prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1noc(C)c1CN(C)C(=O)c1cccc(C[S@+](C)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1Cc1sc(C(=O)c2cccc(C[S@+](C)[O-])c2)cc1C#N | Cc1noc(C)c1CN(C)C(=O)c1cccc(C[S@+](C)[O-])c1 | Cc1noc(C)c1Cc1sc(C(=O)c2cccc(C[S@+](C)[O-])c2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N23C"
} |
Can you make molecule Cc1noc(C)c1CN(C)C(=O)c1cccc(C[S@+](C)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1Cc1ccc(C(=O)c2cccc(C[S@+](C)[O-])c2)cc1C#N | Cc1noc(C)c1CN(C)C(=O)c1cccc(C[S@+](C)[O-])c1 | Cc1noc(C)c1Cc1ccc(C(=O)c2cccc(C[S@+](C)[O-])c2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N23C"
} |
Can you make molecule Cc1noc(C)c1CN(C)C(=O)c1cccc(C[S@+](C)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CN1CCC(=NOC(=O)c2cccc(C[S@+](C)[O-])c2)CC1 | Cc1noc(C)c1CN(C)C(=O)c1cccc(C[S@+](C)[O-])c1 | Cc1noc(C)c1CN1CCC(=NOC(=O)c2cccc(C[S@+](C)[O-])c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N23C"
} |
Can you make molecule Cc1noc(C)c1CN(C)C(=O)c1cccc(C[S@+](C)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1Cc1cc(C(=O)c2cccc(C[S@+](C)[O-])c2)cnc1C#N | Cc1noc(C)c1CN(C)C(=O)c1cccc(C[S@+](C)[O-])c1 | Cc1noc(C)c1Cc1cc(C(=O)c2cccc(C[S@+](C)[O-])c2)cnc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1ncc&cc1&",
"old_substring": "N23C"
} |
Can you make molecule Cc1noc(C)c1CN(C)C(=O)c1cccc(C[S@+](C)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CCC1=CCCN(C(=O)c2cccc(C[S@+](C)[O-])c2)C1 | Cc1noc(C)c1CN(C)C(=O)c1cccc(C[S@+](C)[O-])c1 | Cc1noc(C)c1CCC1=CCCN(C(=O)c2cccc(C[S@+](C)[O-])c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "N23C"
} |
Can you make molecule COc1cccc(C(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CC(=O)SN(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 | COc1cccc(C(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 | COc1cccc(CC(=O)SN(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule COc1cccc(C(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C(=O)CCCC(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 | COc1cccc(C(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 | COc1cccc(C(=O)CCCC(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule COc1cccc(C(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C(C)(C)CC(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 | COc1cccc(C(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 | COc1cccc(C(C)(C)CC(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule COc1cccc(C(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C(C)(C)CCC(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 | COc1cccc(C(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 | COc1cccc(C(C)(C)CCC(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule COc1cccc(C(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H](C)C(=O)SN(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 | COc1cccc(C(=O)N(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 | COc1cccc([C@H](C)C(=O)SN(Cc2ccc([C@H]3C[C@H]3C)o2)C2CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C48=O"
} |
Can you make molecule C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCCC3)c2)C[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCCCCC3)c2)C[C@H]1O | C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCCC3)c2)C[C@H]1O | C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCCCCC3)c2)C[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCCC3)c2)C[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCCCCCC3)c2)C[C@H]1O | C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCCC3)c2)C[C@H]1O | C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCCCCCC3)c2)C[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCCC3)c2)C[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OSC3=CCCCCC3)c2)C[C@H]1O | C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCCC3)c2)C[C@H]1O | C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OSC3=CCCCCC3)c2)C[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCCC3)c2)C[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCC(Cl)CC3)c2)C[C@H]1O | C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCCC3)c2)C[C@H]1O | C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCC(Cl)CC3)c2)C[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "ClC1CCC&CC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCCC3)c2)C[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OCCC3=CCCC3)c2)C[C@H]1O | C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OC3CCCC3)c2)C[C@H]1O | C[C@@H]1CCN(C(=O)C(=O)Nc2cccc(OCCC3=CCCC3)c2)C[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule Cc1ccc(NC(=O)Cn2nc3ccc(SC(C)(C)C)nn3c2=O)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)Cn2nc3ccc(SC(Cl)(Cl)Cl)nn3c2=O)cc1C | Cc1ccc(NC(=O)Cn2nc3ccc(SC(C)(C)C)nn3c2=O)cc1C | Cc1ccc(NC(=O)Cn2nc3ccc(SC(Cl)(Cl)Cl)nn3c2=O)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule Cc1ccc(NC(=O)Cn2nc3ccc(SC(C)(C)C)nn3c2=O)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)Cn2nc3ccc(SC(C)(C)CC(C)(C)C)nn3c2=O)cc1C | Cc1ccc(NC(=O)Cn2nc3ccc(SC(C)(C)C)nn3c2=O)cc1C | Cc1ccc(NC(=O)Cn2nc3ccc(SC(C)(C)CC(C)(C)C)nn3c2=O)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule Cc1ccc(NC(=O)Cn2nc3ccc(SC(C)(C)C)nn3c2=O)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)Cn2nc3ccc(SCCCC(C)(C)C)nn3c2=O)cc1C | Cc1ccc(NC(=O)Cn2nc3ccc(SC(C)(C)C)nn3c2=O)cc1C | Cc1ccc(NC(=O)Cn2nc3ccc(SCCCC(C)(C)C)nn3c2=O)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule Cc1ccc(NC(=O)Cn2nc3ccc(SC(C)(C)C)nn3c2=O)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)Cn2nc3ccc(SCCCC(F)(F)F)nn3c2=O)cc1C | Cc1ccc(NC(=O)Cn2nc3ccc(SC(C)(C)C)nn3c2=O)cc1C | Cc1ccc(NC(=O)Cn2nc3ccc(SCCCC(F)(F)F)nn3c2=O)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule Cc1ccc(NC(=O)Cn2nc3ccc(SC(C)(C)C)nn3c2=O)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)C(C)=[SH]c1ccc2nn(CC(=O)Nc3ccc(C)c(C)c3)c(=O)n2n1 | Cc1ccc(NC(=O)Cn2nc3ccc(SC(C)(C)C)nn3c2=O)cc1C | CCC(CC)C(C)=[SH]c1ccc2nn(CC(=O)Nc3ccc(C)c(C)c3)c(=O)n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)C(CC)CC",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule CC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 less soluble in water? The output molecule should be similar to the input molecule. | C=CS[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 | CC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 | C=CS[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 | CC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 | C=CCC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 less soluble in water? The output molecule should be similar to the input molecule. | ClCCC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 | CC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 | ClCCC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 less soluble in water? The output molecule should be similar to the input molecule. | SCCCC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 | CC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 | SCCCC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(C[C@H]([NH2+]CCCBr)[C@@H]2C[NH+]3CCN2CC3)s1 | CC[NH2+][C@@H](Cc1ccc(Cl)s1)[C@@H]1C[NH+]2CCN1CC2 | Clc1ccc(C[C@H]([NH2+]CCCBr)[C@@H]2C[NH+]3CCN2CC3)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.