repo_name
stringlengths
6
69
path
stringlengths
6
178
copies
stringclasses
278 values
size
stringlengths
4
7
content
stringlengths
671
917k
license
stringclasses
15 values
scscgit/scsc_wildstar_addons
MailHelper/libs/GeminiAddon/GeminiAddon.lua
6
25267
--- GeminiAddon-1.1 -- Formerly DaiAddon -- Inspired by AceAddon -- Modules and packages embeds are based heavily on AceAddon's functionally, so credit goes their authors. -- -- Allows the addon to have modules -- Allows for packages to be embedded (if supported) into the addon and it's modules -- -- The core callbacks have been "renamed" for consumption that are used when creating an addon: -- OnLoad -> OnInitialize -- -- New callback: -- OnEnable - Called when the character has been loaded and is in the world. Called after OnInitialize and after Restore would have occured -- -- General flow should be: -- OnInitialize -> OnEnable local MAJOR, MINOR = "Gemini:Addon-1.1", 6 local APkg = Apollo.GetPackage(MAJOR) if APkg and (APkg.nVersion or 0) >= MINOR then return -- no upgrade is needed end local GeminiAddon = APkg and APkg.tPackage or {} -- Upvalues local error, type, tostring, select, pairs = error, type, tostring, select, pairs local setmetatable, getmetatable, xpcall = setmetatable, getmetatable, xpcall local assert, loadstring, rawset, next, unpack = assert, loadstring, rawset, next, unpack local tconcat, tinsert, tremove, ostime = table.concat, table.insert, table.remove, os.time local strformat = string.format -- Wildstar APIs local Apollo, ApolloTimer, GameLib = Apollo, ApolloTimer, GameLib -- Package tables GeminiAddon.Addons = GeminiAddon.Addons or {} -- addon collection GeminiAddon.AddonStatus = GeminiAddon.AddonStatus or {} -- status of addons GeminiAddon.Timers = GeminiAddon.Timers or {} -- Timers for OnEnable local mtGenTable = { __index = function(tbl, key) tbl[key] = {} return tbl[key] end } -- per addon lists GeminiAddon.Embeds = GeminiAddon.Embeds or setmetatable({}, mtGenTable) GeminiAddon.InitializeQueue = GeminiAddon.InitializeQueue or setmetatable({}, mtGenTable) -- addons that are new and not initialized GeminiAddon.EnableQueue = GeminiAddon.EnableQueue or setmetatable({}, mtGenTable) -- addons awaiting to be enabled -- Check if the player unit is available local function IsPlayerInWorld() return GameLib.GetPlayerUnit() ~= nil end local tLibError = Apollo.GetPackage("Gemini:LibError-1.0") local fnErrorHandler = tLibError and tLibError.tPackage and tLibError.tPackage.Error or Print -- xpcall safecall implementation local function CreateDispatcher(argCount) local code = [[ local xpcall, eh = ... local method, ARGS local function call() return method(ARGS) end local function dispatch(func, ...) method = func if not method then return end ARGS = ... return xpcall(call, eh) end return dispatch ]] local ARGS = {} for i = 1, argCount do ARGS[i] = "arg"..i end code = code:gsub("ARGS", tconcat(ARGS, ", ")) return assert(loadstring(code, "safecall Dispatcher[" .. argCount .. "]"))(xpcall, fnErrorHandler) end local Dispatchers = setmetatable({}, {__index=function(self, argCount) local dispatcher = CreateDispatcher(argCount) rawset(self, argCount, dispatcher) return dispatcher end}) Dispatchers[0] = function(func) return xpcall(func, fnErrorHandler) end local function safecall(func, ...) if type(func) == "function" then return Dispatchers[select('#', ...)](func, ...) end end local function AddonToString(self) return self.Name end local Enable, Disable, Embed, GetName, SetEnabledState, AddonLog local EmbedModule, EnableModule, DisableModule, NewModule, GetModule, SetDefaultModulePrototype, SetDefaultModuleState, SetDefaultModulePackages -- delay the firing the OnEnable callback until after Character is in world -- and OnRestore would have occured local function DelayedEnable(oAddon) local strName = oAddon:GetName() if GameLib.GetPlayerUnit() == nil then -- If the Player Unit doesn't exist we wait for the CharacterCreated event instead GeminiAddon.Timers[strName] = nil Apollo.RegisterEventHandler("CharacterCreated", "___OnDelayEnable", oAddon) return end local tEnableQueue = GeminiAddon.EnableQueue[strName] while #tEnableQueue > 0 do local oAddonToEnable = tremove(tEnableQueue, 1) GeminiAddon:EnableAddon(oAddonToEnable) end -- Cleanup GeminiAddon.EnableQueue[strName] = nil GeminiAddon.Timers[strName] = nil Apollo.RemoveEventHandler("CharacterCreated", oAddon) oAddon.___OnDelayEnable = nil end local function NewAddonProto(strInitAddon, oAddonOrName, oNilOrName) local oAddon, strAddonName -- get addon name if type(oAddonOrName) == "table" then oAddon = oAddonOrName strAddonName = oNilOrName else strAddonName = oAddonOrName end oAddon = oAddon or {} oAddon.Name = strAddonName -- use existing metatable if exists local addonmeta = {} local oldmeta = getmetatable(oAddon) if oldmeta then for k,v in pairs(oldmeta) do addonmeta[k] = v end end addonmeta.__tostring = AddonToString setmetatable(oAddon, addonmeta) -- setup addon skeleton GeminiAddon.Addons[strAddonName] = oAddon oAddon.Modules = {} oAddon.OrderedModules = {} oAddon.DefaultModulePackages = {} -- Embed any packages that are needed Embed( oAddon ) -- Add to Queue of Addons to be Initialized during OnLoad tinsert(GeminiAddon.InitializeQueue[strInitAddon], oAddon) return oAddon end -- Create a new addon using GeminiAddon -- The final addon object will be returned. -- @paramsig [object, ] strAddonName, bOnConfigure[, tDependencies][, strPkgName, ...] -- @param object Table to use as the base for the addon (optional) -- @param strAddonName Name of the addon object to create -- @param bOnConfigure Add a button to the options list and fire OnConfigure when clicked. Instead of issuing true, you can pass custom text for the button. -- @param tDependencies List of dependencies for the addon -- @param strPkgName List of packages to embed into the addon - requires the packages to be registered with Apollo.RegisterPackage and for the packages to support embedding -- @usage -- -- Create a simple addon -- local MyAddon = Apollo.GetPackage("Gemini:Addon-1.1").tPackage:NewAddon("MyAddon", false) -- -- -- Create a simple addon with a configure button with custom text -- local MyAddon = Apollo.GetPackage("Gemini:Addon-1.1").tPackage:NewAddon("MyAddon", "Addon Options Button") -- -- -- Create a simple addon with a configure button and a dependency on ChatLog / ChatLogEx -- local MyAddon = Apollo.GetPackage("Gemini:Addon-1.1").tPackage:NewAddon("MyAddon", true, { "ChatLog", "ChatLogEx" }) -- -- -- Create an addon with a base object -- local tAddonBase = { config = { ... some default settings ... }, ... } -- local MyAddon = Apollo.GetPackage("Gemini:Addon-1.1").tPackage:NewAddon(tAddonBase, "MyAddon", false) -- -- -- Create an addon with a base object with a dependency on ChatLog / ChatLogEx -- local tAddonBase = { config = { ... some default settings ... }, ... } -- local MyAddon = Apollo.GetPackage("Gemini:Addon-1.1").tPackage:NewAddon(tAddonBase, "MyAddon", false, { "ChatLog", "ChatLogEx" }) function GeminiAddon:NewAddon(oAddonOrName, ...) local oAddon, strAddonName local oNilOrName = nil local i = 1 -- get addon name if type(oAddonOrName) == "table" then strAddonName = ... oNilOrName = strAddonName i = 2 else strAddonName = oAddonOrName end if type(strAddonName) ~= "string" then error(("Usage: NewAddon([object, ] strAddonName, bOnConfigure[, tDependencies][, strPkgName, ...]): 'strAddonName' - string expected got '%s'."):format(type(strAddonName)), 2) end if self.Addons[strAddonName] then error(("Usage: NewAddon([object, ] strAddonName, bOnConfigure[, tDependencies][, strPkgName, ...]): 'strAddonName' - Addon '%s' already registered in GeminiAddon."):format(strAddonName), 2) end -- get configure state local strConfigBtnName = select(i, ...) i = i + 1 local bConfigure = (strConfigBtnName == true or type(strConfigBtnName) == "string") if bConfigure then strConfigBtnName = type(strConfigBtnName) == "boolean" and strAddonName or strConfigBtnName else strConfigBtnName = "" end -- get dependencies local tDependencies if select(i,...) and type(select(i, ...)) == "table" then tDependencies = select(i, ...) i = i + 1 else tDependencies = {} end local oAddon = NewAddonProto(strAddonName, oAddonOrName, oNilOrName) self:EmbedPackages(oAddon, select(i, ...)) -- Setup callbacks for the addon -- Setup the OnLoad callback handler to initialize the addon -- and delay enable the addon oAddon.OnLoad = function(self) local strName = self:GetName() local tInitQueue = GeminiAddon.InitializeQueue[strName] while #tInitQueue > 0 do local oAddonToInit = tremove(tInitQueue, 1) local retVal = GeminiAddon:InitializeAddon(oAddonToInit) if retVal ~= nil then Apollo.AddAddonErrorText(self, retVal) return retVal end tinsert(GeminiAddon.EnableQueue[strName], oAddonToInit) end GeminiAddon.InitializeQueue[strName] = nil self.___OnDelayEnable = function() DelayedEnable(self) end -- Wait 0 seconds (hah?) this allows OnRestore to have occured GeminiAddon.Timers[strName] = ApolloTimer.Create(0, false, "___OnDelayEnable",self) end -- Register with Apollo Apollo.RegisterAddon(oAddon, bConfigure, strConfigBtnName, tDependencies) return oAddon end -- Get the addon object by its name from the internal GeminiAddon addon registry -- Throws an error if the addon object cannot be found (except if silent is set) -- @param strAddonName the addon name registered with GeminiAddon -- @param bSilent return nil if addon is not found instead of throwing an error -- @usage -- local MyAddon = Apollo.GetPackage("Gemini:Addon-1.1").tPackage:GetAddon("MyAddon") function GeminiAddon:GetAddon(strAddonName, bSilent) if not bSilent and not self.Addons[strAddonName] then error(("Usage: GetAddon(strAddonName): 'strAddonName' - Cannot find an GeminiAddon called '%s'."):format(tostring(strAddonName)), 2) end return self.Addons[strAddonName] end --- Enable the addon -- Used internally when the player has entered the world -- -- **Note:** do not call this manually -- @param oAddon addon object to enable function GeminiAddon:EnableAddon(oAddon) if type(oAddon) == "string" then oAddon = self:GetAddon(oAddon) end local strAddonName = AddonToString(oAddon) if self.AddonStatus[strAddonName] or not oAddon.EnabledState then return false end -- set status first before calling OnEnable. this allows for Disabling of the addon in OnEnable. self.AddonStatus[strAddonName] = true safecall(oAddon.OnEnable, oAddon) if self.AddonStatus[strAddonName] then -- embed packages local tEmbeds = self.Embeds[oAddon] for i = 1, #tEmbeds do local APkg = Apollo.GetPackage(tEmbeds[i]) local oPkg = APkg and APkg.tPackage or nil if oPkg then safecall(oPkg.OnEmbedEnable, oPkg, oAddon) end end -- enable modules local tModules = oAddon.OrderedModules for i = 1, #tModules do self:EnableAddon(tModules[i]) end end return self.AddonStatus[strAddonName] end function GeminiAddon:DisableAddon(oAddon) if type(oAddon) == "string" then oAddon = self:GetAddon(oAddon) end local strAddonName = AddonToString(oAddon) if not self.AddonStatus[strAddonName] then return false end -- set statuses first before calling OnDisable, this allows for aborting the disable in OnDisable. self.AddonStatus[strAddonName] = false safecall( oAddon.OnDisable, oAddon ) if not self.AddonStatus[strAddonName] then local tEmbeds = self.Embeds[oAddon] for i = 1, #tEmbeds do local APkg = Apollo.GetPackage(tEmbeds[i]) local oPkg = APkg and APkg.tPackage or nil if oPkg then safecall(oPkg.OnEmbedDisable, oPkg, oAddon) end end local tModules = oAddon.OrderedModules for i = 1, #tModules do self:DisableAddon(tModules[i]) end end return not self.AddonStatus[strAddonName] end --- Initialize the addon after creation -- Used internally when OnLoad is called for the addon -- -- **Note:** do not call this manually -- @param oAddon addon object to initialize function GeminiAddon:InitializeAddon(oAddon) local _, retVal = safecall(oAddon.OnInitialize, oAddon) if retVal ~= nil then return retVal end local tEmbeds = self.Embeds[oAddon] for i = 1, #tEmbeds do local APkg = Apollo.GetPackage(tEmbeds[i]) local oPkg = APkg and APkg.tPackage or nil if oPkg then local _, retVal = safecall(oPkg.OnEmbedInitialize, oPkg, oAddon) if retVal ~= nil then return retVal end end end end --- Embed packages into the specified addon -- @paramsig oAddon[, strPkgName, ...] -- @param oAddon The addon object to embed packages in -- @param strPkgName List of packages to embed into the addon function GeminiAddon:EmbedPackages(oAddon, ...) for i = 1, select('#', ...) do local strPkgName = select(i, ...) self:EmbedPackage(oAddon, strPkgName, false, 4) end end --- Embed a package into the specified addon -- -- **Note:** This function is for internal use by :EmbedPackages -- @paramsig strAddonName, strPkgName[, silent[, offset]] -- @param oAddon addon object to embed the package in -- @param strPkgName name of the package to embed -- @param bSilent marks an embed to fail silently if the package doesn't exist (optional) -- @param nOffset will push the error messages back to said offset, defaults to 2 (optional) function GeminiAddon:EmbedPackage(oAddon, strPkgName, bSilent, nOffset) local APkg = Apollo.GetPackage(strPkgName) local oPkg = APkg and APkg.tPackage or nil if not oPkg and not bSilent then error(("Usage: EmbedPackage(oAddon, strPkgName, bSilent, nOffset): 'strPkgName' - Cannot find a package instance of '%s'."):format(tostring(strPkgName)), nOffset or 2) elseif oPkg and type(oPkg.Embed) == "function" then oPkg:Embed(oAddon) tinsert(self.Embeds[oAddon], strPkgName) return true elseif oPkg then error(("Usage: EmbedPackage(oAddon, strPkgName, bSilent, nOffset): Package '%s' is not Embed capable."):format(tostring(strPkgName)), nOffset or 2) end end --- Return the specified module from an addon object. -- Throws an error if the addon object cannot be found (except if silent is set) -- @name //addon//:GetModule -- @paramsig strModuleName[, bSilent] -- @param strModuleName unique name of the module -- @param bSilent if true, the module is optional, silently return nil if its not found (optional) -- @usage -- local MyModule = MyAddon:GetModule("MyModule") function GetModule(self, strModuleName, bSilent) if not self.Modules[strModuleName] and not bSilent then error(("Usage: GetModule(strModuleName, bSilent): 'strModuleName' - Cannot find module '%s'."):format(tostring(strModuleName)), 2) end return self.Modules[strModuleName] end local function IsModuleTrue(self) return true end --- Create a new module for the addon. -- The new module can have its own embedded packages and/or use a module prototype to be mixed into the module. -- @name //addon//:NewModule -- @paramsig strName[, oPrototype|strPkgName[, strPkgName, ...]] -- @param strName unique name of the module -- @param oPrototype object to derive this module from, methods and values from this table will be mixed into the module (optional) -- @param strPkgName List of packages to embed into the module -- @usage -- -- Create a module with some embeded packages -- local MyModule = MyAddon:NewModule("MyModule", "PkgWithEmbed-1.0", "PkgWithEmbed2-1.0") -- -- -- Create a module with a prototype -- local oPrototype = { OnEnable = function(self) Print("OnEnable called!") end } -- local MyModule = MyAddon:NewModule("MyModule", oPrototype, "PkgWithEmbed-1.0", "PkgWithEmbed2-1.0") function NewModule(self, strName, oPrototype, ...) if type(strName) ~= "string" then error(("Usage: NewModule(strName, [oPrototype, [strPkgName, strPkgName, strPkgName, ...]): 'strName' - string expected got '%s'."):format(type(strName)), 2) end if type(oPrototype) ~= "string" and type(oPrototype) ~= "table" and type(oPrototype) ~= "nil" then error(("Usage: NewModule(strName, [oPrototype, [strPkgName, strPkgName, strPkgName, ...]): 'oPrototype' - table (oPrototype), string (strPkgName) or nil expected got '%s'."):format(type(oPrototype)), 2) end if self.Modules[strName] then error(("Usage: NewModule(strName, [oPrototype, [strPkgName, strPkgName, strPkgName, ...]): 'strName' - Module '%s' already exists."):format(strName), 2) end -- Go up the family tree to find the addon that started it all local oCurrParent, oNextParent = self, self.Parent while oNextParent do oCurrParent = oNextParent oNextParent = oCurrParent.Parent end local oModule = NewAddonProto(oCurrParent:GetName(), strformat("%s_%s", self.Name or tostring(self), strName)) oModule.IsModule = IsModuleTrue oModule:SetEnabledState(self.DefaultModuleState) oModule.ModuleName = strName oModule.Parent = self if type(oPrototype) == "string" then GeminiAddon:EmbedPackages(oModule, oPrototype, ...) else GeminiAddon:EmbedPackages(oModule, ...) end GeminiAddon:EmbedPackages(oModule, unpack(self.DefaultModulePackages)) if not oPrototype or type(oPrototype) == "string" then oPrototype = self.DefaultModulePrototype or nil --self:_Log("Using Prototype type: " .. tostring(oPrototype)) end if type(oPrototype) == "table" then local mt = getmetatable(oModule) mt.__index = oPrototype setmetatable(oModule, mt) end safecall(self.OnModuleCreated, self, oModule) self.Modules[strName] = oModule tinsert(self.OrderedModules, oModule) return oModule end --- returns the name of the addon or module without any prefix -- @name //addon|module//:GetName -- @paramsig -- @usage -- Print(MyAddon:GetName()) -- Print(MyAddon:GetModule("MyModule"):GetName()) function GetName(self) return self.ModuleName or self.Name end -- Check if the addon is queued to be enabled local function QueuedForInitialization(oAddon) for strAddonName, tAddonList in pairs(GeminiAddon.EnableQueue) do for nIndex = 1, #tAddonList do if tAddonList[nIndex] == oAddon then return true end end end return false end --- Enables the addon, if possible, returns true on success. -- This internally calls GeminiAddon:EnableAddon(), thus dispatching the OnEnable callback -- and enabling all modules on the addon (unless explicitly disabled) -- :Enable() also sets the internal `enableState` variable to true. -- @name //addon//:Enable -- @paramsig -- @usage function Enable(self) self:SetEnabledState(true) if not QueuedForInitialization(self) then return GeminiAddon:EnableAddon(self) end end function Disable(self) self:SetEnabledState(false) return GeminiAddon:DisableAddon(self) end --- Enables the Module, if possible, return true or false depending on success. -- Short-hand function that retrieves the module via `:GetModule` and calls `:Enable` on the module object. -- @name //addon//:EnableModule -- @paramsig name -- @usage -- -- Enable MyModule using :GetModule -- local MyModule = MyAddon:GetModule("MyModule") -- MyModule:Enable() -- -- -- Enable MyModule using the short-hand -- MyAddon:EnableModule("MyModule") function EnableModule(self, strModuleName) local oModule = self:GetModule(strModuleName) return oModule:Enable() end --- Disables the Module, if possible, return true or false depending on success. -- Short-hand function that retrieves the module via `:GetModule` and calls `:Disable` on the module object. -- @name //addon//:DisableModule -- @paramsig name -- @usage -- -- Disable MyModule using :GetModule -- local MyModule = MyAddon:GetModule("MyModule") -- MyModule:Disable() -- -- -- Disable MyModule using the short-hand -- local MyAddon:DisableModule("MyModule") function DisableModule(self, strModuleName) local oModule = self:GetModule(strModuleName) return oModule:Disable() end --- Set the default packages to be mixed into all modules created by this object. -- Note that you can only change the default module packages before any module is created. -- @name //addon//:SetDefaultModulePackages -- @paramsig strPkgName[, strPkgName, ...] -- @param strPkgName List of Packages to embed into the addon -- @usage -- -- Create the addon object -- local MyAddon = Apollo.GetPackage("Gemini:Addon-1.1").tPackage:NewAddon("MyAddon") -- -- Configure default packages for modules -- MyAddon:SetDefaultModulePackages("MyEmbeddablePkg-1.0") -- -- Create a module -- local MyModule = MyAddon:NewModule("MyModule") function SetDefaultModulePackages(self, ...) if next(self.Modules) then error("Usage: SetDefaultModulePackages(...): cannot change the module defaults after a module has been registered.", 2) end self.DefaultModulePackages = {...} end --- Set the default state in which new modules are being created. -- Note that you can only change the default state before any module is created. -- @name //addon//:SetDefaultModuleState -- @paramsig state -- @param state Default state for new modules, true for enabled, false for disabled -- @usage -- -- Create the addon object -- local MyAddon = Apollo.GetPackage("Gemini:Addon-1.1").tPackage:NewAddon("MyAddon") -- -- Set the default state to "disabled" -- MyAddon:SetDefaultModuleState(false) -- -- Create a module and explicilty enable it -- local MyModule = MyAddon:NewModule("MyModule") -- MyModule:Enable() function SetDefaultModuleState(self, bState) if next(self.Modules) then error("Usage: SetDefaultModuleState(bState): cannot change the module defaults after a module has been registered.", 2) end self.DefaultModuleState = bState end --- Set the default prototype to use for new modules on creation. -- Note that you can only change the default prototype before any module is created. -- @name //addon//:SetDefaultModulePrototype -- @paramsig prototype -- @param prototype Default prototype for the new modules (table) -- @usage -- -- Define a prototype -- local prototype = { OnEnable = function(self) Print("OnEnable called!") end } -- -- Set the default prototype -- MyAddon:SetDefaultModulePrototype(prototype) -- -- Create a module and explicitly Enable it -- local MyModule = MyAddon:NewModule("MyModule") -- MyModule:Enable() -- -- should Print "OnEnable called!" now -- @see NewModule function SetDefaultModulePrototype(self, tPrototype) if next(self.Modules) then error("Usage: SetDefaultModulePrototype(tPrototype): cannot change the module defaults after a module has been registered.", 2) end if type(tPrototype) ~= "table" then error(("Usage: SetDefaultModulePrototype(tPrototype): 'tPrototype' - table expected got '%s'."):format(type(tPrototype)), 2) end self.DefaultModulePrototype = tPrototype end --- Set the state of an addon or module -- This should only be called before any enabling actually happened, e.g. in/before OnInitialize. -- @name //addon|module//:SetEnabledState -- @paramsig state -- @param state the state of an addon or module (enabled = true, disabled = false) function SetEnabledState(self, bState) self.EnabledState = bState end --- Return an iterator of all modules associated to the addon. -- @name //addon//:IterateModules -- @paramsig -- @usage -- -- Enable all modules -- for strModuleName, oModule in MyAddon:IterateModules() do -- oModule:Enable() -- end local function IterateModules(self) return pairs(self.Modules) end -- Returns an iterator of all embeds in the addon -- @name //addon//:IterateEmbeds -- @paramsig local function IterateEmbeds(self) return pairs(GeminiAddon.Embeds[self]) end --- Query the enabledState of an addon. -- @name //addon//:IsEnabled -- @paramsig -- @usage -- if MyAddon:IsEnabled() then -- MyAddon:Disable() -- end local function IsEnabled(self) return self.EnabledState end local function IsModule(self) return false end function AddonLog(self, t) self._DebugLog = self._DebugLog or {} tinsert(self._DebugLog, { what = t, when = ostime() }) end local tMixins = { NewModule = NewModule, GetModule = GetModule, Enable = Enable, Disable = Disable, EnableModule = EnableModule, DisableModule = DisableModule, IsEnabled = IsEnabled, SetDefaultModulePackages = SetDefaultModulePackages, SetDefaultModuleState = SetDefaultModuleState, SetDefaultModulePrototype = SetDefaultModulePrototype, SetEnabledState = SetEnabledState, IterateModules = IterateModules, IterateEmbeds = IterateEmbeds, GetName = GetName, -- _Log = AddonLog, DefaultModuleState = true, EnabledState = true, IsModule = IsModule, } -- Embed( target ) -- target (object) - target GeminiAddon object to embed in -- -- **Note:** This is for internal use only. Do not call manually function Embed(target) for k, v in pairs(tMixins) do target[k] = v end end --- Get an iterator over all registered addons. -- @usage -- -- Print a list of all registered GeminiAddons -- for name, addon in GeminiAddon:IterateAddons() do -- Print("Addon: " .. name) -- end function GeminiAddon:IterateAddons() return pairs(self.Addons) end --- Get an iterator over the internal status registry. -- @usage -- -- Print a list of all enabled addons -- for name, status in GeminiAddon:IterateAddonStatus() do -- if status then -- Print("EnabledAddon: " .. name) -- end -- end function GeminiAddon:IterateAddonStatus() return pairs(self.AddonStatus) end function GeminiAddon:OnLoad() end function GeminiAddon:OnDependencyError(strDep, strError) return false end Apollo.RegisterPackage(GeminiAddon, MAJOR, MINOR, {})
mit
RunAwayDSP/darkstar
scripts/globals/weaponskills/true_strike.lua
10
1507
----------------------------------- -- True Strike -- Club weapon skill -- Skill level: 175 -- Deals params.critical damage. params.accuracy varies with TP. -- 100% Critical Hit Rate. Has a substantial accuracy penalty at 100TP. http://www.bg-wiki.com/bg/True_Strike -- Will stack with Sneak Attack. -- Aligned with the Breeze Gorget & Thunder Gorget. -- Aligned with the Breeze Belt & Thunder Belt. -- Element: None -- Modifiers: STR:100% -- 100%TP 200%TP 300%TP -- 1.00 1.00 1.00 ----------------------------------- require("scripts/globals/status") require("scripts/globals/settings") require("scripts/globals/weaponskills") ----------------------------------- function onUseWeaponSkill(player, target, wsID, tp, primary, action, taChar) local params = {} params.numHits = 1 params.ftp100 = 1 params.ftp200 = 1 params.ftp300 = 1 params.str_wsc = 0.5 params.dex_wsc = 0.0 params.vit_wsc = 0.0 params.agi_wsc = 0.0 params.int_wsc = 0.0 params.mnd_wsc = 0.0 params.chr_wsc = 0.0 params.crit100 = 1.0 params.crit200 = 1.0 params.crit300 = 1.0 params.canCrit = true params.acc100 = 0.5 params.acc200= 0.7 params.acc300= 1 params.atk100 = 2; params.atk200 = 2; params.atk300 = 2; if (USE_ADOULIN_WEAPON_SKILL_CHANGES == true) then params.str_wsc = 1.0 end local damage, criticalHit, tpHits, extraHits = doPhysicalWeaponskill(player, target, wsID, params, tp, action, primary, taChar) return tpHits, extraHits, criticalHit, damage end
gpl-3.0
lichtl/darkstar
scripts/zones/Aht_Urhgan_Whitegate/npcs/Hadahda.lua
14
1047
----------------------------------- -- Area: Aht Urhgan Whitegate -- NPC: Hadahda -- Type: Standard NPC -- @pos -112.029 -6.999 -66.114 50 ----------------------------------- package.loaded["scripts/zones/Aht_Urhgan_Whitegate/TextIDs"] = nil; ----------------------------------- require("scripts/zones/Aht_Urhgan_Whitegate/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:startEvent(0x0206); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
scscgit/scsc_wildstar_addons
twinkieplates/TwinkiePlates.lua
1
83326
----------------------------------------------------------------------------------------------- -- Client Lua Script for TwinkiePlates -- Copyright (c) NCsoft. All rights reserved ----------------------------------------------------------------------------------------------- require "Window" require "ChallengesLib" require "Unit" require "GameLib" require "Apollo" require "PathMission" require "Quest" require "Episode" require "math" require "string" require "DialogSys" require "PublicEvent" require "PublicEventObjective" require "CommunicatorLib" require "GroupLib" require "PlayerPathLib" require "bit32" local TwinkiePlates = {} local E_VULNERABILITY = Unit.CodeEnumCCState.Vulnerability local F_PATH = 0 local F_QUEST = 1 local F_CHALLENGE = 2 local F_FRIEND = 3 local F_RIVAL = 4 local F_PVP = 4 local F_AGGRO = 5 local F_CLEANSE = 6 local F_LOW_HP = 7 local F_GROUP = 8 local F_NAMEPLATE = 0 local F_HEALTH = 1 local F_HEALTH_TEXT = 2 local F_CLASS = 3 local F_LEVEL = 4 local F_TITLE = 5 local F_GUILD = 6 local F_CASTING_BAR = 7 local F_CC_BAR = 8 local F_ARMOR = 9 local F_BUBBLE = 10 local N_NEVER_ENABLED = 0 local N_ENABLED_IN_COMBAT = 1 local N_ALWAYS_OUT_OF_COMBAT = 2 local N_ALWAYS_ENABLED = 3 local _ccWhiteList = { [Unit.CodeEnumCCState.Blind] = "Blind", [Unit.CodeEnumCCState.Disarm] = "Disarm", [Unit.CodeEnumCCState.Disorient] = "Disorient", [Unit.CodeEnumCCState.Fear] = "Fear", [Unit.CodeEnumCCState.Knockdown] = "Knockdown", [Unit.CodeEnumCCState.Subdue] = "Subdue", [Unit.CodeEnumCCState.Stun] = "Stun", [Unit.CodeEnumCCState.Root] = "Root", [Unit.CodeEnumCCState.Tether] = "Tether", [Unit.CodeEnumCCState.Vulnerability] = "MoO", } local _tDisplayHideExceptionUnitNames = { ["NyanPrime"] = false, -- Hidden ["Cactoid"] = true, -- Visible ["Spirit of the Darned"] = true, ["Wilderrun Trap"] = true, ["Essence of Logic"] = true, ["Teleporter Generator"] = false, ["Firewall"] = false, ["Engineer2 - Hostile Invisible Unit for Fields (1.2m Radius)"] = false, ["Spiritmother Selene's Echo"] = true, ["Data Devourer Spawner"] = false, ["Spore Cloud"] = false, } local _color = ApolloColor.new local _tFromPlayerClassToIcon = { [GameLib.CodeEnumClass.Esper] = "NPrimeNameplates_Sprites:IconEsper", [GameLib.CodeEnumClass.Medic] = "NPrimeNameplates_Sprites:IconMedic", [GameLib.CodeEnumClass.Stalker] = "NPrimeNameplates_Sprites:IconStalker", [GameLib.CodeEnumClass.Warrior] = "NPrimeNameplates_Sprites:IconWarrior", [GameLib.CodeEnumClass.Engineer] = "NPrimeNameplates_Sprites:IconEngineer", [GameLib.CodeEnumClass.Spellslinger] = "NPrimeNameplates_Sprites:IconSpellslinger", } local _tFromNpcRankToIcon = { [Unit.CodeEnumRank.Elite] = "NPrimeNameplates_Sprites:icon_6_elite", [Unit.CodeEnumRank.Superior] = "NPrimeNameplates_Sprites:icon_5_superior", [Unit.CodeEnumRank.Champion] = "NPrimeNameplates_Sprites:icon_4_champion", [Unit.CodeEnumRank.Standard] = "NPrimeNameplates_Sprites:icon_3_standard", [Unit.CodeEnumRank.Minion] = "NPrimeNameplates_Sprites:icon_2_minion", [Unit.CodeEnumRank.Fodder] = "NPrimeNameplates_Sprites:icon_1_fodder", } local _dispColor = { [Unit.CodeEnumDisposition.Neutral] = _color("FFFFBC55"), [Unit.CodeEnumDisposition.Hostile] = _color("FFFA394C"), [Unit.CodeEnumDisposition.Friendly] = _color("FF7DAF29"), [Unit.CodeEnumDisposition.Unknown] = _color("FFFFFFFF"), } local _tFromSettingToColor = { Self = _color("FF7DAF29"), Target = _color("xkcdLightMagenta"), FriendlyPc = _color("FF7DAF29"), FriendlyNpc = _color("xkcdKeyLime"), NeutralPc = _color("FFFFBC55"), NeutralNpc = _color("xkcdDandelion"), HostilePc = _color("xkcdLipstickRed"), HostileNpc = _color("FFFA394C"), Group = _color("FF7DAF29"), -- FF597CFF Harvest = _color("FFFFFFFF"), Other = _color("FFFFFFFF"), Hidden = _color("FFFFFFFF"), NoAggro = _color("FF55FAFF"), Cleanse = _color("FFAF40E1"), LowHpFriendly = _color("FF0000FF"), LowHpNotFriendly = _color("FF55FAFF"), } local _paths = { [0] = "Soldier", [1] = "Settler", [2] = "Scientist", [3] = "Explorer", } local _tUiElements = { ["Nameplates"] = { ["Self"] = "NameplatesSelf", ["Target"] = "NameplatesTarget", ["Group"] = "NameplatesGroup", ["FriendlyPc"] = "NameplatesFriendlyPc", ["FriendlyNpc"] = "NameplatesFriendlyNpc", ["NeutralPc"] = "NameplatesNeutralPc", ["NeutralNpc"] = "NameplatesNeutralNpc", ["HostilePc"] = "NameplatesHostilePc", ["HostileNpc"] = "NameplatesHostileNpc", ["Other"] = "NameplatesOther" }, ["Health"] = { ["Self"] = "HealthSelf", ["Target"] = "HealthTarget", ["Group"] = "HealthGroup", ["FriendlyPc"] = "HealthFriendlyPc", ["FriendlyNpc"] = "HealthFriendlyNpc", ["NeutralPc"] = "HealthNeutralPc", ["NeutralNpc"] = "HealthNeutralNpc", ["HostilePc"] = "HealthHostilePc", ["HostileNpc"] = "HealthHostileNpc", ["Other"] = "HealthOther" }, ["HealthText"] = { ["Self"] = "HealthTextSelf", ["Target"] = "HealthTextTarget", ["Group"] = "HealthTextGroup", ["FriendlyPc"] = "HealthTextFriendlyPc", ["FriendlyNpc"] = "HealthTextFriendlyNpc", ["NeutralPc"] = "HealthTextNeutralPc", ["NeutralNpc"] = "HealthTextNeutralNpc", ["HostilePc"] = "HealthTextHostilePc", ["HostileNpc"] = "HealthTextHostileNpc", ["Other"] = "HealthTexOther" }, ["Class"] = { ["Self"] = "ClassSelf", ["Target"] = "ClassTarget", ["Group"] = "ClassGroup", ["FriendlyPc"] = "ClassFriendlyPc", ["FriendlyNpc"] = "ClassFriendlyNpc", ["NeutralPc"] = "ClassNeutralPc", ["NeutralNpc"] = "ClassNeutralNpc", ["HostilePc"] = "ClassHostilePc", ["HostileNpc"] = "ClassHostileNpc", ["Other"] = "ClassOther" }, ["Level"] = { ["Self"] = "LevelSelf", ["Target"] = "LevelTarget", ["Group"] = "LevelGroup", ["FriendlyPc"] = "LevelFriendlyPc", ["FriendlyNpc"] = "LevelFriendlyNpc", ["NeutralPc"] = "LevelNeutralPc", ["NeutralNpc"] = "LevelNeutralNpc", ["HostilePc"] = "LevelHostilePc", ["HostileNpc"] = "LevelHostileNpc", ["Other"] = "LevelOther" }, ["Title"] = { ["Self"] = "TitleSelf", ["Target"] = "TitleTarget", ["Group"] = "TitleGroup", ["FriendlyPc"] = "TitleFriendlyPc", ["FriendlyNpc"] = "TitleFriendlyNpc", ["NeutralPc"] = "TitleNeutralPc", ["NeutralNpc"] = "TitleNeutralNpc", ["HostilePc"] = "TitleHostilePc", ["HostileNpc"] = "TitleHostileNpc", ["Other"] = "TitleOther" }, ["Guild"] = { ["Self"] = "GuildSelf", ["Target"] = "GuildTarget", ["Group"] = "GuildGroup", ["FriendlyPc"] = "GuildFriendlyPc", ["FriendlyNpc"] = "GuildFriendlyNpc", ["NeutralPc"] = "GuildNeutralPc", ["NeutralNpc"] = "GuildNeutralNpc", ["HostilePc"] = "GuildHostilePc", ["HostileNpc"] = "GuildHostileNpc", ["Other"] = "GuildOther" }, ["CastingBar"] = { ["Self"] = "CastingBarSelf", ["Target"] = "CastingBarTarget", ["Group"] = "CastingBarGroup", ["FriendlyPc"] = "CastingBarFriendlyPc", ["FriendlyNpc"] = "CastingBarFriendlyNpc", ["NeutralPc"] = "CastingBarNeutralPc", ["NeutralNpc"] = "CastingBarNeutralNpc", ["HostilePc"] = "CastingBarHostilePc", ["HostileNpc"] = "CastingBarHostileNpc", ["Other"] = "CastingBarOther" }, ["CCBar"] = { ["Self"] = "CCBarSelf", ["Target"] = "CCBarTarget", ["Group"] = "CCBarGroup", ["FriendlyPc"] = "CCBarFriendlyPc", ["FriendlyNpc"] = "CCBarFriendlyNpc", ["NeutralPc"] = "CCBarNeutralPc", ["NeutralNpc"] = "CCBarNeutralNpc", ["HostilePc"] = "CCBarHostilePc", ["HostileNpc"] = "CCBarHostileNpc", ["Other"] = "CCBarOther" }, ["Armor"] = { ["Self"] = "ArmorSelf", ["Target"] = "ArmorTarget", ["Group"] = "ArmorGroup", ["FriendlyPc"] = "ArmorFriendlyPc", ["FriendlyNpc"] = "ArmorFriendlyNpc", ["NeutralPc"] = "ArmorNeutralPc", ["NeutralNpc"] = "ArmorNeutralNpc", ["HostilePc"] = "ArmorHostilePc", ["HostileNpc"] = "ArmorHostileNpc", ["Other"] = "ArmorOther" }, ["TextBubbleFade"] = { ["Self"] = "TextBubbleFadeSelf", ["Target"] = "TextBubbleFadeTarget", ["Group"] = "TextBubbleFadeGroup", ["FriendlyPc"] = "TextBubbleFadeFriendlyPc", ["FriendlyNpc"] = "TextBubbleFadeFriendlyNpc", ["NeutralPc"] = "TextBubbleFadeNeutralPc", ["NeutralNpc"] = "TextBubbleFadeNeutralNpc", ["HostilePc"] = "TextBubbleFadeHostilePc", ["HostileNpc"] = "TextBubbleFadeHostileNpc", ["Other"] = "TextBubbleOther" }, } local _tUnitCategories = { "Self", "Target", "Group", "FriendlyPc", "FriendlyNpc", "NeutralPc", "NeutralNpc", "HostilePc", "HostileNpc", "Other", } local _matrixButtonSprites = { [N_NEVER_ENABLED] = "MatrixOff", [N_ENABLED_IN_COMBAT] = "MatrixInCombat", [N_ALWAYS_OUT_OF_COMBAT] = "MatrixOutOfCombat", [N_ALWAYS_ENABLED] = "MatrixOn", } local _asbl = { ["Chair"] = true, ["CityDirections"] = true, ["TradeskillNode"] = true, } local _flags = { opacity = 1, contacts = 1, } local _fontPrimary = { [1] = { font = "CRB_Header9_O", height = 20 }, [2] = { font = "CRB_Header10_O", height = 21 }, [3] = { font = "CRB_Header11_O", height = 22 }, [4] = { font = "CRB_Header12_O", height = 24 }, [5] = { font = "CRB_Header14_O", height = 28 }, [6] = { font = "CRB_Header16_O", height = 34 }, } local _fontSecondary = { [1] = { font = "CRB_Interface9_O", height = 20 }, [2] = { font = "CRB_Interface10_O", height = 21 }, [3] = { font = "CRB_Interface11_O", height = 22 }, [4] = { font = "CRB_Interface12_O", height = 24 }, [5] = { font = "CRB_Interface14_O", height = 28 }, [6] = { font = "CRB_Interface16_O", height = 34 }, } local _tDispositionToString = { [Unit.CodeEnumDisposition.Hostile] = { ["Pc"] = "HostilePc", ["Npc"] = "HostileNpc" }, [Unit.CodeEnumDisposition.Neutral] = { ["Pc"] = "NeutralPc", ["Npc"] = "NeutralNpc" }, [Unit.CodeEnumDisposition.Friendly] = { ["Pc"] = "FriendlyPc", ["Npc"] = "FriendlyNpc" }, [Unit.CodeEnumDisposition.Unknown] = { ["Pc"] = "Hidden", ["Npc"] = "Hidden" }, } local _tUiElementToFlag = { ["Nameplates"] = F_NAMEPLATE, ["Health"] = F_HEALTH, ["HealthText"] = F_HEALTH_TEXT, ["Class"] = F_CLASS, ["Level"] = F_LEVEL, ["Title"] = F_TITLE, ["Guild"] = F_GUILD, ["CastingBar"] = F_CASTING_BAR, ["CCBar"] = F_CC_BAR, ["Armor"] = F_ARMOR, ["TextBubbleFade"] = F_BUBBLE, } local _tPvpZones = { [4456] = true, -- The Slaughterdome [4457] = true, -- The Slaughterdome [4460] = true, -- The Slaughterdome [478] = true, -- The Cryoplex [4471] = true, -- Walatiki Temple [2176] = true, -- Walatiki Temple [2193] = false, -- Test [2177] = true, -- Halls of the Bloodsworn [4472] = true, -- Halls of the Bloodsworn [103] = true, -- Daggerstone Pass } local _unitPlayer local _playerPath local _playerPos local _bIsPlayerBlinded local _tTargetNameplate local _floor = math.floor local _min = math.min local _max = math.max local _ipairs = ipairs local _pairs = pairs local _tableInsert = table.insert local _tableRemove = table.remove local _next = next local _type = type local _weaselStr = String_GetWeaselString local _strLen = string.len local _textWidth = Apollo.GetTextWidth local _or = bit32.bor local _lshift = bit32.lshift local _and = bit32.band local _not = bit32.bnot local _xor = bit32.bxor local _wndConfigUi local _tSettings = {} local _count = 0 local _cycleSize = 25 local _iconPixie = { strSprite = "", cr = white, loc = { fPoints = { 0, 0, 1, 1 }, nOffsets = { 0, 0, 0, 0 } }, } local _tTargetPixie = { strSprite = "BK3:sprHolo_Accent_Rounded", cr = white, loc = { fPoints = { 0.5, 0.5, 0.5, 0.5 }, nOffsets = { 0, 0, 0, 0 } }, } ------------------------------------------------------------------------------- function TwinkiePlates:new(o) o = o or {} setmetatable(o, self) self.__index = self return o end function TwinkiePlates:Init() Apollo.RegisterAddon(self, true) end function TwinkiePlates:OnLoad() self.tNameplates = {} self.pool = {} self.buffer = {} self.challenges = ChallengesLib.GetActiveChallengeList() Apollo.RegisterEventHandler("NextFrame", "OnDebuggerUnit", self) Apollo.RegisterSlashCommand("tp", "OnConfigure", self) Apollo.RegisterEventHandler("ShowTwinkiePlatesConfigurationWnd", "OnConfigure", self) Apollo.RegisterEventHandler("InterfaceMenuListHasLoaded", "OnInterfaceMenuListHasLoaded", self) Apollo.RegisterEventHandler("NextFrame", "OnFrame", self) Apollo.RegisterEventHandler("ChangeWorld", "OnChangeWorld", self) Apollo.RegisterEventHandler("SubZoneChanged", "OnSubZoneChanged", self) Apollo.RegisterEventHandler("UnitCreated", "OnUnitCreated", self) Apollo.RegisterEventHandler("UnitDestroyed", "OnUnitDestroyed", self) Apollo.RegisterEventHandler("UnitTextBubbleCreate", "OnTextBubble", self) Apollo.RegisterEventHandler("UnitTextBubblesDestroyed", "OnTextBubble", self) Apollo.RegisterEventHandler("TargetUnitChanged", "OnTargetUnitChanged", self) Apollo.RegisterEventHandler("UnitActivationTypeChanged", "OnUnitActivationTypeChanged", self) Apollo.RegisterEventHandler("UnitLevelChanged", "OnUnitLevelChanged", self) Apollo.RegisterEventHandler("PlayerTitleChange", "OnPlayerMainTextChanged", self) Apollo.RegisterEventHandler("UnitNameChanged", "OnUnitMainTextChanged", self) Apollo.RegisterEventHandler("UnitTitleChanged", "OnUnitMainTextChanged", self) Apollo.RegisterEventHandler("GuildChange", "OnPlayerMainTextChanged", self) Apollo.RegisterEventHandler("UnitGuildNameplateChanged", "OnUnitMainTextChanged", self) Apollo.RegisterEventHandler("UnitMemberOfGuildChange", "OnUnitMainTextChanged", self) -- Apollo.RegisterEventHandler("UnitGibbed", "OnUnitGibbed", self) Apollo.RegisterEventHandler("CombatLogDeath", "OnCombatLogDeath", self) Apollo.RegisterEventHandler("CombatLogResurrect", "OnCombatLogResurrect", self) -- Apollo.RegisterEventHandler("CharacterFlagsUpdated", "OnCharacterFlagsUpdated", self) Apollo.RegisterEventHandler("ApplyCCState", "OnCCStateApplied", self) -- Apollo.RegisterEventHandler("UnitGroupChanged", "OnGroupUpdated", self) Apollo.RegisterEventHandler("ChallengeUnlocked", "OnChallengeUnlocked", self) -- Too unreliable -- Apollo.RegisterEventHandler("UnitEnteredCombat", "OnUnitCombatStateChanged", self) Apollo.RegisterEventHandler("UnitPvpFlagsChanged", "OnUnitPvpFlagsChanged", self) Apollo.RegisterEventHandler("FriendshipAdd", "OnFriendshipChanged", self) Apollo.RegisterEventHandler("FriendshipRemove", "OnFriendshipChanged", self) self.nameplacer = Apollo.GetAddon("Nameplacer") if (self.nameplacer) then Apollo.RegisterEventHandler("Nameplacer_UnitNameplatePositionChanged", "OnNameplatePositionSettingChanged", self) end self.perspectivePlates = Apollo.GetAddon("PerspectivePlates") self.xmlDoc = XmlDoc.CreateFromFile("TwinkiePlates.xml") Apollo.LoadSprites("TwinkiePlates_Sprites.xml") end function TwinkiePlates:OnSave(p_type) if p_type ~= GameLib.CodeEnumAddonSaveLevel.Account then return end return _tSettings end function TwinkiePlates:OnRestore(p_type, p_savedData) if p_type ~= GameLib.CodeEnumAddonSaveLevel.Account then return end _tSettings = p_savedData self:CheckMatrixIntegrity() end function TwinkiePlates:OnFriendshipChanged() _flags.contacts = 1 end function TwinkiePlates:OnNameClick(wndHandler, wndCtrl, nClick) local l_unit = wndCtrl:GetData() if (l_unit ~= nil and nClick == 0) then GameLib.SetTargetUnit(l_unit) return true end end function TwinkiePlates:OnChangeWorld() _unitPlayer = nil if (_tTargetNameplate ~= nil) then if (_tTargetNameplate.targetMark ~= nil) then _tTargetNameplate.targetMark:Destroy() end _tTargetNameplate.wndNameplate:Destroy() _tTargetNameplate = nil end end function TwinkiePlates:UpdateCurrentZoneInfo(nZoneId) -- local tCurrentZone = GameLib.GetCurrentZoneMap() self.nCurrentZoneId = nZoneId end function TwinkiePlates:OnUnitCombatStateChanged(unit, bIsInCombat) if (unit == nil) then return end local tNameplate = self.tNameplates[unit:GetId()] self:SetCombatState(tNameplate, bIsInCombat) if (_unitPlayer ~= nil and _unitPlayer:GetTarget() == unit) then self:SetCombatState(_tTargetNameplate, bIsInCombat) end end function TwinkiePlates:OnGroupUpdated(unitNameplateOwner) if (unitNameplateOwner == nil) then return end local tNameplate = self.tNameplates[unitNameplateOwner:GetId()] if (tNameplate ~= nil) then local strPcOrNpc = tNameplate.bIsPlayer and "Pc" or "Npc" tNameplate.bIsInGroup = unitNameplateOwner:IsInYourGroup() tNameplate.strUnitCategory = tNameplate.bIsInGroup and "Group" or _tDispositionToString[tNameplate.eDisposition][strPcOrNpc] end end function TwinkiePlates:OnUnitPvpFlagsChanged(unit) if (not unit) then return end local bPvpFlagged = self:IsPvpFlagged(unit) local tNameplate = self.tNameplates[unit:GetId()] -- Update unit nameplate if (tNameplate) then tNameplate.bIsPvpFlagged = bPvpFlagged end -- Update target nameplate as well if (_tTargetNameplate and _unitPlayer:GetTarget() == unit) then _tTargetNameplate.bIsPvpFlagged = bPvpFlagged end end function TwinkiePlates:OnSubZoneChanged(nZoneId, strSubZoneName) -- Print("TwinkiePlates:OnSubZoneChanged; Current zone: " .. tostring(nZoneId)) self:UpdateCurrentZoneInfo(nZoneId) end function TwinkiePlates:InitNameplate(unitNameplateOwner, tNameplate, bIsTargetNameplate) tNameplate = tNameplate or {} bIsTargetNameplate = bIsTargetNameplate or false local bIsCharacter = unitNameplateOwner:IsACharacter() tNameplate.unitNameplateOwner = unitNameplateOwner tNameplate.unitClassID = bIsCharacter and unitNameplateOwner:GetClassId() or unitNameplateOwner:GetRank() tNameplate.bPet = self:IsPet(unitNameplateOwner) tNameplate.eDisposition = self:GetDispositionTo(unitNameplateOwner, _unitPlayer) tNameplate.bIsPlayer = bIsCharacter tNameplate.bForcedHideDisplayToggle = _tDisplayHideExceptionUnitNames[unitNameplateOwner:GetName()] tNameplate.strUnitCategory = self:GetUnitCategoryType(unitNameplateOwner) tNameplate.color = "FFFFFFFF" tNameplate.bIsTargetNameplate = bIsTargetNameplate tNameplate.bHasHealth = self:HasHealth(unitNameplateOwner) if (bIsTargetNameplate) then local l_source = self.tNameplates[unitNameplateOwner:GetId()] tNameplate.nCcActiveId = l_source and l_source.nCcActiveId or -1 tNameplate.nCcNewId = l_source and l_source.nCcNewId or -1 tNameplate.nCcDuration = l_source and l_source.nCcDuration or 0 tNameplate.nCcDurationMax = l_source and l_source.nCcDurationMax or 0 else tNameplate.nCcActiveId = -1 tNameplate.nCcNewId = -1 tNameplate.nCcDuration = 0 tNameplate.nCcDurationMax = 0 end tNameplate.bRefreshHealthShieldBar = false tNameplate.bIsLowHealth = false tNameplate.nCurrHealth = tNameplate.bHasHealth and tNameplate.unitNameplateOwner:GetHealth() or nil tNameplate.healthy = false tNameplate.prevArmor = nil tNameplate.levelWidth = 1 tNameplate.iconFlags = -1 tNameplate.nNonCombatStateFlags = -1 tNameplate.nMatrixFlags = -1 tNameplate.bRearrange = false tNameplate.bIsUnitOutOfRange = true tNameplate.bIsOccluded = unitNameplateOwner:IsOccluded() tNameplate.bIsInCombat = self:IsInCombat(tNameplate) tNameplate.bIsInGroup = unitNameplateOwner:IsInYourGroup() tNameplate.isMounted = unitNameplateOwner:IsMounted() tNameplate.bIsObjective = false tNameplate.bIsPvpFlagged = unitNameplateOwner:IsPvpFlagged() tNameplate.bHasActivationState = self:HasActivationState(unitNameplateOwner) tNameplate.bHasShield = unitNameplateOwner:GetShieldCapacityMax() ~= nil and unitNameplateOwner:GetShieldCapacityMax() ~= 0 local l_zoomSliderW = _tSettings["SliderBarScale"] / 2 local l_zoomSliderH = _tSettings["SliderBarScale"] / 10 local l_fontSize = _tSettings["SliderFontSize"] local l_font = _tSettings["ConfigAlternativeFont"] and _fontSecondary or _fontPrimary if (tNameplate.wndNameplate == nil) then -- Print("TwinkiePlates: InitNameplate; New form!") tNameplate.wndNameplate = Apollo.LoadForm(self.xmlDoc, "Nameplate", "InWorldHudStratum", self) tNameplate.containerTop = tNameplate.wndNameplate:FindChild("ContainerTop") tNameplate.wndContainerMain = tNameplate.wndNameplate:FindChild("ContainerMain") tNameplate.containerIcons = tNameplate.wndNameplate:FindChild("ContainerIcons") tNameplate.wndUnitNameText = tNameplate.wndNameplate:FindChild("TextUnitName") tNameplate.textUnitGuild = tNameplate.wndNameplate:FindChild("TextUnitGuild") tNameplate.textUnitLevel = tNameplate.wndNameplate:FindChild("TextUnitLevel") tNameplate.wndContainerCc = tNameplate.wndNameplate:FindChild("ContainerCC") tNameplate.containerCastBar = tNameplate.wndNameplate:FindChild("ContainerCastBar") tNameplate.wndCastBar = tNameplate.containerCastBar:FindChild("BarCasting") tNameplate.wndClassRankIcon = tNameplate.wndNameplate:FindChild("IconUnit") tNameplate.iconArmor = tNameplate.wndNameplate:FindChild("IconArmor") tNameplate.wndHealthProgressBar = tNameplate.wndNameplate:FindChild("BarHealth") tNameplate.wndHealthText = tNameplate.wndNameplate:FindChild("TextHealth") tNameplate.wndShieldBar = tNameplate.wndNameplate:FindChild("BarShield") tNameplate.wndAbsorbBar = tNameplate.wndNameplate:FindChild("BarAbsorb") tNameplate.wndCcBar = tNameplate.wndNameplate:FindChild("BarCC") tNameplate.wndCleanseFrame = tNameplate.wndNameplate:FindChild("CleanseFrame") tNameplate.wndCleanseFrame:SetBGColor(_tFromSettingToColor["Cleanse"]) if (not _tSettings["ConfigBarIncrements"]) then tNameplate.wndHealthProgressBar:SetFullSprite("Bar_02") tNameplate.wndHealthProgressBar:SetFillSprite("Bar_02") tNameplate.wndAbsorbBar:SetFullSprite("Bar_02") tNameplate.wndAbsorbBar:SetFillSprite("Bar_02") end tNameplate.wndCastBar:SetMax(100) self:InitNameplateVerticalOffset(tNameplate) self:InitAnchoring(tNameplate) local l_fontH = l_font[l_fontSize].height local l_fontGuild = l_fontSize > 1 and l_fontSize - 1 or l_fontSize tNameplate.iconArmor:SetFont(l_font[l_fontSize].font) tNameplate.containerTop:SetAnchorOffsets(0, 0, 0, l_font[l_fontSize].height * 0.8) tNameplate.wndClassRankIcon:SetAnchorOffsets(-l_fontH * 0.9, 0, l_fontH * 0.1, 0) tNameplate.wndUnitNameText:SetFont(l_font[l_fontSize].font) tNameplate.textUnitLevel:SetFont(l_font[l_fontSize].font) tNameplate.textUnitGuild:SetFont(l_font[l_fontGuild].font) tNameplate.wndHealthText:SetFont(l_font[l_fontGuild].font) -- tNameplate.textUnitGuild:SetAnchorOffsets(0, 0, 0, l_font[l_fontGuild].height * 0.9) tNameplate.containerCastBar:SetFont(l_font[l_fontSize].font) tNameplate.wndContainerCc:SetFont(l_font[l_fontSize].font) tNameplate.containerCastBar:SetAnchorOffsets(0, 0, 0, (l_font[l_fontSize].height * 0.75) + l_zoomSliderH) tNameplate.wndContainerCc:SetAnchorOffsets(0, 0, 0, (l_font[l_fontSize].height * 0.75) + l_zoomSliderH) tNameplate.wndContainerMain:SetFont(l_font[l_fontSize].font) tNameplate.wndCastBar:SetAnchorOffsets(-l_zoomSliderW, (l_zoomSliderH * 0.25), l_zoomSliderW, l_zoomSliderH) tNameplate.wndCcBar:SetAnchorOffsets(-l_zoomSliderW, (l_zoomSliderH * 0.25), l_zoomSliderW, l_zoomSliderH) local l_armorWidth = tNameplate.iconArmor:GetHeight() / 2 tNameplate.iconArmor:SetAnchorOffsets(-l_armorWidth, 0, l_armorWidth, 0) end tNameplate.nMatrixFlags = self:GetCombatStateDependentFlags(tNameplate) self:UpdateAnchoring(tNameplate) if (not tNameplate.bIsVerticalOffsetUpdated) then self:InitNameplateVerticalOffset(tNameplate) end tNameplate.wndUnitNameText:SetData(unitNameplateOwner) tNameplate.wndHealthProgressBar:SetData(unitNameplateOwner) tNameplate.bIsOnScreen = tNameplate.wndNameplate:IsOnScreen() self:UpdateOpacity(tNameplate) tNameplate.wndContainerCc:Show(false) tNameplate.wndContainerMain:Show(false) tNameplate.containerCastBar:Show(false) tNameplate.textUnitGuild:Show(false) tNameplate.iconArmor:Show(false) tNameplate.wndCleanseFrame:Show(false) -- self:UpdateHealthShieldText(tNameplate) tNameplate.wndShieldBar:Show(tNameplate.bHasShield) local mc_left, mc_top, mc_right, mc_bottom = tNameplate.wndContainerMain:GetAnchorOffsets() tNameplate.wndContainerMain:SetAnchorOffsets(mc_left, mc_top, mc_right, tNameplate.bHasShield and mc_top + 14 or mc_top + 11) if (_tSettings["ConfigLargeShield"]) then tNameplate.wndShieldBar:SetAnchorOffsets(0, 8, 0, 14) end -- Some NPCs do seem to spawn in combat while they don't have a valid HP value. -- We still want to show their health bars if (tNameplate.bHasHealth or tNameplate.bIsInCombat) then self:UpdateMainBars(tNameplate) self:UpdateHealthShieldText(tNameplate) else tNameplate.wndHealthText:Show(false) -- When a PC dyes we also hide the CC status container window tNameplate.wndContainerCc:Show(false) end tNameplate.nNonCombatStateFlags = self:GetNonCombatStateDependentFlags(tNameplate) self:UpdateNonCombatStateElements(tNameplate) tNameplate.containerIcons:DestroyAllPixies() if (tNameplate.bIsPlayer) then self:UpdateIconsPc(tNameplate) else self:UpdateIconsNpc(tNameplate) end self:UpdateTextNameGuild(tNameplate) self:UpdateTextLevel(tNameplate) self:UpdateInterruptArmor(tNameplate) self:InitClassRankIcon(tNameplate) tNameplate.wndNameplate:Show(self:GetNameplateVisibility(tNameplate), true) self:UpdateTopContainer(tNameplate) tNameplate.wndNameplate:ArrangeChildrenVert(1) return tNameplate end function TwinkiePlates:UpdateAnchoring(tNameplate, nCodeEnumFloaterLocation) local tAnchorUnit = tNameplate.unitNameplateOwner:IsMounted() and tNameplate.unitNameplateOwner:GetUnitMount() or tNameplate.unitNameplateOwner local bReposition = false local nCodeEnumFloaterLocation = nCodeEnumFloaterLocation if (self.nameplacer) then if (not nCodeEnumFloaterLocation) then local tNameplatePositionSetting = self.nameplacer:GetUnitNameplatePositionSetting(tNameplate.unitNameplateOwner:GetName()) if (tNameplatePositionSetting and tNameplatePositionSetting["nAnchorId"]) then nCodeEnumFloaterLocation = tNameplatePositionSetting["nAnchorId"] end end if (nCodeEnumFloaterLocation) then -- Already updated if (nCodeEnumFloaterLocation == tNameplate.nAnchorId and tAnchorUnit == tNameplate.wndNameplate:GetUnit()) then return end tNameplate.nAnchorId = nCodeEnumFloaterLocation tNameplate.wndNameplate:SetUnit(tAnchorUnit, tNameplate.nAnchorId) return end end if (_tSettings["ConfigDynamicVPos"] and not tNameplate.bIsPlayer) then local tOverhead = tNameplate.unitNameplateOwner:GetOverheadAnchor() if (tOverhead ~= nil) then bReposition = not tNameplate.bIsOccluded and tOverhead.y < 25 end end nCodeEnumFloaterLocation = bReposition and 0 or 1 if (nCodeEnumFloaterLocation ~= tNameplate.nAnchorId or tAnchorUnit ~= tNameplate.wndNameplate:GetUnit()) then tNameplate.nAnchorId = nCodeEnumFloaterLocation tNameplate.wndNameplate:SetUnit(tAnchorUnit, tNameplate.nAnchorId) end end function TwinkiePlates:InitNameplateVerticalOffset(tNameplate, nInputNameplacerVerticalOffset) local nVerticalOffset = _tSettings["SliderVerticalOffset"] local nNameplacerVerticalOffset = nInputNameplacerVerticalOffset if (self.nameplacer or nNameplacerVerticalOffset) then if (not nNameplacerVerticalOffset) then local tNameplatePositionSetting = self.nameplacer:GetUnitNameplatePositionSetting(tNameplate.unitNameplateOwner:GetName()) if (tNameplatePositionSetting) then nNameplacerVerticalOffset = tNameplatePositionSetting["nVerticalOffset"] end end end if (not nNameplacerVerticalOffset) then nNameplacerVerticalOffset = 0 end self:SetNameplateVerticalOffset(tNameplate, nVerticalOffset, nNameplacerVerticalOffset) tNameplate.bIsVerticalOffsetUpdated = true end function TwinkiePlates:IsInCombat(tNameplate) -- Print("TwinkiePlates: _tPvpZones[self.nCurrentZoneId]: " .. tostring(_tPvpZones[self.nCurrentZoneId])) if (not self.nCurrentZoneId) then -- Print("TwinkiePlates:IsInCombat; Updating current zone!") self:UpdateCurrentZoneInfo(GameLib.GetCurrentZoneId()) end -- PvP zones always on if (_tSettings["ConfigAlwaysPvPCombatDetection"] and _tPvpZones[self.nCurrentZoneId]) then -- Print("TwinkiePlates:IsInCombat; PvP Zone detected!") return true end -- Player based combat status if _tSettings["ConfigPlayerCombatDetection"] then -- Print("TwinkiePlates:IsInCombat; Player setting! " .. tostring(_unitPlayer:IsInCombat())) return _unitPlayer:IsInCombat() end return tNameplate.unitNameplateOwner:IsInCombat() end function TwinkiePlates:IsPet(unit) local strUnitType = unit:GetType() return strUnitType == "Pet" or strUnitType == "Scanner" end function TwinkiePlates:IsPvpFlagged(unit) if (self:IsPet(unit) and unit:GetUnitOwner()) then unit = unit:GetUnitOwner() end return unit:IsPvpFlagged() end function TwinkiePlates:OnUnitCreated(unitNameplateOwner) _tableInsert(self.buffer, unitNameplateOwner) end function TwinkiePlates:UpdateBuffer() for i = 1, #self.buffer do local l_unit = self.buffer[i] if (l_unit ~= nil and l_unit:IsValid()) then self:AllocateNameplate(l_unit) end self.buffer[i] = nil end end function TwinkiePlates:OnFrame() -- Player initialization. if (_unitPlayer == nil) then _unitPlayer = GameLib.GetPlayerUnit() if (_unitPlayer ~= nil) then _playerPath = _paths[PlayerPathLib.GetPlayerPathType()] if (_unitPlayer:GetTarget() ~= nil) then self:OnTargetUnitChanged(_unitPlayer:GetTarget()) end self:CheckMatrixIntegrity() end end -- Addon configuration loading. Maybe can be used to reaload the configuration without reloading the whole UI. if (_wndConfigUi == nil and _next(_tSettings) ~= nil) then self:InitConfiguration() end if (_unitPlayer == nil) then return end --------------------------------------------------------------------------- _playerPos = _unitPlayer:GetPosition() _bIsPlayerBlinded = _unitPlayer:IsInCCState(Unit.CodeEnumCCState.Blind) for flag, flagValue in _pairs(_flags) do _flags[flag] = flagValue == 1 and 2 or flagValue end local nCount = 0 for id, tNameplate in _pairs(self.tNameplates) do nCount = nCount + 1 local bIsCyclicUpdate = (nCount > _count and nCount < _count + _cycleSize) self:UpdateNameplate(tNameplate, bIsCyclicUpdate) end _count = (_count + _cycleSize > nCount) and 0 or _count + _cycleSize if (_tTargetNameplate ~= nil) then self:UpdateNameplate(_tTargetNameplate, true) end if (_wndConfigUi ~= nil and _wndConfigUi:IsVisible()) then self:UpdateConfiguration() end self:UpdateBuffer() for flag, flagValue in _pairs(_flags) do _flags[flag] = flagValue == 2 and 0 or flagValue end end function TwinkiePlates:UpdateNameplate(tNameplate, bCyclicUpdate) if (bCyclicUpdate) then local nDistanceToUnit = self:DistanceToUnit(tNameplate.unitNameplateOwner) tNameplate.bIsUnitOutOfRange = nDistanceToUnit > _tSettings["SliderDrawDistance"] end tNameplate.bIsOnScreen = tNameplate.wndNameplate:IsOnScreen() if (tNameplate.bIsOnScreen) then tNameplate.eDisposition = self:GetDispositionTo(tNameplate.unitNameplateOwner, _unitPlayer) if (tNameplate.bHasHealth or (tNameplate.bIsPlayer and self:HasHealth(tNameplate.unitNameplateOwner)) -- Some units only start having HPs after some events (eg. Essence of Logic) or (tNameplate.bForcedHideDisplayToggle and self:HasHealth(tNameplate.unitNameplateOwner))) then tNameplate.bHasHealth = true tNameplate.nCurrHealth = tNameplate.unitNameplateOwner:GetHealth(); end tNameplate.strUnitCategory = self:GetNameplateCategoryType(tNameplate) end tNameplate.bIsOccluded = tNameplate.wndNameplate:IsOccluded() local bIsNameplateVisible = self:GetNameplateVisibility(tNameplate) if (tNameplate.wndNameplate:IsVisible() ~= bIsNameplateVisible) then tNameplate.wndNameplate:Show(bIsNameplateVisible, true) end if (not bIsNameplateVisible) then return end --------------------------------------------------------------------------- -- local bIsInCombat = tNameplate.unitNameplateOwner:IsInCombat() local bIsInCombat = self:IsInCombat(tNameplate) if (tNameplate.bIsInCombat ~= bIsInCombat) then if (tNameplate.unitNameplateOwner == _unitPlayer) then -- Print("Updating combat state") end tNameplate.bIsInCombat = bIsInCombat if (tNameplate.unitNameplateOwner == _unitPlayer) then -- Print("tNameplate.bIsInCombat: " .. tostring(tNameplate.bIsInCombat)) end if (tNameplate.unitNameplateOwner == _unitPlayer) then -- Print("Combat state flags: " .. tostring(tNameplate.nMatrixFlags)) end tNameplate.nMatrixFlags = self:GetCombatStateDependentFlags(tNameplate) if (tNameplate.unitNameplateOwner == _unitPlayer) then -- Print("New combat state flags: " .. tostring(tNameplate.nMatrixFlags)) end self:UpdateTextNameGuild(tNameplate) self:UpdateTopContainer(tNameplate) end local bShowCcBar = GetFlag(tNameplate.nMatrixFlags, F_CC_BAR) if ((bShowCcBar and (tNameplate.nCcActiveId ~= -1 or tNameplate.nCcNewId ~= -1)) -- We need to hide the CC bar cause the combat state may have changed or (not bShowCcBar and tNameplate.wndContainerCc:IsVisible())) then self:UpdateCc(tNameplate) end if (_flags.opacity == 2) then self:UpdateOpacity(tNameplate) end if (_flags.contacts == 2 and tNameplate.bIsPlayer) then self:UpdateIconsPc(tNameplate) end self:UpdateAnchoring(tNameplate) self:UpdateCasting(tNameplate) self:UpdateInterruptArmor(tNameplate) if (tNameplate.bHasHealth) then self:UpdateMainBars(tNameplate) self:UpdateHealthShieldText(tNameplate) end if (bCyclicUpdate) then local nNonCombatStateFlags = self:GetNonCombatStateDependentFlags(tNameplate) if (tNameplate.nNonCombatStateFlags ~= nNonCombatStateFlags) then tNameplate.nNonCombatStateFlags = nNonCombatStateFlags self:UpdateNonCombatStateElements(tNameplate) end if (not tNameplate.bIsPlayer) then self:UpdateIconsNpc(tNameplate) end end if (tNameplate.bRearrange) then tNameplate.wndNameplate:ArrangeChildrenVert(1) tNameplate.bRearrange = false end if self.perspectivePlates then tNameplate.wndNameplate = tNameplate.wndNameplate tNameplate.unitOwner = tNameplate.unitNameplateOwner self.perspectivePlates:OnRequestedResize(tNameplate) end end function TwinkiePlates:UpdateMainBars(tNameplate) local nHealth = tNameplate.nCurrHealth; local nHealthMax = tNameplate.unitNameplateOwner:GetMaxHealth(); local nShield = tNameplate.unitNameplateOwner:GetShieldCapacity(); local nShieldMax = tNameplate.unitNameplateOwner:GetShieldCapacityMax(); local bIsFullHealth = nHealth == nHealthMax; local bIsShieldFull = false; local bIsHiddenBecauseFull = false; local bIsFriendly = tNameplate.eDisposition == Unit.CodeEnumDisposition.Friendly if (tNameplate.bHasShield) then bIsShieldFull = nShield == nShieldMax; end if (not tNameplate.bIsTargetNameplate) then local bConfigHideWhenFullHealth = _tSettings["ConfigSimpleWhenHealthy"] local bConfigHideWhenFullShield = _tSettings["ConfigSimpleWhenFullShield"] bIsHiddenBecauseFull = -- Check only health (bConfigHideWhenFullHealth and bIsFullHealth) and (not bConfigHideWhenFullShield) -- Check only shield or (bConfigHideWhenFullShield and bIsShieldFull) and (not bConfigHideWhenFullHealth) -- Check health and shield or (bConfigHideWhenFullHealth and bIsFullHealth) and (bConfigHideWhenFullShield and bIsShieldFull); end local bConfigShowHealthBar = GetFlag(tNameplate.nMatrixFlags, F_HEALTH) local bIsHealthBarVisible = bConfigShowHealthBar and not bIsHiddenBecauseFull and nHealth if (tNameplate.wndContainerMain:IsVisible() ~= bIsHealthBarVisible) then tNameplate.wndContainerMain:Show(bIsHealthBarVisible) tNameplate.bRearrange = true end if (bIsHealthBarVisible) then if (tNameplate.bHasShield) then self:SetProgressBar(tNameplate.wndShieldBar, nShield, nShieldMax) end local strLowHealthCheck = bIsFriendly and "SliderLowHealthFriendly" or "SliderLowHealth" if (_tSettings[strLowHealthCheck] ~= 0) then local nLowHealthThresholdCutoff = (_tSettings[strLowHealthCheck] / 100) local nHealthPercentage = nHealth / nHealthMax tNameplate.bIsLowHealth = nHealthPercentage <= nLowHealthThresholdCutoff end self:SetProgressBar(tNameplate.wndHealthProgressBar, nHealth, nHealthMax) tNameplate.bRefreshHealthShieldBar = false local nAbsorb = tNameplate.unitNameplateOwner:GetAbsorptionValue(); if (nAbsorb > 0) then if (not tNameplate.wndAbsorbBar:IsVisible()) then tNameplate.wndAbsorbBar:Show(true) end self:SetProgressBar(tNameplate.wndAbsorbBar, nAbsorb, nHealthMax) else tNameplate.wndAbsorbBar:Show(false) end end end function TwinkiePlates:UpdateTopContainer(tNameplate) local bIsLevelVisible = GetFlag(tNameplate.nMatrixFlags, F_LEVEL) local bIsClassIconVisible = GetFlag(tNameplate.nMatrixFlags, F_CLASS) tNameplate.wndClassRankIcon:SetBGColor(bIsClassIconVisible and "FFFFFFFF" or "00FFFFFF") local l_width = tNameplate.levelWidth + tNameplate.wndUnitNameText:GetWidth() local l_ratio = tNameplate.levelWidth / l_width local l_middle = (l_width * l_ratio) - (l_width / 2) if (not bIsLevelVisible) then local l_extents = tNameplate.wndUnitNameText:GetWidth() / 2 tNameplate.textUnitLevel:SetTextColor("00FFFFFF") tNameplate.textUnitLevel:SetAnchorOffsets(-l_extents - 5, 0, -l_extents, 1) tNameplate.wndUnitNameText:SetAnchorOffsets(-l_extents, 0, l_extents, 1) else tNameplate.textUnitLevel:SetTextColor("FFFFFFFF") tNameplate.textUnitLevel:SetAnchorOffsets(-(l_width / 2), 0, l_middle, 1) tNameplate.wndUnitNameText:SetAnchorOffsets(l_middle, 0, (l_width / 2), 1) end end function TwinkiePlates:UpdateHealthShieldText(tNameplate) local bHealthTextEnabled = GetFlag(tNameplate.nMatrixFlags, F_HEALTH_TEXT) and tNameplate.bHasHealth if (tNameplate.wndHealthText:IsVisible() ~= bHealthTextEnabled) then tNameplate.wndHealthText:Show(bHealthTextEnabled) tNameplate.bRearrange = true end if (bHealthTextEnabled) then local nHealth = tNameplate.nCurrHealth; local nHealthMax = tNameplate.unitNameplateOwner:GetMaxHealth(); local nShield = tNameplate.unitNameplateOwner:GetShieldCapacity(); local nShieldMax = tNameplate.unitNameplateOwner:GetShieldCapacityMax(); local strShieldText = "" local strHealthText = self:GetNumber(nHealth, nHealthMax) if (tNameplate.bHasShield and nShield ~= 0) then strShieldText = " (" .. self:GetNumber(nShield, nShieldMax) .. ")" end tNameplate.wndHealthText:SetText(strHealthText .. strShieldText) -- self:UpdateMainContainerHeightWithHealthText(tNameplate) -- else -- self:UpdateMainContainerHeightWithoutHealthText(tNameplate) end -- tNameplate.bRearrange = true end function TwinkiePlates:UpdateNonCombatStateElements(tNameplate) local bPvpFlaggedSettingEnabled = _unitPlayer:IsPvpFlagged() and GetFlag(tNameplate.nNonCombatStateFlags, F_PVP) local bNoAggroSettingEnabled = GetFlag(tNameplate.nNonCombatStateFlags, F_AGGRO) local bIsShowCleansableSettingEnabled = GetFlag(tNameplate.nNonCombatStateFlags, F_CLEANSE) local bIsLowHpSettingEnabled = GetFlag(tNameplate.nNonCombatStateFlags, F_LOW_HP) local colorNameplateText = _tFromSettingToColor[tNameplate.strUnitCategory] local colorNameplateBar = _dispColor[tNameplate.eDisposition] local bHostile = tNameplate.eDisposition == Unit.CodeEnumDisposition.Hostile local bIsFriendly = tNameplate.eDisposition == Unit.CodeEnumDisposition.Friendly tNameplate.color = colorNameplateText if (tNameplate.bIsPlayer or tNameplate.bPet) then if (not bPvpFlaggedSettingEnabled and bHostile) then colorNameplateText = _dispColor[Unit.CodeEnumDisposition.Neutral] colorNameplateBar = _dispColor[Unit.CodeEnumDisposition.Neutral] tNameplate.color = colorNameplateText end if (bIsShowCleansableSettingEnabled and bIsFriendly --[[ and not tNameplate.wndCleanseFrame:IsVisible()]]) then tNameplate.wndCleanseFrame:Show(true) tNameplate.wndCleanseFrame:SetBGColor(_tFromSettingToColor["Cleanse"]) -- elseif (tNameplate.wndCleanseFrame:IsVisible()) then else tNameplate.wndCleanseFrame:Show(false) end else if (bNoAggroSettingEnabled and bHostile) then colorNameplateText = _tFromSettingToColor["NoAggro"] end if (tNameplate.wndCleanseFrame:IsVisible()) then tNameplate.wndCleanseFrame:Show(false) end end if (bIsLowHpSettingEnabled) then colorNameplateBar = bIsFriendly and _tFromSettingToColor["LowHpFriendly"] or _tFromSettingToColor["LowHpNotFriendly"] end tNameplate.wndUnitNameText:SetTextColor(colorNameplateText) tNameplate.textUnitGuild:SetTextColor(colorNameplateText) tNameplate.wndHealthProgressBar:SetBarColor(colorNameplateBar) if (tNameplate.bIsTargetNameplate and tNameplate.targetMark ~= nil) then tNameplate.targetMark:SetBGColor(tNameplate.color) end end function TwinkiePlates:GetCombatStateDependentFlags(tNameplate) local nFlags = 0 local bIsInCombat = tNameplate.bIsInCombat local strUnitCategoryType = tNameplate.strUnitCategory if (tNameplate.unitNameplateOwner == _unitPlayer) then -- Print("GetCombatStateDependentFlags; tNameplate.bIsIncombat:" .. tostring(tNameplate.bIsInCombat)) end for strUiElement in _pairs(_tUiElements) do local nMatrixConfigurationCellValue = _tSettings[_tUiElements[strUiElement][strUnitCategoryType]] if ((_type(nMatrixConfigurationCellValue) ~= "number") or (nMatrixConfigurationCellValue == N_ALWAYS_ENABLED) or (nMatrixConfigurationCellValue == N_ENABLED_IN_COMBAT and bIsInCombat) or (nMatrixConfigurationCellValue == N_ALWAYS_OUT_OF_COMBAT and not bIsInCombat)) then nFlags = SetFlag(nFlags, _tUiElementToFlag[strUiElement]) end end if (not tNameplate.bHasHealth) then nFlags = ClearFlag(nFlags, F_HEALTH) end return nFlags end function TwinkiePlates:GetNonCombatStateDependentFlags(tNameplate) if (_unitPlayer == nil) then return end local nFlags = SetFlag(0, tNameplate.eDisposition) local bIsFriendly = tNameplate.eDisposition == Unit.CodeEnumDisposition.Friendly if (tNameplate.bIsInGroup) then nFlags = SetFlag(nFlags, F_GROUP) end if (tNameplate.bIsPvpFlagged) then nFlags = SetFlag(nFlags, F_PVP) end if (tNameplate.bIsLowHealth) then nFlags = SetFlag(nFlags, F_LOW_HP) end if (_tSettings["ConfigAggroIndication"]) then if (tNameplate.bIsInCombat and not tNameplate.bIsPlayer and tNameplate.unitNameplateOwner:GetTarget() ~= _unitPlayer) then nFlags = SetFlag(nFlags, F_AGGRO) end end if (_tSettings["ConfigCleanseIndicator"] and bIsFriendly) then local tUnitDebuffs = tNameplate.unitNameplateOwner:GetBuffs()["arHarmful"] for i = 1, #tUnitDebuffs do if (tUnitDebuffs[i]["splEffect"]:GetClass() == Spell.CodeEnumSpellClass.DebuffDispellable) then nFlags = SetFlag(nFlags, F_CLEANSE) end end end return nFlags end function TwinkiePlates:GetDispositionTo(unitSubject, unitObject) if (not unitSubject or not unitObject) then return Unit.CodeEnumDisposition.Unknown end if (self:IsPet(unitSubject) and unitSubject:GetUnitOwner()) then unitSubject = unitSubject:GetUnitOwner() end return unitSubject:GetDispositionTo(unitObject) end function SetFlag(p_flags, p_flag) return _or(p_flags, _lshift(1, p_flag)) end function ClearFlag(p_flags, p_flag) return _and(p_flags, _xor(_lshift(1, p_flag), 65535)) end function GetFlag(p_flags, p_flag) return _and(p_flags, _lshift(1, p_flag)) ~= 0 end function TwinkiePlates:GetNumber(p_current, p_max) if (p_current == nil or p_max == nil) then return "" end if (_tSettings["ConfigHealthPct"]) then return _floor((p_current / p_max) * 100) .. "%" else return self:FormatNumber(p_current) end end function TwinkiePlates:UpdateConfiguration() self:UpdateConfigSlider("SliderDrawDistance", 50, 155.0, "m") self:UpdateConfigSlider("SliderLowHealth", 0, 101.0, "%") self:UpdateConfigSlider("SliderLowHealthFriendly", 0, 101.0, "%") self:UpdateConfigSlider("SliderVerticalOffset", 0, 101.0, "px") self:UpdateConfigSlider("SliderBarScale", 50, 205.0, "%") self:UpdateConfigSlider("SliderFontSize", 1, 6.2) end function TwinkiePlates:UpdateConfigSlider(p_name, p_min, p_max, p_labelSuffix) local l_slider = _wndConfigUi:FindChild(p_name) if (l_slider ~= nil) then local l_sliderVal = l_slider:FindChild("SliderBar"):GetValue() l_slider:SetProgress((l_sliderVal - p_min) / (p_max - p_min)) l_slider:FindChild("TextValue"):SetText(l_sliderVal .. (p_labelSuffix or "")) end end function TwinkiePlates:OnTargetUnitChanged(unitTarget) if (not _unitPlayer) then return end if (unitTarget and self.tNameplates[unitTarget:GetId()]) then self.tNameplates[unitTarget:GetId()].wndNameplate:Show(false, true) end if (unitTarget ~= nil) then if (_tTargetNameplate == nil) then _tTargetNameplate = self:InitNameplate(unitTarget, nil, true) if (_tSettings["ConfigLegacyTargeting"]) then self:UpdateLegacyTargetPixie() _tTargetNameplate.wndNameplate:AddPixie(_tTargetPixie) else _tTargetNameplate.targetMark = Apollo.LoadForm(self.xmlDoc, "Target Indicator", _tTargetNameplate.containerTop, self) local nTargetMarkVerticalOffset = _tTargetNameplate.targetMark:GetHeight() / 2 _tTargetNameplate.targetMark:SetAnchorOffsets(-nTargetMarkVerticalOffset, 0, nTargetMarkVerticalOffset, 0) _tTargetNameplate.targetMark:SetBGColor(_tTargetNameplate.color) end else -- Target nameplate is never reset because it's not attached to any specific unit thus is never affected by OnUnitDestroyed event _tTargetNameplate.bIsVerticalOffsetUpdated = false _tTargetNameplate = self:InitNameplate(unitTarget, _tTargetNameplate, true) if (_tSettings["ConfigLegacyTargeting"]) then self:UpdateLegacyTargetPixie() _tTargetNameplate.wndNameplate:UpdatePixie(1, _tTargetPixie) end end -- We need to call this otherwise hidden health text configuration may not update correctly -- self:UpdateHealthShieldText(_tTargetNameplate) end _flags.opacity = 1 _tTargetNameplate.wndNameplate:Show(unitTarget ~= nil, true) end function TwinkiePlates:UpdateLegacyTargetPixie() local nWidth = _tTargetNameplate.wndUnitNameText:GetWidth() local nHeight = _tTargetNameplate.wndUnitNameText:GetHeight() if (_tTargetNameplate.textUnitLevel:IsVisible()) then nWidth = nWidth + _tTargetNameplate.textUnitLevel:GetWidth() end if (_tTargetNameplate.textUnitGuild:IsVisible()) then nHeight = nHeight + _tTargetNameplate.textUnitGuild:GetHeight() end if (_tTargetNameplate.wndContainerMain:IsVisible()) then nHeight = nHeight + _tTargetNameplate.wndContainerMain:GetHeight() end nHeight = (nHeight / 2) + 30 nWidth = (nWidth / 2) + 50 nWidth = nWidth < 45 and 45 or (nWidth > 200 and 200 or nWidth) nHeight = nHeight < 45 and 45 or (nHeight > 75 and 75 or nHeight) _tTargetPixie.loc.nOffsets[1] = -nWidth _tTargetPixie.loc.nOffsets[2] = -nHeight _tTargetPixie.loc.nOffsets[3] = nWidth _tTargetPixie.loc.nOffsets[4] = nHeight end function TwinkiePlates:OnTextBubble(unitNameplateOwner, p_text) if (_unitPlayer == nil) then return end local tNameplate = self.tNameplates[unitNameplateOwner:GetId()] if (tNameplate ~= nil) then self:ProcessTextBubble(tNameplate, p_text) end end function TwinkiePlates:ProcessTextBubble(p_nameplate, p_text) if (GetFlag(p_nameplate.nMatrixFlags, F_BUBBLE)) then self:UpdateOpacity(p_nameplate, (p_text ~= nil)) end end function TwinkiePlates:OnPlayerMainTextChanged() if (_unitPlayer == nil) then return end self:OnUnitMainTextChanged(_unitPlayer) end function TwinkiePlates:OnNameplatePositionSettingChanged(strUnitName, tNameplatePositionSetting) -- Print("[TwinkiePlates] OnNameplatePositionSettingChanged; strUnitName: " .. strUnitName .. "; tNameplatePositionSetting: " .. table.tostring(tNameplatePositionSetting)) if (not tNameplatePositionSetting or (not tNameplatePositionSetting["nAnchorId"] and not tNameplatePositionSetting["nVerticalOffset"])) then return end if (_tTargetNameplate and _tTargetNameplate.unitNameplateOwner and _tTargetNameplate.unitNameplateOwner:GetName() == strUnitName) then if (tNameplatePositionSetting["nAnchorId"]) then self:UpdateAnchoring(_tTargetNameplate, tNameplatePositionSetting["nAnchorId"]) end if (tNameplatePositionSetting["nVerticalOffset"]) then self:InitNameplateVerticalOffset(_tTargetNameplate, tNameplatePositionSetting["nVerticalOffset"]) end end for _, tNameplate in _pairs(self.tNameplates) do if (tNameplate.unitNameplateOwner:GetName() == strUnitName) then if (tNameplatePositionSetting["nAnchorId"]) then self:UpdateAnchoring(tNameplate, tNameplatePositionSetting["nAnchorId"]) end if (tNameplatePositionSetting["nVerticalOffset"]) then self:InitNameplateVerticalOffset(tNameplate, tNameplatePositionSetting["nVerticalOffset"]) end end end end function TwinkiePlates:OnUnitMainTextChanged(unitNameplateOwner) if (unitNameplateOwner == nil) then return end local tNameplate = self.tNameplates[unitNameplateOwner:GetId()] if (tNameplate ~= nil) then self:UpdateTextNameGuild(tNameplate) self:UpdateTopContainer(tNameplate) end if (_tTargetNameplate ~= nil and _unitPlayer:GetTarget() == unitNameplateOwner) then self:UpdateTextNameGuild(_tTargetNameplate) self:UpdateTopContainer(_tTargetNameplate) end end function TwinkiePlates:OnUnitLevelChanged(unitNameplateOwner) if (unitNameplateOwner == nil) then return end local l_nameplate = self.tNameplates[unitNameplateOwner:GetId()] if (l_nameplate ~= nil) then self:UpdateTextLevel(l_nameplate) self:UpdateTopContainer(l_nameplate) end if (_tTargetNameplate ~= nil and _unitPlayer:GetTarget() == unitNameplateOwner) then self:UpdateTextLevel(_tTargetNameplate) self:UpdateTopContainer(_tTargetNameplate) end end function TwinkiePlates:OnUnitActivationTypeChanged(unitNameplateOwner) if (_unitPlayer == nil) then return end local tNameplate = self.tNameplates[unitNameplateOwner:GetId()] local bHasActivationState = self:HasActivationState(unitNameplateOwner) if (tNameplate ~= nil) then tNameplate.bHasActivationState = bHasActivationState elseif (bHasActivationState) then self:AllocateNameplate(unitNameplateOwner) end if (_tTargetNameplate ~= nil and _unitPlayer:GetTarget() == unitNameplateOwner) then _tTargetNameplate.bHasActivationState = bHasActivationState end end function TwinkiePlates:OnChallengeUnlocked() self.challenges = ChallengesLib.GetActiveChallengeList() end ------------------------------------------------------------------------------- function string.starts(String, Start) return string.sub(String, 1, string.len(Start)) == Start end function TwinkiePlates:OnConfigure(strCmd, strArg) if (strArg == "occlusion") then _tSettings["ConfigOcclusionCulling"] = not _tSettings["ConfigOcclusionCulling"] local l_occlusionString = _tSettings["ConfigOcclusionCulling"] and "<Enabled>" or "<Disabled>" -- Print("[nPrimeNameplates] Occlusion culling " .. l_occlusionString) elseif ((strArg == nil or strArg == "") and _wndConfigUi ~= nil) then _wndConfigUi:Show(not _wndConfigUi:IsVisible(), true) end end function TwinkiePlates:OnCombatLogDeath(tLogInfo) -- Print("tLogInfo: " .. tLogInfo.unitCaster:GetName()) end function TwinkiePlates:OnCombatLogResurrect(tLogInfo) -- Print("tLogInfo: " .. tLogInfo.unitCaster:GetName()) end -- Called from form function TwinkiePlates:OnConfigButton(wndHandler, wndControl, eMouseButton) local strHandlerName = wndHandler:GetName() if (strHandlerName == "ButtonClose") then _wndConfigUi:Show(false) elseif (strHandlerName == "ButtonApply") then RequestReloadUI() elseif (string.starts(strHandlerName, "Config")) then _tSettings[strHandlerName] = wndHandler:IsChecked() end end -- Called from form function TwinkiePlates:OnSliderBarChanged(p1, wndHandler, nValue, nOldValue) local strParentHandlerName = wndHandler:GetParent():GetName() if (_tSettings[strParentHandlerName] ~= nil) then _tSettings[strParentHandlerName] = nValue end end -- Called from form function TwinkiePlates:OnMatrixClick(p_wndHandler, wndCtrl, nClick) if (nClick ~= 0 and nClick ~= 1) then return end local l_parent = p_wndHandler:GetParent():GetParent():GetName() local l_key = l_parent .. p_wndHandler:GetName() local l_valueOld = _tSettings[l_key] local l_xor = bit32.bxor(bit32.extract(l_valueOld, nClick), 1) local l_valueNew = bit32.replace(l_valueOld, l_xor, nClick) p_wndHandler:SetTooltip(self:GetMatrixTooltip(l_valueNew)) _tSettings[l_key] = l_valueNew p_wndHandler:SetSprite(_matrixButtonSprites[l_valueNew]) end function TwinkiePlates:OnInterfaceMenuListHasLoaded() Event_FireGenericEvent("InterfaceMenuList_NewAddOn", "TwinkiePlates", { "ShowTwinkiePlatesConfigurationWnd", "", "" }) end function TwinkiePlates:CheckMatrixIntegrity() if (_type(_tSettings["ConfigBarIncrements"]) ~= "boolean") then _tSettings["ConfigBarIncrements"] = true end if (_type(_tSettings["ConfigHealthText"]) ~= "boolean") then _tSettings["ConfigHealthText"] = true end if (_type(_tSettings["ConfigShowHarvest"]) ~= "boolean") then _tSettings["ConfigShowHarvest"] = true end if (_type(_tSettings["ConfigOcclusionCulling"]) ~= "boolean") then _tSettings["ConfigOcclusionCulling"] = true end if (_type(_tSettings["ConfigFadeNonTargeted"]) ~= "boolean") then _tSettings["ConfigFadeNonTargeted"] = true end if (_type(_tSettings["ConfigDynamicVPos"]) ~= "boolean") then _tSettings["ConfigDynamicVPos"] = true end if (_type(_tSettings["ConfigLargeShield"]) ~= "boolean") then _tSettings["ConfigLargeShield"] = false end if (_type(_tSettings["ConfigHealthPct"]) ~= "boolean") then _tSettings["ConfigHealthPct"] = false end if (_type(_tSettings["ConfigSimpleWhenHealthy"]) ~= "boolean") then _tSettings["ConfigSimpleWhenHealthy"] = false end if (_type(_tSettings["ConfigSimpleWhenFullShield"]) ~= "boolean") then _tSettings["ConfigSimpleWhenFullShield"] = false end if (_type(_tSettings["ConfigAggroIndication"]) ~= "boolean") then _tSettings["ConfigAggroIndication"] = false end if (_type(_tSettings["ConfigHideAffiliations"]) ~= "boolean") then _tSettings["ConfigHideAffiliations"] = false end if (_type(_tSettings["ConfigAlternativeFont"]) ~= "boolean") then _tSettings["ConfigAlternativeFont"] = false end if (_type(_tSettings["ConfigLegacyTargeting"]) ~= "boolean") then _tSettings["ConfigLegacyTargeting"] = false end if (_type(_tSettings["ConfigCleanseIndicator"]) ~= "boolean") then _tSettings["ConfigCleanseIndicator"] = false end if (_type(_tSettings["SliderDrawDistance"]) ~= "number") then _tSettings["SliderDrawDistance"] = 100 end if (_type(_tSettings["SliderLowHealth"]) ~= "number") then _tSettings["SliderLowHealth"] = 30 end if (_type(_tSettings["SliderLowHealthFriendly"]) ~= "number") then _tSettings["SliderLowHealthFriendly"] = 0 end if (_type(_tSettings["SliderVerticalOffset"]) ~= "number") then _tSettings["SliderVerticalOffset"] = 20 end if (_type(_tSettings["SliderBarScale"]) ~= "number") then _tSettings["SliderBarScale"] = 100 end if (_type(_tSettings["SliderFontSize"]) ~= "number") then _tSettings["SliderFontSize"] = 1 end --[[ for i, category in _ipairs(_tUiElements) do for j, filter in _ipairs(_tUnitCategories) do local l_key = category .. filter if (type(_tSettings[l_key]) ~= "number") then _tSettings[l_key] = 3 end end end]] for _, tUiElement in _pairs(_tUiElements) do for _, strUiElementCategory in _pairs(tUiElement) do if (_type(_tSettings[strUiElementCategory]) ~= "number") then _tSettings[strUiElementCategory] = 3 end end end end function TwinkiePlates:InitConfiguration() _wndConfigUi = Apollo.LoadForm(self.xmlDoc, "Configuration", nil, self) _wndConfigUi:Show(false) local wndConfigurationMatrix = _wndConfigUi:FindChild("MatrixConfiguration") -- Matrix layout self:DistributeMatrixColumns(wndConfigurationMatrix:FindChild("RowNames")) for strUiElementName, tUiElement in _pairs(_tUiElements) do local wndCategoryContainer = wndConfigurationMatrix:FindChild(strUiElementName) self:DistributeMatrixColumns(wndCategoryContainer, strUiElementName) end for k, v in _pairs(_tSettings) do if (string.starts(k, "Config")) then local l_button = _wndConfigUi:FindChild(k) if (l_button ~= nil) then l_button:SetCheck(v) end elseif (string.starts(k, "Slider")) then local l_slider = _wndConfigUi:FindChild(k) if (l_slider ~= nil) then l_slider:FindChild("SliderBar"):SetValue(v) end end end end function TwinkiePlates:DistributeMatrixColumns(wndElementRow, p_categoryName) -- local l_columns = (1 / #_tUnitCategories) for i, filter in _ipairs(_tUnitCategories) do -- local l_left = l_columns * (i - 1) -- local l_right = l_columns * i local l_button = wndElementRow:FindChild(filter) -- l_button:SetAnchorPoints(l_left, 0, l_right, 1) -- l_button:SetAnchorOffsets(1, 1, -1, -1) if (p_categoryName ~= nil) then local l_value = _tSettings[p_categoryName .. filter] or 0 l_button:SetSprite(_matrixButtonSprites[l_value]) l_button:SetStyle("IgnoreTooltipDelay", true) l_button:SetTooltip(self:GetMatrixTooltip(l_value)) end end end function TwinkiePlates:GetMatrixTooltip(nValue) if (nValue == 0) then return "Never enabled" end if (nValue == 1) then return "Enabled in combat" end if (nValue == 2) then return "Enabled out of combat" end if (nValue == 3) then return "Always enabled" end return "?" end function TwinkiePlates:DistanceToUnit(unitNameplateOwner) if (unitNameplateOwner == nil) then return 0 end local l_pos = unitNameplateOwner:GetPosition() if (l_pos == nil) then return 0 end if (l_pos.x == 0) then return 0 end local deltaPos = Vector3.New(l_pos.x - _playerPos.x, l_pos.y - _playerPos.y, l_pos.z - _playerPos.z) return deltaPos:Length() end ------------------------------------------------------------------------------- function TwinkiePlates:FormatNumber(p_number) if (p_number == nil) then return "" end local l_result = p_number if p_number < 1000 then l_result = p_number elseif p_number < 1000000 then l_result = _weaselStr("$1f1k", p_number / 1000) elseif p_number < 1000000000 then l_result = _weaselStr("$1f1m", p_number / 1000000) elseif p_number < 1000000000000 then l_result = _weaselStr("$1f1b", p_number / 1000000) end return l_result end function TwinkiePlates:UpdateTextNameGuild(tNameplate) local bShowTitle = GetFlag(tNameplate.nMatrixFlags, F_TITLE) local bShowGuild = GetFlag(tNameplate.nMatrixFlags, F_GUILD) local bHideAffiliation = _tSettings["ConfigHideAffiliations"] local unitNameplateOwner = tNameplate.unitNameplateOwner local strUnitName = bShowTitle and unitNameplateOwner:GetTitleOrName() or unitNameplateOwner:GetName() local strGuildName local nFontSize = _tSettings["SliderFontSize"] local tFontSettings = _tSettings["ConfigAlternativeFont"] and _fontSecondary or _fontPrimary local nWidth = _textWidth(tFontSettings[nFontSize].font, strUnitName .. " ") --[[ if (tNameplate.unitNameplateOwner == _unitPlayer) then Print("Updating title/guild text: " .. tostring(bShowTitle) .. " " .. tostring(bShowGuild)) end ]] if (bShowGuild and tNameplate.bIsPlayer) then strGuildName = unitNameplateOwner:GetGuildName() and ("<" .. unitNameplateOwner:GetGuildName() .. ">") or nil elseif (bShowGuild and not bHideAffiliation and not tNameplate.bIsPlayer) then strGuildName = unitNameplateOwner:GetAffiliationName() or nil end tNameplate.wndUnitNameText:SetText(strUnitName) tNameplate.wndUnitNameText:SetAnchorOffsets(0, 0, nWidth, 0) local l_hasGuild = strGuildName ~= nil and (_strLen(strGuildName) > 0) if (tNameplate.textUnitGuild:IsVisible() ~= l_hasGuild) then tNameplate.textUnitGuild:Show(l_hasGuild) tNameplate.bRearrange = true end if (l_hasGuild) then tNameplate.textUnitGuild:SetTextRaw(strGuildName) end end function TwinkiePlates:UpdateTextLevel(p_nameplate) local l_level = p_nameplate.unitNameplateOwner:GetLevel() if (l_level ~= nil) then l_level = --[[ "Lv" .. --]] l_level .. " " local l_fontSize = _tSettings["SliderFontSize"] local l_font = _tSettings["ConfigAlternativeFont"] and _fontSecondary or _fontPrimary local l_width = _textWidth(l_font[l_fontSize].font, l_level) p_nameplate.levelWidth = l_width p_nameplate.textUnitLevel:SetText(l_level) else p_nameplate.levelWidth = 1 p_nameplate.textUnitLevel:SetText("") end end function TwinkiePlates:InitClassRankIcon(tNameplate) local tIconMappingTable = tNameplate.bIsPlayer and _tFromPlayerClassToIcon or _tFromNpcRankToIcon local strIconRef = tIconMappingTable[tNameplate.unitClassID] tNameplate.wndClassRankIcon:Show(strIconRef ~= nil) tNameplate.wndClassRankIcon:SetSprite(strIconRef ~= nil and strIconRef or "") end --[[ function TwinkiePlates:OnCharacterFlagsUpdated(strRandomVar) Print("OnCharacterFlagsUpdated; strRandomVar: " .. tostring(strRandomVar)) end ]] function TwinkiePlates:OnCCStateApplied(nCcId, unitNameplateOwner) if (_ccWhiteList[nCcId] == nil) then return end local l_nameplate = self.tNameplates[unitNameplateOwner:GetId()] if (l_nameplate ~= nil) then if (GetFlag(l_nameplate.nMatrixFlags, F_CC_BAR)) then self:RegisterCc(l_nameplate, nCcId) end end if (_tTargetNameplate ~= nil and _tTargetNameplate.unitNameplateOwner == unitNameplateOwner) then if (GetFlag(_tTargetNameplate.nMatrixFlags, F_CC_BAR)) then self:RegisterCc(_tTargetNameplate, nCcId) end end end function TwinkiePlates:RegisterCc(tNameplate, nCcId) local strCcNewName = _ccWhiteList[nCcId] if (strCcNewName) then -- Register the new CC only if there no MoO already ongoning. The CC duration check is performed in the UpdateCc method if (tNameplate.nCcNewId == -1 or (tNameplate.nCcNewId ~= -1 and tNameplate.nCcActiveId ~= Unit.CodeEnumCCState.Vulnerability and tNameplate.nCcNewId ~= Unit.CodeEnumCCState.Vulnerability)) then tNameplate.nCcNewId = nCcId end end end function TwinkiePlates:UpdateCc(tNameplate) local nCcNewDuration = tNameplate.nCcNewId >= 0 and tNameplate.unitNameplateOwner:GetCCStateTimeRemaining(tNameplate.nCcNewId) or 0 tNameplate.nCcDuration = tNameplate.nCcActiveId >= 0 and tNameplate.unitNameplateOwner:GetCCStateTimeRemaining(tNameplate.nCcActiveId) or 0 if (nCcNewDuration <= 0 and tNameplate.nCcNewId ~= -1) then tNameplate.nCcNewId = -1 end if (tNameplate.nCcDuration <= 0 and tNameplate.nCcActiveId ~= -1) then tNameplate.nCcActiveId = -1 end local strCcActiveName = _ccWhiteList[tNameplate.nCcActiveId] local strCcNewName = _ccWhiteList[tNameplate.nCcNewId] local bShowCcBar = (strCcActiveName and tNameplate.nCcDuration > 0) or (strCcNewName and nCcNewDuration > 0) if (tNameplate.wndContainerCc:IsVisible() ~= bShowCcBar) then tNameplate.wndContainerCc:Show(bShowCcBar) tNameplate.bRearrange = true end if (bShowCcBar) then local bUpdateCc = not tNameplate.nCcDurationMax or tNameplate.nCcActiveId == -1 or (tNameplate.nCcNewId == Unit.CodeEnumCCState.Vulnerability) or ((nCcNewDuration and nCcNewDuration > tNameplate.nCcDuration) and tNameplate.nCcActiveId ~= Unit.CodeEnumCCState.Vulnerability) -- New CC has a longer duration than the previous one (if any) and the current CC state is not a MoO if (bUpdateCc) then tNameplate.nCcDurationMax = nCcNewDuration tNameplate.nCcDuration = nCcNewDuration tNameplate.nCcActiveId = tNameplate.nCcNewId tNameplate.nCcNewId = -1 tNameplate.wndContainerCc:SetText(strCcNewName) tNameplate.wndCcBar:SetMax(nCcNewDuration) end -- Update the CC progress bar tNameplate.wndCcBar:SetProgress(tNameplate.nCcDuration) end end function TwinkiePlates:UpdateCasting(tNameplate) local bCastingBarConfiguration = GetFlag(tNameplate.nMatrixFlags, F_CASTING_BAR) local bShowCastBar = tNameplate.unitNameplateOwner:ShouldShowCastBar() and bCastingBarConfiguration if (tNameplate.containerCastBar:IsVisible() ~= bShowCastBar) then tNameplate.containerCastBar:Show(bShowCastBar) tNameplate.bRearrange = true end if (bShowCastBar) then local bIsCcVulnerable = tNameplate.unitNameplateOwner:GetInterruptArmorMax() >= 0 -- tNameplate.wndNameplate:ToFront() tNameplate.wndCastBar:SetBarColor(bIsCcVulnerable and "xkcdDustyOrange" or _color("ff990000")) tNameplate.wndCastBar:SetProgress(tNameplate.unitNameplateOwner:GetCastTotalPercent()) tNameplate.containerCastBar:SetText(tNameplate.unitNameplateOwner:GetCastName()) end end function TwinkiePlates:UpdateInterruptArmor(tNameplate) local nArmorMax = tNameplate.unitNameplateOwner:GetInterruptArmorMax() local nCurrentInterruptArmor = tNameplate.unitNameplateOwner:GetInterruptArmorValue() local bShowArmor = GetFlag(tNameplate.nMatrixFlags, F_ARMOR) and --[[nArmorMax]] (nCurrentInterruptArmor ~= 0 or nArmorMax == -1) if (tNameplate.iconArmor:IsVisible() ~= bShowArmor) then tNameplate.iconArmor:Show(bShowArmor) end if (not bShowArmor) then tNameplate.prevArmor = 0 return end if (nCurrentInterruptArmor --[[nArmorMax]] > 0) then -- p_nameplate.iconArmor:SetText(p_nameplate.unitNameplateOwner:GetInterruptArmorValue()) tNameplate.iconArmor:SetText(nCurrentInterruptArmor) end if (tNameplate.prevArmor ~= nArmorMax) then tNameplate.prevArmor = nArmorMax if (nArmorMax == -1) then tNameplate.iconArmor:SetText("") tNameplate.iconArmor:SetSprite("NPrimeNameplates_Sprites:IconArmor_02") elseif (nArmorMax > 0) then tNameplate.iconArmor:SetSprite("NPrimeNameplates_Sprites:IconArmor") end end end function TwinkiePlates:UpdateOpacity(tNameplate, bHasTextBubble) if (tNameplate.bIsTargetNameplate) then return end bHasTextBubble = bHasTextBubble or false if (bHasTextBubble) then tNameplate.wndNameplate:SetOpacity(0.25, 10) else local l_opacity = 1 if (_tSettings["ConfigFadeNonTargeted"] and _unitPlayer:GetTarget() ~= nil) then l_opacity = 0.6 end tNameplate.wndNameplate:SetOpacity(l_opacity, 10) end end function TwinkiePlates:UpdateIconsNpc(tNameplate) local nFlags = 0 local nIcons = 0 local tRewardInfo = tNameplate.unitNameplateOwner:GetRewardInfo() if (tRewardInfo ~= nil and _next(tRewardInfo) ~= nil) then for i = 1, #tRewardInfo do local strType = tRewardInfo[i].strType if (strType == _playerPath) then nIcons = nIcons + 1 nFlags = SetFlag(nFlags, F_PATH) elseif (strType == "Quest") then nIcons = nIcons + 1 nFlags = SetFlag(nFlags, F_QUEST) elseif (strType == "Challenge") then local l_ID = tRewardInfo[i].idChallenge local l_challenge = self.challenges[l_ID] if (l_challenge ~= nil and l_challenge:IsActivated()) then nIcons = nIcons + 1 nFlags = SetFlag(nFlags, F_CHALLENGE) end end end end tNameplate.bIsObjective = nFlags > 0 if (nFlags ~= tNameplate.iconFlags) then tNameplate.iconFlags = nFlags tNameplate.containerIcons:DestroyAllPixies() local l_height = tNameplate.containerIcons:GetHeight() local l_width = 1 / nIcons local l_iconN = 0 tNameplate.containerIcons:SetAnchorOffsets(0, 0, nIcons * l_height, 0) if (GetFlag(nFlags, F_CHALLENGE)) then self:AddIcon(tNameplate, "IconChallenge", l_iconN, l_width) l_iconN = l_iconN + 1 end if (GetFlag(nFlags, F_PATH)) then self:AddIcon(tNameplate, "IconPath", l_iconN, l_width) l_iconN = l_iconN + 1 end if (GetFlag(nFlags, F_QUEST)) then self:AddIcon(tNameplate, "IconQuest", l_iconN, l_width) l_iconN = l_iconN + 1 end end end function TwinkiePlates:UpdateIconsPc(tNameplate) local nConfigurationFlags = 0 local nIconsCounter = 0 if (tNameplate.unitNameplateOwner:IsFriend() or tNameplate.unitNameplateOwner:IsAccountFriend()) then nIconsCounter = nIconsCounter + 1 nConfigurationFlags = SetFlag(nConfigurationFlags, F_FRIEND) end if (tNameplate.unitNameplateOwner:IsRival()) then nIconsCounter = nIconsCounter + 1 nConfigurationFlags = SetFlag(nConfigurationFlags, F_RIVAL) end if (nConfigurationFlags ~= tNameplate.iconFlags) then tNameplate.iconFlags = nConfigurationFlags tNameplate.containerIcons:DestroyAllPixies() local nIconsContainerHeight = tNameplate.containerIcons:GetHeight() local nIconsContainerWidth = 1 / nIconsCounter local nIconPos = 0 tNameplate.containerIcons:SetAnchorOffsets(0, 0, nIconsCounter * nIconsContainerHeight, 0) if (GetFlag(nConfigurationFlags, F_FRIEND)) then self:AddIcon(tNameplate, "IconFriend", nIconPos, nIconsContainerWidth) nIconPos = nIconPos + 1 end if (GetFlag(nConfigurationFlags, F_RIVAL)) then self:AddIcon(tNameplate, "IconRival", nIconPos, nIconsContainerWidth) nIconPos = nIconPos + 1 end end end function TwinkiePlates:AddIcon(p_nameplate, p_sprite, p_iconN, p_width) _iconPixie.strSprite = p_sprite _iconPixie.loc.fPoints[1] = p_iconN * p_width _iconPixie.loc.fPoints[3] = (p_iconN + 1) * p_width p_nameplate.containerIcons:AddPixie(_iconPixie) end function TwinkiePlates:HasHealth(unitNameplateOwner) if (unitNameplateOwner == nil or not unitNameplateOwner:IsValid()) then return false end if (unitNameplateOwner:GetMouseOverType() == "Simple" or unitNameplateOwner:GetMouseOverType() == "SimpleCollidable") then return false end if (unitNameplateOwner:IsDead()) then return false end local nUnitMaxHealth = unitNameplateOwner:GetMaxHealth() if (nUnitMaxHealth == nil or nUnitMaxHealth == 0) then return false end return true end function TwinkiePlates:GetNameplateVisibility(tNameplate) if (_bIsPlayerBlinded) then return false end local unitTarget = _unitPlayer:GetTarget() -- return false if the nameplate is targeted by the player. Targeted nameplate is handled by _TargetNP if (unitTarget == tNameplate.unitNameplateOwner and not tNameplate.bIsTargetNameplate) then return false end if (not tNameplate.bIsOnScreen) then return false end if (_tSettings["ConfigOcclusionCulling"] and tNameplate.bIsOccluded) then return false end if (tNameplate.bIsUnitOutOfRange) then return false end -- if this is the target nameplate if (tNameplate.bIsTargetNameplate) then -- return true if this still is the player's target nameplate return unitTarget == tNameplate.unitNameplateOwner end if (not GetFlag(tNameplate.nMatrixFlags, F_NAMEPLATE)) then return tNameplate.bHasActivationState or tNameplate.bIsObjective end if (tNameplate.unitNameplateOwner:IsDead() or (tNameplate.nCurrHealth and tNameplate.nCurrHealth <= 0)) then return false end if (tNameplate.bForcedHideDisplayToggle ~= nil) then return tNameplate.bForcedHideDisplayToggle end -- Uninportant NPCs handling local bIsFriendly = tNameplate.eDisposition == Unit.CodeEnumDisposition.Friendly if (not tNameplate.bIsPlayer and bIsFriendly) then return tNameplate.bHasActivationState or tNameplate.bIsObjective end return true end function TwinkiePlates:InitAnchoring(tNameplate, nCodeEnumFloaterLocation) local tAnchorUnit = tNameplate.unitNameplateOwner:IsMounted() and tNameplate.unitNameplateOwner:GetUnitMount() or tNameplate.unitNameplateOwner if (self.nameplacer or nCodeEnumFloaterLocation) then if (not nCodeEnumFloaterLocation) then local tNameplatePositionSetting = self.nameplacer:GetUnitNameplatePositionSetting(tNameplate.unitNameplateOwner:GetName()) if (tNameplatePositionSetting and tNameplatePositionSetting["nAnchorId"]) then nCodeEnumFloaterLocation = tNameplatePositionSetting["nAnchorId"] end end if (nCodeEnumFloaterLocation and (nCodeEnumFloaterLocation ~= tNameplate.nAnchorId or tAnchorUnit ~= tNameplate.unitNameplateOwner)) then tNameplate.nAnchorId = nCodeEnumFloaterLocation tNameplate.wndNameplate:SetUnit(tAnchorUnit, tNameplate.nAnchorId) return end end tNameplate.nAnchorId = 1 tNameplate.wndNameplate:SetUnit(tAnchorUnit, tNameplate.nAnchorId) end function TwinkiePlates:GetUnitCategoryType(unitNameplateOwner) if (unitNameplateOwner == nil or not unitNameplateOwner:IsValid()) then return "Hidden" end if (unitNameplateOwner:CanBeHarvestedBy(_unitPlayer)) then return _tSettings["ConfigShowHarvest"] and "Other" or "Hidden" end if (unitNameplateOwner:IsThePlayer()) then return "Self" end -- Not using GameLib.GetTarget() cause it seems to return a copy of the original unit and that can be more resource intensive - untested if (_unitPlayer and _unitPlayer:GetTarget() == unitNameplateOwner) then return "Target" end if (unitNameplateOwner:IsInYourGroup()) then return "Group" end local strUnitType = unitNameplateOwner:GetType() if (strUnitType == "BindPoint") then return "Other" end if (strUnitType == "PinataLoot") then return "Other" end if (strUnitType == "Ghost") then return "Hidden" end if (strUnitType == "Mount") then return "Hidden" end -- Some interactable objects are identified as NonPlayer -- This hack is done to prevent display the nameplate for this kind of units if (strUnitType == "NonPlayer" and not unitNameplateOwner:GetUnitRaceId() and not unitNameplateOwner:GetLevel()) then return "Hidden" end local eDisposition = unitNameplateOwner:GetDispositionTo(_unitPlayer) local bIsCharacter = unitNameplateOwner:IsACharacter() local strPcOrNpc = (bIsCharacter) and "Pc" or "Npc" if (_tDisplayHideExceptionUnitNames[unitNameplateOwner:GetName()] ~= nil) then return _tDisplayHideExceptionUnitNames[unitNameplateOwner:GetName()] and _tDispositionToString[eDisposition][strPcOrNpc] or "Hidden" end local tRewardInfo = unitNameplateOwner:GetRewardInfo() if (tRewardInfo ~= nil and _next(tRewardInfo) ~= nil) then for i = 1, #tRewardInfo do if (tRewardInfo[i].strType ~= "Challenge") then return _tDispositionToString[eDisposition][strPcOrNpc] end end end if (bIsCharacter or self:HasActivationState(unitNameplateOwner)) then return _tDispositionToString[eDisposition][strPcOrNpc] end if (unitNameplateOwner:GetHealth() == nil) then return "Hidden" end local l_archetype = unitNameplateOwner:GetArchetype() -- Returning Friendly/Neutral/Hostile .. Pc/Npc if (l_archetype ~= nil) then return _tDispositionToString[eDisposition][strPcOrNpc] end return "Hidden" end function TwinkiePlates:GetNameplateCategoryType(tNameplate) local unitNameplateOwner = tNameplate.unitNameplateOwner if (unitNameplateOwner == nil or not unitNameplateOwner:IsValid()) then return "Hidden" end -- Top priority checks: -- 1) Self (Player) -- 2) Player's target -- 3) Group if (tNameplate.strUnitCategory == "Self") then return tNameplate.strUnitCategory end -- TODO Replace this check with a more consistent one if (_unitPlayer and _unitPlayer:GetTarget() == tNameplate) then return "Target" end if (tNameplate.bIsInGroup) then return "Group" end -- Harvesting nodes if (unitNameplateOwner:CanBeHarvestedBy(_unitPlayer)) then return _tSettings["ConfigShowHarvest"] and "Other" or "Hidden" end local eDisposition = tNameplate.eDisposition local bIsCharacter = tNameplate.bIsPlayer local strPcOrNpc = (bIsCharacter) and "Pc" or "Npc" local strUnitCategory = _tDispositionToString[eDisposition][strPcOrNpc] -- Forced exceptions (hide/show) if (tNameplate.bForcedHideDisplayToggle ~= nil) then return tNameplate.bForcedHideDisplayToggle and strUnitCategory or "Hidden" end -- Objectives --[[ local tRewardInfo = unitNameplateOwner:GetRewardInfo() if (tRewardInfo ~= nil and _next(tRewardInfo) ~= nil) then for i = 1, #tRewardInfo do if (tRewardInfo[i].strType ~= "Challenge") then return strUnitCategory end end end]] -- Interactables if (bIsCharacter or tNameplate.bHasActivationState) then return strUnitCategory end -- Dead creatures if (tNameplate.nCurrHealth == nil) then return "Hidden" end return strUnitCategory end function TwinkiePlates:SetCombatState(tNameplate, bIsInCombat) -- Do nothing because combat state change event is too unreliable for PCs -- Combat state change detection is performed on frame --[[ if (tNameplate == nil) then return end -- If combat state changed if (tNameplate.bIsInCombat ~= bIsInCombat) then tNameplate.bIsInCombat = bIsInCombat tNameplate.nMatrixFlags = self:GetCombatStateDependentFlags(tNameplate) self:UpdateTextNameGuild(tNameplate) self:UpdateTopContainer(tNameplate) end self:UpdateHealthShieldText(tNameplate) ]] end function TwinkiePlates:HasActivationState(unitNameplateOwner) local tActivationStates = unitNameplateOwner:GetActivationState() if (_next(tActivationStates) == nil) then return false end local bShow = false for strState, a in _pairs(tActivationStates) do if (strState == "Busy") then return false end if (not _asbl[strState]) then bShow = true end end return bShow end function TwinkiePlates:SetProgressBar(p_bar, p_current, p_max) p_bar:SetMax(p_max) p_bar:SetProgress(p_current) end function TwinkiePlates:SetNameplateVerticalOffset(tNameplate, nVerticalOffset, nNameplacerVerticalOffset) tNameplate.wndNameplate:SetAnchorOffsets(-200, -75 - nVerticalOffset - nNameplacerVerticalOffset, 200, 75 - nVerticalOffset - nNameplacerVerticalOffset) if self.perspectivePlates then local bounds = {} bounds.left = -200 bounds.top = -75 - nVerticalOffset - nNameplacerVerticalOffset bounds.right = 200 bounds.bottom = 75 - nVerticalOffset - nNameplacerVerticalOffset tNameplate.unitOwner = tNameplate.unitNameplateOwner self.perspectivePlates:OnRequestedResize(tNameplate, 1, bounds) end end function TwinkiePlates:AllocateNameplate(unitNameplateOwner) if (self.tNameplates[unitNameplateOwner:GetId()] == nil) then local strUnitCategoryType = self:GetUnitCategoryType(unitNameplateOwner) if (strUnitCategoryType ~= "Hidden") then local l_nameplate = self:InitNameplate(unitNameplateOwner, _tableRemove(self.pool) or nil) self.tNameplates[unitNameplateOwner:GetId()] = l_nameplate end end end function TwinkiePlates:OnUnitDestroyed(unitNameplateOwner) local tNameplate = self.tNameplates[unitNameplateOwner:GetId()] if (tNameplate == nil) then return end if (#self.pool < 50) then tNameplate.wndNameplate:Show(false, true) tNameplate.wndNameplate:SetUnit(nil) tNameplate.wndUnitNameText:SetData(nil) tNameplate.wndHealthProgressBar:SetData(nil) tNameplate.bIsVerticalOffsetUpdated = nil _tableInsert(self.pool, tNameplate) else tNameplate.wndNameplate:Destroy() end self.tNameplates[unitNameplateOwner:GetId()] = nil end function TwinkiePlates:UpdateMainContainerHeightWithHealthText(p_nameplate) -- local l_fontSize = _tSettings["SliderFontSize"] -- local l_zoomSliderH = _tSettings["SliderBarScale"] / 10 -- local l_shieldHeight = p_nameplate.bHasShield and l_zoomSliderH * 1.3 or l_zoomSliderH -- local l_healthTextFont = _tSettings["ConfigAlternativeFont"] and _fontSecondary or _fontPrimary -- local l_healthTextHeight = _tSettings["ConfigHealthText"] and (l_healthTextFont[l_fontSize].height * 0.75) or 0 -- p_nameplate.wndHealthProgressBar:SetAnchorOffsets(0, 0, 0, --[[l_shieldHeight + l_healthTextHeight]] p_nameplate.bHasShield and 0 or -4) p_nameplate.wndHealthText:Show(true) end function TwinkiePlates:UpdateMainContainerHeightWithoutHealthText(p_nameplate) -- Reset text -- Set container height without text -- local l_zoomSliderH = _tSettings["SliderBarScale"] / 10 -- local l_shieldHeight = p_nameplate.bHasShield and l_zoomSliderH * 1.3 or l_zoomSliderH -- p_nameplate.wndContainerMain:SetAnchorOffsets(144, -5, -144, --[[l_shieldHeight]] 16) p_nameplate.wndHealthText:Show(false) end ------------------------------------------------------------------------------- --------------------------------------------------------------------------------------------------- -- Configuration Functions --------------------------------------------------------------------------------------------------- function TwinkiePlates:OnButtonSignalShowInfoPanel(wndHandler, wndControl, eMouseButton) end local TwinkiePlatesInst = TwinkiePlates:new() TwinkiePlatesInst:Init() function table.val_to_str(v) if "string" == type(v) then v = string.gsub(v, "\n", "\\n") if string.match(string.gsub(v, "[^'\"]", ""), '^"+$') then return "'" .. v .. "'" end return '"' .. string.gsub(v, '"', '\\"') .. '"' else return "table" == type(v) and table.tostring(v) or tostring(v) end end function table.key_to_str(k) if "string" == type(k) and string.match(k, "^[_%a][_%a%d]*$") then return k else return "[" .. table.val_to_str(k) .. "]" end end function table.tostring(tbl) if (not tbl) then return "nil" end local result, done = {}, {} for k, v in ipairs(tbl) do table.insert(result, table.val_to_str(v)) done[k] = true end for k, v in pairs(tbl) do if not done[k] then table.insert(result, table.key_to_str(k) .. "=" .. table.val_to_str(v)) end end return "{" .. table.concat(result, ",") .. "}" end
mit
lichtl/darkstar
scripts/zones/Northern_San_dOria/npcs/Vamorcote.lua
13
2690
----------------------------------- -- Area: Northern San d'Oria -- NPC: Vamorcote -- Starts and Finishes Quest: The Setting Sun -- @zone 231 -- @pos -137.070 10.999 161.855 -- -- Auto-Script: Requires Verification (Verified by Brawndo) ----------------------------------- package.loaded["scripts/zones/Northern_San_dOria/TextIDs"] = nil; ----------------------------------- require("scripts/globals/quests"); require("scripts/globals/settings"); require("scripts/zones/Northern_San_dOria/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) -- "The Setting Sun" conditional script if (player:getQuestStatus(SANDORIA,THE_SETTING_SUN) == QUEST_ACCEPTED) then if (trade:hasItemQty(535,1) and trade:getItemCount() == 1) then player:startEvent (0x0292) end; end; end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) -- Look at the "The Setting Sun" quest status and San d'Oria player's fame theSettingSun = player:getQuestStatus(SANDORIA,THE_SETTING_SUN); if (theSettingSun == QUEST_AVAILABLE and player:getFameLevel(SANDORIA) >= 5 and player:getQuestStatus(SANDORIA, BLACKMAIL) ~= QUEST_COMPLETED) then player:startEvent(0x028e,0,535,535); --The quest is offered to the player. elseif (theSettingSun == QUEST_ACCEPTED) then player:startEvent(0x028f,0,0,535); --The NPC asks if the player got the key.' elseif (theSettingSun == QUEST_COMPLETED and player:needToZone()) then player:startEvent(0x0293); --The quest is already done by the player and the NPC does small talks. else player:startEvent(0x028b); end; end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); if (csid == 0x028e and option == 1) then --Player accepts the quest player:addQuest(SANDORIA,THE_SETTING_SUN); elseif (csid == 0x0292) then --The player trades the Engraved Key to the NPC. Here come the rewards! player:tradeComplete(); player:addGil(GIL_RATE*10000); player:messageSpecial(GIL_OBTAINED,GIL_RATE*10000); player:addFame(SANDORIA,30); player:completeQuest(SANDORIA,THE_SETTING_SUN); end; end;
gpl-3.0
raingloom/yaoui
examples/anime/main.lua
2
15447
yui = require 'yaoui' function love.load() yui.UI.registerEvents() love.graphics.setBackgroundColor(23, 24, 27) love.window.setMode(1200, 755) -- Create anime grid anime_view = generateAnimeGrid('All') -- Create top left tabs bar tabs_bar = yui.View(0, 0, 600, 80, { yui.Stack({ bottom = { yui.Flow({ yui.Tabs({ tabs = { {text = 'All', hover = 'All', onClick = function(self) anime_view = regenerateAnimeGrid('All') end}, {text = 'Action', hover = 'Action', onClick = function(self) anime_view = regenerateAnimeGrid({'Action'}) end}, {text = 'Fantasy', hover = 'Fantasy', onClick = function(self) anime_view = regenerateAnimeGrid({'Fantasy'}) end}, {text = 'Magic', hover = 'Magic', onClick = function(self) anime_view = regenerateAnimeGrid({'Magic'}) end}, {text = 'Sci-Fi', hover = 'Sci-Fi', onClick = function(self) anime_view = regenerateAnimeGrid({'Sci-Fi'}) end}, {text = 'Shounen', hover = 'Shounen', onClick = function(self) anime_view = regenerateAnimeGrid({'Shounen'}) end}, {text = 'Super Power', hover = 'Super Power', onClick = function(self) anime_view = regenerateAnimeGrid({'Super Power'}) end}, {text = 'Supernatural', hover = 'Supernatural', onClick = function(self) anime_view = regenerateAnimeGrid({'Supernatural'}) end}, } }), }), } }) }) -- Create top right dropdown + settings bar right_bar = yui.View(600, 0, 600, 80, { yui.Stack({ bottom = { yui.Flow({margin_right = 10, spacing = 5, yui.Dropdown({ options = { 'All', 'Action', 'Adventure', 'Comedy', 'Drama', 'Fantasy', 'Historical', 'Horror', 'Magic', 'Mecha', 'Military', 'Music', 'Mystery', 'Parody', 'Police', 'Psychological', 'Romance', 'Samurai', 'School', 'Sci-Fi', 'Seinen', 'Shounen', 'Slice of Life', 'Space', 'Sports', 'Super Power', 'Supernatural', 'Thriller', }, onSelect = function(self, option) if option == 'All' then anime_view = regenerateAnimeGrid(option) else anime_view = regenerateAnimeGrid({option}) end end, }), right = { yui.IconButton({icon = 'fa-cutlery', hover = 'PORN', size = 28}), yui.IconButton({icon = 'fa-eye', hover = 'PORN', size = 28}), yui.HorizontalSpacing({w = 1}), yui.IconButton({icon = 'fa-wheelchair', hover = 'PORN', size = 28}), yui.IconButton({icon = 'fa-bell', hover = 'the Bells of Awakening', size = 28}), yui.IconButton({icon = 'fa-tree', hover = 'PORN', size = 28}), yui.IconButton({icon = 'fa-cog', hover = 'Settings', size = 28}), }, }) } }) }) -- Store ImageButton objects so that they don't have to be recreated on regeneration -- Recreating too many objects (which would happen if we recreated them on every regeneration) -- currently bugs Thranduil out and I haven't figured out a fix animes = {} for i = 1, 8 do table.insert(animes, anime_view[1][1][i]) end for i = 1, 8 do table.insert(animes, anime_view[1][2][i]) end for i = 1, 8 do table.insert(animes, anime_view[1][3][i]) end end function love.update(dt) yui.update({anime_view, tabs_bar, right_bar}) anime_view:update(dt) tabs_bar:update(dt) right_bar:update(dt) end function love.draw() anime_view:draw() love.graphics.setColor(unpack(yui.Theme.colors.hover_bg)) love.graphics.rectangle('fill', 0, 0, 1200, 80) love.graphics.setColor(255, 255, 255) tabs_bar:draw() right_bar:draw() end function regenerateAnimeGrid(genres_filter) local animeGenreInGenresFilter = function(anime_genres, genres_filter) for _, genre in ipairs(anime_genres) do for _, filter_genre in ipairs(genres_filter) do if genre == filter_genre then return true end end end end local anime_info = getAnimeInfo() local grid = {} for i = 1, 24 do local insert_current_anime = false if genres_filter == 'All' then insert_current_anime = true elseif animeGenreInGenresFilter(anime_info[i].genres, genres_filter) then insert_current_anime = true end if insert_current_anime then table.insert(grid, animes[i]) end end local rows = {} rows[1], rows[2], rows[3] = {}, {}, {} for i = 1, 8 do table.insert(rows[1], grid[i]) end for i = 9, 16 do table.insert(rows[2], grid[i]) end for i = 17, 24 do table.insert(rows[3], grid[i]) end local anime_view = yui.View(0, 80, 1200, 755, { yui.Stack({ yui.Flow(rows[1]), yui.Flow(rows[2]), yui.Flow(rows[3]), }) }) return anime_view end function generateAnimeGrid() local anime_info = getAnimeInfo() local grid = {} for i = 1, 24 do table.insert(grid, yui.ImageButton({ image = anime_info[i].image, w = 150, h = 225, ix = anime_info[i].image_offsets[1] or 0, iy = anime_info[i].image_offsets[2] or 0, onClick = function(self) love.system.openURL(anime_info[i].link) end, overlayNew = function(self) self.font_awesome_font = love.graphics.newFont(self.yui.Theme.font_awesome_path, 14) self.overlay_font = love.graphics.newFont(self.yui.Theme.open_sans_bold, 14) self.title = anime_info[i].title self.score = anime_info[i].score end, overlay = function(self) -- Draw overlay rectangle love.graphics.setColor(50, 50, 50, self.alpha/3) love.graphics.rectangle('fill', self.x, self.y, self.w, self.h) -- Draw title if self.title then local r, g, b = unpack(self.yui.Theme.colors.text_light) love.graphics.setColor(r, g, b, self.alpha) love.graphics.setFont(self.overlay_font) if type(self.title) == 'string' then love.graphics.print(self.title, self.x + self.w - self.overlay_font:getWidth(self.title) - 10, self.y + 5) elseif type(self.title) == 'table' then love.graphics.print(self.title[1], self.x + self.w - self.overlay_font:getWidth(self.title[1]) - 10, self.y + 5) love.graphics.print(self.title[2], self.x + self.w - self.overlay_font:getWidth(self.title[2]) - 10, self.y + self.overlay_font:getHeight() + 5) end love.graphics.setColor(255, 255, 255, 255) end -- Draw score love.graphics.setColor(255, 255, 255, self.alpha) local score_text = self.score .. '/10' local score_text_w = self.overlay_font:getWidth(score_text) love.graphics.print(score_text, self.x + self.w - score_text_w - 5, self.y + self.h - 5 - self.overlay_font:getHeight()) -- Draw stars love.graphics.setFont(self.font_awesome_font) love.graphics.setColor(222, 222, 64, self.alpha) love.graphics.setScissor(self.x + 5, self.y + self.h - 6 - self.font_awesome_font:getHeight(), (self.score/10)*75, self.font_awesome_font:getHeight()) love.graphics.print(self.yui.Theme.font_awesome['fa-star'], self.x + 5, self.y + self.h - 6 - self.font_awesome_font:getHeight()) love.graphics.print(self.yui.Theme.font_awesome['fa-star'], self.x + 5 + 15, self.y + self.h - 6 - self.font_awesome_font:getHeight()) love.graphics.print(self.yui.Theme.font_awesome['fa-star'], self.x + 5 + 30, self.y + self.h - 6 - self.font_awesome_font:getHeight()) love.graphics.print(self.yui.Theme.font_awesome['fa-star'], self.x + 5 + 45, self.y + self.h - 6 - self.font_awesome_font:getHeight()) love.graphics.print(self.yui.Theme.font_awesome['fa-star'], self.x + 5 + 60, self.y + self.h - 6 - self.font_awesome_font:getHeight()) love.graphics.setScissor() love.graphics.setFont(self.overlay_font) love.graphics.setColor(255, 255, 255, 255) end, })) end local rows = {} rows[1], rows[2], rows[3] = {}, {}, {} for i = 1, 8 do table.insert(rows[1], grid[i]) end for i = 9, 16 do table.insert(rows[2], grid[i]) end for i = 17, 24 do table.insert(rows[3], grid[i]) end local anime_view = yui.View(0, 80, 1200, 755, { yui.Stack({ yui.Flow(rows[1]), yui.Flow(rows[2]), yui.Flow(rows[3]), }) }) return anime_view end function getAnimeInfo() local info = {} local titles = { 'Shin Sekai Yori', 'Hunter x Hunter', {'Fullmetal Alchemist', 'Brotherhood'}, 'Steins;Gate', 'Gintama', {'Clannad', 'After Story'}, {'Great Teacher', 'Onizuka'}, 'Death Note', 'Monster', {"Howl's Moving", "Castle"}, 'Haikyuu!!', 'Attack on Titan', {'The Disappearance', 'of Haruhi Suzumiya'}, 'Hajime no Ippo', 'Samurai X', 'Gurren Lagann', 'Mononoke Hime', 'Fate/Zero', {'Legend of Galactic', 'Heroes'}, 'Code Geass', 'Spirited Away', 'Your Lie in April', 'Mushishi', 'Wolf Children' } local scores = { 8.54, 9.15, 9.25, 9.18, 9.16, 9.12, 8.79, 8.76, 8.75, 8.73, 8.67, 8.68, 8.88, 8.86, 8.45, 8.82, 8.81, 8.58, 9.08, 8.86, 8.93, 8.93, 8.80, 8.88, } local genres = { {'Mystery', 'Drama', 'Horror', 'Sci-Fi', 'Supernatural'}, {'Action', 'Adventure', 'Shounen', 'Super Power'}, {'Action', 'Adventure', 'Drama', 'Fantasy', 'Magic', 'Shounen', 'Military'}, {'Sci-Fi', 'Thriller'}, {'Action', 'Comedy', 'Historical', 'Parody', 'Samurai', 'Sci-Fi', 'Shounen'}, {'Drama', 'Fantasy', 'Romance', 'Slice of Life', 'Supernatural'}, {'Comedy', 'Drama', 'School', 'Shounen', 'Slice of Life'}, {'Mystery', 'Supernatural', 'Police', 'Psychological', 'Thriller'}, {'Mystery', 'Drama', 'Horror', 'Police', 'Psychological', 'Thriller', 'Seinen'}, {'Adventure', 'Drama', 'Fantasy', 'Romance'}, {'Comedy', 'Drama', 'School', 'Shounen', 'Sports'}, {'Action', 'Drama', 'Fantasy', 'Shounen', 'Super Power'}, {'Comedy', 'Mystery', 'Romance', 'School', 'Sci-Fi', 'Supernatural'}, {'Comedy', 'Drama', 'Shounen', 'Sports'}, {'Action', 'Adventure', 'Comedy', 'Historical', 'Samurai', 'Romance'}, {'Action', 'Comedy', 'Mecha', 'Sci-Fi'}, {'Action', 'Adventure', 'Fantasy'}, {'Action', 'Fantasy', 'Supernatural'}, {'Drama', 'Sci-Fi', 'Space', 'Military'}, {'Action', 'Mecha', 'School', 'Sci-Fi', 'Super Power', 'Military'}, {'Adventure', 'Drama', 'Supernatural'}, {'Drama', 'Music', 'Romance', 'School', 'Shounen'}, {'Adventure', 'Mystery', 'Fantasy', 'Historical', 'Slice of Life', 'Supernatural', 'Seinen'}, {'Fantasy', 'Slice of Life'}, } local images = { love.graphics.newImage('images/ssy.jpg'), love.graphics.newImage('images/hxh.jpg'), love.graphics.newImage('images/fma.jpg'), love.graphics.newImage('images/sg.jpg'), love.graphics.newImage('images/gin.jpg'), love.graphics.newImage('images/clan.jpg'), love.graphics.newImage('images/oni.jpg'), love.graphics.newImage('images/dn.jpg'), love.graphics.newImage('images/mons.jpg'), love.graphics.newImage('images/howl.jpg'), love.graphics.newImage('images/hai.jpg'), love.graphics.newImage('images/tit.jpg'), love.graphics.newImage('images/haru.jpg'), love.graphics.newImage('images/ippo.jpg'), love.graphics.newImage('images/x.jpg'), love.graphics.newImage('images/lag.jpg'), love.graphics.newImage('images/hime.jpg'), love.graphics.newImage('images/fate.jpg'), love.graphics.newImage('images/den.jpg'), love.graphics.newImage('images/geass.jpg'), love.graphics.newImage('images/sen.jpg'), love.graphics.newImage('images/lie.jpg'), love.graphics.newImage('images/shi.jpg'), love.graphics.newImage('images/wolf.jpg'), } local image_offsets = { {450, 160}, {55, 50}, {40, 60}, {50, 80}, {20, 0}, {260, 130}, {10, 10}, {30, 30}, {175, 80}, {70, 0}, {150, 240}, {240, 40}, {45, 60}, {20, 0}, {50, 80}, {25, 0}, {60, 20}, {180, 180}, {80, 0}, {30, 10}, {50, 25}, {20, 30}, {25, 80}, {50, 120}, } local links = { 'http://myanimelist.net/anime/13125/Shinsekai_yori', 'http://myanimelist.net/anime/11061/Hunter_x_Hunter_%282011%29', 'http://myanimelist.net/anime/5114/Fullmetal_Alchemist:_Brotherhood', 'http://myanimelist.net/anime/9253/Steins;Gate', 'http://myanimelist.net/anime/28977/Gintama%C2%B0', 'http://myanimelist.net/anime/4181/Clannad:_After_Story', 'http://myanimelist.net/anime/245/Great_Teacher_Onizuka', 'http://myanimelist.net/anime/1535/Death_Note', 'http://myanimelist.net/anime/19/Monster', 'http://myanimelist.net/anime/431/Howl_no_Ugoku_Shiro', 'http://myanimelist.net/anime/20583/Haikyuu!!', 'http://myanimelist.net/anime/16498/Shingeki_no_Kyojin', 'http://myanimelist.net/anime/7311/Suzumiya_Haruhi_no_Shoushitsu', 'http://myanimelist.net/anime/263/Hajime_no_Ippo', 'http://myanimelist.net/anime/45/Rurouni_Kenshin:_Meiji_Kenkaku_Romantan', 'http://myanimelist.net/anime/2001/Tengen_Toppa_Gurren_Lagann', 'http://myanimelist.net/anime/164/Mononoke_Hime', 'http://myanimelist.net/anime/10087/Fate_Zero', 'http://myanimelist.net/anime/820/Ginga_Eiyuu_Densetsu', 'http://myanimelist.net/anime/1575/Code_Geass:_Hangyaku_no_Lelouch', 'http://myanimelist.net/anime/199/Sen_to_Chihiro_no_Kamikakushi', 'http://myanimelist.net/anime/23273/Shigatsu_wa_Kimi_no_Uso', 'http://myanimelist.net/anime/457/Mushishi', 'http://myanimelist.net/anime/12355/Ookami_Kodomo_no_Ame_to_Yuki', } for i = 1, 24 do table.insert(info, { title = titles[i], link = links[i], score = scores[i], image = images[i], image_offsets = image_offsets[i] or {}, genres = genres[i], }) end return info end
mit
RunAwayDSP/darkstar
scripts/zones/Rabao/npcs/Shupah_Mujuuk.lua
12
3349
----------------------------------- -- Area: Rabao -- NPC: Shupah Mujuuk -- Title Change NPC -- !pos 12 8 20 247 ----------------------------------- require("scripts/globals/titles") ----------------------------------- local eventId = 1011 local titleInfo = { { cost = 200, title = { dsp.title.THE_IMMORTAL_FISHER_LU_SHANG, dsp.title.INDOMITABLE_FISHER, dsp.title.KUFTAL_TOURIST, dsp.title.ACQUIRER_OF_ANCIENT_ARCANUM, dsp.title.DESERT_HUNTER, dsp.title.ROOKIE_HERO_INSTRUCTOR, }, }, { cost = 300, title = { dsp.title.HEIR_OF_THE_GREAT_WIND, }, }, { cost = 400, title = { dsp.title.FODDERCHIEF_FLAYER, dsp.title.WARCHIEF_WRECKER, dsp.title.DREAD_DRAGON_SLAYER, dsp.title.OVERLORD_EXECUTIONER, dsp.title.DARK_DRAGON_SLAYER, dsp.title.ADAMANTKING_KILLER, dsp.title.BLACK_DRAGON_SLAYER, dsp.title.MANIFEST_MAULER, dsp.title.BEHEMOTHS_BANE, dsp.title.ARCHMAGE_ASSASSIN, dsp.title.HELLSBANE, dsp.title.GIANT_KILLER, dsp.title.LICH_BANISHER, dsp.title.JELLYBANE, dsp.title.BOGEYDOWNER, dsp.title.BEAKBENDER, dsp.title.SKULLCRUSHER, dsp.title.MORBOLBANE, dsp.title.GOLIATH_KILLER, dsp.title.MARYS_GUIDE, }, }, { cost = 500, title = { dsp.title.SIMURGH_POACHER, dsp.title.ROC_STAR, dsp.title.SERKET_BREAKER, dsp.title.CASSIENOVA, dsp.title.THE_HORNSPLITTER, dsp.title.TORTOISE_TORTURER, dsp.title.MON_CHERRY, dsp.title.BEHEMOTH_DETHRONER, dsp.title.THE_VIVISECTOR, dsp.title.DRAGON_ASHER, dsp.title.EXPEDITIONARY_TROOPER, }, }, { cost = 600, title = { dsp.title.ADAMANTKING_USURPER, dsp.title.OVERLORD_OVERTHROWER, dsp.title.DEITY_DEBUNKER, dsp.title.FAFNIR_SLAYER, dsp.title.ASPIDOCHELONE_SINKER, dsp.title.NIDHOGG_SLAYER, dsp.title.MAAT_MASHER, dsp.title.KIRIN_CAPTIVATOR, dsp.title.CACTROT_DESACELERADOR, dsp.title.LIFTER_OF_SHADOWS, dsp.title.TIAMAT_TROUNCER, dsp.title.VRTRA_VANQUISHER, dsp.title.WORLD_SERPENT_SLAYER, dsp.title.XOLOTL_XTRAPOLATOR, dsp.title.BOROKA_BELEAGUERER, dsp.title.OURYU_OVERWHELMER, dsp.title.VINEGAR_EVAPORATOR, dsp.title.VIRTUOUS_SAINT, dsp.title.BYEBYE_TAISAI, dsp.title.TEMENOS_LIBERATOR, dsp.title.APOLLYON_RAVAGER, dsp.title.WYRM_ASTONISHER, dsp.title.NIGHTMARE_AWAKENER, }, }, } function onTrade(player,npc,trade) end function onTrigger(player,npc) dsp.title.changerOnTrigger(player, eventId, titleInfo) end function onEventUpdate(player,csid,option) end function onEventFinish(player,csid,option) dsp.title.changerOnEventFinish(player, csid, option, eventId, titleInfo) end
gpl-3.0
lichtl/darkstar
scripts/zones/Windurst_Walls/npcs/Jack_of_Diamonds.lua
17
1238
----------------------------------- -- Area: Windurst Walls -- NPC: Jack of Diamonds -- Adventurer's Assistant -- Working 100% ------------------------------------- require("scripts/globals/settings"); package.loaded["scripts/zones/Windurst_Walls/TextIDs"] = nil; require("scripts/zones/Windurst_Walls/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) if (trade:getItemCount() == 1 and trade:hasItemQty(0x218,1) == true) then player:startEvent(0x2712,GIL_RATE*50); player:addGil(GIL_RATE*50); player:tradeComplete(); end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:startEvent(0x2711,0,2); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
sjznxd/lc-20130222
applications/luci-statistics/luasrc/model/cbi/luci_statistics/rrdtool.lua
80
3431
--[[ Luci configuration model for statistics - collectd rrdtool plugin configuration (c) 2008 Freifunk Leipzig / Jo-Philipp Wich <xm@leipzig.freifunk.net> Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 $Id$ ]]-- m = Map("luci_statistics", translate("RRDTool Plugin Configuration"), translate( "The rrdtool plugin stores the collected data in rrd database " .. "files, the foundation of the diagrams.<br /><br />" .. "<strong>Warning: Setting the wrong values will result in a very " .. "high memory consumption in the temporary directory. " .. "This can render the device unusable!</strong>" )) -- collectd_rrdtool config section s = m:section( NamedSection, "collectd_rrdtool", "luci_statistics" ) -- collectd_rrdtool.enable enable = s:option( Flag, "enable", translate("Enable this plugin") ) enable.default = 1 -- collectd_rrdtool.datadir (DataDir) datadir = s:option( Value, "DataDir", translate("Storage directory") ) datadir.default = "/tmp" datadir.rmempty = true datadir.optional = true datadir:depends( "enable", 1 ) -- collectd_rrdtool.stepsize (StepSize) stepsize = s:option( Value, "StepSize", translate("RRD step interval"), translate("Seconds") ) stepsize.default = 30 stepsize.isinteger = true stepsize.rmempty = true stepsize.optional = true stepsize:depends( "enable", 1 ) -- collectd_rrdtool.heartbeat (HeartBeat) heartbeat = s:option( Value, "HeartBeat", translate("RRD heart beat interval"), translate("Seconds") ) heartbeat.default = 60 heartbeat.isinteger = true heartbeat.rmempty = true heartbeat.optional = true heartbeat:depends( "enable", 1 ) -- collectd_rrdtool.rrasingle (RRASingle) rrasingle = s:option( Flag, "RRASingle", translate("Only create average RRAs"), translate("reduces rrd size") ) rrasingle.default = true rrasingle.rmempty = true rrasingle.optional = true rrasingle:depends( "enable", 1 ) -- collectd_rrdtool.rratimespans (RRATimespan) rratimespans = s:option( Value, "RRATimespans", translate("Stored timespans"), translate("seconds; multiple separated by space") ) rratimespans.default = "600 86400 604800 2678400 31622400" rratimespans.rmempty = true rratimespans.optional = true rratimespans:depends( "enable", 1 ) -- collectd_rrdtool.rrarows (RRARows) rrarows = s:option( Value, "RRARows", translate("Rows per RRA") ) rrarows.isinteger = true rrarows.default = 100 rrarows.rmempty = true rrarows.optional = true rrarows:depends( "enable", 1 ) -- collectd_rrdtool.xff (XFF) xff = s:option( Value, "XFF", translate("RRD XFiles Factor") ) xff.default = 0.1 xff.isnumber = true xff.rmempty = true xff.optional = true xff:depends( "enable", 1 ) -- collectd_rrdtool.cachetimeout (CacheTimeout) cachetimeout = s:option( Value, "CacheTimeout", translate("Cache collected data for"), translate("Seconds") ) cachetimeout.isinteger = true cachetimeout.default = 100 cachetimeout.rmempty = true cachetimeout.optional = true cachetimeout:depends( "enable", 1 ) -- collectd_rrdtool.cacheflush (CacheFlush) cacheflush = s:option( Value, "CacheFlush", translate("Flush cache after"), translate("Seconds") ) cacheflush.isinteger = true cacheflush.default = 100 cacheflush.rmempty = true cacheflush.optional = true cacheflush:depends( "enable", 1 ) return m
apache-2.0
lichtl/darkstar
scripts/zones/Port_Windurst/npcs/Taniko-Maniko.lua
17
1797
----------------------------------- -- Area: Port Windurst -- NPC: Taniko-Maniko -- Standard Merchant NPC -- Confirmed shop stock, August 2013 ----------------------------------- require("scripts/globals/shop"); package.loaded["scripts/zones/Port_Windurst/TextIDs"] = nil; require("scripts/zones/Port_Windurst/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:showText(npc,TANIKOMANIKO_SHOP_DIALOG); stock = { 0x4181, 2542,1, --Brass Zaghnal 0x4302, 7128,1, --Wrapped Bow 0x43AB, 162,1, --Ice Arrow 0x43AC, 162,1, --Lightning Arrow 0x4015, 104,2, --Cat Baghnakhs 0x4001, 129,2, --Cesti 0x4109, 5864,2, --Bone Pick 0x4301, 482,2, --Self Bow 0x43A6, 3,2, --Wooden Arrow 0x439C, 54,2, --Hawkeye 0x4380, 1575,2, --Boomerang 0x4102, 4198,3, --Bone Axe 0x4180, 309,3, --Bronze Zaghnal 0x41C0, 97,3, --Harpoon 0x4300, 39,3, --Shortbow 0x43A7, 4,3 --Bone Arrow } showNationShop(player, NATION_WINDURST, stock); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
lichtl/darkstar
scripts/zones/Southern_San_dOria/npcs/Lotte.lua
17
1455
----------------------------------- -- Area: Southern San d'Oria -- NPC: Lotte -- General Info NPC ------------------------------------- package.loaded["scripts/zones/Southern_San_dOria/TextIDs"] = nil; ----------------------------------- require("scripts/zones/Southern_San_dOria/TextIDs"); require("scripts/globals/settings"); require("scripts/globals/quests"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) -- "Flyers for Regine" conditional script local FlyerForRegine = player:getQuestStatus(SANDORIA,FLYERS_FOR_REGINE); if (FlyerForRegine == 1) then local count = trade:getItemCount(); local MagicFlyer = trade:hasItemQty(532,1); if (MagicFlyer == true and count == 1) then player:messageSpecial(FLYER_REFUSED); end end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:startEvent(0x234); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
RunAwayDSP/darkstar
scripts/globals/mobskills/gregale_wing_air.lua
11
1147
--------------------------------------------- -- Gregale Wing -- -- Description: An icy wind deals Ice damage to enemies within a very wide area of effect. Additional effect: Paralyze -- Type: Magical -- Utsusemi/Blink absorb: Wipes shadows -- Range: 30' radial. -- Notes: Used only Jormungand and Isgebind --------------------------------------------- require("scripts/globals/settings") require("scripts/globals/status") require("scripts/globals/monstertpmoves") --------------------------------------------- function onMobSkillCheck(target,mob,skill) if (mob:AnimationSub() ~= 1) then return 1 end return 0 end function onMobWeaponSkill(target, mob, skill) local typeEffect = dsp.effect.PARALYSIS MobStatusEffectMove(mob, target, typeEffect, 40, 0, 120) local dmgmod = 1 local info = MobMagicalMove(mob,target,skill,mob:getWeaponDmg()*5,dsp.magic.ele.ICE,dmgmod,TP_NO_EFFECT) local dmg = MobFinalAdjustments(info.dmg,mob,skill,target,dsp.attackType.MAGICAL,dsp.damageType.ICE,MOBPARAM_WIPE_SHADOWS) target:takeDamage(dmg, mob, dsp.attackType.MAGICAL, dsp.damageType.ICE) return dmg end
gpl-3.0
lichtl/darkstar
scripts/zones/Bastok_Markets/npcs/Zacc.lua
14
1605
----------------------------------- -- Area: Bastok Markets -- NPC: Zacc -- Type: Quest NPC -- @zone 235 -- @pos -255.709 -13 -91.379 ----------------------------------- package.loaded["scripts/zones/Bastok_Markets/TextIDs"] = nil; require("scripts/zones/Bastok_Markets/TextIDs"); require("scripts/globals/quests"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) if (player:getQuestStatus(BASTOK, WISH_UPON_A_STAR) == QUEST_COMPLETED) then -- Quest: Wish Upon a Star - Quest has been completed. player:startEvent(0x0150); elseif (player:getFameLevel(BASTOK) > 4 and player:getQuestStatus(BASTOK, WISH_UPON_A_STAR) == QUEST_AVAILABLE) then -- Quest: Wish Upon a Star - Start quest. player:startEvent(0x0149); else -- Standard dialog player:startEvent(0x0148); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); if (csid == 0x0149) then -- Quest: Wish Upon a Star player:addQuest(BASTOK, WISH_UPON_A_STAR); player:setVar("WishUponAStar_Status", 1); end end;
gpl-3.0
lichtl/darkstar
scripts/zones/Southern_San_dOria/npcs/Emoussine.lua
27
2406
----------------------------------- -- Area: Southern San d'Oria -- NPC: Emoussine -- Type: Chocobo Renter -- @pos -11 1 -100 ----------------------------------- package.loaded["scripts/zones/Southern_San_dOria/TextIDs"] = nil; ----------------------------------- require("scripts/globals/chocobo"); require("scripts/globals/keyitems"); require("scripts/globals/settings"); require("scripts/globals/status"); require("scripts/zones/Southern_San_dOria/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) if (FlyerForRegine == 1) then count = trade:getItemCount(); MagicFlyer = trade:hasItemQty(532,1); if (MagicFlyer == true and count == 1) then player:messageSpecial(FLYER_REFUSED); end end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) local level = player:getMainLvl(); local gil = player:getGil(); if (player:hasKeyItem(CHOCOBO_LICENSE) and level >= 15) then local price = getChocoboPrice(player); player:setLocalVar("chocoboPriceOffer",price); if (level >= 20) then level = 0; end player:startEvent(0x0258,price,gil,level); else player:startEvent(0x025B); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish Action ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); local price = player:getLocalVar("chocoboPriceOffer"); if (csid == 0x0258 and option == 0) then if (player:delGil(price)) then updateChocoboPrice(player, price); if (player:getMainLvl() >= 20) then local duration = 1800 + (player:getMod(MOD_CHOCOBO_RIDING_TIME) * 60) player:addStatusEffectEx(EFFECT_CHOCOBO,EFFECT_CHOCOBO,1,0,duration,true); else player:addStatusEffectEx(EFFECT_CHOCOBO,EFFECT_CHOCOBO,1,0,900,true); end player:setPos(-126,-62,274,0x65,0x64); end end end;
gpl-3.0
lichtl/darkstar
scripts/zones/Ifrits_Cauldron/npcs/Flame_Spout.lua
14
1607
---------------------------------- -- Area: Ifrit's Cauldron -- NPC: Flame Spout -- @pos 193.967 -0.400 19.492 205 ----------------------------------- require("scripts/zones/Ifrits_Cauldron/TextIDs"); require("scripts/globals/settings"); require("scripts/globals/quests"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) local npcid = npc:getID(); if (trade:getItemCount() == 1 and trade:hasItemQty(4105,1) == true) then -- Ice Cluster Trade GetNPCByID(npcid+5):openDoor(90); player:tradeComplete(); end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) -- printf("%u",npc:getID()) local npcid = npc:getID(); -- Commented out to preserve CSIDs for the quest, since the workaround was removed. --[[if (npcid == 17617204) then player:startEvent(0x000b); elseif (npcid == 17617205) then player:startEvent(0x000c); elseif (npcid == 17617206) then player:startEvent(0x000d); elseif (npcid == 17617207) then player:startEvent(0x000e); end]] end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
lichtl/darkstar
scripts/zones/Southern_San_dOria/npcs/Amaura.lua
14
3069
----------------------------------- -- Area: Southern San d'Oria -- NPC: Amaura -- Involved in Quest: The Medicine Woman, To Cure a Cough -- @zone 230 -- @pos -85 -6 89 ----------------------------------- package.loaded["scripts/zones/Southern_San_dOria/TextIDs"] = nil; ----------------------------------- require("scripts/globals/settings"); require("scripts/globals/titles"); require("scripts/globals/keyitems"); require("scripts/globals/quests"); require("scripts/zones/Southern_San_dOria/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) if (player:hasKeyItem(AMAURAS_FORMULA) == true) then if (trade:hasItemQty(920,1) == true and trade:hasItemQty(642,1) == true and trade:hasItemQty(846,1) == true and trade:getItemCount() == 3) then player:startEvent(0x027D); end end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) medicineWoman = player:getQuestStatus(SANDORIA,THE_MEDICINE_WOMAN); toCureaCough = player:getQuestStatus(SANDORIA,TO_CURE_A_COUGH); if (medicineWoman == QUEST_ACCEPTED) then amaurasFormulaKI = player:hasKeyItem(AMAURAS_FORMULA); coldMedicine = player:hasKeyItem(COLD_MEDICINE); if (amaurasFormulaKI == false and coldMedicine == false) then player:startEvent(0x027C); else player:startEvent(0x0282); end elseif (player:getVar("DiaryPage") == 3 or toCureaCough == QUEST_ACCEPTED) then if (player:hasKeyItem(THYME_MOSS) == false and player:hasKeyItem(COUGH_MEDICINE) == false) then player:startEvent(0x0285); -- need thyme moss for cough med elseif (player:hasKeyItem(THYME_MOSS) == true) then player:startEvent(0x0286); -- receive cough med for Nenne end else player:startEvent(0x0282); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); if (csid == 0x027C and option == 0) then player:addKeyItem(AMAURAS_FORMULA); player:messageSpecial(KEYITEM_OBTAINED,AMAURAS_FORMULA); elseif (csid == 0x027D) then player:tradeComplete(); player:delKeyItem(AMAURAS_FORMULA); player:addKeyItem(COLD_MEDICINE); player:messageSpecial(KEYITEM_OBTAINED,COLD_MEDICINE); elseif (csid == 0x0285) then player:addQuest(SANDORIA,TO_CURE_A_COUGH); elseif (csid == 0x0286) then player:delKeyItem(THYME_MOSS); player:addKeyItem(COUGH_MEDICINE); player:messageSpecial(KEYITEM_OBTAINED,COUGH_MEDICINE); end end;
gpl-3.0
lichtl/darkstar
scripts/zones/Valley_of_Sorrows/npcs/Field_Manual.lua
29
1049
----------------------------------- -- Area: Valley of Sorrows -- Field Manual ----------------------------------- require("scripts/globals/settings"); require("scripts/globals/fieldsofvalor"); ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) startFov(FOV_EVENT_SORROWS,player); end; ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onEventSelection ----------------------------------- function onEventUpdate(player,csid,menuchoice) updateFov(player,csid,menuchoice,139,140,141,0,0); end; ----------------------------------- -- onEventFinish Action ----------------------------------- function onEventFinish(player,csid,option) finishFov(player,csid,option,139,140,141,0,0,FOV_EVENT_SORROWS); end;
gpl-3.0
lichtl/darkstar
scripts/globals/effects/magic_shield.lua
33
1698
----------------------------------- -- -- Magic Shield BLOCKS all magic attacks -- ----------------------------------- require("scripts/globals/status"); ----------------------------------- -- onEffectGain Action ----------------------------------- function onEffectGain(target,effect) if (effect:getPower() == 3) then -- arcane stomp target:addMod(MOD_FIRE_ABSORB, 100); target:addMod(MOD_EARTH_ABSORB, 100); target:addMod(MOD_WATER_ABSORB, 100); target:addMod(MOD_WIND_ABSORB, 100); target:addMod(MOD_ICE_ABSORB, 100); target:addMod(MOD_LTNG_ABSORB, 100); target:addMod(MOD_LIGHT_ABSORB, 100); target:addMod(MOD_DARK_ABSORB, 100); elseif (effect:getPower() < 2) then target:addMod(MOD_UDMGMAGIC, -101); else target:addMod(MOD_MAGIC_ABSORB, 100); end; end; ----------------------------------- -- onEffectTick Action ----------------------------------- function onEffectTick(target,effect) end; ----------------------------------- -- onEffectLose Action ----------------------------------- function onEffectLose(target,effect) if (effect:getPower() == 3) then -- arcane stomp target:delMod(MOD_FIRE_ABSORB, 100); target:delMod(MOD_EARTH_ABSORB, 100); target:delMod(MOD_WATER_ABSORB, 100); target:delMod(MOD_WIND_ABSORB, 100); target:delMod(MOD_ICE_ABSORB, 100); target:delMod(MOD_LTNG_ABSORB, 100); target:delMod(MOD_LIGHT_ABSORB, 100); target:delMod(MOD_DARK_ABSORB, 100); elseif (effect:getPower() < 2) then target:delMod(MOD_UDMGMAGIC, -101); else target:delMod(MOD_MAGIC_ABSORB, 100); end; end;
gpl-3.0
lichtl/darkstar
scripts/zones/Xarcabard/npcs/Luck_Rune.lua
14
1042
----------------------------------- -- Area: Xarcabard -- NPC: Luck Rune -- Involved in Quest: Mhaura Fortune -- @pos 576.117 -0.164 -16.935 112 ----------------------------------- package.loaded["scripts/zones/Xarcabard/TextIDs"] = nil; ------------------------------------- require("scripts/zones/Xarcabard/TextIDs"); ----------------------------------- -- onTrade ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger ----------------------------------- function onTrigger(player,npc) player:messageSpecial(NOTHING_OUT_OF_THE_ORDINARY); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
raingloom/yaoui
examples/anime/yaoui/UI/Draggable.lua
9
4084
local ui_path = (...):match('(.-)[^%.]+$') .. '.' local Object = require(ui_path .. 'classic.classic') local Draggable = Object:extend('Draggable') function Draggable:draggableNew(settings) local settings = settings or {} self.dragging = false self.drag_hot = false self.drag_enter = false self.drag_exit = false self.drag_start = false self.drag_end = false self.drag_margin = settings.drag_margin or self.h/4 self.drag_x, self.drag_y = 0, 0 self.drag_min_limit_x, self.drag_min_limit_y = settings.drag_min_limit_x, settings.drag_min_limit_y self.drag_max_limit_x, self.drag_max_limit_y = settings.drag_max_limit_x, settings.drag_max_limit_y self.only_drag_horizontally = settings.only_drag_horizontally self.only_drag_vertically = settings.only_drag_vertically self.previous_drag_hot = false self.drag_previous_mouse_position = nil end function Draggable:draggableUpdate(dt, parent) local x, y = self.getMousePosition() if self.draggable then -- Check for drag_hot if self.hot and x >= self.x and x <= (self.x + self.w) and y >= self.y and y <= (self.y + self.drag_margin) then self.drag_hot = true else self.drag_hot = false end -- Check for drag_enter if self.drag_hot and not self.previous_drag_hot then self.drag_enter = true else self.drag_enter = false end -- Check for drag_exit if not self.drag_hot and self.previous_drag_hot then self.drag_exit = true else self.drag_exit = false end self.drag_start = false self.drag_end = false end -- Drag if self.drag_hot and self.input:pressed('left-click') then self.dragging = true self.drag_start = true end -- Resizing has precedence over dragging if self.dragging and not self.resizing and self.input:down('left-click') then local dx, dy = x - self.drag_previous_mouse_position.x, y - self.drag_previous_mouse_position.y local parent_x, parent_y = 0, 0 if parent then parent_x, parent_y = parent.x, parent.y end if self.only_drag_horizontally or (not self.only_drag_horizontally and not self.only_drag_vertically) then self.drag_x = self.drag_x + dx if self.drag_min_limit_x then if (parent_x + self.ix + self.drag_x) < self.drag_min_limit_x then self.drag_x = self.drag_x - dx end end if self.drag_max_limit_x then if (parent_x + self.ix + self.drag_x) > self.drag_max_limit_x then self.drag_x = self.drag_x - dx end end end if self.only_drag_vertically or (not self.only_drag_vertically and not self.only_drag_horizontally) then self.drag_y = self.drag_y + dy if self.drag_min_limit_y then if (parent_y + self.iy + self.drag_y) < self.drag_min_limit_y then self.drag_y = self.drag_y - dy end end if self.drag_max_limit_y then if (parent_y + self.iy + self.drag_y) > self.drag_max_limit_y then self.drag_y = self.drag_y - dy end end end end if self.dragging and self.input:released('left-click') then self.dragging = false self.drag_end = true end if parent then self.x, self.y = parent.x + self.ix + self.drag_x + (self.resize_x or 0), parent.y + self.iy + self.drag_y + (self.resize_y or 0) else self.x, self.y = self.ix + self.drag_x + (self.resize_x or 0), self.iy + self.drag_y + (self.resize_y or 0) end -- Set previous frame state self.previous_drag_hot = self.drag_hot self.drag_previous_mouse_position = {x = x, y = y} end function Draggable:setDragLimits(x_min, y_min, x_max, y_max) self.drag_min_limit_x = x_min self.drag_min_limit_y = y_min self.drag_max_limit_x = x_max self.drag_max_limit_y = y_max end return Draggable
mit
sjznxd/lc-20130222
applications/luci-firewall/luasrc/model/cbi/firewall/forwards.lua
85
3942
--[[ LuCI - Lua Configuration Interface Copyright 2008 Steven Barth <steven@midlink.org> Copyright 2010-2012 Jo-Philipp Wich <xm@subsignal.org> Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 ]]-- local ds = require "luci.dispatcher" local ft = require "luci.tools.firewall" m = Map("firewall", translate("Firewall - Port Forwards"), translate("Port forwarding allows remote computers on the Internet to \ connect to a specific computer or service within the \ private LAN.")) -- -- Port Forwards -- s = m:section(TypedSection, "redirect", translate("Port Forwards")) s.template = "cbi/tblsection" s.addremove = true s.anonymous = true s.sortable = true s.extedit = ds.build_url("admin/network/firewall/forwards/%s") s.template_addremove = "firewall/cbi_addforward" function s.create(self, section) local n = m:formvalue("_newfwd.name") local p = m:formvalue("_newfwd.proto") local E = m:formvalue("_newfwd.extzone") local e = m:formvalue("_newfwd.extport") local I = m:formvalue("_newfwd.intzone") local a = m:formvalue("_newfwd.intaddr") local i = m:formvalue("_newfwd.intport") if p == "other" or (p and a) then created = TypedSection.create(self, section) self.map:set(created, "target", "DNAT") self.map:set(created, "src", E or "wan") self.map:set(created, "dest", I or "lan") self.map:set(created, "proto", (p ~= "other") and p or "all") self.map:set(created, "src_dport", e) self.map:set(created, "dest_ip", a) self.map:set(created, "dest_port", i) self.map:set(created, "name", n) end if p ~= "other" then created = nil end end function s.parse(self, ...) TypedSection.parse(self, ...) if created then m.uci:save("firewall") luci.http.redirect(ds.build_url( "admin/network/firewall/redirect", created )) end end function s.filter(self, sid) return (self.map:get(sid, "target") ~= "SNAT") end ft.opt_name(s, DummyValue, translate("Name")) local function forward_proto_txt(self, s) return "%s-%s" %{ translate("IPv4"), ft.fmt_proto(self.map:get(s, "proto"), self.map:get(s, "icmp_type")) or "TCP+UDP" } end local function forward_src_txt(self, s) local z = ft.fmt_zone(self.map:get(s, "src"), translate("any zone")) local a = ft.fmt_ip(self.map:get(s, "src_ip"), translate("any host")) local p = ft.fmt_port(self.map:get(s, "src_port")) local m = ft.fmt_mac(self.map:get(s, "src_mac")) if p and m then return translatef("From %s in %s with source %s and %s", a, z, p, m) elseif p or m then return translatef("From %s in %s with source %s", a, z, p or m) else return translatef("From %s in %s", a, z) end end local function forward_via_txt(self, s) local a = ft.fmt_ip(self.map:get(s, "src_dip"), translate("any router IP")) local p = ft.fmt_port(self.map:get(s, "src_dport")) if p then return translatef("Via %s at %s", a, p) else return translatef("Via %s", a) end end match = s:option(DummyValue, "match", translate("Match")) match.rawhtml = true match.width = "50%" function match.cfgvalue(self, s) return "<small>%s<br />%s<br />%s</small>" % { forward_proto_txt(self, s), forward_src_txt(self, s), forward_via_txt(self, s) } end dest = s:option(DummyValue, "dest", translate("Forward to")) dest.rawhtml = true dest.width = "40%" function dest.cfgvalue(self, s) local z = ft.fmt_zone(self.map:get(s, "dest"), translate("any zone")) local a = ft.fmt_ip(self.map:get(s, "dest_ip"), translate("any host")) local p = ft.fmt_port(self.map:get(s, "dest_port")) or ft.fmt_port(self.map:get(s, "src_dport")) if p then return translatef("%s, %s in %s", a, p, z) else return translatef("%s in %s", a, z) end end ft.opt_enabled(s, Flag, translate("Enable")).width = "1%" return m
apache-2.0
PrimaStudios/ProjectPrima
src/libs/LoveAStar-master/astar.lua
1
5545
-- This version has a few LOVE specific calls for getting some benchmarking information -- Please use astar_good.lua if you plan on using this in your projects binary_heap = require "binary_heap" --- Toggle off the pathMap toggles to set up for the next call -- @param pathMap: the flattened path map -- @param openSet: the open set -- @param closedSet: the closed set local function cleanPathMap(pathMap, openSet, closedSet) cleanUpStart = love.timer.getTime() -- <== FOR STRESS TEST for _,v in pairs(openSet) do if type(v) == "table" then pathMap[v.value.pathLoc].open = false end end for _,v in pairs(closedSet) do pathMap[v.pathLoc].closed = false end cleanUpEnd = love.timer.getTime() -- <== FOR STRESS TEST end --- Constructs the found path. This works in reverse from the --- pathfinding algorithm, by using parent values and the associated --- location of that parent on the closed set to jump around until it --- returns to the start node's position. -- @param closedSet: the closed set -- @param startPos: the position of the start node -- #returns path: the found path local function buildPath(closedSet, startPos) buildPathStart = love.timer.getTime() -- <== FOR STRESS TEST local path = {closedSet[#closedSet]} while path[#path].pathLoc ~= startPos do table.insert(path, closedSet[path[#path].pCloseLoc]) end buildPathEnd = love.timer.getTime() -- <== FOR STRESS TEST aStarEnd = love.timer.getTime() -- <== FOR STRESS TEST return path end --- The A* search algorithm. Using imported heuristics and distance values --- between individual nodes, this finds the shortest path from the start --- node's position to the exit node's position. -- @param pathMap: the flattened path map -- @param startPos: the start node's position, relative to the pathMap -- @param exitPos: the exit node's position, relative to the pathMap -- #returns path: the found path (or empty if it failed to find a path) function startPathing(pathMap, startPos, exitPos) aStarStart = love.timer.getTime() -- <== FOR STRESS TEST pathMap[startPos].parent = pathMap[startPos] -- Initialize the gScore and fScore of the start node pathMap[startPos].gScore = 0 pathMap[startPos].fScore = pathMap[startPos].gScore + pathMap[startPos].hScore -- Toggle the open trigger on pathMap for the start node pathMap[startPos].open = true -- Initialize the openSet and add the start node to it local openSet = binary_heap:new() openSet:insert(pathMap[startPos].fScore, pathMap[startPos]) -- Initialize the closedSet and the testNode local closedSet = {} local testNode = {} mainLoopStart = love.timer.getTime() -- <== FOR STRESS TEST -- The main loop for the algorithm. Will continue to check as long as -- there are open nodes that haven't been checked. while #openSet > 0 do -- Find the next node with the best fScore findNextStart = love.timer.getTime() -- <== FOR STRESS TEST _, testNode = openSet:pop() findNextEnd = love.timer.getTime() -- <== FOR STRESS TEST pathMap[testNode.pathLoc].open = false -- Add that node to the closed set pathMap[testNode.pathLoc].closed = true table.insert(closedSet, testNode) -- Check to see if that is the exit node's position if closedSet[#closedSet].pathLoc == exitPos then mainLoopEnd = love.timer.getTime() -- <== FOR STRESS TEST -- Clean the path map cleanPathMap(pathMap, openSet, closedSet) -- Return the build path return buildPath(closedSet, startPos) end neighborStart = love.timer.getTime() -- <== FOR STRESS TEST -- Check all the (pre-assigned) neighbors. If they are not closed -- already, then check to see if they are either not on the open -- or if they are on the open list, but their currently assigned -- distance score (either given to them when they were first added -- or reassigned earlier) is greater than the distance score that -- goes through the current test node. If either is true, then -- calculate their fScore and assign the current test node as their -- parent for k,v in pairs(testNode.neighbors) do if not pathMap[v].closed then local tempGScore = testNode.gScore + testNode.distance[k] if not pathMap[v].open then pathMap[v].open = true pathMap[v].parent = testNode pathMap[v].pCloseLoc = #closedSet pathMap[v].gScore = tempGScore pathMap[v].fScore = pathMap[v].hScore + tempGScore openSet:insert(pathMap[v].fScore, pathMap[v]) elseif tempGScore < pathMap[v].gScore then pathMap[v].parent = testNode pathMap[v].gScore = tempGScore pathMap[v].fScore = pathMap[v].hScore + tempGScore end end end neighborEnd = love.timer.getTime() -- <== For STRESS TEST end -- Returns an empty table if it failed to find any path to the exit node return {} end --====================================================================== -- Helper functions for easier plug-in to other games --====================================================================== function newNode(pathLoc, hScore, neighbors, distance) assert(type(pathLoc) == "number", "bad arg #1: needs number") assert(type(hScore) == "number", "bad arg #1: needs number") assert(type(neighbors) == "table" and type(next(neighbors)) == "number", "bad arg #1: needs table") assert(type(distance) == "table" and type(next(distance)) == "number", "bad arg #1: needs number") local n = { pathLoc = pathLoc, hScore = hScore, neighbors = neighbors, distance = distance, } return n end
apache-2.0
lichtl/darkstar
scripts/zones/Bastok_Markets/npcs/Porter_Moogle.lua
14
1535
----------------------------------- -- Area: Bastok Markets -- NPC: Porter Moogle -- Type: Storage Moogle -- @zone 235 -- @pos TODO ----------------------------------- package.loaded["scripts/zones/Bastok_Markets/TextIDs"] = nil; ----------------------------------- require("scripts/zones/Bastok_Markets/TextIDs"); require("scripts/globals/porter_moogle_util"); local e = { TALK_EVENT_ID = 545, STORE_EVENT_ID = 546, RETRIEVE_EVENT_ID = 547, ALREADY_STORED_ID = 548, MAGIAN_TRIAL_ID = 549 }; ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) porterMoogleTrade(player, trade, e); end ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) -- No idea what the params are, other than event ID and gil. player:startEvent(e.TALK_EVENT_ID, 0x6FFFFF, 0x01, 0x06DD, 0x27, 0x7C7E, 0x15, player:getGil(), 0x03E8); end ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) porterEventUpdate(player, csid, option, e.RETRIEVE_EVENT_ID, RETRIEVE_DIALOG_ID, ITEM_CANNOT_BE_OBTAINED); end ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) porterEventFinish(player, csid, option, e.TALK_EVENT_ID, ITEM_CANNOT_BE_OBTAINED, ITEM_OBTAINED, NOT_HAVE_ENOUGH_GIL); end
gpl-3.0
lichtl/darkstar
scripts/zones/Phomiuna_Aqueducts/npcs/_0rq.lua
14
1474
----------------------------------- -- Area: Phomiuna_Aqueducts -- NPC: Oil lamp -- @pos -60 -23 60 27 ----------------------------------- package.loaded["scripts/zones/Phomiuna_Aqueducts/TextIDs"] = nil; ----------------------------------- require("scripts/globals/missions"); require("scripts/zones/Phomiuna_Aqueducts/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) local DoorOffset = npc:getID(); player:messageSpecial(LAMP_OFFSET+6); -- light lamp npc:openDoor(7); -- lamp animation local element = VanadielDayElement(); --printf("element: %u",element); if (element == 6 or element == 7) then -- lightday or darkday if (GetNPCByID(DoorOffset+1):getAnimation() == 8) then -- lamp dark open? GetNPCByID(DoorOffset-5):openDoor(15); -- Open Door _0rk end end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
cracker1375/mr-Error
libs/serpent.lua
656
7877
local n, v = "serpent", 0.28 -- (C) 2012-15 Paul Kulchenko; MIT License local c, d = "Paul Kulchenko", "Lua serializer and pretty printer" local snum = {[tostring(1/0)]='1/0 --[[math.huge]]',[tostring(-1/0)]='-1/0 --[[-math.huge]]',[tostring(0/0)]='0/0'} local badtype = {thread = true, userdata = true, cdata = true} local keyword, globals, G = {}, {}, (_G or _ENV) for _,k in ipairs({'and', 'break', 'do', 'else', 'elseif', 'end', 'false', 'for', 'function', 'goto', 'if', 'in', 'local', 'nil', 'not', 'or', 'repeat', 'return', 'then', 'true', 'until', 'while'}) do keyword[k] = true end for k,v in pairs(G) do globals[v] = k end -- build func to name mapping for _,g in ipairs({'coroutine', 'debug', 'io', 'math', 'string', 'table', 'os'}) do for k,v in pairs(G[g] or {}) do globals[v] = g..'.'..k end end local function s(t, opts) local name, indent, fatal, maxnum = opts.name, opts.indent, opts.fatal, opts.maxnum local sparse, custom, huge = opts.sparse, opts.custom, not opts.nohuge local space, maxl = (opts.compact and '' or ' '), (opts.maxlevel or math.huge) local iname, comm = '_'..(name or ''), opts.comment and (tonumber(opts.comment) or math.huge) local seen, sref, syms, symn = {}, {'local '..iname..'={}'}, {}, 0 local function gensym(val) return '_'..(tostring(tostring(val)):gsub("[^%w]",""):gsub("(%d%w+)", -- tostring(val) is needed because __tostring may return a non-string value function(s) if not syms[s] then symn = symn+1; syms[s] = symn end return tostring(syms[s]) end)) end local function safestr(s) return type(s) == "number" and tostring(huge and snum[tostring(s)] or s) or type(s) ~= "string" and tostring(s) -- escape NEWLINE/010 and EOF/026 or ("%q"):format(s):gsub("\010","n"):gsub("\026","\\026") end local function comment(s,l) return comm and (l or 0) < comm and ' --[['..tostring(s)..']]' or '' end local function globerr(s,l) return globals[s] and globals[s]..comment(s,l) or not fatal and safestr(select(2, pcall(tostring, s))) or error("Can't serialize "..tostring(s)) end local function safename(path, name) -- generates foo.bar, foo[3], or foo['b a r'] local n = name == nil and '' or name local plain = type(n) == "string" and n:match("^[%l%u_][%w_]*$") and not keyword[n] local safe = plain and n or '['..safestr(n)..']' return (path or '')..(plain and path and '.' or '')..safe, safe end local alphanumsort = type(opts.sortkeys) == 'function' and opts.sortkeys or function(k, o, n) -- k=keys, o=originaltable, n=padding local maxn, to = tonumber(n) or 12, {number = 'a', string = 'b'} local function padnum(d) return ("%0"..tostring(maxn).."d"):format(tonumber(d)) end table.sort(k, function(a,b) -- sort numeric keys first: k[key] is not nil for numerical keys return (k[a] ~= nil and 0 or to[type(a)] or 'z')..(tostring(a):gsub("%d+",padnum)) < (k[b] ~= nil and 0 or to[type(b)] or 'z')..(tostring(b):gsub("%d+",padnum)) end) end local function val2str(t, name, indent, insref, path, plainindex, level) local ttype, level, mt = type(t), (level or 0), getmetatable(t) local spath, sname = safename(path, name) local tag = plainindex and ((type(name) == "number") and '' or name..space..'='..space) or (name ~= nil and sname..space..'='..space or '') if seen[t] then -- already seen this element sref[#sref+1] = spath..space..'='..space..seen[t] return tag..'nil'..comment('ref', level) end if type(mt) == 'table' and (mt.__serialize or mt.__tostring) then -- knows how to serialize itself seen[t] = insref or spath if mt.__serialize then t = mt.__serialize(t) else t = tostring(t) end ttype = type(t) end -- new value falls through to be serialized if ttype == "table" then if level >= maxl then return tag..'{}'..comment('max', level) end seen[t] = insref or spath if next(t) == nil then return tag..'{}'..comment(t, level) end -- table empty local maxn, o, out = math.min(#t, maxnum or #t), {}, {} for key = 1, maxn do o[key] = key end if not maxnum or #o < maxnum then local n = #o -- n = n + 1; o[n] is much faster than o[#o+1] on large tables for key in pairs(t) do if o[key] ~= key then n = n + 1; o[n] = key end end end if maxnum and #o > maxnum then o[maxnum+1] = nil end if opts.sortkeys and #o > maxn then alphanumsort(o, t, opts.sortkeys) end local sparse = sparse and #o > maxn -- disable sparsness if only numeric keys (shorter output) for n, key in ipairs(o) do local value, ktype, plainindex = t[key], type(key), n <= maxn and not sparse if opts.valignore and opts.valignore[value] -- skip ignored values; do nothing or opts.keyallow and not opts.keyallow[key] or opts.valtypeignore and opts.valtypeignore[type(value)] -- skipping ignored value types or sparse and value == nil then -- skipping nils; do nothing elseif ktype == 'table' or ktype == 'function' or badtype[ktype] then if not seen[key] and not globals[key] then sref[#sref+1] = 'placeholder' local sname = safename(iname, gensym(key)) -- iname is table for local variables sref[#sref] = val2str(key,sname,indent,sname,iname,true) end sref[#sref+1] = 'placeholder' local path = seen[t]..'['..tostring(seen[key] or globals[key] or gensym(key))..']' sref[#sref] = path..space..'='..space..tostring(seen[value] or val2str(value,nil,indent,path)) else out[#out+1] = val2str(value,key,indent,insref,seen[t],plainindex,level+1) end end local prefix = string.rep(indent or '', level) local head = indent and '{\n'..prefix..indent or '{' local body = table.concat(out, ','..(indent and '\n'..prefix..indent or space)) local tail = indent and "\n"..prefix..'}' or '}' return (custom and custom(tag,head,body,tail) or tag..head..body..tail)..comment(t, level) elseif badtype[ttype] then seen[t] = insref or spath return tag..globerr(t, level) elseif ttype == 'function' then seen[t] = insref or spath local ok, res = pcall(string.dump, t) local func = ok and ((opts.nocode and "function() --[[..skipped..]] end" or "((loadstring or load)("..safestr(res)..",'@serialized'))")..comment(t, level)) return tag..(func or globerr(t, level)) else return tag..safestr(t) end -- handle all other types end local sepr = indent and "\n" or ";"..space local body = val2str(t, name, indent) -- this call also populates sref local tail = #sref>1 and table.concat(sref, sepr)..sepr or '' local warn = opts.comment and #sref>1 and space.."--[[incomplete output with shared/self-references skipped]]" or '' return not name and body..warn or "do local "..body..sepr..tail.."return "..name..sepr.."end" end local function deserialize(data, opts) local env = (opts and opts.safe == false) and G or setmetatable({}, { __index = function(t,k) return t end, __call = function(t,...) error("cannot call functions") end }) local f, res = (loadstring or load)('return '..data, nil, nil, env) if not f then f, res = (loadstring or load)(data, nil, nil, env) end if not f then return f, res end if setfenv then setfenv(f, env) end return pcall(f) end local function merge(a, b) if b then for k,v in pairs(b) do a[k] = v end end; return a; end return { _NAME = n, _COPYRIGHT = c, _DESCRIPTION = d, _VERSION = v, serialize = s, load = deserialize, dump = function(a, opts) return s(a, merge({name = '_', compact = true, sparse = true}, opts)) end, line = function(a, opts) return s(a, merge({sortkeys = true, comment = true}, opts)) end, block = function(a, opts) return s(a, merge({indent = ' ', sortkeys = true, comment = true}, opts)) end }
gpl-2.0
RunAwayDSP/darkstar
scripts/zones/Metalworks/npcs/Karst.lua
9
1444
----------------------------------- -- Area: Metalworks -- NPC: Karst -- Type: President -- Involved in Bastok Missions 5-2 -- !pos 106 -21 0 237 ----------------------------------- require("scripts/globals/keyitems"); require("scripts/globals/missions"); ----------------------------------- function onTrade(player,npc,trade) end; function onTrigger(player,npc) local currentMission = player:getCurrentMission(BASTOK); if (currentMission == dsp.mission.id.bastok.XARCABARD_LAND_OF_TRUTHS and player:getCharVar("MissionStatus") == 0) then player:startEvent(602); elseif (currentMission == dsp.mission.id.bastok.XARCABARD_LAND_OF_TRUTHS and player:hasKeyItem(dsp.ki.SHADOW_FRAGMENT)) then player:startEvent(603); elseif (currentMission == dsp.mission.id.bastok.ON_MY_WAY) and (player:getCharVar("MissionStatus") == 0) then player:startEvent(765); elseif (currentMission == dsp.mission.id.bastok.ON_MY_WAY) and (player:getCharVar("MissionStatus") == 3) then player:startEvent(766); else player:startEvent(601); end end; function onEventUpdate(player,csid,option) end; function onEventFinish(player,csid,option) if (csid == 602) then player:setCharVar("MissionStatus",2); elseif (csid == 765) then player:setCharVar("MissionStatus",1); elseif (csid == 766 or csid == 603) then finishMissionTimeline(player, 1, csid, option); end end;
gpl-3.0
RunAwayDSP/darkstar
scripts/zones/Bostaunieux_Oubliette/npcs/Novalmauge.lua
9
3889
----------------------------------- -- Area: Bostaunieux Obliette -- NPC: Novalmauge -- Starts and Finishes Quest: The Rumor, Souls in Shadow -- Involved in Quest: The Holy Crest, Trouble at the Sluice -- !pos 70 -24 21 167 ----------------------------------- local ID = require("scripts/zones/Bostaunieux_Oubliette/IDs") require("scripts/globals/keyitems") require("scripts/globals/npc_util") require("scripts/globals/pathfind") require("scripts/globals/wsquest") require("scripts/globals/quests") ----------------------------------- local path = { 41.169430, -24.000000, 19.860674, 42.256676, -24.000000, 19.885197, 41.168694, -24.000000, 19.904638, 21.859211, -24.010996, 19.792259, 51.917370, -23.924366, 19.970068, 74.570229, -24.024828, 20.103880, 44.533886, -23.947662, 19.926519 } local wsQuest = dsp.wsquest.spiral_hell function onSpawn(npc) npc:initNpcAi() npc:setPos(dsp.path.first(path)) onPath(npc) end function onPath(npc) dsp.path.patrol(npc, path) end function onTrade(player, npc, trade) local wsQuestEvent = dsp.wsquest.getTradeEvent(wsQuest, player, trade) if player:getCharVar("troubleAtTheSluiceVar") == 2 and npcUtil.tradeHas(trade, 959) then -- Dahlia player:startEvent(17) npc:wait() elseif player:getQuestStatus(SANDORIA, dsp.quest.id.sandoria.THE_RUMOR) == QUEST_ACCEPTED and npcUtil.tradeHas(trade, 930) then -- Beastman Blood player:startEvent(12) npc:wait() elseif wsQuestEvent ~= nil then player:startEvent(wsQuestEvent) npc:wait() end end function onTrigger(player, npc) local wsQuestEvent = dsp.wsquest.getTriggerEvent(wsQuest, player) local troubleAtTheSluice = player:getQuestStatus(SANDORIA, dsp.quest.id.sandoria.TROUBLE_AT_THE_SLUICE) local troubleAtTheSluiceStat = player:getCharVar("troubleAtTheSluiceVar") local theHolyCrestStat = player:getCharVar("TheHolyCrest_Event") local theRumor = player:getQuestStatus(SANDORIA, dsp.quest.id.sandoria.THE_RUMOR) npc:wait() if wsQuestEvent ~= nil then player:startEvent(wsQuestEvent) -- THE HOLY CREST elseif theHolyCrestStat == 1 then player:startEvent(6) elseif theHolyCrestStat == 2 and player:getCharVar("theHolyCrestCheck") == 0 then player:startEvent(7) -- TROUBLE AT THE SLUICE elseif troubleAtTheSluiceStat == 1 then player:startEvent(15) elseif troubleAtTheSluiceStat == 2 then player:startEvent(16) -- THE RUMOR elseif theRumor == QUEST_AVAILABLE and player:getFameLevel(SANDORIA) >= 3 and player:getMainLvl() >= 10 then player:startEvent(13) elseif theRumor == QUEST_ACCEPTED then player:startEvent(11) elseif theRumor == QUEST_COMPLETED then player:startEvent(14) -- Standard dialog after "The Rumor" else player:startEvent(10) -- Standard dialog end end function onEventFinish(player, csid, option, npc) if csid == 6 then player:setCharVar("TheHolyCrest_Event", 2) elseif csid == 7 then player:setCharVar("theHolyCrestCheck", 1) elseif csid == 12 and npcUtil.completeQuest(player, SANDORIA, dsp.quest.id.sandoria.THE_RUMOR, {item = 4853}) then player:confirmTrade() elseif csid == 13 and option == 1 then player:addQuest(SANDORIA, dsp.quest.id.sandoria.THE_RUMOR) elseif csid == 14 then player:setCharVar("theHolyCrestCheck", 0) elseif csid == 15 then player:setCharVar("troubleAtTheSluiceVar", 2) elseif csid == 17 then npcUtil.giveKeyItem(player, dsp.ki.NEUTRALIZER) player:setCharVar("troubleAtTheSluiceVar", 0) player:setCharVar("theHolyCrestCheck", 0) player:confirmTrade() else dsp.wsquest.handleEventFinish(wsQuest, player, csid, option, ID.text.SPIRAL_HELL_LEARNED) end npc:wait(0) end
gpl-3.0
RunAwayDSP/darkstar
scripts/zones/Bastok_Markets_[S]/npcs/GentleTiger.lua
9
1233
---------------------------------- -- Area: Bastok Markets [S] -- NPC: GentleTiger -- Type: Quest -- !pos -203 -10 1 ----------------------------------- require("scripts/globals/quests"); ----------------------------------- function onTrade(player,npc,trade) end; function onTrigger(player,npc) local onSabbatical = player:getQuestStatus(CRYSTAL_WAR,dsp.quest.id.crystalWar.ON_SABBATICAL); local onSabbaticalProgress = player:getCharVar("OnSabbatical"); if (onSabbatical == QUEST_ACCEPTED) then if (onSabbaticalProgress == 1) then player:startEvent(46); else player:startEvent(47); end elseif (player:getQuestStatus(CRYSTAL_WAR,dsp.quest.id.crystalWar.FIRES_OF_DISCONTENT) == QUEST_ACCEPTED) then if (player:getCharVar("FiresOfDiscProg") == 5) then player:startEvent(160); else player:startEvent(161); end else player:startEvent(109); end end; function onEventUpdate(player,csid,option) end; function onEventFinish(player,csid,option) if (csid == 46) then player:setCharVar("OnSabbatical", 2); elseif (csid == 160) then player:setCharVar("FiresOfDiscProg",6); end end;
gpl-3.0
lichtl/darkstar
scripts/zones/The_Garden_of_RuHmet/npcs/_iz2.lua
14
2003
----------------------------------- -- Area: The Garden of RuHmet -- NPC: _iz2 (Ebon_Panel) -- @pos 422.351 -5.180 -100.000 35 | Hume Tower ----------------------------------- package.loaded["scripts/zones/The_Garden_of_RuHmet/TextIDs"] = nil; ----------------------------------- require("scripts/zones/The_Garden_of_RuHmet/TextIDs"); require("scripts/globals/missions"); require("scripts/globals/titles"); require("scripts/globals/keyitems"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) local Race = player:getRace(); if (player:getCurrentMission(COP) == WHEN_ANGELS_FALL and player:getVar("PromathiaStatus") == 1) then player:startEvent(0x00CA); elseif (player:getCurrentMission(COP) == WHEN_ANGELS_FALL and player:getVar("PromathiaStatus") == 2) then if ( Race==2 or Race==1) then player:startEvent(0x0078); else player:messageSpecial(NO_NEED_INVESTIGATE); end else player:messageSpecial(NO_NEED_INVESTIGATE); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); if (csid == 0x00CA) then player:setVar("PromathiaStatus",2); elseif (0x0078 and option ~=0) then -- Hume player:addTitle(WARRIOR_OF_THE_CRYSTAL); player:setVar("PromathiaStatus",3); player:addKeyItem(LIGHT_OF_VAHZL); player:messageSpecial(KEYITEM_OBTAINED,LIGHT_OF_VAHZL); end end;
gpl-3.0
lichtl/darkstar
scripts/zones/Outer_Horutoto_Ruins/npcs/_5ej.lua
17
3739
----------------------------------- -- Area: Inner Horutoto Ruins -- NPC: Ancient Magical Gizmo #6 (J out of E, F, G, H, I, J) -- Involved In Mission: The Heart of the Matter ----------------------------------- package.loaded["scripts/zones/Outer_Horutoto_Ruins/TextIDs"] = nil; ----------------------------------- require("scripts/globals/keyitems"); require("scripts/globals/missions"); require("scripts/zones/Outer_Horutoto_Ruins/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) -- Check if we are on Windurst Mission 1-2 if (player:getCurrentMission(WINDURST) == THE_HEART_OF_THE_MATTER) then MissionStatus = player:getVar("MissionStatus"); if (MissionStatus == 2) then -- Entered a Dark Orb if (player:getVar("MissionStatus_orb6") == 1) then player:startEvent(0x0033); else player:messageSpecial(ORB_ALREADY_PLACED); end elseif (MissionStatus == 4) then -- Took out a Glowing Orb if (player:getVar("MissionStatus_orb6") == 2) then player:startEvent(0x0033); else player:messageSpecial(G_ORB_ALREADY_GOTTEN); end else player:messageSpecial(DARK_MANA_ORB_RECHARGER); end else player:messageSpecial(DARK_MANA_ORB_RECHARGER); end return 1; end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); if (csid == 0x0033) then orb_value = player:getVar("MissionStatus_orb6"); if (orb_value == 1) then player:setVar("MissionStatus_orb6",2); -- Push the text that the player has placed the orb player:messageSpecial(SIXTH_DARK_ORB_IN_PLACE); --Delete the key item player:delKeyItem(SIXTH_DARK_MANA_ORB); -- Check if all orbs have been placed or not if (player:getVar("MissionStatus_orb1") == 2 and player:getVar("MissionStatus_orb2") == 2 and player:getVar("MissionStatus_orb3") == 2 and player:getVar("MissionStatus_orb4") == 2 and player:getVar("MissionStatus_orb5") == 2) then player:messageSpecial(ALL_DARK_MANA_ORBS_SET); player:setVar("MissionStatus",3); end elseif (orb_value == 2) then player:setVar("MissionStatus_orb6",3); -- Time to get the glowing orb out player:addKeyItem(SIXTH_GLOWING_MANA_ORB); player:messageSpecial(KEYITEM_OBTAINED,SIXTH_GLOWING_MANA_ORB); -- Check if all orbs have been placed or not if (player:getVar("MissionStatus_orb1") == 3 and player:getVar("MissionStatus_orb2") == 3 and player:getVar("MissionStatus_orb3") == 3 and player:getVar("MissionStatus_orb4") == 3 and player:getVar("MissionStatus_orb5") == 3) then player:messageSpecial(RETRIEVED_ALL_G_ORBS); player:setVar("MissionStatus",5); end end end end;
gpl-3.0
lichtl/darkstar
scripts/zones/Windurst_Woods/npcs/Tesch_Garanjy.lua
16
4318
----------------------------------- -- Area: Windurst Woods -- NPC: Tesch_Garanjy -- Armor Storage NPC ----------------------------------- package.loaded["scripts/zones/Windurst_Woods/TextIDs"] = nil; ----------------------------------- require("scripts/globals/quests"); require("scripts/globals/armorstorage"); require("scripts/zones/Windurst_Woods/TextIDs"); Deposit = 0x272b; Withdrawl = 0x272c; ArraySize = #StorageArray; G1 = 0; G2 = 0; G3 = 0; G4 = 0; G5 = 0; ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) for SetId = 1,ArraySize,11 do TradeCount = trade:getItemCount(); T1 = trade:hasItemQty(StorageArray[SetId + 5],1); if (T1 == true) then if (player:hasKeyItem(StorageArray[SetId + 10]) == false) then if (TradeCount == StorageArray[SetId + 3]) then T2 = trade:hasItemQty(StorageArray[SetId + 4],1); T3 = trade:hasItemQty(StorageArray[SetId + 6],1); T4 = trade:hasItemQty(StorageArray[SetId + 7],1); T5 = trade:hasItemQty(StorageArray[SetId + 8],1); if (StorageArray[SetId + 4] == 0) then T2 = true; end; if (StorageArray[SetId + 6] == 0) then T3 = true; end; if (StorageArray[SetId + 7] == 0) then T4 = true; end; if (StorageArray[SetId + 8] == 0) then T5 = true; end; if (T2 == true and T3 == true and T4 == true and T5 == true) then player:startEvent(Deposit,0,0,0,0,0,StorageArray[SetId + 9]); player:addKeyItem(StorageArray[SetId + 10]); player:messageSpecial(KEYITEM_OBTAINED,StorageArray[SetId + 10]); break; end; end; end; end; end; end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) CurrGil = player:getGil(); for KeyItem = 11,ArraySize,11 do if player:hasKeyItem(StorageArray[KeyItem]) then if StorageArray[KeyItem - 9] == 1 then G1 = G1 + StorageArray[KeyItem - 8]; elseif StorageArray[KeyItem - 9] == 2 then G2 = G2 + StorageArray[KeyItem - 8]; elseif StorageArray[KeyItem - 9] == 3 then G3 = G3 + StorageArray[KeyItem - 8]; elseif StorageArray[KeyItem - 9] == 4 then G4 = G4 + StorageArray[KeyItem - 8]; elseif StorageArray[KeyItem - 9] == 6 then G5 = G5 + StorageArray[KeyItem - 8]; end; end; end; player:startEvent(Withdrawl,G1,G2,G3,G4,CurrGil,G5); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) if (csid == Withdrawl) then player:updateEvent(StorageArray[option * 11 - 6], StorageArray[option * 11 - 5], StorageArray[option * 11 - 4], StorageArray[option * 11 - 3], StorageArray[option * 11 - 2], StorageArray[option * 11 - 1]); end; end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) if (csid == Withdrawl) then if (option > 0 and option <= StorageArray[ArraySize] - 10) then if (player:getFreeSlotsCount() >= StorageArray[option * 11 - 7]) then for Item = 2,6,1 do if (StorageArray[option * 11 - Item] > 0) then player:addItem(StorageArray[option * 11 - Item],1); player:messageSpecial(ITEM_OBTAINED,StorageArray[option * 11 - Item]); end; end; player:delKeyItem(StorageArray[option * 11]); player:setGil(player:getGil() - StorageArray[option * 11 - 1]); else for Item = 2,6,1 do if (StorageArray[option * 11 - Item] > 0) then player:messageSpecial(ITEM_CANNOT_BE_OBTAINED,StorageArray[option * 11 - Item]); end; end; end; end; end; if (csid == Deposit) then player:tradeComplete(); end; end;
gpl-3.0
lichtl/darkstar
scripts/zones/Northern_San_dOria/npcs/Abeaule.lua
25
4316
----------------------------------- -- Area: Northern San d'Oria -- NPC: Abeaule -- Starts and Finishes Quest: The Trader in the Forest, The Medicine Woman -- @pos -136 -2 56 231 ----------------------------------- package.loaded["scripts/zones/Northern_San_dOria/TextIDs"] = nil; ----------------------------------- require("scripts/globals/settings"); require("scripts/globals/titles"); require("scripts/globals/keyitems"); require("scripts/globals/quests"); require("scripts/zones/Northern_San_dOria/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) theTraderInTheForest = player:getQuestStatus(SANDORIA,THE_TRADER_IN_THE_FOREST); if (theTraderInTheForest == QUEST_ACCEPTED) then if (trade:hasItemQty(4367,1) and trade:getItemCount() == 1) then -- Trade Batagreens player:startEvent(0x020d); end end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) theTraderInTheForest = player:getQuestStatus(SANDORIA,THE_TRADER_IN_THE_FOREST); medicineWoman = player:getQuestStatus(SANDORIA,THE_MEDICINE_WOMAN); if (theTraderInTheForest == QUEST_AVAILABLE) then if (player:getVar("theTraderInTheForestCS") == 1) then player:startEvent(0x0250); else player:startEvent(0x020c); player:setVar("theTraderInTheForestCS",1); end elseif (theTraderInTheForest == QUEST_ACCEPTED) then player:startEvent(0x0251); elseif (theTraderInTheForest == QUEST_COMPLETED and medicineWoman == QUEST_AVAILABLE and player:getFameLevel(SANDORIA) >= 3) then if (player:getVar("medicineWomanCS") == 1) then player:startEvent(0x0267); else player:startEvent(0x0265); player:setVar("medicineWomanCS",1); end elseif (player:hasKeyItem(COLD_MEDICINE)) then player:startEvent(0x0266); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); -- "The Trader in the Forest" Quest if (csid == 0x020c and option == 0 or csid == 0x0250 and option == 0) then if (player:getFreeSlotsCount() == 0) then player:messageSpecial(ITEM_CANNOT_BE_OBTAINED,592); else player:addQuest(SANDORIA,THE_TRADER_IN_THE_FOREST); player:setVar("theTraderInTheForestCS",0); player:addItem(592); player:messageSpecial(ITEM_OBTAINED,592); -- Supplies Order end elseif (csid == 0x0251 and option == 1) then local SUPPLIES_ORDER = 592; if (player:getFreeSlotsCount() > 0 and player:hasItem(592) == false) then -- Supplies Order player:addItem(SUPPLIES_ORDER); player:messageSpecial(ITEM_OBTAINED, SUPPLIES_ORDER); else player:messageSpecial(ITEM_CANNOT_BE_OBTAINED, SUPPLIES_ORDER); end elseif (csid == 0x020d) then if (player:getFreeSlotsCount() == 0) then player:messageSpecial(ITEM_CANNOT_BE_OBTAINED,12600); -- Robe else player:tradeComplete(); player:addTitle(GREEN_GROCER); player:addItem(12600); player:messageSpecial(ITEM_OBTAINED,12600); -- Robe player:addFame(SANDORIA,30); player:completeQuest(SANDORIA,THE_TRADER_IN_THE_FOREST); end -- "The Medicine Woman" Quest elseif (csid == 0x0265 and option == 0 or csid == 0x0267 and option == 0) then player:addQuest(SANDORIA,THE_MEDICINE_WOMAN); elseif (csid == 0x0266) then player:addTitle(TRAVELING_MEDICINE_MAN); player:delKeyItem(COLD_MEDICINE); player:addGil(GIL_RATE*2100); player:messageSpecial(GIL_OBTAINED,GIL_RATE*2100); player:addFame(SANDORIA,30); player:completeQuest(SANDORIA,THE_MEDICINE_WOMAN); end end;
gpl-3.0
NiLuJe/koreader
frontend/ui/data/keyboardlayouts/fa_keyboard.lua
6
4330
local en_popup = require("ui/data/keyboardlayouts/keypopup/en_popup") local fa_popup = require("ui/data/keyboardlayouts/keypopup/fa_popup") local prd = en_popup.prd -- period (.) local _at = en_popup._at local alef = fa_popup.alef local h_aa = fa_popup.h_aa -- This is Persian letter هـ / as in English "hello". local waw = fa_popup.waw local yaa = fa_popup.yaa local kaf = fa_popup.kaf local diacritics = fa_popup.diacritics local arabic_comma = fa_popup.arabic_comma return { min_layer = 1, max_layer = 4, shiftmode_keys = {["1/2"] = true, ["2/2"] = true}, symbolmode_keys = {["نشانه‌ها"] = true,["الفبا"]=true}, -- نشانه‌ها means "Symbol", الفبا means "letter" (traditionally "ABC" on QWERTY layouts) utf8mode_keys = {["🌐"] = true}, -- The famous globe key for layout switching umlautmode_keys = {["Äéß"] = false}, -- No need for this keyboard panel keys = { -- first row { -- 1 2 3 4 { "ض", "ض", "~", "1", }, { "ص", "ص", "`", "2", }, { "ث", "ث", "|", "3", }, { "ق", "ق", "•", "4", }, { "ف", "ف", "√", "5", }, { "غ", "غ", "π", "6", }, { "ع", "ع", "÷", "7", }, { h_aa, h_aa, "×", "8", }, { "خ", "خ", "¶", "9", }, { "ح", "ح", "Δ", "0", }, { "ج", "ج", "‘", ">" }, }, -- second row { -- 1 2 3 4 { "ش", "ش", "£", _at, }, { "س", "س", "¥", "#", }, { yaa, yaa, "$", "﷼", }, { "ب", "ب", "¢", "ـ", }, { "ل", "ل", "^", "&", }, { alef, alef, "°", "-", }, { "ت", "ت", "=", "+", }, { "ن", "ن", "{", "(", }, { "م", "م", "}", ")" }, { kaf, kaf, "\\", "٫", }, { "گ", "گ", "/", "<", }, }, -- third row { -- 1 2 3 4 { "ظ", "ظ", "٪", "/", }, { "ط", "ط", "©", "«", }, { "ژ", "ژ", "®", "»", }, { "ز", "ز", "™", ":", }, { "ر", "ر", "✓", "؛", }, { "ذ", "ذ", "[", "!", }, { "د", "د", "]", "؟", }, { "پ", "پ", "↑", "↑", }, { waw, waw, "←", "←", }, { "چ", "چ", "→", "→", }, { label = "", width = 1, bold = false }, }, -- fourth row { {"نشانه‌ها","نشانه‌ها","الفبا","الفبا", width = 1.75}, { arabic_comma, arabic_comma, "2/2", "1/2", width = 1}, { label = "🌐", }, { label = "فاصله", " ", " ", " ", " ", width = 3.6}, { label = ".‌|‌.", diacritics, diacritics, diacritics, diacritics, width = 1}, { prd, prd, "↓", "↓", }, { label = "⮠", "\n", "\n", "\n", "\n", width = 1.7, }, }, }, }
agpl-3.0
yariplus/love-demos
love-slider/entities/SliderTile.lua
1
2602
local Entity = require "entities/Entity" local SliderTile = {} setmetatable(SliderTile, {__index = Entity}) SliderTile.blankQuad = love.graphics.newQuad(0, 0, 64, 64, 640, 640) function SliderTile:update(dt) end function SliderTile:draw(dt) love.graphics.setColor(50, 0, 0) love.graphics.print(self.number, self.sprite.x + 30, self.sprite.y + 30) end function SliderTile:flip() end function SliderTile:click(x, y, button) if button == "l" then self.clickables:click(x, y, button) end end function SliderTile:new(sprite, x, y, number) local o = { position = { x = x, y = y } } o.sprite = sprite setmetatable(o, {__index = self}) o.sprite:setPos(x * 96 - 24, y * 96 - 24) o.side = "back" o.sprite.batch:set( o.sprite.id, SliderTile.blankQuad, o.sprite.x, o.sprite.y ) o.number = number o.clickables = Clickables:new(o) o.clickables:addClickableArea(0, 0, 64, 64, function () local bx = game.blank.x local by = game.blank.y if bx == o.position.x then if by > o.position.y then local _by = by local _oy = o.position.y while _by > _oy do game.positions[bx][_by] = game.positions[bx][_by - 1] game.positions[bx][_by].sprite:setPos(bx * 96 - 24, _by * 96 - 24) game.positions[bx][_by].position.y = _by game.positions[bx][_by - 1] = {number=0} game.blank.x = bx game.blank.y = _by - 1 _by = _by - 1 end else local _by = by local _oy = o.position.y while _by < _oy do game.positions[bx][_by] = game.positions[bx][_by + 1] game.positions[bx][_by].sprite:setPos(bx * 96 - 24, _by * 96 - 24) game.positions[bx][_by].position.y = _by game.positions[bx][_by + 1] = {number=0} game.blank.x = bx game.blank.y = _by + 1 _by = _by + 1 end end end if by == o.position.y then if bx > o.position.x then local _bx = bx local _ox = o.position.x while _bx > _ox do game.positions[_bx][by] = game.positions[_bx - 1][by] game.positions[_bx][by].sprite:setPos(_bx * 96 - 24, by * 96 - 24) game.positions[_bx][by].position.x = _bx game.positions[_bx - 1][by] = {number=0} game.blank.x = _bx - 1 _bx = _bx - 1 end else local _bx = bx local _ox = o.position.x while _bx < _ox do game.positions[_bx][by] = game.positions[_bx + 1][by] game.positions[_bx][by].sprite:setPos(_bx * 96 - 24, by * 96 - 24) game.positions[_bx][by].position.x = _bx game.positions[_bx + 1][by] = {number=0} game.blank.x = _bx + 1 _bx = _bx + 1 end end end end) return o end return SliderTile
cc0-1.0
lichtl/darkstar
scripts/zones/Southern_San_dOria/npcs/Foletta.lua
17
1458
----------------------------------- -- Area: Southern San d'Oria -- NPC: Foletta -- General Info NPC ------------------------------------- package.loaded["scripts/zones/Southern_San_dOria/TextIDs"] = nil; ----------------------------------- require("scripts/zones/Southern_San_dOria/TextIDs"); require("scripts/globals/settings"); require("scripts/globals/quests"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) -- "Flyers for Regine" conditional script local FlyerForRegine = player:getQuestStatus(SANDORIA,FLYERS_FOR_REGINE); if (FlyerForRegine == 1) then local count = trade:getItemCount(); local MagicFlyer = trade:hasItemQty(532,1); if (MagicFlyer == true and count == 1) then player:messageSpecial(FLYER_REFUSED); end end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:startEvent(0x29a); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
lichtl/darkstar
scripts/zones/Windurst_Woods/npcs/Boizo-Naizo.lua
14
1621
----------------------------------- -- Area: Windurst Woods -- NPC: Boizo-Naizo -- Involved in Quest: Riding on the Clouds -- @zone 241 -- @pos -9.581 -3.75 -26.062 ----------------------------------- package.loaded["scripts/zones/Windurst_Woods/TextIDs"] = nil; ----------------------------------- require("scripts/globals/settings"); require("scripts/globals/keyitems"); require("scripts/globals/quests"); require("scripts/zones/Windurst_Woods/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) if (player:getQuestStatus(JEUNO,RIDING_ON_THE_CLOUDS) == QUEST_ACCEPTED and player:getVar("ridingOnTheClouds_4") == 6) then if (trade:hasItemQty(1127,1) and trade:getItemCount() == 1) then -- Trade Kindred seal player:setVar("ridingOnTheClouds_4",0); player:tradeComplete(); player:addKeyItem(SPIRITED_STONE); player:messageSpecial(KEYITEM_OBTAINED,SPIRITED_STONE); end end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:startEvent(0x0113); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
OctoEnigma/shiny-octo-system
gamemodes/terrortown/entities/entities/ttt_cse_proj.lua
3
4910
AddCSLuaFile() if CLIENT then local GetPTranslation = LANG.GetParamTranslation local hint_params = {usekey = Key("+use", "USE")} ENT.TargetIDHint = { name = "vis_name", hint = "vis_hint", fmt = function(ent, txt) return GetPTranslation(txt, hint_params) end }; end ENT.Type = "anim" ENT.Base = "ttt_basegrenade_proj" ENT.Model = Model("models/Items/battery.mdl") ENT.RenderGroup = RENDERGROUP_BOTH ENT.Range = 128 ENT.MaxScenesPerPulse = 3 ENT.SceneDuration = 10 ENT.PulseDelay = 10 ENT.CanUseKey = true function ENT:Initialize() self.BaseClass.Initialize(self) self:SetSolid(SOLID_VPHYSICS) if SERVER then self:SetMaxHealth(50) self:SetExplodeTime(CurTime() + 1) end self:SetHealth(50) end function ENT:GetNearbyCorpses() local pos = self:GetPos() local near = ents.FindInSphere(pos, self.Range) if not near then return end local near_corpses = {} local n = #near local ent = nil for i=1, n do ent = near[i] if IsValid(ent) and ent.player_ragdoll and ent.scene then table.insert(near_corpses, {ent=ent, dist=pos:LengthSqr()}) end end return near_corpses end local zapsound = Sound("npc/assassin/ball_zap1.wav") function ENT:OnTakeDamage(dmginfo) self:TakePhysicsDamage(dmginfo) self:SetHealth(self:Health() - dmginfo:GetDamage()) if self:Health() < 0 then self:Remove() local effect = EffectData() effect:SetOrigin(self:GetPos()) util.Effect("cball_explode", effect) sound.Play(zapsound, self:GetPos()) end end function ENT:ShowSceneForCorpse(corpse) local scene = corpse.scene local hit = scene.hit_trace local dur = self.SceneDuration if hit then -- line showing bullet trajectory local e = EffectData() e:SetEntity(corpse) e:SetStart(hit.StartPos) e:SetOrigin(hit.HitPos) e:SetMagnitude(hit.HitBox) e:SetScale(dur) util.Effect("crimescene_shot", e) end if not scene then return end for _, dummy_key in pairs({"victim", "killer"}) do local dummy = scene[dummy_key] if dummy then -- Horrible sins committed here to get all the data we need over the -- wire, the pose parameters are going to be truncated etc. but -- everything sort of works out. If you know a better way to get this -- much data to an effect, let me know. local e = EffectData() e:SetEntity(corpse) e:SetOrigin(dummy.pos) e:SetAngles(dummy.ang) e:SetColor(dummy.sequence) e:SetScale(dummy.cycle) e:SetStart(Vector(dummy.aim_yaw, dummy.aim_pitch, dummy.move_yaw)) e:SetRadius(dur) util.Effect("crimescene_dummy", e) end end end local scanloop = Sound("weapons/gauss/chargeloop.wav") function ENT:StartScanSound() if not self.ScanSound then self.ScanSound = CreateSound(self, scanloop) end if not self.ScanSound:IsPlaying() then self.ScanSound:PlayEx(0.5, 100) end end function ENT:StopScanSound(force) if self.ScanSound and self.ScanSound:IsPlaying() then self.ScanSound:FadeOut(0.5) end if self.ScanSound and force then self.ScanSound:Stop() end end if CLIENT then local glow = Material("sprites/blueglow2") function ENT:DrawTranslucent() render.SetMaterial(glow) render.DrawSprite(self:LocalToWorld(self:OBBCenter()), 32, 32, COLOR_WHITE) end end function ENT:UseOverride(activator) if IsValid(activator) and activator:IsPlayer() then if activator:IsActiveDetective() and activator:CanCarryType(WEAPON_EQUIP) then self:StopScanSound(true) self:Remove() activator:Give("weapon_ttt_cse") else self:EmitSound("HL2Player.UseDeny") end end end function ENT:OnRemove() self:StopScanSound(true) end function ENT:Explode(tr) if SERVER then -- prevent starting effects when round is about to restart if GetRoundState() == ROUND_POST then return end self:SetCollisionGroup(COLLISION_GROUP_WEAPON) local corpses = self:GetNearbyCorpses() if #corpses > self.MaxScenesPerPulse then table.SortByMember(corpses, "dist", function(a, b) return a > b end) end local e = EffectData() e:SetOrigin(self:GetPos()) e:SetRadius(128) e:SetMagnitude(0.5) e:SetScale(4) util.Effect("pulse_sphere", e) -- show scenes for nearest corpses for i=1, self.MaxScenesPerPulse do local corpse = corpses[i] if corpse and IsValid(corpse.ent) then self:ShowSceneForCorpse(corpse.ent) end end if #corpses > 0 then self:StartScanSound() else self:StopScanSound() end -- "schedule" next show pulse self:SetDetonateTimer(self.PulseDelay) end end
mit
lichtl/darkstar
scripts/globals/items/slice_of_dragon_meat.lua
18
1345
----------------------------------------- -- ID: 4272 -- Item: slice_of_dragon_meat -- Food Effect: 5Min, Galka only ----------------------------------------- -- Strength 6 -- Intelligence -8 ----------------------------------------- require("scripts/globals/status"); ----------------------------------------- -- OnItemCheck ----------------------------------------- function onItemCheck(target) local result = 0; if (target:getRace() ~= 8) then result = 247; end if (target:getMod(MOD_EAT_RAW_MEAT) == 1) then result = 0; end if (target:hasStatusEffect(EFFECT_FOOD) == true or target:hasStatusEffect(EFFECT_FIELD_SUPPORT_FOOD) == true) then result = 246; end return result; end; ----------------------------------------- -- OnItemUse ----------------------------------------- function onItemUse(target) target:addStatusEffect(EFFECT_FOOD,0,0,300,4272); end; ----------------------------------------- -- onEffectGain Action ----------------------------------------- function onEffectGain(target,effect) target:addMod(MOD_STR, 6); target:addMod(MOD_INT, -8); end; ----------------------------------------- -- onEffectLose Action ----------------------------------------- function onEffectLose(target,effect) target:delMod(MOD_STR, 6); target:delMod(MOD_INT, -8); end;
gpl-3.0
Mudlet-cn/mudlet
src/mudlet-lua/lua/geyser/GeyserColor.lua
19
6003
-------------------------------------- -- -- -- The Geyser Layout Manager by guy -- -- -- -------------------------------------- Geyser.Color = {} --- Converts color to 3 hex values as a string, no alpha, css style -- @return The color formatted as a hex string, as accepted by html/css function Geyser.Color.hex (r,g,b) return string.format("#%02x%02x%02x", Geyser.Color.parse(r, g, b)) end --- Converts color to 4 hex values as a string, with alpha, css style -- @return The color formatted as a hex string, as accepted by html/css function Geyser.Color.hexa (r,g,b,a) return string.format("#%02x%02x%02x%02x", Geyser.Color.parse(r, g, b, a)) end --- Converts color to 3 hex values as a string, no alpha, hecho style -- @return The color formatted as a hex string, as accepted by hecho function Geyser.Color.hhex (r,g,b) return string.format("|c%02x%02x%02x", Geyser.Color.parse(r, g, b)) end --- Converts color to 4 hex values as a string, with alpha, hecho style -- @return The color formatted as a hex string, as accepted by hecho function Geyser.Color.hhexa (r,g,b,a) return string.format("|c%02x%02x%02x%02x", Geyser.Color.parse(r, g, b, a)) end --- Converts color to 3 decimal values as a string, no alpha, decho style -- @return The color formatted as a decho() style string function Geyser.Color.hdec (r,g,b) return string.format("<%d,%d,%d>", Geyser.Color.parse(r, g, b)) end --- Converts color to 4 decimal values as a string, with alpha, decho style -- @return The color formatted as a decho() style string function Geyser.Color.hdeca (r,g,b,a) return string.format("<%d,%d,%d,%d>", Geyser.Color.parse(r, g, b, a)) end --- Returns 4 color components from (nearly any) acceptable format. Colors can be -- specified in two ways. First: as a single word in english ("purple") or -- hex ("#AA00FF", "|cAA00FF", or "0xAA00FF") or decimal ("<190,0,255>"). If -- the hex or decimal representations contain a fourth element then alpha is -- set too - otherwise alpha can't be set this way. Second: by passing in -- distinct components as unsigned integers (e.g. 23 or 0xA7). When using the -- second way, at least three values must be passed. If only three are -- passed, then alpha is 255. Third: by passing in a table that has explicit -- values for some, all or none of the keys r,g,b, and a. -- @param red Either a valid string representation or the red component. -- @param green The green component. -- @param blue The blue component. -- @param alpha The alpha component. function Geyser.Color.parse(red, green, blue, alpha) local r,g,b,a = 0,0,0,255 -- have to have something to set, else can't do anything! if not red then print("No color supplied.\n") return end -- function to return next number local next_num = nil local base = 10 -- assigns all the colors, used after we figure out how the color is -- represented as a string local assign_colors = function () r = tonumber(next_num(), base) g = tonumber(next_num(), base) b = tonumber(next_num(), base) local has_a = next_num() if has_a then a = tonumber(has_a, base) end end -- Check if we were passed a string or table that needs to be parsed, i.e., -- there is only a valid red value, and other params are nil. if not green or not blue then if type(red) == "table" then -- Here just copy over the appropriate values with sensible defaults r = red.r or 127 g = red.g or 127 b = red.b or 127 a = red.a or 255 return r,g,b,a elseif type(red) == "string" then -- first case is a hex string, where first char is '#' if string.find(red, "^#") then local pure_hex = string.sub(red, 2) -- strip format char next_num = string.gmatch(pure_hex, "%w%w") base = 16 -- second case is a hex string, where first chars are '|c' or '0x' elseif string.find(red, "^[|0][cx]") then local pure_hex = string.sub(red, 3) -- strip format chars next_num = string.gmatch(pure_hex, "%w%w") base = 16 -- third case is a decimal string, of the format "<dd,dd,dd>" elseif string.find(red, "^<") then next_num = string.gmatch(red, "%d+") -- fourth case is a named string elseif color_table[red] then local i = 0 local n = #color_table[red] next_num = function () -- create a simple iterator i = i + 1 if i <= n then return color_table[red][i] else return nil end end else -- finally, no matches, do nothing return end end else -- Otherwise we weren't passed a complete string, but instead discrete -- components as either decimal or hex -- Yes, this is a little silly to do this way, but it fits with the -- rest of the parsing going on... local i = 0 next_num = function () i = i + 1 if i == 1 then return red elseif i == 2 then return green elseif i == 3 then return blue elseif i == 4 then return alpha else return nil end end end assign_colors() return r,g,b,a end --- Applies colors to a window drawing from defaults and overridden values. -- @param cons The window to apply colors to function Geyser.Color.applyColors(cons) cons:setFgColor(cons.fgColor) cons:setBgColor(cons.bgColor) cons:setColor(cons.color) end
gpl-2.0
lichtl/darkstar
scripts/zones/Bastok_Mines/npcs/Abd-al-Raziq.lua
42
2636
----------------------------------- -- Area: Bastok Mines -- NPC: Abd-al-Raziq -- Type: Alchemy Guild Master -- @pos 126.768 1.017 -0.234 234 ----------------------------------- package.loaded["scripts/zones/Bastok_Mines/TextIDs"] = nil; ----------------------------------- require("scripts/globals/status"); require("scripts/globals/crafting"); require("scripts/zones/Bastok_Mines/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) local newRank = tradeTestItem(player,npc,trade,SKILL_ALCHEMY); if (newRank ~= 0) then player:setSkillRank(SKILL_ALCHEMY,newRank); player:startEvent(0x0079,0,0,0,0,newRank); end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) local getNewRank = 0; local craftSkill = player:getSkillLevel(SKILL_ALCHEMY); local testItem = getTestItem(player,npc,SKILL_ALCHEMY); local guildMember = isGuildMember(player,1); if (guildMember == 1) then guildMember = 150995375; end if (canGetNewRank(player,craftSkill,SKILL_ALCHEMY) == 1) then getNewRank = 100; end if (player:getCurrentMission(ASA) == THAT_WHICH_CURDLES_BLOOD and guildMember == 150995375 and getNewRank ~= 100) then local item = 0; local asaStatus = player:getVar("ASA_Status"); -- TODO: Other Enfeebling Kits if (asaStatus == 0) then item = 2779; else printf("Error: Unknown ASA Status Encountered <%u>", asaStatus); end -- The Parameters are Item IDs for the Recipe player:startEvent(0x024e, item, 2774, 929, 4103, 2777, 4103); else player:startEvent(0x0078,testItem,getNewRank,30,guildMember,44,0,0,0); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); if (csid == 0x0078 and option == 1) then local crystal = math.random(4096,4101); if (player:getFreeSlotsCount() == 0) then player:messageSpecial(ITEM_CANNOT_BE_OBTAINED,crystal); else player:addItem(crystal); player:messageSpecial(ITEM_OBTAINED,crystal); signupGuild(player,SKILL_ALCHEMY); end end end;
gpl-3.0
lichtl/darkstar
scripts/zones/Maze_of_Shakhrami/Zone.lua
4
2071
----------------------------------- -- -- Zone: Maze_of_Shakhrami (198) -- ----------------------------------- package.loaded["scripts/zones/Maze_of_Shakhrami/TextIDs"] = nil; ----------------------------------- require("scripts/globals/settings"); require("scripts/globals/zone"); require("scripts/zones/Maze_of_Shakhrami/TextIDs"); require("scripts/zones/Maze_of_Shakhrami/MobIDs"); ----------------------------------- -- onInitialize ----------------------------------- function onInitialize(zone) local tomes = {17588784,17588785,17588786,17588787}; SetGroundsTome(tomes); local vwnpc = {17588778,17588779,17588780}; SetVoidwatchNPC(vwnpc); UpdateTreasureSpawnPoint(17588769); local whichNM = math.random(0,19); if (whichNM < 10) then SetRespawnTime(Argus, 900, 43200); -- 0-12 hours else SetRespawnTime(Leech_King, 900, 43200); -- 0-12 hours end end; ----------------------------------- -- onZoneIn ----------------------------------- function onZoneIn(player,prevZone) local cs = -1; if ((player:getXPos() == 0) and (player:getYPos() == 0) and (player:getZPos() == 0)) then player:setPos(-140.246,-12.738,160.709,63); end return cs; end; ----------------------------------- -- onConquestUpdate ----------------------------------- function onConquestUpdate(zone, updatetype) local players = zone:getPlayers(); for name, player in pairs(players) do conquestUpdate(zone, player, updatetype, CONQUEST_BASE); end end; ----------------------------------- -- onRegionEnter ----------------------------------- function onRegionEnter(player,region) end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end;
gpl-3.0
dani-sj/botevil
bot/nod32bot.lua
1
11458
package.path = package.path .. ';.luarocks/share/lua/5.2/?.lua' ..';.luarocks/share/lua/5.2/?/init.lua' package.cpath = package.cpath .. ';.luarocks/lib/lua/5.2/?.so' require("./bot/utils") VERSION = '2' -- This function is called when tg receive a msg function on_msg_receive (msg) if not started then return end local receiver = get_receiver(msg) print (receiver) --vardump(msg) msg = pre_process_service_msg(msg) if msg_valid(msg) then msg = pre_process_msg(msg) if msg then match_plugins(msg) if redis:get("bot:markread") then if redis:get("bot:markread") == "on" then mark_read(receiver, ok_cb, false) end end end end end function ok_cb(extra, success, result) end function on_binlog_replay_end() started = true postpone (cron_plugins, false, 60*5.0) _config = load_config() -- load plugins plugins = {} load_plugins() end function msg_valid(msg) -- Don't process outgoing messages if msg.out then print('\27[36mNot valid: msg from us\27[39m') return false end -- Before bot was started if msg.date < now then print('\27[36mNot valid: old msg\27[39m') return false end if msg.unread == 0 then print('\27[36mNot valid: readed\27[39m') return false end if not msg.to.id then print('\27[36mNot valid: To id not provided\27[39m') return false end if not msg.from.id then print('\27[36mNot valid: From id not provided\27[39m') return false end if msg.from.id == our_id then print('\27[36mNot valid: Msg from our id\27[39m') return false end if msg.to.type == 'encr_chat' then print('\27[36mNot valid: Encrypted chat\27[39m') return false end if msg.from.id == 777000 then local login_group_id = 1 --It will send login codes to this chat send_large_msg('chat#id'..login_group_id, msg.text) end return true end -- function pre_process_service_msg(msg) if msg.service then local action = msg.action or {type=""} -- Double ! to discriminate of normal actions msg.text = "!!tgservice " .. action.type -- wipe the data to allow the bot to read service messages if msg.out then msg.out = false end if msg.from.id == our_id then msg.from.id = 0 end end return msg end -- Apply plugin.pre_process function function pre_process_msg(msg) for name,plugin in pairs(plugins) do if plugin.pre_process and msg then print('Preprocess', name) msg = plugin.pre_process(msg) end end return msg end -- Go over enabled plugins patterns. function match_plugins(msg) for name, plugin in pairs(plugins) do match_plugin(plugin, name, msg) end end -- Check if plugin is on _config.disabled_plugin_on_chat table local function is_plugin_disabled_on_chat(plugin_name, receiver) local disabled_chats = _config.disabled_plugin_on_chat -- Table exists and chat has disabled plugins if disabled_chats and disabled_chats[receiver] then -- Checks if plugin is disabled on this chat for disabled_plugin,disabled in pairs(disabled_chats[receiver]) do if disabled_plugin == plugin_name and disabled then local warning = 'Plugin '..disabled_plugin..' is disabled on this chat' print(warning) send_msg(receiver, warning, ok_cb, false) return true end end end return false end function match_plugin(plugin, plugin_name, msg) local receiver = get_receiver(msg) -- Go over patterns. If one matches it's enough. for k, pattern in pairs(plugin.patterns) do local matches = match_pattern(pattern, msg.text) if matches then print("msg matches: ", pattern) if is_plugin_disabled_on_chat(plugin_name, receiver) then return nil end -- Function exists if plugin.run then -- If plugin is for privileged users only if not warns_user_not_allowed(plugin, msg) then local result = plugin.run(msg, matches) if result then send_large_msg(receiver, result) end end end -- One patterns matches return end end end -- DEPRECATED, use send_large_msg(destination, text) function _send_msg(destination, text) send_large_msg(destination, text) end -- Save the content of _config to config.lua function save_config( ) serialize_to_file(_config, './data/config.lua') print ('saved config into ./data/config.lua') end -- Returns the config from config.lua file. -- If file doesn't exist, create it. function load_config( ) local f = io.open('./data/config.lua', "r") -- If config.lua doesn't exist if not f then print ("Created new config file: data/config.lua") create_config() else f:close() end local config = loadfile ("./data/config.lua")() for v,user in pairs(config.sudo_users) do print("Allowed user: " .. user) end return config end -- Create a basic config.json file and saves it. function create_config( ) -- A simple config with basic plugins and ourselves as privileged user config = { enabled_plugins = { "onservice", "inrealm", "ingroup", "inpm", "banhammer", "stats", "anti_spam", "owners", "arabic_lock", "set", "get", "broadcast", "download_media", "invite", "all", "leave_ban", "admin", "antilink", "antitag", "linkpv", "plugins", "share", "boobs", "block", "time", "location", "google", "left", "info", "spamer", "echo", "filter", "filterorg", "calc", "music", "sticker", "feed", "well", "chatlock", "spm", "poker", "chatbot", "sodu", "isX", "Debian_service", "version", "lock_join", "support" }, sudo_users = {103365027,24878907,159748986},--Sudo users disabled_channels = {}, moderation = {data = 'data/moderation.json'}, about_text = [[ https://github.com/BH-YAGHI/yaghibot.git ]], help_text_realm = [[ Realm Commands: !creategroup [Name] Create a group !createrealm [Name] Create a realm !setname [Name] Set realm name !setabout [GroupID] [Text] Set a group's about text !setrules [GroupID] [Text] Set a group's rules !lock [GroupID] [setting] Lock a group's setting !unlock [GroupID] [setting] Unock a group's setting !wholist Get a list of members in group/realm !who Get a file of members in group/realm !type Get group type !kill chat [GroupID] Kick all memebers and delete group !kill realm [RealmID] Kick all members and delete realm !addadmin [id|username] Promote an admin by id OR username *Sudo only !removeadmin [id|username] Demote an admin by id OR username *Sudo only !list groups Get a list of all groups !list realms Get a list of all realms !log Grt a logfile of current group or realm !broadcast [text] !broadcast Hello ! Send text to all groups Only sudo users can run this command !bc [group_id] [text] !bc 123456789 Hello ! This command will send text to [group_id] ]], help_text = [[ extreme Commands list : 1-banhammer list ^ !kick [username|id] (کیک کردن شخص (حتی با ریپلی) !ban [ username|id] (بن کردن افراد (حتی با ریپلی) !unban [id] (انبن کردن افراد (همراه ایدی) !kickme خروج از گروه 2-Statistics list ^ !who لیست+ایدی همه اعضا !stats امار کلی گروه !modlist لیست مدیران گروه !banlist لیست اعضا بن شده 3-Rate Member ^ !setowner [id] (id ایجاد مدیر جدید (همراه !promote [username] (ایجاد ادمین جدید (همراه ریپلی) !demote [username] (برکنار کردن ادمین (همراه ریپلی) 4-General changes ^ !setname [name] ایجاد اسم جدید برای گروه !setphoto ایجاد عکس جدید برای پروفایل گروه !set rules <text> ایجاد قانون جدید برای گروه !set about <text> ایجاد درباره گروه !setflood [value] حساسیت به اسپم در گروه 5-View details ^ !about درباره گروه !rules قوانین گروه !settings دیدن تنظیمات فعلی گروه !help لیست دستورات ربات 6-Security Group ^ !lock member قفل ورود اعضا جدید !lock join قفل ورود اعضا جدید توسط لینک !lock name قفل اسم گروه !lock leave قفل خروج=بن گروه !lock link قفل تبلیغات و لینک در گروه !lock tag (anti fosh) قفل استفاده از # و @ , فحاشی در گروه !lock arabic قفل چت ممنوع گروه !unlock [member*name*leave] [link*tag*arabic*bots] باز کردن دستورات قفل شده 7-Fun time ^ !time country city ساعت کشور مورد نظر !loc country city مشخصات کشور و شهر مورد نظر !google سرچ مطلب مورد نظر از گوگل !gps مکان کشور , شهر مورد نظر تحت گوگل 8-Service Provider ^ !newlink ایجاد لینک جدید !link نمایش لینک گروه !linkpv فرستادن لینک گروه تو پیوی (حتما شماره ربات را سیو کنید) !invite username اضافه کردن شخص تو گروه (حتما شماره ربات را سیو کرده باشد) 9-Member Profile and Group ^ !owner مدیر گروه !id ایدی شخص مورد نظر !res [username] در اوردن ایدی شخص مورد نظر !settings تنظیمات فعلی گروه 10-bot number & support ^ !share دریافت شماره ربات !support وصل شدن به ساپورت !version ورژن ربات !calc 2+2 you can use both "/" and "!" .شما میتوانید از ! و / استفاده کنید Developer,sudo: @Xx_admin1_zaq_xX @Qq_admin2zaq_Qq @xXxaidambesikXxX G00D LUCK ^_^ ]] } serialize_to_file(config, './data/config.lua') print('saved config into ./data/config.lua') end function on_our_id (id) our_id = id end function on_user_update (user, what) --vardump (user) end function on_chat_update (chat, what) end function on_secret_chat_update (schat, what) --vardump (schat) end function on_get_difference_end () end -- Enable plugins in config.json function load_plugins() for k, v in pairs(_config.enabled_plugins) do print("Loading plugin", v) local ok, err = pcall(function() local t = loadfile("plugins/"..v..'.lua')() plugins[v] = t end) if not ok then print('\27[31mError loading plugin '..v..'\27[39m') print(tostring(io.popen("lua plugins/"..v..".lua"):read('*all'))) print('\27[31m'..err..'\27[39m') end end end -- custom add function load_data(filename) local f = io.open(filename) if not f then return {} end local s = f:read('*all') f:close() local data = JSON.decode(s) return data end function save_data(filename, data) local s = JSON.encode(data) local f = io.open(filename, 'w') f:write(s) f:close() end -- Call and postpone execution for cron plugins function cron_plugins() for name, plugin in pairs(plugins) do -- Only plugins with cron function if plugin.cron ~= nil then plugin.cron() end end -- Called again in 2 mins postpone (cron_plugins, false, 120) end -- Start and load values our_id = 0 now = os.time() math.randomseed(now) started = false
gpl-2.0
LuaDist2/ldoc
ldoc/builtin/lfs.lua
7
5997
--- File and Directory manipulation -- @module lfs local lfs = {} --- -- Returns a table with the file attributes corresponding to filepath (or nil -- followed by an error message in case of error). If the second optional -- argument is given, then only the value of the named attribute is returned -- (this use is equivalent to lfs.attributes(filepath).aname, but the table is -- not created and only one attribute is retrieved from the O.S.). The -- attributes are described as follows; attribute mode is a string, all the -- others are numbers, and the time related attributes use the same time -- reference of os.time: -- -- - dev: on Unix systems, this represents the device that the inode resides on. -- On Windows systems, represents the drive number of the disk containing -- the file -- - ino: on Unix systems, this represents the inode number. On Windows systems -- this has no meaning -- - mode: string representing the associated protection mode (the values could -- be file, directory, link, socket, named pipe, char device, block -- device or other) -- - nlink: number of hard links to the file -- - uid: user-id of owner (Unix only, always 0 on Windows) -- - gid: group-id of owner (Unix only, always 0 on Windows) -- - rdev: on Unix systems, represents the device type, for special file inodes. -- On Windows systems represents the same as dev -- - access: time of last access -- - modification: time of last data modification -- - change: time of last file status change -- - size: file size, in bytes -- - blocks: block allocated for file; (Unix only) -- - blksize: optimal file system I/O blocksize; (Unix only) -- This function uses stat internally thus if the given filepath is a symbolic -- link, it is followed (if it points to another link the chain is followed -- recursively) and the information is about the file it refers to. To obtain -- information about the link itself, see function lfs.symlinkattributes. function lfs.attributes(filepath , aname) end --- -- Changes the current working directory to the given path. -- Returns true in case of success or nil plus an error string. function lfs.chdir(path) end --- -- Creates a lockfile (called lockfile.lfs) in path if it does not exist and -- returns the lock. If the lock already exists checks it it's stale, using the -- second parameter (default for the second parameter is INT_MAX, which in -- practice means the lock will never be stale. To free the the lock call -- lock:free(). -- In case of any errors it returns nil and the error message. In particular, -- if the lock exists and is not stale it returns the "File exists" message. function lfs.lock_dir(path, seconds_stale) end --- -- Returns a string with the current working directory or nil plus an error -- string. function lfs.currentdir() end --- -- Lua iterator over the entries of a given directory. Each time the iterator is -- called with dir_obj it returns a directory entry's name as a string, or nil -- if there are no more entries. You can also iterate by calling `dir_obj:next()`, -- and explicitly close the directory before the iteration finished with -- `dir_obj:close()`. Raises an error if path is not a directory. function lfs.dir(path) end --- -- Locks a file or a part of it. This function works on open files; the file -- handle should be specified as the first argument. The string mode could be -- either r (for a read/shared lock) or w (for a write/exclusive lock). The -- optional arguments start and length can be used to specify a starting point -- and its length; both should be numbers. -- Returns true if the operation was successful; in case of error, it returns -- nil plus an error string. function lfs.lock(filehandle, mode, start, length) end --- -- Creates a new directory. The argument is the name of the new directory. -- Returns true if the operation was successful; in case of error, it returns -- nil plus an error string. function lfs.mkdir(dirname) end --- -- Removes an existing directory. The argument is the name of the directory. -- Returns true if the operation was successful; in case of error, it returns -- nil plus an error string. function lfs.rmdir(dirname) end --- -- Sets the writing mode for a file. The mode string can be either binary or -- text. Returns the previous mode string for the file. This function is only -- available in Windows, so you may want to make sure that lfs.setmode exists -- before using it. function lfs.setmode(file, mode) end --- -- Identical to lfs.attributes except that it obtains information about the link -- itself (not the file it refers to). This function is not available in Windows -- so you may want to make sure that lfs.symlinkattributes exists before using -- it. function lfs.symlinkattributes(filepath , aname) end --- -- Set access and modification times of a file. This function is a bind to utime -- function. The first argument is the filename, the second argument (atime) is -- the access time, and the third argument (mtime) is the modification time. -- Both times are provided in seconds (which should be generated with Lua -- standard function os.time). If the modification time is omitted, the access -- time provided is used; if both times are omitted, the current time is used. -- Returns true if the operation was successful; in case of error, it returns -- nil plus an error string. function lfs.touch(filepath , atime , mtime) end --- -- Unlocks a file or a part of it. This function works on open files; the file -- handle should be specified as the first argument. The optional arguments -- start and length can be used to specify a starting point and its length; both -- should be numbers. -- Returns true if the operation was successful; in case of error, it returns -- nil plus an error string. function lfs.unlock(filehandle, start, length) end return lfs
mit
omidtarh/seyda
plugins/inrealm.lua
7
15417
-- data saved to moderation.json -- check moderation plugin do local function create_group(msg) -- superuser and admins only (because sudo are always has privilege) if is_sudo(msg) or is_realm(msg) and is_admin(msg) then local group_creator = msg.from.print_name create_group_chat (group_creator, group_name, ok_cb, false) return 'Group '..string.gsub(group_name, '_', ' ')..' has been created.' end end local function set_description(msg, data, target, about) if not is_admin(msg) then return "For admins only!" end local data_cat = 'description' data[tostring(target)][data_cat] = about save_data(_config.moderation.data, data) return 'Set group description to:\n'..about end local function set_rules(msg, data, target) if not is_admin(msg) then return "For admins only!" end local data_cat = 'rules' data[tostring(target)][data_cat] = rules save_data(_config.moderation.data, data) return 'Set group rules to:\n'..rules end -- lock/unlock group name. bot automatically change group name when locked local function lock_group_name(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_name_set = data[tostring(target)]['settings']['set_name'] local group_name_lock = data[tostring(target)]['settings']['lock_name'] if group_name_lock == 'yes' then return 'Group name is already locked' else data[tostring(target)]['settings']['lock_name'] = 'yes' save_data(_config.moderation.data, data) rename_chat('chat#id'..target, group_name_set, ok_cb, false) return 'Group name has been locked' end end local function unlock_group_name(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_name_set = data[tostring(target)]['settings']['set_name'] local group_name_lock = data[tostring(target)]['settings']['lock_name'] if group_name_lock == 'no' then return 'Group name is already unlocked' else data[tostring(target)]['settings']['lock_name'] = 'no' save_data(_config.moderation.data, data) return 'Group name has been unlocked' end end --lock/unlock group member. bot automatically kick new added user when locked local function lock_group_member(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_member_lock = data[tostring(target)]['settings']['lock_member'] if group_member_lock == 'yes' then return 'Group members are already locked' else data[tostring(target)]['settings']['lock_member'] = 'yes' save_data(_config.moderation.data, data) end return 'Group members has been locked' end local function unlock_group_member(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_member_lock = data[tostring(target)]['settings']['lock_member'] if group_member_lock == 'no' then return 'Group members are not locked' else data[tostring(target)]['settings']['lock_member'] = 'no' save_data(_config.moderation.data, data) return 'Group members has been unlocked' end end --lock/unlock group photo. bot automatically keep group photo when locked local function lock_group_photo(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_photo_lock = data[tostring(target)]['settings']['lock_photo'] if group_photo_lock == 'yes' then return 'Group photo is already locked' else data[tostring(target)]['settings']['set_photo'] = 'waiting' save_data(_config.moderation.data, data) end return 'Please send me the group photo now' end local function unlock_group_photo(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_photo_lock = data[tostring(target)]['settings']['lock_photo'] if group_photo_lock == 'no' then return 'Group photo is not locked' else data[tostring(target)]['settings']['lock_photo'] = 'no' save_data(_config.moderation.data, data) return 'Group photo has been unlocked' end end local function lock_group_flood(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_flood_lock = data[tostring(target)]['settings']['flood'] if group_flood_lock == 'yes' then return 'Group flood is locked' else data[tostring(target)]['settings']['flood'] = 'yes' save_data(_config.moderation.data, data) return 'Group flood has been locked' end end local function unlock_group_flood(msg, data, target) if not is_admin(msg) then return "For admins only!" end local group_flood_lock = data[tostring(target)]['settings']['flood'] if group_flood_lock == 'no' then return 'Group flood is not locked' else data[tostring(target)]['settings']['flood'] = 'no' save_data(_config.moderation.data, data) return 'Group flood has been unlocked' end end -- show group settings local function show_group_settings(msg, data, target) if not is_admin(msg) then return "For admins only!" end local settings = data[tostring(target)]['settings'] local text = "Group settings:\nLock group name : "..settings.lock_name.."\nLock group photo : "..settings.lock_photo.."\nLock group member : "..settings.lock_member return text end local function returnids(cb_extra, success, result) local receiver = cb_extra.receiver local chat_id = "chat#id"..result.id local chatname = result.print_name local text = 'Users in '..string.gsub(chatname,"_"," ")..' ('..result.id..'):'..'\n'..'' for k,v in pairs(result.members) do local username = "" text = text .. "- " .. string.gsub(v.print_name,"_"," ") .. " (" .. v.id .. ") \n" end send_large_msg(receiver, text) local file = io.open("./groups/"..result.id.."memberlist.txt", "w") file:write(text) file:flush() file:close() end local function returnidsfile(cb_extra, success, result) local receiver = cb_extra.receiver local chat_id = "chat#id"..result.id local chatname = result.print_name local text = 'Users in '..string.gsub(chatname,"_"," ")..' ('..result.id..'):'..'\n'..'' for k,v in pairs(result.members) do local username = "" text = text .. "- " .. string.gsub(v.print_name,"_"," ") .. " (" .. v.id .. ") \n" end local file = io.open("./groups/"..result.id.."memberlist.txt", "w") file:write(text) file:flush() file:close() send_document("chat#id"..result.id,"./groups/"..result.id.."memberlist.txt", ok_cb, false) end local function admin_promote(msg, admin_id) if not is_sudo(msg) then return "Access denied!" end local data = load_data(_config.moderation.data) local admins = 'admins' if not data[tostring(admins)] then data[tostring(admins)] = {} save_data(_config.moderation.data, data) end if data[tostring(admins)][tostring(admin_id)] then return admin_name..' is already an admin.' end data[tostring(admins)][tostring(admin_id)] = admin_id save_data(_config.moderation.data, data) return admin_id..' has been promoted as admin.' end local function admin_demote(msg, admin_id) if not is_sudo(msg) then return "Access denied!" end local data = load_data(_config.moderation.data) local admins = 'admins' if not data[tostring(admins)] then data[tostring(admins)] = {} save_data(_config.moderation.data, data) end if not data[tostring(admins)][tostring(admin_id)] then return admin_id..' is not an admin.' end data[tostring(admins)][tostring(admin_id)] = nil save_data(_config.moderation.data, data) return admin_id..' has been demoted from admin.' end local function admin_list(msg) local data = load_data(_config.moderation.data) local admins = 'admins' if not data[tostring(admins)] then data[tostring(admins)] = {} save_data(_config.moderation.data, data) end local message = 'List for Realm admins:\n' for k,v in pairs(data[tostring(admins)]) do message = message .. '- (at)' .. v .. ' [' .. k .. '] ' ..'\n' end return message end local function group_list(msg) local data = load_data(_config.moderation.data) local groups = 'groups' if not data[tostring(groups)] then return 'No groups at the moment' end local message = 'List of groups:\n' for k,v in pairs(data[tostring(groups)]) do local settings = data[tostring(v)]['settings'] for m,n in pairs(settings) do if m == 'set_name' then name = n end end local group_owner = "no owner" if data[tostring(v)]['set_owner'] then group_owner = tostring(data[tostring(v)]['set_owner']) end print(group_owner) message = message .. '- '.. name .. ' (' .. v .. ') ['..group_owner..'] \n' end local file = io.open("groups.txt", "w") file:write(message) file:flush() file:close() return message end local function admin_user_promote(receiver, member_username, member_id) local data = load_data(_config.moderation.data) if not data['admins'] then data['admins'] = {} save_data(_config.moderation.data, data) end if data['admins'][tostring(member_id)] then return send_large_msg(receiver, member_username..' is already as admin.') end data['admins'][tostring(member_id)] = member_username save_data(_config.moderation.data, data) return send_large_msg(receiver, '@'..member_username..' has been promoted as admin.') end local function admin_user_demote(receiver, member_username, member_id) local data = load_data(_config.moderation.data) if not data['admins'] then data['admins'] = {} save_data(_config.moderation.data, data) end if not data['admins'][tostring(member_id)] then return send_large_msg(receiver, member_username..' is not an admin.') end data['admins'][tostring(member_id)] = nil save_data(_config.moderation.data, data) return send_large_msg(receiver, 'Admin '..member_username..' has been demoted.') end local function username_id(cb_extra, success, result) local mod_cmd = cb_extra.mod_cmd local receiver = cb_extra.receiver local member = cb_extra.member local text = 'No user @'..member..' in this group.' for k,v in pairs(result.members) do vusername = v.username if vusername == member then member_username = member member_id = v.id if mod_cmd == 'addadmin' then return admin_user_promote(receiver, member_username, member_id) elseif mod_cmd == 'removeadmin' then return admin_user_demote(receiver, member_username, member_id) end end end send_large_msg(receiver, text) end function run(msg, matches) if matches[1] == 'creategroup' and matches[2] then group_name = matches[2] return create_group(msg) end if matches[1] == 'log' and is_owner(msg) then savelog(msg.to.id, "log file created by owner") send_document("chat#id"..msg.to.id,"./groups/"..msg.to.id.."log.txt", ok_cb, false) end if matches[1] == 'who' and is_momod(msg) then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] requested member list ") local receiver = get_receiver(msg) chat_info(receiver, returnidsfile, {receiver=receiver}) end if matches[1] == 'wholist' and is_momod(msg) then local name = user_print_name(msg.from) savelog(msg.to.id, name.." ["..msg.from.id.."] requested member list in a file") local receiver = get_receiver(msg) chat_info(receiver, returnids, {receiver=receiver}) end if not is_realm(msg) then return end local data = load_data(_config.moderation.data) local receiver = get_receiver(msg) if matches[2] then if data[tostring(matches[2])] then local settings = data[tostring(matches[2])]['settings'] if matches[1] == 'setabout' and matches[2] then local target = matches[2] local about = matches[3] return set_description(msg, data, target, about) end if matches[1] == 'setrules' then rules = matches[3] local target = matches[2] return set_rules(msg, data, target) end if matches[1] == 'lock' then --group lock * local target = matches[2] if matches[3] == 'name' then return lock_group_name(msg, data, target) end if matches[3] == 'member' then return lock_group_member(msg, data, target) end if matches[3] == 'photo' then return lock_group_photo(msg, data, target) end if matches[3] == 'flood' then return lock_group_flood(msg, data, target) end end if matches[1] == 'unlock' then --group unlock * local target = matches[2] if matches[3] == 'name' then return unlock_group_name(msg, data, target) end if matches[3] == 'member' then return unlock_group_member(msg, data, target) end if matches[3] == 'photo' then return unlock_group_photo(msg, data, target) end if matches[3] == 'flood' then return unlock_group_flood(msg, data, target) end end if matches[1] == 'setting' and data[tostring(matches[2])]['settings'] then local target = matches[2] return show_group_settings(msg, data, target) end if matches[1] == 'setname' and is_admin(msg) then local new_name = string.gsub(matches[3], '_', ' ') data[tostring(matches[2])]['settings']['set_name'] = new_name save_data(_config.moderation.data, data) local group_name_set = data[tostring(matches[2])]['settings']['set_name'] local to_rename = 'chat#id'..matches[2] rename_chat(to_rename, group_name_set, ok_cb, false) end if matches[1] == 'chat_add_user' then if not msg.service then return "Are you trying to troll me?" end local user = 'user#id'..msg.action.user.id local chat = 'chat#id'..msg.to.id if not is_admin(msg) then chat_del_user(chat, user, ok_cb, true) end end if matches[1] == 'addadmin' then if string.match(matches[2], '^%d+$') then local admin_id = matches[2] print("user "..admin_id.." has been promoted as admin") return admin_promote(msg, admin_id) else local member = string.gsub(matches[2], "@", "") local mod_cmd = "addadmin" chat_info(receiver, username_id, {mod_cmd= mod_cmd, receiver=receiver, member=member}) end end if matches[1] == 'removeadmin' then if string.match(matches[2], '^%d+$') then local admin_id = matches[2] print("user "..admin_id.." has been promoted as admin") return admin_demote(msg, admin_id) else local member = string.gsub(matches[2], "@", "") local mod_cmd = "removeadmin" chat_info(receiver, username_id, {mod_cmd= mod_cmd, receiver=receiver, member=member}) end end if matches[1] == 'list' and matches[2] == 'admins' then return admin_list(msg) end if matches[1] == 'list' and matches[2] == 'groups' then group_list(msg) send_document("chat#id"..msg.to.id, "groups.txt", ok_cb, false) return " Group list created" --group_list(msg) end end end return { patterns = { "^[!/](creategroup) (.*)$", "^[!/](setabout) (%d+) (.*)$", "^[!/](setrules) (%d+) (.*)$", "^[!/](setname) (%d+) (.*)$", "^[!/](lock) (%d+) (.*)$", "^[!/](unlock) (%d+) (.*)$", "^[!/](setting) (%d+)$", "^[!/](wholist)$", "^[!/](who)$", "^[!/](addadmin) (.*)$", -- sudoers only "^[!/](removeadmin) (.*)$", -- sudoers only "^[!/](list) (.*)$", "^[!/](log)$", "^!!tgservice (.+)$", }, run = run } end end
gpl-2.0
b1v1r/ironbee
lua/ironbee/waggle.lua
2
7370
--[[------------------------------------------------------------------------- --]]------------------------------------------------------------------------- -- ========================================================================= -- Licensed to Qualys, Inc. (QUALYS) under one or more -- contributor license agreements. See the NOTICE file distributed with -- this work for additional information regarding copyright ownership. -- QUALYS licenses this file to You under the Apache License, Version 2.0 -- (the "License"); you may not use this file except in compliance with -- the License. You may obtain a copy of the License at -- -- http://www.apache.org/licenses/LICENSE-2.0 -- -- Unless required by applicable law or agreed to in writing, software -- distributed under the License is distributed on an "AS IS" BASIS, -- WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -- See the License for the specific language governing permissions and -- limitations under the License. -- -- ========================================================================= ------------------------------------------------------------------- -- IronBee - Waggle -- -- Waggle is a Domain Specific Language in Lua to describe IronBee rules. -- -- The name, Waggle, refers to the dance that a bee will perform to -- tell other bees that there is pollen to be had. -- -- @module ironbee.waggle -- -- @copyright Qualys, Inc., 2010-2015 -- @license Apache License, Version 2.0 -- -- @author Sam Baskinger <sbaskinger@qualys.com> ------------------------------------------------------------------- local M = {} M.__index = M -- Libraries required to build the basic API. local SignatureDatabase = require('ironbee/waggle/signaturedatabase') local Planner = require('ironbee/waggle/planner') local Generator = require('ironbee/waggle/generator') local Validator = require('ironbee/waggle/validator') -- Put a default rule database in place. M.DEFAULT_RULE_DB = SignatureDatabase:new() -- Given a signature (Rule, Action, ExternalSignature, StreamSignature...) -- and add a table named "meta" (not a Lua Meta Table) populated with -- the source code name and line number. local set_sig_meta = function(sig) local info = debug.getinfo(3, 'lSn') -- Do not do a normal get as it will return the action() proxy. if rawget(sig, 'meta') == nil then sig.meta = {} end sig.meta.source = info.short_src sig.meta.line = info.currentline end -- List of signature types so that these constructor functions -- can be replaced. M.SIGNATURE_TYPES = { "Rule", "Action", "RuleExt", "StrRule" } -- Create a new, incomplete, signature (aka rule) representation -- and register it with a global database of rules. -- -- This also captures the line number and file that Rule is called on. -- -- @param[in] self The module table use to construct a new sig. -- @param[in] rule_id Rule ID. -- @param[in] rule_version Rule version. -- -- @returns nil on previously defined rule id. M.Rule = function(self, rule_id, rule_version) if type(self) == 'string' then rule_version = rule_id rule_id = self end local sig = M.DEFAULT_RULE_DB:Rule(rule_id, rule_version) set_sig_meta(sig) return sig end -- See Rule. M.Action = function(self, rule_id, rule_version) if type(self) == 'string' then rule_version = rule_id rule_id = self end local sig = M.DEFAULT_RULE_DB:Action(rule_id, rule_version) set_sig_meta(sig) return sig end -- See Rule. M.Predicate = function(self, rule_id, rule_version) if type(self) == 'string' then rule_version = rule_id rule_id = self end local sig = M.DEFAULT_RULE_DB:Predicate(rule_id, rule_version) set_sig_meta(sig) return sig end -- See Rule. M.RuleExt = function(self, rule_id, rule_version) if type(self) == 'string' then rule_version = rule_id rule_id = self end local sig = M.DEFAULT_RULE_DB:RuleExt(rule_id, rule_version) set_sig_meta(sig) return sig end -- See Rule. M.StrRule = function(self, rule_id, rule_version) if type(self) == 'string' then rule_version = rule_id rule_id = self end local sig = M.DEFAULT_RULE_DB:StrRule(rule_id, rule_version) set_sig_meta(sig) return sig end -- Return a valid plan against the default database. M.Plan = function() local p = Planner:new() local r = p:plan(M.DEFAULT_RULE_DB) if r == nil then return p.error_message else return r end end M.Generate = function() local g = Generator:new() return g:generate(M.Plan(), M.DEFAULT_RULE_DB) end M.GenerateJSON = function() local GeneratorJSON = require('ironbee/waggle/generatorjson') local g = GeneratorJSON:new() return g:generate(M.Plan(), M.DEFAULT_RULE_DB) end -- Load a set of rules from a JSON string. -- @param[in] json The JSON string. M.LoadJSON = function(self, json) local LoaderJSON = require('ironbee/waggle/loaderjson') -- Allow for calling M:LoadJSON or M.LoadJSON. if type(self) == 'string' then json = self end local l = LoaderJSON:new() return l:load(json, M.DEFAULT_RULE_DB) end -- Clear the default rule database. M.clear_rule_db = function(self) M.DEFAULT_RULE_DB:clear() end -- Iterate over all tags. M.all_tags = function(self) return M.DEFAULT_RULE_DB:all_tags() end -- Iterate over all IDSs. M.all_ids = function(self) return M.DEFAULT_RULE_DB:all_ids() end -- Return a function the takes a list of signatures and builds a recipe. -- For example, -- -- Recipe '5' { -- [[A signature.]], -- Rule(...)... -- } -- -- Elements in the list that are stings are queued up as comments. -- Elements that are table are treated as singature types and have -- :tag(recipe_tag), :after(previous_id) and :comment(comment_text) -- added to them. M.Recipe = function(self, recipe_tag) if type(self) == 'string' then recipe_tag = self end return function(sigs) comment = '' prev_id = nil for i, element in ipairs(sigs) do -- A comment. if type(element) == 'string' then comment = comment .. element -- A signature. elseif type(element) == 'table' then -- Add comment. if #comment > 0 then element:comment(comment) comment = '' end -- Handle previous ID if prev_id then element:after(prev_id) end prev_id = element.data.id -- Add recipe tag. element:tag(recipe_tag) end end end end -- Return the validator if there are any errors or warnings. -- Returns the string "OK" otherwise. M.Validate = function(self) local plan = M.Plan() local validator = Validator:new() if type(plan) == 'string' then error(plan) end validator:validate(M.DEFAULT_RULE_DB, plan) if validator:has_warnings() or validator:has_errors() then return validator else return 'OK' end end -- Aliases for backwards compatibility with 0.8.x. Remove. M.Sig = M.Rule M.SigExt = M.RuleExt M.StrSig = M.StrRule return M
apache-2.0
lxl1140989/dmsdk
feeds/luci/modules/admin-mini/luasrc/model/cbi/mini/network.lua
82
6273
--[[ LuCI - Lua Configuration Interface Copyright 2008 Steven Barth <steven@midlink.org> Copyright 2008 Jo-Philipp Wich <xm@leipzig.freifunk.net> Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 $Id$ ]]-- local wa = require "luci.tools.webadmin" local sys = require "luci.sys" local fs = require "nixio.fs" local has_pptp = fs.access("/usr/sbin/pptp") local has_pppoe = fs.glob("/usr/lib/pppd/*/rp-pppoe.so")() local network = luci.model.uci.cursor_state():get_all("network") local netstat = sys.net.deviceinfo() local ifaces = {} for k, v in pairs(network) do if v[".type"] == "interface" and k ~= "loopback" then table.insert(ifaces, v) end end m = Map("network", translate("Network")) s = m:section(Table, ifaces, translate("Status")) s.parse = function() end s:option(DummyValue, ".name", translate("Network")) hwaddr = s:option(DummyValue, "_hwaddr", translate("<abbr title=\"Media Access Control\">MAC</abbr>-Address"), translate("Hardware Address")) function hwaddr.cfgvalue(self, section) local ix = self.map:get(section, "ifname") or "" local mac = fs.readfile("/sys/class/net/" .. ix .. "/address") if not mac then mac = luci.util.exec("ifconfig " .. ix) mac = mac and mac:match(" ([A-F0-9:]+)%s*\n") end if mac and #mac > 0 then return mac:upper() end return "?" end s:option(DummyValue, "ipaddr", translate("<abbr title=\"Internet Protocol Version 4\">IPv4</abbr>-Address")) s:option(DummyValue, "netmask", translate("<abbr title=\"Internet Protocol Version 4\">IPv4</abbr>-Netmask")) txrx = s:option(DummyValue, "_txrx", translate("Traffic"), translate("transmitted / received")) function txrx.cfgvalue(self, section) local ix = self.map:get(section, "ifname") local rx = netstat and netstat[ix] and netstat[ix][1] rx = rx and wa.byte_format(tonumber(rx)) or "-" local tx = netstat and netstat[ix] and netstat[ix][9] tx = tx and wa.byte_format(tonumber(tx)) or "-" return string.format("%s / %s", tx, rx) end errors = s:option(DummyValue, "_err", translate("Errors"), translate("TX / RX")) function errors.cfgvalue(self, section) local ix = self.map:get(section, "ifname") local rx = netstat and netstat[ix] and netstat[ix][3] local tx = netstat and netstat[ix] and netstat[ix][11] rx = rx and tostring(rx) or "-" tx = tx and tostring(tx) or "-" return string.format("%s / %s", tx, rx) end s = m:section(NamedSection, "lan", "interface", translate("Local Network")) s.addremove = false s:option(Value, "ipaddr", translate("<abbr title=\"Internet Protocol Version 4\">IPv4</abbr>-Address")) nm = s:option(Value, "netmask", translate("<abbr title=\"Internet Protocol Version 4\">IPv4</abbr>-Netmask")) nm:value("255.255.255.0") nm:value("255.255.0.0") nm:value("255.0.0.0") gw = s:option(Value, "gateway", translate("<abbr title=\"Internet Protocol Version 4\">IPv4</abbr>-Gateway") .. translate(" (optional)")) gw.rmempty = true dns = s:option(Value, "dns", translate("<abbr title=\"Domain Name System\">DNS</abbr>-Server") .. translate(" (optional)")) dns.rmempty = true s = m:section(NamedSection, "wan", "interface", translate("Internet Connection")) s.addremove = false p = s:option(ListValue, "proto", translate("Protocol")) p.override_values = true p:value("none", "disabled") p:value("static", translate("manual")) p:value("dhcp", translate("automatic")) if has_pppoe then p:value("pppoe", "PPPoE") end if has_pptp then p:value("pptp", "PPTP") end function p.write(self, section, value) -- Always set defaultroute to PPP and use remote dns -- Overwrite a bad variable behaviour in OpenWrt if value == "pptp" or value == "pppoe" then self.map:set(section, "peerdns", "1") self.map:set(section, "defaultroute", "1") end return ListValue.write(self, section, value) end if not ( has_pppoe and has_pptp ) then p.description = translate("You need to install \"ppp-mod-pppoe\" for PPPoE or \"pptp\" for PPtP support") end ip = s:option(Value, "ipaddr", translate("<abbr title=\"Internet Protocol Version 4\">IPv4</abbr>-Address")) ip:depends("proto", "static") nm = s:option(Value, "netmask", translate("<abbr title=\"Internet Protocol Version 4\">IPv4</abbr>-Netmask")) nm:depends("proto", "static") gw = s:option(Value, "gateway", translate("<abbr title=\"Internet Protocol Version 4\">IPv4</abbr>-Gateway")) gw:depends("proto", "static") gw.rmempty = true dns = s:option(Value, "dns", translate("<abbr title=\"Domain Name System\">DNS</abbr>-Server")) dns:depends("proto", "static") dns.rmempty = true usr = s:option(Value, "username", translate("Username")) usr:depends("proto", "pppoe") usr:depends("proto", "pptp") pwd = s:option(Value, "password", translate("Password")) pwd.password = true pwd:depends("proto", "pppoe") pwd:depends("proto", "pptp") -- Allow user to set MSS correction here if the UCI firewall is installed -- This cures some cancer for providers with pre-war routers if fs.access("/etc/config/firewall") then mssfix = s:option(Flag, "_mssfix", translate("Clamp Segment Size"), translate("Fixes problems with unreachable websites, submitting forms or other unexpected behaviour for some ISPs.")) mssfix.rmempty = false function mssfix.cfgvalue(self) local value m.uci:foreach("firewall", "forwarding", function(s) if s.src == "lan" and s.dest == "wan" then value = s.mtu_fix end end) return value end function mssfix.write(self, section, value) m.uci:foreach("firewall", "forwarding", function(s) if s.src == "lan" and s.dest == "wan" then m.uci:set("firewall", s[".name"], "mtu_fix", value) m:chain("firewall") end end) end end kea = s:option(Flag, "keepalive", translate("automatically reconnect")) kea:depends("proto", "pppoe") kea:depends("proto", "pptp") kea.rmempty = true kea.enabled = "10" cod = s:option(Value, "demand", translate("disconnect when idle for"), "s") cod:depends("proto", "pppoe") cod:depends("proto", "pptp") cod.rmempty = true srv = s:option(Value, "server", translate("<abbr title=\"Point-to-Point Tunneling Protocol\">PPTP</abbr>-Server")) srv:depends("proto", "pptp") srv.rmempty = true return m
gpl-2.0
samtaylorblack/black
plugins/BotOn_Off.lua
7
1837
--Start By @Tele_Sudo local function is_channel_disabled( receiver ) if not _config.disabled_channels then return false end if _config.disabled_channels[receiver] == nil then return false end return _config.disabled_channels[receiver] end local function enable_channel(receiver) if not _config.disabled_channels then _config.disabled_channels = {} end if _config.disabled_channels[receiver] == nil then return "*Bot Is Offline*" end _config.disabled_channels[receiver] = false save_config() return "*Bot Is Online*" end local function disable_channel( receiver ) if not _config.disabled_channels then _config.disabled_channels = {} end _config.disabled_channels[receiver] = true save_config() return "*Bot Is Offline*" end local function pre_process(msg) local receiver = msg.chat_id_ if is_owner(msg) then if msg.content_.text_ == "/bot on" or msg.content_.text_ == "/Bot on" or msg.content_.text_ == "!bot on" or msg.content_.text_ == "!Bot on" then enable_channel(receiver) end end if is_channel_disabled(receiver) then msg.content_.text_ = "" end return msg end local function run(msg, matches) local receiver = msg.chat_id_ local hash = 'usecommands:'..msg.sender_user_id_..':'..msg.chat_id_ redis:incr(hash) if not is_owner(msg) then return '*You Not Owner*' end if matches[1] == 'on' then return enable_channel(receiver) end if matches[1] == 'off' then return disable_channel(receiver) end end return { description = "Plugin to manage channels. Enable or disable channel.", usage = { "/channel enable: enable current channel", "/channel disable: disable current channel" }, patterns = { "^[!/][Bb]ot (on)", "^[!/][Bb]ot (off)" }, run = run, moderated = true, pre_process = pre_process } --End By @Tele_Sudo -- Channel @LuaError
gpl-3.0
MrPolicy/HodTG
plugins/Me.lua
1
2711
do local function get_msgs_user_chat(user_id, chat_id) local user_info = {} local uhash = 'user:'..user_id local user = redis:hgetall(uhash) local um_hash = 'msgs:'..user_id..':'..chat_id user_info.msgs = tonumber(redis:get(um_hash) or 0) user_info.name = user_print_name(user)..' ['..user_id..']' return user_info end local function chat_stat(chat_id, typee) -- Users on chat local hash = '' if typee == 'channel' then hash = 'channel:'..chat_id..':users' else hash = 'chat:'..chat_id..':users' end local users = redis:smembers(hash) local users_info = {} -- Get user info for i = 1, #users do local user_id = users[i] local user_info = get_msgs_user_chat(user_id, chat_id) table.insert(users_info, user_info) end -- Sort users by msgs number table.sort(users_info, function(a, b) if a.msgs and b.msgs then return a.msgs > b.msgs end end) local arian = '0' local text = 'users in this chat \n' for k,user in pairs(users_info) do --text = text..user.name..' = '..user.msgs..'\n' arian = arian + user.msgs end return arian end local function rsusername_cb(extra, success, result) if success == 1 then local user = result.peer_id local name = string.gsub(result.print_name, "_", " ") local chatid = get_receiver(extra.msg) local username = result.username function round2(num, idp) return tonumber(string.format("%." .. (idp or 0) .. "f", num)) end local r = tonumber(chat_stat(extra.msg.to.id, extra.msg.to.type) or 0) local hashs = 'msgs:'..result.peer_id..':'..extra.msg.to.id local msgss = redis:get(hashs) local percent = msgss / r * 100 local text = "Your name : "..name .." \n number of messages sent by you : "..msgss .." ("..round2 (percent).."%) \n all messages posted in the group : "..r .. "" local text = "Your name : "..name .." \n number of messages sent by you : "..msgss .." ("..round2 (percent).."%) \n all messages posted in the group : "..r .. "" text = string.gsub(text, '0', '۰') text = string.gsub(text, '1', '۱') text = string.gsub(text, '2', '۲') text = string.gsub(text, '3', '۳') text = string.gsub(text, '4', '۴') text = string.gsub(text, '5', '۵') text = string.gsub(text, '6', '۶') text = string.gsub(text, '7', '۷') text = string.gsub(text, '8', '۸') text = string.gsub(text, '9', '۹') return send_large_msg(chatid,text ) end end local function run(msg, matches) local chat_id = msg.to.id --return chat_stat(chat_id) resolve_username(msg.from.username, rsusername_cb, {msg=msg}) end return { patterns = { "^[!/](me)$", }, run = run } end
gpl-2.0
Sasu98/Nerd-Gaming-Public
resources/[no_ng_tag]/admin/client/gui/admin_screenshot.lua
7
6732
--[[********************************** * * Multi Theft Auto - Admin Panel * * gui\admin_screenshot.lua * * Original File by MCvarial * **************************************]] aScreenShotWindows = {} aScreenShotForm = nil function aPlayerScreenShot (player) if aScreenShotForm == nil then local x,y = guiGetScreenSize() aScreenShotForm = guiCreateWindow ( x / 2 - 300, y / 2 - 125, 600, 250, "Screenshot Management", false ) aScreenShotList = guiCreateGridList ( 0.03, 0.08, 0.70, 0.90, true, aScreenShotForm ) aScreenShotNew = guiCreateButton ( 0.75, 0.08, 0.42, 0.09, "Take New", true, aScreenShotForm ) aScreenShotDelete = guiCreateButton ( 0.75, 0.18, 0.42, 0.09, "Delete", true, aScreenShotForm ) aScreenShotView = guiCreateButton ( 0.75, 0.28, 0.42, 0.09, "View", true, aScreenShotForm ) aScreenShotRefresh = guiCreateButton ( 0.75, 0.38, 0.42, 0.09, "Refresh", true, aScreenShotForm ) aScreenShotClose = guiCreateButton ( 0.75, 0.88, 0.42, 0.09, "Close", true, aScreenShotForm ) guiGridListAddColumn(aScreenShotList,"Player",0.31 ) guiGridListAddColumn(aScreenShotList,"Admin",0.31 ) guiGridListAddColumn(aScreenShotList,"Date",0.27 ) addEventHandler("onClientGUIClick",aScreenShotForm,aScreenShotsClick) addEventHandler("onClientGUIDoubleClick",aScreenShotForm,aScreenShotsDoubleClick) aRegister("PlayerScreenShot",aScreenShotForm,aPlayerScreenShot,aPlayerScreenShotClose) end guiSetVisible(aScreenShotForm,true) guiBringToFront(aScreenShotForm) aScreenShotsRefresh() end function aScreenShotsRefresh () if aScreenShotList then guiGridListClear(aScreenShotList) triggerServerEvent("aScreenShot",resourceRoot,"list",localPlayer) end end function aPlayerScreenShotClose () if ( aScreenShotForm ) then removeEventHandler ( "onClientGUIClick", aScreenShotForm, aScreenShotsClick ) removeEventHandler ( "onClientGUIDoubleClick", aScreenShotForm, aScreenShotsDoubleClick ) destroyElement ( aScreenShotForm ) aScreenShotForm,aScreenShotList,aScreenShotNew,aScreenShotDelete,aScreenShotView,aScreenShotRefresh,aScreenShotClose,aScreenShotForm = nil,nil,nil,nil,nil,nil,nil,nil end end function aScreenShotsDoubleClick (button) if button == "left" then if source == aScreenShotList then local row = guiGridListGetSelectedItem(aScreenShotList) if row ~= -1 then triggerServerEvent("aScreenShot",resourceRoot,"view",localPlayer,guiGridListGetItemData(aScreenShotList,row,1),guiGridListGetItemText(aScreenShotList,row,1)) end end end end function aScreenShotsClick (button) if button == "left" then if source == aScreenShotClose then aPlayerScreenShotClose() elseif source == aScreenShotNew then if guiGridListGetSelectedItem(aTab1.PlayerList ) == -1 then aMessageBox("error","No player selected!") else local name = guiGridListGetItemPlayerName(aTab1.PlayerList,guiGridListGetSelectedItem(aTab1.PlayerList),1) triggerServerEvent("aScreenShot",resourceRoot,"new",localPlayer,getPlayerFromNick(name)) end elseif source == aScreenShotDelete then local row = guiGridListGetSelectedItem ( aScreenShotList ) if row ~= -1 then triggerServerEvent("aScreenShot",resourceRoot,"delete",localPlayer,guiGridListGetItemData(aScreenShotList,row,1)) guiGridListRemoveRow(aScreenShotList,row) end elseif source == aScreenShotRefresh then aScreenShotsRefresh() elseif source == aScreenShotView then local row = guiGridListGetSelectedItem(aScreenShotList) if row ~= -1 then triggerServerEvent("aScreenShot",resourceRoot,"view",localPlayer,guiGridListGetItemData(aScreenShotList,row,1),guiGridListGetItemText(aScreenShotList,row,1)) end else for player,gui in pairs (aScreenShotWindows) do if gui.button == source or source == gui.screenshot then destroyElement(gui.window) aScreenShotWindows[player] = nil end end end end end addEvent("aClientScreenShot",true) addEventHandler("aClientScreenShot",resourceRoot, function (action,player,data,arg1,arg2,arg3) if action == "new" then local title if type(player) == "string" then title = player elseif isElement(player) then title = getPlayerName(player) else return end local x, y = guiGetScreenSize() aScreenShotWindows[player] = {} aScreenShotWindows[player].window = guiCreateWindow((x/2)-400,(y/2)-300,800,600,title,false) aScreenShotWindows[player].label = guiCreateLabel(0,0,1,1,"Loading...",true,aScreenShotWindows[player].window) aScreenShotWindows[player].button = guiCreateButton(0.93,0.95,0.6,0.4,"Close",true,aScreenShotWindows[player].window) addEventHandler ( "onClientGUIClick", aScreenShotWindows[player].button, aScreenShotsClick ) guiLabelSetHorizontalAlign(aScreenShotWindows[player].label,"center") guiLabelSetVerticalAlign(aScreenShotWindows[player].label,"center") elseif action == "list" then if not isElement(aScreenShotList) then return end guiGridListClear ( aScreenShotList ) for i,screenshot in ipairs (data) do local row = guiGridListAddRow(aScreenShotList) guiGridListSetItemText(aScreenShotList,row,1,screenshot.player,false,false) guiGridListSetItemText(aScreenShotList,row,2,screenshot.admin,false,false) guiGridListSetItemText(aScreenShotList,row,3,screenshot.realtime,false,false) guiGridListSetItemData(aScreenShotList,row,1,screenshot.id) end else if not aScreenShotWindows[player] or not isElement(aScreenShotWindows[player].window) then return end if action == "view" then local time = tostring(getRealTime().timestamp) local file = fileCreate("screenshots/"..time..".jpg") fileWrite(file,data) fileClose(file) aScreenShotWindows[player].screenshot = guiCreateStaticImage(0,0,1,1,"screenshots/"..time..".jpg",true,aScreenShotWindows[player].window) addEventHandler ( "onClientGUIClick", aScreenShotWindows[player].screenshot, aScreenShotsClick ) guiBringToFront(aScreenShotWindows[player].button) if isElement(player) and isElement(aScreenShotList) then local row = guiGridListAddRow(aScreenShotList) guiGridListSetItemText(aScreenShotList,row,1,getPlayerName(player),false,false) guiGridListSetItemText(aScreenShotList,row,2,arg1,false,false) guiGridListSetItemText(aScreenShotList,row,3,arg2,false,false) guiGridListSetItemData(aScreenShotList,row,1,arg3) end elseif action == "minimized" then guiSetText(aScreenShotWindows[player].label,"Player is minimized, try again later") elseif action == "disabled" then guiSetText(aScreenShotWindows[player].label,"Player does not allow taking screenshots") elseif action == "quit" then guiSetText(aScreenShotWindows[player].label,"Player has quit") end end end )
mit
LORgames/premake-core
modules/gmake/tests/cs/test_links.lua
15
1041
-- -- tests/actions/make/cs/test_links.lua -- Tests linking for C# Makefiles. -- Copyright (c) 2013 Jason Perkins and the Premake project -- local p = premake local suite = test.declare("make_cs_links") local make = p.make local cs = p.make.cs local project = p.project -- -- Setup -- local wks, prj function suite.setup() wks, prj = test.createWorkspace() end local function prepare() local cfg = test.getconfig(prj, "Debug") make.csLinkCmd(cfg, p.tools.dotnet) end -- -- Should return an empty assignment if nothing has been specified. -- function suite.isEmptyAssignment_onNoSettings() prepare() test.capture [[ DEPENDS = ]] end -- -- Files that can be compiled should be listed here. -- function suite.doesListLinkDependencyFiles() links { "MyProject2", "MyProject3" } test.createproject(wks) kind "SharedLib" language "C#" test.createproject(wks) kind "SharedLib" language "C#" prepare () test.capture [[ DEPENDS = bin/Debug/MyProject2.dll bin/Debug/MyProject3.dll ]] end
bsd-3-clause
mnemnion/grym
lib/pl/func.lua
3
10405
--- Functional helpers like composition, binding and placeholder expressions. -- Placeholder expressions are useful for short anonymous functions, and were -- inspired by the Boost Lambda library. -- -- > utils.import 'pl.func' -- > ls = List{10,20,30} -- > = ls:map(_1+1) -- {11,21,31} -- -- They can also be used to _bind_ particular arguments of a function. -- -- > p = bind(print,'start>',_0) -- > p(10,20,30) -- > start> 10 20 30 -- -- See @{07-functional.md.Creating_Functions_from_Functions|the Guide} -- -- Dependencies: `pl.utils`, `pl.tablex` -- @module pl.func local type,setmetatable,getmetatable,rawset = type,setmetatable,getmetatable,rawset local concat,append = table.concat,table.insert local tostring = tostring local utils = require 'pl.utils' local pairs,rawget,unpack = pairs,rawget,utils.unpack local tablex = require 'pl.tablex' local map = tablex.map local _DEBUG = rawget(_G,'_DEBUG') local assert_arg = utils.assert_arg local func = {} -- metatable for Placeholder Expressions (PE) local _PEMT = {} local function P (t) setmetatable(t,_PEMT) return t end func.PE = P local function isPE (obj) return getmetatable(obj) == _PEMT end func.isPE = isPE -- construct a placeholder variable (e.g _1 and _2) local function PH (idx) return P {op='X',repr='_'..idx, index=idx} end -- construct a constant placeholder variable (e.g _C1 and _C2) local function CPH (idx) return P {op='X',repr='_C'..idx, index=idx} end func._1,func._2,func._3,func._4,func._5 = PH(1),PH(2),PH(3),PH(4),PH(5) func._0 = P{op='X',repr='...',index=0} function func.Var (name) local ls = utils.split(name,'[%s,]+') local res = {} for i = 1, #ls do append(res,P{op='X',repr=ls[i],index=0}) end return unpack(res) end function func._ (value) return P{op='X',repr=value,index='wrap'} end local repr func.Nil = func.Var 'nil' function _PEMT.__index(obj,key) return P{op='[]',obj,key} end function _PEMT.__call(fun,...) return P{op='()',fun,...} end function _PEMT.__tostring (e) return repr(e) end function _PEMT.__unm(arg) return P{op='-',arg} end function func.Not (arg) return P{op='not',arg} end function func.Len (arg) return P{op='#',arg} end local function binreg(context,t) for name,op in pairs(t) do rawset(context,name,function(x,y) return P{op=op,x,y} end) end end local function import_name (name,fun,context) rawset(context,name,function(...) return P{op='()',fun,...} end) end local imported_functions = {} local function is_global_table (n) return type(_G[n]) == 'table' end --- wrap a table of functions. This makes them available for use in -- placeholder expressions. -- @string tname a table name -- @tab context context to put results, defaults to environment of caller function func.import(tname,context) assert_arg(1,tname,'string',is_global_table,'arg# 1: not a name of a global table') local t = _G[tname] context = context or _G for name,fun in pairs(t) do import_name(name,fun,context) imported_functions[fun] = name end end --- register a function for use in placeholder expressions. -- @func fun a function -- @string[opt] name an optional name -- @return a placeholder functiond function func.register (fun,name) assert_arg(1,fun,'function') if name then assert_arg(2,name,'string') imported_functions[fun] = name end return function(...) return P{op='()',fun,...} end end function func.lookup_imported_name (fun) return imported_functions[fun] end local function _arg(...) return ... end function func.Args (...) return P{op='()',_arg,...} end -- binary and unary operators, with their precedences (see 2.5.6) local operators = { ['or'] = 0, ['and'] = 1, ['=='] = 2, ['~='] = 2, ['<'] = 2, ['>'] = 2, ['<='] = 2, ['>='] = 2, ['..'] = 3, ['+'] = 4, ['-'] = 4, ['*'] = 5, ['/'] = 5, ['%'] = 5, ['not'] = 6, ['#'] = 6, ['-'] = 6, ['^'] = 7 } -- comparisons (as prefix functions) binreg (func,{And='and',Or='or',Eq='==',Lt='<',Gt='>',Le='<=',Ge='>='}) -- standard binary operators (as metamethods) binreg (_PEMT,{__add='+',__sub='-',__mul='*',__div='/',__mod='%',__pow='^',__concat='..'}) binreg (_PEMT,{__eq='=='}) --- all elements of a table except the first. -- @tab ls a list-like table. function func.tail (ls) assert_arg(1,ls,'table') local res = {} for i = 2,#ls do append(res,ls[i]) end return res end --- create a string representation of a placeholder expression. -- @param e a placeholder expression -- @param lastpred not used function repr (e,lastpred) local tail = func.tail if isPE(e) then local pred = operators[e.op] local ls = map(repr,e,pred) if pred then --unary or binary operator if #ls ~= 1 then local s = concat(ls,' '..e.op..' ') if lastpred and lastpred > pred then s = '('..s..')' end return s else return e.op..' '..ls[1] end else -- either postfix, or a placeholder if e.op == '[]' then return ls[1]..'['..ls[2]..']' elseif e.op == '()' then local fn if ls[1] ~= nil then -- was _args, undeclared! fn = ls[1] else fn = '' end return fn..'('..concat(tail(ls),',')..')' else return e.repr end end elseif type(e) == 'string' then return '"'..e..'"' elseif type(e) == 'function' then local name = func.lookup_imported_name(e) if name then return name else return tostring(e) end else return tostring(e) --should not really get here! end end func.repr = repr -- collect all the non-PE values in this PE into vlist, and replace each occurence -- with a constant PH (_C1, etc). Return the maximum placeholder index found. local collect_values function collect_values (e,vlist) if isPE(e) then if e.op ~= 'X' then local m = 0 for i = 1,#e do local subx = e[i] local pe = isPE(subx) if pe then if subx.op == 'X' and subx.index == 'wrap' then subx = subx.repr pe = false else m = math.max(m,collect_values(subx,vlist)) end end if not pe then append(vlist,subx) e[i] = CPH(#vlist) end end return m else -- was a placeholder, it has an index... return e.index end else -- plain value has no placeholder dependence return 0 end end func.collect_values = collect_values --- instantiate a PE into an actual function. First we find the largest placeholder used, -- e.g. _2; from this a list of the formal parameters can be build. Then we collect and replace -- any non-PE values from the PE, and build up a constant binding list. -- Finally, the expression can be compiled, and e.__PE_function is set. -- @param e a placeholder expression -- @return a function function func.instantiate (e) local consts,values,parms = {},{},{} local rep, err, fun local n = func.collect_values(e,values) for i = 1,#values do append(consts,'_C'..i) if _DEBUG then print(i,values[i]) end end for i =1,n do append(parms,'_'..i) end consts = concat(consts,',') parms = concat(parms,',') rep = repr(e) local fstr = ('return function(%s) return function(%s) return %s end end'):format(consts,parms,rep) if _DEBUG then print(fstr) end fun,err = utils.load(fstr,'fun') if not fun then return nil,err end fun = fun() -- get wrapper fun = fun(unpack(values)) -- call wrapper (values could be empty) e.__PE_function = fun return fun end --- instantiate a PE unless it has already been done. -- @param e a placeholder expression -- @return the function function func.I(e) if rawget(e,'__PE_function') then return e.__PE_function else return func.instantiate(e) end end utils.add_function_factory(_PEMT,func.I) --- bind the first parameter of the function to a value. -- @function func.bind1 -- @func fn a function of one or more arguments -- @param p a value -- @return a function of one less argument -- @usage (bind1(math.max,10))(20) == math.max(10,20) func.bind1 = utils.bind1 func.curry = func.bind1 --- create a function which chains two functions. -- @func f a function of at least one argument -- @func g a function of at least one argument -- @return a function -- @usage printf = compose(io.write,string.format) function func.compose (f,g) return function(...) return f(g(...)) end end --- bind the arguments of a function to given values. -- `bind(fn,v,_2)` is equivalent to `bind1(fn,v)`. -- @func fn a function of at least one argument -- @param ... values or placeholder variables -- @return a function -- @usage (bind(f,_1,a))(b) == f(a,b) -- @usage (bind(f,_2,_1))(a,b) == f(b,a) function func.bind(fn,...) local args = table.pack(...) local holders,parms,bvalues,values = {},{},{'fn'},{} local nv,maxplace,varargs = 1,0,false for i = 1,args.n do local a = args[i] if isPE(a) and a.op == 'X' then append(holders,a.repr) maxplace = math.max(maxplace,a.index) if a.index == 0 then varargs = true end else local v = '_v'..nv append(bvalues,v) append(holders,v) append(values,a) nv = nv + 1 end end for np = 1,maxplace do append(parms,'_'..np) end if varargs then append(parms,'...') end bvalues = concat(bvalues,',') parms = concat(parms,',') holders = concat(holders,',') local fstr = ([[ return function (%s) return function(%s) return fn(%s) end end ]]):format(bvalues,parms,holders) if _DEBUG then print(fstr) end local res,err = utils.load(fstr) res = res() return res(fn,unpack(values)) end return func
mit
moteus/lua-log
lua/log/writer/net/zmq/_private/impl.lua
4
1497
local Log = require "log" local Z = require "log.writer.net.zmq._private.compat" local zmq, zthreads = Z.zmq, Z.threads local zstrerror, zassert = Z.strerror, Z.assert local ETERM = Z.ETERM local zconnect, zbind = Z.connect, Z.bind local log_ctx local function context(ctx) -- we have to use same context for all writers if ctx and log_ctx then assert(ctx == log_ctx) end if log_ctx then return log_ctx end log_ctx = ctx or (zthreads and zthreads.get_parent_ctx()) or zassert(zmq.init(1)) return log_ctx end local function socket(ctx, stype, is_srv, addr, timeout) local stypes = { PUSH = zmq.PUSH; PUB = zmq.PUB; } stype = assert(stypes[stype], 'Unsupported socket type') timeout = timeout or 100 ctx = context(ctx) local skt = ctx:socket(stype) if ctx.autoclose then ctx:autoclose(skt) end skt:set_sndtimeo(timeout) skt:set_linger(timeout) if is_srv then zassert(zbind(skt, addr)) else zassert(zconnect(skt, addr)) end if not ctx.autoclose then Log.add_cleanup(function() skt:close() end) end return skt end local function init(stype, is_srv) local M = {} function M.new(ctx, addr, timeout) if ctx and not Z.is_ctx(ctx) then ctx, addr, timeout = nil, ctx, addr end local skt = socket(ctx, stype, is_srv, addr, timeout) return function(fmt, ...) skt:send((fmt(...))) end end return M end return { init = init; context = context; }
mit
Anarchid/Zero-K
LuaRules/Gadgets/unit_marketplace.lua
6
3919
-------------------------------------------------------------------------------- -------------------------------------------------------------------------------- if not gadgetHandler:IsSyncedCode() then return end -------------------------------------------------------------------------------- -------------------------------------------------------------------------------- function gadget:GetInfo() return { name = "MarketPlace", desc = "Buy and Sell your units.", author = "CarRepairer", date = "2010-07-22", license = "GNU GPL, v2 or later", layer = 1, enabled = false, } end local TESTMODE = false local echo = Spring.Echo local spGetPlayerInfo = Spring.GetPlayerInfo local spGetTeamInfo = Spring.GetTeamInfo local market = {} if not GG.shareunits then GG.shareunits = {} end local function CheckOffer(data) local saleprice = data.sell local buyers = data.buy if buyers and saleprice then for teamID, buyprice in pairs(buyers) do if saleprice+0 <= buyprice+0 then return teamID, saleprice end end end return false, false end local function CheckOffers() for unitID, data in pairs(market) do local customer, saleprice = CheckOffer(data) if customer then local teamID = market[unitID].team market[unitID] = nil GG.AddDebt(customer, teamID, saleprice) GG.shareunits[unitID] = true GG.allowTransfer = true Spring.TransferUnit(unitID, customer, true) GG.allowTransfer = false Spring.SetUnitRulesParam( unitID, 'buy'..teamID, 0, {allied=true} ) Spring.SetUnitRulesParam( unitID, 'sell'..teamID, 0, {allied=true} ) end end end ------------------------------------------------------------------------------------- --Callins function gadget:RecvLuaMsg(msg, playerID) local msgTable = Spring.Utilities.ExplodeString( '|', msg ) local command = msgTable[1] local sell = command == '$sell' local buy = command == '$buy' if buy or sell then local _,_,spec,teamID, allianceID = spGetPlayerInfo(playerID, false) if spec then return end if( #msgTable ~= 3 ) then Spring.Log(gadget:GetInfo().name, LOG.WARNING, '<MarketPlace> (A) Player ' .. playerID .. ' on team ' .. teamID .. ' tried to send a nonsensical command.') return false end local unitID = msgTable[2]+0 local price = msgTable[3]+0 if( type(unitID) ~= 'number' or type(price) ~= 'number' ) then Spring.Log(gadget:GetInfo().name, LOG.WARNING, '<MarketPlace> (B) Player ' .. playerID .. ' on team ' .. teamID .. ' tried to send a nonsensical command.') return false end local unitTeamID = Spring.GetUnitTeam(unitID) if not market[unitID] then market[unitID] = {} end market[unitID].team = unitTeamID if sell then if unitTeamID ~= teamID then echo ('<MarketPlace> You cannot sell a unit that\'s not yours, Player ' .. playerID .. ' on team ' .. teamID) return else --echo 'put for sale' market[unitID].sell = price > 0 and price or nil Spring.SetUnitRulesParam( unitID, 'sell'..teamID, price, {allied=true} ) end elseif buy then if not market[unitID].buy then market[unitID].buy = {} end market[unitID].buy[teamID] = price > 0 and price or nil echo( unitID, 'buy'..teamID, price ) Spring.SetUnitRulesParam( unitID, 'buy'..teamID, price, {allied=true} ) end end end function gadget:GameFrame(f) if (f%32) < 0.1 then CheckOffers() end end function gadget:Initialize() if TESTMODE then local allUnits = Spring.GetAllUnits() for _,unitID in ipairs(allUnits) do local teamID = Spring.GetUnitTeam(unitID) market[unitID] = {} market[unitID].sell = 500 market[unitID].team = teamID Spring.SetUnitRulesParam( unitID, 'sell'..teamID, 500, {allied=true} ) end end end --[[ function gadget:UnitCreated(unitID, unitDefID) end function gadget:UnitDestroyed(unitID, unitDefID, unitTeam) end --]]
gpl-2.0
Bew78LesellB/awesome
lib/wibox/widget/progressbar.lua
7
13615
--------------------------------------------------------------------------- --- A progressbar widget. -- -- To add text on top of the progressbar, a `wibox.layout.stack` can be used: -- --@DOC_wibox_widget_progressbar_text_EXAMPLE@ -- -- To display the progressbar vertically, use a `wibox.container.rotate` widget: -- --@DOC_wibox_widget_progressbar_vertical_EXAMPLE@ -- -- By default, this widget will take all the available size. To prevent this, -- a `wibox.container.constraint` widget or the `forced_width`/`forced_height` -- properties have to be used. -- --@DOC_wibox_widget_defaults_progressbar_EXAMPLE@ -- -- @author Julien Danjou &lt;julien@danjou.info&gt; -- @copyright 2009 Julien Danjou -- @classmod wibox.widget.progressbar --------------------------------------------------------------------------- local setmetatable = setmetatable local ipairs = ipairs local math = math local gdebug = require("gears.debug") local base = require("wibox.widget.base") local color = require("gears.color") local beautiful = require("beautiful") local shape = require("gears.shape") local gtable = require("gears.table") local progressbar = { mt = {} } --- The progressbar border color. -- If the value is nil, no border will be drawn. -- -- @property border_color -- @tparam gears.color color The border color to set. -- @see gears.color --- The progressbar border width. -- @property border_width --- The progressbar inner border color. -- If the value is nil, no border will be drawn. -- -- @property bar_border_color -- @tparam gears.color color The border color to set. -- @see gears.color --- The progressbar inner border width. -- @property bar_border_width --- The progressbar foreground color. -- -- @property color -- @tparam gears.color color The progressbar color. -- @see gears.color --- The progressbar background color. -- -- @property background_color -- @tparam gears.color color The progressbar background color. -- @see gears.color --- The progressbar inner shape. -- --@DOC_wibox_widget_progressbar_bar_shape_EXAMPLE@ -- -- @property bar_shape -- @tparam[opt=gears.shape.rectangle] gears.shape shape -- @see gears.shape --- The progressbar shape. -- --@DOC_wibox_widget_progressbar_shape_EXAMPLE@ -- -- @property shape -- @tparam[opt=gears.shape.rectangle] gears.shape shape -- @see gears.shape --- Set the progressbar to draw vertically. -- This doesn't do anything anymore, use a `wibox.container.rotate` widget. -- @deprecated set_vertical -- @tparam boolean vertical --- Force the inner part (the bar) to fit in the background shape. -- --@DOC_wibox_widget_progressbar_clip_EXAMPLE@ -- -- @property clip -- @tparam[opt=true] boolean clip --- The progressbar to draw ticks. Default is false. -- -- @property ticks -- @param boolean --- The progressbar ticks gap. -- -- @property ticks_gap -- @param number --- The progressbar ticks size. -- -- @property ticks_size -- @param number --- The maximum value the progressbar should handle. -- -- @property max_value -- @param number --- The progressbar background color. -- @beautiful beautiful.progressbar_bg --- The progressbar foreground color. -- @beautiful beautiful.progressbar_fg --- The progressbar shape. -- @beautiful beautiful.progressbar_shape -- @see gears.shape --- The progressbar border color. -- @beautiful beautiful.progressbar_border_color --- The progressbar outer border width. -- @beautiful beautiful.progressbar_border_width --- The progressbar inner shape. -- @beautiful beautiful.progressbar_bar_shape -- @see gears.shape --- The progressbar bar border width. -- @beautiful beautiful.progressbar_bar_border_width --- The progressbar bar border color. -- @beautiful beautiful.progressbar_bar_border_color --- The progressbar margins. -- Note that if the `clip` is disabled, this allows the background to be smaller -- than the bar. -- -- See the `clip` example. -- -- @tparam[opt=0] (table|number|nil) margins A table for each side or a number -- @tparam[opt=0] number margins.top -- @tparam[opt=0] number margins.bottom -- @tparam[opt=0] number margins.left -- @tparam[opt=0] number margins.right -- @property margins -- @see clip --- The progressbar padding. -- Note that if the `clip` is disabled, this allows the bar to be taller -- than the background. -- -- See the `clip` example. -- -- @tparam[opt=0] (table|number|nil) padding A table for each side or a number -- @tparam[opt=0] number padding.top -- @tparam[opt=0] number padding.bottom -- @tparam[opt=0] number padding.left -- @tparam[opt=0] number padding.right -- @property paddings -- @see clip --- The progressbar margins. -- Note that if the `clip` is disabled, this allows the background to be smaller -- than the bar. -- @tparam[opt=0] (table|number|nil) margins A table for each side or a number -- @tparam[opt=0] number margins.top -- @tparam[opt=0] number margins.bottom -- @tparam[opt=0] number margins.left -- @tparam[opt=0] number margins.right -- @beautiful beautiful.progressbar_margins -- @see clip --- The progressbar padding. -- Note that if the `clip` is disabled, this allows the bar to be taller -- than the background. -- @tparam[opt=0] (table|number|nil) padding A table for each side or a number -- @tparam[opt=0] number padding.top -- @tparam[opt=0] number padding.bottom -- @tparam[opt=0] number padding.left -- @tparam[opt=0] number padding.right -- @beautiful beautiful.progressbar_paddings -- @see clip local properties = { "border_color", "color" , "background_color", "value" , "max_value" , "ticks", "ticks_gap" , "ticks_size", "border_width", "shape" , "bar_shape" , "bar_border_width", "clip" , "margins" , "bar_border_color", "paddings", } function progressbar.draw(pbar, _, cr, width, height) local ticks_gap = pbar._private.ticks_gap or 1 local ticks_size = pbar._private.ticks_size or 4 -- We want one pixel wide lines cr:set_line_width(1) local max_value = pbar._private.max_value local value = math.min(max_value, math.max(0, pbar._private.value)) if value >= 0 then value = value / max_value end local border_width = pbar._private.border_width or beautiful.progressbar_border_width or 0 local bcol = pbar._private.border_color or beautiful.progressbar_border_color border_width = bcol and border_width or 0 local bg = pbar._private.background_color or beautiful.progressbar_bg or "#ff0000aa" local bg_width, bg_height = width, height local clip = pbar._private.clip ~= false and beautiful.progressbar_clip ~= false -- Apply the margins local margin = pbar._private.margins or beautiful.progressbar_margins if margin then if type(margin) == "number" then cr:translate(margin, margin) bg_width, bg_height = bg_width - 2*margin, bg_height - 2*margin else cr:translate(margin.left or 0, margin.top or 0) bg_height = bg_height - (margin.top or 0) - (margin.bottom or 0) bg_width = bg_width - (margin.left or 0) - (margin.right or 0) end end -- Draw the background shape if border_width > 0 then -- Cairo draw half of the border outside of the path area cr:translate(border_width/2, border_width/2) bg_width, bg_height = bg_width - border_width, bg_height - border_width cr:set_line_width(border_width) end local background_shape = pbar._private.shape or beautiful.progressbar_shape or shape.rectangle background_shape(cr, bg_width, bg_height) cr:set_source(color(bg)) local over_drawn_width = bg_width + border_width local over_drawn_height = bg_height + border_width if border_width > 0 then cr:fill_preserve() -- Draw the border cr:set_source(color(bcol)) cr:stroke() over_drawn_width = over_drawn_width - 2*border_width over_drawn_height = over_drawn_height - 2*border_width else cr:fill() end -- Undo the translation cr:translate(-border_width/2, -border_width/2) -- Make sure the bar stay in the shape if clip then background_shape(cr, bg_width, bg_height) cr:clip() cr:translate(border_width, border_width) else -- Assume the background size is irrelevant to the bar itself if type(margin) == "number" then cr:translate(-margin, -margin) else cr:translate(-(margin.left or 0), -(margin.top or 0)) end over_drawn_height = height over_drawn_width = width end -- Apply the padding local padding = pbar._private.paddings or beautiful.progressbar_paddings if padding then if type(padding) == "number" then cr:translate(padding, padding) over_drawn_height = over_drawn_height - 2*padding over_drawn_width = over_drawn_width - 2*padding else cr:translate(padding.left or 0, padding.top or 0) over_drawn_height = over_drawn_height - (padding.top or 0) - (padding.bottom or 0) over_drawn_width = over_drawn_width - (padding.left or 0) - (padding.right or 0) end end over_drawn_width = math.max(over_drawn_width , 0) over_drawn_height = math.max(over_drawn_height, 0) local rel_x = over_drawn_width * value -- Draw the progressbar shape local bar_shape = pbar._private.bar_shape or beautiful.progressbar_bar_shape or shape.rectangle local bar_border_width = pbar._private.bar_border_width or beautiful.progressbar_bar_border_width or pbar._private.border_width or beautiful.progressbar_border_width or 0 local bar_border_color = pbar._private.bar_border_color or beautiful.progressbar_bar_border_color bar_border_width = bar_border_color and bar_border_width or 0 over_drawn_width = over_drawn_width - bar_border_width over_drawn_height = over_drawn_height - bar_border_width cr:translate(bar_border_width/2, bar_border_width/2) bar_shape(cr, rel_x, over_drawn_height) cr:set_source(color(pbar._private.color or beautiful.progressbar_fg or "#ff0000")) if bar_border_width > 0 then cr:fill_preserve() cr:set_source(color(bar_border_color)) cr:set_line_width(bar_border_width) cr:stroke() else cr:fill() end if pbar._private.ticks then for i=0, width / (ticks_size+ticks_gap)-border_width do local rel_offset = over_drawn_width / 1 - (ticks_size+ticks_gap) * i if rel_offset <= rel_x then cr:rectangle(rel_offset, border_width, ticks_gap, over_drawn_height) end end cr:set_source(color(pbar._private.background_color or "#000000aa")) cr:fill() end end function progressbar:fit(_, width, height) return width, height end --- Set the progressbar value. -- @param value The progress bar value between 0 and 1. function progressbar:set_value(value) value = value or 0 self._private.value = value self:emit_signal("widget::redraw_needed") return self end function progressbar:set_max_value(max_value) self._private.max_value = max_value self:emit_signal("widget::redraw_needed") end --- Set the progressbar height. -- This method is deprecated. Use a `wibox.container.constraint` widget or -- `forced_height`. -- @param height The height to set. -- @deprecated set_height function progressbar:set_height(height) gdebug.deprecate("Use a `wibox.container.constraint` widget or `forced_height`", {deprecated_in=4}) self:set_forced_height(height) end --- Set the progressbar width. -- This method is deprecated. Use a `wibox.container.constraint` widget or -- `forced_width`. -- @param width The width to set. -- @deprecated set_width function progressbar:set_width(width) gdebug.deprecate("Use a `wibox.container.constraint` widget or `forced_width`", {deprecated_in=4}) self:set_forced_width(width) end -- Build properties function for _, prop in ipairs(properties) do if not progressbar["set_" .. prop] then progressbar["set_" .. prop] = function(pbar, value) pbar._private[prop] = value pbar:emit_signal("widget::redraw_needed") return pbar end end end function progressbar:set_vertical(value) --luacheck: no unused_args gdebug.deprecate("Use a `wibox.container.rotate` widget", {deprecated_in=4}) end --- Create a progressbar widget. -- @param args Standard widget() arguments. You should add width and height -- key to set progressbar geometry. -- @return A progressbar widget. -- @function wibox.widget.progressbar function progressbar.new(args) args = args or {} local pbar = base.make_widget(nil, nil, { enable_properties = true, }) pbar._private.width = args.width or 100 pbar._private.height = args.height or 20 pbar._private.value = 0 pbar._private.max_value = 1 gtable.crush(pbar, progressbar, true) return pbar end function progressbar.mt:__call(...) return progressbar.new(...) end --@DOC_widget_COMMON@ --@DOC_object_COMMON@ return setmetatable(progressbar, progressbar.mt) -- vim: filetype=lua:expandtab:shiftwidth=4:tabstop=8:softtabstop=4:textwidth=80
gpl-2.0
iamgreaser/iceball
pkg/base/lib_namegen.lua
4
1536
--[[ This file is part of Ice Lua Components. Ice Lua Components is free software: you can redistribute it and/or modify it under the terms of the GNU Lesser General Public License as published by the Free Software Foundation, either version 3 of the License, or (at your option) any later version. Ice Lua Components is distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU Lesser General Public License for more details. You should have received a copy of the GNU Lesser General Public License along with Ice Lua Components. If not, see <http://www.gnu.org/licenses/>. ]] -- yes, this is a great idea! do local n_base1 = { "b","c","ch","cl","d","fl","h","j","l","m","n","r","sh","spl","th","thr","w","z", } local n_base2 = { "alt","arp","at","each","erf","erp","iff","it","itt","ing","izz","og","ong","oog","oop","ooze","ug","urf", } local n_base3 = { "ator","ate","er","es","ette","ing","it","iser","le","ler","man","ner","son","ter" } function name_generate() local s1 = n_base1[math.floor(math.random()*#n_base1+1)] local s2 = n_base2[math.floor(math.random()*#n_base2+1)] local s3 = n_base3[math.floor(math.random()*#n_base3+1)] if string.sub(s2,-1,-1) == "e" and string.sub(s3,1,1) == "e" then s2 = string.sub(s2,1,-2) end local s = s1..s2..s3 return s end --[[local i for i=1,100 do print("name "..i..": "..name_generate()) end]] end
gpl-3.0
b1v1r/ironbee
lua/ironbee/waggle/generator.lua
2
6682
#!/usr/bin/lua --[[-------------------------------------------------------------------------- -- Licensed to Qualys, Inc. (QUALYS) under one or more -- contributor license agreements. See the NOTICE file distributed with -- this work for additional information regarding copyright ownership. -- QUALYS licenses this file to You under the Apache License, Version 2.0 -- (the "License"); you may not use this file except in compliance with -- the License. You may obtain a copy of the License at -- -- http://www.apache.org/licenses/LICENSE-2.0 -- -- Unless required by applicable law or agreed to in writing, software -- distributed under the License is distributed on an "AS IS" BASIS, -- WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -- See the License for the specific language governing permissions and -- limitations under the License. --]]-------------------------------------------------------------------------- -- -- IronBee Waggle --- Generator -- -- Generates rules. -- -- @author Sam Baskinger <sbaskinger@qualys.com> local Util = require('ironbee/waggle/util') local Action = require('ironbee/waggle/actionrule') local RuleExt = require('ironbee/waggle/ruleext') local StreamInspect = require('ironbee/waggle/streaminspect') -- ########################################################################### -- Generator - generate a rules.conf or similar -- ########################################################################### local Generator = {} Generator.__index = Generator Generator.type = 'generator' Generator.new = function(self) local g = {} return setmetatable(g, self) end Generator.gen_op = function(self, rule) if rule.is_a(RuleExt) then return rule.data.op else if string.sub(rule.data.op, 1, 1) == '!' then return string.format("!@%s", string.sub(rule.data.op, 2)) else return string.format("@%s", rule.data.op) end end end Generator.gen_fields = function(self, rule) local field_list = {} for _, field in ipairs(rule.data.fields) do local f = field.collection if field.selector then f = f .. ':' .. field.selector end if field.transformation then f = f .. '.' .. field.transformation end table.insert(field_list, f) end return '"' .. table.concat(field_list, '" "') .. '"' end -- Generate actions, including tags, etc. -- -- This ignores the 'chain' action. That is inserted as-needed. Generator.gen_actions = function(self, rule) local t = {} -- Add the tags. for val,_ in pairs(rule.data.tags) do table.insert(t, "tag:"..val) end -- Add the actions that are not id, rev, or phase. -- They may only appear once. for _, act in pairs(rule.data.actions) do if act.name ~= 'id' and act.name ~= 'rev' and act.name ~= 'phase' then if act.argument then table.insert(t, act.name .. ":"..act.argument) else table.insert(t, act.name) end end end -- Add the message if it exists. if rule.data.message then table.insert(t, "msg:"..rule.data.message) end if #t > 0 then return '"' .. table.concat(t, '" "') .. '"' else return '' end end -- Generate a string that represents an IronBee rules configuration. -- -- @param[in] self The generator. -- @param[in] plan The plan generated by Planner:new():plan(db) or equivalent. -- @param[in] db The SignatureDatabase used to plan. Generator.generate = function(self, plan, db) -- String we are going to return representing the final configuration. local s = '' for _, chain in ipairs(plan) do for i, link in ipairs(chain) do local rule_id = link.rule local result = link.result local rule = db.db[rule_id] if rule:is_a(Rule) then if rule.data.comment then s = s .. "# ".. string.gsub(rule.data.comment, "\n", "\n# ") .."\n" end s = s .. string.format( "%s %s %s \"%s\" %s", rule.data.rule_type, self:gen_fields(rule), self:gen_op(rule), rule.data.op_arg, self:gen_actions(rule)) -- The first rule in a chain gets the ID, message, phase, etc. if i == 1 then local last_rule = db.db[chain[#chain].rule] s = s .. ' "id:' .. last_rule.data.id .. '"' s = s .. ' "rev:' .. last_rule.data.version .. '"' if last_rule.data.phase then s = s .. ' "phase:' .. last_rule.data.phase .. '"' end end if i ~= #chain then s = s .. ' chain' end elseif rule:is_a(RuleExt) then if rule.data.comment then s = s .. "# ".. string.gsub(rule.data.comment, "\n", "\n# ") .."\n" end s = s .. string.format( "%s %s %s \"%s\" %s \"id:%s\" \"rev:%s\"", rule.data.rule_type, self:gen_fields(rule), self:gen_op(rule), rule.data.op_arg, self:gen_actions(rule), rule.data.id, rule.data.version) elseif rule:is_a(Action) then if rule.data.comment then s = s .. "# ".. string.gsub(rule.data.comment, "\n", "\n# ") .."\n" end s = s .. string.format( "%s %s \"id:%s\" \"rev:%s\"", rule.data.rule_type, self:gen_actions(rule), rule.data.id, rule.data.version) elseif rule.is_a(StreamInspect) then if rule.data.comment then s = s .. "# ".. string.gsub(rule.data.comment, "\n", "\n# ") .."\n" end s = s .. string.format( "%s %s %s \"%s\" %s \"id:%s\" \"rev:%s\"", rule.data.rule_type, self:gen_fields(rule), self:gen_op(rule), rule.data.op_arg, self:gen_actions(rule), rule.data.id, rule.data.version) end s = s .. "\n" end end return s end return Generator
apache-2.0
Sasu98/Nerd-Gaming-Public
resources/[shaders]/SHDRSkyBox/c_shader_skybox_alt.lua
2
4859
-- Skybox alternative v0.46 by Ren712 -- Based on GTASA Skybox mod by Shemer -- knoblauch700@o2.pl local sphereObjScale=100 -- set object scale local sphereShadScale={1,1,0.9} -- object scale in VS local makeAngular=true -- set to true if you have spheric texture local sphereTexScale={1,1,1} -- scale the texture in PS local FadeEffect = true -- horizon effect fading local SkyVis = 1-- sky visibility vs fading fog ammount (0 - sky not visible ) -- color variables below local ColorAdd=-0.15 -- 0 to -0.4 -- standard colors are too bright local ColorPow=2 -- 1 to 2 -- contrast local shadCloudsTexDisabled=false local modelID=15057 -- that's probably the best model to replace ... or not --setWeather(7) -- the chosen weather (you might delete that but choose a proper one) setCloudsEnabled(true) local skydome_shader = nil local null_shader = nil local skydome_texture = nil local getLastTick,getLastTock = 0,0 function startShaderResource() if salEffectEnabled then return end skydome_shader = dxCreateShader ( "shaders/shader_skydome.fx",0,0,true,"object" ) null_shader = dxCreateShader ( "shaders/shader_null.fx" ) skydome_texture=dxCreateTexture("textures/skydome.jpg") if not skydome_shader or not null_shader or not skydome_texture then outputChatBox('Could not start Skybox alternative !',255,0,0) return else outputConsole('Shader skybox alternative v0.45 has started.') end setCloudsEnabled(false) dxSetShaderValue ( skydome_shader, "gTEX", skydome_texture ) dxSetShaderValue ( skydome_shader, "gAlpha", 1 ) dxSetShaderValue ( skydome_shader, "makeAngular", makeAngular ) dxSetShaderValue ( skydome_shader, "gObjScale", sphereShadScale ) dxSetShaderValue ( skydome_shader, "gTexScale",sphereTexScale ) dxSetShaderValue ( skydome_shader, "gFadeEffect", FadeEffect ) dxSetShaderValue ( skydome_shader, "gSkyVis", SkyVis ) dxSetShaderValue ( skydome_shader, "gColorAdd", ColorAdd ) dxSetShaderValue ( skydome_shader, "gColorPow", ColorPow ) -- apply to texture engineApplyShaderToWorldTexture ( skydome_shader, "skybox_tex" ) if shadCloudsTexDisabled then engineApplyShaderToWorldTexture ( null_shader, "cloudmasked*" ) end txd_skybox = engineLoadTXD('models/skybox_model.txd') engineImportTXD(txd_skybox, modelID) dff_skybox = engineLoadDFF('models/skybox_model.dff', modelID) engineReplaceModel(dff_skybox, modelID) local cam_x,cam_y,cam_z = getElementPosition(getLocalPlayer()) skyBoxBoxa = createObject ( modelID, cam_x, cam_y, cam_z, 0, 0, 0, true ) setObjectScale(skyBoxBoxa,sphereObjScale) setElementAlpha(skyBoxBoxa,1) addEventHandler ( "onClientHUDRender", getRootElement (), renderSphere ) -- sky object addEventHandler ( "onClientHUDRender", getRootElement (), renderTime ) -- time applyWeatherInfluence() salEffectEnabled = true end function stopShaderResource() if not salEffectEnabled then return end removeEventHandler ( "onClientHUDRender", getRootElement (), renderSphere ) -- sky object removeEventHandler ( "onClientHUDRender", getRootElement (), renderTime ) -- time if null_shader then engineRemoveShaderFromWorldTexture ( null_shader, "cloudmasked*" ) destroyElement(null_shader) null_shader=nil end engineRemoveShaderFromWorldTexture ( skydome_shader, "skybox_tex" ) destroyElement(skyBoxBoxa) destroyElement(skydome_shader) destroyElement(skydome_texture) skyBoxBoxa=nil skydome_shader=nil skydome_texture=false salEffectEnabled = false end lastWeather=0 function renderSphere() -- Updates the position of the object if getTickCount ( ) - getLastTock < 2 then return end local cam_x, cam_y, cam_z, lx, ly, lz = getCameraMatrix() if cam_z<=200 then setElementPosition ( skyBoxBoxa, cam_x, cam_y, 80,false ) else setElementPosition ( skyBoxBoxa, cam_x, cam_y, 80+cam_z-200,false ) end local r1, g1, b1, r2, g2, b2 = getSkyGradient() local skyBott = {r2/255, g2/255, b2/255, 1} dxSetShaderValue ( skydome_shader, "gSkyBott", skyBott ) if getWeather()~=lastWeather then applyWeatherInfluence() end lastWeather=getWeather() getLastTock = getTickCount () end function renderTime() local hour, minute = getTime ( ) if getTickCount ( ) - getLastTick < 100 then return end if not skydome_shader then return end if hour >= 20 then local dusk_aspect = ((hour-20)*60+minute)/240 dusk_aspect = 1-dusk_aspect dxSetShaderValue ( skydome_shader, "gAlpha", dusk_aspect) end if hour <= 2 then dxSetShaderValue ( skydome_shader, "gAlpha", 0) end if hour > 2 and hour <= 6 then local dawn_aspect = ((hour-3)*60+minute)/180 dawn_aspect = dawn_aspect dxSetShaderValue ( skydome_shader, "gAlpha", dawn_aspect) end if hour > 6 and hour < 20 then dxSetShaderValue ( skydome_shader, "gAlpha", 1) end getLastTick = getTickCount () end function applyWeatherInfluence() setSunSize (0) setSunColor(0, 0, 0, 0, 0, 0) end
mit
PichotM/DarkRP
gamemode/modules/fadmin/fadmin/playeractions/teleport/cl_init.lua
6
2349
FAdmin.StartHooks["zz_Teleport"] = function() FAdmin.Messages.RegisterNotification{ name = "goto", hasTarget = true, message = {"instigator", " teleported to ", "targets"} } FAdmin.Messages.RegisterNotification{ name = "bring", hasTarget = true, message = {"instigator", " brought ", "targets", " to them"} } FAdmin.Access.AddPrivilege("Teleport", 2) FAdmin.Commands.AddCommand("Teleport", nil, "[Player]") FAdmin.Commands.AddCommand("TP", nil, "[Player]") FAdmin.Commands.AddCommand("Bring", nil, "<Player>", "[Player]") FAdmin.Commands.AddCommand("goto", nil, "<Player>") FAdmin.ScoreBoard.Player:AddActionButton("Teleport", "fadmin/icons/teleport", Color(0, 200, 0, 255), function(ply) return FAdmin.Access.PlayerHasPrivilege(LocalPlayer(), "Teleport") end, function(ply, button) RunConsoleCommand("_FAdmin", "Teleport", ply:UserID()) end) FAdmin.ScoreBoard.Player:AddActionButton("Goto", "fadmin/icons/teleport", Color(0, 200, 0, 255), function(ply) return FAdmin.Access.PlayerHasPrivilege(LocalPlayer(), "Teleport") and ply ~= LocalPlayer() end, function(ply, button) RunConsoleCommand("_FAdmin", "goto", ply:UserID()) end) FAdmin.ScoreBoard.Player:AddActionButton("Bring", "fadmin/icons/teleport", Color(0, 200, 0, 255), function(ply) return FAdmin.Access.PlayerHasPrivilege(LocalPlayer(), "Teleport") and ply ~= LocalPlayer() end, function(ply, button) local menu = DermaMenu() local Padding = vgui.Create("DPanel") Padding:SetPaintBackgroundEnabled(false) Padding:SetSize(1,5) menu:AddPanel(Padding) local Title = vgui.Create("DLabel") Title:SetText(" Bring to:\n") Title:SetFont("UiBold") Title:SizeToContents() Title:SetTextColor(color_black) menu:AddPanel(Title) local uid = ply:UserID() menu:AddOption("Yourself", function() RunConsoleCommand("_FAdmin", "bring", uid) end) for k, v in pairs(DarkRP.nickSortedPlayers()) do if v ~= LocalPlayer() then local vUid = v:UserID() menu:AddOption(v:Nick(), function() RunConsoleCommand("_FAdmin", "bring", uid, vUid) end) end end menu:Open() end) end
mit
Insurgencygame/LivingDead
TheLivingDeadv0.1.sdd/lups/particleclasses/jet.lua
1
6353
-- $Id: Jet.lua 3171 2008-11-06 09:06:29Z det $ ----------------------------------------------------------------------------------------------------------------- ----------------------------------------------------------------------------------------------------------------- local Jet = {} Jet.__index = Jet local jitShader local tex --//screencopy local timerUniform ----------------------------------------------------------------------------------------------------------------- ----------------------------------------------------------------------------------------------------------------- function Jet.GetInfo() return { name = "Jet", backup = "", --// backup class, if this class doesn't work (old cards,ati's,etc.) desc = "", layer = 4, --// extreme simply z-ordering :x --// gfx requirement fbo = true, shader = true, distortion= true, atiseries = 2, ms = -1, intel = -1, } end Jet.Default = { layer = 4, life = math.huge, repeatEffect = true, emitVector = {0,0,-1}, pos = {0,0,0}, --// not used width = 4, length = 50, distortion = 0.02, animSpeed = 1, texture1 = "bitmaps/GPL/Lups/perlin_noise.jpg", --// noise texture texture2 = ":c:bitmaps/GPL/Lups/jet.bmp", --// jitter shape } ----------------------------------------------------------------------------------------------------------------- ----------------------------------------------------------------------------------------------------------------- local spGetGameSeconds = Spring.GetGameSeconds local glUseShader = gl.UseShader local glUniform = gl.Uniform local glTexture = gl.Texture local glCallList = gl.CallList function Jet:BeginDrawDistortion() glUseShader(jitShader) glUniform(timerUniform, spGetGameSeconds()) end function Jet:EndDrawDistortion() glUseShader(0) glTexture(1,false) glTexture(2,false) end function Jet:DrawDistortion() glTexture(1,self.texture1) glTexture(2,self.texture2) glCallList(self.dList) end ----------------------------------------------------------------------------------------------------------------- ----------------------------------------------------------------------------------------------------------------- -- used if repeatEffect=true; function Jet:ReInitialize() self.dieGameFrame = self.dieGameFrame + self.life end function Jet.Initialize() jitShader = gl.CreateShader({ vertex = [[ uniform float timer; varying float distortion; varying vec4 texCoords; const vec4 centerPos = vec4(0.0,0.0,0.0,1.0); // gl_vertex.xy := width/length // gl_vertex.zw := texcoord // gl_MultiTexCoord0.x := (quad_width) / (quad_length) (used to normalize the texcoord dimensions) // gl_MultiTexCoord0.y := distortion strength // gl_MultiTexCoord0.z := animation speed // gl_MultiTexCoord1 := emit vector void main() { texCoords.st = gl_Vertex.pq; texCoords.pq = gl_Vertex.pq; texCoords.p *= gl_MultiTexCoord0.x; texCoords.pq += timer*gl_MultiTexCoord0.z; gl_Position = gl_ModelViewMatrix * centerPos; vec3 dir3 = vec3(gl_ModelViewMatrix * gl_MultiTexCoord1) - gl_Position.xyz; vec3 v = normalize( dir3 ); vec3 w = normalize( -vec3(gl_Position) ); vec3 u = normalize( cross(w,v) ); gl_Position.xyz += gl_Vertex.x*v + gl_Vertex.y*u; gl_Position = gl_ProjectionMatrix * gl_Position; distortion = gl_MultiTexCoord0.y; } ]], fragment = [[ uniform sampler2D noiseMap; uniform sampler2D mask; varying float distortion; varying vec4 texCoords; void main(void) { float opac = texture2D(mask,texCoords.st).r; vec2 noiseVec = (texture2D(noiseMap, texCoords.pq).st - 0.5) * distortion * opac; gl_FragColor = vec4(noiseVec.xy,0.0,gl_FragCoord.z); } ]], uniformInt = { noiseMap = 1, mask = 2, }, uniform = { timer = 0, } }) if (jitShader == nil) then print(PRIO_MAJOR,"LUPS->Jet: shader error: "..gl.GetShaderLog()) return false end timerUniform = gl.GetUniformLocation(jitShader, 'timer') end function Jet:Finalize() if (gl.DeleteShader) then gl.DeleteShader(jitShader) end end ----------------------------------------------------------------------------------------------------------------- ----------------------------------------------------------------------------------------------------------------- local glMultiTexCoord = gl.MultiTexCoord local glVertex = gl.Vertex local glCreateList = gl.CreateList local glDeleteList = gl.DeleteList local glBeginEnd = gl.BeginEnd local GL_QUADS = GL.QUADS local function BeginEndDrawList(self) local ev = self.emitVector glMultiTexCoord(0,self.width/self.length,self.distortion,0.2*self.animSpeed) glMultiTexCoord(1,ev[1],ev[2],ev[3],1) --// xy = width/length ; zw = texcoord local w = self.width local l = self.length glVertex(-l,-w, 1,0) glVertex(0, -w, 1,1) glVertex(0, w, 0,1) glVertex(-l, w, 0,0) end function Jet:CreateParticle() self.dList = glCreateList(glBeginEnd,GL_QUADS, BeginEndDrawList,self) --// used for visibility check self.radius = self.length self.dieGameFrame = thisGameFrame + self.life end ----------------------------------------------------------------------------------------------------------------- ----------------------------------------------------------------------------------------------------------------- local MergeTable = MergeTable local setmetatable = setmetatable function Jet.Create(Options) local newObject = MergeTable(Options, Jet.Default) setmetatable(newObject,Jet) -- make handle lookup newObject:CreateParticle() return newObject end function Jet:Destroy() --gl.DeleteTexture(self.texture1) --gl.DeleteTexture(self.texture2) glDeleteList(self.dList) end ----------------------------------------------------------------------------------------------------------------- ----------------------------------------------------------------------------------------------------------------- return Jet
gpl-2.0
jirutka/luapak
luapak/build/toolchain/utils.lua
1
1311
--------- -- Utilities for toolchain modules. -- -- **Note: This module is not part of public API!** ---- local fs = require 'luarocks.fs' local lrutil = require 'luarocks.util' local log = require 'luapak.logging' local concat = table.concat local push = table.insert local variable_substitutions = lrutil.variable_substitutions local M = {} --- Runs a command displaying its execution on standard output. -- -- @tparam string ... The command and arguments. -- @return bool true if command succeeds (status code 0), false otherwise. function M.execute (...) log.debug('Executing: '..concat({...}, ' ')) return fs.execute(...) end --- Pushes the `flag` with `values` into the given table `tab` and substitutes -- all variables in `values`. -- -- @tparam {string,...} tab The target table to push flags into. -- @tparam string flag The flag with single format pattern to be substituted by `values`. -- @tparam {string,...}|string|nil values -- @tparam ?{[string]=...} variables function M.push_flags (tab, flag, values, variables) variables = variables or {} if not values then return end if type(values) ~= 'table' then values = { tostring(values) } end variable_substitutions(values, variables) for _, v in ipairs(values) do push(tab, flag:format(v)) end end return M
mit
BarnamehNevisan/ss
plugins/inpm.lua
243
3007
do local function pairsByKeys (t, f) local a = {} for n in pairs(t) do table.insert(a, n) end table.sort(a, f) local i = 0 -- iterator variable local iter = function () -- iterator function i = i + 1 if a[i] == nil then return nil else return a[i], t[a[i]] end end return iter end local function chat_list(msg) local data = load_data(_config.moderation.data) local groups = 'groups' if not data[tostring(groups)] then return 'No groups at the moment' end local message = 'List of Groups:\n*Use /join (ID) to join*\n\n ' for k,v in pairs(data[tostring(groups)]) do local settings = data[tostring(v)]['settings'] for m,n in pairsByKeys(settings) do if m == 'set_name' then name = n end end message = message .. '👥 '.. name .. ' (ID: ' .. v .. ')\n\n ' end local file = io.open("./groups/lists/listed_groups.txt", "w") file:write(message) file:flush() file:close() return message end local function run(msg, matches) if msg.to.type ~= 'chat' or is_sudo(msg) or is_admin(msg) and is_realm(msg) then local data = load_data(_config.moderation.data) if matches[1] == 'join' and data[tostring(matches[2])] then if is_banned(msg.from.id, matches[2]) then return 'You are banned.' end if is_gbanned(msg.from.id) then return 'You are globally banned.' end if data[tostring(matches[2])]['settings']['lock_member'] == 'yes' and not is_owner2(msg.from.id, matches[2]) then return 'Group is private.' end local chat_id = "chat#id"..matches[2] local user_id = "user#id"..msg.from.id chat_add_user(chat_id, user_id, ok_cb, false) local group_name = data[tostring(matches[2])]['settings']['set_name'] return "Added you to chat:\n\n👥"..group_name.." (ID:"..matches[2]..")" elseif matches[1] == 'join' and not data[tostring(matches[2])] then return "Chat not found." end if matches[1] == 'chats'then if is_admin(msg) and msg.to.type == 'chat' then return chat_list(msg) elseif msg.to.type ~= 'chat' then return chat_list(msg) end end if matches[1] == 'chatlist'then if is_admin(msg) and msg.to.type == 'chat' then send_document("chat#id"..msg.from.id, "./groups/lists/listed_groups.txt", ok_cb, false) elseif msg.to.type ~= 'chat' then send_document("user#id"..msg.from.id, "./groups/lists/listed_groups.txt", ok_cb, false) end end end end return { patterns = { "^[/!](chats)$", "^[/!](chatlist)$", "^[/!](join) (.*)$", "^[/!](kickme) (.*)$", "^!!tgservice (chat_add_user)$" }, run = run, } end
gpl-2.0
hacklex/OpenRA
mods/cnc/maps/gdi04a/gdi04a.lua
21
4901
AutoTrigger = { CPos.New(51, 47), CPos.New(52, 47), CPos.New(53, 47), CPos.New(54, 47) } GDIHeliTrigger = { CPos.New(27, 55), CPos.New(27, 56), CPos.New(28, 56), CPos.New(28, 57), CPos.New(28, 58), CPos.New(28, 59)} Nod1Units = { "e1", "e1", "e3", "e3" } Auto1Units = { "e1", "e1", "e3" } KillsUntilReinforcements = 12 HeliDelay = { 83, 137, 211 } GDIReinforcements = { "e2", "e2", "e2", "e2", "e2" } GDIReinforcementsWaypoints = { GDIReinforcementsEntry.Location, GDIReinforcementsWP1.Location } NodHelis = { { delay = DateTime.Seconds(HeliDelay[1]), entry = { NodHeliEntry.Location, NodHeliLZ1.Location }, types = { "e1", "e1", "e3" } }, { delay = DateTime.Seconds(HeliDelay[2]), entry = { NodHeliEntry.Location, NodHeliLZ2.Location }, types = { "e1", "e1", "e1", "e1" } }, { delay = DateTime.Seconds(HeliDelay[3]), entry = { NodHeliEntry.Location, NodHeliLZ3.Location }, types = { "e1", "e1", "e3" } } } SendHeli = function(heli) units = Reinforcements.ReinforceWithTransport(enemy, "tran", heli.types, heli.entry, { heli.entry[1] }) Utils.Do(units[2], function(actor) actor.Hunt() Trigger.OnIdle(actor, actor.Hunt) Trigger.OnKilled(actor, KillCounter) end) Trigger.AfterDelay(heli.delay, function() SendHeli(heli) end) end SendGDIReinforcements = function() Media.PlaySpeechNotification(player, "Reinforce") Reinforcements.ReinforceWithTransport(player, "apc", GDIReinforcements, GDIReinforcementsWaypoints, nil, function(apc, team) table.insert(team, apc) Trigger.OnAllKilled(team, function() Trigger.AfterDelay(DateTime.Seconds(5), SendGDIReinforcements) end) Utils.Do(team, function(unit) unit.Stance = "Defend" end) end) end BuildNod1 = function() if HandOfNod.IsDead then return end local func = function(team) Utils.Do(team, function(actor) Trigger.OnIdle(actor, actor.Hunt) Trigger.OnKilled(actor, KillCounter) end) Trigger.OnAllKilled(team, BuildNod1) end if not HandOfNod.Build(Nod1Units, func) then Trigger.AfterDelay(DateTime.Seconds(5), BuildNod1) end end BuildAuto1 = function() if HandOfNod.IsDead then return end local func = function(team) Utils.Do(team, function(actor) Trigger.OnIdle(actor, actor.Hunt) Trigger.OnKilled(actor, KillCounter) end) end if not HandOfNod.IsDead and HandOfNod.Build(Auto1Units, func) then Trigger.AfterDelay(DateTime.Seconds(5), BuildAuto1) end end kills = 0 KillCounter = function() kills = kills + 1 end ReinforcementsSent = false Tick = function() enemy.Cash = 1000 if not ReinforcementsSent and kills >= KillsUntilReinforcements then ReinforcementsSent = true player.MarkCompletedObjective(reinforcementsObjective) SendGDIReinforcements() end if player.HasNoRequiredUnits() then Trigger.AfterDelay(DateTime.Seconds(1), function() player.MarkFailedObjective(gdiObjective) end) end end SetupWorld = function() Utils.Do(enemy.GetGroundAttackers(enemy), function(unit) Trigger.OnKilled(unit, KillCounter) end) Utils.Do(player.GetGroundAttackers(), function(unit) unit.Stance = "Defend" end) Hunter1.Hunt() Hunter2.Hunt() Trigger.OnRemovedFromWorld(crate, function() player.MarkCompletedObjective(gdiObjective) end) end WorldLoaded = function() player = Player.GetPlayer("GDI") enemy = Player.GetPlayer("Nod") SetupWorld() Trigger.OnObjectiveAdded(player, function(p, id) Media.DisplayMessage(p.GetObjectiveDescription(id), "New " .. string.lower(p.GetObjectiveType(id)) .. " objective") end) Trigger.OnObjectiveCompleted(player, function(p, id) Media.DisplayMessage(p.GetObjectiveDescription(id), "Objective completed") end) Trigger.OnObjectiveFailed(player, function(p, id) Media.DisplayMessage(p.GetObjectiveDescription(id), "Objective failed") end) Trigger.OnPlayerWon(player, function() Media.PlaySpeechNotification(player, "Win") end) Trigger.OnPlayerLost(player, function() Media.PlaySpeechNotification(player, "Lose") end) gdiObjective = player.AddPrimaryObjective("Retrieve the crate with the stolen rods.") reinforcementsObjective = player.AddSecondaryObjective("Eliminate " .. KillsUntilReinforcements .. " Nod units for reinforcements.") enemy.AddPrimaryObjective("Defend against the GDI forces.") BuildNod1() Utils.Do(NodHelis, function(heli) Trigger.AfterDelay(heli.delay, function() SendHeli(heli) end) end) autoTrigger = false Trigger.OnEnteredFootprint(AutoTrigger, function(a, id) if not autoTrigger and a.Owner == player then autoTrigger = true Trigger.RemoveFootprintTrigger(id) BuildAuto1() end end) gdiHeliTrigger = false Trigger.OnEnteredFootprint(GDIHeliTrigger, function(a, id) if not gdiHeliTrigger and a.Owner == player then gdiHeliTrigger = true Trigger.RemoveFootprintTrigger(id) Reinforcements.ReinforceWithTransport(player, "tran", nil, { GDIHeliEntry.Location, GDIHeliLZ.Location }) end end) Camera.Position = Actor56.CenterPosition end
gpl-3.0
mohammad4569/matrix
plugins/invite.lua
299
1025
-- Invite other user to the chat group. -- Use !invite name User_name or !invite id id_number -- The User_name is the print_name (there are no spaces but _) do local function callback(extra, success, result) vardump(success) vardump(result) end local function run(msg, matches) local user = matches[2] -- User submitted a user name if matches[1] == "name" then user = string.gsub(user," ","_") end -- User submitted an id if matches[1] == "id" then user = 'user#id'..user end -- The message must come from a chat group if msg.to.type == 'chat' then local chat = 'chat#id'..msg.to.id chat_add_user(chat, user, callback, false) return "Add: "..user.." to "..chat else return 'This isnt a chat group!' end end return { description = "Invite other user to the chat group", usage = { "!invite name [user_name]", "!invite id [user_id]" }, patterns = { "^!invite (name) (.*)$", "^!invite (id) (%d+)$" }, run = run, moderation = true } end
gpl-2.0
Motiejus/tictactoelib
tictactoelib/play.lua
1
2168
local Board = require("board") local validate = function(board, a1, b1, x1, y1, x2, y2) if a1 ~= nil and not (a1 == x1 and b1 == y1) then return false, "incorrect placement" end if x1 == nil or y1 == nil or x2 == nil or y2 == nil then return false, "4 numbers expected, got nil" end for _, i in ipairs({x1, y1, x2, y2}) do if type(i) ~= "number" then return false, "number expected, got " .. type(i) end if not (i >= 1 and i <= 3) then return false, "number out of bounds" end end if board[x1][y1][x2][y2] then return false, "non-empty spot" end return true end -- Yields: -- xo; moveresult; log; board -- moveresult :: -- * {"state_coords", state_coords} -- * {"error", error_string} -- state_coords :: -- {state, {x1, y1, x2, y2}} -- state :: -- * "x" ("x" won) -- * "o" ("o" won) -- * "draw" -- * "continue" local play = function(p1, p2) local board, state = Board.new(), nil local p, xo, a1, b1 = p1, "x", nil, nil while state == nil do local pp = function() return p(xo, board:copy(), a1, b1) end collectgarbage() local success, x1_or_err, y1, x2, y2 = pcall(pp) collectgarbage() if not success then coroutine.yield(xo, {"error", x1_or_err}, "", board) return end local x1 = x1_or_err local valid, err = validate(board, a1, b1, x1, y1, x2, y2) if not valid then coroutine.yield(xo, {"error", err}, "", board) return end board[x1][y1][x2][y2] = xo state = board:state() state_ret = state == nil and "continue" or state state_coords = {"state_coords", {state_ret, {x1, y1, x2, y2}}} coroutine.yield(xo, state_coords, "", board) p = p == p1 and p2 or p1 xo = xo == "x" and "o" or "x" if board[x2][y2]:state() == nil then a1, b1 = x2, y2 else a1, b1 = nil, nil end end end return function(p1, p2) return coroutine.wrap(function() play(p1, p2) end) end
apache-2.0
b1v1r/ironbee
lua/event_processor.lua
2
8323
-- ======================================================================== -- Licensed to Qualys, Inc. (QUALYS) under one or more -- contributor license agreements. See the NOTICE file distributed with -- this work for additional information regarding copyright ownership. -- QUALYS licenses this file to You under the Apache License, Version 2.0 -- (the "License"); you may not use this file except in compliance with -- the License. You may obtain a copy of the License at -- -- http://www.apache.org/licenses/LICENSE-2.0 -- -- Unless required by applicable law or agreed to in writing, software -- distributed under the License is distributed on an "AS IS" BASIS, -- WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -- See the License for the specific language governing permissions and -- limitations under the License. -- ======================================================================== local ibmod = ... -- ======================================================================== -- This module processes events to: -- -- * Supress potential False Positives -- * Categorize -- * Promote events to alerts -- -- Categories for events must be specified via tags in the following form: -- -- tag:cat/<category-name> -- -- Example: -- tag:cat/XSS -- -- This module is designed to be used with the threat_level.lua module. -- -- -- Directives: -- -- EventProcessorCategoryFilter <category> <min-confidence> -- -- Defines the minimum acceptable event confidence for a given -- category. -- -- EventProcessorDefaultFilter <min-confidence> -- -- Defines the minimum acceptable event confidence for an -- undefined category. -- -- Usage: -- -- # Load the lua support module -- LoadModule "ibmod_lua.so" -- -- # Load this lua module -- LuaLoadModule "event_processor.lua" -- LuaLoadModule "threat_level.lua" -- -- # Set the Filters -- EventProcessorCategoryFilter XSS 75 -- EventProcessorCategoryFilter SQLi 25 -- EventProcessorCategoryFilter LFi 25 -- EventProcessorCategoryFilter RFi 50 -- EventProcessorDefaultFilter 50 -- -- # Set the minimum allowed event confidence -- # to be considered in the threat score calculation -- ThreatLevelMinConfidence 25 -- -- # Define a site with rules to utilize this module -- <Site default> -- SiteId 138E7FB0-1129-4FA5-8A63-432CE0BBD37A -- Service *:* -- Hostname * -- -- # Generate some events -- Rule ARGS @rx foo id:test/1 rev:1 msg:TEST1 \ -- tag:cat/XSS \ -- event confidence:50 severity:70 -- Rule ARGS @rx bar id:test/2 rev:1 msg:TEST2 \ -- tag:cat/SQLi \ -- event confidence:50 severity:80 -- Rule ARGS @rx boo id:test/3 rev:1 msg:TEST3 \ -- tag:cat/LFi \ -- event confidence:10 severity:100 -- -- # Check the threat level, blocking >=75 -- Rule THREAT_LEVEL @ge 75 id:test/100 rev:1 phase:REQUEST \ -- "msg:Testing THREAT_LEVEL" \ -- event block:phase -- </Site> -- ======================================================================== -- --------------------------------------------------------- -- Handle "EventProcessorCategoryFilter <category> <num>" -- directive. -- --------------------------------------------------------- ibmod:register_param2_directive( "EventProcessorCategoryFilter", function(ib_module, module_config, name, param1, param2) local numval = tonumber(param2) -- Validate parameter if ((numval < 0) or (numval > 100)) then ibmod:logError("Directive \"%s %s %s\" confidence value must be in range 0-100", name, param1, param2) return nil end -- Store in the config if module_config["cat-min"] == nil then module_config["cat-min"] = {} end module_config["cat-min"][param1] = numval return 0 end ) -- --------------------------------------------------------- -- Handle "EventProcessorDefaultFilter <num>" -- directive. -- --------------------------------------------------------- ibmod:register_param1_directive( "EventProcessorDefaultFilter", function(ib_module, module_config, name, param1) local numval = tonumber(param1) -- Validate parameter if ((numval < 0) or (numval > 100)) then ibmod:logError("Directive \"%s %s\" confidence value must be in range 0-100", name, param1) return nil end -- Store in the config module_config["def-min"] = numval return 0 end ) -- --------------------------------------------------------- -- Get the category from an event -- --------------------------------------------------------- local get_category = function(evt) local cat --[[ Run through all tags in the event and pick the last "cat/<cat-name>" tag, extracting the <cat-name> as the category. ]] evt:forEachTag( function(tag) local cat_str = string.match(tag, [[^cat/(.*)]]) if cat_str ~= nil then cat = cat_str end end ) return cat end -- --------------------------------------------------------- -- Process the events. -- --------------------------------------------------------- local process_events = function(ib) --[[ Run through events, supressing events if needed. ]] for i,evt in ib:events() do if evt:getSuppress() == "none" then local cat = get_category(evt) if cat ~= nil then --[[ Fetch the minimum confidence based on the event category or the default. ]] local min_confidence = ib.config["cat-min"][cat] if min_confidence == nil then min_confidence = ib.config["def-min"] if min_confidence == nil then min_confidence = 0 end end --[[ Suppress if confidence is too low. ]] local c = evt:getConfidence() if c < min_confidence then ib:logDebug("Supressing low confidence event: %s", evt:getMsg()) evt:setSuppress("false_positive") end end end end return 0 end -- --------------------------------------------------------- -- Generate alerts. -- --------------------------------------------------------- local generate_alerts = function(ib) local evt_cat = {} --[[ Run through events, generating scores for categorization. ]] for i,evt in ib:events() do if evt:getSuppress() == "none" then local cat = get_category(evt) if cat ~= nil then local s = evt:getSeverity() if evt_cat[cat] == nil then evt_cat[cat] = { 1, s, { evt } } else table.insert(evt_cat[cat][3], evt) evt_cat[cat] = { evt_cat[cat][1] + 1, evt_cat[cat][2] + s, evt_cat[cat][3] } end end end end --[[ Run through events in the category and promote the events to alerts. ]] local cat_final local cat_severity = 0 for cat,val in pairs(evt_cat) do if val[2] > cat_severity then cat_severity = val[2] cat_final = cat end end if cat_final ~= nil then for i,evt in pairs(evt_cat[cat_final][3]) do if evt:getType() ~= "alert" then ib:logInfo("Promoting event to alert status: %s", evt:getMsg()) evt:setType("alert") end end end return 0 end -- --------------------------------------------------------- -- Process events when an event is triggered. -- --------------------------------------------------------- ibmod:handle_logevent_state(process_events) -- --------------------------------------------------------- -- Generate alerts before logging. -- --------------------------------------------------------- ibmod:handle_postprocess_state(generate_alerts) -- Return IB_OK. return 0
apache-2.0
Anarchid/Zero-K
units/chickenlandqueen.lua
4
12201
return { chickenlandqueen = { unitname = [[chickenlandqueen]], name = [[Chicken Queen]], description = [[Clucking Hell!]], acceleration = 3.0, activateWhenBuilt = true, autoHeal = 0, brakeRate = 18.0, buildCostEnergy = 0, buildCostMetal = 0, builder = false, buildPic = [[chickenflyerqueen.png]], buildTime = 40000, canGuard = true, canMove = true, canPatrol = true, canSubmerge = false, cantBeTransported = true, category = [[LAND]], collisionSphereScale = 1, collisionVolumeOffsets = [[0 0 15]], collisionVolumeScales = [[46 110 120]], collisionVolumeType = [[box]], customParams = { selection_scale = 2, }, explodeAs = [[SMALL_UNITEX]], footprintX = 4, footprintZ = 4, iconType = [[chickenq]], idleAutoHeal = 5, idleTime = 1800, leaveTracks = true, maxDamage = 200000, maxVelocity = 2.5, minCloakDistance = 250, movementClass = [[AKBOT4]], noAutoFire = false, noChaseCategory = [[TERRAFORM SATELLITE FIXEDWING GUNSHIP STUPIDTARGET MINE]], objectName = [[chickenflyerqueen.s3o]], power = 65536, reclaimable = false, script = [[chickenlandqueen.lua]], selfDestructAs = [[SMALL_UNITEX]], sfxtypes = { explosiongenerators = { [[custom:blood_spray]], [[custom:blood_explode]], [[custom:dirt]], }, }, sightDistance = 2048, sonarDistance = 2048, trackOffset = 18, trackStrength = 8, trackStretch = 1, trackType = [[ChickenTrack]], trackWidth = 100, turnRate = 480, upright = true, workerTime = 0, weapons = { { def = [[MELEE]], mainDir = [[0 0 1]], maxAngleDif = 150, onlyTargetCategory = [[SWIM LAND SUB SINK TURRET FLOAT SHIP HOVER]], }, { def = [[FIREGOO]], mainDir = [[0 0 1]], maxAngleDif = 150, onlyTargetCategory = [[SWIM LAND SINK TURRET FLOAT SHIP HOVER]], }, { def = [[SPORES]], onlyTargetCategory = [[FIXEDWING LAND SINK TURRET SHIP SWIM FLOAT GUNSHIP HOVER]], }, { def = [[SPORES]], onlyTargetCategory = [[FIXEDWING LAND SINK TURRET SHIP SWIM FLOAT GUNSHIP HOVER]], }, { def = [[SPORES]], onlyTargetCategory = [[FIXEDWING LAND SINK TURRET SHIP SWIM FLOAT GUNSHIP HOVER]], }, { def = [[QUEENCRUSH]], onlyTargetCategory = [[SWIM LAND SINK TURRET FLOAT SHIP HOVER]], }, { def = [[DODOBOMB]], onlyTargetCategory = [[NONE]], }, { def = [[BASILISKBOMB]], onlyTargetCategory = [[NONE]], }, { def = [[TIAMATBOMB]], onlyTargetCategory = [[NONE]], }, }, weaponDefs = { BASILISKBOMB = { name = [[Basilisk Bomb]], accuracy = 60000, areaOfEffect = 48, avoidFeature = false, avoidFriendly = false, burnblow = true, collideFriendly = false, craterBoost = 1, craterMult = 2, customparams = { spawns_name = "chickenc", spawns_expire = 0, }, damage = { default = 180, }, explosionGenerator = [[custom:none]], fireStarter = 70, flightTime = 0, impulseBoost = 0, impulseFactor = 0.4, interceptedByShieldType = 0, model = [[chickenc.s3o]], range = 500, reloadtime = 10, smokeTrail = false, startVelocity = 200, tolerance = 8000, tracks = false, turnRate = 4000, turret = true, waterweapon = true, weaponAcceleration = 200, weaponType = [[AircraftBomb]], weaponVelocity = 200, }, DODOBOMB = { name = [[Dodo Bomb]], accuracy = 60000, areaOfEffect = 1, avoidFeature = false, avoidFriendly = false, burnblow = true, collideFriendly = false, craterBoost = 0, craterMult = 0, customparams = { spawns_name = "chicken_dodo", spawns_expire = 30, }, damage = { default = 1, }, explosionGenerator = [[custom:none]], fireStarter = 70, flightTime = 0, impactOnly = true, impulseBoost = 0, impulseFactor = 0.4, interceptedByShieldType = 0, model = [[chicken_dodobomb.s3o]], range = 500, reloadtime = 10, smokeTrail = false, startVelocity = 200, tolerance = 8000, tracks = false, turnRate = 4000, turret = true, waterweapon = true, weaponAcceleration = 200, weaponType = [[AircraftBomb]], weaponVelocity = 200, }, TIAMATBOMB = { name = [[Tiamat Bomb]], accuracy = 60000, areaOfEffect = 72, avoidFeature = false, avoidFriendly = false, burnblow = true, collideFriendly = false, craterBoost = 1, craterMult = 2, customparams = { spawns_name = "chicken_tiamat", spawns_expire = 0, }, damage = { default = 350, }, explosionGenerator = [[custom:none]], fireStarter = 70, flightTime = 0, impulseBoost = 0, impulseFactor = 0.4, interceptedByShieldType = 0, model = [[chickenbroodqueen.s3o]], noSelfDamage = true, range = 500, reloadtime = 10, smokeTrail = false, startVelocity = 200, tolerance = 8000, tracks = false, turnRate = 4000, turret = true, waterweapon = true, weaponAcceleration = 200, weaponType = [[AircraftBomb]], weaponVelocity = 200, }, FIREGOO = { name = [[Napalm Goo]], areaOfEffect = 256, burst = 8, burstrate = 0.033, cegTag = [[queen_trail_fire]], customParams = { light_radius = 500, }, craterBoost = 0, craterMult = 0, damage = { default = 400, planes = 400, }, explosionGenerator = [[custom:napalm_koda]], firestarter = 400, impulseBoost = 0, impulseFactor = 0.4, intensity = 0.7, interceptedByShieldType = 1, noSelfDamage = true, proximityPriority = -4, range = 1200, reloadtime = 6, rgbColor = [[0.8 0.4 0]], size = 8, sizeDecay = 0, soundHit = [[weapon/burn_mixed]], soundStart = [[chickens/bigchickenroar]], sprayAngle = 6100, tolerance = 5000, turret = true, weaponType = [[Cannon]], weaponVelocity = 600, }, MELEE = { name = [[Chicken Claws]], areaOfEffect = 32, craterBoost = 1, craterMult = 0, damage = { default = 1000, planes = 1000, }, explosionGenerator = [[custom:NONE]], impulseBoost = 0, impulseFactor = 1, interceptedByShieldType = 0, noSelfDamage = true, range = 200, reloadtime = 1, size = 0, soundStart = [[chickens/bigchickenbreath]], targetborder = 1, tolerance = 5000, turret = true, waterWeapon = true, weaponType = [[Cannon]], weaponVelocity = 600, }, QUEENCRUSH = { name = [[Chicken Kick]], areaOfEffect = 400, collideFriendly = false, craterBoost = 0.001, craterMult = 0.002, customParams = { lups_noshockwave = "1", }, damage = { default = 10, chicken = 0.001, planes = 10, }, edgeEffectiveness = 1, explosionGenerator = [[custom:NONE]], impulseBoost = 500, impulseFactor = 1, intensity = 1, interceptedByShieldType = 1, noSelfDamage = true, range = 512, reloadtime = 1, rgbColor = [[1 1 1]], thickness = 1, tolerance = 100, turret = true, weaponType = [[Cannon]], weaponVelocity = 0.8, }, SPORES = { name = [[Spores]], areaOfEffect = 24, avoidFriendly = false, burst = 8, burstrate = 0.1, collideFriendly = false, craterBoost = 0, craterMult = 0, customParams = { light_radius = 0, }, damage = { default = 75, planes = [[150]], }, dance = 60, explosionGenerator = [[custom:NONE]], fireStarter = 0, flightTime = 5, groundbounce = 1, heightmod = 0.5, impactOnly = true, impulseBoost = 0, impulseFactor = 0.4, interceptedByShieldType = 2, metalpershot = 0, model = [[chickeneggpink.s3o]], noSelfDamage = true, range = 600, reloadtime = 4, smokeTrail = true, startVelocity = 100, texture1 = [[]], texture2 = [[sporetrail]], tolerance = 10000, tracks = true, turnRate = 24000, turret = true, waterweapon = true, weaponAcceleration = 100, weaponType = [[MissileLauncher]], weaponVelocity = 500, wobble = 32000, }, }, } }
gpl-2.0
Insurgencygame/LivingDead
TheLivingDeadv0.1.sdd/units/unused/armalab.lua
1
2802
return { armalab = { acceleration = 0, brakerate = 0, buildangle = 1024, buildcostenergy = 13761, buildcostmetal = 2729, builder = true, buildinggrounddecaldecayspeed = 30, buildinggrounddecalsizex = 7, buildinggrounddecalsizey = 7, buildinggrounddecaltype = "armalab_aoplane.dds", buildpic = "ARMALAB.DDS", buildtime = 16224, canmove = true, category = "ALL NOTLAND PLANT NOTSUB NOWEAPON NOTSHIP NOTAIR NOTHOVER SURFACE", collisionvolumescales = "75 32 91", collisionvolumetest = 1, collisionvolumetype = "Box", corpse = "DEAD", description = "Produces Level 2 Kbots", energystorage = 200, explodeas = "LARGE_BUILDINGEX", footprintx = 6, footprintz = 6, icontype = "building", idleautoheal = 5, idletime = 1800, maxdamage = 3808, maxslope = 15, maxwaterdepth = 0, metalstorage = 200, name = "Advanced Kbot Lab", objectname = "ARMALAB", radardistance = 50, seismicsignature = 0, selfdestructas = "LARGE_BUILDING", sightdistance = 286, terraformspeed = 1000, usebuildinggrounddecal = true, workertime = 300, yardmap = "occccooccccooccccooccccooccccoocccco", buildoptions = { [10] = "armfboy", [11] = "armspid", [12] = "armaak", [13] = "armvader", [14] = "armdecom", [15] = "armscab", [16] = "armaser", [17] = "armspy", [18] = "armmark", [1] = "armack", [2] = "armfark", [3] = "armfast", [4] = "armamph", [5] = "armzeus", [6] = "armmav", [7] = "armsptk", [8] = "armfido", [9] = "armsnipe", }, featuredefs = { dead = { blocking = true, category = "corpses", collisionvolumeoffsets = "0 -17 -1", collisionvolumescales = "73 56 89", collisionvolumetest = 1, collisionvolumetype = "CylZ", damage = 2285, description = "Advanced Kbot Lab Wreckage", energy = 0, featuredead = "HEAP", featurereclamate = "SMUDGE01", footprintx = 5, footprintz = 6, height = 20, hitdensity = 100, metal = 1773, object = "ARMALAB_DEAD", reclaimable = true, seqnamereclamate = "TREE1RECLAMATE", world = "All Worlds", }, heap = { blocking = false, category = "heaps", damage = 1143, description = "Advanced Kbot Lab Heap", energy = 0, featurereclamate = "SMUDGE01", footprintx = 5, footprintz = 5, height = 4, hitdensity = 100, metal = 887, object = "5X5A", reclaimable = true, seqnamereclamate = "TREE1RECLAMATE", world = "All Worlds", }, }, sounds = { canceldestruct = "cancel2", underattack = "warning1", unitcomplete = "untdone", count = { [1] = "count6", [2] = "count5", [3] = "count4", [4] = "count3", [5] = "count2", [6] = "count1", }, select = { [1] = "plabactv", }, }, }, }
gpl-2.0
gbox3d/nodemcu-firmware
lua_modules/http/http.lua
89
6624
------------------------------------------------------------------------------ -- HTTP server module -- -- LICENCE: http://opensource.org/licenses/MIT -- Vladimir Dronnikov <dronnikov@gmail.com> ------------------------------------------------------------------------------ local collectgarbage, tonumber, tostring = collectgarbage, tonumber, tostring local http do ------------------------------------------------------------------------------ -- request methods ------------------------------------------------------------------------------ local make_req = function(conn, method, url) local req = { conn = conn, method = method, url = url, } -- return setmetatable(req, { -- }) return req end ------------------------------------------------------------------------------ -- response methods ------------------------------------------------------------------------------ local send = function(self, data, status) local c = self.conn -- TODO: req.send should take care of response headers! if self.send_header then c:send("HTTP/1.1 ") c:send(tostring(status or 200)) -- TODO: real HTTP status code/name table c:send(" OK\r\n") -- we use chunked transfer encoding, to not deal with Content-Length: -- response header self:send_header("Transfer-Encoding", "chunked") -- TODO: send standard response headers, such as Server:, Date: end if data then -- NB: no headers allowed after response body started if self.send_header then self.send_header = nil -- end response headers c:send("\r\n") end -- chunked transfer encoding c:send(("%X\r\n"):format(#data)) c:send(data) c:send("\r\n") end end local send_header = function(self, name, value) local c = self.conn -- NB: quite a naive implementation c:send(name) c:send(": ") c:send(value) c:send("\r\n") end -- finalize request, optionally sending data local finish = function(self, data, status) local c = self.conn -- NB: req.send takes care of response headers if data then self:send(data, status) end -- finalize chunked transfer encoding c:send("0\r\n\r\n") -- close connection c:close() end -- local make_res = function(conn) local res = { conn = conn, } -- return setmetatable(res, { -- send_header = send_header, -- send = send, -- finish = finish, -- }) res.send_header = send_header res.send = send res.finish = finish return res end ------------------------------------------------------------------------------ -- HTTP parser ------------------------------------------------------------------------------ local http_handler = function(handler) return function(conn) local req, res local buf = "" local method, url local ondisconnect = function(conn) collectgarbage("collect") end -- header parser local cnt_len = 0 local onheader = function(conn, k, v) -- TODO: look for Content-Type: header -- to help parse body -- parse content length to know body length if k == "content-length" then cnt_len = tonumber(v) end if k == "expect" and v == "100-continue" then conn:send("HTTP/1.1 100 Continue\r\n") end -- delegate to request object if req and req.onheader then req:onheader(k, v) end end -- body data handler local body_len = 0 local ondata = function(conn, chunk) -- NB: do not reset node in case of lengthy requests tmr.wdclr() -- feed request data to request handler if not req or not req.ondata then return end req:ondata(chunk) -- NB: once length of seen chunks equals Content-Length: -- onend(conn) is called body_len = body_len + #chunk -- print("-B", #chunk, body_len, cnt_len, node.heap()) if body_len >= cnt_len then req:ondata() end end local onreceive = function(conn, chunk) -- merge chunks in buffer if buf then buf = buf .. chunk else buf = chunk end -- consume buffer line by line while #buf > 0 do -- extract line local e = buf:find("\r\n", 1, true) if not e then break end local line = buf:sub(1, e - 1) buf = buf:sub(e + 2) -- method, url? if not method then local i -- NB: just version 1.1 assumed _, i, method, url = line:find("^([A-Z]+) (.-) HTTP/1.1$") if method then -- make request and response objects req = make_req(conn, method, url) res = make_res(conn) end -- header line? elseif #line > 0 then -- parse header local _, _, k, v = line:find("^([%w-]+):%s*(.+)") -- header seems ok? if k then k = k:lower() onheader(conn, k, v) end -- headers end else -- spawn request handler -- NB: do not reset in case of lengthy requests tmr.wdclr() handler(req, res) tmr.wdclr() -- NB: we feed the rest of the buffer as starting chunk of body ondata(conn, buf) -- buffer no longer needed buf = nil -- NB: we explicitly reassign receive handler so that -- next received chunks go directly to body handler conn:on("receive", ondata) -- parser done break end end end conn:on("receive", onreceive) conn:on("disconnection", ondisconnect) end end ------------------------------------------------------------------------------ -- HTTP server ------------------------------------------------------------------------------ local srv local createServer = function(port, handler) -- NB: only one server at a time if srv then srv:close() end srv = net.createServer(net.TCP, 15) -- listen srv:listen(port, http_handler(handler)) return srv end ------------------------------------------------------------------------------ -- HTTP server methods ------------------------------------------------------------------------------ http = { createServer = createServer, } end return http
mit
Insurgencygame/LivingDead
TheLivingDeadv0.1.sdd/units/unused/armham.lua
1
2925
return { armham = { acceleration = 0.11999999731779, brakerate = 0.22499999403954, buildcostenergy = 1231, buildcostmetal = 121, buildpic = "ARMHAM.DDS", buildtime = 2210, canmove = true, category = "KBOT MOBILE WEAPON ALL NOTSUB NOTSHIP NOTAIR NOTHOVER SURFACE", corpse = "DEAD", description = "Light Plasma Kbot", energymake = 0.60000002384186, energyuse = 0.60000002384186, explodeas = "BIG_UNITEX", footprintx = 2, footprintz = 2, idleautoheal = 5, idletime = 1800, mass = 300, maxdamage = 810, maxslope = 14, maxvelocity = 1.539999961853, maxwaterdepth = 12, movementclass = "KBOT2", name = "Hammer", nochasecategory = "VTOL", objectname = "ARMHAM", seismicsignature = 0, selfdestructas = "BIG_UNIT", sightdistance = 380, smoothanim = true, turnrate = 1094, upright = true, featuredefs = { dead = { blocking = true, category = "corpses", collisionvolumeoffsets = "1.85908508301 -3.40689422363 2.59911346436", collisionvolumescales = "31.0182495117 8.18759155273 36.3284454346", collisionvolumetype = "Box", damage = 486, description = "Hammer Wreckage", energy = 0, featuredead = "HEAP", featurereclamate = "SMUDGE01", footprintx = 2, footprintz = 2, height = 40, hitdensity = 100, metal = 79, object = "ARMHAM_DEAD", reclaimable = true, seqnamereclamate = "TREE1RECLAMATE", world = "All Worlds", }, heap = { blocking = false, category = "heaps", damage = 243, description = "Hammer Heap", energy = 0, featurereclamate = "SMUDGE01", footprintx = 2, footprintz = 2, height = 4, hitdensity = 100, metal = 32, object = "2X2E", reclaimable = true, seqnamereclamate = "TREE1RECLAMATE", world = "All Worlds", }, }, sounds = { canceldestruct = "cancel2", underattack = "warning1", cant = { [1] = "cantdo4", }, count = { [1] = "count6", [2] = "count5", [3] = "count4", [4] = "count3", [5] = "count2", [6] = "count1", }, ok = { [1] = "kbarmmov", }, select = { [1] = "kbarmsel", }, }, weapondefs = { arm_ham = { areaofeffect = 36, craterboost = 0, cratermult = 0, explosiongenerator = "custom:LIGHT_PLASMA", gravityaffected = "true", impulseboost = 0.12300000339746, impulsefactor = 0.12300000339746, name = "PlasmaCannon", noselfdamage = true, predictboost = 0.40000000596046, range = 380, reloadtime = 1.75, soundhit = "xplomed3", soundstart = "cannon1", turret = true, weapontype = "Cannon", weaponvelocity = 286, damage = { bombers = 21, default = 104, fighters = 21, subs = 5, vtol = 21, }, }, }, weapons = { [1] = { badtargetcategory = "VTOL", def = "ARM_HAM", onlytargetcategory = "NOTSUB", }, }, }, }
gpl-2.0
codneutro/L2D
sys/lua/L2D/player/player.lua
1
1407
--- -- Player implementation -- -- @author x[N]ir -- @release 04/04/16 -- --- Player array -- @tfield table players players = {}; --- -- Saves the specified player into the database -- -- @tparam int id player ID -- function savePlayer(id) local lines = {}; local p = players[id]; --> User received files but leave during download process (-__-) if (p) then local userFile = USERS_FOLDER..p.usgn..".dat"; for k, v in pairs(p) do lines[#lines + 1] = v; end File.writeLines(userFile, lines); printDebug(p.nick.." ["..p.usgn.."] has been saved"); end end --- -- Returns the loaded player -- -- @tparam int id player ID -- @treturn Player a player -- function loadPlayer(id) local usgn = player(id, "usgn"); local userFile = USERS_FOLDER..usgn..".dat"; local p = Player.new(id); p.usgn = usgn; if (File.isFile(userFile)) then File.loadFile(userFile); for k, v in pairs(p) do if (k ~= "nick") then p[k] = tonumber(File.getLine()); else p[k] = File.getLine(); end end end printDebug(p.nick.." ["..p.usgn.."] has been loaded"); return p; end --- -- Returns a player id from usgn or -1 on error -- -- @tparam int usgn player USGN -- @treturn int player's ID associated with the usgn -- function getPlayerID(usgn) for k, id in pairs(player(0, "table")) do if(player(id, "usgn") == usgn) then return id; end end return -1; end
gpl-3.0
Goranaws/Dominos
Dominos/libs/LibKeyBound-1.0/LibKeyBound-1.0.lua
1
18271
--[[ Name: LibKeyBound-1.0 Revision: $Rev: 109 $ Author(s): Gello, Maul, Toadkiller, Tuller Website: http://www.wowace.com/wiki/LibKeyBound-1.0 Documentation: http://www.wowace.com/wiki/LibKeyBound-1.0 SVN: http://svn.wowace.com/wowace/trunk/LibKeyBound-1.0 Description: An intuitive keybindings system: mouseover frame, click keys or buttons. Dependencies: CallbackHandler-1.0 --]] local MAJOR = 'LibKeyBound-1.0' local MINOR = tonumber(("$Revision: 109 $"):match("(%d+)")) + 90000 --[[ LibKeyBound-1.0 ClickBinder by Gello and TrinityBinder by Maul -> keyBound by Tuller -> LibKeyBound library by Toadkiller Functions needed to implement button:GetHotkey() - returns the current hotkey assigned to the given button Functions to implement if using a custom keybindings system: button:SetKey(key) - binds the given key to the given button button:FreeKey(key) - unbinds the given key from all other buttons button:ClearBindings() - removes all keys bound to the given button button:GetBindings() - returns a string listing all bindings of the given button button:GetActionName() - what we're binding to, used for printing --]] local LibKeyBound, oldminor = LibStub:NewLibrary(MAJOR, MINOR) if not LibKeyBound then return end -- no upgrade needed local _G = _G local NUM_MOUSE_BUTTONS = 31 -- CallbackHandler LibKeyBound.events = LibKeyBound.events or _G.LibStub('CallbackHandler-1.0'):New(LibKeyBound) local L = LibKeyBoundLocale10 LibKeyBound.L = L -- ToDo delete global LibKeyBoundLocale10 at some point LibKeyBound.Binder = LibKeyBound.Binder or {} -- #NODOC function LibKeyBound:Initialize() do local f = CreateFrame('Frame', 'KeyboundDialog', UIParent) f:SetFrameStrata('DIALOG') f:SetToplevel(true) f:EnableMouse(true) f:SetMovable(true) f:SetClampedToScreen(true) f:SetWidth(360) f:SetHeight(140) f:SetBackdrop{ bgFile='Interface\\DialogFrame\\UI-DialogBox-Background' , edgeFile='Interface\\DialogFrame\\UI-DialogBox-Border', tile = true, insets = {left = 11, right = 12, top = 12, bottom = 11}, tileSize = 32, edgeSize = 32, } f:SetPoint('TOP', 0, -24) f:Hide() f:SetScript('OnShow', function() PlaySound(SOUNDKIT.IG_MAINMENU_OPEN) end) f:SetScript('OnHide', function() PlaySound(SOUNDKIT.IG_MAINMENU_CLOSE) end) f:RegisterForDrag('LeftButton') f:SetScript('OnDragStart', function(f) f:StartMoving() end) f:SetScript('OnDragStop', function(f) f:StopMovingOrSizing() end) local header = f:CreateTexture(nil, 'ARTWORK') header:SetTexture('Interface\\DialogFrame\\UI-DialogBox-Header') header:SetWidth(256); header:SetHeight(64) header:SetPoint('TOP', 0, 12) local title = f:CreateFontString('ARTWORK') title:SetFontObject('GameFontNormal') title:SetPoint('TOP', header, 'TOP', 0, -14) title:SetText(L.BindingMode) local desc = f:CreateFontString('ARTWORK') desc:SetFontObject('GameFontHighlight') desc:SetJustifyV('TOP') desc:SetJustifyH('LEFT') desc:SetPoint('TOPLEFT', 18, -32) desc:SetPoint('BOTTOMRIGHT', -18, 48) desc:SetText(format(L.BindingsHelp, GetBindingText('ESCAPE', 'KEY_'))) -- Per character bindings checkbox local perChar = CreateFrame('CheckButton', 'KeyboundDialogCheck', f, 'OptionsCheckButtonTemplate') _G[perChar:GetName() .. 'Text']:SetText(CHARACTER_SPECIFIC_KEYBINDINGS) perChar:SetScript('OnShow', function(self) self:SetChecked(GetCurrentBindingSet() == 2) end) local current perChar:SetScript('OnClick', function(self) current = (perChar:GetChecked() and 2) or 1 LoadBindings(current) end) -- Okay bindings checkbox local okayBindings = CreateFrame('CheckButton', 'KeyboundDialogOkay', f, 'OptionsButtonTemplate') getglobal(okayBindings:GetName() .. 'Text'):SetText(OKAY) okayBindings:SetScript('OnClick', function(self) current = (perChar:GetChecked() and 2) or 1 if InCombatLockdown() then self:RegisterEvent('PLAYER_REGEN_ENABLED') else SaveBindings(current) LibKeyBound:Deactivate() end end) okayBindings:SetScript('OnHide', function(self) current = (perChar:GetChecked() and 2) or 1 if InCombatLockdown() then self:RegisterEvent('PLAYER_REGEN_ENABLED') else SaveBindings(current) end end) okayBindings:SetScript('OnEvent', function(self, event) SaveBindings(current) self:UnregisterEvent(event) LibKeyBound:Deactivate() end) -- Cancel bindings checkbox local cancelBindings = CreateFrame('CheckButton', 'KeyboundDialogCancel', f, 'OptionsButtonTemplate') getglobal(cancelBindings:GetName() .. 'Text'):SetText(CANCEL) cancelBindings:SetScript('OnClick', function(self) if InCombatLockdown() then self:RegisterEvent('PLAYER_REGEN_ENABLED') else LoadBindings(GetCurrentBindingSet()) LibKeyBound:Deactivate() end end) cancelBindings:SetScript('OnEvent', function(self, event) LoadBindings(GetCurrentBindingSet()) self:UnregisterEvent(event) LibKeyBound:Deactivate() end) --position buttons perChar:SetPoint('BOTTOMLEFT', 14, 32) cancelBindings:SetPoint('BOTTOMRIGHT', -14, 14) okayBindings:SetPoint('RIGHT', cancelBindings, 'LEFT') self.dialog = f end SlashCmdList['LibKeyBoundSlashCOMMAND'] = function() self:Toggle() end SLASH_LibKeyBoundSlashCOMMAND1 = '/libkeybound' SLASH_LibKeyBoundSlashCOMMAND2 = '/kb' SLASH_LibKeyBoundSlashCOMMAND3 = '/lkb' LibKeyBound.initialized = true end -- Default color to indicate bindable frames in your mod. LibKeyBound.colorKeyBoundMode = LibKeyBound.colorKeyBoundMode or { 0, 1, 1, 0.5 } --[[ LibKeyBound:SetColorKeyBoundMode([r][, g][, b][, a]) --]] --[[ Arguments: number - red, default 0 number - green, default 0 number - blue, default 0 number - alpha, default 1 Example: if (MyMod.keyBoundMode) then overlayFrame:SetBackdropColor(LibKeyBound:GetColorKeyBoundMode()) end ... local r, g, b, a = LibKeyBound:GetColorKeyBoundMode() Notes: * Returns the color to use on your participating buttons during KeyBound Mode * Values are unpacked and ready to use as color arguments --]] function LibKeyBound:SetColorKeyBoundMode(r, g, b, a) r, g, b, a = r or 0, g or 0, b or 0, a or 1 LibKeyBound.colorKeyBoundMode[1] = r LibKeyBound.colorKeyBoundMode[2] = g LibKeyBound.colorKeyBoundMode[3] = b LibKeyBound.colorKeyBoundMode[4] = a LibKeyBound.events:Fire('LIBKEYBOUND_MODE_COLOR_CHANGED') end --[[ Returns: * number - red * number - green * number - blue * number - alpha Example: if (MyMod.keyBoundMode) then overlayFrame:SetBackdropColor(LibKeyBound:GetColorKeyBoundMode()) end ... local r, g, b, a = LibKeyBound:GetColorKeyBoundMode() Notes: * Returns the color to use on your participating buttons during KeyBound Mode * Values are unpacked and ready to use as color arguments --]] function LibKeyBound:GetColorKeyBoundMode() return unpack(LibKeyBound.colorKeyBoundMode) end function LibKeyBound:PLAYER_REGEN_ENABLED() if self.enabled then UIErrorsFrame:AddMessage(L.CombatBindingsEnabled, 1, 0.3, 0.3, 1, UIERRORS_HOLD_TIME) self.dialog:Hide() end end function LibKeyBound:PLAYER_REGEN_DISABLED() if self.enabled then self:Set(nil) UIErrorsFrame:AddMessage(L.CombatBindingsDisabled, 1, 0.3, 0.3, 1, UIERRORS_HOLD_TIME) self.dialog:Show() end end --[[ Notes: * Switches KeyBound Mode between on and off Example: local LibKeyBound = LibStub('LibKeyBound-1.0') LibKeyBound:Toggle() --]] function LibKeyBound:Toggle() if (LibKeyBound:IsShown()) then LibKeyBound:Deactivate() else LibKeyBound:Activate() end end --[[ Notes: * Switches KeyBound Mode to on Example: local LibKeyBound = LibStub('LibKeyBound-1.0') LibKeyBound:Activate() --]] function LibKeyBound:Activate() if not self:IsShown() then if InCombatLockdown() then UIErrorsFrame:AddMessage(L.CannotBindInCombat, 1, 0.3, 0.3, 1, UIERRORS_HOLD_TIME) else self.enabled = true if not self.frame then self.frame = LibKeyBound.Binder:Create() end self:Set(nil) self.dialog:Show() self.events:Fire('LIBKEYBOUND_ENABLED') end end end --[[ Notes: * Switches KeyBound Mode to off Example: local LibKeyBound = LibStub('LibKeyBound-1.0') LibKeyBound:Deactivate() --]] function LibKeyBound:Deactivate() if self:IsShown() then self.enabled = nil self:Set(nil) self.dialog:Hide() self.events:Fire('LIBKEYBOUND_DISABLED') end end --[[ Returns: boolean - true if KeyBound Mode is currently on Example: local LibKeyBound = LibStub('LibKeyBound-1.0') local isKeyBoundMode = LibKeyBound:IsShown() if (isKeyBoundMode) then -- Do something else -- Do another thing end Notes: * Is KeyBound Mode currently on --]] function LibKeyBound:IsShown() return self.enabled end --[[ Arguments: table - the button frame Example: local button = this LibKeyBound:Set(button) Notes: * Sets up button for keybinding * Call this in your OnEnter script for the button * Current bindings are shown in the tooltip * Primary binding is shown in green in the button text --]] function LibKeyBound:Set(button) local bindFrame = self.frame if button and self:IsShown() and not InCombatLockdown() then bindFrame.button = button bindFrame:SetAllPoints(button) bindFrame.text:SetFontObject('GameFontNormalLarge') bindFrame.text:SetText(button:GetHotkey()) if bindFrame.text:GetStringWidth() > bindFrame:GetWidth() then bindFrame.text:SetFontObject('GameFontNormal') end bindFrame:Show() bindFrame:OnEnter() elseif bindFrame then bindFrame.button = nil bindFrame:ClearAllPoints() bindFrame:Hide() end end --[[ Arguments: string - the keyString to shorten Returns: string - the shortened displayString Example: local key1 = GetBindingKey(button:GetName()) local displayKey = LibKeyBound:ToShortKey(key1) return displayKey Notes: * Shortens the key text (returned from GetBindingKey etc.) * Result is suitable for display on a button * Can be used for your button:GetHotkey() return value --]] function LibKeyBound:ToShortKey(key) if key then key = key:upper() key = key:gsub(' ', '') key = key:gsub('ALT%-', L['Alt']) key = key:gsub('CTRL%-', L['Ctrl']) key = key:gsub('SHIFT%-', L['Shift']) key = key:gsub('NUMPAD', L['NumPad']) key = key:gsub('PLUS', '%+') key = key:gsub('MINUS', '%-') key = key:gsub('MULTIPLY', '%*') key = key:gsub('DIVIDE', '%/') key = key:gsub('BACKSPACE', L['Backspace']) for i = 1, NUM_MOUSE_BUTTONS do key = key:gsub('BUTTON' .. i, L['Button' .. i]) end key = key:gsub('CAPSLOCK', L['Capslock']) key = key:gsub('CLEAR', L['Clear']) key = key:gsub('DELETE', L['Delete']) key = key:gsub('END', L['End']) key = key:gsub('HOME', L['Home']) key = key:gsub('INSERT', L['Insert']) key = key:gsub('MOUSEWHEELDOWN', L['Mouse Wheel Down']) key = key:gsub('MOUSEWHEELUP', L['Mouse Wheel Up']) key = key:gsub('NUMLOCK', L['Num Lock']) key = key:gsub('PAGEDOWN', L['Page Down']) key = key:gsub('PAGEUP', L['Page Up']) key = key:gsub('SCROLLLOCK', L['Scroll Lock']) key = key:gsub('SPACEBAR', L['Spacebar']) key = key:gsub('SPACE', L['Spacebar']) key = key:gsub('TAB', L['Tab']) key = key:gsub('DOWNARROW', L['Down Arrow']) key = key:gsub('LEFTARROW', L['Left Arrow']) key = key:gsub('RIGHTARROW', L['Right Arrow']) key = key:gsub('UPARROW', L['Up Arrow']) return key end end --[[ Binder Widget ]]-- function LibKeyBound.Binder:Create() local binder = CreateFrame('Button') binder:RegisterForClicks('anyUp') binder:SetFrameStrata('DIALOG') binder:EnableKeyboard(true) binder:EnableMouseWheel(true) for k,v in pairs(self) do binder[k] = v end local bg = binder:CreateTexture() bg:SetTexture(0, 0, 0, 0.5) bg:SetAllPoints(binder) local text = binder:CreateFontString('OVERLAY') text:SetFontObject('GameFontNormalLarge') text:SetTextColor(0, 1, 0) text:SetAllPoints(binder) binder.text = text binder:SetScript('OnClick', self.OnKeyDown) binder:SetScript('OnKeyDown', self.OnKeyDown) binder:SetScript('OnMouseWheel', self.OnMouseWheel) binder:SetScript('OnEnter', self.OnEnter) binder:SetScript('OnLeave', self.OnLeave) binder:SetScript('OnHide', self.OnHide) binder:Hide() return binder end function LibKeyBound.Binder:OnHide() LibKeyBound:Set(nil) end function LibKeyBound.Binder:OnKeyDown(key) local button = self.button if not button then return end if (key == 'UNKNOWN' or key == 'LSHIFT' or key == 'RSHIFT' or key == 'LCTRL' or key == 'RCTRL' or key == 'LALT' or key == 'RALT') then return end local screenshotKey = GetBindingKey('SCREENSHOT') if screenshotKey and key == screenshotKey then Screenshot() return end local openChatKey = GetBindingKey('OPENCHAT') if openChatKey and key == openChatKey then ChatFrameEditBox:Show() return end if key == 'ESCAPE' then self:ClearBindings(button) LibKeyBound:Set(button) return end -- dont bind unmodified left or right button if (key == 'LeftButton' or key == 'RightButton') and not IsModifierKeyDown() then return end --handle mouse button substitutions if key == 'LeftButton' then key = 'BUTTON1' elseif key == 'RightButton' then key = 'BUTTON2' elseif key == 'MiddleButton' then key = 'BUTTON3' elseif key:match('^Button%d+$') then key = key:upper() end --apply modifiers if IsModifierKeyDown() then if IsShiftKeyDown() then key = 'SHIFT-' .. key end if IsControlKeyDown() then key = 'CTRL-' .. key end if IsAltKeyDown() then key = 'ALT-' .. key end end if button:IsMouseOver() then self:SetKey(button, key) LibKeyBound:Set(button) end end function LibKeyBound.Binder:OnMouseWheel(arg1) if arg1 > 0 then self:OnKeyDown('MOUSEWHEELUP') else self:OnKeyDown('MOUSEWHEELDOWN') end end function LibKeyBound.Binder:OnEnter() local button = self.button if button and not InCombatLockdown() then if self:GetRight() >= (GetScreenWidth() / 2) then GameTooltip:SetOwner(self, 'ANCHOR_LEFT') else GameTooltip:SetOwner(self, 'ANCHOR_RIGHT') end if button.GetActionName then GameTooltip:SetText(button:GetActionName(), 1, 1, 1) else GameTooltip:SetText(button:GetName(), 1, 1, 1) end local bindings = self:GetBindings(button) if bindings then GameTooltip:AddLine(bindings, 0, 1, 0) GameTooltip:AddLine(L.ClearTip) else GameTooltip:AddLine(L.NoKeysBoundTip, 0, 1, 0) end GameTooltip:Show() else GameTooltip:Hide() end end function LibKeyBound.Binder:OnLeave() LibKeyBound:Set(nil) GameTooltip:Hide() end --[[ Update Functions ]]-- function LibKeyBound.Binder:ToBinding(button) return format('CLICK %s:LeftButton', button:GetName()) end function LibKeyBound.Binder:FreeKey(button, key) local msg if button.FreeKey then local action = button:FreeKey(key) if button:FreeKey(key) then msg = format(L.UnboundKey, GetBindingText(key, 'KEY_'), action) end else local action = GetBindingAction(key) if action and action ~= '' and action ~= self:ToBinding(button) then msg = format(L.UnboundKey, GetBindingText(key, 'KEY_'), action) end end if msg then UIErrorsFrame:AddMessage(msg, 1, 0.82, 0, 1, UIERRORS_HOLD_TIME) end end function LibKeyBound.Binder:SetKey(button, key) if InCombatLockdown() then UIErrorsFrame:AddMessage(L.CannotBindInCombat, 1, 0.3, 0.3, 1, UIERRORS_HOLD_TIME) else self:FreeKey(button, key) if button.SetKey then button:SetKey(key) else SetBindingClick(key, button:GetName(), 'LeftButton') end local msg if button.GetActionName then msg = format(L.BoundKey, GetBindingText(key, 'KEY_'), button:GetActionName()) else msg = format(L.BoundKey, GetBindingText(key, 'KEY_'), button:GetName()) end UIErrorsFrame:AddMessage(msg, 1, 1, 1, 1, UIERRORS_HOLD_TIME) end end function LibKeyBound.Binder:ClearBindings(button) if InCombatLockdown() then UIErrorsFrame:AddMessage(L.CannotBindInCombat, 1, 0.3, 0.3, 1, UIERRORS_HOLD_TIME) else if button.ClearBindings then button:ClearBindings() else local binding = self:ToBinding(button) while (GetBindingKey(binding)) do SetBinding(GetBindingKey(binding), nil) end end local msg if button.GetActionName then msg = format(L.ClearedBindings, button:GetActionName()) else msg = format(L.ClearedBindings, button:GetName()) end UIErrorsFrame:AddMessage(msg, 1, 1, 1, 1, UIERRORS_HOLD_TIME) end end function LibKeyBound.Binder:GetBindings(button) if button.GetBindings then return button:GetBindings() end local keys local binding = self:ToBinding(button) for i = 1, select('#', GetBindingKey(binding)) do local hotKey = select(i, GetBindingKey(binding)) if keys then keys = keys .. ', ' .. GetBindingText(hotKey, 'KEY_') else keys = GetBindingText(hotKey, 'KEY_') end end return keys end LibKeyBound.EventButton = LibKeyBound.EventButton or CreateFrame('Frame') do local EventButton = LibKeyBound.EventButton EventButton:UnregisterAllEvents() EventButton:SetScript('OnEvent', function(self, event, addon) if (event == 'PLAYER_REGEN_DISABLED') then LibKeyBound:PLAYER_REGEN_DISABLED() elseif (event == 'PLAYER_REGEN_ENABLED') then LibKeyBound:PLAYER_REGEN_ENABLED() elseif (event == 'PLAYER_LOGIN' and not LibKeyBound.initialized) then LibKeyBound:Initialize() EventButton:UnregisterEvent('PLAYER_LOGIN') end end) if IsLoggedIn() and not LibKeyBound.initialized then LibKeyBound:Initialize() elseif not LibKeyBound.initialized then EventButton:RegisterEvent('PLAYER_LOGIN') end EventButton:RegisterEvent('PLAYER_REGEN_ENABLED') EventButton:RegisterEvent('PLAYER_REGEN_DISABLED') end
bsd-3-clause
The-HalcyonDays/darkstar
scripts/globals/items/silken_sash.lua
36
1212
----------------------------------------- -- ID: 5632 -- Item: Silken Sash -- Food Effect: 4 Hrs, All Races ----------------------------------------- -- TODO: Group Effect -- HP Recovered while healing +3 -- MP Recovered while healing +5 ----------------------------------------- require("scripts/globals/status"); ----------------------------------------- -- OnItemCheck ----------------------------------------- function onItemCheck(target) result = 0 if (target:hasStatusEffect(EFFECT_FOOD) == true or target:hasStatusEffect(EFFECT_FIELD_SUPPORT_FOOD) == true) then result = 246; end return result; end; ----------------------------------------- -- OnItemUse ----------------------------------------- function onItemUse(target) target:addStatusEffect(EFFECT_FOOD,0,0,14400,5632); end; ----------------------------------- -- onEffectGain Action ----------------------------------- function onEffectGain(target,effect) target:addMod(MOD_HPHEAL, 3); target:addMod(MOD_MPHEAL, 5); end; ----------------------------------------- -- onEffectLose Action ----------------------------------------- function onEffectLose(target,effect) target:delMod(MOD_HPHEAL, 3); target:delMod(MOD_MPHEAL, 5); end;
gpl-3.0
APItools/monitor
lua/autoswagger/lib/md5.lua
2
8414
------------------------------------------------------------------------------- -- MD5 computation in Lua (5.1) ------------------------------------------------------------------------------- -- bit lib implementions local floor, abs, max = math.floor, math.abs, math.max local char, byte, format, rep, sub = string.char, string.byte, string.format, string.rep, string.sub local function check_int(n) -- checking not float if(n - floor(n) > 0) then error("trying to use bitwise operation on non-integer!") end end local function tbl2number(tbl) local n = #tbl local rslt = 0 local power = 1 for i = 1, n do rslt = rslt + tbl[i]*power power = power*2 end return rslt end local function expand(tbl_m, tbl_n) local big = {} local small = {} if(#tbl_m > #tbl_n) then big = tbl_m small = tbl_n else big = tbl_n small = tbl_m end -- expand small for i = #small + 1, #big do small[i] = 0 end end local to_bits -- needs to be declared before bit_not local function bit_not(n) local tbl = to_bits(n) local size = max(#tbl, 32) for i = 1, size do if(tbl[i] == 1) then tbl[i] = 0 else tbl[i] = 1 end end return tbl2number(tbl) end -- defined as local above to_bits = function (n) check_int(n) if(n < 0) then -- negative return to_bits(bit_not(abs(n)) + 1) end -- to bits table local tbl = {} local cnt = 1 while (n > 0) do local last = n % 2 if(last == 1) then tbl[cnt] = 1 else tbl[cnt] = 0 end n = (n-last)/2 cnt = cnt + 1 end return tbl end local function bit_or(m, n) local tbl_m = to_bits(m) local tbl_n = to_bits(n) expand(tbl_m, tbl_n) local tbl = {} local rslt = max(#tbl_m, #tbl_n) for i = 1, rslt do if(tbl_m[i]== 0 and tbl_n[i] == 0) then tbl[i] = 0 else tbl[i] = 1 end end return tbl2number(tbl) end local function bit_and(m, n) local tbl_m = to_bits(m) local tbl_n = to_bits(n) expand(tbl_m, tbl_n) local tbl = {} local rslt = max(#tbl_m, #tbl_n) for i = 1, rslt do if(tbl_m[i]== 0 or tbl_n[i] == 0) then tbl[i] = 0 else tbl[i] = 1 end end return tbl2number(tbl) end local function bit_xor(m, n) local tbl_m = to_bits(m) local tbl_n = to_bits(n) expand(tbl_m, tbl_n) local tbl = {} local rslt = max(#tbl_m, #tbl_n) for i = 1, rslt do if(tbl_m[i] ~= tbl_n[i]) then tbl[i] = 1 else tbl[i] = 0 end end return tbl2number(tbl) end local function bit_rshift(n, bits) check_int(n) local high_bit = 0 if(n < 0) then -- negative n = bit_not(abs(n)) + 1 high_bit = 2147483648 -- 0x80000000 end for i=1, bits do n = n/2 n = bit_or(floor(n), high_bit) end return floor(n) end local function bit_lshift(n, bits) check_int(n) if(n < 0) then -- negative n = bit_not(abs(n)) + 1 end for i=1, bits do n = n*2 end return bit_and(n, 4294967295) -- 0xFFFFFFFF end -- convert little-endian 32-bit int to a 4-char string local function lei2str(i) local f=function (s) return char( bit_and( bit_rshift(i, s), 255)) end return f(0)..f(8)..f(16)..f(24) end -- convert raw string to big-endian int local function str2bei(s) local v=0 for i=1, #s do v = v * 256 + byte(s, i) end return v end -- convert raw string to little-endian int local function str2lei(s) local v=0 for i = #s,1,-1 do v = v*256 + byte(s, i) end return v end -- cut up a string in little-endian ints of given size local function cut_le_str(s,...) local o, r = 1, {} local args = {...} for i=1, #args do table.insert(r, str2lei(sub(s, o, o + args[i] - 1))) o = o + args[i] end return r end local swap = function (w) return str2bei(lei2str(w)) end local function hex2binaryaux(hexval) return char(tonumber(hexval, 16)) end local function hex2binary(hex) local result, _ = hex:gsub('..', hex2binaryaux) return result end -- An MD5 mplementation in Lua, requires bitlib (hacked to use LuaBit from above, ugh) -- 10/02/2001 jcw@equi4.com local FF = 0xffffffff local CONSTS = { 0xd76aa478, 0xe8c7b756, 0x242070db, 0xc1bdceee, 0xf57c0faf, 0x4787c62a, 0xa8304613, 0xfd469501, 0x698098d8, 0x8b44f7af, 0xffff5bb1, 0x895cd7be, 0x6b901122, 0xfd987193, 0xa679438e, 0x49b40821, 0xf61e2562, 0xc040b340, 0x265e5a51, 0xe9b6c7aa, 0xd62f105d, 0x02441453, 0xd8a1e681, 0xe7d3fbc8, 0x21e1cde6, 0xc33707d6, 0xf4d50d87, 0x455a14ed, 0xa9e3e905, 0xfcefa3f8, 0x676f02d9, 0x8d2a4c8a, 0xfffa3942, 0x8771f681, 0x6d9d6122, 0xfde5380c, 0xa4beea44, 0x4bdecfa9, 0xf6bb4b60, 0xbebfbc70, 0x289b7ec6, 0xeaa127fa, 0xd4ef3085, 0x04881d05, 0xd9d4d039, 0xe6db99e5, 0x1fa27cf8, 0xc4ac5665, 0xf4292244, 0x432aff97, 0xab9423a7, 0xfc93a039, 0x655b59c3, 0x8f0ccc92, 0xffeff47d, 0x85845dd1, 0x6fa87e4f, 0xfe2ce6e0, 0xa3014314, 0x4e0811a1, 0xf7537e82, 0xbd3af235, 0x2ad7d2bb, 0xeb86d391, 0x67452301, 0xefcdab89, 0x98badcfe, 0x10325476 } local f=function (x,y,z) return bit_or(bit_and(x,y),bit_and(-x-1,z)) end local g=function (x,y,z) return bit_or(bit_and(x,z),bit_and(y,-z-1)) end local h=function (x,y,z) return bit_xor(x,bit_xor(y,z)) end local i=function (x,y,z) return bit_xor(y,bit_or(x,-z-1)) end local z=function (f,a,b,c,d,x,s,ac) a=bit_and(a+f(b,c,d)+x+ac,FF) -- be *very* careful that left shift does not cause rounding! return bit_or(bit_lshift(bit_and(a,bit_rshift(FF,s)),s),bit_rshift(a,32-s))+b end local function transform(A,B,C,D,X) local a,b,c,d=A,B,C,D local t=CONSTS a=z(f,a,b,c,d,X[ 0], 7,t[ 1]) d=z(f,d,a,b,c,X[ 1],12,t[ 2]) c=z(f,c,d,a,b,X[ 2],17,t[ 3]) b=z(f,b,c,d,a,X[ 3],22,t[ 4]) a=z(f,a,b,c,d,X[ 4], 7,t[ 5]) d=z(f,d,a,b,c,X[ 5],12,t[ 6]) c=z(f,c,d,a,b,X[ 6],17,t[ 7]) b=z(f,b,c,d,a,X[ 7],22,t[ 8]) a=z(f,a,b,c,d,X[ 8], 7,t[ 9]) d=z(f,d,a,b,c,X[ 9],12,t[10]) c=z(f,c,d,a,b,X[10],17,t[11]) b=z(f,b,c,d,a,X[11],22,t[12]) a=z(f,a,b,c,d,X[12], 7,t[13]) d=z(f,d,a,b,c,X[13],12,t[14]) c=z(f,c,d,a,b,X[14],17,t[15]) b=z(f,b,c,d,a,X[15],22,t[16]) a=z(g,a,b,c,d,X[ 1], 5,t[17]) d=z(g,d,a,b,c,X[ 6], 9,t[18]) c=z(g,c,d,a,b,X[11],14,t[19]) b=z(g,b,c,d,a,X[ 0],20,t[20]) a=z(g,a,b,c,d,X[ 5], 5,t[21]) d=z(g,d,a,b,c,X[10], 9,t[22]) c=z(g,c,d,a,b,X[15],14,t[23]) b=z(g,b,c,d,a,X[ 4],20,t[24]) a=z(g,a,b,c,d,X[ 9], 5,t[25]) d=z(g,d,a,b,c,X[14], 9,t[26]) c=z(g,c,d,a,b,X[ 3],14,t[27]) b=z(g,b,c,d,a,X[ 8],20,t[28]) a=z(g,a,b,c,d,X[13], 5,t[29]) d=z(g,d,a,b,c,X[ 2], 9,t[30]) c=z(g,c,d,a,b,X[ 7],14,t[31]) b=z(g,b,c,d,a,X[12],20,t[32]) a=z(h,a,b,c,d,X[ 5], 4,t[33]) d=z(h,d,a,b,c,X[ 8],11,t[34]) c=z(h,c,d,a,b,X[11],16,t[35]) b=z(h,b,c,d,a,X[14],23,t[36]) a=z(h,a,b,c,d,X[ 1], 4,t[37]) d=z(h,d,a,b,c,X[ 4],11,t[38]) c=z(h,c,d,a,b,X[ 7],16,t[39]) b=z(h,b,c,d,a,X[10],23,t[40]) a=z(h,a,b,c,d,X[13], 4,t[41]) d=z(h,d,a,b,c,X[ 0],11,t[42]) c=z(h,c,d,a,b,X[ 3],16,t[43]) b=z(h,b,c,d,a,X[ 6],23,t[44]) a=z(h,a,b,c,d,X[ 9], 4,t[45]) d=z(h,d,a,b,c,X[12],11,t[46]) c=z(h,c,d,a,b,X[15],16,t[47]) b=z(h,b,c,d,a,X[ 2],23,t[48]) a=z(i,a,b,c,d,X[ 0], 6,t[49]) d=z(i,d,a,b,c,X[ 7],10,t[50]) c=z(i,c,d,a,b,X[14],15,t[51]) b=z(i,b,c,d,a,X[ 5],21,t[52]) a=z(i,a,b,c,d,X[12], 6,t[53]) d=z(i,d,a,b,c,X[ 3],10,t[54]) c=z(i,c,d,a,b,X[10],15,t[55]) b=z(i,b,c,d,a,X[ 1],21,t[56]) a=z(i,a,b,c,d,X[ 8], 6,t[57]) d=z(i,d,a,b,c,X[15],10,t[58]) c=z(i,c,d,a,b,X[ 6],15,t[59]) b=z(i,b,c,d,a,X[13],21,t[60]) a=z(i,a,b,c,d,X[ 4], 6,t[61]) d=z(i,d,a,b,c,X[11],10,t[62]) c=z(i,c,d,a,b,X[ 2],15,t[63]) b=z(i,b,c,d,a,X[ 9],21,t[64]) return A+a,B+b,C+c,D+d end ---------------------------------------------------------------- local md5 = {} function md5.sumhexa(s) local msgLen = #s local padLen = 56 - msgLen % 64 if msgLen % 64 > 56 then padLen = padLen + 64 end if padLen == 0 then padLen = 64 end s = s .. char(128) .. rep(char(0),padLen-1) .. lei2str(8*msgLen) .. lei2str(0) assert(#s % 64 == 0) local t = CONSTS local a,b,c,d = t[65],t[66],t[67],t[68] for i=1,#s,64 do local X = cut_le_str(sub(s,i,i+63),4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4) assert(#X == 16) X[0] = table.remove(X,1) -- zero based! a,b,c,d = transform(a,b,c,d,X) end return format("%08x%08x%08x%08x",swap(a),swap(b),swap(c),swap(d)) end function md5.sum(s) return hex2binary(md5.sumhexa(s)) end return md5
mit
The-HalcyonDays/darkstar
scripts/globals/weaponskills/heavy_swing.lua
30
1339
----------------------------------- -- Heavy Swing -- Staff weapon skill -- Skill Level: 5 -- Deacription:Delivers a single-hit attack. Damage varies with TP. -- Will stack with Sneak Attack. -- Aligned with the Thunder Gorget. -- Aligned with the Thunder Belt. -- Element: None -- Modifiers: STR:30% -- 100%TP 200%TP 300%TP -- 1.00 1.25 2.25 ----------------------------------- require("scripts/globals/status"); require("scripts/globals/settings"); require("scripts/globals/weaponskills"); ----------------------------------- function onUseWeaponSkill(player, target, wsID) local params = {}; params.numHits = 1; params.ftp100 = 1; params.ftp200 = 1.25; params.ftp300 = 2.25; params.str_wsc = 0.3; params.dex_wsc = 0.0; params.vit_wsc = 0.0; params.agi_wsc = 0.0; params.int_wsc = 0.0; params.mnd_wsc = 0.0; params.chr_wsc = 0.0; params.crit100 = 0.0; params.crit200 = 0.0; params.crit300 = 0.0; params.canCrit = false; params.acc100 = 0.0; params.acc200= 0.0; params.acc300= 0.0; params.atkmulti = 1; if (USE_ADOULIN_WEAPON_SKILL_CHANGES == true) then params.str_wsc = 1.0; end local damage, criticalHit, tpHits, extraHits = doPhysicalWeaponskill(player, target, params); damage = damage * WEAPON_SKILL_POWER return tpHits, extraHits, criticalHit, damage; end
gpl-3.0
The-HalcyonDays/darkstar
scripts/globals/mobskills/Spike_Flail.lua
7
1247
--------------------------------------------------- -- Spike Flail -- Deals extreme damage in a threefold attack to targets behind the user. --------------------------------------------------- require("scripts/globals/settings"); require("scripts/globals/status"); require("scripts/globals/monstertpmoves"); --------------------------------------------------- function onMobSkillCheck(target,mob,skill) if (mob:hasStatusEffect(EFFECT_MIGHTY_STRIKES)) then return 1; elseif (mob:hasStatusEffect(EFFECT_SUPER_BUFF)) then return 1; elseif (mob:hasStatusEffect(EFFECT_INVINCIBLE)) then return 1; elseif (mob:hasStatusEffect(EFFECT_BLOOD_WEAPON)) then return 1; elseif(target:isBehind(mob, 48) == false) then return 1; elseif (mob:AnimationSub() == 1) then return 1; end return 0; end; function onMobWeaponSkill(target, mob, skill) local numhits = 1; local accmod = 2; local dmgmod = math.random(5,7); local info = MobPhysicalMove(mob,target,skill,numhits,accmod,dmgmod,TP_DMG_VARIES,2,3,4); local dmg = MobFinalAdjustments(info.dmg,mob,skill,target,MOBSKILL_PHYSICAL,MOBPARAM_SLASH,MOBPARAM_3_SHADOW); target:delHP(dmg); return dmg; end;
gpl-3.0
zhaozg/luvit
tests/test-http-encoder.lua
14
3883
--[[ Copyright 2014 The Luvit Authors. All Rights Reserved. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS-IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. --]] local encoder = require('http-codec').encoder local deepEqual = require('deep-equal') local function testEncoder(encoder, inputs) local outputs = {} local encode = encoder() for i = 1, #inputs + 1 do local chunk = encode(inputs[i]) if chunk and #chunk > 0 then outputs[#outputs + 1] = chunk end end return outputs end require('tap')(function (test) test("server encoder", function () local output = testEncoder(encoder, { { code = 200 } }) p(output) assert(deepEqual({ "HTTP/1.1 200 OK\r\n\r\n" }, output)) end) test("server encoder - Keepalive", function () local output = testEncoder(encoder, { { code = 200, {"Content-Length", 12} }, "Hello World\n", "", { code = 304 }, }) p(output) assert(deepEqual({ "HTTP/1.1 200 OK\r\nContent-Length: 12\r\n\r\n", "Hello World\n", "HTTP/1.1 304 Not Modified\r\n\r\n", }, output)) end) test("server encoder - Chunked Encoding, explicit end", function () local output = testEncoder(encoder, { { code = 200, {"Transfer-Encoding", "chunked"} }, "Hello World\n", "Another Chunk", "", { code = 304 }, }) p(output) assert(deepEqual({ "HTTP/1.1 200 OK\r\nTransfer-Encoding: chunked\r\n\r\n", "c\r\nHello World\n\r\n", "d\r\nAnother Chunk\r\n", "0\r\n\r\n", "HTTP/1.1 304 Not Modified\r\n\r\n", }, output)) end) test("server encoder - Chunked Encoding, auto end", function () local output = testEncoder(encoder, { { code = 200, {"Transfer-Encoding", "chunked"} }, "Hello World\n", "Another Chunk", }) p(output) assert(deepEqual({ "HTTP/1.1 200 OK\r\nTransfer-Encoding: chunked\r\n\r\n", "c\r\nHello World\n\r\n", "d\r\nAnother Chunk\r\n", "0\r\n\r\n", }, output)) end) test("server encoder - Chunked Encoding, auto keepalive end", function () local output = testEncoder(encoder, { { code = 200, {"Transfer-Encoding", "chunked"} }, "Hello World\n", "Another Chunk", { code = 304 }, }) p(output) assert(deepEqual({ "HTTP/1.1 200 OK\r\nTransfer-Encoding: chunked\r\n\r\n", "c\r\nHello World\n\r\n", "d\r\nAnother Chunk\r\n", "0\r\n\r\nHTTP/1.1 304 Not Modified\r\n\r\n", }, output)) end) test("client encoder", function () local output = testEncoder(encoder, { { method = "GET", path = "/my-resource", {"Accept", "*/*"} }, "", { method = "GET", path = "/favicon.ico", {"Accept", "*/*"} }, { method = "GET", path = "/orgs/luvit", {"User-Agent", "Luvit Unit Tests"}, {"Host", "api.github.com"}, {"Accept", "*/*"}, {"Authorization", "token 6d2fc6ae08215d69d693f5ca76ea87c7780a4275"}, } }) p(output) assert(deepEqual({ "GET /my-resource HTTP/1.1\r\nAccept: */*\r\n\r\n", "GET /favicon.ico HTTP/1.1\r\nAccept: */*\r\n\r\n", "GET /orgs/luvit HTTP/1.1\r\nUser-Agent: Luvit Unit Tests\r\nHost: api.github.com\r\nAccept: */*\r\nAuthorization: token 6d2fc6ae08215d69d693f5ca76ea87c7780a4275\r\n\r\n" }, output)) end) end)
apache-2.0
The-HalcyonDays/darkstar
scripts/globals/items/burning_cesti.lua
16
1030
----------------------------------------- -- ID: 16398 -- Item: Burning Cesti -- Additional Effect: Fire Damage ----------------------------------------- require("scripts/globals/status"); require("scripts/globals/magic"); ----------------------------------- -- onAdditionalEffect Action ----------------------------------- function onAdditionalEffect(player,target,damage) local chance = 5; if (math.random(0,99) >= chance) then return 0,0,0; else local dmg = math.random(3,10); local params = {}; params.bonusmab = 0; params.includemab = false; dmg = addBonusesAbility(player, ELE_FIRE, target, dmg, params); dmg = dmg * applyResistanceAddEffect(player,target,ELE_FIRE,0); dmg = adjustForTarget(target,dmg,ELE_FIRE); dmg = finalMagicNonSpellAdjustments(player,target,ELE_FIRE,dmg); local message = 163; if (dmg < 0) then message = 167; end return SUBEFFECT_FIRE_DAMAGE,message,dmg; end end;
gpl-3.0
The-HalcyonDays/darkstar
scripts/zones/The_Garden_of_RuHmet/Zone.lua
9
11407
----------------------------------- -- -- Zone: The_Garden_of_RuHmet (35) -- ----------------------------------- package.loaded["scripts/zones/The_Garden_of_RuHmet/TextIDs"] = nil; ----------------------------------- require("scripts/globals/settings"); require("scripts/zones/The_Garden_of_RuHmet/TextIDs"); require("scripts/zones/The_Garden_of_RuHmet/MobIDs"); require("scripts/globals/missions"); require("scripts/globals/keyitems"); ----------------------------------- -- onInitialize ----------------------------------- function onInitialize(zone) zone:registerRegion(1, -421, -2, 377, -417, 0, 381); -- RDC zone:registerRegion(2, -422, -2, -422, -418, 0, -418); -- +1 zone:registerRegion(3, 418, -2, 378, 422, 0, 382); -- +2 zone:registerRegion(4, -506,-4,697, -500,4,703);--hume niv 0 150 vers niv 1 zone:registerRegion(5, -507,-4,-103, -501,4,-97);--hume niv 1 158 vers niv 0 zone:registerRegion(6, -339,-4,-103, -332,4,-97);--hume niv 1 159 vers niv 2 zone:registerRegion(7, 501,-4,697, 507,4,702);--hume niv 2 169 vers niv 1 zone:registerRegion(8, 332,-4,696, 339,4,702);--hume niv 2 168 vers niv 3 zone:registerRegion(9, 332,-4,-102, 338,4,-97);--hume niv 3 178 vers niv 2 zone:registerRegion(10, -102,-4,541, -96,4,546);--elvaan niv 0 151 vers niv 1 zone:registerRegion(11, -103,-4,-259, -96,4,-252);--elvaan niv 1 160 vers niv 0 zone:registerRegion(12, -103,-4,-427, -67,4,-420);--elvaan niv 1 161 vers niv 2 zone:registerRegion(13, 736,-4,372, 742,4,379);--elvaan niv 2 171 vers niv 1 zone:registerRegion(14, 736,-4,540, 743,4,546);--elvaan niv 2 170 vers niv 3 zone:registerRegion(15, 737,-4,-259, 743,4,-252);--elvaan niv 3 179 vers niv 2 zone:registerRegion(16, -178,-4,97, -173,4,103);--galka niv 0 152 vers niv 1 zone:registerRegion(17, -178,-4,-703, -173,4,-697);--galka niv 1 162 vers niv 0 zone:registerRegion(18, -347,-4,-703, -340,4,-696);--galka niv 1 163 vers niv 2 zone:registerRegion(19, 492,-4,96, 499,4,103);--galka niv 2 173 vers niv 1 zone:registerRegion(20, 660,-4,96, 667,4,102);--galka niv 2 172 vers niv 3 zone:registerRegion(21, 660,-4,-702, 667,4,-697);--galka niv 3 180 vers niv 2 zone:registerRegion(22, -498,-4,97, -492,4,102);--taru niv 0 153 vers niv 1 zone:registerRegion(23, -499,-4,-703, -492,4,-697);--taru niv 1 164 vers niv 0 zone:registerRegion(24, -667,-4,-703, -661,4,-696);--taru niv 1 165 vers niv 2 zone:registerRegion(25, 172,-4,96, 178,4,102);--taru niv 2 175 vers niv 1 zone:registerRegion(26, 340,-4,97, 347,4,102);--taru niv 2 174 vers niv 3 zone:registerRegion(27, 340,-4,-703, 347,4,-697);--taru niv 3 181 vers niv 2 zone:registerRegion(28, -742,-4,373, -736,4,379);--mithra niv 0 154 vers niv 1 zone:registerRegion(29, -743,-4,-427, -736,4,-421);--mithra niv 1 166 vers niv 0 zone:registerRegion(30, -742,-4,-259, -737,4,-252);--mithra niv 1 167 vers niv 2 zone:registerRegion(31, 97,-4,541, 102,4,547);--mithra niv 2 177 vers niv 1 zone:registerRegion(32, 97,-4,372, 102,4,379);--mithra niv 2 176 vers niv 3 zone:registerRegion(33, 97,-4,-427, 102,4,-421);--mithra niv 3 182 vers niv 2 -- Give the Fortitude ??? a random spawn local qm1 = GetNPCByID(Jailer_of_Fortitude_QM); local qm1position = math.random(1,5); qm1:setPos(Jailer_of_Fortitude_QM_POS[qm1position][1], Jailer_of_Fortitude_QM_POS[qm1position][2], Jailer_of_Fortitude_QM_POS[qm1position][3]); --Give the Faith ??? a random spawn local qm3 = GetNPCByID(Jailer_of_Faith_QM); local qm3position = math.random(1,5); qm3:setPos(Jailer_of_Faith_QM_POS[qm3position][1], Jailer_of_Faith_QM_POS[qm3position][2], Jailer_of_Faith_QM_POS[qm3position][3]); end; ----------------------------------- -- onGameHour ----------------------------------- function onGameHour(npc, mob, player) local VanadielHour = VanadielHour(); local qm2 = GetNPCByID(16921028); -- Jailer of Faith local qm3 = GetNPCByID(16921029); -- Ix'aern drk local s = math.random(6,12) -- wait time till change to next spawn pos, random 15~30 mins. -- Jailer of Fortitude spawn randomiser if (VanadielHour % 6 == 0) then local qm1 = GetNPCByID(Jailer_of_Fortitude_QM); qm1:hideNPC(60); local qm1position = math.random(1,5); qm1:setPos(Jailer_of_Fortitude_QM_POS[qm1position][1], Jailer_of_Fortitude_QM_POS[qm1position][2], Jailer_of_Fortitude_QM_POS[qm1position][3]); end -- Jailer of Faith spawn randomiser if (VanadielHour % s == 0) then -- Get the ??? NPC local qm3 = GetNPCByID(Jailer_of_Faith_QM); -- Hide it for 60 seconds qm3:hideNPC(60); -- Get a new random position from the possible places local qm3position = math.random(1,5); -- Set the new ??? place qm3:setPos(Jailer_of_Faith_QM_POS[qm3position][1], Jailer_of_Faith_QM_POS[qm3position][2], Jailer_of_Faith_QM_POS[qm3position][3]); end --[[ -- Ix'DRK spawn randomiser if(VanadielHour % 6 == 0) then -- Change ??? position every 6 hours Vana'diel time (~15 mins) local qm2p = math.random(1,4); -- random for next @pos. -- start in spawn pos 1. --print(qm2p) qm3:hideNPC(30); if (qm2p == 1) then qm2:setPos(-240,5.00,440); -- spawn point 1 "Hume-Elvaan" SetServerVariable("[POSI]Ix_aern_drk",1); --printf("Qm2 is at pos 1"); elseif (qm2p == 2) then qm2:setPos(-280,5.00,240); -- spawn point 2 "Elvaan-Galka" SetServerVariable("[POSI]Ix_aern_drk",2); --printf("Qm2 is at pos 2"); elseif (qm2p == 3) then qm2:setPos(-560,5.00,239); -- spawn point 3 "Taru-Mithra" SetServerVariable("[POSI]Ix_aern_drk",3); --printf("Qm2 is at pos 3"); elseif (qm2p == 4) then qm2:setPos(-600,5.00,440); -- spawn point 4 "Mithra-Hume" SetServerVariable("[POSI]Ix_aern_drk",4); --printf("Qm2 is at pos 4"); end end ]]-- end; ----------------------------------- -- onConquestUpdate ----------------------------------- function onConquestUpdate(zone, updatetype) local players = zone:getPlayers(); for name, player in pairs(players) do conquestUpdate(zone, player, updatetype, CONQUEST_BASE); end end; ----------------------------------- -- onZoneIn ----------------------------------- function onZoneIn(player,prevZone) local cs = -1; if ((player:getXPos() == 0) and (player:getYPos() == 0) and (player:getZPos() == 0)) then player:setPos(-351.136,-2.25,-380,253); end if(player:getCurrentMission(COP) == WHEN_ANGELS_FALL and player:getVar("PromathiaStatus")==0)then cs = 0x00C9 ; end player:setVar("Ru-Hmet-TP",0); return cs; end; ----------------------------------- -- onRegionEnter ----------------------------------- function onRegionEnter(player,region) if(player:getVar("Ru-Hmet-TP")==0 and player:getAnimation()==0)then switch (region:GetRegionID()): caseof { [1] = function (x) if(player:getCurrentMission(COP)==DAWN or player:hasCompletedMission(COP,DAWN) or player:hasCompletedMission(COP,THE_LAST_VERSE) )then player:startEvent(0x0065); else player:startEvent(0x009B); end end, --101 [2] = function (x) if(player:hasKeyItem(BRAND_OF_DAWN) and player:hasKeyItem(BRAND_OF_TWILIGHT))then player:startEvent(0x009C); else player:startEvent(0x00B7); end end, --102 [3] = function (x) player:startEvent(0x0067); end, --103 [4] = function (x) player:startEvent(0x0096);end,--hume niv 0 150 vers niv 1 [5] = function (x) player:startEvent(0x009E);end,--hume niv 1 158 vers niv 0 [6] = function (x) player:startEvent(0x009F);end,--hume niv 1 159 vers niv 2 [7] = function (x) player:startEvent(0x00A9);end,--hume niv 2 169 vers niv 1 [8] = function (x) player:startEvent(0x00A8);end,--hume niv 2 168 vers niv 3 [9] = function (x) player:startEvent(0x00B2);end,--hume niv 3 178 vers niv 2 [10] = function (x) player:startEvent(0x0097);end,--elvaan niv 0 151 vers niv 1 [11] = function (x) player:startEvent(0x00A0);end,--elvaan niv 1 160 vers niv 0 [12] = function (x) player:startEvent(0x00A1);end,--elvaan niv 1 161 vers niv 2 [13] = function (x) player:startEvent(0x00AB);end,--elvaan niv 2 171 vers niv 1 [14] = function (x) player:startEvent(0x00AA);end,--elvaan niv 2 170 vers niv 3 [15] = function (x) player:startEvent(0x00B3);end,--elvaan niv 3 179 vers niv 2 [16] = function (x) player:startEvent(0x0098);end,--galka niv 0 152 vers niv 1 [17] = function (x) player:startEvent(0x00A2);end,--galka niv 1 162 vers niv 0 [18] = function (x) player:startEvent(0x00A3);end,--galka niv 1 163 vers niv 2 [19] = function (x) player:startEvent(0x00AD);end,--galka niv 2 173 vers niv 1 [20] = function (x) player:startEvent(0x00AC);end,--galka niv 2 172 vers niv 3 [21] = function (x) player:startEvent(0x00B4);end,--galka niv 3 180 vers niv 2 [22] = function (x) player:startEvent(0x0099);end,--taru niv 0 153 vers niv 1 [23] = function (x) player:startEvent(0x00A4);end,--taru niv 1 164 vers niv 0 [24] = function (x) player:startEvent(0x00A5);end,--taru niv 1 165 vers niv 2 [25] = function (x) player:startEvent(0x00AF);end,--taru niv 2 175 vers niv 1 [26] = function (x) player:startEvent(0x00AE);end,--taru niv 2 174 vers niv 3 [27] = function (x) player:startEvent(0x00B5);end,--taru niv 3 181 vers niv 2 [28] = function (x) player:startEvent(0x009A);end,--mithra niv 0 154 vers niv 1 [29] = function (x) player:startEvent(0x00A6);end,--mithra niv 1 166 vers niv 0 [30] = function (x) player:startEvent(0x00A7);end,--mithra niv 1 167 vers niv 2 [31] = function (x) player:startEvent(0x00B1);end,--mithra niv 2 177 vers niv 1 [32] = function (x) player:startEvent(0x00B0);end,--mithra niv 2 176 vers niv 3 [33] = function (x) player:startEvent(0x00B6);end,--mithra niv 3 182 vers niv 2 } end end; ----------------------------------- -- onRegionLeave ----------------------------------- function onRegionLeave(player,region) end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); if((csid >0x0095 and csid < 0x00B8)or csid ==0x0066 or csid ==0x0067 or csid ==0x0065)then player:setVar("Ru-Hmet-TP",1); end end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); if(csid == 0x0065 and option == 1) then player:setPos(540,-1,-499.900,62,0x24); player:setVar("Ru-Hmet-TP",0); elseif((csid >0x0095 and csid < 0x00B8)or csid ==0x0066 or csid ==0x0067 or csid == 0x0065 )then player:setVar("Ru-Hmet-TP",0); elseif(csid ==0x00C9)then player:setVar("PromathiaStatus",1); end if(csid == 0x7d00 and option==1)then player:setPos(420,0,398,68); end end;
gpl-3.0
The-HalcyonDays/darkstar
scripts/zones/East_Ronfaure_[S]/npcs/qm5.lua
27
1615
----------------------------------- -- Area: East Ronfaure [S] -- NPC: qm5 "???" -- Involved in Quests: Steamed Rams -- @pos 380.015 -26.5 -22.525 ----------------------------------- package.loaded["scripts/zones/East_Ronfaure_[S]/TextIDs"] = nil; ----------------------------------- require("scripts/globals/keyitems"); require("scripts/globals/campaign"); require("scripts/zones/East_Ronfaure_[S]/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) if (player:getQuestStatus(CRYSTAL_WAR,STEAMED_RAMS) == QUEST_ACCEPTED) then if (player:hasKeyItem(OXIDIZED_PLATE)) then player:messageSpecial(NOTHING_OUT_OF_ORDINARY); else player:startEvent(0x0003); end else player:messageSpecial(NOTHING_OUT_OF_ORDINARY); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish Action ----------------------------------- function onEventFinish(player,csid,option) -- print("CSID:",csid); -- print("RESULT:",option); if (csid == 0x0003) then player:addKeyItem(OXIDIZED_PLATE); player:messageSpecial(KEYITEM_OBTAINED,OXIDIZED_PLATE); end end;
gpl-3.0
The-HalcyonDays/darkstar
scripts/globals/items/bowl_of_sunset_soup.lua
35
1498
----------------------------------------- -- ID: 4341 -- Item: bowl_of_sunset_soup -- Food Effect: 4Hrs, All Races ----------------------------------------- -- Agility 3 -- Vitality -1 -- HP Recovered While Healing 5 -- Ranged Accuracy % 9 (cap 20) ----------------------------------------- require("scripts/globals/status"); ----------------------------------------- -- OnItemCheck ----------------------------------------- function onItemCheck(target) local result = 0; if (target:hasStatusEffect(EFFECT_FOOD) == true or target:hasStatusEffect(EFFECT_FIELD_SUPPORT_FOOD) == true) then result = 246; end return result; end; ----------------------------------------- -- OnItemUse ----------------------------------------- function onItemUse(target) target:addStatusEffect(EFFECT_FOOD,0,0,14400,4341); end; ----------------------------------------- -- onEffectGain Action ----------------------------------------- function onEffectGain(target,effect) target:addMod(MOD_AGI, 3); target:addMod(MOD_VIT, -1); target:addMod(MOD_HPHEAL, 5); target:addMod(MOD_FOOD_RACCP, 9); target:addMod(MOD_FOOD_RACC_CAP, 20); end; ----------------------------------------- -- onEffectLose Action ----------------------------------------- function onEffectLose(target,effect) target:delMod(MOD_AGI, 3); target:delMod(MOD_VIT, -1); target:delMod(MOD_HPHEAL, 5); target:delMod(MOD_FOOD_RACCP, 9); target:delMod(MOD_FOOD_RACC_CAP, 20); end;
gpl-3.0
The-HalcyonDays/darkstar
scripts/zones/Dynamis-Beaucedine/mobs/Goblin_Statue.lua
15
3353
----------------------------------- -- Area: Dynamis Beaucedine -- NPC: Goblin Statue -- Map Position: http://images1.wikia.nocookie.net/__cb20090312005233/ffxi/images/thumb/b/b6/Bea.jpg/375px-Bea.jpg ----------------------------------- package.loaded["scripts/zones/Dynamis-Beaucedine/TextIDs"] = nil; ----------------------------------- require("scripts/globals/dynamis"); require("scripts/zones/Dynamis-Beaucedine/TextIDs"); ----------------------------------- -- onMobSpawn Action ----------------------------------- function onMobSpawn(mob) mob:setMobMod(MOBMOD_SUPERLINK, mob:getShortID()); end; ----------------------------------- -- onMobEngaged ----------------------------------- function onMobEngaged(mob,target) local X = mob:getXPos(); local Y = mob:getYPos(); local Z = mob:getZPos(); local spawnList = beaucedineGoblinList; if(mob:getStatPoppedMobs() == false) then mob:setStatPoppedMobs(true); for nb = 1, table.getn(spawnList), 2 do if(mob:getID() == spawnList[nb]) then for nbi = 1, table.getn(spawnList[nb + 1]), 1 do if((nbi % 2) == 0) then X=X+2; Z=Z+2; else X=X-2; Z=Z-2; end local mobNBR = spawnList[nb + 1][nbi]; if(mobNBR <= 20) then if(mobNBR == 0) then mobNBR = math.random(1,15); end -- Spawn random Vanguard (TEMPORARY) local DynaMob = getDynaMob(target,mobNBR,2); if(DynaMob ~= nil) then -- Spawn Mob SpawnMob(DynaMob):setMobMod(MOBMOD_SUPERLINK, mob:getShortID()); GetMobByID(DynaMob):setPos(X,Y,Z); GetMobByID(DynaMob):setSpawn(X,Y,Z); -- Spawn Pet for BST, DRG, and SMN if(mobNBR == 9 or mobNBR == 15) then SpawnMob(DynaMob + 1):setMobMod(MOBMOD_SUPERLINK, mob:getShortID()); GetMobByID(DynaMob + 1):setPos(X,Y,Z); GetMobByID(DynaMob + 1):setSpawn(X,Y,Z); end end elseif(mobNBR > 20) then SpawnMob(mobNBR):setMobMod(MOBMOD_SUPERLINK, mob:getShortID()); local MJob = GetMobByID(mobNBR):getMainJob(); if(MJob == 9 or MJob == 15) then -- Spawn Pet for BST, DRG, and SMN SpawnMob(mobNBR + 1):setMobMod(MOBMOD_SUPERLINK, mob:getShortID()); GetMobByID(mobNBR + 1):setPos(X,Y,Z); GetMobByID(mobNBR + 1):setSpawn(X,Y,Z); end end end end end end end; ----------------------------------- -- onMobDeath ----------------------------------- function onMobDeath(mob,killer) local mobID = mob:getID(); -- Time Bonus: 031 046 if(mobID == 17326860 and mob:isInBattlefieldList() == false) then killer:addTimeToDynamis(15); mob:addInBattlefieldList(); elseif(mobID == 17326875 and mob:isInBattlefieldList() == false) then killer:addTimeToDynamis(15); mob:addInBattlefieldList(); -- HP Bonus: 037 041 044 051 053 elseif(mobID == 17326866 or mobID == 17326870 or mobID == 17326873 or mobID == 17326880 or mobID == 17326882) then killer:restoreHP(2000); killer:messageBasic(024,(killer:getMaxHP()-killer:getHP())); -- MP Bonus: 038 040 045 049 052 104 elseif(mobID == 17326867 or mobID == 17326869 or mobID == 17326874 or mobID == 17326878 or mobID == 17326881 or mobID == 17326933) then killer:restoreMP(2000); killer:messageBasic(025,(killer:getMaxMP()-killer:getMP())); end end;
gpl-3.0
The-HalcyonDays/darkstar
scripts/globals/mobskills/Foxfire.lua
7
1177
--------------------------------------------- -- Foxfire -- -- Description: Damage varies with TP. Additional effect: "Stun." -- Type: Physical (Blunt) -- RDM, THF, PLD, BST, BRD, RNG, NIN, and COR fomors). -- --------------------------------------------- require("scripts/globals/settings"); require("scripts/globals/status"); require("scripts/globals/monstertpmoves"); --------------------------------------------- function onMobSkillCheck(target,mob,skill) local job = mob:getMainJob(); if(job == JOB_RDM or job == JOB_THF or job == JOB_PLD or job == JOB_BST or job == JOB_RNG or job == JOB_BRD or job == JOB_NIN or job == JOB_COR) then return 0; end return 1; end; function onMobWeaponSkill(target, mob, skill) local numhits = 1; local accmod = 1; local dmgmod = 2.6; local info = MobPhysicalMove(mob,target,skill,numhits,accmod,dmgmod,TP_DMG_VARIES,1,2,3); local dmg = MobFinalAdjustments(info.dmg,mob,skill,target,MOBSKILL_PHYSICAL,MOBPARAM_BLUNT,info.hitslanded); local typeEffect = EFFECT_STUN; MobPhysicalStatusEffectMove(mob, target, skill, typeEffect, 1, 0, 6); target:delHP(dmg); return dmg; end;
gpl-3.0
kesor/wow-binder
Priest.lua
1
3542
local _, Binder = ... local m1 = Binder.m1 -- Modifier.lua local m2 = Binder.m2 -- Modifier.lua Binder.priest = {} Binder.priest["macros"] = { ["Mind Sear"] = "#showtooltip Mind Sear\n/cast [nochanneling: Mind Sear] Mind Sear", ["Mass Dispel"] = "#showtooltip Mass Dispel\n/cast !Mass Dispel", ["Lightwell"] = "#showtooltip Lightwell\n/cast !Lightwell", ["Mind Flay"] = "#showtooltip Mind Flay\n/cast [nochanneling: Mind Flay] Mind Flay", } Binder.priest["keybinds"] = { ["Fear Ward"] = { key = "`" }, ["Smite"] = { key = "1" }, ["Holy Fire"] = { key = "2" }, ["Mind Spike"] = { key = "3" }, ["Mind Blast"] = { key = "4" }, ["Shadow Word: Death"] = { key = "5" }, ["Greater Heal"] = { key = "C" }, ["Mind Control"] = { key = "F" }, ["Divine Hymn"] = { key = "H" }, ["Prayer of Mending"] = { key = "R" }, ["Fade"] = { key = "T" }, ["Flash Heal"] = { key = "V" }, ["Heal"] = { key = "X" }, ["Leap of Faith"] = { key = "Z" }, ["Mind Sear"] = { key = m1.."4" }, ["Mind Soothe"] = { key = m1.."A" }, ["Mind Vision"] = { key = m1.."C" }, ["Inner Fire"] = { key = m1.."E" }, ["Prayer of Healing"] = { key = m1.."F" }, ["Power Word: Fortitude"] = { key = m1.."G" }, ["Inner Will"] = { key = m1.."Q" }, ["Hymn of Hope"] = { key = m1.."R" }, ["Shackle Undead"] = { key = m1.."S" }, ["Shadowfiend"] = { key = m1.."X" }, ["Cure Disease"] = { key = m2.."2" }, ["Archangel"] = { key = m2.."3" }, ["Holy Nova"] = { key = m2.."4" }, ["Levitate"] = { key = m2.."5" }, ["Mana Burn"] = { key = m2.."A" }, ["Renew"] = { key = m2.."C" }, ["Devouring Plague"] = { key = m2.."D" }, ["Dispel Magic"] = { key = m2.."E" }, ["Psychic Scream"] = { key = m2.."F" }, ["Shadow Protection"] = { key = m2.."G" }, ["Resurrection"] = { key = m2.."L" }, ["Power Word: Shield"] = { key = m2.."R" }, ["Shadow Word: Pain"] = { key = m2.."S" }, ["Desperate Prayer"] = { key = m2.."T" }, ["Mass Dispel"] = { key = m2.."V" }, ["Binding Heal"] = { key = m2.."X" }, } Binder.priest["shadow keybinds"] = { ["Psychic Horror"] = { key = "6" }, ["Silence"] = { key = "E" }, ["Mind Flay"] = { key = "Q" }, ["Shadowform"] = { key = m1.."W" }, ["Vampiric Touch"] = { key = m2.."Q" }, ["Vampiric Embrace"] = { key = m2.."T" }, ["Dispersion"] = { key = m2.."Z" }, } Binder.priest["holy keybinds"] = { ["Lightwell"] = { key = "6" }, ["Holy Word: Chastise"] = { key = "E" }, ["Circle of Healing"] = { key = "Q" }, ["Chakra"] = { key = m2.."Q" }, ["Guardian Spirit"] = { key = m2.."Z" }, } Binder.priest["discipline keybinds"] = { ["Inner Focus"] = { key = "6" }, ["Power Word: Barrier"] = { key = "E" }, ["Penance"] = { key = "Q" }, ["Power Infusion"] = { key = m2.."Q" }, ["Pain Suppression"] = { key = m2.."Z" }, }
bsd-3-clause
The-HalcyonDays/darkstar
scripts/zones/Periqia/IDs.lua
49
3842
Periqia = { text = { -- General Texts ITEM_CANNOT_BE_OBTAINED = 6378, -- You cannot obtain the item <item> come back again after sorting your inventory ITEM_OBTAINED = 6381, -- Obtained: <item> GIL_OBTAINED = 6384, -- Obtained <number> gil KEYITEM_OBTAINED = 6384, -- Obtained key item: <keyitem> -- Assault Texts ASSAULT_31_START = 7447, ASSAULT_32_START = 7448, ASSAULT_33_START = 7449, ASSAULT_34_START = 7450, ASSAULT_35_START = 7451, ASSAULT_36_START = 7452, ASSAULT_37_START = 7453, ASSAULT_38_START = 7454, ASSAULT_39_START = 7455, ASSAULT_40_START = 7456, TIME_TO_COMPLETE = 7477, MISSION_FAILED = 7478, RUNE_UNLOCKED_POS = 7479, RUNE_UNLOCKED = 7480, ASSAULT_POINTS_OBTAINED = 7481, TIME_REMAINING_MINUTES = 7482, TIME_REMAINING_SECONDS = 7483, PARTY_FALLEN = 7485, -- Seagull Grounded EXCALIACE_START = 7494, EXCALIACE_END1 = 7495, EXCALIACE_END2 = 7496, EXCALIACE_ESCAPE = 7497, EXCALIACE_PAIN1 = 7498, EXCALIACE_PAIN2 = 7499, EXCALIACE_PAIN3 = 7500, EXCALIACE_PAIN4 = 7501, EXCALIACE_PAIN5 = 7502, EXCALIACE_CRAB1 = 7503, EXCALIACE_CRAB2 = 7504, EXCALIACE_CRAB3 = 7505, EXCALIACE_DEBAUCHER1 = 7506, EXCALIACE_DEBAUCHER2 = 7507, EXCALIACE_RUN = 7508, EXCALIACE_TOO_CLOSE = 7509, EXCALIACE_TIRED = 7510, EXCALIACE_CAUGHT = 7511, }, mobs = { -- Seagull Grounded [31] = { CRAB1 = 17006594, CRAB2 = 17006595, CRAB3 = 17006596, CRAB4 = 17006597, CRAB5 = 17006598, CRAB6 = 17006599, CRAB7 = 17006600, CRAB8 = 17006601, CRAB9 = 17006602, DEBAUCHER1 = 17006603, PUGIL1 = 17006604, PUGIL2 = 17006605, PUGIL3 = 17006606, PUGIL4 = 17006607, PUGIL5 = 17006608, DEBAUCHER2 = 17006610, DEBAUCHER3 = 17006611, } }, npcs = { EXCALIACE = 17006593, ANCIENT_LOCKBOX = 17006809, RUNE_OF_RELEASE = 17006810, _1K1 = 17006836, _1K2 = 17006837, _1K3 = 17006838, _1K4 = 17006839, _1K5 = 17006840, _1K6 = 17006841, _1K7 = 17006842, _1K8 = 17006843, _1K9 = 17006844, _1KA = 17006845, _1KB = 17006846, _1KC = 17006847, _1KD = 17006848, _1KE = 17006849, _1KF = 17006850, _1KG = 17006851, _1KH = 17006852, _1KI = 17006853, _1KJ = 17006854, _1KK = 17006855, _1KL = 17006856, _1KM = 17006857, _1KN = 17006858, _1KO = 17006859, _1KP = 17006860, _1KQ = 17006861, _1KR = 17006862, _1KS = 17006863, _1KT = 17006864, _1KU = 17006865, _1KV = 17006866, _1KW = 17006867, _1KX = 17006868, _1KY = 17006869, _1KZ = 17006870, _JK0 = 17006871, _JK1 = 17006872, _JK2 = 17006873, _JK3 = 17006874, _JK4 = 17006875, _JK5 = 17006876, _JK6 = 17006877, _JK7 = 17006878, _JK8 = 17006879, _JK9 = 17006880, _JKA = 17006881, _JKB = 17006882, _JKC = 17006883, _JKD = 17006884, _JKE = 17006885, _JKF = 17006886, _JKG = 17006887, _JKH = 17006888, _JKI = 17006889, _JKJ = 17006890, _JKK = 17006891, _JKL = 17006892, _JKM = 17006893, _JKN = 17006894, _JKO = 17006895, } }
gpl-3.0
The-HalcyonDays/darkstar
scripts/zones/Al_Zahbi/npcs/Suldiran.lua
17
1811
----------------------------------- -- Area: Al Zahbi -- NPC: Suldiran -- Type: NPC Quest -- @zone: 48 -- @pos 41.658 -6.999 -42.528 -- -- Auto-Script: Requires Verification (Verified by Brawndo) ----------------------------------- package.loaded["scripts/zones/Al_Zahbi/TextIDs"] = nil; require("scripts/globals/quests"); require("scripts/globals/settings"); require("scripts/globals/titles"); require("scripts/zones/Al_Zahbi/TextIDs"); ----------------------------------- ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) if(player:getQuestStatus(AHT_URHGAN,FEAR_OF_THE_DARK_II) ~= QUEST_AVAILABLE) then if(trade:hasItemQty(2163,2) and trade:getItemCount() == 2) then player:startEvent(0x0010); end end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) if(player:getQuestStatus(AHT_URHGAN,FEAR_OF_THE_DARK_II) == QUEST_AVAILABLE) then player:startEvent(0x000e); else player:startEvent(0x000f); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) if(csid == 0x000e and option == 1) then player:addQuest(AHT_URHGAN,FEAR_OF_THE_DARK_II); elseif(csid == 0x0010) then player:tradeComplete(); player:addGil(GIL_RATE*200); player:messageSpecial(GIL_OBTAINED,GIL_RATE*200); player:addTitle(DARK_RESISTANT); if(player:getQuestStatus(AHT_URHGAN,FEAR_OF_THE_DARK_II) == QUEST_ACCEPTED)then player:completeQuest(AHT_URHGAN,FEAR_OF_THE_DARK_II); end end end;
gpl-3.0
otservme/global1053
data/movements/scripts/pits of inferno quest/pitsOfInfernoQuestThrones.lua
1
1275
local thrones = { [2080] = {text = "You have touched Infernatil's throne and absorbed some of his spirit.", animation = CONST_ME_FIRE}, [2081] = {text = "You have touched Tafariel's throne and absorbed some of his spirit.'", animation = CONST_ME_DEATH}, [2082] = {text = "You have touched Verminor's throne and absorbed some of his spirit.", animation = CONST_ME_POISON}, [2083] = {text = "You have touched Apocalypse's throne and absorbed some of his spirit.", animation = CONST_ME_EXPLOSION}, [2084] = {text = "You have touched Bazir's throne and absorbed some of his spirit.", animation = CONST_ME_MAGIC_GREEN}, [2085] = {text = "You have touched Ashfalor's throne and absorbed some of his spirit.", animation = CONST_ME_FIRE}, [2086] = {text = "You have touched Pumin's throne and absorbed some of his spirit.", animation = CONST_ME_DEATH} } function onStepIn(cid, item, position, lastPosition) if(getPlayerStorageValue(cid, item.uid) < 1) then setPlayerStorageValue(cid, item.uid, 1) doSendMagicEffect(position, thrones[item.uid].animation) doCreatureSay(cid, thrones[item.uid].text, TALKTYPE_ORANGE_1) else doPlayerSendTextMessage(cid, MESSAGE_EVENT_ADVANCE, "You've already absorbed energy from this throne.") end return true end
gpl-2.0
The-HalcyonDays/darkstar
scripts/zones/Southern_San_dOria_[S]/npcs/Wyatt.lua
17
1981
----------------------------------- -- Area: Southern SandOria [S] -- NPC: Wyatt -- @zone 80 -- @pos 124 0 84 ----------------------------------- package.loaded["scripts/zones/Southern_San_dOria_[S]/TextIDs"] = nil; ----------------------------------- require("scripts/zones/Southern_San_dOria_[S]/TextIDs"); require("scripts/globals/titles"); require("scripts/globals/quests"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) if (trade:getItemCount() == 4 and trade:hasItemQty(2506,4)) then player:startEvent(0x0004); end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) local seeingSpots = player:getQuestStatus(CRYSTAL_WAR,SEEING_SPOTS); if (seeingSpots == QUEST_AVAILABLE) then player:startEvent(0x0002); elseif (seeingSpots == QUEST_ACCEPTED) then player:startEvent(0x0003); else player:showText(npc, WYATT_DIALOG); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); if (csid == 0x0002) then player:addQuest(CRYSTAL_WAR,SEEING_SPOTS); elseif (csid == 0x0004) then player:tradeComplete(); if(player:getQuestStatus(CRYSTAL_WAR,SEEING_SPOTS) == QUEST_ACCEPTED) then player:addTitle(LADY_KILLER); player:addGil(GIL_RATE*3000); player:messageSpecial(GIL_OBTAINED,GIL_RATE*3000); player:completeQuest(CRYSTAL_WAR,SEEING_SPOTS); else player:addTitle(LADY_KILLER); player:addGil(GIL_RATE*1500); player:messageSpecial(GIL_OBTAINED,GIL_RATE*1500); end end end;
gpl-3.0
The-HalcyonDays/darkstar
scripts/globals/items/salmon_rice_ball.lua
21
1567
----------------------------------------- -- ID: 4590 -- Item: Salmon Rice Ball -- Food Effect: 30Min, All Races ----------------------------------------- -- HP +25 -- Dex +2 -- Vit +2 -- Mnd -1 -- hHP +1 -- Effect with enhancing equipment (Note: these are latents on gear with the effect) -- Atk +40 -- Def +40 ----------------------------------------- require("scripts/globals/status"); ----------------------------------------- -- OnItemCheck ----------------------------------------- function onItemCheck(target) local result = 0; if (target:hasStatusEffect(EFFECT_FOOD) == true or target:hasStatusEffect(EFFECT_FIELD_SUPPORT_FOOD) == true) then result = 246; end return result; end; ----------------------------------------- -- OnItemUse ----------------------------------------- function onItemUse(target) target:addStatusEffect(EFFECT_FOOD,0,0,1800,4590); end; ----------------------------------- -- onEffectGain Action ----------------------------------- function onEffectGain(target,effect) target:addMod(MOD_HP, 25); target:addMod(MOD_DEX, 2); target:addMod(MOD_VIT, 2); target:addMod(MOD_MND, -1); target:addMod(MOD_HPHEAL, 1); end; ----------------------------------------- -- onEffectLose Action ----------------------------------------- function onEffectLose(target,effect) target:delMod(MOD_HP, 25); target:delMod(MOD_DEX, 2); target:delMod(MOD_VIT, 2); target:delMod(MOD_MND, -1); target:delMod(MOD_HPHEAL, 1); end;
gpl-3.0
nvoron23/skia
tools/lua/paths.lua
92
3129
-- -- Copyright 2014 Google Inc. -- -- Use of this source code is governed by a BSD-style license that can be -- found in the LICENSE file. -- -- Path scraping script. -- This script is designed to count the number of times we fall back to software -- rendering for a path in a given SKP. However, this script does not count an exact -- number of uploads, since there is some overlap with clipping: e.g. two clipped paths -- may cause three uploads to the GPU (set clip 1, set clip 2, unset clip 2/reset clip 1), -- but these cases are rare. draws = 0 drawPaths = 0 drawPathsAnti = 0 drawPathsConvexAnti = 0 clips = 0 clipPaths = 0 clipPathsAnti = 0 clipPathsConvexAnti = 0 usedPath = false usedSWPath = false skpsTotal = 0 skpsWithPath = 0 skpsWithSWPath = 0 function sk_scrape_startcanvas(c, fileName) usedPath = false usedSWPath = false end function sk_scrape_endcanvas(c, fileName) skpsTotal = skpsTotal + 1 if usedPath then skpsWithPath = skpsWithPath + 1 if usedSWPath then skpsWithSWPath = skpsWithSWPath + 1 end end end function string.starts(String,Start) return string.sub(String,1,string.len(Start))==Start end function isPathValid(path) if not path then return false end if path:isEmpty() then return false end if path:isRect() then return false end return true end function sk_scrape_accumulate(t) if (string.starts(t.verb, "draw")) then draws = draws + 1 end if (string.starts(t.verb, "clip")) then clips = clips + 1 end if t.verb == "clipPath" then local path = t.path if isPathValid(path) then clipPaths = clipPaths + 1 usedPath = true if t.aa then clipPathsAnti = clipPathsAnti + 1 if path:isConvex() then clipPathsConvexAnti = clipPathsConvexAnti + 1 else usedSWPath = true end end end end if t.verb == "drawPath" then local path = t.path local paint = t.paint if paint and isPathValid(path) then drawPaths = drawPaths + 1 usedPath = true if paint:isAntiAlias() then drawPathsAnti = drawPathsAnti + 1 if path:isConvex() then drawPathsConvexAnti = drawPathsConvexAnti + 1 else usedSWPath = true end end end end end function sk_scrape_summarize() local swDrawPaths = drawPathsAnti - drawPathsConvexAnti local swClipPaths = clipPathsAnti - clipPathsConvexAnti io.write("clips = clips + ", clips, "\n"); io.write("draws = draws + ", draws, "\n"); io.write("clipPaths = clipPaths + ", clipPaths, "\n"); io.write("drawPaths = drawPaths + ", drawPaths, "\n"); io.write("swClipPaths = swClipPaths + ", swClipPaths, "\n"); io.write("swDrawPaths = swDrawPaths + ", swDrawPaths, "\n"); io.write("skpsTotal = skpsTotal + ", skpsTotal, "\n"); io.write("skpsWithPath = skpsWithPath + ", skpsWithPath, "\n"); io.write("skpsWithSWPath = skpsWithSWPath + ", skpsWithSWPath, "\n"); end
bsd-3-clause
Kinathka/gmod_airbase_vehicles
avehicle_heli/lua/entities/avehicle_ch46_rotor/init.lua
1
2574
AddCSLuaFile( "cl_init.lua" ) AddCSLuaFile( "shared.lua" ) include( 'shared.lua' ) function ENT:Initialize() self:SetModel( "models/Flyboi/Ch46/ch46rotorm_fb.mdl" ) --A fix for the physics because the model's is currently bugged. Comment out this section and see below for defautls. --local lowerBound = Vector(10, -250, -5) --local upperBound = Vector(10, 250, 5) --self.Entity:PhysicsInitBox(lowerBound, upperBound) --self.Entity:SetCollisionBounds(lowerBound, upperBound) --self.Entity:SetSolid( SOLID_BBOX ) --self:SetSolid( SOLID_VPHYSICS ) --Default model physics. Commented self:PhysicsInit( SOLID_VPHYSICS ) self:SetSolid( SOLID_VPHYSICS ) self:SetMoveType( MOVETYPE_VPHYSICS ) --self:SetMoveType( MOVETYPE_FLY ) if IsValid(self.Heli) then self:SetOwner(self.Heli) end self.ActiveAngleSpeed = 400 self.ImpactSound = CreateSound(self, "npc/manhack/grind5.wav") self.PhysObj = self:GetPhysicsObject() if ( self.PhysObj:IsValid() ) then self.PhysObj:EnableGravity(true) self.PhysObj:EnableDrag(true) self.PhysObj:SetMass(1000) --self.PhysObj:SetDamping(0,10.0) self.PhysObj:Wake() end self.IsAVehicleObject = true end function ENT:PhysicsCollide( data, physobj ) if ( data.Speed > 350 && data.DeltaTime > 0.2 ) then if IsValid(self.Heli) then if( data.Speed > 12500 ) then self.Heli:DamageHurt(8000, "rotor") end for i =1, 6 do local e = EffectData() e:SetOrigin( data.HitPos ) e:SetNormal( data.HitNormal + Vector( math.random(-12,12), math.random(-12,12), 4 ) ) e:SetScale( 20 ) util.Effect("ManhackSparks", e) self.ImpactSound:PlayEx( 1.0, math.random( 100, 120 ) ) end if IsValid(data.HitEntity) and (data.HitEntity:IsWorld() or data.HitEntity:GetClass() == "worldspawn") then self.Heli:DamageHurt(4000, "rotor") end if IsValid(data.HitEntity) and not (data.HitEntity:IsNPC() or data.HitEntity:IsPlayer()) then if IsValid(physobj) and !physobj:IsMoveable() then self.Heli:DamageHurt(math.random(50,physobj:GetMass()/10), "rotor") elseif IsValid(physobj) then self.Heli:DamageHurt(math.random(1,physobj:GetMass()/50), "rotor") end end end else self.ImpactSound:FadeOut( 0.25 ) end end function ENT:Think() local phys = self:GetPhysicsObject() if phys and phys:IsValid() then if phys:GetAngleVelocity():Length() > self.ActiveAngleSpeed then self:SetNWBool("rotor_online", true) else self:SetNWBool("rotor_online", false) end end self.Entity:NextThink( CurTime() + 0.5 ) return true end
lgpl-3.0
The-HalcyonDays/darkstar
scripts/zones/Caedarva_Mire/npcs/qm1.lua
8
1167
----------------------------------- -- Area: Caedarva Mire -- NPC: ??? (Spawn Verdelet(ZNM T2)) -- @pos 417 -19 -69 79 ----------------------------------- package.loaded["scripts/zones/Caedarva_Mire/TextIDs"] = nil; ----------------------------------- require("scripts/zones/Caedarva_Mire/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) if(trade:hasItemQty(2599,1) and trade:getItemCount() == 1) then -- Trade Mint Drop player:tradeComplete(); SpawnMob(17101202,180):updateClaim(player); end end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:messageSpecial(NOTHING_HAPPENS); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
The-HalcyonDays/darkstar
scripts/globals/items/rolanberry_pie_+1.lua
35
1376
----------------------------------------- -- ID: 4339 -- Item: rolanberry_pie_+1 -- Food Effect: 60Min, All Races ----------------------------------------- -- Magic 60 -- Intelligence 3 -- Health Regen While Healing 1 ----------------------------------------- require("scripts/globals/status"); ----------------------------------------- -- OnItemCheck ----------------------------------------- function onItemCheck(target) local result = 0; if (target:hasStatusEffect(EFFECT_FOOD) == true or target:hasStatusEffect(EFFECT_FIELD_SUPPORT_FOOD) == true) then result = 246; end return result; end; ----------------------------------------- -- OnItemUse ----------------------------------------- function onItemUse(target) target:addStatusEffect(EFFECT_FOOD,0,0,3600,4339); end; ----------------------------------- -- onEffectGain Action ----------------------------------- function onEffectGain(target,effect) target:addMod(MOD_MP, 60); target:addMod(MOD_INT, 3); target:addMod(MOD_HPHEAL, 1); end; ----------------------------------------- -- onEffectLose Action ----------------------------------------- function onEffectLose(target,effect) target:delMod(MOD_MP, 60); target:delMod(MOD_INT, 3); target:delMod(MOD_HPHEAL, 1); end;
gpl-3.0
coltonj96/UsefulCombinators
UsefulCombinators_0.2.0/prototypes/item/items.lua
2
5898
data:extend( { { type = "item", name = "timer-combinator", icon = "__UsefulCombinators__/graphics/icons/timer-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="timer-combinator", order = "b[combinators]-u[timer-combinator]", stack_size= 10, }, { type = "item", name = "counting-combinator", icon = "__UsefulCombinators__/graphics/icons/counting-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="counting-combinator", order = "b[combinators]-u[counting-combinator]", stack_size= 10, }, { type = "item", name = "random-combinator", icon = "__UsefulCombinators__/graphics/icons/random-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="random-combinator", order = "b[combinators]-u[random-combinator]", stack_size= 10, }--[[, { type = "item", name = "logic-combinator", icon = "__UsefulCombinators__/graphics/icons/logic-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="logic-combinator", order = "b[combinators]-u[logic-combinator]", stack_size= 10, }]], { type = "item", name = "comparator-combinator", icon = "__UsefulCombinators__/graphics/icons/comparator-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="comparator-combinator", order = "b[combinators]-u[comparator-combinator]", stack_size= 10, }, { type = "item", name = "converter-combinator", icon = "__UsefulCombinators__/graphics/icons/converter-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="converter-combinator", order = "b[combinators]-u[converter-combinator]", stack_size= 10, }, { type = "item", name = "min-combinator", icon = "__UsefulCombinators__/graphics/icons/min-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="min-combinator", order = "b[combinators]-u[min-combinator]", stack_size= 10, }, { type = "item", name = "max-combinator", icon = "__UsefulCombinators__/graphics/icons/max-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="max-combinator", order = "b[combinators]-u[max-combinator]", stack_size= 10, }, { type = "item", name = "and-gate-combinator", icon = "__UsefulCombinators__/graphics/icons/and-gate-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="and-gate-combinator", order = "b[combinators]-u[and-gate-combinator]", stack_size= 10, }, { type = "item", name = "or-gate-combinator", icon = "__UsefulCombinators__/graphics/icons/or-gate-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="or-gate-combinator", order = "b[combinators]-u[or-gate-combinator]", stack_size= 10, }, { type = "item", name = "not-gate-combinator", icon = "__UsefulCombinators__/graphics/icons/not-gate-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="not-gate-combinator", order = "b[combinators]-u[not-gate-combinator]", stack_size= 10, }, { type = "item", name = "nand-gate-combinator", icon = "__UsefulCombinators__/graphics/icons/nand-gate-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="nand-gate-combinator", order = "b[combinators]-u[nand-gate-combinator]", stack_size= 10, }, { type = "item", name = "nor-gate-combinator", icon = "__UsefulCombinators__/graphics/icons/nor-gate-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="nor-gate-combinator", order = "b[combinators]-u[nor-gate-combinator]", stack_size= 10, }, { type = "item", name = "xor-gate-combinator", icon = "__UsefulCombinators__/graphics/icons/xor-gate-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="xor-gate-combinator", order = "b[combinators]-u[xor-gate-combinator]", stack_size= 10, }, { type = "item", name = "xnor-gate-combinator", icon = "__UsefulCombinators__/graphics/icons/xnor-gate-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="xnor-gate-combinator", order = "b[combinators]-u[xnor-gate-combinator]", stack_size= 10, }, { type = "item", name = "detector-combinator", icon = "__UsefulCombinators__/graphics/icons/detector-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="detector-combinator", order = "b[combinators]-u[detector-combinator]", stack_size= 10, }, { type = "item", name = "sensor-combinator", icon = "__UsefulCombinators__/graphics/icons/sensor-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="sensor-combinator", order = "b[combinators]-u[sensor-combinator]", stack_size= 10, }, { type = "item", name = "railway-combinator", icon = "__UsefulCombinators__/graphics/icons/railway-combinator.png", flags = { "goes-to-quickbar" }, subgroup = "circuit-network", place_result="railway-combinator", order = "b[combinators]-u[railway-combinator]", stack_size= 10, } })
mit
hxw804781317/MT7620N
package/ralink/ui/luci-mtk/src/applications/luci-polipo/luasrc/model/cbi/polipo.lua
79
5961
--[[ LuCI - Lua Configuration Interface Copyright 2008 Aleksandar Krsteski <alekrsteski@gmail.com> Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 $Id$ ]]-- m = Map("polipo", translate("Polipo"), translate("Polipo is a small and fast caching web proxy.")) -- General section s = m:section(NamedSection, "general", "polipo", translate("Proxy")) s:tab("general", translate("General Settings")) s:tab("dns", translate("DNS and Query Settings")) s:tab("proxy", translate("Parent Proxy")) s:tab("logging", translate("Logging and RAM")) -- General settings s:taboption("general", Flag, "enabled", translate("enable")) o = s:taboption("general", Value, "proxyAddress", translate("Listen address"), translate("The interface on which Polipo will listen. To listen on all " .. "interfaces use 0.0.0.0 or :: (IPv6).")) o.placeholder = "0.0.0.0" o.datatype = "ipaddr" o = s:taboption("general", Value, "proxyPort", translate("Listen port"), translate("Port on which Polipo will listen")) o.optional = true o.placeholder = "8123" o.datatype = "port" o = s:taboption("general", DynamicList, "allowedClients", translate("Allowed clients"), translate("When listen address is set to 0.0.0.0 or :: (IPv6), you must " .. "list clients that are allowed to connect. The format is IP address " .. "or network address (192.168.1.123, 192.168.1.0/24, " .. "2001:660:116::/48 (IPv6))")) o.datatype = "ipaddr" o.placeholder = "0.0.0.0/0" -- DNS settings dns = s:taboption("dns", Value, "dnsNameServer", translate("DNS server address"), translate("Set the DNS server address to use, if you want Polipo to use " .. "different DNS server than the host system.")) dns.optional = true dns.datatype = "ipaddr" l = s:taboption("dns", ListValue, "dnsQueryIPv6", translate("Query DNS for IPv6")) l.default = "happily" l:value("true", translate("Query only IPv6")) l:value("happily", translate("Query IPv4 and IPv6, prefer IPv6")) l:value("reluctantly", translate("Query IPv4 and IPv6, prefer IPv4")) l:value("false", translate("Do not query IPv6")) l = s:taboption("dns", ListValue, "dnsUseGethostbyname", translate("Query DNS by hostname")) l.default = "reluctantly" l:value("true", translate("Always use system DNS resolver")) l:value("happily", translate("Query DNS directly, for unknown hosts fall back " .. "to system resolver")) l:value("reluctantly", translate("Query DNS directly, fallback to system resolver")) l:value("false", translate("Never use system DNS resolver")) -- Proxy settings o = s:taboption("proxy", Value, "parentProxy", translate("Parent proxy address"), translate("Parent proxy address (in host:port format), to which Polipo " .. "will forward the requests.")) o.optional = true o.datatype = "ipaddr" o = s:taboption("proxy", Value, "parentAuthCredentials", translate("Parent proxy authentication"), translate("Basic HTTP authentication supported. Provide username and " .. "password in username:password format.")) o.optional = true o.placeholder = "username:password" -- Logging s:taboption("logging", Flag, "logSyslog", translate("Log to syslog")) s:taboption("logging", Value, "logFacility", translate("Syslog facility")):depends("logSyslog", "1") v = s:taboption("logging", Value, "logFile", translate("Log file location"), translate("Use of external storage device is recommended, because the " .. "log file is written frequently and can grow considerably.")) v:depends("logSyslog", "") v.rmempty = true o = s:taboption("logging", Value, "chunkHighMark", translate("In RAM cache size (in bytes)"), translate("How much RAM should Polipo use for its cache.")) o.datatype = "uinteger" -- Disk cache section s = m:section(NamedSection, "cache", "polipo", translate("On-Disk Cache")) s:tab("general", translate("General Settings")) s:tab("advanced", translate("Advanced Settings")) -- Disk cache settings s:taboption("general", Value, "diskCacheRoot", translate("Disk cache location"), translate("Location where polipo will cache files permanently. Use of " .. "external storage devices is recommended, because the cache can " .. "grow considerably. Leave it empty to disable on-disk " .. "cache.")).rmempty = true s:taboption("general", Flag, "cacheIsShared", translate("Shared cache"), translate("Enable if cache (proxy) is shared by multiple users.")) o = s:taboption("advanced", Value, "diskCacheTruncateSize", translate("Truncate cache files size (in bytes)"), translate("Size to which cached files should be truncated")) o.optional = true o.placeholder = "1048576" o.datatype = "uinteger" o = s:taboption("advanced", Value, "diskCacheTruncateTime", translate("Truncate cache files time"), translate("Time after which cached files will be truncated")) o.optional = true o.placeholder = "4d12h" o = s:taboption("advanced", Value, "diskCacheUnlinkTime", translate("Delete cache files time"), translate("Time after which cached files will be deleted")) o.optional = true o.placeholder = "32d" -- Poor man's multiplexing section s = m:section(NamedSection, "pmm", "polipo", translate("Poor Man's Multiplexing"), translate("Poor Man's Multiplexing (PMM) is a technique that simulates " .. "multiplexing by requesting an instance in multiple segments. It " .. "tries to lower the latency caused by the weakness of HTTP " .. "protocol. NOTE: some sites may not work with PMM enabled.")) s:option(Value, "pmmSize", translate("PMM segments size (in bytes)"), translate("To enable PMM, PMM segment size must be set to some " .. "positive value.")).rmempty = true s:option(Value, "pmmFirstSize", translate("First PMM segment size (in bytes)"), translate("Size of the first PMM segment. If not defined, it defaults " .. "to twice the PMM segment size.")).rmempty = true return m
gpl-2.0
The-HalcyonDays/darkstar
scripts/zones/Rolanberry_Fields/npcs/qm1.lua
25
1561
----------------------------------- -- Area: Rolanberry Fields -- NPC: qm1 (???) -- @pos -686.216 -31.556 -369.723 110 -- Notes: Spawns Chuglix Berrypaws for ACP mission "Gatherer of Light (I)" ----------------------------------- package.loaded["scripts/zones/Rolanberry_Fields/TextIDs"] = nil; ----------------------------------- require("scripts/globals/settings"); require("scripts/globals/keyitems"); require("scripts/zones/Rolanberry_Fields/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) local Gob = GetMobAction(17228249); if ( (Gob == ACTION_NONE or Gob == ACTION_SPAWN) and (player:hasKeyItem(JUG_OF_GREASY_GOBLIN_JUICE) == true) and (player:hasKeyItem(SEEDSPALL_CAERULUM) == false) and (player:hasKeyItem(VIRIDIAN_KEY) == false) ) then SpawnMob(17228249,180):updateClaim(player); else player:messageSpecial(NOTHING_HAPPENS); end end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) -- printf("CSID: %u",csid); -- printf("RESULT: %u",option); end;
gpl-3.0
rrpgfirecast/firecast
Plugins/Sheets/Ficha D&D Next/output/rdkObjs/08.Companheiro.Select.lfm.lua
3
3474
require("firecast.lua"); local __o_rrpgObjs = require("rrpgObjs.lua"); require("rrpgGUI.lua"); require("rrpgDialogs.lua"); require("rrpgLFM.lua"); require("ndb.lua"); require("locale.lua"); local __o_Utils = require("utils.lua"); local function constructNew_frmFichaRPGmeister8CS_svg() local obj = GUI.fromHandle(_obj_newObject("form")); local self = obj; local sheet = nil; rawset(obj, "_oldSetNodeObjectFunction", rawget(obj, "setNodeObject")); function obj:setNodeObject(nodeObject) sheet = nodeObject; self.sheet = nodeObject; self:_oldSetNodeObjectFunction(nodeObject); end; function obj:setNodeDatabase(nodeObject) self:setNodeObject(nodeObject); end; _gui_assignInitialParentForForm(obj.handle); obj:beginUpdate(); obj:setName("frmFichaRPGmeister8CS_svg"); obj:setWidth(180); obj:setHeight(30); obj:setTheme("dark"); obj.button1 = GUI.fromHandle(_obj_newObject("button")); obj.button1:setParent(obj); obj.button1:setWidth(30); obj.button1:setHeight(30); obj.button1:setText("X"); obj.button1:setName("button1"); obj.label1 = GUI.fromHandle(_obj_newObject("label")); obj.label1:setParent(obj); obj.label1:setLeft(35); obj.label1:setTop(5); obj.label1:setWidth(145); obj.label1:setHeight(20); obj.label1:setText("Teste de label"); obj.label1:setField("nomeComp"); obj.label1:setName("label1"); obj.dataLink1 = GUI.fromHandle(_obj_newObject("dataLink")); obj.dataLink1:setParent(obj); obj.dataLink1:setField("nomeComp"); obj.dataLink1:setDefaultValue("Nome Companheiro"); obj.dataLink1:setName("dataLink1"); obj._e_event0 = obj.button1:addEventListener("onClick", function (_) dialogs.confirmOkCancel("Tem certeza que quer apagar esse companheiro?", function (confirmado) if confirmado then ndb.deleteNode(sheet); end; end); end, obj); function obj:_releaseEvents() __o_rrpgObjs.removeEventListenerById(self._e_event0); end; obj._oldLFMDestroy = obj.destroy; function obj:destroy() self:_releaseEvents(); if (self.handle ~= 0) and (self.setNodeDatabase ~= nil) then self:setNodeDatabase(nil); end; if self.dataLink1 ~= nil then self.dataLink1:destroy(); self.dataLink1 = nil; end; if self.button1 ~= nil then self.button1:destroy(); self.button1 = nil; end; if self.label1 ~= nil then self.label1:destroy(); self.label1 = nil; end; self:_oldLFMDestroy(); end; obj:endUpdate(); return obj; end; function newfrmFichaRPGmeister8CS_svg() local retObj = nil; __o_rrpgObjs.beginObjectsLoading(); __o_Utils.tryFinally( function() retObj = constructNew_frmFichaRPGmeister8CS_svg(); end, function() __o_rrpgObjs.endObjectsLoading(); end); assert(retObj ~= nil); return retObj; end; local _frmFichaRPGmeister8CS_svg = { newEditor = newfrmFichaRPGmeister8CS_svg, new = newfrmFichaRPGmeister8CS_svg, name = "frmFichaRPGmeister8CS_svg", dataType = "", formType = "undefined", formComponentName = "form", title = "", description=""}; frmFichaRPGmeister8CS_svg = _frmFichaRPGmeister8CS_svg; Firecast.registrarForm(_frmFichaRPGmeister8CS_svg); return _frmFichaRPGmeister8CS_svg;
apache-2.0
cc-paw/cc-paw
releases/cc-paw/0.4.3/util.lua
1
1367
local util = {} util.quiet = false util.log = true local logFile = "/var/log/cc-paw.log" local errFile = "/var/log/cc-paw-errors.log" -- print() with output toggling and logging function util.p(...) if not util.quiet then print(...) end if util.log then local args = {...} local out = "" for i = 1, #args do out = out .. "\t" .. args[i] end local file = fs.open(logFile, fs.exists(logFile) and 'a' or 'w') file.write(out .."\n") file.close() end end -- error() with logging function util.e(msg) local file = fs.open(errFile, fs.exists(errFile) and 'a' or 'w') file.write(msg.."\n") file.close() error(msg) end -- assert() using our error function function util.a(truthy, errMsg) if truthy then return truthy else e(errMsg) end end local p, e, a = util.p, util.e, util.a -- run pre/post install/upgrade/remove/purge scripts function util.script(pkg, id, msg) if package[id] then p("Running "..msg.." script...") ok, result, errMsg = pcall(loadstring(pkg[id])()) if not ok then e(msg..'" script errored: "'..result..'"\nAborting.') end if not result == 0 then e(msg..'" script failed: "'..errMsg..'"\nAborting.') end end end return util
mit
The-HalcyonDays/darkstar
scripts/globals/items/slice_of_ziz_meat.lua
18
1283
----------------------------------------- -- ID: 5581 -- Item: Slice of Ziz Meat -- Effect: 5 Minutes, food effect, Galka Only ----------------------------------------- -- Strength +4 -- Intelligence -6 ----------------------------------------- require("scripts/globals/status"); ----------------------------------------- -- OnItemCheck ----------------------------------------- function onItemCheck(target) result = 0; if (target:getRace() ~= 8) then result = 247; end if(target:getMod(MOD_EAT_RAW_MEAT) == 1) then result = 0; end if (target:hasStatusEffect(EFFECT_FOOD) == true or target:hasStatusEffect(EFFECT_FIELD_SUPPORT_FOOD) == true) then result = 246; end return result; end; ----------------------------------------- -- OnItemUse ----------------------------------------- function onItemUse(target) target:addStatusEffect(EFFECT_FOOD,0,0,300,5581); end; ----------------------------------------- -- onEffectGain Action ----------------------------------- function onEffectGain(target,effect) target:addMod(MOD_STR, 4); target:addMod(MOD_INT,-6); end; ----------------------------------------- -- onEffectLose Action ----------------------------------- function onEffectLose(target,effect) target:delMod(MOD_STR, 4); target:delMod(MOD_INT,-6); end;
gpl-3.0
coltonj96/UsefulCombinators
UsefulCombinators_0.4.2/prototypes/item/items.lua
3
8216
data:extend( { { type = "item-with-tags", name = "timer-combinator", icon = "__UsefulCombinators__/graphics/icons/timer-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "main", place_result="timer-combinator", order = "a[timer]", stack_size= 50, }, { type = "item-with-tags", name = "counting-combinator", icon = "__UsefulCombinators__/graphics/icons/counting-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "main", place_result="counting-combinator", order = "b[counting]", stack_size= 50, }, { type = "item-with-tags", name = "random-combinator", icon = "__UsefulCombinators__/graphics/icons/random-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "main", place_result="random-combinator", order = "c[random]", stack_size= 50, }, { type = "item-with-tags", name = "color-combinator", icon = "__UsefulCombinators__/graphics/icons/color-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "other", place_result="color-combinator", order = "e[color]", stack_size= 50, }, { type = "item-with-tags", name = "converter-combinator", icon = "__UsefulCombinators__/graphics/icons/converter-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "other", place_result="converter-combinator", order = "a[converter]", stack_size= 50, }, { type = "item-with-tags", name = "min-combinator", icon = "__UsefulCombinators__/graphics/icons/min-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "main", place_result="min-combinator", order = "f[min]", stack_size= 50, }, { type = "item-with-tags", name = "max-combinator", icon = "__UsefulCombinators__/graphics/icons/max-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "main", place_result="max-combinator", order = "e[max]", stack_size= 50, }, { type = "item-with-tags", name = "and-gate-combinator", icon = "__UsefulCombinators__/graphics/icons/and-gate-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "logic-gates", place_result="and-gate-combinator", order = "a[and]", stack_size= 50, }, { type = "item-with-tags", name = "or-gate-combinator", icon = "__UsefulCombinators__/graphics/icons/or-gate-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "logic-gates", place_result="or-gate-combinator", order = "o[or]", stack_size= 50, }, { type = "item-with-tags", name = "not-gate-combinator", icon = "__UsefulCombinators__/graphics/icons/not-gate-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "logic-gates", place_result="not-gate-combinator", order = "n[not]", stack_size= 50, }, { type = "item-with-tags", name = "nand-gate-combinator", icon = "__UsefulCombinators__/graphics/icons/nand-gate-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "logic-gates", place_result="nand-gate-combinator", order = "n[nand]", stack_size= 50, }, { type = "item-with-tags", name = "nor-gate-combinator", icon = "__UsefulCombinators__/graphics/icons/nor-gate-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "logic-gates", place_result="nor-gate-combinator", order = "n[nor]", stack_size= 50, }, { type = "item-with-tags", name = "xor-gate-combinator", icon = "__UsefulCombinators__/graphics/icons/xor-gate-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "logic-gates", place_result="xor-gate-combinator", order = "x[xor]", stack_size= 50, }, { type = "item-with-tags", name = "xnor-gate-combinator", icon = "__UsefulCombinators__/graphics/icons/xnor-gate-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "logic-gates", place_result="xnor-gate-combinator", order = "x[xnor]", stack_size= 50, }, { type = "item-with-tags", name = "detector-combinator", icon = "__UsefulCombinators__/graphics/icons/detector-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "other", place_result="detector-combinator", order = "b[detector]", stack_size= 50, }, { type = "item-with-tags", name = "sensor-combinator", icon = "__UsefulCombinators__/graphics/icons/sensor-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "other", place_result="sensor-combinator", order = "c[sensor]", stack_size= 50, }, { type = "item-with-tags", name = "railway-combinator", icon = "__UsefulCombinators__/graphics/icons/railway-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "other", place_result="railway-combinator", order = "d[railway]", stack_size= 50, }, { type = "item-with-tags", name = "emitter-combinator", icon = "__UsefulCombinators__/graphics/icons/emitter-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "other", place_result="emitter-combinator", order = "f[emitter]", stack_size= 50, }, { type = "item-with-tags", name = "receiver-combinator", icon = "__UsefulCombinators__/graphics/icons/receiver-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "other", place_result="receiver-combinator", order = "g[receiver]", stack_size= 50, }, { type = "item-with-tags", name = "power-combinator", icon = "__UsefulCombinators__/graphics/icons/power-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "main", place_result="power-combinator", order = "d[power]", stack_size= 50, }, { type = "item-with-tags", name = "daytime-combinator", icon = "__UsefulCombinators__/graphics/icons/daytime-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "other2", place_result="daytime-combinator", order = "a[daytime]", stack_size= 50, }, { type = "item-with-tags", name = "pollution-combinator", icon = "__UsefulCombinators__/graphics/icons/pollution-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "other2", place_result="pollution-combinator", order = "c[pollution]", stack_size= 50, }, { type = "item-with-tags", name = "statistic-combinator", icon = "__UsefulCombinators__/graphics/icons/statistic-combinator.png", icon_size = 32, flags = { "goes-to-quickbar" }, group = "useful-combinators", subgroup = "other2", place_result="statistic-combinator", order = "b[statistic]", stack_size= 50, } })
mit
The-HalcyonDays/darkstar
scripts/zones/Port_Windurst/npcs/Ryan.lua
34
1805
----------------------------------- -- Area: Port Windurst -- NPC: Ryan -- Standard Merchant NPC ----------------------------------- package.loaded["scripts/zones/Port_Windurst/TextIDs"] = nil; ----------------------------------- require("scripts/globals/shop"); require("scripts/zones/Port_Windurst/TextIDs"); ----------------------------------- -- onTrade Action ----------------------------------- function onTrade(player,npc,trade) end; ----------------------------------- -- onTrigger Action ----------------------------------- function onTrigger(player,npc) player:showText(npc,RYAN_SHOP_DIALOG); stock = { 0x4100, 290, -- Bronze Axe 0x4097, 246, -- Bronze Sword 0x43B8, 5, -- Crossbow Bolt 0x3120, 235, -- Bronze Harness 0x3121, 2286, -- Brass Harness 0x31A0, 128, -- Bronze Mittens 0x31A1, 1255, -- Brass Mittens 0x3220, 191, -- Bronze Subligar 0x3221, 1840, -- Brass Subligar 0x32A0, 117, -- Bronze Leggings 0x32A1, 1140, -- Brass Leggings 0x3128, 1145, -- Kenpogi 0x31A8, 630, -- Tekko 0x3228, 915, -- Sitabaki 0x32A8, 584 -- Kyahan } showShop(player, WINDURST, stock); end; ----------------------------------- -- onEventUpdate ----------------------------------- function onEventUpdate(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end; ----------------------------------- -- onEventFinish ----------------------------------- function onEventFinish(player,csid,option) --printf("CSID: %u",csid); --printf("RESULT: %u",option); end;
gpl-3.0