2s1",
"old_substring": "c18cccnc1"
} |
Can you make molecule O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)NCCNC(=O)N2C[C@H]3CC=CC[C@@H]3C2)c(C)n1 | O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1cccnc1 | Cc1ccc(C(=O)NCCNC(=O)N2C[C@H]3CC=CC[C@@H]3C2)c(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)nc1C",
"old_substring": "c18cccnc1"
} |
Can you make molecule O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1ccncc1Cl | O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1cccnc1 | O=C(NCCNC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1ccncc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c18cccnc1"
} |
Can you make molecule O=c1n(CCO)c2ccccc2n1CCO less soluble in water? The output molecule should be similar to the input molecule. | C=COn1c(=O)n(CCO)c2ccccc21 | O=c1n(CCO)c2ccccc2n1CCO | C=COn1c(=O)n(CCO)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CO&",
"old_substring": "C3CO"
} |
Can you make molecule O=c1n(CCO)c2ccccc2n1CCO less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)n1c(=O)n(CCO)c2ccccc21 | O=c1n(CCO)c2ccccc2n1CCO | CCC(=O)n1c(=O)n(CCO)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&=O",
"old_substring": "C3CO"
} |
Can you make molecule O=c1n(CCO)c2ccccc2n1CCO less soluble in water? The output molecule should be similar to the input molecule. | C=C=COn1c(=O)n(CCO)c2ccccc21 | O=c1n(CCO)c2ccccc2n1CCO | C=C=COn1c(=O)n(CCO)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=C=CO&",
"old_substring": "C3CO"
} |
Can you make molecule O=c1n(CCO)c2ccccc2n1CCO less soluble in water? The output molecule should be similar to the input molecule. | O=c1n(CCO)c2ccccc2n1C1COC1 | O=c1n(CCO)c2ccccc2n1CCO | O=c1n(CCO)c2ccccc2n1C1COC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&COC1",
"old_substring": "C3CO"
} |
Can you make molecule O=c1n(CCO)c2ccccc2n1CCO less soluble in water? The output molecule should be similar to the input molecule. | CCn1c(=O)n(CCO)c2ccccc21 | O=c1n(CCO)c2ccccc2n1CCO | CCn1c(=O)n(CCO)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC&",
"old_substring": "C3CO"
} |
Can you make molecule COC(=O)Cc1csc(NC(=O)Cc2coc3cc(C)ccc23)n1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)Cc1csc(NSC(=O)Cc2coc3cc(C)ccc23)n1 | COC(=O)Cc1csc(NC(=O)Cc2coc3cc(C)ccc23)n1 | COC(=O)Cc1csc(NSC(=O)Cc2coc3cc(C)ccc23)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C5(=O)C8"
} |
Can you make molecule COC(=O)Cc1csc(NC(=O)Cc2coc3cc(C)ccc23)n1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)Cc1csc(NC(=O)CCCC(=O)c2coc3cc(C)ccc23)n1 | COC(=O)Cc1csc(NC(=O)Cc2coc3cc(C)ccc23)n1 | COC(=O)Cc1csc(NC(=O)CCCC(=O)c2coc3cc(C)ccc23)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C5(=O)C8"
} |
Can you make molecule COC(=O)Cc1csc(NC(=O)Cc2coc3cc(C)ccc23)n1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)Cc1csc(NC(=O)CC(C)(C)c2coc3cc(C)ccc23)n1 | COC(=O)Cc1csc(NC(=O)Cc2coc3cc(C)ccc23)n1 | COC(=O)Cc1csc(NC(=O)CC(C)(C)c2coc3cc(C)ccc23)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C5(=O)C8"
} |
Can you make molecule COC(=O)Cc1csc(NC(=O)Cc2coc3cc(C)ccc23)n1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)Cc1csc(NC[S@+]([O-])CCCc2coc3cc(C)ccc23)n1 | COC(=O)Cc1csc(NC(=O)Cc2coc3cc(C)ccc23)n1 | COC(=O)Cc1csc(NC[S@+]([O-])CCCc2coc3cc(C)ccc23)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C5(=O)C8"
} |
Can you make molecule COC(=O)Cc1csc(NC(=O)Cc2coc3cc(C)ccc23)n1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)Cc1csc(NC(=O)CCC(C)(C)c2coc3cc(C)ccc23)n1 | COC(=O)Cc1csc(NC(=O)Cc2coc3cc(C)ccc23)n1 | COC(=O)Cc1csc(NC(=O)CCC(C)(C)c2coc3cc(C)ccc23)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C5(=O)C8"
} |
Can you make molecule Cc1ccc(N2CC[C@@H](NS(=O)(=O)c3ccccc3C)C2=O)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CCS[C@@H](NS(=O)(=O)c3ccccc3C)C2)cc1C | Cc1ccc(N2CC[C@@H](NS(=O)(=O)c3ccccc3C)C2=O)cc1C | Cc1ccc(N2CCS[C@@H](NS(=O)(=O)c3ccccc3C)C2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCS[C@@H]&C1",
"old_substring": "N16CC[C@@H]5C1=O"
} |
Can you make molecule Cc1ccc(N2CC[C@@H](NS(=O)(=O)c3ccccc3C)C2=O)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CC[C@](F)(NS(=O)(=O)c3ccccc3C)C2)cc1C | Cc1ccc(N2CC[C@@H](NS(=O)(=O)c3ccccc3C)C2=O)cc1C | Cc1ccc(N2CC[C@](F)(NS(=O)(=O)c3ccccc3C)C2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC[C@@]&(F)C1",
"old_substring": "N16CC[C@@H]5C1=O"
} |
Can you make molecule Cc1ccc(N2CC[C@@H](NS(=O)(=O)c3ccccc3C)C2=O)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)NS(=O)(=O)c1ccccc1C)c1ccc(C)c(C)c1 | Cc1ccc(N2CC[C@@H](NS(=O)(=O)c3ccccc3C)C2=O)cc1C | CC[C@H](CC(=O)NS(=O)(=O)c1ccccc1C)c1ccc(C)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H]&CC&=O",
"old_substring": "N16CC[C@@H]5C1=O"
} |
Can you make molecule Cc1ccc(N2CC[C@@H](NS(=O)(=O)c3ccccc3C)C2=O)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CCCC[C@@H](NS(=O)(=O)c3ccccc3C)C2)cc1C | Cc1ccc(N2CC[C@@H](NS(=O)(=O)c3ccccc3C)C2=O)cc1C | Cc1ccc(N2CCCC[C@@H](NS(=O)(=O)c3ccccc3C)C2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC[C@@H]&C1",
"old_substring": "N16CC[C@@H]5C1=O"
} |
Can you make molecule Cc1ccc(N2CC[C@@H](NS(=O)(=O)c3ccccc3C)C2=O)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CCC[C@@H](NS(=O)(=O)c3ccccc3C)C2)cc1C | Cc1ccc(N2CC[C@@H](NS(=O)(=O)c3ccccc3C)C2=O)cc1C | Cc1ccc(N2CCC[C@@H](NS(=O)(=O)c3ccccc3C)C2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@H]&C1",
"old_substring": "N16CC[C@@H]5C1=O"
} |
Can you make molecule CC[C@H](C)C[C@@H](C)NC(=O)N1CCN(CC(=O)NC2CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)C[C@@H](C)NC(=O)SN1CCN(CC(=O)NC2CC2)CC1 | CC[C@H](C)C[C@@H](C)NC(=O)N1CCN(CC(=O)NC2CC2)CC1 | CC[C@H](C)C[C@@H](C)NC(=O)SN1CCN(CC(=O)NC2CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N14CCN7CC1"
} |
Can you make molecule CC[C@H](C)C[C@@H](C)NC(=O)N1CCN(CC(=O)NC2CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)C[C@@H](C)NC(=O)N1CCN=C1CCC(=O)NC1CC1 | CC[C@H](C)C[C@@H](C)NC(=O)N1CCN(CC(=O)NC2CC2)CC1 | CC[C@H](C)C[C@@H](C)NC(=O)N1CCN=C1CCC(=O)NC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N14CCN7CC1"
} |
Can you make molecule CC[C@H](C)C[C@@H](C)NC(=O)N1CCN(CC(=O)NC2CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)C[C@@H](C)NC(=O)N1CC(CC(=O)NC2CC2)C1 | CC[C@H](C)C[C@@H](C)NC(=O)N1CCN(CC(=O)NC2CC2)CC1 | CC[C@H](C)C[C@@H](C)NC(=O)N1CC(CC(=O)NC2CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N14CCN7CC1"
} |
Can you make molecule CC[C@H](C)C[C@@H](C)NC(=O)N1CCN(CC(=O)NC2CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)C[C@@H](C)NC(=O)N1CCCN(CC(=O)NC2CC2)C1=O | CC[C@H](C)C[C@@H](C)NC(=O)N1CCN(CC(=O)NC2CC2)CC1 | CC[C@H](C)C[C@@H](C)NC(=O)N1CCCN(CC(=O)NC2CC2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N14CCN7CC1"
} |
Can you make molecule CC[C@H](C)C[C@@H](C)NC(=O)N1CCN(CC(=O)NC2CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)C[C@@H](C)NC(=O)N1CCN=C1SCC(=O)NC1CC1 | CC[C@H](C)C[C@@H](C)NC(=O)N1CCN(CC(=O)NC2CC2)CC1 | CC[C@H](C)C[C@@H](C)NC(=O)N1CCN=C1SCC(=O)NC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N14CCN7CC1"
} |
Can you make molecule CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1CCCCC1)N(C1CCCCC1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1CCCCCCC1)N(C1CCCCC1)C2=O | CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1CCCCC1)N(C1CCCCC1)C2=O | CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1CCCCCCC1)N(C1CCCCC1)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C17CCCCC1"
} |
Can you make molecule CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1CCCCC1)N(C1CCCCC1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NSC1=CCCCCC1)N(C1CCCCC1)C2=O | CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1CCCCC1)N(C1CCCCC1)C2=O | CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NSC1=CCCCCC1)N(C1CCCCC1)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C17CCCCC1"
} |
Can you make molecule CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1CCCCC1)N(C1CCCCC1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)N=CC1CCCCC1)N(C1CCCCC1)C2=O | CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1CCCCC1)N(C1CCCCC1)C2=O | CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)N=CC1CCCCC1)N(C1CCCCC1)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "C=&C1CCCCC1",
"old_substring": "C17CCCCC1"
} |
Can you make molecule CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1CCCCC1)N(C1CCCCC1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1CCCCCCCCCCC1)N(C1CCCCC1)C2=O | CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1CCCCC1)N(C1CCCCC1)C2=O | CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1CCCCCCCCCCC1)N(C1CCCCC1)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCCCCCC1",
"old_substring": "C17CCCCC1"
} |
Can you make molecule CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1CCCCC1)N(C1CCCCC1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1(C#N)CCCCCCC1)N(C1CCCCC1)C2=O | CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1CCCCC1)N(C1CCCCC1)C2=O | CC(=O)Nc1c2n(c3ccccc13)C[C@](C)(C(=O)NC1(C#N)CCCCCCC1)N(C1CCCCC1)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCCCCCC1",
"old_substring": "C17CCCCC1"
} |
Can you make molecule N#Cc1ccncc1NC[C@@H]1C[C@@]12CCc1ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CN(C[C@@H]1C[C@@]12CCc1ccccc12)C(=S)Sc1cnccc1C#N | N#Cc1ccncc1NC[C@@H]1C[C@@]12CCc1ccccc12 | CN(C[C@@H]1C[C@@]12CCc1ccccc12)C(=S)Sc1cnccc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N34"
} |
Can you make molecule N#Cc1ccncc1NC[C@@H]1C[C@@]12CCc1ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccncc1-c1cc(C[C@@H]2C[C@@]23CCc2ccccc23)oc1N | N#Cc1ccncc1NC[C@@H]1C[C@@]12CCc1ccccc12 | N#Cc1ccncc1-c1cc(C[C@@H]2C[C@@]23CCc2ccccc23)oc1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N34"
} |
Can you make molecule N#Cc1ccncc1NC[C@@H]1C[C@@]12CCc1ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccncc1SC1=NCCN1C[C@@H]1C[C@@]12CCc1ccccc12 | N#Cc1ccncc1NC[C@@H]1C[C@@]12CCc1ccccc12 | N#Cc1ccncc1SC1=NCCN1C[C@@H]1C[C@@]12CCc1ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N34"
} |
Can you make molecule N#Cc1ccncc1NC[C@@H]1C[C@@]12CCc1ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccncc1C1CCN(CC[C@@H]2C[C@@]23CCc2ccccc23)CC1 | N#Cc1ccncc1NC[C@@H]1C[C@@]12CCc1ccccc12 | N#Cc1ccncc1C1CCN(CC[C@@H]2C[C@@]23CCc2ccccc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N34"
} |
Can you make molecule N#Cc1ccncc1NC[C@@H]1C[C@@]12CCc1ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccncc1-c1cccc(C[C@@H]2C[C@@]23CCc2ccccc23)c1N | N#Cc1ccncc1NC[C@@H]1C[C@@]12CCc1ccccc12 | N#Cc1ccncc1-c1cccc(C[C@@H]2C[C@@]23CCc2ccccc23)c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&cccc1&",
"old_substring": "N34"
} |
Can you make molecule Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C(C)C)cnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C3(C)CCCC3)cnc12 | Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C(C)C)cnc12 | Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C3(C)CCCC3)cnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C7(C)C"
} |
Can you make molecule Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C(C)C)cnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C(Cl)(Cl)Cl)cnc12 | Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C(C)C)cnc12 | Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C(Cl)(Cl)Cl)cnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C7(C)C"
} |
Can you make molecule Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C(C)C)cnc12 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)[C@H]1OCC[C@@H]1CNC(=O)c1cnc2c(C)cccn2c1=O | Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C(C)C)cnc12 | CCCC(C)(C)[C@H]1OCC[C@@H]1CNC(=O)c1cnc2c(C)cccn2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C7(C)C"
} |
Can you make molecule Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C(C)C)cnc12 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(CC)[C@H]1OCC[C@@H]1CNC(=O)c1cnc2c(C)cccn2c1=O | Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C(C)C)cnc12 | CCC(C)(CC)[C@H]1OCC[C@@H]1CNC(=O)c1cnc2c(C)cccn2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "C7(C)C"
} |
Can you make molecule Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C(C)C)cnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C3(C=O)CCCCCC3)cnc12 | Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C(C)C)cnc12 | Cc1cccn2c(=O)c(C(=O)NC[C@H]3CCO[C@@H]3C3(C=O)CCCCCC3)cnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C=O)CCCCCC1",
"old_substring": "C7(C)C"
} |
Can you make molecule CNC(=O)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNSC(=O)Cc1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 | CNC(=O)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 | CNSC(=O)Cc1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CNC(=O)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CCCC(=O)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 | CNC(=O)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 | CNC(=O)CCCC(=O)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule CNC(=O)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CC(C)(C)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 | CNC(=O)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 | CNC(=O)CC(C)(C)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CNC(=O)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CCC(C)(C)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 | CNC(=O)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 | CNC(=O)CCC(C)(C)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CNC(=O)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNSC(=O)[C@@H](C)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 | CNC(=O)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 | CNSC(=O)[C@@H](C)c1ccc(C=CC(=O)Nc2c(C)cc(C)nc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule CC1=C(CNC(=O)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(CNSC(=O)Cc2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 | CC1=C(CNC(=O)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 | CC1=C(CNSC(=O)Cc2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule CC1=C(CNC(=O)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(CNC(=O)CCCC(=O)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 | CC1=C(CNC(=O)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 | CC1=C(CNC(=O)CCCC(=O)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule CC1=C(CNC(=O)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(CNC(=O)CC(C)(C)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 | CC1=C(CNC(=O)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 | CC1=C(CNC(=O)CC(C)(C)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CC1=C(CNC(=O)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(CNC(=O)CCC(C)(C)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 | CC1=C(CNC(=O)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 | CC1=C(CNC(=O)CCC(C)(C)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CC1=C(CNC(=O)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(CNSC(=O)[C@@H](C)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 | CC1=C(CNC(=O)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 | CC1=C(CNSC(=O)[C@@H](C)c2cc(-c3ccccc3)nc3c2CNN3C(C)C)CN=N1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1ccccc1Cl | C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1ccccc1 | C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1"
} |
Can you make molecule C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1ccc(I)cc1 | C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1ccccc1 | C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17ccccc1"
} |
Can you make molecule C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H](C)NC(=O)COC(=O)C=Cc2ccc(Cl)cc2)cc1I | C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1ccccc1 | Cc1ccc([C@@H](C)NC(=O)COC(=O)C=Cc2ccc(Cl)cc2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c17ccccc1"
} |
Can you make molecule C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1cccc(Br)c1 | C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1ccccc1 | C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c17ccccc1"
} |
Can you make molecule C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@@H](C)NC(=O)COC(=O)C=Cc2ccc(Cl)cc2)c1C | C[C@@H](NC(=O)COC(=O)C=Cc1ccc(Cl)cc1)c1ccccc1 | Cc1cccc([C@@H](C)NC(=O)COC(=O)C=Cc2ccc(Cl)cc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17ccccc1"
} |
Can you make molecule CCc1ccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)cc1I | CCc1ccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)cc1 | CCc1ccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c18ccc5cc1"
} |
Can you make molecule CCc1ccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)ccc1Br | CCc1ccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)cc1 | CCc1cc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c18ccc5cc1"
} |
Can you make molecule CCc1ccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)cc1Cl | CCc1ccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)cc1 | CCc1ccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c18ccc5cc1"
} |
Can you make molecule CCc1ccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)c1Br | CCc1ccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)cc1 | CCc1cccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c18ccc5cc1"
} |
Can you make molecule CCc1ccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)c1Cl | CCc1ccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)cc1 | CCc1cccc(N(Cc2ccc(C)s2)C(=O)c2ccc(=O)n(C)n2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c18ccc5cc1"
} |
Can you make molecule CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H]([NH+](CC)CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H](C2(CC)CC[NH+](CC)C2)C1 | CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H]([NH+](CC)CC)C1 | CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H](C2(CC)CC[NH+](CC)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH+]568"
} |
Can you make molecule CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H]([NH+](CC)CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H]([C@@]2(CC)CCC[NH+](CC)C2)C1 | CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H]([NH+](CC)CC)C1 | CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H]([C@@]2(CC)CCC[NH+](CC)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH+]568"
} |
Can you make molecule CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H]([NH+](CC)CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H](c2c(CC)[nH+]cn2CC)C1 | CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H]([NH+](CC)CC)C1 | CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H](c2c(CC)[nH+]cn2CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH+]568"
} |
Can you make molecule CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H]([NH+](CC)CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H](c2cc(CC)[nH+]n2CC)C1 | CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H]([NH+](CC)CC)C1 | CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H](c2cc(CC)[nH+]n2CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH+]568"
} |
Can you make molecule CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H]([NH+](CC)CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H](c2c(CC)[nH+]n(C)c2CC)C1 | CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H]([NH+](CC)CC)C1 | CCOC(=O)c1nnc2ccccc2c1N1CC[C@@H](c2c(CC)[nH+]n(C)c2CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH+]568"
} |
Can you make molecule Cc1ccc(C#N)cc1S(=O)(=O)NCc1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C#N)cc1S(=O)(=O)SCNCc1ccnc(OC(C)(C)C)c1 | Cc1ccc(C#N)cc1S(=O)(=O)NCc1ccnc(OC(C)(C)C)c1 | Cc1ccc(C#N)cc1S(=O)(=O)SCNCc1ccnc(OC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N45"
} |
Can you make molecule Cc1ccc(C#N)cc1S(=O)(=O)NCc1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C#N)cc1S(=O)(=O)SC(=N)NCc1ccnc(OC(C)(C)C)c1 | Cc1ccc(C#N)cc1S(=O)(=O)NCc1ccnc(OC(C)(C)C)c1 | Cc1ccc(C#N)cc1S(=O)(=O)SC(=N)NCc1ccnc(OC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N45"
} |
Can you make molecule Cc1ccc(C#N)cc1S(=O)(=O)NCc1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C#N)cc1S(=O)(=O)SC(=S)N(C)Cc1ccnc(OC(C)(C)C)c1 | Cc1ccc(C#N)cc1S(=O)(=O)NCc1ccnc(OC(C)(C)C)c1 | Cc1ccc(C#N)cc1S(=O)(=O)SC(=S)N(C)Cc1ccnc(OC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N45"
} |
Can you make molecule Cc1ccc(C#N)cc1S(=O)(=O)NCc1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C#N)cc1S(=O)(=O)c1cc(Cc2ccnc(OC(C)(C)C)c2)oc1N | Cc1ccc(C#N)cc1S(=O)(=O)NCc1ccnc(OC(C)(C)C)c1 | Cc1ccc(C#N)cc1S(=O)(=O)c1cc(Cc2ccnc(OC(C)(C)C)c2)oc1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N45"
} |
Can you make molecule Cc1ccc(C#N)cc1S(=O)(=O)NCc1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C#N)cc1S(=O)(=O)SC1=NCCN1Cc1ccnc(OC(C)(C)C)c1 | Cc1ccc(C#N)cc1S(=O)(=O)NCc1ccnc(OC(C)(C)C)c1 | Cc1ccc(C#N)cc1S(=O)(=O)SC1=NCCN1Cc1ccnc(OC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N45"
} |
Can you make molecule O=C(O[C@H]1CCOC1)C1(c2ccc(Cl)c(Cl)c2)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SC1(c2ccc(Cl)c(Cl)c2)CCC1)O[C@H]1CCOC1 | O=C(O[C@H]1CCOC1)C1(c2ccc(Cl)c(Cl)c2)CCC1 | O=C(/C=C/SC1(c2ccc(Cl)c(Cl)c2)CCC1)O[C@H]1CCOC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(O[C@H]1CCOC1)C1(c2ccc(Cl)c(Cl)c2)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(O[C@H]2CCOC2)nc1C1(c2ccc(Cl)c(Cl)c2)CCC1 | O=C(O[C@H]1CCOC1)C1(c2ccc(Cl)c(Cl)c2)CCC1 | O=Cc1sc(O[C@H]2CCOC2)nc1C1(c2ccc(Cl)c(Cl)c2)CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(O[C@H]1CCOC1)C1(c2ccc(Cl)c(Cl)c2)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(O[C@H]2CCOC2)sc1C1(c2ccc(Cl)c(Cl)c2)CCC1 | O=C(O[C@H]1CCOC1)C1(c2ccc(Cl)c(Cl)c2)CCC1 | O=Cc1nc(O[C@H]2CCOC2)sc1C1(c2ccc(Cl)c(Cl)c2)CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(O[C@H]1CCOC1)C1(c2ccc(Cl)c(Cl)c2)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/CC1(c2ccc(Cl)c(Cl)c2)CCC1)O[C@H]1CCOC1 | O=C(O[C@H]1CCOC1)C1(c2ccc(Cl)c(Cl)c2)CCC1 | O=C(N/N=C/CC1(c2ccc(Cl)c(Cl)c2)CCC1)O[C@H]1CCOC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N/N=C/C&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(O[C@H]1CCOC1)C1(c2ccc(Cl)c(Cl)c2)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(C2(N3CCC(=NOO[C@H]4CCOC4)CC3)CCC2)cc1Cl | O=C(O[C@H]1CCOC1)C1(c2ccc(Cl)c(Cl)c2)CCC1 | Clc1ccc(C2(N3CCC(=NOO[C@H]4CCOC4)CC3)CCC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C35"
} |
Can you make molecule CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1cscc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1scc(C)c1Cl | CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1cscc1C | CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1scc(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1csc&c1Cl",
"old_substring": "c17cscc1C"
} |
Can you make molecule CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1cscc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1csc2c1CCCC2 | CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1cscc1C | CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1csc2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2c1CCCC2",
"old_substring": "c17cscc1C"
} |
Can you make molecule CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1cscc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1scc2c1CCCC2 | CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1cscc1C | CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1scc2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&scc2c1CCCC2",
"old_substring": "c17cscc1C"
} |
Can you make molecule CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1cscc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1sccc1Br | CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1cscc1C | CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1sccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c17cscc1C"
} |
Can you make molecule CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1cscc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1sc2ccccc2c1C | CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1cscc1C | CCC[NH2+][C@@H]1COC[C@H]1C(=O)NCc1sc2ccccc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1C",
"old_substring": "c17cscc1C"
} |
Can you make molecule O=C(NCc1nccc2ccccc12)c1ccc[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCSCc1nccc2ccccc12)c1ccc[nH]c1=O | O=C(NCc1nccc2ccccc12)c1ccc[nH]c1=O | O=C(NCSCc1nccc2ccccc12)c1ccc[nH]c1=O | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N34"
} |
Can you make molecule O=C(NCc1nccc2ccccc12)c1ccc[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | N=C(NC(=O)c1ccc[nH]c1=O)SCc1nccc2ccccc12 | O=C(NCc1nccc2ccccc12)c1ccc[nH]c1=O | N=C(NC(=O)c1ccc[nH]c1=O)SCc1nccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N34"
} |
Can you make molecule O=C(NCc1nccc2ccccc12)c1ccc[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)c1ccc[nH]c1=O)C(=S)SCc1nccc2ccccc12 | O=C(NCc1nccc2ccccc12)c1ccc[nH]c1=O | CN(C(=O)c1ccc[nH]c1=O)C(=S)SCc1nccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N34"
} |
Can you make molecule O=C(NCc1nccc2ccccc12)c1ccc[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | Nc1oc(C(=O)c2ccc[nH]c2=O)cc1Cc1nccc2ccccc12 | O=C(NCc1nccc2ccccc12)c1ccc[nH]c1=O | Nc1oc(C(=O)c2ccc[nH]c2=O)cc1Cc1nccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N34"
} |
Can you make molecule O=C(NCc1nccc2ccccc12)c1ccc[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc[nH]c1=O)N1CCN=C1SCc1nccc2ccccc12 | O=C(NCc1nccc2ccccc12)c1ccc[nH]c1=O | O=C(c1ccc[nH]c1=O)N1CCN=C1SCc1nccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N34"
} |
Can you make molecule CC(=O)c1ccc(S(=O)(=O)N2CCCC[C@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](C)S(=O)(=O)c1ccc(C(C)=O)cc1 | CC(=O)c1ccc(S(=O)(=O)N2CCCC[C@H]2C)cc1 | CCCC[C@@H](C)S(=O)(=O)c1ccc(C(C)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&C",
"old_substring": "N13CCCC[C@H]1C"
} |
Can you make molecule CC(=O)c1ccc(S(=O)(=O)N2CCCC[C@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[C@@H](C)S(=O)(=O)c1ccc(C(C)=O)cc1 | CC(=O)c1ccc(S(=O)(=O)N2CCCC[C@H]2C)cc1 | CCCCC[C@@H](C)S(=O)(=O)c1ccc(C(C)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC[C@H]&C",
"old_substring": "N13CCCC[C@H]1C"
} |
Can you make molecule CC(=O)c1ccc(S(=O)(=O)N2CCCC[C@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[C@H](CC)S(=O)(=O)c1ccc(C(C)=O)cc1 | CC(=O)c1ccc(S(=O)(=O)N2CCCC[C@H]2C)cc1 | C=CCC[C@H](CC)S(=O)(=O)c1ccc(C(C)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC[C@@H]&CC",
"old_substring": "N13CCCC[C@H]1C"
} |
Can you make molecule CC(=O)c1ccc(S(=O)(=O)N2CCCC[C@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1ccc(S(=O)(=O)N2CCCCCCCC2)cc1 | CC(=O)c1ccc(S(=O)(=O)N2CCCC[C@H]2C)cc1 | CC(=O)c1ccc(S(=O)(=O)N2CCCCCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N13CCCC[C@H]1C"
} |
Can you make molecule CC(=O)c1ccc(S(=O)(=O)N2CCCC[C@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1ccc(S(=O)(=O)N2CCc3sccc3[C@H]2C)cc1 | CC(=O)c1ccc(S(=O)(=O)N2CCCC[C@H]2C)cc1 | CC(=O)c1ccc(S(=O)(=O)N2CCc3sccc3[C@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2sccc2[C@H]1C",
"old_substring": "N13CCCC[C@H]1C"
} |
Can you make molecule O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2cccc(Cl)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2c(Cl)cccc2Cl)CC1 | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2cccc(Cl)c2)CC1 | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2c(Cl)cccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1&",
"old_substring": "c17cccc(Cl)c1"
} |
Can you make molecule O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2cccc(Cl)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2ccc(Cl)cc2I)CC1 | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2cccc(Cl)c2)CC1 | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2ccc(Cl)cc2I)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c17cccc(Cl)c1"
} |
Can you make molecule O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2cccc(Cl)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2ccc(Cl)cc2Br)CC1 | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2cccc(Cl)c2)CC1 | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2ccc(Cl)cc2Br)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c17cccc(Cl)c1"
} |
Can you make molecule O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2cccc(Cl)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2ccc(Cl)c(I)c2)CC1 | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2cccc(Cl)c2)CC1 | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2ccc(Cl)c(I)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c17cccc(Cl)c1"
} |
Can you make molecule O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2cccc(Cl)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2ccc(Cl)c(Cl)c2)CC1 | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2cccc(Cl)c2)CC1 | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1N1CCN(c2ccc(Cl)c(Cl)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c17cccc(Cl)c1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.